Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
) be the second derivative of -52m3/3 - 2m - 290. Let z(c) = -9c2. What is x(z(g))? 936g*2 Let t = 3332 - 3329. Let n(q) be the third derivative of 1/6q*t + 0 + 1/24q*4 - 26q*2 + 0q. Let i(r) = 2r. Determine n(i(y)). 2y + 1 Let t(h) be the first derivative of 59h6/360 - 10h*3 - 7. Let d(b) be the third derivative of t(b). Let f(z) = z. Determine f(d(v)). 59v2 Let s(u) be the first derivative of -u4/4 + 99u + 66. Let b(v) be the first derivative of s(v). Let y(i) = -23i - 1. Give b(y(f)). -1587f2 - 138f - 3 Suppose 0 = s - 2s + j + 4, -4s + 14 = -5j. Let v(r) = sr + 12791 - 12791. Let x(c) = 22c2 + 15c*2 - 35c*2. What is v(x(b))? 12b*2 Let x(l) = -3l - 7. Let u(f) = -9f2 + 10360f. Calculate x(u(k)). 27k2 - 31080k - 7 Let y(s) = -4s2. Let w(v) be the first derivative of -v2 + 133. Let d(u) = -2u. Let p = 11 - 8. Let h(k) = pw(k) - 2d(k). What is h(y(o))? 8o2 Let s(c) = -c2 + 23c + 54. Let w be s(25). Let u(i) = wi2 + 85i - 162i + 77i. Let t(z) = 20z. Calculate t(u(g)). 80g*2 Let c(o) = -1118o - 21 + 1115o + 8 - 10. Let i(b) = -4b. Determine c(i(z)). 12z - 23 Let y(m) = 40m + 2m2 - 40m - 153. Let s(f) be the third derivative of f*4/24 - 284f*2 + 1. What is y(s(l))? 2l*2 - 153 Let b(k) = 1214k*2. Let f(l) = -l. Let h(j) = -9j. Let x(m) = -7f(m) + h(m). Calculate x(b(y)). -2428y*2 Let u(l) = 5l + 10. Let y(t) = -t - 1. Let f(o) = u(o) + 4y(o). Let v(w) = 3w + 11. Let a(d) = -11f(d) + 6v(d). Let z(m) = -m*2. What is a(z(g))? -7g*2 Let j(t) be the third derivative of 9t5/20 + t2. Let o(l) be the third derivative of l*5/20 - 91542l*2. Give o(j(n)). 2187n*4 Let p(i) = 2i. Let t(d) = 3303208d. What is t(p(y))? 6606416y Let y(o) be the second derivative of o*4/12 + 67o - 6. Let k(j) = 6j - 47. Give y(k(q)). 36q*2 - 564q + 2209 Let k be 465180/135 + (-2)/(-9). Let f(v) = -v*2 + 3446v - kv. Let m(h) = -330h*2. Determine m(f(j)). -330j4 Let j(g) be the third derivative of g4/8 - 5g2. Let u(b) = -61b*2 - 59b*2 - 56b*2 + 175b*2. Calculate u(j(i)). -9i*2 Let c(n) = 522079n*2. Let t(g) = 236g*2. Determine c(t(s)). 29077711984s*4 Let t(c) = 142c2. Let f(a) be the third derivative of -a5/60 + 59a3/6 - 33a*2 - 1. Let u(k) be the first derivative of f(k). What is t(u(w))? 568w*2 Let i be 2 - 4 - 10/(-5). Let d(b) = -3b + 6b + ib. Let f(l) = 210l2 - 422l*2 + 202l*2. Give d(f(y)). -30y2 Let m(b) = b. Let u(d) = d2 + 76d - 5756. Determine m(u(y)). y2 + 76y - 5756 Let d(m) = -m*2. Suppose -w + 4r + 10 = 0, -r - 6 = -w - 2. Suppose 5a - 6a - x = -94, -a + 3x + 78 = 0. Let t(h) = 10h*w - 90h + ah. What is d(t(y))? -100y*4 Let b(n) = 1138n*2 + n + 242. Let d(t) = -40t. What is b(d(u))? 1820800u2 - 40u + 242 Let w(i) = -371 + 2i2 - 361 + 732 - 5i*2. Let x(r) = 1118r. Determine w(x(g)). -3749772g2 Let x(j) = 158j + 12. Let t(b) = 135b + 10. Let u(z) = 7t(z) - 6x(z). Let i(n) = 1. Let y(l) = -l - 3. Let o(f) = -12i(f) - 4y(f). What is u(o(p))? -12p - 2 Let g(s) = 9957286s2. Let l(z) = -z. What is l(g(i))? -9957286i*2 Let f(i) = i - 8. Let d(j) = -296j + 585. Let u(n) = -222n + 450. Let k(v) = 10d(v) - 13u(v). Calculate f(k(o)). -74o - 8 Let y(k) = -1263k + 1906k - 987k. Let v(z) = 7z. Determine y(v(h)). -2408h Let h(v) = -4v. Let r(u) = -2553057u. Calculate h(r(t)). 10212228t Let h = -46 + 57. Let w(x) = -11 - 2x2 - 7x2 + h. Let p(b) = -b + b2 + b. Determine p(w(k)). 81k4 Let h(m) = -12m*2 + 1625m. Let o(y) = 147y. Determine o(h(l)). -1764l*2 + 238875l Let b(q) = -q + 8. Let o be b(6). Let r(z) = 0 + 4zo + 0. Let s(a) = 4a + 1. Let c(x) = 5x2 - 20x - 5. Let d(u) = -c(u) - 5s(u). Determine d(r(f)). -80f*4 Let c(o) = 158o - 2 + 152o - 479o + 157o. Let m(x) = 61x + 11. Let n = -2 - -13. Let i(a) = nc(a) + 2m(a). Let g(p) = p*2. What is i(g(l))? -10l*2 Let b(s) = -8s + 20. Let r(y) = 13y - 32. Let q(t) = 8b(t) + 5r(t). Let d(p) = -857p*2. Give q(d(j)). -857j*2 Let f(q) = -5q*2 - 4. Let b be ((-476070)/63)/((-1)/3). Let y(n) = 22670n - 4n2 - bn + 5n2. Determine f(y(l)). -5l4 - 4 Let f(c) be the first derivative of c2 - 26. Let a = 22 + -22. Let w(v) = 2v2 - 7v*2 - 3v*2 + av*2. Determine f(w(g)). -16g*2 Let f(b) = 9b*2 + 29b + 120. Let r(d) = 11d2 + 36d + 119. Let t(l) = 5f(l) - 4r(l). Let y(o) = 2o. Calculate y(t(h)). 2h*2 + 2h + 248 Let b(s) be the second derivative of s*3/6 + 280s. Let g(c) = -43c2 + 1. Calculate b(g(q)). -43q*2 + 1 Let s(l) = 92l + 435870. Let i(q) = -3q. Calculate i(s(p)). -276p - 1307610 Let l(t) = 2t2 - 8t - 12. Let k(y) = 4y + 6. Let i(r) = 2k(r) + l(r). Let x be 9/15 + 96/15. Let d(b) = b*2 + xb*2 - 6b*2. Determine d(i(a)). 8a*4 Let l(v) = -2v*2. Let f(b) = -120b*2 + 20371b. What is f(l(y))? -480y4 - 40742y*2 Let l(k) = -55k*2 - 72k*2 - 72k*2 - 67k*2 + 269k*2. Let d(q) = 5 - 5 + 9q*2. Determine d(l(j)). 81j*4 Let k(j) = 17j*2 + 8j - 4. Let s(t) = 30t2 + 14t - 7. Let a(q) = 7k(q) - 4s(q). Let b(c) = 947c + 3. Determine a(b(v)). -896809v*2 - 5682v - 9 Let t(m) = 2m2. Let f(l) be the second derivative of -215l - 1/2l2 + 0 + 269/6l*3. Give f(t(w)). 538w*2 - 1 Let x(z) = -124z*3 - 5z2 + z - 6. Let l be x(-4). Let u(h) = h2 - lh + 7846h. Let q(c) = 10c - 1. Determine u(q(k)). 100k*2 - 20k + 1 Let v(s) = -s*2 - 10s - 5. Let x be v(-8). Suppose 9 = -2d + x. Let i(l) = -d + l + 1 + 0. Let h(u) = u - 11. Determine i(h(y)). y - 11 Let m(i) be the third derivative of -i5/60 - i3 - 602i*2. Let d(b) = 0b*2 - 2b + 2b + 2b*2. What is d(m(j))? 2j*4 + 24j*2 + 72 Let o(h) = -4h. Let y(v) be the first derivative of v5/15 - v2 - 27v + 127. Let a(b) be the second derivative of y(b). Give a(o(n)). 64n*2 Let j(g) = 22g. Let u(c) = c*2 - 2c + 1. Let o(i) = 98i2 - 294i + 147. Let s(v) = -o(v) + 147u(v). What is j(s(z))? 1078z*2 Let j(s) = -202904s + 100617s + 97656s. Let g(k) = -2k. Determine g(j(u)). 9262u Let w(f) = -57453 - 6f2 + 57453. Let k(j) = 281j - 2j2 - 281j. What is w(k(i))? -24i4 Let g(o) be the first derivative of 13o*3 + 8 - 1 - 5o*3 - 7o*3. Let d(s) be the second derivative of -19s*4/6 + 285s. What is g(d(t))? 4332t4 Let t(l) be the first derivative of -l3/3 + 1. Let g(o) be the first derivative of -156o*3 + 75o*3 + 278 + 83o*3 - 7o. Give t(g(h)). -36h4 + 84h*2 - 49 Let n(k) = -3k. Let b(l) = 21558862l. What is b(n(v))? -64676586v Let g(a) = -a. Let f(r) = 242r2 - 697246. Give g(f(i)). -242i2 + 697246 Let m(a) = a2 - 3a + 4. Let b be m(-7). Let u = -71 + b. Let x(n) = -12 + u + 9 - 10n*2. Let s(o) = -o. Determine s(x(r)). 10r2 Let a(g) = g2. Let s be 6(2 - -3 - (-7)/3). Let v(k) = -103k*2 + sk*2 - 69k*2 - 20k*2. Determine v(a(z)). -148z*4 Let w(b) = 0b + 0 + b + 3b - 19. Let o be w(6). Let j(r) = 5 + 3r - o. Let u(s) = 5s2. Determine j(u(a)). 15a*2 Let n(x) = 9x. Let z(m) = 217405 - 57m - 217405. Determine z(n(t)). -513t Let c(w) = -w*2. Let d(y) = -98607115y. What is c(d(x))? -9723363128623225x2 Let d(g) = -5g + 3. Let u(w) = 561w - 363. Let k(p) = 242d(p) + 2u(p). Let z(f) = 5f*2. What is z(k(o))? 38720o*2 Let a(p) = -p + 1074. Let u(q) = 207q. Let g(r) = -166r. Let d(y) = -5g(y) - 4u(y). Determine a(d(c)). -2c + 1074 Let k(u) = 67u2. Let t(z) = -4z*2 + 182z + 25. Give t(k(s)). -17956s4 + 12194s*2 + 25 Let l(m) be the second derivative of 20m - 1/15m5 + 0m3 + m2 + 0 + 0m4. Let r(t) be the first derivative of l(t). Let p(q) = -2q. Give p(r(v)). 8v2 Suppose 10y - 5738 = 1042. Let h(p) = -yp - 667p + 1352p. Let a(u) = 3u*2. Give h(a(z)). 21z*2 Let u(h) = 14441h*2 - 2h - 1. Let w(r) = r. Determine w(u(j)). 14441j2 - 2j - 1 Let c(z) = 1486z. Let f(x) = 3x*2 - 115x - 10. Let n(m) = 5m2 - 184m - 16. Let a(w) = 8f(w) - 5n(w). What is a(c(d))? -2208196d2 Let m(v) = -624v. Let g(l) = -189719883 + 4l + 189719883. Determine m(g(n)). -2496n Let c(p) = -11p2. Let h(n) = 64802n	{ "pile_set_name": "DM Mathematics" }
949 What is the third derivative of -2z4 + 5456z*3 - 3z*2 + 1088 wrt z? -48z + 32736 Differentiate 2262j2 - 14j - 21649 with respect to j. 4524j - 14 Differentiate -10lqz - 1658lz*2 + 2qz2 + 4qz - z2 - 453 with respect to l. -10qz - 1658z*2 Find the third derivative of 2g*6 + 452894g*5 - 2g*2 + 2g + 612569 wrt g. 240g3 + 27173640g*2 What is the third derivative of 369b*2i*3 - 2b*2i*2 - 4025bi4 + 1102833bi2 wrt i? 2214b*2 - 96600bi Find the second derivative of -29072l*4 + 4l*3s + 12250l + s wrt l. -348864l*2 + 24ls What is the third derivative of 2g*3n - 8764g3 + g2n - g*2 + 69n + 14 wrt g? 12n - 52584 Find the second derivative of -210424p*2 + 65p + 8 wrt p. -420848 Find the first derivative of 2ail2 - 61650ai - 3il2 + 159il wrt a. 2il2 - 61650i What is the second derivative of -26203g2kn2t + 21gkn2 - 2gknt - 3gk - gn - 2n2 + 6nt wrt g? -52406kn2t What is the third derivative of 392y4 - 1747y*3 + 3443720y*2 wrt y? 9408y - 10482 What is the derivative of 45443b2z - b*2 - 30b + 247z - 1600 wrt b? 90886bz - 2b - 30 Find the second derivative of 75q2u*2 + 207q*2u + 7q2 + 467qu - 1077u*2 wrt q. 150u*2 + 414u + 14 Differentiate -3175921fw - 57673w + 3 with respect to f. -3175921w What is the derivative of k*2l + 58720k2 + 19567kl wrt l? k2 + 19567k Find the third derivative of 77371q3 - q2 - 21q - 215 wrt q. 464226 What is the second derivative of -25445b2w*2 + 34204b*2w + w*4 - w wrt w? -50890b*2 + 12w*2 What is the second derivative of -16u*5 - 2u*4 - 91u*2 + 3805u - 4? -320u3 - 24u*2 - 182 Differentiate 84z3 + z2 - 10556z - 3389960 with respect to z. 252z*2 + 2z - 10556 Find the third derivative of 1709g2y3 - g2 - gy2 + 92y*3 + 212y - 136 wrt y. 10254g2 + 552 Differentiate 30114j*2 - 26131 with respect to j. 60228j Find the second derivative of 118h3k + 5h2k - 54h2 + 8hk - 2h - 2k + 10079 wrt h. 708hk + 10k - 108 Find the third derivative of 14805jk*3v - 2jkv - jk + 887j + 9k*3v + 2k2 wrt k. 88830jv + 54v What is the third derivative of -5s4w + 108s4 + 490s*3 + 3s*2w - 963sw - 2s - 5w wrt s? -120sw + 2592s + 2940 What is the second derivative of 995ln2o*2 - 3lno*2 + 32lno + 10lo*2 + 70n*2o*2 + 2no2 + 6no wrt n? 1990lo2 + 140o*2 What is the derivative of 3j*4 - 3j*3 + 156j + 116186 wrt j? 12j3 - 9j*2 + 156 Find the third derivative of -2282g*5 - 4560g*2 + 5 wrt g. -136920g*2 Differentiate 2118060a*2 + a + 3278761 with respect to a. 4236120a + 1 What is the second derivative of -20252j4 - 102j + 377? -243024j2 Find the third derivative of -203p*4w - 5342p4 + p3w - 176p2w - 6p2 + pw - 10p - w wrt p. -4872pw - 128208p + 6w Differentiate -21k*4 - 1159kp3 - 39642p*3 wrt k. -84k*3 - 1159p*3 Differentiate -31486n + 32709 with respect to n. -31486 Differentiate 1417589f2h - 8f2 - f - 35769 wrt h. 1417589f*2 Find the third derivative of 3o*5 + 3o*4p - 1060o3 - 101o*2p + 360o + 1 wrt o. 180o*2 + 72op - 6360 What is the derivative of 17053a*2 + 11859 wrt a? 34106a Find the second derivative of -c*2dh3n - 3813c2h - 3cdh3n + 2cdh2 - 17cdhn - 2hn wrt c. -2dh3n - 7626h Find the second derivative of -45190m*3u - mu + 943m - u + 5 wrt m. -271140mu What is the second derivative of 21773a3 + 46969a? 130638a What is the derivative of -26449c*2s + 2cs*2t + ct + 14479s*2t - 7s2 wrt c? -52898cs + 2s*2t + t What is the derivative of -1026q3 - 179q*2 - 679881 wrt q? -3078q*2 - 358q What is the second derivative of 3520931y2z - 1092yz + 66y - 13 wrt y? 7041862z Find the first derivative of 4060du + 129d - 39u + 1802 wrt u. 4060d - 39 Find the second derivative of -36896h*2s*2 - 174h*2s - 6h2 + 3hs2 - s2 + 2s wrt s. -73792h2 + 6h - 2 Differentiate -5709d4 + 4d*3 + 43166 with respect to d. -22836d*3 + 12d*2 Find the first derivative of -1516421d*2 - 979429 wrt d. -3032842d Find the second derivative of 2x4 - 4x*3 + 153x*2 - 36153x. 24x2 - 24x + 306 Differentiate -9w3 - 3147w + 1927189 wrt w. -27w2 - 3147 Find the second derivative of 1168305m*2u*2 + 6mu2 + 69567mu wrt m. 2336610u*2 Find the third derivative of -581564j*3 + 1093618j*2. -3489384 What is the third derivative of -1239996i*5 - 35964i*2 - 12i wrt i? -74399760i2 Find the third derivative of -2b*2s*3z*2 + 5b*2s*2z - 2b2s*2 + 390416b*2sz3 + bs*3z*4 + 201bs3z*2 + 16s*3 + 6s*2 wrt z. 2342496b*2s + 24bs*3z What is the second derivative of -24jy*5 - 90jy3 + 63jy - j - 2y - 27 wrt y? -480jy*3 - 540jy Find the second derivative of -13g*4l*2 - 24406g*2l*3 + 2gl - 451g - l*3 - 16l*2 wrt g. -156g*2l*2 - 48812l*3 What is the derivative of -202796g*3 - 251898 wrt g? -608388g*2 Find the first derivative of 40dhr*3 + 17dhr*2 - 3dr3 - 5d - 31h - 16r*3 - 168r*2 + 2r wrt h. 40dr*3 + 17dr2 - 31 Find the third derivative of 96700h*4 - 3421216h*2 wrt h. 2320800h Find the third derivative of 2665p3q + 7p3 + 43p*2q - 819p2 wrt p. 15990q + 42 Differentiate -5599f3 + 2f + 161459. -16797f2 + 2 Find the second derivative of -11884v*2 + 61772v. -23768 Differentiate 45018km - 46414k - 2 wrt m. 45018k Differentiate -2sw*4 + 74057s - 59133w4 wrt w. -8sw3 - 236532w*3 What is the third derivative of -115wx3 - wx*2 - 37x*3 - 223x*2 - 6 wrt x? -690w - 222 Find the third derivative of -3bpqz*3 - bpq - 2bpz*2 - 8bpz + bqz - 88bz*4 - 3bz2 - 429bz + 78pqz*3 + 10pqz*2 wrt z. -18bpq - 2112bz + 468pq Find the second derivative of -12306i2k*2 + 22i*2k - k*5 + 63k + 5 wrt k. -24612i2 - 20k*3 Find the third derivative of -7381k*3 + 12k*2 + 113k wrt k. -44286 What is the second derivative of -24h3 - 964h*2 - 97179h wrt h? -144h - 1928 Find the second derivative of -2b*3 + 1964349b*2z - 19bz - 49305b wrt b. -12b + 3928698z Find the second derivative of 23j*3o*2 + 3451j*3o + 2j3s + 3j2os - 3jo2s - 2o2s + 7o2 wrt o. 46j*3 - 6js - 4s + 14 What is the third derivative of -a*3x*5 - 21869a*3x4 + a3x2 + 84716x*2 wrt x? -60a*3x*2 - 524856a*3x What is the third derivative of -133o3s*2 + 46o*3s + 5348o2s + s*2 - 4 wrt o? -798s*2 + 276s What is the third derivative of 4683j4 - 7j*3 - 782j*2 + 7j wrt j? 112392j - 42 Find the third derivative of -81937a*3 + 2805649a*2 wrt a. -491622 What is the first derivative of 107127o*2v - 121209o2 - 2ov wrt v? 107127o*2 - 2o Find the third derivative of 70561h6 + 15231h*2 wrt h. 8467320h*3 Differentiate 2r*4 + 33457r*3 + 2r - 590799. 8r3 + 100371r*2 + 2 What is the second derivative of 98502k*4s2 + k3s2 - 123784ks2 wrt k? 1182024k*2s*2 + 6ks2 What is the second derivative of -c3s*2 - 100c*3s - 141c2s + 1043717cs*2 - 3cs wrt s? -2c*3 + 2087434c Find the first derivative of 25twx3 - 294tx3 + 3tx2 - 458wx3 - 109w wrt t. 25wx*3 - 294x*3 + 3x*2 What is the derivative of -33896p*2 - 43020? -67792p What is the second derivative of 3478237n2 - 114647n + 3? 6956474 What is the third derivative of 5s6t + 13774s4t - 136s2 + 42t - 3 wrt s? 600s3t + 330576st Find the second derivative of 40b3n + 17467b3 + 374bn - b + 10n - 50 wrt b. 240bn + 104802b Find the second derivative of 4a*3vx + 10a*3x*2 + 2a*3x - 33avx2 - 2avx - 2ax*2 - 364v wrt x. 20a3 - 66av - 4a Find the second derivative of 1118i2mq3 - 11i*2m - i*2q*2 + 2iq3 + 5iq - 2mq2 - 6681q*2 wrt i. 2236mq3 - 22m - 2q2 Differentiate 16016ch2 - 5chp*2 + 2cp2 + 307h*2p*2 wrt p. -10chp + 4cp	{ "pile_set_name": "DM Mathematics" }
(h(q)). 134q Let l(c) = -58204799c. Let v(t) = -5t2. Determine v(l(j)). -16938993133152005j*2 Let r = 505 - 503. Let n(y) = 6y*2 - 8y*r + 2y*2 + 4y*2. Let s(f) = -5f*2 + 10f. Calculate s(n(w)). -80w4 + 40w*2 Suppose -2g - 4k - 12 = 0, 2g - 2k - 20 = 2k. Let a(d) be the first derivative of 9 + 4d2 - 3d*g - 1 - 1. Let q(z) = 10z. What is q(a(s))? 20s Let x(v) = 197v2. Let s(g) be the second derivative of -g4/24 - 103g2/2 - 5g - 8. Let h(l) be the first derivative of s(l). Determine x(h(n)). 197n2 Let b(l) = -113l + 284l + 141l - 3. Let k be b(1). Let h(x) = -kx + 309x - 2x2. Let s(v) = -2v. What is s(h(y))? 4y2 Let s(r) = -41r + 5r + 6r + 32r. Let o(a) be the third derivative of -a4/24 - 2a*2. Give s(o(t)). -2t Let w(v) = -107v. Let q(n) = 164717n. Give q(w(k)). -17624719k Let s(t) = 7t. Suppose 0 = 6q - 203 - 331. Let c(w) = -104w - qw + 202w. Calculate c(s(g)). 63g Let w(r) = -r2 + 6. Let u(y) = -9y + 287. What is u(w(t))? 9t2 + 233 Let m(g) = -2g. Let w(l) = -4489506l2 - 74925l - 2997. Let b(d) = -5994d2 - 100d - 4. Let v(c) = 2997b(c) - 4w(c). What is v(m(z))? -23976z2 Let i(a) = -19a. Let q(m) = 69729m. Give i(q(v)). -1324851v Let o(a) be the first derivative of -a*2 + 4. Let s(m) = -2m. Let d(r) = -12r. Suppose 50 = -5i - 5i. Let b(j) = is(j) + d(j). Determine b(o(k)). 4k Let x(s) = -s2. Suppose -4j = 8, 3j + j = -5u + 7. Let w(q) = uq2 - q2 + 19q*2. Determine x(w(p)). -441p*4 Let s(j) = -6j*2 - 172. Let x(k) = -11k*2 - 301. Let y(p) = -7s(p) + 4x(p). Let t(b) = -2b*2 + 183. Give y(t(d)). -8d*4 + 1464d*2 - 66978 Let v(a) = 6a*2 - 5a. Let m(r) = 5r + 12 - 3r - 13. Let b be m(0). Let f(x) = -x*2 + x. Let n(s) = bv(s) - 5f(s). Let w(c) = 14c*2. Give n(w(d)). -196d*4 Let x(h) = 344h*2 + 167. Let k(d) = -86d*2 - 40. Let s(b) = 25k(b) + 6x(b). Let r(f) = 10f + 10f + 2f - 21f. Give s(r(g)). -86g*2 + 2 Let g(a) = -65177a. Let b(c) = 5460c. Calculate g(b(s)). -355866420s Let j(v) = v. Let w(t) = 295630376t. Give w(j(d)). 295630376d Let d(o) = -277o + 1 - 44o - 1 - 134o. Let k(u) = -2u. Calculate k(d(h)). 910h Let r(y) = -219876y. Let o(m) = 3438m. Give r(o(a)). -755933688a Let m(j) = -2j2 - 25j + 10. Let y(d) = 9d2 + 120d - 48. Let s(n) = 24m(n) + 5y(n). Let w(p) = 2p2 - 12p. Give s(w(u)). -12u4 + 144u*3 - 432u*2 Let w(p) be the first derivative of 40p3/3 - 1. Let o(j) be the third derivative of -j5/60 - 9485j2. Determine o(w(a)). -1600a*4 Let w(t) = 2 - 6t - 2 - t. Let x be (0 + -11 + 0)/1. Let o(n) = -3n2 + 6. Let s(l) = 15l*2 - 33. Let r(h) = xo(h) - 2s(h). Give r(w(p)). 147p*2 Let y(w) = -61807w - 1. Let u(p) = -1000p2. Calculate y(u(l)). 61807000l*2 - 1 Let l(r) be the second derivative of -2r*3/3 - 822r. Let q(p) = 1125p - 2. Calculate q(l(y)). -4500y - 2 Let o(h) be the third derivative of -1/10h5 + 0h + 0h4 + 0 + 0h*3 - 11h2. Let b(y) be the second derivative of -y4/6 - 112y. What is o(b(k))? -24k*4 Let x(s) = 2153s - 56. Let n(w) = -6w2 - w. Determine x(n(q)). -12918q*2 - 2153q - 56 Suppose 0 = m + m. Let p(n) = -7n + n + mn. Let t(y) = -8y2 - 7y - 119. Let q(h) = -4h2 - 4h - 68. Let b(d) = 7q(d) - 4t(d). Give p(b(s)). -24s2 Let f(u) = 14u. Let b(s) be the first derivative of s*4/6 - 98s*2 - 106. Let t(g) be the second derivative of b(g). Give t(f(w)). 56w Let c(f) = f*2 - 45. Let m(k) be the first derivative of 4k*3/3 - 3373. Give m(c(d)). 4d*4 - 360d*2 + 8100 Let y(o) = 6o + 35 + 126 - 36 - 4o. Let i(s) = 10s*2. Determine y(i(v)). 20v*2 + 125 Let d = 1 - -1. Let w(l) = 2l + 0l + dl. Let i(x) = -x*2 + 6x + 2. Let u(a) = 80a2 - 486a - 162. Let b(k) = -648i(k) - 8u(k). Give b(w(m)). 128m2 Let s(g) = -5907363g. Let h(f) = -8f. Determine s(h(l)). 47258904l Let t(z) = -z*2. Suppose 14v - 19v = -105. Let x(n) = vn + 8n + 0n + 8n + n. Determine t(x(b)). -1444b*2 Let q(n) = n + 0n + n. Suppose 2v + m = 9, -2m = 3v - 80 + 67. Let u(i) = 9i. Let a(o) = -o. Let t(k) = vu(k) + 54a(k). Give t(q(x)). -18x Let i(m) be the first derivative of -m5/60 + m3/3 - 13m*2 - 50. Let k(r) be the third derivative of i(r). Let h(x) = 63x. Determine k(h(p)). -126p Let d(s) = -s + 202. Let z(r) = 116 + 8r - 67 - 49. Determine z(d(a)). -8a + 1616 Let u(t) be the second derivative of 499t*4/6 - 3674t. Let h(x) = -3x2. Determine u(h(j)). 8982j*4 Let l(w) = 10428w*2 + 10489w*2 - 21212w*2 + 1 - 1. Let x(z) = -13z. Determine x(l(v)). 3835v2 Let j(f) = 23f2. Let d(z) be the second derivative of z6/120 + z*3/6 + 44z*2 + z - 13. Let w(s) be the second derivative of d(s). Calculate w(j(o)). 1587o*4 Let f(j) be the second derivative of 43/6j*3 + 13j + j*2 + 0. Let s(u) = u. What is f(s(t))? 43t + 2 Let c(u) = 16933420u. Let a(f) = -2f. Determine a(c(n)). -33866840n Let n(k) = 0k + 4 - 4 - 2k. Let a(j) = -285j + 55. Let z(h) = 715h - 143. Let g(x) = 13a(x) + 5z(x). Give g(n(r)). 260r Let p(r) = -205r2 + 6r - 2. Let a(o) = -2975o. Determine a(p(l)). 609875l*2 - 17850l + 5950 Let h(v) = -73v + 34v + 42v. Let i(k) = -3k*2 - 346. What is i(h(p))? -27p*2 - 346 Let x(y) = 223y2. Let c(v) be the second derivative of v4/6 - 1949v. Give x(c(j)). 892j4 Let g(m) = m2. Let n(q) = -q*2 + 7q - 4. Let z be n(5). Let x(v) = 167v - 165. Let f be x(1). Let y(b) = 11b*2 - 2b*f + zb*2. Calculate g(y(h)). 225h4 Let a(p) = -p2 + 6. Suppose 205 = 95k - 90k. Let u(n) = -20n - 20n + kn. Calculate a(u(l)). -l2 + 6 Let x(z) = 9065z. Let i(y) = -y - 33. Let r(b) = -11b - 330. Let p(l) = 10i(l) - r(l). Give x(p(g)). 9065g Let w(i) = i. Let n(y) = -37946095y*2. Give w(n(o)). -37946095o*2 Let k(w) = 664w*2. Let z(r) = 6r + 65. Let i(s) = -8s - 78. Let p(d) = 5i(d) + 6z(d). Give k(p(l)). 10624l*2 Let j(f) = 18237540f*2. Let h(q) = 5q*2. What is j(h(n))? 455938500n*4 Let o(v) = -46v*2. Let d(i) = 218280i. What is o(d(u))? -2191723286400u2 Let y(q) = -q. Let x(k) = -27k - 135k2 - 12k + 64k - 26k - 3293k2. Give x(y(l)). -3428l*2 + l Let p = 6605 - 6579. Let y(i) be the third derivative of pi*2 + 0i*4 + 0i - 1/30i5 + 0i*3 + 0. Let o(w) = 23w. Give o(y(j)). -46j2 Let b(i) = -8945821i. Let x(m) = 3m. Calculate b(x(n)). -26837463n Let f(d) = -188d2. Let g(a) = 135491a*2. Determine g(f(z)). 4788793904z*4 Let h = -153 - -155. Let y(d) = -18d + 25d - 7d + d*h. Let u(b) be the third derivative of 5b4/8 + b2. Give y(u(g)). 225g2 Let o(r) = -8591334r*2 + 36138r + 72276. Let t(y) = 951y2 - 4y - 8. Let s(d) = -2o(d) - 18069t(d). Let j(z) = 2z2. What is s(j(n))? -3804n*4 Let j(k) = 30k - 9. Let r(f) = 8 - 24f - f + 2f - 6f. Let z(n) = -6j(n) - 7r(n). Let l(y) be the second derivative of y3/3 + 96y. Give z(l(c)). 46c - 2 Let s(f) = -f + 1. Let u(j) = -j - 5. Let q(m) = -6s(m) + 3u(m). Let o(k) be the first derivative of -2k*3/3 + 1055. Calculate o(q(i)). -18i*2 + 252i - 882 Let t(g) = -5g. Let p(k) = 2466526k*2. Determine p(t(u)). 61663150u*2 Let k(s) = -737s. Let t(x) = -4x2 - 50. Let u(h) = h2 + 15. Let c(m) = 3t(m) + 10u(m). Calculate k(c(j)). 1474j*2 Let t be (5 - 3)3/21. Let x(f) = -9f + 2f + tf. Let z(h) = 11h2 + 13. Let y(r) = -5r*2 - 6. Let q(n) = -13y(n) - 6z(n). Determine x(q(m)). 4m*2 Let q(c) = -22119259c*2. Let x(h) = -2h*2. Determine q(x(i)). -88477036i*4 Let f(x) = 14x - 9x - 3x - 3x. Let o(b) = 2b + 19. Let t be o(-5). Let z(d) = 14 - 5 - t + 36d2. Determine z(f(c)). 36c*2 Let j(v) be the second derivative of 43v3/6 + v2 - 45v + 1. Let k(m) = 303m + 15. Let r(s) = -15j(s) + 2k(s). Let w(g) = g*2. Calculate w(r(d)). 1521d*2 Let m(j) = -5j. Let r(k) = -16k2 - 1 - 10 + 36k + 31 - 29. Let n(i) = -4i2 + 8i - 2. Let d(u) = -9n(u) + 2r(u). What is d(m(p))? 100p2 Let z(h) = -62h + 9. Let x(b) = -41b + 6. Let s(c) = 3x(c) - 2z(c). Let o(p) = 5761p - 2. What is o(s(n))? 5761n - 2 Let h(b) = 22b - 50b - 10 + 30b. Let u(p) = -p +	{ "pile_set_name": "DM Mathematics" }
ulate the smallest common multiple of p and d. 357 Let g be (-2 - (-310)/144)/(28/213996). Let m = -8144/7 + g. Calculate the common denominator of m and (-74)/66(-9)/(-2). 264 Let g(n) = 40 - n - 2n + 6n - 12. Calculate the smallest common multiple of 16 and g(2). 272 Suppose 0 = 3i + i - 3p - 372, -5i - 4p + 465 = 0. Let v = 250 + -247. What is the smallest common multiple of i and v? 93 Suppose 25 + 20 = -9r. Calculate the lowest common multiple of 5/(10 + r)8 and 6. 24 Suppose 0 = -5t + 20, 26 = a + 4t - 0. Calculate the common denominator of 222/(-42) - -5 - (-526)/(-1148) and ((-36)/a)/(64/(-880)). 82 Suppose 239d = -101d + 69d + 631701. Calculate the least common multiple of 2331 and d. 2331 Suppose o - 165 = 4t, -280 = -2o - 3t + t. Suppose -5356u + 5365u = -90. Calculate the least common multiple of 16 and 1 + (-312)/u + (-29)/o. 32 Let c = -1864617577/690056 - -1/86257. Let a = c - -2708. Calculate the common denominator of a and -85/192. 192 Let m = -27 + 15. Let r(g) = g + 24. What is the least common multiple of (50/(-30))/(10/(-36)) and r(m)? 12 Calculate the common denominator of (1 + 5/(-3))16/((-1920)/1635) and -125/3804. 3804 Suppose 3c = 2y - 16, 4y - c - 32 = -0y. Let o be 102475/27500 + 2/y. Let f = o + 19/275. What is the common denominator of f and -73/20? 220 Let w be 2/7 + 180/(-42). What is the lowest common multiple of (28/8)/((-7)/(-14)) and (w/(-6))/((-35)/(-21) + -1)? 7 Let l(v) = -21v + 25 + 12v + 6v. Calculate the least common multiple of l(7) and 40. 40 Let v be 2/(-2 - 0) + -28. What is the lowest common multiple of v/(-2) + (-1)/2 and (-16)/32 - -10(-6)/(-8)? 14 Let m(b) = 10b - 42. Let z be m(3). Find the common denominator of 61/8 and 1/((-44)/30) + (-18)/z. 88 Suppose 0 = 6m + 4m - 3m. Let z(o) = -12o + 2. What is the lowest common multiple of 30 and z(m)? 30 Calculate the lowest common multiple of 54/(-2 - ((-2268)/282 + 6)) and 138. 58374 Let u = -12749 + 18017. What is the lowest common multiple of 15 and u? 26340 What is the least common multiple of 3(9 + (-110)/15) and (-3)/24 + (-1250)/(-16)? 390 Let y = 48143 + -25178810/523. Calculate the common denominator of y and 149/6. 3138 Let n be ((-2)/(-18))/((52/(-10968))/(-13)). Let y = n + -3869/12. Find the common denominator of 31/10 and y. 20 Let k = 3369 + -6759/2. Find the common denominator of k and 119/7920. 7920 Let s = 7/41 + -659/738. Let x = -779439/20 + 38972. Find the common denominator of s and x. 180 Suppose n + 5z = 1002, 3z + 44 = -5n + 4856. What is the least common multiple of 174 and n? 1914 Let m = -16 + 22. Calculate the common denominator of -3 + 2 + 55/(-30) and (-4)/m(-312)/(-160). 30 Suppose 5o - 7 - 3 = 0. Suppose 34y + 3r = 35y - 29, -r - 23 = -y. Calculate the lowest common multiple of o and y. 20 Let m(z) = 2z3 - 41z*2 - 48z + 3. What is the smallest common multiple of m(22) and 21? 399 Let b = 48 + -44. Suppose -bp = p - 480. Calculate the lowest common multiple of p and 9. 288 Suppose -4u + 2k + 222 = 0, u = k - 3k + 68. Let t = 51 - u. Let g = 21 + t. What is the lowest common multiple of g and 8? 56 Find the common denominator of (-10)/65 + 1159/(-156) + 3 and 42/(-24) - 2/(-5). 60 Let r(s) = -20s + 2924. What is the lowest common multiple of 148 and r(135)? 8288 Let m(d) = 1366d. Let q be m(-1). Suppose 0 = 147s - 153s + 24. Find the common denominator of -113/12 and q/(-1044) + (-1)/(18/s). 348 Let p be 548/(-20) - (-3)/(-5). Let c be 3420/(-7931) - 12/p. Let g = c + 69131/6798. Find the common denominator of g and 23/33. 66 Let x be (132/24 - (4 + 1))-606. Let k = -291 - x. What is the least common multiple of 33 and k? 132 What is the common denominator of 660/250(9 - -1)/(6/(-2)) and 44/75? 75 Suppose -28i = -93i - 42i + 21935. What is the least common multiple of 1066 and i? 5330 Let s = -21409/8 - -2683. Suppose -20 = -78b + 79b. What is the common denominator of 2 + (15/20 - 99/b) and s? 40 Let j = -169 - -167. Calculate the lowest common multiple of 2 and (-3)/(3/j) - (2 + -2). 2 Let j = -282111593/804 + 350885. What is the common denominator of -79/28 and j? 5628 Suppose 5v + 3c = 7, -1 = 3c - 2c. Suppose 27z - 104 - 490 = 0. What is the least common multiple of z and (-8)/16 - (-13)/v? 66 Calculate the common denominator of (((-4)/(-300))/((-102)/(-18105)))/((-400)/6) and 47/4. 2000 Calculate the common denominator of 30 and (-4 + (-36615)/(-9155))(-45)/3. 1831 Let d = -941979/40 + 23552. Find the common denominator of -38/5 and d. 40 Let r = 183 + -169. What is the smallest common multiple of r and 616? 616 Let m(b) = -b + 9. Let p(g) = g - 8. Let j(y) = -2m(y) - 3p(y). Let z(h) = 706h - 9156. What is the lowest common multiple of z(13) and j(-8)? 154 Suppose -2x + 2o - 9010 = 0, 2x = -4o + o - 9035. Let t = x + 2929. Find the common denominator of t/210 - (-6)/(-15) and 125/18. 126 Let n = -1623/14 - -117. What is the common denominator of -53/1650 and n? 11550 Let n be (-91)/(-14) + -7 - 162/(-4). Let f be (10/n)/(-1 + 108). Let o = f - -24821/1284. Find the common denominator of o and -47/81. 81 Let l(v) = v*2 - v + 6. Let h be l(3). Find the common denominator of (1022/h)/(-7)-1 and -20 + 23 + (-2 - (-162)/(-32)). 48 Let z = -2/393 - 649/1179. What is the common denominator of z and (-3)/11(9 + (-232)/72)? 99 Suppose -69 = 16o - 3237. Calculate the lowest common multiple of 1188 and o. 1188 Suppose i - 4i + 4i = 0. Let s be (i - 1)-4 + 0/(-4). Suppose sn + 5 = 41. Calculate the least common multiple of n and 6. 18 Find the common denominator of 899/(-1827)(-3)/77 and -1/693. 4851 Let j = -331247/58 - -5711. Calculate the common denominator of 45/46 and j. 1334 What is the lowest common multiple of 21 and 1044/406(-147)/(-6)? 63 Let m(t) = 1. Let i(u) = -3u - 34. Let j(o) = i(o) + 4m(o). Suppose -p - b = -9, 3p - 8p - 4b + 45 = 0. What is the lowest common multiple of j(-11) and p? 9 Let m = -17968/424457 - 2/9031. Find the common denominator of m and 107/6. 282 Let b(o) = 11o*2 + o + 1. Let g = -339 - -349. Suppose -gc + 9c = -1. What is the lowest common multiple of b(-1) and c? 11 What is the lowest common multiple of 375 and ((-14)/252-6)/(-2 + (-4503)/(-2250))? 750 Let k(u) = u*2 - 5u - 12. Let b be k(-2). Suppose bt = 7 - 3. Calculate the lowest common multiple of t and 123. 246 Let u = -1463 + 399. Calculate the common denominator of (-4)/10 + -5 + u/(-180) and -77/18. 90 Suppose 2v - 84 = -4m, v - 233 = -3m - 173. Let d = 250 + -151. What is the least common multiple of d and m? 198 Suppose -22 - 8 = -3a. Let w = 298 - 280. What is the lowest common multiple of a and w? 90 Let h = -6241 - -10779. What is the common denominator of 8/(53088/h) + (-6)/14 and 65/14? 3318 Let d = -2/2652671 + 55735217/38630847773. What is the common denominator of d and -9/5? 72815 Let k be (2 - 308673) + (-5 - (4 + -8)). Let x = -182116437/590 - k. What is the common denominator of -97/16 and x? 4720 Let y = 3562 + -81910/23. Let v = 36691 - 47918449/1306. Let g = v - 41133/2612. Calculate the common denominator of g and y. 92 Calculate the least common multiple of 13398/28 - 12/(-8) and 3. 480 Let a(y) = -41 + 53 - 69y*2 + 11y - y*3 + 74y*2. Suppose 2r - 46 = 20. What is the smallest common multiple of a(-2) and r? 198 Suppose -b - 4b + 5i + 105 = 0, i + 41 = 2b. Let o(a) = -a3 + a2 + 5a - 69. Let t be o(0). Let d = t + 83. What is the least common multiple of b and d? 140 Let w be (-30(-5)/(-40))/(4/32). What is the common denominator of -43/27 and (-65)/(-15)w/162? 81 Let z = 80 + -152. What is the common denominator of (-126 - 1)12/z and (-10)/8092? 12 Let f = -2603921/21 - -123965. Let m = f + 27731/840. What is the common denominator of -1/2 and m? 40 Let h(d) = d3 - 5d*2 - 42d - 2. Let v be h(-5). Find the common denominator of -69/4 and v/(-147) - -2(-163)/896. 64 Let y = 200542/3 + -65830. Let s = y - 18371/18. What is the common denominator of (109/(-18))/1-1 and s? 18 Let x = -1843521 + 6172108187/3348. Calculate the common denominator of x and 79/465. 16740 Let v(d) = -d + 2d3 - 4d + 13d + 6 + 11d*2 - 3d. What is the lowest common multiple of 4 and v(-5)? 12 Let j(l)	{ "pile_set_name": "DM Mathematics" }
e Is 253703 a prime number? True Is 5971 a composite number? True Is 389219 composite? False Is 62459 a composite number? False Is 95813 a composite number? False Is 2149 a prime number? False Is 56299 prime? True Is 208061 a prime number? False Is 541 a prime number? True Is 60563 prime? False Is 27299 prime? True Is 47363 prime? True Is 3761 a prime number? True Is 315411 a prime number? False Is 77951 composite? False Is 39707 a prime number? False Is 3909755 a composite number? True Is 11369 a composite number? False Is 520099 a prime number? False Is 199607 composite? True Is 317887 prime? True Is 172394 a composite number? True Is 449 a composite number? False Is 63197 a composite number? False Is 1361017 a composite number? True Is 30617 a prime number? False Is 14957 a composite number? False Is 1170689 a prime number? False Is 28511 a composite number? True Is 83543 prime? False Is 101009 a prime number? True Is 79603 a composite number? True Is 1007 a prime number? False Is 37735 composite? True Is 4729 composite? False Is 1515857 a prime number? False Is 517 prime? False Is 1801 a prime number? True Is 8147 a prime number? True Is 136009 prime? False Is 122099 a prime number? True Is 12301 prime? True Is 2161 a composite number? False Is 92507 composite? False Is 49019 a prime number? True Is 8651 prime? False Is 437027 composite? True Is 35521 a composite number? False Is 26405 composite? True Is 7901 a composite number? False Is 14023 a composite number? True Is 4831 prime? True Is 3449 composite? False Is 346639 a composite number? False Is 7901 composite? False Is 7201 a prime number? False Is 12197 prime? True Is 618739 composite? True Is 3352957 composite? False Is 2503 prime? True Is 58817 prime? False Is 28738 a composite number? True Is 54973 a composite number? False Is 276841 composite? True Is 1154199 prime? False Is 3631 composite? False Is 1769281 a composite number? False Is 1305637 a composite number? False Is 39133 prime? True Is 97141 composite? True Is 116131 composite? False Is 2498971 composite? False Is 602753 a composite number? False Is 1022167 prime? True Is 716327 a prime number? False Is 15343 prime? False Is 7393 composite? False Is 809 composite? False Is 2076791 a prime number? True Is 30283 a prime number? False Is 245963 prime? True Is 686197 a composite number? False Is 38113 a prime number? True Is 145994 prime? False Is 21283 a composite number? False Is 18743 a prime number? True Is 403099 prime? False Is 785383 a composite number? True Is 6117 a prime number? False Is 189841 prime? False Is 50741 prime? True Is 1744007 a prime number? True Is 17201 a prime number? False Is 24657 composite? True Is 153607 a composite number? False Is 8641 a composite number? False Is 274441 composite? False Is 2309 prime? True Is 37753 composite? True Is 12895 a composite number? True Is 265079 prime? True Is 33997 prime? True Is 7981 a prime number? False Is 156481 a composite number? True Is 18623 a prime number? False Is 19529 prime? False Is 3949 a composite number? True Is 5731 composite? True Is 153247 composite? False Is 64982 composite? True Is 16049 composite? True Is 1477 a composite number? True Is 1739 a prime number? False Is 63741 a composite number? True Is 279691 a prime number? False Is 61441 a composite number? False Is 28261 prime? False Is 30059 a composite number? False Is 118029 prime? False Is 49561 a composite number? True Is 1039 a composite number? False Is 11027 a prime number? True Is 14179 prime? False Is 248573 a composite number? True Is 5167587 composite? True Is 3459029 prime? False Is 46073 a prime number? True Is 1963187 composite? False Is 126199 composite? False Is 40519 a prime number? True Is 277477 a prime number? False Is 34057 prime? True Is 5328217 a composite number? False Is 1177493 a prime number? False Is 15031 prime? True Is 670471 a prime number? True Is 294629 a composite number? False Is 56299 a composite number? False Is 4258 a composite number? True Is 162209 a composite number? False Is 11177 a composite number? False Is 81709 composite? True Is 14583 a composite number? True Is 278387 a composite number? False Is 10237 composite? True Is 29917 composite? False Is 282757 a composite number? True Is 632959 prime? False Is 8677 composite? False Is 1116809 a prime number? True Is 99967 a composite number? True Is 18155 prime? False Is 160967 a composite number? False Is 67047 prime? False Is 1906 a composite number? True Is 1873331 composite? True Is 83531 a prime number? False Is 91909 a composite number? False Is 750377 a composite number? True Is 13231 composite? True Is 1181 a composite number? False Is 21 prime? False Is 19347 prime? False Is 102013 composite? False Is 929 a composite number? False Is 46753 prime? False Is 12661 prime? False Is 199559 prime? True Is 39099 a prime number? False Is 84809 a composite number? False Is 177091 a composite number? False Is 9521 composite? False Is 39523 a prime number? False Is 38897 composite? True Is 2897 composite? False Is 81749 a prime number? True Is 381 composite? True Is 51411 composite? True Is 13885 prime? False Is 1889 a composite number? False Is 3643 prime? True Is 958 composite? True Is 24554 a prime number? False Is 56263 composite? False Is 8549 a prime number? False Is 9763 a composite number? True Is 1244729 a prime number? True Is 87773 composite? True Is 2025689 a composite number? False Is 10259 a composite number? False Is 102359 a composite number? False Is 1119947 a composite number? False Is 56891 a composite number? False Is 78341 a composite number? False Is 27791 composite? False Is 5601 a composite number? True Is 385967 a composite number? False Is 4201 a prime number? True Is 59141 prime? True Is 28277 a composite number? False Is 124633 a prime number? True Is 56237 a prime number? True Is 10441 prime? False Is 824155 prime? False Is 4467 a prime number? False Is 105217 a composite number? True Is 59431 a composite number? True Is 21433 a prime number? True Is 8609 a prime number? True Is 965629 a composite number? True Is 42511 a composite number? True Is 3433 a composite number? False Is 26311 composite? True Is 117677 composite? True Is 439273 composite? False Is 8651 prime? False Is 5914 a prime number? False Is 35771 a prime number? True Is 91209 a composite number? True Is 488731 prime? False Is 689551 a composite number? False Is 6007 a composite number? False Is 249943 a prime number? True Is 8561 composite? True Is 139423 prime? True Is 290698 a composite number? True Is 7373 a prime number? False Is 47327 prime? False Is 239929 a composite number? False Is 2210881 composite? False Is 3557 prime? True Is 6769 composite? True Is 111845 a composite number? True Is 274579 prime? True Is 53453 prime? True Is 65867 composite? False Is 2985365 prime? False Is 399353 a composite number? False Is 830729 prime? True Is 70823 composite? False Is 1877609 composite? False Is 8674 a prime number? False Is 105583 prime? False Is 1511 a composite number? False Is 213677 a composite number? True Is 6353 prime? True Is 995003 prime? False Is 55163 a composite number? False Is 403181 a prime number? True Is 735133 composite? True Is 45641 prime? True Is 147481 prime? True Is 26309 a prime number? True Is 390361 prime? False Is 2179 prime? True Is 33595 a composite number? True Is 458729 prime? True Is 154891 prime? False Is 482939 a composite number? True Is 1635889 a composite number? False Is 78823 composite? False Is 8939 prime? False Is 19297 a prime number? False Is 49081 a prime number? True Is 33541 composite? True Is 8419 prime? True Is 6295 composite? True Is 4429 a composite number? True Is 5667 composite? True Is 981227 a composite number? True Is 630659 a prime number? True Is 15907 composite? False Is 195677 composite? False Is 694 a prime number? False Is 92581 a composite number? False Is 64979 prime? False Is 391243 a composite number? True Is 422 composite? True Is 124841 a composite number? True Is 4645 prime? False Is 37781 a composite number? False Is 641279 a prime number? True Is 48641 a composite number? True Is 33109 a composite number? True Is 268091 prime? True I	{ "pile_set_name": "DM Mathematics" }
cnt*2 + 2nt3 wrt c. 6cn + 18c - 6n + 4t*3 What is the derivative of 17i*3 + 28i + 11270? 51i2 + 28 What is the second derivative of -507h*3r2 - h2r3 + 170hr + r3 - 2r*2 wrt h? -3042hr2 - 2r*3 What is the third derivative of -307g*3x*3 + 38g*3 - 2x*2 + x wrt x? -1842g*3 What is the third derivative of -843r*4 - 3r*3 + 4r*2 + 2r + 323 wrt r? -20232r - 18 What is the second derivative of 7f*2v*3 - 1152f*2 + 33v*3 + 2v wrt v? 42f2v + 198v What is the third derivative of 247w*6 + 59w*2 - 3 wrt w? 29640w*3 Find the first derivative of 3h*3iv3 + 103h*3iv - 3h*3v*3 - 7h*3v2 - h3 wrt i. 3h3v*3 + 103h*3v What is the second derivative of -92b3s2 - b3s + 4b*2s*2 + 2bs2 + bs + 29s - 6 wrt s? -184b*3 + 8b*2 + 4b What is the derivative of 90k + 773 wrt k? 90 Differentiate 1006dhm*3 + 548dm3 + dm*2 - hm*3 wrt h. 1006dm3 - m3 What is the third derivative of -5h*3n*3z + 210h3nz + h2n*3 - 3h*2n*2z + 2h2z - 83n wrt h? -30n*3z + 1260nz Differentiate 96c4 + 55. 384c*3 What is the first derivative of -24703w - 9644 wrt w? -24703 What is the third derivative of 3928z6 + 163z*2 - 3z wrt z? 471360z3 What is the derivative of -53t*4 + 78t + 6776 wrt t? -212t3 + 78 What is the third derivative of -463g*3v*3 - 4g*2v + 13v3 wrt g? -2778v*3 Find the third derivative of -1640c*5 - 1610c*2. -98400c*2 Find the second derivative of 9j*5u3 + j5 + 4ju*3 - 12ju + j wrt j. 180j*3u*3 + 20j*3 Find the second derivative of 702v*5 - 5v*4 + 210v - 19. 14040v3 - 60v*2 Find the third derivative of 5466w3 - w2 - 170w + 3. 32796 Find the first derivative of -100h*3o4 - h3 - 4h2o*4 + 444 wrt o. -400h*3o*3 - 16h*2o3 Find the second derivative of -a3l2 - a3 - 30a*2l*2 + 70a*2l wrt l. -2a3 - 60a*2 Find the first derivative of -60c*2d - 5c2r + 2cd - dr - 16d - r wrt c. -120cd - 10cr + 2d What is the third derivative of -1055l*3 + 7667l*2? -6330 What is the derivative of -2d*2o + 52d2 + 9o wrt o? -2d2 + 9 Find the third derivative of -226f6 + f4 + 649f2. -27120f*3 + 24f Differentiate 1985h - 2291 with respect to h. 1985 What is the third derivative of 15125z3 + z2 - 3z + 175 wrt z? 90750 Find the third derivative of 45u*4w + 41u3w*3 - 2u*2w*3 + 7u*2w*2 - 3u*2 wrt u. 1080uw + 246w*3 What is the second derivative of 668v*2 + 240v + 2? 1336 Find the second derivative of -126i5k2 + i2k3 + ik*2 - 51k*3 + k wrt i. -2520i*3k*2 + 2k*3 Find the second derivative of 14598l*5 + 10434l. 291960l3 What is the second derivative of -2759b*4 - 4481b? -33108b2 What is the third derivative of r3t2 + r3tv - 5r3v - 87r2 - 9rt2v + 2t2v wrt r? 6t2 + 6tv - 30v Find the third derivative of 12fu*6 - fu*5 - 2fu2 + 13f + u*3 wrt u. 1440fu3 - 60fu2 + 6 What is the first derivative of -3ax3 + 7ax2 - 730x*3 wrt a? -3x*3 + 7x*2 What is the third derivative of 381k*3 + 26k*2 + 3k? 2286 What is the third derivative of -27q4 - q3 - 2q*2 - 6q wrt q? -648q - 6 What is the second derivative of 10o*4 - 73o*3 - o + 60? 120o*2 - 438o Find the second derivative of -5h2u*3 - 178h*2u - 2u4 - 4u*3 + 25u wrt u. -30h2u - 24u2 - 24u Find the second derivative of 8jn*3r*2 - jn*3r + 5jn*3 - 64jn2r*2 - 6jnr - 10n3 wrt r. 16jn3 - 128jn2 What is the third derivative of -263t*4 + 2t*3 + 9t*2 + 2t + 13? -6312t + 12 What is the third derivative of -9ao5 + ao*3 - 690ao2 + 5o*5 wrt o? -540ao2 + 6a + 300o2 What is the second derivative of 2tw2 + tw - 19w2 - 79w wrt w? 4t - 38 What is the first derivative of -31j*2 + j - 180 wrt j? -62j + 1 Find the third derivative of -1768o3 + 628o*2 wrt o. -10608 Differentiate 40f*2 - 531 wrt f. 80f Differentiate -88r + 232. -88 Find the second derivative of 2j*4 + 2j*2 + j + 74. 24j*2 + 4 Find the third derivative of -3fgh*3 - 4fgh + 3656gh*3 + 13gh2 - 6gh wrt h. -18fg + 21936g What is the first derivative of -2761y4 - 1317 wrt y? -11044y*3 What is the third derivative of 611z4 + z2 - 59z? 14664z Find the third derivative of -93o4 + 117o*2. -2232o Find the first derivative of -2blt2 - 11bt2 - 2lt - 35t*2 wrt b. -2lt2 - 11t*2 What is the first derivative of 27j*2 - 3j - 225? 54j - 3 What is the third derivative of -3a*6 - 40a*5 + 2a*2 + 143? -360a*3 - 2400a*2 What is the derivative of -237o*4 - 64 wrt o? -948o*3 What is the first derivative of 110h*3 + hv + 6h - 1293v - 1 wrt h? 330h2 + v + 6 Find the third derivative of -14b*4s*3 + 625b*3s + 4329b2s*3 - 2bs3 wrt b. -336bs3 + 3750s Find the first derivative of -5a2 + 675a - 9426. -10a + 675 Find the second derivative of j5o*3 - 88j*2o*3 + jo*3 - 110j wrt j. 20j3o*3 - 176o*3 What is the derivative of 22a*3 + 14ar + 325r + 1 wrt a? 66a2 + 14r Find the third derivative of 3fh*2 + 11fhw*3 + 5h*2w*3 + 5h*2 - 2hw3 + hw*2 wrt w. 66fh + 30h*2 - 12h What is the first derivative of 5rw - 57r - 3w - 3 wrt w? 5r - 3 What is the derivative of -329o + 479? -329 What is the third derivative of 77a3b*2 - 5a*3b + 4a2 + 21ab2 wrt a? 462b*2 - 30b Differentiate -110t3u*2 - 172t*3 - 4t*2u*2 with respect to u. -220t*3u - 8t2u Find the second derivative of -7653a3 - 340a + 1. -45918a Differentiate -356t*2x*4 + 221t*2 - 2x*4 - 1 wrt x. -1424t*2x*3 - 8x*3 What is the first derivative of 6hiq*3 - 2hiq*2 - 9hq3 + 10iq - 3q*3 + 10 wrt h? 6iq3 - 2iq2 - 9q*3 Find the first derivative of -3k*2r*2s2 + k2 + 863r4s + 1726s2 wrt r. -6k*2rs2 + 3452r*3s What is the third derivative of -3283j5 - 7j*2 - 109 wrt j? -196980j*2 What is the derivative of 112m*3 - 5m - 6455? 336m2 - 5 Find the third derivative of 11709h*6 - 12183h*2. 1405080h*3 What is the derivative of 2hpst2 - 4hst*2 - 5hs + 12ps + 5pt2 + 2st2 wrt h? 2pst*2 - 4st2 - 5s Find the third derivative of 9148x3 + 2x*2 + 1491x + 1. 54888 Find the second derivative of 7430j4 - 118j - 2 wrt j. 89160j2 Find the first derivative of i4 + 85i*2 + 245. 4i*3 + 170i Find the second derivative of 2g3r*4 + 8g*3r*3 - 39g*3r + 2r2 wrt r. 24g*3r*2 + 48g*3r + 4 Find the second derivative of -18673n2 - n + 2141 wrt n. -37346 What is the third derivative of -k6p*2 + 119k*3p2 - k2p2 + 10p*2 wrt k? -120k*3p*2 + 714p*2 Find the second derivative of -408d*4 + 2d + 293. -4896d2 Differentiate -3fv3x - 2fv*2x + 8fv*2 + 25fx + f + v3 with respect to x. -3fv3 - 2fv2 + 25f What is the second derivative of -3b3z*3 + 83b*3z*2 - 2b*3z + 16bz - 6 wrt z? -18b3z + 166b3 What is the third derivative of 5b*4q - 7b4 - 2b*3q + 20b3 - 45b*2 + 7q wrt b? 120bq - 168b - 12q + 120 Find the second derivative of 14457d3 - 4045d - 1. 86742d What is the first derivative of -41m*3s - 2m2s*2 + 2ms + 49s*2 wrt m? -123m*2s - 4ms*2 + 2s What is the first derivative of -737y4 + 3y - 7757 wrt y? -2948y3 + 3 Find the first derivative of -2150gr2 - 1117r*2 wrt g. -2150r*2 What is the first derivative of 844f*4 + 235 wrt f? 3376f*3 Find the second derivative of -5d*5 + 8d*2 - 1350d. -100d3 + 16 Find the second derivative of 3072x*2 + 7047x. 6144 Find the second derivative of 12jp*3 + 55jp2 + 7jp - 154p wrt p. 72jp + 110j What is the second derivative of -15p*4q + 35p2q*2 + 234pq2 wrt p? -180p*2q + 70q2 What is the first derivative of c3k*2m + 2531c3k2 + c2m - k2m - 24m wrt m? c3k2 + c2 - k*2 - 24 What is the first derivative of -362js2 - 287j wrt s? -724*j	{ "pile_set_name": "DM Mathematics" }
ue Suppose -386z = -389z + 33. Let y(h) = 3h3 - 6h*2 - 2. Is y(z) prime? False Let k(q) = 114q*3 + 17q*2 + 226q - 111. Is k(14) a prime number? True Let x(u) = 11u - 6. Let h be x(1). Is (-78)/130 - (-15818)/h prime? True Suppose 5v = 3z - 6105, -2z + v = -4z + 4057. Let f = z - -1329. Is f prime? True Is 30745 - (56/10 + 64/160) a composite number? True Suppose 2g - 949458 = 1201o - 1207o, -3o + 2g + 474747 = 0. Is o a composite number? True Let m(w) = w*3 - 26w*2 + 27w - 50. Let k be m(25). Let g(x) = 25x + 8751. Is g(k) prime? False Suppose -4z - 3g = 14 - 34, 2z - g = 0. Suppose -3n + 5x = -6, -8n + zx = -7n - 2. Is (-1)/((-3198)/1598 + n) a prime number? False Is (0 + -35)2694448/(-3248) composite? True Let g = -3 + 14. Suppose -3b = g + 1. Is (22/b - -4)-358 composite? True Let g = -6 + 6. Suppose -f - b + 51 = -80, 5f = 4b + 673. Suppose gs = 7s - f. Is s composite? False Let y = 870709 - 545528. Is y composite? False Let o(w) = 7w - 23. Let d be o(4). Suppose 6z = dz + 2101. Is z prime? False Let c(y) = -13y - 6. Let m be c(-6). Let s = m - 65. Suppose 859 = j - 5o, -10 = 2o - so. Is j a prime number? False Let x be (1 - 3)1/(-2). Let k be (-3)/(-5)(6 - x). Suppose -c = -kn - 0n - 100, 4n - 405 = -5c. Is c prime? False Let y be 10/4(-13)/(455/(-14)). Is -2 - -641 - ((-14)/y)/7 a prime number? True Let j(i) = -81i3 - 15i*2 + 11i - 39. Let n be j(-8). Suppose n + 33678 = 11m. Is m a prime number? True Let m(c) = -2047c*3 + 14c*2 + 10c + 11. Is m(-2) a prime number? False Suppose -47976970 + 142096093 = 357v. Is v a composite number? True Is ((-14 - -204821) + -2)/1 a composite number? True Let q(i) be the third derivative of -i6/120 - i5/60 + 5i*4/12 + 7i*3/6 - 19i*2. Is q(-6) a composite number? False Suppose f + 15 = -2g, f - 5g + 4g + 3 = 0. Let a(s) = -s*2 - 9s - 4. Let k be a(f). Suppose -9t = -kt + 719. Is t a composite number? False Suppose -2v - 13 = -3v - 2i, 2v + 5i - 31 = 0. Suppose vn - 116430 = -7n. Is n composite? True Suppose 2r - 4d + 16 = 3r, 0 = -2d. Suppose 3t + 21b = rb + 1432, 4t - 1915 = -b. Is t prime? True Suppose 5p + g - 522642 = 0, -4g + 522607 = 5p - 8g. Is p a composite number? False Is (3 - ((-4 - -3) + 10)) + 352668/12 composite? False Let l = -83208 - -246311. Is l a composite number? True Let s = 4014 + 44. Let y = s - -2073. Is y a composite number? False Let j(i) = 1025i - 90. Let k be j(6). Let f = k - -4487. Is f prime? False Let m = 10693 - -12042. Is m prime? False Let p be (-1)/(-35/240). Let k be 2/(-4) - (-1160)/p. Let l = k + 167. Is l a prime number? True Let x = 72636 + -49715. Is x a prime number? True Let n = -13276 + 28665. Suppose 0 = -u - 10u + n. Is u prime? True Let j(b) = 47b2 + 393b - 869. Is j(90) a composite number? False Let p(a) = 12a2 - 9a + 46. Let x = -68 - -75. Is p(x) a composite number? False Suppose -2u - 4u = 174. Let b = u + 43. Is 4/b + -3 + 9160/35 a composite number? True Suppose -4o = -o - 3l - 7257, -4o + l = -9676. Let w be 6/(-3) + (-5 + 2 - -5). Suppose t + o = 3j + 5t, w = -j - 2t + 805. Is j prime? True Let s(m) = 140m - 9. Let w be s(-6). Let y = w + 1821. Suppose -174 + y = 6t. Is t a prime number? False Suppose 37v + 84 = 43v. Suppose vj + 353 = 15j. Is j a composite number? False Let p(n) = -4n + 275. Let u(h) = h + 2. Let b(z) = -p(z) - 3u(z). Let x be b(0). Let d = x - -1348. Is d prime? False Let k(m) = -m*3 - 8m*2 - 4m - 2. Let p be (26/39)/((-4)/(-30)). Let g be -6 - -1 - 20/p. Is k(g) prime? False Let u = -23679 + 30484. Is u composite? True Let q = -218 + 517. Let c = 801 - q. Is c a prime number? False Let n(i) = -12601i - 17. Let b be n(-3). Is 1/(-1) + b/2 + 3 composite? True Let w = -30684 + 78587. Is w a prime number? True Is (56 - -579337) + (62/8 - (-9)/36) a composite number? True Suppose -46y + 5650657 = 76y - 1815377. Is y prime? False Suppose 0 = m - 2p - 13, 76 = 2m + 2m - 2p. Is (m + -4)/(1/7) composite? True Let f be 21/8 + (-48)/(-128). Suppose fj - 1057 = 1604. Is -3 + 3 + j + 0 composite? False Let x(f) = 253318f2 + 14f + 3. Is x(-1) a prime number? True Let n(f) = 4532f + 37. Let g be n(6). Suppose -20b - 2049 = -g. Is b prime? True Let l be (-28)/(-21) + (0 - 0). Let p(u) = -6 + 2u*2 + 13u + 1 - 6. Is p(l) prime? True Let o be ((-140)/42(-99)/(-5))/(-2). Suppose -30c + oc = 3369. Is c a composite number? False Let d(u) = u2 + 17u - 79. Let g be d(4). Suppose 2f - 20573 = gk, 11k - 20583 = -2f + 6k. Is f a composite number? False Let p(q) = -2 + 0 + 3018q + 9455q. Let u be p(-2). Is u/(-16) + 1/(-4) a prime number? True Let n be 9/2((-15)/(-9) - 1). Suppose nl - 9 = -3. Suppose 2p - 738 = -2i, -lp = p + 2i - 1111. Is p composite? False Let a(i) = 8i - 20. Let p be a(4). Let m be 4/p + 0 - 481/3. Let h = 453 + m. Is h a composite number? False Let u(l) = -l - 2. Let f be u(-2). Suppose 2n = 120 + 6. Suppose 2h = 2w + n - 19, 3w + 9 = f. Is h a composite number? False Let z(h) be the second derivative of h*4/12 + 191h*3/6 - 3h*2/2 + 22h. Let c(f) be the first derivative of z(f). Is c(0) composite? False Let t(j) = 54j - 70. Let d be t(-6). Let x = 237 - d. Is x prime? True Let x(g) be the first derivative of 24g5/5 + g4/12 + g*3/2 - 5g*2/2 - 7g + 12. Let m(y) be the first derivative of x(y). Is m(3) composite? True Let f = 218268 - -325655. Is f composite? True Suppose 179107 = 4u + 3i - 61965, 4u + 5i - 241064 = 0. Is u composite? False Let a be (0 + 1 - 2)-11. Suppose 67 = 2t - a. Suppose 3r = 45 - t. Is r prime? True Suppose -33g = 164g - 19725807. Is g a composite number? True Suppose -1097v - 4o - 60066 = -1099v, 4o = -24. Is v prime? False Suppose -17p - 75880 + 232909 = 0. Suppose -2l + a = -p, -5l + a = -10705 - 12395. Is l prime? True Suppose -26 = 4p - 5u + 13, 5u + 3 = -3p. Is p/(-4)56686/633 a composite number? False Suppose 0 = -q + 24149 + 26244. Suppose 0 = 15x + 8x - q. Is x prime? False Suppose -7o + 25 = -2o. Suppose 4q = or + 10, -8r + 5q = -4r + 8. Let g(b) = -330b - 1. Is g(r) prime? True Suppose 75w - 1966349 - 1088476 = 0. Is w a composite number? True Let b(y) be the third derivative of 1223y*4/24 + 3y*3 + 12y*2. Let w be b(10). Is 4/(-22) + w/88 a prime number? True Let i be (-2)/((-24)/(-3860))(-36)/12. Suppose -964h + ih = 1139. Is h a composite number? True Suppose 0 = -4s - s + 5u + 58265, 0 = 4s - u - 46609. Suppose 4a - s = 5m - 2m, 0 = 5a - 3m - 14562. Is 2/6(-8)/((-16)/a) a composite number? True Suppose -2a + a - 5o - 16 = 0, 0 = 2o + 8. Let b be (-596)/8 - (-6)/a. Is b/(-1) - 3/(-31) composite? True Let c = -53 - -56. Is c + -2 - -3 - (5 - 998) composite? False Let m be -5 + (-132)/(-28) + (-3257)/(-7). Suppose -3t - m = -2331. Is t a prime number? False Let s(o) = 443o3 + 2o*2 + o - 4. Let a be s(2). Let m = a - -11814. Is (-6)/(-10) + m/10 a prime number? False Let m(j) = 36j*2 - 11j - 11. Let o be m(-1). Suppose -109895 = -oq + 5q. Is q a prime number? False Let l(s) = -42s2 + 6 - 5 + 10s + 132s2 + 20s*2. Is l(8) a prime number? True Suppose 8161g - 8131g + 51960 = 0. Suppose 4z - 24472 = -4. Let t = g + z. Is t a composite number? True Suppose -26521 = -22f + 149127. Suppose 8g - 8440 = f. Is g prime? True Let j = 41638 - 24861. Let d = j - 11253. Suppose -37r + 33r = -d. Is r composite? False Let a(m) = m*3 + 17m*2 + 5m - 39. Let c(t) = -t*3 + 16t*2 - 7t - 25. Let q be c(15). Let o = 81 - q. Is a(o) prime? True Let a(h) be the third derivative of 9h4/8 - 28h*3/3 + 202h2. Is a(5) a composite number? False Let y(g) = g2 - g - 42. Let a be y(-6). Suppose -2c = -2 - 8. Suppose ah + 3x - 683 = -2h, -h = -cx - 309. Is h prime? False Let t = 1459379 - 1003752. Is t composite? False Suppose -2z = -2v - 42, -7z + 2z = 2v - 112. Suppose -zi = -18i - 11476. Is i a composite number? True Suppose -11l + 846483 = 46418 - 15486. Is l a prime number? False Let m(j) = -31j - 11. Let d(k) = -30k - 11. Let a(z) = -2d(z) + 3m(z). Let r be a(-3). Let t = 71 + r. Is t prime? False Suppose -a = 3, 2x + 3*x +	{ "pile_set_name": "DM Mathematics" }
). Let m be 2/(-6)w-3. What is the biggest value in m, k, -0.3? -0.3 Let n(i) = -i*3 + i - 1. Let b be n(-2). Suppose 3w + 55 = 8w. Suppose -w - 14 = bj. What is the third biggest value in -0.2, 1, j? j Let u = -22 + 15. Let h = -7.6 - u. Which is the second smallest value? (a) 4 (b) -5 (c) h c Let p = 173 - 1214/7. What is the third smallest value in 5, -0.6, p? 5 Let c be (4/252)/((-1)/5). Let f = -2/9 - c. What is the third smallest value in -1, f, -4/5? f Let o be (-11)/5510/(-14). Which is the second biggest value? (a) 4 (b) 2/63 (c) o c Let k = 211/4 + -337/4. Suppose -4i - 4m - 143 = m, 2m = 4i + 122. Let q = k - i. Which is the third smallest value? (a) -0.3 (b) -1 (c) q c Let q = -0.04 - -5.04. Let c = -9 + 9.3. What is the second biggest value in c, q, -0.2? c Suppose 4l + 9 = -11. Let s = -7 - -4. What is the second smallest value in 2/5, s, l? s Let x = -126 + 122. Which is the third smallest value? (a) 5 (b) -9/4 (c) x a Let h = 2/181 - -348/1267. Let c = -0.2 - -0.1. Let y = c + -0.1. What is the biggest value in y, 1, h? 1 Let y = -2755/16 - -172. Let o = -11/16 - y. Let g = 1.2 + -0.2. What is the third biggest value in -2, g, o? -2 Let f = -8 - -14. Suppose -5a - 2g - 15 = 0, -2a + fg + 18 = 2g. What is the second biggest value in 0, 5, a? 0 Let n = -3 + 2. Let l = -16 - -17. What is the biggest value in l, 1/4, n? l Let k be -3 + 0 - 23/(-7). Let l = -0.07 - 0.03. Let q = 0 + l. Which is the smallest value? (a) q (b) k (c) 1 a Let y = -16/8095 - -2237212/1513765. Let m = -22/17 + y. Which is the second smallest value? (a) 4 (b) m (c) -2 b Let f = 41.5 - 41.4. Let k = 0.03 - -0.37. Let t = k + -3.4. Which is the third smallest value? (a) 3 (b) t (c) f a Let c = -21/8 + 41/8. What is the second biggest value in 0.2, c, -2, -1? 0.2 Let s = 0 - 0. Let g = s + -0.1. Let y = 0.4 + -0.1. What is the smallest value in -0.5, y, g? -0.5 Let g be 4/5(-12)/(-16). Let z be 2/(-11) + 3 - 3. Which is the third smallest value? (a) z (b) g (c) -3 b Let w = -24.6 - -25. What is the second biggest value in 1/5, -1/7, w? 1/5 Let s = 1431/82 - 35/2. Which is the third biggest value? (a) s (b) -2/5 (c) -2 c Let a = -382/5 + 76. What is the biggest value in 4, 4/7, 0.1, a? 4 Let m = -126 - -507/4. Let t = -66 + 65.9. Let h be (3 - 2)/54. What is the smallest value in m, t, h? t Let f = -0.5 + 1. Let n = 0.9 + 0.1. What is the third smallest value in n, -3/4, f? n Let v = 2/89 - -253/623. Let m be 2/7 - (-18)/378. Let z = 2.15 + -0.15. What is the third biggest value in m, v, z? m Let r = 6.6 - 3.9. Let d = r + -2.5. Which is the second smallest value? (a) -1/6 (b) 3/4 (c) d c Let z = 12 - 12.8. Let o = z - 2.2. What is the biggest value in o, -0.3, 0.2? 0.2 Let n = 2/17 + 28/51. Let z = -0.6 - 2.4. What is the biggest value in n, -0.1, z? n Suppose -p = 4p - 5c + 35, -3c + 13 = -p. What is the third biggest value in 3, 2, p? p Let s = 222/3967 + 15951944/59505. Let c = s - 268. What is the third biggest value in c, 5, -0.5? -0.5 Let r = -0.04 - 0.76. Let l = r - -1. Let z be (-1)/28 - (-3)/(-12). Which is the third biggest value? (a) l (b) 2/9 (c) z c Let x = -9.21 - -0.21. Let n = 1.3 + 8.1. Let i = n + x. Which is the third smallest value? (a) -3 (b) i (c) 0.5 c Let u = 0.05 + 2.95. Let p = 0 - u. Let j = -19 + 22. What is the third biggest value in -4, p, j? -4 Let r = -37.5 + 37.6. Suppose 3q = 3f, 2q - f + 1 = -2. Let p = q - -7. What is the third biggest value in r, -4, p? -4 Suppose 0 = 2r - 7r - 55. Let i = r - -16. Let j = -2 - -4. Which is the third biggest value? (a) i (b) j (c) -0.5 c Let d be ((-8)/3)/(4/(-30)). Suppose 4h = -3g - g - d, -3 = g. Let s = -10/39 + -155/156. Which is the second biggest value? (a) 0.4 (b) s (c) h b Let t be (-7)/22 + 1/2. Let f be 45/280(-7 + 1). Which is the third smallest value? (a) f (b) 1/3 (c) t b Let s(z) = 4z3 + z2. Let r be s(-1). Let f = 0.5 + -0.4. Which is the smallest value? (a) 0.5 (b) r (c) f b Let t = 5.84 + 0.16. Let i = 6.8 - 1. Let s = i - t. What is the third smallest value in 1, 0, s? 1 Let t = 3.988 - -0.012. What is the third biggest value in -1, 0, t, -1/25? -1/25 Suppose 10 + 0 = 5m. Let x = 4.5 - 5. What is the smallest value in -3, x, m? -3 Let k = 64 + -62. Which is the second smallest value? (a) 4 (b) 1/3 (c) k (d) -0.4 b Let g = -0.02 - -0.02. What is the smallest value in -3, -4, g? -4 Let u = 7.065 + -0.065. Which is the third smallest value? (a) -0.2 (b) u (c) -0.1 (d) 0.2 d Let b be (-1)/(-2) - 417/42. Let p = b - -10. What is the second biggest value in p, -2, 4? p Let j = -53.1 - -53. Which is the second smallest value? (a) j (b) 4 (c) 0.54 c Let k = 989480 - 565978. Let v = k - 5510035/13. Let t = v + 347. Which is the second smallest value? (a) -1/5 (b) 0 (c) t b Let t = 0.38 - 0.78. Which is the biggest value? (a) -3/2 (b) -2/7 (c) 6/7 (d) t c Let f = -9 - -6. Let l be (2 - (1 - -1))/(-1). Let d be 6/5 - (1 + l). What is the second biggest value in -4, f, d? f Let p = 78.2 - 72. Let x = 6 - p. Let k be 0 + -3 + (-3 - -2). What is the second smallest value in k, -2/5, x? -2/5 Let n be 24/33 - (1 - -1). Let t = n + 111/44. Let w(o) = -o3 - 5o*2 + 5o - 7. Let y be w(-6). What is the third biggest value in y, t, 3? y Let m = 1.62 + -0.62. Suppose -2 = -2c + r, -6 = c - r - 3r. Suppose -10 = 3h + cq, 4h + 2q = -0 - 10. What is the biggest value in 2, h, m? 2 Let d = 6.4 - 6.5. What is the smallest value in d, -1/5, -0.4? -0.4 Let v = -118 + 113. Which is the fourth smallest value? (a) -1 (b) 0.2 (c) v (d) 2 d Let k be (-4)/(-10) + (-20)/175. Let t be 1/5 + (-155)/25. Let s = -10 - t. What is the second biggest value in k, -3, s? -3 Suppose 3v + 14 = 2. Let t be v/(-12) - (-13)/(-21). Let s = 7 + -5. Which is the second biggest value? (a) -3/4 (b) s (c) t c Let i = 1.4 + -2.4. Which is the second smallest value? (a) 0.2 (b) i (c) 9 a Let i = 10 + -10. Let m = 0.5 - i. What is the third smallest value in -0.5, -0.1, m? m Let u = 92 - 365/4. What is the second smallest value in u, 0.3, 1/2, -1? 0.3 Suppose -2w - 2w - 256 = 0. Let o be 3 + 0 - w/(-20). Let i(j) = j3 + 2j*2 - 2j. Let q be i(-2). What is the biggest value in q, -2, o? q Let s = 97 - 681/7. Which is the fourth smallest value? (a) -0.4 (b) -0.5 (c) 4 (d) s c Let j = 0.07 + -0.47. Let z = -39/5 + 371/45. Which is the smallest value? (a) j (b) 2/11 (c) z a Let q be 1/((-3 - 0)/(-12)). Suppose y + 0 = q. Which is the third smallest value? (a) -0.5 (b) -4 (c) y c Let b = -124 + 129. What is the smallest value in 0, -5, b, -2.2? -5 Let r = 3.3 + -0.3. Let s = r - 3. Let q = 7.1 + -7. Which is the third biggest value? (a) s (b) -0.2 (c) q b Let n be 8/(-28) + (-20)/(-21). Which is the second biggest value? (a) n (b) -3 (c) -2/17 c Let l(x) = x*2 - 3x + 6. Let p be l(6). Let y be (p/16)/((-27)/(-4)). Which is the third biggest value? (a) y (b) 0.3 (c) -0.3 c Let w = -5.6 - -3.6. Which is the third smallest value? (a) w (b) 0.1 (c) 1/3 c Let w be (1 + 1)/42(5 - 3). Let a = 1172/7 + -168. What is the smallest value in w, a, 0.4? a Let t = 0.13 - 3.13. Let s = t - 2. What is the third smallest value in s, -0.2, -0.3? -0.2 Let m = -0.132 + -0.168. Let z = -1.6 + -0.2. Let i = z + -0.2. Which is the second biggest value? (a) i (b) m (c) 0.4 b Let k(j) = -j2 - 2j. Let i be k(-2). Let y = -0.4 - 0.1. Which is the smallest value? (a) 2/13 (b) y (c) i b Let h = -0.07 - -0.13. Let i = h + -0.06. Suppose 0o = o + 2. Which is the second biggest value? (a) i (b) 5 (c) o a Let y = -1372/15249 + 2/663. Which is the second smallest value? (a) 1/4 (b) y (c) -2 b Let l = 0.29 + -0.49. Let q = 0.06 + 2.44. Let z = q - 2. Which is the third biggest value? (a) l (b) z (c) 1 a Let q = 0.06 - 0.09. Let o = q + 0.33. Which is the biggest value? (a) -2 (b) o (c) -8 b Let w(o) = o3 + 9o*2. Let l be w(-9). Let g = l + 0. Which is the third biggest value? (a) g (b) 5 (c) -0.4 c Let l(n) = 2n + 3. Let g be l(-3). Which is the second biggest value? (a) -4/9 (b) g (c) -2/21 a Let x(o) = -1 + 2o + 0 + 11. Let g be x(-7). Let v(l) = l3 + 4l**2 - 4. Let h be v	{ "pile_set_name": "DM Mathematics" }
-166846.8? -13/6 What is the second biggest value in 7783, 0.19, -1.23? 0.19 What is the second biggest value in -9.5, -2/13, -848, 2/5, -4? -2/13 Which is the third biggest value? (a) 36844 (b) -280 (c) -1/5 b Which is the seventh biggest value? (a) 2 (b) -3 (c) -15/16 (d) 2/7 (e) 0.4 (f) 95 (g) 1/8 b Which is the second smallest value? (a) -5849 (b) 1/13 (c) 10 b Which is the third biggest value? (a) -0.1 (b) 251 (c) -0.01425 a Which is the second smallest value? (a) -9/2 (b) -17 (c) 179 (d) -8 (e) 0 (f) 6 (g) -1 d What is the fifth smallest value in -304, 4, -15, -12, 3/4? 4 What is the third smallest value in -271, 5.875, 4? 5.875 What is the second smallest value in 0.5, -19.2, -2/9, -5, 0, 24? -5 Which is the second biggest value? (a) -14768/7 (b) 2 (c) 739 b What is the second smallest value in 4, -5, -4, -62, -21? -21 What is the second biggest value in 6580, -2, 0.7, -432? 0.7 Which is the fifth smallest value? (a) 0.1 (b) -1.8 (c) -5.9 (d) 1/2 (e) -1/6 d What is the fourth biggest value in -7/3, -0.2, 0.5, -2, 0.9, -1/4, 29.8? -0.2 Which is the sixth smallest value? (a) -1/6 (b) -1/2 (c) 0 (d) 45 (e) 5 (f) 2.29 d Which is the third biggest value? (a) -3 (b) -7/3 (c) 5 (d) 174.1 b What is the biggest value in 0.2, 6601, -3/2, -0.3? 6601 What is the third smallest value in -11/5, -26, -3/2, -1.3, -5, -0.036, -2? -11/5 What is the smallest value in -2, -47792, 1, -2/3, 2/185? -47792 What is the fifth biggest value in -0.5, 0.5, -2, -19151, 1/9, 0.3, -6? -2 Which is the third smallest value? (a) -2 (b) -4 (c) -0.4 (d) -3 (e) 5741 (f) 0.3 (g) 4 a Which is the second smallest value? (a) 0.11 (b) 47/274 (c) -1/4 a Which is the second smallest value? (a) -26 (b) -54/25 (c) -1/3 (d) -2/5 b What is the third biggest value in 4, 12, 3/2, -59, 0, -374? 3/2 Which is the fourth smallest value? (a) -1/5 (b) -4/3 (c) -8 (d) 0 (e) 54 (f) 2/9 (g) 0.006 d What is the second biggest value in 2/15, -57770, -4? -4 What is the third smallest value in -1, -1/4, 16020, 0, 1, 0.05? 0 What is the biggest value in -1/6, -6, 1759909? 1759909 What is the fourth biggest value in 4127, -57, 0.02, 2.4? -57 What is the fourth biggest value in 0.4, -2085, -4, -28? -2085 What is the third biggest value in 2/15, 15, -42.5, 0.04, -1/3? 0.04 What is the biggest value in 904, -5, -9.21, 0.4, 0.5? 904 Which is the fourth biggest value? (a) 21 (b) 1 (c) 0.05 (d) 0.3 (e) -1.5 (f) 4/25 f Which is the second biggest value? (a) 1347 (b) -3/5 (c) -17 b Which is the fifth smallest value? (a) 3 (b) -1/107 (c) -0.2 (d) -0.3 (e) -3/25 (f) -2/3 (g) -7.8 e Which is the sixth biggest value? (a) -5 (b) 0.5 (c) -3/5 (d) -10 (e) -12 (f) 4 e What is the sixth biggest value in -553, -2, -5, 0.2, -3, -0.3? -553 Which is the fourth smallest value? (a) 1/11 (b) -3 (c) 0.1 (d) 6059 (e) -0.05 (f) 4 c What is the biggest value in -1/2, -3/4, -0.2, 0.55387? 0.55387 Which is the third smallest value? (a) -0.0299 (b) -10 (c) 2/17 (d) 8/25 (e) 1 c What is the second biggest value in -3/4, 1, -406, -2/13, 2, 165? 2 What is the second biggest value in 1.2, 47, 592, -0.3? 47 Which is the second smallest value? (a) -3075.3 (b) 2/9 (c) -3.3 c Which is the third biggest value? (a) 1/5 (b) -1081 (c) -1.543 b What is the second biggest value in -373, 0.3, 433, -1, 1? 1 What is the sixth smallest value in -16/9, -3, -1, 0.1, 12/11, -2/13, -5? 0.1 Which is the third smallest value? (a) -4 (b) 4595 (c) 3/8 b Which is the second smallest value? (a) 41 (b) 0.1 (c) 342.86 a What is the fifth smallest value in 0.24, -104, -5, -2/5, 23.4? 23.4 What is the second smallest value in 1.51, -203.5, 21? 1.51 Which is the third smallest value? (a) -42 (b) 3 (c) 0.2628 b Which is the third biggest value? (a) -3/4 (b) 4 (c) 0.18 (d) -419683 a What is the smallest value in -24, -0.2677, 289? -24 What is the fourth biggest value in 25, 0.4, -12009, -3, 0? -3 Which is the second biggest value? (a) 0.4 (b) 25.66 (c) 2/37 (d) -352 a What is the second smallest value in 0.7123, 0, 4, -9/8? 0 What is the sixth smallest value in -0.1, -1/36, 0, 36, -2/9, 117? 117 What is the smallest value in -1849, 3/13040, -15? -1849 Which is the fourth biggest value? (a) -2 (b) -4 (c) -1 (d) -0.1 (e) 10 (f) -102184 a Which is the second smallest value? (a) -1/47 (b) 8/7 (c) 77 (d) -2/3 (e) -1/10 e Which is the second smallest value? (a) -1/2 (b) 2 (c) -4 (d) 3118 (e) -8 (f) -13 e What is the smallest value in -0.2, -3177594, -14, -4/5? -3177594 Which is the third smallest value? (a) -5 (b) 0.4 (c) 0.38 (d) -4 (e) -1/48 e Which is the second biggest value? (a) 0.5 (b) -90 (c) 4 (d) 0.4 (e) 64/7 (f) 111 e What is the biggest value in -5, 0.1, 2/7953, -5/3? 0.1 What is the smallest value in -12, -54062, 1/60? -54062 Which is the third smallest value? (a) -0.4 (b) -1.09 (c) -20 (d) 1/6 (e) -2 (f) -15 (g) 2/11 e What is the second biggest value in -6, -3008, 0.04? -6 What is the second smallest value in -0.5, 0, -35426, 20? -0.5 What is the second biggest value in -11/3, 2/7, -3352.54? -11/3 Which is the biggest value? (a) 1/7 (b) -1.52 (c) 34065/8 (d) 0.3 c Which is the smallest value? (a) 25158 (b) 0.3 (c) 10613 b Which is the second smallest value? (a) -1759 (b) -35/4 (c) 0.7 (d) 2 b Which is the smallest value? (a) -5152 (b) 42 (c) -4 (d) -7 a Which is the second biggest value? (a) -1 (b) -55833/17 (c) -1/5 (d) -1/2 d Which is the fourth biggest value? (a) 2/7 (b) 0.1 (c) -5124 (d) 1525 c What is the third biggest value in -1/21, -4, -225048? -225048 What is the second biggest value in 4, -0.03, -23099? -0.03 What is the second biggest value in 5, -5374/5, -0.4, -0.03, 14/11, -3/7? 14/11 What is the smallest value in -4, -0.2, -114809, -124, -1/9? -114809 What is the sixth biggest value in -1/4, -9.43, 1/7, -4/27, -81, 2/5? -81 What is the fourth smallest value in 4, 0.5, -4, 2/4009, -18, 2/17? 2/17 Which is the second smallest value? (a) 112542 (b) -0.1 (c) 67 c What is the fourth biggest value in -0.1, 2/15, 0.049, -1/4, -9/7, -3, 0? -0.1 What is the smallest value in -48, -1/4, 43030? -48 What is the fourth smallest value in 83/4, -12/13, -0.3, -2, -24, 3/7, 0.2? -0.3 Which is the second smallest value? (a) -228/37 (b) -5/4 (c) -2/7 b Which is the smallest value? (a) 2.3 (b) -2/11 (c) 77437 (d) 6 b What is the fourth biggest value in -78, -606, -0.03, 1/4? -606 What is the second smallest value in 988, 4, 0.3, -0.3, 122.4? 0.3 What is the smallest value in 1/8, -0.2, 32/9, 0.1416127? -0.2 What is the smallest value in -22733/20, -5, 20? -22733/20 Which is the biggest value? (a) -11/7 (b) 173 (c) -0.4 (d) 2/5 (e) -1 (f) -3 b What is the fifth biggest value in 0.2, 25, -5, -69.682, -0.1? -69.682 Which is the fifth biggest value? (a) -4 (b) -9 (c) -0.4 (d) -1/149 (e) -119/5 (f) 8 b What is the third biggest value in 0.4, 2787, 5554? 0.4 Which is the fourth smallest value? (a) -70 (b) -9/4 (c) 43 (d) 50 d What is the second biggest value in -3, -21/131, 3/2, -2076? -21/131 What is the fourth smallest value in -2.412, 3, -14, -1/4, -20? -1/4 Which is the smallest value? (a) 939.09 (b) 152 (c) 1 c What is the third biggest value in 0.0444, 0, 0.9, 0.3, -47, -3? 0.0444 What is the fifth smallest value in -8, -5, 0.2, 0.1, 0.4, 14, -0.3? 0.2 What is the smallest value in -0.4, 1/2, -1.4, 2/9, -27, -11? -27 What is the sixth biggest value in -1/5, 0.06, -5/113, -2, -0.1, 1/4, 25? -1/5 Which is the second biggest value? (a) 0.07 (b) -4 (c) 177.5 (d) 2/5 (e) 23 (f) 8 e What is the second smallest value in -0.4, -7, 1780.876? -0.4 Which is the second smallest value? (a) 30 (b) 0.5 (c) 0.1 (d) -52 (e) 7 (f) 5 (g) -2/9 g Which is the sixth smallest value? (a) 126 (b) 306 (c) -5 (d) 1/4 (e) -0.1 (f) 3 (g) 2 a What is the fifth smallest value in -43, -1, 4, -10, 5, -8/3? 4 Which is the second biggest value? (a) 625 (b) -0.021 (c) -2 (d) -0.4 (e) -3 (f) -0.1 (g) 0.4 g Which is the second biggest value? (a) -28169 (b) -2632 (c) -1/9 b Which is the second biggest value? (a) -4224/17 (b) 2 (c) 2.59 b Which is the third bigges	{ "pile_set_name": "DM Mathematics" }
96y - 100y + 37656. Suppose -17j + y + 11309 = 0. Is j a composite number? True Suppose -14d + 203177 = 21471. Is d prime? True Let w(p) = -p*2 + p + 2. Let k be w(-2). Let f be k - (-2 + 3)-7. Is -30(2/f + -1) composite? True Let y(n) = 5227n*3 + 2n*2 + 6n - 9. Is y(2) composite? True Let d = -12319 + 18288. Is d a prime number? False Suppose 3l - 4g - 530 = 0, -4l + 443 = -g - 268. Let h = l + 145. Is h a prime number? False Let t = -8664 - -15381. Is t composite? True Let i = 4466 - 2149. Is i composite? True Suppose -5d + 74568 = 4f, 5f - 2d - 21437 = 71740. Is f a composite number? False Let h be (-4)/6 + (-12624)/(-9) + -2. Is 4/(-6) + h/30 a prime number? False Let w = -13 - -8. Let a = -12 - w. Is (-6)/42 - 848/a a prime number? False Let r(g) = g3 + 17g*2 - 9g + 12. Let x be r(-11). Let o = x + -76. Is o prime? True Let t = 367 + 52. Is t a composite number? False Let m(q) = 6q2 - 13q - 11. Let t be m(17). Suppose -2r - 2b = -t, 0 = 5r + 2b + 287 - 4048. Is r a prime number? False Let t = -36 + 39. Suppose 2v = -tv + 480. Let b = 257 - v. Is b a prime number? False Let i(r) = 227r - 268. Is i(21) a composite number? True Is 2 + (-2)/(-7) + (-243416)/(-56) prime? True Let m = -3977 - -9714. Is m composite? False Let x = -47 + 37. Let f(o) = -46o + 39. Is f(x) composite? False Is (3511/(-3))/((-9)/27) prime? True Suppose -7b + 2639 + 12488 = 0. Is b a prime number? True Suppose -35v = -38v + 23097. Is v a composite number? False Let t(k) = 37k*2 + 3k + 13. Let w = 40 - 43. Is t(w) a prime number? True Let h(r) = -150r3 - 3r*2 + 4r - 6. Is h(-5) prime? False Let j be (-169)/(((-2)/3)/2). Suppose j = 3q - 5g + 6g, 845 = 5q - 2g. Is q prime? False Let u = -8976 - -14015. Is u a composite number? False Let k be (-15 - -3)/(-3) + -2. Suppose 1 = q - k. Suppose qz + z = 1028. Is z a prime number? True Is ((-52)/(-39))/((-8)/(-2274)) prime? True Let x(m) = 12m3 + 4m*2 + m + 3. Let o be x(4). Suppose -2n - 3n + 2517 = 3w, o = w + 5n. Is w composite? False Let z(s) = -s2 + 17s. Let u be z(7). Is 20517/u + 1/(-10) composite? False Let w be (-10)/((-6)/(-9)-1). Let l = w - 11. Suppose 2y + 2k = 110, k = -ly - 0k + 220. Is y a composite number? True Suppose -3g + 2s = 215, -4g - 3s - 68 = -3g. Let l = 517 + g. Is l prime? False Suppose 32a = 19a + 138749. Is a composite? True Let w(c) be the third derivative of -c6/120 + c5/12 + c4/24 + c3/3 + 8c2. Is w(3) prime? True Suppose -96018 = -11c + 29503. Is c a composite number? False Let g(n) = 7n2 - 4n + 4. Let v = -11 - -9. Let h(d) = -d*3 + 2d - 1. Let j be h(v). Is g(j) composite? True Suppose -6 - 3 = d. Is 3/d564/(-4) a prime number? True Let p be (-5 - (-60)/(-4))/(4/(-10)). Let j = p - -161. Is j a composite number? False Let z be 0(3 - 20/8). Suppose z = -3w + 5f - 51, w + w = -3f - 15. Is 4042/12 - 2/w prime? True Let b(u) be the third derivative of -557u*4/12 - 14u*2. Is b(-1) a composite number? True Suppose 7468 + 2267 = 15h. Is h a prime number? False Suppose 4 + 1 = 2y - u, -3y - 5u = -14. Suppose -8o + 28 + 4 = 0. Let w = o + y. Is w a composite number? False Let o be (10 + -9)/(2/14624). Is (-2 + -1)/(4(-12)/o) a prime number? True Let k = -2614 - -7691. Is k composite? False Let n = -139 + 38. Let z = 318 - n. Is z prime? True Let d be (-1 + 2)(1 + -2)-3. Suppose -2i + 412 = -dp, 839 = 4i + p + 29. Is i prime? False Let p(m) = 4m3 - 13m*2 + 12m + 61. Is p(14) a prime number? False Suppose 10f = 111 - 321. Is ((-27105)/f - -2) + (-2)/(-7) prime? False Let d(n) = n3 + 9n*2 + 13n - 3. Let u be d(-7). Suppose -s + us = 447. Is s composite? False Suppose 2k - 46 + 10 = 0. Is (1076/363)/(2/k) a prime number? False Let t(l) = -231l3 - l2 + 3. Is t(-2) a prime number? True Is ((-86685)/(-12))/((-11)/(-44)) a prime number? False Suppose 2r + 3q - 6098 = q, -5r = -q - 15215. Suppose x - r - 452 = 0. Suppose -3k = 5k - x. Is k composite? True Let o(y) = 37y - 6. Suppose 5z - 4c + 18 = 6, -5z - 5c + 15 = 0. Suppose -p + 17 = -6l + 3l, z = 4l + 16. Is o(p) prime? True Suppose -l + 4g = -24, -l = 4g + 8 + 8. Suppose -l = d - 1, -5d = -3b + 2124. Is b composite? True Let b(u) = -36u*2 + 5u + 4. Let l be b(6). Let j(s) = s*2 - 33s + 121. Let f be j(44). Let d = f - l. Is d prime? True Suppose -4615 + 504 = -f. Is f a prime number? True Let y be 4 - 1 - 5(-3)/(-5). Suppose y = -2k + 148 + 46. Is k a composite number? False Suppose 0 = -5h + 6 + 9. Is 2 + 555/h - -4 prime? True Let z(q) = 12q*2 + 66q - 57. Is z(21) prime? False Let y be (-3)/((-12)/1720)-2. Let i be 4/4 - y - -3. Let j = 1211 - i. Is j a composite number? False Let t = -26 + 22. Let k(z) = 14z*2 + z + 2. Let x be k(t). Suppose -u + x = u. Is u composite? True Let k(r) = -3r + 31. Is k(-8) a composite number? True Let n be (-6333)/(-13) + 4/(-26). Let h(f) = -5f2 + 3f - 4. Let q be h(7). Let l = q + n. Is l composite? True Let m(p) = -4p3 - 1 + 13p + 3p3 - 7p + 9p + 12p*2. Let x = 26 + -20. Is m(x) composite? True Let p(o) = 10o*2 - 103o - 88. Is p(37) composite? False Suppose 4x - 1707 - 995 = -5b, x - b - 671 = 0. Is x prime? True Let h(d) = -d*3 + 3d*2 + 3d. Let a be h(4). Let c be (2 + 24)34/a. Let t = 312 + c. Is t a composite number? True Suppose 18d = 166379 + 168727. Is d a prime number? True Let a(h) = -h*3 + 4h*2 + 3h - 1. Let f be a(5). Is (f - -1872) + (-2)/((-2)/(-3)) prime? False Let n be 10/5 + 0/(-1). Suppose nu - 2b - 328 = 0, 5u - 813 = -4b + 2b. Is u prime? True Suppose -3c + 10694 = -6925. Is c composite? True Suppose -p - 6788 = -6p - 3a, 5429 = 4p + a. Is p prime? False Let j = 145868 - 81747. Is j a composite number? True Let b = 53 + 326. Is b prime? True Suppose 3m + 3b + 7 = 55, 3b = m. Suppose 19l = 27l + 25408. Is (-6)/4l/m composite? False Suppose -2t - 4q + 1372 = -2278, t + 3q = 1826. Is t a prime number? True Suppose 0 = 1631t - 1625t - 54882. Is t a composite number? True Suppose 0 = -2n - 3n + 10. Suppose nq = 7q. Suppose 0y + 5y + 143 = 4a, q = a + 5y - 42. Is a a composite number? False Suppose -5d - 3b - 8196 = -8d, -b = 3d - 8192. Is d a prime number? True Let j = 16 - 109. Let q = -75 - -185. Let r = q - j. Is r a prime number? False Let j be -1 + 1(3 - 3). Let y be 12/24 - j/2. Is (3 - -50)1/y a prime number? True Let b be (17 + -1274)(-4)/(-3). Let g = b + 4519. Is g prime? True Let p = -56 - -61. Suppose 3c = pg + 328, -c + 3g + 218 = c. Is c a composite number? True Suppose -9o - 230 + 3209 = 0. Is o a prime number? True Let l = 17 - 17. Suppose -2g = -lg + 56. Let d = 50 + g. Is d prime? False Suppose 19j - 42545 = 5582. Is j prime? False Is -3 + 5 + 1 - (-15 + -4240) a prime number? False Is 157(-12)/(120/(-710)) prime? False Is 3/(-6) + 7083/2 a prime number? True Let l(v) = 1052v*2 - 9v + 11. Is l(2) a composite number? False Is 15867/4 - (-2 - 7/(-4)) prime? True Let u = 134546 - 75889. Is u a composite number? False Let u(r) be the second derivative of 7r5/20 + r4/12 - 2r*3 + 5r*2/2 - 4r + 3. Is u(6) a composite number? False Suppose -i = -p - 2358, 16p + 5 = 15p. Is i a prime number? False Let h = 9504 + -6719. Is h prime? False Let a be (-2)/6 + (-3)/(-9). Suppose a = p - 2. Is 134 - 3p/6 prime? False Suppose -37j = -36j + 2, -2r = 4j - 2294. Is r a composite number? False Let w = 8717 - 5218. Is w a prime number? True Let d(v) = 304v - 14. Let b be d(9). Suppose 0 = 4p + u - 5472, 0u - b = -2p + 3u. Is p prime? True Is 2(-8)/(-48)20409 a prime number? True Let t(n) = n*3 + 3n*2 - 2n + 1. Let g be t(-4). Let a(h) = -h*3 + 14h*2 + 2h - 26. Let v be a(14). Let s = v - g. Is s a prime number? False Let y = -89 - -91. Let l be -11/(-1) - -296. Suppose 0 = yq - 205 - l. Is q composite? False Let v be (1 - -2)45/(-5). Is -1438(4 + v/6) a composite number? False Suppose 0 = 5p - 5j - 5308 - 11957, 10357 = 3p - 4j. Suppose h = 3y - p, 0 = -2y - 0h - 3h + 2296. Is y a composite number? False Let o(f) = -f*3 + 5f*2 + 6f - 1. Let l = -3 + 9. Let k be o(l). Is (5 - 4)/(k/(-43)) composite? False Let k = 11111	{ "pile_set_name": "DM Mathematics" }
h2 - 245304h + 2736864 = 0. -8772, -13, -3, 2 What is h in -2h3/9 + 33266h*2/9 - 136497526h/9 - 15276053738/9 = 0? -109, 8371 Factor -3y2 - 1490652612y - 185170434138535212. -3(y + 248442102)2 Solve -30x*5 + 1282x*4/11 - 58x*3 - 2034x*2/11 + 1168x/11 + 952/11 = 0. -1, -17/33, 7/5, 2 Determine p so that p*4/6 - 2179p*3/6 + 49247p*2/6 + 735559p/6 - 130438 = 0. -11, 1, 33, 2156 Find l, given that l*4/5 - 145l*3 + 109337l*2/5 + 4951877l/5 - 1012098 = 0. -37, 1, 291, 470 Determine l, given that -l*4/5 + 363l*3 - 850998l*2/5 + 24719104l/5 - 4773984 = 0. 1, 30, 892 Solve -x*3 + 10794x*2 - 29899584x + 4138366496 = 0. 146, 5324 Find h such that -h*3 + 268845h*2 - 1613043h + 2419551 = 0. 3, 268839 Determine n, given that -3n5 + 44727n*4 - 166775679n*3 + 498404613n*2 + 5663668854n + 7998798096 = 0. -3, -2, 8, 7453 Determine m, given that 5m4 + 49550m*3 - 5842980m*2 + 228469410m - 2973958065 = 0. -10027, 39 Find p such that -40p5 + 26125p*4 + 761855p*3 - 1730040p*2 + 204300p = 0. -30, 0, 1/8, 2, 681 Factor -2s3/17 - 4893086s*2/17 + 24465480s/17. -2s(s - 5)(s + 2446548)/17 What is f in 2f*5 - 8440f*4 + 392350f*3 - 367040f*2 - 767832f = 0? -1, 0, 2, 46, 4173 Factor 7l2/3 - 109746520l/3 + 31356148/3. (l - 15678074)(7l - 2)/3 Determine s, given that 2s5/17 + 8844s*4/17 + 10095422s*3/17 + 696731436s*2/17 - 2999850424s/17 - 3686495280/17 = 0. -2174, -78, -1, 5 Factor 3l3 + 14802534l*2 + 18259584401763l. 3l(l + 2467089)*2 Factor -2s*2 - 445776s + 891560. -2(s - 2)(s + 222890) Determine c so that -2c4/3 - 9452c*3/3 - 3536350c*2 + 1336372400c/3 + 1346972000/3 = 0. -2420, -1, 115 Factor -28g3 - 132284g*2 + 529184g/7 - 10800. -4(g + 4725)(7g - 2)2/7 Let y5/9 + 1184y*4/9 - 185716y*3/3 + 30762766y*2/9 + 63201707y/9 + 3542290 = 0. Calculate y. -1555, -1, 67, 306 What is v in 4v3/5 + 175356v*2/5 + 70140v + 175348/5 = 0? -43837, -1 Factor -3q3 - 3195942q*2 + 6391893q - 3195948. -3(q - 1)2(q + 1065316) Let 2y5/11 - 2460y*4/11 - 236262y*3/11 - 1764016y*2/11 - 2829096y/11 - 118080 = 0. Calculate y. -82, -6, -1, 1320 Determine g, given that 4g2 - 220492540g = 0. 0, 55123135 Find a, given that -2a2 - 12300a + 870800 = 0. -6220, 70 Factor -3n2 + 33324510n - 92543580561675. -3(n - 5554085)2 Suppose 2i*5/3 - 123952i*4/3 - 371870i*3/3 - 247916i*2/3 = 0. Calculate i. -2, -1, 0, 61979 Determine t so that -4t*5 - 1144t*4 + 50832t*3 - 436256t*2 - 1084928t = 0. -326, -2, 0, 16, 26 Find r such that 2r3 - 2410r*2 + 423718r + 426130 = 0. -1, 215, 991 Determine u so that -32u5/7 + 3076u*4/7 - 82440u*3/7 + 296224u*2/7 + 4335232u/7 + 929280 = 0. -4, -15/8, 14, 44 Factor -2s2/7 + 3241076s/7 - 1313071704722/7. -2(s - 810269)2/7 Factor 11555v*2 + 34643v - 66. (v + 3)(11555v - 22) Let 2l2/9 + 59837260l/9 + 59837258/9 = 0. What is l? -29918629, -1 Factor 3x4 - 1901466x*3 + 301404209043x*2 - 33739384528080x + 944535832363200. 3(x - 316855)2(x - 56)*2 Determine t, given that -1052t*5 - 2974t*4 - 506t*3 + 3338t*2 + 1558t - 364 = 0. -2, -1, 91/526, 1 Factor -2s2/17 - 792522s/17 + 77686364/17. -2(s - 98)(s + 396359)/17 Factor 4u5/7 - 584872u*4/7 + 28505881444u*3/7 - 463087544978480u*2/7 - 926260609940800u/7 - 463144558496000/7. 4(u - 48740)3(u + 1)*2/7 Factor -2z*2/3 - 354872z/3 - 1182840. -2(z + 10)(z + 177426)/3 Factor -2h2 + 69908h + 2449230. -2(h - 34989)(h + 35) Factor g*3/7 - 17453g*2/7 + 11045173g - 1446009705. (g - 8659)*2(g - 135)/7 Factor o*3 - 8468882o*2 - 16937767o - 8468884. (o - 8468884)(o + 1)2 Factor -w2/2 - 4852w - 508694. -(w + 106)(w + 9598)/2 Factor u2/8 - 317u/8 - 62905/4. (u - 547)(u + 230)/8 Find i, given that -2i*2/3 - 11784i - 882550/3 = 0. -17651, -25 Solve 338i3 - 170786772i*2 + 52549752i - 4042288 = 0. 2/13, 505286 What is j in -2j4/5 - 4532356j*3/5 - 13597056j*2/5 - 13597052j/5 - 906470 = 0? -2266175, -1 Suppose 3764d4 + 30000d*3 + 25452d*2 - 784d = 0. What is d? -7, -1, 0, 28/941 Determine m, given that -m*4/4 - 4169m*3/4 - 1732227m*2/4 - 36600971m/4 - 49636378 = 0. -3704, -443, -11 Factor w*2/3 - 55033w/3 + 348422. (w - 55014)(w - 19)/3 What is s in -4s*5 - 184s*4 + 22076s*3 + 411696s*2 - 1428480s = 0? -93, -20, 0, 3, 64 Factor -v*2/6 + 215267v/6 + 3121792/3. -(v - 215296)(v + 29)/6 Solve 5h*4 - 5121015h*3 + 1311175716480h*2 + 32782593624500h = 0 for h. -25, 0, 512114 Factor -23427605i2 - 70282825i - 30. -5(i + 3)(4685521i + 2) Let -4x*5/3 - 4790096x*4/3 - 1434073310716x*3/3 - 5736211811504x*2/3 + 1434073310720x/3 + 5736216601600/3 = 0. What is x? -598760, -4, -1, 1 Determine h so that 4h2 + 35392h - 106212 = 0. -8851, 3 Factor 4x3 + 187012x*2 + 7847768x + 14947520. 4(x + 2)(x + 40)(x + 46711) Factor i2/4 - 420205i/4 - 420209. (i - 420209)(i + 4)/4 Determine u, given that u5/5 + 6382u*4/5 + 1931916u*3 - 337895640u2 = 0. -3270, 0, 158 Find o such that -o5 + 13599389o4 - 46235865692409o*3 + 138707501881519o*2 - 92471649788498o = 0. 0, 1, 2, 6799693 Factor n*3/7 - 778583n2. n2(n - 5450081)/7 Find a such that a3/7 + 669086a*2/7 + 111920357009a/7 + 447670722724/7 = 0. -334541, -4 Factor -2z2/11 - 132800z/11 - 12730368/11. -2(z + 96)(z + 66304)/11 Suppose w*4/8 - 595w*3 - 33531w*2/2 + 35910w = 0. Calculate w. -30, 0, 2, 4788 Suppose -j*2 - 5356481j - 16069434 = 0. What is j? -5356478, -3 Solve 3v3 - 330360v*2 + 17170761v - 16840404 = 0 for v. 1, 51, 110068 Let 2v2 + 312202764v - 312202766 = 0. What is v? -156101383, 1 Factor -3t3 - 112722t*2 - 1036182315t + 428191107300. -3(t - 396)(t + 18985)*2 Factor -3k*2/5 + 1509842k/5 - 201312. -(k - 503280)(3k - 2)/5 Determine g so that 4g5 - 1224g*4 + 15292g*3 + 308520g*2 + 292000g = 0. -10, -1, 0, 25, 292 Solve -4h3/7 + 62724h*2/7 - 4251360h/7 + 72194512/7 = 0. 34, 15613 Factor 2q2/11 + 2719668q/11 + 10878640/11. 2(q + 4)(q + 1359830)/11 Factor 5h3 + 119950h*2 - 3963795h. 5h(h - 33)(h + 24023) Determine y so that -1154y*5/15 + 64552y*4/15 - 952634y*3/15 + 374772y*2/5 + 453600y + 139968/5 = 0. -2, -36/577, 4, 27 Determine p so that -p*4 - 5845p*3 - 1613348p*2 + 23386031020p - 93517936176 = 0. -3754, 4, 1659 Suppose 335y5 - 12065y*4 - 24945y*3 - 12355y*2 + 190y = 0. Calculate y. -1, 0, 1/67, 38 Solve -2t3/7 - 6600t*2/7 + 5688t + 476064/7 = 0 for t. -3306, -6, 12 Factor -b*2/6 + 3565b/2 - 10693/3. -(b - 10693)(b - 2)/6 Factor 2a*2 - 418834a + 4606932. 2(a - 209406)(a - 11) Factor -4o3 + 320o*2 + 43900o + 403000. -4(o - 155)(o + 10)(o + 65) Let 4d*5/3 - 181496d*4 + 18696299900d*3/3 - 3782434625800d*2 - 6232099968d + 3782434807296 = 0. Calculate d. -1, 1, 618, 67752 Factor 4j2 - 17520j - 1047604. 4(j - 4439)(j + 59) Let 2l3/13 + 740l*2/13 - 61166l/13 - 256376/13 = 0. Calculate l. -439, -4, 73 Solve 560320h4 + 4202410h*3 + 1681035h*2 - 1961090h - 35 = 0. -7, -1, -1/56032, 1/2 Factor 2t3 - 100984t*2 - 504970t. 2t(t - 50497)(t + 5) Factor -2m*2 - 1847326m - 3694644. -2(m + 2)(m + 923661) Suppose u*5 + 284654u*4 - 1992611u*3 + 4554564u*2 - 3415932u = 0. Calculate u. -284661, 0, 2, 3 Suppose -3z2/4 + 57993z/4 - 144945/2 = 0. Calculate z. 5, 19326 Find l, given that 2l2/9 + 369227536l/9 + 17041121667578912/9 = 0. -92306884 Solve 768j4 - 1246462j*3 - 4999086j*2 - 3761618j - 9762 = 0 for j. -3, -1, -1/384, 1627 Let -6o4 + 14870595o*3 - 7435296o*2 = 0. What is o? 0, 1/2, 2478432 Factor -106f*2 + 392966f - 88968. -2(f - 3707)(53f - 12) Factor -4q*2 - 1773760q - 5321244. -4(q + 3)(q + 443437) Factor -3o3 - 144o*2 + 135525o + 271602. -3(o - 191)(o + 2)(o + 237) Find f such that f4/3 + 82f*3/3 - 5980f*2/3 - 53896f/3 + 43680 = 0. -126, -10, 2, 52 Find y, given that 2y3/7 - 276660y*2/7 + 9555964146y/7 + 114950612376 = 0. -84, 69207 Find m, given that 22m5/7 - 2850m*4/7 + 24044m*3/7 + 2520576m	{ "pile_set_name": "DM Mathematics" }
-15574, -31123, -46642, -62125, -77566, -92959, -108298, -123577? -138790 What comes next: 27823, 27842, 27909, 28048, 28283, 28638? 29137 What is next in -70010, -70014, -70014, -70010, -70002? -69990 What is the next term in -335177, -670470, -1005763, -1341056, -1676349? -2011642 What comes next: -511, 492, 3009, 7040? 12585 What comes next: -16684490, -16684489, -16684488, -16684487, -16684486, -16684485? -16684484 What is the next term in 79900, 159770, 239644, 319522, 399404? 479290 What comes next: -168766, -168703, -168624, -168523, -168394, -168231, -168028? -167779 What is next in -2046, -2709, -4512, -8025, -13818, -22461? -34524 What comes next: 1300, 5204, 11730, 20896, 32720, 47220? 64414 What is next in 2093, 1648, 903, -142, -1487? -3132 What is the next term in -2224126, -4448338, -6672550, -8896762? -11120974 What is next in -182237696, -364475391, -546713086, -728950781, -911188476, -1093426171? -1275663866 What comes next: 4025, 7772, 17951, 37778, 70469, 119240? 187307 What comes next: 4791, 9832, 15115, 20640? 26407 What is the next term in 778105, 6224910, 21009083, 49799308, 97264269? 168072650 What is next in -52249, -52162, -52075? -51988 What is the next term in -221939, -221949, -221957, -221957, -221943, -221909, -221849? -221757 What is the next term in -26588, -105653, -237424, -421901, -659084, -948973? -1291568 What comes next: 9640024, 19280053, 28920082, 38560111, 48200140, 57840169? 67480198 What is the next term in 17901299, 17901298, 17901297, 17901296, 17901295? 17901294 What is the next term in -8622, -75415, -256710, -609759, -1191814? -2060127 What is next in -125253, -125105, -124957, -124809, -124661, -124513? -124365 What comes next: 1320, 80, -3308, -9918, -20824, -37100, -59820, -90058? -128888 What comes next: -2325130, -2325121, -2325112, -2325103? -2325094 What is next in 1303985, 1304019, 1304053, 1304087, 1304121, 1304155? 1304189 What comes next: -14907005, -29814007, -44721007, -59628005, -74535001, -89441995, -104348987? -119255977 What is next in -929031, -1858006, -2786981, -3715956? -4644931 What is next in 88151, 88156, 88165, 88178? 88195 What is next in -11075, -19249, -32865, -51917, -76399, -106305, -141629? -182365 What is next in 18572, 37867, 57164, 76463, 95764? 115067 What is the next term in -5138, -10180, -15226, -20276, -25330? -30388 What is the next term in 217939, 435860, 653765, 871648, 1089503, 1307324, 1525105? 1742840 What is next in -2890624, -5781230, -8671832, -11562436, -14453048? -17343674 What is the next term in 191369, 191393, 191485, 191687, 192041, 192589, 193373? 194435 What is the next term in 615743, 1231499, 1847255, 2463011? 3078767 What is the next term in -3072, -6163, -9232, -12273, -15280, -18247, -21168, -24037? -26848 What is the next term in 619, 515, 185, -485, -1609, -3301? -5675 What is next in -20819, -83269, -187363, -333101, -520483, -749509? -1020179 What is next in -621274, -621275, -621276, -621277? -621278 What is the next term in -5561, -44380, -149729, -354872, -693073, -1197596? -1901705 What is next in -229182, -229242, -229336, -229458, -229602, -229762, -229932, -230106? -230278 What comes next: 96796, 774306, 2613252, 6194350, 12098316? 20905866 What is next in -3803727, -3803675, -3803589, -3803469, -3803315, -3803127, -3802905? -3802649 What is next in 404229, 407393, 412673, 420075, 429605, 441269, 455073, 471023? 489125 What is the next term in 1386, 11672, 28814, 52812, 83666? 121376 What is the next term in -62348, -124688, -187034, -249386, -311744, -374108? -436478 What is next in 10632, 11645, 12660, 13677, 14696, 15717? 16740 What is the next term in -2220809, -2220887, -2221019, -2221205, -2221445? -2221739 What comes next: -406629, -813256, -1219881, -1626504, -2033125? -2439744 What is the next term in -478, -7703, -27312, -65497, -128450, -222363, -353428, -527837? -751782 What is next in -28076, -30270, -32464, -34658, -36852? -39046 What comes next: -21268, -24720, -28172, -31624, -35076? -38528 What is next in -91274, -182674, -274060, -365426, -456766, -548074, -639344? -730570 What comes next: 966, 10387, 35954, 85737, 167806, 290231, 461082, 688429? 980342 What comes next: -1716, -3547, -5486, -7533? -9688 What is next in -6101020, -12202105, -18303190? -24404275 What is the next term in 47942, 96543, 145132, 193703, 242250, 290767? 339248 What is next in 161, 416, 367, -370, -2179, -5444? -10549 What is next in -17075, -36945, -56815, -76685, -96555? -116425 What is next in 1188, 3317, 6838, 11751? 18056 What comes next: 80, -54, -480, -1366, -2880? -5190 What comes next: 121123, 484531, 1090209, 1938157? 3028375 What is next in 1674664, 3349330, 5023996, 6698662? 8373328 What is the next term in 8502, 8210, 7724, 7062, 6242, 5282, 4200, 3014? 1742 What is next in -17085535, -68342136, -153769805, -273368542, -427138347, -615079220? -837191161 What comes next: -21, -604, -1769, -3516, -5845? -8756 What is the next term in -5239483, -20957922, -47155321, -83831680, -130986999? -188621278 What is the next term in 129677397, 259354795, 389032193? 518709591 What comes next: -1880867, -1880640, -1880413, -1880186, -1879959? -1879732 What is next in 6700, 4208, 1716? -776 What is the next term in 15302, 30797, 46290, 61781? 77270 What is next in -211640, -209152, -206664, -204176, -201688? -199200 What comes next: 5439, 21736, 48901, 86934, 135835, 195604, 266241? 347746 What is the next term in -6571, -6606, -6671, -6766? -6891 What comes next: 25945, 104252, 234763, 417478, 652397, 939520, 1278847? 1670378 What is next in -230400, -230578, -230874, -231288? -231820 What is next in 3075293, 3075297, 3075303, 3075311, 3075321? 3075333 What is next in -137294, -274615, -411960, -549329, -686722, -824139, -961580? -1099045 What is next in 6910, 7270, 7836, 8596, 9538, 10650, 11920? 13336 What is the next term in 29021, 116083, 261175, 464297, 725449? 1044631 What is next in -43, 196, 601, 1196, 2005? 3052 What is the next term in 32, 61, 102, 155, 220? 297 What is next in 3, -1273, -3817, -7623, -12685, -18997, -26553, -35347? -45373 What comes next: 145767, 145152, 144537, 143922? 143307 What comes next: 95780521, 191561044, 287341567? 383122090 What comes next: 1573, 3157, 4749, 6343, 7933, 9513, 11077? 12619 What comes next: -656801, -2627106, -5910947, -10508324, -16419237? -23643686 What comes next: 2992, 11507, 25700, 45571, 71120? 102347 What is next in -243274, -485431, -727588, -969745, -1211902, -1454059? -1696216 What comes next: -3893466, -7786931, -11680400, -15573873, -19467350, -23360831? -27254316 What is next in -691177, -691038, -690661, -689926, -688713? -686902 What is the next term in 6807, 6821, 6855, 6921, 7031, 7197, 7431, 7745? 8151 What comes next: 974211730, 974211729, 974211728, 974211727, 974211726? 974211725 What comes next: -85, -310, -1007, -2440, -4873? -8570 What is next in 724, -23416, -88934, -216518, -426856, -740636, -1178546, -1761274? -2509508 What comes next: 255031, 509538, 764045, 1018552, 1273059, 1527566? 1782073 What is next in -614, -465, -338, -233? -150 What comes next: 8540346, 17080693, 25621040, 34161387, 42701734? 51242081 What comes next: 1520, 14099, 48258, 114785, 224468? 388095 What is the next term in 11738, 47187, 106268, 188981? 295326 What comes next: -520550, -1040844, -1561138, -2081432, -2601726? -3122020 What is next in -10429641, -10429642, -10429643, -10429644, -10429645, -10429646? -10429647 What comes next: 3282, 6366, 9430, 12468, 15474, 18442? 21366 What comes next: -1624917, -6499687, -14624311, -25998789, -40623121, -58497307? -79621347 What comes next: 248151211, 248151212, 248151223, 248151250, 248151299, 248151376, 248151487, 248151638? 248151835 What comes next: -294176, -1176686, -2647540, -4706744, -7354304? -10590226 What is next in -393, 665, 2485, 5067, 8411? 12517 What is the next term in -4893, -5437, -5981, -6525, -7069, -7613? -8157 What is the next term in -508783, -1017564, -1526357, -2035168, -2544003, -3052868? -3561769 What is the next term in 13308170, 13308140, 13308108, 13308074? 13308038 What comes next: 4429, -44580, -177603, -436646, -863715, -1500816, -2389955? -3573138 What comes next: 2097, 3083, 4729, 7035? 100	{ "pile_set_name": "DM Mathematics" }
2q(n) + 14y(n). What is v(d(f))? 8f2 Let r(l) = 539l*2. Let v(w) = 0w*2 + 3w*2 + 5w*2 - 3w*2 - 7w*2. Determine v(r(b)). -581042b*4 Let l(c) = 5c*2 - 18c*2 - 11c - c + 12c. Let r(j) = 26j. Calculate r(l(b)). -338b2 Let g(r) = 41463r*2. Let z(q) = -2q. Determine z(g(n)). -82926n2 Let y(a) be the first derivative of -3a3 + a3 - 7 - 2. Let f(m) = -5m. Calculate y(f(x)). -150x*2 Let x(y) = -2y + 9. Let h(i) = -2i + 3i - 11i + 8i. Give h(x(l)). 4l - 18 Let z(c) = -c. Let p(i) be the first derivative of i5/30 + 13i*2/2 + 13. Let m(j) be the second derivative of p(j). Give z(m(u)). -2u*2 Let z(k) = k. Let x(g) = 2g. Let f be ((-2)/6)/(2/30). Let y(c) = fz(c) + 4x(c). Let j(q) = 2q2 + 4q*2 - 2q*2 + 4q*2. What is y(j(u))? 24u2 Let b(w) = w2 + 0w2 - 6w*2 + 8w2 + w - w2. Let t(x) = 2x2. What is b(t(d))? 8d*4 + 2d*2 Let m(y) = 17y. Let x(h) = -87h. Let w(k) = -11m(k) - 2x(k). Let c(o) = -2o*2. Calculate c(w(z)). -338z*2 Let q(p) = 2p*2. Let x(o) = 3o - 5. Let h be x(3). Suppose 30 = 5r + ha, 0a + 15 = 3a. Let m(w) = -w*2 + 3w*2 - 6w*2 + 9w*r. What is q(m(z))? 50z4 Let u(y) = -y2. Let k = -16 + 28. Suppose 0 = -3x - k. Let c(h) = h + 1. Let b(f) = -f - 3. Let w(t) = xb(t) - 12c(t). What is w(u(m))? 8m*2 Let l(x) = -3x + 0x - x + 5x. Let b(t) = 169t. What is b(l(v))? 169v Let o(g) be the third derivative of -g*5/15 + 165g2. Let c(s) = -s2 - 33s. Determine o(c(u)). -4u*4 - 264u*3 - 4356u*2 Let b be (-4)/4(-1 + -1). Let u be ((-48)/36)/((-2)/3). Let c(n) = -n*b + 0n2 - nu. Let l(g) = 2g. Calculate l(c(i)). -4i*2 Let c(g) be the first derivative of -2g*3/3 + 1. Let j(o) be the third derivative of 0 + 5o*2 + 0o - 1/8o4 + 0o*3. Give c(j(k)). -18k*2 Let l(x) = -5x + 3x + 4x - x. Let p(h) = -89h. Give l(p(o)). -89o Let b(g) be the first derivative of -7g3/3 - 1. Let f(k) be the second derivative of -k4/12 - 1577k. What is b(f(s))? -7s4 Let v(k) = 5k*2. Let y(t) = -36t - 5. Let h(a) = 2a2 + 43a - 17. Let i be h(-22). Let x(q) = -522q - 72. Let c(p) = ix(p) - 72y(p). Calculate c(v(b)). -90b*2 Let s(l) = -l. Let j(n) = 14n - 128. Let g(o) = -5o + 42. Let z(x) = 17g(x) + 6j(x). Determine z(s(d)). d - 54 Let n(x) = 8x + 116. Let v(p) = -3p2. Give v(n(g)). -192g*2 - 5568g - 40368 Let b(y) = 3y. Let c(w) = 1917w - 4. Determine c(b(j)). 5751j - 4 Let a(k) = -2k. Let g = 1 - -15. Let z(n) = -gn - 103 + 103. Determine a(z(p)). 32p Let y(d) = -9d2 - 51. Let a(n) = -n2 - 17. Let c(q) = 3a(q) - y(q). Let x(m) = -m. Let i(r) = 10r. Let u(g) = -i(g) - 5x(g). Give u(c(h)). -30h2 Let p(i) = -16i*2. Let a(u) = 7821u. Give p(a(l)). -978688656l2 Let h(t) = -2t. Let n(a) be the first derivative of -4a2 + 7 + 1 + 3a*2. What is n(h(z))? 4z Let q(s) be the second derivative of s*4/4 - 46s - 2. Let g(v) = 12v - 12v - 6v2. Calculate g(q(t)). -54t4 Let i(n) = -n2 + 17n - 39. Let m be i(12). Let o(d) = -18d - md + 35d. Let y(f) = -13f. Give y(o(c)). 52c Let u(s) = -2s2. Let d(k) = -1. Let c(q) = -13q + 5. Suppose -4n - v = 7, v + 6 = -v. Let o = 7 + -12. Let j(f) = nc(f) + od(f). Determine u(j(g)). -338g*2 Let j(b) = 0b + 0b + 0b - 2b2. Let z(q) be the first derivative of q2 - 4. Determine j(z(y)). -8y*2 Let v(b) = -222b. Let x(r) = -4r2 + 0r*2 + 6r*2 - 3r*2. What is x(v(w))? -49284w*2 Let h(g) = 1625g*2. Let l(u) = 619u. Give l(h(j)). 1005875j2 Let q(b) = -b2 + 215b - 4. Let i(z) = 4z2. Determine q(i(f)). -16f*4 + 860f*2 - 4 Let k(t) = -56577t*2. Let y(j) = 2j*2. Give y(k(u)). 6401913858u*4 Let n(v) = 2v*2. Let m(k) be the first derivative of -3k*2/2 - 50k + 651. Give m(n(r)). -6r2 - 50 Let h(b) = -10b. Let p(i) be the first derivative of i*4/12 - 23i*2/2 + 3. Let a(j) be the second derivative of p(j). What is h(a(w))? -20w Let x(r) = -15r - 3r*2 - 13r + 28r. Let q(f) be the third derivative of f4/4 - 25f*2. Calculate q(x(k)). -18k*2 Let c(p) = -3p. Let y(h) = 301109h. Give c(y(f)). -903327f Let n(k) = -9k2 - 5k - 5. Let u(m) = 8m2 + 4m + 4. Let d(c) = -4n(c) - 5u(c). Let r(s) = 0s2 - 3s2 + s2 + 4s2. Calculate r(d(q)). 32q*4 Let r(j) = -8j - 3. Let z(m) be the first derivative of 3m2/2 - 80. Give z(r(v)). -24v - 9 Let q(k) = -3k - k + 6k. Let f(b) = 4b2 + 3b. Let r(p) = 16p2 + 11p. Let w(v) = 22f(v) - 6r(v). Determine q(w(u)). -16u2 Let s(b) = 52b - 13b - 20b - 18b. Let a(l) be the third derivative of -3l*5/5 - 2l*2. Calculate s(a(h)). -36h*2 Let k(j) = -160j. Let b(v) = 5257v2. Calculate b(k(x)). 134579200x*2 Let k(a) = -63a + 12. Let t = -47 - -50. Let y(z) = -31z + 7. Let h(f) = tk(f) - 5y(f). Let o(r) = 2r. Calculate o(h(s)). -68s + 2 Let k(t) = -4t*2 - 3t. Let j(w) = 100w2 + 98w*2 - 194w*2. What is j(k(f))? 64f*4 + 96f*3 + 36f*2 Let t(j) = -j. Let n(l) = 1284l - 11. Determine n(t(i)). -1284i - 11 Let u be 10 - 3 - (-4 + 1). Let c(j) = 3j + 10 - 9j - u. Let b(x) = -35x*2 + 12x*2 + 9x*2 + 13x*2. What is b(c(t))? -36t*2 Let c(f) = -10f - 7f + 0f. Let l(q) be the third derivative of -q*5/30 + 148q*2. Determine c(l(t)). 34t*2 Let k(x) = -6x. Let m(c) = 2c - 2155. Calculate k(m(p)). -12p + 12930 Let t(h) = -577267 + h2 + 577267. Let b(r) be the third derivative of -r4/6 + r*2. Give b(t(i)). -4i*2 Suppose 2r = -5l - 10, 3r = l + 2l + 6. Let t(x) = -2x*2 + rx*2 + 2x2 - x2. Let b(h) = -h + 3h - h. Determine b(t(m)). -m2 Let v(z) = -4z*2. Suppose 0 = 25n - 46 - 104. Let f be (-4 - 0)17/(-4). Let u(l) = -7l. Let c(b) = 20b. Let x(a) = fu(a) + nc(a). Determine v(x(h)). -4h2 Let g(o) = o2 + 2o - 7. Let n be g(-5). Let i = n + -6. Let v(k) = 3k*2 - 4k*2 + 3k*i - 3k*2. Let w(f) = -3f*2. What is w(v(z))? -3z*4 Let b(r) = -4r*2 - 3r + 3. Let t(c) = c*2 + c - 1. Let z(a) = 2b(a) + 6t(a). Let x(k) = -3k*2 - 2k*2 - 3k2 + k2. What is z(x(f))? -98f4 Let t be 10/4(-12)/(-15). Let m = 37 + -34. Let p(q) = t + 1 + q - m. Let n(s) = -3s. Give n(p(a)). -3a Let f(t) = -135109t2. Let y(z) = -z2. Determine y(f(x)). -18254441881x*4 Let l(g) be the third derivative of 0g + 0 + 34g2 + 0g*3 + 0g*4 - 1/60g5. Let o(j) = j + j - j + 0. What is o(l(w))? -w2 Let l(w) be the third derivative of -w*4/8 + 14w*2. Let y(d) = 3d + 5d2 + 6d*2 - 3d. Give y(l(h)). 99h2 Let x(l) = -l. Let j(r) be the third derivative of 31r*6/360 + 5r*4/6 - 28r*2. Let q(w) be the second derivative of j(w). Calculate q(x(d)). -62d Let v(j) be the first derivative of -j2 - 625. Let k(s) be the third derivative of s5/12 - s*2. Calculate v(k(b)). -10b*2 Let o(s) = -4539s. Let c(j) = -66j - 1. Determine o(c(b)). 299574b + 4539 Let m be (-219)/(-45) + 4/30. Let h(y) = -9 + 9 - my + 13y. Let r(c) = -4c. Give h(r(w)). -32w Let r(c) = c*2 - 1. Let h(n) = 102n + 28. Calculate h(r(p)). 102p2 - 74 Let i(x) = -2x2. Let g(k) = -k2 - 3k + 7. Let b(s) = 4s*2 + 7s - 15. Let u(o) = -3b(o) - 7g(o). What is i(u(y))? -50y4 - 80y*2 - 32 Let m(g) = 8g. Let x(r) = 4487r2. Give x(m(z)). 287168z*2 Let o(k) = 2k + 11 - 5 - 6. Let s(w) = -w. Let y(q) = -8q. Let m(d) = -6s(d) + y(d). Calculate o(m(l)). -4l Let m(g) = -12g. Let l(o) = -6o - 8o + 2o + 2o. Calculate m(l(w)). 120w Let x(w) = 42574w*2. Let v(g) = 3g. Give x(v(c)). 383166c2 Let c(z) = 2z*2. Let v(k) = 192k - 49. Give v(c(o)). 384o2 - 49 Let q(l) = l2 + 2l + 2. Let r(f) = f*2 - 6f - 6. Let v(s) = -3q(s) - r(s). Let b(x) = 6x*2 - 4x*2 + 0x*2. Determine b(v(k)). 32k*4 Let q(r) = -9r. Suppose 2j = -0j - 10. Let m(s) = -4s. Let h(i) = i. Let z = 0 - 1. Let l(y) = jh(y) + zm(y). Give q(l(a)). 9a Let a(c) = -7875c. Let z(q) = -10q. Calculate a(z(t)). 78750t Let h(v) = -3v. Let t(p) = -131350p + 131350p - 39p2. Give t(h(q)). -351q*2 Let l(i) = -4027 + 4027 + 17i*2 - 2i*2. Let o(f) = -4f*2. Calculate l(o(q)). 240q*4 Let o(f) = -3f. Let q(w) = 2 + 0 + 0. Let u(g) = 18 - 11 - 5 - 2g2 + g	{ "pile_set_name": "DM Mathematics" }
ifths of a millennium? 4200 What is 7083.295 tonnes in nanograms? 7083295000000000000 How many centimeters are there in 72/5 of a meter? 1440 How many micrometers are there in 17/4 of a millimeter? 4250 How many millilitres are there in six fifths of a litre? 1200 How many microseconds are there in 70859.86 days? 6122291904000000 How many micrometers are there in 9/10 of a millimeter? 900 What is 4864.311ms in nanoseconds? 4864311000 What is 2268.61 centuries in decades? 22686.1 How many millennia are there in 953516.3 years? 953.5163 What is 707.961 micrometers in nanometers? 707961 What is twenty-one quarters of a centimeter in micrometers? 52500 Convert 5204.767l to millilitres. 5204767 What is 13/4 of a litre in millilitres? 3250 What is 0.5981175 millilitres in litres? 0.0005981175 Convert 12564.585 months to years. 1047.04875 Convert 4.168624 micrometers to kilometers. 0.000000004168624 How many centuries are there in 3/10 of a millennium? 3 How many milliseconds are there in 722199.4ns? 0.7221994 What is 4159.271 minutes in nanoseconds? 249556260000000 What is 1/10 of a millennium in centuries? 1 How many micrograms are there in 25/4 of a milligram? 6250 How many grams are there in 74735.38 tonnes? 74735380000 Convert 515954.9 years to millennia. 515.9549 What is 13753.72 litres in millilitres? 13753720 What is 48.6208 meters in nanometers? 48620800000 How many grams are there in 365.4955 tonnes? 365495500 What is 3/8 of a millisecond in microseconds? 375 What is twenty-seven halves of a litre in millilitres? 13500 How many millilitres are there in 78.92207 litres? 78922.07 Convert 2.366145 months to millennia. 0.00019717875 What is seventeen halves of a tonne in kilograms? 8500 How many nanometers are there in seven halves of a micrometer? 3500 How many litres are there in 0.594527ml? 0.000594527 How many millimeters are there in 0.8387918 meters? 838.7918 Convert 84524.41 years to millennia. 84.52441 What is thirty-seven halves of a litre in millilitres? 18500 What is thirteen fifths of a litre in millilitres? 2600 What is 3/50 of a tonne in grams? 60000 Convert 0.7679987 decades to years. 7.679987 How many hours are there in 0.0959976 minutes? 0.00159996 Convert 62.44111mm to kilometers. 0.00006244111 Convert 5.654197 centimeters to nanometers. 56541970 Convert 520922.4l to millilitres. 520922400 What is 844678.3mg in kilograms? 0.8446783 How many millimeters are there in 46/5 of a meter? 9200 What is 6956.76 millilitres in litres? 6.95676 What is 0.768517ns in microseconds? 0.000768517 How many nanoseconds are there in 27/5 of a microsecond? 5400 What is thirty-one halves of a litre in millilitres? 15500 What is 93625.57 litres in millilitres? 93625570 What is nineteen quarters of a decade in months? 570 Convert 2538185.1 months to decades. 21151.5425 What is 0.0047374ml in litres? 0.0000047374 What is 6/25 of a millennium in months? 2880 How many microseconds are there in 0.1720029 minutes? 10320174 What is eleven halves of a litre in millilitres? 5500 What is 17/2 of a gram in milligrams? 8500 What is 886482.7cm in kilometers? 8.864827 Convert 41.17526kg to nanograms. 41175260000000 Convert 1.018108 millilitres to litres. 0.001018108 What is 0.9440283ml in litres? 0.0009440283 What is 999881.5l in millilitres? 999881500 How many millilitres are there in 6/25 of a litre? 240 Convert 22246.101 months to years. 1853.84175 Convert 0.4540423 grams to micrograms. 454042.3 What is twenty-one eighths of a tonne in kilograms? 2625 Convert 41.037 years to months. 492.444 How many micrometers are there in 82090.55cm? 820905500 How many centimeters are there in 320631.2 millimeters? 32063.12 What is 43186.72 millennia in years? 43186720 What is thirty-two fifths of a microgram in nanograms? 6400 Convert 42.78818ms to nanoseconds. 42788180 Convert 72.6595 decades to millennia. 0.726595 What is 329577.8g in micrograms? 329577800000 What is 61.4846673 minutes in weeks? 0.006099669375 How many nanoseconds are there in 0.7862997 hours? 2830678920000 Convert 869645.8 milligrams to nanograms. 869645800000 How many litres are there in 83.36718ml? 0.08336718 What is 0.5523981l in millilitres? 552.3981 What is twenty-three eighths of a meter in millimeters? 2875 Convert 21976.03 centuries to millennia. 2197.603 What is 552.2639 centuries in millennia? 55.22639 How many centimeters are there in seven quarters of a meter? 175 What is 2/125 of a millennium in years? 16 What is 575206.3l in millilitres? 575206300 What is 1/4 of a millisecond in microseconds? 250 Convert 2942.22 millilitres to litres. 2.94222 What is 4134.6095 days in weeks? 590.6585 What is 2.1004659 nanoseconds in minutes? 0.000000000035007765 Convert 57313.09 centuries to months. 68775708 What is 4376.795 nanometers in millimeters? 0.004376795 How many millilitres are there in one twentieth of a litre? 50 How many meters are there in 86.32354 centimeters? 0.8632354 What is 99.67999 millilitres in litres? 0.09967999 How many centimeters are there in 43/2 of a meter? 2150 Convert 4.76927g to milligrams. 4769.27 How many millilitres are there in 0.0061681l? 6.1681 What is 21/8 of a kilogram in grams? 2625 How many millilitres are there in 33/5 of a litre? 6600 What is 3/5 of a century in decades? 6 How many millilitres are there in thirteen fifths of a litre? 2600 Convert 77189.99 nanograms to tonnes. 0.00000000007718999 Convert 6.749757 meters to kilometers. 0.006749757 What is 96609.51ms in days? 0.001118165625 How many minutes are there in seventy-nine thirds of a hour? 1580 What is seventy-three quarters of a microgram in nanograms? 18250 What is 1/5 of a kilometer in centimeters? 20000 What is 516.6852nm in micrometers? 0.5166852 What is twenty-five quarters of a litre in millilitres? 6250 How many tonnes are there in 128.3384 milligrams? 0.0000001283384 What is 17/4 of a kilogram in grams? 4250 What is 4/15 of a decade in months? 32 What is 26/5 of a millisecond in microseconds? 5200 Convert 0.8454742ml to litres. 0.0008454742 What is 25.983g in tonnes? 0.000025983 How many months are there in 1/4 of a year? 3 What is 8297.997 seconds in nanoseconds? 8297997000000 Convert 58.47466 nanometers to millimeters. 0.00005847466 How many millimeters are there in 1/10 of a kilometer? 100000 How many meters are there in 215.2683um? 0.0002152683 What is eighteen fifths of a decade in months? 432 What is twenty-seven fifths of a millennium in years? 5400 How many seconds are there in seventeen sixths of a hour? 10200 What is twenty-nine halves of a millennium in decades? 1450 What is 38.83271g in micrograms? 38832710 What is thirty-three fifths of a millennium in centuries? 66 How many microseconds are there in 975.2717 seconds? 975271700 What is four thirds of a hour in minutes? 80 What is five eighths of a centimeter in micrometers? 6250 How many micrometers are there in fourty-six fifths of a millimeter? 9200 What is 77.43953 decades in centuries? 7.743953 What is 11517.31 kilograms in micrograms? 11517310000000 What is 62.75115 litres in millilitres? 62751.15 What is thirteen fifths of a kilogram in grams? 2600 What is thirteen eighths of a decade in months? 195 What is 86119.93 tonnes in kilograms? 86119930 How many milliseconds are there in 0.6522693 weeks? 394492472.64 Convert 4.366649 litres to millilitres. 4366.649 What is 3/32 of a gram in micrograms? 93750 How many kilograms are there in 6266.777ug? 0.000006266777 What is 4552.604 days in milliseconds? 393344985600 How many kilograms are there in 53/4 of a tonne? 13250 How many millennia are there in 172.0767 decades? 1.720767 Convert 47673.58km to centimeters. 4767358000 What is 800.5225 nanometers in kilometers? 0.0000000008005225 What is 1613.454255ns in weeks? 0.0000000000026677484375 Convert 2180597.1 microseconds to minutes. 0.036343285 How many milliseconds are there in 70110.01 hours? 252396036000 Convert 0.7516212 millilitres to litres. 0.0007516212 What is 1.006142 years in centuries? 0.01006142 How many nanometers are there in 15/4 of a micrometer? 3750 How many millilitres are there in seventeen halves of a litre? 8500 What is twenty-five halves of a litre in millilitres? 12500 What is twenty-six fifths of a day in min	{ "pile_set_name": "DM Mathematics" }
) - sqrt(21))-6))/(sqrt(21)/sqrt(3)4 + (-2sqrt(567) - sqrt(7) - sqrt(7))). 25sqrt(3)/16 Simplify (1 + (sqrt(6)/sqrt(3)-6 - (sqrt(2) + -4 + sqrt(2))-4))*2. -60sqrt(2) + 233 Simplify ((-1(5sqrt(209)2 + sqrt(209)))/((sqrt(704)1 - sqrt(704)) + sqrt(704) + -2sqrt(11)-2))*2. 2299/144 Simplify 5(sqrt(30) - sqrt(120)/sqrt(4))/sqrt(10) - ((1sqrt(3) - sqrt(3))-6 + (sqrt(192) - 2sqrt(192)))2. -192 Simplify (-4(sqrt(114) - (sqrt(114) + sqrt(114) + sqrt(114) + (sqrt(114) - (sqrt(114) + sqrt(114)-2) - sqrt(114))))1)/(sqrt(48)/((-1sqrt(8) - sqrt(8))-1)). 24sqrt(19) Simplify (2(sqrt(136)-2 - sqrt(136) - sqrt(136))4)/(sqrt(128) - (sqrt(128) + -2sqrt(128) - sqrt(128)) - (2sqrt(8)6 - sqrt(8))). -32sqrt(17) Simplify 2((sqrt(208) - 1sqrt(208))*2 - sqrt(208))-2 - (sqrt(65)/sqrt(20) + (sqrt(143)/(sqrt(11) - (sqrt(275) - sqrt(11) - sqrt(11))))*2). -13/4 + 31sqrt(13)/2 Simplify (-2-1sqrt(1344))/(sqrt(42)/(sqrt(18)/(sqrt(3) - (sqrt(3) - (sqrt(3) + sqrt(27)))) + sqrt(6))). 20sqrt(3) Simplify (4 + -2-4(3 + sqrt(4032)2))*2. 21504sqrt(7) + 1032976 Simplify ((0 + sqrt(242)-3 - sqrt(242)) + (sqrt(242) - (sqrt(242) + (sqrt(242) - (3 + sqrt(242))))3))5. -330sqrt(2) + 45 Simplify -6(2 + 4(1 + sqrt(539) + 5)) + 5. -168sqrt(11) - 151 Simplify ((sqrt(243) - (1 + sqrt(243))) + 5 - sqrt(12)/(-5sqrt(4)-1))-6. -24 + 6sqrt(3)/5 Simplify 4(2 + sqrt(637) + sqrt(637) + 1 - (-1sqrt(637)-1 + sqrt(637))). 12 Simplify (-2(-1sqrt(704) - sqrt(704)) - (sqrt(11) + -1 + 3 - sqrt(11) - (sqrt(88)/sqrt(4) - sqrt(22))/sqrt(2)))*2. -128sqrt(11) + 11268 Simplify 4 + (sqrt(208) - (sqrt(208) + (-5sqrt(208)-3)*2)) + ((sqrt(208) + -2)6)*2. -39164 - 576sqrt(13) Simplify ((1(sqrt(288)2 + sqrt(288) + sqrt(288) + sqrt(288)) + sqrt(288))-4-5-1)2 + 5. 4147205 Simplify -4(sqrt(243) + 0 + 1 + sqrt(243) - sqrt(243))4. -144sqrt(3) - 16 Simplify (sqrt(90)/(sqrt(18)/sqrt(6))1)/((sqrt(100)/(sqrt(30)/sqrt(3)) + sqrt(10))1). sqrt(3)/2 Simplify -2(-1 + (-2sqrt(22)2)/(sqrt(150)/sqrt(3) + sqrt(2))). 2 + 4sqrt(11)/3 Simplify (sqrt(42)/(sqrt(14)/sqrt(2))2)/(4(sqrt(2) + -2sqrt(2) + sqrt(2)) - (sqrt(2) - 5sqrt(18))). sqrt(3)/7 Simplify 1(((-2sqrt(2) - sqrt(2))1 - (sqrt(162) + 1)) + (sqrt(24)/(-2sqrt(12)) - (sqrt(32) + 1)*2)). -34 - 41sqrt(2)/2 Simplify (0 + sqrt(448) + (sqrt(252) + -1 - sqrt(252)) + sqrt(252) + (sqrt(1008) + -1)3)2-5 + 5. -87575 + 2000sqrt(7) Simplify (-5((sqrt(1331) + 1 - sqrt(1331))4 + -1(1 + sqrt(1331) + sqrt(1331)) + sqrt(1331) + -5 + (sqrt(1331) + 1)4))2. 3300sqrt(11) + 299575 Simplify -4(sqrt(40)/(sqrt(32)/sqrt(4)) - -2sqrt(125))*2 + -4. -2424 Simplify (-1 + -5(sqrt(200)1 + 0 + sqrt(200)-1 + 4))*2 + 5. 446 Simplify ((sqrt(343) + 0)2 - (2 + sqrt(1008) + 4)) + 2. -4 + 2sqrt(7) Simplify (sqrt(684) + (-2sqrt(684) - sqrt(684)))*2 + (sqrt(171)-2)/sqrt(9) + (-4(sqrt(2736) + -1))2. -386sqrt(19) + 46528 Simplify (5(-2 + sqrt(2448) + sqrt(2448)) + 2 - -4(sqrt(1700)-1 + 3sqrt(272)))*2. -2048sqrt(17) + 278592 Simplify (-42(sqrt(114) + -2sqrt(114)))/(-6-2sqrt(486)). 2sqrt(19)/27 Simplify (-1(sqrt(21) - (sqrt(84) - sqrt(21) - sqrt(21))))/((sqrt(27) - (sqrt(27) + sqrt(243)))/sqrt(9)) + 5. sqrt(7)/3 + 5 Simplify (2 + -2 + 5 + sqrt(27) - (sqrt(24)/(sqrt(8) + sqrt(16)/sqrt(2)) - (sqrt(42)/sqrt(2))/sqrt(7)))2. 35sqrt(3) + 247/4 Simplify (-2sqrt(2304)-3)/((1(sqrt(48) + (sqrt(768) - sqrt(48))))/sqrt(6)). 18sqrt(2) Simplify (sqrt(77)2-5 + -2sqrt(77)1)/(-4-2sqrt(28)). -3sqrt(11)/4 Simplify 1(-1sqrt(931) + 3sqrt(76) + 2). -sqrt(19) + 2 Simplify ((5 + (0 + sqrt(2))5-6)2 + 4)2. -1680sqrt(2) + 7396 Simplify (sqrt(2662) + -1-1sqrt(2662))/(sqrt(88)/(sqrt(8)-1)-2). 11sqrt(2) Simplify (-2sqrt(242)-2 + (sqrt(242) + 0)4 + sqrt(242) + 4)*2. 792sqrt(2) + 19618 Simplify ((1 + sqrt(1377))-1 + sqrt(1377))2 + -4sqrt(17)56. -120sqrt(17) + 1 Simplify (-4 + (sqrt(432) - (sqrt(432) + sqrt(432) + -3 + 1 + sqrt(432) + sqrt(432) + sqrt(432))2) + 2)-4. -1008sqrt(3) + 43224 Simplify (sqrt(240)-1)/(sqrt(432)-6). sqrt(5)/18 Simplify 0 + -5(5 + sqrt(847) + 2 - -2(sqrt(847)1 + sqrt(847)))*2. -106120 - 3850sqrt(7) Simplify 4(-1sqrt(567) + sqrt(567))*2 - (-1sqrt(28)/sqrt(4)-5)2. -175 Simplify -4 + ((sqrt(20) + -1sqrt(20) + sqrt(20) + sqrt(20))-5)/(sqrt(640)2 - sqrt(640)) + -4. -8 - 5sqrt(2)/4 Simplify -6(sqrt(5040)-3)/(sqrt(25)/sqrt(80)). 864sqrt(7) Simplify (sqrt(405) + -1 + 2)*2 + 2(sqrt(405) - (-2sqrt(405))2) + -2. -2836 + 36sqrt(5) Simplify -6(1 + (sqrt(68) + 1 - sqrt(68)) + 4 + (sqrt(68) + 1)2 + -3). -432 - 24sqrt(17) Simplify ((sqrt(117)-3)/sqrt(3))/sqrt(3) - 4-3((sqrt(13) + 2)2 + sqrt(13) - sqrt(13)). 45sqrt(13) + 204 Simplify (1sqrt(76)2 + 4 + 1)*2. 40sqrt(19) + 329 Simplify ((4 + (sqrt(50) - sqrt(2))4 - (sqrt(288)-1 + sqrt(288))3)-2)*2. 512sqrt(2) + 2112 Simplify sqrt(245) + ((-2 + sqrt(245))-3)2 + ((-5(sqrt(5) + 0 + sqrt(5)))*2 - (sqrt(180) + sqrt(45) - sqrt(45))/sqrt(9)) + 3. -247sqrt(5) + 2744 Simplify (sqrt(204)34)/(sqrt(132)/(1sqrt(11))). 12sqrt(17) Simplify ((sqrt(448)/sqrt(392))/(sqrt(800)-1))2. 1/700 Simplify (16(-2 + 3 + sqrt(80) + sqrt(80) + 0 + -5))2. -2304sqrt(5) + 12096 Simplify (1 + -6(-1 + sqrt(5)) - sqrt(45)/(1(sqrt(9) + (sqrt(9) - sqrt(81))))) + -5. -5sqrt(5) + 2 Simplify -2 + -5 + sqrt(1300)3 + -4. -11 + 30sqrt(13) Simplify ((sqrt(2940) - 4sqrt(2940))-4)/(2sqrt(1728)-5). -7sqrt(5)/10 Simplify 6(-1 + (-1 + (sqrt(2) - (-1 + sqrt(2))))-1). -6 Simplify (sqrt(95)2-5 + -3(sqrt(95)1 + sqrt(95)))/(sqrt(500) + (sqrt(500) - sqrt(500)-4)-4 + sqrt(500) - sqrt(500)). 8sqrt(19)/95 Simplify (sqrt(133) + 5sqrt(133)-2)/sqrt(7) + (sqrt(152) + sqrt(152) + (sqrt(152) - sqrt(152)-2)5 + sqrt(152) - sqrt(152))/sqrt(8). 8sqrt(19) Simplify (5(sqrt(931) + 2 + sqrt(931))-6 + 3)*2 + -1. 47880sqrt(19) + 3354848 Simplify ((sqrt(784) - 4sqrt(784)-2) + sqrt(784))/((sqrt(80)15)/sqrt(10)). 14sqrt(2) Simplify ((sqrt(352) + sqrt(352)2 + sqrt(352))-3 + sqrt(352))/(sqrt(33)/sqrt(3)1) + 0. -44sqrt(2) Simplify (3 + -5(5(1 + sqrt(684)) - (sqrt(684) + -1 + -3))-4)*2. 175680sqrt(19) + 4411089 Simplify -4(-4(-3(sqrt(77) + (-1sqrt(77) - sqrt(77)) + sqrt(77)) + sqrt(77)))/(-2sqrt(704)-1). sqrt(7) Simplify ((-1(sqrt(242) - (sqrt(242) + 0)) + -5)-24 + 3)2. 1849 Simplify -5 + (-2(2sqrt(243) + -4 + 3 + sqrt(243)-2) + 2)*2. 11 Simplify (4(sqrt(216) + 1sqrt(216)) - sqrt(216))/((sqrt(108) + 2sqrt(108))-4). -7sqrt(2)/12 Simplify (-4(sqrt(132) - sqrt(132)1-4))/(sqrt(12) + (sqrt(24)/(sqrt(8)/sqrt(4)) - sqrt(12)) + sqrt(12) + (sqrt(12) - -1sqrt(300))). -5sqrt(11)/2 Simplify ((1sqrt(112))/sqrt(7))/(sqrt(72) + -1sqrt(72) + sqrt(72) + sqrt(72) - sqrt(72))-21. -2sqrt(2)/3 Simplify -1 + ((sqrt(4000) - sqrt(4000)-1)/sqrt(4))/(sqrt(50)/(sqrt(10) - 2sqrt(10)) + ((sqrt(5) + -2sqrt(5))4 - sqrt(5))). -10sqrt(2)/3 - 1 Simplify (2sqrt(114) - sqrt(114))/sqrt(6) + -3 - (sqrt(19)-24 - 4(sqrt(19) + 0)). -3 + 13sqrt(19) Simplify (5(1sqrt(1700) + sqrt(1700) + sqrt(34)/sqrt(2)6))2 + (3 + sqrt(2448)-1 + -1 + sqrt(2448) + sqrt(2448) + 2sqrt(2448))2. 144sqrt(17) + 309336 Simplify (-6sqrt(20)/sqrt(64) + 2 + -2sqrt(405))-2. -4 + 39sqrt(5) Simplify (-3sqrt(896) + sqrt(56) - sqrt(56))/(sqrt(24)/sqrt(27)). -36sqrt(7) Simplify ((sqrt(2448) - -2sqrt(2448)-6) + (sqrt(85)-21 - sqrt(85))/sqrt(5))*2-5. -1549125 Simplify 4 + (-2-4(sqrt(117)-24 - sqrt(117)1-6))*2. 29956 Simplify (-1-61sqrt(153))/(sqrt(18)/sqrt(2)6 + sqrt(9) + sqrt(1296)1 + sqrt(1296))-6. -36sqrt(17)/31 Simplify -2 + -2 + sqrt(1700) - 22sqrt(17)-3. -4 + 22sqrt(17) Simplify ((sqrt(75) - (-3 + sqrt(75) - sqrt(75)) - sqrt(75)) + 0 + (2sqrt(75)5 - sqrt(75)))*2. 270sqrt(3) + 6084 Simplify (sqrt(36) + 1sqrt(2304))/sqrt(12) + (-1 + sqrt(147))2 + 5. -5sqrt(3) + 153 Simplify (sqrt(112) + -4)*2 + sqrt(42)/(-3sqrt(6)) + -4 + -4. -97sqrt(7)/3 + 120 Simplify 61((5 + sqrt(44))2 - -1sqrt(11)-3)6. 612sqrt(11) + 2484 Simplify 3 + (sqrt(1008)-55 + (sqrt(1008) + sqrt(1008) + 1 + sqrt(1008) + 5 - sqrt(1008)))2. -3312sqrt(7) + 533271 Simplify (5 + 2 + 4 + ((sqrt(114) - sqrt(114)4)4)/sq	{ "pile_set_name": "DM Mathematics" }
ors of t? 2, 7 Suppose 3u + 9 = 3w, 5w - 21 = 2u - 3u. Suppose wv - 5v = -11. List the prime factors of v. 11 Let a = 1 - 3. What are the prime factors of 2(a + 27/2)? 23 Let w be (-10)/52/(-4). Let j = -1 + 11. Let b = j + w. List the prime factors of b. 11 Let k be (-3 + 1)(-1)/(-2). Let j = k + 5. What are the prime factors of j? 2 Suppose -g - 5m = -48, -3g - 2m - 2m = -122. List the prime factors of g. 2, 19 Suppose -10y = -7y - 42. Suppose 2x + 14 = 4o, -o + 3x + 2 = -4. Let b = y - o. What are the prime factors of b? 11 Let l = -82 + 136. What are the prime factors of l? 2, 3 Let g(v) = -3v + 11. Let c(p) = -3p + 10. Let o(s) = 4c(s) - 3g(s). List the prime factors of o(-3). 2 Let g(l) be the third derivative of -11/6l*3 - 3/8l*4 - 2l*2 + 0l + 0 + 1/60l5. List the prime factors of g(11). 11 Let f(v) = -v3 + 3v*2 - 4v + 2. Let y = -1 + 3. Let m be f(y). List the prime factors of (m/(-5))/(2/60). 2, 3 Let j(t) be the second derivative of 0t3 - 1/10t5 - t2 - 1/12t4 + 0 + 3t. List the prime factors of j(-2). 2, 5 Suppose -43 = -5h + 4h. Suppose -2 = i - h. List the prime factors of i. 41 Suppose 4y + 28 = -3v, 0y + 4 = -4y + 3v. List the prime factors of y/5(-70)/4. 2, 7 Suppose -4x + 40 = -5x. Let h = x + 57. List the prime factors of h. 17 Suppose 0 = 3o - o + 2w - 18, -o = -5w + 21. Suppose -oa + 51 = z, -a + 0z - 2z + 11 = 0. What are the prime factors of a? 13 Suppose 11f - 9f - 390 = 0. List the prime factors of f. 3, 5, 13 Let q(o) = -o*3 + 9o*2 + 9o + 8. Let b be q(10). Let v be -29(-3)/(-6)b. Let u = 43 - v. List the prime factors of u. 2, 7 Let y(q) = 2q2 + 7q - 10. Let l be y(-7). Suppose -2d - d + l = 0. What are the prime factors of d? 13 Suppose -2x = -5x + 21. Let i = x + -4. What are the prime factors of i? 3 Let k(f) = 3f - 20. What are the prime factors of k(12)? 2 Suppose -3n - 4 = 2h, -4n + 4h = 11 - 39. Suppose -p + 5 = -nu, 5p - 2u + u = 16. Suppose 24 = pg - g. What are the prime factors of g? 2, 3 Let a(h) = -9h - 1. Let i(c) = -19c - 2. Let y(z) = -5a(z) + 2i(z). Let t(o) = o - 7. Let s be t(8). What are the prime factors of y(s)? 2 Let u(r) = r*2 - 2r + 2. Let q be u(3). Suppose 2g = 4t + 66, 0g - 100 = -qg - 3t. List the prime factors of g. 23 Suppose 2a + 114 = 6a - 3x, a - 37 = 5x. What are the prime factors of a? 3 Suppose -2 = 2d - 20. Suppose dq - 6q = 45. List the prime factors of q. 3, 5 Let p(g) = g*2 + 18g - 5. What are the prime factors of p(9)? 2, 7, 17 What are the prime factors of (73/4 - (-14)/56)14? 7, 37 List the prime factors of (1 - 80/4)/(-1). 19 Let i(r) = -r2 + 3r - 3. Let m be i(3). Let x = -3 - m. Suppose x = -3v + v + 8. List the prime factors of v. 2 List the prime factors of (5 - 7 - 4)(-63)/2. 3, 7 Suppose -9f = -8f - 179. List the prime factors of f. 179 Let v = -59 - -187. Suppose -5f + v = -f. List the prime factors of f. 2 Let f(c) = -c3 - 6c*2 - 4c + 5. Let i be f(-5). Suppose i = -3o - o. Suppose l - 4 - 6 = o. What are the prime factors of l? 2, 5 Suppose 5g - 20 = -5q, 0 = -g + 6g - 3q - 12. Let f(t) = t3 - 3t*2 + 3t - 4. Let z be f(g). Suppose zb = -0b + 45. What are the prime factors of b? 3 Let d be 1/(-2 + 5)9. Let w be 61/(-2) + d. Suppose -3n + wn + 48 = 0. What are the prime factors of n? 2 List the prime factors of ((-8)/10)/((-14)/805). 2, 23 Let t(h) = 2h2 - 3h + 1. Let a(w) = -w - 1. Let f be a(-4). Suppose -2x = -x - f. What are the prime factors of t(x)? 2, 5 Let r be (2 - 2)/(-2) - -4. Let p = 3 + r. Suppose -p - 1 = -4s. What are the prime factors of s? 2 What are the prime factors of 133/2 + (-7)/14? 2, 3, 11 Suppose -4i - i = -25. Suppose f - 2b = 10, if - 62 = 3b + b. What are the prime factors of f - (2 - 1)-1? 3, 5 Let u(v) be the second derivative of v4/6 - v3 - 3v*2 - v. What are the prime factors of u(5)? 2, 7 Let x = -4 - -3. Let b be 122x - 0. Let p = -10 - b. List the prime factors of p. 2, 3 Let d(i) = 3i - 6. Suppose -5x = 3f - 2, 2x = 4x + 2f - 4. Let o = x + 6. List the prime factors of d(o). 2, 3 Let t be 1/224. Suppose -2d - 8 = -d + tz, 3d + 2z = 26. List the prime factors of d. 2, 3 Let s(k) = k3 - k + 11. What are the prime factors of s(0)? 11 Let u(m) = -m2 - 17m + 15. What are the prime factors of u(-14)? 3, 19 Let f(p) = -p*2 - p + 6. Let n be f(-4). List the prime factors of (-1414)/(-42) - (-4)/n. 3, 11 Suppose -16 = 3d + d. Let k = -2 + 3. Let u = k - d. What are the prime factors of u? 5 Let k(h) = -h*3 + 7h*2 + 8h + 10. Let m be k(8). Suppose -m = -2a - 0a. Suppose 11 = -5d - 4, ap + 3d - 6 = 0. What are the prime factors of p? 3 Let n(w) = w2 - 4w + 4. Suppose -d + 20 = 5o, 7d - 4d + 20 = 5o. What are the prime factors of n(o)? 2 Let y = 2 - 0. Let n be 15/96/y. List the prime factors of (6/n)/((-8)/(-140)). 3, 7 List the prime factors of ((-1938)/(-10) - 5) + (-1)/(-5). 3, 7 Let h = 0 + 2. Suppose 3j - k - 26 = j, hj - 4k = 20. List the prime factors of j. 2, 7 Let h(d) be the first derivative of -d*3/3 + 5d*2 - 3d - 4. What are the prime factors of h(8)? 13 Suppose 0d - 18 = 3d. Let x(w) = -w - 4. Let h be x(d). Let n(l) = 3l2 + 2l - 2. What are the prime factors of n(h)? 2, 7 Suppose 0 = -4z + 3z. Let y(i) = i*2 - i + 18. Let t be y(z). Suppose -r - 2v + 3 = -0r, t = 4r + 5v. What are the prime factors of r? 7 Let g = -27 + 40. List the prime factors of g. 13 Let o = 293 + -107. List the prime factors of o. 2, 3, 31 Let g(y) = 118y3 + y2 + 2y - 1. List the prime factors of g(1). 2, 3, 5 Suppose 11 = 3x - 4. Suppose n - 3n - 44 = -xm, -m = -n - 10. Let l = 2 + m. What are the prime factors of l? 2, 5 Let m = -20 - -33. List the prime factors of (m + -1)/((-6)/(-16)). 2 Suppose -5t - a = -25, 2t + 3a = 6t - 39. Suppose -tj = -j - 55. What are the prime factors of j? 11 Suppose 0 = 3n + 2n - 10. Suppose s + 3 = 5o, 2s - 3 = -no + 3s. Suppose ow = w - 2. What are the prime factors of w? 2 Suppose 0 = h - 4h + 66. Let a = -9 + h. What are the prime factors of a? 13 Let x(w) = 5w*2 - 4w. What are the prime factors of x(-2)? 2, 7 Let a be 68/(-18) + (-6)/27. Let h = a - -4. Suppose h = c - 5s - 30, c + c + 3s = 8. List the prime factors of c. 2, 5 Suppose -g + 18 = 2g. What are the prime factors of g/9 - (-52)/3? 2, 3 Suppose -k = 71 - 204. List the prime factors of k. 7, 19 Suppose -4r + 5l = -0r - 111, 3l = -2r + 61. What are the prime factors of r? 29 Let m = -172 + 111. Let n = -29 - m. List the prime factors of n. 2 Let j be 10((-14)/4 - -2). Let z = -21 - j. List the prime factors of z/8(-12 - -8). 3 Let q(r) be the second derivative of r*4/12 + 4r3/3 - r2 - 2r. What are the prime factors of q(-9)? 7 Suppose 1 = -6k - 5. Let r(a) = 37a2 + a - 1. List the prime factors of r(k). 5, 7 Let h(a) = 8 + 2a - 5a2 + 6a*2 - a. What are the prime factors of h(0)? 2 Let u = 19 + -1. Suppose 0k - k + u = 0. List the prime factors of 32/k - (-6)/27. 2 Let t = -1 - 29. What are the prime factors of (108/t)/((-1)/5)? 2, 3 Suppose -2v + v - 4 = 0. Let x(u) = u3 + 4u*2 + 6u + 4. Let t be x(v). What are the prime factors of 11/4 - 5/t? 3 Suppose -10 = 2v + 3w - w, 2v - 3w = 0. Let g be -4((-2)/(-1) + v). Suppose 4a + 3l = 13, 7a + 4l - 1 = ga. What are the prime factors of a? 7 Let i be 19 - (-2)/(6/9). Let x = i - 7. List the prime factors of x. 3, 5 Let s(j) = 9j - 17. Let f(i) = 9i - 17. Let a(z) = 6f(z) - 5s(z). List the prime factors of a(6). 37 Let z be 4/(-2) - (-6 + 0). Let a(d) = d - 1. Let n be a(z). Suppose 3k - f = -k + 3, 0 = -nk - f + 11. List the prime factors of k. 2 Let r(h) = h3 - h2 + 3. Let s be r(-3). Let u = 48 + s. What are the prime factors of u? 3, 5 Suppose -k + u - 2 = 0, -2k = -k - 3u + 10. Suppose -2l = kl - 72. What are the prime factors of l? 2, 3 Suppose 0 = -z + 11z - 3470. What are the prime factors of z? 347 Let b(c) = 0 - 4c + 0c - 1 + c3 - 4c*2. Let y be b(5). Suppose x - y = 0, 2a - 4x - 2 = x. List the prime factors of a. 11 Let d = 8 + -6. List the prime factors of 2 + 1 + d + 10. 3, 5 Let h(q) = -4q. Let r	{ "pile_set_name": "DM Mathematics" }
divide ((-8)/q)/((-2)/39)? False Let c(f) = 2f + 16. Let x be c(-6). Suppose 2v + 2 = -x, -3w + v + 156 = 0. Does 4 divide w? False Suppose 0y = 4f - 5y - 697, -5y = -5f + 865. Is f a multiple of 70? False Let p(z) = -z*2 - 6z - 3. Let b be p(-6). Let x be (-1)/((-1)/b)1. Is 15 a factor of 450/10 - (-1 - x)? False Suppose 138l - 112l = 14950. Is 103 a factor of l? False Let d(r) = r2 + 9r - 11. Suppose x = 2t + 24 - 2, -x + 52 = -5t. Let b be d(t). Let a = 38 - b. Does 14 divide a? False Suppose 28 = -a - 0a. Is (144/a)/(2/(-35)) a multiple of 15? True Let p(m) = -2m + 18. Let q be p(8). Suppose -qa = 5f - 67, 121 = 5a + f - 4f. Does 8 divide a? False Is 1469/(-26)2/(-1) a multiple of 13? False Let s(t) be the first derivative of 1 + 7t + 3/2t2. Is s(13) a multiple of 9? False Let w(v) = -2v*3 + 2v*2 - 2v + 4. Let o be w(3). Let k = 73 + o. Does 4 divide k? False Let l be -2 + (3 - 0 - 1). Let g be -2 - -1177 - (l - 1). Does 14 divide g/35 + 2/5? False Suppose 2t = -0t - 112. Let d = -99 - t. Let f = -21 - d. Is 11 a factor of f? True Let i(c) = -3c - 8. Let n be i(-6). Let a = 13 - n. Is -3 + (a - -2) - -28 a multiple of 19? False Suppose 6z - 42 = 3z. Suppose -906 = -20a + z. Does 3 divide a? False Suppose 31 = -2w + 3y - 48, -5w - 202 = -3y. Let m = 82 + w. Let c = -26 + m. Is c a multiple of 15? True Let k be 4 - (-1)/((-5)/5). Suppose 5d - 130 = -kb, -3b + 13 + 13 = d. Is d a multiple of 2? True Let y(k) = k2 + 4k + 4. Let i be y(-3). Let f(b) = 4b - i + 2 - b2 - 3b + 57b2. Does 11 divide f(-1)? False Let a(s) = -15s + 62. Is 5 a factor of a(-4)? False Let d be (51/(-34))/(6/12464). Is 16 a factor of 2 - (-8)/(-3) - d/12? False Suppose -4y - 4y + 680 = 0. Let v = y - 70. Is 3 a factor of v? True Suppose -3l + l + 5h + 20 = 0, 0 = 5l + 5h + 20. Suppose -2s + 187 = 177. Suppose -3z = l, 0 = si - 0i - 5z - 240. Does 24 divide i? True Let g(b) be the first derivative of 14b*2 - 16b + 34. Does 20 divide g(7)? True Suppose -3r = -8r + 150. Suppose -3t + t + r = 0. Does 4 divide t? False Let n(a) = 3a - 6. Let d be n(8). Let l(h) = -18 - 25h + dh + 14h. Does 22 divide l(12)? True Let w = 240 - 90. Is w a multiple of 50? True Let i(h) = -h3 + 32h*2 + 70h - 27. Is i(33) a multiple of 6? True Let d be ((-4)/10)/(2/(-140)). Let w = -2 + d. Is w a multiple of 5? False Let b(y) be the first derivative of y3/3 + y2/2 + 42y - 1. Let k(p) = -p2 - p. Let z be k(0). Does 13 divide b(z)? False Let q(n) = -5n + 318. Is 19 a factor of q(37)? True Let g = 2 - 4. Let w be 31 + (108/(-45))/((-12)/20). Is 7 a factor of (w/(-2))/(1/g)? True Suppose 196 = -165h + 172h. Is h a multiple of 4? True Let w(s) = 2s2 - 48s - 32. Does 60 divide w(-13)? False Suppose 3n + 3j = 6, 0n - 3n + 38 = -5j. Does 6 divide (-70)/(-4) - n/(-9 + -3)? True Let w = 36 + -32. Is 6 a factor of 36/(-1 + (w - 1))? True Let s be (2 - 11/1) + 3. Let a be (-9)/(-2)(-4)/s. Suppose 2h + 56 = 4i, ah = 5i - 9 - 61. Is 4 a factor of i? False Let i(h) = 2h + 12. Let t be i(-5). Suppose -5k - 4g = -10k + 127, -tk + 62 = 4g. Does 7 divide k? False Suppose -6w + 2w - 20 = 2q, -5q - 62 = -2w. Let k(o) = -15o - 25. Does 38 divide k(q)? False Suppose -d + 5r = d - 857, 5 = r. Suppose 14x + d = 21x. Is 9 a factor of x? True Let m be ((-33)/4)/(3/(-16)). Let a = m - -10. Suppose -2j + 4s = -30 + 8, 3j - a = -s. Is 6 a factor of j? False Is 4 a factor of -4(-6 + (-9)/(-9))? True Let q(p) be the third derivative of p6/120 - 17p*5/60 - 49p*4/24 + 3p*3 - 19p*2. Is q(20) a multiple of 17? True Let n(j) = -4j + 10. Let g be n(4). Let s(x) = -4x - 3. Let b(k) = -k - 1. Let l(q) = gb(q) + s(q). Is l(6) a multiple of 6? False Let s be (-9 - -10)(1 - -3). Let y be (-6)/(41/s). Let d(i) = i*2 + 6i + 4. Is d(y) a multiple of 3? False Suppose 10b - 4 = 96. Suppose 0 = -4m - bm + 672. Is m a multiple of 6? True Let c(n) = -36n - 4. Does 31 divide c(-3)? False Let w be 0 + 2 + -2 + 8. Let g(r) = r*2 - 7r - 3. Let x be g(w). Let s(v) = v*2 + 2v + 7. Is s(x) a multiple of 9? False Let z be (4 + -3)/(1/52). Suppose -284 = -5l - 3w, -w - 55 = -2l + z. Does 11 divide l? True Let m be (-299)/(-65) + (-3)/5. Suppose 0 = y - 7 + m. Suppose 0 = ya - w + 13 - 119, 4 = -4w. Is 26 a factor of a? False Let d(q) be the second derivative of q4/12 - q3/3 + q2/2 + 2q. Let l be d(3). Suppose 2p - l = 2. Is p even? False Let j(s) = 9s - 9. Suppose -6z + 3 = -5z. Let w be j(z). Suppose -wf - 104 = -22f. Does 4 divide f? False Let n(w) = -w*3 + 8w*2 - w + 10. Let r be n(8). Suppose 2a - 454 = -2b, 10b - 5b = -ra + 1144. Is b a multiple of 23? True Suppose 5778 = 21l - 10602. Is 78 a factor of l? True Suppose -5s - n - 512 = 2n, 4n + 416 = -4s. Let t(g) = 2g*2 + 40g + 18. Let p be t(-14). Let v = s - p. Does 16 divide v? False Let g(i) be the first derivative of i*4/4 - 2i3 + i2 - 3i + 85. Suppose 0w - 24 = -4j + w, -5j = -3w - 30. Is g(j) a multiple of 6? False Let i be (-16)/32 - (-9)/2. Suppose -ic + 4m + 448 = 0, c + c + m - 221 = 0. Is 12 a factor of c? False Let s(c) = -4c - 7. Let g be s(-3). Suppose 0x = 4y - 2x - 256, -gy + 350 = 5x. Is y a multiple of 33? True Let t(o) = -o2 - 10o + 1600. Does 20 divide t(0)? True Is 13 a factor of ((-2028)/(-48))/(-3 + 25/8)? True Suppose -3b = -5a + 5073, 4b + b = -a + 1009. Is a a multiple of 78? True Let u(w) = -9w3 + w2 - 2w. Let o = -6 - -8. Let m be u(o). Does 10 divide ((-14)/3)/(16/m)? False Let m = 669 - 629. Is m a multiple of 10? True Is 2 a factor of (-663(-6)/9 + 1)1? False Let o(p) = -15p - 175. Let l(u) = -5u - 58. Let c(g) = 7l(g) - 2o(g). Is 3 a factor of c(-16)? True Suppose 16r = -5a + 20r + 2084, -4a - 3r = -1692. Is 28 a factor of a? True Suppose 12v = 570 + 822. Is v a multiple of 6? False Let k = 774 - 351. Is k a multiple of 47? True Let v(d) = -d2 - 7d. Is v(-3) a multiple of 4? True Suppose 0 = 3q + 4h - 785, -q - 3h + 6h + 240 = 0. Suppose 2g + 194 = -3k, -q = 2k + 2k - g. Does 8 divide (-2)/8 + (-2192)/k? False Suppose 5k = 9837 - 3087. Is 54 a factor of k? True Let h = 34 - -62. Does 15 divide h - (-7 - 1)/2? False Let j = -147 - -79. Let p = -39 - j. Does 11 divide p? False Suppose -2r + 0f - f = -235, 5r = -2f + 587. Let h = 174 - r. Is h a multiple of 19? True Let t(h) = -7h - 27. Let s be t(-6). Let g be ((-26)/8 - -1)-4. Suppose -o = -g - s. Is 4 a factor of o? True Suppose 3r - 15 = -2t, 9 = -2r + 11. Does 2 divide t? True Let l(d) = d*3 - 13d*2 + 14d - 3. Let j be l(12). Suppose -5i + j = 6. Suppose b = -ib + 104. Is 13 a factor of b? True Suppose 1040 = 13k - 702. Does 19 divide k? False Let o = 3801 - 1671. Is o a multiple of 30? True Suppose 4j - 182 = 3j. Let g = j - 112. Let q = g - 34. Is 12 a factor of q? True Let r(u) be the third derivative of -5u*4/24 - 4u*3 - 7u*2. Let y(z) = 2z + 4. Let p be y(-7). Does 13 divide r(p)? True Let c(u) = -u*3 + 11u*2 - 10u - 12. Let f(a) = 5a3 - 55a*2 + 51a + 60. Let s(h) = 11c(h) + 2f(h). Is s(10) a multiple of 4? True Let y(r) = -r*3 - 3r*2 - r + 5. Let j(c) = -2c*3 - 6c*2 - 3c + 10. Let f(b) = -6j(b) + 13y(b). Let l be f(-4). Does 12 divide ((-4)/(-5))/(l/75)? True Suppose -3l - 2i - 136 = l, -3l - 116 = 5i. Let v = l - -30. Let d(k) = -10k - 2. Does 18 divide d(v)? True Suppose -4g + 139 = -305. Is 3 a factor of g? True Let b be 3 + 0 + 6/(-3). Let h be (b - -3)2/(-4). Let s(p) = -2p3 - p2 - 2p - 2. Is 14 a factor of s(h)? True Let y = 620 - 290. Suppose -150 - y = -3p. Does 32 divide p? True Let p = 10 + 16. Suppose p = 7j - 58. Does 12 divide j? True Suppose 6j - 2j + 4w - 80 = 0, -2w - 32 = -j. Does 37 divide 178(-18)/j2/(-3)? False Let m(l) = l3 + 8l*2 + 8l + 4. Let q be m(-7). Let h be -4(-3)/6 + q. Does 10 divide h - -1 - (-220)/11? True Let i(j) = -j3 - 9j*2 - 22. Does 6 divide i(-10)? True Suppose -4354 = -5q - 944. Does 62 divide q? True Let x = -17 - -24. Suppose -19 = -3i - x. Suppose 0 = io - 8o + 472. Is o a multiple of 24? False Suppose 444 + 234 = 2c - 5g, 3g = 2*c - 678. Is 39	{ "pile_set_name": "DM Mathematics" }
o six decimal places. 0 Let s = 1471.29 - 1458. Let v = 14.3 - s. Let o = -0.73 + v. Round o to 1 dp. 0.3 Let f = 0.062489 - 0.0682844. What is f rounded to 5 dps? -0.0058 Let p = -522 - -779. Let r = -99 + p. Round r to the nearest 100. 200 Let v(y) = 47y - 39 + 103y*2 + 45 - 18y. Let d be v(-6). What is d rounded to the nearest 100? 3500 Let y = -8931 - -17709. Round y to the nearest one hundred. 8800 Let j = 186.5 + -137. Let q = j + -49.49998551. What is q rounded to six dps? 0.000014 Let l = -93 + -2850. Let u = l - -2942.8679. What is u rounded to 2 decimal places? -0.13 Let u = -295.899998304 + 295.9. What is u rounded to six decimal places? 0.000002 Let s be 4/312/(-8). Let b be (0 - s)(-5)/(-2). Suppose -3r - i + 285 = 0, -bi - 95 = -r - 0i. What is r rounded to the nearest ten? 100 Suppose 24o - 77040535 + 272751079 = 0. Let h = -16324606 - o. Round h to the nearest 1000000. -8000000 Let n be (108/(-10))/(-4 + 348/90). Let z = n + -197. Let q be 1/(4 + 468/z). Round q to the nearest ten. -30 Let r = 119532471318364.06339717 - 119557718109642.0634. Let v = r - -25246790864. Let n = v + 414. What is n rounded to 6 dps? -0.000003 Suppose z - 1017 = -5m + 1532, 2m = 12. Round z to the nearest one hundred. 2500 Let m = 1113447846 - 1113447841.00000061. Let j = -5.195 + 10.195. Let k = j - m. What is k rounded to seven decimal places? 0.0000006 Let p = 350 + -168. Let n = -48 + p. Let h = n - 134.57. Round h to one decimal place. -0.6 Let c = -6115 + 4198. Let w = 1916.998483 + c. Round w to four decimal places. -0.0015 Suppose -9m + 4m = -25. Suppose 0 = -mt + 352415 + 2622585. What is t rounded to the nearest 100000? 600000 Let z = -6554.9948371 - -6555. Round z to four dps. 0.0052 Let p = 149290811770600.8999874 + -149290879703445. Let y = 67932858 + p. Let q = y + -13.9. Round q to six dps. -0.000013 Let i = 2.57705766 - 2.577. Round i to 6 dps. 0.000058 Let h = 36.1 - 5.1. Let d = 0.2773 + 30.3827. Let v = d - h. What is v rounded to zero decimal places? 0 Let t = -279791 + 279791.166269. What is t rounded to 2 dps? 0.17 Let b = 28971343.93718265332 - 28724.21718052332. Let o = 28942621.4 - b. Let x = 1.68 - o. Round x to 7 decimal places. 0.0000021 Let h = 11 + -8. Let y = 0.03249 + -3.03225. Let v = y + h. Round v to 4 dps. 0.0002 Let q(l) = 6l - 36. Let t be q(7). Suppose -3a = -ta - c - 185700004, 5a + 5c = -309500020. What is a rounded to the nearest 1000000? -62000000 Let s = -11.19 + 1338.19. Let u = -353 + s. Let w = 974.689 - u. What is w rounded to 1 decimal place? 0.7 Let l = -42811665 - 22334335. What is l rounded to the nearest one hundred thousand? -65100000 Let q(u) = -5028u2 - 20u + 112. Let o = -840 - -818. Let k be q(o). Round k to the nearest 100000. -2400000 Suppose 5z - 2d = -7d - 14805, 0 = -4z - 3d - 11843. Let k = z - -5108. Round k to the nearest one hundred. 2100 Let j = -5854751482.00000095 + 5854751350. Let c = -132 - j. What is c rounded to seven dps? 0.000001 Let u = -140801 + 140790.00108. Let k = -11.01 - -0.01. Let f = k - u. Round f to four dps. -0.0011 Let v = 13691.78 - 13189. What is v rounded to the nearest ten? 500 Let z = 31 + -39.6. Let f = -2813 - -2804.606. Let l = f - z. What is l rounded to 2 dps? 0.21 Let x = -0.0097581026 - -13.0097615226. Let y = x - 13. Round y to seven dps. 0.0000034 Let t = -27.779395 + -27394931.220605. Let u = 27394817.99897 + t. Let x = u + 141. What is x rounded to four dps? -0.001 Suppose -2f + 345 = 13f. Suppose 79860000 = 34z - fz. What is z rounded to the nearest one hundred thousand? 7300000 Let c be (-3)/(-1) + 912670111/47. Suppose -17781484 = 4x + c. What is x rounded to the nearest 1000000? -9000000 Let s = -13463176 + 8072676. What is s rounded to the nearest 10000? -5390000 Let k = 424 + -495.7. Let j = -69.415 - k. Round j to one decimal place. 2.3 Let k = 134049.00055681 - 134049. Round k to 4 decimal places. 0.0006 Let l = -7 - -2. Let s = l + -25. Let z = 30.75 + s. Round z to 1 dp. 0.8 Let w = 2794.00000439 - 2794. What is w rounded to six dps? 0.000004 Let x = 744 + -744.034. Let w = -0.009 - 0.038. Let f = w + x. What is f rounded to two decimal places? -0.08 Let a = 234.32 + -234.13141. What is a rounded to three decimal places? 0.189 Let g = 1260.06 - 1247. Let d = 13 - g. Let c = 0.1016 + d. What is c rounded to two decimal places? 0.04 Let g = 42.062 + -0.062. Let n = 41.914 - g. Let u = -0.0727 - n. What is u rounded to 3 dps? 0.013 Let w = 783.38 - 696.1. Round w to zero dps. 87 Let g = 6.13 - 4.8. Let a = g - 1.329999415. What is a rounded to 7 decimal places? 0.0000006 Let p(y) = 2y - 10. Suppose -3m = -a + 5a - 30, 2m = a + 9. Let f be p(m). Suppose 3h - f + 47 = 0. What is h rounded to the nearest 10? -20 Let u = 15491 + -15491.05288. What is u rounded to 2 dps? -0.05 Let l = -2574 + 2573.999995306. What is l rounded to seven decimal places? -0.0000047 Let i be (2 + 4435599/2)/(3/(-30)). Let g = i + 32648712. Suppose 8m - 7849303 - g = 0. What is m rounded to the nearest 100000? 2300000 Suppose 0 = 5r - 4c - 5652600, -4r + 1710c - 1714c + 4522080 = 0. What is r rounded to the nearest 10000? 1130000 Let h = 451 - 450.966. Let f = h - -0.1348. Round f to two decimal places. 0.17 Let z = -788032.7470799802 + 1.7587799802. Let l = -787807 - z. Let g = l + -224. Round g to 3 dps. -0.012 Let b(z) = -12z*3 + 13z*2 - 18z + 84. Let w(q) = 18q3 - 20q*2 + 27q - 126. Let n(j) = 8b(j) + 5w(j). Let f be n(-10). Round f to the nearest 100. 6500 Let i = -467604 + 1555604. What is i rounded to the nearest one hundred thousand? 1100000 Let a = 44.3402 - 44.3. Let o = a - -75.7598. What is o rounded to zero dps? 76 Let l = 0.06437804 + 49.93562096. Let k = -50 + l. Round k to 7 decimal places. -0.000001 Let q = -171264711.96 + 171264475.95999926. Let k = 236 + q. What is k rounded to 7 decimal places? -0.0000007 Let j = 1.06009599 - -0.04327141. Let y = 1.103 - j. Round y to five decimal places. -0.00037 Let k = 1260.1 + -1200. Let t = -60.1263 + k. What is t rounded to two decimal places? -0.03 Let q = 0.01958 + 13.32642. What is q rounded to 1 dp? 13.3 Let a = 2770216 - 2769943.9322. Let i = a - 0.0678. Let n = i - 272.0000157. Round n to five dps. -0.00002 Let v = -28.96599 + 29.186. What is v rounded to 3 decimal places? 0.22 Let c = -10.26604653 - -10.266. What is c rounded to 5 decimal places? -0.00005 Let s = 888.79 - 0.79. Let q = -889.122 + s. What is q rounded to one dp? -1.1 Let d = -47592 + 47592.00043258. Round d to four decimal places. 0.0004 Let l = -802.969 - -1.969. Let i = l - -800.99999431. What is i rounded to 7 dps? -0.0000057 Let p = 567.5 - 567.499999881. What is p rounded to seven decimal places? 0.0000001 Let w = 19444.184 + -19443. Round w to 1 dp. 1.2 Let z = 1371 - -1281. Let v = z - 2639.97. What is v rounded to 0 dps? 12 Let y = -84 - -91. Suppose yw - 537 = 898. Round w to the nearest 10. 210 Let a(z) = -z - 5. Let u be a(-7). Let t be u/4 - (-2880012)/8. Suppose 5p + t = d, 3p + 5d = 2p - 71990. Round p to the nearest 10000. -70000 Let u = -65905.9900088 + 65868.99. Let d = -10 - -47. Let g = u + d. What is g rounded to six decimal places? -0.000009 Let h = 0.25 + 84.75. Let p = 196 + h. Let g = p + -280.9999746. Round g to 6 dps. 0.000025 Let v = -0.10021 + 0.100189791. What is v rounded to five decimal places? -0.00002 Let o = 2014.8 - 2157.694. Let a = 0.106 - o. Let l = -142.695 + a. Round l to two decimal places. 0.31 Let s be 2 + -7 + 4 + -4 + -13. Let y be (-8)/(-36) + (-21020)/s. Let d = y - 2128. What is d rounded to the nearest one hundred? -1000 Let f = 99.53 - -0.47. Let c = f + -38.85. Let m = c + -63. Round m to one dp. -1.9 Let u = -1221467 + 1221559.00215. Let z = 7.6 + -99.6. Let q = u + z. Round q to three dps. 0.002 Let m(z) = z2 - 6z - 18. Let w be m(-2). Let f(i) = 384i - 2. Let r be f(w). What is r rounded to the nearest 100? -800 Let o = -11210 - -11204.271. Round o to zero dps. -6 Let n = 174.68086 + -130.6818. Let x = 0.037 - -43.963. Let i = x - n. Round i to 4 dps. 0.0009 Suppose 207w + 4540780 - 28452529 = 123184521. Round w to the nearest 1000. 711000 Let a = 695 + -11. Let m = 599 + a. Let t = -1283.000000933 + m. Round t	{ "pile_set_name": "DM Mathematics" }
f 1743, 3493, 5243, 6993? 1750f - 7 What is the q'th term of -442, -422, -396, -364, -326, -282, -232? 3q*2 + 11q - 456 What is the t'th term of -4147112, -4147123, -4147148, -4147193, -4147264, -4147367? -t3 - t2 - t - 4147109 What is the d'th term of -20478, -40963, -61448, -81933? -20485d + 7 What is the o'th term of -460, -894, -1328, -1762? -434o - 26 What is the q'th term of -221, -886, -1993, -3542, -5533, -7966? -221q2 - 2q + 2 What is the f'th term of 1938, 3907, 5872, 7833, 9790? -2f2 + 1975f - 35 What is the i'th term of -5, 72, 173, 298, 447? 12i2 + 41i - 58 What is the k'th term of -247490, -247480, -247456, -247412, -247342, -247240? k3 + k2 - 247492 What is the o'th term of 133, 942, 3117, 7336, 14277, 24618, 39037, 58212? 113o3 + 5o*2 + 3o + 12 What is the p'th term of -4160, -8332, -12526, -16754, -21028, -25360, -29762, -34246? -2p3 + p2 - 4161p + 2 What is the w'th term of 4099, 4125, 4153, 4183, 4215, 4249? w*2 + 23w + 4075 What is the a'th term of 6633, 26563, 59779, 106281? 6643a2 + a - 11 What is the b'th term of 10503, 10492, 10459, 10392, 10279, 10108? -2b3 + b2 + 10504 What is the n'th term of -70, -139, -168, -139, -34, 165, 476? 3n3 + 2n*2 - 96n + 21 What is the p'th term of 101, 421, 991, 1841, 3001, 4501, 6371? 5p3 + 95p*2 + 1 What is the i'th term of 110, 220, 336, 458, 586? 3i*2 + 101i + 6 What is the z'th term of -353, -752, -1193, -1676? -21z2 - 336z + 4 What is the l'th term of -696, -2506, -5428, -9462? -556l2 - 142l + 2 What is the f'th term of -74, -298, -690, -1262, -2026, -2994, -4178, -5590? -2f3 - 72f*2 + 6f - 6 What is the c'th term of -2277, -4532, -6763, -8958, -11105, -13192, -15207? 2c3 - 2269c - 10 What is the r'th term of 286, 639, 992? 353r - 67 What is the w'th term of 160, 157, 154, 151? -3w + 163 What is the o'th term of 75555, 151111, 226667? 75556o - 1 What is the z'th term of 4901, 19039, 42603, 75593, 118009, 169851? 4713z*2 - z + 189 What is the i'th term of -653, -687, -793, -1007, -1365, -1903, -2657? -6i*3 + 8i - 655 What is the p'th term of -38, -110, -208, -344, -530? -2p3 - p2 - 55p + 20 What is the b'th term of 9989, 9981, 9973, 9965, 9957? -8b + 9997 What is the s'th term of -1107, -1248, -1389, -1530? -141s - 966 What is the v'th term of -1119, -4469, -10061, -17901, -27995, -40349? -v*3 - 1115v*2 + 2v - 5 What is the d'th term of -3196, -6394, -9588, -12778, -15964? 2d2 - 3204d + 6 What is the h'th term of 8720, 8691, 8662, 8633, 8604, 8575? -29h + 8749 What is the k'th term of -77, -229, -463, -767, -1129? 2k*3 - 53k*2 - 7k - 19 What is the d'th term of 2825, 3120, 3415, 3710? 295d + 2530 What is the w'th term of 1111, 1187, 1235, 1249, 1223? -w3 - 8w*2 + 107w + 1013 What is the u'th term of -36310, -72634, -108958? -36324u + 14 What is the a'th term of 1104, 1222, 1418, 1692? 39a*2 + a + 1064 What is the c'th term of 24215, 48415, 72615, 96815? 24200c + 15 What is the a'th term of 198, -245, -984, -2019? -148a2 + a + 345 What is the m'th term of -1007, -1000, -993, -986, -979? 7m - 1014 What is the d'th term of 2364, 2371, 2366, 2349, 2320? -6d2 + 25d + 2345 What is the h'th term of -34, -131, -316, -613, -1046, -1639? -4h3 - 20h*2 - 9h - 1 What is the p'th term of -16699, -16696, -16693? 3p - 16702 What is the i'th term of -59, -109, -145, -161, -151, -109, -29? i3 + i2 - 60i - 1 What is the h'th term of 75, 157, 253, 369, 511? h3 + h2 + 72h + 1 What is the j'th term of -852372, -852386, -852410, -852450, -852512, -852602, -852726, -852890? -j3 + j2 - 10j - 852362 What is the g'th term of 8157, 16323, 24489, 32655, 40821? 8166g - 9 What is the c'th term of 116, 73, 18, -43, -104, -159, -202? c3 - 12c*2 - 14c + 141 What is the q'th term of 3572, 14343, 32304, 57461, 89820, 129387, 176168? q*3 + 3589q*2 - 3q - 15 What is the q'th term of -16, -81, -130, -157, -156, -121? q*3 + 2q*2 - 78q + 59 What is the y'th term of -1882, -1846, -1794, -1720, -1618, -1482, -1306, -1084? y*3 + 2y*2 + 23y - 1908 What is the v'th term of 29373, 58750, 88131, 117516, 146905? 2v2 + 29371v What is the t'th term of 73, 80, 41, -68, -271, -592, -1055, -1684? -4t3 + t2 + 32t + 44 What is the v'th term of 3037, 6065, 9089, 12109, 15125, 18137? -2v2 + 3034v + 5 What is the d'th term of 64, -189, -766, -1667, -2892, -4441, -6314? -162d2 + 233d - 7 What is the u'th term of -2346, -4711, -7104, -9537, -12022? -2u3 - 2u*2 - 2345u + 3 What is the t'th term of 168, 411, 650, 885? -2t2 + 249t - 79 What is the j'th term of 449, -86, -1543, -4384, -9071, -16066, -25831? -77j3 + j2 + j + 524 What is the o'th term of 18, -60, -158, -246, -294, -272, -150, 102? 5o*3 - 40o*2 + 7o + 46 What is the h'th term of -5915, -5919, -5937, -5975, -6039, -6135, -6269? -h3 - h2 + 6h - 5919 What is the x'th term of -3242, -3251, -3260? -9x - 3233 What is the d'th term of -354, -689, -1012, -1323, -1622, -1909, -2184? 6d2 - 353d - 7 What is the z'th term of -476615, -953222, -1429829, -1906436? -476607z - 8 What is the r'th term of 3384, 6812, 10240, 13668? 3428r - 44 What is the t'th term of -953, -938, -917, -890, -857, -818, -773? 3t2 + 6t - 962 What is the q'th term of -1227, -1202, -1139, -1020, -827, -542, -147, 376? 3q3 + q2 + q - 1232 What is the p'th term of 393994, 787991, 1181998, 1576021, 1970066, 2364139? p3 - p2 + 393993p + 1 What is the b'th term of 1725, 3451, 5177, 6903? 1726b - 1 What is the s'th term of -5623, -5736, -5849? -113s - 5510 What is the a'th term of 2748, 9883, 21782, 38451, 59896, 86123, 117138? a*3 + 2376a*2 + 371 What is the o'th term of 86, 415, 992, 1835, 2962, 4391? 3o*3 + 106o*2 - 10o - 13 What is the q'th term of -787, -1709, -4213, -9091, -17135, -29137, -45889, -68183? -132q3 + q2 - q - 655 What is the y'th term of -6, 131, 426, 879, 1490? 79y*2 - 100y + 15 What is the g'th term of -2272, -4304, -6346, -8404, -10484, -12592? -g3 + g2 - 2028g - 244 What is the p'th term of 17, 83, 233, 509, 953, 1607? 7p*3 + 17p - 7 What is the v'th term of 17378, 17380, 17382, 17384, 17386, 17388? 2v + 17376 What is the m'th term of 11, -7, -23, -37, -49, -59, -67? m2 - 21m + 31 What is the z'th term of 2767, 5561, 8343, 11107, 13847, 16557, 19231, 21863? -z*3 + 2801z - 33 What is the s'th term of 55382, 110763, 166144, 221525? 55381s + 1 What is the o'th term of 2700, 5218, 7760, 10338, 12964? 2o*3 + 2504o + 194 What is the q'th term of 475, 968, 1453, 1924, 2375, 2800, 3193? -q*3 + 2q*2 + 494q - 20 What is the c'th term of 144879, 144880, 144881, 144882, 144883? c + 144878 What is the u'th term of 184, 304, 464, 664, 904? 20u2 + 60u + 104 What is the y'th term of -5981, -5784, -5457, -5000? 65y2 + 2y - 6048 What is the o'th term of -16, -94, -298, -688, -1324, -2266, -3574, -5308? -10o3 - 3o*2 + o - 4 What is the s'th term of 935, 998, 1061, 1124, 1187? 63s + 872 What is the w'th term of -3336, -6612, -9876, -13122, -16344, -19536, -22692, -25806? w*3 - 3283w - 54 What is the v'th term of 148, -185, -730, -1487, -2456, -3637, -5030? -106v2 - 15v + 269 What is the q'th term of 9955, 9977, 9999, 10021? 22q + 9933 What is the b'th term of -269, -335, -457, -647, -917? -2b*3 - 16b*2 - 4b - 247 What is the n'th term of -92, -147, -160, -125, -36, 113, 328, 615? n*3 + 15n*2 - 107n - 1 What is the j'th term of -564133, -564134, -564135? -j - 564132 What is the s'th term of 732, 523, 314, 105, -104? -209s + 941 What is the b'th term of -4747, -9455, -14163, -18871? -4708b - 39 What is the d'th term of 100, -201, -676, -1319, -2124, -3085, -4196? d*3 - 93d*2 - 29d + 221 What is the t'th term of -1159, -1109, -1035, -943, -839, -729, -619? -t*3 + 18t*2 + 3t - 1179 What is the j'th term of 978, 1047, 1160, 1317, 1518, 1763? 22j2 + 3j + 953 What is the m'th term of 2150, 3832, 5512, 7190, 8866, 10540, 12212? -m*2 + 1685m + 466 What is the c'th term of -3650, -3627, -3618, -3623, -3642? -7c2 + 44c - 3687 What is the w'th term of 473105, 473108, 473113, 473120, 473129, 473140? w**2 + 473104 What	{ "pile_set_name": "DM Mathematics" }
+ 3215 = t. What is the highest common factor of h and 37? 37 Let t(u) = -13u3 + 3u*2 + 2u - 1. Let p(w) = -w*3 + 5w*2 - 1. Let y be p(5). Let b be t(y). Calculate the highest common divisor of 1 and b. 1 Suppose 5k - 388 = m, 3k + k + m = 314. Suppose -2x = -s - 20, 3s - 30 = 5x - k. Calculate the greatest common divisor of 156 and x. 12 Let i(r) = 45r2 - 5r - 4. Let s be i(-3). Suppose 5u - 7u - 2n = -160, 5u + n = s. Calculate the greatest common factor of u and 210. 42 Let m(n) = -n*3 - 8n*2 - 10n + 1. Let o be m(-7). Calculate the greatest common divisor of 10648 and o. 22 Suppose 0 = -42r + 1087 + 1433. Let c = -83 + 323. What is the highest common factor of r and c? 60 Suppose -10v = -8v - 10. Let x = -95 + 239. Let l be 176/18 + 32/x. What is the highest common factor of v and l? 5 Let c = 139 + -30. Suppose 5a = -3u + c, -u - 37a = -33a - 48. What is the greatest common factor of u and 8? 4 Suppose 35 = -18u + 23u. Suppose un - 456 = -n. What is the highest common divisor of n and 19? 19 Let y(w) = 4w + 3. Let h be y(7). Suppose 132 = 87g - 99g. Let x = h + g. What is the highest common factor of 30 and x? 10 Let v be 235/45 - 5 - ((-92793)/27 - -3). What is the greatest common divisor of v and 34? 34 Suppose 2b + r = 0, 5b + 13 = 4r + 26. Suppose 4x = -13 + 77. What is the greatest common divisor of b and x? 1 Suppose -32 = -5f - 3c, -12 = -c - 2c. Suppose 3 - 11 = -fa. Calculate the highest common factor of a and 36. 2 Let r(g) = 2g*3 - 2g*2 + g + 144. Let c = -287 + 287. Let v be r(c). What is the highest common factor of v and 27? 9 Suppose -l + 121 = 3r, 378 = -0l + 3l + 4r. Let z = -22 + l. Suppose 5n - 12 = z. What is the highest common factor of n and 60? 12 Let t(y) = -53y - 2835. Let g be t(-55). What is the greatest common factor of g and 556? 4 Suppose -9x + x = -768. Suppose 19z - x = 11z. Calculate the greatest common divisor of z and 48. 12 Let a(d) be the second derivative of -13/6d3 - 38d - d*2 + 0. Let l be a(-2). Calculate the highest common divisor of 60 and l. 12 Suppose 0 = -84w + 95w - 2783. Calculate the greatest common factor of 66 and w. 11 Let s(m) = 9m*2 - 2m - 2. Let u be s(-3). Suppose 847x = 834x + 65. Calculate the highest common divisor of u and x. 5 Let v(a) = -6a2 - 4a + 20. Let i be v(-10). Let r = i + 562. Calculate the greatest common factor of r and 814. 22 Suppose -5n - 6 + 16 = 0. Suppose -w - 4 = np - 7, 24 = p - 4w. Suppose 12 = pk, -4k = -7h + 3h + 12. Calculate the greatest common divisor of 3 and h. 3 Let v = -207 - -109. Let g = v + 97. Let m = 98 - g. What is the highest common divisor of 9 and m? 9 Let j be (535/10)/((-1)/2). Let r = 118 + j. What is the greatest common factor of r and 253? 11 Suppose 4f - 6 = -2k, 4k - 4f = -f + 56. Let n be 94/24 + (-26279)/(-22) - -3. Calculate the highest common divisor of n and k. 11 Let w = -209 - 162. Let d = w + 1211. Suppose 18q - d = 6q. What is the greatest common factor of 10 and q? 10 Let g = -969 + 1515. Let d = 564 - g. Calculate the highest common divisor of d and 12. 6 Suppose 0 = h + 8 - 2. Let d(y) = -y*2 - 8y - 8. Let s be d(h). Suppose -x - 7 - 9 = -a, 0 = -sx + 8. What is the highest common factor of a and 45? 9 Let h be 1(-15)/(-20)236. Suppose h = 4g - 75. Calculate the greatest common divisor of g and 18. 9 Let n be (336/(-210))/((-2)/15). Let k be 8/6 - (-20)/n. What is the highest common factor of 69 and k? 3 Let t(b) = 2b2 - 9b - 50. Let d be t(8). Let n be ((-4)/d)/((-20)/570). What is the greatest common factor of n and 38? 19 Suppose 5l = -15 + 5. Let h be (-1)/(-3 + (l - -4)). Suppose 2 = 2b + 2s - 30, -s = -h. What is the greatest common divisor of b and 6? 3 Suppose 4c - 154 = -142. Suppose 3t = -l + 7t + c, -5t = l - 30. Calculate the highest common divisor of l and 10. 5 Let d = -1119 + 1768. What is the highest common divisor of d and 44? 11 Suppose 0 = 2m + 4, r + 293 = -3m + 662. What is the highest common factor of 36375 and r? 375 Let w(l) = -55l + 34l2 + 1913l*3 + 4 - 1914l*3 - 6l + 40. Let v be w(32). Calculate the greatest common divisor of v and 14. 14 Suppose 0 = -379y + 12351 - 4392. Calculate the highest common factor of y and 9149. 7 Suppose -16m + 1212 = -180. What is the greatest common factor of 9 and m? 3 Suppose 0 = 3g - 3, -v - 12 = -g - 51. Let r = 2 + v. Calculate the greatest common divisor of r and 105. 21 Let q(j) = -2j*2 - 14j + 17. Let n be q(-7). Suppose 748 = 14h - 10h. Calculate the greatest common divisor of h and n. 17 Suppose -4a + 28 = 2h, -3a - h + 0h + 22 = 0. Let p = 115 - 100. Let g be (p/(-3))/(-10) - (-46)/4. What is the greatest common divisor of a and g? 4 Let w = 5023 - 4998. What is the greatest common factor of w and 1975? 25 Suppose 3l - 143 = -h, 8h - 635 = 3h + l. Let n be h/12(13 - 1). Calculate the greatest common divisor of 16 and n. 16 Let n(j) = -40j + 7. Let f be n(-5). Suppose 0 = 296w - 1069 - 580 - 684 - 2995. What is the greatest common divisor of f and w? 9 Suppose 5x = 4 - 39. Let y = x - -19. Suppose 0 = -9k + 771 + 201. Calculate the greatest common factor of k and y. 12 Let w be 286/4(1 - -1). Let s be ((-832)/(-40))/(2/(-7) + 624/910). What is the greatest common factor of s and w? 13 Let p be 977/3 - (-2)/(-3). Suppose -53q - 213 + 902 = 0. What is the greatest common divisor of p and q? 13 Let j(c) be the second derivative of c*4/4 - 2c*3 - c + 3. Let t be j(-6). Let u = 121 + -1. Calculate the highest common factor of u and t. 60 Let u be ((-2)/6)/(20/(-540)) + -4. Suppose 98 = 4z + 2y, 118 = -z + uz - 2y. What is the greatest common factor of 135 and z? 27 Let r(s) = -12s*2 + 9s - 22. Let b(x) = 10x2 - 9x + 21. Let p(u) = 4b(u) + 3r(u). Let o be p(9). Calculate the highest common divisor of 29 and o. 29 Suppose 2n - 640 - 654 = -4a, 0 = a + 3n - 326. What is the highest common factor of 34561 and a? 323 Suppose 2273 - 788 = 41y - 2205. Calculate the greatest common divisor of y and 4014. 18 Let h = -89094 + 133218. What is the greatest common factor of 12 and h? 12 Suppose o - 173 = 9c - 12c, -373 = -2o + 3c. Let m = 30 - -9. Calculate the greatest common divisor of m and o. 13 Let b be (-171 - 20)((-1023)/8 + (-15)/120). Calculate the highest common divisor of b and 191. 191 Suppose 7x - 14 = -56. Let o be (-5 + -1)-22 + x. Suppose 2q = 50 + 118. What is the highest common divisor of q and o? 42 Let p be 9/(-9)(-1 - 14). Let j be p/(-25) - (-828)/5. Let l = -245 + 260. What is the greatest common divisor of j and l? 15 Suppose -2672 - 30 - 14308 = -42w. Calculate the highest common divisor of 1125 and w. 45 Let n be 0(13/52 + (-3)/4). Suppose n = 3k + y - 96 - 72, 2k + y - 112 = 0. Calculate the highest common factor of k and 16. 8 Let i(v) = -2v + 12. Let n be i(4). Let p = n + -4. Suppose 2g = 5k - 26, p = -4k - g - g + 10. Calculate the greatest common factor of k and 18. 2 Suppose -20y + 9y = -165. Let l be (-93)/155 + 2709/y. What is the highest common factor of 420 and l? 60 Let u(v) = -2v + 62. Suppose 0 = -30l - 10l - 760. Let c be u(l). Calculate the greatest common divisor of 15 and c. 5 Let a(k) = 2k - 13. Suppose 0 = -0u + 7u - 70. Let l be a(u). Suppose -5f + lf = 90. Calculate the highest common factor of 18 and f. 9 Let v = 1186 - 710. Suppose 6k - v = 148. What is the greatest common factor of k and 156? 52 Suppose -3w + 2b = -80, -w = -0w + 4b - 50. Let z(q) = q + 14. Let i be z(-12). Suppose il - 4l + 480 = 0. What is the highest common divisor of l and w? 30 Let t(y) = y*3 + 20y*2 - 91y + 174. Let o be t(-24). What is the greatest common factor of 88 and o? 2 Suppose 18 = 215z - 212z. Let x(t) = -t*2 + 14t - 12. Let d be x(z). What is the greatest common divisor of 9 and d? 9 Let d(q) = 2q + 0q + 13q2 + 2 - 8q*2 + 2. Let l be d(2). Let x = 52 - l. Calculate the greatest common divisor of 12 and x. 12 Let q = -25251 - -25264. Let m = -3 + 4. Let j be m - -5(5 - 0). Calculate the greatest common divisor of q and j. 13 Let m be ((-1715)/25 - -5)/(21/(-35)). What is the highest common factor of m and 424? 106 Let a = -30368 +	{ "pile_set_name": "DM Mathematics" }
80526, -45720784, -60961042, -76201300? -15240258r - 10 What is the d'th term of -5500, -10719, -16404, -22789, -30108, -38595, -48484? -39d3 + d2 - 4949d - 513 What is the d'th term of -121, -928, -2371, -4450, -7165, -10516? -318d*2 + 147d + 50 What is the i'th term of -33533, -67041, -100549, -134057? -33508i - 25 What is the u'th term of 63779688, 127559374, 191339058, 255118740, 318898420? -u2 + 63779689u What is the f'th term of 4192, 10818, 17444, 24070, 30696, 37322? 6626f - 2434 What is the d'th term of 59669, 91604, 123539, 155474, 187409? 31935d + 27734 What is the a'th term of -103541, -207048, -310567, -414098, -517641, -621196? -6a2 - 103489a - 46 What is the q'th term of 2348, -2738, -7824? -5086q + 7434 What is the m'th term of -677261, -2708948, -6095099, -10835720, -16930817, -24380396, -33184463? -m3 - 677226m*2 - 2m - 32 What is the n'th term of 2902, 2801, 2676, 2527, 2354, 2157? -12n2 - 65n + 2979 What is the n'th term of -544, -4301, -8060, -11821? -n*2 - 3754n + 3211 What is the w'th term of 18999, 37731, 56463, 75195? 18732w + 267 What is the u'th term of -27938239, -55876472, -83814705, -111752938, -139691171, -167629404? -27938233u - 6 What is the l'th term of -45248, -51105, -56962, -62819, -68676? -5857l - 39391 What is the t'th term of -144334, -144758, -145182, -145606, -146030, -146454? -424t - 143910 What is the p'th term of -4226, -8284, -12170, -15884, -19426, -22796? 86p2 - 4316p + 4 What is the o'th term of -6935, -13928, -20899, -27842, -34751, -41620, -48443? o*3 + 5o*2 - 7015o + 74 What is the a'th term of 1344, 6503, 15098, 27123, 42572? -a*3 + 1724a*2 - 6a - 373 What is the j'th term of 7919127, 15838226, 23757315, 31676388, 39595439, 47514462, 55433451, 63352400? -j3 + j2 + 7919103j + 24 What is the q'th term of -19042669, -38085345, -57128021, -76170697, -95213373, -114256049? -19042676q + 7 What is the c'th term of 565223, 565240, 565259, 565280, 565303? c*2 + 14c + 565208 What is the c'th term of -747, -3489, -8213, -14913, -23583, -34217, -46809? c*3 - 997c*2 + 242c + 7 What is the n'th term of 706572, 707627, 709386, 711849, 715016, 718887, 723462? 352n2 - n + 706221 What is the l'th term of -6, -615, -1624, -3033, -4842, -7051? -200l*2 - 9l + 203 What is the v'th term of 1474769367, 1474769366, 1474769365, 1474769364? -v + 1474769368 What is the w'th term of -54347, -103600, -152853, -202106, -251359? -49253w - 5094 What is the t'th term of -1110717, -1110723, -1110735, -1110753, -1110777, -1110807? -3t*2 + 3t - 1110717 What is the f'th term of 18614, 37544, 56828, 76466? 177f2 + 18399f + 38 What is the d'th term of -65189, -67682, -70175? -2493d - 62696 What is the r'th term of -50068, -49972, -49810, -49582, -49288, -48928? 33r*2 - 3r - 50098 What is the i'th term of 538620, 538571, 538522, 538473, 538424? -49i + 538669 What is the y'th term of -4391, -8373, -12343, -16301? 6y*2 - 4000y - 397 What is the x'th term of 85137, 170493, 255849, 341205, 426561? 85356x - 219 What is the b'th term of 13801015, 13801016, 13801017, 13801018, 13801019, 13801020? b + 13801014 What is the j'th term of -742040, -742012, -741984, -741956? 28j - 742068 What is the x'th term of -70709763, -70709762, -70709761, -70709760, -70709759? x - 70709764 What is the g'th term of 181, 782, 1799, 3238, 5105, 7406, 10147? g*3 + 202g*2 - 12g - 10 What is the u'th term of -215981, -1728054, -5832247, -13824620, -27001233, -46658146, -74091419? -216010u3 - 3u + 32 What is the u'th term of -186475, -186463, -186445, -186421, -186391, -186355? 3u2 + 3u - 186481 What is the m'th term of -52264, -59321, -66378, -73435? -7057m - 45207 What is the x'th term of -209970, -209984, -210004, -210030? -3x*2 - 5x - 209962 What is the l'th term of -36263, -145464, -327473, -582290, -909915, -1310348, -1783589? -36404l2 + 11l + 130 What is the k'th term of 4629067, 4629051, 4629011, 4628935, 4628811? -2k3 - 2k + 4629071 What is the g'th term of -16462, -16375, -16108, -15571, -14674? 15g3 - 18g - 16459 What is the b'th term of 864850, 1729667, 2594454, 3459211, 4323938, 5188635, 6053302? -15b2 + 864862b + 3 What is the b'th term of 141309, 141115, 140793, 140343, 139765, 139059? -64b2 - 2b + 141375 What is the j'th term of -278, -1332, -4240, -9944, -19386, -33508? -157j3 + 15j*2 - 136 What is the v'th term of 32722, 65470, 98240, 131032, 163846, 196682? 11v*2 + 32715v - 4 What is the w'th term of 35363291, 70726581, 106089871, 141453161, 176816451, 212179741? 35363290w + 1 What is the z'th term of -14452, -16323, -18192, -20059, -21924, -23787? z2 - 1874z - 12579 What is the y'th term of -51073, -50224, -48801, -46798, -44209, -41028, -37249? y*3 + 281y*2 - y - 51354 What is the h'th term of -8077884, -16155766, -24233648, -32311530, -40389412, -48467294? -8077882h - 2 What is the m'th term of 793209, 793005, 792801? -204m + 793413 What is the z'th term of 99022066, 198044135, 297066204? 99022069z - 3 What is the g'th term of 291, 886, 1507, 2154, 2827? 13g2 + 556g - 278 What is the s'th term of -39563, -38052, -35533, -32006? 504s2 - s - 40066 What is the z'th term of 5910, 5702, 5352, 4860, 4226, 3450? -71z*2 + 5z + 5976 What is the n'th term of 11774, 14887, 23340, 39803, 66946? 445n3 - 2n + 11331 What is the u'th term of -10376, -12513, -14640, -16757, -18864? 5u2 - 2152u - 8229 What is the h'th term of 75002904, 75002887, 75002870, 75002853, 75002836? -17h + 75002921 What is the d'th term of 829874, 1659723, 2489498, 3319163, 4148682? -6d3 - d2 + 829894d - 13 What is the z'th term of -5558855, -11117706, -16676557, -22235408, -27794259? -5558851z - 4 What is the z'th term of -889, -1828, -2841, -3958, -5209, -6624? -5z3 - 7z*2 - 883z + 6 What is the c'th term of 13110, 13589, 14070, 14553, 15038, 15525? c*2 + 476c + 12633 What is the v'th term of -592911, -2371650, -5336209, -9486588, -14822787, -21344806? -592910v2 - 9v + 8 What is the o'th term of -16094, -63797, -143298, -254591, -397670, -572529, -779162, -1017563? o*3 - 15905o*2 + 5o - 195 What is the d'th term of -1967363, -1967289, -1967215? 74d - 1967437 What is the p'th term of -83467, -85080, -87763, -91510, -96315, -102172, -109075? p3 - 541p*2 + 3p - 82930 What is the l'th term of 38688, 83325, 127962, 172599, 217236, 261873? 44637l - 5949 What is the w'th term of 52064, 52092, 52166, 52310, 52548? 4w3 - w2 + 3w + 52058 What is the x'th term of -22187079, -22187080, -22187081, -22187082, -22187083, -22187084? -x - 22187078 What is the b'th term of 1907515, 3815034, 5722553? 1907519b - 4 What is the h'th term of -37355, -36563, -35239, -33383, -30995? 266h2 - 6h - 37615 What is the c'th term of -10933601, -10933605, -10933609, -10933613, -10933617? -4c - 10933597 What is the y'th term of -579657, -2318612, -5216877, -9274458, -14491361, -20867592? -y3 - 579649y*2 - y - 6 What is the j'th term of -395663, -791321, -1186979, -1582637? -395658j - 5 What is the w'th term of 35333, 141338, 318029, 565418, 883517? 2w3 + 35331w*2 - 2w + 2 What is the h'th term of -4226, -29188, -95624, -224270, -435862, -751136, -1190828? -3456h3 - h2 - 767h - 2 What is the f'th term of -1242, -1232, -1034, -642, -50, 748, 1758? f*3 + 88f*2 - 261f - 1070 What is the f'th term of 10838, 42256, 94256, 166838? 10291f2 + 545f + 2 What is the c'th term of -1135872, -1136235, -1136840, -1137687? -121c2 - 1135751 What is the c'th term of -1600, -5401, -11558, -20071, -30940, -44165? -1178c*2 - 267c - 155 What is the h'th term of 57523, 114871, 172245, 229645, 287071? 13h2 + 57309h + 201 What is the s'th term of 713, 947, 1187, 1433? 3s2 + 225s + 485 What is the a'th term of 21094, 42305, 63516, 84727? 21211a - 117 What is the x'th term of 9240, 9180, 9032, 8760, 8328? -6x*3 - 8x*2 + 6x + 9248 What is the g'th term of 30921727, 30921737, 30921755, 30921781, 30921815? 4g2 - 2g + 30921725 What is the w'th term of 3984147, 15936558, 35857243, 63746202? 3984137w2 + 10 What is the m'th term of 96352408, 192704816, 289057224, 385409632? 96352408m What is the	{ "pile_set_name": "DM Mathematics" }
e the first derivative of b(j). What is s in z(s) = 0? -1, 1, 2 Suppose -2w - 12 = -5w. Let m be ((-1)/(-4))/(w(-3)/(-72)). Let 9/2 + mc*2 + 6c = 0. What is c? -3, -1 Suppose z - 7 = -5f, -2f - 3f + 3z = -19. Let 0 - 1/6hf - 1/2h = 0. What is h? -3, 0 Let s(j) = -j*3 + 6j*2 - 5j + 1. Let w be s(5). Let r be (4 + w)((-16)/(-14))/4. Find a such that -8/7a*2 + ra + 2/7a3 - 4/7 = 0. 1, 2 Let i(h) be the third derivative of -3/56h*4 + 0h + 0 - 3/140h5 - 1/280h*6 - 1/14h3 - h2. Factor i(f). -3(f + 1)3/7 Let u(a) be the first derivative of -5a*4/3 - 172a*3/27 + 4a*2/3 - 235. Factor u(l). -4l(l + 3)(15l - 2)/9 Let z(a) = -a3 + 7a*2 - 11a - 1. Let u be z(5). Let r be u + 2 - (-11)/(154/63). Find g, given that -1 + 1/2g2 + rg = 0. -2, 1 Let l(d) = d*2 + 27d + 23. Let w(n) = 26n + 24. Let o(q) = 2l(q) - 3w(q). Let o(r) = 0. Calculate r. -1, 13 Suppose 867v - 12762 = 1977. Factor 12 - 3/2z2 + vz. -(z - 12)(3z + 2)/2 Suppose 13 = -i + 5z, 18z - 22z = 3i - 18. Let x(j) be the second derivative of 0ji + 0j*4 + 3/20j*5 - 2j*3 + 0 - 11j. Solve x(o) = 0. -2, 0, 2 Suppose 4k - v = 15, 8k + v = 4k + 9. Let o(b) be the second derivative of 0b*k - 3b + 0 + 0b2 + 1/60b4. Factor o(h). h2/5 Let g = 9634 + -9631. Factor -3/4fg - 3/2f*2 - 3/4f + 0. -3f(f + 1)*2/4 Let h(j) be the first derivative of 2j*3 + 5j*2/2 + 5j - 53. Let k(r) = 1 + 17 + 4r + 21r*2 + 14r. Let q(x) = 18h(x) - 5k(x). What is y in q(y) = 0? 0 Factor 28/9 - 2/9g2 + 26/9g. -2(g - 14)(g + 1)/9 Let j(r) be the second derivative of 2r6/135 + 43r*5/45 + 221r*4/9 + 8450r*3/27 + 17576r*2/9 + 436r. Factor j(i). 4(i + 4)(i + 13)3/9 Let z(m) = m2 - 3m + 14. Let d be z(4). Let c = 23 - d. Solve l2 - l4 - 1/3l*3 - 1/3l*c + 2/3l + 0 = 0. -2, -1, 0, 1 Let a(k) be the third derivative of k5/630 - k4/84 - 4k3/63 - 29k*2. Factor a(f). 2(f - 4)(f + 1)/21 Let j(y) = 28y*2 + 752y + 488. Let a(r) = 9r2 + 251r + 163. Let t(o) = 8a(o) - 3j(o). Factor t(z). -4(z + 20)(3z + 2) Let g(r) be the second derivative of 1/80r*5 - 1/8r*4 + 3/8r*3 - 1/2r*2 + 17r + 0. Factor g(v). (v - 4)(v - 1)2/4 Factor 7z - 8z3 - 2z*2 - 18z*2 + z + 18z*4 + 2z*4. 4z(z - 1)(z + 1)(5z - 2) Let m(u) = -3u. Let w be m(-4). Factor -9d*2 + 12d*4 - 15d*4 + wd*3 + 7 - 7. -3d*2(d - 3)(d - 1) Let j(l) = -l3 + 6l*2 - 3l - 9. Let x be j(5). Let v be 2((-2 - -2) + x). Factor -1/4h*3 + 1/2h*v + 0h + 0 - 1/4h4. -h2(h - 1)(h + 2)/4 Let t = -8731/40 + 1092/5. Factor -1/4v - t - 1/8v2. -(v + 1)2/8 Suppose 114 = j + 116. Let f be 2(-6)/72j. Find t such that 0t + ft2 - 1/3 = 0. -1, 1 Let l be (392/312 + -1)24/40. Solve lk4 - 2/13k*2 + 0 + 6/13k*3 - 4/13k - 2/13k5 = 0. -1, 0, 1, 2 Suppose 2g - 15 = -3k, 0g = 5k - 2g - 25. Factor 55m + 92m*3 + 156m*3 + 135m*k + 28m*4 - 230m*2 - 5 - 433m*4 + 202m*3. 5(m - 1)*2(3m - 1)3 Factor -16s + 1/3s2 + 192. (s - 24)2/3 Determine t, given that 26/11t*4 + 4/11t*2 - 12/11t*5 - 18/11t*3 + 0t + 0 = 0. 0, 1/2, 2/3, 1 Find z, given that -131/10z - 2/5z*3 - 109/10z*2 - 13/5 = 0. -26, -1, -1/4 Let f(m) = 2m*2 - 17m + 27. Let c be f(12). Let n be c/(-90) - (-3)/2. Factor -2/15x2 + nx + 2/5. -2(x - 3)(x + 1)/15 Suppose 0 + 0q2 + 3q*3 + 3/2q*4 + 0q = 0. Calculate q. -2, 0 Let t(v) be the second derivative of -v*4/8 - 5v*3/8 - 3v*2/4 - 344v. Solve t(r) = 0 for r. -2, -1/2 Let c(x) be the third derivative of 1/126x4 + 1/90x*5 + 1/441x*7 + 1/3528x*8 + 0x*3 + 1/140x*6 - 22x*2 + 0x + 0. Factor c(v). 2v(v + 1)*3(v + 2)/21 Let a(k) = -k*3 + 2k*2 + 5k - 3. Let j be a(3). Factor 2v2 - 8v*j + 9v3 - v4 + 0v2. -v2(v - 2)(v + 1) Let r(k) be the second derivative of k8/560 + k7/140 - k6/120 - k5/20 + 7k*3/2 - 18k. Let u(i) be the second derivative of r(i). Factor u(s). 3s(s - 1)(s + 1)(s + 2) Let x(s) be the second derivative of -s*4/27 + 28s*3/27 - 26s*2/9 - 3s - 23. Solve x(y) = 0 for y. 1, 13 Let c be (-17)/34 - 2/((-4)/5). Factor 0l2 + 99 + l2 - 6l - 4lc - 90. -3(l - 1)(l + 3) Factor 19k + 0k - 35k*4 + 35k*2 - 9k - 5k3 - 5k*3. -5k(k - 1)(k + 1)(7k + 2) Suppose 7n - 3n = 16. Let j be ((-3)/(-12))/(n/32). Let -l*2 + 4l*j - 2l - 4l + 3l*3 = 0. What is l? -2, 0, 1 Suppose -3s + 4 + 37 = d, -s = 5d - 163. Let r(i) be the first derivative of -2/3i*3 - di - 3 - 8i2. Factor r(t). -2(t + 4)2 Let v(s) be the first derivative of -s3/2 + 15s2/2 - 27s/2 - 35. Suppose v(j) = 0. Calculate j. 1, 9 Let u(m) = -6m3 - 477m*2 - 10098m - 9609. Let y(r) = -3r3 - 239r*2 - 5048r - 4804. Let f(v) = 4u(v) - 9y(v). Let f(w) = 0. What is w? -40, -1 Let t(v) be the third derivative of 1/30v6 + 0v*3 + 0v*4 + 11v*2 + 0 + 0v + 1/15v5 + 1/210v7. Factor t(u). u2(u + 2)2 Let t(a) = -4a*3 - 3a*2 + 3a + 6. Let r(j) = -3j3 - 2j*2 + 2j + 4. Let c(n) = -3r(n) + 2t(n). Factor c(f). f*3 Let r = -34 - -37. Factor r - 2z*2 - 2z - 3. -2z(z + 1) Let g be (2/(-4))/((-2)/12). Let k(j) = j*3 + 23j*2 + 41j - 18. Let f be k(-21). Suppose x*3 + 0x*2 - gx*2 - 2x*3 + 4xf = 0. Calculate x. 0, 1 Let m(t) = t4 - t*3. Let r be 23/3 + 10/(-15). Let o(j) = -3j - 2 - rj + 6j + 8j4 + 3j*3 - 5j*3. Let y(a) = 6m(a) - o(a). Factor y(d). -2(d - 1)(d + 1)*3 Let s = 2/23671 - -497083/94684. Solve 3/4f*3 + 9/2f + 0 + sf2 = 0 for f. -6, -1, 0 Suppose 38 = -18d + 20d. Determine t so that -t3 - 19t*2 - 2t*4 - 14t*4 - dt*3 - 4t*5 + 11t*2 = 0. -2, -1, 0 Let d(p) be the first derivative of -2p*6/21 + 2p*5/5 - 9p*4/14 + 10p3/21 - p2/7 + 51. Find f, given that d(f) = 0. 0, 1/2, 1 Let c(q) be the second derivative of q*4/12 + q. Let i(k) = 7 + 8k*2 + 3k - 5 - 2. Let o(x) = -5c(x) + i(x). Suppose o(h) = 0. What is h? -1, 0 Let k(g) be the first derivative of 3/4g*4 - 15/2g*2 - 9g - g3 + 10. Suppose k(a) = 0. Calculate a. -1, 3 Let c(t) be the second derivative of t4/96 + 5t3/6 + 39t*2/16 - 79t. Factor c(g). (g + 1)(g + 39)/8 Let r(j) = -j2 - 116j - 2631. Let l be r(-31). Suppose 24 - 136/3q2 - 20q - 8/3ql - 20q3 = 0. What is q? -3, -2, 1/2 Let p(x) be the second derivative of x7/1365 - 7x6/780 + x5/26 - 3x*4/52 + 5x*2 + x. Let b(m) be the first derivative of p(m). Factor b(c). 2c(c - 3)2(c - 1)/13 Let l(k) = -k*2 + 6k - 3. Let j = 13 + -10. Let y be l(j). Factor 1 - yi2 + 6i*4 - 1 + 3i - 3i5. -3i(i - 1)3(i + 1) Let q(w) be the first derivative of 5/6w6 - 15/4w*4 - 1 + 0w + 0w5 - 10/3w*3 + 0w*2. Solve q(d) = 0. -1, 0, 2 Let r(n) be the second derivative of -13n*6/80 + 9n*5/20 - 9n4/32 - n3/8 + 482n. Determine p, given that r(p) = 0. -2/13, 0, 1 Let f(q) be the first derivative of -2q5/25 - q4/10 + 4q3/3 - 8q*2/5 - 220. Factor f(n). -2n(n - 2)(n - 1)(n + 4)/5 Let k(i) = 1 - 6i*3 + 11 - 29i*2 + 17i - 1 + 16i3. Let z(s) = -9s*3 + 28s*2 - 18s - 10. Let h(f) = -4k(f) - 6z(f). Determine p so that h(p) = 0. -2/7, 2 Let b be 3/(-7) + 2025/21. Solve -92 + b + 2h - 3h*3 - 4h2 + h3 = 0 for h. -2, -1, 1 Suppose 363/4a + 435/2a*2 + 213a*3 + 33/4a*5 + 21/2 + 84a*4 = 0. What is a? -7, -1, -2/11 Let n(y) be the second derivative of -2y*2 - 20y + 0 - 5/2y4 - 17/3y*3. Determine k so that n(k) = 0. -1, -2/15 Solve -16/5z + 3 - 14/5z2 - 1/5z*4 + 16/5z*3 = 0. -1, 1, 15 Suppose -34 + 12 = -11k. Factor 3h2 - 6 - 3h*2 + kh*2 - 4h. 2(h - 3)(h + 1) Let r = 8924/93261 - 2/4441. Let i(q) be the third derivative of 0 + 0q + 1/84q*4 - rq*3 + 1/105q*5 + 7q*2 - 1/420q*6. Factor i(h). -2(h - 2)(h - 1)(h + 1)/7 Suppose 0 = 8q - 83 + 67. Let u(o) be the first derivative of -6o*q + 2 + 0o - 4/3o3. Factor u(s). -4s(s + 3) Let i(v) = 15v*2 - 70v + 670. Let t(b) = -b*2 + 5b - 48. Let h(k) = -6i(k) - 85t(k). Factor h(z). -5(z - 3)(z + 4) Let v(j) be the second derivative of -j6/105 + j4/42 - 362j. Factor v(f). -2f*2(f	{ "pile_set_name": "DM Mathematics" }
s 3d4 + 2d*4 - 6d*4 + (2d + 3d - 3d)(-3077d*3 + 1564d*3 + 1652d*3) in the form pd*2 + fd*4 + m + id*3 + ud and give f. 277 Express -2h3 + 2923h*2 - 41 - 2939h*2 + 308h - 305h as yh*3 + v + dh*2 + sh and give d. -16 Rearrange -69d + 110d - 5d2 + 116d - 13d + 213d to the form vd2 + ld + b and give l. 357 Rearrange 866j + 459518j*2 + 1 + 0 - 459515j*2 to tj*2 + wj + y and give t. 3 Rearrange -528o - 36 - 31 - 115o + 65 + 37o to the form n + fo and give n. -2 Rearrange 7d2 + 13958 + 2d*2 - 13921 + (3 - 3 - 2)(-2d2 - d2 + d2) - 3d + 7d2 + 3d to the form s + fd2 + ud and give f. 20 Rearrange 181z2 - 32z*4 - 2z - 99z2 + 31z*4 - 78z*3 - 89z*2 to yz*4 + bz + lz3 + h + az*2 and give l. -78 Rearrange (7q - 8q + 9q)(q - 4133q*2 + 2 + 5q*3 - 5 + 4123q*2) to wq*2 + oq*4 + gq + iq3 + d and give i. -80 Rearrange -322r + 4r3 - 320r - 321r + 959r + 20 - 3 to b + xr3 + lr + ur2 and give l. -4 Express 6j + 310032j2 - 2 - 310023j2 - j4 + 3j3 - 2j*3 as yj*2 + rj*3 + mj + v + sj4 and give v. -2 Express -z + 950z*3 + 5805 - 2z - 11603 + 5800 in the form x + sz3 + wz*2 + vz and give x. 2 Express -52g2 - 8 - 11g + 103g2 - 4g - 46g2 in the form xg*2 + tg + o and give x. 5 Express (-1 + 2 + 0)(-163f + 1185f + 123f)(-2f*3 + 2f3 + f3) as tf4 + uf*3 + c + df + kf2 and give k. 0 Rearrange (-7d - d + 4d)(13 + 31 + 58) to bd + t and give b. -408 Express (-3 - 9 - 35)(-p + 0p + 0p)(-2p + 3p - 3p)(-15p - 35p - 20p) as ap2 + s + tp + ip3 and give i. 6580 Rearrange -641i*2 - 189i + 90i2 - 187i - 205i + 9 + 582i to the form hi2 + oi + q and give q. 9 Express (2w2 - 6w*2 + 3w*2)(30 - 23194w - 23181w + 46419w) as aw + iw3 + vw*2 + o and give i. -44 Rearrange -2021g - 5259g - 9961g to ug + s and give u. -17241 Rearrange 31p + 38p + 45p + 96p2 - 167p + 37p to dp + b + up2 and give d. -16 Express -146 - q3 + 68 - 1060q*4 + 74 in the form h + vq*3 + mq*2 + tq + zq4 and give z. -1060 Express -121t - 13t + 7t + (-3 + 3 + 2)(-3t + 7t - 3t) + 21 - 6t - 21 + 0t + t + 0t + (t + 4t - 3t)(4 - 1 + 0) as j + st and give s. -124 Rearrange -3b + 1096b2 + b - 3767b*2 + 2b to the form xb + ob*2 + g and give o. -2671 Express (2r + 0r + 2r)(-2r*2 + 2r*2 + 5r*2) + 183r*3 + 206r*3 + 860r*3 as jr*2 + br*3 + dr + t and give b. 1269 Rearrange 57 + 16983h2 - 8490h*2 - 143 + 2h*3 - 8492h*2 to the form bh*3 + y + nh + sh2 and give b. 2 Rearrange -4p*2 + 251p - 239443p3 + 2p*2 + 239422p*3 to the form op*2 + lp*3 + rp + g and give r. 251 Express 29v + 3 - v3 + v4 - 45v + 4v4 - 6v + 23v as zv + kv4 + ov*2 + g + av*3 and give o. 0 Rearrange (-28s + 55s - 56 - 28s)(94s - 168 + 168) + (-4s + 2s + 3s)(-2 + s + 2) to as2 + f + cs and give a. -93 Express (-2t - 4 + 4)(66 + 20 - 38) - 16t + 33t - 1 - 12t as ht + m and give h. -91 Express 4c3 - 8c*3 + 2c*3 + 0c*3 + 1187c - 12 + 11 in the form bc + jc*3 + h + kc*2 and give j. -2 Rearrange 12t*3 - 113t + 116t + 16t*3 + (-2 + 2t + 2)(-5t*2 - 26t + 26t) to v + zt*3 + st + ot2 and give s. 3 Rearrange 39z - 80z - 3 + 42z - 13z2 + (-1 - 7z + 1)(4z - 3z - 3z) to the form rz + az*2 + o and give o. -3 Rearrange 6a - 7a - 15 + 0a + (-1 - 4 + 4)(2 - 2 + 2a) + a - 22a - 3a to n + va and give n. -15 Rearrange -3812y + 24127 - 24127 + 393y to a + jy and give j. -3419 Rearrange (0 + 1 + 0)(-2x*4 - 2x4 + x4) - 1366x4 - 619x*4 + 332x*4 to the form d + yx*4 + ux*2 + vx*3 + fx and give y. -1656 Express 2095r + r2 + 772 - 1527 + 755 as ir + o + wr2 and give w. 1 Rearrange -3137o2 + o3 + o*3 - 167 + 136 + 31 to the form io*3 + u + jo + no2 and give n. -3137 Rearrange 1572353t2 - t3 - 1572383t2 + 1 - 3t + 5t4 - 3t*4 to it*4 + d + qt + ot2 + st*3 and give o. -30 Rearrange (-240 - 320 - 232 + 233)((4 - 3 + 0)(2o - o - 2o) - 35o + 15o - 17o) to jo + v and give v. 0 Rearrange 57y + 8477y2 + 3y*3 - 8482y*2 - 68y - 10y4 to s + cy*2 + uy*4 + xy + my3 and give u. -10 Rearrange (-2f - 2f + 2f)(14397f + 11005f - 9371f + 7353f) - 3f*2 + 0 + 0 to the form tf + r + pf2 and give p. -46771 Express -444 + 105172o*2 - 16 - 105177o*2 as vo*2 + x + fo and give x. -460 Express -1376p2 - 327p*2 - 2409p*2 in the form jp + l + qp2 and give q. -4112 Rearrange (-1 - 3 + 5)(-54 - 1053 + 3911)(0m - m - m)(2m - 1 + 1) to pm + v + fm*2 and give f. -11216 Rearrange -7 - 140b*4 + 31 + 137b*4 + (-2b*2 + 2b2 + b2)(-8b*2 + 12 - 12) to tb*4 + pb*2 + xb + mb3 + i and give m. 0 Express -19v*3 + 81v - 186v2 + 185v*2 - 85v in the form hv + av*3 + fv*2 + k and give h. -4 Express 26 + 69m*2 - 70m*2 + 2m + 11m3 + 15m*2 as c + fm + bm2 + im*3 and give c. 26 Rearrange (-54 + 142k + 190k + 64)(4 - 1 + 0) to zk + g and give z. 996 Express (0 - 3 + 4)(1 + 1 + 0)(1622 + 301 + 569)(4h - 4h + 2h)(4 - 1 - 1) as d + nh and give n. 19936 Express (7b - 4b - 2b)(b + 3b - 3b)(-2 - 2 + 1)(-176 - 39 - 6) in the form jb + x + pb2 and give p. 663 Rearrange -319 + 398 + 1267t - 79 to the form ct + v and give c. 1267 Rearrange 4259s*2 + 2227s*2 - 1275s*2 to the form ms*2 + f + zs and give m. 5211 Rearrange 13s2 + 24s - 25 - 11s - 11 + 48 - 19 to the form g + xs + hs2 and give h. 13 Express 13k*3 + 15 - 50k3 - k2 + 14k3 + 10k*3 + 12k*3 as zk + p + nk2 + hk*3 and give p. 15 Rearrange -3s*2 - 203s + 11 - 232s + 4s*2 + 493s to ds2 + j + qs and give d. 1 Rearrange (-26517v + 1339 - 673 - 666)(-2 + 0 + 1) to the form a + zv and give z. 26517 Rearrange ((u + 2u*2 - u)(3u - 6u + u) + 18u3 + 57u3 - u3)(0u - 3u + 4u) to au + tu*2 + s + gu*4 + lu*3 and give g. 70 Rearrange -7 - 33q*3 - 18q3 + q2 - 2q - 34q*3 + 117q*3 - 39q*3 to the form oq*3 + z + gq*2 + yq and give g. 1 Rearrange -82 + 0k + 4k - 581 + 301 - 20 to dk + w and give d. 4 Rearrange -210 + r2 + 862 + 320 to the form ar*2 + d + yr and give y. 0 Rearrange -3f2 + 7f*2 - 23f*2 + (62f + 78f - 45f)(f + 0f + f) - f*2 + 3f - 3f to the form if + cf2 + y and give c. 170 Express -80b2 - b4 + b - 3b + 2b*4 + 79b*2 + 21b*3 as ob*2 + c + ib*3 + db*4 + qb and give d. 1 Rearrange -74i4 - 127i*4 + 70i*3 - 2i + 188i4 to the form j + gi + pi4 + ci*2 + ni3 and give n. 70 Express q2 + 3q2 - 5q*2 + (241q + 256q - 428q)(-4q - 8q + 61q) in the form mq + o + vq*2 and give v. 3380 Rearrange 4105h*2 - 17h*2 - 3563h*2 + 5049h*2 + 5488h*2 to the form ih*2 + y + nh and give i. 11062 Express -29n + 2n - 5n + (-2 + 4n + 0n - 3n)(4 - 6 - 1 + (2 + 2 - 3)(-4 - 12 + 11))(0 + 0 + 1) in the form in + s and give i. -40 Rearrange 9 - 27b3 - 8 - 7b*4 + 7b*4 + 10b*4 + 28b*3 - 3b*2 + b to gb + jb2 + ob*3 + qb*4 + a and give g. 1 Rearrange 21c + 9c3 + 12c*3 - 40c*3 + 10c*3 + 11c*3 + 11c*2 to lc + a + sc2 + gc*3 and give l. 21 Express 6 - 17 - 475v*4 + 474v*4 + 21v*2 in the form qv*2 + yv*3 + w + nv + fv4 and give f. -1 Express (0t + 2t + 0t)(-9t + 23t + 5t) - 5t2 + 20t*2 - t - 8t*2 - 8 in the form mt + c + wt2 and give c. -8 Express -11598r*2 + 11008r - 21971r + 10964r as i + dr2 + or and give d. -11598 Express (2182j + 2471j + 1157j)(-3j2 + 2j*3 + 2j + 0j2 + 5j*2) as aj*3 + sj*4 + qj + l + mj2 and give m. 11620 Express 35b + 48b + 30b*2 - 53b*2 + 53b as kb + r + mb*2 and give m. -23 Rearrange -1229i*2 + 505i*2 - 651i*2 - 2483i*2 - 360i*2 to the form hi + m + vi2 and give v. -4218 Express 1522m + 2 - 3050m - 3m*2 + 1538m as dm + g + um*2 and give g. 2 Express -13s - 86s2 + 40s - 16s - 13s - 3 + 185s2 as ns + ts2 + v and give v. -3 Express -p*2	{ "pile_set_name": "DM Mathematics" }
ose -6r + 11r - j = 0. Let o = 914 + r. Is o a composite number? True Suppose 10t - q - 2026125 = 0, -t - 15q + 202633 = -11q. Is t composite? False Let d be (5 - 11 - -7)5/1. Let x(b) = 35b3 + 4b*2 + 11b + 1. Is x(d) a composite number? True Suppose 2s + 985631 = 5c, 4c - 3392s - 788495 = -3389s. Is c a prime number? False Suppose 5d = -l + 772875, -l - 34d + 33d = -772859. Is l a prime number? False Let y be (-1 + 67)/(-3)(-6)/12. Suppose 0 = yf - 9f. Suppose f = -3k + 1337 + 712. Is k a prime number? True Suppose 6f - 3j = 2f + 64, 2f = -2j + 32. Suppose 0 = -15z + fz - 3273. Is z a prime number? False Let c = 5328 - 2998. Let f = -1276 + c. Let s = 1949 - f. Is s prime? False Suppose 61139 = z - 37s + 40s, 4s - 305629 = -5z. Is z prime? True Is (-1 + -2)/((-47)/(227520514/78)) a composite number? False Let x be (-2)/((-2)/13)(-428)/(-1). Suppose -19043 = -4p - 3u + 3161, -p = 4u - x. Suppose 10n + p = 14n. Is n composite? True Is (-2742)/(-1828)(58020 - 32/(-9)) a composite number? True Let r(d) = d3 + 6d*2 + 3d + 3. Let v be r(-3). Is (3 + -208)v/(-35) a composite number? True Let z(f) = 140f - 68. Let p be z(-10). Let l = -477 - p. Is l a composite number? False Let t(r) = 36r3 - 4r*2 + 3r + 3. Let h be t(2). Suppose -hd + 280d + 2333 = 0. Is d a composite number? False Let t = 27 - 25. Let r be ((-23328)/45)/(t/(-10)). Let p = r - 1754. Is p a composite number? True Let g = -16029 - -32798. Is g a prime number? False Let a(v) = 30789v - 1426. Is a(3) a composite number? True Let c(n) = 29751n - 56. Is c(1) a prime number? False Let r(d) = 235d - 171. Let j(g) = 233g - 174. Let w(b) = 7j(b) - 6r(b). Is w(19) a composite number? False Suppose 0q - w = -2q + 71, 3q + 5w - 113 = 0. Suppose -3t = -5z - 7t + 534, 2 = 2t. Let h = z + q. Is h a prime number? False Suppose -8i = -6i - 12. Suppose -8k + ik = 16. Is 15/(-10) + (-3060)/k a prime number? False Suppose 2w - 3990 = 3y - w, 2w = -4y - 5350. Let o = 800 - y. Let r = 3532 - o. Is r composite? True Suppose -729812 = -2o - 3q, -2o = 306q - 309q - 729824. Is o prime? True Let v(t) = 409t*2 - 69t + 13. Is v(-11) prime? True Let m = 2972157 - 1859518. Is m prime? False Let v = 137 - 137. Suppose v = -j - 368 + 1587. Is j prime? False Suppose -5f = 5d - 608790, -121757 = 21f - 22f - 2d. Is f composite? True Suppose -2d + 13a - 12a = -947662, -4d - 2a = -1895340. Is d a prime number? True Let d(n) = -1359n3 + 12n*2 + 21n - 77. Is d(-7) a composite number? True Let d = -259 + 270. Suppose -dz + 2648 + 13005 = 0. Is z a composite number? False Suppose 25r - 618253 = -296791 + 683813. Is r a prime number? False Let k be 22/((13/(-455))/((-2)/(-5))). Let g = k - -2107. Is g a composite number? True Suppose 15d - 1100 = 11d. Suppose 5l + d = 4y, 0 = 2l - 7l + 5. Let r = 141 + y. Is r a prime number? True Suppose -b + 10 + 1079 = 5l, 0 = l - 4b - 201. Let w = 1182 + l. Is w prime? True Suppose 6s - 253351 = 402095. Is s composite? True Suppose v + 5y = 19589, -89y + 87y - 39250 = -2v. Is v a prime number? False Suppose -28 - 12 = -4w - 3q, -4w - q + 40 = 0. Suppose wu = 2u + 9736. Is u a prime number? True Let z(l) = 704l3 + 24l - 77. Is z(3) a composite number? True Suppose -4k + 58021 + 167383 = 0. Is k a composite number? True Let r be (1/3)/((-13)/94029)-1. Suppose s - 259 - 964 = -2t, -r = -2s + 3t. Is s composite? False Suppose 4f = -0f + 1924. Suppose -196q + 666 = -193q. Let i = f - q. Is i prime? False Let x(n) = -4n + 560n3 + 2n + 123n3 + n2 + 4 + 16n*3. Let l be x(2). Suppose -9r = -13r + l. Is r composite? False Is 6/57 + 0 + 19244856/152 prime? True Let q(o) = -10780o*2 - o - 1. Let d be q(-2). Let l be (6/3)/((-18)/d). Suppose 1627 = -4w + l. Is w prime? False Let t(m) = 207m3 - 17m*2 - 40m + 25. Is t(9) prime? False Let m = 184 - 180. Suppose -48931 = -my - 4n - n, -6 = -2n. Is y a prime number? False Is (1/(-5))/(26/65)(-40092 - -14) a composite number? True Suppose 17x = 12x. Let u be ((-2609)/3)/((-3)/(-9)). Is (-10)/(-5 - x)u/(-2) a prime number? True Suppose 80724 + 280688 = 4r. Is r a prime number? True Let d(i) = -3096i + 3607. Is d(-51) a prime number? True Suppose -12q + 4u - 36722 = -7q, 36698 = -5q - 4u. Let z = 34385 + q. Is z a prime number? True Let z = -294650 + 2490732. Suppose -6t = 43t - z. Is t a composite number? True Suppose -3939 - 7670 = 13h. Suppose -3j + 5v = 1676, 1931 = -3j + v + 247. Let n = j - h. Is n prime? True Let n be (-7)/(((-14)/(-64))/7). Let l be (((-2664)/(-14))/(-2))/(48/n). Let d = l - 179. Is d a prime number? False Suppose i - 43 = -36. Suppose 11 = ia - 24. Suppose ah - 3702 = 7963. Is h a prime number? True Suppose -3p - 2t + 6 = 0, 8p - t = 3p - 3. Suppose 0h - 2 = h, p = -4q + h + 266. Suppose 61w = qw - 2365. Is w prime? False Is ((-278394)/(-6))/(-6 - (2 - 9)) prime? True Let b(c) = -c. Suppose 5m - 51 = -61. Let t be b(m). Suppose 0w + w + 5s - 21 = 0, 5w = -ts + 36. Is w prime? False Suppose -52r - 234231 = -55r. Is r a composite number? True Let o(l) = 120l + 61. Suppose -4g + 71 = -9. Is o(g) composite? True Suppose 2g - 3i = 1109141, -2i - 22 + 20 = 0. Is g a composite number? False Let x(k) = -1243k - 89. Suppose -5o - n - 24 = -o, 0 = 5n. Is x(o) composite? False Let k(b) = 323b*3 + 4b*2 - 11b - 7. Is k(3) a prime number? False Suppose 190w - 11332824 = -39w + 26086463. Is w a composite number? False Suppose -18l + 155 = -133. Is (-3034)/(-8) - 4/l a prime number? True Suppose 2z = -2f - 0f + 2, -f - 2z + 6 = 0. Is 34/(-2)(f - 79) a composite number? True Let f = 68658 + -7301. Is f a composite number? False Let i(n) = 5n2 + n - 77. Let l = 312 + -334. Is i(l) composite? True Is (70/(-21) + 4)/((-1326864)/(-663426) - 2) a composite number? False Let r(p) = 395p*3 - 5p*2 - 75p + 539. Is r(8) composite? True Let r be (-22 - -12)36/20-1. Is -2((-197955)/r)/5 prime? False Suppose 18s - 618698 - 5281937 = 459827. Is s prime? True Suppose 6j - 19 = -1. Suppose 0k + 18 = jk. Suppose ks - 2s - 4c - 10436 = 0, 13045 = 5s + c. Is s a composite number? False Suppose 0 = 5f + 2k - 1389475, 273f = 271f - k + 555789. Is f prime? True Suppose 41h = 82 + 82. Suppose 0 = 3s + 3m - 6288, -10s + 15s + hm = 10483. Is s a prime number? True Let b(p) = -53p*2 - 5p + 3. Let y be b(16). Let x = y - -6738. Is x1/(-1)1 composite? False Let v(b) = 194b2 - 53b + 188. Is v(21) prime? True Let v(o) = -15o - 34o*2 + 17o + 38o2. Let h be v(-1). Suppose 6p = 2p + 12, 3p = -hr + 2383. Is r a prime number? True Let b(h) be the first derivative of 14h*3/3 - 8h*2 - 17h - 2828. Suppose -2i - 8 = 12. Is b(i) composite? False Suppose 2l - 59206 + 10620 = 0. Suppose 62143 - l = 10p. Is p composite? True Suppose -27d + 39064 + 68885 + 49920 = 0. Is d a prime number? False Let s(p) = -29 - 22 - 31 - 1723p. Is s(-3) a prime number? True Suppose -40618 - 36967 = -5y. Is y a composite number? True Let t(d) = 90d + 37. Let p be t(6). Let b = -373 - -97. Let s = b + p. Is s prime? False Is 1506669 + (-64)/(-12)24/32 composite? True Let m(g) = 18g + 6g - 3 - g*3 - 11g + 3g2 - 2. Let k be m(5). Suppose -11t + 907 = -kt. Is t a composite number? False Let c(p) = -p2 - 4p*3 - 3p - 23p3 + 4p*2 + 4. Let j be c(3). Let a = -38 - j. Is a a prime number? False Is (-20 - (-1 - 33))/((-4)/(-141238)) composite? True Suppose 4x = -h + 7, 5h - x - 5 = -12. Let c(d) = d3 + 2d*2 + d. Let g be c(-5). Is (h + -19)5/(g/652) a composite number? True Suppose 0 = -4z - 4u + 3398788, 3u = -2923z + 2924z - 849673. Is z composite? False Suppose 178 + 857 = 5m. Let o = -87 + m. Suppose y + r = o, -y + 83 = 4r - 52. Is y composite? True Let p(v) = v + 3. Let g be p(4). Let m be -3(0 - -1) - (g + -5). Is (-3933)/18((m - -1) + 2) a prime number? False Suppose 5b - 4f = 63, -6f + f - 10 = 0. Suppose br + 883 - 4491 = 0. Let j = r + -141. Is j prime? False Suppose -4t - 165403 = -4c + 64489, -3c - 4t + 172405 = 0. Is c a composite number? True Suppose 9f + 23f = 14f + 636102. Is f a	{ "pile_set_name": "DM Mathematics" }
y(a) wrt a. 120a Let v(i) be the first derivative of -2i*7/7 - 7i*3/3 + 7. What is the third derivative of v(r) wrt r? -240r*3 Let k(f) be the second derivative of 0 + 0f*4 - 1/2f*3 - 3/20f*5 + 0f*2 + f. What is the second derivative of k(d) wrt d? -18d Let p(l) be the first derivative of -l*4/4 + 5l + 1. Differentiate p(i) wrt i. -3i2 Let n(v) be the second derivative of 0v*5 + v + 0v*2 + 0 - 1/12v*4 + 3/10v*6 + 0v*3. Find the third derivative of n(z) wrt z. 216z Suppose 31 = 5v + 6. Suppose vq + 4t = 31, 8t - 4t - 4 = 4q. Differentiate -2 - 3pq + 4p3 + p3 with respect to p. 6p2 Let a(d) be the second derivative of 3d*7/7 - 5d*4/6 - 2d. What is the third derivative of a(g) wrt g? 1080g2 Let k(x) be the first derivative of -7x*3/3 + 2x*2 + 3. What is the second derivative of k(t) wrt t? -14 Let u(l) be the first derivative of 2l*5 + 44l - 23. What is the derivative of u(t) wrt t? 40t3 Find the third derivative of -64k*4 + 58k*4 - 4k*2 - 3k*2 wrt k. -144k Let z(b) be the first derivative of b6/120 + b3/2 - b*2 + 4. Let v(i) be the second derivative of z(i). Find the first derivative of v(h) wrt h. 3h*2 Let k be ((-2)/(-4))/(1/26). Let c = -8 + k. What is the first derivative of cz - 1 + 0z - 3z wrt z? 2 Let l(v) be the first derivative of -v*6 + 0v*4 + 0v*3 - 6 + 0v + 0v5 - 1/2v*2. Find the second derivative of l(t) wrt t. -120t*3 What is the second derivative of -39p*3 - 11p + p + 39p3 + 6p*5 wrt p? 120p*3 Find the second derivative of 0s + 6s - 210s*3 + 228s*3 wrt s. 108s Suppose -3w = -2q + 7, -w + 3q = -0w + 7. Let d(b) = -1. Let g(m) = -4m - 1. Let c(p) = wg(p) - 2d(p). What is the first derivative of c(t) wrt t? 4 Let h(w) = -4w*5 + 5w*2 + 2w. Let f(a) = a*5 - 35a*3 + 35a3 - a2 + 0a2 - a. Let y(b) = 2f(b) + h(b). Find the third derivative of y(p) wrt p. -120p2 Let g be (1 - (4 - 0))-1. What is the derivative of 2n4 - 4n*g + 4n*3 + 2 wrt n? 8n3 Let c(h) = -h2 + h - 1. Let j = 1 - 0. Let i(b) = -9b3 + 8b*2 - 6b + 6. Let p(n) = ji(n) + 6c(n). What is the third derivative of p(r) wrt r? -54 Let a = 5 - 2. Suppose -ai + 0i = -12. Find the third derivative of -2x2 + x6 - x2 + ix*2 wrt x. 120x3 Let s(n) = -n3 - 4n2 + 3n - 7. Let k be s(-5). What is the second derivative of -7h3 + 5h*3 + 2h*3 - 5h*k + 3h wrt h? -30h What is the second derivative of z + 5z*4 - 22z*3 + 4z*4 + 22z*3 wrt z? 108z*2 Let p(f) = -8f*4 - 5f*3 + 10f*2 + 5f. Let g(y) = 4y4 + 3y*3 - 5y*2 - 3y. Let r(z) = 5g(z) + 3p(z). What is the third derivative of r(u) wrt u? -96u Let g(s) = s + 3. Let l be g(-1). Suppose 2n + 1 = 9. What is the third derivative of lt4 - 5tn - t2 - t*2 wrt t? -72t Find the second derivative of 24x - 9x*3 - 9x3 + x2 + 39x3 - 9x*3 wrt x. 72x + 2 Suppose -10 = -5s + 2w + 3w, 0 = -w. Find the second derivative of 11j*3 + j - 15j*3 - sj wrt j. -24j Let r(o) be the first derivative of o9/1512 + 7o*6/360 - 7o*3/3 + 1. Let v(l) be the third derivative of r(l). What is the third derivative of v(i) wrt i? 120i*2 Let g(m) be the first derivative of 0m*2 + 0m + 1 + 0m4 + 2/7m*7 + 0m6 - m3 + 0m5. What is the third derivative of g(o) wrt o? 240o*3 Let a(h) be the second derivative of 0h*4 + 2h + 0h2 - 2/3h*3 - 1/14h*7 + 0h*6 + 0h*5 + 0. Find the second derivative of a(y) wrt y. -60y3 Let l(v) = v2 + 2v + 4. Let c(x) = x2 + 1. Suppose -1 - 4 = -5a. Let f(g) = al(g) - 4c(g). Find the second derivative of f(s) wrt s. -6 Suppose 0 = x - 0x - 4. What is the third derivative of 0v*2 + xv2 + v2 + 3v6 wrt v? 360v3 Let s(h) = h + h2 - 6h + 17 - 11. Let c = 5 - 1. Let w(x) = x2 - 4x + 5. Let m(i) = cs(i) - 5w(i). What is the derivative of m(v) wrt v? -2v Let m be 3 + (1 - (1 - -1)). Differentiate 2 + t + 0 + tm - t wrt t. 2t Suppose 4q - h = q + 22, -q = -h - 8. Let w(x) = x2 - 6x - 5. Let z be w(q). Find the third derivative of -o2 - o3 + zo3 - o3 - 3o*4 wrt o. -72o Let u(i) be the third derivative of i*7/70 + 7i*5/60 + 7i*2. What is the third derivative of u(j) wrt j? 72j Let w(r) be the third derivative of r8/1680 - r5/40 - r*4/24 + 2r*2. Let p(u) be the second derivative of w(u). Find the first derivative of p(x) wrt x. 12x*2 Let t(d) = d - 1. Suppose 3n - 2 + 1 = l, -5 = 5l - 2n. Let r(v) = -2v + 3. Let m(q) = lr(q) - t(q). Find the first derivative of m(k) wrt k. 1 What is the derivative of -1 + 11 - 9p - 8p wrt p? -17 Let i(l) = 4l3 - 17l*2 + 3l + 3. Let o(t) = 5t3 - 17t*2 + 4t + 4. Let b(v) = -4i(v) + 3o(v). What is the third derivative of b(q) wrt q? -6 Let w(u) = 2u - 3. Let j(p) = 5p - 6. Let h(d) = 3j(d) - 5w(d). Let s(x) = -9x + 6. Let r(a) = 5h(a) + 3s(a). Differentiate r(q) with respect to q. -2 Let n(v) = 30v*6 + 4v*4 - 24v*2 - 4. Let t(m) = -31m*6 - 3m*4 + 25m*2 + 3. Let w(q) = -3n(q) - 4t(q). Find the third derivative of w(b) wrt b. 4080b*3 Let z = -114 - -116. Let k(i) be the third derivative of -4i*z + 0i*4 + 0i*3 + 0i + 0 - 1/60i6 - 1/30i5. Find the third derivative of k(f) wrt f. -12 Let u(r) be the second derivative of r7/70 - 5r4/24 + 3r*2/2 + r. Let g(c) be the first derivative of u(c). What is the second derivative of g(w) wrt w? 36w*2 Let o(a) be the second derivative of 0a*4 + 0 - 1/15a*6 + 0a*2 + 1/3a*3 + 0a*5 + 3a. What is the second derivative of o(d) wrt d? -24d2 Let j(l) be the third derivative of l6/10 - l5/60 - 25l*4/12 - 26l*2. What is the second derivative of j(u) wrt u? 72u - 2 Let b be -1 - (3 + 0 + -7). What is the second derivative of 3d - 1 + bd*4 + 1 - 7d wrt d? 36d2 Let b = 4 - 3. Suppose -c = 3f - 10, 3 = -2f + 2c - b. Find the first derivative of -2 + 3 - 3 - ft4 wrt t. -8t*3 Let m(c) = -10c*4 - 6c*2 + 4c - 4. Let k(f) = -19f4 - 11f*2 + 7f - 7. Let p(a) = -4k(a) + 7m(a). Find the third derivative of p(i) wrt i. 144i Let b = -9 - -12. What is the second derivative of x - 4x + 5x + 3x*b + x wrt x? 18x What is the first derivative of 23u - 2 - 3 - 16u wrt u? 7 Differentiate 8 - 4z4 + 24 + 29z*4 wrt z. 100z*3 Let h be (-2)/8 - (-3)/12. Suppose -2b + 3 + 1 = h. What is the first derivative of 2 - 9y2 + 9yb - y3 wrt y? -3y2 Let f(s) = 8s*3 + 3s*2 - 5. Let x(u) = 15u*3 + 5u*2 - 10. Let l(p) = -5f(p) + 3x(p). What is the derivative of l(n) wrt n? 15n*2 What is the third derivative of -1 + 13x*2 + 3 - 2 + 10x*5 wrt x? 600x*2 Let a(r) be the third derivative of 17r*4/24 + 2r*3 - 11r*2. Differentiate a(l) with respect to l. 17 Suppose -4h = -4b - 8, -5 - 3 = -4h + 5b. Suppose 0 = u - 6 + 1. Find the first derivative of u - 2 - 1 + 2n*h wrt n. 4n Find the third derivative of 7r6 + r6 + 13r*2 + 15r*6 + 0r*2 wrt r. 2760r*3 Let v(c) = -7c*5 - 4c*3 + 8c*2 + 4. Let q(g) = -13g*5 - 7g*3 + 16g*2 + 7. Let w(z) = -4q(z) + 7v(z). Find the third derivative of w(d) wrt d. 180d*2 Suppose 4 = t + 5l - 5, 4l + 16 = 5t. What is the third derivative of -tr2 + 6r*2 + 3r4 + r4 wrt r? 96r Let v(h) be the third derivative of 5h*5/12 - 17h*3/6 - 26h*2. Differentiate v(r) wrt r. 50r Suppose -h - 3h = -28. What is the second derivative of -hx*2 + 2x*2 + 2x*2 + 0x*2 + x wrt x? -6 Let d(i) = 8i*3 - 16i + 3. Let k(t) = 9t3 - 17t + 4. Let h(g) = 4d(g) - 3k(g). What is the second derivative of h(l) wrt l? 30l Let r(i) be the third derivative of 2/3i*3 - 8i*2 + 1/12i*4 + 0i + 0. What is the first derivative of r(h) wrt h? 2 Suppose -4z + 11 = -9. Suppose k = a + 1, 21 = zk - 0k + 3a. What is the second derivative of -kp + 4p - 3p2 + 5p*2 wrt p? 4 Let l(s) be the third derivative of 17s*6/30 + 7s5/60 - s4/6 + 49s2. What is the third derivative of l(c) wrt c? 408 Let q(n) be the third derivative of 3n6/40 - n3 + 8n2. Find the first derivative of q(k) wrt k. 27k*2 Find the third derivative of 9a*5 - 34 + 11a*2 + 0a**5 + 33 wrt a. 540	{ "pile_set_name": "DM Mathematics" }
PM and 9:54 PM? 572 How many minutes are there between 2:31 AM and 9:43 AM? 432 What is 123 minutes after 11:20 PM? 1:23 AM What is 679 minutes after 4:32 PM? 3:51 AM What is 714 minutes before 2:22 AM? 2:28 PM How many minutes are there between 12:14 PM and 6:09 PM? 355 How many minutes are there between 11:49 AM and 2:29 PM? 160 What is 211 minutes after 6:39 AM? 10:10 AM How many minutes are there between 7:24 AM and 4:37 PM? 553 What is 625 minutes after 12:07 PM? 10:32 PM What is 546 minutes after 8:01 PM? 5:07 AM What is 310 minutes before 2:19 AM? 9:09 PM What is 480 minutes after 4:38 PM? 12:38 AM What is 309 minutes after 1:47 PM? 6:56 PM How many minutes are there between 8:15 AM and 7:43 PM? 688 What is 504 minutes after 5:08 AM? 1:32 PM How many minutes are there between 2:43 PM and 2:29 AM? 706 What is 344 minutes after 3:56 AM? 9:40 AM How many minutes are there between 5:14 PM and 2:00 AM? 526 What is 616 minutes before 6:47 PM? 8:31 AM What is 152 minutes before 5:16 AM? 2:44 AM How many minutes are there between 2:16 PM and 4:19 PM? 123 How many minutes are there between 8:37 AM and 6:19 PM? 582 What is 462 minutes after 5:52 AM? 1:34 PM How many minutes are there between 6:16 AM and 8:40 AM? 144 What is 202 minutes before 1:19 PM? 9:57 AM What is 430 minutes before 10:45 PM? 3:35 PM How many minutes are there between 8:56 PM and 3:02 AM? 366 What is 175 minutes after 10:06 PM? 1:01 AM How many minutes are there between 4:32 PM and 2:42 AM? 610 How many minutes are there between 10:29 AM and 9:08 PM? 639 What is 505 minutes before 2:08 AM? 5:43 PM How many minutes are there between 7:46 PM and 2:58 AM? 432 How many minutes are there between 6:09 PM and 3:42 AM? 573 What is 145 minutes after 7:24 PM? 9:49 PM What is 359 minutes before 12:39 AM? 6:40 PM How many minutes are there between 6:20 PM and 9:07 PM? 167 How many minutes are there between 8:21 AM and 8:59 AM? 38 How many minutes are there between 9:18 AM and 1:42 PM? 264 What is 661 minutes after 2:57 PM? 1:58 AM What is 354 minutes before 10:07 AM? 4:13 AM What is 394 minutes after 1:39 PM? 8:13 PM How many minutes are there between 9:08 AM and 6:32 PM? 564 What is 432 minutes after 12:43 AM? 7:55 AM How many minutes are there between 2:28 AM and 7:26 AM? 298 What is 366 minutes before 11:13 AM? 5:07 AM What is 110 minutes before 11:44 PM? 9:54 PM How many minutes are there between 3:21 AM and 5:18 AM? 117 What is 576 minutes before 3:27 PM? 5:51 AM What is 98 minutes before 3:09 AM? 1:31 AM How many minutes are there between 11:23 PM and 8:07 AM? 524 How many minutes are there between 11:19 AM and 5:58 PM? 399 What is 59 minutes after 9:20 PM? 10:19 PM How many minutes are there between 7:29 AM and 2:32 PM? 423 How many minutes are there between 12:20 AM and 12:58 AM? 38 How many minutes are there between 4:48 PM and 5:51 PM? 63 What is 528 minutes after 5:25 PM? 2:13 AM How many minutes are there between 9:13 PM and 2:55 AM? 342 How many minutes are there between 6:29 PM and 11:29 PM? 300 How many minutes are there between 7:31 AM and 7:16 PM? 705 What is 172 minutes before 8:24 AM? 5:32 AM How many minutes are there between 11:00 PM and 1:39 AM? 159 How many minutes are there between 5:51 PM and 4:08 AM? 617 How many minutes are there between 7:01 AM and 10:18 AM? 197 How many minutes are there between 4:27 AM and 1:30 PM? 543 How many minutes are there between 4:59 AM and 2:58 PM? 599 What is 578 minutes before 8:13 AM? 10:35 PM How many minutes are there between 3:43 AM and 2:38 PM? 655 How many minutes are there between 3:23 PM and 2:07 AM? 644 What is 627 minutes after 4:26 AM? 2:53 PM How many minutes are there between 1:00 PM and 12:43 AM? 703 How many minutes are there between 6:55 AM and 6:54 PM? 719 How many minutes are there between 12:32 PM and 12:46 PM? 14 How many minutes are there between 12:12 AM and 5:04 AM? 292 How many minutes are there between 1:39 PM and 8:43 PM? 424 What is 663 minutes after 7:46 PM? 6:49 AM How many minutes are there between 4:33 PM and 6:14 PM? 101 How many minutes are there between 11:55 AM and 8:47 PM? 532 What is 359 minutes before 12:11 PM? 6:12 AM How many minutes are there between 2:02 AM and 1:44 PM? 702 What is 148 minutes after 8:48 AM? 11:16 AM How many minutes are there between 3:23 AM and 7:34 AM? 251 What is 685 minutes before 3:21 AM? 3:56 PM What is 690 minutes after 12:31 PM? 12:01 AM How many minutes are there between 9:35 AM and 7:59 PM? 624 How many minutes are there between 12:35 AM and 5:24 AM? 289 What is 448 minutes before 8:40 AM? 1:12 AM How many minutes are there between 1:19 AM and 10:36 AM? 557 How many minutes are there between 5:21 PM and 6:12 PM? 51 How many minutes are there between 11:25 AM and 3:59 PM? 274 How many minutes are there between 3:42 PM and 4:58 PM? 76 How many minutes are there between 7:25 AM and 2:23 PM? 418 What is 313 minutes before 3:26 PM? 10:13 AM What is 315 minutes after 5:12 PM? 10:27 PM What is 315 minutes after 12:25 AM? 5:40 AM How many minutes are there between 2:00 AM and 9:53 AM? 473 How many minutes are there between 12:14 AM and 5:06 AM? 292 What is 48 minutes after 8:55 AM? 9:43 AM How many minutes are there between 4:49 AM and 4:07 PM? 678 How many minutes are there between 3:17 AM and 3:59 AM? 42 How many minutes are there between 10:42 AM and 8:01 PM? 559 What is 706 minutes before 7:06 AM? 7:20 PM What is 376 minutes before 11:13 PM? 4:57 PM What is 502 minutes before 1:46 AM? 5:24 PM What is 631 minutes before 4:11 PM? 5:40 AM What is 342 minutes before 5:26 AM? 11:44 PM What is 156 minutes before 8:11 AM? 5:35 AM What is 60 minutes before 9:11 PM? 8:11 PM What is 646 minutes after 12:51 AM? 11:37 AM How many minutes are there between 2:26 PM and 6:38 PM? 252 How many minutes are there between 7:50 AM and 8:02 AM? 12 What is 595 minutes before 8:26 PM? 10:31 AM What is 204 minutes after 3:40 AM? 7:04 AM What is 270 minutes after 11:26 PM? 3:56 AM How many minutes are there between 1:40 AM and 11:56 AM? 616 What is 402 minutes after 9:01 AM? 3:43 PM How many minutes are there between 8:44 AM and 8:16 PM? 692 How many minutes are there between 9:03 AM and 5:05 PM? 482 What is 260 minutes before 10:03 PM? 5:43 PM How many minutes are there between 4:12 AM and 11:54 AM? 462 What is 520 minutes before 9:55 PM? 1:15 PM How many minutes are there between 8:27 AM and 9:58 AM? 91 How many minutes are there between 1:08 PM and 1:44 PM? 36 What is 71 minutes before 8:08 AM? 6:57 AM What is 663 minutes before 2:05 AM? 3:02 PM How many minutes are there between 2:57 PM and 7:40 PM? 283 What is 584 minutes after 7:26 AM? 5:10 PM What is 144 minutes after 4:07 AM? 6:31 AM What is 612 minutes after 10:24 AM? 8:36 PM How many minutes are there between 2:52 AM and 7:48 AM? 296 How many minutes are there between 3:10 AM and 11:23 AM? 493 How many minutes are there between 10:36 PM and 5:35 AM? 419 What is 443 minutes before 1:12 AM? 5:49 PM How many minutes are there between 12:37 PM and 4:52 PM? 255 What is 439 minutes after 1:36 AM? 8:55 AM How many minutes are there between 1:46 PM and 1:45 AM? 719 How many minutes are there between 1:36 PM and 9:38 PM? 482 How many minutes are there between 12:42 AM and 6:48 AM? 366 What is 52 minutes before 8:50 AM? 7:58 AM How many minutes are there between 6:32 PM and 7:14 PM? 42 What is 317 minutes before 2:23 PM? 9:06 AM How many minutes are there between 6:39 AM and 5:06 PM? 627 What is 704 minutes after 4:14 AM? 3:58 PM How many minutes are there between 3:16 AM and 2:00 PM? 644 How many minutes are there between 1:25 AM and 6:25 AM? 300 What is 508 minutes before 8:23 AM? 11:55 PM What is 302 minutes after 6:11 PM? 11:13 PM What is 121 minutes before 1:18 PM? 11:17 AM What is 538 minutes after 1:20 PM? 10:18 PM What is 110 minutes after 10:23 PM? 12:13 AM What is 52 minutes after 3:22 PM? 4:14 PM How many minutes are there between 4:30 PM and 6:06 PM? 96 What is 56 minutes after 2:19 AM? 3:15 AM How many minutes are there between 9:36 AM and 3:50 PM? 374 What is 244 minutes after 11:57 AM? 4:01 PM What is 501 minutes before 7:29 AM? 11:08 PM How many minutes are there between 1:28 PM and 8:02 PM? 394 How many minutes are there	{ "pile_set_name": "DM Mathematics" }
11 Let a(s) = s*3 + 11s*2 + 6s + 7. Let z be (1(-15)/(-6))/((-124)/496). What is a(z)? 47 Suppose -114p + 129p + 75 = 0. Let x(l) = -14l*2 - 5l - 14. Let y(m) = 5m2 + 2m + 5. Let h(w) = -6x(w) - 17y(w). Determine h(p). -6 Let x be (2 - 3)/(1/(-32)). Let y = -7 + 36. Let o = y - x. Let v(z) = z*3 + 3z*2 - 2z - 4. Calculate v(o). 2 Suppose -4o + 3o - t = -483, 5o = -3t + 2411. Let s(b) = -b*3 + ob - 9b2 - 487b + 3 + 3. Give s(-8). -10 Let h(q) = -q - 10. Let g(j) = j*2 - 20j + 46. Let v be (-2 - (-45)/20)/((-6)/(-72)). Let d be g(v). Determine h(d). -5 Let o be (-6)/(-9) + (-160)/320. Let r(c) be the second derivative of 5/2c2 - oc*3 + 12c + 0. What is r(4)? 1 Let i(o) = o*2 - 5o + 1. Let b be i(4). Let q(w) be the second derivative of w5/20 + w4/6 + w*2/2 + 23461w. Calculate q(b). -8 Let m(y) = 4y + 12. Let h(c) = 8c + 25. Let x(l) = 7h(l) - 13m(l). Calculate x(7). 47 Let q(w) = w*2 - 8w + 6. Let i(h) = h + 1. Let s(n) = -i(n) + q(n). Let r(y) = -3y2 - 4y + 9. Let c be r(0). What is s(c)? 5 Let i(h) = -h*2 - 12h - 14. Let d be i(-10). Let x(a) be the second derivative of a*3/2 - 5a*2/2 + 32a - 4. Calculate x(d). 13 Let q(m) = -m*3 + 2m - 2. Let a(j) = j*2 + 5j + 359. Let k be a(0). Let o = k - 356. Give q(o). -23 Let m(n) = 7 + 3n + 24n - 12 + 2n3 - 26n*2 - 2n. What is m(12)? 7 Let n(f) = -f*2 + 2f + 1. Suppose -4x - 174 + 62 = 0. Let h be x15/(-10). Suppose g - 8g + h = 0. Determine n(g). 1 Suppose 35n - 6n - 24 - 5 = 0. Let u(g) = 3g - 8. Calculate u(n). -5 Let j(h) = -2068h*2 - 20h - 12 + 7h + 1420h*2 + 726h*2. Determine j(-1). 79 Let p = 21151/63435 + -2/21145. Let b(v) be the first derivative of -4v + 3v2 - 22 - pv*3. Determine b(5). 1 Let p(u) = -4u*2 - 3u + 2. Suppose -70c - 68 = -74c. Suppose -27 = cl + 24. What is p(l)? -25 Suppose 54s + 27809 + 8155 = 0. Let z = s - -659. Let q(i) = -i*3 - 9i*2 - 16i - 7. Calculate q(z). 7 Suppose a = -o + 5a + 6, -3o + 2a - 12 = 0. Let d be 20/o(-12)/8. Let v(p) = dp - 7p + p - 5. Give v(-4). -1 Suppose 17g - 18g + 28 = -5f, -4f = 20. Suppose 5q + 25 = ga + 4q, 0 = -3a + 4q + 19. Let s(b) = -b2 + 7b + 6. Calculate s(a). -12 Let g(z) = z*3 - 8z*2 + 15z - 3. Suppose -5h + 30 = -5i, -7h + 24 = -3h + 4i. Calculate g(h). 15 Let t(h) be the second derivative of h4/8 - 3h*2/2 + 3h. Let g(r) be the first derivative of t(r). Suppose 34z + 69z = 515. Determine g(z). 15 Suppose -3f + 12 = 11a + 31, -2a + 2f - 6 = 0. Let l(w) = w3 - w2 - 4w - 8. Calculate l(a). -12 Let w(h) be the second derivative of h3/6 + 5h*2/2 + 806h. Determine w(-4). 1 Suppose -4 = 2d - 3d, -4 = 4s + d. Let h(y) = -5y - 4. Let l(p) = 10p + 6. Suppose 4c + 33 = 15c. Let z(a) = cl(a) + 5h(a). Determine z(s). -12 Let j(b) be the first derivative of -b4/4 - 7b*3/3 - 3b*2 + 2b + 2403. Suppose -v = 2z + 10, -32 = 4z - v - 3v. Calculate j(z). 2 Let i(n) = 8n*2 + 40n - 4. Let u(p) = -13p2 - 70p + 9. Let j(s) = 10i(s) + 6u(s). What is j(7)? -28 Let m = -220 - -222. Let p(t) = 12t - 71t*2 - 16t + 72tm + 2. Calculate p(3). -1 Suppose 502q + g - 15 = 506q, -5g + 59 = -4q. Let b(i) be the second derivative of -2i5 + i3/3 + i2/2 + i. Give b(q). 39 Let s(v) be the third derivative of -v4/8 - 4v3 + 2751v*2 - 2v. Let u be (-11 - -1)/(2 + -1). Calculate s(u). 6 Let a(g) be the first derivative of -4g - 4/3g*3 - 2g*2 + 96 - 1/4g4. What is a(-3)? -1 Let b(x) = x3 - x*2 - 2x + 2. Let h(z) = 8z3 - 8z*2 + 25. Let d(k) = 6b(k) - h(k). Calculate d(-1). 3 Let m(z) be the first derivative of -z*6/360 + 2z*4/3 - 209z*3/3 + 181. Let q(g) be the third derivative of m(g). Give q(0). 16 Let l be -4 - (-3 - -4)1. Let j be 3 - (-280)/(-147) - (-6)/(-63). Let x(u) = -3 + 0 + j + u + 2. What is x(l)? -5 Let a(z) be the second derivative of -z*3/6 - 37z*2/2 - 2z + 863. Determine a(-23). -14 Let x(f) = -22f + 2. Let v(l) = -138l + 14. Let c(z) = 70z - 7. Let b(k) = 5c(k) + 3v(k). Let w(p) = 2b(p) - 7x(p). Let y = 30 + -29. What is w(y)? 26 Let w be 41/(-7) + 6/7. Let p(h) = 2h - 108 + 0h + 118. Give p(w). 0 Suppose 3a - 5s - 6 = a, 0 = -5a + s + 15. Let r(d) = 18d2 + 5d + 5 - 19d2 - ad - d*3 - 2. What is r(-2)? 3 Let i = 51 - 38. Let y(m) = m + 0m*2 - 5m*2 - i - 3m - m*3 + 10. Let c(f) = 21f + 79. Let a be c(-4). Calculate y(a). 7 Let o(h) = -13h - 409. Suppose 0 = -16495a + 16447a - 1536. Give o(a). 7 Let h(t) = -22t - 1314019t2 - 47t + 95 + 1314017t2. Give h(-36). -13 Let s(u) = 9u - 12. Let c(v) = v*2 + 2v + 2. Let k be c(3). Suppose 5m + k = -8. Let a(n) = 4n - 6. Let d(o) = ma(o) + 2s(o). What is d(5)? -4 Let o(p) = 3p + 32. Let l = -1778 - -1771. Give o(l). 11 Let a = 17 - 12. Let r(w) = -w2 + 12w - 20. Let y be r(8). Let s(q) = 6q2 - 14q3 - q2 + q*3 + 5 - 2q + yq3. Calculate s(a). -5 Let q(v) be the first derivative of -v2/2 - 9v + 2. Let j(t) = 2717t - 46194. Let m be j(17). Calculate q(m). -4 Let l(q) = -q3 - 3q*2 - 3q + 3. Let z be l(-2). Let w be -5(z + -1 - 3). Let f(x) = 0x - 4 + 9 + x + x. Determine f(w). -5 Let l = 10841 - 10838. Let a(i) = i*2 - i + 1. Let p(k) = 3k. Let x(q) = 2a(q) + p(q). Calculate x(l). 23 Suppose -19 = 5b + w, b - 3w = -6w - 15. Let g(z) be the third derivative of z4/6 - z3/2 - z*2 + 210z. Determine g(b). -15 Let x(p) = -25p2 - 4p - 22. Let b(k) = 8k2 - k + 3. Let y(u) = 3b(u) + x(u). What is y(-5)? -3 Let k(b) = -2b - 30b + 41b - 7b + 5. Suppose -3t - 15 = -0t. What is k(t)? -5 Let c(g) = -8g - 14g*2 + 80g*3 + 3g*2 + 35g - 79g3 - 8 - 1. Determine c(4). -13 Suppose -5g + 6s + 0 = -5, s = 5g - 5. Let c(t) = 23t2 + 3t - 2. What is c(g)? 24 Let b be 3/((-42)/(-396) + (-8)/(-132)). Let l(t) = 2t3 - 36t*2 + 5t - 57. Give l(b). 33 Let z = -4060 - -4060. Let i(r) be the second derivative of 0r2 - 1/6r*3 + 2/5r*5 - 1/6r*4 + z + 17r. Calculate i(-1). -9 Let i = 234 - 232. Suppose -18 = 2b + 3h + i, -2b + h = 12. Let l(n) = n3 + 7n2 + n - 5. Determine l(b). -12 Let h(f) = -f3 + 14f2 - 12f + 29. Suppose t - 288d + 285d - 16 = 0, 0 = -t - 4d + 9. What is h(t)? 42 Let h(f) = f + 2. Let u(r) = 4r - 10. Suppose -2p + 5n + 27 = 0, -13n + 18n = -25. Let t(s) = pu(s) - 3h(s). Determine t(15). -1 Let s(u) = 8u. Let q(m) be the third derivative of -m5/60 - m4/3 + m3/6 + 68m*2. Let a be q(-8). What is s(a)? 8 Let q(d) = -2d + 4. Let c = 310 + -591. Let f = 290 + c. Determine q(f). -14 Let v(x) = 6x - 60. Suppose -2q = -2j + 14, 4j - 216 = 9q - 213. Determine v(j). 12 Let f(v) be the third derivative of -v6/60 - 7v5/30 + v4/8 - 11v3/6 - 170v*2 - 9. Calculate f(-7). -32 Suppose 0 = 2m - 0m - 4, -2t - 4m - 6 = 0. Let j = 1545 + -1545. Let l(z) = jz*3 + 3z*3 - 6z + 2z2 - 10z*2 - 4z*3 + 188 - 178. What is l(t)? 3 Suppose -3355 = -u - 3358, 3u = -4c - 33. Let v(q) = -3q*2 - 12q - 9. Give v(c). -45 Suppose 14s = 16s - 4. Suppose 4d + 0 = -3n + 2, -n = -sd + 6. Let l(b) = -b2 - 9b - 8 - b*3 - 6bd + 1 - b2. Determine l(-7). 7 Suppose -3r = -p - 21, -6p + p - 40 = -2r. Let i = p + 12. Let b(z) be the third derivative of -z4/24 - z3/3 + 3z2. Calculate b(i). -8 Let p(g) = -g + 8. Let b(q) = q3 + 5q2 - 9. Suppose 3j + 4j + 497 = 0. Let t = -75 - j. Let x be b(t). Calculate p(x). 1 Suppose -2z - 3d = 14, 2d - d - 42 = 4z. Let l be z/((-2)/(1/1)). Let b(w) = 39w + 6. Let a(u) = -88u - 12. Let x(y) = -4a(y) - 9b(y). Determine x(l). -1 Let u(n) = 5n - 16. Let p(s) = 14s - 47. Let c(f) = -6p(f) + 17u(f). Suppose -23d + 149d + 1134 = 0. Give c(d). 1 Let b(s) = -18s + 2s + 3s + 12 + 2s2 - s2 - 2. Let w be b(0). Let k(c) = c3 - 10c*2 + 3c - 3. Determine k(w). 27 Let b(m) be the second derivative of m*5/60 + 5m*4/24 - 5m3/6 + m2/2 + 4m. Let l(o) be the first derivative of b(o). Let d = 274 + -279. Give l(d). -5 Let j(n) = -17n + 49. Let i(k) = -6k + 16. Let b(v) = 11i(v) - 4j(v). Let p be b(10). Let s(d) = -4 - 14d + 0 + 15d. What is s(p)? -4 Let q(l) = -4l - 1. Let h	{ "pile_set_name": "DM Mathematics" }
. Calculate i(f(k)). 18k4 Let i(g) = -3g. Let q(k) = -18k2. Give i(q(u)). 54u2 Let n(u) be the third derivative of u4/8 + 28u2. Let x(a) = 16a*2. Give n(x(y)). 48y*2 Let d(u) = -u - 18. Let z(g) = 2. Let r(b) = 2d(b) + 18z(b). Let q(f) = 8f. Give r(q(t)). -16t Let s(n) = 6n*2. Let f(p) = -441p*2. Give f(s(b)). -15876b*4 Let z(o) be the third derivative of 0o*3 + 0o + o*2 + 0 + 1/12o*4. Let h(y) = 6y - 7y - y. Give z(h(c)). -4c Let m(n) = 4147 - 4147 + 19n. Let r(j) = -2j. Determine m(r(q)). -38q Let v(w) = -5w + 2. Let z(r) = -r. Calculate z(v(x)). 5x - 2 Let b(z) = -21z*2. Let l(r) = 6r*2. Let a(x) = -5b(x) - 18l(x). Let m(u) = 4u*2. What is a(m(q))? -48q*4 Let d(c) = 3c + 6c + c - 7c. Let o(z) = 2z2. Determine o(d(n)). 18n*2 Let u(j) = 2j*2. Let b(d) = 3691d + 1. Determine b(u(f)). 7382f2 + 1 Let o(c) = -2c. Let k(g) = -g + 2g + g. Calculate k(o(x)). -4x Let h(r) = r2. Let a(z) be the first derivative of z6/180 + 5z3/3 + 3. Let o(p) be the third derivative of a(p). What is o(h(v))? 2v*4 Let u(f) = -f. Let i(r) = -2r - 47. Give i(u(y)). 2y - 47 Let w(a) = -a. Let k(j) be the second derivative of 4j*3/3 - 26j. Determine k(w(x)). -8x Let t(u) = -u2. Let r(l) = -8l*2 + l - 28. Determine r(t(g)). -8g4 - g2 - 28 Let n(a) = 22a. Let w(z) = 7z*2. Give w(n(y)). 3388y*2 Let i(q) = -4q*2. Let a(u) = 30u*2 - 61u*2 + 30u*2. What is i(a(h))? -4h*4 Let i(l) = 9l + 2. Let a(o) = 143o + 33. Let m(f) = -2a(f) + 33i(f). Let v(d) = 2d. Determine m(v(k)). 22k Let m(p) = 3p*2. Let d(a) = 70a - 2. Give d(m(l)). 210l2 - 2 Let i(h) be the first derivative of -h2 + 2. Let m be 1 + -3 + 2 - -2. Let s(d) = 0d*m - 2d2 + d2. Give s(i(l)). -4l2 Let w(f) = -2f*2 - 3f - 3. Let k(l) = -10l2 - 14l - 14. Let s(j) = 3k(j) - 14w(j). Let c(v) = -8v + 0v + 13v - 3v. Determine s(c(a)). -8a2 Let x(b) be the second derivative of 0b*3 + 1/24b*4 + 0 + 3/2b*2 + b. Let d(q) be the first derivative of x(q). Let r(w) = -8w. Determine r(d(p)). -8p Let l(x) = -x2. Suppose -2s = -4s + 10. Let z(y) = -2y*2. Let b(g) = sz(g) - 14l(g). Let h(q) = -2q. Determine b(h(d)). 16d2 Let d(i) = i3 - 12i*2 - 13i + 6. Let l be d(13). Let h(a) = -3a2 + 3a*2 - la*2 + 2a2. Let g(n) = -n2. Give g(h(m)). -16m4 Let x(d) = 5d - 3. Let f be 2 + 2/((-6)/15). Let b(q) = 26q - 16. Let l(n) = fb(n) + 16x(n). Let g(w) = w. Calculate l(g(u)). 2u Let a(v) = 2v2. Let l(t) = 36t - 36t - 7t*2. What is l(a(y))? -28y4 Let h(t) be the third derivative of -t5/5 - 2t2. Let u(a) = a. What is h(u(q))? -12q*2 Let w(z) = 5z*2. Let m(s) = 29s*2 - 2s. What is w(m(y))? 4205y4 - 580y*3 + 20y*2 Let c(o) = -o. Let u(w) be the first derivative of 0w + 1/12w4 + 0w3 + w2 + 1. Let q(f) be the second derivative of u(f). Give c(q(h)). -2h Suppose -5w + 12 - 2 = 0. Let z(v) = wv2 - v2 - v2 + 2v*2. Let f(l) = 4l. Determine f(z(u)). 8u2 Let j(b) = -13b - 4. Let o(q) = 299q + 91. Let h(m) = -91j(m) - 4o(m). Let p(s) = 2s. What is p(h(g))? -26g Let q(v) be the third derivative of -v4/6 - 2v*2. Let j(t) = -11t*2. Determine q(j(p)). 44p*2 Let s(y) = -15 + 15 - 2y. Let h(w) be the third derivative of -w4/24 - w2. What is h(s(c))? 2c Let w(v) = -v2 - v - 1. Let c(r) = 4r*2 + 6r + 6. Let o(u) = c(u) + 6w(u). Let a(d) be the first derivative of -d2 - 2. What is a(o(b))? 4b*2 Let b(h) = -4h. Let n(j) = 2j - 4. Let c(f) = -4f + 9. Let k(s) = -4c(s) - 9n(s). Calculate b(k(w)). 8w Suppose -3v + 4v = i + 2, 2v = 3i + 9. Let o = -2 - v. Let p(n) = -1 - 2n + o. Let b(h) = -h*2. Give b(p(c)). -4c2 Let u(d) be the third derivative of d5/20 - d2. Let m(b) = b2 - 2b. Let s(t) = -6t + t*2 + 2t + t. Let c(x) = 3m(x) - 2s(x). What is u(c(l))? 3l4 Let v be 4/(-14) + (-22)/(-77). Let l(x) = -x2 + 2x*2 + vx2. Let n(h) = h. Give l(n(o)). o2 Let v(c) = 7c2. Let y(h) = -170h*2. What is y(v(z))? -8330z4 Let c(a) = -a2 - 1. Let x(f) = -3f2 - 6. Let p(i) = 6c(i) - x(i). Let u(k) = -k*2. What is p(u(q))? -3q*4 Let h(n) = 9n*2. Let p(w) be the first derivative of -2w*3/3 - 6. Calculate p(h(b)). -162b*4 Let c(s) be the first derivative of 2s*3/3 - 15. Let r(o) = o. Determine c(r(z)). 2z*2 Let v(t) = 5t. Let u be v(1). Let j(s) = -4s - 2s + us. Let y(w) = w. Determine j(y(x)). -x Let t(d) = -d2. Let s be (-2 + 1)/((-1)/3). Let l(p) = -8p + sp + 2p. What is t(l(h))? -9h2 Let v(y) = 24y + 5. Let m(w) = 5w2. Determine v(m(q)). 120q*2 + 5 Let y be (-4)/(-6) - (-4)/3. Let c(g) = 0g*2 + 0g*2 + 2g*y. Let q(z) = 0z2 + z2 + 0z2. Calculate q(c(b)). 4b4 Let w(f) be the second derivative of -f3/6 + 2f. Let q(a) = -a2 - a. Let g(u) = -49u*2 - 42u. Let n(c) = g(c) - 42q(c). Determine w(n(j)). 7j*2 Let x(w) = 13w*2 + 4w - 4. Let i(q) = 14q2 + 5q - 5. Let j(b) = -4i(b) + 5x(b). Let y(n) = -n. What is y(j(d))? -9d2 Let c be 1/(3/12) + 1. Let r(u) = -48 + 48 + cu. Let g(y) = -6y2 - 5y + 5. Let w(v) = -v*2 - v + 1. Let x(p) = g(p) - 5w(p). What is r(x(i))? -5i2 Let x(c) = -c2. Suppose 3t = 8t. Let w(b) = -b2 - 2b*2 + tb*2 + 2b2. Determine w(x(z)). -z4 Let u(s) = 8s2. Let c(i) = 29i*2. Calculate u(c(m)). 6728m*4 Let g(x) = 249x*2 - 3x. Let h(b) = b. Determine g(h(t)). 249t2 - 3t Let d(j) = -69j2 - j + 2. Let v(i) = i. Calculate d(v(s)). -69s2 - s + 2 Let c(a) = -a2 - 4a + 4. Let d be c(-4). Let v(m) = 5m - 3 + 1 - dm. Let y(g) = -3g + 5. Let i(l) = 10v(l) + 4y(l). Let w(j) = -5j. What is w(i(s))? 10s Let i(s) = -5s. Let o(c) = -11c. Give i(o(k)). 55k Let s(l) = -3l2 + 45 - 45. Let q(a) = a2. Give s(q(k)). -3k4 Let q(f) = 11f*2. Let v(a) = -6a*2. Determine v(q(x)). -726x4 Let a(d) = d2 - 11d - 11. Let m(t) = 2t + 2. Let i(o) = 2a(o) + 11m(o). Let z(r) be the third derivative of r4/8 + r2. Give z(i(j)). 6j2 Let b(y) = -y2. Let m(x) be the second derivative of x4/8 - 3x*2/2 + x. Let i(j) be the first derivative of m(j). Give i(b(n)). -3n2 Let d(g) = -g. Let z(a) = a2 + a + 1. Let j(h) = 4h2 + 6h + 6. Suppose 0 = i - 0 + 1. Let f(n) = ij(n) + 6z(n). Calculate f(d(k)). 2k2 Let t(g) = -3g*2. Let k(c) = 0 + 3 - 8 + 4. Let v(b) = 2b - 2. Let n(d) = 4k(d) - 2v(d). Give t(n(l)). -48l2 Let n(c) = -1. Let h(u) = 2u - 6. Let k(i) = -h(i) + 6n(i). Let w(m) be the second derivative of 0m*2 + 0 + 0m*3 + 3m + 1/12m4. Determine w(k(t)). 4t*2 Let s(o) = -13o*2. Let m(c) = 114c. Calculate m(s(d)). -1482d2 Let d(c) = 75c. Let l(f) = 113f2. Determine d(l(y)). 8475y*2 Let j(l) = 2l*2. Let o be 3 - (1 - (2 + 0)). Suppose oi = -13 - 31. Let s(w) = 3w - 4. Let c(z) = 8z - 11. Let q(h) = is(h) + 4c(h). Calculate j(q(f)). 2f2 Let y(l) be the first derivative of l5/120 - l3 - 1. Let s(w) be the third derivative of y(w). Let c(p) = -3p*2. Calculate c(s(z)). -3z*2 Let q(c) = -5c*2 + 138. Let a(r) = 2r*2. Calculate a(q(t)). 50t*4 - 2760t*2 + 38088 Let r(x) = -2x*2. Let h(s) = 13s - 2 + 9 + 1. Let p(v) = 4v + 3. Let q(d) = -3h(d) + 8p(d). Calculate q(r(g)). 14g*2 Let g(t) be the first derivative of -2t*3/3 + 9. Let l(y) = 5y*2. What is g(l(q))? -50q*4 Let r(j) = -13j. Let h(d) = 346d. Calculate r(h(s)). -4498s Let p(w) = -2w2. Suppose 5g + 1 = 11. Let n(o) be the first derivative of -o2 + og - 5 - o*2 + 3. Calculate p(n(t)). -8t*2 Let v(u) = -3 - 2u + 3. Let l(r) be the first derivative of 0r + 2/3r*3 + 0r*2 - 4. Determine l(v(h)). 8h*2 Let v(s) = 4s. Let b(q) = -17q2 + 11q*2 + 10q*2. What is b(v(r))? 64r2 Let l(n) = n2. Let c(s) = 5s2 + 2. Give c(l(u)). 5u*4 + 2 Let u(c) = 2c*2. Suppose 0 = -3y - 2 - 4. Let x be y/8 + 3/12. Let p(z) = z - 2z + xz. Give u(p(t)). 2t2 Let q(m) = 1863m + 115. Let t(g) = -49g - 3. Let s(o) = -3q(o) - 115t(o). Let y(i) = -i. Determine y(s(a)). -46a Let y(s) = -6s. Let u(o) = 8o2 - 6. Let l(r) = -11 + r2 + 8r2 + 6r*2. Let v(a) = 6l(a) - 11u(a). What is y(v(j))? -12j**	{ "pile_set_name": "DM Mathematics" }
uming b is positive. b(15652/75) Simplify (t/(t/(t(-2/13)t))ttt*(-2)t)*(3/7)/((tt*5)/(t(tt(t*2t)/t)/t))(7/10) assuming t is positive. t(-277/455) Simplify ((((vvv/(v1/v))/v)/v)/(v/v(-1))(vvv(-3/7)/v)/vv(-8))/((v(1/2))*(1/30)v(-1)/(v/v(2/5))) assuming v is positive. v(-659/84) Simplify ((z(-3/7)z)/z6(z*3z)/zz/(zz/((z/((z/(zz(1/11))z)/z))/z)))/((z(1/2))20z7z(-2/13)) assuming z is positive. z(-20204/1001) Simplify ((((zz(-11))/z)/zzz(-7/5)/zz)/(z*(-1/16)/((zz16/z)/z)))(3/14) assuming z is positive. z*(639/1120) Simplify ((xx(-1/2))/x)(-26)(xx*(2/11))/xxx/(x/(x4/x))x(-1/2)/(x/x(2/3))x/(xx*(-1/4))xx3/x assuming x is positive. x(2587/132) Simplify (v(-2/5)v(1/3))(1/4)/((v*0/vv)*(-44)vv3v(-6)) assuming v is positive. v(119/60) Simplify ((((i/i*(-2/7)i)/i*(3/8))/(((ii*(-3)i)/i)/(i/(i/(i*(1/5)i)))))13)(-24) assuming i is positive. i(-55809/35) Simplify ((n14nn(nn*(-2)n)/nn)/(n(1/9)nnn(-12)))(-27) assuming n is positive. n(-699) Simplify (t44/t45)/(t26)30 assuming t is positive. t(-781) Simplify (u1/(u/u(-4)))*(4/5)(uu2)/u0(u(2/3))(2/67) assuming u is positive. u(-181/1005) Simplify (w11/((w*(-1)w)/w))3/((w(1/4))*(-5/7)w*3(w/((w/(w/(w/((w/w*(2/3))/w))))/w)w)/w) assuming w is positive. w*(2759/84) Simplify ((rr(-4/3))/(r/(r/r6)))/((rr(-7/4)r)/r*(-1/5))(rr1r/(r(r/r(5/4))/rr))(1/2) assuming r is positive. r(-679/120) Simplify (p5)(-46)/(p34)(12/11) assuming p is positive. p(-2938/11) Simplify (((c(2/17)c)/cc)/(cc/(c/c(-2/3)c))((ccc(cc(-1/5)c)/cc)/cc)/c(-3/7))(-6) assuming c is positive. c*(-25036/595) Simplify ((pp/p*0p)/(p/(p*8/p))pp(-8)ppp*(-1))/(pp/p*(-1/10)pp9)(-43) assuming p is positive. p(5233/10) Simplify b(-4/7)/b(-2/9)b(-4/7)/(b(-4/7)b)(b*(-2/9)(bb(3/5))/b)31 assuming b is positive. b(1088/105) Simplify ((o(-10/17)o)/o*(1/4))/((ooo31)/o8) assuming o is positive. o(-1689/68) Simplify ((w(-2/3))(19/4))(-1/38)/(w/w(-6)w(-2/3))(-13) assuming w is positive. w(989/12) Simplify ((s(-9))*(3/16)ss7ss/s(5/2))(1/17) assuming s is positive. s(93/272) Simplify ((l(l(l/l28)/l)/l)/(((lll(-16/9))/ll)/l)l/l(7/4)ll17)8 assuming l is positive. l(-646/9) Simplify (ll(-14)/l)/(l(2/81)lll)l*(1/11)/(ll*(-20)l) assuming l is positive. l(950/891) Simplify (s18/(ss/(s(s*27/s)/s))(s/(ss(-25)))/s(-14))(-30) assuming s is positive. s(-2430) Simplify (((n(-1/6)/(n/(n(nn/(n/n(-1/18))n)/n)))(-48))45)(2/9) assuming n is positive. n(-1120/3) Simplify (((dd(-8))/((d/d(1/6))/d))/(d/(d/(dd*(4/5)/d))d(-1/2)))/((d(2/3))22)(-20) assuming d is positive. d*(1431/5) Simplify (zz0)41z(5/3)/z(4/9)(z(-1))(1/62)/((z*1z)/z(z/((z(z/z1)/z)/z))/z) assuming z is positive. z(22435/558) Simplify m/m*38m/(m/(mm(-12)))(mmm*31m)(-26) assuming m is positive. m(-932) Simplify (j*0j(-11))(-27/2)((j(1/4))(-2/5))(-43) assuming j is positive. j(764/5) Simplify ((i/(i(-1/3)/i))(-3/23))18/((ii*(-1)i)(-8/7))21 assuming i is positive. i*(426/23) Simplify ((z/(zz*(-3)z))/(z*(-6/7)z))(-8/11)/(z9/zzzz/z8)(-21) assuming z is positive. z(4747/77) Simplify (((s/(s(-6)s))/s4)/((s5/s)/(s/(s(s/s(4/5))/sss))))/((s(2/7))(-5/6)/(s(-7)/(s(-2)/s))) assuming s is positive. s(-731/105) Simplify ((ww/w0)(-26))*43w/w*(-2)www(ww*(-4))/www/(w/(w/(ww*4)))w(-4) assuming w is positive. w(-2241) Simplify (((kk1)(7/10)(k/(k/k*(2/9)))/(kk/(k/((k/k1)/k))))(26/7))33 assuming k is positive. k(20878/105) Simplify r*(3/5)r*0(r2)(-12/7)(rr/(((r/(r*(2/5)/r))/r)/r)rr(-1)r)/(r*3rr(-1/3)) assuming r is positive. r(-65/21) Simplify (((ff/f(1/4))/f)/f0)/(f(-2/9)/(f/f1))(((f/(f/(ff(f(-3/2)/f)/ff)))/f)/(ff/f(1/3)))(-3/29) assuming f is positive. f(1357/1044) Simplify ((rr*0)/(rr/r*(-2/11)r))26/((r1)*40/((rr(-1/2))/r(2/9))) assuming r is positive. r(-19097/198) Simplify ((h/h(-3/8)hh(-1/6))/(h1/h)*13)/((hh*7h)/(h/(h/(h/h*6)))h*8hhh(-4/9)) assuming h is positive. h(-1537/72) Simplify (c*1c)*(-7)/(cc/(cc(-1/4))c)*(2/49)(((c/((c/c*(-1))/c))/cc)/c)*(2/23)(c*(-1)c)(-7/9) assuming c is positive. c(-31959/2254) Simplify (x*10x(-4/7))3/(x(-1/2)/x7x2xx(-4/5)) assuming x is positive. x(2351/70) Simplify ((q(-4/5)q0)/(q0)*(-8/5))/((q(qqq/(qq(-1/2)q)q)/qq)(-4/7))(-2) assuming q is positive. q(-24/5) Simplify ((z/z(-5/7))/(z/z*(-14))(zz(-25))/(z20/z))35 assuming z is positive. z(-1970) Simplify ((hh*3)/(h/(hh*(-2)/hhhh))h(1/5)/hh*13hhhh)(-8) assuming h is positive. h(-808/5) Simplify ((cc(-2))/c(-2/5))*(3/14)(c(1/5)/(c/((c/c(-3)c)/c)))/(c(-1/7)/c(-1/7)) assuming c is positive. c(43/14) Simplify ((((mm/(mm7))/(m/m(-1)))(1/30))(-2/13))(1/9) assuming m is positive. m(8/1755) Simplify ((o/o(-4)o)/oo(-1))(-3/5)(o(-2/5))(-2/21)(o/o(-5))/(o(((oo(-2/9))/o)/o)/oo) assuming o is positive. o(1216/315) Simplify ((p/(p/p(-3)))/ppp/p(1/3))/(p4/(p*(2/25)/p))(p(-1))(-11/7)(((p/(ppp(-2/5))p)/p)/p)(-21) assuming p is positive. p(14657/525) Simplify (b*(-3)bb2((b/b*1bb)/b)(10/13))/((b(-2))(-21)b*0b(-7)) assuming b is positive. b(-445/13) Simplify y(-2/9)/y(-5/2)(yy/(y/(y/y(-5))))/y(2/9)(y/y(-3)(y/y(-3/8))/y)/((y(1/2)y)/y)36 assuming y is positive. y(-329/72) Simplify ((p/(p/(p/(pp*(-2/115))))pp)/p(2/27))/((p((p/p*(1/8)p)/p)/p)/ppp(12/5)) assuming p is positive. p(-33079/24840) Simplify (((((s*0/s)/s)/(s((s(-10)/s)/s)/s))(-20))(1/3))(-21) assuming s is positive. s1400 Simplify ((c(-5)c0)/(c/c0c)(1/5))/(c6c/c(2/11)c/(((c/((cc(-3/7))/c))/c)/c)c(3/4)/c) assuming c is positive. c(-20851/1540) Simplify (((k/(kk(-5/4)))/k)/(k/k4)k*(1/2)/kkk(-4))/(k/(((k/k3)/k)/k)kk(-4/5)(k(-1))(-30)) assuming k is positive. k*(-709/20) Simplify ((w/(ww*(-6))w/(w/(w(ww/((w*4/w)/w))/w))(w*(-1)w)(-40))(4/21))(-22) assuming w is positive. w(-176/7) Simplify ((qqq/((q*(-1/2)q)/q))*(-35)(qq(-20/7)q)(-5/8))24 assuming q is positive. q*(-20490/7) Simplify (rr*(-4)/rrr(7/5))/((r/r(-8))/(r2/r))((r7/r)/r(-1/11))/(r*2/rr/(r*(4/3)r)) assuming r is positive. r*(-524/165) Simplify (bbb(b*(1/3)b)/b)*(-8/7)((b/(b(-1)/b))/b)/(b(-4/7)b)(bb1)(-6)/(b/((b(-1)b)/b))12 assuming b is positive. b(-803/21) Simplify (((c/((c/c(-1/4))/c))29c4/c(4/5))(-46))(-11/4) assuming c is positive. c(126247/40) Simplify ((u(15/2)/u)(2/17)/(u(-7))27)49 assuming u is positive. u(158074/17) Simplify (((g(gg/((g/g(-2/3))/g))/gg)/g)*(-38)(g/(g/(g*(-2/11)/g))g)/(g/(gg/((g/(gg/(gg(2/11))))/g)g)gg))(-20) assuming g is positive. g(33020/33) Simplify ((y*(-4/7)/(yy(-5)))/(y(-1/3))(-45))/(y12y(6/7))35 assuming y is positive. y(-3231/7) Simplify (((m(14/3)m)/mm)/(m(28/3)/m))/((m(1/3)/m)/m(-6)) assuming m is positive. m(-8) Simplify (f7ff2f)*(-26)/(((fff/(ff/f*(-1/2)))/ff)*(-13)(f5/f)/(f/(f/(f/(f/(f(-5/6)f))))f)) assuming f is positive. f(-847/3) Simplify ((((t/t(3/7))/tt)/t(-1/4)(t(2/3))1)(-3/8))(-46) assuming t is positive. t*(2875/112) Simplify ((mm(m2/m)/m)(-8/7)m*(7/8)m*(-1/3)m)(-21) assuming m is positive. m(125/8) Simplify ((c1)11)25/(c(-1/6)/c(-2/17))(22/9) assuming c is positive. c(126280/459) Simplify ((h/h(-2/83))/hhh/(h/(hh(-2/11)))h/(hh/(hh*(-27))h)h(-42)/h)10 assuming h is positive. h(-631410/913) Simplify (((s/(s(4/3)sss))/(s/((ss/s(1/4)s)/s)))/(s(-1))(-10/13))(7/10) assuming s is positive. s(-3661/1560) Simplify (k(2/3)/k)(-1/56)(k1kk)*(-3/20)	{ "pile_set_name": "DM Mathematics" }
ive. q*(-87/40) Simplify (((oo*(5/6))/ooo)/o(-2/23)(o(5/4))(-19))(4/3) assuming o is positive. o(-5749/207) Simplify (q/(qq0/q))(3/19)q*(-2/7)q*(1/3)(q*(1/9)q(q/(q(-2/3)/q)q)/q)/(q*4q/(q/q2)) assuming q is positive. q(-2414/1197) Simplify ((nn(1/29)n)/(n/(n/(n(n/n(-1/25))/n))))/(nn*(-37/2)n(-3/7)) assuming n is positive. n(192069/10150) Simplify (((i*(-2/5)/i)/ii)/i*(-3))/((ii/(i/((i(ii/i*(1/4)i)/ii)/i)))/(i/i3))(i/i(-1))4i/i3ii(-1/3) assuming i is positive. i(151/60) Simplify (((ff2)(-46)f/(f/((ff/f*(1/9))/f))((f/f(-2/15))/f)/f)(2/41))(2/3) assuming f is positive. f(-24836/5535) Simplify (((p/(p6/p))/(p(2/15)pp))/((p*0p)/p(-7)))/(p(-4)(p(2/17)/p)/p(p*1p)(4/5)) assuming p is positive. p(-2512/255) Simplify ((g/(g*(-2/19)g))(1/8)/((g(5/2)/g)/(gg/((((g(-2/37)g)/g)/g)/g))))(-12) assuming g is positive. g(-21657/703) Simplify (((((o*(-2/27)/o)/o)/oo)/(o/(o/(oo/(o(-1/30)o)o))))(-1))(-14) assuming o is positive. o(-7763/135) Simplify (s(-5)ss(-1))(1/6)((s(1/3))(-2/9))(-5/16) assuming s is positive. s(-175/216) Simplify ((((x1)(-43))(4/17))16)27 assuming x is positive. x(-74304/17) Simplify (dd/(d/(d/(d/d(2/3)))))(2/65)(dd/d1)(11/2)((ddd/(ddd/d*(4/5)d))/(dd(d*(-2/9)dd)/d))/(d(1/4))(-8) assuming d is positive. d(5351/1170) Simplify (((((v/(v/v(-7)))/vv)/v)/(v/(v/(vv/v8v))))/(v/(vv(-14)))(-11/2))28 assuming v is positive. v2072 Simplify (h15)(-20)/(h7/h(-24)) assuming h is positive. h(-331) Simplify ((g(gg/g(2/17))/g)/g(-7))/(g(5/3)gg2)gg(-2)g*(-1/2)(g*(-2/7)g)(3/5) assuming g is positive. g(2245/714) Simplify ((((d/d*(-4/9))/d)/(dd/(dd(-1/6))))/(d1)28)/((d(-2/7))(-22)(d(-2/3))(-3/13)) assuming d is positive. d*(-57595/1638) Simplify (cc(-1/15))/c(-1/17)cc/c*(2/11)cc/(c3/c)((c/c*(3/5))/(ccc/(c0c)))/((c/c(-2/27))/c0) assuming c is positive. c*(688/5049) Simplify ((y/(yy*(-1/6)/yy)y(-2)((y/(yy/(yyyy*(-5/2)y)y)y)/y)/y3)(-15/4))(-2) assuming y is positive. y(-40) Simplify ((r(r(1/2)/r)/rr)*(1/18)/(rrr(-1)r6))/((r(-1/4)r)(38/5)(rr/(rr*2)r)/(r/r*(-7)r)) assuming r is positive. r(-661/180) Simplify ((r/(r2/r))*14/((rr/(rr(1/9)r)r)/r)(1/3))(-11) assuming r is positive. r(-11/27) Simplify (j(-2/7))(2/21)j/(j/(j*(2/5)/jj))j/j(-4/7)jjj/(jj/(j/(j(-2/3)/j)))jj/(j/j(1/2)j)jj*6/(jj*(-1/3)j) assuming j is positive. j(16823/1470) Simplify ((c(2/7)/cc)/cc*(-9)c)*15((c*(-2/9)c)/ccc)*(-1/10)c*4/(cc*(-5)c) assuming c is positive. c*(-39026/315) Simplify ((s(s/s49)/s)(-6)(((s/s(4/7))/s)/s)17)46 assuming s is positive. s(84134/7) Simplify (((w13/w)/w)(4/5)/(w11/w)(-50))(-9/5) assuming w is positive. w(-22896/25) Simplify (((x/((x(-2/3)xx)/x))(-12)/(xx*(-2/23)x/x(-8)))(-34))(-1/9) assuming x is positive. x(-14008/207) Simplify qq(1/8)q*(1/29)q*27qq(-4/23)/q assuming q is positive. q(149331/5336) Simplify (((i(1/3)/i)/((ii*(2/17)i)/i))/((i/i(1/7))/(i/i(2/7)i)))/((i/(ii*(-2/13))i(-7))/(i7/(i/(i/i*1ii)))) assuming i is positive. i(64598/4641) Simplify (((w/w(4/3))/(w/(w/(ww(-9/7)))))/(w(-1/8))(22/9))(2/35) assuming w is positive. w(13/882) Simplify ((p/(p38/p)p)/pppp/(p/(p/p(5/14))))/(p(-2/145)/(pp(-1/19))) assuming p is positive. p(-1249513/38570) Simplify (w10www*(1/11)/www(-5)www(2/5))(18/7) assuming w is positive. w(9396/385) Simplify (v3/((v/(v3/v))/v))(-5)(((vv/(v*(3/5)v)v)/v)/vv(vvvvv(-6)vv)/v)/(v(-6/7)v/((v/v*(-3/5))/v)v) assuming v is positive. v(-183/7) Simplify ((((g(3/17)gg)/ggg)/((g/(g/(gg6/gggg)))/g)(g/g(1/3))/((g/g(-14))/g))(9/2))(-10/17) assuming g is positive. g(13890/289) Simplify (d((dd5)/d)/dd)*(-34)(d/(d/((dd(-19/6))/d)))(-1/15) assuming d is positive. d(-18341/90) Simplify (p/(ppp3p)p(2/11))/(p/(pp/(pp0p)p))(4/13)((pp(1/8)pppp)/p(-1))/(p2p/(p/(p/p*(-3)p))) assuming p is positive. p*(-501/88) Simplify (((m/(m/((mm*(2/5))/m)))/(mm*14)m*(-4)m/m(6/7))(-26))(1/45) assuming m is positive. m(16796/1575) Simplify (r0)31(r/r(5/2))/r(1/6)(r/(rr1))(1/52)/((r4/r)/r((rrr(-2))/r)/r) assuming r is positive. r(-263/156) Simplify ((l(1/7)/l)/l2l(-1)l*(1/5)/ll)/((l/l1)(-8/13)(l/l(-5/3)l)/(l(1/4)/l)) assuming l is positive. l(-3391/420) Simplify ((((d*15/d)/d)/(d/(d(dd13)/d)))(6/7))(-42) assuming d is positive. d(-936) Simplify (uu*(1/8)uu38)/(uu/(uu7u)u32) assuming u is positive. u(121/8) Simplify p3/(p(-2/3)/pp)p(1/2)/p(2/9)(pp(2/3)/pppp)*(6/17)p(1/4)/p(1/5) assuming p is positive. p(16183/3060) Simplify ((h(2/5)/(h((h/h(-6))/hh)/h)(h/(hh*(-3))h)(-1/3))(-9/2))(-2/21) assuming h is positive. h(-17/5) Simplify (j*4jj5j*(1/4)j/j(1/5))/((j(-5)/(j/((j*(4/3)j)/j)))/(j(-1)/j6)) assuming j is positive. j(523/60) Simplify ((o(-2/53)/(oo(-2/11)o))/(((o6/o)/o)/o(-4/5)))(2/43) assuming o is positive. o(-38804/125345) Simplify (((l5)(-6)/(l(2/15)/l)(-15/4))43)(-31) assuming l is positive. l(177289/4) Simplify (((f(5/4)/f)/f)*(-3)f*4fff/f(2/15))(-25) assuming f is positive. f(-2735/12) Simplify ((q/q(-1))*(-1/57)/(qq/(qq(-4/7))q(2/11)))/((q(1/2))50/(q1)(-47)) assuming q is positive. q(-323857/4389) Simplify ((www/((w/w*(1/2))/w))/wwww)(1/66)/((w(-1/9)/w)/w*(-3/4))(w(-1))(-18)/((w*(-1/9)www)/(w/(www(2/7)))) assuming w is positive. w(899/63) Simplify (l(-6)/l)/(l/(l/l(-1/12)))(l(2/5))3((l/l3)(-3/13))29 assuming l is positive. l(5981/780) Simplify ((o*(4/7)/oo)*(4/19)(oo(10/3))(-2/43))(3/29) assuming o is positive. o(-1394/165851) Simplify (((h(4/9)/h)/h(3/13))/(h(3/5)hh(-13)))(4/15) assuming h is positive. h(24836/8775) Simplify (((p(2/17)pp)/p)(14/11)/((p(-8)/p)/(p(((pp(3/4))/p)/p)/pp)))29 assuming p is positive. p(242353/748) Simplify (((a/a(-2/15))/a(-4))/((aa4)/(a/a(-1)a)))/((a(a/((a(-1/2)a)/a))/a)*(-25)a/(aa4)aaa/(((aa1)/a)/a)) assuming a is positive. a(1249/30) Simplify (((k(2/43)/k)/(k/k(-6/11)))(5/7))(-1/76) assuming k is positive. k(2955/125818) Simplify (j/(j42/j))/(j/j(-35))jjjj/((j/j(-12/13))/j)j(10/11) assuming j is positive. j(-10298/143) Simplify (i*(1/13)i(2/11))/(i/i2i/(i/(iii7i)))(i9ii(1/7))(1/5) assuming i is positive. i(-33597/5005) Simplify (l1/((ll*(-1)/l)/l)(l/l(-3))(4/11))17 assuming l is positive. l(833/11) Simplify ((o4)(-2/19))*(-38/5)(o/(oo5)o*(-1/3))/((oo*(1/3))/oo)(3/23) assuming o is positive. o(-796/345) Simplify j*(1/8)jj(-2/3)j*(-4/3)jj1j(j6(j(-3)/j)/j)27 assuming j is positive. j*(233/8) Simplify ((mm/((m*(2/85)/m)/m)mm)/m29m22/m(2/19))(-2/29) assuming m is positive. m(3646/46835) Simplify ((u/(u*(-2)u))*(5/3)u*(11/3)uu3)(-10/9) assuming u is positive. u(-110/9) Simplify (a(-1/3)a/(((a/(a/a(-1/4)))/a)/a))(-35)a/(a(-1/3)a)a(-6)aa(-1/2)a(2/13) assuming a is positive. a(-5569/52) Simplify (((s*(1/8)(s/(ss(-1/5)))/s)(-9/10))(-28))14 assuming s is positive. s(-11907/50) Simplify ((((o0/o)/((o/(o/(o(-1)o)))/o))/(oo(3/10)o5/o))(1/7))(-34) assuming o is positive. o(901/35) Simplify (((y(1/2)/y)/(y/(y/(y(-3/10)y))))/(y8((y/(yy(y(-6)/y)/y))/y)/y))/(y(2/7)y(-2/3)/y)2 assuming y is positive. y(-1201/105) Simplify ((n(n/(n(n/n(-1/6))/n))/n)/(n/n(-3/2)))32/((nn/n(2/3))41/(((nn(-1/9)/nnn)/n)/(n/n4))) assuming n is positive. n(-1225/9) Simplify ((sss/s(2/15))/(s(-2/15)/s))/((ss*(-3/4))/ss/s*(-7))((s/s*(2/37))/(ss(-11/2)))43 assuming s is positive. s*(34177/148) Simplify ((ff*(2/29)f**(3/	{ "pile_set_name": "DM Mathematics" }
least common multiple of (42/(-10) - -1)(-250)/m and 45? 360 What is the least common multiple of (-189225)/(-375) + (-3)/5 and 4? 504 Let x = -73648575/466 - -158044. What is the common denominator of x and -65/14? 3262 Calculate the least common multiple of 6 and -752(-3)/6. 150 Let t(a) = -11a - 30. Let y be t(-13). Let d = y + -83. Calculate the least common multiple of d and 30. 30 Suppose -3b + 3 = 4y - 9, -3y + 12 = 3b. Let h = b + 6. What is the smallest common multiple of h and 7? 70 Find the common denominator of 161/66 and -6 - 88/(-16) - 141/(-144). 528 Let k = -1496524979/408 - -3667956. Let l = k - 41/17. Calculate the common denominator of -83/12 and l. 24 Let w be 1-280/(-32). Suppose 0 = -3g - 2g - 15, 0 = -ws + 4g - 33. Let b = s + 27. What is the lowest common multiple of b and 6? 18 Calculate the lowest common multiple of 12 and (-126)/(3 - 4) - (14 - 16). 384 Calculate the common denominator of 38537/15308 - (0 - -12) and -55/2. 172 Let r(g) = -g2 - 16g - 40. Let p be r(-13). Find the common denominator of 81/28 and ((-325)/(-24))/(-13) + (2 - p). 168 What is the common denominator of -23/24 and (2/6)/(372/(-1054))? 72 Calculate the common denominator of 137/90 and (-22)/((1 - 1632/(-42)) + 3). 450 Let r(d) = 3d - 15. Let q be r(6). Let o = 13 - q. Suppose -n = 1, 3b - b - 18 = -2n. Calculate the smallest common multiple of o and b. 10 Let a(g) = -5g*3 - 9g*2 - 30g - 14. Calculate the smallest common multiple of a(-5) and 4. 536 Suppose 5a = 3a - 7a. Suppose 8i - 160 = -ai. Calculate the lowest common multiple of i and 22. 220 Let n(s) = s3 - s. Let g be n(0). Suppose g + 72 = 12x. Calculate the least common multiple of x and 16. 48 Let w(g) = g*2 - 3g - 4. Let z be w(-3). Suppose 0a - 660 = -4a. Calculate the common denominator of a/z21/18 and 39/10. 20 Let i be 222/123. Suppose -1 = n - i. Calculate the smallest common multiple of n and ((-18)/(-8))/(6/24). 90 Let s(a) = -4a - 34. What is the smallest common multiple of 214 and s(-9)? 214 Suppose 40 = 2k - 5d, 7k + 3d - 38 = 2k. Suppose 0 = kp + 2p - 960. What is the lowest common multiple of p and 12? 240 Let y = 1492301/676940 + 1/15385. Calculate the common denominator of -7/52 and y. 572 Suppose -10r + 502 = 5i - 1253, -3r = i - 354. Calculate the lowest common multiple of 46 and i. 690 Let g = 46779 - 4397147/94. Calculate the common denominator of 27/14 and g. 658 What is the common denominator of (15 - 480/36)/(84/(-22)) and -71/90? 630 Let x = 161567/12 + -13452. Calculate the common denominator of x and -53/28. 84 Calculate the common denominator of (-16)/(-88) + 1677/(-1056) and 71/30. 480 Find the common denominator of 65/3 and -6(-7)/154(-34)/20. 330 Suppose 4o + 4y = 20, 0y - 52 = -5o + 4y. Calculate the least common multiple of 120 and o. 120 Let s = -9451/126 + 520/7. Find the common denominator of 107/6 and s. 18 Suppose 4i = 5m + 204, -4m - 60 - 94 = -3i. Suppose -3z + 5r + 34 = 0, 4z - 2r - i = z. Let p = -9 + z. What is the smallest common multiple of 3 and p? 9 Find the common denominator of (46/12)/(4(-392)/(-96)) and 13/112. 784 Let o(t) = t*3 + 13t*2 - 7t + 18. Let a be o(-13). Suppose -4s - 21 = -a. Calculate the smallest common multiple of s and 6. 66 Let r = -887/132 - -333/22. Find the common denominator of -3/32 and r. 96 Suppose -13 = -5v - 3. Let d be (v/6)/(2/30). Suppose 2p - 44 = 2u, 0u + du - 52 = -4p. What is the least common multiple of 22 and p? 198 Suppose 363w - 367w + 48 = 0. Calculate the least common multiple of 32 and w. 96 Let i be (8/12)/((-1)/(-12)). What is the common denominator of -43/26 and (-66)/i(-14)/(-18)? 156 Suppose 6a - 27 = 3a - 3w, 3a - 23 = -2w. Suppose -107 = -3m - x + 2, -ax = -2m + 50. What is the common denominator of 13/17 and m? 17 Find the common denominator of -17/104 and (7/(-70))/(-1 - 598/(-590)). 104 Let i = -3 - 3. Let u = -64 - -190/3. What is the common denominator of u and (-99)/308119/i? 24 Let n = -391083/52 + 7522. Let y = 3305/468 - n. What is the common denominator of -43/32 and y? 288 Suppose -2c - 5t + 122 = -52, 3t - 178 = -2c. What is the least common multiple of 36 and c? 828 Suppose 3u = 2u + 7. Let t(c) = -c - 7. Let a be t(-10). Suppose -ap - 10 = -43. Calculate the smallest common multiple of u and p. 77 Let k = 339 - 335. Suppose -4w - 5h + 71 = 0, 2w - 3w + h = -11. Let g = w + -5. What is the lowest common multiple of k and g? 36 Suppose 0 = 25s + 39s - 14336. What is the least common multiple of s and 196? 1568 Suppose f + 7762 = -4d - 15806, -2f = 8. Let x = d - -35243/6. Let q = 1127/18 + -244/9. Find the common denominator of x and q. 6 Let j(d) = -41d3 + 2d*2 - d. Let k be j(2). Calculate the common denominator of ((-1)/(-28))/((-6)/(-108)) and 4 - (-4 + k/(-20)). 70 Let z = -66/17 + 985/153. Let r = 9163/4710 - -10/471. Find the common denominator of z and r. 90 Let s = -3 - -5. Suppose -sq + 52 = -54. Suppose -q = -5g + 5j - 8, 0 = -2g - 3j + 18. Calculate the smallest common multiple of g and 12. 36 Let d be 120/(-50)(-54339)/16. Let j = -8154 + d. Calculate the common denominator of -27/10 and j. 20 Suppose 0c = -4c - 5w + 21, c = 3w - 16. Calculate the common denominator of (-182)/8055/(-22) and (-28)/1610 + c. 16 Let x = -89 + 83. Calculate the common denominator of 19/38 + (-142)/x and 2 + (-2)/(-20) - 1. 30 Let j = -2/649 - 4327/70092. Calculate the common denominator of -119/108 and j. 108 Let h(i) = -i3 - i2 + 4i - 3. Let v be h(-4). Let z = 173/6 - v. Find the common denominator of z and 315/(-72) + -9 + (0 - -1). 24 Suppose -46 - 4 = -5p. Let x(t) = t2 - 9t - 5. Let q = 1 + 0. What is the least common multiple of q and x(p)? 5 Suppose 3k = -i + 23, -3k + 2 = -13. Suppose -p + 12 = i. What is the common denominator of -3 + 3 + 26/p and -29/4? 4 Suppose 29g + 131 = 7990. What is the least common multiple of g and 4? 1084 Let h(o) = 3o*2 - 4o - 22. What is the lowest common multiple of h(-4) and 48? 336 Suppose -3k + 0k - g = -45, 0 = -4g. Let v(l) = l3 - 6l*2 + 8l - 6. What is the smallest common multiple of v(5) and k? 45 Let y be 348/(-42) - (-2)/7. Let a(h) = h*2 + 8h + 4. Let d be a(y). Suppose -8u = -du - 80. Calculate the smallest common multiple of u and 12. 60 Let o = -86739 - -11536482/133. Let u = o - 15080/4389. Calculate the common denominator of 43/33 and u. 33 Let v = -52 + 45. Find the common denominator of 47/30 and (((-156)/v)/3)/((-351)/91). 270 Let k be (483468/96)/(2 - 3602/(-4)). Let c = k - 47/361. Find the common denominator of c and (2/(-3))/(64/262). 240 What is the common denominator of (-15)/120146/(-5) and 32/3? 60 Let f = -14/219 + -3521/876. Calculate the common denominator of f and -57/44. 132 Let v be (-13 - -14) + -11. Suppose -4o + 3j + 35 = -4, v = 4o + 3j - 57. Calculate the least common multiple of 4 and o. 12 Let c = 266/5 - 2119/45. Calculate the common denominator of 12/40(66/(-9) - -7) and c. 90 Suppose -j - 29 - 35 = 0. Let o = -40 - j. What is the smallest common multiple of 14 and o? 168 Calculate the lowest common multiple of 15 and (50/(-15))/((-6)/99). 165 Let r be (-728)/(-6) - (-20)/30. Suppose -r = -5g - 2. Calculate the least common multiple of 20 and g - (4 + -2 + 0). 220 Let t be 2/(-4)(1 + -5). Suppose tv - 3v = -2. Let k = -293 + 298. Calculate the lowest common multiple of v and k. 10 Suppose -4w - 84 = 4u, 5w = 2u + 33 + 30. Calculate the common denominator of 375/u(-2)/(-5) and ((-4)/64)/(5/(-115)). 16 Suppose -2 = m - 3o - 6, -m + 5o = -6. Let j = 4 - m. Suppose jy - 5p = -11, 2y + 2 = 3p - 4. What is the smallest common multiple of y and 1? 3 Let f = 69 + -102. Let m = f + 44. Let k = 14 + -7. Calculate the smallest common multiple of k and m. 77 Let g(v) = v*3 - 4v*2 + 2v + 16. Calculate the smallest common multiple of g(0) and 16. 16 What is the common denominator of -1 + (-8146)/(-5472) - (-20)/(-90) and 37/12? 912 Suppose -5n + 44 = 2c - 15, c = 5n + 22. What is the lowest common multiple of c and 24? 216 Let u = 5525/16 - 345. Calculate the common denominator of u and -49. 16 Let v be (-15)/1(3 - 1). Calculate the comm	{ "pile_set_name": "DM Mathematics" }
pose 11 = -5w - 3j, 0 = 6w - 5w + j + 1. Let m = -3 - w. Let i(d) = -d*3 - 6d*2 - 3d + 14. Let b be i(-5). Which is smaller: m or b? m Let x = 1 - 1. Let q = 1.09 - 1. Let y = 0.01 + q. Is y < x? False Let m = 11 + -7. Let o = m - 6. Which is bigger: 0 or o? 0 Suppose h - 54 = 10h. Does 0 = h? False Let a = 0.1 - -0.1. Let k = 7 + -1. Suppose -kq = -2q + 4. Is a smaller than q? False Let q = -5 - 16. Which is smaller: -0.2 or q? q Let z be (16/40)/(1/(-5)) - -1. Is z greater than 3/37? False Let k(b) = -b3 + 4b*2 - 5b + 2. Let f be k(3). Let g be 3(4/(-6) + 2). Suppose -2z = 4 + g. Are f and z nonequal? False Let a = -45 + 133/3. Let i = -0.02 + 0.02. Which is smaller: a or i? a Let x = 7 - 12. Suppose 14 + 14 = -4y. Which is bigger: x or y? x Let h = 1 + 3. Suppose -h = 3w + 5. Is -1 at least as big as w? True Let r = -688/835 - -4/167. Let n(i) = 2i - 1. Let b be n(3). Suppose 4l = bz + 20, -4z - 4 = l - 9. Which is bigger: r or z? z Suppose -3d = 2 + 1. Let a = 9 + -6. Suppose -f - a = -0f. Which is bigger: d or f? d Let b = -2 + 2. Let m be 0 - ((-148)/(-3) + -3). Let r = m + 46. Which is smaller: r or b? r Let m = 8 + -8. Which is smaller: m or 4/9? m Let j be (-2)/9 - 14/18. Suppose g = -4g + 5s + 5, 5s - 35 = -5g. Suppose -2k + 2 = go, -7 = -3o - 4. Is j not equal to k? False Let u = 0.016 - 2.116. Let v = 1 + 1. Let b = v + u. Is 0.5 greater than b? True Let d = 99 - 43. Let o = d - 278/5. Which is smaller: 1 or o? o Let z = 16 - 81/5. Is 0 smaller than z? False Let p be (40/(-6))/(8/660). Let k be (-8)/(-44) - (-34)/p. Is k != 0? True Suppose 0m = -3m + 6. Let x be 63/(-4)(-8)/(-3). Let r be 38/x + m/2. Which is greater: 1 or r? 1 Suppose 45 = -6l + l. Let d be (-6)/l - (-32)/(-30). Let z be -2 + (-2)/(-12). Is d less than z? False Suppose 3 = 2j - 1, 6 = -2u + 4j. Let d be 1 + 1 + 16/(-10). Which is greater: d or u? u Let d = -30 + 26. Let f be ((-2)/4)/((-2)/4). Let z be f + d/3 + 1. Which is smaller: 0 or z? 0 Let u = 1 - -5. Suppose w = 3w + u. Which is greater: w or -3/2? -3/2 Let a = -3 - -2. Let f = a + 1. Which is smaller: -1 or f? -1 Let l = -7 + -5. Let d = l - -18. Let v = d - 2. Is v greater than or equal to 1? True Let a = 6 + -6. Let c = a - 6. Let v be (c/(-20))/(8/(-10)). Is v not equal to 1? True Let y be ((-1)/8)/((-9)/(-34)). Let u = 43 - 385/9. Let l = u + y. Which is smaller: 1 or l? l Let j(w) be the third derivative of w*4/12 - 11w*3/6 + 2w*2. Let x be j(6). Are 3/10 and x equal? False Suppose 4c - 2c = 0. Suppose 5r - r = 3o - 164, r + 2o + 30 = c. Let n = 153/4 + r. Is n smaller than 1? True Let t be 238/6 - (-1 + -1). Let u = t - 41. Let x = -2.6 + 2.5. Which is bigger: x or u? u Suppose j + 28 = 3j - 5n, 5j = n + 24. Suppose -2y + jy + 14 = 0. Let f be y/(-15) - 1/(-5). Which is bigger: f or -4? f Let q = -95 - -72. Is q at most as big as -24? False Suppose b - 2b = -4y - 14, 3y + 3 = -3b. Suppose 0 = x - 4 - b. Let d be 1/3 - 14/(-3). Is x at least as big as d? True Let y be 6/(-45) + (-31)/105. Is -1 < y? True Let w = -9 - -4. Let u = 1.61 + -0.67. Let o = u - -0.06. Which is smaller: w or o? w Let j = 5 + -1. Suppose -jo - 9 = -5. Which is bigger: -2 or o? o Suppose s + 25 = 6s. Let m(b) = -b2 + 6b - 4. Let q be m(s). Let h be (2/(-20) + 0)-2. Which is smaller: h or q? h Let u = -1 - -1.1. Let x = 0 - u. Let r = 4.9 - 5. Is r smaller than x? False Let z be 10/854/(-8). Is 0 > z? True Let g(n) = -n*2 - 9n - 9. Let x be g(-7). Suppose 0 = -3t + 12, xb = 2t - 14 + 1. Is 2 > b? True Let w be (1/6)/((-100)/(-225)). Which is greater: -1 or w? w Let y(a) = 4a*2 - 4a + 4. Let j(q) = q*2 - q. Let n(c) = -5j(c) + y(c). Let z be n(0). Suppose zh + 9 = -3. Is h greater than or equal to -5? True Suppose -3h = -h + 18. Let b = h + 11. Which is greater: b or 3? 3 Let o = 530 - 4756/9. Is o greater than or equal to 3? False Let h(f) be the third derivative of -f*4/8 + 3f*3/2 - 3f*2. Let q be h(4). Are -2 and q nonequal? True Let m be ((-24)/(-9))/(-2)3/2. Is -9 >= m? False Let m = 1.8 + -1.73. Let v = 0.07 - m. Which is greater: v or -3? v Let t(v) = v*2 - 9v - 3. Let w be t(8). Let a be (8 + w)2/(-3). Which is smaller: a or 5/6? 5/6 Let l = 127 + -259/2. Let t = 5 - 3. Suppose -td + 5 = 13. Is d < l? True Let j = 10 - 28/3. Which is smaller: -0.04 or j? -0.04 Let g(y) = -y*3 - 4y*2 + y. Let p be g(-5). Suppose -3j + 12 = -2b - 2b, -5j + p = -3b. Suppose bd = -2d. Which is greater: -1/6 or d? d Let s = -11.08 + 11. Let g = -0.92 + s. Which is smaller: -0.1 or g? g Let i = 63/2 + -30. Let n = 23 - 21. Which is smaller: n or i? i Let s = -2.52 + 2.4. Let d = 0.42 + s. Is d smaller than -4/5? False Let x(d) = -3 + 2 + 0d - 2d*2 - d - 2d. Let l be x(-2). Let j = 0 - 2. Do l and j have the same value? False Let v = -0.18 - -0.08. Let p be 219/(-135) - (-2)/9. Is p less than v? True Let a = -3 - -4. Let z(p) = -p*2 + 2p - 1. Let c be z(a). Suppose -n + 1 = -c. Is 2 less than n? False Let k = -0.16 + 2.16. Let b = 2 - 2. Which is smaller: b or k? b Suppose -z - 4 = -4n + 5, -n = -3z + 6. Suppose nf - 2f = -2. Which is smaller: 1 or f? f Let c(h) = 3h2 - h + 1. Let g = -5 + 6. Let z be c(g). Which is bigger: 3/2 or z? z Suppose -2w - 10 = 3p, 5w + 5p = 4p + 1. Is -2/73 <= w? True Let n(m) = m + 9. Let c be n(-7). Suppose 0 = cy + 3i + 21, -4y - 4i = -0y + 52. Let p be (-1)/3y/(-21). Is 1 equal to p? False Let n = 0.95 + -1.1. Let s = -0.25 - n. Is -10 != s? True Let z(a) = a - 2. Let b be z(6). Suppose -2r - 2r - b = 0. Let y be (-3 + 3)r/(-2). Is y at least 0? True Let z = 12 - 12. Suppose z = 8x - 12x - 12. Let r be (-4)/2 - (1 - -1). Which is greater: r or x? x Let w = -366/13 + 28. Suppose 5u - j = 135, 2j + 3 - 123 = -5u. Suppose -13 = -2y - 3a, -5a = -y - 0y - u. Which is bigger: w or y? w Let z(m) = -4m3 + 0m*2 - 2 - 6m*2 + 3m*3. Let f be z(-6). Let v be (-2)/(2f)-2. Which is greater: -3 or v? v Let c = 128 + -126.22. Let w = c - -0.22. Which is smaller: w or -2/9? -2/9 Let o(n) = n3 + 3n*2 + 10n + 5. Let s be o(-2). Let x(z) = z3 + z2 - 2z + 1. Let d be x(-3). Is d at most s? True Let x = 0 - -1/4. Let r = 135/7 + -19. Is x equal to r? False Let g be 10/4 - 1/2. Let s be 4/(-6)15/g. Which is smaller: s or -4? s Let w(t) = t2 - 9. Let x be w(0). Let l = 8 + x. Is l at most 0.1? True Let y(t) = t3 - 8. Let g be y(0). Let j be ((-7)/g + -1)2. Is 2/5 >= j? True Let n be (-2)/6 + 30/9. Let k = -5 + n. Suppose -f + o = 3, 2o = 4o - 2. Is k not equal to f? False Suppose 0 = l - 6l + 30. Let p be (20/l)/((-11)/33). Is -10 != p? False Let u = 1.94 + 0.06. Let c(z) = 8z + 11. Let n(f) = 3f + 4. Let d(h) = 4c(h) - 11n(h). Let t be d(2). Which is greater: u or t? u Let x(a) = 5a3 + 5a2 - a + 2. Let v(j) = -j3 + j - 1. Let m(i) = -4v(i) - x(i). Let z be m(-4). Is -3 at least z? False Let f be 1/4 - 1/4. Are f and 4 equal? False Let g = -1 + 3. Let l = 3954 - 11720/3. Let b = l + -47. Is g < b? False Let y = 5 + -2. Let n = y + 6. Which is smaller: n or 1? 1 Let x = 143/7 - 4154/203. Which is smaller: 0 or x? x Suppose -3g = -0 + 6. Suppose 4m + 3d - 11 = 0, -3m + 0m - 3d + 9 = 0. Let n = g + m. Which is smaller: -1 or n? -1 Suppose 3w - 16 = 5l, 3w + 2l = 5w - 4. Let m be 1 - (-1 - -6)1. Is m less than or equal to w? True Let a(x) = -x2 + 2x + 2. Suppose -5y + 9 = -3y + c, 2y = 4c - 6. Let m be a(y). Is m < -1? False Let q(w) = 2w2 + 7w - 3. Let y be q(-5). Is y bigger than -1? True Let h = 1827/11 - 166. Which is bigger: 0 or h? h Suppose 19 = -5h + 3f + 85, 4 = -2f. Is h <= -1? False Let w be (-48)/(-9) + (-1)/3. Suppose -4 = -wb + 1. Is b bigger than -1/3? True Let u = 1.4 - 0.8. Let w = -0.4 - u. Let x = -0.7 - w. Which is smaller: 2/7 or x? 2/7 Let f = -0.5 - -0.3. Let r = 0.1 + f. Suppose 0p + 3 = -3p. Which is greater: p or r? r Let z be (4/(-18))/(14/11550). Let a = z + 179. Is -3 < a? False Let m = 11 - 11.2. Which is smaller: m or -0.1? m Let v = -21 - -13. Let j be (-42)/v + (-6)/(-8). Suppose -m - j = -3b, 0 = 3m - 2m + b - 2. Which is bigger: m or 2? 2 Let h(b) = b2 - 11b. Let t be h(11). Which is bigger:	{ "pile_set_name": "DM Mathematics" }
ch is the closest to -1.3? (a) 69 (b) 21 (c) -3 (d) -0.12 (e) -5 d Which is the closest to -2? (a) 3/4 (b) -0.114 (c) -1711 (d) 4 (e) 5 (f) 6 b What is the nearest to 26 in 0.4, 10, -4, -5997? 10 Which is the closest to 1.3? (a) -33 (b) -6509 (c) -1/4 c What is the closest to 0.07 in -2.47, -2, 4, -4? -2 What is the closest to 10 in -0.3, 117.1, -0.5? -0.3 What is the nearest to 305 in 1, -137, 0.13, -5, -0.3, -2? 1 What is the closest to 11 in 0.4, 2, -40687, 0.06? 2 Which is the nearest to 1/102? (a) 3 (b) 196 (c) -2/9 (d) -0.2 (e) -1.3 d Which is the closest to -3/11? (a) -1482 (b) -1/4 (c) 20 (d) 5 (e) 4 b What is the nearest to -1/2 in 1/2, 7, 6/7, -3/22, 230? -3/22 Which is the nearest to 1? (a) 3/4 (b) 1.550478 (c) 2/19 (d) -1/8 a Which is the closest to -37917427/4? (a) -1 (b) 3 (c) -0.1 (d) 0.4 a Which is the nearest to 0? (a) 2/105 (b) -24 (c) 19 (d) 5 (e) -1 (f) 2/7 a Which is the closest to 1? (a) 0.1 (b) 4 (c) -4 (d) 8 (e) -30/293 a Which is the closest to 72396? (a) -1/4 (b) -2/5 (c) 113 c What is the nearest to 334768 in -1, -0.4, 1/14? 1/14 Which is the closest to 4? (a) -136 (b) 2/19 (c) -0.02737 (d) -2 b Which is the nearest to -0.1? (a) 8 (b) 4 (c) -1214 (d) -1/4 (e) 19.9 d What is the nearest to -2 in 3070, 3/7, -0.5, 5, -5? -0.5 Which is the nearest to -7/8803? (a) -6 (b) 20 (c) -4 (d) -1/2 d What is the nearest to 200/9 in 84, -46, 0.5? 0.5 Which is the closest to -1? (a) 2579 (b) -17 (c) 4/31 c Which is the closest to 0.1? (a) -11/30126 (b) -3/4 (c) -5/4 (d) -714 (e) -0.2 (f) -1/4 a Which is the nearest to 0.0495? (a) -50 (b) -48/11 (c) -0.2 c What is the nearest to -152 in 7, -4, -45/19? -4 What is the nearest to -446 in 0.2, -2/3, -8, -0.4? -8 Which is the nearest to -1? (a) 2/5 (b) -1/2502772 (c) 26 b Which is the nearest to 2? (a) 0.3 (b) -10489 (c) 0.5 (d) 2/7 (e) -3/4 (f) -1 c Which is the closest to -2/3? (a) -11976 (b) 0 (c) 2/9 (d) -2 (e) -0.2 e Which is the nearest to 0.3797? (a) -4 (b) -0.5 (c) 0.1 (d) 388 (e) 5 c What is the nearest to 1 in -3.28, -3/5, 2/7, -4, 124? 2/7 Which is the closest to -1/4? (a) -0.02 (b) 10 (c) 4/31 (d) -40 (e) -4 a Which is the nearest to -2/9? (a) 2/17 (b) 0.3 (c) 4 (d) -0.3 (e) 1873304 d What is the nearest to 196 in 157, 1/3, 2? 157 What is the closest to -7/4 in 302, -1, 37, 4/9, 1/3? -1 Which is the nearest to 3/5? (a) -0.5 (b) -0.4238 (c) 19.89 b Which is the closest to 0? (a) 10 (b) -3 (c) 1/8 (d) -2/7 (e) -41 c Which is the closest to 0.04? (a) 0.6 (b) 2/7 (c) 1/2309 (d) -4 c What is the nearest to -2/5 in 83, -3/2, -0.3, 4, -201? -0.3 Which is the closest to -1? (a) -59/4 (b) -11/2 (c) 5 (d) -36 b Which is the closest to 25? (a) 4 (b) 2 (c) 0.2 (d) 7/2 (e) -2 (f) -27 a Which is the closest to 2/23? (a) 360 (b) 2 (c) -3/7 (d) -0.4 (e) 0.119 e Which is the nearest to 7? (a) 1 (b) -3/7 (c) 6/5 (d) 4 (e) 15 d Which is the nearest to -2/5? (a) -2/3 (b) 5 (c) 3/2 (d) 299697 a What is the nearest to 54 in -52, -32/3, -12, 3? 3 Which is the closest to 1? (a) 1/2 (b) 0.0418 (c) -20 (d) 0.3 (e) -4 a Which is the nearest to 0.01? (a) -2 (b) -3/2 (c) 2/23 (d) 4 (e) 2/33 (f) 5210 e What is the nearest to -2/9 in -0.2, 2773, -4, -25/3, 0.4? -0.2 What is the closest to -2 in -2/833, 2/3573, -0.3? -0.3 Which is the nearest to 1854? (a) 1189 (b) 3 (c) 5 a What is the nearest to -0.1 in -0.4, -1, -5, -19076, -2/61? -2/61 What is the nearest to 0 in 1/2456, 0.15, 0, 2? 0 Which is the nearest to 2/7? (a) 0.18 (b) 0.4 (c) -414 (d) 5/8 (e) -1 a Which is the nearest to -1/89? (a) -2/47 (b) 5 (c) -13.8 (d) 0.2 a What is the nearest to -1/4 in 1209, -0.5, 0.3, -2? -0.5 What is the nearest to 0.16 in 1504, -1/4, 0.2, 1? 0.2 Which is the closest to 0.5? (a) 10 (b) -7191 (c) 0.4 (d) -0.4 c Which is the nearest to -2? (a) 78/7 (b) 5 (c) 2/6039 c What is the closest to -0.1 in -1, 1/4, -5/11, 6/11, 5? 1/4 What is the nearest to 696.24 in 1/12, -2/15, -2, -1/5? 1/12 Which is the nearest to 2485? (a) 0.2 (b) 29 (c) 1 (d) -1 b Which is the closest to 7.4? (a) -12 (b) 2 (c) 0.4 (d) 8 (e) 0 (f) -0.04 d What is the closest to -226 in -1, 1, -24, -0.9, 0.1, -3? -24 Which is the nearest to -3/73? (a) -2/3 (b) 1/4 (c) 3/3902 c Which is the nearest to -2? (a) -4/11 (b) -154 (c) -4 (d) 19 a Which is the closest to -157? (a) -3/38 (b) -59 (c) 3/14 b Which is the closest to 5.1? (a) -23 (b) -3 (c) 799 b Which is the closest to -46? (a) 2 (b) -5 (c) -0.0163 (d) 0 (e) -3 b What is the nearest to -1 in -1, 23.3, 421, 1/11, 0? -1 What is the nearest to -2/17 in 3/739, 8, 114? 3/739 Which is the closest to 2/29? (a) -653.83 (b) -1/6 (c) -7/2 b What is the nearest to 1/2 in -5, -0.04, -44417, 0.5? 0.5 Which is the nearest to 2/5? (a) 0.4 (b) 2480/69 (c) 5 (d) -1/6 (e) 10/11 a What is the nearest to -0.1 in -0.175, 1/211, 1, 0.3, 2/7, -0.49? -0.175 Which is the closest to -15? (a) 4 (b) -560 (c) 17 (d) 0.4 (e) 3/2 d What is the nearest to 2/1167 in -239, -0.17, 0.4? -0.17 Which is the nearest to 1/32? (a) 0.1 (b) 2/15 (c) 10936 a Which is the closest to 1? (a) 103 (b) -3/2 (c) 143 (d) -1 (e) 0.5 e Which is the closest to -2? (a) -3/7 (b) -3 (c) -131 (d) 3 (e) -563 b What is the nearest to -4/3 in 4, -0.5, 0.3, 47513565? -0.5 What is the closest to -0.1 in -4, 1, -1.36, -0.134? -0.134 What is the closest to 2 in -3/4, 23, -5, -3, 0.36, -23/2? 0.36 What is the nearest to -0.1 in -0.2, -2.577692, -5? -0.2 Which is the nearest to 4? (a) 3/371 (b) 132/13 (c) -6 (d) 3 (e) 4 e What is the nearest to -6/23 in 1, -3, 632, 4/45, 0.2? 4/45 Which is the nearest to -0.1? (a) 0.4 (b) -5 (c) -363/218 (d) -2/5 (e) -0.3 e Which is the closest to -4? (a) 10 (b) 0.1 (c) -1/5 (d) 0.065 (e) 0.5 c Which is the nearest to 11.2? (a) -2 (b) 1.82 (c) 49 b Which is the closest to -2? (a) -5 (b) 0.2 (c) 38/735 (d) 0.3 (e) -3 e What is the nearest to 32 in -0.1005, -0.4, -4, 1.54? 1.54 Which is the closest to 3615? (a) 2/49 (b) 2/5 (c) 5 (d) -2/287 c What is the closest to -2/3 in 4.8278, -0.4, 2/9, -10.5? -0.4 What is the closest to -0.5 in -3, 40, 3/17, 1, 3, 78? 3/17 Which is the nearest to 4/5? (a) 1/8 (b) -4/9 (c) -0.04 (d) 0 a Which is the nearest to -26? (a) 35 (b) -0.086 (c) -2/3 c Which is the closest to -1? (a) 0.1 (b) 3 (c) 0.12 (d) -11/830 (e) -4/9 e Which is the closest to 95? (a) -1/9 (b) 15/11 (c) 0.2 (d) -2 b Which is the nearest to 1? (a) 0.2 (b) -4 (c) 0.0445 (d) -0.088 (e) 0.5 e Which is the nearest to 0? (a) 0.03 (b) -1/4 (c) -0.2 (d) -2 (e) 801 a What is the nearest to -2 in 201, 56, -6/5, -4? -6/5 Which is the closest to -6.14? (a) 2/13 (b) 0.4 (c) 4/5 (d) 4 (e) 3 (f) -1/3 f What is the closest to -1 in 2/19, 5, 0.4, -13/522, 0.2? -13/522 Which is the closest to -143/2? (a) -1 (b) -1.4 (c) -21/11 c Which is the closest to 2/109? (a) 1/5 (b) -8 (c) 5 (d) 5/6 (e) -1/88 (f) -2/15 e Which is the closest to -1? (a) -1 (b) 2 (c) 0.6 (d) -62 (e) 2244 a Which is the nearest to -64? (a) 1277 (b) -3 (c) 1 (d) 144 (e) -0.1 b What is the closest to -1/6 in 0, 5, -17/31, 104/11? 0 What is the nearest to -0.1 in 0.02, -0.5, 6/7, -6, -5/3, -380? 0.02 What is the closest to 4/5 in 148.6, 4, 0, 2/33? 2/33 Which is the nearest to -0.6? (a) 99 (b) 1/13 (c) 2880 b What is the closest to -13 in 0.2, 3, -20147? 0.2 Which is the closest to 1? (a) -3 (b) 0.1 (c) 0.5 (d) -5 (e) -2155/2 c What is the closest to 6 in 0.23, -0.1, 1/3, -10, -292? 1/3 Which is the nearest to -1? (a) -345 (b) -1/3 (c) 5 (d) 1 (e) -29 (f) -0.11 b Which is the closest to -0.02? (a) 0 (b) -6 (c) 0.1 (d) -2/9 (e) 57 (f) -1 a Which is the nearest to -14? (a) -1/69 (b) 1/4 (c) -0.3 (d) 1 c Which is the closest to 0? (a) -259 (b) 0.8 (c) -2/15 (d) -47 (e) -5 c What is the closest to -0.1 in -0.0281, 0.67, -0.1, 7/3? -0.1 Which is the closest to -0.083261? (a) -4/5 (b) 3 (c) -2/15 (d) -3/10 c What is the nearest to -10/3 in 40, -5, -0.488, 2? -5 What is the closest to -189/4 in 1, -2, 14, -3, 9? -3 What is the nearest to -0.4 in 17/40109, -6, -3? 17/4010	{ "pile_set_name": "DM Mathematics" }
be y(12). Let n = -7 + 4. What is the third biggest value in -0.5, n, o? o Suppose m + 0 = 3. What is the third smallest value in 0.2, m, 1? m Let o = 12.2 - 12. Let n be (-7)/(-15) + 2/6. What is the third smallest value in n, -5, o? n Let i = -6 - -11. Suppose -3z - 2v + 8 - 21 = 0, -23 = 3z + 4v. Which is the biggest value? (a) i (b) 4/3 (c) z a Let v = -49 - -247/5. Which is the third smallest value? (a) v (b) -1/10 (c) 3 (d) -3 a Let b be -1 + -1 + 33/18. Let s = 55 + -59.9. Let n = -5 - s. What is the third biggest value in 0.2, n, b? b Let v = 0.1 + 0.2. Let r be 1/(-16)-14 + -1. Which is the second biggest value? (a) v (b) r (c) -5 b Let w = -0.44 - 0.06. Which is the smallest value? (a) w (b) -5 (c) -4 (d) -1/4 b Let q = -6.07 - -0.07. Let d = 7 + q. Which is the third smallest value? (a) d (b) -0.1 (c) -0.3 a Let i = 241 + -1209/5. Let s = 0.9 - -0.1. Which is the biggest value? (a) -0.1 (b) i (c) s c Let x be 0 - (1 + 2/(-4)). Let d = 923/5 - 184. Which is the smallest value? (a) x (b) d (c) 5 a Let b(f) = -f2 - 9f + 16. Let m be b(-11). Let d be (-7)/4 - (m + 3). Let k = -25/22 + 10/33. What is the second biggest value in k, -2, d? k Suppose t = 3t. Suppose -f - f = t. Let h be (-51)/57 + (1 - f). Which is the biggest value? (a) 2/13 (b) -2/11 (c) h a Let m = -0.7 - -2.3. Let f = -0.6 + m. Let o be (-5)/50(-15)/(-2). Which is the second biggest value? (a) o (b) f (c) -1/5 c Let q = 0.02 - 3.52. Let n = 3 + q. Let m = 5/6 + -7/6. What is the smallest value in m, 2/3, n? n Let m = 0.637 + -0.137. Let u = 3.3 + -3. What is the smallest value in m, u, -5? -5 Let o = 11.9 - 12. Which is the second smallest value? (a) -0.3 (b) o (c) 0.4 (d) 0 b Let x = 1376/8775 - 2/675. Which is the third biggest value? (a) x (b) -0.4 (c) -0.3 (d) 5 c Let y = 0.1 + 0.4. Suppose 7 = f - 2f. Let a = -7 - f. What is the biggest value in a, y, -3/4? y Let s = -0.05 - -0.05. Let z = -0.2 - -0.6. Let d = 0.1 - z. What is the smallest value in s, d, -2/9? d Let o = 6 - 3. Let x = -18 + 12.2. Let g = x - -6. What is the third biggest value in g, o, 5? g Let n = -24.1 + 24. Which is the biggest value? (a) -2 (b) n (c) 4 c Let q = 0.12 + 0.28. Which is the biggest value? (a) q (b) -7 (c) 2 c Suppose 2z - 15 + 39 = 0. Let s = z + 16. Which is the second biggest value? (a) -5 (b) s (c) -0.8 c Suppose -x + 3 = -0x. Suppose xj = j. Let u = 0.2 - -0.8. What is the second biggest value in -0.2, u, j? j Let u = 127/3 - 42. Let l = 0.2 + -0.11. Let k = l - 0.59. Which is the third biggest value? (a) k (b) 4 (c) u a Let r = -1.79 + -76.21. What is the second biggest value in -3, 0.5, r? -3 Let i = 191 - 2863/15. What is the second smallest value in 2/21, i, -5? 2/21 Let h(y) = -4y - 30. Let v be h(-7). Let n = -2.8 + 3. Let p = n - 0.6. What is the biggest value in p, -2/19, v? -2/19 Let w = 61 + -61.04. What is the third biggest value in w, -2/11, -0.3? -0.3 Let p(d) = -4d*2 - 3d - 1. Let n be p(-1). Let h(v) = -v + 3. Let r be h(n). Which is the second smallest value? (a) r (b) -3/2 (c) -6 b Suppose -33 = 4v - 5t, -3v + 4v - 3t + 17 = 0. Let j be (20/75)/(2/(-9)). Let r = j - -28/15. What is the smallest value in r, 3, v? v Let g = -5 + -4. Let i be (-160)/396 - 2/g. Let f = -2 - -3. Which is the third smallest value? (a) i (b) f (c) -2 b Let n = -0.407 + -0.053. Let f = 0.16 + n. Which is the smallest value? (a) 0.1 (b) f (c) -3/2 c Let p = -6 + 2. Let w = -5 - -3. Which is the second biggest value? (a) w (b) -5 (c) p c Let s(g) = g3 - 25g*2 + 24g - 2. Let n be s(24). Which is the third smallest value? (a) 3 (b) 2 (c) n (d) 0.3 b Let j = -163 + 163. Which is the smallest value? (a) j (b) 1 (c) -2/7 c Let f = 0.7 - 0.2. Let l = -1 + f. Let v = 61 + -60. Which is the smallest value? (a) 0.5 (b) v (c) l c Let p = 531/4 - 132. Let k = -1.46 + 1.96. Which is the smallest value? (a) k (b) -0.2 (c) p b Let f = 66 - 69. What is the second biggest value in -0.1, -32, 5, f? -0.1 Let y = 0.2 + -0.2. Let i = 1 + y. Let p = -41.7 - -41.2. Which is the smallest value? (a) i (b) -0.2 (c) p c Let j(a) be the first derivative of a*4/4 - 4a*3 + 5a*2 + 14a - 6. Let p be j(11). What is the biggest value in 2/9, p, 0.2? p Let k = 1.6 - -0.4. Let f be (-16)/(-9) + 2/9. Let w be (-2)/72 + f/8. Which is the second smallest value? (a) w (b) 1 (c) k b Let v = 21 + -20.9. Which is the third smallest value? (a) 14 (b) v (c) -1 a Let a = -0.11 - -0.62. Let h = -1.09 - -1.1. Let f = a - h. What is the smallest value in f, 0.2, 0? 0 Let w = 0 - 0.4. Let v = 75 - 77. What is the biggest value in 3, w, v? 3 Let f be (-11)/(-2) + 1/(-2). What is the biggest value in f, 0.4, 2/17? f Let i be (-1)/312/64. What is the biggest value in 1, 2, -1, i? 2 Suppose 7z - 4z = -810. Let t = -1893/7 - z. What is the second biggest value in 5, t, -1/2? t Let s = -8.524 + -0.076. Let v = s + 9. What is the smallest value in v, -0.8, -1? -1 Let a be -15/((-10)/(-4)). Let c = -216 + 216.1. What is the second biggest value in c, a, -2/5? -2/5 Let h be 2/2 + 21. Let u = -1.5 + 1.5. What is the third smallest value in h, -1, u? h Suppose 5w - 5g - 9 = 7w, 4w = g + 15. Which is the smallest value? (a) w (b) -2/41 (c) 4 b Suppose -4f - 16 = -2v, -2f = -3v + 6 - 2. Let y(g) = -5g*2. Let q be y(3). Let h be (-2)/10 + (-24)/q. Which is the smallest value? (a) h (b) v (c) -1 b Suppose -3t + 2z - 17 = 0, -5t - 4z - 2 + 3 = 0. Let d = -2 - -1. Let x = 2/21 + 4/7. Which is the biggest value? (a) x (b) t (c) d a Let i be (-2)/12 - (1 + (-47)/30). Which is the smallest value? (a) 4 (b) -8 (c) i b Let l = 0.12 - 0.52. What is the second biggest value in 2/21, -0.3, l? -0.3 Let t = -5 - -2. Let i = -10.5 - -11. Which is the smallest value? (a) i (b) t (c) 1 b Let t = 8 + -11. Let r = -10 - -28. Let a = r + -13. What is the second biggest value in -2, t, a? -2 Let c = 123 - 81. What is the biggest value in 0.5, 1, c? c Let g = 22.45 - 40.87. Let z = g - -0.42. Let w = -13 - z. Which is the smallest value? (a) w (b) 2 (c) 1/2 c Let t = 3 + -6. Which is the third smallest value? (a) 0.1 (b) t (c) 0 a Let p(t) = -t - 9. Let h be p(-9). Suppose -29 = -i - 5w, hw = 2w - 6. Let d be (-3)/(-8)i/21. Which is the smallest value? (a) 3 (b) d (c) -1/2 c Suppose 0 = -38a + 40a - 4. Let q(p) = p3 - 4p*2 + 2p + 1. Let h be q(2). What is the second biggest value in -2/3, h, a? -2/3 Let s = 0.049 - 0.549. What is the fourth smallest value in s, 7, -4, 0? 7 Let w = -0.19 - 0.81. Let n = -7 - -10. Let v be 4/(-12) + 16/n. What is the smallest value in v, -5, w? -5 Let y = -0.04 - -6.24. Let q = -6 + y. Which is the second smallest value? (a) q (b) -3/7 (c) 0.4 a Let f = -0.3 - -0.5. Let x = -72 + 214/3. Let b = 2.6 - 3. What is the third smallest value in x, b, f? f Let s = 16/91 + -6/13. Let o = 4 + -2. Which is the biggest value? (a) s (b) o (c) 1 b Let g = 22.017 + -0.017. Let s = 21 - g. Let n = 0.3 + -0.5. Which is the biggest value? (a) n (b) 2 (c) s b Let p = -1.7 + 1.9. Which is the third biggest value? (a) p (b) -0.5 (c) 3 b Let z(i) = -4i2 - 2i - 1. Let s be z(-1). Suppose 0 = -r - 3r + 4. Let g be r/(-3)(-2 - -4). What is the third smallest value in s, g, -2/11? -2/11 Let t = -24.3 + 23. Which is the third smallest value? (a) t (b) -2 (c) -2/15 c Let d = 21 - 29. Let b be 10/(-15)6/d. Let u be 1 - (0 + 10/8). What is the second biggest value in b, -0.2, u? -0.2 Let k = -0.03 - -2.23. Let u = -8 + 8.8. Let r = u + k. Which is the second biggest value? (a) 5 (b) r (c) -0.4 b Let d = 0.14 - 0.04. What is the third biggest value in d, 3/2, -4? -4 Let a be 6/(-4)(-1 + 7). Let k be -1 + a/6 - -2. What is the biggest value in k, 5, -4? 5 Suppose -2x = k + 14 + 7, 5k - 5x + 30 = 0. Let h = -19 - k. Let b be (-1)/(-15)20/h. What is the smallest value in 2, 3, b? b Let j(q) = q*2 + 3q - 4. Let z(u) = u*2 + 5u + 1. Let v be z(-4). Let s be j(v). Which is the third biggest value? (a) -3 (b) -2 (c) s c Let q = 11 + 0. Let d = q - 8. Let u = d + -3.1. Which is the second biggest value? (a) -2/5 (b) u (c) 3/4 b Let g = 7 + -5. What is the second	{ "pile_set_name": "DM Mathematics" }
(c) = c*3 + 15c*2 + c + 13. Let t be s(z). Put t, -1, d in ascending order. t, -1, d Suppose 0 = -g - h, -3g - 2g + 6 = 3h. Suppose g = 2b - b. Let c(p) = 201p - 202. Let s be c(1). Put b, s, 6 in descending order. 6, b, s Let i = -9 - 0. Let p = i + 9. Let c be (p - -3)(3 + -4). Put c, 4, 5 in decreasing order. 5, 4, c Suppose -15 = -5h, 5v + 7 = -4h + 8h. Sort -15, -5, v. -15, -5, v Let a = 18.84 + 0.16. Let c = a + -18.7. Let b(l) = -l2 - 2l + 1. Let n be b(-3). Sort n, -0.3, c in ascending order. n, -0.3, c Let i = -234 + 235. Let f(h) = -h - 3. Let a be f(-6). Suppose -o = -at - 2 - 0, o + 4t = -12. Put o, -5, i in ascending order. -5, o, i Suppose -2p - d - 11 = 0, -4d = -7p + 2p + 5. Suppose 3u + 5g - 5 = 0, -6g + 10 = 4u - g. Put u, -5, p in decreasing order. u, p, -5 Suppose 223b + 66 = 212b. Put b, -2, -5 in descending order. -2, -5, b Let g = 0.9 - 5.9. Let u = 1057999/44 - 24044. Let q = -3/44 - u. Put g, q, -0.07 in increasing order. g, q, -0.07 Let f be (-1)/16/171-3. Let j = -5.8 - -6. Sort f, 0.5, j in increasing order. f, j, 0.5 Suppose -2i + 112 = -88. Suppose 9v - i = 5v. Let q be (-2)/(-20)v/(-20). Put 4, q, -2/3 in decreasing order. 4, q, -2/3 Let o = -1 + 9. Let h = o + -4. Let q(m) = m*2 + 2m + 2. Let i be q(-2). Put -2, i, h in increasing order. -2, i, h Suppose -2p + 1 = -1. Suppose v = 3v + 16. Let b be (10/(-10))/(2/v). Sort -5, b, p. -5, p, b Suppose -c - 3 + 1 = 0. Suppose -4h - 16 = -6h. Suppose -7v = -3v - h. Put 4, v, c in decreasing order. 4, v, c Let r be ((-3)/(-6) + -2)12/72. Sort -5, r, -4, -0.11 in descending order. -0.11, r, -4, -5 Suppose 0 = -0x - 3x + 36. Suppose xk - 5 = 7k. Sort 0, 3, k. 0, k, 3 Let p be 8/(-14)63/(-234). Sort 0.5, 8, p in increasing order. p, 0.5, 8 Let p = -20.59 - -21.7. Let a = 0.35 - 0.24. Let z = p - a. Put 0.4, z, 0.2 in increasing order. 0.2, 0.4, z Let u be (18/(-4))/(-9) + 156/(-24). Put u, 2, -9, -3 in ascending order. -9, u, -3, 2 Let v be (-2)/316. Let w be (-5 + 6)(-1)/30. Sort v, 1, w in descending order. 1, w, v Let k(h) = 6 + h*2 - 3123h + 3134h + h2. Let v be k(-5). Let z = -3 - -7. Sort -4, z, v in decreasing order. z, v, -4 Let f = 164 + -161. Sort 27, -3, f. -3, f, 27 Let p be 71 - (22 + -4 - 14). Sort 2, -91, -5, p in increasing order. -91, -5, 2, p Suppose 18 = -7q + 4q - 3x, 2q = -x - 9. Let d be (-2)/(-10) - 267/(-15). Put d, q, 1 in decreasing order. d, 1, q Let v be (-1 - 0)/((-3)/87 - 0). Let c = 30 - v. Sort 3, -1, -3, c in increasing order. -3, -1, c, 3 Let m be 22/(-55)52/2. Put m, -10, -6 in descending order. m, -6, -10 Let m be 6/(-16)8/(-18). Let s = -284 + 2558/9. Sort s, m, -1 in decreasing order. s, m, -1 Let x = -18 + 14. Let g = -0.9 - x. Let t = g + -0.1. Sort 0.2, t, -1 in ascending order. -1, 0.2, t Let z = -1.9 - -2. Let h be (22/(-40))/(16/64) + 3. Put h, 3/2, -0.1, z in descending order. 3/2, h, z, -0.1 Let d = -397 - -392. Put -46, d, 0, -3 in increasing order. -46, d, -3, 0 Let c = 1.2 - 5.2. Let t = c - -8. Sort -0.1, 6, -4, t. -4, -0.1, t, 6 Let d = -0.1612 + 3.1612. Sort -43, d, -0.2, -3 in descending order. d, -0.2, -3, -43 Let q(h) be the first derivative of -h4/4 - 7h*3/3 - 7h*2/2 - 5h + 5. Let v be q(-6). Put 4, 5, -4, v in descending order. 5, 4, v, -4 Let l(w) = 6w - 11. Let a be l(2). Sort 1/14, -0.5, 4, a. -0.5, 1/14, a, 4 Let p(l) = -l3 + 2l*2 + 6l. Let v be p(-4). Let u = v + -67. Let s(q) = q*2 + 6q - 2. Let y be s(-6). Put 4, y, u in ascending order. y, 4, u Let v = -764 - -763.95. Suppose -3o - 3i + 1 = -o, 5 = -5i. Put 5, o, -4, v in descending order. 5, o, v, -4 Let i = 1 + 0. Let n = 0.6525 + -0.8525. Put n, i, 4, -4 in decreasing order. 4, i, n, -4 Let i be (-6)/8(-189)/567. Put i, -3/4, -1 in increasing order. -1, -3/4, i Suppose 0 = 484a - 477a - 28. Let w be (2 - 3/3) + -1. Put w, -42, a in decreasing order. a, w, -42 Suppose 7h - 3h = -20. Let p(y) = 3y + 198 - 177 - 5y. Let g be p(11). Put g, 1, h in ascending order. h, g, 1 Let p be 263/(-263)(5 + -1 - 0). Let j = -34 + 20. Put p, j, 3, 1 in decreasing order. 3, 1, p, j Let u = -690 - -690. Put 3, 25, -2, u in decreasing order. 25, 3, u, -2 Suppose 0h = h + 2, -w - 4h = 8. Let i be 1/1 + 21. Suppose -2 + 11 = -io. Put 2, o, w in ascending order. o, w, 2 Let v = 110 - 109.8. Put v, -1/4, -3.25 in ascending order. -3.25, -1/4, v Let s(g) be the first derivative of -g2/2 - 10g - 5. Let a be s(-14). Sort 3, -5, a in descending order. a, 3, -5 Let k = 3.9 + -24.6. Let w = 21 + k. Sort -2/7, -2/3, w. -2/3, -2/7, w Let q be (3/45)/((-231)/35 - -6). Put -4, -6/11, q in descending order. q, -6/11, -4 Let p(h) = -h*3 - 4h*2 - 6h - 22. Let t be p(-4). Suppose 0 = -b - 8 + 3. Let z be 14/10 - (-2)/b. Put t, -3, z in increasing order. -3, z, t Let r = 114 - 119. Let w(a) = -a*3 + 6a*2 + 6a + 9. Let k be w(7). Sort k, r, 5 in descending order. 5, k, r Let o(k) = -k*2 + 4k + 4. Let d be o(4). Let z be -2d/((-6)/3). Sort -6, -4, z in increasing order. -6, -4, z Let a be 16/(-3) + (-6)/9. Let g(f) be the first derivative of f3/3 + 3f*2 - 3f - 1. Let p be g(a). Sort -6, p, -4 in descending order. p, -4, -6 Let u = -0.04 + -1.96. Let j be 3 - 5 - (-29)/26. Let y = 18/13 + j. Put y, u, -2/9 in descending order. y, -2/9, u Suppose 14d = 17d - 3r - 12, -3r = 3d. Let u(m) = m. Let p be u(3). Suppose -pn = -n + 10. Put 0, n, d in descending order. d, 0, n Let s = -1031 - -1035. Sort -21, 2, -0.5, s in decreasing order. s, 2, -0.5, -21 Let p = 3 + 0. Let q be 4/14 + 1311/(-399). Sort q, 6, p in descending order. 6, p, q Let v = 87.88 - -0.12. Let o = v - 92. Put 2, -2, -5, o in ascending order. -5, o, -2, 2 Suppose 4i = 5u + 240 - 36, -51 = -i - 3u. Sort -2, 1, i in decreasing order. i, 1, -2 Let i = 78 - 77.1. Let c = i + -0.5. Put 5, -5, c, -2 in decreasing order. 5, c, -2, -5 Let b be (-24)/(-9)(-6)/4. Let j be (20/90)/(2(-3 + 53/18)). Suppose 0 = -0w + 2w + 6. Put j, b, w in descending order. j, w, b Let t = 2667 - 2666.9. Sort -5, -1/2, t, 1/4. -5, -1/2, t, 1/4 Let y be 8/(-30)25/(-30). Let q = -8.2 + 8. Let g = q - 0.2. Put g, 1, y in ascending order. g, y, 1 Let n(x) = 2x2 - x + 3. Let c be n(2). Suppose -6q + cq - 21 = 0. Sort 2, 4, q. 2, 4, q Let g = -0.78 - 4.22. Sort 0.5, g, 3. g, 0.5, 3 Let s(g) = -g3 + 6g*2 + 3. Let z be 1 - -2(-9)/(-6). Let y be 16/8 + 1z. Let v be s(y). Put -1, v, 5 in decreasing order. 5, v, -1 Let g = -36 + 39. Let b be (1 + 3/(-6))-6. Put g, b, 5 in decreasing order. 5, g, b Let f be (4 + 16/(-5))/(4/10). Suppose 0 = 6r + 8 - f. Let i = 0 + 0.1. Put i, r, 4 in decreasing order. 4, i, r Let q(t) = t2 + 2t + 3. Let j be q(-3). Let r be ((-39)/j)/((-1)/(-4)). Let h = 22 + r. Sort -8, h, -1. -8, h, -1 Suppose 4h + 12 = 4g, 7h = 5h - 5g + 29. Put -16, 3, h, 5 in increasing order. -16, h, 3, 5 Let c = 1 + -0.5. Let x = 0.14 + 0.66. Let v = x + 1.2. Put 3/7, c, v in decreasing order. v, c, 3/7 Let i be 203/4(-12)/(-3). Suppose 3o = -4h - 157, 0 = 4h + h - 3o + i. Sort h, 2, 4 in decreasing order. 4, 2, h Let l(j) = j*3 + 6j*2 - 2j + 19. Let w be l(-6). Suppose -4y - 4f = y - w, -y - 5f = -23. Suppose 1 + y = h. Sort -2, 0, h in ascending order. -2, 0, h Let s = 66 + 37. Let c = s - 103.5. Let g(m) = -4m - 1. Let a be g(1). Sort a, 2, c in descending order. 2, c, a Suppose 5a + 72 = -7a. Put 0, 5, 4, a in decreasing order. 5, 4, 0, a Suppose -3f + 18 - 6 = 0. Suppose 3g = -3, -g + fg + 18 = -3d. Let k be (-6)/183/d. Sort 2/3, -0.2, k in decreasing order. 2/3, k, -0.2 Let q(j) = -2j*3 - 26j*2 + 28j + 4. Let k be q(-14). Sort -5, -12, k. -12, -5, k Suppose 2u + 43 + 39 = 0. Let x = -46 - u. Let q = 22/51 + 4/17. Sort -3, x, q in descending order. q, -3, x Let l(x) = -x + 10. Let c be l(7). Suppose 5i + 5z = -5, 4z - 1 = -ci - 2. Sort -1, -2, i in decreasing order. -1, -2, i Let p = -0.2 + 8.2. Let j = -2966/5 + 594. Sort -1/5, p, j in descending order. p, j, -1/5 Let t be (-25)/35 + 8/(-28). Let g be (15/10 + t)-2. Let w be (-2)/(-9) + (-65)/9. Sort w, 0, g. w, g, 0 Let r be (3 - -6) + (-10 - -3). Put 0, 19, -3, r in decreasing order. 19, r, 0, -3 Let x = -9 + 6. Suppose -i = -5*n	{ "pile_set_name": "DM Mathematics" }
y + 488807 = 490535 for y. 24 Solve 0 = -237227l + 236001l - 98080 for l. -80 Solve -2843w = 507w - 688w - 130438 for w. 49 Solve -309h + 628h - 240 = 331h for h. -20 Solve -4207p = 4251p - 8730p - 17408 for p. -64 Solve 5369y = -580y - 12797y + 18746 for y. 1 Solve 804 - 878 - 2212 = 561o + 7812 for o. -18 Solve -204579 = 90a + 6673a + 255305 for a. -68 Solve -859y + 3898y - 967y = 1401y - 51667 for y. -77 Solve -157n = 366n + 1329 - 36370 for n. 67 Solve 50516 - 13220 = 518s for s. 72 Solve -1786i + 8056 = 32764 + 10082 + 18790 for i. -30 Solve -10825 - 6247 = -592r + 5424 for r. 38 Solve -4894x - 7113x + 65632 - 317779 = 0 for x. -21 Solve 35532 = 1686w - 4647w for w. -12 Solve -873 = -104i + 2051 - 5004 for i. -20 Solve 15356106 - 15355526 = -145l for l. -4 Solve -53750 = -860c + 116c + 28c - 359c for c. 50 Solve -31920849 + 31897181 = -194w for w. 122 Solve 855w - 408w + 334w = -963w - 130800 for w. -75 Solve -112m - 2955 + 603 = 0 for m. -21 Solve 258l + 976l = 5656l + 192168 - 28554 for l. -37 Solve -2627 - 7853 - 664 = 5572a for a. -2 Solve 1648v + 2270v = 1197v - 291147 for v. -107 Solve 1229953 - 1242004 = -117m for m. 103 Solve -1461866 = 208g - 1477674 for g. 76 Solve -296v + 462v + 39438 = -331v - 442v for v. -42 Solve 1865b - 28311 = -78666 for b. -27 Solve 109161x = 109122x + 1950 for x. 50 Solve -1677496b - 1280 = -1677528b for b. 40 Solve 12399c - 16646c - 309302 = 94163 for c. -95 Solve 0 = -10598s + 10328s - 5940 for s. -22 Solve 92600 = 2j + 92608 for j. -4 Solve -156t - 3978 = -88t + 238t for t. -13 Solve -17496 = -25409095b + 25409419b for b. -54 Solve 85n - 37355 = -32935 for n. 52 Solve -3015 = 35c + 52c - 840 for c. -25 Solve 0 = -95k + 12k - 830 for k. -10 Solve 532d - 7034 - 1311 + 1349 = 8432 for d. 29 Solve -6488i + 7146i = -27636 for i. -42 Solve -9889n - 24072 = -19557n + 9904n for n. -102 Solve -99q - 115q = -234q + 181 - 1201 for q. -51 Solve -2487y + 58915 + 37836 = -22625 for y. 48 Solve 3801 - 3175 = 634r - 10786 for r. 18 Solve -26390r - 337484 = -31353r for r. 68 Solve -67811 = -995j + 363j - 945j for j. 43 Solve 73m - 2746 + 2281 = 15m + 3827 for m. 74 Solve -481z + 51513 = 344z - 157z + z for z. 77 Solve -146c - 109c - 90692 = -1361c for c. 82 Solve -298k + 1626k + 1514k + 281358 = 0 for k. -99 Solve -63u + 16u = 21u - 2244 for u. 33 Solve 1837s - 409s + 1848 - 23268 = 0 for s. 15 Solve -11b - 101b - 35b - 267 = 1350 for b. -11 Solve -489y - 1050 = 879y - 2066 - 3088 for y. 3 Solve -153k = 42776 - 45071 for k. 15 Solve 1159p = -114p + 15276 for p. 12 Solve 14y = 729 - 613 + 1158 for y. 91 Solve 10552r - 11637r = -18445 for r. 17 Solve 0 = 2x - 7x - 18315 + 18290 for x. -5 Solve 136j + 10037 - 10725 = -209j + 14492 for j. 44 Solve 1072895s - 1074074s + 13462 + 26624 = 0 for s. 34 Solve -28570 + 291889 + 148166 = 6369m - 85297 for m. 78 Solve -1468k + 11443 - 4234 = -3067 for k. 7 Solve -97860 = -1717q - 1079q for q. 35 Solve -30842u + 31374u = -8512 for u. -16 Solve 61p + 13p - 5p + 698 + 544 = 0 for p. -18 Solve 0 = -602v + 39v - 583v + 75636 for v. 66 Solve -657m = -49732 - 8741 for m. 89 Solve 74p = -71p - 244p + 6613 for p. 17 Solve -6986 = -93r + 547 for r. 81 Solve 4543 = -33090p + 33013p for p. -59 Solve 386q + 207q = 128q - 30690 for q. -66 Solve 514b + 1138 = -55b for b. -2 Solve 918y = 1129y + 17724 for y. -84 Solve 205w + 3815 + 5410 = 0 for w. -45 Solve 3594 = -438y - 1224 for y. -11 Solve 1698z + 37673 - 165023 = 0 for z. 75 Solve 74 - 74 = -2923k for k. 0 Solve -21810 = 88f - 22602 for f. 9 Solve 350 + 637 = -74o - 197 for o. -16 Solve -22i = 174i - 0i + 17052 for i. -87 Solve -26x - 34x + 392 + 106 = -1662 for x. 36 Solve 3n + 3n + 942 = -12n - 156 for n. -61 Solve 10279 - 1393 = -215r + 16 - 10480 for r. -90 Solve -118147p = -118053p - 2538 for p. 27 Solve 0 = -1448s - 1198s + 653s - 7972 for s. -4 Solve 107372f = 107248f - 6200 for f. -50 Solve -59i + 637 = -1070 - 372 - 2700 for i. 81 Solve 12 = -114y + 15y + 125y + 1000 for y. -38 Solve -271804t + 272595t = -82264 for t. -104 Solve 860 = 14508247j - 14508333j for j. -10 Solve -5355u + 3009 = 5247u - 10425u for u. 17 Solve -11289 = -986j + 3364 - 1835 for j. 13 Solve -285y - 3639 + 22217 = 138y - 17800 for y. 86 Solve -32758x - 610 = -32819x for x. 10 Solve -483r + 119r - 17059 = 174r + 1771 for r. -35 Solve 4975l + 62636 = -3973l for l. -7 Solve 11177s - 8083s = -173264 for s. -56 Solve -24l - 252 = 253 - 169 for l. -14 Solve 150h + 62h + 163h = 86h + 38148 for h. 132 Solve -122x = 322x - 81x + 153x - 26316 for x. 51 Solve 2518 = -707v + 5523 + 28091 + 12 for v. 44 Solve 373y - 9y = 61y - 324 - 3009 for y. -11 Solve -2475 + 6553 = 156r - 8402 for r. 80 Solve -157k + 25 = -137k - 12 - 3 for k. 2 Solve 1622m - 51268 = 37493 - 131498 - 194075 for m. -146 Solve -877s - 2687 = -924s - 102 for s. 55 Solve -665k + 3810 = -127k - 3184 for k. 13 Solve 66y - 2373 + 2967 = 0 for y. -9 Solve -166o - 194o + 467o + 61 + 153 = 0 for o. -2 Solve -28d + 11028 + 3154 = 98d + 1834 for d. 98 Solve -28a - 285 = 26a - 39a for a. -19 Solve 5016 = 3265c - 3133c for c. 38 Solve 486x + 792x - 65424 = 1095x - 569x for x. 87 Solve -860o - 355o - 508o + 219o - 9024 = 0 for o. -6 Solve 39928 = -123s + 1549s for s. 28 Solve -26c - 3676 = 3546 - 7560 for c. 13 Solve -6382b - 6359b + 19088b + 3320 = 6430b for b. 40 Solve 0 = 1529r - 2333r - 29748 for r. -37 Solve -39s - 81s - 49s - 1521 = 0 for s. -9 Solve -435w = 692w - 78685 - 1439 - 23560 for w. 92 Solve -58h - 19586 = -26372 for h. 117 Solve -3583o = 212758 - 635552 for o. 118 Solve 11 - 6 = -241h + 885h + 5 for h. 0 Solve -90 = 2u + 135 - 163 for u. -31 Solve 351164 + 527246 = -14345u + 831u for u. -65 Solve 1538j + 351 - 2 = 17267 for j. 11 Solve 1119a - 270 - 168 = -92 - 10417 for a. -9 Solve -31r - 512 = -1649 + 579 for r. 18 Solve -575 = 210x - 308x - 4495 for x. -40 Solve -312288k + 73780 = -311234k for k. 70 Solve -3337b - 72213 = -1355b + 2230b - 299661 for b. 54 Solve 145u + 113u - 23u = -173u + 69u for u. 0 Solve -135l + 18067 = -8039 + 13416 for l. 94 Solve -365y + 22375 = -4011 - 6829 for y. 91 Solve -6425w = -6397w - 980 for w. 35 Solve -836 = -260i + 165i + 3652 + 2542 for i. 74 Solve 379r + 175r + 2078r = -389536 for r. -148 Solve -1290q = -2098q + 999q + 18909 for q. -99 Solve -117r + 17527 = 21154 for r. -31 Solve 610p + 619p + 2300 = 1329p for p. 23 Solve 85 + 4947 = -304s - 325s for s. -8 Solve 153669 + 52186 = -15835v for v. -13 Solve -14219 = 818x + 20537 - 9398 for x. -31 Solve 4666v - 4707v + 2178 = -348 - 3009 for v. 135 Solve -4146l - 376675 = -61579 for l. -76 Solve 497d + 900d - 14240 = 38846 for d. 38 Solve -670x = -614x - 134 - 648 - 5490 for x. 112 Solve 423v + 9602 + 29778 = -472v for v. -44 Solve 3h - 10h - 48h = -4h + 1581 for h. -31 Solve -46249p + 48976p + 283608 = 0 for p. -104 Solve -300w - 938w - 15140 - 244895 = 747w for w. -131 Solve -6233c + 4216c = 193632 for c. -96 Solve -4983j - 1873 + 7202 = -9620 for j. 3 Solve -169 = -336689a + 336676a for a. 13 Solve 0 = 624k - 42183 - 12105 for k. 87 Solve -100x - 3096 = -127x - 45x for x. 43 Solve 0 = 35655z - 35885z - 2530 for z. -11 Solve 0 = -11p - 125p + 8530 + 3030 for p. 85 Solve 8204 = 1710r - 290r + 872r - 12424 for r. 9 Solve -341l = 3810 + 1608 + 2766 for l. -24 Solve -270x - 46112 = -1711x for x. 32 Solve -57730 = -4667r - 133510 - 68897 for r. -31 Solve -47v + 4872 = 223v - 186v for v. 58 Solve 899 = -3q + 24q - 387 - 58 for q. 64 Solve -159q - 5055q - 10074 = -177q for q. -2 Solve 1297 - 11608 - 11338 = 517y - 3554 for y. -35 Solve -37i - 451 = 27i - 23i for i. -11 Solve 104w + 4737 + 0 = 1511 - 6238 for w. -91 Solve 1704f + 2843f - 1270f = 1196 + 11912 for f. 4 Solve 157f + 164f - 488f + 166f - 41 = 0 for f. -41 Solve -280k - 292k - 1452 = -865k + 260k for k. 44 Solve 729q + 418q - 329q + 4312 = -260q for q. -4 Solve 372h - 121h + 23952 = -248*h for h. -48 Solv	{ "pile_set_name": "DM Mathematics" }
t*4 + 36t*3 + 0t + 0t2 + 95. Find the third derivative of i(y) wrt y. 102 Let p = 354 - 351. Differentiate -15 - 1 - 9 - 102i*p wrt i. -306i2 Let u(x) = x3 - 22x2 + 6x + 13. Let q be u(22). What is the second derivative of -231 + 76c3 + 231 - 17c*3 + qc wrt c? 354c Suppose 89 = 2u - 47. Suppose 7h - u + 5 = 0. Find the first derivative of -1 - 1 - 29i*3 + h wrt i. -87i*2 Suppose 109i - 644 = 102i. What is the second derivative of -67a + ia5 + 99a + 3a3 - 3a*3 wrt a? 1840a3 Let s = 14 + 5. Find the second derivative of f3 + 32f + f2 - 6f*3 + sf + 5f2 wrt f. -30f + 12 Let r(f) be the first derivative of -7f5/5 + 31f*3 + 3246f - 1464. What is the first derivative of r(m) wrt m? -28m3 + 186m Let i(s) be the first derivative of s6/15 - s5/2 - 7s2 + 132s + 203. Let x(r) be the first derivative of i(r). Differentiate x(f) wrt f. 8f3 - 30f*2 Suppose -4t = 3z + 115, -5t + 79 = -0z - 3z. Let l = z + 52. Find the third derivative of 11r2 - lr*5 + 19r*5 - 5r*6 - 5r*6 wrt r. -1200r*3 Find the second derivative of 5051n*3 - 4233n - 7256n + 5610n wrt n. 30306n Find the third derivative of -74d*4 + 5049d*2 - 16d*3 + 36 - 5081d*2 + 9 wrt d. -1776d - 96 Let s be -25 + 28 + -21. Find the second derivative of -1461w*4 - 2 + 1483w*4 - s + 17w wrt w. 264w2 Let v(q) be the second derivative of 1559q*5/20 - 85q*3/2 - 3q*2/2 + 5q + 69. What is the second derivative of v(i) wrt i? 9354i What is the second derivative of 571 + 34b*3 - 9b + 13b - 18b - 2b2 + 12b - 7b3 wrt b? 162b - 4 Let f(h) be the third derivative of 109/6h3 + 10/21h*7 + 0h*6 + 0h*5 + 0h*4 + 204h*2 + 0h + 0. Differentiate f(r) with respect to r. 400r3 Suppose 15 = 15k - 12k. What is the third derivative of -579a*2 + 614a*2 - 4a*k + 7a*5 wrt a? 180a*2 Find the third derivative of 684d*2 + 1316d*2 + 400d*2 + 855d*4 + 843d*4 + 178d*2 wrt d. 40752d Let g(a) = -9a - 52. Let n(d) = -5d - 2. Let t(f) = 6f + 2. Let r(p) = -4n(p) - 3t(p). Let x(i) = 2g(i) - 6r(i). Differentiate x(z) wrt z. -30 Let q = -367 - -369. What is the third derivative of -2r*5 + 0r*5 + 54r2 + r4 - r*4 + 2r*q - 7r*4 wrt r? -120r*2 - 168r Let s(t) be the second derivative of 5t4/12 - 389t*3/6 - 13843t*2/2 - 5790t. Find the first derivative of s(h) wrt h. 10h - 389 Let t(v) = -2358v*3 - 21v*2 + 47v + 32. Let d(s) = -2359s3 - 18s*2 + 44s + 30. Let o(p) = -7d(p) + 6t(p). Find the second derivative of o(b) wrt b. 14190b Let b(g) = 11g + 14 - 26g + 22g + g*2. Let l be b(-5). Find the third derivative of 88o*4 + 86o*4 + 3o*2 - 179o*l wrt o. -120o Let s(w) be the first derivative of 10465w4/4 + 5027w - 1666. Differentiate s(z) wrt z. 31395z2 Let m(w) = 516w*5 - 9w*3 - 217w*2 + 9w. Let l(h) = -h5 + h3 - h. Let r(f) = 18l(f) + 2m(f). What is the third derivative of r(t) wrt t? 60840t2 Let y(w) be the second derivative of -w7/840 - w5/20 + 5w*4/4 + 7w*3/3 - 2w + 13. Let r(x) be the second derivative of y(x). Differentiate r(v) wrt v. -3v2 - 6 Let p(r) = -7424r*2 - 4938r - 22. Let a(d) = -18560d2 - 12344d - 56. Let v(g) = -11a(g) + 28p(g). Find the second derivative of v(x) wrt x. -7424 Let r(n) = -n + 52. Let a be r(20). Let s be ((-152)/a)/((-3)/12). What is the third derivative of -4x5 - 3x*5 - sx*5 - 32x*2 wrt x? -1560x*2 Find the second derivative of -279 + 5501x*2 + x - 441x*5 - 5501x*2 wrt x. -8820x*3 What is the third derivative of 0y*5 - 7y*2 - 4y*5 + 6 - 59566y + 575y6 + 59578y + 2 wrt y? 69000y3 - 240y*2 Let n = 1 + 2. What is the first derivative of -28p*2 + 25p*2 - 108 + np*2 - 63p*3 wrt p? -189p*2 Let m(z) = -30z*2 - 12z - 232. Let s(v) = -v*2 + v + 1. Let n be (-756)/70 + -2 - (-4)/5. Let q(f) = ns(f) - m(f). Find the first derivative of q(r) wrt r. 84r What is the third derivative of 11i*5 + 8639 + 2667i2 + i4 - 8642 - 15i5 - 6i*3 wrt i? -240i*2 + 24i - 36 Suppose -5q + 3q = a - 10, 4a - 16 = 0. What is the third derivative of 57v*q - 69v*2 + 39v*3 - 31v*3 + 119v*2 wrt v? 390 What is the second derivative of 57a*3 + 150a - 143 + a*5 - 57a*3 + 28 - 175a - 579a2 wrt a? 20a*3 - 1158 Suppose h - r - 104 = 0, -3r - 416 = -4h - 8r. Find the second derivative of q + 144q5 - q3 - hq*5 + 32 - 79 wrt q. 800q*3 - 6q Suppose -20i + 44i + 77i = 505. Let f(v) be the third derivative of 0v + 0 + 11/6v3 - 4v*2 + 5/12v*i + 0v*4. Differentiate f(a) with respect to a. 50a Let i(b) be the second derivative of 73b5/10 + 3b*3/2 - 4607b*2/2 - 34b + 19. Differentiate i(r) with respect to r. 438r2 + 9 Find the third derivative of 340u*2 - 1030u*3 - 154u*2 - 417u*3 + 2u + 190u2 wrt u. -8682 Let j(u) = 2u*2 + 5u + 4. Let g be (-1 + -2)(-5 + (2 - -2)). Let w be j(g). What is the first derivative of 0h - 3h - 8 - 2 + w wrt h? -3 Let g(j) be the first derivative of -6344j*5/5 - 3j*2/2 + 885j - 3967. Find the second derivative of g(a) wrt a. -76128a2 Let f(g) = -g3 + 14g*2 + 15g + 4. Let c be f(15). What is the derivative of 68 - 443o4 + 2o*2 + 370o*c - 2o*2 + 63 wrt o? -292o*3 Let o be 2(2 + (-15)/6). Let k(n) = -13. Let a(i) = -22. Let q(m) = 3a(m) - 5k(m). Let g(v) = 5v2. Let c(z) = og(z) + 6q(z). Differentiate c(b) wrt b. -10b Let j(c) be the third derivative of -57c8/14 - c5/15 - 5c4/8 + c3/2 - 4c2 - 138c + 1. What is the third derivative of j(n) wrt n? -82080n2 Differentiate -105a - 676a + 378a - 421a - 1126 - 156a wrt a. -980 Let l(g) = 2755g4 - 74g*2 - 6g + 14. Let f(o) = -8258o4 + 223o*2 + 18o - 40. Let k(u) = 6f(u) + 17l(u). Find the third derivative of k(m) wrt m. -65112m Let x(z) be the first derivative of 4625z*4/2 + 121z*2/2 + 4z + 7402. What is the second derivative of x(a) wrt a? 55500a Find the second derivative of -842i*2 - 2 + 11i*3 + 456i + 94i + 330i + 384i2 + 406i*2 wrt i. 66i - 104 Let a(k) = 5k3 - 2k*2 + 5k - 5. Let q be a(2). What is the derivative of 61 - q + 76 - 3g3 wrt g? -9g*2 Let i be (-1508)/(-18) - (-4)/18. Find the first derivative of -2 - 27o - i - 4 wrt o. -27 Let f(s) = s*2 + 5s + 8. Suppose -2b - 1 = -5g + 29, -2b - 4g = -6. Let j be f(b). Find the third derivative of -8627c + 29c*3 + 8627c - jc2 wrt c. 174 Let d(j) be the second derivative of -226j6/15 + j3/6 + 45j2/2 + 1895j. Find the second derivative of d(y) wrt y. -5424y2 Let u(x) = -89x*2 - 534x + 9. Let y(b) = -2b2 - 10b - 1. Let c(t) = 2u(t) + 18y(t). Find the second derivative of c(r) wrt r. -428 Let m be (-1 + -1)((-102)/16 + -8 + 12). Let y(q) be the first derivative of 0q*3 - 20 + 0q*2 - mq*4 - 22q. Differentiate y(g) with respect to g. -57g2 Let v(m) be the first derivative of -111/5m*5 + 0m*3 - 57m - 9 + 0m2 + 0m*4. What is the first derivative of v(l) wrt l? -444l*3 Let x(v) be the first derivative of -2v*6/3 - 3v5/5 - v4/4 + 2v3/3 + 3v*2/2 + 312v - 3434. What is the third derivative of x(u) wrt u? -240u2 - 72u - 6 Let c(p) = -354p3 + 1847p. Let v(t) = 351t3 - 1846t. Let r(g) = 6c(g) + 5v(g). Find the second derivative of r(q) wrt q. -2214q Let q(t) = -2235t*2 + 407t - 3. Let y(l) = -6707l2 + 1221l - 10. Let c(z) = -7q(z) + 2y(z). Find the second derivative of c(b) wrt b. 4462 Let t(q) = -q + 4. Let w be t(9). Let m be (24/(-30))/(2/w). Find the second derivative of -2c2 + 2c*2 - c - mc*3 - 16c*3 wrt c. -108c Let t(x) = -x. Let z(n) = 1250n - 1102. Let w(u) = -4t(u) - z(u). Find the first derivative of w(l) wrt l. -1246 Let g(n) = -8525n2 - 294n + 4953. Let j(w) = 8527w2 + 196w - 4953. Let z(y) = -2g(y) - 3j(y). Differentiate z(b) with respect to b. -17062b Suppose -p - o + 3o = -6, -17 = -3p + 5o. Suppose 5r = -4i + 2i + 86, r - pi = 26. What is the third derivative of 676 + 21c2 - 676 + rc*3 wrt c? 108 What is the first derivative of 3124g*3 - 5889 + 7605g*3 - 3589g*3 wrt g? 21420g**2 Let y(z) =	{ "pile_set_name": "DM Mathematics" }
hen 182 is divided by x(12). 27 Suppose 0 = 9m - 49 - 509. Suppose 0 = -6y + 2y + 20. Let h(n) = n + 11. What is the remainder when m is divided by h(y)? 14 Suppose 10 + 2 = -4q - 4v, 5q + 3v = -5. Suppose 5u - 120 = -0w - 3w, -qu = -w + 51. Calculate the remainder when w is divided by 12. 9 Calculate the remainder when 65/20 + 3 - (-7)/(-28) is divided by 4. 2 Let g(s) = -2s3 + s2 - 8s - 11. Let m(f) = 3f3 - f2 + 16f + 21. Let y(v) = 5g(v) + 3m(v). What is the remainder when y(-4) is divided by 25? 22 Calculate the remainder when 119 is divided by -2 - 320/(-12) - (-1)/3. 19 Let d = 1077 + -966. Calculate the remainder when d is divided by 19. 16 Suppose 12i = 2625 - 1041. Let f(g) = 3g3 + g2 - 1. What is the remainder when i is divided by f(2)? 24 Let u = -6031 + 6078. Let a be 0 - 7(-5 + -2). Suppose 5q - 169 = -a. What is the remainder when u is divided by q? 23 Suppose -2r - r = -216. Calculate the remainder when r is divided by (-38)/(3/3)2/(-4). 15 Calculate the remainder when ((-80)/(-4))/4 + 252 + -16 is divided by 63. 52 Let d = -6 - 110. Let f(s) = -7s + 178. What is the remainder when 6/(-4)d/6 is divided by f(24)? 9 Suppose -4h - 18 = -262. Calculate the remainder when 78 is divided by h. 17 Let f(d) = -8d - 4. Let j be f(3). Let a = 22 + -37. Let g = a - j. Calculate the remainder when 75 is divided by g. 10 Suppose 40 = -2q + 3z + 150, -260 = -4q - 4z. What is the remainder when 191 is divided by q? 8 Let t be (15 - 3)/3 - 0. Suppose tf = 20, 60 + 78 = -3l + 3f. Let y = -19 - l. Calculate the remainder when 41 is divided by y. 19 Let d = -2 - -8. Suppose -m = 3 - 30. What is the remainder when m is divided by d/(-24) + (-122)/(-8)? 12 Let a(p) = -p - 9. Let v be a(-12). Suppose -vg + z = -142, -46 = -2g + 3z + 37. Calculate the remainder when g is divided by 25. 24 Let d(t) = -t + 84. Let z be d(28). Suppose zw = 53w + 180. What is the remainder when 297 is divided by w? 57 Let s(g) = g - 7. Let z be s(6). Let h(q) = -q2 - 13q + 1. Let c be h(-13). Calculate the remainder when 31 is divided by c + z + 1 + 15. 15 Suppose 0 = -5s + 20, 2x - 3s + 112 = 6x. Calculate the remainder when x is divided by 7. 4 Suppose -j = -2g - g - 561, 3j = 4g + 1683. Suppose j = 5t + 196. Suppose -2i + i = -t. Calculate the remainder when i is divided by 19. 16 Calculate the remainder when 132 is divided by 8/(-12)((-1410)/20)/1. 38 Calculate the remainder when 533 is divided by (-19 - -20)/((-4)/(-308)). 71 Suppose -2v + 67 = -5s, -v + s + 125 = 3v. Let q = 8 + 3. Calculate the remainder when v is divided by q. 9 Suppose 0 = -0b - 12b + 504. Suppose -47k = -bk - 65. What is the remainder when 50 is divided by k? 11 Calculate the remainder when ((-2106)/(-30) + -9)/((-2)/(-5)) is divided by 7. 6 Let a = 30 + -29. What is the remainder when 13 is divided by (-8)/(-3) + a/3? 1 Suppose 339a - 578 = 338a. Calculate the remainder when a is divided by 59. 47 Suppose x + 4h = 3x - 24, 0 = 5h + 20. Suppose -4u = b - 16, xb = -3u - u + 76. What is the remainder when 38 is divided by b? 18 What is the remainder when 1212/6((165/(-10))/11)/(-3) is divided by 34(0 + 1 + 0)? 33 Let b(z) = -2z - 7. Let p be b(-4). Suppose -3i - 2 - p = 2g, -5g = -i - 18. Calculate the remainder when g is divided by 2. 1 Let o(k) = 7k*2 + 9k - 7. What is the remainder when 43 is divided by o(1)? 7 Suppose -7o = -8o + 3. Suppose -2y = oz - 154, -4y + 3 = -7y. What is the remainder when z is divided by (-2)/(-8) - (-71)/4? 16 Suppose 3k + 45 = 5k + j, -25 = 5j. Calculate the remainder when 139 is divided by k. 14 Let s(l) = 11l*2 - 18l + 13. What is the remainder when s(-6) is divided by 104? 101 Suppose -4u + 249 = -2q + u, 2q + u + 243 = 0. Calculate the remainder when (-13)/52 - q/8 is divided by 4. 3 Let s(a) = -a2 - 9a - 10. Let h = -12 - -28. What is the remainder when h is divided by s(-4)? 6 Let j = 1 - -26. Suppose 0 = 4s - 16, 3a - s - s = 7. Suppose 36 = ay + m, 4y - 5m + 11 = 34. What is the remainder when j is divided by y? 6 Suppose 8 + 24 = 4q. Let n = 16 - q. Let l = 43 - n. Calculate the remainder when l is divided by 12. 11 Suppose -v - 2m + 39 = 0, -66 = -4v - m + 83. Calculate the remainder when v is divided by (20/(-30))/((-4)/78). 11 Suppose -5s = -s - 2h - 218, -4s = h - 233. What is the remainder when 214 is divided by s? 43 Let m = -20 - -76. Let v(f) = f3 - 6f*2 + 8f. What is the remainder when m is divided by v(5)? 11 Let m = -1544 - -1612. Suppose j + 2z + 3z - 19 = 0, 5j - 2z - 68 = 0. Calculate the remainder when m is divided by j. 12 Let r(t) = -t*3 + 6t*2 + 6t + 9. Suppose -v + 2v = 3. Suppose 2q + v = 3q + 2g, -4q + 20 = 4g. What is the remainder when 5 is divided by r(q)? 1 Let p(n) = 5n - 13. Calculate the remainder when 83 is divided by p(5). 11 Suppose 11q = -1007 + 2998. Calculate the remainder when q is divided by 53. 22 Let g = -24 - -25. Let n(q) = q + 13. Let z be n(-10). Suppose -16 = -4a + 2v, -a = -zv - v - 11. Calculate the remainder when a is divided by g. 0 Let v(b) = -b2 - 3b + 2. Calculate the remainder when 9 + ((-12)/(-4))/3 is divided by v(-2). 2 Let v = -1974 - -2019. What is the remainder when 264 is divided by v? 39 Let g = 518 - 367. Calculate the remainder when g is divided by 13. 8 Let c = 625 - 571. What is the remainder when c is divided by 5? 4 Suppose -112s + 475 = -107s. Calculate the remainder when s is divided by 29. 8 Suppose 224 = 20j - 256. Suppose 0 = 5r + 3t - 47, 4r - 4 - 12 = 3t. What is the remainder when j is divided by r? 3 Let f be 154(-5)/(-10). Suppose 0 = 3l - 5z - 34, -2l - 3z - 4 = -z. Suppose 0d = -ld + f. Calculate the remainder when 15 is divided by d. 6 Suppose h = 14 - 1. What is the remainder when (-4)/(-14) - (-4460)/70 is divided by h? 12 Suppose -16o + 44 = -12o + 4v, -o + 20 = 4v. Calculate the remainder when 414 is divided by o. 6 Let r = 2 + 8. What is the remainder when 4/r + 452/20 is divided by (18/7)/(12/56)? 11 Suppose -16t - 2t + 2052 = 0. Calculate the remainder when t is divided by 21. 9 Let z(i) = i2 + 10i - 33. Suppose r + 4r + 5c = 440, 5r + 2c = 446. Calculate the remainder when r is divided by z(-14). 21 Let t be (-1)/(-1 + (-204)/(-207)). Suppose 4x = 55 + t. Calculate the remainder when x is divided by 4. 3 Suppose 17u - 14u = 21. Calculate the remainder when u/(-42) + 254/12 is divided by 8. 5 Let f(o) be the first derivative of o4/4 + 13o3/3 - o2/2 + 6o - 5. Let m = -22 + 9. What is the remainder when 55 is divided by f(m)? 17 Suppose 0 = -2g + 26 - 6. Let m(a) be the third derivative of a5/60 - a4/8 + 19a3/6 + 16a*2. Calculate the remainder when m(0) is divided by g. 9 Let v = -13 - -37. Let t(l) be the first derivative of -3l*2 - 23l + 32. Calculate the remainder when v is divided by t(-6). 11 Suppose m + 2l - 10 = 0, -4l = l - 5. Suppose 0 = -9h + 4h - 3r + 231, 0 = -h + r + 43. What is the remainder when h is divided by m4/(-6)-3? 13 Suppose 21g + 900 = 27g. What is the remainder when g is divided by 14? 10 Suppose 6g - 4g = -38. Let c = g + 37. Suppose 66 = -3n + 171. Calculate the remainder when n is divided by c. 17 Let u(k) = k*3 - 38k*2 + 86k + 142. What is the remainder when u(36) is divided by 81? 79 Suppose 5i - 7 = -2o - 1, 5i = 0. What is the remainder when 20 is divided by 6 - 2 - (-4 - o)? 9 Suppose 12 = -2b + 8. Let l(v) = v - 1. Let h(d) = 8d + 2. Let p(i) = -h(i) + l(i). Calculate the remainder when p(b) is divided by 4. 3 Suppose 5f - 25 = 0, 2w = -2w - f + 17. Let q(l) = 13l + 1. Calculate the remainder when 79 is divided by q(w). 39 Suppose 2h - 4h + 22 = 0. Let v be (3/2)/(10/20). Suppose x - 89 = -vy, x - 42 = -2y + 17. What is the remainder when y is divided by h? 8 Suppose -f - 10 - 90 = 0. Let z = 113 + f. What is the remainder when 61 is divided by z? 9 Let a = -473 + 888. Calculate the remainder when a is divided by 104. 103 Suppose -104 = 2m + 2m. Let u = m + 79. Calculate the remainder when u is divided by 14. 11 Suppose 343 = 13r + 122. What is the remainder when r is divided by 3? 2 Let m = 139 + -129. What is the	{ "pile_set_name": "DM Mathematics" }
ond derivative of -4a4 + 4a*2f*3 - 3a*2 - 7a + 3f3 wrt a? -48a*2 + 8f*3 - 6 Differentiate 23b*3 + 733 wrt b. 69b*2 Find the third derivative of 413c*6x*3 - 2c*6 + 3c*2x + 6cx*3 wrt c. 49560c*3x*3 - 240c*3 Find the third derivative of 3n*5q - 282n3q - 3n2q + n*2 - 223q wrt n. 180n2q - 1692q Find the third derivative of 608g*4i + 2g3 - g2i + 193g2 wrt g. 14592gi + 12 Find the second derivative of 1009w*5 + 33054w. 20180w3 Find the second derivative of 3al3ot - al*3o + al2ot + 6al + 2at - 18lo - 2ot wrt l. 18alot - 6alo + 2aot What is the first derivative of 379w*4 + 95 wrt w? 1516w*3 Find the second derivative of -672n5 + n2 - n + 42 wrt n. -13440n3 + 2 Find the third derivative of 490y*3 - 642y*2 wrt y. 2940 Differentiate 4a*2bcx + 6a2bx + 2a*2cx + 2a*2c - 75a2x + 2bc with respect to b. 4a2cx + 6a*2x + 2c What is the derivative of -2644hx3 - 6320x*3 wrt h? -2644x*3 Find the first derivative of -2183o + 4318. -2183 Differentiate 4i2m*4 - 12i*2m*2 - 27i*2 - 1 wrt m. 16i*2m*3 - 24i*2m What is the third derivative of 203s6 + 321s*2? 24360s*3 Find the second derivative of 2a*2p*2 - 12a*2p + 12ap - 12p2 wrt a. 4p*2 - 24p What is the second derivative of 3v4 + v3 - 3v - 82 wrt v? 36v2 + 6v Find the second derivative of 3c5 - 5691c*3 - 1830c wrt c. 60c3 - 34146c Find the third derivative of 6kp*5 - 7kp - 13p*3 - 5p*2 - 2p wrt p. 360kp*2 - 78 What is the third derivative of -8l*6 - 703l*5 + 6l*2 - 483l? -960l3 - 42180l2 What is the derivative of -f3q - 1155f*3 + 734f*2q wrt q? -f*3 + 734f*2 Differentiate 13912x*3 - 2x*2 + 21794. 41736x*2 - 4x What is the second derivative of -9i2j*3 + 223i*2j + 67ij*3 - 26ij wrt j? -54i*2j + 402ij What is the first derivative of -1906u4 + 1969? -7624u*3 Find the second derivative of 1631o*3 + 9o + 7 wrt o. 9786o Find the second derivative of -325c*2y*3 - 263cy3 wrt c. -650y*3 Find the second derivative of -1584j*2w*2 + 26j*2 + 6jw2 - 230jw wrt w. -3168j*2 + 12j Find the second derivative of 6g4 + g3j3 + g2j2 + 164gj3 wrt g. 72g*2 + 6gj3 + 2j*2 Differentiate 297mt4 + 2mt3u - 184mu with respect to t. 1188mt*3 + 6mt2u What is the first derivative of -2fjtu - 7fj - fu - 2jt + ju - j + 16tu - t wrt t? -2fju - 2j + 16u - 1 Differentiate -6a*2 - 18a + 386 wrt a. -12a - 18 Differentiate -416u*2 - 105. -832u What is the third derivative of 8728w3 + 901w*2 + 2w wrt w? 52368 What is the third derivative of 136j6 + 83j*2 + 6j wrt j? 16320j3 What is the second derivative of -qx*5 - 65qx - 197x*5 - x wrt x? -20qx3 - 3940x*3 Find the second derivative of 2j*4 - 800j*2 + 113j + 2. 24j2 - 1600 Find the third derivative of -1784s*3v3 - s3v - 1068sv2 wrt v. -10704s3 What is the third derivative of -f5z + 1161f*3z*2 - 289f*2 + 3z*2 wrt f? -60f*2z + 6966z2 Find the second derivative of 11b*5y - 3b4y2 - b2 + 2by*2 - 117y*2 wrt b. 220b*3y - 36b2y2 - 2 Find the third derivative of -t5 - 2t4 + 30t*3 - 14t*2 - 3t + 14 wrt t. -60t2 - 48t + 180 Find the second derivative of 155v5 + 3v - 6. 3100v3 Find the third derivative of -1065h*4 + 86h*2 wrt h. -25560h Find the second derivative of -6h3 + 6h*2 - 380h wrt h. -36h + 12 Find the third derivative of 5f*3y*3 + 2f*3y*2 + 11f*3y - 61f2y*3 - 9f*2y*2 wrt y. 30f*3 - 366f*2 Find the third derivative of -24334k*3 - 13524k*2. -146004 Find the second derivative of 492a*4 - 72a - 19 wrt a. 5904a2 What is the first derivative of 5d*4 + 251d*2 + 2d + 22639? 20d3 + 502d + 2 What is the second derivative of 10051a2 + 4239a? 20102 What is the second derivative of 86b2o - 839bo + 2o + 3 wrt b? 172o What is the third derivative of -10k5 + 5k3 + k2 - 9k? -600k*2 + 30 Find the third derivative of 21bgs*3z - 4bgs2 + 35bgsz3 + 2bgsz2 - 10bs3z*3 + bsz2 wrt z. 210bgs - 60bs*3 What is the second derivative of 14s*5 + 13s*3v - sv - 86v wrt s? 280s3 + 78sv What is the second derivative of 28r*4 + 136r wrt r? 336r2 Differentiate -346t + 1387 with respect to t. -346 Find the third derivative of -6j2n*3v - 2j2n*2v*2 - 33jn2v*2 + 2jnv3 - n3v3 wrt n. -36j*2v - 6v3 What is the third derivative of -4i*6z*2 - 169i*4z*2 + 1300i*2z*2 wrt i? -480i*3z*2 - 4056iz2 What is the third derivative of 3j*3w*3 - 2j*3w*2 - 3j*3wx - 2j*2mw - mw*3x - 12mw*3 - 5mwx + 4w2x wrt w? 18j3 - 6mx - 72m What is the second derivative of 2k3w + 6k3 + 56k*2w + 126kw - 10 wrt k? 12kw + 36k + 112w What is the third derivative of 4572a5 - 2a*2 + 10a - 216? 274320a2 Differentiate -5i*4 - 54i*2 + 186 with respect to i. -20i*3 - 108i What is the third derivative of 18l6 + 12l*3 - 277l*2 - l + 2 wrt l? 2160l*3 + 72 What is the third derivative of -13h*6s*2 - 3h*4s*3 - 110h*2s*2 + 2hs3 wrt h? -1560h*3s*2 - 72hs3 Find the second derivative of -3954p*2 - 4190p. -7908 Find the second derivative of -35aw*2z - 2372awz - 11w*2z wrt w. -70az - 22z Differentiate -44l*2 - 26l - 8655 with respect to l. -88l - 26 What is the third derivative of 7k*3w3 + k3w2 - 12k*3 + 5kw4 + kw*2 + 3w*3 wrt w? 42k*3 + 120kw + 18 Find the third derivative of -3931h*6 + 1727h*2 wrt h. -471720h*3 Differentiate 16m*2r*3 + 4mr3 + 2mr + 453r*3 wrt m. 32mr3 + 4r*3 + 2r Find the second derivative of 161j3o3 - j2o3 - 10jo3 + 5jo + 3o*3 wrt j. 966jo3 - 2o*3 Find the second derivative of 87b*5j - 5b4s*3 + 2bjs*3 + bjs - 21bs3 - 2bs + 65js2 wrt b. 1740b*3j - 60b2s*3 Find the first derivative of lw*2 - 293lw - 3l + 2w2 - 893 wrt w. 2lw - 293l + 4w Differentiate 226f + 14 with respect to f. 226 Find the third derivative of 3361dr*6 - dr*2 + 677r*2 wrt r. 403320dr3 Find the third derivative of -297fh6 - fh*3 - 2fh - 61f + 2h6 + h2 wrt h. -35640fh3 - 6f + 240h3 What is the third derivative of 324g*3y*3 - 2g*3y - 73gy*2 wrt y? 1944g*3 Find the third derivative of 9535w3 - w2 + 893w - 4. 57210 Differentiate 57q*3x2 - q3x + 1773q*3 + 16q*2x with respect to x. 114q3x - q*3 + 16q*2 What is the first derivative of -138k - 332 wrt k? -138 Differentiate -p*2 + 11p - 777 wrt p. -2p + 11 What is the third derivative of 13k*4s*2 + 34k4 + k3 + 21k2s2 - k2s - ks - 10s wrt k? 312ks2 + 816k + 6 Find the second derivative of -188d3q*2s*2 + 20d*3qs2 + d3s*3 + dq*2s*3 - 2qs3 + 2qs2 wrt q. -376d*3s*2 + 2ds3 What is the first derivative of 8j*3 + 63j - 424? 24j2 + 63 Find the first derivative of 885a*2 - 320 wrt a. 1770a Find the first derivative of 448m2 - 1153 wrt m. 896m What is the second derivative of -69d2g*2v - 9d2v + 2dgv - dg wrt g? -138d2v Find the third derivative of 2h2o*4 - 3h*2o*3 + 20h*2o*2 + 4h*2 - ho*2 - 90o*4 wrt o. 48h*2o - 18h2 - 2160o What is the third derivative of -9c4f - 127c3f*3 - 2c*3f*2 - 114c*2 + 4cf3 wrt c? -216cf - 762f*3 - 12f*2 Find the third derivative of 2f*5 + 662f*4 + 651f*2 wrt f. 120f*2 + 15888f What is the third derivative of -8086c3x - 151c2x + 6c2 wrt c? -48516x Find the second derivative of 11y5 - 18y - 7. 220y3 Find the first derivative of 14561c + 6409. 14561 What is the derivative of 45nx + 2n - 48x wrt n? 45x + 2 What is the third derivative of 2b*3gx3 - b3gx2 - 1162b*3g - 2b3x*3 + 2bx2 + 329gx3 wrt x? 12b*3g - 12b3 + 1974g Find the second derivative of -2q3 + 74q*2 + 207q wrt	{ "pile_set_name": "DM Mathematics" }
8, -504, -45, -0.5? -0.5 What is the closest to 0.01 in 4, 2/11, -0.3, 20, -2/9? 2/11 What is the closest to -15/2 in -238, 1, 1/3? 1/3 What is the closest to -1/5 in 0.3, -5, -3, 1/9, 1? 1/9 What is the closest to -0.055 in -1/3, -2/9, -5, -0.8, -0.06? -0.06 What is the nearest to 0.12 in 10, -5, -69? -5 Which is the closest to -1? (a) 0 (b) 184 (c) 0.2 a What is the closest to -0.32 in 0.9, 0.06, -2/173, -3/2? -2/173 What is the closest to 0.1 in 0.9, 0.14, -492? 0.14 Which is the nearest to 32? (a) 0.04 (b) -4 (c) -0.2 (d) -295 a What is the nearest to -0.1 in 2/5, 1.217, -0.01, 3? -0.01 What is the closest to 1046 in -103, 0.2, -1? 0.2 What is the nearest to -0.4 in 0.13, -5, -2.8, 0.07? 0.07 Which is the nearest to -3151? (a) 0.3 (b) 0.1 (c) 3 b What is the nearest to 0 in -63, -2, 1, 1/12, -3? 1/12 What is the closest to -2/3 in -11/91, -4/5, -5? -4/5 Which is the closest to -0.08? (a) 91 (b) 0.2 (c) -0.4 (d) 0 d Which is the nearest to 1/2? (a) -1 (b) -256 (c) 3/5 (d) -0.14 c Which is the nearest to -0.3? (a) -1.8 (b) -3/2 (c) 1/13 (d) 0 (e) 1/11 d What is the closest to -2/9 in 2, -5, -6/5, 6? -6/5 What is the closest to -7 in 3/7, 2/7, 1.5, 2, 4? 2/7 Which is the nearest to -0.1? (a) 0.3 (b) 5 (c) -2 (d) -0.8522 a What is the nearest to -3/4 in 0, -1041, 9? 0 Which is the nearest to 0.4? (a) -59 (b) 5/6 (c) 3 (d) -0.6 b Which is the nearest to -2/5? (a) 0.3 (b) -2/13 (c) 36/25 b Which is the closest to 1/5? (a) 19.04 (b) 4 (c) 0.3 c What is the nearest to 2/11 in 0, 10.822, -0.4? 0 What is the nearest to 73/4 in -3/7, -2, -42, 5, 0.3? 5 What is the nearest to -0.1 in -1.3, -14, -3010, 3, 1/3? 1/3 What is the closest to -0.06 in 0.3, -4/47, -0.1, -0.2, 2/17? -4/47 Which is the nearest to 1? (a) 8 (b) 4/9 (c) 2.24 b Which is the closest to 2/17? (a) -7 (b) 563 (c) 2/3 (d) -1/3 d Which is the nearest to -1? (a) -2987 (b) -4 (c) -3 (d) 0.8 d Which is the nearest to 0.2? (a) 0.04 (b) 1.2 (c) -0.2 (d) -5 (e) -1/4 a What is the closest to 1/2 in 1, 1/645, -0.3? 1/645 What is the nearest to 0.3 in -2/21, 5.6, 4, -7, -9? -2/21 Which is the closest to 0.1? (a) -4 (b) 3 (c) -6 (d) 1 (e) 0.82 e Which is the closest to -7950? (a) 0 (b) -0.4 (c) 7 b What is the closest to -1/16 in -1.6, -5, -13? -1.6 Which is the closest to -1? (a) -37/39 (b) 7/4 (c) -0.2 (d) 3 a What is the closest to -1/3 in 0.5, -4, -2/3, 265.89? -2/3 Which is the nearest to -1/24? (a) 1 (b) 0.2 (c) 19/5 (d) 2 b Which is the closest to 1/3? (a) -13 (b) 0.5 (c) -319 (d) 5 b Which is the nearest to -47? (a) 1 (b) 2/19 (c) 421 b Which is the closest to 0.1? (a) 0.4 (b) 0.5 (c) 1/48 c What is the nearest to -4/3 in -0.17, -1.3, 1, 0.3? -1.3 Which is the nearest to 19? (a) 0.1 (b) -0.9 (c) 15 c Which is the closest to 3/8? (a) 3 (b) 0 (c) -1032 (d) -2/3 b What is the closest to -1 in -0.4, -5/4, -3, 88, -1/6? -5/4 Which is the closest to -0.058? (a) 9 (b) -1 (c) -3/65 c What is the nearest to -48 in 0.95, -2, 1/4? -2 Which is the closest to 878? (a) -0.3 (b) -4/7 (c) 5 c What is the nearest to 1.3 in -45, -1/8, -0.23? -1/8 What is the nearest to -0.12 in -0.4, 2043, 4, 1/2? -0.4 Which is the closest to -2/3? (a) -1.6 (b) -565 (c) 2 a Which is the closest to 8/5? (a) 0 (b) -1/4 (c) 0.5 (d) -5 (e) 0.3 c Which is the closest to -1? (a) -3/4 (b) 643.7 (c) -0.1 a Which is the nearest to -1? (a) -6 (b) -1 (c) -5 (d) -4 (e) -3156 b Which is the closest to 3/58? (a) -2 (b) 0 (c) 12 b Which is the nearest to -4/9? (a) 0.5 (b) -1/5 (c) 0.113 (d) 0.4 (e) -7/2 b Which is the closest to -0.5? (a) 878 (b) 5 (c) -4/7 c Which is the closest to -1/350? (a) 3 (b) 3/5 (c) 2 (d) -0.05 d What is the closest to 188 in -0.4, 3, 1.8, 0? 3 Which is the nearest to 0.5? (a) 3 (b) -0.7 (c) -0.064 c Which is the nearest to -169? (a) 5 (b) -2 (c) -0.5 (d) -18 d Which is the closest to -3? (a) -0.5 (b) 3 (c) -28575 (d) 0.4 a What is the nearest to 2344 in 0, 3, -1/5? 3 Which is the nearest to 16? (a) -0.02 (b) 0 (c) 2/7 (d) 1 d Which is the nearest to -4? (a) -3 (b) 5 (c) -0.005 (d) -0.4 (e) 1/6 a Which is the closest to 0.1? (a) -19.5 (b) 10 (c) 0 (d) 13 c Which is the nearest to 0.2? (a) -20 (b) -0.1 (c) 4 (d) -149 b What is the nearest to 1/19 in -8/5, -2/7, 1, 1/6, -2/43? -2/43 What is the closest to 0 in -5, 4, -2, 1/59? 1/59 Which is the nearest to -1? (a) -3 (b) -1/32 (c) -3/7 (d) 2 (e) 281 c What is the closest to 7 in -5, -2/9, -1/13, 13, 4/5? 13 Which is the closest to 0.1? (a) 4 (b) 2/3 (c) -1/48 (d) -5 c What is the closest to -1/7 in -0.02, 0.984, -0.3, -2, 0? -0.02 What is the closest to -1/3 in 0.1, 4, 3, -0.08, -2599? -0.08 Which is the closest to -33.8? (a) -5 (b) -2 (c) -0.06 (d) -3/2 a What is the nearest to -3 in 2, 1/6, 55/2, 8/3, -0.5? -0.5 Which is the closest to 0.2? (a) 2/11 (b) 3/2 (c) -5 (d) 27 a Which is the closest to -2? (a) -14 (b) -2/13 (c) -0.02 (d) -1.4 (e) -2 e What is the nearest to -1/7 in 0.4, -0.3, 5.8, -1.8, 1? -0.3 Which is the closest to 0.05? (a) 28/3 (b) 0 (c) -288 (d) 0.2 b Which is the closest to -6/95? (a) 4 (b) -0.5 (c) 0.5 b What is the nearest to -2/5 in 46, 3, -106? 3 Which is the closest to 1.5? (a) 2/3 (b) 2/5 (c) 3/5 (d) -0.2 (e) 4 a What is the closest to 0.8 in -3, 0.08, -2/3, 338? 0.08 Which is the closest to 5460? (a) 0.2 (b) -1/14 (c) -3 a Which is the closest to -2/3? (a) -0.5 (b) 2/9 (c) -5 (d) -21 (e) -9 a What is the closest to -5/32 in 1, -96, -2? 1 Which is the closest to 84.5? (a) -0.5 (b) 0.2 (c) 1/7 (d) 4 (e) -2 d Which is the nearest to -2/9? (a) -0.2 (b) -8.6 (c) -1/30 (d) -2 a What is the closest to 0.1 in -4/7, -17/28, 0.2, -3, 31? 0.2 What is the closest to -15/8 in -273, 5, 0.05? 0.05 What is the nearest to 18 in 2, -8/5, -5/19? 2 What is the nearest to 160 in -0.2, -3, -0.055? -0.055 What is the nearest to 2/7 in 5, -0.4, 11872? -0.4 Which is the closest to 1? (a) 0.3 (b) -372/127 (c) -0.3 a Which is the closest to 6? (a) -2 (b) -0.1 (c) 2/59 c Which is the closest to -0.06? (a) 1 (b) 0 (c) -2 b What is the nearest to 0.1 in -41738, 1/4, -7? 1/4 Which is the nearest to -0.1? (a) -34 (b) -1750 (c) -0.5 (d) 5 c What is the nearest to -0.1 in 0.1, 2/25, -1/9, -8/3? -1/9 What is the closest to 0.1 in 3/2, -2/5, -11739, 1/3? 1/3 Which is the nearest to -2/19? (a) 44 (b) 73 (c) -2/19 (d) 0.3 c Which is the nearest to 2/285? (a) 1 (b) -4 (c) -2/7 (d) -5 (e) -1.1 c What is the closest to -6 in -0.211, 1/4, 1/16? -0.211 Which is the nearest to 0.1? (a) -2 (b) -4 (c) -14 (d) 3/29 d What is the nearest to -1/2 in 3, -2/101, 3/5, -262, -0.1? -0.1 What is the nearest to 38 in 1, -16, -2, -1/14, 3? 3 Which is the closest to 15? (a) -1 (b) -2/5 (c) -2 (d) -7 (e) -0.1 e What is the closest to 1 in -11/2, 61, -4, 0, -0.4? 0 Which is the closest to 3? (a) 4/13 (b) 5 (c) -3 (d) 4/5 (e) -139 b Which is the closest to 1489/4? (a) -2/5 (b) -4 (c) -1/14 c Which is the closest to 1/9? (a) 0.4 (b) 4/7 (c) 1 (d) -6/499 d Which is the nearest to -1? (a) -30 (b) 0.2 (c) -872 (d) -1 d Which is the nearest to -2/21? (a) 1/4 (b) 7/6 (c) -3/4 (d) -1 (e) 0.18 e Which is the closest to -2/9? (a) -2 (b) 1/5 (c) -2970 b Which is the nearest to 0.5? (a) -0.1 (b) 2/5 (c) -4 (d) -5/254 (e) 0 b Which is the closest to 9293? (a) 0 (b) 1/10 (c) -0.5 (d) -0.7 b Which is the closest to 78? (a) 0.5 (b) -402/7 (c) -3 a What is the closest to -0.1 in 1/3, 0.2, 2/193? 2/193 What is the closest to 1 in 2/59, 5, 88? 2/59 Which is the nearest to 1? (a) -16 (b) 10/7 (c) -4/3 (d) 9 b Which is the nearest to -0.1? (a) -31 (b) -5.7 (c) -1/3 (d) 2/13 c What is the closest to 0.04 in -2/25, -3/4, -0.1, -8.4? -2/25 Which is the closest to -1? (a) -1 (b) 0.5 (c) 52 (d) 5 (e) -9 a What is the nearest to -0.1 in -3, 6, -3/7, -2/43? -2/43 What is the closest to 2/3 in 1/7, 3/1048, -5, -0.4? 1/7 Which is the nearest to -2/5? (a) 2 (b) 2/3 (c) 9.9 (d) -7 b What is the nearest to 2/11 in 8, -0.3, -34/3, 0? 0 What is the closest to 1 in -3.7, -0.0729, -11? -0.0729 Which is the nearest to -27.77? (a) -4 (b) 3 (c) 0.3	{ "pile_set_name": "DM Mathematics" }
. Let p be d(-6). Let t = -35 - p. Is 3 + (-172)/8t a composite number? True Let z(f) = f3 + 187. Suppose 4b + 4b = 3b. Is z(b) prime? False Let a(r) = -r*3 + 7r*2 + 3r - 8. Let g be a(7). Let w = -11 + g. Suppose -3d + wq = -0d - 1395, -5d + q + 2332 = 0. Is d prime? True Suppose -k = 4w - 317, -k = 2k - w - 1016. Let b(a) = -a*3 + 18a*2 + 12a + 7. Let t be b(19). Let n = k + t. Is n a prime number? True Let v(t) = -t*2 - 10t + 16. Let p be v(-11). Suppose 0 = -pf + 51 - 6. Is 3/f795/1 composite? True Let a(n) = -19n3 - 16n + 19. Let q(l) = -13l3 - 11l + 13. Let z(b) = -5a(b) + 7q(b). Suppose -5 - 7 = -4i. Is z(i) composite? False Let v = 4833 - -5146. Is v composite? True Let m(l) = 28l*2 - 7l + 1. Let o(q) = -q*2 + 10q + 6. Let b be o(10). Is m(b) composite? False Let q(z) = -76z3 + 22z*2 + 13z + 15. Is q(-8) a prime number? True Let p = -5 - -10. Suppose -pl + 2227 = -4j, 2l - 486 = j + 403. Is l a prime number? True Let a be -124 - (-1 - (1 - 2)). Let p be 1 + 0 - (2 - -346). Let v = a - p. Is v prime? True Suppose -5h - 3852 = -5b + 4368, 0 = -3b + 4h + 4934. Is b a composite number? True Suppose 2r - 24463 = -5y, -20y - 2r - 9774 = -22y. Is y a composite number? True Let m = -302 + 428. Suppose 5u + 89 = -2q, 2q + q + 99 = 4u. Let z = q + m. Is z composite? False Let l(f) be the third derivative of f9/30240 + f8/6720 + f7/2520 + f6/240 + f5/20 - f2. Let w(n) be the third derivative of l(n). Is w(4) composite? True Let x = -8282 + 56781. Is x prime? False Let v(g) = -g + 6. Let u be v(2). Suppose -5d - 2z + 3z + 938 = 0, 0 = -d + uz + 199. Is d composite? True Suppose -873t + 867t + 463674 = 0. Is t a composite number? False Suppose -25 = -5g, -3z - 3g = -25 - 11. Let l(x) = 7x*3 + 3x*2 + 9x - 6. Is l(z) a prime number? False Let c = -539 + 3060. Is c composite? False Let y = -14 + 19. Let f be y/(-10) - 278/(-4). Let a = f + -46. Is a prime? True Suppose 5i - 15 = 0, -72i + 68i - 10424 = -4u. Is u prime? True Let b = 9456 - 577. Is b prime? False Let x = -72 - 21. Is ((-33)/(-6))/1(1 - x) a composite number? True Is 4 + 6670/((-100)/(-10)) prime? False Let c be ((-4)/(-5))/((-10)/175). Let f = c - -9. Is (614/f)/((-4)/10) a composite number? False Let a = -5989 - -9263. Is a a prime number? False Let y(f) = -22f - 26. Let g be y(-16). Let o = g - -393. Is o composite? False Let c(r) = -r - 11. Let k be c(16). Let q = k - -112. Is q composite? True Suppose -6n + 330 = -11n. Let l be (26)/((-3)/10). Let j = l - n. Is j a composite number? True Let i(n) = n3 - 13n*2 - 36n - 19. Let h be i(21). Let a = -1888 + h. Is a prime? False Is 82/(-6) - -13 - (-18910)/6 prime? False Let d = -1098 - -403. Let g = -192 - d. Is g a prime number? True Is -3 - (5 - 3) - (-15517 + -17) prime? False Let z(a) = -2a3 - 4a*2 + 4a - 2. Let l be z(2). Let u = -5 + 102. Let p = u - l. Is p composite? True Let j be (40/(-50))/((-4)/10). Suppose 6 = 4f + jf. Let d = 112 + f. Is d composite? False Is 727338/54 - (-2)/18-2 prime? True Let w be 2/6(9 + -15). Is (-2)/(-12) - (23545/(-30) + w) composite? False Let c(m) = 7 + 9 + 21m3 - 12m*2 - 13m*3 - 4m*3 + 11m. Is c(7) prime? True Suppose 0 = 2g - u - 8163, g + 4g + 2u = 20421. Is g a prime number? False Let s be -1 + -2 + 4 + 3. Suppose -4p = -3g + 1596, -sg + 2041 + 87 = p. Is -1 + g/((-6)/(-3)) a prime number? False Suppose -4a = 14 - 26. Is (-394 + -3)(a + -4) a prime number? True Let d = 7455 - 5122. Is d a prime number? True Suppose 951642 = -5q + 59q. Is q a composite number? False Let g = 163 - 402. Let q = 140 + -234. Let x = q - g. Is x composite? True Let u(m) = -m*2 + 4m - 3. Let a(o) = 5o - 4. Let q(v) = 4a(v) - 5u(v). Let s be q(1). Suppose 872 = sf + 4w, -3w - 13 + 4 = 0. Is f a prime number? False Suppose -4 = -4h, -3j - 3h = -0h - 89154. Is j a prime number? True Let o be 0/(0 - (2 + 1)). Suppose o = 3m + m. Suppose -5f + f + 6980 = m. Is f prime? False Let l(q) = q - 5. Let r be l(8). Suppose -rp = -5h + 1561, -p + 2p - h = -521. Let x = 917 + p. Is x a prime number? False Suppose -4m + 115 = -5. Let j = -27 + m. Suppose -jh + 575 = 2h. Is h prime? False Let p = 9 - 22. Let k = -8 - p. Suppose 4n = -kr - 0n + 1177, -5n = 3r - 701. Is r prime? False Let l(z) = 25z - 2. Suppose -3y + 2 = q - 13, y - 13 = -3q. Let o be (2/(-4))/(q/(-30)). Is l(o) a composite number? True Suppose -2n + 399 = n. Let b = n - 82. Is b composite? True Suppose -15t + 2h = -12t - 80277, 0 = 5t - h - 133795. Is t prime? True Let o = -1476 - -2432. Let a = 1851 - o. Is a a prime number? False Suppose 5a - 117 = -8a. Is 3/((-3)/(-293)) - (a + -9) a composite number? False Let z(k) = 225k*2 - 19k - 109. Is z(-9) prime? True Suppose -13f + 113 = -888. Is f composite? True Suppose 0 = -3x - x + 16. Let l(c) = -c*2 + c + 8. Let v be l(x). Is (-2)/(v/(-83))-10 a composite number? True Is (-155970)/(-4) + -7 + 105/14 composite? False Suppose -16n - 3033 = -137785. Is n composite? True Suppose 0 = 46c - 50c + 684. Suppose 2y = 2893 - c. Is y composite? False Suppose -4s + v - 171 = -2196, s = -3v + 490. Is s composite? True Let p(q) = -q*3 + 8q*2 - 6q - 5. Let y be p(7). Is -3y/3 - -39 a composite number? False Let d be 20/(-6)(-42)/35 - 10. Is -9 + 25/3 + (-15802)/d composite? False Suppose -4w - 616 = -8340. Is w composite? False Suppose 289955 = -149c + 154c. Is c a composite number? False Suppose -5z + 0m - 4m = 0, -2z + 4m = 0. Is -5 + 7 - (1 + -222 + z) prime? True Suppose 1855 = 5a - 2z + 4z, -a + 5z = -398. Is a prime? True Let r = -484 - -2205. Is r a composite number? False Let w be (30/2 - 1) + -4. Suppose 6a + 5748 = wa. Is a a composite number? True Suppose l + 962 = -2s + 5s, -6 = 3l. Suppose 0 = -4k + 4b + s, -2k - 5b + 0b = -139. Suppose -2a + k = 3. Is a a composite number? False Let q be (-1389)/(-3) + (-1 - 3). Let a = q + 194. Is a composite? False Let d(k) = -9890k - 127. Is d(-4) a composite number? True Suppose 0 = 2z + 8, 9x - 2z = 6x + 13997. Is x composite? False Let m(t) = 53t2 - 18t + 2. Is m(-6) composite? True Let q(m) = m + 17. Let b(p) = -p - 16. Let t(z) = -6b(z) - 5q(z). Let l be t(-11). Is -3 + 98 + l + 0 prime? False Let f be (-2)/(-11) + 42/11. Suppose -2a + fv = 6v - 638, 0 = 4a - v - 1266. Is a a prime number? True Suppose -10r + 99095 = 23385. Suppose 0 = 7o - 9866 - r. Is o composite? True Let o = -6 + 4. Let g(v) = v - v*2 - 1 + 0v*2 + 0v*2 + 0v - 81v3. Is g(o) a composite number? False Suppose -24298 = -4a + 2m, 4a - 6079 = 3a + 5m. Is a a prime number? False Suppose 0 = 5c + 2t + 67 - 1171, 3c = -2t + 664. Suppose -4b + 3b + 2y = 7, -5y + 37 = 4b. Suppose bx = 47 + c. Is x a prime number? True Suppose 0 = b + 4w - 395, 4b - 3w - 844 - 812 = 0. Is b prime? False Let o be (774/(-12))/((-1)/2). Suppose 3u - 240 - o = 0. Suppose 3n = -5v + 786, 4v - 501 - u = -4n. Is v a composite number? True Let d = 366 - 233. Is d a prime number? False Let q = -2 + 3. Let f = 4 - q. Is (163 - -7)/(f - 1) composite? True Is -7 + (-1 - -2) + 13228 + 37 composite? False Suppose 7i - 14214 = 13849. Is i prime? False Let f = -2520 - -5477. Is f prime? True Suppose 4t - 2t = 154. Let r = t + -19. Is r prime? False Suppose -4q - 7281 = -5q - 5v, 0 = -2v + 8. Is q prime? False Let o(b) = -6b*3 - 3b*2 + 13b - 3. Let p(d) = 11d3 + 7d*2 - 25d + 5. Let k(a) = -7o(a) - 4p(a). Is k(-6) a composite number? False Suppose 4n - 44615 = -5b, 25n = b + 23n - 8923. Is b prime? True Suppose 4a - 2r - 20 = 0, 0 + 34 = 2a + 5r. Suppose 1345 - 204 = ap. Is p a composite number? False Let r = 21 - 10. Suppose -2i - r = -5. Let h(u) = -4u3 - u2 + 3u - 3. Is h(i) a prime number? False Suppose -u + 6 = 8. Is 291/u8/(-12) a prime number? True Let u(r) = -30r + 59. Let w = 8 + -31. Is u(w) prime? False Suppose 1730 = -4x + 3958. Is x prime? True Let y(c) = c2 - 2c + 202. Let s be y(0). Suppose -4u = -z - 359, 0 = 2u + 2z + 2z - s. Is u a prime number? False Let k(b) = b*3 + 3b**2 - 10. Let n be k(-5). Let m be ((-1)/1)/(1/n). Suppose x	{ "pile_set_name": "DM Mathematics" }
(c) 4/7 b Let c = -146.8 + 147. Let a = 49 + -55. Let i be ((-2)/(0 + 6))/((-3)/a). What is the nearest to -0.2 in -1, c, i? c Let k = -6.215 - -6.215. What is the closest to k in -2, -0.1, 4/3? -0.1 Let b = 643 - 643.2. Let x = 32 + -31.9. What is the closest to 0.2 in 0.4, b, x? x Let f be ((-18)/189 - (-109)/42)6/15. Which is the closest to 2/19? (a) 0.34 (b) f (c) -0.2 (d) 0.4 a Suppose -13v - 100 = -3l - 8v, -3v + 24 = l. Suppose -416 = -lo - 116. Which is the nearest to 0? (a) -1/6 (b) -1 (c) o a Let f be -2 + 14/(-8)114/(-399). Which is the closest to 0.1? (a) 2/13 (b) f (c) -0.1 (d) -2/9 a Let s = 64/603 + 1/201. Let a be 238/(-119) + -6((-28)/8 + 3). What is the nearest to -0.1 in 2/7, s, a? s Let c = -3.2478 + -0.7522. What is the closest to -2 in c, 5, -2, 3/5? -2 Let b = 18.81 - 22.71. What is the closest to b in 2/5, -12, -0.5? -0.5 Let a be ((-118)/42 - 2/(-14)) + (-16)/(-24). Let m(i) = 5i. Let n(t) = 6t. Let c(q) = 5m(q) - 4n(q). Let w be c(4). What is the nearest to -1 in a, w, 2/5? a Let t = 147904.1 + -147904. Let s = -5.761 + 0.061. Let g = s - -0.7. Which is the closest to t? (a) -0.1 (b) g (c) 5 a Let k = 47 + -236/5. Suppose 21 = -2w + 45. Let d be ((-54)/w + 2)4/35. Which is the nearest to -1/3? (a) k (b) d (c) -1/3 c Let f = -254/7 - -34. What is the nearest to 0.9 in 0.4, 2/7, f? 0.4 Let k = -452 + 323. Let j = -129.5 - k. Let x be (2/(-11))/2-2. What is the closest to -1 in j, 3/4, x? j Let m = -4263 + 4257. Which is the closest to -2? (a) m (b) -0.2 (c) 14 b Let m = -2.7699 - -2.7299. What is the closest to -2/9 in m, 2/13, 0.5, 2.3? m Let t = 7614 + -7611. Which is the nearest to 0.17? (a) -5 (b) -0.2 (c) t b Let k = 171 - 515/3. Suppose -4x = -2x - 8. Let z be 4 + -2 - 6/x. What is the nearest to k in z, 2/9, -1/9? -1/9 Suppose 2x - 1 - 5 - 2 = 0, 81 = o + 25x. Let j = -3.6 - -4. What is the nearest to -1/2 in 5, o, j? j Let y be ((-12)/(-12))/(35/(-14)). What is the closest to y in -0.5, 2, 1, 29? -0.5 Let h = 185.57 + -3.57. Let k = h + -175. What is the closest to 4 in k, 3, 0.1? 3 Let n = -10970/3 + 3605. Let z = -51 - n. Suppose 0 = 3l - 10l + 7. What is the closest to -1 in l, z, 1/4? 1/4 Let k be 16 - ((-221)/(-34) + 10). What is the closest to -101 in 1/6, k, -22? -22 Let j = -2399.857 + 2397. Let k = -1.285 - -1.428. Let r = j - k. What is the closest to 1 in r, 1, 0.2? 1 Let t = 0.47 - 1.47. Let r(y) be the first derivative of 4y*3/3 - 3. Let s be r(1). What is the nearest to t in 1/6, s, -0.4? -0.4 Let n = 320 - 345.3. Let j = 26 + n. Let w = 0.5 - 1. Which is the closest to j? (a) 5 (b) w (c) 1/4 c Let t be (0 + 2/500)(-5 + 11). Let x = t - 28/125. Which is the closest to 1/4? (a) -4 (b) -28 (c) x c Let z = -11 - -15. Suppose 12 = -29i + 23i. Let p be (-60)/(-15) - (-16)/i. Which is the nearest to z? (a) -2/5 (b) p (c) -1 a Let o = 3453 + -3467. Which is the nearest to -1? (a) -3/4 (b) o (c) -22 a Let h = -7427 + 7435. Which is the nearest to 7? (a) h (b) 1/3 (c) -1/4 a Let u = 19 - 18.74. Let j = 0.76 - u. Let x be -11 - (-472)/24 - 8. Which is the closest to -1? (a) j (b) -6 (c) x a Let n = -1/3720 - 144253/1240. Let k = n - -115. What is the closest to 1 in k, -1.9, -1/13? -1/13 Let c = -0.1368 + -0.3632. What is the closest to 0.2 in -5, 19/4, c? c Let n be (-126)/294 + 6/14. What is the closest to n in 2/13, -4, 39? 2/13 Let j = 7235/2 + -3615. Which is the closest to -0.3? (a) -54 (b) -5 (c) j (d) -3 d Let u = 42 - -135. Let s = u + -173. What is the nearest to -1 in -12, -0.2, s? -0.2 Let l = -0.2149 - 0.0851. Let f = -114 + 71. What is the closest to 1 in l, f, -1? l Let m = -27 - -31. Let f = -20.1 + 20.5. Let v be (6/(-8))/(63/56). Which is the nearest to v? (a) f (b) m (c) 0 c Let z = -1060.65 + 1061. Which is the nearest to 0.1? (a) -2 (b) z (c) -0.2 b Let g be -2 - (-10 - (-2)/1). Suppose g = 5z - 4. Suppose 3w + z = -4. Which is the closest to -1? (a) w (b) 0.1 (c) -1/4 c Suppose -20j + 738 = -18j. Suppose -j = -2v - v. Let k = -859/7 + v. Which is the closest to 1? (a) 0.3 (b) k (c) -1/4 a Let z = -33102 + 33099. What is the closest to 2 in 149, 0.03, 2/9, z? 2/9 Suppose -3p + 5n + 17 = 0, -18 + 2 = 4n. Let c be (4 - 3)p/11. Let j = -2.9108 - 0.0892. What is the closest to 0.4 in -0.4, j, c? c Let f be (-2)/(-5) - (-2)/(-30). Let l be (93/31)/((-2)/(30/(-1))). Let x be -5 - 0 - (-220)/l. What is the closest to f in -4, x, 2? x Suppose -158a - 197 = 277. What is the closest to -1 in a, -1, 3/4, -33? -1 Let i be 19/(-15) + (-2)/6. Suppose 5m = -0m - 10. Let f be (30/(-45) - (-15)/36)-4. Which is the nearest to 0.1? (a) f (b) i (c) m a Let t be 0/(1/(3 + -4)). Suppose -z - 4o + 4 = -3o, 2z - 3o + 7 = t. Which is the nearest to 0.1? (a) 0 (b) z (c) -5 a Let l = 5431 + -5431. What is the nearest to l in 0.1, -1205, 3? 0.1 Let l = -5954 + 5957.089. Let i = 0.089 - l. Let y = 2.25 - 2.2. What is the closest to -2/7 in y, i, 4? y Let w = 6750 - 6753. Which is the closest to 0.2? (a) -62 (b) w (c) -1 c Let r = 0 + 2. Let j be (-3 - (0 - r))3/27. Let h = -62 - -61.8. Which is the nearest to 0? (a) j (b) h (c) 5 a Let g = -19859/4 - -7804595/1572. What is the nearest to -0.1 in -1, 0.09, g? g Let f = -3847 - -3847.3. Which is the nearest to 13/6? (a) 3/7 (b) 4 (c) f a Let g = -0.1 + -0.1. Let h = 642 + -647. Let j be h5/(-10) + 15/6. What is the closest to g in 3, 0.2, j? 0.2 Let z = -30.53 + 25.53. Suppose -13 = 2l - 3x, 0 = -l + 4x - 27 + 8. Which is the nearest to l? (a) z (b) 1 (c) 0 b Let b be (1 - (5 + -4))(-1)/3. Let u be b + 2 - -1 - 0. Let q = 19 - 18.7. What is the closest to -2 in 5, q, u? q Let v = 19/3095 + 2156873/55710. Let f = 223/6 - v. Which is the closest to 0.1? (a) f (b) -6/11 (c) 2 b Let b = 3716 - 3715.83. What is the nearest to -1 in -0.2, b, 0.2, 3/2? -0.2 Let t = 5 + -7. Let l = 11.1052 - 10.7052. Which is the closest to -0.3? (a) t (b) -0.08 (c) -3/4 (d) l b Suppose 2l + 2 + 2 = -4d, 4d = 4l + 8. Let z be d((-20)/8 + 2). Suppose -17t + 12t = z. Which is the nearest to 0.2? (a) t (b) 0.5 (c) 0.1 c Suppose -i - v + 15 = 0, -2i + 13 + 25 = 4v. What is the nearest to i in 0.2, 1/3, 1/9? 1/3 Let h be 2/(-3) + ((-2040)/135)/(-17). What is the nearest to -1 in h, -1/3, -2/11? -1/3 Let j be (-7)/2((-7)/(882/(-12)))/(-2). Which is the closest to j? (a) 4 (b) -0.09 (c) 0.4 (d) -0.04 d Let w = 18974 - 18973. What is the closest to -0.1 in 7/6, w, 0.22? 0.22 Let h be ((-6)/(-8))/((-333)/(-222)). Which is the closest to h? (a) 0.5 (b) -0.3 (c) -558 a Let z = 0.2756 + -0.1756. Which is the closest to z? (a) -0.3 (b) 4 (c) -7 (d) -4 a Let s = 164 + -653/4. Let n be (-6)/4(-5 - 26/(-6)). Which is the closest to -0.1? (a) -2/9 (b) s (c) n a Let y be (-4)/18 - 261/(-81). Let s be (-90)/(-25) - 9y/45. Which is the nearest to -3? (a) -0.2 (b) -2/17 (c) s a Suppose 2t + 3n - 10 = 0, -t + 12n - 11n = 0. Which is the nearest to t? (a) -4 (b) -23/8 (c) -0.2 c Let z = 0.538 + 0.162. Let t = 5.7 - z. Let j be 1/(2 + (-3)/2). Which is the closest to j? (a) -1/4 (b) 0.2 (c) t b Let g = 178.5 - 13.5. Let v = 168 - g. What is the nearest to -0.05 in -0.2, -2, v? -0.2 Let z = 4.843 + -4.76. Let h = 0.183 - z. Which is the closest to h? (a) -2/11 (b) -0.3 (c) 5 a Let s = 1496/5187 - 2/741. Which is the closest to s? (a) -2 (b) 22/17 (c) 3 b Suppose -117y + 120y = l - 141, l = -3y + 123. Which is the nearest to l? (a) -0.5 (b) 0.3 (c) 2 c Suppose 2379 = 11h - 470. Let t = 776/3 - h. What is the closest to -2 in t, 4, -5? t Let p = 5/366 + -83/122. Which is the closest to p? (a) -8 (b) 2 (c) 10.9 (d) -2 d Let q(x) = 121x - 1332. Let n be q(11). What is the closest to n in -3/5, 0.2, -1, -0.07? -1 Let h = 779/11 + -71. Let p be (-4)/30 - (-2)/6. Suppose -y - 3n - 2 = -2n, -2y - 5n = -5. Which is the nearest to y? (a) h (b) p (c) 2/9 a Let k = 3.2 - 3. Let n = 2899/5546 - 63/2773. Let z = 3 + -10. What is the nearest to z in n, k, -2/21? -2/21 Let y = 11 + -6. Let t = -0.0227 - 0.0773. What is the nearest to 2/11 in -1, y, t? t Let w = 0.4845 - 0.5045. Let z = -8.12 + 8. Let n = z - w. What is the nearest to	{ "pile_set_name": "DM Mathematics" }
third derivative of c(f) wrt f. -264f Let g(k) be the first derivative of 0k*3 + 2k - 3 + 1/6k4 - 5/2k*2. Let m(w) be the first derivative of g(w). Find the first derivative of m(z) wrt z. 4z What is the third derivative of 21j2 - j4 + 0j*4 - 2j*4 - 9j*2 wrt j? -72j Let u = 6 + -2. What is the third derivative of 5r4 + r2 + 5r*u - 8r*4 wrt r? 48r Let n(y) be the first derivative of 0y + 2y*3 + 0y*2 + 3/4y*4 + 1. What is the third derivative of n(g) wrt g? 18 Let a(t) be the third derivative of -3t*6/20 - 19t*3/6 - 16t*2. What is the derivative of a(f) wrt f? -54f*2 What is the third derivative of 1195 - 1195 + 7c*6 + 8c + 5c2 + 39c*6 wrt c? 5520c*3 Let j(l) = 5l - 7. Let n(w) = -3w + 5. Let h(q) = -5j(q) - 8n(q). Let u be h(-7). What is the second derivative of -3a + 2a + ua + a*5 wrt a? 20a*3 Let x(u) be the third derivative of 1/168u*8 + 0u + 0u3 + 0u*7 + 0u*5 + 0 + 0u*6 + 2u*2 + 1/8u*4. Find the second derivative of x(f) wrt f. 40f*3 Find the third derivative of 29o - 29o - 12o*5 - 3o*2 - 5o*2 wrt o. -720o*2 Let a(u) = 13u*3 - 5u - 3. Let g(i) = -26i3 + 10i + 5. Let v(h) = -5a(h) - 3g(h). Find the second derivative of v(s) wrt s. 78s Find the third derivative of -11i*5 - 778i*4 + 778i*4 + 2i*2 wrt i. -660i*2 Suppose i - 4i = -6. Suppose 10 = ir + 2k, 4r - 5k + 9 = -16. What is the second derivative of 2h - 3h*2 + rh + h*2 wrt h? -4 Suppose 8 = -2v - p - 0, -5p - 30 = 5v. Let i(n) = 3n + 4. Let y(g) = 10g + 13. Let m(h) = vy(h) + 7i(h). Differentiate m(z) wrt z. 1 Suppose 2y = -2y + 8. Suppose y - 8 = -3x. What is the second derivative of 2v*2 - 5v*2 + xv + 2v2 wrt v? -2 Let d(q) be the third derivative of -23q5/60 - q3/6 + 2q2. What is the first derivative of d(n) wrt n? -46n Suppose -3r + 19 + 14 = 0. Let g = 15 - r. What is the second derivative of 4a*3 - 2a*3 - ga*3 + 2a wrt a? -12a Let h(x) be the second derivative of x7/840 + x5/12 - x3/2 - 9x. Let t(v) be the second derivative of h(v). Find the second derivative of t(d) wrt d. 6d Find the second derivative of -241 - 12w + 241 - w + 14w2 wrt w. 28 Suppose 19 = 4d - 1. Let r(a) = -2a - 2. Let p be r(-2). What is the third derivative of -l4 + 3l*p - dl6 + l4 + 2l6 wrt l? -360l*3 Let s(t) = 5t*3 - 4t*2 - 4t + 9. Let z(n) = -81n3 + 63n*2 + 63n - 144. Let a(b) = 63s(b) + 4z(b). Differentiate a(u) with respect to u. -27u2 Let m be -1 - 0 - (-5 + 0). What is the first derivative of 2 - 2g*3 + 0 + 3g*m + 2g*3 wrt g? 12g*3 Suppose 3c = c. Find the second derivative of 0u3 + cu3 + u3 - 2u wrt u. 6u Let s(y) = 3y3 - 16y*2 + 11y. Let f = -4 - 2. Let i(b) = b*3 - 8b*2 + 6b. Let c(g) = fs(g) + 11i(g). What is the third derivative of c(l) wrt l? -42 Let a(f) = 27f4 + 5f*3 + 5f*2 + 5. Let c(w) = -13w*4 - 2w*3 - 3w*2 - 2. Let n(l) = 2a(l) + 5c(l). Find the third derivative of n(p) wrt p. -264p Let s(g) = -4g4 - g3 - 10g2 + 1. Let v(w) = w4 + w3 + w2 - 1. Let t(p) = s(p) + v(p). What is the third derivative of t(c) wrt c? -72c Let c(b) be the second derivative of b4/12 - b3/3 - 4b*2 + 3b. Let s(v) = -v*2 - v + 1. Let h(x) = -c(x) + 2s(x). What is the derivative of h(p) wrt p? -6p Let f be (-4)/(-6)9/1. Find the first derivative of -fp3 + 4p*3 + 2 - 5 wrt p. -6p2 Let i(g) = g3 + g*2 - 5g - 5. Let p(v) = -2v2 + 4v + 4. Let l(c) = -4i(c) - 5p(c). What is the third derivative of l(r) wrt r? -24 Let z(u) = -19u3 + 8u*2 + 23u. Let k(n) = 6n3 - 3n*2 - 8n. Let r(w) = 8k(w) + 3z(w). Find the second derivative of r(h) wrt h. -54h Let x(b) be the first derivative of b6/180 + b5/30 + b3 - 3. Let r(u) be the third derivative of x(u). Find the second derivative of r(s) wrt s. 4 Let x(f) = 8f*3 - 4f*2 + 4f + 11. Let z(h) = -9h3 + 3h*2 - 3h - 11. Let l(b) = -3x(b) - 4z(b). Find the first derivative of l(m) wrt m. 36m2 Let y(m) = 4m*2 + 15. Let g(a) = -6a*2 - 23. Let h(i) = -5g(i) - 8y(i). Differentiate h(d) wrt d. -4d Let p(o) = 11o - 6. Let d(n) = 22n - 11. Let i(y) = 5d(y) - 11p(y). What is the first derivative of i(x) wrt x? -11 Let r(h) be the third derivative of h*4/3 + 13h*3/2 + 18h*2 - 2. Differentiate r(q) with respect to q. 8 Let p(j) = -25j*2 + 29. Let w(a) = 13a*2 - 15. Let t(r) = 6p(r) + 11w(r). What is the first derivative of t(n) wrt n? -14n What is the third derivative of -34d - 9d*6 - 4d*2 + 34d wrt d? -1080d3 Let n(o) = 12o3 + o2 + o + 13. Let q(g) = g3 + g2 + g + 1. Let l(a) = n(a) - q(a). What is the derivative of l(f) wrt f? 33f2 Suppose 9 = 2r - 1. Let a(d) = -d*2 - 5d - 2. Let k be a(-4). Find the first derivative of -rj3 + 8 + 1 + kj*3 - 4 wrt j. -9j*2 Let i(t) = 57t*4 + 7t*3 - 7t - 6. Let z(n) = 19n4 + 2n*3 - 2n - 2. Let u(l) = 2i(l) - 7z(l). What is the first derivative of u(o) wrt o? -76o3 Find the third derivative of 25u*4 + 11u*2 - 15u*4 - 15u*4 wrt u. -120u Let d(c) be the second derivative of -9c8/28 + 7c*4/12 + 16c. Find the third derivative of d(s) wrt s. -2160s3 Let o(n) = -3. Let a(d) = -d2 + d - 9. Let u(i) = 2a(i) - 7o(i). Let x(f) = f. Let z(b) = -u(b) + 2x(b). What is the derivative of z(y) wrt y? 4y Let a = 3 - 3. Let g = 1 + a. What is the derivative of -j + 0j + g - 2 wrt j? -1 Let d(n) be the second derivative of 0n2 - 1/6n*4 + 0n*3 + 0 - 1/30n*6 + 2n + 0n5. What is the third derivative of d(q) wrt q? -24q Let z(u) = -23u3 - 32u*2 + 11u. Let s(r) = 12r3 + 16r*2 - 6r. Let c(d) = -11s(d) - 6z(d). What is the third derivative of c(y) wrt y? 36 Let l = 0 + 1. Let q(a) = 2a - 3. Suppose 10k = 2k + 8. Let g(o) = -o. Let x(u) = kg(u) + lq(u). Differentiate x(w) wrt w. 1 Find the third derivative of -16k*2 + 0k*3 + 9k*2 + 13k*2 + 6k*3 wrt k. 36 What is the derivative of -185c*3 + 371c*3 - 173c*3 + 30 wrt c? 39c*2 Let b(p) be the first derivative of -4p*5/5 + 10p*3/3 - 10. Find the third derivative of b(n) wrt n. -96n Let t be 7 - -4(-2)/4. What is the derivative of -tv*3 - 11v*2 + 11v*2 + 4 wrt v? -15v*2 Let b(f) = f + 7. Let l(k) = k + 13. Let p be l(0). Suppose -2 - p = -3q. Let s(o) = 1. Let m(y) = qs(y) - b(y). Find the first derivative of m(h) wrt h. -1 Let d(j) be the first derivative of 0j*3 - 1/12j*4 - 1/2j*2 + 2j + 1. Let r(x) be the first derivative of d(x). What is the derivative of r(g) wrt g? -2g Let d(q) be the second derivative of 0q*2 - 1/6q*3 + 1/12q*4 + 0 - 2q. Find the second derivative of d(b) wrt b. 2 Let s(r) be the second derivative of 2r4 + 5r*3/2 + 26r. Find the second derivative of s(z) wrt z. 48 What is the third derivative of 8z2 - z2 + 3z4 - z4 wrt z? 48z What is the third derivative of 35k*4 - 4k*2 - 2k*4 - 3k*4 + 31k*2 wrt k? 720k Let k(u) = -u*2 - 5u + 2. Let z be k(-5). Find the third derivative of -r*2 - 6 + 6 - zr3 wrt r. -12 Let n(p) = p - 1. Let v be n(3). Let c(q) = -q3 + 5q2 - 3q - 1. Let g be c(3). What is the second derivative of 8k2 - gk*2 + k + vk*5 wrt k? 40k*3 Let p be 5/3 - (-2)/(-3). Suppose d - p - 2 = 0. What is the third derivative of -3m*4 + 2m*2 - dm2 - m2 wrt m? -72m Let r(b) be the third derivative of 0b*5 - 1/120b*6 + 0b*4 + 0 - 3b*2 - 1/2b*3 + 0b. Find the first derivative of r(a) wrt a. -3a2 Differentiate -7f*4 + 14 - 5f*4 + 15f*4 wrt f. 12f*3 Suppose -t = -5c - 31, c - 59 = -5t + 2c. Find the second derivative of 0v + tv*2 - 5v*2 - 6v wrt v. 12 Find the first derivative of -1 + 14g3 + 4 - 6g*3 + 4g*3 wrt g. 36g*2 Let i be 1/212/3. Find the second derivative of -4ri - 2r*2 - 3r + 5r2 + 2r2 wrt r. 2 Let m(l) = l3 + 7l2 + 8l + 5. Let k be m(-6). Let s = 9 + k. What is the second derivative of 7qs - 7q*2 + 2q*4 - 5q + 2q wrt q? 24q2 Let t(y) = -y3 + y2 - 1. Let j(s) be the first derivative of -s6/2 - s*4/4 - s - 2. Let n(d) = j(d) - t(d). What is the third derivative of n(r) wrt r? -180r**2	{ "pile_set_name": "DM Mathematics" }
15/28 Three letters picked without replacement from emmemmeememm. Give prob of picking 3 m. 7/44 Four letters picked without replacement from {p: 3, t: 1, b: 2, g: 6}. Give prob of picking 1 t and 3 p. 1/495 Calculate prob of picking 1 r and 1 v when two letters picked without replacement from rrvvvvvvvrvvvvv. 12/35 Two letters picked without replacement from {e: 7, x: 12}. Give prob of picking 1 e and 1 x. 28/57 Four letters picked without replacement from ufuiifif. What is prob of picking 1 u and 3 f? 1/35 What is prob of picking 2 z when two letters picked without replacement from lzlzllzlzzlzzllzlzz? 5/19 Two letters picked without replacement from {p: 1, y: 1, u: 8, w: 4, h: 3}. What is prob of picking 1 w and 1 h? 3/34 Calculate prob of picking 1 m, 2 t, and 1 y when four letters picked without replacement from ttmymtmmyymt. 2/11 Two letters picked without replacement from ppjjkpjpppjkkwx. What is prob of picking 1 x and 1 w? 1/105 Calculate prob of picking 1 a and 1 n when two letters picked without replacement from ubqna. 1/10 What is prob of picking 1 o and 2 h when three letters picked without replacement from oyolcoccccchpho? 4/455 Three letters picked without replacement from {q: 11, x: 1, o: 1}. Give prob of picking 1 x and 2 q. 5/26 Calculate prob of picking 1 g and 1 y when two letters picked without replacement from gryhghh. 2/21 Calculate prob of picking 1 d and 1 v when two letters picked without replacement from ykydovkvkykyyv. 3/91 Calculate prob of picking 3 n and 1 t when four letters picked without replacement from tntttnnntt. 4/35 Four letters picked without replacement from nxxxnnnnxx. What is prob of picking 1 n and 3 x? 5/21 Three letters picked without replacement from ssssssssssssssx. What is prob of picking 3 s? 4/5 Two letters picked without replacement from {o: 2, c: 6, q: 2, y: 1, t: 1, p: 3}. Give prob of picking 2 o. 1/105 What is prob of picking 1 x and 1 p when two letters picked without replacement from nnntntnnnxsttsnptnnt? 1/190 What is prob of picking 3 o when three letters picked without replacement from oooomm? 1/5 What is prob of picking 1 e and 3 x when four letters picked without replacement from xexxxxexxxxexexxxx? 364/765 Calculate prob of picking 3 f and 1 h when four letters picked without replacement from ffxxfxh. 1/35 Two letters picked without replacement from yrzgpryh. Give prob of picking 1 g and 1 r. 1/14 Three letters picked without replacement from {t: 2, a: 3, p: 1, d: 1, j: 3, g: 1}. What is prob of picking 1 p, 1 d, and 1 j? 1/55 Calculate prob of picking 2 d and 1 g when three letters picked without replacement from {g: 3, d: 2}. 3/10 Calculate prob of picking 2 k when two letters picked without replacement from {b: 10, x: 2, k: 4}. 1/20 Four letters picked without replacement from {c: 1, o: 2, i: 7, r: 3, s: 5, z: 2}. What is prob of picking 1 c, 2 s, and 1 o? 4/969 Two letters picked without replacement from ollloollollo. What is prob of picking 2 l? 7/22 Calculate prob of picking 1 v and 1 a when two letters picked without replacement from {g: 2, a: 4, s: 5, v: 2, y: 1}. 8/91 Four letters picked without replacement from qbbyqqqbybqmbqbqmb. What is prob of picking 2 m, 1 b, and 1 y? 7/1530 Two letters picked without replacement from {t: 2, s: 3, u: 10}. What is prob of picking 1 u and 1 s? 2/7 Calculate prob of picking 1 w and 1 s when two letters picked without replacement from wsswwwswwwwmwww. 11/35 Three letters picked without replacement from {v: 2, a: 9}. Give prob of picking 2 v and 1 a. 3/55 What is prob of picking 3 m and 1 k when four letters picked without replacement from {n: 2, k: 8, m: 4}? 32/1001 Two letters picked without replacement from {a: 6, c: 1, n: 6, h: 5, q: 1, u: 1}. Give prob of picking 1 u and 1 q. 1/190 Calculate prob of picking 2 i when two letters picked without replacement from {i: 9}. 1 Calculate prob of picking 2 a when two letters picked without replacement from aqahhffaaahi. 5/33 Three letters picked without replacement from mmccmcmcmmcccmcmmmcm. What is prob of picking 1 c and 2 m? 33/76 Calculate prob of picking 3 h when three letters picked without replacement from hhhhh. 1 What is prob of picking 3 u and 1 c when four letters picked without replacement from uuaucuuuu? 5/18 Calculate prob of picking 1 k and 1 f when two letters picked without replacement from {x: 1, h: 1, j: 2, f: 1, k: 2}. 2/21 Four letters picked without replacement from hwsdshhsvgvdv. Give prob of picking 3 s and 1 d. 2/715 What is prob of picking 3 g when three letters picked without replacement from {g: 3, v: 1, d: 2, c: 1, b: 7}? 1/364 Four letters picked without replacement from {p: 4, a: 2, m: 1, k: 4, f: 8, n: 1}. Give prob of picking 3 f and 1 n. 56/4845 What is prob of picking 2 y when two letters picked without replacement from {w: 1, y: 3}? 1/2 Calculate prob of picking 2 h when two letters picked without replacement from {h: 7, e: 2}. 7/12 Calculate prob of picking 3 i when three letters picked without replacement from {r: 1, z: 8, i: 8}. 7/85 What is prob of picking 1 r and 2 w when three letters picked without replacement from uwwttrututrtrurtrt? 5/816 What is prob of picking 2 p when two letters picked without replacement from {l: 8, p: 3}? 3/55 Calculate prob of picking 1 l and 1 s when two letters picked without replacement from jljjjljssjlslj. 12/91 Four letters picked without replacement from {a: 7, k: 8, g: 2, e: 3}. Give prob of picking 1 g and 3 e. 2/4845 Calculate prob of picking 1 b and 1 j when two letters picked without replacement from {b: 2, j: 2}. 2/3 Two letters picked without replacement from {n: 4, u: 2, a: 4, z: 9}. Give prob of picking 1 n and 1 u. 8/171 Three letters picked without replacement from cuufusfuuscscuucwcu. Give prob of picking 1 s, 1 w, and 1 f. 2/323 Two letters picked without replacement from {c: 1, e: 3, u: 2, o: 6}. What is prob of picking 1 c and 1 u? 1/33 Four letters picked without replacement from {l: 2, p: 2, e: 4, s: 2}. Give prob of picking 1 l, 1 e, 1 s, and 1 p. 16/105 Three letters picked without replacement from {w: 2, a: 1, p: 2, f: 3, g: 6, l: 1}. Give prob of picking 1 a and 2 g. 3/91 Calculate prob of picking 1 i and 2 q when three letters picked without replacement from qdbiqqi. 6/35 Three letters picked without replacement from {h: 3, m: 9}. What is prob of picking 2 h and 1 m? 27/220 Three letters picked without replacement from yoydwwwyywy. What is prob of picking 1 d and 2 y? 2/33 Two letters picked without replacement from jhhdddjsjhd. What is prob of picking 1 d and 1 s? 4/55 What is prob of picking 1 i and 3 o when four letters picked without replacement from zizxzozopp? 0 Two letters picked without replacement from {a: 6, i: 2, d: 3, r: 3, c: 1}. What is prob of picking 1 i and 1 a? 4/35 What is prob of picking 1 d and 1 w when two letters picked without replacement from dpewdww? 2/7 What is prob of picking 1 m, 2 w, and 1 h when four letters picked without replacement from qzwquhwmuwq? 1/110 Calculate prob of picking 2 y and 2 r when four letters picked without replacement from {r: 8, s: 1, k: 2, y: 5, j: 1}. 2/17 What is prob of picking 1 u, 1 a, and 1 t when three letters picked without replacement from duddmmtmstsatud? 6/455 Four letters picked without replacement from {a: 2, l: 3, m: 9, o: 3, q: 1}. Give prob of picking 2 o and 2 a. 1/1020 Two letters picked without replacement from zzydzpb. What is prob of picking 2 p? 0 Calculate prob of picking 2 q and 1 e when three letters picked without replacement from dqqeeqq. 12/35 What is prob of picking 1 s, 1 r, and 1 v when three letters picked without replacement from rvvxwswxvwvwwwrvvvw? 14/969 Calculate prob of picking 4 p when four letters picked without replacement from {p: 10}. 1 Two letters picked without replacement from {y: 2, k: 3, e: 4}. What is prob of picking 2 y? 1/36 Two letters picked without replacement from zqfqzffxuufueuu. What is prob of picking 1 u and 1 q? 2/21 Calculate prob of picking 1 t and 1 h when two letters picked without replacement from djpdhht. 2/21 Calculate prob of picking 4 m when four letters picked without replacement from mkkmkmmmmkkmmmmm. 33/182 Two letters picked without replacement from coooooocooccoqooc	{ "pile_set_name": "DM Mathematics" }
n be b(-3). Factor -12 - 22p3 - 96p*2 - 12p*3 + 61p*n - 70p - 9p3. 2(p - 6)(3p + 1)*2 Suppose -9 = 5r - 34. Let a be (-117)/78(-2 + 0/(-1)). Suppose 4x*2 + 4x*4 - 3x*2 - rx*4 + 2x + x*a - 3x = 0. Calculate x. -1, 0, 1 What is v in 8v2 + 17v - 3v - 8v*2 + 5v*2 - 7v*2 = 0? 0, 7 Suppose 62k - 21 = 55k. Let n = 15 + -13. What is d in -1/2d*k + 0d + d4 - dn + 0 + 1/2d5 = 0? -2, -1, 0, 1 Factor 30s*2 - 16s*4 - 5 + 31s*4 - 20s*3 - 20s*3. 5(s - 1)*3(3s + 1) Let y(o) be the third derivative of 0 + 1/60o*5 + 1/24o*4 + 0o - o*2 - 1/6o*3 - 1/120o6. Factor y(q). -(q - 1)2(q + 1) Suppose 0 = 16h - 12h + 32. Let l(j) = -14j*3 + 58j*2 - 202j + 142. Let i(t) = 5t3 - 19t*2 + 67t - 47. Let z(y) = hi(y) - 3l(y). Factor z(k). 2(k - 5)2(k - 1) Let q(a) = 55a3 + 60a*2 + 60a - 100. Let p(m) = -2m3 - m2 - m + 1. Let f(t) = 25p(t) + q(t). Solve f(n) = 0. -5, -3, 1 Let x be 6/(-4) + 174/116. Suppose -2s + 5 = 1. Find n such that 0n*s + 0 + 4/3n*4 + xn + 1/3n3 = 0. -1/4, 0 Let t(m) be the first derivative of 5/7m*3 + 3/14m*2 + 9/35m*5 + 3/4m*4 + 24 + 0m. Factor t(x). 3x(x + 1)*2(3x + 1)/7 Let u = -8633/3 + 2878. Let -ud + 1 - d*2 + 1/3d*3 = 0. What is d? -1, 1, 3 Let o(j) be the second derivative of 0 + 9j + 20/3j3 + 5/12j*4 + 0j*2. Solve o(x) = 0. -8, 0 Factor 1/2x*3 + 5x*2 + 14x + 12. (x + 2)*2(x + 6)/2 Let w be 125 - (-12)/3 - 4. Let p = 251/2 - w. Factor 1/3c + p - 1/6c*2. -(c - 3)(c + 1)/6 Factor 0 - 4d3 - d4 + 0d + 1/2d5 + 0d2. d3(d - 4)(d + 2)/2 Let m = -3/182 - -561/910. Factor mq2 + 3/5 + 6/5q. 3(q + 1)2/5 Let t(s) be the second derivative of -s6/360 - s5/120 + s4/18 - s3/12 - 21s*2/2 - 7s. Let c(k) be the first derivative of t(k). Factor c(g). -(g - 1)(g + 3)(2g - 1)/6 Let v = 258/35 - 146/35. Find m, given that vm - 4/5m3 - 8/5 + 2/5m*4 - 6/5m*2 = 0. -2, 1, 2 Let d(k) be the first derivative of 8k + 0k2 - 2k*3 - 4 - 1/2k*4. Solve d(s) = 0 for s. -2, 1 Let r = 1279 - 1276. Factor -10/11q + 4/11 + 6/11q2 + 2/11q*r - 2/11q*4. -2(q - 1)*3(q + 2)/11 Suppose 19p + 3p = -17p. Factor 0 + pd - 1/5d2 - 3/5d*3 - 3/5d*4 - 1/5d5. -d2(d + 1)3/5 Let f be 1 - (121/385 + (-4)/(-10)). Let r(q) be the first derivative of -9 - fq*2 - 1/14q*4 + 0q + 2/7q3. Factor r(z). -2z(z - 2)(z - 1)/7 Let j(w) be the first derivative of 3w4 + 0w*2 + 6/5w*5 + 2/15w*6 - 11 + 0w*3 + 9w. Let n(p) be the first derivative of j(p). Factor n(v). 4v2(v + 3)*2 Let o(h) be the second derivative of -6h - 9/4h2 + 25/8h*3 + 0 + 9/16h*4. Determine n so that o(n) = 0. -3, 2/9 Suppose 0 = 4h - 1 - 19. Suppose hs + 0 = 3q - 2, 0 = 3q - s - 10. Factor -6 - d2 + q - 5d + 0 - 2d2. -(d + 1)(3d + 2) Let z = 235/4016 - -1/251. Let g(w) be the second derivative of 1/2w*3 + 0 + 3/2w*2 + 3w + zw4. Determine p so that g(p) = 0. -2 Let b(r) = -14r - 3r - 35r*2 + 30 - 8r + 25r3. Let i(w) = -w4 - 24w*3 + 34w*2 + 24w - 29. Let f(q) = -4b(q) - 5i(q). Factor f(o). 5(o - 1)2(o + 1)(o + 5) Factor -234 + 60n - 1/2n3 - 1/2n2. -(n - 6)2(n + 13)/2 Let g(s) be the second derivative of 32/3s*2 - 31s - 64/9s3 + 0 + 7/3s*4 - 11/30s*5 + 1/45s*6. Factor g(y). 2(y - 4)*2(y - 2)(y - 1)/3 Let o(b) be the third derivative of -b6/280 - 3b*5/140 + 58b*2. Factor o(y). -3y*2(y + 3)/7 Factor -7l2 - 17/6l*3 + 2/3l - 1/6l4 + 28/3. -(l - 1)(l + 2)*2(l + 14)/6 Let w(l) be the third derivative of 0l - 1/420l*7 + 0 - 1/2016l*8 - 1/360l*6 - 38l*2 + 0l*3 + 0l*4 + 0l*5. Suppose w(z) = 0. What is z? -2, -1, 0 Let g(q) be the second derivative of -9q + 117/50q6 + 1 + 4/5q*3 + 0q*2 - 17/5q*4 + 183/50q*5 - 81/70q*7. Let g(s) = 0. Calculate s. -1, 0, 2/9, 2 Let f be -4 - ((-5 - -2) + -6). Suppose 0 = -fl + l + 5g + 9, 2l + g - 1 = 0. Factor 2k2 + l - 1 - 2k + 0k2. 2k(k - 1) Let s be 0 + (-4)/(-10) + (-264)/(-990). Let n(i) be the first derivative of -1/4i*4 + si*3 - 6 - 2i + 1/2i2. Find y, given that n(y) = 0. -1, 1, 2 Let u(k) = 71k*3 + 2k*2 + k. Let v be u(-1). Let l = -70 - v. Determine b, given that lb*3 + 0 - 1/3b*5 + 0b + 0b2 - 2/3b4 = 0. -2, 0 Let m(v) = v3 + 6v2 - 5v - 48. Let g be m(-5). Solve -2/5y - 7/5y*g + 0 = 0 for y. -2/7, 0 Let l(p) be the third derivative of 0p*4 - 5/6p*3 + 0p - 2p2 - 1/1440p*6 - 1/240p*5 + 0. Let z(a) be the first derivative of l(a). Factor z(b). -b(b + 2)/4 Let n(f) = -f2. Let h(z) be the second derivative of -z4/12 + z*3 + 5z*2/2 + 45z. Let r(b) = -h(b) + 2n(b). Factor r(a). -(a + 1)(a + 5) Let c = 83 - 80. Factor -46b + 0b + 126b2 - 29b - 17bc - 10b*3 + 12. -3(b - 4)(3b - 1)*2 Let n be (3/(-43))/((-30)/(-219)). Let x = -2/215 - n. Let 27/2 + 27/2d + xd3 + 9/2d*2 = 0. What is d? -3 Let o(u) be the first derivative of 0u + 0u2 + 1 + 1/720u*6 - 4/3u*3 + 1/120u*5 - 1/16u*4. Let a(h) be the third derivative of o(h). Factor a(c). (c - 1)(c + 3)/2 Suppose -2s = 10s - 48. Suppose sx - 2 = 14. What is a in 0 + 3/2a*3 + 0a*2 + 0a - 9/4ax + 3/4a*5 = 0? 0, 1, 2 Suppose 76729/8 + 1/8x*2 + 277/4x = 0. What is x? -277 Let t = -74 - -79. Let n(l) be the second derivative of 0 + 4/15l4 - 4/15l*3 - 1/10l*t + 0l*2 + 2l + 1/75l6. Factor n(m). 2m(m - 2)2(m - 1)/5 Let z(o) be the third derivative of -o*6/360 - 2o*5/45 - 13o4/72 - o3/3 + 28o2 + 2. Let z(i) = 0. Calculate i. -6, -1 Let f(i) be the second derivative of 0i*3 + 0 - 2i + 0i2 - 1/135i*6 - 1/90i*5 + 0i*4. Factor f(a). -2a*3(a + 1)/9 Let p(m) be the third derivative of m*7/105 - 29m*6/60 + 112m*5/15 - 49m*4/3 - 30m2. Find j such that p(j) = 0. 0, 1, 14 Let c(u) be the second derivative of -u6/150 - u5/50 + u3/15 + u*2/10 - 118u. Factor c(w). -(w - 1)(w + 1)3/5 Let j be (-1 - -1) + (-1395)/(-217) + -5. Suppose -6/7m*2 - 8/7 + 24/7m - jm3 = 0. What is m? -2, 2/5, 1 Let v(t) be the third derivative of -t7/105 + t6/10 - t5/30 - 2t*4 - 16t*3/3 + 65t*2 + 2t. Suppose v(c) = 0. Calculate c. -1, 4 Let x(f) = 280f3 - 2832f*2 - 6012f + 1936. Let l(g) = 51g3 - 515g*2 - 1093g + 352. Let y(r) = 28l(r) - 5x(r). Factor y(h). 4(h - 11)(h + 2)(7h - 2) Let o(a) = a*2 - 6a - 16. Let d be o(9). Let u = d - 10. Suppose -t2 + t2 - u + 2t - t2 = 0. What is t? 1 Let r(u) be the second derivative of -1/15u*4 + 2/5u*2 + 1/5u*3 - 3/50u*5 + 0 + 19u. Factor r(c). -2(c - 1)(c + 1)(3c + 2)/5 Let n(k) be the first derivative of -k*6/2 - 24k*5/5 - 15k*4 - 10k*3 + 63k*2/2 + 54k - 199. Find m, given that n(m) = 0. -3, -2, -1, 1 Let d(i) = -3i2 + 23i - 28. Let q(j) = -16j2 + 91j - 111. Let u(a) = -9d(a) + 2q(a). Factor u(n). -5(n - 1)(n + 6) Suppose 19 = -3a - 4y - y, 15 = -3a - 3y. Let s(n) = n*2 + n - 6. Let o(q) = -6. Let b(u) = as(u) + 2o(u). Solve b(i) = 0 for i. -2, 1 Let -36 - 4y*3 + 10y + 4y - 44y*2 - 90y = 0. What is y? -9, -1 Let i be -7(-36)/63 - 0. Let v(a) be the third derivative of -5a*2 + 0 + 1/36a*i + 0a + 0a3 + 1/90a*5. Determine g, given that v(g) = 0. -1, 0 Suppose -l + 2o = -3, -l = 3l + 2o - 52. Let -5 - lm - 20m*2 - 3 + 39m = 0. What is m? 2/5, 1 Solve 0n + 4/7n*3 + 0 + 2/7n*4 - 48/7n*2 = 0 for n. -6, 0, 4 Let a be 1440/140 + -10 - 5/42. Let q(g) be the first derivative of -ag*2 + 4 - 1/18g*3 + 1/24g*4 + 0g. Factor q(z). z(z - 2)(z + 1)/6 Let u(y) be the first derivative of 3y4/28 - y3/7 - 51y*2/7 - 24y + 49. Factor u(f). 3(f - 7)(f + 2)(f + 4)/7 Suppose 4k = 2b + 14, 4k + 9b = 5b - 4. Let 4/13 + 0wk - 2/13w*3 + 6/13w = 0. Calculate w. -1, 2 Let i be 8/12(265/(-35) + 8). Factor 0m - 2/7m5 + 0m*2 + 4/7m*3 + 0 + im*4. -2m*3(m - 2)(m + 1)/7 Let g be ((-26)/8 + (-6)/8)/(-14). What is h in -2h*3 - 4/7h*2 - 8/7h*4 + 0 + gh = 0? -1, 0, 1/4 Let w be 8/30 + (-7168)/(-1920). Let -2 - 2fw + 28/3f*2 + 8/3f*3 + 8/3f = 0. What is f? -1, 1/3, 3 Let m(l) be the first de	{ "pile_set_name": "DM Mathematics" }
y + 14. Solve 0 = yn - dn - 2 for n. 2 Let n be 5 - (3/(-3) + 2). Let v(u) = u + 1. Let m be v(n). Solve 0 - m = h for h. -5 Suppose -3d = -4j - 12, -5j - d - d + 8 = 0. Let t(s) = s3 - s2 - s - 3. Let b = 16 - 13. Let f be t(b). Solve j = -0h + 4h + f for h. -3 Suppose -5 + 3 = -l. Solve 4u = lu + 8 for u. 4 Suppose 0t + 2t + 6t = 0. Solve 2a + a + 9 = t for a. -3 Let w = -8 + 13. Solve d = -4d + w for d. 1 Let y = 0 + -2. Let n(w) = -w + 2. Let u be n(y). Suppose -2x = 0, -4x = up - 3x - 8. Solve pf = -f + 3 for f. 1 Let u = 10 - 7. Let s be -4(7/(-2) - -2). Suppose -s = -y - u. Solve -r = -0r + y for r. -3 Let l(w) = w3 + 6w*2 + 3w + 3. Let h be l(-6). Let f be -8(2 - h/(-6)). Solve 0 = 3d - 4d - f for d. -4 Let s = -7 + 7. Suppose 4q - 73 + 9 = 0. Suppose -40 = -5p - 5j, p + 0p + 3j - q = 0. Solve m + 2 - p = s for m. 2 Suppose -23 = -3a + a + 5m, 2m + 26 = 5a. Suppose -2g = 4o - 20, -3g + 7 = ao - 17. Solve 0 = -i - oi - 12 for i. -3 Let k be (1 + -2)/(4/12). Let a(g) = g3 - 3g*2 - 5g + 3. Let i be a(4). Let s be 2ik/6. Solve 2b - b = s for b. 1 Let d(o) = o2 + 14o - 8. Let h be d(-15). Solve 2w = 15 - h for w. 4 Let r be ((-3 - -5)3)/1. Suppose -rf + 3f = -9. Solve fw = -w for w. 0 Let u(t) = t2 + 4t + 16. Let z be u(0). Solve -2f = -6 + z for f. -5 Let r be (-4)/14 - 60/(-14). Suppose 3p - 2 = -5z + r, 0 = -2p + 4. Solve w = -zw for w. 0 Suppose 2x - 14 = -2p, -4x + 6 = -2p - x. Suppose 0 = 4z - n - pn - 16, 5n = -20. Suppose z = f - 1. Solve -9 = -2y - f for y. 4 Suppose -3h = -8h + 10. Suppose 4 = hl - c, 5l + 0c - 5c - 10 = 0. Solve -lo - o = 0 for o. 0 Suppose -o + 104 = -5o. Let f = -13 - o. Suppose -4n + 61 = f. Solve 0 = 2t + 2t + n for t. -3 Let g(w) = -w*3 + 11 - 9w2 + w3 - 9w - w3. Let f be g(-8). Solve -4l = -3 + f for l. -4 Let g(k) = -k*2 - 8k - 7. Let w be g(-6). Suppose -5 - 10 = -wz. Suppose x - o + 12 = 34, -o = zx - 58. Solve -r - 3r = -x for r. 5 Let q(t) = 4t*3 - 2t*2 + t - 6. Let n be q(2). Solve -s + 6s - n = 0 for s. 4 Let k(p) = 2p3 + 9p*2 - 5p + 2. Let j be k(-5). Solve d = -d + j for d. 1 Suppose -6n + n = 3v - 57, v + 3n - 19 = 0. Solve -v = 4r - 3 for r. -4 Suppose -2l + 3h + 6 = 0, 2h + 1 = l - 3. Suppose 0 = -5b - 4d + 7, 0d - 13 = -5b - d. Let w be 6/b - (l + 0). Solve 0 = -wv - 0v + 6 for v. 3 Let a(d) = -d + 1. Suppose 0 = 2j + 4q + 20 - 8, 5j - 2q + 6 = 0. Let v be a(j). Let p be 3 + v + 2 + -6. Solve -p - 2 = -2c for c. 2 Let n be 7/2 + 3/(-6). Suppose nj = -2l - 0 + 22, 0 = -4j + 16. Suppose -m = 3 - l. Solve -c = c - m for c. 1 Let b(f) = -4f3 + f2 - 1. Let d be 0 + 0 - (-3 - 0). Suppose -4y - d = 1. Let r be b(y). Solve -rw = -0 - 4 for w. 1 Suppose -i + 0i = 2b + 6, -22 = -5i + 3b. Suppose 2d = -id + 16. Suppose -4w = -2w - 10. Solve dk + w = -k for k. -1 Let k be 5/20 - 11/(-4). Suppose -2n = kq + 28, -q = 5n - 0n + 31. Let v be (q1)/(-2)1. Solve 1 = -vd - 11 for d. -4 Let k be (1 - -2) + (-3 - -4). Solve -2a = k - 8 for a. 2 Let q = -1 - -17. Let i(j) = -j2 + 4j + 7. Suppose p + 0 = -5, 5p = -3u - 10. Let m be i(u). Solve 2y = -my + q for y. 4 Let i = 14 + -11. Suppose -2x - 45 = -3g + ix, 4x - 60 = -4g. Let r = -5 - -9. Solve rl = -l - g for l. -3 Suppose -s = 2b - 11, -2b = -3s - s - 6. Solve 2 = -4g + bg for g. 2 Let v(o) = o + 4. Let l be v(0). Suppose t = 4t - i - l, 17 = 4t + i. Solve tk - 1 = 2k for k. 1 Let i be 4 + -2 - (-1 - -3). Suppose 5f + 9 - 69 = i. Suppose r = 4r - f. Solve -t + rt - 9 = 0 for t. 3 Let n(j) be the first derivative of 2j3/3 + j2/2 - 2j + 2. Let g be n(-2). Let i be (8/(-3))/((-2)/9). Solve -i = gm - 0m for m. -3 Let g = 1 + -1. Suppose -2r = -5o + 1 - 3, -2o + 3r - 3 = g. Let z = o - -2. Solve -3q = -zq for q. 0 Let x(b) = -b*3 - 5b*2 - b - 1. Let r be x(-5). Let s be (r + 2)20/3. Suppose 3v - s = v. Solve -5c = -0c + v for c. -4 Suppose -39 = -4z + 41. Suppose 5j = 5v + 57 - 12, z = 2j - 4v. Let m be 2 + j - (3 + -1). Solve -p - m = p for p. -4 Let b = -5 + 11. Let g = 11 + b. Solve 3 = -4y - g for y. -5 Suppose 0 = -7t + 5t - 2. Let a(s) = -5s. Let z be a(t). Suppose -q = zv - 31 + 11, -4q + 5v + 5 = 0. Solve -2 - 23 = qd for d. -5 Suppose -4h - h + 32 = 4g, -2h = -g - 5. Suppose -7 - 5 = -ha, 2n = -3a + 49. Solve 4r + 0 + n = 0 for r. -5 Let w(d) = d2 + 5d. Let c be w(-5). Solve 2g - 4 + 2 = c for g. 1 Let n(x) = x2 + 4x - 6. Let t be n(-6). Let q be 50/8 - t/24. Solve 2w + 2 = q for w. 2 Let g = 13 + 16. Suppose -3l + 140 = g. Let a = -25 + l. Solve -3t = -6t + a for t. 4 Suppose -n = -0n. Suppose d = -na + 3a + 8, -4d - 32 = 4a. Let c be a/14 - (-30)/7. Solve -8 = -ci + 8i for i. -2 Let x(p) = 2p - 1. Let k be x(3). Suppose -4y = -7 - k. Suppose 2n - ya = n, -n - a = 0. Solve d - 2d + 4 = n for d. 4 Suppose 4o = 4d + 16, 2o - 8 = 3o + 2d. Solve o = 3p + 9 + 6 for p. -5 Let w(m) = -m*2 - 4m + 1. Suppose -5s + 2 - 22 = 0. Let z be w(s). Solve 3 + z = -b for b. -4 Let l(j) = j2 - 5j - 2. Let y be l(10). Let q be y/(-27) + (-2)/9. Let t be -1 + q + 42. Solve -ta = -a + 12 for a. -3 Let l(o) = o*2 + 5o + 5. Let a be l(-4). Let m(k) = -k*3 - 5k*2 + 2. Let r be (-4)/((-32)/(-10))4. Let y be m(r). Solve 3 = yx + a for x. 1 Let d be -136/(-9). Let i(n) = -3n + 9. Let g be i(3). Suppose 3a - da - 2 = g. Solve ac = 5c + 9 for c. -3 Let q = 24 + -20. Let d(r) be the third derivative of -r*4/24 - 3r3/2 + r2. Let y be d(-9). Solve q + y = -o for o. -4 Let k = 20 + -3. Suppose -p + 5 = -0p, f + k = 4p. Let g = 2 - 2. Solve g = 4b - 1 - f for b. 1 Suppose 4h - 5 = -o + 14, -5o = 5h - 20. Suppose a + 6 = -4b + 4a, 2a = -b + 4. Solve 0 = hy - by + 10 for y. -2 Let o(s) = -s2 + 6s - 4. Let z be o(4). Suppose 0v - q + 2 = 2v, 16 = -zq. Solve 3l + v = 15 for l. 4 Let f(w) = -w + 9. Let t be f(7). Let r(n) = -n*2 + 6n + 7. Let h be r(6). Suppose -4y = 3 - h. Solve tl + y = l for l. -1 Let o = 71 + -64. Solve -o + 3 = -2n for n. 2 Suppose 5r = 24 + 1, -2a + 1 = -r. Suppose -w - k = -a + 1, 0 = 5w + k - 6. Solve 5i + w = 21 for i. 4 Suppose -2l + 2i + 22 = 0, 2i = -3l + 7 + 1. Let v = -4 + l. Solve vz + 3 = -3 for z. -3 Suppose 4g = -3b - 17, -2b + 3g - 18 = -g. Let n = 21 + b. Solve -2 = -4i - n for i. -3 Let p be 2 + 3 + -5 + 3. Solve -2j = -p + 1 for j. 1 Let l = 3 - -1. Let j = 5 + 2. Suppose j + 5 = lr. Solve -r = g - 0g for g. -3 Let k(l) = -8l2 - 3l - 3. Let f be k(-2). Let r = f + 40. Solve 3c + 5 = r for c. 2 Let i = 5 - 5. Suppose -8 = f + 5s - 29, -4s = -2f. Suppose 2w - 2j = 12, 5j + 7 = 4w - 20. Solve i = 3k + w + f for k. -3 Let g be 0/((2/2)/((-4)/8)). Solve g = -b + 2b - 1 for b. 1 Let m(i) = i*3 - 2i. Let q be m(2). Suppose -3s = q - 19. Solve -sr = -0r - 20 for r. 4 Suppose -3v + 24 = 3o, 11 = o + 2v + 2. Suppose -10 = -4b + 2b. Let a = o - b. Solve as = 3s for s. 0 Suppose 0 = 2h - 45 + 9. Let g = h + -18. Solve 0 = 4s - gs + 4 for s. -1 Suppose 0x = -3x + 30. Suppose 2w - w - 2 = 0. Suppose -4s + 34 = wy, 5s - 44 = -y - 9. Solve x = 4v - s for v. 4 Let w(g) = g*3 + 6g*2 + 6g + 6. Let h be w(-5). Suppose 4m = 11 + h. Suppose 6d + 4 = 8d. Solve -j = -dj + m for j. 3 Suppose 4i + 18 = -5s - 7, i + 2s + 4 = 0. Let v(t) = -t2 - 11t - 6. Let z be v(i). Solve k = -zk for k. 0 Let w(v) = v2 + 2v - 4. Let r be w(-4). Let s be 8/(-1)(-1)/r. Solve -2 = -sp - 0 for p. 1 Suppose -5m = -k + 3k - 23, 3k = -5m + 22. Solve -mh = -0 - 5 for h. 1 Let g(x) = x2 + 3x - 5. Let k be g(-5). Let z be (-2)/(k/((-30)/(-4))). Let o = 6 + z. Solve o + 3 = -3p for p. -2 Let n = 1 + -1. Suppose -w - 4 + 6 = n. Suppose wr + r = 0. Solve 4 = -ru + 4u for u. 1 Let l be (10 + 1)/(-5 - -6). Suppose -3n - l = 5b, b + 0b = -4n + 8. Suppose 0 = -0z - z + n. Solve -zm - m = 0 for m. 0 Let n(b) = b*3 - 6b*2 + 6b. Let r be n(5). Solve 0 = rk + 10 - 5 for k. -1 Let m be (1 - 3) + 32. Solve -3d - m - 8 = 0 for d. -4 Let j = -32 - -32. Solve jc + c - 3 = 0 for c. 3 Let i(h) = h**2 - h. Let l be i(-1). Su	{ "pile_set_name": "DM Mathematics" }
m + 67m - 53821306. Is m a composite number? True Let l = -152707 + 217440. Is l a prime number? False Let w(p) = -p - 10. Let x(j) = -j3 + 4j*2 - 5j - 4. Let l be x(3). Let m be w(l). Suppose m = 7g + 457 - 3306. Is g a composite number? True Let j be 8(6/15 + (-35)/25). Suppose -3z + 16 = -z. Is 2/j + 2362/z a prime number? False Let i(d) = -d. Let h(a) = -223a - 3. Let f(p) = h(p) + 3i(p). Let v be f(-17). Suppose 0b = 5b + 3l - v, -5b + 3835 = 5l. Is b prime? True Suppose 0 = -3c + 2o - 1220, c = -4o - 378 - 52. Let i = c - -2727. Is i a prime number? False Let x be (-14)/91 - (228/13)/3. Is -1(x - 28012/4) a prime number? False Let t = -9847 + 9843. Let i(g) = 11g - 63g - 15 - 18g. Is i(t) prime? False Let c(k) be the third derivative of 17k*4/24 + 977k*3/6 - 40k*2 + 1. Is c(0) a composite number? False Suppose -y + 0 + 2 = 0. Suppose -4g - yv = -20912, -4g + v + 20912 = -0g. Is 3/(54/(-4)) - g/(-36) a composite number? True Let h(f) = 230f*2 + 3f + 617. Is h(-26) a composite number? False Suppose 7t = 3t + 12. Let v = 2676 - 2676. Suppose v = 3i + 5h - 1025, -2i - th = h - 686. Is i a composite number? True Suppose -165640 = -10g + 5g. Is g + (-7 - -4) + 2 + 0 prime? False Let a(i) = -25i - 284. Suppose -5v = 10, 4v - 3 + 77 = -2k. Is a(k) a prime number? True Let m = -138 - -188. Suppose 273483 = mg - 23g. Is g a prime number? False Let s(m) = 81 + m*3 - 9m*2 - 70 - 2m*2 + 6m. Let q be s(9). Let g = q - -576. Is g composite? False Let j be 224970/45(-12)/8. Let a = j - -12298. Is a a prime number? True Suppose 0 = 13t - 915428 - 458503. Suppose -t = 24j - 27j. Is j a composite number? True Let n(g) = -317g - 3098. Is n(-15) prime? True Let p = 18679 - 11010. Is p composite? False Let z = -8 - -86. Is 1104/(-32)z/(-9) prime? False Let l = 22500 - 11679. Is l a prime number? False Suppose 12i - 97195 - 478817 = 0. Is i a prime number? False Let y(a) = -27a - 13. Let k be y(-2). Let t = k + -36. Suppose tr - 3681 + 161 = -u, 0 = -r + 4u + 683. Is r a composite number? True Suppose 0 = 9n - 753 + 510. Is 2/(-6) - ((-48609)/n + -1) a composite number? False Let x(h) = 38h + 3243. Is x(86) a prime number? False Suppose 259f = 249f + 75950. Suppose -404 + f = 9v. Is v a prime number? False Let x(z) be the first derivative of -z5/5 - 4z*4/3 - 7z*3/3 + 15z*2/2 - 10z + 11. Let w(l) be the first derivative of x(l). Is w(-7) composite? False Let h = 61 + -45. Suppose -433246 = -hg + 99346. Is g composite? False Suppose -2b = -3f - 1, 0 = -3b + 18 - 3. Suppose 0 = fi - 2x - 3825, -3i - 4x + 967 = -2840. Is i composite? True Suppose -2271539 = -16u - 563171. Is u prime? False Suppose 593 - 557 = 12p. Suppose 4b - pg - 46082 = 0, 2g - g - 57593 = -5b. Is b prime? True Let j(k) = 300443k2 + 87k + 89. Is j(-1) prime? False Let w(q) = -q*2 - 10q - 12. Let p be w(-8). Let t(k) = 3086k - 125. Is t(p) composite? True Is (-5254982)/(-6) - (-22 - 3648/(-171)) composite? True Let p(r) = -r3 + 6r*2 - 9r + 4. Let g be p(4). Suppose -4s + c = -9005, g = -s - 5c + 2116 + 130. Is s prime? True Let g = -760 + 1341. Is (-52 + 50)g/(-2) prime? False Let p = -71 - -71. Suppose -2d = 2 - p. Let h(m) = -610m3 + 4m*2 + 3m. Is h(d) prime? False Suppose -2p + 4i - 192 = 0, -63 - 236 = 3p + 5i. Let u = -96 - p. Suppose -5n - 6046 = -6h + 2h, uh - 3034 = -3n. Is h composite? True Suppose 0 = 4y - 4v - 5072, 6v + 6331 = 5y + 4v. Suppose 402 = c - y. Suppose -3q + 0b + c = 4b, 5q + 4b = 2781. Is q a prime number? True Suppose 0 = 5p - n - 69756, -3p + 0n + 2n + 41855 = 0. Suppose 10k - p - 1119 = 0. Is k prime? False Let h(z) = -z*2 + 9z - 19. Let x be h(5). Suppose -c - 2833 + 48488 = -4b, -b + x = 0. Is c prime? True Let x be (-37)/(-7) - (-34)/(-119). Is 20244/4 + 1 + (2 - x) a composite number? False Let l = -45 + 57. Suppose -lr + 72 + 0 = 0. Let m(a) = 328a - 1. Is m(r) prime? False Let s(l) = -l3 - 7l*2 - 8l + 13. Suppose 11h + 69 - 14 = 0. Let i be s(h). Is 0 - i - (-1107 + 1) composite? False Let i(f) = -5313f - 23. Let d be (5 + -3)/(-4)4. Is i(d) a prime number? False Let o(n) = -n3 + 25n*2 - 30n - 13. Is o(-16) composite? True Let u be (-16)/72 + (-4)/(-18). Suppose -3174 = -um - 6m. Suppose -a + m = 5w - 2732, -2592 = -4w - 5a. Is w a prime number? True Suppose -52z + 432817 = 3d - 48z, 5d = -4z + 721383. Is d a prime number? False Let b be (7 + -41)-4113/2. Let f = b - 2213. Is f a composite number? False Let x(a) = 1951a2 + 222a - 4186. Is x(24) prime? False Let d(o) = o*3 + 5o*2 - 3o - 10. Let u be d(-5). Is -3 + (-26 - (u - 8))-104 a prime number? True Let u be ((-9)/27)/((-2)/6)1. Suppose 2d - 9 = -u. Suppose s - 2152 = -3w, -w - 3w + 2856 = ds. Is w a prime number? True Let a(k) = -203k - 119. Let l be 196/(-147) + (-92)/3. Is a(l) prime? False Let z(p) = -26p*3 - 10p*2 - 17p + 26. Is z(-15) a composite number? False Is 2/(-33) + 1953/(-2079) - 138288/(-2) a prime number? True Let a be 4/5 - (-5 + (-112558)/(-10)). Let k = a + 16081. Is k a prime number? True Let s(n) = 26796n2 - 235n + 935. Is s(4) prime? True Let f(i) = 41i2 - 161i - 55. Is f(54) prime? True Let s(z) = -z*2 + 16z - 28. Let y(q) = -q - 1. Let w(l) = s(l) - y(l). Let k be w(16). Let n(v) = -21v + 34. Is n(k) composite? True Let l be (-493578)/(-108) + 2/(-12). Suppose p + 5t = 1115, -l = -p - 3p + 2t. Is (2 - p/8)-6 a prime number? False Suppose f - 8118 = -2r - 343, 0 = 2f + 2r - 15540. Let d = f - 5316. Is d composite? True Suppose 10m + 12431 = 74771. Suppose 5k - 25 = 0, -3h + 5k + 1340 = -m. Is h prime? False Let w = -391 - -857. Suppose -8t + w + 350 = 0. Suppose 5q - 2863 = t. Is q a composite number? False Let r(k) = -346k - 1. Let h be r(-2). Suppose 1402 = 2a + 2b, -2a + 3a - 4b - h = 0. Let z = a + 62. Is z composite? False Let z(t) = -12t2 - 23t - 11. Let r(g) = 8g2 + 15g + 7. Let x(i) = 8r(i) + 5z(i). Let b be x(-2). Let h = b + 6. Is h a composite number? False Let y be ((-6)/(-2))/(-1 - (-1)/4). Let q be y/(36/(-33)) - (-6)/18. Suppose 4k + z - 9831 = 0, qz + 5 = 3z. Is k a prime number? True Let r(c) = 119425c - 1792. Is r(15) prime? True Let r = -50943 + 232442. Is r prime? True Let b = -1045058 - -1815119. Is b a composite number? True Is (134/12)/(17/20094) composite? True Suppose -3d + 2v + 688261 = 0, 8d - 5v = 7d + 229416. Is d a prime number? False Let d be 19293 - -1(-25)/(-10)-2. Let k = d + -13229. Is k prime? False Suppose -220682 = -6n + 165855 + 200089. Is n a prime number? True Let w(s) = s*3 + 9s*2 + 8s + 5. Let a be w(-8). Suppose 4t = 5b - 14987, -ab = 5 - 0. Let g = t - -6033. Is g a prime number? False Let i(c) = c3 + 23c*2 - 13c + 3. Suppose 100 = -6w + 16. Is i(w) composite? False Let b = 620604 - -415905. Suppose b = 28w + 256121. Is w a composite number? True Suppose 4d - 21 = -3u, 3u + d + 6 = 6d. Let g(m) = 0m + 0m*u - 9m*2 + 8m + 5 + 6m3 - 4m*3. Is g(8) a prime number? False Let q(r) = -3492r + 1. Let v(p) = -p*2 - 19p - 1. Let n be v(-19). Is q(n) a composite number? True Let t(n) = -81n2 + 14. Let r be t(6). Let w = -1379 - r. Is w a prime number? True Suppose 0 = 31x - 44x + 1794. Suppose 137t + 3387 = xt. Is t a composite number? True Suppose 43z - 152z + 4281629 = 0. Is z a composite number? True Suppose -22p + 166579 + 1863603 = 0. Is p a composite number? True Suppose -3r - 12 + 69 = 0. Let g = r - 17. Suppose -4p = -4, -p = 5a + gp - 578. Is a a prime number? False Let q be 101/(-6)-2 + (-2)/(-6). Is 8/(-12)(-64209)/q a composite number? False Let r(c) = -c*3 + 15c*2 - 14c - 1. Let l be r(14). Let x be l/(-3) + 45/27. Suppose -g + 609 = -4b, xg + 588 = -4b + 1866. Is g composite? True Let u be 33834/(-18) - 6/18. Is (3 - u/(-15))-33 a prime number? False Let w(g) = 365g2 + 10g + 186. Is w(14) a composite number? True Suppose 0 = 3r - 2c - 47 + 5, -4r + 56 = -5c. Let j(h) = 12h + 18. Let t be j(r). Suppose -4y = 2y - t. Is y a prime number? True Is ((-42322)/5)/((-722)/855 + 8/18) composite? True Let s = -24 + 134. Suppose -y = -2y + 4	{ "pile_set_name": "DM Mathematics" }
alue of ((-15)/(-90)33 + (-3069)/165)-10? 131 What is 341600/2812320 + 6/(-62)? 2/81 Evaluate (126/(-630))/(35/(-6825)). 39 What is the value of (-9)/2((-128)/38 - (935/255 - 7))? 3/19 Calculate -5 - 120/(-204)33. 5/17 452/32(-639 - -631) -113 What is (-422)/9292 + (-99843)/(-2323) + -43? -3/46 What is ((-2178)/(-94380))/((2 - 0)((-12)/(-10))/(-1))? -1/104 What is the value of (-9845)/165 + 59 - 434/(-660)? -1/110 (4172192/(-22413))/(-8) - (-2)/31 70/3 What is ((-41405)/(-325) + -128)/(82/10)? -3/41 Evaluate (1 - (-800)/25) + 180/(-12). 18 Calculate 588/54 + (-80)/12(-180)/(-120). 8/9 Calculate (2550/(-2125)10/8)/(3/34). -17 Evaluate 2585 - 2661 - (15 + -1 + 3 - 1). -92 Evaluate (13 - 13)2/(-20) + 2/213. 2/213 (-24836)/1554 - (-134 + 118) 2/111 What is (-40 - 83750/(-2100) - (4 + 69/(-18)))-301? 86 Calculate -3 + -30 - (20640/(-43))/32. -18 What is the value of ((-14)/82652/(-1547))/(1/((-159)/9))? -53 What is the value of 2/75 - (-14 - 85291/5025)? 31 Evaluate (-1)/(2/(-12))1191/(-1588) + 0. -9/2 (-10)/4((-30186)/3705)/129 3/19 64 + (40 - 210980/2030) 2/29 What is the value of (-18 - (-558)/27)3/280? 1/35 Evaluate (-42)/18 + -10 + 678/54. 2/9 Calculate -35(-100)/(-5250) + 5/((-30)/56) - 72. -82 Evaluate (-1 - (366/15)/2)(-2713320)/331628. 108 What is (-499 - -445) + 194? 22 Evaluate (-16)/((-24)/(-32)15/((-15525)/240)). 92 Evaluate 9 + 4 + (7/(-112))/((-8)/(-1424)). 15/8 (-20)/(-15)90/165 8/11 What is ((-10)/(-6) - 0)(-17928)/(-830)? 36 (-16)/1400-14(-890)/712 -1/5 1/(-4)(29 + -59 + 32) -1/2 Calculate (-440)/(-12) + 1 - (-352)/(-96). 34 What is ((-450)/7800)/(-6 - (28/42)/(8/(-78)))? -3/26 Calculate (-4264)/3198 - (-2 + 62/33)-16. -36/11 Calculate (-4 + 4 + 32)/((-1)/1) - (167 - 175). -24 What is (-7340)/550506/(-20)? 1/25 (30/45)/(56/12)0 + 24 24 ((-11235)/(-18725))/(672/225 + -3) -45 Calculate 40/18(-284814)/79115. -8 What is the value of (118/15)/((-1365)/2275) + 13 + (-24)/27? -1 Evaluate (-32)/2-1 + -14167 + 14113. -38 Evaluate (-317)/(-5) + 2 - -3 - ((-8122)/(-155) - 52). 68 Evaluate (25/6)/((-83 + 89)/108). 75 What is 54/(-63)(-273)/78? 3 94/18 + (-64)/288 + 3 + -52 -44 What is the value of (36/15)/(6/(-12) - ((-1467)/270 - -5))? -36 13 - (49 - -20) - -111 55 Evaluate 10/35 - (-17 + 15 + 5282/(-133)). 42 What is the value of (-4)/(-34) + 5/850-428? -12/5 What is (-30)/(-8 + 3) - ((-94)/752)/(2/208)? 19 Evaluate (-38 - (28 - 200))((-94)/12 + -8 + 16). 67/3 What is (-20 - 4354/(-245))/(16/56)? -39/5 (-5021/210 - (146/17)/(-2))/(-2) 6/17 396/36 - (-1)/((-230)/2500) 3/23 Calculate ((-144)/720)/((-28)/(-560)). -4 What is the value of (-84350)/1015 + (-349 - -432)? -3/29 (88/(8800/(-2250)))/(-10) 9/4 What is (((-20)/(-15))/((-1)/(-24)))/(33866/7257)? 48/7 Evaluate (13 - -26) + -22 - 76/(-3 + 7). -2 What is (-5)/30((-138)/4 - -3)36/(-27)? -7 (-62)/(-12) - -22285/(-1320) 5/12 What is (-196)/35 + (-28269)/(-5265)? -3/13 (-36)/(-114)(-99085)/745 -42 Evaluate (144/(-252))/(1/(2 + 255/(-138))). -2/23 (0 - (-3 - 3)) + ((-85)/(-36))/((-30)/48) 20/9 (8/(-6) + (-22)/(-11))/((-48134)/1761) -1/41 Calculate ((-7)/13 + -1)(-21113)/42226. 10/13 What is (-15)/735-49 + 2/(500/(-246))? 2/125 Evaluate (-8)/(-120)4184/(-276)9/28. -2/35 Calculate 79/(-19750)50 - (-935)/50. 37/2 What is the value of ((-128)/120)/((-1682)/4205)? 8/3 What is the value of 963 + -1045 - (-50 - -3)? -35 Calculate ((-1026)/(-57))/(((-1)/7)/((-43)/(-301))). -18 Evaluate 112254/4942 + 2 + -23. 12/7 What is the value of 39 + (207948/(-117))/43? -7/3 Calculate ((-8)/80 - 0)/(226/133340). -59 182/6 - (14 + (-242)/(-198)-12) 31 (-308)/(-30030)-901/(-4) 3/13 -8 + ((-315)/2310110 - 143/(-7)) -18/7 (-288)/(-2800) + 1286/22505 4/25 ((-13)/9 - -1) + 5362965/(-260901) -21 What is 31((-4)/18 + 407/333)? 31 Calculate (-1202792)/(-1383690) + 6/(-495). 6/7 Evaluate 1 + (-22)/10 - -4457/12540. -1 What is the value of (24/7)/(((-8176)/100 - -82)/((-63)/15))? -60 What is (502/(-10))/((-224)/(-160)) - (-2 - (-80)/70)? -35 Evaluate 2 - (21/(252/(-8)))/(-6 + 0 + 4). 5/3 Evaluate (-198)/(-38) + (59840/(-24320) - 45/(-20)). 5 What is (-588)/99 + (-17 + 66/3 - -1)? 2/33 What is the value of ((-102)/96 - 92/(-1472))/((2 - -5)1)? -1/7 Calculate (295/413168/900)/(34/(-780)). -26/3 Evaluate (-10)/((-1360)/56)((-102)/119)/((-2)/10). 30/17 What is the value of ((-218)/4251 - (-2196)/1755)(-2 - 38)? -48 What is (-278200)/(-128400)(-2)/(-533)? 1/123 Evaluate (-230)/(-207) - ((-50500)/1980)/(-25). 1/11 Calculate (2/6)/(9(112/(-18) + (-238)/(-1071))). -1/162 63/(-630)162/1377 -1/85 (-10 + 14 + -1)(-7 + 6)/(-111) 1/37 What is the value of 4/((-16)/36) - (8/20 - 106/(-10))? -20 ((-90)/12 - 1)(-148)/370 17/5 Calculate -9 + 6/(1/(-32)-60)(-175)/14. -49 What is 100/125 + (-222)/90 + 278/12? 43/2 What is 26/(-56) + 0 + (-3000)/(-4000)? 2/7 What is (47 - (-7498)/(-161))/(2/(-364))? -78 What is (-2068)/360 - (-161)/(-2898)? -29/5 666(-123)/11808 - (-2 - (-33)/16) -7 What is the value of (160/36)/4(62 - (-4031)/(-58))? -25/3 What is (19 - 2134/110)/(((-2)/20)/(64/(-32)))? -8 (1/64)/(32/(-24544)) + 62 + -22 + -28 1/64 Calculate 665(-2136)/(-10680). 78 Evaluate 840/(-20) - ((-21)/18)/(17/(-102)). -49 What is the value of 11600/280 - 41 - (-38)/(-133)? 1/7 What is (204/17654 + 4/(-44))4/(-10)? -25 Evaluate (-27)/643666/16497. -3/32 What is the value of 2(-2)/(-26) - 365/((-29252925)/(-8768))? 2/45 Calculate (-11)/15 + ((-196)/462)/(-10(-3)/(-165)). 8/5 What is the value of 0 + -3 - 70 - (810 - 834)? -49 Evaluate (12/14 - (3 - 7/3))(-4744)/(-66416). 2/147 What is (-5)/22(-4 + 5) + (-13585)/(-2695)? 2/49 What is the value of 4-3((-7 - (-10)/4) + (-38)/(-152))? 51 Calculate 8/(-6)(-291)/(-970)((-81)/(-66) - 1). -1/11 What is (-26)/(5278/(-2523)) - 11? 10/7 Calculate (1180/(-472))/(2 - 1 - -4). -1/2 What is (47477/25305 - (-17)/((-6120)/(-16))) + 4/18? 15/7 Calculate ((-5)/(-22))/((-252875)/32725). -1/34 What is the value of (-45 - -31)/(((-7)/(14/6))/((-4)/24))? -7/9 Evaluate -59 - 24/((-2)/13 + (-21330)/780 + 26). -43 Evaluate (383 + -395)/((4/10 - 228/(-30))/(-2)). 3 (-880)/1120(2 + 1)(-40)/110 6/7 What is the value of (0 + 0 - -4) + -144 + 12535/115? -31 ((-2)/4)/(5 - 2895/580) + (157 - 153) -54 ((-1026)/(-171))/(1/(-2) - 1) - (0 - -14) -18 What is 204/(-3)(10/12)/(-86 - (-77669)/909)? 102 Evaluate (480/(-1188) - ((-4)/22)/1) + (-237395)/3555. -67 ((-9)/15393)/(-139 + 140) -1/57 What is ((-4)/(-42))/((-30)/4095-78)? 1/6 Evaluate (2/(-2) - 14)(-22728)/79548. 30/7 Calculate 714/49(-89 + -6)/(-19). 10 Calculate (-306)/(-4) - 11436/7624. 75 Calculate (1/7)/((2263/1095 - 2) + (-106)/(-210)). 1/4 (30/(-33))/((-217)/9548) 40 What is (-9)/(-84)3840/(-360)? -8/7 What is ((-238)/12)/17(2 + 1 + 3)? -7 Calculate (-174 - -134) + (92 - 4). 48 Evaluate 4/((-1420)/5)(-159)/(6837/(-86)). -2/71 Evaluate 1/(-18) - (-8372)/23400-25. -9 37883/(52290/180) 108 Calculate (-1 + 9)/(11188/24299). 94 6/21 - (2 - 10)/(11704/66880) 46 Evaluate 5/35 - (-43)/(1204/(-24)). -5/7 Calculate (-125)/(3125/1200) - (19 - 16). -51 What is the value of (-223)/25 + 9 - 91773/2475? -37 (2210/8840)/(1 + (-20)/19) -19/4 What is 11 + 266/846 - (3 - -11 - 2)? 18 (16/12)/(16 - (-13 - 4011/(-126))) -8/17 What is the value of (2030/116 + -14)(2 - 3)? -7/2 (-7 - 0)(532/147)/(-38)(3 + 24) 18 What is ((-1474)/187 + 8)(2 + 0)? 4/17 Evaluate 115200/5850 - 286/169. 18 ((2 - -20) + 2)((-8)/42)/((-34)/119) 16 What is the value of ((-3193596)/(-1160))/171 + (-38)/5? 17/2 Evaluate (-26 + -32)/((-40)/28 - (10 + (-73)/7)). 58 Evaluate ((26 + -40 + -15)/(2/6))/(12/(-8)). 58 What is the value of -16((-4)/70-5)/(8/(-140)-20)? -4 Evaluate ((-140)/(-300) - (-1)/3) + (-5 - (-216)/55). -3/11 What is the value of (-9540)/(-69615) - (-3 - (-60)/16)(-16)/(-78)? -2/119 Calculate (-51260)/12870 - (32/(-16) - 2). 2/117 (-1)/((-1)/(-12)) + 124470/1728 + -60 1/32 Calculate 13(-70)/9555 - (4 + (-4544)/966). 14/23 Evaluate 303(-255)/(-17170)(-16)/63. -8/7 Evaluate (221/(-39) - -5)(-5 + 2 + (-1 - 38)). 28 Calculate (349/(-9))/(-1) + (-15 - (-24 + 1975/225)). 39 Calculate 69 + -164 + (-92400)/(-975). -3/13 Evaluate 52/18(42 - 38136/910). 4/15 (-2)/(-34) + 79058/287997 1/3 What is ((-5186)/(-62232))/(-1	{ "pile_set_name": "DM Mathematics" }
p(w) prime? True Let h(p) = -59p + 3. Let j(k) = -k3 - 2k*2 + 4k - 1. Let l be ((-6)/(-4))/((-3)/6). Let m be j(l). Is h(m) a prime number? True Suppose r = -4, 4d - 3r = 4 - 0. Let w be -942/8d. Suppose -2c + c = -w. Is c a prime number? True Suppose -3i - 12 = 3a, 0 = 4i - 7i + 3a + 18. Let z(l) = l3 + l2. Let v(j) = 60j3 - 8j*2 + 2j - 1. Let y(r) = v(r) + 6z(r). Is y(i) prime? False Let g be (-442)/(-12) - (-9)/54. Suppose g = -2v + 3w + 524, v - 240 = -2w. Let i = 405 - v. Is i a prime number? True Suppose -2z + 8 = -6z + 4y, 5z = -3y - 18. Let l(w) = w2 + 6. Let m be l(z). Is (-2)/6 - (-1730)/m prime? False Suppose -16v - 111702 = -22v. Is v prime? True Let h(b) = b2 + 4b + 3. Let v = 12 - 8. Suppose 0k + vk + 22 = u, 3k + 9 = 0. Is h(u) a composite number? True Suppose 11t = 33930 + 17891. Is t a composite number? True Let y(z) = 1902z - 1. Let j(v) = 7609v - 5. Let i(q) = 2j(q) - 9y(q). Let o be i(-1). Suppose -5b + o + 346 = 0. Is b prime? True Let x(m) = m - 7. Let k be x(-8). Let h(v) = -11v + 6. Let r be h(1). Is 373r3/k a prime number? True Suppose 16s = 13s + 5262. Is s a composite number? True Let y(f) = -19f3 - f. Let w be y(-1). Let r be (-13 - -33)/(2/w). Suppose 4q + 4h - r = 0, -3q + 5h - 144 = -6q. Is q a prime number? True Suppose -9404 = -4k + 240. Let m = -1722 + k. Is m a composite number? True Suppose i = 3i + 3x + 11, 3x = -5i - 5. Suppose ic = 1355 + 2795. Suppose a + c = 6a. Is a a prime number? False Let i = -17366 - -44295. Is i composite? True Is 43800/20 + (-1 - -6) composite? True Suppose 5n + 3x = 56782, -x + 45429 = 4n - 2x. Is n composite? True Let m = 12485 + 3242. Is m prime? True Let f be (-18)/(-4)(-7 + 9). Is (1 + -258)/(f + -10) composite? False Let v = 9 - 11. Suppose -2q + 4d - 864 = -68, 0 = 5q - 2d + 1950. Is (q/10)/(v/10) prime? False Let d = -1196 - -1955. Suppose -3n + 0n + d = 0. Is n composite? True Let o(h) = -6h2 - 57h - 2. Let n(x) = 2x2 + 19x + 1. Let u(i) = 7n(i) + 2o(i). Let r(j) be the first derivative of u(j). Is r(9) a composite number? True Suppose -25 = -4o - 0c - c, -5c = -5. Let p = -6 + o. Suppose -254 = -3q + 5n - 2, p = 4n - 12. Is q a composite number? False Let q(y) = 300y3 + y2 - 3y + 1. Let f be q(2). Suppose 0 = -5z + 4z - 2u + 471, f = 5z - u. Is z composite? False Let z = 9 - 9. Suppose 0 = -za + 2a. Suppose a = -2s - 53 + 307. Is s prime? True Suppose 4j + 4a = 94302 + 119594, -20 = 4a. Is j prime? True Suppose 154 = 2p - 2x, 2p + x = -x + 170. Let h = p + -50. Is h prime? True Suppose -3382 - 6274 = -8h. Is h prime? False Let q be 693/2 + (-1)/2. Suppose a - 213 = -4w, 2a - 3w - 2w = 374. Let u = q - a. Is u a composite number? False Suppose -14 = 5c + 6. Let z(r) = 3r*2 + 7r + 6. Let t be z(c). Suppose -t = -g + 4j + 157, -5j - 990 = -5g. Is g a composite number? True Let h be -1 - (-18)/30 - (-24)/10. Suppose 9 = o - 3c + 2, -ho = 2c - 46. Is o a composite number? False Suppose 10d - 9d - 32 = 0. Suppose 4l = -0l + d. Let g = l + 363. Is g a composite number? True Suppose 4i = -p + 19948, -4i + 3i - 5p = -4987. Is i a prime number? True Suppose -8p = -5p - 534. Suppose 0o + p = 2o. Is o composite? False Let i be -1(5 + 0) - -2. Let g(k) = -65k + 2. Let b be g(i). Let r = b - 130. Is r composite? False Suppose 0 = 7t - 4t - 285. Let w = t + -48. Is w a composite number? False Let a(v) = 2v - 7. Let d be a(5). Let c be -3 + 2 + 6 - d. Suppose -ct = -92 - 26. Is t composite? False Suppose 69v - 51v - 147366 = 0. Is v a prime number? False Let s be (26/(-2))/((-301)/49 - -6). Suppose 0 = 2z - 547 - s. Is z prime? False Suppose 0 = 3k + k - 5c - 68313, -5k + 85386 = -c. Is k a composite number? False Suppose q - 8 = -3i, 0 = i - 2i - 2. Suppose 3v = -4x + 443, -x - 451 = -3v + 3x. Suppose qc - v = 13c. Is c composite? False Let f(h) = 102h2 - 14h + 27. Is f(2) prime? False Suppose 1346 = h + 2q - 6q, 0 = -5h + q + 6787. Let t = h + -696. Is t prime? False Let p = 990 + -361. Is p prime? False Suppose -190 = -3g + g. Suppose -o + 2z = -3 - 3, o = -5z - 15. Suppose 5m - g - 20 = o. Is m prime? True Suppose -3w - u + 14164 = 0, -5u - 14158 = -2w - w. Is w prime? True Let a be 2/(8/(-10))(-124)/5. Suppose -2f - a = -180. Is f prime? True Let g be (3 + -1)/(2/3508). Suppose o - g = -3o. Is o a prime number? True Suppose 0 = k - 2v + v - 10713, -5k = -3v - 53557. Is k a composite number? False Let x be (-10)/15 + (-5912)/(-12). Suppose -m + x = 54. Suppose u + z = 215, -3z - m = -2u - 7z. Is u a prime number? True Let u = 316 - 224. Suppose 5z - 231 = -o, -327 = -5z - 4o - 93. Let w = u - z. Is w a composite number? True Let u = -1811 + 4920. Is u a composite number? False Suppose -114f + 103f + 30943 = 0. Is f a composite number? True Suppose -65796 = 8k - 203692. Is k composite? True Let l(u) = -34u*3 - 29u*2 - 2u + 4. Is l(-9) a prime number? False Suppose -4m + 4r + 872 = 0, 292 + 595 = 4m - r. Is m a composite number? False Suppose 95a - 92a - 14663 = 4g, -19544 = -4a + 2g. Is a a prime number? False Suppose 3d - 3o - 115930 = 103442, 2d = 3o + 146251. Is d composite? False Suppose 0 = -3c + 20 - 5. Suppose -5d + 0l - l = -7, -3d + cl = 7. Let h = d - -52. Is h composite? False Let f(g) = -485g + 23. Is f(-3) a prime number? False Let q(j) = -j*2 - j + 953. Let i = -26 - -26. Is q(i) prime? True Suppose 22 = j - 78. Suppose 4w + 2b = j, -3b - 57 = -5w + 2w. Is w composite? False Suppose -92 = -3j + 112. Is (-4)/(48/(-33))j composite? True Let o = 287 + -29. Suppose m = -7 + 2, -m = 5n + 15. Is n/(-4)-2 + o a prime number? True Let i = 3 + 3. Let q be 6/(-2)(-10)/i. Suppose qh = 3x + 370, -5x - 309 = 3h - 7h. Is h a composite number? False Let z(o) = 188o + 24. Let j be z(12). Let c = -1483 + j. Is c a prime number? True Let y(l) = 5l + 19. Let f be y(-3). Suppose m = 2a + 741, -a - 6 = -f. Is m composite? True Suppose 90615 = 19d + 2d. Is d prime? False Suppose -p - k + 2 = 0, 4k - 8 = -4p - k. Suppose 5n + p = 4b - 3, -16 = 3n - 5b. Suppose -nc = -235 + 70. Is c composite? True Let a(k) = -272k - 229. Is a(-14) prime? False Let m = -33 - -38. Suppose mg - 566 = 389. Is g composite? False Suppose -6h + 205 = -65. Suppose 0 = -0j + 2j + 4. Is 5709/h - j/15 prime? True Let a(p) be the first derivative of -p2/2 - 7p - 2. Let c be a(-12). Suppose -2f - cu + 678 = -3u, 0 = 3u. Is f prime? False Let p(m) = -8m - 21. Let y(i) = 5i + 19. Let f be y(-6). Is p(f) prime? True Suppose 0 = -g + 5g + 4. Let j be g + 9 - 68/17. Suppose -3i + 282 = 3w, 3i + 40 = -jw + 322. Is i composite? True Suppose 5b + 10 = 35. Suppose 5o = -4z + 2403, -bz = -2o - 0o + 948. Is o composite? False Let y be 198/9(-52 - -1). Let m be y/8(2 + -6). Let z = 1004 - m. Is z prime? True Let m = 3964 + -2783. Let p be (220/176)/(2/8 - 0). Suppose -156 = pf - m. Is f a prime number? False Let w = 6081 + -1019. Is w a composite number? True Let h(v) = 10v2 - 11v + 76. Is h(-15) a composite number? True Suppose -5s = -4w - 6297, 2s - 907 - 1625 = -5w. Is s a composite number? True Let d = 2039 - 306. Is d a prime number? True Suppose u = 732 + 416. Suppose 4p - u = -0p. Is p a prime number? False Suppose -f + 8 = 3. Let s(a) = -118a + 56. Let u be s(-6). Suppose -4h + fm = -u, -3h = -m - m - 573. Is h prime? True Let u be 112/(-5) - (-48)/(-80). Suppose 0 = 5n + 22 - 652. Let b = n - u. Is b a composite number? False Let a = -2313 - -3316. Is a prime? False Suppose -47773 = -71x + 82228. Is x a prime number? True Suppose -10 = 8k - 10k. Suppose 0 = w - 3w + 2q + 8, -2q - 12 = -3w. Suppose kx = -3d + 167, -wx = -9x + 4d + 139. Is x prime? True Is 24484-64/(-96) composite? False Let s = 13067 - 336. Is s prime? False Is (20872/28)/(4/14) - -2 prime? False Suppose 0 = -149r + 17522584 - 2412941. Is r a prime number? False Suppose 3s - 6878 = -0s - 2b, 3s + 3b - 6873 = 0. Suppose -5n - 5725 = -5y, 0 = -4y + 6y - 4n - s. Suppose -22m + y = -20m. Is m a composite number? False Let z = -68 - -136. Suppose 3*	{ "pile_set_name": "DM Mathematics" }
4) - 11/(484/(-16)). What is the closest to -1 in 5, -2/13, -5, v? -2/13 Let n = -0.97 - 0.03. Let y = -139 + 139.006. Let o = y + -0.606. What is the nearest to n in 3, o, 2/5? o Let b = -1/8873 - -541256/26619. What is the nearest to -2/7 in 0.3, -31, b? 0.3 Let j(w) = -3w2 + 21w + 437. Let d be j(16). Let s = -9 + 8. Which is the closest to s? (a) -0.07 (b) d (c) -4 a Let l = -75 - 407. Let p = l - -482.07. What is the nearest to 1 in p, -0.5, 8? p Let l = 27/514 - -1353/3598. What is the closest to -0.18 in -306, -0.3, l? -0.3 Let x = -16672/25011 + -2/25011. Let s = 25 + -67. Let k be (-14)/(-49) - 2/s. Which is the closest to k? (a) x (b) 3/5 (c) 2/15 c Let l = 0.04 + 5.96. Let j = l + -7. Suppose 3v = 3d - 3, 4v + 3d - 35 = -32. What is the closest to j in 2/3, 2/13, v? v Let d be -54 + 48 - (0 + -2). Let f = -6 - -3. Which is the closest to 0.2? (a) d (b) -5 (c) f c Let r = 4.1 + 0.9. Let x be 8 - 12/(-16)-372. Let m = 269 + x. Which is the closest to -1? (a) -2/9 (b) m (c) r a Suppose 473 + 1039 = 12y. Let r be (6 + (-828)/y)/((-20)/14). Let f = 0.1 + -0.6. Which is the closest to -4? (a) f (b) r (c) -5 c Let k = 2.95385 + 0.04615. What is the closest to 1 in k, -0.2, 76? -0.2 Let i = -25884 - -25879. What is the closest to -1 in -4, 3519, 0.1, i? 0.1 Let u = 400 + -1201/3. Let m = 13/15 - 1/5. Let t = 0.14 + 8.86. Which is the nearest to m? (a) -2 (b) t (c) u c Let j be 1/2 + 28/(-40) - (-24)/20. What is the closest to j in -16, -2/9, -2/3? -2/9 Suppose -4d = -15 - 45. Let f = 5/277 - 287/554. Which is the closest to 1? (a) f (b) 0.05 (c) d b Let x = 1098/11 + -100. Let n = -156295/208372 + 4/52093. Which is the closest to n? (a) 0.2 (b) -0.1 (c) x (d) -6/13 d Let w = 11502 - 11501. Let y = 2 + -1. What is the closest to y in 4, 0.5, w? w Let t = 4.302 + -0.792. Let n = 5.51 - t. Which is the nearest to -2/13? (a) 0 (b) n (c) 1 (d) 4 a Let h be (16/(-4))/(112/(-24)-3). Which is the nearest to -15? (a) h (b) -4 (c) 9/2 b Let l = -9304 - -9303.9. What is the nearest to l in 2/13, -21, 0.36, -0.3? -0.3 Let y = -579.8 + 584.8. Which is the closest to -4? (a) y (b) -0.3 (c) -43 (d) 0.2 b Let f = 7.31336 + -0.31336. Which is the closest to 1/5? (a) 0 (b) -3.7 (c) f a Let y = -12250 + 12250. Which is the closest to 8? (a) 0.4 (b) 8 (c) -2/11 (d) y b Let x be -3 - (-9)/4 - 1359/(-36). Let f = -145/4 + x. What is the closest to -2 in f, -0.3, 4? -0.3 Let l = 3056 - 9169/3. Which is the closest to l? (a) -5 (b) -1 (c) 2 b Let h = 0.11344 + 1.28656. Which is the closest to 2? (a) h (b) -2/9 (c) -0.2 a Let x(v) = -v*2 - v + 20. Let j be x(-5). Suppose w + 3h = -jw - 11, -3w - 13 = -h. Let k = 0.1 + -0.2. Which is the closest to k? (a) w (b) 10 (c) 1/8 c Let o be (-4756)/(-1595) + -2 + -1 + (-1)/(-5). What is the closest to -2/3 in 2/29, 3, 26, o? 2/29 Let n = 73.23 + -70.23. What is the closest to -1/3 in -2, -359, n? -2 Let b = -2807 + 2804. What is the closest to 1/2 in -1502, b, -5? b Let l = 5213.62 - 5212. Which is the closest to 0.4? (a) -1 (b) l (c) 4 b Let m be -2 - 36/(-24)1. Which is the closest to 0.1? (a) m (b) 5 (c) -4/133 (d) -2 c Let l(m) = m2 + 95m - 2437. Let f be l(21). Which is the closest to f? (a) -3/32 (b) 2.5 (c) 0.4 a Let f be 0 + (-3)/(-2) - 0. Suppose 11u + 9500 = u. Let h be ((-20)/u)/(1/(-5)). Which is the closest to -0.1? (a) -7 (b) f (c) h c Suppose -5u = 2d + 41, -u + 0d - 19 = -5d. Let s be u/11 + (7 - 13)/(-6). What is the nearest to -2/7 in 15, s, 3/8? s Let g = 83.7 + -108.7. Let w = g + 27. What is the closest to 2/5 in -3/5, w, -0.3, -0.5? -0.3 Let k = -0.1166 + 0.2166. Let f = -20 + 15. Let n be 5/(-5) + 1/2. What is the nearest to k in f, n, 2? n Let w = 137 + -126. Suppose 69n - 28 = 76n. What is the nearest to n in 3/5, -3, w? -3 Let h = 4109/8 + -513. Let s = -9.3 + 8.3. Which is the closest to s? (a) h (b) 2 (c) -2/9 c Let m = 92.096 - 92. Let k = 0.104 + m. Let t = -0.6 - -1.2. What is the nearest to k in t, -1, 5? t Let u = -21290 + 21760. What is the nearest to u in 0.5, 0.1, 3? 3 Let m be (72/15)/(30/1275). Let t = m - 611/3. Which is the closest to -1/4? (a) -0.5 (b) t (c) -0.2 (d) 4 c Let y = -0.112 - 40.288. Let w = y + 40.8. Which is the nearest to -1? (a) -2 (b) -2/11 (c) w (d) -4 b Let x = -349 - -342.33. Let b = x + 1.67. What is the nearest to b in -2/15, -2, 3? -2 Suppose 3y = -2n - 66, -3y - 2n + 5n - 81 = 0. Let t be (-1)/((-6)/y) + (-52)/(-14). Let w = -1 + 0.6. Which is the nearest to 1? (a) t (b) w (c) -6 a Let p be 14/(-6) - 8/(-4). Let u = 379.4 - 374.4. Which is the nearest to p? (a) 1/3 (b) u (c) 0.1 c Let p = 1616.4 + -1615. Which is the closest to -1? (a) p (b) 6 (c) -7 a Let m = 0.46617 + 0.13383. Let l = 13 + -14. Let f be l/(8/126). What is the closest to 1/2 in -0.4, f, m? m Let w = -4.9 - -7.99. Let m = -1.78 + w. Let f = -0.31 + m. What is the nearest to 2 in 1/8, f, 0.5? f Let g(l) = 20l + 1. Let z be g(1). Suppose -67 = -12q + 33 + 176. Let v = z - q. Which is the closest to v? (a) -2 (b) -5 (c) -0.5 a Suppose -c + 2j - 32 = -13, 0 = 4c + 5j - 2. What is the closest to c in 0.3, 1/5, -2/9, -4? -4 Suppose -16 = 2k - 4u, -4k + 1 = u - 12. Let j(g) = g2 + 11g - 22. Let m be j(k). Let f = -2 - -4. What is the nearest to -2 in 0.3, m, f? 0.3 Let f = 404 - 346. Let o = f + -54. What is the closest to -4 in -2, o, 3/7? -2 Let q(v) = 2v3 - 17v*2 + 25v - 10. Let t be q(7). Suppose -5a - t = g, a - 6a = -5g. Let l = 2 - 1.8. What is the nearest to -2 in 0, l, a? a Let v = 0 + -2. Let w = -0.35 + 43.35. Let j = w - 40. Which is the closest to j? (a) v (b) -2/19 (c) 1/2 c Let n be 2/(-2)70/7. Let c be 4/6 - n/3. Let l be ((-2)/c)/((-3)/((-132)/2)). What is the nearest to -0.1 in l, 3, 0.3? 0.3 Let g = 422 - 421.9772. Let p = g - 0.4228. Let w be ((2/4)/(-1))/(-1). What is the closest to 2/7 in -5, p, w? w Let t = -9 + -4. Let y = t - -13. Suppose 0 = 7r - 13 + 20. Which is the nearest to r? (a) 3/2 (b) 4 (c) y c Let j = 10086 + -10088. Let o(x) = x3 + 4x*2 - 2x. Let g be o(3). Let c = 401/7 - g. What is the nearest to c in -2/9, j, -0.5? -2/9 Let h = -34 - -58. Let u = 35 - h. Let j = -11.3 + u. What is the nearest to 2/7 in 2, j, -5? j Let v be (-84)/208 - (534/78 - 7). Which is the closest to 0.1? (a) -10 (b) -3 (c) -6 (d) v d Let l = -102.8 - -112. Let j = l + -9.69. Let h = j + 0.39. Which is the closest to 2/5? (a) 5 (b) -4 (c) h c Let f = 664.041 + -0.041. Which is the nearest to 1? (a) f (b) 0.4 (c) -0.5 b Suppose -65k + 67k = 42. Let u be (-6 - (-112)/k)3. What is the closest to 2/7 in -0.42, u, -4? -0.42 Suppose 0 = -d - b + 9 - 6, -d - 11b = -13. What is the closest to 0.1 in d, 6.8, -2? d Let v be (-1 + 2 + -2 + 39/26)/1. What is the nearest to v in -2, 2/53, 82? 2/53 Let o be ((-290)/58)/(1/(-2)). Let j be 3/(-12)1032/o. Suppose -4s - 12 = -0. What is the nearest to -1 in j, s, -4? s Let s = 0.1 - -0.1. Let u = 0 - s. Suppose 2p = 31d - 30d + 3, -3p - 2d = 20. What is the nearest to p in 4, -5, u? u Let l = 15 - 13. Suppose -l + 0 = h. Let w be (-4)/10 + (520/(-75))/26. What is the nearest to h in -5, -2, w? -2 Let h(c) = -c*2 + 19c - 53. Let w be h(3). What is the nearest to -2/7 in w, 1, 17? 1 Let w = -489.6 - -10.6. Let a = -474 - w. What is the nearest to -2 in -4, 0.4, a, 1? -4 Let q = -14446 + 187792/13. Which is the closest to 1.6? (a) 0.2 (b) -4 (c) q a Let m(i) = -4i - 94. Let f be m(-16). Let d be (-8)/36f/40. What is the closest to -0.4 in 1/5, 1, d? d Let h = 53 - 64. Let z = h - 3. Let n = z - -41/3. Which is the closest to -6? (a) 0.1 (b) -0.5 (c) n b Let o = -0.4911 - 0.0139. Let v = o - -1.005. What is the nearest to 0.2 in -0.04, v, 0.04? 0.04 Let o = -0.3 + 0. Suppose 9b = 4b + 25, -3q + 2b = 25. Let z = q + 7/2. What is the closest to 0 in o, 5/4, z? o Let u(v) = -10v2 - 349v - 5. Let g be u(-35). Which is the nearest to 2.2? (a) -0.4 (b) -2 (c) 2 (d) g c Let q = -9148/3 - -3049. What is the closest to 3 in -3/5, q, -23, -1/11? -1/11 Let x = 3614 - 3618. What is the nearest to 0 in -30/23, -1/4, 2, x? -1/4 Let s = 18245.3 - 18245.3. Let n = 5/23 + 3/92.	{ "pile_set_name": "DM Mathematics" }
, -1, 1, 22 Suppose x*2/2 - 1170813x/2 + 19317870 = 0. Calculate x. 33, 1170780 Let 34c5/7 - 1994c*4/7 + 30754c*3/7 - 94214c*2/7 + 96220c/7 - 4400 = 0. Calculate c. 11/17, 1, 2, 20, 35 Factor f*2/4 - 43820894f + 1920270750959236. (f - 87641788)*2/4 Find p such that 3p*3/2 - 198p*2 - 5756985p/2 - 1414857981 = 0. -757, 1646 Determine b so that 3b4/8 - 2595b*3/2 + 1295511b*2/4 + 1303299b/2 + 2611791/8 = 0. -1, 273, 3189 Factor -3j3/8 + 42129813j*2/8 - 147910116349485j/8 + 147910074219675/8. -3(j - 7021635)2(j - 1)/8 Factor -4277z3/5 + 42071z*2/5 - 19987z - 3495. -(z - 5)*2(4277z + 699)/5 What is i in -4i*4 - 756560i*3 - 199523796i*2 - 13361225528i - 25930408288 = 0? -188876, -131, -2 Find o, given that 27o5/2 + 118413o*4 - 26540439o*3/2 - 4541817o*2 + 11778198o + 5915412 = 0. -8882, -2/3, 1, 111 What is c in -332c5 - 60816c*4 + 664c*3 + 121632c*2 - 332c - 60816 = 0? -15204/83, -1, 1 Factor c*2 - 4691c + 125928. (c - 4664)(c - 27) Factor 3z*2 - 50292z - 11932596. 3(z - 16998)(z + 234) Solve -2n3/3 - 2098n*2/3 - 126040n/3 - 1778744/3 = 0. -986, -41, -22 Factor 3b3 - 5250945b*2 + 2297694072981b + 6893129477529. 3(b - 875159)2(b + 3) Determine m, given that 3m4 + 1029m*3 + 71337m*2 + 1020051m - 1092420 = 0. -255, -68, -21, 1 Suppose 4a5 + 392a*4 - 3140a*3 - 307720a*2 + 3136a + 307328 = 0. What is a? -98, -28, -1, 1, 28 Suppose 3b5 + 3948b*4 + 1302744b*3 + 2475486b*2 - 37671723b - 38848410 = 0. What is b? -657, -6, -1, 5 Let -3c5 - 585c*4 + 22923c*3 + 765921c*2 - 788256c = 0. What is c? -224, -23, 0, 1, 51 Solve 2h3/11 + 182932h*2/11 + 4191416754h/11 + 384063562296/11 = 0 for h. -45687, -92 Let -3105h4 - 2580250h*3 + 20907015h*2 + 52068240h - 83900 = 0. What is h? -839, -2, 1/621, 10 Find l, given that -500l5/21 - 1690l*4/7 - 194l*3/21 + 1710l*2/7 + 694l/21 - 20/7 = 0. -10, -1, -1/5, 3/50, 1 What is q in q*5/3 + 261287q*4/3 + 17068116016q*3/3 + 51201996488q*2/3 - 1045136q/3 - 68269328656/3 = 0? -130642, -2, 1 Factor 4i3 + 1424i*2 + 127964i + 1240624. 4(i + 11)(i + 133)(i + 212) Suppose k3/2 - 6000k*2 + 37787925k/2 - 5295423875 = 0. Calculate k. 310, 5845 Factor -2m2 - 80098m/11 - 240096/11. -2(m + 3)(11m + 40016)/11 Factor -2y*2/17 - 151558y/17 + 303124/17. -2(y - 2)(y + 75781)/17 Suppose 2w2 + 37976w + 493350 = 0. What is w? -18975, -13 Determine c so that 5c2 - 380c - 5421600 = 0. -1004, 1080 Factor 14i2 - 507092i + 1014128. 2(i - 2)(7i - 253532) Factor 21k*2/5 + 86019k/5 + 2944908. 3(k + 179)(7k + 27420)/5 Suppose -3m*5 + 170m*4 + 120m*3 - 3510m*2 - 4597m - 1140 = 0. What is m? -4, -1, -1/3, 5, 57 Find d, given that 2d3/17 + 36418272d*2/17 = 0. -18209136, 0 Suppose -265081w*4/2 - 2385731w*3 - 14314410w*2 - 28628964w - 432 = 0. What is w? -6, -4/265081 Factor f*3 + 40f*2 - 319081f - 15613360. (f - 569)(f + 49)(f + 560) Find s such that -4s2 + 82780s + 31519224 = 0. -374, 21069 Suppose 4s5 - 19100s*4 - 267908s*3 - 1321220s*2 - 2604896s - 1532480 = 0. What is s? -5, -4, -1, 4789 Find k, given that 2k5/19 - 172k*4/19 - 8900k*3/19 - 24920k*2/19 + 8898k/19 + 25092/19 = 0. -34, -3, -1, 1, 123 Determine t, given that -4t4/3 - 5180t*3 - 210500t*2 - 4167820t/3 - 1183952 = 0. -3844, -33, -7, -1 Suppose -g*4 + 10478g*3 - 27841028g*2 + 2056610626g - 2028780075 = 0. What is g? 1, 75, 5201 Find d, given that -d*2/2 + 26196d - 628416 = 0. 24, 52368 Suppose 2k2/3 + 21457862k/3 + 42915716/3 = 0. What is k? -10728929, -2 Factor -11h3 - 1487h*2 - 43786h - 7912. -(h + 43)(h + 92)(11h + 2) Let -835q*5 - 197065q*4 - 10206550q*3 - 198908010q*2 - 1338988455q - 8010765 = 0. Calculate q. -173, -21, -1/167 Determine s, given that 4s2/5 + 104632s/5 - 41856 = 0. -26160, 2 Suppose 4p2 + 392190376p + 392190372 = 0. Calculate p. -98047593, -1 Factor -5i3 - 15670i*2 - 31200i + 375840. -5(i - 4)(i + 6)(i + 3132) Factor -4u*2 - 73914888u. -4u(u + 18478722) Determine g so that -5g3 - 751705g*2 + 15787910g - 15036200 = 0. -150362, 1, 20 Factor 3a3 + 7599474a*2 + 15198936a. 3a(a + 2)(a + 2533156) Solve 4y*5/3 - 44y*4/3 - 10984y*3 + 231560y*2/3 - 364108y/3 + 55180 = 0. -89, 1, 5, 93 Let 2r2/15 - 556996r/5 + 1670986/15 = 0. What is r? 1, 835493 Solve -5w3/3 - 1165w*2 + 6451910w/3 = 0 for w. -1538, 0, 839 Factor 2j2 + 3982j + 690816. 2(j + 192)(j + 1799) Factor 2l2 + 44630960l - 44630962. 2(l - 1)(l + 22315481) Factor 4j2 + 190676j + 1715760. 4(j + 9)(j + 47660) Factor 5k3 - 448625k*2 - 8076785k - 7628155. 5(k - 89743)(k + 1)(k + 17) Factor -2o*3 + 23644o*2 - 236272o + 377984. -2(o - 11812)(o - 8)(o - 2) Suppose 2a*2 + 5358a - 33451704 = 0. Calculate a. -5643, 2964 Solve -3v3 + 167511v*2 - 1172298v - 7369560 = 0 for v. -4, 11, 55830 Determine l so that 85l3 + 765015l*2 - 630085l - 135015 = 0. -9001, -3/17, 1 Factor -22a2/5 - 2899902a + 43498728/5. -2(a - 3)(11a + 7249788)/5 Suppose -5i*2 - 5897755i - 5897750 = 0. Calculate i. -1179550, -1 Suppose i*3/7 + 376i*2/7 + 30451i/7 - 33132 = 0. What is i? -251, -132, 7 Determine j so that 45j5 - 984j*4 - 2697j*3 + 8568j*2 + 20628j + 2592 = 0. -3, -2, -2/15, 3, 24 Suppose 3b5 - 1800b*4 + 49779b*3 - 56694b*2 - 881964b - 1110024 = 0. Calculate b. -2, 6, 27, 571 Factor 5v2 + 5210805v + 5210800. 5(v + 1)(v + 1042160) Factor -g*4/5 + 1053572g*3 + 31607184g*2/5 + 63214384g/5 + 42142928/5. -(g - 5267866)(g + 2)3/5 Factor -d3/9 - 3005d*2/9 - 667d + 1001. -(d - 1)(d + 3)(d + 3003)/9 Factor 2a4/9 + 3770a*3/9 - 164169950a*2/3 - 4707036885250a/9 - 12325105813300000/9. 2(a - 18800)(a + 6895)*3/9 Suppose 35325c*4 - 20220005c*3/6 + 2686731c*2/2 - 268153c/2 - 95/6 = 0. What is c? -1/8478, 1/5, 95 Factor -2x2/7 + 6744x/7 - 2131414/7. -2(x - 3019)(x - 353)/7 Find j, given that 10448281993729683j2 + 7081790280j + 1200 = 0. -20/59014919 Let 115u4 - 31620u*3 + 2071440u*2 + 17012800u - 395136000 = 0. What is u? -16, 252/23, 140 Find r, given that 5r2/3 + 32735r/3 + 3838170 = 0. -6174, -373 Find a such that a*2 - 18832088a + 18832087 = 0. 1, 18832087 Find w, given that 2w4 - 47936w*3 + 1197374w*2 - 5362056w - 28156968 = 0. -3, 14, 23943 Suppose -62t4/9 - 17110t*3/9 - 138758t*2/3 + 1494t = 0. Calculate t. -249, -27, 0, 1/31 Factor -2k4 + 51616k*3 - 340123772k*2 + 91584075360k - 6296529384450. -2(k - 12765)2(k - 139)*2 Find w such that -4w*3 + 4186776w*2 = 0. 0, 1046694 What is t in 5t*5 - 14045t*4 + 10395995t*3 - 740099055t*2 + 2765435400t + 45499954500 = 0? -6, 11, 74, 1365 Factor 2t3/3 - 18364t*2/3 - 202186t/3 - 183860. 2(t - 9193)(t + 5)(t + 6)/3 Solve -2025s*3/2 - 3262185s*2/2 + 144989s/2 - 1611/2 = 0. -1611, 1/45 Solve -22x2 + 89741920x - 16316712 = 0. 2/11, 4079178 Determine j so that -j*4 + 2441j*3 + 111303j*2 + 1408239j + 3288978 = 0. -21, -3, 2486 Let -4o4 + 5028o*3 + 1650520o*2 + 30967200o = 0. What is o? -253, -20, 0, 1530 Let l*5 - 446l*4 + 23257l*3 - 293500l*2 + 519008l - 248320 = 0. Calculate l. 1, 16, 40, 388 Suppose 2u5/13 + 2740u*4/13 + 24506u*3/13 + 10600u*2/13 - 392608u/13 - 871040/13 = 0. Calculate u. -1361, -5, -4, 4 Let -5z2 - 1086996130z - 59078029331748845 = 0. What is z? -108699613 Factor 5c3 + 5355c*2 + 100030c + 94680. 5(c + 1)(c + 18)(c + 1052) Determine l, given that 5l*3/4 - 4176820l*2 = 0. 0, 3341456 Factor -5n*2 - 57953220n - 167928785418420. -5(n + 5795322)2 Let -s2/4 + 77360063s/2 - 5984579347363969/4 = 0. What is s? 77360063 Suppose d*5/6 - 827d*4/3 + 128243d*3/2 - 759550d*2/3 + 756250d/3 = 0. What is d? 0, 2, 275, 1375 Find w, given that 5w2 - 843440w + 42159500 = 0. 50, 168638 Factor 2t2 - 52926532t + 350152223693378. 2(t - 13231633)2 Suppose d5 + 115239d*4 + 3319949159d*3 - 3320179639d*2 - 3319949160d + 3320064400 = 0. What is d? -57620, -1, 1 Let 5j2 + 59605j + 23985840 = 0. Calculat	{ "pile_set_name": "DM Mathematics" }
ming m is positive. m(-3602/2145) Simplify (k(-1)/k*(2/13))/((k(k/(kk(2/7)))/k)/(k(6/11)/k))(k*2k(-2/3))/(k(1/5)/k(4/5)) assuming k is positive. k(9169/15015) Simplify (a*(-3/8)aa/(a/a3))(-25)a(4/5)/(a5/a)(a/a(3/4))/((a/(a/a(1/2)))/a) assuming a is positive. a(-3723/40) Simplify (c(-5/3)/c(3/2)((c/c(-1))/c)(-50))/((c(-1/2))39)(6/19) assuming c is positive. c(-5359/114) Simplify (i(-4)/i3ii*(2/15)/iii/i(-6))36 assuming i is positive. i(204/5) Simplify (p(-2/15)/p(-1/5))(-11/3)(p(1/6)/(p(2/33)/p))/(p*(-3)p/(p/p(-3/8))) assuming p is positive. p(16777/3960) Simplify ((((jj(4/9)j)/jj(j/j(4/3))/j)/(j(-1/4)j(-3/7)))(-19))(-14) assuming j is positive. j(8569/18) Simplify (((b(-1/3)b)/bb)/b(-7)(b/b(4/7))/b(1/2))/((b(1/3))(2/97)/(bb(-2/9)b(-3))) assuming b is positive. b(65585/12222) Simplify (k*(-1/3)k)50/(k0k)40(k*5/(kk6))/(k(2/9)k(-5/6)) assuming k is positive. k(-145/18) Simplify (zzzz(5/4))/((z/(z(-30)z))/z)(z(-35))(-19) assuming z is positive. z*(2561/4) Simplify ((m(mm/(mm(-11)))/m)25/(m(-9))(-3/23))45 assuming m is positive. m(309285/23) Simplify (((www/(ww5))/((w/w(-1))/www))/(w(-3/4)ww(1/7)))/((ww/(ww/w(-1)w)w)(2/9))17 assuming w is positive. w(-659/252) Simplify (((i(-9/8)/i)/i)2/((i(5/8)i)/(i*(9/7)i)))(-15/7) assuming i is positive. i(4695/392) Simplify ((qq(-3/2)q)/((qq5q)/q))*(-20/7)((qq/(qq/(q/q*6)q))/(qq/q(-2/3)))/(qqqqq1q)3 assuming q is positive. q(-230/21) Simplify (v*2v)/(vv1)v((vvv/v(2/9))/v)/vvv(2/5)(v*(-4/5)vv/(((v/v(-6))/v)/v))/(v/(vv*(2/3)v))(-1/36) assuming v is positive. v(179/540) Simplify ((h/(h*(2/9)h))12/(h(-1/10)h/(h/h(2/7))))/(((hh/h5)/(h/h(2/17)))/(h3/((h/(h(1/4)/h))/h))) assuming h is positive. h*(23419/7140) Simplify aaa(a*(4/7)/a)/aaaa*5a*(-2)a*(-1/3)(aa/a(-2)a(-2/5))/((a/(a(-2/15)/a))/(aaa/a*(-4)a)) assuming a is positive. a(1649/105) Simplify ((k0)(-7/9))18/(k(1/8)/k(1/3)(k(k(k7k)/k)/k)/k(-1/7)) assuming k is positive. k(-1333/168) Simplify ((n/n*(-2))/nn)/(nn/n3nnn)((n/(n/((n(-4/3)n)/nn)))/n)/(n(1/4)n)(nn/(n*0n))*(-1)(n*(-2/5)n)(1/6) assuming n is positive. n(-149/60) Simplify ((t(-1))45)*(-2/33)((ttt*(5/2)t)/(t/t1))/(t0/t)(13/3) assuming t is positive. t(829/66) Simplify (b(((b/((bb*(-1/10))/b))/b)/b)/bb*(-1)b(b(-13)b)/(bb(-12)b))(-13/3) assuming b is positive. b(377/30) Simplify ((z14/((z/z(-14))/z))/(z(1/4))(-8/7))(-36) assuming z is positive. z(-72/7) Simplify (((ff(3/4))/f)/(f/(f3/f)ff)((ff/(fff(-2)ff))/f)40)/((f/f(-1)f6)/(f(2/13)f1f)) assuming f is positive. f(-2397/52) Simplify l(-1/4)/ll(ll10)/ll(ll(-17))(-50) assuming l is positive. l*(3243/4) Simplify (((hhhh/(h/(h(hh*17)/hh)))/h(3/22))/(h(-2/27))14)(7/11) assuming h is positive. h*(95221/6534) Simplify ((k/(kk/k*(-2/23)))/kkk(k/(k/(kk/((k(1/4)/k)/k)k)k))/k)/((k(-5/3)k)/kk(2/7))((k/k*(-5))/kkk/k6)(1/27) assuming k is positive. k(70961/17388) Simplify (b(-8)/(b/(b/(b(1/5)/b)))b/b*(-2/13)b(-9))/(b(-12)bb8)(-1/9) assuming b is positive. b*(-2999/195) Simplify (oo(oo0)/o)(-18)/(oo/(oo2))(5/14)(o3/(o/(o/((oo*(-3))/o))))/((o/(oo7))/o8) assuming o is positive. o*(-205/14) Simplify ((s/(ss/((s*13/ss)/s)s))/(s8s))*10(s*(13/2)/ss/s(-2/7))(-12) assuming s is positive. s(-500/7) Simplify (i6/(i(-2/23)/i))(2/9)(i(1/2)/i(3/5))/(i(1/5)/(i/(i1ii))) assuming i is positive. i(-1501/2070) Simplify (l/l1)(12/7)/(l/(l((l/(l/(lll/((l*(-1)l)/l))))/ll)/l))(-2/15)(l/l*(1/6)l5)(7/6) assuming l is positive. l(1153/180) Simplify ((h(-1)h)(-49))21/((h/((h(-3/4)/h)/h)hh(-5))/(h(-1/2)/h)(-44/5)) assuming h is positive. h(269/20) Simplify (l(-15)/(lll(-2/97)/l))/(l(5/2)/l(-2/15)) assuming l is positive. l(-54163/2910) Simplify (c(-2)c)*(2/109)c(cc*(-1/11)c)/ccc*(2/5)c3/c(2/15)((ccc(-5))/c)/(c/(c/(c/(cc(-1/2))))) assuming c is positive. c(59617/35970) Simplify ((r(-3))(8/15)(r/(r/r(-6/7)rr))/(rr/r(2/29)))(-27) assuming r is positive. r*(175068/1015) Simplify ((p/(p/(pp/(p/(p/p*3pp)))))(1/22)(p*(2/23)/pp)/p(p/p(-2/5))/p)17 assuming p is positive. p(-20111/2530) Simplify n(1/17)/(nn(n(3/22)/n)/n)n*(2/37)n/(nn(4/5))n assuming n is positive. n(12213/69190) Simplify ((n/n(-1/12)n(1/2))/(n(-2/9)n/(n/(nn(3/4)/nnn))))/((n(-1/4))(-7)n*(-6)nnnn1) assuming n is positive. n(-25/36) Simplify (p(-4/7)/(pp*(-6)/p))/((pp*(-1/7)p)/(p/(pp(-2))))p*(1/2)/(pp*3ppp)(pp(3/2))/p5 assuming p is positive. p(-24/7) Simplify (d(-1/6)(dd/(d*0d))/dd(4/7)/d(4/7))/((d/d2)(-23))(-1/4) assuming d is positive. d(67/12) Simplify ((x(x(1/2)/x)/x)42)*(-36)/((((x/(xx(-7)))/x)/x)/(x/x2xxx))(-2/35) assuming x is positive. x(26466/35) Simplify (n(-2)/(nn/n*4))/(n(nn((n/(n*0nn))/n)/nn)/n)*(-25)((n(2/3))(-39))(-1/2) assuming n is positive. n13 Simplify (o(-1)/o(-2))(-29/5)/(o(-1/3)/o(-1/10))36 assuming o is positive. o(13/5) Simplify (k(34/5)k)/(k/(k/k(-5/3)k)kk)(kk/(k/((k(-31)/k)/k)))/(k/(k(1/4)/k)k) assuming k is positive. k(-1577/60) Simplify ((((ll/(l*(-2/5)/l))/l)/ll)*15ll(2/11)ll(-1/5)l)/(((l*0l)/ll)(-2/29)(l*(-1)l)/l(-2/7)) assuming l is positive. l(432812/11165) Simplify ((f(2/7)/f)(-14))*(-15/8)f*3/((ff*(-2/15)f)/f)f(-3)/(f/(f/(ff*(-2)f))) assuming f is positive. f*(-1177/60) Simplify (((c(c/((c/c*(1/4))/c))/cc)/c)/((cc6c)/c))*(28/9)(c/(c/(c/c*4)c)(c(-2)cc)/c)/(c(-4)/c(c(-1/3)/c)/c) assuming c is positive. c(-140/9) Simplify (z(-1/4))(-4/9)/(z*(1/5)z*(-4/5))(zz/(z(-2/11)z)z/((z/z2z)/z))11 assuming z is positive. z(1607/45) Simplify ((k*0k)*(32/5)/(kkkk/(k*0/kk)k)(-5/8))/(k(-6)k*(-1/5)(k1)(-1/35)) assuming k is positive. k*(4411/280) Simplify ((((tt/t*(-9))/(t/(ttt3/tttt)))(-29))(20/9))(-2) assuming t is positive. t(19720/9) Simplify (dd(11/4)ddd(2/7))(2/75)(d(-1/2)/d)/d1(d/(dd(-2/5)dd)d)/dd(-1)/d assuming d is positive. d(-3118/525) Simplify ((n(-1)/nn/(n*(2/17)/n))/(n(n*(-2)/n)/nnn(-1)))/(n(5/2)n(1/8))(-8/7) assuming n is positive. n*(100/17) Simplify ((a/(aa*(-36)/a)aa(a(a/(a27/a))/a)/a)/((aa*40)/aa(-44)))(-18/5) assuming a is positive. a(-306/5) Simplify ((q(6/7)/q((q/(qq*(-3/2)q))/qq)/q)/(q(-2)/q)(-4/33))/((qq(-1/5)/q)/q(-13))(-5/11) assuming q is positive. q(741/154) Simplify (((o(12/11)/o)/o)/(o/((o/o(12/5))/o)))/(o*44/oo/(o/o(-9))) assuming o is positive. o(-2107/55) Simplify ((b/(b*(-1)/b)b(b/(b9b))/b)/((b/(b*(1/6)b))/(bb(-3/5))))/((b(2/7)/b(-1/2))/(b(2/11)/(((b(-3/4)/b)/b)/b))) assuming b is positive. b(-10567/4620) Simplify (c(17/7)c(2/5)/c)/(c(-24)c(-22)) assuming c is positive. c(1674/35) Simplify ((h/(h/(h/((h(-7)h)/h)))h((h*(2/11)h)/h)/h(hh1)/(h(-3)h))(22/9))(5/8) assuming h is positive. h(335/18) Simplify (c(c/(((c*(2/5)c)/c)/c))/c)*(-1/27)(cc/(c/(c(-3)/ccc)c)cc)/c*(2/7)((c*(4/3)cc)/(cc/c*(-6)c))(-2/55) assuming c is positive. c(-1444/10395) Simplify ((f(-1/4)/f)(26/5)/(f*(-5/6)/ffff/(f/f*(-7))f))/(f(2/3)/f(-8)(f/f8)/(ff(2/3))) assuming f is positive. f(-2/3) Simplify (((cc(-36)/c)(-42))(-7))(-13/7) assuming c is positive. c19656 Simplify ((n/(n/(n(1/4)n)n))(-12/19)nn1n*(-5)n)/(nn(3/2)n*(-6)(n(-1/2))(-3/11)) assuming n is positive. n(252/209) Simplify ((g(1/5))*(-1/15)g/g*(-2/7)g6)(-47) assuming g is positive. g*(-179446/525) Simplify ((zzz(2/3)zz)/((zz*3zz)/z))/(zz*(1/6)zz(4/11))((z/((zz/z*1	{ "pile_set_name": "DM Mathematics" }
x, q, w, 2 in increasing order. q, w, x, 2 Let k = -64 + 101. Suppose 4f - 3f = 33. Suppose 10r = -k - f. Sort 3, -4, r in ascending order. r, -4, 3 Let p = 59691 + -59687. Let s = -30 + 9. Put s, p, -1/7 in descending order. p, -1/7, s Suppose 5 = -0m - m. Let b = -48610 - -48610. Put m, b, -1 in ascending order. m, -1, b Suppose -3r - 3a = 6, 2r = 7r + 4a + 14. Put r, -5, -18, 2 in increasing order. -18, r, -5, 2 Let o = -151.09 + 0.09. Let s = o - -154. Sort 0.04, 5, s in ascending order. 0.04, s, 5 Suppose 3r = -3, 0 = 3u - 553r + 556r - 3. Put u, 4, 27 in increasing order. u, 4, 27 Let d = -1 + 1. Suppose w + 3a + 1 = d, 0a = -4w - 5a + 10. Let k = 302 + -303. Sort w, k, 15 in ascending order. k, w, 15 Let t = -11060 - -10178. Sort t, 2, -4. t, -4, 2 Let o be ((-135)/(-153) - -4) + 2/17. Put 10, o, 16 in descending order. 16, 10, o Let u be (32/5)/(836/55 + -15). Sort 67, u, 4 in descending order. 67, u, 4 Let y(z) = z + 1. Let j(x) = x3 + 10x*2 + 3x - 12. Let s(n) = j(n) + 5y(n). Let l be s(-9). Put -3, l, -5 in ascending order. -5, -3, l Let f be (-38)/30 + 40/24. Suppose -2h + 0 + 6 = 0. Put f, 1/2, h, -25 in decreasing order. h, 1/2, f, -25 Suppose -2n + 4u + 12 = 0, -11n + 7n = u - 6. Sort 222, -5, n in decreasing order. 222, n, -5 Let a be (-36)/51/((-12)/40). Let w be a/16 + 135/2. Suppose -7n + w = -3n + v, 5n - 78 = -4v. Sort -2, -4, n. -4, -2, n Suppose 3z - 5k = -z + 15, -5k = 5z - 30. Let b be ((-190)/(-380))/(2 - 51/12). Sort -2/7, b, z, -61 in decreasing order. z, b, -2/7, -61 Let j = -1471 + 1474. Sort 1, 21, -10, j in decreasing order. 21, j, 1, -10 Let o(h) = -3315h - 6634. Let t be o(-2). Suppose 2x - 8 = 0, 4w - w + 3x = -3. Sort 4, -3, w, t in descending order. 4, -3, t, w Let v = 1101 - 14311/13. Sort 1/6, v, -21/19. -21/19, v, 1/6 Let c be 8/(-6) - (-12 + 10/((-9450)/(-10077))). Sort 0.2, -5, -4, c in descending order. 0.2, c, -4, -5 Suppose 3h = -0 - 15. Let n(w) = -w*2 - 11w - 1. Let a be n(-11). Let b(g) = -2g3 + g + 1. Let m be b(a). Sort h, 4, m, -1. h, -1, m, 4 Let d = -2163 + 2108. Sort -7, 4, d in descending order. 4, -7, d Let d(k) = k3 - 5k*2 - 8k + 44. Let m be d(7). Let a = -84 + m. Sort a, -70, -3. -70, -3, a Let m = 85/8 + -1469/136. Let o = 61/153 + m. Let g be (-21)/55 - (160/88)/(-10). Sort g, 3, o, -2/3 in descending order. 3, o, g, -2/3 Let f(s) = s + 34. Let d(p) = p. Let y(t) = 2d(t) - f(t). Let c be y(34). Sort 5, 1, 2, c in decreasing order. 5, 2, 1, c Suppose -41 - 7 = 12c. Let v = 1.096 + -0.096. Put c, -0.4, v in descending order. v, -0.4, c Let k = 37.82 - 43.62. Put k, -9, -3 in decreasing order. -3, k, -9 Let t = -0.03 - -0.33. Let a = 1008 + -1014. Let y be 4 - ((-171)/(-33) - 1). Sort y, a, t in ascending order. a, y, t Suppose -40 = -282c + 262c. Sort 3, 222, c in increasing order. c, 3, 222 Let j = -682 - -685. Sort -53, -4, 4, j in descending order. 4, j, -4, -53 Let t = 0.11 + -0.1. Let i = 2.99 + t. Let b = -129675 - -907722/7. Put -0.4, i, b in ascending order. b, -0.4, i Let p = 3299 + -3302. Let h = 7.9 + -7.96. Sort h, p, -4/3 in increasing order. p, -4/3, h Suppose 2t - 1863 = 3l - 1885, -5t - 5l = 5. Put -2, 2, t, 124 in increasing order. t, -2, 2, 124 Let l = 0.0745 + -102.0745. Sort 0.1, -0.4, l, 2/3, -1/9 in ascending order. l, -0.4, -1/9, 0.1, 2/3 Let k(a) = -a*2 - 65a - 65. Let z be k(-1). Put z, 1/2, 3, -4 in decreasing order. 3, 1/2, z, -4 Let g be (-46690)/140 - 14/4. Let h = 342 + g. Put 46, h, -0.3 in decreasing order. 46, h, -0.3 Let p(w) = -2w2 + 13w - 25. Let f be p(4). Let m(d) = d - 2. Let v be m(6). Let t be ((-4)/(-6))/(-24/(-24)). Put v, t, f, 0.07 in increasing order. f, 0.07, t, v Let w = -112 + 558/5. Let u be ((-54)/(-8))/((-18)/(-24)). Suppose -8s = -us - 5g - 20, -3g - 12 = s. Sort w, -4, s, -0.1 in descending order. s, -0.1, w, -4 Let n be -7 + (-27 - -26)4/(-1). Put n, 4, 235 in increasing order. n, 4, 235 Let h be (-6)/(12/26) + (-876)/(-73). Let j = 156 - 230. Sort 4, 0, h, j. j, h, 0, 4 Suppose 0 = 4n - 16 - 80. Suppose -23q + n = -15q. Let l = 6 - 11. Sort 1, -4, l, q in decreasing order. q, 1, -4, l Let k(g) = -149g*2 - g. Let a be k(1). Let z be ((-432)/(-1344))/((-3)/(-4))-3 + 1. Sort 2/11, z, a. a, z, 2/11 Let d(a) = a*3 + 3a*2 + 4a - 3. Let j be d(3). Let q be (8/24)/(1/j). Suppose 0c = -3i - 2c + 17, 0 = -5i + 4c + q. Put -4, -2, i in ascending order. -4, -2, i Let p = 1 + -1.2. Let l = -34 - 412. Let v = l - -5796/13. Sort -4/7, p, v, 2 in decreasing order. 2, v, p, -4/7 Let d = 42 - 17. Let z(k) = -k + 29. Let a be z(d). Let j = -3 - -8. Put -5, j, 0.3, a in descending order. j, a, 0.3, -5 Let s be 3/42 - 697/(-238). Suppose sc + 11 = 5p, 3p + 5c - 37 = -44. Sort -0.5, p, -0.2 in decreasing order. p, -0.2, -0.5 Let q(g) = 2g + 9. Let s be q(-6). Suppose 0 = 9n - 14n + 365. Suppose 2i + 81 = n. Put 4, s, i in ascending order. i, s, 4 Let l be (-37)/(-95) + (-244)/(-1159). Sort l, 5, 16, 4. l, 4, 5, 16 Let z = -2 + 4. Let y(c) = 33c - 183. Let f(i) = -16i + 92. Let t(n) = -9f(n) - 5y(n). Let x be t(4). Sort x, -0.06, z. -0.06, z, x Let y = -340/2513 - 54/359. Suppose -4j + 7l = 9l - 18, 5l + 15 = 2j. Sort y, j, 0.2. y, 0.2, j Let v = -3274.2 - -3581. Let n = v - 307. Sort 0, 2/11, 4/7, n in descending order. 4/7, 2/11, 0, n Let j = 65.98 - 66. Let n = j - -33.02. Let a = 41 - n. Sort 3, -1/4, a in increasing order. -1/4, 3, a Suppose 2w + 9 = -3y, 3w = 4y - 2y - 7. Let t be 3 + 3 + (0 - 3) + 3. Suppose 0 = -tc + 16c + 140. Sort -5, c, w in decreasing order. w, -5, c Let z be (-6)/32/(-50). Let f = 0.090653 - -0.069347. Sort 0, f, z in decreasing order. f, z, 0 Let z(v) = -36v + 2. Let s be z(1). Let t = 29 + s. Let u be 2/((-30)/35) - -3. Put t, -20, u in decreasing order. u, t, -20 Let b be (-148)/(-259) + (-6)/(-14). Let h = -89/2 - -43. Sort 0, -2/7, h, b in increasing order. h, -2/7, 0, b Let x = -2479 + 42145/17. Sort x, -0.057, -2/45. -0.057, -2/45, x Suppose -5a = 3x + 4, 12a - 15a + 3x - 36 = 0. Let p be (-74)/10 + 2/5. Put p, -2, 2, a in increasing order. p, a, -2, 2 Suppose k + 7682 = 4s + 7697, 0 = -2s - 2k + 10. Put 2, s, 11, -5, 4 in decreasing order. 11, 4, 2, s, -5 Suppose 47g - 1302 = 5g. Suppose 46y - gy = 30. Sort y, 4, 5 in decreasing order. 5, 4, y Suppose 347 = 25r + 397. Suppose 0 = -2u - 10, d + 4u + 9 = -16. Sort -3, 5, r, d. d, -3, r, 5 Let a = 75 + -72. Suppose 182m = 136m + 92. Sort m, a, -6 in ascending order. -6, m, a Let m = 14.843 - 14.781. Put m, 49, 0 in decreasing order. 49, m, 0 Suppose -7k = 15k - 132. Suppose k = 5h + 5l + 1, -5h + 5 = l. Sort 4, h, 5, -10. -10, h, 4, 5 Suppose -28536 = 8u - 29088. Put 0, 0.136, -0.1, u in increasing order. -0.1, 0, 0.136, u Let h = -0.028 - -0.258. Let u = h + -0.29. Sort -0.08, -3/5, 4, u. -3/5, -0.08, u, 4 Let t = -34/181 + 363/2896. Sort 0.3, -1, 5, t in ascending order. -1, t, 0.3, 5 Let q = -31 + 35. Suppose n - 4n = -78. Suppose -nb + 6 = -20b. Put q, -4, 0, b in descending order. q, b, 0, -4 Let o(y) = y3 - 10y*2 + 10y + 72. Let r be o(7). Sort r, 8, 4, 6, -2 in ascending order. r, -2, 4, 6, 8 Let u = -7 + 9. Suppose -177 = ug - 67. Let q = g + 53. Put 3, q, 19 in ascending order. q, 3, 19 Let r = -0.10582 - -0.50582. Sort 3, -3, r, -41, -2/13 in ascending order. -41, -3, -2/13, r, 3 Let b = 5634 + -5627. Put 2, 68, -4, b in descending order. 68, b, 2, -4 Let h = -39 + 37. Suppose 0 = -25w + 20w - 25. Sort w, 0, h, -4 in descending order. 0, h, -4, w Let x = -124 - -100. Let u be 1 + (-39)/(-12) + 6/x. Put u, 2, 0, -14 in decreasing order. u, 2, 0, -14 Let t = 46.58 - 47. Let m = -0.12 - t. Let q = 3.813 - 1.813. Sort q, 27/4, m in increasing order. m, q, 27/4 Suppose 0 = p + 2p + 2n + 20, -4p = -5n - 4. Let y(w) = w2 + 5w - 71. Let j be y(-11). Put p, -3, j, 59 in decreasing order. 59, -3, p, j Let y(d) = -d*2 + 57d - 164. Let t be y(54). Let r = -4 - -9. Sort r, -135, t, 3 in descending order. r, 3, t, -135 Let z = -103 + 47. Let v = 61 + z. Suppose vx = 4x - 5. Put 4, x, -2, -3 in descending order. 4, -2, -3, x Let a = 663 + -657. Let h(b) = b - 6. Let j be h(9). Put a, -2, j in descending order. a,	{ "pile_set_name": "DM Mathematics" }
True Does 24 divide 14449? False Does 75 divide 4280? False Is 9 a factor of 25501? False Does 16 divide 73333? False Is 2172 a multiple of 12? True Is 78778 a multiple of 11? False Is 324 a multiple of 18? True Is 5 a factor of 1942? False Is 366 a multiple of 122? True Is 32570 a multiple of 113? False Does 15 divide 1525? False Is 60 a factor of 7800? True Does 10 divide 68970? True Does 31 divide 3813? True Does 17 divide 9387? False Is 2039 a multiple of 55? False Is 11692 a multiple of 86? False Is 13 a factor of 5870? False Is 10017 a multiple of 21? True Is 21 a factor of 315? True Is 59 even? False Does 18 divide 4190? False Is 2035 a multiple of 2? False Is 1748 a multiple of 76? True Is 12 a factor of 2051? False Is 101039 a multiple of 11? False Does 5 divide 3595? True Is 5 a factor of 183? False Is 882 a multiple of 7? True Is 65 a factor of 1499? False Is 143 a factor of 4004? True Is 15 a factor of 270? True Does 155 divide 4185? True Does 7 divide 21104? False Is 17 a factor of 170? True Is 107772 a multiple of 14? True Is 37 a factor of 1086? False Does 9 divide 153? True Is 977 a multiple of 6? False Is 73 a factor of 6278? True Does 23 divide 552? True Does 14 divide 598? False Is 65796 a multiple of 12? True Does 4 divide 3327? False Is 11 a factor of 6336? True Is 396 a multiple of 28? False Does 17 divide 1207? True Does 8 divide 144? True Is 3141 a multiple of 6? False Is 12120 a multiple of 8? True Does 25 divide 4900? True Is 19 a factor of 42029? False Is 37 a factor of 31931? True Is 35 a factor of 6658? False Is 6 a factor of 5990? False Is 41 a factor of 35301? True Does 14 divide 12754? True Is 24 a factor of 352? False Is 153131 a multiple of 17? False Does 14 divide 714? True Does 188 divide 3458? False Is 10464 a multiple of 12? True Is 149 a multiple of 31? False Does 23 divide 4232? True Is 19 a factor of 779? True Is 32 a factor of 7162? False Is 1904 a multiple of 34? True Is 555 a multiple of 15? True Is 4 a factor of 912? True Is 120 a factor of 3518? False Does 130 divide 95602? False Is 104 a multiple of 4? True Is 10 a factor of 20040? True Is 280 a multiple of 3? False Does 23 divide 51785? False Is 21 a factor of 14714? False Does 31 divide 2971? False Does 5 divide 8563? False Is 1308 a multiple of 4? True Is 243 a multiple of 81? True Does 17 divide 765? True Does 32 divide 57803? False Does 10 divide 97591? False Is 118 a factor of 354? True Does 38 divide 3291? False Is 308 a multiple of 7? True Is 115 a factor of 520? False Is 65280 a multiple of 16? True Does 36 divide 396? True Does 172 divide 8084? True Is 158 a factor of 36559? False Is 5289 a multiple of 2? False Is 198 a multiple of 12? False Does 19 divide 63? False Does 12 divide 26244? True Is 640 a multiple of 64? True Is 194 a multiple of 5? False Does 15 divide 7650? True Is 16 a factor of 208? True Does 15 divide 4144? False Is 1139 a multiple of 77? False Is 6 a factor of 54? True Is 1992 a multiple of 6? True Is 15075 a multiple of 15? True Is 381 a multiple of 9? False Is 10 a factor of 3776? False Is 485 a multiple of 97? True Is 66 a factor of 602? False Is 38799 a multiple of 66? False Is 2635 a multiple of 158? False Does 107 divide 7169? True Is 30 a factor of 53084? False Does 14 divide 2686? False Is 18 a factor of 452? False Does 13 divide 1135? False Is 23800 a multiple of 34? True Is 35 a factor of 11784? False Is 17696 a multiple of 316? True Is 653 a multiple of 156? False Is 361 a multiple of 16? False Is 29133 a multiple of 56? False Is 104 a factor of 43186? False Does 22 divide 2979? False Is 12 a factor of 60567? False Does 8 divide 243? False Does 15 divide 315? True Does 8 divide 13104? True Is 1403 a multiple of 16? False Is 7661 a multiple of 2? False Is 141 a multiple of 22? False Is 12 a factor of 648? True Does 11 divide 117612? True Is 41160 a multiple of 280? True Does 42 divide 462? True Is 969 a multiple of 19? True Is 28 a factor of 2337? False Is 66223 a multiple of 349? False Is 51 a factor of 306? True Does 40 divide 193? False Does 10 divide 26910? True Does 15 divide 1990? False Does 7 divide 7? True Is 30 a factor of 330? True Does 7 divide 11822? False Is 21 a factor of 294? True Is 48723 a multiple of 53? False Is 9 a factor of 163? False Is 3231 a multiple of 9? True Is 15 a factor of 4395? True Is 19584 a multiple of 50? False Is 2755 a multiple of 22? False Is 157 a factor of 3284? False Is 581 a multiple of 83? True Is 25 a factor of 36650? True Is 252 a multiple of 12? True Is 740 a multiple of 4? True Is 68292 a multiple of 84? True Is 958 a multiple of 22? False Is 468 a multiple of 39? True Is 24799 a multiple of 9? False Is 15041 a multiple of 11? False Does 62 divide 19344? True Is 364 a multiple of 13? True Is 7072 a multiple of 17? True Is 7 a factor of 308? True Is 5 a factor of 544? False Is 6 a factor of 642? True Is 7 a factor of 11704? True Does 9 divide 618? False Is 13 a factor of 6032? True Is 87630 a multiple of 41? False Is 96 a factor of 13509? False Does 24 divide 626? False Is 5940 a multiple of 9? True Is 47 a factor of 658? True Is 11 a factor of 1925? True Is 4 a factor of 124? True Is 321 a factor of 36602? False Is 53 a factor of 622? False Is 8835 a multiple of 31? True Does 136 divide 17952? True Is 1078 a multiple of 72? False Is 912 a multiple of 24? True Does 13 divide 2704? True Does 75 divide 5775? True Is 16 a factor of 1584? True Does 40 divide 3039? False Does 4 divide 56? True Is 23 a factor of 483? True Does 8 divide 12480? True Is 7 a factor of 147? True Is 90059 a multiple of 13? False Does 32 divide 8768? True Does 65 divide 6045? True Is 1651 a multiple of 127? True Is 1194 a multiple of 22? False Is 63 a factor of 504? True Does 46 divide 11720? False Does 138 divide 23913? False Does 10 divide 17103? False Does 173 divide 30890? False Is 170 a factor of 1360? True Does 36 divide 324? True Is 35378 a multiple of 266? True Is 9680 a multiple of 121? True Is 939 a multiple of 5? False Is 676 a multiple of 52? True Is 72 a multiple of 8? True Does 24 divide 3655? False Is 58 a factor of 2512? False Is 1215 a multiple of 45? True Is 11211 a multiple of 70? False Is 19652 a multiple of 289? True Is 20436 a multiple of 156? True Is 196 a multiple of 14? True Is 69 a factor of 2967? True Is 3 a factor of 42? True Is 258 a factor of 25680? False Does 16 divide 605? False Is 4970 a multiple of 35? True Is 81 a factor of 5913? True Does 12 divide 372? True Is 956 a multiple of 28? False Is 45 a factor of 5625? True Does 10 divide 1611? False Does 9 divide 153? True Is 1840 a multiple of 92? True Is 32 a multiple of 16? True Is 66 a factor of 10784? False Does 6 divide 271? False Does 11 divide 23914? True Is 183 a factor of 31842? True Is 280 a multiple of 25? False Is 50554 a multiple of 157? True Is 2720 a multiple of 25? False Is 166 a factor of 83000? True Does 29 divide 232? True Does 25 divide 2225? True Is 54 a factor of 13284? True Is 43 a factor of 970? False Is 1200 a multiple of 16? True Does 24 divide 22464? True Is 34 a factor of 1088? True Is 624 a multiple of 6? True Is 10689 a multiple of 55? False Is 810 a multiple of 30? True Is 4 a multiple of 4? True Is 12427 a multiple of 156? False Is 1136 a multiple of 120? False Is 5319 a multiple of 27? True Does 202 divide 60615? False Is 107 a multiple of 18? False Is 15 a factor of 1320? True Is 69 a factor of 5313? True Does 14 divide 21294? True Is 29 a factor of 2681? False Is 38 a factor of 3664? False Is 26 a factor of 16480? False Is 12816 a multiple of 18? True Is 2 a factor of 211? False Does 9 divide 58227? False Does 12 divide 35532? True Is 2110 a multiple of 134? False Is 46 a factor of 4646? True Is 10517 a multiple of 8? False Does 18 divide 2008? False Is 19 a factor of 9218? False Does 4 divide 2920? True Is 17 a factor of 1032? False Does 6 divide 6096? True Does 145 divide 435? True Is 7404 a multiple of 12? True Is 60684 a multiple of 51? False Is 175 a multiple of 3? False Is 30 a factor of 110? False Does 23 divide 9709? False Does 141 divide 7755? True Does 7 divide 162? False Does 3 divide 22? False Does 183 divide 13888? False Does 6 divide 240? True Does 3 divide 1	{ "pile_set_name": "DM Mathematics" }
ecreasing order. 10.5, 1/4, -0.2, -2 Sort 3, 15, -2/5, 1, -5/12. -5/12, -2/5, 1, 3, 15 Sort 4, -1, -65, -3 in decreasing order. 4, -1, -3, -65 Sort 4, 55, -4 in decreasing order. 55, 4, -4 Sort 4, -2, 1, 5. -2, 1, 4, 5 Sort 3, 0, 1472. 0, 3, 1472 Sort -3, -5/2, 0.08 in descending order. 0.08, -5/2, -3 Sort -73, -3, 3 in descending order. 3, -3, -73 Sort 9, -0.1, 0.42, 2/7 in decreasing order. 9, 0.42, 2/7, -0.1 Sort -1, -56, -5, 1 in descending order. 1, -1, -5, -56 Put 4, -5, -118 in decreasing order. 4, -5, -118 Sort 2, 106, 1, -2, 4 in descending order. 106, 4, 2, 1, -2 Sort -0.2, 4187, -0.4 in descending order. 4187, -0.2, -0.4 Sort 0.2, -0.3, -29038. -29038, -0.3, 0.2 Put 1, -8, 12 in ascending order. -8, 1, 12 Sort 662, -2/9, 2/17. -2/9, 2/17, 662 Sort -2, 2, -4, 39 in ascending order. -4, -2, 2, 39 Put 183, -3, -4 in decreasing order. 183, -3, -4 Put 0.04, 0.1, -3, 0.2, 58 in decreasing order. 58, 0.2, 0.1, 0.04, -3 Sort -2649, -1, 1 in increasing order. -2649, -1, 1 Sort 0.03, 6, -3, 0.3. -3, 0.03, 0.3, 6 Sort -4, -36, -0.074. -36, -4, -0.074 Sort -2, -4, 21, 2 in decreasing order. 21, 2, -2, -4 Put -1, 2, 0 in ascending order. -1, 0, 2 Put 1/5, 0, 40, 0.1 in descending order. 40, 1/5, 0.1, 0 Sort -5, 2, 0, 9 in ascending order. -5, 0, 2, 9 Put -9, -7, 3, -6 in descending order. 3, -6, -7, -9 Put 1, 0, -19, -0.1 in descending order. 1, 0, -0.1, -19 Sort -10, 3, 6 in descending order. 6, 3, -10 Put 3, 18, 2, 0 in increasing order. 0, 2, 3, 18 Put -15, -11, -2/9, 1, -2 in increasing order. -15, -11, -2, -2/9, 1 Put 4, 7, 3 in decreasing order. 7, 4, 3 Sort 112, 4, 5, -5. -5, 4, 5, 112 Sort -34, -5, -2, 5 in decreasing order. 5, -2, -5, -34 Put -2/3, 0.5, -5, -325, 0 in decreasing order. 0.5, 0, -2/3, -5, -325 Sort 14, -3, 18 in decreasing order. 18, 14, -3 Put -12.6, -4, 2/5 in ascending order. -12.6, -4, 2/5 Sort 3, -19, -0.23, -0.3 in increasing order. -19, -0.3, -0.23, 3 Sort -2, -3, 0.7 in decreasing order. 0.7, -2, -3 Put -0.3, 0.3, -1/11, -0.0533 in decreasing order. 0.3, -0.0533, -1/11, -0.3 Put 3, 5, -3, 13, -1 in increasing order. -3, -1, 3, 5, 13 Sort 9, -8, -1, -5 in ascending order. -8, -5, -1, 9 Sort 12, 5, 0 in increasing order. 0, 5, 12 Put 22, 5, 2, -0.3 in decreasing order. 22, 5, 2, -0.3 Sort 15, -33, -5 in ascending order. -33, -5, 15 Put 42, -6, -0.1, -4 in descending order. 42, -0.1, -4, -6 Sort 0, -7, -1, -5 in ascending order. -7, -5, -1, 0 Sort 3, -67, -0.5, 4. -67, -0.5, 3, 4 Put -3, -4, 8, 2 in ascending order. -4, -3, 2, 8 Sort -57, -10, 3, 4, -3 in ascending order. -57, -10, -3, 3, 4 Sort 2/7, 1, -56 in descending order. 1, 2/7, -56 Put -3, -2, 33, 2 in ascending order. -3, -2, 2, 33 Put 1, -5, 0, 1172 in increasing order. -5, 0, 1, 1172 Sort -1, 17, 5. -1, 5, 17 Put 4, -2, 29, 5, 35 in descending order. 35, 29, 5, 4, -2 Sort 1/5, -3, 36 in increasing order. -3, 1/5, 36 Put -1, 1.1, 3/7 in decreasing order. 1.1, 3/7, -1 Sort 2, 56, 5, -4. -4, 2, 5, 56 Sort 2.6, 4, -1/2, -3, 2/9 in ascending order. -3, -1/2, 2/9, 2.6, 4 Sort -13, 2, -5 in descending order. 2, -5, -13 Sort -2/7, 3/5, 14/5, 0.5 in ascending order. -2/7, 0.5, 3/5, 14/5 Put -3, -195, -4, 1, 3 in increasing order. -195, -4, -3, 1, 3 Sort 2/9, -112, -2/13, 3/7 in descending order. 3/7, 2/9, -2/13, -112 Put -10, -2, 0, -4, 1 in descending order. 1, 0, -2, -4, -10 Put -5, -1216, -0.5 in descending order. -0.5, -5, -1216 Sort 28, 2/5, 70. 2/5, 28, 70 Put 1, 3, 7, -71 in increasing order. -71, 1, 3, 7 Sort -220, 2, -1, -5, -4 in ascending order. -220, -5, -4, -1, 2 Put 2, 1/4, -1.6, 6 in decreasing order. 6, 2, 1/4, -1.6 Put 5, 6, -6 in increasing order. -6, 5, 6 Sort -5, -0.5, -5/3, 2, 0.1 in decreasing order. 2, 0.1, -0.5, -5/3, -5 Sort -4/7, -5, 14, 0.5 in descending order. 14, 0.5, -4/7, -5 Put -0.02, 0.5, 3/7, 0.2, 7 in decreasing order. 7, 0.5, 3/7, 0.2, -0.02 Sort -5, -1, 0.27 in decreasing order. 0.27, -1, -5 Sort 2, -42, 0.4, 1 in descending order. 2, 1, 0.4, -42 Sort 3, 8, 36, -3 in decreasing order. 36, 8, 3, -3 Sort -9, -4, 2, 3. -9, -4, 2, 3 Put 0.4, 0, -15, -0.3 in increasing order. -15, -0.3, 0, 0.4 Sort -1, -192, 2, -5, -2. -192, -5, -2, -1, 2 Sort -13, -1, 0, 2, 13 in decreasing order. 13, 2, 0, -1, -13 Put -0.02, -2/11, -1/4, -1.5, -4 in decreasing order. -0.02, -2/11, -1/4, -1.5, -4 Sort -3, 0, 2. -3, 0, 2 Put 40, -3, 16, 1 in decreasing order. 40, 16, 1, -3 Put -1, -338, 6, 3 in descending order. 6, 3, -1, -338 Sort -49, 5, -3 in descending order. 5, -3, -49 Sort -1/6, -4/5, 2/11, -1/2, -12 in decreasing order. 2/11, -1/6, -1/2, -4/5, -12 Sort 2, -19, 0, 4 in descending order. 4, 2, 0, -19 Put 0, 5, 2, 11, -5 in ascending order. -5, 0, 2, 5, 11 Put 3, -3/4, -3/8, 4/5 in increasing order. -3/4, -3/8, 4/5, 3 Put -3, -1.42, 0.4, -0.3, 1 in decreasing order. 1, 0.4, -0.3, -1.42, -3 Sort -0.016, 9, -2 in ascending order. -2, -0.016, 9 Sort 2, 0.4, -0.43 in descending order. 2, 0.4, -0.43 Put 2/15, 54, -4 in ascending order. -4, 2/15, 54 Sort -7, 1, -5, -3, 12 in ascending order. -7, -5, -3, 1, 12 Sort 1, 25, 1/3. 1/3, 1, 25 Put -6, 5, -16, -1, 0 in decreasing order. 5, 0, -1, -6, -16 Sort -9, -2, 16, 4, 0. -9, -2, 0, 4, 16 Sort -0.006, -2, -0.1, -1 in ascending order. -2, -1, -0.1, -0.006 Sort 2, 1/46, 0 in descending order. 2, 1/46, 0 Put 0, -3, 12 in increasing order. -3, 0, 12 Put -5, -15, 2 in ascending order. -15, -5, 2 Put -0.2, -3/26, -2.8 in decreasing order. -3/26, -0.2, -2.8 Sort 2, 15, -4, -5. -5, -4, 2, 15 Sort 5, 0.4, 1, 21. 0.4, 1, 5, 21 Put 2, 4/3, 0, -5, -0.18 in descending order. 2, 4/3, 0, -0.18, -5 Put -4, 0, 2, -2 in increasing order. -4, -2, 0, 2 Put -1, -102, 0, -4 in ascending order. -102, -4, -1, 0 Sort 1, 4, -15, 5, 0.2. -15, 0.2, 1, 4, 5 Sort 1/3, 0.07, 38 in decreasing order. 38, 1/3, 0.07 Put 5, 4, 7, -71 in ascending order. -71, 4, 5, 7 Put 4, -4, 1/5, 11/2, 0.1 in decreasing order. 11/2, 4, 1/5, 0.1, -4 Put -1, -5, -3, 0 in ascending order. -5, -3, -1, 0 Put 5, 15/4, -49, -1/4 in descending order. 5, 15/4, -1/4, -49 Sort -1, -3, 0 in increasing order. -3, -1, 0 Put -0.1, -0.3, -0.2, 1028 in descending order. 1028, -0.1, -0.2, -0.3 Put -15, 4, 0, 2 in descending order. 4, 2, 0, -15 Put 0.083, -3/4, -5 in increasing order. -5, -3/4, 0.083 Sort 2, -5, -3091 in descending order. 2, -5, -3091 Sort -3, -2, -7, -4 in ascending order. -7, -4, -3, -2 Put -0.2, 0.6, -1, -0.4 in descending order. 0.6, -0.2, -0.4, -1 Sort -4, 149, 1, -2 in decreasing order. 149, 1, -2, -4 Sort 1/3, 49, 0.2, -7 in ascending order. -7, 0.2, 1/3, 49 Put 3, -4, 4, -22 in decreasing order. 4, 3, -4, -22 Sort 3, 7, 1, 2, 10 in decreasing order. 10, 7, 3, 2, 1 Sort -37, 123, 0. -37, 0, 123 Put -3, -1, 5, 81 in ascending order. -3, -1, 5, 81 Put -1/10, 0, -2/5 in descending order. 0, -1/10, -2/5 Put -4, -18, -5 in increasing order. -18, -5, -4 Put 153, -1, 7 in ascending order. -1, 7, 153 Sort 15, -2, -4. -4, -2, 15 Sort 1, -1, -5, -3 in decreasing order. 1, -1, -3, -5 Sort -0.1, 32, 2/7 in increasing order. -0.1, 2/7, 32 Sort 5, -0.19, -0.02, -5 in decreasing order. 5, -0.02, -0.19, -5 Put 29.1, 0.3, 5, 3, 0 in ascending order. 0, 0.3, 3, 5, 29.1 Put -41, -33, 0 in increasing order. -41, -33, 0 Sort -2/15, -0.2, -3/5, -4 in decreasing order. -2/15, -0.2, -3/5, -4 Sort -5, 7/6, -3. -5, -3, 7/6 Put -4, 0.5, 705 in ascending order. -4, 0.5, 705 Sort 1, -8, -478, 2 in ascending order. -478, -8, 1, 2 Sort -2, 2, -3, -4, -57 in decreasing order. 2, -2, -3, -4, -57 Sort -4, 5, -1, 7, 0 in ascending order. -4, -1, 0, 5, 7 Put -2/87, -7, -0.1 in descending order. -2/87, -0.1, -7 Sort 5, 1/5, 4, 19 in decreasing order. 19, 5, 4, 1/5 Sort -2, 3/5, 6/41. -2, 6/41, 3/5 Put -3/5, 11, -2/489 in decreasing order. 11, -2/489, -3/5 Sort -2, -17, 2, -0.5, -4 in descending order. 2, -0.5, -2, -4, -17 Sort -0.2, 4, -1/11, -0.4 in ascending order. -0.4, -0.2, -1/11, 4 Put -4, 0, -41, -7 in increasing order. -41, -7, -4, 0 Sort 0, 5, -2, 2, 21 in increasing order. -2, 0, 2, 5, 21 Sort 0, -29, -3/220. -29, -3/220, 0 Put 4, -7, -25, 2 in decreasing order. 4, 2, -7, -25 Sort -6, -5, -40 in increasing order. -40, -6, -5 Put -3, 9, 2 in decreasing order. 9, 2, -3 Sort -1/27, -0.04, 0.4, 6 in descending order. 6, 0.4, -1/27, -0.04 Put -5, 24, -15, 2 in decreasing order	{ "pile_set_name": "DM Mathematics" }
+ q + 1. Give g(d) - 3x(d). 4d*3 - 3d*2 Let j(n) = -2n + 3 - 2n + 3n. Suppose 0u = -2o - u + 40, -2o + 2u + 52 = 0. Let w(r) = o - r + 2r - 6r - 6. Determine -11j(z) + 2w(z). z - 1 Let k(v) = 3v - 9. Let o(u) = u - 4. Let g = 65 - 60. Calculate go(c) - 2k(c). -c - 2 Let y be (3 - 8)9/15. Let q(v) = -2v - 1. Let j(f) = f + 1. Give yj(g) - q(g). -g - 2 Let z(f) = 5f - 61. Let p be z(11). Let c(h) = 7h*3 + 9h*2 + 13h + 9. Let t(s) = 3s3 + 4s*2 + 6s + 4. Calculate pc(n) + 13t(n). -3n3 - 2n2 - 2 Suppose -1 = -c + 7. Let l(x) = -x3 + 8x2 + 2x - 11. Let b be l(c). Let n(v) = -v*2 + 6v. Let g(j) = -j*2 + 5j. What is bn(a) - 6g(a)? a*2 Let u(g) = 3g*3 + 2g*2 + 2g. Let p(w) = -3w3 - w2 - 2w. What is 4p(m) + 3u(m)? -3m3 + 2m*2 - 2m Let q(t) = -2t. Let u = 1 - 2. Let o = -1 - u. Let p be (-10)/2 + (1 - o). Let f(w) = -3w - 1. Determine pq(a) + 2f(a). 2a - 2 Let w(h) be the second derivative of h5/4 - h4/6 - h3/3 + h2 + h. Let p(r) = -11r*3 + 5r*2 + 5r - 5. Calculate -2p(b) - 5w(b). -3b3 Let j(p) = p3 + p. Let g(z) = -16z*3 - 8z. Give 5g(w) + 40j(w). -40w3 Let w(f) = 9f + 5. Let t(h) be the first derivative of 5h2 + 6h - 49. Calculate -5t(g) + 6w(g). 4g Let s = -17 - -18. Let c(u) = u3 - u - 1. Let i(h) = 3h*3 - 4h - 4. What is si(t) - 4c(t)? -t3 Let b(o) be the first derivative of o3 + 7o2/2 + 3o - 192. Let p(r) = r*2 + 2r + 1. Let n = -4 - -2. Calculate nb(l) + 7p(l). l*2 + 1 Let g(p) = -2 + 6 - 116p*3 + 115p3 - p. Let z(s) be the second derivative of -s5/10 - s*3/3 + 5s*2 + s. Give -12g(b) + 5z(b). 2b*3 + 2b + 2 Let o(z) = 2z3 + 3z2 - 3. Let w(d) = -d3 - d*2 + 1. Let h = -39 - -37. Determine ho(j) - 6w(j). 2j*3 Let t(s) = -s - 2. Let n be ((-22)/33)/(1/(6/4)). Let w(g) = g. Determine nt(q) - 4w(q). -3q + 2 Let k(c) = -12c3 - 9c*2 - 9c - 9. Let l(m) = 6m3 + 5m*2 + 5m + 5. What is 5k(j) + 9l(j)? -6j3 Let q(g) = -4g*3 + 17g*2 - 5g - 5. Let s(v) = 6v3 - 26v*2 + 8v + 8. Calculate 8q(j) + 5s(j). -2j3 + 6j2 Let k(v) = v3 + 6v2 + v + 2. Let m be k(-6). Let f(t) = -t. Let a(l) = -6l - 1. What is mf(h) + a(h)? -2h - 1 Let y(z) = 17z2 + z. Let d(v) = v. Give -2d(u) + 2y(u). 34u*2 Let s(w) = -7w + 14. Let c(j) = -2j + 5. Let i(d) = 8c(d) - 3s(d). Let o(p) = -p - 2 + 6 - 10p + 1. What is 9i(f) + 4o(f)? f + 2 Let l(j) = -j2 + j2 - 1 + j*2. Let b = -1 - 3. Let o(u) = -5u2 - u + 3. Let r(g) = -g2 - 6g - 6. Let v be r(-5). Calculate bl(w) + vo(w). w2 + w + 1 Let v(g) = g3 - g2. Let h(f) = 8f2 - f2 - 130f3 + 120f*3. Give -h(u) - 6v(u). 4u3 - u2 Let d(i) = -i2 + 2i + 1. Let v(w) be the first derivative of 3w2/2 + w - 8. What is -3d(f) + 2v(f)? 3f2 - 1 Let k(s) = s3 - 4s2 + 4s. Let c be k(3). Suppose 0 = 2j - c + 1. Let w(r) = -1. Let t(i) = -2i - 4. Give jt(u) - 5w(u). -2u + 1 Let y(n) = -8n + 7. Suppose -3k - 13 = 2i, 3k + 0k - 17 = 4i. Let l(b) = 7b - 6. What is iy(w) - 6l(w)? -2w + 1 Let w(g) = -7g*2 + 4g. Let f(i) = -8i2 + 3i. Give -6f(c) + 5w(c). 13c2 + 2c Let f(l) = 4l + 1. Let x(b) = -3 - 7b + 2 - 1. Calculate 11f(d) + 6x(d). 2d - 1 Let i(l) = l3 + l2 + 3. Let z(u) = u3 + 5u + 11. Let x(o) = o3 + o2 - o + 1. Let f(n) = 5x(n) + z(n). What is -4f(a) + 22i(a)? -2a*3 + 2a*2 + 2 Suppose -2n = -4 - 18. Let v(t) = 5t + 1 + 0t - t. Let k(g) = 21g + 5. Let d(y) = -y3 + 4y*2 - 3y - 2. Let l be d(3). Determine lk(p) + nv(p). 2p + 1 Let m(s) = s2. Let c(k) = -225k*2. Calculate c(z) + 150m(z). -75z2 Let v(r) = 5r - 6. Let i be (-5)/2(1 + -7). Let b(n) = -14 + 13 - 6n - 10 + in. Give 6b(s) - 11v(s). -s Suppose 0 = -0b + 3b - 6. Let t(d) = 3 + 8d - d + 1 + 2db. Let v(q) = -2q*2 - 6q - 3. Determine 4t(o) + 5v(o). -2o2 - 2o + 1 Let m(i) = 27i3 - 21i*2 + 21. Let x(b) = -7b*3 + 5b*2 - 5. What is -5m(a) - 21x(a)? 12a*3 Let z(w) = -2w*2 + 37w - 4. Let t(c) = 4c2 - 74c + 7. Determine 4t(y) + 7z(y). 2y2 - 37y Let o(p) = -20p + 7. Let y(q) = -19q + 6. Give 4o(d) - 5y(d). 15d - 2 Let v(t) = -2t - 1. Let p(i) = -i. Let h(x) = x*3 + 6x*2 + 4x - 4. Let q be h(-5). Suppose -6 = y - q. Give yp(s) + 2v(s). s - 2 Let p(s) = s + 1. Let t(w) = 15. Give 2p(x) - t(x). 2x - 13 Let c(u) = -u*2 - 1. Let g(r) = -4r*2 - 2. Let w(p) = -c(p) - g(p). Suppose 4l + 40 = -l. Let x(k) = -3k2 - 2. Let h = -11 - -6. Give hw(s) + lx(s). -s2 + 1 Let j(x) = -x + 1. Let i(d) = -3d*2 - 2d + 6. Let w be i(-3). Let t = w + 7. Let p(a) = -2a2 + 8a - 6. Determine tj(r) - p(r). 2r*2 - 2 Let b(y) = 69y - 5. Let k(t) = 104t - 8. Give -8b(v) + 5k(v). -32v Suppose 5i - 22 - 38 = 0. Let x be (-4)/i3-5. Let r(p) = 9p*2 - 5p. Let f(k) = 14k2 - 8k. Calculate xf(m) - 8r(m). -2m2 Let a(q) = q2 - 15q + 32. Let x be a(12). Let l(t) = -6t3 - 5t*2 + 4t + 2. Let h(y) = -5y3 - 4y*2 + 3y + 2. What is xh(i) + 3l(i)? 2i3 + i2 - 2 Let f(q) = -6q*3 - 7q*2 + 3. Let m(i) = 2i*3 + 2i*2 - 1. Let b(j) = -j - 6. Let n be b(-8). What is nf(w) + 7m(w)? 2w*3 - 1 Let y(a) = -49a*3 - 21a*2 + 21a. Let n(m) = 5m3 + 7m + 12m + 5m + 2m2 - 26m. What is 21n(s) + 2y(s)? 7s3 Let r(f) = 7f*2 - 8. Let j(a) be the first derivative of -2a*3 + 7a - 13. Calculate 6j(s) + 5r(s). -s*2 + 2 Let z(v) = -575v. Let p(k) = -18k. What is 161p(y) - 5z(y)? -23y Let l(g) = 25g2 + 3g - 4. Let b(z) = 25z2 + 4z - 5. Calculate 3b(p) - 4l(p). -25p2 + 1 Let i = 1 + 4. Suppose m - im = 12. Let o(u) = -11u. Let a(r) = -r - 1. Let j(b) = -7b - 2. Let v(y) = 2a(y) - j(y). Determine mo(p) - 7v(p). -2p Let a(h) = -2h2 + 6h - 2. Let f(k) = 3k2 - 11k + 3. Let i = 12 + -8. Let o(m) = m*2 - 3m + 3. Let g be o(i). What is ga(j) + 4f(j)? -2j2 - 2j - 2 Let b(w) = -35w2 - 3w + 3. Let a(g) = -280g2 - 25g + 25. What is 3a(c) - 25b(c)? 35c2 Let i(q) = 16q3 + q2 - 20q. Let h(p) = 5p*3 - 7p. Give -7h(z) + 2i(z). -3z3 + 2z*2 + 9z Let p(o) = o + 1. Let j(a) = -a - 4. Let n(m) = j(m) - 5p(m). Let x(i) = 3i + 4. Determine -4n(v) - 9x(v). -3v Let d(c) = -4c*3 + 2c + 1. Let l(p) = -13p3 + 6p + 4. Calculate 7d(i) - 2l(i). -2i3 + 2i - 1 Let f(p) = 5p + 5. Let x(o) = -o + 1. Let m(t) = 5t - 4. Let l(v) = -2m(v) - 9x(v). Suppose -2h = -3 + 1. Calculate hf(z) + 3l(z). 2z + 2 Let i(o) = -2 + 3 - 2o3 + 0 + o2 - 3. Let q(h) = 2h3 - h2 + 2. Determine -3i(s) - 4q(s). -2s3 + s2 - 2 Let s(k) = 2k. Let r(v) = -4v - 4v + 6v. Suppose -2g - 5q = -21, -4g - 2q + 3 = -5q. Let x = -10 - -12. What is gs(l) + xr(l)? 2l Let o(z) = z3 - 6z + 7. Let p(y) = -y*3 + 5y*3 + 6 - 3y*3 - 5y. Calculate -5o(l) + 6p(l). l3 + 1 Let f(o) be the third derivative of o5/20 + o*4/8 + 3o*3/2 - 13o*2. Let v(g) = -2g*2 - 2g - 5. What is -4f(j) - 7v(j)? 2j2 + 2j - 1 Let c(n) be the first derivative of 4n2 + 4n + 7. Suppose 0 = 3q - 4o - 30, 24 = -0q + 3q - 2o. Let y(r) = -r - 1. What is qy(w) + c(w)? 2w - 2 Let w(o) = 6o*3 - 6o*2 - 4o. Let i(r) = r3 - r2 - r. Give 4i(h) - w(h). -2h*3 + 2h*2 Let l(m) = 36m*3 + 26m*2 - 26. Let j(t) = 4t*3 + 3t*2 - 3. Determine 52j(z) - 6l(z). -8z*3 Suppose 1 + 3 = 2n. Let i(d) = d*2 - d + 2 - 1 + nd. Let y be 2/8 + 13/(-4). Let c(b) = -2b2 - 2b - 1. Give yc(a) - 5i(a). a*2 + a - 2 Let s(v) = 4v + 2. Let h(j) = j. Let l(m) = -3h(m) - s(m). Let r(w) = 20w + 6. What is 11l(g) + 4r(g)? 3g + 2 Let j(b) = -b - 3. Let i(o) = -6o - 16. Let q(p) = -2i(p) + 11j(p). Let f(z) = z - 3. Let x(c) = -4. Let g(u) = -3f(u) + 2x(u). Determine -g(m) - q(m). 2m Let k(m) = -m3 + m2 - 1. Let v(r) be the first derivative of -r4/4 - r - 6. Determine 3k(x) - 2v(x). -x3 + 3x*2 - 1 Let u(j) = -2j*2. Let a(l) = 182l + l*2 - 4l2 + l3 - 182l. Determine 4a(d) - 6u(d). 4d*3 Let v = -84 + 82. Let x(j) = -6j*3 - 3j*2 + 3j + 1. Let b(h) = 5h3 + 2h*2 - 2h - 1. Calculate vx(a) - 3b(a). -3a*3 + 1 Let x(f)	{ "pile_set_name": "DM Mathematics" }
nded to 2 dps? -0.56 Let w be (0 - (2 + -2))(-17)/34. Suppose w = -64h + 8h + 7464800. Round h to the nearest ten thousand. 130000 Let k = -13.7069 - -13.707049353. Round k to 5 dps. 0.00015 Let m = -2135.012 - -2128. What is m rounded to the nearest integer? -7 Suppose -26115 = 5f - 15u + 10u, -2f - 10431 = 3u. What is f rounded to the nearest ten thousand? -10000 Let s = -123.64 - 29.33. Let b = s - -154. Let p = 1.0300054 - b. What is p rounded to 6 dps? 0.000005 Suppose 51t + 33t + 611688 = 0. What is t rounded to the nearest one thousand? -7000 Let n be 26025((-152)/(-1444) - (-392)/(-114)). Round n to the nearest ten thousand. -90000 Let l = 0.72 + 0.81. Let u = l - 19.93. Let c = 31.1 + u. What is c rounded to the nearest integer? 13 Let c = -0.2386 - -44.6686. What is c rounded to the nearest 10? 40 Suppose -53l = -48l - 5a + 51600, -2l - 20649 = a. Round l to the nearest one hundred. -10300 Let f = -18339 - -18263.544. What is f rounded to the nearest 10? -80 Let x = -0.37490453 - 2.82509506. Let h = x - -3.2. What is h rounded to seven dps? 0.0000004 Let w = 12257.9994399 - 12258. What is w rounded to 4 decimal places? -0.0006 Let c be 10/35 + 182/49. Suppose -5h = -ch - 4, -t = 3h - 20900012. What is t rounded to the nearest 1000000? 21000000 Let j = 196 - 196.13. Let u = 21.36 + -21. Let g = j + u. Round g to 1 decimal place. 0.2 Let k = -26516.3 + 27884. What is k rounded to the nearest ten? 1370 Let m(b) = 32200007b - 5. Let x be m(2). Suppose 4t - 2f - 13027224 + 77427218 = 0, 4t + 3f + x = 0. Round t to the nearest one million. -16000000 Suppose 0 = -5f + 8f + 356490000. Round f to the nearest 1000000. -119000000 Let n = -1735.7 - -1530. Let u = n - -196. Let z = -8.48 - u. What is z rounded to one dp? 1.2 Let g = -9.54182 + 0.02582. What is g rounded to one decimal place? -9.5 Let j(p) = -p2 - 1. Let h(l) = 4l*2 + 19. Let y(f) = h(f) + 5j(f). Let g be y(6). Let i = -9 - g. Round i to the nearest one hundred. 0 Let h = -175.278612 + -0.127388. What is h rounded to the nearest integer? -175 Let y = 7.49 + -6.391. Let x = 1.10439 - y. What is x rounded to 4 decimal places? 0.0054 Let y = -585 - -587.63. Let p = -2.629999422 + y. What is p rounded to 7 decimal places? 0.0000006 Let w = -0.2168 + -9.2372. Round w to the nearest integer. -9 Let h be (5/(-10))/(-2 + 52598/26300). Suppose o = -1, 2n = 5n - 4o + h. Let d be 600/(-9)(n + 3). What is d rounded to the nearest one hundred thousand? 100000 Let q = -0.139 - 187.861. Let p = q + 187.99055. Round p to three dps. -0.009 Let l = 39.7 + -75.6. Let r = -34.6 - l. What is r rounded to the nearest 10? 0 Let c = 373 + -265. Let m = -767632 - -767739.99412. Let w = c - m. What is w rounded to three dps? 0.006 Suppose 0 = 7p - 82 + 40. Suppose -pk = 3k + 192600000. What is k rounded to the nearest one million? -21000000 Suppose 3m - 4z - 9 = 11, 3m + 3z = 27. Suppose -31653830 + 7157830 = mc. Round c to the nearest one hundred thousand. -3100000 Let x = -4776302 + 4776380.00068. Let k = x + -78. Round k to four dps. 0.0007 Let j = -1325512 + 1325488.099725. Let t = 23.9 + j. What is t rounded to 5 dps? -0.00028 Let w = -10809 - -10808.9969162. What is w rounded to five dps? -0.00308 Let r(d) be the second derivative of -4723d3/6 - 61d*2/2 + 13d. Let i be r(-7). What is i rounded to the nearest one hundred thousand? 0 Let g be (2904/56 + -9)/(2/1883). What is g rounded to the nearest one hundred? 40400 Let k = -652650 + 653893.957. Let a = k + -1248. What is a rounded to 1 decimal place? -4 Let h = -12045 - -12065.034. Round h to the nearest integer. 20 Let t = -7986454.83945 + 7991674.010449504. Let n = t + -5219.223. Let i = -0.052 - n. What is i rounded to 7 dps? 0.0000005 Let h = 1091956.6 - 1091925.299315. Let y = h - 31.3. What is y rounded to five dps? 0.00069 Let h = 6.7 + -15.3. Let v = h - -3.6. Let j = 5.00102 + v. What is j rounded to 4 decimal places? 0.001 Let b = -177816 + 177815.8670069. Let d = 29.3 + -29.433. Let j = b - d. What is j rounded to 6 decimal places? 0.000007 Let w = 2.1246 - 2.893. What is w rounded to one dp? -0.8 Let j = 18.18228167 - 18.182. What is j rounded to 5 decimal places? 0.00028 Let o = 9546.0013198 + -9546. Round o to five decimal places. 0.00132 Let h = 4619 - 4619.00005672. Round h to six decimal places. -0.000057 Suppose -3r = -5r - 3s - 7, -3r = 2s - 2. Suppose 0 = -16m + 10261 + 21419. Suppose 5i + 2484 = -rl, 0i - m = 4i + 5l. Round i to the nearest 1000. -1000 Let x = -50.04 + 1.04. Let f = -5822 + 5871.074. Let y = x + f. Round y to 2 decimal places. 0.07 Let k = 115 + -111. Suppose -3v = -5a - 0 - 14, 0 = 2v + 2a - k. Let d be -10(0 + -107 + v). What is d rounded to the nearest one hundred? 1000 Suppose -4543670 = -3m + 2364238. Let y = m + -11032636. What is y rounded to the nearest one hundred thousand? -8700000 Let c = -74.4254347 - 667.574528. Let h = c + 742. Round h to five dps. 0.00004 Let c = -33.1 + 33.62. Let x = -0.51999972 + c. What is x rounded to 7 decimal places? 0.0000003 Let o = -1636.29999258 - -1636.3. Round o to 5 decimal places. 0.00001 Let u = -191876 + 191628.001. Let f = u + 248. What is f rounded to 1 dp? 0 Let p = 141893.7 + -66077. Let y = p - 75853.699915. Let s = 37 + y. Round s to five dps. 0.00009 Let l(u) = -397150u + 11. Let i be l(-8). Suppose i = 3h - 1132559. Suppose -4436590 = -3y - h. Round y to the nearest one million. 1000000 Let v(s) = -s*3 + 13s*2 + 2s + 14083. Let n be v(0). What is n rounded to the nearest 10000? 10000 Let d = 1290.31 + -1249. Round d to the nearest ten. 40 Let o = -2 - -1. Let s = o - 11. Let w be ((-5753)/(-3) - 1)s. Round w to the nearest 10000. -20000 Let y = 15.8 - 1273.8. Let j = 1182.9 + y. Round j to zero dps. -75 Suppose 9k - 13 - 86 = 0. Suppose kq - 2q = -14400000. What is q rounded to the nearest 100000? -1600000 Let q(t) = 810760t2 + 258t + 1290. Let w be q(-5). What is w rounded to the nearest one hundred thousand? 20300000 Let v = -38239719643 - -38239720557.000002045. Let j = v + -914. Round j to 7 decimal places. 0.000002 Let h = 4111.33 + -4105. Round h to the nearest ten. 10 Let f = -2.55 + 2.764. Let d = 9.284 - f. Round d to the nearest integer. 9 Let v(h) be the third derivative of -h5/60 + h4/3 - 2h3/3 + 8h*2. Let s be v(7). Suppose -st = -156 - 714. Round t to the nearest 100. 300 Let s(t) be the second derivative of 7t3/3 + 51t*2/2 + 21t. Let h be s(-5). What is h rounded to the nearest ten? -20 Let v = 1.958 + 469.642. Let n = v - 411. Round n to the nearest 10. 60 Let v = 604.57 + -604. Let w = 577.402 - 578. Let n = w + v. Round n to 2 dps. -0.03 Let q = -9071 + 9070.9978124. What is q rounded to five dps? -0.00219 Let t = -4.002 + 3.6256. What is t rounded to 1 dp? -0.4 Let y = 4.2 + -0.7. Let w = y + -3.561. Let l = w - -0.06094. What is l rounded to four decimal places? -0.0001 Let q = -200976.579964 + 200977. Let k = q - 0.42. What is k rounded to five dps? 0.00004 Let l = -266 - -266.796. Round l to one decimal place. 0.8 Let d = 65.09 - 65. Let j = d - -65.91. Let z = j - 66.166. Round z to 2 decimal places. -0.17 Let l = -62071.239 + 61992. What is l rounded to the nearest ten? -80 Let r = 14.06223639 + -14.162237. Let k = 0.1 + r. What is k rounded to 7 dps? -0.0000006 Let j = -55 + 56.44. Let k = -1.71642 - -0.27204. Let s = j + k. Round s to three dps. -0.004 Suppose -4z + 28159 = -207669. Let g = z + -98157. Round g to the nearest one thousand. -39000 Let u = 460408 + -460629.8577. Let b = u + 222. Round b to two dps. 0.14 Suppose -t - m + 4m - 15 = 0, -m = -5. Suppose -12g - 517230 - 19470 = t. Let l = -88725 - g. What is l rounded to the nearest 10000? -40000 Let c = -366 - -82. Let n(f) = -673f + 3. Let j be n(-1). Let x = j - c. Round x to the nearest 1000. 1000 Let o = -0.0070619046544 + -1567.9929359583456. Let a = -1568 - o. What is a rounded to 7 dps? -0.0000021 Let p = 0.4232 + 83.0868. What is p rounded to the nearest 10? 80 Let v = 91.7839 - 94.4. Let k = v - 0.0839. What is k rounded to the nearest 10? 0 Let s = 1.248 + -1.06. Let o = s + 0.042. Let x = o - -3.57. Round x to the nearest integer. 4 Let b = 48 + -118. Let t	{ "pile_set_name": "DM Mathematics" }
t from {l: 4, z: 2, r: 1, w: 5, i: 4}. What is prob of picking 1 r and 2 z? 1/560 What is prob of picking 1 d and 1 w when two letters picked without replacement from wcebdwbddeuddwbee? 15/136 Two letters picked without replacement from yyyyeygyegyyyagegg. Give prob of picking 2 e. 1/51 Calculate prob of picking 2 z when two letters picked without replacement from {z: 10, w: 9}. 5/19 Calculate prob of picking 1 p and 1 q when two letters picked without replacement from pqqrdppdqqqrdnqd. 3/20 Three letters picked without replacement from vvvvvvbvbpvppylyvb. What is prob of picking 1 y, 1 l, and 1 v? 3/136 Calculate prob of picking 1 v and 1 m when two letters picked without replacement from mmqeeqmeeqmeqkve. 1/30 Four letters picked without replacement from ssesumas. Give prob of picking 2 s, 1 u, and 1 a. 3/35 Two letters picked without replacement from xxxgxgx. Give prob of picking 1 x and 1 g. 10/21 Two letters picked without replacement from {y: 1, q: 7}. Give prob of picking 1 q and 1 y. 1/4 Three letters picked without replacement from {l: 8, o: 2, b: 4, s: 2, r: 3, u: 1}. Give prob of picking 1 u and 2 b. 1/190 What is prob of picking 2 r when two letters picked without replacement from {w: 7, r: 3}? 1/15 Three letters picked without replacement from yyyryyry. Give prob of picking 2 r and 1 y. 3/28 Three letters picked without replacement from {o: 3, y: 8, a: 6}. What is prob of picking 1 a and 2 y? 21/85 Calculate prob of picking 1 c and 3 x when four letters picked without replacement from ncnnnknxnnxppnnxn. 1/2380 Calculate prob of picking 1 m and 2 g when three letters picked without replacement from {m: 2, l: 1, g: 2}. 1/5 Four letters picked without replacement from {m: 2, s: 2, q: 2}. What is prob of picking 2 m and 2 s? 1/15 Four letters picked without replacement from guuuggcuggggcc. Give prob of picking 2 g and 2 c. 9/143 What is prob of picking 1 q, 1 i, and 2 s when four letters picked without replacement from hkhuiuhshuqhuusuqihi? 2/1615 What is prob of picking 3 q when three letters picked without replacement from eeeqexqooqoeee? 1/364 Calculate prob of picking 1 s and 3 c when four letters picked without replacement from {u: 9, c: 3, w: 3, s: 5}. 1/969 Three letters picked without replacement from {k: 1, c: 4, r: 1, w: 3, z: 2}. What is prob of picking 1 r and 2 c? 2/55 What is prob of picking 1 r and 3 c when four letters picked without replacement from {c: 7, r: 2}? 5/9 What is prob of picking 3 d and 1 h when four letters picked without replacement from hhddhhhdhhhddh? 90/1001 Calculate prob of picking 2 c, 1 r, and 1 w when four letters picked without replacement from {v: 5, w: 5, r: 1, c: 3, a: 3, g: 1}. 1/204 Two letters picked without replacement from ohbppdqh. What is prob of picking 1 d and 1 o? 1/28 What is prob of picking 1 d, 1 r, 1 t, and 1 j when four letters picked without replacement from rjdatdtrdftrfdfdf? 9/476 Two letters picked without replacement from {w: 3, e: 2, z: 4, f: 3, l: 3, n: 1}. What is prob of picking 1 e and 1 z? 1/15 Two letters picked without replacement from {z: 1, m: 2, i: 1, r: 1, b: 2, o: 1}. Give prob of picking 2 b. 1/28 Calculate prob of picking 1 t and 1 k when two letters picked without replacement from {z: 1, t: 4, j: 1, o: 1, k: 4, e: 7}. 16/153 Calculate prob of picking 3 o and 1 s when four letters picked without replacement from oooooososoo. 28/55 Calculate prob of picking 4 y when four letters picked without replacement from yyyyy. 1 Two letters picked without replacement from pwypwwyw. Give prob of picking 1 y and 1 p. 1/7 Three letters picked without replacement from dmemkkemmemmkf. What is prob of picking 1 d and 2 m? 15/364 Calculate prob of picking 2 f when two letters picked without replacement from {n: 2, f: 2, x: 1, b: 3, y: 4, v: 2}. 1/91 What is prob of picking 2 o when two letters picked without replacement from ootgccgotogottg? 2/21 Three letters picked without replacement from {w: 1, v: 2, q: 4}. What is prob of picking 2 q and 1 w? 6/35 Calculate prob of picking 3 q and 1 z when four letters picked without replacement from yxqzzqqzyxzyyqxyyqx. 10/969 What is prob of picking 3 w when three letters picked without replacement from {n: 16, w: 4}? 1/285 Three letters picked without replacement from {h: 2, a: 3, u: 1, i: 4, g: 1}. Give prob of picking 2 i and 1 u. 2/55 Three letters picked without replacement from vnnnaavnaanaa. What is prob of picking 3 a? 10/143 What is prob of picking 1 i, 1 y, 1 f, and 1 u when four letters picked without replacement from iiyddiafuda? 1/110 What is prob of picking 3 o when three letters picked without replacement from {o: 5, h: 3, p: 1}? 5/42 Three letters picked without replacement from {p: 1, t: 1, u: 1, m: 5, l: 6}. Give prob of picking 2 m and 1 u. 5/182 Calculate prob of picking 1 l and 1 t when two letters picked without replacement from {t: 1, l: 2}. 2/3 What is prob of picking 2 l when two letters picked without replacement from {l: 2, w: 10}? 1/66 Three letters picked without replacement from oononnnnnnononoo. What is prob of picking 1 o and 2 n? 9/20 Calculate prob of picking 1 b, 1 n, and 2 u when four letters picked without replacement from {l: 2, n: 2, m: 2, b: 7, u: 2}. 2/195 Two letters picked without replacement from kkrkirkkkk. Give prob of picking 1 r and 1 i. 2/45 Two letters picked without replacement from zqqqqzqqq. Give prob of picking 2 z. 1/36 Three letters picked without replacement from hxxktkhxkmxthkkxkkt. What is prob of picking 1 k, 1 h, and 1 m? 7/323 Calculate prob of picking 2 h when two letters picked without replacement from {y: 2, h: 1, k: 1, d: 2}. 0 Four letters picked without replacement from rmiifjj. What is prob of picking 1 i, 1 m, 1 j, and 1 f? 4/35 What is prob of picking 1 k and 1 r when two letters picked without replacement from llklzjzzzppjlpjjr? 1/136 What is prob of picking 2 a when two letters picked without replacement from aawww? 1/10 What is prob of picking 2 r when two letters picked without replacement from jrjddjjrjr? 1/15 Calculate prob of picking 1 v and 1 b when two letters picked without replacement from bvovsbavavaabaab. 2/15 What is prob of picking 1 m and 1 k when two letters picked without replacement from {s: 6, p: 2, i: 1, k: 2, m: 1}? 1/33 What is prob of picking 1 g and 1 v when two letters picked without replacement from {c: 1, z: 1, v: 3, g: 2}? 2/7 Four letters picked without replacement from {m: 3, l: 9}. Give prob of picking 3 l and 1 m. 28/55 Four letters picked without replacement from {o: 3, v: 10, a: 4, c: 2}. Give prob of picking 1 v and 3 a. 10/969 Four letters picked without replacement from sjssssjjjssjj. Give prob of picking 3 j and 1 s. 28/143 What is prob of picking 1 x and 2 q when three letters picked without replacement from xqo? 0 Four letters picked without replacement from uuumouiuaiuauauum. Give prob of picking 1 o, 1 m, and 2 i. 1/1190 Two letters picked without replacement from iuyysyxllysi. Give prob of picking 1 i and 1 s. 2/33 Calculate prob of picking 1 s and 1 t when two letters picked without replacement from ottoossjtttooss. 4/21 Two letters picked without replacement from arfaffpaaaapfaafaaar. Give prob of picking 1 a and 1 f. 11/38 Two letters picked without replacement from {z: 3, c: 1, x: 2, e: 1}. What is prob of picking 1 x and 1 z? 2/7 Four letters picked without replacement from {a: 4, t: 14}. Give prob of picking 1 a and 3 t. 364/765 Two letters picked without replacement from annaulnnnnandnuvnddl. What is prob of picking 1 n and 1 d? 27/190 What is prob of picking 2 l when two letters picked without replacement from {l: 2, j: 3}? 1/10 Calculate prob of picking 4 e when four letters picked without replacement from eeieeie. 1/7 Calculate prob of picking 1 t and 1 i when two letters picked without replacement from {t: 2, j: 2, i: 2}. 4/15 Calculate prob of picking 1 b and 2 m when three letters picked without replacement from {l: 1, m: 3, s: 2, b: 6}. 9/110 Three letters picked without replacement from {s: 1, e: 1, b: 1, x: 1, m: 1}. What is prob of picking 1 x, 1 b, and 1 e? 1/10 Calculate prob of picking 1 z, 1 l, and 1 h when three letters picked without replacement from {w: 2, z: 1, t: 1, h: 1, o: 1, l: 1}. 1/35 Wh	{ "pile_set_name": "DM Mathematics" }
+ 10, -oz - 6 = -3t + z. Suppose -4 = -4r + t. Solve rw + 0w + 1 = 3u, -4w - 4 = -4u for w. -2 Let t be ((-36)/(-16))/((-6)/(-16)). Let w(r) = -r*3 - 5r*2 - 6r - 5. Let o be w(-4). Suppose -oi = -ti + 12. Solve -s + 1 = -j, j - 3j + 4s = i for j. 0 Suppose 0 = 4b + 2t, b - 17 + 6 = 5t. Let x(h) = -11h + 311. Let v be x(28). Solve -g = 4l + 7, b = -l - vg + 13 for l. -3 Let t be 2/(-5) - (-16)/40. Suppose 3c - 3m - 21 = 0, 0c + 3m + 31 = 5c. Solve cg - s + 2 = -0g, t = -4s + 8 for g. 0 Let l = -6 + 9. Solve lm - 2x = -13, 2m + 19 = 3m + 4x for m. -1 Let a = -30 - -32. Solve 2b = -ar - 2r - 12, 5b - 35 = 3r for r. -5 Suppose 2w + w - 27 = 0. Suppose 0r = -3r + w. Suppose -29 = -8q + 3q + 3c, -2q - rc - 1 = 0. Solve 5j - 3j - q = 0, 3p - 19 = -5j for p. 3 Let f(o) = -o - 2. Let v be f(-6). Solve -4w = -2m + 17 + 9, vw + 23 = m for m. 3 Let u be 58/6 - (-1)/3. Solve -2j = 4c, -2j - 2j + 2c + u = 0 for j. 2 Let h = -4 + 6. Let l(w) = -3w + 8. Let m be l(6). Let s = m - -12. Solve -hn + 8 = -n - st, 20 = 4n - 4t for n. 2 Suppose -5 = -3u + 4m, 4m - m - 26 = -2u. Solve -3z = -uq + 3q + 14, -2q - 2z = 0 for q. 2 Let m be (-76)/(-20) - 2/(-10). Suppose -2q + m = 4k - 18, 3k - 27 = -5q. Suppose -kp = 5 - 25. Solve 0 = -o + 4n + 7, 2o - pn = 5 + 3 for o. -1 Let p(w) be the third derivative of w5/60 + w4/12 + w*3/2 - 6w*2. Let b be p(-2). Solve -a - q = -5a - 15, ba + 2q + 3 = 0 for a. -3 Suppose n + 3n + 24 = 0. Let f = n - -10. Solve x - fm - 6 - 2 = 0, -4x + 3m + 6 = 0 for x. 0 Let b(d) = -d*3 + 1 - 6d*2 + 0 - d + 4d*2. Let f be 7/(-3) - 12/18. Let k be b(f). Solve 5w + 7 = 3m - k, 4w - 4m + 24 = 0 for w. -1 Suppose -16 = -3w + 4r + 2, 0 = 2r. Solve 3a = 4u + u + 37, 0 = 2u + 4a - w for u. -5 Let v(t) be the third derivative of t4/8 + t2. Let w be v(-1). Let s be (30/(-9))/(2/w). Solve 3m = -3u - 15, -sm - 13 = -0u + u for u. -3 Suppose 4 = -4k + 16. Suppose h = 3v + 17, kh - 21 = 3v - 0v. Solve 4f + 3t - 1 = -5, 5f + 5 = -ht for f. -1 Let h be (-1 + 1)/(3/(-1)). Suppose 2k + h = 4. Suppose -6 = -d - 4n, -5n + k = -2d + 1. Solve 6 = -x + 2x + dz, 5x + 6 = -z for x. -2 Let f(z) = -4z2 + z. Let i be f(-5). Let h be ((-4)/6)/(14/i). Suppose 0 = -0o - o + 3. Solve -o = -2k + h, -4p = -2k + 12 for p. -1 Let z(j) = -j2 - 7j - 2. Let k be (4 + 2)(4 + -5). Let u be z(k). Solve 5m = -3f - 0 - 14, 3m = uf - 20 for m. -4 Suppose 0 = 3l + 2a - 37, a - 14 = -l + 2a. Let z = -95 - -98. Solve -zr - 2 = k, -2r + 5k = 11 + l for r. -2 Let h be (-10 + 2)3/(-6). Solve -r - 4 - 2 = hi, 2r = i - 3 for r. -2 Suppose -12 = -6o + 3o. Solve 2d = -4u + 4 + 4, -2u = -d - o for d. 0 Suppose 5d + 0 = 10. Solve -df - 14 = 2h + 3f, -3f = 6 for h. -2 Suppose 0 = -5w + 6w - 3. Solve wc - 25 = 5o, 7c = -5o + 2c + 15 for o. -2 Suppose 3q - 3p = -2q + 5, -5p = -3q - 13. Let z(r) = 3r2 + r. Let b be z(1). Let y = b + 1. Solve 5i = 0, 0 = qj - yi - 5 + 1 for j. 1 Suppose -4l - 8 = g, -3l = -l + 6. Suppose -u - u = -2z + 6, -2z = -gu - 12. Solve -n - 5 = -2c - 0c, 4n + 2c = z for n. -1 Let t = 0 - -3. Suppose 2m = -2z + 6, -tz = -2z + 5m - 7. Let h be 31 + (-6)/(-2) + -4. Solve -zn = 4y - 3n + 4, 5n = -5y - h for y. -2 Let x(i) = i2 - 2i - 12. Let f be x(5). Solve -u - 4 = 0, -g + u = -u - f for g. -5 Let u = -7 - 3. Let d be (u/12)/(6/(-36)). Solve 5w = -10, dy + 5w = 1 + 4 for y. 3 Let i be 3 + -3(-1)/3. Solve 0 = -3n - 5r + 5 + i, 2n - 5r = 6 for n. 3 Let m = 13 + -22. Let h = m - -15. Solve d - r - 2 = 0, h = 3d - 0d + 4r for d. 2 Let s = 24 + -14. Suppose -3n - 5w = -9 - 4, 4n - s = -3w. Solve 3g + 8 = x - 1, -3x = 4g - n for x. 3 Let o be 13/1 - 2/(-1). Let y = o + -6. Solve 3p - 3t = y, -6p - 14 = -4p + 2t for p. -2 Let l = -2 - -4. Suppose -5v = 4v. Solve lz = -g + 5, 5z - 10 = -vg - 5g for z. 3 Let h be (-2)/(2 - -2)-6. Suppose -ho + 9 = -3s - 0s, 5o = 2s + 21. Let n be 2 - (s - 4 - -2). Solve -8 - 4 = nc - 4q, -q = c - 3 for c. 0 Suppose -l + 5r + 17 = -0l, -3r - 7 = l. Suppose lm - 42 = -m. Solve -4w = -5d + 23 + 5, -2d + 3w + m = 0 for d. 4 Suppose j - 2j + 15 = 0. Solve -3l = 5y - 0l - 11, 5l + j = 0 for y. 4 Suppose -r = -6 + 1. Let v = 230 - 230. Solve z - rp = -24, -4p + 3p + 5 = v for z. 1 Suppose -4u + 11 = -5, 5y = -5u + 40. Suppose -15 = -yr + 5. Solve -5s = -4z + 13, 5z + 5s = -0z + r for z. 2 Let p(s) = s*3 - 2s*2 - s - 1. Let j be p(3). Solve 4c + 3o + j = 0, 4c = -5o - 5 + 2 for c. -2 Suppose 5z + 9 = -3l, -8 = 5l + 5z - 3. Solve 4 = -4f + y + y, -lf - 10 = -5y for f. 0 Let x = 20 + -13. Let f(g) = -g - 1. Let q(u) = 7u + 1. Let t(l) = 6f(l) + q(l). Let s be t(x). Solve 3z = -3r - sz + 32, -2z + 8 = 0 for r. 4 Let t be (2 - 1)2 - -1. Suppose 2n + 1 = -5l - 9, 3n - 11 = -l. Let u = 6 - 2. Solve nf + 5 = 5b, -tb + 17 = uf - 0f for f. 2 Suppose 24 = 3x + 6. Let c = -6 + x. Solve -4h + h + r - 14 = c, 0 = 2h + r + 11 for h. -5 Let m(l) = -l*3 - 3l*2 + 6l + 2. Let q be m(-4). Let v(i) = -i*2 + 2i + 4. Let g be v(5). Let b = q - g. Solve 30 + 2 = -4y - 5u, -2u - b = -y for y. -3 Suppose -5w + 57 = 5a - 103, 0 = -2w + 8. Let x = a - 25. Solve -xi - 10 = -7i - 2k, -7 = 2i - 3k for i. 1 Let y = 33 + -20. Let c be 2 + 1/(-1) + -1. Suppose -4x + 5 + 39 = c. Solve -5s - y = 2b + x, -s + 5b + 6 = 0 for s. -4 Let i(v) = -v3 + 9v*2 + 11v - 5. Let n be i(10). Solve 8 + 0 = t - na, -3a - 15 = -4t for t. 3 Suppose -3s = -2m - 61, -m - 73 = -2s - 2s. Solve -a - 5g - s = 0, 4g = -5a + a - 20 for a. -2 Suppose 13 = 2u + 7. Let h = 2 + -2. Suppose 2x = -2x + 4f + 24, 0 = x - 4f + 3. Solve -4y - um - 25 = h, 0y + 3y = m - x for y. -4 Let y = -7 + 9. Suppose 0 = 5d - 3x + 2x - 15, -yx - 8 = d. Let m = 5 - 3. Solve 2t + 2z + 0z + m = 0, dt + 5z = 1 for t. -2 Let p(n) = -n*3 + 4n*2 + 2n - 2. Let z be p(4). Let w = z + -4. Solve v + y + 4 = 10, 4v = -wy + 20 for v. 4 Suppose -12 = -3s + 3z, 4s - 2z - 30 = -5z. Suppose -sx + 2x = -12. Solve b + m - 11 = -m, 0 = 4b + xm - 19 for b. 1 Suppose 4g - 9 - 3 = 0. Suppose 20 = 7b - gb. Solve bn + 2h + 5 = -3h, 5 = -h for n. 4 Suppose -3o = 3a + 9, -3o + 2a + 4 = 18. Let w be (-72)/27(-3)/(-1). Let j = o - w. Solve -b - l - 1 = -jl, -b - 2l - 1 = 0 for b. -1 Let b(s) = 5s2 - 2s*2 - 3 + 9s + 2s2 - 2s - s*3. Let q be b(6). Solve 2i + g = 3g - 2, -qg + 3 = -4i for i. 0 Suppose -5n + 43 = 2a, 5n + 52 = -3a + 6a. Let b = 12 - a. Let x = -5 - b. Solve j - 15 - 11 = 5l, -l - x = 3j for l. -5 Let o be (6 + -9)(-4)/3. Suppose q + oq = 0. Suppose q = 5l - 4h - 15, -l + 3h - 1 = -4. Solve 0 = 5i, 0w + w = li for w. 0 Let l(w) = -w*2 + 6w. Let b be l(5). Solve -18 = -v + 4m, -4v + bm = v - 15 for v. -2 Suppose 0 = -4l + 11 + 13. Suppose 2j - 2 = l. Solve -4s - 2z + 6 = 0, 0 = -0z + jz + 20 for s. 4 Suppose -u - u = 0. Suppose u = 11m - 14m. Solve 18 + 0 = 3y - 3f, m = 4y + f - 19 for y. 5 Let u = -22 - -24. Solve 2v + 4 = 4w + 24, 4v = -uw for w. -4 Let c be (-16)/6144/64. Let z(k) be the first derivative of -k2/2 - k + 2. Let y be z(c). Solve -q - 2g = -0q, -yq = g - 9 for q. 2 Let g(h) = h*2 - 4h - 1. Let j be g(3). Let w = j + 7. Let z = 7 + -5. Solve zx + wa - 11 = 0, 3x + 3a = 5 + 7 for x. 1 Suppose -b + 13 = 2b - 2j, 2j = -2b + 2. Solve -3m + br + r = 13, -r = -4 for m. 1 Let z(o) = -5o3 + 3o2 + o + 2. Let u(i) = i3 + i*2 - i. Let s(v) = 4u(v) + z(v). Let n be s(6). Solve 8y - 3y - n = 5a, 0 = -5a - 5y for a. -2 Let f be (-4)/18 + 87/27. Solve -i - 4i = -4j, 4j + fi + 32 = 0 for j. -5 Suppose 0s - 2n = -2s, 2n + 5 = s. Let o = 5 + s. Solve l + 3u + 16 = 0, -3l + l + 5u + 12 = o for l. -4 Suppose w + 3n - 12 = -0w, 6 = 5w - 3n. Suppose 64 = wr + 2t, -3 = t - 2. Solve -4o + 2h + r = 0, -10 = -0o - 5o - h for o. 3 Let s(y) = y*3 + 7y*2 - y - 3. Let h = -20 - -13. Let g be s(h). Solve 0 = -3o + gk + 23, -5o + 3k = -33 + 2 for o. 5 Suppose 44 + 54 = 5d + 2j, -2d - 4*j	{ "pile_set_name": "DM Mathematics" }
y*2 Collect the terms in -785s + 225 - 1641s - 223. -2426s + 2 Collect the terms in 9f3 + 530907f*2 - 96 - 530907f*2 + 0f*3 + 96. 9f*3 Collect the terms in 3d*2 + 7 - 15d*2 - 14d*2 - 4 + 19d*2. -7d*2 + 3 Collect the terms in 56731c*2 + 58196c*2 + 58188c*2 - 173121c*2. -6c*2 Collect the terms in -1597o - 4o2 - 27o*2 + 590o. -31o2 - 1007o Collect the terms in -6 + 0 + 32c2 - 23c*2 + 28c*3 - 7c*2 - 301c. 28c3 + 2c*2 - 301c - 6 Collect the terms in 37f2 - 12081781697 + 12081781697. 37f*2 Collect the terms in 552 + 546 - 990w*3 + 2511w*3 - 1098 + 3293w*3. 4814w*3 Collect the terms in -26082i*2 + 13093i*2 + 13064i*2. 75i*2 Collect the terms in 155494f*2 + 9 - 155622f*2 - 3 - 6. -128f*2 Collect the terms in 431 + 891z*2 + 304 - 892z2 - 753. -z2 - 18 Collect the terms in -621l3 - 384l*2 + 188l*2 + 197l*2. -621l3 + l2 Collect the terms in 373a - 46172 - 72a - 303a - 11412 + 653. -2a - 56931 Collect the terms in 50z2 + 11 - 49z*2 - 316z*2 - 408z*2. -723z*2 + 11 Collect the terms in 602g*3 + 204380 - 204380 - 2g*2 - 71g*3. 531g*3 - 2g*2 Collect the terms in 554b*3 - 544b*3 - 525545021b*2 + 525545021b*2. 10b*3 Collect the terms in 149198542469 - 3f - 149198542469 - 2f. -5f Collect the terms in 354 - 11t + 2260 - 85. -11t + 2529 Collect the terms in 15v3 + 2710475902v - 2710475902v. 15v*3 Collect the terms in 11l - 645l3 + l2 + 7l*2 + 345l*3 - 9l + 357l3. 57l*3 + 8l*2 + 2l Collect the terms in 310y + 1640y - 15859y - 733y - 6276y. -20918y Collect the terms in 13642p3 + 13102p*3 - 26735p*3. 9p*3 Collect the terms in 338008m - 337761m - 37800 + 37800. 247m Collect the terms in 188m - 4m*3 - 801m + 2m3. -2m*3 - 613m Collect the terms in -3083n2 + 3078n*2 + 165 - 168. -5n*2 - 3 Collect the terms in 46954u*2 + 76086u*2 + 78821u*2 + u - 72241u*2 + 90326u*2. 219946u*2 + u Collect the terms in -10r - 968833r3 + 968843r*3 - 424r*2 + 424r*2. 10r*3 - 10r Collect the terms in -18302 - 16933 + x3 + 35235. x3 Collect the terms in -3 + 4 - 4259w + 8591w - 4 - 4291w. 41w - 3 Collect the terms in -8186u + 8186u + 620u2 + 644u*2. 1264u*2 Collect the terms in 1957030y + 3 + 4 - 7. 1957030y Collect the terms in -160686 + 160686 - 7d*2 - 81d. -7d2 - 81d Collect the terms in 69b - 38b - 55b2 - 92b*2 - 3b*2 + 19b*2. -131b*2 + 31b Collect the terms in 100g + 52g*2 + 17 + 22g*2 - 102g. 74g2 - 2g + 17 Collect the terms in -333j - 20 - 478j - 384j. -1195j - 20 Collect the terms in -285n2 + 744n*2 - 276n*2 - 186n*2. -3n*2 Collect the terms in 51 + 89g*3 + 125g*3 + 73 - 124 + 44g*3 + 45g*3. 303g*3 Collect the terms in 2042347l*3 + 262896l*3 + 2484898l*3. 4790141l*3 Collect the terms in -7 - 7 + 299504h*3 + 14 - 299530h*3. -26h*3 Collect the terms in 112 + 160 + 2p - 258. 2p + 14 Collect the terms in 15974v - 32122v - 11 + 16144v. -4v - 11 Collect the terms in -188o + 1059o - 2009o. -1138o Collect the terms in 612h*2 - 1267h*2 + 23h - 27h + 663h*2. 8h*2 - 4h Collect the terms in -119h - 148h + 5h - 150h + 416h. 4h Collect the terms in -77a + 408a - 85a - 79a - 85a + 807 - 81a. a + 807 Collect the terms in o - 4o + 12o - 3o - 74144 - 5o - 2o2. -2o*2 + o - 74144 Collect the terms in -1665b*2 + 6656b*2 - 1666b*2 + 30b*3 - 1663b*2 - 24b*3 - 1662b*2. 6b*3 Collect the terms in 632b*3 - 5b + b - 726b3. -94b*3 - 4b Collect the terms in 0 - 15126h + 0 + 6184h + 6948h. -1994h Collect the terms in -267m2 + 4m + m*3 + 270m*2 + 0m. m*3 + 3m*2 + 4m Collect the terms in 30i + 3757456 - 3757456. 30i Collect the terms in 2u3 - 92 - 29u*2 - 2u*3 - 15u + 23u2 + 2u*3. 2u*3 - 6u*2 - 15u - 92 Collect the terms in -4o2 - 945 + 33o - 11o - 14o - 6o. -4o*2 + 2o - 945 Collect the terms in -29016z3 - 29365z*3 + 58382z3. z3 Collect the terms in -2296a + 764a + 768a + 10 + 768a. 4a + 10 Collect the terms in 3 + 76895o*2 + 1510920o*2 - 3. 1587815o*2 Collect the terms in -9i + 17i + 97 - i - 10i + 0i. -3i + 97 Collect the terms in 11962f - 35882f - 143f2 + 11960f + 11959f + 9f*2. -134f*2 - f Collect the terms in 4u - 20 - 3u - 2u - 40 - 100. -u - 160 Collect the terms in -70n - 102n*2 + 81n - 69n + 127n - 69n. -102n*2 Collect the terms in 4761y + 1384y + 179y + 442y - 135y. 6631y Collect the terms in 1201y + 1060y - 114y + 2232y - 680y. 3699y Collect the terms in -42 + 1894o + 9 + 35. 1894o + 2 Collect the terms in 5649c*2 - 113c*2 - 2c + 2c - 316c*2. 5220c*2 Collect the terms in -11425n*2 - 11474n*2 + 23626n*2. 727n*2 Collect the terms in -149t - 323t2 - 148t + 81t - 28t*2. -351t*2 - 216t Collect the terms in 337447 - 337447 + 551v3 - 1623v*3. -1072v*3 Collect the terms in 2518630g - 740236g + 1771540g. 3549934g Collect the terms in 566f*3 - 73 - 2244f*3 + 122 + 559f*3 + 562f*3 + 562f*3 - f. 5f*3 - f + 49 Collect the terms in -5r*2 - 160r - 14r2 + 615r - 455r. -19r*2 Collect the terms in -89z*2 - 906z*3 + 189z*2 + 195z*3 - 100z*2. -711z*3 Collect the terms in 470w*3 - 627w*3 - 519w*3. -676w*3 Collect the terms in -44197f + 232 - 232. -44197f Collect the terms in -93248l*2 + 3304 + 93228l*2 - 3304. -20l*2 Collect the terms in -5 - 7p*3 - 121p*3 - 98p*3 - 140p*3 - 2p*2 + 0. -366p*3 - 2p*2 - 5 Collect the terms in 862138 + 862119 + 23l - 1724239. 23l + 18 Collect the terms in -1192l + 28 + 2 - 14 - 894l - 8. -2086l + 8 Collect the terms in 12q + 366q*3 + 431q*3 - 1006q*3 - 4q*2. -209q*3 - 4q*2 + 12q Collect the terms in -13712f2 + 6859f*2 - 2454f + 6855f2. 2f*2 - 2454f Collect the terms in 1505l - 2l*2 + 21464l*3 - 1505l. 21464l3 - 2l*2 Collect the terms in -60 + 29w*2 - 83w*2 + 19w*2 + 33w*2 + 2w. -2w2 + 2w - 60 Collect the terms in 13691t2 + 23t*3 + 57t*3 - 41061t*2 + 13686t*2 + 13684t*2. 80t*3 Collect the terms in -105647c*2 - 62c*3 + 105647c*2. -62c*3 Collect the terms in -3l + 1089883213l3 + l - 1089883214l*3 + 0l. -l*3 - 2l Collect the terms in 51 + 4473y2 + 16 - 4482y*2 - 65. -9y*2 + 2 Collect the terms in -3948a*2 + 8a*3 - 18035a*2 + 21983a*2. 8a*3 Collect the terms in -429r*2 + 247r*3 - 480r*3 + 239r*3 + 0 + 0. 6r*3 - 429r*2 Collect the terms in 28133475b - 28133469b + 467 - 109. 6b + 358 Collect the terms in -19 + 11 + 23063a - 23119a + 8. -56a Collect the terms in 2480j*2 + 75 + 2670j*2 - 39 - 36. 5150j*2 Collect the terms in d + 97006575 - 97006575. d Collect the terms in 137815c*2 - 1680c*2 - 15829c*2. 120306c*2 Collect the terms in -51m*2 - 85m*2 - 49m*2 - 47m*2 + 248m*2 - 70m*2. -54m*2 Collect the terms in 871r - 1736r + 7 + 867r. 2r + 7 Collect the terms in 45q*3 - 3391q + 1138q + 1110q + 1152q. 45q*3 + 9q Collect the terms in -103 + 6586w - 16 + 119. 6586w Collect the terms in 514q + 768q - 2 + 6q2 + 770q - 2052q. 6q*2 - 2 Collect the terms in -130k + 86k - 123k. -167k Collect the terms in -34158g + 34158g - 140g*2. -140g*2 Collect the terms in -162h - 2388h - 2345h - 1226h. -6121h Collect the terms in 106 + 119 + 127 + 123 + 5199k3 - 475. 5199k*3 Collect the terms in -4560t*2 - 444200t + 444200t. -4560t*2 Collect the terms in 15 + 35172r*2 - 15 + 163724r*2. 198896r*2 Collect the terms in 15r + 8r - 1966r*2 - 22r - 820r2. -2786r*2 + r Collect the terms in 0m + 61795955m3 + 0m. 61795955m3 Collect the terms in -67q*2 - 9 - 78q*2 - 76q*2 - 76q*2 + 280q*2. -17q*2 - 9 Collect the terms in -2135m*2 - 443 - 441 - 446 + 1330. -2135m*2 Collect the terms in -504z + 164z + 1724z*2 + 159z + 181z. 1724z*2 Collect the terms in 474j - 437j + 51j + 1015j. 1103j Collect the terms in 88969j - 28625j + 309 - 309. 60344j Collect the terms in 27u + 11 - 60u + 33u + 690*	{ "pile_set_name": "DM Mathematics" }
= g - 3, -4g - 8 = 61j - 59j for j. 2 Solve 2378p = -n + 2374p - 18, -3n = -p - 11 for n. 2 Solve 0 = -5i + m - 23, 2m = -2i + 340398 - 340400 for i. -4 Solve 5p + 5 = 7q, -2q = -53p + 48p - 5 for p. -1 Solve -51 + 37 = 2h - 4w, 0 = -5w + 15 for h. -1 Solve 2a + 21 = 417t - 414t, 0 = -5a - 4t + 28 for a. 0 Solve 4r - 20 = -4j, -2r - 113 = j - 122 for r. 4 Solve 16c = 3y + 17c - 7, -y + 15c = -125 for y. 5 Solve -19 = s - 3d, s + 11d - 49 = 44 for s. 5 Solve 0 = 5g - 2t + 25, 90t - 20 = 4g + 94t for g. -5 Solve 3m = -2g + 7, -32m + 31m + 19 = 4g for m. -1 Solve 806o = 5x + 815o + 37, -3x - 3 = -o for x. -2 Solve 26f + 2 = 4w + 27f, -3w + f = 16 for w. -2 Solve 3m - 12 = 3r, 4353r = 4m + 4355r + 2 for m. 1 Solve -16 = 53q - 57q + 3n, 4n + 8 = 2q for q. 4 Solve 2m - 2n + 4n - 80 = -96, -3n = -3m for m. -4 Solve -167h + 163h + 44 = 3x, -4x - 5h + 60 = 0 for x. 20 Solve -u + 3 = -2r, 2u - 9r - 437 = -421 for u. -1 Solve -4u - 3v = 573 - 573, -13 = 3u - v for u. -3 Solve 0 = 3k + 2g - 1, -5k - g = -3k - 0k for k. -1 Solve -5s = u + 20, -3454u + 3449u - s - 4 = 0 for u. 0 Solve 0 = d - 5v + 12, -20429v + 117 = -4d - 20432v for d. -27 Solve -2i = 5v + 3, 0 = 517v - 512v + 4i - 9 for v. -3 Solve -4y - 13 = c, 564c + 12 = -5y + 567c for y. -3 Solve 8 - 3 = 5n, -2d + 2n = 6 for d. -2 Solve -5y + 3x = -9, -112y + x - 17 = -117y for y. 3 Solve 80 = f - 2h + 89, 5f = -3h + 7 for f. -1 Solve 44 = -4o - 20, -5o = -0k - 4k + 60 for k. -5 Solve -18f = -20f - 4t - 2, -4t + 7 = -f for f. -3 Solve 2l - 10h - 1 - 63 = 0, 2l - 5h - 34 = 0 for l. 2 Solve 3l - 2w = 7l, 0 = -2l - 5w + 24 for l. -3 Solve -1226y - 6 = -1229y, -2y - 5 = -3u for u. 3 Solve -2v + 25 = -3s, -29 = 4s - 4v + 11 for s. -5 Solve 331j + 15 = 326j - v, 30 = 3v for j. -5 Solve -5t + 25 = -4v, -6t - 1 = 3v - 31 for v. 0 Solve 0 = -2m - 4, -29i = -5i - 19i - m - 17 for i. 3 Solve 31 = 8z - 3z + 3k, -23 = -5z + k for z. 5 Solve s = f - 3, s - 9f = -7f - 3 for s. -3 Solve 13f - 10f = a, -13f = -11f - 3a + 7 for f. 1 Solve -f - 7i = -10i - 8, f = -i - 4 for f. -1 Solve -12 = -4b - 4f, 201b - 202b = 3f - 3 for b. 3 Solve 2u = 10n - 44, u + 14 = 2n + 4 for u. -2 Solve 4h - 293 = q - 309, -3h + 5q = 12 for h. -4 Solve t + 358f = 4t + 355f, -4f + 144 = 32t for t. 4 Solve 5k - 5r - 15 = 0, 14k = 18k + 5r - 21 for k. 4 Solve 25 = 5d, -4b - 28d = -23d - 45 for b. 5 Solve -4j = 3b - 11j - 7, j = 4b + 24 for b. -7 Solve -150f = d - 146f - 11, 0 = -2d + 6f - 34 for d. -5 Solve -22q + 20 = -3g - 30q, 2q + 20 = 13g - 10g for g. 4 Solve 4u = -t - 20, -t - 4 = 4t - 4u for t. -4 Solve -8 = -4x - 232w + 230w, 0 = 3x + w - 4 for x. 0 Solve -2k - 3c + 23 = 0, -4k = 345c - 347c + 26 for k. -2 Solve -4p + 37 = -3s + 40, 4p = -2s + 22 for s. 5 Solve 2r + 13 = -3t, -61 = -4666t + 4687t - r for t. -3 Solve 868p - 869p - 14 = -5s, p = 3s - 10 for s. 2 Solve -3u + 22 - 19 = 5a - 5, -3a - 2u + 4 = 0 for a. 4 Solve 0 = 17i + 4g - 106, 0 = 5i - 4g + 112 - 138 for i. 6 Solve 139a - 134a + 5g + 35 = 0, -2a + 10 = -4g for a. -3 Solve -20 = 5m, -9m = -3p - 12m - 3 for p. 3 Solve 2v = -r - 5, -v + 7r - 469 = -459 for v. -3 Solve 5a - 2n + 21 = 0, 221 = 2a - n + 229 for a. -5 Solve -4l - 48 = 0, -r + 169l + 39 = 166l for r. 3 Solve 2y - v - 19 = 0, -4v + 38 - 94 = -4y for y. 5 Solve 2p = n + 2, 351n + 42p + 26 = 355n for n. -4 Solve 11 = 5b - 2s, -62s + 71s = -4b + 30 for b. 3 Solve 3n + 4s = 12, -42n = -47n - 2s + 20 for n. 4 Solve 2x + 11 = 3k, 4k + 595x = 592x - 42 for k. -3 Solve -4u - 43 = 5q - 41, -4u - 2q + 4 = 0 for u. 2 Solve 6 = 3x - 3w, 261w - 34 = 3x + 266w for x. -3 Solve -3r = 4a - 65, -211 + 199 = -4r - 0r for a. 14 Solve m + 859 - 863 = 0, 2b = -m + 12 for b. 4 Solve 3q + 20 = -4s, -34s + 38s + 4 = -q for q. -8 Solve -2m - 21 = 2p - 1, 0 = -4m - 20 for p. -5 Solve 2a = 3y - 21, 0 = 4y - 3a - 45 + 16 for y. 5 Solve 0 = -4p - 2q + 4, -271p = -274p - 5q - 11 for p. 3 Solve -219g = -222g + q + 14, -4g + 2q + 20 = 0 for g. 4 Solve -4a + 482v + 20 = 481v, -4v - 8 = 2a for a. 4 Solve -2j = f - 5, -8 = 14f - 9124j + 9126j for f. -1 Solve -2g - 40 = 615s - 613s, -4g + 5s = 80 for g. -20 Solve 5n - 55d + 57d = 25, -14 = 2n - 4d for n. 3 Solve -3g = d - 14, 3d + 19 - 11 = g for d. -1 Solve 3h - f + 17 = 0, 39h - 5f + 341 = 208 for h. -2 Solve 2c = 4t + 34, -c + 41 = 7t - 12t for c. 1 Solve -847b = 3l - 852b + 7, -5b + 11 = -4l for l. -4 Solve 5o = 4n - 10, -75o = 3n - 70o + 45 for n. -5 Solve -20 = -2923l + 2927l - 5o + 30, -4l = 3o + 34 for l. -10 Solve 3r + 87 - 68 = -2l, -45r = l + 140 for r. -3 Solve 5p + 2f - 16 = 0, 5p - 7f + 800 = 654 for p. -4 Solve 24b - 22 = 2v + 20b, 4v - 3b + 39 = 0 for v. -9 Solve -3x + 6r = 7r - 8, -3x - 2r = -10 for x. 2 Solve 3j + 2w - 1 = 0, -4w + 188 = 2j + 206 for j. 5 Solve 4f + 2 = 3r - 14, 16 = -5r - 4f for r. 0 Solve 5n + 12 - 22 = 3h, 5h - 10 = -5n for h. 0 Solve -6 = -2x, 2k - 91 = 2x - 101 for k. -2 Solve -2m - 22 = 4v, 24 = -23v + 25v - 4m for v. -2 Solve 0 = 588t - 591t - 2m - 23, 0 = 4t + 4m + 32 for t. -7 Solve -3r + 5l = 6, 2l - 18 = -4r - 0l for r. 3 Solve b - 5p + 359 - 384 = 0, -52 = -4b - 4p for b. 15 Solve -222t + 227t - 2u - 3 = 0, -t - 5u = -6 for t. 1 Solve -5v - 20 = 0, 0 = 2439j - 2435j - 4v - 20 for j. 1 Solve -2k = 3t - 43, 4t - 98k - 48 = -96k for t. 13 Solve h = 20f - 14f, f + 2f = 3h for h. 0 Solve -25 = -o + 2f - 35, -9o + 2f = 42 for o. -4 Solve 73q = 4o + 74q - 4, 4o - 8 = -2q for o. 0 Solve 44v + 4p + 26 = 39v, 0 = v - 5p - 18 for v. -2 Solve -5n = 283x - 286x - 3, n - 3 = 0 for x. 4 Solve -170g - 14 = -171g + 4o, 3g - 5o - 14 = 0 for g. -2 Solve -88 = -11p + 3x + 14, -4p = -5x - 41 for p. 9 Solve 9t = 5c + 102, -87 = -174c + 179c - 4t for c. -15 Solve 2u + 3v + 12 = 0, -14v = 2u - 10v + 14 for u. -3 Solve 0 = 3l + 3d + 6, 675d - 680d - 19 = 2l for l. 3 Solve 0 = -5x + 2v - 3, -10v - 13691 = 3x - 13678 for x. -1 Solve 2459t - 17 = 2463t + 3h, 3t = 4h + 56 for t. 4 Solve -2c + 22 = -5i + 2, -4c + 4i + 28 = 0 for c. 5 Solve 5o - 927m + 925m + 7 = 0, 3o - 3m = -6 for o. -1 Solve 3m = 13h + 52, 5m - 970 + 974 = -h for h. -4 Solve -2h - 4p + 5p - 2 = 0, -1 = h - p for h. -1 Solve -10 = l + 2z, 33 = l - 5z + 8 for l. 0 Solve 157891c - 2z + 71 = 157886c, -2z - 19 = c for c. -15 Solve -4l = 3v - 11, -33l + 39 = 3v - 36l for v. 9 Solve b = -2i + 5, -56 = b + 4i - 61 for b. 5 Solve -2o - 16 = -9v, 122o - 127o + 5v - 5 = 0 for o. 1 Solve 2 = 2k + 2y, 1711k = 1706k - 4y + 8 for k. 4 Solve -9z = 2i + 19, -4z - 15 + 1 = 2i for i. -5 Solve -70 = 3v - 5g - 6, 2g + 46 = 2v + 70 for v. 2 Solve 4b - 15 = -3m, -448m + 447m - b = -5 for m. 5 Solve -4q = w + 3730 - 3752, -16 = -2q + 2w for q. 6 Solve 4u - 54 = -2a, -u - 401a + 48 = -399a for u. 2 Solve -3u - 2m - 5m + 12 = 4, 3m - 6 = 0 for u. -2 Solve -h = -5o - 30, 2h - 2o + 1697 = 1717 for h. 5 Solve -3k = 14f + 6, 0 = -8793f + 8790f for k. -2 Solve -8b - 4 = 2x, 5x + 3229b + 10 = 3234b for x. -2 Solve 7h = 4p + 11, -2h + 32 = -5p + 25 for h. 1 Solve s - 11 = 32n - 72n + 38n, 0 = 3s - 2n - 9 for s. 5 Solve 12 = -3b + 7a - 11a, 9 = -4b - 3a for b. 0 Solve -5c - 33 = -35v + 39v, -c - 15 = 2v for c. -1 Solve 4m - 18 = -2q, -64q - 45 = -5m - 68q for m. -3 Solve 4v + 4u - 20 = 0, 355v - 22 = 351v - 5u for v. 3 Solve -7398v + 7396v + 8 = -2x, 17 = 3v - 4x for v. -1 Solve 14g - 10 = -5r + 13g, -6r + 2g = -12 for r. 2 Solve -5l + 17 = -3m, -2m - 414l - 18 = -419l for m. 1 Solve 0 = 717h - 713h - 5w - 8, 6 = 3h - w for h. 2 Solve -8t + 26 = 2j, 0 = -2t + 3j - 366 + 313 for t. -1 Solve -5f - 74 = -64, 12 = 2g - f for g. 5 Solve -3y - k + 20 = 0, 94 + 98 = -y + 5k + 172 for y. 5 Solve -i + 5 = 2z, 319i - 2z = 314i + 25 for i. 5 Solve 0 = -4a + n + 23, 0 = 2*a +	{ "pile_set_name": "DM Mathematics" }
. Let l(w) = 59105w. Determine r(l(c)). 2541515c Let l(i) = -i*2. Let w(o) be the second derivative of -15o + 0o4 + 0 + 0o*3 + 1/30o*5 + 6o*2. Let p(f) be the first derivative of w(f). Give p(l(u)). 2u*4 Let a(x) = 2602x. Let z(r) = -87r2 - r + 5. Determine a(z(k)). -226374k*2 - 2602k + 13010 Let i(p) be the second derivative of p*3/6 + 23p - 208. Let d(z) = -3z - 313. Calculate d(i(u)). -3u - 313 Let o(l) = 19l2 + 33l + 14. Let a be o(-6). Let j(c) = 500 + 2c2 - a + 0c*2. Let x(b) = 18b + 2b + 9b. What is j(x(t))? 1682t2 Let k(r) = -7r. Let y(n) = 5n2 + 953535n + 2. Calculate k(y(t)). -35t2 - 6674745t - 14 Let y(j) = -4j - 4j*2 - j + 5j. Let b(a) be the third derivative of -a*5/15 - 1976a*2. Determine y(b(o)). -64o*4 Suppose -132 = -26u + 4054. Let n(f) = 165f + uf - 320f. Let k(d) = -6d*2. Calculate n(k(y)). -36y*2 Let t(q) = 4q*2 + 2q - 10099. Let a(y) = 23y - 6. Calculate a(t(g)). 92g*2 + 46g - 232283 Let s(z) = -70z2 - 3z - 3. Let k(t) = t*2 - t - 1. Let j(f) = 3k(f) - s(f). Let r(y) = 0y - y - 6y + 8y. What is r(j(g))? 73g*2 Let v(s) be the first derivative of 2s*3/3 + 3. Let m(h) = -33h - 976. Let t(u) = -u + 244. Let d(j) = -m(j) - 4t(j). What is v(d(x))? 2738x*2 Let t(g) = 2g. Let l be 3 - 3/6(1 + 1). Let y(d) = 5d*2 - 13 + 13 - 6d*l. Give y(t(x)). -4x*2 Let l(k) = 2k*2. Let r(w) = 391w*2 - 596w. Calculate r(l(x)). 1564x4 - 1192x*2 Let l(s) = 57s*2 + 6390. Let h(y) = 18y. Determine h(l(q)). 1026q2 + 115020 Let l(j) = 36j. Let c(k) = 1231k2 + 1234k*2 - 2456k*2. Calculate c(l(a)). 11664a*2 Let g(p) be the third derivative of -1/30p*5 + 0 - 36p*2 + 0p*4 + 0p*3 - 2p. Let j(w) = -12w. Calculate g(j(v)). -288v*2 Let n(b) = -84b*2. Let x(o) = -955675o. Give x(n(k)). 80276700k2 Let k(b) = -2b. Let i(p) = 2p2 + 4268147. What is i(k(s))? 8s*2 + 4268147 Let j be (5/(-3))/(120/(-144)). Let z(t) = -1 + j - 40t + 19t. Let k(l) = -13 - l2 + 13. Calculate z(k(f)). 21f*2 + 1 Let r be 0(3 + (-15)/6)-1. Let g(x) = 15x + 24 - 24 + rx. Let t(b) = -7b*2. Determine t(g(o)). -1575o*2 Let g(a) be the second derivative of -44/3a*3 - 190a + 0 + 0a2. Let j(h) = -h. What is g(j(i))? 88i Let i(w) be the first derivative of 41w5/20 + 38w*2 + 8. Let x(s) be the second derivative of i(s). Let u(r) = 2r. Calculate x(u(p)). 492p2 Let s(b) = -3b. Let l(i) = -11i + 1. Let n be l(-9). Suppose 13o = 412 - n. Let r(g) = -o + 24 - g*2. What is r(s(h))? -9h*2 Let i(v) = v - 1. Let n(t) = 4t - 4. Let y(a) = 6i(a) - n(a). Let q(m) be the third derivative of -m4/24 - 18m*2. Give q(y(p)). -2p + 2 Let a be (0 + 0)(5 + -6). Suppose 8y - 86 = -14. Let v(x) = ax - y + 9 + 2x. Let j(c) = -33c. What is v(j(o))? -66o Let c(p) = -85p. Let g(q) = -707q*2 + 332. Calculate c(g(t)). 60095t*2 - 28220 Let v(c) = 8714c. Let n(i) = 7193i + 1. Calculate v(n(a)). 62679802a + 8714 Let k(h) be the third derivative of 1/24h4 + 0h + 0 + 0h3 - 152h*2. Let l(i) = -i + 37. What is l(k(s))? -s + 37 Let i(l) = -4l. Let a(u) = -15u2 - 118u - 3334. Calculate i(a(v)). 60v2 + 472v + 13336 Let g be -1 + (-967)/(-6) + (-12)/72. Let l(x) = 11 - 179x2 - 11 + gx*2. Let t(j) = 6j. What is l(t(d))? -684d2 Let w(s) = -5s*2. Let f(k) = -6k + 30214. Determine f(w(h)). 30h2 + 30214 Let w(k) = 4k + 3. Let o(p) = 7p + 5. Let g(f) = -3o(f) + 5w(f). Let h(c) = -31c*2 - 11c*2 + 37c*2. Calculate g(h(l)). 5l*2 Let w(v) = 33836v*2 + 12v - 33851v2 - 12v. Let f(h) = -236h2. Determine f(w(l)). -53100l*4 Let p(w) be the first derivative of 2w*3/3 + 10w*2 + 57. Let o(g) be the first derivative of 0g - 8 + 0g2 + 1/3g*3. Give p(o(f)). 2f*4 + 20f*2 Let m(v) = 50834761v*2 - 3. Let h(j) = 3j. Give m(h(y)). 457512849y2 - 3 Let g(n) = 2n. Let j(f) = -f*2. Let l = -84 + 84. Let a be j(l). Let o(r) = -11r + ar + 6r + 8r. Give g(o(w)). 6w Let c(q) = -299q2 - 2q - 2. Let m(z) = 595z2 + 5z + 5. Let v(h) = 5c(h) + 2m(h). Let k(f) = -7f. Give v(k(j)). -14945j*2 Let g(x) = 34x - 60. Let z(l) = 11l - 19. Let a(h) = 3g(h) - 10z(h). Let p(n) = 11n - 11. Let r(c) = -4a(c) - 3p(c). Let d(k) = -5k2. What is r(d(t))? 5t*2 - 7 Let b(c) = -1282662c. Let d(x) = -74x2. Determine d(b(i)). -121746413662056i*2 Let m(y) be the first derivative of 2y*2 - 346. Let k(p) = 5p*2. Let n(l) = -6l*2. Suppose 6 + 0 = 2s. Let v(q) = sk(q) + 2n(q). What is m(v(x))? 12x2 Let l(a) = -5a*2. Let r(y) be the first derivative of 2y*3/3 - 4y*2 + 3297. Determine r(l(t)). 50t*4 + 40t2 Let p(w) = -w2 - 884605. Let t(n) = 26n. Give t(p(m)). -26m*2 - 22999730 Let q(t) be the first derivative of -4t*2 + 3. Let x(p) = -2p*2 - 4p + 8. Let m be x(-3). Let o(j) = -4j2 - 2j*m + 2j*2 + 2j*2. What is q(o(f))? 16f*2 Let k(o) = -22377o*2 + 3. Let g(l) = -5l + 60. Determine g(k(h)). 111885h2 + 45 Let l(g) = 3g + 8g - 82g*2 - 11g. Let p(v) be the second derivative of v*3/3 + 11v. What is p(l(a))? -164a2 Let c(j) = 23j*2. Let f(w) = -51554 - 5w + 51554. What is f(c(m))? -115m2 Let j(h) = -3h*2. Let y(p) = 16p + 30. Let q(f) = -5f - 10. Let u(m) = -7q(m) - 2y(m). Determine u(j(w)). -9w*2 + 10 Let u(p) = 1736p*2 - 92 - 91 - 98 + 372 - 93. Let d(x) = -x. What is u(d(z))? 1736z*2 - 2 Suppose -28n = -13n - 210. Let f(m) = -11m - m + nm. Let h(q) = -22q - 15q + 12q. Give h(f(b)). -50b Let f = -10 + 317. Let l(r) = -fr + 308r + 5 - 5. Let k(o) = -5o + 1. What is k(l(g))? -5g + 1 Let r(f) = 1268f + 1271f + 1275f - 3812f. Let u(g) be the first derivative of -28g*2 + g - 5. Give r(u(i)). -112i + 2 Let f(o) = 79o - 1. Let q(j) be the third derivative of -7j*4/24 + 3j*2 - 81j + 1. Determine f(q(t)). -553t - 1 Let g(c) = -5c + 514462 - 514462. Let y(t) = -t*2 + t + 1. Let q(v) = -264v*2 + 242v + 242. Let u(z) = 2q(z) - 484y(z). Determine g(u(m)). 220m2 Let b(l) = 5421l. Let o(s) = 7s2 + s - 14. Determine b(o(q)). 37947q*2 + 5421q - 75894 Let m(s) = -3s + s2 + 5s*2 + 3s. Let c(x) be the third derivative of -7x4/12 + 13180x*2. Determine c(m(q)). -84q*2 Let n(l) = -122l - 4. Let g(u) = 162u + 5. Let k(t) = -4g(t) - 5n(t). Suppose -2v - 2v + 44 = 0. Let y(a) = -va + 2a2 - 3a*2 + 11a. Give k(y(w)). 38w2 Let p(z) = -1578z - 14. Let d(i) = 944426i + 8380. Let n(r) = -7d(r) - 4190p(r). Let y(k) = 18k*2. Calculate n(y(h)). 15084h*2 Let l(c) = -c - 23. Let m(f) = -f - 18. Let v(d) = 3l(d) - 4m(d). Let r(w) = 2. Let x(k) = 4r(k) - 3v(k). Let n(o) = -7o*2. What is x(n(y))? 21y*2 - 1 Let i(u) = -22u. Let f be 0 + (7 - 9) + 10. Let y(w) = -14w. Let z(o) = fy(o) - 5i(o). Let h(n) = -223n*2. What is z(h(p))? 446p*2 Let k(b) = -15b. Let j(d) = 19 + 18 + 19 - 27d + 103d - 55. What is j(k(g))? -1140g + 1 Let d(q) = -19q + 43. Let r(b) = -378b + 854. Let i(w) = 119d(w) - 6r(w). Let f(g) = 5g*2. Determine f(i(v)). 245v*2 - 490v + 245 Let n(r) = 45r2. Let u = 165 + -139. Let v(l) = -u + 15 + 3l + 11. Determine v(n(a)). 135a2 Let y(x) be the second derivative of -277x*4/6 - 12x + 7. Let b(w) = -w*2. Give y(b(r)). -554r*4 Let w(x) be the third derivative of -5x*4/4 - 2x*3/3 - 2x*2 - 3x + 17536. Let h(z) be the third derivative of -z5/60 + z2. Give w(h(k)). 30k2 - 4 Let s(u) = -16 - 12 + 0u + 32 + 2u + u. Let q(i) = i2 - 2. Let j(p) = 3p*2 - 7. Let g(t) = 2j(t) - 7q(t). Determine s(g(w)). -3w*2 + 4 Let w(n) = 19n*2 + 13n + 2746. Let l(k) = 2k. Determine w(l(x)). 76x*2 + 26x + 2746 Let i(n) = -7n. Let a(r) = -29376r*2 + 680r. Calculate i(a(u)). 205632u2 - 4760u Let n(v) = -133v2 + 7. Let p(o) = 295 - 170 - 125 - o. What is n(p(q))? -133q*2 + 7 Let x be -80(2 - (-25)/(-10)). Suppose u - x = -g - g, 5g - 52 = -u. Let o(j) = uj + 5j - 2j. Let r(i) = i*2. Calculate r(o(d)). 1225d*2 Let z(l) be the first derivative of 5l*2/2 + 3l + 34. Let w(m) = -28m - 17. Let p(r) = 6w(r) + 34z(r). Let d(u) = 261u*2. Determine p(d(x)). 522x*2 Let i(p) = p. Let s(o) = -148302o. L	{ "pile_set_name": "DM Mathematics" }
z*3 - 4r*2z*3 wrt r? -6i*3z*2 - 8z*3 What is the derivative of -34n*3y - 13n3z + n3 + n2yz - 2n2z wrt y? -34n3 + n2z Find the third derivative of -48a3 - 349a*2 wrt a. -288 Differentiate 13amw*2 + amw - am - 2aw - 2a + 5m with respect to w. 26amw + am - 2a What is the second derivative of 2bd3o*3 - 3bd3o + 1016bd*2o*2 - 2b + 203o wrt o? 12bd3o + 2032bd*2 What is the first derivative of 813i*3 - 750? 2439i*2 What is the second derivative of 186f*5 - 336f? 3720f3 What is the second derivative of -11g*3 + 19g*2 + 99g? -66g + 38 Differentiate -2b*2dr - 11b*2 + 87bdr + 4r with respect to d. -2b*2r + 87br What is the third derivative of 2f6 - 70f*4x + f*2x - 2fx - 965f wrt f? 240f*3 - 1680fx What is the third derivative of 178q*3 - 609q*2 wrt q? 1068 What is the third derivative of -156z6 - z5 - 158z2 + 2z wrt z? -18720z3 - 60z*2 What is the third derivative of 25180l*3 - 964l*2 - 6l wrt l? 151080 Find the second derivative of -98d2f*2 - 18d*2fz2 - 5d*2 + 5df2 + 7dfz*2 - 13f*2z2 + f2z wrt z. -36d*2f + 14df - 26f2 Find the third derivative of -2c*4v*2 + 7c*4 - 194c*3v*2 + 241c*2v*2 + c wrt c. -48cv2 + 168c - 1164v2 Find the first derivative of -r4 + 58r*2 - 52. -4r*3 + 116r Find the first derivative of bh2sy + bh*2s - 2bhsy + 3h2s + h*2y - 2hs - 3y wrt b. h2sy + h2s - 2hsy What is the derivative of -4c*2 - 118c + 697? -8c - 118 Find the second derivative of 118l*5 - 143l. 2360l3 Differentiate 464l*4 + 993 with respect to l. 1856l*3 What is the third derivative of 847vx4 - 2214vx2 - x6 wrt x? 20328vx - 120x*3 Differentiate -11h*4 - 13hi3 - 2i*3 - 2 wrt h. -44h*3 - 13i*3 Find the first derivative of 171h*2p*3 - 2h*2p - 1039h2 wrt p. 513h*2p*2 - 2h*2 Find the first derivative of -5b*2t*2 + 18b*2t - 2bt - 10t2 - 1 wrt b. -10bt2 + 36bt - 2t What is the third derivative of -6o3p*2 + 2o*3pr - 2o*3r - 9o2p + p*2r + 34r - 1 wrt o? -36p*2 + 12pr - 12r Find the first derivative of -21hw - 366h - 13w*3 wrt w. -21h - 39w2 Find the third derivative of -7a*5 + 19a*2 wrt a. -420a2 What is the second derivative of -m2y2 - 5m*2 + 5my2 + 3my - 4y wrt y? -2m2 + 10m Find the second derivative of -7394r2s + r*2 + 20rs + 11r - 3s - 4 wrt r. -14788s + 2 Find the second derivative of 5a4l - 4a4 + a3l*3 - 3al3 - 46a + 3 wrt a. 60a2l - 48a2 + 6al3 Find the third derivative of h2u*3 - 33h*2u + 3hu*3 - 3hu2 + 26u*3 + 33u*2 wrt u. 6h*2 + 18h + 156 Find the second derivative of -899v2 + 4v + 39. -1798 Find the second derivative of r*4 - 3569r*3 + 13910r wrt r. 12r2 - 21414r Differentiate -3glq2 - 287gq2 - 171lq2 + 2l with respect to g. -3lq*2 - 287q*2 Find the third derivative of 2bj3 + 2bj2l*3 - 326j*3l*3 + 5j*3l*2 - 292j*2l*3 wrt j. 12b - 1956l3 + 30l*2 What is the second derivative of -20y*5 - 883y wrt y? -400y3 Find the second derivative of -8r*4 - 121r3 - r2 - 766r. -96r*2 - 726r - 2 Find the second derivative of 170o2 - 2o + 20. 340 What is the derivative of f*2m*2 - 86fm - 2m*2 + 2m wrt f? 2fm*2 - 86m Find the second derivative of 36a3d*2 - 6a*3d - 17a3 + 6ad3 + 2 wrt d. 72a*3 + 36ad What is the derivative of 68h*3s - h*3 + 88hp3 - 2p*3s wrt s? 68h3 - 2p*3 What is the second derivative of -1040j4 - j3 + 2654j wrt j? -12480j*2 - 6j Differentiate 5i2k*2 - 42i*2k - 564i2 with respect to k. 10i*2k - 42i2 Find the first derivative of 2d*2 - 50df2p - 25dp*3 + 3f*2p3 - f2 + 45p3 - 1 wrt d. 4d - 50f2p - 25p3 Find the first derivative of -l2t*2 + 795lt + 2t*2 - 715t wrt l. -2lt*2 + 795t What is the derivative of 283fy*4 - 5fy2 + 2f + 6874 wrt y? 1132fy*3 - 10fy Find the third derivative of -12i*3t*2 + 130i*3t + 2i3 + i2 + 2t*2 - 1140t wrt i. -72t2 + 780t + 12 What is the second derivative of ho2yz + 2ho2y - hoy + 4ho + 2hyz - 4o*2yz - 5o*2 - 2oyz - 3z wrt o? 2hyz + 4hy - 8yz - 10 What is the second derivative of 80bt*2 - 6bt - 2b - 2t2 - 5t wrt t? 160b - 4 Find the second derivative of -174dn4 - 11d - 2n3 + 31n - 1 wrt n. -2088dn*2 - 12n Find the third derivative of -4730u5 + 2u*2 + u - 250. -283800u*2 Find the first derivative of dfi3 + dfil*2 - 3di3l + dl2 + 166fi3l + i*3 + 3i wrt f. di3 + dil2 + 166i*3l Find the second derivative of 4981i3 - 2414i wrt i. 29886i Differentiate -fj*3 - 303fjz*3 - fz*3 - 151j*3z*3 + 2j*3z*2 - 2j*3z wrt f. -j*3 - 303jz3 - z3 What is the second derivative of -13850o*2 + 12959o wrt o? -27700 What is the second derivative of 542i2p*2s*2 - ip*2s*2 - 47ips*2 - 2s*2 wrt i? 1084p*2s*2 Find the first derivative of -3b*2it + 28bi3t - bi2t - 46i3t + 12t wrt b. -6bit + 28i3t - i*2t Find the first derivative of -11r4t + 16r2t + 329t wrt r. -44r*3t + 32rt Find the third derivative of 85b3tx2 + 3b*3t + b*2t + btx*2 - 2bt + 2t wrt b. 510tx*2 + 18t Differentiate 235c3r*3 + 222c*3 with respect to r. 705c*3r*2 What is the third derivative of 438y*6 - 2y3 + y2 - 651y? 52560y*3 - 12 What is the third derivative of 35c*3p*3 + 45c*3 + 72cp4 + cp + 3p2 - p wrt p? 210c*3 + 1728cp Find the second derivative of -4b*2r*3 + 336b*2r - b*2 + 2br3 + 136r*3 wrt r. -24b*2r + 12br + 816r What is the second derivative of -750q*4 - 102q - 3 wrt q? -9000q2 What is the third derivative of -27m*5 + 72m4 - m2 + 60m - 8? -1620m*2 + 1728m What is the second derivative of -3m4 - 92m*3 + 2m + 49? -36m2 - 552m What is the second derivative of -8lo*2 - 3lo - 72l + 28o4 wrt o? -16l + 336o2 Find the third derivative of 7q*2wy3 + 2q*2wy2 + 137q*2y + qwy*2 - 29qy3 wrt y. 42q*2w - 174q Find the third derivative of -909m*3 + 70m*2 + 3 wrt m. -5454 Find the second derivative of -106g*3 - 35g*2 - 6183g wrt g. -636g - 70 Find the second derivative of 82z*5 - 2z*2 + 748z wrt z. 1640z3 - 4 What is the derivative of -268p - 116? -268 Find the third derivative of -5052v3 - 5v*2 + 73v - 6. -30312 What is the first derivative of fj2v*2 - 2fj2 + fj + 2fv*2 - 1223fv - 6930 wrt v? 2fj2v + 4fv - 1223f Differentiate -3784y - 702 wrt y. -3784 Find the second derivative of 1963w3 + 1208w. 11778w Find the first derivative of -1281i + 366 wrt i. -1281 Find the second derivative of 5jr*2w*2 + 364jr2 + 3jrw*2 - 2jrw + 4jw*2 + j wrt w. 10jr2 + 6jr + 8j Find the second derivative of -29p5 + 11p wrt p. -580p3 Find the third derivative of 110o5 + o3 - 1619o2 wrt o. 6600o*2 + 6 Find the second derivative of 67h*5 + 8h*3 + 8h + 20. 1340h3 + 48h What is the derivative of 2d3 - 2d*2 - 1755d - 3383? 6d2 - 4d - 1755 What is the second derivative of -70s3t*2z*2 - 3s*3tz3 + s3t + 2s2t + 124sz - 63t2z*3 wrt t? -140s*3z*2 - 126z*3 Find the first derivative of -7319c*2k - 21c2 + ck*2 - 227 wrt k. -7319c*2 + 2ck What is the second derivative of 102t*2 - 212t wrt t? 204 Find the third derivative of -27dk*5 + 8dk4 + dk + 6k2 wrt k. -1620dk2 + 192dk What is the second derivative of 58g*2v*3 - gv*3 - gv*2 - 5v*3 wrt g? 116v*3 Find the third derivative of 102q*3r3 - q2r3 + 2qr3 + 48r*2 wrt q. 612r*3 What is the derivative of -1365x*3z + 2xz*3 + 209z*3 wrt x? -4095x*2z + 2z3 Differentiate -581h + 1185. -581 What is the second derivative of 14c4s + 2c4 + 4c*3s - 4c + 3s + 6 wrt c? 168c2s + 24c2 + 24c*s Find the	{ "pile_set_name": "DM Mathematics" }
b(f) = f*2 + 2f - 11. Let w be b(-5). Suppose -a + w = -0a. Factor -t5 - 5t*3 + 5t*3 - 2t*a + t + 2t*2. -t(t - 1)(t + 1)3 Let x(k) be the third derivative of k7/210 + 13k*6/60 + 3k*5 - 25k*4/3 - 2000k*3/3 + 34k*2. Find d, given that x(d) = 0. -10, 4 Let j(q) = 7q*3 - 13q*2 - 11q + 31. Let n(f) = -3f3 + 6f*2 + 5f - 16. Let u(a) = -2j(a) - 5n(a). Factor u(l). (l - 3)*2(l + 2) Suppose -a + 17 = -3l - 0, -12 = 3l. Suppose -12 = -3y - 2k - a, 0 = 2y - k - 7. Factor -yc*4 + 11c*4 - 9c*3 - 11c*4. -3c*3(c + 3) Let h(j) be the third derivative of j5/120 + j4/3 + 19j2. Factor h(w). w(w + 16)/2 Let z(g) = -15g3 - 30g*2 - 75g - 40. Let c(y) = y3 - y2 - 2y - 2. Let m(t) = -10c(t) - z(t). Suppose m(n) = 0. Calculate n. -4, -3, -1 Let w(c) = c*2 + 6c - 5. Let l be w(-8). Suppose 7g + l - 25 = 0. Suppose 0 - 1/4a + 3/2a3 + 3/4a*5 - ga*4 + 0a*2 = 0. Calculate a. -1/3, 0, 1 Factor -2/7d*5 + 0 + 24/7d*4 + 64/7d*2 - 72/7d*3 + 0d. -2d2(d - 8)(d - 2)2/7 Suppose -20d + 14d = -18. Let z(y) = 4y4 - y3 + y - 1. Let l(m) = 9m4 - m3 - m2 + m - 1. Let b(u) = dl(u) - 7z(u). Determine q so that b(q) = 0. -1, 1, 2 Suppose 2y - 4 = 2s - s, s + y - 11 = 0. Factor 2d - s - 2 - d2 + 7 + 0. -(d - 1)2 Let f = 249 + -247. Let j(b) be the second derivative of -b*3 + 3/10b*6 - 5b + 0 + 3/2bf - b4 + 3/10b*5. Factor j(r). 3(r - 1)(r + 1)2(3r - 1) Let x be ((-18)/(-12))/((-3)/(-4)). Suppose -j + 8 = 3j. Determine p so that p*x - jp + 3 + 0p2 - 2p = 0. 1, 3 Let j(u) be the second derivative of u*5/4 - 10u*4/3 - 95u*3/6 - 25u*2 + 8u - 9. Factor j(m). 5(m - 10)(m + 1)*2 Let d be (50/(-8) - -6)/((-5)/24). Solve -4/5w*3 + dw + 4/5 - 6/5w2 = 0 for w. -2, -1/2, 1 Suppose 0 = 2z - z - 2. Let u(p) be the first derivative of -1/2p4 + 0p + 2/3p3 + zp*2 + 4. Factor u(b). -2b(b - 2)(b + 1) Let f(j) be the third derivative of -j7/105 - j6/20 + j5/6 + j4/4 - 4j3/3 + 42j*2 - j. Factor f(s). -2(s - 1)*2(s + 1)(s + 4) Let k(n) = -14n*2 + 552n - 132. Let c(r) = 43r2 - 1654r + 393. Let j(f) = 4c(f) + 11k(f). Determine p so that j(p) = 0. 2/9, 30 Suppose -1288j + 644j + 651j - 21 = 0. Factor 14/5i + 1/10i5 + 4/5i*4 + 5/2i*j + 4/5 + 19/5i2. (i + 1)2(i + 2)3/10 Let t(g) be the third derivative of -g7/210 + g6/90 + g5/30 - g4/6 + 3g*3 - 3g*2. Let l(u) be the first derivative of t(u). Factor l(w). -4(w - 1)*2(w + 1) Let w(a) be the first derivative of a6/45 - a4/15 + a*2/15 + 149. Let w(p) = 0. Calculate p. -1, 0, 1 Let v(d) be the third derivative of -3d*7/140 + 7d*6/80 + 3d*5/20 - 62d2. Find w such that v(w) = 0. -2/3, 0, 3 Let f(n) = n2 - 185n - 181. Let b(t) = 184t + 180. Let x(d) = 5b(d) + 4f(d). Let x(q) = 0. What is q? -44, -1 Let p be 6 + 11/(-4) + 45/(-18). Suppose 0 - pu2 - 1/2u = 0. What is u? -2/3, 0 Factor 114/5b + 0 - 3/5b*2. -3b(b - 38)/5 Let a(n) be the first derivative of n4/24 - n3/12 - n2/2 + 11n - 30. Let s(v) be the first derivative of a(v). Factor s(m). (m - 2)(m + 1)/2 Let c(f) be the first derivative of -2/21f*3 + 0f + 30 - 1/7f2. Factor c(l). -2l(l + 1)/7 Let b(x) be the second derivative of x5/5 - 10x*4/3 - 46x*3/3 - 24x*2 + 72x. Factor b(f). 4(f - 12)(f + 1)*2 Let 35x*2 + 480 - 12x*2 - 18x*2 + 100x = 0. What is x? -12, -8 Let k(a) be the second derivative of 3a5/20 + a4/2 - 5a*3/2 - 9a*2 - 206a. Factor k(v). 3(v - 2)(v + 1)(v + 3) Let b be (-200)/(-35) + 4 - 2/(-7). Let x5 - 14x*3 - 3x*5 + 7x*2 - bx*4 - 5x*2 - 8x*2 = 0. What is x? -3, -1, 0 Let v = 21313/650 + -1971/50. Let o = -55/13 - v. Let 16/5 - og*2 - 24/5g + 14/5g3 + 6/5g4 = 0. What is g? -2, 2/3, 1 Let w(x) be the third derivative of -x7/525 - x6/75 - x5/150 + x*4/10 + 4x*2 + 12x. Factor w(v). -2v(v - 1)(v + 2)(v + 3)/5 Let a(j) = -4j5 - 28j*4 - 62j*3 + 10j*2 + 90j - 2. Let c(l) = l*5 - 2l3 - l2 - l + 1. Let u(w) = a(w) + 2c(w). Suppose u(f) = 0. What is f? -11, -2, 0, 1 Suppose 2g - 4b = 6, 51 = 3g + 2137b - 2136b. Determine l so that -5/3l2 - g - 10l = 0. -3 Let w be (-6)/(-4(-18)/(-168)). Let h(y) be the first derivative of 0y + w - 2/15y3 + 2/5y*2. Let h(a) = 0. Calculate a. 0, 2 Suppose 62 = -2o - 4b, -7o + 2o + 4b = 85. Let s = o - -31. Factor sd2 - 5d*2 - 2d + 6d + d. 5d(d + 1) Let k be -430/2884/(-7). Let n = k + 1/3. Let 0 - nc*3 - 4/7c*5 + 0c*2 + 8/7c*4 + 0c = 0. What is c? 0, 1 Let s(c) be the second derivative of -c*5/10 - 4c*4/3 + 10c. Suppose s(m) = 0. What is m? -8, 0 Let y(d) be the third derivative of -1/280d7 + 3/8d*4 + 0 + 3/80d*6 - 1/2d*3 - 13/80d*5 + 0d - 22d2. Determine m so that y(m) = 0. 1, 2 Let b(i) be the first derivative of -i3/21 + i2 - 7i + 85. Suppose b(v) = 0. Calculate v. 7 Let j(f) be the first derivative of -1/9f2 + 4/9f + 24 + 1/18f4 - 4/27f*3. Solve j(g) = 0. -1, 1, 2 Let d(x) be the first derivative of -5x*3/3 + 30x*2 - 55x - 62. Determine c, given that d(c) = 0. 1, 11 Let r be -1 - 3/1 - -7. Factor 3b4 + 757b*2 - rb*5 - 757b*2. -3b*4(b - 1) Let r(t) be the third derivative of -1/60t6 + 14t*2 + 2/3t*3 - 1/6t*5 + 0t + 1/35t7 + 1/12t*4 + 0. What is m in r(m) = 0? -1, -2/3, 1 Let a(t) be the third derivative of 7t*6/600 - 33t*5/50 + 49t*4/24 - 9t3/5 + t2 + 12. Suppose a(x) = 0. What is x? 2/7, 1, 27 Let g(p) be the first derivative of -7p3/9 - 104p*2/3 + 20p + 86. Factor g(s). -(s + 30)(7s - 2)/3 Let a be (15 + -6 - 6) + 3/15. Solve -4/5s5 - as + 8/5s4 + 0 + 12/5s*3 - 16/5s*2 = 0. -1, 0, 2 Suppose -62t - 22 + 40 = -168. Factor a*2 - 1/4a*t - 1 + 1/4a. -(a - 4)(a - 1)(a + 1)/4 Let g(b) be the second derivative of -b4/12 + b3/6 - b*2/2 + 14b. Let q(y) = -12y2 - 3y - 9. Let z(c) = -9g(c) + q(c). Let z(a) = 0. Calculate a. -4, 0 Let a = -5/766 - -6153/3830. What is i in ai + 0 + 2/5i2 = 0? -4, 0 Let i(l) be the first derivative of -l4 - 8l*3/3 + 2l*2 + 8l + 42. Factor i(f). -4(f - 1)(f + 1)(f + 2) What is m in 21/2m + 0 - 3/2m2 = 0? 0, 7 Suppose 2n - 10 = -2b, -5b = 5n - 6n - 19. What is z in 4z - z4 + 7z3 - z3 - 35z2 - 2z*5 + 25z*2 + 3z*b = 0? -2, 0, 1 Let t(l) be the third derivative of -25/24l*4 - 1/12l*5 + 0 + 0l + 9l2 - 10/3l*3. Factor t(k). -5(k + 1)(k + 4) Suppose -5j = 3u - 8, -4u - j + 3 = -2j. Factor -27r*3 + u + 3 + 25r3 - r2 + 8r. -(r - 2)(r + 2)(2r + 1) Let i(h) = -h2 + h. Let u(g) = -g3 + g*2 + g + 1. Let l(y) = 8y*3 - 18y*2 + 5y - 5. Let z(m) = l(m) + 5u(m). Let a(r) = 4i(r) - z(r). Factor a(f). -3f(f - 2)(f - 1) Let u(x) be the second derivative of -1/35x*5 + 0x*3 + 0x*2 + 0x*4 + 17x + 0. Suppose u(y) = 0. What is y? 0 Let a(z) = -9z2 + 17z + 2. Let k(p) = p*2 - p - 2. Let v(r) = -5a(r) - 40k(r). Factor v(w). 5(w - 7)(w - 2) Let v(z) be the third derivative of z8/24 + z7/21 - 23z6/60 - z5/30 + 4z4/3 - 4z*3/3 - 61z*2. Solve v(w) = 0. -2, -1, 2/7, 1 Let n(d) be the first derivative of -1/6d*2 + 28 + 1/24d*4 + 0d - 1/18d3. Determine s so that n(s) = 0. -1, 0, 2 Factor -59/4g - 15/2g2 + 1/2. -(g + 2)(30g - 1)/4 Suppose -2a + 22 = -0a. Let y(c) = -c2 + 10c + 11. Let w be y(a). Factor 2h2 + w + 8h + 7 - 1. 2(h + 1)(h + 3) Determine u, given that 3u + 70u*2 - 77u*2 + 6 + 5u*3 - 8u - u*4 + 2u*4 = 0. -6, -1, 1 Let d(q) be the third derivative of 1/105q*7 + 36q*2 - 1/140q*6 - 1/30q*5 + 0 + 5/1176q*8 - 1/42q*4 + 0q*3 + 0q. Let d(z) = 0. Calculate z. -1, -2/5, 0, 1 Let g = -281 + 2249/8. Let s(j) be the first derivative of 1/2j3 - 7 + gj*4 + 1/2j + 3/4j2. Find x, given that s(x) = 0. -1 Suppose h - 3h + 6 = 0. Let f be (-5)/6 + 1 + (-322)/(-84). Find g, given that 0g4 - 1 - 2g + 2gh + gf + 0g*3 = 0. -1, 1 Factor -2/9j*3 - 2/9j*2 + 4/9j + 0. -2j(j - 1)(j + 2)/9 Determine d so that 0d*2 + 5d*2 - 171 + 200d + 109 - 143 = 0. -41, 1 Let n = 111 + 15. Let m be ((-6)/(-4))/(n	{ "pile_set_name": "DM Mathematics" }
-15)/12). What is the second smallest value in p, 2, -2, c? -2 Let k = 2213.3 - 2213. Which is the third biggest value? (a) 3/5 (b) -7 (c) -0.1 (d) k c Let u = -4979/5 + 29869/30. Let y(j) = j*2 - 4j + 3. Let k be y(3). Which is the biggest value? (a) 17 (b) -3 (c) k (d) u a Let o = -6 - -5.6. Let t be (-364)/17056 + 7/(-56). Which is the second biggest value? (a) o (b) 0.2 (c) t c Let n = 430837 + -430833. Let b = -19 - -27. Let l be ((-10)/b)/((-2)/(-8)). What is the biggest value in l, 5, n, -3? 5 Let x(y) = -y*3 - 27y*2 - 24y - 643. Let u be x(-27). Let m = -1.4 + 4. Let o = m + -6.6. What is the third smallest value in -2/5, -1, u, o? -2/5 Let y = 5.08 - 0.08. Let z = 3.649 + -3.58. Let v = -0.109 + z. What is the biggest value in y, -3, v? y Let v = -0.164 + 0.264. Let s = -141 - -1271/9. What is the third smallest value in 2, s, v, 10/9? 10/9 Suppose -3k + 5h + 9 = 0, k - 12 = -3k - 2h. Let d be 15(-4)/126/45. Let w = -0.1 + 0.3. Which is the second smallest value? (a) d (b) w (c) k b Let c = 2139 - 2139.3. What is the third biggest value in -8, -41, -0.2, c? -8 Let h be ((-4064)/18)/(-95 + 97). Suppose -u = -3u + 226. Let j = h + u. What is the biggest value in -0.02, 2/7, j? 2/7 Let w = -590.2 + 588.2. Which is the second biggest value? (a) -2/17 (b) 1/7 (c) -662 (d) w a Let s = -139.026 - -138.926. Let z = 0.4 - 0.1. What is the fourth smallest value in -0.3, z, 0, s? z Let c = 7/443 - 921/2215. What is the biggest value in 15, 1, 0.026, c? 15 Let w be 2/4 + 525/30. Let y be -20(4/(-16))/((-3)/w). Let i be (1/(-2))/(y/(-12)). Which is the smallest value? (a) 0.4 (b) i (c) -3/11 c Let g be 20/25 + (-1610)/200 - -7. Which is the second smallest value? (a) -2/13 (b) 13 (c) -0.8 (d) g d Let f = -2695 + 10779/4. Which is the second smallest value? (a) f (b) 1 (c) 4 (d) 0.4 d Let u be 28/(-84)(5 + 132/(-28)). Let f = -10 - -2. Which is the third biggest value? (a) 5 (b) f (c) -0.4 (d) u c Let n(w) = -13w + 57. Let v be n(9). Let s be 6 + 606/v - -5. Which is the second biggest value? (a) 1 (b) -4 (c) s c Let q = -169 + 161.3. Let z = -6.7 - q. Let i = -4 + 3.9. Which is the biggest value? (a) 14 (b) z (c) 1/3 (d) i a Let r = 1.4 + -1.71. Let w = -1.31 - r. Let h = -59/3 + 19. What is the biggest value in w, h, 4? 4 Let w = 1.7 + -1.7. Let h = 5.78 + -0.49. Let r = h + -0.29. What is the third biggest value in r, 6, w? w Let p be (3 - 115/45)12/24. Which is the third smallest value? (a) -0.4 (b) -1 (c) p (d) -7 a Let z = -2.3 + -0.7. Let f = 0.0823 + -0.2823. What is the third biggest value in f, 2/3, z, -1/7? f Suppose 454 = -6p - 1982. Let o = 1625/4 + p. Let v = -3 + 0. Which is the smallest value? (a) v (b) 22 (c) o (d) -4/7 a Let z = 13358 - 13324. What is the smallest value in -5, 2/15, z, -3? -5 Let i = -0.62 + 1.62. Let w = 0.22 + -22.52. Let n = w + 22. Which is the third biggest value? (a) n (b) i (c) 9 a Let i = 4054/3 + -1352. Which is the fourth smallest value? (a) -4 (b) i (c) 198 (d) -1 (e) -0.1 e Let i = 204.8 - 207.8. What is the third smallest value in -2/7, 2, -1/6, i, 0.38? -1/6 Let p = -4.8 - -5.2. Let j = 777 - 776.8. What is the second smallest value in p, 1.8, j, -0.1? j Let q = 518969/7 - 74139. Let h = 7 - 3. Which is the fourth smallest value? (a) 0.4 (b) q (c) -41 (d) h d Let x be (-7)/(-33) + 8/24. Let w = 89 - 93.6. Let q = w - -3.7. What is the second biggest value in x, 0.4, q? 0.4 Let c = -2658 + 2657. What is the smallest value in 0.1, -5, 18, c, 6/7? -5 Let t = -1/73 + -68/365. Let s = -1102 + 975.4. Let x = -128.6 - s. What is the second biggest value in t, x, 2, -9? t Let q = 199794/5 + -39959. What is the second biggest value in q, -0.48, 2/15, 0.3? 2/15 Let x = -14141 - -14140. Which is the fifth biggest value? (a) -0.1 (b) 1/6 (c) -0.3 (d) 3 (e) x e Suppose 28l - 12 = -2n + 24l, 3l - 18 = 3n. What is the smallest value in 2/523, 1, n? n Let y = -2/9 - 1/36. Let r = 5.949 + -6.149. What is the fourth smallest value in 0.2, r, 0.3, y? 0.3 Suppose 3y - 2n + 25 = 0, 4y = 2n + 2n - 40. Let j be 150/19 + (-254 - -254) + (1 - 9). Which is the second smallest value? (a) -2.9 (b) y (c) j a Let f = -14.3 + 32.8. Let n = 25.5 - f. Let v = 4 - -1. Which is the smallest value? (a) 2/5 (b) v (c) n a Let y = 72241/11 - 6569. Which is the second biggest value? (a) y (b) 2/19 (c) 1 b Let r(h) = h*2 + 12h - 1. Let z be r(0). Let u = -1.24 - -0.74. Which is the second biggest value? (a) u (b) 0.7 (c) z a Let i = -38054 + 38052. Let v = 4 - -3. What is the second biggest value in v, 5, i? 5 Let x = -880 - -891.1. What is the smallest value in 0.5, 16/7, x? 0.5 Let l = 31195.9999 - 31198. Let r = l + 0.0001. Which is the smallest value? (a) 3/8 (b) 1 (c) r c Let o = -128.782 + -0.218. Let p = o + 127. Which is the second biggest value? (a) 12 (b) 4 (c) 0.5 (d) p b Let t = -0.3 - -0.3. Let z = -0.417 - -0.557. Let d = -42 + 41. Which is the third biggest value? (a) d (b) z (c) t a Let s = 0.2 + -0.3. Let r = 3771 + -3765. What is the second smallest value in s, -0.01, r? -0.01 Let u = 235/7 - 817/21. Suppose -141p - 13881 = -13458. Which is the third smallest value? (a) p (b) u (c) 1/4 c Let q be (-4)/3(-69)/46. Let p = 135/7 + -1229/63. What is the smallest value in -5, -2/13, p, q? -5 Let y be 65/3 - 5145/245. Let k = 9/62 + 645/682. Which is the second smallest value? (a) y (b) k (c) -0.3 (d) -1 c Suppose -4i - 5g + 18 = 0, 5i - 25g = -30g + 20. What is the third smallest value in -5, 0.3, i, 1/339, 0? 1/339 Let o = 31238 - 31807. What is the third smallest value in -0.3, -1/16, o? -1/16 Let q = -3733 + 3634. Which is the third smallest value? (a) q (b) 4 (c) -1 (d) -4 c Let u = 2645/2 + -1274. Let w = 50 - u. Let y(x) = -x + 8. Let q be y(12). What is the fourth biggest value in -1, -2/15, w, q? q Let v = -2 + 5. Let t be (v/(-2))/(2 + 38/(-20)). What is the second smallest value in -3/5, -5, t, 4? -5 Let t = -10/67 + 324/1273. Let u = -59213 - -59213.5. What is the second biggest value in u, 13, t, 0.1? u Let g = -0.25 + 671.25. Let q = -670.5 + g. Let v = 9/40 + 1/40. Which is the fourth biggest value? (a) -2 (b) q (c) v (d) -0.5 a Suppose 271j + 22j + 1170 = -97j. Let o = 59 + -296/5. Which is the second smallest value? (a) o (b) -0.4 (c) j b Let w be 3-12656/1632 - -5. Which is the third smallest value? (a) 19 (b) w (c) 40 c Let l = -1/15166 - -11375/7583. What is the second biggest value in -12/17, 3, l? l Let q = 165529/790155 + 1128/1951. Let z = -90 - -7289/81. Let m = z - q. Which is the third smallest value? (a) -2/21 (b) m (c) -5 (d) 5 a Suppose 40p = 193p. Suppose -x + 44 = -2r, 3x + 3r = 137 - 32. Let t be -212/x. Which is the second biggest value? (a) -0.23 (b) t (c) -0.5 (d) p b Let q = -195.42 - -482.42. Which is the third biggest value? (a) 1/8 (b) q (c) 0.2 a Let x = -0.0609 - -35.0609. Let v = 70 + -69. What is the second biggest value in 2, x, v? 2 Let w = -6/35 - 8/35. Which is the second biggest value? (a) -0.09 (b) 60 (c) w (d) 0 d Let z = -292/7 + 42. Let i = -1.6 - 12.4. Let p = i - -14.2. Which is the third biggest value? (a) 4 (b) p (c) 2 (d) z d Suppose 2 = h + 4. Let k = 0.047 + -0.106. Let p = k + 0.059. Which is the smallest value? (a) h (b) 0.3 (c) p a Let s = -6/43 + 331/215. Which is the second biggest value? (a) 2 (b) 0.2 (c) s (d) 28 a Let l(k) = -3k2 + k3 + 0k3 + k3 + 10 - 5. Let t be l(3). Suppose -33p = -tp + 9. What is the third smallest value in -0.5, -2, 1, p? -0.5 Let i = -6.4 + -0.6. Let f = 6 + i. Let o = -32/19 - -1/57. Which is the third smallest value? (a) f (b) 0 (c) 0.2 (d) o b Let y be (-40)/238 - (-6)/21. Let b = -8693 + 8698. What is the biggest value in y, -3, 0.05, b? b Let h = -11.2 - -19. Let g = -40.8 + h. Let d = g + 36. Which is the second smallest value? (a) d (b) -1/17 (c) -1 b Let g be (1/210)/(1751/(-206)). What is the fourth biggest value in 5, g, 1/5, 0.5? g Let t = -223.99 + 189.99. What is the biggest value in 1/5, -0.5, -5, 4, t? 4 Let a = 7 - 5. Let w = -3 + a. Let q = 2.0516 + -0.0516. What is the second smallest value in -2/7, q, w? -2/7 Let v	{ "pile_set_name": "DM Mathematics" }
2, v, f in ascending order. v, f, 2 Let g = -3 + 113. Let i = -12 - 787/8. Let y = g + i. Put 1/6, y, 0.2 in increasing order. y, 1/6, 0.2 Let p be (-36)/7 + 5/35. Put -1, 1, p in descending order. 1, -1, p Let w = -8 - -3. Let m = -5 - w. Put m, -3, -4 in decreasing order. m, -3, -4 Let h be 60/33 - 8/(-44). Suppose 5 = -4o + 1. Let b = o - h. Sort b, 5, 1 in decreasing order. 5, 1, b Let b = -0.36 - -0.4. Let d = -0.26 - b. Put -2/9, -2/7, d in decreasing order. -2/9, -2/7, d Let p = -6 + 5.94. Let a = p + -0.04. Sort 2/3, a, 0.4. a, 0.4, 2/3 Suppose -3p + g - 41 = 5g, g = p + 2. Suppose 4k - 1 + 29 = 0. Let m = p - k. Sort m, -2, -4 in descending order. m, -2, -4 Let g = 3/7 + 1/14. Let y = 0.07 + -0.07. Let p = y + 3. Sort g, p, 0.2 in ascending order. 0.2, g, p Let r be -2 + 2 - (-9)/(-45). Sort 0.2, -1, 5, r in ascending order. -1, r, 0.2, 5 Suppose 2m - 12 = -m. Let b be (-6)/21 - m/(-14). Put b, -5, -4 in decreasing order. b, -4, -5 Let n = -2 - 2. Suppose -2d - 4p = -6, -3d + d = 3p - 2. Sort d, n, -2 in descending order. -2, n, d Let d(u) = -u2 - 6u - 2. Let o be d(-5). Let f be (-11)/o - 4/(-6). Sort -1/2, f, 0. f, -1/2, 0 Let v = 3 + -7. Let n be 0(-3)/(-9) - 3. Sort v, n, -5. -5, v, n Let n be 0/(-22/4). Let r(i) = -i3 + i2 - 2. Let s be r(n). Let f(u) = u + 1. Let k be f(2). Sort 0, k, s in ascending order. s, 0, k Let w(x) = -x*2 + 11x + 1. Let a be w(11). Suppose q - c + 2 = -3c, 3c + 9 = -3q. Sort a, -1, q in increasing order. q, -1, a Let y = 3 - 3. Suppose y = a + t, -3a + 4t + 27 = 2a. Suppose -z + 4z + 15 = 0. Sort z, a, 4. z, a, 4 Suppose -14k = -7k - 7. Put -2, -3, k, 0 in decreasing order. k, 0, -2, -3 Suppose 6r + o = 2r - 11, -o - 9 = 3r. Let c = 5 + -4.6. Let z = c + -0.5. Put r, z, 1/2 in descending order. 1/2, z, r Suppose -4r + 24 = -2q, 0 = -5r + 7r - 3q - 20. Let w be (-1)/(-4) + (-5)/4. Put w, 3, r in decreasing order. r, 3, w Suppose -h = -2h + 4. Let p(a) = -a*2 - 5a - 5. Let j be p(-5). Sort h, j, 2 in decreasing order. h, 2, j Let c = -4 + 10. Let n(g) = g*3 - 9g*2 - 8. Let i be n(9). Let d = i + c. Sort d, 2/15, -4. -4, d, 2/15 Let a = -0.168 - -0.068. Put -1/5, 1, a, 4 in decreasing order. 4, 1, a, -1/5 Let c = -3 - 2. Let p = -1 - c. Let r be -3(1 - 4/(-6)). Put 2, p, r in decreasing order. p, 2, r Let y(z) = -z - 8. Let s be 4/6(-210)/20. Let x be y(s). Sort -2, x, -3 in descending order. x, -2, -3 Suppose c + 1 = 4u + 16, 4u + 3c = -3. Sort 5, u, 2 in ascending order. u, 2, 5 Suppose 3 = z - 1. Let j = -5 + 7. Suppose -2 = h + j. Sort z, h, 5 in ascending order. h, z, 5 Let v be 60/14 - (-6)/(-21). Let z be -2 + 1 + 0 + -3. Put v, z, -3 in increasing order. z, -3, v Let c(l) = -2 - l*2 - 13l + 3l + 15. Let x be c(-11). Let a be 3/(-3)(-2 - -7). Sort -7, x, a. -7, a, x Let c be 1/(-2 - 28/(-12)). Suppose g - cg + 8 = 0. Put 5, -3, g in decreasing order. 5, g, -3 Let k(f) = 3f - 3f - 2f + 4. Let m be k(3). Sort 4, 2, m. m, 2, 4 Suppose 0 = -s + 4z + 10 - 0, -2z = 4. Suppose -15 = -5t + st. Put 0, t, 1 in descending order. t, 1, 0 Let s = -0.82 - -0.32. Sort -0.31, 1/4, -2/5, s in descending order. 1/4, -0.31, -2/5, s Let q = 0.89 + -1.19. Sort -3, 0.1, q in descending order. 0.1, q, -3 Let u = 0.4 - 0.6. Put 0.1, u, 10 in decreasing order. 10, 0.1, u Let w = -0.8 + 0.5. Let q be 5/1 - 585/105. Sort q, w, -2 in ascending order. -2, q, w Let r(s) = -2s + 9. Let g be r(3). Put -5, -3, g in ascending order. -5, -3, g Suppose -4w - 2 = -2w. Let r be w/(-8) + (-123)/24. Sort -14, 5, r. -14, r, 5 Let f be (-10)/(-2) - (6 + -3). Put 4, 5, f, -7 in increasing order. -7, f, 4, 5 Let l = -0.68 - -0.08. Let o = -0.9 - -0.1. Let y = o - l. Sort y, -4, 1. -4, y, 1 Suppose 4b + k - 2 = -5, -k = 3b + 1. Suppose 3u + 16 = 7u. Put b, u, -3 in decreasing order. u, b, -3 Let g = -9.8 - -8.9. Put g, 0, 5 in descending order. 5, 0, g Let y = 2.5 - 2. Let k = -3 + 2.9. Sort y, k, 3 in descending order. 3, y, k Let g be (2(-18)/21)/(22/(-77)). Sort -0.4, g, 4/9 in decreasing order. g, 4/9, -0.4 Let g be (-2 + -3)(-8)/10. Let f(z) = 2 + 1 - z + 5 - 4. Let k be f(7). Sort k, -5, g in ascending order. -5, k, g Let m be (-6)/(-10) + (-6)/(-15). Let a = 0.12 + 0.38. Sort m, a, -1/5. -1/5, a, m Let k = 76 - 153/2. Suppose 5u - 5 - 5 = 0. Sort u, -2, k. -2, k, u Let a be (-4)/(-6)(12 + 6). Let u = -8 + a. Let g be 3/(-12) + (-3)/(-8). Sort u, g, 2. g, 2, u Let c be (2/(-6))/((-3)/(-4)). Let w = -22.9 + 23. Sort -1, c, w in decreasing order. w, c, -1 Let f(o) = o + 2. Let n be f(2). Sort -6, -4, n. -6, -4, n Let o(l) = -l2 - l - 2. Let g be o(-5). Let m be ((-6)/45)/(g/10). Let d = -20/33 - m. Put -0.4, d, -5 in descending order. -0.4, d, -5 Let v = 1 + -4.5. Let k = 0.5 - v. Let u = 0.4 - 0.7. Sort k, u, -3 in descending order. k, u, -3 Suppose 5k - 4 = -s + 3, 5s - 3k + 21 = 0. Sort 3, 5, 1, s in decreasing order. 5, 3, 1, s Suppose 0 = 4a + 16. Let w(n) = n2 - 6n - 11. Let f be w(8). Put a, -1, f in decreasing order. f, -1, a Let g = -0.12 - -4.12. Let d = 2.92 - -0.08. Let a = -148 + 1033/7. Sort d, a, g in decreasing order. g, d, a Let j be 1/(-2 - -3) - -7. Let x(c) = c*3 - 9c*2 + 9c - 6. Let a be x(j). Suppose 2g + ag = -12. Put 3, g, -2 in decreasing order. 3, -2, g Let o be 164/9 + 4/(-18). Let p be -2 + (-1 - (-95)/o). Let f = p + -16/9. Put -0.5, f, -0.1 in increasing order. -0.5, -0.1, f Suppose -2d + h = -3, -3d = 2d - 5h. Sort d, 4, 13 in descending order. 13, 4, d Let h(j) = -j*3 - 5j*2 - 4j + 5. Let k be h(-4). Suppose 5z + 15 = 0, a - 2a - 9 = 5z. Suppose ag - g = 15. Sort -3, k, g in descending order. k, g, -3 Let s(g) be the second derivative of g*4/12 + 3g*3/2 + 2g*2 - 4g. Let y be s(-9). Let v = 0 - -1. Sort v, -2, y in decreasing order. y, v, -2 Let t be 60/2530/(-4). Let w be (68/6)/(2/t). Let l = w - -508/5. Put -1, 1, l in descending order. 1, l, -1 Let t(u) = u3 - 3u*2 + 8. Let f be t(2). Put -13, -5, f, -2 in decreasing order. f, -2, -5, -13 Let c be ((-6)/2)/(-4 - 215/(-20)). Put 1, c, 0.04 in decreasing order. 1, 0.04, c Suppose -4r + 5m - 6 = 0, 4 = 8m - 6m. Sort r, -4, 4 in decreasing order. 4, r, -4 Let k = -2.4 + 2. Let a = 0.04 + -0.14. Sort 1/4, a, k. k, a, 1/4 Let b = 0.07 + -0.11. Let x = b + -4.96. Let p be 0/((-3)/3 - -3). Sort -3, p, x in increasing order. x, -3, p Let y = -363 - -232. Let z = y + 923/7. Let t = 47.1 - 47. Put 2, t, z in descending order. 2, z, t Let a(l) = l2 + 2l - 11. Let j be (-5 - (-3 + 1)) + -2. Let s be a(j). Sort -4, s, -6. -6, -4, s Let z = 170 + -173. Sort z, -2, -21, 3. -21, z, -2, 3 Let q = 63 + -63.3. Sort -0.28, -1/3, -3, q in increasing order. -3, -1/3, q, -0.28 Suppose u - 1 = 3j + 17, 3j - 5u = -30. Sort j, 5, 4 in descending order. 5, 4, j Let w be (-1)/(-2) - 1/2. Suppose w = l + 1 + 1. Let f = 4 - 9. Put -1, l, f in descending order. -1, l, f Let s = 264/5 + -53. Suppose 5p + 0p + q = 32, 5p - 24 = 3q. Suppose -px + 10 = -x. Sort -0.5, s, x in descending order. x, s, -0.5 Let b(k) = k*3 + 15k*2 + 26k - 3. Let m be b(-13). Sort m, -1, 2 in descending order. 2, -1, m Suppose -2r + 4 = 2s - 4r, 0 = -5s + 3r + 6. Suppose s = -v - 3v. Sort v, -5, -4 in ascending order. -5, -4, v Let d be ((-15)/(-5))/3 - 7. Sort -4, -3, d in decreasing order. -3, -4, d Let f = -0.22 - 0.08. Let m = -6 + 9. Suppose 0d - 12 = md - 2r, 0 = 5d + 3r + 1. Sort f, d, 2 in decreasing order. 2, f, d Let b = -17.7 - -18. Put 4/3, b, -2, -5 in descending order. 4/3, b, -2, -5 Let d(k) = k - 13. Let f = -18 + 26. Let z be d(f). Sort 3, z, 0 in descending order. 3, 0, z Let k be 2(-2)/(-2) - 3. Let f be 0 + 0 - 6/(-21). Put 4, k, f in ascending order. k, f, 4 Let x = -5.08 + 0.08. Let v = -13.1 + 13. Put 2, x, v in descending order. 2, v, x Let f = -5 + 6. Let q = -69 + 64. Sort 3, f, q in increasing order. q, f, 3 Let m be (-50)/28 - (-9)/6. Sort m, -0.4, -29 in descending order. m, -0.4, -29 Suppose 2i - 4c = -8, i - 2c = -4i - 20. Let y = -7 + 12. Sort y, i, -2 in increasing order. i, -2, y Let h(d) = -d*2 - 5d - 2. Let a be h(-4). Suppose 0y = -3y + 15. Sort -5, a, y in decreasing order. y, a, -5 Let d be (-100)/195 - (-4)/6. Sort 0.4, -3/	{ "pile_set_name": "DM Mathematics" }
, 3? -1/5 Let z be -84/16-5. Suppose 6y = zy - 16. What is the biggest value in y, 1/2, -4/7? y Let g = 4.6 - 4.4. Let y = 0 + 0. What is the smallest value in y, g, -4? -4 Let o = -8.64 + 0.04. Let j = -12 + 21. Let y = j + o. What is the biggest value in 0.2, y, 3? 3 Let s = 0.095 - -0.005. Let d = 16.3 + -3.3. Let j = d + -8. Which is the third smallest value? (a) -2/9 (b) s (c) j c Suppose 0f = 5f. Let n = -3 + f. Which is the second biggest value? (a) n (b) 0.5 (c) -0.4 c Suppose 4v = -16 + 8. Let z = 43/78 + -2/39. What is the third smallest value in 3, v, z? 3 Let o be (16/(-180))/((-48)/(-40)). What is the smallest value in 0.2, o, 0.4, -3? -3 Let d = 16 - 19. What is the second biggest value in d, 1, 0? 0 Let q = -26/3 - -155/18. Which is the second biggest value? (a) 0.5 (b) q (c) -2 (d) -4 b Let a = -8 - -8.3. Let s = -1.2 + 0.7. Let j = 895/22 - 81/2. What is the second biggest value in a, s, j? j Let m be -1 + (-65)/(-6) + 0. Let o = 55/6 - m. Which is the second smallest value? (a) -4 (b) 2 (c) o c Let d be (18/20)/((-12)/(-10)). Let m be (3 + (-3 - 1))-5. Let u = -4.97 + -0.03. Which is the third smallest value? (a) u (b) d (c) m c Let v = -4.7 - -0.7. Let w = 1 + v. What is the biggest value in 2, w, 0.3? 2 Let m = -7 + 6.9. Let d = -3.9 + m. What is the third smallest value in 2, d, -5? 2 Let x be 1/(-3) + (-28)/6. Let a = x + 34/7. What is the third biggest value in a, 5, -1? -1 Let n = -5 - -4.9. Let t be (-2)/(-1) + 2 + 2. Let v be (-10)/t4/(-30). What is the third smallest value in n, 0.4, v? 0.4 Let d = -1.7 + 1.5. What is the second biggest value in -1/6, -2, d? d Let i = -127 + 127.1. What is the fourth biggest value in -1, i, 3, 6? -1 Let h(c) = -c - 6. Let z be h(-5). Let r be 5/(-10)(0 + 2). Let j be 30/(-9) - r/3. What is the second smallest value in z, j, -0.2? z Let l = -22/15 - -199/105. What is the third biggest value in 2/7, -1, l? -1 Let y = 223 - 2451/11. Let m = -2/89 - 57/1424. Which is the second biggest value? (a) y (b) m (c) 2 a Let o = -5 - -4. What is the smallest value in o, 1, -0.3? o Let g = -12 + 9. Let y be 3 - 2 - 3/4. What is the second smallest value in g, y, -2? -2 Suppose -2h + 33 = h. Suppose 2 + 1 = -y - 4f, -2f + h = 3y. Let t = -85 - -167/2. Which is the smallest value? (a) y (b) -1 (c) t c Suppose -4q - 16 = 16. Let z = q + 11. What is the second biggest value in 0.2, z, 0? 0.2 Let n = 1.04 + -0.04. Let y be 6/(-4)(-48)/9. Let a = -6 + y. What is the third smallest value in n, -2/3, a? a Let j = 11 + -16. Which is the third smallest value? (a) -0.3 (b) 0 (c) j b Let a be ((-3)/(-12))/(4/8). What is the second smallest value in -2/13, a, -1/2? -2/13 Let x = -0.035 - -0.435. Let j = -6 + 1. Which is the second biggest value? (a) 1 (b) x (c) j b Let x = -4.4 - 2. Let s = 9.3 + x. Let u = s + 1.1. Which is the smallest value? (a) -2 (b) -1/6 (c) u a Let y(b) = b + 13. Let s be y(-9). Let w = -47 - -140/3. What is the second smallest value in -0.04, s, w? -0.04 Let s be (4/(-3) + 0)/((-46)/3). Which is the biggest value? (a) -1/7 (b) s (c) 1/6 (d) -0.2 c Let s = 0 + -1. Let x = s + 4. Let q = 21 - 20.6. What is the smallest value in q, 2/15, x? 2/15 Suppose 0 = -12k + 17k + 15. Let s = 4 + -5. What is the third biggest value in 5, s, k? k Let g be (-6)/(-27) - (-58)/(-18). Suppose -2i = -4 + 12. Let j be 1 - 3 - 10/i. Which is the second smallest value? (a) g (b) j (c) 2/15 c Let k = -11 - -15. Let a = -0.9 - 0.3. Let o = a - -1.1. What is the smallest value in k, o, 1? o Let t(l) = -5l3 + l2 + l - 1. Let q be t(1). What is the fourth smallest value in 3, q, 0, -4/5? 3 Let n = 2162/9 - 240. Which is the smallest value? (a) 6 (b) -0.5 (c) n b Let x = 0.16 + -0.12. Let o = 6.57 - 2.53. Let h = x - o. What is the third biggest value in -3/8, h, -2? h Let p(n) = n*3 - 3n*2 - 2n + 4. Let d be p(3). Let h be d/4 + 1/2. Which is the third smallest value? (a) -1 (b) -0.5 (c) h c Let k = 11.4 + -4.1. Let f = k - 7. Which is the third biggest value? (a) 3 (b) f (c) 1 b Let k = 3.8 + -4. Which is the third smallest value? (a) 1 (b) k (c) 4/3 c Let w = 10952552 - 9430148428/861. Let k = -7/123 - w. What is the smallest value in -1/5, k, 0.1? -1/5 Let y be 38/12 - (-4)/(-24). Let v be (-3)/(-1) - 44/y. Let z = 184/15 + v. Which is the smallest value? (a) -3/2 (b) z (c) 0.5 a Let d be 3 - (2 + -2 + 2). Let r = -3.9 + 1.1. Let p = 0.2 - r. Which is the biggest value? (a) p (b) d (c) -0.2 a Let t = 5 - 5. Let y = t - -3. Which is the third smallest value? (a) y (b) -1 (c) -2/7 a Let k = 7 + -13. Let g be k/(-4) + -4 + 2. Which is the third biggest value? (a) g (b) 2/15 (c) 2/9 a Let v = 10 - 18. Let g be ((-12)/40)/(6/v). Which is the second biggest value? (a) g (b) -1/4 (c) 4 a Let g = -0.068 + 0.268. Which is the third smallest value? (a) 0.5 (b) -4 (c) g (d) -1/2 c Let o = -72.3 - -91. Let d = 19 - o. Which is the second biggest value? (a) d (b) 0.1 (c) 3/2 a Let r be 1/(-2)(-15 + 5). Let n = r + -6. Which is the third smallest value? (a) n (b) 0.5 (c) -5 b Let h = -4.09 - -0.09. Which is the biggest value? (a) 4 (b) 0.3 (c) h a Let w = 0.1 + 0.3. Let q = 0 + 0. Let t = q + -0.2. Which is the third smallest value? (a) 0.3 (b) t (c) w c Let f = -102.3 + 102. Let w = -5 + 3. Which is the second smallest value? (a) f (b) w (c) -4 b Let m be 3 + -10 - ((-4)/2 + 0). What is the third smallest value in 4, m, -4/7, 0? 0 Let l be 2801/(-2406) + 3 + -1. Let t = l + -1/401. Let z = -77.4 + 77. Which is the second smallest value? (a) z (b) t (c) -1/3 c Suppose -17p - 25 = -12p. Which is the third biggest value? (a) -0.2 (b) p (c) -3 b Let m(h) = -h3 + 2h*2 + 9h - 8. Let u be m(4). What is the biggest value in 5, u, 3? 5 Let a = 69 + 169. Suppose 4n - a + 30 = 0. Let l be 6/(-12) + 34/n. What is the smallest value in -1, l, -2/21? -1 Let q = -0.35 + -0.05. Let u = -15 - -4. Let d = u + 10. Which is the third smallest value? (a) 2 (b) q (c) d a Let z be (-32)/(-10) - (-3 - -6). Let h = -2739/10 - -265. Let k = -9 - h. Which is the second smallest value? (a) 4 (b) k (c) z c Let j(t) = -t2 + 2t. Let z be j(1). Let o = -2.3 - 0.7. What is the third biggest value in z, o, -5? -5 Suppose 4f = 2f + 6. Let i be 9/f + -1 + -2. Which is the third smallest value? (a) 1 (b) 0.1 (c) i a Let d be (0 - 1) + 5 + -10. Which is the third biggest value? (a) 2 (b) d (c) -2 b Let k = 2.2 + -1.8. What is the third biggest value in 0, k, 2/3? 0 Let h = 0 + -3. Let q = 8.98 - -0.02. Let z = q - 9.4. What is the third biggest value in -1/2, z, h? h Let x = -16 + 16.4. What is the second smallest value in 0, x, 3, -1/4? 0 Let m = 0.2 - 1.2. Let n(q) = -17q - 1. Let a be n(1). Let j be (a/(-8))/(-3)4. What is the third biggest value in -0.3, j, m? j Let i = 11 - 11.03. Let u = i - -0.43. What is the third smallest value in -2, -0.5, u? u Suppose -k - 4v + 23 = 0, k + 3v = -k + 21. Let d(f) = -f*3 - 5f*2 + 6f + 5. Let u be d(-6). What is the third biggest value in k, -4, u? -4 Let x(h) = h*3 - 4h*2 + 2h + 2. Suppose 3w - 14 = -5. Let j be x(w). Which is the third smallest value? (a) j (b) 4 (c) 5 c Let r = 14 + -14.3. Which is the second biggest value? (a) 2/13 (b) r (c) 2/5 a Let p = 73 - 147/2. Which is the second biggest value? (a) -0.1 (b) -2/11 (c) -0.2 (d) p b Let r = -1.5 + 3.5. Which is the biggest value? (a) r (b) -3 (c) -2/9 a Let t = -40 + 45. What is the fourth biggest value in t, -4, 3/4, -1? -4 Let r = 9 - 5. Let o = -2 - -7. Let k = -5.3 + o. What is the second smallest value in -0.4, r, k? k Let a = -169 - -1180/7. What is the third biggest value in -5, 0.4, a? -5 Let g = 3 - 3.5. Let m = -4.86 - -5. Let o = m + -0.04. What is the second biggest value in g, -1, o? g Let c = -0.06 + -0.04. Let z = -0.03 + -0.97. What is the biggest value in z, 4, c? 4 Let j = -7.8 + 8. Which is the biggest value? (a) j (b) 1/3 (c) 3 c Let o = 5.8 + -5.85. What is the third biggest value in -1/10, 1/5, o, -0.2? -1/10 Suppose -3b = 0, -5x + 2x + 9 = -b. Let w be 33/18 - x/2. What is the second smallest value in 2, w, -0.5? w Let y = -13 - -18. Let s = 62 - 56.8. Let v =	{ "pile_set_name": "DM Mathematics" }
n base 9, what is -125543 - 2? -125545 In base 9, what is 0 - 481? -481 In base 10, what is -2 + 58395? 58393 In base 13, what is b4 + 17c0? 18a4 In base 5, what is 10 + -10042033? -10042023 In base 13, what is 30 + -33a0? -3370 In base 8, what is 107 + 1201? 1310 In base 13, what is 1 - -b8135? b8136 In base 2, what is 1011 - -1000111011001111? 1000111011011010 In base 9, what is -4 - -253108? 253104 In base 8, what is 1 - 342142? -342141 In base 5, what is 1344 - -223110? 230004 In base 2, what is -1010101111 - -1101? -1010100010 In base 4, what is -10013 + 32123? 22110 In base 11, what is 2 - -23686? 23688 In base 8, what is 7644712 - -3? 7644715 In base 7, what is 1511300 + -5? 1511262 In base 2, what is 110000 - 10010101110100? -10010101000100 In base 9, what is -172 - -6082? 5810 In base 4, what is -100103 + -12? -100121 In base 7, what is 2 + 115230? 115232 In base 5, what is -4 + 42440032? 42440023 In base 2, what is -101 + -111111110101? -111111111010 In base 15, what is 13 + -14b71? -14b5d In base 9, what is -434271 + 3? -434267 In base 6, what is 5312 - 1315? 3553 In base 2, what is -1000100101101 + 10011? -1000100011010 In base 16, what is -2f - 59e? -5cd In base 4, what is -13 + 23222203? 23222130 In base 5, what is 111 - -110? 221 In base 7, what is -2415 - 20336? -23054 In base 6, what is -4014542 + -12? -4014554 In base 8, what is -6773 - 172? -7165 In base 9, what is 51 - 141? -80 In base 4, what is -202333 - -3233? -133100 In base 14, what is 653 - -a91? 1304 In base 15, what is -132b + 5e? -12bc In base 10, what is 0 - -203745? 203745 In base 10, what is -16546 + -5? -16551 In base 4, what is -10 + -113221130? -113221200 In base 12, what is -5b84 + -a? -5b92 In base 5, what is -10133 + -3044? -13232 In base 3, what is 2 + 1022211201011? 1022211201020 In base 15, what is -166 + -293c? -2aa3 In base 11, what is -5 + 18553? 18549 In base 8, what is 75 - 12232? -12135 In base 15, what is -14 + -a8? -bc In base 15, what is -1c - -31e? 302 In base 3, what is 21022211 - 100? 21022111 In base 4, what is 121 + -23203330? -23203203 In base 11, what is -168750 + 0? -168750 In base 2, what is 1000101000 + 1101110100? 10110011100 In base 12, what is -ba386 - -2? -ba384 In base 9, what is 5 - -132557? 132563 In base 16, what is 487bcf - -1? 487bd0 In base 3, what is 12010 + -10001120? -2212110 In base 12, what is -421 - -76? -367 In base 3, what is -10000101 + -10200? -10011001 In base 4, what is -200 - -103301? 103101 In base 6, what is -1235 + -30? -1305 In base 14, what is -d7a + -1? -d7b In base 16, what is 176 - 295? -11f In base 2, what is -101101110100 - -10101? -101101011111 In base 4, what is -201 + -10232213? -10233020 In base 11, what is 6511 + a? 6520 In base 8, what is -364 + 16307? 15723 In base 10, what is 4 - 53868? -53864 In base 5, what is 2212 - -22? 2234 In base 2, what is 1000101110001 + 1? 1000101110010 In base 11, what is 3 - 959a? -9597 In base 16, what is 6c0c - -23? 6c2f In base 9, what is 37 - -467? 515 In base 8, what is 261 + 700? 1161 In base 15, what is 309 + a7? 3b1 In base 10, what is -413870 + -2? -413872 In base 7, what is 4124160 + 2? 4124162 In base 4, what is 101 + -1001232? -1001131 In base 13, what is 12ab - 5b2? 9c9 In base 3, what is -1 - 1100001202200? -1100001202201 In base 12, what is 478ab6 + 4? 478aba In base 12, what is -425169 + 2? -425167 In base 15, what is -6 - 1179c? -117a3 In base 10, what is 1275 + -805? 470 In base 13, what is 76 - 94? -1b In base 6, what is 4 - 1005211? -1005203 In base 12, what is 73b - -136? 875 In base 2, what is 10110001101011 + 100011? 10110010001110 In base 12, what is 13a74 - 3? 13a71 In base 12, what is -3 + -50? -53 In base 4, what is -2001120332 + 2? -2001120330 In base 5, what is 1202 + 214? 1421 In base 13, what is -232 + -84a? -a7c In base 15, what is 1dab40 + 0? 1dab40 In base 10, what is 5 + -3642? -3637 In base 8, what is 17 + -101044? -101025 In base 11, what is -193a47 - 5? -193a51 In base 14, what is 1cb6 - 15? 1ca1 In base 4, what is 312112132 - 0? 312112132 In base 2, what is -101 + 1010110100010100? 1010110100001111 In base 3, what is 1120202120 + -102? 1120202011 In base 12, what is -42ba + 2a? -4290 In base 10, what is -200493 - 0? -200493 In base 10, what is -30128 - -1? -30127 In base 16, what is 5 - -4f7f? 4f84 In base 2, what is 0 + 100100000011001? 100100000011001 In base 4, what is 200331222 - 0? 200331222 In base 5, what is 101342 + -303? 101034 In base 14, what is a866 - 5? a861 In base 12, what is -438b3 + 1? -438b2 In base 8, what is 3 + -22110? -22105 In base 5, what is 333 - -142020? 142403 In base 14, what is 2b6 - 338? -62 In base 5, what is 4042 + 1112? 10204 In base 3, what is 11012200 + 10020? 11022220 In base 8, what is 6 - -261370? 261376 In base 7, what is 6112 - 16? 6063 In base 8, what is -14247 - -27? -14220 In base 14, what is 2 + -9ac77? -9ac75 In base 6, what is -1 - -101310? 101305 In base 3, what is -100121 - 12220? -120111 In base 10, what is 3 + 64424? 64427 In base 11, what is -4 + -a181? -a185 In base 10, what is 9 + -1176? -1167 In base 6, what is 1144 - -21? 1205 In base 16, what is -d27c - -15? -d267 In base 10, what is 1 + 979949? 979950 In base 4, what is 1011 - 30320? -23303 In base 14, what is 345 + -632? -2cb In base 9, what is -1420 - -41? -1368 In base 10, what is -1790 + 646? -1144 In base 11, what is 12488 + 34? 12511 In base 3, what is 11 - -22011012? 22011100 In base 2, what is -101 - 1010010110111? -1010010111100 In base 10, what is 1770 + 13? 1783 In base 15, what is -9ce - -56? -978 In base 16, what is 4 - -297b? 297f In base 16, what is -2d87 - 4? -2d8b In base 5, what is 31223 + 12? 31240 In base 11, what is 1 - 276? -275 In base 8, what is -14076 + 36? -14040 In base 13, what is cabb4 + 3? cabb7 In base 6, what is 21354014 - -5? 21354023 In base 9, what is 1 + -1467607? -1467606 In base 13, what is 8 + -3a? -32 In base 6, what is 431015 + 5? 431024 In base 6, what is -132 + 244? 112 In base 2, what is 11 + -110100100000? -110100011101 In base 4, what is -10101 + 30321? 20220 In base 11, what is -27 - 1646? -1672 In base 8, what is 0 - -255773? 255773 In base 11, what is -3 + -8450? -8453 In base 11, what is 5 + 90383a? 903844 In base 10, what is 32136 - -38? 32174 In base 2, what is -11000 - -1010101110? 1010010110 In base 7, what is 2 + 311230? 311232 In base 14, what is -192 + -26? -1b8 In base 14, what is -8 + 300a9? 300a1 In base 11, what is -255a3 + 69? -25535 In base 8, what is -14 + -3467? -3503 In base 15, what is 1 + -6bec? -6beb In base 6, what is 0 + -543122? -543122 In base 7, what is -141 + 10361? 10220 In base 16, what is 6c75 - 1a? 6c5b In base 2, what is 111011011100011 - 10001? 111011011010010 In base 14, what is 4 - 14859? -14855 In base 12, what is -4a + -43? -91 In base 10, what is 236 + 4? 240 In base 7, what is -4362332 - -2? -4362330 In base 15, what is -5 + -c6ca? -c6d0 In base 16, what is 35d - -f? 36c In base 3, what is 10221222120 + -1001? 10221221112 In base 8, what is 46754 + -3? 46751 In base 10, what is 6 + -717? -711 In base 4, what is -1211001221 + -10? -1211001231 In base 8, what is 2 + -352150? -352146 In base 6, what is 5 - 22534? -22525 In base 5, what is -314032130 - -3? -314032122 In base 16, what is -52 - 375? -3c7 In base 12, what is -2a362 - 2? -2a364 In base 14, what is -908 + -59? -963 In base 9, what is 21 - -5801? 5822 In base 4, what is -1300 + 3311? 2011 In base 12, what is -793 + -3? -796 In base 11, what is -238 + -1130? -1368 In base 13, what is -1162 - -12? -1150 In base 8, what is 10727 - 42? 10665 In base 2, what is 110111 + -1001100110100? -1001011111101 In base 15, what is 2b70 + 35? 2ba5 In base 16, what is -b + -bf1? -bfc In base 2, what is 10100111100 + -110? 10100110110 In base 11, what is 2757 + 0? 2757 In base 11, what is -2305 + 41? -2274 In base 11, what is 22a057 + -3? 22a054 In base 3, what is -120 + 202002? 201112 In base 13, what is 14cba45 - -4? 14cba49 In base 16, what is -3ea4 - -38? -3e6c In base 12, what is 0 + -20634? -20634 In base 13, what is -4 - 997c? -9983 In base 3, what is -10 - -201011021? 201011011 In base 16, what is 292 - 3? 28f In base 8, what is -21 + 267305? 267264 In base 7, what is 11 - 1030? -1016	{ "pile_set_name": "DM Mathematics" }
he terms in -4t3 + 6t*3 - 6t*3. -4t3 Collect the terms in -4 - d3 + 2d3 - 3. d3 - 7 Collect the terms in -2 + 82n*2 - 55n*2 + 2. 27n*2 Collect the terms in -5288 + 5288 + 3y. 3y Collect the terms in -8h2 + h2 + 4h2. -3h*2 Collect the terms in 25 + 7d*2 - 48 + 23. 7d*2 Collect the terms in 24n + 1283 + 1280 - 2563. 24n Collect the terms in 32n*2 + 7 - 29n*2 - 73n*2. -70n*2 + 7 Collect the terms in -6o*2 + 82o - 82o - 7o*2. -13o*2 Collect the terms in 7f + 102f - 202f - 323f. -416f Collect the terms in -9j3 + j3 - 2j*3 - 7j*2 + 9j3. -j3 - 7j2 Collect the terms in -116592f + 116592f + 23f*2. 23f*2 Collect the terms in v - 82715 - 3v + 82715. -2v Collect the terms in -13440b + 13440b - 8b*3. -8b*3 Collect the terms in -61w*3 + 31w*3 + 28w*3. -2w*3 Collect the terms in 59 - 217y - 59. -217y Collect the terms in -92g*2 + 126g*2 - 39g*2. -5g*2 Collect the terms in 24y*2 + 719 + 19y*2 - 719. 43y*2 Collect the terms in 4a + 14a + 9a. 27a Collect the terms in 9c + 13c + 12c - 44c + 8c. -2c Collect the terms in 52 + b - 52. b Collect the terms in -3 + 3 - 96y*2 + 93y*2 + 0. -3y*2 Collect the terms in -6 + 170a - 161a + 6. 9a Collect the terms in 10q - 10q - 2q2 + 4q*2. 2q*2 Collect the terms in 7f*3 + 57f*3 - 14f*3. 50f*3 Collect the terms in 55w - 6 - 270w + 4. -215w - 2 Collect the terms in -2x3 - 1738x*2 - 1742x*2 + 3480x*2. -2x*3 Collect the terms in 0d2 - d2 - d*2 + 0d*2. -2d*2 Collect the terms in -22q*2 + 149q*2 - 41q*2 - 38q*2 - 46q*2. 2q*2 Collect the terms in 3i + 5i - 7i - 3i. -2i Collect the terms in 12o + 6o - 32o. -14o Collect the terms in 6q3 + 7q*3 - 34q*3. -21q*3 Collect the terms in -4i3 - i3 - 12i3. -17i*3 Collect the terms in -5x - 185 + 185 + x. -4x Collect the terms in -247l*2 + 0l + 0l - 84l*2. -331l*2 Collect the terms in -6y - 86y2 + 6y. -86y2 Collect the terms in 20 - 20 + 4y. 4y Collect the terms in 68o - 6 + 6. 68o Collect the terms in -8r*2 - 16r*2 + 25r2. r2 Collect the terms in 198 - 198 - i3. -i3 Collect the terms in 6l + l - 3l - 1. 4l - 1 Collect the terms in -2m - m - 2m + 2m. -3m Collect the terms in 68920q*2 - 68920q*2 + 8q*3 - 6q. 8q3 - 6q Collect the terms in k - 831 + 415 + 416. k Collect the terms in -5j + 2j + 15j. 12j Collect the terms in 3l2 - 5l2 - l2 - 32l. -3l*2 - 32l Collect the terms in 70l - 29l*2 - 70l. -29l2 Collect the terms in 2g + 54g3 - 5g + 0g + g. 54g*3 - 2g Collect the terms in -13l - 20l - 13l + 29l. -17l Collect the terms in -3 + 10 + 16b*3 - 7 - 12b*3. 4b*3 Collect the terms in m - 33 - 3m + m + 47. -m + 14 Collect the terms in -244 + 125 + l + 127. l + 8 Collect the terms in -18r3 + 27 - 27. -18r*3 Collect the terms in 0 + 18i*2 + 0 - 14i*2. 4i*2 Collect the terms in -102x*2 + 102x*2 + 33x*3 - 5x*3. 28x*3 Collect the terms in -15m*2 - 21m*2 + 35m2. -m2 Collect the terms in -37y2 + 23y*2 + 18y*2. 4y*2 Collect the terms in -48637o + 48637o - 95o*3. -95o*3 Collect the terms in 20y*3 - 50y*3 + 65y*3. 35y*3 Collect the terms in -19 + 13r + 19. 13r Collect the terms in 11u*3 - 8 + 8. 11u*3 Collect the terms in 232 - 139 - 3o - 93. -3o Collect the terms in -43d + 34d + 28d. 19d Collect the terms in 1 + 15o*3 - 10o*3 + 0 - 1. 5o*3 Collect the terms in -3d + d + 2d - 2d*2. -2d*2 Collect the terms in -22q*2 + 0q*2 + 4q*2. -18q*2 Collect the terms in 13g - 3 + 3 + 0. 13g Collect the terms in -132i*3 - 266i*3 - 533i*3. -931i*3 Collect the terms in 0q*2 + 4q*2 - 6q*2 - 90q*3. -90q*3 - 2q*2 Collect the terms in -1 + 1 + 4w + 14w. 18w Collect the terms in 5 + 9 + 237h3 - 14. 237h*3 Collect the terms in -66n*2 + 41n*2 + 36n*2. 11n*2 Collect the terms in -29o*3 + 83o*3 + 22o*3. 76o*3 Collect the terms in -28p*3 + 54p*3 - 24p*3. 2p*3 Collect the terms in 3r2 + 62139 - r2 - 62139. 2r2 Collect the terms in 0l - 679l2 + 0l. -679l2 Collect the terms in 42v*3 - 32v*3 - 9v3. v3 Collect the terms in -1 + 0 - 300c3 - 15c*3. -315c*3 - 1 Collect the terms in 2u*2 - 5u*2 - 2u*2 + 4u2. -u2 Collect the terms in -33s - 7s + 10s. -30s Collect the terms in 2w2 - 4w - 2w + 4w - 36w2. -34w*2 - 2w Collect the terms in 190k - 93k - 97k + 2k*3. 2k*3 Collect the terms in -15j*2 - 11j*2 + 43j*2 - 18j2. -j2 Collect the terms in -4w3 + 6w*3 - 3w*3 - 4w*3 + 5w. -5w3 + 5w Collect the terms in -13537o2 + 13537o*2 - 5o*3. -5o*3 Collect the terms in 1 + 10 + b + 3. b + 14 Collect the terms in -8j + 12j - 10j - 9j. -15j Collect the terms in 2 + 16t - 2. 16t Collect the terms in j - 44 + 48 - 26. j - 22 Collect the terms in 383o3 - 733o + 733o. 383o*3 Collect the terms in 11246o + 7o2 - 11246o. 7o2 Collect the terms in 4n2 + n2 - 9 - 5n2 + 3n*3. 3n*3 - 9 Collect the terms in -102 + 0b2 + 102 + b2. b*2 Collect the terms in -3075m*2 + 3075m*2 - 7m*3. -7m*3 Collect the terms in -3m*2 + 5m*2 + 4m*2 - 3m*2. 3m*2 Collect the terms in 3 + 3 - 6 + 2 - 214t. -214t + 2 Collect the terms in -3z2 + z2 + 0z - 3z + 3z. -2z*2 Collect the terms in 3k*3 + 4k*3 - 4 + 4. 7k*3 Collect the terms in -109z + 144z - 70z. -35z Collect the terms in 5405 - 5405 + 4a. 4a Collect the terms in -580w*3 + 299w*3 + 284w*3. 3w*3 Collect the terms in -19l*2 + 9l*2 + 15l*2. 5l*2 Collect the terms in 832h*3 + 838h*3 - 1681h*3. -11h*3 Collect the terms in 9 + 13 + 2 - 6 - 3t. -3t + 18 Collect the terms in 1068h - 6663h - 217h. -5812h Collect the terms in 26h*2 + 33h*2 - 19h*2. 40h*2 Collect the terms in -y - y - 3y + 3y. -2y Collect the terms in 691 - 3u2 - 691 - u2. -4u*2 Collect the terms in 36z - 9z - 22z. 5z Collect the terms in -48o + 39o + 7o. -2o Collect the terms in -46p*3 + 10p*3 - 10p*3. -46p*3 Collect the terms in -26q - 2 - 15q - 10q. -51q - 2 Collect the terms in 2g*3 - 3g*3 - 5g*3 + 3g*3. -3g*3 Collect the terms in -121a*2 + 37a*2 + 36a*2 + 41a*2. -7a*2 Collect the terms in 2 - 37h - 5 + 3. -37h Collect the terms in -590j*2 - 294j*2 - 65j*2. -949j*2 Collect the terms in -14g - 7g + 4g. -17g Collect the terms in 11g*3 + 5g*3 - 93g*3. -77g*3 Collect the terms in 50i*2 + 5i*2 + 31i*2. 86i*2 Collect the terms in 9t*2 + 1 + 12t*3 - 4 - 9t*2. 12t*3 - 3 Collect the terms in 22g*2 - 2g*2 + 6g*2. 26g*2 Collect the terms in -8o*2 - 16o*2 + 33o*2 - 15o*2. -6o*2 Collect the terms in 7b*3 - 5b*3 + 0b - 15b + 15b. 2b3 Collect the terms in -18l*2 + 18l*2 - 4l*3. -4l*3 Collect the terms in -5 + 5q - 4q + q. 2q - 5 Collect the terms in k - 4k - k + 5k. k Collect the terms in 24 - 623z2 - 24. -623z*2 Collect the terms in 14f*3 + 4f*2 + 84 - 4f*2 - 82. 14f*3 + 2 Collect the terms in -452m*2 + 220m*2 + 221m*2. -11m*2 Collect the terms in -4 - p + 27 + 107 + 72. -p + 202 Collect the terms in 513 - 513 - 3x. -3x Collect the terms in 0 + 6s*3 + 6 + 0. 6s*3 + 6 Collect the terms in -o - 40o*3 + 2530 - 2530. -40o*3 - o Collect the terms in -7 + 17i + 2 + 5 - 18i. -i Collect the terms in -2r*2 - 3372r + 3372r. -2r*2 Collect the terms in -21a*2 + 10a*2 + 14a*2. 3a*2 Collect the terms in 7l*2 + 5l*2 + 2l*2 + 2l*2. 16l*2 Collect the terms in -2w + 2w - 4w + w. -3w Collect the terms in 2 - 2 - 36c*2 + 58c*2. 22c*2 Collect the terms in -360i*2 + 96 - 96. -360i*2 Collect the terms in -116b + 240b - 123b. b Collect the terms in 0 - 24x3 - 2x*3 + 0. -26x*3 Collect the terms in 2f - 11 - 4f + 14. -2f + 3 Collect the terms in 4t - 3t - 3 + 2 - 1. t - 2 Collect the terms in -32k2 + 16k*2 + 0k + 0k + 19k*2. 3k*2 Collect the terms in 58h*2 + 274 - 274. 58h*2 Collect the terms in -2r + 4080 - 4080 - 2r. -4r Col	{ "pile_set_name": "DM Mathematics" }
Find the common denominator of -1/576580 and -91/9988. 6342380 Find the common denominator of 107/211500 and -179/33300. 7825500 What is the common denominator of 13/23064 and -85/1418064? 43959984 Calculate the common denominator of 49/355788 and -65/4244. 377491068 What is the least common multiple of 14196375 and 2839275? 14196375 Find the common denominator of 67/12354 and -6/51901. 9030774 Calculate the smallest common multiple of 700 and 407960. 2039800 What is the common denominator of -6/17961463 and 16/39? 53884389 Find the common denominator of 41/1060296 and 123/3534320. 10602960 What is the smallest common multiple of 34479600 and 283200? 137918400 Find the common denominator of 191/660 and -139/10815310. 64891860 Find the common denominator of 91/276 and 11/17983608. 17983608 What is the least common multiple of 8938 and 182214537? 364429074 What is the smallest common multiple of 81077836 and 60808377? 243233508 Calculate the least common multiple of 597636 and 14047. 6573996 Calculate the common denominator of -4/4260117 and -46/267. 379150413 Calculate the smallest common multiple of 9808 and 32800. 20106400 Calculate the smallest common multiple of 151565400 and 1317960. 151565400 What is the common denominator of -22/10888265 and 29/65? 141547445 Find the common denominator of -23/6010 and -103/10085982. 50429910 What is the smallest common multiple of 78796472 and 39656? 78796472 Calculate the lowest common multiple of 1106 and 1684956. 133111524 What is the smallest common multiple of 125 and 20493? 2561625 Calculate the common denominator of -13/20660102 and -61/216931071. 433862142 What is the common denominator of 113/14022 and -1/10709692? 96387228 Calculate the least common multiple of 1830 and 40366445. 242198670 What is the lowest common multiple of 52380 and 87471? 509081220 Find the common denominator of -35/1804 and -103/11064752. 121712272 Calculate the lowest common multiple of 90 and 9884210. 88957890 Find the common denominator of -139/102 and -125/3064926. 52103742 What is the least common multiple of 167652 and 36? 167652 Calculate the smallest common multiple of 6413508 and 20. 32067540 Calculate the lowest common multiple of 68040 and 51030. 204120 What is the lowest common multiple of 10690487 and 262? 2800907594 Calculate the common denominator of -76/17325 and -149/26466. 13894650 Calculate the common denominator of 37/4486 and -5/16992968. 16992968 Find the common denominator of 79/1253786 and -97/166. 104064238 Calculate the smallest common multiple of 637686 and 4788. 24232068 What is the smallest common multiple of 3340440 and 5040? 46766160 What is the smallest common multiple of 454360 and 185? 454360 What is the common denominator of 23/1381974 and -31/44? 2763948 Calculate the lowest common multiple of 57605382 and 9600897. 57605382 What is the common denominator of -9/48662 and -81/1120? 27250720 Calculate the common denominator of -13/228088 and 5/182. 2965144 Find the common denominator of 35/6 and 5/7877986. 23633958 Calculate the least common multiple of 107124 and 156. 1392612 Calculate the least common multiple of 54142542 and 495. 2977839810 What is the common denominator of 59/11484 and -127/206316? 5983164 What is the common denominator of 137/16423170 and -107/645855? 114962190 Find the common denominator of 157/588563076 and 99/4. 588563076 What is the common denominator of -19/17299689 and 163/66? 34599378 Calculate the common denominator of 11/20195728 and 43/1527408. 181761552 Find the common denominator of -89/354456 and -103/402840. 661060440 What is the smallest common multiple of 931 and 32358767? 32358767 Find the common denominator of 131/5562732 and 45/2251582. 94566444 Calculate the common denominator of 67/19348 and -31/1293552. 9054864 Calculate the lowest common multiple of 8381541 and 367590441. 2573133087 What is the lowest common multiple of 939000 and 375? 939000 Calculate the lowest common multiple of 20 and 290752082. 2907520820 What is the least common multiple of 89624 and 2799? 250857576 Calculate the lowest common multiple of 300 and 607860. 3039300 Calculate the common denominator of 93/6881920 and -59/161295. 20645760 What is the common denominator of 157/1260168 and -131/3640? 6300840 Find the common denominator of -83/6 and -43/51772506. 51772506 Find the common denominator of -4/1172607 and 29/126. 49249494 What is the common denominator of 55/1602042 and 139/1591554? 972439494 Calculate the common denominator of 81/9703250 and 34/892625. 1872727250 What is the lowest common multiple of 3989350 and 4197490? 482711350 Calculate the least common multiple of 605 and 3465. 38115 Calculate the lowest common multiple of 4 and 14903718. 29807436 Calculate the lowest common multiple of 636 and 121964130. 243928260 Calculate the least common multiple of 16627632 and 2375376. 16627632 Calculate the smallest common multiple of 1094269 and 3600498. 111615438 Calculate the smallest common multiple of 96294 and 3212. 14058924 What is the least common multiple of 41117058 and 6? 41117058 Calculate the least common multiple of 39 and 2420652. 2420652 What is the least common multiple of 18259 and 39824? 38270864 What is the least common multiple of 232812388 and 14512? 931249552 What is the common denominator of -83/13365 and 17/7506675? 22520025 Calculate the least common multiple of 129024 and 384. 129024 What is the common denominator of 97/168 and -19/39074700? 78149400 Calculate the common denominator of -18/60082217 and -35/1653639. 180246651 Find the common denominator of -187/4860 and 139/21020310. 126121860 What is the smallest common multiple of 42 and 180490590? 180490590 What is the lowest common multiple of 16574565 and 7095? 182320215 Calculate the smallest common multiple of 1150296 and 28056. 1150296 Calculate the smallest common multiple of 14 and 47787772. 334514404 Calculate the smallest common multiple of 395925 and 25180830. 125904150 Calculate the common denominator of -23/483888438 and -81/14. 3387219066 What is the common denominator of 83/30708 and 41/483156? 412132068 Calculate the lowest common multiple of 76 and 20096452. 20096452 Calculate the smallest common multiple of 1025982 and 688. 352937808 Calculate the common denominator of -17/8328 and 29/99144. 34402968 What is the lowest common multiple of 53802 and 457632? 195408864 Calculate the common denominator of -19/84415 and -30/725969. 3629845 Find the common denominator of -89/3473940 and -53/444. 128535780 What is the lowest common multiple of 1954925 and 275? 21504175 What is the common denominator of -85/9013928 and -9/409724? 9013928 Calculate the least common multiple of 290 and 2734236. 13671180 Calculate the smallest common multiple of 6308 and 3648. 302784 Calculate the least common multiple of 1010210 and 28. 14142940 Calculate the smallest common multiple of 37528412 and 18764206. 37528412 What is the common denominator of 12/3723569 and 33/2? 7447138 Calculate the smallest common multiple of 164968 and 259080. 314264040 What is the lowest common multiple of 366465 and 99? 1099395 Calculate the common denominator of 67/10 and 113/2082620. 2082620 Calculate the lowest common multiple of 837866 and 1675732. 1675732 What is the common denominator of 47/1634432 and -109/98883136? 197766272 What is the lowest common multiple of 2148045 and 690? 98810070 What is the common denominator of 95/168 and -167/494088? 494088 Calculate the smallest common multiple of 787116124 and 6. 2361348372 Calculate the lowest common multiple of 33771722 and 7915. 168858610 What is the smallest common multiple of 388008 and 936? 5044104 What is the lowest common multiple of 3305246 and 15167? 1728643658 Calculate the common denominator of -53/28 and -119/8056620. 56396340 What is the smallest common multiple of 4854546 and 19777780? 534000060 Find the common denominator of 109/18 and -101/7375226. 66377034 Calculate the common denominator of -119/1620 and 143/143570. 23258340 Find the common denominator of -44/7385 and 20/749. 790195 Calculate the common denominator of -31/285783 and 16/5239355. 15718065 What is the smallest common multiple of 107760 and 588960? 264443040 What is the least common	{ "pile_set_name": "DM Mathematics" }
b Suppose -25 = -x - 34. Let u be (-12)/x6/(-20). Let q = 21.061 - 0.061. Which is the closest to u? (a) q (b) 0.3 (c) 4 b Let n = -226.97 + 227.17. Which is the closest to 0.03? (a) -128 (b) n (c) 5 b Let h = 13663 - 13658. Which is the nearest to -2? (a) 1 (b) 414 (c) 2/3 (d) h c Let z be ((-42)/15)/7 - 309/(-310). Let v = 3/31 - z. Let j = -0.07 + -4.93. Which is the closest to -0.1? (a) j (b) v (c) -2/11 c Let u = 0.14 + -1.74. Suppose -f + 9j + 31 = 5j, -f - 3j = 32. Which is the nearest to -0.1? (a) f (b) u (c) 2/11 c Let n = 3999 + -4003. Which is the nearest to -0.052? (a) 4/3 (b) -2/5 (c) 0.2 (d) n c Let z = 0.03624 - -0.36376. Which is the nearest to 0.172? (a) 4 (b) 5 (c) z (d) -0.2 c Let j = 36 + -16. Let b = -148 + 167.6. Let l = j - b. What is the closest to 1 in 4, -15, l? l Let p = -16 + 15.5. Let l = 5.5 + p. Let g = 5.3 - l. Which is the closest to 2/5? (a) 2 (b) g (c) 3/5 b Let o be 2/(-4) + 329/70 - 4. Let j be 392/608 - (-2)/19. What is the nearest to -1 in -1.6, o, j? -1.6 Let h(m) = -m*2 + 32m - 155. Let k be h(26). Let d = 9 + -55/6. What is the closest to k in d, -2/11, -5? d Let h(f) = -131f - 10. Let r be h(-2). Let z be -1 - (r/(-570))/((-8)/(-20)). Let g be -2 + (-5)/((-45)/24). What is the closest to g in z, -0.5, 0? z Let x(p) = -18p - 107. Let w be x(-6). Which is the nearest to w? (a) 10/3 (b) 3 (c) -25 (d) 2 d Let q = 2791 - 2790.6. Which is the nearest to 2/5? (a) q (b) -21/4 (c) 1/3 a Let c be 10/256/4. Let h be (-2)/6 - (-53)/667814. What is the closest to h in -0.5, c, 2/23? -0.5 Let s = 278 - 287. Let d be s - 2232/(-48). What is the closest to d in -3/2, -1, -2, -4? -1 Let y = -2.585 - -2.475. Which is the nearest to y? (a) 5 (b) -2 (c) 6 b Let i = 2616 + -2616. What is the closest to 0.1 in i, -3, 1/3, -126? i Let p(h) = 5 + 6h - 2 - 2 - 5h. Let r be p(-3). Let j be r/(-11) - 133/308. Which is the nearest to 1? (a) 0.3 (b) j (c) -2/5 a Let f = 1/54 - 77/1242. Suppose 0 = 87z + 77 + 10. What is the closest to -0.1 in f, z, 1? f Let h = 508 + -512. Let y = -32.2 - -32. What is the nearest to 1 in h, y, 18? y Let f = 4020.03 + -3989. Let r = f - 31. Let t = r + 1.97. Which is the closest to -3? (a) -1 (b) t (c) 5 a Let l = -4/3899 - -11705/7798. Which is the closest to 1662/11? (a) l (b) -0.2 (c) -0.3 a Let n = -20 - -104/5. What is the closest to -3/2 in -9, n, 1? n Let q = -3200 + 67198/21. Suppose 3u = 6u. Let h = -0.1 - 0. Which is the nearest to h? (a) u (b) q (c) 4 b Let u = 2794.8 - 2795. Which is the closest to -3? (a) u (b) 1/3 (c) -2/7 (d) 6 c Let t = 11 - -2. Let l = -9 + t. Let s = -1.681 + -1.319. What is the closest to s in 0, -1, l? -1 Let w be (-50)/60 - 3(-6)/(-27). Let q = 16 + -14.4. Let p = q + -1.7. Which is the nearest to p? (a) w (b) 0.2 (c) 0.5 b Let h = 149.6 - 136. Let j = h + -9.6. Let n = -130.1 + 130. Which is the closest to n? (a) 5 (b) -1 (c) j b Let l = 15074 - 15074. What is the nearest to -0.1 in l, 0.0356, -2/7? l Let r = 226/69 - 6416/2001. Let d = -6 - -6.4. Which is the closest to -1? (a) -0.09 (b) r (c) d a Let x = 27954/5 + -5603. Which is the nearest to 0? (a) -2/7 (b) 1/2 (c) x (d) 2 a Let k be (-4 - 108/(-28)) + 129/(-28). Which is the nearest to k? (a) 0.2 (b) 2 (c) 15 (d) 2/3 a Let o = -67 + 67.4. Let x = 231/458 - 1/229. Let k = 0.42 - -0.08. What is the nearest to x in o, 8, k? k Let g be 39/(-12) + (-2)/(-8). Let f(h) = -h2 + 229h - 12575. Let d be f(138). What is the nearest to d in g, 0.3, 0.1? g Let o(u) = 194u + 3472. Let f be o(-18). What is the closest to 0.098 in 1/2, -1/10, f? -1/10 Let g = -1.865 + 1.365. Let p = 4/13 + 5/26. What is the closest to -0.3 in p, g, -5? g Let t = -2686 - -40292/15. Let i = 8 + -7.7. Let d = -0.03 + 4.03. Which is the closest to -9? (a) i (b) t (c) d b Suppose -5o + 4o = -4o + o. Which is the nearest to 0.7? (a) o (b) -0.14 (c) 2/5 c Let q = -25568 - -25575. Which is the nearest to 0.07? (a) 5 (b) -3/4 (c) q (d) -4 b Suppose 8k - 2n - 666 = 6k, -3n + 1360 = 4k. Let z = 338 - k. Let y be (-12)/(-9)2/(-8). Which is the closest to z? (a) 0.3 (b) y (c) 0 a Let r(n) = -7n + 73. Let z be r(10). Suppose 5f = -2w + 2 + 6, 4f = 5w + 13. What is the nearest to -1 in 2/7, z, f? 2/7 Let m be -4 + 6 - 6/8. Let o = 0 - 2. Let b be ((2/14)/(11/22))/(-1). What is the nearest to o in -1/9, m, b? b Suppose -5g = -2g. Let k = -5 + g. Suppose 0 = -24x + 60x + 144. Which is the nearest to 2/5? (a) 6 (b) x (c) k b Let r = 3157.79 + -3156.9. Which is the closest to r? (a) 10 (b) 0.3 (c) 2/7 b Suppose i + 110 = -10i + 154. Suppose 12 = 2r + 2r + 4f, -5r + 27 = -f. Suppose 1 = rl - 4. Which is the closest to -1? (a) i (b) -0.5 (c) l b Let y = -923 + 922.9. Which is the closest to 1/4? (a) 5 (b) -93 (c) y c Let t = 18446.5 + -18446. Which is the nearest to -2? (a) 0 (b) t (c) 3/14 (d) 0.03 a Let d = 4199/5 + -17811/20. Let j = 51 + d. Let m = 2.015 - 0.015. What is the nearest to 0.1 in m, 3/2, j? j Let x be -1 - ((2 - -1) + (-1050)/280). Let c = 1 - -1. Let v = -0.3 + 0.7. What is the nearest to c in v, x, 5? v Let d = -3850 - -30797/8. What is the nearest to 0.2 in 1/3, -5/3, d, 4? 1/3 Let u = 715 - 715. Let f = 235 + -275. Which is the nearest to u? (a) 0.5 (b) 2/9 (c) 0.1 (d) f c Let g = -86 + 36. Let o be (-15)/g + 10/100. Which is the closest to -1/2? (a) 2 (b) o (c) -9 b Let u be 2 - ((-871)/(-165) + -4). Let l = -3/55 + u. Let z = 0 - -4. Which is the nearest to -0.1? (a) 0.1 (b) z (c) l a Let l be (-2 + (-13)/(-6))2. Let x be (2/4)/((-3)/24). Let f = -105.1 - -105. Which is the nearest to l? (a) f (b) x (c) 1/5 c Let m = 119 - 107. Let i be 9/(126/8)(-21)/(-30). Let l = 0 + 0.2. Which is the closest to i? (a) l (b) m (c) -3 a Let a = -17 - -17.14. Let h = -5597/11082 + 28/5541. What is the closest to -1 in h, 2/15, a? h Let l = 34.71 + -34.81. What is the closest to l in -6/13, 4, 1/2? -6/13 Let v = 148 - 147. Let m = -138 + 413/3. Which is the nearest to 0.2? (a) m (b) v (c) 0.8 a Let u = 3.3576 - 0.3576. What is the nearest to 0.3 in -94, u, 1/3, 0? 1/3 Let n = -0.8336 + 2.8336. Which is the nearest to 2/5? (a) 6/5 (b) n (c) -3 a Let n = -15462 + 15457. What is the closest to 33 in -3, -2/9, n, -1/3? -2/9 Let v = 2567 - 2565. What is the closest to v in 2, -5, -2, -3.4? 2 Let o be 0 - 5/(-4) - (-1443)/(-1036). What is the closest to o in -2/17, -1/7, -0.5? -1/7 Let t = 19492 - 19493. Which is the nearest to t? (a) 1/9 (b) -2 (c) 6 (d) 0.4 b Let f = -0.24 - -0.04. Let z = 5.347 + -5.247. Which is the nearest to z? (a) f (b) 0 (c) -2/9 b Let m = 19 + -32. Let s = -8 - -4. Let y = -69/19 - -659/171. Which is the nearest to y? (a) m (b) s (c) -0.1 c Let s = -0.1873 + 50.1873. Which is the nearest to 0.2? (a) 2 (b) 0 (c) s b Let r be 60/(-21) - -2 - (-13832)/19110. Which is the nearest to 3? (a) r (b) 0.5 (c) 5 (d) 2/5 c Let f = 8632 + -8636. Which is the nearest to 28? (a) -0.4 (b) 0.3 (c) f (d) 4 d Let l = 208/7 + -2274/77. Let i be (6/(-4))/1 - -1. Which is the closest to i? (a) l (b) -3 (c) -1/5 c Let g = -0.03 - -0.06. Let h = 27/1364 - -2485/12276. Which is the nearest to -1? (a) h (b) g (c) 3 b Suppose 0 = -3m + 2o + 70, 2m + 7 = -2o + 67. Suppose 0 = i + 136 - 133, -5i = -d + 13. Which is the closest to -0.1? (a) d (b) -4/3 (c) m b Let c be (-1)/2 - 45/(-130). Let o = 0.1 + -0.2. Let m = 0.4477 + -0.4477. What is the nearest to m in c, -5/3, o? o Let z = -3443 - -3439. What is the closest to 0 in 5, z, 0.5, 0.01? 0.01 Let i = -469.1 - -469.1. What is the closest to -1 in i, -0.2, -34? -0.2 Let f(g) = g*3 + 10g*2 - 25g - 17. Let t be f(-12). Let v be (145/(-30) - t) + (-26)/48. Let y = 8.3 - 8. What is the nearest to -0.01 in y, -5, v? y Let w = -3.3 + 0.3. Let r = -9006 + 9005.6. Let i(d) = -d*3 - 6d*2 - 5d - 2. Let h be i(-5). What is the nearest to 0.2 in h, w, r? r Let s = -4 + 1. Let m = 1 - s. Suppose 2j - 8 = 0, 4n - 4j = n - 25. Which is the nearest to 1? (a) 3 (b) m (c) n a Let k = 50.9 - 51. Let i = -2.9778 + -0.0222. What is the nearest to k in i, 5, 0.5? 0.5 Let p(f) = f3 - 5f**2 + f + 5. Let b be p(3	{ "pile_set_name": "DM Mathematics" }
= f*3 - 2f*2 - 4f - 1. Give s(3). -4 Let r(h) = h*3 - 17h*2 + 32h - 18. What is r(15)? 12 Let c(t) = t*3 - 9t*2 - 12t + 8. Calculate c(10). -12 Let n(d) = -11d2. Calculate n(-1). -11 Let m(c) = c2 + 20c + 105. Give m(-13). 14 Let l(x) = x*2 - 14x + 36. Give l(11). 3 Let v(x) = x*3 - 15x*2 - 17x + 28. Give v(16). 12 Let s(m) = m*2 - 13m + 13. Give s(16). 61 Let k(g) = 3g2 - 43g - 21. What is k(15)? 9 Let u(w) = w*2 + 2w - 3. Give u(-2). -3 Let o(y) = y*2 - 11y - 1. Calculate o(12). 11 Let m(q) = 3q2 + 8q + 16. Calculate m(-3). 19 Let r(n) = n*3 - 7n*2 + 7n - 10. Calculate r(5). -25 Let v(n) = n + 4. What is v(3)? 7 Let u(x) = 2x + 40. Calculate u(-19). 2 Let l(d) = -d + 15. Calculate l(14). 1 Let p(s) = -4s*2 + 2s - 9. Give p(2). -21 Let d(s) = 3s3 - s2 - 7s - 3. Calculate d(-2). -17 Let g(v) = -2v2 + 13v + 27. Calculate g(8). 3 Let d(n) = 8n3 - 6n + 3. Determine d(2). 55 Let b(v) = v - 5. Determine b(3). -2 Let l(z) = -z*3 - 7z*2 - 5z + 8. Calculate l(-6). 2 Let o(b) = b + 2. Give o(4). 6 Let b(p) = -2p3 - 2p - 4. Determine b(3). -64 Let b(w) = -42w + 130. Calculate b(3). 4 Let m(d) = -9d*2 + 63d + 7. Give m(7). 7 Let q(s) = s*3 + 11s*2 - 11s + 13. Give q(-12). 1 Let p(i) = -i + 1. Determine p(-7). 8 Let r(y) = -2y3 - 21y - 21. Determine r(-1). 2 Let p(z) = -31z + 807. Calculate p(26). 1 Let m(k) = -2k*3 - 16k*2 - 28k + 11. What is m(-5)? 1 Let r(y) = -2y - 15. Calculate r(-10). 5 Let d(q) = -q3 - 21q*2 + 17q - 42. What is d(-22)? 68 Let k(x) = x*2 + 7x - 13. What is k(-9)? 5 Let a(l) = l*3 + 6l*2 - 6l + 3. What is a(-7)? -4 Let r(i) = 2i2 - 21i - 23. Calculate r(12). 13 Let r(s) = -5s - 6. Determine r(10). -56 Let f(u) = -2u3 + u2 + 5u + 5. Determine f(-2). 15 Let c(s) = -135s - 681. Calculate c(-5). -6 Let k(b) = 2b2 + 32b - 31. Calculate k(-17). 3 Let c(w) = -2w2 - 23w - 36. Give c(-9). 9 Let x(v) = v - 31. Give x(14). -17 Let c(f) = f*3 - 6f*2 + 13f - 7. Determine c(4). 13 Let j(k) = k*3 - 2k*2 - 6k - 10. Calculate j(4). -2 Let b(a) = 36a3 - a2 - a. Determine b(-1). -36 Let l(z) = -z - 10. Calculate l(-3). -7 Let i(f) = -f3 + 25f*2 - 22f - 43. Calculate i(24). 5 Let q(v) = -6v3 - v - 1. Determine q(-1). 6 Let g(d) = -d2 - 18d + 224. Determine g(-26). 16 Let n(f) = f*3 - 7f*2 + 7f - 22. Determine n(8). 98 Let v(f) = 5f2 + f - 5. Calculate v(-5). 115 Let g(v) = -2v*2 + 19v - 27. Give g(8). -3 Let b(m) = -m*2 - 73m + 228. What is b(3)? 0 Let c(o) = o - 22. Calculate c(19). -3 Let d(p) = 4p2 - 27p + 22. Give d(7). 29 Let h(v) = v2 - v - 2. What is h(0)? -2 Let j(u) = u3 - 7u2 - 2u - 11. Calculate j(8). 37 Let l(k) = -k*2 + 15k - 14. Calculate l(14). 0 Let b(j) = 5j - 44. Give b(10). 6 Let d(f) = 13f*2 + 1. What is d(1)? 14 Let s(q) = -12q - 4. Give s(-2). 20 Let k(p) = 2p2 - 5p + 3. What is k(4)? 15 Let j(g) = -g*3 - 5g*2 + 3g + 2. Give j(-6). 20 Let v(d) = -8d - 18. Determine v(8). -82 Let k(g) = -3g - 25. Give k(-9). 2 Let g(t) = -2t3 - 8t*2 + 12t. Calculate g(-5). -10 Let m(p) = -p*3 + 3p*2 + 5p - 5. What is m(2)? 9 Let w(i) = 20i3 + 2i*2 - 1. Give w(-1). -19 Let w(n) = -4n - 37. Calculate w(-16). 27 Let m(l) = l*2 - 36l - 15. Give m(26). -275 Let u(q) = -q*3 - 36q*2 + 40q + 110. Determine u(-37). -1 Let r(c) = 3c. What is r(-2)? -6 Let s(v) = 3v*2 - 25v - 14. Calculate s(9). 4 Let a(b) = -5b - 103. Calculate a(-37). 82 Let u(v) = -24v3 - v2 + v. Give u(1). -24 Let v(m) = -2m2 - 5m + 8. Calculate v(-5). -17 Let f(c) = c*2 - 9c - 11. Calculate f(10). -1 Let k(j) = -2j2 + 9j + 3. Calculate k(5). -2 Let u(r) = r3 + r2 + 2r - 1. Calculate u(-4). -57 Let k(r) = -r3 + 13r*2 - 12r + 4. What is k(12)? 4 Let p(w) = -w*2 + 2w + 2. What is p(-8)? -78 Let z(f) = -f3 + f2 + 31f - 2. Give z(-5). -7 Let j(m) = 2m - 30. Determine j(10). -10 Let h(b) = -b*2 - 9b - 7. Determine h(-5). 13 Let a(r) = -2r - 12. Determine a(-7). 2 Let q(t) = -6t*2 + 4t. Determine q(3). -42 Let r(h) = -2h2 + 12h. Give r(5). 10 Let f(n) = -3n - 35. Calculate f(-8). -11 Let m(y) = -y2 - 6y + 16. Give m(-8). 0 Let b(l) = -2l - 33. What is b(-11)? -11 Let w(q) = -11q - 2. Give w(2). -24 Let w(i) = -i*3 + 8i*2 + 9i. Give w(9). 0 Let f(l) = -l*3 - 9l*2 + 8l + 30. Calculate f(-10). 50 Let p(i) = -i*3 + 7i*2 + i + 7. What is p(8)? -49 Let r(q) = -5q*2 + q. Determine r(2). -18 Let b(x) = 22x - 160. Give b(7). -6 Let c(t) = -t*2 - 11t - 5. What is c(-11)? -5 Let j(h) = -2h - 3. What is j(6)? -15 Let k(y) = -7y*2 - 19y - 26. Calculate k(-2). -16 Let v(i) = -17i + 6. Give v(-3). 57 Let h(z) = -z3 - 9z*2 - 7z - 18. What is h(-8)? -26 Let u(h) = 6h + 19. Calculate u(-16). -77 Let u(n) = -n - 5. Determine u(4). -9 Let t(n) = n3 + 16n*2 - 2n - 23. Determine t(-16). 9 Let u(b) = 7b3 + 2. Give u(-2). -54 Let w(i) = 2i*2 + 54i - 54. What is w(-28)? 2 Let q(s) = -2s2 + 18s - 15. Calculate q(9). -15 Let w(a) = a*3 + 11a2 - 10. Calculate w(-11). -10 Let w(j) = -j3 - 7j2 - 1. Give w(-5). -51 Let z(u) = u3 + 3u*2 + 6u + 16. Calculate z(-5). -64 Let d(t) = -t*3 + 3t*2 - 4t - 4. Determine d(5). -74 Let r(l) = -l3 - l2 + 2l + 26. Determine r(0). 26 Let k(b) = 21b - 81. Calculate k(6). 45 Let s(g) = 13g + 333. Give s(-26). -5 Let t(u) = 18u - 2. Calculate t(2). 34 Let z(p) = -4p - 4. Give z(5). -24 Let a(q) = -2q*3 - 34q2 + q + 9. Give a(-17). -8 Let d(j) = -j2 - j - 7. Calculate d(-10). -97 Let j(m) = m*2 + 27m - 49. Calculate j(-29). 9 Let m(l) = -l*3 - 8l*2 - 8l + 4. Calculate m(-7). 11 Let z(h) = 3h2 + 38h + 59. Determine z(-11). 4 Let z(o) = o*3 + 9o*2 + 7o - 10. Determine z(-8). -2 Let r(y) = -y*3 + 3y*2 + 3y - 5. Give r(4). -9 Let w(r) = -8r - 3. Calculate w(4). -35 Let d(w) = -w3 + 7w*2 - 2w - 23. Determine d(6). 1 Let m(s) = 2s + 9. What is m(-7)? -5 Let j(w) = -6w*2 + 8w - 6. Determine j(4). -70 Let h(v) = 3v2 - 32v - 24. Give h(12). 24 Let h(s) = -11s2 + 25s + 3. Determine h(2). 9 Let h(m) = m*3 + 2m*2 - 7m - 3. What is h(-3)? 9 Let t(r) = -r*3 - 3r*2 + 3r + 1. What is t(-2)? -9 Let y(u) = u*2 + 14u - 33. Determine y(-14). -33 Let t(m) = m + 1. What is t(4)? 5 Let j(b) = -4b3 + 46b*2 - 21b + 11. Calculate j(11). 22 Let t(x) = x*2 + 5x - 24. What is t(-9)? 12 Let s(f) = -11f + 2. Give s(3). -31 Let n(l) = l3 - 4l*2 - 5l + 5. Determine n(5). 5 Let o(g) = -g*2 - 3g - 5. Give o(-2). -3 Let i(l) = l*3 + 8l*2 - 12l - 13. Determine i(-9). 14 Let q(n) = -20n + 15. Determine q(4). -65 Let o(h) = -h3 - h2 + 2h + 1. Give o(-3). 13 Let v(o) = 4o + 5. Calculate v(5). 25 Let v(g) = g2 - 27g + 35. Give v(26). 9 Let c(x) = -x + 5. Determine c(9). -4 Let x(z) = 3z + 55. Determine x(-17). 4 Let b(r) = -28r - 12. What is b(3)? -96 Let n(i) = -4i2 + 33i + 33. What is n(9)? 6 Let o(p) = p - 6. What is o(-8)? -14 Let r(o) = o2 - o - 6. Determine r(-3). 6 Let q(u) = -u3 - 14u2 + 17u + 21. Calculate q(-15). -9 Let s(f) = -4f + 111. Determine s(35). -29 Let x(v) = v2 + 7v + 20. Give x(-4). 8 Let r(c) = -2c - 19. Determine r(-13). 7 Let f(k) = -3k - 3. Determine f(6). -21 Let g(n) = -19n - 124. What is g(-9)? 47 Let i(p) = -14p*3 - 4p*2 + 7p - 2. Give i(1). -13 Let z(c) = -c*2 + 2c. Determine z(-2). -8 Let v(o) = -o*2 + 6o - 1. Determine v(7). -8 Let g(f) = -2f3 + 2f*2 - 2f. What is g(2)? -12 Let j(o) = -10o + 21. Calculate j(3). -9 Let k(c) = 6c + 36. Give k(-11). -30 Let j(t) = -t*2 - 9t - 6. Calculate j(-9). -6 Let j(u) = 2u2 - 4u + 9. What is j(3)? 15 Let s(k) = k3 + k + 8. Determine s(0). 8 Let y(t) = -t2 - 13t - 37. Determine y(-10). -7 Let v(c) = -c3 + 4c + 3. Give v(-2). 3 Let z(r) = -155r - 924. Determine z(-6). 6 Let u(y) = 9y - 44. What is u(2)? -26 Let h(c) = -c*3 - 4c2 - 7. What is h(-4)? -7 Let y(j) = -j3 - 7j2 - 9j - 15. Determine y(-6). 3 Let f(u) = -4u2 - 8u + 1. Calculate f(-3). -11 Let r(b) = -76b - 303. Give r(-4). 1 Let v(c) = c2 - 4c - 5. What is v(-5)? 40 Let z(v) = v*2 + 7v - 8. What is z(-9)? 10 Let t(k) = -k*3 - 3k	{ "pile_set_name": "DM Mathematics" }
2 - 1 - (5 + -3). Suppose -4 = -4f + c, -4f - 8 = -6c + 2c. Let h(y) = -35y. Let g(u) = -7u. Let r(i) = fh(i) - 11g(i). What is r(v)? -7 Let j(r) = -2r + 5r*2 + 23r*3 - 22r*3 - r. Determine j(-6). -18 Let s(y) = 2y3 - y2 + y. Let z(n) = -5n3 - 2n*2 + 4n + 6. Let b(g) = -2s(g) - z(g). Determine b(-5). -1 Let u(s) = 2s*2 - 4s. Let t(w) = 2w2 - 5w - 1. Let v(p) = 2t(p) - 3u(p). Calculate v(2). -6 Suppose -19 = -2j - n - 0n, 4j = 3n + 13. Let o(q) = -3q + 0q + 2q - j. Give o(-5). -2 Suppose -4u = -q - 13, 0 = -2q - 9 - 1. Suppose 0 = g + um - 14 - 1, -4m + 45 = 5g. Let k(i) = 1 - 2i + 0 - g + 0i. Calculate k(-4). 4 Let c(b) = b*3 - 2b*2 + 1. Suppose -10g + 12 = -4g. Give c(g). 1 Let k(v) be the second derivative of v5/20 + 2v*4/3 + 4v*3/3 + 9v*2/2 + 16v. Determine k(-7). 2 Let n(x) = -3x - 5. Let z be n(-6). Let w = z - 7. Let m be (-1)/w-3-2. Let c(r) = -4r. Calculate c(m). 4 Let b(c) be the first derivative of -c*2 - 6c + 2. Suppose 2s = -j - 14, -4j - s - 6 = -3s. What is b(j)? 2 Suppose 3 = x - 0. Let j = 3 - -1. Let l(t) = 5 + x - t - j. Determine l(0). 4 Let p(y) be the third derivative of -y7/420 + y5/120 + y4/24 - y3/2 + 2y*2. Let t(h) be the first derivative of p(h). Give t(-1). 2 Let y(g) = 10g*2 - 7g - 7. Let t(s) = -s*2 + s + 1. Let u(q) = -14t(q) - 2y(q). Suppose 61 = 5j + 66. Calculate u(j). -6 Suppose 3n + 1 = 5g - 14, -3n - 3g - 15 = 0. Let x(p) be the first derivative of -1 + 5p + 1/2p*2. Calculate x(n). 0 Suppose 0 = -2d - 6d + 3d. Let f(w) = w + 25. Give f(d). 25 Let p(u) = -u*2 - 8u + 2. Suppose -45h + 40 = -50h. Calculate p(h). 2 Let y(g) = -g - 7. Let k be y(-8). Suppose -3h - k = -13. Let c(p) = -p - 2. Determine c(h). -6 Let p(f) be the second derivative of -f5/20 - f4/2 - f3/3 + 3f*2 - 2f. Let z be (-2)/5 - (-69)/(-15). What is p(z)? -9 Let f(d) = d + 8 - 15 - d2 + 2. Calculate f(0). -5 Let m(f) = f2 - 2f + 1. Let j be m(2). Let q(w) be the first derivative of -5 + 3w + j + 3 - w*2. Determine q(3). -3 Let t(c) = -2c*3 - 6c*2 + 3c - 7 + c2 - 5. Let z(s) = -s3 - 3s2 + 2s - 6. Let y(v) = -2t(v) + 5z(v). Suppose 2r - 3r = 6. What is y(r)? 6 Let r(i) = 2i3 - 3i*2 + 2i. Let l(b) = b + 5. Let s = 2 - 5. Let c be l(s). Let d be (2 + -5)/((-3)/c). What is r(d)? 8 Let p(f) = f - 1. Let m be 504/(-48)((-5)/3 - -1). What is p(m)? 6 Suppose -8 - 2 = -2o - h, -4o = h - 18. Let s be (2/o)/((-4)/(-24)). Let d(t) = t2 - t. Give d(s). 6 Let h = -12 - -8. Let u(i) be the first derivative of -2i*3/3 - 5i*2/2 + 3i + 6. Give u(h). -9 Let k(r) = 6r + 4 + 4 - 7r. Calculate k(6). 2 Let m(j) be the first derivative of j*3/3 - 4j*2 + 10j + 21. Determine m(8). 10 Let m be (-30)/(-8) - (-1)/4. Let n(w) = w*2 - 5w + 6. Let s be n(4). Let q(y) = -sy + 8 - y + my. Calculate q(-4). 4 Let j = 3 + -2. Let s(b) = 0b + 0 + 2 - b2 + j + b. Calculate s(3). -3 Let w(g) = g3 + 3g*2 + g + 3. Let b = 8 + -4. Let q(v) = 3v*2 + 6 + 2v - v*3 - 3 - bv. Let a be q(3). Determine w(a). 0 Suppose 0 = -5k - n - 55, -5k - n - 45 = -k. Let w be 2/k + 305/25. Suppose -4z = w + 4. Let d(u) = -u - 2. Calculate d(z). 2 Let f(c) = -c3 - 4c*2 + 4c + 2. Let n be (-11 - -1)2/5. Calculate f(n). -14 Let l be ((-4)/10)/((-5)/25). Suppose 0 = 2p - 3n - 34, -2n + 4n - 64 = -3p. Suppose lq - p = 7q. Let h(k) = -k - 2. Determine h(q). 2 Suppose 5d + 3x - 5 + 4 = 0, 2d - 4x - 16 = 0. Let i(l) = -5l2 + 4l*2 - 3l + 2ld - 2. Determine i(5). 8 Let x(l) = 4l. Suppose 0 = -3v - 5 - 13. Let p = v - -6. Suppose p = -5m + m + 4. Calculate x(m). 4 Suppose m + m = 10. Let q(o) = o*3 - 5o*2 - 3o + 7. What is q(m)? -8 Suppose 5k = -10, 2m - 2k + 11 = 7m. Let h(y) = 5y + m - 1 - 3 - 2. What is h(2)? 7 Let i(o) = -o2 - 6o. Let u = -18 - -14. What is i(u)? 8 Let p(h) be the third derivative of h*5/60 + 5h4/12 + h3/2 - 2h2. Let x be p(-10). Let m(a) = -4a + 2a + 3a - 3a - x. What is m(-4)? 5 Suppose 0 = -5q + 1 - 6. Let r(t) = t*2 - t. Determine r(q). 2 Let y be 1(1/(-1) + 9). Let p = 6 - y. Let s(o) be the second derivative of -o4/12 - o3/6 + o*2 + 5o + 5. Determine s(p). 0 Let c(p) = -2p + 0p + p. Let f be c(-4). Suppose 2b + 2 = 3m + 3, -f = 4b. Let t(q) = -2q2 + 1. Give t(m). -1 Let f(u) = u2 - 1. Let b be f(-1). Suppose 3 = w - bw. Let y(v) = wv + 0 + 0. Calculate y(2). 6 Let g(u) be the third derivative of 0u - 3u*2 - 1/3u*3 + 1/8u4 + 0. Let t be (-1)/((-2)/(-4) - 1). Determine g(t). 4 Let f(x) = -x3 - 4x2 - 2x + 4. Let q be f(-4). Let i(r) = r + 12 - q + 2r. Determine i(3). 9 Let t(c) = -2c + 5 - 6 + 0c + 4c. Let n(g) = g2 + g + 2. Let z be n(0). Give t(z). 3 Let d(s) = -s2 - 2s. Let n(t) = -t2 - 17t + 15. Let a be n(-18). Calculate d(a). -3 Let k(j) = -j*3 - 6j*2 - 5j - 2. Let a be 14/(-2) - 1/1. Let u be a/33/2. Calculate k(u). -14 Suppose -3a - h + 15 = 3h, -a = 3h. Suppose -a = -2f - 0g - g, -4f - g + 17 = 0. Let x(m) = -1 + 1 - 4m + 5. Give x(f). -11 Let b(j) be the third derivative of -j*4/12 + 2j3/3 - j2. Let a be b(3). Let n(i) = 2i2 + 2i + 1. Determine n(a). 5 Let y(w) be the third derivative of 0w + 1/12w6 + 0 - w2 + 0w4 - 1/30w*5 + 1/6w*3. Calculate y(1). 9 Let s(d) = -d + 10d + 0d - 8d. Give s(4). 4 Let l(d) = -d*2 + 4d*2 - d - 4d - 4d2. What is l(-4)? 4 Let l be 21/(3 + -2). Suppose 5r = i, -r + lr - i - 4 = 0. Let q(p) = -2p2 + 1. Give q(r). -1 Suppose g = 1 + 3. Let v(n) = n. Determine v(g). 4 Let d(p) = 3p + 5. Let t be 19 + (0 - (2 - 2)). Suppose 4l = 2o - 20, 0 = 3l + 3o + t - 4. What is d(l)? -10 Let i be 0/3 + 1 - 0. Let j(b) = -7b2 - 2b + 1. Determine j(i). -8 Let i be (1 - (-2 + 4))-3. Let g(j) = 3j2 + ji - 10 - 4j + 10. What is g(-4)? 0 Suppose 0 = -2y + y. Suppose yv - 4v = -24. Let t(i) = -i*2 + 7i - 7. What is t(v)? -1 Let i(n) = 2n2 - n2 + 2 - 2n - 6n2 - n3 + 0n. Calculate i(-2). -6 Let s(x) be the second derivative of -x5/20 + x4/12 + x*3/6 + 3x*2 + 18x. Let a be 0/11/(-2). Calculate s(a). 6 Let a be (-2 + 0)2/(-4). Let w(b) = 3 - 2b3 + 3b - a - 3. What is w(2)? -11 Let q(n) = -4n + 3. Let y(b) = b2 + 3b + 4. Let r be y(0). What is q(r)? -13 Let s(n) be the third derivative of n5/60 - n4/24 + 5n3/6 + 9n2. What is s(4)? 17 Let d(n) = n2 - 5n - 4. Suppose 2o + 0o = 24. Suppose -x + 4j - 6j = -o, -j + 3 = -x. Suppose -18 = -xf - f. What is d(f)? 2 Let h(a) = 4a + 1. Suppose -12r - 9 + 69 = 0. Determine h(r). 21 Let f(l) be the second derivative of -l5/20 + l4/2 - 7l3/6 + 5l2/2 - l. Give f(5). -5 Let m(o) = o3 + 19 - o - 18 + 2o2 - o2. What is m(-3)? -14 Let d(y) = -y2 + 2y + 4. Let m be d(3). Let q(s) = -m - 2s2 + 0s*2 - 4s2. Give q(-1). -7 Let d(f) = f3 + 7f2 - 2f - 2. Let y(h) = -2h3 - 14h*2 + 3h + 5. Let t(w) = -13d(w) - 6y(w). Determine t(-8). -4 Let z(f) = 5f - 6f*2 - 6f*2 + f + 11f*2 + 2. Calculate z(5). 7 Let x(c) = 6c3 + c2 + c. Suppose -4n + 43 = -h, 4h = -4 - 8. Suppose y - n = -11. Give x(y). -6 Let b(t) = t3 - t2 - 2t + 1. Let u(d) = d - 10. Let l be u(10). Suppose l = -5m - s + 7 + 13, 2m + 3s = -5. Suppose mk = -1 - 9. Calculate b(k). -7 Suppose a + 10 = -4a. Let f(h) = h*3 + 3h*2 + 2h. What is f(a)? 0 Let a(w) = 0w - 4 + 3 + w - 13w2. Let t(u) = -u2 - 2u + 9. Let g be t(2). What is a(g)? -13 Let b(i) = -2i*3 - 4i - 1. Let j(g) = -2g3 - 5g - 2. Let c(o) = 3b(o) - 2j(o). Calculate c(1). -3 Let r(f) be the first derivative of -f*2/2 + 3f + 1. Let p be r(0). Let d(h) = 2h - h - 3h - 2 + ph. Give d(2). 0 Let j(k) be the second derivative of 3k5/20 + k4/12 - k*3/6 - 44k. Calculate j(1). 3 Let f(j) = -j*2 - 2 + 2j + 7j3 - 5j*2 - 2j*2. Let d(z) = -7z*2 - 2z*3 - 1 + 5z*3 + 3z*3 + z. Let k(m) = 6d(m) - 5f(m). What is k(3)? 1 Let r(m) = -m3 + 3m*2 - 3m + 2. Let w = -11 - -12. Suppose 4a = -a + 5. Let n = w + a. What is r(n)? 0 Let z(w) = 3w*2 - 10w - 9. Let s(o) = -o*2 + 5o + 4. Let u(t) = -5s(t) - 2z(t). Determine u(-3). 4 Let h(q) = -q + 10. L	{ "pile_set_name": "DM Mathematics" }
452? 567 What is next in -180, -358, -532, -702? -868 What comes next: -175, -358, -541, -724, -907? -1090 What is the next term in 215, 209, 203? 197 What comes next: -42, -103, -164, -225, -286, -347? -408 What comes next: -36, -69, -102, -135, -168? -201 What is next in -380, -392, -404, -416? -428 What comes next: -685, -690, -693, -694? -693 What comes next: 438, 448, 484, 558, 682, 868, 1128? 1474 What comes next: -1762, -1756, -1738, -1702, -1642, -1552, -1426, -1258? -1042 What comes next: 32, 278, 944, 2240, 4376, 7562, 12008, 17924? 25520 What is the next term in -22, -32, -42? -52 What is next in 12, 9, -8, -45, -108, -203? -336 What comes next: -906, -911, -918, -927, -938, -951? -966 What is the next term in -31, -38, -55, -88, -143, -226? -343 What is next in -235, -197, -135, -49, 61? 195 What comes next: 47, 84, 145, 230, 339, 472, 629? 810 What is the next term in 126, 124, 122, 120? 118 What is the next term in 35, 69, 103? 137 What is the next term in -16, -20, -14, 8, 52, 124, 230? 376 What is next in 23, 35, 51, 71? 95 What is next in -19, -28, -37, -46, -55? -64 What comes next: 1, 41, 97, 157, 209, 241, 241, 197? 97 What is next in -54, -45, -34, -21? -6 What comes next: 68, 73, 78? 83 What comes next: 41, 91, 143, 197, 253, 311? 371 What is the next term in 189, 425, 645, 843, 1013? 1149 What comes next: -16, -18, -20, -22? -24 What is the next term in -1544, -1542, -1540, -1538, -1536, -1534? -1532 What is next in 7, 5, 3, 1? -1 What comes next: -98, -196, -294, -392, -490? -588 What is the next term in 2383, 2382, 2381? 2380 What is next in -42, -51, -62, -75? -90 What is next in -36, -64, -82, -90, -88, -76, -54? -22 What is the next term in 138, 135, 132, 129, 126, 123? 120 What is next in -19, -34, -61, -106, -175, -274, -409? -586 What comes next: 48, 58, 68, 78, 88, 98? 108 What comes next: -101, -82, -59, -32, -1, 34, 73? 116 What is the next term in 4, 21, 28, 7, -60? -191 What is next in -6, -22, -58, -120, -214, -346? -522 What is the next term in 21, 37, 49, 57, 61, 61, 57? 49 What is next in 6, 11, 22, 39, 62, 91, 126? 167 What comes next: -1158, -2297, -3436, -4575, -5714, -6853? -7992 What comes next: 301, 306, 311, 316? 321 What is the next term in 96, 92, 86, 78, 68, 56? 42 What is next in 31, 118, 257, 442, 667, 926, 1213? 1522 What comes next: 3, 18, 33, 48? 63 What is next in -30, -33, -20, 15, 78? 175 What comes next: 14, 3, -18, -55, -114, -201? -322 What comes next: 29, -4, -55, -124? -211 What comes next: -873, -872, -871? -870 What comes next: -21, -44, -69, -96, -125, -156, -189? -224 What is the next term in 201, 400, 599, 798, 997, 1196? 1395 What comes next: -63, -69, -75, -81, -87, -93? -99 What comes next: -911, -947, -1007, -1091, -1199, -1331, -1487? -1667 What comes next: 179, 180, 181, 182, 183, 184? 185 What comes next: -2, -13, -24, -35, -46, -57? -68 What comes next: -720, -1441, -2162, -2883, -3604? -4325 What is the next term in 48, 22, -22, -84, -164, -262, -378? -512 What is next in -568, -2240, -5018, -8896, -13868, -19928? -27070 What comes next: 0, -23, -56, -105, -176, -275, -408? -581 What comes next: 272, 270, 268? 266 What comes next: -8943, -8947, -8953, -8961, -8971, -8983, -8997? -9013 What comes next: -22, -99, -256, -517, -906, -1447? -2164 What is next in 2747, 2751, 2757, 2765, 2775? 2787 What is next in -4661, -9321, -13981, -18641, -23301? -27961 What is the next term in -19, -37, -65, -109, -175, -269, -397, -565? -779 What comes next: 19, 21, 37, 73, 135, 229? 361 What is next in 14375, 14373, 14371? 14369 What is the next term in 33, 35, 47, 75, 125, 203? 315 What is the next term in 42, 50, 82, 150, 266, 442, 690, 1022? 1450 What is next in -230, -460, -690, -920, -1150, -1380? -1610 What is the next term in 2310, 4624, 6938, 9252? 11566 What comes next: 427, 471, 515, 559, 603, 647? 691 What comes next: 114, 244, 376, 510? 646 What is the next term in 7621, 7620, 7619, 7618? 7617 What is next in -477, -946, -1405, -1854? -2293 What is the next term in -22, -21, -12, 11, 54? 123 What is next in -169, -396, -623, -850? -1077 What is the next term in 58, 67, 76? 85 What is the next term in 321, 636, 947, 1248, 1533, 1796? 2031 What is next in 19, 76, 171, 304? 475 What is the next term in -405, -403, -401, -399? -397 What is the next term in -952, -1754, -2546, -3322, -4076, -4802, -5494? -6146 What is next in -12, -11, -10, -9, -8, -7? -6 What is next in -4, -29, -66, -115, -176? -249 What comes next: -30, -29, -28? -27 What is the next term in 17, 88, 211, 392, 637, 952, 1343, 1816? 2377 What is next in -11079, -11077, -11075, -11073, -11071? -11069 What is the next term in 10, 15, 42, 103, 210? 375 What is next in 2184, 4363, 6538, 8709, 10876? 13039 What comes next: 18, 37, 46, 39, 10, -47? -138 What is the next term in 212, 410, 606, 800? 992 What comes next: -19, -54, -151, -340, -651, -1114? -1759 What is the next term in -678, -682, -686? -690 What is next in -266, -1011, -2244, -3959, -6150, -8811, -11936, -15519? -19554 What comes next: 650, 1311, 1960, 2591, 3198, 3775, 4316? 4815 What is next in -308, -389, -468, -545? -620 What comes next: -405, -408, -413, -420, -429, -440, -453? -468 What is the next term in -20, -24, -40, -74, -132, -220, -344, -510? -724 What comes next: 312, 1260, 2832, 5022, 7824, 11232, 15240? 19842 What is the next term in 54, 430, 1450, 3438, 6718, 11614, 18450, 27550? 39238 What comes next: -138, -132, -122, -108, -90? -68 What is next in -9656, -9655, -9654? -9653 What is next in -85, -329, -739, -1321, -2081, -3025, -4159, -5489? -7021 What is next in -92, -184, -278, -374, -472? -572 What is the next term in 49, -16, -129, -296, -523, -816, -1181? -1624 What comes next: 0, 58, 216, 522, 1024? 1770 What is next in -249, -484, -719? -954 What comes next: 52, 56, 62, 70? 80 What is the next term in 42, 13, -34, -99, -182, -283, -402? -539 What is next in -73, -229, -489, -853, -1321, -1893, -2569? -3349 What is next in -11, -58, -191, -452, -883, -1526, -2423? -3616 What is the next term in 12, 11, 10? 9 What is next in 634, 2527, 5684, 10105, 15790, 22739? 30952 What comes next: 5, 19, 45, 83? 133 What is the next term in 72, 50, 22, -6, -28, -38, -30? 2 What is next in 1027, 2056, 3085, 4114, 5143, 6172? 7201 What is next in 210, 441, 686, 951, 1242, 1565, 1926? 2331 What is the next term in -15, 22, 121, 312, 625, 1090, 1737? 2596 What is next in -308, -318, -314, -290, -240? -158 What is next in -230, -228, -226, -224, -222? -220 What is the next term in -355, -340, -327, -322, -331? -360 What is next in -3090, -6157, -9236, -12333, -15454, -18605? -21792 What is the next term in 264, 265, 266, 267, 268, 269? 270 What comes next: 104, 102, 102, 104, 108, 114? 122 What is next in -13734, -13736, -13738, -13740, -13742, -13744? -13746 What is next in 38, 77, 114, 149, 182, 213? 242 What is next in 10, 44, 92, 160, 254, 380, 544? 752 What comes next: -1431, -2866, -4301, -5736, -7171? -8606 What comes next: -187, -207, -225, -241, -255, -267? -277 What comes next: 2868, 2866, 2864, 2862? 2860 What is the next term in 1279, 1275, 1271, 1267, 1263? 1259 What is the next term in 561, 1112, 1663? 2214 What is next in 28, 25, 14, -11, -56, -127, -230, -371? -556 What comes next: 222, 448, 674, 900, 1126, 1352? 1578 What is next in -14, -30, -52, -80? -114 What comes next: -242, -227, -214, -203? -194 What is next in 633, 1248, 1863, 2478, 3093, 3708? 4323 What is next in 304, 609, 914? 1219 What is next in 80, 112, 152, 194, 232? 260 What comes next: 302, 414, 526, 638, 750? 862 What is the next term in -110, -453, -1024, -1823, -2850, -4105, -5588? -7299 What comes next: 151, 152, 163, 190, 239, 316? 427 What comes next: 13, 67, 217, 511, 997, 1723, 2737? 4087 What comes next: -50, -113, -218, -365, -554, -785, -1058? -1373 What is the next term in 10, 43, 108, 217, 382? 615 What is the next term in 114, 229, 344, 459, 574, 689? 804 What is next in -3283, -3282, -3281, -3280, -3279? -3278 What is next in 778, 777, 776, 775, 774? 773 What comes next: -942, -938, -932, -924, -914, -902? -888 What comes next: -224, -449, -674, -899, -1124? -1349 What is next in 23, 43, 77, 131, 211, 323, 473? 667 What comes next: -89, -18	{ "pile_set_name": "DM Mathematics" }
5. Let w(y) = -1361y - 2 - 1 + 1357y. Let b(z) = -6p(z) - 10w(z). Determine g(b(j)). -32j2 + 140j Let z(l) be the first derivative of -219l2/2 - 5189. Let i(n) = -4n. What is i(z(u))? 876u Let i = 9 + -12. Let v(x) = -x + 6. Let a(l) = -2l + 20. Let k(p) = ia(p) + 8v(p). Let m(g) = 2g. Give m(k(o)). -4o - 24 Let x(k) = -10k + 18. Let l(c) be the second derivative of 2c*3/3 - 2149c. Calculate l(x(b)). -40b + 72 Let n(b) = b2. Let v(q) = -17596359q. Calculate n(v(s)). 309631850056881s2 Let q(o) = -2o. Let x(t) = 6720423t2 - 2t + 1. Give q(x(f)). -13440846f2 + 4f - 2 Let v(j) = 25j2 - 10j + 15. Let z(n) = 13n2 - 6n + 9. Let b(y) = -6v(y) + 10z(y). Let s(w) = 27w2. Determine s(b(t)). 10800t*4 Let p(c) be the first derivative of 5c*2/2 - 43. Let z be (-90)/(-12)12/15. Let d(j) = 0 + 0 - zj2. Give p(d(a)). -30a2 Let j(h) be the second derivative of h6/360 - 19h3/6 - 11h + 1. Let a(g) be the second derivative of j(g). Let t(m) = -120m. What is t(a(p))? -120p*2 Let w = -421 + 452. Let k(n) = wn - 4n - 8n - 6n - 10n. Let a(o) = 48o. Give a(k(i)). 144i Let c(z) = 492424z. Let t(u) = -2u. Calculate t(c(g)). -984848g Let z(t) = -t2 - 12t + 21. Let v be z(-11). Let s(i) = -51i - vi + 118i. Let p(a) = 5a - 3a - a. Calculate s(p(k)). 35k Let v(l) = -244427422l. Let s(w) = w. What is v(s(u))? -244427422u Suppose -2c = 10, c + 26 = -35g + 42g. Let r(f) be the first derivative of 19 + 2/3f*g + 0f*2 + 0f. Let s(w) = 3w. What is s(r(i))? 6i*2 Let h(b) = -514b*2 + 10b + 10. Let w(m) = 36m2 - m - 1. Let l(x) = -3h(x) - 30w(x). Let n(d) = -d. What is n(l(k))? -462k*2 Let q(v) = -2 + 82v - 2v2 + 79v - 221v + 82v. Let c(o) = -o. Determine c(q(s)). 2s2 - 22s + 2 Let f = 13 - 6. Let b(n) = fn2 + 25n*2 + 26n*2. Let y(i) = -7i + 78. Let x(h) = 18h - 195. Let m(s) = 2x(s) + 5y(s). Calculate m(b(v)). 58v*2 Let f(n) be the third derivative of 3/8n*4 + 0n + 0 + 0n3 + 10n2. Let u(g) be the third derivative of -g4/8 - 5g2. Calculate f(u(y)). -27y Let t(m) = 27482152m2. Let x(r) = 3r. What is t(x(d))? 247339368d2 Let k(w) = 7w + 6. Let u(g) = -99g - 88. Let c(l) = -44k(l) - 3u(l). Let j(m) = -74m*2. What is j(c(d))? -8954d*2 Let z(u) = -205u*2 + 8. Let d(x) = 20868x*2 - 814. Let m(p) = 4d(p) + 407z(p). Let g(w) = 308w. Give g(m(b)). 11396b2 Let o(w) = 24w. Let n(m) be the third derivative of 0m4 + 0m - 1/60m5 + 4m*2 - 8 + 0m*3. Give o(n(g)). -24g*2 Let u(i) = 24360 - 48720 - 78i + 24360 - 39i. Let t(m) = 2m*2 - 5 + 5. Calculate t(u(v)). 27378v*2 Let s(t) = -3t + 56. Let u(m) = -4m + 84. Let w(k) = 15s(k) - 10u(k). Let q(x) = -128x*2 + 3. Give q(w(g)). -3200g*2 + 3 Let o(g) = -10g*2. Let j(t) be the first derivative of 88t*3 - 281. Calculate j(o(h)). 26400h4 Let n(x) be the second derivative of -x4/4 + 47675x. Let z be -1 + (0 - -1 - -2). Let b(y) = 3y*2 - 3y*z - 3y*2. What is b(n(j))? -27j*4 Let o(c) = -2c*2. Let f(w) be the first derivative of -43w*4/12 + 5w*2/2 + 3w - 62. Let m(d) be the second derivative of f(d). Determine m(o(n)). 172n2 Let p(t) = -36t. Let h(z) = -z*3 + 6z*2 - 8z. Let w be h(4). Let b(g) = -301013 + 301013 + 3g + wg. Give p(b(r)). -108r Suppose -48 - 54 = -3s. Let j(c) = 45c - 20c - sc - 17c. Let w(p) = p. Determine w(j(g)). -26g Let y(n) be the second derivative of n5/60 - 23n*2 - 4n. Let k(q) be the first derivative of y(q). Let a(m) = 13m. Give k(a(u)). 169u*2 Let d(l) = 52 - 94 + 54 + 10l*2 + 24l. Let x(z) = -z*2 - 2z - 1. Let b(p) = d(p) + 12x(p). Let i(o) = -186o. What is i(b(c))? 372c2 Let m(l) be the third derivative of l7/1260 - 33l*5/20 - 49l*2. Let t(h) be the third derivative of m(h). Let i(u) = 3u*2. Calculate t(i(d)). 12d*2 Let w(c) = -2c*2. Let n be 22 - 8/4. Suppose -6z + 16 = -nz. Let s(m) = -8 + 8 + 6m - zm. What is w(s(r))? -8r2 Let m(c) be the second derivative of 4c + 1/3c3 + 0c*2 + 0. Let u(o) = 23o - 2. Calculate m(u(n)). 46n - 4 Let t(l) = -3572l. Let f(q) = -8378190q. Let p(a) = -5f(a) + 11728t(a). Let m(v) = -v2. What is p(m(g))? 1466g2 Let l(w) = w2 - 50514w - 1. Let p(a) = 77a. What is p(l(m))? 77m2 - 3889578m - 77 Let n(y) = -135 + 276 - 261y - 141. Let j(f) = -8f*2 - 13f*2 + 19f*2. Calculate n(j(c)). 522c*2 Let u(l) = -40l - 230 + 164 + 66. Let s(t) = t*2 - 2t*2 - 5t2 + t2. Give s(u(b)). -8000b2 Let i(m) be the second derivative of m5/40 + 65m*3/6 - 2m + 88. Let j(l) be the second derivative of i(l). Let o(u) = -10u + 5u + 8u. What is o(j(p))? 9p Let w(o) be the second derivative of -o*4/3 + 527o - 3. Let a be ((-12)/(-8))/(3/4). Let r(k) = 3k2 + 2k*2 + ak*2. What is r(w(u))? 112u*4 Let r(s) = -7s + 36. Let o(d) = -5d + 27. Let j(q) = 4o(q) - 3r(q). Let m(a) = 170a*2 - 11a + 1. Give j(m(p)). 170p2 - 11p + 1 Let u(b) = b. Let l(a) = 21218747a2. What is u(l(x))? 21218747x*2 Let x(h) = 112722h. Let m(k) = -9k2 - 2. Calculate x(m(z)). -1014498z2 - 225444 Let v(c) be the second derivative of c7/630 - 83c4/12 + 2c - 23. Let j(p) be the third derivative of v(p). Let l(q) = 2q2 - 19. Determine j(l(z)). 16z*4 - 304z*2 + 1444 Let u(h) = -7h*2 - 52h. Let o(c) = -25c2 - 183c. Let l(p) = 5o(p) - 18u(p). Let t(f) be the third derivative of -f4/12 - f2. What is l(t(x))? 4x2 - 42x Let u(q) = 10q2. Let p(g) be the third derivative of g8/20160 - g5/60 - 5g*4/8 + 13g*2 + g. Let j(y) be the third derivative of p(y). Give u(j(o)). 10o4 Let k(f) = f2 - f + 1. Let v(d) be the first derivative of -4d3/3 + 5d*2/2 - 5d - 144. Let o(a) = -5k(a) - v(a). Let t(g) = 11g. Give o(t(c)). -121c2 Let c(o) = -1039207192o. Let q(x) = -x. What is q(c(h))? 1039207192h Let m(r) = -15r - 2r2 + 15r. Let v(s) be the second derivative of -s*3/6 - 5s*2 + 10210s. Calculate m(v(n)). -2n2 - 40n - 200 Let v(a) = a*2 - 2a + 3. Let z be v(1). Let s(y) = -297y + 2y*2 + 5y*2 - 3y*z + 297y. Let q(i) = -23i2. Calculate q(s(t)). -368t*4 Let u(q) = -3q*2. Let x(s) = -s - 5. Let i(z) = -3. Suppose 7k = 4k - 3. Let w be k - (4/(16/28) + -3). Let v(j) = wi(j) + 3x(j). Give v(u(l)). 9l*2 Let t(o) = -1853o + 5. Let m(l) = 31l - 1. Give m(t(w)). -57443w + 154 Let z(h) = -458510h2 - h + 9. Let t(v) = -42v. What is z(t(r))? -808811640r2 + 42r + 9 Let m = 144 + -141. Let c(j) = -4j - 3. Let s(r) = -r - 1. Let i(d) = ms(d) - c(d). Let h(y) = 15y2 - 4. Calculate i(h(u)). 15u*2 - 4 Let q be (4/(-5))/(4/(-30))7. Let c(g) = -49g + 124g - 53g - qg. Let h(o) = 5o. Determine c(h(b)). -100b Let w(n) = -30n - 3. Let q(d) = -18d - 2. Let o(a) = 3q(a) - 2w(a). Let s(f) = -238f. Give o(s(u)). -1428u Let p(f) be the first derivative of -578f3/3 + 2f + 2668. Let n(w) = 2w2. Determine p(n(q)). -2312q*4 + 2 Let g(q) = -2q + 2. Let o(f) = 1. Suppose -7b - 4 = -3b. Let a(s) = bg(s) + 2o(s). Let w(u) = -4u + 1. Determine w(a(k)). -8k + 1 Let p(j) = 4j2 - 1209j + 1209j - 6j2 + j2. Let d(x) = 3235x2. Give p(d(o)). -10465225o*4 Let a(u) = -2u. Let z be ((-6)/21)/(-1) - 16/56. Let c(n) be the second derivative of -7/3n3 + z - 16n + 0n2. Calculate c(a(s)). 28s Let f(g) = 12275 - 24695 + 12420 - 20g2. Let x(t) = -6. Let w(u) = u + 17. Let l(d) = 6w(d) + 17x(d). Determine l(f(i)). -120i*2 Let y(v) = -7v*2. Let n(l) = 946074l*2. Calculate y(n(j)). -6265392094332j4 Let z(s) be the second derivative of -s4/6 + 6s + 1. Suppose 8v = 16 - 0. Let h(k) = 4kv - 101 + 101. Give z(h(n)). -32n*4 Let u(s) = 56s - 3. Let y(i) = -523i + 28. Let r(v) = 28u(v) + 3y(v). Suppose 3t = 3 + 3. Let n(g) = -tg - 5g + 2g. What is n(r(a))? 5a Let u(w) = -12w2 - 2w. Let n(l) = -2860892l. Give n(u(h)). 34330704h*2 + 5721784h Let w(t) = -4t2 + 106 - 3927t + 3927t. Let k(i) = -3i*2. Give k(w(c)). -48c*4 + 2544c*2 - 33708 Let r(o) = 316488850o. Let v(w) = 2w2. Give v(r(t)). 200330384348645000t*2 Let n(t) be the first derivative of -2t**3/3 + 78. Let l(s) =	{ "pile_set_name": "DM Mathematics" }
ms in 79z - 281z + 213z + 182z + 25z. 218z Collect the terms in 31246p + 0 + 13635p + 0 - 11465p. 33416p Collect the terms in -2n + 4n - 3395n2 - 29n*3 - 2n + 3392n2. -29n*3 - 3n*2 Collect the terms in -m + 1361 - 6531 - 825 - 3416 + 0m. -m - 9411 Collect the terms in 285p - 3 + 5 - 2 - 1067p - 2p2. -2p*2 - 782p Collect the terms in 2283o - 2282o + 151 - 177o3 - 15o*3. -192o*3 + o + 151 Collect the terms in -6v - 51v - 80v + 3v - 38v. -172v Collect the terms in 4s - 2s - 4s + 979s3 + 1439s*3 + 2s. 2418s3 Collect the terms in 147498766 - 147498766 + 4u*2. 4u*2 Collect the terms in 112130p*3 - 37372p*3 - 37382p*3 - 37374p*3. 2p*3 Collect the terms in -24a + 85 + 9a - 7a + 29. -22a + 114 Collect the terms in 302 - 5g - 911 - 4g + 300 + 308. -9g - 1 Collect the terms in -184y3 - 95y*2 + 49y*2 + 47y*2 + 78y*3. -106y3 + y2 Collect the terms in -16278898r2 + 16278898r*2 + 218r*3. 218r*3 Collect the terms in -9 - 3 - 4280s + 7 + 4713s + 6. 433s + 1 Collect the terms in -85852u + 42626u + 43190u. -36u Collect the terms in 521i2 - 669i + 1330i - 661i - 2. 521i2 - 2 Collect the terms in -80231h*2 - 80238h*2 + 160462h*2. -7h*2 Collect the terms in 463p - 1786p - 649p - 5 - 2584p. -4556p - 5 Collect the terms in -1362914g - 78g*2 + 1362914g + 1. -78g2 + 1 Collect the terms in 3343y*3 + 3332y*3 - 60 + 78 + 3329y*3 - 10008y*3. -4y*3 + 18 Collect the terms in 4f*2 + 107926f - 216293f + 108367f. 4f2 Collect the terms in 81179o*2 + 101999o*2 - 22996o*2 - 9258o*2. 150924o*2 Collect the terms in 284 + 244v - 140 - 5324v - 759v - 135. -5839v + 9 Collect the terms in -708410m + 1134961m + 1192370m + 99074m. 1717995m Collect the terms in 8569t + 52t + 6641t + 1629t + 3256t. 20147t Collect the terms in -23o2 - 6o*2 - 9o*2 - 12o*2 + 4o*2 + 95o*2. 49o*2 Collect the terms in -592r + 324r - r2 + 144r - 3r2 + 168r. -4r2 + 44r Collect the terms in 722506k - 5124k*2 + 2 - 722506k + 2k3. 2k*3 - 5124k*2 + 2 Collect the terms in -2b + 61 - 202 + 378 - 305 - 353. -2b - 421 Collect the terms in -220567d*3 + 25674d*2 - 25674d*2 + 220560d*3. -7d3 Collect the terms in -p2 - 13923p + 4638p + 4646p + 4630p - p*2. -2p*2 - 9p Collect the terms in -129i2 + 87i*2 - 3 + 3 + 142i*2 + 122i*2. 222i*2 Collect the terms in -33t*2 - 3t*2 + 8t*2 - 2t + 33t2. 5t*2 - 2t Collect the terms in 3g2 + 24 + 0g*2 + 97 + 464. 3g*2 + 585 Collect the terms in 5f*2 - 8418395724944f + 8418395724944f. 5f*2 Collect the terms in -2d*2 - 248736 + 17d + 248736. -2d2 + 17d Collect the terms in -42 - 54 + 213 - 18787h2 - 63 - 54 + 18789h*2. 2h*2 Collect the terms in 317l*2 - 514 + 1042 - 534 - 322l*2. -5l*2 - 6 Collect the terms in 160x - 259x + 267x + 163x. 331x Collect the terms in -94g2 - 208g*2 - 484g*2 + 134g*2 - 225g*2. -877g*2 Collect the terms in 5764t*2 + 7427t*2 - 13144t*2. 47t*2 Collect the terms in 117986n - 236016n - 15 + 13n*2 + 118030n. 13n2 - 15 Collect the terms in -1094w + 12 - 6 + 1096w - 9. 2w - 3 Collect the terms in -1686738u + 18 + 239592u - 18. -1447146u Collect the terms in 41q + 36q + 0 + 61q + 2q2 + 0 - 89q. 2q2 + 49q Collect the terms in -692f3 + 1133f - 2285f + 1152f. -692f3 Collect the terms in 878a + 877a + 865a + 878a - 4373a + 895a. 20a Collect the terms in 10224029702220 - 2f3 - 10224029702220. -2f3 Collect the terms in -189 - 132 + d2 + 205. d*2 - 116 Collect the terms in -q + 709 - 296 - 116 - 298. -q - 1 Collect the terms in 3 - 6086t - 3 + 96902t. 90816t Collect the terms in -318902z2 + 1 + 318928z*2 - 1. 26z*2 Collect the terms in 61339o + 61341o + 61337o + 61332o - 245335o. 14o Collect the terms in 4313b*2 - 1417b*2 - 1445b*2 + 3 - 1409b*2. 42b*2 + 3 Collect the terms in 178329s*2 - 91664s*2 + 998543s*2. 1085208s*2 Collect the terms in 461i - 12 + 511i - 976i. -4i - 12 Collect the terms in 81z + 774 - 72z - 28 - 387 + 1200. 9z + 1559 Collect the terms in 123r2 - 100650r + 201295r - 62r*2 - 100645r - 58r2. 3r*2 Collect the terms in 18173d*2 + 18173d*2 - 36346d*2 - 637d*3 - 633d*3 + 1274d*3. 4d*3 Collect the terms in g + 460 + 74 + 325 - 859. g Collect the terms in 1659792 - 3319394 + 1659602 - 6a. -6a Collect the terms in 244m + 17205896 - 8602951 - 8602945. 244m Collect the terms in 5o*2 - 7o*2 - 11o*2 + 17o + 16o2 - 26o + 9o. 3o*2 Collect the terms in -1034 + 211 - 3x*3 + 7x*3 + 0x*3. 4x*3 - 823 Collect the terms in 134m + 4m + 2m - 140m + 3m - 12m3. -12m*3 + 3m Collect the terms in -386312r3 - 5r + 387667r3 + 5r. 1355r3 Collect the terms in -250125z + 751578z - 250726z - 250725z. 2z Collect the terms in -209 - 204 - 20q2 - 225 - 214 + 852. -20q*2 Collect the terms in -600128 - 6z*3 + 600128. -6z*3 Collect the terms in -199z + 34z + 84z + 39z + 39z + 35z - 34z. -2z Collect the terms in 1147s*2 - 682s*2 - 526s*2. -61s*2 Collect the terms in 220233h - 278223h - 360083h - 272750h. -690823h Collect the terms in -35n + 11n*2 - 50n + 9 + 6 - 6. 11n2 - 85n + 9 Collect the terms in -301d2 - 312d*2 - 34d + 34d + 658d*2 - 21d*2. 24d*2 Collect the terms in 1 + 2 - 76966i - 76951i - 3 + 153914i. -3i Collect the terms in 9q - 20 - 28 - 41q - 29 - 25 + 101. -32q - 1 Collect the terms in 122251f + 1 + 712929f + 62114f. 897294f + 1 Collect the terms in -152n2 - 355n*2 - 12 - 62 + 74. -507n*2 Collect the terms in 53994 - 53994 - 2x*2 - 13x. -2x2 - 13x Collect the terms in 4824135a - 2412058a - 2412047a. 30a Collect the terms in -5871f3 + 4f + f + 2944f3 + 2f + 2929f3. 2f*3 + 7f Collect the terms in 2849 - 8o2 - 12o*2 + 2o - 2850. -20o2 + 2o - 1 Collect the terms in -132782263965f2 + 132782263965f*2 - 9f*3 - 2f. -9f3 - 2f Collect the terms in -1164k - 1163k - 1158k - 1186k - 1163k + 5837k. 3k Collect the terms in 245448 + 9m - 245208 + 11m. 20m + 240 Collect the terms in 107757q - 76 + 76 - 107755q. 2q Collect the terms in -209r - 222r - 374r - 269r - 371r. -1445r Collect the terms in -273637j*2 + 136818j*2 + 136821j*2 + 43. 2j*2 + 43 Collect the terms in 63p*3 + 68p*3 + 65p*3 + 46p*3 + 69p*3 - 340p*3. -29p*3 Collect the terms in 81 - 21t*2 + 22t2 - 28. t2 + 53 Collect the terms in 3422i2 + 5012i*2 - 8441i*2. -7i*2 Collect the terms in -129 + 5l*2 + 28 + 54 + 27 + 20. 5l*2 Collect the terms in 12987128923a - 12987128923a + a3. a3 Collect the terms in -68g*2 + 179732263890g - 179732263890g. -68g*2 Collect the terms in 862w + 872w + 871w + 864w - 4404w*3 - 3469w + 4406w3. 2w*3 Collect the terms in -40w + 236w2 - 241w*2 - 550 + 40w + 519. -5w2 - 31 Collect the terms in 10078i*3 - 20264i*3 + 9958i*3. -228i*3 Collect the terms in 45w - 30w - 118w + 2 - 92w - 5. -195w - 3 Collect the terms in -247b + 60b*2 - 278b + 743b - 218b - 1. 60b2 - 1 Collect the terms in 31w*3 - 31970w*2 - 27w*3 + 5w + 56w3 + 31970w*2. 60w*3 + 5w Collect the terms in -6c2 + 2 - 11c*2 + 17c*2 + 1288c*3. 1288c*3 + 2 Collect the terms in -469a*3 + 525467623a*2 - 525467623a*2. -469a*3 Collect the terms in 315165k + 1104 - 1104. 315165k Collect the terms in -19738205 + 9869104 + 9869101 + 14l. 14l Collect the terms in -3753k + 948k + 3k*2 + 940k + 941k + 949k. 3k2 + 25k Collect the terms in 2r3 + 0r + 4r - 4r + 6r - 4353r*2 - 12r. 2r3 - 4353r*2 - 6r Collect the terms in -1379602s - 13 - 149431s + 13. -1529033s Collect the terms in 11l*2 + 366699463l - 366699463l. 11l*2 Collect the terms in 1707132s*2 - 3414223s*2 + 1707100s*2. 9s*2 Collect the terms in 10i + 10i - 29i + 9i - 82323i*2. -82323i*2 Collect the terms in 1904 + 4r*3 + 1798 + 1800 - 7265 + 1763. 4r*3 Collect the terms in 1631 - 3237 + 145h**2 + 1606. 1	{ "pile_set_name": "DM Mathematics" }
digit of i? 1 Suppose 8 = f - 3. What is the units digit of f? 1 Suppose -2c + 24 = -14c. Let r(s) = -23s2 + s. Let g be r(-1). What is the units digit of 4/3g/c? 6 Let v(u) = u*3 - 5u*2 + 7u + 1. What is the tens digit of v(5)? 3 Suppose -5 + 15 = 4a + 2x, -4x = -4. Suppose y = a + 14. What is the units digit of y? 6 Let q(d) = 2 - 2 - 5d + 6. Let w be q(-5). Let r = w + -20. What is the tens digit of r? 1 Suppose 2p - 2t - 7 = -3t, 19 = 5p + t. Let l = 5 - p. What is the units digit of l? 1 Let k(a) = -a*3 + 2a*2 + 2a - 2. Let h be k(2). Suppose c = hc. Let i(q) = -q3 + q2 + q + 4. What is the units digit of i(c)? 4 Let k = -64 + 127. Let z = k + -44. What is the units digit of z? 9 Suppose 0 = -4f - w - 7, f - 4w + 6 = 0. What is the units digit of ((-4)/f)/(8/136)? 4 Suppose -2h = -27 - 59. What is the tens digit of h? 4 Let x(n) = n + 5. Let y be x(-5). Suppose 6 = 3l - yl. What is the units digit of ((0 - 1) + 2)l? 2 Suppose 0b - 4q + 104 = 4b, -2b = -q - 58. What is the units digit of b? 8 Let r be (-10)/(-3)(-9)/(-3). Suppose -4q + q + 11 = 4l, 0 = -l - 5q - r. Suppose 2f = li - 4i - 19, -56 = -4i - 2f. What is the tens digit of i? 1 Let y be 2/(-4)16/8. Let d = 3 + y. What is the units digit of d? 2 What is the tens digit of 5556/27 - ((-34)/(-9) + -4)? 0 Suppose 0 = -w + g + 114 + 37, -4g = 3w - 446. What is the hundreds digit of w? 1 Suppose -87 - 9 = -3t. Let q = t - 21. What is the units digit of q? 1 Suppose 0 = 3y + u - 7, 0u + 2u = 2y - 2. Suppose 16 = 6i - yi. What is the units digit of i? 4 Let x = 20 + -31. Let v = 16 + x. What is the units digit of v? 5 Let u(r) = 3r - 12. What is the units digit of u(6)? 6 Suppose -50 = 6f - f. Let s = f + 21. What is the tens digit of s? 1 Let t be (9 + -1)3/(-6). Let w = 1 - t. What is the units digit of w? 5 Suppose 0 = -2m, -4p + 76 = -0m + 2m. What is the units digit of p? 9 What is the tens digit of 300 - (12/28 + (-62)/14)? 0 Let x = 30 + -15. Suppose -4n + x = -5b, 4b = 4n + 5b - 45. What is the tens digit of n? 1 Let x(l) = 2l2 - l - 15. What is the units digit of x(7)? 6 Suppose -20 = -4o, s = -s + 5o + 585. What is the units digit of s? 5 Let d(n) be the second derivative of n5/20 - n4/3 - n3/2 + n2 - 2n. Let y be d(5). What is the units digit of (6/5)/(y/40)? 4 Let l(n) = -5n3 + n2 - 1. What is the units digit of l(-2)? 3 Suppose 5b = 3b + 4. Let g(u) = 8u*2 - u + 1. What is the units digit of g(b)? 1 Let t = 3 - 3. Suppose 5o - 4o - 22 = t. What is the tens digit of o? 2 Let z(r) = 2r*3 - 9r*2 + 13. Let o(b) = 3b*3 - 14b*2 + 20. Let c(m) = 5o(m) - 7z(m). Let g be 7/(-3)(-4 - -1). What is the units digit of c(g)? 9 Let z = 0 + 17. Let w = z - 8. What is the units digit of w? 9 Let q = 16 - -9. Let f = 82 - q. Suppose 0 = -n - 4t + 28, 4n + 2t = -3t + f. What is the units digit of n? 8 Let r be ((-28)/8)/(1/(-2)). Suppose 2k + r = -n, 0 = -4k - 12 - 0. Let m = 6 + n. What is the units digit of m? 5 Let f = 1 - 2. Let x be 5f + (0 - -1). Let l = x - -7. What is the units digit of l? 3 Suppose -7g = -9g + 44. Let r = 34 - g. What is the tens digit of r? 1 Let s = -5 - -7. Suppose -sb + 4f = -4, -2f - 19 = -5b - f. Suppose bv + v + 25 = 0, 0 = -2p + 2v + 20. What is the units digit of p? 5 What is the units digit of -2 + (-835)/(-5) - (-2 + -1)? 8 Suppose 2m - 3 = m. Suppose 3o - mb = 66, -b + 6b = 10. Suppose -4a = -2a - o. What is the units digit of a? 2 What is the units digit of (-4)/(-3 - 49/(-17))? 4 Let z(a) = a + 2. Let h be z(0). Suppose -hk + 4 = -18. What is the tens digit of k? 1 Suppose q - 1 = 4a, -4q + 3a = -3q - 2. Suppose 3z = -qj - 42, -3j + 5z = -j - 8. What is the units digit of 2/6(-90)/j? 5 Let i = 46 + 2. What is the units digit of i? 8 What is the tens digit of (5 + 5 + 183)/1? 9 Let t = -2 + 4. Suppose 0 = 4w + 5c - 44, 0 = -w - tc + 13 + 1. What is the units digit of w? 6 Let q(i) = -i2 + 11i - 3. Suppose l + 4a - 57 = 0, -l + 2l - 71 = 3a. Suppose 3k - l = -5d, 3d - 2k - k = 15. What is the units digit of q(d)? 7 Let n(i) = -i3 - 10i*2 + 7i + 15. Let b be n(-11). Let l = b + -36. What is the units digit of l? 3 Let v = -25 + 48. What is the units digit of v? 3 Suppose 7p + 14 = 9p. What is the units digit of p? 7 Suppose 0 = -2s + 2h - 1 + 7, -4h = -20. Let n(x) be the third derivative of x4/24 + 2x3/3 - x2. What is the tens digit of n(s)? 1 Suppose -4h + 10 + 10 = 0. Let r(d) = 7d + 4. Let n(b) = -6b - 4. Let g(i) = -6n(i) - 5r(i). What is the units digit of g(h)? 9 Let w = 4 + 29. Suppose -5q + a + 18 = -3, -2a + w = 5q. What is the units digit of q? 5 Let u(f) = -f - 1. Let h be u(-1). Suppose -2p + h = -2. What is the units digit of p? 1 Let t be 2/4(1 - 1). Suppose tg - 6 = -g. Suppose -gz = -2z - 52. What is the units digit of z? 3 Let n be 212/20 + (-4)/(-10). Let a = -7 + n. What is the units digit of ((-52)/16)/((-1)/a)? 3 What is the hundreds digit of (1 + 1)133 + -2? 2 Let f(x) = -x*3 - 5x*2 - 2x - 5. Let r be f(-5). Let k = -8 - -12. Let t = r - k. What is the units digit of t? 1 Let k = 296 - 140. Suppose 2i + k = -4c + 9c, -5c + 168 = 4i. What is the units digit of c? 2 Let q(h) = -h2 - h + 3. Let p be q(0). Let g = 5 + p. Suppose 2l - g = l. What is the units digit of l? 8 Suppose 0 = 2b - 4i, -6i + 32 = 3b - 4i. Let w = b + 0. What is the units digit of w? 8 Let m be 63/5 + (-2)/(-5). Suppose 0 = 2y - 3 - m. What is the units digit of y? 8 Let a = 246 - -71. What is the tens digit of a? 1 Let j = 3 - 4. Let t = 3 + j. What is the units digit of 1/3(t - -4)? 2 Let q(l) = -2l + 31. Let y(g) = g - 12. Let o be y(12). What is the units digit of q(o)? 1 Let x(q) = 10 - 1 - 2 - q. Let t = 0 - 0. What is the units digit of x(t)? 7 Suppose 6 = 3u - 2m, -5u = 3m + 2m - 10. Suppose 5f = -w + f, -5f + 6 = uw. What is the units digit of w? 8 Suppose 5z - 17 = 23. What is the units digit of z? 8 Let y(d) = -3d*3 + 2d - 13. Let l(j) = 4j3 - j2 - 2j + 14. Let r(o) = -4l(o) - 5y(o). What is the units digit of r(4)? 1 Let i be ((-2)/(-4))/((-2)/(-8)). Let g(h) = 6h2 - 2h + 1. Let t be g(1). Let f = t - i. What is the units digit of f? 3 Let j(f) = -f3 + f2 - f + 3. Let m be j(0). Suppose -n + 0n = 2r - 12, r = -mn + 6. What is the units digit of r? 6 Suppose 0 = -4s + 21 + 515. What is the hundreds digit of s? 1 Suppose -57 = -4w - 17. What is the tens digit of w? 1 Suppose a - 4 = q, -2a + 6 = -4. What is the tens digit of (-1)/(42/(-39) + q)? 1 Let s(y) = -2y2 + 8y - 9. Let o be s(9). What is the units digit of (-18)/o - (-152)/11? 4 Let u(b) = 2b2 - b + 1. Let h be u(1). Let i = 4 - h. Suppose -iz + 9 = -z. What is the units digit of z? 9 Let b be (-9 + -1)/(-4 + 2). Suppose -4k + 2x + 22 = -0x, -x - 29 = -bk. What is the units digit of (-2 - (-2 - 1)) + k? 7 Let r be (-2)/7 + 51/7. Let z = -2 + r. Suppose -z - 9 = -2j. What is the units digit of j? 7 Suppose h = -f + 46, 5f = 4h + 284 - 99. What is the units digit of f? 1 Let y be (-25)/44/(-1). Suppose 5q - y = -r + 2q, 5q - 55 = -2r. Suppose -d - 2t = -18, -14 = -3d + 5t + r. What is the tens digit of d? 1 Let b(a) = 10a. What is the tens digit of b(3)? 3 Suppose -6m + m = 3v, -3m = v - 4. What is the units digit of m? 3 Let a(s) = s + 13. Let j be a(-13). Suppose 4u + 44 = 2g - 10, -5g + 5u + 115 = j. What is the tens digit of g? 1 Let z = -18 + 11. Let k(i) = -6i - 1. Let f(t) = 5t + 2. Let a(s) = 7f(s) + 6k(s). What is the units digit of a(z)? 5 What is the units digit of 0 - -23 - 0/6? 3 Suppose 2d + 48 = 2v, -2d + 27 = 4v - 45. What is the tens digit of ((-96)/v)/(2/(-5))? 1 Let m(t) = 3t - 1. Let h be m(2). Let j be 272/h + (-8)/20. Suppose 4y = -18 + j. What is the units digit of y? 9 Suppose -2h + 1 = 3. Suppose 4m + 16 = 2x, -x + 5m + 11 = -3x. What is the units digit of x - (h + -2) - 0? 5 Let c(b) = b*3 - 6b*2 - 5b + 9. What is the units digit of c(7)? 3 Let t(h) = -6h - 1 - 10 + 3. Let k(f) = -7f - 9. Let u(v) = -5k(v) + 6t(v). What is the units digit of u(-6)? 3 Let x = -77 + 109. What is the units	{ "pile_set_name": "DM Mathematics" }
w) be the third derivative of -w*5/120 + 5w4/24 - w3/6 + w*2. Let x(q) be the first derivative of t(q). Calculate x(-4). 9 Let t(p) = 4 + 1 + p - 4p - 6 - p2. Calculate t(-5). -11 Let b = -7 + 13. Let c(a) = -a3 + 6a2 - 3a + 9. Calculate c(b). -9 Let o(r) = -4r2 - 4r*2 + 17 - 9 - 2r - 9. Calculate o(-1). -7 Let w(j) = j*3 - 12j*2 + 7 + 7j2 - 1 - j. Calculate w(5). 1 Let n(a) be the first derivative of -a2/2 - 1. Suppose -2j + 7j = 0. Suppose -2p + j = -8. Determine n(p). -4 Let t(p) = 5p*3 + 2p2 - 1. Let x(u) = u3 - 11u2 + 2. Let y be x(11). Let j be ((-5)/10)/(2/4). Let i = y + j. Give t(i). 6 Let c(s) be the third derivative of -s4/4 - 5s*3/6 - 55s2. Give c(4). -29 Let c(g) = g2 + 5. Suppose v + 20 = -4o, -5o - 24 - 1 = v. Calculate c(v). 5 Suppose z + 2z - 6 = 0. Suppose 4o + 1 = v + z, 2o + 3 = -3v. Let f(n) = 1 + 7n - 2n*2 + 2n*2 + on2 + n2. Give f(-6). -5 Let p(m) = -m3 - m2 - m - 3. Let q(c) = -c + 1. Let l(h) = h2 - h - 1. Let r be l(-1). Let n be q(r). Determine p(n). -3 Let i(f) = -f2 + 2 - 4f3 - 1 + f - 7f*3. Suppose -g + r = -4, -r - 3r - 1 = -g. Suppose -p - 5x = 6, -4 = gp + x + 2. Determine i(p). 10 Let b(m) be the third derivative of 7/120m6 + 0m*3 + 0m + 0 + 1/24m4 - 1/30m5 - m2. Suppose -3 = 5r - 8. Calculate b(r). 6 Let x(q) = -7q + 3. Suppose -14g - 20 = -9g. Calculate x(g). 31 Let r(q) = -q - 4. Let f(h) = 3h2 - 13h + 8. Let s(d) = -2d2 + 12d - 7. Let x(u) = 3f(u) + 4s(u). Let y be x(-9). Determine r(y). 0 Let v(l) = -8l2 + 5l + 4. Let s(n) be the second derivative of n4/12 - n2/2 + 2n. Let t(k) = -6s(k) - v(k). Give t(3). 5 Let z(x) = 3x + 3. Let l(m) = 2m - 17. Let n(g) = -g - 2. Let u be n(-12). Let r be l(u). Determine z(r). 12 Let x be 2/3(-1 - 2). Let y(l) = -5l - 3. Let i be y(x). Let z(j) = -j*3 + 8j*2 - 6j - 6. Determine z(i). 1 Let a be 7/((-98)/(-4))(7 - 0). Let c(n) = -n + 2. Determine c(a). 0 Let j(t) = t3 + 3t*2 - t + 2. Let w = 0 + 3. Let v = -1 + w. Suppose 5b + 12 = v. Give j(b). 8 Let f(s) = -5s2 - 10s - 3. Let k = -26 - -20. Let i(m) = -11m2 - 21m - 6. Let u(x) = ki(x) + 13f(x). Determine u(4). -3 Suppose 2 = -7a + 23. Suppose -2l - l = -5j + 14, 2j + 2 = 5l. Let r(z) = lz - 1 - z*2 + 4 + 2z. Determine r(a). 6 Let h be 8(9/(-6) - -2). Suppose 0 = hx - 17 - 55. Let w be (-14)/x - (-4)/(-18). Let o(q) = -q2 + 1. Calculate o(w). 0 Let u(l) = l2 + 8l + 1. Suppose 3t - t + 26 = -5b, t = 2. Calculate u(b). -11 Let q = 348 - 243. Suppose c + 3d = 1, 0c - 5c = -5d - q. Suppose 0 = 3o - 7o + c. Let p(t) = t2 - 5t - 1. What is p(o)? -5 Let f = 4 - 2. Let p(a) = -6a3 + 7a*2 - 6a + 6. Let d(i) = -15i2 + 3 - 16 + 13i + 0i + 13i*3. Let w(m) = -4d(m) - 9p(m). Determine w(f). 6 Let i = 6 - 13. Let c(h) = -h - 11 + 1 + 1 - h. Give c(i). 5 Let o(m) = -m3 + 5m*2 + 2m - 9. Let p(k) = -2k3 + 11k*2 + 5k - 19. Let r(x) = -13o(x) + 6p(x). What is r(-2)? -9 Suppose 2d - 30 = 4p, 2p - 6d + 11 = -d. Let s(k) = -2k2 - 4. Let y(a) = 5a*2 + a + 11. Let g(v) = ps(v) - 3y(v). Determine g(3). -1 Suppose -4j = -0j - 4. Let p(z) = -2z*3 + 3z*3 + j - 5 - 2z - 2z2. Give p(3). -1 Let t(h) be the third derivative of h5/60 - h4/24 + h3/6 - 7h2. What is t(0)? 1 Let p(r) = r2 - 1. Let d = -5 + 10. Suppose -4z = 3u + 17, -dz - 3u + u - 16 = 0. Give p(z). 3 Let m(g) = -g*3 + 3g2 - g + 1. Let f = 11 + -9. Calculate m(f). 3 Let c(x) = -x3 + 8x2 + 6. Let a(o) = o2 - 13o - 1. Let j be a(13). Let p = j + 9. Determine c(p). 6 Suppose 5w - 3s = -0w - 27, 19 = -4w + 5s. Let i = w - -5. Let r(f) = 3f - 4. Let q(n) = -n + 1. Let g(k) = ir(k) - 6q(k). Calculate g(3). 7 Let r(a) = -3a + 6. Let u = 0 + 4. Let g = u - 7. Let b be (-11)/g + 1/3. Give r(b). -6 Let z(f) = 13f + 19. Let q(u) = -7u - 10. Let i(v) = -11q(v) - 6z(v). Suppose -17 = o - 0o. Let t = o + 12. Determine i(t). 1 Let i(m) = -1 - 5m2 + 3 + 4m*2. Let c(d) = 6d*2 - 2d - 2. Let v(f) = -11f2 + 4f + 3. Let s(t) = 5c(t) + 3v(t). Let j be s(1). What is i(j)? -2 Let l = 5/44 + -139/1320. Let o(b) be the third derivative of 1/20b5 + 0b + 2b2 - 1/24b*4 + 0 - 1/3b*3 - lb*6. Give o(2). 0 Let r(v) = 7v + 3v2 - 6 + 3v - 4v2 - 12v. Determine r(-5). -21 Let x(r) = -r*2 + 6r - 2. Let m be x(6). Let a(f) = f3 + f2 + 2f. Give a(m). -8 Let w(p) be the second derivative of -p6/120 + p5/120 + p4/24 - 2p*3/3 + 3p. Let k(t) be the second derivative of w(t). What is k(2)? -9 Let u(a) = a - 1. Let f(l) = 4l2 + 37l + 12. Let g be f(-9). What is u(g)? 2 Let i(p) = -p*2 + 4p - 1. Let v(d) = d - 1. Let y be v(5). Determine i(y). -1 Let j(u) = -u - 62u3 - 5u*2 + 9 - 6u*2 + 63u*3. Calculate j(11). -2 Let o be -13((-2)/(-1) - 3). Let m = -12 + o. Let s(u) = 10u3 + u2 - u. Calculate s(m). 10 Let y(n) = -n2 + 7n + 3. Let b(c) = -c*2 + 8c + 4. Let x(f) = -3b(f) + 4y(f). Calculate x(2). 4 Let x(f) = f*3 - 3f*2 + f - 2. Let y be 47/2 + (-7)/14. Suppose -y = -5d - 8. Give x(d). 1 Let b(v) = -v*2 + 5v + 4. Let k be b(6). Let g = -3 + 6. Let c(o) = o*3 - 33o - g + 17o + 14o + o*2. What is c(k)? -3 Let q(b) = -5b2 + 1. Let p = -13 - -14. Let z be p/(-3) + 2/(-3). What is q(z)? -4 Let w(z) = -z3 - 7z2 + 10z + 16. Let o be w(-8). Let q(l) = l*3 + l - 4. What is q(o)? -4 Let g(w) = 43w3 - w2 - 10w. Let p(q) = 29q3 - q2 - 7q. Let m(y) = -5g(y) + 7p(y). Give m(1). -13 Let d(v) = -v2 - 7v - 5. Let s be (-1704)/(-108) - 4/(-18). Suppose 4j + s + 0 = 0. Determine d(j). 7 Let d(b) = 7b - b - 6b - 2 + 3b. Give d(5). 13 Let g = 7 + -5. Let z(m) = -g - 5m - 3m + 3m + m2. Calculate z(4). -6 Let i be 3/6-4 - -1. Let r(b) = -5b2 - 7b - 5. Suppose 3 = 5y + 23. Let s(u) = u2. Let p(n) = ir(n) + ys(n). What is p(-5)? -5 Let c(d) be the first derivative of -4d*2 - 3d - 5. Let w(q) = -q. Let u(o) = -c(o) + 6w(o). Let a be ((-10)/(-6))/(2/(-6)). Calculate u(a). -7 Let c(h) = -4h. Let r(g) = -g. Let n(u) = -c(u) + 3r(u). Let y be -6 + (-1 - -5 - 3). Let v be n(y). Let k(l) = -l2 - 3l + 6. What is k(v)? -4 Let z(x) be the third derivative of -x4/24 - x3/6 + 2x2. Let q(a) = -a - 6. Let c be q(-5). Let r be c + -31/(-3). Calculate z(r). -1 Let f(u) = u*2 - u + 1. Suppose -3 = 5z - 13. Let r be ((-3)/z)/(3/(-10)). Suppose 4 = rb - b. Calculate f(b). 1 Let c(v) = v - 4. Let j(g) = -5g + 20. Let n(d) = -11c(d) - 2j(d). Give n(5). -1 Suppose 4l + 4y + 12 = 0, 4l - 4y = 23 + 5. Let b(h) = 2 + 2hl - 4h - 9h3 + 3h - 2. Calculate b(1). -8 Let g(b) = -3b3 - 6b*2 - 6b - 4. Let n(k) = -4k3 - 6k*2 - 6k - 5. Let u(s) = -3g(s) + 2n(s). Give u(-4). 10 Suppose 3p - 7p = -12. Let o(r) = 1 - pr + 6r - 5r + 3r. Give o(5). 6 Let s be (-92)/(-22) + (-4)/22. Let k(o) = 5 - s + 4o + 0o + 6o. What is k(-1)? -9 Let o(w) be the first derivative of -w3/3 + 3w*2 + 5w - 2. Suppose -4g + a = -15, -3a + 8a - 10 = 3g. Determine o(g). 10 Suppose 1 = -4h + 13. Let d(j) = 3j + 2. Let p(t) = 1. Let k(n) = d(n) - 5p(n). Calculate k(h). 6 Let x = -4 - 1. Let a(w) = -w3 - 7w*2 - 8w - 3. What is a(x)? -13 Suppose 2 = -3o - 7. Let a(l) = 2l + 3. Give a(o). -3 Let t(a) = 2a3 - 6a2 + a - 1. Let v(m) = m2 + 1. Let b(z) = t(z) + 3v(z). Suppose 6x - 3x - 3 = -3d, 5 = 2d - x. Determine b(d). 8 Let n(i) = -3i + 3. Let o = 55 + -52. Determine n(o). -6 Let y(a) = -5a. Let h = -2 - -7. Let n = -7 + h. Give y(n). 10 Let q(i) = 2i + 6. Let d be 2 + (-5 - 1) - 13. Let b = d - -11. Calculate q(b). -6 Let p(a) = -a*2 - 11a - 7. Let r be p(-9). Let f = -7 + r. Let u(y) = -y + 3. Let z be u(f). Let v(n) = 6n3 - n2 + 1. Calculate v(z). -6 Let h = 12 - 3. Let p(n) = 2 - 4n - 5 + hn. Let y = 2 - 0. Calculate p(y). 7 Let b(x) = -x2 + 4. Let c(u) = u3 + 6u*2 - 7u - 3. Let w be c(-7). Give b(w). -5 Let f(v) = -v*3 - 3v*2 - 6v - 4. Let l(b) = -b*3 - 2b*2 - 5b - 4. Let n = -13 - -7. Let r(j) = nl(j) + 5f(j). Determine r(3). 4 Let t be (-247)/(-52) - (-2)/8. Let f(j) = -j*2 + j + 4. Let b be f(0). Let q(l) = l	{ "pile_set_name": "DM Mathematics" }
? 17/4 What is (-28)/8(-137)/((-822)/(-36))? 21 Evaluate (((-2)/7)/((-32)/56))/(((-12903)/180)/(-253)). 30/17 What is the value of (((-288)/(-42))/(-16))/((-36)/42)? 1/2 What is the value of 1323/(-378)(-130)/(-7)? -65 What is the value of ((-2)/(-1))/2(-101)/808344? -43 Evaluate 2798/6995(-75)/(-24). 5/4 What is (22235/53364)/((-15)/(-1332))? 37 Evaluate (1018/(-1620))/(42/18). -1/21 ((17465/1497)/(14/24))/(4/6) 30 Calculate ((-114114)/13794(-11)/(-2))/(-12/4). 91 What is the value of ((-6674)/(-142))/(6/6)? 47 What is the value of -16-1(-20)/(-6)726/(-605)? -64 (372/48)/(40/160) 31 Evaluate (6/18)/(302/(-42582)). -47 Calculate (936/273-5)/((-3)/14). 80 Calculate ((943/(-615))/(-23))/16. 2/5 Evaluate 360/(-630)(-49)/(-32). -7/8 What is the value of (4422/536)/(613/936)? 99 What is ((-10)/1-1)/(((-93)/1395)/(9/30))? -45 Evaluate (7/(-42))/(13/195)42/15. -7 Evaluate (-36(-1189)/(-1740))/((9/(-30))/(-1)). -82 What is the value of ((-7)/(-1))/(1653/(-3306))? -14 What is (8/(-42))/((((-992)/(-2))/(-16))/(14/4))? 2/93 What is the value of (-10)/(-26)221/(-204)? -5/12 Evaluate ((-84)/(-448))/(((-14)/(-196)12)/(8/7)). 1/4 What is the value of (-41)/(82/28)9/108? -7/6 Evaluate (870/5075)/(14/(-49)). -3/5 (3/(-6))/((-2291)/(-158)) -1/29 Calculate 180/145838/(-3753). -20 What is ((((-12)/(-9))/1)/((-3)/9))/((-44)/(-528))? -48 Calculate (-24)/(-6)23/((-2392)/3)-8. 12/13 What is the value of (-3(-33)/198-10)/3? -5/3 What is the value of (-90)/(-99)-1(-726)/44? 15 Evaluate 144/208020-26/12. -18/13 What is ((-1)/10)/(14991/(-399760))? 8/3 Calculate 72/336((-5)/(20/(-14)))/((-762)/127). -1/8 What is ((-14994)/136)/(-7(-297)/(-1848))? 98 What is the value of -40(-2)/((1-3)/((4182/68)/41))? -40 Calculate (14/(-6))/((2424079/126)/811). -6/61 What is (2/(-1))/(4/6(-1890)/(-350))? -5/9 What is (-144)/(-7)686/(-7448)-38? 72 What is the value of 1/((-20)/(-35)109/(-1308))? -21 (-52)/((-3016)/145)3(-380)/25 -114 Evaluate 279/(-3)(-2)/(-36)124/(-62). 31/3 What is (-10)/(-54)439875/21250? 23/6 What is 52/(-33930)-8736/60? 2/25 What is (6/(3024/(-15)))/(6940/(-4858))? 1/48 Calculate (-3)/(-34)(-8859)/(-26577). 1/34 ((28/350)/(5/(200/4)))/(82/5) 2/41 (((-85)/680)/(2/16))/(12/(-16)12) 1/9 (-120)/2203762/(-10773) 4/21 What is (17342/(-333336))/((-18)/(-8))? -1/129 7(-90)/(-180)18/(-45)(-10)/(-32) -7/16 What is (-28)/105-10(-508)/34544? -2/51 Evaluate ((-79)/316)/(((-3)/(-24))/(-1)(-16)/744). -93 What is the value of 185-7((-27)/(101871/(-22)))/((-35)/(-49))? -74/7 (2/4-1090/105)/(81/(-756)) 40 What is (-8)/52((-16)/(-336))/((-350)/1470)? 2/65 Evaluate 210(24(-9)/1080)/(-5). 42/5 Calculate ((-7284)/1821)/((9/6)/((-30)/(-5))). -16 Evaluate (154/1386)/(-1238/126). -1/17 What is (1096/959)/((-10)/28)(-55)/11? 16 What is 2-262363/1452? -131 What is the value of (-4)/(-24)-424/40135/(-378)? 1/7 What is the value of ((-11)/((-352)/24))/((-5)/(820/3))? -41 Evaluate (5278/(-2639))/((-1)/3). 6 Calculate ((-18)/33)/(5/(-6)-11(-4)/110). 18/11 What is the value of (-245)/(-273)2651/24106/11? 7/13 What is the value of (93/(-2))/(219/233616)? -31 What is (-4)/(-5)-33310/16368? -1/2 Evaluate 725/(-10)624/(-780). 58 What is ((-262)/(95892/10431))/(6/(-32)-4)? -38 ((-135)/((-8370)/(-3844)))/((-4)/(-24)-3) 124 What is (-6)/3(1/5)/((-33)/(2805/(-442)))? -1/13 What is the value of (-36)/2(-2643)/(-7929)? -6 Evaluate 63/1413064/(-5112). -23/2 What is the value of (136/(-85)-3(-119)/42)/((-28)/(-70))? -34 What is (-1)/1152/((-2584)/(-68))3? -12 What is ((-7686)/1098)/((-7)/(-83))? -83 What is ((-11052)/68768)/(3/40)? -15/7 What is ((-903)/(-735))/((-6)/30)7? -43 What is (((-2688)/(-20))/(-8))/(35/(14000/(-120)))? 56 ((-293)/((-28421)/22116))/3 76 Evaluate 109634/1346932(-4)/(-14). 1/43 Evaluate 157-234/68. -57 What is 13/(-754)8/1821/(-7)? 2/87 Calculate (9/35)/((-987)/56416/(-420)). 27/7 Evaluate (-7)/45560/228655. -2/47 Evaluate 132/1210110/(-80). -3/20 (39/((-858)/40))/(((-16)/72)/((-1)/9)) -10/11 What is ((-8)/(-14))/((-5100)/26775)? -3 2/(((-750)/(-42600))/(15/363/2)) 71 Calculate -23/99-29(-1364)/(-46748). 2/39 Evaluate -66((-434)/7595)/((-11)/((-55)/6)). 22/7 Calculate (20/28)/(((-11)/(110/2))/((-18)/(-75))). -6/7 ((-192)/(-4224))/(2077/(-341)) -1/134 What is the value of (116/609-33)/(((-5)/(-7))/(-5))? 44 Calculate (1/(-2))/(3(-255)/1836(-2)/1). -3/5 What is 432/4968((6/(-27))/(-1))/((-6)/(-9))? 2/69 What is the value of ((-542)/3794)/(2/(-98))? 7 What is 6063/(-2268)12? -20 ((-144)/(-15))/(15048/47025) 30 Evaluate ((-2)/(-8))/((-7045)/(-169080)-1292/4). -4/43 324/(-2079)(-51051)/102 78 Evaluate (2/(-5))/((-9)/(-90))5699/278. -82 What is the value of (4/(-9))/((-464)/80450/(-135))? -2/87 (((-5)/(-30)-2)/(-7)3)/((-182)/26) -1/49 ((-8964)/(-3486)(-14)/(-15))/(6/100) 40 What is 216/(-72)15/(945/117)? -13/4 Evaluate (835/(-1904))/((-180)/306). 1/4 2796/(-1165)8(-30)/12 48 What is (3/(-4))/(((-16)/(2368/(-5)))/((-85)/(-51)))? -37 Evaluate -61/((-2176)/48)3(-8)/36. -3/34 What is the value of (115/(-5)4/(-10))/(5364/(-40230))? -69 Evaluate ((-4)/(-52))/(31/((-15717)/(-468)))(-102)/4. -17/8 Calculate ((-10680)/1424)/((63/112)/(2/((-32)/(-12)))). -10 What is (500/(-8750))/(-43/(-42))-53? 53/5 Calculate (-2)/(-215/10)43/(63210/(-90)). -2/49 Evaluate (1255/(-120480))/((-2)/(-8)). -1/24 What is -310(-17391)/9486? 55 What is the value of (96/(-36))/(((-3)/42)/(19/((-760)/90)))? -84 8(-49)/((-5586)/(-3515))3/10 -74 Calculate (63/4)/((-92)/(-161)35/(-80)). -63 Evaluate ((1/(-95))/(57/(-114)))/((-6)/5). -1/57 What is (-1115)/(35410/7082)? -23 What is (-12)/2145591/668? -39 Calculate (-96)/5((-90)/(-279))/((-316)/(-2449)). -48 What is the value of ((30/9)/5)/((-17)/((-1581)/2))? 31 What is (6/120)/(28/(-7280))? -13 What is the value of 1/(-50)1/((-2)/(-12))(-23400)/(-11700)? -6/25 What is ((-1738500)/(-95))/12223/36? 25 What is the value of 282/(-141)(-75)/70? 15/7 Calculate 102/306(-1)/((-42)/(-4)). -2/63 What is the value of ((-2992)/132(-3)/51)/(((-8)/90)/(-2))? 30 Calculate 2-7(264/12)/88. -7/2 Calculate (-42)/74/(7/(14/16)). -3 What is ((7/(-28))/(1232/396))/(27/(-72))? 3/14 Calculate (-24)/63/(-1)(-27)/81. -4 Calculate (71/(47215/38))/(660/35(-5)/(-15)). 1/110 What is the value of 32/(112/((-728)/(-52)))? 4 Calculate ((-178)/1513)/((-90)/(-850)). -10/9 Calculate (-288)/72(-232)/4(4/4)/32. 29/4 What is 56/216462/(-66774)? -8/31 Evaluate 0/((36/(-30))/(((-585)/(-75))/13)). 0 What is ((-2)/(-20))/(3716/668880)? 18 What is 202122/(-1232)6? -45 Evaluate -63/9(-455)/(-546). -5/3 3/(27/((-54)/6))-7 7 Calculate 1/(-35)(-967)/((-8703)/240). -16/21 What is the value of ((-184)/138)/(74(-2)/12)? 4/37 ((-168)/(-2856))/((-56)/(-68)) 1/14 What is the value of ((3/(30/25))/((-110)/88))/35? -2/35 Evaluate ((-442)/832)/17(-1080)/54. 5/8 Calculate (-1)/(-78)-32(-678)/452. 8/13 Evaluate (-351)/90((-240)/(-24))/(108/9). -13/4 What is the value of 4581/12216(-400)/(-6)? 25 6/3635/(210/(-36))144/3 -48 Calculate ((-516)/645)/((-5)/150). 24 Evaluate 8120/(-725)(-810)/144. 63 What is the value of (-33)/6(-24)/(-968)? -3/22 What is (((-47985)/75405)/(6/22))/((-1)/(18/7))? 6 What is the value of (64/(-18))/4(-148)/(18056/(-366))? -8/3 Calculate (-157)/((-1577850)/120)15/(-4). -3/67 What is the value of ((-31632)/9226)/((-6)/(-231))? -132 What is the value of ((4914/3861)/(2/(-88)))/1? -56 (2/(-133))/(1993/41231) -2/57 What is the value of 8(-6)/198(-2)/(68/(-255)5)? -4/11 Calculate ((-421)/(-2947))/((-4)/(-4)). 1/7 Evaluate ((-169)/2535)/(12/(-400)). 20/9 Calculate (12/(-6))/(((-15336)/(-2106))/(-142)). 39 Calculate (19/34)/((-610)/(-20740)). 19 What is the value of 71097/32814(-6)/(-286)? 1/22 Evaluate 312/132-16(-15)/1920. 6 (((-57)/2)/((-720)/(-320)))/(48/72) -19 (-71280)/(-1800)30/856/126 66 (((-8)/28)/((-3)/14))/((-350070)/75015) -2/7 1110/(-518)1/5 -3/7 Evaluate 129338/(-29395)(-100)/(-22). -20 What is the value of 35(-187)/(-33)270/1785? 30 What is 1/(((-7)/6)/(5/(360/(-252))))? 3 Evaluate 42/(-15)(-8025)/(-642). -35 What is the value of 2/4-3(-138848)/1197564? 4/23 What is ((141/470)/((-1)/(-1)))/(27(-11)/(-495))? 1/2 Cal	{ "pile_set_name": "DM Mathematics" }
16. 16 Let w(l) = -6l + 356. Let m be w(47). What is the highest common factor of m and 962? 74 Suppose 65b + 1705 = 70b. What is the greatest common divisor of b and 62? 31 Let g = 0 + 3. Suppose gt - 660 = -0t. Suppose -4x + 0x = -t. What is the greatest common factor of 5 and x? 5 Let u be 0 + 0 - (1 - 3). Suppose -3302c + 3x + 10 = -3301c, -5x = 2c - 42. Calculate the highest common divisor of u and c. 2 Let s = 58 - 40. Let j be (40/50)/((-2)/(-180)). Calculate the greatest common divisor of j and s. 18 Suppose 5c + l = 9363, 10 - 7 = l. Calculate the highest common divisor of c and 6. 6 Suppose 5s - 2 = 3s. Let w(i) = 21i. Let m be w(s). Let r(z) = z*2 - 170z - 1970. Let a be r(-11). What is the greatest common divisor of m and a? 21 Let g = -170 - -215. What is the greatest common divisor of g and 120? 15 Suppose -47j = -17j - 1620. Suppose 0 = 3v + 2v - 30. What is the highest common factor of j and v? 6 Suppose 15g = -133 + 1078. What is the greatest common divisor of g and 252? 63 Let n(w) = 9w - 24. Let g be n(9). Calculate the highest common divisor of g and 551. 19 Suppose -5617 = -22q + 3953. What is the greatest common divisor of q and 15? 15 Suppose 9f - 200 = 4f. Suppose -5b = 3u - 49, 5b + 3 - 49 = -2u. Calculate the highest common factor of b and f. 8 Suppose 4q = 2q + 6. Suppose -qn - 4b + 502 = 0, 0b + b - 848 = -5n. Let h = n - 79. Calculate the greatest common factor of 13 and h. 13 Let g = 1805 + -1791. Suppose 3z + 21 = 3t, 3 = -t - 2z + 1. Let a = t + g. Calculate the greatest common divisor of 27 and a. 9 Let t(y) be the third derivative of 5y4/6 - 5y*3/3 + 11y*2. Let o be t(3). What is the highest common factor of 20 and o? 10 Suppose -5a + 15 = 2u, 0 = -5u + 2u + 3a + 54. Let w = -8 + u. What is the highest common divisor of w and 35? 7 Let r(d) = d*3 + 3d*2 - 3d. Let g = 13 + -10. Suppose -4 = -4l + 2a + 4, 0 = -ga. Let h be r(l). Calculate the greatest common divisor of h and 2. 2 Let h(a) = -a2 - 8a + 22. Let l be 292/(-20) + (-4)/10. Let z be h(l). Let n be z/(-9) - (-6)/(-27). What is the greatest common factor of 54 and n? 9 Let z be -4(-21)/(-2)6/(-14). Suppose 0 = 5o - 172 - z. What is the greatest common factor of 95 and o? 19 Suppose 0 = -8p + 1369 + 1575. What is the greatest common factor of 4 and p? 4 Suppose 2f - 3a = 268 - 56, 0 = -f - a + 116. What is the highest common factor of f and 4? 4 Let n be (4 + -2)(7 + -9). Let h be -1 + (4 - 2) - n. Suppose 3r - h = 2r. What is the highest common factor of r and 15? 5 Let u(a) = -7a*2 + 3a + 2. Let p be u(-1). Let z = 64 + p. Suppose -2r - 22 = -4f, r = 5 - 0. Calculate the greatest common divisor of f and z. 8 Let s be 8 + -1 - (13 + -20). What is the greatest common divisor of s and 147? 7 Suppose -4o + 92 = 2t, -37 = -t - 3o + 5. Calculate the highest common factor of t and 2538. 54 Let l(w) = 13w*2 - 7w + 9. Let p be l(3). Suppose -3j - 23 = -68. What is the highest common divisor of p and j? 15 Suppose 6t + 251 = 1295. What is the highest common divisor of t and 6? 6 Let q be (7 - -62) + (-3 + 7)-1. What is the highest common divisor of q and 39? 13 Let l be 716 - (2/(-4))/((-2)/8). What is the highest common divisor of l and 42? 42 Let l be 2(-3)/824/(-6). Suppose 2d + 160 = ld. Let g(i) = -21i - 1. Let x be g(-1). What is the greatest common factor of x and d? 20 Let z(b) = b*3 + 13b*2 + 31b + 22. Let w be z(-10). Calculate the greatest common divisor of w and 54. 6 Let i = -5 - -8. Let h = -112 - -114. Suppose -6 = 2u, -hv - u + iu + 14 = 0. What is the greatest common factor of 8 and v? 4 Let x = 38 + 3. Suppose 19 + x = 2k. What is the greatest common divisor of k and 120? 30 Suppose -3r = -h + 140, -2r = -3r - 5. Calculate the greatest common divisor of h and 175. 25 Suppose 4x - d = 151 + 301, 0 = -3x + 3d + 330. Suppose 24 = p - 5a, -2a - x = -6p + 2p. What is the greatest common divisor of p and 203? 29 Let p be (-34 + 35)/(2/130). Calculate the highest common factor of p and 10. 5 Let g = -8 + 47. Let v = -19 - -25. Suppose 2d - 58 = -v. What is the highest common divisor of g and d? 13 Let s(i) = -3i*3 - 3i*2 - 29i - 144. Let r be s(-6). Calculate the highest common divisor of r and 45. 15 Suppose -u + 4x + 30 = -1, -160 = -4u - 2x. What is the highest common factor of 52 and u? 13 Let t be 9 + (2 - 7) - -524. Calculate the highest common factor of 48 and t. 48 Let w = 129 + -123. Calculate the greatest common divisor of 222 and w. 6 Suppose -2k - 53 = -1. Let u be (-16 - -12)k/(-4). Let y = -8 - u. What is the greatest common factor of y and 36? 18 Suppose x = -4j - 4x + 122, -x = -j + 35. Calculate the highest common factor of 187 and j. 11 Suppose 20y - 10y - 440 = 0. What is the greatest common factor of 172 and y? 4 Suppose 406 + 654 = 5k. Suppose -x - k = x. Let p be (-2 - -2) + 4 - x. What is the highest common divisor of p and 22? 22 Let u = 14 - 8. Suppose 2k - 5k = 30. Let m(i) = i*3 + 11i*2 + 10i + 6. Let r be m(k). Calculate the highest common factor of r and u. 6 Suppose -2o - 4x = -8, 2o - x = -0o + 13. Calculate the greatest common factor of o and 81. 3 Let m be ((-4)/4)/((-2)/8). Suppose w - 56 = mp, 3p + 3 = 9. Suppose -3j + 96 = 5g, j + 3g = -j + w. What is the greatest common divisor of j and 4? 4 Suppose -138u + 4y = -139u + 2027, 0 = u + y - 2039. What is the highest common factor of u and 9? 9 Let l(z) = 26z - 76. Let y be l(6). What is the greatest common factor of y and 100? 20 Suppose 4k - 2 = 2, -4o - 3k = -59. Let z(y) = -6 + 3y3 - 5y*2 - 2y3 - y2 + 3 + 7y. Let v be z(5). What is the greatest common factor of o and v? 7 Suppose 37 = 6b + 7. Suppose -5k - bk + 340 = 0. What is the greatest common divisor of 340 and k? 34 Suppose -4q + 40 = -2q. Let d = -16 + q. Let w be d/(12/27) - -2. Calculate the greatest common factor of 11 and w. 11 Let r = -12 - 108. Let u = 450 + r. What is the highest common factor of u and 30? 30 Let l(t) be the third derivative of t5/60 + t4/12 + 4t3/3 + 10t*2. Let a be l(6). Calculate the highest common factor of a and 7. 7 Let y = 76 + -28. Suppose -5l = -l - y. Suppose -2u = u - 24. What is the highest common factor of l and u? 4 Let p be (-1)/(3/(-424)) - 6/(-9). Let y = 133 + p. Calculate the highest common divisor of y and 25. 25 Suppose 0q - 2q - 3p + 8 = 0, -5q + 3p = -41. What is the greatest common factor of q and 7? 7 Let w be -32/(-12)-2. Let a be w(-8)/(1 + 1). Suppose 2f + 2r - 44 = -f, ar = -4f + 56. What is the highest common divisor of f and 16? 16 Suppose 177l - 180l = -36. What is the greatest common factor of 96 and l? 12 Suppose 19i - 15i = 148. What is the highest common factor of i and 74? 37 Let m be (-8)/12(-6)/(-4). Let u be m/((-3 + 2)/5). Let n = 32 + 8. What is the greatest common divisor of u and n? 5 Let x be (-2 + 1)-2 - -31. What is the highest common factor of x and 11? 11 Suppose 5m + 66 + 26 = 2p, 0 = -5p - 2m + 259. Let a = p + -4. Calculate the greatest common divisor of a and 47. 47 Suppose -4r + 8 = 4. Let c be r - (-5)/((-10)/(-6)). Let m be (14/(-77) - (-348)/99)3. Calculate the greatest common divisor of m and c. 2 Let p(b) = -b3 + 12b*2 + 6b + 26. Let n be p(12). What is the highest common factor of 2 and n? 2 Let z = -58 - -58. Suppose 4r + k - 25 = -4k, 5r + 5k - 30 = z. Calculate the greatest common factor of 30 and r. 5 Let z = -81 + 42. Let x be z((-21)/(-2))/((-72)/32). Calculate the greatest common divisor of x and 26. 26 Let v be 9 - 7/((-7)/4). Suppose -8 = -2d + 4x, -3d + 0d + x + 2 = 0. Let c be (d - 1) + 140. Calculate the highest common divisor of v and c. 13 Let a(g) = -59g - 183. Let u be a(-5). What is the highest common divisor of u and 504? 56 Let x be ((-28)/(-42))/(1/84). Let u = 36 + -22. What is the greatest common factor of u and x? 14 Suppose 33x - 32x = -2. Let y be 5(x + 8) - -3. Calculate the greatest common factor of 3 and y. 3 Suppose -25 = 3u - 37. Suppose uq = -2p + 78, 3p + q - 127 = -25. What is the highest common divisor of p and 3? 3 Let r = 506 + -472. What is the greatest common factor o	{ "pile_set_name": "DM Mathematics" }
v + 3. Let r be q(4). Suppose 4y - 800 = -5t + r, 2t - 5y = 316. Is t prime? True Suppose 3q - 6q = 15. Let w(b) = -5b*2 - 2b - 9. Let o(h) = -6h2 - h - 10. Let u(y) = 3o(y) - 4w(y). Is u(q) a composite number? False Let x(l) = l3 - 13l*2 - 13l - 12. Let f be x(14). Suppose -7 = fk - d - 23, 44 = 4k - 5d. Is k composite? True Let h(y) be the first derivative of 11y7/840 - y6/180 + y4/24 - y3/3 - 1. Let g(k) be the third derivative of h(k). Is g(1) a composite number? True Let l(t) = 5t2 - 2t - 8. Is l(-5) prime? True Let o be ((-6)/12)/((-1)/270). Let l = -68 + o. Is l composite? False Is 9/6-2 + 392 a prime number? True Let v(u) = u3 - 4u*2 + 2u + 2. Let j be v(3). Let l be 0 - (8 - (-1)/j). Is (1 - 2)(l + -2) prime? False Is (3/(-9))/(1/(-57)) a composite number? False Let r(b) = b2 - 10b + 3. Suppose 2v - 12 = u, -3u - 22 = v + 7. Is r(u) composite? True Let x be 27 - (-1 - -4)/(-3). Let t = 49 - x. Is t a composite number? True Suppose 2583 = 5n + 3w + w, 0 = 4w - 8. Suppose 0s + 5s = n. Is s prime? True Suppose 1 = 3z - 4z. Let q = z - -26. Is q a composite number? True Let h(v) = v + 11. Let r be h(-7). Suppose 4f = -s + 206, -3s - f + 573 = -rf. Is s prime? False Let i be 580/(-18) + (-8)/(-36). Let g = i - -83. Is g a composite number? True Let c(s) = s*2 - 3s - 5. Let p be c(5). Suppose -3l + 30 = -pl. Let r = l - -226. Is r prime? True Let r(d) = d*3 - 8d*2 + 14d + 10. Is r(7) a prime number? True Suppose 1 = 4z + 5. Let x be 1 - ((2 - 1) + z). Is (3 + -4)/(x/(-83)) a prime number? True Suppose 13j + 686 = 27j. Is j a prime number? False Let l(n) = 42n*2 + 2n + 7. Is l(-3) prime? True Is 67 + -23/3 a composite number? True Let m(o) = o3 - 7o*2 + 11o + 11. Is m(8) a composite number? False Let p be 4 - (2 - (3 + 80)). Suppose r = 124 + p. Is r a composite number? True Suppose 4n - 3c - 20 = 0, 2n + 0n = -2c - 4. Suppose -ny = -y. Suppose 31 = -yx + x. Is x prime? True Let p(l) = -l + 1. Let j be p(-3). Let k(m) = m2 + 5. Is k(j) a prime number? False Suppose 0l + 2l + 3t = -11, 5t - 3 = 2l. Let x(s) = s*2 + 4s + 2. Let p be x(l). Suppose 3y - 379 = 2r, 169 = py - 4r - 81. Is y composite? False Suppose 2m = -x + 352, x + 194 = 2m - 166. Let g(k) = -k + 4. Let w be g(4). Suppose -4l - 30 + m = w. Is l a composite number? False Let j be 0 + (1 - 2) - -1. Let l be (j - 0) + 146. Suppose 3w + 7 = l. Is w composite? False Suppose -3c - 6s + 5s = -578, -3c - 4s + 593 = 0. Let r = c - 88. Is r a composite number? False Let c(i) = i + 5. Let p be c(11). Suppose 5u = -4s + 29, -3s - p - 23 = -3u. Is 6/9 + 1281/u composite? True Let f = 15 - 1. Is (-9 - 34)/((-2)/f) composite? True Let h = 4900 + -2801. Is h prime? True Let j be (-2)/6 - 26/(-6). Suppose 256 + 321 = 4t + 5q, 4q = j. Is t a composite number? True Let r = 5 + -2. Suppose -7c = -2c - rx - 1804, 0 = -3x - 9. Is c a prime number? True Let c be (-1)/((-2 + 4)/(-2)). Let i be (-20 - 2)/(-2 + c). Is i + (-1 - (0 + 0)) prime? False Is -3(-29 + 4 + -4) a prime number? False Suppose 0j - 5j + o - 6 = 0, o = 4j + 4. Is (4/j - -139) + -3 prime? False Let p be 0/(-1) - 21. Let h be 44 + 1(p + 4). Suppose f + 0f = h. Is f composite? True Let f = 1 + 1. Let q(j) = 5j2 - 2j + 2. Let y be q(f). Suppose -4g + 10 = -y. Is g a prime number? True Let t be (-2)/4(-8)/2. Let w = 69 + -34. Suppose ts - 101 = 5h - w, -h - 96 = -4s. Is s prime? True Let c(s) = -s - 5. Let b be c(-7). Suppose -5h = q - 1, 2h = -bh. Is q - -12(-12)/(-3) a composite number? True Is 2/(16/12)106 composite? True Let l = 0 + 2. Let j(x) = x*2 - 5x + 2. Let s be j(6). Suppose -lp - s = -38. Is p composite? True Let z be -1 - 1 - (-200)/(-5). Let m = 187 + z. Is m composite? True Suppose 3 = 4s - 9. Suppose -d - 3d + 271 = -3i, sd - 200 = -i. Is d a composite number? False Suppose -5t + 39 = -4u, -5u - 3t - 18 = t. Let m = u - -11. Suppose -56 = -mi + 49. Is i a prime number? False Let c(a) = 69a3 + 12a*2 - 16a + 21. Let q(k) = 17k3 + 3k*2 - 4k + 5. Let t(r) = -2c(r) + 9q(r). Is t(2) a prime number? True Suppose 3d - 5 = 2d. Suppose 0q - 4q + 163 = -3w, dq - 205 = 4w. Is q a prime number? True Suppose 4s + 4v = 2s + 1266, 3v = -4s + 2522. Is s a composite number? True Let f(y) = -4y + 7. Let d be f(5). Let x = d + 38. Suppose x = 5z, -2z = 2v + 2v - 142. Is v a prime number? False Let q(n) = 57n*2 + 13n - 1. Is q(-6) composite? False Let h(a) = 7a2 + 7a + 4. Is h(-3) a prime number? False Let h(o) = o*3 - 8o*2 - 5o - 1. Let r be 194/22 + (-6)/(-33). Is h(r) a prime number? False Is (1 - -94) + (-12 - -14) prime? True Let r(p) = 5p3 - 6p*2 - 7p + 1. Let u be r(5). Suppose u - 1253 = -4l. Is l a composite number? True Is (-4)/16-4 + 5876/2 composite? False Let j(z) = -z*2 + 67. Suppose 2i + 0 = -8. Let l = i + 4. Is j(l) a prime number? True Suppose -q = -5r + 26635, -3r - 2r = 4q - 26635. Is r composite? True Suppose 2342 = 5b + 867. Is b a prime number? False Let o be (-15)/(-3)1 - 0. Is (-12)/(-60) - (-1114)/o composite? False Suppose 0 = -3j + 2236 - 439. Let g = -388 + j. Is g a prime number? True Let r be 10/(-10)(-7 - -1). Suppose 0 = rw - 785 - 337. Is w a prime number? False Suppose -3h + 4 + 2 = 0. Suppose 0 = hv - 5v - 615. Let c = 354 + v. Is c a composite number? False Suppose -k = 3k. Suppose k = n + n. Suppose 3u - 3 - 18 = n. Is u prime? True Suppose 0 = -2b - 3b - 10, 4 = u - 2b. Suppose uz - 16 = -4z. Suppose zx + 50 = s, -232 = -5s + 4x - 2x. Is s composite? True Suppose 7n - 56 = 2583. Is n a prime number? False Let v(q) = 307q + 1. Let x be v(-1). Let m = x - -557. Is m a composite number? False Let w(p) be the first derivative of -17p*2/2 + 4p + 3. Is w(-3) composite? True Let i = 16 + -12. Suppose iz - 519 = 109. Is z prime? True Let o be (-1)/5 - (-64)/20. Suppose -5p - oy = -2 + 17, -4y = 2p + 20. Suppose 3t - 3 = p, 0t - 2t = l - 5. Is l prime? True Suppose -18 = t - 103. Is t a composite number? True Let w(x) = x*2 - 2x - 1. Let b be -12(-2 + 5/2). Let i = b - -2. Is w(i) a prime number? True Is (4/(-22) - (-3841)/11) + -3 composite? True Let m(d) = 92d*2 + 1. Is m(1) composite? True Suppose -3t + 4985 = 2t. Let w = t + -666. Is w a prime number? True Suppose -4 = -z - 0. Suppose -zn + 15 = -n. Suppose -w = 2 - n. Is w a prime number? True Suppose -3u + 2u + 4p = -200, -5 = -5p. Is (u/(-10))/((-10)/25) a composite number? True Let x(q) = q*3 + 5q*2 + 3q + 6. Let l be x(-5). Let t = l + 11. Suppose ta + 2a - 819 = -3g, a - 2g - 191 = 0. Is a prime? False Suppose -3s + 4z + 2 = -0, 5s - 4z - 6 = 0. Is s composite? False Is (-2)/7 - -9(-258)/(-42) composite? True Let u be (-1 + (-1)/(-2))-4. Let q be 54(-1)/1 - u. Is (-4)/10(q - -1) a composite number? True Suppose 0 = -2q + 14 - 4. Suppose -4k = 3p + 28 - 155, qp - 197 = -3k. Let o = 102 - p. Is o prime? False Let j(c) = 2c*2 + 9c - 9. Is j(-8) a composite number? False Let v(z) = -172z - 6. Let d be v(-3). Suppose d = 4j - i, 633 = 5j - 0i + i. Is j prime? True Suppose 3j - 148 = 5r, -j = -0j + 4r - 38. Is j + 0 - 2/(-2) composite? False Let k(p) = -130p - 23. Is k(-25) a composite number? True Is ((-2)/(-4))/(8/6704) a composite number? False Let h = 4 + -1. Suppose -4f - 12 = 0, f = k + hk - 15. Is (-4)/12 - (-274)/k a composite number? True Let r be ((-2)/(-4))/(3/354). Let x = r - 26. Is x a prime number? False Let h = 16 - 2. Is h a composite number? True Is 35(-4)/(-4 + 0) a prime number? False Let m = -2535 - -4820. Is m composite? True Let n = -1 + -5. Let x(w) = -6w2 - 14w + 1. Let p(a) = -5a2 - 13a. Let c(m) = 5p(m) - 4x(m). Is c(n) composite? True Let h be 23/6103. Suppose 0 = 5f - 303 + h. Let a = f - 25. Is a a prime number? False Let m = -4 + 4. Let n = m + -3. Is n/9 - 1074/(-9) a prime number? False Suppose 6y - 5y + 4u = 16, -13 = -y - 3u. Suppose c = 5a - 2c - 218, -ya = -c - 173. Is a a prime number? True Suppose -i + 6o = 3o - 11, 0 = -2i - 5o. Suppose 0 = -it + 40 + 25. Is t a prime number? True Suppose -l - 4g = 3*l - 194	{ "pile_set_name": "DM Mathematics" }
53725450? 50 Calculate the greatest common factor of 1133290 and 29030. 10 Calculate the greatest common factor of 49734890 and 40. 10 Calculate the highest common divisor of 255335 and 76489. 223 What is the highest common factor of 312552 and 19548? 108 What is the highest common divisor of 2 and 1048412? 2 What is the highest common factor of 2864763 and 26334? 1881 What is the greatest common divisor of 277975 and 8216941? 11119 Calculate the highest common divisor of 110068 and 2688. 28 Calculate the greatest common divisor of 6095040 and 3948. 84 What is the highest common divisor of 14416 and 12536514? 1802 What is the highest common divisor of 16 and 32046992? 16 What is the highest common divisor of 1567359875 and 250? 125 What is the highest common factor of 1340 and 428999660? 1340 Calculate the highest common divisor of 14284012 and 17. 17 Calculate the highest common factor of 32618 and 678038. 694 What is the highest common factor of 253090708 and 488? 244 What is the greatest common factor of 311067 and 102787? 41 What is the greatest common divisor of 471 and 60030677? 157 What is the highest common divisor of 191661651 and 10095? 2019 What is the greatest common divisor of 210 and 38282097? 21 Calculate the highest common factor of 97788160 and 2560. 1280 Calculate the greatest common factor of 1918208 and 144. 16 What is the greatest common divisor of 37735158 and 66258? 2454 Calculate the greatest common divisor of 4163518 and 44. 2 Calculate the highest common factor of 679702 and 15370. 58 What is the greatest common divisor of 981035 and 891? 11 What is the highest common factor of 3197372353 and 7379? 7379 What is the highest common factor of 1834 and 5233452? 14 Calculate the greatest common divisor of 93131392 and 16. 16 What is the highest common divisor of 268056 and 1095480? 1224 Calculate the greatest common factor of 68074142 and 82297. 4841 What is the greatest common factor of 2236212367 and 107? 107 Calculate the greatest common factor of 14720689 and 2. 1 What is the highest common factor of 77488 and 1744? 16 What is the greatest common divisor of 4119555 and 330? 165 What is the highest common divisor of 16271541 and 235? 47 Calculate the greatest common factor of 9688 and 12078514. 2422 What is the highest common factor of 16077 and 12078105? 69 Calculate the highest common divisor of 15140806 and 932. 466 Calculate the highest common divisor of 886499 and 2652. 17 Calculate the greatest common factor of 8143109 and 221. 13 What is the highest common factor of 86820 and 4? 4 Calculate the highest common divisor of 651 and 108299926. 217 What is the highest common divisor of 126449 and 23467? 31 What is the highest common factor of 4270731 and 39693? 393 What is the greatest common factor of 166071 and 1738722? 591 Calculate the highest common factor of 336 and 1917111. 21 What is the highest common factor of 8055257 and 7595? 1519 Calculate the greatest common factor of 46675 and 3075. 25 What is the highest common divisor of 44758084 and 112? 28 Calculate the highest common divisor of 191288574 and 8952. 2238 What is the highest common factor of 1391911 and 8894? 4447 What is the greatest common factor of 16464874 and 9010? 1802 Calculate the highest common factor of 22 and 14158. 2 What is the greatest common divisor of 41410952 and 1166? 22 What is the highest common divisor of 4598265 and 140? 35 Calculate the highest common factor of 1701 and 229509. 63 Calculate the highest common factor of 643326 and 9156. 6 What is the highest common divisor of 1751 and 279233? 103 What is the highest common factor of 531545 and 15? 5 What is the greatest common divisor of 27171 and 31230? 9 Calculate the greatest common divisor of 140225 and 818914. 5609 Calculate the greatest common divisor of 810 and 1857897. 81 What is the highest common divisor of 1945 and 141207000? 1945 Calculate the greatest common divisor of 95657 and 1196. 23 Calculate the greatest common factor of 2681152 and 41344. 64 Calculate the highest common factor of 72 and 2788045488. 72 What is the greatest common factor of 6241 and 780520? 79 Calculate the highest common factor of 96 and 554491596. 12 Calculate the highest common divisor of 23219 and 13433850. 3317 What is the greatest common factor of 2314780 and 28652? 1508 Calculate the greatest common divisor of 34485 and 5818978. 209 Calculate the greatest common divisor of 109680 and 402676410. 13710 Calculate the highest common factor of 4359973 and 51. 17 Calculate the highest common factor of 185816187 and 122. 61 Calculate the highest common factor of 2040066252 and 1362. 1362 What is the highest common factor of 9080790 and 36733? 109 Calculate the highest common factor of 304 and 14163189. 19 What is the greatest common divisor of 998928 and 11032? 56 Calculate the greatest common divisor of 60204424 and 168. 56 What is the highest common factor of 8602 and 14434904? 374 What is the greatest common divisor of 3858345 and 135? 45 Calculate the highest common factor of 104716 and 23500. 188 Calculate the highest common divisor of 959868 and 2344. 1172 What is the highest common divisor of 76702313 and 1597? 1597 What is the highest common factor of 11715487 and 161? 161 What is the greatest common factor of 228 and 24114990? 114 Calculate the greatest common divisor of 3852 and 23418. 18 What is the greatest common factor of 4466502 and 2647863? 9423 What is the greatest common factor of 202240 and 1105210? 790 What is the highest common factor of 92846572 and 213028? 11212 What is the greatest common divisor of 18967 and 497393? 13 Calculate the greatest common divisor of 312740 and 6080. 380 What is the highest common factor of 94982917 and 58? 29 Calculate the greatest common divisor of 209174859 and 108. 27 What is the greatest common divisor of 68928 and 31296? 192 Calculate the greatest common divisor of 144409800 and 6060. 6060 Calculate the highest common factor of 1130991 and 30747. 831 Calculate the highest common divisor of 80 and 350947216. 16 Calculate the highest common divisor of 985338 and 52942. 514 What is the highest common divisor of 3573 and 2023579269? 3573 What is the highest common divisor of 344728 and 47110024? 8408 Calculate the greatest common divisor of 4143519 and 262959. 2553 What is the highest common factor of 1280 and 60880? 80 Calculate the highest common factor of 60390 and 48740. 10 What is the highest common factor of 2977 and 1243699? 229 Calculate the greatest common factor of 27232764 and 116. 4 Calculate the highest common factor of 282 and 33732417. 141 What is the greatest common divisor of 23840 and 1995408? 2384 Calculate the greatest common factor of 90 and 1046210. 10 Calculate the highest common divisor of 140729652 and 63. 63 Calculate the greatest common divisor of 224307 and 16. 1 What is the greatest common factor of 628838 and 25746? 14 What is the highest common factor of 1161 and 684861? 129 What is the highest common factor of 379890 and 5741820? 1890 Calculate the greatest common divisor of 362988652 and 4. 4 What is the highest common divisor of 140 and 7415695? 35 Calculate the highest common divisor of 1312 and 14576812. 164 What is the highest common factor of 42 and 5997292? 14 Calculate the greatest common factor of 265 and 3856220. 5 What is the highest common divisor of 2234645 and 533365? 1715 What is the greatest common factor of 7280299 and 1053? 13 What is the greatest common divisor of 2461 and 1103563? 23 Calculate the highest common divisor of 813247 and 1704707. 841 What is the highest common factor of 1209765 and 10110? 15 What is the highest common factor of 244538 and 23366? 14 What is the greatest common factor of 3176 and 7488214? 794 Calculate the greatest common factor of 386775 and 7696345. 955 Calculate the highest common factor of 4636 and 271099372. 4636 What is the greatest common factor of 97495 and 2931140? 3145 Calculate the highest common factor of 24114856 and 56. 8 What is the highest common divisor of 16465 and 48327365? 185 Calculate the highest common factor of 111537 and 216189. 1377 Calculate the greatest common factor of 63392385 and 28140. 7035 What is the greatest common factor of 1	{ "pile_set_name": "DM Mathematics" }
- 4x2 + 20x + 3)(-3x + 5x + x). 324x*5 - 243x*3 Expand ((3 - 1 + 0)(2 - 2 - 2z) + 2z + 0z - 3z - 5z - z + 2z + 5z + z - 2z + 3z - 3z - 2z)(-2z + 2z + 2z). -14z*2 Expand 0v*3 + 2v*3 - 3v*3 + (2v*2 + 0 + 0)(6v + 0v + 0v). 11v*3 Expand (0t + 3t - 4t)(-893 + 36t + 229t + 891). -265t*2 + 2t Expand (2w + w - 5w)(1 - 6 + 3) + (2 - 2 + 2w)(27 - 1 + 9) + 2w + 2w - w + (2w + 4w - 4w)(-2 + 2 - 1). 75w Expand (-4t3 + 2t3 + t3 + t*3 + 0t*3 + 0t*3 + (t - t + t)(-t*2 - 2t2 + t2) - 6t3 + t3 + t3)(-3t + 5t + 7t)(-2 - t + 2). 54t5 Expand ((-27 - 40 + 40)((-v + 4v - 4v)(2 - 3 - 1) + 4v - 3v + v) - 2 + 2 - v)(0v + v + 0v). -109v2 Expand 6 + 5 - 276g + 305g - g4 + 3g*4 - 3g*4 + 2g*4 + (-2g + 0g + 3g)(g3 + g2 - g2). 2g*4 + 29g + 11 Expand (-2c + 2c + c)(-6c + 3c + 5c) + (-c + 2c + 3c)(-c - 15c + 2c). -54c*2 Expand ((2s + 0s - 3s)(4s - s - 5s) + 6s*2 - 3s*2 + 0s*2)(-2s + 16s - 6s). 40s*3 Expand (3v - 3v - v)(-5v3 + 0v*3 + 4v*3) - 10v + 4v4 + 10v + v + 14v4 + 2 - 9v*4 + v. 10v*4 + 2v + 2 Expand (1 - 1 + 2c - 2)(-2 - 6 + 1). -14c + 14 Expand (-5 - t + 447t*3 + 1 - 456t*3)(-38t - 24t + 14t). 432t*4 + 48t*2 + 192t Expand 2q2 - 3q*2 - 1 + 0q*2 + (0 + 0 + 7)(1 - 1 - q*2) - 2q*2 + 0q*2 + 3q*2. -7q*2 - 1 Expand (1 - 1 - h)(2h2 + 7h*2 + 0h*2) + 12h*3 - 16 + 16. 3h*3 Expand (y - y - y)(0y + 2y - y) - 1291y - 2 + 1291y - 8y2. -9y*2 - 2 Expand (-50k + 50k - 9k*2)(6k - 3k - k + (3k + k - 2k)(0 - 5 + 3) + k + 0k - 3k). 36k3 Expand (-1 - m3 + 1)(4 + 0 - 2) + 4m*3 - 2m*3 - 4m*3 - 2m*3 - 2m*3 + 2m*3 - 121m*2 + 121m*2 - 284m*3. -290m*3 Expand (0 - 2d + 0)(-17d - 20d2 + d4 + d4 + 19d*2). -4d*5 + 2d*3 + 34d*2 Expand -3 + 3 - 2c + (4c - 5c - c)(-3 + 0 + 4) + 2c - 5c - 8c + 5c + c - 4c. -13c Expand (-20l + 20l + 4l*4)(-1 + 1 - l) + 3 + 2l5 - 3 + (-125l*4 + 65l*4 + 49l*4)(-4l - 3l + 6l). 9l*5 Expand ((3l - 4l + 0l)(-3l*2 + 0l2 + l2) + 7l3 - 2l*3 - 2l*3)(227l - 156l + 101l). 860l*4 Expand (3j - j - j + 6j + 0j - 4j + (5j - j - 2j)(0 - 2 + 0) - 4j + 2j + 0j + 4j + 4j - 7j)(2j*2 - 24j + 49j - 4j*2). 4j*3 - 50j*2 Expand 16c*2 - c - 2c*4 + 0c*2 + 2630 - 2631 + (2c - 3c - c)(-c*3 + 0c*3 + 2c*3). -4c*4 + 16c*2 - c - 1 Expand (-2 + 4 - 3)(-v - 4 + 4)(v4 + 4v*4 - 2v*4) - 5v*4 + 5v*4 + 2v*3 + 2v*5. 5v*5 + 2v*3 Expand 1 + d - 1 + (0d - 5d + 3d)(-15 - 19 + 13). 43d Expand (4070f - 4070f - 26f3 + 2)(0f2 - 3f*2 - 2f*2). 130f*5 - 10f2 Expand d5 - 40d5 - 5d5 + (d3 + d*3 - 4d*3)(-2d2 + 2d*2 - 2d*2) + 2d*3 - 2d*5 - 2d*3 + (-5 + 4 + 0)(5d - d5 - 5d). -41d5 Expand -2h*3 + 2h*3 + 4h*3 + ((-1 - 3 + 5)(-3h - 2h + 3h) + 5 - 5 - 8h)(2 - 2 + h2) - 6 + 6 - 2h*3. -8h*3 Expand 0i*3 - 4i*3 + 2i*3 + (0 + 2i + 0)(i2 - 3i2 + i2) + 3i3 - 3i*3 - 3i3 + (0 + i2 + 0)(-4i + i - i) + 0i3 - 3i3 + i3. -13i3 Expand (29 - 22 + 30)(-36 + 4t + 36). 148t Expand (-3o2 + o2 + o2)(1 - 1 + 1)(0 - 10 + 4) - 2o*2 + 2o*2 + 5o*2. 11o*2 Expand (3u*2 - 2u*2 + 9u*2)(-60 - 12u2 + 60). -120u*4 Expand (-112a - 277a + 61a - 147a)(a + 2a - 4a). 475a2 Expand -5 + 1 - 9 - 4b + 11b + (6b - 5b - 2b)(-7 - 7 + 1). 20b - 13 Expand 694a2 - 11a*4 + 18a*5 - 694a2 + (-a5 + 2a5 - 2a*5)(2 + 1 - 5). 20a5 - 11a*4 Expand ((-3 - 1 + 2)(y + y - 4y) + 3y + 0y - 4y + (3y - 4y - y + (-2y + 0y + 0y)(-3 + 2 + 0) + 2y + 3 - 3)(-5 + 5 + 5))(-1 + 2y + 1). 26y2 Expand (174h + 74h - 108h)(0 - 1 + 0)(-4h + 3h + 2h). -140h*2 Expand (-u + 0 + 0)(2u + 3 - 3)(u + 5u - 3u)(-1 - 2 + 0). 18u*3 Expand 3x*5 + 8x*2 - 8x2 + (2 - 2 - x5)(-7 + 14 - 22) + (0 - 3x + 0)(3x - 3x + x4)(2 - 1 - 2). 21x5 Expand (-3 - 4 + 6)(0r + 3r*2 + 0r) + (r*2 + 0r2 + r2)(518 - 336 + 436). 1233r*2 Expand 10246 - 10246 - 29q + (-2q - q + 5q)(2 - 3 - 1). -33q Expand (6 - 4 + 17y - 15y)(y - 2y + 2y) - 29 + 29 + 12y*2. 14y*2 + 2y Expand (5 - 2b2 + 4b*2 + 0)(-163 - 34b + 163). -68b*3 - 170b Expand (-5 + 0 + 3)(3g*4 - 13g4 - g4) - 2g4 + 0g4 + 2 - g4. 19g4 + 2 Expand (-1 - 2 + 0)(-13u2 + 6u*2 - 7u*2 + (3u + 0u - 2u)(2u - 1 + 1) + 3u2 - 3u2 + u2). 33u2 Expand 5m*4 + 6m - 6m + (2m*3 + 3m*2 - 3m*2)(-3m + 3m + 2m) + (-2m + 0m + 0m)(-3 + 6 + 2)(29m3 + 6m*3 - 18m*3). -161m*4 Expand (11k - 5k + 33k + (-1 + 0 + 3)(-6k + 3k + 4k))(-5 + 2 + 2) - 3k - k + 5k + (3 + 1 - 2)(-k - 3k + 2k) - 4 + 4 + k. -43k Expand (-1 - 3 + 2)(50p5 - 15p*5 - 92p*5). 114p*5 Expand 2m + 2m - 2m - m + 0 + 0 + (-37 + 85 - 39)(0m + 3m - 2m). 10m Expand (-2 + 5 - 4)(2a + a - a) + (-2 - 1 + 2)(13 - 13 + 30a) + 4 - 2a - 4. -34a Expand (-511 - 186w*2 + 511)(3w - 3w + w*2). -186w*4 Expand (109k*3 - 109k3 - k4)((1 - 3 + 1)(1 - 5 + 2) - 2 + 3 + 1 - 10 + 3 - 6). 9k4 Expand (-2s + 1 - 1)(6 - 6 - 15s) + s*2 + 17s*2 - 2s*2 + 49s*2. 95s*2 Expand -5d*5 - 11d*5 - 5d*5 - 4d*5 + 0d*5 + 3d*5 + (2d*2 - 2d*2 + 3d*4)(-d + 3d - d). -19d*5 Expand 0s2 - s3 + 0s2 + (3s*2 - 2s*2 + 0s*2)(-73s - 9s + 23s) + 2s*3 + 0s*3 - 3s*3. -61s3 Expand -c3 + 2c5 + c3 + (3c + 5c - 3c)(507c*3 - 507c*3 - 23c*4). -113c*5 Expand (7 - 4 + 9)(132g2 + 53g*3 - 132g*2). 636g*3 Expand (0 - 2 + 35)(-8c + 8c + 1 - c*3). -33c*3 + 33 Expand ((-1 - 5 + 4)(0t - 5t - 8t) + 3 - 2 - 4t - 3t)(-4 + 2 + 1). -19t - 1 Expand 3o2 - o2 - 3o2 + (2 - 3 + 0)(-5o2 - o2 + 5o*2) + 0o*2 + 2o2 - o2 + (-o + 3o - 4o)(13340 - 13340 - 17o). 35o2 Expand (28 + 4c - 28)(6c + 2c + 4c + (1 + 2 - 5)(0c + 3c - 2c) - 1 - c + 1). 36c2 Expand (1 - 1 - 3a*2)(6 - 2 + 1)(19a*3 - 47a*3 + 369a - 374a + 2a*2). 420a*5 - 30a*4 + 75a*3 Expand (-13o - 12o + 3o)(6o - o + 0o). -110o*2 Expand (3 + 6 - 3)(-25 + 35 + 43)(-g4 + 0g*4 - 2g*4). -954g*4 Expand -4 + s + 4 + (7 + 2 - 28)(-5 + 5 + 2s). -37s Expand 136 - 2b4 + 8b*4 - 17b*3 - 135 + (-2b - 2b + 5b)(0b3 - b3 + 0b3). 5b*4 - 17b*3 + 1 Expand 2y*4 + 29y*4 - 3y*4 + (-3y*4 + 2y4 - y4)(3 - 2 + 8). 10y*4 Expand (-21u - 5 + 5)(-u + 0 + 0)(-u - 2 + 2)(0 - 7 + 3). 84u*3 Expand (-7 - 3f - 8 + 3)(1 + 1 + 2). -12f - 48 Expand (9w - w - 2w)(-2 + 2 - w4) + 22w*5 + 44w*5 - 3w*5. 57w*5 Expand ((0 - 2 + 3)(53 - 6 + 105) + 0 + 3 - 2)(2i + i - 4i). -153i Expand (z + 4z2 - z)(3 - 4 + 0)(4 - 3 + 8)(-4z - 2z + 5z). 36z*3 Expand (3l*4 - 4l*4 + 2l*4)(1 - 1 - 2) + 3l4 + 2l*2 - 2l*2 + 20 - 20 - 27l*4. -26l*4 Expand (-61n + n + 21n)(-6n2 + n2 + 4n*2 - 4n*2 + 2n*2 + 4n*2 + (2n - 2n + 2n*2)(-1 + 3 + 0) + 0n2 + n2 - 4n*2). -78n*3 Expand (35r - 304 + 304)(0 + 4 - 2). 70r Expand (0 + 2n4 + 0)(-722 - 856 - 1211 + 624 - 372). -5074n4 Expand (-5k + 2k + 2k)((-k - 5k + 5k)(2k - 3k + 3k) - 3k*2 + 5k2 - k2 + 0 - k*2 + 0 - 72k*2 - 113k*2 + 76k*2). 111k3 Expand o5 + 2o5 - 4o*5 + (875 - 80o - 875)((2o*2 + 3o*2 - 4o*2)(-o*2 - 2o + 2o) - 2o*4 + 0o*2 + 0o*2). 239o*5 Expand (-11i + 5i + 7i + 2)(-23i + 7i + 6i). -10i2 - 20i Expand ((-8a4 + 2a*4 + 3a*4)(0 + 0 - 2) + 36a4 + 10a*4 + 29a*4)(-3 + 0 + 2 + (-1 - 1 + 0)(0 - 1 + 2)). -243a*4 Expand (0z*2 + 0z*2 - 3z*3)(-z*2 + 5z*2 - 9z*2)((1 + 0 - 3)(0 - 1 + 2) + 1 - 3 + 4 + (-1 - 4 + 6)(3 - 2 - 3) - 5 + 3 + 1 + 1 + 4 - 6). -60z5 Expand (m3 - 1 + 1)(m - 2m - m) - 2m*4 - 3m*4 + 3m*4 + 0m*2 + 51m*4 - 6m*2 - 52m*4. -5m*4 - 6m*2 Expand (-98u + 98u - 114u*3)(-2 + 1 - 1)(2u + 0u - u). 228u*4 Expand (0 - 4 + 1)(-4t + 58 - 58) + (-3t + 2t + 2t)*(1 - 5	{ "pile_set_name": "DM Mathematics" }
Suppose 0q = -3q + 15, 3k + 2q - 13 = t. Which is the second biggest value? (a) k (b) 0.2 (c) -0.4 b Let g be (-2)/((-2 + -16)/(-2)). Which is the second smallest value? (a) -0.1 (b) 2/9 (c) g a Let i = 10.7 - -2.3. Let t = -12.8 + i. Let l = 2.5 + -2. What is the smallest value in t, 0.4, l? t Let v = 0.041 - 0.411. Let p = v + -0.03. Which is the second smallest value? (a) -3 (b) -1/3 (c) p c Let w be 24/(-24)1/(-12). Which is the second biggest value? (a) 1/5 (b) 2 (c) w a Let h = 8 + -5. Let m = -2 + h. Let t = -6 - -11. Which is the second smallest value? (a) m (b) t (c) -3 a Let k = -2.1 + 0.1. Let v be 2/(-15)(4 + -1). What is the second biggest value in 0.3, k, v? v Let o be -1 + ((-12)/8)/(-1). Which is the smallest value? (a) o (b) -4 (c) 2 b Let y = -991/8 - -124. Let u = -0.275 + -4.725. What is the smallest value in 5, y, u? u Let p = 202.1 - 202. Which is the smallest value? (a) 7 (b) 0 (c) p b Let u be ((-8)/20)/(16/(-10)). Suppose 7 = 5q + 2. Suppose 2i = q + 3. What is the second smallest value in u, i, -2/19? u Let q = -0.1 - 3.9. Let r = -1 - q. Let w(h) = -h*3 + 6h*2 - h + 1. Let t be w(6). Which is the third biggest value? (a) r (b) 0.5 (c) t c Let v = -0.74 + 0.8. Let n = 132 + -135. What is the third biggest value in n, -5, v? -5 Let n = 3 - 2.5. Let t = n + -0.3. Let o = -282 + 281.9. Which is the biggest value? (a) o (b) t (c) -5 b Let g = -1.9 - -2. Let s be 1/2 + 99/(-18). What is the second smallest value in g, 2, s? g Let n = -45641/2178 - -43/242. Let u = n + 21. Which is the biggest value? (a) u (b) -4 (c) 3/2 c Let g be ((-60)/27 - -2) + (-8)/(-18). What is the third smallest value in g, 20, -0.1? 20 Let f = 0.27 + -0.37. What is the biggest value in f, 0.1, -2/7? 0.1 Let y = 37/4 - 10. Let h = 0.06 + -0.56. Let f = 0.6 + h. What is the second smallest value in f, y, 4? f Let p = -2.2 + -6.8. Which is the third smallest value? (a) p (b) -2/13 (c) 5/2 c Let i = -6.2 - -6. Let t = i - -0.7. Which is the biggest value? (a) t (b) 2/11 (c) 1 c Let c be 51/119 + -1 + 0. What is the third smallest value in c, -2, -0.3? -0.3 Let r = 5 - 8. Let z = -3 - -2.9. What is the second biggest value in 3, z, r? z Let t(g) = 2g + 2. Let n be t(4). Suppose 2q - 2o = q - 10, -n = -5q - 2o. Which is the third smallest value? (a) q (b) 0.3 (c) -3 b Let w = -30 + 30.5. Which is the second smallest value? (a) -0.4 (b) -3/2 (c) w a Let h be 2/(-7) - 12/(-14). Let w = 0.003 + 2.957. Let p = 0.04 + w. What is the second biggest value in p, 0, h? h Let w be 2 + -3 + (-2 - -2). Let u(g) = -2g3 - 2g*2 + g - 1. Let j be u(-2). What is the smallest value in -2/9, w, j? w Suppose v = 2v - 3. Let o be (-1)/(84/34) + (-2)/(-4). Which is the second smallest value? (a) v (b) o (c) 2/5 c Let d be (-1)/10/(-4). Suppose d = -4g + g + 12. Suppose 3r + 8 = 11r. What is the biggest value in r, g, 0.3? g Let v = -0.2 - 0. Let k = -12 - -8. Which is the third biggest value? (a) v (b) -2 (c) k c Suppose -26o + 23o = 0. Which is the fourth smallest value? (a) o (b) -2 (c) 1.3 (d) 0.5 c Let k = -2 + 19. What is the biggest value in k, 6/7, 0? k Let f be (-7 + 1)5/(-55). Which is the second smallest value? (a) 2 (b) f (c) 4 a Suppose 2s + d - 42 = -3d, -d - 27 = -2s. Let k = s - 15. Which is the third biggest value? (a) -0.4 (b) 4 (c) k a Suppose 0 = 4r - f + 6, -2f = -5r - 4f - 1. Which is the second biggest value? (a) -1/4 (b) -1/11 (c) r a Let m be 0/(0/1 - -1). Suppose m = -4o - j + 19, -o - 5j + 7 = -12. Let w = 28.2 + -28.4. What is the smallest value in w, -2/7, o? -2/7 Let v(y) = -y - 4. Let p be v(0). Which is the third smallest value? (a) -2/3 (b) -0.5 (c) p b Let z = -63 + 253/4. Let a = z + 1/12. Let p be (-6)/48/66. What is the biggest value in p, -1, a? a Let p = 2.01 + -0.01. Let b = 6.9 + -7.2. What is the third biggest value in -5, b, p? -5 Let y = 1.6 - 0.4. Let d = y + -0.2. Let s = -1.12 + 0.62. What is the smallest value in s, d, 0.5? s Let d = 8 - 8.1. Suppose 5 = -2p - 5. What is the biggest value in d, -1, p? d Let f be 2 + 2 + 1 + -10. What is the second smallest value in 2, 1, f? 1 Let j = 515 - 515. Let t be ((-1)/(-14))/((-1)/(-4)). What is the third biggest value in j, t, -3? -3 Let q = 7.079 + -0.079. What is the second biggest value in 1, -3, 2/7, q? 1 Let k = 0 - -1. Which is the second biggest value? (a) -2/9 (b) -3 (c) k a Suppose 3j = 0, -4h + 1 = -4j - 31. Let b = 13 - h. What is the second smallest value in -2/11, b, -3? -2/11 Let y = 0 - -5. Which is the third biggest value? (a) 0.2 (b) 1/7 (c) y b Let w be -34/(-72)-4. Let v be 5/(-3)8/5. Let s = 68/21 + v. What is the smallest value in w, s, 0? w Let j = 55 - 53. What is the second biggest value in -0.1, 1/3, -3, j? 1/3 Let u = -132.7 + 126. Let l = u - -7. Which is the third smallest value? (a) l (b) -1/4 (c) 4 c Let p = 0.16 - 0.56. Which is the smallest value? (a) -2/15 (b) 3 (c) p (d) 0.3 c Suppose 0 = 3q + 2 + 1. Let k be q/4 + 9/4. Suppose kd = -2d - 12. What is the third biggest value in d, -5, -1/7? -5 Suppose 4s - 15 - 13 = 0. Let l = -10 + s. Which is the second smallest value? (a) l (b) 2/9 (c) 4 b Let y = 64/99 - -2/99. Suppose -37 = 23t - 152. Which is the third smallest value? (a) -1/4 (b) t (c) y b Let k be (-838)/(-7) + 4/(-14). Let i = k + -119. Let u be 57 + -60 + -1 + 9/2. Which is the second biggest value? (a) u (b) -0.5 (c) i c Let n = 3 - 3.5. Let k = n + 0.8. Let d = -2.2 + 2. What is the third smallest value in k, -4/7, d? k Let u = 54 - 44.22. Let d = 0.22 + u. Let n = 10.3 - d. Which is the second biggest value? (a) -3/5 (b) n (c) 1 b Let g = 2 + -3/2. Let r = -184/9 - -20. Let p = 0.8 + -0.9. What is the third smallest value in r, g, p? g Let a = -44.1 - -44. What is the second biggest value in 3, -1, a? a Let y = 5.31 + -0.31. What is the second biggest value in -5, 4, y? 4 Let f(i) = -i + 17. Let l be f(15). Which is the second biggest value? (a) l (b) 3 (c) -5 a Let r = 1.6 + -1.3. Let g = -4 - -3.7. Which is the third biggest value? (a) g (b) r (c) 2 a Let t = -0.1 - -4.1. Let f = 6.04 - 0.04. Let n = f - t. Which is the third smallest value? (a) n (b) 0.4 (c) 1/6 a Let d(l) = -2l - 1. Let p be d(2). Let i = -3244/5 + 649. Which is the second biggest value? (a) p (b) -1/3 (c) i b Let g = -43 + 42.5. What is the second biggest value in g, 3, -1? g Let g(q) = 10q2 - 2q - 3. Let j be g(3). Let p = j - 245/3. Which is the third smallest value? (a) 6 (b) p (c) -2 a Let y be ((-5)/10)/(3/2). Let a be (-9)/(-8)6/9. What is the third smallest value in 2/7, a, y? a Suppose 0 = -2k - 19 - 1. Let q be ((-6)/10)/(2/k). Suppose -r + 10 = r. Which is the third smallest value? (a) q (b) -1 (c) r c Let x be (-2)/30 - (-2)/5. What is the third smallest value in -1, 2/9, x? x Let m = 14 + -14.01. Let v = 0.21 + m. Which is the second smallest value? (a) -5 (b) v (c) 3 b Let x = 0 + -0.5. Let j = x + 0.52. Let h = 0.22 - j. Which is the second smallest value? (a) h (b) 3/4 (c) 5 b Let y = -32 + 31.9. Let u = -14 - -14.5. Which is the smallest value? (a) -2/9 (b) y (c) u a Let r = -0.18 + 0.18. What is the third biggest value in r, 4, -3? -3 Let l = 4.97 - 0.87. Let m = -0.1 + l. Which is the second biggest value? (a) m (b) 3 (c) -4 b Let m = -1/95 + 4/19. Let v(f) = 4f3 + f2 + f - 1. Let o be v(1). Let w be -8 - -7 - (-2 - 1). Which is the second biggest value? (a) m (b) w (c) o b Let l be (11/(-2) - 0) + -6 + 10. Which is the third biggest value? (a) 0 (b) l (c) -2 c Let r = -239/4 + 60. Suppose 2j = -2j + 12. What is the second biggest value in r, j, -5? r Let b = -6 - -9. Let q be (-2)/6(-1)/b. What is the third smallest value in -1/5, q, -5? q Let q = -9 + 9.2. Which is the second smallest value? (a) 0.3 (b) q (c) 0 b Let l = -3.9 + 3.87. What is the second biggest value in 1, l, -0.4? l Let t(g) = 6g + 13. Let m be t(-2). Which is the second smallest value? (a) m (b) 1.4 (c) 2/9 a Let w(c) = -c3 + 0c*3 + 7c + 0c3 - 7c2 + 7 - 18. Let q be w(-8). Let s = q + 43/15. What is the smallest value in 0, 4, s? s Let j(h) = h3 - 7h2 - 2h + 13. Let	{ "pile_set_name": "DM Mathematics" }
or of 10440 and 65235600? 360 Calculate the greatest common divisor of 182372 and 407162. 254 Calculate the highest common factor of 30744 and 8389208. 488 Calculate the greatest common factor of 537 and 219413546. 179 What is the highest common factor of 365 and 2008814? 73 What is the greatest common divisor of 238242472 and 8528? 4264 Calculate the greatest common factor of 121213 and 517. 47 Calculate the greatest common divisor of 5814 and 1843. 19 What is the greatest common factor of 504415 and 14615? 395 Calculate the greatest common factor of 51 and 3239843. 17 What is the highest common factor of 87977305 and 67353? 2041 Calculate the highest common factor of 12 and 37689816. 12 Calculate the highest common divisor of 8782812 and 8128. 508 What is the greatest common factor of 50545 and 2167? 11 Calculate the highest common divisor of 3529880 and 43975600. 19720 Calculate the highest common factor of 7 and 3344173. 7 What is the greatest common factor of 702 and 5012683? 13 Calculate the highest common factor of 2159 and 7132193. 127 Calculate the greatest common divisor of 264505740 and 60. 60 Calculate the highest common divisor of 99000 and 5477000. 1000 Calculate the greatest common divisor of 171488 and 768992. 32 Calculate the greatest common factor of 19961861 and 4991. 713 What is the highest common divisor of 69378 and 9046668? 186 What is the highest common factor of 11 and 306828467? 11 Calculate the greatest common divisor of 2373 and 733761. 21 What is the greatest common factor of 185967639 and 1287? 1287 Calculate the greatest common factor of 119739060 and 6804. 2268 What is the greatest common divisor of 37060 and 66580? 20 What is the greatest common factor of 2045849 and 6266? 3133 What is the highest common divisor of 19261953 and 513? 171 Calculate the highest common factor of 43033003 and 26. 13 What is the highest common divisor of 18 and 340476417? 9 Calculate the highest common divisor of 177550 and 4221. 67 What is the greatest common divisor of 893964 and 26112? 12 Calculate the greatest common divisor of 260217 and 34394. 29 Calculate the greatest common divisor of 115 and 77581990. 115 Calculate the highest common factor of 2295865 and 368420. 845 What is the highest common divisor of 519354432 and 64? 64 What is the greatest common divisor of 989 and 745407322? 989 Calculate the highest common divisor of 568 and 139200. 8 What is the highest common factor of 2250733 and 33821? 1091 What is the greatest common factor of 54575 and 48548150? 1475 Calculate the greatest common factor of 23529 and 79267. 31 Calculate the greatest common factor of 15181908 and 2235. 447 Calculate the highest common divisor of 46566 and 4469142. 1194 Calculate the highest common divisor of 179299 and 34. 17 What is the greatest common divisor of 18632770 and 1430? 130 What is the greatest common factor of 3041107260 and 60? 60 Calculate the highest common divisor of 5036 and 26436482. 2518 Calculate the greatest common divisor of 522 and 55591362. 18 Calculate the greatest common factor of 2047 and 34886843. 89 Calculate the highest common factor of 6678 and 144039. 21 What is the greatest common divisor of 885807 and 4355? 871 What is the greatest common divisor of 149518936 and 56? 56 Calculate the greatest common divisor of 17024 and 4039. 7 Calculate the greatest common divisor of 60 and 183621. 3 What is the greatest common divisor of 164459 and 4664? 53 What is the greatest common factor of 2017920 and 1504? 32 Calculate the highest common divisor of 34528 and 9256. 104 What is the highest common divisor of 48070 and 103873? 209 What is the highest common factor of 6908832 and 147? 21 What is the greatest common factor of 21461721 and 978? 489 What is the highest common divisor of 777 and 2185960? 259 What is the highest common divisor of 10445511 and 6085? 1217 Calculate the highest common divisor of 16098532 and 119316. 652 What is the greatest common factor of 22482471 and 186? 93 What is the greatest common factor of 7202 and 4197658? 554 What is the greatest common factor of 204951850 and 31? 31 Calculate the highest common divisor of 668935050 and 62. 62 Calculate the highest common factor of 23525308 and 41. 41 Calculate the highest common divisor of 13632 and 2735772. 852 Calculate the greatest common factor of 1436505 and 105. 105 Calculate the highest common divisor of 1 and 37026683. 1 Calculate the greatest common factor of 551880 and 89964. 756 Calculate the highest common divisor of 15159656 and 55400. 2216 Calculate the greatest common divisor of 13190 and 860. 10 Calculate the highest common divisor of 190535862 and 132. 66 Calculate the greatest common divisor of 3107489 and 1155. 77 Calculate the highest common factor of 68340 and 5806860. 1020 Calculate the highest common divisor of 11832488 and 125008. 4808 Calculate the greatest common factor of 493185 and 787479. 1617 What is the greatest common factor of 4216 and 42408? 248 Calculate the greatest common factor of 1324920 and 3077. 181 Calculate the highest common factor of 5351967 and 702. 27 What is the greatest common factor of 35 and 492235? 5 What is the highest common factor of 226344916 and 196? 196 Calculate the greatest common factor of 17 and 2995518626. 17 What is the greatest common factor of 41315667 and 9423? 1047 Calculate the highest common factor of 529347 and 16010046. 10803 Calculate the highest common factor of 10180 and 903590. 10 Calculate the greatest common divisor of 9667866 and 858. 78 What is the highest common factor of 14 and 146202448? 14 What is the greatest common divisor of 43092 and 13784904? 2268 What is the greatest common divisor of 9 and 11531739? 3 What is the highest common divisor of 347 and 11908346? 347 What is the greatest common factor of 27 and 372707? 1 Calculate the greatest common factor of 50547025 and 16425. 1825 What is the highest common divisor of 2925 and 9293115? 195 What is the highest common divisor of 1884267 and 315? 63 What is the greatest common factor of 20075506 and 8? 2 Calculate the highest common divisor of 875647553 and 11. 11 What is the highest common factor of 1260836 and 3127400? 3292 Calculate the greatest common factor of 26627852 and 4. 4 Calculate the greatest common divisor of 636755 and 2403891. 1127 Calculate the highest common factor of 39130860 and 112968. 6276 What is the highest common factor of 1311 and 9143443? 23 Calculate the highest common factor of 273 and 349839. 21 What is the highest common divisor of 29286670 and 1470? 70 Calculate the highest common factor of 5339 and 1712014. 19 What is the greatest common divisor of 2919 and 620067? 21 Calculate the highest common divisor of 10 and 13202635. 5 Calculate the highest common factor of 2514 and 9637. 419 Calculate the greatest common divisor of 1055691 and 8316. 63 Calculate the highest common factor of 231246 and 19654581. 1329 Calculate the greatest common factor of 2889096 and 28942. 58 What is the highest common divisor of 8721 and 176733? 9 What is the highest common factor of 690130 and 175? 35 What is the highest common divisor of 9288513 and 93717? 1053 What is the greatest common divisor of 38640 and 283603110? 4830 What is the highest common factor of 26172 and 215208? 36 Calculate the highest common divisor of 3609090 and 1890. 270 What is the greatest common divisor of 49162374 and 36? 18 What is the highest common divisor of 13756 and 76348? 4 Calculate the highest common divisor of 146599 and 7348866. 4729 What is the highest common factor of 17370318 and 210? 42 Calculate the greatest common factor of 7240469 and 94944. 989 Calculate the greatest common divisor of 6502 and 2324523518. 6502 Calculate the highest common factor of 59441 and 523. 1 What is the highest common divisor of 26323588 and 608? 76 Calculate the highest common factor of 49740216 and 2296. 328 Calculate the highest common factor of 146 and 750639874. 146 Calculate the greatest common divisor of 92346513 and 189. 21 Calculate the highest common factor of 7924 and 42159076. 1132 Calculate the highest common divisor of 1810402 and 3146. 242 Calculate the greatest common divisor of 602 and 72569896. 602 Calculate the greates	{ "pile_set_name": "DM Mathematics" }
d(v(y)). 36y2 Let o(i) = 0i*2 - 7i*2 - 6i*2. Let k(z) = -z. Let j(s) = -8s. Let q(c) = j(c) - 6k(c). Calculate o(q(m)). -52m*2 Let t(s) = 5s*2. Let j(m) = 2091m - 1. What is j(t(z))? 10455z2 - 1 Let d(b) = -b. Let f(y) = 2224y. Give f(d(n)). -2224n Suppose 2p - 7 + 3 = 0. Let u(d) = -d - pd + 7d - d. Let g(y) = 11y + 8. Let t(l) = -4l - 3. Let s(f) = -3g(f) - 8t(f). What is u(s(w))? -3w Let f(i) = -5i*2. Let v(z) = 1044 + 8z - 1044. Determine v(f(l)). -40l2 Let p(g) = -2g. Suppose 0 = -y - 3c + 8, 3y - 2 = 2c - 0. Let x(z) = -4z*y + 4z*2 + 2z2 - z2. Give p(x(o)). -2o2 Let w(a) be the third derivative of a5/30 - a2. Let y(k) = -3k - 4. Let d(q) = -4q - 5. Let s(r) = 4d(r) - 5y(r). Calculate w(s(o)). 2o*2 Let q(a) = 2a2. Let b(m) be the second derivative of -m3/6 + m. Let o be 51/15 + 6/(-15). Let d(r) = r. Let p(u) = od(u) + 2b(u). What is q(p(h))? 2h2 Let p(j) = -2 + 3 - 1 - j2. Let i(u) = -8u*2. Give p(i(v)). -64v*4 Let o(r) = 21r. Let f(q) = 357q. What is f(o(x))? 7497x Let l(o) = -o*2 + 1. Let v(g) = -13g*2 + 7. Let y(i) = -14l(i) + 2v(i). Let j(t) = -t. What is j(y(c))? 12c*2 Let b(m) = -2m*2. Suppose -l + 22 = l. Suppose l = 5u + 1. Let a(k) = -3ku + 7k*2 - 3k*2. What is b(a(g))? -2g*4 Suppose 5h = -0h + 30. Let t(m) = -4m + 7m2 + 4m. Let i(n) = 15n2. Let x(g) = hi(g) - 13t(g). Let k(z) = -z2. Give k(x(y)). -y4 Suppose 0 = -3i + 5 + 1. Let b(q) = 0qi - 5q*2 + 6q*2. Let u(k) = -2k*2. What is u(b(l))? -2l*4 Let l(m) = 3m*2. Let n(s) = 5s*2 + 3. Let g(j) = -6j*2 - 4. Let z(p) = 3g(p) + 4n(p). Give z(l(c)). 18c4 Let o(n) be the first derivative of -n2 + 9. Let g(r) = -10r2. Give o(g(m)). 20m2 Let h(t) = t2. Let v(f) be the first derivative of 5f2 + 7. Determine v(h(i)). 10i*2 Let y(a) = -4a. Let m(n) = -4027n. Calculate m(y(l)). 16108l Let b(s) = 5s - 6s + 0s. Let t(l) be the third derivative of -l7/2520 + l4/24 + 2l2. Let f(i) be the second derivative of t(i). What is f(b(v))? -v2 Let v(k) = -2k2. Let s(w) be the third derivative of -w5/15 + 23w*2. What is v(s(m))? -32m*4 Let h(j) = -22j. Let y(l) = -73l2. Calculate h(y(n)). 1606n*2 Let j(m) = 2m*2. Let s(a) = 7a - 4. Suppose -2x + 5 = -1. Let o = 1 + x. Let n(r) = 8r - 5. Let d(c) = on(c) - 5s(c). Determine j(d(g)). 18g2 Let k(j) = j. Let d(r) = -129r*2 + 105. Determine k(d(n)). -129n2 + 105 Let f(p) = -p2 - 5p - 2. Let b be f(-4). Let d(q) = 1 - 1 + bq2. Let a(o) be the third derivative of o5/60 + o*2. What is a(d(t))? 4t*4 Let a(v) = -v. Let h(u) be the first derivative of 28u*3/3 - 22. Determine h(a(g)). 28g*2 Let o(u) = 126u*2. Let a(j) = 2j*2. What is o(a(c))? 504c*4 Let r(x) = -7x*2. Let g(n) = 53n. What is r(g(q))? -19663q2 Let v(m) = 440m*2. Let d(l) = -24l. Determine v(d(u)). 253440u2 Let g = 0 - -2. Let o(z) = -z2 - 2z. Let t(v) = -2v2 - 5v. Let k(w) = gt(w) - 5o(w). Let a(i) = -3i. Determine a(k(n)). -3n*2 Let x(s) = 8s. Let j(g) = 7g + 57. What is j(x(h))? 56h + 57 Let h(l) = -5257l2. Let u(o) = -o. Determine h(u(j)). -5257j*2 Let x(o) = -3o*2 - 2o*2 + 4o + 0o. Let m(y) = -11y*2 + 9y. Let v(g) = -4m(g) + 9x(g). Let b(i) = 3i2 - i2 + 0i*2. Calculate b(v(k)). 2k*4 Let k(o) = -39o*2. Let l(t) = 2t*2. Determine l(k(i)). 3042i*4 Let i(h) = h + 2. Let j be i(2). Let t(n) = 8n + 9. Let u(s) = -s - 1. Let c(v) = jt(v) + 36u(v). Let x(b) = 2b. Calculate c(x(l)). -8l Let j(f) = -f*2. Let x(b) = -b - 2. Let y(d) = -2d - 7. Let q(h) = 7x(h) - 2y(h). What is q(j(u))? 3u2 Let x(i) = -2i. Let y(s) = s*2 + 3s - 4. Let t be y(-7). Let q(u) = tu - 6u - 7u. Calculate q(x(j)). -22j Let j(c) = -c - 1. Let l be j(-4). Let g(b) = l - 3b - 3. Let a(q) = -q2 - 2q*2 + 2q*2. Give a(g(i)). -9i*2 Let q = 26 + 2. Let t(h) = h + q - 28. Let x(z) = -4z*2. Calculate t(x(u)). -4u2 Let v(t) = -t2 - 5t + 3. Suppose 0 = z - 3f + 20, -5f + 33 + 12 = -4z. Let w be v(z). Let c(s) = -ws + 0 + 0. Let m(b) = -b2. Determine c(m(l)). 3l*2 Let w(s) = 2s*2. Let i(l) = -15l - 14l + 32l. Calculate w(i(y)). 18y2 Let r(t) = 26t + 3. Let y(n) = 3n2. Give r(y(o)). 78o*2 + 3 Let u be (7 + -1)4/(-12). Let z be u/(-10) + (-116)/(-20). Let q(r) = -6 + z + 6r. Let k(w) = w2. Calculate q(k(m)). 6m*2 Let m(z) = 2 + 0 - 6 - 8z + 4z + z2. Let w(t) = 6t*2 - 21t - 21. Let h(k) = -21m(k) + 4w(k). Let y(q) = 4 + q - 4. Calculate h(y(n)). 3n2 Let w(z) = -2z. Let m(p) be the first derivative of -2 + 0p + 3/2p*2. What is m(w(x))? -6x Let w(n) = -n - 13. Let d be w(-15). Let z(u) be the second derivative of 0ud + 0 - 2u + 1/3u3. Let h(r) = -2r. What is z(h(m))? -4m Let m(h) be the first derivative of 1/2h*2 - 2 + 0h. Let r(p) = -9p2. Determine m(r(v)). -9v2 Let s(a) be the second derivative of -a3/6 + a. Let y(k) = -105k3 - k2 + k + 1. Let w be y(-1). Let x(n) = 104 - 7n - w. Determine x(s(f)). 7f Let b(d) = -d2 + 1827d - 2. Let u(t) = -t. Give b(u(k)). -k*2 - 1827k - 2 Let a(y) = 3y. Let j(q) be the second derivative of q3/6 - q2/2 - q. Let m(f) = -8f + 6. Let l = 105 - 99. Let u(d) = lj(d) + m(d). Determine u(a(b)). -6b Let t(n) be the second derivative of 0 + 0n2 + 3n - 1/3n3. Let g(f) = 2f*2 - 3f*2 + 0f*2. Give t(g(h)). 2h*2 Let c(k) = 2k2. Let f(p) be the second derivative of p4/6 - p*2 + 3p. Let r(a) be the first derivative of f(a). Give c(r(b)). 32b2 Let w(m) = m2. Let t(o) = -2o*2 + 3o*2 + 0o2. Give w(t(i)). i4 Let k(c) = -4c2 - 7. Let y(t) = -13t. Give k(y(q)). -676q2 - 7 Let x(t) = t. Let j(q) = 50q. What is x(j(k))? 50k Let j(m) = -2m*2. Let b(n) = -1229n. Determine j(b(r)). -3020882r2 Let a = 6 + -4. Let l(u) = u2 + 2u*2 - 6u*a. Let i(x) = 6x - 4. Let n(y) = -7y + 5. Let k(v) = -5i(v) - 4n(v). Calculate l(k(d)). -12d*2 Let l(u) = u + 1. Let v(i) = 2i + 1. Let f(b) = -8l(b) + 5v(b). Let t(w) = -w + 2. Let a(q) = 2f(q) + 3t(q). Let g(c) = 3c2. Calculate g(a(m)). 3m*2 Let s(p) be the first derivative of -17p*3/3 + 9. Let v(h) = -2h*2. Calculate s(v(w)). -68w*4 Let h(a) = -3a2. Let r(x) be the first derivative of -x5/60 - x*2 - 2. Let d(u) be the second derivative of r(u). Calculate d(h(s)). -9s*4 Let x(f) = -2f + 16. Let j(y) = -4y2. Determine x(j(d)). 8d2 + 16 Let q(m) = m2 - 112. Let f(s) = 12s. Calculate f(q(l)). 12l*2 - 1344 Let f(r) = 1518r. Let g(v) = -v. Give g(f(x)). -1518x Let a(c) = 3c*2 + 2c + 2. Let p(f) = -65f2 - 45f - 45. Let w(s) = 45a(s) + 2p(s). Let m(z) = z*2. What is w(m(g))? 5g4 Let y(w) be the second derivative of -w4/12 - w. Let q(i) be the third derivative of 0 - 1/30i5 - 6i*2 + 0i + 0i4 + 0i*3. Calculate q(y(n)). -2n*4 Let y(c) = 2c. Let j(l) = 1381l. What is y(j(o))? 2762o Let q(a) = -2a2 - 3a. Let h(c) = -25c2 - 40c. Let x(p) = 3h(p) - 40q(p). Let k(d) = 2d2. Give x(k(i)). 20i4 Let c(z) = z3 + 3z2 - 2. Let b be c(-2). Let n(s) = -5 + 4 + 1 + bs. Let h(x) = x*2. Determine h(n(l)). 4l*2 Let w(n) be the first derivative of 3n*3 + 47. Let y(u) = 1 - 1 + 2u. What is y(w(h))? 18h2 Let b(k) = -21k. Let n(v) = -2v + 30 - 16 - 14. Give n(b(u)). 42u Let u(m) = -4052 - 9m + 4052. Let c(o) = 3o*2 - 5o - 5. Let w(r) = -r*2 + 2r + 2. Let k(p) = 2c(p) + 5w(p). What is u(k(j))? -9j2 Let s(g) = -9g. Let b(n) be the third derivative of -n6/180 + n3 - 8n2. Let u(x) be the first derivative of b(x). Calculate u(s(y)). -162y2 Let l(s) = -s2 + 2s2 + 2s*2 - 2s*2. Let m(x) = 2x*2 - 3x - 3. Let v(w) = -3w2 + 4w + 4. Let g(r) = 4m(r) + 3v(r). Give l(g(q)). q*4 Let o(g) be the second derivative of -1/4g*4 + 0g*3 + 2g + 0 + 0g2. Let j(x) = 2x. Give o(j(b)). -12b2 Let k(z) = 7z. Let u(x) = 476x2. Determine u(k(d)). 23324d*2 Let x(q) = -q. Let p(a) be the first derivative of 61a*2/2 - 1. Calculate p(x(m)). -61m Let f = 99 + -68. Let z(y) = -2y - f + 31. Let x(p) = -4p*2 - 4p. Let g(o) = o. Let q(d) = -4*g(d) - x(d). Giv	{ "pile_set_name": "DM Mathematics" }
ulate the highest common divisor of 38 and h. 38 Let j(h) = h*2 + 24h + 452. Let v be j(-26). Calculate the highest common factor of v and 2583. 63 Let w be 7/(1144/(-80) + 15). What is the greatest common divisor of 4050 and w? 10 Suppose -3d = -5q - 4d + 14, 0 = -2q - 3d + 16. Suppose 87 = qs - 5h, -4h - 48 = -s - 0h. Calculate the highest common factor of s and 90. 18 Suppose -39f - 23f + 5520 = -16f. Let k be 678/15 - (-2)/(-10). What is the highest common divisor of k and f? 15 Let s(f) = 6f2 + 134f + 1224. Let r be s(-9). What is the highest common factor of r and 360? 72 Suppose 20t = 53t - 46t + 35438. Calculate the highest common divisor of 116 and t. 58 Let h(p) = 195p + 1907. Let i be h(6). Calculate the highest common factor of i and 34. 17 Let n = 62 + -40. Suppose q - 64 - n = 0. Let d be q + -3 + 1 + 1. What is the highest common factor of d and 17? 17 Suppose -23y + 58 = 12. Suppose -yb + 10 = 0, -4 = -2i + 3b + 121. What is the highest common factor of i and 15? 5 Let u = -21 + 24. Suppose -244 = 10n - 64. Let s = 21 + n. Calculate the greatest common factor of u and s. 3 Let h(t) = -8295t + 82964. Let u be h(10). Let n = -217 - -315. Suppose 3r = r + n. Calculate the greatest common divisor of u and r. 7 Let v(w) = 8w + 109. Let n be v(-12). Let r(i) = -7i + 182. Let a be r(n). Suppose 3h + h = 104. Calculate the highest common divisor of h and a. 13 Suppose 0 = 39l - 252l + 8414991. Calculate the greatest common divisor of 39 and l. 39 Let a be 4/(-52) + (-3 - (-26420)/52). What is the greatest common factor of 7979 and a? 101 Suppose 174519 = -45v + 174744. Let b be -1 - -68 - (-2)/(-1). Calculate the highest common factor of b and v. 5 Let v = 1769 + -1689. Calculate the highest common factor of v and 20. 20 Suppose 2y - p - 545 = 0, -4y + p + 863 = -230. Suppose -2l + y = 3h, 2l - 23 + 117 = h. What is the greatest common factor of h and 69? 23 Let q be ((-10)/(-6))/((-115)/(-414)). Let c be ((10 - q) + 18)(-1 - -7). Calculate the highest common factor of 12 and c. 12 Suppose 149l - 17723 - 23308 - 33469 = 0. Calculate the greatest common factor of l and 4. 4 Let o be 1458/(-8)372/(-279). Suppose 4d = -f + 5 + 110, 2d = -3f + 395. What is the highest common factor of o and f? 27 Suppose 12z - 4 = -88. Let w be 2 + 2 - z - 3/(-1). What is the greatest common divisor of 266 and w? 14 Let d(y) = y2 + 19y - 1867. Let t be d(-57). What is the greatest common factor of t and 975? 13 Let l be (243/(-108))/(5/(-300)). What is the greatest common divisor of l and 20? 5 Let z = -1229 + 2858. Calculate the greatest common divisor of 18 and z. 9 Suppose -1560d + 1576d - 199392 = 0. What is the highest common factor of d and 12? 6 Suppose -3u + y + 65 = 2u, 0 = -y. Let h = -111 + 119. Suppose 14x + h = 22x. What is the greatest common divisor of x and u? 1 Let k be ((-148)/(-3))/((-348)/(-6003)). What is the highest common factor of k and 92? 23 Let n be 746/22 - (-5)/55. Calculate the highest common divisor of 2074 and n. 34 Let b = -387 + 931. Let t = b + -403. Calculate the greatest common factor of t and 47. 47 Let x = -134 - -604. Let n be x/3 + (-6)/9. Suppose 52g - 17g - 420 = 0. What is the highest common factor of n and g? 12 Suppose 3g - g - 307 = -3s, -g - 3s = -155. Let t be -9 - (9 - (-1 + 8))-14. Calculate the greatest common divisor of g and t. 19 Let g = 5986 - 5812. Calculate the greatest common factor of g and 31494. 174 Let d be (4 - (-2 + -9 + 3 + 4)) + 4. What is the greatest common divisor of 11436 and d? 12 Let h be (2/3)/((-8)/492 + 0). Let u = -36 - h. Let n be 220/u + 4-1. Calculate the greatest common factor of 8 and n. 8 Suppose 20z + 924 = 95z + 9z. Let j be 6/42/1. Calculate the greatest common factor of j and z. 1 Let h be 0/((-5)/(-5)) + 1. Let a be (-322)/(-84) + h/(6/1). Suppose -ad = 6 - 66. Calculate the highest common divisor of d and 3. 3 Suppose 0 = -19l + 928 + 338 + 653. Calculate the highest common factor of 4343 and l. 101 Let j(y) = -5y*2 + 8y + 4. Let q be j(2). Let x be (1141 - q) + 14/(-7). Calculate the greatest common factor of 17 and x. 17 Let s be 58((-35)/(-10) - 3). Let i be 02/(-4)2. Suppose 5l - 4t + s - 381 = i, 150 = 2l + 3t. What is the highest common factor of l and 8? 8 Suppose 3b = -t + 14, 2b - b = -2. Let c = 37 - t. Let d be 50/3 - (-1)/3. Calculate the highest common divisor of c and d. 17 Let t(g) = -47g - 8. Let s be t(-4). Let v = 310 - s. What is the highest common divisor of v and 52? 26 Let c = 135 + -129. Suppose -5p + m + 38 = 8, -m = -p + c. What is the greatest common divisor of 258 and p? 6 Suppose 6v + 1540 = 10v. Suppose 5k = 3p + v, 2k - 4p - 135 = p. Calculate the highest common divisor of 48 and k. 16 Let u be (-1)/(-2)((-224)/(-7) - 30) - -3. Suppose 243 = 3t - 189. Calculate the greatest common factor of t and u. 4 Let h(g) = 427g - 1261. Let p be h(3). What is the greatest common divisor of p and 34660? 20 Let d be (0 - 4/6)399/(-38). Suppose -9j = dj - 48. Calculate the greatest common factor of 2 and j. 1 Suppose 3h - 30 = -5v + 136, -2v - h + 67 = 0. Let u be (192/144)/(2/420). What is the greatest common factor of v and u? 35 Suppose 2f + 5b = 1134, -7f + 2b = -2f - 2835. Let i = f - 227. Calculate the greatest common divisor of i and 20. 20 Let k be 819/6 + (-21)/14. Let x = k - 3. Suppose 4m - x = n + n, 4n = -4m + 120. What is the highest common factor of m and 16? 16 Let n be 25/15 - 16/(-3). Suppose -nw + 4w = 0. Let l be 77/22(w - -30). What is the greatest common divisor of 21 and l? 21 Suppose 20t + 322423 = 530131 + 414952. What is the highest common factor of t and 191? 191 Let r(x) = 7x*2 - 2x - x*3 + 6x*2 - 14x*2 + 6. Suppose -l + 6l = -2l. Let b be r(l). Calculate the greatest common divisor of 9 and b. 3 Let f(j) = j - 1. Let c be f(2). Let n(o) = 7o - 3o - 2o + 3 - 5o + 32o*2. Let v be n(c). What is the highest common divisor of v and 8? 8 Let y be -310(-6)/10. Let c be (y + ((-4)/(-4))/(-1))1. Suppose -m - 34 = -119. What is the greatest common factor of m and c? 17 Let q = 62 + -59. Suppose -g = f + 1, g = 2f - qg + 14. Let w be 49 - f/150. What is the highest common divisor of w and 147? 49 Suppose -1806 = -8s - 686. Let k = -129 + s. What is the greatest common divisor of 275 and k? 11 Let p(l) = 38l + 2. Let u be p(6). Suppose 4v + 2b - 128 = 0, v - 43b = -39b + 14. What is the highest common divisor of u and v? 10 Suppose 5k = -2s + 340, 0s - 2s = 2k - 142. Suppose k = 5i - 34. Let d(w) = 5w*2. Let a be d(-1). What is the greatest common factor of a and i? 5 Let w = 28225 + -28207. What is the greatest common factor of w and 158? 2 Let i = 17583 + -15027. What is the greatest common factor of 994 and i? 142 Suppose 0 = 4z - 3g + 267, -5g - 25 = -10. Let t = -65 - z. Suppose 114 - 18 = tl. Calculate the greatest common factor of 24 and l. 24 Let s(x) = -x3 + 6x*2 + 15x + 24. Let h be s(10). Let j = -213 - h. What is the highest common divisor of 143 and j? 13 Let q be 1 + 33(-20)/(-12). Suppose -103v = -75v - 896. What is the highest common factor of v and q? 8 Let l = -168 + 197. Suppose -l + 95 = 2b. Calculate the highest common factor of 44 and b. 11 Suppose 5i - 5 = -5d + 55, -i - 4d + 21 = 0. Suppose -41536 - 12964 = 21c - 239c. Suppose -c + 7 = -im. Calculate the highest common divisor of m and 3. 3 Let m(b) = 12b2 - 4b - 4. Let o be m(-3). Suppose -6q - 4r + 278 = -4q, 2q - 3r - 299 = 0. What is the greatest common divisor of q and o? 29 Suppose 15c - 559 + 154 = 0. Let a(n) = 65n - 29. Let w be a(10). Calculate the greatest common factor of w and c. 27 Let n be (((-27216)/(-140))/1)/((-8)/(-30)). Calculate the greatest common factor of n and 3. 3 Suppose -4g = -3g + 4p + 1, 5p = 5. Let u be (g - -9) + -6 + 81. What is the highest common divisor of 158 and u? 79 Let w be ((-40)/(-4))/((-4 - 0)/(-2)). Suppose -2r + wp + 100 = p, 0 = -3p + 9. Calculate the highest common factor of 21 and r. 7 Let a = -12083 + 12084. Suppose 5o - 38 = 17. Calculate the greatest common factor of o and a. 1 Let t(c) = -16c + 295. Let x be t(16). Let f(q) =	{ "pile_set_name": "DM Mathematics" }
n is positive. n(5279/91) Simplify (b(1/67)/bbbbb*(-1/46)b/b*(1/29)bb(7/4)/bb)(-22) assuming b is positive. b(-11225115/89378) Simplify (g*(2/29)(g/(g*(4/15)/g))/g(ggg*15g)/(ggg/(g/g*5)g))(6/19) assuming g is positive. g(9398/2755) Simplify (m/(m(-1/3)/m))48m/m(-6/11)mmm*(-1/3)m/m*(-2/3)m/m*(-1/17)(m/(mm(-7)))/(m/(m(mmm/m(-2))/m)) assuming m is positive. m(72334/561) Simplify (v/v1)(-45)/(v/v(2/5))27(v(-5)v0/v)/((v0/v)/vv/(v/((v(vv(-2))/v)/v))v) assuming v is positive. v*(-96/5) Simplify ((ooo(-7)ooo(3/2))/(o(-1/3)o7))/(o(-2/5)oo/(o/o(-4))o(o/(o/o(-2)))/(o(-5)o)) assuming o is positive. o(-233/30) Simplify (z(2/7))*(3/4)/(zz*(2/7)z)*(1/51)(z0/z)(-4/5)/((z*(-1/12)/z)/(((zz/((zz(1/5)z)/zzz))/zz)/z)) assuming z is positive. z(-1051/7140) Simplify ((((f(-5/2)/f)/(ff*4f))/(f/(ff1))(-13))(2/5))44 assuming f is positive. f(-396) Simplify ((k(k*(-1/3)k)/kk)(3/4)/(k(-1/2)/k(-3)))/((k2kk(-5))/(k(-2/5))(-27)) assuming k is positive. k(231/20) Simplify (f(-1/7)/(ff/f(-3/4)))(-21)/((f/f*(-5))/ff6)25 assuming f is positive. f*(-857/4) Simplify (t(tt(-2/3)/tt)/t(tt*(-2))/tt(1/12)/t(-8))/((t(2/9)/t(1/2))/(t(-2/5))(-1/69)) assuming t is positive. t(27739/4140) Simplify ((b/b0)(-6/7))(-46)/((b(-1/2)/b)/(b0b)(b*(3/4)/b)/(b/((b/(bb/(b/b(-2))))/b))) assuming b is positive. b(1181/28) Simplify (((z/(zz8zz))/z)/(z/(z2/z))(z(-4))(5/7))5 assuming z is positive. z(-485/7) Simplify ((n/n*(-5/6))/nnn(-1/10))32(n*(-6)n/(n5/n))/(n(-1/4)n)(10/3) assuming n is positive. n(1319/30) Simplify ((d(-3/5)d(2/5))/((d/(d/(d/((d4d)/d))))/d(8/7)))/(d(-2/7)dd(-1/20))(1/15) assuming d is positive. d(2729/700) Simplify ((f(-4/9)f(1/9))/(f0(f(-3)/f)/f))20 assuming f is positive. f(280/3) Simplify (p(-3)/(p(pp/p(2/7))/p))/(p0p/p*(-1/4))(p1)(-1/50)(p/(p/((ppp(1/3))/p)))2 assuming p is positive. p(-6967/2100) Simplify ((y5)(-30))(-3/5)/((y9y*(-5/4))/((yy*(-2/11))/yy*(-5/3)y)) assuming y is positive. y(10745/132) Simplify (d5/(d/(d/(dd(-8))))d*(1/12)ddd/(dd(-1/13)/ddd)dddd)(-39) assuming d is positive. d(-2677/4) Simplify (((y(-2/3))(-7))21)37 assuming y is positive. y3626 Simplify (o/o(-3)o/(((o*(2/19)o)/o)/oo))(15/7)o1/o(7/5)(o/(oo(1/3)))(-2/17) assuming o is positive. o*(343489/33915) Simplify ((aa1)(-7/8)/(((a(a/a(2/3))/aa)/aa)/a)(3/2))/(a(4/5)/a(2/19)(a(-2/3))(-25)) assuming a is positive. a*(-22357/1140) Simplify ((l(l/(l/(l/l*(3/4)l))l)/lll19)/((l/(ll/((lll*(-1/6))/l))l)/(ll(6/11)/l)))(-45) assuming l is positive. l(-43485/44) Simplify (w9/w8(w(-2/11))(-29/4))(-49) assuming w is positive. w(-2499/22) Simplify (d14/(d(-1/10)/d)((ddd/(d(-7)/d))/d)(1/8))(6/11) assuming d is positive. d(981/110) Simplify (((rr/(r/((r(r/(rr/((r/r*(4/3))/r)))/r)/r)))/r)/rr/r(-1/13))(7/3)r5r*6(r/(r/r1))/((r/r(-2))/r) assuming r is positive. r(281/117) Simplify (((n(-7)n)/n(3/5))/(nn(-6))(-7))(-4) assuming n is positive. n(832/5) Simplify ((g/g*(2/23)gg(-3)g)/(gg5/gg(-6/7)))(2/63) assuming g is positive. g(-454/3381) Simplify (i21/iiii(i/i*16ii)/ii(i(2/11))(2/43))(9/5) assuming i is positive. i(42606/2365) Simplify (ll*(2/9)/ll)*(-2/45)l*0lll/(l/(((l/l*(-1/7))/l)/l))l(ll*(2/5)l(-5))/(l1l(1/10)) assuming l is positive. l(-14807/5670) Simplify ((g(3/23)g(2/21))(1/28))(-33) assuming g is positive. g(-1199/4508) Simplify ((j(1/4))(8/7))*(-5/8)(j/(jj/j(-2/5)))(-23)/((j(2/7)j)/((j*1/jjj)/j)) assuming j is positive. j(4443/140) Simplify (y21/(y/(y/y(-6/11)))y*5y(-1/19)/y)4 assuming y is positive. y(21312/209) Simplify ((y4y)(1/12)y/(yy/(y(-11)/y))(y/(y/(y*(-1/14)y)))/y)(18/13) assuming y is positive. y(-3189/182) Simplify (((c*6/cc)/cc(-1/4))/((c/(c0c))/(cc/c(-2))))/(c5/(c/c(-3)))(11/4) assuming c is positive. c6 Simplify (z0)23z(-1/4)/z(-7)((z(2/5)zzz)(-13))(6/11) assuming z is positive. z(-3819/220) Simplify ((u(2/7)u)/u(-6))/(u3u*(-3/2)/uu)u3/uu*(-2)(u0/u)(-10) assuming u is positive. u(221/14) Simplify (g(-10/3)/g(1/4))/(g32/(gg(4/15))) assuming g is positive. g(-2059/60) Simplify (w(ww/w0)/w)(1/28)/(w(-9/2)/((ww(w/(ww*(-30/11)w))/ww)/w)) assuming w is positive. w(562/77) Simplify (a0)(2/25)(aa/(a(-2/5)a))*(3/16)a(4/3)/(a/(a/((a2/a)/a)))(aa(1/9))/(a/(a(-2/7)/a)a) assuming a is positive. a(-2917/5040) Simplify (((o14oooo(-9/7))(-22/3))(-4))(1/69) assuming o is positive. o(9680/1449) Simplify ((l3/(ll*(1/3)l))/(l*(-5)l*(-2/5)))/((lllll/(l2/l)ll)(-7/9)/((ll/(lll*(-7)/l))/ll(-2))) assuming l is positive. l(236/15) Simplify ((d(5/6)/((d/(d(-13)d))/d))/((((d15d)/d)/dd)/(d/(d(-13/3)/d))))(-1/17) assuming d is positive. d(7/6) Simplify ((n1/n)(-30))(-16)/(((n/(n(1/2)n))/n*(3/8))/((nn*2)/(n(nn(-2/7))/n))) assuming n is positive. n(177/56) Simplify (l(2/5)/(l/(ll*(-3)l))(l(-1))(-44))/((((ll/((l*(2/7)l)/l))/l)/ll)(-2/11)((l(-1)/l)/l)(-9/7)) assuming l is positive. l(2127/55) Simplify m/(m2mmm)m*(-1/4)m*6m/(mm/(mm*3m))mm((m(-1))(-15/8))(2/159) assuming m is positive. m(412/53) Simplify (r27/r(-1/8))/((r/((r/((r/(r(-2/19)rr))/rr))/r))/(r(rr21)/r)) assuming r is positive. r(7451/152) Simplify ((f21/f)/f)/f(1/3)f(-17)/(f(-11/3)/f) assuming f is positive. f(19/3) Simplify (b(bb(-5))/b)/(bb*(-5))b*(-6/5)b*(1/5)b*(-4)/(bb/(b*0b))(b((b/(b/(b*(-2/9)/b))b)/b)/b)/b(-2/3) assuming b is positive. b(-59/9) Simplify (((g(gg*(1/5)gg)/g)/g(-19))/(g(2/45)g)(10/7))(12/5) assuming g is positive. g*(26092/525) Simplify ((a(a/((a/(aa/(a(2/17)a)))/a))/a)/a*(-3)((a*(-2/5)a)/a)48)/(a(-4/7)/aa(-5)(a1)41) assuming a is positive. a*(-29004/595) Simplify (aa*(-2/23)aa(-2/29)a((a/a(1/5))/a)/(a/(a(-14)a)))26 assuming a is positive. a(-984672/3335) Simplify (m*(-2/13)m*(2/3)/mm*(-5/2)((m/((mmm/m*(-1/7)mm)/m))/m)/mm)/((m0)(-10/3)mm*(2/7)m4) assuming m is positive. m(-6779/546) Simplify ((zz/z16z*(-18))/((zzz(-2/101))/z(-3/22)))36 assuming z is positive. z(-1364526/1111) Simplify ((g(g/(g*(-1)/gg)g)/gg)/g)*(3/4)/(g/(g/(gg*2/gg)))*(-7/2)((ggg/(g/(g(-1/3)/g)))(-5))(-27) assuming g is positive. g(411/4) Simplify (((x*(6/7)x9)/((x/(x(-9)x))/(xx7)))(10/7))(-4/11) assuming x is positive. x(-2480/539) Simplify (t/((t*8tt)/t))(-23)t/(t*(2/73)t)tt/(t*(2/21)t) assuming t is positive. t*(283417/1533) Simplify (ll/(l(((l/(ll*(3/2))l)/ll)/l)/ll)ll*(-7)(l/l*2l)*(-8/3))/(ll*(-2/3)ll/l1(l/l(-1/4))19) assuming l is positive. l(-343/12) Simplify (((z8/zz)/(z/(zz/z*10z)))/(z/(zz(-3)))(-2/187))(-23) assuming z is positive. z(-138/187) Simplify (aa(1/3))24/((a(-8)/a)/(a/(a/(a/(a/a(4/3)))a)a))(a(-1))16/(((a/a(-1/2))/a)/(a2/a)) assuming a is positive. a(161/6) Simplify (x/(x3/x)x*(-1)x)*(-3/32)/(xx/((((((x/x*(-5))/xx)/x)/x)/x)/x)(x5/xx)/x)(-50) assuming x is positive. x(6403/32) Simplify ((aa12)/a13)(-20)/((aa*(3/5)aa(-2/19))/((aa*6)/aa*(-3/11)aa)) assuming a is positive. a(5468/1045) Simplify ((c(11/3)/(c(-1/12)c))/(cc/c(4/3)cc)22)(-42) assuming c is positive. c(4697/2) Simplify ((n/n(2/21))/(nn/((n*8n)/n)nnn))(3/2)n2/((n(-5/2)/n)/n)n(-7)/nn(-8) assuming n is positive. n(-51/14) Simplify ((rr(1/3))/r(5/3)(r(1/5)/r)22)/(((rr(6/7))/(((r/r(-1/5))/r)/r))/((rr*(1/8)rr)/r(-1/3))) assuming r is positive. r(-4797/280) Simplify ((((v/v17)/v)/(vv(vvv3)/vvvv))/((v/((v/(v/((v(v7v)/v)/v	{ "pile_set_name": "DM Mathematics" }
822000000 What is -209.0041 rounded to the nearest integer? -209 Round -0.0017496848 to 5 decimal places. -0.00175 What is 1544.5484 rounded to the nearest 100? 1500 Round 0.01249587 to three decimal places. 0.012 Round -9447110 to the nearest 1000000. -9000000 What is 10.43953 rounded to 1 decimal place? 10.4 Round -6801002000 to the nearest 1000000. -6801000000 Round 26.99683 to 1 decimal place. 27 Round -53.9488 to one dp. -53.9 Round 0.000084722541 to 6 dps. 0.000085 Round 15.4543 to 1 dp. 15.5 What is 57523140 rounded to the nearest one hundred thousand? 57500000 Round -0.000001615323 to seven decimal places. -0.0000016 What is -70.7303 rounded to zero dps? -71 Round 1036246.5 to the nearest 1000000. 1000000 What is -0.010998437 rounded to 4 decimal places? -0.011 Round 99475.65 to the nearest ten. 99480 Round 30401.953 to the nearest one hundred. 30400 What is 1159.57 rounded to the nearest 100? 1200 Round 182117.68 to the nearest 100. 182100 What is -157629.66 rounded to the nearest 10000? -160000 Round -90695300 to the nearest 100000. -90700000 What is 54588800 rounded to the nearest 1000000? 55000000 Round -11804.577 to the nearest one thousand. -12000 Round 0.002641611 to 4 dps. 0.0026 What is 79703500 rounded to the nearest one hundred thousand? 79700000 Round -519.1748 to 1 decimal place. -519.2 What is 0.0002009032 rounded to 7 dps? 0.0002009 Round -34.38978 to 1 dp. -34.4 Round 32179100 to the nearest 1000000. 32000000 Round 0.00492573 to five decimal places. 0.00493 Round -271861500 to the nearest 100000. -271900000 Round 0.00041757 to 4 dps. 0.0004 Round 2383287 to the nearest one hundred thousand. 2400000 What is -62166.1 rounded to the nearest one hundred? -62200 What is -92169630 rounded to the nearest 10000? -92170000 What is -0.0144639 rounded to four dps? -0.0145 Round 0.00000848835 to 7 decimal places. 0.0000085 Round -0.03961007 to 2 decimal places. -0.04 What is -4111.56 rounded to the nearest one thousand? -4000 Round 447969.9 to the nearest 100000. 400000 What is -1052092000 rounded to the nearest 1000000? -1052000000 What is -114550 rounded to the nearest 10000? -110000 What is 5.55385 rounded to two decimal places? 5.55 Round 315413 to the nearest 1000. 315000 Round -4900810 to the nearest one hundred thousand. -4900000 What is -377.6509 rounded to the nearest one hundred? -400 What is 0.00021263 rounded to 6 dps? 0.000213 What is -15.6317 rounded to zero decimal places? -16 What is 16206.532 rounded to the nearest ten? 16210 What is -26.22114 rounded to one decimal place? -26.2 Round -0.03480684 to 3 decimal places. -0.035 Round 0.04561786 to three decimal places. 0.046 What is -9528.21 rounded to the nearest ten? -9530 What is 2.1241263 rounded to 1 decimal place? 2.1 Round -1.778276 to three dps. -1.778 What is -673.9322 rounded to the nearest 100? -700 What is -0.000000463674 rounded to seven decimal places? -0.0000005 Round 54.6153 to the nearest 100. 100 Round -59.41142 to the nearest integer. -59 What is 2674.019 rounded to the nearest integer? 2674 What is 1207.422 rounded to the nearest ten? 1210 What is 0.001337785 rounded to 6 dps? 0.001338 Round -0.03885015 to four dps. -0.0389 What is -0.000000145881 rounded to seven decimal places? -0.0000001 Round 9.2811 to zero dps. 9 Round 0.00000317432 to 5 dps. 0 What is 7.422 rounded to the nearest integer? 7 What is 0.0024688843 rounded to six dps? 0.002469 Round 3089260 to the nearest 100000. 3100000 What is -0.000125691 rounded to six dps? -0.000126 What is -8.1328 rounded to 2 dps? -8.13 What is -1322448000 rounded to the nearest 1000000? -1322000000 Round 4868993 to the nearest ten thousand. 4870000 Round 0.000062682 to seven decimal places. 0.0000627 What is -0.00000779184 rounded to six decimal places? -0.000008 What is -99388.348 rounded to the nearest 10000? -100000 Round -537290 to the nearest 100000. -500000 What is 0.0002600762 rounded to 5 dps? 0.00026 Round 70138.7 to the nearest one million. 0 What is 0.000456582 rounded to five decimal places? 0.00046 What is 270.0696 rounded to the nearest ten? 270 Round 0.113259 to three decimal places. 0.113 Round -249498.2 to the nearest 10000. -250000 What is 0.107994 rounded to three dps? 0.108 What is -0.000000840584 rounded to 7 decimal places? -0.0000008 Round 248573 to the nearest one hundred thousand. 200000 Round -84671.2 to the nearest 10. -84670 Round -0.01958691 to five decimal places. -0.01959 What is -9066290 rounded to the nearest one million? -9000000 What is 7.992836 rounded to 1 dp? 8 Round 711376000 to the nearest one million. 711000000 What is -0.056879229 rounded to 4 decimal places? -0.0569 What is -0.1329976 rounded to two decimal places? -0.13 Round -23238.073 to the nearest one hundred. -23200 What is 134.91925 rounded to 1 dp? 134.9 Round 6740.93 to the nearest 100. 6700 What is 4.23779 rounded to one dp? 4.2 Round 3.46805 to one dp. 3.5 What is -0.00000897705 rounded to 6 dps? -0.000009 What is 31.77585 rounded to 2 decimal places? 31.78 Round 177268250 to the nearest one million. 177000000 Round -0.2940191 to 3 decimal places. -0.294 Round -0.0000216772 to five dps. -0.00002 What is -0.0273448 rounded to three dps? -0.027 Round 14.580783 to 1 dp. 14.6 What is 2442715 rounded to the nearest one thousand? 2443000 What is 0.00004721267 rounded to 6 dps? 0.000047 Round -0.000175439 to five dps. -0.00018 Round 5480706 to the nearest 1000000. 5000000 Round -2013290100 to the nearest 1000000. -2013000000 What is 18842.57 rounded to the nearest 100? 18800 What is 2685000 rounded to the nearest one hundred thousand? 2700000 Round -4605.426 to the nearest one thousand. -5000 Round 124.29479 to 0 decimal places. 124 Round -358.388 to 0 decimal places. -358 Round 71789.8 to the nearest one hundred. 71800 Round -4533.038 to the nearest one hundred. -4500 Round -13.94992 to 2 dps. -13.95 What is -372284.8 rounded to the nearest ten thousand? -370000 Round -253.683 to the nearest 10. -250 What is -217.14628 rounded to the nearest integer? -217 What is -2654955 rounded to the nearest one hundred thousand? -2700000 Round -3.63757 to 1 decimal place. -3.6 Round 5707843.5 to the nearest 100000. 5700000 Round 49.4312 to one decimal place. 49.4 What is -5.818129 rounded to three dps? -5.818 Round -90.09307 to one decimal place. -90.1 Round 0.0005718469 to 7 decimal places. 0.0005718 What is 0.00000606271 rounded to seven dps? 0.0000061 Round 0.00000829405 to seven decimal places. 0.0000083 What is -0.0004865844 rounded to 5 dps? -0.00049 Round -0.0000057571 to four dps. 0 Round 0.00001993005 to six decimal places. 0.00002 What is 1.889208 rounded to two decimal places? 1.89 Round -50517.8 to the nearest 100. -50500 What is 0.075483 rounded to 4 decimal places? 0.0755 Round -1.79821 to two decimal places. -1.8 What is -0.0002760275 rounded to five decimal places? -0.00028 Round -5894200 to the nearest 100000. -5900000 What is -11784.2 rounded to the nearest 100? -11800 What is -0.001788 rounded to three dps? -0.002 What is 47614 rounded to the nearest 100? 47600 What is 1611827 rounded to the nearest 1000? 1612000 What is -0.0001150401 rounded to six dps? -0.000115 What is 6.7983 rounded to 2 dps? 6.8 Round 0.02516935 to 4 decimal places. 0.0252 Round -0.12081037 to three decimal places. -0.121 Round -0.0008113508 to four dps. -0.0008 What is 92.8362 rounded to one dp? 92.8 Round 48.2532 to zero decimal places. 48 What is -1143049.4 rounded to the nearest 100000? -1100000 What is 4400721.7 rounded to the nearest 10000? 4400000 Round 8161510 to the nearest 100000. 8200000 Round -0.3981666 to one decimal place. -0.4 Round 3794946 to the nearest one thousand. 3795000 What is -0.000010245671 rounded to 6 decimal places? -0.00001 What is 0.0000212803 rounded to 6 decimal places? 0.000021 Round 0.21823 to 2 decimal places. 0.22 What is 8.11049 rounded to two dps? 8.11 What is -0.000568217 rounded to four decimal places? -0.0006 What is 0.00000100814 rounded to six decimal places? 0.000001 Round 1761090.9 to the nearest one hundred. 1761100 What is 18690.7 rounded to the nearest 1000? 19000 What is -0.2218115 rounded to 3 decimal places? -0.222 Round 0.231539 to three dps. 0.232 Round -192929540 to the nea	{ "pile_set_name": "DM Mathematics" }
+ 32. Is n a composite number? False Suppose -3m + 2780 + 1075 = 0. Suppose -5p - 1285 = -5d, -2d = -7d + 4p + m. Is d a composite number? False Let x(w) = -6w2 - w3 - 3w*3 + 3w + 1 + 5w3. Let l = 10 - 4. Is x(l) composite? False Suppose 88414 = 6y + 28612. Is y a composite number? False Let x(q) = 22q2 + 5 + 6 - 3q - 4. Let l(i) = 18i - 184. Let p be l(10). Is x(p) composite? True Let l = 2928 - 1712. Suppose -4f - l = -4y, 298 = 2y - y - 4f. Suppose -4d - y = -1054. Is d a prime number? False Let a = -317 + 564. Let c = -481 + a. Let w = c + 537. Is w a prime number? False Let j = 21 - 20. Is 2823 - (3 + -7 - (j - 5)) prime? False Suppose -22i + 2 = -21i. Suppose ir + 38 = 824. Is r a prime number? False Let i = 32 + -23. Suppose -il = -l - 3352. Is l a prime number? True Suppose 5q = -q - 162. Let r = 32 + q. Suppose ri - 1475 = -0i. Is i a prime number? False Let p(x) be the second derivative of 7x5/20 - x4/4 + x*3 - 5x*2/2 - 5x. Is p(4) prime? True Let a be 5216/(-48) + (-2)/(-3). Let f be (a/45)/((-3)/40). Suppose -4h + 40 = -2v - f, 5h - 103 = -4v. Is h prime? True Let w = -30110 + 42253. Is w prime? True Suppose -3l = -4l - 2. Is 5112 + l + -1 a composite number? False Suppose 2 - 6 = h - 3p, 3h = 3p. Suppose hf = -0f + 2994. Suppose 4n = n + f. Is n composite? False Suppose 2n - u - 31 = -11, -4u - 24 = -n. Let o(k) = k2 + 5k + 2. Let f(i) = -2i2 - 11i - 5. Let q(d) = 3f(d) + 7o(d). Is q(n) composite? False Let w(j) = 2j + 6. Let z be w(-5). Let x(m) = 25m*2 - 2m - 1. Is x(z) prime? False Let g = 2052 - 948. Suppose -5u - 85 = -h - g, -8 = 2h. Suppose -w - q + u = -4q, -5q = 5w - 1055. Is w prime? False Suppose 0 = 2y + 3y - 320. Suppose 3j + j = -8, 5j - y = -2z. Is z composite? False Let p(r) = -5 + 4 + 741r + 660r. Let a be p(1). Suppose 4z - a = 276. Is z a composite number? False Let b(s) = 69s*2 - 6s - 8. Is b(-3) prime? True Let j(a) = -a + 7. Let k be j(5). Suppose -4v = -kg + 26, 2g + 0g + 3v - 5 = 0. Let q(i) = -i2 + 15i + 6. Is q(g) a prime number? False Let k(r) = -19r3 - 10r*2 - 13r - 1. Is k(-6) composite? False Let l be (3/(-12))/(5/(-40)). Suppose 0 = -lu - 0u + 1530. Let b = u - 434. Is b composite? False Let k(h) = -h*2 - 2h + 8. Let g be k(-4). Suppose i = 0, 0x + x + 4i - 503 = g. Let j = -130 + x. Is j composite? False Let d(l) = l*3 - 3l + 3. Let y be d(2). Suppose -867 = -yn - 3h - 247, 244 = 2n + 2h. Is n composite? False Let z = 837 + 3746. Is z a composite number? False Let o(i) = 1436i2 + 51i - 358. Is o(7) a composite number? True Suppose -7a - 3l - 2741 = -11a, 3a + 3l = 2040. Is a a prime number? True Suppose 2c + 35 = -867. Let j(r) = 2r2 + r - 788. Let t be j(0). Let w = c - t. Is w a composite number? False Suppose 8a - 16511 - 39465 = 0. Is a a prime number? True Let l(a) = -5a2 - 28a - 13. Let z(h) = -9h2 - 55h - 26. Let x(m) = 5l(m) - 3z(m). Is x(-18) a prime number? True Suppose 0 = m - 3, 5x - 8557 = -3m + 107787. Is x composite? True Suppose 5s - 16 = 9s, 0 = 5m - 3s - 2. Is 1 + m - 396/(-3) a prime number? True Let t(i) = 3i2 + 4i + 7. Let n(s) = -s*2 - 2s - 3. Let m(k) = 5n(k) + 2t(k). Suppose -2p - 4 = -p - 4u, 5u = -5p - 45. Is m(p) a composite number? False Let q = 30 - 23. Suppose -1 - 14 = -5z. Suppose zw + 1036 = qw. Is w prime? False Is (28 + -26)(53758/(-4))/(-1) composite? False Let l be 0 + 3 + 520254/14 - -3. Suppose 0 = -3t + 16t - l. Is t composite? True Let o = 529 + -136. Suppose -4s + o = -3s. Is s a prime number? False Let p(h) = 996h2 + 4h - 3. Is p(2) prime? True Let y(l) = 4l3 + 4l*2 + 3l + 2. Let h = 32 + -28. Is y(h) prime? False Let f = -1645 - -439. Let x(s) = -211s + 3. Let z be x(2). Let t = z - f. Is t a prime number? True Is ((-12)/(-27)3)/((-2)/(-1461)) a composite number? True Suppose -7 + 151 = 9j. Let z(m) = 5m*2 - 11m - 7. Is z(j) composite? False Let l = -153 - -493. Suppose -797 = -b + 3c, -1254 = -2b - 5c + l. Is b prime? True Let o be ((-2)/10)/((-6)/101670). Suppose -o = -r + 4n, 3r + 2n - 10151 = -2n. Is r a prime number? False Let h(q) = 14q*2 - 9q + 56. Is h(23) composite? True Suppose 16x = 19x - 39927. Is x a composite number? False Let g(u) = 4u - 5u - 5 - 3. Let v be g(-12). Suppose -vz = 5w - 640 - 407, -1 = w. Is z composite? False Is (-2863)/(-15) + (-240)/(-1800) prime? True Let c = 52 + -19. Suppose ck - 29k - 5588 = 0. Is k a composite number? True Let t = -15247 + 22968. Is t a composite number? True Let c be 453(4/6)/1. Suppose -p + 3v - 6 = 2, -5p - v + 24 = 0. Suppose -pq - 42 = -c. Is q a composite number? True Let r(f) = 3f - 2. Let t(h) = h3 + 5h*2 + h + 7. Let p be t(-5). Let n be r(p). Suppose 0j = nj - 2524. Is j a prime number? True Let j be (2/6)/((-1)/(-3)). Let v = -4 - -2. Is 49 - -1 - (v - j) prime? True Is (-4)/7 + 474540/140 a prime number? True Let b(k) = 1149k - 392. Is b(15) composite? False Suppose -43l + 46l = 3. Is 0 + 1301 + -3 + l a composite number? True Let m(j) = j*3 - 3j*2 - 7j + 5. Suppose c = -3c - 4i, -4c - 15 = i. Let r(u) = -u + 1. Let h be r(c). Is m(h) prime? True Is (-6 - 3 - -3250) + (5 - -1) composite? True Is 17341 + (-23 + 24)/(2/(-4)) prime? False Suppose -p + 6p - 20 = 0. Is -3 + (591 - p - 3) prime? False Suppose 2 = -n + 6. Let j(i) = 14i3 - 5i*2 - 5i + 6. Is j(n) a composite number? True Let a(r) be the third derivative of r*5/30 + 5r4/24 + r3/6 - 10r2 - 1. Let t(g) = -2g + 4. Let y be t(-3). Is a(y) composite? False Suppose -18 = -d - 2d. Suppose 114 + 672 = ds. Is s a composite number? False Let j be 491 - (-5 - (2 + -4)). Suppose -j - 14 = -2q. Suppose -2f + 3f = q. Is f a composite number? True Let l be 1685/(-15) + 4/(-6). Suppose -5h = 3b - 932, -4h + 2h - 296 = -b. Let p = b + l. Is p a composite number? False Let i = -83 - -57. Let d = i - -28. Is (d/(-4))/(8/(-2576)) composite? True Let j be (2/(-3))/(-4(-2)/(-204)). Let u(s) = 20s + 69. Is u(j) composite? False Suppose 47 = 2g + 3n, -3g + 2n + 22 = -29. Suppose -20 = 15v - gv. Suppose 520 + 145 = vz. Is z composite? True Let q(l) = -4l2 + l - 12. Let k(b) = -21b*2 + 4b - 60. Let o(v) = 2k(v) - 11q(v). Is o(-5) prime? False Suppose 5m = 3m + 5l + 24771, -l + 24765 = 2m. Suppose m = 4n + 5211. Is n composite? True Let j be (2 + 4/(-6))/(4/12). Suppose -1090 = -d + 5l, 5555 = jd + d - 4l. Is d a composite number? True Suppose 176 + 104 = 4p. Suppose -pa - 49756 = -74a. Is a a prime number? False Let x(k) = k2 + 3k - 5. Let a(z) = -1. Let i(f) = 2a(f) + x(f). Let r be i(-5). Suppose 4c = 4n + 6c - 232, 4n + rc - 230 = 0. Is n composite? False Let t = 2216 + -324. Let b = -259 + t. Is b composite? True Suppose -5y + 3 = 2q, 4y = 4q - 0 - 20. Let c(m) = 2m2 - m - 9. Is c(q) a composite number? False Is (366/(-488))/((-6)/58264) a composite number? False Is -11 + -1 + 4 + 83545 prime? True Let h(k) = 390k - 43. Is h(4) prime? False Let k be 1 + (-103406)/30 + 2/(-15). Let h = -2233 - k. Is h a composite number? False Let y(z) = 7 - 63z3 - 2 - 6. Is y(-2) prime? True Let g(k) = -1444k + 25. Is g(-7) a composite number? False Suppose 0 = 4x + 3n - 2525, 3x = -4n + 1083 + 802. Is x a composite number? True Let v be 9/(-6)56/(-12). Suppose 2p + 160 = vp - 5w, -5w + 128 = 3p. Is ((-99)/p)/((-1)/28) a prime number? False Let n(m) = -4m + 1 - 4m - 6. Is n(-18) a composite number? False Let u = -9 + 9. Suppose -24 = 6h - u. Is ((-3 - h) + 11)/2 a prime number? False Let t = -27 - -31. Is 534 + (-1)/t + 39/(-52) a composite number? True Let w(o) = -2o + 21. Let j be w(8). Suppose 0 = -3q - s - 2552, q + 183 = -js - 649. Let g = q + 2129. Is g composite? False Let z(h) = 208h2 + 31h - 108. Is z(7) a prime number? True Let f(c) = -c*3 - 2c*2 - 4c - 1. Let u be f(-3). Suppose -2z - 3z + a = -8, -u = -5z - 5a. Is 34 - 9/(1 + z) a composite number? False Suppose -12 + 2 = -2l. Suppose 5c - 3255 = -lt, -t = -3t - 5c + 1308. Is t composite? True Let q = 9012 + -1973. Is q a prime number? True Let a be (1 - 5)/((-10)/15). Suppose -ai +	{ "pile_set_name": "DM Mathematics" }
Let l(h) = -7h - 6. Let f be l(7). Let b = 55 + f. Which is smaller: 1 or b? b Let t(x) = x3 + 9x*2 + 13x + 5. Let y be t(-13). Let s be 7/(196/16) + 459/y. Is -1 less than or equal to s? True Let r = 0.031 - -0.969. Let h = -191/5 + 38. Which is smaller: r or h? h Let a(g) = -14g - 76. Let u be a(-11). Suppose 75i - ui = 0. Let r be 2/6 + (-28)/(-6). Is r greater than i? True Let b be (-5)/(-7) + (-4)/(-14). Let y(m) = -9m - m*3 + 3m - 1 - 11m2 + 18m*2. Let i be y(6). Is b at most as big as i? False Let g be ((-1)/7)/(2/38). Let y = g + 157/63. Does 7 = y? False Suppose 14 = 4c - 58. Is 93/5 greater than c? True Let w = -9 + -70. Is -75 at most as big as w? False Let s be (-101338)/(-10) - 12/30. Let q = s - 10230. Let d = 96 + q. Is d at most 0? True Let j(g) = 13g2 - 25g. Let f(m) = -3m2 + 6m. Let x(r) = 9f(r) + 2j(r). Let c be x(4). Let n be (6 - c)(-5)/(-50). Is n greater than or equal to 1? False Let g be 2/(-4)(-13)/(-5). Let u be (-1 - -6)/(-10)0. Is g less than u? True Let o = -6.4 - -1.4. Let m = 6.5 + o. Which is smaller: 0.2 or m? 0.2 Let f(b) = 5b - 22. Let w be f(5). Suppose -v - wd = v + 5, -4v = 5d + 9. Is 1/8 at most as big as v? False Let s = 319 + -313. Is s at most 3? False Let z be (-6)/(-4)24/(-18). Suppose -b - 4o + 55 = 0, -b + 0b - 2o + 45 = 0. Let u be b/211/(-2). Are u and z nonequal? True Let q = -50 + 39. Let t = -38 - -27. Is t less than q? False Let r(w) = 24w - 63. Let p be r(2). Let o(y) = y2 + y - 5. Let j be o(-6). Suppose -4z - 4 = 0, j = -5n + 5z - 50. Which is smaller: p or n? n Let k = -286 - -294. Is -2/71 bigger than k? False Let z be -1 + -2 + 77/25. Let r = 97 + -89. Let n = 7 - r. Which is greater: z or n? z Suppose -6 = -o - 8. Suppose -3l = -10 - 2. Is o less than l? True Let b = -1756 - -1755. Let z = 0.2 - 0.49. Let l = -11.71 + z. Which is greater: b or l? b Let b be (0 + (-12)/(-20))/((-7)/665). Which is smaller: b or -61? -61 Let k be 2(18/22 + (-4)/(-22)). Suppose -3s = -3p + 2s - 12, kp + 3s = 11. Let j be (-39)/(-12) + (-1 - 1). Is p > j? False Let n(k) = 660k - 48. Let o be n(1). Which is smaller: o or 611? 611 Let n(a) = -7a - 32. Let v(d) = 13d + 63. Let l(k) = 5n(k) + 3v(k). Let h be l(-7). Is -1 < h? True Let o be (73/27)/(-3 - 64/6). Let t = -1/41 + o. Let g be 1/6 + 2/4. Which is bigger: t or g? g Suppose -5615 = -27b - 755. Are b and 178 nonequal? True Suppose 0 = 9g - 3g. Suppose 2c + 6 = 0, 3y + 2c + 9 = -g. Is -6 bigger than y? False Let p be 2/6(-2556)/(-6). Let z = p + -1276/9. Suppose 2 = -5x - 2y, -4x + 4y + 3 + 1 = 0. Is z less than x? False Let c = 0.13 + -0.1. Is 4 < c? False Let o be ((-30)/60)/(22/12). Let y be -1 + (-1 + 2 - -1). Is o > y? False Suppose 3r - r = 36. Let a be (-3 - 141/(-27)) + (-4)/r. Is a not equal to -0.1? True Let u be (614/(-1659))/3. Is u at most 1? True Suppose -7c = -c - 18. Let z be (c/6)/((-711)/18). Let h = 235/158 - z. Is 1 < h? True Suppose 5l + 6l = -264. Let i(o) = 5o + 21. Let k be i(-9). Is l bigger than k? False Let i = -894 - -894. Which is bigger: -20/87 or i? i Suppose 7h - 4h - 60 = 0. Suppose 0 = 5q - 0q + h. Let f be (-171)/324 + q/18. Which is smaller: -2 or f? -2 Let g = -759 + 712. Which is greater: -45 or g? -45 Let s = -184665/8 + 23196. Let m = s - 113. Which is smaller: 0 or m? m Suppose 9i - 11i = 0. Suppose i = -2b - x - 7, b + 4x + 11 = x. Which is smaller: b or -8/3? -8/3 Let w = -1138 - -1143. Is w bigger than 94/15? False Suppose 960 = 2b + 19r - 15r, -2r - 984 = -2b. Which is bigger: 487 or b? b Let i = -17 + 12.9. Let t = 2.9 + i. Let j = 0.5 + t. Is j bigger than 0.1? False Let w = -3403 - -78242/23. Is w greater than -1? False Suppose 3s = -5j - 49, -s - 5 = -j - 2. Which is smaller: s or 0.1? s Let f be (-5)/(3/(-37)). Suppose 37 = 4v - f. Let z be ((-9)/v)/(1 + 1). Is 0 smaller than z? False Let b = -25735/1407 - -128/7. Is -1 > b? False Suppose 2j + 13 = -3p - 37, -p - 13 = -3j. Let u = 20 + p. Let f be u - 1 - 17/6. Which is smaller: f or 1? f Suppose n = -4n. Let a be (485505/(-435))/(6/(-4)). Let p = -744 + a. Is n greater than p? False Let q = -0.8 - -0.9. Let s = 0.72 - -11.28. Is s equal to q? False Let v = -2263 - -2264. Let k(a) = -a2 - a. Let y be k(-1). Which is bigger: v or y? v Let v be ((-140)/48 + 3)/((-2)/6). Which is smaller: -23 or v? -23 Let j(t) = t2 - 4t - 16. Let k = -24 - -31. Let v be j(k). Let d = -5 + 10. Is v greater than d? False Let v(t) = -t3 + 4t2 - t - 4. Let s be v(4). Let r = 13 + s. Let m(f) = -f3 - f*2 - 4f - 4. Let i be m(-2). Which is bigger: r or i? i Let j = 248 + -248. Let s = -2 - -2. Is s smaller than j? False Let b = -6 - -2. Let u = -122/35 + 2/7. Which is greater: u or b? u Suppose -3a + 84 = 4r, 0 = a + 4a + 3r - 151. Let u = -45 + a. Let d = 9 + u. Which is smaller: d or -1? d Let u = 10 + -10. Suppose u = 4d + 4, -w + d - 6d - 5 = 0. Suppose w = 4f - 10f. Which is greater: f or 4? 4 Let r = -37 - -47. Suppose -8u + 4 = -ru. Do -8 and u have different values? True Let i = -2.6869 - -0.1869. Do i and 2/3 have the same value? False Let g(u) = 6u - 17. Let j be g(7). Suppose -4i + 2 = 5w, 5w + 0i - 14 = 2i. Suppose -wr = b + j, -2r - 4b + 3 = 25. Which is bigger: 0 or r? 0 Suppose 0 = 5z + 2u + 589, -5z - 3u = -0z + 591. Is -114 at most as big as z? False Let q = 29658/5 + -5932. Suppose 0 = -3a + 2a. Let u = a + 0. Are q and u equal? False Let u = -30464 - -212469/7. Let z be 3/(0 - 3/111). Let d = u - z. Which is bigger: d or -1? d Let a = -346 - 36. Which is greater: a or -381? -381 Let a be 2 + 2 - (-34)/11. Which is smaller: a or 1/3? 1/3 Suppose l = -4v - 5 + 2, 0 = 2l - 4v - 6. Suppose 3p + 4n = l, 0 = 2p - 3p - 5n + 4. Are p and 5 nonequal? True Let d(n) = -n*3 + 7n*2 - 7n + 4. Let c be d(6). Let q be (-1)/c14/7. Is q equal to -5/12? False Let c = 106 - 105.81. Which is smaller: 0.06 or c? 0.06 Let n = -703 - -704. Is n greater than 238? False Let i(h) = -h3 + 4h*2 + 5h + 3. Let d be i(5). Let o be (-5)/((-4)/14 + 92/(-168)). Suppose -d = -ok + 3k. Which is smaller: k or 9/7? k Let a = 24 - 32. Let l = 16 + a. Suppose 2 + 2 = -t + w, 0 = t - 5w - l. Is -7 bigger than t? False Suppose i - 10 = -a, -5a + 6i - 12 = -3a. Suppose 3v + 5u - 6 - 30 = 0, 0 = -5v - 3u + 44. Is a less than v? True Suppose -3h = 4r - 350, 522 = 4h - 4r + 18. Does 123 = h? False Let g = -25 - -18. Suppose 77 = -37s - 219. Which is greater: g or s? g Let z be 360/(-225)10/4. Which is bigger: z or -74/19? -74/19 Let p be 3/(-114)(-48)/(-5). Let c = 1/19 + p. Let z = 446 - 446.1. Is z greater than c? True Let j = 2.5 - -32.5. Let m = j + -25. Let v = m - 10.04. Which is smaller: -1 or v? -1 Let w = -15 + 9. Let u = -6.9 - w. Let p = 8 - 9. Is u >= p? True Let o = -70 + 77. Suppose -4b = -3g + 22, 2g - og = b - 6. Is 2 at most g? True Let r be 119 + (-26)/(-13). Let k be ((-70)/r)/((-4)/(-78)). Let f be (-8)/20 - 6/k. Which is bigger: f or 1? 1 Let l = -500/111 + -6/37. Suppose 10k + 11 = 8k + a, -4k + 3a - 21 = 0. Is k at most as big as l? True Let m(l) = l*2 + 22l + 57. Let c be m(-19). Is -6/23 less than or equal to c? True Let i = -79 - -42. Let c = 11 + i. Let s = c - -27. Is 1 equal to s? True Let h(u) = -248u + 6. Let l be h(2). Let w = l - -3412/7. Let x = w - -17/7. Is x >= 0? False Let k(u) = 8u + 16. Let h be k(-2). Which is greater: 1/1241 or h? 1/1241 Let k = -41360/63 - -5708/9. Which is bigger: k or -22? -22 Let t be 10/4(-4)/(-5). Suppose 23 = 7z - 2z + tv, -5z = v - 24. Let u = 10 - z. Is 5 less than or equal to u? True Suppose 0 = -5r + 5f - 4f - 11, -3r + 5f + 11 = 0. Let q be (-1 - 6/(-10))/(r/(-5)). Which is smaller: 6/17 or q? q Let s = 3 + -4. Let i = -98 - -96. Let c be -5 - (i - (-92)/(-28)). Which is smaller: c or s? s Suppose -5q + 2y + 3y - 25 = 0, 3q + 2y = 10. Let k(f) = -9f + 3. Let j be k(3). Let b be j/(-714)(-7)/(-6). Which is smaller: b or q? q Let s be (-33984)/(-2600) + -3 + -1 + 2. Let g = -146/13 + s. Is 0 >= g? True Let p be 17 + 4/(-2). Let d = -4 + p. Let z(h) = -h*3 + 3h**2 + h - 1. Let r be z(3). Which is smaller: r or d? d Let k = -721 - -698.	{ "pile_set_name": "DM Mathematics" }
Give prob of sequence tww. 1/56 Calculate prob of sequence bnb when three letters picked without replacement from {b: 3, n: 11, w: 2, j: 3}. 11/969 Calculate prob of sequence pacc when four letters picked without replacement from {l: 1, a: 1, z: 4, p: 3, c: 4}. 3/1430 Calculate prob of sequence qxb when three letters picked without replacement from xsxqhdsqbdhxsqddsdsd. 1/760 What is prob of sequence uuw when three letters picked without replacement from {i: 6, u: 2, w: 11}? 11/2907 Two letters picked without replacement from {a: 1, m: 1, u: 1, g: 1, d: 1}. Give prob of sequence ug. 1/20 Calculate prob of sequence fkk when three letters picked without replacement from kkkkkkkkkkkkkkkkfkk. 1/19 Calculate prob of sequence adc when three letters picked without replacement from acccaiccdcaandcac. 1/51 What is prob of sequence vrvk when four letters picked without replacement from vvrk? 1/12 What is prob of sequence hi when two letters picked without replacement from {h: 10, z: 1, f: 3, i: 4}? 20/153 Three letters picked without replacement from cckjcjrrkc. Give prob of sequence cjr. 1/45 Calculate prob of sequence hyyh when four letters picked without replacement from ychycchcctchccct. 1/3640 What is prob of sequence llol when four letters picked without replacement from {l: 9, o: 2}? 7/55 Four letters picked without replacement from {s: 1, f: 1, c: 3}. Give prob of sequence fccc. 1/20 Calculate prob of sequence qsx when three letters picked without replacement from {x: 1, s: 1, p: 1, e: 1, c: 2, q: 2}. 1/168 Calculate prob of sequence gx when two letters picked without replacement from xkrrgrrgr. 1/36 Four letters picked without replacement from {p: 5, n: 1, b: 2, c: 1}. What is prob of sequence bnpc? 5/1512 Four letters picked without replacement from ccccccc. Give prob of sequence cccc. 1 Calculate prob of sequence ko when two letters picked without replacement from orrrorrokrrrcccrk. 3/136 What is prob of sequence mqn when three letters picked without replacement from qccxcqqcnqqcmmqcxqc? 7/2907 Two letters picked without replacement from {w: 1, z: 9, b: 1, f: 2, m: 5}. Give prob of sequence fm. 5/153 Calculate prob of sequence tuun when four letters picked without replacement from tnuttutttpppptt. 2/4095 Calculate prob of sequence ene when three letters picked without replacement from {y: 1, n: 1, e: 2}. 1/12 Calculate prob of sequence yc when two letters picked without replacement from {e: 1, z: 1, y: 3, c: 7, r: 1}. 7/52 What is prob of sequence qtq when three letters picked without replacement from iigqigiiitiqgittiii? 1/969 Two letters picked without replacement from zznjnnjnnnzzjzz. What is prob of sequence nj? 3/35 What is prob of sequence acr when three letters picked without replacement from {c: 2, a: 1, l: 3, r: 1}? 1/105 Three letters picked without replacement from eesgeeexg. Give prob of sequence esx. 5/504 Two letters picked without replacement from {d: 2, w: 1, r: 2, l: 1, z: 8}. Give prob of sequence zw. 4/91 Two letters picked without replacement from {d: 1, c: 2, h: 2, t: 2, p: 1}. Give prob of sequence ht. 1/14 Calculate prob of sequence ojz when three letters picked without replacement from lrzrzrrrylllrjol. 1/1680 Four letters picked without replacement from iiiweeiewgnqnewnwiww. What is prob of sequence ewnn? 2/1615 Three letters picked without replacement from {h: 7, m: 1, r: 1}. Give prob of sequence rhh. 1/12 Calculate prob of sequence rsrv when four letters picked without replacement from {v: 2, r: 2, s: 7}. 7/1980 Three letters picked without replacement from wbabn. What is prob of sequence bbn? 1/30 Two letters picked without replacement from {z: 1, h: 1, p: 6, u: 3, a: 1}. Give prob of sequence hz. 1/132 Two letters picked without replacement from uduuddrurdurrd. What is prob of sequence uu? 10/91 What is prob of sequence bbmb when four letters picked without replacement from {k: 2, p: 3, m: 8, b: 6}? 10/969 Calculate prob of sequence xxz when three letters picked without replacement from zxe. 0 Calculate prob of sequence iiii when four letters picked without replacement from iiiiii. 1 What is prob of sequence jf when two letters picked without replacement from {f: 2, p: 1, j: 4}? 4/21 What is prob of sequence heh when three letters picked without replacement from eheeeheeeeehhe? 5/91 What is prob of sequence un when two letters picked without replacement from {n: 1, d: 2, u: 11}? 11/182 Two letters picked without replacement from {i: 1, w: 1, a: 2, e: 12, l: 1}. What is prob of sequence iw? 1/272 What is prob of sequence os when two letters picked without replacement from somsooqsdqsoqooq? 1/10 Three letters picked without replacement from dpdppveeepegvv. What is prob of sequence gde? 1/273 Three letters picked without replacement from {y: 14, c: 4}. What is prob of sequence ccy? 7/204 What is prob of sequence ahha when four letters picked without replacement from ahahghhhg? 5/378 What is prob of sequence ggo when three letters picked without replacement from {m: 5, g: 2, t: 2, c: 1, o: 4}? 1/273 Calculate prob of sequence yx when two letters picked without replacement from {y: 4, x: 7}. 14/55 What is prob of sequence vzjk when four letters picked without replacement from {v: 2, j: 1, r: 2, k: 2, z: 1}? 1/420 Calculate prob of sequence ebbb when four letters picked without replacement from bbbbbibeeb. 1/12 Three letters picked without replacement from xnnyxnyyxxxxxxxxyx. What is prob of sequence nyn? 1/204 What is prob of sequence pp when two letters picked without replacement from {g: 2, p: 7, o: 2}? 21/55 What is prob of sequence hhj when three letters picked without replacement from {j: 7, h: 6}? 35/286 Three letters picked without replacement from wwdwzwwwwwco. Give prob of sequence owc. 1/165 What is prob of sequence ch when two letters picked without replacement from {h: 1, n: 1, k: 3, l: 1, c: 1}? 1/42 Four letters picked without replacement from xpjyppjgjpypgjjpj. Give prob of sequence pxyg. 1/2380 Four letters picked without replacement from {n: 5, a: 3}. Give prob of sequence anna. 1/14 Four letters picked without replacement from {b: 5, m: 7, h: 4}. Give prob of sequence hhhb. 1/364 Three letters picked without replacement from {a: 2, i: 2, z: 9, p: 3}. What is prob of sequence iai? 1/840 Calculate prob of sequence jv when two letters picked without replacement from mojvm. 1/20 Three letters picked without replacement from nnnnnnn. Give prob of sequence nnn. 1 Two letters picked without replacement from eeeekeeekeeoekeeoe. What is prob of sequence ke? 13/102 Four letters picked without replacement from {a: 7, j: 7, t: 4}. What is prob of sequence jatj? 49/3060 What is prob of sequence uv when two letters picked without replacement from ulvkfugv? 1/14 Three letters picked without replacement from {e: 2, l: 1, w: 2, q: 1}. Give prob of sequence ewl. 1/30 Four letters picked without replacement from lunnffnnutlcn. Give prob of sequence utln. 1/858 Four letters picked without replacement from {i: 5, v: 5}. Give prob of sequence vivv. 5/84 Four letters picked without replacement from {v: 2, b: 16}. What is prob of sequence bvbb? 14/153 Three letters picked without replacement from rrccrrrmrmhccrrrhrrr. What is prob of sequence hrm? 2/285 Calculate prob of sequence jjjj when four letters picked without replacement from {j: 10}. 1 Calculate prob of sequence yplp when four letters picked without replacement from ylaplladpaa. 1/1320 What is prob of sequence phrh when four letters picked without replacement from {p: 8, x: 3, h: 2, r: 6}? 1/969 Four letters picked without replacement from {b: 3, o: 3, n: 1, m: 2, v: 2, s: 4}. What is prob of sequence mbbs? 2/1365 What is prob of sequence ufui when four letters picked without replacement from fiujfiuijfufuifiif? 1/170 Three letters picked without replacement from {j: 2, n: 1}. Give prob of sequence jnj. 1/3 Two letters picked without replacement from {b: 2, i: 1, r: 2, f: 2, u: 3, m: 4}. What is prob of sequence rm? 4/91 Two letters picked without replacement from cddanrm. What is prob of sequence md? 1/21 Calculate prob of sequence uo when two letters picked without replacement from goefeuullgfe. 1/66 Three letters picked without replacement from rsrrrrrrrrr	{ "pile_set_name": "DM Mathematics" }
lue? (a) 2/37 (b) 18 (c) 0 a Which is the biggest value? (a) 1 (b) -10 (c) 0.2 (d) -0.4 a What is the biggest value in -2/11, -3, 5, 0.245? 5 What is the fourth smallest value in -0.4, -0.1, 0.4, 13? 13 What is the third smallest value in 62, 4, 5? 62 Which is the second smallest value? (a) -3/4 (b) -0.1 (c) 19 b What is the second biggest value in -1, 147, 2, -4? 2 What is the smallest value in -5, -2, 5? -5 Which is the second biggest value? (a) -1 (b) 2.2 (c) 0.5 (d) -0.2 c Which is the fourth smallest value? (a) -4 (b) 4 (c) -5 (d) 0.1 (e) 3 e Which is the second smallest value? (a) -0.1 (b) 0.2 (c) 5 (d) 2/3 b Which is the fifth smallest value? (a) 0 (b) -1/21 (c) 1/2 (d) 1 (e) 0.66 d Which is the second smallest value? (a) 2/15 (b) -4 (c) 4 (d) 0.4 (e) 183/7 a What is the fifth biggest value in 1/4, 4, -2/11, 2/5, 2/7? -2/11 Which is the second biggest value? (a) 5 (b) 0.2 (c) 74 a Which is the second biggest value? (a) -2 (b) -0.5 (c) 1/4 (d) -16 (e) -0.2 e Which is the smallest value? (a) -49/9 (b) 3/4 (c) -0.1 a Which is the third biggest value? (a) 0 (b) 0.08 (c) 0.1 a What is the smallest value in 13, -12/11, 3? -12/11 Which is the biggest value? (a) -6 (b) -4 (c) -3/8 (d) 1/3 d Which is the biggest value? (a) -4 (b) -3 (c) -1/942 (d) 0.2 d Which is the second biggest value? (a) 0.07 (b) -2 (c) 4 a Which is the fifth smallest value? (a) 0.1 (b) -8 (c) 3/7 (d) -3 (e) 3/5 e What is the fourth biggest value in -0.1, 138, -1, 0? -1 What is the third smallest value in 0.6, 0.15, -2/7? 0.6 What is the third biggest value in 194, -3/5, -0.1, 2? -0.1 Which is the smallest value? (a) 0.4 (b) 0 (c) -1.7 (d) -5 (e) 2 d What is the third smallest value in -0.1, -0.3, 0.22? 0.22 Which is the third biggest value? (a) -4 (b) 57 (c) 2/9 a What is the third smallest value in -0.2, 50/3, 3.4? 50/3 What is the biggest value in 1, -993, -1? 1 Which is the smallest value? (a) 0.2 (b) 19 (c) 1/34 c What is the fifth biggest value in -0.2, -0.13, -2, 1, -5? -5 What is the third smallest value in 1/2, -5, -1, 4? 1/2 Which is the smallest value? (a) -2.42 (b) 0.1 (c) -3/7 a Which is the second biggest value? (a) -2 (b) -1/5 (c) -0.21 c What is the fourth smallest value in 1/2, -5, 0.1, -1/40? 1/2 Which is the third smallest value? (a) 2/3 (b) 0 (c) 1 (d) -3 a What is the second smallest value in -1/9, 4, -0.59? -1/9 Which is the second smallest value? (a) 3 (b) 0.166 (c) -2/3 (d) 2 b What is the second biggest value in 1, 0.4, -4, 18? 1 Which is the fourth smallest value? (a) -1/13 (b) -2/13 (c) -3 (d) -1 a What is the fourth smallest value in -5, -0.1, 4, 0.0078? 4 Which is the third smallest value? (a) -1/2 (b) 0 (c) -1644 b What is the smallest value in 3, 29, 4? 3 Which is the biggest value? (a) -0.5 (b) 0 (c) -2/3 (d) 5 d What is the second biggest value in 3/4, -0.3, 0.05, -9, -2/13? 0.05 Which is the smallest value? (a) -1 (b) -0.4 (c) 1 (d) 21 a What is the second smallest value in 0.5, -4, -21, 2/15, -0.02? -4 What is the third biggest value in -2, 91/3, -0.15? -2 What is the biggest value in 0.5, 0.3, -3/40? 0.5 Which is the smallest value? (a) 0.1 (b) 1/5 (c) -2/7 (d) 245 c What is the second smallest value in 2, -4, 4, 2/5, 1.8? 2/5 Which is the smallest value? (a) -1 (b) -61 (c) 5 b Which is the third smallest value? (a) 3/13 (b) -1/3 (c) 2 c Which is the second smallest value? (a) 2/27 (b) 32 (c) -0.2 a What is the smallest value in 1, 0.08, -59? -59 Which is the biggest value? (a) -1 (b) 68 (c) 4 (d) -7 (e) -4 b What is the third biggest value in 0.04, -2/35, -1? -1 Which is the second smallest value? (a) -0.14 (b) 5 (c) 1 c What is the second biggest value in 2/11, -27, 2/17, -2/13? 2/17 Which is the second smallest value? (a) -0.7 (b) 1/2 (c) 0 (d) 4/7 c What is the biggest value in 0.1, -91, -2/19? 0.1 What is the fourth smallest value in 1, 0.0573, -5, -5/3? 1 What is the biggest value in 298, 3, -3/5? 298 What is the third smallest value in 9, -7, 5? 9 Which is the second biggest value? (a) -152 (b) -8 (c) 0 b What is the third biggest value in 2/5, 5, -4, 25/2? 2/5 Which is the smallest value? (a) -1 (b) 8 (c) 0.2 a What is the second biggest value in -0.5, 69, -2/7? -2/7 Which is the second smallest value? (a) -0.02 (b) -1 (c) 4 (d) 0.2 a Which is the second smallest value? (a) -4 (b) -14 (c) 0.11 (d) 4 a Which is the third smallest value? (a) -0.5 (b) -5 (c) 1/10 (d) -22/7 a What is the biggest value in 0, -399, -1/3, -5? 0 What is the second biggest value in -54, -5, -3? -5 Which is the second smallest value? (a) 0.2 (b) 2/3 (c) -4 (d) -12/13 d Which is the fourth smallest value? (a) 2 (b) -3/2 (c) -1 (d) 71 d What is the biggest value in 30, 2, 0.1? 30 What is the third biggest value in -2/5, 0.1, 5/23? -2/5 Which is the third smallest value? (a) 1 (b) 3/5 (c) -361 a What is the third smallest value in 5, -1, -19, 0? 0 What is the second biggest value in -2/5, -1, 3/4, -1/185? -1/185 Which is the fourth smallest value? (a) -3 (b) -131 (c) -0.2 (d) 0.1 d What is the third smallest value in -1, 0.1, 2/47, 1/2? 0.1 What is the fourth biggest value in 0.2, -1, -4/3, 3/5? -4/3 Which is the fourth biggest value? (a) -5 (b) 0.01 (c) -1/2 (d) 2/7 a Which is the third biggest value? (a) -1/2 (b) -0.11 (c) 7 a Which is the third biggest value? (a) -7/4 (b) -1 (c) 1/4 (d) -5 a What is the smallest value in -138/41, 5, 0? -138/41 What is the biggest value in 14, -2/15, -0.3? 14 What is the third smallest value in -2.79, -6, 5? 5 What is the second smallest value in 38, -2/7, -16? -2/7 Which is the second smallest value? (a) -5/3 (b) 0.25 (c) -5 a Which is the smallest value? (a) 5 (b) -6 (c) 3 (d) -0.2 b What is the fourth smallest value in 0, -4, -2/9, -24? 0 Which is the second biggest value? (a) -0.4 (b) 0 (c) -5 (d) -1/4 d Which is the second smallest value? (a) 1/4 (b) 1 (c) 3/7 (d) 133 c Which is the third biggest value? (a) -12.3 (b) 2 (c) 3 (d) 5 b Which is the biggest value? (a) 0.181 (b) 2/17 (c) 4 (d) -0.1 (e) 6 e What is the second smallest value in 9, -40, -0.1? -0.1 Which is the third smallest value? (a) -4 (b) -6 (c) 0.02 c Which is the biggest value? (a) 5 (b) -3 (c) -0.057 (d) -2/9 (e) -0.4 a What is the third biggest value in 82, -1, 2, 5? 2 What is the biggest value in -3/7, -20, -1, -1/9? -1/9 Which is the second smallest value? (a) -26.5 (b) -0.3 (c) -5 c Which is the third smallest value? (a) 2 (b) 9 (c) -7/3 (d) -1 a What is the second smallest value in 1/7, 454, -0.02? 1/7 Which is the smallest value? (a) -0.1 (b) -0.4 (c) -0.5 (d) 29 c Which is the smallest value? (a) 1737 (b) -6 (c) 2/5 b Which is the second smallest value? (a) 0.049 (b) -6 (c) -1 (d) 1/3 c What is the second biggest value in -5, -3/10, -4/3, 10? -3/10 Which is the biggest value? (a) -0.5 (b) -6/151 (c) 0.3 c What is the smallest value in 2/9, 0.01, 4? 0.01 What is the second biggest value in 1, 3/5, -0.9? 3/5 Which is the second smallest value? (a) -0.2 (b) 6 (c) 4 (d) 3 d What is the fifth smallest value in 1/3, 565, -1/10, 0.4, -0.2? 565 Which is the second smallest value? (a) -0.008 (b) -4 (c) -12/115 c What is the fifth smallest value in 3/2, 0.5, 0.02, 0, -0.12? 3/2 What is the second biggest value in -1/3, -16, -1? -1 What is the fourth smallest value in 1/2, -2/3, -3, -4? 1/2 Which is the third biggest value? (a) 59 (b) 4 (c) 8 b Which is the biggest value? (a) 3 (b) -1/3 (c) -4 a Which is the third biggest value? (a) 12 (b) -4 (c) -0.4 b Which is the third smallest value? (a) -0.3 (b) 4/9 (c) 0 (d) -50 c What is the second biggest value in 3, -2/5, -4/5, -12? -2/5 What is the second smallest value in -128, 0.12, -1? -1 What is the third smallest value in 3/10, 0.6, -6? 0.6 Which is the third biggest value? (a) -10 (b) 0.4 (c) 1 (d) 3/5 b What is the fourth smallest value in 1.3, -3/2, 1/4, 0? 1.3 Which is the smallest value? (a) 1 (b) -0.6 (c) -4 c What is the second smallest value in 0.7, -2/223, -3? -2/223 Which is the second smallest value? (a) -0.2 (b) -10 (c) -1/12 a Which is the fou	{ "pile_set_name": "DM Mathematics" }
- f. List the prime factors of h. 2, 3 Let q(i) = -i*2 + 14i - 11. List the prime factors of q(6). 37 Suppose 2m + 3p = 73, -4p + 136 = 4m - 0p. Let d = m - 12. Suppose d = 4y - 23. List the prime factors of y. 2, 5 Let t(v) = v3 + v2 - 7v - 13. List the prime factors of t(6). 197 Suppose -2d + 36 = z - 0d, 215 = 5z + 3d. What are the prime factors of z? 2, 23 Suppose -3w + 1 = -k, -k - 7 = -4w - 5. Let m = 7 + w. List the prime factors of m. 2 Let a(v) = -v3 - 7v*2 + 7v - 4. Let m be a(-8). Suppose -p + 0p = -2. Suppose -8 = pd, o + md + 2 = -3. List the prime factors of o. 11 Let d = 39 + -35. List the prime factors of d. 2 What are the prime factors of 12/10150/2? 2, 3, 5 Let w(h) = h*3 + 4h*2 - 5h - 4. Let t be w(-5). What are the prime factors of 15 + t/8-2? 2 Suppose 8 = t - 2s, -8 = 3t - 0s + 2s. Suppose 0 = -2x + 4 - t. List the prime factors of (32/40)/(x/30). 2, 3 Suppose 2a + p = -1, p = 5p - 20. Let h(l) be the third derivative of l5/20 + l4/8 - l3/6 + l2. List the prime factors of h(a). 17 Let g = -58 - -20. Let c = 55 + g. What are the prime factors of c? 17 Suppose 22 = 5a - 173. Suppose -a = -4l + l. List the prime factors of l. 13 Let o(n) = n*3 + 10n*2 + 11n + 8. What are the prime factors of o(-8)? 2, 3 List the prime factors of (-1)/(-5) - 195/(-25). 2 Suppose 3g + p - 346 = 0, -3g - p + 348 = 2p. Suppose 15j - 10j - g = 0. List the prime factors of j. 23 Suppose 22q = 17q + 295. List the prime factors of q. 59 Suppose 4p = 2b - 98, -3p = -0b + 2b - 77. List the prime factors of b. 43 Let m be 4(2 + -3)/(-2). Let g = 2 - -1. Suppose -3b + 4i = gi - 42, i - 23 = -mb. List the prime factors of b. 13 Let n = -674 + 959. List the prime factors of n. 3, 5, 19 Suppose -5n - 4j = -15, n + 0n - 3 = 2j. Suppose -nl = -l + 4. List the prime factors of 2 - (l - (-2)/(-1)). 2, 3 What are the prime factors of 48/5160/48? 2 Suppose 2v + h - 11 = -0v, 5h = 5v - 5. Let g be (-2)/(-8) - (-139)/v. Let u = g - 23. List the prime factors of u. 2, 3 Suppose 3i - 19 = 2k, -4i + 0i + 4k + 28 = 0. Suppose ip = j, -3j = -8j - 25. List the prime factors of -3 - (p + -2) - -15. 3, 5 Suppose -a - 2a + 54 = 0. What are the prime factors of a? 2, 3 Suppose -4u + 8u + h = 108, -4h = u - 42. List the prime factors of u. 2, 13 Let i be -5 - -4 - (0 - -3). List the prime factors of (-22 - -10)2/i. 2, 3 What are the prime factors of (-324)/(-8) + 3/6? 41 Let o(x) = -x*3 - 8x*2 - 2x + 2. List the prime factors of o(-8). 2, 3 Suppose -4j = -3j - 1. Suppose -j + 30 = 5u - 3n, -5n - 23 = -2u. Suppose 2r + 3w = 2 - 1, 0 = -5r - uw + 6. List the prime factors of r. 2 Let b = -4 + 9. Suppose -bj + 126 = 31. What are the prime factors of j? 19 Suppose 0 = 2z - 27 - 139. Let h = -46 + z. What are the prime factors of h? 37 Let v(f) = f*3 - 10f*2 - 11f + 4. Let u be v(11). List the prime factors of u/12 - 74/(-3). 5 Let n(p) = -p*3 + 5p*2 + 2p - 5. Let s be n(-3). Suppose -s = -3g + 32. What are the prime factors of g? 31 Let g = 0 - -2. Suppose 80 = go + 2o. Suppose -28 = -4j + o. What are the prime factors of j? 2, 3 Let m = -111 - -201. Suppose 5a = m + 235. Suppose 10b = 5b + a. List the prime factors of b. 13 Let u be (-530)/(-1)(7 - 6). Let y be u/7 - (-4)/14. Suppose -y = -3v - 25. What are the prime factors of v? 17 Suppose -4h + 122 = -2o, 0o + o - 71 = -2h. List the prime factors of h + -1 + 1 + -2. 31 Suppose 0 = 4j + j - 10. Suppose 2b - 10 = -j. Suppose 9 = 7o - bo. What are the prime factors of o? 3 Let t = -135 + 258. List the prime factors of t. 3, 41 Suppose 5y - 3 = -v + 10, 0 = -4v + y + 94. List the prime factors of v. 23 Suppose -4r + 0r = -136. What are the prime factors of r? 2, 17 Suppose -3k - 68 - 52 = -x, -5k - 199 = -2x. Let s = k - -59. List the prime factors of s. 2, 3 Suppose u + a = 4u - 87, -u - 3a + 29 = 0. What are the prime factors of u? 29 Let n be 12/(-2)(4 - 0). List the prime factors of 30/(-4)32/n. 2, 5 Let x = 12 + -6. Suppose -3o + 6 = -q, -3q - o + x - 4 = 0. Suppose -y + 5a - 4a + 9 = q, 4a = -16. What are the prime factors of y? 5 Let g = -10 + 14. Suppose 0 = -gm + 8. Suppose -5a - mr - r + 12 = 0, -5a + r + 16 = 0. List the prime factors of a. 3 Suppose -10x + 8x + 8 = 0. List the prime factors of 54/x + 1/2. 2, 7 Suppose -1222 = -6z + 3z + 2a, 4a - 2000 = -5z. List the prime factors of z. 2, 101 Suppose -36 = -f - f. List the prime factors of f. 2, 3 Let j = 4 - 5. Let q = j - -22. What are the prime factors of q? 3, 7 Let g(p) = p*2 - 11p + 5. Let k be g(12). Let l = k - 11. What are the prime factors of l? 2, 3 Let k be (3 - 7)/((-1)/7). Let h = k + -19. Let g(p) = -p*3 + 8p*2 + 9p + 3. What are the prime factors of g(h)? 3 Let u = -12 - -27. List the prime factors of u. 3, 5 Let n = 53 + -32. Suppose -n + 4 = -p. What are the prime factors of p? 17 Let a = -6 - -9. Let u(f) = -3f2 + 2f + 2 - 3 + 2fa - f. What are the prime factors of u(2)? 5 Let n = 4 + 2. Let u(r) = r2 - 5r - 8. Let i be u(n). List the prime factors of (i + 1)/(3/(-12)). 2 List the prime factors of (-256)/16(0 - 1). 2 Let l = 103 - 57. What are the prime factors of l? 2, 23 Suppose -3g + 0z + 228 = 3z, 3g + 4z = 233. What are the prime factors of g? 71 Let p(u) = -u*3 - 5u*2 - 6. Let c be p(-5). Let a be 5(-39)/30c. List the prime factors of 6/(-9)a/(-2). 13 Let t be 2 - 1 - 0/(-2). Let b = 6 - t. Suppose -2 - 1 = -n + 3j, bn = -2j + 32. What are the prime factors of n? 2, 3 Suppose -6m + 5m + 4 = 0. Suppose -25 = -mq - 5. List the prime factors of q. 5 What are the prime factors of (-552)/(2 + -4) + (-2)/(-2)? 277 Let w(d) be the third derivative of -5d4/12 + d3/2 - 6d*2. What are the prime factors of w(-1)? 13 Suppose 3l - 354 = -4f, 0l + 3f = -4l + 472. What are the prime factors of l? 2, 59 Let o = -778 + 1107. What are the prime factors of o? 7, 47 Let g(j) = 10j - 3. What are the prime factors of g(6)? 3, 19 What are the prime factors of -4(805/(-20))/7? 23 Suppose -2g - 2g = -16, 0 = -b + 5g - 16. Let a be b/5(0 - -5). Suppose 27 = aq - 3s, -4q = q - 5s - 30. What are the prime factors of q? 3 Suppose 4n - 255 = 317. List the prime factors of n. 11, 13 Suppose -5o + 0o + 30 = 0. Suppose 4h + op - 38 = p, -5p - 18 = -4h. What are the prime factors of h? 7 Let i(j) = 20j - 21. What are the prime factors of i(5)? 79 Suppose -q = -4q + k + 72, -4k = q - 37. List the prime factors of q. 5 Let w(a) = a*2 - 1. List the prime factors of w(4). 3, 5 Let n be 3 + 1 + -2 + 3. Suppose na + 25 + 60 = 0. Let q = -11 - a. What are the prime factors of q? 2, 3 Let w = 19 - 14. Suppose -b + 18 = -wl, -l = -4l. List the prime factors of b. 2, 3 Let w(j) = 4j - 7. Let t be w(10). List the prime factors of 61t/6. 3, 11 Let c(s) = 3 + 9 - s - 3. What are the prime factors of c(4)? 5 Let o be (-3)/((-1)/((-4)/(-6))). Let g(h) = 2h*2 - 4h. Let b be g(3). Suppose 7m - 4 = 3m - od, 0 = -2m - 3d - b. What are the prime factors of m? 3 List the prime factors of -7(-4 + 3 + 0). 7 Let a(h) = -2h3 + h2 + h + 1. Let f be (9/6)/3-2. Let w be (-1)/f + -1 - 1. List the prime factors of a(w). 3 Let f be 2 + -1 + 442/(-13). Let q = f - -55. List the prime factors of q. 2, 11 Suppose -7q + 524 = -5q - 4m, 4m = -3q + 836. List the prime factors of q. 2, 17 Suppose 75 = 5o - 2o. List the prime factors of o. 5 Let b be 10/(-3)99/(-2). Suppose 0 = -5u + b + 15. Suppose -3f - u = -6f. List the prime factors of f. 2, 3 Let t = 77 - 65. What are the prime factors of t? 2, 3 Let r(k) = -5 - 10 - 7k*3 - 2k + 14. What are the prime factors of r(-1)? 2 Suppose 3k - 40 - 53 = 0. List the prime factors of k. 31 What are the prime factors of -3335/(-75)5? 67 Suppose -2r + 372 = -0r. Let l = r - 71. Suppose 3k - 52 - 9 = w, w = -5k + l. What are the prime factors of k? 2, 11 Let q be 1(3 - 3 - -1). List the prime factors of -2 + -2 - (-59)/q. 5, 11 Suppose 0 = 2s + d - 6d - 168, 2s = -4d + 204. Suppose -19 = -3v - s. Let x = v - -37. List the prime factors of x. 2, 3 Let j(d) = -d3 - 4d*2 - 4d - 3. Let q be j(-5)	{ "pile_set_name": "DM Mathematics" }
e -2g - 7 = -3p, 0g - lp + 27 = 3g. Solve -4i + 6 = 8s - 6s, -9 = gs + i for s. -3 Suppose -30 = -5o + 3h, -6h + 4h = 5o - 30. Let y be (-16)/o(-9)/2. Let v be -38/y-2. Solve -d = -3z + 11, -5z + 9 = -vd - 0d for d. 4 Suppose 2w - 2g = -3w + 45, -w = -g - 12. Let m = w - 3. Solve -my + 3r + 20 = -5y, 0 = 2y + 3r + 25 for y. -5 Let a = 141 - 142. Let b be (-3)/4 - (-1)/(-4). Let h = a - b. Solve -r = -4x - 6r - 10, x + 5r - 5 = h for x. -5 Let m(a) = -a*2 - 9a + 11. Let y be m(-9). Suppose -yd + 14d - 9 = 0. Suppose r - dr + 40 = 0. Solve 4o - r = 0, 2z + 2o = o - 5 for z. -5 Let z = 11 - 7. Let w = -7 - -16. Suppose 2v + v - w = 0. Solve 3x + vd = x + z, 0 = -d for x. 2 Let p(n) = 13n - 9. Let a be p(1). Solve -ak = -4f + 5f - 21, -3f = -k + 2 for f. 1 Suppose 0 = -12z + 8z - 2g + 42, 2z - g = 11. Solve 0 = -2v + 4d + z, -5v - 4d = -6d + 4 for v. -2 Let w(o) = -8o + 13. Let k be w(6). Let i = -27 - k. Suppose -2b + c + 41 = 4, -106 = -5b - 2c. Solve 2s + i = 3h, 0 = -5s + 4h - 0h - b for s. -4 Let v(d) = -d*3 + 2d*2 + 8d - 1. Let p be v(4). Let g = p + 7. Solve 2c - 5q = -g, 4c = -q + 8 + 2 for c. 2 Let z(c) = c2 + c - 36. Let l be z(0). Let r be (-2868)/l - 1/(-3). Let t = r + -45. Solve 5j + 23 = w, 5w - 4j - t = j for w. 3 Suppose i = 4a - 4, 3i = -4a + 2a + 16. Suppose 3w + aw + 3l - 19 = 0, 0 = -3w + 2l. Solve 5b + 15 = k, b - 2b = w for k. 5 Suppose -183c + 181c = -8. Solve -5m - 2 = -2s, -3s + c = s for m. 0 Suppose -5u + 17 - 62 = 0. Suppose -168 = -8a - 4a. Let h = a + u. Solve -hm + 8 = -3m, 16 = 5w + 4m for w. 0 Let f = -62 - -64. Solve 0 = -n + 3o + f - 10, n - 2o + 5 = 0 for n. 1 Let f(z) = z2 + 2. Suppose 0 = -n + 3n. Let h be f(n). Solve -9 = hr - 1, -t + 13 = -4r for t. -3 Let r(z) = -z*3 - 21z*2 - 2z - 41. Let w be r(-21). Solve 4j + w - 2 = -3x, 2j = x + 3 for j. 1 Let x(z) = z3 + 71z*2 - 74z - 142. Let k be x(-72). Solve -4v - 4 - 12 = 2r, 2v + 12 = -kr for v. -2 Let b = 7 + 12. Suppose -b = 7n - 54. Solve 0 = 4m + 2f - 6, 0 = nf - 25 for m. -1 Let w = 119 + -113. Let d be (w/(-4))/((-18)/60). Solve u - i - 3i = 13, di + 16 = u for u. 1 Suppose -5d = 4a - 86, -3a - 2d + 42 = -a. Solve 6s + a = s + 4v, -5s - 18 = -3v for s. -3 Let d(b) = 5b3 + 3b*2 - 3b. Let a be d(1). Solve j - 5 = 2y + 6j, -2y = -aj - 25 for y. 5 Suppose -9k - 17k = -156. Solve m - 5l = -kl + 2, -1 = l for m. 3 Suppose 18u = 25u. Solve -4y - 24 = -4b, -4y + ub - 15 = -b for y. -3 Let r(b) = -11b + 82. Let h be r(7). Solve 3i + 13 = ht, 4i + t - 7 = 9i for i. -1 Suppose 5n = -4h - 25, -7 + 19 = 4n. Let y = h + -9. Let c = 23 + y. Solve 2g + 0g = v + c, -g - 9 = 5v for g. 1 Let c = 890 - 888. Solve -2u = -v + 1, -cv = -0v + 10 for u. -3 Let f(l) = 10l + 533. Let r be f(-53). Solve 24 = x - 5u, -x + 4u + 32 = rx for x. 4 Let v = 161 - 161. Solve -8 = 4g - vg + 2c, 0 = c + 4 for g. 0 Let k(y) = -y2 + 54y - 153. Let w be k(3). Solve -o - 3 = -2g - w, 2o + 5g - 12 = 0 for o. 1 Suppose 4v - 351 + 335 = 0. Solve 5r + 7 = -3m, vm - r + 2 = -4r for m. 1 Let z be ((-8)/12 + (-20)/6)-16. Let t = 65 - z. Solve 5y - 2 + t = -3r, 0 = 4r + y - 7 for r. 2 Suppose -5k - n + 25 = 0, -2k + 4n + 4 = -6. Suppose -4t + 0g = -2g - 34, kt - g - 41 = 0. Solve -5 = 5l, 2c - 2 - t = 4l for c. 3 Let h(s) = 2s2 + 3s - 1. Let t be h(-2). Suppose 3d + 7 = 5g, d + t = -3g + 8. Solve gl - 5f - 6 + 18 = 0, 5l - f - 16 = 0 for l. 4 Suppose -4h - 22 = -z, -2h = -10z + 7z + 26. Solve x - z = 3a, -3x = -x + a + 9 for x. -3 Suppose -2 - 2 = -2s. Let m = s + 5. Let l(n) = n3 - 7n*2 + 2n + 2. Let t be l(m). Solve 0p = 4y - 3p + t, 0 = 5y - 3p + 17 for y. -1 Suppose 311d + 15 = 316d. Solve -dj + 5a = 25, 0 = -5j - 5a + 2a + 15 for j. 0 Let m be 16/2 + -3 + -1. Suppose 7 = 3o + 1, 14 = 3j - 5o. Suppose 13s - js = 40. Solve 0 = -mb - 0 - 16, s = -4q + 2b for q. -4 Let c(v) = -v + 39. Suppose q = 5q. Let k be c(q). Let x be 169/k13. Solve 2t + 3r + 10 = r, 5t + r + x = 0 for t. -2 Suppose 4u - 3x - 13 = 10, -3u + 3x = -21. Suppose a = 3 - 0. Suppose 2b + 0m + 1 = -am, -3m = 9. Solve -4o + up = 12, -bo - 7p = -3p + 36 for o. -5 Let k = -594 - -599. Solve 0 = -m + 3j - 1, -2j = -km - 4j + 12 for m. 2 Let w(s) = -s2 + 28s - 184. Let x be w(16). Solve -x = 2h + z + 3, 0 = -5h + 3z for h. -3 Let g be -2(-2)/(-3 - -1). Let x be ((-3)/(-9))/(g/(-18)). Solve 5h - 4a = x, 5h - 2a - 7 = 2 for h. 3 Let z = -25 + 16. Let r = z - -9. Suppose 5h - 4h - 6 = r. Solve -4a = 4m + 16, -2a + ha - 11 = 5m for a. -1 Let b = 39 + -35. Suppose s = b - 1. Suppose 0 = sz - 9z + 30. Solve -5j + 7 = -2h + h, -zj = -4h + 2 for j. 2 Let t = -331 + 333. Solve 2h = -0i + ti, 4i - 1 = 3h for i. 1 Let o be 6/8 - (-1800)/32. Let u = -53 + o. Solve 3d = -w - 12, 6w - 32 = 2w + ud for w. 3 Suppose 35w = 33w + 4s + 24, 0 = 4w + s - 12. Solve -wq - 5a - 45 = 0, 4a + 6 + 4 = 2q for q. -5 Suppose 0 = 83k - 30k - 1007. Solve m + k = -4q, -4m + 14 = -q - q for q. -5 Suppose n + 5t + 14 = 0, -3t + 28 = 4n + 16. Let z be 0 + (-3 - (-6 - -3)). Solve -3a + s - 6 - 5 = z, 0 = 2a - s + n for a. -5 Let r be (42/(-42) - (-6)/1)1. Solve -3j = -m - 13, 10 = -rj - 2m + 39 for j. 5 Let u = 0 + 3. Let z = -15494 + 15498. Solve 5w + 10 = -5h, zw + 4h - uh + 5 = 0 for w. -1 Let s = -53 - -55. Solve 0 = -su + 3b - 9, -b = -5b + 12 for u. 0 Suppose -66l + 154 = 22. Solve -k - 10 = -lh + 6h, -4k = 8 for h. -2 Suppose d + 33 = 4r - 2d, 4r - 68 = -4d. Suppose -15q - r = -19q. Solve -3g = -9, 6 = -qi + 5g - g for i. 2 Let o(c) = 5c + 84 + c + 4. Let z be o(-12). Solve -2q = -5a + 20, -2q = 3q - 4a + z for q. 0 Let h(o) = -3o + 4 + 5o*2 - 5o2 - o - o2. Let c be h(-4). Suppose -1 = k - c. Solve -kg + 8g = 2n + 2, 5g + 2n + 2 = 0 for g. 0 Let m be (15/(-40))/(3/(-24)). Solve mk - 5v + 5 = -k, -3v = 4k - 35 for k. 5 Let m(t) = t3 + 30t*2 - 4. Let d be m(-30). Let l be (-4 - d)/((1 + 0)-1). Solve lu + r + 2 = -u, -u - 3r - 12 = 0 for u. 3 Suppose u - 4 - 3 = 2d, 4u + 2d - 18 = 0. Let h be 3(-1)/(-3)u. Solve hl = 2m - 1, 0m - 2m - 3 = -l for l. -1 Let g(z) = -z2 + 7z - 10. Let f be g(3). Suppose -4i - 4 = 2s, -2s - 2i = -5s + f. Solve 0 = -w - 2m + 3, -w - 3m + 5 = -s for w. -1 Let y(u) = u + 1. Let j be y(3). Suppose -4v + 5v - 10 = ja, 0 = -2v - 3a - 2. Solve 2p - 3q - 12 = -0p, 4p - vq = 16 for p. 3 Let b = 4 - -47. Let k = -47 + b. Solve d = -3q - 11, -4q + 2q = k for d. -5 Let v = -30 - -32. Let k be 110/25 + v/(-5). Solve x = 3x + 2, kl + 16 = -4x for l. -3 Let z = 633 + -621. Suppose 4y = y. Solve yh + z = 2h - 3w, 5h + w - 13 = 0 for h. 3 Let i be 4 + (-3 - -3 - 4). Suppose -5h + 2k - 6k + 6 = 0, i = 2h + k - 3. Solve 4n - 1 = -hc + 17, -3n + 12 = 0 for c. 1 Let h = -1296 - -1299. Solve -a = hf + 9, -2f = 2a - 0 + 2 for f. -4 Let d = -8 + 13. Suppose -14 - 11 = -dg. Let z = -3104 - -3106. Solve gf + z + 8 = 0, 5r - 29 = 2f for r. 5 Let w(s) = 62s - 121. Let l be w(2). Solve 4f + 5 = lp, 5p = -15f + 10f - 15 for p. -1 Suppose -2 = 9j - 56. Solve -4h + 19 = -s, 0 = -3s + js - 3 for h. 5 Suppose 0 = b - 2 - 1. Suppose 5x + 4k - 38 = bk, -5x - 5k + 30 = 0. Suppose t - x = -t. Solve 0 = tz - 2u - 7 - 5, 2z + 3u - 14 = 0 for z. 4 Let v(u) = -4u3 + u2 + 7u + 5. Let q be v(-2). Let y = q + -25. Solve 0 = -5g - yj + 23, 3g = 4g + 5j - 23 for g. 3 Let g be (70/(-455) - (-30)/26) + 4. Solve 0 = 4s - 3v - 11 + 33, -5s = -gv + 30 for s. -4 Suppose -2v - 3 + 5 = 2x, -3x = -2v - 23. Suppose 0 = -2o + 73 - 61. Suppose -16w + 17w = o. Solve 36 = t + 5m + w, 25 = xm for t. 5 Let x(z) = -z2 + 2z + 1. Let f be x(4). Let k = f + 12. Let j(i) = i*3 + 6i*2 - 9i - 9. Let q be j(-7). Solve d + 3n = -3 - 1, -qn - 40 = -kd for d. 5 Let g(f) = -f2 - 3f + 5. Let j be g(0). Let h be 2/(-7) - 300/(-21). Let u = -11 + h. Solve jz + 14 = 3r - 1, 4r = -uz + 20 for r. 5 Suppose 8b - 9 = 5b. Solve -3w - 5x = -w	{ "pile_set_name": "DM Mathematics" }
actor of b? False Let s be (-46)/(-14) - 2/7. Suppose 7u = su + 72. Does 3 divide u? True Suppose 4h = -5 + 1, -2b + 4h - 12 = 0. Does 3 divide 2((-18)/b + (-3)/(-4))? True Let m = 81 - 130. Let c = m + 82. Let b = c + -16. Is 17 a factor of b? True Suppose -3k - 10047 = -3t, -58k + 54k + 10040 = 3t. Does 62 divide t? True Suppose 33h + 11664 = 39h. Does 6 divide h? True Let h be 1 + (1 - 0)(-1 - -4). Let s = h - -4. Is 8 a factor of s? True Let r(p) = 4p2 - 6p + 4. Let s be r(2). Suppose -10o + 214 = -so. Is o a multiple of 26? False Is 2754 + ((-32)/160)/((-1)/5) a multiple of 24? False Suppose 0 = -6y + 8y - 2. Let k(o) = -o2 + o. Let s(b) = -b3 + 9b2 + 3b + 8. Let f(a) = ys(a) - 3k(a). Does 2 divide f(12)? True Let k be 82 - (0 + (0 - 1)). Suppose 4d - 3c = 288, -3d - 2c = -2d - k. Is 8 a factor of d? False Suppose -29 - 34 = -3l. Does 21 divide l? True Suppose 0 = -13m + 18701 - 4232. Is 53 a factor of m? True Suppose 2h = 10h - 808. Does 19 divide h? False Let o(g) = 2g*2 - 3g - 4. Let z be o(3). Let w = 20 - z. Is w a multiple of 5? True Let z = -469 - -829. Is 40 a factor of z? True Suppose 0 = n + 2, 2n = -5a + 1737 - 296. Is a a multiple of 2? False Let v(i) = -33i. Is 11 a factor of v(-13)? True Let k(r) be the first derivative of -r4/4 + 4r*3/3 - 3r*2/2 - 2r - 7. Let h be k(4). Does 3 divide (-38)/h - 10/(-35)? True Let x(d) = -23d + 3. Suppose 3j + n - 14 = 0, -3n + 0 = -6. Let q be x(j). Let c = 143 + q. Is c a multiple of 17? False Suppose q = -2q. Suppose 0a + 5a - 500 = q. Is ((-9)/2)/((-15)/a) a multiple of 8? False Suppose 0 = 5s - s + 5i - 7, 3i = -3. Suppose -sp = 2p. Let l(k) = -k3 + k2 + k + 14. Is 14 a factor of l(p)? True Suppose 7b + b - 24 = 0. Let m = 84 - 56. Suppose m = -bp + 70. Is 8 a factor of p? False Let y(t) = -t + 1. Let r be y(-8). Let q = 14 - r. Suppose -116 = -qc + c + u, 0 = c - 2u - 22. Is c a multiple of 22? False Let y(i) = -i3 + 26i*2 - 21i - 1. Let d be y(25). Suppose 12l = l + d. Is l a multiple of 9? True Let g = 7 - 5. Suppose 21 = 3f - gf. Is 21 a factor of f? True Suppose -4m + 0m - 2v - 312 = 0, 0 = -4m - v - 316. Is 8 a factor of (m/12)/(-2)(-96)/(-5)? True Suppose -6q = -5q - 5. Suppose 2o = -2n + 4n + 96, -4o - qn + 237 = 0. Let a = o + -38. Is 3 a factor of a? True Suppose -21 = -k - 7. Let i(l) = l2 - 9l - 21. Is 12 a factor of i(k)? False Suppose -5 = 4a - 25, -2p = 3a - 483. Is 18 a factor of p? True Suppose 2m - 85 = -2r - 41, r - 16 = 5m. Let y(z) = 2z - 4. Let c be y(3). Suppose -ct + 3 = -r. Is 6 a factor of t? True Let w = 47 - 13. Suppose -2o - 4 = -w. Is 29 a factor of 444/o(-5)/(-2)? False Suppose -4j = 5r - r - 44, -6 = -2r. Does 4 divide j? True Suppose -8612 = -5l + s, 9943 = 4l + 3s + 3061. Does 12 divide l? False Suppose -13l = -72l + 1475. Is l a multiple of 5? True Let d(b) = b - 3. Let g be d(3). Suppose -2s = -2c + 4 + 14, g = 2c + 3s + 2. Suppose cq = q + 156. Is q a multiple of 13? True Let h(j) = -j2. Let w(n) = 2n*2 + 7n - 11. Let a(d) = -3h(d) - w(d). Let x be a(9). Let l = x - 25. Is 4 a factor of l? True Let u = 8 + -5. Suppose 0 = -w + 4z - 115, -uw - 230 = 3z + 40. Let f = -64 - w. Does 13 divide f? False Suppose 4q - 20 + 0 = 0. Suppose -4s + 100 = qf + s, 36 = f + 5s. Does 4 divide f? True Let p(i) = -124i3 - 3i*2 + 9. Does 12 divide p(-2)? False Let m(d) = -64d*3 + 6d*2 - 3d + 6. Let r(w) = -32w3 + 3w*2 - w + 3. Let v(k) = -3m(k) + 5r(k). Is 23 a factor of v(2)? False Suppose -107 = 2f - 505. Is f a multiple of 76? False Suppose -24q = -12q - 17136. Is q a multiple of 68? True Suppose 0 = -y + 2v - 35, 0 = -y + 3v - 0v - 40. Let w = -19 - y. Is 14 a factor of ((-63)/2)/(w/(-16))? True Let l(h) = -h2 - 7h + 62. Is 8 a factor of l(-10)? True Suppose -4c = 4v - 20, 5v - 3c - 12 - 5 = 0. Suppose -i = 3w - 4i - 198, 300 = vw + 5i. Is 17 a factor of w? False Let c(k) = -6k + 1. Let y be c(-4). Suppose 5 - y = 2j. Let u = 67 + j. Does 33 divide u? False Suppose l - n + 8 = 0, -2l - 3n = -3l - 18. Is 12 a factor of (25/l)/(1/(-24))? False Suppose -d + 230 = -6d. Suppose -w = -3s - 29, 4w + s - 51 = -0s. Let n = w - d. Is n a multiple of 15? True Does 8 divide (-18)/(905/(-150) - -6)? False Let c(v) = -3v3 - 28v*2 - 11v - 18. Let i be c(-9). Suppose -7j + 1497 - 111 = i. Is j a multiple of 33? True Let o(a) = a3 - 3a*2 + 3a - 5. Let c be o(3). Suppose cr + 2t = 130, t + 33 = r + 2t. Is r a multiple of 8? True Suppose 4k = -s + 816, 5k + 2569 = 5s - 1636. Is s a multiple of 76? True Let p(v) = 5v2 - 55v - 39. Is 26 a factor of p(23)? False Is 42 a factor of (-96 - -12)68/(-8)? True Let x(i) = -i2 - 35i - 36. Let p be x(-23). Suppose 0 = -3o - 51 + p. Does 21 divide o? True Let n(j) = -2j - 1. Let y be n(-3). Suppose -yi - 50 = -0i. Is -48(-3 - i/4) a multiple of 8? True Let m(d) be the second derivative of 29d3/6 - d2/2 + d. Let x(y) = -19y + 1. Let l(f) = -5m(f) - 7x(f). Is 2 a factor of l(-1)? True Let h(b) be the third derivative of -5b4/8 + b3 - 6b2. Is h(-3) a multiple of 17? True Suppose 3i - 5a - 5 = 0, 10 = 2a + 3a. Let r(h) = -h3 + 5h*2 + 2. Let m be r(i). Is 4 a factor of (13/m)/(2/4)? False Let a(v) = -v + 18. Let j be a(16). Suppose -i + 12 = -jd, 38 = 2i + i - 4d. Is i a multiple of 14? True Let a be 6 - (-5)/((-5)/(-3)). Is 23/((a/(-2))/(-9)) a multiple of 6? False Let g(l) = 1. Let m(q) = -3q - 36. Let w(u) = 66g(u) + 2m(u). Suppose -i + 4k = 13, 22i - 3k + 16 = 20i. Is 8 a factor of w(i)? True Let x(q) = -5q*2 - 4q - 4. Let p(b) = 2b + 6. Let f be p(-4). Let d be x(f). Does 12 divide d/(-48)312? True Suppose -4q = -4o - 4, -2q + 6 = -0. Suppose 15 = 5d, 4d - 7d = oi - 117. Does 18 divide i? True Suppose 55 + 105 = 5u + 5m, u - 42 = 4m. Does 34 divide u? True Let g be (-2)/(-5) - 103/(-5). Let n be 0/2 - -1 - (21 + -302). Does 12 divide n/g + 6/(-14)? False Suppose -b = -5o - 5, 12 = -5o + 2b + 2. Suppose 5y + 27 = t, -t + oy - y = 3. Let r(l) = 21l - 2. Is r(t) a multiple of 10? True Suppose 290t + 866 = 292t. Does 18 divide t? False Let k = 542 + -461. Is k a multiple of 7? False Let z = 24 + -18. Does 13 divide 181 + z + -9? True Suppose 0 = 10k - 1012 - 1188. Is k a multiple of 10? True Let w = 12 - -12. Suppose 3x + 8 = 20. Suppose w = xp - 3p. Is p a multiple of 13? False Is 6 a factor of (((-11781)/(-28))/(-33))/((-6)/376)? False Does 53 divide (4 + 584)1? True Let j(m) = m + 30. Suppose 5g = 5p - 22 - 48, 0 = -2g + 4. Is 9 a factor of j(p)? False Suppose -x + 3w = -967, -5x + 3w - 7w = -4892. Is x a multiple of 16? True Let h(t) = -2t*3 + 5t*2 + 45t + 5. Is 15 a factor of h(-6)? False Let w(n) be the first derivative of -n*2 + 49n + 6. Let t(k) = -k*3 - 5k2 + k + 5. Let h be t(-5). Is 13 a factor of w(h)? False Let q(h) = -h3. Let z(c) = -3c3 - 7c*2 - 9c - 9. Let a(j) = 2q(j) - z(j). Let i be a(-5). Suppose 0 = 18w - iw - 28. Does 5 divide w? False Suppose 0 = -3o + 5174 - 1019. Does 18 divide o? False Suppose -d - 4 = 4y + 3d, -5d - 8 = 4y. Suppose -6c - yc = -1764. Does 14 divide c? True Is ((-2)/7)/(96/(-168))7744 a multiple of 34? False Let v(f) = -f2 + 29f - 42. Let g be (-2)/3(-92)/(-8)-3. Is 12 a factor of v(g)? True Let w = -8 - -11. Suppose wc - 6 = 102. Is (-277)/(-9) + 8/c a multiple of 19? False Is ((-660)/16)/((-10)/40) a multiple of 11? True Let m(q) = q3 + q2 - 4q - 3. Let a be m(-2). Let i(o) = o - o + 0o + 60o*2. Is i(a) a multiple of 11? False Suppose 125m = 129m - 3840. Is 48 a factor of m? True Let a(x) = -2 + x3 - 2x*2 - 2 + 0 + 13x*2 - 15x. Does 8 divide a(-12)? True Let f(l) = 5l2 - l + 2. Let g be f(2). Let k be (g/5)/(2/3). Does 12 divide 51 - k(-4)/(-8)? True Let w = 238 + -182. Is 8 a factor of w? True Suppose 0 = 3s - 4x - 725, -5s + 2x = -4s - 243. Is s a multiple of 16? False Let p(d) = -d2 + 6d + 5. Suppose 4c - n + 1 = 20, c + 4n - 26 = 0. Let z be p(c). Suppose zg - 75 = 5m, -3g - 5m - 21 + 74 = 0. Does 8 divide g? True Let w = -1144 - -2096. Does 68 divide w? Tr	{ "pile_set_name": "DM Mathematics" }
0a2. -5a*3 Collect the terms in -5167m*2 - 5232m*2 + 10354m*2. -45m*2 Collect the terms in -51f - 26f + 32f - 63f - 2. -108f - 2 Collect the terms in 16476p3 + 5p*2 - 5p*2. 16476p*3 Collect the terms in -22 + 15o*2 + 0o + 65 - 46 + 0o. 15o*2 - 3 Collect the terms in -8m*2 + 11m + 9m3 + 14m*2 - 11m - 7m2. 9m3 - m2 Collect the terms in -x + 15x2 + 2083x*3 + 3x*2 - 18x*2. 2083x*3 - x Collect the terms in -53k*3 - 398 - 397 + 51k*3 + 795. -2k*3 Collect the terms in 15443f + 16285f - 48902f + 16298f. -876f Collect the terms in -33 - 29 - 25 + 20v2 + 84. 20v*2 - 3 Collect the terms in -94v + 3 + 5v - 3. -89v Collect the terms in -376s3 + 202s*3 + 1134s*3 + 101s*3. 1061s*3 Collect the terms in 27 - 1536z + 760z + 763z. -13z + 27 Collect the terms in 1218h*3 - 2444h*3 + 1225h*3 + 820h2. -h3 + 820h2 Collect the terms in -27826f*2 + 55630f*2 - 27837f*2. -33f*2 Collect the terms in -1 + 1 + 76392v. 76392v Collect the terms in 16m*3 + 9 - 23m3 - 5 + m3 - 4. -6m3 Collect the terms in m2 + 94m*2 - 93m*2. 2m2 Collect the terms in t2 - 3t - 12t*2 - 17t*2 + 22 - 2. -28t*2 - 3t + 20 Collect the terms in 41i + 19i*3 - 62i + 21i. 19i*3 Collect the terms in 6s*2 + 6080s + 9s2 - 20s*2 - 6080s. -5s2 Collect the terms in 4b*2 - 19 - 2b + 46 + 24 - b*2. 3b*2 - 2b + 51 Collect the terms in -1683g2 + 3358g*2 - 1675g2 + g3. g*3 Collect the terms in -27 + 28 - 51l*3 + 2 - 3 + 4l. -51l3 + 4l Collect the terms in 4 - 15263b2 + 15263b*2 + 6b*3. 6b*3 + 4 Collect the terms in 200t*3 + 9t*3 + 25t*3. 234t*3 Collect the terms in 398z + 2z2 + 2z*2 - 398z + 2z2. 6z*2 Collect the terms in -33 - 37 - 28 + 98 + 17h. 17h Collect the terms in -494492 + 494492 - 15b. -15b Collect the terms in -681f*2 + 3069f*2 - 793f*2 - 795f*2 - 798f*2. 2f*2 Collect the terms in -920 + 459 + 857i + 460. 857i - 1 Collect the terms in -2609c*3 - 239c*3 + 2840c*3. -8c*3 Collect the terms in -87q + 0q2 + 0q*2 - 714q*3 + 87q + 709q3. -5q*3 Collect the terms in 41 - 5p + 14 - 10. -5p + 45 Collect the terms in 11p*2 + 3p3 - p2 - 10p3 + 0p*2 - 2p*2. -7p*3 + 8p*2 Collect the terms in -88y - 63y + 45y - 42y. -148y Collect the terms in -t*3 + 46 - 46 + 10t3 + t3 + 0t3. 10t*3 Collect the terms in -11u + 45336497 - 45336497. -11u Collect the terms in 20k*2 + 17k*2 + 13k*2 + 13k*2 - 2k*3 - 63k*2. -2k*3 Collect the terms in 3m*2 - 2174 + 1078 + 1082. 3m*2 - 14 Collect the terms in 68 + 64 - 72h*3 - 132 + 174h*3. 102h*3 Collect the terms in 3484d*2 - 1743d*2 - d + d - 1729d*2. 12d*2 Collect the terms in 297p*2 + 16626p*3 - 149p*2 - 148p*2. 16626p*3 Collect the terms in -445h*3 + 775h*3 - 2h*2 + 6h*2 - 6h*2. 330h*3 - 2h*2 Collect the terms in 734y*3 - 626y*3 - 111y*3. -3y*3 Collect the terms in -9150t*3 - 37t + 37t + 1356t*3. -7794t*3 Collect the terms in -20d*2 + 10d*2 - 5d - 38d2 - 41d*2. -89d*2 - 5d Collect the terms in -1 - 2 - 759l2 + 1. -759l*2 - 2 Collect the terms in 2s*2 - 8s2 - s2 - 1882s3 + 1880s*3. -2s*3 - 7s*2 Collect the terms in -68152h*3 - 68131h*3 + 136256h*3. -27h*3 Collect the terms in 359u*2 + 2u*3 + 6u*3 - 175u*2 - 184u*2. 8u*3 Collect the terms in 2869 + 28l*3 - 2869. 28l*3 Collect the terms in -6 - 37m*3 + 8 - 2 + 56m - 58m. -37m*3 - 2m Collect the terms in -16031 + 32026 + 8s - 15994. 8s + 1 Collect the terms in -735w3 - 738w*3 + 1479w*3. 6w*3 Collect the terms in 51 - 28 + 12m*2 - 2m*2. 10m*2 + 23 Collect the terms in 922a*2 + 2a + 923a2 - 1850a*2. -5a*2 + 2a Collect the terms in 0j3 + 4879j - 4j3 + 4j*2 - 4879j - 5j2. -4j3 - j2 Collect the terms in -15108k + 15108k + 338k3. 338k*3 Collect the terms in 1102f*3 - 48f - 2195f3 + 8f + 1097f3. 4f*3 - 40f Collect the terms in -497 - 90f3 + 179f*3 + 497 - 85f*3. 4f*3 Collect the terms in 35m*3 - 9m*3 + 91m*2 - 4m3 - m3. 21m3 + 91m*2 Collect the terms in -613j*2 + 1231j*2 - 2j*3 - 576j*2. -2j*3 + 42j*2 Collect the terms in 8b - 591943659 + 591943659. 8b Collect the terms in -2b*2 + 333b - 661b + 70b*3 + 328b + 4b3. 74b*3 - 2b*2 Collect the terms in 23x*2 + 28x*2 - 70x*2. -19x*2 Collect the terms in 1 + 19p*3 + 7 - 5p*3 - 8 - 12p*3. 2p*3 Collect the terms in 1076m*2 + 23m + 33m - 18m + 9m. 1076m*2 + 47m Collect the terms in 90l2 + 87l*2 + 17l*2. 194l*2 Collect the terms in 196739r*3 - 98249r*3 - 98494r*3. -4r*3 Collect the terms in 58y*2 + 4386 - 4386 - 11y*2. 47y*2 Collect the terms in 177492 - 177492 - 136y*2. -136y*2 Collect the terms in -18 + 21 + 30 - 10q + 0q. -10q + 33 Collect the terms in -253d2 + 188d*2 + 80d*2. 15d*2 Collect the terms in 5d + 12d - 19d*3 - 17d + 54d3. 35d*3 Collect the terms in 32t - 39 + 17 + 17. 32t - 5 Collect the terms in -104u*2 - 79u*2 + 187u*2 - 7. 4u2 - 7 Collect the terms in -j3 + 15027j2 - 15027j*2 + 0j3. -j3 Collect the terms in 1031945 + 1031949 - s3 - 2063894. -s3 Collect the terms in 714c - 2649 + 2649. 714c Collect the terms in -324 + 324 + 21v2. 21v*2 Collect the terms in -9608 + 9608 + 844p*2. 844p*2 Collect the terms in 15758 - 15758 - 26i. -26i Collect the terms in 115q*3 + 537q*3 + 90q*3 + 650q*3. 1392q*3 Collect the terms in -14w + 17w2 - 159w*2 - 19w + 33w. -142w*2 Collect the terms in -4 + 10 - 13y + 1 - 4 + 0y. -13y + 3 Collect the terms in -2q3 + 8q*3 + 19831206q - 19831206q. 6q*3 Collect the terms in 21 + 22 + 56c - 39c - 16c. c + 43 Collect the terms in 0t2 - 64t + 17 + 6t2 - 50 + 64t. 6t2 - 33 Collect the terms in -16g*3 + 3g*3 - 3g*3. -16g*3 Collect the terms in -95 + 1394w*2 + 95. 1394w*2 Collect the terms in 7m*2 + 43m*2 - 12m*2 - 23m*2 - 16m2. -m2 Collect the terms in 155o + 1741o*2 - 10 - 155o + 10. 1741o2 Collect the terms in v3 + 23v + v*3 - 8v - 15v. 2v*3 Collect the terms in -98l + 652l3 + 98l. 652l3 Collect the terms in -18 - 5u - 16 - 15u + 34. -20u Collect the terms in -6s + 4330564257 - 4330564257. -6s Collect the terms in 55g2 - 4g + 0g + 6g + 2g - 3g. 55g2 + g Collect the terms in 10187p - 5142p - 5046p. -p Collect the terms in 13 - 9 + 339c + 28c - 3. 367c + 1 Collect the terms in -1 - 55n - 2 + 6 + 2 + 144n. 89n + 5 Collect the terms in 4w - 1302955 + 1302955 - 9w*2. -9w*2 + 4w Collect the terms in -617b - 187 + 187. -617b Collect the terms in -2a2 - 23a*2 - 51 + 7a*2 + 50 - 11a*2. -29a*2 - 1 Collect the terms in 8f*2 + 3f*2 - 11f*2 + 11 - 42f*3 - 4. -42f*3 + 7 Collect the terms in -11n*3 + 24n*3 - 12n2 + n3 + 12n2 - 17n*3. -3n*3 Collect the terms in -772v + 1285v + 1300v. 1813v Collect the terms in 2z*2 - 831z + 1458z - 627z. 2z2 Collect the terms in -93l - 90l - 91l - 99l + 456l - 82l. l Collect the terms in -15 - 122f*3 + 32f*3 - 192f*3. -282f*3 - 15 Collect the terms in -2k + 5 + 57k2 - 24k*2 - 21k*2 + 19. 12k*2 - 2k + 24 Collect the terms in -48z3 + 124z*3 - 11z*3 - 8z*3 - 27z*3. 30z*3 Collect the terms in 1330m - 2709m + 1371m. -8m Collect the terms in 30 - 117 - 67 + v2 + 20 + 3v. v*2 + 3v - 134 Collect the terms in 5x2 + 6x - 223 - 3x - 3x. 5x2 - 223 Collect the terms in -16i + 158i - 148i. -6i Collect the terms in -785q*2 + 213q*2 + 267q*2. -305q*2 Collect the terms in 20a*2 - 50a - 8a2 - 19a*2 - 4 - 5a*2. -12a*2 - 50a - 4 Collect the terms in 5905 - 5905 + 30s. 30s Collect the terms in 15a2 + 12a*2 - 21a*2 + 8a*2. 14a*2 Collect the terms in 0i*2 + 5735i3 - i2 + 2i2 + 3i*2. 5735i*3 + 4i*2 Collect the terms in -9b - 50b + 59b + 16b3. 16b*3 Collect the terms in 10 - 6 - 7x + 5 - 9. -7x Collect the terms in -2w*2 + 2w**2 -	{ "pile_set_name": "DM Mathematics" }
h(w) = -w*3 + 6w*2 + 4w + 2. Give h(r). 26 Let q = -4 + 9. Let s(n) = -3 + q - 6 + 5n + 2n*2 + 5. Calculate s(-4). 13 Let q(m) = m + 11. Let v be -12(3/(-2))/((-9)/(-3)). Suppose 0 = 2p - 3s + 16, p + s + v + 2 = 0. Determine q(p). 3 Let l be (-2)/(-6) + 40/6. Let t(p) be the third derivative of 0 + 1/4p4 + 4/3p*3 - 6p*2 + 0p - 1/60p5. Determine t(l). 1 Let c(p) = -p2 - 19p - 38. Suppose 15w + 105 = -150. Give c(w). -4 Suppose 0 = 5f + 25, -2o + 5 + 15 = -4f. Let h(s) = s*2 + 4 + 0 + os*2. Calculate h(0). 4 Let k be 5/(-1 - (2 + -2)). Let d = -1 + k. Let w(a) = 4a*2 - 3a*2 + 2 + 8a - 2a. What is w(d)? 2 Let c = 38 - 33. Let g(v) = -v2 + 8v - 6. Let q(o) = o*2 - 9o + 7. Let u(p) = cq(p) + 6g(p). Determine u(4). -5 Suppose -3j - 3v + 17 - 44 = 0, -3j - 22 = -2v. Let t(y) = -y*2 - 10y - 11. Determine t(j). 5 Suppose 2w - 3o = 2, 2o = -2w - 1 - 7. Let u(j) = -j*3 - 2j*2 + 2. What is u(w)? 2 Let y = -100 - -100. Let f(d) be the first derivative of -8d - 1/3d3 - 2 + 1/2d*2. What is f(y)? -8 Let w = 3 + -9. Suppose 4y = -4m + 3 - 11, 4m + 5y = -13. Let u(z) = -6 + z2 - 8z*2 - 6z + 0z - zm. Determine u(w). -6 Let m(j) = 4j*2 - 2j + 9. Let q(b) = 3b - 4. Let x be q(3). Suppose -3n - 4 = -1. Let t(i) = i*2 - i + 1. Let k(o) = nm(o) + xt(o). What is k(3)? -4 Let m(i) be the second derivative of 1/12i*4 + 0 - 1/20i*5 - 3/2i*2 + 1/3i*3 - 10i. What is m(3)? -15 Let y(n) = -n*2 + n - 2. Suppose -3a - r = -70, 4r + 80 = -a + 4a. Let f be (-4)/a + 58/(-12). Let k = -5 - f. What is y(k)? -2 Let y(t) = -3t2 + t2 + 2 + 6t*2. Let u = 396 - 398. What is y(u)? 18 Let l = 143/2 + -70. Let g(h) be the first derivative of -6 - lh*2 - 2h. Determine g(-4). 10 Let w = -4039 + 4043. Let z(i) = -i*3 - 3i*2 + 6i2 - 1 - i + 2. Determine z(w). -19 Let f(b) be the third derivative of -b7/2520 - b6/180 + b5/20 - b*4/8 - 18b*2. Let w(t) be the second derivative of f(t). Calculate w(-5). 1 Suppose 18j = 73 - 19. Let q(w) be the first derivative of -5/2w2 + jw + 1 - 1/3w3. What is q(-6)? -3 Let c(p) = -p - 2. Let b(r) = 2r*3 + 20r*2 + 22r + 29. Let d be b(-9). Give c(d). 5 Let n(t) be the first derivative of -t*2 - 3t - 247. Calculate n(9). -21 Let j be 15/(-2)(84/10 + -8). Let d(k) = -3k*2 - 2k - 2. Give d(j). -23 Let l(u) = -7u - 2 + 2u*2 + 3u2 - 2 + u3. Let z(r) = -2r - 18 + 63 - 13. Let f be z(19). Calculate l(f). 2 Let r(m) = -m2 + 7m + 6. Let t be r(-2). Let y(q) = q + 10. What is y(t)? -2 Let d(i) be the second derivative of -5i3/6 - i2 + 2i. Let a = -99 + 97. Calculate d(a). 8 Let h(f) = -6f + 42. Let r be h(6). Let o(v) be the first derivative of -v4/24 + 2v3/3 + v2 + 1. Let d(j) be the second derivative of o(j). Give d(r). -2 Let h(z) = z*2 + 3z - 6. Suppose -4f = k - 10, 3k = -k + 2f - 32. Give h(k). 12 Let p(t) = 5t*3 + 53t*2 + 51t - 61. Let c(n) = -2n3 - 18n*2 - 17n + 20. Let d(r) = -8c(r) - 3p(r). What is d(16)? 7 Let b = 35 + -36. Let v(t) = 2t - 3. Let o(p) = 1. Let d(h) = bv(h) - 2o(h). What is d(1)? -1 Let c(p) = -p3 + 12p*2 - p + 17. Suppose -3y = 3v - 51, 2y + 39 = 2v + 5y. Determine c(v). 5 Suppose -5j = 160 - 185. Let r(p) = -p3 + 4p*2 + p + 1. Calculate r(j). -19 Let u(r) be the third derivative of 0 + 0r*3 - 14r*2 + 0r - 5/12r4. Let k(n) = n2 - 2n + 1. Let d be k(2). Determine u(d). -10 Let t(n) = -3. Let i(p) = 10. Let q(x) = 3i(x) + 12t(x). Let h(j) = j*2 - j + 5. Let a(o) = -3h(o) - 2q(o). Determine a(2). -9 Let y(c) = -c + 10. Let j = -788 + 798. Give y(j). 0 Let c(i) = -6 + 3 + 7 + i + 1 - 3. Calculate c(-2). 0 Let c(h) = h2 - 7h - 1. Let t be c(8). Let j(x) = x*3 - 8x*2 + 7x + 5. Let p be j(t). Let a(q) = q*2 - 5q - 7. What is a(p)? -7 Let o = -1634 - -1633. Let h be (-156)/(-27) - (-2)/9. Let g(v) = 0v + 5v - 7v - hv - 1. Determine g(o). 7 Let o(p) = -p*2 + 3p - 10. Let l(a) = -a*2 + 31a - 221. Let q be l(19). What is o(q)? -38 Let j(z) = -z*2 - 6z + 3. Let i(t) = -t*3 + 10t*2 + 2. Let o be i(10). Calculate j(o). -13 Let s(l) = -2l + 2. Let f = 131 + -187. Let n be (-6)/15 - f/(-35). Give s(n). 6 Let h(v) = -v*3 - 5v*2 + 10v + 9. Let c be ((-2)/6)/(11 - (-2300)/(-210)). Calculate h(c). 37 Let l(p) = p + 11. Let r = 10 + -15. Let h be l(r). Let c(w) = -w*3 - h - 1 + 2w + 0 + 1 + 6w2. Determine c(6). 6 Let o(v) = 3v*2 + 7v - 9. Let t = -30 + 31. Let l(w) = -w*2 + 1. Let b(m) = to(m) + 4l(m). Give b(7). -5 Let v(l) be the third derivative of 0l - 5/6l3 - 9l*2 + 0 - 1/60l*5 + 1/4l*4. Let n = 2 + 4. Give v(n). -5 Suppose 0 = 3z + 62 + 142. Let x = -79 - z. Let t(l) = -l - 6. Determine t(x). 5 Let g(m) = -6m + 1. Let x be 20(1 - (-14)/(-8)). Let h be (-2)/(-7) - x/21. What is g(h)? -5 Let f(w) = -w*2 - 27. Let v be 0/((-2)/((20/3)/(-10))). Calculate f(v). -27 Suppose -5j - t + 18 = 0, 0 = -5j + 7t - 6t + 22. Let l(b) be the second derivative of -8b + 0 + b*3 + 1/12b*j + 0b*2. Give l(-6). 0 Let i be (-3)/9 + 13/3. Suppose 3z + 5t = 2, -iz - 2 = -3z + 3t. Suppose -31 = zg - 15. Let c(x) = x2 + 3x - 3. Calculate c(g). 1 Suppose 4b = -8 - 8. Let s(d) = -6d + 7. Let h(j) = 1. Let k(c) = -5h(c) + s(c). What is k(b)? 26 Suppose v - 2f + f + 13 = 0, 49 = -5v - 3f. Let l(a) = -a*2 - 12a - 13. Let c be l(v). Let k(j) = 7j + 2. Calculate k(c). -12 Let q(o) = o3 + 2. Let w be q(0). Let m(d) = -14 - 13d + 28d - w - d2 - 14d. What is m(0)? -16 Let q be 24/(-16)(-4)/(-6). Let f(n) = 4n*3 - 4n2. Let s(m) = -m3 + m*2. Let a(j) = 2f(j) + 7s(j). Give a(q). -2 Let u(n) = n3 - 4n*2 - 4n - 5. Let g be u(5). Let z(y) = -y - 4 + 0y + gy. Suppose 8o - 3o - x - 3 = 0, 3o + 6 = -2x. Determine z(o). -4 Let x(v) = -10. Let s(r) = -3r2 + 47r - 19. Let a(y) = s(y) - 4x(y). Determine a(16). 5 Let q be -2 - (-4 - (-6)/2). Let v be (-12)/(-8) + q/(-2). Let o(s) = 5 - 3s*v + 2s*2 - 9 - 2s. Calculate o(-3). -7 Suppose 2a - 3f - f = 26, -2a - 1 = 5f. Let d be (-26)/(-8) - (-7)/(-28). Let k(p) = 0p3 + 4 - pd + 2p - 6p2 - 11p + 2p3. Determine k(a). -10 Suppose 3 = -19s + 20s. Let j(u) be the first derivative of 2u3/3 + u2 - 4u - 1. Give j(s). 20 Let o(w) = -3w - 1 - 6 + 1 - 5. Determine o(9). -38 Let n(r) = -125r + 252r - 126r + 3. What is n(-2)? 1 Suppose -5o = -4f - 46, 3o - 45 = -2o + 5f. Let d = -6 + o. Let i(l) = -1 + 3 - 2 - 4 + l. Calculate i(d). 0 Let f(p) be the third derivative of -6p2 - 1/24p*4 + 0 + 0p*3 + 0p + 7/60p5. What is f(1)? 6 Suppose -1 = 3t - 13. Let a = t - 2. Let r(h) = 3h + 2h + ah - 4h - 8. What is r(6)? 10 Let a(d) = -2d2 + 3d - 5. Let s be a(2). Let i(x) = 3 + 9x + 0 - x2 + 0x*2 + 2x2. Determine i(s). -11 Let p(q) = -q3 + 4q2 + 2q + 2. Let j be (-3)/(-4)(11 - 78/18). Give p(j). -13 Let v be 54/10 - 2/5. Let q(m) = 4m - 5 - 268899m2 + 268898m*2 + 2m. Calculate q(v). 0 Let p(f) = f*2 + 15f + 3. Let k(l) be the third derivative of -l*5/20 - 11l*4/6 - 5l*3/3 - 11l*2. Let h(n) = -6k(n) - 17p(n). Calculate h(-7). -5 Suppose 7t - 3y - 22 = 11t, -2y = -4t - 12. Let h(m) = -m*2 + m + 1. Calculate h(t). -19 Let u = 2 - 0. Suppose -4j = 4r - 8, ur - 5r = 4j - 10. Suppose 0 = jp + 5o - 34, 5p - 5o - 2 - 18 = 0. Let b(n) = -n*2 + 8n - 9. Calculate b(p). 3 Suppose 7j - 12j + 20 = 0. Suppose -ji = -11i + 35. Let s(q) = q + 1. Let g(n) = n*2 + 2n - 4. Let h(f) = g(f) - 3s(f). Give h(i). 13 Suppose -u - 85 = 4u. Let h = 17 + u. Suppose -3y + 20 - 8 = h. Let o(c) = -c + 5. Give o(y). 1 Let r(w) = -w3 + 2w*2 + 4w. Let d(k) = k*2 - 7k + 9. Let f be d(9). Suppose f = 28z - 19z. Calculate r(z). 3 Let i(q) = -34q - 212. Let z be i(-6). Let y(b) = -b3 - 9b*2 - 9b - 8. What is y(z)? 0 Suppose -11s + 58 + 349 = 0. Suppose -n + 5d + s = -3n, -3n - d - 23 = 0. Let y(p) = -p*3 - 7p*2 - 4p + 7. Give y(n). -5 Let o(c) = -c - 13. Suppose 0 = 4k + 21 + 3. Let p(y) = 1. Let u(j) = kp(j) - o(j). Let b(m) = -m*3 + 9m*2 - 8m - 5. Let d be b(8). Give u(d). 2 Let c(s) = -s*2 + 16s - 18. Suppose 2h = 4n - 58, n + 8h - 4h = 19.	{ "pile_set_name": "DM Mathematics" }
-0.5, 1 Sort -1/157, -1, 3, 0 in ascending order. -1, -1/157, 0, 3 Sort -0.07, -1/2, 2/11, -11 in descending order. 2/11, -0.07, -1/2, -11 Put 2, 3, -12, -0.1, -0.04 in ascending order. -12, -0.1, -0.04, 2, 3 Sort 2, -1, 4, 283, -5 in ascending order. -5, -1, 2, 4, 283 Sort 16, 2, 4, -3 in ascending order. -3, 2, 4, 16 Sort -1, -6, 34, 3 in decreasing order. 34, 3, -1, -6 Put -0.1, 0, 2.9, -2 in decreasing order. 2.9, 0, -0.1, -2 Sort 1.3, -1/8, -1/4, -1. -1, -1/4, -1/8, 1.3 Put 4, -1, -5, -2 in decreasing order. 4, -1, -2, -5 Put -1, 4, -2/11, -605/8 in ascending order. -605/8, -1, -2/11, 4 Put -3, -22, 26, -2, -1 in ascending order. -22, -3, -2, -1, 26 Sort -1/3, -2, 71, -3/4 in descending order. 71, -1/3, -3/4, -2 Sort 93, -2/5, 4, -1 in descending order. 93, 4, -2/5, -1 Sort 2, 11, 1, 3 in decreasing order. 11, 3, 2, 1 Put 8, 52, 2 in descending order. 52, 8, 2 Sort 9/4, 0.131, 3. 0.131, 9/4, 3 Put 5, -5/4, -1/4, 0.019, -3/4 in increasing order. -5/4, -3/4, -1/4, 0.019, 5 Sort 0.03, -56, 0. -56, 0, 0.03 Put 4, -154, -5 in decreasing order. 4, -5, -154 Sort 5, -0.01, -0.26, 4 in descending order. 5, 4, -0.01, -0.26 Sort -22, -2, -5, 1. -22, -5, -2, 1 Sort -2, 5, 1, -5 in descending order. 5, 1, -2, -5 Sort -1, 4, 22, -2, 0 in descending order. 22, 4, 0, -1, -2 Put 89, 1, 3 in ascending order. 1, 3, 89 Sort 2/5, 2, 92, 1, -5 in decreasing order. 92, 2, 1, 2/5, -5 Put -4, -8/97, 3 in decreasing order. 3, -8/97, -4 Sort -4, 16, -1, 5 in increasing order. -4, -1, 5, 16 Sort 5, -1.8, -0.2 in descending order. 5, -0.2, -1.8 Sort -14, 5, 1 in decreasing order. 5, 1, -14 Sort -4, -2, 3, -430 in descending order. 3, -2, -4, -430 Sort 0.02, -1/4, -27, 1/3 in descending order. 1/3, 0.02, -1/4, -27 Put -0.5, 14/379, -2/19 in increasing order. -0.5, -2/19, 14/379 Put -6, 1, 0, 38 in increasing order. -6, 0, 1, 38 Sort 5, 3, -114. -114, 3, 5 Put -3/5, -48, -2/3, 8 in increasing order. -48, -2/3, -3/5, 8 Sort -0.2, -191, 2, 2/9, 0.3. -191, -0.2, 2/9, 0.3, 2 Put -70, 18, -2 in descending order. 18, -2, -70 Sort -7, -5, 1 in ascending order. -7, -5, 1 Sort -3, 1, 21. -3, 1, 21 Sort -3, 4, -67 in descending order. 4, -3, -67 Put 595, 1, -2 in increasing order. -2, 1, 595 Sort -20, -3, -1, -0.1 in descending order. -0.1, -1, -3, -20 Put 5, -3, -71, -5 in decreasing order. 5, -3, -5, -71 Sort -2/21, 0.03, 1, 1/2. -2/21, 0.03, 1/2, 1 Put -5, 1, 591 in ascending order. -5, 1, 591 Put 1, 1/3, 7, 20, -2 in descending order. 20, 7, 1, 1/3, -2 Sort -1/7, -185, 2. -185, -1/7, 2 Put 12, 5, -19, 3/5 in increasing order. -19, 3/5, 5, 12 Sort -2/5, -1/3, 20.6 in descending order. 20.6, -1/3, -2/5 Sort 0.6, -8/5, -1, 2 in ascending order. -8/5, -1, 0.6, 2 Put -5, -150, -4, 4 in decreasing order. 4, -4, -5, -150 Put 1/5, 0.4, 1/7, 67, 3 in descending order. 67, 3, 0.4, 1/5, 1/7 Put -11, 2, 0 in decreasing order. 2, 0, -11 Put -2, -1, -28 in decreasing order. -1, -2, -28 Put 10, -1, 1, -9 in descending order. 10, 1, -1, -9 Sort -5, -5003, -4. -5003, -5, -4 Sort -1, -0.05, -0.5 in decreasing order. -0.05, -0.5, -1 Put 0, 2, -520 in ascending order. -520, 0, 2 Sort -5, 0.4, -0.03. -5, -0.03, 0.4 Sort 0.5, 42, -0.4, 2/3, 6/31 in ascending order. -0.4, 6/31, 0.5, 2/3, 42 Put -238, -3, -5, 2/3, -4 in increasing order. -238, -5, -4, -3, 2/3 Put -3.93, 1/3, 4 in decreasing order. 4, 1/3, -3.93 Sort -1, 6, 5, 10. -1, 5, 6, 10 Put 47, -4, 6 in increasing order. -4, 6, 47 Sort 190/13, -2, -3 in increasing order. -3, -2, 190/13 Sort 0.04, 0.2, -1/2, 0.3 in increasing order. -1/2, 0.04, 0.2, 0.3 Sort 2.4, 4, 6 in decreasing order. 6, 4, 2.4 Put 2, -3, -1/2, -4/3 in ascending order. -3, -4/3, -1/2, 2 Put 0, -2, 163 in descending order. 163, 0, -2 Put -3, -2, 2, -4 in descending order. 2, -2, -3, -4 Put -5, -1, 22 in descending order. 22, -1, -5 Sort 19, 5, -9, 4. -9, 4, 5, 19 Sort 3, -2/15, 0.1, 0.3, 13/5 in decreasing order. 3, 13/5, 0.3, 0.1, -2/15 Put 1, -0.42, -5, 4 in increasing order. -5, -0.42, 1, 4 Put 3, 1, -7, 765 in descending order. 765, 3, 1, -7 Sort 11, -3, 0, -2 in descending order. 11, 0, -2, -3 Sort 40, -3, -12. -12, -3, 40 Put -5, -4/9, -65, -2/3 in ascending order. -65, -5, -2/3, -4/9 Put 1, 2, 5, 10, -51 in descending order. 10, 5, 2, 1, -51 Sort -8, 3, -2/7. -8, -2/7, 3 Put -1, -0.1, 2/13, 3 in increasing order. -1, -0.1, 2/13, 3 Put 1/5, -9, 4, -3 in increasing order. -9, -3, 1/5, 4 Sort 13, 52, 1. 1, 13, 52 Put 2/175, 0.3, 0.5, 0.039 in decreasing order. 0.5, 0.3, 0.039, 2/175 Sort -4/35, 1/2, 2/3 in decreasing order. 2/3, 1/2, -4/35 Sort 0.5, 207, -2/5 in descending order. 207, 0.5, -2/5 Put 8, 0, -164, -2 in ascending order. -164, -2, 0, 8 Sort 2, -4, 3, 0, -516. -516, -4, 0, 2, 3 Put 4, 2, -12, -5 in increasing order. -12, -5, 2, 4 Sort -0.1, 2/5, -6/11, 3 in increasing order. -6/11, -0.1, 2/5, 3 Sort 2, -0.04, -7, -4. -7, -4, -0.04, 2 Sort -1, -16, 0, -4 in descending order. 0, -1, -4, -16 Put 4, 0.5, -4, 5 in ascending order. -4, 0.5, 4, 5 Put -4, -106, 1, -1, 8 in decreasing order. 8, 1, -1, -4, -106 Sort 69, 2, -5, 0. -5, 0, 2, 69 Sort 0.03, 1, 0.11 in ascending order. 0.03, 0.11, 1 Put 1/5, 4, -0.5, 1/52, -19 in decreasing order. 4, 1/5, 1/52, -0.5, -19 Sort -0.3, -0.5, 3, 240, -5. -5, -0.5, -0.3, 3, 240 Put 0, 2, -5, -4, 4 in decreasing order. 4, 2, 0, -4, -5 Put -3, -6, -6/7 in ascending order. -6, -3, -6/7 Put 2, -5, -9, 4 in ascending order. -9, -5, 2, 4 Put -5, -2, -1, -3 in decreasing order. -1, -2, -3, -5 Put -4, -0.5, 0.7, 6 in increasing order. -4, -0.5, 0.7, 6 Sort 0, 5/4, 707, -0.2 in descending order. 707, 5/4, 0, -0.2 Sort 34.4, 3, -1/3 in decreasing order. 34.4, 3, -1/3 Sort 0.03, 2, -7, 4/5 in descending order. 2, 4/5, 0.03, -7 Sort 1, 234, -5 in descending order. 234, 1, -5 Put 5, -2, -4, 55, -6 in decreasing order. 55, 5, -2, -4, -6 Sort -4, -3113, -5. -3113, -5, -4 Put -2, -4/3, -20, 2 in ascending order. -20, -2, -4/3, 2 Put -50, -1, 2, -2, -3 in increasing order. -50, -3, -2, -1, 2 Sort 2, -2, -368 in ascending order. -368, -2, 2 Put 1/27, 0.5, 2 in ascending order. 1/27, 0.5, 2 Sort 2, -10, -15, -1 in ascending order. -15, -10, -1, 2 Sort 1/6, 4/7, 1, -7 in decreasing order. 1, 4/7, 1/6, -7 Put -1, 3, 0, 10 in descending order. 10, 3, 0, -1 Sort -7, -2, -4, 3. -7, -4, -2, 3 Put 125, -2, 7 in ascending order. -2, 7, 125 Put 0, -49, 10 in increasing order. -49, 0, 10 Sort -4, -7, 5, 2. -7, -4, 2, 5 Sort 1/2, -1/6, 2. -1/6, 1/2, 2 Put -3/7, -0.51, 4, 0.2, -0.04 in descending order. 4, 0.2, -0.04, -3/7, -0.51 Put 118, 1/9, -1/3 in descending order. 118, 1/9, -1/3 Put -2/15, -1, 1, 4 in descending order. 4, 1, -2/15, -1 Put 2, -4, 25, -16 in ascending order. -16, -4, 2, 25 Sort 23, -4, 32 in descending order. 32, 23, -4 Sort 8, 6, 3. 3, 6, 8 Sort 28, 2, -0.5. -0.5, 2, 28 Put 2, -5, 2/3, -26 in decreasing order. 2, 2/3, -5, -26 Sort 28/5, -0.5, 30 in descending order. 30, 28/5, -0.5 Sort 789, 3, 5/3 in decreasing order. 789, 3, 5/3 Sort 5, 8/13, 0, -5. -5, 0, 8/13, 5 Put -3/5, -8, 3, -1/37 in descending order. 3, -1/37, -3/5, -8 Sort -4/5, 1, 2/19, -7. -7, -4/5, 2/19, 1 Put 2/5, -4/9, -40, -0.3 in increasing order. -40, -4/9, -0.3, 2/5 Sort -657, 2, 1, 0.2 in decreasing order. 2, 1, 0.2, -657 Sort 0.5, -196.5, 3/4 in descending order. 3/4, 0.5, -196.5 Sort 3313, 5, -4, 1, -2 in descending order. 3313, 5, 1, -2, -4 Sort -2/7, -115/2, 2/3 in descending order. 2/3, -2/7, -115/2 Sort 23, 2, 9, 5, -1 in ascending order. -1, 2, 5, 9, 23 Sort 0, -25, 2/5 in decreasing order. 2/5, 0, -25 Sort 0, 51, 11 in descending order. 51, 11, 0 Put 22, 5, -11 in descending order. 22, 5, -11 Put -4, 0, 13, 1, -32 in decreasing order. 13, 1, 0, -4, -32 Sort -1/51, 0.5, -2/9 in descending order. 0.5, -1/51, -2/9 Put -34, -3, -4, -2 in ascending order. -34, -4, -3, -2 Sort -3, 0.3, -2/53 in ascending order. -3, -2/53, 0.3 Put -5, 27, 6, 2 in decreasing order. 27, 6, 2, -5 Put -54, -4, 5, 33 in decreasing order. 33, 5, -4, -54 Sort 4, 2, 22, -11 in decreasing order. 22, 4, 2, -11 Sort -3, -60, -4, -5 in descending order. -3, -4, -5, -60 Sort 5, 25, -22, 1 in decreasing order. 25, 5, 1, -22 Put -4, -0.6, 8 in descending order. 8, -0.6, -4 Put 2, 0, -26, 3 in increasing order. -26, 0, 2, 3 Sort 23, -2, -0.5. -2, -0.5, 23 Sort 1, -7, 4 in increasing order. -7, 1,	{ "pile_set_name": "DM Mathematics" }
Let k = 11 - 4. Let w(j) = -j*2 + 9j - 3. Let u be w(k). Let x(y) = 2y2 + 3y*2 - 4y - 3 - 1. Let i(q) = 14q2 - 11q - 11. Give ux(h) - 4i(h). -h2 Let v(q) = q3 + 5q2 - 5. Let y(k) = -k2 - 4. Let z(j) = 1. Let s(n) = 2y(n) + 10z(n). What is -5s(d) - 2v(d)? -2d*3 Let n(j) = 25j*3 - 2j*2 - 2j - 2. Let z(t) = 74t3 - 7t*2 - 7t - 7. What is 7n(d) - 2z(d)? 27d3 Let a(c) = 2c. Suppose 2r - j = 0, 4j - 33 = -3r - 11. Let x(z) be the first derivative of 1/2z*r + 4 + 0z. What is a(u) - x(u)? u Let q(w) = -w - 6. Let v(f) = 2f2. Let g(n) = n2 - n. Let c(j) = g(j) - v(j). What is -c(z) + q(z)? z2 - 6 Let z(t) = 85t*3 - 84t*3 + 1 - 3 + 4t. Let h(p) = p*3 + 7p - 4. Give 3h(q) - 5z(q). -2q3 + q - 2 Let u(k) = -6k*3 - 5k*2 - k + 7. Let t(x) = 7x*3 + 6x*2 + x - 7. Determine -5t(g) - 6u(g). g3 + g - 7 Let c(b) = -b3 - b2 + b + 1. Let f(r) = 3r*3 - r. Determine c(y) + f(y). 2y3 - y2 + 1 Let o be ((-2)/(-6))/(4/(-24)). Let y(b) = 4b2 - 2b + 5. Let n(h) = h*2 - h + 1. Calculate on(s) + y(s). 2s2 + 3 Let a(j) = 4j - 1 + 3 + 0j. Let i(c) = -3c - 2. Let m be 3/((-1)/12-9). Give ma(t) + 5i(t). t - 2 Let b(c) = -3c. Let l(d) = 4d - 5. Let y(w) = w - 1. Let v(a) = -l(a) + 5y(a). Let u(p) = p*3 - 7p*2 - 7p - 1. Let m be u(8). Determine mv(g) + 3b(g). -2g Let q(n) = -4n. Let a be q(2). Let x(r) = -2r3 + 5r*2 - 5r + 2. Let s(b) = -8b2 + 6 + 3b*3 + 8b - 4 - 5. Determine ax(k) - 5s(k). k*3 - 1 Suppose -1 = d - 3. Let i(n) = -1 - 2n*d + n - 6n*2 + 2n*2 + 0. Let s(x) = -5x*2 + x - 1. What is -3i(j) + 4s(j)? -2j2 + j - 1 Let p(r) be the first derivative of -r4/2 - 3r2/2 - 4r + 12. Let m(z) = -5z3 - 7z - 9. Calculate -3m(b) + 7p(b). b*3 - 1 Let i(s) = 4s - 3. Let v(g) = -2g + 1. Let n be (2/1 - -1)/(-1). Calculate ni(t) - 7v(t). 2t + 2 Let u(b) = 13b3 - 5b*2 + 7b - 2. Let x(c) = -19c3 + 8c*2 - 10c + 3. What is 7u(y) + 5x(y)? -4y3 + 5y*2 - y + 1 Suppose 0p + 2p = 4. Suppose 2s = 4z + 12, pz + z = s - 7. Let y(u) = -u. Let h(m) = -2m + 1. Give sy(w) - h(w). -2w - 1 Let f(t) = 9t + 6. Let o(a) = 19a + 13. What is 9f(p) - 4o(p)? 5p + 2 Let u(j) = 2j - 9. Let p(o) = -o + 4. Suppose 4d + 3r - 3 = 0, -2d - 3r + 8r = -21. Suppose 0 = -dl + 1 - 16. What is lp(w) - 2u(w)? w - 2 Let j(v) = 53 + v2 - 23 - 30. Let g(s) = 2s2. Let m(p) = -p2 + 1. Let f be m(2). Give fg(t) + 4j(t). -2t2 Let i(y) = 7y*2 + 3y + 5. Let j(q) = q*2 + q + 1. What is -i(b) + 5j(b)? -2b2 + 2b Let f(r) = -r - 5r2 + 0r3 - r2 - r*3 + 6r*3. Let k(q) = -4q*3 + 5q*2 + q. What is -5f(o) - 6k(o)? -o3 - o Suppose -5u - 2p = -3p - 14, p = 1. Let s(h) = 11 - 11 + h*u - 3h + 3h2. Let t(n) = 2n*3 + 7n*2 - 7n. Calculate 7s(c) - 3t(c). c*3 Let n(b) be the second derivative of 7b*3/6 + 2b*2 - 7b. Let w(h) = 15h + 9. Suppose -2r + 3z = -32, -4r + 5z = 1 - 63. Determine rn(c) - 6w(c). c - 2 Let u(h) = 4h*2 + 9h. Let s(m) be the second derivative of -m4/12 - m3/3 - m. Give -18s(t) - 4u(t). 2t2 Let w(n) = -n2 + n - 1. Let x(j) = -8j*3 - 3j*2 + 6j + 11. Let h(k) = k3 + k2 - k - 1. Let f(p) = 6h(p) + x(p). Give f(g) + 3w(g). -2g3 + 3g + 2 Let w(i) = i + 4. Let q(p) = p - 5. Let c(g) = -2g + 5. Let b(j) = -2c(j) - 3q(j). Calculate -6b(o) + 7w(o). o - 2 Let s(d) = -5d - 7. Let a be ((-8)/(-5))/((-8)/(-20)). Let o(b) = 5b + 2. Let r(y) = 11y + 3. Let m(f) = ar(f) - 10o(f). Determine -6m(u) + 7s(u). u - 1 Let k(w) be the first derivative of -w*2/2 + 7w - 1. Suppose s = 2q + 1, s = -0s - q + 7. Let i(r) = -r + 6. What is sk(b) - 6i(b)? b - 1 Let x(v) = -6v2 - 6v + 1. Suppose -6y = -4y + 8. Let r(j) be the second derivative of -13j4/12 - 13j3/6 + j2 - j. Calculate yr(w) + 9x(w). -2w2 - 2w + 1 Let l(c) = -6c3 + 68c*2 + 14. Let i(j) = 2j*3 - 23j*2 - 5. Calculate 14i(o) + 5l(o). -2o*3 + 18o*2 Let f(k) = -25k - 2. Let j(m) = -175m - 15. What is -15f(n) + 2j(n)? 25n Let q(j) = j + 7. Let o(v) be the second derivative of 0 - 15/2v2 - 1/3v*3 + v. Suppose -3z = -z + 12. Calculate zo(f) - 13q(f). -f - 1 Let a(b) = -b. Let t(g) = g. Let u be (-3 - -1)/(2/(-1)). Let o(k) = -1 + 3 + 0 + 0 - k*2 + 15k. Let n be o(15). Determine na(r) + ut(r). -r Let c(a) = -2a + 2a - 3 - a + 3a. Let p(z) = -7z + 13. What is -9c(x) - 2p(x)? -4x + 1 Let p(c) = 2c - 3c - 3c + 3c. Let i(k) = -3k*2 + 18k. Give -i(o) - 18p(o). 3o*2 Let z(p) be the second derivative of 8p*2 + 0 - 2p + 2/3p3. Let r(j) = j + 5. What is -10r(u) + 3z(u)? 2u - 2 Let x(k) = -6k3 - 2k*2 - 4k + 5. Let b(s) = -7s3 - 2s*2 - 5s + 6. Determine 3b(t) - 4x(t). 3t3 + 2t2 + t - 2 Let q(v) be the first derivative of -v4/2 - 2v3/3 + v2 + 2v + 70. Let i(t) be the second derivative of t3/6 + t2/2 - t. Give 2i(d) - q(d). 2d*3 + 2d2 Let i(m) = -m2 - 3m + 3. Let v be i(-3). Suppose -5f = 6 + 84. Let y = f + 8. Let b(w) = -w*2 + 3. Let t(c) = -4c*2 + 10. Calculate vt(q) + yb(q). -2q*2 Let f(z) = -9z + 6. Let o be (0 + 4/8)-2. Let h(k) = k - 1. Determine of(g) - 6h(g). 3g Let x(f) = -2f + 2. Let a(j) = -j3 - j + 2. Determine -3a(i) + 2x(i). 3i*3 - i - 2 Let a = -9 + 11. Let x(n) = 0 + 2n*2 - 3n*a - 1 + 0. Let c(v) be the second derivative of -2v*4/3 - 3v*2 + v. Give c(i) - 6x(i). -2i2 Let i(h) = 0 + 46h - 45h + 0. Let g = 49 - 51. Let x(m) = m2 + m. Let q(n) = 5n*2 + 12n. Let s(p) = -q(p) + 6x(p). Calculate gs(j) - 11i(j). -2j*2 + j Let f(j) = 8j. Suppose 8 = -4x - 4. Let o(l) = l. Determine xf(r) + 21o(r). -3r Let p(t) = 6t3 + 2t*2 + 6t + 6. Let h(a) = 11a3 + 4a*2 + 13a + 13. What is -6h(g) + 13p(g)? 12g3 + 2g2 Let j = 11 - 7. Let m(a) = -a3 + 4a2 - 4a - 1. Let i(o) = -o*2 + o. Give ji(b) + m(b). -b*3 - 1 Let y(w) = -8w*2 + 5w - 5. Let d(c) = 9c2 - 4c + 2. Let v(k) = -19k2 + 8k - 3. Let a(l) = 5d(l) + 2v(l). Calculate 5a(g) + 4y(g). 3g2 Let t(s) = 22s + 2. Let j(q) = 21q + 2. Give -4j(b) + 3t(b). -18b - 2 Let j(d) = 8d - 3. Let r(g) = -17g + 6. Calculate -5j(a) - 3r(a). 11a - 3 Let n(r) = -1. Let a(s) = 6s + 2. Let w(k) = -5k - 3. Let h(t) = -3a(t) - 4w(t). Calculate -h(y) - 4n(y). -2y - 2 Let n(k) = -3k + 5. Let y(l) = 3l - 6. Suppose -7s + 15 = -2s. What is sy(h) + 4n(h)? -3h + 2 Let m(l) = -l*2 + 4l + 37. Let z(w) = -w*2 + 5w + 37. What is 6m(j) - 5z(j)? -j*2 - j + 37 Let h(c) = -4c*2 + 6. Let l(v) = -15v*2 + 5v + 19. Let i(d) = 7d2 - 2d - 9. Let y(f) = -5i(f) - 2l(f). Calculate -4h(o) + 3y(o). o*2 - 3 Let d(z) = -2z*2 - 2z + 1. Let w(j) = j*2 + 3j - 1. Let u(f) = 3f2 - f - 2. Let m be u(-1). Give mw(p) + 3d(p). -4p*2 + 1 Let f(k) = 6k - 11. Let v(m) = m - 2. Let c = -52 + 50. Calculate cf(r) + 11v(r). -r Let q(v) be the first derivative of 3v + 0v*3 - 2 + 3/2v*2 + 1/4v4. Let z(g) = -g3 - g - 1. What is q(i) + 2z(i)? -i3 + i + 1 Let c(o) = -o3 + 17o*2 + 5o + 2. Let v(n) = n*3 - 9n*2 - 3n - 1. What is -3c(q) - 5v(q)? -2q3 - 6q*2 - 1 Let y(a) = -a + 1. Let l(s) = -4s*2 + 2s - 6. Determine l(o) + 3y(o). -4o2 - o - 3 Let h(g) = -g2 - 5g + 1. Let b(d) = d2 + d - 1. What is 2b(o) + h(o)? o*2 - 3o - 1 Let y be (2/(-4)2)/(1/(-11)). Suppose -2j = 6 + 6. Let v(c) = 5c2 - 7. Let z(n) = 9n*2 - 13. Give jz(k) + yv(k). k2 + 1 Suppose -9g + 20 = -4g. Let a(t) = 6t*2 - 3t - 3. Let d(c) = 7c2 - 4c - 4. Calculate ga(x) - 3d(x). 3x2 Let c be (-3)/(-1)11. Let l(g) = -3g*c - 4g + 2g3 + 5g. Let o(b) = -3b + 2b + 3b3 - 2b*3. What is 6l(f) + 4o(f)? -2f*3 + 2f Let d(l) = 2l2 + 5l + 2. Let u(v) = -1 + 2 + 30v2 - 17v*2 - 12v*2 + 2v. Determine -3d(c) + 8u(c). 2c2 + c + 2 Let f(j) = -5 + 4 + 0 - j - j2 + 0. Let t(p) = -p3 + 5p*2 + 5p + 4. What is 4f(m) + t(m)? -m3 + m2 + m Let k(p) = 6p*3 + 4p. Let b(m) = -m3 + m2 + 3m + 2. Let c be b(3). Let a(s) = -4s*3 - s - 4s + 2s. What is ca(h) - 5k(h)? -2h*3 + h Let f(v) = 3v + 6. Let i	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.