Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
losest to 2/7? (a) 2/9 (b) 0.3 (c) 3/763 (d) 0.4 (e) 149 (f) 3/8 b Which is the closest to 1? (a) 0.2 (b) -1.7975 (c) 3/2 (d) 77/6 c What is the closest to 0 in 8192106, 5, 0.2? 0.2 What is the nearest to 2 in 111, -9, -5/2, 5, 4? 4 Which is the closest to -45.9? (a) 1 (b) 2 (c) 449/4 a What is the nearest to 0.24 in -1, 0.4, -1/2572? 0.4 What is the closest to -0.1 in 10887.2, 1/12, -4, 1, -0.1? -0.1 What is the closest to -2/3 in 2, 14/33, -2, -5, 10541? 14/33 Which is the nearest to 3/5? (a) -0.1 (b) -2/3 (c) 1/4 (d) -636/5 (e) 4 c What is the nearest to -3/2 in -93, -16, -9? -9 What is the nearest to 0 in 3, 44, 5, -0.003, -0.143? -0.003 Which is the closest to -24.9? (a) -1 (b) -18.6 (c) 16 b Which is the nearest to -2961? (a) -13/6 (b) 0 (c) -4 c What is the closest to -7997 in 0.4, 13, -1/3, -1/6? -1/3 What is the closest to 0 in 8422, 2/7, 12, 2/9, 0.5, 3/7? 2/9 What is the closest to 10305 in 10, -2/5, -2/19? 10 Which is the nearest to 0.29? (a) 21 (b) 415 (c) -0.5 (d) -4 c Which is the closest to -21/11? (a) -3 (b) 5813 (c) -5 a Which is the closest to 1? (a) -0.49 (b) 2145 (c) -76 a Which is the nearest to 1/2? (a) -5 (b) -1.6 (c) 60/79 c What is the nearest to 2/5 in -2452, -0.0411, -0.3? -0.0411 Which is the closest to 2/17? (a) 1/2 (b) 2 (c) -2/3 (d) -1/2 (e) 100 (f) -0.04 f Which is the closest to -2? (a) -0.12595 (b) -4/9 (c) -6.67 (d) -0.5 d What is the nearest to 3.8 in 0.3, 3, -0.5, -389, 5? 3 What is the closest to -0.4 in -51239, -42, -10? -10 Which is the closest to -54? (a) 7.39 (b) -248 (c) 0.4 (d) 3 c What is the closest to -1 in -240, -5, -0.00791? -0.00791 Which is the nearest to 0.4? (a) -1 (b) -2/3 (c) 1 (d) 5/2 (e) 2/13471 (f) 70 e Which is the closest to 4? (a) -2 (b) 1/6 (c) -3.5408 (d) -5 (e) -3/5 b What is the closest to 599/3 in -4949, 0.13, -1? 0.13 Which is the closest to 7? (a) 12 (b) -2645 (c) 0.1 a What is the nearest to 0.3 in -2/11, -20053, -0.79? -2/11 Which is the closest to 10? (a) 16 (b) -0.7 (c) -0.0196 a What is the nearest to -1/2 in -64, 122, -4, -20/23? -20/23 What is the closest to -9/2 in 5/9, 202.5, 0.2, 0.3? 0.2 Which is the nearest to 939045? (a) -4 (b) 1 (c) -1/2 b Which is the nearest to 582? (a) 6/7 (b) 3 (c) 4/7 (d) 0.4 (e) -1/4 b What is the nearest to 487/23 in 5, -4, -3, 0, -471/7? 5 What is the nearest to -0.1 in 5, 46.9, -2/7, 1/796? 1/796 Which is the nearest to 52? (a) -608157 (b) 4 (c) -2 (d) -0.1 b What is the closest to 0 in 33.25, -2/1859, 3? -2/1859 Which is the nearest to -1/4? (a) 0 (b) 3 (c) 4 (d) 25/21 (e) -346 a Which is the nearest to -0.734? (a) 0 (b) -4.9 (c) -45 a Which is the closest to 3/5? (a) 3/8 (b) -14 (c) 0.2 (d) -1/7 (e) -1/71 (f) 66 a Which is the closest to -20/7? (a) -8 (b) 14394 (c) -3 (d) 4 (e) 3/5 c Which is the closest to -6? (a) -2 (b) -2/11 (c) -2/9 (d) -36 (e) -0.04 a What is the closest to -1.22 in -3000, 2/11, -25, -0.2? -0.2 Which is the closest to -1? (a) 3 (b) 1 (c) 2.4 (d) -4541 (e) 0.4 (f) 6 e What is the closest to -0.1 in 0.001, -1, -318, 9.7? 0.001 Which is the closest to 1/277? (a) 5/6 (b) -7 (c) 0.5 (d) -6 c Which is the closest to 157/2? (a) 0.3 (b) 2/3 (c) 0.2 (d) -2 (e) 1.1 (f) 1.296 f Which is the closest to -24? (a) 3 (b) 2/3 (c) -0.2 (d) -1.144 d Which is the nearest to -3? (a) 2/145 (b) -0.18 (c) 0.5 (d) -4 d What is the closest to 373 in -684/13, 2/15, -1/2? 2/15 What is the closest to -40 in -2, -2.91, 34? -2.91 Which is the nearest to 2/7? (a) 1098 (b) 172 (c) 4 c What is the closest to -5 in -3, 0.86464, -0.091? -3 What is the closest to 3/5 in 5, 96, -1693, 2? 2 Which is the nearest to 2/5? (a) 1/18 (b) -0.7 (c) 4/3 (d) 4 (e) 307/6 a What is the closest to 15/58 in -5, 0, 9823? 0 What is the nearest to 21 in -5/4, 9147/14, -5? -5/4 What is the closest to 1 in -2/3, 0.06, 22/169, -4? 22/169 Which is the nearest to 2? (a) -2/5 (b) -42408 (c) 8/17 c Which is the closest to -0.67? (a) 0.1 (b) -2/15 (c) 2/999 (d) -1/2 d What is the closest to 0 in -3, -131, 2/7, 38, -118? 2/7 Which is the closest to 1? (a) -0.5 (b) 0.2 (c) 4/3 (d) 3 (e) 40 (f) -0.0519 c Which is the closest to -3/5? (a) -3 (b) -14285 (c) 1 (d) -1/3 d Which is the nearest to 5? (a) -3 (b) 290.6 (c) -29 a Which is the closest to -0.143? (a) -3/8 (b) 1 (c) 0.27 (d) 4/63 (e) -11 d Which is the nearest to -0.1? (a) 1/2 (b) 5068 (c) -2 (d) 3/530 d What is the closest to 0 in 2, 7, 0, -119, 876? 0 Which is the closest to 6? (a) 9.015 (b) 14/15 (c) -0.02 a Which is the nearest to -7? (a) 2730.9 (b) -0.3 (c) 1.2 b What is the closest to 23695 in -20, 3/7, 3/2, 5? 5 What is the nearest to 2 in -12, -934, 1, 42? 1 What is the nearest to -4 in -5, 1/2, -2/45, -2/5, 432? -5 What is the nearest to -209 in -77, 1/3, -0.4, -2/3, 0.5? -77 What is the nearest to 2/7 in 0.08, 126/17, 14, 2/3, 2? 0.08 What is the nearest to -15 in -1/4, -3/4, -294.9, 3, -0.2, 1/2? -3/4 What is the closest to 4/3 in -2.49, -147, 1/4? 1/4 Which is the nearest to 0.5? (a) 5 (b) -53.74 (c) -1/4 (d) 0.4 (e) 0.1 d What is the closest to -7/80 in 0.0278, 2, 5? 0.0278 Which is the closest to -1? (a) 4 (b) -2/11 (c) -21 (d) -0.2 (e) -26 (f) -0.92 f Which is the nearest to 14.72? (a) -12 (b) 0.1 (c) -2/23 (d) -1 (e) 16.1 e Which is the nearest to 2? (a) 0.3 (b) -4 (c) -2/3 (d) 2/5 (e) -16 (f) 632/3 d What is the nearest to -0.1 in -12.2, -5, -2/9, -14, 2/393, -2/23? -2/23 What is the nearest to 266 in 60, 3, 0.2, -8/7, -1? 60 What is the closest to 2 in 29, -3, -342, -2, 9? -2 Which is the nearest to -1? (a) 78 (b) 106 (c) 4 (d) 2 (e) 2/9 e Which is the nearest to 2032454? (a) 10 (b) -1/6 (c) 4/7 (d) -0.4 a What is the closest to 0.1 in -5, 2.33, 21571? 2.33 Which is the closest to -2/7? (a) 2 (b) -1/4 (c) -502 (d) -1516 (e) 0.5 b Which is the closest to 0.2? (a) -2 (b) -2/7 (c) -12/5 (d) -170/7 (e) 4 b What is the closest to -0.062 in -0.053, -181, -5, 2? -0.053 What is the nearest to 2476358 in -0.2, -2/7, -0.6? -0.2 What is the nearest to 0 in 27656/11, -0.01, 0.1, 0.2, 5? -0.01 Which is the nearest to -1/3? (a) 0.5 (b) 22 (c) 1 (d) -125/9 a Which is the nearest to 2/3? (a) -0.041 (b) 0.1 (c) 0 (d) 5/4 (e) 0.2 e What is the closest to -1 in -1, 1592625, -4? -1 Which is the closest to 2? (a) -0.1 (b) -402 (c) 33/65 c What is the closest to -63 in 13.2, -4, 48? -4 Which is the closest to 171? (a) -0.1 (b) -5 (c) -245666 a Which is the nearest to -4? (a) -13 (b) -2/11 (c) 9 (d) -1/3 (e) -1/2 e Which is the nearest to 2/9? (a) -3 (b) -2/7 (c) 3 (d) -5/17 (e) -2/9 e Which is the closest to 4/7? (a) 5 (b) 2/11 (c) 5347 (d) -0.4 (e) 0.5 e Which is the nearest to 0.2? (a) 3/4 (b) 0.04 (c) -0.3 (d) 0.3 (e) 0.64 d Which is the closest to -2? (a) 2/4095 (b) -5 (c) 1064 (d) 4 a Which is the nearest to -123? (a) -0.201 (b) 6 (c) 2/23 a What is the nearest to 2/9 in 2, 0, 17/6784? 17/6784 What is the closest to 44 in -1/2, -0.2, 1/17839, -2? 1/17839 What is the closest to 1/3 in 0.7, -4, -51, -59, 1/5, 2? 1/5 Which is the nearest to 16? (a) 14.83 (b) 0.6 (c) -1/3 a Which is the nearest to -5? (a) 0.01 (b) -152 (c) 0.4 (d) 3/5 (e) 1/2 (f) -9/5 f What is the nearest to -0.3 in -2/19, 3348, -21? -2/19 What is the closest to 2/23037 in 4/3, -2/147, 2, 0.1? -2/147 Which is the closest to -1/3? (a) 0 (b) 4/19 (c) 87 (d) 2/13 a What is the closest to -9 in -4, 0, 12, 266.5? -4 What is the closest to -0.1 in 1/9, -1020, 2.905? 1/9 What is the closest to -0.1 in 5, -5, 4/3, -222, 584? 4/3 What is the closest to -2201 in 0.32, 2/7, -449? -449 Which is the nearest to 0.1? (a) 1/4 (b) -0.02 (c) -2.3 (d) 0.2 (e) 0.05 (f) -23 e What is the nearest to 2 in -0.0826, 2, 4, 2/3, -5, -0.042? 2 Which is the closest to 1/2? (a) 0.2 (b) -0.02 (c) -5 (d) -16.3 a Which is the nearest to -2/7? (a) 11751 (b) -0.3 (c) 2/7 (d) -1 (e) 3 b Which is the nearest to -5/3? (a) -1/6 (b) -2.2 (c) 5322 (d) -0.3 b Which is the closest to 1/26? (a) -0.131 (b) -2/7 (c) -2/17 c Which is the nearest to 0? (a) -1047 (b) 81 (c) 8 (d) 0.1 (e) -2/5 d Which is the neares	{ "pile_set_name": "DM Mathematics" }
+ 18/4. Suppose -nv = -3 - 1, -5v + 62 = c. What is the remainder when c is divided by 20? 17 Suppose 3v - 4g = 11 + 5, -3v + 2g + 8 = 0. Suppose -5x + h + 368 = v, 5x = 2h + 193 + 173. Calculate the remainder when x is divided by 19. 17 Suppose -4o - 4z - 104 = -6o, z = 0. Let x(y) = 6y + 252. What is the remainder when o is divided by x(-39)? 16 Let s = -4 - -6. Suppose 16 + 6 = sd. Suppose -4f + 69 = 3u, 0 = -3u - f + 40 + 20. What is the remainder when u is divided by d? 8 Let d(u) = 3u*3 - 3u*2 + 5u - 4. Calculate the remainder when d(3) is divided by ((-153)/(-9) - 18)(-34 - 0). 31 Let c = 23 + -28. Let b = 12 + c. What is the remainder when b is divided by 5? 2 Let v = -51 - -56. Suppose 3s = 3b + 240, -5b + 3b = -vs + 415. Calculate the remainder when s is divided by 33/(-2)8/(-6). 19 Let o be (-206)/2 + 2 + -7. Let j = -104 - o. What is the remainder when 11 is divided by j? 3 Let x(q) = q + 8. Suppose 5c - 5n = 125, -55 = 3c - 6c - n. Let u be (-1)/(1 - 22/c). Calculate the remainder when 52 is divided by x(u). 16 Let s be 2(27/(-6))/9. Suppose o + 280 = -4o. What is the remainder when 35 is divided by s/(4/o) + -2? 11 Let c(k) = -k3 + 3k*2 + 183k + 41. Let r(l) = -4l - 3. Calculate the remainder when r(-6) is divided by c(-12). 1 Let p = 524 - 492. Calculate the remainder when 79 is divided by p. 15 Suppose -25m + 20m = 220. Let t be m/(-6)(-4 + 7). Suppose t = 3g - 8. Calculate the remainder when 39 is divided by g. 9 Suppose 0x = 4v - 4x, -v = -4x + 3. Let w = v - -2. Calculate the remainder when w is divided by 0 - 22/11 - (0 + -4). 1 Let s be 16/(-20) + (-2)/10. Let v = 9 - s. Suppose -m = 5i + v, -m = -3i + 2i - 8. Calculate the remainder when 17 is divided by m. 2 Suppose 222 = 239h - 236h. Calculate the remainder when h is divided by 13. 9 Let w be (-3 + 24)(-15)/(-9). Suppose 0 = -4p + 4x + 48, 4x = 3p - 0p - w. What is the remainder when (22/(-77))/((-1)/77) - 1 is divided by p? 8 Let k(n) = -n*2 + 14n - 8. Let m be k(13). Suppose my = -y + 396. What is the remainder when y is divided by 17? 15 Suppose 0 = 20o - 19o - 64. Calculate the remainder when o is divided by 28. 8 Suppose 2f + 11 = 19. Suppose 6c = fc + o + 293, 442 = 3c - o. What is the remainder when c is divided by 30? 29 Suppose 206k - 18 = 200k. Calculate the remainder when 8 is divided by k. 2 Suppose 3o - 112 = z, -13 = -5o + 4z + 176. What is the remainder when 62 is divided by o? 25 Let l be 63 - (-2 - 0 - 2). Let f = l + -13. What is the remainder when f is divided by 15? 9 Suppose 98 = h + 13. Calculate the remainder when 337 is divided by h. 82 Suppose -k = 3b - 52, 0 = b + k - 9 - 11. What is the remainder when 3222/42 - 10/(-35) is divided by b? 13 Suppose -x + 35 = 5l + 4x, -5x = -l + 13. Suppose -4g = -y - 3y - 20, 0 = g + 3. What is the remainder when (828/y)/9-2 is divided by l? 7 Let m = -14 + 7. What is the remainder when 32 is divided by m/(2 + (-4 - -1))? 4 Let q = 41 - 13. Let g(z) = z3 + 12z*2 + 26z + 68. What is the remainder when q is divided by g(-10)? 4 Let x(z) = -z*3 + 4z*2 + 4z + 7. Let c be x(5). What is the remainder when 13 - (-1 - -5)/c is divided by (-3)/(-4) - 84/(-16)? 5 Suppose 3x + 2v - 41 = 0, -5x + 47 = 4v - 24. Let u = x - -15. What is the remainder when u is divided by 7? 5 Let a = -92 + 93. Let w = a - -24. What is the remainder when w is divided by 10? 5 Suppose 19v - 3616 - 716 = 0. Calculate the remainder when v is divided by 95. 38 Let h = -4 - -11. Let n = -12 + 16. Let y = 7 + n. What is the remainder when y is divided by h? 4 Suppose 0 = 4l - 2v - 88, 4l - 6v - 88 = -v. What is the remainder when l is divided by ((-12)/(-14))/(2/14)? 4 Let n(c) = -c3 + 8c*2 - 9c + 1. Calculate the remainder when 113 is divided by n(6). 18 Let d = 1911 - 1829. What is the remainder when d is divided by 23? 13 Let v = -1568 + 1728. Calculate the remainder when v is divided by 56. 48 What is the remainder when 5 + 2((-450)/(-12) + -4) is divided by 48? 24 Let p(i) = 16i*2 + 2i + 1. Let h(x) = 5x2 - 3x + 3. Suppose -9 = d + 2d. What is the remainder when h(d) is divided by p(-1)? 12 Let o be -1 - 1/(-4) - 1255/(-20). Let y = o + -49. What is the remainder when y is divided by 7? 6 Let a(t) be the third derivative of t5/2 - 5t*4/24 - 2t*3/3 - 42t*2. Calculate the remainder when 91 is divided by a(-1). 29 Let d = -2743 - -3064. What is the remainder when d is divided by 12? 9 Let k(i) = -59i3 + i2 + i + 1. Let v be k(-1). Suppose 20 = -0b - 5b, 4f - 5b = v. What is the remainder when 16 is divided by f? 6 Suppose 4n = 2l - 18, -5n - 17 + 2 = -5l. Let a = 5 - n. Calculate the remainder when a is divided by 3. 2 Let y be (-9)/(-21) - 1/((-7)/(-59)). Let m = y - -30. Calculate the remainder when 63 is divided by m. 19 Suppose -3p = 2n - 137, -5n + 184 = 2p - 131. Calculate the remainder when 176 is divided by n. 54 Let r(v) = 6v - 211. Calculate the remainder when 181 is divided by r(39). 20 What is the remainder when 457/2 + 21/(-14) is divided by 46? 43 Suppose -4580 = -22o - 92. Calculate the remainder when o is divided by 44. 28 Suppose -2l - 2q = 6, 2q + 3 = 5l + 18. Calculate the remainder when 1(58/l)/(18/(-27)) is divided by 10. 9 Let z be 6 - (-1 + 12/3)1. What is the remainder when z/(-2)4/3-17 is divided by (-10)/1(-12)/10? 10 Let n(p) = p2 + 21p - 9. Let s be n(-15). Let v = -65 - s. What is the remainder when v is divided by 9? 7 Suppose 55 = c + 4c. What is the remainder when (-2)/(-9) + (-367)/(-9) is divided by c? 8 Let p = 1214 - 1152. Calculate the remainder when 1424 is divided by p. 60 Let v = 85 + -50. What is the remainder when v is divided by (45/5 - 1 - (-5 - 8)) + -1? 15 Suppose 0 = -k - 2s - 4, 4k + s = -2s - 36. Let d = 11 + k. Calculate the remainder when 7 is divided by 4 + d + 8/4. 2 Calculate the remainder when (9 - 2 - 3)(31 - 4) is divided by 19. 13 Let s(v) be the third derivative of 0v + 0 - 5v2 + 1/24v*4 + 0v*3. Calculate the remainder when s(7) is divided by 3. 1 Suppose -3k = 2k - 155. What is the remainder when (204 + -1)(-14)/(-49) is divided by k? 27 Let p = 8 - -43. Suppose -4q = -18q + 182. Calculate the remainder when p is divided by q. 12 Let g be 3/(-6) + 705/10. Let q be (2 - 8/6)3. Suppose 2v + qi - g = -2i, 5v = -i + 166. What is the remainder when v is divided by 9? 6 Suppose -5i = -n + 89, 0 = -4n - 4i - 142 + 402. What is the remainder when 217 is divided by n? 10 Let b(t) = -21t + 190. Calculate the remainder when 43 is divided by b(8). 21 Calculate the remainder when ((-1431)/(-81))/((-1)/(-9)3) is divided by 43. 10 Let w = 551 + -428. What is the remainder when w is divided by 21? 18 Let y = -98 + 68. Let u(j) = -j*3 - 7j*2 - 2j - 7. Calculate the remainder when 14/(-105) - 604/y is divided by u(-7). 6 Let t(j) = -j*3 - 57j*2 + 56j - 92. Calculate the remainder when 98 is divided by t(-58). 2 Let q(h) = -4 - 165h3 + 3 + 2h + 171h3. Let c(v) = v2 + 5v + 3. What is the remainder when q(1) is divided by c(-5)? 1 Suppose -24 = 4y - 6y. Let v = 758 + -712. What is the remainder when v is divided by y? 10 Let u be ((-2)/3)/(10/45). Let k = u - -27. What is the remainder when 93 is divided by k? 21 Suppose 11c - 7c - 226 = -2w, 2c + 4w = 122. What is the remainder when c is divided by 19? 17 Let p(s) = s3 - 15s*2 + 17s + 6. Let u be p(14). Suppose 4j - 255 = -7. What is the remainder when j is divided by (16/u)/((-2)/(-96))? 14 Let m = -45 + 48. Let r(f) = 2f3 - f2 + 2f - 6. Calculate the remainder when r(m) is divided by 16. 13 Suppose -1519 = -38h + 4181. What is the remainder when 438 is divided by h? 138 Let j be (-4)/3 + (-76)/(-12). Suppose -k = -2f + 14, -4 = jf - 3f. What is the remainder when (-7 + 8)/((-2)/k) is divided by 5? 4 Let f(g) = g2 - g + 1. Let h be 112/(-8)4. Calculate the remainder when f(h) is divided by 11. 10 Let o = 19 + -7. Suppose -4x - a = -2a - 25, 2x = -5a + 29. Calculate the remainder when (22/4)/(x/42) is divided by o. 9 Let v be (-4 + 2)(-1)/2. Suppose -v = -0d + 3d + k, k - 15 = 5d. What is the remainder when (5 + -2)(-2)/d	{ "pile_set_name": "DM Mathematics" }
form kw3 + fw*2 + a + jw and give j. -2 Rearrange s*3 + 65s*2 - 2 + 3s*4 - 4s*4 - 6s - 67s2 to h + zs*2 + ns + fs3 + qs4 and give n. -6 Express (-1 + u2 + 1)(4 - 12 + 0)(5u2 - 3u*2 + 4u*2) in the form mu*2 + t + xu*4 + lu + vu3 and give x. -48 Rearrange 240 - 7b + 11b - b to the form jb + o and give o. 240 Rearrange -91t4 - 54 - 89t*4 - 3t + 3t - 2t*2 + 176t*4 to the form pt*4 + yt*3 + mt*2 + x + zt and give z. 0 Rearrange (k*4 - 4k + 4k)(2 - 1 - 20)(3 - 3 - 9) to xk + pk2 + rk*3 + lk*4 + m and give l. 171 Rearrange -3j3 + 2 - j3 + 74j4 + 3j*3 + 5j - 75j4 + 2 - j2 to the form q + oj + lj4 + tj*3 + fj*2 and give t. -1 Express -l - 12 + 1 + 5 + (-3 + 2 + 0)(3l + l - 3l) - 3l + 3l + 4l as dl + v and give d. 2 Express -20i - 7i2 - i2 - 15 + 4 + 9 in the form ki + g + qi*2 and give g. -2 Express -q + 187 - 376 - 1658q*3 + 189 as r + dq*3 + aq + wq2 and give a. -1 Express (-79 + 25 + 147)(-42 + 42 + 2k)(2k3 - 2k3 + k3) in the form fk4 + uk*3 + hk + vk2 + b and give u. 0 Rearrange (6 - 3 - 8)(6h - 329h*2 + 341h*2 - 17h) to w + mh2 + rh and give m. -60 Express (-11 + 13b3 + 11)(12b + b + 13b) in the form jb + m + ob*2 + kb*4 + ub*3 and give m. 0 Rearrange -2b + 8b3 - 3b*3 - 2 - 838b*2 + 838b*2 to vb*3 + cb*2 + n + mb and give n. -2 Express (-3n - 10 + 10)(-29 + 0 - 4)(3n - 5n + 8n) in the form s + jn2 + mn and give j. 594 Rearrange (-96o - 324 + 324)(19 - 7 + 15) to ko + b and give k. -2592 Rearrange -41 + 17 - 1496i*2 + 9 + 13 to di + f + qi2 and give f. -2 Rearrange (-169 + 57 - 103)(5u - u - u)((1 + 1 - 1)(-u + 3u + 0u) - u + 4u - 2u) to yu*2 + j + zu and give y. -1935 Express x - x - 2x + (1 + 1 - 1)(2 - 2 + 2x) - 2x - 2x + 3x - 2x + 0x + 6x + (-4x + 6x - x)(-1 - 2 + 6) + 2x + 0x + 2x as ax + s and give a. 10 Rearrange -203l - 2l*2 - 3l*3 + 5l*4 + 205l + 4l2 to the form vl*3 + ol + m + tl2 + pl*4 and give o. 2 Rearrange 295o*4 + 3o*3 + 5o*2 + 2o*3 - 7o*3 - 293o*4 - 16 to the form xo*3 + co*4 + g + ao*2 + zo and give z. 0 Rearrange 17g - 42 + 18g - 37g to y + ng and give y. -42 Express -5j3 + 6j*3 + 2 + 5 + 2j*2 + (1 + j - 1)(-2 + 2 + 2j)(20 - 20 - 21j) as kj + rj2 + c + nj*3 and give c. 7 Express 48r*2 + 28r*2 + 13r*2 - 7r - 46r2 + 20r*2 in the form jr*2 + fr + i and give j. 63 Rearrange (-3 + 3 - 2)(3d - 6d + d) - d - 3d + 5d - 4d + 22 - 22 - 4d + 4d - 2d + (-4 + 0 + 3)(0 - 4d + 0) to fd + g and give f. 3 Express (3y + 3 - 3)(198y + 41y*2 - 198y)(y + 2y - 4y) in the form ny*2 + zy*4 + uy*3 + b + ly and give z. -123 Rearrange (1264r + 236770 - 236770)(2r - 5r + 0r) to the form gr + ar2 + u and give u. 0 Rearrange -25c + c*3 + 4c*2 + 22c - 2c4 + 4c*2 + (-13c*3 - 4c3 + c3)(2c - 1 + 1) to the form vc4 + m + lc*2 + tc*3 + qc and give m. 0 Express -2 - 16v4 - 18v*3 + 8v*4 + 22v*3 + 3v*2 in the form kv*2 + c + pv*3 + uv*4 + tv and give c. -2 Rearrange -2m4 - 8m*3 + 7m*3 - 2 - 3m + 33m2 + 3 - 3 to the form tm*2 + am*3 + qm + x + gm4 and give t. 33 Express (54l*2 - 30l*2 + 1 - 8l - 27l2)(-1 + 3 - 9) in the form f + kl2 + gl and give f. -7 Rearrange (-18z - 76z + 27z - 3)(3z2 - z2 - 3z*2) to xz*2 + hz + iz3 + u and give x. 3 Express -4042c + 2c3 + 1 - 1 - c2 - 2c*4 + 4016c in the form yc + ac*2 + qc*3 + l + dc*4 and give a. -1 Express (-2y + 3y + 3y - 2y)((0 + 0 + 3)(1 - 1 - 4y) - 9y - 33y - 2y) as ry*2 + f + oy and give r. -112 Express -6b2 + 11b - 11b - 44b*2 in the form w + lb*2 + ub and give l. -50 Express 226597h - 226597h - 190h2 as w + qh + th2 and give t. -190 Rearrange 12r - 8r - 282 - 3r to the form wr + x and give w. 1 Express (-5k - 2k + 5k)(1304k - 14543 + 14543) as i + wk2 + sk and give w. -2608 Rearrange (-2o2 + 3o2 + o2)(-2 + 5 - 2) - 3o*2 + 2o - 2o + 322o*2 + 649 - 649 to the form bo*2 + l + go and give g. 0 Express -p*3 - 2 + 2 + (-13p*2 + 9p*2 + 17p*2)(2p - 2p + 8p) + (-5 - p3 + 5)(0 - 7 + 3) in the form hp2 + cp + b + lp3 and give l. 107 Express -4982j*2 + 4982j*2 + 10 - 74j*3 + 3j - 3j as q + kj + dj3 + hj*2 and give q. 10 Express 29 - 19 - 5 - 1853o*2 - 5 in the form r + co*2 + so and give c. -1853 Express -11y + y2 + 1 + 11y + (3y2 - 2y + 2y)(5 - 2 - 2) + (6 - 6 - 2y)(-y - y + 0y) as ry*2 + d + vy and give d. 1 Rearrange -278l2 + 573l*2 - 271l*2 - 2l to n + bl2 + al and give b. 24 Express 8 + 5 - 4x + 0x + 4 in the form bx + g and give b. -4 Rearrange (0 + 0 - 2 + (0 + 0 + 2)(-1 - 2 - 2) - 1 + 3 - 3 - 1 + 1 + 2)(-h + h - h2 - 8) to o + uh + ih2 and give o. 88 Rearrange (186c*2 - 29c*2 + 3c*2)(2c - c + 3c) to the form y + bc3 + fc + mc2 and give b. 640 Rearrange (-1 + 4 - 4)(3u2 - 3u*2 - 2u*2)(39661 - 1040u + 349u - 39659) to the form ou2 + iu*3 + mu + w and give i. -1382 Express -35u2 - 32u*2 - 2u*3 - 2u + 4u2 - 34u*2 in the form l + pu + cu2 + au*3 and give p. -2 Express -33 + 11f + 53 - 21f + 14f as af + y and give y. 20 Express 7k - 3k3 - 196k - 10k as zk*2 + gk + xk3 + h and give g. -199 Rearrange (3c - 4c + 3c)(5 - 1 - 1) + 2c - 2c + c - 315c + 36c - 44c to h + kc and give k. -316 Express (59n*2 - 12n*2 + 2 - 268n*2)(n + n + 0n) in the form hn + bn3 + f + pn*2 and give h. 4 Express (0 - 5 + 0)(-22s - s - 31s) as ps + r and give p. 270 Rearrange (4 - 1 + 1)(-a + 1 - 1)(-85 - 7 + 10) to the form i + qa and give q. 328 Express -24z - 6z*4 + 41z - 21z - 1 in the form xz*4 + oz*2 + tz*3 + v + mz and give m. -4 Express (1 - 1 + 29t + (1 - 6 + 4)(2t + t - 2t) + 0t + 2t - 3t)(66 - 35 - 56) in the form i + qt and give q. -675 Express -3o - 10o + 14o - 57 as xo + w and give w. -57 Rearrange (3z - z - 3z + 1)(-11 + 0 - 99) to the form q + gz and give q. -110 Rearrange (2l*2 - 7l*2 + 3l*2)(-649 - 1364 - 573) to jl + t + fl*2 and give f. 5172 Express z - 4z + z + (109z + 100z - 19z)(2 - 4 + 1) in the form mz + y and give y. 0 Express -40 - 41 + 120 - w2 - 39 + 4w*3 + 2w as bw3 + jw + v + dw2 and give j. 2 Express 10x*3 - 31x*3 + 16x*3 + 2x2 - x4 + 4 + 6x3 - 5 as wx + gx2 + fx*3 + p + ix*4 and give i. -1 Rearrange -28o - 21 + 31o + 35o + 15 to h + jo and give h. -6 Rearrange -x4 + 0x - 2x4 + 2x + 1065 - 1092 to the form kx3 + dx*2 + ix + g + fx4 and give i. 2 Rearrange 194b*2 + 25b - 5b + 0b - 5b - 4 - 14b to ob2 + jb + s and give o. 194 Express (638l - 81l + 728l)(3l3 + 0l*3 - 5l*3) in the form fl*2 + jl + cl3 + ql*4 + w and give q. -2570 Express -9a + 7a - 8a3 + 12 + a4 - 14 as ta3 + xa*4 + ba*2 + v + wa and give v. -2 Express (-q - 2q - 6q)(-2 + 3 + 0) - 5 - 68q + 5 + 1 as l + zq and give z. -77 Rearrange -20 + 19k + 14 - 10k - 3k to gk + m and give g. 6 Rearrange 3n + 253n3 + 2 - 254n*3 - 4n to rn + an*2 + in*3 + b and give i. -1 Rearrange -126v*3 + 42v*3 - 114v*3 + (3v + 0v - 2v)(-2v*2 + 0v*2 + 4v*2) + 0v*3 + 3v*3 + 2v*3 to d + cv*3 + bv*2 + nv and give c. -191 Rearrange 289 - 289 + 5o - 19o*3 + (2 - 2 - 2o*2)(2o + 0 + 0) to ao + so3 + fo*2 + c and give s. -23 Rearrange (2 - 2 + 4k)(-4 + 2 - 1) - 7k - k - k to x + ck and give c. -21 Express -6u + 2u - 4u + 198 - 17u - 198 + (-3 + 4 + 1)(-2 + 2 + 2u) + 0u + 2u - 4u in the form g + yu and give y. -23 Rearrange -3361 - 6u - 2368 + 7782 - 3157 + (4u + 0u - 3u)(1 + 1 - 3) to the form au + z and give z. -1104 Rearrange (-1 + 3 - 5)(-22j + 4j + 8j)(2j2 + 3j - 3j)(3j - 3j - j) to the form tj4 + lj*3 + k + gj + zj2 and give t. -60 Rearrange (6a - 4a + 6a)(-296 + 38a + 296 + 108a) to the form ua + wa2 + y and give w. 1168 Express 1 - 11 - 1 + 11 - 3018v as z	{ "pile_set_name": "DM Mathematics" }
p. Let y(a) = -29a. Let m(z) = 5f(z) + 124y(z). Let t(w) = 7w + 6. Let n(h) = -20h - 17. Let d(q) = 6n(q) + 17t(q). Give m(d(c)). 31c Let r(q) = q - 27. Let l(n) = -14. Let j(t) = -5l(t) + 3r(t). Let b be j(5). Let a(i) = -b - 3i*2 + 4 + 4i*2. Let o(z) = -2z. Calculate a(o(y)). 4y2 Let u(a) be the first derivative of -a3/3 - 14a - 29. Let v(r) be the first derivative of u(r). Let l(j) = 71j2. What is l(v(k))? 284k*2 Let c(x) = 7x*2 - 4. Let d(i) = 24i*2 + 1. Give c(d(o)). 4032o*4 + 336o*2 + 3 Let j(n) = -n. Let c(y) = 512773y*2. Determine j(c(k)). -512773k*2 Let f(i) = 4599i. Let d(c) = -3c + 2. What is f(d(t))? -13797t + 9198 Let x(i) = -15i. Let w(v) = -4v*2 + 85v. What is x(w(n))? 60n2 - 1275n Suppose -5b - 7 = -3a + 4, -5a - b = -9. Let h(m) = -16m*a - m + m + 15m*2. Let t(n) = 10n. Determine t(h(u)). -10u2 Suppose 6y - 2 - 10 = 0. Let q(g) = 13gy - 29g + 29g. Let p(i) = -i. Let n(j) = -2j. Let m(o) = 4n(o) - 7p(o). Give q(m(d)). 13d2 Let a(j) = 72j*2. Let d(i) = -i + 2. Let r(y) = 2y*2 + 3y - 6. Let s(b) = -3d(b) - r(b). Calculate a(s(n)). 288n*4 Let w(x) = 3x. Let c(f) = -113683f. Determine c(w(l)). -341049l Let k = 21 - 19. Let c(p) = 4pk + p2 - 7p*2. Let d(g) = -6g*2. Calculate c(d(n)). -72n*4 Let h(r) be the first derivative of -2r*3 - 1. Let q(v) = 117v - 118v + 19 - 19. Calculate h(q(d)). -6d*2 Let r(t) = -3t. Let n(f) = 5f. Let c(b) = -2n(b) - 5r(b). Let s(j) = -10j. Calculate c(s(z)). -50z Let o(r) be the third derivative of -r5/60 - 2r*2. Let k(m) = 0 - 1 + 5m - 4m. Let q(b) = -4. Let g(u) = -4k(u) + q(u). Calculate g(o(l)). 4l2 Let b(l) = 18l*2 + 4l + 4. Let v(o) = -40o2 - 9o - 9. Let m(u) = 9b(u) + 4v(u). Let q(k) = 73k2 - 28k*2 + 20k*2. What is m(q(i))? 8450i*4 Let n(d) = 9d*2 + 8d + 4. Let m(r) = -100r2 - 90r - 45. Let a(w) = -4m(w) - 45n(w). Let s(v) = -13v2. Give a(s(l)). -845l*4 Let r(q) = 246q. Let i(g) = 7g - 48. Calculate i(r(h)). 1722h - 48 Let f(n) = -3n2. Let x(z) = -746388z + 746388z + 11z*2. Determine x(f(h)). 99h*4 Let u(k) = 14k. Let b(l) = 38l2 - 71l*2 + 42l*2. Determine b(u(r)). 1764r*2 Let w = 425 + -422. Let a(p) be the second derivative of 0 + 0p*2 - 7/6p*w + 9p. Let t(m) = -m. What is a(t(j))? 7j Let f(r) be the third derivative of -r5/30 - 8r*2 - 3r. Let t(q) = -101q. Calculate f(t(h)). -20402h*2 Let j(s) = 0 - 6s + 0 - 10s + 17s. Let k(b) = -81b2. Give j(k(u)). -81u*2 Let z(w) = -3 + 3 + w + w. Let q(j) = 8j*2 + 13. What is z(q(t))? 16t*2 + 26 Let j(o) = 26o. Let w(d) = -31480d. What is j(w(a))? -818480a Let x(a) = -2a2. Let u(c) = -13c - 18c + 76c - 27c. Calculate u(x(v)). -36v*2 Suppose 2k + k = 12. Let r(q) = 5q + 7q - 10q - kq. Let i(d) = 14d2. Determine r(i(t)). -28t*2 Let x(w) = -57w. Let q(u) = -8u2 + 4u - 8. Let o(d) = d*2 - d + 2. Let k(m) = 4o(m) + q(m). Calculate x(k(h)). 228h2 Let c(g) = -7 + 7 + 50g*2 - 47g*2. Let b = 24 - 17. Let q(m) = bm*2 - 7m + 7m. Determine q(c(a)). 63a*4 Let j(u) = 36u + 96. Let d(f) = 7f + 20. Let b(r) = 24d(r) - 5j(r). Let o(c) = 6c*2. Determine o(b(k)). 864k*2 Let m(t) = -78695t*2. Let o(r) = r. Calculate m(o(v)). -78695v*2 Let f(h) = -10h + 3. Let d(c) be the second derivative of -c*4/4 + 39c. Determine f(d(m)). 30m2 + 3 Let w(z) = -2z + z + z - 5z. Let o(i) be the third derivative of 0i3 - i2 + 1/24i4 + 0i + 0. What is w(o(v))? -5v Let u be (1/2)/((-4)/(-16)). Let d(c) = -7c*u + 28c*2 - 11c*2 - 9c*2. Let q(f) = 4 - 4 - 3f. Calculate d(q(n)). 9n2 Let x(l) = 2l. Let i(j) be the third derivative of 97j5/60 - 140j*2 + 2j. What is x(i(k))? 194k2 Let c(b) = 2b*2. Let i(y) = -59339y*2. Give c(i(o)). 7042233842o*4 Let i(k) = 152k*2 - 18. Let c(j) = 217j. Calculate c(i(t)). 32984t2 - 3906 Let l(w) = w2 - 210w + 15. Let f(o) = -3o2. Determine l(f(z)). 9z*4 + 630z2 + 15 Let z(y) = y. Let f(v) be the second derivative of -v3/3 + 3v2/2 - 28v. Let w(s) = -s + 1. Let q(t) = 5f(t) - 15w(t). What is q(z(k))? 5k Let a(p) = p3 + 8p*2 + p + 16. Let l be a(-8). Let x(r) = 13r + 5. Let f(c) = 20c + 8. Let u(v) = lx(v) - 5f(v). Let y(j) = 3j*2. What is y(u(g))? 48g*2 Let n(u) = 2u + 1132. Let r(i) = -9i2 + 4i. Give r(n(o)). -36o2 - 40744o - 11528288 Let b(v) be the first derivative of 26v3 - 20. Let h(p) = 3p. Calculate h(b(j)). 234j2 Let x(q) be the second derivative of -17q + 0q3 + 11/12q*4 + 0q*2 + 0. Let w(c) = -8c. Determine x(w(y)). 704y2 Let g(v) = -3v. Let t(y) be the second derivative of 0y2 + 14y + 0y3 - 1/12y*4 + 0. Give t(g(j)). -9j*2 Let y(l) = -4l*2. Let o(s) be the third derivative of 1/30s*5 + 0s + 9s2 + 0 + 0s*3 + 0s*4. Determine y(o(j)). -16j*4 Let b(h) = -10h + 7. Let o(d) = 7d - 5. Let v(x) = 5b(x) + 7o(x). Suppose -2p - 99 = -3a + 71, -5p = -2a + 117. Let y(l) = -l + a - 56. Give y(v(m)). m Let x(s) = 2s. Let k(u) = 10u - 7. Let d(y) be the third derivative of 7y*4/24 - 5y*3/6 + 7y*2. Let h(w) = -7d(w) + 5k(w). Give x(h(n)). 2n Let u(f) = -4f. Let y(h) = 53848h*2. Determine u(y(c)). -215392c*2 Let y(c) be the second derivative of 5c*4/3 + c. Let u(o) be the first derivative of -o - 37. Let d(g) = -g - 2. Let r(l) = -d(l) + 2u(l). Give y(r(a)). 20a2 Suppose -5t + 35 = -5w, -1 = 4w + 3. Let n(r) = r*2 + r + 1. Let u be n(-3). Let j(h) = uh - 6h + th. Let z(g) = 2g. Determine z(j(y)). 14y Let r(m) = 2m2 - 32. Let x(n) = 52n*2. Determine r(x(l)). 5408l*4 - 32 Let k(g) = 2g*2. Let w(u) be the third derivative of 7u*6/360 - 43u*3/6 + 2u*2. Let l(r) be the first derivative of w(r). Determine k(l(z)). 98z*4 Let g(w) = 2 - 3w - 2 + 0w - 10w. Let a(s) = s*2. Calculate g(a(l)). -13l*2 Let x(h) = 6h. Let g(z) = 3z2 + 121z + 2. Determine g(x(f)). 108f2 + 726f + 2 Let h(s) = -s*2 - 139s - 5. Let v(x) = -x*2 - 138x - 6. Let k(r) = -6h(r) + 5v(r). Let u(o) = 2o2. Calculate k(u(j)). 4j*4 + 288j*2 Let w = -215/8 - -27. Let i(m) be the third derivative of -2m*2 + 0m*3 + 0 + 0m + wm4. Let y(v) = -3v*2. What is i(y(p))? -9p*2 Let k(p) = 37p*2. Let n(w) = 1749w. Determine n(k(u)). 64713u2 Let k(s) = -2s*2 - 28. Let m(l) = -6l + 65. Let o be m(11). Let q(x) = -2x + 12. Let v(w) = 1. Let r(u) = oq(u) + 12v(u). What is k(r(g))? -8g*2 - 28 Let h(k) = 6k + 5. Let w(z) = -z - 1. Let o(l) = -l - 1. Let c(n) = -4o(n) + 3w(n). Let t(r) = 30c(r) - 6h(r). Let m(a) = -4a. Calculate m(t(i)). 24i Let p(j) = 1531j. Let t(c) = 2c*2 - 8c. What is t(p(l))? 4687922l2 - 12248l Let q(r) = 5r2. Let s = -4 + 6. Suppose -2y - 4o = 0, 3y - o = 3o. Let p(k) = sk - k + yk. What is p(q(m))? 5m2 Let f(r) = r2 + 34 - 16 - 18. Let j(v) be the first derivative of -11/2v2 + 0v - 5. What is j(f(c))? -11c2 Let j(v) = -v2 - v. Let n be j(-1). Let l(k) = 0k2 + k2 - 2k2 + nk*2. Let i(c) = -11c. Determine l(i(h)). -121h2 Let s(x) = -10x*2 + 2x + 1320. Let y(t) = 5t2. Determine s(y(i)). -250i*4 + 10i*2 + 1320 Let d(g) = -187324g. Let j(p) = 23p2. Calculate j(d(n)). 807076462448n*2 Let m(g) = -6g*2. Let q(h) = 58042h. Calculate m(q(c)). -20213242584c2 Let k(o) = -28o. Let c(l) = 5l. Let d(m) = 11c(m) + 2k(m). Let x(y) = 107y - 4. Give x(d(p)). -107p - 4 Let m(u) = 88u + 530. Let q(g) = -6g. Determine q(m(c)). -528c - 3180 Let o(s) be the third derivative of 7s5/30 - 15s*2. Let v be (124/(-8))/(2/(-20)). Let f(u) = -v + 155 + u. Determine o(f(a)). 14a*2 Let y(v) = 3v2. Let w(p) be the first derivative of p4/6 - 9p - 6. Let n(u) be the first derivative of w(u). Determine n(y(b)). 18b*4 Let t(l) = 6l*2 + 5l. Let k(h) = h*2 + h. Let n(v) = 3v + 28. Let c be n(-9). Let j(f) = ct(f) - 5k(f). Let z(x) = 45x. Calculate j(z(a)). 2025a2 Let z(d) be the second derivative of -d6/360 + d*3/6 + 2d. Let p(c) be the second derivative of z(c). Let o(a) = 0a - 83 + 83 - 3a. Calculate o(p(k)). 3k2 Let g(x) = 2x2. Let o(c) = -c2 + 2	{ "pile_set_name": "DM Mathematics" }
(b) 1.2 (c) -3 (d) 4 (e) -4 (f) 0.3 f Which is the second biggest value? (a) -0.08 (b) 0 (c) -125 a What is the fourth smallest value in 2/5, -45, 1/35, 9, 0, -3? 1/35 What is the second smallest value in -0.04, 16, -2/7, -14/9? -2/7 What is the fourth biggest value in 1, -4, 0.8, 49.76? -4 Which is the fourth smallest value? (a) -4 (b) -2 (c) 3/5 (d) -3/7180 c Which is the fifth biggest value? (a) -269 (b) 4 (c) 43 (d) 2/11 (e) 5 a What is the fourth smallest value in 1/4, -6, 18527, -1, 0.4? 0.4 Which is the second biggest value? (a) 10 (b) -17/15 (c) -4 (d) -5 b Which is the third biggest value? (a) 4 (b) -37.9 (c) 0.3 (d) 1/2 (e) -5 (f) -1/23 c Which is the second smallest value? (a) 0.052 (b) 0.2 (c) 22 b What is the fifth biggest value in -45, -2.3, 4/7, 2, 1/16? -45 What is the fourth smallest value in 0.4, 5, 0, 6, 25? 6 What is the second biggest value in -5, 0.4, -39, -80.5? -5 Which is the fourth smallest value? (a) 5 (b) 234 (c) -3/8 (d) -1 (e) -62 a Which is the smallest value? (a) -21/20 (b) -0.2 (c) 0.4 (d) 5 (e) 0 (f) -0.4 a Which is the fourth smallest value? (a) 4/3 (b) -2/19 (c) -0.5 (d) -0.23 (e) -0.199 (f) -3 e Which is the fourth smallest value? (a) 4 (b) 2836 (c) 1 (d) -1 (e) 3 a Which is the fourth smallest value? (a) 5 (b) 2 (c) 1/5 (d) -0.181 (e) -6/37 b What is the biggest value in -0.3, 5, 3/7, 12/5, 12, -0.27? 12 Which is the smallest value? (a) 1 (b) 9/55 (c) 2/5 (d) 0.004 d Which is the sixth smallest value? (a) 0.4 (b) 4 (c) -3 (d) -0.4 (e) -5 (f) 5.1 f Which is the sixth biggest value? (a) 1/28 (b) 0.4 (c) -23 (d) -0.5 (e) -7 (f) -5 c What is the second biggest value in 5, -6269, 8? 5 What is the fifth biggest value in 2, 3/2, 3/5, 2/7, 6.7, 16? 3/5 Which is the third smallest value? (a) -0.1 (b) -5/11 (c) -4 (d) 596/23 a What is the third smallest value in -0.2, -3.911, 0.4, -2? -0.2 Which is the fifth smallest value? (a) 3709 (b) -0.4 (c) 4 (d) -0.5 (e) -2/11 (f) -6/11 c What is the third smallest value in -1626, 0.03, -34, -5? -5 Which is the third biggest value? (a) -314 (b) -9/5 (c) 4/11 (d) 2 b What is the second smallest value in -1/3, 24954.2, 1? 1 Which is the third smallest value? (a) -2/5 (b) -3/7 (c) 0.1 (d) -1/8 (e) -2/213 d What is the third biggest value in 1320/19, -1/2, -3? -3 Which is the second smallest value? (a) -3/10 (b) 19 (c) 1/25 c Which is the second biggest value? (a) 4/9 (b) 0.7 (c) 4 (d) -42 b What is the third biggest value in 0.3, 2/7, 7.391, -0.93? 2/7 Which is the fourth smallest value? (a) 292 (b) 8 (c) 4 (d) 2 (e) -1 b Which is the fifth smallest value? (a) 0.4 (b) 6 (c) -1/5 (d) -2/97 (e) -25 (f) -5 a Which is the third smallest value? (a) -885 (b) 3 (c) 2/13 (d) -339 c What is the third biggest value in 22, 25, -0.3, -22/5? -0.3 Which is the second biggest value? (a) 0.057 (b) -0.2 (c) 1324 a What is the biggest value in -7, -7604, -0.2? -0.2 What is the third biggest value in 2/5, 8, 481, 0.5? 0.5 What is the fifth smallest value in 2, 2651, -4, 0, -3? 2651 What is the fifth biggest value in -0.017, -2, -2/117, 3/8, 1, -0.7? -0.7 Which is the second smallest value? (a) -3 (b) -1179 (c) 1 a What is the fifth biggest value in -5, -0.2, 62, -0.4, -1748? -1748 What is the second biggest value in -4, -3/13, 5342? -3/13 Which is the fourth biggest value? (a) 5 (b) 3221 (c) 0.4 (d) 5/4 c Which is the smallest value? (a) 34 (b) 102 (c) 60/11 c What is the third biggest value in -0.1, 3/4, -2/19, 2, 7/2? 3/4 Which is the fourth smallest value? (a) 5 (b) -2.8685 (c) 1/6 (d) -1 (e) 0.3 (f) 0.5 e Which is the biggest value? (a) 1 (b) 0.4 (c) 3/4 (d) -4 (e) -0.6 (f) -99 a What is the second biggest value in -9.6, 2/5, 2/631? 2/631 What is the second biggest value in 4, 19, -2, -1/3, 0.085? 4 What is the third smallest value in 1, -2, 218/187? 218/187 What is the fourth smallest value in 2, -1/4, -10, -4/11, 4, -0.6? -1/4 Which is the biggest value? (a) -8 (b) -2 (c) -96 (d) 1.3 d What is the third biggest value in -41/5, -0.2, -4, -29, -2, 4? -2 Which is the fourth biggest value? (a) 30.3 (b) -3/2 (c) 0.05 (d) 3.3 b Which is the fourth biggest value? (a) -32 (b) 2 (c) 1 (d) 0.86 a What is the smallest value in -155, -1, 4, -3, -0.4, -0.5? -155 Which is the smallest value? (a) 29.073 (b) -4 (c) -0.29 b Which is the third biggest value? (a) -14 (b) 3 (c) 139 a Which is the second biggest value? (a) 202/55 (b) 0 (c) 4 (d) 5 (e) 3 c What is the smallest value in 3, 9, -1/4, 5808? -1/4 Which is the third smallest value? (a) -802 (b) -4/11 (c) 5/4 (d) -1/2 b What is the second biggest value in -1/3, -0.28, -3, 32? -0.28 What is the smallest value in 0.7, 5, 4, 61, 35/4? 0.7 What is the third biggest value in 1/195, 2, -1, 3, 5, -18? 2 What is the third biggest value in -353, 4, -0.5, 2? -0.5 What is the smallest value in 2/19, -4/31, 0.3, -0.3, 2/11? -0.3 What is the fourth smallest value in -0.2, 0, 51/10, -8? 51/10 Which is the second biggest value? (a) -346.3 (b) 61 (c) 1 c What is the third smallest value in 0.015, -0.2, 1, -1/4? 0.015 What is the biggest value in -3/8, -4, -12727? -3/8 Which is the biggest value? (a) 0.3 (b) 0.042 (c) -0.3 (d) 6 (e) 1/9 d What is the biggest value in 9, -3/4, -29, 5, -5, 0.7? 9 What is the second smallest value in 3, -1, 13/5, 0.6, -0.2, -43? -1 Which is the smallest value? (a) -60 (b) 1 (c) 742 a What is the fourth smallest value in -0.02, 0.5, 393, 0.4? 393 What is the second smallest value in 4, 0.043, 3, 5, 4.6, -3/4? 0.043 Which is the second biggest value? (a) -1 (b) -173 (c) -5 c Which is the second smallest value? (a) 0.12 (b) -3 (c) 18 (d) 2 (e) -2 (f) -6/11 e What is the fifth biggest value in 0.03, -0.04, 3/5, -0.3, -7/18, -0.1? -0.3 What is the smallest value in -1/4, -91, -2/9, 0? -91 Which is the second biggest value? (a) -21.8 (b) -0.3 (c) 2 (d) -1489 b Which is the fourth smallest value? (a) -0.09 (b) -6/13 (c) -3 (d) -0.7 (e) 2/21 a Which is the biggest value? (a) -0.55 (b) 1 (c) -1/3 (d) 3 (e) -0.4 (f) -0.1 d Which is the second biggest value? (a) 3 (b) 0 (c) -0.5 (d) 53/6 (e) -0.8 (f) -1 a Which is the fifth biggest value? (a) -3/4 (b) 0.4 (c) 0.15 (d) -49 (e) 3/2 d Which is the smallest value? (a) -7/8 (b) -6 (c) -0.2 (d) 7/6 b Which is the third biggest value? (a) 0.2 (b) 13 (c) -49.3 (d) -5 d Which is the sixth smallest value? (a) -0.3 (b) -1/4 (c) 0 (d) -0.074 (e) 1 (f) -4/3 e Which is the third biggest value? (a) 13 (b) -38/13 (c) -3/26 (d) 0.2 (e) -1/7 (f) -1/2 c Which is the second smallest value? (a) -4/5 (b) 2/9 (c) -39 (d) 0.6 (e) 10 a Which is the third biggest value? (a) 0.7 (b) 4 (c) 2/681 (d) -8 (e) -3/5 (f) -4 c Which is the biggest value? (a) 11868/25 (b) 3 (c) -4 a Which is the second smallest value? (a) -4 (b) 5.117 (c) 0.1 c What is the fourth smallest value in -11/2, 2, -0.3, 2/15, -0.5, -3? -0.3 Which is the second biggest value? (a) -1 (b) 0.1 (c) -2/15 (d) 3/2 b Which is the second biggest value? (a) -0.03 (b) -8 (c) 2/3 (d) -15 (e) -5 a What is the third biggest value in -36/23, 1, 2/9? -36/23 Which is the third smallest value? (a) 12 (b) -1 (c) 6 (d) 2/5 (e) 3 (f) 0.3 d Which is the fourth biggest value? (a) -9 (b) 8 (c) -1 (d) 18/7 (e) 5 c What is the third biggest value in 1/3, -4, -0.3, -2.4? -2.4 What is the second smallest value in 3/4, -4, 2/3, 689? 2/3 What is the third biggest value in -15, -0.498, 0? -15 What is the third smallest value in 156, -1/5, 4, -4? 4 What is the second smallest value in -3, -7/743, -0.3? -0.3 Which is the second biggest value? (a) 0.1 (b) -12082 (c) -1.2 c Which is the smallest value? (a) 161.7 (b) 4.1 (c) -2 c Which is the second biggest value? (a) 0.7 (b) -6 (c) 2 a Which is the fourth smallest value? (a) 187 (b) 0.4 (c) -0.08 (d) 0.05 (e) -4 b Which is the biggest value? (a) -1/5 (b) 94 (c) -16 b What is the fifth biggest value in -11, -1/7, -4, -3, -1, -2? -4 What is the second biggest value in 9/11, -2, 0.3, 2/3, 8? 9/11 Which is the third biggest value? (a) -0.176 (b) 5 (c) -0.0234	{ "pile_set_name": "DM Mathematics" }
e common denominator of 69/11032 and 23/15169? 121352 Find the common denominator of -51/55 and -1/25. 275 Find the common denominator of 13/40 and 15/184. 920 Calculate the lowest common multiple of 11074 and 98. 11074 Calculate the common denominator of 51/14 and -83/28. 28 What is the common denominator of -34/7209 and 83/1602? 14418 What is the least common multiple of 10 and 10? 10 Calculate the smallest common multiple of 39 and 24. 312 Find the common denominator of 47/10 and 25/11. 110 What is the common denominator of 71/16 and -9/160? 160 What is the common denominator of -59/10 and -1/224? 1120 What is the lowest common multiple of 10554 and 18? 31662 Calculate the common denominator of 93/2 and 13/495. 990 Calculate the least common multiple of 658 and 752. 5264 Find the common denominator of 67/3837 and 149/6. 7674 What is the least common multiple of 5 and 721? 3605 Calculate the smallest common multiple of 2007 and 8920. 80280 What is the smallest common multiple of 5220 and 3654? 36540 Calculate the least common multiple of 737 and 22. 1474 What is the least common multiple of 3978 and 143? 43758 Calculate the common denominator of -7/10 and 75/724. 3620 What is the common denominator of -105/3484 and -73/546? 73164 What is the least common multiple of 1864 and 12? 5592 Calculate the smallest common multiple of 677 and 8. 5416 What is the common denominator of -43/1397 and -53/762? 8382 Calculate the lowest common multiple of 39 and 27. 351 Calculate the lowest common multiple of 294 and 1666. 4998 Find the common denominator of -83/374 and -105/68. 748 What is the least common multiple of 498 and 664? 1992 Calculate the lowest common multiple of 84 and 147. 588 Find the common denominator of -29/52 and 99/10. 260 What is the common denominator of -65/332 and 47/830? 1660 Find the common denominator of -10/639 and -38/63. 4473 What is the common denominator of 15 and 155/132? 132 Calculate the lowest common multiple of 169 and 10. 1690 What is the common denominator of 127/276 and -13/330? 15180 What is the common denominator of -91/12 and 38/29? 348 Find the common denominator of -50/9 and -33/806. 7254 Calculate the common denominator of 87/16 and 133/60. 240 What is the common denominator of -71/180 and 107/40? 360 Calculate the lowest common multiple of 217 and 62. 434 Find the common denominator of 81/20 and -19/48. 240 Calculate the lowest common multiple of 1012 and 242. 11132 Calculate the common denominator of -121/1686 and -53/2248. 6744 Calculate the least common multiple of 74 and 370. 370 Calculate the common denominator of -87/50 and -91/94. 2350 What is the lowest common multiple of 75 and 55? 825 Calculate the common denominator of 23/312 and 64/9. 936 Calculate the common denominator of 61/1304 and 109/44. 14344 Find the common denominator of 83/28 and 1/28. 28 What is the common denominator of 17/65 and 31/4485? 4485 What is the least common multiple of 1830 and 4? 3660 Calculate the least common multiple of 1781 and 7. 12467 What is the common denominator of -46/33 and 23/15? 165 What is the common denominator of -23/366 and 103/854? 2562 Calculate the common denominator of -67/6 and -33/398. 1194 Find the common denominator of 131/264 and -65/924. 1848 Calculate the smallest common multiple of 1928 and 2169. 17352 Calculate the lowest common multiple of 204 and 30. 1020 What is the common denominator of 75/4 and 77/26? 52 Calculate the lowest common multiple of 90 and 120. 360 Calculate the common denominator of 41/620 and -37/1550. 3100 Find the common denominator of 63/4 and 29/1191. 4764 Find the common denominator of 83/5250 and 4/273. 68250 Find the common denominator of 4 and 26/613. 613 What is the common denominator of 79/8 and -43/4? 8 Find the common denominator of 35/918 and 43/3. 918 Calculate the lowest common multiple of 6 and 24. 24 What is the smallest common multiple of 33 and 63? 693 Calculate the smallest common multiple of 2160 and 560. 15120 Calculate the smallest common multiple of 2428 and 32. 19424 What is the common denominator of 11/16 and -77/64? 64 Find the common denominator of -42/5 and -99/8. 40 Find the common denominator of 31/24 and 55/2034. 8136 What is the common denominator of 37/6 and -9/622? 1866 Find the common denominator of 63/10 and 9/89. 890 Find the common denominator of -20/1557 and 67/1557. 1557 What is the common denominator of 5/384 and -47/6? 384 Calculate the common denominator of -89/1743 and -10/33. 19173 Calculate the common denominator of 109/30 and 19/265. 1590 Calculate the common denominator of 113/24 and -23/404. 2424 Calculate the common denominator of 50/7 and -93/22. 154 Calculate the common denominator of 77/710 and 19/20. 1420 Calculate the least common multiple of 124 and 20. 620 Calculate the lowest common multiple of 10 and 1682. 8410 What is the smallest common multiple of 36 and 4? 36 What is the smallest common multiple of 3294 and 4? 6588 What is the common denominator of -59/40 and 111/88? 440 Calculate the lowest common multiple of 42 and 105. 210 Find the common denominator of -58/75 and 191/1890. 9450 Calculate the least common multiple of 715 and 1105. 12155 Find the common denominator of -95/22 and -1/6. 66 Calculate the least common multiple of 12669 and 10. 126690 Calculate the least common multiple of 144 and 144. 144 What is the least common multiple of 3 and 1686? 1686 Calculate the common denominator of -79/8970 and -151/552. 35880 Calculate the common denominator of 74/57 and 5/27. 513 What is the lowest common multiple of 125 and 125? 125 What is the lowest common multiple of 1125 and 10? 2250 Calculate the common denominator of 113/6 and 9/2. 6 Find the common denominator of 67/3690 and 56/615. 3690 Calculate the smallest common multiple of 3 and 10560. 10560 Calculate the common denominator of 68/945 and 53/21. 945 Find the common denominator of -77/159 and -38/2385. 2385 What is the smallest common multiple of 1995 and 20? 7980 Calculate the common denominator of 17/3 and -113/24. 24 Find the common denominator of -85/12 and -63/36986. 221916 What is the common denominator of -29/750 and -25/27? 6750 What is the lowest common multiple of 1652 and 9? 14868 Calculate the least common multiple of 348 and 8. 696 What is the smallest common multiple of 20 and 6900? 6900 Calculate the least common multiple of 156 and 92. 3588 Calculate the smallest common multiple of 12 and 4. 12 Calculate the common denominator of 79/130 and -74/245. 6370 What is the lowest common multiple of 50 and 14? 350 Calculate the common denominator of 101/50 and 1/80. 400 What is the common denominator of -69/4984 and -23/6? 14952 Calculate the lowest common multiple of 352 and 14. 2464 Calculate the common denominator of -75/598 and 9/22. 6578 What is the common denominator of 133/30 and -139/24? 120 Calculate the least common multiple of 8 and 2655. 21240 What is the common denominator of -27/100 and -67/8? 200 Calculate the common denominator of -7/22 and -41/14. 154 What is the common denominator of 51/4567 and 95/8? 36536 What is the common denominator of 1/2384 and 33/14? 16688 What is the least common multiple of 168 and 10? 840 Calculate the common denominator of -97/48 and 133/96. 96 What is the common denominator of -61/84 and -59/105? 420 Calculate the common denominator of 119/900 and -149/3300. 9900 Find the common denominator of 73/12 and 64/429. 1716 Calculate the smallest common multiple of 28 and 6. 84 What is the common denominator of 62/455 and 54/25? 2275 Calculate the common denominator of -20/57 and 28/171. 171 What is the lowest common multiple of 312 and 3336? 43368 Calculate the least common multiple of 2 and 971. 1942 What is the least common multiple of 72 and 64? 576 Calculate the least common multiple of 16416 and 4. 16416 What is the least common multiple of 8 and 2? 8 What is the smallest common multiple of 16 and 450? 3600 Calculate the common denominator of -87/160 and 89/160. 160 What is the common denominator of 22/135 and -7/9? 135 Calculate the smallest common multiple of 5792 and 1267. 40544 Calculate the lowest common multiple of 3 and 3468. 3468 What is the least common multiple of 1064 and 17? 18088 Find th	{ "pile_set_name": "DM Mathematics" }
fth biggest value? (a) -0.08 (b) -9 (c) 3 (d) -16 (e) 0.2 (f) -0.1 (g) -1 g What is the seventh biggest value in 4, 0.5, 64, 2, 41, 0.01, 961? 0.01 What is the fifth smallest value in 247, 146, 0, 16/3, 3/5? 247 What is the sixth smallest value in 2/17, 0, -1/6, -4, -2/195, -2/9, -2? 0 What is the fifth biggest value in 2/5, 0.1, -5753, 0, -0.11, -2/13? -2/13 Which is the fourth biggest value? (a) 17257 (b) -9 (c) -2 (d) 0.05 b What is the third smallest value in -0.00499219, 0.1, 0.04? 0.1 What is the third smallest value in -4/9, -1.134, 1/3, -0.504, 2/11? -4/9 Which is the third biggest value? (a) 0.3 (b) -2 (c) -74 (d) 4 (e) -0.0081 e Which is the second smallest value? (a) -163 (b) -0.985 (c) 65 b What is the third smallest value in -2/3, -7, 0, 8, 1, 50? 0 What is the smallest value in 5, 4, 138.4, -0.2, -3, 55? -3 Which is the fourth biggest value? (a) 2/11 (b) 5 (c) 1/2 (d) 2 (e) 0.2 (f) -12/127 (g) 1 c Which is the third biggest value? (a) 5/23 (b) -14.6917 (c) 4 b What is the biggest value in 12/103, -3, -2249? 12/103 What is the sixth biggest value in -13, -2/19, 0.1, -58/7, 4, -2/3? -13 What is the smallest value in -6/13, 5/3, 2/51865, -0.2? -6/13 Which is the biggest value? (a) -0.2 (b) -1 (c) 2/9 (d) 4 (e) -550 (f) -1.5 d What is the sixth smallest value in -1, 0.004, 0, 0.1, -41/12, 2/7? 2/7 Which is the third smallest value? (a) 4/13 (b) -0.2 (c) 1 (d) 87 (e) -2/5 (f) -20/103 (g) -0.5 b Which is the fourth biggest value? (a) -3/7 (b) 4/3 (c) 1 (d) 66 (e) -1/5 (f) 0.3 f Which is the second biggest value? (a) 102 (b) 7 (c) -264 (d) 26 (e) 0 d What is the second biggest value in 0.2, -9/109, -1/3, 2/3, -42? 0.2 Which is the second smallest value? (a) 1 (b) 1.2 (c) -0.5 (d) 2/15 (e) -5/3 (f) 3064 c Which is the third biggest value? (a) 7 (b) 2 (c) -0.3 (d) -798 c What is the third smallest value in -0.2, -1/14, 0.1, -3, -742/5, -5, -2/93? -3 Which is the second biggest value? (a) -979 (b) -2 (c) 7 (d) -14 (e) 3 e What is the third smallest value in 2, 0.007, 4, 2/11, -2, -7295, 2.7? 0.007 What is the smallest value in -2/301047, -2, 2/11? -2 What is the smallest value in 553, 0.02, -4, -1/470? -4 What is the fifth biggest value in -0.1, -4, -3/8, 4, 15/8, 936? -3/8 What is the smallest value in -198341, -3, 78? -198341 Which is the fourth biggest value? (a) -0.3 (b) -0.4 (c) -1/3 (d) 0.3 (e) -13/892 (f) 17 a What is the fifth biggest value in 2/3, -4, -13, -1/6, -1/4? -13 What is the third biggest value in -47777, -1/6, -1/10, 20, 10? -1/10 Which is the third smallest value? (a) -0.608 (b) -72344 (c) -0.1 c What is the second smallest value in 0.4, -0.4, -520, 4, -3, -11, 0.01? -11 Which is the seventh smallest value? (a) 2/9 (b) 0.3 (c) -69 (d) -2 (e) 454 (f) -4 (g) 0 e Which is the smallest value? (a) 0.1 (b) -28/27 (c) 0.3 (d) 4 (e) 0.2 b What is the third smallest value in -1, 1108, 1/13914? 1108 What is the third smallest value in -44, 3.57, -2/9, -0.4, -0.3, -1/5? -0.3 What is the fourth smallest value in -0.06, 2/9, -0.1, -2/7, -0.109, -1/8? -0.1 Which is the second biggest value? (a) -1/3 (b) 0.02 (c) -38 (d) -380 (e) 0 e Which is the fourth biggest value? (a) -3 (b) 1/2 (c) 18 (d) 4 (e) 1 (f) -2 (g) -168/25 b What is the smallest value in -1078, 2, 4, -1/6, 6/11, 5? -1078 What is the smallest value in 2, -5, 747, 1/4, -212, 3, -0.3? -212 Which is the sixth biggest value? (a) 48388 (b) 2/13 (c) -0.5 (d) 0.5 (e) 0.6 (f) 3 c What is the second smallest value in -3, -4, 4, -2/17, 1410, -0.4, -7/4? -3 What is the third biggest value in 269, -5/59, 0.022? -5/59 Which is the fourth biggest value? (a) 18 (b) -2 (c) -394/5 (d) 1659 (e) 0 b What is the sixth biggest value in -0.2, 45, 24, -6, 356, 1? -6 What is the fourth smallest value in -10787, 0, -3, 1655? 1655 Which is the third smallest value? (a) -1/4 (b) -85 (c) 2 (d) -2/21 (e) 5 (f) -0.2 (g) -10 a What is the third smallest value in 17/5, -0.4, 3, 2, 1/3, -1/5, -2? -1/5 What is the third biggest value in 12, -0.2, 1, 4, 8, 109? 8 Which is the smallest value? (a) -1/67497 (b) 3 (c) -0.75 c What is the biggest value in -6, -62, -86916? -6 What is the second smallest value in -12, 2, 99, -6, 28, 0.2, 4? -6 What is the fourth smallest value in 0.0112, 5, -2/7, -3, 1, 3, -2? 0.0112 What is the smallest value in 1/5, 1635, 291/8, -1/5? -1/5 Which is the fifth biggest value? (a) -4/5 (b) 0.3 (c) 1 (d) 4/29 (e) -63886/13 e What is the fifth biggest value in 2, -8, 2.99, 0.2, -11? -11 What is the fourth biggest value in -0.5, 1/53, 2, -20, -34/11? -34/11 Which is the fourth biggest value? (a) 274 (b) 268 (c) -3/4 (d) 0.1 (e) -1269 c Which is the smallest value? (a) -0.34 (b) 0.3 (c) -2/11 (d) 2/3 (e) 1/10 (f) 15 a Which is the third smallest value? (a) -8 (b) -0.4 (c) -0.3 (d) -9 (e) 1/2 (f) 0.0628 b Which is the third smallest value? (a) 5 (b) -5 (c) 161 (d) 3157/3 (e) -3/4 a Which is the second biggest value? (a) 1 (b) 0 (c) -3/2 (d) 509/4 (e) 5 (f) 15 f What is the seventh smallest value in 4, -0.2, -49, -0.1, -2, -75/8, 0.6? 4 What is the sixth smallest value in -2/5, -5, 5, -0.76, -21107, 0.1, 0.2? 0.2 What is the fourth smallest value in 4, 1.8, -3, 0.4, -2/147? 1.8 What is the fifth smallest value in 2, -4/7, 69018, -1/3, -18? 69018 Which is the second smallest value? (a) -2/11 (b) -56869 (c) 59 (d) 15 a Which is the second smallest value? (a) -73874 (b) 9 (c) 4 c Which is the smallest value? (a) 1 (b) -288 (c) 132 (d) 1.9 b Which is the fifth smallest value? (a) 5/9 (b) 1 (c) 0.059 (d) -1 (e) 3/2 (f) -47 (g) -4 a What is the sixth biggest value in -7, -1/3, 1/3, -708.28, -3, 4? -708.28 What is the fifth smallest value in -2/7, -1, -2, 2/15, 559987/3? 559987/3 What is the fifth smallest value in -5, 0.2, -46, 593, 0, -2? 0.2 What is the biggest value in 2, -0.132, 39, -145? 39 What is the fourth biggest value in 314255, -0.2, 4, -0.3? -0.3 Which is the fifth smallest value? (a) -0.6 (b) -1/5 (c) 0.19 (d) -1/19198 (e) 3/2 e What is the third biggest value in 0.5, -1061.5, 0.2, 1/10, 9? 0.2 Which is the third smallest value? (a) 0.7 (b) -8831 (c) -1/2 (d) 0.0026 d What is the biggest value in -126, 1, -21245? 1 Which is the fourth smallest value? (a) 0.2 (b) 363018 (c) 3 (d) 1/8 b What is the biggest value in 34/69, -4, -0.2, -2/5, -1? 34/69 What is the third smallest value in -42, -122, 1, 10, -1/6, -4, 3/2? -4 Which is the third biggest value? (a) 1.19 (b) 49 (c) -1/4 (d) 3/41 d Which is the third biggest value? (a) -2/9 (b) 2/15 (c) -1 (d) 231/2 (e) -16/29 (f) 0.1 (g) 3 b Which is the biggest value? (a) 38033 (b) -312 (c) 0.4 (d) -0.4 a Which is the third smallest value? (a) -0.4 (b) -0.3641 (c) -14 (d) -213 a Which is the third biggest value? (a) -0.5 (b) 1 (c) -51/70 (d) 3 (e) -18 (f) 22 b Which is the biggest value? (a) -2 (b) -4 (c) -26 (d) -0.338 (e) 5 e Which is the sixth biggest value? (a) 201 (b) 4/3 (c) -0.16 (d) -0.37 (e) -0.2 (f) -0.5 f What is the smallest value in -8.5, -8, -2, 4, 0.31, 0? -8.5 What is the third biggest value in 3, -4, 968, -1422/11, -0.2, 2/7? 2/7 Which is the third biggest value? (a) 22 (b) 321 (c) -222 c Which is the sixth biggest value? (a) 0.1 (b) 2/11 (c) -95 (d) 4 (e) 13 (f) -3 (g) -4/13 f Which is the sixth smallest value? (a) 2 (b) -32 (c) 11 (d) -23/2 (e) -2/17 (f) -4 (g) -2 a Which is the second biggest value? (a) 2/179 (b) -354360 (c) -4 c What is the third biggest value in 1.28, -3.778, -24, 0? -3.778 Which is the fifth smallest value? (a) 5/6 (b) 0.04 (c) 4 (d) -2 (e) -0.5 (f) 2 (g) -1 a Which is the smallest value? (a) -93 (b) 16.7 (c) -3/4 (d) 0.2 (e) 1/2 (f) 4 a Which is the third biggest value? (a) 0 (b) 2/3 (c) -0.3 (d) -3 (e) 4.5 (f) 61 (g) 3 g Which is the second biggest value? (a) 2 (b) 4302 (c) -50 (d) -4 a What is the biggest value in -3, 4/3, 57966, 8, 1/2? 57966 What is the second smallest value in 0.5, 0.1, 4680, -2/11, -5? -2/11 Which is the biggest value? (a) 2/2065 (b) -2/15 (c) 83 (d) 1/3 c Which is the third smallest value? (a) -3.9 (b) 3 (	{ "pile_set_name": "DM Mathematics" }
e prime factors of s? 2, 3, 7 What are the prime factors of (-855)/2(-28)/(-175)-190? 2, 3, 19 Let o be (-5 - (-1162)/(-21)) + 9/27. Let m(v) = 33v2 + 3v. Let r be m(-2). Let z = r + o. List the prime factors of z. 2, 3, 11 Suppose -8f + 10848 + 20096 = 0. What are the prime factors of f? 2, 967 Let o be (-6)/(-24) - (-5419)/4. Let p = o + -728. What are the prime factors of p? 3, 11, 19 Let i be -39(10 + -5 + 222/(-9)). Let q = 1359 - i. List the prime factors of q. 2, 37 Suppose 38i - 300 = 43i. What are the prime factors of (1230/25)/(3/i-6)? 2, 41 Suppose 0 = -l + 6l - 50. Suppose 3o = lo - 2450. List the prime factors of o. 2, 5, 7 Suppose -4h - 4k - 340 = 0, -3h - k = 27 + 220. What are the prime factors of (-294 - h)/((-3)/8)? 2, 71 Suppose 288 = 4q + 4n, 2q - 102 = 4n + 30. Let r = -66 + q. Suppose h - 3o = 6h - 474, -2h + ro = -200. What are the prime factors of h? 2, 3 Let b(j) = -j3 + 20j*2 - 18j - 118. What are the prime factors of b(13)? 3, 277 Let j = 132 + -125. List the prime factors of (j/(-1) + 5 + -7)-7. 3, 7 Suppose -96k + 48 = -99k. What are the prime factors of k/(-12)(324 + 3)? 2, 109 Suppose -46529 = -31w + 15657. List the prime factors of w. 2, 17, 59 Let u(l) = 28l*3 - 13l*2 + 24l - 111. What are the prime factors of u(8)? 5, 11, 13, 19 Let g = -319 - -319. Suppose -15d - 3d + 29088 = g. What are the prime factors of d? 2, 101 What are the prime factors of (364/35)/(14/(-70) + 493/2455)? 2, 13, 491 Suppose 5v + 69 = 4r, -2v - 31 + 4 = -r. Let l = 34 + v. Suppose -l = -b + 3d - 6d, d - 29 = -4b. List the prime factors of b. 2, 3 What are the prime factors of (-553 - -330)/((-2)/46)? 23, 223 Let g(z) = -1099z + 934. List the prime factors of g(-13). 31, 491 Let r(i) = i3 - i2 - 8i + 2. Let x be r(3). Let y be (1/(x/(-6)))/312. Suppose -48 = -yz + 390. List the prime factors of z. 73 Suppose 0 = 4b + 239 - 1843. Let j(t) = t2 - 15t - 748. Let h be j(-24). Let a = b - h. What are the prime factors of a? 3, 71 List the prime factors of (2 + -6)/(-16) - -170807/4. 2, 53, 167 Let m = -123 + 123. Suppose 0 = -2j - 2j + 144. Let h = j + m. List the prime factors of h. 2, 3 Let p be (-9 + 9 + 35)436/10. Let k = p + -782. List the prime factors of k. 2, 3, 31 Suppose -52 = -o - 47. Suppose 4v - 2548 = -3a, oa + 5v - 4244 = v. What are the prime factors of a? 2, 53 Suppose -264 = 17c + 263. What are the prime factors of 3 - c/221? 2, 17 Let p = -269 + 1018. Let s = p - 409. What are the prime factors of s? 2, 5, 17 Suppose -q = -8 + 8. Suppose -4f - 8 = 0, 4u + qu - 86 = -f. Suppose -2i + u = -168. List the prime factors of i. 5, 19 Let p = -41807 - -58562. What are the prime factors of p? 3, 5, 1117 Let f = 8521 + 4375. List the prime factors of f. 2, 13, 31 Suppose 42v - 26047 - 71053 = 126004. List the prime factors of v. 2, 83 Suppose -34w = 37w - 349604. What are the prime factors of w? 2, 1231 Let m = 136 + -125. Let l(t) = t*3 - 9t*2 + 15t - 35. List the prime factors of l(m). 2, 3, 31 Suppose p = -s - 491, -5s - 3223 = 3p - 764. Let a = 712 + s. List the prime factors of a. 3, 73 Let u(f) = 3f + 26. Let q be u(-8). Suppose 3c + n - 76 = -qc, -2c + 33 = 3n. Suppose 0p + c = 4d - 3p, -5 = -2d - p. What are the prime factors of d? 3 Let d = 382 + -42. Suppose -5n - 5k + 2785 = 0, n - d = 3k + 213. What are the prime factors of n? 2, 139 Suppose 27760 = -12w + 88791 + 63577. What are the prime factors of w? 2, 11, 59 Suppose -5z + 25 = -5. Let s(i) = 312 - 95 + 30i - 233. What are the prime factors of s(z)? 2, 41 What are the prime factors of (232/(-14) - (-264)/462)-1151? 2, 151 Let a(s) = 2923s - 2118. What are the prime factors of a(8)? 2, 7, 31 Suppose 0 = -33g + 34g - 3. Suppose gk - 99 = -2s, -2s + 36 = -4k - 70. Let m = -45 + s. List the prime factors of m. 2, 3 Suppose 3z - 3y = 747, 2z = -y + 5y + 490. Let s = z - -104. List the prime factors of s. 3, 7, 17 Let m(k) be the first derivative of -k5/10 + k4/24 + 4k3/3 - 16. Let v(x) be the third derivative of m(x). What are the prime factors of v(-7)? 5, 17 Suppose o + 2y - 6y - 1102 = 0, -3o = y - 3280. What are the prime factors of o? 2, 547 Suppose 83b + 3039 = -3601. Suppose 3y + 769 = -2x - 0x, -4y - 3x - 1024 = 0. Let a = b - y. What are the prime factors of a? 179 Let a be (152/(-6))/2(-8484)/56. Suppose 3u + 4t = 1147, -5u + 0t + a = 3t. Suppose 3g + 2g - u = 0. What are the prime factors of g? 7, 11 Suppose -c + 43x = 46x - 3824, -4x = -5c + 19082. What are the prime factors of c? 2, 23, 83 Suppose 0 = 14b - 28b - 1778. Let o = 322 + b. What are the prime factors of o? 3, 5, 13 Let i = 8507 - -1777. What are the prime factors of i? 2, 3, 857 Let c(s) = -171s + 67. Let n(v) = -v - 1. Let w(a) = c(a) + 3n(a). What are the prime factors of w(-2)? 2, 103 Suppose -36o + 228775 = -63815 - 40266. List the prime factors of o. 2, 3, 23, 67 Suppose 5d + s - 9654 = 0, 49s = -4d + 44s + 7719. What are the prime factors of d? 1931 Let z = -159 + 151. Let m = z + 77. What are the prime factors of m? 3, 23 Suppose m = -4u + 5598, -3u = 5m + 2073 - 6280. Suppose -2r = -3c + u, -2c + 0r + 931 = -r. What are the prime factors of c? 463 Let z be (-2)/(0 + (1 - 2)). Let d = 1699 + -1639. Suppose 13 - 1 = -3l, -zm = -3l - d. List the prime factors of m. 2, 3 Let g = 18 - 13. Suppose ga + 4y - 8 = 2y, -2y + 8 = -3a. Suppose 0 = -2c - ac + 124. List the prime factors of c. 2, 31 Suppose -o + 58757 = 4z, 176262 = 3o + 75z - 72z. List the prime factors of o. 41, 1433 Suppose -4x + x + 15 = 0. Suppose -xq + 0q + 19 = -3d, -3d = -q - 1. Suppose 4r - qb = 451, -4r + 2b + 285 = -181. List the prime factors of r. 7, 17 Let q = 92 + -100. Let d be (-54)/q7/((-14)/(-8)). Suppose -23n = -dn + 580. What are the prime factors of n? 5, 29 Suppose -3x = 4c - 23136, 38560 = 5x - 4c + 2c. List the prime factors of x. 2, 241 Let y(b) = b2 + 6b - 3. Let c be y(-7). Suppose q + 2607 = cq. What are the prime factors of 5 + (-189)/39 - q/(-13)? 67 Suppose w + 2934 = 3h, 6h - 4890 = h + 2w. Suppose -8g + 4g + c = -h, 5g = -2c + 1229. What are the prime factors of g? 5, 7 Suppose -6v = -19v + 6383. Suppose 20h + v = 21h. List the prime factors of h. 491 Let x = -258 - -248. List the prime factors of (-1142)/(-5)x/(-4). 571 Suppose 5u + 6w = w + 45, 0 = 2u + w - 16. Let d(b) = 5b - 33. Let p be d(u). Suppose pn = -5r + 24, 5n - 90 = -4r - r. List the prime factors of n. 2, 11 Suppose -53z - 48z = 4z - 3325980. List the prime factors of z. 2, 7919 Suppose 322 = 7d + 2744. Let v = d - -712. What are the prime factors of v? 2, 3, 61 Let f(c) = 52c + 42c - 28 - 91c. Let z be f(13). Suppose -8m + zm = 627. List the prime factors of m. 11, 19 Suppose -7w - 3i + 3064 = -6w, -5w + 5i + 15260 = 0. Let b = w + -2171. List the prime factors of b. 2, 13, 17 Let x(i) = 61i*2 - 3i + 6. Let a be x(3). Suppose -7n + 1771 = a. What are the prime factors of n? 5, 7 Suppose 0 = 3d - 3r + 6, -5d + 1 - 2 = -2r. Let o(b) = -2 + 2b*2 + b - d + 0b + 0. List the prime factors of o(-2). 3 Let l(r) = -2728r + 2196. List the prime factors of l(-3). 2, 3, 5, 173 Let c be ((-5)/10)/((-1)/(-4)). Let t be (42/(-7))/(3c/(-6)). What are the prime factors of (t/(-9))/(9/((-20493)/(-6)))? 11, 23 List the prime factors of -2 + (-2 + 8 + -11)(-5414)/2. 3, 13, 347 Suppose 0 = -276t + 282t - 24120. What are the prime factors of t? 2, 3, 5, 67 Suppose -61 = -4r - 5i, 3i = -4r + 7i + 52. What are the prime factors of (8/(-10) - -1)/(r/60130)? 859 Let g(m) = 96m + 952. What are the prime factors of g(-5)? 2, 59 Suppose 0 = 6m - 502 + 508. Let q(k) = 496k2 - 5k - 5. List the prime factors of q(m). 2, 31 Let h(u) = -9u - 67. Let o be h(-8). What are the prime factors of 13305/20 + o/(-20)? 5, 7, 19 Let p(f) = 3f*2 + 43f + 21. Let z be p(-14). Let u(v) = 2v2 + 7v - 25. What are the prime factors of u(z)? 2, 61 Suppose u = -2t + 11396, 172t - 167t - 5u = 28490. What are the prime factors of t? 2, 7, 11, 37 What are the prime factors of (-80846)/(-4) - (-73)/146? 2, 31, 163 Suppose s + 6*s	{ "pile_set_name": "DM Mathematics" }
b)(-3b*2 + 6b2 - b2) - b3 + b3 - b*3. -13b*3 Expand (-3z + 2z - z)(1 + 2 - 4)(52 + 41z - 52)(-3 + 3 + 2). 164z*2 Expand -2m*3 + 4m*3 + 3m*3 + 3m*3 + 2m*3 - 4m*3 + (-2m*3 - m + m)(-3 - 2 + 3) - 1 + 2m3 + 1 + m3 - m3 + 3m*3. 15m3 Expand g3 + g*3 - 4g*3 + 3 - 3 - 2g*3 + (-4g*2 + 2g2 + g2)(5g - g - 3g) - 3g*3 - 2g*2 + 2g*2 - 3g*3 - 2g*3 + 4g*3. -9g*3 Expand (3x*2 - 3x*2 + 2x*2)(158 - 30x - 158) + (1 + 5x*2 - 1)(-2x + 2 - 2). -70x*3 Expand (-9 + 6 - 8)(-100 - 17v2 + 100) - 1 + 3 - 5 + 2v*2. 189v2 - 3 Expand -o4 + 3 - 3 + (-2o2 + 2o*4 + 2o*2)(-5 + 1 + 2) + o3 - o3 + o*4 + (9o*2 - 10o*2 - 36o*2)(-2o2 - 1 + 1). 70o*4 Expand (3o + 0o - 2o)(153 - 153 - 109o + 783o). 674o*2 Expand (5 - 5 - 2q)((3 - 2 + 0)(-6 + 2 + 2) - 1 - 2 - 1). 12q Expand (4 - 2k - 4)(249 - 106 + 33)(3 - k - 3). 352k2 Expand (12 + 5 - 4)(-4l - 4l + l + (-1 + 2 + 1)(2l + l - l) - 1 + 1 - 2l)(-2l4 + 4l*4 + 0l*4). -130l*5 Expand (4y2 + y2 + 6y2)(-11 + 39 + 6)(3 - 3 + 3). 1122y*2 Expand (-2 - 7 + 2)(-t - 2t + 0t)(0t*2 - 2t*2 + 0t*2). -42t*3 Expand (-2y*2 + 0y*2 - 3y*2)(2y - 4y + 0y) + (-7 - 2 + 4)(-3y3 + 2y*3 + 2y*3). 5y*3 Expand -6r*2 + 4r*3 + 6r*2 + (-2 + 2 + r)(-2r2 + 3r*2 - 2r*2) + 6r + 1 + 16r - r3 - 19r. 2r3 + 3r + 1 Expand (354 - 354 + 87r)(-3r3 - 3r*3 + 0r*3). -522r*4 Expand 508j*3 - 5492 + 5492 + (-5j + 4j - j)(-j*2 + 3j2 - j2). 506j3 Expand (0 + 0 + 9b*4)(-5 - 4b - 6b + 8) - 4b2 + 2b*5 + 0b*2 + 3b*2. -88b*5 + 27b4 - b2 Expand (0a2 + a2 + a2)(5a - 4a - 3a) - a - a3 + a + (-3a*2 + 2a*2 + 0a*2)(-6a + 10a + 4a). -13a*3 Expand ((-d - 2d + 2d)(-2d + 4d + 0d) + 0d*2 + 0d2 - d2 - d*2 + 7d*2 + 4d*2)(-13d + 16d + 16d). 133d*3 Expand 0l*3 + 0l*3 - 2l*4 + (-4l*3 + 6l3 - l3)(3l + 6l - 12l) + (-4l + 2l + 0l)(-l*3 - 2l*3 + 2l*3) - 8l*4 + 14 - 14. -11l*4 Expand (4b + b - 3 - 6b)(60b2 - 82b*2 - 61b*2). 83b*3 + 249b*2 Expand (-5h*4 + 0h*4 + 4h*4)(-h - 1 + 1) + 80h5 - 2h*2 + 85h*5 - 172h*5. -6h*5 - 2h*2 Expand (-49 + 14 - 74)(-j5 + j3 - j*3). 109j*5 Expand (0 - 2 + 3)(-1 + 0 - 2)(6o*4 - 4o*4 + 0o*4). -6o*4 Expand (-2x + 2x + x)(-2x3 + 3x*3 + 0x*3) + 2x4 + x4 - 2x4 + 23x + x*4 - 23x + 2x4 - x4 - 3x4. x4 Expand (-7 + 16 - 36)(1 - 1 + 3q + 2)(2q*3 - 3q*3 + 2q*3). -81q*4 - 54q*3 Expand (6v*3 - 3v*2 + 0v*2 - 5v*3)(13v + v - 6v) + v*4 + 0v + 0v. 9v*4 - 24v*3 Expand ((2g + 0 + 0)(-3 + 4 + 0) + 2g - 4g + 3g)(-95g*4 + 384g*4 + 282g*4). 1713g*5 Expand ((2o + 472 - 468 + 2o)(-2 + 3 + 0) + (3o - o - 4o)(-4 + 1 + 4))(0 - 1 + 3). 4o + 8 Expand (-1 - z3 + 1)(1771z2 + 636z*2 - 640z*2) + 3z*5 - 4z*5 + 2z*5. -1766z*5 Expand (-f + 0f + 2f)(2f - f - 2f) + f - f - 2f2 - 33f*2 + 13f*2 - 9f*2 + 0f*2 - 2f*2 + 6f*2. -28f*2 Expand (6 + 2 - 3)(3d + 2d - 7d)(4d3 + 5d*2 - 4d2 - d3). -30d4 - 10d*3 Expand (-5g - 6g + 18g + 6)(-3 - 6 + 7)(0 + 0 - 1). 14g + 12 Expand -6z + 9z + 0z*4 - 2z*4 - 1 - 2z*4 - 2 + 2 + (0z - z*3 + 0z)(4 - z - 4) - 1 + 1 - z4 + 3z*4 + 2z4 - z4 + z*4 + 4z4 + z4. 6z4 + 3z - 1 Expand (3n4 + n2 - 4n*4 + 0n*4)(0 + 1 - 2 + (-2 + 4 + 0)(-4 + 15 + 5)). -31n*4 + 31n*2 Expand (-134t + 71t + 72t)(4 + 0 - 3)(-4t2 - 1 + 3 + 7t*2). 27t*3 + 18t Expand ((f + 0 + 0)(0 + 2f + 0) + 32 + 104f2 - 32)(-f*3 + 4f*3 - 2f*3). 106f*5 Expand (-2o + 3o - 2o)(-28o - 6o + 7o)(-1 - o2 + 1). -27o*4 Expand -127 + 127 + 10t*4 + 7t*2 + (2t2 - t2 + 0t2)(-6t2 + 9 - 9). 4t*4 + 7t2 Expand (-q3 + 2q3 + q3)(10 - 8 + 8) + 2q3 + 4q - 4q + (1 - 2 + 3)(0q3 - q3 + 3q3) + q3 - 2 + 2. 27q3 Expand (34 - 17 - 74)(-5z4 - 2z4 - z4). 456z4 Expand 4g*2 - 3g*4 - 4g*2 - 2g*4 - 2g*4 + 6g*4 + (-2g + 0g + 4g)(-3g*2 + 3g*2 + 2g*3) + 0g*3 + 0g3 - g4 + 4g4 + 3g*4 - 4g*4. 5g*4 Expand 0r + 0r + 2r*4 + (0r2 + r4 + 0r2)(-3 - 4 + 3 + (-7 + 2 - 1)(0 - 2 + 4) - 1 + 10 + 0). -5r*4 Expand (-16d + 6d + 26d)(-3d + 2d + 2d + (0d - 3d + d)(4 - 3 + 1) + 2d - 4d + d + 0d + d + d)(-2d + 2d + 7d). -224d3 Expand (2y2 - y2 + 0y2)(-y3 - y3 + 53y - 42y). -2y5 + 11y*3 Expand 2x - 2x - x5 + ((-4 + 2 + 1)(-45x4 - 91x*4 - 9x*4) - 2x4 + x4 + 4x4)(-x + 0x - x). -297x*5 Expand (-5 + 6 + 19)(-3 + d2 - 1 + 29) - 5 + 5 - d2. 19d2 + 500 Expand (2l*2 + 4l*2 - 4l*2)(-l - 42l2 - l + 0l). -84l4 - 4l*3 Expand (2o - 8o - 4o)(1 + 1 + 0). -20o Expand (2u2 + 2 - 2u*2 + 3u*2)(-84 + 67 + 2u + 0u - 3u3). -9u*5 - 51u*2 + 4u - 34 Expand (-5 + 7v3 + 16v - 15v - 2v*3)(0 - 1 + 3). 10v3 + 2v - 10 Expand (2 - 10 + 47)(-4 + 2i + 4)(-i2 + i2 + 3i - i*2 + 3). -78i*3 + 234i*2 + 234i Expand (-2k + 5k*4 - 3k4 + k4)(2k + 6k - 4k + 5k + 3 - 3 + (-2k - k + k)(-1 - 4 + 6)). 21k*5 - 14k*2 Expand (-27w*4 - 850w + 850w)(-15 - 10w + 15). 270w*5 Expand -2b2 + 2 - 2 + b2 + b*2 + 0b*2 + (-3b + 7b + 0b)(-24 + 24 - 11b) + 2 + 4b2 - 2. -40b*2 Expand 3p*4 - 5p*4 + 3p*4 + (-5p + 2p + 5p)(0p - 2p3 + 0p) - p + p + 2p4 + (p3 + 2p3 - p3)(-21 + 7p - 17p + 6p). -9p4 - 42p*3 Expand (-2b - b - b)(0 + 9 - 1 - 2 + 5 - 1 + 3 + 2 - 4 + (1 - 1 + 2)(2 + 1 - 2) + 2 - 1 + 1 + 5 - 5 - 2 + 4 - 1 - 7) + 2b - 5b + b. -38b Expand (26 + 97 + 95 + 189 + 105)(1 + 2w - 1). 1024w Expand 302y4 - 351y*4 - 481y4 + (y3 - y*3 - 2y*3)(y + 4y - 6y). -528y4 Expand (20o + 38o - 48o)(0o + 20 - 21 - 4o + o2). 10o*3 - 40o*2 - 10o Expand -19o4 - 52o + 110o - 58o + (-6o + 0o + 4o)(-13o + 2o*3 + 13o). -23o4 Expand (-25d + 20d + 31d)(4d*2 - 20d*2 - 11d*2). -702d*3 Expand (-14h + 3h - 7h)(3h*2 + 2h*2 - 3h*2) + (-3h + 2 - 2)(-h2 - 1 + 1). -33h*3 Expand (0y + 2y - y)(23y - 4y*2 - 23y)(-6y - y - 7y). 56y*4 Expand (223f - 2f3 - 223f)(3 - 3 + f2 - 3f2 - f2 + 2f2 + (1 + 1 + 0)(-3f2 + 3f - 3f)). 14f*5 Expand -1018p*2 + 32p*3 + 1018p2 + (0 - p2 + 0)(-4p + 2p + 0p). 34p3 Expand -2l*2 + 0 + 0 + (2l + 6l - 5l)(3l + 1 - 1) - 2l + 4l*2 + 2l. 11l2 Expand (-2m*3 + 0m*3 + 0m*3 + 3m*3 + 2m*3 - 3m*3 + (-3m + m + 4m)(3m2 - m2 + 0m*2))(-4 + 2 + 3 + (-10 + 19 + 17)(2 - 1 - 2)). -100m3 Expand (-r2 + 4r2 + 3 - 2)(-8 - 6 + 4)(-5 + 1 + 1). 90r*2 + 30 Expand (2z*2 + 3z*2 - 3z*2)(8z + 2z - 3z + (2z + 0 + 0)(0 - 10 - 6)). -50z*3 Expand (0j*2 - 22j*2 - 8j*2)(-j - j + j + (3 + 1 - 3)(2j - 3j - j) + 0j - 4j + 2j + j + 2j - 5j). 210j3 Expand (3402d - 3402d + 105d*2)(-3d + 3d + 2d3). 210d5 Expand (6 + f3 - 6)(-10 + 6 + 8 + (-3 + 4 + 7)(-4 + 4 + 1)). 12f3 Expand (3g + g - 5g)(-4 - 4g + 4)(-3g + 0g + 2g)(0 + 2 - 4) + 9g3 + g3 + 0g*3. 18g*3 Expand (0g + 0g + 2g)(5g - 8 + 8) + 2g2 + 2g*2 - 5g*2 + 8g*2 - 24g + 24g. 17g*2 Expand (3 - 3 + 1)(-q + q - 2q) + 22 + 13q - 8q - q. 2q + 22 Expand -t*5 - 3t*5 - 4t5 - t5 - t*5 + 4t*5 + 3t - 3t + t5 + (1 - 2t*2 - 1)(t*3 - 2t*3 + 3t*3) - 8t*5 - 4t + 4t. -17t*5 Expand (-r - r + r)(2r + 0r - 4r)(-r - 5r + 3r)((-1 + 4 - 2)(-3r - 12 + 12) + r + 6r - 5r). 6r*4 Expand (0 + 1 - 4 + (2 - 3 - 1)(-2 - 2 + 5) + 2 + 2 - 5 - 1 + 0 + 2 - 1 + 5 - 2 + 1 + 2 - 1 + 2 - 1 - 2)(-u4 - u + u). 2u*4 Expand 2n - n + 2n4 - 2n + 3n4 - 3n + 3n + (n - 3n + 3n)(4n3 - 5n*3 + 0n*3). 4n*4 - n Expand (-4 - 3 + 2)(-1 + 0 + 2)(-3g + 3g + 2g)(6g + 1 - 1). -60g2 Expand (-3g + g - g)(-398 - 159 + 57). 1500g Expand (0y - 6y + 3y)(3y2 - 6y*2 + 5y*2 + (-3 + 2 + 3)(-2y2 + 3 - 3))(-2y - 3y	{ "pile_set_name": "DM Mathematics" }
Is 3586 a multiple of 27? False Is 1675 a multiple of 15? False Is 1002 a multiple of 4? False Is 11 a factor of 167? False Is 3 a factor of 348? True Does 6 divide 1519? False Is 90 a factor of 1643? False Does 40 divide 908? False Is 154 a multiple of 14? True Is 17270 a multiple of 22? True Is 12 a factor of 2556? True Does 75 divide 13425? True Does 215 divide 4085? True Is 5538 a multiple of 78? True Is 6912 a multiple of 54? True Is 25 a factor of 4507? False Is 96 a factor of 16032? True Is 9073 a multiple of 211? True Is 9822 a multiple of 210? False Does 17 divide 10873? False Is 7 a factor of 756? True Is 17 a factor of 9491? False Is 1252 a multiple of 9? False Is 14 a factor of 975? False Is 5 a factor of 62? False Does 22 divide 182? False Is 8 a factor of 304? True Is 434 a multiple of 77? False Does 73 divide 2005? False Does 55 divide 331? False Does 20 divide 884? False Is 16 a factor of 1184? True Is 47 a factor of 58797? True Does 6 divide 27852? True Is 13 a factor of 2171? True Is 1234 a multiple of 66? False Does 59 divide 23360? False Does 24 divide 288? True Is 348 a multiple of 12? True Is 1726 a multiple of 26? False Does 87 divide 13833? True Is 75 a factor of 767? False Is 14 a factor of 644? True Does 18 divide 900? True Is 12 a factor of 873? False Is 12 a factor of 852? True Does 2 divide 2343? False Does 13 divide 7232? False Does 52 divide 6812? True Does 52 divide 26988? True Does 141 divide 2504? False Is 696 a multiple of 5? False Is 74 a multiple of 7? False Does 16 divide 1520? True Is 35456 a multiple of 34? False Is 34 a factor of 340? True Is 10 a factor of 28372? False Is 970 a multiple of 43? False Is 102 a multiple of 34? True Does 30 divide 1646? False Does 95 divide 894? False Is 23119 a multiple of 4? False Is 713 a multiple of 23? True Is 12 a factor of 10079? False Is 6 a factor of 34668? True Does 14 divide 24? False Is 13 a factor of 5200? True Is 58 a factor of 77661? False Is 66 a factor of 1188? True Is 2930 even? True Is 18 a factor of 395? False Is 1751 a multiple of 17? True Does 90 divide 5721? False Is 15 a factor of 44625? True Does 32 divide 49015? False Does 2 divide 139? False Is 5948 a multiple of 21? False Is 46 a factor of 3182? False Is 888 a multiple of 4? True Does 8 divide 372? False Does 14 divide 40? False Does 37 divide 1697? False Is 9 a factor of 1314? True Does 12 divide 43236? True Is 73 a factor of 12410? True Does 18 divide 762? False Is 65 a factor of 3056? False Is 17233 a multiple of 60? False Does 25 divide 350? True Is 10 a factor of 340? True Does 53 divide 40598? True Is 6 a factor of 9950? False Does 96 divide 1632? True Is 72 a factor of 51624? True Is 15 a factor of 11115? True Is 3335 a multiple of 109? False Is 17565 a multiple of 114? False Is 5 a factor of 2389? False Is 6 a factor of 6621? False Does 44 divide 8800? True Is 7 a factor of 322? True Is 21424 a multiple of 4? True Does 5 divide 2412? False Is 19 a factor of 5586? True Is 15 a factor of 1680? True Is 27 a factor of 918? True Is 76 a multiple of 6? False Is 10514 a multiple of 4? False Is 9316 a multiple of 39? False Is 583 a multiple of 53? True Does 6 divide 17112? True Does 22 divide 2706? True Is 69 a factor of 2898? True Is 1397 a multiple of 15? False Is 106 a factor of 13992? True Does 17 divide 343? False Is 22 a factor of 14784? True Is 6270 a multiple of 57? True Is 653 a multiple of 20? False Does 61 divide 44713? True Does 7 divide 292? False Does 6 divide 38? False Is 2622 a multiple of 69? True Is 3857 a multiple of 29? True Is 21027 a multiple of 129? True Is 65395 a multiple of 25? False Is 190 a factor of 23940? True Does 61 divide 1769? True Is 490 a multiple of 10? True Is 4 a factor of 472? True Does 13 divide 754? True Is 45 a factor of 1717? False Is 47952 a multiple of 148? True Is 18 a factor of 960? False Is 23449 a multiple of 18? False Is 4500 a multiple of 150? True Is 5 a factor of 3270? True Is 1511 a multiple of 6? False Is 1740 a multiple of 15? True Does 166 divide 47790? False Is 11 a factor of 7032? False Is 29 a factor of 1479? True Is 37 a factor of 22866? True Is 27173 a multiple of 23? False Is 141 a factor of 21009? True Does 95 divide 2672? False Is 14 a factor of 14532? True Is 6380 a multiple of 15? False Does 34 divide 517? False Does 9 divide 5041? False Is 45532 a multiple of 21? False Is 16 a factor of 67498? False Does 14 divide 42? True Is 14 a factor of 510? False Is 2 a factor of 4852? True Is 10 a factor of 5080? True Is 14 a factor of 1260? True Is 247 a multiple of 8? False Is 74 a factor of 370? True Is 19212 a multiple of 76? False Does 107 divide 4494? True Is 331 a multiple of 67? False Is 5 a factor of 536? False Is 12600 a multiple of 9? True Does 42 divide 1764? True Is 4980 a multiple of 15? True Is 29 a factor of 1107? False Is 875 a multiple of 25? True Is 52 a factor of 12584? True Does 10 divide 1171? False Is 39083 a multiple of 21? False Is 143 a factor of 29887? True Does 4 divide 448? True Is 498 a multiple of 29? False Does 108 divide 11274? False Does 47 divide 15792? True Does 8 divide 356? False Is 32 a factor of 45542? False Is 18 a factor of 1332? True Does 58 divide 2030? True Is 9 a factor of 783? True Does 7 divide 42553? True Is 3275 a multiple of 25? True Is 81 a factor of 6369? False Is 1003 a multiple of 15? False Is 16 a factor of 8830? False Is 45 a factor of 630? True Is 129 a multiple of 30? False Does 15 divide 13807? False Is 42 a factor of 156408? True Does 7 divide 1052? False Is 180 a multiple of 8? False Is 1190 a multiple of 70? True Is 2321 a multiple of 8? False Is 44 a multiple of 7? False Does 14 divide 3012? False Is 13140 a multiple of 73? True Does 38 divide 342? True Is 38130 a multiple of 15? True Is 562 a multiple of 9? False Is 18 a factor of 2538? True Does 9 divide 6750? True Is 14749 a multiple of 49? True Is 7 a factor of 13? False Is 31 a factor of 31? True Is 11708 a multiple of 148? False Does 13 divide 5772? True Is 8666 a multiple of 29? False Is 13 a factor of 494? True Is 5191 a multiple of 15? False Is 9 a factor of 418? False Does 30 divide 720? True Is 91 a factor of 49868? True Is 837 a multiple of 9? True Is 5016 a multiple of 14? False Does 29 divide 8743? False Is 243 a multiple of 9? True Does 6 divide 846? True Does 29 divide 2632? False Is 91 a factor of 34125? True Does 13 divide 377? True Does 158 divide 52772? True Is 9346 a multiple of 51? False Is 22 a factor of 374? True Is 17 a factor of 527? True Does 63 divide 189? True Is 135 a multiple of 13? False Is 1440 a multiple of 45? True Does 19 divide 2755? True Is 20 a factor of 410? False Is 2 a factor of 7739? False Does 231 divide 104779? False Is 14271 a multiple of 71? True Is 60442 a multiple of 47? True Does 50 divide 4100? True Does 367 divide 43673? True Is 29874 a multiple of 13? True Is 71 a factor of 11644? True Does 4 divide 198? False Is 7242 a multiple of 6? True Is 98 a factor of 51548? True Is 5252 a multiple of 26? True Does 22 divide 16224? False Is 31 a factor of 2108? True Does 25 divide 13227? False Does 5 divide 12680? True Is 14079 a multiple of 2? False Is 10570 a multiple of 151? True Does 54 divide 1512? True Is 300 a multiple of 6? True Does 15 divide 10005? True Does 12 divide 228? True Is 6 a factor of 35? False Is 1899 a multiple of 67? False Is 3520 a multiple of 16? True Is 52 a multiple of 6? False Does 61 divide 18898? False Does 49 divide 539? True Is 1173 a multiple of 6? False Is 2 a factor of 886? True Is 46 a factor of 9522? True Is 8 a factor of 3339? False Does 23 divide 2875? True Is 12524 a multiple of 4? True Is 48 a factor of 614? False Is 153 a factor of 18054? True Does 6 divide 448? False Does 40 divide 34998? False Is 215 a multiple of 30? False Is 48937 a multiple of 111? False Is 13605 a multiple of 23? False Does 171 divide 63667? False Is 13 a factor of 3562? True Is 555 a multiple of 24? False Is 2026 a multiple of 28? False Is 116 a factor of 49228? False Is 27291 a multiple of 33? True Is 40 a factor of 3720? True Does 31 divide 50013? False Is 70 a multiple of 10? True Does 13 divide 65? True Is 2220 a multiple of 30? True Does 92 divide 5244? True I	{ "pile_set_name": "DM Mathematics" }
3). Let h = w - y. What is h rounded to the nearest 1000000? 5000000 Let d = -5.12 + 5. Let c = d + 0.07. Let a = c - -0.08. What is a rounded to two decimal places? 0.03 Let t = 2.09999912 + -2.1. Round t to 7 dps. -0.0000009 Let k = 1396 - 923. Suppose 2i = k + 1743. Suppose -1092 = s + i. What is s rounded to the nearest one thousand? -2000 Let k = -0.68193909 + 365.93426909. Let c = -349.252339 + k. Let r = 16 - c. Round r to 5 decimal places. 0.00001 Let q = 3 + -2.4. Let n = 0.59969 - q. What is n rounded to 4 decimal places? -0.0003 Let o = 7666218.44 + 678.56. Let q = -7666835.99951 + o. Let i = -61 + q. Round i to 4 dps. 0.0005 Let p = -0.45 + 0.438. Round p to three decimal places. -0.012 Let h = 80 + -79.9776. What is h rounded to 3 decimal places? 0.022 Suppose 2p + 170627 = -169373. What is p rounded to the nearest one hundred thousand? -200000 Let l = -354.7 + 422. Round l to the nearest 10. 70 Let q = -1.066 + -63.034. Let k = q + 51. Let p = 5 + k. What is p rounded to 0 dps? -8 Let g = -53 + 52.99976. Round g to four dps. -0.0002 Suppose -7268 = -5d + d. Let w = d - -43183. Round w to the nearest 10000. 50000 Let b = -0.129051 - -0.029008. Let i = -0.5 - -0.4. Let q = i - b. Round q to five dps. 0.00004 Let k = 2.547881922 - 0.197883192. Let z = 2.35 - k. What is z rounded to seven decimal places? 0.0000013 Let g(f) = 36f. Suppose 12 = 3s + 2s - 2y, 3s - 4 = 2y. Suppose 20 - 8 = sc. Let r be g(c). What is r rounded to the nearest ten? 110 Let f = 162.0000714 - 162. What is f rounded to five decimal places? 0.00007 Suppose 5516 - 1646 = w. Round w to the nearest one thousand. 4000 Let z = 423 + 186. Let g = z - 109. Let w be g60 + 1 + -1. What is w rounded to the nearest 10000? 30000 Let r = -190.6 - -176. Round r to zero decimal places. -15 Let k = 6 + -5.99912. Round k to 4 decimal places. 0.0009 Let k = -1232888.1 - -1232887.2099929. Let o = 218.11 - 219. Let v = k - o. What is v rounded to 6 dps? -0.000007 Let j = 0.3 - -0.5. Let n = j - 0.80025. Round n to 4 dps. -0.0003 Let i = 530.272801 - 517.2728. Let w = i + -13. Round w to six decimal places. 0.000001 Let l = -0.0402 - -0.0401787. What is l rounded to 6 dps? -0.000021 Suppose l = -4r + 8, l - 18 - 6 = 4r. Let t be 88/l - (-6)/(-4). Suppose 5j - 1115 = f + 4f, 865 = -tf - 5j. What is f rounded to the nearest 100? -200 Let d = -0.08 - -95.08. Let g = d - 95.0000079. What is g rounded to six decimal places? -0.000008 Let f be -5(-126 + (4 - (-36)/(-10))). What is f rounded to the nearest 10? 630 Let j = 4.5 - 4. Let t = j - 4.2. What is t rounded to 0 dps? -4 Suppose 9m - 15153175 = 4m. Let p = -1380635 + m. What is p rounded to the nearest one hundred thousand? 1700000 Let a = -25.1 + 4.5. Let y = a - -19. Round y to 0 dps. -2 Let k be (-4 - 16048/(-12))-96. What is k rounded to the nearest 10000? -130000 Let m = -29246 + 646. Round m to the nearest 10000. -30000 Let u = 2676.655 + -13412.704. Let l = u + 10783. Let c = -47 + l. What is c rounded to 2 dps? -0.05 Let v = 25.0412 - 15.03. Let g = 9.4 + 0.6. Let o = v - g. Round o to three decimal places. 0.011 Suppose m - 3m - k + 7 = 0, -2k + 2 = 0. Suppose 0 = -v - 3i + 1515453 + 1584535, 0 = mv + 5i - 9299980. Round v to the nearest one million. 3000000 Let y = 13.4 - 2.4. Let b = 2383263 + -2383273.999944. Let x = b + y. What is x rounded to five dps? 0.00006 Let q = 806900.2999978 - 806899. Let m = q - 1.3. Round m to 6 decimal places. -0.000002 Let f = -21503 - -21514.101. Let w = f + 0.099. What is w rounded to 0 dps? 11 Let h = -21 + 20.35. What is h rounded to 1 dp? -0.7 Let q = 61 + -61.0051. What is q rounded to 3 dps? -0.005 Let z = -191662 - -461662. Round z to the nearest one hundred thousand. 300000 Let t = 4.9 - -34.1. Let c = 37.51 - t. Round c to one decimal place. -1.5 Suppose 0 = -4p + 5h - 7295, 3p = 2p - 3h - 1811. What is p rounded to the nearest one hundred? -1800 Let v = 7.9437119 + 0.0568781. Let l = -8.8 - -0.8. Let f = l + v. Round f to 4 decimal places. 0.0006 Let m = 0.021 + -1.821. Round m to zero dps. -2 Let u = 2.56872157 - -22.43127749. Let t = u - 25. What is t rounded to seven dps? -0.0000009 Let u = -131.13 - -130. What is u rounded to one dp? -1.1 Let n = -129.999963 - -130. What is n rounded to five dps? 0.00004 Let q = 18523 + -11797. Suppose c = -c + q. Let g = c + -363. What is g rounded to the nearest 10000? 0 Let r = 1198818.30453 + -1198936.4. Let g = 115.7954662 + r. Let f = g - -2.3. What is f rounded to 6 decimal places? -0.000004 Let a(y) = 3y*2 - 3y - 2. Let p be a(-1). Suppose pu + 14800 = 2u. Round u to the nearest one thousand. -7000 Let b = 3 - 6. Let p = b + 2.9. Let i = 0.09999 + p. Round i to 5 decimal places. -0.00001 Let b(w) = -w3 - w2 - w + 8700. Suppose y + 5a = 15, 1 + 14 = -2y + 5a. Let m be b(y). What is m rounded to the nearest one thousand? 9000 Let t = 1130 + -1130.673. What is t rounded to one decimal place? -0.7 Let k = 2.298 + 0.55. Let h = -61 + 63.9. Let z = h - k. Round z to 2 dps. 0.05 Let q = 23 - -17. Let c = q - 40.033. What is c rounded to 2 decimal places? -0.03 Let h = 0.67 + 0.19. Let w = 1.59 - h. Let q = 0.07 + w. What is q rounded to one decimal place? 0.8 Let q = -1803118.9000003 - -1803119. Let d = q + -0.1. What is d rounded to 7 decimal places? -0.0000003 Let h = 0.25 + 0.27. Let u = h + -0.17. Round u to 1 dp. 0.4 Suppose -v - 3 = -2k, k - v - 2 = -1. Let u be 1 - 3/(-5 + k). Suppose -x - 5 = -u, 4x + 94012 = 2z. Round z to the nearest 10000. 50000 Let w = 14 - 14.45. Let m = w - -0.44999735. Round m to seven dps. -0.0000027 Let u(y) = y*3 - 6y*2 + 3y + 12. Let g be u(5). Suppose gc + 1114 = -3o + 51, 4c + 2121 = -o. Round c to the nearest one hundred. -500 Suppose 7o = 6o - 4800. Round o to the nearest 1000. -5000 Let r be (92 - (-9)/3)/(-1). Round r to the nearest ten. -100 Let u = 1.8244 - -13.9646. Let h = u + -0.189. Let k = h - 15.60103. What is k rounded to four decimal places? -0.001 Let c = -0.128 - -0.128415. What is c rounded to 5 decimal places? 0.00042 Suppose -745827 - 854879 = -2t. Suppose -t = -3w - 230353. Round w to the nearest 10000. 190000 Let h = 381.0000306 + -381. Round h to 6 decimal places. 0.000031 Let g = -458 - -708. Round g to the nearest 100. 300 Let h = -21.9 - -12.2. Let m = h - -8.33. What is m rounded to one decimal place? -1.4 Let k = 2.09 - 213.959. Let f = 212 + k. Let j = -0.130882 + f. What is j rounded to five dps? 0.00012 Suppose w - 1063 - 34 = 0. Let c be w + 9/(6/2). Round c to the nearest 1000. 1000 Let v = 1.5 - -2.7. Let d = v - 5. Let r = -0.80003 - d. What is r rounded to 5 decimal places? -0.00003 Let u = -240994 - -121527. Let a = u - -119417.949. Let y = a - -49. What is y rounded to two decimal places? -0.05 Let j = -8.15 - -8. Let f = 0.1487 + j. Round f to 3 decimal places. -0.001 Let j = -9 + 9.0000065. Round j to 6 dps. 0.000007 Let r be 22/5 + 4/(-10). Suppose -rk - 1470000 = -k. What is k rounded to the nearest one hundred thousand? -500000 Let i = 39106396819 - 39108109658.9949. Let p = i - -1712762. Let j = -78 - p. Round j to 3 decimal places. -0.005 Suppose -5r = 3q - 1536, 2r - 3q - 1524 = -3r. Suppose -z - r = 5x, 2x - 54 = 3x + 2z. What is x rounded to the nearest 10? -60 Let k = -34.4137 + 0.0337. Let m = 35 + k. Round m to 1 dp. 0.6 Suppose 3 + 31 = z + 4g, 0 = 4g - 12. Let m = z + 0. Let v be (-6)/(-33) + 788/m. What is v rounded to the nearest ten? 40 Let r = 950 + -950.000417. Round r to 4 decimal places. -0.0004 Let n = -1.072 + -0.108. Let z = n + 1.17999794. Round z to seven decimal places. -0.0000021 Let q = 13 - 4. Let y be (-66)/((-4)/(120/q)). What is y rounded to the nearest 10? 220 Let o be (-4)/(-10) + (-69)/(-15). Suppose -ox - 300 = -2x. Round x to the nearest one thousand. 0 Let m = 46 - -16. Let b = -62.0083 + m. Round b to three decimal places. -0.008 Let b be -2 + (-2 + 99779 - -1). Suppose -2s = b + 60224. What is s rounded to the nearest 10000? -80000 Let r = 535.948 - 539. Let q = r + 3. Round q to two dps. -0.05 Let c = -21.06 + 21. Let l = -1 - c. Round l to one dp. -0.9 Let x = -0.3709400137 + -195.6290696863. Let u = x - -196. Round u to 6 dps. -0.00001 Let l = 185	{ "pile_set_name": "DM Mathematics" }
*2 - 2l + 5. Let h(b) = b*3 - 8b*2 - 18b - 2. Let y be h(10). Let s(a) = -4 - 13 + y. What is -5s(d) + v(d)? d2 - 2d Let y(j) = j*2 - 96j + 451. Let l be y(5). Let i(d) = d3 - d2 - d. Let r(k) = -k*3 - 4k*2 - 4k + 2. Give li(o) + r(o). -5o*3 + 2 Let y(a) = -90a + 1. Let j(z) = -1136z - 24. Calculate 2j(u) - 24y(u). -112u - 72 Let j(r) = -8r2 + 17r. Let g(l) = 4l2 - 9l. Let m be 7 - 0/((-252)/(-21)). What is mg(v) + 4j(v)? -4v2 + 5v Let w(v) = 2v3 - 32v - 5. Let a(d) = d*3 - 16d - 2. Let j(i) = -32i2 - 39i - 2. Let r be j(-1). What is ra(n) - 2w(n)? n*3 - 16n Let r(i) be the first derivative of -i*4/4 - 7i3/3 - i2 + 2i - 2587. Let g(s) = -3s*3 - 15s*2 - 5s + 5. Calculate 4g(x) - 10r(x). -2x3 + 10x*2 Let x(d) = -87d - 163. Let v(t) = 114t + 218. Calculate -7v(j) - 9x(j). -15j - 59 Let f(x) = 83x2 + 71x + 6. Let h(v) = 27v2 + 23v + 2. Determine 3f(d) - 8h(d). 33d2 + 29d + 2 Let d(i) = -2531i2 - 3i - 2. Let k(z) = -5050z2 - 8z - 5. Give -5d(w) + 2k(w). 2555w2 - w Let g(r) = -19r*2 - 15r + 7. Let h(i) = 27i2 + 61i - 29. Let t(d) = 18d2 + 42d - 20. Let p(q) = -7h(q) + 10t(q). Determine -6g(k) + 13p(k). -3k2 - k - 3 Let w = -55 - -26. Let n = w + 30. Let g(u) = 7. Let q(b) = 6. Let j(x) = -5g(x) + 6q(x). Let l(v) = -v2 + 2v - 8. Determine nl(a) + 6j(a). -a*2 + 2a - 2 Let u(v) = 298v - 4. Let t(l) = 299l - 7. Give 2t(y) - 3u(y). -296y - 2 Let i(v) = 1706v - 9. Let o(b) = -7b + 1. Determine -i(k) - 8o(k). -1650k + 1 Let a(n) = 7n*3 - 60n + 12. Let p(k) = -15k3 + 130k - 26. Let y(j) = -13a(j) - 6p(j). Let u(r) = 4r3 - r2 + 3r + 7. Determine u(g) + 3y(g). g3 - g2 + 3g + 7 Let r(u) = u - 1. Let m(p) = -23p2 + 6p - 6. Let o(f) = 63f - 1826. Let b be o(29). What is bm(k) - 6r(k)? -23k*2 Let h(x) = 2x*2 - 39x + 56. Let c(n) = 6n2 - 118n + 170. What is 5c(l) - 16h(l)? -2l2 + 34l - 46 Let h(g) = 3g + 4 - 3 + 0g + g. Suppose 13 = 3z - 50. Let i = 17 - z. Let p(o) = -3o - 1. Calculate ih(a) - 5p(a). -a + 1 Let m(o) = 33o2 + 56. Let u(r) = r2 - 5. What is 6m(j) + 66u(j)? 264j*2 + 6 Let b(z) = z + 9. Let g(t) = 2t + 17. Let f be 16/(-2) - (15 + 234/(-13)). Calculate fb(n) + 2g(n). -n - 11 Let j(t) = -t + 19. Let f(c) = 296c - 45. Determine f(i) + 3j(i). 293i + 12 Let y(f) = 5f*2 + 4f + 13. Let l(v) be the first derivative of 11v3/3 + 9v*2/2 + 27v - 3988. Let h = -29 - -25. Calculate hl(q) + 9y(q). q*2 + 9 Let d(a) = -6a + 21. Let t(f) = -f*2 - 8f - 4. Let c be t(-5). Suppose -56u = -54u - 60. Let o(v) = 29v + 0 - uv + 4. What is co(g) - 2d(g)? g + 2 Let s(c) = -6c3 - c2 - 14c - 13. Let o be s(-1). Let f(q) = 8q - 8. Let m(z) = 1. Calculate om(n) + f(n). 8n - 2 Let v(u) = u + 3. Let h(n) = 14n + 1. Determine -h(k) - 5v(k). -19k - 16 Let z(k) = -2k + 2268 - 6810 + 2274 + 2265 + 0k - 4k2. Let m(c) = -7c*2 - 4c - 5. Let g(y) = y*2 - 5y - 5. Let q be g(5). What is qz(i) + 3m(i)? -i*2 - 2i Let i = -37 - -40. Suppose -it + a + 26 = 8, 3a - 11 = -4t. Let n(c) = -4c*3 - 5c*2 - 5c + 7. Let w(d) = -d3 - d2 - d + 1. Give tw(l) - n(l). -l3 - 2 Let u(h) = -3h*3 + 40h*2 + 30h - 25. Let w be u(14). Let j(s) = 2s3 - 4s*2 + 4s + 3. Let g(x) = -x*3 + 3x*2 - 3x - 2. Calculate wg(o) + 2j(o). o3 + o2 - o Let z(y) = 21y3 - 11y*2 - 20y + 14. Let i(h) = -3h3 + h2 + 3h - 2. Let l(b) = 5i(b) + z(b). Let k(c) = -c3 + c2 + c - 1. Give -5k(v) - l(v). -v3 + v2 + 1 Suppose 4o = o + 3. Suppose -12 = -22i + 18i. Let r(u) = -4. Let b(c) be the third derivative of c4/24 + c3/6 - 26c*2. Calculate ib(n) + or(n). 3n - 1 Let s(r) = -5r2 + 13r + 17. Let u = 37 + -25. Suppose 7b - 9 = u. Let p(i) = -11 + bi + 10 - i*2 + 5 + 0i*2. Determine 9p(n) - 2s(n). n2 + n + 2 Let f(h) = -1827h*2 - 4h + 4. Let c(d) = -7905453d2 - 17307d + 17307. What is 4c(q) - 17307f(q)? -1923q2 Let t(d) = 13d*3 - 4d. Let z(x) = -26x3 + 9x. Let q be 0 - -2 - (143 + -136). Calculate qt(s) - 2z(s). -13s3 + 2s Let k(z) = 15z3 - 11z*2 - 13z + 22. Let w(c) be the second derivative of -7c5/20 + 5c4/12 + c3 - 11c2/2 + 5353c. Calculate -6k(n) - 13w(n). n3 + n2 + 11 Let c(a) = a3 - a2 + a + 1. Let t(d) = 7 - 8d3 - 16d + 1 - 14 - 10 + 16d2. Determine 48c(v) + 3t(v). 24v*3 Let s(z) = -9697z*2 - 5z + 6. Let v(l) = -19390l2 - 12l + 14. What is 7s(r) - 3v(r)? -9709r2 + r Let x(w) = 458250w - 286. Let a(n) = 4823n - 3. Determine -572a(v) + 6x(v). -9256v Let m(q) = -120q + 6. Let x(f) = 247f - 12. Calculate -9m(h) - 4x(h). 92h - 6 Let c = -146 - -86. Let k = c - -57. Let h(v) be the first derivative of -2v*3/3 + 3v - 1. Let b(d) = 10d2 - 14. Determine kb(p) - 14h(p). -2p*2 Let x(w) = -2w3 + w2 - 6w - 5. Let p = -140 - -140. Suppose 0 = -3g - 6, i + pg - 3 = -g. Let b(y) = y3 + y + 1. What is ib(c) + x(c)? 3c3 + c2 - c Let l(j) = -10. Let k(b) = 3b*3 + 508b*2 - 30. Give k(v) - 3l(v). 3v3 + 508v*2 Let k(z) = -114z - 9. Let t(v) = -115v - 9. What is -2k(l) + 3t(l)? -117l - 9 Let g(n) = -4n3 - n2 - 7n - 6. Let w be g(-2). Let k(h) = -6 + wh3 + 4 + 7 - 32h*3. Let j = -13 + 6. Let f(m) = -6m*3 - 7. What is jk(s) - 5f(s)? 2s*3 Let o(u) = 16u + 8. Suppose 0 = 5m + 4j + 5, -367j - 22 = -4m - 365j. Let f(d) = 5d + 3. Calculate mo(v) - 8f(v). 8v Let d(j) = 76 - 9 - 34 - 5j - 20 + 5j2 - 16. Let s(n) = 6n*2 - 5n - 4. Give -3d(v) + 2s(v). -3v2 + 5v + 1 Let a(t) = -7t - 3. Let x = 78 + -73. Let q be -228/(-8) + 1. Let h(w) = -16 + 33 + qw - 13. Determine xh(v) + 6a(v). -2v + 2 Let f(x) = 2x2 + 13. Let i(v) = -2v*2 - 12. Let m = -458 - -437. Let z be 1/(m/36(-4)/(-14)). Determine zi(a) - 5f(a). 2a2 + 7 Let g be (-6)/((-30)/(-25)) - -7. Let k(u) = -4u2 + u - ug + 6u2. Let i(f) = -1. Let d(h) = -2. Let o(z) = 2d(z) - 5i(z). Give -2k(n) - o(n). -2n2 - 2n - 1 Let l(v) be the first derivative of v + 224. Let q = 6 + 3. Suppose 0 = 2u + 3 - q. Let x(h) = -h2 - 2. What is ux(w) + 4l(w)? -3w*2 - 2 Let o(w) = 119w*3 + 8w*2 - 8w. Suppose 4808 = -15p + 4883. Let k(i) = -79i*3 - 5i*2 + 5i. Give po(u) + 8k(u). -37u3 Let d(l) = 1174130371l*3 + 179663l*2 + 179663. Let y(g) = 32676g*3 + 5g*2 + 5. Determine -5d(j) + 179663y(j). 16333j3 Let r(d) = 168 - 82 - d2 - 88 - 3d. Let p(g) = 2g*2 + 10g + 7. Calculate -2p(x) - 7r(x). 3x2 + x Let j(y) = -4y*3 - 19y*2 + 33y + 21. Let w be j(-6). Let m(d) = -d + 2. Let p(q) = -q + 3. Calculate wp(t) - 4m(t). t + 1 Let n(k) = 33k3 - k2 - 6k - 3. Let y(q) = -35q3 + q2 + 7q + 4. Determine 4n(a) + 3y(a). 27a3 - a2 - 3a Let y(u) = 83u2 - 12u - 20. Let t(i) = 42i2 - 7i - 8. Calculate 5t(c) - 2y(c). 44c2 - 11c Let g(w) = -2w3 - 7w2 + 75. Let h(l) = l3 + 4l2 - 38. Let s = 4078 + -4071. Calculate sh(d) + 4g(d). -d3 + 34 Let q(w) = -6w + 29. Let o(b) = -55b - 3 - 27 + 62b. Determine -4o(d) - 5q(d). 2d - 25 Let w(s) = 2s*2 + 16s + 1. Let g(c) = -3c2 - 12c - 4. Calculate 4g(q) + 3w(q). -6q2 - 13 Let q = 6153 - 73835/12. Let j(i) be the second derivative of 15i + i*2 + 0 + 0i*3 + qi*4. Let v(o) = -o - 2. Calculate 2j(c) + 3v(c). 2c*2 - 3c - 2 Let q(t) = t*2 + 51. Let r(a) = 13a*2 + 203. Let m(k) = -4q(k) + r(k). Let g(w) = -28w2 + 2. Determine 3g(d) + 8m(d). -12d*2 - 2 Let m(f) = 3f + 2. Let a = -45 + 43. Suppose 0 = 4d - 5q + 17, -4q + 30 = 5d - 0q. Let k(b) = bd - 7b - 4 - 1 - 5 + 5. Give ak(p) - 5m(p). -2p2 - p Let z(n) = 3n*2 + 9n - 2. Let j(o) = -o*2 + o + 1. Let t = 27898 + -27897. What is tz(l) + 4j(l)? -l2 + 13l + 2 Let l(q) = 3721q3 - 10q*2 - 13q - 120. Let a(p) = 1241p3 - 3p*2 - 4p - 37. Determine -13a(d) + 4l(d). -1249d3 - d2 + 1 Let y(j) = -10j*2 - 946j - 45. Let p(z) = 3z2 + 315z + 14. Determine 13p(l) + 4y(l). -l*2 + 311l + 2 Let z(s) = 6s3 - 26s*2 + 46s + 5. Let j(q) = -q*3 + 5q*2 + q - 1. What is -5j(o) - z(o	{ "pile_set_name": "DM Mathematics" }
-1 - ((sqrt(567) - (sqrt(567) + 1))-1 + (sqrt(567) + sqrt(567) + -1sqrt(567))-4)))2. -2430sqrt(7) + 46152 Simplify 3(sqrt(10)/(sqrt(605) - sqrt(605)-2)1 + -4)-1. -sqrt(2)/11 + 12 Simplify (sqrt(102) - 4(sqrt(102) - sqrt(102)-2))/(-3sqrt(6)1). 11sqrt(17)/3 Simplify -1 + (-6(sqrt(304) + -5 + sqrt(304) + -1 + -6-2(0 + sqrt(19))))*2. -8640sqrt(19) + 274895 Simplify -5 + -2(-5 + sqrt(24)/(sqrt(12) + ((sqrt(36)2)/sqrt(3) - sqrt(12))) + 5). -5 - sqrt(2) Simplify -1 + -5(sqrt(1620)/sqrt(10)-2)*2. -3241 Simplify (3 + (-1sqrt(70))/sqrt(10) - (-1sqrt(112))/sqrt(4))2 + 5. 6sqrt(7) + 21 Simplify (((sqrt(152) - sqrt(152)-3)-3 - sqrt(152)) + sqrt(152) - sqrt(152))/(sqrt(16)/sqrt(2)2)-6. 39sqrt(19) Simplify ((-5-1(sqrt(85) + sqrt(85)1 + sqrt(85) + sqrt(85) + sqrt(85)))/((sqrt(220)/sqrt(4))/sqrt(11) + -3sqrt(5)-1))*2. 10625/16 Simplify (3sqrt(600))/((sqrt(243)/sqrt(9))/sqrt(9)). 30sqrt(2) Simplify 1 + 4(sqrt(240)/(sqrt(6)2))/(sqrt(8) - sqrt(648)-3). sqrt(5)/14 + 1 Simplify (2-2sqrt(98)2)2-5. -31360 Simplify 2(sqrt(242) - (sqrt(242) + 2 - sqrt(242))) - 4(sqrt(12) - (sqrt(12)-3 - sqrt(12)))/sqrt(6). -4 + 2sqrt(2) Simplify (sqrt(55)/((2sqrt(11) + sqrt(11))-3))*2 + sqrt(35)/(-3(sqrt(7)-3 + sqrt(7))) + -5. -400/81 + sqrt(5)/6 Simplify (sqrt(99) + (sqrt(99) - sqrt(99)-23))/(-4(sqrt(9) - (sqrt(9) - sqrt(18)/sqrt(2)))) + 0. -2sqrt(11) Simplify (sqrt(76) + 4(sqrt(76) + sqrt(76)1 + sqrt(76) + sqrt(76) - sqrt(76)) - (sqrt(76) + 2sqrt(76))-6)/(5-1sqrt(4)-1). 31sqrt(19)/5 Simplify (-2sqrt(19)4 - sqrt(19) - -5sqrt(95)/sqrt(5) - ((-2 + 0 + sqrt(19) - (1sqrt(152) + sqrt(152) + sqrt(152))/sqrt(8)) + 5))2. 12sqrt(19) + 85 Simplify -5 + (2sqrt(2880) - sqrt(2880))/(5sqrt(12)/sqrt(3) - sqrt(4)) + -3. -8 + 3sqrt(5) Simplify (sqrt(5324) - 5(sqrt(5324) - (sqrt(5324)2 - sqrt(5324))))/(sqrt(96)/sqrt(6) - sqrt(8)/sqrt(2)3). -11sqrt(11) Simplify sqrt(33)/sqrt(275) + sqrt(27)/(sqrt(36)/sqrt(4) + sqrt(9)) + (sqrt(300) + 1 + (sqrt(120)/sqrt(4) - sqrt(30))/sqrt(10))2. 207sqrt(3)/10 + 301 Simplify ((5 + sqrt(2) + 1 + (sqrt(2)1 + -3 - sqrt(2)))2 - (sqrt(2) + -1 + sqrt(8) + -2)) + -1. 3sqrt(2) + 13 Simplify sqrt(2432)/sqrt(2)-1 + ((sqrt(114) - (sqrt(114) + sqrt(114) + sqrt(114)-2) - sqrt(114))/sqrt(6) + -3(sqrt(171) + sqrt(19)))2. -8sqrt(19) + 2736 Simplify (1 + sqrt(17) + sqrt(17)-2 + -4 - (sqrt(2448) - -2sqrt(2448) - (sqrt(204)/(sqrt(12)1) + sqrt(17))))2-6. -125004 - 1260sqrt(17) Simplify (sqrt(65) + (2sqrt(65) - sqrt(65)))/sqrt(5) + -1 + (sqrt(208)1)2 + sqrt(39)/(sqrt(6)/sqrt(2)). 3sqrt(13) + 207 Simplify (-5((sqrt(243)11 - sqrt(243)) + -6(0 + sqrt(243)))-4)2. 3499200 Simplify -52(((-2 + sqrt(2))4)*2 + sqrt(2) - ((sqrt(16) - (sqrt(16)-1 - sqrt(16)))/sqrt(8))*2). -780 + 630sqrt(2) Simplify ((sqrt(1008) - (sqrt(1008) - (sqrt(1008)1 + sqrt(1008)))) + -5 + ((1 + sqrt(1008))2 + sqrt(1008))6)-5. -30245 - 1200sqrt(7) Simplify (-3 + (1 + sqrt(176)-1 + -2)-5)*2. 80sqrt(11) + 4404 Simplify -6(6(-3 + sqrt(1900)))*26. -2474064 + 77760sqrt(19) Simplify ((sqrt(304) - (-1sqrt(304) + -4)) + 1)*2 - ((sqrt(304) + sqrt(304) + -3 + sqrt(304)-1)*2 - sqrt(304)-21). 96sqrt(19) + 928 Simplify (1(sqrt(891) + 0 - sqrt(891))-6 + -6(-1(sqrt(11) + -1) + ((1sqrt(77))/sqrt(7) - sqrt(11))))2. -72sqrt(11) + 432 Simplify (-3(sqrt(243) - (sqrt(243) + 0)))2 + (((sqrt(36) + sqrt(72)/sqrt(2))/sqrt(12))2 - -1sqrt(3)-6). -6sqrt(3) + 12 Simplify ((1sqrt(171)/sqrt(81) - (sqrt(304)1 + 0))-4)2. 36784/9 Simplify (-5 + (sqrt(3) - (sqrt(9)/sqrt(3) + 5))-2 + (-4(sqrt(300) + (sqrt(300) + sqrt(300)-1 - sqrt(300))) - (-1 + (sqrt(300) - (sqrt(300) + 1)))))*2. 49 Simplify -2-1(sqrt(396) + 0)-1 + 2. -12sqrt(11) + 2 Simplify (-2 + (-3 + sqrt(1539))-4)*25. -3600sqrt(19) + 123620 Simplify (((sqrt(18) - sqrt(126)/(sqrt(28)/sqrt(4)))5)/(sqrt(1296) + sqrt(1296) + sqrt(1296)1 - -1sqrt(576)))2. 0 Simplify -1 + ((0 + sqrt(972))2 + sqrt(972) + 3)1 + 3. 18sqrt(3) + 977 Simplify -3 + 4 + (3sqrt(700) - sqrt(700))-1. -20sqrt(7) + 1 Simplify (((-2sqrt(425)4 - (1 + sqrt(425) + -5)) + 3)-1)*2. -630sqrt(17) + 34474 Simplify -1(sqrt(7) - ((-2 + sqrt(7))2 + 2 + sqrt(7))) + (sqrt(672)2)/sqrt(6). 4sqrt(7) + 13 Simplify (2 + (sqrt(1584) + 1 + sqrt(1584) - sqrt(1584)))1-4 + 5. -48sqrt(11) - 7 Simplify (1 + 1(2 + sqrt(567))1)*2. 54sqrt(7) + 576 Simplify -31(-1(-2 + sqrt(5)) - (sqrt(5) + sqrt(220)/sqrt(11) + sqrt(5)))2. -387 + 60sqrt(5) Simplify (2sqrt(1216)-5 + sqrt(190)/(sqrt(50)/sqrt(5)-2))2. 492499/4 Simplify (sqrt(539) - (sqrt(539) + sqrt(539) + 0 + 3))4 + (-2 + 1(sqrt(539) - (sqrt(539) + -2)))2. -28sqrt(11) - 12 Simplify (sqrt(128) - (-2 + sqrt(128) + 0))*2 + 6(sqrt(128) + -2). -8 + 48sqrt(2) Simplify (3-6(2 + -1 + sqrt(272) + 1))2. 5184sqrt(17) + 89424 Simplify (-22sqrt(162))/(sqrt(384) - -6sqrt(384)-2). 3sqrt(3)/22 Simplify (sqrt(162)2-5)/(2sqrt(6)2). -15sqrt(3)/2 Simplify ((sqrt(136) + (-5sqrt(136) - sqrt(136)))4 - sqrt(136) - sqrt(136))/(sqrt(96)/sqrt(588) + sqrt(8)). -77sqrt(17)/4 Simplify 5 + (3 + -532sqrt(432))*2. -2160sqrt(3) + 388814 Simplify 5 + 1sqrt(1700) + sqrt(1700) + ((sqrt(833)1)*2 + sqrt(17))2. 22sqrt(17) + 1671 Simplify 4sqrt(1053)-4 - 3((sqrt(130) - (sqrt(130) + sqrt(130)3)) + sqrt(130) - sqrt(130))/sqrt(10). -135sqrt(13) Simplify 5 + (4(sqrt(13) - -6sqrt(13)-2))2 + -3. 25170 Simplify (sqrt(171) + -3 - 1sqrt(475))*2 - (sqrt(76) - (sqrt(76) + sqrt(76) + 62sqrt(76)) - sqrt(76))/sqrt(4). 85 + 26sqrt(19) Simplify (4(2sqrt(78) - sqrt(78)))/(4sqrt(30)/sqrt(5)) + -4. -4 + sqrt(13) Simplify (sqrt(85) - -1sqrt(85)-6)/(sqrt(10)/sqrt(2)-3)-6. -10sqrt(17) Simplify (sqrt(80) + 2 + sqrt(30)/(sqrt(36)/sqrt(6)) + (-2(sqrt(720) + 1) - sqrt(720) - (4 + sqrt(720)-1)))*2. 152sqrt(5) + 1821 Simplify (6(sqrt(539) + -1 + -5 - (sqrt(539)-1 + 2) - (41sqrt(539) + -3)))*2. 5040sqrt(11) + 78516 Simplify 4(sqrt(6) - (sqrt(150) + sqrt(150)-3 + sqrt(150)))/(sqrt(2)-15). -24sqrt(3)/5 Simplify ((sqrt(1900) - (1sqrt(1900) + 5) - (sqrt(1900) + -2(sqrt(1900) + -1))2) + 4)-3. -120sqrt(19) + 5715 Simplify (sqrt(19) + (sqrt(19) + 3 - sqrt(19)))21 + 2 + 4(sqrt(76)-3 + sqrt(76))/sqrt(4). -2sqrt(19) + 30 Simplify -4((sqrt(4598)2-6)/(-6(sqrt(200) + (sqrt(200) - sqrt(200)-2) + sqrt(200)) - sqrt(200)))*2. -331056/24025 Simplify sqrt(2)-2-3 + -2 - (sqrt(200) - (-4(4sqrt(200))2 - sqrt(200))). -12802 - 14sqrt(2) Simplify ((sqrt(96)5)/sqrt(3))/(-2sqrt(324)). -5sqrt(2)/9 Simplify (sqrt(22) - (sqrt(264)-1)/sqrt(12))/(sqrt(11) - (sqrt(11) - 2sqrt(11))4) + ((sqrt(648) - (sqrt(648) + 1sqrt(648))) + 4)2. -718sqrt(2)/5 + 664 Simplify -5 + sqrt(300) + 1sqrt(300) + sqrt(300) + (sqrt(300)2)*2 + -5 + -4. 30sqrt(3) + 1186 Simplify 3 + ((sqrt(2) - sqrt(72))-2)2 + 5 + (sqrt(18)/sqrt(9) - sqrt(2)) + 5. 213 Simplify (3 + (sqrt(20) - sqrt(80)/sqrt(4))/sqrt(4) - (sqrt(5) + sqrt(5)1 + -2 + -1 + sqrt(5) + 3))*2. -18sqrt(5) + 54 Simplify -1(-5 + 3(sqrt(132)/(-1sqrt(972)))2). 124/27 Simplify (sqrt(57) - sqrt(456)/(sqrt(8) - -2sqrt(8)))/(sqrt(6)/sqrt(72)) + 1. 1 + 4sqrt(19) Simplify (-4(-1 + sqrt(704))-1)2 - -5-2(sqrt(704)-2 - sqrt(704)). -16sqrt(11) + 11280 Simplify ((sqrt(14)/sqrt(2) + -3 + sqrt(567))2 + sqrt(63) + 4 + -2)5. -285sqrt(7) + 3555 Simplify ((sqrt(52)/sqrt(100) + -3)3)*2 + 5. -54sqrt(13)/5 + 2267/25 Simplify (-23(4 + sqrt(1008) + -1 + -1(sqrt(1008) + 0 + sqrt(1008))))2. -2592sqrt(7) + 36612 Simplify -2 + (5(-2sqrt(320) - sqrt(320)))*2 - ((sqrt(550)/sqrt(40))/sqrt(11) + -3). -sqrt(5)/2 + 72001 Simplify 1sqrt(80)1 - (-2 + (0 + sqrt(5) + sqrt(5))2 + 0). -18 + 4sqrt(5) Simplify -1 + 1(sqrt(396)2 + -4 + ((sqrt(396) + 0)-2)2) + -5. 12sqrt(11) + 1574 Simplify (-5sqrt(76)/((sqrt(36)-2)/sqrt(9)))*2 + (-2sqrt(304))*26 + -2sqrt(304) + 4. -8sqrt(19) + 29675/4 Simplify (1 + (sqrt(475) - (1 + sqrt(475))) + sqrt(475) + -5)*2 - (sqrt(19)-26 + sqrt(57)/sqrt(3) + 2 + 3). -39sqrt(19) + 495 Simplify (sqrt(132)/(2sqrt(1200)) + 3 + sqrt(22)/(sqrt(6)/sqrt(3)))2. 63sqrt(11)/10 + 8451/400 Simplify (sqrt(4)*-2)/sqrt(2) + 3 + -5 - 1	{ "pile_set_name": "DM Mathematics" }
tive of -53w2 - 370w + 104058? -106w - 370 What is the third derivative of i3o*3u*2 + 52137i*3o*2u*2 + 2io2 + 103918o*3u*2 wrt o? 6i*3u*2 + 623508u*2 What is the first derivative of 33259cd + 2c + 59d + 1001 wrt c? 33259d + 2 Find the second derivative of -7g2i*3 + 2g*2i + 13gi*2 - 3g + 7i3 + 447i*2 - 2i + 73770 wrt i. -42g2i + 26g + 42i + 894 What is the second derivative of 255i4y*3 + 134i*4 + 757iy2 + 11y*3 wrt i? 3060i*2y*3 + 1608i*2 What is the third derivative of -189089g*3y*2 + 2g*2y*2 + 171323y*2 wrt g? -1134534y*2 What is the second derivative of -12b*2m - 12152b2 - 18bm + 6b - 140m wrt b? -24m - 24304 What is the third derivative of -109b2u*4 + 226b*2u*3 + 2b*2u*2 - 25b*2 + 6bu2 + 232 wrt u? -2616b*2u + 1356b2 Differentiate 1769j*2l - 24732j2 - 2j - 1 with respect to l. 1769j2 What is the derivative of 2532h*3k*3 + 9h*3 - 97k*3 + 3k*2 + k + 1611 wrt h? 7596h*2k*3 + 27h2 What is the third derivative of n2y3 - 2n*2 - 6y*5 - 4427y*4 + 2y*2 + 3783y + 14 wrt y? 6n2 - 360y*2 - 106248y Differentiate 5910253i + 4897388 wrt i. 5910253 Find the first derivative of 73x*3 + 1205x*2 + 3x - 3778185 wrt x. 219x2 + 2410x + 3 Find the third derivative of -416l5 + 22l*4 - 34784l*2 - l. -24960l*2 + 528l What is the third derivative of -8z6 - 4587z*4 + 37z*2 - 2673z - 1 wrt z? -960z3 - 110088z Find the third derivative of 491jw*5 + jw - 6j - 2w5 - w4 + 1998w2 wrt w. 29460jw2 - 120w*2 - 24w Differentiate 604812u + 1844793 with respect to u. 604812 What is the second derivative of 459816f*2k + 4fk + 2f + 2k - 20337 wrt f? 919632k Find the third derivative of 4l*3v*3 + 64l*3v*2z - l*3z + 146l2v*3z + 2l2v + v*3z + 51vz wrt v. 24l3 + 876l*2z + 6z What is the third derivative of -47650x*4 + 489718x*2 wrt x? -1143600x Find the third derivative of -58w4 - 378w*3 + 109209w*2 wrt w. -1392w - 2268 Find the third derivative of 187kxz3 - 161kz2 - xz*2 - 5x - 117z3 wrt z. 1122kx - 702 What is the second derivative of -503m*4 + 21m3 - m2 + 675m - 17? -6036m*2 + 126m - 2 Find the second derivative of 401t2w - 30t2 + 58t + 2w - 126 wrt t. 802w - 60 What is the second derivative of 34r3 - 1490r*2 + 166r + 451? 204r - 2980 What is the first derivative of -147t*4 - 2t*3 + 65t*2 + 51324 wrt t? -588t*3 - 6t*2 + 130t Find the second derivative of -375000p2 - 397642p. -750000 What is the third derivative of 512662n3 + 69n*2 + 6n - 3? 3075972 What is the third derivative of 59h3l*4 + 56479h*3l2 + h3l - hl*3 - 138l4 + l3 wrt l? 1416h3l - 6h - 3312l + 6 Find the third derivative of -17c4d*3 + 11947c*3d3 - c3 + 5c2d*3 - 416c*2d*2 - 7d*3 wrt c. -408cd3 + 71682d3 - 6 Find the third derivative of -c4d + 11c*4 - 354c*3d - c*2d - 15547d wrt c. -24cd + 264c - 2124d Find the third derivative of -213204b*2s*3 - 634240b*2s*2 + 4bs3 wrt s. -1279224b*2 + 24b Differentiate 193l3p2 + l3 + l - 12p4 - 5115 with respect to p. 386l*3p - 48p3 Find the first derivative of -52903f*3 - 2f*2 + 3f + 1141277 wrt f. -158709f2 - 4f + 3 Find the first derivative of 8f2w*2 - 3751413f*2 + fw*2 - 213445w wrt w. 16f2w + 2fw - 213445 Differentiate -4776884y + 2925094 with respect to y. -4776884 What is the derivative of 32094g - 12797 wrt g? 32094 What is the second derivative of -398402k2u*2 - 2k*2u - 452k2 + 3ku2 + 62ku + u - 4 wrt u? -796804k*2 + 6k What is the third derivative of -18a2lp3 - 6a*2p*2 - 2al + 24ap3 + 14lp3 + 41lp2 + lp + 9p wrt p? -108a*2l + 144a + 84l Find the second derivative of 2217870a4 - 3455564a. 26614440a2 Find the third derivative of 139611s*3 - 416377s*2 wrt s. 837666 Find the third derivative of 6h*3s + 75883h3 + 28h*2s - 239h2 - 11hs wrt h. 36s + 455298 What is the third derivative of 3w6 - 552w*5 - 43w4 - w2 - 12w - 720 wrt w? 360w*3 - 33120w*2 - 1032w Find the second derivative of -69538k5 + 99947k wrt k. -1390760k3 What is the third derivative of 47276v*3z*6 - 9v*3z*3 - 2v*3z*2 - 1129v*2z*2 + 3v*2 - 9z wrt z? 5673120v3z*3 - 54v*3 What is the first derivative of 105877j - 96636? 105877 What is the third derivative of 16499h3 - 117h*2 - 7h - 10? 98994 What is the third derivative of -928738s5 - 2s*2 - 4573s - 30 wrt s? -55724280s2 What is the second derivative of -58s*2w*2x*2 + 399s*2w*2 + 8sw2x*2 + 11swx + sx + 23x*2 wrt s? -116w*2x*2 + 798w*2 What is the derivative of 406820rx - 16087x + 2 wrt r? 406820x What is the second derivative of 254wy2 - 28wy - 5661w + 322y4 + 1 wrt y? 508w + 3864y2 What is the third derivative of -5615908w*5 - 1050w*2 + 2w + 457 wrt w? -336954480w2 Find the second derivative of -61897i*2 + 89903i wrt i. -123794 What is the first derivative of -11844f4 - f + 270719 wrt f? -47376f3 - 1 Find the second derivative of o2qu*2 - 14633o*2qu + 34o*2u*2 - 1485qu2 - u wrt u. 2o*2q + 68o2 - 2970q What is the second derivative of -92a2cj + 2a*2c + a*2j*3 - 29a*2j - 11848acj3 + 3ac wrt a? -184cj + 4c + 2j3 - 58j What is the third derivative of 473212o4 - 1111254o*2? 11357088o Find the first derivative of -32943b3 - b2 - 90214 wrt b. -98829b*2 - 2b What is the second derivative of -27j2z*3 + 41918j*2 + 2250jz3 - 418z*2 wrt j? -54z*3 + 83836 Find the second derivative of 73636p*2 + 6p + 1220 wrt p. 147272 What is the first derivative of -5852ix*3 + 72x*3 + 5x*2 + x wrt i? -5852x*3 What is the derivative of 185cg + 185697c - 381g - 1 wrt g? 185c - 381 Find the second derivative of -m*3q*2 - 2m*3q - 48082mq*2 + mq + 19q - 104 wrt q. -2m*3 - 96164m What is the first derivative of -5646c - 46157? -5646 What is the derivative of 256558h*2 - 2103709? 513116h Find the first derivative of 5343v3 + 26298. 16029v*2 What is the third derivative of -3a*3gu2 + 490a*3u + 4a3 + 2a*2gu + 845a*2g - 2a2u*2 wrt a? -18gu2 + 2940u + 24 What is the first derivative of -97916y2 - 248601 wrt y? -195832y Find the second derivative of 33600x3 - 43982x. 201600x Find the third derivative of 9909b*3o*3 + 2b*3 - 6b*2o*3 + 328o*3 wrt b. 59454o*3 + 12 What is the third derivative of 2o*4v*3 + 65832o*4 + 3253o*2 - 14ov3 wrt o? 48ov3 + 1579968o Differentiate -836036w2 + 200472. -1672072w Find the third derivative of -520k5 - 2k*4 - 22550k*2. -31200k*2 - 48k What is the third derivative of -566896r3s3 - r3 - 420r2s + 1136rs*3 wrt r? -3401376s*3 - 6 What is the first derivative of 3139251r*3 - 3505395? 9417753r*2 What is the third derivative of 1735304z*3 - 146z*2 - 2z - 162? 10411824 Differentiate -2r4 - 4r*3 + 306r*2 - 71039 wrt r. -8r*3 - 12r*2 + 612r What is the third derivative of -48969n3 + 2096n*2 wrt n? -293814 Differentiate -406648b + 120050 with respect to b. -406648 What is the third derivative of -1259b6 - 2b*4 + 193b*2 + 20b + 2? -151080b3 - 48b What is the second derivative of -3734042t2 - 180t - 111? -7468084 Find the second derivative of -185c4o*3 + 62c*4o - 3020co*2 - 2c + 5o3 wrt c. -2220c*2o*3 + 744c*2o What is the second derivative of 15f2o*2u*2 + 12f*2o*2 + 4fo2u*2 - 5fo - 62o*2 + 2ou2 wrt f? 30o*2u*2 + 24o*2 Find the first derivative of -96m*4 + 34m*3 - 2m*2 - 3m + 295652. -384m3 + 102m*2 - 4m - 3 What is the first derivative of -3k2 + 452689k - 3171163? -6k + 452689 Find the third derivative of -55h*3z*3 - 7h*3z*2 + 3h*3 + 25hz3 - 306hz2 wrt z. -330h*3 + 150h Find the first derivative of -1402763q - 1398931. -1402763 Differentiate -15a*2 + 4adf - a*f - 8	{ "pile_set_name": "DM Mathematics" }
is the biggest value in a, -0.2, 19? 19 Let p = 0.86 + 0.14. Let n = 3 + p. Let r = 0.2 + -0.3. Which is the second biggest value? (a) r (b) -4 (c) n a Let s = -331/14 + 190/7. What is the third biggest value in 0.3, -10, s? -10 Let q = 0.8 + -2. Let x be 11 + -5 - (-6 - 48/(-3)). What is the third biggest value in -0.4, x, q? x Let x be (-12)/(-4) + (-17)/17. Let g = -2.9971 - 0.0329. Let o = g - -0.03. What is the third smallest value in o, x, -0.2? x Suppose 4x + 22 = 2n, -n + 1 = -2. Let l = x + -1. Let p = -22 + 31. Which is the smallest value? (a) 0 (b) l (c) p b Let p be ((-1)/(-3))/(8/9). Let w be -2 - 7 - (-132)/16. Which is the fourth smallest value? (a) 4 (b) p (c) w (d) 1 a Let t = 0.24 + -0.04. Let f = -0.26 + 0.16. What is the smallest value in f, t, -4/7, 1? -4/7 Let h = 771.3 + -771. Let d = -8 - -8.3. Let f = d + -0.2. Which is the smallest value? (a) -0.4 (b) f (c) h a Let z = -271 + 276. What is the third smallest value in -0.3, z, 8? 8 Let v = 0.242 + -1.342. What is the biggest value in -2, -0.5, -0.2, v? -0.2 Let z = 3.38 + -8.38. Which is the fourth biggest value? (a) z (b) -10 (c) 0 (d) -0.4 b Let q = 14 + -21. Let w = 5 + q. Let p = -1.1 + 0.7. Which is the third smallest value? (a) 4 (b) p (c) w a Let v be 6/8 + 0/(-2). Let i = -1.89 + 1.91. Let h be 6/(-15) + ((-24)/(-55))/2. Which is the biggest value? (a) h (b) i (c) v c Suppose 10 = l + 5f, 0f - f = 3l - 44. Let d be 0 + -4 - (-63)/l. Which is the third biggest value? (a) d (b) 3 (c) 0.4 a Let x = -3 - -7. Let p = -4878 - -4877.5. Which is the third biggest value? (a) -1 (b) 4/3 (c) x (d) p d Let x = -12.59 - -12.39. Which is the second smallest value? (a) 2/3 (b) 15 (c) x a Let z = 123 - 127. Which is the fourth biggest value? (a) z (b) 5 (c) -3 (d) 0.4 a Suppose -3p - 12 = 0, -16 = 5j - 10j - p. Suppose -jw - 12 = 4. What is the third biggest value in 0.3, -2/7, w? w Let n = -45 - -21.5. Let j = n + 24. Let r(o) = -o2 + o + 3. Let a be r(0). What is the second smallest value in a, 5, j? a Let k = 16 - 8. Let o = -6/19 + 29/152. What is the third smallest value in o, k, 5? k Let a = -24 + 18. Let y = 79 + -554/7. What is the third biggest value in a, 0.1, y? a Let w(n) = 4n*3 - 4n*2 - 4n + 1. Let d = -8 + 7. Let x be w(d). Let v = -0.6 - -0.1. Which is the third smallest value? (a) -2/9 (b) v (c) x a Let k = 0.045 + 35.955. Let y = -41 + k. What is the third biggest value in y, -0.5, 0? y Let g = -5 + 3.1. Let o = 25.6 - 23.8. Let x = o + g. What is the third smallest value in 0.07, 2/9, x? 2/9 Let o(b) = -2b3 + 14b*2 - 5b - 10. Let v be o(6). Let q be 1-3 - (-4)/(v/30). What is the second biggest value in 5, 0.4, q, 1? 1 Let j = -1241/5 - -249. Which is the fourth smallest value? (a) 2/15 (b) -3 (c) j (d) 0.2 c Let o = 2 + -5/2. Let d = 0.1601 - 0.4601. What is the third biggest value in o, 3, d, 0.3? d Let h = 721/3 + -242. What is the second smallest value in h, 0.4, 3/8, -5? h Let z = -7/4 + 1. Let x = 15 + -21. Let t be 24/9 + x/2. What is the third biggest value in 0.2, z, t? z Let k = 1 + -5. Let h = -25 + 25.17. Let l = -0.17 + h. What is the smallest value in l, -1/6, k? k Let p(z) = -z2 - 2z + 3. Suppose 0 = 2j + 5v - 15, 3j - 15 = -2j - 5v. Let t be p(j). Which is the smallest value? (a) t (b) -2/9 (c) -11 c Let q = -385 + 390. Which is the smallest value? (a) 1/4 (b) -0.5 (c) q b Suppose 2z + 6 = 5z. Suppose zq + 2q - 4y = -20, 5q = y - 5. Suppose o + o = q. Which is the biggest value? (a) o (b) -2 (c) -1 a Let i = -506/3 - -169. Which is the second biggest value? (a) 0.3 (b) i (c) -1/2 (d) -2 a Let z be (22/55)/((-1)/(-5)-1). What is the second smallest value in -2/11, -14, z, 2? z Suppose 10 = -4d - 3h - 6, 2h = 5d - 3. Let j = -135 - -677/5. Which is the smallest value? (a) j (b) 0.3 (c) d c Let t(w) = 3w + 2. Let a be t(-2). Suppose 68i - 71i = 0. Let g be 3/2 + (-4 - -1). What is the third biggest value in i, g, a? a Let a = -6 - -5.7. Let x = 0.3201 + -0.0201. What is the third biggest value in -8, x, a? -8 Let k = -3.58 - 0.42. Which is the third biggest value? (a) -0.08 (b) 3 (c) 1/5 (d) k a Let u = -0.9 - -0.5. Let n = -20.5 + 20.9. Which is the third biggest value? (a) u (b) -2/7 (c) n a Let u = 8 - 9. Let v = -42 + 47.8. Let p = 6 - v. What is the second biggest value in 0.4, p, u? p Let m be (9/12)/((-2)/48). Suppose -4i - s = 84, -2s = 3i - s + 64. Let r be 2/(i/m) + -2. Which is the second smallest value? (a) 1/5 (b) r (c) 2/15 c Let r = 3.7 - 21.7. Let t = r - -17.7. Let z = 14 - 14.5. Which is the second smallest value? (a) z (b) t (c) -4 a Let d = 0.03 - -0.07. Let c = -32 + 32.43. Let b = c - 5.43. What is the third biggest value in d, b, -1/10? b Let r be (-15)/50-21. Let t(p) = p - 1. Let h be t(4). Let f be (-1)/3(-18)/12. Which is the second smallest value? (a) h (b) f (c) r c Let j = -681.1 + 716. Let l = -35 + j. What is the smallest value in l, -5, 3? -5 Let u = 11.24 + -9.74. What is the second biggest value in 4, -0.05, u? u Let g = -1 + 0. Let u = -17.2 - -18.4. Let f = g + u. What is the third biggest value in -3/8, f, 3? -3/8 Let h be ((-6)/(-9))/(1/3). Let j be (182/195 - 4/(-10))(-6)/20. Which is the biggest value? (a) h (b) j (c) 0 (d) 0.5 a Let k be (-4)/(-6) + (2 - 124/(-12)). Let m = -8 - 0. Let g = m + k. What is the smallest value in g, -4, -0.3? -4 Let f = 76/29 + -438/145. Which is the third biggest value? (a) -2 (b) f (c) -0.2 (d) 0.1 b Let k = -26.1 - -0.1. Let g = 28 + k. Let t = -0.2 - -0.1. Which is the second smallest value? (a) 1/4 (b) t (c) g a Let y = -0.6 + 0.2. Let s = 0.1 + -0.2. Let x be -4 - (34/(-6))/((-4)/(-3)). Which is the biggest value? (a) x (b) s (c) y a Let p = 0.402 - 0.002. What is the second biggest value in -5, p, 1/2, -2/23? p Let h be (-430)/30 + 13 - (-16)/3. Which is the second smallest value? (a) 0 (b) 2/15 (c) 0.1 (d) h c Let z(k) = -2k3 + 23k*2 - 32k + 15. Let a be z(10). What is the third biggest value in a, -0.4, 2/9? a Let d = -68.2 + 68.2. What is the second biggest value in -0.5, d, 4, 0.1? 0.1 Let h(b) be the second derivative of b5/20 - b4/4 + 2b2 - 2b. Let a be h(3). Let u = 0.6 + -0.2. What is the biggest value in 1/3, u, a? a Let s be (-81)/190 - (-2)/(-10). Let c = s + 1/38. What is the smallest value in 0.6, c, -3? -3 Let v = 0.13 + 0.87. Let p = -0.8 + v. What is the third biggest value in 5, 0, p? 0 Let s = 7953/91582 - 1/1579. Let p = s - 209/406. Let l = 6 + -1. Which is the biggest value? (a) -3/4 (b) p (c) l c Let m be (2 - -2)/(4 - 11 - 7). Which is the third biggest value? (a) -2/5 (b) m (c) -1/6 (d) -2/19 b Let c = 52.78 - 0.78. Let o = c + -60. What is the smallest value in 3, 0.07, o? o Let f = 23.76 + -23.56. Which is the third biggest value? (a) f (b) 0.168 (c) 0.5 b Let n be 1/(2/4)27/1206. Let z = 101/737 + n. Which is the smallest value? (a) 4 (b) z (c) 2/15 c Let k = 74 + -75. What is the third smallest value in -1/8, -0.026, k, 0.1? -0.026 Let h = 84.03 - 11.93. Let s = h + -72. What is the biggest value in s, -2/5, 16? 16 Let g = 4.94 - -0.06. Let l = 5.6 + -6. Which is the second smallest value? (a) -4 (b) l (c) g b Let s = -131/1406 - -3/74. Let p = 52898 - 52901. What is the biggest value in s, p, 0? 0 Let f = 125 + -124. Which is the third biggest value? (a) 4 (b) -2/3 (c) f b Let o = 106/5 + -343/15. Which is the second smallest value? (a) -0.31 (b) 0.4 (c) o (d) -5 c Let y = -10 - -5. Let o be (-1 + -3)/(1 - -4). Let a = -14.6 - -19.6. What is the second smallest value in o, y, a? o Let m = 4.4 + -8.4. Which is the fourth biggest value? (a) -56 (b) 3 (c) m (d) -0.2 a Let p = 1247/4 - 312. What is the third smallest value in 0.5, p, 1, 3? 1 Let u = -3 - -2.6. Let z be (-44)/(-165)40/48. Which is the third smallest value? (a) z (b) -0.3 (c) u a Let h = -5095/78 + 391/6. What is the third smallest value in 2/9, -4, -58, h? h Let t = 584 - 578. What is the fourth smallest value in -1, t, -0.17, 0? t Let y be ((-9)/21)/((-18)/(-12)). Which is the second biggest value? (a) 5 (b) y (c) -2/11 c Let y be (1/20)/((-36)/96). Let z = 0.24 - 0.54. Which is the	{ "pile_set_name": "DM Mathematics" }
8. Suppose 75h - 80h = -t. Is h a multiple of 29? True Let c = 14 - 34. Let b = 22 + c. Suppose -2d + 30 = bg, 3g = d + 63 - 6. Is 18 a factor of g? True Let x(u) = 45u*2 - u + 3. Let m be x(-2). Let s = -112 + m. Is s a multiple of 14? False Let u be 34 + -2(0 + -1). Let w(l) = 2l2 + 6l - 18. Let j be w(2). Suppose -u = -0d - jd. Is d a multiple of 18? True Suppose -3f = -6f - 75. Let w = f + 61. Is 7 a factor of w? False Suppose 0 = -2x + 3s + 286, -4x = -2x + s - 286. Let k = 398 - x. Suppose -3t - 369 = -5b, 3t + k + 42 = 4b. Does 12 divide b? True Let r(m) = -m*3 + 20m*2 - 7m + 16. Is r(18) a multiple of 30? False Let d(c) = -c + 83. Is d(11) a multiple of 12? True Let o = -15 - -21. Does 8 divide (268/o + -2)/(6/18)? True Let r(s) = -2s3 + 38s*2 - 27s - 53. Is 22 a factor of r(16)? False Let y = 58 - 85. Let g be (0 - (-2)/(-1)) + -67. Let t = y - g. Is t a multiple of 12? False Suppose 42p + 78912 = 66p. Is p a multiple of 9? False Suppose -2v + 3b + 18 = 0, -5v - b = b - 45. Let r(s) = 30s*3 + s - vs*3 + 27s*3 + 0s*3 - 2s*2. Is 22 a factor of r(1)? False Let r(w) be the third derivative of 3w*5/10 - 5w4/24 + w3/6 + 8w2. Is r(2) a multiple of 15? False Let c(d) = -d2 + 2d + 58. Does 29 divide c(0)? True Let i(g) = g + 11. Let p be i(-11). Suppose -21 = -3n + 3x, n - 5n - 2x + 10 = p. Suppose nl - 20 = 16. Is 9 a factor of l? True Let p(r) = -r2 - 12r - 11. Let n be p(-11). Suppose n = -0f - 4f + 8. Suppose 5b - 123 = -2t, 4t = -0b - fb + 46. Is 25 a factor of b? True Let z(c) = c2 + 134 - 3c*2 - 32 + 0c2 - c3. Does 7 divide z(0)? False Let p = -34 - -32. Does 30 divide (-3504)/(-39) - p/13? True Let z be (1/(-1) - -1)/1. Suppose z = -15o + 10o + 15. Suppose -l - 113 = -4k, -ok + 17 = l - 59. Does 9 divide k? True Let a(x) = x*2 + 12x - 17. Let d be a(-13). Let p be 16/(-6)(-6)/d. Let w(n) = -n3 - n2 + 4n + 6. Does 19 divide w(p)? True Let c(u) = -56u - 123. Is 5 a factor of c(-5)? False Suppose 3w - 39 = 3h, 3w - 2h - 3 = 35. Let g = 50 - w. Is g a multiple of 10? False Let c be 38(-1)/(-6). Let t = -182 - -442. Suppose -2n - 2n = 3k - 156, 5k + cn - t = 0. Is k a multiple of 13? True Suppose 2m = -4i + 6i + 16, -4i - 3m = 11. Let g be -1 + (2i - 2). Let f = g + 50. Does 11 divide f? False Suppose -4a = -3a. Suppose 3j - o - 360 = a, 2o + 7 - 1 = 0. Suppose 3n + j = 2p, -4p = -6p + 5n + 113. Is 16 a factor of p? True Is -58(15/6 + -4) + -1 a multiple of 26? False Let h(y) = 3 - 13y + 5 + 0y - y*3 - 10 + 16y*2. Is h(15) even? True Let k(y) = 2y*2 - 9y + 10. Let i be k(8). Let m = 42 - i. Let f = -3 - m. Is 8 a factor of f? False Let j be 12/114 - (-6)/(-57). Suppose j = -2v - 10v + 1320. Is 11 a factor of v? True Let n = 147 - 128. Suppose -14h + nh - 1120 = 0. Is 16 a factor of h? True Let g = 1431 - 891. Is g a multiple of 12? True Let l(u) = u + 2. Let v(t) = -90t - 57. Let n(r) = -18l(r) - v(r). Is n(4) a multiple of 13? False Suppose -5k - 5g = -0g - 495, 3g + 327 = 3k. Suppose -3y + k = y. Is 6 a factor of y? False Suppose -c - 3 = -7. Does 22 divide ((-405)/(-20) - 2)c? False Let z be ((-11)/3)/((-35)/(-12) - 3). Suppose -11r + z = -198. Is r a multiple of 11? True Let g be (3 + -6 + 2)-21. Is -63/g-112 a multiple of 16? True Suppose 0w = -3n - w + 368, 4w = -3n + 383. Let a = 199 - n. Is a a multiple of 39? True Let f = -16 + -2. Let l be (f/(-8) - 2)12. Suppose -3n - t = -3t - 48, -ln - 2t = -48. Is n a multiple of 13? False Let x(c) = 4c2 - c. Let v be x(1). Suppose -3d = -vt + 2d + 22, -2t + 3d = -15. Suppose -q = 1 - t. Does 4 divide q? True Suppose 2g - g = 2q - 61, -3q - 3g = -96. Suppose -34o + qo = -126. Does 8 divide o? False Let p(a) = -a - 1. Let b be p(1). Let l be (-11)/(-22) + (-223)/b. Let n = -70 + l. Is 14 a factor of n? True Let g(v) = -2v3 - 2v*2 + 5v - 2. Let k be g(4). Let y = -40 - k. Is 18 a factor of y? False Let y(b) = -b*3 - 5b*2 + b + 7. Let p be y(-5). Suppose -414 = -pj - 2s + s, -4s = 4j - 832. Does 42 divide j? False Let y(t) = -t - 8. Let i be y(8). Suppose -4o - 5m + 80 = 0, 2m = 4o + 47 - 127. Does 12 divide (i/o)/(2/(-85))? False Suppose -3y + 2y + 5f = -23, 5y - f - 235 = 0. Does 2 divide y? True Let t = -1051 + 2319. Does 15 divide t? False Suppose -7p = p - 224. Let v = p - -1. Is v a multiple of 9? False Suppose -6n + 7n + 3q = 73, -5n + 5q + 285 = 0. Is 37 a factor of n? False Suppose -5w + 20555 = -3d, 4w - 9422 = -d + 7005. Is w a multiple of 13? True Let j = 130 - 63. Let d = j - 17. Does 5 divide d? True Let m(q) = q - 56. Let j be m(-8). Is 28 a factor of ((-21)/(-4))/((-2)/j)? True Let a be 25/(-4) + (-3)/(-12). Let k(p) = p*2 - 16p + 8. Let d(r) = 4r - 2. Let y(x) = 9d(x) + 2k(x). Is y(a) a multiple of 23? True Let r be 1/2 + 175/14. Suppose 0p - 10 = -5p, 3w = p + r. Suppose wx + 2m - 3m = 53, 25 = 3x - 4m. Is 11 a factor of x? True Suppose 2 = u + 3d, -d - d = -5u + 10. Suppose k + j + uj - 30 = 0, 2k - 33 = 3j. Does 13 divide k? False Let v be (-2)/3(-45)/10. Suppose 5k = vx + 217, -90 = -2k - x - x. Suppose -2r = 4s - 48, -s - 137 = -3r - k. Does 10 divide r? True Let j = -2300 + 2383. Is j a multiple of 83? True Let b = -180 - -113. Let y = b + 79. Is y a multiple of 2? True Let b = -21 + 14. Let x be (95/20)/((-4)/(-16)). Let h = x + b. Does 9 divide h? False Suppose 4j - 4l = 20, -3l - 3 = -j + 6. Suppose -5u + 2x = -x - 117, 3u + 4x = 76. Suppose -66 = -jn + u. Does 5 divide n? True Suppose -2t + 13 = 65. Let u be (-505)/(-13) - 4/t. Suppose -15 = 3p - u. Is p a multiple of 2? True Suppose 3s + 1569 = r - 0r, -2s = r - 1569. Is r a multiple of 22? False Suppose 0 = -4y + 3y + 5o + 540, 4o + 1587 = 3y. Suppose -4m + y = -m. Is m a multiple of 25? True Let b = -36 + 129. Suppose -4o + 2a = -78, -4o + b = o + 2a. Is o even? False Suppose -2u + 2c + 74 = 0, 3u - 4c - 55 = 58. Let f = u + -11. Is 8 a factor of f? True Let f(v) be the third derivative of 11v4/12 + 2v*3/3 + 11v*2. Is 24 a factor of f(2)? True Suppose -5184 = -40v + 4936. Does 11 divide v? True Suppose -9n + 350 = -7n. Is n a multiple of 25? True Suppose 3h - 648 = -228. Is h a multiple of 6? False Suppose -8g = -11g + 3k + 2421, -3g - 3k + 2427 = 0. Is 8 a factor of g? True Suppose -4u + 39 = 3d, -u - 4u = 4d - 52. Does 2 divide d? False Let v(b) be the third derivative of 5b4/12 + b3/2 - 5b2. Is 11 a factor of v(3)? True Let m = 1835 - 273. Is m a multiple of 13? False Let a(z) = z3 - 8z2 - z + 8. Let i be a(8). Suppose is = 4s - 176. Does 11 divide s? True Let r(u) = -u + 11. Let i be r(9). Let m(g) = -g3 + 2g - 1. Let z be m(-3). Does 4 divide z/2 + (i - 0)? True Let n(c) = -c*3 + 9c*2 - 8c + 2. Let m be n(8). Let v be (38 - m)/((-2)/4). Is v/28(-280)/12 a multiple of 20? True Suppose 3w - 122 = -0u - 2u, 0 = 2w + 3u - 73. Let m be (0 + 2)/((-4)/58). Let o = m + w. Is 5 a factor of o? True Suppose -n + 14 - 6 = -3v, 0 = -5v + 20. Is 20 a factor of n? True Let o(d) = 2d2 - 34d. Let i be o(16). Let u(n) = n + 69. Let a be u(0). Let y = a + i. Is 15 a factor of y? False Suppose 0 = 31t - 34 + 3. Let k = 16 - -3. Is 4 a factor of (k + t)/2 + 0? False Let w(j) = -j3 + 5j*2 - 3j. Let i be w(4). Let l(x) = -x + 15 - x - x + ix. Is 8 a factor of l(-7)? True Let c(m) = -m3 - 6m*2 - 5m - 8. Let f be c(-6). Is f/(-3 + (-21)/(-6)) a multiple of 44? True Let a(w) = -42w + 72. Is a(-9) a multiple of 90? True Suppose -76 = -5v + 14. Let g = 150 + v. Suppose -g = t - 5t. Does 14 divide t? True Suppose 4d + 111 + 8 = p, 3p - 364 = 5d. Let o = 178 - p. Is o a multiple of 12? False Suppose 6 = -2b, 18 = 2q - 2b + 2. Suppose -qp - 365 = -4k, -k + 3k - p = 175. Does 25 divide k? False Suppose -5q + 0q = -5w + 175, 2q - 50 = -w. Is w a multiple of 20? True Suppose 11n + 4f - 2957 = 8n, -3948 = -4n - 4f. Does 68 divide n? False Let k = 50 + -100. Let l = k + 74. Does 6 divide l? True Suppose -34k - 49876 + 156772 = 0. Is 118 a factor of k? False Let o(p) = -2p3 + 3p - p - 2p*2 - p. Let h	{ "pile_set_name": "DM Mathematics" }
n wrt n. 24kn2 + 18kn - 4146n Find the third derivative of 9l5o*2 + 13l*4o*2 - 2l*2o2 - l2o + lo*2 + 427o wrt l. 540l2o*2 + 312lo2 What is the third derivative of -2k*5 + 271k*2? -120k*2 What is the second derivative of 4584fq4 + 2fq3 - 482fq - f wrt q? 55008fq2 + 12fq What is the second derivative of 3834f*3m*2q3 - f3mq*3 - 2f*2mq3 + 1991f*2 wrt m? 7668f*3q*3 What is the second derivative of -7m*4 - 2705m*3 - 2m*2 - 332m? -84m2 - 16230m - 4 What is the second derivative of 2c3 + 33c*2 + 2090c? 12c + 66 What is the third derivative of -17338g*3 - 4719g*2 - 2? -104028 Differentiate 208n + 479. 208 What is the second derivative of -19s4 + 2s*3 - s - 156? -228s*2 + 12s What is the first derivative of 3p2 - 354p + 4836 wrt p? 6p - 354 Find the third derivative of -206p*4 - 21p*2 + 2. -4944p What is the second derivative of 1127k3 - 13313k? 6762k What is the first derivative of 1112n*4 + 472 wrt n? 4448n*3 What is the second derivative of 33g*3x + 2g2x + gx - g + 15x wrt g? 198gx + 4x Find the third derivative of -3276p6 - p3 + 11741p2 wrt p. -393120p*3 - 6 What is the second derivative of -7573z*2 - 170z + 51? -15146 What is the third derivative of -25m2v*3 - 2m*2v*2 - 2m*2 - 29mv3 - v3 + 208v*2 - v wrt v? -150m*2 - 174m - 6 What is the third derivative of -10hluy*3 - 26hluy2 + 2hly*2 + 26hly + hy4 + 22uy4 - uy*2 wrt y? -60hlu + 24hy + 528uy Find the third derivative of 75j5 - j2 + 4 wrt j. 4500j2 What is the second derivative of -a3jx*2 + 267a*3x*2 + 22ajx*2 + 8ajx - 2jx wrt a? -6ajx2 + 1602ax2 What is the first derivative of 2140dm2w + 23dm2 - d - m2w - 8 wrt w? 2140dm2 - m2 Find the third derivative of 435s*4 - 3s*3 + 6534s*2. 10440s - 18 What is the first derivative of 2p4s + 23p4 - ps + 62s wrt p? 8p*3s + 92p3 - s What is the third derivative of 7c*5 - 11c*4 + 48c*2 wrt c? 420c*2 - 264c Find the third derivative of 3d3u*2 - 44d*3u - 3d2u*2 + 18d*2u wrt d. 18u2 - 264u What is the third derivative of -144f4v + 2f4 + 128f*2v - 13f wrt f? -3456fv + 48f Differentiate -n*4p*2 - 32n*2p*2 - 3665p*2 wrt n. -4n*3p*2 - 64np2 Find the third derivative of -1508m*3s*3 + 3m*3s + 349m2s*2 wrt s. -9048m*3 What is the third derivative of -15849c*6 - 12947c*2? -1901880c*3 What is the first derivative of -12d*2gv - 2d*2 + 92dgv - dv - 200d wrt g? -12d2v + 92dv What is the third derivative of d*3y*4 + 2d*3 - 1809d*2y4 + d2y2 - 1329dy wrt y? 24d*3y - 43416d2y Differentiate -w*4 - 11766w*3 + 13268 wrt w. -4w*3 - 35298w*2 Find the first derivative of 581d*3 - 3858. 1743d2 What is the second derivative of c2qr*2 - 2c*2 + 6cnqr2 - 2cnq + 4cqr2 - 27cqr - 2nqr wrt r? 2c*2q + 12cnq + 8cq What is the second derivative of -497f*2u + 834f - 2u wrt f? -994u What is the derivative of 7j - 201? 7 What is the first derivative of 10f2t*2 - 2f*2 + 106fw + t2w - 28t2 + 4w - 3 wrt t? 20f2t + 2tw - 56t What is the third derivative of 2644n*3 - 16n2 - 7 wrt n? 15864 Differentiate j3t2 - 81jt2 - 5041t*2 with respect to j. 3j*2t*2 - 81t*2 Find the first derivative of -7d*4f*3 - 348d*4f*2 - 10551f*3 wrt d. -28d*3f*3 - 1392d*3f*2 What is the third derivative of -6a*5 + 32a*3 - 1415a*2 + 3a? -360a2 + 192 Differentiate -691p*2 - p + 48 wrt p. -1382p - 1 Find the third derivative of 4825g3 + 11034g*2 wrt g. 28950 What is the second derivative of -4l*4 + 347l*3 - 2761l? -48l2 + 2082l Find the second derivative of -2853j3 + 3j*2 + 40j - 5 wrt j. -17118j + 6 Find the second derivative of -2j*2m*4 - 272j*2m + 3jm*4 - 5m*2 wrt m. -24j*2m*2 + 36jm2 - 10 Find the second derivative of -2011ku3 - 16ku - u wrt u. -12066ku What is the third derivative of -822n*3 - 6082n*2? -4932 What is the third derivative of -661d*3rt + 229d*2rt + d2r wrt d? -3966rt Find the third derivative of 28d2k*3 + 2d*2k*2 - 2dk2s + 85dk*2 - ds - 2k5s + k*4s wrt k. 168d2 - 120k*2s + 24ks Find the third derivative of 97o2u*5 + 33o*2u*2 - 27u*3 + 74u*2 + 2 wrt u. 5820o*2u*2 - 162 What is the third derivative of 3t*2v*3 - 15t*2v + t*2 - 20tv6 - 2v*2 wrt v? 18t*2 - 2400tv3 Differentiate 1262i*4 + 1002. 5048i*3 Find the third derivative of -2a*4 + 247a*3 + 2a*2 - 107a + 2 wrt a. -48a + 1482 Differentiate -1048m*4 - 5537 with respect to m. -4192m*3 What is the third derivative of 4c*4 - 14c*3 - 454c*2? 96c - 84 Find the second derivative of -51y4 - 6y*3 + 410y. -612y2 - 36y What is the third derivative of 368p3 + 2p*2 - 237p? 2208 What is the second derivative of 99h3i + h*2i + 470hi wrt h? 594hi + 2i What is the third derivative of 3794j*3s*2u*2 + 19j*2s*2u*2 - 8j*2su + 3j*2s - s*2u*2 + 2s*2 wrt j? 22764s*2u*2 What is the third derivative of -617l*3u + 213l2 + 5u wrt l? -3702u Find the second derivative of -533h*2 - 11829h wrt h. -1066 Find the second derivative of k*2n*2 + 226k*2n - 23kn*2 wrt n. 2k*2 - 46k Find the third derivative of p*3u - 1157p3 - 9p*2u + 2p - 2u + 11 wrt p. 6u - 6942 What is the first derivative of 51af - 914ax3 - 9fx3 wrt f? 51a - 9x3 What is the second derivative of -75c*2g*3z*3 - 2c*2g*2z*3 + 4cg3z*3 - cg*2 - gz*3 wrt c? -150g*3z*3 - 4g*2z*3 What is the second derivative of 18866s*2 + 6s + 805? 37732 Find the second derivative of 20r5 - 8r*2 + 102r wrt r. 400r3 - 16 Find the second derivative of -g4r*3 - 121g*2r*3 - 17gr3 - 33gr wrt g. -12g*2r*3 - 242r*3 Differentiate -9a*3y*3 - 2a*2 - 14ay3 + 45y*3 + 3y*2 with respect to a. -27a*2y*3 - 4a - 14y3 What is the first derivative of -s4 - 2s*3 - 80s + 5633 wrt s? -4s3 - 6s*2 - 80 Find the first derivative of -2l*2z*2 + 232lz2 - 293z*2 wrt l. -4lz2 + 232z*2 What is the third derivative of sz*5 + 3sz4 - 5523sz2 + 5z*6 wrt z? 60sz2 + 72sz + 600z*3 What is the derivative of -2119w*4 - 13? -8476w*3 Find the third derivative of 18pt5 + 6pt4 + 3p - t*3 - 2t*2 + 9 wrt t. 1080pt2 + 144pt - 6 Find the second derivative of 763l*2p*2 + 7lp2 + 12l wrt l. 1526p2 Find the third derivative of 2c*4 - 11c*3 - 2c*2 - 31 wrt c. 48c - 66 Find the second derivative of 5b5 - 3b*2 - 176b wrt b. 100b3 - 6 What is the second derivative of 3gkt*2 + gkt - gt*2 + 4gt - 476kt2 + 3k - 13 wrt t? 6gk - 2g - 952k What is the derivative of 7736h + 5441 wrt h? 7736 Find the second derivative of -c2t*4 - 124c*2t*2 - 29c*2t + c*2 + 2c wrt t. -12c2t*2 - 248c*2 Differentiate 2653y*2 - 1396. 5306y Differentiate 208m4 + 222. 832m*3 Find the first derivative of 44r*4x - 23r2 - 739x wrt r. 176r3x - 46r What is the third derivative of -3t*2z*4 - 2t*2z + 27tz*2 wrt z? -72t*2z Differentiate 9g3tv3 - 3g*3v*2 - gv*3 - 9tv3 wrt t. 9g*3v*3 - 9v*3 What is the third derivative of 6j*5 + 63j*4 - 2j*3 + 2j*2 + 2j + 173? 360j2 + 1512j - 12 Find the second derivative of -4130l2p*3 - 250l*2p - p*4 - p wrt p. -24780l*2p - 12p2 What is the third derivative of 20788uz3 - 110uz2 - 73uz wrt z? 124728u Find the first derivative of 10a4 - 13a*3 - 390. 40a*3 - 39a*2 What is the first derivative of -28d*3j*2l + 2d3j*2 + 23d*2j*3l - 56dj*3 - 21dj2 wrt l? -28d*3j*2 + 23d*2j*3 What is the second derivative of -3078f*2oz2 + 16f*2oz + 6f*2o + 3oz wrt z? -6156f2o Find the first derivative of -2017m3v3 - m - v3 + 144v2 wrt m. -6051m*2v*3 - 1 Differentiate 7460t*	{ "pile_set_name": "DM Mathematics" }
242 - 242) + (0 + 3 + 1)(2f - 2f + f))(-2f + 6f - 3f). 570f2 Expand (b4 - 8b4 + b4)(53 + 3b + 28 - 44). -18b*5 - 222b*4 Expand (2p4 - p4 + p*4 - 38p*4 - 31p*4 + 51p*4 - 3p*4 - 2p4 - p4 + (-1 + 4 - 1)(p4 + 2p*4 - 5p*4))(7 + 1 - 2 + 3p). -78p*5 - 156p*4 Expand (10l - 10l - 5l*4)(27 + 538 - 288). -1385l4 Expand -4 + 4 - 5q2 - q2 + q2 - q2 + (5q2 - 2q*2 + 0q*2)(-109 - 116 + 66). -483q2 Expand (-86f*3 - 125f*3 - 152f*3)(-1 + 1 + 2f + (-1 + 5 - 2)(-f - 6f + 5f) + 21 - 25 - 11f - f). 5082f*4 + 1452f*3 Expand (37d - 119 + d*2 + 5 + 71)(0d + d - 2d). -d*3 - 37d*2 + 43d Expand (-1 - 3 + 2)(60173f - 60173f + 144f*4)((-1 - 2 + 5)(-3 - 1 + 5) + 2 - 4 + 3)(2 - 2 + f). -864f5 Expand (105c*2 + 13c*2 + 111c*2)(-8c3 - 19c*3 + 2c*3 + (4c + 0c - 2c)(0c*2 + 4c*2 - 2c*2) + 4c*3 - 2c*3 + 0c*3). -4351c*5 Expand (-11d + 4d - 2d)(132 - 77 + 165). -1980d Expand ((r + 1 - 1)(-r + 2 - 2) + 2r*2 - 7r*2 + 0r*2)(-13r3 - 5r*3 - 24r*3). 252r*5 Expand 7p*4 - 2p*4 + 32p*4 - 5p*4 + 16p*4 + 3p*4 + (-1 + 4 - 2)(-3p4 + 3p*4 + 2p*4). 53p*4 Expand (-14i*3 + 12i*3 + 21i*3)(5024 - 5024 - 51i) - i4 - i4 + 0i*4. -971i*4 Expand -4728v*2 + 4728v*2 - 2 - 20v*4 - 43v - 9v4 + 43v + (-4 - 1 + 3)(0v*3 + 0v*3 - 2v4) + v4 + 0v + 0v. -24v4 - 2 Expand (25 - 19x + 4 + 17x)(4 - x - 3 + 1)(-2x + 2x + 2x). 4x3 - 66x*2 + 116x Expand (5m - 3m - 8m)(18m3 - m4 - 10m*3 - 5m*3) - 2m*5 + 3 - 3 + 3m - 3m + m5 + (-2m + m - m)(4m*4 - 2m4 - m4). 3m5 - 18m*4 Expand 5w*5 - 2w*5 + 4w*5 + (22 - 22 - 5w*2)(3w3 - 4w*3 - 3w*3). 27w*5 Expand (-5080c + 2672c - 866c - 2050c - 4513c)(0c*2 + 3c*2 - 4c*2). 9837c*3 Expand 5n*3 + 2n - 2n + n2 + n3 - n2 + (-61 - 140 + 284)(n3 + n3 + n*3). 255n*3 Expand (0 - 2 + 4 + (-4 + 3 - 1)(2 + 1 - 4))(424u - 1024u - 912u). -6048u Expand -555f*3 + 291f*3 - 623f*3 + (3f - 3f - 2f*3)(-2 + 4 + 0) + (4f - f - f)(f*2 + 0f*2 + 0f*2). -889f*3 Expand (4z3 - z3 - z*3)(-22 + 173769z + 2z*2 - 172591z + 20). 4z5 + 2356z*4 - 4z*3 Expand (-3 + 1 - 2)(3 + 0 - 5)((0o*2 + 2o*2 - 3o*2)(o*2 - 6o*2 + 4o*2) + 2o*4 - 4o*4 + 4o*4 - 27o*4 + 93o*4 + 74o*4). 1144o*4 Expand (82q - q + 57q + 25)(-1 - 2 + 4). 138q + 25 Expand (-1 - 2 + 6)(0 + 0 - 2)(-4 - 6m + 4)(-2m - 12329 + 12213 + 0m). -72m*2 - 4176m Expand (-8n + n - 3n)(48 - 77 - 180)(-2n + 0n + n)(-2n*3 - 3n*3 + 3n*3). 4180n*5 Expand -59p*2 + 94p*2 + 218p*2 + (6p*2 + 6p*2 - 3p*2)(-1 + 2 + 1). 271p2 Expand (-1793 + y - 3914 + 8162)(-5y2 + 3y*2 + 0y*2). -2y*3 - 4910y*2 Expand (2f + f - f + (0 + 3 - 1)(f + 0f - 5f))(-1 + 0 + 0)(3 - 3 - f). -6f*2 Expand (2c2 + c2 - 5c2)(298 + 170 - 60 + 8). -832c2 Expand -3f3 + f3 + f*3 + (-4 + 4 - 2)(-4f3 + f3 + 2f3) - f3 + 0f3 - 8f*3 - 22 + 3f*3 + 274f - 274f. -5f*3 - 22 Expand -2 + 4x*3 - 2x4 - 1 + 5 + (x2 - 2x2 + 3x*2)(2x - 3x*2 - 2x) + 22x4 - 51x*3 + 51x*3. 14x*4 + 4x*3 + 2 Expand (0 + 1 + 0)(147o2 + 345o*2 - 311o*2) + (12o - 22 + 22)(2o + o - 5o). 157o*2 Expand (-228g + 441g - 214g + 541)(0 + 0 + 1). -g + 541 Expand (0q - 3q + 5q)(-938q - 5645q + 167q - 2422q). -17676q*2 Expand (54 + 55 - 29)(21z - 19z + 13z). 1200z Expand -3m3 + 3m*3 - 13m5 - m5 - 2 + m*5 - 2m5 + (m2 + 5m2 - m2)(2m - 2m - 2m3) + 0m5 - m5 + 0m5. -26m*5 - 2 Expand (-3a + a + 4a)(-3a3 + 6a*3 - 2a*3) + ((-1 - 2a + 1)(-1 - 3 + 2) - 4a - 2a + 3a + 2a - 6a + 9a)(a*3 - 5a*3 + 3a*3). -4a*4 Expand (26 - 3 - 907)(-1 + 4 - 2 + q). -884q - 884 Expand (6x*2 + 0x*2 - 48x*2)(-3x2 - x2 + 3x*2)(1 + x - 1 + (0x + 0x - x)(4 + 0 - 5) + 12x - x + 9x + (-1 + 0 - 1)(4 - 4 + x)). 840x5 Expand (2 + 2 - 2)(-54 - 826p + 421p + 412p)(-4 + 4 + 10). 140p - 1080 Expand (33i*3 - 767i + 767i)(-14 - 10i + i + 10i). 33i4 - 462i*3 Expand (11w + 20w + w)(0w3 - 3w*3 + 2w*3) - 2w4 + w4 + 3w4. -30w*4 Expand 3v*4 - 13v*4 - 83v*4 + (5v*3 - 3v*3 + 0v*3)(2 - 2 + v) + v*4 - 2 + 2 - 22v*3 - 15v*4 + 22v3 + (0 - v4 + 0)(6 - 1 - 4). -106v*4 Expand (339r*4 - 166r*4 - 165r*4)(-39 + 39 - 12r) + (r4 - r4 - r4)(3r + 0r - r). -98r5 Expand (j - 3j + j + (-1 + 4 - 1)(0j + 0j + 2j) - 5j + 2j + j + 4j - j - 5j)(-259j*3 - 272j*3 + 603j*3). -72j*4 Expand (1 - 1 + 2v)(-12v + 6958 - 6960 + 442v). 860v*2 - 4v Expand 3509t - 292t*5 - 3509t + (0t4 + t4 - 3t*4)(0t - 4t + 2t) + t5 + t5 - 3t*5 - 4t*5 + 6t*5 + 2t*5. -285t*5 Expand (201 - 91 - 82r - 37)(-2 + 4 - 1). -82r + 73 Expand 578b2 - 64 - 331b*2 + 64 + (2b*2 - 2b*2 + 2b*2)(-4 + 5 - 16) + 4b2 - 2b*2 + 0b*2 - b. 219b*2 - b Expand 3 - 43a*3 + 72a*4 - 61a*4 - 19a*4 + (0a*2 + 3a*2 - 4a*2)(-3a2 + 3a2 - a2). -7a4 - 43a*3 + 3 Expand (0x + 2x + 0x)(-2x + 0x + 0x) - 16x2 + 2x*2 - 15x*2 - 63 - 28x + 27x - x2 + 83. -34x*2 - x + 20 Expand (-2l + 3l + l)(-l + 0l - l) + 0l*2 + 13l2 - l2 - 24l + 24l*2 + 24l. 32l2 Expand 66b*2 - 66b + 66b + (34b - 49b - 63b)(3b - 5b + b). 144b*2 Expand 11a*5 + 66a*5 - 43a*5 + (-2a5 + a5 - 2a5)(-3 - 3 + 3). 43a5 Expand (2n + 2n - 6n)(23n + 5091 - 6312 - 24n - 7n*3). 14n*4 + 2n*2 + 2442n Expand (-2t + 4 - 4)(-5 + 2 + 1) + (-2 - 2 + 3 + 2 + 2 - 2 + (-1 + 1 + 1)(3 - 3 - 2) - 2 - 1 + 1)(-4t + 3t + 2t)(217 - 146 - 245). 526t Expand (7p - 7p + 5p*2)(-12p + 6p + 4p + (p + 0p - 3p)(-2 + 0 + 3) - 8p + 10p + p). -5p3 Expand (77 - 77 - 10v)(-1 - v2 + 1)(-143v2 + 105v*2 + 100v*2). 620v*5 Expand (-262z*3 + 370z*3 + 376z*3)(-2z + z - 2z). -1452z4 Expand (-3 - 3 + 0)(5i2 - 4460 + 8914 - 4432). -30i*2 - 132 Expand (-2 + 2 + 2s - 3 + 3 - 2s + (-4s + s + 4s)(2 - 3 - 1) + 52s + 178s - 50s)(2s2 + 7s*2 - 7s*2). 356s*3 Expand -d + 5d - 4 - d*3 - 4d*3 + (-4 - 3 + 5)(18d + 780 - 780)(d2 + d2 - 4d2 - d2 + 5d - 5d + (-3d + 4d + d)(3d + d - 2d)). -41d3 + 4d - 4 Expand (2 - c - 2)(1 + 2c - 1) + c - c + c*2 - 29c*2 - 213c + 213c + (49c + 31c - 56c)(-1 + 5c + 1). 90c2 Expand (3 + 3 - 5)(290 + 24 + 42)(-3f*2 + 7f*2 - 3f*2). 356f*2 Expand (6 + 6 + 2)(-6c4 + 2c*4 + 3c*4) + 493c*4 - 42490 + 42490. 479c*4 Expand (0 - 13 - 8)(5s - 5s - s)(-5 + 87 + 6)(-2 + 4 - 3). -1848s Expand (1 - 1 - j)(j*4 + 4j*4 - 2j*4)(-79 + 7 - 102). 522j5 Expand (2 + 0 + 5)(-j + 4 - 4 + (2j + 0j - j)(3 - 2 + 5)) - 4j - j + 2j. 32j Expand 105z + 8z + 90z + 4 + z - 4 + (-2 - z + 2)(0 + 0 - 1) + z + z + 2z. 209z Expand (-175 - 111 - 7 - 2y + 22)(3y - 3y + 2y + (-2 + 2 - 6y)(-4 + 1 + 2)). -16y*2 - 2168y Expand (-2b - 3b + 3b)(-1 - 1 + 4) - 826b - 87812 + 43908 + 43908 + 271b - 500b. -1059b + 4 Expand 4z4 - 2z*4 - 5z*4 + (-1 + 1 - 2z)(-2z*2 + z - z)(-106 + 16 + 87 + 233z). 929z*4 - 12z*3 Expand -75 - 509y + 255y + 255y + (9 - 7 + 0)(-3 + 3 + y). 3y - 75 Expand y*5 - 2y*5 + 3y*5 + (-2y + 3y + 2y)(-348y*4 + 4439y - 4439y). -1042y*5 Expand (0t*2 + 5t2 - t2)(-t + t + t) + (-2t*2 + 2 - 2)(-214 + 73t + 214). -142t*3 Expand (-22 + 26 - 22)(-4 + 0 + 3)(9 - 8 - 25)(-4c - c + 4c). 432c Expand (49k*3 - 26k*3 + 9k*3)(-4 - 2 - 2) - 2k3 + k3 + 2k*3. -255k*3 Expand 2l*2 + 2 - 2 - 4l*2 + 3l*2 - 3l*2 + (-5l + 4l - 2l)(l + 2l - 7l) + (-5 + 4l + 5)(-4 - 2l + 4) + 2l2 + 2l*2 - 2l*2. 4l*2 Expand (1 + 2 - 4)(-6t4 - t4 + 3t*4) - 4511t*4 - 4418t*4 + 124t*3 + 132t*3 + 131t*3 - 387t*3. -8925t*4 Expand (-2 + 0 + 0)(-19m - 5m - 4m) + 516m - 440 + 440. 572m Expand v3 + 2v - 2v - 2v*3 + 4v3 + v3 + (-v*3 + 0v*3 + 2v*	{ "pile_set_name": "DM Mathematics" }
without replacement from yyyyjyjyajjjyyya. 1/24 What is prob of sequence je when two letters picked without replacement from jkkefnnkjjfjff? 2/91 Four letters picked without replacement from {w: 3, g: 4, h: 2}. Give prob of sequence hwww. 1/252 Two letters picked without replacement from ooo. What is prob of sequence oo? 1 What is prob of sequence ap when two letters picked without replacement from szszpaapjsazzossas? 4/153 Two letters picked without replacement from {q: 3, p: 17}. Give prob of sequence qp. 51/380 Calculate prob of sequence lcfl when four letters picked without replacement from {f: 1, l: 4, x: 1, c: 2}. 1/70 Calculate prob of sequence xz when two letters picked without replacement from {n: 1, x: 6, z: 8, v: 3}. 8/51 Four letters picked without replacement from {x: 2, l: 5, q: 3, i: 2}. What is prob of sequence ixqq? 1/495 Two letters picked without replacement from {h: 1, r: 1, k: 1, m: 3, j: 1}. What is prob of sequence hj? 1/42 Calculate prob of sequence lktk when four letters picked without replacement from lotkdtklktakldoo. 9/3640 Two letters picked without replacement from {k: 15, c: 3}. What is prob of sequence ck? 5/34 Two letters picked without replacement from {u: 1, g: 3, t: 6, o: 8}. What is prob of sequence og? 4/51 Calculate prob of sequence ibi when three letters picked without replacement from bbbbbiibbb. 1/45 Three letters picked without replacement from {u: 4, t: 1, s: 1, k: 1, y: 1}. What is prob of sequence ukt? 1/84 Three letters picked without replacement from ririii. What is prob of sequence iir? 1/5 Calculate prob of sequence iar when three letters picked without replacement from aoiaaaroa. 5/504 Calculate prob of sequence pw when two letters picked without replacement from npinpolpoiwppoo. 1/42 Two letters picked without replacement from dvxdxbsb. What is prob of sequence sv? 1/56 Two letters picked without replacement from {s: 6, n: 12}. Give prob of sequence ns. 4/17 What is prob of sequence zn when two letters picked without replacement from {e: 1, z: 5, g: 5, n: 5}? 5/48 What is prob of sequence xub when three letters picked without replacement from vxbrvbvvaxuxrxrxruvr? 1/342 Two letters picked without replacement from {g: 2, v: 1, i: 13, k: 1}. What is prob of sequence ii? 39/68 Two letters picked without replacement from nwnnonnln. What is prob of sequence nn? 5/12 Three letters picked without replacement from ybgaybbkylbbggyyy. What is prob of sequence yya? 1/136 Three letters picked without replacement from iwlwwlllllw. Give prob of sequence ilw. 4/165 Three letters picked without replacement from blzjzjjzbb. What is prob of sequence jlj? 1/120 Two letters picked without replacement from {g: 3, h: 13}. Give prob of sequence hg. 13/80 What is prob of sequence vkvv when four letters picked without replacement from {v: 6, k: 13}? 65/3876 Calculate prob of sequence ww when two letters picked without replacement from {w: 7, a: 6}. 7/26 Four letters picked without replacement from jtyyttytttyyytyyt. Give prob of sequence jyyy. 1/170 Calculate prob of sequence dk when two letters picked without replacement from {d: 1, w: 1, e: 5, n: 6, k: 2}. 1/105 Calculate prob of sequence ee when two letters picked without replacement from eee. 1 Two letters picked without replacement from zpzsnzzpzzspeezp. Give prob of sequence pn. 1/60 What is prob of sequence iid when three letters picked without replacement from {g: 6, d: 5, m: 1, i: 5}? 5/204 What is prob of sequence kl when two letters picked without replacement from oldovkdddodb? 1/132 Two letters picked without replacement from {b: 1, x: 2, q: 7, u: 1, g: 9}. What is prob of sequence bx? 1/190 Calculate prob of sequence cv when two letters picked without replacement from {v: 1, a: 1, c: 2}. 1/6 Two letters picked without replacement from prrrrpr. Give prob of sequence pr. 5/21 What is prob of sequence jy when two letters picked without replacement from jqqzqyqqjj? 1/30 Calculate prob of sequence dif when three letters picked without replacement from jqqdjfqiji. 1/360 Three letters picked without replacement from {a: 10, b: 7, f: 1}. Give prob of sequence aaa. 5/34 Calculate prob of sequence vtqf when four letters picked without replacement from {q: 2, f: 12, t: 2, v: 4}. 8/4845 Two letters picked without replacement from otetxkdxtekt. Give prob of sequence xk. 1/33 Two letters picked without replacement from {r: 3, o: 8, x: 3, j: 2, k: 1, b: 1}. What is prob of sequence jb? 1/153 Calculate prob of sequence yeym when four letters picked without replacement from {e: 2, i: 1, f: 3, y: 5, m: 1}. 1/297 What is prob of sequence mmfk when four letters picked without replacement from {k: 4, f: 1, m: 2}? 1/105 Calculate prob of sequence gm when two letters picked without replacement from {m: 8, g: 3}. 12/55 What is prob of sequence oiip when four letters picked without replacement from iuupodi? 1/420 Two letters picked without replacement from bbaaaaa. Give prob of sequence aa. 10/21 Calculate prob of sequence bb when two letters picked without replacement from {f: 2, b: 5, o: 7}. 10/91 Three letters picked without replacement from qccccccqcccccqcccc. What is prob of sequence qcq? 5/272 Two letters picked without replacement from ukllhkkuhkluuukhlhu. What is prob of sequence lh? 8/171 Two letters picked without replacement from {u: 1, k: 5, i: 5}. Give prob of sequence uk. 1/22 Calculate prob of sequence oaom when four letters picked without replacement from {s: 3, m: 5, o: 4, a: 5, u: 1}. 5/1224 Three letters picked without replacement from {l: 1, u: 1, e: 1, d: 2, n: 2}. Give prob of sequence nel. 1/105 Calculate prob of sequence jck when three letters picked without replacement from ccjcakkckjcckkkjaj. 1/34 What is prob of sequence ov when two letters picked without replacement from {o: 2, v: 1}? 1/3 What is prob of sequence ptst when four letters picked without replacement from pztzzpszpstpp? 1/858 What is prob of sequence bjjb when four letters picked without replacement from jbjjjjjjjjjjjjjjbjj? 1/171 What is prob of sequence tv when two letters picked without replacement from {e: 1, x: 1, t: 3, o: 1, v: 1}? 1/14 Three letters picked without replacement from eemoeceececemf. Give prob of sequence ocf. 1/728 Calculate prob of sequence gu when two letters picked without replacement from {l: 1, k: 2, u: 1, g: 1, i: 1, q: 1}. 1/42 Calculate prob of sequence jx when two letters picked without replacement from vvvjxmjjujmmjummmm. 5/306 Four letters picked without replacement from uuhhhuh. What is prob of sequence hhhh? 1/35 Two letters picked without replacement from {s: 8, o: 1, f: 4}. Give prob of sequence fs. 8/39 Calculate prob of sequence yyb when three letters picked without replacement from bbyybbbbbybbbbybbbbb. 8/285 Two letters picked without replacement from ytyyyttttt. Give prob of sequence ty. 4/15 Four letters picked without replacement from {b: 1, w: 3, u: 5, v: 5, p: 2}. Give prob of sequence vbuv. 5/2184 What is prob of sequence xl when two letters picked without replacement from xlbxtxxyy? 1/18 Calculate prob of sequence nt when two letters picked without replacement from twwn. 1/12 Calculate prob of sequence iziz when four letters picked without replacement from {z: 7, i: 5}. 7/99 Four letters picked without replacement from {x: 2, h: 5, g: 5, w: 3}. What is prob of sequence ggwh? 5/546 Calculate prob of sequence ll when two letters picked without replacement from {x: 1, l: 17}. 8/9 Four letters picked without replacement from llolvonvvlllvvlnl. What is prob of sequence novl? 1/357 Three letters picked without replacement from {e: 5, f: 4, u: 6}. What is prob of sequence ffu? 12/455 What is prob of sequence tepe when four letters picked without replacement from peptrppe? 1/210 Calculate prob of sequence ipo when three letters picked without replacement from {r: 6, p: 3, j: 2, m: 3, i: 1, o: 5}. 1/456 Two letters picked without replacement from {m: 9, v: 3, r: 5, a: 2}. What is prob of sequence mm? 4/19 What is prob of sequence oo when two letters picked without replacement from oooooooodddoooddoo? 26/51 Two letters picked without replacement from {f: 6, d: 3, q: 8}. Give prob of sequence df. 9/136 Calculate prob of sequence hle when three lette	{ "pile_set_name": "DM Mathematics" }
t x = 11.6 - 12. Sort x, -1, 3 in descending order. 3, x, -1 Let r = -2.5 - -0.5. Let s = -0.39 + 7.39. Put r, 0, s in increasing order. r, 0, s Let w = -11 + 16. Let j = -4.7 + w. Let v = j - 0.2. Put 4, 2, v in ascending order. v, 2, 4 Let z(h) = -2h2 + 13h. Let x(r) = -r*2 + 12r - 1. Let i(l) = -3x(l) + 2z(l). Let o be i(-10). Put -2, -3, o in ascending order. -3, -2, o Let h be (2/(-3))/((-4)/6). Let p = 22 + -23. Sort 5, h, p. p, h, 5 Let r = -0.2 - -0.2. Let g = -1 + r. Let w = 99 - 99.1. Sort -2, w, g in ascending order. -2, g, w Let g = -10 - -6. Let t be -3 + (3 + 27)/2. Suppose 0 = -3r - r - t. Put r, g, 3 in decreasing order. 3, r, g Let p be -1 - (2 + 1 - -1). Let m = -30 - -34. Sort m, -3, p. p, -3, m Let o = 22 - 7. Let t be 12/o + (-3)/(-15). Let m be (-1 - -3)4/(-2). Put m, t, -5 in descending order. t, m, -5 Let q = -6 + 0. Let k = 10 + q. Let m be (1 - 0) + 22. Sort k, 1, m in decreasing order. m, k, 1 Let m be 20/15(-6)/(-4). Suppose -3v = g - 16, -g + mv = 7v - 26. Put -2, g, 2 in ascending order. -2, g, 2 Let j be (-4)/(8/((-8)/(-2))). Sort j, 3, 0. j, 0, 3 Let y = 13/3 - 4. Let d = 0.9 - 0.5. Put d, y, -2 in descending order. d, y, -2 Let g(c) = c2 + 7c + 2. Let b be g(-7). Suppose 0 = -bx + 2 + 8. Sort x, 4, 1 in descending order. x, 4, 1 Suppose -3z = -6z - 2g - 3, 0 = -z + 4g - 1. Suppose -3j + 12 = -7j. Put z, 4, j in decreasing order. 4, z, j Let d(i) = -2i - 3. Let k be d(-2). Let x be (3/3)/((-7)/21). Let l be 3 + -2 - 4 - x. Sort 3, k, l. l, k, 3 Let m = 17 + -18. Put m, -3, 0 in descending order. 0, m, -3 Suppose -5v + 20 = 5. Sort 4, -2, v in decreasing order. 4, v, -2 Let x(a) = -a2 + 4a - 5. Let i be x(4). Let n = i + 9. Let d be (-1 + 0 - -4)-1. Sort n, d, 2. d, 2, n Let p = 37/93 + -2/31. Sort -2/11, 1, 4, p in increasing order. -2/11, p, 1, 4 Let h(y) = -y3 + 4y*2 - 2y. Let q be h(3). Put -8, 0, q in decreasing order. q, 0, -8 Suppose -5x - 105 + 15 = 0. Sort 1, 0, x in ascending order. x, 0, 1 Let g(i) = -i + 3. Let k(z) = z2 - z + 4. Let p be k(0). Let f be g(p). Let x(v) = -v3 + 4v*2 - 2v + 5. Let u be x(4). Put u, f, -5 in increasing order. -5, u, f Let k = -0.2 + 1.2. Let g = 0 - k. Let w = g + 0.7. Sort -5, w, 0.5 in increasing order. -5, w, 0.5 Suppose -s - 8 = 3s, 0 = 3w - 3s - 9. Put w, 0, 4, -1 in descending order. 4, w, 0, -1 Suppose 1 - 5 = -4i - 2q, -i = -q - 4. Suppose b - 4u - 9 = 0, 5b + 3u + 18 = 2b. Sort -1, b, i in decreasing order. i, -1, b Let o = -0.2 + -2.8. Let v = -5/98 - -61/98. Sort o, -0.8, v in decreasing order. v, -0.8, o Suppose c + 4n = -2c - 26, -3c - n - 11 = 0. Let x = -6 - -3. Put 5, c, x in decreasing order. 5, c, x Let q = -0.06 + 0.46. Let r = 6.6 - 6. Let v = 0.1 - r. Sort q, v, -3 in increasing order. -3, v, q Let h be 3 + 1 + -3 + 3. Suppose -5t - 5 = 0, -hu - t = -2u - 3. Put u, 3, -2/7 in descending order. 3, u, -2/7 Let z(y) = y + 2. Let m be z(10). Suppose 18 + m = 2s. Let f be (-2)/4(-10)/s. Sort f, -1/4, 3 in decreasing order. 3, f, -1/4 Suppose 5c = -p + 10, -4c = -2p + 3p - 9. Sort 0, -4, c in decreasing order. c, 0, -4 Let c = -2.4 + -0.6. Let x = -2 + c. Sort -0.1, x, 0.5 in increasing order. x, -0.1, 0.5 Let f(t) = -t2 + t + 2. Suppose 3u - 4u = 0. Let z be f(u). Sort z, -4, 0. -4, 0, z Let t = -0.6 + 0.3. Let y be 5/340/100. Put t, -0.5, y in increasing order. -0.5, t, y Suppose -8 = -5p - 48. Let o = -4 - p. Sort -5, o, 5. -5, o, 5 Suppose -3y = y + 3m - 14, 3y - m - 4 = 0. Let q be ((-4)/30)/(y/6). Let d be 1 + 1 - (-2)/(-1). Put q, 2/5, d in decreasing order. 2/5, d, q Let r be (0/(-2))/(-3) + -4. Sort -2/9, 2/3, r in decreasing order. 2/3, -2/9, r Suppose 3r = -4f + 35, 9 = 3r + 3f - 21. Suppose 0k - 15 = rk, -m = k + 6. Suppose 4s + 1 - 13 = 0. Put s, m, 5 in increasing order. m, s, 5 Suppose -2p + 4f = p + 35, 5f = -5p. Sort 10, p, -4 in decreasing order. 10, -4, p Let a be 81/(-24) + (-9)/(-24). Let k = -3 + 6. Put -4, k, a in decreasing order. k, a, -4 Let h = 0.98 - -0.02. Let x = h + 0. Sort x, 0.1, 0.3 in ascending order. 0.1, 0.3, x Let f be 6/96/(-5). Let p be -1(-48)/(-45)3. Let a = p - -47/10. Sort f, a, 1/4. f, 1/4, a Let m = 0.24 - 2.24. Put -2/3, -3, m in descending order. -2/3, m, -3 Let t be (12/(-70))/((-3)/5). Put t, -4, -1/6 in descending order. t, -1/6, -4 Let f be (-22)/5 + (-6)/(-15). Let o be (f + 6 + -2)/2. Put -2, o, -2/5 in decreasing order. o, -2/5, -2 Let x = -2.6 + 2.1. Put 0, 5, x in descending order. 5, 0, x Let h(v) = v*3 - 10v*2 + v - 12. Let r be h(10). Suppose -2o = -5y, -2y = o - 3 - 6. Suppose -2g = 3g + o. Put g, 1, r in decreasing order. 1, g, r Let k = 24 + -28. Put -5, k, -1, -3 in increasing order. -5, k, -3, -1 Suppose v - 18 = 4c + 3, -5c - v = 24. Let u(d) = d*3 - 5d*2 - 6d + 5. Let m be u(6). Sort -3, c, m in ascending order. c, -3, m Suppose 4y + 2x + 3x = -10, -2y + 4 = -2x. Suppose 0 = 2c - c - 2. Sort y, c, 5 in ascending order. y, c, 5 Let w be 4/(-6) - (-2)/(-6). Suppose 0 = -4o - 12, -5o - 6 + 3 = 2c. Put -5, c, w in decreasing order. c, w, -5 Let n = -11 - -8. Sort n, 10, -0.4. n, -0.4, 10 Let c = -6.2 + 6. Sort -0.1, c, -5. -5, c, -0.1 Suppose -7y = -3y + 56. Let k be y/(-35) - 26/(-10). Let t be (-3)/(-2 + 3) + k. Put t, -5, 1 in decreasing order. 1, t, -5 Let r be (4/5)/(((-36)/15)/4). Sort 0.1, r, -12, 0.4. -12, r, 0.1, 0.4 Let v = -5.71 - -6. Let l = 0.01 + v. Sort -5, l, -0.5 in increasing order. -5, -0.5, l Suppose -2s = s - 12. Let h be -1 - 1 - 8/s. Suppose 6 = -3w - 0, 0 = 2a - 5w - 8. Put -2, a, h in decreasing order. a, -2, h Suppose -30r = -27r - 15. Suppose -8 = -0s - 4s. Sort r, s, 0 in descending order. r, s, 0 Suppose y = -4f - 4y + 20, -3y + 12 = 5f. Suppose 3h - 12 = f, -5r - 4h + 15 = -9h. Put r, 2, 3 in decreasing order. r, 3, 2 Let u(j) be the third derivative of j4/24 - j3/3 - 3j*2. Let s be u(5). Suppose 0 = -3o + 12 - s. Put 4, o, -1 in increasing order. -1, o, 4 Let v = 156 - 159. Sort v, 1/15, -5/3 in decreasing order. 1/15, -5/3, v Let a = 172 + -167. Sort 2/13, a, 3/2 in decreasing order. a, 3/2, 2/13 Suppose -3s + 33 = -6s. Let b = 13 + s. Put b, 4, 1 in decreasing order. 4, b, 1 Suppose 0 = 4o - 2m + 9 + 1, 5m - 25 = 0. Let q = 8 + -5. Put o, -4, q in ascending order. -4, o, q Let f = -4 - -22/5. Sort 1/2, f, -5 in decreasing order. 1/2, f, -5 Let g(k) = k2 - 1. Let a be g(1). Sort a, -1/4, 3/2, 5 in ascending order. -1/4, a, 3/2, 5 Let p = -0.6 + -12.4. Let g = p - -10. Put g, -6/5, -2/11 in descending order. -2/11, -6/5, g Let y(a) = -2a + 12. Let d be y(5). Suppose 3t = -7 - 5. Let z(m) = m2 - 5m - 6. Let r be z(6). Sort d, t, r in ascending order. t, r, d Let h(c) = -c. Let o be h(-6). Suppose -n + o = 2n. Sort -2/7, n, 1/5 in decreasing order. n, 1/5, -2/7 Let y(x) = -4x - 4. Let q be y(-6). Suppose -q = -m + 5a, 5m - a - 1 = 3. Put 0.3, m, 3/7 in decreasing order. 3/7, 0.3, m Suppose -4c + 10 + 10 = 0. Let t = -4.9 + -0.1. Put c, 3, t in ascending order. t, 3, c Let v = -2 + 4. Let l = v - 4. Let g be 0/(2 - -1) + 2. Put g, 1, l in ascending order. l, 1, g Let j = -43.6 - -44. Sort 0.3, j, -1.4 in ascending order. -1.4, 0.3, j Suppose o - 2o + 1 = 0. Suppose 0 = 4r - 4w - 56, 2w + 2w = -20. Suppose 0 = 6h - h + 2i + 21, -2h - r = i. Sort h, o, 2 in decreasing order. 2, o, h Let y(z) = -3z - 3. Let r be y(-3). Let f = -8 + r. Suppose -4b - 4s = -16, b = 4s + 8 + 1. Sort f, -3, b in ascending order. -3, f, b Let o be 9/(-4) - 23/(-92). Sort o, -28, 5, 2 in descending order. 5, 2, o, -28 Let y = 5 - 21. Let s = y + 12. Sort -3, s, 5 in descending order. 5, -3, s Suppose 3h = 5l - 0l, 4l - 5h = 0. Suppose l = 2y - 3r + 6 + 9, -y + 3 = 2r. Let c = 3 + -2. Sort y, -1, c in decreasing order. c, -1, y Suppose -9z - 8 = -5z. Sort z, -4, 2 in decreasing order. 2, z, -4 Let l(p) = -p2 + 6p - 4. Let m be l(4). Sort 5, m, -3 in increasing order. -3, m, 5 Let p(d) = -d + 11. Let y be p(8). Suppose -yx - 8 = -x. Suppose 0 = 2g - 5g. Sort x, 2, g in decreasing order. 2, g, x Let z = -32 + 16. Let j = 15 + z. Sort -0.5, j, 1/3 in increasing order. j, -0.5, 1/3 Let h be (-3 - -2)1*0. Suppose -1	{ "pile_set_name": "DM Mathematics" }
first derivative of -2z3/3 + 1. Determine j(g(p)). -50p*2 Let g(r) = 1 - 4r + 0r2 - r2 + 3. Let p(m) = -153 + 68 + 0m*2 + 3m*2 + 74 + 11m. Let o(i) = -11g(i) - 4p(i). Let b(j) = 11j2. Determine o(b(k)). -121k4 Let i(l) = -l2. Let s(t) = 654t - 10. What is s(i(u))? -654u*2 - 10 Let o(i) = 3860i*2. Let r(d) = -21d. What is o(r(t))? 1702260t2 Let r(z) = -3z2. Let j(f) = f3 - 14f2 + 14f - 2. Let l be j(13). Let h = l - 9. Let x(u) = hu2 - u2 - u2 + 8u*2. Give r(x(s)). -192s*4 Let v(u) = -10u. Let g(h) = 5h. Let b(s) = 7g(s) + 3v(s). Let l(t) = 10t*2. Give l(b(r)). 250r*2 Let w(p) = 16p*2. Let z(i) = -2i*2 + 22i. Let c(l) = -l. Let n(r) = -44c(r) - 2z(r). Calculate n(w(s)). 1024s4 Let i(t) = -7t*2 + 4t. Let w(d) = 5d2 + 913d - 913d. What is w(i(p))? 245p*4 - 280p*3 + 80p*2 Let k(g) = 7g2. Let v(a) = 2. Let r(t) = -t2 + 1. Let q(y) = -2r(y) + v(y). What is k(q(w))? 28w*4 Let m(w) = -4w. Let v(x) = -9543x. Give m(v(j)). 38172j Let g(v) be the second derivative of -9v3/2 - v2 - 21v. Let f(u) = -1. Let b(x) = 2f(x) - g(x). Let r(n) = n2. Calculate r(b(c)). 729c*2 Let n(h) = 1447 - h - 1447. Let c(l) = 52l*2. Determine n(c(z)). -52z*2 Let x(i) = -42i. Let j(w) be the third derivative of w*4/8 - 7w*3/6 - 23w*2. Let n(f) = -2f + 4. Let s(p) = 4j(p) + 7n(p). Give x(s(g)). 84g Let r(u) = 22u. Let x(p) be the third derivative of -5p4/3 + 605p*2. Give r(x(o)). -880o Let x(n) = 55n2. Let m(j) = -219 - 2j + 219. What is m(x(v))? -110v2 Let q(f) = 9f - 4. Let o(h) = -1. Let v(a) = 4o(a) - q(a). Let t(s) = -21s*2 + 82s*2 - 22s*2 - 19s*2 - 21s*2. Calculate v(t(y)). 9y*2 Let x(b) = -4b. Let l(k) be the first derivative of -11 - 52k2 + 29k*2 + 25k*2. What is x(l(h))? -16h Let p(r) = 15r2. Let w(k) be the first derivative of -7k*2 + 5. Determine w(p(a)). -210a*2 Let g(k) = -4k - 6. Let s(l) = -2379l. Determine s(g(o)). 9516o + 14274 Let f be (-2)/(-6) - (-70)/15. Suppose -f = 2g + 3h, 3h - 19 = 3g - 49. Let y(d) = 4d2 - gd*2 - 6d*2. Let m(u) = 4u. Give m(y(l)). -28l2 Let g(j) = -8j2. Let o(d) = -d3 - d*2 + d. Let s be o(-2). Suppose sa - 4a + 10 = 0. Let m(y) = ay - 2y + 0y - y. Give m(g(c)). -16c2 Let p(y) = 2y. Let k(o) = -2o2 - 34o - 446. What is k(p(n))? -8n2 - 68n - 446 Let s(l) = 2l. Let p(g) = 524383g. Calculate s(p(o)). 1048766o Let g(m) = -3m. Let t(n) = -26591n. What is g(t(v))? 79773v Let y = -9 + 16. Let n(q) = 11q2. Let l(f) = -6f*2. Let r(i) = yl(i) + 4n(i). Let s(u) = 6u - 6u - 3u*2. What is r(s(d))? 18d*4 Let j(g) = -2g*2. Let r(s) = -2s - 3. Let h be r(-2). Let o = -7 - -2. Let m(t) = t - 1. Let k(b) = -3b - 5. Let v(w) = hk(w) + om(w). Calculate v(j(a)). 16a*2 Let m(c) = 2c. Let d(o) = 4o2 + 10. Let s(x) = x2 + 1. Let t = -48 - -18. Let v(k) = ts(k) + 3d(k). Give m(v(w)). -36w*2 Let b(c) = -15c2. Let v(h) be the second derivative of -h4/12 - 2h + 119. Give v(b(d)). -225d*4 Let v(n) = 8n*2. Let i(y) = -4y*2 + y + 1. Let d(w) = -34w*2 + 8w + 8. Let m(b) = -d(b) + 8i(b). Give v(m(z)). 32z*4 Let v(c) = 3c. Let k(h) = -210h2 - 2h - 72. Calculate v(k(d)). -630d2 - 6d - 216 Let a(j) = 68j - 1. Let q(h) = -h2 - 54h. Calculate a(q(k)). -68k2 - 3672k - 1 Let c(p) be the second derivative of -4p3/3 + 521p. Let a(f) = -45f. Give a(c(g)). 360g Let s(t) = 2t2. Let y(c) = 27c - 15c - 13c. Let n(i) = 78i. Let m(p) = 2n(p) + 130y(p). Determine s(m(o)). 1352o*2 Let r(d) = 5d. Let s = -4 + 6. Let n(i) = -i*2 + 3i*2 + 0is. Let h(m) = m2. Let p(z) = 3h(z) - n(z). What is p(r(y))? 25y*2 Let p(a) = 2a. Suppose 0 = -3c - 2w + w + 31, 35 = 3c - w. Let h = -4 + c. Let u(b) = 2b - b + 2b - hb. What is u(p(s))? -8s Let t(o) = -5o*2. Let m(v) = -342 + 662 + 3v - 331. What is m(t(j))? -15j2 - 11 Let a(c) = 2c. Let l(y) = 2527y - 7. Calculate l(a(k)). 5054k - 7 Let v(b) = 3b2. Let y(f) = 64274f. Give v(y(z)). 12393441228z2 Let f(p) = -p2 - 3p + 2517. Let b(t) = 2t2. Give f(b(d)). -4d*4 - 6d*2 + 2517 Let l(k) be the first derivative of -2/3k*3 + 30 + 0k*2 + 0k. Let d(s) = 12s2. Calculate d(l(b)). 48b*4 Let y be (-43)/(-3) + 14/21. Let r(b) = -204 - 8b*2 + 204 - 2b - yb2. Let m(i) = 2i*2. Give m(r(w)). 1058w*4 + 184w*3 + 8w*2 Let o(y) = 3y + 14958. Let z(k) = -2k2. Determine o(z(x)). -6x*2 + 14958 Let j(c) be the first derivative of 2c*4/3 + 7c + 8. Let a(r) be the first derivative of j(r). Let i(u) = u. Give i(a(w)). 8w2 Let n(d) = -13d. Let r(g) = 318g2. What is n(r(m))? -4134m*2 Let f(l) = -3l*2 + 41l. Let i(o) = -6o - 4. Determine i(f(s)). 18s*2 - 246s - 4 Let f(q) = 4027566q. Let y(o) = -o2. Determine y(f(b)). -16221287884356b*2 Let g(q) = 361 - 31q - 719 + 357. Let b(n) = 5n2. Calculate g(b(h)). -155h2 - 1 Let w(z) = -z2 - 1. Let k(c) = -12c2 - 5. Let j(a) = a3 + 5a*2 + a - 13. Let i be j(-4). Let x(g) = ik(g) + 5w(g). Let r(v) = -3v. What is x(r(b))? 63b2 Let d(v) be the third derivative of -11v*4/24 + 2v*3/3 + 7v2. Let c(h) = h2. Give c(d(k)). 121k2 - 88k + 16 Let q(r) be the first derivative of 0r - 1/2r*2 - 9. Let b(v) = -11v*2 + 5. Let y(u) = 27u*2 - 12. Let i(k) = -12b(k) - 5y(k). Calculate i(q(j)). -3j*2 Let m(x) = 6x*2 + 0 + 19x2 + 1. Let k(c) be the second derivative of c4/6 - 2c + 111. Give m(k(u)). 100u*4 + 1 Let j(g) = -2 + 2 - g. Let x(o) = 11o*2. Determine x(j(i)). 11i*2 Let a(w) = 3w. Let y(n) = n*2 + 4n. Let x(l) = -104l2 - 20l. Let v(q) = x(q) + 5y(q). Calculate v(a(r)). -891r*2 Let h(o) = -2o*2. Let b(l) = -8l - l - 38l + 5l. Give b(h(z)). 84z2 Let g(l) = -20l. Let y(h) = h*2 - 42. Let b(f) = 3f*2 - 84. Let x(t) = 3b(t) - 7y(t). Let n(d) be the first derivative of x(d). What is g(n(k))? -80k Let p(n) = 4n2. Let l be 7(30/14 - 3). Let y be (-9)/l96/9. Let x(m) = 5m*2 + 10m*2 - ym*2. What is x(p(c))? -16c*4 Let z(l) = -10l. Let s be (-6)/27 - 6/81-57. Let h(p) = 2p*2 - 3p. Let w(d) = -2d2 + 4d. Let n(o) = sh(o) + 3w(o). Give z(n(c)). -20c2 Let a(x) = -x - 1019 + 1019. Let j(g) = -3g*2 + 3g. Let h(n) = -16n2 + 14n. Let m(f) = -3h(f) + 14j(f). Calculate m(a(k)). 6k2 Let n(y) = 12y*2 - 8y. Let h(c) = c*2 - c. Let p(g) = -8h(g) + n(g). Let r(o) = -3o2. Calculate p(r(j)). 36j*4 Let c(x) = 5x. Let t be 9 + -9 - 1-4. Let a(n) = -tn*2 - 99n + 99n. What is c(a(z))? -20z*2 Let k(i) = 277i - 23. Let j(z) = -7z. Give j(k(v)). -1939v + 161 Let x(v) = -8v. Let a(b) be the third derivative of -b5/30 + 20b*3/3 + 333b*2. Determine a(x(w)). -128w*2 + 40 Let f(i) = 212779i*2. Let u(n) = n. Give f(u(q)). 212779q*2 Let a(c) = c. Let x(i) = 6i*2 - 4i + 4. Let z(k) = -11k2 + 9k - 9. Let l = -25 - -11. Let w = -5 - l. Let u(f) = wx(f) + 4z(f). Determine u(a(h)). 10h2 Let c(z) = -9z*2. Let u(p) = -p - 725. Calculate c(u(j)). -9j*2 - 13050j - 4730625 Let s(z) = -7z2. Let x(k) = -159669k*2. Calculate s(x(w)). -178459326927w*4 Let f(d) = 181d. Let p(n) = -32n. Let j(r) = 6f(r) + 34p(r). Let c(q) = 369q. What is c(j(a))? -738a Let u(m) be the second derivative of 73/6m*3 + 0m*2 + 2 + 7m. Let s(y) = y. Give s(u(f)). 73f Let z(m) = -7m*2. Suppose 0 = 4g + 4, 4g = -4k + 27 - 3. Let a(h) = -5h + kh - 4h. Determine a(z(r)). 14r2 Let y(l) be the first derivative of -l3 + 2. Let f(w) = -6w2 - 2w*2 + 19w*2. Determine f(y(s)). 99s*4 Let v(l) = 2l2. Let b(r) be the third derivative of -r4/12 + r*3/3 - 19r2. Let d(c) = -c2 - 3c + 3. Let q(w) = 3b(w) - 2d(w). Calculate q(v(x)). 8x*4 Let w(m) = -841m*2. Let u(h) = -h. Determine u(w(p)). 841p*2 Let w(g) = 258g*2. Let n(q) = -2q + 157 - 320 + 163. Determine w(n(h)). 1032h2 Let t(y) be the first derivative of -2y4/3 - y3/3 + 7y2 + 17. Let q(h) be the second derivative of t(h). Let k(r) = 2r. Calculate k(q(n)). -32n - 4 Let z(q) = -4 + 4 - 3q*2. Let u(p) be the third derivative of -3p4/8 + p2 - 108*p. Deter	{ "pile_set_name": "DM Mathematics" }
be (49/(-2) - 2)-12. Suppose -14l + 16l - 266 = 0. Let i = t - l. Is i composite? True Let w(y) = 100y*2 + 43y - 8. Is w(-13) a prime number? True Suppose 2a = -2w - 0w + 16106, -3a = -4w - 24131. Is a composite? True Suppose -3r + 2m = -2m + 68, 0 = -3r + m - 53. Let x = -11 - r. Suppose 97 = xb - 238. Is b a composite number? False Is 3134((-33)/2)/(-3) a composite number? True Let m(r) = 5r*2 + 7r - 9. Is m(-13) composite? True Let z = 87 + -142. Let s = z - -254. Is s a prime number? True Let s = -27 - -20. Is s/(-2)(-1464)/(-42) a prime number? False Let y(k) = -24282k3 - k2 + 7k + 7. Is y(-1) prime? True Let z(b) = -b3 - 25b*2 - 21b - 299. Is z(-30) composite? False Let y = -14 - -14. Suppose -a = y, 3j = -0j + 3a + 318. Is j composite? True Suppose 2n - 1325 = -c, 1317 = c + 6n - 2n. Is c prime? False Is 180/(-60)(-19157)/3 composite? False Let f(o) = 107o + 10. Let b = -1 + 4. Is f(b) composite? False Let v(b) = 26b2 - 8b - 7. Let a be v(-6). Suppose a = 3i - 1462. Is i composite? True Let g = 13 - 18. Let k be 22/8 + g/(-20). Suppose -5b - s = s - 339, ks - 6 = 0. Is b a composite number? False Let t = 1057 + -48. Is t a prime number? True Suppose 3n = -5a + 213, 8a = 7a - 5n + 25. Let v be (-83)/(-1) - 1/1. Let d = v + a. Is d a composite number? False Let k be (-22)/(-99) - (-2 + (-3146)/18). Let c(r) = r*2 - r. Let z be c(2). Suppose -k + 11 = -zi. Is i a prime number? True Let s = 40 + -36. Suppose 7z - s = 17. Is z a prime number? True Let r = -2063 - -1301. Let f = -199 - r. Is f a composite number? False Suppose -16 = -3i - 2i + s, 0 = 2s + 2. Suppose w + 2 = -id, -2d + 2w = 2d - 14. Is d - -78 - (-4 + 6) a composite number? True Let u(d) = -450d3 - 2d*2 - 2d - 1. Let r be u(-1). Let f = -156 + r. Is f a composite number? False Suppose -2k + 1008 = -4562. Is k a composite number? True Let r(p) = 1997p + 293. Is r(12) a prime number? False Suppose -5n + 4z + 4007 = 0, 3n - 20 - 2393 = -2z. Is n a composite number? True Suppose 5n = 2y + 10903, 524 + 1659 = n - y. Is n a composite number? False Let d(t) = -41t + 7. Let u be ((-4)/(-5))/(4/(-10)). Is d(u) composite? False Suppose 9 = -4k - 7. Is (k/(-12))/(-22/(-2388)) a composite number? False Let r(h) = -h3 + 22h*2 + 32h + 6. Let d(w) = 5w3 - 87w*2 - 129w - 23. Let u(y) = 2d(y) + 9r(y). Is u(-21) a composite number? False Suppose -6f + 80f = 1344358. Is f a composite number? True Let c(o) = 448o + 14. Let k(y) = 448y + 15. Let r(n) = -2c(n) + 3k(n). Is r(3) a composite number? False Let l(a) = 39a2 - 9a - 2. Let v be l(-7). Suppose 568 + v = 5w. Is w(-3)/24-2 a composite number? False Suppose -23b + 183370 = -342709. Is b prime? False Let n = 9920 + 6159. Is n a prime number? False Suppose 2f - 3f = -4. Suppose -11 = -fb - 2t + t, 0 = 3b + 5t - 21. Suppose -2i = -i + bs - 71, 3i + 4s = 213. Is i composite? False Suppose 0 = -1034j + 1028j + 18. Suppose -3v + 36 - 9 = 0. Is (347/j)/(3/v) a composite number? False Suppose -2p + g = 3p - 12307, 0 = -4g + 12. Is p prime? False Suppose 2715 = c + 3r, 21c - 13599 = 16c - 3r. Is c a composite number? True Is ((-96)/(-18))/(-8) + (-56938)/(-6) composite? True Let x(b) be the second derivative of 13b3/6 + 5b*2 + 38b. Is x(13) a composite number? False Let x(n) = n*3 - 6n*2 - n + 3. Let l(f) = -2f*2 - 9f + 2. Let i be l(-4). Let j be x(i). Is (-3)/((-2)/(-44)j) composite? True Is (7 + (-120438)/12)/((-1)/2) prime? False Let c be (30/4)/(-5)-2. Suppose 321 - 54 = cv. Suppose -5r = -v - 246. Is r a composite number? False Let y = 828 - -259. Is y a composite number? False Let d(o) = o*2 + 2o + 2521. Let n(a) = a*3 - 4a*2. Let w be n(4). Is d(w) composite? False Suppose -7 = 4w + 9. Is -10 + (-57)/(-6) - 6526/w a composite number? True Let h = 6746 + -3655. Is h composite? True Let f(c) be the second derivative of 88c3/3 - 7c*2/2 + 13c. Is f(6) a composite number? False Let m(x) = x*3 - 6x*2 + 3x + 3. Let w be m(4). Let h(u) = -4u - 21. Is h(w) composite? False Suppose -7d + 119451 = 3z - 11d, 0 = -2z + d + 79639. Is z a prime number? True Suppose 0 = 4d - 16 - 4. Let n(z) = 23z2 - 2z + 7. Let v be n(d). Suppose 0 = 5f - f - v. Is f a composite number? True Let s(o) = 11o*2 + 6o + 4o2 - 103 + 102. Is s(10) a composite number? False Let y(v) = -v - 8 + 8 - 23v*2 - 150v*2. Let z be y(2). Let m = -483 - z. Is m prime? True Suppose 0 = 3n + 1 - 16. Suppose -nq = -11q + 1482. Is q prime? False Suppose -9g = -1977 + 231. Is g prime? False Let b(z) = 2223z*2 - z + 13. Is b(3) a composite number? True Is ((-2)/16-4820)/(1/2) composite? True Suppose 232 = -4k - 460. Let s = -250 - k. Is (1 + -4)/3s a prime number? False Let k(h) = h - 3. Let f be k(-5). Let i(y) = -y*2 - 13y - 10. Let b be i(f). Is 6345/b - (-1)/(-2) a prime number? True Let k = -7 + 12. Suppose -3b + 2y + 48 = -20, -4y - 114 = -kb. Is b composite? True Suppose -5i + 2i = 8841. Let r = -378 - i. Suppose 543 + r = 8v. Is v a prime number? True Let o = 21653 + -9352. Is o a composite number? False Suppose -2s + 10 = 0, 3n + 2n + 2s + 90 = 0. Let o = 23 + n. Suppose of - 761 = 2u, 4 = -u - 0. Is f a composite number? False Let l(v) = 55v*3 + v. Let b be l(1). Is -5 + (-6)/(-3) + b a composite number? False Suppose -7a = -10a + 30. Let w(o) = 19 - a - 2o + 7 + 5o2 + 8o. Is w(-7) a prime number? False Let z(o) = 11o2 + 14o - 3. Let w be z(-6). Let h = w - 50. Is h prime? False Let m = 133 - 286. Let r(z) = -7z2 + 7z + 2. Let f be r(-6). Let w = m - f. Is w a prime number? True Let h = -2247 - -8828. Is h a composite number? False Let v(p) = -p3 + p2 - 2p + 5. Let g be v(0). Suppose 5d - 7w = -3w + 2337, -w - 2343 = -gd. Is d a prime number? False Let r = 4 - 2. Let s = 114 + -124. Is 14/s(-10)/r a composite number? False Suppose 0 = 3j + 2m - 7819, j + 5m = -0j + 2615. Is j prime? False Let x(g) = -g*2 - g + 2. Let p be x(-3). Let v be (8/(-5))/(p/10). Suppose -r - 2t + 475 = 0, 3r - vt - 926 = r. Is r composite? True Suppose 4 = 3a + 1. Let j(w) = -264w*3 - 2w*2 - 2w + 5. Let r(t) = -265t3 - 3t*2 - 2t + 6. Let y(h) = -5j(h) + 4r(h). Is y(a) composite? True Let b(q) = -q*3 + 69q*2 + 31q + 40. Is b(45) composite? True Suppose 0 = -2x + a + 60483, 0 = x + 3a - 1735 - 28489. Is x a prime number? False Suppose 9393 = b + 3324. Suppose n = -5r + 10283 + b, 3259 = r + 4n. Is r composite? False Let x = 1599 - -2758. Is x a prime number? True Let w = 55 + -57. Let j(c) = -1167c - 5. Is j(w) composite? True Suppose 8b + 41 = 201. Let t = b - 7. Is t composite? False Suppose -5o + 2o = 0. Suppose 942 = 2h - oh. Is h composite? True Is (-6)/21 + 1168475/245 composite? True Is (-708)/(-30) + 9/(-15) composite? False Let i(t) = -3t3 + 7t*2 - 5t + 27. Is i(-20) prime? True Let x(y) = 5y + 6. Let v be x(-1). Is ((-3)/12)/(10527/(-10524) + v) a prime number? True Suppose 3p + 13j - 50909 = 9j, -16973 = -p - 2j. Is p a composite number? False Let m(q) = 21775q - 642. Is m(5) composite? False Suppose 5 + 10 = 3q. Suppose -5p - 4y - 424 = -p, -qy = -4p - 442. Let i = p - -159. Is i a prime number? False Let y(b) = -27b - 4. Let x(t) = -t*3 - 11t*2 - 10t - 2. Let w be x(-10). Let o be ((-20)/(-30))/(w/21). Is y(o) prime? False Let s = 3247 + -654. Suppose -2t + 7t + 3210 = 5z, t = -4z + s. Is z composite? False Let b(t) = 2t2 + t2 - t + 5t*3 - 2564 + 2562. Is b(3) a composite number? False Suppose -3s = -2s - 3. Suppose -4p + 949 = -sp. Is p a prime number? False Is 1 - -10 - (-1270566)/31 a prime number? False Suppose -2y = -4y + 4682. Let v = y - 1017. Is ((-2)/2)/((-4)/v) a prime number? True Let o be (-1 - -167)15/10. Suppose -t - 2t = -o. Is t a composite number? False Let v be ((-30)/4)/(1/2). Let r be (-4)/(-6) + (-2 - 8/(-6)). Is v(r + 71/(-3)) a prime number? False Is (-1 - -39823)(-13)/(-78) a prime number? True Suppose 11c = 6c + 10. Is (-684 - (1 - c))1/(-1) a prime number? True Is ((-85)/(-17))/((-2)/(-622)) a composite number? True Let u(j) be the first derivative of 222j*2 + j -	{ "pile_set_name": "DM Mathematics" }
ine cd(k) + 5b(k). k*3 - 42 Let c(v) = -5v3 + v2 - 2v + 2. Let u(j) = -26j*3 + 5j*2 - 11j + 10. Let k be ((-11)/11)/((-1)/(-28)-2) - 3. Determine kc(g) - 2u(g). -3g3 + g2 + 2 Suppose -t - 3b - 35 = -59, 2b = 3t + 27. Let s(u) = 2u + 1 + 4u - 5u. Let m(f) = -1. Give tm(n) - s(n). -n + 2 Let f(o) = -10o - 6. Let i(b) = -49b - 217. Let r(n) = 12n + 49. Let k(z) = 2i(z) + 9r(z). Determine -6f(m) - 5k(m). 10m + 1 Suppose 92p - 88p + 6t + 132 = 0, 4p + 5t + 112 = 0. Let u(v) = v - 1. Let a(i) be the first derivative of -4i2 + 8i - 1. What is pa(b) - 21u(b)? 3b - 3 Let z(l) = 8l*3 + 5l*2 + 3l. Let x(v) = v3 + v2 + v. Suppose 166 = -5b - 19. Let d = b + 38. Calculate dz(a) - 5x(a). 3a*3 - 2a Let o(g) = 34 + 2650g - 2658g - 33. Let r(q) = 9q - 1. Give -6o(s) - 4r(s). 12s - 2 Let b(c) = -2c + 2 + 1 + 9c - 6. Let g(t) = -8t + 93t - 40t - 11t - 14. Determine 28b(i) - 6g(i). -8i Let y(q) = -116q + 19. Let v(o) = 231o - 43. Calculate -2v(j) - 5y(j). 118j - 9 Let r(m) = -57m + 1. Let o(q) = -36q + 2 - 19q + 36q - 2. Give -7o(f) + 2r(f). 19f + 2 Let t(d) = -2d*2 - 54d - 9. Let w(x) = -4x2 - 111x - 16. What is -5t(z) + 2w(z)? 2z2 + 48z + 13 Suppose 236u + 100 - 65 = -201. Let k(c) = 1. Let y(f) = 4f - 9. Calculate uy(i) - 5k(i). -4i + 4 Let u(i) = -2i*2 + 2i + 2. Let m(d) = 25d2 - 35d - 11. Calculate -m(n) - 6u(n). -13n*2 + 23n - 1 Let s(r) = 2r2 + 6r + 30. Let t(j) = 9j2 + 23j + 120. Calculate -15s(m) + 4t(m). 6m2 + 2m + 30 Let i(r) = 1051479r2 - 1677r - 3354. Let n(t) = 5015t2 - 8t - 16. Calculate -8i(h) + 1677n(h). -1677h2 Let w(f) = -f2 + 45. Let j(a) = -7a*2 - 2a + 386. Give j(i) - 5w(i). -2i*2 - 2i + 161 Let x(f) = -2f + 37. Let c(p) = 2294p + 294. Determine c(i) - 8x(i). 2310i - 2 Let z(h) = -66h3 - 27h + 27. Let s(v) = -5v3 - 2v + 2. Suppose -9f - 2001 = 2283. Let l = f + 449. Calculate ls(b) + 2z(b). 3b*3 Let t(r) = 19r*2 - 2r - 32. Let u(v) = -2v2 + 8. What is -t(d) - 5u(d)? -9d2 + 2d - 8 Let x(f) = -f*3 + 4f2 - f - 6. Let b(g) = g3 + g*2 - g. What is -3b(n) + x(n)? -4n3 + n2 + 2n - 6 Let h(z) = z - 295. Let o(d) = -2d + 867. Determine -22h(p) - 8o(p). -6p - 446 Let b(s) = s2 + s. Let j(o) = -o3 - 11o2 + 3o + 35. Let q be j(-11). Let k(h) = 7hq - 5h + 2 - 6h2 - 4h*2. Calculate -4b(g) - k(g). -g*2 + g - 2 Let a(q) = 227q*2 + 16q - 28. Let l(d) = 151d2 + 10d - 18. Give 5a(v) - 8l(v). -73v2 + 4 Let i(y) = 4y + 15. Let l(b) = 6b - 19. Let u(s) = -2i(s) - l(s). Let k(z) = 9z + 7. What is -8k(f) - 5u(f)? -2f - 1 Let o be ((-252)/45)/(-14)(5 + 0). Let x(p) = -1720p - o + 1717p + 2. Let h(n) = -15n - 1. Give 2h(f) - 11x(f). 3f - 2 Let m(q) = -20q - 48. Let s(j) = -25j - 51. Determine -3m(y) + 2s(y). 10y + 42 Suppose 15u - 390 = -450. Let l(i) = 2i*2 + 16i - 9. Let m(v) = v*2 + 8v - 4. Give ul(b) + 9m(b). b*2 + 8b Let j(w) = 14w - 11. Let d be ((6 + (-210)/36)-9)/(3/34). Let h(q) = 2q - 7. Let x(a) = 5a - 13. Let r(i) = 5h(i) - 3x(i). What is dr(p) - 6j(p)? p - 2 Let b(f) = 200f2 + 4f. Let j(r) = -96r2 - 2r. Determine 4b(o) + 7j(o). 128o2 + 2o Let y be 14/35 + (-219)/(-15). Let t(l) = y - 13 - 4 - 5 - 3l. Let r(w) = -1. Suppose -5m - 46 = -4a, -4m + 6m - a + 16 = 0. Determine mr(o) + t(o). -3o - 1 Let t(r) = 18r - 435. Let o(d) = 2d - 130. What is 5o(p) - t(p)? -8p - 215 Let z(k) = 16k - 1. Let a(p) = 31p + 2185. What is a(q) - 2z(q)? -q + 2187 Let n(i) = -12i2. Let l be 5 + -8 + (-11)/(11/(-7)). Let c(d) = d2. Calculate ln(k) + 44c(k). -4k*2 Suppose -4g - 32 = -5h, 0 = 2h - 0h - 3g - 17. Let b(n) = -n - 5. Let y(d) = 5601. Let j(k) = -6722. Let f(l) = -5j(l) - 6y(l). What is hb(x) + 5f(x)? -4x Let p(x) = x. Suppose 0 = 2v + 3v - 11v - 36. Let w(h) = 5h. Calculate vp(f) + 6w(f). 24f Let g(a) = -a + 2. Let r(u) = -10u2 - 2u + 1. Let f(k) = 2g(k) + r(k). Let d = -314 - -311. Let s(x) = 9x*2 + 3x - 4. What is df(v) - 4s(v)? -6v2 + 1 Let b be (-6 - (-21 + 3))/(-2). Suppose -6 - 4 = 2q. Let t(a) = -8a3 + 8a*2 + 4a + 6. Let c(l) = 7l3 - 7l*2 - 3l - 5. Give bc(k) + qt(k). -2k3 + 2k*2 - 2k Let d(t) = 46t + 80. Let n(w) = -10w - 16. Calculate 3d(k) + 14n(k). -2k + 16 Let i be -4 + 10 + 1/(-1). Let n(m) = 3 - 4 - i + 2m*2. Let b(z) = -4z*2 + 13. Let w(s) = 69s - 151. Let y be w(2). What is yn(h) - 6b(h)? -2h2 Let b(d) be the third derivative of d4/12 - 2d*3/3 - 326d*2. Let g(r) = -3r + 5. Suppose 0 = 3i - 8 - 1. What is ig(k) + 4b(k)? -k - 1 Let z(n) = 7n + 1. Let j(w) = 40w + 225. Give -j(g) + 6z(g). 2g - 219 Let u(q) = -4q*2 + 12q. Let c(h) = 17h - 48. Let g(b) = 21b - 60. Let f(y) = 5c(y) - 4g(y). Determine 4f(a) - u(a). 4a*2 - 8a Let c(g) = 27g3 - 24g*2 + 35g + 77. Let u(p) = 43p3 - 38p*2 + 52p + 115. Give 8c(n) - 5u(n). n*3 - 2n*2 + 20n + 41 Let k(j) = j + 5. Let c(s) = 8s + 9. Give c(d) - 4k(d). 4d - 11 Let l(w) = -643w - 4. Let v(b) = -216b - 1. What is -3l(c) + 8v(c)? 201c + 4 Let v(y) = 2y2 + 23y + 4. Let k be v(-11). Let t(r) = -5r. Let w(g) = -g + 1. Let n(f) = 3. Let p(u) = -n(u) + 3w(u). What is kp(h) + 4t(h)? h Let p(w) = 29w3 - 3w*2 + 89w - 3. Let v(o) = -78o3 + 8o*2 - 268o + 8. Determine 8p(f) + 3v(f). -2f3 - 92f Let d(o) = 11122o2 + 10o + 70. Let l(h) = 74183741h2 + 66702h + 466914. Calculate -33351d(m) + 5l(m). -11117m2 Suppose 0 = u + 9f - 5f - 14, -2u - 12 = -2f. Let o(t) = -t3 - 2t*2 - 2t + 3. Let b = -41 - -44. Let d(x) = -3x2 - 3x + 4. What is bo(g) + ud(g)? -3g3 + 1 Let b(j) = -34j*2 + 3j - 3. Let d(s) = -470s2 + 10s - 58. Let m(p) = -155p2 + 2p - 20. Let f(k) = 3d(k) - 8m(k). What is -28b(q) + 6f(q)? -68q2 Let y(h) = -604h + 5. Let b(w) = 7854w - 66. Determine 5b(n) + 66y(n). -594n Let m(a) = 18a. Let q(b) be the third derivative of -b4/24 - 3b*2 - 952b. Determine -m(u) + 6q(u). -24u Let o(p) be the third derivative of -13p6/120 + p5/20 + 5p4/24 + p3/3 - 143p2 - p. Let t(v) = -7v*3 + 2v*2 + 3v + 1. What is -3o(k) + 5t(k)? 4k3 + k2 - 1 Let o(t) = 106t*2 + t - 5. Let q(g) = -532g*2 - 5g + 27. Give -11o(r) - 2q(r). -102r2 - r + 1 Suppose -72b = -154b + 75b - 7. Let a(f) = f - 8. Let q(v) = -v*2 + 1. Give ba(n) - 5q(n). 5n2 - n + 3 Let g(i) = -i3 + i*2 + i - 1. Let d(s) be the first derivative of 5s*4/2 - 2s*3/3 + 2s + 640. What is d(x) + 2g(x)? 8x*3 + 2x Let o(p) = -p*3 + 2p*2 - 3p - 8. Let m(t) = -t*3 + 2t*2 - 2t - 4. Determine 5m(f) - 2o(f). -3f3 + 6f*2 - 4f - 4 Let k(c) = -6c3 + 2c. Let g(l) = 3 - 333l3 + 332l*3 - 4. Suppose 6q - 10 - 2 = 0. Calculate qg(b) - k(b). 4b*3 - 2b - 2 Let n(f) = f - 11. Suppose 61 - 40 = -3s. Let o(c) = c - 7. Determine so(r) + 5n(r). -2r - 6 Let w(t) = -51t2 + 8t + 21. Let f(p) = 154p2 - 22p - 58. What is 3f(v) + 8w(v)? 54v2 - 2v - 6 Let p be 208/32(-2)/(-1). Suppose -9s = ps + 176. Let y(a) = a + 5. Let r(x) be the first derivative of x2 + 8x + 1. What is sy(i) + 5r(i)? 2i Let u(z) = 300z*3 - 4z*2 - 18z + 2. Let q(t) = 289t3 - 3t*2 - 15t + 1. Give 4q(s) - 3u(s). 256s3 - 6s - 2 Let g(l) = 2l3 + l + 2. Let i(q) = 5q*3 + 79q + 6. Calculate -12g(k) + 4i(k). -4k3 + 304k Let k(r) = 16r + 16. Let t(f) = 1. Let w = 16537 - 16521. Determine wt(m) - k(m). -16m Let n(w) = -w2 + w + 1. Let k = -71 - -74. Suppose ki - i + 2 = 0. Let b be 3(2 + i/(-3) + -3). Let x(g) = -3g*2 + g + 1. Calculate bx(h) + 2n(h). 4h*2 Let p(o) = -6o - 2. Let b be 1/(-3)(0 - 3). Let u(n) = 3n - 6 + b - 16n. Suppose 29 - 5 = 792j - 780j. Calculate ju(t) - 5p(t). 4t Let z(s) = -8s2 - 14s + 22. Let b(n) = n*2 + 2n - 4. Let f(v) = 6b(v) + z(v). Let i(w) = -w3 + 3w*2 + 3w + 3. Calculate 3f(h) + 2i(h). -2h3 Let u(s) = 73s*2 - 231s. Let h(f) = 161f2 - 461f. Calculate 4h(o) - 9u(o). -13o2 + 235o Let i(x) be the first derivative of x*2 - 8x + 400. Let r(y) = -3	{ "pile_set_name": "DM Mathematics" }
. -4 Evaluate (-42 - -60) + -6 + -21. -9 Calculate 37 - 103 - -38 - (-10 - 0). -18 What is (28 - 5) + (-2 - 3) - (12 + -11)? 17 (0 - 11) + 0 + 7 - -23 19 Evaluate 26 + ((-23 - -14) + 27 - 18). 26 Calculate -18 + (3 - -2) - -21. 8 Evaluate -4 + 0 + (101 - 92) + 1 + -19. -13 Calculate -3 + (-2 - (-15 + 4)) - (-1 + 19). -12 9 + (7 - (-6 - (7 + 4 - 45))) -12 What is the value of -6 - (-6 - -57) - -30? -27 -9 + -3 + 0 + 43 + -18 + -3 10 Evaluate 4 + (-4 - 0) + (18 - 27) + 2. -7 Evaluate (45 - 5) + -181 + 164. 23 -6 - (-3 + (-8 - -13) + 1) -9 (25 - (-17 - -46)) + -2 - (0 + 5) -11 Evaluate -5 + 2 + (-10 + -2 - (27 - 63)). 21 Calculate -479 + 472 - (-24 - 1). 18 What is the value of (7 - 15 - -7 - -3) + (2 - 7)? -3 What is (12 - 0) + 118 + -135 - -42? 37 24 - ((16 - 17) + 22) 3 What is 4 - (23 + -12 - -5)? -12 Evaluate 5 + 11 + -7 + (11 - 5). 15 Calculate (3 - (-2 - -11)) + 14 + -29. -21 Evaluate -19 + 53 - 23 - 10. 1 -3 + ((-2 - -4) + -18 + 9 - 2) -12 What is -41 - (82 + -94 - (-3 - -4))? -28 Calculate (-53 - -86) + 1 + -4 + -3 + -1. 26 Calculate -60 - (-30 - -8) - (-5 + 3 + -1). -35 What is the value of 2 + (6 + 1 - (9 + 9)) + 29? 20 What is the value of (27 - (17 + 7)) + (-2 + -12 - -2)? -9 Evaluate (-9 - (-26 - (9 - 23))) + 24. 27 Calculate 929 + -901 - (37 + -1). -8 What is the value of 17 + -18 + 23 - 16? 6 What is the value of 152 + -164 - (1 + 0)? -13 What is 4 + 1 + 0 - (-8 - (46 - 72))? -13 What is the value of -5 + 6 - (-6 - -3) - (3 + -3)? 4 Calculate 2 + -12 + (-10 + 35 - 16). -1 8 + (0 + 4 - 8) + 5 9 What is the value of 14 - (-33 + (33 - -15))? -1 What is 1 + ((-9 - -15) + 7 - -10)? 24 Calculate 1 + -1 + -6 + -1 + -15 + 2. -20 Evaluate (-4 - (-1 + 3)) + 0 + (3 - -17). 14 48 + -8 - (17 - -3) 20 What is the value of -6 + -12 + 30 + -19? -7 Calculate -6 + (2 - -9) - 33. -28 -5 + 0 + -3 - (8 + 2 + 0) -18 What is (2 - 0) + -6 + 8 + (-34 - -40)? 10 What is -8 + (3 + -4 + 2 + 1 - 1)? -7 What is -20 + (295 + -303 - (0 - 3))? -25 What is the value of 1 - 9 - (0 - -4) - -23 - -9? 20 What is the value of -10 - 2 - (-68 + 49)? 7 -2 + 36 + 22 + -29 + (0 - -2) 29 Calculate 41 + 25 + (44 - 126). -16 What is (-16 + 7 - -3 - (-3 - 30)) + -3? 24 Calculate 72 - 80 - (-16 - (2 - 2)). 8 What is the value of -50 - -46 - (2 + -16)? 10 What is -25 + (20 - 22) - -31? 4 Calculate 26 - (-37 + 22) - 24. 17 Evaluate -11 + 31 + -5 + -5 + 0. 10 What is (3135 - 3127) + (-12 - ((-2 - -1) + 0))? -3 Calculate 52 + -52 - (2 + (3 - -2)). -7 Calculate 23 - (62 - 21) - -18. 0 -9 + 8 + 7 - (6 + -5) 5 What is 1 - 3 - (6 + 12 + -7)? -13 (5 + 1 - -8) + 69 + -50 33 Calculate 30 + (-21 - (11 + -4 - 17)). 19 What is -4 + 7 - (-12 + 4 + 17)? -6 -14 - -16 - 15 - -16 3 Evaluate -29 + (-67 - -95) - (0 + 0 + -3). 2 Evaluate 247 + -224 + (1 - 12). 12 What is 3 + 0 + -20 + 6 - -27? 16 What is 817 - 856 - (-1 - 24)? -14 What is the value of 1079 + -1087 + (0 - 15)? -23 Evaluate 0 + 35 + (-951 - -951). 35 (11 + -6 - 12) + -2 - -30 21 Calculate -4 + -21 + -11 + 25. -11 19 + 53 + -38 - (-1 - -18) 17 Calculate 6 - (-6 - -7 - -4 - 12). 13 Calculate -5 - ((3 - 4) + -7 + -2). 5 Evaluate -11 + -8 + -22 + 52 - 6. 5 12 + 26 + 22 + -40 20 What is the value of -5 + 4 - -17 - (1 + 6 + -1)? 10 What is the value of 1 - 3 - -34 - (-27 - -40)? 19 Calculate -9 - (-1 + (0 - 13) + 6). -1 15 - (39 - (0 + 12)) -12 Evaluate -8 - (15 - (-6 + 1 + 11)). -17 What is the value of (-36 - (-3 - 21)) + 10 + 0? -2 Evaluate -26 + 46 - (7 - -1). 12 What is 26 + (1 - (-1 + 2)) - (-1570 + 1576)? 20 Evaluate 0 + -21 - (-5 + (13 - 9)). -20 What is -11 - (-22 + 28 + -31)? 14 Evaluate 8 + 3 - (-47 + (41 - 22)). 39 Evaluate -11 + (16 - 3) - (2 - (-3 + 3)). 0 Evaluate 25 - (6 + 20 - 13). 12 What is (6 - (19 - 1)) + 12? 0 Evaluate 3 - (5 + (-1 - -7 - (0 - -4))). -4 Evaluate (-8 - (20 - 34)) + 1 + 5. 12 Evaluate (-4 - 6) + -8 - -27. 9 8 + -7 + -6 + (9 - 3) + -3 -2 (-519 + 526 - (-13 + 0)) + 7 27 Calculate (9 - (18 - 10)) + -1. 0 Calculate (21 + -28 - (-6 - -3)) + (1 - 4). -7 Calculate 22 - (-14 + -8 - -58). -14 What is 25 - (-12 - (-33 - -25))? 29 What is 3 + -18 - (4 + (2 - 6 - 6))? -9 Calculate (2 - (-4 - -9)) + (1 - -1 - -6). 5 Evaluate 3 - (3 + 2 - (2 + 6 + -8)). -2 What is the value of (2 - 3 - 2) + (5 + 4 - 0)? 6 Evaluate (6 - 7) + 12 - 23. -12 What is 4 + (10 - 13) - 0 - -8? 9 (-11 + 23 - 17) + -15 + 7 -13 What is 6 - (-5 - 0) - 14 - (12 + -1)? -14 What is the value of -10 - (-21 + 12 + -3 + -4)? 6 What is the value of (8 - 3) + 1 + -11 + -2? -7 Evaluate 53 + -3 - 63 - (2 - 41). 26 What is the value of (29 - 36) + -29 + 21? -15 What is the value of -13 - 0 - (-31 + (40 - 9))? -13 What is 3 + 0 - (-7 + 7) - 9? -6 Evaluate -8 + 2 + (15 - (15 + -6)). 0 What is the value of -5 - -28 - (34 + -21)? 10 Evaluate -27 + 17 + -31 - -5. -36 Evaluate (172 - 175) + 4 + -21 + -4. -24 11 + -20 + -11 + 2 -18 What is the value of -25 - (-7 - -2) - -13? -7 Calculate 11 + (-1 - 5) - (-184 - -203). -14 What is (-4 - 1 - 1) + 1 + -1 - 6? -12 -1294 - -1284 - (-2 + 6 + 1 - 0) -15 -41 - (3 + -41 + 23) -26 What is the value of (-25 - -26 - 42) + 10? -31 Calculate -8 + -27 + (6 - (-2 + 4)). -31 Evaluate (392 - 395) + 0 + -5 - (-43 + 2). 33 What is the value of 14 + (11 - 24) + -11? -10 2 + -10 + (-19 - (3 + -5)) + 4 -21 What is the value of -6 + -6 + -2 + 10? -4 What is the value of 2 + -1 + (12 - 30)? -17 (34 - 36) + -3 + (3 - 2 - -5) 1 (-47 - -57) + (3 - 0 - -4) 17 Evaluate (0 - 2) + (14 - (-15 - -33)). -6 Evaluate 0 + (-1 + -5 - (-2 + -2) - -13). 11 What is -8 + 1 + 52 + (-14 - -9) + -11? 29 What is the value of 14 + (-6 + (2 - -1) - 9)? 2 Calculate -2 - (-5 - 1) - (-40 + -3 + 38). 9 What is (6 - (-3 + -3 + 4)) + 2 + -20? -10 -2 + ((-5 - -1) + 2 + -2 - 1) -7 What is -21 + (7 - (17 + -8 + 8) - -5)? -26 What is -19 + (4 - (8 + -10))? -13 What is -17 - (-8 + -25) - 17? -1 -42 + 16 + 5 - -34 13 Calculate 46 - 23 - (56 - 3). -30 What is the value of -8 + 1 + 3 + -4 - (-28 + 21)? -1 Evaluate -28 - (-3 + (1 - 7)). -19 Evaluate 8 - (-4 - -5) - (0 - (0 + -11)). -4 Evaluate -6 - ((-10 + 0 - -20) + -7) - -23. 14 Calculate 1 - 2 - (-13 + 5 + (62 - 39)). -16 What is the value of -23 + 11 - -13 - -9? 10 What is (-54 - (-57 + 16)) + 44 + -1? 30 Evaluate 18 - (7 - (33 + -19 - 13)). 12 Evaluate 3 + -25 - -25 - (0 + 9) - 8. -14 -15 + 7 + -1 - (-24 - -12) 3 What is the value of -7 + 17 + 4 + 0 + -3 + 2? 13 (0 - (13 - 10)) + 1 + -4 + 4 -2 What is -20 + (23 - -8) + -2? 9 Evaluate 2 + -8 + 0 + -7. -13 What is (1 - 1) + (-21 - -26 - 14)? -9 -7 + (14 + -2 - (4 - 3)) - 34 -30 What is 34 - 8 - 9 - 2? 15 What is the value of (1 + -2 - (17 + -14 - -3)) + -1? -8 10 - (-7 + (8 - (13 + -7 + -8))) 7 Calculate (-45 - -50) + -2 + (2 - (7 - 2)). 0 Evaluate 0 - 2 - (-12 + 7 + -9). 12 4 + 4 - (12 + -1) -3 What is 8 + 7 + -16 + -6 + -8 + -1? -16 -8 + 24 + -3 - -10 23 Calculate -4 + -7 - (11 - 9 - 10) - 3. -6 Calculate 16 - (1 - (-12 - (-22 + 1))). 24 Calculate (-6 + 16 - 3) + -17 + 1. -9 What is the value of (-12 + -1 + -5 + 12 - -6) + 9? 9 Calculate 7 + -15 + 6 - (-4 + 3 + 7). -8 Evaluate 32 - (11 - -24) - -3. 0 What is the value of -25 + -9 - -21 - -13? 0 Calculate 4 + -23 - (11 - (1 + 9)). -20 What is -4 - ((4 - -5) + -6 + -3 + -42)? 38 What is the value of -2 + -2 + 5 + -7 + 9 + 1? 4 Evaluate 12 + -14 + (2 + -3 - -3). 0 What is the value of -2 - -2 - (-11 + (24 - 9))? -4 What is the value of (-16 - (0 + -3 - -5)) + 160 + -157? -15 18 + 3 + -37 - -11 -5 Evaluate (13 - 12) + -79 + 57. -21 Calculate 7 + -19 + (-5 - -5). -12 -2 + 19 - (-2 + 2 + 8) 9 15 + -36 - (-53 + 10) 22 2 - 6 - (-15 + (15 - 0 - 7)) 3 Evaluate -2 - 2 - (-69 - -78). -13 -103 - -113 - (17 - -1) -8 What is the value of 8 - -2 - (-7 - (30 - 43))? 4 Calculate 49 - (-21 - (-57 + -1)). 12 What is 31 - (38 - (13 + 6))? 12 Calculate (-10 + 24 - 8) + -25 - -7 - -14. 2 What is the value of 32 + (16 + -57 - 15)? -24 Calculate 9 - (-6 - (-17 - -8)) - (1 + 11). -6 Evaluate (-16 - (7 + -19)) + (-2 - -23) + -2. 15 What is 7 + (4 - 14) + -4? -7 What is the value of -22 + -6 + 1 + -1 + 200 + -186? -14 -1 + -2 + (-16 - (21 + -17)) -23 Calculate -62 - -51 - (1 + -13). 1 Calculate -78 + 82 + 5 + -29. -20 What is -7 + 18 - ((-27 - -10) + 4 - -4)? 20 Calculate -29 + 11 + 4 + 3 + -14. -25 What is the value of -4 + 19 - (7 - (-3 + 2))?	{ "pile_set_name": "DM Mathematics" }
9 + 1. Determine cy(l) - 4d(l). -l*2 - l + 2 Let h(s) = -8s*3 - 5s*2 + 6s - 1. Let b(l) = 17l3 - 6l + 3l2 - 16l*3 - 2l*2 + 5l. Determine 6b(m) + h(m). -2m3 + m2 - 1 Let a(v) = 3v2 + 3v + 2. Let z(g) = 13g2 + 12g + 7. Give -9a(c) + 2z(c). -c*2 - 3c - 4 Let h(r) = 3r3 - 7r*2 + 3r - 13. Let t(l) = 2l3 - 5l*2 + 2l - 9. Suppose -2m + 5d = -10, -m + 0m - 5d = -5. What is mh(s) - 7t(s)? s*3 + s - 2 Let u(z) = 3z*3 - 2z*2 + 4z. Let v(i) = -2i3 + 2i*2 - 3i. Suppose -4q + 9 = -3. What is qu(w) + 4v(w)? w3 + 2w*2 Let w(c) = 3c*3 - 4c*2 - 6c - 6. Let k be (-1)/((1 - (-8)/(-4))/(-11)). Let g(j) = 3j2 - 8j*3 + 8 + 8j*2 + 17j + 9. Give kw(a) - 4g(a). -a*3 - 2a - 2 Let g(z) = -z + 1. Let p(j) = j - 5. Let i be 5/((-15)/(-9)) - (4 - -2). What is ig(v) - p(v)? 2v + 2 Let y(i) = i*2 + 1. Let c(z) = 5z*2 + z + 1. What is -c(o) + 4y(o)? -o2 - o + 3 Let t(g) = g2 - g - 1. Let n(x) = -8x2 + 7x + 8. Suppose -4w - 5d = -0w + 31, 2d - 24 = w. Determine wt(s) - 2n(s). 2s2 - 2 Let j(f) = -f + 2. Let h(d) = -5d + 9. Let r(q) = -2h(q) + 9j(q). Let w(k) = k - 1. Give -r(l) - w(l). -2l + 1 Let u(t) = 8t*2 + 5t + 1. Let q(b) be the first derivative of 3b3 + 3b*2 + b - 14. Give 6q(i) - 7u(i). -2i2 + i - 1 Let q(m) = m2 + m. Let o = -3 + 7. Let b(t) = 2t3 - 4t*2 - 4t. Let i = -4 - -8. Suppose -4 = in - 4f - 20, 4n + 2f = -2. What is nb(g) + oq(g)? 2g3 Let f(v) = -161v*2 - 49v. Let w(c) = c*2 - 2. Let s(z) = -6z*2 - 3z - 8. Let q(i) = -s(i) + 4w(i). Calculate -3f(p) - 49q(p). -7p2 Let x(r) be the first derivative of -r2 + 4r - 2r - 4r + 1. Let l be (16/20)/(1/5). Let n(a) = a. What is ln(i) + x(i)? 2i - 2 Let t(a) = -a + 1. Let s(l) = 2l - 2. Let h = -8 - -11. Calculate hs(f) + 8t(f). -2f + 2 Suppose 12 + 23 = 5m. Let s(r) = -5r + 2. Let c(b) = 6b - 2. Calculate ms(p) + 6c(p). p + 2 Let r(l) = -5l3 - 2l. Let d(c) = -24c3 - 11c - 1. Calculate 2d(x) - 11r(x). 7x3 - 2 Let s(i) = -3i*2 + 3i. Let o(p) = 10p2 - 10p. Let z = 3 - 5. Determine zo(c) - 7s(c). c*2 - c Let g(k) = -4k2 - 5. Let w(n) = -n3 + 4n2 + 3n + 5. Let r be w(5). Let u(z) = 12z2 + 16. Calculate ru(l) - 16g(l). 4l*2 Let g(p) = -p - 1 - 3 + 3 + 5. Let n(a) = 1. Determine g(w) - 6n(w). -w - 2 Let f(d) = 21d3 - 12d2 - 12. Let b(o) = -o3 + o*2 + 1. Calculate -12b(t) - f(t). -9t3 Let j(z) = 28z + 8. Let r(q) = q + 1. Calculate j(g) - 10r(g). 18g - 2 Let p(j) = -j - 1. Let d(u) = u + 4. Let m(o) = -o - 3. Let n(f) = -5d(f) - 7m(f). What is -3n(w) - 4p(w)? -2w + 1 Let d(g) = 6g*2 + 14g - 14. Let a(t) = -t*2 - 3t + 3. Determine 14a(q) + 3d(q). 4q2 Let i(f) = -3f*2 - 4f + 2. Let h = -31 + 29. Let p(z) = z*2 + z - 1. Calculate hp(w) - i(w). w*2 + 2w Let i(g) = -132g2. Let p(x) = 19x*2. Give 5i(u) + 36p(u). 24u*2 Let u(f) = -2f + 2. Suppose -5m + 40 = -5y, -2y = -2m + 4m. Let o(s) = 0 + 3 - 5s + 2s. Determine mu(x) - 3o(x). x - 1 Let w(g) = g2 + g + 1. Let k(l) = -7l*2 - 4l - 10. Calculate k(n) + 5w(n). -2n*2 + n - 5 Let u(g) = g - 1. Let p be 2/((6 - 2) + -3). Let y = 6 - p. Let w(n) = 5n - 4. Determine yu(v) - w(v). -v Let b(s) = 3s + 1. Let j(f) = 3f. What is 2b(i) - 3j(i)? -3i + 2 Let p(b) = -1. Let t(o) = -o - 5. Let m be t(-3). Let u(l) be the third derivative of 0 - l*3 + 0l + l*2 - 1/24l*4. What is mu(q) + 11p(q)? 2q + 1 Let w(t) = t*3 - 5t*2 - 5t - 4. Let f(j) = -j*3 + 6j*2 + 5j + 5. What is 5f(o) + 6w(o)? o*3 - 5o + 1 Let m(x) = 2x2 + 9x + 1. Let c(g) = g - 1. What is -2c(y) - m(y)? -2y*2 - 11y + 1 Let l(v) = -2. Let d(p) = -p*2 + 4p - 6. Let h(z) = 5z2 + 11 + 0z - 3z2 - 7z. Let q(r) = -7d(r) - 4h(r). What is -3l(w) + 2q(w)? -2w2 + 2 Let w = 0 - -2. Let o(n) be the third derivative of n5/60 + n2. Let v(m) be the first derivative of -m4/4 - 2m3/3 + m2/2 - 7. Give wv(g) + 3o(g). -2g3 - g2 + 2g Let a(h) = h*2 - 7. Let z be (6/(-36)3)/(3/12). Suppose 0 = 2p - 3n - 23, -2p + 2n + 13 = -5. Let i(q) = -4 + 1 + p. Give za(y) - 14i(y). -2y2 Let n(k) = k2 + 2k + 3. Let h be n(-3). Suppose 15 = hy - y. Let s(x) = x2 + x3 + 0x*2 + 0xy. Let j(f) = f3 + f*2 - 1. What is 2j(i) - s(i)? i3 + i2 - 2 Let x(j) = -4j - 3. Let g be x(-2). Let d(b) = -4b*3 - gb + 0b - 6b2 + b2. Let r(z) = -z3 - z2 - z. Calculate -d(w) + 3r(w). w3 + 2w*2 + 2w Let v be -41(-7)/4. Let y = v - 1. Let k(a) = a - 4. Let c(j) = j - 5. Give yk(w) - 5c(w). w + 1 Let o(i) be the first derivative of i*2 + 11. Let w(x) = 4x. Determine -7o(g) + 3w(g). -2g Let f(j) = 3j*2 + 7j*3 - j + 2j*3 - 7j*3. Let n(h) = 4h*3 + 7h*2 - 2h. Calculate -5f(x) + 2n(x). -2x3 - x2 + x Let c(j) = j3 - j. Let z(a) be the second derivative of a5/4 + a4/12 - 7a*3/6 - 7a. What is -6c(k) + z(k)? -k3 + k2 - k Let z be 4/(-10) - 6/10. Let a(g) = -g2 - g. Let m(f) = 5f*2 + 3f + 1. Suppose -7o = -7 + 28. What is oa(c) + zm(c)? -2c*2 - 1 Let x(b) = 4b*3 + 11b*2 + 6b. Let j(o) = o3 + o2 + o. Let d(c) = 6j(c) - x(c). Let p(s) = -s3 + 2s*2. What is 2d(u) + 5p(u)? -u3 Let m(q) = 4q - 4. Let s(d) = -3d2 + 7d + 3. Let v(n) = 2n2 - 4n - 2. Let y(l) = 3s(l) + 5v(l). Give m(p) - 4y(p). -4p2 Let m(y) = -y2 + y + 1. Let i(r) = r*2 + 19 - 7 + 2r + r - 9. Determine -i(z) + 3m(z). -4z*2 Let v(p) = 2p - 14. Let i(w) = -3w + 15. Determine 4i(b) + 5v(b). -2b - 10 Let u(i) = -5i2 - 8i + 8. Suppose 8 = -z + 3z. Let j(t) = 2t*2 + 3t - 3. Suppose 0 = 5d - 11d + 66. Determine dj(o) + zu(o). 2o2 + o - 1 Let v(n) be the second derivative of 5n*4/12 - 11n*3/6 - 9n*2/2 - 205n. Let u(t) = -4t + 8t - 2t2 + 3 + 0. Give -11u(y) - 4v(y). 2y*2 + 3 Let k(w) = w + 1. Let a(g) be the second derivative of -g + 0 + 2g*2 + 1/3g*3 - 1/12g*4. Determine -a(j) + 4k(j). j*2 + 2j Let w(a) = -6a - 2. Let c(l) = l + 1. Calculate -3c(k) - w(k). 3k - 1 Let c(r) = 2r*2 + 5r - 1. Let l(a) = -3a2 - 6a + 1. Calculate -4c(i) - 3l(i). i*2 - 2i + 1 Let w(v) = v*3 + v - 3. Let x(z) = -5z*3 - 4z + 12. Calculate -9w(o) - 2x(o). o3 - o + 3 Let h(o) = o3 + 3o2 + o - 1. Let b(k) = 2k*3 + 7k*2 + 3k - 2. Suppose 29 = -3x + 2c + 2, -3c = -5x - 45. Let g = x + 12. Give gb(m) - 7h(m). -m*3 + 2m + 1 Let n be (-2)/3 + (-123)/(-9). Suppose h + 2 - n = -g, -3g + 13 = -h. Let c(u) = -u + 0u + 0u. Let f(m) = -3m. Calculate gf(w) - 17c(w). -w Let x(o) = o + 1. Let h(y) = -70y - 84. What is h(j) + 84x(j)? 14j Let s be (1 + -2)-1 + 3. Let g = 10 - 17. Let t(k) = 5k2 + 7k - 9. Let m(c) = 3c2 + 6c - 6 - 2c + 1. What is gm(x) + st(x)? -x2 - 1 Let k(h) be the first derivative of 9 + 2h - 8 - h. Let y(f) = f*2 - 9f + 3. Let s be y(8). Let i(m) = -m*2 - m + 2. Calculate sk(b) + 2i(b). -2b*2 - 2b - 1 Let c = -14 - -7. Let p(r) = 2r + 5. Let b(h) = -2h + 11 - 11 - 6. Give cp(q) - 6b(q). -2q + 1 Let q(s) = 2s*3 - 6s*2. Suppose 7 = -3j + 25. Let x(g) = 6g3 - 15g2 + 2. Let w(l) = -l2 - 1. Let v(t) = -2w(t) - x(t). Calculate jv(p) + 17q(p). -2p3 Let n(h) = h. Let y(s) be the second derivative of -s3/6 - 26s. Calculate n(w) + 4y(w). -3w Suppose 4 = -8h + 4h. Let s(v) = v3 + v2 + v + 1. Let a(x) = -4x*3 - 5x*2 - 3x - 3. Give ha(p) - 3s(p). p*3 + 2p2 Let z(t) = t2 + t - 1. Suppose -3y - 5 = -2. Let a = -21 + y. Let l(j) = 12j*2 + 11j - 11. Let d be 0/(-1) - 4/(-2). What is az(o) + dl(o)? 2o2 Let y(a) = -46a*2 + 3a - 2. Let v(j) = -46j2 + 2j - 1. Calculate -3v(p) + 2y(p). 46p2 - 1 Let j(k) = 17k*2 - 5k - 4. Let l(w) = -18w2 + 6w + 5. Determine 5j(r) + 4l(r). 13r2 - r Let j(y) = -4y*3 - 2y + 1. Let i(c) = c*3 + c. Calculate -6i(u) - 3j(u). 6u*3 - 3 Let o(l) = -8l*2 - 9l + 11l3 + 17l - 16l - 2. Let n(p) = 7p*3 - 5p*2 - 5p - 1. Give 8n(y) - 5o(y). y3 + 2 Let b(d) = d - 5. Let n be b(5). Let f = 3 + n. Let y(l) = l2 + l2 + lf + 0 + 1 - 2l. Let c(p) = -p3 - p*2 + p - 1. What	{ "pile_set_name": "DM Mathematics" }
- 20, -w = 5i - 219. Does 12 divide i? False Let a(y) = y3 + 12y*2 + 13y + 6. Does 3 divide a(-10)? False Let r = 101 - 77. Suppose -2h + r = -60. Is 3 a factor of h? True Let o(l) = 2 + 3 - 20 + 2l. Let z be o(10). Let n(s) = 9s. Is 20 a factor of n(z)? False Let c = 48 + 133. Let u = c - 61. Suppose 4t - u + 16 = 0. Is 6 a factor of t? False Suppose -30 = -2d + 5d. Is (-3 + 2)d - 2 even? True Let j(c) = c3 + 10c*2 + c + 16. Let b be j(-10). Suppose -ba + 144 = -0a. Is a a multiple of 4? True Let a = 349 - -2106. Is 90 a factor of a? False Suppose -j + 54 = -d - 456, -1024 = -2j - 2d. Is 39 a factor of j? False Let p = 323 + -263. Is p a multiple of 17? False Let c be ((-12)/(-14))/(4/14). Suppose -5y + n + 129 = 2n, 0 = y + n - 29. Suppose 1 = -cd + y. Is d a multiple of 8? True Is 9 a factor of 246 + 15 + -7 + 7? True Is -7 - -154 - (0 + 2 + -3) a multiple of 23? False Suppose -p = -2c + 1988, p + 20 = 6p. Does 12 divide c? True Suppose -3y + 76 = -7y. Let m = y - -21. Suppose 88 = v + 4s, s = -mv - 2s + 156. Is 24 a factor of v? True Let m = -1228 - -1425. Does 6 divide m? False Suppose 832 = 4b - 328. Is 39 a factor of b? False Let r = -10 - -12. Suppose 2k + r + 12 = 2p, 2p - 3k = 19. Suppose -2a + 9 = -a - pl, 3a - 23 = 2l. Does 3 divide a? False Let d(j) = 2j - 13. Let y be d(9). Does 8 divide (-50)/(-5) + y + -7? True Suppose 6v - 795 - 3189 = 0. Suppose -3p = -5 - 7, -3f - p + v = 0. Does 13 divide f? False Suppose 0 = -2y + z + 3708, 3y + 13z = 14z + 5561. Does 109 divide y? True Let r = 580 + -297. Is 8 a factor of r? False Let o(j) = j*2 - 4j + 1. Let x be o(4). Let h be (136/(1 + x))/1. Let a = h + -28. Is 10 a factor of a? True Suppose 2v - 2x - 598 = 3x, v + 4x = 325. Suppose 3h + i = -v, 0 = h + 2i + 29 + 79. Let p = -48 - h. Is 10 a factor of p? False Does 23 divide (1 - (-8)/(-2)) + 414? False Suppose 0 = 3v - c - 15, -5v - 2c = 3c - 25. Suppose -4z + 36 = 3p + 2p, vz - 20 = 0. Suppose 26 + p = 5u. Does 3 divide u? True Let i(f) = 7f*3 + 17f*2 - 30f - 10. Let k(z) = 6z3 + 16z*2 - 29z - 10. Let u(r) = 5i(r) - 6k(r). Is u(-13) a multiple of 8? False Let a be (0 - -4)(-12)/(-16). Let g be (2/(-2))/(4/(-664)). Suppose ay - y = g. Is 27 a factor of y? False Let u = -1735 - -3121. Is u a multiple of 63? True Let z(p) = -2p - 13. Let x = 21 - 21. Suppose 2a + xa + 34 = 0. Does 10 divide z(a)? False Suppose -3b = 18b - 21588. Is 36 a factor of b? False Suppose -3p = a - 14, 2a = -p + 4 + 9. Suppose 750 = -ab - 0b. Let y = -100 - b. Is y a multiple of 25? True Suppose -66f + 72f - 4176 = 0. Is f a multiple of 24? True Let n(v) = v2 + 3v + 6. Let s be ((-4)/(-6))/(2/6). Suppose 0 = -2q + 4z - 6, 0 = sq - 2z + 12 - 2. Is n(q) a multiple of 12? False Let s = -4699 - -8534. Is s a multiple of 13? True Let q be 9/(-12)1132/(-12). Let x = 92 - q. Is 14 a factor of x? True Let c be -3(2 - (-21)/(-9)). Let z be 1 + 1 + c + -1. Suppose 212 = 5t + z. Is t a multiple of 21? True Suppose -6s + 15 = -s. Suppose -sr - 4 = -d, 0d + 20 = 2r + 5d. Suppose -j - 3 = -2x + 2, -j + 4x - 13 = r. Is 2 a factor of j? False Let r(k) = 26k - 4. Let o be r(-1). Let u = o - -75. Does 9 divide u? True Let b = 1188 - 689. Is 16 a factor of b? False Suppose 3h - 286 + 34 = 0. Suppose -r - 2r = 0. Suppose -11 = -2z + m + h, r = z + 5m - 20. Is z a multiple of 16? False Let r(a) = -13a3 + 23a*2 + 17a - 41. Let m(u) = 7u3 - 12u*2 - 9u + 21. Let d(z) = 11m(z) + 6r(z). Does 2 divide d(6)? False Let l = 6 - 22. Let q = l - -16. Suppose -5u + 150 = 4h + h, q = 5h - 2u - 178. Does 18 divide h? False Is 5/(-3) + (-9 - 74410/(-15)) a multiple of 45? True Suppose -23a - 13a = -10476. Is a a multiple of 75? False Is -1 + -4 - (-1308 - -1) a multiple of 14? True Suppose -5v - 23 = -v - 3u, 4v - 2u + 18 = 0. Let h be (v/2)/(1/6). Is 19 a factor of h + 61 - (-1 - 2)? False Suppose 0 = c - 2s - 2, -3c - 11 = -6c + s. Suppose d + cq - 208 = 3d, -347 = 3d + q. Let k = -62 - d. Does 13 divide k? True Suppose 7s + 5 = 2s. Let b(t) = -6t3 + t2 - 1. Let i be b(s). Suppose if - 224 + 8 = 0. Is f a multiple of 8? False Suppose -89m + 119m - 27360 = 0. Is m a multiple of 16? True Let t be (-1)/(93/48 + -2). Suppose -2b + 2 - t = 0. Let x = 16 + b. Is 5 a factor of x? False Suppose -4k = -2k - 10. Suppose 4j + 34 = -5b + kj, 0 = 5b - 4j + 31. Is 10 a factor of (-173)/b - 2/(-7)? False Is 23 a factor of -1 + 14928/27 + 6/54? True Suppose 12n - 31339 = n. Does 16 divide n? False Let r = -4 - -54. Suppose n + 10 = 2n + 3a, 5n + a = r. Is n a multiple of 8? False Suppose 8l + 15 = 3l. Let z(i) = i*2 - 5i - 7. Let q be z(5). Let u = l - q. Is u even? True Let f(v) = 4 + 5v - 5 - 1. Is f(1) a multiple of 3? True Let t = 1428 + -910. Does 9 divide t? False Let x(i) = -i + 2. Let c be x(-1). Suppose -710 = -cl - 7l. Is 39 a factor of l? False Let t(p) = p3 - 8p*2 + 6p + 10. Let m = 12 + -11. Suppose -5r + m = 2v - 18, 5r = -5v + 40. Is 2 a factor of t(v)? False Let d(x) = 153x + 155. Is 134 a factor of d(13)? True Let b be 12/(-4)0. Let a(k) = -4k*3 - 5k*2 + 3k - 6. Let g(n) = -9n3 - 11n*2 + 7n - 11. Let d(o) = -7a(o) + 3g(o). Does 4 divide d(b)? False Let a be (-9)/12 - 86/(-8). Let q be (-12)/60 + (-28)/a. Is 2 + 1 + q + 45 a multiple of 15? True Does 44 divide 8 + (-30)/5 - (-344)/4? True Suppose 3z - 15 + 0 = 0. Let o be 5/((-5)/(-2)) + 31. Suppose zu = 57 + o. Is u a multiple of 6? True Suppose 3s - 6 = 3r, -5r + 0s = -4s + 6. Is 12 a factor of -14(r - 1)54/(-18)? False Let h(o) = 10o*2 - 2o. Let l be 1/2(-16)/(-2). Suppose 3y + l = 5y. Does 25 divide h(y)? False Let x be -66/9-14. Suppose 13c - 11c = x. Does 8 divide c? False Let d = 15 + -14. Is ((-2)/d)/((-4)/78) - -3 a multiple of 14? True Suppose 2 - 1 = -2r - 3p, 5r - 2p = -12. Is 20 a factor of 12/2 + r + (-327)/(-3)? False Let t = -869 + 240. Let m be 9/45 - t/5. Suppose 4u = 2u + m. Does 21 divide u? True Let z be 1 - 1 - 1785/7. Let v be 1/(-4) - z/60. Suppose -3a + 56 = a + 3n, 4n - 56 = -va. Is 6 a factor of a? False Let f = 9 + 12. Let y be (-160)/(-28) - (-6)/f. Is 14 a factor of (21/2)/(y/16)? True Let v be (18/15)/(2/(-60)). Suppose k = 3t + 59, 17 + 239 = 4k - 2t. Let q = v + k. Is q a multiple of 10? False Let g = -8 - -10. Suppose -go + 228 = o. Let u = o - -49. Is u a multiple of 32? False Let c = -8 - -9. Does 7 divide (-77)/(-44)16/c? True Let b be (7/7)/(1/5). Suppose 7o = 6o + b. Is 336/o - 2/10 a multiple of 18? False Let z be (-3)/(18/15 + -1). Let d = -13 - z. Suppose h = 5h + f - 146, dh = -5f + 82. Is 12 a factor of h? True Let v(b) = -b3 - 5b*2 - 20b - 52. Let t be v(-5). Let j be (0/(-1))/(-1 - 0). Is 4 a factor of j - t/(6/(-2))? True Suppose m + 2d - 1385 = -3d, -2d = 2m - 2778. Is m a multiple of 13? False Let l(o) be the second derivative of -o*5/10 - 2o*4/3 - 2o*3/3 + 21o*2/2 + 2o + 24. Is l(-6) a multiple of 27? True Let h(g) = g*3 - 13g*2 - 15g + 14. Let k be h(14). Suppose 4y + k = -60. Let w(p) = -p2 - 16p - 1. Is w(y) a multiple of 14? True Suppose 55m = -107812 + 384902. Is 89 a factor of m? False Let d(c) = c2 - 5c - 2. Let a be d(6). Suppose -al + 24 = -56. Is 5 a factor of 6/4l/3? True Let s(w) = 4w3 - 1. Let t be s(2). Suppose 5i - 2y - 125 = 2y, i = 2y + t. Is 3 a factor of i? True Suppose -208 = 5x - 13x. Suppose x = t - 27. Is t even? False Suppose 3y - 3g - 27 = -231, -4g - 8 = 0. Let o be (y/21)/((-1)/(-9)). Let m = -1 - o. Does 24 divide m? False Let f = 16 + 46. Is f a multiple of 5? False Suppose -1857 = -6b + 3471. Does 70 divide b? False Let m = -9 + 12. Suppose -3i + i + 13 = mo, 4 = 4o - 4i. Is 5/20204/o a multiple of 12? False Let c(x) = 4x3 + 2x + 1. Suppose -11 = 3d + 2z - 0, 11 = 5d - 4z. Let y be c(d). Is 3 a factor of (-2)/y - 212/(-20)? False Suppose -2f = -3f + 4. Suppose fx - 49 = 3j, 3x - 33 = 3j - 0j. Is (204/x)/(12/32) a multiple of 20? False Let z(v) = 18v - 38. Suppose 6u - 13 = 53. Is z(u) a multiple of 32? True Suppose w + 6w + 42 = 0. Is 2/(-6) + (-584)/w a multipl	{ "pile_set_name": "DM Mathematics" }
s3 - 300s + (6 - 2 - 2)(2 + s2 - 2 + s3). 10s*3 + 2s*2 Expand (1 - 1 + 2)(2m - 3 - 1 + 2). 4m - 4 Expand (-4 + 1 - 3)(3 - 1 - 1)(-s*2 + 0s + s + 0s). 6s*2 - 6s Expand (-2o + 2o - o*3)(1 + 1 - 1) - 2o2 + 9o*3 - 2o*2 - 11o*3. -3o*3 - 4o*2 Expand (-14i + 9i + 3i)((-2 + 0 + 4)(-2 - 3 + 4) + 6 - 6 - 7)(-2i + 0i + 0i). -36i2 Expand (3070 - 3070 + 36g*4)(6g + 0g - 4g). 72g*5 Expand 2s3 + s5 - 2s3 - 2s*4 + 2s4 - s5 + (-5 + 3 + 4)(-2s*5 - 2s*2 + 2s*2) - 21s*5 + 21s*5 - 15s*5. -19s*5 Expand -9 - q + 9 + (-q - 4q + 4q)(9 - 1 - 1). -8q Expand (c3 - c3 - c3)(-13 + 4 + 24). -15c3 Expand (-3 - 1 + 0)(0 + 2 + 7)(0b*4 + 2b*4 + 0b4) - b3 + 2b4 + b3. -70b*4 Expand (-3 + 2 + 0)(0 - 1 - 2)(-9u*3 + 41u*2 - 41u*2). -27u*3 Expand (11m + 20 - 20)(1 + 0 - 2)(3m - 5m + m). 11m2 Expand (34j*2 - 36j*2 + 0j4 - j4)(-j + 3j - 3j). j5 + 2j*3 Expand (6q - 30q - 2q)(-1 + 1 + 2) - 5q + 4q - 3q. -56q Expand (1 - 3 + 3)(x*2 - 3x*2 + 3x*2) + 21x*2 - 17x*2 - 13x*2 + (-2x*2 + 2x*2 + 3x*2)(0 - 1 - 2) + 0x2 + 2x2 - x2. -16x2 Expand (-h2 + 5h*2 - 2h*2 + 1)(-1 - 5 - 3h + 2). -6h*3 - 8h*2 - 3h - 4 Expand (3j + 2j - 2j)(3 - 6 + 2) + 2j - 2j + j. -2j Expand (-2v + 0 + 0)(194 + 37v - 194). -74v2 Expand (l3 + 2l*3 + 2l*3 + (-4l + 6l - l)(-l*2 + 4l2 - l2) - l + l - l*3 - 4l*3 + 0l*3 + 5l*3)(-1 - 4 + 4). -7l3 Expand (a + 3a - 5a)(0 + 0 - 3)(3 - 6 + 4). 3a Expand (-2y - y + 6y)(-4y*3 + 5y*3 - 3y3) - y2 - 2y4 + y2 + y4 + 0y*4 + 0y*4. -7y4 Expand (w2 + 2w2 - 4w*2 + (2w - 3w + 2w)(-4w + w + w))(-3 + 3 + 2w) + 5w3 - w3 - 3w*3. -5w*3 Expand (3 + 4 - 13)(4z + 0z - 3z)(z + 2z - 4z). 6z2 Expand 2p - 2p + p2 + (-p + 0p - 4p)(-p - 2p + 0p). 16p2 Expand 2v*2 - 2 + 2 + (2 - 2 + 3v)(-3v - 3v + 4v). -4v2 Expand 1 - 1 - o + (-1 + 0 + 0)(0o - 3o + 4o) + 16 - 16 + 9o + (4 - 4 - 2)(0o - o - o) - 3o + 6o - o - 4o + 2o + 4o. 15o Expand (1 - 7 - 1 + 1 + 1 - 1 + 4 + 3 - 5 + (-1 + 1 - 2)(7 - 2 - 3))(0 + 0 + f*3). -8f*3 Expand ((2i - 2 + 2)(4 + 0 - 1) - i + 0i - 2i)(-4 - 2 + 5). -3i Expand (2c + 1 - 1)(-c + 3c + c)(-1 + 2 + 1)(-2c + c + 3c). 24c3 Expand -2w2 + w2 + 2w2 + (w + 3w - 2w)(0w + 7w - 2w). 11w*2 Expand 6a - 5a + 3a + (a + 1 - 1)(-1 - 2 + 2) - a - 4a + 4a. 2a Expand 0k2 - 2k2 + k2 + 0k2 + k2 - 2k*2 + (2 - 7k - 2)(5k - 4k + k). -16k*2 Expand (0k + 4k - 10k)(-3k + 1 - 1)(-3k - 1 + 1). -54k3 Expand 1 - p2 - 14p*2 + 3p*2 + (-1 + 1 - 2)(-2p2 + p2 + 0p*2). -10p*2 + 1 Expand (0k + 0k + k3)(2 + 2k - 2) - 3k*4 - 3k*2 + 3k2. -k4 Expand (3 - 2j - 3)(-4j3 + 0j*3 + 3j*3) + (-6j2 - j2 + 2j2)(3j2 - 1 + 1). -13j*4 Expand (3 - 2d - 2d2 + 4d*2 - 2)((-4 + 1 + 2)(-4 + 2 + 0) - 3 + 0 + 4 + 1 + 4 - 3). 10d*2 - 10d + 5 Expand (-2 + 4 + 0)(0r*4 + 2r*4 + 3r*4)(0 + 0 + 2r). 20r*5 Expand (5c*4 - 4c*3 + 4c*3)(-c + 2c + 2 + 0c). 5c5 + 10c*4 Expand (-6m + 2m + m)(-17 - 10 + 4)(2m + 1 - 1). 138m2 Expand (2w*3 + 1 - 1)(2w2 + 2w - 2w) - w5 + 3w*2 - 3w*2 - 2w*5 - 2w*5 - 9w*5. -10w*5 Expand (-1 + 4 - 4)(w*2 - 2w2 - w2). 2w2 Expand (-y4 + 4y - 4y)(3y - 2y - 2y) + 5y*2 + 2y*5 - 2y*2 + 3y*2 + 2y*3. 3y*5 + 2y*3 + 6y*2 Expand 5 + 2y2 - y2 - 6y2 + (1 - 3 + 4)(-4 + 4 - 2y2) - 3y*2 + 3y2 + y2 - 2y2 + 4y*2 + 0y*2. -6y*2 + 5 Expand (1 - 2 - 1)(4d + 6d + 6d). -32d Expand 0z3 - z3 + 0z*3 + 4z3 + z3 - 3z3 + (-3z*3 + 0z*3 + 0z*3)(0 + 0 + 2) - 3z3 - 2z*3 + 4z*3 + 1. -6z*3 + 1 Expand (2 + 4 - 1)(3j2 - 5j*2 + 4j*2). 10j*2 Expand (4a - a + 2a)(a*2 + 2a2 - a2) + 4a3 - 5a*3 + 0a*3. 9a*3 Expand -2d*4 + 2d4 + d4 - d2 + d2 - d*4 + (2d*3 + 0d + 0d)(-2d + 0d + 0d) - 82d - 15d4 + 82d. -19d4 Expand (-m - 2 + 2)(-30m - 112m + 50m). 92m*2 Expand (-4x*3 + 3x*3 + 0x*3)(-1 - 1 - 1)(6x - 3x - x). 6x*4 Expand (4 - 6 + 2f + f)(0f - f + 2f). 3f*2 - 2f Expand (-2 + 1 + 3)(-2 + 2 - 2p*2). -4p*2 Expand (24 + 8h*2 - 24 + (-3 + 3 - 2h)(-h + 6h - 3h) + 1 - 1 - 2h*2)(1 - 1 + 3h3). 6h*5 Expand (3 + 2 - 4)(5f + f - 4f) + (28 - 12 - 2)(1 + 2f - 1). 30f Expand (-2f + 0f - 2f)(-2f + 4f - 3f)(2f - 6f + 2f)(3 + f - 3). -8f*4 Expand (-4 + 1 - 6)(o - o + 8o). -72o Expand -2r5 - r3 + r3 + r5 + 3r - 3r + (r2 + 5r*2 - 4r*2)(r - r*3 - r) - 3r*5 + 4r*5 - 2r*5. -4r*5 Expand (-5f*3 + 0f*3 + 3f*3)(-7 + 5 - 1). 6f3 Expand (0o + 2o2 + 0o)((0 + 0 + 1)(4o2 - 3o2 + o2) + 5o2 + 0o + 0o)(-7o + o + o + (-5o + 3o + 3o)(-1 + 1 + 2)). -42o*5 Expand (-3i*4 + 2i*4 + 4i*4)(-i + 3i - i) - 6i*5 + 2i5 + i5 + (0i3 - 3i*3 + 2i*3)(-i*2 + 3i2 - i2). -i*5 Expand 4p - 2p3 - 4p + (p*3 - 2p*3 + 2p*3)(2 + 1 - 4) - 2p3 - 4p*3 + 4p*3. -5p*3 Expand (-3s - s + 2s)(2 + 2 - 6)(-25s + 0s + 62s). 148s2 Expand 2k4 + k4 - 2k4 + (k3 - 8k*3 + 3k*3)(4 + k - 4). -3k4 Expand (12a*2 - 11a2 - 1 + 2 + a3)(a2 - a + a). a5 + a4 + a2 Expand (3x - 5x + 3x)(-6 - 9 + 13 + 18x). 18x2 - 2x Expand ((0 + 0 - 2g)(0 + 1 - 3) + g + 0g + 0g)(-1 - 4 + 0 + (3 + 0 - 4)(2 + 0 - 4)). -15g Expand (-2 + 6 - 2)(-14o + 2 - 2o*3 + 14o). -4o3 + 4 Expand (1 + 1 - 1)(-2m - 13m + 3m)(5m - 3m - m). -12m2 Expand (3t - 5t + 4t)(2 - 2 + t3) + (0t - 5t + 2t)(3t3 + t3 - 2t3). -4t*4 Expand (-2 + 2 + 1)(-10 + 2 - 9)(-2a + 0 + 0). 34a Expand (5t - 3t + 0t + (-4 - 3 + 6)(-2t + t - t) + t + t - t + 4t - 2t + t)(22 + 0 - 6). 128t Expand (-o*2 + 0o*2 - 3o*2)(-476o + 478o - 3 - 3o2 + 4). 12o*4 - 8o*3 - 4o*2 Expand (-3o*4 + 2o4 - o4)(0o + o + 3o) + 3 - 3 - 2o*5. -10o*5 Expand 0b4 + b4 + b4 - b4 + b*4 - 2b*4 + (-2b*3 - 2b*4 + 2b*3)(0 - 2 + 3) + b*4 - 3b4 + b4 + 17b4 - 11b*4 + 6b*4. 9b*4 Expand (-2c*5 + 4c - 4c)(-24 + 44 - 19). -2c5 Expand ((q - 3q + 0q)(-3q + 5q - 4q) - 5 + q2 + 5 - q2 - q2 + 4q*2 + 4q2 - q2 - q*2)(q2 - q2 - 2q2). -18q*4 Expand (3 - 5 + 3)(-291 - 17q + 291). -17q Expand 2n4 + 0n*4 - 4n*4 + (0n*2 - 4n*2 + 2n*2)(-1 + 1 - 2n2) - 5n*4 + 10n*4 + 7n*4 + (-n + 3 - 3)(-5n + 5n - n*3). 15n*4 Expand (6z - 2z3 - 2z*5 + 2z*3)(-4 - 4 + 6). 4z5 - 12z Expand (-2 + 2 - 2)(-3i - 5i + 4i)(-2 + 4 - 3 + (1 + 3 - 3)(-1 + 4 - 1) - 3 + 1 + 3 + 3 - 2 - 2). 8i Expand (-3r*2 + 3r2 - r2)(-r3 + 0r*3 + 3r*3) + 3 - 2r*5 - 3 - 2r*5 + 6r*5 - 6r5 - r4. -6r5 - r4 Expand (-3q + 4q + q)(3q + 3q + 2q)(2 - 7 + 0). -80q2 Expand (0 - q + 0)(-51 + 74q + 51). -74q*2 Expand (3u*2 + 0u*2 - 2u2 + u2 + 2u2 - 4u*2 + (2u - 3u + 3u)(-2u + 0u + 4u) - 11u2 - 47u + 47u)(u*2 + 4 - 4). -7u*4 Expand (-3a + 3a - a)(-1 + 1 + a) + 3 - 2a2 - 3 + (6a - 3a + a)(-2a - 3a + 3a). -11a*2 Expand 3y4 + y4 - 5y4 + (4y - y - y)(3y - 3y - 7y*2)(0y + 0y + 3y). -43y*4 Expand (-91i*2 + 91i*2 - 14i*3)(3 + 3 - 5). -14i3 Expand (-h + h2 + h)(-3h - 7h - 8h). -18h*3 Expand (3 + 2 - 7)(3y + y - y) - 3y + 0y + 6y. -3y Expand (2s*2 + 0s*2 - 5s*2)(4 + 0 - 5)(3s - 2s + 0s)(-1 + 3 - 1). 3s3 Expand (m2 - 4m2 + 2m*2)(0 - 2 + 4)(2 - 3 + 3 + (-4 + 1 + 1)(-3 + 0 + 2) + 2 + 1 + 0). -14m2 Expand (-j - 1 + 1)(0 + 3 - 4)(4 - 3 - 2). -j Expand (0s + 0s - 3s*2)(2s3 + 7s*3 - 5s*3). -12s*5 Expand -3y*4 - 3y*4 + 4y*4 + (-3y + 3y - 3y)(-2y*2 + 2y*2 + 5y*3). -17y*4 Expand (-315h + 41h2 + 315h)(3h - 2h - 3h). -82h3 Expand (-3 + 4 + 0)(-3n3 - n3 + 7n3) - n3 - n3 + n3. 2n3 Expand (-1 + 3 - 3)(2h + h - h) - 15h + 24h + 23h.	{ "pile_set_name": "DM Mathematics" }
r) be the third derivative of -r5/30 + r4/4 + r*3/3 - 2r2. Calculate h(t). -18 Let m(u) = -u3 - 7u2 + 9u - 4. Let r be (3/(-5)-2)/((-186)/1240). Give m(r). -12 Suppose -11 = -3a + 2m, m - 2m = 3a + 1. Suppose -b + 0b + 2u = 8, -16 = 5b - 4u. Let h(k) = k2 - k + b - 5 + 6. What is h(a)? 1 Let v(o) be the third derivative of o5/60 - 13o*3/6 + 3o2 - o. Determine v(0). -13 Let j = 15 - 9. Let f(k) = -k3 - 3k - 5. Let u(q) = -q. Let x(n) = -2n*3 - 10n - 9. Let r(p) = -5u(p) + x(p). Let m(o) = jr(o) - 11f(o). Give m(-2). 3 Let m = 131 + -53. Let k = -77 + m. Let r(j) be the second derivative of 5j*4/12 + j. What is r(k)? 5 Let w be (-12)/(-18) + 8/(-12). Suppose -2j - 3j = w. Let g(o) = 1 - 5o - 3 + j. Calculate g(-2). 8 Let w(l) = l + 3. Let o be w(3). Let t(x) be the second derivative of 0 - 4x2 - 1/20x*5 + 1/2x*4 - 1/6x*3 + 12x. Give t(o). -14 Let a(t) be the second derivative of t*2/2 + 11t. Let z(n) = 2n + 5. Let y(v) = -5a(v) + z(v). Determine y(-2). -4 Let v be 120/32 + 6/(-8). Let l(c) = -c. Let i(r) = -5r - 4. Let y(x) = -i(x) + 6l(x). What is y(v)? 1 Suppose 0 = f - 11f + 40. Let y(v) = -v3 + 5v*2 - 6v + 4. Give y(f). -4 Let d(m) = -m3 - m2 - m + 1. Let i(f) = -3 + 13 + f + f*2 - 5f*3 - 5f - 12f2. Suppose 5h - 15 = 15. Let j(l) = hd(l) - i(l). Calculate j(3). 8 Let l be ((-189)/(-108))/(1/(-4)). Let r(h) = h2 + 8h - 5. Calculate r(l). -12 Let p(o) be the first derivative of -o4/4 - o3/3 + 2o2 + o + 343. Give p(-4). 33 Let b(s) = 2s - 8. Let w be b(5). Let g(t) = -t*3 + t - t - 5t*w - 6t - 1. Calculate g(-4). 7 Let z(k) = -k*3 + 3k. Suppose 0 = 2c + 2o + 2, 7c + 13 = 6c - 4o. Calculate z(c). -18 Let q(m) = m2 + 2m - 2. Let r(y) = y*3 + 2y*2 - 7y - 5. Let p be r(-3). Suppose -5v - 8 = p. Determine q(v). 1 Let w be 3 + -1 + 8/(-2). Let l be 0 - (3 + w - 3). Let g(y) = -4y*3 + 3y - ly - 4 + 3y*3 - 2y - 6y2. Calculate g(-6). 2 Let p(t) = -3t*2 + t - 2. Suppose -3k = -7k. Let o(g) = 0g*3 - 2g*3 + g + 2 + 3g*3. Let x be o(k). Determine p(x). -12 Let p(x) = -42 - 21x - 333x2 + 332x*2 - 8. Give p(-18). 4 Let q(p) = -p + 5. Suppose -9r = -7r. Calculate q(r). 5 Let f(m) be the third derivative of -m6/360 - m5/120 - m4/12 + 11m*3/6 + 8m*2. Let t(w) be the first derivative of f(w). Calculate t(0). -2 Let f(g) = -2g*2 + 2g + 3. Let r be f(0). Let v(x) = -x - 3. Let s(j) = -5j - 12. Let m(w) = -2s(w) + 9v(w). What is m(r)? 0 Let t(u) be the first derivative of u4/4 - 11u*3/3 + 6u*2 - 26u + 309. Give t(10). -6 Suppose 0i = -2i + 36. Suppose 3d - 3n + i = 0, 2n - 12 = -3d - 5. Let j(f) = -12f2 - f - 1. What is j(d)? -12 Let s(g) = 1. Let i = 1 + 0. Let d(p) = -4p + 6p + 6 - p2 + 4 - 3p. Let l(b) = id(b) - 6s(b). Determine l(0). 4 Let h(g) = -g*2. Let z(w) = -w - 1. Let p(x) = -4x*2 - 13x - 12. Let t(v) = -p(v) + 4z(v). Let r(f) = 5h(f) + t(f). Give r(9). 8 Let c(u) = u*3 - 13u*2 + 22u - 8. Suppose 2g - 72 + 50 = 0. Let z be c(g). Let q(h) = -h3 - 7h*2 + 9h + 12. Calculate q(z). 4 Let t(w) be the first derivative of -8 - w*2 - 5/3w*3 + 2w - 1/4w4. Let r(l) = l3 - 5l*2 + 3l. Let x be r(4). Calculate t(x). -6 Suppose -4t + 108 = 4r, r - 2t - 12 - 30 = 0. Let c = 29 - r. Let q(m) = -2m*2 + 3m + 2. What is q(c)? -25 Let t = 9 - 9. Suppose t = q - 2q + 4. Let u(y) = 0y*2 - qy + y*2 - 2 + 2y. Determine u(-2). 6 Let d(r) = 2r2 - 6r - 25. Let w(a) = -3a2 + 12a + 46. Let l(y) = 5d(y) + 3w(y). What is l(-7)? 20 Suppose -3m + 22 = 13. Let w(i) = 6i + i*m + 4i*2 - 6i + 6 + 2i. Calculate w(-4). -2 Suppose 0 = s, -5b - 6s = -s - 15. Let n(a) = -a2 + 11a - 27. Let k(m) = -3m + 9. Let i(c) = 3k(c) + n(c). Determine i(b). -3 Let y(t) be the third derivative of t7/840 - t5/40 + t*4/6 - 7t*3/3 + 5t*2. Let k(i) be the first derivative of y(i). What is k(3)? 22 Let j(b) = -2b + 9. Let l(d) = 7 + 3 - 5d + 4d - 12. Let p be (-8)/3(4 + -1). Let z be l(p). Calculate j(z). -3 Let h = 1 - 1. Let t(l) = 4 - 2l + l + hl. Suppose 76s = 66s + 20. Calculate t(s). 2 Let x(s) = s2 + 9s + 5. Let y be (-5)/256/(-70) + 1. Suppose 2k + 14 = -yr, 4k = 2r - 0k + 36. Give x(r). -3 Let c = 198 + -208. Let w(k) = 2k + 23. Determine w(c). 3 Let q = 83 - 50. Let w = q + -33. Let z(h) = -h + 15. Determine z(w). 15 Let m(f) = 8f + 15 - 12 + 10 + 8. What is m(-3)? -3 Let w(p) be the first derivative of p*4/4 + 2p*3 + 3p*2/2 - 6p + 2. Suppose 0 = -4y + 4j + 54 + 2, 0 = y + 2j - 17. Suppose 2c + 25 = y. Give w(c). 4 Let b(r) be the second derivative of r4/12 + r3/6 + 7r2/2 - r. Let v = 9 + -7. Suppose -3f - vt = 6, -3 = 4f + t - 0. Give b(f). 7 Suppose w + 8 - 9 = 0. Let s(c) = -1 + 2c + 4 - 1 - c2 + w. Calculate s(4). -5 Let o be 2/3 + -6 + 132/18. Let p(f) be the first derivative of -1/4f*4 + 1/3f*3 - 1/2f*2 - o - 3f. What is p(0)? -3 Let c(a) be the third derivative of 0a3 + 0a + 5a2 + 0 - 1/24a*4 - 1/360a*6 - 1/120a*5. Let t(x) be the second derivative of c(x). Calculate t(1). -3 Let i(s) = 4s*3 + 1 + 2s - 7s3 + 0s. Let f = -1 + 4. Suppose 4g + 0n + 5n - 1 = 0, f = -g + 2n. Give i(g). 2 Let d(s) = 3s2 + 3s + 3. Suppose -3j = -5f - 1 - 41, 18 = 3j + 3f. Let g = -11 + j. Give d(g). 9 Let u = 27 - 32. Let z be 18/45 - 23/u. Let m(o) = -o*2 + 8o - 7. Calculate m(z). 8 Let v(k) = 5k2 - 5k - 1. Let m(o) = -o*2. Let n(t) = 4m(t) + v(t). Calculate n(4). -5 Let v(m) be the first derivative of 15m4/2 + m3/3 + m2/2 + m + 83. Give v(-1). -29 Let r(t) = -2t - 1. Suppose c = -1 - 4, 2z - 4c = 30. Let h be (2/z)/(2/(-5)). Calculate r(h). 1 Let n(p) be the second derivative of -2p3/3 + 2p*2 - 2p + 132. What is n(6)? -20 Let a(n) = 8n2 - 3n - 4. Let j(q) = -7q2 + 4q + 5. Let r(i) = -4a(i) - 3j(i). What is r(1)? -10 Let b = -4 + 6. Let g(y) = -8 + 6y3 + 4y + 7yb - 9y*3 + 4y*3. Give g(-6). 4 Let q = 1609/2 + -802. Let m(g) be the second derivative of -1/12g*4 - qg*2 + 1/20g*5 - 1/6g*3 - 7g + 0. Give m(0). -5 Let a(f) = f*3 - 6f*2 - 4f - 5. Let h be (0 - -5)/15 + (-140)/(-21). Give a(h). 16 Let h(b) be the third derivative of -28b2 - 1/120b*6 + 1/12b*5 - 1/8b*4 - 1/3b*3 + 0b + 0. Determine h(3). 7 Let v(b) = 2b + 31. Let f(p) = -p - 17. Let i(m) = -11f(m) - 6v(m). Give i(-10). 11 Let o(x) = -30 + 23 + 2x - x - 2x. Let v(z) = -3z + 4. Let l be v(3). Let b be o(l). Let h(r) = r3 - r2 - 4r - 3. Determine h(b). -7 Suppose 4t - 129 = 63. Let a = t + -45. Let x(f) be the third derivative of -f4/24 + f2. Determine x(a). -3 Let v(j) = 7j - 2. Let x(k) = -5k + 2. Let p(n) = 2v(n) + 3x(n). What is p(-5)? 7 Suppose -8k - 58 + 18 = 0. Let q(w) = w3 + 6w*2 + 2w - 5. Determine q(k). 10 Let w(j) = j*2 + 3j - 6. Suppose -28l = 184 + 12. Determine w(l). 22 Suppose 2s = -0s + 16. Let q(g) = -5g + 5g - 1 + sg. Let m = -12 + 13. Calculate q(m). 7 Let c(y) = 2y3 + 5y*2 + 2y. Let w(o) = o*3 + 7o*2 + 20o + 47. Let r be w(-5). Determine c(r). -15 Let r = -576 + 580. Let g(d) be the second derivative of -4d2 + 0 - 1/20d*5 + 5d - 5/12dr + d3. Give g(-6). -8 Let d = 123 + -122. Let l(m) = -31m*3 + 1. Give l(d). -30 Let d(n) = -4n*2 + 18n*2 + 1 - 3n - n*2 + 9n*2 + 2n. Give d(1). 22 Let y(g) = -2g3 - 3g*2 + 3g - 3. Let v be -2(-5)/(-45)(-27)/3. What is y(v)? -25 Let l(p) = -7p2 + 7p + 6. Let k(s) = -s - 1. Let d(r) = 6k(r) + l(r). Suppose 0 = 2j - 3 - 1. Suppose 3 = jq - 5q. What is d(q)? -8 Let o = 11 - 1. Let p(v) = v*3 - 10v2 - v + 13. Let c be p(o). Let j(n) = n2 - 4n + 2. Give j(c). -1 Let w(c) = -4c*3 + 8c*2 + 8c. Let g(r) = -11r3 + 23r*2 + 24r - 1. Let v(q) = -3g(q) + 8w(q). Determine v(6). -9 Let r(n) = -n*3 - 21. Let g(v) = -8v*2 - 27v + 42. Let o(q) = 3q2 + 9q - 14. Let i(t) = -4g(t) - 11o(t). Let p be i(7). What is r(p)? -21 Let c(i) = i*2 - i + 1. Let r(p) = -9p*2 + 4p - 12. Let t(w) = 24c(w) + 3r(w). Let l(d) = -d*2 - d. Let j(o) = 2l(o) - t(o). Calculate j(-8). -4 Let i = 83 - 76. Let p(j) = 15j - i - 12j - 2*j. Give	{ "pile_set_name": "DM Mathematics" }
01 + 111101010? 111100101 In base 11, what is -210 + 1? -20a In base 8, what is 1374 + 0? 1374 In base 11, what is -6 - 16? -21 In base 3, what is 2 - -2220222? 2221001 In base 9, what is -2 - 1? -3 In base 14, what is 1a33 + -3? 1a30 In base 12, what is 28 - 137? -10b In base 14, what is 10 - -1c? 2c In base 11, what is 13 + -15? -2 In base 9, what is -1 - -35? 34 In base 2, what is -11100001110011 - -10? -11100001110001 In base 16, what is 295 + 8? 29d In base 5, what is 40400 - 2? 40343 In base 12, what is -5 - 63? -68 In base 7, what is 30 + -21? 6 In base 16, what is -96 - 4? -9a In base 2, what is -1000000011 - 0? -1000000011 In base 6, what is -23 + 3? -20 In base 3, what is -1000010 - 2? -1000012 In base 11, what is -4 + -197? -1a0 In base 10, what is 707 - 4? 703 In base 15, what is 2 - 27? -25 In base 11, what is 279 - -2? 280 In base 3, what is -221 - 2211? -10202 In base 10, what is 70 + 4? 74 In base 5, what is 3 + 31? 34 In base 13, what is 7 + -3c? -35 In base 14, what is 25 + -d? 16 In base 12, what is -3641 + 5? -3638 In base 14, what is 82 - -2d? b1 In base 16, what is -135 + -2? -137 In base 7, what is -5 - 1? -6 In base 6, what is -1 + 12144? 12143 In base 7, what is -3 - -5614? 5611 In base 13, what is 1c + 4? 23 In base 3, what is 100102 + -10? 100022 In base 11, what is 2 + 50? 52 In base 6, what is -4 - -102? 54 In base 3, what is 1 - -2111? 2112 In base 11, what is -20 + -12? -32 In base 3, what is -1 + 121000? 120222 In base 15, what is 36 - b? 2a In base 11, what is -64 + -1? -65 In base 8, what is 3 + 2266? 2271 In base 7, what is -1 - -26? 25 In base 12, what is -10 - 7? -17 In base 3, what is -10 + 20021? 20011 In base 12, what is 32 + 5? 37 In base 15, what is -13 - 173? -186 In base 13, what is 2 - -599? 59b In base 16, what is 2e + -8? 26 In base 8, what is 6371 + 5? 6376 In base 15, what is -5 + -972? -977 In base 13, what is 1c - 6? 16 In base 8, what is 17 + 153? 172 In base 6, what is -2 - -122? 120 In base 8, what is -111175 + 5? -111170 In base 4, what is 1333 - 11? 1322 In base 11, what is 2 - -3819? 3820 In base 12, what is -206a + -3? -2071 In base 13, what is -10 + 784? 774 In base 5, what is 10 + 1203? 1213 In base 15, what is 33 - 1? 32 In base 2, what is -1101010 - 0? -1101010 In base 4, what is 333 + 3? 1002 In base 16, what is b - 25? -1a In base 4, what is -2001 - 12? -2013 In base 4, what is 3 + 31003? 31012 In base 8, what is -2 - 2236? -2240 In base 8, what is 15 - 17? -2 In base 11, what is -a0 + 1? -9a In base 15, what is -4b1 - -3? -4ad In base 12, what is 19 + 180? 199 In base 8, what is -10 - -15? 5 In base 4, what is -1003222 + -10? -1003232 In base 16, what is 0 + 614? 614 In base 5, what is -10 - 20340? -20400 In base 5, what is -24 - 3? -32 In base 3, what is 110122 - 1100? 102022 In base 6, what is 23044 + -1? 23043 In base 13, what is 14b13 + 5? 14b18 In base 13, what is 6 + -24c2? -24b9 In base 14, what is -1 - 166b? -166c In base 2, what is 11 + -100100110? -100100011 In base 16, what is 59 - 8? 51 In base 14, what is a + 2? c In base 11, what is -25 - -1? -24 In base 15, what is -91 + 2e? -62 In base 13, what is 50c - -2? 511 In base 4, what is 310230 + -1? 310223 In base 11, what is 27 - 1a? 8 In base 5, what is -100 - -34? -11 In base 16, what is -8 + a? 2 In base 2, what is -11 - -11101011? 11101000 In base 7, what is 2662 + -2? 2660 In base 12, what is -5 - -51? 48 In base 7, what is -3 - -5340? 5334 In base 6, what is 0 - -424? 424 In base 12, what is 2 - 90? -8a In base 6, what is -24 + -41? -105 In base 11, what is -3 + 1a5? 1a2 In base 8, what is 744 - 4? 740 In base 10, what is -2 + -35? -37 In base 6, what is 312 + -2? 310 In base 2, what is -11100111 + 100? -11100011 In base 10, what is 77 + 6? 83 In base 13, what is 3 - -14b? 151 In base 9, what is 305 + -102? 203 In base 13, what is -394 - -4? -390 In base 8, what is -1547 - 5? -1554 In base 11, what is 0 - -28? 28 In base 10, what is -1363 - 0? -1363 In base 10, what is 4 + -250? -246 In base 11, what is -128 + 13? -115 In base 7, what is 501 - 3? 465 In base 3, what is 21 - 1101121? -1101100 In base 5, what is 130200 - 10? 130140 In base 16, what is -b - -f3? e8 In base 9, what is -14 - 444? -458 In base 12, what is 120 - -b? 12b In base 9, what is 3 - -43? 46 In base 11, what is 134 - 0? 134 In base 7, what is -4 - 136? -143 In base 12, what is -b + 19? a In base 12, what is -61 + -4? -65 In base 15, what is -28 + 5? -23 In base 2, what is 10110011100111 - 1? 10110011100110 In base 4, what is -233212 - -10? -233202 In base 6, what is -134 - 20? -154 In base 11, what is 111 + -13? a9 In base 2, what is -1000101101 + 10? -1000101011 In base 6, what is 2 + -104? -102 In base 5, what is 12 - -3? 20 In base 2, what is -1111 - 11? -10010 In base 9, what is -1 + 21? 20 In base 12, what is 2 + 112? 114 In base 5, what is -404 + 23? -331 In base 5, what is -21423 + 3? -21420 In base 10, what is 4 - 894? -890 In base 12, what is 63 - -43? a6 In base 15, what is -2 + 513? 511 In base 10, what is 620 + -3? 617 In base 2, what is 100101110100 - -1? 100101110101 In base 5, what is -1 - 1104? -1110 In base 7, what is 26 - 362? -333 In base 8, what is -13 + -46? -61 In base 16, what is 1 + -c? -b In base 11, what is 0 - -44? 44 In base 13, what is 91 + -5c? 32 In base 2, what is -11 + -10001? -10100 In base 14, what is c76 + 0? c76 In base 3, what is -2111 + -1? -2112 In base 11, what is -1 - 21a? -220 In base 11, what is -3 + -2a? -32 In base 10, what is -540 - -2? -538 In base 13, what is -8 - 2? -a In base 15, what is 18d - 3? 18a In base 16, what is -57 + -1? -58 In base 5, what is 3 - 40? -32 In base 10, what is -64 + 4? -60 In base 13, what is 42 - -c4? 136 In base 2, what is 1000001 - -111? 1001000 In base 7, what is 54 + -501? -414 In base 10, what is -32 + 5? -27 In base 3, what is -11 - 102212? -110000 In base 5, what is -3 + 2? -1 In base 9, what is 0 - 572? -572 In base 8, what is -212 + -12? -224 In base 14, what is 23 - 10? 13 In base 5, what is 311 - 31? 230 In base 13, what is -1 + -15? -16 In base 15, what is -a - 278? -283 In base 3, what is 1020210 - 0? 1020210 In base 4, what is -1210 + 200? -1010 In base 5, what is 314 + -1110? -241 In base 13, what is -5 + -12? -17 In base 9, what is -2213 + -5? -2218 In base 15, what is 1c1 + 9? 1ca In base 5, what is -4 + 20413? 20404 In base 6, what is -2 - 252? -254 In base 9, what is 10632 + 5? 10637 In base 5, what is 0 - -134? 134 In base 3, what is -201200 - -1? -201122 In base 4, what is 1031 + 12? 1103 In base 7, what is 5 - 1540? -1532 In base 13, what is -4 + 84? 80 In base 8, what is -76 + -203? -301 In base 10, what is -3 + 3? 0 In base 2, what is 1000111 + -1? 1000110 In base 11, what is -2378 + 0? -2378 In base 15, what is a - 475? -46a In base 6, what is 334 - 2? 332 In base 2, what is 1 - -100010? 100011 In base 14, what is 2 - -44? 46 In base 6, what is 432 - -101? 533 In base 16, what is 1 + -11a2? -11a1 In base 12, what is -3 + -120? -123 In base 10, what is -40 + 24? -16 In base 2, what is -101 + 100000110? 100000001 In base 7, what is 156 - 20? 136 In base 7, what is 164 - -1? 165 In base 4, what is -22300 - -1? -22233 In base 11, what is -1 + 4118? 4117 In base 9, what is 178 + -12? 166 In base 14, what is -5 + 9? 4 In base 8, what is -13 - -4? -7 In base 14, what is 19 - -2c7? 302 In base 5, what is -2 + -1003? -1010 In base 2, what is -1110 - -100? -1010 In base 4, what is -10 - -313222? 313212 In base 10, what is 396 + -4? 392 In base 3, what is -212 - -202? -10 In base 9, what is -26 - 5? -32 In base 11, what is -2 - 27? -29 In base 10, what is -24 + 5? -19 In base 2, what is -10000000101 - -100? -10000000001 In base 6, what is 4 + -220? -212 In base 14, what is -20 - -19? -5 In base 8, what is -3676 + -1? -3677 In base 5, what is -2412202 + -3? -2412210 In base 14, what is 0 + 135? 135 In base 14, what is 5 - -74? 79 In base 8, what is -4 + -3352? -3356 In base 13, what is 1a3a - 4? 1a36 In base 10, what is -30 - 11? -41 In base 13, what is -1545 - 5? -154a In base 12, what is -460 - 2? -462 In base 16, what is -1 - 1c? -1d In base 9, what is 4 - 358? -354 In base 14, what is -120 - -5? -119 In base 6, what is 0 - -11540? 11540 In base 7, w	{ "pile_set_name": "DM Mathematics" }
uming y is positive. y*(-28/3) Simplify ww*20(w/(ww/w(-4/13)))/w assuming w is positive. w(243/13) Simplify (f(-1/4))35f/(f/f*(1/5)f)f/(f/((f/(ff*7))/f)f) assuming f is positive. f(-371/20) Simplify (x(-4/9)(xx/(((x/(x(-2/11)/x))/x)/x))/x)/(x0/x(-2)) assuming x is positive. x(-161/99) Simplify (((p(-2/7)/p)/p)/p)(2/45)p(-1)/(p/(p/(pp*0p))) assuming p is positive. p(-991/315) Simplify (v/(v/v(-1/18)))/((v(-1/8)/v)/v) assuming v is positive. v(149/72) Simplify ((ww(-1/15)/w)/(w/((w(-5)/ww)/w)))/(w(-1/2)/(w(2/17)w)) assuming w is positive. w(-2779/510) Simplify (((r/(rr*(-20))r)/r)/r)/r(1/2) assuming r is positive. r(37/2) Simplify ((gg(-6))13)(-8) assuming g is positive. g520 Simplify kk/(k*(-6)k)k4k*(2/7)/(kk*(2/5)kk) assuming k is positive. k(276/35) Simplify (((i(-3)ii)/i)/i0)/(i/(ii*2)i(2/7)) assuming i is positive. i(-2/7) Simplify (yy/y(-1/15))/y(-10) assuming y is positive. y(181/15) Simplify (a/a(-3))/a(-5/7) assuming a is positive. a(33/7) Simplify (l(-1/4)/l(-1/2))(-11) assuming l is positive. l(-11/4) Simplify m2m/((mmm/(m(-4)/m))/m) assuming m is positive. m(-4) Simplify (i(-1/3)/i5)/(i*(-1/5)i/(i*1/iiiii)) assuming i is positive. i(-32/15) Simplify (w/w(2/27)w(-1/3))16 assuming w is positive. w*(256/27) Simplify (w/(ww0))(5/6)/(w/w*6w10/w) assuming w is positive. w(-4) Simplify (nn(2/7))7(n1)(-39) assuming n is positive. n(-30) Simplify (k(2/3))*(3/22)k*(-2/9)k(-2/7) assuming k is positive. k(-289/693) Simplify (s/(ss(-5/3)))/s(-8)(s(1/3)/s)(12/13) assuming s is positive. s*(353/39) Simplify (cc*(-3/11)(c(-4)/c)/c)30 assuming c is positive. c(-1740/11) Simplify h14/(h1/h) assuming h is positive. h14 Simplify (x*(-1)x/(xxx/(x/x*(1/4))xxx))/((x/x(2/3))/x(2/9)) assuming x is positive. x(-193/36) Simplify ((n(-4)/nn)(-3/10))32 assuming n is positive. n(192/5) Simplify p(9/5)/pp(-2/9) assuming p is positive. p(26/45) Simplify m/(mm(-1/13)m)m(-11) assuming m is positive. m(-155/13) Simplify gggg/g*1g*(-2)gg0g*(1/5)/ggg assuming g is positive. g(16/5) Simplify (zzz(4/11)zz)/zz22 assuming z is positive. z(279/11) Simplify (r*(4/7)/(rr*(-3/4)/r))/((rr/(rr3))/r(-4)) assuming r is positive. r(-19/28) Simplify (ii*(-1/6)i)(-15) assuming i is positive. i(-55/2) Simplify (h2)(-9/5)/(h/(h(-1)/h))(-37) assuming h is positive. h(537/5) Simplify o(-18)/(o(-9)/o) assuming o is positive. o(-8) Simplify (o(-31))(-3) assuming o is positive. o*93 Simplify (hh(-2/7))(-2/39)h6/(h8h) assuming h is positive. h(-829/273) Simplify j(-2/29)/jj(-6)j assuming j is positive. j(-176/29) Simplify (k(-1/2)kk/((((k/(kk(k/k*(1/6))/k)kk)/k)/k)/k))/((k(2/5)k)/k)(3/28) assuming k is positive. k(691/210) Simplify r*3/((rr*(2/3)r)/r)r(-1/3)rrrr(2/3)r assuming r is positive. r*(17/3) Simplify kk*(-13)((k(k/k28k)/kk)/k)/k assuming k is positive. k(-39) Simplify v4/v(-7) assuming v is positive. v11 Simplify (z(-1))(5/17) assuming z is positive. z(-5/17) Simplify (t/(t(2/7)t))*(-49)/(t/(tt*(-6))t(1/7)) assuming t is positive. t(55/7) Simplify (a*(-2)a)*(5/21)((aa2)/a)15 assuming a is positive. a(625/21) Simplify (mmm6m(-2))/(m/m(-2/19)m/(mm/(m/((m/(m*(-1/5)m)m)/m)))) assuming m is positive. m(484/95) Simplify n(-1/15)((n*(2/71)n)/n)/n assuming n is positive. n*(-1106/1065) Simplify ((zz*(-3))/((zzz/(z(3/4)zz)zz)/z))(-34) assuming z is positive. z(221/2) Simplify o(-21)((oo13)/o)/o assuming o is positive. o(-9) Simplify ((ww*(-21))/wwww)/(w*29w) assuming w is positive. w(-48) Simplify y22y/(yy*(1/8))y assuming y is positive. y(183/8) Simplify (p/p(-17))/pp(6/11)p assuming p is positive. p(204/11) Simplify (t(-1)/t)*(-2/3)/(((tt8)/t)/(t(3/2)t)) assuming t is positive. t(-25/6) Simplify (((q(2/15)q)/q)/qq(-16))49 assuming q is positive. q(-12397/15) Simplify (a/(a(3/10)a))(-26) assuming a is positive. a(39/5) Simplify (p(2/23)/(p(2/25)/p))(-18/13) assuming p is positive. p(-10422/7475) Simplify i*(-2/5)/i(i/(i/(i/(i*8i))))/i assuming i is positive. i*(-52/5) Simplify (a/((aa(-3)/a)/a))(-14/11)(a/(a10/a))/a(-3/2) assuming a is positive. a(-283/22) Simplify k(-19)kk/(k(2/23)k)k assuming k is positive. k(-393/23) Simplify (r(1/2))(-13)/(r2/rr)(-26/3) assuming r is positive. r(65/6) Simplify ((k*5k)/(k(k/((k/(k/(((kk*(-5)/kk)/k)/k)))/k)k)/k))(-1/32) assuming k is positive. k(3/32) Simplify ((qq*(1/8)/q)/(q/((qq6)/q)))/(q7qq(-2/9)) assuming q is positive. q(-191/72) Simplify t(5/2)/t(-11) assuming t is positive. t*(27/2) Simplify (dd(-1/5))(-33)d(3/5)/d(5/7) assuming d is positive. d(-928/35) Simplify (ll(7/4))/l(-2)(l(-1))(-29/4) assuming l is positive. l12 Simplify ((a/(aa/(aa/(aa/(a/((aa(1/4))/aa))a)a))a)(-18))(4/15) assuming a is positive. a(6/5) Simplify (m(-6)m)/(m*(3/5)m)m/m2m(-5) assuming m is positive. m(-63/5) Simplify (ff/f0f)/f*3f/f*(-5)f/(((ffffff(-1/2)fff)/f)/f) assuming f is positive. f*(3/2) Simplify (m/((m/(mm(2/9)))/m))(-3/5) assuming m is positive. m(-4/3) Simplify (r(-2/9))*7/((r/((rr/(rrr/(r*(-3/7)/r))r)/r))/((r*(1/11)r)/r)) assuming r is positive. r(-3391/693) Simplify (g/g(-25))/g(2/11) assuming g is positive. g(284/11) Simplify ((j/((jj/((jj*(3/8)j)/j)j)/j))/(j0/j))/(((j/(j(j/(jj(-2/5)))/jjjj)jj)/jj)/j6) assuming j is positive. j(311/40) Simplify ((m(-1/12))24)(-30/7) assuming m is positive. m(60/7) Simplify (nn(-13/3)/n)/n24 assuming n is positive. n(-85/3) Simplify (d/(d(-4/3)/d))(-1/18) assuming d is positive. d(-5/27) Simplify (r/r*6r)/(r/(r*(-7)/r))((rrrr(-1/2))/r)/((r(-8)/r)/rr) assuming r is positive. r*(-5/2) Simplify jj/j*(-23)j/j8 assuming j is positive. j18 Simplify ((w/(w/(w/w(-26))))/w)(-38) assuming w is positive. w(-988) Simplify (h(-2)/h)/h(h/(h(-9)/h))/h assuming h is positive. h6 Simplify uuu0uu(-2/11)(u(-2/3))(-24) assuming u is positive. u(207/11) Simplify a(1/3)/aa(-1/6) assuming a is positive. a(-5/6) Simplify ((nnn2/n)18)23 assuming n is positive. n1242 Simplify (k(2/3)kk)(6/17)/(k1)(2/19) assuming k is positive. k(270/323) Simplify ((y/(yy/(y/y3)))28)10 assuming y is positive. y(-840) Simplify z(2/23)/z(-4)z(-1)z1 assuming z is positive. z(94/23) Simplify (s*(1/18)/s)/(s/(s/(s/(ss(ss(ss(-1/7))/s)/s)))) assuming s is positive. s(115/126) Simplify q/q*(-2/43)q/(q/(q*8q)) assuming q is positive. q(432/43) Simplify ((y/y0)/y)(-4)/(y(-1/3)y)(-1/53) assuming y is positive. y(2/159) Simplify ((s/(s/s(-3)s))/s*0)/((ss*(-2/5))/(ssss*(-6)ss)) assuming s is positive. s(-28/5) Simplify (xxx(2/11))/((xx(x/(x/x(-6/7)))/xx)/xx)(x*4x)/x3 assuming x is positive. x(234/77) Simplify ((xx(-16)x)/(x*(1/5)x))(1/52) assuming x is positive. x(-19/65) Simplify z*17/(zz/z32) assuming z is positive. z47 Simplify ((a/(((a*(3/11)a)/aa)/a))/(a/a1))(-24) assuming a is positive. a(-192/11) Simplify ((m(-1/2)m)/mm)(-45)(m/(m*0m))(24/7) assuming m is positive. m(-45/2) Simplify (((((k/k*(10/11)kk)/k)/k)/k)/(k(-3/4)/k))(-1/9) assuming k is positive. k(-37/396) Simplify (q(-9)/q)/q13 assuming q is positive. q(-23) Simplify (k/k(1/3))(3/20)(k/k(1/4))(-22) assuming k is positive. k(-82/5) Simplify p(-1/6)/(p/(p(pp*(-1/2)/p)/pppppp)) assuming p is positive. p(10/3) Simplify ((o(-2/35)/o)/o(5/7))(-2/77) assuming o is positive. o(124/2695) Simplify (m(4/7)m(2/9))/(m/(m(-2)m)mm/(m/m(5/2))) assuming m is positive. m(-593/126) Simplify n/((nn(-29)n)/n)nn(-3/11) assuming n is positive. n(327/11) Simplify	{ "pile_set_name": "DM Mathematics" }
s(g) = g + 0g + 0 + 0. Give s(c(j)). -j2 Let y(o) = 11o*2 + 5. Let b(u) = 6u*2 + 3. Let m(j) = -5b(j) + 3y(j). Let l(x) = 9x. Calculate m(l(d)). 243d2 Let v(x) = x2. Let p(u) = u + 1. Let m(b) = -7b - 6. Let o = -6 - -7. Let h(z) = om(z) + 6p(z). Determine v(h(a)). a*2 Let g be 1/2 - (-6)/4. Let p(b) = -b - 3 + 3 + gb. Let z(t) = 6t + 4. Let w(u) = -7u - 5. Let s(y) = 4w(y) + 5z(y). Determine s(p(l)). 2l Let t(p) = 14p. Let r(l) = -7l2. Calculate t(r(v)). -98v2 Let h(i) = -i2 - 3i. Let d(g) = -g. Let q(l) = 12d(l) - 4h(l). Let x(s) = 2s*2. What is q(x(z))? 16z*4 Let l(g) = -4g*2. Let q(h) = 17h - 1. Calculate l(q(o)). -1156o2 + 136o - 4 Suppose -4o + 17 = -3b, 0b = -2o - 4b - 8. Let j(c) = -13c - 2co + 13c. Let v(w) = 3w. Give j(v(g)). -18g2 Let h(u) be the first derivative of -u2 - 1. Let f(c) = 2c - 2c - c. Calculate h(f(p)). 2p Let f(q) = -9q*2. Let z(r) = 2r + 10. Calculate f(z(h)). -36h2 - 360h - 900 Let x(i) = 1 - 1 - 4 + 3. Let b(z) = -18z - 27. Let a(n) = b(n) - 27x(n). Let c(l) = l. What is a(c(u))? -18u Let g(j) = -6 + 14 - 9. Suppose 2t + t = 5f - 2, 2 = 5t - 3f. Let i(b) = -b - 4. Let n(k) = ti(k) - 4g(k). Let y(p) = -2p. Calculate y(n(c)). 2c Let q(u) be the first derivative of u3 - 3. Let v(j) be the second derivative of 5j*4/12 + 3j. Give q(v(g)). 75g4 Let d(u) = 2u. Let c(r) = -269r2. What is d(c(h))? -538h*2 Let s(t) = -3706t. Let v(z) = 2z2. What is v(s(i))? 27468872i*2 Let f(v) = v - 17. Let j be f(12). Let x(r) = -r - 1. Let a(c) = 3c + 4. Let m(b) = ja(b) - 20x(b). Let h(n) = -2n. Give h(m(w)). -10w Let i(m) = -3m2 - 13. Let r(a) = -22a*2 - 3. Give r(i(s)). -198s*4 - 1716s*2 - 3721 Let i(z) = 88z - 26z - 32z - 32z. Let r(n) = 9n*2 + 5n - 5. Let h(j) = -j*2 - j + 1. Let k(x) = -10h(x) - 2r(x). Determine i(k(u)). 16u*2 Let t(n) = -14n. Let d(h) = -2h2. What is t(d(p))? 28p2 Let w(p) be the second derivative of p3/2 + 6p. Let z(t) = 2t*2. Determine w(z(o)). 6o*2 Let i(c) = -6c*2. Let t(n) = 9n*2. Determine t(i(g)). 324g4 Let k(d) = d2. Let h(v) = 2v2 + 4v + 4. Let x(j) = -3j2 - 7j - 7. Let y(t) = 7h(t) + 4x(t). Determine y(k(a)). 2a4 Let v(l) = 7l*2 - 6. Let z(h) = 8h*2 - 7. Let r(b) = -7v(b) + 6z(b). Let n(a) = 10a*2. What is n(r(o))? 10o*4 Let p(f) = -8f*2 - 2f. Let i(n) = -n. Give p(i(v)). -8v2 + 2v Let q be (1 - 14/8)-8. Let l(p) = -qp - p + 5p. Let i(a) = -a - 24 + 24 - 2a. Calculate i(l(r)). 6r Let n(t) = t. Let w(x) be the second derivative of x + 1/2x*3 + 0 + 0x*2. Give w(n(g)). 3g Let y(l) = 5l2. Let f(q) be the first derivative of q5/20 - q2/2 - 7. Let p(t) be the second derivative of f(t). Give p(y(u)). 75u*4 Let s(c) be the third derivative of 0c*3 + 1/24c*4 + 0c + 0 + 2c2. Let d(a) be the first derivative of -a2 - 2. Give s(d(p)). -2p Let l(t) be the third derivative of t*4/24 + 19t*2. Let p(g) = -40g*2. Give p(l(j)). -40j*2 Let z(k) = 34k2. Let b(c) be the second derivative of -c3/3 - c. Calculate b(z(y)). -68y2 Let d(f) be the third derivative of -f4/8 - 13f2. Let c(q) be the second derivative of -q4/6 - q. Determine c(d(h)). -18h2 Let l(m) = 4m*2 - 3m. Let s(q) be the first derivative of 7q3/3 - 5q*2/2 + 2. Let n(d) = 5l(d) - 3s(d). Let v(t) = 2t. Calculate n(v(i)). -4i2 Let g(z) = -1836z. Let j(p) = -2p. Give j(g(f)). 3672f Let i(h) = 5h. Let b(l) be the second derivative of 7l*4/12 - 23l. What is i(b(p))? 35p2 Let f(r) be the second derivative of -1/4r*4 + 0r*3 + 5r + 0 + 0r2. Let a(h) = h. Determine f(a(p)). -3p*2 Let z(c) = 4c. Let j(f) = 12f. Let m(v) = 7v. Let t(b) = -3j(b) + 5m(b). Calculate t(z(o)). -4o Let w(i) = -i2. Let j(r) = r - 1. Let s(l) = 11l + 9. Let t(q) = 6j(q) + s(q). Calculate w(t(v)). -289v*2 - 102v - 9 Let g(k) = 9k. Let d(b) = -b. Let t(m) = -6d(m) - g(m). Let j(l) = l*2. Calculate t(j(v)). -3v*2 Let z(n) = 798n*2. Let j(l) = 2l*2. What is z(j(g))? 3192g4 Let c(g) = g2. Let s = -10 + 24. Let n(z) = 4z2 - 5. Let v(q) = -12q*2 + 14. Let u(a) = sn(a) + 5v(a). Give c(u(l)). 16l*4 Let o(p) = -213p. Let i(r) = 2r2. Determine o(i(n)). -426n*2 Let j(b) = -2b*2. Let v(p) be the third derivative of 0p*3 + 0 + 0p*4 + 5p*2 + 1/15p*5 + 0p. Calculate v(j(s)). 16s4 Let x(p) be the first derivative of -p5/120 - 2p*3/3 - 1. Let i(a) be the third derivative of x(a). Let s(b) = b + 0b - 3b + 5b. What is s(i(g))? -3g Let r(v) = -3v. Let n(g) = -9g + 14. Determine n(r(u)). 27u + 14 Let i(v) = -2v2. Let j(o) = -11o - 1. What is i(j(k))? -242k2 - 44k - 2 Let s(a) = 3 + a*2 - 3. Let t(i) be the first derivative of -9i*2/2 - 108. Determine t(s(n)). -9n*2 Let o(s) = -2s*2. Let d(a) = 636a*2. Calculate d(o(p)). 2544p*4 Let u(k) = k + k - 4k. Let p(o) be the third derivative of -17o4/24 + 37o*2. Calculate p(u(f)). 34f Let d(n) = 14n - 11n + 4 - 4. Let i be ((-2)/(2/(-3)))/1. Let u(w) = w*2 + 3w - 3. Let v(j) = j*2 + j - 1. Let m(y) = iv(y) - u(y). Give d(m(q)). 6q2 Let i(k) = 2k + 199. Let w(r) = -4r. Give i(w(p)). -8p + 199 Let v(g) = g. Let y(f) = 1775f. Calculate y(v(c)). 1775c Let i(j) be the third derivative of -1/6j4 + 0 + 0j - 2j2 + 0j*3. Let g(s) = s. Let o(d) = -4d. Let u(c) = 5g(c) + o(c). Calculate u(i(t)). -4t Let i(k) = -41 + 41 - 4k. Let r(z) = -24z. Give r(i(v)). 96v Let l(d) = -3d. Let f(u) = 10u. Let m(h) = h. Let k(c) = f(c) - 2m(c). Determine k(l(t)). -24t Let b(s) = -12s*2. Let x(y) = y - 77. What is b(x(l))? -12l*2 + 1848l - 71148 Let b(u) = 30u2 - 2u. Let k(g) = 5g - 6g + g + g. Determine b(k(d)). 30d2 - 2d Let f(a) = 3a. Let u(b) = -42b. Let i(h) = 27f(h) + 2u(h). Let y(o) = -3o. Let m(j) = 20j. Let l(t) = 3m(t) + 21y(t). Give i(l(n)). 9n Let d(h) = h2 - 2 + 2. Let f(b) = -3b*2 + 5b. Let s(y) = -y*2 + y. Let z be 50/4(-12)/(-30). Let o(g) = zs(g) - f(g). Calculate d(o(w)). 4w*4 Let f(v) = -7v + 2v + 4v. Suppose -h = 3, 0x + 4x = 2h + 10. Let i(o) = -3o*2 - x + 0 + 1. Give i(f(d)). -3d*2 Let v(k) = 2k*2 - 5k*2 + 4k*2. Let f(p) be the first derivative of -5p*3/3 + 2. What is v(f(q))? 25q*4 Let n(z) = -88z*2. Let t(h) = 3h*2 + 6h*2 - 11h*2 + 4h*2. Give n(t(x)). -352x*4 Let t(s) = 5s*2 - 3. Let u(p) = -9p*2 + 5. Let f(v) = 5t(v) + 3u(v). Suppose 0 = -3h + 2 + 4. Let o(n) = -2 + h + n*2. Determine o(f(j)). 4j4 Let o(t) = t. Let q(v) = -v + 8. Let g be q(6). Let f(a) = a2 + 0ag - 2a2. Determine f(o(d)). -d2 Let l(w) = 2w2 + 44w. Let o(j) = j*2 - 293 + 293. Give l(o(f)). 2f*4 + 44f*2 Let t = -4 + 4. Let y(i) = i + ti + i. Let g(k) = 2k2. Give g(y(p)). 8p2 Let m = 11 + -8. Let u(i) = i2 + 8i + 2. Let f be u(-8). Let h(a) = ma - fa + 2a*2 - a. Let p(n) = 2n*2. Calculate h(p(d)). 8d*4 Let r(j) = -40j + 3. Let w(n) = n. Calculate w(r(x)). -40x + 3 Let z(b) = -8b*2 - 858 + 858. Let m(w) = -4w + 5. Let f(p) = -3p + 4. Let g(x) = 5f(x) - 4m(x). Determine z(g(i)). -8i*2 Let y(c) = 2c + 88c2 - 82c*2 - 2c. Let z(q) = 0q + 2q - q. What is y(z(x))? 6x2 Let x(w) be the second derivative of w4/6 + 7w. Let t(r) = r. What is t(x(j))? 2j2 Let q(i) = -3i2. Let f(n) = n2 + n + 1. Let b(v) = -3v - 3. Let y(p) = b(p) + 3f(p). What is q(y(s))? -27s4 Let c(r) = -r2 - 14r - 11. Let i be c(-13). Let k(b) = -b2 - b2 + ib2 - 2b*2. Let h(d) = 0d - 6d + 3d. What is h(k(y))? 6y2 Suppose -4f + 73 - 17 = 0. Let o(n) = 5n - 14 + f. Let z(t) = 2t. Give o(z(w)). 10w Let q(t) = 4t. Suppose -4y - 17 - 34 = -5c, 3c = -y + 34. Suppose -n + 0 = -11. Let d(x) = x - n + c. Calculate q(d(g)). 4g Let n(j) be the first derivative of -j*3/3 - 15. Let o(l) = -l + 2. Let q(r) = -3r + 7. Let z(a) = 21o(a) - 6q(a). What is n(z(v))? -9v2 Let q(j) = 5j. Let d(t) = -t + 6. Give q(d(p)). -5p + 30 Let u(i) = -11i + 10 - 10. Let h(b) = 2b. Calculate h(u(j)). -22j Let v(t) be the second derivative of -2t3/3 + 2t. Let k(r) = -5r2. Let z(u) = u*2. Let c(q) = -k(q)	{ "pile_set_name": "DM Mathematics" }
127? 127 Which is smaller: 3/124 or 0? 0 Is 1 bigger than -3/59? True Are 2 and -802 non-equal? True Which is bigger: 1231 or 1233? 1233 Is 1 equal to 15? False Which is smaller: -301 or -272? -301 Is 134 greater than -6/17? True Is -440 less than -440? False Which is smaller: 71 or -2/3? -2/3 Which is greater: 43 or -5? 43 Which is bigger: 101 or 716/7? 716/7 Are -1 and 21/374 equal? False Which is greater: -1.15 or -2? -1.15 Which is greater: 6/37 or 1? 1 Which is greater: -5705 or -11411/2? -5705 Which is greater: 693 or 2/21? 693 Which is smaller: 0 or 1/284? 0 Is -1 >= -3113? True Which is greater: 46 or 134/3? 46 Which is smaller: -219 or 6? -219 Is -343 <= -343? True Which is bigger: 0.22 or -1/217? 0.22 Is -1 > -0.005? False Is -69/10 equal to -6? False Is -3/2 smaller than -230? False Is 1 < 7/950? False Which is smaller: 159 or 8? 8 Which is bigger: 0 or 300? 300 Is -1 bigger than -1/47? False Which is smaller: 298 or 301? 298 Which is smaller: 2 or -3/13? -3/13 Is 379 >= 405? False Which is greater: 34/35 or 1? 1 Are -542 and -1081/2 nonequal? True Are 0 and 92.25 non-equal? True Is 3 != 126? True Which is bigger: -1237 or -1239? -1237 Is 6 <= 1586? True Is 1 greater than 7/2428? True Which is smaller: -1 or 7/340? -1 Is 0.1 greater than or equal to 4629? False Is 435 at most 4? False Which is greater: 1 or -1/11496? 1 Which is smaller: -13 or 9? -13 Which is greater: -1 or -5/18? -5/18 Do 3.2 and 1.9 have the same value? False Which is smaller: -190 or -189? -190 Is 2 smaller than -647? False Is 70 greater than -1? True Which is smaller: 1/50 or 0? 0 Which is smaller: -2.5 or 15? -2.5 Is -2 < -25/22? True Which is greater: -47 or -73? -47 Is -64/33 equal to -2? False Which is smaller: -2595 or -0.1? -2595 Is 4414 at most 4414? True Is -61 greater than or equal to -27? False Is -1 greater than or equal to 8/17? False Is 220/3 != 74? True Is -7/389 less than or equal to 1? True Which is greater: -1/41298 or 0? 0 Which is smaller: 107 or 111? 107 Is 484/5 less than 97? True Are 4 and -3/2 equal? False Which is greater: -124 or -119? -119 Which is smaller: 3 or 240/77? 3 Are 1 and 2/1811 equal? False Is 2 greater than 31/18? True Which is smaller: -5/14 or -1/4? -5/14 Are -7 and 46 unequal? True Which is greater: 5421 or -2/7? 5421 Which is bigger: 210 or 3381/16? 3381/16 Is -30 at least 113? False Is -1 greater than or equal to -3/1159? False Is 0.09 greater than 0.6? False Which is greater: 132 or 133? 133 Which is greater: -35 or -49? -35 Which is bigger: -1318 or -1317? -1317 Which is bigger: 54 or -9? 54 Is 15289 >= 76441/5? True Do 46 and -1 have the same value? False Which is greater: 0 or -2/795? 0 Which is smaller: -0.4249 or 1? -0.4249 Which is smaller: -287/3 or -96? -96 Which is bigger: 568 or 1133/2? 568 Which is smaller: 150 or 37? 37 Which is smaller: 419/4 or 106? 419/4 Is -134 greater than -136? True Do 14/13 and 20 have different values? True Which is smaller: 4 or 35? 4 Which is smaller: 3 or 47/96? 47/96 Which is bigger: -1/8 or -1? -1/8 Is 514/61 > 9? False Is -409 bigger than -819/2? True Which is smaller: 110 or -0.5? -0.5 Is -323/5 > -66? True Which is smaller: 182 or 191? 182 Which is smaller: -2/5 or 14/19? -2/5 Which is smaller: 696 or 698? 696 Is 1 bigger than -14/265? True Does 133 = -1? False Which is smaller: 0 or 2/47? 0 Is -1604 bigger than -1605? True Is 0 less than or equal to -1/1455? False Are -0.0085 and 1/2 nonequal? True Is -1 <= -22/1501? True Which is smaller: -153 or -159? -159 Which is bigger: 14 or 35? 35 Are 5/69 and -0.5 equal? False Which is smaller: -1 or -6/3319? -1 Is 2171 at least as big as 2172? False Is 4140 at least 4140? True Is -7566 greater than -52964/7? True Which is smaller: 6 or 168/25? 6 Which is smaller: 10416 or 0.1? 0.1 Is 0 greater than or equal to 3/4736? False Which is smaller: 1 or 30/791? 30/791 Is -2/583 less than 0? True Are 6429 and 6429 equal? True Is 11092 < 11093? True Is -39.9 < 2? True Which is smaller: -91 or -77? -91 Which is smaller: 2845/4 or 710? 710 Is -4933 at least -4932? False Is -0.06 greater than or equal to -0.31? True Which is smaller: -452 or -450? -452 Which is bigger: 41 or 35? 41 Is 116 bigger than 118? False Which is smaller: 3243 or 22705/7? 3243 Are -63 and -63 equal? True Which is smaller: 11971 or 11970? 11970 Are -42 and -46 equal? False Which is greater: -1 or -3/1183? -3/1183 Which is smaller: 15 or 17? 15 Which is bigger: -0.0217 or 30? 30 Which is greater: 1 or 2/1071? 1 Which is greater: -1040 or -1038? -1038 Is 1624/5 bigger than 326? False Which is greater: -664/7 or -96? -664/7 Is -210 > -208? False Do 1 and 94/391 have the same value? False Are -3877/3 and -1293 unequal? True Which is greater: 20 or -10? 20 Which is smaller: -96 or -89? -96 Is 2/5 > -472? True Which is smaller: -302 or -1203/4? -302 Is -1/257 at least as big as 0? False Is 0.0026 smaller than 3? True Which is smaller: 2 or 0.9? 0.9 Which is bigger: -41 or 0? 0 Is -8/575 not equal to -1? True Which is greater: -6/103 or -1? -6/103 Do 1 and -1/52 have the same value? False Which is bigger: 55 or 54? 55 Does -1/662 = 1? False Is -133 at least -141? True Are 107 and -19 nonequal? True Do -4239 and -4243 have different values? True Which is smaller: 0.34 or -11? -11 Which is greater: -4 or -49/17? -49/17 Is -0.12 > -2/9? True Is 1 bigger than -1/1595? True Is -3694 at least as big as -3695? True Which is bigger: -352 or -4585/13? -352 Which is smaller: -5856 or -5858? -5858 Which is smaller: 1 or 1/209? 1/209 Which is bigger: 1/3 or -33862? 1/3 Which is greater: 66 or 59? 66 Is 28480 greater than -2? True Which is smaller: 31 or 123? 31 Are 0 and -0.267 non-equal? True Which is greater: 14/17 or 0? 14/17 Which is greater: -205 or 14/3? 14/3 Is -2467 less than or equal to -2469? False Is -1 greater than or equal to -20/77? False Is 22 bigger than -14/3? True Which is bigger: 63 or -65? 63 Which is smaller: -4.2 or 3.9? -4.2 Is -8981 at least as big as -8981? True Which is smaller: -21 or -17? -21 Is -1/15 < -1? False Which is bigger: -864/35 or -24? -24 Which is smaller: -3605 or -3607? -3607 Which is smaller: 12 or 180/17? 180/17 Which is smaller: 157/17 or 8? 8 Do 2711 and 2712 have different values? True Which is bigger: -5222 or -5223? -5222 Does 743 = 746? False Which is smaller: -1/9 or 1? -1/9 Is 868/13 >= 67? False Are 1 and 286 equal? False Is 82 at least as big as -15? True Which is greater: 0.6 or 29/14? 29/14 Is 94 bigger than 94? False Is 1 less than or equal to -7? False Is 0 less than 5/2196? True Which is greater: 40 or 39? 40 Which is smaller: 90 or 19? 19 Which is smaller: 649/3 or -0.1? -0.1 Is -8 bigger than 300? False Do 10/9 and 1379 have different values? True Is -3 at least as big as 4/143? False Which is smaller: 246 or 239? 239 Which is smaller: -39 or -133? -133 Is 32/341 bigger than -1? True Is -1/5 greater than or equal to 61? False Which is bigger: -72.7 or -0.1? -0.1 Which is greater: -1/7 or -0.084? -0.084 Which is smaller: -159/10 or -15? -159/10 Is 0.05 equal to -3/134? False Which is greater: -47/67 or 0? 0 Which is bigger: -21 or -2? -2 Which is greater: -464/53 or -8? -8 Which is smaller: 1411 or 1413? 1411 Which is smaller: 15 or 32? 15 Which is bigger: -290 or -284? -284 Which is greater: -39/212 or -1? -39/212 Is -0.3 at least -23.9? True Is 21398 smaller than 21398? False Which is greater: 45/2 or 24? 24 Which is greater: -2/17363 or -1? -2/17363 Which is bigger: -99 or -493/5? -493/5 Does -5.4 = -1/3? False Is 1 bigger than 8/5745? True Which is smaller: -1/4637 or -1? -1 Which is bigger: -33 or -151? -33 Which is smaller: -8 or -370? -370 Which is smaller: 4/61 or 4? 4/61 Are -42 and -303/7 non-equal? True Which is bigger: 252 or 262? 262 Is 33 less than 33? False Is -8168 >= -2? False Which is smaller: 2/1871 or -1? -1 Which is bigger: -1 or -9/527? -9/527 Which is bigger: 0 or 9/283? 9/283 Which is smaller: 15280 or 15278? 15278 Do 36821 and 36820 have the same value? False Which is greater: -1/293 or 0? 0 Which is bigger: -0.03 or -0.029? -0.029 Is 519 at most as big as -4? False Is -183 smaller than -180? True Which is bigger: -97 or -120? -97 Which is bigger: -11/21 or 0.1? 0.1 Is -37 at most as big as -31? True	{ "pile_set_name": "DM Mathematics" }
n)/1 + 1. Find the first derivative of 1 - 15h3 + h3 + rh*3 wrt h. -42h*2 Let y(c) be the first derivative of 36 + 1/2c*2 - 1/4c*4 + 2c*3 - 3c. Find the second derivative of y(x) wrt x. -6x + 12 Suppose -4y + m = -3, -28 = y - 5m - 5. Find the second derivative of y - 10b - 8b2 - 9b*2 + 0 - 6b*2 wrt b. -46 What is the second derivative of -26076j*3 - 31 - 2j + 4j + 25980j*3 wrt j? -576j Let j(o) be the third derivative of -o*7/210 + 23o6/15 + o5/30 - 61o3/3 + 314o*2. Find the third derivative of j(d) wrt d. -24d + 1104 Differentiate 68t2 - 62t*2 + 6t + 2 - 71 wrt t. 12t + 6 Suppose -2t = -2k + 8, -3k + 5k = -2. Let g = t - -7. What is the second derivative of -3m + 7m + gm*4 - 10m4 - m4 wrt m? -108m2 Let l(v) be the second derivative of -3v*7/14 - 7v*6/30 + 63v*4/2 - 13v - 5. Find the third derivative of l(g) wrt g. -540g2 - 168g Suppose 1 + 3 = s. Suppose -w - 11 = -4r, r + 3w = -r + 9. What is the third derivative of 2d5 + 0d*4 + 0d*5 + 0d*s + rd*2 wrt d? 120d2 Let l(x) = x3 - 2x2 + x - 1. Let k(a) = -68a*4 + 4a*3 - 7a*2 + 3a - 85. Let z(m) = 2k(m) - 6l(m). What is the third derivative of z(f) wrt f? -3264f + 12 Let d(z) be the first derivative of 4z*5/5 - 15z4/4 + z3 + 68. Find the third derivative of d(n) wrt n. 96n - 90 Let i = -6 + 5. Let l(h) = 0h + 133h2 - h - 134h*2. Let n(d) = -7d*2 - 6d - 3. Let q(o) = in(o) + 6l(o). Differentiate q(j) with respect to j. 2j Let f(c) be the third derivative of 49c*6/24 + 91c*5/30 - 150c*2. Find the third derivative of f(a) wrt a. 1470 What is the third derivative of -58j*6 - 547j*2 - 2j + 277j2 + 271j*2 wrt j? -6960j*3 Find the third derivative of -79q*2 - 1458q*4 + 1458q*4 + 23q*6 wrt q. 2760q*3 Let s(a) be the third derivative of -23a*7/70 - 13a*5/20 - 2a*2 + 70. Find the third derivative of s(w) wrt w. -1656w Let m = 29 - 29. What is the second derivative of 4t + 4t - 10t2 + mt + 21t2 wrt t? 22 Let g(f) = -f4 + f3 + f - 1. Let m(v) = 45v*5 - 2v*4 - 3v*3 + 17v*2 - 3v + 1. Let r(p) = 3g(p) + m(p). Find the third derivative of r(a) wrt a. 2700a*2 - 120a Suppose 0p = p - 4, 0 = 4a - 4p. Find the second derivative of 8t*5 - 27t - 3343ta + 3343t*4 wrt t. 160t*3 What is the derivative of -2405b + 1351b + 1361b - 532 wrt b? 307 Let q = 4 - 1. What is the third derivative of -2w3 + w3 - w3 + 2w*2 + 10wq wrt w? 48 Let f(q) = -q2 + 1. Suppose 0 = -0x - 5x - 5. Let s(n) = -13n2 + 11n + 1. Let g(u) = xs(u) + f(u). Find the second derivative of g(w) wrt w. 24 Let o = 17 + -7. Let l be o(0/4 - -1). Find the second derivative of 5z2 - 5z*2 - 143z + 135z - lz*3 wrt z. -60z Let d(k) = -2k3 - 2k - 1. Let n(q) = 18q3 - 17q*2 - 364q + 8. Let z(b) = 8d(b) + n(b). Find the second derivative of z(u) wrt u. 12u - 34 Let w(u) be the second derivative of -25u7/42 + 38u4/3 - u3/6 - 54u. Find the third derivative of w(t) wrt t. -1500t*2 Find the third derivative of -105d*3 - 28d*3 - 12 + 5d*2 - 96d*3 + 55d*3 wrt d. -1044 Let v(y) be the second derivative of 4y + 0 + 0y4 + 0y*3 - 3/10y*5 - 17/2y*2. Differentiate v(w) wrt w. -18w*2 Let l = -72/23 - -4343/1380. Let b(d) be the third derivative of 5d*2 + 0 + 1/3d*3 + ld*5 + 0d + 0d4. Differentiate b(p) wrt p. 2p Let r(p) = -2p3 - 586p*2 + 532p. Let w(v) = -2v3 - 587v*2 + 531v. Let x(j) = 5r(j) - 6w(j). What is the second derivative of x(c) wrt c? 12c + 1184 Let a(m) be the third derivative of 11m6/60 - m5/30 + 29m3/2 + 56m*2. Differentiate a(r) with respect to r. 66r*2 - 4r Let x(g) be the first derivative of 0g3 + 0g*5 + 7/3g*6 + 0g + 4 - 6g2 + 0g*4. Find the second derivative of x(z) wrt z. 280z*3 Let g = -31 - -38. Let v(m) = -12m*2 + 3m. Let w(n) = -n*3 + 24n*2 - 7n. Let z(o) = gv(o) + 3w(o). Find the third derivative of z(u) wrt u. -18 Let h(z) be the first derivative of -25z2/2 + 112z - 46. Differentiate h(f) wrt f. -25 Let d(y) = -10 + 8y2 - 23 + 25y*2 + 0y*2. Let j(l) = 16l*2 - 16. Let t(z) = -6d(z) + 11j(z). Differentiate t(q) with respect to q. -44q Let f(m) = 17m2 - 3m + 2. Let n be f(1). What is the second derivative of -a*2 - 4a*2 - na + 14a wrt a? -10 Let j be 3 + 0 - (-3)/(-3). Let t(z) = 5z - 5. Let w be t(j). Find the third derivative of -wn2 + 4n*2 + 13n*4 - 16n*4 wrt n. -72n Let u = 14 - 18. Let i be 32/14 - u/(-14). Find the second derivative of 3bi - 2b - 2b - b2 wrt b. 4 Let g(t) = -t3 + 6t*2 + t - 1. Let n(q) = 250q*4 + 7q*3 + 3q*2 - 6q + 6. Let d(y) = -6g(y) - n(y). Find the third derivative of d(x) wrt x. -6000x - 6 Find the third derivative of 29 - 97x3 + 97x*3 - 13x*6 + 22x*6 - 2x*2 wrt x. 1080x*3 What is the second derivative of 0g2 - g2 + 98g5 - 139g*5 - 45g - 33g + 63g*5 wrt g? 440g*3 - 2 Let h(q) = -493q*4 + 2q*3 - 657q*2 + 4q - 2. Let u(p) = p3 - p2 + 2p - 1. Let a(w) = -h(w) + 2u(w). What is the third derivative of a(l) wrt l? 11832l Let c(p) = -15p*3 + 11p*2 - 245p + 726. Let u(l) = -3l3 + 2l*2 - 49l + 145. Let k(t) = -2c(t) + 11u(t). What is the derivative of k(j) wrt j? -9j2 - 49 Let k(x) = 115x*4 - 6x*3 + 58x*2 - 6x + 4. Let c(v) = -v4 - v3 - v*2 - v + 1. Let y(q) = -6c(q) + k(q). What is the third derivative of y(t) wrt t? 2904t Find the first derivative of -57d*4 + 40 - 11 - 25d*4 wrt d. -328d*3 Let r(l) be the third derivative of -16l7/7 - l4/24 - 47l3/6 - 221l*2. What is the second derivative of r(z) wrt z? -5760z*2 Let p(y) be the second derivative of 107y*3/3 - 36y*2 - y - 97. Find the first derivative of p(q) wrt q. 214 Let d be (-888)/(-840) + (-1)/(-7). Let k(c) be the first derivative of 0c*3 + dc*5 - 2 + 0c*4 - 3c*2 + 0c. Find the second derivative of k(m) wrt m. 72m2 Let x(p) be the second derivative of 2p7/21 + p5/2 + p*3/2 + 93p*2/2 - 36p + 4. Find the second derivative of x(c) wrt c. 80c3 + 60c Suppose 2b + 5 = i + b, 3i - 15 = 5b. Suppose 0 = q - 0 - 3. Find the first derivative of 3t*3 - 2t*3 + 8 + it*q - 3 wrt t. 18t2 Let f(h) be the first derivative of -h6/3 + 39h5/5 - 3h*2/2 + 11h - 219. What is the second derivative of f(d) wrt d? -40d3 + 468d*2 Let y(s) be the first derivative of 0s*2 + 4 - 31/5s*5 + 0s*3 + 37s + 0s4. What is the first derivative of y(w) wrt w? -124w*3 Suppose z - 2 = -2r, -r + 4z + 10 = -0r. Suppose -ri - 5 = -21. What is the second derivative of -ic*5 + 0c + 7c + 5c wrt c? -160c3 Let f = -5 - -5. Suppose f = -5x - 25, -4l + 0x - x = -19. Find the second derivative of -lg + 0g*5 + 0g*5 + 5g5 - g5 wrt g. 80g3 Let k(b) be the first derivative of -92b*3 + 359b - 284. Differentiate k(q) wrt q. -552q Suppose 7z = 6 + 8. Find the second derivative of 4p3 - 3p*2 - 5p*2 + 13p + 8pz wrt p. 24p Let m(a) = 146a4 + 10a - 147. Let u(h) = 73h4 + 4h - 73. Let q(n) = -2m(n) + 5u(n). Differentiate q(b) with respect to b. 292b3 Let w(s) = 276s*5 - 12s*3 + 7s*2 - 34s - 6. Let k(i) = 2i3 - i2 - i + 1. Let p(f) = 6k(f) + w(f). Find the third derivative of p(t) wrt t. 16560t2 Let z = 150 - 146. Let r(d) be the third derivative of -2d*2 + 0d + 0 + 1/8dz - 1/3d*3. Differentiate r(o) wrt o. 3 Suppose -5g + 6 = -3g. Let f(m) = 4m*2 + 1. Let l(b) = 7b*2 - 2b2 - b2. Let a(k) = gl(k) - 4f(k). What is the first derivative of a(v) wrt v? -8v Let w(c) be the second derivative of -c4/12 - 2c*3 + 5c*2/2 + 8c. Let u be w(-12). Find the first derivative of -4 + 4t4 - ut*4 - 3t*4 wrt t. -16t3 Let j(k) = k2 + 6k - 1. Let o(s) = -301s*2 + 22s + 11. Let m(r) = -2j(r) + o(r). What is the second derivative of m(w) wrt w? -606 Let a = 10 + -6. Suppose 0 = -2f + a + 4. Differentiate 4 + fk4 + 7k*4 - 5k*4 wrt k. 24k*3 Find the third derivative of 16c - 15c - 5c*3 - 22c*3 - 7c*2 wrt c. -162 Let p(k) = 6k**2 - k. Let j be p(1). What is the first derivative o	{ "pile_set_name": "DM Mathematics" }
35/143 Four letters picked without replacement from {i: 2, u: 4, a: 2, h: 1}. What is prob of picking 2 a, 1 h, and 1 i? 1/63 Three letters picked without replacement from hhahhwhhhhhhah. Give prob of picking 2 h and 1 w. 55/364 What is prob of picking 1 j and 1 c when two letters picked without replacement from dcicji? 2/15 Three letters picked without replacement from tcbtytct. Give prob of picking 2 t and 1 y. 3/28 Two letters picked without replacement from {s: 5, o: 2}. What is prob of picking 2 s? 10/21 Three letters picked without replacement from frftw. What is prob of picking 1 f, 1 w, and 1 r? 1/5 Calculate prob of picking 1 v, 1 m, and 1 l when three letters picked without replacement from vltztttqmtmmzztzttmt. 1/285 Two letters picked without replacement from mslmsblbsmssbllccc. Give prob of picking 2 l. 2/51 Two letters picked without replacement from {k: 5, g: 7, z: 1, t: 1}. What is prob of picking 2 k? 10/91 What is prob of picking 2 r when two letters picked without replacement from ebbbbbrbbbrbe? 1/78 Three letters picked without replacement from {c: 2, v: 6, k: 1, j: 2, l: 3}. Give prob of picking 2 j and 1 v. 3/182 Four letters picked without replacement from {b: 4, k: 1, v: 8}. What is prob of picking 3 b and 1 v? 32/715 What is prob of picking 3 y when three letters picked without replacement from {y: 5, s: 11}? 1/56 What is prob of picking 3 y when three letters picked without replacement from cmjvbbyyjbym? 1/220 Three letters picked without replacement from {n: 1, t: 2, o: 3, i: 7, g: 5}. What is prob of picking 1 o and 2 g? 5/136 Calculate prob of picking 1 d and 1 v when two letters picked without replacement from {l: 1, d: 2, c: 1, w: 1, v: 1, r: 2}. 1/14 What is prob of picking 3 k when three letters picked without replacement from kckknkwwwkkwwwcwkn? 35/816 Three letters picked without replacement from {n: 4, m: 15}. What is prob of picking 1 n and 2 m? 140/323 Four letters picked without replacement from {c: 2, j: 4, i: 2, g: 1, m: 2, z: 3}. What is prob of picking 1 z, 2 m, and 1 g? 3/1001 Two letters picked without replacement from {l: 3, p: 13, k: 1}. What is prob of picking 1 l and 1 k? 3/136 Calculate prob of picking 1 q and 1 x when two letters picked without replacement from {x: 1, a: 11, q: 2}. 2/91 Four letters picked without replacement from {y: 6, r: 4, u: 4}. What is prob of picking 2 r, 1 y, and 1 u? 144/1001 Calculate prob of picking 1 k and 1 s when two letters picked without replacement from qzkqqqpqqzqzqqzsqqp. 1/171 Calculate prob of picking 1 q and 1 v when two letters picked without replacement from {o: 4, p: 2, v: 2, q: 8}. 2/15 Two letters picked without replacement from araqabbqbra. Give prob of picking 1 r and 1 q. 4/55 Calculate prob of picking 3 o when three letters picked without replacement from ooo. 1 Two letters picked without replacement from wxwaa. Give prob of picking 2 a. 1/10 Three letters picked without replacement from tnttnttnnttgt. What is prob of picking 1 g, 1 n, and 1 t? 16/143 Three letters picked without replacement from {o: 2, f: 15, r: 3}. What is prob of picking 3 f? 91/228 Four letters picked without replacement from {v: 9, o: 10}. What is prob of picking 4 v? 21/646 Three letters picked without replacement from hhhhhsskhssskhhh. What is prob of picking 1 s, 1 h, and 1 k? 9/56 What is prob of picking 1 q and 1 b when two letters picked without replacement from {z: 2, h: 1, q: 3, b: 4}? 4/15 Four letters picked without replacement from ggjgjjjgggjjggjg. Give prob of picking 4 j. 1/52 Three letters picked without replacement from jifijeeefffeeejij. What is prob of picking 3 e? 1/34 Four letters picked without replacement from nmmnnn. Give prob of picking 3 n and 1 m. 8/15 Calculate prob of picking 2 e when two letters picked without replacement from hkeeb. 1/10 Calculate prob of picking 2 z and 1 y when three letters picked without replacement from {y: 2, i: 9, z: 4, c: 3}. 1/68 Three letters picked without replacement from {b: 7, v: 5}. Give prob of picking 3 v. 1/22 Two letters picked without replacement from {z: 4, k: 1, d: 9}. What is prob of picking 1 z and 1 k? 4/91 Calculate prob of picking 1 f, 2 w, and 1 o when four letters picked without replacement from fhflwfhfwufhfofohffu. 6/1615 Two letters picked without replacement from mbbpppp. Give prob of picking 1 m and 1 b. 2/21 Three letters picked without replacement from {u: 12, y: 6}. Give prob of picking 2 y and 1 u. 15/68 Four letters picked without replacement from {r: 3, x: 9}. What is prob of picking 3 r and 1 x? 1/55 Three letters picked without replacement from uleus. What is prob of picking 1 l, 1 e, and 1 u? 1/5 What is prob of picking 1 e and 1 q when two letters picked without replacement from eqx? 1/3 What is prob of picking 1 f and 2 a when three letters picked without replacement from {a: 6, f: 2, l: 4}? 3/22 Two letters picked without replacement from maoxa. Give prob of picking 1 m and 1 x. 1/10 Calculate prob of picking 2 u, 1 h, and 1 v when four letters picked without replacement from hdvuubb. 1/35 Calculate prob of picking 1 i and 1 d when two letters picked without replacement from {j: 3, i: 10, d: 2}. 4/21 Two letters picked without replacement from {a: 9, c: 5}. What is prob of picking 2 c? 10/91 Three letters picked without replacement from {v: 6, q: 12}. Give prob of picking 2 q and 1 v. 33/68 What is prob of picking 1 x and 1 k when two letters picked without replacement from ppwpxpddpdkxxdppwpjk? 3/95 Two letters picked without replacement from {i: 1, t: 3, y: 1, z: 1, x: 1}. What is prob of picking 1 x and 1 z? 1/21 Three letters picked without replacement from qfuzzsfqquzuqhq. What is prob of picking 1 z, 1 s, and 1 f? 6/455 Three letters picked without replacement from wbghgbhxhglghhg. Give prob of picking 1 g, 1 x, and 1 l. 1/91 Calculate prob of picking 1 y and 1 h when two letters picked without replacement from rrzzmzzmyyhkyzz. 1/35 Calculate prob of picking 2 j when two letters picked without replacement from {b: 5, j: 7}. 7/22 Three letters picked without replacement from {x: 3, f: 1, q: 3, m: 7}. What is prob of picking 2 m and 1 x? 9/52 Calculate prob of picking 2 g when two letters picked without replacement from eeeeeeggegegggggggee. 9/38 Two letters picked without replacement from tcchf. Give prob of picking 1 f and 1 h. 1/10 What is prob of picking 2 h and 1 v when three letters picked without replacement from {v: 4, z: 3, h: 4, i: 4, t: 1}? 3/70 Four letters picked without replacement from {n: 9, l: 1, z: 1}. Give prob of picking 2 z and 2 n. 0 Two letters picked without replacement from {q: 1, b: 5, j: 1, d: 3}. What is prob of picking 2 j? 0 Two letters picked without replacement from tvtuuvttuurvutttu. Give prob of picking 2 u. 15/136 Three letters picked without replacement from {e: 2, b: 5, n: 2, k: 6, a: 1, u: 1}. What is prob of picking 1 u, 1 e, and 1 a? 1/340 Calculate prob of picking 1 e and 1 d when two letters picked without replacement from eebibidbeeb. 4/55 What is prob of picking 1 s and 1 w when two letters picked without replacement from {s: 2, w: 7}? 7/18 Four letters picked without replacement from {b: 7}. What is prob of picking 4 b? 1 Four letters picked without replacement from {f: 3, b: 1, g: 1, v: 2}. What is prob of picking 1 v, 2 f, and 1 b? 6/35 Calculate prob of picking 1 k and 1 e when two letters picked without replacement from {f: 2, e: 2, x: 1, w: 1, k: 2}. 1/7 Two letters picked without replacement from {x: 17, h: 2}. What is prob of picking 1 x and 1 h? 34/171 Two letters picked without replacement from {x: 2, w: 4, n: 2, y: 1}. Give prob of picking 2 w. 1/6 Two letters picked without replacement from {k: 1, j: 1, n: 1}. What is prob of picking 1 j and 1 n? 1/3 What is prob of picking 1 d and 1 i when two letters picked without replacement from {k: 5, d: 1, i: 2, v: 1}? 1/18 Three letters picked without replacement from {l: 2, c: 3}. What is prob of picking 2 l and 1 c? 3/10 Two letters picked without replacement from dudpdddppdtd. What is prob of picking 1 t and 1 d? 7/66 Three letters picked without replacement from {p: 1, w: 2, o: 3, x: 1, f: 1, h: 3}. What is prob of picking 1 h, 1 p, and 1 w? 2/55 Calculate prob of picking 2	{ "pile_set_name": "DM Mathematics" }
c)))c)/c))/(c/(c/(c/c(-1)))))/(c8c13/cc))1 assuming c is positive. c(-27) Simplify ((y*(-9)/y)/(yy*(-1/34)yy))/(y15y(-12)/y) assuming y is positive. y(-509/34) Simplify (((tt/(t(-1)/ttt)t)/tt)/((t/(t/t(-1/2)t))/t)(t(1/2))(-3/29))(1/42) assuming t is positive. t(79/609) Simplify q(-8)/(q/(q(1/4)q))(q7/q)17 assuming q is positive. q(377/4) Simplify k(-2/3)/(k(-2/5)/k)k*(-9)/kk(-5/2) assuming k is positive. k(-353/30) Simplify ((n/(n*(-5)/n))/n)/(n/(nn*(-1/3)n))n/(nn/(n*(-10)/n))n(n(-3)/n)/nn assuming n is positive. n(-25/3) Simplify (j/j(-1/3))*(-35/3)/((j/(jj*(-1))j)/j7) assuming j is positive. j(-95/9) Simplify x*(-2/21)x/(x/x*(-2)x)x(xx2)(-2/11) assuming x is positive. x(-610/231) Simplify (s/(s/(s(3/5)s)))/s*(2/83)s*(1/10)ss/(s/s(-1/16))s assuming s is positive. s(23993/6640) Simplify ((d(-7)dd)/((d/d*(-11))/d)d*(-7)dd(2/7))11 assuming d is positive. d(-1672/7) Simplify ((ww/(w/w(2/37)))(-45))(35/4) assuming w is positive. w(-61425/148) Simplify ((cc(-1))/c)50/(c(1/9)c/(cc(-2/15)c)) assuming c is positive. c*(-2216/45) Simplify (u(u/((u/(u(u/u(-1))/u)u)/u))/uuuu)/(u/(u/(u(-1/17)/uu)u))(u/u3)(-6) assuming u is positive. u(307/17) Simplify ((a13)(3/2))(2/3) assuming a is positive. a*13 Simplify ((((s(s/(ss/(ss/((s/(s*(1/2)/s))/ss)s)ss))/s)/s)/s)/s)8/(s(-1/3))14 assuming s is positive. s(-94/3) Simplify ((w/(w/(w/(w/w(-37)))))/((w((w/w*(-1/36)w)/w)/w)/w))/(w*(2/45)/w(www*(-12)w)/ww) assuming w is positive. w(-4873/180) Simplify ((x(1/4))38/((x(x*(1/2)x)/xx)/x(-1/9)))(-4) assuming x is positive. x(-248/9) Simplify x(-1/6)/xx*(-3/2)x(x28)36 assuming x is positive. x(3019/3) Simplify ((gg*(-13))/(g/(gg(1/5))))/(g19/(gg(-2/7))) assuming g is positive. g(-1053/35) Simplify (y7/((((((yy/(y*(1/23)y))/y)/y)/y)/y)/y))/(((y/(yyy/(y*(-17)/y))y)/yy)/(y/(y/y24y))) assuming y is positive. y*(1220/23) Simplify ((hh*(-1/24)h)(-1/40))(-38) assuming h is positive. h(893/480) Simplify ((q(-22)q12/q)45)(2/11) assuming q is positive. q(-90) Simplify (q(-1/3)/(q(-29)/q))/(q(-3))38 assuming q is positive. q(431/3) Simplify (((((kk*(-3)k)/k)/k)/k(1/2))/((k(-1/4)/k)/k)31)24 assuming k is positive. k1590 Simplify (r(-2)r)/r(5/4)(r*3r)(-32) assuming r is positive. r(-521/4) Simplify d6/d(3/7)(dd/d*(2/3)d)(-3/7) assuming d is positive. d(32/7) Simplify (qq/(q(4/3)q))(-25)/(q1)(3/29) assuming q is positive. q(716/87) Simplify (j/(jj(3/4)/j)j)(-9/8)/(j(-1/6)(jj4)/j) assuming j is positive. j(-503/96) Simplify (n*(-1/4)nnn((nn*34n)/n)/n)/(nn(1/2)((nn/n(1/3)nn)/n)/n) assuming n is positive. n(403/12) Simplify (p/(p(-1)/pp))*29(p(-4/5))(-3/16) assuming p is positive. p(1163/20) Simplify (w/(w(3/22)w)w39)45 assuming w is positive. w*(38475/22) Simplify hhh(-14)/h(h*4/h)/hhh/h(-2/19)h((h/(h/h(1/2)h))/h)/h assuming h is positive. h(-395/38) Simplify (((b/((b/b10)/b))/b)/bbbb/b25)/((b/(b(-10)/b)b)/bbb(-1/3)) assuming b is positive. b(-77/3) Simplify (i/(i*(-3/2)i)i(-7/3))/(i/(ii1))(-19/3) assuming i is positive. i(-43/6) Simplify (c(-2/7)/(cc/c(-1)))/(c(-6/11)cc(-2/3)c) assuming c is positive. c(-941/231) Simplify (u14/(u(-17)/u))/((u/u(-3/5))/u)39 assuming u is positive. u(43/5) Simplify ((v1)(-34)/(v*(-1/2)v(v(3/10)vv)/v))(-37) assuming v is positive. v(6623/5) Simplify ((b(3/2))43)(-4/37) assuming b is positive. b(-258/37) Simplify c(-17/3)ccc*(3/5)ccc(c5/c)(3/17) assuming c is positive. c(163/255) Simplify (j(-5))(-15)(jjj*16jj)/(j/(jj(-6))) assuming j is positive. j89 Simplify ((b*(5/4)b)/b)/(bb/(b/(bb/(b/(bb/b(12/7)b))))b)b*10/(b(b(-1/4)/b)/b) assuming b is positive. b(115/14) Simplify (k(-3))(-22)(kk(-12))/((k2kk)/k) assuming k is positive. k52 Simplify ((b/b(-2/7))/bbb(-3))/(b2/(b/(bb(1/2)bbb))) assuming b is positive. b(-101/14) Simplify (j(-24)/(j/(jj(-3/5))))/(j1/jj(4/9)) assuming j is positive. j(-1127/45) Simplify (((z*(-1)/zz)/zz)(4/9)/(z(2/3))(2/3))(-2/131) assuming z is positive. z(16/1179) Simplify (u(-9/4))42u7/((u(-2/3)/u)/u) assuming u is positive. u(-509/6) Simplify (w/(w25w))(-1/14)/(w(w*16w)/ww((w/(w/w(-19)))/w)/w) assuming w is positive. w(67/14) Simplify ((r*(-1/3)r)/(r/r(-9/5)))35 assuming r is positive. r(-224/3) Simplify (l11)(-8)/(l16l)(-48) assuming l is positive. l728 Simplify (y/y(3/2)y1)/(y/(((y/y(-4))/y)/yy)yy(-4/5)) assuming y is positive. y(33/10) Simplify ((rr/r*(1/3)r)*(-20/11)(r/(r/(r*(-1/3)/r))r)(-6/13))(-9/2) assuming r is positive. r(3021/143) Simplify o17((o(-3/16)o)/o)/o(o(-1/6)o)/(o(-27)/o) assuming o is positive. o(2143/48) Simplify (n(1/12))(2/11)/(n(-1/52))(-1/74) assuming n is positive. n(1891/126984) Simplify (i/i(-4))(-1/4)/(i/i1)(-2/13) assuming i is positive. i(-5/4) Simplify w*17/(w/(w/((w(w/(w/(ww(5/8))w))/w)/w)))(w/(w(3/13)/w))/(w(9/5)/w) assuming w is positive. w(9539/520) Simplify j2/j(-9)((j*(-2/13)j)/j)(-5/7) assuming j is positive. j(1011/91) Simplify ((w*(-3/4)w)/ww)/w3w/(w*11w)w/w6 assuming w is positive. w(-75/4) Simplify a5/(a23a)a(12/7)aa(-3/7)/a assuming a is positive. a(-124/7) Simplify (n(-4/29)/nnn(7/4))/(n(n/(n*27/nn))/nnn(5/9)) assuming n is positive. n(27203/1044) Simplify ((pp(4/3)p)/p)/p*(9/2)pp4p10 assuming p is positive. p(77/6) Simplify (b/(b/(b/(bb22))))/(b/b(2/3))(bb/b(-1))(-8) assuming b is positive. b(-139/3) Simplify (v/v(-15))(1/77)v*34/vvv/((vv/v*25v)/vv)v assuming v is positive. v*(4482/77) Simplify (tt*(-2/13)t(-2/33))(2/39) assuming t is positive. t(674/16731) Simplify (o(1/5)/o)*(11/9)o*(-6/19)/(oo(-6)) assuming o is positive. o(3169/855) Simplify z(zz/z*(-3/2))/zz*(3/2)(z1)(-27) assuming z is positive. z*(-22) Simplify ((pp/(p/((pp(2/5))/p))p)*(-49)p*(2/17)(pp(-2/3))/p)(1/25) assuming p is positive. p(-30128/6375) Simplify (y/(y/(y/(y(-2)/yy))))*(-2/17)(y(-1/2))(1/65) assuming y is positive. y(-797/2210) Simplify (m3m)/m(3/4)m*(-3/4)m(-10) assuming m is positive. m(-15/2) Simplify ((m*(-2/11)/(mmm/(m/(mm*5m))))/(m(-2/11)/(m(1/6)m)))22 assuming m is positive. m(-517/3) Simplify t(1/4)t*32t(t(-21/2)t)/ttt/(tt(-12)) assuming t is positive. t(143/4) Simplify (q(-7))(-21)/(qqq0)3 assuming q is positive. q141 Simplify n(-2/23)/((nn((n/n(-2/15))/n)/n)/n)(nnn(6/5)/n)/(n7n) assuming n is positive. n(-2077/345) Simplify r(-5/3)r/(r/((r*(3/2)r)/rr)r)(r(3/10)/r)/rrrr/r(1/5) assuming r is positive. r(14/15) Simplify (s*(8/3)/(ss*(-9))s*(3/7)/ss(-4))(-11) assuming s is positive. s*(-1408/21) Simplify ((xx(1/5))/x(-3/8))/(xx(4/3)/x)30 assuming x is positive. x(-1537/40) Simplify ((w/w(1/4)w)(-14/9))(3/2) assuming w is positive. w*(-49/12) Simplify (ww(5/8))(-29)/(w*(-2/3)ww(-2/37)www) assuming w is positive. w(-44759/888) Simplify (x(-5)xx(-2)/x)/(x(-3))28 assuming x is positive. x77 Simplify (ss(3/2))(-39)/((s/s25s)/s(-23)) assuming s is positive. s(-195/2) Simplify (uu(3/2)u)2/(u(-1/24)uu*(-31)u) assuming u is positive. u(865/24) Simplify (m(-10)m/(mm*16))/(mm*(2/5)mmm5) assuming m is positive. m(-172/5) Simplify i/(ii/(i(i*10/i)/i))i/((i/(i/(((ii(-11))/ii)/i)i))/i)i*(-2/61)ii/(i/i(2/5)) assuming i is positive. i(7127/305) Simplify (q(-1/2))35q*(-2/5)qq(11/2)q assuming q is positive. q(-52/5) Simplify ((r(2/3)/rrr)*(-6/17)(r*(2/3)rr)/((r6r)/r))35 assuming r is positive. r(-7000/51) Simplify (x/(x/(xx(3/5)x)x))/(x(1/3)x)x*	{ "pile_set_name": "DM Mathematics" }
? -50 What is 66019 rounded to the nearest 100? 66000 What is -0.0033503 rounded to 3 dps? -0.003 What is 0.12087 rounded to three decimal places? 0.121 What is -1254 rounded to the nearest 100? -1300 What is -9.01 rounded to the nearest ten? -10 Round 78100000 to the nearest one million. 78000000 Round 0.000020411 to 7 decimal places. 0.0000204 What is -86.19 rounded to the nearest 100? -100 Round -4430000 to the nearest one hundred thousand. -4400000 What is -0.000028652 rounded to six decimal places? -0.000029 What is -177100 rounded to the nearest 100000? -200000 Round -0.00001275 to seven decimal places. -0.0000128 What is -2.254 rounded to 1 dp? -2.3 Round -2500 to the nearest 10000. 0 Round -341770 to the nearest ten thousand. -340000 What is 408.5 rounded to the nearest one hundred? 400 Round 0.06055 to 3 dps. 0.061 Round -34479 to the nearest one hundred. -34500 Round 0.00023812 to five decimal places. 0.00024 What is -1520000 rounded to the nearest one hundred thousand? -1500000 Round 2907.04 to the nearest one hundred. 2900 Round -168 to the nearest integer. -168 Round 0.20425 to 1 dp. 0.2 Round -9.9585 to one decimal place. -10 What is -0.002529 rounded to three decimal places? -0.003 Round -2644.3 to the nearest one hundred. -2600 What is 2.443 rounded to 1 decimal place? 2.4 What is -2.06 rounded to 1 dp? -2.1 What is -0.0000053643 rounded to 7 dps? -0.0000054 What is -6530 rounded to the nearest one hundred? -6500 Round 385.6 to the nearest 10. 390 What is 56581000 rounded to the nearest one hundred thousand? 56600000 Round 189.89 to the nearest 10. 190 What is 0.044461 rounded to two dps? 0.04 What is -0.017928 rounded to four dps? -0.0179 Round -101.42 to the nearest 10. -100 What is -142.1 rounded to the nearest ten? -140 What is -0.0659 rounded to 1 dp? -0.1 What is 0.0071342 rounded to three dps? 0.007 Round 0.00881 to three dps. 0.009 What is 0.015683 rounded to two dps? 0.02 What is -0.000000727 rounded to 7 dps? -0.0000007 Round 7667.3 to the nearest one thousand. 8000 Round 718800 to the nearest 10000. 720000 What is -48.7 rounded to the nearest ten? -50 Round -0.21482 to 3 dps. -0.215 Round 612 to the nearest 100. 600 Round 1.89 to zero decimal places. 2 What is -3450 rounded to the nearest 1000? -3000 Round 0.00061931 to four dps. 0.0006 What is -153 rounded to the nearest 10? -150 Round -2738 to the nearest 100. -2700 Round 25539 to the nearest 1000. 26000 Round 0.00000023 to seven dps. 0.0000002 Round 16.7555 to two dps. 16.76 Round 0.029148 to three dps. 0.029 Round 3491000 to the nearest 100000. 3500000 Round -26290000 to the nearest 1000000. -26000000 What is -0.008972 rounded to 3 decimal places? -0.009 What is 0.012785 rounded to 3 dps? 0.013 Round 13830000 to the nearest 100000. 13800000 Round 0.00028358 to 5 decimal places. 0.00028 Round 69.242 to the nearest 10. 70 Round -0.0002051 to five decimal places. -0.00021 Round -0.002203 to four decimal places. -0.0022 Round -2.91 to 0 dps. -3 Round -52249100 to the nearest one million. -52000000 What is -0.00000486713 rounded to six decimal places? -0.000005 What is 40.294 rounded to the nearest ten? 40 What is 0.1651 rounded to 3 dps? 0.165 What is 0.0000003773 rounded to seven decimal places? 0.0000004 What is -0.0000004367 rounded to 7 decimal places? -0.0000004 What is -624 rounded to the nearest one hundred? -600 Round 0.0000118959 to 7 dps. 0.0000119 Round -1751500 to the nearest one hundred thousand. -1800000 What is -0.08608 rounded to 2 decimal places? -0.09 Round 0.00101 to four decimal places. 0.001 What is -0.01157 rounded to 4 dps? -0.0116 What is 0.000003347 rounded to 7 decimal places? 0.0000033 What is -0.0612 rounded to 1 decimal place? -0.1 Round 0.000002004 to six dps. 0.000002 What is -0.003218 rounded to five decimal places? -0.00322 Round -0.00069341 to five dps. -0.00069 What is -4400 rounded to the nearest 10000? 0 Round 26.722 to the nearest 10. 30 What is -0.055889 rounded to two dps? -0.06 Round 0.01086 to 3 dps. 0.011 What is -0.001596 rounded to five dps? -0.0016 What is 464000 rounded to the nearest 10000? 460000 Round -85000 to the nearest ten thousand. -90000 What is -19.192 rounded to zero decimal places? -19 Round 7300 to the nearest 10000. 10000 Round -0.000002763 to six dps. -0.000003 Round 0.000086716 to 6 decimal places. 0.000087 What is 929.28 rounded to the nearest 10? 930 Round 0.67874 to 1 decimal place. 0.7 Round -3.689 to 1 decimal place. -3.7 What is -0.00208289 rounded to 5 dps? -0.00208 Round 55.37 to the nearest 10. 60 Round -756.4 to the nearest 1000. -1000 Round -0.238 to 2 decimal places. -0.24 What is -4.8649 rounded to two dps? -4.86 Round -0.0000337 to 6 dps. -0.000034 What is -0.00083425 rounded to four decimal places? -0.0008 What is -9541.8 rounded to the nearest one thousand? -10000 Round 0.01394 to two decimal places. 0.01 Round 0.000079934 to six dps. 0.00008 Round -17060 to the nearest ten thousand. -20000 What is -36.48 rounded to 0 decimal places? -36 Round 22125000 to the nearest 1000000. 22000000 Round 437000 to the nearest 100000. 400000 What is 571030 rounded to the nearest 10000? 570000 What is 0.008078 rounded to 2 dps? 0.01 Round 0.00072 to 3 decimal places. 0.001 What is -1438920 rounded to the nearest one hundred thousand? -1400000 What is 15.6782 rounded to one decimal place? 15.7 Round -0.0000048 to 5 decimal places. 0 Round -353056 to the nearest 1000. -353000 Round 0.07996 to two dps. 0.08 What is 0.209 rounded to one decimal place? 0.2 What is 661.61 rounded to the nearest 100? 700 Round -1573000 to the nearest 100000. -1600000 What is 0.0034969 rounded to three dps? 0.003 What is 0.0000096 rounded to six dps? 0.00001 What is 0.00024183 rounded to five dps? 0.00024 Round 647.86 to 0 decimal places. 648 Round -371.5 to the nearest one hundred. -400 Round -46.63 to the nearest 10. -50 Round 2459000 to the nearest 100000. 2500000 Round -183350 to the nearest one thousand. -183000 What is 3484000 rounded to the nearest one hundred thousand? 3500000 What is 0.013174 rounded to 4 dps? 0.0132 Round -222500 to the nearest 10000. -220000 Round -0.000007696 to six dps. -0.000008 Round -7100 to the nearest 10000. -10000 Round -0.00000050079 to 7 decimal places. -0.0000005 What is 4017 rounded to the nearest 10? 4020 What is -0.0000009483 rounded to seven dps? -0.0000009 Round -57000000 to the nearest 1000000. -57000000 Round -2.4887 to 1 decimal place. -2.5 What is 86730 rounded to the nearest 1000? 87000 What is 10554 rounded to the nearest 1000? 11000 Round -0.00054181 to 6 dps. -0.000542 What is -11925000 rounded to the nearest 100000? -11900000 Round -0.00009977 to 6 decimal places. -0.0001 What is 28763000 rounded to the nearest one hundred thousand? 28800000 What is -1145900 rounded to the nearest 10000? -1150000 What is 24.1 rounded to the nearest 10? 20 What is -122222 rounded to the nearest one thousand? -122000 What is 0.0000458878 rounded to 6 decimal places? 0.000046 Round 0.000031052 to six decimal places. 0.000031 What is 0.0000007231 rounded to seven decimal places? 0.0000007 What is 0.1765 rounded to two decimal places? 0.18 What is 0.00000046678 rounded to seven dps? 0.0000005 Round -253 to the nearest 1000. 0 What is 5.64 rounded to the nearest ten? 10 What is -185530 rounded to the nearest ten thousand? -190000 What is 24.0475 rounded to one decimal place? 24 What is -0.000917 rounded to five decimal places? -0.00092 What is 0.000125696 rounded to 7 dps? 0.0001257 Round 0.000002113 to seven dps. 0.0000021 What is -2769.3 rounded to the nearest 100? -2800 What is -0.151756 rounded to 2 decimal places? -0.15 Round 0.0000031 to 6 decimal places. 0.000003 Round 5000 to the nearest one hundred. 5000 What is -88.548 rounded to zero dps? -89 What is 0.0000100535 rounded to 7 dps? 0.0000101 What is -0.00034 rounded to three dps? 0 Round 0.03533 to two decimal places. 0.04 Round 0.2218 to 2 dps. 0.22 What is -15112000 rounded to the nearest one hundred thousand? -15100000 Round 6720000 to the nearest one million. 7000000 What is -518.5 rounded to the nearest 10? -520 What is -2794.7 rounded to the nearest ten? -2790 Round -0.032495 to 4 decimal places. -0.0325 What is -172297000 rounde	{ "pile_set_name": "DM Mathematics" }
eatest common factor of 215 and 125730753. 43 What is the highest common divisor of 10052 and 48930? 14 Calculate the highest common divisor of 8 and 288712120. 8 What is the greatest common factor of 387930 and 24125? 965 Calculate the greatest common divisor of 7892 and 698434108. 7892 Calculate the highest common factor of 10885 and 52700505. 1555 What is the greatest common divisor of 166422135 and 2530? 1265 What is the greatest common factor of 14 and 8668849? 7 What is the highest common divisor of 153 and 3875116? 17 Calculate the highest common factor of 3239057 and 2269205. 6217 What is the highest common factor of 13856326 and 374? 374 What is the highest common factor of 5896 and 24044089? 67 What is the greatest common divisor of 56808 and 820989? 27 What is the highest common divisor of 39 and 271927409? 13 Calculate the highest common factor of 35951865 and 51045. 1245 Calculate the greatest common divisor of 2874 and 55620522. 2874 What is the highest common divisor of 72 and 21488652? 36 Calculate the highest common divisor of 1694950 and 2739910. 3110 What is the highest common factor of 17955 and 6234660? 855 What is the greatest common divisor of 46066400 and 2650? 50 What is the highest common divisor of 13450817 and 477? 53 What is the greatest common divisor of 60 and 769255965? 15 What is the highest common divisor of 24451 and 6365743? 499 Calculate the greatest common factor of 808339 and 94017. 259 What is the highest common factor of 8970603 and 67248? 1401 Calculate the highest common divisor of 811987 and 485. 97 What is the highest common divisor of 1500453 and 23733? 2637 Calculate the greatest common factor of 622 and 1906855759. 311 Calculate the greatest common factor of 6994708 and 42. 14 What is the highest common divisor of 379790 and 693641? 233 What is the greatest common factor of 333976 and 365368? 872 What is the greatest common divisor of 3271021 and 3914? 19 Calculate the greatest common factor of 56431840 and 32. 32 What is the greatest common factor of 84 and 462994? 14 What is the highest common factor of 494 and 1920776? 26 What is the greatest common factor of 67680 and 42084000? 1440 Calculate the greatest common factor of 16168 and 841864. 376 Calculate the highest common divisor of 140716 and 906344. 1108 What is the highest common factor of 35464 and 18236? 4 Calculate the highest common factor of 206777 and 76. 19 Calculate the greatest common factor of 637 and 4259521. 49 What is the highest common divisor of 852608 and 296? 8 Calculate the highest common factor of 84166505 and 6410. 3205 What is the highest common divisor of 173696 and 32936? 184 Calculate the highest common factor of 1653 and 5376165. 87 Calculate the greatest common divisor of 182377 and 2821. 13 What is the greatest common divisor of 1427206 and 377? 29 Calculate the greatest common factor of 9590955 and 1332. 111 What is the greatest common factor of 153917 and 22499? 149 What is the greatest common factor of 17641 and 435479? 59 What is the highest common factor of 396 and 50863692? 132 What is the greatest common factor of 9450 and 23203950? 1050 What is the greatest common factor of 2781 and 87859? 103 What is the greatest common factor of 10416 and 152016? 48 Calculate the greatest common divisor of 4836 and 17527152. 372 What is the greatest common factor of 64 and 54893632? 64 Calculate the highest common divisor of 20468742 and 199080. 3318 Calculate the greatest common divisor of 49623252 and 588. 84 What is the greatest common divisor of 49840 and 28? 28 What is the greatest common factor of 3883 and 145387? 11 What is the highest common factor of 8687144 and 8? 8 Calculate the highest common divisor of 5844 and 51963. 3 Calculate the highest common factor of 6608 and 6018. 118 What is the highest common divisor of 12802 and 31663564? 74 What is the highest common divisor of 650 and 2107274? 26 Calculate the highest common divisor of 38013836 and 5236. 476 Calculate the highest common factor of 44138 and 22896968. 1522 Calculate the highest common divisor of 33033858 and 858. 858 What is the highest common factor of 1440 and 330288? 48 Calculate the greatest common divisor of 3555 and 158553. 711 What is the greatest common factor of 182 and 4767070? 14 What is the highest common divisor of 348 and 940789? 29 Calculate the greatest common factor of 5578634 and 15554. 202 Calculate the highest common factor of 184 and 7820408. 8 What is the highest common factor of 12 and 7931572? 4 What is the greatest common divisor of 122 and 830175291? 61 Calculate the greatest common divisor of 340 and 943330. 170 What is the greatest common factor of 7500 and 99250? 250 What is the greatest common factor of 22432 and 872? 8 Calculate the greatest common factor of 124362 and 41034854. 4606 What is the highest common divisor of 5340 and 1407891000? 5340 What is the greatest common divisor of 45236 and 2294675? 263 What is the highest common factor of 12649 and 79925? 139 What is the greatest common divisor of 1406 and 2127722? 74 Calculate the highest common factor of 2533226 and 1640. 82 What is the greatest common divisor of 2248774 and 198? 22 Calculate the greatest common factor of 482 and 19702. 2 Calculate the greatest common factor of 21333 and 406653. 39 What is the highest common factor of 678 and 215858702? 226 Calculate the greatest common divisor of 4608056 and 2096. 1048 Calculate the highest common factor of 1640 and 5140990. 410 Calculate the highest common divisor of 1031591 and 506. 11 What is the greatest common factor of 18 and 11180718? 18 Calculate the highest common divisor of 18881300 and 129. 43 Calculate the highest common divisor of 3380240 and 12760. 1160 Calculate the highest common factor of 1450 and 458084. 58 What is the greatest common divisor of 10430 and 6162940? 70 What is the highest common factor of 809496 and 1800? 72 Calculate the highest common divisor of 38879938 and 106542. 3946 What is the highest common factor of 20014240 and 1120? 160 Calculate the greatest common divisor of 17464 and 1089376. 472 Calculate the highest common factor of 663 and 12496819. 17 What is the highest common factor of 2968 and 9890648? 424 Calculate the highest common divisor of 4529490 and 840. 210 Calculate the greatest common divisor of 25414116 and 45177. 4107 Calculate the greatest common divisor of 256 and 90887456. 32 What is the highest common factor of 3403 and 1757383? 41 Calculate the greatest common divisor of 58932056 and 16. 8 What is the greatest common divisor of 80 and 5013570? 10 Calculate the greatest common factor of 539688 and 246. 6 What is the highest common divisor of 1342980 and 19548? 108 What is the highest common divisor of 1023319 and 25707? 451 Calculate the greatest common divisor of 11632 and 167020253. 727 What is the greatest common divisor of 516644 and 748159? 2437 What is the greatest common factor of 12259031 and 1356? 113 What is the greatest common factor of 1301446 and 7742? 158 Calculate the greatest common factor of 1123034 and 30514. 22 Calculate the highest common divisor of 120620685 and 240. 15 Calculate the highest common divisor of 3725 and 657565310. 745 Calculate the greatest common factor of 129636765 and 36. 9 Calculate the highest common divisor of 49024046 and 106. 106 What is the highest common divisor of 6022860 and 111? 111 What is the highest common factor of 5263 and 706627? 277 What is the highest common factor of 525159 and 4302? 9 Calculate the highest common factor of 4766926 and 1484. 106 What is the highest common divisor of 6678270920 and 20? 20 Calculate the highest common divisor of 5 and 2310214. 1 Calculate the highest common factor of 1147254876 and 90. 18 What is the highest common factor of 13860648 and 216? 72 Calculate the highest common divisor of 29138 and 43825266. 1714 Calculate the greatest common divisor of 232785 and 1715. 35 Calculate the greatest common divisor of 1781 and 5281761. 137 Calculate the greatest common divisor of 21 and 17923521. 21 Calculate the highest common divisor of 38 and 17149799. 19 Calculate the greatest common factor of 788139 and 24658569. 3771 Calculate the highest common factor of 11 and	{ "pile_set_name": "DM Mathematics" }
= a + -3.8. Let i = v - -5.994. Round i to 3 decimal places. -0.006 Suppose 97834529 + 168115471 = -9m. What is m rounded to the nearest one million? -30000000 Let a = 13.5 + -13.12. Let g = 566.870038 - 567.25. Let t = a + g. What is t rounded to five decimal places? 0.00004 Let g(i) = 1605i + 341. Let s be g(-5). Round s to the nearest one hundred. -7700 Suppose 2a - 3p = 5, -4a + 4 = -3p + 3. Let b(f) = 203749f3 - f2 - 2f - 8. Let c be b(a). What is c rounded to the nearest one million? -2000000 Suppose 4k + 4 = 5i, 4k - 18 = -2i + 6. Suppose kv = -4y + y - 9865486, 2 = y. Let o = v - -4266373. What is o rounded to the nearest 1000000? 2000000 Let y = -165.82 + 166. Let h = -0.179748 + y. What is h rounded to 5 dps? 0.00025 Let n = -26962 + 14449. What is n rounded to the nearest 1000? -13000 Let u = 9.3 - 8.91. Let t = u + -0.238. Let r = t + -0.1382. Round r to three dps. 0.014 Let s(g) = -g*3 + 12g*2 + 12g - 16. Let a be s(7). Suppose 2z + a = 35. Round z to the nearest ten. -140 Let f = -0.5 + 0.8. Let j = f + 0.01. Let o = -0.6 + j. What is o rounded to 1 decimal place? -0.3 Let r(w) = w3 + 4w*2 + 14w - 14. Let u be r(7). Round u to the nearest one thousand. 1000 Let l(x) = -2x2 - 4x + 1. Let v be l(-4). Let a = -1 - v. Let z be 88/a + 2/(-7). What is z rounded to the nearest integer? 6 Let w = -232387 - 865565. Let h = 1097952.1260126 + w. Let b = h + -0.126. Round b to six dps. 0.000013 Let l be 42/9 - 4/(-12). Suppose -4q - 3 = -lq. Suppose -2v + 2415 = -6v - qm, 0 = -5v - 5m - 3025. Round v to the nearest 100. -600 Let o = 1179.99993792 + -1180. Round o to five dps. -0.00006 Let g = -106789561 + 106789544.99999944. Let x = g - -16. What is x rounded to seven decimal places? -0.0000006 Let z = 2 + -9. Let i = z - -10. Let r = i - 3.2. Round r to one dp. -0.2 Let t = 0.0271 - 0.0067. Round t to two decimal places. 0.02 Let u = -92.41 + 1.41. Let s = -90.99919 - u. Round s to four decimal places. 0.0008 Let d = 0.00362 + -0.0721. Round d to two decimal places. -0.07 Suppose 5q = -5u + 25558465, 0q + 25558465 = 5q + 3u. Suppose 0 = v - q + 21401934. Let d = v - -10590241. What is d rounded to the nearest 1000000? -6000000 Let j = 14.58 - 7.623. Round j to zero dps. 7 Let c be -1-15(20/12)/5. Suppose 5n - 845 = -2m, cn - 2 + 17 = 0. Round m to the nearest one hundred. 400 Suppose m = -3m + 3k - 47520003, 3m = 2k - 35640002. Round m to the nearest 1000000. -12000000 Let d = -42 + 42.0038. Let q = d - 0.027. Round q to three decimal places. -0.023 Let v = 9.203 - 22.1515. Let z = v + 12.9. What is z rounded to 2 decimal places? -0.05 Let d = -372338 + 64312. Let v = 130387 + d. Let j = -1117639 - v. What is j rounded to the nearest 100000? -900000 Let x = -682298.964 + 684632. Let y = 2348 - x. Let p = y - 15. What is p rounded to two decimal places? -0.04 Let v = -0.14 - -2.79. Let l = -2.65000438 + v. Round l to 6 dps. -0.000004 Let k = 332089 - 332104.1989. Let v = k + 15.2. What is v rounded to 4 decimal places? 0.0011 Let l = -7584 + 7903.9. What is l rounded to the nearest 10? 320 Let v = 490049445.0000604 + -490049203. Let a = v + -242. Round a to five dps. 0.00006 Let s = -13.4 - 1.6. Let j = s - -14.815. Let r = 23.015 - j. Round r to the nearest integer. 23 Suppose -5s + 0 = -5. Let v be (-35355987)/(-6) - s/2. Suppose -v = -4l + 2627336. Round l to the nearest one hundred thousand. 2100000 Let q(y) = 26810y - 50. Let v be q(5). Round v to the nearest ten thousand. 130000 Let m = 57 - 63. Let c be -4 + 65/15 - (-266)/m. What is c rounded to the nearest integer? -44 Let y = -7.9 - -8. Let b = -0.9 - y. Let w = b - 1.2. What is w rounded to 0 dps? -2 Let s = 1134 + -1132.033. What is s rounded to 1 dp? 2 Let n be (-208)/36 - -6 - 19008004/18. Round n to the nearest 100000. -1100000 Let u = -171.657 + 170.9. Round u to 1 decimal place. -0.8 Let a = -2.9 - 172.1. Let g = a + 176.66. What is g rounded to one dp? 1.7 Let a = -3.5 + 3.517. Let k = -0.0777 - -0.0684. Let c = k + a. Round c to three dps. 0.008 Let z = 2275073.2399997 + -2275073. Let n = 0.24 - z. Round n to six dps. 0 Let a = 669 - 669.2215. What is a rounded to two decimal places? -0.22 Suppose -12l + 12571 = -9629. What is l rounded to the nearest one hundred? 1900 Let i(x) = -2803x*3 + 2x*2 + x + 4. Let m be i(-3). Round m to the nearest 1000. 76000 Let l = 0.74 - 23.74. Let b = 22.95 + l. What is b rounded to 1 dp? -0.1 Let y = -302706.696729 - 0.303271. Let a = 302707.250038 + y. Let v = 0.25 - a. What is v rounded to 5 dps? -0.00004 Let f be 4/12 - 442803/9. Let g be (5000/6)/((-2)/f). Round g to the nearest 1000000. 21000000 Let y = 6.13 - 19. What is y rounded to the nearest integer? -13 Let g = 158 - 91. Let n = 67.56354 + -0.57574. Let u = g - n. Round u to 3 decimal places. 0.012 Let p(l) = 2l + 6l2 - 7l*2 + 3 + 3l*2. Let r be p(-9). What is r rounded to the nearest 10? 150 Let p = 25.4 - 27. Let z = -0.4 + p. Let x = z + 1.958. Round x to two dps. -0.04 Suppose 0 = 33t - 17t + 555840000. Round t to the nearest one million. -35000000 Let g = -0.3306 - -0.0506. Let s = -1.7 - -1.98. Let r = s - g. Round r to 1 decimal place. 0.6 Let s = 2167.0001938 + -2167. Round s to four decimal places. 0.0002 Let v = -1194 + 1750. Let q = v - 555.9591. Round q to three decimal places. 0.041 Let z be -12 - -9 - -801313. Suppose 5c - 1816950 = -r, -4c + 4r + 5129 = -1448431. Let j = z - c. What is j rounded to the nearest ten thousand? -120000 Let t = 262594.5 - -1366950.5. Let o = t + -1629585.99915. Let y = 41 + o. What is y rounded to four dps? 0.0009 Let h = -40.8 + 40.8000184. Round h to five dps. 0.00002 Let y = 88175806.00000505 - 88175834. Let i = y - -28. What is i rounded to 7 dps? 0.0000051 Let c(h) = 5h*2 - 14h + 32. Let d be c(-10). What is d rounded to the nearest 100? 700 Let p = -2.57 - -216.57. Let q = 219.35 - p. What is q rounded to zero dps? 5 Let p = 68.098 - 0.098. Let n = p + -68.134. Round n to 2 decimal places. -0.13 Let w = -0.032 + 27.032. Let o = w - 39. Let v = o - -20.5. Round v to the nearest integer. 9 Let o = -871272 + -546728. Round o to the nearest 100000. -1400000 Let h = -58.3 - 3.7. Let g = 42664949 + -42665010.999934. Let s = g - h. What is s rounded to 5 dps? 0.00007 Let z = 9.85 + 0.15. Let b = 5.8 - z. Let n = b - -4.20000067. What is n rounded to seven decimal places? 0.0000007 Let s = -275 + 275.444. Round s to two dps. 0.44 Let k(h) = 82h3 + 2h*2 - h + 2. Let b be k(2). Suppose 0o = 2o - b. Round o to the nearest 10. 330 Let j = -2173778.3 + 2169721.99995. Let w = -4055 - j. Let u = 1.3 - w. Round u to four dps. -0.0001 Let o = 216.3 - 212. Let s = 5320.7095 + -5325. Let d = o + s. What is d rounded to 3 dps? 0.01 Let k(p) = -p2 + 5p - 7. Let g be k(4). Let r(i) = -10000i2. Let t be r(g). Round t to the nearest one hundred thousand. -100000 Let k = -0.035070606 - 23.469952394. Let v = k + 0.505283. Let z = v + 23. What is z rounded to 4 dps? 0.0003 Let s = 2204.6 + -1947. Let i = s - 23.6. Let r = -235.43 + i. Round r to one decimal place. -1.4 Let q = 0.175 + -0.17. Let f = 3.01 + -3. Let c = q - f. What is c rounded to 2 decimal places? -0.01 Let f = -103.94 + 103.9400007771. What is f rounded to 7 decimal places? 0.0000008 Let l = 0.0324 - 0.0001. Let m = l - 0.059. What is m rounded to three decimal places? -0.027 Let g = -2.951 + 0.101. Let v = -187.1 + 190. Let t = v + g. What is t rounded to 1 decimal place? 0.1 Suppose -18m + 17m = -2932381. Suppose -2w = -15932381 + m. What is w rounded to the nearest one million? 7000000 Let m(b) = -5b - 4. Let w = 21 + -25. Let f be m(w). Let i = -3 + f. Round i to the nearest 10. 10 Let s = 2452 - 1272. Let v = s + -768. Round v to the nearest 100. 400 Suppose 4r - 39800008 = 10d - 5d, r = 3d + 23880002. What is d rounded to the nearest 100000? -8000000 Suppose -4i = -5l + 537 - 157, 0 = 3l + 5i - 265. Suppose -lx = -78*x - 1962000. Round x to the nearest 100000. 1000000 Let q = 963 - 985.5. Round q to the nearest 10. -20 Let k = -0.09264072 - -4211275.09264072. Let s = k + -4211268.0000104. Let c = 7 - s. Round c to six decimal places. 0.00001 Let q = -92.897 - -93. Let r = q +	{ "pile_set_name": "DM Mathematics" }
tors of 331844? 2, 23, 3607 What are the prime factors of 3644031? 3, 227, 5351 List the prime factors of 333702. 2, 3, 18539 List the prime factors of 739. 739 What are the prime factors of 665880? 2, 3, 5, 31, 179 List the prime factors of 3916021. 3916021 List the prime factors of 2653435. 5, 97, 5471 What are the prime factors of 484517? 11, 17, 2591 What are the prime factors of 736373? 11, 66943 What are the prime factors of 110815? 5, 37, 599 What are the prime factors of 76? 2, 19 What are the prime factors of 263020? 2, 5, 13151 List the prime factors of 633907. 163, 3889 List the prime factors of 8824. 2, 1103 What are the prime factors of 2144818? 2, 13, 82493 List the prime factors of 3877387. 19, 29, 31, 227 List the prime factors of 1155470. 2, 5, 115547 What are the prime factors of 1330302? 2, 3, 221717 What are the prime factors of 6693519? 3, 7, 29, 379 What are the prime factors of 5696989? 17, 335117 List the prime factors of 3389966. 2, 71, 23873 What are the prime factors of 252938? 2, 7, 29, 89 What are the prime factors of 1480336? 2, 11, 13, 647 What are the prime factors of 17959? 17959 What are the prime factors of 885308? 2, 221327 What are the prime factors of 165339? 3, 18371 List the prime factors of 1592745. 3, 5, 7, 11, 197 What are the prime factors of 365954? 2, 67, 2731 What are the prime factors of 1184914? 2, 23, 25759 List the prime factors of 1480595. 5, 29, 10211 List the prime factors of 2654138. 2, 29, 67, 683 List the prime factors of 284464. 2, 23, 773 List the prime factors of 11024. 2, 13, 53 List the prime factors of 748206. 2, 3, 197, 211 List the prime factors of 7228559. 13, 556043 What are the prime factors of 665439? 3, 221813 What are the prime factors of 8029157? 8029157 List the prime factors of 313050. 2, 3, 5, 2087 List the prime factors of 545153. 7, 47, 1657 List the prime factors of 3686819. 293, 12583 What are the prime factors of 739181? 29, 71, 359 What are the prime factors of 613444? 2, 13, 47, 251 What are the prime factors of 340768? 2, 23, 463 What are the prime factors of 13134647? 3343, 3929 List the prime factors of 3956483. 23, 172021 What are the prime factors of 468556? 2, 11, 23, 463 List the prime factors of 263588. 2, 13, 37, 137 List the prime factors of 991532. 2, 487, 509 What are the prime factors of 202861? 17, 11933 What are the prime factors of 557700? 2, 3, 5, 11, 13 List the prime factors of 134669. 134669 What are the prime factors of 706150? 2, 5, 29, 487 What are the prime factors of 904739? 11, 233, 353 What are the prime factors of 2819359? 61, 46219 What are the prime factors of 650050? 2, 5, 13001 What are the prime factors of 19059715? 5, 193, 19751 List the prime factors of 19908254. 2, 1801, 5527 What are the prime factors of 5963729? 5963729 What are the prime factors of 2354757? 3, 784919 List the prime factors of 3072324. 2, 3, 503, 509 List the prime factors of 220811. 220811 What are the prime factors of 194827? 194827 What are the prime factors of 228152? 2, 19, 79 What are the prime factors of 473484? 2, 3, 11, 17, 211 List the prime factors of 210225. 3, 5, 2803 What are the prime factors of 167764? 2, 41941 List the prime factors of 82822. 2, 41411 List the prime factors of 4126152. 2, 3, 171923 List the prime factors of 18010117. 18010117 List the prime factors of 2923659. 3, 563, 577 What are the prime factors of 203695? 5, 40739 List the prime factors of 256182. 2, 3, 42697 What are the prime factors of 17493003? 3, 11, 29, 677 What are the prime factors of 28358528? 2, 11, 1831 List the prime factors of 4109761. 4109761 List the prime factors of 326819. 19, 103, 167 What are the prime factors of 4233473? 4233473 What are the prime factors of 256057? 256057 List the prime factors of 2397687. 3, 197, 4057 List the prime factors of 206989. 449, 461 List the prime factors of 1025247. 3, 341749 What are the prime factors of 380? 2, 5, 19 What are the prime factors of 294511? 7, 42073 What are the prime factors of 31280? 2, 5, 17, 23 List the prime factors of 602. 2, 7, 43 List the prime factors of 9322. 2, 59, 79 List the prime factors of 2609072. 2, 29, 5623 List the prime factors of 513321. 3, 397, 431 What are the prime factors of 11573902? 2, 379, 15269 List the prime factors of 5887679. 7, 841097 What are the prime factors of 9256361? 9256361 List the prime factors of 3760840. 2, 5, 167, 563 List the prime factors of 2991696. 2, 3, 62327 List the prime factors of 2390334. 2, 3, 269, 1481 List the prime factors of 1254459. 3, 271, 1543 What are the prime factors of 67442? 2, 33721 List the prime factors of 1129441. 1129441 What are the prime factors of 142707? 3, 47569 What are the prime factors of 500136? 2, 3, 7, 13, 229 What are the prime factors of 282366? 2, 3, 7, 83 What are the prime factors of 4260502? 2, 2130251 What are the prime factors of 1189574? 2, 41, 89, 163 List the prime factors of 7985834. 2, 3992917 What are the prime factors of 419512? 2, 41, 1279 What are the prime factors of 322307? 31, 37, 281 What are the prime factors of 1213820? 2, 5, 137, 443 What are the prime factors of 3236840? 2, 5, 19, 4259 List the prime factors of 468697. 468697 What are the prime factors of 227402? 2, 7, 37, 439 List the prime factors of 284942. 2, 7, 20353 List the prime factors of 2195974. 2, 11, 99817 What are the prime factors of 9151570? 2, 5, 915157 List the prime factors of 164079. 3, 59, 103 What are the prime factors of 3289666? 2, 163, 10091 List the prime factors of 452576. 2, 14143 List the prime factors of 170862. 2, 3, 28477 List the prime factors of 397663. 7, 56809 List the prime factors of 555308. 2, 13, 59, 181 What are the prime factors of 1494103? 13, 19, 23, 263 What are the prime factors of 101802? 2, 3, 19, 47 What are the prime factors of 24276? 2, 3, 7, 17 What are the prime factors of 36289793? 137, 264889 List the prime factors of 23633. 23633 List the prime factors of 1265412. 2, 3, 17, 6203 List the prime factors of 351652. 2, 7, 19, 661 What are the prime factors of 7593189? 3, 149, 16987 What are the prime factors of 363921? 3, 29, 47, 89 What are the prime factors of 219174? 2, 3, 36529 List the prime factors of 718728. 2, 3, 29947 List the prime factors of 452938. 2, 53, 4273 List the prime factors of 1470994. 2, 7, 105071 What are the prime factors of 70450? 2, 5, 1409 List the prime factors of 1371785. 5, 274357 List the prime factors of 982430. 2, 5, 17, 5779 What are the prime factors of 562968? 2, 3, 7, 1117 What are the prime factors of 357995? 5, 11, 23, 283 What are the prime factors of 1573968? 2, 3, 11, 271 What are the prime factors of 34196933? 2371, 14423 What are the prime factors of 3088053? 3, 251, 1367 What are the prime factors of 104710? 2, 5, 37, 283 List the prime factors of 3572466. 2, 3, 595411 What are the prime factors of 6520035? 3, 5, 593, 733 List the prime factors of 2166155. 5, 29, 14939 List the prime factors of 759049. 433, 1753 What are the prime factors of 14018267? 47, 298261 What are the prime factors of 492772? 2, 7, 17599 List the prime factors of 242306. 2, 97, 1249 What are the prime factors of 113835? 3, 5, 7589 List the prime factors of 7216028. 2, 1804007 List the prime factors of 24741212. 2, 6185303 List the prime factors of 10556429. 13, 812033 What are the prime factors of 464949? 3, 19, 2719 List the prime factors of 4531254. 2, 3, 7, 13, 43, 193 List the prime factors of 5667005. 5, 137, 8273 List the prime factors of 351255. 3, 5, 23417 What are the prime factors of 605172? 2, 3, 29, 37, 47 What are the prime factors of 18652991? 7, 41, 103, 631 What are the prime factors of 3738067? 1103, 3389 List the prime factors of 23137282. 2, 7, 101, 16363 What are the prime factors of 332444? 2, 7, 31, 383 What are the prime factors of 2291221? 61, 37561 List the prime factors of 4670645. 5, 7, 133447 What are the prime factors of 1348287? 3, 17, 26437 List the prime factors of 745465. 5, 7, 19, 59 List the prime factors of 670894. 2, 7, 173, 277 What are the prime factors of 529982? 2, 264991 What are the prime factors of 5502776? 2, 687847 What are the prime factors of 6954694? 2, 23, 151189 What are the prime factors of 519964? 2, 61, 2131 What are the p	{ "pile_set_name": "DM Mathematics" }
g) = -g*2 + 13g - 22. Calculate q(10). 8 Let h(r) = r*2 + 39r + 34. Determine h(-38). -4 Let z(u) = -168u2 + 3u + 2. Determine z(-1). -169 Let y(b) = -3b - 4. Give y(-3). 5 Let s(o) = -17o + 99. What is s(22)? -275 Let p(m) = m*3 + 6m*2 - 9m - 12. Calculate p(-7). 2 Let d(l) = l*3 - 13l*2 - 2l + 28. What is d(13)? 2 Let s(k) = -8k + 258. Give s(33). -6 Let l(h) = -4h*3 - 2h*2 + 11h - 3. What is l(-2)? -1 Let v(s) = s*2 + 20s + 72. Calculate v(-16). 8 Let k(a) = a*2 + 9a + 8. Determine k(-5). -12 Let d(w) = 2w3 + w2 - w + 1. What is d(0)? 1 Let x(b) = -5b*3 - 3b*2 - 8b - 3. What is x(-2)? 41 Let u(k) = -k*2 - 21k + 145. Calculate u(-26). 15 Let y(j) = -21j + 1037. Give y(49). 8 Let a(v) = 2v*2 - 15v - 37. Give a(9). -10 Let l(q) = -q2 + 3. Give l(2). -1 Let o(b) = -b2 - 16b + 39. What is o(-17)? 22 Let c(b) = -73b*3 + 3b + 2. Calculate c(-1). 72 Let h(s) = -s*2 - 3s + 1. Calculate h(-4). -3 Let o(r) = r*3 - 4r*2 - 4r + 14. Give o(3). -7 Let h(m) = 2m3 - 2m2 - m - 4. Give h(3). 29 Let n(m) = m3 - 10m2 + 3m - 17. What is n(10)? 13 Let p(i) = i*2 + 4i - 12. Give p(-6). 0 Let j(a) = -a*3 - 15a*2 - 15a + 2. What is j(-14)? 16 Let y(h) = 21h - 15. Determine y(0). -15 Let i(c) = -140c + 557. Give i(4). -3 Let y(n) = 2n + 2. Give y(1). 4 Let t(b) = -b3 + 7b*2 + 6b + 12. What is t(8)? -4 Let b(k) = 11k - 360. Calculate b(32). -8 Let n(c) = -c - 6. Give n(2). -8 Let x(c) = 3c*2 - 14c + 13. Give x(6). 37 Let b(l) = -l*2 + 9l - 14. Calculate b(6). 4 Let y(q) = 3q + 5. What is y(-3)? -4 Let v(h) = -9h - 1. Determine v(3). -28 Let h(m) = m + 18. What is h(-19)? -1 Let d(j) = -4j2 + 9j - 18. Calculate d(6). -108 Let h(z) = -z*3 + 8z*2 + 4z - 82. What is h(7)? -5 Let i(d) = -2d3 - 87d*2 - 40d + 121. What is i(-43)? -8 Let l(h) = -16h - 67. Calculate l(-5). 13 Let a(q) = -q3 + 2q2 + q - 6. Calculate a(2). -4 Let h(w) = w2 - 8w - 179. Give h(-10). 1 Let q(l) = -2l3 - l2 + 2l - 2. What is q(-2)? 6 Let l(r) = -r3 + 16r*2 - 46r - 18. What is l(12)? 6 Let s(o) = 23o3 + o2 + o - 1. Calculate s(1). 24 Let f(z) = 2z*3 - 35z*2 - 10z - 150. Give f(18). -6 Let o(n) = 3n3 - 2n*2 + 16n + 18. What is o(-1)? -3 Let l(x) = -54x3 + x2 - 5x - 5. Determine l(-1). 55 Let c(b) = 6b + 16. What is c(-7)? -26 Let u(o) = -o - 5. Determine u(-8). 3 Let o(u) = 9u3 - u2 + 3u + 5. Give o(-2). -77 Let b(k) = -k2 - k + 14. Determine b(0). 14 Let l(z) = 4z - 1. Calculate l(8). 31 Let k(t) = -t*2 - 9t - 19. Calculate k(-3). -1 Let q(g) = 3g + 19. What is q(-6)? 1 Let b(m) = m3 - 8m*2 + 5m + 3. Give b(6). -39 Let v(r) = -r*3 - 4r*2 + 3r + 5. Calculate v(-4). -7 Let g(y) = -y - 3. Determine g(-6). 3 Let o(v) = v*2 - 2v - 29. Give o(7). 6 Let h(u) = 8u - 4. Determine h(1). 4 Let i(s) = s2 + 7s. What is i(-5)? -10 Let d(g) = g*3 + 16g2 + g - 203. What is d(-15)? 7 Let n(u) = u2 - 10u - 7. Calculate n(9). -16 Let a(h) = -15h + 1. What is a(5)? -74 Let r(f) = 2f3 + 2f2 + f - 3. Determine r(-2). -13 Let z(v) = v3 + 23v2 + 42v + 9. What is z(-21)? 9 Let r(a) = a*3 + 5a*2 + a - 1. Calculate r(-4). 11 Let u(p) = 18p + 60. Calculate u(-4). -12 Let l(p) = p*2 + 21p + 18. Determine l(-20). -2 Let m(u) = 4u - 153. Calculate m(39). 3 Let s(h) = h2 + 5h - 105. What is s(-13)? -1 Let y(t) = -5t + 6. Calculate y(4). -14 Let w(m) = 5m - 45. Give w(8). -5 Let t(b) = b - 13. What is t(12)? -1 Let c(h) = h - 15. What is c(16)? 1 Let x(r) = 4r + 1. What is x(-1)? -3 Let b(f) = -f3 - 7f*2 + 31f + 16. What is b(-10)? 6 Let m(n) = n*2 + n. Determine m(5). 30 Let l(a) = -2a*2 - 18a - 63. Calculate l(-3). -27 Let x(j) = j*3 + 2j*2 + j + 9. What is x(0)? 9 Let o(q) = -2q*2 - 2q - 7. Determine o(-6). -67 Let r(b) = 17b - 21. Give r(8). 115 Let d(s) = -s2 - 17s - 24. Give d(-10). 46 Let k(r) = 9r + 3. Calculate k(-3). -24 Let j(m) = -m2 + 29m + 24. What is j(30)? -6 Let d(v) = -24v - 2. Give d(3). -74 Let x(h) = -18h + 60. What is x(4)? -12 Let t(w) = -2w3 - 41w*2 + 23w + 38. Calculate t(-21). -4 Let b(w) = -5w + 37. Determine b(7). 2 Let s(a) = -a2 - 5a + 3. Calculate s(-7). -11 Let v(l) = -95l - 5. Determine v(1). -100 Let d(v) = -v3 - 6v*2 - 6v - 5. What is d(-4)? -13 Let d(y) = 50y + 755. Determine d(-15). 5 Let i(g) = g3 - 6g*2 - 5g + 1. Give i(7). 15 Let o(m) = -m*2 - m - 21. Give o(0). -21 Let j(z) = -2z - 33. Give j(-6). -21 Let z(n) = 7n - 58. Determine z(8). -2 Let u(f) = f2 + 9f + 5. What is u(-10)? 15 Let k(f) = -f*3 - 17f*2 + 19f + 25. What is k(-18)? 7 Let a(q) = -3q + 41. Determine a(11). 8 Let c(d) = d2 + 17d - 34. Give c(-19). 4 Let k(n) = 2n2 + n - 13. Calculate k(0). -13 Let m(b) = -12b - 17. Determine m(-2). 7 Let x(a) = -6a2 - a - 3. What is x(-2)? -25 Let c(n) = 12n*2 + 5n - 2. What is c(3)? 121 Let y(n) = n*3 - 13n*2 + 13n + 12. What is y(12)? 24 Let i(k) = -k*3 - 8k*2 - 3k + 10. Give i(-7). -18 Let x(k) = -2k2 + 12k - 15. What is x(5)? -5 Let h(z) = 3z2 - 5z + 2. Give h(4). 30 Let c(o) = 4o + 58. What is c(-17)? -10 Let v(i) = i3 + 7i*2 - 11i + 46. What is v(-9)? -17 Let f(q) = q*3 + 14q*2 + 19q + 4. Determine f(-12). 64 Let b(t) = -t*3 - 8t*2 + 23. Give b(-7). -26 Let g(n) = 3n - 6. Determine g(-9). -33 Let x(v) = -8v - 6. Calculate x(-5). 34 Let v(u) = u2 - 4u + 1. Give v(3). -2 Let w(u) = -u*3 + 5u*2 - 3u + 11. Calculate w(5). -4 Let h(x) = -x + 3. What is h(-3)? 6 Let p(g) = -g*3 - 5g*2 + 6g + 2. What is p(-6)? 2 Let g(t) = 6t + 18. Calculate g(-14). -66 Let j(z) = 2z - 41. What is j(20)? -1 Let u(m) = 13m - 39. Give u(3). 0 Let i(d) = d + 9. What is i(9)? 18 Let y(n) = -7n - 84. Calculate y(-10). -14 Let h(a) = -3a2 + 41a + 122. What is h(16)? 10 Let k(g) = g*3 + 8g*2 - 27g - 55. Give k(-10). 15 Let l(f) = -3f2 + 24f - 39. Calculate l(6). -3 Let z(h) = -2h3 + 6h2 + 3. Determine z(3). 3 Let b(y) = -y2 + 7y - 4. Calculate b(6). 2 Let d(o) = 4o*3 + 33o*2 - 26o + 1. Calculate d(-9). -8 Let y(o) = -o*2 + 4o - 4. Determine y(5). -9 Let w(x) = 6x - 13. Determine w(-7). -55 Let n(m) = m3 + 17m*2 - 86m - 52. Determine n(-21). -10 Let d(w) = -w*3 - 15w*2 + 16w - 16. Determine d(-16). -16 Let t(f) = 7f2 + 42f - 5. Determine t(-6). -5 Let l(j) = 6j + 4. What is l(5)? 34 Let h(i) = -i3 + 8i*2 + 28i - 8. Give h(11). -63 Let b(r) = -r2 - 1. Determine b(4). -17 Let r(g) = -g3 + 2g2 + 5g + 3. What is r(4)? -9 Let j(z) = z*3 - 17z*2 + 3z - 50. Determine j(17). 1 Let l(v) = v*3 - 23v*2 - 22v - 52. Calculate l(24). -4 Let y(u) = -3u - 14. Determine y(-4). -2 Let z(y) = 3y - 16. What is z(6)? 2 Let b(q) = 14q - 1. Determine b(1). 13 Let v(s) = -8s - 4. Determine v(-3). 20 Let t(o) = 36o3 - o2 + 1. Calculate t(-1). -36 Let g(t) = -t2 + 3t + 17. What is g(6)? -1 Let y(f) = 34f - 190. Give y(7). 48 Let a(u) = -u3 - 16u*2 - 30u - 30. Determine a(-14). -2 Let d(n) = n*3 - 5n*2 + 4n + 11. Calculate d(4). 11 Let v(q) = q*2 + 15q - 55. Calculate v(-18). -1 Let n(g) = 2g - 16. Determine n(6). -4 Let h(q) = -2q*3 + 10q2 + q + 6. Determine h(4). 42 Let t(l) = -l2 - 6l + 10. Determine t(-7). 3 Let a(v) = 6v*3 + 2v*2 - v. Calculate a(1). 7 Let t(z) = 3z - 30. Determine t(17). 21 Let v(d) = d*3 - 11d*2 + 9d + 9. Calculate v(10). -1 Let f(h) = h + 10. Give f(-17). -7 Let a(v) = v*2 - 9v - 25. Give a(-3). 11 Let i(k) = -k*2 - 7k - 4. Determine i(-6). 2 Let u(d) = 3d - 8. Determine u(-7). -29 Let m(n) = n2 - 22n - 104. Determine m(26). 0 Let z(w) = -26w + 31. Calculate z(1). 5 Let j(o) = 2o. Calculate j(-2). -4 Let k(i) = 7i - 89. Calculate k(14). 9 Let s(q) = q2 + 24q - 58. Determine s(-26). -6 Let v(l) = l*2 - 12l + 14. Give v(8). -18 Let m(c) = c*3 + 7c*2 - 8c + 1. Determine m(-8). 1 Let i(f) = -f*3 - 5f*2 - 3f - 18. Calculate i(-5). -3 Let b(v) = -3v - 1. Determine b(-2). 5 Let o(w) = w3 + 16w*2 - 2w - 17. Calculate o(-16). 15 Let l(s) = -s*3 - 2s*2 - 2s + 2. What is l(-2)? 6 Let h(i) = -2i2 - 3i + 3. Give h(2). -11 Let d(r) = r*3 - 20r*2 + 16r - 23. Determin	{ "pile_set_name": "DM Mathematics" }
z, x, b? z Let k = -349 - -326. Let i = 0.1 - 0.3. What is the biggest value in i, k, -1/3? i Let d = -5 + 5.5. What is the smallest value in -14, d, 0.3, -0.4? -14 Let f be 3493/49 + (-8)/2. Let z = f + -67. Let x = -5 + 5.4. Which is the smallest value? (a) x (b) z (c) 2 b Let p = -340 + 342. What is the biggest value in 4, -5, p? 4 Let n be (-4)/((-8)/(-14)) - -2. Let r = n - -37/7. Which is the fourth smallest value? (a) r (b) 3 (c) -3 (d) 0.3 b Let w(i) = -i + 10. Let k be w(8). Suppose 3h = kf + 17, 3f - f = -5h + 7. Let y be (-1)/2 - (-6)/f. Which is the smallest value? (a) 1/5 (b) -0.3 (c) y c Let o = -0.04 + 0.64. Suppose 100 = -79f + 84f. Suppose f = 258z - 254z. What is the smallest value in o, 0, z? 0 Let f = 1.4 - 3.4. Let c = -516 + 512. What is the second smallest value in f, 5, c? f Let x(p) = p*2 + 11p. Let q be x(-11). What is the biggest value in q, -1/3, 5, -13? 5 Let r be (57/38)/(-1 + (-34)/8). What is the smallest value in r, -2/83, -4? -4 Let m be 3-32/(-18). Let o = 4.9 - 3.6. Let u = -5.3 + o. Which is the biggest value? (a) -20 (b) u (c) m c Let k = -927 + 922. Let v(o) = -o*2 + 5o - 6. Let u be v(5). What is the biggest value in 1, u, k? 1 Let f = 1/4 + -1/2. Let x = 656/15 - 130/3. Which is the smallest value? (a) f (b) x (c) -2/11 (d) 4 a Let s = -0.07 + -0.43. Let y = 5 - 3. Let d = 0.07 + 4.93. What is the second biggest value in s, d, y? y Let n = -17.518 + 1.518. Which is the biggest value? (a) -2 (b) -7 (c) n a Let i be 575/(-20)(-16)/(-2651). Let r = 2/241 - i. Which is the second biggest value? (a) -3 (b) 5 (c) r c Suppose -c + 6t = 4t + 385, -4t = 3c + 1145. What is the third biggest value in 0.3, c, 2? c Let v = 4.78 - 0.78. Let r = -62.24 - -62. What is the third biggest value in -1/2, v, r? -1/2 Suppose -a = -4l - 44, -124 = -5a - l - 9. What is the third smallest value in -5, a, 0? a Let s = -14.1 + 0.1. Let v = s + 20. Let i = v - 8. Which is the third smallest value? (a) 5 (b) i (c) 3/4 a Let j(s) = 28s + 138. Let l be j(-5). Which is the third biggest value? (a) 4/3 (b) 4 (c) -22 (d) l d Let j = -3 + 41/14. Which is the second biggest value? (a) 2/5 (b) j (c) -3 b Let d be (-2)/(-28) + (-5 - (-304)/56). Which is the second biggest value? (a) -0.4 (b) -26 (c) d a Let d = -2.6 + 5. Let o = -5.2 + d. Let l = o + 2.4. Which is the second smallest value? (a) -0.5 (b) -5/3 (c) l a Suppose t + 7 = 4. Let h = 17 - 14. Let v = 0 - 0.3. Which is the second biggest value? (a) h (b) t (c) v c Let s = 1 - -5. Let y = 5.7 - s. Let t be ((1240/(-336))/(-31) - 3/(-18))/1. What is the smallest value in t, y, 1? y Suppose -118q + 8 = -122q. Let n be (-56)/18 + (1 - q). What is the biggest value in 0.1, n, 0.5? 0.5 Let g = 1114 - 1110. Which is the fourth smallest value? (a) g (b) 3 (c) -1 (d) 33 d Let o = 116 - 96. Let h = o + -17. Which is the third smallest value? (a) -0.4 (b) -16 (c) h c Let u(y) = -y*3 - 6y*2 - 2y. Let c be u(-5). Let a be (1 - -1)((-85)/c + -6). What is the third biggest value in a, -0.4, 0.9? a Let c = -10.52 + 50.52. What is the biggest value in c, 3, 1? c Let y be 44/52 - (0 + 1). Let h(j) = -j - 15. Let u be h(-8). Let s be (2/(-15))/(-1) + (-5)/(-25). Which is the smallest value? (a) s (b) y (c) u c Let m = -110 - -82. Let o = m + 27.943. Which is the second smallest value? (a) 3 (b) -2 (c) o c Let n = -13.8 + 14. Let g be (-1)/3(18 + -21). Which is the third smallest value? (a) 2/7 (b) -7/2 (c) g (d) n a Let s = 106/115 + -12/23. Let n = 27 - 29. Suppose p - 6 = -2p. What is the second smallest value in p, n, s? s Let f = 517 + -3617/7. What is the fourth smallest value in f, -0.3, 2/15, 1.2? 1.2 Let m = -11 - -8. Let h = m + -1. Let j be (-2)/1 + 6 + -5. Which is the smallest value? (a) h (b) j (c) 2/5 a Let p = 87 + -84. Let f be (1 + 1)/(4/14). Let g be (-21)/3(-6)/f. What is the second biggest value in p, g, 0.1? p Let o = -0.3 + 0.8. Let d = -6700 + 6705. What is the third biggest value in o, d, 7, 4/3? 4/3 Let f = 8 + -23. Let n be (-10)/25 + (-6)/f. Let x = -70 + 67. Which is the smallest value? (a) n (b) 5 (c) x c Suppose -2j + 168 = 2v, 5j - 5v - 62 - 368 = 0. What is the fourth biggest value in j, 0, -7, 0.2? -7 Let k = 18 - 27. Let d = -6.03 + 0.03. Let q = d - k. Which is the third smallest value? (a) -5/6 (b) q (c) -4 b Let h = -1070.4 - -1065.483. Let q = 0.083 - h. Which is the smallest value? (a) -3 (b) 3/2 (c) -1/2 (d) q a Let d = 19 - 32. Let u = d + 14. Let w = 4 - u. Which is the biggest value? (a) 5/6 (b) -2 (c) w c Let h = -3 + -1. Let w be (-2 + (-27)/(-12))-2. What is the biggest value in w, 3/4, h? 3/4 Let q = -34.9 + 34.4. Which is the second smallest value? (a) 2/15 (b) q (c) 1/13 (d) -0.4 d Suppose -10 = -8r + 3r. Let m = 194/85 - 12/5. Which is the second smallest value? (a) -1/3 (b) r (c) m c Let d = -9.9 + 0.7. Let z = -8.9 - d. What is the third smallest value in -29, 1, z? 1 Let h = -0.32 - -0.02. Let l = h - -0.3. Let a be -1 + 1 + -2 - 605/(-363). What is the biggest value in l, a, -0.4? l Let l be -5 + 1 + 2 - -72. Let j be l/28 - 2/(-4). What is the second biggest value in -0.11, 2, j? 2 Let h = -0.7 - -7.3. Let v = 8 - h. Let j = 1.4 - v. What is the second smallest value in 1/5, -5, j? j Let h = -42267 - -253601/6. Let d = 1202 + -22830/19. Let f = d - 94/133. What is the biggest value in h, f, 2/5? 2/5 Let x = 47.3 - 65.3. Which is the smallest value? (a) -4 (b) 1/3 (c) x (d) -2/3 c Let w = 2371/69387 - 13/303. Let r = 452/687 - w. Let f = 2 - 1. Which is the biggest value? (a) -3 (b) f (c) r b Let j = 145/1442 - 3/103. Let o = 5.884 + -0.884. Which is the second smallest value? (a) -2 (b) o (c) j (d) 1/6 c Let g(s) = s2 - 3s. Let i be g(7). Let k = i + -25. Suppose -3 = -5r + kd, -d = -5r + 3d + 4. Which is the smallest value? (a) 2/9 (b) 0.4 (c) r c Let q = -1185449/61467 - -2/8781. What is the biggest value in q, 2/13, -3? 2/13 Suppose 11a - 22 = 22a. What is the second biggest value in 0.9, -1, a, 7? 0.9 Let o = -1890 + 1870. Let d = 5 - 2. Which is the third biggest value? (a) o (b) d (c) 0.3 a Let o be 4/(39/(-9) - -1). Let y = 56 + -842/15. What is the third biggest value in 1, o, y? o Let f = 22.03 + -19.03. Let j = 378 + -2275/6. Which is the third smallest value? (a) 0 (b) f (c) j b Let k = -11 + 6. Let b be -15 - (22 - 9101/247). What is the fourth biggest value in -4, k, 3, b? k Let v = -5.0337 - -0.0337. Let g be (-9)/(-21)(-4)/(-6). Which is the second smallest value? (a) v (b) -3 (c) g (d) 1 b Let n = 0.354 + 2.666. Let x = 0.02 - n. Let s = -2.1 - -2. What is the biggest value in -1, x, s? s Let p = 12.96 - 4.96. What is the smallest value in -0.5, p, 1/2, 1? -0.5 Let j = 28.89 - 29. Let y = -3.89 + j. Let l = -0.0197 + 0.0297. Which is the second smallest value? (a) y (b) l (c) -2 c Let x = -13 + 13. Suppose 7d - 2d = 105. Let o(a) = -a + 16. Let p be o(d). What is the biggest value in p, x, -2? x Let x be 3/(-6)4/(-23). What is the fourth biggest value in x, -1/4, -0.4, -1? -1 Let v = -5582/9 - -620. Which is the fourth biggest value? (a) v (b) -19 (c) -5 (d) 3 b Let r = -1.1 - -7.1. Let j = 8 - r. Let s = -10597.9 - -10598. Which is the second smallest value? (a) j (b) s (c) -3 b Let w = 284 - 264. What is the second smallest value in 1, 1/2, w? 1 Let z = -11.58 + 12. Let q = z - 2.32. Let y = 11.4 - 11. Which is the smallest value? (a) y (b) 2/9 (c) q c Let t be (-16)/(-18) + 18/(-81). Let n = 0.17 - 9.17. Let h = n + 4. Which is the second smallest value? (a) 4 (b) h (c) t c Let u = 1.1 - 0.9. What is the second biggest value in u, -5, 0.06, -2? 0.06 Let i = 4/17 + 73/51. What is the smallest value in i, 0.3, -3, -0.3? -3 Let x be ((-8)/(-26))/((-612)/(-1326)). Let h = -5069 - -410584/81. Let w = h - 29/405. Which is the third biggest value? (a) w (b) x (c) 0.1 a Let s = -256 - -259. What is the smallest value in 0.1, -2, s, 1? -2 Let p = 2 + 3. Let f = 0.092 - 6.092. Let o = f + 1. What is the third biggest value in p, -3, o? o Let i(u) = 26*u + 4. Let l be i(8). Let p be -1 + 0 + 214/l. Let j = p - -79/53. Which is the biggest value? (a) 2 (b) 1/	{ "pile_set_name": "DM Mathematics" }
h*2 + 768h - 25 What is the x'th term of 69, 282, 643, 1158, 1833? x*3 + 68x*2 + 2x - 2 What is the r'th term of -145, -147, -149, -151, -153? -2r - 143 What is the n'th term of 486, 479, 460, 423, 362, 271, 144, -25? -n3 + 487 What is the t'th term of -42039, -42037, -42035, -42033, -42031? 2t - 42041 What is the d'th term of -87, -88, -77, -48, 5, 88? d*3 - 8d - 80 What is the h'th term of 497, 490, 483? -7h + 504 What is the f'th term of -46, -188, -416, -724, -1106, -1556, -2068? f3 - 49f*2 - 2f + 4 What is the w'th term of 1105, 1088, 1071, 1054? -17w + 1122 What is the o'th term of 19, 67, 115, 163? 48o - 29 What is the n'th term of -6789, -6786, -6779, -6768, -6753, -6734, -6711? 2n2 - 3n - 6788 What is the i'th term of -111, -98, -53, 42, 205, 454? 3i3 - 2i*2 - 2i - 110 What is the p'th term of -113, -54, 5, 64, 123, 182? 59p - 172 What is the h'th term of 142, 133, 126, 121, 118? h2 - 12h + 153 What is the c'th term of -53, -109, -165, -221, -277, -333? -56c + 3 What is the j'th term of -115, -103, -79, -37, 29, 125, 257, 431? j3 + 5j - 121 What is the c'th term of -56, -105, -140, -155, -144, -101? c3 + c2 - 59c + 1 What is the y'th term of -30, -252, -856, -2034, -3978, -6880, -10932? -32y3 + y2 - y + 2 What is the a'th term of 699, 697, 695? -2a + 701 What is the h'th term of 65, 119, 161, 191, 209, 215? -6h*2 + 72h - 1 What is the l'th term of -506, -541, -576? -35l - 471 What is the i'th term of 4, 11, 24, 43, 68, 99, 136? 3i*2 - 2i + 3 What is the w'th term of 11, 25, 41, 59, 79, 101? w*2 + 11w - 1 What is the b'th term of 16, 38, 74, 130, 212, 326? b3 + b2 + 12b + 2 What is the i'th term of 58, 71, 84, 97? 13i + 45 What is the j'th term of 93, 87, 87, 99, 129? j*3 - 3j*2 - 4j + 99 What is the l'th term of 321, 330, 345, 366? 3l2 + 318 What is the u'th term of 1272, 1271, 1270, 1269, 1268? -u + 1273 What is the a'th term of -477, -486, -495, -504, -513? -9a - 468 What is the a'th term of -13524, -13519, -13512, -13503, -13492? a*2 + 2a - 13527 What is the t'th term of -595, -1183, -1771, -2359, -2947? -588t - 7 What is the s'th term of -8, 11, 60, 139, 248? 15s*2 - 26s + 3 What is the d'th term of -26, -100, -224, -398, -622? -25d2 + d - 2 What is the y'th term of 15147, 30296, 45447, 60600, 75755, 90912, 106071? y2 + 15146y What is the w'th term of 511, 512, 513? w + 510 What is the h'th term of 38, 86, 138, 194? 2h2 + 42h - 6 What is the a'th term of -503, -459, -415, -371, -327, -283? 44a - 547 What is the v'th term of 1, 9, 39, 103, 213, 381, 619, 939? 2v3 - v2 - 3v + 3 What is the f'th term of -5957, -5970, -5997, -6044, -6117, -6222, -6365? -f3 - f2 - 3f - 5952 What is the t'th term of 62, 125, 188, 251, 314? 63t - 1 What is the y'th term of -58, -210, -470, -844, -1338, -1958? -y3 - 48y*2 - y - 8 What is the x'th term of 246, 237, 224, 207, 186? -2x*2 - 3x + 251 What is the t'th term of -112, -224, -336, -448? -112t What is the h'th term of -2429, -2431, -2433? -2h - 2427 What is the c'th term of -1548, -3096, -4644? -1548c What is the l'th term of 0, -2, -4, -6, -8? -2l + 2 What is the i'th term of -1, 0, -1, -4, -9? -i*2 + 4i - 4 What is the v'th term of -124, -119, -114, -109, -104, -99? 5v - 129 What is the r'th term of 3186, 6371, 9556, 12741? 3185r + 1 What is the w'th term of 156, 628, 1414, 2514, 3928, 5656? 157w2 + w - 2 What is the d'th term of -82, -91, -112, -151, -214, -307? -d3 - 2d - 79 What is the i'th term of 88, 79, 66, 49? -2i2 - 3i + 93 What is the w'th term of 1397, 2795, 4193, 5591? 1398w - 1 What is the h'th term of 189, 186, 183, 180? -3h + 192 What is the m'th term of -2110, -4222, -6336, -8452, -10570, -12690? -m*2 - 2109m What is the k'th term of -9, -57, -145, -279, -465, -709, -1017? -k*3 - 14k*2 + k + 5 What is the j'th term of 134, 270, 406, 542? 136j - 2 What is the u'th term of -3, -6, -19, -48, -99, -178, -291? -u3 + u2 + u - 4 What is the l'th term of -3096, -3088, -3080, -3072? 8l - 3104 What is the l'th term of 16, 18, 30, 58, 108, 186? l3 - l2 - 2l + 18 What is the q'th term of -43, -91, -141, -193? -q*2 - 45q + 3 What is the r'th term of 740, 736, 732? -4r + 744 What is the h'th term of -15, -7, 3, 15, 29, 45? h2 + 5h - 21 What is the d'th term of 51161, 51160, 51159, 51158? -d + 51162 What is the w'th term of -516, -523, -532, -543, -556, -571, -588? -w*2 - 4w - 511 What is the t'th term of 173, 173, 171, 167? -t*2 + 3t + 171 What is the k'th term of -93, -85, -67, -33, 23, 107, 225, 383? k3 - k2 + 4k - 97 What is the t'th term of 17386, 17387, 17388, 17389, 17390, 17391? t + 17385 What is the m'th term of -8143, -8144, -8145, -8146, -8147? -m - 8142 What is the r'th term of 254, 508, 762, 1016, 1270? 254r What is the z'th term of -48, -64, -104, -180, -304, -488? -2z3 - 2z - 44 What is the f'th term of 44, 129, 286, 551, 960? 6f3 + 43f - 5 What is the w'th term of -1079, -1083, -1099, -1133, -1191? -w*3 + 3w - 1081 What is the i'th term of 5, 13, 37, 83, 157, 265? i*3 + 2i*2 - 5i + 7 What is the t'th term of 10330, 20660, 30990? 10330t What is the v'th term of -36, -66, -104, -144, -180, -206, -216? v3 - 10v*2 - 7v - 20 What is the h'th term of 370, 361, 338, 295, 226, 125, -14, -197? -h3 - h2 + h + 371 What is the z'th term of -52, -126, -218, -334, -480, -662? -z*3 - 3z*2 - 58z + 10 What is the j'th term of -74, -163, -252? -89j + 15 What is the b'th term of -6, -34, -70, -108, -142, -166? b3 - 10b*2 - 5b + 8 What is the z'th term of -95, -75, -47, -11, 33, 85? 4z2 + 8z - 107 What is the l'th term of 27, 33, 37, 39, 39? -l*2 + 9l + 19 What is the i'th term of -76, -168, -260, -352, -444, -536? -92i + 16 What is the w'th term of 306, 617, 932, 1251, 1574, 1901, 2232? 2w*2 + 305w - 1 What is the d'th term of 104, 114, 124? 10d + 94 What is the a'th term of -77, -3, 201, 601, 1263, 2253? 11a3 - a2 - 87 What is the q'th term of 445, 447, 449, 451, 453? 2q + 443 What is the y'th term of -4091, -4097, -4103, -4109, -4115, -4121? -6y - 4085 What is the d'th term of 130, 133, 138, 145? d*2 + 129 What is the l'th term of -8, -3, 2, 7, 12, 17? 5l - 13 What is the h'th term of -16, -50, -108, -202, -344? -2h3 - 20h + 6 What is the m'th term of -201, 6, 571, 1674, 3495, 6214? 30m3 - m2 - 230 What is the j'th term of -41, -80, -197, -434, -833, -1436, -2285, -3422? -7j*3 + 3j2 + j - 38 What is the o'th term of -1, -12, -25, -40, -57, -76, -97? -o2 - 8o + 8 What is the f'th term of 4, 11, 20, 31? f2 + 4f - 1 What is the i'th term of -16, -54, -94, -136, -180? -i*2 - 35i + 20 What is the i'th term of -15214, -15213, -15212, -15211? i - 15215 What is the a'th term of 619, 623, 627, 631? 4a + 615 What is the x'th term of 9151, 9146, 9129, 9094, 9035? -x3 + 2x + 9150 What is the c'th term of -807, -806, -805? c - 808 What is the w'th term of -152, -149, -146? 3w - 155 What is the w'th term of 11, 32, 65, 116, 191, 296? w3 + 14w - 4 What is the p'th term of 173, 353, 535, 719? p*2 + 177p - 5 What is the w'th term of 25, 36, 55, 82, 117, 160? 4w2 - w + 22 What is the b'th term of 2390, 2388, 2386, 2384, 2382, 2380? -2b + 2392 What is the d'th term of -93, -110, -137, -174? -5d2 - 2d - 86 What is the s'th term of 78, 152, 230, 312? 2s2 + 68s + 8 What is the q'th term of 461, 923, 1385, 1847, 2309? 462q - 1 What is the a'th term of -60, -62, -78, -114, -176, -270, -402, -578? -a3 - a2 + 8a - 66 What is the g'th term of -1315, -1327, -1343, -1363, -1387? -2g2 - 6g - 1307 What is the s'th term of 11, 6, -3, -16? -2s2 + s + 12 What is the s'th term of -63, -125, -187, -249? -62s - 1 What is the s'th term of 24, 32, 40? 8s + 16 What is the l'th term of 31, 167, 393, 709, 1115, 1611? 45l*2 + l - 15 What is the a'th term of -423, -478, -537, -600, -667, -738, -813? -2a*2 - 49a - 372 What is the r'th term of 2, -42, -114, -214, -342, -498? -14r2 - 2r + 18 What is the f'th term of -143, -140, -135, -128, -119? f*2 - 144 What is the m'th term of 3391, 3389, 3387? -2m + 3393 What is the v'th term of 70, 93, 140, 217, 330, 485,	{ "pile_set_name": "DM Mathematics" }
lify 642(((3sqrt(196) + sqrt(196))-2)/sqrt(7))2. 86016 Simplify (((sqrt(50) + 5(sqrt(50) + sqrt(1250)))/sqrt(320))/(sqrt(80)-2 + sqrt(40)/(-3sqrt(8))))*2. 8649/20000 Simplify (((sqrt(1700)2 - sqrt(1700)) + sqrt(1700))-5 + (1 + sqrt(1700) + sqrt(1700) + 1 - sqrt(1700)) + (sqrt(1700) + 1 - sqrt(1700)) + -1 + -4)245. 7200sqrt(17) + 2754080 Simplify 6((sqrt(1100) + -2 - sqrt(1100)) + sqrt(1100) + sqrt(1100))2-6 + -1(sqrt(176) + 0) + -4. -158548 + 2876sqrt(11) Simplify (4-4sqrt(104) - (sqrt(104) - (sqrt(104) - (sqrt(104) + -3sqrt(104)2))))/(sqrt(8)-26 + sqrt(8) + 3sqrt(16)/sqrt(2)). 11sqrt(13)/8 Simplify -5(1 + sqrt(931) - (2sqrt(228))/sqrt(12))*2 + (-4(2 + sqrt(475) + -3 + sqrt(19)))*2 + 5. -242sqrt(19) + 8585 Simplify ((sqrt(1216) + -3 + -4 + sqrt(1216))-2)2 + -1 + ((sqrt(114)/sqrt(6))2 + sqrt(19))-2 + -1. -898sqrt(19) + 19612 Simplify -5 + (2(sqrt(2793) + (sqrt(2793) - (sqrt(2793)3 + sqrt(2793) + sqrt(2793) + sqrt(2793)))))/(sqrt(363) + sqrt(363) + -2sqrt(363)-6 + sqrt(363)). -5 - 56sqrt(19)/165 Simplify (((sqrt(216) - (-5sqrt(216) + sqrt(216)))/sqrt(6) + sqrt(36))/(sqrt(22)/(2sqrt(11)-4 + sqrt(11))))2. 31752 Simplify ((sqrt(21) - (sqrt(21) + sqrt(42)/sqrt(2))3) + sqrt(21)-2-3)/(2sqrt(252)4-4). -sqrt(3)/192 Simplify ((sqrt(24) + -2sqrt(1944))/(sqrt(66)/sqrt(99)))/((1sqrt(1408) + sqrt(1408))/(sqrt(33)/sqrt(12))). -51sqrt(2)/32 Simplify 4 + ((-1sqrt(1536))/((sqrt(84)-3)/sqrt(7)) + 0)3 + 5. 9 + 8sqrt(2) Simplify (4(sqrt(98) + 0 + 5))2 - ((sqrt(162))2-4 - (sqrt(2) - (-1 + 0 + sqrt(2)))*2). 1120sqrt(2) + 2617 Simplify (62sqrt(1792)-6)/(sqrt(4) + sqrt(256) + (sqrt(256)-2 - sqrt(256)) + (-4sqrt(40))/sqrt(10)). 576sqrt(7)/19 Simplify (3(sqrt(32)/(-1sqrt(4)) - 1sqrt(200)))/(((sqrt(288) + 1sqrt(288) + sqrt(288))/sqrt(8))/(sqrt(45)/(-2sqrt(5)))). 3sqrt(2) Simplify (4sqrt(1100)-4)*2 + (-3sqrt(1100)-2 - sqrt(1100)) + (3((sqrt(1100) - (-2sqrt(1100) + sqrt(1100))) + sqrt(1100) + -2))2-5. -164080 + 5450sqrt(11) Simplify (6-4(sqrt(44) - ((sqrt(484)1)/sqrt(11) - sqrt(44))))/(sqrt(12)/(sqrt(3) + sqrt(147)) - sqrt(108)/sqrt(3)). 192sqrt(11)/23 Simplify 3(sqrt(352) - -1sqrt(352)3)/((-1sqrt(64))/sqrt(8)) + 1. -24sqrt(11) + 1 Simplify (((sqrt(320) - (sqrt(320) - (0 + sqrt(320) + sqrt(320)))-6) + sqrt(320) + sqrt(320)22 - 3(sqrt(320) + 4-2sqrt(320))) + -2)*2. -672sqrt(5) + 141124 Simplify (-1 + -4 + (-2sqrt(2448)-2 + 2)-4-3)*2. 21888sqrt(17) + 5640553 Simplify ((-4sqrt(385)2)/(sqrt(396)-2 + sqrt(396) + sqrt(396) - sqrt(396)))/(1sqrt(605)2-4). -sqrt(7)/66 Simplify (6sqrt(18) + sqrt(288)-1 + 2)*2 - ((sqrt(12)/sqrt(2) - sqrt(6))5 + sqrt(6))/((sqrt(12) + sqrt(3) + sqrt(3) + sqrt(3))2). 239sqrt(2)/10 + 76 Simplify 6((sqrt(1100) + -1)-3 - sqrt(1100))2 - (-2 + (3 + (sqrt(2156) + -2 - sqrt(2156) - sqrt(2156) - sqrt(2156)))2). -1384sqrt(11) + 97031 Simplify (4sqrt(220)/sqrt(4) + sqrt(2695) + (-4sqrt(2695) - sqrt(2695)))/(-2(-2sqrt(275) - (sqrt(704)-2 - sqrt(704)))). 6sqrt(5)/7 Simplify ((2 + (0 + (0 + sqrt(208) - sqrt(208)) + sqrt(208) + sqrt(208) + -1 + sqrt(208) + 3 - (sqrt(208) + -1 + 0 + -4)))-3)*2. 1296sqrt(13) + 8217 Simplify (sqrt(2600)-2 + (-3sqrt(130) + sqrt(130))/sqrt(5))/(sqrt(8)/sqrt(36) - -3sqrt(2)-1). 33sqrt(13)/4 Simplify (-3(-1sqrt(100) - sqrt(100)) + sqrt(100) + 51sqrt(100))/(sqrt(200) + sqrt(8)/(sqrt(4) - -3sqrt(4))). 240sqrt(2)/41 Simplify (6(4 + -1(sqrt(432) + 1)-1 + 1 + -5(sqrt(432) - (sqrt(432) - (sqrt(432) + 1)) - sqrt(432))))2. 864sqrt(3) + 15588 Simplify 0 + ((2 + -4(sqrt(833) + 0) + 4(0 + sqrt(833)) + 4 + 2sqrt(833) + sqrt(833) + sqrt(833))3)*2. 3024sqrt(17) + 120276 Simplify (((6sqrt(49)/sqrt(7) - 4sqrt(700)) + (5 + 1sqrt(7) + -6(sqrt(7) - (sqrt(7) + 0) - sqrt(7)))-6)-6)*2. 164160sqrt(7) + 1487952 Simplify (-6(4 + (sqrt(1088) - sqrt(1088)2 - sqrt(1088))) + 5)*2 + -3 + (0 + sqrt(1088) + 3 - -2(sqrt(1088) + 1)*2). -3608sqrt(17) + 159211 Simplify (-3(sqrt(80) - (0 + sqrt(80))) + sqrt(80) - (sqrt(80) + 2 + 0 - sqrt(80)))2 - ((4 + sqrt(720) + 2)2 + (-3 + 2sqrt(720))*2). -3561 - 16sqrt(5) Simplify sqrt(192) + 1 + 1 + (sqrt(192)-3 - sqrt(192)) + 4 + (sqrt(192) + -1)56 + -4. -28 + 216sqrt(3) Simplify -5 + 5((sqrt(171)1)*2 + sqrt(2299)-1 - ((sqrt(2299) + -2)-4 + sqrt(2299))2). -102925 + 2585sqrt(19) Simplify (1sqrt(3)3 + 0 - ((sqrt(108)/sqrt(3)2)/sqrt(12))2) + -5 + 5 + 0. -12 + 3sqrt(3) Simplify -2-4-3((sqrt(95) - (sqrt(95) + (sqrt(95) - sqrt(95)22)))/((sqrt(245) - (sqrt(245) + (sqrt(245) + -1sqrt(245) - sqrt(245)))) + sqrt(5)) + 4). -96 - 9sqrt(19) Simplify 2 + -4 + (2(((sqrt(363)-1 - sqrt(363))3 - sqrt(363)) + -6(sqrt(363) + (sqrt(363) - (sqrt(363) + 3 + sqrt(363)))) + 0))2. -11088sqrt(3) + 72442 Simplify -3 + ((5(sqrt(72) + 1)1 + 1)*2 + -4)1. 360sqrt(2) + 1829 Simplify (4(sqrt(448) + 1) + 0 + 1)*2 - 4-1((1 + sqrt(448))2 + 0 - sqrt(448) - sqrt(448)). 320sqrt(7) + 8989 Simplify (((sqrt(102) - (sqrt(102) + (sqrt(102) + 1sqrt(102)4 - sqrt(102)) - sqrt(102))) + sqrt(102)4-2)/((-1sqrt(42))/sqrt(7) - 1sqrt(384)))*2. 2057/81 Simplify -1 + ((1sqrt(304) + sqrt(304) + sqrt(304) + -5)2 + 0 + sqrt(304) + -2 - (sqrt(304) + (5 + sqrt(304) + 2 - sqrt(304)))21) + 5. -172sqrt(19) + 2410 Simplify 1 + (-5 + -1 + sqrt(242) - (1sqrt(242) + 4 + sqrt(242)) - 1(3 + sqrt(242))5)2-5. -46684 - 16500sqrt(2) Simplify 4(sqrt(28)1-4)/(-4sqrt(4)-6) + -5 + 3. -2 - 2sqrt(7)/3 Simplify (-4(sqrt(228) - (sqrt(228) + (sqrt(228) - 3sqrt(228)))) + (sqrt(228) - -3sqrt(228)-3) + sqrt(228))/(1(sqrt(3888)2)/sqrt(4)). -5sqrt(19)/6 Simplify (1 + -6(5 + -5 + -5 + (sqrt(12)/sqrt(4) + -4 - (5 + sqrt(6)/sqrt(2)))))2. 7225 Simplify (-2sqrt(18))/sqrt(6) - sqrt(3) - (sqrt(48)2 - sqrt(3)) - sqrt(84)/(-5sqrt(343)). -348sqrt(3)/35 Simplify 2(5 + sqrt(833) + 2 + -2)*2 - (4(-6sqrt(833)-2 - ((sqrt(833) - (sqrt(833) + 1sqrt(833))) + -3)))2. -2250860 - 8596sqrt(17) Simplify ((2(2sqrt(133)1 - sqrt(133) - sqrt(133) - 5(sqrt(133) + 1sqrt(133))))/((sqrt(672) - (sqrt(672)2 + sqrt(672)))/(sqrt(108)/sqrt(2))))*2. 4275/4 Simplify (-3 + sqrt(45)1 - (5 + -2(sqrt(5) + 1)) - ((sqrt(5) + 4sqrt(15)/sqrt(3))2 - -6sqrt(55)/sqrt(176)))*2 + -5. 78sqrt(5) + 969/4 Simplify 4(sqrt(55) - sqrt(330)/sqrt(24))/(sqrt(11) - 2-1sqrt(11)) - (sqrt(385)/(sqrt(28)/sqrt(4)) + sqrt(55) + sqrt(55))/(22sqrt(11))2. -5sqrt(5)/6 Simplify (1sqrt(198))/(1(sqrt(2) + sqrt(18))) - (5(sqrt(176) + 2) - 1sqrt(176)4)*2. -276 - 317sqrt(11)/4 Simplify (6sqrt(385)/sqrt(7)5)/(1sqrt(320) + sqrt(5) + sqrt(15)/sqrt(3)-4). 6sqrt(11) Simplify (-2 + ((sqrt(162)-2 - sqrt(162)) + sqrt(162))*2 + sqrt(162) + 4 - (-2(-4 + (sqrt(2) - 1sqrt(2)4 - sqrt(2))))*2)-1. -458 + 119sqrt(2) Simplify -4((sqrt(500) + (sqrt(500) - (sqrt(500) + -2sqrt(500))) + 5)5 + (sqrt(500) + 1sqrt(500) + 0)-4)*2. -100500 - 14000sqrt(5) Simplify ((sqrt(209)-21 + sqrt(209))/(sqrt(1584)-3))2 - (-2 + ((sqrt(133)-1 + sqrt(133))/sqrt(7))2 + (sqrt(76) - sqrt(19))2 + 4 + sqrt(19)). -27197/1296 - sqrt(19) Simplify (-1((-6(sqrt(77) + -2sqrt(77) + sqrt(77)))/(sqrt(112) + (sqrt(112) - sqrt(112)-1)) - (sqrt(11)-1 + 5 + sqrt(1100)/sqrt(4))))2. 40sqrt(11) + 201 Simplify (3sqrt(560) - 1sqrt(3500))/(sqrt(35)/(-6sqrt(28))). -24sqrt(7) Simplify 4((-2sqrt(2736)3 - (1sqrt(2736) + -3 - sqrt(2736)))2 + (-2 + sqrt(2736))2-6-4) + -1. -6336sqrt(19) + 657059 Simplify (-2 + (5sqrt(864)-1)/(-6-3sqrt(128)))2. 5sqrt(3)/3 + 217/48 Simplify (4((sqrt(297) + sqrt(297)2)/sqrt(11) - (sqrt(27) - (sqrt(1728) + sqrt(1728)1))))/(sqrt(27)/(sqrt(15)/sqrt(5)-6)-2). 216sqrt(3) Simplify (1(-3 + (sqrt(75) + 0)5) + -3-1sqrt(75)-65)*2. 2550sqrt(3) + 541884 Simplify -1(-1 + ((sqrt(171)1-1)/sqrt(9))2 + ((sqrt(76)/sqrt(4) + sqrt(19) - sqrt(19)) + -3 - 1sqrt(19)6)). -15 + 5sqrt(19) Simplify (sqrt(95)2-5 - sqrt(95) - sqrt(95))/sqrt(5)-5 - (2sqrt(19)-3 + sqrt(171)-4). 78sqrt(19) Simplify (2(sqrt(18) + sqrt(450))/sqrt(3))/(sqrt(3200)4). 3sqrt(3)/40 Simplify (-3 + 6-3((-5 + (sqrt(147)1 - sqrt(147)) - (1sqrt(147) + 5))1 + -1))2. 49140sqrt(3) + 85653	{ "pile_set_name": "DM Mathematics" }
s -14-613/(-156)? -7 What is -31(23/2)/23? -3/2 (1/(-2))/(294/1932)-7 23 What is (450/(-120))/((-5)/(-2))? -2/3 Evaluate (-1)/((-1)/(-1))845/(-65). 13 What is the value of (-9)/(-612)-17(-4)/9? 1/9 Calculate 0/112/18015. 0 What is the value of ((-1488)/496)/(6/8)? -4 Evaluate 70/(-5)(-27)/216(-8)/6. -7/3 Evaluate 36/(-81)(-27)/(-10)(-4)/12. 2/5 What is the value of (2862/742)/(5/35)? 27 Calculate ((-80)/(-15))/((-184)/(-207))10/3. 20 (28/1750)/(9/(-45)) -2/25 Evaluate (-5)/((63/105)/((-27)/15)). 15 What is the value of -100(-7)/140-1? -5 Evaluate (19602/(-11616))/((-3)/4). 9/4 What is 64/(-96)(-1)/((-5)/(-45))? 6 What is (-606)/(-14544)(-552)/(-1)? 23 ((2139/(-62))/(-23))/6 1/4 What is the value of ((-45)/35(-8)/200)/(-1)? -3 What is the value of 592/17612(-7)/2? -2/17 Calculate (-4)/70(-110)/663. 2/7 What is the value of ((-32)/12)/(-4)4170/556? 5 Evaluate (-1)/1(28/50)/((-64)/160). 7/5 Calculate (-27)/15(-60)/126. 6/7 What is (3/1)/((-822)/(-9042))? 33 Calculate -2-211230/1380. 7 Calculate ((-6)/2)/(123/(-205)). 5 Calculate (1/(-4))/(16/3843)-1. 2 Evaluate (-142)/(1792/(-2048)). 32 Calculate 16/(-28)28(-1)/12. 4/3 ((-7)/(-49))/((2/(-14))/(1/(-1))) 1 What is -54(4(-15)/30)/(-12)? -9 Calculate 1(-3)/(16/(448/231)). -4/11 What is the value of (264/(-6534))/((-4)/162)? 18/11 What is 12/162(-26)/(-65)15? 9 0/2(-449)/4490 0 What is the value of (27/1)/(2/(8/12))? 9 What is 14((-13)/(-78))/(4/(-12))? -7 (70/385)/(713/(-253)) -2/31 46/(19/(-38)-4) 23 Calculate (60/(-10))/((-6)/(-8)). -8 52/365532/(-6915) -2/9 What is 27/((-2)/(-38)(-2451)/(-129))? 27 Calculate (-24)/16(-1)/(-10)10. -3/2 What is the value of 11658/603(-3)/(-2)? 29 What is ((-80)/192)/(15/(-24))6? 4 Evaluate (-160)/2805/(780/42). -2/13 Calculate 8/(-14)(-2625)/(-2250)(-189)/(-6). -21 Calculate (5/1)/((3/((-63)/28))/(-4)). 15 Calculate 4-63(-1)/(-36). -7 What is (36/(-387))/(((-60)/6)/(-5))? -2/43 (65/273)/(5/(-3)) -1/7 Calculate ((-2133)/17775)/((-6)/(-10)). -1/5 Calculate (98/105)/14168(-10)/4. -28 What is the value of (-4)/(-6)220/1320? 1/9 What is the value of ((-15)/(-40)(-3)/9)/(473/516)? -3/22 Evaluate ((-513)/7605)/(3/(-4)). 9/2 Evaluate ((16/18)/((-144)/(-72)))/(11/(-66)). -8/3 Evaluate -3(72/(-84)2)/((-9)/14). -8 Evaluate ((-8)/(-6))/(127/(590931/(-188))). -33 (-158)/(-1343)(-17)/(-18) 1/9 What is (-2375)/(-475)(-44)/10? -22 What is (-6)/16212/(-53)? 3/2 What is the value of (-51)/(39/(-104)-8)1? -17 Calculate (-2)/(27/(-4347)14). 23 What is ((-12)/14)/(3(-7)/490)? 20 What is (24/40)/((-2295)/(-850))? 2/9 Evaluate (14/56)/((-13)/(-208)-106). -2/53 Calculate 24/1575-515/(-12). 2/21 (4/(-18))/((-18)/(-126)(-21)/(-18)) -4/3 Evaluate (4/1402/1)/(306/357). 1/15 4/154(-301)/172 -1/22 What is the value of 2/(8/28)(-2)/14? -1 Evaluate (1/(2/4))/((-50)/((-85)/17)). 1/5 Calculate (3705/(-38))/39(-16)/20. 2 What is the value of (60/(-18))/(70/42(-12)/10)? 5/3 What is the value of (2/(-3))/(37/(-4440)-10)? -8 What is the value of (6/3)/(9/((-360)/(-10)))? 8 (6/(-15)-5)/((168/49)/24) 14 What is the value of ((-900)/750)/(6/(-100))? 20 What is 608/(-64)(-2)/(-38)? -1/2 Evaluate 6/(-5)(-1000)/160(-4)/3. -10 Calculate ((-16)/(-192)-39)/((-7)/((-84)/(-15))). 13/5 What is the value of ((-1)/((-1)/5-10))/((-3)/(-6))? -1 (-2898)/241570/6 -14 Evaluate (1/(12/(-81)))/(16/(-64)). 27 What is (1458/(-405))/((-4)/(-25))12/(-15)? 18 ((42/(-35))/((-24)/15))/((-9)/72) -6 Calculate 6/((741/(-26))/(-19))7. 28 (-2)/(3/(-3))(765/(-60))/(-17) 3/2 What is the value of (5203/(-9460))/(2/8)? -11/5 What is (18/(-15))/(15/25)? -2 Calculate ((-13)/(130/(-24)))/(8/30). 9 Calculate 9/3(-18)/(-12)2. 9 What is ((391/85)/23)/(2/2)? 1/5 Evaluate (15/7)/(2752/(-19264)). -15 Calculate ((-12)/(-60))/((-13)/(-2340)). 36 What is (((-50)/(-17))/25)/((-2)/(-17))? 1 What is the value of ((-5)/(-69))/((-1560)/2808)? -3/23 What is the value of 150/(-225)(-18)/(-4)? -3 10/(((-10)/8)/(450/150)) -24 Calculate 13/(-1)2728/3224. -11 What is (-10)/20-12(-4)/(-18)? 4/3 Evaluate 69/(2208/(-256))7/4. -14 What is (10/2)/(-1)(-30845)/(-4975)? -31 (28(-12)/(-1344))/((-2)/2) -1/4 What is the value of (106/1855)/(40/(-100))? -1/7 Calculate 20(-1)/(-24)(-48)/(-180)-6. -4/3 (-2)/6210/((-270)/(-567)) -14 What is ((-16)/(-128))/(3/48)? 2 What is the value of (-1)/4(-141)/(3525/(-2900))? -29 Calculate (-15)/91214/35. -8 5(-418)/880-18 19 Calculate ((-267)/(-178))/(2/8). 6 Calculate 2808/(-234)(-1)/1. 12 34/((-9724)/(-66))91 21 Evaluate 6/(-4)13560/(-452)1/63. 5/7 What is the value of (4(24/8)/(-30))/(4/60)? -6 What is the value of 6/(8/16015)? 8 Evaluate (-2)/16(-76)/68454. 3/4 (-58)/(76734/245)2/5 -2/27 ((-5)/(-3))/(6/225(-550)/220) -25 (20/(-15))/(((-992)/(-480))/31) -20 What is (-10800)/(-300)(-1)/2? -18 Evaluate 2064/(-1290)15/(-2). 12 What is 5/60-612/(-15)? 2/5 (-3)/((-45)/(-50))-6(-3)/15 -4 What is ((-2)/(-4))/((-11441)/(-1346))? 1/17 (12/549)/(3/(-57)) -38 243/(-27)(-4)/(-18) -2 What is 807/538(3/(-9))/((-1)/2)? 1 What is 18/282(-56)/(-8)? 9 What is 24/(-2)16/36108/144? -4 Calculate (36/165)/((-2152)/2690). -3/11 What is the value of (-1)/((-6)/(-1)(-194)/(-2328))? -2 ((-1)/3)/(35/(-140)(-8)/30) -5 What is (60/(-7125)-25)/((-182)/(-133))? 2/13 What is the value of (3/(-45)-66)/((-210)/(-525))? 11 What is 686/3926/(-12)-6? 21/4 What is the value of (0/((-9)/91))/3? 0 Evaluate -13((-506)/23)/22. 13 Evaluate (50/(-20))/(((-30)/(-5))/24). -10 -54((-4)/(-30))/(54/(-90)) 12 (-144)/(-396)1/2 2/11 Evaluate 2/2(84525/49)/(-69). -25 (-3168)/1764/3 -24 What is (-785)/(-1413)(-7)/(735/(-9))? 1/21 Calculate (2/8)/((378/(-48))/7). -2/9 (6/(-9))/(-1)(-10)/((-650)/(-39)) -2/5 What is ((-3)/41)/(2126/(-364))? 2/41 Calculate 36/(-2)((224/8)/7)/(-6). 12 Calculate (-864)/192(3/54)/(4/6). -3/8 (3/(-39))/((-9)/(-30))6/10 -2/13 What is 3/((-4)/52836)? -11 -12(-244)/610 4/5 Evaluate (52/19)/((-614)/(-5833)). 26 What is the value of (((-3)/99)/(1255/(-8283)))/((-11)/2)? -2/55 Calculate (4/2)/((-468)/(-4914)(-42)/(-10)). 5 What is (-11)/(-14)(-169)/((-24167)/156)? 6/7 Calculate ((2/9)/(-1))/((-48)/(-108))20. -10 What is the value of (-620)/(-31)22/(-88)? -5 Evaluate ((-12)/(-10))/(7855/85800). 24 Evaluate 1/((-62)/310((-25)/(-13))/5). -13 What is the value of (-1344)/(-3248)(4/(-24))/(-1)? 2/29 Evaluate ((-1136)/(-93436))/((-4)/14). -2/47 Calculate (103/(-618))/((-4)/30). 5/4 Evaluate ((-15)/170)/((9/4)/3). -2/17 Evaluate 4/(-3)135/(-525)10/(-12). -2/7 Evaluate (24/100)/3(-1845)/(-492). 3/10 What is the value of (-10)/(-620)52/(-13)? -2/31 1(-10)/302-2-6 -8 What is the value of (-16)/(-70)1370/1096? 2/7 What is ((-135)/360)/(((-9)/8)/((-9)/18))? -1/6 Evaluate ((-3)/(-16))/(((-8)/(-52))/((-124)/403)). -3/8 What is the value of (15/75)/((-6)/(-150)1)? 5 Calculate (14/(-28))/((-270)/(-60)). -1/9 Evaluate 17/68(-40)/6(-549)/(-61). -15 Calculate 5/25(-135)/54. -1/2 What is the value of (32/44)/(12/(36/(-6)))? -4/11 Calculate (12/(-10))/(((-1773)/1379)/(20/7)). 8/3 What is ((-54)/(-8))/(44(-48)/512)? -18/11 (-1638)/(1677/(-43))(-2)/(-28) 3 Evaluate (((-15)/30)/(9/6))/((-606)/(-36)). -2/101 (-10)/(-15)15/((-630)/231) -11/3 Calculate (2/6)/1(-418)/41839. -13 Calculate ((-115)/(709665/(-102)))/(1/11). 2/11 Evaluate (-289/18)/((-48)/24). 7 Evaluate ((-3)/(-7))/((-26676)/(-2184)). 2/57 Calculate (1855/11872)/((-10)/12). -3/16 Calculate (4/6-2)/(51/(-459)). 12 Evaluate (3/((-450)/(-204)))/((-62)/(-155))-5. -17 What is 6/(-2)(-14)/(140/(-90))? -27 Calculate ((-69)/6831)/((-8)/72). 1/11 What is (1/1)/(14/(-4))? -1 (46/(-8))/((-28)/112) 23 What is the value of (2/(-2))/((-33)/(9207/(-62)))? -9/2 Evaluate 770/(-350)25/(-5). 11 (-33(-35)/(-126)6)/1 -15 Evaluate (-1)/21/(-4)2464/2002. 2/13 What is (-3)/(-1)188/5640? 1/10 What is the value of (15/10)/((-1995)/76)? -2/35 Calculate (-2(-4)/(-4))/(3/1356). -15 Evaluate ((-16)/6)/8(-12)/54-9. -2/3 Calculate (-180)/(-40)(-1)/(3/(-6)). 9 What is the value of (-1)/(-1)((-30)/(-6))/(-15)? -1/3 Calculate ((4/42)/(316/(-474)))/(3/(-21)). 1 1/(((-10)/(-48))/((-60)/(-24))) 12 Calculate (-39)/132/4(-20)/6. 5 Calculate 20/(-204)2/26/(-5). 2/17 3/	{ "pile_set_name": "DM Mathematics" }
, 5h + 5t = 40. Determine q(h). -14 Suppose s = 5s - 16. Let b(y) = y2 - 4y + 3. What is b(s)? 3 Let p(y) be the second derivative of -y4/12 + y3/6 - y*2 - 11y. Give p(3). -8 Let n(w) = 9w - w3 - 5w2 - w + 9 - 2. Calculate n(-6). -5 Let z = -5 - -10. Let j(a) = -a2 + 13a2 - za*2. Calculate j(-1). 7 Suppose 4v + 1 = -2s + 3, 19 = 3v - 2s. Let p(c) = -c2 + 6c. What is p(v)? 9 Let h(q) = -q*3 - 7q*2 - 3q + 2. Suppose y + 5 = -1. What is h(y)? -16 Let h(a) = 10a2 - 6a + 5. Let r(y) = -11y2 + 7y - 6. Let k(s) = -5h(s) - 4r(s). Calculate k(1). -5 Let l be 2/5 + 138/30. Let d(i) = -i + 2. Give d(l). -3 Let r be 28/5 - 2/(-5). Let z(o) = o + r - 3o + 3o. Give z(-5). 1 Let p(t) = t*3 + 2t*2 - 3t + 3. Suppose 32 = -4d - 4m, 3d - 2m = 2d + 4. Calculate p(d). -17 Let q(d) be the third derivative of d4/12 - d3/2 - 3d*2. Suppose 2n - 3 = -23. Let s be ((-6)/(-10))/((-2)/n). Calculate q(s). 3 Let o(r) be the second derivative of r*3/6 + 3r*2/2 + 9r. Calculate o(6). 9 Suppose -4f = -0f. Let j(i) = -i3 - i2 + i + 1. Let s(t) = -2t3 - 2t*2 + 3t - 7. Let d(m) = 3j(m) - s(m). Determine d(f). 10 Let b(y) = -2y + 5. Let n(a) = 2a - 4. Let l(o) = 2b(o) + 3n(o). Let u(k) = k3 + 3k*2 + 2. Let j be u(-3). Determine l(j). 2 Suppose 4h + 5b + 2 = 20, 0 = -h - 5b - 3. Let y be 2/h + (-66)/(-14). Let r(i) = -i*2 + 3 - yi + i3 - i - i2 + 3i. Determine r(3). 3 Let p be ((-2)/5)/(-1 + (-18)/(-15)). Let t(c) = -5c*3 + 3c*2 - 2c + 4. Let b(m) = -m3 + m2 - m + 1. Let g(h) = 4b(h) - t(h). What is g(p)? 0 Let o = -3 + 6. Suppose oi + 0i = 12. Let a(u) = u2 + 5 + u - 3 - iu*2 + 2u2. What is a(-2)? -4 Let r = 8 - 5. Let f(j) be the second derivative of j2 - 2j + 1/6j*4 + 0 - 2/3j*3. Calculate f(r). 8 Suppose 4j = -5 - 3. Let p(q) = -6q3 + 3q*2 - 7q - 7. Let k(c) = -5c3 + 2c*2 - 6c - 6. Let b(n) = 5k(n) - 4p(n). Calculate b(j). 2 Let g(j) be the third derivative of -2/3j3 + 0 - 3j*2 - 1/120j*6 - 1/20j*5 - 1/8j*4 + 0j. Calculate g(-3). 5 Let i = -8 - -13. Let x(n) = n - i + 10 - 2n. Give x(0). 5 Let p(t) = t2 + t - 8. Suppose 0 = -3u + 3, 2m + 4u - 2 = 2u. Determine p(m). -8 Suppose 0 = 4c + 6 - 14. Suppose 0v + 3m = -3v + 9, 3v = cm - 11. Let o = v - -2. Let b(h) = -h2 - 2h + 1. Calculate b(o). -2 Let q(b) = 21b - 41. Let g(f) = -4f + 8. Let k(o) = 11g(o) + 2q(o). What is k(5)? -4 Suppose -2r + 18 = 4k, 2r - 4r + 11 = 3k. Suppose -ko = -6o. Let t(n) = -n2 + 7. Calculate t(o). 7 Let l be 102/18 - 2/3. Let a(r) = 4r - 2r - 2r + r - l. What is a(4)? -1 Let s(c) = 4 + 2 - 2c + c - 3. Let i be s(-9). Let o(u) = -2 + 17u + i - 18u. Calculate o(5). 5 Suppose -4s = -5q - 26, -3q + 6 = 2s - 2q. Let l(m) = m - 3. Calculate l(s). 1 Let a(m) = 4m + 3. Suppose -3 + 1 = f. Give a(f). -5 Let u(k) = -6 + k - 2 + 3 + 4. What is u(-7)? -8 Let h(v) = 2v*3 + 2v*2 - 1. Let c be h(1). Let y(g) = -2g + 5 - 4g2 + cg2 - g + 2. Give y(-5). -3 Let l(b) = b2 - 3b - 5. Let z(f) = -f2 - f + 5. Let w be z(0). Determine l(w). 5 Let d(a) = 10a*3 - 19a*2 - 16a + 10. Let l(f) = -3f3 + 6f*2 + 5f - 3. Let z(k) = -2d(k) - 7l(k). Give z(5). 11 Let c(g) = g + 3 + 1 - 2. Let u = -18 + 14. What is c(u)? -2 Let j(u) = 4u - 7. Let a(v) = 13v - 21. Let y(d) = -8d3 - d2 + d + 1. Let f be y(-1). Let m(k) = fj(k) - 2a(k). What is m(5)? 3 Suppose 8 = -4r - 20. Let l(s) = s*3 + 8s*2 + 7s - 3. Let w be l(r). Let o(n) = -2n + 13. Let c(z) = -z + 1. Let p(d) = wc(d) + o(d). What is p(-5)? 5 Let x(q) be the first derivative of q*2 - 5q + 2. Let p be x(5). Let v(r) = r*2 - 7r - 1. What is v(p)? -11 Let j(g) = 3g3 + 5g*2 - g - 4. Let t(w) = -7w*3 - 11w*2 + 3w + 9. Let r(p) = -5j(p) - 2t(p). What is r(-2)? 0 Let d(v) = -v*3 + 3v*2 + 6v - 4. Let y be 2/(1 - (-5)/(-10)). Calculate d(y). 4 Suppose -2 = i + 2. Let z(p) = p*2 + 4p. Determine z(i). 0 Suppose -5k = -k. Let n(c) = c - 1. Calculate n(k). -1 Let x be (-32)/(-18) + (-4)/(-18). Suppose -xo + 3o - 5 = 0. Let u(r) = 3r - 6. Let w(n) = -n + 1. Let z(b) = u(b) + 2w(b). Determine z(o). 1 Suppose -2d + 7d = 30. Let w(x) = x3 - 6x*2 + x + 7. What is w(d)? 13 Suppose -5z + 16z - 11 = 0. Let i(k) = -6k*3 + 2k*2 - 2k + 1. Calculate i(z). -5 Let z(j) = j*3 - 9j*2 - 3j + 12. Let b = 25 + -16. Calculate z(b). -15 Let z(q) = -4q + 5q - 1 + 3q2 + q2 + q. Suppose -s - 3 = -3r + 2, -6 = -2s - 2r. Determine z(s). 5 Suppose -5 = 4h + r, 4r = 4h + h + 1. Let f be 4 - ((3 - 0) + h). Let u(b) = -b3 + 2b*2 - 2b. Determine u(f). -4 Suppose 3h = 5h - 6. Let v(n) be the second derivative of -n*3/3 - 3n*2/2 + 2n - 6. Determine v(h). -9 Let v(r) = -r. Let h(u) = -8u - 2. Let q(k) = -h(k) + 3v(k). Determine q(-2). -8 Let g(d) = d*2 + 3d - 6. Let y be 5/((-65)/63) + 2/(-13). Calculate g(y). 4 Let z(y) = y + 7. Let q be z(-5). Let o(s) = s3 - 1. Determine o(q). 7 Let t(z) = -z2 + 4. Let h(j) be the second derivative of -j*3/6 + 4j*2 + j. Let v be ((-33)/9)/(4/(-12)). Let f be h(v). Determine t(f). -5 Suppose 0i - 30 = -6i. Let x(v) = -v3 + 7v*2 - 7v. What is x(i)? 15 Suppose 1 = b + 3s, -5b = -0b - 2s - 5. Let j(c) be the first derivative of -11c3/3 - 1. Give j(b). -11 Let l = 10 - 15. Let c be -4 + -4 + (-2 - l). Let t(x) = x. Determine t(c). -5 Let q(r) = r3 + 4r*2 + 2r + 2. Suppose -5m = 2k - m - 4, 4m = -3k. What is q(k)? -6 Let r(n) = -n + 1 + 2n2 + 4n*2 + 2n*2 + 0n. Calculate r(1). 8 Let w(l) = -4l2 + 5l - 2. Let b(u) = -13u2 + 16u - 6. Let q(k) = 2b(k) - 7w(k). What is q(4)? 22 Let i be (16/10)/((-18)/(-45)). Let d(h) = -3h3 + h2 + 5h + 2. Let j(m) = 13m3 - 3m*2 - 20m - 9. Let a(f) = 9d(f) + 2j(f). Give a(i). 4 Let q(m) be the first derivative of -5m3/6 - 3m - 2. Let g(b) be the first derivative of q(b). Give g(-2). 10 Suppose -2x = 2x. Suppose xa - 2a - 4h = 8, 5a + 3h = 1. Let b(u) = u2 + 0u*a - 2u - 3 - 1. Determine b(4). 4 Let s(q) be the third derivative of -q*2 + 1/6q*4 + 0q - 1/3q3 - 1/15q*5 + 1/120q*6 + 0. Determine s(2). -2 Let z = 0 - -4. Let n(r) = -10r*3 + 15r*2 - 11r - 1. Let y(d) = -3d3 + 5d*2 - 4d. Let s(g) = -2n(g) + 7y(g). Give s(z). -6 Let u be (-1 + (2 - 1))/2. Let b(x) = -x - 6 + 4x2 + ux + x*3 - x. Give b(-4). 2 Let x(g) = -5g - 2g3 + 4 - 6g*3 + g + 7g*3 + 7g*2. Give x(6). 16 Let t(b) = -6b*2 + 4b - 2. Let j(l) = 3l2 - 2l + 1. Let g(u) = -5j(u) - 3t(u). Let s be ((-2)/(-4))/(1/(-4)). Let k = -1 - s. Give g(k). 2 Let z(m) = m*2 + 5m + 4. Let a(j) = -3j - 4 + 2 + 2j. Let n be a(3). Give z(n). 4 Suppose -z = -2k + 11, 0 = 3k + 3z - 0z + 6. Let a(g) be the third derivative of 0 - 1/2g3 + 0g - 1/24g4 - g2 + 1/60g5. What is a(k)? 3 Let b(s) = -s3 + 4s2 + 2s + 1. Let n(v) = -v*3 + 2v*2 + 5v - 2. Suppose 5m + 2o + 7 = 6m, o = m - 5. Let w be n(m). Determine b(w). 9 Let h be -2 - 1/(2/(-12)). Let r = h - 1. Suppose 4 = -rl + 7. Let v(k) = 4k3 - 2k*2 + 2k - 1. Calculate v(l). 3 Suppose -4l + 2 = -4p - 10, -l = -2p - 4. Let w(k) be the second derivative of -2k - 1/6k3 + 3kl + 0. Determine w(4). 2 Let c(x) = -x3 + 3x2 + 3. Let u be c(3). Let b(d) = d2 + 4d + 2. Let i(t) = t*2 + 8t + 3. Let m(s) = 5b(s) - 3i(s). Give m(u). 7 Let c(x) = -x*3 - 5x*2 + 2x + 5. Suppose 3d = -2 + 53. Suppose 3j + j = -4g - 24, 3j = 4g + d. Calculate c(g). -5 Let u(y) = -y3 - 5y*2 + 6y - 6. Let m be u(-6). Let v(h) = -3h + 3. Calculate v(m). 21 Let l(t) = -t2 + 6t - 4. Suppose 41j - 46j + 20 = 0. What is l(j)? 4 Let l(t) = 2t2 - 7t + 3. Suppose -50 = 15h - 25h. What is l(h)? 18 Let j(q) be the second derivative of -7q5/20 + q4/6 - q3/6 + 19q. Suppose 5 - 13 = -2y. Let x = 5 - y. Give j(x). -6 Let z(l) = 3l + 3. Suppose 5w + 0w = -35. Calculate z(w). -18 Let p be 8/2 - (9 - 2). Let r(k) = -k - 3. Calculate r(p). 0 Let c(f) be the first derivative of f + 5 - 1/2f2. Calculate c(2). -1 Suppose 0 = -s - 0 + 2. Let l(x) = 5x - x*2 - 3 + sx*2 + 3. What is l(-4)? -4 Let k(s) = 5s*3 - 5s**3	{ "pile_set_name": "DM Mathematics" }
f 63210194? 2, 31605097 List the prime factors of 380333945. 5, 17, 4474517 What are the prime factors of 7484516071? 773, 9682427 What are the prime factors of 11019253? 7, 59, 26681 List the prime factors of 22339653. 3, 7, 71, 14983 List the prime factors of 16386446. 2, 1993, 4111 List the prime factors of 556788191. 556788191 What are the prime factors of 1727937331? 2143, 806317 What are the prime factors of 119565392? 2, 1483, 5039 List the prime factors of 239680760. 2, 5, 11, 83, 6563 List the prime factors of 5627173849. 11, 1831, 2309 List the prime factors of 30015425. 5, 11, 109147 What are the prime factors of 3027535862? 2, 13, 23, 73, 223, 311 What are the prime factors of 927529263? 3, 9011, 11437 What are the prime factors of 60243379? 7, 8606197 List the prime factors of 30505494. 2, 3, 5084249 List the prime factors of 24167088. 2, 3, 11, 19, 73 List the prime factors of 314887251. 3, 7, 89, 331, 509 What are the prime factors of 7443301899? 3, 11, 683, 330241 List the prime factors of 2023428411. 3, 5233, 14321 List the prime factors of 2036670463. 181, 1759, 6397 What are the prime factors of 319919938? 2, 13, 29, 31, 13687 What are the prime factors of 3923770547? 509, 7708783 List the prime factors of 27216064. 2, 425251 What are the prime factors of 4194804? 2, 3, 349567 What are the prime factors of 40930162? 2, 7, 13, 224891 List the prime factors of 263851345. 5, 52770269 What are the prime factors of 908789302? 2, 15923, 28537 What are the prime factors of 1750732648? 2, 7, 31263083 List the prime factors of 2266216874. 2, 43, 26351359 What are the prime factors of 8829255394? 2, 9199, 479903 What are the prime factors of 32159644? 2, 11, 730901 What are the prime factors of 209887465? 5, 2129, 19717 What are the prime factors of 108588311? 13, 8352947 What are the prime factors of 4730121484? 2, 11, 31, 3467831 List the prime factors of 896211936. 2, 3, 3111847 What are the prime factors of 3811521339? 3, 1471, 10663 List the prime factors of 26928520. 2, 5, 83, 8111 List the prime factors of 27434953. 7, 13, 3313 What are the prime factors of 1607392084? 2, 401848021 What are the prime factors of 78547978? 2, 39273989 What are the prime factors of 4491733382? 2, 29, 77443679 What are the prime factors of 5576468497? 257, 21698321 What are the prime factors of 851840? 2, 5, 11 What are the prime factors of 13313430? 2, 3, 5, 13, 3793 List the prime factors of 106497627. 3, 43, 787, 1049 What are the prime factors of 11554804? 2, 37, 101, 773 What are the prime factors of 3886345402? 2, 233, 701, 11897 List the prime factors of 95329101. 3, 7, 4539481 What are the prime factors of 2445211242? 2, 3, 31, 179, 24481 List the prime factors of 892911141. 3, 33070783 What are the prime factors of 1538989? 1538989 What are the prime factors of 22189484? 2, 5547371 What are the prime factors of 2954725987? 17, 29, 5993359 List the prime factors of 223143463. 1129, 197647 List the prime factors of 756066904. 2, 94508363 What are the prime factors of 88248227? 31, 2846717 List the prime factors of 368659481. 368659481 List the prime factors of 176234962. 2, 88117481 What are the prime factors of 159591844? 2, 31, 41, 31391 What are the prime factors of 463245784? 2, 17, 3406219 What are the prime factors of 3704643025? 5, 53, 331, 8447 What are the prime factors of 101937509? 107, 952687 What are the prime factors of 872674279? 872674279 What are the prime factors of 502461066? 2, 3, 83743511 List the prime factors of 1798134021. 3, 53, 3769673 What are the prime factors of 101540761? 7, 1499, 9677 What are the prime factors of 22377760? 2, 5, 139861 What are the prime factors of 332982332? 2, 17, 71, 4057 List the prime factors of 146838061. 17, 19, 163, 2789 List the prime factors of 17488023. 3, 7, 832763 List the prime factors of 232957612. 2, 58239403 What are the prime factors of 8074906? 2, 7, 79, 149 What are the prime factors of 38766364? 2, 7, 13, 106501 What are the prime factors of 116164017? 3, 4302371 List the prime factors of 34041031. 467, 72893 List the prime factors of 187727409. 3, 6952867 List the prime factors of 2332815911. 2332815911 List the prime factors of 258140083. 37, 167, 41777 What are the prime factors of 192092454? 2, 3, 1571, 6793 What are the prime factors of 113911836? 2, 3, 131, 233, 311 List the prime factors of 2965188231. 3, 2281, 144439 List the prime factors of 1252921584. 2, 3, 1109, 23537 List the prime factors of 108535541. 37, 2933393 What are the prime factors of 155922595? 5, 31184519 What are the prime factors of 2058226320? 2, 3, 5, 107, 80149 What are the prime factors of 1091670602? 2, 11, 49621391 List the prime factors of 3684045873. 3, 599, 2050109 What are the prime factors of 1098823061? 7, 157, 283, 3533 List the prime factors of 15744932. 2, 7, 73, 7703 What are the prime factors of 2596941231? 3, 865647077 What are the prime factors of 119400771? 3, 7, 71, 73, 1097 List the prime factors of 42541188. 2, 3, 73, 48563 List the prime factors of 1363722441. 3, 257, 1768771 List the prime factors of 424129400. 2, 5, 19, 239, 467 List the prime factors of 238061082. 2, 3, 7, 353, 16057 List the prime factors of 195445442. 2, 29, 41, 82189 List the prime factors of 3780593629. 3780593629 What are the prime factors of 116062199? 11, 61, 172969 What are the prime factors of 2316712051? 79, 109, 269041 List the prime factors of 17579422. 2, 7, 73, 103, 167 What are the prime factors of 111810409? 233, 311, 1543 List the prime factors of 970898547. 3, 323632849 What are the prime factors of 38003720? 2, 5, 41, 23173 What are the prime factors of 92927866? 2, 23, 2020171 List the prime factors of 277664. 2, 8677 What are the prime factors of 4146534285? 3, 5, 276435619 What are the prime factors of 5548050342? 2, 3, 102741673 What are the prime factors of 25283869? 13, 971, 2003 List the prime factors of 173861957. 157, 1107401 List the prime factors of 56215810. 2, 5, 7, 359, 2237 List the prime factors of 4026204860. 2, 5, 17, 11841779 List the prime factors of 112663849. 53, 2125733 List the prime factors of 2769178137. 3, 11, 31, 211, 12829 List the prime factors of 2794737341. 11, 19, 1481, 9029 What are the prime factors of 6614970? 2, 3, 5, 311, 709 List the prime factors of 86027073. 3, 11, 2606881 List the prime factors of 1662440899. 7, 41, 73, 79349 List the prime factors of 7297875088. 2, 7, 2857, 22807 List the prime factors of 740534826. 2, 3, 123422471 List the prime factors of 172914355. 5, 53, 652507 What are the prime factors of 561167802? 2, 3, 13, 43, 1297 List the prime factors of 4596476. 2, 223, 5153 What are the prime factors of 173645789? 181, 959369 List the prime factors of 1286409792. 2, 3, 1871, 3581 List the prime factors of 116082500. 2, 5, 59, 787 What are the prime factors of 2075983? 7, 13, 3259 List the prime factors of 305799505. 5, 11, 881, 6311 List the prime factors of 1825971214. 2, 379, 2408933 List the prime factors of 150484513. 37, 4067149 What are the prime factors of 201242304? 2, 3, 349379 What are the prime factors of 117275742? 2, 3, 2171773 What are the prime factors of 27558471? 3, 457, 20101 List the prime factors of 5469384957. 3, 43, 42398333 What are the prime factors of 15951098? 2, 23, 346763 List the prime factors of 151949949. 3, 50649983 List the prime factors of 11055630. 2, 3, 5, 368521 What are the prime factors of 2779313249? 1741, 1596389 What are the prime factors of 208999478? 2, 83, 1259033 What are the prime factors of 865315009? 13, 167, 211, 1889 List the prime factors of 32152370. 2, 5, 19, 197, 859 List the prime factors of 123220455. 3, 5, 8214697 What are the prime factors of 215492326? 2, 7, 15392309 List the prime factors of 3320294874. 2, 3, 13, 42567883 What are the prime factors of 2595931825? 5, 103837273 List the prime factors of 351146957. 7, 23, 647, 3371 What are the prime factors of 131995304? 2, 7, 2357059 List the prime factors of 408398538. 2, 3, 61, 1115843 What are the prime factors of 3856267747? 151, 337, 75781 List the prime factors of 42031661. 7, 457, 1877 What are the prime factors of 2473603352? 2, 11, 277, 101477 What are the prime factors of 15514399? 859, 18061 List the pri	{ "pile_set_name": "DM Mathematics" }
Let t be 6 - 2i/(-2) - 5. Solve -2b + 13 - 5 = t for b. 4 Let l(u) = 3u3 + 36u*2 + 8u + 19. Let r be l(-11). Solve -4m - 298 + r = 0 for m. -1 Suppose 0 = -4c + 280 + 644. Let a = -223 + c. Solve aw - 12 = 4w for w. 3 Suppose -719 = -207h + 2179. Solve hn = 132 - 62 for n. 5 Let y be (13(3 - (2 + 0)))/1. Let b(h) = h3 - 12h*2 - 12h - 16. Let j be b(y). Let n be ((-4)/(-5))/(j/15)-1. Solve -nf + 0 - 16 = 0 for f. -4 Let o be 10/4(9 - 5). Let n be (2 + o)(-6)/18. Let v be (-5 - -3)/(2/n). Solve -c + v = 7 for c. -3 Suppose -10 = -0f + 5f. Let t = f + -2. Let x(z) = -z*2 - 4z + 2. Let p be x(t). Solve -pl - 2l = 20 for l. -5 Suppose 0 = -3n - 4h + 27, -4h - 6 - 6 = 0. Suppose 0 = 11r - nr + 8. Suppose 5w = -3a + 47, 3w = 6w - ra - 34. Solve 3t - w = t for t. 5 Let o(q) = q3 + 27q*2 + q + 19. Let p be o(-27). Let h be 3/p - 70/(-32)2. Suppose -5j = hj - 45. Solve 4f = -f + j for f. 1 Suppose 0 = 4z - 9z - 25, -4x + z = -5. Suppose 10n = 14n - 12. Solve x = -5c + nc for c. 0 Let r be (189/12 - 3)(-84)/(-63). Solve 2y = -ry for y. 0 Suppose 3u + w = 61, -7w = 2u - 11w - 64. Solve 0 = 2n - u + 10 for n. 6 Let k = 86 - 39. Suppose 6q - 125 = -k. Let r = -12 + q. Solve 3m + r = 16 for m. 5 Let u(r) = -r + 7. Let i(t) = t*2. Let b be i(-2). Let f be u(b). Let a = -1309 - -1320. Solve -a - 4 = -fq for q. 5 Let p be 0((-40)/12 + 3). Suppose -w - 11u + 12 = -7u, p = w - 3u + 9. Let z = -58 + 61. Solve w = zh - 4h for h. 0 Let f = -510 - -533. Suppose 26h = -fh + 294. Solve g = hg for g. 0 Let k = -873 - -886. Solve -59v - k = -46v for v. -1 Let p(b) = 83b. Let l be p(2). Let d = l - 160. Solve -3v = -dv for v. 0 Let i be (1/(-3))/((-1130)/(-282) - 4). Let a = i + 51. Solve 0 = ad + 17 + 3 for d. -5 Suppose -o + 11 = 4z - 0z, 2z + 4o + 12 = 0. Suppose -3 = -zn - 3s, n = -5s + 7 - 19. Solve -w = -0w - n for w. 3 Let q be (-51)/(124/64 - 2). Suppose 17i - i = q. Solve o - 20 = io for o. -5 Let p(r) be the first derivative of 1/3r3 + r2 + 28 - 15r. Let y be p(-5). Solve 10 + y = 5i for i. 2 Let z = 16 + -14. Suppose 1 = t + j, -3t - zj = -2 - 1. Suppose 132 = -6b + 156. Solve -3 - t = -bp for p. 1 Let x = 10 + -1. Suppose -4q - x = -17. Suppose -2u - 2 = -qt, 3u - 2u - 2t = -4. Solve -uz + 1 = -1 for z. 1 Let y(i) = -5i3 - 12i*2 - 6i - 4. Let g be y(-2). Solve g = 32r - 14r + 36 for r. -2 Let x = 4 - 1. Let f(v) = -24v + 312. Let c be f(13). Suppose -54m + 63m - 18 = c. Solve -5t = m + x for t. -1 Let h = -80 + 84. Let c be (h/6-46)/(-2). Solve -3 = -5o - c for o. -1 Let p(j) = -j3 + 10j*2 + 21j + 48. Let l be p(12). Solve -14 + l = 2i for i. -1 Let y(k) = 2k*3 + 30k*2 + 111k - 6. Let w be y(-8). Let b(c) = c*3 + 5c*2 - 9c - 8. Let o be b(-6). Solve -o + w = -2z for z. 4 Suppose 37h - 7675 + 2561 = 2360. Solve 214 = 12o + h for o. 1 Let w = 34 + -28. Suppose -j = 4r - 27, -4 = wr - 4r + 4j. Suppose rg - 18 + 2 = 0. Solve 2 = -2b - g for b. -2 Suppose 5p - 4m = 160, -4p - p = 3m - 195. Suppose -2b + 3x = b - p, 0 = -5x. Solve b = 5l - 3 for l. 3 Let h = -29478 - -29478. Solve 4f + 200 - 208 = h for f. 2 Let h(s) = s*3 - 5s*2 + 6s - 6. Let i be h(4). Let z(v) = -8v + 26. Let y be z(-22). Let p = 207 - y. Solve 7 = pa + i for a. 1 Suppose -16q + 240 + 32 = 0. Solve 7t - q + 17 = 0 for t. 0 Let x be -24 + 49 + 6 + -22. Solve -xi = -78i + 345 for i. 5 Let i(h) = 340h - 2931. Let c be i(9). Solve -19r = 72 - c for r. 3 Let v(l) = 16l2 - 33l + 7. Let d(h) = -h3 + h2 + h - 1. Let z(a) = -d(a) + v(a). Let c be z(-17). Solve 12u = cu + 16 for u. 4 Let p(f) = -2f - 85. Let m be p(-49). Suppose 0 = mg - 0g - 91. Solve -5s = -gs + 4 for s. 2 Let p(i) = 2i3 - i2 + 12i + 2. Let m be p(0). Let h(d) = -d2 + 8d - 6. Let f be h(6). Solve -4z - m = f for z. -2 Suppose 0 = -164g + 166g - 6, -3g = 4w - 25. Suppose wc = 2l - 22, 3c = 5l - 30 + 3. Let f be 0/2 - (0 - 8). Solve f + 1 = -lt for t. -3 Let m(d) = 2d2 + 287d + 285. Let l be m(-1). Solve -66v + 30v - 108 = l for v. -3 Let y(c) = c*2 - 15c + 27. Let l be y(13). Suppose 252 = h - 5h. Let r = 63 + h. Solve r = -d + l for d. 1 Suppose -3z + 0z + 6 = 0, 2c - 678 = z. Let i = 361 - c. Solve 3 = -6n - i for n. -4 Suppose 23 = 4g - 4r - 5, -g + 5r - 5 = 0. Let l = 10582 - 10580. Let q = -2 - -5. Solve ln = -qn - g for n. -2 Let r(z) = 172z2 - 809z - 18. Let q be r(5). Solve -8j = 213 - q for j. 3 Suppose 4i = r - i + 5, -20 = -2r - 5i. Let w(v) = -3v - 10 + 0v + 0v + v. Let m be w(-9). Solve 7p + m = rp for p. -4 Let j be 147/5 - (-3 + 34/10). Let l = j + -17. Let s be 63/l + 1/(-4)1. Solve -sr + 2 + 18 = 0 for r. 4 Let g = -22 - -26. Suppose 0 = gr - 5r. Suppose 6 = 5l - 3l. Solve -lo = -ro + 3 for o. -1 Let d be 8 + ((-161)/(-92) - 156/16). Solve d = -1259k + 1266k for k. 0 Let n be ((-3)/(-12)9)/(17/(-2312)-17). Solve -nv = -20v + 10 for v. 5 Let s be 98/(-12)(-5)/15. Suppose 0 = sq - 13 + 5. Solve -qf + 8 = -2f for f. 4 Let h be 628/10(-10 + 0). Let i be h/(-28) - 6/14. Let a be i/121 + (-4)/22. Solve -3q - 5 - 1 = a for q. -2 Let o be 22/4(-6)/(-3). Let n = -14501 + 14537. Solve -oz = -2z - n for z. 4 Let z(m) = 5m*2 + 3. Let w be z(-2). Suppose wa - 21a = 0. Suppose 2t + 4u - u = 15, -4t - 4u + 24 = a. Solve 6 = tx - 9 for x. 5 Let l(k) = 2k3 - 12k*2 - 21k + 100. Let n be l(7). Solve -nm + 24 = -63m for m. -2 Let x(l) = -5l + 67. Suppose -f = 2f - 4q - 59, 0 = -5f + 3q + 80. Let y be x(f). Solve 5k - 8 = y for k. 2 Suppose -2210 = 20z - 3z. Let y = -130 - z. Solve -22h + 20h + 10 = y for h. 5 Let m(d) = -6d - 78. Let c be m(-15). Let q(h) = -2h*2 + 23h + 15. Let j be q(c). Solve -jf = 2f for f. 0 Let f = 3718 - 3487. Solve 225c - fc + 12 = 0 for c. 2 Let n be (6 - 10)/(1/(-2)). Let m = 9 - n. Suppose 3 = -2g - t, g - 4t - t = 15. Solve -m = q - g for q. -1 Let l be (-3)/(238/28 - 9). Solve lo - 5o = 10o for o. 0 Let u be (30/121)/((-1)/22). Let b be ((-36)/(-20) + -3)u. Suppose -bl + 5 = -65l. Solve lx = 7 - 2 for x. 1 Suppose 0 = -5h + o + 44, -4o = 93h - 97h + 48. Solve 9 = -f - hf for f. -1 Suppose 3j + 18 = 4p, -3j = j + 8. Suppose 12 = pt - 12. Suppose -t = -28u + 24u. Solve uo = -3o - 20 for o. -4 Let v(s) = 133s*2 - 78s*2 + 37s - s*3 + 54 - 90s*2. Let q be v(-36). Solve -2k + q = 14 for k. 2 Let p be (7 + 465/(-60))(-24)/9. Solve 0 = -pu - 11 + 3 for u. -4 Let d(u) = u*3 - 10u*2 - 6u + 21. Let r be d(10). Let j = 41 + r. Solve jo + o = 0 for o. 0 Suppose -5v - 26 = 2y - 7v, 47 = -3y + 5v. Let t = 17 + y. Solve 0 = -10i + 8i + t for i. 4 Suppose 30b + 84 = 16b. Let g(a) = 6a2 + 0a + 2a - 8 - 3a + 3 + a*3. Let p be g(b). Solve r + 3 = -p for r. -4 Suppose 19r = 16r + 3. Let o be (0 + r)-3 - (-30)/5. Solve -os + 6s = 0 for s. 0 Let v(l) = l*3 - 2l*2 - 16l + 9. Let j be v(5). Suppose -h + 11 = 1. Solve -j = -3a - h for a. -2 Suppose 4c - 2o = 1260, 3c + 43o = 45o + 945. Solve 74n = -31n + c for n. 3 Suppose 0 = 4u - 11u - 1043. Let j = -148 - u. Solve 4i + j = -3 for i. -1 Suppose 23u - 18u - r = 39, r - 1 = 0. Suppose uc = 6c + 6c. Solve 15y - 16y + 1 = c for y. 1 Suppose -1615 = -5f - 5x, -x = 2f - 4x - 636. Let i = 337 - f. Let y(t) = t*3 - 9t*2 - 9t - 6. Let a be y(10). Solve 0v - av - i = 0 for v. -4 Let a be ((-3)/5)/((-9)/270). Suppose -2o = 5y - 195, -5y + 2o + 197 = -a. Let n = y - 38. Solve n = -i + 2 for i. -1 Let g(b) = -b - 26. Let v be g(-30). Suppose -18 = -vx - 10. Solve -xo - 5 = 5 for o. -5 Let c = -8202 - -8300. Solve -36 = 116z - cz for z. -2 Suppose 2i - 11 = 2p - 17, -4p - 4i = -36. Solve 9a = 15a - p for a. 1 Let m = -126 - -129. Suppose -mj + 5s + 10 = 4s, -2s + 20 = 2j. Solve 1 = ju - 4 for u. 1 Let l(g) = 31g. Let w be l(6). Let u = 195 - w. Solve -un = -11n for n. 0 Let d = -75 + 40. Let k = d + 55. Suppose -364w = -727w. Solve -4z + k = -wz for z. 5 Let m = 12 - 16. Let k(g) be the second derivative of -g5/20 - g*4/3 + g - 8. Let a be k(m). Solve a = y + y for y. 0 Let o = -18 -	{ "pile_set_name": "DM Mathematics" }
= 3q(j) - 8z(j). Factor t(y). y(y - 1) Let y(n) = -3n*3 - 2n*2 + 1. Let p be y(-1). Solve 2g + 8g2 - gp - 4g*4 - 3g*2 - 2g*5 = 0. -1, 0, 1 Suppose -131 = -70p + 79. Let f be 0 + 0 + 10/6. Let pc + 7/3c*4 - 2/3 - 3c*3 - fc*2 = 0. What is c? -1, 2/7, 1 Let q be (-23)/(-5) - (8 + -5). Factor -2/5d*2 - q - 8/5d. -2(d + 2)2/5 Let c be (22/(-99))/(1/(-9)). Suppose -3/5d*c + 0d + 3/5 = 0. Calculate d. -1, 1 Let m(z) be the second derivative of -z6/5 + z5/5 + z*4/6 - 4z. Suppose m(q) = 0. Calculate q. -1/3, 0, 1 Suppose a - 5 + 21 = -4v, 0 = 2v + 3a + 8. Let g be v/816/(-6). Determine b so that -1/3b3 - 2/3b*2 + gb*4 + 0 + 0b + b*5 = 0. -1, 0, 2/3 Find z, given that -z - 3/4z*3 + 0 + 2z*2 = 0. 0, 2/3, 2 Let z = 619/410 + -2/205. Find m, given that 0 + 1/2m*5 - m + 5/2m*2 - 1/2m*4 - zm3 = 0. -2, 0, 1 Let q(r) = r4 - r2 + r + 1. Let o(n) = -n5 - 5n4 - 5n3 - n2 - n - 1. Let j be -1 - (-2 - (-1 - -2)). Let v(w) = jq(w) + 2o(w). Factor v(i). -2i2(i + 1)*2(i + 2) Solve -10/3 + 35/3z2 - 25/3z = 0 for z. -2/7, 1 Let d(k) be the first derivative of k*4 + 16k*3/3 + 6k*2 - 4. Factor d(z). 4z(z + 1)(z + 3) Let s(h) be the second derivative of h*8/4800 + 2h*7/1575 + 11h6/3600 + h5/300 + 5h4/12 - 4h. Let o(l) be the third derivative of s(l). Factor o(j). (j + 1)*2(7j + 2)/5 Suppose 34j + 12 = 40j. Factor 6/5t*3 - 2/5t*j + 0 + 2/5t*5 + 0t - 6/5t4. 2t*2(t - 1)*3/5 Let h be (-6)/(-2 + (-3)/(-6)). Solve 0z*2 + 4z2 + z2 - 2zh - z + z5 - 3z*2 = 0. -1, 0, 1 Let s(d) be the second derivative of -2d*7/21 - 2d6/5 - d5/5 + d*4 + 4d*3/3 + 12d + 4. Solve s(h) = 0 for h. -2, -1, 0, 1 Let g = -4 - -6. Let w(j) be the second derivative of 0 + 1/42j4 + 2/21j*3 + 2j + 0jg. Factor w(h). 2h(h + 2)/7 Let z be ((-4)/20)/((3 + -1)/(-2)). Let w(a) be the second derivative of 0a*3 + 0 + za5 - a2 + a + 1/2a4. Determine g, given that w(g) = 0. -1, 1/2 Let m = 8 - 6. Suppose n2 - n2 - nm + 2n*2 = 0. Calculate n. 0 Determine u so that 1675u*4 - 109u - 1910u3 - 375u*5 + 38u + 820u2 - 49u = 0. 0, 2/5, 2/3, 3 Find y such that 2/5y5 + 0 - 8/5y*4 - 8/5y*2 + 2/5y + 12/5y3 = 0. 0, 1 Let a be (-8)/6(-150)/20. Let f(k) = k - 8. Let t be f(a). Factor n*3 + 0 - 1/2n*4 - 1/2n*t + 0n. -n*2(n - 1)*2/2 Let o = 31/92 - 2/23. Find n such that -on*2 + 1/2n + 3/4 = 0. -1, 3 Let w be (0/3)/(8/(-4) + 0). Let v(i) be the third derivative of -1/120i5 + 0i*3 + wi + 0 + 3i2 + 1/24i*4. Factor v(l). -l(l - 2)/2 Let b(p) = -p*2 + p + 1. Let y(w) = -5w*2 + 15w. Let g(f) = -10b(f) + y(f). Determine n so that g(n) = 0. -2, 1 Let v(x) be the third derivative of x6/150 + x5/25 + x4/10 + 2x3/15 + x2 + 7x. Let v(d) = 0. What is d? -1 Let g = -431/6 - -3125/42. Let w = -29/14 + g. Factor 1/2p*2 + 0 - wp. p(p - 1)/2 Let a be ((-4)/3)/((-1)/6). Suppose -4 = -3z + a. Solve r*3 + 0 - 3r*2 + 14/3r*z + 2/3r = 0. -1, 0, 2/7, 1/2 Suppose -2s = -4m + 49 - 7, 0 = 4m - s - 45. What is w in -8/3 - 25/3w*3 + mw - 10w2 = 0? -2, 2/5 Let y(g) be the first derivative of -2g*6/3 + 10g*5/3 - 41g*4/6 + 22g*3/3 - 13g*2/3 + 4g/3 - 1. Suppose y(r) = 0. Calculate r. 1/2, 2/3, 1 Let x(p) be the first derivative of -7p5/15 + p4 + 4p3/9 - 33. Factor x(k). -k2(k - 2)(7k + 2)/3 Let z(k) be the first derivative of 1/5k*3 + 1/5k - 1 - 1/20k4 - 3/10k2. Factor z(s). -(s - 1)3/5 Let x be (-128)/(-96)(-9)/(-4). Solve -6/5p*2 + 3/5p - 3/5px + 6/5 = 0 for p. -2, -1, 1 Suppose -4t = -7t + 36. Factor -3f + 14f2 + f + f - tf*2. f(2f - 1) Let p = 12 + -7. Let r(j) be the first derivative of 0j*2 + 1/3j*3 + 0j - 3 + 0j4 - 1/5jp. Factor r(l). -l2(l - 1)(l + 1) Let b(h) be the third derivative of -h*5/20 + 17h*4/24 - 5h*3/3 - 11h*2. Suppose b(l) = 0. Calculate l. 2/3, 5 Let m = -354 - -2482/7. What is j in -2/7j - 2/7 + mj2 = 0? -1/2, 1 Let n(j) = j3 - 7j*2 + 4j - 4. Let b(y) = -3y3 + 27y*2 - 15y + 15. Let w(x) = -4b(x) - 15n(x). Factor w(f). -3f2(f + 1) Let q(i) be the first derivative of 2i3/21 - 2i*2/7 - 9. Factor q(n). 2n(n - 2)/7 Suppose 0y + 8/3y2 + 0 + 10/3y*5 + 34/3y*4 + 32/3y*3 = 0. What is y? -2, -1, -2/5, 0 Let z(v) = 1. Let c(g) = -4g*2 + 56g + 2. Let u(m) = -c(m) + 2z(m). Let u(s) = 0. Calculate s. 0, 14 Let d be (3 - (-11)/(-3))-3. Solve 2m3 + 12 + dm*2 - 12 = 0. -1, 0 Factor 2/3r*3 + 8/15 + 16/5r + 14/5r2. 2(r + 2)*2(5r + 1)/15 Let h be (-2)/(-11) + (-97)/(-11). Let r(o) = o3 - 8o*2 - 8o - 7. Let x be r(h). Factor 4j - 25j*3 + 2j*x + 26j*3 - 3j. j(j + 1)2 Factor -4r*2 - 34r*4 + 0 - 5r*5 - 32r + r*5 + 38r*4 + 20r*3 - 16. -4(r - 2)*2(r + 1)*3 Suppose 13z - 17z = -80. Let c be 6z/15 + -4. Factor -1 + 128s5 - 128s*c - 31/2s - 208s3 - 88s*2. (s - 2)(4s + 1)4/2 Let y(t) = -t3 + t2 + t. Let q(j) = 6j*3 - 10j*2 - 4j + 8. Let i(z) = q(z) + 4y(z). Solve i(w) = 0 for w. -1, 2 Let h(a) be the first derivative of 4a - 5 + 3/2a2 - 1/3a*3. Factor h(u). -(u - 4)(u + 1) What is p in -4p2 - 5p*2 - 9p - 34 + 6p2 + 46 = 0? -4, 1 Suppose 4j + 12 = -12. Let c(w) = -4w3 + 6w*2 - 2. Let u(g) = -5g*3 + 7g*2 - 3. Let s(i) = jc(i) + 4u(i). Factor s(y). 4y*2(y - 2) Let f(l) be the second derivative of 4l6/25 + 17l5/50 - l4/30 - l3/3 + l2/5 - 21l. Let f(u) = 0. What is u? -1, 1/4, 1/3 Let r = 1 - -2. Suppose mr - 4m + 6m + m3 - 5m*2 = 0. What is m? 0, 1/2, 2 Solve 3r*3 - 3r*3 + 24r*2 + 48r + 0r3 + 3r3 = 0. -4, 0 Let l(u) be the first derivative of u8/336 - u*7/210 + 3u2/2 + 1. Let f(r) be the second derivative of l(r). Let f(d) = 0. What is d? 0, 1 Let x(y) be the second derivative of y6/60 - y5/10 - y4/8 + 5y3/6 + 2y*2 + 64y. Factor x(a). (a - 4)(a - 2)(a + 1)*2/2 Let k(c) = 0 + c + 4 + 3. Let y be k(-5). Factor -1 + 7/2w*y + 5/2w. (w + 1)(7w - 2)/2 Let a be (6/5)/(6/10). Factor 1/4za - 1 + 0z. (z - 2)(z + 2)/4 Let m(z) be the second derivative of z7/14 - 3z*5/20 - 6z. Determine l so that m(l) = 0. -1, 0, 1 Let q(j) be the third derivative of -j11/1164240 + j9/105840 - j7/17640 - j5/20 - 3j2. Let x(z) be the third derivative of q(z). Factor x(l). -2l(l - 1)2(l + 1)*2/7 Let l(z) = 5z*2 + z. Let d(a) = 21a*2 + 3a. Let g(s) = -2d(s) + 9l(s). Factor g(y). 3y(y + 1) Suppose 0f - 5f = 30. Let t be (f/(-8))/((-9)/(-6)). Solve t - o*2 + 1/2o = 0. -1/2, 1 Suppose 0 = s + 3, 5i + s = 12. Determine y, given that -iy + 3y2 - 2y + 4y + 4y = 0. -1, 0 Let o(m) = 14m2 - 17m - 2. Let t(h) = -7h2 + 8h + 1. Let p(u) = 6o(u) + 15t(u). Factor p(c). -3(c - 1)(7c + 1) Let g(h) be the second derivative of h6/3 + h5/4 - 13h. Factor g(j). 5j3(2j + 1) Let o(m) be the third derivative of -m6/300 - m5/50 + m4/60 + m3/5 + 50m*2. Factor o(l). -2(l - 1)(l + 1)(l + 3)/5 Let g(s) be the first derivative of s3/3 - s2/4 - s/2 + 6. Factor g(o). (o - 1)(2o + 1)/2 Let m(c) be the third derivative of 0c4 + 0c*3 - 3/160c*6 + 2c*2 - 1/448c*8 + 3/280c*7 + 0c + 0 + 1/80c5. Let m(o) = 0. Calculate o. 0, 1 Let d(q) be the first derivative of 3q*4/20 - 3q*3/5 + 3q*2/5 - 16. Factor d(n). 3n(n - 2)(n - 1)/5 Let m be (-28)/(-4)(-1)/(-7). Let x(t) be the first derivative of m - 4t - 9/4t4 - 8t*2 - 7t*3. Factor x(l). -(l + 1)(3l + 2)2 Factor 4l + 4/5l3 - 24/5l*2 + 0. 4l(l - 5)(l - 1)/5 Let c(b) be the first derivative of -b*6/30 - 3b*5/25 - 3b4/20 - b3/15 + 2. Factor c(r). -r*2(r + 1)*3/5 Factor -2/9t*3 + 16/9 + 8/9t - 4/9t2. -2(t - 2)(t + 2)2/9 Let b(o) be the first derivative of o6/15 + o5/10 - o4/6 - o3/3 + 2o - 1. Let c(q) be the first derivative of b(q). Determine f so that c(f) = 0. -1, 0, 1 Let k(m) be the third derivative of -m6/48 + m5/24 + 5m4/48 - 5m*3/12 + 4m*2. Find t, given that k(t) = 0. -1, 1 Suppose -5 = 3x - 4x. Let t(h) be the first derivative of -8h + 2h2 + 10/3h*3 - 1/6h**6 + 1 -	{ "pile_set_name": "DM Mathematics" }
w. Which is the nearest to l? (a) 0.2 (b) -0.1 (c) -4 b Let i = 4.2 + -5. Let l = i - 6.2. Let f = 5 + -3. Which is the closest to -1? (a) l (b) -1 (c) f b Let u = -468 - -483. What is the nearest to 0.2 in -7, 0, u? 0 Let z be 949/65 + -2 - 13. Which is the closest to z? (a) 0.2 (b) -2/71 (c) -4 (d) 4 b Let x = 1.933 - -0.067. Let t = 4.056 + -0.056. What is the closest to x in 0.5, t, -3? 0.5 Let m be (-28)/(-5)(-470)/(-188). Let v(f) = -2f2 + f2 + 10 + 7f + 6f. Let d be v(m). Which is the closest to 0.1? (a) -3 (b) -1 (c) d b Let g = 45/23 + -181/69. Which is the closest to -0.1? (a) 1 (b) 0 (c) g (d) 0.2 b Let l = 1413 + -1418. Which is the closest to l? (a) 10 (b) -2/9 (c) 2/9 b Let d be (-15)/(-2)(-26)/(-39). Let p = 4.08 + -4. Let q = 4.08 - p. Which is the closest to d? (a) q (b) -0.3 (c) 1/5 a Let j = -1992 - -1997. What is the nearest to -1/4 in 0.4, 1/3, j? 1/3 Let g = 3983/9 - 443. Let m be (4 - -1) + -6 - 5/(-3). Which is the closest to 2? (a) g (b) m (c) 3 c Let f = -62449/105 + 10402/15. Let s = f + -99. Let h = -1 - 1. Which is the closest to 10? (a) s (b) 4 (c) h b Let f = -0.7 - -0.8. Let i = -6.4 + 6.1. Let g be 1/1 + 52/(-60). Which is the nearest to f? (a) -0.1 (b) i (c) g c Let v = 537/1855 - 1/265. Let l be ((-2)/(-8) - (-153)/24)2. Let y = l + -13. What is the closest to -8 in v, y, 2/19? 2/19 Let q = -0.094 - -0.594. Let i = 5 + -2. What is the closest to 0 in i, q, 0.1? 0.1 Let s = -782 - -778. Which is the closest to s? (a) -0.05 (b) -2/17 (c) 1 (d) -5 d Let q = 7.9 + -2.4. Let g = -5 + q. Let j = 2/1593 + 3176/7965. Which is the closest to j? (a) -1/2 (b) -3/7 (c) g c Let n = 12.44 + 5.56. What is the nearest to 2 in -3, 4, n? 4 Suppose -5t + 80 = -t. Let o be ((-22)/t - -1)-4. What is the nearest to o in -0.1, 0.02, -3? 0.02 Let j = 6.42 + -6.32. What is the closest to j in 1, 53, 0? 0 Let j = -0.7 + -0.7. Let f = j - -0.6. Let u = -0.6 - f. What is the nearest to 1 in -3, u, 3? u Let k be ((-1)/(-28))/((-22)/77). Which is the nearest to 22? (a) 2/5 (b) k (c) -1/3 a Let x(s) = 4s + 1. Let t be x(1). Let c = -61.1 + 61.3. What is the nearest to 0 in -9, c, t? c Let f(x) = -x + 5. Let l be f(0). Suppose 5k + 203 = 4k - 2r, -lk - 2r = 991. Let j = k + 4139/21. What is the nearest to 1 in 5, j, 0.1? 0.1 Let l = -25 + 42. What is the nearest to l in 0, 0.5, -4? 0.5 Let f = 0.29 - 0.39. Let x be 2/(-6) + (-16)/(-12). Suppose 2o = o + x. Which is the closest to f? (a) -0.5 (b) -1 (c) o a Let f(i) = -i2 + 4i + 12. Let h be f(6). Suppose h = 2v - 6 - 14. Suppose -2t = 3t + v. What is the closest to 0.1 in -1, t, -5? -1 Suppose 2m + 38 = 12. Let w = m - -16. Suppose 0 = -0o + wo - 15. Which is the nearest to 0.1? (a) o (b) -0.4 (c) -2/9 c Let a = -2619 + 2615. Let t = -13 - -8. Let k = -4.5 - t. What is the closest to 7/2 in a, -0.4, k? k Let l(c) = -c*3 + 13c*2 + 29c + 17. Let w be l(15). What is the closest to 2 in 4, w, -4, 2/7? w Let t = -1 - -1. Let u be (-60)/(-14) - (140/7)/5. What is the nearest to u in t, 0.5, -4? 0.5 Let h = 31/4 - 157/20. Let f be 18/(-81) - (-4)/6. What is the closest to f in 0, h, 2? 0 Let v = -6 - -6.07. Let a = 186 + -188. Let i = a - -5. What is the closest to 2 in v, i, 2/15? i Let l = 466 - 465.98. What is the closest to -2/115 in 2, l, -3? l Let q = 0.23 + 0.51. Let i = q + -0.74. What is the closest to 1 in 8, i, -2/9? i Let k = -856 + 861.052. Let h = -0.052 + k. What is the nearest to 1 in 1/4, 0, h? 1/4 Let t be 104/286 + 130/(-176). Which is the nearest to -2/11? (a) -3 (b) t (c) 0.3 b Let u = 680 + -680.4. What is the closest to 0.3 in 0.4, 3, u, -0.2? 0.4 Let f = 4 - 4. Let g = 119 - 955/8. Suppose -5q + 4s + 11 = 0, -3s + 4s = q - 2. What is the closest to 1 in q, g, f? f Let o be 6/3(-3 + 4). Suppose 5 = of - 85. Let j be (-80)/f + 2/(-9). Which is the nearest to 0? (a) -1 (b) j (c) -2/7 c Let u(l) = -3l + 45. Let o(r) = -r + 15. Let v(k) = 11o(k) - 4u(k). Let f be v(16). Which is the nearest to f? (a) -1 (b) 2/3 (c) -0.02 b Let q be 1/35 - -24(-15)/840. Let v = 17/2 + -9. What is the nearest to q in -2, -4, v? v Let f be (-2 + 4)(-15)/50. Which is the closest to -0.1? (a) 1/5 (b) f (c) -0.2 c Suppose 3t = -0t. Let p = 973.1 + -973. Which is the nearest to t? (a) p (b) -5 (c) -8/3 a Let j = -118 - -123. Let s = -0.2 + 2.2. Let y = -7 + s. Which is the nearest to j? (a) 1 (b) y (c) 2/5 a Let o = -3.61 - -19.91. Let x = -16 + o. Which is the nearest to -1? (a) 0.4 (b) 0 (c) x b Suppose -21a - 155 = 10a. What is the nearest to -1/2 in 12, a, 0.1, 0? 0 Let b = 0.6 + -0.5. Let j = 27.7148 - 0.0148. Let i = j + -28. What is the closest to b in i, 2, -1/5? -1/5 Let d = -3.09 - 1.01. Let z = d + 4. What is the closest to -0.1 in z, -2/9, -0.5? z Let u = 116 - 115. Which is the closest to -4/3? (a) u (b) -2 (c) -1/5 b Suppose -4s - 180 = s. Let t = s - -37. Which is the nearest to t? (a) 1 (b) -0.5 (c) -0.12 a Let j = 64 - 64.1. Let q = 0.2 - 0.5. Which is the closest to j? (a) q (b) -5 (c) -0.2 c Let h be ((-2)/(-4))/(-1 - -2). Let r be (-1 - 5/(-7))/((-32)/(-64)). Let d = 1.2 + -1.3. Which is the closest to h? (a) d (b) 5 (c) r a Let w = -129.94 + 130. Which is the closest to 0.2? (a) 0.3 (b) w (c) 1 a Let t = -22.962 - -23. Let n = t + 1.962. Let k = -3 - -6. What is the closest to n in 0.1, k, -5? k Let d = -4/12251 - 9641381/477789. Let v = d - -61/3. Which is the nearest to v? (a) 7 (b) 0 (c) -5 b Let i = -49 - -44. Which is the nearest to -1.7? (a) 0 (b) i (c) 0.3 a Let n = -1 + 4. Let k = -19 - 1. Let u = k + 19.9. Which is the nearest to u? (a) 0.4 (b) n (c) 3/4 a Suppose -u + 4u + 8 = -p, 2u = 3p + 13. Suppose 4m = -112 + 408. Suppose mo - 6 = 71o. Which is the nearest to u? (a) o (b) 0.1 (c) -0.2 c Let q = -9.88 - -10.08. Let w be (2/(-2))/(-1)-5. Let t = 2 + w. Which is the nearest to q? (a) t (b) 0.1 (c) 0.4 b Let t be (8 - 8)(6/(-8))/(-3). Which is the closest to -2? (a) t (b) 2 (c) 0.02 a Let n = 53 - 52. Let y = 0.61 - -1.39. What is the closest to n in -0.4, -1, y? y Let h be (6 - (-132)/(-18))3. Which is the nearest to h? (a) 2 (b) 3 (c) 1/10 c Let q = -1465 + 1468. What is the closest to -5 in q, 0.1, -4? -4 Let c = 1.1 + -1.6. Let k = -64.2 + 58. Let j = k - -5.9. What is the closest to j in c, 0.3, 2/3? c Let f(p) = -16p - 180. Let i be f(-11). Let d = 0.3 - -1.7. Which is the nearest to 0? (a) d (b) i (c) 2/11 c Let w be (-60)/(-105) - 3/(-7). Let s = -5 - -6. Which is the closest to w? (a) s (b) 2/11 (c) 0 a Suppose -4f + 9 = 3g, 3 = f - 0f. Let o be -4 + (-3)/g + -1. Suppose -2q + 10q + 8 = 0. What is the closest to o in q, -5, -0.5? q Let o = 22/75 - -8/75. Let p = -0.2 - -0.16. Let k be -3(1 + (-20)/18). Which is the nearest to p? (a) k (b) 2/9 (c) o b Suppose -2g = -2 + 2. Suppose -2i + 14 = -3y, gi + 2y + 6 = -2i. Which is the nearest to -5? (a) i (b) 2 (c) 0 c Suppose -3f = -7f - 16. Let q = -3.3 - -0.3. Let x = -46 + 183/4. What is the closest to x in q, f, -2? -2 Let l = 42.23 + 0.77. Let i = l - 46. Let g = 0 + 0.1. Which is the closest to g? (a) i (b) 2/3 (c) -1 b Let o be 5 + (-87)/12 + 2. Let i be ((-2)/(-12))/((-4)/(-8)). What is the closest to -2/5 in i, 2/3, o? o Let l = -179.1 + 179. Which is the nearest to l? (a) -2/9 (b) -1 (c) -25 a Let w = -2.16 + 2. Let s = w + -0.14. Let u = 7 + -7.2. Which is the nearest to s? (a) u (b) 0 (c) -4 a Let y = -100/91 + 18/13. Which is the nearest to 3/5? (a) -1/3 (b) -1/4 (c) y (d) -0.1 c Let k = 89 - 85.1. Let i = -4 + k. Let l = -0.28 + 0.08. Which is the nearest to -1? (a) i (b) 2/15 (c) l c Suppose -6h + 2h + 20 = 0. Suppose -6q - h = -2q - p, 0 = -3*p + 15. Which is the closest to 2/9? (a) -5 (b) 0.2 (c) q b Let d = -0.2696 + 63.2296. Let o = -63 + d. Which is the closest to 0? (a) o (b) 0.1 (c) -2 a Let y = 43 + -44. Let q be (-2)/(-6) + (-62)/9. Let d = -20/3 - q. Which is the closest to 0? (a) d (b) -2/17 (c) y a Let l(n) = -n - 13. Let q be l(-20). Let o = -0.1 + 0. Let b = -1 - -1.1. What is the closest to -1 in o, b, q? o Let f = -709.713 + 710. Let u = 0.013 + f. Which is the closest	{ "pile_set_name": "DM Mathematics" }
5u = -8u + 72. Let i = u - 20. What are the prime factors of i + (57 + 4 - -2)? 67 Suppose -r - 5s + 1701 = -3s, -5102 = -3r - 5s. What are the prime factors of r? 1699 Suppose 4u = 20, 3 = 2o - u - 2. Suppose -256 - 167 = -or + 4t, 4 = -2t. Suppose w + w = -v + r, 4w - 2v - 154 = 0. List the prime factors of w. 2, 5 Suppose 5 = f - 7. Suppose m - 44 = -f. What are the prime factors of m? 2 Let q = 54 + -57. What are the prime factors of q - 3((-159)/9 + -3)? 59 Let z = 0 - 1. Let m = 1 - z. Suppose 116 = 5g - 2x, -3g - 2x + 80 = mx. List the prime factors of g. 2, 3 Let u(c) = c3 - 3c + 4. Let l be u(-3). What are the prime factors of 28/98 + (-444)/l? 2 Let z = 42 - 16. Suppose -2o + 3o = 3y - 17, 0 = 4y - 3o - z. Suppose yw = 2w + u + 111, 0 = 4w - 5u - 148. What are the prime factors of w? 37 Suppose 0 = -6w + 7w - 2. Suppose -wb = -r - 212, 2r - 106 = -7b + 6b. List the prime factors of b. 2, 53 Let d be ((-68)/16 - -4)-26. Suppose 5r - 33 = 27. Suppose 0 = -4n + r, 5f - dn - 87 = -21. What are the prime factors of f? 3, 5 Let o = 55 - 48. Suppose -op + 3p = -428. List the prime factors of p. 107 Suppose 4q = -c + 114, -2q + 3q - 4 = 0. What are the prime factors of c? 2, 7 Suppose -10n + 688 + 2122 = 0. List the prime factors of n. 281 Suppose 22 = 4n - 2a, 0n - 5a - 10 = -n. What are the prime factors of 341/n + -2 - 4/20? 2, 3, 11 Let y = -23 - -28. Suppose -yz + 113 = -7. List the prime factors of z. 2, 3 Let k be 452/5. Let x be 4805/20 + (-2)/k. Suppose 8q = 4q + x. List the prime factors of q. 2, 3, 5 Let w be (54/4)/(2/4). Let m be (-1)/(2 + (-51)/w). Let f = m - -16. What are the prime factors of f? 7 Let j(s) = 11s2 + 2s - 2. Let g be j(-2). Let f = g + -26. What are the prime factors of f? 2, 3 Let q(h) = -h*3 - 10h*2 - 11h - 10. Suppose o - 15 = 4o - 5c, 3o = -3c - 39. What are the prime factors of q(o)? 2, 5 List the prime factors of (-12/3)/(6/(-8316)). 2, 3, 7, 11 Let w be 1/(-3) + (-28)/(-3). Let i = w - 8. Let y = i - -8. What are the prime factors of y? 3 Suppose 28j - 22j = 36. Suppose ji = -5i + 1705. List the prime factors of i. 5, 31 Suppose 3v - 156 = -0v. Suppose p - v = 14. Suppose 3m = 5l - 139, 2l = -l - 4m + p. What are the prime factors of l? 2, 13 Let o = 677 + -410. Let s = o - 184. List the prime factors of s. 83 Let x(l) = l2 + 28l + 42. List the prime factors of x(22). 2, 571 Suppose 3o = -0o. Suppose -3d + 6 + o = 0. What are the prime factors of (-1)/d - (-675)/18? 37 Let q(d) = -2d*3 - 16d*2 + 11d - 11. Let n(c) = -2c + 19. Let h be n(14). List the prime factors of q(h). 2, 13 Let t(x) be the third derivative of -5x*4/24 + 2x*3/3 - 6x*2. List the prime factors of t(-8). 2, 11 Let a be (-12)/(-21) - (-34)/14. Suppose 252 = 4p + 5n, -ap = -0n - n - 170. What are the prime factors of p? 2, 29 Let u(l) = 11l*3 - 7l*2 + 21l - 1. List the prime factors of u(4). 3, 5 Let w(o) = o*3 + 22o*2 + 41o + 23. Let s be w(-20). Suppose -4t = -3i + 279, si - 57 = 5t + 219. List the prime factors of i. 97 Let o = -4 - -7. Let c = 301 - 141. Suppose 6q = 3q + o, 5u = -5q + c. List the prime factors of u. 31 Let i = -182 - -402. List the prime factors of i. 2, 5, 11 Let n = 8 - 10. Let s be (-1210)/(-33)(-3)/n. Suppose 0 = -3i - s + 145. What are the prime factors of i? 2, 3, 5 Let p = -866 - -1310. What are the prime factors of p? 2, 3, 37 Let q(v) = 58v2 - v + 1. Let n = -35 - -34. List the prime factors of q(n). 2, 3, 5 Let x(h) be the second derivative of -h5/10 - 5h4/12 - h3/6 - 3h2/2 + 2h. Let k be 3/5 + 46/(-10). What are the prime factors of x(k)? 7 Let f be ((-508)/(-18) - -3) + (-4)/18. Suppose fy - 6279 = 8y. What are the prime factors of y? 3, 7, 13 Let h(m) = -m*2 - 14m - 1. Let b be h(-14). Let n be 2 - (b8 + 4). Suppose -12u + 9u + n = 0. What are the prime factors of u? 2 Let y(k) = 6k - 4 + 4 - 3 - 2k. Let i(z) = 3z - 2. Let d be i(3). What are the prime factors of y(d)? 5 Suppose -3m + 2 + 9 = w, 9 = 3m. Let l = 66 + 34. Suppose -wf = 2f - l. List the prime factors of f. 5 Let r(g) be the third derivative of g5/24 + g4/8 - g*3/2 - 3g*2. Let q(u) be the first derivative of r(u). What are the prime factors of q(5)? 2, 7 Let j = 2 - 2. Suppose 5n - 1 + 11 = j. List the prime factors of 61/2 - 1/n. 31 Suppose -44o + 19062 = -21330. List the prime factors of o. 2, 3, 17 Let s = 12 + -10. Suppose so - 4h - 110 = 0, h + 53 = 5o - 231. Suppose 2g + 5c = 52, -2g + o = c + 5. List the prime factors of g. 2, 13 Let n = 98 - 95. Suppose -6t + nt + 772 = -l, 3l + 1284 = 5t. List the prime factors of t. 2, 3, 43 Suppose 7a - 2a - 28 = 4s, 3s = a - 10. Let c be -2 + (10 + s)/2. Suppose 3q - 82 = -5x, 26 = 4q - 3q + cx. List the prime factors of q. 2, 17 Suppose 3q = -4w + 2996, -5w + 2q + 3780 = -3q. List the prime factors of w. 2, 47 Suppose 39217 = 11i - 25298. What are the prime factors of i? 3, 5, 17, 23 Let m(p) = p*3 + 2p*2 + p - 1. Let b be m(2). Suppose 6i = -b + 299. List the prime factors of i. 47 Suppose 4 = 4s - 4p, 2 = -0s + 3s - 4p. Suppose 0 = j - sd - 101, -d - 404 = -4j - 2d. What are the prime factors of j? 101 Let c = 117 + -67. What are the prime factors of (-8)/2 + c + 4? 2, 5 Suppose 128p - 113p = 31845. List the prime factors of p. 11, 193 Suppose 13r - 14r + 85 = 0. Suppose -r = 26g - 27g. What are the prime factors of g? 5, 17 Let w(a) = a - 1 + 1 - 2 + 0a. What are the prime factors of w(12)? 2, 5 Let y(j) = 2j + 20 - 8 - 9j + 8j. Let i be y(-7). Suppose il = -l + 234. What are the prime factors of l? 3, 13 Let g(s) be the first derivative of -s4/4 - 5s*3/3 + 6s*2 + 12s - 1. Let r be g(-7). Suppose -2l + 46 + r = 0. List the prime factors of l. 2, 3 Let a be 5 - (2 - 1) - 4. Suppose 371 = 5t + 3x, -t + x + 79 = -at. List the prime factors of t. 2, 19 Let v(l) = 2l3 - 5l*2 + 5l + 1. What are the prime factors of v(4)? 3, 23 Let h = -691 - -922. List the prime factors of h. 3, 7, 11 Let w(h) be the second derivative of -h*4/12 + 19h*3/6 - 5h*2 + 2h. List the prime factors of w(14). 2, 3, 5 Suppose 32 = 4d - 244. Suppose 32 = f - 5k - 19, -d = -f - k. Let g = f + -39. List the prime factors of g. 3 Let t be (-10)/(-5)298/4. Suppose -4y + 0w = 2w - 180, 0 = 3y + 5w - t. What are the prime factors of y? 43 Let t(k) = 3k - 27. Let i be t(9). Suppose -5u + 2q = -0q - 358, i = 3u + q - 217. List the prime factors of u. 2, 3 Let i be (0(-1)/(-4))/(-2). Let t be 4 + -2 - (i + -1). What are the prime factors of 3/t - (-32 + 3)? 2, 3, 5 Let s(i) be the first derivative of -8i - 3/2i*2 - 5. List the prime factors of s(-8). 2 Let z be 1/((-2)/(-1 - 11)). Let t(u) = 2u*2 - 6u - 1. Let m be t(z). Suppose m + 40 = 5v. List the prime factors of v. 3, 5 Let t(h) = -2h*3 - 7h*2 + 17h + 49. List the prime factors of t(-7). 3, 7, 13 Suppose 51k - 1560 = 38k. What are the prime factors of k? 2, 3, 5 Let x = 1624 + -1053. List the prime factors of x. 571 List the prime factors of 1/((-1)/(-13))(-35 + 174). 13, 139 Suppose 2y - 34816 = -6y. What are the prime factors of y? 2, 17 Suppose 0 = f - 0f - 7. Suppose -w = -6 + f. List the prime factors of -27(-1)/(-1)w. 3 Suppose -2r - m + 28 = -14, 53 = 3r - m. List the prime factors of r. 19 Let q(i) = i*2 - 2i - 2. Let a be (-28)/21 + (-44)/(-6). List the prime factors of q(a). 2, 11 Let k(n) = n*2 + 4n - 8. Let g be k(-6). Suppose -b - 4r = -4b + 169, -114 = -2b + gr. List the prime factors of b. 5, 11 Suppose -v = -y - 0v, -4y + 12 = -v. Let z(g) = -g + 17. Let a be z(11). Suppose yu + a = 274. What are the prime factors of u? 67 Suppose -x + 2z + 147 = 0, -2z - 767 = -16x + 11x. Let d = 190 - x. List the prime factors of d. 5, 7 Suppose -12z = -8z - 24. Suppose -z + 15 = q. List the prime factors of q. 3 Let d = -93 - -99. Suppose 7 = s - d. List the prime factors of s. 13 Suppose 3j = 2r + 307, -16 = -2r - 2r. Let i = j - -22. List the prime factors of i. 127 Suppose -21u + 7462 = -8u. List the prime factors of u. 2, 7, 41 Let c(q) = -36q - 92. What are the prime factors of c(-10	{ "pile_set_name": "DM Mathematics" }
+ 4h - 4. Let i(b) = 4 - b3 + 22b*2 + 0 + 42b - 23b2 + 1. Let w be i(6). Determine p(w). -9 Let a(i) = -i3 + 4i*2 + 2. Let l be a(4). Let n(m) be the first derivative of 6m + m*2 - 3 + 0ml - m2 + m2. Calculate n(-6). -6 Let p(g) be the first derivative of g3/3 - 5g2 + 103. What is p(7)? -21 Let q(r) = -2 + 4 + 65r - 56r + 4. Calculate q(-5). -39 Let n(o) = 8o*2 + 32o + 57. Let c(t) = -2t2 - 8t - 13. Let g(b) = 9c(b) + 2n(b). Give g(-5). -13 Let d(c) = c*2 + 9c + 3. Let g(v) = -2v3 + 16v*2 - v - 1. Let k be g(8). Give d(k). 3 Let m be (-3 - -4)/((-4)/(-20)). Suppose 3q - m - 4 = 0, -s + 3q - 1 = 0. Suppose 0 = 4t - st + 12. Let g(v) = -2v*2 + 3v + 4. Determine g(t). -5 Let u be (-240)/32(12/5 + 0). Let g(n) = -n - 26. What is g(u)? -8 Let k = 181 + -179. Let m(v) = -6v*2 + 2v. Calculate m(k). -20 Let x(h) be the third derivative of h5/60 - h4/24 + 5h3/6 - 91h*2. Determine x(0). 5 Suppose -7o + 2o = 0. Let j(g) = -g3 + 2g*2 + g - 8. Let k = -7 - -4. Let h(x) = 2x*3 - 3x*2 - 2x + 17. Let u(y) = kh(y) - 5j(y). Calculate u(o). -11 Suppose 3j - 9 = 3. Let n(g) = -6g*3 - 26g*2 - 31g + 25. Let y(q) = q*3 + 5q*2 + 6q - 5. Let t = 7 + -9. Let u(k) = tn(k) - 11y(k). Give u(j). 5 Let r be -2 + 16/(-8) - -7. Let i = 7 - 5. Let q(l) = -l + il2 - l2 - 1 - l. Determine q(r). 2 Let v(x) = x3 + 6x*2 + 6x - 1. Let g be v(-5). Let u be g(4 - 27/6). Let h(n) = -n + 9 + un + 4n - n2 + 2n. Determine h(8). 9 Let b(y) = 3y - 32. Let r(p) = 5p - 48. Let t(z) = -8b(z) + 5r(z). Calculate t(-7). 9 Let x(n) be the third derivative of 0n3 - 1/40n*5 + 1/360n*6 + 0 - 1/6n*4 + 0n - 5n2. Let v(a) be the second derivative of x(a). Calculate v(-5). -13 Let f(t) = -2t*2 - 11t + 10. Let c(q) = -q*2 - 5q + 5. Suppose 0 = -2s + 4s - 10. Let u(g) = sc(g) - 2f(g). What is u(-5)? -5 Let t(l) be the second derivative of l*3 - 2l. Let g be ((-2)/(-3))/((-4)/12). Determine t(g). -12 Let t(i) = i*3 - 2i*2 - 2i - 4. Suppose 8h = 5p + 3h - 70, 2p = -4h + 34. Let m(q) = -q2 - 14q + 18. Let n be m(-14). Let z = n - p. Give t(z). -1 Let w(i) = i - 16. Suppose 13h - 4h - 108 = 0. Let r be w(h). Let y(v) = 5 - 4 + v + 0v. What is y(r)? -3 Let s(q) = 5q - 1. Let h(z) = z. Let m(n) = 22h(n) - 4s(n). Let k(y) = -y*3 + 7y*2 - 8y + 9. Let u be k(6). Let c be u/(-1) + 0 + 0 + -8. Give m(c). -6 Let p(u) = -u*3 - 3u*2 - 2u. Let o be (-92)/(-1)(-2)/(-4). Let d = o - 48. Calculate p(d). 0 Suppose -8 = -3o + 6o - 2x, 20 = -3o + 5x. Let j(p) = -p - 24 - 7 + 0p + 34. Calculate j(o). 3 Let b(y) be the second derivative of y5/10 - y4/12 + y3/6 - 3y*2/2 - 26y - 2. Give b(2). 11 Let p = -328 - -324. Let h(z) = z*3 + 7z*2 + 9z + 1. Determine h(p). 13 Let c = -67 + 97. Let q be (16/24)/(2/c). Let l be (-22)/4 + (-5)/q. Let b(p) = p*3 + 8p*2 + 10p + 6. What is b(l)? 18 Let q(r) = 0r + r3 + 5503 - 5498 - 5r*2 - 4r. Determine q(5). -15 Let o(t) = 10t + 13. Suppose 6 = -4f + w, -799w + 801w = -5f - 14. Determine o(f). -7 Let o(z) = 2z*3 - 5z*2 + 3z + 2. Let d be o(2). Let k(h) = 5h - 6h*2 + 4h*2 - dh - 2 + h2. What is k(5)? -22 Let f(l) = -l3 + 17l2 - 28l - 32. Let j be f(15). Let h(d) = 4 - 4d + 2d - 3 + 1 - 3d2. What is h(j)? -6 Let r be 127 - (0 + (1 - 2)). Suppose 5a + 2j + 170 = 0, -3a + 0j = -4j + r. Let i be 9/a + 34/8. Let d(o) = o*2 - 3o - 5. Give d(i). -1 Let n(p) = -111p - 2 + 112p - 1. What is n(8)? 5 Let f(r) = r*2 - 3r - 8. Let a be f(7). Let n(q) = -13q - 18q + aq. Calculate n(2). -22 Let b(i) = -6i*2 - 3i - 2. Let x be (-6)/27 + (-43)/9. Let m be -2(5/6)/x-6. What is b(m)? -20 Let d(j) = j*3 + 6j*2 - 2j - 9. Let z be d(-6). Let m(a) = -6 - 4a2 - 3a + 5az - 9a*3 + 5a*3. Let g(h) = 3h - 7. Let y be g(4). Calculate m(y). 4 Let n(a) = 6a + 6 + 2a - 3a + 2a. Determine n(-5). -29 Let g(t) = -3t2 + 9. Let x(m) = m2 - 7m - 6. Let f be x(7). Let c be (-24)/f + 1-1. Let i(r) = -r2 + 3. Let q(a) = cg(a) - 8i(a). Calculate q(-3). -6 Let l(z) = -z2 - z - 6z - 2 + 3z. Suppose 18r + 9 = -45. Calculate l(r). 1 Let x be 2/(2/(-12)-4). Let m(n) = n - 3n + 6n2 + n3 + n + 5 + xn. Calculate m(-6). -7 Let x(s) = 3s2 - 8s + 4. Let o be ((-2)/4)/((-1)/(-10)). Let l(u) = -58u2 + 6u + 53u2 - 4 - 2 + 6u. Let g(n) = ol(n) - 8x(n). Determine g(-4). -2 Let k(q) = 11q3 - 27q*2 - 19q - 20. Let x(d) = 5d3 - 13d*2 - 9d - 10. Let p(a) = -6k(a) + 13x(a). Determine p(-7). 11 Let p be (-46)/(-14) - (1 - (-15)/(-21)). Suppose 5 = px - 1. Let a(d) = 5d*2 + 4 - 3 - 2d*2. Determine a(x). 13 Suppose 6b = 42 - 12. Let k(r) = -5r2 - 4. Let j(f) = 11f*2 + f + 8. Let g(h) = 4j(h) + 9k(h). Give g(b). -9 Let z(c) = 2c - 4c2 - c2 + 1 - 4c. Let j(k) be the third derivative of -k*5/60 + 5k*4/24 + 7k*3/6 - 17k*2. Let p be j(6). Give z(p). -6 Suppose -6i - 3i + 36 = 0. Let l = -5 - -8. Suppose -iu + 5u = -l. Let j(f) = -3f - 4. Calculate j(u). 5 Let r(u) = u*3 - 4u*2 + u. Suppose 0 = 3a - 5a + 6. Let g be r(a). Let s(p) = p3 + 5p*2 - 6p - 1. Give s(g). -1 Let g(a) be the third derivative of a4/24 + a3/3 + 47a2. What is g(-6)? -4 Let s(m) = 9m*2 - 268m*3 + 141m*3 - 5 + m + 126m3. What is s(9)? 4 Let g(u) be the second derivative of u5/20 - 7u4/12 - 5u*2/2 + u - 34. Calculate g(7). -5 Let r(t) = -5t + 3. Suppose 2j - 22 = 5o + 14, 3j = 9. Determine r(o). 33 Let z = 589 + -585. Let i(p) = 3 + 4 - 2 + 2p. Give i(z). 13 Let o(c) be the second derivative of -c*4/12 - 5c*3/6 + 4c*2 + 10c. Let p be 1(-33)/(-6)-2. Let b = -17 - p. Calculate o(b). 2 Let p(i) = i - 1. Let r(g) = -g + 1. Let y be r(1). Let u be (12/10)/(87/290). Suppose -2t - u - 2 = y. Calculate p(t). -4 Let b(i) be the first derivative of -2i*2 + 2. Suppose 4f + 3 + 5 = 0. Let q be (10/(-2) - f)/(-3). Determine b(q). -4 Suppose -5u = 56u + 549. Let n(d) = -d*3 - 10d*2 - 11d. Calculate n(u). 18 Let v(k) be the third derivative of -k*6/120 + 13k5/60 - k4/12 + 7k3/6 + 292k*2. Give v(13). -19 Suppose 3b = b + 56. Let m = 26 - b. Let t(a) = a*2 - 3a - 3. Determine t(m). 7 Let v(a) = -420a - 415a + 834a + 16. Suppose 0t = 2t. Calculate v(t). 16 Let k(n) = -n3 + 3n + 7n2 - 7n*2 - n - 4n2 + 6. Determine k(-4). -2 Let t(w) be the third derivative of -w5/60 + w*4/8 + 2w*3/3 + 39w*2 - 2w. Calculate t(4). 0 Let f(x) = 2x - 336 + 170 - x + 164. Give f(-8). -10 Let w(f) = -3f + 1. Let q(u) = -u*3 - 8u*2 + 10u - 2. Let s be q(1). What is w(s)? 4 Let l(q) = -q*3 + q - 5. Let y = -73 - -69. Let h be 2/(-4)(y - -4)/6. What is l(h)? -5 Let t(q) = 4q - 4. Let j(b) = -b + 1. Let w(a) = -9j(a) - 2t(a). Let y(i) = -i3 + 8i*2 + 8i + 3. Let r be y(9). Let p = r - -11. Determine w(p). 4 Suppose 10p + 194 = 204. Let z(y) = y3 + y - 1. Determine z(p). 1 Let u = -788 - -784. Let k(d) = -d2 - 2d - 5. Calculate k(u). -13 Suppose 0j - 2j = 3z, -4z = j. Suppose q - 2i = 33, -3i - 12 = i. Let r(y) = y + q - 36 + 18. Calculate r(j). 9 Let t(b) = 8b3 + 2b*2 - 2b + 1. Suppose -3d = -32 - 1. Suppose -18 = 2r - 4z, 2z - d = -1. Determine t(r). 9 Let p(v) = 2v2 + 7v + 3. Let s(n) = -n*2 - n + 1. Let g(z) = -p(z) - 3s(z). Let m = -9 - -15. Let i be (-2)/((-8)/m + 1). Give g(i). 6 Let t(z) = 2z - 26. Let c be t(17). Let u(s) = 5s - 6 + 0 + 2s2 + c. Suppose -3o - 3 - 6 = 0. Calculate u(o). 5 Let w(n) = -11n2 + 11n - 4. Let s(z) = 2z2 - 2z + 2. Let c(f) = -5s(f) - w(f). What is c(0)? -6 Let q(r) = -20r*3 - 2r*2 + 2r - 1. Suppose 16 - 34 = -6u. Suppose -2d + 4 = -0d, 2n - 8 = -ud. What is q(n)? -21 Let g(h) = -4h - 1. Let o(s) = 5s3 - 7s*2 + 11s - 18. Let u(i) = -i*3 - i. Let w(y) = -o(y) - 6u(y). Let q be w(-8). Calculate g(q). 23 Let t(r) = 8r3 - r. Let j be (-1)/(-1)(6 - -1). Suppose a - 6 = ja. What is t(a)? -7 Let n(v) = -7v + 47. Let u(o) = -5o + 47. Let l(k) = -4n(k) + 5u(k). Calculate l(-17). -4 Let s(u) be the first derivative of -3u - 1/3u3 + 3u**2 - 24. What is s(4)? 5 Let d(l) be the first derivative of 2 + 1/	{ "pile_set_name": "DM Mathematics" }
o the power of 1/2, to the nearest integer? 1979 What is the third root of 66344 to the nearest integer? 40 What is the cube root of 6040715 to the nearest integer? 182 What is the cube root of 2031384 to the nearest integer? 127 What is the square root of 1180184 to the nearest integer? 1086 What is the fifth root of 1892840 to the nearest integer? 18 What is 76436 to the power of 1/2, to the nearest integer? 276 What is 2684891 to the power of 1/2, to the nearest integer? 1639 What is the cube root of 14207393 to the nearest integer? 242 What is 116082 to the power of 1/9, to the nearest integer? 4 What is 53371 to the power of 1/5, to the nearest integer? 9 What is the third root of 1306437 to the nearest integer? 109 What is 1518466 to the power of 1/2, to the nearest integer? 1232 What is 2178207 to the power of 1/3, to the nearest integer? 130 What is the square root of 4381437 to the nearest integer? 2093 What is 5585843 to the power of 1/3, to the nearest integer? 177 What is 24608 to the power of 1/9, to the nearest integer? 3 What is 449241 to the power of 1/3, to the nearest integer? 77 What is the sixth root of 12108952 to the nearest integer? 15 What is the ninth root of 310231 to the nearest integer? 4 What is the sixth root of 221282 to the nearest integer? 8 What is 212811 to the power of 1/2, to the nearest integer? 461 What is the third root of 2038479 to the nearest integer? 127 What is the third root of 11888246 to the nearest integer? 228 What is the fourth root of 4032416 to the nearest integer? 45 What is 1198248 to the power of 1/2, to the nearest integer? 1095 What is the tenth root of 1528378 to the nearest integer? 4 What is the cube root of 595804 to the nearest integer? 84 What is the square root of 212581 to the nearest integer? 461 What is 871130 to the power of 1/2, to the nearest integer? 933 What is 8290859 to the power of 1/5, to the nearest integer? 24 What is the seventh root of 305176 to the nearest integer? 6 What is 196983 to the power of 1/5, to the nearest integer? 11 What is the cube root of 24124940 to the nearest integer? 289 What is 138404 to the power of 1/4, to the nearest integer? 19 What is 589085 to the power of 1/2, to the nearest integer? 768 What is the cube root of 1872238 to the nearest integer? 123 What is 3394293 to the power of 1/3, to the nearest integer? 150 What is the square root of 246116 to the nearest integer? 496 What is 19586259 to the power of 1/10, to the nearest integer? 5 What is the cube root of 1079472 to the nearest integer? 103 What is the cube root of 11080993 to the nearest integer? 223 What is the ninth root of 25724517 to the nearest integer? 7 What is 9506562 to the power of 1/9, to the nearest integer? 6 What is 282057 to the power of 1/4, to the nearest integer? 23 What is the square root of 440862 to the nearest integer? 664 What is 1497797 to the power of 1/2, to the nearest integer? 1224 What is the third root of 10553027 to the nearest integer? 219 What is 170047 to the power of 1/8, to the nearest integer? 5 What is the seventh root of 208403 to the nearest integer? 6 What is 1072324 to the power of 1/4, to the nearest integer? 32 What is 125586 to the power of 1/2, to the nearest integer? 354 What is the sixth root of 17243843 to the nearest integer? 16 What is 2031442 to the power of 1/2, to the nearest integer? 1425 What is the ninth root of 3816948 to the nearest integer? 5 What is the fifth root of 458968 to the nearest integer? 14 What is 2732757 to the power of 1/8, to the nearest integer? 6 What is the cube root of 236541 to the nearest integer? 62 What is 1974231 to the power of 1/9, to the nearest integer? 5 What is the fourth root of 1613336 to the nearest integer? 36 What is 275498 to the power of 1/6, to the nearest integer? 8 What is the square root of 1014575 to the nearest integer? 1007 What is 4829768 to the power of 1/6, to the nearest integer? 13 What is the ninth root of 2823832 to the nearest integer? 5 What is 482360 to the power of 1/6, to the nearest integer? 9 What is the third root of 458270 to the nearest integer? 77 What is the sixth root of 139791 to the nearest integer? 7 What is the tenth root of 4982307 to the nearest integer? 5 What is the square root of 45523 to the nearest integer? 213 What is the third root of 287863 to the nearest integer? 66 What is 224944 to the power of 1/6, to the nearest integer? 8 What is the eighth root of 4701246 to the nearest integer? 7 What is 7926283 to the power of 1/3, to the nearest integer? 199 What is the ninth root of 2566176 to the nearest integer? 5 What is the third root of 99526 to the nearest integer? 46 What is 3628450 to the power of 1/8, to the nearest integer? 7 What is the third root of 147509 to the nearest integer? 53 What is 111697 to the power of 1/9, to the nearest integer? 4 What is the seventh root of 527551 to the nearest integer? 7 What is the fourth root of 4674298 to the nearest integer? 46 What is the square root of 1467878 to the nearest integer? 1212 What is the fifth root of 10767056 to the nearest integer? 25 What is 140825 to the power of 1/3, to the nearest integer? 52 What is the fourth root of 2868384 to the nearest integer? 41 What is 18671860 to the power of 1/2, to the nearest integer? 4321 What is 1384546 to the power of 1/10, to the nearest integer? 4 What is 1741950 to the power of 1/3, to the nearest integer? 120 What is the square root of 5239 to the nearest integer? 72 What is the third root of 5897978 to the nearest integer? 181 What is 563093 to the power of 1/3, to the nearest integer? 83 What is 10419477 to the power of 1/2, to the nearest integer? 3228 What is 26294564 to the power of 1/9, to the nearest integer? 7 What is 834791 to the power of 1/4, to the nearest integer? 30 What is the third root of 6230848 to the nearest integer? 184 What is the square root of 17596 to the nearest integer? 133 What is the cube root of 2691885 to the nearest integer? 139 What is 662307 to the power of 1/3, to the nearest integer? 87 What is the seventh root of 819766 to the nearest integer? 7 What is 166557 to the power of 1/7, to the nearest integer? 6 What is the third root of 1919454 to the nearest integer? 124 What is 2490114 to the power of 1/9, to the nearest integer? 5 What is 890358 to the power of 1/3, to the nearest integer? 96 What is the third root of 582103 to the nearest integer? 83 What is 9889947 to the power of 1/2, to the nearest integer? 3145 What is 317473 to the power of 1/10, to the nearest integer? 4 What is the third root of 5335663 to the nearest integer? 175 What is 1004360 to the power of 1/7, to the nearest integer? 7 What is the ninth root of 34316713 to the nearest integer? 7 What is 2473088 to the power of 1/7, to the nearest integer? 8 What is 10243832 to the power of 1/2, to the nearest integer? 3201 What is the fifth root of 12740131 to the nearest integer? 26 What is 38713 to the power of 1/5, to the nearest integer? 8 What is 198230 to the power of 1/3, to the nearest integer? 58 What is 4188867 to the power of 1/2, to the nearest integer? 2047 What is the square root of 2704854 to the nearest integer? 1645 What is the cube root of 9439293 to the nearest integer? 211 What is the third root of 45108 to the nearest integer? 36 What is the square root of 1655076 to the nearest integer? 1286 What is the square root of 5477232 to the nearest integer? 2340 What is the square root of 1112349 to the nearest integer? 1055 What is the ninth root of 32463300 to the nearest integer? 7 What is the third root of 143093 to the nearest integer? 52 What is 1185635 to the power of 1/7, to the nearest integer? 7 What is 21824148 to the power of 1/3, to the nearest integer? 279 What is the third root of 5568055 to the nearest integer? 177 What is 19680620 to the power of 1/9, to the nearest integer? 6 What is the tenth root of 305858 to the nearest integer? 4 What is the eighth root of 1191157 to the nearest integer? 6 What is 9535823 to the power of 1/3, to the nearest integer? 212 What is the square root of 34801670 to the nearest integer? 5899 What is 32822 to the power of 1/9, to the nearest integer? 3 What is 1421682 to the power o	{ "pile_set_name": "DM Mathematics" }
bm - 5bt*2 + 3mt2 + 221mt wrt b. 86688b*2mt2 + 1838m Find the third derivative of 3n3o + 3704059n3 - 2n*2o - 2n2 - 2no + 14n - 2044o - 2 wrt n. 18o + 22224354 What is the first derivative of -381580543t + 464677261? -381580543 Find the second derivative of -46q*4 - 5q*3 + 207464q*2 + 1859359q - 72. -552q2 - 30q + 414928 What is the first derivative of 149403153k - 76579007 wrt k? 149403153 Find the third derivative of 6758763a*5z + 3a5 + 5a*2z + 15312a2 + 366az wrt a. 405525780a*2z + 180a2 Find the third derivative of 2t*5 - 21t*4 - 140130t*3 - 14t*2 + 2t + 99000. 120t2 - 504t - 840780 Find the second derivative of -36837181r3 + 37864000r. -221023086r Find the second derivative of -1188465m*3x*3 + 15mx3 - 140973m wrt m. -7130790mx*3 What is the first derivative of -25399279o - 9677516? -25399279 What is the third derivative of 914p4 - 28064p*3 - 89p*2 - 3p - 3143 wrt p? 21936p - 168384 Find the third derivative of -70196f*3k*2 + 109f*3k + 8f2k2 - f2k + 28fk2 - 6f + 30k2 wrt f. -421176k*2 + 654k Find the third derivative of 33147168g5 + 34g*2 - 15g + 1869. 1988830080g2 Find the second derivative of 14628145q*2 - 2475940q + 1 wrt q. 29256290 Find the first derivative of 566ux - 19402u - 38727x - 86 wrt u. 566x - 19402 Find the second derivative of 16662936i*2m*2u*2 + 7i*2m*2u + 4imu2 - 2iu2 - i + 55m*2u*2 - 2mu2 + 13mu wrt i. 33325872m*2u*2 + 14m*2u What is the second derivative of -27877063u2 + 39692u - 77? -55754126 Find the third derivative of 271z6 + 82846z*5 - 2z*3 + 155989592z*2. 32520z*3 + 4970760z*2 - 12 What is the third derivative of -40370855f*5m*3 - 2f*2m*3 + 5f*2m*2 + 11f*2 + 472f + 3m wrt f? -2422251300f*2m*3 What is the second derivative of 27840209u*2 - 15u + 792953? 55680418 Find the third derivative of -8689520d4 - 4d*3 - 780d*2 + 30716d. -208548480d - 24 Differentiate -11951j*3 - 12j*2 - 6842836. -35853j*2 - 24j Find the second derivative of -44d5 - 305636d*3 + 2d*2 + 8673855d wrt d. -880d3 - 1833816d + 4 What is the second derivative of -12875866k2 - 31428643k + 1? -25751732 Find the second derivative of 357381133c2v*2 - 3c*2v - 2728120cv + 25c + v wrt v. 714762266c*2 Find the first derivative of 4370399m + 10124047. 4370399 Find the third derivative of -12350982k3 - 91493k2 - k - 2. -74105892 What is the third derivative of -v6 + 468539v3 + 26v*2 - 19v + 123 wrt v? -120v3 + 2811234 Find the second derivative of 10428714u*4 + 7516u + 79 wrt u. 125144568u2 Find the second derivative of -8721651kv2 - 2kv + 218093k - v*3 - 4v - 2 wrt v. -17443302k - 6v Find the second derivative of 2f2v2 - f2v + 6f*2 - 19315031fv2 - 14fv + 5f + 2v2 - 5v + 5 wrt v. 4f2 - 38630062f + 4 What is the third derivative of 112087849l3 + 67885l*2 + 656 wrt l? 672527094 Find the second derivative of 110372p*2t*2 + 7p*2t - 34p2 + 23pt - 5t*2 + 35428t wrt p. 220744t2 + 14t - 68 Find the first derivative of -as + 30896771a - 910s2 - 150s wrt s. -a - 1820s - 150 What is the third derivative of -51557986x*3 - 4x*2 - 194500x - 5 wrt x? -309347916 What is the second derivative of 152d2u*2w*2 + 202d*2u - 2d2w + 4144dlw2 - 22422lu2w*2 + lw wrt u? 304d2w*2 - 44844lw2 What is the third derivative of 2h*4 + 614118h*3i - 453h2i - 58h2 - 3hi + 9 wrt h? 48h + 3684708i What is the third derivative of -163a*4 + 64175a*3t - 2a2t - 5a2 - 5at - a - 1142t wrt a? -3912a + 385050t Find the third derivative of -3621366j5 - 3964025j*2 wrt j. -217281960j*2 What is the derivative of -495191258h*2 - 267389681 wrt h? -990382516h Find the third derivative of 2470053r3 + 6947749r*2. 14820318 Find the third derivative of -216233606g*3 + 7g*2 + 2984667 wrt g. -1297401636 Find the second derivative of -53670036m*2 - 9m + 722992. -107340072 What is the third derivative of -85h3r - 4037h3t + h*3 - 2h*2rt - 3hrt - 29hr - 2ht + 31h + rt + 764r wrt h? -510r - 24222t + 6 What is the third derivative of -2844530c5 - c4 + 3c3 - 836369c*2 - c - 4 wrt c? -170671800c*2 - 24c + 18 Find the second derivative of -1301j3 + 525j*2 + 738j - 1524. -7806j + 1050 What is the first derivative of -5d*3x*3 + 13432365d*3 + 457dx4 wrt x? -15d*3x*2 + 1828dx3 Find the second derivative of 12528060a*2 + 4773373a wrt a. 25056120 Find the second derivative of -16206059d2t + dt + 2757d + 86t + 2 wrt d. -32412118t What is the second derivative of -166cs*3 - 760cs2 + 76cs + c + 36s*3 - 36754s - 2 wrt s? -996cs - 1520c + 216s What is the first derivative of -3g3 - 16gs + 37193g - 5919204s wrt g? -9g*2 - 16s + 37193 Differentiate 34g3 - 173566g + 131538914 wrt g. 102g2 - 173566 What is the second derivative of 22d*3q*3 - 311274d*3q*2 + 29718338d*3q wrt q? 132d3q - 622548d3 Differentiate -7690006s*4 - 25270331. -30760024s*3 Find the third derivative of 5176ls4 - 3ls3 + 4ls2 - 64660ls - 4l - 2s4 + 55s*3 wrt s. 124224ls - 18l - 48s + 330 Find the second derivative of -62566041g*2 - 45304792g. -125132082 Find the second derivative of 2576s3z + 542s3 - 14s*2 - 634sz - 6s + 14z + 686 wrt s. 15456sz + 3252s - 28 Find the third derivative of -5465f4 + 11502f*3 + 49764139f*2 wrt f. -131160f + 69012 What is the second derivative of -62345940r3 - 3r - 4232895 wrt r? -374075640r Find the third derivative of t4z - 9200204t3z + 15t2z + 74t2 - tz + 46z wrt t. 24tz - 55201224z Find the first derivative of 4o2s + 2o2 - 13195os2 - 6o - 6s2 + 344708s wrt o. 8os + 4o - 13195s*2 - 6 What is the third derivative of 5955254i*3 - 3631058i*2 wrt i? 35731524 Differentiate 28140226u*2 - 7612598. 56280452u What is the third derivative of 137uv*3 - 70uv2 - uv - 3u - 23921v*3 - 14v*2 - 7v wrt v? 822u - 143526 What is the third derivative of -2r*2u*3 - 531365r*2 - 3656970ru3 + ru2 + u2 wrt u? -12r2 - 21941820r What is the second derivative of 115261m3 - 159m*2 - 167093m - 29 wrt m? 691566m - 318 Find the third derivative of 15857957m*5n - 2871m2n + 1408m2 wrt m. 951477420m*2n What is the derivative of 41m2 - 123767m - 16241536? 82m - 123767 What is the second derivative of 3887680f*4 - 14332808f? 46652160f2 Find the third derivative of -125924995c*4 - 30c*2 + 410c + 90 wrt c. -3022199880c What is the first derivative of -1484am2y - 76am + 22ay + 2a + 262m*2y + 53755y + 1 wrt m? -2968amy - 76a + 524my Differentiate 147n*3 + 34307n*2 + 1898888 wrt n. 441n*2 + 68614n Differentiate 2f3 + 28f*2j - 439fj - 20f + 480808j wrt f. 6f2 + 56fj - 439j - 20 Find the third derivative of 1248690227w5 - w2 + 53w + 1919748 wrt w. 74921413620w2 What is the first derivative of -24516782j + 24397389? -24516782 Find the third derivative of 13b3u2 + b3u + 500380b*3 - 144b*2u*2 + 4277b*2u wrt b. 78u2 + 6u + 3002280 Find the first derivative of -244932495p + 153179897 wrt p. -244932495 What is the second derivative of 15246816u*2 - 17002902u? 30493632 What is the derivative of -370628l2 - 181l + 19359923 wrt l? -741256l - 181 Differentiate -630nou - 64no - 102nu + 169n - 18o - 2 wrt o. -630nu - 64n - 18 Find the first derivative of 153k*3r - 4k3 + 477k*2r + 31k2 + 197k - 7 wrt r. 153k3 + 477k*2 What is the second derivative of -10471o*3 + 3169935o + 1 wrt o? -62826o What is the third derivative of 391640t*3 + 8t*2 - 3t - 12429? 2349840 What is the third derivative of 70im*3y - 457im*3 + 6338im2y*2 + im - 696m3y*2 - 46m*2y2 + m2 + y*2 wrt m? 420iy - 2742i - 4176y2 What is the third derivative of 111062365n*4 - 174442397n*2? 2665496760n What is the first derivative o	{ "pile_set_name": "DM Mathematics" }
l (d) 0.3 d Let t = -0.5 - -0.1. Let l = -32 - -32.4. Let p = -156/7 + 155/7. Which is the closest to p? (a) 0 (b) t (c) l a Suppose -5h - 4c = 25, -5h + 5c + 14 + 6 = 0. What is the closest to h in -0.1, -2/5, 78? -2/5 Let t be 10/(-160)-8(-36 - -36). Let r = -1 - -2. Suppose 45 = -5i - 5a, -2a = 4i + 25 + r. What is the closest to t in -5, -1.5, i? -1.5 Let f = -17009/51045 + -2/17015. What is the nearest to 0.1 in f, 1413, -5? f Suppose 5f + 5 = -0. Let i = -11629 + 11629. Let z = 2 + -12. What is the closest to i in -3, z, f? f Let t = 3.473 + -4.463. What is the closest to t in -0.5, -5, -0.3? -0.5 Let z = 4185 - 4177. What is the closest to z in -0.2, 0.5, -46, -3? 0.5 Let b = 324 - 304.4. Let d = b - 16.6. Let j = -2.9 - -2.5. What is the closest to j in 4, d, -3? -3 Let v = 20855/3 - 145997/21. Suppose -y - 5q = -2q + 11, 0 = -2y + q - 1. Which is the closest to y? (a) -4 (b) -1 (c) v b Let q = -4.416 + 6.416. Which is the closest to -1/3? (a) -0.1 (b) 0.4 (c) q (d) -6/13 d Let l = -17.43 - -0.43. Let q = 9673/24 - 3225/8. What is the closest to -0.3 in l, 0.1, q? q Let r = -591/10 + 198/5. Let b = r + 19. Let i = 7 - 2. What is the nearest to b in 8, 1/2, i? 1/2 Let s = -6 + 6. Let u = s - 0. Let i(c) = c*3 - 26c*2 - 51c - 137. Let b be i(28). What is the closest to u in 5, 1/6, b? 1/6 Let c = 2846 + -2846. Suppose 5p + 11 + 25 = 4s, -p = -5s + 24. What is the closest to c in 0, p, 8? 0 Let y = -68358 + 68363. Let t = -0.2 + 0.2. Which is the nearest to -2/3? (a) y (b) t (c) -5 (d) 3 b Let w = 42.1 + -42. Let m = -27 - -27.19. Let v = -1.38 - -0.88. Which is the nearest to w? (a) -1 (b) m (c) v b Let h = -112 - -112.5. Let l = 6475.003 - 6472. Let k = l + -0.003. Which is the closest to 0.04? (a) h (b) k (c) 5 a Let z = -12092 + 12096. Which is the nearest to 19/11? (a) z (b) 1 (c) -3 b Let z = 1587 + -1585. What is the closest to 4/7 in 0.2, -0.1, z, -1/2? 0.2 Let p be 137/(-14) - -7 - (-28)/98. Which is the nearest to -4? (a) -0.4 (b) 0.068 (c) p c Suppose 119l - 928 = 44l - 41l. Suppose 0 = -q - 4q + 5. Which is the closest to 10? (a) l (b) -3 (c) q a Let m = 61816/133 - 5552/19. Let q = 172 - m. Let n = -14.7 - -15. Which is the closest to -6? (a) q (b) n (c) 4 a Suppose -3d - 2n = -0n - 1614, 2n = 2d - 1086. Suppose 0s + 4s + d = 0. Let k be 15/s(-2)/1. Which is the nearest to -1? (a) 1/5 (b) -0.5 (c) k b Let m = 162.3 - 162.4. Which is the nearest to m? (a) -14 (b) -24 (c) 0.5 c Let w = 3.473 + -3.473. What is the nearest to -200 in -5, w, -1/5? -5 Let d = 7.3 + -7. Suppose 39 = -14c + 67. Let s = c - 4/3. What is the closest to s in 7, 0.1, d? d Let y be (28/(-21))/((-10)/(-20)) + (-16)/(-24). What is the nearest to y in 0.14, 4, 2/7? 0.14 Let h = -32936 - -32938. What is the nearest to -3 in 0, 8, 2/5, h? 0 Let h = 0.9713 - 0.5713. What is the nearest to 1.18 in -2, h, 3, 2? h Let x(t) = 121t2 - 24t - 41. Let h be x(-2). What is the closest to 2/7 in 1/4, h, -1/6, 0.3? 0.3 Let k be 3 + 0 + 118 + -1. Let c = k - 1792/15. Let j = c - 26/105. What is the nearest to j in -4, 5, -0.5? -0.5 Let u = 2 - 6. Let n = u + 4.5. Let f be (-2982)/497(-2)/12. Which is the closest to -1/3? (a) f (b) n (c) 4 b Let y = -653.73 + 653.5. Suppose 2s - 4o = 6s - 12, s = -4o + 12. Which is the closest to -2/7? (a) y (b) s (c) 1 a Let h = 33.87 + -34. Let q = h - -0.23. Let v = -172 + 169. Which is the nearest to q? (a) 0.1 (b) v (c) 3 a Let o(r) = -r2 - 111r - 224. Let n be o(-2). Which is the closest to n? (a) -0.272 (b) 1 (c) 0.4 (d) -2 d Let l be 59 + -61 + (-14)/(1/((-3)/18)). What is the closest to l in -3, -2/5, 58? -2/5 Let n(m) = m*2 + 4m + 1. Let x be n(-3). Let k = -1 - x. Let t = -1232.6 + 1232.7. Which is the nearest to k? (a) -2 (b) -3/7 (c) t c Let k = 26861 + -26859. Let h = 0.2 + 0.2. Which is the nearest to -3/5? (a) h (b) k (c) 4 a Let b = 0.2 + 0.8. Let j = -290.709 - -299.709. What is the closest to b in 5, -2/5, j? -2/5 Let d = 15885 + -15881. Which is the nearest to 1? (a) 67 (b) 7 (c) d c Let m = -22846 + 22845.8. Let k = 2 + -9. Which is the nearest to m? (a) 4 (b) -0.1 (c) k (d) 2 b Let n = -56 + 56.135. Let y = 0.135 - n. Which is the nearest to -1? (a) -0.1 (b) y (c) 2/35 a Let g = -6 - -6.3. Let p = -94001/12 + 46999/6. Which is the closest to 1/2? (a) 1 (b) -4 (c) p (d) g d Let p = -821/9 + 18874/207. Let l = 1 + -2. What is the nearest to p in l, -0.3, 1? -0.3 Let z = 2 - 6. Let s = -1801.5 - -1801.486. Which is the closest to s? (a) z (b) -3 (c) 1/8 c Let m = 32375/9 - 3597. Which is the nearest to -13? (a) 24 (b) -0.1 (c) m b Let z = -3912 + 3902. Which is the closest to 5? (a) z (b) -1/5 (c) -3 b Let r = 1212.3 + -1213. Let w = 29/2 + -15. Which is the closest to 2/7? (a) w (b) r (c) 2 a Let t = -2/167 - -340/501. Suppose -3u = -0h - 2h + 22, 3u - h = -17. Let f be (u/(-57))/((-4)/(-6)). Which is the nearest to f? (a) 1/4 (b) t (c) 1 a Let p be 22/(-30) + 4/10. Suppose z = 4x + 300, 110x = -z + 112x + 304. Let n = -306 + z. What is the closest to n in -2/3, -0.2, p? -0.2 Let o = -173.64 + 173.66. What is the nearest to -0.2 in o, -5, -0.4, -16? -0.4 Let p = -95 + 98. Let u = 2.52 - -1.14. Let h = u + -3.7. What is the nearest to h in -4, p, 2/5? 2/5 Let c = 0.5816 + -0.3816. What is the nearest to 1/4 in c, -2/9, 3/5, 1/11? c Let v = 3862 + -7725/2. Which is the nearest to 2/9? (a) 5 (b) v (c) -0.2 (d) -0.1 d Let i(l) = l3 - l2 - 2l + 3. Let a be i(2). Suppose 0 = 11b + b - 48. Let j be (10 - 4)/(0 - 30/b). What is the nearest to j in a, 0.5, 1? 0.5 Let q = 3.2027 - 1.2027. Which is the nearest to -1/4? (a) 3/2 (b) q (c) -0.03 (d) 1 c Suppose -2g + 3y + 17 = 0, -13 = 2g + 5y - 2y. Let j = -89/2790 - -277/1395. Which is the closest to -6? (a) g (b) -3 (c) j b Let p = 0.042 - -0.058. Let h be (-1272)/11132/8. Which is the nearest to h? (a) 2 (b) 0.032 (c) p b Let k = 14.07 + -14.07. Which is the nearest to -2/9? (a) 2/7 (b) 0.2 (c) k (d) 2 c Let l = 7.969 - 8.469. What is the nearest to 0.4 in 2/87, -4, 0.1, l? 0.1 Let v = 341.355 + 7.645. Which is the nearest to -0.2? (a) 1/3 (b) -0.1 (c) -1 (d) v b Let q = 4300 - 4297. Which is the closest to 2/5? (a) -59/2 (b) 0.4 (c) 4/7 (d) q b Let m = -628.9 + 969.9. What is the nearest to -2 in -0.4, m, -2, 0.5? -2 Let l(h) = 2h - 2 - 1 + 16 + h. Let v be l(-4). Which is the closest to v? (a) -3/4 (b) 1/3 (c) 45 b Let v be ((-1268)/(-126))/((-627)/18). Let r = v - -2/627. Which is the closest to r? (a) -0.2 (b) 15 (c) 2/21 a Let t = -685 - -685.5. What is the closest to -4/13 in 14/5, -0.09, t? -0.09 Let w(f) = 11f2 - 104f - 63. Let g be w(10). What is the nearest to 9.05 in 1/5, -4, g? 1/5 Let d = 8179415/39729 - -5/2337. Let l = d + -206. Which is the nearest to -1/4? (a) 11 (b) -0.2 (c) l b Let q = 18284.1 - 18284. What is the nearest to q in -17, 3/5, -4, 0.1? 0.1 Let i = 3.007 + -0.007. What is the closest to -3 in -1/40, -0.5, i, -4? -4 Let f = 171/22 - 1065/154. Which is the closest to 2? (a) 5/22 (b) 1 (c) 4 (d) f b Let p = -11 - -1. Suppose -282n + 466 = 184. What is the nearest to 0 in n, 5, p? n Let h be 39/(-102) - (2 - ((-88)/16 + 8)). What is the closest to -441 in 1/6, h, -2? -2 Suppose -q = 2q - 2s - 6, -2s = 5q - 26. Let d be (4 - 1)/((-78)/q). Which is the nearest to -1/2? (a) 0.1 (b) d (c) 0 b Let b = 1 + -2.4. Let s = b + -1.6. Let r = -3747.9 - -3748. What is the nearest to r in s, 2, 3? 2 Let k = -4127 + 4122. What is the nearest to -0.2 in -2, k, 0, 3? 0 Let u = -5283.1 - -5283. Let d = -41.9 + 42. Which is the closest to 91? (a) -0.5 (b) u (c) d c Suppose -8 = 11c - 9c. Let i be (-64)/(-30) - (-2 - c). Let m be -1 + 12/18 + 0 - 16/(-3). What is the nearest to 2 in i, m, -3? i Let f = -14435.1 + 14435. Let q = -0.3 + 0.8. Let j = 0.1 - 0.2. Which is the nearest to f? (a) -7/4 (b) j (c) q b Let o = 3 - 4. Let q = 0.1458 + -0.0458. Suppose 4 = -4m, 5m = x + 2x + 4. Which is the nearest to o? (a) -3/2 (b) q (c) x a Let r = 301 + -301. Suppose r = 2k + 4v + 18, 28k + 2v = 30*k - 6. Which is the closest to k? (a) 5 (b) 7 (c) 0 c Let	{ "pile_set_name": "DM Mathematics" }
nteger? -9 Round 168053000 to the nearest 1000000. 168000000 Round 235749.6 to the nearest ten thousand. 240000 Round -37.42889 to 0 decimal places. -37 Round 1674000 to the nearest 100000. 1700000 What is -1124.14 rounded to the nearest one hundred? -1100 What is 68.829391 rounded to zero decimal places? 69 Round -0.0446197 to two decimal places. -0.04 Round -0.0004194423 to 4 dps. -0.0004 What is 11.64337 rounded to 1 decimal place? 11.6 What is 31.946175 rounded to one dp? 31.9 Round 7.58744 to 0 decimal places. 8 Round 483576.8 to the nearest 100000. 500000 What is 21211520 rounded to the nearest 100000? 21200000 What is 0.000002849744 rounded to 7 decimal places? 0.0000028 Round 23533.33 to the nearest one hundred. 23500 What is 4558702 rounded to the nearest one thousand? 4559000 Round -28431.3 to the nearest 1000. -28000 Round -0.00619619 to three dps. -0.006 Round 104768100 to the nearest 1000000. 105000000 What is 0.0306715 rounded to 3 decimal places? 0.031 What is -0.9792039 rounded to three dps? -0.979 Round -5716800 to the nearest one hundred thousand. -5700000 Round -3827489.6 to the nearest one thousand. -3827000 Round -26972.35 to the nearest ten thousand. -30000 What is -0.00352384 rounded to four decimal places? -0.0035 Round -257.8022 to the nearest integer. -258 Round 59311000 to the nearest 100000. 59300000 Round -5807232 to the nearest 100000. -5800000 What is -0.0000053029 rounded to 7 decimal places? -0.0000053 What is -0.0000384946 rounded to 6 dps? -0.000038 Round -13.303 to 0 decimal places. -13 What is 16682.36 rounded to the nearest ten thousand? 20000 What is -11.55566 rounded to zero dps? -12 Round -0.30318405 to 3 decimal places. -0.303 Round -147320930 to the nearest one hundred thousand. -147300000 Round -6.1822749 to 0 decimal places. -6 Round -0.0045529909 to 3 dps. -0.005 Round -0.000000185749 to seven dps. -0.0000002 What is 0.000662865 rounded to four decimal places? 0.0007 What is 19558.22 rounded to the nearest 1000? 20000 What is -0.005618819 rounded to 5 decimal places? -0.00562 Round -29158.98 to the nearest 10. -29160 What is 0.347261 rounded to two decimal places? 0.35 Round 0.00005822488 to 7 dps. 0.0000582 What is 0.000262705 rounded to 4 decimal places? 0.0003 Round -0.03031139 to 3 dps. -0.03 Round -0.007965669 to four dps. -0.008 Round 1608.2046 to the nearest 100. 1600 Round -0.00000116613 to 5 decimal places. 0 Round 1.0871812 to the nearest integer. 1 Round -4328.336 to zero dps. -4328 What is -6488275 rounded to the nearest one hundred thousand? -6500000 Round -83692 to the nearest ten thousand. -80000 What is -0.03206 rounded to two dps? -0.03 Round -30676.8 to the nearest one hundred. -30700 What is -10177.8 rounded to the nearest one thousand? -10000 What is 416341 rounded to the nearest one hundred thousand? 400000 Round -0.0021148073 to five decimal places. -0.00211 What is 7.475677 rounded to 1 decimal place? 7.5 What is 0.065727 rounded to four decimal places? 0.0657 Round 0.7628685 to three dps. 0.763 What is -11116750 rounded to the nearest one hundred thousand? -11100000 What is 0.16474 rounded to two decimal places? 0.16 What is 15162966 rounded to the nearest 100000? 15200000 What is 0.00004552426 rounded to 7 dps? 0.0000455 What is -0.03637124 rounded to two decimal places? -0.04 What is -0.94445 rounded to one decimal place? -0.9 What is -62705600 rounded to the nearest one million? -63000000 Round -0.000713089 to 5 dps. -0.00071 What is -91805.87 rounded to the nearest 10? -91810 Round 0.3559721 to one dp. 0.4 What is -317489000 rounded to the nearest 1000000? -317000000 What is 9909.8 rounded to the nearest ten thousand? 10000 Round 85045700 to the nearest 1000000. 85000000 Round 0.000002349931 to seven dps. 0.0000023 What is -3.3182 rounded to 2 dps? -3.32 Round 151700300 to the nearest 100000. 151700000 Round -845510.7 to the nearest one hundred. -845500 Round -328682 to the nearest one hundred thousand. -300000 What is -0.000009718553 rounded to seven decimal places? -0.0000097 Round -0.0000009685537 to 7 dps. -0.000001 Round 125.9089 to the nearest integer. 126 Round -1.162683 to one decimal place. -1.2 What is -52617910 rounded to the nearest one million? -53000000 What is 310451.4 rounded to the nearest one thousand? 310000 Round 4194.216 to the nearest integer. 4194 What is 0.0051306858 rounded to 4 dps? 0.0051 What is 5411.17 rounded to the nearest ten? 5410 What is 1.76258 rounded to one decimal place? 1.8 What is -10.81252 rounded to 1 decimal place? -10.8 What is -51117.77 rounded to the nearest 10000? -50000 Round -2285346 to the nearest one thousand. -2285000 What is 1.299009 rounded to two decimal places? 1.3 What is 203.359 rounded to the nearest ten? 200 What is -926.173 rounded to the nearest 10? -930 What is 91843.4 rounded to the nearest one thousand? 92000 What is -0.002571184 rounded to 6 dps? -0.002571 Round 0.000005179163 to 6 dps. 0.000005 What is -0.002911586 rounded to 4 dps? -0.0029 Round 0.0000221621 to 7 dps. 0.0000222 Round 0.00003077399 to 6 decimal places. 0.000031 What is -0.002097063 rounded to six decimal places? -0.002097 What is 0.36336 rounded to zero decimal places? 0 What is 2897.4211 rounded to the nearest one hundred? 2900 Round -8893.783 to the nearest one hundred. -8900 What is 2047465 rounded to the nearest one thousand? 2047000 What is -106.21465 rounded to the nearest ten? -110 Round -135737.21 to the nearest one thousand. -136000 Round -0.0000120649 to seven dps. -0.0000121 Round -2.14728 to 1 dp. -2.1 Round 201.611 to the nearest 100. 200 What is 0.64697009 rounded to four dps? 0.647 Round 471750 to the nearest 10000. 470000 What is -19169.168 rounded to the nearest 10? -19170 What is 20.19514 rounded to 1 decimal place? 20.2 Round -0.00000610301 to six dps. -0.000006 Round -0.00004653588 to 7 decimal places. -0.0000465 Round -9104470 to the nearest 10000. -9100000 Round 64522 to the nearest ten thousand. 60000 Round 0.010323826 to six decimal places. 0.010324 What is 3.96198 rounded to 0 decimal places? 4 What is -0.000000436063 rounded to 7 decimal places? -0.0000004 What is -0.000056954 rounded to 6 dps? -0.000057 What is -0.0000012038 rounded to 6 decimal places? -0.000001 Round -0.0000496258 to 5 decimal places. -0.00005 Round -1351115000 to the nearest one million. -1351000000 What is 48.3498 rounded to the nearest 10? 50 Round -4835.751 to the nearest 1000. -5000 What is -38599320 rounded to the nearest 100000? -38600000 What is 0.52876 rounded to 1 decimal place? 0.5 Round 159858 to the nearest ten thousand. 160000 Round -183560 to the nearest one hundred thousand. -200000 What is -3253.677 rounded to the nearest integer? -3254 What is -0.002457 rounded to five decimal places? -0.00246 Round -0.0570883 to 3 decimal places. -0.057 What is 0.000000511935 rounded to 7 dps? 0.0000005 Round -0.0000217487 to 6 dps. -0.000022 What is -171722200 rounded to the nearest 1000000? -172000000 What is -0.02186359 rounded to 2 dps? -0.02 What is 0.0532011 rounded to four dps? 0.0532 What is 0.70626 rounded to three dps? 0.706 Round 709421.3 to the nearest 1000. 709000 What is -14941.32 rounded to the nearest 1000? -15000 What is -15.9734 rounded to the nearest integer? -16 Round -0.051857 to 3 dps. -0.052 What is 141851470 rounded to the nearest 100000? 141900000 What is -217.903 rounded to 0 dps? -218 What is -2218966 rounded to the nearest 100000? -2200000 What is -0.00002293713 rounded to five dps? -0.00002 What is -24.31142 rounded to 1 decimal place? -24.3 What is 0.0001023265 rounded to 5 decimal places? 0.0001 Round 0.000942467 to 4 decimal places. 0.0009 What is -0.004310909 rounded to 5 decimal places? -0.00431 Round -3246180 to the nearest one hundred thousand. -3200000 Round -154596.46 to the nearest 10000. -150000 What is -0.0008045512 rounded to four decimal places? -0.0008 What is 0.00896809 rounded to 3 dps? 0.009 Round 146456600 to the nearest 1000000. 146000000 Round -0.0617318 to three decimal places. -0.062 What is -6908.71 rounded to the nearest one hundred? -6900 What is 1554607 rounded to the nearest 10000? 1550000 What is 24862800 rounded to the nearest 1000000? 25000000 Round -23.74241 to the nearest one	{ "pile_set_name": "DM Mathematics" }
rder. 2, 0, -3024 Sort 2/7, 0.024, 2/75. 0.024, 2/75, 2/7 Sort 4/7, -0.1, -0.11, 1. -0.11, -0.1, 4/7, 1 Sort 5, -2, -1, -3. -3, -2, -1, 5 Put -19, -3, 5, 3, 1 in decreasing order. 5, 3, 1, -3, -19 Sort -4/41, 0, 1/3. -4/41, 0, 1/3 Sort -0.8, 43/5, -0.04 in increasing order. -0.8, -0.04, 43/5 Put 2/165, 6/31, 1/8 in descending order. 6/31, 1/8, 2/165 Sort -82, 4, 0.3, -0.2 in ascending order. -82, -0.2, 0.3, 4 Put 1, -4, -1, -14 in descending order. 1, -1, -4, -14 Put -2/9, 4/53, 0.5, -0.3, -3 in decreasing order. 0.5, 4/53, -2/9, -0.3, -3 Sort 0, 3/4, 4, 92. 0, 3/4, 4, 92 Put -3, -2, -21, -1, 4 in descending order. 4, -1, -2, -3, -21 Sort 4, 10, -0.93 in descending order. 10, 4, -0.93 Put -3/2, -0.1, -3, 1/4, -225 in descending order. 1/4, -0.1, -3/2, -3, -225 Put 4, 0, -5.3, -1/3 in ascending order. -5.3, -1/3, 0, 4 Put 0.77, 128, 1/10 in descending order. 128, 0.77, 1/10 Sort -151, 3, 5 in ascending order. -151, 3, 5 Sort -8, -4, 1/3, 0.5 in descending order. 0.5, 1/3, -4, -8 Put -1/2, -1, 5 in ascending order. -1, -1/2, 5 Sort 3, -20, -3, 1. -20, -3, 1, 3 Put 3/4, 1/5, 2/5, -68/9 in increasing order. -68/9, 1/5, 2/5, 3/4 Put -1, 4, -8, 5, -2 in descending order. 5, 4, -1, -2, -8 Sort -47, 14, -3, -5. -47, -5, -3, 14 Put -4/9, 0.4, -3/4, 5.9 in increasing order. -3/4, -4/9, 0.4, 5.9 Put 0, 5, 68, 31, -2 in decreasing order. 68, 31, 5, 0, -2 Put 68, 2, -5, 0.3, -17 in decreasing order. 68, 2, 0.3, -5, -17 Put 1, -29, 78 in descending order. 78, 1, -29 Put -15, 79, 2, -2 in ascending order. -15, -2, 2, 79 Put -41, 2, 5 in increasing order. -41, 2, 5 Put -3, 69, 3, 0 in ascending order. -3, 0, 3, 69 Sort -6, -2, -3, 5 in decreasing order. 5, -2, -3, -6 Sort -5, 0, -8/7 in ascending order. -5, -8/7, 0 Sort 7, 53, -5/3, -2/15 in descending order. 53, 7, -2/15, -5/3 Put 0, -4, 201 in decreasing order. 201, 0, -4 Put 1, -5, -4, 5 in decreasing order. 5, 1, -4, -5 Sort 1/8, -4/9, -0.011 in descending order. 1/8, -0.011, -4/9 Put 5, -1, 4, -2, -171 in descending order. 5, 4, -1, -2, -171 Put 2, 8, -5 in descending order. 8, 2, -5 Put -3, -2012, 4, -0.4 in descending order. 4, -0.4, -3, -2012 Sort -3, 5/98, 0.2. -3, 5/98, 0.2 Sort 13, 2, 10 in descending order. 13, 10, 2 Put 4.298, -4, 0.2 in descending order. 4.298, 0.2, -4 Sort 4.8, -4, 2/7, -1, 3 in ascending order. -4, -1, 2/7, 3, 4.8 Sort 8, 2, -5, -2. -5, -2, 2, 8 Put -5, 508, 1 in ascending order. -5, 1, 508 Sort -60, -4, 0, -18, -3. -60, -18, -4, -3, 0 Put -1/10, 1989/4, -2, 0.2 in ascending order. -2, -1/10, 0.2, 1989/4 Sort 0.2, 2/31, -42, -1/2, 4 in decreasing order. 4, 0.2, 2/31, -1/2, -42 Put 10, -2, 226 in descending order. 226, 10, -2 Sort 2, -0.3, -3/7, 51. -3/7, -0.3, 2, 51 Sort 1/6, -0.5, 6/523. -0.5, 6/523, 1/6 Put 1.5, -1, 3, 2 in descending order. 3, 2, 1.5, -1 Sort -6, 7, -11 in descending order. 7, -6, -11 Sort 0.03, -3, 1.1 in decreasing order. 1.1, 0.03, -3 Sort 2, 2/3, -4 in ascending order. -4, 2/3, 2 Sort -1/9, -2/13, 0.5, -1/20 in descending order. 0.5, -1/20, -1/9, -2/13 Put -4, 6, -3, 2 in descending order. 6, 2, -3, -4 Put -4, 4, -1, -93 in decreasing order. 4, -1, -4, -93 Sort 0.08, -1/4, -0.4 in ascending order. -0.4, -1/4, 0.08 Sort 3, 16, 0, -2, 5. -2, 0, 3, 5, 16 Put 11, 1, -3, 0.2, 0 in increasing order. -3, 0, 0.2, 1, 11 Sort 0, 1, 5, 2 in decreasing order. 5, 2, 1, 0 Sort 1, -196, -3 in ascending order. -196, -3, 1 Sort 2, 1760, 3, 5 in descending order. 1760, 5, 3, 2 Put 7/6, 2/331, -2/19 in decreasing order. 7/6, 2/331, -2/19 Put 1, -7, -5, 8, -2 in ascending order. -7, -5, -2, 1, 8 Sort 4, -3, 0, 33, -1 in decreasing order. 33, 4, 0, -1, -3 Put 0, 3, 4, 5 in increasing order. 0, 3, 4, 5 Sort -1/8, -0.1, 5, -5 in descending order. 5, -0.1, -1/8, -5 Put 4, -25/3, -2, 0.1, 1 in descending order. 4, 1, 0.1, -2, -25/3 Sort 140, -1, 2.4 in ascending order. -1, 2.4, 140 Put -2, 5, 4, 1 in descending order. 5, 4, 1, -2 Put -97, -1, 4, 9 in ascending order. -97, -1, 4, 9 Sort -14, -12, 5 in increasing order. -14, -12, 5 Put 0, 0.9, 5, 6/61 in decreasing order. 5, 0.9, 6/61, 0 Sort 0.8, 3, -1.5 in increasing order. -1.5, 0.8, 3 Put -5, 4, 3, -21 in ascending order. -21, -5, 3, 4 Put 2, -2, 0 in decreasing order. 2, 0, -2 Sort 1, -5, 9, -14, 4 in ascending order. -14, -5, 1, 4, 9 Sort -0.2, -0.1, 2/39, 4, 1.2 in descending order. 4, 1.2, 2/39, -0.1, -0.2 Sort -6, 169, -1. -6, -1, 169 Sort 8, 5, -1, 0, 58 in descending order. 58, 8, 5, 0, -1 Sort 6, -1, -2/7, -0.1. -1, -2/7, -0.1, 6 Sort -5, 5, 521 in ascending order. -5, 5, 521 Sort -0.4, -0.02, -1, -0.08, 1 in decreasing order. 1, -0.02, -0.08, -0.4, -1 Sort -1/6, -33, -2/19, 1/5 in descending order. 1/5, -2/19, -1/6, -33 Sort -2, 5, -0.4, 54, -0.2 in increasing order. -2, -0.4, -0.2, 5, 54 Put 0, 0.8, -0.5, -3 in decreasing order. 0.8, 0, -0.5, -3 Put -1, 21, 2 in descending order. 21, 2, -1 Put -27/5, 2, 35, -0.4 in decreasing order. 35, 2, -0.4, -27/5 Put -3/7, -2, -31, 0.2 in increasing order. -31, -2, -3/7, 0.2 Put 14, -2, -14 in descending order. 14, -2, -14 Put 0.4, 2, 2/69, -1 in descending order. 2, 0.4, 2/69, -1 Sort -13, -4, -269 in ascending order. -269, -13, -4 Sort 2/7, -125/2, 5. -125/2, 2/7, 5 Sort -2, 3, -73, -3, -5 in increasing order. -73, -5, -3, -2, 3 Sort -1/7, 53, 3/7, -2/17, 0 in ascending order. -1/7, -2/17, 0, 3/7, 53 Sort 3/2, -0.05, -2/7, -2/5, 3. -2/5, -2/7, -0.05, 3/2, 3 Sort 1/2, 0.3, -7/13, -0.5 in ascending order. -7/13, -0.5, 0.3, 1/2 Sort 0.3, -30, 0, 1/4 in descending order. 0.3, 1/4, 0, -30 Put -42, 4.5, -5, -0.3 in decreasing order. 4.5, -0.3, -5, -42 Put -7, 1, -1, -3 in descending order. 1, -1, -3, -7 Put 33, 0, -1/3 in decreasing order. 33, 0, -1/3 Put 9, -2, 37, -4 in decreasing order. 37, 9, -2, -4 Put -4, -23, 0, -8 in decreasing order. 0, -4, -8, -23 Sort -1/2, -3, -1 in decreasing order. -1/2, -1, -3 Sort -0.9, -1, -7/43 in decreasing order. -7/43, -0.9, -1 Put -1, -76, 6, 0 in decreasing order. 6, 0, -1, -76 Sort 0.05, 0.73, 5, -0.5, -1 in decreasing order. 5, 0.73, 0.05, -0.5, -1 Sort 6, -14, 2, -3, -5. -14, -5, -3, 2, 6 Put -1, 3, 5, -4, -158 in ascending order. -158, -4, -1, 3, 5 Put 55, 4, 3 in ascending order. 3, 4, 55 Sort -3, -1, -2, -53, 5 in descending order. 5, -1, -2, -3, -53 Sort -12, 1, -0.4, -1/4 in decreasing order. 1, -1/4, -0.4, -12 Put -4, -2, -912 in descending order. -2, -4, -912 Put -5, -2, 2, -244, 4 in decreasing order. 4, 2, -2, -5, -244 Sort 9, 23, 1, -2. -2, 1, 9, 23 Put 2, -2, 1, -5 in ascending order. -5, -2, 1, 2 Put 4, 2, 10.1, 0.4 in ascending order. 0.4, 2, 4, 10.1 Sort 5, 4, -35 in increasing order. -35, 4, 5 Sort -212, 4/11, -0.3 in descending order. 4/11, -0.3, -212 Sort -1, -2, 3, 4, 563 in decreasing order. 563, 4, 3, -1, -2 Sort 5, -6, -4 in ascending order. -6, -4, 5 Put -41, -0.1, -3 in descending order. -0.1, -3, -41 Put -2/7, 49, 4, -5 in descending order. 49, 4, -2/7, -5 Put -62, 3, -2, -4, -1 in ascending order. -62, -4, -2, -1, 3 Put 9, -6, -5, 3, 1 in ascending order. -6, -5, 1, 3, 9 Sort 4/5, -2, 5/6, 3, -0.13 in decreasing order. 3, 5/6, 4/5, -0.13, -2 Put -2, -9, 12 in increasing order. -9, -2, 12 Sort 5, 39, 6 in ascending order. 5, 6, 39 Sort -2.3, -5, -5/8 in increasing order. -5, -2.3, -5/8 Put 52, -4, 3, 0 in increasing order. -4, 0, 3, 52 Put 2, -5, 6, -1, 17 in descending order. 17, 6, 2, -1, -5 Put 0, -10571, 4 in ascending order. -10571, 0, 4 Sort 5, -0.5, 0.4, -0.05 in ascending order. -0.5, -0.05, 0.4, 5 Sort 3/4, -27, -2/213 in descending order. 3/4, -2/213, -27 Sort 2, -6, -3, 0 in ascending order. -6, -3, 0, 2 Put 5, -3, 0, 2 in decreasing order. 5, 2, 0, -3 Sort 5, -4, -348 in increasing order. -348, -4, 5 Sort -2/13, 2/5, -27 in increasing order. -27, -2/13, 2/5 Sort 4, 3, 1/2 in ascending order. 1/2, 3, 4 Sort 0.07, -1, -1/6, 0.06 in descending order. 0.07, 0.06, -1/6, -1 Put -2, -4, 2/3, 16 in ascending order. -4, -2, 2/3, 16 Put -20, 0.3, -0.1 in decreasing order. 0.3, -0.1, -20 Sort 4, -47, -2 in descending order. 4, -2, -47 Put -1, 2, -7 in decreasing order. 2, -1, -7 Sort -3, -5, -1, -12 in descending order. -1, -3, -5, -12 Put -6, 2, 5, 4 in increasing order. -6, 2, 4, 5 Sort -88, 1, -3 in ascending order. -88, -3, 1 Put 3, -44, -5, 4 in decreasing order. 4, 3, -5, -44 Sort -4/85, 0.4, 4 in increa	{ "pile_set_name": "DM Mathematics" }
= -14p - 28. Let m be d(4). Let o = m + 87. Solve -oz + 0z + 14 = -g, 5g - 25 = -4z for z. 5 Suppose 35n - 27 = 26n. Solve 5l - 5 = -5c, -nc - 5l + 6 = c for c. -1 Suppose 0y + y = 2. Suppose -p - 2j = -5p + 78, -2j + 30 = 2p. Suppose p - 3 = 3w. Solve -wv + 16 = -4q, -5q + 3 = -v + y for q. 1 Let g be (-1)/146 - (-9)/21. Solve 0x - x + 7 = 4q, -q + 3 = g for x. -5 Let j be (-169)/(-39) + 6/9. Solve b - 20 = ji, 2i = 5b - 0b - 31 for i. -3 Let p(c) = -2c*3 + 32c*2 - 6c + 102. Let r be p(16). Solve 18g - z + r = 22g, -4z = -4g + 16 for g. 2 Let s be 132/220 + 2/5. Solve -a - t = s, -5a + 1 = -2t - 1 for a. 0 Let v be (-4 + 2)/(4/(-6)). Solve 0 = o - vb + 7, 3o = -0o - b + 19 for o. 5 Let s(h) = h2 - 2h - 135. Let o be s(13). Suppose 4 = 4d + 3u, -4d - 8 = -3d + 3u. Solve -dx = -5l - ox + 3, 3x = 2l + 8 for l. -1 Suppose 20f + 60 = 18f. Let t be -1(f/3)/5. Solve -l + 2y - 3 = 0, -24 = 4l + ty + 2y for l. -5 Let w = -384 + 393. Solve -w = x - 5j, 2x - 2j = -j - 9 for x. -4 Let r be (-4)/24-1090/50. Solve -m + g = -9, -g - 2 + r = m for m. 5 Let p be 0/(((-6)/(-12))/(2/(-4))). Solve -16 - 4 = 3v - 5c, p = -v + 2c - 8 for v. 0 Let y = 1357 + -1352. Solve -4o + 0 = -5d + 30, 0 = -yo - 4d - 17 for o. -5 Let t = -48 - -43. Let m(s) = s3 + 5s*2 - 2s - 7. Let p be m(t). Solve 5 = -o, pj + j + o = 11 for j. 4 Let c be 2/(0 + 10/175). Let n = c + -31. Suppose -nk - 5 = -3w - 2, 3k + 2w - 2 = 0. Solve 5o - 2q - 3q + 20 = k, -3q = 0 for o. -4 Suppose 3q - 14 = -5. Suppose 0 = qv - 7v + 12. Solve z - 10 = -2f - z, -3 = 3f - vz for f. 2 Let t(f) = -5f - 2. Let q be t(-1). Suppose -qz + 0 = -9. Solve 3x + 8 = 2, zx + 11 = -5j for j. -1 Suppose 561 = -7v + 596. Solve -8 = -3d + 2z, -vd + 3z + 7 = 6z for d. 2 Let n be 2/(8/12) + 16/4. Solve -4w - 2y - 24 = 0, 2w + 12y = ny - 20 for w. -5 Let u be (-147)/12 + 1/4. Let y = -32 - -24. Let o = y - u. Solve og - 3p = 2 - 1, 1 = -2g + 3p for g. 1 Suppose -2y = -3y + 5. Let c be -1 + 3 + -1 + -12 + 0. Let m be (-4)/1 + (-99)/c. Solve q = f - 4f - m, -35 = 5f - yq for f. -3 Let z be (-2 - -1)(1 - -1). Let i be z - (-23 + 1 + 2). Suppose 3j - 6j - 5r = -30, 3j + r = i. Solve -2u = -a - a, 0 = 4u + a + j for u. -1 Suppose -2t - f + 24 = -19, t + f = 23. Let n = t + 4. Suppose 3l - 8 = -l. Solve lx + n = 3i - x, 4i = -5x - 4 for i. 4 Suppose -4 = -0o - 2o. Suppose 4b - 56 = -b - 4r, -ob - 3r + 28 = 0. Suppose 0i = 4i - b. Solve -5 = j + iq, 0 = -j + q + 5 + 5 for j. 5 Suppose -2480 = 12b - 884. Let a = 135 + b. Solve -3r = -ag - 4, 0 = 4r + 2g - 27 + 3 for r. 4 Suppose 0j - 5j + 5 = 0, 0 = 3i - j - 17. Solve i = 2u + y - 3, -20 = -4y for u. 2 Let j(l) = l*2 + 5l. Let q be j(-5). Suppose -38x + 2662 = -27x. Let y = x - 237. Solve 0 = -5d - yw - qw + 40, 2d - 3w + 9 = 0 for d. 3 Suppose p - 2w - 6 = -3w, 4w - 15 = -p. Solve 5j - 13 = -v - 0, 3j - pv = 15 for j. 3 Let m(k) = 90k*2 - 35k*2 - 26k*2 - 28k*2 + 4k + 3. Let f be m(4). Solve -5l - f = -2y, 20 = 4y - 5y - 5l for y. 5 Suppose 3c = -5b + 38, -4b - 3 = -c - 47. Suppose u + b = 5. Let r be 2/u + 12/5. Solve 3i + 12 = -5s, -s - i = -rs - 4 for s. -3 Suppose 0 = 3w + 2g - 116, 3w + 3g - 91 - 29 = 0. Solve 6t = 8t + 2y + 16, -4t = 5y + w for t. -4 Let z be ((-162)/216)/(3/(-20)). Solve m + 7 = 4i, 1 = -3i + i + zm for i. 2 Suppose -8m = -5m + 4m. Solve c - 10 = d - 3, -d + 4c - 13 = m for d. -5 Suppose -3i = i + 128. Let n be (6/8)/((-4)/i). Let d(y) = -y*2 + 6y - 5. Let k be d(5). Solve 8 + n = 3x + 5b, -2x - b = k for x. -2 Suppose 4j + 4 = 4q, -47j + 42j + 2q = -7. Solve 0 = -2n + f - 3, -5n + 2f = -jf + 5 for n. -2 Suppose 2a - 78 = 13d - 14d, 2d + 3a = 153. Let m = 77 - d. Solve u = 5s + 19, -s + 4 = -mu + 27 for s. -3 Let p be (0 + 3)/66. Suppose -7s = -ps - 16. Suppose -sk + 3 = -k. Solve -2h - 9 = k, w + h + 10 = 0 for w. -5 Suppose 2t - 18 = 3c, 0 = -t - 7c + 4c. Suppose -2q = h - 11, 2q - th = -h + 41. Suppose -7 = -3f + q. Solve 2b - v - 2 = 0, 7v = fb + 2v + 5 for b. 3 Let k = -59 + 53. Let d be 21/4 + k/24. Let f(v) = -3v - 3. Let h be f(-4). Solve -q + 6z - z = 9, -dq + h = 2z for q. 1 Let h = 17 - 6. Let y = -5 - -5. Suppose -3w = 2z - h + 2, 4w + z - 12 = y. Solve -2l = -j + 1, 2l + wl = 2j for j. 5 Let h = 5 - -9. Suppose -w + 0w - h = -2p, 5p - 5 = -5w. Solve -2a - 2g - 3 = -p, a = -4g - 5 for a. 3 Let a(y) = 5y + 80. Let i be a(-12). Solve q = -3q - 2t + 8, 5q = -5t + i for q. 0 Let f be (-28 + 3)4/(-10). Let c = -629 - -632. Solve -3v - 2n = 25, -n + f = -0v - cv for v. -5 Suppose -2d + 4a = -5d, -3a = -4d + 25. Let n = 42 + -40. Solve 3p - 12 = nl, dp + 5 = 2p - 3l for p. 2 Suppose 21 = 4y + 5c, y + 0y = 3c + 1. Let w(s) = -s*3 + 4s*2 + 7s - 7. Let k be w(5). Solve 2v - 2d = -kd - 12, 0 = -2d - y for v. -5 Suppose 39j - 48j = -27. Solve 5q = 2y + 30, -2y + 3y + 2q - j = 0 for y. -5 Let n(t) = 4t + 18. Let u(j) = j*2 + 5j. Let i be u(-4). Let c be n(i). Solve h + 8 = cx - x, 5x - 10 = -h for h. -5 Let y(m) = -2m3 - 2m*2 - 9m - 18. Let o be y(-2). Solve -4t = 2x + 18, 3t + 2 = 5x + o for x. -3 Suppose -18 = -c - 5c. Solve -5x + 2i = -2x + 15, 12 = -cx + i for x. -3 Suppose 0 = -3n + 4n + 36. Let m = n - -41. Solve -4 = -2t + 2c, -4c - 25 = 2t - m for t. -2 Let q be (-3)/((-9)/2(-5)/(-30)). Solve -3b + 2f - 3 = 3, qb - 3 = -f for b. 0 Suppose z + 2c = -2 + 7, 2z = c + 10. Solve -4l + 7l = i + z, -2l = 5i + 8 for l. 1 Let v = 144 - 77. Suppose 39 = -4q + v. Solve -4x + 18 = -f, 4x + q = 2f + 27 for x. 4 Let l be (16 - 0)/((-6)/9). Let r be (l - -1)(5 - 7). Suppose a = -4n + 40, 2n - 2a - r + 16 = 0. Solve 7d - 9 = 4d, 5d - n = b for b. 4 Suppose 51u = 52u - 30. Solve -11g - u = 4w - 6g, 0 = w - g + 3 for w. -5 Let o(a) = -a2 - 16a - 6. Let x be o(-15). Suppose x = 2t + t. Solve -tf + 7f = 3b + 26, 2b + 9 = f for b. -2 Suppose 2d = -3d + 35. Suppose 0 = -8b + db. Solve b = a - 4h, 5a = 2a - 4h for a. 0 Suppose 8 = 4s - 2b, -4s + 2b - b + 8 = 0. Solve -sq + 16 = 2u, -u = -3q + 8 + 4 for q. 5 Suppose -4v + 4f + 52 = 0, v + 0f - 9 = -3f. Let g(j) = j*3 + 7j*2 + j + 9. Let n be g(-7). Solve -2s - v = 4q - q, -ns - 4 = q for q. -4 Suppose -13 = m - 0. Let y = 20 + m. Solve -r - z = y, -3r + 4z = -6r - 25 for r. -3 Let x be (4/(-3))/(4/(-6)). Let c(k) = k3 + 4k*2 - 22k - 4. Let w be c(-7). Solve -t - 5b + 28 = wt, -5t + 3b = x for t. 2 Let v be ((-48)/(-9) + (-15)/5)6. Solve f - 5t - 12 = 0, 4t + v = 4f - f for f. 2 Let d = -454 - -459. Solve v = 6v - dq - 10, -10 = -5v - 5q for v. 2 Let w(q) = -2q - 4. Let z be w(-3). Suppose -7 = -4y - 5k - z, -k - 18 = -3y. Let h = y + -2. Solve 4r = -ha - 12, -3a - 3r + 4r = -3 for a. 0 Let f be 3/7 + 7/(-98)6. Solve f = 2w + 2y - 14, 3w - 27 = -2w - 3y for w. 3 Suppose 3h = 5h + 16. Let f = h + 11. Solve 4p = -5r - 15, -f = -2r - 1 for p. -5 Suppose -4p = -77 + 13. Solve -2g + p = -4w, g + w - 1 = 4g for g. -2 Suppose 3c + 12 = -c. Let x be 8/(-6)c/2. Solve 0 = g + 3a, 6g - 4a = xg for g. 0 Let d = -28 + 44. Let l = d + -10. Suppose -4a + la = -2s + 20, a = -3s + 28. Solve -s = 4b + 5j, 0 = b - 2b - 5j - 6 for b. -1 Let j = 1 + 5. Let p(u) = -u*3 + 8u*2 + 8u + 29. Let c be p(9). Suppose m + c = jm. Solve 3f - 3b = f - 18, -3f - mb = -7 for f. -3 Let j be (10/6 + -1)255/34. Solve -5l = 3d + 40, 5d = jl + 4d + 20 for l. -5 Let i = 109 - 224. Let j = i - -115. Solve -5o + 0y - 3y = 20, j = -4y for o. -4 Let v = 1 - 10. Let f be v/12104/(-6). Let h be (-64)/(-10) - 2/5. Solve -h = 2a - c, -f = 2a - a - 3c for a. -1 Let m = 7 - 3. Let j(z) = 7z - 67. Let s be j(10). Suppose -sc + m = -c. Solve -3o + q + 3 - 1 = 0, -co + 4q - 12 = 0 for o. 2 Suppose 3l + y = -18, 3l - 1 = -4y - 28. Let q be l/(20/8) + 2. Let v = 6 + -1. Solve -x - x + u + 2 = q, -vu = -3x + 3 for x. 1 Let j(p) = p2 - 4p - 1. Let z be j(3). Let f = z + 73. Let o be f/21 + (-2)/7. Solve 0 = l +	{ "pile_set_name": "DM Mathematics" }
2g + 4. Let x be b(0). Suppose l + 4y + 13 = -0l, y - 2 = -2l. Suppose xq - l = 9. Is q a multiple of 3? True Let o = -1 - -11. Let f(m) = 5m + 2. Does 13 divide f(o)? True Let n be (-25)/2 - (-3)/6. Let f(b) = -b - 23. Let g be f(n). Let a = 19 + g. Is a a multiple of 8? True Suppose 0 = -l + 2 + 2. Let n be 2/l - (-6)/4. Suppose 0 = -2z - ny + 76, 0z + 70 = 2z - y. Is z a multiple of 12? True Let o(h) = -h*2 + 11h + 5. Let z(y) = -y. Let x(q) = o(q) - 2z(q). Let c be x(13). Suppose -ct - 2r - 5 = -183, -2t = -3r - 56. Is t a multiple of 17? True Let j = -52 - -59. Suppose -jg + 11g - 128 = 0. Does 16 divide g? True Suppose -5o - 70 = -7o. Suppose 0 = 5b - 130 + o. Does 13 divide b? False Suppose 145 = 3u - 2. Suppose 2k = -5z - u, -17 = 4z - 4k + 11. Let g = z - -23. Is g a multiple of 7? True Let w = 767 - 392. Let x = w - 254. Is x a multiple of 17? False Suppose -1320 = x - 6x. Suppose w = 4s - 16 + x, -2w = 5s + 323. Does 22 divide (-2 - 0)/(-2) - s? False Let v(d) = -d3 + 49d*2 - 92d + 26. Does 119 divide v(46)? True Suppose 4a - 18 = -b - a, 2a = 6. Let h(o) = 60o + 10. Is h(b) a multiple of 38? True Let u = -571 - -319. Is ((-3)/6)/(9/u) a multiple of 4? False Let j be (1/12 + 9/(-12))-12. Suppose ju = 5u + 312. Is 13 a factor of u? True Let r(z) = -z*3 - 8z*2 - 7z - 5. Let k be r(-7). Is (k - -1) + 61 + 3 a multiple of 10? True Let a(c) be the first derivative of 13c2/2 - 8. Let g be a(1). Let p = 28 - g. Does 15 divide p? True Suppose -5y + 374 = -2506. Is 24 a factor of y? True Let y(o) = -o*3 - 17o*2 + 26o - 46. Is y(-19) a multiple of 14? True Let m = -320 - -350. Is 6 a factor of m? True Is (-10)/(-25) - 1/((-10)/1616) a multiple of 18? True Let i = -43 - -117. Let l = 79 + i. Is l a multiple of 17? True Let v(j) = -j*3 + 6j*2 - 3j - 6. Let k be v(5). Suppose -ka - 1 + 17 = 0. Suppose -6t + 10 = -t, at = -2b + 22. Does 2 divide b? False Let m = 150 + 255. Suppose -m = -r - 4r. Is r a multiple of 14? False Suppose -8w + 1982 = -2354. Suppose 8c - 98 = w. Is 20 a factor of c? True Let w(v) = -186v - 110. Is 8 a factor of w(-3)? True Let d(k) = -90k - 2. Let o(t) = 178t + 4. Let f(u) = 5d(u) + 3o(u). Is 11 a factor of f(1)? False Suppose 2u - 41 = 5h, -h = u - 4u + 81. Suppose 0 = -5l + g - u, 7l - 3l = -2g - 28. Does 21 divide 53 + (l - -3) + 4? False Let h be 7/(56/(-12)) - (-161)/2. Suppose -g + 317 = 5l, -l + 2g + h = -3g. Is l a multiple of 16? True Let q = 1969 + -1152. Is 43 a factor of q? True Let w(g) be the third derivative of 0g - 5g*2 + 5/12g*5 + 0 - 1/6g*3 + 0g*4. Does 17 divide w(-1)? False Let h be (147/(-14) - -6)/(1/(-2)). Suppose 0 = k + 3s - h, 5k - 26 = 5s - 1. Is 4 a factor of k? False Let j be (-3)/(6/(-4)) + 250. Suppose 6g - j = 2g. Is 9 a factor of g? True Let v(h) = -231h + 117. Is 12 a factor of v(-5)? True Let g(p) = p + p + 0p*2 + 2 + 7p*3 - 3p*2. Is 25 a factor of g(2)? True Let d(u) = -22u - 1. Let p be d(1). Let n = 1 - p. Suppose o - n = -7. Is o a multiple of 17? True Suppose 2q - 118 = -u, -2u + 244 = 4q + 2u. Does 51 divide q? False Let k be 10/10 + 0 + 2. Let b = 1 + k. Suppose h = -2h - br + 154, -3r = h - 48. Is 27 a factor of h? True Suppose 3w + 33 = -3g, 3g - 6g = 12. Let u = w + 3. Does 9 divide 24 + (-6)/8u? True Is 14 a factor of (-9)/27 - (4 - 27020/15)? False Let k be (-13)/((0 - -4) + -3). Let w(c) = -3c - 6. Is 4 a factor of w(k)? False Is 17 a factor of (-2804)/14((-26)/4 - -3)? False Let q = 18 + -6. Let y be (-3)/q - 9/(-4). Suppose -4c + 6b - 2b = -64, 34 = yc - b. Does 9 divide c? True Suppose -g - 5g = -444. Let u = g + -36. Is u a multiple of 38? True Let g(k) = -k + 8. Let o be g(0). Suppose -13 = -5h - o. Suppose 13 = d + v, 4v + h = d - 2. Is 3 a factor of d? False Let m(g) be the second derivative of g4/12 - 11g*2/2 + 5g. Let n be m(-9). Suppose 2i + 3x - 15 = 8x, -n = -3i - 2x. Does 5 divide i? True Suppose -3c + 32 = -2c. Let n = c + -20. Does 6 divide n? True Suppose -3w - 5p + p + 232 = 0, 143 = 2w + 5p. Does 3 divide w? True Suppose -4a + 22 - 90 = 0. Let s = -2 - a. Does 3 divide s? True Let r be (-1 - (2 - 0)) + (12 - 5). Suppose 2y + 128 = ry. Does 16 divide y? True Let n(x) = x*3 + 9x*2 + 5x - 8. Let j be n(-8). Suppose 0 = -2p - 2p + j. Suppose o + 3s = 20 + 9, -3o + ps + 113 = 0. Is 25 a factor of o? False Let l(s) = 136s*2 + s - 2. Let j(a) = 272a*2 + 3a - 5. Let m(c) = -2j(c) + 5l(c). Is 15 a factor of m(1)? True Let p(n) = 11n2 - 8n - 19. Let c(y) = -10y2 + 4y + 9. Let i(f) = -f*2. Let o(b) = -c(b) + 5i(b). Let x(l) = 9o(l) - 4p(l). Does 2 divide x(6)? False Suppose 0 = -5a - 2b + 9, -4 - 5 = -4a - b. Suppose 8u - au = 90. Suppose l - 2n = u, 4l + 2n - 28 = -n. Is 10 a factor of l? True Let t be (-44)/(-10) + (-4)/10. Suppose 0 = -tz + 46 + 98. Is z a multiple of 10? False Let g(d) = -49d + 1. Let c(o) = -48o + 1. Let l(a) = -5c(a) + 4g(a). Let y(t) = 44t - 1. Let h(m) = -3l(m) + 2y(m). Does 15 divide h(-1)? True Let b(r) = r*2 - 8r - 5. Let i be b(9). Suppose 181 = 2c - 3f - i, 4c - 380 = -4f. Is 47 a factor of c? True Suppose 4u = 2c + 26, 4u - 14 = 3c + 17. Suppose 0 = 3a - 15 + 6. Suppose 3b - 33 = -aq, -uq + 29 = 3b + q. Does 3 divide b? False Let p(h) = -h - 1. Suppose -3z - 15 = -3g, 0 = -5z + 5g - 2g - 23. Let b be p(z). Suppose -bi + 2c + 32 = 0, -i + 6c - 3c = 1. Is 4 a factor of i? False Let r(v) = 11v2 - v. Let k be (-2)/(-9) - 18/81. Suppose k = 2p - 0 - 4. Is r(p) a multiple of 21? True Let h = -411 + 771. Is h a multiple of 15? True Let r = -6 + 295. Does 17 divide r? True Let f = 5266 + -3394. Is 48 a factor of f? True Suppose -5n + x = -2462, 5x - 15 + 0 = 0. Is 55 a factor of n? False Suppose -5y + 1976 = -4y. Is 38 a factor of y? True Does 50 divide (226/4)/((-28)/(-168))? False Suppose r + 2q - 1956 = -82, -2r + 3775 = -5q. Is r a multiple of 20? True Suppose 0 = -2t + r - 15, 2t - 5r = -14 - 21. Is 146 - (t - -6)/((-1)/(-3)) a multiple of 13? True Suppose -4b + 7 = -13, 3b - 95 = -5t. Suppose -t + 62 = r. Is 9 a factor of r? False Let x(d) be the first derivative of d3/3 - d2/2 - 26d + 34. Is 13 a factor of x(17)? False Let u be 12/(-12) + (0 - -3). Suppose -18 = 4z + 2, -uz + 35 = 3h. Is h a multiple of 5? True Suppose 66k + 616 = 70k. Is k a multiple of 7? True Suppose 4p - 2p - 127 = 3a, 3a - 97 = -2p. Let x = p - 46. Does 3 divide x? False Let d = -28 + 35. Suppose 0 = dy - 5y - 190. Is 19 a factor of y? True Suppose -1260 = -4t + t - 3i, 0 = 4t - 5i - 1716. Let k = -268 + t. Does 13 divide k? True Let r = 30 + -21. Let x(o) = -3o - o + 2o*2 + 0o*2 + ro + 2. Is 22 a factor of x(-6)? True Let a(x) be the first derivative of x4/4 - x3/3 - x*2 + 2. Let f be a(4). Let q = 8 + f. Is q a multiple of 24? True Let a = -780 - -1380. Is 60 a factor of a? True Let x = -14 - -8. Let q(r) = 3r*2 - 8r - 36. Does 60 divide q(x)? True Suppose -4g + 4 = 5p, p + 0g = g + 8. Let k be 196 + 1/(-2)p. Suppose -4q + k = 30. Is q a multiple of 14? False Suppose 4r - 3j + 2j = 8, 3j + 2 = r. Suppose 0 = -0m - rm. Suppose m = -3v - 135 + 354. Is 21 a factor of v? False Let z = 18 - 14. Is ((2 + 2)/z - -1) + 121 a multiple of 27? False Suppose -6w = -2w + 252. Suppose 2z - 9 = 31. Let m = z - w. Is m a multiple of 15? False Let l be 0 + ((-4)/(-4) - -4). Suppose c - 71 = 5m, 5c - lm - 143 - 132 = 0. Does 7 divide c? False Let j = 4 + -4. Suppose j = 2w + 9 - 79. Is 19 a factor of w? False Suppose c + 1 - 2 = 0, -g + 4c - 2 = 0. Suppose -3b = -2z + gb, -4z + 26 = 3b. Is 2 + z/((-20)/(-56)) a multiple of 8? True Let p be (-4)/(-6)(-60)/(-8). Suppose -4o + po - 92 = -5h, -48 = -3h - 3o. Does 6 divide h? False Suppose 0j + 3j = 12. Let g be (4 - 4)/j + 3. Is 15((3 - 5) + g) a multiple of 3? True Let v(z) = -z*3 + 12z*2 + 28z - 11. Let s be v(14). Let n(b) = 2b2 + 16b + 27. Is n(s) a multiple of 31? True Suppose 0 = 4y - 0m - 5m - 2775, -5m = -3y + 2085. Suppose 4s + 151 = -l + y, s - 161 = 5l. Is 17 a factor of s? True Let q(d) = -d2 + 5d + 8. Let k b	{ "pile_set_name": "DM Mathematics" }
aces. 0.02 Let r = 5271923 - 5271924.5000054. Let d = 4 + -5.5. Let y = r - d. Round y to six decimal places. -0.000005 Let j = 413.467 + -413. What is j rounded to 1 dp? 0.5 Let r(v) = -44463v3 + 3v*2 - 3v - 7. Let b be r(-5). Let w = -2914579 + b. Suppose -5l - 22856621 = w. Round l to the nearest 1000000. -5000000 Let o = 8671 + 40059. What is o rounded to the nearest one thousand? 49000 Suppose 2n = -2k, k - 5k + 7 = -3n. Let f be -42202857/6 - k. What is f rounded to the nearest 100000? -1400000 Let q = 177415748364 + -177415748384.1126799366. Let j = 0.0126928366 + q. Let z = j - -20.1. Round z to 6 dps. 0.000013 Let g be (0 - (-3 + 2))/1. Let c be -150462/9g. Round c to the nearest one thousand. -8000 Let p = 42317.200004 - 42317. Let k = 0.2 - p. What is k rounded to 5 dps? 0 Let w = -68 + 8. Let u be (-15)/w - 86402/8. What is u rounded to the nearest 1000? -11000 Let z be -2-7667182(-4)/(-16). Let f be (-2)/9 - 19022321/(-9). Let v = f - z. Round v to the nearest 100000. -1700000 Let y be (2 - 0)/(4 + 37199996/(-9300000)). What is y rounded to the nearest 100000? 4700000 Let u = -782574339 + 782574448.99999975. Let d = u - 110. Round d to 7 dps. -0.0000003 Let b = 62823186464116 - 62823180390783.6399946. Let s = b - 6073333. Let k = s - -0.64. What is k rounded to six dps? 0.000005 Let p = -2738 + 2852.1. Let d = -107 + p. What is d rounded to 0 dps? 7 Let h = 0.1647932281 + 82.8352184719. Let c = 83 - h. What is c rounded to six decimal places? -0.000012 Let s = 2038.9 - 2298. Let w = s + 125.2. Let z = -141 - w. What is z rounded to the nearest integer? -7 Let v = 128.119 - -0.081. What is v rounded to the nearest integer? 128 Let j = -81.802 - 1.498. Let l = -83.3409 - j. Round l to two decimal places. -0.04 Suppose 5g = -q, -5g - 46 = -4q + 4. Suppose 2d - 5s - 498 = -120, -5s + q = 0. Round d to the nearest ten. 190 Let k(l) = -1496l2 - 3l - 8. Let s be k(-7). Let q = s + 136691. Let a be (10/1)/(2/q). Round a to the nearest 10000. 320000 Suppose y = 3o - 4, -2o - y + 16 = y. Suppose ol = c - 674230 - 825770, 0 = 3l. What is c rounded to the nearest one hundred thousand? 1500000 Let y = 1.17294721 + 6.82704869. Let f = 8 - y. Round f to six decimal places. 0.000004 Let b = 1992 + -1026. What is b rounded to the nearest 100? 1000 Let k = -21 - -51. Let m = 37 - k. Suppose mc = -c + 1928. What is c rounded to the nearest 10? 240 Let r = 86 + 0. Let q = r + -38. Let t = q + -47.79. Round t to one decimal place. 0.2 Let x = 170 + -172.5. Let t = x - -6.9. Round t to one decimal place. 4.4 Let y = 47.04 + -47. Let p = 8.67916 + -8.64. Let r = y - p. Round r to four dps. 0.0008 Let y = 85 - 183. Let z = -17.602739 - 80.398131. Let j = z - y. What is j rounded to four decimal places? -0.0009 Let l = 0.058 + -0.063. Let u = 7.205 + l. Round u to the nearest integer. 7 Let x be 9/6 - (-24)/(-16). Let a be 4 + -8 - (x - 115004). Round a to the nearest 100000. 100000 Let v(z) = -z3 - 10z*2 - 10z - 14. Let k be v(-9). Let b(c) = 34399c3 - 5c*2. Let s be b(k). What is s rounded to the nearest one million? -4000000 Suppose 123 = 6m - 747. Suppose 0 = 15j - 10j + m. Round j to the nearest ten. -30 Let u be 21/12 - 2/(-8). Let h be 22 + u + 10/(-2). Suppose -4y + 3y + h = 0. What is y rounded to the nearest ten? 20 Let s be 4/(-10) - (22/(-5) + 4). Let y(i) = 4i + 59. Let n be y(s). Round n to the nearest 10. 60 Let x = 2730402.580009 + -2730404. Let w = 1.42 + x. What is w rounded to five dps? 0.00001 Let d = -103230 + 103205.6817. Let q = -24.3 - d. Round q to 3 decimal places. 0.018 Let n = -980 + 980.00806. Round n to four dps. 0.0081 Let y = 1.162 - 0.102. Let t = -1 + y. Let h = t + -0.0572. What is h rounded to 3 decimal places? 0.003 Let n be (4 - 0) + 6/3. Suppose 0 = 3q + nh - 5h + 8099995, 0 = -5q + 2h - 13500010. What is q rounded to the nearest one million? -3000000 Suppose 0 = -6b + 7b + 3. Let a be (4812/(-8))/(b/2). What is a rounded to the nearest 10? 400 Let q = 156.7 - 156.4938. Let p = q - 0.21. Let j = p + 0.0038223. What is j rounded to 6 decimal places? 0.000022 Let p = -2320.37 - -2338. Let x = p - -0.37. Let g = 18.000003 - x. What is g rounded to 5 dps? 0 Let g = 577 - 576.99999454. What is g rounded to six dps? 0.000005 Suppose 0 = 176m - 188m - 161520000. What is m rounded to the nearest one hundred thousand? -13500000 Let z = -3117049860089.59999982 + 3117049897719. Let y = -37629.36 + z. Let j = y - 0.04. What is j rounded to seven decimal places? 0.0000002 Let r(i) = 9452i3 - 8i*2 + 7i - 8. Let y be r(-8). What is y rounded to the nearest 1000000? -5000000 Let g = 16996.7 + -16066. Round g to the nearest one hundred. 900 Let d = 28.998334 - 29. Round d to four decimal places. -0.0017 Let h = 0.54 - -29.46. Let k = -34.1 + h. What is k rounded to the nearest integer? -4 Let x = -0.6149 + -311.2851. What is x rounded to the nearest 10? -310 Suppose -g - 772 - 472 = 4y, -5y - 6280 = 5g. What is g rounded to the nearest 100? -1300 Let s be (-1 - -1)1/3. Let j(h) = 50757h + s + 63169h - 2 - 425h. Let x be j(2). What is x rounded to the nearest ten thousand? 230000 Let w = 0.47 + 0.03. Let a = 0.34391 - -0.15573. Let k = a - w. Round k to 4 dps. -0.0004 Let r = 1601.4996 - 1601. What is r rounded to 2 decimal places? 0.5 Let c(w) = -3w + 0w + 11w - 6w + 14 + 18w*2. Let h be c(-6). What is h rounded to the nearest 100? 700 Let z = 12.94 - -39.5. What is z rounded to the nearest integer? 52 Let y = 6 - -13. Let x = 524.55 - 543. Let c = y + x. What is c rounded to one decimal place? 0.6 Let c = 139 - 137.88. Let l = -1.066 + c. What is l rounded to 2 decimal places? 0.05 Let z = 7473.4590003 + -7472.949. Let w = z - 0.51. Round w to 7 decimal places. 0.0000003 Let y = -0.0899 + 0.05851. Round y to 4 decimal places. -0.0314 Let z = 24.8 - 150.8. Let x = 125.99999894 + z. Round x to seven dps. -0.0000011 Let j = 24.87 + -26. Let m = j - -2.35. Round m to 1 dp. 1.2 Let o = -36.363 - -0.063. Round o to zero dps. -36 Let x = 292.877 - 293. Let i = -16.13 + 16. Let v = i - x. Round v to 3 decimal places. -0.007 Suppose -h + 11 = 1. Let d be ((-6)/5)/((-2)/h). Let l be (-82800012)/18 - (-4)/d. Round l to the nearest 1000000. -5000000 Suppose 18y - 134042 = 13y + 4r, 0 = 5y - 5r - 134040. What is y rounded to the nearest one thousand? 27000 Let n(o) = 9o2 + 4o - 5. Let s be n(1). Let g be 41001 + (s - 3 - 6). What is g rounded to the nearest 10000? 40000 Let n = 1352 - 1237.6. Round n to the nearest ten. 110 Suppose 5z - 4y - 46 = -3y, -40 = -5z - 5y. Suppose zg - 50 = 4g. Suppose 1170000 = go - 7o. Round o to the nearest one hundred thousand. 400000 Let l = -66.9 - -70. Let d = l - 5.5. Let r = -2.3974 - d. Round r to three dps. 0.003 Let j = -83846945 - -83846940.7000001. Let z = j - -4.3. What is z rounded to 7 dps? 0.0000001 Let b = -117645112.36729936 - -117644358.01. Let i = b + 758.3573. Let a = 4 - i. Round a to seven dps. -0.0000006 Let i(f) = -5 + 5 - 3 + 7f - 2 - f*2. Let m be i(-7). Round m to the nearest ten. -100 Let t(b) = -54653b*2 - 2b + 8. Let y be t(-12). What is y rounded to the nearest 1000000? -8000000 Suppose 5o - 230385 = u, -230385 = -5o + 7u - 10u. Suppose o - 9477 = -2w. Round w to the nearest 1000. -18000 Let m be (12 - 44114)2 + 4. What is m rounded to the nearest ten thousand? -90000 Let p(q) = -60q3 + 42q*2 - 7q. Let n be p(-24). Round n to the nearest ten thousand. 850000 Let w = -7460.053 + 7423.9. Let a = 36.3 + w. Round a to two dps. 0.15 Let c = 42.123 + -40.1. What is c rounded to one decimal place? 2 Let u(q) = -14q2 + q + 4. Let m be u(7). Let y = 1673 + m. Let t = -408 + y. Round t to the nearest 100. 600 Let i(s) be the first derivative of 1600001s*2/2 - 5s + 3. Suppose 0 = -5w + 4c + 5, 3c - c - 20 = -2w. Let g be i(w). Round g to the nearest 1000000. 8000000 Let d = -20449 - -20449.12417. What is d rounded to three decimal places? 0.124 Let u(r) = -615r2 + 21r + 4. Let i be u(-9). Round i to the nearest 10000. -50000 Let b = -14943 - -14943.000007451. What is b rounded to 7 decimal places? 0.0000075 Let k = 2138 - 1872138. Round k to the nearest 100000. -190000	{ "pile_set_name": "DM Mathematics" }
4. Let u = -0.7 + 4.7. Let r = u + -3. Sort 2, r, h in decreasing order. 2, r, h Let z = -18.2 + 18. Let t = -1.9 + 2. Let x = z + t. Sort -3/2, x, 2/5 in ascending order. -3/2, x, 2/5 Let l be -524/(-8). Put 3, l, -1 in increasing order. -1, 3, l Suppose 0a - 6 = 2y + 2a, -y = -3a + 11. Suppose 3n - 4 = 4n. Let f be n/(-14) + (-32)/14. Sort f, y, -3 in descending order. f, -3, y Suppose 10 = 2i - w - 0w, 0 = -i - 5w - 6. Sort 1, i, -2. -2, 1, i Let s be 4/(-8)(0 + 0). Suppose s = -x - x + 4. Put x, -5, 1 in increasing order. -5, 1, x Let o = -0.04 - -5.04. Let b = 10 - 61/6. Let s = -2 - -1.6. Put s, b, o in decreasing order. o, b, s Let f = -380/9 - -42. Sort -0.3, f, 3/7, 4. -0.3, f, 3/7, 4 Let d = 3.1 + 0.9. Let f = -54 - -21. Let q = 299/9 + f. Put -1, q, d in decreasing order. d, q, -1 Let n(m) = -m*2 - m - 8. Let y be n(0). Let a = 4 + y. Put a, 1, 3 in increasing order. a, 1, 3 Let k = -8 + 4. Let c be ((-2)/14)/(k/(-24)). Put 0.1, c, -2 in decreasing order. 0.1, c, -2 Let v = -1.1 + 4.1. Let w = -3.5 + v. Sort 5, w, -0.2. w, -0.2, 5 Let i be (-2)/7 - (-48)/364. Let w = -0.5 - -0.3. Let n = w + 0.3. Sort -4, i, n in decreasing order. n, i, -4 Let u = -4 - -6. Suppose 2 = d, -2f + 8 = -4f + ud. Let t = -0.3 - -0.5. Sort f, -0.4, t in ascending order. f, -0.4, t Let j(w) = 2w2 + 1. Let z be j(1). Let f = 0 + 2. Sort -4, z, f in decreasing order. z, f, -4 Let i be (28/245)/(4/(-10)). Sort i, -4/13, -4/3, 5 in decreasing order. 5, i, -4/13, -4/3 Let g = 8 + -9.4. Let p = g - 3.6. Sort 0, p, -1. p, -1, 0 Let j be (1 + -1 - -2)5. Let h = 7 - j. Sort -4, h, -2 in descending order. -2, h, -4 Suppose 12 = 3a - 7a. Suppose 5q - 70 = 5s, 3s - 7 + 33 = -q. Let w = s + 6. Put -5, w, a in ascending order. -5, w, a Let r be (-9)/2(-4)/6. Let k be -3 + (-2 + 1 - 0). Let f be (-15)/10 + 6/(-4). Sort f, k, r in ascending order. k, f, r Let i = -276 + 267. Suppose 4r + 1 = -3. Put r, i, -4 in ascending order. i, -4, r Let r = -12 + 6. Let h = r - -1. Let u = 5.1 + h. Put u, -1/4, 1/3 in descending order. 1/3, u, -1/4 Let q(l) = -2l - 8. Let z be q(-6). Let n = z + -3. Put 5, -4, n in increasing order. -4, n, 5 Suppose 6t - 3t - 42 = 0. Suppose 0 = -c + 4o - t, -3o + 5 = -2c - 3. Sort 5, -3, c. -3, c, 5 Let p = -13.4 - -15.4. Put -1, 4, -0.02, p in ascending order. -1, -0.02, p, 4 Let t be (-18 + 2)/41. Sort 1, t, 3 in decreasing order. 3, 1, t Let d = 256 + -1789/7. Sort 0.9, -1/4, d in increasing order. -1/4, d, 0.9 Let a = 23 + -23.5. Put 0, 0.5, -0.9, a in decreasing order. 0.5, 0, a, -0.9 Let i(s) = -s*3 + 2s*2 + 3s - 3. Let a be i(3). Let c(f) = f*2 + f - 3. Let p be c(0). Let y be p - -2 - (-9)/7. Sort -2/3, y, a in decreasing order. y, -2/3, a Let k = 0 + 5. Let l = 5 - k. Suppose 0 = -3c - lc. Sort 0.5, c, 1/4. c, 1/4, 0.5 Let w = -101/4 - -25. Let a = -3 + 3.1. Put a, w, -4 in ascending order. -4, w, a Let t be 4/6 + 5/(-3). Let b(u) = u3 + 6u*2 + 4u - 3. Let h be b(-5). Suppose -4f = l - 5, hf + 15 = 3l - 0f. Sort l, 1, t. t, 1, l Suppose q - 5d - 8 = 0, -6q + q = d + 38. Let j = q + 5. Sort j, -5, 4. -5, j, 4 Let x = -431/174 + -2/87. Sort -15, x, 2. -15, x, 2 Let u(f) = -f*3 + 15f - 1. Let g be u(-4). Suppose k = 2k. Let h(p) = p3 - 5p*2 - 5p - 7. Let j be h(6). Put j, k, g in ascending order. j, k, g Suppose 2 = -63r + 62r. Sort 0, r, -10 in decreasing order. 0, r, -10 Let i = 56 + -58. Sort i, -4, -1, -10 in descending order. -1, i, -4, -10 Suppose 0 = 5c + 31 + 29. Let r(b) = b2 + 11b - 15. Let g be r(c). Put g, -2, -1 in descending order. -1, -2, g Let a = -6.26 + 6.3. Let i = 11 + -11.24. Let f = i + a. Put -0.3, f, -0.5 in ascending order. -0.5, -0.3, f Let s be -6 - (1 + -2) - 2. Let m = s + 8. Suppose -t + m = -0. Put t, -1, -4 in descending order. t, -1, -4 Suppose 14 + 1 = 5v. Let i be ((-10)/(-2))/(-3 + 2). Put -3, v, i in decreasing order. v, -3, i Let u = 0.247 - 0.047. Let v(d) = 7d + 1. Let l be v(-1). Let r = -10 - l. Sort r, 2, u in decreasing order. 2, u, r Let n = 0 - -0.1. Let w = n + -3.1. Let d be 68/(-42) - (8 + (-174)/21). Sort 0.1, d, w in decreasing order. 0.1, d, w Suppose 4 = -2c + c. Suppose 2l + 6 = -v, 3l - 3 + 11 = -v. Sort l, c, 1. c, l, 1 Let t = 3 - 5. Let l = -72 + 71. Sort 1, t, l in decreasing order. 1, l, t Suppose 0 = 3s + 2v + 4, 0v = -4v - 20. Let d(a) = a2 + 6a - 9. Let x be d(-7). Sort x, s, -5 in decreasing order. s, x, -5 Let g(z) = -z + 5. Let r be (40/6)/56. Let y be g(r). Let u be 5/((9/3)/y). Sort 3/4, -0.6, u. u, -0.6, 3/4 Let i(z) = -2z + 2. Let b be i(0). Sort b, -5, 1 in ascending order. -5, 1, b Let w(u) = u + 7. Let h be w(-6). Let z(p) = p*3 - 12p*2 - 13p + 3. Let i be z(13). Sort i, -2, h in increasing order. -2, h, i Let p = 42 - 44. Sort -1, 12, p. p, -1, 12 Suppose 9w - 15 = 4w. Let h be -1 + w + (-48)/28. Let x = -0.7 + 1.2. Put x, h, 0.1 in ascending order. 0.1, h, x Let n be 29/66 - (-9)/(-54). Put 3, -2/3, n in ascending order. -2/3, n, 3 Let b be 115/1. Let h(s) = -3s + s + s. Let j be h(-2). Sort b, 4, j. j, 4, b Let s = -0.01 - 0.04. Let c = -0.15 - s. Put 5, 2/23, c in descending order. 5, 2/23, c Let v(x) = x. Let o be v(-4). Let p = 0.14 - 0.34. Sort 2/9, p, o in increasing order. o, p, 2/9 Let z be -2 - -2 - (1 - 2). Let c = -2 + z. Let j = -11 - -6. Put j, c, 2 in decreasing order. 2, c, j Let a = 6/13 + 1/26. Sort -1/23, a, -5 in increasing order. -5, -1/23, a Let k(q) be the first derivative of q4/4 - 4q*3/3 + 5q*2/2 - 2q + 2. Let a be k(3). Let t = -18 + 21. Put t, 5, a in increasing order. t, a, 5 Suppose -f = 3j - 7j + 46, -5f - 65 = -5j. Suppose 3c + 12 = -2c - 3y, -5c - 4y = j. Sort -7, c, -1 in decreasing order. -1, c, -7 Let z = 2 + -1. Let b be 0 + 9/7 - z. Let p = -11.3 - -11.2. Put b, p, -1 in decreasing order. b, p, -1 Let p(c) = c3 + 2c*2 - 3c - 3. Let f be p(-2). Suppose 0 = -0n + fn. Let l(d) = d*3 - 8d*2 + 6d + 5. Let y be l(7). Sort y, 4, n in decreasing order. 4, n, y Let s be (-15 + 15)(1 + -2). Suppose -q = -sc - 3c + 8, -2c - 3q + 20 = 0. Sort c, 3, -6 in increasing order. -6, 3, c Let w = 0 + -0.5. Let y = -0.05 + 0.25. Sort w, y, 3. w, y, 3 Suppose 1 + 35 = 2c. Suppose -d = o + d + 7, 3d + c = o. Put -2, -4, o in descending order. o, -2, -4 Suppose 3m - 15 = -2m. Suppose m = 2p + 1. Let w = 13 + -13. Put w, -3, p in increasing order. -3, w, p Suppose 19f = 16f + 6. Put 3, f, -9 in increasing order. -9, f, 3 Let k(i) = 5i + 16. Let z be k(-4). Sort z, -2, -1 in decreasing order. -1, -2, z Let i be -2 - ((-1)/(-3) - (-8)/(-3)). Put 0, 2/3, i in descending order. 2/3, i, 0 Let l = -105 - -110.1. Let y = l - 5. Sort y, 1, 0.3 in decreasing order. 1, 0.3, y Let g = -0.05 - 1.95. Let t(d) = 3 + 2 + 11d + 2 + d*3 + 11d*2. Let f be t(-10). Put f, 0.3, g in ascending order. f, g, 0.3 Let d = 0.23 - 0.33. Put 0.3, 2/9, d in ascending order. d, 2/9, 0.3 Let v be (2 + 1)3 + -2. Suppose v = -3c + 16. Suppose -r - c = 2. Sort 0, 3, r. r, 0, 3 Suppose -6j + 18 - 6 = 0. Sort 0.5, 3, -1, j. -1, 0.5, j, 3 Suppose -8m + 4m = u - 7, -2m + 7 = -3u. Sort 3, -10, 5, u in increasing order. -10, u, 3, 5 Let k = -3 - -7. Let y = 4 - k. Put -2, y, -4/3 in increasing order. -2, -4/3, y Let r = -7 + 3. Let x = 64 + -63. Put x, -3, r in decreasing order. x, -3, r Suppose -2q + 5g - 187 = -0g, 4q + g = -363. Let m be 64/78 + 14/q. Sort m, 0, -0.4 in ascending order. -0.4, 0, m Let z = 17 - 21. Put z, 1/5, 2 in descending order. 2, 1/5, z Suppose 63 = 3g + 2b - 5b, -3b = g - 5. Sort g, -4, 4. -4, 4, g Let z be (0 + -2)30/(-20). Sort 1, z, -2 in descending order. z, 1, -2 Suppose -t = t - 2x + 6, 18 = -5t + 2x. Let h be 28/4 + -1 + -1. Suppose 13 = 2c - 3z, -7 = 3c + c + hz. Sort 5, t, c in ascending order. t, c, 5 Suppose 3i - 4i = 0. Suppose -w + 0 + 1 = i. Let x = 11 + -8. Put 5, x, w in descending order. 5, x, w Let r = -8.21 + 0.21. Let m = -12 - r. Let k = -14 + 14. Sort k, m, 1 in decreasing order. 1, k, m Suppose 0 = 9c - 7c + 4. Suppose -2 = -3a + 4. Put c, 0, a in descending order. a, 0, c Let l(x) = 6x - 1. Let t be l(1). Let q be (-2)/6 + (-4)/(-3) + -1. Put t, -5, q in ascending order. -5, q, t Let u =	{ "pile_set_name": "DM Mathematics" }
ose 12v = 24v - s. Let n = 397/6 - 66. What is the third biggest value in -13, n, v? -13 Let c be ((-1)/(((-594)/(-12))/9))/1. Let y = 0 + 5. What is the smallest value in 1, y, c, -0.2? -0.2 Let q = 0.659 - -1.341. What is the second biggest value in -90, q, -17? -17 Let u = 0.438 - -67.562. Let q = 68 - u. What is the third biggest value in q, 5, -35? -35 Let k = 2170 - 2171. What is the third smallest value in k, 4, -73? 4 Let v = 3095 - 15472/5. Let b = 14 + -10. Let d be 1/b + 4/(-16). What is the biggest value in d, 0.3, v, 3? 3 Suppose -10n = 3676 - 3586. Which is the second smallest value? (a) 12/5 (b) n (c) 0.3 c Let w = 332/151 - -112285/1057. Let l = w - 108. Suppose -3 = 2b + b + 5c, -2b - 2 = 4c. What is the third biggest value in l, b, 4? b Let v = 1629 + -1289. Which is the third smallest value? (a) -3 (b) -1/5 (c) -1 (d) v b Let j = -2828 + 2860. What is the second smallest value in -12, 5, j? 5 Let p = 20.8 + -16.5. Let n = p + -3.9. Which is the second smallest value? (a) -0.5 (b) n (c) -4 (d) 0 a Let c(k) = -k3 - 44k*2 + 44k - 50. Let h be c(-45). What is the biggest value in -1.4, -2/7, -3, h? -2/7 Let j = -52/5 - -223/20. Let r = 478 - 1921/4. Let s = -7/4 - r. Which is the third smallest value? (a) -2/39 (b) j (c) s b Suppose 50o + 12513 = 1863. Let l be ((-38)/1995)/((-11)/5 - -2). Which is the third biggest value? (a) o (b) 0.3 (c) l a Let x = 5.5142 - 0.5142. What is the smallest value in x, -0.2, -0.3, -279? -279 Let d = 1008 + -1018. Let q be (2/(-8))/(d/(-48)). Let y = -6 - -10. Which is the second smallest value? (a) q (b) y (c) 2 c Let r = 31/5 + -6. Suppose -63 = 2g - 5g. Let v be 7/g + 1/(-3). Which is the smallest value? (a) 1/4 (b) r (c) 5 (d) v d Let b = -2 - -2. Let v = 17709 + -17711. What is the third smallest value in v, -1/2, b? b Let c = -71/6 + 31/3. Let z = -1.95 + 1.9. What is the biggest value in c, 3/2, z? 3/2 Let z = -50433.9 + 50434. Let t = -1/17 - 11/102. Which is the second smallest value? (a) t (b) 6 (c) z (d) 5 c Let j = -19.48 - -19.58. Which is the biggest value? (a) -0.1 (b) 1/13 (c) j (d) 0.07 c Let n = 10922 + -10880. What is the second biggest value in -26, n, 2/7? 2/7 Let u = 0.07 + 0.93. Let i = -103 + 103.3. What is the fourth biggest value in 0.36, -5, u, i? -5 Let j = 8255 + -8254. Which is the fourth smallest value? (a) 4 (b) j (c) 3 (d) 32 d Suppose -69 = -t + 3. Suppose 0 = -3h - 6h + t. Let r be -1 - 24/h. What is the smallest value in 4, r, 0.3? r Let x = -2914 + 2913. Which is the third biggest value? (a) -0.01 (b) 0.2 (c) -4 (d) -1/10 (e) x d Let j = -103 + 107. Suppose -w + 2w + 5s + 115 = 0, 4w + js + 412 = 0. Let z = 699/7 + w. Which is the smallest value? (a) -2/3 (b) -2/5 (c) z (d) 0.1 a Let t = -2379 + 1683. Let s = 696 + t. Let a be (2/1)/(-6 + -1). What is the fourth smallest value in -2/17, a, s, -2/5? s Let j = 997 - 996.2. Which is the third smallest value? (a) -2/5 (b) j (c) -1/7 b Let k = -21.7 - -26.7. Which is the biggest value? (a) -3 (b) 0.3 (c) -39 (d) k d Let k(j) = 2j2 + 4j + 2. Let h be k(-2). Suppose -h = -3t + t. Let u = -19489 - -19489.3. Which is the biggest value? (a) t (b) -3 (c) u a Let q = 0.2 - 0. Let o = 11.2 + -9.02. Let l = o + 2.82. Which is the third biggest value? (a) q (b) l (c) 4/7 (d) -0.11 a Let r = 0.545 + -13.545. What is the second smallest value in r, -15, 4? r Let w = -5.69 - -14.69. Which is the third biggest value? (a) w (b) 1/11 (c) 0 c Let k = -2.9 + 2.546. Let w = -0.026 + k. Let r = w - -0.08. Which is the third biggest value? (a) 2 (b) r (c) -4 c Let u be ((-93)/(-30) - 2) + 4/10. Let i = -824 + 824.1. Which is the third biggest value? (a) i (b) u (c) 1/6 a Let t be -1(-2)/(-4)-2. Let w be 2 + t - (-8 - -12). Let z = -21.7 - -22. What is the smallest value in w, -5/4, 0, z? -5/4 Let d = -58.1 - -70. Let h = -11.8 + d. Which is the smallest value? (a) -4 (b) h (c) -2 a Let j(k) = -k3 + 19k*2 - 39k + 99. Let o be j(17). Which is the biggest value? (a) 76/7 (b) -3 (c) o (d) -5 c Let s = -159 - -161. Suppose -4k + y = k + 20, 4k = sy - 22. What is the second smallest value in 0, k, 39? 0 Let t be (9 - 15) + (3 - ((-3 - -4) + -3)). Let l = -20 - -20. Which is the second smallest value? (a) -0.3 (b) t (c) -3 (d) l b Let i = 0 + 2. Let v = 3.966841 - -0.033159. Which is the fourth biggest value? (a) -1/2 (b) -4.8 (c) i (d) v b Let m = 11799.9 + -11800. Which is the fourth biggest value? (a) m (b) -3/7 (c) 3 (d) -3 (e) -6 d Suppose -4f - 2h - 472 = 0, 1848h + 564 = -5f + 1852h. Which is the second biggest value? (a) f (b) 3/5 (c) -3 c Let g = 57 + -131.6. Let f = 3.1 + g. Let x = f + 72. Which is the second smallest value? (a) x (b) -3 (c) 3/5 a Let d = -5/238 - -856/3927. Let p be 2/3 + (-280)/528. Let w = p + d. What is the third smallest value in w, -0.4, 4? 4 Suppose 0 = 5t - t. Suppose 0x - 4x = t. Let w = -2.32873 - -2.52873. What is the second smallest value in x, -4, w? x Let x(k) = 2k*3 - 36k*2 - 1293k - 47. Let i be x(36). What is the third smallest value in i, -4/7, 1, 0? 1 Suppose -3s + 344 = 101. Let y = -19521/5 - -133822/35. Let k = y + s. What is the second biggest value in -3/8, k, -0.4, -2? -3/8 Let n(v) = v3 - 12v*2 + 31v + 3. Let r be n(8). Let k = -0.05 + -0.05. Let f = -0.6 - k. Which is the second biggest value? (a) r (b) f (c) -2/5 b Let u be 2/(-7) + ((-2856205)/(-280))/(-11). Let q = u - -928. Let l be (-3)/9 - 1/24. Which is the second biggest value? (a) q (b) l (c) 2/13 (d) -2/15 c Let k be (6/33)/(2/(8/4)). Which is the biggest value? (a) 5 (b) -10 (c) k (d) -33 a Let y = -34725/4 - -8681. Let o = -0.1 + 0.1. Which is the fourth biggest value? (a) 0.2 (b) 0.5 (c) o (d) y d Let v = -59 - -174. Let k = v + -112. Let y = -0.8 + 0.5. Which is the smallest value? (a) k (b) y (c) -6 c Let q = 13.5 + -13. Let f = 127 + -125.92. Let x = -0.92 - f. Which is the third biggest value? (a) -1/2 (b) q (c) -6 (d) x d Let k = -550.9 + 548.9. What is the biggest value in 19/4, k, 1/3, 0.1, -2/15? 19/4 Let k be (2/(-4))/(-11 - (-2329)/204). Which is the fourth biggest value? (a) -2/5 (b) k (c) 2 (d) 1143 b Let q = -1.3 - -3.3. Let x = 1674 + -1674. Which is the third biggest value? (a) q (b) x (c) -1/5 (d) -7 c Suppose 15q - 20q = -2q + 15. What is the third smallest value in 0.017, q, 2/5, -0.5, -10? -0.5 Let q = -8.292 + 12.292. Which is the third smallest value? (a) -1 (b) q (c) -2/5 (d) 2/5 (e) 1/3 e Let r = 9.1 + -9.663. Let o = -0.063 - r. Let q = -5.21 + 0.21. What is the third biggest value in o, 1/4, 4/5, q? 1/4 Let s(u) = -u3 + 119u*2 - 120u - 82. Let h be s(118). Which is the third smallest value? (a) -2/13 (b) 5 (c) h b Let r = 0.34 + 18.26. Let p = r + -18.51. Which is the third biggest value? (a) p (b) 4/3 (c) 1/3 a Let k = 1.6 - 1.1. Let z be 10 + 171(-10)/(-20) + (-1)/2. Which is the second smallest value? (a) k (b) z (c) -5/3 a Let j = -0.56 + -26.44. Let o = 23 + j. Let k = -2.72 - -3.12. Which is the smallest value? (a) o (b) 1/4 (c) k (d) 22 a Let o = 0.779 - -0.221. Suppose 0 = -2f + 2g, -2g - 20 = -f + 3f. Let v = 59 + -53. Which is the second smallest value? (a) f (b) v (c) -4 (d) o c Let u = -0.047 + 0.447. Let n = 80 + -116. Let f = 36.3 + n. What is the second biggest value in u, 0.2, f, -2? f Let a = -12 + 82/7. Let u = 4.14 - 4.54. Let s be (-30)/26 - -1 - 0. What is the smallest value in a, s, u? u Let p = 0.012 - -11.488. Let y = p - 15.5. What is the fourth biggest value in -58, y, 2/11, -5? -58 Let i = 32500.944 + -32235. Let y = -266 + i. What is the second biggest value in 0.2, y, 2/19, -1/2? 2/19 Suppose -65u - 70 + 24 = 604. What is the second smallest value in u, 5/9, -0.5, 2/7? -0.5 Let s = -341.5 + 341.8. What is the fourth biggest value in 3/77, -0.4, -2, s? -2 Let m = 0.5434 - -0.0046. Let j = m - 0.748. What is the third smallest value in 0.2, -3, 7/5, j? 0.2 Suppose 75 - 113 = -19w. What is the second biggest value in w, -10, 1/7, 4? w Let t(o) = o3 - o2 + 39o - 135. Let g be t(3). Which is the fifth biggest value? (a) g (b) 27/5 (c) -0.1 (d) -2 (e)	{ "pile_set_name": "DM Mathematics" }
ime factors of 94059? 3, 7, 1493 List the prime factors of 108380. 2, 5, 5419 What are the prime factors of 468? 2, 3, 13 List the prime factors of 1017. 3, 113 List the prime factors of 2926. 2, 7, 11, 19 What are the prime factors of 6535? 5, 1307 List the prime factors of 11819. 53, 223 List the prime factors of 804. 2, 3, 67 What are the prime factors of 2788? 2, 17, 41 What are the prime factors of 481? 13, 37 What are the prime factors of 7205? 5, 11, 131 What are the prime factors of 1035? 3, 5, 23 List the prime factors of 7207. 7207 What are the prime factors of 12399? 3, 4133 What are the prime factors of 4903? 4903 List the prime factors of 3991. 13, 307 List the prime factors of 2316. 2, 3, 193 What are the prime factors of 767? 13, 59 List the prime factors of 48906. 2, 3, 11, 13, 19 What are the prime factors of 424? 2, 53 What are the prime factors of 8500? 2, 5, 17 List the prime factors of 3993. 3, 11 List the prime factors of 1044. 2, 3, 29 What are the prime factors of 19029? 3, 6343 What are the prime factors of 4741? 11, 431 What are the prime factors of 150086? 2, 101, 743 What are the prime factors of 1840? 2, 5, 23 List the prime factors of 1203. 3, 401 List the prime factors of 51681. 3, 7, 23, 107 What are the prime factors of 1064? 2, 7, 19 What are the prime factors of 18683? 7, 17, 157 What are the prime factors of 39619? 39619 What are the prime factors of 40370? 2, 5, 11, 367 List the prime factors of 2656. 2, 83 What are the prime factors of 8287? 8287 List the prime factors of 1495. 5, 13, 23 What are the prime factors of 16045? 5, 3209 What are the prime factors of 12487? 12487 What are the prime factors of 106291? 106291 What are the prime factors of 1565? 5, 313 What are the prime factors of 686? 2, 7 List the prime factors of 20892. 2, 3, 1741 What are the prime factors of 84300? 2, 3, 5, 281 What are the prime factors of 2107? 7, 43 List the prime factors of 41362. 2, 20681 List the prime factors of 1921. 17, 113 List the prime factors of 7260. 2, 3, 5, 11 List the prime factors of 74878. 2, 29, 1291 List the prime factors of 24582. 2, 3, 17, 241 List the prime factors of 116121. 3, 38707 List the prime factors of 67769. 13, 401 List the prime factors of 2048. 2 List the prime factors of 15107. 15107 What are the prime factors of 534? 2, 3, 89 What are the prime factors of 1955? 5, 17, 23 List the prime factors of 75412. 2, 17, 1109 What are the prime factors of 26473? 23, 1151 List the prime factors of 1383. 3, 461 List the prime factors of 9756. 2, 3, 271 List the prime factors of 13495. 5, 2699 List the prime factors of 27369. 3, 3041 List the prime factors of 871. 13, 67 List the prime factors of 30379. 17, 1787 List the prime factors of 3623. 3623 What are the prime factors of 1279? 1279 List the prime factors of 8160. 2, 3, 5, 17 What are the prime factors of 2128? 2, 7, 19 What are the prime factors of 17462? 2, 8731 What are the prime factors of 751? 751 List the prime factors of 595. 5, 7, 17 What are the prime factors of 1203? 3, 401 What are the prime factors of 13713? 3, 7, 653 What are the prime factors of 6501? 3, 11, 197 What are the prime factors of 77901? 3, 23, 1129 What are the prime factors of 74547? 3, 11, 251 What are the prime factors of 3043? 17, 179 List the prime factors of 1471. 1471 What are the prime factors of 28844? 2, 7211 What are the prime factors of 29106? 2, 3, 7, 11 List the prime factors of 44685. 3, 5, 331 What are the prime factors of 1326? 2, 3, 13, 17 What are the prime factors of 6856? 2, 857 What are the prime factors of 200? 2, 5 List the prime factors of 13695. 3, 5, 11, 83 List the prime factors of 54720. 2, 3, 5, 19 What are the prime factors of 1119? 3, 373 List the prime factors of 2183. 37, 59 List the prime factors of 3271. 3271 List the prime factors of 297. 3, 11 What are the prime factors of 570? 2, 3, 5, 19 List the prime factors of 490. 2, 5, 7 What are the prime factors of 1925? 5, 7, 11 List the prime factors of 709. 709 List the prime factors of 48. 2, 3 What are the prime factors of 3894? 2, 3, 11, 59 What are the prime factors of 339? 3, 113 What are the prime factors of 2557? 2557 List the prime factors of 86. 2, 43 What are the prime factors of 5383? 7, 769 What are the prime factors of 49023? 3, 13, 419 What are the prime factors of 4426? 2, 2213 List the prime factors of 35886. 2, 3, 5981 List the prime factors of 1715. 5, 7 What are the prime factors of 625? 5 What are the prime factors of 7568? 2, 11, 43 What are the prime factors of 274? 2, 137 List the prime factors of 20904. 2, 3, 13, 67 What are the prime factors of 3886? 2, 29, 67 List the prime factors of 29059. 29059 What are the prime factors of 49280? 2, 5, 7, 11 List the prime factors of 27814. 2, 13907 What are the prime factors of 16140? 2, 3, 5, 269 What are the prime factors of 1154? 2, 577 List the prime factors of 1592. 2, 199 What are the prime factors of 35042? 2, 7, 2503 What are the prime factors of 3981? 3, 1327 List the prime factors of 2481. 3, 827 What are the prime factors of 1317? 3, 439 List the prime factors of 34800. 2, 3, 5, 29 What are the prime factors of 5047? 7, 103 What are the prime factors of 50231? 50231 List the prime factors of 549. 3, 61 What are the prime factors of 14831? 14831 List the prime factors of 10973. 10973 What are the prime factors of 141143? 29, 31, 157 What are the prime factors of 34644? 2, 3, 2887 List the prime factors of 1242. 2, 3, 23 What are the prime factors of 107381? 167, 643 List the prime factors of 2079. 3, 7, 11 What are the prime factors of 4051? 4051 List the prime factors of 1037. 17, 61 List the prime factors of 33010. 2, 5, 3301 List the prime factors of 883. 883 What are the prime factors of 14326? 2, 13, 19, 29 List the prime factors of 2127. 3, 709 List the prime factors of 1270. 2, 5, 127 List the prime factors of 3197. 23, 139 What are the prime factors of 2462? 2, 1231 List the prime factors of 9266. 2, 41, 113 What are the prime factors of 10995? 3, 5, 733 List the prime factors of 5253. 3, 17, 103 List the prime factors of 43699. 89, 491 List the prime factors of 4903. 4903 What are the prime factors of 36506? 2, 18253 List the prime factors of 2412. 2, 3, 67 What are the prime factors of 163105? 5, 32621 What are the prime factors of 13505? 5, 37, 73 List the prime factors of 184. 2, 23 What are the prime factors of 3788? 2, 947 List the prime factors of 19346. 2, 17, 569 What are the prime factors of 50468? 2, 11, 31, 37 What are the prime factors of 71745? 3, 5, 4783 List the prime factors of 4154. 2, 31, 67 List the prime factors of 18866. 2, 9433 What are the prime factors of 1954? 2, 977 What are the prime factors of 4146? 2, 3, 691 List the prime factors of 977. 977 List the prime factors of 47672. 2, 59, 101 What are the prime factors of 1722? 2, 3, 7, 41 List the prime factors of 38334. 2, 3, 6389 List the prime factors of 81695. 5, 16339 What are the prime factors of 17515? 5, 31, 113 List the prime factors of 3072. 2, 3 List the prime factors of 4742. 2, 2371 List the prime factors of 70821. 3, 43, 61 List the prime factors of 34574. 2, 59, 293 List the prime factors of 386. 2, 193 List the prime factors of 64753. 13, 17, 293 List the prime factors of 35707. 7, 5101 List the prime factors of 24281. 24281 List the prime factors of 63117. 3, 7013 List the prime factors of 37401. 3, 7, 13, 137 List the prime factors of 23165. 5, 41, 113 What are the prime factors of 1074? 2, 3, 179 List the prime factors of 81793. 263, 311 List the prime factors of 82919. 283, 293 List the prime factors of 601. 601 List the prime factors of 6756. 2, 3, 563 List the prime factors of 21892. 2, 13, 421 What are the prime factors of 373? 373 What are the prime factors of 1228? 2, 307 List the prime factors of 16854. 2, 3, 53 List the prime factors of 12611. 12611 List the prime factors of 6787. 11, 617 List the prime factors of 2659. 2659 What are the prime factors of 1917? 3, 71 List the prime factors of 8690. 2, 5, 11, 79 What are the prime factors of 13022? 2, 17, 383 What are the prime factors of 234? 2, 3, 13 List the prime factors of 46768. 2, 37, 79 List the prime factors of 11108. 2, 2777 What are the prime	{ "pile_set_name": "DM Mathematics" }
- c, z - c + 2 = -0c. Suppose -zh + 2v - 14 = 6v, 4h = 2v + 22. Sort 5, -4, h in decreasing order. 5, h, -4 Let y be (1/2)/(5/(-70)). Sort 0, 3, 5, y in increasing order. y, 0, 3, 5 Suppose 0 = t - 3k + 22, 4k + 24 = 3t - 7t. Let j = t - -5. Let u = 12 - 16. Put j, u, 2 in ascending order. j, u, 2 Let k be (-2)/6 + 2/(-3). Suppose -4i = -3f + 31, 4f = 5 + 15. Let o be (-3)/45 - i/6. Put k, 0.2, o in descending order. o, 0.2, k Let g be (6 - 8/2)/1. Sort 2/5, g, -3/4. -3/4, 2/5, g Let p = -1553/12 - -130. Let d = -1/12 + p. Put 3, -1, d in decreasing order. 3, d, -1 Suppose 4n = 2n + 6. Let i be (31)/((-3)/(-6)). Let q(c) = -c*3 + 7c*2 - 6c. Let v be q(i). Sort 2, v, n in ascending order. v, 2, n Let h be 1/((-34)/(-4) - 4). Put -1/2, 0.3, h in increasing order. -1/2, h, 0.3 Suppose 0 = 7p - 2p + 25. Put 0, p, 1 in ascending order. p, 0, 1 Let i = -0.6 + 0.04. Put -0.2, i, -3 in increasing order. -3, i, -0.2 Suppose 4s - 8 = -3u - 5, 5u + 24 = 3s. Let p(b) = -2b2 + 1. Let m be p(-1). Let j be 7 + m(3 - 1). Put j, s, -1 in descending order. j, s, -1 Let q = -0.2 - 9.8. Let x = q + 11. Sort x, 3/7, 3/4 in decreasing order. x, 3/4, 3/7 Let o = -20 - -10. Let c = o + 7. Sort 0, c, -4 in decreasing order. 0, c, -4 Suppose l = 5d + 29, d - 15 = -0l - 5l. Put -2, -3, l in descending order. l, -2, -3 Suppose 0b - 2b - 2 = 0. Let n be 4/6 + 26/6. Let f be (2/(-3))/((-4)/6). Put b, n, f in increasing order. b, f, n Let l = -0.003 + -5.077. Let y = -0.02 - -0.1. Let x = y + l. Sort x, 3, -0.1 in ascending order. x, -0.1, 3 Let d = 10 + -18. Let g be d((-5)/2)/5. Let m(v) = v*2 + 6v - 1. Let s be m(-6). Put 2, s, g in descending order. g, 2, s Let q be (6/(-12))/((-10)/(-12) + -1). Sort q, 0, -14 in descending order. q, 0, -14 Let f = -0.2 + 0.7. Let r = f + -0.4. Sort r, -2/9, -1. -1, -2/9, r Suppose 3n = 2g - 12, -g - 4 = n - 0g. Suppose f + 3 = -4o + 10, 0 = -o - 3f - 1. Put n, o, 1 in decreasing order. o, 1, n Let j(y) = y2 + 8y - 10. Let a be j(-9). Let n = a + 5. Let d = -0.7 + 1. Put d, n, 1 in increasing order. d, 1, n Let t be ((-4)/2 - -7)1. Sort t, 0, 8. 0, t, 8 Let k(z) = z - 8. Let a be k(10). Let l = 0.1 + -0.1. Let i = 1 - l. Put i, a, 0.4 in decreasing order. a, i, 0.4 Let r be -2 + (2 + 3 - 0). Let f = r - 3. Sort 5, f, 4 in decreasing order. 5, 4, f Let d(z) = z2 - 7z + 6. Let o be d(5). Let i be ((-2)/5)/((-1)/(-5)). Suppose 0 = j - 0j - 1. Sort j, i, o in descending order. j, i, o Let b be (3 + 0)(-13)/156. Sort -0.1, b, 0.03. b, -0.1, 0.03 Let z be (-18)/(-14) - 18/63. Sort z, -1, 6. -1, z, 6 Let d = 12.77 + 0.23. Let t = -17 + d. Sort -0.2, t, -5 in descending order. -0.2, t, -5 Suppose 7g + 3 + 18 = 0. Sort -17, 2, g in increasing order. -17, g, 2 Let v = -3 - -3. Let n = 3 - v. Let j = 4/11 - 1/33. Put n, 4, j in ascending order. j, n, 4 Let h = 2779/9 + -308. Let c = h - 4/9. Suppose 3y = -k + 2k + 8, 0 = -2y + 2. Sort k, 1, c in ascending order. k, c, 1 Let v(s) = -s*3 - 7s*2 + 8s - 4. Let y be v(-8). Sort -2, y, -14. -14, y, -2 Suppose -6 + 4 = -2f. Suppose 3k - 7 = 5. Sort f, k, -3 in descending order. k, f, -3 Suppose 0 = -5k - 38 + 63. Sort 1, k, 6 in ascending order. 1, k, 6 Let i = 15 - 16. Let v be (i + 0)(3 - 5). Let g be (-40)/(-12) - (-2)/(-6). Sort 4, v, g in descending order. 4, g, v Let a = -5.01 + 0.01. Let j = -2 - -4. Put a, j, -3 in increasing order. a, -3, j Let y(k) = k*3 - 5k*2 - 6k + 2. Let a be (24/10)/((-12)/(-30)). Let p be y(a). Sort -4, p, 1 in descending order. p, 1, -4 Let h = 0.6 + -0.1. Let g = 8 - 15. Let c = g + 11. Put 5, h, c in ascending order. h, c, 5 Let i = -0.05 + 0.45. Let p = 4 - -2. Sort p, i, 0 in descending order. p, i, 0 Let f(z) = z*3 - 1 - 2z*2 + 3z*2 - 4 - 3z + 3. Let y be f(-2). Let s(t) = t*3 - 2t*2 + 3t - 2. Let i be s(2). Put -1, i, y in ascending order. -1, y, i Let c be (-1 + -7)(-1 - -2). Let g = 3 + c. Let r be ((-2)/(-18))/(g/(-10)). Put -0.3, r, -4/9 in increasing order. -4/9, -0.3, r Let r = -51 + 54. Sort r, -4, -3, 0. -4, -3, 0, r Suppose -8j + 0j + 104 = 0. Put j, -1, 0.5, -0.3 in ascending order. -1, -0.3, 0.5, j Suppose -q + 18 = -2p, 4q - 4p - 12 = 5q. Suppose 3w + 4v - 125 = 0, -4w = -w - v - 100. Let f be w/(-20) + (-2)/q. Sort -4, 4, f in descending order. 4, f, -4 Let g be (-3)/(-1)11. Suppose -2s + h + g = 0, 19 = -4s - 2h - h. Sort -5, s, 4. -5, s, 4 Let p(u) = -u - 2. Let o be p(-6). Let h be (-2)/(-8)26. Suppose 3l + 4f = 4 + 2, -5l = hf + 1. Put -1, l, o in ascending order. l, -1, o Let u = -0.77 - 0.03. Let m = u + 0.87. Let n = m - -1.93. Sort 4/5, -3, n in decreasing order. n, 4/5, -3 Let k = -18.07 - -2.77. Let v = -16 - k. Let o = -0.4 - v. Sort 3, 2, o in ascending order. o, 2, 3 Let h be (-3 - -4)-3 + -3. Let a be 8/6(-16 + 13). Put h, a, 1 in decreasing order. 1, a, h Let c(j) = 5j*3 + 1. Let b be c(-1). Sort -2, -3, b in decreasing order. -2, -3, b Suppose 2t - 3t - 1 = 0. Suppose 0 = l - 3l + 6. Sort -2, l, t in descending order. l, t, -2 Let m = -52/35 + 9/7. Let q be (83/(-332))/(-1 + 1/8). Sort q, m, 0.3 in ascending order. m, q, 0.3 Suppose 0 = -2n + 3n + 2. Let v = -1 + n. Let i = v + 3. Sort -1, 5, i in descending order. 5, i, -1 Let k(v) = v*2 - 9v + 16. Let c be k(7). Sort -2, -8, c, -1 in descending order. c, -1, -2, -8 Suppose 0 + 20 = -2l. Let r be (6/(-15))/((-2)/l). Let f = 0.37 - -0.03. Put r, -1/3, f in increasing order. r, -1/3, f Let a(f) = f3 - 9f*2 - 9f - 1. Let h be a(10). Let g = 8 - h. Sort g, -2/19, 0. g, -2/19, 0 Let p = 6 + -17. Let j = p + 7. Put -5, j, 4 in increasing order. -5, j, 4 Let d(l) = -l*2 - 5l + 11. Let o be d(-7). Suppose 0 = -f - 2f + 12, -2f + 17 = 3b. Sort b, o, 0. o, 0, b Suppose -8 - 5 = -5g + 4d, 2 = -2g + 4d. Put -13, g, -2 in descending order. g, -2, -13 Let v = 2 + 1. Let t = -17 + 23. Sort v, 0.1, t. 0.1, v, t Suppose 0 = 4h - 3h - 5. Suppose -4q + 24 = 5b, 3b - h = 3q + b. Let f be (-7 - -3)3/6. Put -3, f, q in descending order. q, f, -3 Suppose -9a - 11 + 38 = 0. Let g(n) = -n2 - 10n + 9. Let f be g(-11). Put -3/7, f, a in decreasing order. a, -3/7, f Let u = 1 - 3. Let t be (-1 - u)/(0 + -1). Let m = 0.2 - -0.2. Sort 0.5, t, m in descending order. 0.5, m, t Let p(i) = -i + 4. Let o be p(0). Let s be (-2)/(-6) - (-168)/9. Let j = s + -17. Put j, o, -0.4 in decreasing order. o, j, -0.4 Let b = 3.42 - 3.12. Let y = 3 - 8. Put y, 4, b in increasing order. y, b, 4 Let g(b) = -2b3 - 4b*2 - 3b - 2. Let y be g(-2). Let f = y + 0. Suppose -18 = 3t - 9t. Sort -5, t, f in descending order. f, t, -5 Let p = -6 + 11. Sort 1, -3, p in increasing order. -3, 1, p Suppose 0c = 4c - 12. Suppose 3l + 0l + 15 = 0. Let p = 30 + -32. Sort p, c, l in ascending order. l, p, c Suppose 0 = -h + 4 - 2. Suppose z + 1 = 2z. Let n be -1 + 3/9z. Put h, 4, n in decreasing order. 4, h, n Suppose -x = -4 + 2. Sort -4, x, -5 in decreasing order. x, -4, -5 Let b(s) = s*2 + 3s + 4. Let p be b(-3). Let r be 5(14/(-10) - -1). Let n = r - -4. Sort n, -3, p in increasing order. -3, n, p Let t be (-9)/15 - 0/4. Sort -1, -5, t in decreasing order. t, -1, -5 Let l = 35.98 - 32. Let j = l - -0.02. Suppose 19 = -4f + 5u, f + 7 = -2u + 4u. Put j, f, -2/5 in decreasing order. j, -2/5, f Let j be 8/(-16)(1 - 2). Let w = 5 - 5. Put w, -1, j in decreasing order. j, w, -1 Suppose 2l - 1 = 2u + 5, 0 = l + 2u - 3. Sort -7, 1, l in decreasing order. l, 1, -7 Let u = -10 - -39/4. Suppose 0 - 4 = -4s. Put u, -0.4, s in ascending order. -0.4, u, s Let b = -0.18 + 0.38. Sort -4, b, 2/5 in decreasing order. 2/5, b, -4 Suppose 2v - 3v + 3 = 0. Suppose -16f + 25f - 18 = 0. Sort 0, f, v in ascending order. 0, f, v Let q be 4/(-3) + 76/12 + -5. Put -2, q, 5 in ascending order. -2, q, 5 Let j = -34 - -36. Sort j, -4, -6. -6, -4, j Suppose 4 = 4i, 22 = -2y - 3i - i. Let s = 16 + y. Sort s, 5, -5 in decreasing order. 5, s, -5 Suppose 5u = -0u. Let i(t) = -t3 + t2. Let z be i(1). Let v be -2 - -2 - (z - 4). Put u, -5, v in decreasing order. v, u, -5 Let x(r) = r3 + 5r*2 + 4r + 5. Let l be x(-4). Let w be 88/660 - 32/15. Sort -5, w, l in ascending order. -5, w, l Suppose x - 5*a - 3	{ "pile_set_name": "DM Mathematics" }
69/6930) Simplify ((aa1)/a)(-2/49)aa9a*(-9)(aa(1/3)aa/(a/(a/(aa*(-1))a))a)/(a1)(4/11) assuming a is positive. a(9587/1617) Simplify (b0)14/(bb*(-2/9)b*(-2/5)b)((b/b(-1/2))(2/83))(1/28) assuming b is positive. b(-143953/104580) Simplify ((ff/(f*(2/5)/f)ff(-3)f)/((ff(-5/6))/(ff/(ff(f/((f(f/(f(-8/5)f))/f)/f)f)/ff))))2 assuming f is positive. f(1/15) Simplify (g*(-5/7)/gg(3/2))(3/5)/((g*(2/19)gg(-1))/((g/g(-2/3))/g)(-16)) assuming g is positive. g(-43493/3990) Simplify (g(-1/4)/(g(-6/5)g))/(gg(-1/4)(gg9/g)/g)((gg/g(-1/6))(-2/45))(-11) assuming g is positive. g(-209/27) Simplify (((gg*(-18)(g*(-3)/gg)/gg)31)(-5))(1/17) assuming g is positive. g(3100/17) Simplify ((l/(l/l(-7)))/((((l(l/l*(-3)ll)/l)/l)/ll)/l))/(l0/l)(-3/4)(l10l*(-1/5)l)27 assuming l is positive. l(5597/20) Simplify ((i/i*(-3/4)i)(-16)/(i(-4)(ii(-1/2))/i))(-9/4) assuming i is positive. i*(711/8) Simplify ((c/(cc(cc/(cc(2/7)))/ccc))(1/6))(9/7)/((ccc(-2/5)cc)40)(-42) assuming c is positive. c(592647/98) Simplify ((x(-27)x*22)/(xx(-1/10))37)(-38/3) assuming x is positive. x(7277/15) Simplify (n(10/13))(-2/131)/(nnn(-2/7))(12/19) assuming n is positive. n(-247892/226499) Simplify ((v/v(-2/7))*(9/5)(vv5)(3/8))(-41) assuming v is positive. v(-26199/140) Simplify (((v(8/5)v(-2))(-2/19))43)(-13) assuming v is positive. v*(-2236/95) Simplify (((xx(-1))(-1/22)/(x(-1/4))(2/123))48)(1/40) assuming x is positive. x(1/205) Simplify ((u(-6/5)/u(3/7))/(u5)(-2/97))42 assuming u is positive. u(-31074/485) Simplify ((z2z)39)42(zzz1)(-2/15)z/(zz*(-1/7))z(2/5) assuming z is positive. z(34399/7) Simplify (((yyy*(-3/25)yyy)/(yy(-14)))/((yy*7)/yy(-3/25)))(-7/5) assuming y is positive. y*(-77/5) Simplify ((aa*(-5/3))/(aaaa*(1/10))(a*(-1/4)/aa)26)/(a(5/4)aa*1/a(aa/(aa*(1/3)))/(aaa/(a/a(-3)))) assuming a is positive. a(-851/60) Simplify (x(1/5)/x(-1/4))(1/38)((x(-2/3))35)27 assuming x is positive. x(-478791/760) Simplify (j(-1))(4/7)(j(-2/13)/jj)/(jj(-4/5))(j(-2))8/(j*(-5)/(jj(-2/5))) assuming j is positive. j(-5153/455) Simplify l/l*(-3/10)l*(1/19)ll41l(-1/2) assuming l is positive. l(4071/95) Simplify (s(-1/3)/(s/(s/(s/s(1/5)))s)s(s/s17)/sss17/s)(1/13) assuming s is positive. s(-17/195) Simplify (t/t(-2)t(-2))49/(tt(t/((t*0t)/tt))/tt/(t/t*(1/4)tt))(-15) assuming t is positive. t(151/4) Simplify ((u/((uu(-7)/u)/u))/(u/u(-4)))/((uu/(u5u))/(u/(uu(5/7))))((u0/u)/(u/u(-4/7)))6 assuming u is positive. u(-57/7) Simplify ((uu0/uu)16)(-7/3)(u(-1/8)u(1/3))23 assuming u is positive. u(-781/24) Simplify ((y(-1/5)/y)/y*(-28)y2/y(-4))(-19) assuming y is positive. y(-3116/5) Simplify (((w/w(-6))/w)/(w4/w)w(-1/5)www3)/((w(-1/4)/w)(-1/9))(2/9) assuming w is positive. w(6293/810) Simplify (f(-2/7))*(-26)/((ff2)/((f/(f/(f(-1/4)/f)))/f))f(-4)f/(f/f*(1/10))ff1f5 assuming f is positive. f(739/140) Simplify ((gg(-6)g)/(g/g(5/2)))/((g/g(1/2))/g)*(39/5)(gg/((gg/(ggg*3))/gg))/(ggg*(-1))(g(-1/4))(-1/25) assuming g is positive. g(541/100) Simplify (p(2/15)/pp/(p3/p))(-11/5)(pp(1/3)pp(-5))/(p/(p/(pp(-2/7))))28 assuming p is positive. p(-464/25) Simplify (((f/f(2/13))/f)/f(2/5))/(f(3/5)/f*(1/3))(f(-2/5))29f(-5)f(-1/4) assuming f is positive. f(-13783/780) Simplify (uuu*(-2/9)/uu*2u)*(1/53)((u*(-3/7)u)/u(-1/4))(14/3) assuming u is positive. u(3725/954) Simplify ((((c(-2/5)/c)/(c*18c))(2/3))23)(-2/109) assuming c is positive. c(3128/545) Simplify b(-30)/(b/b(1/17))(b/(b8b))(-1/45) assuming b is positive. b(-23534/765) Simplify (c(-2/45))47c2/(c/(c/c(-46))) assuming c is positive. c(2066/45) Simplify (q(-2)/((q/q6qq)/q)(qqq*(2/9))/(qqq(1/2)qq))/((q(1/3))9((q*(1/6)qq)/q)/q(-2)) assuming q is positive. q(-58/9) Simplify ((c(-2)/c)24/(cc(-1/4))21)/(c*8c(-4))(5/9) assuming c is positive. c*(-3239/36) Simplify (xx*(9/8))/(xx*(-3/7))(xx(-2/41))/x(11/4) assuming x is positive. x(-563/2296) Simplify ((x7/xxx(-4)/xx)/((x/(x*(-2/3)x))/(xxx*(1/11)/x)))/((x/(xx*(1/6))x/(xx(2/9)))/(x(1/10)/x(4/5))) assuming x is positive. x(1541/495) Simplify (((o/(o/(o/(o/((oo*(2/29)/o)/o))o)))/o)/((o*(1/4)o)/o)o(-11)o/((oooo(-7/4)o)/o))(-13) assuming o is positive. o(9373/58) Simplify ((j(-2)/j11)/(j*(-12)jj11))(-1/24) assuming j is positive. j(13/24) Simplify (r(-2/27)r*(-23)(r(-1/20))(2/7))5 assuming r is positive. r(-43637/378) Simplify (l(-3/7)/l4)/(l(1/3))(18/5)((lll1)(3/11))(-18/5) assuming l is positive. l(-3301/385) Simplify ((s/(s/(ss*(-1/3)))s)(3/20))(29/5)/((s(ss*(-2/7))/ss)(-41))(2/13) assuming s is positive. s(22319/1820) Simplify (v(-3/7)v(2/13))/(v1)(-3/7)((vv(7/2))/v(v/(v/v*16v)v)/v)(-1/5) assuming v is positive. v(-461/130) Simplify ((d(-4))(-22)(dd(-1/2)/d)(-17))(-19) assuming d is positive. d(-3667/2) Simplify ((m(3/11)/m(7/8))/(m(3/10)/mm((m/((m/(m/(m/((((m/(mm*17))/m)/m)/m)m)))/m)m)/mm)/m))(-17/3) assuming m is positive. m(-47617/440) Simplify (n*8nn/(n(-2/7)/nnn))(-6/5)/(n(-1/2)((nn/(n/(n/(nnn(3/8)nn)))n)/n)/nn1/(n/n1)) assuming n is positive. n(-463/56) Simplify ((t(tt1)/t)/ttt(1/4)(tt7)/t(-3/2))/(((tt/t(2/11))/(t/(t/(t/t(-2/3)))))/(t/(t*(1/3)t)(tt*(-1)tt)/t)) assuming t is positive. t(1619/132) Simplify (o(-3/7)oo(-6)/o(o/o(-5))/o2)/(((oo(-4))/ooo)(-5/9))(-38) assuming o is positive. o(2507/63) Simplify ((u(2/7))4u*(2/19)uu(-5)/uu)/(u*6/(u/(uu*(-1/2)))uu/(u/u4)u/u(-1/5)) assuming u is positive. u(-19221/1330) Simplify (s/s*25s(-11))/(s(-4/13)/(ss(14/5))) assuming s is positive. s(-2008/65) Simplify ((jj*1j)*(3/5)jj/j19j/(j(-2/9)/j))(-2/37) assuming j is positive. j*(1168/1665) Simplify (hh(-1))(39/5)/(h/h(-2))(-42)((h/(h1/h))/h)4/((h(-2/17)/h)/hh(2/15)) assuming h is positive. h(32636/255) Simplify (bb(2/13)/bbb/(b30/b)bb(-8)b/(b27/b))(2/5) assuming b is positive. b(-306/13) Simplify ((h15/h)*(10/7)h*(-24)/hhhh(1/14))(-18) assuming h is positive. h*(369/7) Simplify (s/(ss*(-1/2)))/(ss*(-6))(sss(1/2))(-2/163)(s/(ss*(2/7)s))*(3/4)(ss(-1))/s(3/7) assuming s is positive. s(18605/4564) Simplify ((((b9/b)(2/31))41)(-2/59))42 assuming b is positive. b(-55104/1829) Simplify ((ww*(1/5)w)*(21/2)w/((((w*(20/7)/w)/w)/w)/w)w(2/3))22 assuming w is positive. w(59851/105) Simplify ((((n(-1))(-19))13)(-1/10))(-1/4) assuming n is positive. n*(247/40) Simplify ((zz(1/2))(6/23)z(-20)z(-1/19))18 assuming z is positive. z*(-154656/437) Simplify ((xxx(7/4)x)/x*(-14)xx/(x/(x/x(5/7)))xxx(2/11))(-47) assuming x is positive. x(-321621/308) Simplify ((h3h(-7)/hh/(hh(-2/31))(hh5h)/h)16)(7/12) assuming h is positive. h(308/31) Simplify ((u(-3))*(-22)u*(-10/7)u(-14))(-11/6) assuming u is positive. u(-649/7) Simplify (z(-28)zz(-17))/(z18)21 assuming z is positive. z(-422) Simplify ((l(-1))(-29)/(ll(-1/3))(37/4))/(l/(l7/l)(l(-6/5)/l)/l)(-15) assuming l is positive. l(-601/6) Simplify ((((r/r2)/r)/r)/(r/(rrr*(-1/4)))((r*(-2)r)/r)/r(2/3))/(((r(-6)r)/r)/r3)(5/6) assuming r is positive. r(31/12) Simplify (t(-33)/((tttt/t*(2/131)ttt)/t))/(ttt*32t(8/11)) assuming t is positive. t(-106219/1441) Simplify ((u(4/3))(-36)/(u(u(-1)/u)/uu/(uu(-7))u))(-11) assuming u is positive. u594 Simplify (t*(-8)t(tt/(tt(t*(5/4)t)/t))/t)(3/14)/((t(-1/3)/t)/(t*(-1/3)t)(t/(t/((t/t(-1))/t)))	{ "pile_set_name": "DM Mathematics" }
y 1? 0 Let g(r) = -18r - 3. Suppose -7 = 5v + 18. Let w be g(v). Suppose -w = 2j - 5j. What is the remainder when j is divided by 10? 9 Calculate the remainder when (-130)/(-30)(1 + -4)-4 is divided by 11. 8 Suppose -4u + 8 = -4. Suppose -4n - 229 = 4m - 1, 279 = -5m - un. What is the remainder when (-2)/5 + m/(-10) is divided by 3? 2 Suppose 0 = 2x + 3x - 280. Let d = -26 - -45. Calculate the remainder when x is divided by d. 18 Let i(a) be the third derivative of a6/120 + a5/10 + a4/6 + a3/2 + 7a*2. Calculate the remainder when i(-4) is divided by 7. 5 Let d = -139 + 197. Suppose 0 = -3l - 3h + 34 + 8, 0 = -4l - 5h + d. What is the remainder when 33 is divided by l? 9 Let l(k) = k3 + 6k*2 + 2k - 1. Let r(c) = 22c - 2. Calculate the remainder when r(2) is divided by l(-2). 9 Let f = 24 + 26. Calculate the remainder when f is divided by 17. 16 Let o be (-3 + (-21)/(-6))40. Let q = o + -13. Calculate the remainder when q is divided by 2. 1 Suppose -15 = -r + 64. Suppose 0k = -k - 1, -k - r = -2u. What is the remainder when u is divided by 10? 9 Let w(k) = -k*3 - 14k*2 - 3k - 13. Suppose 3u - 139 - 29 = 0. What is the remainder when u is divided by w(-14)? 27 Suppose 3 = -3g + 18. Suppose 11 + g = 4q, 0 = -2v + q. Suppose 7 = vn - n. What is the remainder when 12 is divided by n? 5 Let l(v) = 4v + 22. Let a(c) = -6c - 33. Let m(w) = 5a(w) + 7l(w). Calculate the remainder when m(-8) is divided by 2. 1 Let v = -151 + 205. Suppose -18 = -2d + 10. Calculate the remainder when v is divided by d. 12 Suppose 2o - 60 = -3o. Let r = 25 + -2. What is the remainder when r is divided by o? 11 Let m = 18 - 1. What is the remainder when m is divided by 9? 8 Let h = -6 + 55. Suppose h = 2n + 7. Suppose -3t + 3c - n = -72, 4t - 89 = -3c. What is the remainder when t is divided by 7? 6 Let r be -2 + 3 + -851. Let y = 137 + r. Calculate the remainder when y is divided by 18. 17 Suppose -5k = -6 - 4. Suppose 0 = -7x + kx. Suppose m - 4a - 41 = x, -m + 0m - 3a = -55. Calculate the remainder when m is divided by 17. 15 Suppose -3c = -c. Suppose cu + 38 = 2u. Calculate the remainder when u is divided by 10. 9 Suppose 3o + 5i - 1 - 59 = 0, 0 = -o + 4i + 3. Let q = 51 - o. Suppose 0z + 2 = z, t + 2z - q = 0. What is the remainder when t is divided by 17? 15 Let g = -28 - -67. What is the remainder when g is divided by 20? 19 Suppose -3g = -6g - 9. Let a = g - -14. Calculate the remainder when 40 is divided by a. 7 Suppose -1 = -3k + 2. Let h(j) = j2 - j + 2. Let r be h(0). Let b = 0 + r. What is the remainder when b is divided by k? 0 Let c be 1/(-4) + 666/(-24). Let d = c + 57. Calculate the remainder when d is divided by 8. 5 Let q(y) = 9y + 18. What is the remainder when q(13) is divided by 34? 33 Calculate the remainder when 21 is divided by (10/20)/(2/20). 1 Let k(l) = l*2 + 5l. Suppose -5w - 4j = 8, -3w + w - 11 = -j. Let z be k(w). Let x = 15 + z. What is the remainder when 32 is divided by x? 10 Suppose 4c = 3c + 12. Calculate the remainder when c is divided by (60/(-25))/(6/(-20)). 4 Suppose 6r = 2r + 44. What is the remainder when 32 is divided by r? 10 Let c(j) = 11j - 34. What is the remainder when 59 is divided by c(5)? 17 Let n = -152 - -240. Calculate the remainder when n is divided by 23. 19 Let h(u) = 3u - 3u - u + 4. Suppose 0 = -0c + c - 3s + 12, 2c = 5s - 21. Calculate the remainder when 20 is divided by h(c). 6 Suppose -w + 5w = 4o - 44, 5o - 95 = -3w. Calculate the remainder when 45 is divided by o. 13 Suppose -l + 2l = 7. Suppose 2z + 0 = -6. Calculate the remainder when (-38)/(0 + z + 1) is divided by l. 5 Let t(b) = b*3 - 9b*2 - 8. Let l be t(9). Let o = l + 8. Suppose oj + 3j = 39. What is the remainder when 36 is divided by j? 10 Let j(g) = 5g*2 - 2g + 3. Let i(l) = -l*2 - 6l - 3. Let m be i(-5). Calculate the remainder when 36 is divided by j(m). 17 Let f(w) = w*2 + w - 10. Calculate the remainder when 36 is divided by f(-5). 6 Suppose -301 + 121 = -4i. Let t(z) = -10z - 17. What is the remainder when i is divided by t(-4)? 22 Suppose 16 = 3c - 4d, c + 0c - 3 = -d. Let i(x) = 3 - 3x2 + 6x - 5x + 4x*2 + 3. Calculate the remainder when i(0) is divided by c. 2 Suppose -5c = -38 - 212. Let h = -216 - -233. What is the remainder when c is divided by h? 16 Let v(h) = -3h - 7. Calculate the remainder when 5 - (0 + (-1 - -3)) is divided by v(-3). 1 Suppose 25q - 5q - 300 = 0. Let n(w) = -w3 + 4w*2 + 7w - 6. Calculate the remainder when q is divided by n(5). 3 Suppose 5v - o = 110, 5v + 59o - 54o = 110. Let y = -76 - -119. What is the remainder when y is divided by v? 21 Suppose 4s - 71 = -3t, 2t - s - 4s = 32. Let g(f) = f*3 - 3f*2 + 3f - 3. Let j be g(3). What is the remainder when t is divided by j/(-15) - (-114)/10? 10 Let n(r) = 2r2 + 4r + 2. Let j be n(-3). What is the remainder when 17 is divided by j/2 + (2 - 0)? 5 Let f(l) = -l*3 + 9l*2 + 10l - 6. What is the remainder when f(9) is divided by 22? 18 Suppose 0 = -o - 2o - r + 49, -44 = -4o + 4r. What is the remainder when (o/4)/((-3)/(-12)) is divided by 8? 7 Let h be (-3)/(-2 + 21/11). Let i(w) = -3w + 1. What is the remainder when 3 + h - 1-2 is divided by i(-4)? 12 Suppose 2c + 3z - 11 = 0, -2c + z - 7 = -2z. Calculate the remainder when 3 - (c + 76/(-2)) is divided by 14. 12 Let i(c) be the second derivative of -c4/12 + 7c3/6 + c2 + 2c. What is the remainder when (12 - -2 - -1)1 is divided by i(6)? 7 Let i = 7 - 3. Suppose -8 = -ij + 8j. Calculate the remainder when j + 39(-4)/(-6) is divided by 13. 11 Let m be 18/12(-44)/(-2). Suppose 3k + k + 4y - 108 = 0, 2k - 5y - m = 0. What is the remainder when k is divided by 9? 6 Suppose p = -2v + 2, 1 = -3p - 4v - 3. What is the remainder when (18 + -6)(-2)/p is divided by 2? 1 Suppose -8k + 15 = -3k, 3k + 71 = 2i. Suppose -5w + 2m - 68 = 0, -5w - 12 - i = 2m. What is the remainder when 3/((-3)/3) - w is divided by 4? 1 Suppose 0 = -4t + 2r - r + 84, -2r + 105 = 5t. Calculate the remainder when 83 is divided by t. 20 Let h be 3/18 - 23/(-6). Suppose 0 + 8 = -hw. Calculate the remainder when w(1 - 23/2) is divided by 11. 10 Let n(h) = -h*3 + 2h2 - h + 3. Let w be n(3). Let b(o) = o3 + 9o2 - 2o + 11. What is the remainder when b(w) is divided by 10? 9 Suppose 0 = -o + 4s + 14, 5s + 17 = o - 0s. Suppose -178 = -4d - oi, -4d + 0i = -2i - 198. What is the remainder when d is divided by 12? 11 Suppose 6 = 5y - 9. Let f be 7/(21/26)-3. What is the remainder when f/(-3) - (-4)/(-6) is divided by y? 2 Suppose -5d + 11 = -q, -4q + 11 = -2d + 1. Suppose 0c - 6 = -dc. Suppose -cb - 20 = -i, -2i + 4 + 6 = 2b. What is the remainder when 29 is divided by i? 9 Let t(n) = n*3 - 15n*2 + 15n + 9. Calculate the remainder when 108 is divided by t(14). 16 Suppose 0 = -3f - 5f + 416. What is the remainder when 101 is divided by f? 49 Let a(h) = h*2 - 10h - 10. Calculate the remainder when a(12) is divided by 3. 2 Let k(f) = -f*3 + f + 58. Let d = -94 - -114. Calculate the remainder when k(0) is divided by d. 18 Suppose -4l = -0l + 32. Suppose 5d + n = -2n, 5d - n = -20. Let u = d - l. What is the remainder when u is divided by 2? 1 Suppose 0 = 4w - 0 - 4, -s + 17 = -5w. Calculate the remainder when s is divided by 8. 6 Let t = 10 - -7. Calculate the remainder when t is divided by 6. 5 Let x(y) = y*2 - 2y. Let g = -9 - -17. Calculate the remainder when x(5) is divided by g. 7 Let k(l) = l*2 - 7. Let y(b) = b - 3. Let n be y(9). Calculate the remainder when k(n) is divided by 8. 5 Let q = 69 - 54. Suppose j = k + k - 14, 0 = -2k - 5j + 38. What is the remainder when q is divided by k(-2)/(-6)3? 6 Suppose -t - 2j + 1 = 4, 0 = 2j + 6. Let c = -9 - 1. Calculate the remainder when (16/c)/((-1)/5) is divided by t. 2 Let t(h) = -h + 7. Let d be t(0). Let m = 48 - d. Calculate the remainder when m is divided by 21. 20 Let m = 1 + 3. Suppose -2c + c - 2p = -25, -mc + 144 = -3p. Suppose 0 = 4n - 8 - 60. Calculate the remainder when c is divided by n. 16 Let b(t) = -t*3 - 10t*2 - 12t - 7. Let u be b(-9). Suppose -x = 2 +	{ "pile_set_name": "DM Mathematics" }
the fourth biggest value in 3, -3, -3/542, 14, -6, 0.14? -3/542 What is the fourth smallest value in -255, -4/7, -58, 0, -0.5, -0.3? -0.5 Which is the biggest value? (a) -2/47 (b) -5/1198492 (c) -0.4 b What is the smallest value in -0.3, 0.11, 2, -4, 3/4, -28, 23? -28 What is the fifth biggest value in 1/10, -4, 1/7, -5, -0.799? -5 What is the fourth biggest value in -0.5, 0.5, -2, 917, -3/5, 18/169? -0.5 What is the fourth smallest value in -3/8, 0.4, 3/5, 183, 66, 0? 3/5 Which is the fifth biggest value? (a) -3/1397 (b) 3/4 (c) -0.2 (d) 0.09 (e) 0 c What is the fourth smallest value in -75, -3, 2839.35, 3? 2839.35 Which is the second smallest value? (a) -5 (b) 2 (c) -8 (d) -2/3 (e) 32 (f) -2/251 a What is the second biggest value in -1, 4/3, 16, -2/53, 1, -2/7? 4/3 What is the smallest value in 57/75367, 22, -2/9? -2/9 Which is the third biggest value? (a) -1 (b) -1/5248 (c) -6 (d) 0.1 (e) -1/5 (f) 2/9 b Which is the second biggest value? (a) 212 (b) 2/938089 (c) 2/21 c Which is the biggest value? (a) -29 (b) 0.2 (c) -2/7 (d) -2/19 (e) -111 b What is the biggest value in 2, 4, -6, -0.04, 474, -6/97? 474 Which is the fourth biggest value? (a) -6 (b) 9.3 (c) -914 (d) -5 c What is the second biggest value in 9479, -5, 38, 1/5? 38 What is the biggest value in -12, -1, 0.201, 3207? 3207 What is the smallest value in -4.4, -0.4, -3.4, -30, -5, 1/6? -30 What is the third biggest value in -3/7, -1040, 26/525? -1040 What is the biggest value in 0.22, -25, 0.2, -10.648? 0.22 What is the second smallest value in 1, -66/5, -964/9? -66/5 What is the smallest value in 0.69, -16239, 0? -16239 Which is the second smallest value? (a) -1206 (b) -1 (c) -45185/4 a What is the sixth smallest value in 0.1, -0.1, 0.287, 0.18, 2/7, 4, 2? 2 Which is the second biggest value? (a) -712.5839 (b) 2 (c) 1/9 c Which is the biggest value? (a) 89 (b) -4 (c) 1/4 (d) 18 (e) 27 a Which is the smallest value? (a) 7135 (b) 14512 (c) -1 c What is the fourth biggest value in 12.6, 2, -8, 0.5, 3181? 0.5 Which is the third biggest value? (a) 268 (b) -7421 (c) 0.02 b What is the fourth biggest value in 0.073, -5, -60, 0.2, -0.4, -41/5? -5 What is the fifth biggest value in 20, -2, -14.2, 47, -126/11? -14.2 What is the sixth biggest value in 3/4, 32, -0.5, -1/3, -72, -2/7? -72 What is the smallest value in -4229394, -4/3, -1/7? -4229394 What is the second smallest value in -7/4, -1, 2/5, 80, 23412? -1 What is the second biggest value in -5, -0.5, 2434921? -0.5 What is the second smallest value in 0, 10/21, -4, 20, 3/112, -2/11? -2/11 Which is the third smallest value? (a) -234 (b) 4 (c) 2/135 (d) 1/3 (e) -59 (f) 1 c What is the fifth biggest value in 19, -0.2, -3, 0.07, -3/97, 0.016? -0.2 What is the biggest value in -6455, -0.4, 5, 0, -233? 5 What is the seventh smallest value in 1/3, -3, 14/29, 1, -168, 1/7, -0.5? 1 What is the third smallest value in -9, -2/11, -1/5, -2/53, -0.11, 4? -2/11 Which is the seventh biggest value? (a) -48 (b) -1/3 (c) 1 (d) 1/4 (e) -1/213 (f) -0.5 (g) -25 a What is the second smallest value in 0.4, 4, -0.3, 2, 5/4, -2353, -23.5? -23.5 What is the second smallest value in -1, 2/11, 1/25, 0.3, -3, 26? -1 What is the biggest value in -1/8, -0.17, -1507934? -1/8 What is the biggest value in 8/1463095, 1, 0.2? 1 What is the third biggest value in 5082, 3/5, 18? 3/5 Which is the smallest value? (a) 26 (b) -1/2 (c) 592 (d) 108 b What is the third smallest value in 8/5, -2.4, 4839? 4839 What is the fourth biggest value in -0.4, -0.13, 4, 3/13826, 1? -0.13 What is the biggest value in 2/15, -6/31, -3/11788? 2/15 Which is the third biggest value? (a) -6 (b) -223 (c) 2/11 (d) 3 (e) 5 (f) 0.3 f What is the third smallest value in 1, 12.628, 4, 12, -5? 4 What is the smallest value in 55, 1923, -0.5, -3? -3 Which is the third smallest value? (a) 2 (b) 1/8 (c) -3/8 (d) 0.4 (e) 35550 (f) 9.9 (g) 1 d Which is the third smallest value? (a) 13 (b) 0.1 (c) 21 (d) -34 a Which is the third biggest value? (a) 4 (b) 0 (c) 138 (d) -3 (e) -0.3 (f) -0.0416 b Which is the third biggest value? (a) 326 (b) -17 (c) -3 (d) -9.95 (e) 2/11 (f) 1/4 e What is the second smallest value in 0.4, 527.75, -24, -8/9? -8/9 What is the smallest value in -445, 27, -4, 99? -445 What is the fourth smallest value in -5, 3, -5/4, -1062, 0.02, -0.4, 0.9? -0.4 What is the third smallest value in 0.4, 3, 1/25584, -305? 0.4 What is the fifth biggest value in -5/4, -4.96, 0, 0.56, -5, 0.08, -0.2? -5/4 Which is the third biggest value? (a) -19387 (b) 15/4 (c) -1 (d) 2/9 (e) -2/3 (f) 0.5 d Which is the third biggest value? (a) 6/43 (b) -0.01 (c) 2/13 (d) -3/7 (e) 13/2 (f) 2/9 c What is the third smallest value in 0.5, -46694, -1/2, -0.6? -1/2 What is the third smallest value in 33.3, -2/7, 610831? 610831 Which is the fifth smallest value? (a) -4 (b) 0.1 (c) 4 (d) -0.1 (e) -2/11 (f) 3 (g) 880752 f What is the biggest value in 103, -23, 0.07, 1, 4/41? 103 What is the second biggest value in -0.2, 193, -4, -129, 2/45, -0.4, -0.3? 2/45 Which is the fourth smallest value? (a) 4 (b) 1/2 (c) 1/5 (d) -18 (e) -1 (f) -0.3 (g) 132/7 c What is the third smallest value in 0.1844, 1/3, -4, -886, -14? -4 Which is the sixth smallest value? (a) 8 (b) 1 (c) 244 (d) 2 (e) 0.1 (f) 34 c Which is the smallest value? (a) 14.88 (b) -5 (c) 0.015 (d) -1 (e) -0.2 b What is the third biggest value in -4, -56200/7, 3? -56200/7 What is the third biggest value in 54, 6, 1/3, -1.29019? 1/3 Which is the third smallest value? (a) -0.3 (b) -9/2 (c) 315272 c What is the fifth smallest value in 3, 1, 2, -10/7, -0.1, 0, 63? 2 What is the second smallest value in 0.4, 0.07719, 2/9, 9? 2/9 What is the biggest value in 13.913, 0.13, -209? 13.913 What is the second smallest value in 1376, -71305, -5? -5 What is the third biggest value in -24, 0.81883, -16? -24 What is the second smallest value in 9, 4, 1/3, -12/217, 55? 1/3 Which is the fifth smallest value? (a) -0.1 (b) 1 (c) -1/16 (d) 5 (e) 8 (f) -1.14 (g) 0.5 b What is the third smallest value in -9/4, 0, -3, -31155? -9/4 What is the smallest value in 1/3, -109, -3/4, -19, -2, 3, -6? -109 Which is the second biggest value? (a) 63 (b) -1 (c) 12/13 (d) 1 (e) 0.3 (f) 4 f What is the sixth smallest value in 2, 31252, -0.2, 1, -2/43, -3, 0.4? 2 What is the biggest value in 3, 1, -2/23, 26.23085, -2? 26.23085 Which is the third smallest value? (a) 3 (b) 0.2 (c) -5 (d) -0.056 (e) -96 (f) 0 (g) -3 g What is the smallest value in 10.474, -0.13, -2/9, 1, 2/3? -2/9 Which is the second biggest value? (a) -11 (b) 0.116 (c) -17 (d) -1/5 d Which is the smallest value? (a) -1/3 (b) 3/4 (c) 2/5 (d) 0.103 (e) -0.51 (f) 33 e What is the smallest value in -141, -80.9, 2/5, -3? -141 What is the third biggest value in 3/158, 3, -205? -205 What is the third smallest value in 0, 7.8, -65787? 7.8 What is the biggest value in 9776/53, -0.3, 4, 2? 9776/53 Which is the second smallest value? (a) 1/13 (b) 23/2 (c) -12/5 (d) -2 (e) -6 (f) -4/5 c What is the third biggest value in -12, -3415815, 0.3, 2? -12 What is the biggest value in 184, 0, -4/5, -311? 184 Which is the fourth biggest value? (a) 1 (b) 3 (c) 2 (d) 0.018 (e) 2/6441 d Which is the biggest value? (a) 0 (b) 785 (c) -3/4 (d) -0.2 (e) 2/15 (f) -11 (g) -2/3 b What is the fourth smallest value in 6, -2/5, -33, 0.51, 0.8, 36? 0.8 Which is the third smallest value? (a) 16688 (b) -1/5 (c) 0 (d) 12/329 d What is the sixth smallest value in 51, 3/5, -15, -3/40, -8, 2, 0.5? 2 Which is the biggest value? (a) -0.3 (b) -3 (c) 193 (d) -13/2480 c Which is the fourth smallest value? (a) 54 (b) -3/2 (c) -1 (d) -1/53076 a What is the sixth biggest value in 0.4, -1/5, 5, 0.2, -0.22, 1006? -0.22 Which is the third biggest value? (a) 1 (b) -2/125 (c) 109 (d) -3 b Which is the fifth biggest value? (a) -0.3 (b) 5 (c) 0 (d) -0.9 (e) -1/2 (f) -1.673 d Which is the sixth biggest value? (a) 7/3 (b) -1/8 (c) -30 (d) 2/5 (e) -1 (f) 2 c What is the sixth smallest value in -172, 0, -2/27, -3/5, -3/11, 128? 128 What is the second biggest value in -1, -911, -413? -413 Which is the fi	{ "pile_set_name": "DM Mathematics" }
1679? 1959 What is the next term in -121, -135, -183, -283, -453? -711 What is the next term in 28, -12, -82, -188, -336, -532, -782, -1092? -1468 What comes next: -153, -145, -147, -165, -205, -273? -375 What is the next term in -204, -401, -586, -753, -896, -1009? -1086 What comes next: 110, 215, 308, 383, 434, 455, 440? 383 What is next in 2, -57, -114, -169? -222 What is next in 522, 516, 510, 504, 498? 492 What is the next term in -10, 104, 294, 560? 902 What is next in 6, 22, 38? 54 What comes next: 52, 51, 34, -5, -72, -173, -314, -501? -740 What is the next term in -7, 15, 55, 119, 213, 343, 515, 735? 1009 What comes next: 29, 70, 111, 152, 193, 234? 275 What is next in 16, 25, 28, 19, -8, -59, -140, -257? -416 What is the next term in -4954, -4949, -4942, -4933, -4922, -4909, -4894? -4877 What comes next: 234, 505, 774, 1041, 1306? 1569 What is next in 1499, 1491, 1469, 1427, 1359, 1259? 1121 What is next in 2, 6, 12, 20, 30? 42 What is the next term in -75, -166, -275, -408, -571, -770, -1011, -1300? -1643 What comes next: 20, 27, 38, 53? 72 What is the next term in 25325, 25326, 25327, 25328, 25329? 25330 What is the next term in -349, -343, -335, -325, -313, -299, -283? -265 What is next in 1467, 1465, 1463, 1461? 1459 What comes next: -2, 37, 106, 205, 334, 493? 682 What comes next: 1188, 2373, 3558, 4743, 5928, 7113? 8298 What is next in 12417, 12418, 12427, 12450, 12493, 12562, 12663, 12802? 12985 What is the next term in -2, 28, 120, 304, 610, 1068, 1708? 2560 What comes next: 15, 38, 67, 102, 143, 190? 243 What is next in 2526, 2571, 2618, 2667, 2718, 2771? 2826 What is next in 33, 66, 103, 144, 189? 238 What is the next term in 20, 68, 116, 164, 212, 260? 308 What is next in 1042, 1050, 1062, 1078, 1098, 1122, 1150? 1182 What is the next term in 66, 40, 14, -12, -38? -64 What comes next: -80, -99, -128, -173, -240, -335, -464? -633 What comes next: 170, 187, 218, 269, 346, 455, 602? 793 What comes next: 455, 456, 457? 458 What is the next term in 70, 126, 186, 244, 294, 330? 346 What is next in -27, -27, -17, 9, 57, 133? 243 What is next in -2005, -4012, -6025, -8044? -10069 What is the next term in -216, -213, -198, -165, -108, -21? 102 What is next in -27, -24, -21, -18, -15, -12? -9 What is the next term in -93, -188, -283, -378? -473 What is next in 18, 24, 34, 48, 66? 88 What is the next term in -68, -139, -210, -281? -352 What comes next: 38, 51, 62, 71? 78 What is the next term in 143, 516, 1143, 2030, 3183, 4608, 6311, 8298? 10575 What is the next term in 48, 93, 138? 183 What comes next: -95, -88, -77, -62? -43 What is the next term in 43, 75, 109, 145? 183 What is the next term in -423, -442, -475, -528, -607, -718, -867? -1060 What is the next term in 501, 1001, 1495, 1983, 2465, 2941, 3411? 3875 What is the next term in 29, 74, 153, 284, 485, 774, 1169, 1688? 2349 What is the next term in -36, -145, -326, -579, -904, -1301? -1770 What is the next term in -647, -1290, -1931, -2570, -3207, -3842? -4475 What is next in 12, -45, -116, -207, -324, -473? -660 What comes next: 6638, 6632, 6616, 6584, 6530? 6448 What comes next: 58, 54, 40, 10, -42, -122? -236 What is next in 104, 200, 310, 440, 596, 784, 1010, 1280? 1600 What is the next term in 5, -22, -77, -172, -319, -530, -817, -1192? -1667 What is next in 66, 119, 172, 225, 278, 331? 384 What is the next term in 163, 164, 165, 166, 167? 168 What is the next term in -70, -137, -204, -271? -338 What is next in -19307, -19305, -19301, -19295? -19287 What is the next term in 7, 14, 19, 22, 23? 22 What is next in -113, -171, -217, -245, -249, -223, -161? -57 What comes next: -35, -82, -141, -212, -295, -390? -497 What comes next: 2289, 4579, 6871, 9165? 11461 What is next in -232, -234, -232, -220, -192, -142? -64 What comes next: -5139, -10289, -15451, -20631, -25835, -31069, -36339? -41651 What is next in -19, -42, -77, -124, -183? -254 What is the next term in 93, 193, 303, 429, 577, 753, 963, 1213? 1509 What is the next term in 55, 257, 601, 1087, 1715, 2485? 3397 What comes next: 165, 323, 479, 633? 785 What is the next term in -634, -632, -630, -628, -626? -624 What is next in 418, 415, 412, 409, 406, 403? 400 What is next in 26, 21, 4, -31, -90? -179 What is next in -45, -87, -129, -171, -213? -255 What comes next: -11110, -22230, -33360, -44506, -55674, -66870? -78100 What comes next: -99, -97, -95, -93, -91? -89 What is the next term in -22, -22, -34, -64, -118, -202, -322? -484 What is next in 39, 63, 105, 171, 267, 399? 573 What is next in -160, -312, -464, -616, -768? -920 What is next in -479, -480, -481, -482, -483, -484? -485 What comes next: 185, 184, 181, 176, 169? 160 What is next in 2, 33, 66, 101, 138? 177 What is the next term in 175, 313, 445, 571, 691, 805? 913 What comes next: -27, 70, 241, 492, 829? 1258 What is next in 148, 156, 164, 172? 180 What comes next: 138, 159, 186, 213, 234, 243, 234, 201? 138 What is the next term in -50, -314, -1012, -2360, -4574, -7870, -12464, -18572? -26410 What is next in 703, 844, 1225, 1966, 3187, 5008? 7549 What is the next term in -21, -32, -39, -42, -41? -36 What comes next: -36, -37, -44, -63, -100, -161? -252 What is the next term in -19, -61, -129, -223, -343, -489, -661? -859 What is next in 289, 570, 851, 1132, 1413, 1694? 1975 What comes next: 19, 65, 115, 169? 227 What comes next: -15, 4, 39, 90, 157? 240 What is the next term in 97, 101, 113, 139, 185, 257? 361 What is the next term in -61, -50, -39? -28 What is the next term in -24, -11, 6, 27, 52? 81 What is next in 210, 222, 234, 246? 258 What is next in -65, -80, -95, -110, -125? -140 What is next in -60, -108, -156, -204? -252 What is the next term in -18, -44, -70? -96 What is next in 1000, 2000, 3000, 4000? 5000 What is the next term in -13, -11, -9, -7, -5, -3? -1 What is the next term in 70, 272, 608, 1078, 1682, 2420, 3292? 4298 What comes next: 19, 130, 435, 1030, 2011, 3474? 5515 What comes next: 72, 149, 230, 315, 404, 497? 594 What is next in -191, -193, -195, -197, -199? -201 What comes next: 816, 819, 824, 831, 840, 851, 864? 879 What is next in -1366, -2731, -4096, -5461, -6826, -8191? -9556 What is next in 1001, 1984, 2951, 3896, 4813? 5696 What is the next term in -905, -3597, -8083, -14363, -22437? -32305 What is the next term in 461, 467, 477, 491, 509? 531 What is the next term in 33, 72, 109, 144, 177, 208, 237? 264 What comes next: -172, -346, -520? -694 What is the next term in 137, 256, 373, 488, 601, 712, 821? 928 What is next in 379, 374, 365, 352? 335 What is the next term in 22, 47, 76, 109? 146 What is the next term in 17, 20, 19, 14, 5? -8 What is the next term in -4427, -4431, -4437, -4445, -4455, -4467? -4481 What comes next: 954, 1905, 2854, 3801, 4746, 5689, 6630? 7569 What comes next: -124, -515, -1166, -2077? -3248 What is next in 3552, 3551, 3550, 3549? 3548 What comes next: 216, 412, 608, 804, 1000, 1196? 1392 What comes next: 515, 1017, 1495, 1937, 2331, 2665? 2927 What is next in -45, -26, -5, 18? 43 What is the next term in -251, -485, -719? -953 What comes next: -1786, -1787, -1788? -1789 What comes next: -860, -1721, -2582, -3443, -4304? -5165 What is the next term in 37, 35, 33, 31, 29, 27? 25 What is next in 56, 189, 402, 689, 1044, 1461, 1934? 2457 What is the next term in 14, 80, 184, 320, 482? 664 What is next in -30, -11, 36, 123, 262, 465, 744? 1111 What comes next: 35, 52, 69, 86, 103? 120 What is next in 451, 902, 1353, 1804, 2255? 2706 What is the next term in 138, 142, 148, 156? 166 What comes next: 46, 76, 126, 196, 286? 396 What is next in -35, -78, -141, -218, -303, -390, -473? -546 What comes next: -1154, -1129, -1090, -1031, -946, -829, -674, -475? -226 What is next in -1526, -1534, -1554, -1592, -1654, -1746, -1874? -2044 What is next in 17, 20, 31, 56, 101, 172, 275? 416 What is the next term in -785, -784, -783? -782 What comes next: -131, -235, -345, -467, -607? -771 What is the next term in 59, 125, 199, 287, 395? 529 What is next in 40, 50, 70, 106, 164, 250, 370? 530 What comes next: -16, 37, 136, 287, 496, 769, 1112? 1531 What is the next term in 40055, 40057, 40059, 40061, 40063, 40065? 40067 What comes next: 467, 935, 1405, 1877, 2351, 2827, 3305? 3785 What comes next: -451,	{ "pile_set_name": "DM Mathematics" }
, -403, -586? -b3 - b2 + b - 18 What is the g'th term of 70, 357, 1126, 2617, 5070, 8725, 13822? 40g3 + g2 + 4g + 25 What is the t'th term of -1147, -1148, -1149? -t - 1146 What is the n'th term of 448, 453, 462, 475, 492, 513? 2n2 - n + 447 What is the w'th term of 292, 283, 262, 223, 160, 67, -62? -w3 - 2w + 295 What is the m'th term of 17, 28, 39, 50, 61, 72? 11m + 6 What is the t'th term of -244, -247, -248, -247? t2 - 6t - 239 What is the j'th term of -584, -586, -588, -590, -592? -2j - 582 What is the z'th term of -54, -59, -64, -69, -74? -5z - 49 What is the k'th term of -1828, -3658, -5488, -7318? -1830k + 2 What is the s'th term of -4, 20, 74, 170, 320? 2s*3 + 3s*2 + s - 10 What is the d'th term of 8, -13, -66, -163, -316, -537? -2d*3 - 4d*2 + 5d + 9 What is the o'th term of -21, -31, -35, -33, -25, -11? 3o2 - 19o - 5 What is the l'th term of -145, -127, -111, -97, -85? -l*2 + 21l - 165 What is the j'th term of -60, -114, -168, -222? -54j - 6 What is the k'th term of 52, 54, 56, 58, 60, 62? 2k + 50 What is the y'th term of -2633, -5270, -7907, -10544, -13181, -15818? -2637y + 4 What is the r'th term of 27, 26, 25, 24, 23, 22? -r + 28 What is the o'th term of -46, -99, -238, -505, -942, -1591, -2494? -7o3 - o2 - o - 37 What is the l'th term of -79, -156, -233, -310, -387, -464? -77l - 2 What is the s'th term of 192, 151, 110, 69, 28? -41s + 233 What is the k'th term of -322, -329, -348, -385, -446, -537, -664? -k*3 - 321 What is the y'th term of 406, 806, 1206, 1606? 400y + 6 What is the b'th term of 101, 200, 299? 99b + 2 What is the x'th term of -247, -244, -241? 3x - 250 What is the p'th term of 298, 560, 836, 1132, 1454? p3 + p2 + 252p + 44 What is the y'th term of -44, -89, -134? -45y + 1 What is the p'th term of 297, 594, 891, 1188, 1485? 297p What is the p'th term of -162, -620, -1384, -2454, -3830? -153p*2 + p - 10 What is the q'th term of -10, -8, 2, 20, 46? 4q*2 - 10q - 4 What is the p'th term of -2, -4, -8, -14? -p2 + p - 2 What is the l'th term of -535, -526, -531, -556, -607, -690? -l3 - l*2 + 19l - 552 What is the v'th term of 41, 66, 91? 25v + 16 What is the n'th term of 785, 771, 759, 749, 741, 735? n2 - 17n + 801 What is the n'th term of 3802, 3799, 3796, 3793, 3790? -3n + 3805 What is the b'th term of 1232, 2455, 3664, 4853, 6016? -b3 - b2 + 1233b + 1 What is the q'th term of 137, 128, 119? -9q + 146 What is the d'th term of -71, -89, -107? -18d - 53 What is the h'th term of -24, -20, -6, 24, 76, 156? h3 - h2 - 24 What is the c'th term of 37, 98, 199, 340, 521, 742? 20c2 + c + 16 What is the s'th term of -5, -44, -117, -230, -389, -600, -869? -s3 - 11s*2 + s + 6 What is the d'th term of 99, 70, 21, -48, -137, -246? -10d*2 + d + 108 What is the g'th term of -30, -39, -44, -45, -42, -35? 2g*2 - 15g - 17 What is the a'th term of 4104, 4116, 4136, 4164? 4a2 + 4100 What is the g'th term of -2, 1, 24, 79, 178, 333, 556, 859? 2g*3 - 2g*2 - 5g + 3 What is the p'th term of 56, 146, 246, 362, 500, 666? p3 - p2 + 86p - 30 What is the k'th term of -3, -28, -71, -132? -9k*2 + 2k + 4 What is the z'th term of -8, -20, -46, -92, -164, -268, -410, -596? -z3 - z2 - 2z - 4 What is the w'th term of 79, 143, 209, 277, 347? w2 + 61w + 17 What is the h'th term of -15, -74, -173, -312, -491, -710, -969? -20h2 + h + 4 What is the y'th term of 5, -22, -71, -142, -235, -350? -11y*2 + 6y + 10 What is the l'th term of -53, -54, -45, -26, 3, 42? 5l2 - 16l - 42 What is the s'th term of -90, -86, -82, -78? 4s - 94 What is the v'th term of -375, -753, -1131? -378v + 3 What is the r'th term of -1359, -1357, -1355, -1353, -1351, -1349? 2r - 1361 What is the r'th term of 27, 85, 241, 543, 1039, 1777, 2805, 4171? 8r3 + r2 - r + 19 What is the v'th term of -39, -41, -45, -51, -59, -69, -81? -v*2 + v - 39 What is the v'th term of 41, 159, 353, 623? 38v*2 + 4v - 1 What is the s'th term of -666, -668, -670? -2s - 664 What is the p'th term of -90, -245, -468, -759, -1118, -1545, -2040? -34p*2 - 53p - 3 What is the v'th term of 416, 410, 400, 386? -2v2 + 418 What is the u'th term of 76, 74, 72, 70, 68, 66? -2u + 78 What is the g'th term of 5, 1, 11, 47, 121, 245, 431, 691? 2g3 - 5g*2 - 3g + 11 What is the u'th term of -17, -71, -205, -455, -857, -1447? -6u3 - 4u*2 - 7 What is the i'th term of 643, 1271, 1899, 2527, 3155, 3783? 628i + 15 What is the h'th term of -70, -132, -172, -178, -138, -40, 128, 378? 2h3 - h2 - 73h + 2 What is the f'th term of -72, -108, -182, -306, -492, -752? -2f3 - 7f*2 - f - 62 What is the i'th term of 16, 86, 284, 676, 1328, 2306, 3676? 11i*3 - 2i*2 - i + 8 What is the f'th term of -166, -169, -172, -175, -178, -181? -3f - 163 What is the l'th term of 85, 194, 323, 472, 641, 830? 10l2 + 79l - 4 What is the j'th term of -38, -33, -30, -29, -30? -j*2 + 8j - 45 What is the d'th term of -63, -282, -673, -1242, -1995, -2938, -4077, -5418? -d*3 - 80d*2 + 28d - 10 What is the w'th term of -8, -23, -70, -167, -332? -3w3 + 2w*2 - 7 What is the s'th term of -570, -1139, -1708, -2277? -569s - 1 What is the b'th term of -12808, -12807, -12806, -12805? b - 12809 What is the y'th term of -990, -991, -992, -993, -994, -995? -y - 989 What is the r'th term of 255, 253, 251, 249? -2r + 257 What is the r'th term of -30, -122, -280, -510, -818, -1210? -r3 - 27r*2 - 4r + 2 What is the b'th term of -452, -455, -458, -461? -3b - 449 What is the l'th term of -1835, -3671, -5507, -7343? -1836l + 1 What is the o'th term of -382, -814, -1256, -1714, -2194, -2702, -3244, -3826? -o3 + o2 - 428o + 46 What is the n'th term of -337, -661, -985, -1309, -1633, -1957? -324n - 13 What is the h'th term of 1355, 1371, 1397, 1433, 1479, 1535, 1601? 5h2 + h + 1349 What is the j'th term of -1121, -1120, -1119, -1118, -1117, -1116? j - 1122 What is the l'th term of -17, -63, -127, -203, -285, -367, -443? l3 - 15l*2 - 8l + 5 What is the k'th term of -6885, -13771, -20657, -27543, -34429, -41315? -6886k + 1 What is the m'th term of -163, -320, -477? -157m - 6 What is the l'th term of 263, 560, 867, 1190, 1535, 1908, 2315, 2762? l3 - l2 + 293l - 30 What is the z'th term of 297, 285, 273, 261? -12z + 309 What is the c'th term of -9, 68, 193, 360, 563, 796, 1053? -c*3 + 30c*2 - 6c - 32 What is the f'th term of 419, 796, 1147, 1466, 1747, 1984, 2171, 2302? -f*3 - 7f*2 + 405f + 22 What is the y'th term of 8, 31, 92, 209, 400? 3y3 + y2 - y + 5 What is the q'th term of -972, -971, -970, -969? q - 973 What is the t'th term of -57, -109, -161? -52t - 5 What is the p'th term of -28, -31, -34, -37, -40, -43? -3p - 25 What is the l'th term of -24, -105, -328, -765, -1488, -2569? -12l3 + l2 - 13 What is the t'th term of -19, -48, -117, -244, -447? -3t3 - 2t*2 - 2t - 12 What is the w'th term of 0, -13, -26, -39, -52? -13w + 13 What is the t'th term of -238, -258, -290, -340, -414? -t3 - 13t - 224 What is the o'th term of -5, -35, -127, -311, -617, -1075, -1715, -2567? -5o3 - o2 + 8o - 7 What is the x'th term of -95, -432, -987, -1754, -2727, -3900, -5267? x*3 - 115x*2 + x + 18 What is the q'th term of -11, 28, 67, 106? 39q - 50 What is the j'th term of 40, 319, 1056, 2479, 4816, 8295, 13144, 19591? 38j3 + j2 + 10j - 9 What is the c'th term of 593, 1186, 1789, 2408, 3049, 3718, 4421, 5164? c3 - c2 + 589c + 4 What is the j'th term of -977, -1953, -2929, -3905? -976j - 1 What is the c'th term of 434, 429, 426, 425, 426, 429? c*2 - 8c + 441 What is the b'th term of 422, 413, 402, 389, 374, 357? -b*2 - 6b + 429 What is the v'th term of 1098, 1105, 1112, 1119? 7v + 1091 What is the n'th term of 30, 46, 62, 78, 94? 16n + 14 What is the g'th term of 188, 380, 572? 192g - 4 What is the g'th term of 46, 269, 852, 1975, 3818, 6561? 30g*3 + 13g + 3 What is the p'th term of -112, -118, -124, -130, -136? -6p - 106 What is the p'th term of -6, -15, -48, -117, -234, -411, -660? -2p*3 + 5p - 9 What is the t'th term of 11, 24, 37, 50, 63? 13t - 2 What is the v'th term of 14, 60, 134, 230, 342, 464, 590, 714? -v*3 +	{ "pile_set_name": "DM Mathematics" }
. Suppose -u = 4k, k = 2y - 89 - 39. Is 17 a factor of y? False Is (1022 - -1) + 1(-6 - (12 + -19)) a multiple of 32? True Suppose 4u - 3l = 290, 0 = -2l + 4l + 4. Suppose 5r = 3i + 53, -5i + 0i = -4r + u. Let t(v) = -9v - 58. Is 14 a factor of t(i)? False Is (2 - 3)/((-2)/4989(-24)/(-80)) a multiple of 202? False Let z be -310/8 - 12/(-16). Does 10 divide (z - -1)/(1/(-225))? True Let k(r) = 18r*2 + 223r + 691. Is k(-3) a multiple of 8? True Suppose 18v + 2r + 29040 = 23v, -2v + 11616 = 3r. Is 16 a factor of v? True Let g(v) = -33v + 19. Let d = -69 - -56. Does 64 divide g(d)? True Let b(l) be the second derivative of 3l5/20 - 5l4/4 - l3/2 - 23l2/2 - 25l. Does 50 divide b(7)? True Let m(w) = -14w - 10 + w3 + 8w*2 + 4 - 8w*2. Let t be m(4). Suppose tc + 432 = 20c. Does 8 divide c? True Let z = -140 - -145. Suppose 0 = -2f - u + 17, -zf + 2f - u + 25 = 0. Does 8 divide f? True Let c = 15843 + -5435. Does 89 divide c? False Let k be 55/(-3)(16 + -10). Let o = 96 + k. Let u = 23 - o. Is 3 a factor of u? False Suppose -70 = 5k - 7k. Suppose k = -f + 6f. Let b = f - -80. Is b a multiple of 20? False Suppose 0 = -12n + 13n - 4909. Does 57 divide n? False Suppose 5z - 108 = 67. Suppose -g - 6 = -z. Does 2 divide g? False Suppose 29s = -36s + 67340. Is 8 a factor of s? False Let i(h) = -146h + 164. Let n be i(-6). Let p = n + -698. Is p a multiple of 57? True Let b = 3315 + -2783. Is b a multiple of 19? True Let y = 51 - 192. Is 10 a factor of y(-15)/62/3? False Suppose -3o - s + 62 = 0, 3o + 0s - 42 = 3s. Let f(c) = -c*2 + 7c + 8. Let r be f(8). Let x = o - r. Does 2 divide x? False Let y = 10675 - -1130. Does 15 divide y? True Let r(h) = -h*3 + 6h*2 + 3h + 1. Let b = 91 - 83. Suppose bm + 4 = 36. Is r(m) a multiple of 4? False Is (-2 - -3538) + 26 + -21 a multiple of 134? False Let o(n) = 10n*2 + 3n + 31. Let j(w) = 2w2 + 2. Let x(f) = -4j(f) + o(f). Is x(-27) a multiple of 40? True Let a = 3594 - 3443. Is a even? False Let x = -19 - -19. Suppose 4q - 3q + q = x. Suppose -2v + 5t = -qv - 91, t = -5. Is v a multiple of 11? True Suppose 4d - 305 = -3i, 4i - 3d - 219 = 221. Suppose -546 = 167r - 125r. Let m = r + i. Does 31 divide m? False Suppose 2f + 19975 = 3t, -f + 24084 = 5t - 9238. Is t a multiple of 50? False Let j(f) = 765f2 - 29f + 103. Is j(3) a multiple of 113? False Suppose n - 409 = -2f + 859, -2f + n + 1272 = 0. Let h be 2/4 + f/10. Suppose 0v + h = v. Does 4 divide v? True Let h = -1276 - -534. Let g = -144 - h. Is g a multiple of 84? False Let p be 2(-1)/1 + -190 - 1. Let r = p + 278. Let v = r + -51. Is v a multiple of 17? True Suppose 7714 = 2w + y - 4y, 3y = 3w - 11565. Is w a multiple of 36? False Suppose -21p = -3146 - 6304. Let t = -96 + p. Does 19 divide t? False Suppose -i - 7 = 0, 286i - 46582 = -5y + 282i. Is y a multiple of 15? False Suppose -4g + 2h = -0h + 28, -h + 8 = -g. Let u(n) = -7. Let x(v) = v. Let a(r) = u(r) - 2x(r). Is a(g) a multiple of 5? True Let y(x) = x*3 - 16x*2 + 16x + 15. Let z be y(15). Let s be (z/(-9) + 4)3. Is (-1)/(s/78-3) even? False Let k(d) = 38d + 6. Let q be k(8). Suppose -g + q = 4g. Let h = 12 + g. Does 21 divide h? False Let j(b) = -3b2 - 83b - 2. Let v(a) = a*2 + 41a + 3. Let h(x) = -3j(x) - 5v(x). Is 26 a factor of h(-13)? False Suppose -9p + 78 = -12. Suppose pa = 9 + 31. Suppose -al + 132 = -3l. Is 11 a factor of l? True Let r = -2095 + 2104. Let l = 4 - -6. Suppose -lv + rv = -19. Is 7 a factor of v? False Let n = -264 + 262. Does 16 divide (172n/12)/(3/(-18))? False Suppose -5r = w - 837, 0 = -3r - r + 16. Suppose 2n + 5p = w, -2p = -7p - 15. Is n a multiple of 13? True Let m(l) = -4l - 78. Let r be m(-25). Suppose -3860 = -rc + 17c. Suppose -a + 3a = c. Is 56 a factor of a? False Let a(o) = o2 + 2o + 2. Let c be a(-2). Suppose cp - 5 = 9. Suppose 509 = pr - 23. Does 19 divide r? True Let r = 32567 - 20055. Does 34 divide r? True Let l be (-55)/22(-88)/10. Let q(k) = 3k + 1. Let h be q(1). Let s = l + h. Does 13 divide s? True Let o be 2((-3)/3 + (-453)/(-1)). Let r = o - 646. Is 6 a factor of r? True Let p(l) = 3l - 24. Let v be p(11). Does 60 divide 18265/30 - v - (-2)/12? True Let k be 4 + 4/20 + 1/(-5). Suppose -20 = -ks, s + 2 + 293 = -5g. Let b = g - -96. Does 12 divide b? True Let r be 14/(-3)12 - 1. Is 13 a factor of ((-463)/(-6))/(-3 + r/(-18))? False Suppose -8g + 4g = -128. Suppose -31o = -go + 73. Is 8 a factor of (6/2)/(-1) + o + 2? True Let a(r) = 6r*2 + 36r. Let o be a(-8). Let d = -24 + o. Is d a multiple of 23? False Let t be (12 - 2) + -2 - (9 - 6). Suppose -tm + 12f = 13f - 3220, 3m - 1930 = -f. Is m a multiple of 15? True Suppose 3w - 8w = -75. Suppose -2u + 304 = -4i, 0 = 6i - 3i - w. Suppose 6j - 3j = u. Is 18 a factor of j? True Let f(u) = u*2 - 4u + 4. Let m(t) be the first derivative of -t*3/3 + 2t*2 - 4t + 12. Let l(v) = 4f(v) + 3m(v). Is l(6) a multiple of 16? True Let a(n) = -n*2 - 49n - 218. Let m be a(-44). Let s be (-16)/(-7) - 4/14. Is (-22)/(-2) + s/m a multiple of 2? True Let f(h) = h3 - h2 - 2h + 4. Let n be f(2). Suppose -b - 597 = nu - 0u, 300 = -2u - 2b. Is 33 a factor of (-7 - 1)(-4 - u/(-4))? True Let l(g) = g*2 + 3g + 4. Let x be l(-3). Suppose xk - 868 = -4h, 15k = 10k - 15. Is 4 a factor of h? True Let z = 1191 + 1574. Suppose 461 - z = -4p. Is 64 a factor of p? True Suppose -32n = -27n - 465. Let i = n + -59. Let h = i + 45. Does 18 divide h? False Suppose 5b - 3b - 120 = 0. Let k = b - 64. Is k/22 + 5290/55 a multiple of 24? True Let m = 16184 + -9564. Is 60 a factor of m? False Suppose 3g = 4r - 19 - 9, -5g = 20. Suppose -n = -4w + 2n + 129, w - 45 = 5n. Suppose -m = -z + m + 1, -5m + w = rz. Is 4 a factor of z? False Suppose 0 = 20z - 3z - 34. Suppose 5t - 6x + 5 = -zx, -2x = t + 15. Does 14 divide (-115)/(8/t - (-27)/45)? False Suppose -60 = -k + 36q - 38q, -4k + 240 = 2q. Is 4 a factor of k? True Let u = -94 - -133. Let k(x) = -ux3 + x2 - 94x + 44x + 51x. Is 5 a factor of k(-1)? False Suppose 5t = -5x - 35, -6x + 3x = -3t - 45. Does 28 divide (-33)/t(-280)/(-3)? True Suppose -r - 4w + 1874 = -356, 0 = -5r - 3w + 11133. Is r a multiple of 28? False Let z(n) = -459n3 + n2 + 2. Let x be z(-2). Let m = x - 1206. Suppose 0 = -13v - 15 + m. Is v a multiple of 27? True Let l(q) be the third derivative of q6/120 + q5/12 - 7q4/24 + q3 - 9q*2. Let y be l(6). Suppose m = 5m - y. Does 15 divide m? True Suppose 8o = 278 + 690. Suppose -5i - 306 = -w + 29, 3w = 2i + o. Let y = i + 154. Is 4 a factor of y? False Let w(g) = -48g + 7527. Is w(-108) a multiple of 19? True Let d(b) be the second derivative of b5/20 + b4 + 3b*3 + 28b*2 - 80b. Does 7 divide d(-8)? True Suppose -3i - 984 = -3f, -4f + 1336 = -4i + 8i. Let t = -123 + -12. Let j = t + f. Is j a multiple of 12? False Suppose -l = 7l - 8408. Suppose -l = -3o + 5f, 5o = -3f + 945 + 750. Does 33 divide o? False Suppose 3t - 12653 = -i, 4i + 10t = 9t + 50645. Is 20 a factor of i? False Let d = 29 + -17. Suppose 7z = 3z + d. Suppose n - 164 = -zn. Is n a multiple of 3? False Let k = 1435 - 851. Let p = k - 388. Does 10 divide p - (-1 + (-20)/(-4))? False Let c(u) = u2 - 24u - 103. Let l be c(28). Suppose -141 = lf - 2508. Does 62 divide f? False Let m(n) = 3n*2 - 5n - 2. Let i(g) = -g*2 - 2g + 2. Let j be i(0). Let t be m(j). Suppose -y = -5s + 2 - 62, t = -5y + 2s + 208. Is y a multiple of 10? True Suppose -2g + 2 = -2. Suppose 707 = gc - 61. Does 22 divide c? False Suppose -r + 5v + 5 = 4r, 6 = 4r - 3v. Is (-1)/r - 50442/(-126) a multiple of 28? False Let b(h) = 3h*3 + 279h*2 + 317h + 170. Is 149 a factor of b(-91)? True Suppose 2g + 5t = 31, 4t - 5 = 15. Let w(h) = 13h - 25. Let j(q) = 6q - 13. Let n(v) = gw(v) - 7j(v). Is 15 a factor of n(0)? False Let i be (768/24)/(-1 - (-10)/8). Suppose -11f = -27f - i. Let z(p) = p2 + 5p + 6. Is 15 a factor of z(f)? True Let m be (13 - 5) + (1 + 0)4. Let k(r) = -r2 + 4r - 25. Let x(f) = -2f2 + 7f - 51. Let w(v) = -5k(v) + 2x(v)	{ "pile_set_name": "DM Mathematics" }
(q(n)). -34980n2 + 11 Let s(l) = -1227 + 13l + 1227. Let m(q) = 27q. Let g(j) = 4m(j) - 9s(j). Let r(i) = -4i. Calculate r(g(h)). 36h Let v(c) be the second derivative of 13c*5/60 - 3c*2 + 7c. Let l(p) be the first derivative of v(p). Let z(a) = -a. What is z(l(h))? -13h2 Let c(r) = -962r*2 - 4. Let b(k) = 3k. Calculate b(c(u)). -2886u2 - 12 Let a(w) = -17w. Let z(j) = -37j. Let y(p) = 13a(p) - 6z(p). Let c(o) be the third derivative of -7o*4/24 + 2o*2. Give y(c(u)). -7u Let i(s) = -48s2. Let z(a) = -230797 + 230797 + 5a*2. What is i(z(h))? -1200h*4 Let f(a) be the third derivative of 0a + 0a4 - 1/120a*5 + 3a*2 + 0 + 5/6a*3. Let i(m) be the first derivative of f(m). Let g(h) = 6h. Give g(i(b)). -6b Let d(b) = -10b + 404. Let r be d(40). Let z(v) be the third derivative of 0v3 + 9v*2 + 0 + 0v - 1/24vr. Let y(s) = 3s*2. What is z(y(l))? -3l*2 Let i(q) = 4q. Let v be (-112)/(-3) - 2/6. Let h be 38/76 - 18/(-4). Let t(c) = -4c - v + 37 + hc. What is t(i(u))? 4u Let m(k) = 28k*2 + 18k*2 - 48k*2. Let x(y) = 351y. Calculate x(m(c)). -702c2 Suppose 2q + 3q + 55 = 0. Let s = q - -13. Let p(l) = -2l*s - 26l + 26l. Let x(y) = -3y*2. Give x(p(v)). -12v*4 Suppose -4t + 5s = -2541, 4s + 146 = -t + 776. Let l(w) = -tw + 634w + 6w2. Let a(y) = 8y. Let g(m) = -m. Let x(d) = -2a(d) - 18g(d). Give x(l(u)). 12u2 Let z(u) = -3u + 19. Let q(s) be the first derivative of s*3/3 + 95. Calculate q(z(j)). 9j*2 - 114j + 361 Let f(y) = -2y. Suppose -3l + 5h - 5 = 2l, -5l - 3h = -35. Suppose 2x - l = 4. Let q(v) = -4v*2 + 7v*2 + xv*2. Calculate f(q(g)). -14g2 Let k(a) = a2. Let v(s) = -338047s2. What is k(v(p))? 114275774209p*4 Let v(f) = -f. Let a(s) be the third derivative of 53s*4/12 + 304s*2. What is a(v(q))? -106q Let s(a) = -67449a. Let c(o) = 5o + 8. Determine s(c(q)). -337245q - 539592 Suppose -5 = 3b - q, 5 = 2b - 24q + 25q. Let f(a) be the second derivative of -12a + 0 + ba2 + 1/3a*3. Let k(j) = 2j*2. What is k(f(r))? 8r*2 Let u(i) = -10i. Let c(v) = -2v2 - 8v + 51. Calculate u(c(k)). 20k2 + 80k - 510 Let s(h) = -132h. Let k(z) be the third derivative of z5/60 + 3z*2 + 20z. Calculate s(k(x)). -132x2 Let v(l) = l + 26619. Let t(q) = -2q. Give t(v(f)). -2f - 53238 Let y(a) = 2a*2 - 9a. Let d(f) = f*2 - 4f. Let o(q) = 9d(q) - 4y(q). Let p(k) = k2 - k2 + k2 + k2. What is p(o(m))? 2m4 Let h(x) = -18x. Let d(t) be the third derivative of -13t5/60 + 223t*2. Determine h(d(c)). 234c*2 Let l(v) = 2v*2. Let x(y) be the first derivative of -28 + 0y*2 - 4/3y*3 + 0y. What is l(x(j))? 32j4 Let u(t) = -12t. Let s(r) be the second derivative of r*4/24 - 5r*2 + 7r. Let l(g) be the first derivative of s(g). Calculate l(u(q)). -12q Let y(p) = 88p*2 - 89p*2 + p - p. Let d(h) = 65h + 2. Give d(y(w)). -65w2 + 2 Let z(h) = 16h - 10h + 4h + 13h. Let u(j) be the second derivative of j3/3 + 13j. Give z(u(r)). 46r Let y(k) = 0k - 12 - 11 + 28 + k - 13. Let s(f) = 2f. What is y(s(n))? 2n - 8 Let x(v) be the third derivative of v7/2520 - v5/5 - 10v2. Let f(r) be the third derivative of x(r). Let b(a) = 2a*2. Give f(b(d)). 4d*2 Let q(g) be the first derivative of 31g*3/3 + 6g + 9. Let b(j) = -30j2 - 5. Let n(w) = -6b(w) - 5q(w). Let d(z) = z. Calculate n(d(a)). 25a*2 Let v(o) = 11o*2 + 10o + 5. Let s(b) = 18b2 + 16b + 8. Let w(l) = -5s(l) + 8v(l). Let g(h) = -59h2. Determine g(w(k)). -236k*4 Let p(i) = -21i*2. Let l(n) = 4n*2. Let c(d) = -11l(d) - 2p(d). Let t(g) = -61g + 306g2 + 61g - 295g2. Calculate t(c(x)). 44x*4 Suppose -d = -4m + 2, -m - 5 + 3 = d. Let j(f) be the third derivative of -1/12f4 - 7f*2 + 0 + mf + 0f3. Let u(x) = -x2. Determine u(j(o)). -4o*2 Let y(g) = -772g*2. Let t(i) = -57i*2. What is t(y(u))? -33971088u*4 Let c be 0/(716/56). Let b(o) be the second derivative of 0o3 + 0o*2 + 7o + c - 1/12o4. Let t(f) = 2f. Calculate t(b(r)). -2r2 Let m(a) be the first derivative of 4a*3/3 - 1. Let y(w) be the third derivative of 0 + 6w*2 - 1/24w*4 + 0w + 0w3. Determine y(m(h)). -4h*2 Let a(w) = -3w*2 + 3w - 1787. Let g(f) = -7f. What is a(g(m))? -147m*2 - 21m - 1787 Let b(f) = 351330f2. Let r(q) = -5q. Determine b(r(d)). 8783250d2 Let c be 51/12 - 1/4. Suppose -cf + 11 = 3, -35 = -5b + 5f. Let z(v) = 9 - b - 2v. Let d(q) = -5q*2. Give z(d(k)). 10k*2 Let k be 6 + (1/1)/(-1). Suppose -16 = 2d + kz, -2d + 2z + 7 + 5 = 0. Let l(y) = 2y2 - y2 - 2yd. Let h(o) = -o2. Determine h(l(j)). -j4 Let t(q) = 2q + 20q2 - 2q - 24q2. Let x(o) = -7o. Determine x(t(f)). 28f2 Let k(p) = -2p + 57. Let d(f) = -108f. What is k(d(n))? 216n + 57 Let w(a) = -a. Let d(m) = -24m - 13m + 25m + 14m*2 + 16m - 14m. Determine d(w(v)). 14v*2 + 10v Let c(m) = -2m + 85. Let i(g) = g - 2g + 3g - 336 + 336. Calculate c(i(f)). -4f + 85 Let v(l) be the first derivative of 16l2 - 46. Let g(m) = -24m*2. What is v(g(q))? -768q2 Let p(i) be the second derivative of i7/840 + 3i4/4 - 15i. Let h(r) be the third derivative of p(r). Let n(v) = 2v. Give n(h(t)). 6t*2 Let b(a) = 71a*2 + 24639a - 24641a + 4 - 4. Let s(c) = 3c*2. Determine b(s(r)). 639r*4 - 6r*2 Let z(j) = -j. Let g(o) be the second derivative of 0 + 0o*2 - 7/2o*3 + 15o. Determine z(g(u)). 21u Let l(p) = -19p*2 - 2. Suppose -2v + 2u - 8 = 0, 0v = -5v - 5u. Let o(x) = 303x2 + 33. Let f(k) = vo(k) - 33l(k). Let d(a) = -a. Determine d(f(w)). -21w2 Let q(y) be the first derivative of -y2 - 203. Let d(k) = -7k - 3. Calculate d(q(g)). 14g - 3 Let g = 110 - 106. Let s(r) be the second derivative of 0 + 0r2 - 5/6r*g + 5r + 0r3. Let y(z) = 2z*2. Calculate s(y(p)). -40p*4 Let x(z) = -12z. Let i be ((-2)/4)/(3/(-66)). Suppose 0 = -2o - 3o - 2r + 16, 0 = -4o - r + i. Let f(l) = ol2 - 3l + 0l + 3l. Give x(f(t)). -24t2 Let k(c) = -156c. Let s(l) = 17l2 - 56. What is k(s(o))? -2652o*2 + 8736 Let r(a) = -5a + a - 4a + 3a + a. Let q(w) = 6w2 - 5w + 5. Let g(h) = 5h2 - 4h + 4. Let l(m) = -5g(m) + 4q(m). Give r(l(x)). 4x2 Let l(p) = -1. Let b(h) = -h + 6. Let m(x) = x2 - 10x + 12. Let i be m(9). Suppose 0j = -ij + 18. Let v(f) = jl(f) + b(f). Let c(y) = -10y. Give c(v(g)). 10g Suppose 1824 = w - 4v, -v = 2w - 2859 - 816. Let l(b) = -1836 + b + w. Let c(j) = 4j*2. Calculate c(l(y)). 4y*2 Let d(y) be the second derivative of -314y*3/3 - 210y. Let u(k) = k. Give u(d(q)). -628q Let c(a) be the first derivative of -a3/2 - 4a - 4. Let g(v) be the first derivative of c(v). Let h(x) = x + x + 2 - 2. Give h(g(i)). -6i Let l(s) = s2 - 2s. Let f(q) = 2q2 - 5q. Let a(z) = -6f(z) + 15l(z). Let v(t) = 31t. What is v(a(n))? 93n*2 Let n = 12 + -9. Suppose 7c = 6c + n. Let k(o) = -o - o + 3o - co. Let x(l) = 14l. Calculate x(k(i)). -28i Let i(z) = -z2. Let b(k) be the second derivative of -17k3/6 + k2 - 220k. Calculate b(i(d)). 17d*2 + 2 Let r(w) = w + 2277. Let q(u) = 27u*2. Determine r(q(l)). 27l*2 + 2277 Let q(u) = 3u*2. Let c(f) = -51f - 68. Determine c(q(h)). -153h2 - 68 Let l(r) = 4r*2 + 3r - 3. Let b(w) = 7w2 + 5w - 5. Let q(d) = 3b(d) - 5l(d). Let g(y) = -3 + y2 + 13 - 10. Give g(q(n)). n4 Let l(v) = v*2 + 123v. Let t(a) = -340a. Give l(t(x)). 115600x*2 - 41820x Let j(s) = 8s2 + 9s*2 - 19s*2. Let m(r) be the third derivative of -9r*5/20 + 3r*2. Calculate m(j(i)). -108i*4 Let n(t) = -2t - 2. Let c be n(-3). Let j(v) = 5v - 3v - cv. Let x(w) be the first derivative of -25w*3/3 - 345. Determine x(j(k)). -100k2 Let x(h) = h + 20. Let v = 23 + 205. Let o(z) = v - 228 - z. Determine x(o(k)). -k + 20 Let c(l) = l2 + 15l + 5. Let o be c(-16). Let j(q) = -q + q + 0q - oq2. Let x(t) = t. Determine x(j(f)). -21f*2 Let y(t) = -3t*2. Let d(x) = 16x*2 - 3. Let f(h) = 14h*2 - 2. Let a(l) = 4d(l) - 6f(l). What is a(y(o))? -180o*4 Let j(s) = -2624512s. Let m(x) = -2x2. Give j(m(r)). 5249024r**2 Let l(	{ "pile_set_name": "DM Mathematics" }
s(g) = -7g2 + 400g + 5234. Let x be s(-11). Let k = -6 + 12. Calculate kc(m) + xl(m). m*2 + 3 Let r(a) = 11a - 9. Let c(d) = 5d - 4. Let n be (0 - -8)(-3)/(-4). Let y be (-81400)/5830 - (-1 + (-110)/(-106)). Determine nr(p) + yc(p). -4p + 2 Let v(n) = 2 + 4 - 10. Let z(t) = -t - 4. Let o(u) = 3v(u) - 4z(u). Let x(w) = 14w + 12w + 10 + 17w - 33w. What is -12o(c) + 5x(c)? 2c + 2 Let i(n) = -16n2 + 24n - 11. Suppose 59j - 63j = -u + 84, -2j - 5u - 64 = 0. Let p(m) = 3m2 - 5m + 2. Calculate jp(c) - 4i(c). -2c2 + 14c Suppose -35 = 5w - 12w. Let f(k) = 6k - k - 6k*2 + 4k*2 + wk*2 + 4. Let h(x) = -4x*2 - 6x - 5. Determine -5f(c) - 4h(c). c*2 - c Let y(n) = 1. Let r(w) = 8w*3 + 6 - 2 + 0w*3. Suppose 241z = -77z - 318. Determine zr(g) + 4y(g). -8g*3 Let u(n) = 27n*3 + 2n*2 - 5n + 9. Let v(d) = -25d3 - 3d*2 + 6d - 12. Let t(o) = -3u(o) - 2v(o). Let f(l) = -l + 1. Give -3f(k) - t(k). 31k*3 Let k be (1 - 5)2/4. Let d(i) = -7i + 2. Let v(m) = 21m - 7. Suppose -100s - 84 = -192s + 104s. Calculate kv(t) + sd(t). 7t Let r(k) = 31k - 3. Let q(n) = 3 - 29n + 1 + 4 - 63n. Determine 3q(o) + 8r(o). -28o Let t be ((-42)/(-18))/(-45/(-60)). Let c(b) = 7b - 14b - tb - 7b. Let x(w) = 32w. What is 8c(a) + 5x(a)? -8a Let m(t) = -3t - 11. Let d(s) = 5s + 16. Let q(l) = -3l*2 + 5l + 423. Let i be q(-11). Determine id(f) + 8m(f). f - 8 Let a = -276 + 284. Suppose -d + 3 = -4. Let q(w) = 2w + 3 + 2w - dw - w. Let r(j) = -j + 1. Give ar(v) - 3q(v). 4v - 1 Let a = 368 - 362. Suppose -ai - 166 = -184. Let f(x) = 5x. Let p(u) = -4u. Give if(l) + 4p(l). -l Let o(k) = 17k*3 + 6k*2 + 3k + 517. Let f(v) = 23v3 + 8v*2 + 4v + 517. What is 3f(w) - 4o(w)? w*3 - 517 Let y(v) = -530v + 2122. Let j be y(4). Let k(r) = -3r3 - r2 - r. Let n(u) = -11u*3 - 4u*2 - 5u. Calculate jn(d) - 9k(d). 5d3 + d2 - d Let r(l) = -l - 20. Suppose 0 = 151k - 134 - 168. Let j(a) = -3a - 79. Calculate kj(p) - 9r(p). 3p + 22 Let w(z) = 2z3 - 4z*2 + 4z. Let a(y) = 2y3 - 3y*2 + 3y. Suppose 0 = -12g - 5 + 17. Let h be (4/(-5))/((-7 + g)/(-30)). Give ha(q) + 3w(q). -2q3 Let t(n) be the second derivative of n5/20 + n*3/6 + 2n*2 + 243n. Let q(r) = -3r3 - r - 7. Give 3q(v) + 5t(v). -4v*3 + 2v - 1 Let q(l) = -8l2 - 3. Let d(t) = -1. Let z(f) = -f2 - 3f - 1. Suppose -74 = 13c - 35. Let u be z(c). Give uq(k) + 3d(k). 8k*2 Let d(v) = 954440v*3 + 2453v*2 - 103026v + 2453. Let l(x) = 1557x3 + 4x*2 - 168x + 4. Calculate -4d(h) + 2453l(h). 1561h3 Let w(j) = 5j*3 + 17j*2 - 17j + 1011. Let p(b) = b*3 + 4b*2 - 4b + 253. What is 17p(h) - 4w(h)? -3h3 + 257 Suppose -2g + 10 = -0. Let k(w) = 15w + 14w - 9 - 50w + 9w + 6w. Let c(p) = -3p - 5. Give gk(a) - 9c(a). -3a Let w(h) = 743h*2 - 20h + 10. Let y(q) = -1115q2 + 32q - 15. Give -8w(n) - 5y(n). -369n2 - 5 Let a(m) = -m - 1. Let w be (-8)/(-6) - 6/18. Let b(g) = 2g*3 - 144g*2 - 3g + 220. Let z be b(72). Let v(y) = 11y + 2. Determine wv(d) + za(d). 7d - 2 Let m(s) = -s - 1. Let y(g) = -9g - 5. Suppose 183 = 2x + 7. Suppose x = -4v + 2v. Let w = -50 - v. Calculate wm(a) + y(a). -3a + 1 Let i(b) = -8b3 - 4b*2 - 6b - 2. Let d(t) = 15t3 + 9t*2 + 13t + 5. Give 2d(v) + 5i(v). -10v3 - 2v*2 - 4v Let w(q) = -592q - 10 - 597q + 1180q + 9. Let p(l) = l. Let y be (-4)/(-14) + 5/7. Calculate yw(g) + 3p(g). -6g - 1 Let b(y) = -25y + 11y - 891y2 + 15y + 890y2 + 1. Let i(x) = 8x*2 + 6x + 6. Determine -6b(v) + i(v). 14v*2 Suppose 4s + 5 - 41 = 5b, 5b = -s - 41. Let f(k) = -k - 18. Let x(r) = 3r + 54. Determine bf(w) - 3x(w). -w - 18 Let t(i) be the first derivative of -3/2i*2 - 6i - 2/3i3 + 29. Let h(j) = -j - 1. Let b be (-4)/(-10) - (-576)/160. Calculate bh(z) - t(z). 2z2 - z + 2 Let y(n) = 5688n + 17696. Let b(j) = -28. Give -632b(l) - y(l). -5688l Let r(n) = -8n2 + 130n - 2. Let q(f) = 8f2 - 156f + 2. What is -4q(t) - 3r(t)? -8t2 + 234t - 2 Let g(v) = 21571v - 319. Let s(l) = 814l - 12. Calculate 5g(z) - 132s(z). 407z - 11 Let p(i) = -16i*3 + 13i*2 - 18i + 2160. Let n(j) = -7j3 + 6j*2 - 8j + 1083. Determine 9n(d) - 4p(d). d*3 + 2d*2 + 1107 Let y(p) = 23p*2 - 5p + 5. Let c be -8 + 23 + 42 + (-9 + 0)/3. Let x(q) = 252q2 - 54q + 54. Calculate cy(v) - 5x(v). -18v2 Let h = 83 - 78. Suppose 0 = 3i + y - 2, hy + 6 = -i + 6y. Let p(a) = -a. Let n(x) = 2x - 1. What is in(s) - 4p(s)? 2s + 1 Let m(w) = -3w2 + 3. Let b be (-22625)/(-35) - (-12)/(-28). Let l = b - 648. Let x(v) = 1 + 12 - 1 - 13v*2. What is lx(z) + 9m(z)? -z2 + 3 Let x(n) = -7n*3 - 19n*2 - 2n + 1873. Let r(l) = 2l3 + 5l*2. Give 4r(h) + x(h). h3 + h2 - 2h + 1873 Let l(t) be the third derivative of 0t*5 + 0 + 1/30t*6 + 0t - 7/24t4 - 5/3t*3 + 146t2. Let y(w) = w3 - 2w - 3. Determine 2l(s) - 7y(s). s3 + 1 Let c(z) = -2z + 0 - 1 + 5z + z + 0 + 2z2. Let a(o) = -o2 - o + 1. Let m(y) = -6y - 103. Let g be m(-17). Calculate gc(q) - 3a(q). q2 - q - 2 Let i(c) = -6c + 40. Let q(f) = -565 + 1284f - 1279f + 525. What is -6i(g) - 7q(g)? g + 40 Suppose v + 6n = 2n - 35, 3v = 5n - 71. Let m = v + 26. Let u(a) = -a2. Let z(i) = -i3 - 2i2 - 2i. Give mz(o) + u(o). o3 + o2 + 2o Let i(w) = -18w2 - 16. Let t(c) = -37c*2 - 36. Calculate 5i(l) - 3t(l). 21l2 + 28 Let u(j) = -j2 + j - 1. Suppose -18 = 3t, -3t + 5t + 87 = -5w. Let i(r) = -3r3 - 3r*2 + 3r - 3. Give wu(z) + 5i(z). -15z3 Let y(c) = c2 - 402c + 17. Let w(v) = 3v + 3. What is 5w(r) - y(r)? -r*2 + 417r - 2 Let s(r) = -r3 - r2 - 4r. Let c(w) = 322w*3 - 5w*2 - 20w - 1. Determine -c(y) + 5s(y). -327y3 + 1 Let p(s) be the second derivative of s3/3 - 3s - 387. Let w(c) = 15c + 2. Determine 14p(u) - 2w(u). -2u - 4 Let l(m) = -118m*2 + 4m - 27. Let x(g) = -114g2 + 4g - 35. Calculate 4l(c) - 3x(c). -130c2 + 4c - 3 Let g = -33776 + 33787. Suppose 3b - 2q = 0, -4b + 4 = -q + 9. Let z(r) = -r - 8. Let x(s) = -6s - 41. Calculate bx(l) + gz(l). l - 6 Let v(m) = m*2 - 2m - 1. Let g(f) = -3f2 + 6. Let b(r) = g(r) + 2v(r). Let n(h) = 2h2 + 5 - 2h - 2 - 3h2 - h. Determine -3b(d) + 4n(d). -d2 Let i(s) = 48s + 10. Let b(k) be the first derivative of -16k2 - 7k - 854. Calculate 7b(d) + 5i(d). 16d + 1 Let a(n) = 4n*2 + 7n + 9. Let i(c) = 3c2. Let t(d) = 14d*2 - d - 1. Let p(g) = -5i(g) + t(g). Give a(f) + 6p(f). -2f*2 + f + 3 Suppose -7b + 16 = -3b. Suppose -2n + 7n = q, 0 = 4q - 5n - 15. Let x(a) = 6a + 0a + a - q - ba. Let l(t) = 2t - 4. What is 5l(w) - 4x(w)? -2w Let c(b) = -6b3 + 2b*2 - 15b - 7. Let o(d) = -d - 11d - 2 + 5d*3 + 7d + d*2 - 7d*3. Calculate -2c(w) + 7o(w). -2w*3 + 3w*2 - 5w Let y(t) be the second derivative of -t*3 - 3t*2/2 + 2t + 4456. Let l(a) = -11a - 7. What is -4l(o) + 7y(o)? 2o + 7 Let p(l) = 6l2 - 2l - 1. Let y(x) = -15x2 + 4x + 2. Let v(f) = -2p(f) - y(f). Let s(a) = -a2. Determine -4s(w) - v(w). w*2 Let x(u) = -2u - 9. Let r(c) = 1302c - 53. Determine r(l) - 6x(l). 1314l + 1 Let o(w) = -w3 - w2 - w + 1. Let d(x) = -x2 - 4x + 1021. Let s be d(30). Let g(f) = 4f3 + 2f*2 + f - 1. Determine sg(m) + 2o(m). 2m*3 - m + 1 Let t(k) = 9k*3 - 3k*2 + 3k. Let o be (-42)/(-714) - 86/17. Let j(s) = 17s3 - 5s*2 + 5s. Give ot(h) + 3j(h). 6h3 Let x(l) = l. Let y(o) = 1 - 7o + 37o - 10o - 12o - 9o. Let u be 4/(-2) - (6 - 10). What is ux(w) + y(w)? w + 1 Let p(t) = 1929t + 1616. Let j(o) = 119o + 101. Determine 33j(n) - 2p(n). 69n + 101 Let i(p) = -1021972p2 + 1130. Let n(m) = 3624m*2 - 4. What is 2i(h) + 565n(h)? 3616h*2 Let t(g) = g + 9. Let s(q) = -387q + 1539. Let b be s(4). Let j(x) = -x*2 - 4x - 35. Calculate bt(h) - 2j(h). 2h2 - h - 11 Let z(w) = -18w*3 + 4w*2 - 8396w. Let b(s) = -22s3 + 5s*2 - 8395s. Give 4b(t) - 5z(t). 2t3 + 8400t Let p(x) = 9x + 7. Let n(g) be the second derivative of -g + 13/6g*3 + 5g**2 +	{ "pile_set_name": "DM Mathematics" }
Let m be h(-14). Solve -m = p + 4s, 4p = 2s + 2s + 12 for p. -2 Let y(b) = -4b - 1. Let i be y(-2). Let x be ((-36)/60)/((-1)/5). Solve -5 = -v, -5c + i = 4v - x for c. -2 Let d(r) = -r3 + 3r - 4. Let h be d(-3). Let k(t) = -t*3 - 2t*2 + t + 2. Let j be k(0). Solve h = -2q + 5i, 2q - 9 = -ji + 5 for q. 3 Let b be 28/4 - 21. Suppose -70 = -bd + 2l, -2d - 2l = 3d - 50. Solve 2p + 2i - d = 0, 2p - 3i + 12 = i for p. 2 Suppose -w = -2 + 8. Let a = -14 - w. Let o be (a - -5)/((-3)/4). Solve -c + 2u - 4 = -oc, c - 2u = -4 for c. 0 Let q = 31 + -31. Suppose 0 = x + 3b - 4, -4x + b = 3b + 34. Let w = 16 + x. Solve -3y = q, wm - 5 = -y + 10 for m. 3 Let u(c) = -3 + 2c + 0 + 4c - 5c. Let d be u(7). Solve -12 = -dt + t, 2n - 3t + 22 = 0 for n. -5 Let z(k) = k - 4. Let i be z(9). Solve ic + 11 = 2h - 3, 0 = -4h - 2c + 4 for h. 2 Suppose 4r - 18 = 2. Suppose -3n + rj - 4 = -43, 0 = -2n + 3j + 27. Solve -2v = -2w - n, 0 = -3v - 7w + 4w + 3 for v. 5 Suppose f - 1 = -5u + 1, -2f + u - 7 = 0. Let q = 1 - f. Solve 16 = -qv, -m - 3m - 20 = 3v for m. -2 Suppose -9n + 168 = -2n. Solve -n = 7j - 3j - 5v, 3v - 17 = 5j for j. -1 Suppose -5o + 2o = -15. Solve -2q - 9 = -4r + 13, 2q + 26 = or for q. -3 Let i = -36 + 38. Solve -10 = -2z - il, 5 = z + 2l - 0l for z. 5 Let q(i) = i2 - 8i + 11. Let t be 57/6 - 1/2. Let z be q(t). Solve -2r + 4r - z = -2g, 3r = g + 10 for r. 5 Let l = 1 - -1. Let i be -15/(-2)2. Suppose 6 = 4a + l, -n + ia = 1. Solve 0 = 5c + 20, 0v - 16 = -nv + 3c for v. 1 Let z(a) = a*3 - 14a*2 + 12a - 4. Let p be z(13). Let h = p - -25. Solve 2c - 4 = -q, 4c = -q + 5q + h for c. 2 Suppose 5n + 5 = -0. Let g be (-2 + 1)3/n. Let l be -2 + -2 + 6 + 1. Solve 2x - 4k = -x - g, -15 = -2x - lk for x. 3 Let n(u) = u3 - 13u*2 + 2u - 24. Let k be n(13). Solve -d = kz + 13 - 4, -z - d = 7 for z. -2 Let p(t) = -t3 - 6t*2 - 6t - 4. Let u be p(-5). Let o = -1 + u. Suppose 15 = 3r - or. Solve -3z - 5f = 21, f - 2f - r = z for z. -2 Let t = 78 - 69. Solve -f = k + 6, -4k - f - t = -2f for k. -3 Let y be 2/7 - (-270)/(-14). Let q be y/(-4)(1 - -3). Suppose -3 - 3 = 2g + 3z, -g + 5z + 10 = 0. Solve -b + 5f + q = g, -2b + b - 4f - 8 = 0 for b. 4 Let d be 48/(-40)40/(-3). Let n = -11 + d. Solve 0 = -nl + 5, -3r + l = -0 - 2 for r. 1 Let y = -23 + 27. Solve -f - 5c + 6 = -1, -14 = -5f - yc for f. 2 Suppose 2z - 16 = -4j, -4z - 4j = z - 28. Solve -r - 2 = -p, -5p + 2r + z = -2p for p. 0 Let f be 4/2 - -4(-2)/4. Solve 3x - 4g - 13 = 0, f = 4g - 7g - 12 for x. -1 Let w(g) = g + 1. Let j be w(-1). Let b(i) = -i*2 + 10i - 4. Let k be b(8). Let s = 17 - k. Solve m + sx + 15 = j, -2m - 15 = -0m + 5x for m. 0 Let j(t) = t*2 + 3t - 3. Let k be j(-5). Solve -4h = 3b - 31, h + 3b = 3h + k for h. 4 Let x(w) = w*2 + 21w + 54. Let j be x(-18). Solve -3 = d, -5b - 2d - d - 24 = j for b. -3 Let s = 1 - -4. Suppose 4y - 32 = -sk, 0 = 4k + 4y - 2y - 22. Solve 16 = -4l + 2i - 0i, kl + 3i + 16 = 0 for l. -4 Suppose -420 = -0o - 5o. Suppose -c + 2n + o = 3c, -20 = -5n. Solve -2t + c = -3u - 6t, 3u + 21 = -3t for u. -5 Let t = -43 - -78. Suppose 0l - 5l = 0. Solve 3u + 3 = -x + 10, -5u + 3x + t = l for u. 4 Let j(w) = -4 + 0w2 - w3 + 3w2 + 2. Let x be j(2). Suppose xi - 6 = -i. Solve -m + 22 - i = 4b, 0 = -4m + 16 for b. 4 Let b(q) = q*2 - 7q + 7. Let o be b(6). Suppose 0 = -2a + 3 - o. Solve 3j - 2m - 2 = -j, -2j - m = a for j. 0 Let k be (-6)/24 + 2/8. Suppose kt + t + 1 = n, 4t = -2n + 26. Solve x + 13 = 2x + 4q, 2q - t = 0 for x. 5 Let a = 10 - 6. Suppose 0 = af - 38 - 10. Solve -9 = -3d + 5q - 4q, -4d + f = -5q for d. 3 Let k(v) = v + 3. Let w be k(-8). Let g(u) = -3u + 9. Let t be g(6). Let l = w - t. Solve 2h - 4 = 0, 0r - 3r = -lh + 14 for r. -2 Suppose 5f - 3 = 4f. Solve -6k = -2k + fs, 4s = -3k for k. 0 Suppose 4v + 29 + 11 = 5y, 5v + 29 = y. Let z be y/(-2) + 2 + 7. Solve 5t + 5c + 15 = c, 0 = 2t - c - z for t. 1 Let l = -2 - 1. Let o = l - -5. Solve 5c + r + o = 8, 2c - 4 = -2r for c. 1 Suppose 2v - 1 = v. Let n = -1 - v. Let y = n + 7. Solve -3a + 6 = 0, yo - 11 = -5a + 2a for o. 1 Suppose -5w = 2h - 7h - 125, 5w = 2h + 134. Suppose -4y + w = -8. Let m be (-64)/(-36) - (-2)/y. Solve -3z = g + 8 - 1, mz = g + 2 for g. -4 Suppose 2x + 12 = 3t, -x - x - 2 = 2t. Suppose 0 = -0m - tm. Solve -4 = -0w + 3w + 2q, 3w + 5q + 10 = m for w. 0 Suppose 9 = 3i - 6. Solve r - 6 = -c, 5r + 0r = ic + 10 for r. 4 Let q = -6 + 18. Solve 0 = 3n - 2c - 2c - q, 5n - 5c - 20 = 0 for n. 4 Let w be ((-12)/(-8))/(2/4). Solve -4t = 2y - y, wt - 3y = 0 for t. 0 Let r be 15 - (4/(-2) - -4). Suppose -r = -3s + 5. Let y be 3 - (-3 - 0 - -3). Solve si - i + 9 = 2c, -11 = 5i - yc for i. -1 Suppose 3d - 32 = 4k - 8, -5k = d + 11. Let c = 27 - 27. Suppose 5q = -cj - dj + 12, 0 = -5q + 3j + 26. Solve 2 = 4a - 3y, -qy = -4a - 0y for a. 2 Suppose -3h + 18 = -0h. Suppose 0 = -3c - 2s + 18, -hs = -3c - s + 18. Solve 3v - 3p + 5p + 15 = 0, 5v = 3p - c for v. -3 Let j = -146 - -146. Solve j = -3c + t - 1, -c + 4 - 7 = -t for c. 1 Suppose 0 = 3l - 5 - 1, 5h = 4l + 2. Suppose -3q - 23 = 2s - 7s, 4q + 22 = -hs. Let x = -2 - q. Solve -7b + 4 = -4b - a, 0 = -5b + xa + 2 for b. 2 Let r be (12/(-4))/(3/(-4)). Let y = 63 + -59. Solve -yh = -4m + 10 - 30, 3h - 8 = -rm for m. -1 Let i be 50/(-6) + (-6)/9. Let w be 1 + 0 - (i - -7). Solve 4x - 6s + s = 41, wx + s = 7 for x. 4 Let m be (-2 + -3 + 4)-1. Suppose 9 - m = 2s, -2s + 65 = 3f. Solve 0 = v - 5w - f, -2v + 4w - w = -10 for v. -1 Let n(i) = -3i*2 + 2i + 4. Let q(l) = 4l2 - 3l - 4. Let f(b) = 3n(b) + 2q(b). Let u be f(0). Solve 3s = uj + 4s - 4, 6 = -3j - 3s for j. 2 Let p(m) = m3 - 2m*2 + 2m. Let v be p(2). Let n be ((-4)/(-2))/(-2) - 1. Let d = n + 10. Solve 5u = -x - 2, -2u = 3u - vx - d for u. 0 Suppose 5g + 2y - 13 - 11 = 0, 22 = 4g + 3y. Solve 0i = -2d + 5i, 14 = -gd + 3i for d. -5 Let b = -3 + 11. Solve 3q - b = -l + 3l, 0 = -2q - 4l for q. 2 Suppose 12 = 3y + 3o, -2o = -3y + y + 28. Let p(f) = f - f - 3 + y + f. Let m be p(-3). Solve mj + 1 = -2v - 3, -5j - 5 = 3v for v. -5 Let a(g) = -13g + 107. Let k be a(8). Let f(y) = -y + 6. Let s be f(3). Solve 4j = -12, -sd - kj - 17 = -5d for d. 4 Let s be (-2)/6 + (-20)/(-6). Let f be (12-1)/(6/(-4)). Suppose -d = 3k - 18, -4k = -d - 5k + f. Solve 4m + dw = sm - 3, -m = 2w + 2 for m. 0 Let r(j) = -1 + 0 - 49j2 - 4j + 45j2 + j3. Let y be r(5). Solve 3u - 17 = -yp, -4u + 8p - 4p = -4 for u. 3 Let l(i) = 6i - 9. Let f be l(9). Suppose f = 5r - 15. Solve y = -4d - 3, -4d = y + 3y - r for d. -2 Let p = 125 - 122. Solve -2f = -4b + 5 + 1, pf + 5b + 20 = 0 for f. -5 Suppose 36 = 5z + f - 3f, -4z + 21 = f. Let i be (-4)/z - 55/(-15). Solve 5g + 19 = a + a, 0 = 2g + ia + 19 for g. -5 Suppose 0 = 5j - 16 + 6. Suppose -jg - 5u = g - 59, 0 = 3g + 4u - 55. Solve -5a - 3m - 6 - g = 0, 2a = -5m - 19 for a. -2 Let p be (-4)/(-6) - (-64)/(-6). Let g(r) = -r*2 - 6r + 14. Let l be g(-6). Let j = l + p. Solve -d + 2d - 5a = 11, -jd - 4a - 4 = 0 for d. 1 Let j(p) = p*2 - 8p + 12. Let a be j(8). Solve -3i - 2z = -a, -5z = -2i - 10 - 1 for i. 2 Suppose q + q = 8. Suppose 5p - 29 - 1 = 0. Let s = 7 + p. Solve -3l = -0l - qb - s, -5l - 9 = b for l. -1 Suppose 11z - 4 = 9z. Solve -zm + 16 = -2t + 3m, -2t = m - 8 for t. 2 Let k be (-390)/(-95) - (-4)/(-38). Suppose -4v = -13 - 3. Solve 22 = -ki - s + vs, 0 = -3s + 6 for i. -4 Let z(s) = -3s - 2. Let u be z(-4). Suppose f - u + 5 = 0. Let m be ((-22)/(-5) - 9/(-15)) + -2. Solve 0d + 3d = fx + m, -5 = -d + 3x for d. -4 Suppose 3j = 4c + 92 + 3, 3j - 3c - 90 = 0. Solve 0 = -5a - 2t + 3t + j, 12 = -2a - 4t for a. 4 Suppose -4t = 2o - 36, 2t - 13 = -4o + 5. Let n = 5 + t. Solve -4 = -0b - 4b + 2m, n = 2b + 5m for b. 2 Let q(h) = -2h + 21. Suppose -f = -15 + 6. Let r be q(f). Solve -8 = -k + rd, 2d + 3 = 4k + 1 for k. -1 Let v(s) = 5s*2	{ "pile_set_name": "DM Mathematics" }
26. Let k be ((-3)/(-9))/(1/6). Solve -ci = -kj + o, -3 = i - 2j + 4 for i. -5 Suppose -5i - 11i + 48 = 0. Let t = 4 - 2. Solve -6 = -ip, -r - 3p = tr + 9 for r. -5 Let h be (-1 - 2)8/(-6). Suppose -o - 71 - 37 = 5z, -78 = o - 5z. Let a = -85 - o. Solve -4u - 8 + h = -2q, -4q + 4u + a = 0 for q. 2 Let r(b) = 5b - 42. Let j be r(9). Suppose 45 = 5c + z, 0 = -5c + 3z - 0z + 25. Suppose c = -i + ji. Solve 4 = -is + 3f, f = 1 - 5 for s. -4 Let c be ((-1)/2)/(7/(-28)). Let n be ((-4)/3)/((-2)/6). Let h = -34 + 40. Solve -nz = 4b - h - c, 0 = 4b + 3z - 7 for b. 1 Let l = -689 + 691. Solve 10 = 2b - 3h + 2h, 0 = 3b + lh - 1 for b. 3 Suppose 0 = 7x - 11 - 59. Suppose 4z - x = 2z. Solve -3u + 5 = 3a + 32, 0 = -zu + 4a for u. -4 Let c(l) = l2 + 2l - 4. Let f be (-7 - -5)(1 - -2). Let q be c(f). Solve -4j + r - 8 = -3r, 5j - q = -r for j. 3 Let s = -262 - -262. Solve -20 = -3p + n, 3p + 4n + s = -5 for p. 5 Let d(c) = 21c + 55. Let p be d(-7). Let a = -89 - p. Solve -4f - 2j = -16, 0f - aj - 16 = -4f for f. 4 Let j(x) = -x2 + x + 46. Let a be j(7). Solve -q - 4 = q + 2k, 14 = -aq + 2k for q. -3 Suppose 2r + 4 = 8. Let l be 8/(r + -6) + 2. Suppose l = -3n + 6n. Solve x = c, n = -4x - 0c - 3c + 7 for x. 1 Suppose 4n + 88 = -5g, 4g - 3n = -24 - 34. Let v be (1 - 25/20)g. Solve 3f = 2f + 2c + 13, vc = -5f - 5 for f. 3 Let d(a) = 4a + 1. Let q be d(1). Solve 5l - 4f + q + 12 = 0, -15 = -5f for l. -1 Suppose 1 - 4 = -2n - t, t + 1 = -n. Let i = n - -9. Suppose i = -g + 15. Solve -3l = -gf + 2, -1 - 13 = -l - 3f for l. 2 Let x = 109 - 105. Solve 2r + 2 = -xp, r + 2p = 2r - 3 for r. 1 Let v(c) = c*2 - 9c + 11. Let y = -13 - -21. Let d be v(y). Let z = 45 + -41. Solve -dt - 9 - 3 = b, -zt - 35 = -5b for b. 3 Suppose 23b = -30b. Solve 4p - 8 = -4m, 3m + 2p - 6 - 1 = b for m. 3 Let x(s) be the first derivative of -s4/4 - 4s*3/3 - 4s*2 - 13s - 26. Let g be x(-3). Solve -p + 3 = -4q + 4, 12 = -2p - gq for p. -5 Let p(o) = o2 - 8o + 18. Let w be p(4). Solve 5f - 5 = 5g, 3f + wg + 14 - 2 = 0 for f. -2 Let q be (2 + -1)(23 - 13 - 7). Solve 2u + 2d = -d - 23, 3u = -qd - 27 for u. -4 Let p be (0 - 8)/((-4)/16). Let i = -31 + p. Solve -3m - 3 = -2m - a, -a = m - i for m. -1 Suppose 2b = 4z - 14, 0 = -z - 0 + 5. Suppose -ba - 4j = -2, -17 = -3a + 4j + 17. Solve -2o - 2 = 2c - ao, 3c - o = 2 for c. 1 Suppose -541x + 51 = -524x. Let a = 9 + -4. Suppose r + 3 = ao + 5, -3o - 2r + 4 = 0. Solve -9c = -v - 5c - 2, o = xv - 3c - 3 for v. 2 Suppose 17 = 5k - 3x, -5k + 5x + 26 = 11. Solve 0 = -5t + 15, kn = -t - 5 - 0 for n. -2 Suppose 1 = -4k + 3b, k + k - 7 = -b. Suppose -3x = -25x + 52 + 80. Solve 4d = 2d + 5n - 18, 0 = -kd - n + x for d. 1 Suppose 1972 = -2k + 1984. Solve -2w + 2t + k = 4t, 3t = 12 for w. -1 Let r(l) = -l2 - 5l + 31. Let w be r(-7). Suppose 0 = 14h - 59 + w. Solve 0 = -2j - hx - 12, -j - j + 8 = -2x for j. 0 Let o be (-360)/(-50) - (-1)/(-5). Suppose -o = 2z - 53. Solve 2n + 6 = -2s, 5n = 4s - 10 - z for s. 2 Let n = -59 + 54. Let f be (0 + 1)(-3 - 2). Let p = n - f. Solve 2o + 2u + pu = 12, -4o + 21 = 3u for o. 3 Let s(f) = -f3 + f2 + 11f + 8. Let i be s(4). Solve 0 = 3t + w + 20, i = 5t - w + 24 for t. -5 Suppose 5s - 5w - 30 = 0, w - 2w = 3s - 6. Let t be ((-6)/4)/((-1)/(-2)). Let j be 1/t + 98/6. Solve 2x + 2n + n + j = 0, -x - 11 = sn for x. -5 Let t be (-1)/((-104)/432) - 6/39. Solve -2x + 5i = -28, t = 4x + i + 2i for x. 4 Let x be (-5)/2(-114)/3. Let b = 134 - x. Let q = -32 + b. Solve -22 = 3f - 4w, q = f + 5w - 11 for f. -2 Let u = 12 + -8. Let o be 3/u + 74/8. Suppose -o = 4n + 2t, 0 = -n + 3t - 0 + 15. Solve n = -2d, 5a + d = 6d + 25 for a. 5 Let f(u) = 16u + 3. Let k be f(1). Solve 3l + 2 + k = -3b, 4b = l - 13 for l. -3 Suppose -y = -2u - 13, 4u = 5y - 0y - 41. Let w be (-7)/(-2)((-1672)/(-133) + -12). Solve -1 = x + wp, -yp + 2 = 2x + 2x for x. 3 Let f be (-1)/(1 + -2) - -1. Suppose 2b + k = f, k = 4b - 7b + 1. Let q be b + (-18)/(-3) - 3. Solve 0 = qw + u - 7, 1 = 3u - 2 for w. 3 Let u = 879 + -857. Solve -5j = -j + 2z + u, 18 = -j - 3z for j. -3 Suppose -9f - 345 = -363. Solve n + 10 = -5b - fn, 4b = 4n + 24 for b. 1 Suppose -8l = 252 - 316. Solve -12 = 4h + 11x - 9x, -4h = x + l for h. -1 Suppose 0 = 6t + 2t + 64. Let k be (-2 - 6)(-1 + (-4)/t). Solve -3o + kj = -5, -2o + 4j = 2j for o. -5 Let j be 2/7 + 120/70. Suppose -w = 2w - 3h + 3, -h = -3. Let l be (1 - -1) + (0 - -26). Solve -4m = -wr - l, -jm + 10 = r + 4 for m. 5 Suppose 47 - 2 = 9x. Solve -3h + z + 5 = 0, h - xz + 7 = 2h for h. 2 Let u be (-22)/4 + 2/4. Let d be u - -2 - (8 - 14). Suppose 5 = do - 10. Solve 4f + r - 9 = 0, 5f - 2r + or - 20 = 0 for f. 1 Suppose -16 = 7w - 11w. Suppose wb - 15b + 55 = 0. Solve 0 = -3y - 3x + 25 - 7, -y = bx - 14 for y. 4 Suppose -2u = u + 15, 2u + 2 = -4j. Solve h + 3i + 9 = 0, 2 = -5h + ji + 8 for h. 0 Let g be ((-12)/(-10))/(30/50). Solve -4c + 10 = 5o, 2c + 4o - g = -0o for c. 5 Let d = 0 - -4. Let f = 282 - 281. Let w be (30/(-6 - -11))/2. Solve -9 = 5r - ws, -ds + 0 = -3r - f for r. -3 Let k be (-67)/5 - (-6)/15. Let f = -37 - -21. Let v = k - f. Solve vb - 12 = -p, 5b - 3p = 2p for b. 3 Let l(y) = -y*2 + 6y - 4. Let f be l(3). Suppose -15 + 0 = -fv. Let q be 9 - (-2 + 2 + -2). Solve 3m - 3w + 6 = 0, vw - w = -3m - q for m. -3 Let x = 26 - 18. Let w be (-28)/(-10) - x/(-40). Solve -wq + 4d + 22 = 0, -q + 2d - 1 + 11 = 0 for q. 2 Let u be (2 - (-15)/(-9))12. Suppose 1259z = 1248z + 121. Solve -o - z = -2s, 0 = -us + 2o + o + 25 for s. 4 Suppose 3c - 17 = -y, 2y + y + 4c - 26 = 0. Solve 3r - 24 = 3z, -yz - 4 = r + 3 for z. -5 Suppose 10 = 3i + 3v - 5, 0 = 2v - 6. Let p be (-2 + i)2/4. Let t = p + 4. Solve 3s = -5b + 2b + 12, tb = 4s for b. 2 Suppose 3y - 428 = y. Let k be (-18)/81 + y/(-9). Let g = k - -36. Solve -2d = -2l - g, 4d + 5l + 12 + 0 = 0 for d. 2 Let w = -3 + 10. Let o = -9 + w. Let t be o/(-8) - (-22)/8. Solve tu - z - 6 = 0, -16 = u + 4z - 5 for u. 1 Let r be 100/30 - (-8)/12. Solve -4m = -5a - 6, -2m + 5a - r = -2 for m. 4 Suppose -5q - m = -3q - 12, q = -3m + 16. Solve -3b = 3h + q + 17, -4b - 5h = 32 for b. -3 Let s(v) = -4v + 44. Let f be s(9). Suppose 3g - 7 - 2 = 0. Solve 0 = -4q - 4, -g - f = -3i + 5q for i. 2 Suppose 3p - 9 - 3 = 0. Let l be (-2 + -1)/((-9)/66). Let b be 9 + -4 + -1 + 0. Solve -br = 2f - l, 2f - 26 = -r - pr for r. 4 Suppose 0 = -32q + 36q - 4. Let n be 1 - (-10)/4 - q/(-2). Solve -5i = nu - 31, i - 2u - 7 = -4i for i. 3 Let h be ((-2)/(-25))/(5/175). Solve -h = -2r - 4s + 3s, -2r - 5 = 5s for r. 5 Let u = -130 - -190. Suppose 9a + u = 14a. Solve 2m - a - 18 = 4f, 0 = 4m - 2f - 30 for m. 5 Let p be (-10)/45 + 208/(-36). Let y be (-3)/p - (-27)/6. Solve 0 = -3u + 2b + 17, 3u - 29 = -0b + yb for u. 3 Let n = 14 - 39. Let b = 31 + n. Solve 12 = -3f - 0k - k, b = 2k for f. -5 Suppose 2g - 6 + 1 = f, 0 = -4g + 4f. Suppose -17z = -16z - 20. Solve -3h + 27 = -0h - gu, -4u = -2h + z for h. 4 Let f(j) = -j3 - 13j*2 - 9j + 40. Let n be f(-12). Solve -2i - na - 6 = 0, 9 = -2i + i + 4a for i. -5 Let d(o) = -8o - 28. Let v(b) = -16b - 55. Let w(p) = -13d(p) + 6v(p). Let l be w(-4). Solve lk = 4u - 3k + 35, -2k + 6 = 0 for u. -5 Let g = 62 - 54. Suppose -4y + 5v = -y - 16, g = -4v. Let i be 2/(-6) - 14/(-6). Solve yj = 4p - ij - 4, j + 1 = -2p for p. 0 Let n = -14 - -29. Suppose -n = -4f - f. Suppose -fc = -11 - 1. Solve q + 5m + 18 = 0, 25 + 2 = -cq - 5m for q. -3 Let d = -157 + 93. Let c be d/486/(-4). Solve -5b + 0 = -cl + 35, 15 = -3b for l. 5 Suppose 5r = r + 12. Suppose -rt - 4c = 17, 22 = -3t + 2c - 7c. Suppose 6j = -9j. Solve l + 3 = -2u, j = -3l - 4u - 12 + t for l. -5 Suppose -5h + 70 = 7c - 2c, -4h + 5c + 47 = 0. Let i be h + -5 + 1-2. Let s be 10/3 - 2/i. Solve -2p + 5u = -p + 20, 4u - 5 = sp for p. 5 Let q = 1143 + -1141. Solve -2u + 3f + q = 11, 3 = u + f for u. 0 Let g(d) = 3	{ "pile_set_name": "DM Mathematics" }
3r2. -1226r*2 + 2 Collect the terms in 2f + 4455f2 - 2183f*2 - 2232f*2. 40f*2 + 2f Collect the terms in 14c2 - 1524c + 15c2 - 2726c + 4250c - 22c*2. 7c*2 Collect the terms in -145116q*2 + 412371q*2 + 581146q*2 - 50484q*2. 797917q*2 Collect the terms in -1077q + 3108q - 2042q. -11q Collect the terms in 15v*3 - 930v*2 + 16v*3 - 418v + 930v2 + 7 + 418v. 31v3 + 7 Collect the terms in -q - 5q - 5q2 - 300 + 6q - 1596. -5q2 - 1896 Collect the terms in -59913u + 10 + 120006u - 60090u + 17. 3u + 27 Collect the terms in 712i*3 - 151i*3 + 3 + 73 - 559i*3. 2i*3 + 76 Collect the terms in 582 - 1162 + 147754g*2 + 580. 147754g*2 Collect the terms in 6q*2 - 2439q + 0q2 + 739q - 4q2 + 850q + 850q. 2q*2 Collect the terms in -7o*3 + 433835o*2 - 220989o*2 - 212846o*2. -7o*3 Collect the terms in 533y*2 + 1059y - 2126y + 1096y. 533y2 + 29y Collect the terms in -44r2 - 268r*3 - 48r*2 - 21r*2 + 113r*2. -268r3 Collect the terms in 375 - 180 + 391 - 103 + g2. g*2 + 483 Collect the terms in 426 - 855u*2 - 838u*2 - 509 + 1692u2. -u2 - 83 Collect the terms in -18093y2 + 30 - 48 + 18. -18093y*2 Collect the terms in 44g*2 - 39g*2 - 45851 + 22913 + 22938. 5g*2 Collect the terms in 147653 + 147657 - 295310 - 26n*2. -26n*2 Collect the terms in 54 - 20880f - 64 + 20878f + 10. -2f Collect the terms in -1395c3 + 976c - 1399c3 + 2774c*3. -20c*3 + 976c Collect the terms in -10x3 + 23x*3 - 141x*2 - 12x*3 + 80 + 141x2 - 27. x3 + 53 Collect the terms in 86k3 + 105k*3 + 94k*3 - 292k*3 + 2613k*2. -7k*3 + 2613k*2 Collect the terms in 10880f - 15966f + 1371 - 1376 - 17405f. -22491f - 5 Collect the terms in -30139i*2 + 30253i*2 + 0i3 - i3. -i*3 + 114i*2 Collect the terms in -19 + 2 - 47v*2 + 203v*2 + 13 + 29 + 2v. 156v2 + 2v + 25 Collect the terms in 51l2 + 452l*3 - 51l*2 - 225l*3 + 30216 - 225l*3. 2l*3 + 30216 Collect the terms in 3l - 32 - 27 + 210 - 36 - 116 + 6l. 9l - 1 Collect the terms in 2511n + 9826n*2 - 9805n*2 - 2511n. 21n2 Collect the terms in -5549j*2 - 81j - 53j + 5547j*2. -2j*2 - 134j Collect the terms in 64 - 30 - 36 - 20721f2 + 20208f*2. -513f*2 - 2 Collect the terms in -2736v - 74 + 77 + 2982v. 246v + 3 Collect the terms in -2j3 - 423449j + 211733j + 211716j + 5j3. 3j*3 Collect the terms in -7 - 252g*2 - 29 + 89g*2 + 46g*2 - 4. -117g*2 - 40 Collect the terms in 2829s*2 + 2996s*2 - 9303s*2 + 3476s*2. -2s*2 Collect the terms in -6m + 6m - 7m - 3m + 119 + 398. -10m + 517 Collect the terms in -42117x3 - 58831x*3 - 5 + 13 - 8. -100948x*3 Collect the terms in n - 17123 + 34002 - 16827. n + 52 Collect the terms in 321332 - 5a - 79a3 - 321332. -79a*3 - 5a Collect the terms in 22296 - 22296 + 11505r. 11505r Collect the terms in -748 + 4a2 - 750 + 2500 - 1006. 4a*2 - 4 Collect the terms in -11z*2 - 761z*3 + 204z*3 + 550z*3. -7z*3 - 11z*2 Collect the terms in 2k + k - k - 1705 - 914 - 153. 2k - 2772 Collect the terms in 0o - 10015 + o + 9o. 10o - 10015 Collect the terms in 1196t2 - 1196t*2 - 18445t*3. -18445t*3 Collect the terms in -11272050 + 22544075 - 11272025 + c. c Collect the terms in 1 - 5400k*2 - 5450k*2 - 5451k*2 - 1 - 5435k*2 + 21793k*2. 57k*2 Collect the terms in -2249 - 1193m + 1192m + 2228. -m - 21 Collect the terms in c2 - 3161 - 25000 + 5075. c2 - 23086 Collect the terms in -5 - 55z - 28z + 59z + 131z + 267z. 374z - 5 Collect the terms in -35p*3 + 4 - 33p - p + 18p + 16p. -35p3 + 4 Collect the terms in 99c*2 + 23 - 12 + 3c*3 - 6 - 5. 3c*3 + 99c*2 Collect the terms in -33271 + 66626 - 33353 + 143j. 143j + 2 Collect the terms in 1042b - 942b + b2 + 383b*3 - 4b*2 - 84b*3. 299b*3 - 3b*2 + 100b Collect the terms in -3 - 1679m3 + 2 - 1168m*3 + 1. -2847m*3 Collect the terms in 19x*3 + x + 34x*2 + 8x*2 + 9x*2 - 13x*2 - 6x*2. 19x*3 + 32x*2 + x Collect the terms in -42b*2 - 73b*2 + 21b*2 - 17b*2 - 1 - 3b. -111b2 - 3b - 1 Collect the terms in 2 - 13258h + 26208h - 12943h. 7h + 2 Collect the terms in -11f + 25f - 17f - 7 + f - 27. -2f - 34 Collect the terms in -5557137t2 + 11115271t*2 - 5557219t*2. 915t*2 Collect the terms in -45q*2 + 1737685213q - 1737685213q. -45q*2 Collect the terms in -911g*2 - 892g*2 - 325g*2 - 3g*3 + 3021g*2 - 893g*2. -3g*3 Collect the terms in 14x*2 + 52x*2 + 31x*2 - 128x*2 - 45x + 30x2. -x2 - 45x Collect the terms in -159 + 321 - 19p2 + 11p*2 - 162. -8p*2 Collect the terms in -137y*3 + 32y*3 + 23y*3 - 139y*3. -221y*3 Collect the terms in 24r*3 - 9 + 4 + 9 - 5 + 28r*3 + 8r*3. 60r*3 - 1 Collect the terms in 3b*2 - 2383010b*3 - 4b2 + b2. -2383010b3 Collect the terms in -4 - 1 + 636k*2 + 2693k*2 + 5. 3329k*2 Collect the terms in 34k - 21k - 3k*2 - 2k + 4k2 - 19k - 16k. k2 - 24k Collect the terms in f2 + f2 + 3040 + 11f3 - 586. 11f*3 + 2f*2 + 2454 Collect the terms in -150915z - 150907z + 452741z - 150915z. 4z Collect the terms in 43y - 1137778y*2 + 1137778y*2 - 84y - 6 - 9y3 + 41y. -9y3 - 6 Collect the terms in 423h*2 - 5729h + 1908h + 1914h - 431h2 + 1907h. -8h2 Collect the terms in -30g - 54g - 47g + 221g - 36g - 34g. 20g Collect the terms in 41504 + 51k - 41504. 51k Collect the terms in 10 + x3 - 28 + 39 + 20 + 17 - 8. x3 + 50 Collect the terms in -10401n + 2870 - 8607 + 2872 + 2865. -10401n Collect the terms in 367l - 5 + 602l*3 - 5 - 604l*3. -2l*3 + 367l - 10 Collect the terms in 5 + 58j3 - 17 + 56j*3 - 94j*3 + 6 + 4. 20j*3 - 2 Collect the terms in -2123362h*2 + 1061682h*2 + 1061716h*2. 36h*2 Collect the terms in -42 - 2275a + 18 + 24. -2275a Collect the terms in 45180941242p - 45180941242p - p3. -p3 Collect the terms in -339a + 70a2 - 65a*2 - 340a - 351a + 1030a. 5a2 Collect the terms in 13d + 150 + 2 - 289 + 137. 13d Collect the terms in 117238t - 58604t - 58634t - 112t2. -112t*2 Collect the terms in 218v*2 + 2v + 232v2 + 233v*2 + 236v*2 - 27v*3 - 919v*2. -27v*3 + 2v Collect the terms in i - 10983 - 148547 - 186456. i - 345986 Collect the terms in -1022l + 2012l - 1121l. -131l Collect the terms in -330 + 297t2 - 664t*2 - 1070t*2. -1437t*2 - 330 Collect the terms in -63 - 145b - 5b3 + 74b + 122 + 71b - 63. -5b*3 - 4 Collect the terms in -6b*2 - 4545 - 4727 + 9272. -6b*2 Collect the terms in 57287 + 57335 - 1214y*2 - 114622. -1214y*2 Collect the terms in -152670a*2 - 152653a*2 + 458019a*2 + 3a*3 - 152665a*2. 3a*3 + 31a*2 Collect the terms in -20688d + 7758d - 12564d. -25494d Collect the terms in -15v + 173540v2 + 9v - 171621v2 + 9v. 1919v2 + 3v Collect the terms in -422w + 60w + 61w + 76w + 85w + 66w + 60w. -14w Collect the terms in 73535h3 - 73533h*3 - 44 - 180. 2h*3 - 224 Collect the terms in -578w*3 + 168w*3 + 117w*3 + 118w*3 + 119w*3 - 3. -56w*3 - 3 Collect the terms in -829v*2 + 244 + 60v - 244 - 834v2 + 1656v*2. -7v*2 + 60v Collect the terms in -50934 + 15c - 50931 - 50926 + 5c - 50932 + 203723. 20c Collect the terms in -1057c*2 + 1165c*2 - 861c*2 - 431c*2. -1184c*2 Collect the terms in 251 - 316 + 65 + 83p*2 - 19p*2 - 3p. 64p2 - 3p Collect the terms in 811r - 1052r + 252r + 799r. 810r Collect the terms in -9s*3 - 116s - 177s + 303s. -9s3 + 10s Collect the terms in 44421u - 21277u + 12486u + 43667u. 79297u Collect the terms in 4327h*2 - 3284h*2 - 15592h*2 - 2 + 109h - 109h. -14549h*2 - 2 Collect the terms in -60482u*3 + 20117u*3 + 18939u*3 + 18243u*3. -3183u*3 Collect the terms in 10 + 2 - 12 + 3q - 68349q2. -68349q*2 + 3q Collect the terms in 70v2 - 194v*2 + 72v*2 + 84v*2. 32v*2 Collect the terms in 12f + 30348 - 4f - 10297 - 9757 - 10294. 8f Collect the terms in 35948b2 - 42 - 33 + 74. 35948b**2 -	{ "pile_set_name": "DM Mathematics" }
12, what is 68889 - -1? 6888a In base 10, what is 60 + -1340? -1280 In base 2, what is -110 - 101000110111111010? -101000111000000000 In base 7, what is 3165 + -41? 3124 In base 14, what is 8 - -3a29? 3a33 In base 15, what is 3 - -12ee? 1302 In base 8, what is -1405352 - -5? -1405345 In base 10, what is 6 + -564? -558 In base 12, what is -12 - 1287? -1299 In base 7, what is -11 - 310663? -311004 In base 16, what is -47b + 34? -447 In base 9, what is 16438 + -216? 16222 In base 9, what is 386 - 2527? -2131 In base 2, what is -100100101 + 1000? -100011101 In base 10, what is 1565 + -641? 924 In base 2, what is 1011101 + -111111010000? -111101110011 In base 6, what is 122302144 + -5? 122302135 In base 10, what is 6 - -17803? 17809 In base 3, what is -1211101011 - 201? -1211101212 In base 11, what is 2403 - 933? 1580 In base 6, what is 321024 + 10? 321034 In base 16, what is -4 + -2920? -2924 In base 2, what is -1101 - -1000110101101111? 1000110101100010 In base 11, what is -3 - 13806? -13809 In base 8, what is 374 - 2033? -1437 In base 3, what is -1200010022 - 10? -1200010102 In base 14, what is 112a - -c? 1138 In base 14, what is 11a6b + 6? 11a73 In base 15, what is -4 - 4e324? -4e328 In base 10, what is 332 - -9718? 10050 In base 16, what is -6f3 + 2c0? -433 In base 14, what is -bb + -3? -c0 In base 10, what is 4375159 - 3? 4375156 In base 15, what is 16 - 76c? -756 In base 14, what is -d8 + 9d? -39 In base 15, what is a - c223? -c218 In base 3, what is 1000021 - 101222? 121022 In base 8, what is 1132 + -30? 1102 In base 15, what is -546 + 23? -523 In base 7, what is 5213 - -423? 5636 In base 3, what is -1 - 1221210202? -1221210210 In base 2, what is 11 - -10001011110110? 10001011111001 In base 11, what is -2342a + 86? -23354 In base 5, what is -10 - 14031212? -14031222 In base 5, what is -13144 + -1? -13200 In base 15, what is -43 - c72? -cb5 In base 5, what is 2303110 + 20? 2303130 In base 4, what is -23 + 10131300? 10131211 In base 13, what is 3 - -2687? 268a In base 12, what is 259 - 3262? -3005 In base 10, what is 827107 + -4? 827103 In base 11, what is 79040 + -1? 7903a In base 7, what is 3 + 4102256? 4102262 In base 10, what is -12941 + 1? -12940 In base 12, what is -167 - -40a? 263 In base 3, what is -1202 + 1011000? 1002021 In base 9, what is 1003 - -105? 1108 In base 8, what is 310 + -775? -465 In base 2, what is 1111001101111 - -1011000000? 10000100101111 In base 5, what is -1 + 30033321? 30033320 In base 8, what is -353 + -373? -746 In base 14, what is -17b94 + 3? -17b91 In base 6, what is -4110 - 110? -4220 In base 5, what is 12240234 - -2? 12240241 In base 4, what is -1123 + -12100? -13223 In base 13, what is 1 - 23ab? -23aa In base 12, what is -2308 + 21? -22a7 In base 9, what is 18 + -836? -817 In base 11, what is -103 + 120? 18 In base 6, what is 5 - 402? -353 In base 13, what is 0 + -16a64? -16a64 In base 5, what is -1112403330 - 10? -1112403340 In base 9, what is 1340 + 131? 1471 In base 5, what is -222 - -3122? 2400 In base 10, what is 33 - -35879? 35912 In base 5, what is 1213 + 30240? 32003 In base 10, what is -54 - 75367? -75421 In base 7, what is 13614421 - 3? 13614415 In base 3, what is -122102221110 + -12? -122102221122 In base 8, what is 613 + -1051? -236 In base 15, what is -4 - -c8208? c8204 In base 12, what is -55 + 2558? 2503 In base 11, what is 3 + -61a90? -61a88 In base 11, what is 6 + -35093? -35088 In base 16, what is 39a656 - -4? 39a65a In base 5, what is 1423334203 - -1? 1423334204 In base 16, what is 6 - -443a? 4440 In base 6, what is -211 - 2? -213 In base 5, what is 10 + -22023? -22013 In base 16, what is -1 - d489? -d48a In base 6, what is 22 - -203? 225 In base 14, what is 22 + -906? -8c4 In base 8, what is 4 - -22003? 22007 In base 10, what is 7 - -51848? 51855 In base 7, what is -552150 + 2? -552145 In base 5, what is 44231 + 1104? 100340 In base 5, what is 11 + -233040031? -233040020 In base 2, what is -101011010111010 - -10? -101011010111000 In base 12, what is -123 + 97? -48 In base 14, what is 4 + 107244? 107248 In base 7, what is 2 - -215151? 215153 In base 5, what is -2310 - -342? -1413 In base 4, what is 23023032 + 1? 23023033 In base 6, what is -102 - 5052? -5154 In base 9, what is 374552 + -1? 374551 In base 5, what is -1404 + -203011? -204420 In base 13, what is b91b - 3? b918 In base 10, what is -236412 + -19? -236431 In base 7, what is 1 + 5051? 5052 In base 11, what is 1951 + 36? 1987 In base 9, what is 814 + 527? 1442 In base 8, what is 2245 + 1413? 3660 In base 11, what is 2 - 5894? -5892 In base 16, what is -30 + 411? 3e1 In base 10, what is -1 - -120940? 120939 In base 9, what is -2 + 162236? 162234 In base 14, what is 3 + 262ac? 262b1 In base 11, what is -8 + -189a? -18a7 In base 15, what is -9108 - 0? -9108 In base 11, what is 607 + -126? 491 In base 4, what is -202203 + 111301? -30302 In base 12, what is -29 + -75b? -788 In base 11, what is -694440 - -4? -694437 In base 14, what is 10 - 5d2? -5c2 In base 16, what is -4 + -1245d1? -1245d5 In base 7, what is 2660 + 564? 3554 In base 11, what is -1 - 6797? -6798 In base 8, what is -31 - -1124? 1073 In base 8, what is -777 - 2635? -3634 In base 15, what is 9 + 13780? 13789 In base 15, what is -cd40 + -1? -cd41 In base 16, what is -2d + -2cd? -2fa In base 2, what is 10011010010 + 10110000? 10110000010 In base 7, what is 22322524 + 2? 22322526 In base 10, what is -89 + -1082? -1171 In base 10, what is 15417 + 28? 15445 In base 13, what is 5cb0 - 192? 5b1b In base 15, what is b3c + 27? b64 In base 10, what is 2548 + -36? 2512 In base 15, what is 13 - acc? -ab9 In base 2, what is 111010 + 1011110110000? 1011111101010 In base 11, what is 5 - -396944? 396949 In base 12, what is -25 - -12724? 126bb In base 2, what is 10000001111 + 1? 10000010000 In base 8, what is 11757 - -31? 12010 In base 11, what is 52 - 3a14? -3972 In base 7, what is 0 + -1241261? -1241261 In base 2, what is -10010101110001110000 + 0? -10010101110001110000 In base 12, what is 4 + 13681? 13685 In base 10, what is 29 + -127? -98 In base 3, what is -10022 + -1100220121? -1101000220 In base 4, what is 120011 + 103? 120120 In base 15, what is -7d4a - 47? -7d92 In base 13, what is -715 + 3? -712 In base 4, what is -11 + 100001211? 100001200 In base 8, what is -25 - -7? -16 In base 8, what is 51775 + 5? 52002 In base 3, what is 2 + -100011? -100002 In base 13, what is 1371 + 12? 1383 In base 10, what is 453866 - 0? 453866 In base 6, what is -2442442 - 11? -2442453 In base 6, what is -3 + -11244314? -11244321 In base 12, what is -14b89 + 3? -14b86 In base 2, what is 1110011001010 + 1011001? 1110100100011 In base 16, what is 77 + 1? 78 In base 5, what is 130402 - 12? 130340 In base 13, what is 4 - -1595? 1599 In base 6, what is -5 - -10211? 10202 In base 3, what is -10 - -1002120201? 1002120121 In base 7, what is 15 - 130323? -130305 In base 14, what is -bd4 + c6? -b0c In base 10, what is -5068 + 3? -5065 In base 16, what is dc + -dc? 0 In base 2, what is -110011111 + -1010100110? -10001000101 In base 11, what is -5a - 172? -221 In base 10, what is 23681 + -9? 23672 In base 9, what is -14 - -1423144? 1423130 In base 15, what is a66d + 4? a672 In base 5, what is -130 + 42330? 42200 In base 11, what is 7 + 3556? 3562 In base 13, what is -6b7a4a + -1? -6b7a4b In base 13, what is 113 + 66? 179 In base 15, what is -1b - -39cc? 39b1 In base 10, what is 1 + -661060? -661059 In base 3, what is 2011 - -2121021? 2200102 In base 14, what is 120 - 136? -16 In base 9, what is 5 - -1407835? 1407841 In base 15, what is 1e8c82 + 0? 1e8c82 In base 15, what is -3 + -590e? -5912 In base 9, what is -7663 - 10? -7673 In base 7, what is -52600 - -2? -52565 In base 4, what is 20021012233 - 3? 20021012230 In base 4, what is 11101 + -203300? -132133 In base 5, what is -43004 + 1021? -41433 In base 12, what is a4 + 17b8? 18a0 In base 3, what is -100000200 + -2022? -100002222 In base 15, what is 3 + -3569? -3566 In base 8, what is -7121 - 7? -7130 In base 5, what is 111 + 1314103? 1314214 In base 13, what is 1b9 + -575? -389 In base 4, what is 1 + 12311333? 12312000 In base 6, what is -32330 - -101? -32225 In base 2, what is 11101001 - 1000001101? -100100100 In base 6, what is -2 + 15454154? 15454152	{ "pile_set_name": "DM Mathematics" }
1 + 0f2 + 2f*2 + 0f*2 + (-3f + 6f - 4f)(2f - 2f + f). 6f*2 Expand ((-8 + 8 - 2a)(1 + a - 1) + 18 - 2a*2 - 12 + 7)(-3 + 3a + 3). -12a*3 + 39a Expand (-33 - 6x + 33 + (2 + 5 - 4)(3x - 2x - 2x))(4x + x - 7x). 18x2 Expand (2 - 2 + 1)(m*2 - 6m*2 - 4m*2) + 13m*2 + 31 - 31. 4m*2 Expand (-76j*5 - 20j*3 - 23j*3 + 43j*3)(-22 + 20 + 18). -1216j5 Expand ((-2 - 4 + 0)(-m + 1 - m + 3m) + (0 + 3 - 2)(-m + 0m - 2m))(6 - 10m - 6 + (2 + 0 - 3)(2m - 5m + 2m)). 81m2 + 54m Expand 0u + u + u + (-2 + u + 2)(2 + 0 + 0) + 185u + 197u - 404u. -18u Expand (-173r + 30r + 53r)(-3 + 4 + 0). -90r Expand (-2p - 3 + 3)(2p*2 - 2p*2 + 2p*2)(98 - 96 + 181). -732p3 Expand (13m*2 + 162m*2 + 96m*2)(1 - 1 + m). 271m3 Expand (-5 - 2 + 20)(-73 + 7j2 + 73). 91j*2 Expand (-3 + 2 + 4)(31z + 38z - 76z)(-3 + 1 + 1)(2z + 0z + z). 63z2 Expand (z3 + z*3 + 2z*3)(-3z - 2z + 4z) - 2z*4 + 0z + 0z - 2z*4 - 2z*4 + 3z4 + (z4 + 1 - 1)(7 + 22 - 7). 15z*4 Expand ((5 + 0 - 9)(-2 + 2 - 2) + 0 - 1 - 1)(-10h*2 - 69h + 69h). -60h*2 Expand (-2 + 4 + 1)(56r - 114r - 244r - 51r). -1059r Expand 28v*5 + 27v*5 - 36v*5 + (-2v*3 + v - 2v + v*3)(3v2 + 2v - 2v - v2 + 0v*2 + 2v*2 + (2v*2 + v - v)(-1 + 1 - 1)). 17v5 - 2v3 Expand (-x4 + 3x4 - 3x*4)(0 - 3 + 5)(-3 + 46 - 13) + 2x*3 - 2x*4 - 2x*3. -62x*4 Expand (-17 - 81 - 8)(2 + 3y3 + 6y3 - y3). -848y3 - 212 Expand (2o - 4o + 0o)(1 - 6 + 7)(-3o - 1 + 1). 12o*2 Expand 100p - 100p - 38p*2 + (4p + p - 3p)(-2p + 0p + 0p). -42p*2 Expand (y + 2y - y)(-4 + 1 + 4)(y*2 - 3y*2 + 3y*2) + (-109 - 21y + 109)(-3y*2 + 4y*2 - 3y2) + y3 - y + y. 45y3 Expand (7s + 131 - 131)(1 + 2 - 15). -84s Expand (-2 + 2 - 1)(-r + 0r - r + (0 + r + 0)(1 + 1 - 4) - 6r + 0r + 85 - 76). 10r - 9 Expand (16x + 17x + 23x)(0 + 2 + 1). 168x Expand (0 + 2 + 0)(330z + 219z - 802z - 3). -506z - 6 Expand (-6s2 + s2 + s2)(0 - 2 + 1) - 7 + 6 + 13s2 + 3. 17s*2 + 2 Expand (-2j - j + 4j)(2 + 0 - 3)(2j*3 - 15j*3 - 33j*3). 46j*4 Expand (5 - 2 + 3)((7 + 4 + 8)(-2o + 1 - 1 - o + 0o + 3o + (4o + 0o - 3o)(-3 + 2 + 2)) + (2o - 3 + 3)(3 + 2 - 3) + (0o - 4o + 6o)(3 - 5 + 0)). 114o Expand (-10 - 2g + 10)(5g - 6g - 12g). 26g2 Expand (-1 + 6 - 2)(-129s - 10s + 29s). -330s Expand (4d + d - 4d)(-4 + 4 - d) + 20d*2 + 8d*2 + 16d*2. 43d*2 Expand (201u*2 - 103u*2 - 335u*2)(2 - 2 - 2u) - 4u*3 + 0u*3 + 3u*3. 473u*3 Expand -19003n*2 + 19003n*2 - 272n*4 + (5 - 1 - 3)(n*4 - 4n*3 + 4n*3) - 2n + 2n - 2n*4. -273n*4 Expand (0y + 5y - 3y)(31y - 559y - 53y)(3y2 + y2 - 2y2). -2324y*4 Expand (-35v + 5v - 32v)(1 - 2 - 2) - 3v + v + v - 3v + v + 0v. 183v Expand (4 + 3 - 5)(-13a4 - 11a*4 - 17a*4). -82a*4 Expand (4 - 1 - 2)(-121 - 90 - 256)(j + 4j - 4j). -467j Expand (-494b - 84b + 228b)(0 + 0 + b*4). -350b*5 Expand (0v - 3v + 2v)(-6 + 2 + 2) - 14v - 22v + 28 - 38. -34v - 10 Expand -8m2 + 0m*2 + 5m*2 + (-2m - 2m + m)((2 + 0 + 1)(3m - m - 3m) + 0m - 3m + 4m). 3m2 Expand 0n*4 + 3n*4 - 2n4 + (-n4 - n*4 + 0n*4)(5 + 2 - 3). -7n4 Expand (-40f*3 + 55f*3 + 0f*2 + 0f*2)(7 - 7 + 3f). 45f*4 Expand (0 + 1 - 3)(-a + 0a + 0a) + (-4 - 4 + 4)(-48a - 1099 + 1099) - 3 + 3 + 2a. 196a Expand (7l2 + 4l - 4l)(-l*3 + l + 4l*3 - 4l*3) + (-3l + 2l + 3l)(-4l + 2l4 + 4l). -3l5 + 7l*3 Expand (-6j - 3 + 3)(6j - j - 2j)(2j + 4j*2 - 2j). -72j4 Expand (g2 - 3g*2 + 3g*2)((3g - 4g + 2g)(0 + 4 - 2) + (-3 + 2 + 2)(4g - 5g - g) - 20g + 19g + 13g). 12g3 Expand ((1 - 7 + 20)(19 + 19 + 7) + 3 - 5 + 1)(-3z5 + z5 + 3z5). 629z*5 Expand v - 3 - 3v - 1 + (3 + 1 - 2)(-25 + 2v + 25). 2v - 4 Expand (-2459 + 1241 + 1025)((-4j + 6j + 0j)(2j3 + j - j) + 4j4 - j4 - 2j4 - 4j*4 + 3j*4 + 2j*4). -1158j*4 Expand (-2m + 3 - 3)(-20m + 37m + 18 - 18m). 2m2 - 36m Expand (-35y - 17y + 8y)(y - y + y) + (2 + 4 - 5)(2y2 - y2 + y*2) + 3y*2 + 2y*2 - 3y*2 + (-y + 0y + 0y)(4 - 4 + y) + y*2 + 4y*2 - 3y*2. -39y*2 Expand -4y*5 + 294y + 2y5 - 276y + (-y*4 + 4y*4 - 2y*4)(0y + 0y + y). -y*5 + 18y Expand 15z5 - 113 + 113 + (-4z*4 + 3z4 - z4)(-7z + 2z + 7z). 11z5 Expand (-2k*2 + 3k*2 - 2k2 + (-k2 + 5k2 - 2k*2)(2 - 1 + 0))(-407 - 39k + 407). -39k3 Expand -2345 - 439s + 2345 - 2s + 0s + 0s + (1 - 1 - s)(1 + 2 - 1). -443s Expand ((1 + 0 - 3)(-2 + 1 + 3) + 5 - 3 - 4 + 1 + 2 - 6)(-3z + z + 7z)(4 - 5 + 2)(-5 + 3 - 2). 180z Expand -125f3 + 61f*3 + 62f*3 - 88f + 2f3 + 4f - 4f + (f - 3f + 3f)(-f2 - f2 + f*2) + 0f3 - f3 + 3f3. f3 - 88f Expand (-46x + 92x - 112 - 48x)(x*2 + 0x*2 + 6x - 4x)(-2 + 5 - 2). -2x3 - 116x*2 - 224x Expand 3o5 + 2o*5 + 5o5 + (-o2 - 2 + 2)(12 - 12 + 9o3). o5 Expand (-4p3 - 2p*3 - 5p*3)(-p + 0p - 2p). 33p4 Expand 2f*5 + 2f + 27f3 + 2f*4 - 27f*3 + (-2f*4 + 2f4 + f4)(-19f + 37f - 10f). 10f5 + 2f*4 + 2f Expand -81 + 7h2 + 81 + (4h - 3h - 3h)(2 - 2h - 2) + 2h2 - 4 + 4. 13h*2 Expand (-g - 14g + 2g)(-385 - 77 + 80 + 111). 3523g Expand -2i*4 + 0i4 - i4 + (15i2 + 19 - 19)(16i2 - 11i*2 + 19i*2). 357i*4 Expand (2 - 2 - 5k)(3 - 5 + 3) + 0k + 2k - k - 3k - 1 + 1 + (0 + 1 + 0)(-3k + 2 - 2) - 3 + k + 3 + 2k - 4k + 4k + (-2 + 5 - 1)(5k + 0k - 2k). -k Expand (-2 + 0 + 0)(-13 + 8 - 12)(0 + 0 - 2d)(0d*2 - 2 + 0d2 + d3). -68d4 + 136d Expand (-128 - 75 - 3 + (1 - 4 + 1)(-2 + 1 + 2) + 1 - 3 + 1)(3x + 2x*2 - 3x + (x*2 + 2x - 2x)(2 + 1 - 2)). -627x2 Expand 0 + s + 0 + (-5s + 3s + 0s)(-75 - 183 - 119) + s + 0s + 0s. 756s Expand (-z*2 - 1 + 1 + 3z*2 - 4z2 - z2 - 3 + 2z2 + 3 + (2 - z - 2)(-2z + z - z))(0 + 0 - 2z)(-z + 3z - z)(-2z + 0z - 3z). 10z*5 Expand 4p*2 + 3p*2 - 2p*2 + (0 - 3 + 2)(-p - 5p + 5p)(-26p - 20p + 8p). -33p2 Expand -154 + 154 + 11d - d + 3d + d + (0 - 1 + 0)(3d + 2d - 6d) + (2 - 2 + 2d)(-1 + 3 - 1). 17d Expand 1916 - 1916 - 51r2 - 2r*4 + (-2r*3 - 4r*3 + 4r*3)(4r - 2r + 0r) + 33r*2 - 5r*4 - 33r*2. -11r*4 - 51r*2 Expand (-35 + 18 - 20)(5 - 3 + 0)(-4 + n4 + 4). -74n*4 Expand (-2x + x + 0x)(4x - 4x + 2x + (0 - 2 + 3)(0 + 2x + 0)). -4x*2 Expand (4 - 21657v + 21657v + 28v*2)(v*2 - 2 + 2)(2v - v + v). 56v*5 + 8v*3 Expand -10s*5 + 356s*3 - 356s*3 + (-2s*2 + 4s2 - s2)(s - s + 7s*3). -3s*5 Expand (53a*3 - 163a*3 + 86a*3)(-2a + 0a - 2a)(0 + 0 - 1). -96a4 Expand (j - 26 + 26 - 60)(0j - j + 0j). -j*2 + 60j Expand (-3 + 0 + 2)(-v + v + 2v) + 9v - 2v - 3v. 2v Expand (28y - 214 + 214)(-3y + y + 0y) - 2y2 + 3y*2 + 4y2 + y2 + 0y2 + y2 + (2y - 1 + 1)(3 - 3 + y). -47y*2 Expand (35z - 35z - 218z*3 + (1 - 1 - z)(0z + 0z + 2z2))(2z + 0z - 3z). 220z*4 Expand (2818 - 1943 - 1751 + (1 + 2 - 5)(5 + 0 - 4))(-1 - 2u + 1). 1756u Expand -3k*2 + 3k2 + k2 + (0k - 4k + 5k)(-k + k + 2k) - 8k - k*2 + 6673 - 6673. 2k*2 - 8k Expand (4l2 - l2 - 5l*2)(-4 - 33 - 28)(-3 + 3 + 1) + 4l2 - l2 - l*2. 132l*2 Expand (-10 - 1 + 2)(g + 0g + g) - 33g + 36g - 18g. -33g Expand (3f - 3f - f4)(-3 + 1 - 2)(1 + 0 + 0)(4f - 3f - 3f). -8f*5 Expand (-s - 2s + 4s)(1 - 4 + 1)(-34 + 14 + 14)(-s + 5s - 2s)(-6s*2 + 8s*2 - 4s*2). -48s*4 Expand (-6f*2 - 70f*3 + 61f*3 + 23f - 22f)(2f + f - 2f). -9f4 - 6f3 + f2 Expand (-13h - 10 + 10 + (h + 4h - 4h)(4 - 5 - 1) + h - h - 2h)(5 - 1 - 3) + h + 1 - 1. -16h Expand (1 - 3 + 6)(-35c + 35c - 215c3 - 461c*3). -2704c*3 Expand (4 - 15w - 4)(-2w + 0w - 2w + (w - 5w + 5w)(-1 - 1 + 0)). 90w*2 Expand 7s*2 - 16s*2 - 12s*2 + (s + 1 - 1)(3s + 4 - 4). -18s*2 Expand -2c*3 - 2 + 2 + (c - 2c	{ "pile_set_name": "DM Mathematics" }
- 6. Suppose 0 = -3t + o + 53, 0 = -4t + 4o + u - 4. What is the common denominator of t and 34/11? 11 Let s(o) = -o3 + o2 + o + 7. Suppose -4q = y + 6, y - 2 = 4y + 4q. Calculate the smallest common multiple of s(0) and y. 14 Let p be (-145)/(-30) + (2 - 2). Let j = p + -77/15. Let l = 3295/52 + -606/13. What is the common denominator of l and j? 20 Suppose d = 3d - 6. Let k = 1 - 0. What is the lowest common multiple of (k + 1 - -2) + 1 and d? 15 Suppose -5z + 6 + 4 = 0. Calculate the lowest common multiple of 16 and (7/7)/(z/8). 16 Let z = 4 - 3. Let s(t) = t*2 + t - 3. What is the lowest common multiple of 42/2z/3 and s(-3)? 21 Suppose -4i = i - 90. Calculate the lowest common multiple of (2 - i/4)-2 and 2. 10 Suppose 0 = 5z - z - 24. Let m be 5/(60/28)3. Suppose -ms = -5s - 6. Calculate the smallest common multiple of z and s. 6 Let h = 59 + -50. Calculate the smallest common multiple of 6 and h. 18 Suppose 4v = -1 + 5. Find the common denominator of 19/6 and -12(v - 43/16). 12 Let u = -4 - -16. Let q be (3 + -2)2/(-2). What is the smallest common multiple of (12 - (-3 - q)) + -2 and u? 12 Let f = 4 + -6. Let c be 2/(-1) - (f + 1). Calculate the lowest common multiple of 2 - c/((-3)/(-6)) and 10. 20 Find the common denominator of 29/18 and 2037/(-280)5/(-6). 144 Let z be 10/(-4)12/(-15). Calculate the least common multiple of 16 and 0/((-6)/z) + 12. 48 Find the common denominator of (2/8)/(2/77) and (15/40)/(6/142). 8 Let b = -2/721 - 485/85078. Let u = -343/1298 + b. Find the common denominator of -23/6 and u. 66 Calculate the common denominator of -65/22 and 175/18 - (-23 - -27). 198 Suppose -4m + 9 + 11 = 0. Calculate the smallest common multiple of 9 and m. 45 Suppose 0 = 5b - 5x + 2 - 7, -x = -2b + 3. Suppose -d - bd = -48. Let l = 27 - d. Calculate the lowest common multiple of 10 and l. 110 Let k be (20/6)/((-2)/(-6)). Suppose -y - 4 = 3y. Let m = k + y. What is the smallest common multiple of m and 3? 9 Find the common denominator of ((-351)/(-252))/((-2)/(-7)) and 103/10. 40 Let f = -128 + 155. What is the least common multiple of f and 54? 54 Let b(x) = -x3 - 3x*2 + 3x - 4. Let c(n) = -n3 - n2 - 4. Let h be c(0). Let z be b(h). Calculate the lowest common multiple of 6 - (3 + (z - 3)) and 6. 6 Let w = -6957 + 69639/10. What is the common denominator of w and -89/10? 10 Let i be (-1408)/(-444)(-12)/(-10). Let v = i + 22/37. Find the common denominator of v and -47/7. 35 Suppose v - h - 6 = 0, 3h + h = -4v + 40. Suppose -3r + v = r. Calculate the least common multiple of 7 and r. 14 Suppose -5x = -4h + 20, -4x + 5x = -h - 13. Let y be 174/x - 1/4. Calculate the common denominator of 40/3 and (0 + 6)y/(-40). 30 Let n be 0/1 + -2 + 5. Suppose -160 = -ny + 7y. What is the lowest common multiple of 9 and (6/10)/((-4)/y)? 18 Let b = -6077/666 - -75/74. Calculate the common denominator of ((-1)/2)/((-15)/(-1200)) and b. 9 Let p(i) = i - 7. Suppose 39 = j + 2j - 4o, 0 = j + o - 13. Let y(f) = f3 - 12f*2 - 14f + 15. What is the lowest common multiple of p(10) and y(j)? 6 What is the common denominator of 3(-1)/654 and (71)/((-20)/(-6))? 10 Suppose 0w = -2w + 6. Suppose wo - 15 = -s, 0 = o + 3o + 3s - 25. Suppose -u - 3 = 0, ou = -3z + z + 2. What is the least common multiple of z and 6? 42 Suppose 36 = -77r + 81r. What is the smallest common multiple of 9 and r? 9 Let j = 15 + -29. What is the smallest common multiple of (-100)/(-7) - (-4)/j and 20? 140 Suppose 9 = -3w + 6w. Suppose -p - a + 55 = 4p, 3p = -wa + 21. Let s = -4 + 6. Calculate the least common multiple of s and p. 12 Let i(k) = -k + 4. Let x be i(6). Calculate the least common multiple of 22 and -8(x - 0) + 2. 198 Let y = 2 + 0. Let x be -9y/63. Calculate the common denominator of 1 + -3 + (-50)/x and -40/11. 99 Let o(u) = -u3 + u2 + 2u - 1. Calculate the smallest common multiple of o(-2) and 26. 182 Suppose 5w + 3v - 2v = 94, -2v + 8 = 0. Let s = -8 + w. What is the lowest common multiple of s and 9? 90 Let h = 42603/26 - 1639. Let g = -5935/626 - 6/313. Find the common denominator of g and h. 26 Let t = 5072 + -111669/22. Calculate the common denominator of -49/4 and t. 44 Let v(c) = c2 - 8c + 6. Let p be v(7). Find the common denominator of (p/(-12))/((-1)/122) and -23/7. 42 Let q(w) = -w + w - w + 6 + 4. What is the lowest common multiple of 6 and q(0)? 30 Find the common denominator of ((-26)/(-318))/((-6)/(-36)) and 33/4. 212 Suppose k = 6k - 30. Let d = 10 - 6. What is the common denominator of d/(-6)(-29)/k and 33/4? 36 Let o = 112729/10 + -11282. Calculate the common denominator of 95/16 and o. 80 Suppose -3 = t - 12. Let b be 3(-2)/(-3) - 6. Let j = b - -7. What is the lowest common multiple of j and t? 9 Let d = -11 - -31. Suppose -2p + 1 = -u + 5, -4p - d = -5u. What is the least common multiple of 4 and u? 4 Let g = -13 - -4. What is the lowest common multiple of 12 and 3/(-9)g2? 12 Suppose 7 = 2s - 3t - 7, -3s = -5t - 20. Suppose -13n = -sn - 33. Calculate the least common multiple of 8 and n. 88 Let x = 27604/50785 + -19/35. Let g = x + 15954/10157. Find the common denominator of g and 59/9. 63 Suppose -3q = 5s - 207, -3s + 138 = 3q - q. What is the least common multiple of q and 11? 759 Suppose 0 = r + 4j - 2j - 26, 0 = -4r + j + 68. Let u = -2 + r. What is the least common multiple of u and 22? 176 Let h = -5 + 4. Let a be h(1299/6 + -1). Let w = a + 250. Calculate the common denominator of w and -51/10. 10 Suppose -u + 3w = 7, 0u - 2w + 38 = -4u. What is the smallest common multiple of 10 and (1 - 3)/(5/u)? 20 Suppose 4s = 5k - 14, -4k + s + 4s = -4. Suppose -2d - 48 = -2n + 2d, n + k = -4d. Calculate the smallest common multiple of 20 and n. 140 Suppose l - j = 11, 5j - 26 = -3l + j. Calculate the common denominator of 6/2 - (3 - 222/(-44)) and ((-124)/(-30))/((-24)/l). 198 Suppose -4j - 2 = -3l + 2l, -3j - 9 = 3l. Find the common denominator of (l/4)/(33/(-9)) and 89/20. 220 Suppose -v + 5 - 4 = 0. Suppose o = v + 5. Suppose 0 = 2k + 2k + 2c + 2, -k = c + 3. Calculate the least common multiple of k and o. 6 Find the common denominator of 43 and (-8)/(-2) + (-1899)/288. 32 Suppose -5 = -3t - b - 13, 5b = t + 24. Calculate the common denominator of t/16 + 15/(-9) and (-4)/6 - 83/(-48). 48 Let d = -9 - -10. Calculate the common denominator of 70/(-10 - (-1)/d) and 101/4. 36 Suppose -4n - 3h = 46, -5n - 2h - h - 56 = 0. Find the common denominator of ((-116)/(-90))/((-84)/105) and 2/n - 81/(-20). 180 Suppose 5m = 271 + 9. Suppose -4q = -0q - m. What is the lowest common multiple of q and 18? 126 Let r be 6-436/(-4). Calculate the common denominator of 4/22 - r/(-594) and 87/16. 48 What is the lowest common multiple of 12/(-8) - 124/(-8) and 2? 14 Let g(n) = n + 7. Let h be 12/18 - (-14)/(-3). Let m be g(h). What is the smallest common multiple of 6 and 0 + m/(6/20)? 30 Let h = 0 - -10. Calculate the least common multiple of 44 and h. 220 Let p = -12 + 32. Let j = 66 - 24. Let o = j + -24. Calculate the smallest common multiple of p and o. 180 Let k(d) = -d2 - 7d + 1. Let h(l) = l - 4. Let t be h(8). Suppose t + 0 = w. What is the lowest common multiple of w and k(-6)? 28 Let p = 2049/2 + -1053. Find the common denominator of 4/(-6) + (-687)/(-180) and p. 20 Suppose -4n - 6w = -w - 23, -3n - 2w + 12 = 0. What is the smallest common multiple of n and 1? 2 Suppose 0 = -k + 2c + 6, 0 = c - 0c - 2. Suppose 2p - k = 12. What is the least common multiple of 10 and p? 110 Let z(j) = -j3 - 3j*2 + j - 4. Let o be z(-5). Find the common denominator of (106/(-4) + 1)/(-6) and (o + -2)1/22. 44 Let f = 0 - -4. Suppose -4v = 2u - 76, -2v - 2v + 72 = fu. Calculate the smallest common multiple of v and 22. 220 Let d(k) = k3 + k2 - k + 23. Let v be 0 + 2/(-2) + 1. Let o be d(v). Let z = o + -3. Calculate the lowest common multiple of 2 and z. 20 Suppose 2d - 3 = 5. Let j = 1 + d. What is the least common multiple of 11 and j? 55 Suppose -5u + 7 = 32. Let w = 9 + u. What is the smallest common multiple of 6 and w? 12 Let d(k) = 3k - 7. Let v be d(3). What is the smallest common multiple of 100/12 + v/(-6	{ "pile_set_name": "DM Mathematics" }
n 12d + 13d - 51775d2 + 2 - 2 + 51774d*2 - 25d. -d*2 Collect the terms in 116q - 116q + 815371q*3. 815371q*3 Collect the terms in 10341r + 2r3 - 10341r - 4263669r2 + 4263669r*2. 2r*3 Collect the terms in 57t + 23t - 6498 + 19290. 80t + 12792 Collect the terms in -644261 - 140k2 - 4k + 4k + 644261. -140k*2 Collect the terms in 1163y*3 + 17y*2 + 248y*3 - 63y*2. 1411y*3 - 46y*2 Collect the terms in 3t + t - 51699900 + 51699869 - t*2 - 6t. -t*2 - 2t - 31 Collect the terms in -27 - 19 - 1 - 26l2 + 47 - 14l*2. -40l*2 Collect the terms in 300s*3 + 180s*2 - 180s*2 - 559s*3 + 328s*3. 69s*3 Collect the terms in 39 - 37 - 1221u*2 + 23u*2 - 288u*2. -1486u*2 + 2 Collect the terms in -4188l + 829l + 828l + 835l + 830l + 870l + 1. 4l + 1 Collect the terms in 16u2 + 8u*2 + 14u*2 - 28u*2 - 32 - 11u2. -u2 - 32 Collect the terms in -201616c - 2862547 + 2862547. -201616c Collect the terms in -271y2 - 280y*2 + 829y*2 - 285y*2. -7y*2 Collect the terms in -3547k*3 + 197 - 384 + 3550k*3 + 160. 3k*3 - 27 Collect the terms in -59891d + 164393d + 110946d. 215448d Collect the terms in k - 362 - 336 - 281 + 1139 + 0k. k + 160 Collect the terms in -4011490a + 8104816a + 5260325a. 9353651a Collect the terms in -18s - 37969 + 19s - 17233. s - 55202 Collect the terms in -16n2 - 1703n + 1705n + 12n*2 - 2n*2 - 20n*2. -26n*2 + 2n Collect the terms in -3 + 701495y - 17728y + 4 + 1. 683767y + 2 Collect the terms in 36v*2 + 116v*2 - 12v*2 + 22870 - 22870 + 68v*2. 208v*2 Collect the terms in -1379 - 146p*3 + 112p*3 + 33p3 + 1379. -p3 Collect the terms in 12257j - 1935j*2 - 2 - 12257j. -1935j2 - 2 Collect the terms in -2g*2 + 7087g3 + g2 - 41986g3 - 8406g*3. -43305g3 - g2 Collect the terms in -1822q + 3523q - 2143q. -442q Collect the terms in -31o + 580 - 580 + 553o. 522o Collect the terms in -f2 + 27f + 104f + 10f - f3 + f2. -f*3 + 141f Collect the terms in -4c + 3642697 - 3642697 + 4c + 95c2 - 102c*2. -7c*2 Collect the terms in 12s + 20s - 90s - 2 - 10s - 151s. -219s - 2 Collect the terms in 3055 - 2205 - 9168 - 91l. -91l - 8318 Collect the terms in -2290494b + 4584861b - 2294347b. 20b Collect the terms in -2110b + 94b + 132b. -1884b Collect the terms in 338507j*2 + 5 - 5 - 677335j*2 + 338803j*2. -25j*2 Collect the terms in -3r*3 + 19883084894r - 19883084894r + 2r3. -r3 Collect the terms in -121a + 122a + 297 + 192 + 34a2 + 20a*2 - 489. 54a*2 + a Collect the terms in 117m*2 + 18 - 160m*2 + 630m*2 + 432m*2. 1019m*2 + 18 Collect the terms in 0t*2 + 2t + 4t2 + 6t*2 - 2t*2 - 16t*2 + 61. -8t*2 + 2t + 61 Collect the terms in 9o3 + 10428o*2 - 16829o*2 + 6401o*2. 9o*3 Collect the terms in -1270m*2 + 30 + 36 + 893m*2 - 102 + 36. -377m*2 Collect the terms in 42p*3 - 42p*3 + 20p*3 - 8p + 27p3 + 29p. 47p3 + 21p Collect the terms in 800068p2 - 266656p*2 - 266657p*2 - 266749p*2. 6p*2 Collect the terms in -3436323b*3 + 2204372b*3 - 10392045b*3 - 985260b*3. -12609256b*3 Collect the terms in 109l - 23l + 57l + 56l. 199l Collect the terms in 2 + 694r + 695r + 698r - 3477r + 698r + 695r. 3r + 2 Collect the terms in -19999745 + 17p*3 + 19999745. 17p*3 Collect the terms in -709j*3 - 3497j*3 - 2923j*3. -7129j*3 Collect the terms in 128n + 84n + 137n. 349n Collect the terms in 18 - 46 + 13 + 14 + 20395i. 20395i - 1 Collect the terms in -1356 + 15n + 2179n3 + 1356. 2179n*3 + 15n Collect the terms in -4w2 + 2w - 54 - 45 + 132 - 37. -4w2 + 2w - 4 Collect the terms in 17d - 1003877 + 1003877. 17d Collect the terms in -21509r + 66670r - 45171r. -10r Collect the terms in 16 + 38219k - 19 + 3. 38219k Collect the terms in 72i + 164i*2 - 10 - 168i*2 + 11 + 5 - 10i. -4i2 + 62i + 6 Collect the terms in 1007357167 + 2i + 2i*2 - 1007357167 - 2i. 2i2 Collect the terms in -40304 + 13442 + 13421 - 57c + 13437. -57c - 4 Collect the terms in 0i*3 + 142 - 142 - 23i*3 - 16i*3 - i. -39i*3 - i Collect the terms in -19g + g + 39076g3 + 7g + 11g. 39076g*3 Collect the terms in 4262x - 129853 + 129853. 4262x Collect the terms in -5w*2 - 1516804w + 1516804w. -5w*2 Collect the terms in -4 - 4367497p - 6p3 + 3p*3 + 4367490p + 4. -3p3 - 7p Collect the terms in -72n3 + 971 - 971 + 4n + 19n3. -53n*3 + 4n Collect the terms in -15g2 - 6g*2 - 11g*2 - 5g*2 - 2863g + 36g2. -g2 - 2863g Collect the terms in -12406j3 + 66362j*2 - 66362j*2. -12406j*3 Collect the terms in -79520x + 158760x - 79236x. 4x Collect the terms in -5s - s + 9s - 4s + 144853. -s + 144853 Collect the terms in 109743 + 0u + 2u - 31363 + 2u3 + 0u*3. 2u*3 + 2u + 78380 Collect the terms in -6958l2 + 0l*3 + 13934l*2 - 6976l*2 + 5l*3 + 13 - 2l*3. 3l*3 + 13 Collect the terms in -148a - 286939a2 + 286995a*2 + 148a. 56a2 Collect the terms in 47f*3 - 437f*3 + 400f*3 + 20f*3. 30f*3 Collect the terms in 2d + 130d2 - 1249d*2 + 0d + 7d2 + 340d*2. -772d*2 + 2d Collect the terms in 102g - 791841g*2 - 46g + 791844g2 - 56g. 3g2 Collect the terms in -50s + 105s - 52s + 4s3 + 6s*3. 10s*3 + 3s Collect the terms in -143m3 + 225m + 545m3 - 225m + 668m3. 1070m*3 Collect the terms in 216 + 1308q - 108 + 9q2 - 656q - 108 - 652q. 9q*2 Collect the terms in -67x*3 + 16x*3 + 11x*3 + 17x*3 - 2x*3 + 10x*3 + 11x*3. -4x*3 Collect the terms in -43 + 20j - 804j + 51 - 1189j - 6. -1973j + 2 Collect the terms in -5013j*2 + 44j - 13j - 33j. -5013j2 - 2j Collect the terms in 23b - 23b - 327404b2. -327404b*2 Collect the terms in -72k - 74k - 66k - 60k + 369k - 87k. 10k Collect the terms in 2n + 17n*2 + 44n - 6n2 + 101n*2. 112n*2 + 46n Collect the terms in 881o - 237o - 1 - 223o - 228o - 229o. -36o - 1 Collect the terms in -1316m3 - 361m*3 + 830m*2 - 830m*2. -1677m*3 Collect the terms in 7555v*3 - 7071v*3 + 11331v*3. 11815v*3 Collect the terms in 2572v*2 + 2781v*2 - 4670v*2 - 6v + 4v. 683v*2 - 2v Collect the terms in -10732077f + 1056 + 10732088f - 1056. 11f Collect the terms in -173w + 423w + 1282 - 191w. 59w + 1282 Collect the terms in 390711829b*3 - 390711828b*3 + 18b*2 - 18b2. b3 Collect the terms in 25128c2 - 18076c*2 - 121404c*2. -114352c*2 Collect the terms in 15d*3 - 257 - 6d*3 + 11d + 4d3 - 2d*3. 11d*3 + 11d - 257 Collect the terms in -1094l - 49979l*2 - 16421l*2 + 1093l. -66400l2 - l Collect the terms in 382u*2 - 362u*2 - 110u*2. -90u*2 Collect the terms in -980s*2 - 17445154s*3 + 17445165s*3 + 1831s*2 - 851s*2. 11s*3 Collect the terms in -2b*2 + 6 - 1717572b + 9 - 12. -2b2 - 1717572b + 3 Collect the terms in -x + 1959x2 + 1968x*2 - x + x + 1924x*2 - 5922x*2. -71x*2 - x Collect the terms in -85u*3 + 78u + 226u3 + 81u - 60u3 - 77u*3 - 159u. 4u3 Collect the terms in 1123h + 460h - 306h. 1277h Collect the terms in 11z*3 - 12122z + 6z3 + 9639z + 2483z - 7z*2. 17z*3 - 7z*2 Collect the terms in 956h*2 + 960h*2 + 963h*2 - 2881h*2 + 241. -2h*2 + 241 Collect the terms in -6u*2 + 3u*2 + 5822 + u + 5u*2 + 6u*2. 8u*2 + u + 5822 Collect the terms in 46l - 226l + 51l + 50l + 26l + 55l. 2l Collect the terms in 1 - 1 + 2569d + 0 + 2800d + 1470d. 6839d Collect the terms in 0i + 20 - 168 + 128 + 9i + 23 - 11i. -2i + 3 Collect the terms in 331618274696 - 331618274696 + 23h2. 23h*2 Collect the terms in 0n*2 - 1815902 + 1815902 - 3n2 + n2 + 31n. -2n*2 + 31n Collect the terms in -326034y3 + 652079y*3 - 326033y*3. 12y*3 Collect the terms in -10 - 804613b*2 + 15 + 5 + 804553b*2. -60b*2 + 10 Collect the terms in 1 - 34010048h + 34010048h - 2h*2. -2h*2 + 1 Collect the terms in -48 + 38 + 12 - 20863c*2. -20863c*2 + 2 Collect the terms in 1524y*2 - 4y + 4*y + 7	{ "pile_set_name": "DM Mathematics" }
Simplify ((hh/h(-6/5))/h2hh/(h(hh/(h/(h(-6)h))hh)/hh)h*(-1/9))/(((h/(hh*0hh))/h)(-46/3))(-24) assuming h is positive. h(49864/45) Simplify ((a(-3)/a(-2/9))/(a(-7)a*6a))/(aa5(a*(-6)a)/aaa*(3/5)/a((aa(-6))/a)/a) assuming a is positive. a(163/45) Simplify ((d/(d/(d/d(-6/17))d)d(5/7))/(d(-15)/d4))(3/19) assuming d is positive. d(7164/2261) Simplify ((x7/xx)/(xx1)(x(xx*(-1/4)x)/x)44)/((x2)26)(-44) assuming x is positive. x*2370 Simplify ((u(u/u*(2/5))/uu/(u2/u))/(u(3/2)/(u(uu/u*(-4)u)/uu)))/((uu1/u)(1/36)/(u(2/7))(-5/9)) assuming u is positive. u(8711/1260) Simplify r(-26)(r/r(-2/17))/r(rr(r/(r/(r(((rr*(22/5)/r)/r)/rr)/r)))/r)(-18) assuming r is positive. r(-8932/85) Simplify ((j/((j/j0)/j))(2/13)/((jj3)/j(2/3)))/((j/((((j/(j/j(-1)j))/j)/jj)/j))/j((j/(jj(-2/7)/j))/j)/j)13 assuming j is positive. j(-12529/273) Simplify ((aa*(2/3))/(a/(a/(aaa(2/17)a))a))/(a3a*(2/15))(a(-1/3)/a(-1/6))/(a(1/3))(-37) assuming a is positive. a(1119/170) Simplify ((s0s)(-50)/(ss/(s*(1/3)/s)s)(-10))/(s(2/9)/(ss(-4)s))10 assuming s is positive. s(-320/9) Simplify ((tttt(-3/4)t)/t(-5))(5/7)/((t*(2/11)t/(tt/((tt*(6/7))/t)))/((tt3)/t0)) assuming t is positive. t(3035/308) Simplify (y(7/2)y7(y*(-2/11)y)/y(-1/9))21 assuming y is positive. y(15841/66) Simplify (((t(-3/5)t/t(2/5))(-44))(3/2))(11/4) assuming t is positive. 1 Simplify (u(12/13))(-2/35)/((uu/u(13/6))/(u/((u(-1/31)/u)/u))) assuming u is positive. u*(266261/84630) Simplify ((((zz*(-7)/zz)/(zz/z(-14)z))/((z/(z/(z/((z*(-1/2)zz)/zzz)))zzz)/z)38)32)(-14/5) assuming z is positive. z(18816/5) Simplify ((tt(1/3)t)/t)(-2/7)/(t/(t(-3/2)/t)t/(tt*(-2)))(t2)(-28)(t/t(-2/21))/tt*(-1/5)t assuming t is positive. t(-4269/70) Simplify (h2hh(-5/7))43(h(2/3)/(h/(hh*(-3))h))/(h*(-1)/(h/((h/(h(h(-3/4)/h)/h))/h))) assuming h is positive. h(7997/84) Simplify ((d(-2/9))(-1/44))(2/61)/((d1dd*(-1/4)d)/((d*(-1/10)d)/(dddd/d7))) assuming d is positive. d(138917/120780) Simplify (((l/((l/l(-2/7))/l)llll(2/11))/(l(-2/3)ll/(ll*(3/14))l))(2/29))(-22/3) assuming l is positive. l(-2566/1827) Simplify ((o(-3/5)oo*(4/9)o(o/(o/(o(1/4)oo)))(1/53))36)(-5/17) assuming o is positive. o(-18001/901) Simplify ((k(2/9)/kk)*(-2/79)(k*(-5/2)/kk)/(k*1k))(-35/4) assuming k is positive. k(224245/5688) Simplify (s5)(-4/11)/((ssss37s)/(s(s/((s/s(-43))/s))/s)) assuming s is positive. s(-933/11) Simplify (u1)(-16)/(u(-2/13)u*1)(uuu*6)/((u/((uu/(u/(uu(-1/5)))uu)/u))/u)u/(u*(-3)u)u(-2) assuming u is positive. u(-328/65) Simplify ((v2v*(3/2))/((vv*(2/3)v)/v)(-42))/((v0/v)/v((vv*(1/12)v)/vv)/v((vvv*(-2/11)v)/v)(-24)) assuming v is positive. v(15583/132) Simplify ((v(2/3))(-18/5)/(vv(1/7))(3/19))(-9) assuming v is positive. v(15444/665) Simplify ((h/h(2/11))/((h(hh1)/h)/h)(hh/(hh*(-4)))/(hh/h*(2/15)))/(hh(h/h(-9))/h(hh(6/11))/h)(-21) assuming h is positive. h(40492/165) Simplify (t26/t)(2/11)(t(-10))(1/20) assuming t is positive. t(89/22) Simplify (g(-1/4))(-3/29)/(g(-1))*(-14/3)(g(1/3))(-2/81)/(g*3gg(-1/16)/g) assuming g is positive. g(-855397/112752) Simplify ((((y/y(2/5)yy)/y)/y)31y*(4/9)yy(3/7))/((y(-2)/y)/(y/(y(-2)y))(yyy(-2)y)/(yy(-7)/y)) assuming y is positive. y(5504/315) Simplify ((((oo*27)/o)/oo((o(1/7)/o)/o)/o)/((o/(o/o37o)o)/ooo/((o/(ooo(-34)o))/oo)))26 assuming o is positive. o(3302/7) Simplify ((z(-2/15))(-10)/(zz(-3))50)14 assuming z is positive. z(4256/3) Simplify (((bb2/bb)/b)(2/47))(-49)/((((bb/(b(-3)b)b)/bb)/(b/b*3))/(bb/b(1/4))(1/57)) assuming b is positive. b*(-119371/10716) Simplify (k/(kk*(-2/3))k/k(-2))41(k/(k/k(-9))k(kk(k/((k3k)/kk)k)/kk)/k)(2/139) assuming k is positive. k(62635/417) Simplify ((zz/((z(z(-5/2)/z)/z)/z))/z(-1/7)(zz((zz/(zz*(1/3)))/z)/zz)/z4)/(z(-5)/(z/z*3zz))32 assuming z is positive. z(6901/42) Simplify (((((q/(q/(q20qq)))/q)/qq(1/4))3)38)(5/8) assuming q is positive. q(23085/16) Simplify ((t/(t(-1/10)t)t)/(tt(-1)))/(ttt(1/2)tt)(1/24)((t(-1/3))(-25))(-20) assuming t is positive. t(-39781/240) Simplify (n(-1))(1/16)(nnn(1/3))(-7/4)(nn(-2/3))(-6/35)(n/(n/((n/((n/n*(1/2))/nn))/n)))(-29) assuming n is positive. n(17299/1680) Simplify (((l/(l/(l*(-1)/l))l)*(17/2)/((l(l/l*(4/5))/lllll)/l(-7)))24)(-32) assuming l is positive. l(75648/5) Simplify (s/(ss*(-2/3))(s/(s/s3))/s)(2/19)/((s*(-6/11)s)/(ss0/s))(7/6) assuming s is positive. s(-313/1254) Simplify ((((x(-5)xx)/x)/(x/(x/(x(x/(xxx*8x))/x))))/(x(-2/5))(4/19))/((x*(-2/5)x)(3/25)/(x(-7)/x(-1/4))) assuming x is positive. x(-7009/9500) Simplify ((v(1/4)/v)/v(-9/10))/(vvvv/((vvvv/(((v((v(1/5)/v)/v)/v)/v)/v))/v))(-8) assuming v is positive. v(-89/4) Simplify (l/(l/l26))/ll*(4/17)l(l/(ll/l*(-2/13))l)/(ll(-33)l) assuming l is positive. l(12615/221) Simplify u6/u*(-3/5)(uu0u)*(2/89)(u*(-1)u)*(-43)(u(-2/7))(1/19) assuming u is positive. u(392391/59185) Simplify ((((n(-1/2)/n)/n)/n)*(-3/32)/(nn*(2/3)nn(-1/5)/nn))/(nn(1/3)(n(-2)/n)/n)(-5) assuming n is positive. n(-4951/320) Simplify (((k/k(-8)k)/k)(-2/3)/(k(-1/3)/((((k/(kk*(-2/41)))/k)/k)/kk)))5 assuming k is positive. k(-4685/123) Simplify (oo(3/10))/o3(o/(o*2/o))/(o/(ooo/(oo*7)o))(oo*(1/2)/oo)*(-19)o/(o*(-1/4)o)o2 assuming o is positive. o(-659/20) Simplify ((tt0)(-2/75)t(3/4)t/(tt(-3/5)))/((t/t(-4/9))/t(-14))(-6/7) assuming t is positive. t(10193/700) Simplify ((x(-7))(-10/11)x*(-3/4)/(x/((xx(6/5))/x)))6 assuming x is positive. x*(3837/110) Simplify (rr*(-6/7)/rr(3/2))(-44)/(((r(-1/13)/r)/(r/(r0rr)))/(r*5rr(3/2))) assuming r is positive. r(-3769/182) Simplify ((f2)(3/2)(f/f(-4/5))/f(-3))/((ff(-1))(-1/3)/(f/(f/(ff*(-1/5)))ff(4/5))) assuming f is positive. f(52/5) Simplify ((((a/a(-1/4))/a)/a)/a)(-1/47)((a/(aa/a(-35)a)aa)/aa)(-10/9) assuming a is positive. a(65863/1692) Simplify (c(cc1)/cc)(3/25)/(c(-6)/(c/c*4))((c1)30)32 assuming c is positive. c(24084/25) Simplify ((k(-44))2(k(-22))(-1))16 assuming k is positive. k(-1056) Simplify (u(2/3)uuuu(-5)/uuuu)/(u/u(-1))(-2/37)(((u/u(2/5))/u)(-1/24))48 assuming u is positive. u(874/555) Simplify (((o/o(-16))/oo*(-2/11)o)/(oo(-21)o(3/11)))28 assuming o is positive. o(11256/11) Simplify (c(1/3)/(((c*(-7)/cc)/cc)/c))33(c(-2/7)/c)(-47)/(c*5/((cc*(2/13)/cc)/c)) assuming c is positive. c*(30083/91) Simplify (((c(((c/c(-1/5))/c)/c)/c)/c(-7/6))/((c(c(-3)c)/c)/cc(4/3)))(-1/38) assuming c is positive. c(-61/1140) Simplify ((c/(((c/(cc/(c/(cc(1/4)c)))c)/cc)/c))/(c*(2/7)c))*(1/72)((c/(cc/c(-1)c))0)(3/26) assuming c is positive. c(55/2016) Simplify ((g/(g/g1))29/(g(-5)/(gggg(-3)g)))/((g*3g)/g*(-1/4)g6/(g6/g)) assuming g is positive. g*(119/4) Simplify (c/((ccc8c)/c)c(cc/c43)/cc)/(cc(17/5)c)(2/63) assuming c is positive. c(-1721/35) Simplify (v*(-3)v*(-23)vv6v*22v)(-4/3) assuming v is positive. v(-16/3) Simplify ((b(-8)/b8bb*(-5/2)b4)4)(-20) assuming b is positive. b1080 Simplify ((r/(rr(2/3)r))/(rr/(r/r(6/11))r))/(r*6/(rr*(-1/3)))(r*(1/2)r*(1/3))/((r/(rr*(2/9)))/rr/(r/r(3/2))) assuming r is positive. r(-890/99) Simplify ((y(3/2)/(y/y(4/5)))/(yy/(y/y(2/3))y)43)/((y/(y(-3/8)/y))/(y*(-1/6)/y)y/((y*(1/9)y)/y)y(-3)) assuming y is positive. y(-41327/360) Simplify (((d/d(-3)d/((d*4/d)/dd))(3/11))25)**(-12) assuming d is positiv	{ "pile_set_name": "DM Mathematics" }
et u = -35 - b. Calculate the remainder when u is divided by 12. 9 Let u(a) = a*2 - 2a + 8. Let m be u(6). Let w = m + -14. Calculate the remainder when w is divided by 10. 8 Let p(i) = i + 28. Let x be p(0). Suppose -x = -2l - 2t, 5l - 5t + 20 = 120. Let d = 27 + 5. Calculate the remainder when d is divided by l. 15 Suppose -m = 3 - 5. Suppose -h - mh = -4g + 12, -h = -4g + 20. What is the remainder when g is divided by (1 - (-28)/(-4))/(9/(-6))? 2 Let z be (4 + -6 - -5) + 2. Let u(g) = g3 + 2 - 3g - 5g2 + 2g + 2g. Calculate the remainder when 12 is divided by u(z). 5 Let s(x) = 5x*2 - x - 1. Let a be s(3). Suppose -4l + 19 = -a. What is the remainder when 43 is divided by l? 13 Let k = -96 + 189. Calculate the remainder when k is divided by 24. 21 Suppose 3 = g - 1. Let s = 6 - g. What is the remainder when s is divided by 2? 0 Suppose 2t + 6 = 3t. Suppose 4d + th - h = 66, 0 = -3h + 6. Let a = 74 + -49. What is the remainder when a is divided by d? 11 Suppose 5p - 9 = 4z, 3p - 18 - 5 = -2z. Suppose 3j = -d + 35, -zj + j - 4d = -41. What is the remainder when j is divided by 3? 2 Let d(w) = 3w - 24. Let r(h) = -h + 10. Calculate the remainder when r(6) is divided by d(9). 1 Suppose 5k - 265 + 45 = 0. Let j = -26 - -38. What is the remainder when k is divided by j? 8 Suppose p - 6 - 1 = 0. Let n(s) = 2s3 - 2s*2 - 2s - 4. What is the remainder when n(3) is divided by p? 5 Let c(u) = -u*2 + u + 3. Let b be c(3). Suppose -7 - 20 = -g - 3w, -5w + 25 = 0. Calculate the remainder when (-2)/(-3) - 64/b is divided by g. 10 Suppose 0p - 4p = -c - 12, -3c + p = -8. Suppose -2j - 4r = -24, j - 15 = cr - 5r. Calculate the remainder when 70 is divided by j. 16 Let g = 73 - -25. What is the remainder when g is divided by 33? 32 Let b = 5 - -29. Suppose -d + 23 - 5 = 0. Calculate the remainder when b is divided by d. 16 Let x(h) = -h*2 - h + 4. Let p = 12 - 1. Calculate the remainder when p is divided by x(0). 3 Suppose -3k = -4v + 2k + 61, -v + k + 15 = 0. What is the remainder when v is divided by 8? 6 Suppose -3i + 3 = -3. What is the remainder when 4 is divided by i? 0 Calculate the remainder when (-2)/(-4)114 is divided by (2 - -7) + 12/4. 10 Suppose 2l = -3d, -l + 0l + 5 = -d. Suppose -v - 14 = -3g, 2g = -4v - v - 19. Suppose -4p = -g - 1. What is the remainder when l is divided by p? 0 Suppose 0 = -2h + 14 + 6. Calculate the remainder when 59 is divided by h. 9 Suppose 2 = -0d - d, 2o = 2d - 16. Let k = 6 - o. What is the remainder when 46 is divided by k? 14 Suppose -5d + 3u - 33 = 0, -u = 4u - 5. Let x be (4/6)/(2/d). What is the remainder when (0 - 5/x)2 is divided by 3? 2 Suppose 37 = 11p - 18. Calculate the remainder when 8 is divided by p. 3 Suppose 14 = -4q + 86. Let s = q - 11. What is the remainder when 18 is divided by s? 4 Suppose 0 = -g + 3g + 2, 149 = 4k + 3g. What is the remainder when 73 is divided by k? 35 Calculate the remainder when 33 is divided by (-19)/(-2) + (-2)/((-12)/(-3)). 6 Let l(r) = 18r + 3. Suppose -2x - 3x = -70. Calculate the remainder when l(2) is divided by x. 11 Let r(j) = 2j2 - 5j - 2. What is the remainder when 18 is divided by r(4)? 8 Let v(b) = 2b2 + 4b - 1. What is the remainder when v(5) is divided by 18? 15 Let q(g) = -g*2 - 5g + 1. Let m(y) = -32y + 4. Let k be m(-3). Calculate the remainder when ((-4)/10)/((-2)/k) is divided by q(-3). 6 Let c = 244 - 105. What is the remainder when c is divided by 36? 31 Let c = 12 + -8. Calculate the remainder when c is divided by (1-2 - 0)-1. 0 Suppose -7u - 343 = -14u. Suppose -4g - 52 = -4l, 4g - 26 = -0l - 2l. What is the remainder when u is divided by l? 10 Let h(t) = t*3 + 10t*2 - t + 4. Suppose 4f = -2o - 40, -5 = 3o - 3f - 2f. What is the remainder when h(o) is divided by 4? 2 Let v be -12 - ((1 - -2) + 0). Let z = v - -21. What is the remainder when 11 is divided by z? 5 Let p = 98 + 36. Calculate the remainder when p is divided by 34. 32 Suppose 4z + 14 = 3j - 3, 0 = 3j + 5z - 53. Let s = 66 + -35. Calculate the remainder when s is divided by j. 9 Let p(t) = 11t. Let w = -30 - -71. Calculate the remainder when w is divided by p(1). 8 Let s(l) = l3 + 2l*2 - 6l - 3. Calculate the remainder when 30 is divided by s(-3). 0 Suppose 3n = -17 - 22. Let o = 46 - 23. Let y = n + o. Calculate the remainder when y is divided by 6. 4 Let r(q) = -2q3 - q2 - 3q - 3. Let f(d) = d3 - 6d*2 + 4d + 3. Let b be f(5). Let o = -99 - -128. Calculate the remainder when o is divided by r(b). 14 Suppose 5d - 4d - 3s - 5 = 0, 19 = d + 4s. Suppose 25 + d = 3q. Let b(p) = p3 + 8p*2 + p - 7. What is the remainder when b(-7) is divided by q? 11 Suppose 0 = -0a - 4a - 2p + 150, 5a - 191 = p. Suppose -5x = 4z - a, -x + 15 = 2x + 5z. What is the remainder when 28 is divided by x? 8 Calculate the remainder when 6/(-14) - (-1590)/35 is divided by 16. 13 Let u be (-6 - -17) + -4 + 1. Suppose u + 22 = 2z. What is the remainder when 42 is divided by z? 12 Let h(o) = -4o - 6. Calculate the remainder when 49 is divided by h(-5). 7 Let o be (-7)/(4/1 + -3). Let a = o - -9. Suppose 3f = -4w + 112, -2f - 59 = -aw - 17. Calculate the remainder when w is divided by 13. 12 Let m = 10 + -10. Let u = 3 - m. What is the remainder when 6 is divided by u? 0 Let f(y) = y2 - y - 1. Let r = 5 + 0. Let x be f(r). Suppose 0 = -w + 6 + x. What is the remainder when w is divided by 13? 12 Suppose h = n - 5n + 25, 4n = h + 7. Let c = -38 - -58. Let w = c - 4. Calculate the remainder when w is divided by h. 7 Suppose 3l + 104 = 7l. What is the remainder when l is divided by 3? 2 Suppose -169 = -4f + 3. Let a = -11 + 26. What is the remainder when f is divided by a? 13 Suppose -6 - 2 = -4p. What is the remainder when 36/p3/6 is divided by 4? 1 Let t = 15 + -11. Suppose -tx + 12 + 20 = 0. Calculate the remainder when 21 is divided by x. 5 Suppose -2o = 2k + 3k - 60, k = 2o - 36. Let g(f) = 5 + 4f - 4 - 2. What is the remainder when o is divided by g(2)? 6 Suppose 46 = c + 6. Calculate the remainder when c is divided by 21. 19 Suppose -2f = 3f - 10. Suppose -2y = fy - 100. What is the remainder when y is divided by 7? 4 Suppose 5i - 26 = 3w, -3w + 30 = 5i - 2i. Calculate the remainder when 18 is divided by i. 4 Let f(q) = q2 - 11q - 72. What is the remainder when f(17) is divided by 8? 6 Suppose 3i = 5i + 4, -u + i = -19. Suppose -2q + q = -2. Suppose 0 = 4k - qk - 100. Calculate the remainder when k is divided by u. 16 Suppose -4i - 213 = -3c - 0i, -284 = -4c + 2i. Calculate the remainder when c is divided by 18. 17 Let t(n) = -n*3 - 6n*2 + 9n + 8. Let a be t(-7). What is the remainder when (-3 + 7)(-33)/a is divided by 8? 6 Suppose 2c - 26 = 4n - 204, 0 = -n + 5c + 31. Let j = -26 + n. What is the remainder when j is divided by 11? 9 Suppose -3k - 3h + h = -20, 5h - 14 = -3k. Let w = k + -6. What is the remainder when 3 is divided by w? 1 Let i be (4/(-6))/(4/(-42)). Suppose -10 = -2r + 2y, 2y - 17 = -r + iy. Suppose 0g + 2 = rg, 41 = 5f + g. What is the remainder when 23 is divided by f? 7 What is the remainder when (-206)/(-4) + 8/16 is divided by 28? 24 Suppose 0 = -3u + 5t - 7 + 58, 2t = 0. Suppose 4o = -h + 49, 3h = 4o - 0o + 211. Calculate the remainder when h is divided by u. 14 Suppose 10 = 2k + 3k. Suppose 14 = -3i - ki - 3l, 2i + 2l = -8. Let m = 5 + i. What is the remainder when 6 is divided by m? 2 Let p = 47 + -26. Calculate the remainder when p is divided by 8. 5 Let g = 8 - 6. Calculate the remainder when 7 is divided by g. 1 Calculate the remainder when 91 is divided by ((-3)/(-6))/(4/184). 22 Let y(r) = r3 + 14r*2 + 20r - 24. Calculate the remainder when 69 is divided by y(-12). 21 Calculate the remainder when 2/((-4)/(-52) - 0) is divided by 7. 5 Let z = 94 - 59. Suppose 0 = 3t + 15, 5o - 3o = -t + 19. Calculate the remainder when z is divided by o. 11 Suppose 0 = -3t - 4q + 5q + 128, 2t - 87 = q. What is the remainder when t is divided by 21? 20 Suppose -3t - 56 = t. Let n(c) = -c*3 - 14c*2 - 2c - 19. Calculate the remainder when 23 is divided by n(t). 5 Suppose 5*t	{ "pile_set_name": "DM Mathematics" }
-3o - 1, 81 = n - 4o. Calculate the remainder when n is divided by 13. 11 Suppose 10 = 4t + 5s - 11, t - 2s = 15. What is the remainder when 34 is divided by t? 7 Let i(g) = -6g - 5. Suppose 0 = -2t - 4s + 34, 5t = -6s + 3s + 57. What is the remainder when i(-5) is divided by t? 7 Let x be 14/28 - (-10)/4. Suppose 0 = 2g + 3p - p - 40, 92 = 5g - xp. What is the remainder when 75 is divided by g? 18 Let h(d) be the first derivative of d3/3 - 5d*2/2 + d + 1. Let u = 16 + -9. What is the remainder when 43 is divided by h(u)? 13 What is the remainder when 4/((-11)/((-6325)/10)) is divided by 33? 32 Suppose -4y = 2q + 6, 0 = 5q - 4q - y - 3. Calculate the remainder when 2 is divided by q. 0 Let x(w) = 0w + 3w2 - 4 - w + 4w. Let c = 2 + -5. Calculate the remainder when x(c) is divided by 8. 6 Let j = 2 + 1. Suppose 0 = -o + jo - 8. Calculate the remainder when 15 is divided by o. 3 Let w(n) = -16n + 1. Suppose 0 = -3z - 4s - 8 + 1, -4s = -4z. What is the remainder when 32 is divided by w(z)? 15 Let a = 2 + -8. Calculate the remainder when 14 is divided by 4/a - 104/(-12). 6 Suppose -9 = d + 3p - 61, -5d + 3p = -170. Calculate the remainder when 106 is divided by d. 32 Let k(r) = -4r + 8. Let b be k(4). Let t(g) = -g - 3. What is the remainder when 7 is divided by t(b)? 2 Suppose -g + 37 + 49 = 3m, 0 = -2m + 2g + 52. Calculate the remainder when m is divided by (-3)/2(-100)/15. 8 Suppose -5c = -i - 2 - 6, 2c + 4 = 4i. Let k = 20 + c. Calculate the remainder when k is divided by 6. 4 Suppose o + 5w - 38 = 0, 0 = -w + 3w. Let y(u) = -2u + 1. Let d be y(-5). Suppose -d = -4h + 41. Calculate the remainder when o is divided by h. 12 Suppose 0 = 4a + 5y - 83, 2a = 6y - 2y + 22. What is the remainder when 31 is divided by a? 14 Suppose 0 = -35k + 39k - 52. Calculate the remainder when 178 is divided by k. 9 Let m = 55 - 35. What is the remainder when (2 - (-2 - -3))m is divided by 11? 9 Suppose 5m - 15 + 65 = 0. Let o = 27 + m. What is the remainder when 67 is divided by o? 16 Let s = -4 + 7. Let q(a) = 3a2 - 10a - 6. What is the remainder when s is divided by q(4)? 1 Suppose 0 = -3x, -2m + 3x + 28 = x. Let t(y) = 54y*3 + 1. What is the remainder when t(1) is divided by m? 13 Suppose q - 14 = 5b, -3b - 30 = -4q - 8. What is the remainder when 11 is divided by q? 3 Let f(x) = x*3 + 9x*2 - x + 9. Let v be f(-9). Suppose v = 2i - 0i. Calculate the remainder when 43 is divided by i. 7 Let j = 544 + -354. Calculate the remainder when j is divided by 32. 30 Suppose 3m + 45 - 129 = 3l, -5l + 15 = 0. What is the remainder when 61 is divided by m? 30 Suppose -24 = -5u + 16. What is the remainder when u is divided by 3? 2 Suppose 12 = -3s, 10 = d - 5s - 45. What is the remainder when d is divided by 12? 11 Suppose 41 = 5u - 54. Suppose -3o + u = -5. Suppose 2j + 74 - 118 = 0. What is the remainder when j is divided by o? 6 What is the remainder when 1176/39 + (-14)/91 is divided by 8? 6 Calculate the remainder when 14/(-28) + 50/4 is divided by 9. 3 Let w be (-55)/(-4) + 4/16. Let x = 4 - -5. Calculate the remainder when x is divided by w/(-35) + 44/10. 1 Suppose 24 = -0i + 2i. Suppose u - 4 + 1 = 0, i = s + 2u. What is the remainder when 17 is divided by s? 5 Suppose -c - 5b + 1 = -39, -b + 104 = 5c. Suppose y - 76 = -3y. Let o = y - -38. Calculate the remainder when o is divided by c. 17 Suppose -3x + 8x = 670. Suppose 0 = 3u + 4v - 113, u - 5u + x = 2v. Calculate the remainder when u is divided by 8. 7 Suppose i + 4i = -2a + 85, 65 = 5i - 2a. What is the remainder when 18 is divided by i? 3 Let t = 114 + -47. What is the remainder when t is divided by 17? 16 Let k = -1 - -1. Let p = 29 + k. What is the remainder when p is divided by 15? 14 Let x = -30 - -39. What is the remainder when 33 is divided by x? 6 Suppose 3l = -l + 52. Calculate the remainder when 63 is divided by l. 11 Let u(t) = -t2 + 3t + 6. Let q be u(5). Let m(h) = -h*2 - 3h + 4. Let p be m(q). Suppose -k + 15 = -pk. What is the remainder when k is divided by 8? 7 Let l(h) = 33h*2 - 3. Let q(i) = 50i*2 - 5. Let t(n) = 8l(n) - 5q(n). What is the remainder when t(1) is divided by 6? 3 Let p = 33 + -23. Suppose 0 = 3b + 4 - 142. What is the remainder when b is divided by 160/p(-2)/(-2)? 14 Suppose 4 = y - 4. Let f be ((-4)/(-3))/(28/315). Let g = f - y. What is the remainder when g is divided by 4? 3 Suppose -3t - t = -g - 173, -3t - 2g + 127 = 0. Let o(h) = -h*3 - 8h*2 - 10h - 6. What is the remainder when t is divided by o(-7)? 13 Let u(n) = n*2 - 4n - 4. What is the remainder when u(-7) is divided by 15? 13 Let d = 150 - 85. What is the remainder when d is divided by ((-44)/6)/((-4)/12)? 21 Let u(x) = x*2 - 6x + 3. Let b be u(5). Let f be 4/(-2) - 3b. Suppose 19 = 2h - 3c + fc, -4 = -2h + 2c. What is the remainder when 20 is divided by h? 6 Calculate the remainder when (-1)/(2/(-62) + 0) is divided by 16. 15 Let r(p) = -5p + 1. Let x be r(1). What is the remainder when (-1)/x0 + 5 is divided by 4? 1 Suppose 0 = 3f - 70 + 16. Suppose -u - 4r + f = -2r, r = -2u + 36. Suppose 3d = -3m + 22 + 2, -m + u = 3d. What is the remainder when d is divided by 2? 1 Let h = 249 - 112. Calculate the remainder when h is divided by 28. 25 Let i = 104 - 82. What is the remainder when i is divided by 12? 10 Calculate the remainder when 117 is divided by (-20)/(-100) + 168/10. 15 Let g = -4 - -2. Let f = 18 + g. What is the remainder when 63 is divided by f? 15 Let s(p) = -p3 - 3p*2. Let c be s(-3). Let q = c + 0. Suppose qb = -3b + 57. What is the remainder when b is divided by 7? 5 Let u(t) = 34t*2 + 2. Calculate the remainder when 106 is divided by u(-1). 34 Calculate the remainder when (6/3)/2 + 28 is divided by 17. 12 Let u = 91 - 79. What is the remainder when u is divided by 6? 0 Let z = 40 + -31. What is the remainder when 62 is divided by z? 8 Let y = -19 + 30. Suppose 2c = 8c - 186. Calculate the remainder when c is divided by y. 9 Let z be (-4)/(17/(-5) + 3). Let s = -6 + z. What is the remainder when 1/(-2) - (-162)/s is divided by 14? 12 Suppose -2u + 3u - 9 = -2d, 3u = 2d - 21. Suppose 0 = 3c - dc. Let g(y) = -y3 + y2 + y + 8. What is the remainder when 22 is divided by g(c)? 6 Suppose 2t = -0t - 2. Let l(f) = 6f2 - f - 2. Calculate the remainder when 12 is divided by l(t). 2 Let c(s) = -8s + 5. Calculate the remainder when 71 is divided by c(-4). 34 Calculate the remainder when 6 is divided by (-3)/2(5 + 3)/(-4). 0 Let k(q) be the third derivative of q5/60 + 11q4/24 + q3 + 3q2. Calculate the remainder when 23 is divided by k(-11). 5 Let i(w) = w + 16. Suppose 13 = -3o + 5r, -o = -0o + 5r + 31. What is the remainder when i(o) is divided by 3? 2 Suppose 80 = -v + 2v. What is the remainder when v is divided by 14? 10 Suppose -2v + a - 4a + 6 = 0, -5v + a = -32. Suppose 0d + 15 = d. What is the remainder when d is divided by v? 3 Suppose 3z - 4b - 128 = 0, 5z - 6b + b = 210. Calculate the remainder when z is divided by 12. 4 Suppose -5j + 18 + 77 = 0. Let r(t) = -7t + 12. Calculate the remainder when r(-6) is divided by j. 16 Suppose -2z = z + 84. Let d = -19 - -36. What is the remainder when z1/(-4)7 is divided by d? 15 Suppose 4a - 3a - 197 = 0. What is the remainder when (-7)/(-42) + a/6 is divided by 9? 6 What is the remainder when 32 is divided by (1 + 1)(-136)/(-16)? 15 Suppose 5f = 4s - 204, 5s = 5f - 132 + 387. Calculate the remainder when s is divided by 18. 15 Let n(l) = l - 8. Let w be n(-6). Let y = w + 20. Let o = 33 - 16. Calculate the remainder when o is divided by y. 5 Let d = 162 - 4. What is the remainder when d is divided by 27? 23 Suppose 5v - v = 16. Let c = 27 + v. Suppose -4k + 20 = 3s, 3s + 9 = -5k + c. Calculate the remainder when s is divided by 3. 1 Let c = 15 + 144. What is the remainder when c is divided by 32? 31 Let b(g) be the third derivative of g5/10 - g4/12 + g2. What is the remainder when b(2) is divided by (-2)/3(-63)/6? 6 Let g(t) = 20t + 2. Calculate the remainder when g(2) is divided by 11. 9 What is the remainder when 10/4152/10 is divided by ((-6)/(-	{ "pile_set_name": "DM Mathematics" }
9}? 6/11 Two letters picked without replacement from lljllllj. What is prob of picking 1 j and 1 l? 3/7 Calculate prob of picking 2 x when two letters picked without replacement from xmf. 0 Calculate prob of picking 1 l and 2 m when three letters picked without replacement from {f: 2, l: 10, w: 6, m: 2}. 1/114 What is prob of picking 1 x, 1 s, and 2 q when four letters picked without replacement from qqqqcxxss? 4/21 Four letters picked without replacement from {j: 4, m: 4, x: 7}. Give prob of picking 2 x and 2 j. 6/65 What is prob of picking 2 g and 2 v when four letters picked without replacement from {g: 2, v: 6}? 3/14 Two letters picked without replacement from gcnwcnbnrrnwwb. What is prob of picking 2 b? 1/91 Calculate prob of picking 2 i and 2 y when four letters picked without replacement from {y: 4, i: 3}. 18/35 Two letters picked without replacement from jvggf. Give prob of picking 1 j and 1 g. 1/5 Four letters picked without replacement from {u: 6, o: 1, j: 2, h: 4}. What is prob of picking 1 h, 1 j, and 2 u? 24/143 Two letters picked without replacement from {k: 3, z: 9, v: 5, w: 1}. What is prob of picking 1 z and 1 w? 1/17 Calculate prob of picking 3 k and 1 f when four letters picked without replacement from ffkkkfafkkfffkffktf. 175/1938 Two letters picked without replacement from fdffddddifdidfdfd. What is prob of picking 2 f? 15/136 Calculate prob of picking 1 j and 1 k when two letters picked without replacement from {v: 2, j: 1, e: 1, k: 1}. 1/10 Two letters picked without replacement from luytlje. What is prob of picking 1 t and 1 e? 1/21 Three letters picked without replacement from khvkklhhlhkkkdk. Give prob of picking 1 v, 1 k, and 1 h. 4/65 Four letters picked without replacement from {d: 2, w: 5}. What is prob of picking 4 w? 1/7 What is prob of picking 1 c and 1 r when two letters picked without replacement from {z: 1, c: 1, r: 2, f: 1, g: 2}? 2/21 Calculate prob of picking 2 w when two letters picked without replacement from mwwwmww. 10/21 What is prob of picking 3 v when three letters picked without replacement from eegvevvven? 1/30 Calculate prob of picking 1 v and 2 c when three letters picked without replacement from {i: 1, v: 1, c: 7}. 1/4 Calculate prob of picking 3 y when three letters picked without replacement from {a: 6, t: 1, x: 2, y: 3, m: 4, n: 4}. 1/1140 Four letters picked without replacement from {c: 2, k: 5}. What is prob of picking 4 k? 1/7 What is prob of picking 1 j and 1 r when two letters picked without replacement from ojjjdmordodjdrjjo? 3/34 Two letters picked without replacement from qqnnnqniqqqnpeqpq. Give prob of picking 1 i and 1 e. 1/136 Calculate prob of picking 1 b and 1 o when two letters picked without replacement from {f: 1, o: 2, b: 1}. 1/3 Calculate prob of picking 1 z, 1 s, and 1 v when three letters picked without replacement from peveevvevpzessr. 8/455 Three letters picked without replacement from {e: 2, u: 8}. Give prob of picking 3 u. 7/15 What is prob of picking 1 w and 1 h when two letters picked without replacement from hwowkhzwkhkoz? 3/26 Four letters picked without replacement from ezzzzezzee. Give prob of picking 2 z and 2 e. 3/7 Two letters picked without replacement from muamhvf. What is prob of picking 1 m and 1 a? 2/21 Two letters picked without replacement from {d: 1, w: 3, t: 1, u: 3, a: 2, m: 3}. What is prob of picking 2 w? 1/26 Four letters picked without replacement from lllflfozioliooola. What is prob of picking 2 z, 1 o, and 1 a? 0 What is prob of picking 3 s when three letters picked without replacement from {s: 4}? 1 Four letters picked without replacement from pzyhhzzpppywfzp. What is prob of picking 1 f, 1 y, and 2 p? 4/273 What is prob of picking 1 k, 1 l, and 1 w when three letters picked without replacement from {k: 1, l: 8, i: 2, w: 4}? 32/455 Calculate prob of picking 1 u, 1 o, 1 y, and 1 a when four letters picked without replacement from {u: 1, o: 3, p: 1, y: 4, a: 5}. 60/1001 Calculate prob of picking 3 o when three letters picked without replacement from {s: 2, o: 9, v: 6}. 21/170 Three letters picked without replacement from mmmmmmmeeem. Give prob of picking 3 e. 1/165 Three letters picked without replacement from {u: 2, d: 1, b: 6, j: 9}. Give prob of picking 1 j and 2 b. 45/272 Calculate prob of picking 1 s and 1 n when two letters picked without replacement from nnnsnsnnnnnnsnsnnn. 56/153 Four letters picked without replacement from {w: 5, g: 7}. What is prob of picking 4 g? 7/99 Calculate prob of picking 1 w and 2 e when three letters picked without replacement from {a: 2, e: 4, w: 1}. 6/35 What is prob of picking 1 u, 1 i, and 1 n when three letters picked without replacement from iiggggniggggugggnib? 8/969 What is prob of picking 1 d and 1 f when two letters picked without replacement from dfggmm? 1/15 Two letters picked without replacement from ovxo. What is prob of picking 1 x and 1 v? 1/6 What is prob of picking 1 l and 1 r when two letters picked without replacement from pzrlp? 1/10 Calculate prob of picking 1 h and 1 w when two letters picked without replacement from hwwwwhwhhw. 8/15 Four letters picked without replacement from cpcnpcr. Give prob of picking 1 c, 1 r, 1 n, and 1 p. 6/35 What is prob of picking 1 d and 2 h when three letters picked without replacement from twhdttbtttbbvttvtth? 1/969 Three letters picked without replacement from {f: 3, q: 4, z: 2}. Give prob of picking 2 f and 1 z. 1/14 Calculate prob of picking 2 v when two letters picked without replacement from {j: 2, g: 8, l: 2, v: 5}. 5/68 Calculate prob of picking 3 y and 1 m when four letters picked without replacement from yytnttmyypty. 2/99 Two letters picked without replacement from taattaaaatafmfa. What is prob of picking 2 f? 1/105 Two letters picked without replacement from {c: 3, p: 4, z: 6}. What is prob of picking 1 c and 1 z? 3/13 Calculate prob of picking 1 f and 2 n when three letters picked without replacement from nfdfshdfdnnfhfpnpfpp. 3/95 Three letters picked without replacement from {f: 8, j: 3, i: 1, l: 5, x: 1, n: 2}. What is prob of picking 1 f, 1 l, and 1 x? 2/57 Four letters picked without replacement from sxssxxxxsxx. What is prob of picking 4 s? 1/330 Four letters picked without replacement from niikkhhwkknr. Give prob of picking 2 i, 1 w, and 1 r. 1/495 Two letters picked without replacement from iakaj. Give prob of picking 1 k and 1 j. 1/10 What is prob of picking 1 w, 1 i, and 1 o when three letters picked without replacement from iyzow? 1/10 What is prob of picking 2 k, 1 g, and 1 v when four letters picked without replacement from zkkzzvgqzqekvvq? 3/455 Two letters picked without replacement from xlxlxlll. What is prob of picking 1 x and 1 l? 15/28 What is prob of picking 3 g when three letters picked without replacement from {g: 3, p: 1, y: 4, t: 2, s: 2}? 1/220 Three letters picked without replacement from {d: 3, h: 1, b: 1, a: 2}. What is prob of picking 2 a and 1 b? 1/35 Three letters picked without replacement from mnmzdnmnmmdzmwmemz. What is prob of picking 1 e and 2 z? 1/272 Three letters picked without replacement from rrrrhrhhrzhrrrhhr. Give prob of picking 1 r and 2 h. 15/68 Two letters picked without replacement from {l: 2, g: 1, s: 4, t: 4, d: 1, a: 2}. What is prob of picking 1 d and 1 l? 2/91 Calculate prob of picking 3 k when three letters picked without replacement from kkk. 1 What is prob of picking 2 b, 1 g, and 1 i when four letters picked without replacement from ycmibigiiygggymggbgg? 32/4845 Two letters picked without replacement from ffttttt. Give prob of picking 2 f. 1/21 What is prob of picking 2 k when two letters picked without replacement from zmzkzkj? 1/21 Three letters picked without replacement from {f: 3, t: 1, z: 4, h: 2, m: 1}. What is prob of picking 2 f and 1 z? 4/55 Calculate prob of picking 2 f when two letters picked without replacement from ffffff. 1 Calculate prob of picking 2 g when two letters picked without replacement from {g: 4, n: 6, k: 2}. 1/11 Three letters picked without replacement from avappxpivgv. Give prob of picking 1 i, 1 a, and 1 v. 2/55 Two letters picked without replacement from {g: 4, a: 6, j: 4}. Give prob of picking 2 j. 6/91 Calculate prob of picking 3 g and 1 q when four	{ "pile_set_name": "DM Mathematics" }
0.2246171 decades to years. 2.246171 How many millennia are there in 4.490424 decades? 0.04490424 Convert 7.401928 litres to millilitres. 7401.928 How many years are there in 27/2 of a decade? 135 What is 1354.236 tonnes in grams? 1354236000 Convert 438.7mg to nanograms. 438700000 How many micrograms are there in seven quarters of a milligram? 1750 What is 3/40 of a kilogram in milligrams? 75000 How many grams are there in 329.176ng? 0.000000329176 What is 1/4 of a litre in millilitres? 250 What is eighty-one quarters of a hour in minutes? 1215 What is 3/5 of a millimeter in micrometers? 600 How many millilitres are there in 746511.8 litres? 746511800 What is 8.483571 minutes in days? 0.00589136875 What is thirteen quarters of a day in hours? 78 How many millilitres are there in 6.749415l? 6749.415 What is 5/4 of a millennium in years? 1250 Convert 1.493104 centimeters to micrometers. 14931.04 How many microseconds are there in 1/5 of a millisecond? 200 What is 6/25 of a milligram in micrograms? 240 What is 1/4 of a microsecond in nanoseconds? 250 How many litres are there in 86164.62ml? 86.16462 What is 4163.233us in milliseconds? 4.163233 What is 21/5 of a litre in millilitres? 4200 Convert 620165.1 seconds to microseconds. 620165100000 What is 0.0471488 years in months? 0.5657856 How many months are there in 7/4 of a year? 21 What is 331897.1 millilitres in litres? 331.8971 What is 651.5423 kilometers in micrometers? 651542300000 What is 108.8627 litres in millilitres? 108862.7 What is 7881.281 centuries in months? 9457537.2 Convert 2200.22271ns to days. 0.000000000025465540625 What is 1/10 of a kilometer in meters? 100 Convert 1.141444 millilitres to litres. 0.001141444 What is 207.72705ns in minutes? 0.0000000034621175 What is 24.37661 litres in millilitres? 24376.61 How many grams are there in 2.123877kg? 2123.877 How many days are there in 166.781781 seconds? 0.0019303446875 What is 77/2 of a year in months? 462 What is 1/4 of a century in months? 300 How many meters are there in 0.9460592 micrometers? 0.0000009460592 What is 0.7904168 nanograms in tonnes? 0.0000000000000007904168 What is 666051.2 centuries in millennia? 66605.12 How many meters are there in 462778.9 kilometers? 462778900 How many grams are there in 5.180656ug? 0.000005180656 How many minutes are there in eight fifteenths of a hour? 32 What is 8/15 of a millennium in months? 6400 How many micrograms are there in 1/10 of a milligram? 100 What is 0.8182761 days in microseconds? 70699055040 What is seven halves of a week in hours? 588 How many hours are there in 45/8 of a week? 945 How many centuries are there in 0.2740801 millennia? 2.740801 How many millimeters are there in 1/4 of a meter? 250 Convert 0.7509108us to nanoseconds. 750.9108 What is 825.6561 months in centuries? 0.68804675 What is fifty-three fifths of a litre in millilitres? 10600 What is twenty-seven fifths of a gram in milligrams? 5400 What is 1/64 of a meter in micrometers? 15625 What is 127435.2 litres in millilitres? 127435200 How many milligrams are there in seventeen halves of a gram? 8500 What is 11/8 of a meter in millimeters? 1375 What is nine tenths of a microgram in nanograms? 900 How many nanometers are there in 3/40 of a millimeter? 75000 What is 89209.72 seconds in milliseconds? 89209720 What is six fifths of a millimeter in micrometers? 1200 Convert 675.2712kg to milligrams. 675271200 Convert 114.855 milliseconds to seconds. 0.114855 What is 12/25 of a litre in millilitres? 480 How many months are there in twenty-one quarters of a century? 6300 How many millilitres are there in five eighths of a litre? 625 What is 87/5 of a litre in millilitres? 17400 What is 17/4 of a microgram in nanograms? 4250 How many millilitres are there in 31/2 of a litre? 15500 What is 7/2 of a second in milliseconds? 3500 Convert 18436.76 days to nanoseconds. 1592936064000000000 How many millilitres are there in 13/5 of a litre? 2600 Convert 13031.28 micrograms to nanograms. 13031280 What is seven quarters of a litre in millilitres? 1750 How many micrometers are there in seven quarters of a millimeter? 1750 What is 1/4 of a century in years? 25 How many minutes are there in 1/5 of a week? 2016 How many months are there in seven halves of a decade? 420 What is 0.975589 decades in centuries? 0.0975589 What is 8.0237 centuries in decades? 80.237 What is 25/4 of a kilometer in meters? 6250 Convert 94.97712 months to centuries. 0.0791476 Convert 53.46814 micrometers to kilometers. 0.00000005346814 Convert 7324.489 decades to millennia. 73.24489 What is 33/5 of a gram in milligrams? 6600 How many millennia are there in 5649.26 centuries? 564.926 What is 786340.3l in millilitres? 786340300 Convert 416521.7ns to microseconds. 416.5217 How many nanograms are there in one quarter of a microgram? 250 What is 5.584241m in millimeters? 5584.241 How many micrograms are there in one tenth of a milligram? 100 How many months are there in 405706.4 millennia? 4868476800 Convert 735.34 milligrams to nanograms. 735340000 What is 2.78965 minutes in microseconds? 167379000 What is 7.123559l in millilitres? 7123.559 How many millilitres are there in 13/5 of a litre? 2600 What is 5/4 of a litre in millilitres? 1250 How many milligrams are there in nineteen quarters of a gram? 4750 Convert 98.56682kg to tonnes. 0.09856682 What is 13/4 of a millennium in decades? 325 How many milligrams are there in one fifth of a gram? 200 What is 519666.4t in milligrams? 519666400000000 What is 21/4 of a litre in millilitres? 5250 How many millimeters are there in 421.167 nanometers? 0.000421167 What is one fifth of a centimeter in millimeters? 2 Convert 11.549178 months to years. 0.9624315 What is 13/5 of a microgram in nanograms? 2600 How many meters are there in 85114.53 millimeters? 85.11453 What is fifty-one halves of a meter in millimeters? 25500 What is 7/3 of a hour in minutes? 140 Convert 4817.713ml to litres. 4.817713 How many kilometers are there in 0.7822558cm? 0.000007822558 What is five quarters of a microgram in nanograms? 1250 Convert 436153.6 nanoseconds to microseconds. 436.1536 What is 269842.4 years in decades? 26984.24 Convert 5469.114 millilitres to litres. 5.469114 What is 4049.37 millennia in years? 4049370 What is 888.315 micrometers in nanometers? 888315 What is fifteen quarters of a centimeter in micrometers? 37500 What is 3/5 of a litre in millilitres? 600 How many millilitres are there in twenty-one eighths of a litre? 2625 What is 45/2 of a litre in millilitres? 22500 What is fifty-four fifths of a decade in years? 108 Convert 867.5513 centuries to years. 86755.13 What is 2/7 of a week in hours? 48 What is thirteen quarters of a millennium in months? 39000 How many nanometers are there in 470.6156cm? 4706156000 Convert 17.79993 decades to centuries. 1.779993 How many months are there in 3/32 of a millennium? 1125 What is 622948.06 days in weeks? 88992.58 What is 17/10 of a centimeter in micrometers? 17000 Convert 0.1142025 nanograms to tonnes. 0.0000000000000001142025 How many microseconds are there in 26/5 of a millisecond? 5200 Convert 2447.975m to millimeters. 2447975 Convert 799596.4ml to litres. 799.5964 How many nanoseconds are there in 9301.61 minutes? 558096600000000 How many millilitres are there in thirteen eighths of a litre? 1625 How many millennia are there in 188149.38 months? 15.679115 How many decades are there in 1/10 of a millennium? 10 What is four thirds of a hour in seconds? 4800 What is thirty-seven halves of a litre in millilitres? 18500 How many minutes are there in 2/7 of a week? 2880 What is 4.776963 decades in years? 47.76963 How many micrometers are there in 9/10 of a millimeter? 900 Convert 1.971957 days to seconds. 170377.0848 What is 26/5 of a millimeter in micrometers? 5200 Convert 44.1573 millilitres to litres. 0.0441573 How many millennia are there in 6136.291 decades? 61.36291 How many years are there in 54.30624 months? 4.52552 What is 8046.49 centuries in decades? 80464.9 What is 3/5 of a litre in millilitres? 600 Convert 7925023.8 minutes to days. 5503.48875 How many kilograms are there in three fifths of a tonne? 600 What is 3/8 of a litre in millilitres? 375 What is 868.264 years i	{ "pile_set_name": "DM Mathematics" }
+ 3f - 2 = 0. Let o(n) = f - n + 2n + n*3 - 3n*3. What is 2g(l) + 2o(l)? -2l*3 + 2l Let a(r) be the second derivative of r3/6 + r2 + 3r. Let j(p) be the second derivative of p3/6 + p2 - 11p. Give -5a(w) + 4j(w). -w - 2 Let l(t) = t*2 - 10t - 3. Let u(y) = 3y2 - 20y - 7. Calculate 7l(j) - 3u(j). -2j2 - 10j Let f(k) be the second derivative of 1/12k4 - 3/2k*2 + 0 - 1/2k*3 - 3k. Let d(c) = 2c2 - 4c - 4. Calculate -3d(u) + 4f(u). -2u2 Let l(v) = 2788v - 205. Let f(w) = 41w - 3. What is 205f(p) - 3l(p)? 41p Let w(j) = -7j3 - 5j*2 - 5j + 4. Let m(c) = -10c3 - 8c*2 - 8c + 6. What is -5m(a) + 8w(a)? -6a3 + 2 Let t(u) be the first derivative of -u3 - u - 8. Let o(z) = -z2 + 1. Calculate 2o(d) - t(d). d2 + 3 Let c(n) = n3 + 1. Let s(j) = 84j3 + 77. Give -154c(h) + 2s(h). 14h*3 Let a(j) = -j. Let k(g) = 48g. Calculate 40a(d) + k(d). 8d Let y(a) = -7a2 + 3a + 8. Let d be y(2). Let c(q) = q*2 + 3q + 5. Let h(m) = 4m2 + 14m + 24. Determine dc(k) + 3h(k). -2k2 + 2 Let c(d) = d2 - 1. Let f(j) be the first derivative of 3j - 1. Let v(t) = -t*3 + 5t*2 - 4t - 3. Let x be v(3). Give xc(w) + f(w). 3w*2 Let i(y) = -2y*3 + 3y*2 + 4. Let z(r) = 6r*3 - 9r*2 - 11. Determine -11i(a) - 4z(a). -2a*3 + 3a2 Let o(j) = j2 - 2 - j2 + 3 + j2 - j. Let t(b) = -b*3 + 2b*2 - 2b + 2. Let l be 2/((-3 + 4)2). Suppose 10 = -9r + 4r. Determine lt(w) + ro(w). -w3 Let o(c) = 29c - 5. Let u(w) = -29w + 4. What is 4o(s) + 5u(s)? -29s Suppose -5n - 3 = -4n, 0 = -3h + 2n + 12. Let d(c) = 17c2. Let v(y) = 4y*2. Let q = -4 - 5. Give hd(k) + qv(k). -2k2 Let w(n) be the third derivative of n6/60 + n5/12 + n4/8 + n3/3 - n2. Let o(a) = a*3 + 2a*2 + a + 1. Determine -5o(f) + 2w(f). -f3 + f - 1 Let x(v) = v + 5. Let s(p) = -p - 6. Give 3s(t) + 4x(t). t + 2 Suppose 12 = -2l + 6l. Let j(k) = -11k - 2. Let u(s) = -6s - 1. Calculate lj(y) - 5u(y). -3y - 1 Let p(d) = 18d3 + 3d. Let a(y) = -19y3 - 4y. Give 5a(v) + 6p(v). 13v3 - 2v Let t(a) = -4a3 - 5a*2 - 4a - 4. Let v(o) = o + 1. Let p(b) = -t(b) - 4v(b). Let j(c) = 2c*3 + 3c*2. What is -5j(h) + 3p(h)? 2h*3 Let m(i) = -6i*3 - 2i. Let f = 7 - 2. Suppose f - 1 = p. Let c(v) = -v*3. What is pc(u) - m(u)? 2u3 + 2u Let c(u) be the first derivative of -3u2 - 11u + 10. Let f(z) = -2z - 4. Let h = 0 - 1. Let i be ((-6)/4)/(h/(-2)). Determine ic(y) + 8f(y). 2y + 1 Let m(k) = -4k. Let d(a) = 3a. Let q be (-1 - 0 - 0) + 6. What is qm(v) + 6d(v)? -2v Suppose 5r - 12 = -5v + 13, 3v - 3r = -3. Let l(z) = -3 - z + 2z - vz + 2z. Let t(m) = -m + 2. Calculate 2l(i) + 3t(i). -i Suppose -v = 2 - 0. Let r(k) be the first derivative of 2k3/3 + 5k*2/2 + 7k + 2. Let l(g) = g*2 + 2g + 3. What is vr(i) + 5l(i)? i*2 + 1 Let z(c) = -2c*3 - 3c*2 + 5c - 3. Let u(f) be the first derivative of -f*4/2 - 2f*3/3 + 2f*2 - 2f + 15. Determine 3u(r) - 2z(r). -2r3 + 2r Let y(k) = 2k3 + 2k*2 - 2k - 1. Let h be y(-2). Let g(p) = 4p - 5. Let z(n) be the first derivative of 1/2n*2 + 1 - n. Determine hz(w) + g(w). -w Let v(w) = -8w2 + 4w - 4. Let r = -173 + 169. Let y(z) = 7z2 - 3z + 3. Calculate ry(n) - 3v(n). -4n2 Let o(h) = h2 + 4h - 5. Let q be o(-6). Let b(z) = 3z2 - 9z - 4. Let n = 7 - 10. Let c(r) = r*2 - 4r - 2. Determine nb(i) + qc(i). -2i2 - i - 2 Let f(a) = 8a2 - 12. Let b(w) = w2 - 6w - 1. Let t(x) = -x. Let i(g) = -b(g) + 6t(g). Give f(s) + 12i(s). -4s*2 Let f(o) = 9o - 16. Let l(b) = -4b + 8. Calculate 3f(m) + 7l(m). -m + 8 Let k(w) = -11w*2 - 20w + 14. Let o(r) = -4r2 - 7r + 5. Give 6k(a) - 17o(a). 2a2 - a - 1 Let p(g) = g - 42. Let j(w) = w - 28. What is 7j(x) - 5p(x)? 2x + 14 Let t(y) = -6y + 2. Let z(r) be the first derivative of -5r*2/2 + 2r + 1. Let i be (-4)/26 + 15/13. Let k = 5 - i. What is kz(u) - 3t(u)? -2u + 2 Let r(v) = -3v3 - v2 + 7v + 5. Let w(k) = 2k3 + k2 - 5k - 3. Give 5r(o) + 7w(o). -o3 + 2o*2 + 4 Suppose 46 = -2m - 44. Let v(h) = -155h + 45. Let c(n) = 7n - 2. What is mc(s) - 2v(s)? -5s Let j(a) = -a3 + a2 - a. Let u(i) be the third derivative of i6/12 - i5/5 + i4/2 - 6i*2. Calculate -12j(s) - u(s). 2s3 Suppose 5y + 5j = 4j - 8, -y + j - 4 = 0. Suppose 0w = 2w + 14. Let v(r) = -1. Let o(g) = g + 3. Give wv(s) + yo(s). -2s + 1 Let v(p) = -3p*2 + 2. Let n(x) be the third derivative of -4x*5/15 + 11x*3/6 - 7x*2. Determine -2n(a) + 11v(a). -a2 Let j(l) = 5l + 23. Let i(q) = q. Let n(k) = -i(k) - j(k). Let u(w) = w + 4. What is -6n(g) - 34u(g)? 2g + 2 Let c(l) = -l3 - l2. Suppose 2p + 1 = -1. Let o(v) = -6v3 - 3v*2. Determine po(x) + 3c(x). 3x*3 Let j(r) = 0r*2 - 7r + 8r2 - 4r*2. Let f be ((-16)/(-12))/((-2)/9). Let k(l) = 5l*2 - 8l. What is fk(u) + 7j(u)? -2u2 - u Let p(w) = w + 4. Let r(a) be the first derivative of a4/24 + a3/2 + 2a*2 + 1. Let o(c) be the second derivative of r(c). Give 3o(n) - 2p(n). n + 1 Let g(f) = -f2 + 2f + 2. Let m(y) be the second derivative of -5y4/12 + 5y*3/3 + 11y*2/2 - 2y. Give 11g(b) - 2m(b). -b*2 + 2b Let l(y) be the second derivative of -y3 - y2 - y. Let z = 14 + -21. Let g(b) = -5b - 2. Calculate zg(u) + 6l(u). -u + 2 Let o(h) = -2h. Suppose 0 = 2f - q + 9, -f + 2q = f + 10. Let z = 1 - f. Let g(k) = -k. Give zg(r) - 4o(r). 3r Let p(d) = -14d*3 + 2d*2 + 2. Let r(m) = 57m*3 - 9m*2 - 9. Determine 18p(f) + 4r(f). -24f*3 Let t(g) = 17g. Let i(l) = -8l. What is -7i(y) - 3t(y)? 5y Suppose 4p + 7 = 3. Let n(m) = -5m*2 + 4m - 4. Let g(k) = -k*2 + k - 1. Determine pn(j) + 4g(j). j2 Let j(y) = y2 + 24 - y - 12 - 13. Let d(x) = -7x*2 + 7x + 6. What is d(h) + 6j(h)? -h2 + h Let o(v) = -2v - 2. Let n(j) = -5j - 7 + 5j - 6j + 0j. Give 2n(t) - 7o(t). 2t Let b(a) = 6a + 5. Let o(k) be the second derivative of 7k3/6 + 3k*2 + 9k. Let g(r) = -4b(r) + 3o(r). Let h(v) = 1. Calculate g(j) + 2h(j). -3j Let y(h) be the first derivative of -2h4 + 2h*2 - h - 20. Let j(l) = -9l*3 + 5l - 1. What is -6j(z) + 7y(z)? -2z3 - 2z - 1 Let b(x) = -9x3 - 4x*2 + 2. Let v(q) = 17q*3 + 7q*2 - 4. What is 5b(l) + 3v(l)? 6l3 + l2 - 2 Let w(t) = 4t2 - 2t. Let n(x) = 5x2 - 3x - 1. Suppose 3l = 4l. Suppose l = 3i - i - 16. Let q = -5 + i. Determine qw(m) - 2n(m). 2m*2 + 2 Let b(c) = -6c*3 - 6c*2 + 22c - 7. Let a(n) = -2n3 - 2n*2 + 7n - 2. Determine 7a(k) - 2b(k). -2k3 - 2k*2 + 5k Let t(i) = -i*3 + i + 1. Let s(g) = -3g*3 + 2g + 4. Let d(o) = -o*2 - 11o - 6. Let m be d(-10). What is mt(r) - s(r)? -r3 + 2r Suppose 83 = 4t + 95. Let c(a) = -5a*3 + 3a*2 - a. Let x(z) be the third derivative of 7z*6/60 - 2z5/15 + z4/8 - z*2. Calculate tx(b) - 8c(b). -2b3 - b Let u(n) be the second derivative of n4/6 + 5n2/2 - 11n. Let b(i) = 4i2 + 11. Calculate -3b(l) + 7u(l). 2l*2 + 2 Let x(j) = -3j + 1. Let r(q) = 5 + q - 5q + 0q - 4. Give 4r(l) - 5x(l). -l - 1 Let n(l) = 80l3 - 55l - 55. Let u(p) = -3p3 + 2p + 2. Give -2n(h) - 55u(h). 5h3 Let l(d) = 3d*2 - 4d. Let p(k) be the second derivative of 0k2 + 0 - 5k - 11/6k3 + 2/3k*4. Calculate 11l(o) - 4p(o). o2 Let x(h) = -h3 - h2 - 1. Let n(i) = 2i*3 + 3i*2 + 2i - 3. What is n(c) + 3x(c)? -c3 + 2c - 6 Let j(n) = 3n3 + 5n*2 - 8n + 2. Let r(s) = -s3 - s2 + s. Let f(g) = -j(g) - 4r(g). Let q(k) = k3 - 2k*2 + 5k - 3. What is 3f(w) - 2q(w)? w3 + w2 + 2w Let u(r) = -r - 1. Let o(q) = 8q*2 - 16q - 16. Determine o(m) - 16u(m). 8m2 Let m(n) be the first derivative of -n3 + 2n - 3. Suppose -3c = -3k - 3, -7 = -2c - 4k + 19. Let l(t) = -6t*2 + 5. Calculate cm(a) - 2l(a). -3a*2 Let i be (11/11)/(1/6). Let q(y) = 2y + 2. Let g(m) = -2m - 2. Determine iq(z) + 5g(z). 2z + 2 Let i(t) = -72t3 + 13t*2 - 13. Let h(v) = 36v*3 - 6v*2 + 6. What is 13h(x) + 6i(x)? 36x*3 Let v(h) = 2h + 3. Let n(o) be the second derivative of -o**2/2	{ "pile_set_name": "DM Mathematics" }
). -10b2 - 6b Expand (4b2 + 19b*2 - 2b*2)(0b - 2b + b). -21b3 Expand (-3w*2 + 5w2 - w2)(-8w*2 + 14w*2 + 2 + w - 1). 6w4 + w3 + w*2 Expand 12 - 12 + 11o*3 + (2o - 2o + 2o)(-o + 2o*2 + o) + 5o*3 - 3o*3 + 0o*3 + (2o - 2o3 - 2o)(-1 + 1 - 1) - 3o2 + o3 + 3o2. 20o*3 Expand (-4j + 3j + 4j + 4j - 3j - 2j + (-1 - 2j + 1)(-1 + 1 + 2) - 2j - 3j + 6j + (4 - 2 + 0)(1 + 2j - 1))(-5j + 6j - 3j). -6j2 Expand k5 - k5 + k5 - 2k*5 + 4 - 4 + (2k*4 - 2k*4 - 4k*4)(0k + 2k - k) + (2k5 - 4k*5 - 2k*5)(0 - 2 + 3). -9k5 Expand 7o*2 - 3o - 5o2 + 0o - o2 - o2 - o*2 + (-2o + 2o + 2o)(-2 + 2o + 2). 3o2 - 3o Expand -3 + 3 + 2c2 + (-c + 0c + 3c)(4c - 2c - c) + 0c + 0c - 2c2 + 2c2 - c2 + c*2. 4c*2 Expand (2y*3 + 0y + 0y)((-5y - y - 16y)(y - y - 2y) + (-5y + y + 2y)(-3y + 4y - 2y)). 92y5 Expand (3 + 3 + 1)(1 - 1 + 2m). 14m Expand (-1 + 1 + 3)(-2r*5 - 2r*5 + 5r*5). 3r*5 Expand (-4b + 4b - 25b)(3b + 2 - 2). -75b2 Expand (3l - l + l)(l + l - l)(611 - 611 + 11l). 33l*3 Expand (-3c + 1 + 1 + c)(-14c*3 + 114 - 114). 28c*4 - 28c*3 Expand (3r - 5r + 0r)(10 - 6r - 10). 12r2 Expand -5s*5 - 1 + 1 + 0s5 - s5 + 2s5 + (-2s*2 + 4s*2 - 3s*2)(s2 - s3 - s*2). -3s*5 Expand (1 - 4 + 5)(-27 + 12 - 22)(-x3 + 5x*3 - 5x*3). 74x3 Expand (h4 + 3h4 - 3h*4)(-5 + 0 + 4) + (4 + 5h2 - 4)(-h*2 - 2h*2 + 5h*2). 9h*4 Expand -2k3 + k3 + 3k3 + 4k*3 - 4k3 + k3 + (-k - 3k + 2k)(-6k*2 + 2k*2 + 2k*2) - 4k*3 + 4k3 + k3 - 4k3 + 66k - 66k. 4k3 Expand b3 - 5b3 + 3b*3 + (-1 + 1 - 2b*2)(2b - 5 + 5) + 6b*3 - 5b*3 - 14b*3 + (4b - 5b - b)(b*2 - 4b*2 + 4b*2). -20b*3 Expand -2j*2 - 4j*4 + 16j*4 - 10j4 + (-j2 + j2 + j2)(-j2 + j2 + 3j*2). 5j*4 - 2j*2 Expand (2 + 7v + 1 - 9v)(-1 + 0 + 0)(-5 + 2 + 4). 2v - 3 Expand -2l5 + 3l*5 - 5l*5 + (-2l + 4 - 4)(4l4 - l4 - l*4). -8l5 Expand u3 - 5u3 - u3 + (3 + 0 - 2)(2u3 - 4u3 - u3). -8u3 Expand (b + 0b + 2b)((-2b + 2b + b)(-2b + 4 - 4) + 1 - 1 - b2 - b + b - b2). -12b3 Expand (-2h + 4h - h)(2 - 1 - 5)(2 - 2 + 1). -4h Expand (3 - 5 - 1)(13 + 6u*2 - 7u*2 + 2u*2). -3u*2 - 39 Expand m + 2m*3 - m + (-3m + m + 3m)(5m - 5m*2 - 5m) + (3m2 + 3m*2 - 3m*2)(-3 + 3 + 2m). 3m3 Expand (0 + 0 + n2)(n2 + n2 + 8n*2). 10n*4 Expand (0u + 3u - 4u)(2u + 0u - 4u)((1 - 1 - 3u)(12u*2 + 2u*2 - 4u*2) + 2u*3 - 4u3 + u3). -62u5 Expand (-k - k + 0k)(-2 - 4 + 5) - 2k + 6k + 6k + (-5k + 0k + 6k)(-3 + 3 + 2). 14k Expand -34o - 3o4 + 12 + 34o + (-5o2 + o2 + 5o*2)(o*2 + 0o*2 + 0o*2) + 0o*4 + 3o4 - o4 + 0o2 - o4 + 0o2. -o4 + 12 Expand (-3m + 0 + 0)(-104m + 45m + 126m)(0 - 2m + 0). 402m*3 Expand (2 - 2s - 2)(-4 + 3 + 6). -10s Expand -3m5 - 4m*2 + 4m*2 + (-3m + 5m - 4m)(2m*4 - 3m*3 + 3m*3). -7m*5 Expand 1 + 7g*5 - 1 + (5g - g - 2g)(-5g4 + g4 + 5g*4). 9g*5 Expand 0c*3 + 0c3 - c3 + (0 + c + 0)(-c2 + c2 - 2c*2). -3c*3 Expand (7 + 2l*2 - 6l*4 - 7)((-2l + 4l - l)(-2 + 4 - 1) - 1 + 1 + 3l - 2l + 2l - 2l + (4 - 1 - 1)(l - 4l + l)). 12l*5 - 4l*3 Expand (5z - 2z - 2z)(2z*4 + 2z*4 - 2z*4) + 9z - 9z + z5 + 5z*2. 3z*5 + 5z2 Expand (s3 + 0 + 0)(8 - 8 - 5s*2). -5s*5 Expand (0g*3 - 2g*3 + 0g*3)(-5 + 4 + 2 + 6g2). -12g*5 - 2g3 Expand (-n5 + 0n5 + 3n*5)(4 - 4 + 3) + (-2n + n + 0n)(-n4 + 3n*4 + 0n*4). 4n5 Expand -d + d + d3 + (4d - 3d + 0d)(0d + 0d + d*2) + 2d*3 - 3 + 3 - 2d*3 + 0d*3 + 0d*3 - 95d + 95d + 10d*3. 12d*3 Expand (-z + z + z)(z + 0 + 0 + (z - 2z + 3z)(-3 - 1 + 3) - 1 - 3z + 1). -4z2 Expand 5 - 12t*2 - 5 + (2 + 3 - 2)(2t2 + 3t - 3t). -6t*2 Expand (692 - 692 + 85f)(-3f*2 - 3f*2 + 7f*2). 85f*3 Expand (0n + 7n - 2 - 9n)(1 + 0 + 1). -4n - 4 Expand -3x4 + 2x - 2x - 2x*4 + 7x*4 - 3x*4 + (0 + 0 - 2x*3)(0x + x - 7x). 11x4 Expand (-s - 4s + 3s)(-8 - 2s + 2s*3 + 9 - s). -4s*4 + 6s*2 - 2s Expand (-2l + 3l*2 + 2l + (2l2 - 6l*2 + 3l*2)(1 + 1 - 3))(-l - l + 0l). -8l3 Expand (-7 + 4k + 7)(3k - 4k + 0k)(-3k*2 - 4k2 + k2). 24k4 Expand (4k - k - 5k)(5k - 2k - k) + 0k2 + 0k*2 + 7k2 - k2 + 3 - 3. 2k2 Expand (3 - 2 - 3)(-6n + 2n + 15n). -22n Expand 0f5 + 0f5 + f5 + f5 - f5 - f5 + (2 - 2 - f4)(-f + 5f - 2f) - 3f4 + f5 + 3f4 + (2f*5 + 2f*5 - 6f*5)(0 - 1 - 1). 3f5 Expand 0o*2 + 0o2 - o3 + (-o + 4o + 2o)(-3o*2 + 2o*2 + 2o*2). 4o*3 Expand (3 - 4 - 2)(-4u2 + 5u*2 - 3u*2) + 5u - 3u2 + 14u - 26u. 3u*2 - 7u Expand -118l + 486 - 486 + l - 1 + 1 + (3 + 4 - 5)(4l - 2l + 0l) - l - 2l + l + 4 - 4 + l. -114l Expand z4 - 4z*4 + 8z4 + (z2 - z2 - z3)(4z - z + 0z) - 2z4 - z4 + 5z4. 4z*4 Expand (2n*2 + 0 + 0)(-1 - 1 + 4)(-2 + 0 + 0). -8n*2 Expand (-12 - 12 + 6)(2c4 - 3c*4 + 3c*4) + (-3 + 0 + c + 1)(c3 - c3 + c*3). -35c*4 - 2c*3 Expand (-1 + 3 + 0)(8t3 - 6t*3 - 33t*3). -62t*3 Expand (-3 + 3 - 2z)(-6z*3 + 2z*4 + 10z3 - z4). -2z5 - 8z*4 Expand ((0c - 2c2 + 0c)(4c*2 - 3c*2 + 2c*2) - 2c*4 + 2c*2 - 2c*2 + 0c4 + c4 - 3c4)(1 + 3 - 3). -10c4 Expand 2 + 4p + 2 - 2 + (-5 + 1 + 2)(-3p - 2p + 6p). 2p + 2 Expand 3m*2 - 2m*2 + 4m*2 + (-4 + 4 - 2m)(6 - 2 - 10)(-2m + 0m + 4m). 29m*2 Expand (-i + 3i + 0i)(1 + 1 - 1) + 223 + 20i - 223 - 2i - 5i + 4i. 19i Expand (-d3 - d3 + d3)(-3d2 - 4d2 - d2) - 2d5 + 3d*2 - 3d*2. 6d*5 Expand 0z3 + z3 + 2z4 + 2z*4 - 2z4 - z4 + 4z4 + (0z - z*3 + 0z)(0 - z + 0) + (0 - 3 + 5)(4z4 - 3z*4 + 0z*4). 8z4 + z3 Expand (2o - 5o + o)(69o + 701 + 700 - 1399). -138o2 - 4o Expand 2d2 + 0d*2 + 0d*2 + (d - 2d + 0d)(4d - 2d - 3d) + 1 + d2 - 2d2 - d2. d*2 + 1 Expand (0x - 3x + 4x)(2 + 1 - 5) + (-2 + 0 + 3)(-3x - x + 2x). -4x Expand 6r*5 - 4r*5 - 4r*5 + (-4 + 1 + 2 + (-1 + 3 + 2)(3 + 3 - 4) - 1 + 2 + 0)(2r*5 - 4r*5 + 4r*5). 14r*5 Expand -2s*3 + 7s*2 - 17s*2 + 9s*2 + (s + s + 0s)(0s + 2s2 + 0s). 2s3 - s2 Expand (3 - 5 - 4)(-x*2 - 4x*3 + 3x*2 + 2x*3) - 3x*3 - 3x*3 + 4x*3. 10x*3 - 12x*2 Expand (4 - 3 - 2)(-3b - 6b*4 + 2b + b*4 + 2). 5b4 + b - 2 Expand -p5 - p*5 + 3p*5 + (12p + 8p2 - 12p)(p3 - 4p*2 + 4p*2). 9p*5 Expand (-1 - 4r + 1)(2r - 2r - r)(-2 - 3 + 7)(-2r + 2r - r2). -8r*4 Expand -11g*5 + 32 - 32 + (-2g*2 + 5g2 - g2)(-g3 - 5g*3 + 4g*3) - 3g*5 + 0g*5 + 5g5 + (g4 - 4g4 + g4)(5g - 2g - 2g). -15g5 Expand (w3 + 0w3 + 0w*3)(-w + 7w + 0w) - 2 - w*4 + 2. 5w*4 Expand (1 - 1 + 5q - 2)(-1 + 6q*3 + 2q*3 - 4q*3). 20q*4 - 8q*3 - 5q + 2 Expand (1 + 3 - 3)(-3 + 6 + 0)(2r - 2r - r*5 + (4r - 4r + 2r*2)(-3r3 + r3 + 4r*3) - 2r5 - r5 + r*5). 3r*5 Expand -3t*5 + 4t*5 + 0t5 + ((t2 - t2 + t3)(-t + 1 - 1) - t4 + 0t*4 + 0t*4)(t + 1 - 1). -t*5 Expand (-20r - 20 + 20)(2 + 2r - 2)(r2 + 0r*2 + 0r*2). -40r*4 Expand (4j - 3j + 2j)(3 - 2 + 0) + (-4 - 2j + 4)(-3 + 4 + 1). -j Expand (-n2 - n2 + 0n*2)(10 + 3n - 7 - 2n). -2n3 - 6n*2 Expand -2u*5 + 5u*5 - 2u*5 + (-2u*2 + 3u + u*2 + 3u*2)(2u2 - 2u*2 + 4u*3). 9u*5 + 12u*4 Expand -50w + 50w - 2w*2 - 4w*2 + 2w*2 + 4w*2 + (3w - 3w - w)(-w + 0w + 0w). w*2 Expand -8s + 19s + 21s + (1 - 1 + s)(-2 - 2 + 7). 35s Expand -5 - h*4 + 5 + 0h4 - h4 + 3h4 + (0 + h + 0)(-2h3 + 2h*3 + 7h*3). 8h*4 Expand (s - s - 2s*2)(3s2 - 3s*2 + 2s*2)(-3 + 3 - 3s) + (121s*4 - 140s*4 + 71s*4)(1 - 1 + 2s). 116s5 Expand -a3 + a3 + a3 + (-1 + a + 1)(a2 + 2a2 - a2) +	{ "pile_set_name": "DM Mathematics" }
be the first derivative of 8f5/5 - 7f*4/2 - 2f*3/3 + 7f*2 - 6f + 27. Factor x(v). 2(v - 1)2(v + 1)(4v - 3) Let h(g) = -3g3 - g2 - g + 1. Let p be h(1). Let z be (-2)/p - (-2)/(-20). Find q such that -zq*3 + 0q - 2/5q2 + 0 = 0. -1, 0 Let x(n) be the first derivative of 0n + 2 + 0n2 + 0n*3 + 1/27n*6 + 4/45n*5 + 1/18n*4. Factor x(b). 2b*3(b + 1)2/9 Let x be (2/12)/((12/(-9))/(-4)). Factor -y3 + 1/2y5 + xy*4 + 1/2 + 1/2y - y2. (y - 1)2(y + 1)3/2 Let p(w) be the second derivative of w5/20 + w4/12 - 4w. Let j be p(0). What is s in 0s + s2 + js + 2s4 - 3s2 = 0? -1, 0, 1 Let m(r) be the second derivative of r7/14 + r*6/10 - 9r*5/20 - 5r4/4 - r3 - 4r. Solve m(d) = 0 for d. -1, 0, 2 Let q(i) be the first derivative of 4/3i + 2/3i2 - 1 + 1/9i3. Factor q(r). (r + 2)2/3 Suppose -3u + 8 + 10 = 3r, 0 = -2u - 5r + 24. Suppose -5o = -17 + u. Factor j - j3 + 2j*4 - 5j*2 + 3j*2 - oj*4 + 3j*2. -j(j - 1)(j + 1)2 Let s(x) = -2x + 2. Let i be s(4). Let m = 10 + i. Determine n so that -2n2 + 9n*3 - 9n + 0n2 + 0 + 7n*m - 3n2 - 2 = 0. -1, -2/7, 1 Let k(n) be the second derivative of -n4/8 - n*3/4 + 3n. Let k(t) = 0. Calculate t. -1, 0 Suppose 3y = -n + 11, -y - y - 4 = -5n. Find m such that 11m3 + 7m*2 + 16m*4 - 2m*n + 7m*5 - 3m*2 = 0. -1, -2/7, 0 Let a(p) = 4p*2 + 20p - 50. Let z(d) = 2d2 + 20d - 50. Let m(i) = -2a(i) + 3z(i). Factor m(b). -2(b - 5)2 Let z(y) be the third derivative of -27y*6/8 - 3y*5 - 5y*4/6 - 22y*2. Factor z(w). -5w(9w + 2)*2 Let z be ((-4)/18)/(1/(-3)). Let v = -85 - -87. Factor 0c + 0 + zcv + 2/3c*3. 2c*2(c + 1)/3 Let p(w) = -w*2 - w + 1. Let r(f) = -16f*2 - 20f + 12. Let b(o) = -12p(o) + r(o). Let b(g) = 0. Calculate g. -2, 0 Let h(z) = 3z*3 + 12z*2 - 12z. Let o(j) = j*2 - j. Let r(y) = -h(y) + 12o(y). Factor r(k). -3k3 Let r(a) be the first derivative of 4a*3/15 - 6a*2/5 - 16a/5 - 35. Factor r(z). 4(z - 4)(z + 1)/5 Let r be (6564/8)/(-544 + 1). Let a = -2/181 - r. Find v, given that 3v2 - v3 - 1/2 + av*5 - 1/2v - 5/2v4 = 0. -1, -1/3, 1 Let a be (-48)/(-27) + (-155)/45 + 3. Factor -1/3p*3 - ap + 4/3p2 + 0. -p(p - 2)*2/3 Let r = 4/29 - 43/522. Let u(c) be the second derivative of rc*4 - 3c + 0 + 0c2 + 1/9c3. Solve u(a) = 0. -1, 0 Let j(u) be the third derivative of -u5/480 - 5u4/32 - 75u*3/16 - 27u2. Factor j(r). -(r + 15)2/8 Suppose 14 = 3o + 3c - 2c, 18 = o - 3c. Factor o - 9k3 - 3k*2 + 12k*4 - 6. 3k*2(k - 1)(4k + 1) Let d = 26 + -19. Let 84y2 - 16 - 101y*3 - 20y + 40y4 + dy*3 + 12y - 6y5 = 0. Calculate y. -1/3, 1, 2 Suppose 1 = -p - 3. Let o(c) = -6c*3 + 15c*2 + 6c + 3. Let b(v) = 3v3 - 7v*2 - 3v - 1. Let t(n) = po(n) - 9b(n). Let t(l) = 0. What is l? -1, 1 Let i(o) = -o + 12. Let b be i(8). Suppose t = -t. Factor -8s + ts*b - 2s*2 - 8s*3 - 10s*2 - 2 - 2s*4. -2(s + 1)*4 Let m(y) be the second derivative of 5/3y*3 - 3/4y*4 + 0 + 7/40y*5 - 2y*2 - 1/60y*6 - 3y. Factor m(t). -(t - 2)*3(t - 1)/2 Determine u, given that 1/5u4 + 9/5u*2 + 0 - 6/5u*3 + 0u = 0. 0, 3 Solve 1/2k5 + 5/2k*4 + 0 + 3/2k*2 + 0k + 7/2k3 = 0. -3, -1, 0 Let f(o) = -o3 - o - 1. Let a(i) = -4i - 3. Let p be a(-2). Let j(r) = -4r3 - r2 - 5r - 5. Let t(w) = pf(w) - j(w). Factor t(y). -y2(y - 1) Let g(i) be the first derivative of -1/8i4 + 9 - i + 1/4i*2 + 1/3i*3. Suppose g(y) = 0. What is y? -1, 1, 2 Solve -2/9s*4 + 2/9 + 4/9s - 4/9s3 + 0s*2 = 0 for s. -1, 1 Suppose 47v - 95 = 46. Factor 0 + 0k + 0k*2 + 3/7k*v. 3k*3/7 Let h = 647/5 - 129. Suppose 1 = -u + 3s, 0 = -5u - 5s + s + 33. Let -2/5w2 + 0 + hw*4 - 1/5w*u + 0w*3 + 1/5w = 0. Calculate w. -1, 0, 1 Let o be 5/(-2)12/(-10). Suppose -20 = -2d - 14. Factor -5h3 + 4h2 - h2 - h + 0hd + h4 + 2h*o. h(h - 1)*3 Let k(o) = 37o*2 - 45o - 1. Let w = -4 - -13. Let l(f) = 9f2 - 11f. Let u(m) = wl(m) - 2k(m). Factor u(g). (g - 1)(7g - 2) Let d(c) be the second derivative of -2c6/15 - 7c*5/5 - 5c*4 - 26c*3/3 - 8c*2 + 5c. Suppose d(n) = 0. Calculate n. -4, -1 Let c(r) = -18r4 - 17r*3 + 23r*2 + 12r. Let o(m) = 9m4 + 9m*3 - 12m*2 - 6m. Let i(j) = 3c(j) + 5o(j). Factor i(y). -3y(y - 1)(y + 1)(3y + 2) Determine q, given that 1/2 - 5/4q + q*2 - 1/4q*3 = 0. 1, 2 Let m(z) = -3z*2 + 5z + 3. Let i(q) be the second derivative of q4/12 - q3/3 - q*2/2 - 4q. Let f(h) = 5i(h) + 2m(h). Determine p so that f(p) = 0. -1, 1 Let p(r) = -r - 1. Suppose 5o + 15 = -0o. Let q(t) be the third derivative of t*5/30 - 7t4/24 - t3/6 + 3t2. Let u(a) = op(a) + q(a). Factor u(x). 2(x - 1)2 Let -11t - 39 + 14t - 3t2 + 39 = 0. Calculate t. 0, 1 Let f(h) be the third derivative of h8/90720 + h7/5670 + h6/810 - h*5/20 - 2h*2. Let x(c) be the third derivative of f(c). Factor x(s). 2(s + 2)*2/9 Let f = -2/461 + 11531/1383. Factor 0v*2 - 4/3v*3 + 0v + 20/3v4 - fv5 + 0. -v3(5v - 2)2/3 Let o(f) be the second derivative of -f9/5040 + f*7/840 + 5f*4/12 - 4f. Let m(n) be the third derivative of o(n). What is c in m(c) = 0? -1, 0, 1 Factor 7x - 4x*2 - 4x*4 - 6x*3 - 8x - x*5 + 0x*3. -x(x + 1)*4 Let y = 2/669 + 148/223. What is p in 2/3p + yp3 + 0 + 4/3p2 = 0? -1, 0 Let t(n) be the second derivative of n10/15120 + n9/3780 + n8/3360 - n*4/4 + 2n. Let s(k) be the third derivative of t(k). Factor s(m). 2m3(m + 1)*2 Factor -46f*3 + 64f*2 - 36f - 4f5 + 8 - 10f*3 + 24f*4 - 5f*5 + 5f*5. -4(f - 2)(f - 1)4 Factor 15n + 40n3 + 5n - 255n4 + 10n - 95n2 + 280n*4. 5n(n - 1)(n + 3)(5n - 2) Let p be (-4)/10 - 2/(-5). Let c be (41)/((-2)/(-1)). Solve r2 - 3r*2 + prc = 0 for r. 0 Suppose o = -3 - 15. Let c be 4/18 + (-32)/o. Factor l4 - cl2 + 2l4 + l4 - 2l4. 2l*2(l - 1)(l + 1) Find w, given that -20/3w*3 + 0 + 0w*2 + 0w + 2w4 + 2/3w5 = 0. -5, 0, 2 Let m(l) be the third derivative of l5/60 - 2l3/3 - 25l*2. Factor m(k). (k - 2)(k + 2) Let c(s) be the third derivative of -3s8/14 - 13s*7/35 + 8s*6/15 + 43s5/30 + s4/3 - 4s3/3 - 14s*2. Solve c(j) = 0 for j. -1, -2/3, 1/4, 1 Let r be (-30)/(-2) + (-7 - -8). Find d, given that 16d + 4d5 - 4d*3 - rd = 0. -1, 0, 1 Let g(n) = -8n4 + 26n*3 - 45n*2 + 27n. Let y(z) = -9z4 + 27z*3 - 45z*2 + 27z. Let k(d) = -6g(d) + 5y(d). Let k(w) = 0. What is w? 0, 1, 3 Let q(s) be the third derivative of 7s6/24 + 5s*5/4 + 15s*4/8 + 5s*3/6 - 32s*2. Determine v, given that q(v) = 0. -1, -1/7 Let f be (0 - 4/3)/((-48)/72). Determine b, given that 0 - 1/3b*f + 1/3b*3 + 0b = 0. 0, 1 Suppose -4g - 35 - 73 = 0. Let c be (-12)/g + 6/(-27). Let cp*3 + 0 - 2/9p*4 + 2/9p*2 - 2/9p*5 + 0p = 0. Calculate p. -1, 0, 1 Let h(c) be the third derivative of -5c8/336 + c6/12 - 5c*4/24 - 13c*2. Factor h(o). -5o(o - 1)2(o + 1)2 Let k(n) be the second derivative of n8/3360 - n7/630 - n6/360 + n5/30 - n4/4 + n. Let x(g) be the third derivative of k(g). What is d in x(d) = 0? -1, 1, 2 Let d(y) be the first derivative of -1/7y2 + 1/14y*4 + 2/7y - 2/21y3 + 3. Factor d(t). 2(t - 1)*2(t + 1)/7 Find p, given that -3/4p2 - 1/8p*3 - 3/4 - 11/8p = 0. -3, -2, -1 Let i(f) be the first derivative of -1/3f3 + f5 + 0f*2 + 2 + 0f - 1/8f4. Suppose i(n) = 0. What is n? -2/5, 0, 1/2 Let i = 57847/2492 - 25/356. Find d, given that -72/7d - id2 - 8/7 = 0. -2/9 Let n(h) be the third derivative of 1/420h*7 + 5/48h*4 - 1/240h*6 - 1/40h*5 + 4h*2 - 1/6h*3 + 0h + 0. Factor n(o). (o - 1)*3(o + 2)/2 Let b(k) be the third derivative of k6/90 + k5/9 - 42k2. Factor b(t). 4t*2(t + 5)/3 Let -21/8x3 + 3/8 + 3/4x*4 - 15/8x + 27/8x2 = 0. Calculate x. 1/2, 1 What is i in -3i - 6i + 16i*2 + 2i + 4i3 + 19i = 0? -3, -1, 0 Suppose 17 = 5f - 3. Suppose 3w - 2w = f. Find h, given that 6h*3 + 7h2 + h4 - h*2 + wh - 2h*3 + 1 = 0. -1 Let s(d) be the firs	{ "pile_set_name": "DM Mathematics" }
of 488772. 2, 3, 13577 List the prime factors of 330346. 2, 165173 What are the prime factors of 328044? 2, 3, 27337 What are the prime factors of 1883946? 2, 3, 313991 List the prime factors of 518178. 2, 3, 67, 1289 What are the prime factors of 24590? 2, 5, 2459 What are the prime factors of 2851460? 2, 5, 142573 List the prime factors of 25522. 2, 7, 1823 What are the prime factors of 3080781? 3, 11, 23, 41 List the prime factors of 1949306. 2, 974653 List the prime factors of 18442407. 3, 19, 17029 List the prime factors of 2372438. 2, 757, 1567 List the prime factors of 500430. 2, 3, 5, 7, 2383 What are the prime factors of 1618376? 2, 89, 2273 What are the prime factors of 2784667? 29, 131, 733 What are the prime factors of 3319613? 11, 23, 13121 List the prime factors of 6755921. 47, 143743 List the prime factors of 700509. 3, 239, 977 List the prime factors of 1391132. 2, 23, 15121 What are the prime factors of 11205870? 2, 3, 5, 13, 59, 487 List the prime factors of 35962398. 2, 3, 1997911 What are the prime factors of 905039? 359, 2521 What are the prime factors of 1014341? 1014341 What are the prime factors of 3701543? 3701543 What are the prime factors of 61510? 2, 5, 6151 What are the prime factors of 394153? 394153 What are the prime factors of 42529? 71, 599 What are the prime factors of 12519621? 3, 401, 3469 What are the prime factors of 14226390? 2, 3, 5, 158071 List the prime factors of 4146740. 2, 5, 13, 41, 389 List the prime factors of 296960. 2, 5, 29 List the prime factors of 4310287. 1361, 3167 List the prime factors of 195307. 7, 27901 What are the prime factors of 19862309? 19862309 What are the prime factors of 23629635? 3, 5, 19, 29, 953 List the prime factors of 148408. 2, 13, 1427 List the prime factors of 185042. 2, 11, 13, 647 What are the prime factors of 872877? 3, 290959 What are the prime factors of 745520? 2, 5, 9319 List the prime factors of 3983854. 2, 7, 284561 List the prime factors of 70595. 5, 7, 2017 List the prime factors of 149343. 3, 67, 743 List the prime factors of 21976217. 19, 1156643 List the prime factors of 1847677. 13, 29 What are the prime factors of 198853? 29, 6857 What are the prime factors of 32846? 2, 11, 1493 What are the prime factors of 5094152? 2, 7, 17, 5351 What are the prime factors of 328110? 2, 3, 5, 10937 What are the prime factors of 21331453? 11, 13, 71, 191 What are the prime factors of 125933? 125933 What are the prime factors of 824105? 5, 164821 List the prime factors of 1798218. 2, 3, 99901 What are the prime factors of 547055? 5, 23, 67, 71 List the prime factors of 3810207. 3, 727, 1747 What are the prime factors of 18640541? 18640541 What are the prime factors of 5836097? 19, 307163 What are the prime factors of 264886? 2, 29, 4567 What are the prime factors of 183969? 3, 20441 List the prime factors of 2195404. 2, 548851 What are the prime factors of 4449285? 3, 5, 98873 List the prime factors of 2201440. 2, 5, 13759 What are the prime factors of 17686162? 2, 13, 680237 List the prime factors of 132106. 2, 13, 5081 List the prime factors of 1973731. 1973731 What are the prime factors of 7806836? 2, 1951709 What are the prime factors of 81159? 3, 13, 2081 List the prime factors of 5591738. 2, 19, 147151 What are the prime factors of 21016? 2, 37, 71 What are the prime factors of 564536? 2, 7, 17, 593 List the prime factors of 1812997. 109, 16633 List the prime factors of 33838439. 3881, 8719 What are the prime factors of 15477851? 29, 533719 What are the prime factors of 236496? 2, 3, 13, 379 What are the prime factors of 548306? 2, 11, 24923 What are the prime factors of 299403? 3, 13, 853 List the prime factors of 7238436. 2, 3, 603203 List the prime factors of 1501547. 31, 48437 What are the prime factors of 8496441? 3, 109, 2887 List the prime factors of 1749699. 3, 7, 27773 What are the prime factors of 324767? 19, 17093 List the prime factors of 69313. 69313 What are the prime factors of 4341248? 2, 61, 139 What are the prime factors of 6322086? 2, 3, 59, 5953 What are the prime factors of 184140? 2, 3, 5, 11, 31 What are the prime factors of 2368795? 5, 11, 13, 3313 List the prime factors of 253490. 2, 5, 25349 What are the prime factors of 853753? 79, 101, 107 What are the prime factors of 13773092? 2, 239, 14407 What are the prime factors of 615875? 5, 13, 379 What are the prime factors of 826806? 2, 3, 41, 3361 List the prime factors of 19223172. 2, 3, 29, 18413 What are the prime factors of 4479407? 31, 144497 What are the prime factors of 8622806? 2, 4311403 What are the prime factors of 126881? 181, 701 What are the prime factors of 3159026? 2, 13, 121501 List the prime factors of 1815125. 5, 13, 1117 List the prime factors of 176224. 2, 5507 What are the prime factors of 22311647? 73, 305639 List the prime factors of 119685. 3, 5, 79, 101 List the prime factors of 3911362. 2, 7, 13, 21491 What are the prime factors of 171548? 2, 13, 3299 List the prime factors of 112775. 5, 13, 347 What are the prime factors of 281296? 2, 17581 What are the prime factors of 33024289? 83, 163, 2441 List the prime factors of 3266744. 2, 13, 101, 311 What are the prime factors of 13417421? 37, 362633 List the prime factors of 788747. 19, 41513 What are the prime factors of 3164038? 2, 1582019 What are the prime factors of 41588? 2, 37, 281 What are the prime factors of 12045520? 2, 5, 17, 521 List the prime factors of 7845569. 47, 79, 2113 What are the prime factors of 201464? 2, 25183 What are the prime factors of 117830? 2, 5, 11783 List the prime factors of 1190743. 1190743 List the prime factors of 4174094. 2, 2087047 List the prime factors of 323770. 2, 5, 32377 List the prime factors of 2710383. 3, 13, 69497 What are the prime factors of 40951950? 2, 3, 5, 13, 21001 What are the prime factors of 4459386? 2, 3, 67, 11093 List the prime factors of 69102. 2, 3, 11, 349 What are the prime factors of 3326706? 2, 3, 29, 6373 What are the prime factors of 328266? 2, 3, 6079 List the prime factors of 925266. 2, 3, 154211 What are the prime factors of 34027? 7, 4861 List the prime factors of 29294706. 2, 3, 7, 17, 89, 461 What are the prime factors of 126131? 126131 What are the prime factors of 9236286? 2, 3, 131, 3917 What are the prime factors of 807993? 3, 17, 5281 What are the prime factors of 879498? 2, 3, 61, 89 What are the prime factors of 58330? 2, 5, 19, 307 List the prime factors of 33620015. 5, 11, 13, 3617 List the prime factors of 15458. 2, 59, 131 List the prime factors of 886556. 2, 11, 20149 List the prime factors of 268491. 3, 31, 2887 What are the prime factors of 373664? 2, 11677 List the prime factors of 1822784. 2, 19, 1499 List the prime factors of 1318746. 2, 3, 11, 13, 29, 53 What are the prime factors of 158802? 2, 3, 7, 19, 199 List the prime factors of 7439321. 2131, 3491 List the prime factors of 11643265. 5, 2328653 List the prime factors of 584999. 584999 List the prime factors of 209957. 11, 19087 List the prime factors of 442894. 2, 221447 What are the prime factors of 131930? 2, 5, 79, 167 What are the prime factors of 8889194? 2, 193, 23029 What are the prime factors of 14456645? 5, 7, 29, 14243 What are the prime factors of 667543? 103, 6481 List the prime factors of 12189. 3, 17, 239 List the prime factors of 1625136. 2, 3, 33857 List the prime factors of 3828409. 13, 317, 929 List the prime factors of 48862. 2, 11, 2221 What are the prime factors of 350733? 3, 116911 What are the prime factors of 6111884? 2, 1527971 What are the prime factors of 5675751? 3, 23357 What are the prime factors of 810470? 2, 5, 81047 What are the prime factors of 18408773? 17, 43, 25183 What are the prime factors of 5136671? 1103, 4657 What are the prime factors of 1121384? 2, 11, 12743 List the prime factors of 1556618. 2, 7, 111187 What are the prime factors of 265888? 2, 7, 1187 What are the prime factors of 12063913? 29, 47, 53, 167 What are the prime factors of 131340? 2, 3, 5, 11, 199 What are the prime factors of 124370? 2, 5, 12437 List the prime factors of 30070437. 3, 593, 16903 What are the prime factors of 43195? 5, 53, 163 List the prime factors of 869802. 2, 3, 144967 List the prime factors of 202076. 2, 7, 1031 What are the prime fac	{ "pile_set_name": "DM Mathematics" }
= 273617. Let w be (-1 + y)3000/32. Round w to the nearest 1000000. -6000000 Let u = 26581 + -26820.53. Round u to zero dps. -240 Let f = 1100 + -453. Let z = f - 1049. What is z rounded to the nearest 100? -400 Suppose 53k + 56686618 = -13k - 3283622. Round k to the nearest 1000. -909000 Let p = 8585.467 - 8577. Round p to zero decimal places. 8 Let c = 9247 - 9211.07. What is c rounded to 0 decimal places? 36 Let i = 67680.9999947471 + -67681. What is i rounded to seven dps? -0.0000053 Suppose 46b - 30 = 40b. Suppose bf + 2v = 14029992, -2v - 7 = 1. Let x be (-41/(-2))/(23/f). What is x rounded to the nearest 10000? 240000 Let h(q) = -2q*2 + 35q + 171. Let f be h(38). Round f to the nearest 10. -1390 Let u = 429.2456 + -429. Let q = -115.183 + 115. Let t = q + u. Round t to 2 decimal places. 0.06 Let b = -158100 + 158093.5479. Let j = 6.39 + b. Round j to two dps. -0.06 Let f = 13 - 27. Let b = 18 + f. Suppose 11w = bw + 144900000. Round w to the nearest 1000000. 21000000 Let v = -5.6 - -5. Let o = -8.51 + -0.39. Let u = v - o. What is u rounded to 0 dps? 8 Let x = 131.32 - 131.8693. Round x to 1 dp. -0.5 Let z = 6668634568685 - 6668605973228.000001. Let s = z - 28595384. Let f = -73 + s. Round f to 7 dps. -0.000001 Let j = -267.675 - -212.71. Let a = j + 55. Let p = a - -0.465. Round p to 1 dp. 0.5 Let j(a) = -2a2 + 17a + 88. Let b be j(12). Suppose 2796975 = d - 5g, d + 8390975 = bd - 5g. What is d rounded to the nearest one hundred thousand? 2800000 Let s = -31765 - -31887.6. Round s to 0 dps. 123 Suppose -45319990 = -4b - 5c, -26129066 = -3b - c + 7860932. What is b rounded to the nearest one hundred thousand? 11300000 Let m = 0.05553 + 0.02186. What is m rounded to 2 dps? 0.08 Let k = 383.49273 + 0.33727. What is k rounded to the nearest 10? 380 Let w = 12436.7478 - 12438. Round w to 2 dps. -1.25 Let y = -259621.95600071 - -259620.136. Let n = -1.82 - y. Round n to 7 decimal places. 0.0000007 Let u = 1.9463 - 2.02443. Round u to two dps. -0.08 Let y = 2488.424 + 38.276. Round y to the nearest 10. 2530 Let t = -0.049826096758 - 2080.950089203242. Let q = t - -2081. What is q rounded to 5 dps? 0.00008 Suppose 0 = 9b + 35 - 359. Suppose -15808000 = -bt + 20t. Round t to the nearest 100000. 1000000 Let w = -178096 + 178099.92269. Let f = w + -3.89. Round f to three decimal places. 0.033 Let u = -383 - -385. Suppose 3r - 19100012 = -5p, p = -3r + ur + 3820004. Round p to the nearest one million. 4000000 Let a = 46.9 - 78.8. Let b = 7.1 - a. Let o = b - 38.26. Round o to one decimal place. 0.7 Let s = 66.35 - 60.696. Round s to one dp. 5.7 Let o = -40.12 + -0.88. Let m = 62 + o. Let b = 20.9963 - m. Round b to 3 decimal places. -0.004 Let q = 2625.9265 - 2634.8. Let n = -0.0335 - q. Let x = -12 + n. What is x rounded to one dp? -3.2 Let n(h) = -h3 + 16h*2 + 17h + 22. Let g be n(17). Let f = g - 39. Let w(p) = 5p - 5. Let u be w(f). Round u to the nearest 100. -100 Let j = -242668011 + 242522898.00144. Let o = 145092 + j. Let z = o - -21. What is z rounded to 3 decimal places? 0.001 Let u(f) = 516f*2 + 39f + 570. Let j be u(46). What is j rounded to the nearest one hundred thousand? 1100000 Let j = 336.4 - 336.393241. Round j to three dps. 0.007 Let w = -636.4016 - 61.7669. Let h = 698 + w. Round h to 3 decimal places. -0.169 Let k(o) be the second derivative of 84017o4/6 - 2o*3 + 5o*2/2 + 23o. Let m be k(-6). Let c = m + -3079301. Round c to the nearest 1000000. 3000000 Let v = -905.22 - -368.3. Round v to the nearest one hundred. -500 Let h = 1.7 - 1.708. Let c = -0.152 - h. Let j = c + 0.14286. What is j rounded to four decimal places? -0.0011 Let i(s) = 4175s + 100. Suppose 28 = -59o + 57o. Let k be i(o). What is k rounded to the nearest one thousand? -58000 Let y = 0.05 + -0.014. Let t = y - -6.964. Let f = t + -6.9958. What is f rounded to 4 dps? 0.0042 Let y(w) = -7 - 6 - 5 - 116w - 2. Let c(a) = -a + 3. Let l be c(-2). Let o be y(l). Round o to the nearest one thousand. -1000 Let x be (-105)/(-35) - (-1 - -10). Let j be (x/4)/(4/(21768/(-9))). Round j to the nearest 100. 900 Let b = -160.2177 + 4.7447. Let z = b + 156.2. Round z to 1 dp. 0.7 Let u = -7626.106 - -7652. Round u to one decimal place. 25.9 Let b(p) be the first derivative of 25433p2/2 + p + 72. Let g be b(3). What is g rounded to the nearest 1000? 76000 Let q = 1843.15 + -1940. What is q rounded to the nearest ten? -100 Let c = 174.6945 - 182.694956. Let i = -1.141 - -9.141. Let x = i + c. Round x to 5 decimal places. -0.00046 Let x = -163 + 162.326. Let p = 0.6740128 + x. What is p rounded to five dps? 0.00001 Let r(c) = -475275c + 2850. Let p be r(54). Round p to the nearest 1000000. -26000000 Let a = -132 + 137. Suppose -5b + ar + 175162 = -105463, -b + 56149 = 5r. Let g = b - 143129. What is g rounded to the nearest 10000? -90000 Let c = -7277.694 - -37.894. What is c rounded to the nearest one hundred? -7200 Let u = -38.5 - -38.697. Let k = -0.1971018 + u. Round k to five decimal places. -0.0001 Let g = -110 - 7. Let r = g - -116. Let l be 14((0 - -7001) + r). What is l rounded to the nearest 10000? 100000 Let z = -385.66 + 385.689539. Round z to 2 decimal places. 0.03 Let w = -13003.46 - -12849. Let b = -178.6 - w. Round b to the nearest 10. -20 Let q(g) = g + 5. Let z be q(5). Suppose 0 = -j - j + z. Suppose r = -2r + 15, -ju + 25500015 = 3r. Round u to the nearest one million. 5000000 Let i(f) = 67139f*2 + 34f - 8. Let k be i(38). Suppose -k = 17s - 12s. What is s rounded to the nearest 1000000? -19000000 Suppose 0 = -2h + 7u + 74896, -h + 37435 = -u + 4u. What is h rounded to the nearest 100? 37400 Let s = 150.8 - -3.2. Let u = s + 43. Let d = u + -199.29. What is d rounded to 1 decimal place? -2.3 Let v = -18.6 + 19.88. Let g = 1.77 - v. What is g rounded to one dp? 0.5 Let s = 48.60121544 - 48.6. What is s rounded to 5 decimal places? 0.00122 Let b = -84022.81977 - -84022. Round b to 1 dp. -0.8 Let m = -0.01419 + 232.56419. Let r = m + -237. What is r rounded to 1 decimal place? -4.5 Suppose 5r - 21312144 = -19r. Let w be 3/12-2 - r/(-12). Round w to the nearest 100000. 100000 Let o = -551 + 551.329. Let g = 0.631 - o. What is g rounded to two dps? 0.3 Let n = -178.6001 - -177.54. What is n rounded to one dp? -1.1 Let g = 81 + 68. Let z = -88 + g. Let n = 61.00000029 - z. Round n to seven decimal places. 0.0000003 Let i = -21.9 - -112.5. Let b = -53.5617 - 0.4383. Let t = b + i. Round t to 0 dps. 37 Let d = 385 - 260. Let l be (-1110d)/(5/((-360)/27)). Round l to the nearest one million. 0 Let b(l) = 4l + 5. Let f be b(-3). Let o(a) = 9a2 + 6a - 5. Let v be o(f). Suppose y + v = 3y. Round y to the nearest ten. 200 Let a = 98632915 - 56979915. What is a rounded to the nearest 1000000? 42000000 Let j = 13 - -9. Let z = j - 22.156. Let r = -8.544 + z. Round r to the nearest integer. -9 Let s = -437.99936 + 438. What is s rounded to three dps? 0.001 Let d = -19356401182 + 19356401802.00004648. Let g = d - 620. What is g rounded to six dps? 0.000046 Let s be (1 + -3 + 50324)/(9/300). Round s to the nearest one hundred thousand. 1700000 Let a = 2067.9083 + -2068. Let x = a + 0.09170371. Round x to 7 dps. 0.0000037 Let p(j) = -5j + 84. Let i be p(16). Suppose -60798 = id - a, 0 = -2d + 4a + 8596 - 38988. Round d to the nearest 1000. -15000 Let m = -4552 + 4016.8. Let p = 627 + m. What is p rounded to the nearest ten? 90 Let c = 0.031976 + -0.05765. Let i = c - -0.025. Round i to 5 dps. -0.00067 Let j(f) = 420f + 1641. Let x be j(12). What is x rounded to the nearest one hundred? 6700 Let f = -999 - -1698. Let t = f + -698.9999046. What is t rounded to 5 dps? 0.0001 Let z = 55 - 54.901. Let h = 13.229 - z. Let v = h + -13.1911. Round v to two decimal places. -0.06 Let j = 12.463 - 12.46241584. Round j to four decimal places. 0.0006 Let n = -4448 + 4447.999999705. Round n to seven dps. -0.0000003 Let i = 131 + -127. Let q be (1/2)/((-18)/i - -5). Let u be (q - -249 - 0)*2080. What is u rounded to the nearest 100000? 500000 Let d = 0.748 - 71.948. Let v = -3179 - -3098. Let i = d - v. What is i rounded to the nearest integer? 10 Let p = -75.235 - -76. Let g = -44.865 + p. Round g t	{ "pile_set_name": "DM Mathematics" }
maller: -13/2 or d? -13/2 Let c = 9590 - 28717/3. Suppose -5m + 86 = 5n - 14, 34 = 2m - n. Which is bigger: c or m? m Suppose 3z + 2j - 11 = 2z, -j = -z + 2. Suppose 0 = -v + 5f - 17, 0 = -zv + 2v + f - 51. Is v > -1? False Let n be 0 - 3 - (1 + (-18)/5). Let j be (-3)/2 + (-2)/(-4). Is n smaller than j? False Let g = -1215 + 1214. Is -4.25 less than g? True Suppose -l - 6 = 3. Suppose 4g - 5s = -25, 5g + 3s - 6 = -28. Let f be (-3 + 92/20)g. Which is smaller: f or l? l Let c(v) = -v - 4. Let o be c(-5). Let f = -100 + 96. Let s be (-3 + (-11)/f)/(12/18). Which is smaller: o or s? s Let k be ((172/6)/1)/((-74)/333). Is -130 less than k? True Let z = 174.62 + -173. Let j = 0.38 + z. Which is bigger: j or -8? j Let i = 575 - 570. Are 13/3 and i nonequal? True Suppose 0 = -11j - 26 + 4. Let l be (-5)/25j-1. Which is smaller: 9 or l? l Let s = -2136 + 702742/329. Which is smaller: 1 or s? s Let m = -685.7 - -685. Let z = 1.97 - 2.5. Let u = z - m. Is u bigger than -0.1? True Let o = 2.649 - 0.339. Let d = o - 0.31. Which is smaller: d or -1.2? -1.2 Let g = 7/16 + -85/48. Let f = -77 + 69. Let p be (-1 + 3)/((128/f)/8). Is p != g? True Let h be 2 + (63316/(-29856) - 7/(-56)). Which is smaller: h or 1? h Let l = -21/9010 + 1/85. Let b = -855/742 + l. Suppose 5k = k - 4. Is k <= b? False Let x be (4 + (-5121)/(-6))/6. Let g = x + -143. Which is smaller: 1 or g? g Let x = 1.23 - 61.23. Let p = x - -63. Is p bigger than -6? True Let f = -3.07 + 0.07. Let h(s) = -2s2 - 7s - 25. Let b be h(-10). Let t = b + 2327/15. Are t and f equal? False Let l be (1 - 1)/((-4)/4). Suppose -2z + 5k - 2 = 0, 2z + 5k - 3k + 2 = l. Is z bigger than -8? True Let n = 492 - 492.01. Which is smaller: -51/7 or n? -51/7 Let g = -130.8 + 137.1. Which is smaller: 2 or g? 2 Let h(l) = -9l + 14. Let x(i) = -5i + 7. Let p(v) = 6h(v) - 11x(v). Let m be p(-7). Let j = 5 + -4. Is j < m? False Let y = -25.476 + -0.124. Let r = y - 4.4. Let h = 43 + r. Are 0 and h nonequal? True Let g = -1 + -4. Let c(f) = -11f - 16. Let b be c(g). Is b greater than or equal to 79/2? False Suppose 0 = 5t - 3t. Suppose 0 = -5s - ts. Let h = -177 + 883/5. Which is smaller: h or s? h Let w(a) = 4a2 - 9a*2 - 6a - 6 + 1 - a*3 + 2. Let v be w(-4). Let x = -1 - v. Are -5 and x equal? False Let q(t) = -193t - 60. Let k be q(-2). Which is greater: k or 324? k Let l be (2/(-4))/((-836)/8). Suppose -4p - 16 = 2o, 4p + 16 = -5o + 10o. Is l bigger than o? True Let x(i) = -i3 + 10i*2 - 9i - 4. Let m be x(8). Suppose 5a - 5k = 7a - 119, k - 263 = -5a. Is m <= a? True Suppose 12 = -4q - 5l + 43, -5q = 5l - 35. Let u(b) = -b*3 + 4b*2 + 3b - 2. Let f be u(q). Let x be (1/(-10))/(f/(-25)). Is 0 > x? False Let t(z) be the second derivative of -2z - 9/2z*2 - 1/12z*4 + 3/2z3 + 0. Let v be t(8). Which is smaller: v or 1/10? v Let s be (112/(-49))/8 + 9656/(-14). Let w be 1/(-5) + (-228)/s. Are w and -1 non-equal? True Suppose 10 + 14 = -f. Let w = 4574 + -4599. Is f at most as big as w? False Let g be (-48)/84 - (-288)/14. Let n = g + -18. Does n = 2? True Let b = -14.57 - -14.77. Are -3/7 and b unequal? True Let k = 15095/3081 - 197/39. Which is smaller: 0 or k? k Let j = 80/37 - 1245/148. Which is bigger: -2 or j? -2 Let l(v) = v3 + 2v2 - 2v. Let s(r) = r3 + r2 - 3r. Let z(n) = 3l(n) - 2s(n). Let m be z(-4). Let o be (m + 3)4/48. Are o and 0 nonequal? True Let q(v) = -v*3 - 4v*2 + 26v - 3. Let l be q(-11). Let t be (l/92 - 6)(-2)/(-4). Is t at least 1? False Let h(a) = -a3 - 5a*2 - 9a - 13. Let z be h(-4). Suppose -3 = 6t - zt. Which is smaller: t or 0.03? 0.03 Let j be (30/(-9))/((-12)/18). Suppose j = -2m - 9. Is m less than -6? True Suppose -8470w = -8472w + 2. Which is bigger: w or 4/1423? w Let g = -2/6003 + -720338/66033. Which is smaller: -10 or g? g Let s(o) = 2o - 2. Let z be s(4). Let y(v) = -v*3 + 4v*2 + 9v + 8. Let f be y(z). Is f less than 2? True Let k be 255/36((-16)/20)/2. Is k > -3? True Let n = -69 - -71. Is 39/7 < n? False Let p = -2 - -3. Let l = 0 - p. Suppose -3s = -22o + 20o + 12, 4s - 3o + 17 = 0. Is s < l? True Let w = 186 - 204. Which is smaller: -4 or w? w Let n be (2 + 0)(8 - 3). Suppose 0 = 2d + 2k, d + d + 9 = -5k. Which is bigger: d or n? n Let u = -59.4 + 144.52. Let y = -85 + u. Is y greater than or equal to 0.4? False Suppose 2z + 49 + 15 = -a, 5a + 4z = -338. Is a greater than -70? False Let m(d) = -d3 - 16d*2 + 17d + 22. Let w be m(-17). Let x be 6/30 + w/(-10). Let c be ((0 - -2) + -3)-1. Do c and x have different values? True Let p be (-5)/10 + (-4)/((-200)/(-2945)). Is -60 equal to p? False Suppose q - 3 = 2f, 13 = 5f + q + 3. Let k be 2 - (-2 + (-6)/(-3)). Suppose -kl = -7l. Is f less than or equal to l? False Let h = 6 - 4. Let l = -26 + 32. Let n be (8 - l)2/4. Which is bigger: n or h? h Let k = 71 - 701/10. Suppose 4y = 4m - 8, 3m = -y - y + 16. Is k at most y? True Let o(p) = -4p*2 - 4p + 5. Let y be o(-2). Which is smaller: y or 6? y Let t = -341 + 3754/11. Suppose 10c + 45 = 9c. Let i be 6/c - (-2)/15. Is t greater than i? True Let l be -51(-9)/3246. Is 1/3 <= l? True Let o = -84083/67 + 1255. Let t(k) = -k*3 + 9k*2 + 2k + 80. Let a be t(10). Are a and o nonequal? True Let z(k) = 4k2 + 13k - 3. Let v be z(-2). Which is greater: 14 or v? 14 Suppose m + 134 = 3m. Let l = m + -61. Which is bigger: 7 or l? 7 Let w be 1153(-8)/(-24). Is 49 greater than w? False Suppose 5m + 0m - 10 = 0. Let x be (m/(-4))/(-1 + 27/24). Which is greater: x or -3? -3 Let k be (-76)/(-10) + 27/(-45). Let a = -25 - -29. Let m be 69/12 - (-1)/a. Which is smaller: k or m? m Let g be 11270/(-63) - (-24)/27. Which is greater: -709/4 or g? -709/4 Let f be 2/(-30) - (-2)/(-6). Let r = -14.058 - -0.058. Let x = -13 - r. Does x = f? False Suppose 7y + 20 = 3y + 2j, -4y + 3j = 22. Let n be -22 - -3 - y - 2. Is n at least -2? False Let v be 6(-4)/(-16)2. Suppose -v = k, 3l = -l + 5k + 7. Let j be (l/7)/((-9)/21). Which is bigger: 2 or j? 2 Let x = 18.7 - 28.6. Let w = 9.2 + 0.8. Let v = w + x. Is -4 equal to v? False Let x = -0.065 + 0.06. Let m = x - -0.005. Is 28 greater than m? True Let a = -0.48 - -0.9. Let r = a - 0.02. Let n(q) = q - 8. Let k be n(7). Is k less than r? True Suppose -7k + 67 = 25. Let j(o) = -o + 8. Let v be j(k). Is 3/7 greater than or equal to v? False Let k(l) = -l3 + 11l*2 + 24l - 22. Let m be k(13). Which is bigger: m or -23? -23 Let z be (5/(-10))/(11/(-22)). Is z less than or equal to -2/1743? False Let u = 68 - 71. Are -111 and u non-equal? True Let a = 21039/5 + -4171. Is a > 38? False Let q = 143 + -145. Let r be (3 - q(-4 - -5))-1. Which is smaller: -17 or r? -17 Let x = -14/185 + -306/5735. Suppose 3j + g + g + 3 = 0, -2 = 2j + g. Which is bigger: x or j? x Let l be 2/3 - (-28)/(-141). Let w be (-4)/7 - (7 - 107103/12831). Let f = w - l. Which is bigger: f or -1? f Let h(k) = k*3 - 7k + 1. Let s be h(0). Are 57/52 and s unequal? True Let u = -1/179 - 163/2864. Let o(w) = -2w - 15. Let i be o(-7). Is u > i? True Suppose q - 2q = -5m, 0 = 5m - 25. Suppose w - q = 6k - 2k, -3k + 2w - 25 = 0. Which is smaller: k or 2? k Let p = 32 - 31. Let d = p + -1.5. Let u be -2 + (-174)/(-34) + -3. Which is smaller: u or d? d Let s = 139 + -244. Let i = 116 + s. Is -1/4 at least i? False Let q be (864/(-70))/(-3) - (-18)/63. Is q bigger than 4? True Suppose 2q - m - 3 = 0, -3q + 7 = -3m + 4m. Let v be (-163)/7 + q/7. Let z = v + 24. Is z equal to 4/11? False Let z be (-10)/90 - (-67)/279. Let m = 26/279 + z. Which is bigger: 0 or m? m Let y = -3.79 - -3.79. Which is greater: y or -56? y Let n = 453.03 + -455. Let v = -2.27 - n. Let h = -9.8 - -9. Is h less than v? True Let j = -5 - -9. Let m be (-11)/(-319)j/2. Is m less than 1? True Suppose -9 + 2 = -3j + 4q, 0 = j - 5q + 5. Suppose -jg = -g - 12. Suppose 10 = gr - 2. Is -2/3 >= r? False Let r = 406 + -308. Which is smaller: r or 99? r Suppose -7338 + 2112 = 78v. Let o(t) = -t2 - t - 66. Let n be o(0). Is n < v? False Suppose 0 = 2p + 24720 - 128214. Let q = 18163130/351 - p. Let b = q - -1/27. Which is smaller: b or 1? b Let l = -2/715 + -2846/500	{ "pile_set_name": "DM Mathematics" }
(q) = 7q - 3. Let t(n) = 6j(n) - 17z(n). Let m be t(7). What is the units digit of 1/5 + 118/m? 2 Let a(o) be the second derivative of o3/2 + 25o*2 - 14o. What is the units digit of a(0)? 0 Let l(p) = 3p - 7. Let t be l(7). Let m = -10 + t. Suppose -mi = -2i - 60. What is the tens digit of i? 3 Let y be -10 + 14 - (-10)/(-1). Let p(m) = -m3 - 3m*2 + 7m + 8. What is the units digit of p(y)? 4 Let v(a) = a*3 + 6a*2 - 4a + 2. Let i be 3/(1 + 0) + -9. What is the units digit of v(i)? 6 Let u = -280 + 1352. What is the units digit of u? 2 Let v(g) = 105g - 329. What is the units digit of v(11)? 6 Let j be 3/(((-63)/12)/(-7)). Let r be j - (3-15 + 4). Suppose -r = -5z - 10. What is the units digit of z? 7 Let q(a) = -a2 - 14a - 11. Let z be q(-13). What is the hundreds digit of z - ((-12)/4 + -156)? 1 Let f(d) = -d*2 + 4d - 4. Let y be f(4). Let p be (102/9)/(y/(-30)). Suppose 5t + 10 = p. What is the tens digit of t? 1 Let r(s) = s2 - 33s + 22. What is the units digit of r(-15)? 2 Suppose -5g + 3525 + 4413 = 2w, -4g + 5w = -6324. What is the thousands digit of g? 1 Let u(j) = 804j - 153. What is the hundreds digit of u(4)? 0 What is the units digit of 5 - 13 - (-3 - 22)? 7 Let h be 2/3 - 44/(-132). Let r = -7 - -12. Let q = h + r. What is the units digit of q? 6 Let b = -870 + 1924. What is the units digit of b? 4 What is the hundreds digit of ((-960)/(-75))/((-2)/(-85))? 5 Let c(o) = 2o + 1. Let t be c(-7). Let a(k) = k + 15. Let r be a(t). What is the tens digit of (-495)/(-12) - r/8? 4 Let d(t) = 3t2 + 13t - 9. Let a(l) = -4l2 - 12l + 8. Let o(u) = 4a(u) + 5d(u). What is the units digit of o(14)? 9 Suppose -5g = -20, 170 = s + 3g + 16. What is the tens digit of s? 4 Let y(q) = 175q3 + 5q*2. Let x(o) = 175o*3 + 6o*2. Let d(w) = 4x(w) - 5y(w). What is the units digit of d(-1)? 4 What is the units digit of (-200)/80(4278/5)/(-3)? 3 Suppose -4z - 2i + 776 = 0, -2i - 596 = -4z + z. What is the units digit of z? 6 Let f = -28 - -34. Suppose 42 = 4g + 3a, -g - a + f = 2a. What is the units digit of g? 2 Let y be (1 + -20)(-2 - -1). Let p = 119 + y. What is the units digit of p? 8 Suppose 3n + 2 = -1. Let r be n - (-3 + 2 + 1). Let v(d) = -18d*3 - 2d*2 - 3d - 2. What is the tens digit of v(r)? 1 Suppose -2x + s + 579 = 0, 5x + 3s - 423 - 997 = 0. What is the tens digit of x? 8 Suppose 0s + 7738 = 5s + w, 0 = 4s + w - 6191. What is the units digit of s? 7 Let d be ((-2)/(-1 + -1))/(16/64). Suppose -4b + w + 560 = -3w, -4b + 544 = dw. What is the units digit of b? 8 Let t = 14 - 5. Let n = 11 - t. Suppose -3 = ni - 9. What is the units digit of i? 3 Suppose 0 = -g - 7g. Suppose gv - 14 = -2v. Suppose -3t - 3q = -54, -5t - 4q = -v - 83. What is the tens digit of t? 1 Suppose 4u = -h - 20, -u + 4 = -2h + 9. Suppose h = 5l - 0f + 5f - 110, 58 = 4l - 2f. Let z = 33 - l. What is the tens digit of z? 1 What is the hundreds digit of ((2 - (6 + -7)) + -1)1060? 1 Suppose 0t + 4t + 4a - 12 = 0, 0 = -2t + a + 3. Let p(o) = o*2 - 4o + 4. Let g be p(t). Suppose -2x = -gx - 42. What is the tens digit of x? 2 What is the tens digit of -7 + (14700)/5? 3 Let m = 19 + 53. What is the units digit of 1956/m + (-2)/12? 7 Suppose -200 = -p + 525. What is the hundreds digit of p? 7 What is the units digit of -39((-36)/(-63))/((-12)/364)? 6 Suppose -52f = -37f - 83760. What is the hundreds digit of f? 5 Suppose 5c - 134 + 34 = 0. Suppose 3832 - 832 = cp. What is the hundreds digit of p? 1 Let r(c) = -3c - 3 + 2 + 4. Suppose -17f - 64 = 106. What is the tens digit of r(f)? 3 Suppose 0 = -9p + 3655 + 3239. What is the hundreds digit of p? 7 Let x = 15 - 11. Suppose 16 = -xo, 0i = 4i - 2o - 28. Suppose 3r - 57 = 3t, r - it - 23 = -r. What is the units digit of r? 4 Suppose 8n + 0n - 200 = 0. Suppose -4p - 100 = -4z, z - 3p - 10 = n. What is the units digit of z? 0 Let d(u) = u3 - u2 + u + 183. Let o be d(0). Let z = -127 + o. What is the tens digit of z? 5 Let p(k) = -4k + 1. Suppose -n = 3f + 1, 2n - 3f + 13 = 2. Let a be p(n). Suppose a + 13 = 2l. What is the units digit of l? 5 Suppose 25t = 29t - 16. Suppose -b + 4q + 74 = 0, -2b = -7b - tq + 346. What is the units digit of b? 0 Let i = 30 - 55. Let a = -20 - i. What is the units digit of a? 5 Suppose -4s = 3h - 57, 12 = 3h + 3. Suppose 8g - sg = -484. What is the units digit of g? 1 Let p be (-7)/(35/200) - -4. What is the units digit of 402/8 - (-9)/p? 0 Suppose -d = -f + 143, 597 = 4f + 8d - 7d. What is the tens digit of f? 4 What is the units digit of 5 + -1 - (-18)/(-9)? 2 Suppose 465h = 457h + 16. Suppose -48 = -m + 16. Suppose -hz = -0z - m. What is the units digit of z? 2 Suppose 0 = -5r + s + 942 + 4943, 0 = 4s + 20. Suppose 4v + 2v - r = 0. Suppose -w = -5w + v. What is the tens digit of w? 4 Suppose 40 = 4w - 9w. Let y(o) = o2 - 5o + 2o2 + 1 - 7o - 4o2. What is the tens digit of y(w)? 3 Let c(w) = 152w*2 + 5w + 22. What is the hundreds digit of c(3)? 4 Let s = 2 + 12. Let c be 3/(s/4 + -2). Suppose -ch - 6 + 12 = 0. What is the units digit of h? 3 Let t(a) = -a2 + 5a - 4. Let h be t(3). Suppose -l + 9 = -hl. Let q = l + 19. What is the tens digit of q? 1 Suppose -2614y + 45440 = -2604y. What is the tens digit of y? 4 Suppose 0 = 13u - 6218 - 1686. What is the hundreds digit of u? 6 Let o(k) = -k - 9. Let t be o(-4). What is the tens digit of (-7539)/(-105) - 1/t? 7 Suppose -2x - 105 + 971 = 0. Let d = x + -243. What is the hundreds digit of d? 1 Let a(i) = 4i*2 - 110i + 35. What is the hundreds digit of a(32)? 6 Suppose 0 = 6c + 2c + 32. What is the units digit of 49/21 - c/6? 3 Suppose -4z + 8 = -2z. What is the units digit of (-836)/(-26) + z3/(-78)? 2 Suppose -r - 1300 = -5r. Suppose -10g - 45 = -r. What is the tens digit of g? 2 Let a = 4475 - 1613. What is the hundreds digit of a? 8 Suppose -2 + 6 = 2k. Suppose -5j = kv, 0j = -5j + 4v. Suppose j = -3t - 24 + 159. What is the tens digit of t? 4 Suppose -1941 = 24v - 13053. What is the tens digit of v? 6 Let s(c) = -2c3 - c2 + c. Let r be s(-2). Suppose rq - 4q - 120 = 0. What is the tens digit of q? 2 Suppose -o = 2d - 1, 3d - 4 = -3o - 2d. Suppose 5p + 3 = y, -p - 12 = -2y + o. What is the units digit of y? 8 Suppose s = -2, -4a - s + 3 = -5a. Let c(u) = -u*3 - 4u*2 + 5u + 2. Let x be c(a). What is the tens digit of -18(x/(-4) - 1)? 2 Let v(n) = -n3 - 6n*2 + 8n + 7. Let i be v(-7). Suppose i = 5f - 55 - 645. What is the tens digit of (-30)/8f/(-15)? 3 Suppose -2i - 2 = -2l, 7l - 2l + 2i = 19. Suppose 4f - lq = -4q + 409, f - q = 101. What is the units digit of f? 2 Let o(t) = -t*2 + 10t + 3. Let b be (48/2)/((-24)/(-16)). Suppose 0 = -0i - 2i + b. What is the tens digit of o(i)? 1 Let q = -220 + 239. What is the units digit of q? 9 Suppose -182 = -3k - 524. Let o = 271 + k. What is the hundreds digit of o? 1 Suppose -556p = -563p + 10549. What is the hundreds digit of p? 5 Suppose -5v = -3v - 68. Let k = v + -9. What is the units digit of k? 5 Let o = -4 - 16. What is the units digit of 1 + 2 - o/10? 5 Suppose -14f + 27256 = 9966. What is the thousands digit of f? 1 Let x(n) = 3n2 - 12n - 26. What is the tens digit of x(11)? 0 Let x = -13 + 12. What is the units digit of (-35 - -12)/(-2 - x)? 3 What is the thousands digit of ((-1224)/12)/((-2)/822)? 2 Let q = -43 - -43. Suppose 3n + 7n - 340 = q. What is the units digit of n? 4 Let q be 1 - (-4)/(-20)5. Suppose -2g - 2p = -qp - 126, 4g - 237 = -p. What is the units digit of g? 8 Let b be 1/(8/(-9) - -1). What is the units digit of (-4)/(-18) + b/((-324)/(-2440))? 8 Let w = 7 - 2. Suppose wz + 2p + 81 = 3p, 5z + 84 = 4p. Let f = -10 - z. What is the units digit of f? 6 Let d = 950 + 411. What is the units digit of d? 1 Suppose -5a + 1358 = 2a. Let r = a + -112. What is the tens digit of r? 8 Suppose 0 = i - 3i + 4. Suppose -4x + 108 = -3x + 5w, -160 = -ix + 4w. What is the tens digit of x? 8 Let p = -102 - -165. Suppose -7l = -147 - p. What is the tens digit of l? 3 Let g(b) = -22b2 - 14b + 6. Let w be g(-5). Let i = 689 + w. What is	{ "pile_set_name": "DM Mathematics" }
/(12/(-32)). 2, 3 Let u(i) = -91i - 86. List the prime factors of u(-2). 2, 3 Let n(x) = x3 + 7x*2 - 2x - 5. Let s be n(-7). Let v = s + -6. Suppose 5z + 67 = vg, 0g - 80 = -4g + 2z. What are the prime factors of g? 19 Let h = -58 - -63. Suppose -h = -76p + 75p. List the prime factors of p. 5 Let r(f) = -14f - 69. What are the prime factors of r(-8)? 43 Let g(f) = 113f3 - 2f - 116f3 + 3f*2 - 2f*2. What are the prime factors of g(-2)? 2 Suppose 0 = 3a - 12 - 3. Suppose -ay + 7 = -3. Suppose 0 = -yv - 3v + 115. List the prime factors of v. 23 Let g(l) = 4l*2 + 4l - 6. Let r be g(-3). What are the prime factors of (-2)/(-3) + 456/r? 2, 13 Let s = 17 + 17. Suppose -10 + s = m. Suppose -3t = t - m. List the prime factors of t. 2, 3 Let n be (0 + (-4)/6)(-3699)/18. Let h = n + -32. List the prime factors of h. 3, 5, 7 Let m(t) = 6t2 - 30t - 34. List the prime factors of m(14). 2, 19 Let p = 199 + 54. List the prime factors of p. 11, 23 Suppose 13 = -3l - 4j - j, -3j = -4l + 31. Suppose -x - 5 = 4r - 2, lr + 9 = -3x. What are the prime factors of (-20)/x36/30? 2 Let r be (-2)/4 + 7/(-2). Let g be (-4)/850 - r. List the prime factors of (-156)/(-9)g/(-14). 2, 13 What are the prime factors of 15/3 + 5887/(2 - -5)? 2, 3, 47 Let p = 2 + -14. Suppose -6 = -3n + 4n. What are the prime factors of (n/p)/((-1)/(-10))? 5 Suppose 21s + 30s - 28305 = 0. List the prime factors of s. 3, 5, 37 Let k be (-18)/(-27)(11 + 1). Let u(o) = 7o - 4. What are the prime factors of u(k)? 2, 13 List the prime factors of (-10 - -12)1309/2 + -2. 1307 Suppose i + 12 = 97. Let a = i + -47. List the prime factors of a. 2, 19 Let b = -35 + 1721. What are the prime factors of b? 2, 3, 281 List the prime factors of 778 + 6 - (-3)/(-3)-1. 5, 157 Suppose -3p - 4l = 22, 2l - 5 - 5 = 2p. Let f(m) = m*2 + 2. What are the prime factors of f(p)? 2, 19 Suppose 0 = -3u + i + 7, -10u + 2i - 6 = -14u. Suppose uy - 402 = -5b, -2b = y - 0y - 199. List the prime factors of y. 191 Let c(b) = 5b*3 - 5b*2 + 4b - 8. List the prime factors of c(5). 2 What are the prime factors of -21 + 26 - (-3239 - (0 - 1))? 3, 23, 47 List the prime factors of 21300/(-15)1/3-3. 2, 5, 71 List the prime factors of 1 - ((-90605)/20 + (-1)/(-4)). 23, 197 Suppose -3n + 6 = -2n. Let s be 1/(15/n + -2). Suppose -24 = -sw + w. What are the prime factors of w? 2, 3 Let h = -30 - -97. Let v = -24 + h. Suppose -2o = -5z - o + v, -17 = -z + 3o. List the prime factors of z. 2 Let q(f) = -25 - 3f - 10f + 15f. What are the prime factors of q(16)? 7 Suppose 0 = k - 3k + 662. What are the prime factors of k? 331 Let j = 39 - 36. Suppose js + 12 - 225 = 0. What are the prime factors of s? 71 Let o(h) = h3 + 8h*2 + 4h + 17. Let t be o(-7). Suppose p - 7 = t. What are the prime factors of p? 3, 5 Let h(i) = -i - 5. Let n be h(-7). Suppose -y = -q - n, 0 = 3y + q - 2 - 12. Suppose -195 + 71 = -yx. List the prime factors of x. 31 Let w(t) be the second derivative of t*4 + 4t*3/3 - 8t*2 - 11t. What are the prime factors of w(3)? 2, 29 Let s(b) = -74 + 20 - 6b2 + 9b + 16 + 15 + b*3 + 16. Suppose -4m + 30 = m. List the prime factors of s(m). 47 Suppose -4q - q + 580 = 0. Let c(a) = -a + 18. Let k be c(10). Suppose ko = 4o + q. What are the prime factors of o? 29 Suppose -2m = -3c - 1597, 10m = 15m - c - 3986. List the prime factors of m. 797 Let w = 26 + -50. List the prime factors of (-84)/w(-116)/(-7). 2, 29 Let p = -119 - -49. What are the prime factors of (-8526)/p + 1/5? 2, 61 Let s be 47/5 - 4/10. Let t = 51 - s. Suppose -2o = -3o + t. List the prime factors of o. 2, 3, 7 Suppose 44 = 11k - 0k. Suppose -5o - 4u + 40 = 0, ku - 1 = 2o - 17. What are the prime factors of o? 2 Let b(i) = -6. Let p(z) = z. Let v(n) = b(n) - 12p(n). What are the prime factors of v(-6)? 2, 3, 11 Suppose -71 - 25 = -16d. List the prime factors of d. 2, 3 Let b be 6/12 + 837/6. Suppose 4c - b = 2c. List the prime factors of c. 2, 5, 7 Let c(v) = -v*2 + 2v + 1. Let l be c(2). Let m = -584 + 581. What are the prime factors of 198/6 - lm? 2, 3 Suppose -2w = -358 - 220. Suppose 0 = 4b - 5x - 60 - 356, w = 3b + 2x. What are the prime factors of b? 3, 11 Let s(r) = 3r2 + 34r - 25. List the prime factors of s(-25). 2, 5 Let q(j) = -j*3 - 43j*2 - 100j + 59. List the prime factors of q(-41). 797 Let v(t) = -t*3 - 10t*2 + 13t - 28. What are the prime factors of v(-12)? 2, 13 Let a(q) = 52q + 4. What are the prime factors of a(5)? 2, 3, 11 Let w = 17 + -17. Suppose 0 = -wj - 2j + 124. Let u = -38 + j. What are the prime factors of u? 2, 3 Suppose 179452 = 43s + 15s. List the prime factors of s. 2, 7, 13, 17 Let l be -1 + (-2)/(-4 + 2). Suppose -3g + 124 + 2 = l. Suppose 2d = -0d + g. List the prime factors of d. 3, 7 Let a(y) = -82y - 67. What are the prime factors of a(-2)? 97 Let w = 157 + 198. Let o = w + -245. What are the prime factors of o? 2, 5, 11 Let g = 2803 - 1421. List the prime factors of g. 2, 691 Suppose 4o + 3 + 1 = 0, -3y + 5o + 2 = 0. Let c be (-5)/(10/(-8)) + y. Suppose -4m + a = -132, a - ca - 60 = -2m. What are the prime factors of m? 2, 17 Suppose 5t - 4t + 5 = 0. Let m(l) = -l3 - 4l*2 + 2l - 6. List the prime factors of m(t). 3 Suppose -624 = -0k - 4k. Let d = -5 - -9. Suppose 7r = dr + k. List the prime factors of r. 2, 13 Let q = 128 - 92. Let c = 293 + q. What are the prime factors of c? 7, 47 Let k = -45 + 45. Suppose 654 = 6r - kr. List the prime factors of r. 109 What are the prime factors of ((-28)/6)/7(-262 - 2)? 2, 11 Let k(r) = 33r*2 - 72r - 80. What are the prime factors of k(-12)? 2, 173 Let k = -150 + 279. List the prime factors of k. 3, 43 Let w be (-21)/7 - -10 - 0/3. Let h be (0 - (-1 + 2)) + 31. Let y = h - w. What are the prime factors of y? 23 Suppose w = -2i + 1622, -3i - 2i + 3244 = 2w. List the prime factors of w. 2, 811 Suppose -12z + 335 = -7z. Suppose -2s + z = 19. What are the prime factors of s? 2, 3 Suppose -22y + 11880 = -11y. What are the prime factors of y? 2, 3, 5 Let q = -83 + 94. Let d = q + 135. List the prime factors of d. 2, 73 Suppose 2a + 712 = -692. List the prime factors of (8/(-12))/(12/a). 3, 13 Suppose -91c + 202740 = 33c. What are the prime factors of c? 3, 5, 109 Let o(b) = 144b2 + 41b + 110. What are the prime factors of o(-3)? 1283 Let s = -59 - 169. Let m = -59 - s. What are the prime factors of m? 13 Let w(r) = -8r + 41. Let m(s) = -5s*2 + 4s - 5. Let v be m(2). List the prime factors of w(v). 3, 59 Suppose -4a = -3v + 2363, -10v - 1570 = -12v + 4a. What are the prime factors of v? 13, 61 Let a be (12/(-5))/((-18)/(-225)). List the prime factors of ((-56)/5)/(4/a). 2, 3, 7 Let u be (-40)/(-16)(1 + 1). Let r(p) = 2p3 - 2p*2 - p - 1. List the prime factors of r(u). 2, 97 Let a = -474 + 488. List the prime factors of a. 2, 7 Let m = -480 - -720. What are the prime factors of m? 2, 3, 5 Suppose -14f + 17148 = -422. What are the prime factors of f? 5, 251 Suppose 5d - 160 = -f + 6f, 2f = 10. Let b = d + -26. List the prime factors of b. 11 Suppose -3c + 6c - 3w = 135, -1 = w. Suppose -c = -5y + 4y. What are the prime factors of y? 2, 11 Suppose 0 = -r + f + 58, 2r = 6r + 2f - 232. Suppose 0 = -5h + 6 + 29. Suppose -h = d - r. What are the prime factors of d? 3, 17 Suppose 38477 = 13h - 6087. What are the prime factors of h? 2, 857 Suppose 357 = -42x + 35x. Suppose 3f + 11 = -88. Let d = f - x. List the prime factors of d. 2, 3 Suppose -c + 12 = 3c. Suppose cg - 133 = 4p, -g + 79 = 5p + 3. What are the prime factors of g? 3, 17 Let l(j) = -14j - 141. What are the prime factors of l(-27)? 3, 79 Suppose b - l - 193 = 0, -4l - 396 = -4b + 2b. What are the prime factors of b? 2, 47 Let a = -1 + 3. Let l be (2/(-4))/((-5)/230). Suppose l = af + 5o, 2f - 57 = 3o - 10. What are the prime factors of f? 19 Let k be 23/4 + (-15)/20. Suppose kl + 181 = 626. List the prime factors of l. 89 Let i(q) = q2 + 2q - 8. Let g be i(-4). Let r = -7 - -33. Suppose -3b - 2d + 3d + 71 = g, 2d = -b + r. List the prime factors of b. 2, 3 Suppose -10q = 2g - 9q - 1147, 0 = 3g + 3*q -	{ "pile_set_name": "DM Mathematics" }
o*(-37)/oo)/oo)))) assuming o is positive. o(-25) Simplify (v/(v(1/3)/v)v*(2/17)v)4 assuming v is positive. v(568/51) Simplify c(-11/4)/c(-7/2) assuming c is positive. c*(3/4) Simplify (nn*(-5)n)/(nn(-4/5)) assuming n is positive. n(-16/5) Simplify (v/(vv(-20)))2 assuming v is positive. v40 Simplify (a6aa(1/5))/((a/a8a)/((a/(a/(a/(aa(-3/2)))))/a)) assuming a is positive. a(137/10) Simplify (z*(4/11)zz)/(z/(z/z(2/3)z)) assuming z is positive. z(89/33) Simplify f(-35)f(-12/13) assuming f is positive. f(-467/13) Simplify h(11/4)h(2/9) assuming h is positive. h(107/36) Simplify cc(7/3)/ccc6 assuming c is positive. c(28/3) Simplify (v/(vv/v*(-4/7))v*(1/4)v)(-1/3) assuming v is positive. v(3/28) Simplify (h(-18))(-20/7) assuming h is positive. h*(360/7) Simplify ((mmm2mmm)/m(-6))/(m(2/7)m1) assuming m is positive. m(82/7) Simplify ((ww(2/7))/((w(-2/3)w)/w))43 assuming w is positive. w(1763/21) Simplify ((c(-1/3)/c)/c)36((c/(((c*1/c)/c)/c)c)/c)(-4) assuming c is positive. c(-96) Simplify x*(-21/5)x/(xx28) assuming x is positive. x(-161/5) Simplify (ff*(4/9)f)/(ff/((ff*(4/7)f)/f)f)(fff*(-7)/ff)/(f/(ff(f/((f/f(-2/19))/f))/f)) assuming f is positive. f(-3698/1197) Simplify r(3/2)/(r/((r/r16)/rr)) assuming r is positive. r(-29/2) Simplify (((kk/(k/(k/(kk/k0k))))/k)/k)/kk(-1)k*6k(1/13) assuming k is positive. k(14/13) Simplify (y/y*(-9)(y*(-4)y)/yy)5 assuming y is positive. y35 Simplify ((j(3/8)j)/jj/j7)/(j(2/7)/j)(1/23) assuming j is positive. j(-7205/1288) Simplify ((j(-2/7)j)/(j/j*(2/27)))/(jj*(-4)jjj*(-3)j) assuming j is positive. j(527/189) Simplify ((w/((w(-2/7)w)/ww))/ww/(w/w(-1/3)))/((w/w(-2/3))/(w/((w/((www/(w6w)ww)/www)ww)/w))) assuming w is positive. w*(-33/7) Simplify (nn*0n)*34n*(-3)n*(-1)nn assuming n is positive. n66 Simplify (a(-1/5)/a0)/(a(-3)((a1/a)/a)/a) assuming a is positive. a(24/5) Simplify (y1)49/((y/(((y*(-1)y)/y)/y))/y)45 assuming y is positive. y(-41) Simplify (j*0jj(-9/2)j)(14/5) assuming j is positive. j(-7) Simplify (qq/q(3/5))/q(1/54) assuming q is positive. q(373/270) Simplify (u/u(1/4))46/(u(2/3))(1/4) assuming u is positive. u(103/3) Simplify q/(q(-26)qq)qq(-4/13) assuming q is positive. q(334/13) Simplify (z(-4/3)/(((zzz/z(-3)z)/z)/z))/((z*(-1)/z)/zzz(-6)) assuming z is positive. z(5/3) Simplify ((v/(vv/v(-2)))/v)/v(-5)v(3/2)vvv*(-3/7)v assuming v is positive. v(71/14) Simplify ((d/(d/d(-2/7)))4)(-16/5) assuming d is positive. d*(128/35) Simplify (((qq/(q*(-9)qq)q)/q)/q)(2/63) assuming q is positive. q(16/63) Simplify zzz/(z/((z*(-16)/zz)/z)z)zz/z(5/6) assuming z is positive. z(-89/6) Simplify ((c(-3/2)c)/c)(-1/72) assuming c is positive. c(1/48) Simplify d*(-16)/((d/(dd/d(-17)))/d) assuming d is positive. d3 Simplify h/h*(-1/26)h(-13) assuming h is positive. h(-311/26) Simplify (uu/u11)(7/6) assuming u is positive. u(-21/2) Simplify (f/(f/(f31/f)ff))(-4/19) assuming f is positive. f(-112/19) Simplify (i/i(-1/11)i)/(i/(iiiii*(1/2)))(i(-2/5))(2/41) assuming i is positive. i*(25127/4510) Simplify m(mm/m4mm)/mmm(1/32) assuming m is positive. m(33/32) Simplify (i/(i(-22)/i))/i(17/6) assuming i is positive. i(127/6) Simplify (d(-2/133)/d)/((d/(dd(5/9)))/d) assuming d is positive. d(647/1197) Simplify d*(1/35)d*(-12/5)d assuming d is positive. d(-48/35) Simplify h(-1/29)/(h(h(4/3)/h)/hh) assuming h is positive. h(-119/87) Simplify ((g3/g)/ggg/(gg(-5)))/(g(1/4))(-39/7) assuming g is positive. g(235/28) Simplify (d(-19)d)2 assuming d is positive. d(-36) Simplify r(-2/29)/r(-1/10) assuming r is positive. r(9/290) Simplify (r(2/7)/(r/(r(2/7)/r)))/(r(-1))(-12) assuming r is positive. r(-94/7) Simplify ((a/a0)(-18))42 assuming a is positive. a(-756) Simplify ((i(-7)/i)/i)(-36) assuming i is positive. i324 Simplify (x(-1))(-14/9)/(x(-1/4)xxxx(1/3)/x) assuming x is positive. x(-19/36) Simplify (dd(-1)d/d*(2/3))/((dd(dd/(d/d*0))/d)/ddd(dd/d(1/12))/d) assuming d is positive. d(-43/12) Simplify (kk(-1)/k)(-2/27)kk*(-3/11)kk(2/37) assuming k is positive. k(20389/10989) Simplify (nn(n(-1)n)/n)*16(n(-2/3))3 assuming n is positive. n*14 Simplify ((g/((ggg(1/3)/gg)/gg))/(g(4/7)/g))/(g/(g/(g(2/3)g)))41 assuming g is positive. g(-1454/21) Simplify ((q*(-1/8)q)/q)/qq(-2/9)(q*0q)/(q/(q/((q6/q)/q))) assuming q is positive. q(-313/72) Simplify (l*(-13)/l)/(ll(8/7)) assuming l is positive. l(-113/7) Simplify ((b/(b/b(-2)))(-4/23))13 assuming b is positive. b(104/23) Simplify ((u/(u((u/u(-26))/u)/u))/u)/(u/(u/((u(-7/4)/uu)/uu))) assuming u is positive. u(-97/4) Simplify (j(-3)/jj(-1))/(j(-1)/j)(2/9) assuming j is positive. j(-41/9) Simplify ((s/s2)26)(2/3) assuming s is positive. s(-52/3) Simplify (aa(-2/85))/aa*(-30)a assuming a is positive. a(-2467/85) Simplify (t(-3)/t(-4/5))(-16) assuming t is positive. t(176/5) Simplify g(-4)/(g/(g/g(-1/3))) assuming g is positive. g(-11/3) Simplify (xx3)(-49) assuming x is positive. x(-196) Simplify (r/r3r(1/8))49 assuming r is positive. r*(-735/8) Simplify (xx/x*(-17)xxx)(7/2) assuming x is positive. x77 Simplify (y*(-8)yy(2/3))/(y0/yy)(16/5) assuming y is positive. y(-19/3) Simplify l*(-29)/(l(l/(l(l/(l/((l(3/17)l)/l)))/l))/l) assuming l is positive. l*(-507/17) Simplify (gg(-3/4))/g(-4)g7(g/(g3/g))/g assuming g is positive. g(37/4) Simplify (y*(4/5)/(((yy(-1/2))/y)/y))(-3) assuming y is positive. y(-69/10) Simplify (x/(x/x(-3/7))(xx*(-3))/xx)/(xx(-6)x/(x(x(-2/7)/x)/x)) assuming x is positive. x(2/7) Simplify (z(-1/4))(-11/6)/(z(z/z*(-2/7))/zz)11 assuming z is positive. z(-4147/168) Simplify ((g/(g/g(-5)))/(g/(g4/g)))(-10) assuming g is positive. g30 Simplify ((v/(v/v*(-2/33)))/vv(-16))8 assuming v is positive. v*(-4504/33) Simplify ((dd*(-6)/dd)/d(-12))(-2/19) assuming d is positive. d(-14/19) Simplify ((f(-3/4)f)15)(-31) assuming f is positive. f(-465/4) Simplify (r(-1/2))(-1/14)/(r0)26 assuming r is positive. r(1/28) Simplify ((o(1/6)/o)/(oo(o/(o(2/7)/o)o)/o))(-3/40) assuming o is positive. o(191/560) Simplify ((ppp/(p*15p))/(ppp(-3/7)))(-9) assuming p is positive. p(918/7) Simplify (c(-3)/c(4/5))/(c(-1/3)((c(-2)c)/c)/c) assuming c is positive. c(-7/15) Simplify r(-18)r/r14 assuming r is positive. r(-31) Simplify ((((y/(y/y(-1)))/y)/y)13)(-21) assuming y is positive. y819 Simplify ((kk*22k)/k)/(k/(((kk/(k(k*12kkk)/k))/k)/k)k) assuming k is positive. k6 Simplify (p0/p)39p*0ppp(p1p)/p assuming p is positive. p(-35) Simplify (q(-1)q)(4/11)(q0)(25/4) assuming q is positive. 1 Simplify (w(ww(2/3))/w)(-38/5)/(((ww(2/3))/w)/w)(4/11) assuming w is positive. w(-138/11) Simplify (p(10/7)/(p/(p/p(-2/7)p)p))/(p(-6/5)/(p(-5)/p)) assuming p is positive. p(-108/35) Simplify (cc*(-2/11)c)(7/2) assuming c is positive. c(70/11) Simplify (r(r/r(-1))/r)/(rrr1/r)(r(2/3))(15/7) assuming r is positive. r*(10/7) Simplify (s/((s(ss2)/ss)/s)s)(7/8)((ss/(s/s2))/s)/ssss(-2/5) assuming s is positive. s(69/40) Simplify (o(1/3))(-11)/(o/(oo(3/7))o(-2/5)) assuming o is positive. o(-298/105) Simplify ((m*(-1/4)mm)30)(-40) assuming m is positive. m(-2100) Simplify i(-5/4)i/(i/i*(-3/7))ii/i(-5/4)i*(-4/9)i assuming i is positive. i(134/63) Simplify (l/l1)*22/(ll/(l/l*2l)l7) assuming l is positive. l(-9) Simplify ((g(3/2)/g)/(((gg*0)/gg)/ggg))/((((((g*(3/2)/g)/gg)/g)/g)/gg)/g(-2/5)) assuming g is positive. g(-2/5) Simplify (x(-2/69))(2/17) assuming x is positive. x	{ "pile_set_name": "DM Mathematics" }
(b) -43 (c) -2 (d) -14 c Which is the nearest to -0.16? (a) 0.4 (b) -1 (c) 1/2 (d) 5/4 (e) -0.05 e What is the closest to -0.3 in 0, -11/21, -0.39? -0.39 What is the closest to 0 in -1, 1/2, -305, -2/29? -2/29 What is the closest to 1/8 in 0.08, 8/5, 0.2? 0.08 Which is the closest to 8584? (a) -3 (b) -0.5 (c) 0.09 c What is the closest to 1/2 in -0.03, 0.1, 5, -1/6, -1.2? 0.1 What is the nearest to -3 in -41, -2/13, 0.3, 3/2, 7? -2/13 Which is the nearest to 2/3? (a) -5 (b) -3/4 (c) -0.4 (d) -187 c What is the closest to -2 in -482, -1/5, 6? -1/5 What is the closest to 767 in 0.1, -1, -2/7, 1/4? 1/4 What is the closest to -0.2 in 508, 5, -5/39, 0.5? -5/39 What is the closest to 2/145 in -0.3, -0.57, -1, -2, -0.9? -0.3 What is the closest to -0.2 in -6, 0.5, -6/5, 5/18, 0? 0 What is the closest to -2 in -353, 0.5, -15, -1? -1 What is the nearest to 2/5 in 4, 11, 0.2, -1, -191? 0.2 What is the nearest to -3/5 in 0.3, 2/21, 6, -2353? 2/21 What is the nearest to 1 in -2/7, 1/6, -1, 0.2, 1.4? 1.4 Which is the closest to 5? (a) -5 (b) 25 (c) -2/27 (d) 4 d Which is the closest to -2? (a) -60 (b) 1/5 (c) -0.17 (d) -1 (e) -59 d Which is the closest to -0.129? (a) 0 (b) 2/13 (c) 1 a What is the nearest to -2/3 in -3/5, 4, -6/5, 6.6, 5? -3/5 What is the closest to 2298 in 1, 4/9, 2, -2/7, 2/5? 2 What is the closest to -1/3 in -23/15, -5, -2/7, 2/9, -2? -2/7 Which is the closest to 3/878? (a) -2 (b) -1/5 (c) 5 (d) 3 b What is the nearest to 3 in -1/8, 1/3, -3/47? 1/3 What is the nearest to 3 in -0.3, 3, 2, 44, -11? 3 What is the closest to -3/7 in 4, -0.9, -2/9? -2/9 What is the closest to -1 in -1/4, -2/1479, 0, -0.04, -2/9? -1/4 What is the nearest to 2 in 0, 1399, -0.3, 1/5? 1/5 Which is the nearest to 1.9? (a) -12 (b) 2 (c) 4 (d) -2 b What is the closest to -2/9 in 6/4729, -70, 0? 0 What is the nearest to -0.1 in 29, 2, -2, -29? -2 What is the nearest to 0.2 in 25, 3/113, -0.2? 3/113 What is the closest to 0 in 2/13, 13, 2/107, 3/2? 2/107 What is the closest to 4 in 0.03, -0.4, -1.1, 3? 3 Which is the closest to -2? (a) 13 (b) -201 (c) 2 c What is the nearest to 0.08 in -15, -0.1, -81? -0.1 What is the closest to -569 in -4/5, -14.9, -3? -14.9 What is the closest to 1 in 1/10, -1/4, 0.00455, 0? 1/10 Which is the closest to -15? (a) 0.03 (b) -9 (c) 2/31 b Which is the closest to -17? (a) -4 (b) -3/13 (c) 3 (d) 60 a What is the nearest to -33 in -1372, -5/6, 3? -5/6 Which is the closest to 53183? (a) -3 (b) 1/4 (c) 0.05 b Which is the nearest to 0.2? (a) 1/1834 (b) 1/9 (c) -2/13 b Which is the closest to 0.1? (a) -0.02 (b) 5 (c) -0.05 (d) -0.2 a Which is the closest to 0? (a) 399 (b) -3 (c) 0.4 (d) -2/205 (e) 4/7 d What is the nearest to -0.311 in 4, 0, -0.2, -0.01? -0.2 What is the closest to -2/287 in -1, 0, -2/15, -16? 0 What is the closest to -3 in 5, 2/11, 101/4, 0.5? 2/11 Which is the closest to 2/4845? (a) -1/4 (b) -0.05 (c) 1/3 b Which is the closest to -0.2? (a) -1 (b) -0.2 (c) 1/6 (d) -33 (e) -9 b Which is the nearest to 0.07? (a) 287/2 (b) -4 (c) -61 b What is the nearest to -0.14054 in -4, 1/8, -0.4, 1? -0.4 What is the nearest to -1 in -3, -1, 20/3, 2? -1 Which is the closest to 1? (a) 0.12 (b) -2 (c) -1/322 a Which is the nearest to -1/4? (a) -68 (b) -0.56 (c) 5 (d) 0.05 d What is the closest to -1 in -1, 34, 830/9, -5/8? -1 What is the nearest to -1/3 in 5, 81, 32? 5 Which is the closest to -12? (a) -6 (b) -0.03 (c) 4 (d) -4 a Which is the closest to 0? (a) 90 (b) -1 (c) 5 b What is the closest to 2/25 in 0.5, 0.06, -14, 0? 0.06 What is the nearest to -4/1247 in -0.4, 4, -0.5, -3? -0.4 What is the nearest to -2/7 in 1/7, -2004, 6, 2, 2/9? 1/7 What is the closest to 1 in 3, -1.631, -2/11, 0.2? 0.2 What is the closest to -2/7 in 0.4, -2, -0.4, 474? -0.4 What is the closest to -0.1 in 726, -0.2, 2? -0.2 Which is the closest to 2? (a) -47 (b) -0.5 (c) -0.04 c What is the nearest to -1/3 in -1/9, 94.88, 2/7? -1/9 Which is the closest to -1? (a) 5 (b) -3 (c) -0.17 c What is the nearest to -3 in 3, 0.049, -0.9, 4? -0.9 What is the closest to -0.5 in 7, -0.015, 2/7, 5? -0.015 What is the closest to -0.03 in 120, -1/4, -0.1, 0.2, 0? 0 What is the closest to -47/28 in -1/5, -5/2, 1/5, 3? -5/2 What is the closest to -2/3 in -3, -1, -92, 4, -1/2? -1/2 What is the closest to 3 in 24/11, 0.4, 0.5, -8, 1? 24/11 Which is the closest to -0.2? (a) -0.5 (b) -0.2 (c) -5 (d) -3/1720 b What is the closest to -1 in 2, -7, 8, -6.4, -2? -2 What is the nearest to 4 in -1/3, 0.191, 0.2, -3, 0.1? 0.2 Which is the closest to 2? (a) 1 (b) -0.5 (c) -4 (d) 10/7 (e) 34 d What is the closest to 17/6 in -0.0494, -0.2, 2/11? 2/11 Which is the nearest to -0.1? (a) -0.02 (b) 150 (c) -0.5 (d) -1 a Which is the nearest to 0.12? (a) 1/2 (b) 28 (c) 10/9 (d) -5/6 (e) -5 a What is the nearest to -2/3 in 1, -2/553, -3, 2, -1? -1 Which is the nearest to 98/9? (a) -4 (b) 3/5 (c) 1 c What is the closest to -1/2 in 1, -29, 0.2, -1/6, 3/2? -1/6 What is the closest to -4 in 2, 1259, -4? -4 Which is the nearest to 1.99? (a) -1/10 (b) -2/7 (c) -5 (d) -1/4 a What is the closest to 1/6 in 7, 0.309, -2/7? 0.309 What is the closest to -0.1 in 0.5, -3, 0.3, 41530? 0.3 What is the closest to -1.26 in -2, -5, -2/5, -8? -2 Which is the closest to -0.1? (a) -27/2 (b) -2/11 (c) 2057 (d) 3 b What is the closest to 1 in 1/4, 0, -2/5, -11/30, 1? 1 What is the closest to 3 in 0.2, -0.2, 2/17, 0.06, 7? 0.2 Which is the closest to 2? (a) 44 (b) 136 (c) 1/2 (d) -5 c Which is the nearest to -1? (a) -17 (b) 19 (c) 4 (d) -30 c What is the nearest to 2/5 in -309, 0.04, 12/5? 0.04 What is the nearest to -38 in 0, -56, -0.4, -5.5? -56 What is the closest to 1 in 5, 81.1, -0.128? -0.128 What is the closest to 9.43 in -1, -3, 1, -2? 1 What is the closest to -0.26 in 5, -5, 0.5, 5/27? 5/27 Which is the nearest to -1? (a) 0.3 (b) 5 (c) -2.2 (d) -124 c What is the closest to 1 in -1474, -4, 0.27? 0.27 Which is the nearest to -1? (a) -68 (b) -5 (c) 2/3 (d) -1 d What is the closest to 0.1 in -2, -2/159, 16, 4? -2/159 Which is the closest to 69? (a) 4 (b) -0.2 (c) 4/7 (d) -0.1 a Which is the closest to 1/41? (a) -0.1 (b) -175/4 (c) -2/55 c What is the nearest to -4/9 in 69, 0.3, 30, -0.2, -3? -0.2 Which is the closest to -1? (a) -4 (b) 3/7 (c) -106 (d) 0.2 d Which is the closest to -1/4? (a) -4/5 (b) -0.5 (c) 2/3 (d) 39 b What is the closest to 1 in 4, 1.4, -174? 1.4 Which is the closest to 1/4? (a) 2/113 (b) 1 (c) -0.3 (d) -0.021 a What is the closest to -1 in -3/2, 27, -176? -3/2 What is the nearest to 2/7 in -0.0093, 2/13, 36/5? 2/13 Which is the nearest to -0.1? (a) -35 (b) -66 (c) -2 (d) 2/5 (e) -1 d Which is the nearest to 25/13? (a) 2/11 (b) 8 (c) 0.3 (d) -18 (e) 0.2 c What is the nearest to -0.1 in -5, -4/13, -4/115? -4/115 Which is the nearest to -1? (a) 4 (b) 1.3422 (c) -1 (d) 1/11 c What is the nearest to -0.7 in -10, -2/7, 4/7, -4, 10? -2/7 What is the closest to -2 in -29, 138, 0.4, 0.1? 0.1 Which is the closest to -47? (a) -1 (b) 5 (c) 2 (d) -12 d Which is the nearest to 193? (a) 1 (b) 5 (c) 4/59 b What is the closest to 1 in -20/7, -1/7161, 1/4? 1/4 What is the nearest to 1/3 in 0.5, 2, 0.15, -1.16? 0.5 Which is the closest to -0.07? (a) -0.2 (b) 597 (c) 0.5 a Which is the closest to -3.52? (a) -4 (b) 4 (c) -265 a What is the nearest to -0.1 in 1/7, 0, 372? 0 Which is the closest to -3/11? (a) 0.3 (b) 1/3 (c) -811 a Which is the closest to 2/5? (a) -0.02632 (b) -5/6 (c) 2 (d) 5 a What is the nearest to 2 in 3158, -0.7, -2, -1? -0.7 Which is the closest to -0.114? (a) -7/2 (b) -2/3 (c) -2/5 (d) 0.1 (e) 1 d What is the nearest to -1 in -1/3, 2/3, 0.2, -2590? -1/3 Which is the nearest to -6? (a) 3 (b) 1.5 (c) -0.1 (d) 1/32 c What is the nearest to 34 in -0.043, 3, 5, 2/5? 5 What is the nearest to -1 in -2, 5, 103? -2 Which is the nearest to -1? (a) -0.09 (b) -2 (c) -0.9 (d) 15/26 c Which is the closest to 1? (a) -2/5 (b) 1/5 (c) 211 (d) -1 b Which is the closest to 2? (a) -3 (b) 3 (c) -5 (d) 1049 b What is the closest to -1/8 in 4/37, 2/25, -2/17? -2/17 Which is the nearest to 0.2? (a) 1 (b) -117	{ "pile_set_name": "DM Mathematics" }
ine h(s(z)). -6694z2 Let a(b) = -b2 + 9b. Let q(j) = -974 + j*2 + 2j - 2j + 974. What is a(q(t))? -t4 + 9t*2 Let h(r) = -170r - 2. Let p(t) = 13930t. Determine p(h(s)). -2368100s - 27860 Let v(f) = -9f. Let p(g) be the second derivative of -2g*2 + 0 - 1/3g*3 - 217g. Determine p(v(o)). 18o - 4 Let p(d) = d. Let j(l) = -4l*2 - 119l - 112l + 152l. Determine j(p(v)). -4v2 - 79v Let p(q) = 19q - 15. Let j(t) = 75t - 63. Let l(f) = -5j(f) + 21p(f). Let w(a) = 6a. Let n(d) = 2d. Let s(c) = 11n(c) - 4w(c). What is s(l(h))? -48h Let b(v) = 53v - 1. Let k(z) = 8066z. Give b(k(j)). 427498j - 1 Let o(f) be the third derivative of -f*5/60 + 1215f*2. Let w(b) = 267b. Determine w(o(j)). -267j2 Let i(f) = 58f*2. Let k(l) = 215899l*2 + 1. Give k(i(d)). 726284236d*4 + 1 Let y(n) = -5n. Let c(k) be the second derivative of k*3/6 - 579k. What is c(y(p))? -5p Let p(w) = -8w. Let r(d) = -286d + 60. Let j(h) = -95h + 18. Let o(x) = 10j(x) - 3r(x). What is o(p(k))? 736k Let a(q) be the first derivative of 0q + 8q3 + 0q*4 + 7 - 1/120q*5 + 0q*2. Let z(r) be the third derivative of a(r). Let j(n) = -9n. Give j(z(c)). 9c Let a(n) = -29n*2. Let q(l) = 4170578l - 2. What is q(a(o))? -120946762o2 - 2 Let o(m) be the first derivative of 5m2/2 + 26994. Let f(s) be the third derivative of -s4/3 - s*2. Give f(o(l)). -40l Let y(m) = -m*2 - 15m. Let h(g) = -27g2 + 3g - 9. Let r(i) = -35i2 + 4i - 12. Let f(n) = -4h(n) + 3r(n). Calculate y(f(d)). -9d4 - 45d*2 Let p(s) be the third derivative of 4s*5/15 - 12s*2. Let g(l) be the third derivative of -3l*5/20 - 139l*2. Give p(g(a)). 1296a*4 Let b = 741 + -738. Let x(k) = 5k*2 + 3k + 3. Let p(z) = -9z2 - 5z - 5. Let a(l) = bp(l) + 5x(l). Let n(v) = v - 21. Give n(a(i)). -2i2 - 21 Let l(k) = 0 + 0 - 4k. Let v be (-4)/(-3) - (-108)/162. Let d(r) = 4r2 - 6. Let h(j) = -3j*2 + 9. Let i(b) = vh(b) + 3d(b). Calculate l(i(f)). -24f*2 Let j(u) = 4u. Let i(a) = 2a - 1 + 4a + 3 + 7a. Let k(v) = -495v - 77. Let b(y) = 231i(y) + 6k(y). Give j(b(n)). 132n Let v(b) be the third derivative of -7b4/24 - b2. Let r(z) = -920 + 920 + 3z2. Determine v(r(s)). -21s*2 Let k(n) be the third derivative of 0n + 7/24n4 + 0 + 191n*2 + 0n*3. Let c(i) = 36i. Give c(k(p)). 252p Let l(i) = 139760i + 2. Let s(d) = 47d2. Give l(s(v)). 6568720v*2 + 2 Let c be 26/40 - (-7)/2(-192)/1680. Let g(h) be the second derivative of ch4 + 12h + 0h2 + 0 + 0h*3. Let b(l) = -6l. Give b(g(a)). -18a2 Let s(k) = 4k*2 + 791. Let z(m) = -207m - 315. Calculate z(s(b)). -828b2 - 164052 Let k(a) = -17390a*2. Let m(o) = 5024o*2. Give m(k(r)). 1519318390400r*4 Let y(w) be the first derivative of 1059w*2 + 6779. Let h(k) = -5k*2. Determine h(y(i)). -22429620i*2 Let s(h) = h + 27. Let c(v) = -14v*2 - 30v + 6. Let q(t) = 407t2 + 880t - 176. Let f(l) = -88c(l) - 3q(l). Determine s(f(u)). 11u2 + 27 Let o(q) = 9q. Suppose -51i + 9i = 51i + 11i. Let z(v) be the third derivative of iv + 0 + 0v*4 - 42v*2 + 0v*3 - 1/20v*5. Calculate o(z(b)). -27b*2 Let k(g) = -2g. Suppose -19q + 13q = -90. Suppose -21n = -qn - 6. Let j(z) = 5 + 5 + n - 2 - 3z. Determine k(j(c)). 6c - 18 Let a(f) = -1300f. Let l(q) = 353q - 849q + 494q. Determine l(a(u)). 2600u Let t(q) = -2q*2. Let b(m) = -19887m - 13m2 + 70m*2 + 19887m. Determine t(b(o)). -6498o4 Let r(i) = 41i*2 - 18i*2 - 25i*2. Let a(m) be the first derivative of 2m*2 + 97. Calculate r(a(u)). -32u*2 Let v(j) = 1255j - 24. Let g(k) = 1253k - 28. Let d(p) = 6g(p) - 7v(p). Let x(u) = 3u. Determine d(x(i)). -3801i Let f(n) = 13n + 5. Let v(d) = -10703d2. Give f(v(m)). -139139m*2 + 5 Let u(l) be the first derivative of 0l*2 + 0l + 1 - 19/3l3. Let c(m) = -9m - 346. Let k(r) = -4r - 173. Let w(x) = -2c(x) + 4k(x). Calculate u(w(z)). -76z*2 Let p(z) = 38z*2. Let b(d) = -137349d. What is p(b(g))? 716860416438g2 Let f(t) = 86196666t*2. Let u(n) = n. What is f(u(r))? 86196666r*2 Let r(f) be the second derivative of -13f*4/6 - 310f - 2. Let i(y) = 2y2 - 7. Give i(r(p)). 1352p*4 - 7 Let t(w) = 2w*3 - 65w*2 - 33w. Let n be t(33). Let l(b) = nb - 9b - 9b + 15b. Let u(i) = -3i + 2. Give u(l(k)). 9k + 2 Let d(g) = 33g - 45. Let r(o) = 28o - 43. Let k(b) = 5d(b) - 6r(b). Let c(n) = n. Calculate k(c(j)). -3j + 33 Let u(b) = -12b. Let m(t) = 8t2 - 14. Let x(o) = -o2 + 1. Let f(p) = -5m(p) - 70x(p). Determine f(u(l)). 4320l2 Let k(l) be the second derivative of l3/3 - 29l2 + 458l + 2. Let p(v) = -16v2 - 2v. What is p(k(o))? -64o2 + 3708o - 53708 Let h(r) = r*2 + 33847r + 1. Let y(z) = 3z + 17. What is y(h(t))? 3t*2 + 101541t + 20 Let c(r) = 7r2. Let s(d) = -51296427d*2. Calculate s(c(u)). -2513524923u*4 Let q(m) = 2m*2. Let u(t) = -10227138t. Determine u(q(y)). -20454276y2 Let w(o) = 17o + 95. Let n(h) = -2 + 232709h + 2 - 232707h. Determine n(w(p)). 34p + 190 Let c(n) = -n2 + 2n. Let q(z) be the first derivative of -3z3 - 405. What is q(c(v))? -9v*4 + 36v*3 - 36v*2 Let d(g) = -1437g. Let p(r) = 21r - 129. Calculate p(d(n)). -30177n - 129 Let w(c) be the second derivative of 13c4/12 - 2c + 28. Let p(h) = -18h + 27. Let m(z) = 9z - 12. Let k(q) = -9m(q) - 4p(q). Give w(k(l)). 1053l2 Let q(k) = 117k*2 - 2k. Let o be q(-1). Let m(j) = 2j + o - 119. Let y(f) be the first derivative of 3f*2 - f - 16. Give m(y(p)). 12p - 2 Let s(i) = 884i2. Let l(x) = 21x*2 - 2x2 + x2 - 21x2. Calculate s(l(c)). 884c*4 Let l(r) = -47r*2. Let c(f) = -73f*2 + 240f. Give c(l(m)). -161257m4 - 11280m*2 Let t(a) = 23a - 16a - 8a. Let x(u) = -u*3 + 5u*2 + 8u - 9. Let s be x(6). Let c(j) = 10 - s - 10j2 - 7. Give t(c(w)). 10w2 Let b(a) be the third derivative of -a5/30 + 158a2 + 4a. Let n(c) = -512c2 - 5 + 5. Give b(n(i)). -524288i*4 Let s(q) = -9q. Let k = 3 + 1. Suppose 3p - u = kp + 1, 0 = -u - 4. Let m(t) = pt2 - 9t + 9t - t2. Determine s(m(h)). -18h2 Let j(v) = -v2. Let t(k) = k*2 + 1. Let s(x) = -24 + 5 + 7x*2 + 11x + 21. Let i(y) = -s(y) + 2t(y). Give i(j(o)). -5o*4 + 11o2 Let h(y) be the second derivative of y4/4 + y. Let j(d) = 193d2 - 389d*2 - 58d + 197d2 + 58d. Determine j(h(u)). 9u4 Let g(h) = -2h. Let d(t) = 39459749t - 31736. Let w(q) = -3730q + 3. Let b(r) = 3d(r) + 31736w(r). Give g(b(m)). -7934m Let c(r) = -582 + 582 + 23r*2. Let m(i) be the first derivative of 2i*3/3 - 1150. Calculate m(c(x)). 1058x*4 Let p(l) = l. Let x(z) be the third derivative of 77z4/6 + z2 + 436. What is x(p(n))? 308n Let t(b) = 6b2. Let k(u) be the second derivative of u5/6 + 3u3/2 + 2u*2 - 186u. Let h(m) be the second derivative of k(m). What is h(t(d))? 120d2 Let o(v) = -2v*2. Let a(c) be the second derivative of 0c*2 - 3c - 9 + 15/2c3. What is a(o(l))? -90l*2 Let v(p) = -29p. Suppose 223g = 216g + 28. Let l(x) = -g - 6x - 11 + 6 + 9. Determine l(v(r)). 174r Let t(n) = -2n2 + 3n - 15. Let c(j) = 3j2 - 5j + 25. Let u(k) = -3c(k) - 5t(k). Let o(s) = -339s + 2. What is o(u(q))? -339q*2 + 2 Let d(v) = 2v*2 + 37840576v - 37840576v. Let s(x) = 11x*2 - 2x + 3x + 2x. Give d(s(c)). 242c4 + 132c*3 + 18c*2 Let k(l) be the third derivative of 0l*3 + 6l*2 + 0l - 7 + 7/30l5 + 0l4. Let c(d) = d2. Calculate c(k(o)). 196o4 Let j(u) = -3u. Let o(q) = -19489096q. Give o(j(k)). 58467288k Let a(g) = 2g. Let i(y) = 3937973y*2. What is a(i(q))? 7875946q*2 Let u(y) = 765y. Let i(s) = -12s2 - 8s. Let m(v) = 5v2 + 3v. Let a(l) = -3i(l) - 8m(l). Calculate a(u(g)). -2340900g2 Let g(a) = 3a*2 - 5a*2 + 4a*2 + 5a + 4 - a. Let q(k) = -k*2 - k - 1. Let v(i) = g(i) + 4q(i). Let l(n) = 17n2 + 37n*2 + 13n*2. What is v(l(x))? -8978x*4 Let o(t) = -1891t*2. Let l(v) = 101v*2 + 101v*2 - 203v*2. Determine l(o(h)). -3575881h*4 Let p(x) = -9x + 3. Let g(f) be the second derivative of -5f4/12 + f + 407. Determine p(g(m)). 45m**2 + 3	{ "pile_set_name": "DM Mathematics" }
minutes after 10:42 AM? 9:46 PM How many minutes are there between 5:08 AM and 7:15 AM? 127 How many minutes are there between 5:52 PM and 11:19 PM? 327 What is 255 minutes before 6:47 AM? 2:32 AM How many minutes are there between 9:07 PM and 6:19 AM? 552 How many minutes are there between 3:49 AM and 6:53 AM? 184 How many minutes are there between 8:32 PM and 10:14 PM? 102 How many minutes are there between 3:39 PM and 2:06 AM? 627 How many minutes are there between 7:30 AM and 6:17 PM? 647 What is 528 minutes before 2:05 PM? 5:17 AM How many minutes are there between 4:43 PM and 2:03 AM? 560 How many minutes are there between 2:24 PM and 11:10 PM? 526 How many minutes are there between 11:04 PM and 8:03 AM? 539 How many minutes are there between 5:24 PM and 9:49 PM? 265 How many minutes are there between 4:56 AM and 4:58 AM? 2 How many minutes are there between 11:22 PM and 9:13 AM? 591 What is 38 minutes before 7:52 PM? 7:14 PM What is 657 minutes before 3:24 PM? 4:27 AM How many minutes are there between 10:48 PM and 7:43 AM? 535 What is 517 minutes after 3:14 PM? 11:51 PM What is 538 minutes before 7:42 AM? 10:44 PM What is 538 minutes after 9:52 PM? 6:50 AM What is 610 minutes before 10:52 AM? 12:42 AM How many minutes are there between 5:15 PM and 12:11 AM? 416 What is 91 minutes after 7:27 PM? 8:58 PM How many minutes are there between 4:52 PM and 2:20 AM? 568 How many minutes are there between 4:10 PM and 3:39 AM? 689 How many minutes are there between 9:43 AM and 10:23 AM? 40 What is 488 minutes after 10:29 PM? 6:37 AM How many minutes are there between 12:38 PM and 5:47 PM? 309 What is 428 minutes before 10:54 AM? 3:46 AM What is 588 minutes after 11:01 PM? 8:49 AM How many minutes are there between 3:22 PM and 2:51 AM? 689 What is 371 minutes before 3:41 PM? 9:30 AM What is 582 minutes before 1:34 AM? 3:52 PM How many minutes are there between 4:07 PM and 9:10 PM? 303 What is 485 minutes after 4:15 AM? 12:20 PM How many minutes are there between 11:55 AM and 4:07 PM? 252 How many minutes are there between 5:29 PM and 10:24 PM? 295 How many minutes are there between 4:27 AM and 1:15 PM? 528 How many minutes are there between 3:18 PM and 8:42 PM? 324 What is 646 minutes after 4:47 PM? 3:33 AM How many minutes are there between 3:28 AM and 1:55 PM? 627 What is 154 minutes after 5:19 PM? 7:53 PM How many minutes are there between 8:49 AM and 8:55 AM? 6 What is 52 minutes before 4:08 AM? 3:16 AM How many minutes are there between 12:13 PM and 3:19 PM? 186 What is 467 minutes after 8:36 PM? 4:23 AM How many minutes are there between 2:20 AM and 1:37 PM? 677 What is 576 minutes after 9:14 AM? 6:50 PM How many minutes are there between 6:06 PM and 1:06 AM? 420 How many minutes are there between 6:27 AM and 3:40 PM? 553 How many minutes are there between 3:32 PM and 9:44 PM? 372 What is 612 minutes after 7:20 AM? 5:32 PM How many minutes are there between 1:42 AM and 8:13 AM? 391 How many minutes are there between 6:53 PM and 6:40 AM? 707 What is 620 minutes before 2:56 PM? 4:36 AM What is 35 minutes after 10:11 AM? 10:46 AM What is 643 minutes before 4:24 AM? 5:41 PM What is 439 minutes before 9:11 AM? 1:52 AM How many minutes are there between 7:51 PM and 12:16 AM? 265 How many minutes are there between 10:27 AM and 1:32 PM? 185 How many minutes are there between 4:55 PM and 12:28 AM? 453 How many minutes are there between 8:16 PM and 4:18 AM? 482 How many minutes are there between 1:04 PM and 4:15 PM? 191 How many minutes are there between 12:10 AM and 2:39 AM? 149 How many minutes are there between 9:35 PM and 6:42 AM? 547 What is 585 minutes before 1:10 PM? 3:25 AM What is 612 minutes before 11:36 PM? 1:24 PM What is 270 minutes after 5:12 PM? 9:42 PM What is 424 minutes before 10:19 AM? 3:15 AM What is 558 minutes before 5:36 AM? 8:18 PM How many minutes are there between 12:43 PM and 4:57 PM? 254 How many minutes are there between 2:43 AM and 8:37 AM? 354 What is 89 minutes before 4:16 AM? 2:47 AM What is 714 minutes before 12:25 PM? 12:31 AM How many minutes are there between 8:18 AM and 11:03 AM? 165 How many minutes are there between 2:12 AM and 8:51 AM? 399 What is 11 minutes after 9:18 PM? 9:29 PM How many minutes are there between 9:50 AM and 8:29 PM? 639 How many minutes are there between 9:56 AM and 11:43 AM? 107 How many minutes are there between 2:51 AM and 5:36 AM? 165 How many minutes are there between 8:46 PM and 7:11 AM? 625 How many minutes are there between 9:06 PM and 7:13 AM? 607 How many minutes are there between 1:40 AM and 3:17 AM? 97 How many minutes are there between 5:49 PM and 2:48 AM? 539 What is 623 minutes after 7:19 PM? 5:42 AM How many minutes are there between 10:58 PM and 1:50 AM? 172 What is 324 minutes after 9:21 AM? 2:45 PM How many minutes are there between 7:48 AM and 1:11 PM? 323 How many minutes are there between 12:16 PM and 11:47 PM? 691 What is 181 minutes after 7:51 AM? 10:52 AM How many minutes are there between 8:58 PM and 8:41 AM? 703 What is 69 minutes before 5:15 PM? 4:06 PM How many minutes are there between 8:08 AM and 1:32 PM? 324 What is 592 minutes after 3:26 AM? 1:18 PM How many minutes are there between 4:47 AM and 1:33 PM? 526 How many minutes are there between 12:56 AM and 7:44 AM? 408 How many minutes are there between 1:37 AM and 9:45 AM? 488 What is 660 minutes after 3:20 AM? 2:20 PM What is 457 minutes after 8:57 AM? 4:34 PM How many minutes are there between 3:48 PM and 4:39 PM? 51 What is 51 minutes after 12:38 PM? 1:29 PM What is 305 minutes after 4:28 AM? 9:33 AM How many minutes are there between 4:59 PM and 11:47 PM? 408 How many minutes are there between 9:44 PM and 12:48 AM? 184 What is 708 minutes after 11:43 PM? 11:31 AM How many minutes are there between 10:16 PM and 7:19 AM? 543 What is 96 minutes after 12:17 PM? 1:53 PM What is 127 minutes after 4:05 AM? 6:12 AM What is 255 minutes before 12:56 AM? 8:41 PM How many minutes are there between 8:39 AM and 4:16 PM? 457 What is 689 minutes after 10:32 PM? 10:01 AM How many minutes are there between 9:25 PM and 11:58 PM? 153 What is 49 minutes after 6:07 AM? 6:56 AM How many minutes are there between 11:33 AM and 8:17 PM? 524 What is 152 minutes before 5:28 PM? 2:56 PM How many minutes are there between 6:19 PM and 2:43 AM? 504 How many minutes are there between 1:49 PM and 7:33 PM? 344 How many minutes are there between 3:55 AM and 4:33 AM? 38 How many minutes are there between 11:29 AM and 1:19 PM? 110 How many minutes are there between 2:57 PM and 7:59 PM? 302 How many minutes are there between 10:28 AM and 8:44 PM? 616 What is 313 minutes after 4:18 PM? 9:31 PM What is 6 minutes before 1:55 AM? 1:49 AM What is 342 minutes after 2:31 PM? 8:13 PM What is 631 minutes after 5:12 PM? 3:43 AM What is 54 minutes before 2:00 PM? 1:06 PM How many minutes are there between 6:04 PM and 2:09 AM? 485 How many minutes are there between 6:41 PM and 9:58 PM? 197 What is 564 minutes after 10:09 PM? 7:33 AM What is 203 minutes before 10:44 AM? 7:21 AM How many minutes are there between 10:06 PM and 8:18 AM? 612 How many minutes are there between 1:44 AM and 10:57 AM? 553 What is 501 minutes after 12:17 PM? 8:38 PM How many minutes are there between 12:42 PM and 7:30 PM? 408 What is 202 minutes after 10:02 AM? 1:24 PM What is 538 minutes after 5:58 AM? 2:56 PM What is 616 minutes after 7:20 PM? 5:36 AM How many minutes are there between 5:41 PM and 5:26 AM? 705 How many minutes are there between 2:09 PM and 7:31 PM? 322 How many minutes are there between 5:01 PM and 2:45 AM? 584 How many minutes are there between 8:08 PM and 5:11 AM? 543 How many minutes are there between 5:57 PM and 2:41 AM? 524 What is 430 minutes before 9:34 AM? 2:24 AM What is 197 minutes after 2:35 AM? 5:52 AM How many minutes are there between 9:11 PM and 4:59 AM? 468 What is 543 minutes after 4:59 PM? 2:02 AM What is 76 minutes before 3:28 AM? 2:12 AM What is 401 minutes after 5:56 PM? 12:37 AM How many minutes are there between 11:44 PM and 6:48 AM? 424 What is 667 minutes before 4:09 AM? 5:02 PM How many minutes are there between 2:34 AM and 12:50 PM? 616 How many minutes are there between 1:12 PM and 10:48 PM? 576 What is 320 minutes before 12:45 P	{ "pile_set_name": "DM Mathematics" }
= 8v + 105 - 133 + 180 for v. -19 Solve -193z = 293 + 1849 + 1718 for z. -20 Solve 1573w - 558 = 1591w for w. -31 Solve 16f + 2160 = -128f for f. -15 Solve 13a - 11a - 29 = 31a for a. -1 Solve -911t - 219 = -961t - 1919 for t. -34 Solve 2583 = 559i + 11527 for i. -16 Solve -1447g + 54 = -1429g for g. 3 Solve 13j + 12 + 353 = 27 for j. -26 Solve 1290m = 1259m + 372 for m. 12 Solve 420 = -4407a + 4427a for a. 21 Solve -53 = 27u + 82 for u. -5 Solve 11p + 13 = 15 + 20 for p. 2 Solve -19a - 43a + 2625 = 43a for a. 25 Solve -1220 = 39s - 635 for s. -15 Solve 109o + 92o + 55 + 749 = 0 for o. -4 Solve 0 = -84h - 118 - 302 for h. -5 Solve 182t = -1849 + 29 for t. -10 Solve 7548a + 20 = 7546a for a. -10 Solve 829 = -50a + 279 for a. -11 Solve 732 = 6d + 1635 - 741 for d. -27 Solve -2b = -42b + 569 - 49 for b. 13 Solve 670h + 2453 - 695 = 377h for h. -6 Solve 18k - 30k + 36 = 6k for k. 2 Solve 36f - 86 = -15f + 118 for f. 4 Solve -320o = 521o for o. 0 Solve -52 - 236 = 24m for m. -12 Solve 86x = 206x - 960 for x. 8 Solve -227w + 2521 - 10012 = 0 for w. -33 Solve -484l - 1319 + 2795 = -2880 for l. 9 Solve -40i + 324 = 604 for i. -7 Solve -12y - 101 - 7 = -0 for y. -9 Solve r = -994 + 1003 for r. 9 Solve -1664 = 214h - 62h - 4096 for h. 16 Solve 70m + 58 = 338 for m. 4 Solve -510 = 67n - 711 for n. 3 Solve 2860 = 551f - 7125 + 3373 for f. 12 Solve -222j + 851j + 728j = -1357 for j. -1 Solve -21m - 226m - 247 = 0 for m. -1 Solve -336b + 1458 = 365b - 755b for b. -27 Solve -6b - 58 = 23b for b. -2 Solve -110 - 124 = 74w + 4w for w. -3 Solve -156 = 36i + 3i for i. -4 Solve 19p - 6 + 82 = 0 for p. -4 Solve 6i - 42i = 18i - 108 for i. 2 Solve -520l - 9336 = -3616 for l. -11 Solve u + 340 = 151 + 167 for u. -22 Solve -7t = 35t - 13t - 261 for t. 9 Solve -187s = 184s - 5936 for s. 16 Solve 37927 + 40550 = 404c + 1717c for c. 37 Solve -394y - 462 - 5448 = 0 for y. -15 Solve 220w + 855 = 163w for w. -15 Solve 167j + 613 = -1057 for j. -10 Solve 43i - 252 - 340 - 182 = 0 for i. 18 Solve 209b - 104b = 37b - 1564 for b. -23 Solve -67a + 29a = 532 for a. -14 Solve 8f + 5f + 1792 = 125f for f. 16 Solve -x = 68x - 1104 for x. 16 Solve 32t + 9t = -707 + 10 for t. -17 Solve 0 = -507m + 332m - 4725 for m. -27 Solve 1360 = -7810x + 7730x for x. -17 Solve 12k = -40k - 728 for k. -14 Solve -395k - 442 = -369k for k. -17 Solve -257i = 178i - 171i + 1848 for i. -7 Solve -587 = 115t + 448 for t. -9 Solve -1769 - 4410 = 167v for v. -37 Solve 22j + 10138 = 9434 for j. -32 Solve -28083 = 1609g + 5706 for g. -21 Solve -5405 + 460 = -351z + 2777 for z. 22 Solve 0 = 17747c - 17788c - 1558 for c. -38 Solve 71p - 366 = -224 for p. 2 Solve 14w - 9w + 4w = 0 for w. 0 Solve -45s = 2791 - 3016 for s. 5 Solve 56r = 491 - 771 for r. -5 Solve 201s - 665 + 803 = -2274 for s. -12 Solve 44s + 802s + 2259 = 567 for s. -2 Solve -1873 = 14l - 1719 for l. -11 Solve 114m - 1887 = 21m - 18m for m. 17 Solve -168f + 124 = -389 + 9 for f. 3 Solve 18h = -21h + 530 + 211 for h. 19 Solve -139 + 1 = -13t - 21 for t. 9 Solve 37 = -66f - 30 + 529 for f. 7 Solve -5698 = 51p - 569p for p. 11 Solve -30a + 253 = -9a + 379 for a. -6 Solve 169l - 535 = -307l + 1369 for l. 4 Solve -16 = -54u - 251 - 197 for u. -8 Solve 769z - 425 = 752z for z. 25 Solve 90 = -200y + 215y for y. 6 Solve 40889 = -250g - 188g - 881g for g. -31 Solve -208k = -658 + 1722 + 1016 for k. -10 Solve -24w - 48w = -16w - 1008 for w. 18 Solve -24r + 726 = 15r + 1077 for r. -9 Solve -58 - 78 = 68x for x. -2 Solve -126107g + 24 = -126104g for g. 8 Solve 800u = 915 + 2285 for u. 4 Solve 73y = 942 + 104 - 170 for y. 12 Solve -167t + 547t = -156t + 1608 for t. 3 Solve 0 = -166z - 868 + 1513 + 1679 for z. 14 Solve -2006i + 1968i + 646 = 0 for i. 17 Solve 4969 + 3676 = 269x + 1920 for x. 25 Solve -11 + 9 = 3d + 16 for d. -6 Solve -867 + 50 = 299i - 256i for i. -19 Solve 917 = -2g + 231g - 2289 for g. 14 Solve 0 = -10t - 19 - 33 + 2 for t. -5 Solve -59w - 645 + 173 = 0 for w. -8 Solve -98 + 158 = -10v for v. -6 Solve -2087 = -117u - 5714 for u. -31 Solve 0 = -120n + 7 - 1327 for n. -11 Solve 0 = -1293b - 10638 - 2292 for b. -10 Solve 748g - 399g = 375g + 494 for g. -19 Solve -471v = 174v - 5160 for v. 8 Solve 116v + 31v - 656 = 106v for v. 16 Solve -33k = 107k - 1680 for k. 12 Solve -3x - 17x + 90x - 350 = 0 for x. 5 Solve 19001w = 19036w - 245 for w. 7 Solve 20c - 39c + 22 = -30c for c. -2 Solve 32m - 30 - 2 = 0 for m. 1 Solve -2010 + 1060 = 9p + 29p for p. -25 Solve -374 - 121 = 45k for k. -11 Solve 143l + 885 + 87 = -601 for l. -11 Solve 2973 = 286h + 399 for h. 9 Solve -47 + 436 = 88h - 139 for h. 6 Solve 0 = 117l - 178l + 610 for l. 10 Solve -120 = 42y - 66y for y. 5 Solve -81t + 301 = -473 - 198 for t. 12 Solve -71p + 25p + 296p = 1250 for p. 5 Solve 0 = -23x + 9079 - 8711 for x. 16 Solve 19t - 1649 = -1915 for t. -14 Solve -201 - 72 = 109a + 163 for a. -4 Solve 360x + 418x + 10892 = 0 for x. -14 Solve 71z = 186z - 1840 for z. 16 Solve 0 = -5p - 16826 + 16721 for p. -21 Solve 522 + 930 = -132o for o. -11 Solve 86 + 48 = -23v - 119 for v. -11 Solve -18347h + 18328h = 57 for h. -3 Solve -686b + 848b = 1782 for b. 11 Solve 48h + 305 - 107 = -18h for h. -3 Solve 0 = 384p + 5401 + 2209 + 70 for p. -20 Solve 105o = 66o + 78 for o. 2 Solve 550 = -50543j + 50521j for j. -25 Solve 117p = -153p - 8370 for p. -31 Solve -183k - 216k - 8240 = 13k for k. -20 Solve 14x + 397 + 515 = -138x for x. -6 Solve 419m + 4609 = -2095 for m. -16 Solve -14w - 127 = 53 - 54 for w. -9 Solve 314 + 416 = 73q for q. 10 Solve 10h - 28 = 23h + 11 for h. -3 Solve 1300g = 251g + 6294 for g. 6 Solve -11j + 30j + 5j = -192 for j. -8 Solve 0 = -138b + 814 + 428 for b. 9 Solve -19 + 446 = -61y for y. -7 Solve 7161g - 7149g + 300 = 0 for g. -25 Solve -270h + 346 = -201h + 1381 for h. -15 Solve 0s - 64s = 146s for s. 0 Solve 121 - 167 = 2c for c. -23 Solve 22k = 46k + 312 for k. -13 Solve 622 + 132 = 26h for h. 29 Solve 20y - 287 = 174y + 637 for y. -6 Solve 42b - 696 = 51b - 67b for b. 12 Solve -116x = 113x + 72x + 5117 for x. -17 Solve -3q - 385 + 373 = 0 for q. -4 Solve -236u = -268u - 523 - 277 for u. -25 Solve b + 47b + 55 = -7b for b. -1 Solve 188c = -2822 + 566 for c. -12 Solve -612 + 552 = -20k for k. 3 Solve 249m + 314m + 10007 = 1562 for m. -15 Solve 27c - 11313 = -11718 for c. -15 Solve 0 = -2534f + 2559f - 450 for f. 18 Solve -24z + 17 = -13 + 6 for z. 1 Solve 33r + 34r + 288 = 221 for r. -1 Solve 0 = 4d + 1763 - 1751 for d. -3 Solve 4x - 59 + 102 - 67 = 0 for x. 6 Solve 11c + 6c = 16c + 6 for c. 6 Solve -197i = -49i - 272 - 172 for i. 3 Solve 290579 = -15r + 290984 for r. 27 Solve v = -6v + 237 - 279 for v. -6 Solve -125z = 100z - 4864 + 12289 for z. -33 Solve -2172 = -53t - 112t + 1293 for t. 21 Solve -52 = 212g + 584 for g. -3 Solve 64c + 319 = -129 for c. -7 Solve 27q - 3247 = 139q - 671 for q. -23 Solve -1522a + 19584 = -978a for a. 36 Solve 93g = -115g + 2288 for g. 11 Solve 13x + 37236 = 37002 for x. -18 Solve -355 - 912 = -315h - 8197 for h. -22 Solve 37b + 34b = 355 for b. 5 Solve -771a - 23298 - 5229 = 0 for a. -37 Solve 3674x - 3728x = -1404 for x. 26 Solve 47c - 25c = 9c - 65 for c. -5 Solve 0 = -20p + 72 - 372 for p. -15 Solve -12p - 122p - 536 = 0 for p. -4 Solve 18i - 8775 + 9027 = 0 for i. -14 Solve -49h + 19h - 819 = -69h for h. 21 Solve 143l - 108l + 26 + 44 = 0 for l. -2 Solve -418q = 60q + 5736 for q. -12 Solve 239z = -2096 - 533 for z. -11 Solve -16z + 77z = 41z - 220 for z. -11 Solve -47962t = -48001t - 468 for t. -12 Solve 0 = 183q + 287 - 2487 - 728 for q. 16 Solve -19687 = 475k - 5437 for k. -30 Solve 98n - 149n = -204 for n. 4 Solve -4622n - 117 = -4613n for n. -13 Solve 0 = 5d + 94d - 8d - 273 for d. 3 Solve 92 = -158t + 16t - 476 for t. -4 Solve 6146q = 6143q + 3 for q. 1 Solve 1545 - 1220 = -17p + 4p for p. -25 Solve 33g + 157 = 553 for g. 12 Solve 58r = -396r - 10592 + 1966 for r. -19 Solve 9i - 85i	{ "pile_set_name": "DM Mathematics" }
55 = -25u - 49 for u. -5 Solve -155941u = -155943u - 16, 0l - 3u = 3l + 21 for l. 1 Solve -9s - 10s + 14s = 2v + 3v + 40, -12v - 62 = -5s for s. -2 Solve 4k + 4h = 20, -15413h + 22 = 2k - 15415h for k. 8 Solve 5i = -150, -41i - 450 = 4p + 37i + 34i - 97i for p. 0 Solve 10j = -30, -25664j = 3l - 25666j - 42 for l. 12 Solve 102q - 45 = 3r + 111q, -3r + 5q = 3 for r. -6 Solve 4r - 116 = -x - 127, 0 = -2x + 4r - 7r - 2 for x. 5 Solve -3m - 2a + 16 - 59 = 0, 70 = -5m - 3a for m. -11 Solve 0 = -12r + 5g + 231, 0 = 2r + 278g - 281g - 45 for r. 18 Solve 15 - 61 = 9o - 2s, -4o = 3o - 0s + 5s + 3 for o. -4 Solve 4h + 145 = -3m + 110, 0 = -10h + 4m + 108 for h. 4 Solve -n - 5u = -2, 20505n - 20504n + 8 = 3u + 2 for n. -3 Solve 0k - 3 = -3c - 3k, -387c = -351c + 4k + 220 for c. -7 Solve 3775h = 9w + 3772h + 33, -4h + 4 = -4w for w. -5 Solve -5m + 16 = 5d + 2d, -2d + 5 = m for m. -1 Solve 3c - 38 = 22r + 24, -6r + 7r + 14 = 6c - 4c for r. -2 Solve -n = -6n + 5y - 65, 5y + 35 = 64 + 21 for n. -3 Solve 4w - 15 = 9w, j + 2230w = -0j + 2226w - 6 for j. 6 Solve 4t + 104m - 52 = 108m, -30m = -31m - 1 for t. 12 Solve 0 = -9d - 3t + 174, 2d + 253 = 2t + 305 for d. 21 Solve -70881f = -70885f + q - 12, q + 20 = -4f for f. -4 Solve -5j - 35 = 187332o - 187333o, -5j + 3j - 9o + 550 = 0 for j. 5 Solve 2g + 1231u - 102 = 4g + 1236u, -u - 44 = u for g. 4 Solve -1111b + 463b = -5l - 647b - 5, 5l + 2b - 40 = 0 for l. 2 Solve -2c = -4y + 4, -3749c = -17y - 3745c - 1 for y. -1 Solve -4k = -h + 43, 0 = 8694h - 8688h - 16k - 170 for h. -1 Solve -2b = 4z - 4z + 4, -58z + 87 = -53z + 4b + 85 for z. 2 Solve 8k = 4o - 236, 3k + 764 = -2o + 658 for k. -32 Solve 4x + 17 = 2236q - 2239q, 3q + 7 = -7x - 16 for q. -3 Solve -3818j - 17 = -3815j - 3z + 10, -3z + 25 = -4j for j. 2 Solve 5p + 7p = 3a - 111, p - 432 + 871 = 431 for a. 5 Solve -4i + 3886 - 3902 = -2i + f, 176 = -26i - 5f for i. -6 Solve -5n + 5n - 2 = -3y + n, 4n - 87 = 7y - 85 for y. 2 Solve 76a + 82a = -g + 154a + 81, 7a = -3g + 148 for g. 5 Solve -2g - 4 = 0, g - 4g - 3 - 3 = m - 0 for m. 0 Solve 2c = 4t - 46, -48c - 972 = 26c - 2t - 0t for c. -13 Solve -4l + 116 = s, 3l - 51 - 7 = 75s + l for s. 0 Solve c + 2c = 12z + 5c + 56, -8c - 2 = 4z + c for z. -5 Solve 5r - 4b - 4 = -b, -29b + 27b + 19 = r for r. 5 Solve -5y + 6d - 2 - 7 = 0, -196y + 410y - 3d = 218y + 15 for y. -3 Solve -4w + 17o - 7o - 6552 = -6688, 3w = -o + 119 for w. 39 Solve -19 = -3t + 4o, 44t + 39t - 10o = 81t + 42 for t. 1 Solve 0 = r + k + 6, -3r + 471 = -23k + 437 for r. -4 Solve 5v = -2 - 8, 9k - 19k + 140k + 136 = -3v for k. -1 Solve 8r - 6 = -2l, -2r = -10755l + 10756l + 5 for l. -13 Solve -3q + 21 = 3r, 15q + 413197r + 9 = 413201r for q. 1 Solve 0 = 17226v - 17217v + 5f - 255, 0 = 3v + f - 87 for v. 30 Solve -3c + 33g = -5c + 38g + 39, -21 = -2c - g for c. 12 Solve -5w = 28a + 1415, 0 = 56w - 58w - 6 for a. -50 Solve 0 = -2w + d - 4, -2w - 3d - 373 + 727 = 342 for w. 0 Solve 6d - 717293z - 54 = -717291z, 5z - 4z = -d + 9 for d. 9 Solve 0 = -2y - 5a - 64, -965y + 3a + 45 = -964y for y. 3 Solve 5d - 879 = 53k - 24k, 3k + 89 = d for k. -31 Solve w + 3t - 9 = 2w, 10 = -3w - 4t + 32 + 3 for w. 3 Solve 1037w - 1032w = -15, -5b + 7 = w for b. 2 Solve -v - 53 = 3l, -5l + 2l - 230 = 4v for l. 2 Solve -v - 29w - 6w - 5 = 0, 6w + 25 = -5v + 13w - 2w for v. -5 Solve -340a - 337a - 188 = -699a + 4u, -3u + 26 = 4a - u for a. 8 Solve -k = -t + 5 + 7, 55k + 2t - 4t + 448 = 0 for k. -8 Solve 1 = b - 8z, 55 = 3b + 487z - 485z for b. 17 Solve -2d + q + 51 = 0, 15d - 415 = -24d - d + 5q + 530 for d. 23 Solve 8q + 2t = -56, -2q - 5t = 26 - 17 + 185 for q. 3 Solve -4335b + 4338b - 70 = -5t, -b + 3t + 28 = 0 for b. 25 Solve -3s = s - 3801 + 3793, 2s = -2x - 16 for x. -10 Solve 3i + 2t = -54, 492t - 2 = i + 245t + 253t for i. -20 Solve -d + 4d = 8 + 1, 4x + 36d - 41d - 9 = 0 for x. 6 Solve -29c = -2s + 124, 0 = -5s - 4c + 89 - 88 + 3 for s. 4 Solve -160s + 66 = -157s - 3i, -3i - 18 = -s for s. 24 Solve 4f + 2w - 12 = 0, w = 34f - 24f - 0w - 18 for f. 2 Solve 29i - 93 = 7z - 4z, 0z + 1 = -z + 11z - 6z + 3i for z. -2 Solve -11w - 3p - 30 - 7 = 0, -w = 968p - 963p - 25 for w. -5 Solve -115 = 3t - 69 - 67, -21 = c - 3t for c. 0 Solve 2t - 4q + 2352 = 2364, -4q = -t - 2 + 4 for t. 10 Solve 3h - 6g = 7g + 183, -3h = -4g - 48 for h. -4 Solve 3l + 3 = -36w + 21w, -2w - 3w - 25 = -5l for l. 4 Solve -l - 7d + 342 = 382, -2l - 3d - 47 = 0 for l. -19 Solve 0 = -5c - x - 27, -4462927c - x - 60 = -4462911c for c. -3 Solve 79a + 5c = 1284, -5c - 10 + 78 = 3a for a. 16 Solve y + 130 = -3h, -5709734y - 3h = -5709732y + 125 for y. 5 Solve c + 91 = 43 + 52, -d - c = 0 for d. -4 Solve a - 60u + 62u + 42 = 0, 2u + 23 = a - 23 for a. 2 Solve 189s + 2c + 48 = 190s, -4s + 171 = 13c for s. 46 Solve -5t = 248d - 247d - 125, d = -3t + 77 for t. 24 Solve 0 = 2g - 3z - 3, -398z + 401z + 2 - 1 = 4g + 4 for g. -3 Solve -5n + 353w = 354w - 9, -44n - 5w + 64 = 0 for n. 1 Solve -48k + 93k = -176u + 44k + 5987, 2u = -2k + 74 for u. 34 Solve -m - 996f - 10 = -1001f, 5m - 3f = 12m - 120 for m. 15 Solve 18j = b + 434, -35j = -3b - 40j + 114 for b. -2 Solve -y - 12 = -4s - 0y, -12y - 1 + 49 = -2s - 38 for s. 5 Solve -z - 680 + 142 = 23a - 259, 5z = -8a - 111 for z. -3 Solve -6h = -h - 4h - 309m + 8348, 70 + 16 = -h + 3m for h. -5 Solve -5b - 4d = 74, -40 + 126 = -4b - 6d - 18 for b. -2 Solve -4h - 16 = -4i, -9709h + 9737h + 228 = -i for h. -8 Solve -95 = -4r - 7a, -6r + 43a - 65 = -r + 15a for r. 15 Solve -206h + 207h - 10 = 5s, 3s = -4h + 86 for s. 2 Solve -29 = 4w - 5f, -52019909w + 52019904w - 20 = -3f for w. -1 Solve -195i + 184i + 2x = -87, 52 = i - 9x for i. 7 Solve -4t - 2i = 0, -t + 619i = -623i + 1247i + 18 for t. 2 Solve 3h + 2m - 569 = -558, 11 + 20 = -3h + 4m for h. -1 Solve -9875o + 9872o = 6k - 3, 4o - 3 = k + 10 for k. -1 Solve f - 10 = 5p, 442p + 2f - 7 = 444p - 3 for p. -2 Solve -60 = 4j - 44k + 49k, 3j = k + 11 + 1 for j. 0 Solve -2w - 3x = -4w - 0x - 908 + 892, 3w + 103x - 836 = 0 for w. 4 Solve 0 = -4c - 2f + 40, 4c - 8f - 3 - 33 + 16 = 0 for c. 9 Solve -3r - 3 = -b, -4b + 31r - 49 = -8b - 30 + 122 for b. 12 Solve -22516g = -22519g + 15, -3g = 2w + 3w - 75 for w. 12 Solve -3q - 144 = -3z, 2q + 14z + z + 241 = 1029 for q. 4 Solve 0t - t - 2a + 25602 = 25640, -9t + 19 = -a for t. 0 Solve 1201g = 1200g, 108o + 3g = -7560 for o. -70 Solve 2m = -10, -3v = -2m - 106 + 39 - 33 for v. 30 Solve 9m - 4n = 4m + 13, -2m + 2564 = 15n + 2509 for m. 5 Solve 5x - 12 = m, 0 = -8m - 23548x + 23549x + 60 for m. 8 Solve 23 = -n + 5n + 5u, u - 2u = -n - 1 for n. 2 Solve -5w = -20, -b - 134w + 131w = -43 for b. 31 Solve 175g + 4 = q + 171g, 8 = 2q + g - 5g for q. 4 Solve -2k - 36 = 2p, 5k - 14602 + 14635 = -2p for k. 1 Solve -5235 + 10406 = -16a - 4u + 5199, -2a + u + 3u - 10 = 0 for a. 1 Solve 0 = -4i + 104 - 24, -2l = -35i + 510 + 192 for l. -1 Solve -13g - 10 = 2w - 8g + 4 - 3, -132 = -16w + 4g for w. 7 Solve -10t + 78 = 4y, 124t - 125t + 69 = 4y for y. 17 Solve -3f - 5m = -3m - 33, -2m - 3m - 6 = -2f - 3 for f. 9 Solve -3m - 102 = -5x, -m - 7371x = -7373x + 33 for m. -39 Solve 3282s - 268 = 5o + 3270s, -s + 20 = -o for o. 4 Solve -3z = -193q - 678 + 666, -3z = 4q - 0q - 12 for z. 4 Solve -7g + 5c - 83 = -51g + 5g, -4g + 14 = 2c + 4 for g. 2 Solve 5t + 2x + 70 = 7x, 5t = -3x - 56 + 51 - 41 for t. -11 Solve -17o - 29735u + 106 = -29737u, 0 = 2o + 2u - 8 for o. 6 Solve -6g + 6m = 5m - 146, 0 = 3m + 146474 - 146486 for g. 25 Solve 3z = -3x - 21, -14965x + 14961x - 36 = -4z for z. 1 Solve f = 40z - 47z + 2f + 25 + 28, 25 = 2z + 3f for z. 8 Solve -3b = 3y - 42, -1439b = y - 1447b + 22 for y. 10 Solve 17l - 45u - 44u = 35u - 121u + 35, -4*u =	{ "pile_set_name": "DM Mathematics" }
). Let q = t - 74. Which is greater: -106 or q? q Suppose 0 = -w - 4w. Suppose -4i + 2i - 2 = w. Let l = 5367 - 5368. Does l = i? True Let l be 2 + (4 + -2)/(-1). Suppose 5r + 45 = -lr. Suppose 2k + 16 = -4a - 2k, 3k = -2a - 3. Is r less than a? False Let k(g) = -3g3 + 5g3 - g3 - 135 - 14g2 + 0g*2 - 41g - 7g2. Let z be k(23). Which is smaller: -18 or z? z Let b = -12.919 + 0.119. Let c = -3.415 + 3.615. Which is smaller: b or c? b Let c = 87388199/25277538 - -95/29461. Let m = -75/22 + c. Let d be 3/60/3. Which is smaller: m or d? d Let j be -1 + 22/3 + 13/(-39). Let x be -43/(-30)(-5)/j. Let g = -7 + 11. Which is smaller: x or g? x Let u be (-62)/155105 + 44. Let p(o) be the second derivative of o4/12 + o3/6 - 3o*2/2 + o. Let k be p(-3). Is k smaller than u? False Let s be 1722/(-11) - (-273 + 252). Which is bigger: -135 or s? -135 Let j be 4((-5)/10 - -1) + (0 - 2). Are 2/153 and j nonequal? True Let q = 7409 + -7408.781. Let k = -1.96 + -0.04. Which is smaller: k or q? k Let n = -62 - -64. Suppose 2i - 8 = 0, 2i + 0i = nd. Suppose 0a - 2a - 2o = -2, 3a = -do - 1. Is a at most as big as 5? True Let g(o) = 72o*2 + 3o - 13. Let u be g(2). Are 291 and u unequal? True Suppose 71778 = -113z - 10147. Which is bigger: -717 or z? -717 Let t be 2443/(-14) + 29 + -12 + -33. Suppose -3j = 473 + 97. Which is bigger: j or t? j Let c be (-66)/(-55) + 6/(-30) + (-1341)/1346. Are c and 0 nonequal? True Let u = 132 - 99. Suppose 43p - 270 = up. Suppose -4g = -5b - p, 7g - 3b = 5g + 15. Is g at most 6? True Suppose 36256 = 127s - 159s. Which is greater: -5658/5 or s? -5658/5 Let n be (23 + -33)/(-4(-1)/(-70)). Let w be (-3)/(42/n)(1 + -11). Is -2/5 smaller than w? True Let l = 513 + -320. Let b = l + -210. Let i be 2/(-15) - (-20)/25. Is i less than b? False Let q be (-10 + 6)10/130. Suppose 0o = -2o - 3f - 6, 2f + 4 = 2o. Suppose i - 2a - 10 = 0, -4i = -5a - oa - 25. Is q less than i? True Let j be (-15)/5 + 12 + -5 + -4. Which is smaller: j or -15/34? -15/34 Suppose h + 2 + 0 = -b, 2h + b + 1 = 0. Let x = 60453/7 + -8629. Is h bigger than x? False Suppose 22q + 784 = 29q. Let u = q + -110. Suppose -y = uy - x + 5, x + 1 = 0. Which is bigger: y or -5/2? y Suppose 0 = 13q - 47 - 304. Suppose 44w - qw = 0. Is 245 at least w? True Let f = 32 - 11. Let c(z) = z*2 - 23z + 19. Let g be c(f). Let d = g + 20. Which is smaller: -7/2 or d? -7/2 Let u be 35(-12)/60 + 164004/23428. Is -1 smaller than u? True Let j = -6113.2 + 5453. Let g = 665 + j. Is g less than -0.2? False Let p = 1761 - 1796. Is 32 bigger than p? True Let a = -22.64 - 0.36. Let v = 174/85 + -45/17. Is a at most v? True Let w(x) = 8x*3 + 3x2 + x. Let a = -85 + 84. Let y be w(a). Let v be ((-12)/7)/y + 107/(-7). Which is greater: v or -8? -8 Let g = 69 - 64. Let h be ((-1068)/(-68))/3 - g. Is 2 < h? False Let b be ((-4)/(-6))/(38/(-513)). Let c(x) = x3 + 10x2 + 7x - 19. Let j be c(b). Which is smaller: j or 3/13? j Let m(c) = c*2 + 2c. Let d be m(-2). Let g(t) = -t*3 - 7t*2 - 11t - 4. Let a be g(-2). Let h be (a - d)2/12. Does -2 = h? False Let s be (-3)/(-11) + (-13770)/25806. Which is greater: s or -0.007? -0.007 Let c = 146 + -123. Suppose -15t = -ct + 40. Suppose -td + h = 10, -4d + 3 = -3h - 0. Which is bigger: d or -24? d Suppose -2s = b - 0b - 60, 2b + 141 = 5s. Suppose -10 = 5z - 5. Let c be (s/32 + z)/((-5)/(-60)). Which is smaller: c or -1? c Let j be (93/(-27) + 3)/(204/(-54)). Which is smaller: 14.9 or j? j Let k(w) = -59w*2 + 14w + 2. Let x be k(-1). Is -69 equal to x? False Suppose -2y = 1 + 9. Let p be (-1)/((-3 - y)7). Suppose 4w = -2m + 12, 5w - 11 = 9. Is m > p? False Suppose 14 = a + 2. Suppose -a = -3p - 285. Let q = -52 - p. Is q at most 40? True Let u(c) = -11c + 29. Let j(b) = 5b - 14. Let s(o) = 13j(o) + 6u(o). Let x be s(-7). Let k = 7338/41 - 179. Is x < k? True Let a = -197 - -198.45. Let g = a + -1.45. Let v = -9.951 + 10. Is g equal to v? False Let i be ((-589)/(-593) + -1)((-774)/(-43))/108. Which is greater: 1 or i? 1 Suppose 2j + 6c - 7c - 37 = 0, 3c + 60 = 3j. Suppose -11p = -jp + 330. Do p and 1 have the same value? False Suppose 5s - 4 = 21. Suppose -su + 4u = -192. Let g = -2689/14 + u. Which is greater: g or -1? g Suppose -51 = 9v + 8v - 68. Is v >= -6841? True Let r = 308911/3 - 100298. Let c = -2697 + r. Do -26 and c have the same value? False Let m(c) be the second derivative of 5c*4/24 - 14c*3 - 45c*2/2 - 5c. Let u(z) be the first derivative of m(z). Let t be u(16). Are -4 and t equal? True Let g = -7.285 - -7.185. Is g greater than 1.2632? False Let v be ((-6)/(-9))/(-2) - (-2145)/9. Let j = v + -175. Is 62 at least j? False Let c(v) = -v*2 - 61v - 798. Let u be c(-19). Which is greater: 46/45 or u? 46/45 Let t be 13/26(-13)/(-2). Let m = 29 - 27. Let y be 3((3 - 4) + m). Which is greater: y or t? t Let w = -151375 - -151374.9. Let l be 1/4306/6. Let h = l + -13. Is w greater than h? True Let i(f) = f3 - 20f*2 + 20f + 29. Let u be i(19). Let w be (u/(-60))/((-24)/(-5) + 2). Is w > 0? False Let n be 4/6 + 1 + (17808/(-36) - -5). Which is greater: -485 or n? -485 Let b = -0.13569 + 0.16569. Suppose 0 = 4s + 5r + 1 - 7, -2r = -4. Does b = s? False Suppose 6s = 8s - 4m - 26, 31 = 3s - 4m. Suppose p = sy - 35, -32 = 3p - y + 3. Which is smaller: p or -13? -13 Let n = -25451 - -20992. Do n and -4461 have different values? True Let n(s) = -5s + 2s + 0s + 39. Let c be n(13). Is -9 at least c? False Let r be (-25)/(21/(7 + 35)). Is -10 <= r? False Let y = 32 + -137. Let x be 6/66 - y/(-308). Let k = -15 - -12. Which is smaller: k or x? k Let s(k) = k - 23. Let q be s(-28). Let r = 52 + q. Suppose -r = -u - 4. Are -2 and u nonequal? True Suppose 9 = 649g - 644g + 2v, -g - 2v = -13. Which is greater: -15/278 or g? -15/278 Suppose 3v = 4p - 72, 3v - 78 = -4p - 6. Suppose -5l = -h - 22, h = -0h + l - p. Suppose -3j - c + 7 = c, 6 = 3c. Is j equal to h? False Suppose 4x = -0x + 20. Let h be -3434/28(-4)/33. Do x and h have different values? True Let n be 20304/(-90)10/(-3). Let u = n - 742. Which is greater: 8 or u? u Suppose y = -28y - 138 + 15218. Which is greater: y or -12? y Suppose -3n = 2t + 2n + 5262, -4n + 7916 = -3t. Let g = t - -176609/67. Suppose -2f + 5 = u, -4f - u + 12 = 5. Which is bigger: f or g? f Let a = -85/16 + 1481/80. Is 14 bigger than a? True Let t = 204 + -25. Let i = 185 - t. Is 5 >= i? False Let u = 342 - 342. Let f = 47 + -47.11. Are u and f non-equal? True Let l(r) = -16r - 278. Suppose 14 = -k + w, -w - 34 = 3k - k. Let x be l(k). Are x and -28 non-equal? True Suppose 4x + 0x + 74 = 5t, 4t + 5x - 92 = 0. Let s be (-12)/t + (-149)/(-3). Let l(p) = -16p + 1. Let q be l(-3). Do s and q have different values? False Let g = -32088 - -32087.9. Let n = 2 - 2.2. Let d = n + 0.1. Is g at most as big as d? True Let y = 29366 + -29360. Let i be (-6)/(-30) + (-134)/(-80). Is i > y? False Let j be (-2)/(4/(-5)) - 564/(-2160)-9. Which is smaller: -80 or j? -80 Let r = -1146 - -1146.07. Let z(i) = i2 - 7i - 3. Let b be z(8). Suppose 6s - s = b. Which is smaller: s or r? r Let d = 14/341 - 185/4774. Is -2/7 greater than or equal to d? False Let k = -11 - -11. Let o = 37 - 4. Suppose 5t = -o + 103. Is k > t? False Let c be (38/(-2) - -1)3/(-6). Let j be (-12)/c - (-91)/69. Let z be 1/(-4) + (-30)/40. Which is smaller: j or z? z Let h be ((0 - 1)-2)/((-16)/264). Let g(p) = -3p2 - 5. Let b be g(3). Is b not equal to h? True Let q = -1330.7 - -1394. Let u = 71.28 - q. Let m = -0.02 - u. Are 0.1 and m non-equal? True Let z be (3 + -2)/(-2 - -1). Let q = -2025 + 257173/127. Which is smaller: q or z? z Let p be 3 + -1 - 169/18. Let c be ((-780)/114 - -1) + (-3 - p). Is c greater than or equal to -0.1? False Let u be -3(1 - 1 - (-208)/24). Let f be u/(-6) - 10/(-15). Suppose o + 4 = f. Which is bigger: -1/17 or o? o Let r be 4701/(-33005) - (-1)/(-7)-1. Let c = -42539/245180 + r. Which is greater: -1 or c? c Let m be 6/39 - (-172808)/936. Let g = -185 + m. Which is bigger: -0.1 or g? -0.1 Suppose -42m = -39m + 3p + 570, 4p - 591 = 3*m. Let q = -45 + 4	{ "pile_set_name": "DM Mathematics" }
0 What is prob of sequence gjj when three letters picked without replacement from {p: 2, j: 2, g: 2, m: 1, n: 1, o: 1}? 1/126 Three letters picked without replacement from {a: 5, u: 11}. What is prob of sequence aua? 11/168 Calculate prob of sequence pq when two letters picked without replacement from peprpqpwpppwepei. 1/30 Three letters picked without replacement from osowf. Give prob of sequence wos. 1/30 Four letters picked without replacement from {o: 1, r: 3, z: 1, p: 4, d: 2, e: 4}. Give prob of sequence poer. 2/1365 Calculate prob of sequence uv when two letters picked without replacement from ubv. 1/6 Two letters picked without replacement from {n: 6, u: 7}. What is prob of sequence uu? 7/26 What is prob of sequence fff when three letters picked without replacement from zofofozooozzzzlfolz? 1/969 Two letters picked without replacement from {q: 3, v: 1, o: 7, j: 3, z: 3, k: 3}. What is prob of sequence jo? 21/380 Four letters picked without replacement from ssmnssassssp. What is prob of sequence smps? 7/1485 Four letters picked without replacement from {d: 3, n: 1}. Give prob of sequence ddnd. 1/4 Calculate prob of sequence qqq when three letters picked without replacement from zqqzzqzz. 1/56 Four letters picked without replacement from {g: 1, u: 2, w: 4, y: 2, f: 4, m: 2}. Give prob of sequence gmuf. 2/4095 Two letters picked without replacement from bllbnllnlllkblltthn. Give prob of sequence hb. 1/114 What is prob of sequence xr when two letters picked without replacement from {x: 1, i: 7, r: 4, e: 2}? 2/91 Two letters picked without replacement from gjjc. What is prob of sequence cg? 1/12 What is prob of sequence yyzy when four letters picked without replacement from yyyyyyyyyyyyyyyyzyyy? 1/20 What is prob of sequence cww when three letters picked without replacement from rwwwycrgcwwygyc? 2/91 What is prob of sequence al when two letters picked without replacement from {l: 3, h: 3, a: 1}? 1/14 What is prob of sequence ehz when three letters picked without replacement from {y: 2, p: 1, z: 2, h: 1, e: 1}? 1/105 Three letters picked without replacement from fkfffkfffkikf. What is prob of sequence ikk? 1/143 Four letters picked without replacement from {x: 1, l: 1, w: 1, t: 6, i: 3}. Give prob of sequence ttlt. 1/99 Two letters picked without replacement from {e: 2, j: 8, f: 3, r: 4}. Give prob of sequence je. 1/17 Three letters picked without replacement from {m: 3, r: 3, v: 4, c: 1, f: 1, j: 6}. Give prob of sequence vmj. 1/68 What is prob of sequence ld when two letters picked without replacement from fnfdfllfln? 1/30 Calculate prob of sequence toto when four letters picked without replacement from ooototooootooo. 5/182 What is prob of sequence ph when two letters picked without replacement from {p: 1, h: 19}? 1/20 Calculate prob of sequence hn when two letters picked without replacement from {f: 3, z: 1, h: 1, n: 2}. 1/21 Two letters picked without replacement from {w: 11, n: 7, r: 2}. What is prob of sequence nw? 77/380 Three letters picked without replacement from {a: 2, k: 1, p: 2, i: 1, v: 1, q: 1}. What is prob of sequence pvi? 1/168 Four letters picked without replacement from {l: 2, u: 5}. What is prob of sequence uuul? 1/7 Four letters picked without replacement from qnhlchqslhchsc. Give prob of sequence hshs. 1/1001 Four letters picked without replacement from {i: 3, w: 3, j: 1, x: 3, g: 1, y: 2}. What is prob of sequence xyji? 3/2860 Four letters picked without replacement from {r: 1, n: 4, o: 6, m: 6}. Give prob of sequence mnnm. 3/476 Calculate prob of sequence vgd when three letters picked without replacement from wevvldg. 1/105 What is prob of sequence utk when three letters picked without replacement from hctkhkkktuh? 4/495 Calculate prob of sequence aaa when three letters picked without replacement from aaaa. 1 Four letters picked without replacement from kkxnxn. Give prob of sequence xkkx. 1/90 Three letters picked without replacement from {u: 10, w: 5, l: 4}. What is prob of sequence uuw? 25/323 Four letters picked without replacement from {c: 1, e: 2, z: 2, k: 1}. What is prob of sequence zkce? 1/90 Four letters picked without replacement from {s: 4, e: 2, j: 2}. Give prob of sequence jses. 1/35 Four letters picked without replacement from {x: 7, r: 3, j: 2}. What is prob of sequence jjrx? 7/1980 Four letters picked without replacement from {o: 1, x: 2, v: 1, a: 1, h: 1, f: 2}. What is prob of sequence fxxh? 1/420 Two letters picked without replacement from sls. What is prob of sequence sl? 1/3 Three letters picked without replacement from zawzw. Give prob of sequence wza. 1/15 Two letters picked without replacement from bkebbekbebkbk. What is prob of sequence bb? 5/26 Four letters picked without replacement from {y: 3, b: 4, g: 1, m: 2}. Give prob of sequence byym. 1/105 Two letters picked without replacement from aakkkqa. What is prob of sequence ka? 3/14 What is prob of sequence yiyi when four letters picked without replacement from {y: 9, p: 8, i: 2}? 1/646 Calculate prob of sequence xo when two letters picked without replacement from oxxowoooonnxn. 3/26 Four letters picked without replacement from ajjjaraajjrajj. Give prob of sequence jaar. 5/429 Two letters picked without replacement from {g: 3, n: 3}. What is prob of sequence gg? 1/5 Three letters picked without replacement from rijjbjb. Give prob of sequence ibr. 1/105 Four letters picked without replacement from fcwf. Give prob of sequence wffw. 0 Four letters picked without replacement from dacgg. What is prob of sequence cgda? 1/60 Three letters picked without replacement from ggfggfgggg. Give prob of sequence ffg. 1/45 Calculate prob of sequence cj when two letters picked without replacement from cddjnjjjqxcc. 1/11 Calculate prob of sequence wu when two letters picked without replacement from {w: 1, k: 2, n: 2, j: 1, y: 1, u: 2}. 1/36 Two letters picked without replacement from uusufuuuusuuuuus. What is prob of sequence fu? 1/20 Calculate prob of sequence sns when three letters picked without replacement from ssssnsssssnnss. 55/364 Calculate prob of sequence azaa when four letters picked without replacement from azaaaaaa. 1/8 Two letters picked without replacement from {i: 4, m: 6, c: 3, x: 1, b: 1, h: 1}. What is prob of sequence bm? 1/40 Two letters picked without replacement from {p: 5, b: 3}. What is prob of sequence bp? 15/56 Two letters picked without replacement from {n: 7}. What is prob of sequence nn? 1 Three letters picked without replacement from {f: 7, r: 7}. Give prob of sequence frf. 7/52 Calculate prob of sequence jbn when three letters picked without replacement from crrnbcnnjjbrrjrr. 3/560 Calculate prob of sequence jk when two letters picked without replacement from {j: 1, b: 2, k: 4, q: 3}. 2/45 Calculate prob of sequence ssz when three letters picked without replacement from {z: 2, s: 6}. 5/28 What is prob of sequence nf when two letters picked without replacement from {n: 3, f: 5, b: 5}? 5/52 What is prob of sequence ss when two letters picked without replacement from wjssswjsmwwsijsms? 21/136 What is prob of sequence ee when two letters picked without replacement from {e: 2, a: 2}? 1/6 Two letters picked without replacement from {l: 3, w: 2, d: 2, c: 1, j: 1, o: 6}. Give prob of sequence cw. 1/105 Three letters picked without replacement from hxdgocc. What is prob of sequence gxo? 1/210 What is prob of sequence in when two letters picked without replacement from {n: 7, g: 1, i: 2}? 7/45 Two letters picked without replacement from llhehhhhnfljn. What is prob of sequence jf? 1/156 Calculate prob of sequence ggg when three letters picked without replacement from {g: 7}. 1 Two letters picked without replacement from xdxfuxxvd. What is prob of sequence fu? 1/72 Three letters picked without replacement from eepppneepjpe. Give prob of sequence pje. 5/264 Two letters picked without replacement from vvqvvkvxvivivvvigvi. Give prob of sequence gx. 1/342 What is prob of sequence cg when two letters picked without replacement from cgcccggccggcc? 10/39 Four letters picked without replacement from {c: 2, x: 7, p: 2, n: 2, m: 7}. Give prob of sequence xxnp. 7/4845 Three letters picked without replacement from nddn. Give prob of sequence ddn.	{ "pile_set_name": "DM Mathematics" }
nd 22? 2 Calculate the greatest common factor of 1970 and 15628010. 1970 What is the greatest common factor of 405837 and 27? 27 Calculate the highest common divisor of 16768 and 6784. 128 Calculate the highest common factor of 35 and 1915. 5 Calculate the highest common factor of 6825 and 46917. 39 Calculate the greatest common factor of 50353 and 3483. 43 Calculate the highest common factor of 1029948 and 12. 12 Calculate the greatest common factor of 24 and 893652. 12 Calculate the greatest common divisor of 554598 and 126. 18 What is the highest common factor of 2024802 and 5304? 1326 What is the highest common divisor of 4493450 and 100? 50 Calculate the highest common factor of 26277 and 209. 19 What is the highest common factor of 341386 and 131? 131 Calculate the greatest common factor of 3864 and 1722. 42 Calculate the greatest common factor of 352275 and 1342. 671 Calculate the highest common factor of 57792 and 14. 14 What is the highest common factor of 118849 and 14383? 757 What is the greatest common divisor of 24909 and 304? 19 What is the highest common factor of 455 and 910091? 91 What is the highest common divisor of 294 and 731346? 42 Calculate the highest common factor of 2627129 and 1173. 391 What is the highest common factor of 4002 and 2378? 58 What is the highest common divisor of 6432 and 9916? 268 Calculate the highest common divisor of 588 and 1056. 12 What is the greatest common factor of 13614 and 84? 6 What is the greatest common factor of 19184 and 110? 22 What is the highest common divisor of 310202 and 258? 86 Calculate the greatest common divisor of 2451 and 202143. 129 Calculate the greatest common divisor of 3520 and 69344. 352 What is the highest common factor of 67989 and 21222? 393 What is the greatest common divisor of 87006 and 306? 102 Calculate the greatest common divisor of 67251 and 174. 87 What is the highest common divisor of 102108 and 1143? 381 What is the greatest common factor of 61791 and 129? 129 What is the greatest common divisor of 52244 and 1702? 74 Calculate the greatest common divisor of 36192 and 192. 96 What is the highest common factor of 275295 and 15? 15 What is the highest common divisor of 156086 and 14? 14 Calculate the highest common factor of 44986 and 14525. 83 Calculate the highest common divisor of 6480 and 16560. 720 What is the highest common factor of 85942 and 1746? 194 Calculate the greatest common factor of 130 and 2215655. 65 What is the greatest common factor of 45820 and 27255? 395 Calculate the highest common factor of 940 and 2143435. 235 Calculate the highest common divisor of 45 and 85335. 15 What is the highest common divisor of 104 and 243256? 104 What is the greatest common factor of 462 and 239162? 154 Calculate the greatest common factor of 60650 and 200. 50 What is the greatest common divisor of 92166 and 30? 6 What is the greatest common factor of 89 and 6874004? 89 Calculate the greatest common divisor of 3625 and 1653. 29 Calculate the greatest common divisor of 2785748 and 122. 122 What is the highest common divisor of 242330 and 440? 110 What is the highest common factor of 1650 and 2454? 6 Calculate the highest common factor of 35659 and 422. 211 What is the highest common factor of 29 and 2536949? 29 Calculate the greatest common divisor of 1232 and 1036. 28 What is the highest common factor of 1307872 and 224? 32 What is the highest common divisor of 40 and 418420? 20 What is the greatest common factor of 30 and 1727? 1 Calculate the greatest common factor of 22246 and 44038. 454 What is the highest common factor of 9581 and 121264? 143 Calculate the greatest common divisor of 1979910 and 60. 30 Calculate the highest common divisor of 928 and 24012. 116 What is the highest common factor of 3444408 and 77? 11 What is the greatest common divisor of 6 and 2756526? 6 Calculate the greatest common factor of 20 and 1959730. 10 What is the greatest common factor of 108777 and 404? 101 Calculate the greatest common factor of 2110 and 42310. 10 What is the highest common divisor of 177756 and 24? 12 Calculate the highest common divisor of 140604 and 36. 12 What is the highest common factor of 8416 and 32? 32 What is the greatest common factor of 1090423 and 1? 1 What is the highest common divisor of 78185 and 5? 5 Calculate the greatest common factor of 148 and 168202. 74 What is the greatest common divisor of 1680 and 20958? 42 Calculate the highest common divisor of 1001 and 46423. 13 What is the greatest common divisor of 3723 and 162571? 1241 What is the greatest common divisor of 340 and 352172? 68 Calculate the greatest common factor of 1095696 and 1512. 504 What is the highest common divisor of 183 and 141? 3 Calculate the highest common factor of 1015 and 74515. 35 Calculate the highest common factor of 140 and 286580. 140 What is the greatest common divisor of 2430 and 2130? 30 Calculate the highest common factor of 735 and 1680. 105 Calculate the greatest common divisor of 12 and 213002. 2 What is the greatest common factor of 132187 and 671? 671 Calculate the highest common factor of 624286 and 1690. 338 What is the greatest common factor of 56 and 8480? 8 What is the greatest common factor of 49 and 910? 7 Calculate the highest common divisor of 69842 and 153058. 1486 Calculate the highest common factor of 40 and 39952. 8 What is the greatest common divisor of 6567 and 11517? 33 Calculate the greatest common factor of 36 and 482787. 9 What is the greatest common divisor of 1082641 and 7? 7 Calculate the greatest common factor of 27 and 188847. 9 What is the highest common factor of 2608 and 7619272? 1304 Calculate the greatest common factor of 1988 and 27548. 284 What is the highest common factor of 11888 and 464? 16 What is the greatest common divisor of 13854154 and 38? 38 Calculate the greatest common divisor of 14 and 4632. 2 Calculate the greatest common divisor of 1610 and 24840. 230 Calculate the highest common factor of 28824 and 24. 24 What is the greatest common factor of 113151 and 3? 3 What is the greatest common factor of 2 and 898? 2 Calculate the highest common factor of 1855 and 233359. 371 What is the highest common divisor of 12989 and 403? 31 Calculate the greatest common divisor of 1820 and 4970. 70 Calculate the highest common factor of 36669 and 2329. 17 Calculate the highest common factor of 158498 and 1824. 38 What is the greatest common factor of 1599 and 507? 39 Calculate the highest common factor of 25515 and 7350. 105 What is the greatest common factor of 708 and 13983? 177 What is the greatest common divisor of 1005 and 1532290? 335 Calculate the greatest common factor of 13 and 676117. 13 What is the greatest common factor of 4160 and 699712? 832 Calculate the highest common divisor of 18632 and 5576. 136 What is the highest common factor of 1775 and 275? 25 Calculate the highest common divisor of 161 and 489463. 23 Calculate the greatest common divisor of 435 and 2874. 3 Calculate the highest common divisor of 39 and 69511. 13 Calculate the greatest common factor of 7913 and 15440. 193 Calculate the greatest common factor of 692355 and 1919. 101 What is the greatest common factor of 6095 and 13250? 265 What is the greatest common factor of 11808 and 3168? 288 Calculate the greatest common factor of 86 and 12004912. 86 What is the greatest common divisor of 402 and 23785134? 402 What is the highest common factor of 1639451 and 309? 103 Calculate the greatest common factor of 5348 and 4228. 28 Calculate the greatest common divisor of 1369986 and 6. 6 Calculate the greatest common divisor of 1156 and 1300789. 289 Calculate the greatest common factor of 26092 and 44. 44 What is the highest common factor of 899 and 31? 31 What is the greatest common divisor of 34280 and 16? 8 What is the highest common factor of 11696 and 102? 34 Calculate the highest common factor of 5872160 and 392. 392 Calculate the highest common divisor of 3963070 and 1110. 370 What is the highest common factor of 127052 and 368? 92 What is the greatest common divisor of 115736 and 1088? 136 Calculate the greatest common divisor of 451592 and 3192. 152 What is the greatest common divisor of 232 and 10411? 29 What is the greatest common facto	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.