Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
, 167? 1/7 Which is the closest to 1? (a) -1.2 (b) -2/7 (c) -15 b What is the closest to -3 in 0.15, 1, -0.4? -0.4 Which is the closest to -1? (a) 0.4 (b) -1/2 (c) 3/5 (d) 1 b Which is the nearest to 0? (a) 0.03 (b) -4 (c) -373/2 (d) -1/9 a Which is the nearest to 19? (a) -0.3 (b) -1/3 (c) 5 c Which is the nearest to -1? (a) -2 (b) 0.1 (c) 0.064 (d) 4 a Which is the closest to -1/7? (a) -1 (b) -11.3 (c) -2/5 c What is the nearest to -3 in -3/2, 2.97, -3? -3 What is the closest to -0.1 in 220, 4, -0.1? -0.1 What is the nearest to 0.1 in -1/9, -3, -0.555, -4? -1/9 Which is the nearest to 1/2? (a) 0.23 (b) -3 (c) 2/11 (d) 2 a Which is the nearest to 1/4? (a) -0.06 (b) 1 (c) 4/7 (d) -0.1 a Which is the nearest to 0? (a) 1/4 (b) 2/3 (c) 4.03 (d) -1 a What is the nearest to 0.1 in 2/7, -0.4, -2/53? -2/53 What is the nearest to -1/2 in -41, 4, 2/13? 2/13 What is the nearest to 2/3 in 5, -0.04, -2/11, -0.1? -0.04 Which is the nearest to -1/2? (a) 3 (b) 0.123 (c) -1/5 (d) -2/3 d What is the nearest to -0.5 in -5, -8, -3, 1? 1 Which is the nearest to -1/3? (a) -0.22 (b) 0.1 (c) 2 (d) -3/2 a Which is the closest to -1/3? (a) 0.2 (b) -2/9 (c) 5 (d) 25 b What is the closest to 30 in 4, -2/7, 0? 4 What is the nearest to 0 in -0.1, 8, -11, 0.22? -0.1 Which is the nearest to -2/3? (a) -2 (b) -21 (c) 1 a What is the nearest to 0 in -71, -7/3, -0.3? -0.3 What is the closest to -0.2 in 8, -1, 187/2? -1 Which is the nearest to 0.1? (a) 4/21 (b) 0.2 (c) -0.05 a Which is the closest to 4? (a) 0.1 (b) -0.5 (c) 7 (d) -3/8 c What is the nearest to 6/5 in -0.45, -3, -3/8? -3/8 What is the closest to 1 in -5, 0.034, -4, -0.1? 0.034 What is the nearest to 4/5 in -3, 2, 40, -9? 2 What is the closest to 0.1 in 2/5, -0.3, 13, -2/3? 2/5 What is the closest to 2 in -2/5, -5, -11/4? -2/5 What is the closest to -1/4 in -1, -5, 3/4, -0.08? -0.08 Which is the nearest to 0? (a) 1/3 (b) 3/5 (c) 5 a Which is the closest to 6? (a) 0.3 (b) -1/2 (c) -4 a Which is the nearest to 3? (a) 8 (b) -5 (c) -1 c Which is the closest to -2? (a) 0.5 (b) -1 (c) 0.2 (d) -4 b Which is the closest to -0.1? (a) -2/3 (b) -2 (c) 0.2171 c Which is the nearest to -1? (a) 2/7 (b) 2 (c) -3.9 (d) 0.2 d What is the closest to 1 in -3/7, 0.1, 1? 1 Which is the nearest to -1.2? (a) 5 (b) 10/3 (c) -29/2 b What is the closest to -1 in -0.1, 0.3, -3/19, 4/9? -3/19 Which is the nearest to -1? (a) -1/11 (b) 5 (c) -33 (d) -3 a What is the nearest to -0.1 in -0.5, -1/7, -4, -1/5? -1/7 Which is the nearest to 2.8? (a) -1 (b) 1 (c) -0.1 b Which is the nearest to -19/5? (a) 0 (b) -0.5 (c) -0.2 b Which is the closest to -1? (a) 323 (b) 5 (c) -2.7 c Which is the closest to 1/2? (a) 0.2 (b) -0.3 (c) -9 a What is the closest to -145 in 1/3, 5, -0.2, -2/11? -0.2 Which is the closest to -2? (a) 3/5 (b) -1288 (c) -4 c What is the nearest to -2 in 0, -3, -0.1, 0.5? -3 What is the closest to -7 in -0.08, -0.06, 0.4? -0.08 What is the closest to -26 in 1, 2/9, -1/3, -1/4? -1/3 What is the closest to 1 in 128, 3/4, 10, -1? 3/4 Which is the nearest to -1.2? (a) 1/2 (b) -2/7 (c) -5 (d) 1/14 b Which is the nearest to -1? (a) -1/2 (b) -6 (c) -3 (d) -2/21 a What is the closest to -2/9 in -2/3, 0, 27? 0 Which is the nearest to -1? (a) -47 (b) -6/11 (c) 6 (d) -2/5 b What is the nearest to 1 in -0.3, -0.06, 0.3, 4? 0.3 Which is the closest to 6? (a) -106/5 (b) 2/3 (c) 2/7 b What is the nearest to -1/11 in 0, -2/49, -3? -2/49 What is the nearest to -1 in 12, -0.5, -67? -0.5 Which is the closest to 93? (a) 1 (b) 0.2 (c) 38 c Which is the closest to -0.1? (a) -3 (b) 43 (c) 1.9 c Which is the nearest to 1? (a) 27 (b) 0.1 (c) -5 (d) -3 b What is the nearest to 0.4 in 3, -6, -0.4? -0.4 What is the nearest to 1 in 5, 0.2, 0.145? 0.2 What is the closest to 1 in 0, 5.4, -4? 0 What is the closest to 3/4 in -4, 29, 4? 4 Which is the nearest to 2? (a) -3/5 (b) 2/9 (c) 3.1 c What is the closest to 1.4 in -2/9, -4, 2, -3? 2 What is the nearest to 2/5 in 2, 2/5, -1/2? 2/5 Which is the nearest to 0.1? (a) 61 (b) -2 (c) 0 c Which is the nearest to -13? (a) -4 (b) -2 (c) 4 a What is the closest to 1 in 3, 0.1, -0.4, -1/8? 0.1 What is the nearest to -2 in 5, 0, -5? 0 What is the nearest to 1 in 0.5, 1, 93? 1 Which is the nearest to -1/3? (a) 8 (b) -0.2 (c) 0.5 (d) 4 b What is the nearest to 0.04 in -0.04, 0.4, -1/3, 4? -0.04 Which is the closest to -136? (a) -2 (b) 45 (c) -1/5 a What is the nearest to -1 in -0.4, 3, 3/7, 1/6? -0.4 What is the closest to -2/7 in 71, 4, 1? 1 Which is the nearest to 0.2? (a) -1/6 (b) -0.07 (c) 2/9 c Which is the nearest to 0.3? (a) 0 (b) 1/6 (c) 1/8 (d) -24 b What is the closest to -2 in -4, 40/7, -0.4, -1? -1 What is the nearest to 1 in -4, 0, 7, -1.2? 0 What is the closest to 2/9 in 1, -0.5, 31? -0.5 Which is the closest to -5? (a) -0.1 (b) -2 (c) 2 (d) 14 b Which is the closest to 1/4? (a) 3 (b) 40 (c) -0.1 (d) -0.4 c Which is the closest to 0? (a) -3 (b) -45/11 (c) 18 a Which is the nearest to 1? (a) 0.5 (b) 2 (c) -336 a Which is the closest to -3/4? (a) 2/3 (b) 0 (c) -4 b What is the closest to -3/5 in 0, 56/3, -1? -1 What is the closest to 1/4 in -1, 2/5, -4, 2/15? 2/15 Which is the closest to -4/3? (a) -0.5 (b) 256 (c) -1/6 a What is the closest to -102/11 in 0.05, 1/2, 3? 0.05 Which is the closest to 1/3? (a) -4 (b) 0 (c) 2/17 (d) -0.4 c What is the closest to 1 in -3, 87.63, 3? 3 Which is the closest to -1? (a) -2/3 (b) 44 (c) -0.2 a What is the closest to -90 in 0.2, -2/7, -1? -1 What is the closest to -0.2 in -4, 1, 2/3, -729? 2/3 What is the closest to -6 in -0.2, -3/4, -9? -9 What is the nearest to -2/45 in -2, -4/5, 2? -4/5 What is the nearest to 0.1 in 2/13, -0.33, -0.1? 2/13 Which is the nearest to 1? (a) 0.2 (b) 10 (c) 0 (d) -7 a Which is the nearest to 1? (a) 6 (b) 3/4 (c) 2 b Which is the nearest to 37? (a) 2/3 (b) 1 (c) -3 (d) 1/7 b What is the nearest to -0.1 in 6, 1/11, 0, -4? 0 What is the closest to -65 in -0.2, -2, 0? -2 What is the nearest to 0.09 in 1, 1/5, -0.27? 1/5 What is the nearest to 0 in 5, 0.2, 1, -94? 0.2 What is the nearest to 7/6 in -1/4, -1/5, 0.3? 0.3 What is the closest to -0.1 in -0.2, 6, 3, 2/9? -0.2 What is the closest to -1/3 in 2/7, 1/2, 1/18, 8? 1/18 What is the closest to -3 in 4/7, -0.1, 3, 20? -0.1 What is the nearest to 0.2 in 2/3, -62.6, -0.4? 2/3 Which is the nearest to 2/5? (a) -3 (b) -5 (c) -26 a Which is the closest to 3? (a) 3 (b) 5 (c) -4/3 a What is the closest to 1 in -4, 5/4, -3, 12? 5/4 Which is the closest to 6? (a) -1/3 (b) -0.4 (c) -0.1 (d) -1 c What is the closest to -2 in 27, 0.3, -0.3? -0.3 Which is the nearest to 0.1? (a) 5 (b) -1/13 (c) 0 (d) -1/3 c Which is the closest to 1? (a) 2/9 (b) 0.2 (c) -10/3 a What is the closest to -2/7 in 3/2, 0.2, 5? 0.2 Which is the closest to -2? (a) 1 (b) -2/15 (c) -4 (d) -0.04 b What is the closest to -1/4 in -5, -390, -3/5? -3/5 What is the nearest to -1/5 in -3, -9, 5, 4? -3 Which is the closest to 1? (a) -152 (b) 0 (c) 5/6 c Which is the nearest to 2/27? (a) 7/2 (b) -0.4 (c) 2/7 (d) 1 c Which is the closest to 0.1? (a) 0.1 (b) -13 (c) 2 (d) 2/11 a What is the closest to -2/5 in 4, -2/11, -4? -2/11 What is the closest to 3 in 3, 5, -10/9, -2/3? 3 Which is the closest to 1? (a) 0.04 (b) 2/7 (c) -4 (d) 4 b What is the nearest to 3 in 5, 3/8, -8/9, -1/6? 5 What is the closest to -1 in 1, -1/4, -0.2, -0.07? -1/4 What is the nearest to 0.2 in 4/9, -1/2, 1/6, 168? 1/6 What is the nearest to -1/2 in -0.1, -4/11, 0.01? -4/11 Which is the nearest to 0.22? (a) 0.4 (b) -2 (c) -1/4 a What is the nearest to 0.1 in -0.5, 2/7, -3? 2/7 What is the closest to -0.1 in 5, -8/13, -1, 1? -8/13 Which is the nearest to 1? (a) 0.17 (b) -0.1 (c) -0.3 a Which is the nearest to -0.2? (a) -3 (b) 0.474 (c) 0.4 c What is the nearest to 1/4 in 2, -11, -4? 2 What is the nearest to 1 in 2/29, 21, 10, -1/4? 2/29 What is the closest to -1 in 11, -1/3, -0.4? -0.4 What is the closest to -22 in -1, -2, -5? -5 Which is the closest to 0? (a) -26 (b) -0.4 (c) -4/15 (d) 0.3 c Which is the nearest to 2? (a) -4/13 (b) 0.6 (c) -1/3	{ "pile_set_name": "DM Mathematics" }
What is 45/2 of a year in months? 270 What is 3972.54 centimeters in millimeters? 39725.4 What is 1/15 of a decade in months? 8 What is 5882.545 centuries in years? 588254.5 What is 1/6 of a hour in minutes? 10 What is twenty-one halves of a millennium in decades? 1050 Convert 0.2568976um to millimeters. 0.0002568976 How many centuries are there in thirty-three fifths of a millennium? 66 How many millennia are there in 5138.235 centuries? 513.8235 What is 59.27056 minutes in nanoseconds? 3556233600000 What is 19/4 of a micrometer in nanometers? 4750 Convert 543753.3 kilograms to micrograms. 543753300000000 What is 7/8 of a hour in seconds? 3150 What is 482.8683 decades in months? 57944.196 What is 2.681441l in millilitres? 2681.441 How many meters are there in fifty-one halves of a kilometer? 25500 How many millilitres are there in 6/5 of a litre? 1200 How many meters are there in 3/25 of a kilometer? 120 How many grams are there in eleven halves of a kilogram? 5500 How many nanograms are there in 51/8 of a microgram? 6375 How many microseconds are there in three fifths of a millisecond? 600 How many millimeters are there in 3/50 of a kilometer? 60000 What is 0.8368514 years in decades? 0.08368514 Convert 2295.17ug to nanograms. 2295170 How many meters are there in eleven tenths of a kilometer? 1100 What is three sevenths of a week in hours? 72 How many millimeters are there in 0.7351796 kilometers? 735179.6 What is 0.4235195l in millilitres? 423.5195 Convert 9155.99ug to tonnes. 0.00000000915599 How many decades are there in 0.9965917 years? 0.09965917 What is 61/4 of a microsecond in nanoseconds? 15250 How many months are there in one fifth of a millennium? 2400 What is three eighths of a milligram in micrograms? 375 How many weeks are there in 1160037.207ns? 0.0000000019180509375 How many minutes are there in 5/6 of a hour? 50 What is 15/4 of a millimeter in micrometers? 3750 What is one fifth of a kilometer in centimeters? 20000 Convert 784296.8 years to centuries. 7842.968 What is 85/4 of a millimeter in micrometers? 21250 How many milligrams are there in 13/8 of a gram? 1625 Convert 734.9861 millennia to decades. 73498.61 How many litres are there in 1468.188 millilitres? 1.468188 What is 0.817642ug in milligrams? 0.000817642 What is 0.3213685 millilitres in litres? 0.0003213685 How many meters are there in 6/25 of a kilometer? 240 How many decades are there in six fifths of a century? 12 Convert 26.7741 micrometers to meters. 0.0000267741 Convert 0.6798365ml to litres. 0.0006798365 What is 52/5 of a century in decades? 104 How many hours are there in five sixths of a week? 140 How many decades are there in 6.556863 millennia? 655.6863 How many milligrams are there in 43/4 of a gram? 10750 What is 27/5 of a century in years? 540 How many months are there in 7/4 of a millennium? 21000 What is 1863.34452s in days? 0.0215664875 Convert 7104.244kg to nanograms. 7104244000000000 Convert 3306.74 years to months. 39680.88 How many meters are there in 7186.848mm? 7.186848 What is 3/10 of a millennium in decades? 30 Convert 14.44314 milligrams to nanograms. 14443140 How many months are there in seven sixths of a decade? 140 What is 91/2 of a meter in centimeters? 4550 Convert 0.2157609km to millimeters. 215760.9 How many micrometers are there in 3/25 of a millimeter? 120 How many centimeters are there in 1/16 of a kilometer? 6250 What is twenty-one eighths of a microgram in nanograms? 2625 Convert 116553.8052 milliseconds to weeks. 0.000192714625 How many millilitres are there in thirteen quarters of a litre? 3250 What is 476.6382 years in millennia? 0.4766382 What is 29/5 of a meter in millimeters? 5800 What is 1395.947 micrometers in meters? 0.001395947 What is 244950.2 centimeters in millimeters? 2449502 Convert 0.8405346l to millilitres. 840.5346 What is one tenth of a litre in millilitres? 100 What is fourty-three halves of a decade in months? 2580 Convert 183636.5t to micrograms. 183636500000000000 Convert 2756.77l to millilitres. 2756770 Convert 7.401884 millilitres to litres. 0.007401884 What is 0.1246833m in kilometers? 0.0001246833 How many minutes are there in 2.6848434s? 0.04474739 What is 9179.102 millilitres in litres? 9.179102 What is one tenth of a meter in centimeters? 10 How many seconds are there in 0.9256022 days? 79972.03008 What is one tenth of a century in months? 120 What is 6726.149 centuries in decades? 67261.49 How many millilitres are there in 0.2629249l? 262.9249 What is 34.0124 nanoseconds in seconds? 0.0000000340124 What is 55/2 of a year in months? 330 Convert 3517.847l to millilitres. 3517847 What is 6/5 of a millennium in centuries? 12 How many seconds are there in 8/25 of a hour? 1152 What is 13/12 of a day in minutes? 1560 What is five eighths of a litre in millilitres? 625 What is 11/2 of a week in minutes? 55440 How many nanograms are there in seven halves of a microgram? 3500 How many centuries are there in 142105.32 months? 118.4211 How many millilitres are there in 52/5 of a litre? 10400 How many millilitres are there in 3/8 of a litre? 375 What is 72/5 of a minute in seconds? 864 What is five sixths of a day in seconds? 72000 How many millilitres are there in 83675.73l? 83675730 What is 17/2 of a tonne in kilograms? 8500 How many hours are there in seven halves of a day? 84 What is nineteen quarters of a meter in centimeters? 475 How many nanometers are there in 51/5 of a micrometer? 10200 How many decades are there in 7/4 of a millennium? 175 How many micrometers are there in five eighths of a millimeter? 625 How many years are there in 5/4 of a century? 125 How many centuries are there in 0.4053487 millennia? 4.053487 What is 23.41718 nanoseconds in microseconds? 0.02341718 How many millilitres are there in 1468.042l? 1468042 How many months are there in 80.78214 decades? 9693.8568 How many millilitres are there in 3/10 of a litre? 300 Convert 8036.34 millennia to years. 8036340 How many nanograms are there in eleven halves of a microgram? 5500 What is 15.4883988 seconds in days? 0.000179263875 How many millilitres are there in six fifths of a litre? 1200 How many decades are there in 3154.219 years? 315.4219 How many grams are there in 7/2 of a kilogram? 3500 What is 0.306926 kilograms in milligrams? 306926 How many millilitres are there in twenty-seven fifths of a litre? 5400 What is 3/5 of a micrometer in nanometers? 600 What is 13/8 of a kilogram in grams? 1625 What is 6/5 of a minute in seconds? 72 Convert 438.1852 years to decades. 43.81852 What is 3.580751 millilitres in litres? 0.003580751 Convert 4.088475ms to minutes. 0.00006814125 How many decades are there in 3.906346 millennia? 390.6346 How many millimeters are there in 13/5 of a centimeter? 26 How many kilograms are there in twenty-nine fifths of a tonne? 5800 How many nanograms are there in 6.012799 tonnes? 6012799000000000 How many meters are there in one fifth of a kilometer? 200 How many kilograms are there in 12/25 of a tonne? 480 What is 2863.817 kilograms in tonnes? 2.863817 What is 199.8382nm in meters? 0.0000001998382 What is 9.147995 millennia in centuries? 91.47995 Convert 0.4011215 litres to millilitres. 401.1215 What is fifty-four fifths of a litre in millilitres? 10800 What is 55/2 of a millennium in years? 27500 What is 0.8973716 millennia in months? 10768.4592 What is one quarter of a litre in millilitres? 250 Convert 627505.1um to meters. 0.6275051 What is twenty-one halves of a millimeter in micrometers? 10500 How many decades are there in 33/5 of a millennium? 660 What is twenty-seven quarters of a litre in millilitres? 6750 Convert 566.801us to milliseconds. 0.566801 How many millilitres are there in twenty-seven quarters of a litre? 6750 How many centuries are there in 25/2 of a millennium? 125 How many millilitres are there in 21/8 of a litre? 2625 What is seventeen quarters of a litre in millilitres? 4250 How many nanograms are there in 4.23539kg? 4235390000000 Convert 10.72084um to meters. 0.00001072084 What is 93/4 of a kilogram in grams? 23250 What is 2445.2283 months in centuries? 2.03769025 What is thirty-one halves of a milligram in micrograms? 15500 How many kilograms are there in ninety-five halves of a	{ "pile_set_name": "DM Mathematics" }
76598, -94311, -112024? -129737 What is next in -69761, -141467, -213173? -284879 What comes next: -3245203, -3245230, -3245303, -3245446, -3245683, -3246038? -3246535 What is the next term in -31928, -31680, -31432, -31184? -30936 What is next in -42861424, -42861429, -42861438, -42861451, -42861468? -42861489 What comes next: -55180, -55351, -55788, -56623, -57988, -60015, -62836? -66583 What comes next: -335, -536, -245, 892, 3229? 7120 What comes next: -84532, -169089, -253646, -338203, -422760, -507317? -591874 What is the next term in -13898, -13822, -13602, -13160, -12418, -11298, -9722? -7612 What is next in 853904657, 1707809316, 2561713975, 3415618634? 4269523293 What comes next: -812273, -3249104, -7310495, -12996446, -20306957, -29242028, -39801659? -51985850 What comes next: 26683, 53317, 79951, 106585, 133219? 159853 What is the next term in -5567233, -5567231, -5567229, -5567227, -5567225, -5567223? -5567221 What is next in 1594, 6991, 16014, 28687, 45034, 65079, 88846? 116359 What comes next: 9673, 19286, 28901, 38518? 48137 What comes next: -5541556, -11083111, -16624666? -22166221 What is the next term in 411944, 411358, 410772, 410186, 409600, 409014? 408428 What comes next: 3096, 3079, 3062, 3045, 3028, 3011? 2994 What is next in -48224, -47912, -47390, -46658, -45716, -44564? -43202 What comes next: -347896, -695793, -1043690, -1391587, -1739484, -2087381? -2435278 What is the next term in 273474, 273447, 273420? 273393 What comes next: -1752672, -3505312, -5257952, -7010592? -8763232 What is the next term in 13291835, 53167358, 119626563, 212669450, 332296019, 478506270? 651300203 What is next in -1868, -10505, -33084, -76577, -147956, -254193, -402260? -599129 What is the next term in -213111, -852389, -1917859, -3409527, -5327399, -7671481? -10441779 What comes next: -249981554, -499963110, -749944666, -999926222? -1249907778 What is the next term in -647731, -1295458, -1943183, -2590906? -3238627 What is the next term in 1651, 1519, 1313, 1045, 727? 371 What comes next: 2249, 7525, 15801, 27077, 41353, 58629, 78905? 102181 What is next in -565092, -565098, -565116, -565152, -565212? -565302 What is next in 113973972, 227947945, 341921918, 455895891, 569869864? 683843837 What is the next term in 244076, 1953414, 6593044, 15628112, 30523764, 52745146? 83757404 What is next in -3145947, -6291905, -9437865, -12583827, -15729791? -18875757 What is next in -4152, -4717, -5280, -5841, -6400, -6957? -7512 What is next in -1003, -1872, -2569, -3082, -3399? -3508 What comes next: 1357200, 1357372, 1357544, 1357716, 1357888? 1358060 What comes next: 9079, 8880, 8551, 8092, 7503? 6784 What comes next: 6540, 26408, 59600, 106122, 165980, 239180? 325728 What is next in -139936, -140274, -140614, -140950, -141276, -141586, -141874? -142134 What is the next term in -65040, -64778, -64342, -63732, -62948, -61990, -60858? -59552 What comes next: -8545412, -8545411, -8545410? -8545409 What comes next: 2090, 7007, 11926, 16847, 21770? 26695 What is the next term in -79043124, -79043127, -79043130, -79043133? -79043136 What is the next term in -18864193, -37728388, -56592583, -75456778? -94320973 What is the next term in -718785, -1437481, -2156177, -2874873, -3593569? -4312265 What comes next: -15114, -28796, -42476, -56154, -69830? -83504 What comes next: 50265, 100549, 150861, 201201, 251569, 301965? 352389 What is next in 27252738, 27252742, 27252746, 27252750, 27252754, 27252758? 27252762 What is next in 25272, 25659, 26046? 26433 What comes next: 1377608, 5510402, 12398398, 22041602, 34440020, 49593658? 67502522 What is the next term in -4084934, -4084957, -4084980, -4085003, -4085026, -4085049? -4085072 What comes next: 14758932, 14758931, 14758930, 14758929, 14758928? 14758927 What is the next term in -3728, -4224, -5010, -6086? -7452 What is next in -11790910, -11790904, -11790898, -11790892? -11790886 What comes next: -1074, -4934, -11606, -21090, -33386, -48494? -66414 What is the next term in -137005, -136959, -136913? -136867 What is the next term in 837, 1932, 3281, 4884, 6741? 8852 What is next in -4492972, -4492971, -4492970? -4492969 What is next in 848, 5221, 12950, 24041, 38500? 56333 What is the next term in -93213, -373020, -839369, -1492260, -2331693, -3357668? -4570185 What comes next: -1977, -3923, -5857, -7779? -9689 What is the next term in -2309472, -2309519, -2309566, -2309613, -2309660? -2309707 What is next in 40158, 80399, 120654, 160923, 201206? 241503 What is next in 431533, 3452373, 11651787, 27619063, 53943489, 93214353? 148020943 What comes next: 4903, 19734, 44457, 79078, 123603, 178038, 242389, 316662? 400863 What is next in -2387, -9677, -22079, -39803, -63059, -92057, -127007, -168119? -215603 What is next in -396812, -793618, -1190424? -1587230 What is next in -138429, -138713, -138997? -139281 What comes next: 986234, 986240, 986246, 986252, 986258, 986264? 986270 What comes next: 263, 1981, 6665, 15803, 30883? 53393 What comes next: 4997, 10055, 15099, 20123, 25121, 30087, 35015? 39899 What is the next term in -922, 1052, 6434, 16928, 34238, 60068? 96122 What is the next term in 42441603, 169766408, 381974415, 679065624? 1061040035 What is the next term in 8026, 32269, 72676, 129247, 201982, 290881? 395944 What comes next: 133488, 266963, 400438? 533913 What is next in 283, 309, 83, -395, -1125? -2107 What is next in -103060792, -103060791, -103060790, -103060789, -103060788? -103060787 What is next in -65, 37, 545, 1693, 3715, 6845? 11317 What is next in -50986, -51183, -51416, -51679, -51966, -52271? -52588 What is next in 528073, 1054610, 1581147? 2107684 What comes next: 3342, -68, -5752, -13710, -23942, -36448? -51228 What comes next: 124781, 124813, 124875, 124967, 125089, 125241, 125423? 125635 What comes next: -132719, -132461, -132205, -131951, -131699, -131449? -131201 What is next in -51561, -51612, -51675, -51756, -51861, -51996? -52167 What comes next: -3127668, -6255337, -9383006, -12510675, -15638344? -18766013 What comes next: 1232110, 1232123, 1232150, 1232197, 1232270, 1232375? 1232518 What is next in 1130206, 2260286, 3390366, 4520446, 5650526? 6780606 What is next in 4597, 9415, 14233, 19051, 23869, 28687? 33505 What is next in 5972315, 5972316, 5972317, 5972318, 5972319, 5972320? 5972321 What is next in -16536, -16785, -17034? -17283 What comes next: -710, -3213, -7382, -13217, -20718? -29885 What comes next: -466, -2107, -6572, -15277, -29638, -51071, -80992? -120817 What is the next term in -974, -4303, -9852, -17621? -27610 What is next in 307101, 614095, 921087, 1228077, 1535065, 1842051, 2149035? 2456017 What is the next term in -79088, -158402, -237934, -317684, -397652, -477838? -558242 What comes next: 17463535, 17463558, 17463593, 17463646, 17463723? 17463830 What is the next term in -13101, -52388, -117865, -209532, -327389, -471436? -641673 What is the next term in -3208, -3630, -4114, -4660, -5268, -5938, -6670? -7464 What is the next term in -3013, -8349, -13685, -19021? -24357 What comes next: 14408487, 28816954, 43225417, 57633876? 72042331 What comes next: 2282, 4454, 6662, 8906, 11186? 13502 What is the next term in -926, -1297, -1902, -2735, -3790? -5061 What is the next term in 328588, 1314377, 2957352, 5257507, 8214836, 11829333, 16100992? 21029807 What comes next: 1485, 1500, 1463, 1344, 1113, 740? 195 What comes next: -65421, -130847, -196283, -261735, -327209, -392711, -458247? -523823 What is the next term in 1781, 3945, 6497, 9449, 12813, 16601, 20825? 25497 What comes next: -85195, -85208, -85213, -85210, -85199, -85180, -85153? -85118 What is next in 10998302, 10998304, 10998306, 10998308? 10998310 What is next in -56, -2601, -6838, -12767? -20388 What is the next term in -98494, -97826, -97158, -96490, -95822? -95154 What is the next term in -3583, -14338, -32277, -57412, -89755, -129318? -176113 What is next in -22719, -181773, -613477, -1454151, -2840115, -4907689, -7793193, -11632947? -16563271 What comes next: -106918964, -106918965, -106918966, -106918967? -106918968 What comes next: -4161, -3716, -2945, -1848? -425 What is next in -165887, -165871, -165859, -165851, -165847, -165847? -165851 What is next in -4987, -10413, -16277, -22579,	{ "pile_set_name": "DM Mathematics" }
3, 8, -3, -20, -43, -72, -107? -3x2 + 4x + 12 What is the m'th term of -106, -129, -152? -23m - 83 What is the m'th term of 15, 59, 133, 237? 15m*2 - m + 1 What is the h'th term of -559, -554, -543, -526, -503? 3h*2 - 4h - 558 What is the c'th term of 73, 119, 187, 283, 413, 583? c*3 + 5c*2 + 24c + 43 What is the b'th term of -924, -1838, -2752, -3666, -4580, -5494? -914b - 10 What is the x'th term of -620, -614, -604, -590? 2x2 - 622 What is the u'th term of 7, 6, 3, -2, -9, -18, -29? -u2 + 2u + 6 What is the r'th term of -215, -228, -255, -302, -375? -r3 - r2 - 3r - 210 What is the x'th term of 6, -4, -18, -36, -58, -84, -114? -2x2 - 4x + 12 What is the p'th term of 757, 1504, 2265, 3046, 3853? p3 + p2 + 737p + 18 What is the d'th term of 58, 112, 156, 190, 214? -5d*2 + 69d - 6 What is the r'th term of 1441, 1445, 1451, 1459, 1469, 1481? r*2 + r + 1439 What is the f'th term of 80, 70, 60, 50? -10f + 90 What is the f'th term of -19, -46, -73, -100, -127, -154? -27f + 8 What is the c'th term of 30, -100, -456, -1152, -2302, -4020? -19c3 + c2 + 48 What is the d'th term of -14, 0, 24, 58, 102? 5d2 - d - 18 What is the u'th term of 409, 436, 461, 484? -u2 + 30u + 380 What is the y'th term of 183, 193, 203, 213, 223? 10y + 173 What is the b'th term of 36, 76, 128, 198, 292, 416, 576, 778? b3 + 33b + 2 What is the t'th term of -1, -24, -81, -190, -369, -636? -3t3 + t2 - 5t + 6 What is the s'th term of -29, -90, -181, -308, -477, -694, -965, -1296? -s*3 - 9s*2 - 27s + 8 What is the y'th term of 1399, 2798, 4197? 1399y What is the m'th term of -495, -503, -511, -519, -527? -8m - 487 What is the l'th term of 106, 268, 430? 162l - 56 What is the g'th term of -119, -233, -351, -473, -599? -2g*2 - 108g - 9 What is the d'th term of 8, 17, 12, -13, -64? -d3 - d2 + 19d - 9 What is the k'th term of 24, 29, 30, 27, 20, 9, -6? -2k*2 + 11k + 15 What is the z'th term of -199, -774, -1727, -3058, -4767, -6854? -189z2 - 8z - 2 What is the s'th term of -2111, -2110, -2109? s - 2112 What is the w'th term of -22, -45, -104, -217, -402, -677, -1060, -1569? -3w3 - 2w - 17 What is the h'th term of -2, 8, 18, 28, 38, 48? 10h - 12 What is the j'th term of 2232, 2212, 2192, 2172, 2152, 2132? -20j + 2252 What is the m'th term of 339, 673, 1005, 1335, 1663? -m*2 + 337m + 3 What is the q'th term of 260, 321, 392, 479, 588, 725, 896, 1107? q3 - q2 + 57q + 203 What is the g'th term of 316, 294, 272, 250? -22g + 338 What is the c'th term of 17, 89, 209, 377, 593? 24c2 - 7 What is the i'th term of -17, -119, -311, -605, -1013, -1547, -2219? -2i*3 - 33i*2 + 11i + 7 What is the n'th term of 428, 852, 1276? 424n + 4 What is the i'th term of 26, 23, 18, 11? -i2 + 27 What is the l'th term of -7, -6, 1, 14, 33, 58, 89? 3l*2 - 8l - 2 What is the u'th term of 93, 200, 369, 594, 869, 1188, 1545? -u*3 + 37u*2 + 3u + 54 What is the b'th term of 366, 346, 324, 300, 274, 246, 216? -b*2 - 17b + 384 What is the h'th term of -77, -63, -59, -71, -105, -167, -263? -h3 + h2 + 18h - 95 What is the d'th term of -66, -242, -536, -948, -1478? -59d2 + d - 8 What is the i'th term of 235, 234, 241, 262, 303? i3 - 2i2 - 2i + 238 What is the g'th term of -96, -117, -164, -249, -384? -2g3 - g2 - 4g - 89 What is the d'th term of 40, 42, 44, 46? 2d + 38 What is the n'th term of -1076, -1075, -1074, -1073, -1072, -1071? n - 1077 What is the k'th term of -3608, -3602, -3596, -3590, -3584, -3578? 6k - 3614 What is the d'th term of -1662, -6653, -14972, -26619, -41594, -59897, -81528? -1664d2 + d + 1 What is the h'th term of 67, 57, 49, 43? h2 - 13h + 79 What is the z'th term of 4, 8, 14, 22, 32? z2 + z + 2 What is the x'th term of -1038, -1040, -1034, -1014, -974, -908? x3 - 2x2 - 3x - 1034 What is the u'th term of -269, -277, -291, -311, -337, -369? -3u2 + u - 267 What is the w'th term of 801, 1594, 2387? 793w + 8 What is the i'th term of -556, -557, -566, -589, -632, -701? -i*3 + 2i*2 - 557 What is the k'th term of -8327, -16652, -24977, -33302, -41627, -49952? -8325k - 2 What is the j'th term of 3188, 3197, 3216, 3251, 3308? j3 - j2 + 5j + 3183 What is the b'th term of -96, -134, -160, -168, -152? b3 - 45b - 52 What is the l'th term of -58, -81, -104, -127, -150? -23l - 35 What is the m'th term of 90, 89, 88, 87, 86? -m + 91 What is the j'th term of 118, 236, 356, 478? j2 + 115j + 2 What is the y'th term of -42, -38, -32, -24, -14, -2, 12? y2 + y - 44 What is the i'th term of -8, 1, -2, -23, -68, -143? -i3 + 16i - 23 What is the i'th term of 19, 42, 63, 82? -i2 + 26i - 6 What is the c'th term of -45, -33, -7, 33? 7c2 - 9c - 43 What is the d'th term of 35, 93, 151, 209, 267, 325? 58d - 23 What is the q'th term of 2060, 4114, 6154, 8174, 10168, 12130, 14054, 15934? -q3 - q2 + 2064q - 2 What is the q'th term of -9259, -9263, -9267, -9271? -4q - 9255 What is the r'th term of -265, -545, -809, -1051, -1265, -1445? r3 + 2r*2 - 293r + 25 What is the s'th term of 41, 37, 45, 71, 121, 201? s*3 - 11s + 51 What is the t'th term of -233, -454, -675, -896, -1117? -221t - 12 What is the d'th term of 459, 449, 439, 429, 419? -10d + 469 What is the i'th term of -635, -624, -599, -554, -483, -380? i3 + i2 + i - 638 What is the n'th term of -280, -552, -818, -1078? 3n2 - 281n - 2 What is the b'th term of 1, 34, 107, 226, 397, 626, 919? b*3 + 14b*2 - 16b + 2 What is the v'th term of -25, -28, -31, -34, -37? -3v - 22 What is the b'th term of 20, 86, 198, 356, 560? 23b*2 - 3b What is the w'th term of -661, -1322, -1971, -2602, -3209, -3786, -4327? w*3 - 668w + 6 What is the j'th term of -114, -105, -88, -63, -30, 11, 60? 4j2 - 3j - 115 What is the l'th term of 172, 352, 534, 718, 904, 1092, 1282? l*2 + 177l - 6 What is the u'th term of -27, -31, -45, -75, -127, -207, -321, -475? -u3 + u2 - 27 What is the c'th term of -111, -106, -101, -96, -91, -86? 5c - 116 What is the s'th term of -67, -256, -571, -1012, -1579? -63s*2 - 4 What is the c'th term of 321, 323, 325, 327? 2c + 319 What is the d'th term of -551, -1105, -1661, -2219? -d*2 - 551d + 1 What is the v'th term of 512, 508, 502, 494, 484? -v2 - v + 514 What is the a'th term of -173, -177, -183, -191, -201, -213? -a2 - a - 171 What is the a'th term of 22, -14, -62, -128, -218, -338, -494? -a*3 - 29a + 52 What is the s'th term of -208, -237, -266? -29s - 179 What is the k'th term of -313, -570, -815, -1042, -1245, -1418? k3 - 264k - 50 What is the r'th term of -5, -15, -27, -41, -57? -r*2 - 7r + 3 What is the r'th term of -3932, -3930, -3928? 2r - 3934 What is the n'th term of 4452, 8904, 13356, 17808, 22260, 26712? 4452n What is the w'th term of -277, -554, -831, -1108, -1385? -277w What is the z'th term of 394, 402, 410, 418, 426, 434? 8z + 386 What is the v'th term of 15, 33, 63, 105? 6v2 + 9 What is the w'th term of -140, -141, -150, -173, -216? -w3 + 2w2 - 141 What is the i'th term of 148, 645, 1482, 2665, 4200, 6093, 8350? i3 + 164i2 - 2i - 15 What is the p'th term of -30, -18, -6, 6, 18, 30? 12p - 42 What is the f'th term of 3549, 7096, 10633, 14154, 17653, 21124? -f3 + f2 + 3551f - 2 What is the v'th term of -68, -141, -214? -73v + 5 What is the u'th term of -49, -89, -127, -163? u2 - 43u - 7 What is the p'th term of 121, 244, 367, 490, 613? 123p - 2 What is the k'th term of -289, -583, -877, -1171, -1465? -294k + 5 What is the b'th term of -108, -183, -244, -285, -300, -283, -228? b3 + b2 - 85b - 25 What is the r'th term of -195, -199, -203? -4r - 191 What is the y'th term of -6568, -6570, -6572, -6574? -2y - 6566 What is the m'th term of 46, 94, 158, 238, 334, 446? 8m*2 + 24m + 14 What is the c'th term of 1783, 3585, 5385, 7183, 8979? -c*2 + 1805c - 21 What is the y'th term of 64, 264, 596, 1060, 1656, 2384, 3244? 66y2 + 2y - 4 What is the y'th term of 13, 9, -5, -35, -87, -167, -281? -y3 + y2 + 13 What is the q'th term of -20, -21, -22, -23? -q - 19 What is the c'th term of -355, -710, -1065, -1420, -1775? -355c What is the v'th term of -276, -555, -834, -1113? -279v +	{ "pile_set_name": "DM Mathematics" }
2 - 26u. -463u*2 Collect the terms in -v - 974 + 509 + 465. -v Collect the terms in -367 - 1422p*3 + 367. -1422p*3 Collect the terms in -25s*2 + 3 - 7 + 51s - 4s + 3. -25s*2 + 47s - 1 Collect the terms in -3j2 - 37j*3 + 3j*2 + 4j*3 - 2j*3. -35j*3 Collect the terms in 1217v*3 - 1154v*3 - 1576v*3 - 1652v*3. -3165v*3 Collect the terms in -476049z*2 + 25 + 476051z*2 + 1. 2z*2 + 26 Collect the terms in 14319 + 14321 - 42954 + 14314 - 2i. -2i Collect the terms in -23t + 318t2 + 41t - 18t. 318t*2 Collect the terms in -746099 + 746099 - 207b. -207b Collect the terms in 3z*3 + 15208z - 7629z - 7610z. 3z3 - 31z Collect the terms in 1 - 45i + 59i - 152i. -138i + 1 Collect the terms in -8k + 130k - 1 - 2 + 3. 122k Collect the terms in -70 - 87 - 94 - 5r*2 + 251. -5r*2 Collect the terms in 17o*2 - 33o*2 + 6o*2 + 8o*2 + 183o. -2o2 + 183o Collect the terms in 12 - 12 - 3o - 34o*3 + 78o*3 - 41o*3. 3o*3 - 3o Collect the terms in -981y2 + 938y*2 - 26y - 17y. -43y*2 - 43y Collect the terms in -156165 + 156165 + 171y2 + 176y*2. 347y*2 Collect the terms in -35m - 74m + 178m - 66m + 1 - 1. 3m Collect the terms in 65369d3 - 130766d*3 + 65375d*3. -22d*3 Collect the terms in -13x*3 + 66 - 122 + 56 + 29x*3 - 17x3. -x3 Collect the terms in -788b2 + 3170b*2 - 796b*2 - 794b*2 - 796b*2. -4b*2 Collect the terms in 4t*2 - 1322t + 1322t. 4t*2 Collect the terms in 203 - 2f + 163 - 366. -2f Collect the terms in -21x*3 - 53296 + 53296. -21x*3 Collect the terms in 15y*2 + 3y*3 - 3y*2 + 4y*2 + 3y*3 - 8y*3. -2y*3 + 16y*2 Collect the terms in 5z + 20z2 - 172 - 14z*2 - 277 - 5z. 6z2 - 449 Collect the terms in 5o*3 - 269393 + 269393 + 4o*3. 9o*3 Collect the terms in 16 - 6q*3 + 119 + 5q3. -q3 + 135 Collect the terms in -13i2 + 84i*2 - 24i*2 - 45i*2. 2i*2 Collect the terms in 438 + o - 4o - 4o + 5o. -2o + 438 Collect the terms in 102 + y - 50 - 16y - 53. -15y - 1 Collect the terms in 7113n*3 - 7350n*3 + 1 + 0. -237n*3 + 1 Collect the terms in 83n + 89n + 84n + 88n - 440n + 97n. n Collect the terms in 6507f*2 + 1 - 1 + 6324f*2 - 12823f*2. 8f*2 Collect the terms in -1 + 0 - 82q - 4 + 414q + 7. 332q + 2 Collect the terms in -3010877 - 27g2 + 3010877. -27g*2 Collect the terms in 296p*3 - 116p*3 - 148p*3. 32p*3 Collect the terms in 156z*3 - 23z*3 + 713z*3. 846z*3 Collect the terms in 2y*3 + 4y*3 + 12280y - 6y3 + y3. y3 + 12280y Collect the terms in -7g - 5536 + 10723 - 5187. -7g Collect the terms in 4 - 83887a + 20 + 83881a. -6a + 24 Collect the terms in 128361 - 128361 + r. r Collect the terms in 6l*2 + 0l*2 - 3l*2 - 17l*2. -14l2 Collect the terms in -x2 - 3274x + 6x*2 + 3274x - 6x2. -x2 Collect the terms in 65b - 66b - 27b. -28b Collect the terms in -339879 + 5d*2 + 339879. 5d*2 Collect the terms in 3007w*3 + 3743w*3 + 289w*3. 7039w*3 Collect the terms in -352g*3 + 9g - 9g + 4528g*3. 4176g*3 Collect the terms in 642c*2 - 156c*2 - 161c*2 - 165c*2 - 166c*2. -6c*2 Collect the terms in -45y + 24 - 63y + 145y - 39y - 28 + 4. -2y Collect the terms in -x - 137x2 + x - 154 + 138x2. x2 - 154 Collect the terms in -3705t + 1832t + 1833t. -40t Collect the terms in -1 - 3 + 3 + 334p3. 334p*3 - 1 Collect the terms in 99j - 39j + 104j + 73j. 237j Collect the terms in 10 + 11 + 17 + 2w2 + 20 - 69. 2w*2 - 11 Collect the terms in -5 + 284z - 1570z + 5. -1286z Collect the terms in -30002s + 30002s - 4s3. -4s*3 Collect the terms in 20 + 21y*2 + 26 + 21 - 98 + 31. 21y*2 Collect the terms in 661 - 9z*2 - 1568 + 907. -9z*2 Collect the terms in -3q + 69542q2 + 2q - 69745q2. -203q*2 - q Collect the terms in -287 - 65d*2 + 141 + 161d*2 - 94d*2 + 146. 2d*2 Collect the terms in -8j - 2j + 2 + 11j - 46j - 18j. -63j + 2 Collect the terms in 3g*3 + 206g*2 - 4g*3 - 257g2 - g3. -2g3 - 51g*2 Collect the terms in 1360 - 2724 + 2d + 2d + 1364 + 2d. 6d Collect the terms in 4286o*3 + 4267o*3 - 8566o*3. -13o*3 Collect the terms in -48k*2 - 38k*2 + 111k*2. 25k*2 Collect the terms in 103u - 148u + 110u. 65u Collect the terms in 30j*3 - 36j + 67j - 31j. 30j3 Collect the terms in 139b*2 + 405b*2 - 110b*2 + 386b*2. 820b*2 Collect the terms in -8r*3 - 5r*3 - 37r + 8r3 - 56r. -5r3 - 93r Collect the terms in -10h - h - 82h + 103h - 2h. 8h Collect the terms in 3n - 19n - 130 + n + 4n. -11n - 130 Collect the terms in -3991n - 2n2 + 2n*2 - 3n*3 + 2 + 1470n. -3n3 - 2521n + 2 Collect the terms in -58z2 - 892 + 7z*2 + 892 - 58z*2. -109z*2 Collect the terms in 198 - 257 + 1077 - z. -z + 1018 Collect the terms in 197c*2 + 700 + 195c*2 - 700. 392c*2 Collect the terms in -82w*2 + 39w*2 + 12 + 16w*3 + w + 43w*2. 16w*3 + w + 12 Collect the terms in -83330f*3 + 0 + 0 + 41636f*3 + 41623f*3. -71f*3 Collect the terms in -87m + 266m + 31m + 3m2 + 328m. 3m2 + 538m Collect the terms in 5 + 11j2 - 22j*2 - 31j*2 + 6 - 10. -42j*2 + 1 Collect the terms in -s + 0s + 50 + 3s2 - 2s2 + 1. s2 - s + 51 Collect the terms in -10z - 15z - z*3 + 25z + 227. -z*3 + 227 Collect the terms in 30502o*2 - 1 + 1 - 30519o*2. -17o*2 Collect the terms in -2w*2 + 21w*3 + 26115967w + 2w3 - 26115967w. 23w3 - 2w*2 Collect the terms in -927i*2 - 3i*3 - 940i*2 - 929i*2 + 2796i*2. -3i*3 Collect the terms in 174d - 206195 + 206195. 174d Collect the terms in -613k*3 + 1141k*3 - 549k*3. -21k*3 Collect the terms in 8k - 94k2 + 15k*3 - 87k*2 - 89k*2 + 370k*2 - 91k*2. 15k*3 + 9k*2 + 8k Collect the terms in 549 + 518 - 1067 + 6d2. 6d*2 Collect the terms in 75h*3 - 139h*2 - 183h*2 + 322h*2. 75h*3 Collect the terms in 30a + 22a - 57a + 5a + 4a*3. 4a*3 Collect the terms in 2f - 9f + 10f + 58 + 3f. 6f + 58 Collect the terms in -12u - 7072 + 7072. -12u Collect the terms in 261 + 0t2 - 11t*2 + 2t + 5t2. -6t*2 + 2t + 261 Collect the terms in 3 + 92p + 71p - 3 + 6p3 - 170p. 6p3 - 7p Collect the terms in -30551a + 10a*2 + 30551a + 59a2. 69a*2 Collect the terms in 1 + 384v*2 - 1148v*2 - 1 - 928v*2. -1692v*2 Collect the terms in 162h*3 + 150h*3 - 533h*3. -221h*3 Collect the terms in 80 - 65a*2 - 28 - 27 - 25 + 56a*2. -9a*2 Collect the terms in -338x*3 + 2494x*3 - 56x*3. 2100x3 Collect the terms in -t3 + 7t3 + 3t3 - t3 - 3t3 - 4t3. t3 Collect the terms in -1243k3 - 128 + 128. -1243k*3 Collect the terms in -65p*2 + 163p*2 + 54p*2 + 68p*2 - 65p*2. 155p*2 Collect the terms in -3q*2 + 369 - 10q*2 - 367 + 235q. -13q2 + 235q + 2 Collect the terms in -309d2 - 421d - 415d + 836d + 934d2. 625d*2 Collect the terms in -937r*2 + 3r + 0r - 928r*2 + 1875r*2 - 3r. 10r2 Collect the terms in -b - 17b - 17b - 7b + 4b. -38b Collect the terms in 72m + 1136m*2 - 63m - 9m. 1136m*2 Collect the terms in 688h - 348h + 389h*3 - 340h. 389h3 Collect the terms in -67d*3 + 42d*3 + 41d*3. 16d3 Collect the terms in s2 - 17s3 + 16s*2 + 20s*2 + 11s - 37s2. -17s*3 + 11s Collect the terms in 0 - 18h3 + 0 - 3439703h*2 + 3439703h*2. -18h*3 Collect the terms in 1612343 - 1612343 + 20i*2. 20i*2 Collect the terms in -19l - 106l - 46l - l*3 - 52l. -l*3 - 223l Collect the terms in 66p2 + 54p*2 + 105p - 105p. 120p*2 Collect the terms in -189k*2 + 63k*2 + 87k*2 + 48k*2. 9k*2 Collect the terms in -8b*2 + 101 + 105b*2 + 51 - 152. 97b*2 Collect the terms in -26w + 2 - 13w2 + 17w + 34w + 103w. -13w2 + 128w + 2 Collect the terms in 26v3 + 210v2 + v3 + 210v2 - 420v*2. 27v*3 Collect the terms in -15709878x*2 - 2 + 2 + 15709887x*2. 9x*2 Collect the terms in -98852v - 98874v + 197721v. -5v Collect the terms in 28114b*3 - 3b*2 + 3b*2 - 28065b**	{ "pile_set_name": "DM Mathematics" }
ose 8 = 2i - 2. Let b(l) = -6l + 4l + 16l*2 - il*2 + 9l. Let g(k) = -4b(k) + 7c(k). Let r(m) = -2m. Calculate g(r(s)). -8s*2 Let x(g) = 13g. Let v(k) = -4k2 - 433k + 433k. Calculate v(x(b)). -676b*2 Let n(i) = -i. Let t(a) = -384a. Give t(n(u)). 384u Let q(z) = 2z*2. Let y = -2 - 5. Let t = y + 12. Let f(g) = 13g - tg - 5g. Calculate f(q(x)). 6x2 Let q(f) = -23f*2. Let u(d) = -3d*2 + 118099d - 118099d. Calculate u(q(p)). -1587p*4 Let r(v) = -6v*2. Let b(k) = 3k + 39. Let z be b(-13). Let u(p) be the second derivative of z + 0p2 - 7p + 0p3 + 1/12p*4. Calculate u(r(m)). 36m*4 Let k(b) = 3b. Let g(o) = 251o - 503o + 262o + 7o*2. What is k(g(d))? 21d*2 + 30d Let x(q) = 2q2. Let r(c) = 5c*2 + 4c*2 - 24c*2. What is r(x(z))? -60z*4 Let w(a) = 4a. Let k(t) = -263749t + 2. Determine w(k(s)). -1054996s + 8 Let i(s) = -2s2. Let d(b) = -12b + 184. Let g be d(15). Let p(f) be the third derivative of 0f3 + 0 - 1/20f*5 + 0f + 0fg - 5f*2. Give i(p(q)). -18q*4 Let a(l) = -l + 7l + 2l. Let n(v) = -3 - 602903v*2 + 602902v*2 + 3. Give n(a(j)). -64j*2 Let s(j) = -634792j. Let r(q) = 4q2. Give s(r(v)). -2539168v*2 Let j(l) = 7l + 7. Let p(n) = -5n + 4. Let k(z) = -z + 1. Let m(g) = -4k(g) + p(g). Give j(m(q)). -7q + 7 Let h(a) = a3 - 8a*2 - 10a + 11. Let q be h(9). Let c(y) = -y - 4y + qy - y. Let f(u) = -7u. Give c(f(s)). 28s Let i(f) = 88f2 + 52. Let p(m) = 15m. What is i(p(z))? 19800z2 + 52 Let r(x) = -19x*2 + 15 + 7x2 - 15. Let t(g) be the second derivative of g4/24 - g*2/2 - g. Let z(i) be the first derivative of t(i). Calculate r(z(k)). -12k*2 Let t(q) = -70109q. Let s(k) = -4k. What is t(s(z))? 280436z Let y(f) = 5f2. Let z(j) = -1 - 336j + 360j + 1. Determine y(z(x)). 2880x2 Let j(q) be the first derivative of -q2/2 - 1. Let b = 39 - 7. Let l(n) = bn - 17n - 14n. What is l(j(m))? -m Let g(h) be the third derivative of 223h*5/15 + 2h*2 + 4. Let l(o) = 2o*2. Give l(g(s)). 1591328s*4 Let d be 1/(-2)32/(-8). Let b(a) = 5a - 1. Let h be b(1). Let y(u) = -4u*2 + hu*2 - 4ud + u2. Let n(g) = -3g2. Calculate n(y(z)). -27z*4 Let v(j) be the third derivative of 0j*4 - 1/6j*5 + 0j*3 + 0 + 34j*2 + 0j. Let a(b) = b*2. What is a(v(t))? 100t*4 Let d(o) = -33o*2 - 34o*2 - 28o*2 + 97o*2. Let u(c) = 119c*2 + c. Calculate d(u(k)). 28322k*4 + 476k*3 + 2k2 Let f(h) be the first derivative of -h2 - 207. Let i(o) = -337o2. What is i(f(s))? -1348s2 Let w(x) be the second derivative of x5/60 + 12x2 - 9x. Let v(f) be the first derivative of w(f). Let n(i) = 24i. What is n(v(a))? 24a*2 Suppose 86 = 2h + 74. Let a(o) = -2o - ho + 18o. Let u(g) = -4g*2. Determine a(u(l)). -40l*2 Let v be (-6)/10(-9 + 1 + 3). Let z(a) = 2 + v + a - 5. Let u(o) = 6o. Determine z(u(x)). 6x Let k(w) = 3w - 10w + 25w + 11w. Let v(q) = -5q. Determine k(v(b)). -145b Let a(w) = -6w2. Let k(h) be the second derivative of -h5/15 + 13h*3/6 + 24h. Let o(s) be the second derivative of k(s). Determine o(a(z)). 48z2 Let t(v) = 5v - v*2 - 6v + v. Let g(m) = -3m - 2. Let b(j) = 12j + 9. Let r(i) = 2b(i) + 9g(i). Determine r(t(y)). 3y2 Let l(b) = -49774b2. Let z(u) = u2. Determine z(l(p)). 2477451076p4 Let w(b) = 4b. Let a(t) = -t. Let v(z) = 18a(z) + 4w(z). Let g(x) be the third derivative of -x*5/3 - 397x*2. Give g(v(r)). -80r*2 Let m(u) = -14u. Let c(k) = -18k2 + 20k - 3. Calculate m(c(a)). 252a2 - 280a + 42 Let p(h) = 2h2 + h - 4780. Let n(u) = 4u. Determine n(p(f)). 8f2 + 4f - 19120 Let w be 24(6/(-4) - -1). Let p(z) = 3z + 12. Let s be 2(15/(-30))/(-1 + 2). Let l(x) = -1. Let j(g) = sp(g) + wl(g). Let c(a) = -4a. Determine c(j(b)). 12b Let d(m) be the second derivative of -m4/3 - m - 16. Let o(c) = -3c*2. What is d(o(b))? -36b*4 Let u(g) = -3g. Let i(t) = -176t2 - 7t. Let b(l) = -181l2 - 8l. Let z(f) = 5b(f) - 6i(f). Calculate u(z(d)). -453d2 - 6d Let g(q) = 3350q. Let v(k) = 10k*2 - 9. Give g(v(b)). 33500b*2 - 30150 Let p(c) be the second derivative of 3c*3/2 + 7c*2/2 + 696c. Let x(s) = -4s. Determine p(x(q)). -36q + 7 Let k(j) be the first derivative of -10j3/3 - j + 497. Let s(z) = -5z. Determine k(s(c)). -250c2 - 1 Let s(g) = -53g*2 - 2g. Let t(z) = 237z. Calculate s(t(b)). -2976957b*2 - 474b Let q(l) be the first derivative of -l*2/2 + 146. Let t(x) be the second derivative of 0 + 0x*2 + 4x + 1/2x3. Calculate t(q(a)). -3a Let t(h) = 1900h. Let s(x) = 23x*2. Calculate s(t(g)). 83030000g*2 Let d(w) = 7w + 3. Let k(a) = -1. Let v(z) = -15z - 4. Let x(r) = -3k(r) - v(r). Let m(f) = 7d(f) - 3x(f). Let i(h) = 21h2. What is m(i(p))? 84p*2 Let i(c) be the second derivative of -6c + 0c2 + 0 + 0c*3 + 1/3c*4. Let q(m) = -m. What is i(q(b))? 4b*2 Let d(g) be the first derivative of -95 + 30g - g*2 + 49 + 45. Let l(m) = -2m. Determine d(l(u)). 4u + 30 Let x(z) = -13z*2. Let g(s) = 4s*2. Let u(i) = -7g(i) - 2x(i). Let p(j) = 29j. Calculate p(u(q)). -58q2 Let r(p) be the second derivative of -p4/6 + 5p. Let s(c) = -41c - 12. Let v(n) = 40n + 10. Let q(j) = -5s(j) - 6v(j). Give q(r(z)). 70z2 Let v(j) = -399j + 1. Let p(s) = -4s + 4. Give p(v(g)). 1596g Let k(z) = 8z2. Let v(m) = -m3 + 3m*2 + 4m. Let r be v(5). Let j be (6/15)/((-6)/r). Let i(o) = -jo + 6o - 3o. What is k(i(d))? 8d*2 Let i(y) = -3y*2. Suppose 5o - 15 = 0, 46 + 23 = 3a - o. Let u(l) = -23l + al - 5l. Calculate i(u(d)). -48d2 Let j(r) = -27r + 2. Let a(t) = -4033t2. Determine j(a(g)). 108891g*2 + 2 Let u(h) = -4h - 3. Let z(d) = 1 - 7d - 6 + 0d. Let n(c) = 2c - 5. Let j be n(4). Let q(t) = jz(t) - 5u(t). Let s(g) = 2g. Determine q(s(o)). -2o Let z(p) = 27p*2 - 4p - 4. Let d(y) = 34y2 - 5y - 5. Let x(f) = -4d(f) + 5z(f). Let l(o) = 8o - 58. Determine l(x(s)). -8s*2 - 58 Let t = 39721/60 + -662. Let n(q) be the third derivative of 0q*4 + 0 - 2q*2 + 0q - tq5 + 0q*3. Let j(f) = -6f. Calculate n(j(v)). -36v2 Let y(i) = 2i*2. Let j(b) = 225222b. Calculate j(y(a)). 450444a2 Let k(a) = -4a. Let g(n) = 4 - n*2 - 4 + 0 - n. Let q(t) = -6t*2 - 9t. Let l(h) = 9g(h) - q(h). What is k(l(i))? 12i2 Let j(p) = -p2 + 16p + 2. Let t be j(16). Let q(n) = 2n*t - 3n2 - n2. Let s(i) = -13i. What is s(q(z))? 26z*2 Let p(a) = -5a2 - a2 - 7a2 - 19a*2 + 30a*2. Let y(r) = -26r*2 - 2r. Give y(p(q)). -104q4 + 4q*2 Let c(l) be the first derivative of 11l*3 + 45. Let v(w) = 6w*2. Determine c(v(b)). 1188b4 Let g(z) be the second derivative of -z3/6 + 12z - 94. Let n(b) = -23b - 12b + 8b. What is g(n(o))? 27o Let s(k) = 0k + 5k - 2k. Let b(p) be the third derivative of 1/8p4 + 0p*3 + 23p*2 + 0p + 0. Calculate s(b(j)). 9j Let i(c) = -5c - 5821. Let d(k) = k. Give d(i(u)). -5u - 5821 Let f(i) = -3i. Let n(s) = 1373367s. Determine f(n(l)). -4120101l Let f(h) = -h*2. Let u(g) = -1. Let p(t) = -71t - 5. Let r(k) = -p(k) + 5u(k). Calculate f(r(l)). -5041l2 Let d(c) be the second derivative of -c3/6 + 48c - 1. Let y(r) = -2r - 118. What is y(d(q))? 2q - 118 Let m(d) be the second derivative of 5d*3/3 + d + 24. Let n(s) = -3s*2. Calculate m(n(r)). -30r*2 Let h(w) = 15w. Suppose 0 = 4j + j. Suppose 2g + jg = 4. Let k(i) = -4 + 3 + 1 - gi. Determine h(k(o)). -30o Let o(w) = -521w*2 - 2w. Let u(f) = 162f. Give u(o(v)). -84402v*2 - 324v Let d(p) = p. Let b(x) be the third derivative of -11x4/24 - x3/6 + 6x*2. Let m(l) = -1. Let u(j) = 2b(j) - 2m(j). Determine d(u(i)). -22i Let l(m) = -46m - 316. Let f(s) = 4s*2. Give f(l(t)). 8464t*2 + 116288t + 399424 Let j(i) be the first derivative of -i*2/2 - 61. Let w(f) = 207f*2. What is w(j(x))? 207x*2 Let z(v) = -68v*2. Let b(x) = -x - 312. Determine z(b(j)). -68j*2 - 42432j - 6619392 Let k(y) = 3y2 - 18y. Let z(c) = c. Let d(j) = -k(j) - 18z(j). Let w(f) = f + 2f + 2f + 0f. What is d(w(o))? -75o2 Let x(y) be the second derivative of -5y*4/6 + 29y**2/2	{ "pile_set_name": "DM Mathematics" }
common multiple of (1 + -2)(-3 - h) and w? 40 Let l(u) = -u3 - 6u*2 - 2u + 1. Find the common denominator of -7/9 and l(-3). 9 Suppose 3 = 5h - 7. Suppose -56 = -2p - 4a, hp - 2 = 3p - 4a. What is the lowest common multiple of 8 and p? 72 Let g(y) = 29y2 - 7y - 6. Let u(h) = h*2 - h - 1. Let v(i) = -g(i) + 6u(i). Let z be v(1). What is the least common multiple of 10 and (z/(-2))/(7/14)? 110 Let d = -36 + 28. Let t = d - -13. What is the smallest common multiple of t and 20? 20 Let c(k) = -k*2 - 10k - 2. Suppose 3 + 15 = x - 3u, 3x - 2u - 19 = 0. Suppose 33 - x = 5f. What is the lowest common multiple of c(-4) and f? 66 Suppose 0 = z + 3z. Suppose 0 = -2s - zs - 4. Find the common denominator of s/(-6) - 41/6 and 3/10. 10 Suppose 0 = 6o - 7o - 42. Let d be (3/(-6))/(3/o). Suppose -1 = v - d. Calculate the lowest common multiple of 18 and v. 18 Let n(p) = p - 10. Let r be n(9). Find the common denominator of -87/8 and ((-2)/1 - 0/r) + -42. 8 Let a(y) = -27025y*3 - 3y + 2. Let p be a(1). Let c = p - -486593/18. Find the common denominator of 45/14 and c. 126 Let k = 12654 + -4289741/339. Calculate the common denominator of k and -4/33. 3729 Suppose 12 = -4u + 92. Suppose -37 = -3i + u. Suppose 0 = 6y - 9 - 45. Calculate the smallest common multiple of y and i. 171 Suppose 3l - 3 = 33. Let c = 104 - 92. What is the lowest common multiple of c and l? 12 Suppose -7z = 23498 + 25173. Let a be (-2)/3166778/(-16). Let u = z + a. Calculate the common denominator of u and -23/10. 60 Let c be (-10)/(-35) - (-38)/14. What is the common denominator of 0 + (639/48)/c and (-3)/(-21) - 7/(196/(-102))? 112 What is the common denominator of (-448)/24(-3)/(-306) and -107/18? 306 Let q = 53 + -37. Suppose 8b + 15 = 3b, 5b = -u + 29. Suppose -3n + 76 = 4i, 4i - 40 = -5n + u. What is the least common multiple of q and i? 16 Suppose 5 = a - 0. Calculate the lowest common multiple of a and 55. 55 Suppose 3q + 0b = 5b - 8, -8 = -4q + 2b. What is the common denominator of 11/8 and (-712)/(-6)(-3 + q)/(-48)? 72 Suppose 0 = -g + 5i - 206, -3g - 442 = -i + 162. Find the common denominator of -31/58 and (g/144)/(6/8)-2. 522 Let x be (2 + (-117420)/4299)/(82/(-2)). Let d = x - -24/1433. Find the common denominator of 26/11 and d. 451 Calculate the common denominator of 41/2 and 4(-5)/150 - (-3369)/630. 14 Suppose -2p + 5p - 21 = 0. Suppose -3u = 10 - 1. What is the lowest common multiple of -1 + u + 12 + 0 and p? 56 What is the least common multiple of 21 and 8/52 + (-5 - 987/(-91))? 42 Suppose 0 = -d + 3 + 8. Suppose -5c - 20 = -0c, -5c - 35 = -5y. What is the lowest common multiple of y and d? 33 Let m be (-6)/(-9) - (-48)/9. Let j(d) = d3 - 6d*2 + 2d - 4. Let l = -6 - -14. What is the smallest common multiple of l and j(m)? 8 Suppose -10 = -29v + 27v. Let c(b) = b + 7. What is the smallest common multiple of v and c(-6)? 5 Let l be 12/(-21)59211/12. Let a = -1652 - -4467. Let p = a + l. What is the common denominator of p and 43/8? 56 Let l = -10567/1048 + -11/262. Let s = -9413/8613 + 6/319. Calculate the common denominator of l and s. 216 Let c be -4 + 2 + 1 - -5. Suppose 1 = 3t - 3s + 7, t = 2s - 2. Find the common denominator of 71/9 and c + (87/9 - t). 9 Let g = 13 - -53. Suppose -5r = 4o - g, -4r - r + 46 = -o. Suppose p = -1, 2 = -k + p + r. Calculate the smallest common multiple of 15 and k. 105 Let v(o) be the first derivative of 1/2o*2 + 4o + 1/4o4 + 6 - 7/3o3. What is the lowest common multiple of 8 and v(7)? 88 Let y(j) = j3 + j*2 - 4j - 4. Let c be y(-3). Let t(n) = n*2 - 60n + 305. What is the lowest common multiple of (-4)/c + 116/10 and t(55)? 60 Let f be 1/(-4) - 4/(-16). Suppose -5i + 2 + 13 = f. Find the common denominator of (-395)/(-15) + 2/i and -29. 1 Suppose 0w + 3w - 294 = 0. Let s = -63 + w. Calculate the common denominator of (98/s)/((-4)/(-45)) and -53/20. 20 Suppose 0 = 3m - 2z - z + 240, -5m = 5z + 370. What is the common denominator of 35/4 and (134/12)/(m/22)? 84 Suppose -1 - 71 = -w. Suppose -t = 3t + w. Find the common denominator of 143/6 and (-165)/t(-27)/120. 48 Let k = -2/15773 - -678799/4416440. Find the common denominator of k and -107/12. 840 Calculate the common denominator of -29/10 and (-108)/(-72)302/(-1926). 3210 Suppose -160 = -6u + 5u. Suppose 0 = -l - 4l - 10. Calculate the common denominator of 93/14 and l/(-5) - (-1436)/u. 56 Let l = 27895/3653738 + -4/8741. Let s = l + -20703/1672. What is the common denominator of (-7)/(-2)(-110)/(-14) and s? 8 Find the common denominator of -95/18 and 8/(-14) + ((-927260)/3360)/71. 72 Let o = -38 - -48. Calculate the least common multiple of 14 and o. 70 Calculate the smallest common multiple of 112 and 2/(-6) + (-7315)/(-57). 896 Let u = -870 - -2642/3. What is the common denominator of u and -67/46? 138 Find the common denominator of 3 + 648/(-56) + 5 and -59/112. 112 Suppose 43p + 96 = 1515. Calculate the smallest common multiple of p and 696. 7656 Suppose 3n + 9 = 33. Suppose 0 = -d, d = 2r - 3r + 8. Suppose -7m + rm - 1 = 0. Calculate the least common multiple of n and m. 8 Let s be 3 + -5 + 5 - (0 - 45). Let f = s - 15. What is the lowest common multiple of 30 and f? 330 Let q(c) = 2c - 60. Let v be q(0). Let k be -3 - ((-9880893)/v)/(-9). Let g = 18291 - k. What is the common denominator of g and 51/10? 20 Let h = -136868 - -22172731/162. What is the common denominator of -55/54 and h? 162 Let q(f) = -f3 + 5f*3 - 4f3 + 7 - f3 + 7f - 5f*2. Let k be q(-6). Calculate the common denominator of k/(-4)1139/(-85) and -13/14. 140 Suppose 3n - 108 = 2n. Let l be (n/(-95))/((-16)/(-120)). Let u = l + 1219/114. What is the common denominator of u and 11/10? 30 Let x = 2/259305 - 5099749/10890810. Calculate the common denominator of x and -11/90. 630 Let h(y) = 6y2 - 5y + 5. Let x be h(15). Let o = 3872/3 - x. What is the common denominator of 8/3 and o? 3 Let w = 20 + -12. Let d(b) = -4b - 18. Suppose -v - 11 = 2p, 4p = v - p + 4. What is the lowest common multiple of w and d(v)? 72 Suppose 0 = o + 5 - 3. Let t be (o - -3)/((-1)/(-2)). Suppose -tr + 10 = -8. Calculate the smallest common multiple of r and 10. 90 Suppose u - 4u = -t - 1, 27 = t + 4u. Calculate the common denominator of (t/220)/(2/(-365)) and 57/66(-2 - 0). 88 Let t(b) = -b2 + 12b - 16. Let j be t(10). Suppose -ju = 2o - 48, 34 = 2o + 5u - 18. What is the lowest common multiple of 62 and o? 496 Let q = 17 - 56. Let k = -27 - q. What is the least common multiple of k and 20? 60 Suppose 0 = -2k - c + 35, 9k - 5k - 55 = -5c. What is the least common multiple of 12 and k? 60 Let y = 163 + -159. Suppose 0 = -yq + 5 + 15. Calculate the lowest common multiple of 3 and q. 15 Suppose -3n + 515 = 2s + 3s, 2n + 4s - 342 = 0. Calculate the common denominator of 20/(-6)n/(-84) and 85/54. 54 Calculate the smallest common multiple of 9 and ((-5)/(15/(-4)))/((-32)/(-3840)). 1440 Let w = -31 - -57. Calculate the least common multiple of 18 and (-13)/w + 79/2. 234 Let q = -1232746/49 + 25159. Calculate the common denominator of -30/11 and q. 539 Suppose -3u + u + 4 = 0. Suppose 5a - 3r = -ur + 20, 0 = -3r. Suppose 6 + 2 = al. What is the smallest common multiple of l and 1? 2 Suppose 2g = 3b - 19, 3g - 5b + 21 = -2b. Let x = g - -6. What is the lowest common multiple of x and (1/2)/((-4)/(-64))? 8 What is the common denominator of 11/24 and (-145)/(-24) + (-11 - -1)? 24 Let j = -5 - -7. Suppose 0 = -0s + 4s + 5u - 32, -3u + 12 = 0. Calculate the smallest common multiple of -1s8/(-1) and j. 24 Suppose 6 = -s - 2s, 3s = 2z + 2. What is the common denominator of -119/10 and 37/10 + -4z/8? 10 Suppose 3z = z + 20. Let k be (-8)/68 + 2/17. Suppose -6n = -k*n - 60. What is the least common multiple of n and z? 10 Let l = 4/4709 - 113156/164815. Calculate the common denominator of -53/100 and l. 700 Let g = 2385/22 - 514837/198. Let k = -2498 - g. Find the common denominator of -17/9 and k. 9 Let v = 16345 - 82312/5. Let u = v + 1649/10. Let z = 3/4 - 13/4. Calculate the common denominator of u and z. 2 Let k = -40/13 - -229/104. Let u be (1/(-12))/((-8)/90). Let v =	{ "pile_set_name": "DM Mathematics" }
582 = -3217. Which is bigger: i or 2/19? 2/19 Let d(f) = 5f2 - 3f - 69. Let q(r) = -3r2 + 35. Let t(v) = 4d(v) + 7q(v). Let b be t(-6). Does -1 = b? False Let f(m) = 2m*2 - 20m + 23. Let b be f(7). Let r = b + 10. Is -38/5 bigger than r? True Suppose -6k = -497 + 191. Let u(l) = -161l - 1407. Let r be u(-9). Do r and k have the same value? False Let m(k) = -38 + 4k + 8 + 2 + 19 - 6k. Suppose 4 - 1 = -o. Let v be m(o). Which is bigger: -2 or v? -2 Let j be 192/80 - (-6)/(-15). Let q be -8 + 7 + (-1)/j + 1. Is q less than or equal to 172? True Suppose -23w - 103w + 8w - 10266 = 0. Are w and -262/3 nonequal? True Let g be 8/(-36) + (-442430)/(-765) - 8/68. Which is bigger: g or 589? 589 Let c(o) = o2 - 62o + 26. Let m be c(77). Are m and 1181 unequal? False Let p(v) = v*3 + 5v*2 + 12v + 60. Let y be p(-5). Let x = y + 0. Let j = -64/15 - -583/105. Which is bigger: j or x? j Suppose m = 3m. Let l = 1899.1 - 1775. Let z = -126 + l. Is z less than or equal to m? True Suppose -2t - 5r = 3 - 6, 51 = 5t - 2r. Suppose -4x - 19 = -v, 0 = 3x - 7x + 2v - 18. Is x greater than or equal to t? False Let q be ((-108)/63)/((-9)/1344). Is q bigger than 1541/6? False Let j = 1627 + -1616. Which is smaller: 4/21 or j? 4/21 Suppose 3g = 3c - 216 - 384, 4c = -5g + 827. Let p = c + -188. Which is smaller: 16 or p? p Let f(a) = -4a*3 - 97a*2 - 22a + 57. Let r be f(-24). Suppose -3z - 2z = 5u + 35, 0 = -4z + 12. Which is smaller: u or r? u Let t = 1063759/56190 - -7/3746. Which is greater: 19 or t? 19 Let s be (-3)/(5/(-360)4). Suppose sy - 39y = 0. Are 6/185 and y nonequal? True Let u = -10 + -117. Let t = u - -132. Let k be 0 + 2 - (-5)/(-5). Is k less than or equal to t? True Let g = 1506/5 + -21087/70. Let x = g - -173/770. Which is greater: 2 or x? 2 Let o = 52 - 71. Let l(g) = g3 + 18g*2 - 17g + 33. Let h be l(o). Let b be h/(-10) - 471/918. Are 0 and b equal? False Let m = 14/73 - 34709/180602. Which is smaller: m or 0? m Let a be ((-4 - -2) + 3)(-7 - 0 - -6). Is a less than or equal to 14/249? True Let c = 607 - 606. Let f be -3 + 6(1 - 0). Let q be (f/9)/(38/(-6)). Do c and q have the same value? False Let k be 11/(22/(-3))-122. Suppose 0 = -3h + 2r + 183, -8h = -5h - 3r - k. Suppose 2v = -19 + 141. Is v > h? False Suppose -4n = -3p - 19, -n - 3 = -2n - p. Suppose -127 = nb + 25. Let d = -5 - b. Are 33 and d equal? True Suppose -i - i = 0. Suppose -2y = -2f - 272 + 1192, -2y - 2f - 924 = 0. Let o = -26737/58 - y. Is i equal to o? False Suppose 0i = -2i + 8. Suppose 88 = ij - 0j. Suppose -jt = -23t + 1. Is 1/6 != t? True Let s(c) = -c3 + 14c*2 + 31c + 29. Let y be s(16). Let w(f) = f*2 - f - 4. Let d be w(6). Suppose -du = -31u + 55. Is y less than u? False Let r(j) = j3 + 22j*2 - j - 12. Let w be r(-22). Suppose 6p - 4 = -w. Let b(q) = 39q2 - 2q - 2. Let l be b(p). Which is smaller: l or 40? l Let g = 137042 + -136971. Let d = -93 + 162. Which is greater: g or d? g Suppose 228 = 19r - 17r. Suppose 0c + c = 0, -s - 2c = 0. Let m be (3 - (2 + s)) + r/(-54). Is -2 > m? False Let p be (-7 + 5/((-15)/(-19)))/(2/(-11823)). Is p greater than -1/4? True Let j = -1630346 + 130276057824/79907. Which is smaller: j or -1? -1 Let u be -7 - -11 - (-2786)/(-5). Suppose -2245 = -5t + 510. Let g = t + u. Is -3 at least g? False Let i = 2432 + -2456. Let g = -74 + 76. Does g = i? False Let s = -3 - -3.1. Let v = -6045.58 + 6045.8. Which is smaller: v or s? s Let l = 24403 - 24499. Are -110 and l nonequal? True Let u(b) = -612b - 6119. Let g be u(-10). Let d = -0.0859 + -0.4251. Which is bigger: g or d? g Let w = -2600 + 2559.2. Let u = 47 - 0. Let v = w + u. Which is smaller: v or 0.1? 0.1 Suppose 31q - 73q + 714 = 0. Is 26 less than q? False Let l(d) = d*3 + 7d*2 - 10d - 41. Let s = -724 + 716. Let q be l(s). Which is bigger: -7 or q? -7 Let g = 7 - -2. Suppose -59n + 44 + 263 + 342 = 0. Does g = n? False Suppose 46057 = -194n - 96727. Is n at least -735? False Let o be (-20)/(-8)(768/(-90) - -8)7818. Is o at most as big as -10424? True Let r = -31 - -41. Suppose s = 2o - r, 2o - 3s - 9 = 3o. Let y be 0/(1/(-3)o). Do 1/54 and y have the same value? False Let q be (-47)/9 + 4/18. Suppose 123t - 18 = 120t. Suppose 2n + 8 = t. Is n > q? True Let q be (392/(-16) + -7)4/(-3). Let b be (93)/(21/q). Which is smaller: b or 50? 50 Suppose -113 = 3x + 4n - 435, 5x - 532 = -2n. Let m(k) = -101k - k2 - 1 + xk + 1. Let r be m(5). Is 33 greater than r? True Let b(n) = -n*3 + 24n*2 - 5n - 4. Let j be b(24). Which is greater: j or -371/3? -371/3 Suppose 10 = -5v + 5m, -2m - 5 + 7 = 0. Let y be v + (-1)/2 + (-147)/2. Which is bigger: -71 or y? -71 Let d(n) = n3 + 5n*2 - n + 11. Let t be d(-5). Let f be t/(-12)39 + -4. Suppose y = -5g - 57, -5y + 2g - 171 = -2y. Is y smaller than f? True Let d = 1/29306 + -117827/17671518. Is d at most as big as -1? False Let d = -261 + 379. Let i = d - 21. Is i less than -2/3? False Let k be 42/11 - 6/(-33). Let b be -3 + (609 - -3)/k. Suppose -9w - b + 6 = 0. Are w and -14 equal? False Suppose -51g + 76 = 25. Do g and -1/17 have the same value? False Let w = 51 - 55. Let q = 56 - w. Let i be (-1 - -1) + 255/q. Which is smaller: 4 or i? 4 Let r be (-65)/(-25) - (-4)/10. Suppose g + 172 = d, -rg = 30d - 31d + 514. Is -170 smaller than g? False Let h be (-16)/6 - (-6)/(-18). Let p = -122 - -490. Let t be h/2p/(-69). Which is smaller: -2/3 or t? -2/3 Suppose -42 = 3p + 3y, 2y = 5p + 4 + 31. Let d be ((-18)/4)/(-53/(-150)). Let l be (-18)/d - 37/5. Which is smaller: p or l? p Suppose 30j + 67 = -15 - 68. Which is smaller: j or 1/768? j Let o = -2/125 + -1986/875. Suppose 0c = 7c. Let m be -3 + (2 - (1 - c)). Which is bigger: o or m? m Suppose -23a = -5u - 20a, 0 = 2u + u + 4a. Is u greater than or equal to -51/304? True Suppose -12x + 10 = -302. Suppose -1440 = -31a + xa. Suppose -5o + 11o = -a. Are o and -47 non-equal? True Suppose 0 = 7j + 465 + 627. Let c be (-6)/305(-1 + j/(-36)). Which is smaller: -1 or c? -1 Suppose -5t - 2y - 63282 - 22368 = 0, -4t = 2y + 68522. Which is smaller: t or -17127? t Let y be (3 - (-75)/(-27))/(-3). Let f = -17/135 + y. Let s = 15746 - 15759. Which is greater: f or s? f Suppose 2y - 13 - 10 = -5b, b - 28 = -3y. Suppose ym + 1032 = 141. Which is smaller: m or -94? m Let w = 2183 + -1035. Let u be 7/(w/(-12))(-40)/(-6). Which is greater: u or -1? u Let l be 2 - (-120)/(-256)1014/240. Is l at most -1? False Suppose -5d + 0 + 20 = 0. Let b = 2013 - 2044. Which is bigger: d or b? d Let n be ((-4)/158)/((-10)/(-5)). Suppose 0 = -2b - b + 12b. Which is bigger: b or n? b Let c be 2323/138 + -3 + (-38)/(-12). Which is greater: 21 or c? 21 Suppose 1559 = 3b - 5i, -17i = -13i - 8. Let w = b - 461. Is 61 at most as big as w? True Let s = 9 + -29. Let l = 25 + s. Suppose 0f + 9 = -2f - 5u, 0 = -lf - 3u - 13. Which is bigger: -1 or f? -1 Let q = 5654179/26 + -217434. Which is smaller: q or 33? 33 Let j be 48/506 - 3/345-10. Which is smaller: j or 359? j Let x(w) be the third derivative of 5w*4/12 + 10w*3/3 + 18w*2 + 2w. Let q be x(0). Is q smaller than 8? False Let r = 1725 + -8657/5. Let o(d) = -d*2 + 6530d - 6530d + 18. Let i be o(5). Which is smaller: i or r? i Let s = -297 - -317. Let x be ((-16)/s-1)/(582/(-15)). Which is bigger: x or 1? 1 Let t be (-2)/(-3) + (-10)/(-3). Suppose 4j - 21 = -m + 3, 0 = -2m - 4j + 64. Suppose -m = -c - 34. Do t and c have the same value? False Let q = 2617 + -2841. Does q = 7? False Suppose 19x + 844 = 4i + 15x, 0 = 5i + 5x - 1005. Which is bigger: i or 208? 208 Let r(i) = i*2 + 67i - 7435. Let d be r(-126). Is d greater than or equal to 54/293? False Suppose -5y = -f - 16, -4f - 23y + 11 = -18y. Which is bigger: -12 or f? f Let u be (166/(-249))/(72/23 + -3). Let o be 5/(-2)(-6)/(-3). Is o at least as big as u? True Let l = -26811 - -201377422/7511. Is 1 greater than l? True Let t = 88327 - 1413235/16. Let w(j) = -j3 - 5j*2 - 5j + 1. Let p be w(-4). Suppose -3s = 2i + 2 - 1, p*i - s - 6 = 0. Which is smaller: t or i? t Let c = 1730 + 620. Which is smaller: 2349 or c? 2349 Let v	{ "pile_set_name": "DM Mathematics" }
h4 + 5h*4 + oh*3 - 4. -2(h - 1)*2(h + 1)*3 Let v(w) be the first derivative of 0w*2 + 1/39w*6 - 30 + 6/13w*4 + 12/65w*5 + 0w + 16/39w3. Factor v(u). 2u*2(u + 2)*3/13 Let q(u) be the third derivative of 0 - 2/45u*5 + 0u + 8u2 - 2/9u*3 - 17/108u*4. Factor q(h). -2(3h + 2)(4h + 3)/9 Let y(p) be the first derivative of 0p*3 + 1/18p*4 + 30 + 0p + 1/27p6 + 0p*2 + 4/45p*5. Suppose y(u) = 0. What is u? -1, 0 Determine w so that -351/8 - 159/4w*2 - 153/2w - 3/8w4 - 15/2w3 = 0. -13, -3, -1 Let x(g) be the first derivative of -g6/30 + 3g4/20 - 2g*3/15 - 9. Suppose x(n) = 0. What is n? -2, 0, 1 Find n, given that 135n*2 - 348n*3 + 256n*4 - 91n*2 - 9n*5 + 5n*5 - 40n*5 - 116n*2 = 0. -2/11, 0, 3 Let d(w) be the second derivative of -2/21w*4 - 1/3w*6 + 0 - 11/35w*5 - 25/294w*7 + 13w + 0w2 + 0w3. Factor d(i). -i2(i + 2)(5i + 2)2/7 Suppose 3p - 4v = 18, 2p - p = 4v + 14. Let i(r) be the first derivative of -pr*2 + 11/9r*3 - 1/4r*4 + 9 + 4/3r. Find m, given that i(m) = 0. 2/3, 1, 2 Let d(v) be the first derivative of -34 + 8/13v2 + 8/13v*3 + 0v - 23/13v4 - 7/39v*6 + 66/65v*5. Let d(i) = 0. Calculate i. -2/7, 0, 1, 2 Let c(m) = -5m*2 - 31m + 90. Let n(q) = 70q2 + 435q - 1260. Let i(y) = 55c(y) + 4n(y). Factor i(r). 5(r - 2)(r + 9) Suppose 110z3 + 133z - 57z + 25z*4 + 41z*2 - 72z = 0. What is z? -4, -1/5, 0 Let y(a) = -a*3 - 29a*2 + 6a + 176. Let g be y(-29). Let i(z) be the first derivative of z*4 - 7/8z*g + 1 + 2/3z*3 + 1/4z. Let i(k) = 0. What is k? -1, 1/4 Let l = -1141 - -17117/15. Let p(c) be the first derivative of 0c2 - 2/3c*3 - lc*5 - 2/3c*4 + 0c + 6. Determine w, given that p(w) = 0. -3, -1, 0 Determine t, given that -2/7t5 + 0 + 0t + 8/7t3 + 4/7t*2 - 1/7t*4 = 0. -2, -1/2, 0, 2 Let v = 82 - 85. Let f be ((-1)/4)/(v/4). Factor -1/6 - fl - 1/6l2. -(l + 1)2/6 Let v(k) be the second derivative of -k9/756 - 7k*3/6 + 8k. Let p(b) be the second derivative of v(b). Find q, given that p(q) = 0. 0 Let o(t) be the second derivative of 2/135t6 + 15t - 2/27t3 + 1/45t*5 + 0t*2 + 0 - 1/27t*4. Find n, given that o(n) = 0. -1, 0, 1 Suppose -2v = -2u - 30, 3v + 4u = 83 - 59. Determine x, given that 36/7x*3 + 64/7x + vx2 + 16/7 = 0. -1, -2/3 Let v(g) = 5g*3 + 180g*2 - 1955g + 6865. Let c(o) = 7o3 + 181o*2 - 1954o + 6866. Let w(r) = -5c(r) + 6v(r). Let w(s) = 0. What is s? 7, 14 Let k(g) be the third derivative of 11g7/3780 + g6/81 + 7g5/540 - g4/54 + g*3/6 + 31g*2. Let c(b) be the first derivative of k(b). Factor c(q). 2(q + 1)*2(11q - 2)/9 Let s(h) be the first derivative of -h8/560 + h7/840 + h6/40 + h5/40 - h4/12 - 29h*3/3 + 9. Let j(k) be the third derivative of s(k). Factor j(d). -(d - 2)(d + 1)*2(3d - 1) Factor -12/5 - 6/5s + 16/15s2 - 2/15s*3. -2(s - 6)(s - 3)(s + 1)/15 Let x(i) = 4i3 + 9i*2 + 12i + 7. Let y(h) = 12h3 + 28h*2 + 36h + 20. Let z(w) = -8x(w) + 3y(w). Factor z(c). 4(c + 1)3 Suppose 0 = -t + 3t - f, 3t - 10 = -f. Let n = 84 - 82. Factor 3c*t - 10c*2 + 3c*n. -4c*2 Let i(b) = -2b - 3. Let a be i(-3). Factor 0ha - 4h*3 + 28h*5 - 24h*5. 4h*3(h - 1)(h + 1) Let k(u) be the first derivative of -7921u*3/3 - 89u*2 - u + 50. Find j, given that k(j) = 0. -1/89 Let g(p) be the first derivative of -8p + 4/3p3 - 4 + 2p*2. Factor g(d). 4(d - 1)(d + 2) Let x(z) = z3 + 9z*2 + 10z. Suppose 0 = 2u - 8u + 30. Let h(a) = 3a3 + 19a*2 + 21a. Let o(i) = ux(i) - 2h(i). Factor o(v). -v(v - 8)(v + 1) Solve 2h - 10h*3 + 9h*3 + 3h*3 + 14h - 18h2 = 0 for h. 0, 1, 8 Let g = -40895/3 + 13632. Factor -f - gf*2 + 0. -f(f + 3)/3 Suppose -n + 5g + 36 = -17, -3g - 144 = -4n. Let j be 6/33 - (-93)/n. Factor -a3 + 16a*2 + 12a + 17a3 - 12a*j. 4a(a + 1)(a + 3) Let f(z) be the third derivative of -7z7/165 + 7z*6/30 - 59z*5/110 + 2z*4/3 - 16z*3/33 + 3z*2 + 33z. Factor f(m). -2(m - 1)2(7m - 4)2/11 Let u be 2/14(-2842)/(-1015). Find m such that 0 + 0m + um*3 - 2/3m*4 + 4/15m*2 = 0. -2/5, 0, 1 Let p(x) be the first derivative of 2x*3/21 + 40x*2/7 - 258x/7 - 118. Determine r, given that p(r) = 0. -43, 3 Let p be (-4)/(-8) + -1 + 1404/504. Determine q, given that -2q3 + p - 52/7q*2 - 40/7q = 0. -2, 2/7 Let r(m) be the third derivative of m*6/30 - 13m*5/15 - 7m*4/3 + 55m*2 - 1. Factor r(o). 4o(o - 14)(o + 1) Let y be 414/99 - (1 + 18/(-22)). Suppose -2d - y = -10. Factor 8/3i + 1/3id + 4/3 + 5/3i*2. (i + 1)(i + 2)*2/3 Let n(c) be the first derivative of -1/6c*3 + 28 - 7/2c + 2c2. Factor n(t). -(t - 7)(t - 1)/2 Let k(d) be the first derivative of -d3/15 - 121. Solve k(z) = 0 for z. 0 Let c(d) be the third derivative of d6/96 - d*5/6 + 95d*4/96 - 5d*3/2 - 44d*2 - 2d. Solve c(s) = 0 for s. 1, 3, 4 Let v(u) be the second derivative of -u*7/210 + 13u*6/150 - 29u*5/50 + 53u*4/30 - 17u*3/6 + 5u*2/2 + 19u - 3. Factor v(h). -(h - 5)*2(h - 1)*3/5 Let n be -3(-4)/18-3. Let o be (7 - (-2 - n)) + -3. Determine p so that p + 48p*3 - 45p*3 + op - 3 + 4p - 9p2 = 0. 1 Let g(a) be the third derivative of a9/14400 + a8/2800 - a7/2100 - a*5/12 + 30a*2. Let m(b) be the third derivative of g(b). Factor m(d). 3d(d + 2)(7d - 2)/5 Suppose 25c - 5 - 2 - 43 = 0. Factor 1/2w5 + cw - 6w2 - 3w*4 + 0 + 13/2w*3. w(w - 2)*2(w - 1)*2/2 Let 1/2c*4 + 0 + 3/2c*2 + 0c - 2c3 = 0. What is c? 0, 1, 3 Let g(w) = w2 + w. Let n(r) = -2r*2 + r + 3. Let a be (-1)/(1 - (-1)/(-2)). Let k be 1/(3 - (a - -6)). Let s(u) = kn(u) + g(u). Factor s(q). 3(q - 1)(q + 1) Factor -1596l3 + 387258l*2 - 9961l*4 + 9964l*4 - 68856l*2 - 28231644l + 938702163. 3(l - 133)4 Let d(x) be the second derivative of x6/90 + x5/10 - 5x*4/12 + 4x*3/9 - 60x. Factor d(f). f(f - 1)2(f + 8)/3 Let l be 5/(0 - (0 + 195/(-6))). Find d such that 0 + 0d + 0d*3 + 0d*2 - ld*4 - 2/13d*5 = 0. -1, 0 Let t be (5 + -2 - 1) + -3. Let f(k) = -k + 2. Let i be f(t). Find d, given that 1/2d*i + 1/2d - d2 + 0 = 0. 0, 1 Let j(a) be the second derivative of a7/84 - a6/24 - a5/10 + 17a4/48 - a3/4 - a - 39. Suppose j(g) = 0. What is g? -2, 0, 1/2, 1, 3 Let i(y) = 4y - 12. Let o be i(6). Let w = -9 + o. Factor 4d - 6 + 6d*2 + 3d*4 - w + 3d - 12d3 + 5d. 3(d - 3)(d - 1)*2(d + 1) Let w(h) be the second derivative of -h*8/84 - 4h*7/105 + 2h5/15 + h4/6 + h*2/2 + 6h. Let p(m) be the first derivative of w(m). Factor p(j). -4j(j - 1)(j + 1)3 Let b = -652 + 9782/15. Let d(x) be the third derivative of -1/6x*6 + 0x - 2/15x5 + 0 + 0x*3 + bx*7 + 4x*2 + 0x*4. Factor d(n). 4n*2(n - 1)(7n + 2) Let c = 33 - 23. Let t = 111 + -48. Find u such that 7 + 108u3 - 9u*2 - c - 33u - tu2 = 0. -1/6, 1 Let b = 26 - 18. Let n = -5 - -8. Factor 6 - z - 4z + nz2 - bz + 4z. 3(z - 2)(z - 1) Let p(f) = f3 - 8f*2 + 10f + 8. Let u be p(6). Let t = 4 + u. Solve 8/9l3 - 8/9l*2 + tl - 2/9l4 + 0 = 0. 0, 2 Let y(z) be the first derivative of -z3 - 117z*2/2 - 114z + 155. Suppose y(f) = 0. What is f? -38, -1 Let q = 1/2189 + 8749/15323. Factor qd - 2/7d*2 - 2/7. -2(d - 1)*2/7 Let o = 1584 + -4747/3. Determine x, given that -5/3x - 10/3 + ox2 = 0. -1, 2 Let m = -51126 + 153382/3. What is b in -4/3b - mb2 + 1/3b*4 + 1/3b*3 + 0 = 0? -2, -1, 0, 2 Let g be ((-6)/7)/((-24)/112). Let a(v) be the third derivative of 0v - 1/140v5 + 0 + 1/21v*g - 2v*2 - 2/21v*3. Factor a(n). -(n - 2)(3n - 2)/7 Let s(f) be the first derivative of 1/6f*3 - 1/2f - 8 + 3/8f2. Find v, given that s(v) = 0. -2, 1/2 Let t(c) be the first derivative of -c6/120 + c4/48 + 4c - 14. Let r(d) be the first derivative of t(d). Find q such that r(q) = 0. -1, 0, 1 Let c(q) be the second derivative of -q*4/2 + 11q*3/6 - 7q*2/2 - 17q. Let n(a) = -6a2 + 10a - 8. Let x(y) = -4c(y) + 3n(y). Factor x(d). 2(d - 2)(3d - 1) Factor 12/5 - 7/5j*2 + 8j. -(j - 6)(7j + 2)/5 Let p(s) = -137*s -	{ "pile_set_name": "DM Mathematics" }
ps? -0.009 Suppose -t = -4t + 21. Let u be t + (1 + 0 - 3). Let w(z) = z3 - 3z*2 + 5z - 6. Let m be w(u). What is m rounded to the nearest ten? 70 Suppose 5p + 4h - 2 = -21, 5h = 5p + 55. Let j be 51802/p + (-18)/(-63). Round j to the nearest one thousand. -7000 Let q = -70882523 - -70882134.000159. Let s = -389 - q. What is s rounded to five dps? -0.00016 Let o = -329 - -215.3. Let t = 129 + o. Round t to zero dps. 15 Let k = 10.2 - 10.200001. What is k rounded to five dps? 0 Suppose 20109 = 4h - 5h - 3i, -4h - 80409 = 3i. What is h rounded to the nearest one thousand? -20000 Let t(h) be the second derivative of 3/2h*2 - 4/3h*3 + 0 + h. Let i be t(-5). What is i rounded to the nearest ten? 40 Let c = -42 - 31. Let r = -90.5788 - -17.6878. Let j = c - r. Round j to 2 decimal places. -0.11 Let d = -17.3 - -0.3. Let q = 13.8 + d. What is q rounded to the nearest integer? -3 Let w be (-4257)/21 + 4/(-14). Let s = 371 + w. Suppose -t + s + 237 = k, -3k + 415 = t. Round t to the nearest 100. 400 Let a = -66 + 66.37. Let x = 0.07 - a. Let i = x + 0.299984. What is i rounded to 5 dps? -0.00002 Let s(k) = -11k2 + 13k - 16. Let c be s(14). Round c to the nearest one hundred. -2000 Let g = 6.96 - -0.94. Round g to zero decimal places. 8 Let v = 42 - 27. Let n = v - 14.99989. What is n rounded to 4 dps? 0.0001 Let p = 1431967.9777 - 1432249. Let w = 281 + p. Round w to 3 dps. -0.022 Let g be 22/(-2 - 0)7. Let o be g/(-14)(-5 - -1). What is o rounded to the nearest 10? -20 Let a = -97 + 146.4. What is a rounded to the nearest 10? 50 Let p = 0.3000004 - 0.3. Round p to 6 decimal places. 0 Let s = -0.14 + -0.124. Let l = s - -0.2639843. Round l to 6 decimal places. -0.000016 Let s = -11347.60052 + 11349. Let u = s + -1.4. Round u to four decimal places. -0.0005 Let z = 0.058631 - 0.028922. Let s = 7.029789 - z. Let h = 7 - s. Round h to 4 dps. -0.0001 Let x be (-2 - -8)-1 - -2. Suppose -4i - 116 = 4b, 2b - b = 2i - 23. Let k = x - b. Round k to the nearest 10. 20 Suppose 3u + 175 = 2d, -5d + 8u + 425 = 3u. Round d to the nearest 100. 100 Let z be 10/(-20) + 250475/(-2). Let o = z - -213238. What is o rounded to the nearest 10000? 90000 Let j = 165.0103 + -165. Round j to 3 dps. 0.01 Let o = -277926 - -277923.20062. Let r = -17.2 - -20. Let f = o + r. What is f rounded to 4 decimal places? 0.0006 Suppose -f + 6 - 1 = 0. Suppose -fy = -1 + 16, 3j + 870009 = -3y. Round j to the nearest 100000. -300000 Let c = 10 + -6. Let h = -4.25 + c. Let u = h + 0.249932. What is u rounded to 5 decimal places? -0.00007 Let p = 49417.9991 - 48684.7. Let j = p - 733. Let q = 0.3 - j. Round q to 3 dps. 0.001 Let l = -425 - -1585. What is l rounded to the nearest 100? 1200 Let s = 2868624 - 28868624. What is s rounded to the nearest one million? -26000000 Suppose 10441 = -2a + 4m + 34223, -4a - 3m = -47586. Suppose -5x = 43105 + a. What is x rounded to the nearest one thousand? -11000 Let t = -10 + 15. Let n be 0 + 3 + 3/(-3). Let o be 1 + 119997/(t - n). What is o rounded to the nearest 100000? 0 Suppose 6k = 4k. Suppose k = -5b + 5o - 820, -2o - 468 = 3b + o. What is b rounded to the nearest one hundred? -200 Let z = -4332 + 18332. Round z to the nearest 1000. 14000 Let o = 73 + 544. Suppose -o - 45169 = -2u. Suppose 15907 + u = 4b. Round b to the nearest one thousand. 10000 Suppose 327901 - 3057901 = -3v. Round v to the nearest one hundred thousand. 900000 Let i = 1.61 - 0.01. Let w = 0.605 - 2.26. Let f = i + w. What is f rounded to 2 decimal places? -0.06 Let o = -1 + 0. Let x = o + 1.001. Let p = x + 0.056. What is p rounded to 2 dps? 0.06 Let a = 216168.0899955 + -216168. Let q = -0.09 + a. Round q to six decimal places. -0.000005 Let a be (86875/4)/((-641)/640 - -1). What is a rounded to the nearest 1000000? -14000000 Let v = 266008 + -632008. What is v rounded to the nearest 10000? -370000 Let n = 14656 + -6656. Round n to the nearest 1000. 8000 Let j = 475199 + -475201.129438. Let m = j + -103.879862. Let a = -106 - m. What is a rounded to 3 decimal places? 0.009 Suppose 2k + 41 - 475 = 0. Let d = -987 + k. Round d to the nearest 100. -800 Suppose -2s - 3s + 14 = -3i, -s + 6 = i. Suppose iv - 9983904 = -0v. Let g = 2591952 - v. Round g to the nearest one million. -2000000 Let h = 0.084697 + -0.182883. Let l = -0.098 - h. What is l rounded to five decimal places? 0.00019 Suppose -4920006 = 4l + 2p, 5l + 4919985 = l + 5p. Round l to the nearest 100000. -1200000 Suppose -5v + 67 = 27. Let s be (12/v)/(6/1000). What is s rounded to the nearest one hundred? 300 Let w = -0.05 + 0.1. Let x = -0.032 + w. What is x rounded to two dps? 0.02 Let j = 1.76 - 0.16. Let y = -7.6 + j. Let m = -5.999988 - y. What is m rounded to five dps? 0.00001 Let a = -18.956 + 41.947. Let v = 0.12 - -22.88. Let d = a - v. What is d rounded to 2 decimal places? -0.01 Suppose 5f = 3f. Suppose f = -2h - 0 - 6. Let g be -1340000(h + (-14)/(-4)). Round g to the nearest 100000. -700000 Let s = 59.6155 - -0.0845. Round s to the nearest ten. 60 Let a = 0.5299959 + -0.53. Round a to six dps. -0.000004 Suppose 0 = w + w - g + 68795, 68820 = -2w - 4g. What is w rounded to the nearest 1000? -34000 Suppose -2b = 3b - 50. Let a = 2 - b. What is a rounded to the nearest ten? -10 Let j be 232277 + (6/(-2) - -2). Let y = 12567 + j. Let n = y - 95843. Round n to the nearest ten thousand. 150000 Let q = -0.53 + -0.17. Let g = 0.6999961 + q. What is g rounded to six dps? -0.000004 Let y = 1.61 - -31.99. Let h = -3.4 - y. Let j = h - -48.5. What is j rounded to the nearest integer? 12 Let f = 216 - 216.00161. What is f rounded to 4 dps? -0.0016 Let p = 0.01 + -0.1. Let y = p + 0.57. What is y rounded to 1 dp? 0.5 Let f = -6 + 5.7. Let u = -0.29 - f. What is u rounded to 2 decimal places? 0.01 Let m(o) = 23332o2 + 3o + 3. Let p be (1 - 2)3-1. Let y be m(p). Round y to the nearest one hundred thousand. 200000 Let m = 5 - 3. Suppose -mb = -0b. Suppose b = 5l - 135 - 865. What is l rounded to the nearest one thousand? 0 Let p(y) = 564y + 16. Let x be p(6). Round x to the nearest 1000. 3000 Let l = -3678 + 7278. What is l rounded to the nearest one thousand? 4000 Let v = 48 - 47.879. Round v to two dps. 0.12 Let p(v) = 25v2 + 34v - 25. Let a(r) = -12r2 - 17r + 13. Let s(c) = -7a(c) - 3p(c). Let u be s(11). What is u rounded to the nearest one hundred? 1300 Let c = -0.23 + 0.484. Let g = 0.23 - -0.05. Let s = g - c. What is s rounded to two decimal places? 0.03 Let h = -576 + 576.00714. What is h rounded to three decimal places? 0.007 Let j = -10 - -15. Suppose 2q - j + 1 = 0. Let l(o) = -89o3 + o2 - 2o + 2. Let f be l(q). What is f rounded to the nearest 100? -700 Let q be 1 - 0 - (-10)/2. Suppose 24 = -ql + 2l. Let r(b) = 14b*3 - 4b*2 + 6b + 4. Let z be r(l). Round z to the nearest one thousand. -3000 Let n = -77.4 - 14.6. Let l = 92.000049 + n. Round l to 5 decimal places. 0.00005 Let l = -0.51 + 0.58. What is l rounded to two decimal places? 0.07 Suppose 0 = -2b - 400 - 5340. Round b to the nearest 100. -2900 Let c = -3 + 3. Suppose -5 = -5q - cq. Let g be 39 + (0 - (0 + q)). Round g to the nearest 10. 40 Let i = 2.88 - 2.9371. Round i to 2 decimal places. -0.06 Suppose 5z + 5i + 40799995 = z, 3i = -2z - 20399997. Round z to the nearest 1000000. -10000000 Let s be 8/26/(-8). Let m(q) be the third derivative of -5q4/12 + q3/3 - 15q*2. Let b be m(s). Round b to the nearest ten. 30 Let x = -16 + 16.00115. Round x to four dps. 0.0012 Let b = 0.6038 + -0.6. What is b rounded to 3 dps? 0.004 Let i(x) = 982x*2 + x - 6. Let m be i(-7). Let n = m - 33605. What is n rounded to the nearest 1000? 15000 Let c = -4.80013361 - -73.80013463. Let f = -157 - -88. Let s = c + f. What is s rounded to seven dps? 0.000001 Let d = 213 + -213.143. Let q = d - -0.07. What is q rounded to 2 decimal places? -0.07 Let h = -3.96 - -4. Let c = -0.032 + h. Round c to two decimal places. 0.01 Let r = 180 + -180.189. Let u = -7.911 + r. Round u to 0 decimal places. -8 Let m = 56 - 55.73. Let x = 5 + -5.08. Let n = m + x. What is n rounded to 1 decimal place? 0.2 Suppose 4f - 2*f = 10. Let v be (-2)/(-5) + 8/f. Let h be (150/v	{ "pile_set_name": "DM Mathematics" }
9076bl + 32b Find the first derivative of -3475y*4 + 2042y*3 + 1311801. -13900y*3 + 6126y*2 Find the second derivative of 4s*4 + 1492s*3 - 1285s*2 + 738750994s. 48s2 + 8952s - 2570 What is the third derivative of 3q3u*4 + 12648q*3u*2 + 130q*3u + q*2u*2 - 132u*4 - 3642u*3 wrt u? 72q*3u - 3168u - 21852 What is the third derivative of 2106455i*6 + 2i*4v + 71i2v - 1161iv - 3v wrt i? 252774600i*3 + 48iv What is the second derivative of 45670908g*2 - 12808380g? 91341816 Find the second derivative of 612366094w4 - 718255438w. 7348393128w2 Find the second derivative of 898i*3v*2 + 27i*3 + 438i*2v*2 + 13875iv - 2i + 2275v2 wrt i. 5388iv2 + 162i + 876v2 Find the second derivative of -1062br2z*3 - 43234br2 + 64br + 2rz2 - 3r + 35252z3 - 2z*2 wrt r. -2124bz3 - 86468b Find the third derivative of 4hx*5 - 839180hx3 - 2153546hx - x2 wrt x. 240hx2 - 5035080h Differentiate -72267374p + 7774151 wrt p. -72267374 What is the second derivative of d5n + 5716678d5 - 2dn + 473d + 2n - 182 wrt d? 20d*3n + 114333560d3 What is the second derivative of -j2t*3 - 6356996j*2t*2 + 298094799j - 2t3 wrt j? -2t*3 - 12713992t*2 What is the derivative of -6b*3u + 2b3 - b2 - 3991303bu + 1070327b + 2u wrt u? -6b*3 - 3991303b + 2 What is the third derivative of -7089281n4 + 11n*3 + 12n*2 - 1863739n wrt n? -170142744n + 66 Find the third derivative of -15295403w*5 - 24w*2 + 7400w - 19 wrt w. -917724180w2 What is the third derivative of 167314s*6 + 704915s*2 wrt s? 20077680s*3 Find the third derivative of 67c*5hy + 424480c*3hy + 63c*2hy + 32691c*2 + 3 wrt c. 4020c*2hy + 2546880hy What is the first derivative of -23394167bu + 44617231b wrt u? -23394167b What is the third derivative of -414025ru3 + 4ruw*3 + 532314rw2 + 98u*3w*3 - 6u*2w*3 + uw*2 wrt u? -2484150r + 588w3 Find the third derivative of 11561604x*4 - 2x*2 - 475616. 277478496x What is the first derivative of -59587079ip*3 - 672967615i + 3p wrt p? -178761237ip2 + 3 Find the first derivative of 73455273lq3 + 2q*3 - 1922097 wrt l. 73455273q*3 Find the third derivative of 848724h*6 + 4h*2 - 150668h - 1. 101846880h3 What is the third derivative of -396367758b*6j - 119069597b2j wrt b? -47564130960b3j What is the third derivative of 14298576b4 - 3b*2 + 11b + 254752 wrt b? 343165824b Find the second derivative of 251q*4r - 12266q3r - 3q2 + qr - q + 37396r + 11 wrt q. 3012q*2r - 73596qr - 6 What is the third derivative of 64438091r3z*2 - 5r*2z*2 - 5r*2z + 28rz*2 + 4 wrt r? 386628546z*2 What is the first derivative of 20037851h*3 - 16044849 wrt h? 60113553h*2 Differentiate -256874077q*3 + 280159340. -770622231q*2 Find the second derivative of -13236447k*4 - 132386k + 3 wrt k. -158837364k2 Find the first derivative of 36564aj2 + 2743aj - 40797766j*2 - j wrt a. 36564j*2 + 2743j Find the third derivative of -241371376j3 - 2382j*2 + 16702 wrt j. -1448228256 Find the second derivative of 17428853l*5 - 15899536l wrt l. 348577060l3 Differentiate -415321258c + 43061819. -415321258 Find the second derivative of 17639560w2 - 8412955w wrt w. 35279120 Find the third derivative of 34n6 - 4248381n4 - n2 + 107003523n. 4080n*3 - 101961144n What is the derivative of -581652426d4 - 223094934 wrt d? -2326609704d*3 What is the first derivative of 562q*4 + 17q*3 - 81q*2 + 45573345? 2248q*3 + 51q*2 - 162q Find the third derivative of 10148g2m*3 - 329g*2 - 16579gm2 - 2146m*3 wrt m. 60888g*2 - 12876 Differentiate 400g*3 - 99399g*2 + g + 179460295. 1200g*2 - 198798g + 1 Find the third derivative of -246070153i2x*3 - 52i*2x*2 + 3i*2 + 4008ix + 48 wrt x. -1476420918i*2 Differentiate 5262902t + 9517709 wrt t. 5262902 What is the second derivative of 6425039r3 - 5048963r wrt r? 38550234r What is the derivative of 3841626p*4 - 16451064? 15366504p*3 What is the second derivative of -89678p*3r*2 - 108p*2r*2 + pr*2 + 5pr - 14p - 3r2 + 5r - 87 wrt p? -538068pr*2 - 216r*2 What is the third derivative of 426372272i*3j*3 - 166999i*2j*3 + 1191i*2 wrt i? 2558233632j*3 What is the third derivative of 24405h*4x + 16019h3x2 - h2x2 - h2x + 234hx*2 - 25hx - 124h - 2x2 wrt h? 585720hx + 96114x*2 What is the third derivative of -1097213268w*6 - 15727614w*2 + 7w wrt w? -131665592160w3 What is the third derivative of -238367916b*6 - 14b*2 + 39172b + 4 wrt b? -28604149920b3 What is the second derivative of 480018h*2m - 21h2 - 9hm - 107h - 23m - 665 wrt h? 960036m - 42 What is the third derivative of 36571156n3 + 44925138n*2? 219426936 What is the third derivative of 49613813c4 + c2 + 618501c - 5? 1190731512c What is the third derivative of -9453u6 + 56u*5 - 1978598u*2? -1134360u*3 + 3360u*2 Find the second derivative of 385544w*2 - 1087265w + 2. 771088 Find the third derivative of 25597t4 + 62t*3 + 5785t*2 + t + 4162. 614328t + 372 Differentiate -1515397oq - o + 6886893 wrt q. -1515397o Find the second derivative of 8g*2q + 447028g2 + 3gq - 734g - 21q + 5 wrt g. 16q + 894056 Differentiate 155j2 + 45508j - 1610180 with respect to j. 310j + 45508 Differentiate 7923697u*3 + 23099670. 23771091u*2 What is the second derivative of 22095837t*2 + 742749t + 4 wrt t? 44191674 What is the third derivative of 102681l2x*3 - 1241003l*2x*2 - 43l*2 - 19lx3 - lx*2 + 2x*3 + 1 wrt x? 616086l*2 - 114l + 12 Find the second derivative of 213032m4 - 6m*3 + 6426m + 160 wrt m. 2556384m2 - 36m Find the third derivative of -5154i3v - 2794i3 - 331463i*2 - 2v + 1 wrt i. -30924v - 16764 What is the second derivative of 3g*4 - 9g*3 - 57264g*2 + 52828583g? 36g2 - 54g - 114528 What is the second derivative of 53029n5t - 563n4t - 9nt - 646427t wrt n? 1060580n*3t - 6756n2t Find the first derivative of 2667j3 + 5j*2 - 37j - 4070673. 8001j2 + 10j - 37 What is the first derivative of -2g2p - 15944g2 - 1007997gp2 - 105g wrt p? -2g2 - 2015994gp Find the first derivative of 71547565s - 253809039. 71547565 Find the third derivative of 289340651f2l*3r - 2f2l*3 + 193f*2l*2r + f*2lr + 10f*2l + 2f2r - 3f2 - 2fr + 18l*2 wrt l. 1736043906f*2r - 12f2 What is the second derivative of -19q*2w*4 + 165905q*2w*3 - 343q*2w - 16q2 + q + w - 167 wrt w? -228q*2w*2 + 995430q*2w Differentiate -h*3 + 11040123h*2 + h - 86079647 wrt h. -3h*2 + 22080246h + 1 Differentiate -463008181d + 695455510 with respect to d. -463008181 What is the first derivative of 3g*4 + 10229g*3 - 138g - 27347326? 12g3 + 30687g*2 - 138 Differentiate -362n*2w + 1245n2 - 1055n - 3468w wrt w. -362n*2 - 3468 Find the second derivative of 76187673q*2 + 1938020q. 152375346 Find the second derivative of -4x4 + 21306512x*3 + 24x + 2066319. -48x2 + 127839072x What is the second derivative of 31869779j4 - 29294179j - 2 wrt j? 382437348j2 Find the third derivative of 828398030h*3 - 37h*2 - 664391. 4970388180 Find the first derivative of -529710424h*2 + 428177455 wrt h. -1059420848h Find the first derivative of -342682350v2 - 505976364. -685364700v What is the second derivative of 4f3 - 1959176f*2 + 8640472f? 24f - 3918352 What is the third derivative of -9202165q*3 + 2341q*2 - 1257 wrt q? -55212990 Find the first derivative of 611967bv + 19887237b + 21v wrt v. 611967b + 21 Differentiate 516g3 + 5911g*2 + 3g + 420076480 wrt g. 1548g2 + 11822g + 3 What is the second derivative of 57479859f2 - 3f + 7623049? 114959718 What is the second derivative of -761650722g3 - 4606g - 60129 wrt g? -4569904332g What is the third derivative of 4878v*5 - 563v*4 + 3v*2 - 1741751 wrt v? 292680v*2 - 13512v Differentiate -fxy - 2fy - 2*f - 86	{ "pile_set_name": "DM Mathematics" }
o letters picked without replacement from {l: 9, i: 11}? 18/95 Calculate prob of picking 1 t and 2 o when three letters picked without replacement from {o: 2, c: 1, b: 6, t: 2, e: 4, w: 4}. 2/969 Four letters picked without replacement from {k: 4, y: 6}. What is prob of picking 4 y? 1/14 What is prob of picking 1 w, 1 e, and 1 f when three letters picked without replacement from ewemmmemnmffwfwwmm? 3/68 What is prob of picking 1 a and 1 u when two letters picked without replacement from {t: 1, a: 2, b: 1, z: 1, u: 1, f: 2}? 1/14 Four letters picked without replacement from {t: 4, f: 3}. Give prob of picking 2 f and 2 t. 18/35 Calculate prob of picking 2 p when two letters picked without replacement from pppttppp. 15/28 Three letters picked without replacement from kkkbbkkk. Give prob of picking 3 k. 5/14 Two letters picked without replacement from yrrrxiiriyyxxyii. What is prob of picking 2 x? 1/40 Two letters picked without replacement from {t: 1, k: 1, y: 2, j: 1, n: 2}. Give prob of picking 1 y and 1 t. 2/21 Four letters picked without replacement from lqllxqrffxlfqllq. What is prob of picking 1 q, 2 x, and 1 r? 1/455 Two letters picked without replacement from sppsgpxsasa. What is prob of picking 1 g and 1 p? 3/55 Calculate prob of picking 3 b and 1 u when four letters picked without replacement from {b: 7, u: 5}. 35/99 Calculate prob of picking 3 e when three letters picked without replacement from iiieeiei. 1/56 What is prob of picking 2 w and 1 p when three letters picked without replacement from {i: 1, w: 2, p: 3, f: 3, d: 1}? 1/40 Four letters picked without replacement from {n: 3, p: 5, h: 3, x: 3, e: 2}. What is prob of picking 3 h and 1 e? 1/910 Two letters picked without replacement from bwwwwwbwbw. Give prob of picking 1 b and 1 w. 7/15 Three letters picked without replacement from {u: 1, d: 1, m: 1, r: 2, i: 1, w: 1}. Give prob of picking 1 u, 1 w, and 1 r. 2/35 Two letters picked without replacement from {w: 2, g: 2, c: 3, j: 4}. Give prob of picking 1 j and 1 g. 8/55 Three letters picked without replacement from rprrrrrrpprrrrrprr. What is prob of picking 2 r and 1 p? 91/204 Calculate prob of picking 2 i and 1 b when three letters picked without replacement from rbiirrrbb. 1/28 Calculate prob of picking 1 t and 2 n when three letters picked without replacement from ntnnnnntnn. 7/15 What is prob of picking 1 y and 1 f when two letters picked without replacement from {k: 1, b: 2, t: 1, y: 4, f: 1}? 1/9 Calculate prob of picking 1 c and 1 z when two letters picked without replacement from {j: 2, k: 1, c: 1, z: 4}. 1/7 Three letters picked without replacement from wryrwywr. What is prob of picking 1 w and 2 r? 9/56 What is prob of picking 1 b, 1 f, 1 c, and 1 z when four letters picked without replacement from {z: 2, l: 1, c: 2, v: 1, f: 2, b: 1}? 4/63 Four letters picked without replacement from weeeewwewweee. Give prob of picking 1 e and 3 w. 16/143 Two letters picked without replacement from lnqlnfjf. Give prob of picking 1 j and 1 q. 1/28 Three letters picked without replacement from {e: 3, t: 8, f: 5}. What is prob of picking 2 e and 1 f? 3/112 Four letters picked without replacement from {t: 6, l: 1, n: 4, g: 6}. What is prob of picking 1 t, 2 n, and 1 g? 54/595 Three letters picked without replacement from hoohoxohxoiooibxoo. What is prob of picking 1 b, 1 o, and 1 i? 3/136 Calculate prob of picking 3 d and 1 m when four letters picked without replacement from ddpdmmk. 2/35 Three letters picked without replacement from {g: 4, x: 12, f: 4}. What is prob of picking 1 f and 2 x? 22/95 Three letters picked without replacement from {t: 5, s: 15}. What is prob of picking 3 s? 91/228 Four letters picked without replacement from {h: 3, i: 2, k: 4, z: 1, g: 2}. Give prob of picking 1 h, 2 i, and 1 z. 1/165 Three letters picked without replacement from {g: 1, b: 2, m: 3, d: 1, x: 2, p: 3}. What is prob of picking 1 p, 1 g, and 1 b? 3/110 Calculate prob of picking 1 w and 2 u when three letters picked without replacement from kuwwukwnwwnwnko. 6/455 Two letters picked without replacement from oyyjy. Give prob of picking 1 o and 1 y. 3/10 Two letters picked without replacement from xbboomi. Give prob of picking 2 o. 1/21 Calculate prob of picking 4 f when four letters picked without replacement from fffwffffffff. 2/3 What is prob of picking 1 q, 1 z, 1 u, and 1 m when four letters picked without replacement from {z: 1, u: 10, m: 4, q: 5}? 40/969 Calculate prob of picking 1 o, 1 k, and 1 a when three letters picked without replacement from ohkakh. 1/10 Calculate prob of picking 2 q when two letters picked without replacement from {q: 7}. 1 Two letters picked without replacement from hmhhmmmmmmmm. What is prob of picking 2 m? 6/11 Four letters picked without replacement from {e: 3, y: 3}. What is prob of picking 1 y and 3 e? 1/5 Two letters picked without replacement from {o: 2, e: 1, x: 3, b: 3, y: 1}. Give prob of picking 1 e and 1 y. 1/45 Calculate prob of picking 1 w and 3 g when four letters picked without replacement from kkgkgwgg. 2/35 Two letters picked without replacement from {o: 9, c: 2}. What is prob of picking 2 c? 1/55 What is prob of picking 1 h and 1 r when two letters picked without replacement from rhrrrrrrb? 7/36 Three letters picked without replacement from {w: 15, f: 4}. What is prob of picking 3 w? 455/969 Four letters picked without replacement from yyysyyyssssyy. What is prob of picking 4 y? 14/143 Three letters picked without replacement from zstttstsstszt. Give prob of picking 1 t and 2 s. 30/143 Two letters picked without replacement from {r: 3, t: 1, e: 1}. What is prob of picking 1 r and 1 e? 3/10 What is prob of picking 1 u and 1 v when two letters picked without replacement from jnljvljjvuvj? 1/22 Three letters picked without replacement from {o: 9}. What is prob of picking 3 o? 1 Two letters picked without replacement from {h: 1, f: 8, c: 4}. Give prob of picking 2 c. 1/13 What is prob of picking 1 z and 1 u when two letters picked without replacement from uuuuuzuuuuuuuzuuuu? 32/153 What is prob of picking 4 c when four letters picked without replacement from {g: 5, c: 5}? 1/42 Four letters picked without replacement from {l: 4, q: 3, w: 6, i: 1}. Give prob of picking 1 q, 1 l, and 2 w. 180/1001 Calculate prob of picking 1 a and 2 c when three letters picked without replacement from {f: 1, c: 2, e: 4, a: 1}. 1/56 Four letters picked without replacement from mmmtmttmmmtmtmtmtttm. Give prob of picking 2 m and 2 t. 132/323 Two letters picked without replacement from {j: 1, p: 1, q: 1, l: 1, b: 4}. What is prob of picking 1 q and 1 b? 1/7 What is prob of picking 2 a when two letters picked without replacement from kkkkaakk? 1/28 What is prob of picking 1 b and 2 d when three letters picked without replacement from bdmbtdbdbgbdmbb? 6/65 Four letters picked without replacement from {p: 7, v: 3}. What is prob of picking 4 p? 1/6 Calculate prob of picking 1 x, 1 t, and 1 l when three letters picked without replacement from {z: 1, l: 8, t: 1, x: 4, j: 4, k: 2}. 8/285 Calculate prob of picking 3 w and 1 a when four letters picked without replacement from akakkwaakwwkaak. 2/455 Three letters picked without replacement from oooaaoaaao. Give prob of picking 2 a and 1 o. 5/12 Calculate prob of picking 1 j, 1 u, 1 b, and 1 a when four letters picked without replacement from quoaqjb. 1/35 Three letters picked without replacement from gyyygppgypgggg. What is prob of picking 3 g? 5/52 Calculate prob of picking 1 n and 1 e when two letters picked without replacement from {e: 11, n: 1}. 1/6 Three letters picked without replacement from ooooooooqoooqooooqoo. What is prob of picking 1 q and 2 o? 34/95 What is prob of picking 1 r and 1 b when two letters picked without replacement from birhh? 1/10 Calculate prob of picking 2 k and 1 n when three letters picked without replacement from {z: 2, k: 3, n: 3}. 9/56 Calculate prob of picking 3 o and 1 h when four letters picked without replacement from hohoooooho. 1/2 What is prob of picking 2 r and 1 m when three letters picked without replacement from {m: 3, r: 5, p: 11, n: 1}? 1/38 What is prob of picking 4 k when four letters picked without replacement from {k: 10}? 1 What is p	{ "pile_set_name": "DM Mathematics" }
times -0.11128? 0.89024 45.570.08 3.6456 -3.7 times 0.001508 -0.0055796 Calculate 0.1-0.06457. -0.006457 What is -16 times -298.2? 4771.2 -20.364 * 0 0 Calculate 7-1262. -8834 Product of -0.0466117 and 0.5. -0.02330585 What is the product of -0.6927 and 0.5? -0.34635 -12 1884 -22608 What is the product of 0 and -0.51134? 0 Work out 29 * 13.173. 382.017 330559 times 0.5 165279.5 0.5 * 72.37 36.185 1 times 12.568 12.568 Product of -26307 and -0.4. 10522.8 What is -0.5 times 0.0360232? -0.0180116 Calculate 0.1-88.01. -8.801 What is the product of 115.6708 and 5? 578.354 Product of -597761 and 0.3. -179328.3 What is the product of -0.136 and -12.37? 1.68232 8.348 times 9 75.132 -12298025 -6149010 -0.3427501 -128250.3 Work out -0.155 -9.39. 1.45545 Work out -0.25 * 0.0135. -0.003375 What is the product of -358 and -27.1? 9701.8 Multiply -1.102 and -3.6. 3.9672 What is -0.08 times 0.6564? -0.052512 Calculate -30791-4. 123164 9.5778 -5 -47.889 Multiply 0 and 70430. 0 19 * 0.198 3.762 What is the product of -0.2 and -117.94? 23.588 What is the product of -3225.8 and -0.23? 741.934 Product of 0.3 and -0.3965. -0.11895 22776 times -0.1 -2277.6 Calculate 0.9-0.09368. -0.084312 -0.288 times -2.6 0.7488 -0.2625-1.2 0.315 Work out 1.4 * -4375. -6125 -335-20.79 6964.65 Calculate -0.0143440.5. -0.007172 Product of 10.1514 and -0.2. -2.03028 Work out -439428 * -6. 2636568 Multiply 3805.4 and -0.01. -38.054 What is -2 times -0.07? 0.14 11.0807 1.0807 What is the product of -46620 and -0.5? 23310 Multiply 2.5 and -10281. -25702.5 Product of 1 and -2349. -2349 0.202 -0.009 -0.001818 Product of -0.3 and 675. -202.5 Work out 86685 * 3. 260055 Work out 27 * 286. 7722 Calculate -2.129923. -48.9877 What is -7 times 228? -1596 What is 3.6 times -385? -1386 -1.571 24.36 -38.26956 -277263.7 -102586.2 11.9133 -0.5 -5.95665 Work out 0.124 * 617. 76.508 -54936 times -0.5 27468 -22.3205 * 0.7 -15.62435 19584 times -31 -607104 -128.0365 -8321.95 Product of 105.2092 and 4. 420.8368 Multiply 4 and 0.017586. 0.070344 What is -0.4 times 61.16? -24.464 What is the product of -0.1552 and 0.07? -0.010864 -741.29 -95.46 What is the product of -2.24 and 875? -1960 Product of -0.2 and -101744. 20348.8 Multiply 14551 and 0.04. 582.04 Multiply 0.006 and -3.32. -0.01992 What is the product of -0.2 and -10688.3? 2137.66 11132574 6389768 What is 1.04 times 3223? 3351.92 Product of 219 and 0.224. 49.056 -0.450.5174 -0.23283 What is the product of 0.0588 and -24? -1.4112 What is 226 times 21.9? 4949.4 -0.02238 * -18 0.40284 What is the product of 3816 and 53? 202248 What is the product of 398 and 91? 36218 -1.9-1.895 3.6005 Multiply 379 and -0.93. -352.47 18 -0.354 -6.372 Multiply -0.033204 and 66. -2.191464 6175331 1051986 Multiply -7 and 334346. -2340422 What is 649.6 times -0.01? -6.496 -1.7-278 472.6 Work out 4.2 * 0.815. 3.423 1115-0.1902 -212.073 Multiply -112 and 229. -25648 What is the product of -59.831 and 4? -239.324 What is the product of -43 and 1035.4? -44522.2 What is the product of 401 and -168.9? -67728.9 Work out -1 -248408. 248408 What is the product of 37.5767 and 0.4? 15.03068 Multiply -0.4 and 241761. -96704.4 49684.6 times 4 198738.4 Multiply -133.314 and -0.3. 39.9942 -6-1326156 7956936 What is the product of 3 and 120799? 362397 135 -174 -23490 What is the product of -3.213 and 206? -661.878 223636 times 1 223636 What is the product of 69 and -71.94? -4963.86 What is the product of -6170 and 3? -18510 Multiply 5 and 0.04938. 0.2469 -1.463470.3 -0.439041 0.3 times 8771.11 2631.333 What is the product of -0.1 and 0.3562? -0.03562 What is -2 times -43230? 86460 What is 4 times -0.0035192? -0.0140768 Multiply -0.005511 and 0.2. -0.0011022 324 times -12 -3888 Calculate -0.055-3512. 193.16 What is 1187 times 0.174? 206.538 51-0.003 -0.153 Work out -172943 4. -691772 Calculate -4-584520. 2338080 Product of -7 and 635.1. -4445.7 Work out -7460118 -1. 7460118 Multiply -7 and -4500. 31500 Work out -1.848352 * 2. -3.696704 9182-0.05 -459.1 Multiply -0.5 and 51644. -25822 168553 68553 Calculate -31056530. -3169590 Multiply 14427.4 and -5. -72137 What is the product of 0.21 and 913? 191.73 Multiply -75 and -28.77. 2157.75 399 times -0.002 -0.798 0.054006 times -0.3 -0.0162018 Multiply -12.263 and 0.4. -4.9052 Work out -2 11299.3. -22598.6 What is the product of -0.5 and -63.623? 31.8115 Calculate 1.616760.4. 0.646704 -0.4 times 36.492 -14.5968 What is -0.17 times 8556? -1454.52 4112 13.3 54689.6 Multiply 3925 and -10. -39250 0.4859773 28691.04 -0.4 times 7456 -2982.4 What is the product of -1528 and -2.6? 3972.8 What is 0.6 times 6302.13? 3781.278 13.7 times -271 -3712.7 1.315 7 9.205 Calculate -0.24-0.158097. 0.03794328 Product of 0.2 and -1.94679. -0.389358 4 times 1054.3 4217.2 -645424 times 3 -1936272 -15 times 20021 -300315 Product of 1.82 and -544. -990.08 Multiply -1.3 and 1577. -2050.1 Product of -4 and -0.03827. 0.15308 47476 -0.2 -9495.2 Multiply -120510 and -2. 241020 Product of -441236 and -1. 441236 What is the product of 76.08 and 6? 456.48 Product of 1 and -7554. -7554 0.2 * -0.25111 -0.050222 What is the product of 3 and -2500.6? -7501.8 What is the product of -431 and 216? -93096 1.5 * 29034.7 43552.05 Product of 4 and -9179. -36716 Product of 0.183 and -0.0458. -0.0083814 -141 times 906 -127746 Calculate -19891.38. -2744.82 What is the product of 98034 and 0.2? 19606.8 Product of -441 and -18.82. 8299.62 -21399 4 -85596 Product of -0.1 and -0.41585. 0.041585 5173.8 times 0.4 2069.52 Calculate 1.4670.43. 0.63081 -0.088-58.9 5.1832 1214920.3 36447.6 -4106 -0.23 944.38 What is the product of 0.24 and -5391? -1293.84 Product of -0.5 and -0.104. 0.052 117 * -356.5 -41710.5 70260.21 1475.46 9 16.086 144.774 Calculate -4306938. -1227752 -2440.67 0.04 -97.6268 0.9-434 -390.6 Product of -0.051 and 35. -1.785 268.11 -109 -29223.99 Work out 0.03 * -0.039507. -0.00118521 Work out -0.31 * 0.8759. -0.271529 What is the product of -0.11 and 481? -52.91 What is the product of -3910 and 0.132? -516.12 What is the product of 2598 and -0.1537? -399.3126 Multiply 0.06 and -0.396. -0.02376 Multiply 43.848 and 0.34. 14.90832 What is -466 times 3.462? -1613.292 39-0.46137 -17.99343 72206 times -5 -361030 Multiply 1 and 492.63. 492.63 Work out 6.3 561.7. 3538.71 -429570.17 -7302.69 Work out -29 -0.729. 21.141 Product of -16538 and 5. -82690 1456250 364000 125849 -0.06 -7550.94 6240158 985920 -3313525 -1166775 What is 0.1 times -44549? -4454.9 Calculate 2.995. 275.5 Work out 5 -15016. -75080 Calculate -23600.6-0.5. 11800.3 Multiply 321 and -1129. -362409 Product of 0.3433 and 29. 9.9557 0.4 171.3 68.52 Work out 0.10234 * -5. -0.5117 0.1 * -111782 -11178.2 35917-53 -1903601 Calculate -0.295434. -128.03 Calculate -0.1-56494. 5649.4 What is the product of -1.3 and -5938? 7719.4 What is 0.8 times 0.61487? 0.491896 Product of 8740 and 0.2. 1748 111411 0.3 33423.3 Product of -4.096817 and 1. -4.096817 Product of 3.9 and -601. -2343.9 Calculate -109.59. -985.5 -9214 times -0.18 1658.52 Product of -63 and -6.25. 393.75 What is -430.04 times -17? 7310.68 Multiply -13 and 19.861. -258.193 Work out 2 -13051. -26102 -0.5 * -3845 1922.5 Product of -4 and -2.93615. 11.7446 What is the product of 0.5 and -317.41? -158.705 Multiply 305 and 1787. 545035 2 * -0.21829 -0.43658 Calculate 0.25-31.84. -7.96 What is 0.32 times -63642? -20365.44 Calculate -10590690. 0 0.05007 times 0.03 0.0015021 Product of -21594 and 0.03. -647.82 Product of -2.5775 and -4. 10.31 0.1 times 90222 9022.2 Product of -281 and 5.589. -1570.509 Multiply -0.7 and 5757. -4029.9 14 times -40.58 -568.12 Product of 0.0523 and 577. 30.1771 -13.6832 -11315.2 Calculate -287-383. 109921 -0.17545 * -0.96 0.168432 What is the product of -5.5 and 12297? -67633.5 16 times -11480 -183680 -74839.1 -62093.4 What is 0.04 times -196866? -7874.64 What is -0.2 times -8.01? 1.602 Product of -8.3 and -296. 2456.8 -214 8.9 -1904.6 10584 times 0.11 1164.24 -25.73 * -0.2 5.146 Product of -462 and -0.1. 46.2 81400.4 3256 What is the product of 809 and -42? -33978 Work out -148 447.2. -66185.6 Multiply 1500901 and 0. 0 Work out -1 * 11.765.	{ "pile_set_name": "DM Mathematics" }
6/7 + 2/21v2 + 52/21v. 2(v + 3)(v + 23)/21 Let t(w) be the second derivative of 1 - 1/21w7 + 4/15w*6 - 1/5w*5 - 26w - 2/3w4 + w3 + 0w*2. Suppose t(u) = 0. Calculate u. -1, 0, 1, 3 Let d be -13 - -13 - 3(2 + -1). Let a be (9/(-27))/(87/(-18) - d). Factor 0 + an3 + 2/11n*2 - 4/11n. 2n(n - 1)(n + 2)/11 Let h(v) be the first derivative of 4/9v*3 - 32/3v + 4/3v2 + 53. Determine i, given that h(i) = 0. -4, 2 Suppose -5i - 295 = -5w, -201 = -4w - i - 2i. Suppose 54p + w = 81p. Factor -1/3d*p - 2/3 + d. -(d - 2)(d - 1)/3 Factor -2/3j2 + 740/3j - 68450/3. -2(j - 185)2/3 Let v(r) be the first derivative of -4/25r*5 + 8/15r*3 - 99 - 4/5r - 1/5r4 + 1/15r*6 + 1/5r*2. Solve v(c) = 0. -1, 1, 2 Let v(g) be the first derivative of -6/5g*2 + 4/5g - 1/20g4 + 11/15g*3 - 3/25g*5 + 1/30g6 - 174. Suppose v(a) = 0. Calculate a. -2, 1, 2 Let p(c) = c2. Suppose -b - 37 = -2m - 4b, m - 4b - 13 = 0. Let z(j) = 35 - 17 - m. Let h(n) = p(n) - z(n). Factor h(w). (w - 1)(w + 1) Factor -51/2w + 3/8w*4 + 18w*2 - 39/8w*3 + 12. 3(w - 8)(w - 2)2(w - 1)/8 Let d(w) be the first derivative of w*4/22 + 112w*3/33 + 684w*2/11 - 3043. Factor d(u). 2u(u + 18)(u + 38)/11 Let d(u) = u*3 + 4u*2 + 4u + 7. Let x be d(-3). Suppose 8i - 7 = 3i - 3p, 0 = -2i - xp. Solve 6 - 2w + 1423wi + 0 - 2 - 1425w*2 = 0. -2, 1 Let p(h) be the first derivative of 5h4/4 + h3/3 - h*2 + 6. Let m be p(1). Factor -44s*m - 40s*4 - 6s*3 + 69s*4 - 3 + 9s*5 + 18s*2 - 3s. 3(s - 1)3(s + 1)(3s + 1) Let h(d) be the first derivative of -d7/105 - d6/20 + d4/3 - d2/2 + 10d - 78. Let r(y) be the second derivative of h(y). Factor r(c). -2c(c - 1)(c + 2)*2 Suppose 28m - 75m = -39m - 216. Suppose 0 - mq + 3/2q*2 = 0. What is q? 0, 18 Let w = -126179/2 - -63090. Let 3/2u3 - u5 + 1/2u4 - 1/2u*2 + 0 - wu = 0. What is u? -1, -1/2, 0, 1 Suppose 4/5i - 2708/5i*3 + 1628/5i*2 - 148/5 + 1256/5i*4 - 32/5i*5 = 0. What is i? -1/4, 1/2, 1, 37 Suppose -182x + 177x = 35, 2x + x + 39 = 6k. Factor -3/4i*2 + 2 - 3/2i + 1/4ik. (i - 4)(i - 1)(i + 2)/4 Let y = -19452 - -19454. Suppose 0 + 3z*3 + 3/5z*4 + 21/5z*y + 9/5z = 0. What is z? -3, -1, 0 Let a = 51963 - 51960. Find c such that 2c2 + 22/7c + 4/7 - 22/7ca - 18/7c*4 = 0. -1, -2/9, 1 Let x(o) be the second derivative of 25/42o*3 + 0 - 133o + 0o2 + 1/84o*4. Solve x(y) = 0 for y. -25, 0 Factor 21054838j - 21053977j + j2 - 4j*2. -3j(j - 287) Let z be 15/27-1 + 1. Let n(w) = -4w3 + 16w*2 + w + 4. Let f be n(0). Factor 2/9p*f + 2/9 + 2/9p*5 + 2/9p - zp2 - 4/9p*3. 2(p - 1)*2(p + 1)*3/9 Let w(j) = -343j*3 + 2615j*2 + 829j + 59. Let t(h) = -h*3 + 3h*2 + h - 1. Let v(x) = -5t(x) + w(x). What is k in v(k) = 0? -2/13, 8 Suppose 39y = -2o + 32y + 124, 0 = -y + 4. Suppose -o = -14b + 8b. Let b - 11/2r*2 + 0r - 1/4r4 + 9/4r*3 = 0. What is r? -1, 2, 4 Let z = -6 - -249. Determine x, given that -z + 162x*3 - 729x - 104x5 + 54x*2 + 95x*5 - 3x*4 + 0x*4 = 0. -3, -1/3, 3 Determine h so that 0 + 3/4h*5 + 27h + 105/4h2 - 105/4h*4 - 111/4h*3 = 0. -1, 0, 1, 36 Let d(s) = 11s*4 - 145s*3 + 715s*2 + 13949s + 33856. Let q(a) = 5a4 - 73a*3 + 357a*2 + 6977a + 16928. Let n(b) = -3d(b) + 7q(b). Factor n(t). 2(t - 23)2(t + 4)*2 Suppose 0 = 4t - 18 + 10. Factor 10qt - 12q*3 - 12q - 9q3 + 19q*3. -2q(q - 3)(q - 2) Let h(q) be the first derivative of 66 + 2/21q3 - 5/7q*2 + 1/14q*4 + 6/7q. Factor h(u). 2(u - 1)2(u + 3)/7 Let n(h) be the second derivative of -h8/33600 + h7/840 + h*4/12 - 21h*3/2 + 10h - 2. Let l(i) be the third derivative of n(i). Factor l(q). -q*2(q - 15)/5 Let d(y) be the third derivative of -y*5/15 - 224y*4/3 - 298y*3 - 654y*2 - y + 1. Factor d(s). -4(s + 1)(s + 447) Let o = 54 - 54. Let g be ((-2)/14 - o)14/(-6). Factor 0p2 - gp*3 + 0p + 0 + 1/6p4. p3(p - 2)/6 Let m(r) be the first derivative of -31/3r3 - 1/720r*6 + 0r*2 - 3/80r*5 + 5/24r*4 + 32 + 0r. Let i(g) be the third derivative of m(g). Factor i(z). -(z - 1)(z + 10)/2 Let a(i) be the second derivative of 0 - 1/36i*4 + 1/18i*3 + 1/3i*2 - 17i. Let a(v) = 0. What is v? -1, 2 Let b(a) = -10a3 + 95a*2 + 555a + 25. Let j(n) = -15n3 + 143n*2 + 833n + 35. Let y(h) = -7b(h) + 5j(h). Determine f, given that y(f) = 0. -4, 0, 14 Let d(p) be the second derivative of -55p4/48 + 1615p*3/12 + 525p*2 - 9946p. Factor d(g). -5(g - 60)(11g + 14)/4 Let j be (0 - (-1 - -5 - -1)) + -32. Let x be (-35 - j)/(2/3). Factor -3/8c*2 + 0c*x + 1/8c*4 + 1/4c + 0. c(c - 1)2(c + 2)/8 Let h = 539 - 27. Let g = h - 1534/3. Suppose gc3 - 2c*2 - 2/3c + 4/3 + 2/3c4 = 0. Calculate c. -2, -1, 1 Let n(l) be the first derivative of -21 + 1/60l*4 - 1/300l*5 + 0l*3 - 6l*2 + 0l. Let v(q) be the second derivative of n(q). Factor v(o). -o(o - 2)/5 Let f(k) be the first derivative of k6/1530 - 7k5/204 + k4/12 - 40k3 + 177. Let i(x) be the third derivative of f(x). Suppose i(c) = 0. Calculate c. 1/2, 17 Let f(m) be the second derivative of m6/10 + 18m*5/5 + 11m*4/2 - 12m*3 - 69m*2/2 + 2028m. Determine o, given that f(o) = 0. -23, -1, 1 Let s(q) be the second derivative of 3q5/140 + 9q*4/14 + 11q*3/2 + 90q*2/7 - 5426q + 2. Factor s(l). 3(l + 1)(l + 5)(l + 12)/7 Factor -2z*5 + 4z*5 - 8z*4 + 6z*3 - 8z + 138z2 - 257z*2 + 127z*2. 2z(z - 2)2(z - 1)(z + 1) Suppose -x + 2o = 6, -7x + 4o = -2x. Find q such that -85q*2 - 4q - 7qx - 4q*3 - 11q3 - q5 + 72q2 = 0. -4, -1, 0 Let d(i) be the third derivative of 0 - 19i*4 - 361/10i*3 + 0i - 137i2 - 1/350i*7 - 219/50i*5 - 1/5i*6. Factor d(v). -3(v + 1)*2(v + 19)*2/5 Let l(x) = 17x*2 + 1130x + 1127. Let n(u) = 9u2 + 565u + 564. Let s(z) = 4l(z) - 7n(z). Factor s(g). 5(g + 1)(g + 112) Suppose 2w + 0w = -28. Let z(s) = -s*2 - 17s - 28. Let l be z(w). Factor 6d2 + 13d + 13d2 - 25d2 + d3 + ld2 + 6. (d + 1)2(d + 6) Let x be (-27 + 9087/338)/((-348)/78 + 4). Factor 19/2c2 + 0 - xc*3 - 361/4c. -c(c - 19)2/4 Let -645160 - 646176l - 5082/5l2 - 2/5l3 = 0. Calculate l. -1270, -1 Let x(c) be the second derivative of c4/6 - 562c3/3 + 78961c*2 + 1089c. Factor x(q). 2(q - 281)2 Let a(s) be the second derivative of -3s*5/20 + 3s*4/2 + 15s*3/2 + 12s*2 - 282s. Find h such that a(h) = 0. -1, 8 Let t be (-15)/65 + 1488/1040. Let z(b) be the second derivative of 0 + 1/20b4 + tb*2 - 2/5b*3 - 24b. Factor z(y). 3(y - 2)2/5 Let t = 1995 + -1147. Let p be (10/(-12))/((-265)/t). What is i in -8/3i + 2/3i3 - p + 2/3i*2 = 0? -2, -1, 2 Let z = -20 - -48. Let t be (7/(z/12))/1. Solve 8c*3 - 64 - 96c + 6ct - 36c*2 - 2c*3 - 16c*3 = 0 for c. -4, -1 Let j(q) = 16q*2 + 33 - 6q*2 - 4q*2 - 7q*2 + 30q. Let c be j(31). Factor 9/7 + 12/7f + 3/7f*c. 3(f + 1)(f + 3)/7 Let o be 2/(-3)-1(-2460)/(-820) + (-232)/(-10). Factor -46/5b*3 - 122/5b + 8 + 2/5b4 + ob*2. 2(b - 20)(b - 1)3/5 Let g(f) be the third derivative of -f6/1440 + f5/24 - 3f*4/8 + 74f*3/3 + 250f*2. Let d(x) be the first derivative of g(x). Factor d(r). -(r - 18)(r - 2)/4 Let s be (-5 - -6)1 - (-15)/(-25). Let d = s - -1/10. Factor -d + 2w*2 + 3/2w. (w + 1)(4w - 1)/2 Let h(x) = -2x4 - 21x*3 + 23x2 - x. Let m(t) = t4 + t*3 - 2t2 + t. Let d(a) = -h(a) - m(a). Solve d(j) = 0 for j. -21, 0, 1 Let w(i) be the third derivative of -i5/330 - 131i4/132 + 266i3/33 - i2 + 3i - 1546. Solve w(u) = 0 for u. -133, 2 Let f(h) be the third derivative of -19h*2 + 1/840h*8 + 0 + 2/525h*7 - 1/300h*6 + 0h + 0h4 + 0h*3 - 1/75h*5. Determine x, given that f(x) = 0. -2, -1, 0, 1 Let c be 12/3 + -9(-3)/9. Suppose 9d - 14d = k - c, -3k = -4d - 2. Factor 2zk - 2/11z*3 + 50/11 - 70/11z. -2(z - 5)2(z - 1)/11 Suppose -11/2n3 - 1/4n*2 + 11/2n + 0 + 1/4n4 = 0. Calculate n. -1, 0, 1, 22 Let x(t) = 5t*5 + 3t*4 + 66t*3 + 28t*2 + 4t + 4. Let u(	{ "pile_set_name": "DM Mathematics" }
+ -23 - -13)? 5 Evaluate 1 + 2 + -12 + 6 + 9. 6 (6 - 4 - -4) + 1 - 6 1 3 + (0 + -1 + 4 - 10) -4 What is the value of (-10 - -4) + 6 + (0 - -1)? 1 -2 + (18 - 3) + -9 4 Evaluate 7 - (7 - -2 - 2). 0 What is the value of -1 + -6 + (-9 - -16)? 0 Calculate 11 + -2 + -5 + 2. 6 3 + (6 + 0 + -4 - 4) 1 Evaluate 1 - 4 - (6 - 12 - -1). 2 Evaluate (9 - -1) + (9 - (28 - 13)). 4 Calculate 17 + -5 - (5 + -2) - 3. 6 Evaluate (-14 - (1 - (0 - -4))) + 5. -6 -4 - (4 + -4 + -3 + 2) -3 What is the value of (4 - 2 - -4) + -3? 3 -2 - (-12 + 5 - -5) 0 (3 - 3) + (2 - 4) -2 -31 + 37 - (3 + 3 + 1) -1 6 + -10 + 3 - (-4 + 3) 0 1 - 1 - -10 - 4 - 4 2 Evaluate (-6 - -11) + 1 + -1. 5 What is the value of 1 + -5 + 2 + 5? 3 5 - (4 + -2 - -9 - 2) -4 Calculate 3 - ((1 - (2 - 8)) + -3). -1 Calculate -8 - (-2 - (3 + 1)). -2 14 - 14 - (9 + 5 + -5) -9 What is the value of (3 - 1 - (2 - 0)) + 2? 2 What is the value of -2 + (-5 - -7) - (1 - 6)? 5 5 - (6 - -5) - -7 1 Calculate 2 + -5 + 11 + (-3 - 3). 2 What is the value of -3 - (4 - (0 - -6) - -3)? -4 Evaluate 1 + 1 + 11 + -13 - 1. -1 Evaluate -7 - -7 - (4 - 0). -4 What is the value of (-20 - (-17 + 3)) + (1 - -5)? 0 Evaluate (-9 - -7) + -2 + -2 + 5. -1 Calculate -4 + 1 - (-6 + (-14 - -12)). 5 (-2 - (1 - 5)) + -4 -2 Calculate -2 - 6 - (3 + 2 + -8). -5 Calculate 9 + -2 + (-8 - -3). 2 -13 + (-27 - -37) + -2 + 0 -5 4 - 1 - (3 + 0) 0 Calculate 0 - (3 - (-1 + -3 + 3)). -4 Calculate (-3 - (-4 + -10)) + -5. 6 What is -3 + 2 + -1 + (-4 - -10)? 4 11 + (-19 - -10 - 2) 0 What is -4 - 3 - (-1 - 3)? -3 What is the value of (-5 - (-3 - 4)) + -8? -6 Evaluate (1 - 3) + 14 + -12. 0 What is the value of 0 + -6 + (18 - 14) + -2? -4 (-5 - -12) + -12 + 4 -1 Calculate -9 - (3 + -4 - 4). -4 What is 1 + 1 + -17 + 15? 0 Evaluate 35 + -41 + (0 - -3). -3 Evaluate 3 - 0 - (-2 + 4). 1 (0 - 3) + (-1 - 2) -6 What is the value of 21 + -11 - (-7 - -9)? 8 What is -2 - 1 - (-4 - -2)? -1 Evaluate -3 + (-2 - ((3 - 8) + 0)). 0 What is the value of (1 - -1) + 1 + 0? 3 What is (-1 - (-15 - -3)) + (11 - 15)? 7 Calculate 0 - 1 - (-1 - 2). 2 Evaluate -1 + 11 + (-3 - 11 - -8). 4 What is 13 - (7 + 2 + -4) - 1? 7 What is the value of -4 + (-1 - (3 - 6))? -2 Evaluate (-3 - 0) + 8 + 1 + -2. 4 Calculate 6 - (7 - (6 + (-12 - -7))). 0 What is the value of 5 + (2 - (-3 + 9))? 1 What is the value of -4 + 1 - (5 - 9)? 1 Evaluate 3 - 1 - (-2 - (6 + -5)). 5 Evaluate -5 + 0 - -9 - -1. 5 What is (8 - (4 + 3)) + -5? -4 Calculate 6 - (16 + (6 - (0 + 12))). -4 What is 36 + -43 + 0 + 0 - -10? 3 Evaluate 1 - 2 - (-8 + 15 - 13). 5 What is the value of 6 + -3 + (2 - 0)? 5 What is (-6 - -1) + (-3 - (-4 + -4))? 0 6 - (-6 - (-5 - 11)) -4 Calculate 1 + 0 + 1 - (10 + -12). 4 Evaluate -6 + -4 + 3 + 10. 3 What is 7 - (0 - 7 - -8)? 6 What is -3 + (-1 - -2) + (-8 - -12)? 2 What is the value of -7 - (-10 + 4) - (-2 + -1)? 2 What is the value of -2 + (-2 + 0 - -3) - -3? 2 Evaluate (-7 - -15) + -2 + -1 - 0. 5 What is the value of 5 - (-8 - -12) - 6? -5 -15 - (-8 + (14 - 12)) -9 Evaluate 2 + (-3 - (3 + -2 + -2)). 0 Evaluate 1 - (-3 + 0 - -2). 2 (6 - 1) + -1 + -11 + 6 -1 Evaluate 7 + 2 + (-3 - 1). 5 What is the value of 0 - 3 - (-4 + 3) - 3? -5 2 - ((-4 - 0 - -1) + 3) 2 -10 + (3 - 3) + 5 -5 Calculate 4 - (4 + -2) - (8 + -1). -5 1 + -5 - (0 + 0 + -2) -2 Calculate (8 - 4) + (2 - -3) + -5. 4 -7 - ((4 + -5 - -7) + -14) 1 Evaluate -5 + 1 + 11 + (0 - 3). 4 Evaluate -6 + (-1 - -2 - (-12 + 8)). -1 What is 4 + (-7 - (1 - (-3 + 7)))? 0 What is -3 - (2 + -1) - -4? 0 Evaluate -6 + 25 + -14 + -7 + -1. -3 Calculate -1 - (-1 - 11 - -12). -1 What is the value of -30 - -48 - (11 - 0)? 7 Calculate (-3 - 1) + (-1 - -1 - -2). -2 (-8 - -4) + (-1 - -11) 6 What is the value of 0 + 6 - 0 - 2? 4 What is the value of 6 + -4 - (-2 + 4 + 1)? -1 3 + (0 - -4 - 2) + -2 3 Calculate 1 - (-3 - -3 - -3). -2 1 + -5 - (-4 + -6 + 4) 2 What is 6 + 3 + -9 + 0? 0 What is (-1 - 9) + (85 - 80)? -5 Evaluate -2 - (-4 - -14) - -2 - -4. -6 Calculate -1 + (6 - 3) + -1 + 5. 6 -1 - (-3 + -1 + 5) -2 Calculate 0 + (0 - (-4 + 6 + 0)). -2 What is the value of (2 - 4) + (5 - -2) + -2? 3 What is 0 + (3 - 0) + (3 - 6)? 0 What is -7 + -7 + 6 + 4 + 0? -4 Evaluate 4 + -11 + 3 - -1. -3 What is (-9 - -8 - (-1 + 4)) + 6? 2 28 - 7 - 6 - 19 -4 Evaluate (3 - (6 + -3 - 1)) + 1. 2 Calculate (0 - -5) + -8 - (-1 - 0). -2 What is the value of (-34 - -43) + -6 + 2? 5 Calculate -3 - -7 - -4 - 6. 2 What is the value of (2 + 0 - 8) + 4? -2 What is the value of 2 + -1 - (3 - 1) - -2? 1 Evaluate (5 - 0) + 2 + (-10 - 3). -6 What is -4 - (-5 - 0 - -5)? -4 Evaluate 9 + 3 + (26 - 28). 10 What is the value of 0 - (3 - 1 - 5)? 3 (-6 - -2) + (7 - 4 - 2) -3 What is the value of -16 - (-11 - (14 + -14))? -5 What is 2 + -18 + 23 + -16? -9 Calculate -1 - (-2 - -5 - (8 + -1)). 3 Evaluate -2 + -5 - (-5 + -2). 0 1 + (3 - 11) + 1 + 1 -5 Calculate 2 - (-3 - (-5 + 0)). 0 What is the value of 6 - (6 - 3) - 7? -4 Evaluate -1 + (13 - 8 - 3). 1 Calculate (-1 - 6 - -8) + -6. -5 Evaluate (6 - 14 - -2) + 7. 1 Calculate -6 - ((0 - 19) + -29 + 33). 9 Evaluate 11 + 8 + -15 + -7. -3 What is 6 + 1 + -2 + (-2 - -1)? 4 -13 - 3 - -15 - (-8 + 1) 6 Evaluate -4 + 1 + 3 + 12 + -12. 0 What is -9 - (0 - 5) - -6? 2 Calculate -4 + (-8 - (-1 + -2)) + 5. -4 What is the value of (-11 - (-1 - 7)) + -2? -5 What is 1 + 15 - (-12 - -17) - 6? 5 Evaluate 0 + 5 + -5 - 3. -3 Evaluate -2 + -3 - -9 - 2. 2 Evaluate 5 + -9 + 1 - (1 - 4). 0 Evaluate -7 + 14 - (-2 + 3). 6 What is (-4 - -3 - 3) + 4? 0 Evaluate -9 - (1 - (2 + 6) - -1). -3 What is -10 - ((4 - 1) + -9)? -4 What is 7 + (-14 - 8) + 11? -4 Calculate 0 + -2 + 9 - (0 - 1). 8 Evaluate -6 + (-2 + -3 + 4 - -3). -4 Calculate (2 - 7) + (9 + -19 - -17). 2 (-4 + 3 - 2) + 12 9 What is 67 - 72 - (0 + -4)? -1 -2 + 4 + 4 + -3 + -3 0 0 - 9 - (-20 - -6) 5 Calculate -2 + -1 + -3 + 3. -3 -3 - -1 - (-6 + -9 - -6) 7 Calculate -1 + -7 + (14 - 9). -3 What is the value of 1 + -3 + 4 + -4 + -2? -4 -7 - 0 - (2 - 4) -5 Evaluate -3 - (2 - (4 - 1)). -2 Calculate -7 + (1 + -1 - (13 + -21)). 1 Evaluate -15 + (6 - (4 + -7)). -6 Evaluate 1 + 8 + -1 + (-17 - -16). 7 What is the value of 9 + -1 - (179 - 163)? -8 Calculate 0 + (-2 + 0 - 0) + 2. 0 Evaluate (8 - (16 - 7)) + 7 + -3. 3 What is -12 - (-2 - (1 - -3))? -6 Calculate (23 - 12) + -22 - -3. -8 What is the value of (0 - 3) + (-5 - (-17 + 8))? 1 Evaluate 14 - ((23 - 20) + (6 - 2)). 7 Evaluate 9 - 2 - 8 - -2. 1 What is 1 - 3 - (9 - 17)? 6 What is the value of (-6 - -2) + -14 + 30 + -4? 8 4 - (-3 - -7) - 6 -6 What is -4 - (-7 + (2 - -3)) - -5? 3 (1 - 12) + (17 - 11) + 6 1 -7 + (3 - (-8 + 4)) 0 What is -4 + -2 + 4 - -5? 3 What is the value of 8 - (10 + (-13 - -6))? 5 6 + (-6 - (-7 + 6)) 1 What is (-7 - (-10 + 8 + 0)) + 5? 0 Evaluate 6 + -2 + -1 + -1. 2 What is -2 + 5 + -7 + 3? -1 Calculate -15 + -1 - 5 - -12. -9 Evaluate 13 - (24 - (-14 + 25)). 0 What is (-3 + 12 - 6 - 10) + 4? -3 What is the value of (29 - 33) + (4 - (-1 - -2))? -1 (-2 - -2) + -3 - -2 - -4 3 Evaluate 5 - 2 - (-10 + 6) - 15. -8 Evaluate 9 + -10 + (6 - 0). 5 What is -4 + 11 + 0 - (-2 - -5)? 4 Calculate -4 + 0 - (-24 + 17). 3 What is -5 + 0 + -4 + 6 + 0? -3 Evaluate 0 - -2 - 0 - (21 - 17). -2 Evaluate 7 - (-4 - -3 - -5). 3 -3 - (-1 + 0 - (-1 + 2)) -1 What is (2 - -4 - -1) + -6? 1 Evaluate 8 + -3 + (-7 - -6). 4 -3 + 2 + -5 + 11 + -14 -9 1 + (5 - (-6 - -7)) 5 Calculate (-9 - -2) + -2 + 8. -1 Evaluate 10 - (-3 + 4 + 1). 8 Evaluate 0 + -6 + 18 + -17 + 5. 0 (5 - 2) + -3 + -4 -4 Calculate 4 + -1 + -2 + -8. -7 What is (7 - 2) + -5 - (1 + -2)? 1 Evaluate -18 + -1 + 9 + 12. 2 10 + 2 - (10 + 2) 0 What is -9 - -1 - (-63 - -66) - -4? -7 What is -1 + -3 + 5 + -2? -1 Calculate 1 + -8 - (-20 - -14). -1 What is -1 - (-8 + -3 + 5)? 5 -3 - -12 - (9 - 4) 4 Evaluate 0 - 2 - (-2 - -4 - -4). -8 Calculate 1 + -2 + -3 + 7. 3 Evaluate -12 - (9 - 15) - -2. -4 6 - (-7 + (1 + -3 - -8)) 7 10 + -4 + -2 + 1 5 What is 4 - (0 + 8) - 3? -7 Evaluate -1 + -1 + -1 + 1. -2 Calculate 12 + -7 + -1 + -1 + 3. 6 What is 1 - 2 - (-23 - -19)? 3 What is the value of 2 + -2 - (7 - 4)? -3 Evaluate 2 - (2 + 2 + 3 + -4). -1 What is the value of -6 + 2 + (-8 - -7)? -5 What is -1 - 5 - (-6 + -16 - -17)? -1 Calculate -10 + 4 - (-2 - 3) - 2. -3 -4 - (-10 - -1) - (1 - 1) 5 What is the value of (0 - -12 - 21) + 18? 9 Evaluate 4 - -1 - (0 + 3 + -4). 6 Cal	{ "pile_set_name": "DM Mathematics" }
737 (base 12) in base 15? -4a1 What is 175 (base 8) in base 7? 236 -301 (base 11) to base 9 -444 4200 (base 6) to base 14 4ac Convert 5233 (base 6) to base 11. 977 What is 13321 (base 5) in base 12? 766 Convert 20021 (base 9) to base 14. 4b09 Convert -11101101000 (base 2) to base 9. -2536 What is 2202212 (base 3) in base 10? 2021 What is -2102012 (base 3) in base 7? -5063 Convert -719 (base 13) to base 16. -4b5 Convert 21002210 (base 3) to base 12. 2bb6 What is -4617 (base 10) in base 16? -1209 Convert 155 (base 10) to base 12. 10b 101212 (base 3) to base 13 197 41 (base 15) to base 5 221 -370 (base 16) to base 5 -12010 10730 (base 9) to base 16 1bf3 What is -13352 (base 7) in base 15? -110e Convert 1188 (base 13) to base 2. 100110101110 -7445 (base 10) to base 11 -5659 -10220202 (base 3) to base 13 -13b8 1 (base 9) to base 8 1 What is -300 (base 7) in base 2? -10010011 -726 (base 8) to base 15 -215 144353 (base 6) to base 7 55500 What is 747 (base 9) in base 13? 37c -166 (base 7) to base 10 -97 Convert 2020322 (base 4) to base 15. 28e2 Convert 22132133 (base 4) to base 6. 530355 Convert -12 (base 4) to base 14. -6 What is -200 (base 8) in base 16? -80 Convert -2143 (base 14) to base 6. -42331 What is 73d (base 15) in base 7? 4522 -111001000 (base 2) to base 8 -710 Convert -12431 (base 5) to base 11. -821 Convert 2088 (base 13) to base 14. 18dc 112122 (base 3) to base 11 32a 2ca (base 14) to base 9 703 4ae (base 16) to base 4 102232 What is 232 (base 11) in base 4? 10111 Convert 113100 (base 4) to base 2. 10111010000 344a5 (base 11) to base 16 c2b6 383 (base 11) to base 13 28c What is 111334 (base 5) in base 8? 7601 Convert 12110001 (base 3) to base 16. f82 What is 101 (base 8) in base 9? 72 11123033 (base 4) to base 2 101011011001111 32021 (base 6) to base 8 10355 Convert -8035 (base 15) to base 9. -41085 Convert 10522 (base 7) to base 12. 165a -a05 (base 12) to base 2 -10110100101 What is 22030 (base 6) in base 10? 3042 53c (base 13) to base 11 745 81a3 (base 11) to base 6 122214 1001000101101 (base 2) to base 11 3550 Convert 1a13 (base 13) to base 7. 14244 What is -22106 (base 8) in base 7? -36034 6a9c (base 14) to base 3 221110111 Convert aa8 (base 11) to base 15. 5d8 -566 (base 10) to base 12 -3b2 What is 7c8 (base 16) in base 15? 8cc 2345 (base 12) to base 10 3941 Convert 144 (base 8) to base 11. 91 100101100 (base 2) to base 12 210 What is -365e (base 16) in base 13? -6448 What is -5615 (base 11) in base 10? -7397 What is 33 (base 14) in base 15? 30 Convert 3030 (base 11) to base 2. 111110111010 What is -1100011000010 (base 2) in base 16? -18c2 117d (base 16) to base 12 2711 3436 (base 12) to base 14 2186 -62a (base 11) to base 15 -358 Convert 813 (base 15) to base 14. 93c 3023 (base 7) to base 13 626 What is 370 (base 14) in base 12? 492 38e (base 15) to base 16 329 What is 1405 (base 8) in base 11? 643 Convert -8b (base 12) to base 8. -153 What is 1154c (base 15) in base 3? 2210201100 Convert 85378 (base 9) to base 2. 1101110001111111 1611 (base 7) to base 9 786 1140 (base 8) to base 2 1001100000 What is -103321 (base 4) in base 16? -4f9 Convert -1a (base 12) to base 13. -19 Convert 513 (base 6) to base 12. 139 Convert 1011 (base 7) to base 2. 101011111 Convert 1399 (base 14) to base 8. 6613 bb8 (base 12) to base 8 3274 265 (base 10) to base 15 12a Convert 766 (base 13) to base 10. 1267 Convert -2222 (base 7) to base 13. -497 242 (base 14) to base 3 121200 Convert -2363 (base 9) to base 14. -8d8 -5611 (base 11) to base 8 -16341 Convert -13001 (base 4) to base 9. -548 3604 (base 8) to base 16 784 1000000000110111 (base 2) to base 13 11c2b -84 (base 10) to base 6 -220 What is 2042 (base 12) in base 14? 13c6 Convert bbac (base 14) to base 4. 13323230 323c (base 13) to base 10 6980 Convert 209 (base 15) to base 7. 1224 What is -1640 (base 13) in base 14? -1291 What is 22000210 (base 3) in base 12? 3479 What is 585 (base 9) in base 2? 111100010 Convert 11012112 (base 3) to base 12. 1935 What is 2332 (base 5) in base 3? 110200 1013 (base 7) to base 2 101100001 What is 320a (base 16) in base 2? 11001000001010 -b420 (base 13) to base 9 -37102 2136 (base 7) to base 12 536 Convert -100100000 (base 2) to base 10. -288 Convert 6a (base 16) to base 8. 152 Convert 5457 (base 8) to base 10. 2863 Convert -24472 (base 9) to base 7. -65615 -667 (base 12) to base 15 -42d Convert -10163 (base 8) to base 7. -15164 What is -54ce (base 15) in base 3? -220122112 -23534 (base 6) to base 5 -102232 1021101202 (base 3) to base 12 12618 What is 564 (base 9) in base 5? 3323 What is -784 (base 15) in base 9? -2287 1044 (base 14) to base 10 2804 What is 962a (base 14) in base 2? 110010100110110 What is -a765 (base 15) in base 9? -53525 13112 (base 5) to base 16 408 What is -4446 (base 13) in base 12? -5616 What is -782 (base 14) in base 13? -8a4 Convert 1469 (base 10) to base 4. 112331 What is -1123 (base 5) in base 8? -243 What is -a214 (base 11) in base 3? -200121111 Convert 32230 (base 5) to base 8. 4216 What is -524d (base 14) in base 13? -65bb What is -14a31 (base 13) in base 7? -221635 What is -130103 (base 7) in base 4? -11313332 What is 13 (base 5) in base 9? 8 1111011001101011 (base 2) to base 16 f66b What is 6531 (base 7) in base 12? 1419 30013 (base 4) to base 2 1100000111 Convert -4337 (base 10) to base 6. -32025 -3660 (base 9) to base 2 -101010100111 -6253 (base 7) to base 2 -100010010010 What is -115b3 (base 14) in base 13? -16338 Convert -221232 (base 4) to base 13. -12a5 41c (base 14) to base 9 1100 Convert -21232 (base 6) to base 12. -1818 -9657 (base 13) to base 9 -31546 What is -17291 (base 10) in base 6? -212015 Convert -131312 (base 4) to base 2. -11101110110 Convert -10100001110 (base 2) to base 14. -686 What is 88278 (base 9) in base 16? e4b9 23443 (base 10) to base 15 6e2d Convert 287 (base 16) to base 5. 10042 Convert -131311 (base 4) to base 11. -1486 Convert -556 (base 15) to base 10. -1206 4231 (base 6) to base 16 3bb Convert -341003 (base 5) to base 16. -2ee3 Convert -1054 (base 10) to base 16. -41e What is -100101111001 (base 2) in base 6? -15121 a41 (base 12) to base 10 1489 Convert -1121222202 (base 3) to base 7. -162332 Convert 194 (base 11) to base 15. ee What is -22740 (base 8) in base 13? -454b -30120 (base 4) to base 5 -11132 5454 (base 13) to base 12 6956 Convert 110010100111011 (base 2) to base 15. 7a2a What is -36514 (base 9) in base 10? -24475 7872 (base 13) to base 8 40670 Convert -33312 (base 4) to base 3. -1101120 What is 10134010 (base 5) in base 13? 2c0b1 -7a15 (base 11) to base 3 -112110111 What is -459a (base 14) in base 3? -121120212 -1127 (base 9) to base 14 -439 1222424 (base 5) to base 8 55701 -106 (base 10) to base 2 -1101010 22574 (base 9) to base 8 35314 What is -17527 (base 8) in base 15? -259d Convert 481 (base 10) to base 4. 13201 Convert -38d2 (base 14) to base 10. -9984 What is -240 (base 15) in base 10? -510 What is -4663 (base 9) in base 11? -2665 -112216 (base 7) to base 13 -914b What is 142014 (base 5) in base 4? 1123330 -729 (base 12) to base 14 -545 9a50 (base 12) to base 11 118a2 -13930 (base 12) to base 5 -1333002 What is 2c1 (base 13) in base 2? 111101111 What is 10111000111101 (base 2) in base 4? 2320331 10100111110001 (base 2) to base 6 121413 What is -71d (base 15) in base 3? -2012101 48112 (base 9) to base 11 22194 Convert -3318 (base 10) to base 11. -2547 What is -10100101011111 (base 2) in base 6? -121011 What is -310 (base 6) in base 7? -222 37612 (base 8) to base 14 5cdc What is -22443 (base 5) in base 3? -2020010 Convert -645 (base 13) to base 4. -100233 What is -110010010110 (base 2) in base 16? -c96 689 (base 11) to base 9 1114 -128 (base 13) to base 7 -410 -3bca (base 13) to base 11 -6523 What is -3686 (base 13) in base 2? -1111000100011 Convert -540 (base 9) to base 14. -237 6c1 (base 13) to base 14 5d9 What is 1000111100111 (base 2) in base 3? 20021202 3132 (base 11) to base 15 1369 What is 595 (base 11) in base 6? 3141 What is 43401 (base 8) in base 3? 220221020 What is 123464 (base 8) in base 16? a734 Convert -1334311 (base 5) to base 9. -41586 Convert 31122 (base 4) to base 6. 3550 What is -3310 (base 6) in base 12? -536 -50417 (base 8) to base 9 -31416 What is 8271 (base 12)	{ "pile_set_name": "DM Mathematics" }
*5 - 15k*4 + 20k2 = 0? -2, 0, 1 Let s(c) be the second derivative of c4/12 - c*3/3 + 2c*2 + 2c. Let f = 7 + -1. Let d(a) = -1. Let t(x) = fd(x) + 2s(x). Factor t(u). 2(u - 1)2 Let s(o) be the third derivative of 0o - 1/180o5 - o2 - 1/72o*4 + 0 + 0o*3. Factor s(c). -c(c + 1)/3 Let o(y) be the second derivative of -y*5/80 + 3y*4/16 - 9y*3/8 + 27y*2/8 + 25y. Determine a, given that o(a) = 0. 3 Let f(l) be the third derivative of l5/300 - l4/120 - 35l2. Let f(c) = 0. What is c? 0, 1 Let v(s) = s3 + 1. Let a(c) = c4 + c3 - c2 + 1. Let z(k) = -2a(k) + 2v(k). Solve z(h) = 0. -1, 0, 1 Let s(g) be the second derivative of 1/40g*5 + 0g*2 + 0 - 1/48g*4 + 2g - 1/24g3. Factor s(o). o(o - 1)(2o + 1)/4 Let l(c) be the third derivative of c6/1440 + c5/240 + c4/96 - c3/2 - 2c2. Let g(u) be the first derivative of l(u). Let g(x) = 0. Calculate x. -1 Let y = -5 + 8. Factor 0k5 + k4 - 4k3 + 1 + 2k*y - 2k2 + k5 + k. (k - 1)*2(k + 1)*3 Let w be (-2)/7 + (-6)/(84/(-53)). Let -wk*5 + 9/2k*3 + 0 + 5/2k*2 - 5/2k*4 - k = 0. Calculate k. -1, 0, 2/7, 1 Let w(x) = -14x*3 - 7x*2 + 12x. Let y(i) = -57i3 - 27i*2 + 48i. Let z(b) = -21w(b) + 5y(b). Find l such that z(l) = 0. -2, 0, 2/3 Suppose -3 = -4g + 2o - 13, 2g + 2o - 10 = 0. Let q = 1 - -1. What is i in g + 0iq - 1/3i + 1/3i3 = 0? -1, 0, 1 Let x(q) = -q2 + 8q - 7. Let a be x(7). Determine i so that -3i + 4i - 2i3 - 1 + ai3 + i2 + i3 = 0. -1, 1 Let h(x) = -x3 - 4x2 + 5x + 3. Let v be h(-5). Let y(z) = -z*2 + 3z + 1. Let b be y(v). Factor -2o + b + 1 - o + o2 + 0o. (o - 2)(o - 1) Let k(o) = -8o. Let t(w) = -w*2 + 8w. Let i(y) = 3k(y) + 4t(y). Factor i(h). -4h(h - 2) Let m = -48/7 - -446/63. Solve 2/3w2 + 2/3w + m + 2/9w3 = 0 for w. -1 Suppose 4n - 20 = 0, -t + 3n - 23 = -2n. Let m be t - 0 - 0/(-2). Factor mu4 + 6u*5 - 5u*4 + 2u*2 + 10u*3 + 17u*4. 2u*2(u + 1)*2(3u + 1) Let t(i) = 40i*3 + 40i*2 + 5i - 5. Let x(s) = -s3 - s2 - s - 1. Let m(b) = t(b) - 5x(b). Factor m(n). 5n(3n + 1)(3n + 2) Let l(c) be the third derivative of c8/1120 + c7/280 + c*6/240 + 5c*3/6 - 4c*2. Let x(u) be the first derivative of l(u). Factor x(k). 3k*2(k + 1)*2/2 Factor 4/7 + 2/7m - 4/7m2 - 2/7m*3. -2(m - 1)(m + 1)(m + 2)/7 Let n(o) be the third derivative of 1/12o4 - 1/12o*5 - 1/210o*7 + 1/30o*6 + 0 + 0o + 0o3 - 4o*2. Solve n(t) = 0. 0, 1, 2 Suppose -2f = -4f. Let o(p) be the second derivative of -2p + fp3 + 0p*2 - 1/54p*4 + 0. Solve o(l) = 0 for l. 0 Let d be ((-12)/(-8) - 1)/12. Let m(f) be the second derivative of 0 - 1/40f*5 + 1/168f*7 + f + 0f*4 + 0f*2 + df*3 + 0f*6. Factor m(u). u(u - 1)*2(u + 1)*2/4 Let p(v) be the second derivative of -1/6v*5 - 3v - 1/2v2 - 2/3v*4 + 0 - 4/3v*3 - 1/60v*6. Let i(q) be the first derivative of p(q). Factor i(z). -2(z + 1)(z + 2)2 Suppose 3 + 0 = i. Let 6/7n - 2/7 + 2/7ni - 6/7n2 = 0. What is n? 1 Let c(v) be the second derivative of v9/1008 + v8/140 + v7/56 + v6/60 - v3/3 - 3v. Let w(h) be the second derivative of c(h). Factor w(u). 3u*2(u + 1)*2(u + 2) Let u(a) be the third derivative of a6/30 + a5/60 - a4/6 + a3/3 + 2a2. Let c(n) be the first derivative of u(n). Suppose c(y) = 0. Calculate y. -2/3, 1/2 Suppose 4d - 26 = 5p, -11p = 2d - 7p. Let -2/3wd - 4w*2 + 8/3w - 2/3 + 8/3w3 = 0. What is w? 1 Let v(l) = -l2 + 2l + 4. Let w(k) = -2k2 + 4k + 9. Suppose 4r - 6 = -3u - 2u, 0 = -2r - 2u + 4. Let q(y) = rw(y) - 9v(y). Factor q(g). g(g - 2) Suppose 0 = -9f + 7f + 12. Let j(i) be the third derivative of 0i + 1/80i*5 + 2i*2 - 1/480i*f - 1/32i*4 + 1/24i3 + 0. Factor j(x). -(x - 1)3/4 Let a(v) = v3 + v2 - v - 1. Let o(g) = 13g3 - 18g - 5. Let y(z) = -3a(z) + o(z). Let t(f) = -f3 - 1. Let s(u) = 4t(u) + y(u). Factor s(c). 3(c - 2)(c + 1)(2c + 1) Let x(f) be the third derivative of -f7/630 + f6/180 - f*5/180 + 3f*2. Find c such that x(c) = 0. 0, 1 Suppose -2 - 2 = -y. Factor 0k*2 - 2k3 + k2 + yk3 - k4 - 2k. -k(k - 2)(k - 1)(k + 1) Let f(o) be the first derivative of 3o*8/28 + 11o7/70 + o6/20 - o*2/2 - 5. Let b(r) be the second derivative of f(r). Factor b(v). 3v*3(3v + 2)(4v + 1) Let u be (-6)/(-9)3/2. Let i be -2 - (-3 + -2 + u). Find w, given that iw + 2/3 - 2w*3 - 2/3w*2 = 0. -1, -1/3, 1 Factor 2 + 3y*2 + 2y*3 - 2y - 10y2 + 5y*2. 2(y - 1)*2(y + 1) Let x be (-39)/(-18) - 12/18. Factor 3y2 - xy*4 + 0 + 0y + 3/2y3. -3y*2(y - 2)(y + 1)/2 Let u(h) be the third derivative of -h11/110880 - h10/12600 - h9/5040 + h5/60 - 2h*2. Let c(v) be the third derivative of u(v). What is x in c(x) = 0? -2, 0 Let t(i) be the first derivative of i - 4 - 5i*2 + 25/3i*3. Factor t(l). (5l - 1)*2 Let f(z) = -z - 4. Let t be f(-6). Factor -2m - 4m3 - 4m*2 + 0m2 - m4 - 4m2 + 3m*t. -m(m + 1)*2(m + 2) Let p(a) be the third derivative of a5/360 + a4/24 + 2a3/9 - 28a*2. Determine t, given that p(t) = 0. -4, -2 Let h(k) be the third derivative of 0 + 1/108k*4 + 0k*3 + 0k + 1/270k5 + 2k*2. Factor h(i). 2i(i + 1)/9 Determine i so that 32i*3 + 6i + 9i2 - 64i*3 + 32i*3 - 3i4 = 0. -1, 0, 2 Let i(l) be the second derivative of l6/45 - l5/10 + l4/18 + l*3/3 - 2l*2/3 - 13l. What is h in i(h) = 0? -1, 1, 2 Let r = -3/125 + 423/2000. Let z = 17/80 + r. Let -2/5d + zd2 + 0 = 0. What is d? 0, 1 Let i(k) be the third derivative of k6/80 - k5/80 - k4/16 + k*3/8 - 25k*2. Factor i(l). 3(l - 1)(l + 1)(2l - 1)/4 Let t(f) = -f2 + 2f - 7. Let y be t(-6). Let w be (-10)/y - (-62)/22. Factor 4/9uw - 4/9u*2 + 2/9u*4 - 2/9u*5 - 2/9u + 2/9. -2(u - 1)3(u + 1)*2/9 Let m(v) = -4v*4 + 6v*3 + 2v*2 - 6v. Let j(h) = 8h4 - 13h*3 - 3h*2 + 13h. Let f(u) = 2j(u) + 5m(u). Suppose f(g) = 0. What is g? -1, 0, 1 Factor -r*4 + 2r*3 + 4r*4 - 2r + 2r2 - 2r*4 - 3r*2. r(r - 1)(r + 1)(r + 2) Let o(d) be the first derivative of -d*7/21 + 4d6/15 - d5/2 + d*4/3 - d + 9. Let t(b) be the first derivative of o(b). Suppose t(h) = 0. What is h? 0, 1, 2 Let z be (-3)/(((-18)/4)/3). Suppose 0y + 0 + zy2 - 2y - 4 = 0. Calculate y. -1, 2 Let s(w) be the third derivative of 0 + 0w3 + 1/40w*6 - 1/70w*7 + 0w*4 + 0w + 4w2 + 1/20w*5 - 1/112w*8. Factor s(u). -3u*2(u - 1)(u + 1)2 Let y(u) be the first derivative of -4u*3 + 21u*2/2 - 9u - 1. Solve y(f) = 0. 3/4, 1 Let b = -4 - -1. Let u(h) = h + 3. Let a be u(b). Factor at5 - 2t*5 + 0t - t*4 - 3t*4 + 2t + 4t2. -2t(t - 1)(t + 1)*3 Let z(f) be the first derivative of -2 + 1/240f*5 + 1/24f*3 + 0f + 1/48f4 + 1/2f2. Let c(t) be the second derivative of z(t). Factor c(g). (g + 1)2/4 Let x be 4/22 - 42/(-11). Suppose 7k = xk. Determine f, given that -2/3f3 + k - 2/3f + 4/3f2 = 0. 0, 1 Suppose -10 = 4x - 38. Factor -o + o*3 + 2 - x + 5. o(o - 1)(o + 1) Let t(y) be the first derivative of 1/2y*2 + 4/3y*3 - 1/4y*4 + 4 - 4/5y*5 + 0y. Factor t(a). -a(a - 1)(a + 1)(4a + 1) Let p(b) = -b*3 - 18b*2 + b + 21. Let s be p(-18). Factor 0 - 8/9t*2 - 2/9t - 2/9t5 - 4/3t*s - 8/9t*4. -2t(t + 1)4/9 Let y(c) be the second derivative of c6/120 - c5/10 + c4/2 - 4c*3/3 + 3c*2/2 - 3c. Let q(n) be the first derivative of y(n). Factor q(i). (i - 2)*3 Let i(l) = -3l*2 + 10l + 1. Let p(x) = -7x2 + 21x + 1. Let a(c) = 9i(c) - 4p(c). Let a(w) = 0. Calculate w. -5, -1 Factor 0x2 + 3/4x*3 + 3/4x*5 - 3/2x*4 + 0 + 0x. 3x3(x - 1)*2/4 Let c be 53(-12)/(-45). Factor -4t*2 - 3t*3 + 2t*2 - 3t*c - 4t*2 + 12t*3. -3t*2(t - 2)(t - 1) Let h be -920/(-45)-3. Let y be (6/(-1))/(60/h). Solve yg*2 - 4/5g - 2/5 = 0. -1/3, 1 Let i(n) be the first derivative of -3 + 0n5 - 1/42n*4 + 2n + 0n2 + 0n*3 + 1/105n*6. Let g(u) be the first derivative of i(u). Factor g(b). 2b*2(b - 1)(b + 1)/7 Let k = -6 - -8. Suppose -2q*3 + 0q2 + q2 - 4 + 2q + 3	{ "pile_set_name": "DM Mathematics" }
2 + 2 - 1) as lh3 + ch + p + mh2 and give l. 3390 Rearrange (3n + 3n - 4n)(5 - 2 + 1)(-738n + 377n - 459n) to c + in + dn2 and give d. -6560 Express -772b - 1315b - 15b - 2499b as l + mb and give l. 0 Express (-3 + 1 + 4)(-291 + 151 + 191)(-11x - 27x + 10x) as ix + c and give i. -2856 Rearrange 14141s + 6428s - 1108s to the form v + is and give i. 19461 Express 0f2 - 174 - 5f*3 + 8f*2 - 8f*2 - 244 as bf + n + df2 + yf*3 and give b. 0 Rearrange (-1945t - 358t2 + 1945t)(6t - 9t - 2t*2 + 14t) to a + vt4 + yt*3 + kt + it2 and give k. 0 Rearrange 2364914m*4 + 2m*2 - 3 - 2364905m*4 - 6m - 2m3 - m2 to xm*2 + um*4 + w + am + sm3 and give u. 9 Express (12w*2 - 68w*2 + 7w*2)(-3w2 + w2 - 5w*2)(-5 + 3 + 3) in the form iw + zw*2 + m + qw*3 + pw*4 and give p. 343 Express -703n*3 + 18495n*2 - 18496n*2 - 5n - 2 - n + 4n as pn*3 + on + qn2 + k and give q. -1 Rearrange -39 - 23a + 175 - 42 + 3a2 - 53 to the form na + k + ua2 and give n. -23 Rearrange -5o*3 - 18o + 11823o4 - 23639o*4 + 3 + 11818o*4 to the form so*3 + q + do*4 + po*2 + co and give s. -5 Rearrange -26s + 9s + 16s4 + 404356s*2 - 404357s*2 - 3s*3 to the form cs*3 + j + qs + ds2 + is*4 and give d. -1 Express (-6t + 42 - 42)(-4t + 5 + 2t - 1776t*2 + 1738t*2) in the form nt*3 + u + yt + dt2 and give y. -30 Express (-3x + 1 - 1)(-3x - 2x + 3x) - 1641x2 + 325x*2 - 674x*2 as sx + u + gx2 and give g. -1984 Rearrange -w + 7 - 11662w*3 + 11618w*3 + 87w*2 - 7 to ow*3 + gw*2 + m + dw and give d. -1 Express -1043 + 523 + 7442h + 520 in the form ph + a and give p. 7442 Rearrange (2t - 8 - t - 6t)(10t*2 + 54t + 51t - 175t) to wt2 + ft*3 + dt + n and give d. 560 Express ((41 - 10 + 14)(-2y*2 + 2y*2 + 2y2) + y2 - 3 + 3)(-42y - 10y - 36298 + 36302) in the form i + dy*3 + py*2 + qy and give p. 364 Express -x + 0x - 4x + 3 - 3 - x + 0x + x - 3x + (-x + 2x + x)(5 - 5 + 1) + 3 - 3 - x - 4 - x + 4 + 3207 - 3207 + 96x in the form ax + j and give a. 88 Express 61w - 3w*3 + 16w*2 - 59w - 769w4 + 767w*4 - 2w*3 - 2 as cw*2 + iw*3 + jw*4 + p + uw and give u. 2 Rearrange (3b3 - 2b*3 - 3b*3)(734 - 519 - 347)(5 - 5 + 13b) to the form rb2 + ob*4 + ab + h + db3 and give o. 3432 Express (2x*4 - 4x + 4x)(3312 - 1282 - 3807 - 25980) in the form jx4 + ax + sx2 + yx*3 + b and give y. 0 Rearrange -188 - 8100d + 99 + 89 to q + md and give m. -8100 Express (0 + g + 0)(g + 2g + 12g)(-16 - 5 - 122) as x + qg + rg2 and give r. -2145 Express (40x - 868x3 - 37x + 3 + 74x2 + 881x*3)(-3 + 3 - x) in the form nx2 + px + ix4 + ax*3 + m and give i. -13 Express -8a*4 + 91a*3 - 7a - 752a3 + a2 - 3a + 660a3 in the form qa*2 + ba + f + pa3 + ia*4 and give q. 1 Express -30 + 24h*2 - 52 - 40 + 137 - 2h in the form vh + u + lh2 and give l. 24 Rearrange (-n2 + 2n2 + n2)(31 + 26 + 2560n - 57) - 163n + 28n2 + 163n + n*3 to yn*2 + cn*3 + gn + x and give c. 5121 Rearrange 120505h2 - 65152h*2 - 64237h*2 to the form s + qh*2 + ah and give q. -8884 Rearrange (0l - 2l + 4l)(1 - 1 - l) + l*2 + 15l*2 - 5l*2 + 4l*2 - 17 - 5l*2 + 64 to the form ml*2 + y + cl and give y. 47 Rearrange -3 - s + 3 - 4s + 5s + s + (3 + 1 - 6)(-s - s + s) + 3319s + 262s + 2578s + 8657s + 6219s to y + ls and give l. 21038 Express -33803 + 33803 + 15838x - 3294x as fx + o and give f. 12544 Express -6276h - 2106h + 332h - 2862h in the form mh + q and give m. -10912 Express -62 + 5407t*2 - 2t + 2t - 5401t*2 as zt + lt2 + k and give l. 6 Express -99 - 1905d + 10d2 + 3747d - 1842d as cd*2 + l + yd and give c. 10 Express -3r4 + 0r4 - r4 + (77 - 77 + 45r)(-3r3 - 13r3 - r3) as x + mr3 + cr*2 + sr + gr4 and give g. -769 Express (-3g*2 + 3g*2 + 3g*2)(3 - g - 3) + (68 + 20g2 - 68)(-2g + 4g + g)(1 + 7 + 1) in the form jg*3 + m + og + zg2 and give j. 537 Express 73p + 2p2 + 21p*3 - 5p*3 - 71p in the form mp3 + ip + kp2 + w and give m. 16 Express (2p + 0p - 3p)(323193p*3 + 2 - 81 - 323205p*3) in the form g + bp + qp2 + zp*4 + lp*3 and give b. 79 Rearrange -972n + 970n - 46n*2 + 51n*2 - 9n*4 to the form hn*3 + dn*4 + pn + g + jn2 and give d. -9 Rearrange -1463w*3 + 1464w3 + 7 - 5 + w2 - 6w2 + 5w to the form fw + sw*3 + h + yw*2 and give y. -5 Express (6 + 0 - 4)(-4x + 5x - 4x) + x - 4x + 2x - 336 + 336 + 41x + (-4 + 4 - 1)(8 - 2x - 8) in the form fx + u and give f. 36 Express (-5u - 14 + 14)(6u + u - 5u)(-21 - 19 + 33) + u*2 + 3u - 3u as p + su + hu2 and give h. 71 Express 25p*4 - 88p*4 + 2p + 59p4 - 2p*2 + 34 in the form dp*3 + zp*4 + w + fp*2 + xp and give f. -2 Rearrange 51o - 178o - 89 + 66o - 3o*2 + 45o to the form po2 + n + mo and give n. -89 Rearrange -2w3 + 5w + 302w2 - 3 + 413w*2 - 763w*2 to the form ow + yw3 + g + fw*2 and give g. -3 Express (17 - 17 - 16z)(46 - 85z*2 - 46) + 0z*3 - 2z*3 + 0z*3 + (-z + 0z + 0z)(-z2 + z2 + 2z2) as nz*3 + u + rz + hz2 and give n. 1356 Express (-4 + 6 + 5)(-41 + 57b + 21b - 90b) in the form v + qb and give v. -287 Rearrange (-57 - 873 - 2669)(-3h2 - h2 + 2h2) to rh + p + th2 and give t. 7198 Express (-9 + 3 - 7)(v + 1 - 1)(36 - 18 - 2) in the form rv + g and give r. -208 Express 2s3 + 1204 + 1382 + 201s*2 - s - 202s*2 in the form bs*2 + ts*3 + rs + y and give r. -1 Rearrange 1993483 + 2d4 + 127d*2 + 66d*2 - 1993484 + 3d to id + sd*3 + rd*2 + jd*4 + t and give t. -1 Express -140785l*4 - 23l*2 - 427 + 10l*2 + 140784l*4 + 11l*2 in the form kl*4 + dl + gl3 + p + ml*2 and give m. -2 Rearrange (-3c + 3c + 2c)(-3c + 3c - c)(4876 - 4931 - c - 42124) to uc2 + yc + b + wc3 and give u. 84358 Rearrange -1 - 21961z - 68 + 135 - 66 to mz + r and give m. -21961 Rearrange 4513484 - 832d*2 + d - 4513484 to f + wd*2 + id and give w. -832 Rearrange (1 - 5z - 1)(-5191z3 + 3z - 4295z3 - 2099z*3 - 3z) to iz2 + kz*3 + rz*4 + g + nz and give r. 57925 Rearrange (-4f + f + 0f)(2f*2 - 4 + 4) + (-2 + 2f + 2)(-157f*2 - 1506f*2 - 203f*2) to yf + o + jf3 + wf*2 and give j. -3738 Rearrange (7 + 2 + 8 + 13)((0h + 2h*3 + 0h)(-2h + 2h + 2h) - 5h4 - 6h*4 - 6h*4) to the form g + ih*4 + kh + bh3 + uh*2 and give i. -390 Express -170h - 321h - 1761h - 46 + 46 in the form uh + m and give u. -2252 Express -9s + 5s - 4 - 7 + 17 as cs + u and give c. -4 Rearrange -2f + 615f*2 + 160f*3 - 513f*3 + 355f*3 to the form c + yf*2 + of*3 + nf and give o. 2 Rearrange (-132 + 8054 + 7566 + 18617)(-1 + 1 - p) to the form gp + c and give g. -34105 Rearrange -1272c + 5c*2 + 1271c - 10c3 - 88c*3 to the form kc*2 + yc + g + nc3 and give n. -98 Express 25d*4 + 131d*4 - 11d4 + (d2 - 2d2 - d2)(6 + 1 + 3)(2d*2 - 2d2 - d2) as vd3 + md*4 + w + ad*2 + rd and give m. 165 Express -1989x2 + 5913x*2 - x + 3069x*2 + 1 + 795x*2 as sx + g + hx2 and give h. 7788 Rearrange 375f*2 + 14f - 368f2 + f4 - 109f to the form sf2 + mf*3 + d + bf + gf4 and give g. 1 Rearrange -12 + 3j*4 + 209j + 9 + 5 - 190j - j4 - 30j3 + j2 to the form bj + fj*4 + c + sj*2 + oj*3 and give o. -30 Express 152j - j*3 + 93 + 44j - 194j as vj*3 + r + sj*2 + pj and give p. 2 Rearrange ((2 - 3 + 0)(1 + 2c - 1) + c + 10c - 8c - 3)(7377 - 25938 + 10545) to w + ac and give w. 24048 Express 3089605 - 5757f - 3089605 as tf + p and give t. -5757 Rearrange 17 + 12j2 - 17 + (j - 3 + 3)(j - 55 + 55) to kj2 + wj + a and give k. 13 Rearrange -2j3 + j2 + 7153 - 21470 + 7152 + 18j4 + j3 - 4j + 7155 to fj + gj2 + c + uj*3 + qj*4 and give g. 1 Express (-209o + 525o - 245o + 6)(1 + 0 - 3)(-3 + 0 + 2) in the form r + t*o and give r. 12 Re	{ "pile_set_name": "DM Mathematics" }
= -328/395 + 34/79. Let z = 4.2 + -4. What is the second biggest value in n, z, 43? z Let z be (-11 - 1)/(3/(-96)). Let s = -28415/74 + z. Let m = 79/370 - s. What is the second smallest value in m, -5, 1.1? m Suppose 2s = -15 + 9. Let z(y) = -5y - 11. Let f be z(s). Let g be (f/14)/((-18)/(-14)). Which is the second biggest value? (a) 4 (b) -4 (c) g c Let n = -0.461 - 0.939. Which is the third smallest value? (a) n (b) 1 (c) 5 c Let r = -537/5 - -1069/10. What is the third smallest value in r, 16, 0.18? 16 Let x = -52.062 - 1.038. Let l = x - -53. Suppose 3b = 2o - 50, 4o + 30 = -2b - 30. What is the biggest value in -1/11, b, l? -1/11 Let g = -124.86 + 125. Which is the third smallest value? (a) 4 (b) -0.4 (c) g (d) -0.2 c Let f = -7353 + 602985/82. Let h = 1/41 + f. Which is the second biggest value? (a) h (b) 3/7 (c) -0.6 b Let x(i) = -2i + 2. Let t be x(2). Let v = -1.59 + 3.59. Which is the second biggest value? (a) v (b) 3 (c) t (d) -0.3 a Let s = -9/8 + 133/104. Let y(x) = x2 + 3x - 6. Let j be y(-5). Let u be (j - 2) + 2 + 0. What is the smallest value in -2, s, u? -2 Let f be (3/2105)/((-2)/(-7)). Which is the third biggest value? (a) f (b) 3/4 (c) -0.2 (d) -3/7 c Let l = 2161.06 + -2161. Let q = 5 + -1. What is the smallest value in l, 3/7, q? l Suppose 0 = -2v + 5 + 5. Let t be 8/(-28)84/(-6). Which is the second biggest value? (a) v (b) t (c) -1/4 b Let s = -916/21015 - 2/2335. Which is the biggest value? (a) 1/2 (b) -1/4 (c) s (d) 1/8 a Suppose 2c + 1 = -7. Let n = 244 - 471. Let t = n - -225. What is the second smallest value in t, c, -3? -3 Let a be ((-8)/(-70))/(2 + (-24)/10). What is the third smallest value in 3, -1/5, a? 3 Let x = -261 - 49. Let t = x - -308. Let k = -12 - -7. What is the third smallest value in k, t, 3? 3 Let b = 4089 + -4090. Suppose -v + l = 3l, 0 = -2v + l - 10. What is the third smallest value in b, v, -0.03? -0.03 Let j = 274 - 263. Which is the second smallest value? (a) -0.2 (b) j (c) -2 a Let m = 0.018 - 4.618. Let p = 10 + m. Let q = p - 5. Which is the second smallest value? (a) 2/7 (b) -6 (c) q a Let h = -191.8 - -220. Let p = h + -28. Let x = p - 4.2. What is the second smallest value in x, -2, -2/9? -2 Let u = 0.005 - 0.905. Let x = u - -0.5. What is the fourth smallest value in -6, -1/3, 5, x? 5 Let y = -5.9 + 3. Let i = y + 1.9. Which is the second biggest value? (a) 2/23 (b) 1/12 (c) i b Let j = 10.87 - -0.13. Let g = 5 + j. Let f = g + -16.3. What is the third smallest value in 0.5, f, -0.4? 0.5 Let b = -0.13 - 9.87. Let z = b - 0. Let n = 9.7 + z. What is the biggest value in n, -4, 4? 4 Let v = 4.8 + -2.8. Let w = 0.4 - 0.3. Which is the second smallest value? (a) w (b) v (c) 0.3 c Let x be (-290)/42 - (-108 + 101). Let n be (-36)/10 - 6/15. What is the smallest value in 4, n, x? n Let z = -45 - -46. Let i be 2-2(z + -2). Which is the biggest value? (a) -3 (b) i (c) -7 b Let m = 2.596 + -2.796. Which is the third biggest value? (a) m (b) -71.1 (c) -0.5 b Let s = -2.38 + 1.98. What is the third smallest value in 38, -4, s? 38 Let r(z) = -3z - 16. Let y be r(-6). Let v be -4 + 8/y-5. Let j be v/11 + -11 + 13. Which is the smallest value? (a) 2/3 (b) j (c) 0.2 b Suppose 70x - 58x = -12. Which is the biggest value? (a) x (b) 0.4 (c) 1 (d) -13 c Let b = -36 - -42. Let c be -4 - 4/(-1) - b/8. What is the second smallest value in c, -0.7, 2/3? -0.7 Let j = 901 - 1803/2. What is the third biggest value in 4, -1.1, -4/3, j? -1.1 Let s = 41.6 + -42.1. Which is the third smallest value? (a) s (b) 0 (c) 3/10 (d) 5 c Let f = 53.9 + -49. Let x = 0.1 + f. Let d = x - 0. Which is the third smallest value? (a) d (b) -4 (c) -3 a Let j = -4 + 2. Let s = j + 2.3. Let d be -14/(8 - 7). Which is the third biggest value? (a) s (b) d (c) -0.3 b Let u = 4.8 + -0.8. Let r = -2.8 - -16.8. Let g = -18 + r. What is the third smallest value in g, -3/7, u? u Let t be (-30)/(-20)2/3. Let f be (t/7)/((-12)/(-21)). Which is the third smallest value? (a) 1 (b) 2 (c) f b Let s = 439.08 + -440. Which is the fourth biggest value? (a) -3 (b) s (c) -4 (d) -2/5 c Let g = 0.33 - 0.4. Let s = g - 0.05. Let i = s - -7.12. Which is the third smallest value? (a) -0.1 (b) i (c) 5 b Let l be ((-10)/14 - -1) + 1341/(-63). Let v be 70/2012/l. Which is the second smallest value? (a) 5 (b) -5 (c) v (d) 7 c Let k = -3.1 - -3.1. Let r be (-1)/10 + (-4)/10. What is the biggest value in -5, r, k? k Suppose -d + 480 = 11d. Suppose d = -7r + 5. What is the third biggest value in r, -1, -3? r Let q = 23.52 - 23.02. Which is the fourth biggest value? (a) -4 (b) 86 (c) q (d) 4 a Let x = -1208 + 1204. Let k be 1(1 - -1)/(-2). Which is the third smallest value? (a) k (b) -3 (c) x a Let v = -381.1 - -362. Let l = 19 + v. What is the second smallest value in 4, 0, l? 0 Let x = -15.1 - -14.8. Which is the smallest value? (a) -2 (b) x (c) -6 (d) 7 c Let l = 0.12 + -5.12. Let g = -110 + 115.4. Let s = g + l. Which is the biggest value? (a) s (b) -2 (c) 2/9 a Let z = -2.23 + -0.77. What is the third biggest value in z, 0.3, -0.023? z Let r be 16/(-63/(-189)). Let u be (16/r)/((-1)/3). Which is the third smallest value? (a) 5 (b) u (c) 3/7 a Let n = -6 - -7. Let s be n + (-6)/9 + 1. What is the second smallest value in 1, -0.2, s? 1 Let d = -4/11 + 19/22. Let w = 13 + -9. What is the smallest value in -0.3, w, d? -0.3 Let x = 11 + -52. Let b = x - -45. What is the third smallest value in -3, 2/51, b? b Let b = 0 + 0.1. Let x(q) = 17q. Let v be x(3). Let y be (-9)/3 + v/18. What is the second biggest value in b, -2/5, y? y Let r be ((-91)/(-2))/(-13) + 6. What is the second biggest value in 0, r, -1? 0 Let i = 0.86 - -0.14. Which is the third smallest value? (a) -17 (b) i (c) 0.4 (d) -0.2 c Let r = -0.06 - 0.04. Which is the second smallest value? (a) -0.3 (b) 50 (c) r c Let n = -671/6384 + 3/304. Suppose -2m + 10 = -3z, 50 = z - 6z - 5m. Let c be (1 - (-3)/z)/((-3)/(-6)). What is the third biggest value in -2, n, c? -2 Let n = 0.11 + 0.02. Let u = n - 9.13. Let i = u + 9.5. What is the biggest value in i, 2/5, 5? 5 Let d = 56.5 - 95.5. Which is the second biggest value? (a) -3/2 (b) d (c) -6 c Let s = 1.099 + -1.199. Which is the third biggest value? (a) -18 (b) s (c) 2/17 a Let h(o) = o*2 + 23o - 56. Let p be h(-25). Let r be ((-1200)/52)/p + -4. Which is the second biggest value? (a) 4/9 (b) 2/9 (c) r b Let q = -3.6 - -2.1. Let m = q + 1. Let b = 0 + m. What is the second biggest value in b, -5, 6? b Let f = -39 + 48. Let j = f + -9.3. Let i be (0 + (-6)/(-333))3. What is the second smallest value in j, -2, i? j Let f = 6112 + -12227/2. Let i = 44/105 + 8/21. Which is the second biggest value? (a) 1/4 (b) f (c) i a Let n = -793/3140 + 2/785. Which is the second smallest value? (a) -0.5 (b) n (c) -27 a Let y be (-2)/((2 + 7)/(-1)). Let g = 5.13 - 5. What is the biggest value in -0.2, y, g? y Let w = 50.7 - 52. Let r = -1.2 - w. What is the third biggest value in 4, r, 5? r Let f(q) = -6q*3 + 5q3 + 9 - q2 + 4q2 + 2q. Let x be f(4). Let v = -0.4 + 0.2. Which is the smallest value? (a) -1/8 (b) v (c) x b Let i be -1 + 1 + (-6)/14. Let v be (1 + -3)/(10 + (-11 - -3)). Which is the second smallest value? (a) i (b) -3 (c) v c Let j = 49.9 - 44.9. Which is the second biggest value? (a) j (b) -2.8 (c) 2/7 c Let r = 28.2 + -27.9. Let x = -1.57 - -1.7. Let v = 4.87 + x. What is the second biggest value in v, -4, r? r Let y be 352/1430 + 2/(-5). Let u = 0 - 0.1. Which is the fourth biggest value? (a) y (b) 2/3 (c) 0.05 (d) u a Let z = -694 + 699. Let i = 2 + 1. Which is the biggest value? (a) z (b) 4 (c) i a Let w = 1012/35 + -146/5. Which is the biggest value? (a) 2 (b) 1 (c) 3 (d) w c Let z = -4 - -7. Let d = z + -3. Let w = -149 - -146. Which is the smallest value? (a) d (b) w (c) -4 c Let q be (-1)/6 - ((-36)/8 - -3). Let o = -1.55 + 0.25. Let j = -3.7 + o. Which is the third smallest value? (a) -0.2 (b) j (c) q c Let h = -20.85 + -1.15. Let v = h - -20. Let z be ((-6)/15)/(13/5). Which is the second smallest value? (a) 2 (b) z (c) v b Let o be ((-15)/10 - -1)*0. Sup	{ "pile_set_name": "DM Mathematics" }
728 What is the next term in -70, -69, -82, -115, -174, -265, -394, -567? -790 What is the next term in -2692, -2689, -2686? -2683 What is the next term in 31, 43, 63, 91? 127 What is the next term in -5054, -5056, -5058, -5060, -5062, -5064? -5066 What is next in -74, -150, -238, -344, -474, -634, -830? -1068 What comes next: -14, -6, 4, 16, 30? 46 What is the next term in 184, 183, 180, 175, 168, 159? 148 What is next in -1, -11, -23, -37? -53 What is the next term in -32, -71, -114, -161, -212, -267? -326 What is next in 10, 33, 72, 127, 198, 285? 388 What is next in -7176, -14355, -21536, -28719? -35904 What comes next: 64781, 64782, 64783, 64784, 64785? 64786 What comes next: 2666, 2670, 2674, 2678, 2682? 2686 What is next in -8, -14, -18, -20, -20, -18? -14 What is the next term in -1812, -3628, -5444, -7260, -9076? -10892 What is next in -16269, -16273, -16279, -16287, -16297, -16309, -16323? -16339 What comes next: -3, 14, 31, 48? 65 What is next in 27, 65, 121, 201, 311, 457, 645? 881 What comes next: 6019, 12003, 17973, 23923, 29847, 35739, 41593, 47403? 53163 What is the next term in 468, 1865, 4194, 7455, 11648, 16773, 22830? 29819 What is next in 252, 250, 258, 282, 328, 402, 510, 658? 852 What is next in 11, 13, 15, 17? 19 What is next in 33, 40, 47, 54? 61 What is the next term in 298, 595, 892, 1189, 1486, 1783? 2080 What comes next: 15, 48, 109, 198, 315, 460? 633 What comes next: -151, -177, -205, -235, -267, -301, -337? -375 What comes next: 11, 4, -15, -52, -113? -204 What is the next term in 88, 177, 324, 529? 792 What comes next: -943, -945, -947, -949, -951, -953? -955 What is next in 11, 25, 39, 53? 67 What is next in 37, 41, 47, 55, 65, 77? 91 What comes next: 61, 55, 45, 31, 13? -9 What is the next term in -36, -71, -134, -231, -368, -551, -786, -1079? -1436 What is next in 63, 108, 173, 252, 339? 428 What is next in 662, 660, 658, 656? 654 What is the next term in -479, -499, -517, -533? -547 What is the next term in -21, -61, -133, -243, -397, -601, -861, -1183? -1573 What comes next: -442, -438, -420, -382, -318, -222, -88, 90? 318 What comes next: 466, 437, 408? 379 What is the next term in -1, 11, 27, 47, 71? 99 What is next in 17, 29, 41, 53? 65 What comes next: 118, 161, 204, 247, 290, 333? 376 What is next in -82, -127, -172, -217, -262, -307? -352 What is the next term in -37, -41, -49, -61? -77 What is next in 6041, 6042, 6045, 6050, 6057? 6066 What is the next term in -132, -126, -116, -102? -84 What is next in 21, 42, 75, 120, 177, 246, 327? 420 What is the next term in 6770, 6766, 6760, 6752, 6742? 6730 What comes next: -565, -1134, -1703, -2272, -2841, -3410? -3979 What comes next: -144, -168, -192, -216? -240 What is next in 19, 32, 45, 58, 71, 84? 97 What is the next term in 7, 4, -1, -8, -17? -28 What comes next: -540, -1081, -1622, -2163, -2704, -3245? -3786 What comes next: -571, -564, -553, -538, -519? -496 What is the next term in 129, 518, 1157, 2040, 3161, 4514, 6093? 7892 What is the next term in -1104, -2207, -3310? -4413 What is next in 76, 150, 224? 298 What comes next: -76, -6, 66, 140? 216 What is next in -22, -98, -226, -406? -638 What is next in 27, 52, 77? 102 What is the next term in -1732, -3441, -5138, -6817, -8472, -10097? -11686 What comes next: 11, -26, -125, -316, -629, -1094, -1741? -2600 What is the next term in -69, -88, -109, -132, -157? -184 What comes next: 864, 1731, 2598, 3465, 4332? 5199 What is next in -1136, -1142, -1152, -1166, -1184? -1206 What is the next term in 115, 98, 55, -26, -157, -350, -617? -970 What is next in 164, 102, 28, -64, -180, -326, -508? -732 What comes next: 6922, 13839, 20744, 27631, 34494, 41327, 48124, 54879? 61586 What is the next term in -198, -396, -594? -792 What is next in 289, 1119, 2503, 4441? 6933 What is next in -3978, -3975, -3962, -3933, -3882? -3803 What comes next: 600, 601, 604, 609? 616 What comes next: 500, 493, 482, 467, 448, 425? 398 What is the next term in -30, -46, -62, -78, -94? -110 What comes next: 8, 48, 128, 260, 456, 728, 1088? 1548 What is next in 216, 217, 218, 219? 220 What is next in -123, -940, -3159, -7482, -14611, -25248, -40095, -59854? -85227 What is next in -44, -39, -34, -29, -24? -19 What comes next: 14, 20, 28, 38? 50 What is the next term in -71, -119, -251, -509, -935, -1571, -2459, -3641? -5159 What is the next term in 51, 49, 47, 45? 43 What is the next term in -30, -122, -278, -498, -782, -1130? -1542 What is next in -54, -152, -322, -570, -902, -1324? -1842 What is the next term in 253, 263, 287, 331, 401, 503? 643 What is the next term in -77, -101, -147, -221, -329, -477, -671? -917 What is next in -21, -27, -45, -81, -141, -231, -357, -525? -741 What comes next: 877, 875, 873, 871? 869 What comes next: 23, 73, 209, 473, 907, 1553, 2453, 3649? 5183 What is the next term in 637, 1285, 1947, 2629, 3337, 4077, 4855? 5677 What is next in -9, -15, -21, -27? -33 What comes next: 2626, 2621, 2604, 2569, 2510, 2421, 2296, 2129? 1914 What comes next: 27, 62, 99, 138, 179, 222? 267 What comes next: -5, 30, 93, 190, 327, 510, 745? 1038 What comes next: 107, 127, 159, 203, 259? 327 What is next in -64, -121, -178, -235, -292? -349 What comes next: 209, 208, 207, 206, 205, 204? 203 What is next in 348, 529, 720, 927, 1156, 1413, 1704, 2035? 2412 What is next in 2378, 2371, 2364? 2357 What comes next: -14, -46, -128, -284, -538? -914 What is next in 50473, 50475, 50479, 50485? 50493 What is the next term in -35692, -35693, -35694, -35695? -35696 What is the next term in 81, 131, 171, 195, 197, 171? 111 What is the next term in 152, 308, 464, 620? 776 What comes next: 3791, 7579, 11367, 15155? 18943 What comes next: -86, -95, -106, -119, -134, -151, -170? -191 What comes next: 337, 678, 1019, 1360, 1701? 2042 What is next in 425, 446, 467, 488? 509 What comes next: 197, 203, 219, 251, 305, 387? 503 What is the next term in -8562, -8557, -8538, -8499, -8434, -8337, -8202, -8023? -7794 What is next in -115, -224, -329, -430? -527 What comes next: 136, 118, 96, 64, 16, -54? -152 What is next in 258, 515, 772, 1029, 1286? 1543 What is the next term in 168, 314, 462, 612, 764, 918? 1074 What comes next: -219, -222, -227, -234? -243 What is the next term in 20, 45, 78, 113, 144, 165, 170? 153 What is next in 218, 438, 658, 878, 1098? 1318 What is next in -183, -728, -1637, -2910, -4547? -6548 What is the next term in -391, -390, -389? -388 What comes next: 166, 163, 156, 145, 130? 111 What is the next term in -2353, -2349, -2345, -2341? -2337 What is the next term in -40, -47, -56, -67, -80, -95, -112? -131 What is the next term in -1072, -1075, -1080, -1087, -1096, -1107, -1120? -1135 What comes next: -706, -704, -702, -700, -698? -696 What is the next term in -33, -95, -159, -225, -293, -363? -435 What comes next: -147, -297, -447, -597? -747 What is the next term in 5760, 5769, 5790, 5829, 5892, 5985? 6114 What is the next term in -26, -56, -88, -122, -158? -196 What comes next: 75, 89, 111, 141, 179, 225? 279 What comes next: -424, -430, -448, -484, -544, -634? -760 What comes next: -291, -297, -307, -321, -339? -361 What comes next: 184, 370, 568, 784, 1024, 1294? 1600 What comes next: 670, 1355, 2040, 2725, 3410? 4095 What is the next term in -53, -164, -349, -608, -941, -1348, -1829? -2384 What is the next term in -78, -87, -88, -75, -42, 17, 108, 237? 410 What comes next: -2124, -4249, -6374? -8499 What is the next term in 1264, 1251, 1224, 1177, 1104, 999, 856, 669? 432 What comes next: 167, 152, 135, 116, 95, 72? 47 What is the next term in -847, -1698, -2549, -3400, -4251, -5102? -5953 What comes next: -23378, -23377, -23376, -23375, -23374, -23373? -23372 What is next in -97, -194, -291, -388? -485 What comes next: -20, -48, -86, -134? -192 What comes next: 506, 1008, 1510? 2012 What comes next: -421, -839, -1243, -1627, -1985? -2311 What is next in 16, 25, 26, 13, -20, -79? -170 What comes next: -479, -956, -1433, -1910, -2387, -2864? -3341 What is the next term in -140, -163, -186, -209, -232? -255 What comes next: 58, 62, 64, 64, 62, 58? 52 What is next in -41, -56, -81, -116? -161 What is next in -160, -165, -182, -217, -276? -365 What comes next: 20, 30, 50, 86, 144, 230, 350? 510 What is the nex	{ "pile_set_name": "DM Mathematics" }
, 251, 563 List the prime factors of 103298396. 2, 283, 91253 What are the prime factors of 361951856? 2, 7, 937, 3449 List the prime factors of 157335509. 31, 157, 32327 List the prime factors of 19732799. 491, 40189 List the prime factors of 188273812. 2, 19, 337, 7351 List the prime factors of 73953083. 83, 891001 What are the prime factors of 110356804? 2, 107, 401, 643 What are the prime factors of 1768482933? 3, 7, 59, 1427347 List the prime factors of 7544692. 2, 1886173 What are the prime factors of 498901905? 3, 5, 19, 583511 What are the prime factors of 2877469736? 2, 929, 387173 What are the prime factors of 40306634? 2, 31, 650107 List the prime factors of 1316475201. 3, 59, 83, 89611 What are the prime factors of 369348671? 12589, 29339 List the prime factors of 72382160. 2, 5, 904777 What are the prime factors of 1072322461? 7, 153188923 List the prime factors of 259590534. 2, 3, 7, 882961 List the prime factors of 278657899. 13, 317, 67619 List the prime factors of 493940096. 2, 13, 101, 2939 What are the prime factors of 107677769? 19, 383, 14797 List the prime factors of 1229180489. 1229180489 List the prime factors of 277763085. 3, 5, 17, 283, 1283 What are the prime factors of 829777588? 2, 207444397 What are the prime factors of 1124783026? 2, 61, 349, 26417 What are the prime factors of 5546265085? 5, 401, 2766217 What are the prime factors of 911727785? 5, 182345557 What are the prime factors of 85681963? 19, 139, 32443 List the prime factors of 60299824. 2, 13, 131, 2213 What are the prime factors of 1244118170? 2, 5, 6229, 19973 List the prime factors of 1794058293. 3, 73, 233, 35159 What are the prime factors of 160527387? 3, 331, 161659 List the prime factors of 35253770. 2, 5, 3525377 List the prime factors of 306487266. 2, 3, 31, 1647781 List the prime factors of 410583068. 2, 7, 14663681 What are the prime factors of 64929914? 2, 7, 43, 107857 List the prime factors of 145625547. 3, 48541849 List the prime factors of 269646032. 2, 97, 173741 List the prime factors of 24673369. 7, 3524767 List the prime factors of 548347213. 548347213 What are the prime factors of 6058869603? 3, 131, 15416971 What are the prime factors of 234625793? 13451, 17443 List the prime factors of 462176339. 15391, 30029 What are the prime factors of 4253265196? 2, 149, 277, 25763 What are the prime factors of 117822516? 2, 3, 7, 139, 10091 List the prime factors of 1399497945. 3, 5, 31, 431, 6983 What are the prime factors of 15277227? 3, 7, 727487 What are the prime factors of 18960175? 5, 13, 227, 257 List the prime factors of 144533488. 2, 11, 587, 1399 What are the prime factors of 101252350? 2, 5, 37, 229, 239 What are the prime factors of 220783681? 277, 797053 List the prime factors of 7695052. 2, 1923763 What are the prime factors of 1583402829? 3, 19, 103, 283, 953 List the prime factors of 2950528932. 2, 3, 13, 1277, 4937 What are the prime factors of 1371326514? 2, 3, 228554419 List the prime factors of 5462289184. 2, 11, 131, 118457 List the prime factors of 20576644. 2, 11, 467651 List the prime factors of 26840872. 2, 83, 40423 What are the prime factors of 17226409? 139, 123931 What are the prime factors of 1660940005? 5, 19, 17483579 What are the prime factors of 838412148? 2, 3, 7, 79, 18049 List the prime factors of 1325909416. 2, 13, 101, 126229 What are the prime factors of 1239420078? 2, 3, 13, 41, 129187 What are the prime factors of 45290019? 3, 15096673 List the prime factors of 5872256. 2, 13, 3529 What are the prime factors of 529953888? 2, 3, 29, 190357 List the prime factors of 3755002344. 2, 3, 4289, 36479 What are the prime factors of 46997215? 5, 37, 254039 What are the prime factors of 2317462254? 2, 3, 128747903 List the prime factors of 306429998. 2, 7, 17, 271, 4751 List the prime factors of 767767. 7, 11, 13, 59 What are the prime factors of 34683087? 3, 103, 107, 1049 List the prime factors of 27776822. 2, 19, 730969 List the prime factors of 5940298. 2, 7, 13, 127, 257 List the prime factors of 42699235. 5, 8539847 List the prime factors of 216357385. 5, 17, 449, 5669 What are the prime factors of 3131406140? 2, 5, 223, 307, 2287 List the prime factors of 895081405. 5, 313, 431, 1327 What are the prime factors of 88054482? 2, 3, 67, 219041 What are the prime factors of 37122563? 71, 522853 List the prime factors of 1909219705. 5, 811, 470831 What are the prime factors of 26455637? 13, 101, 20149 What are the prime factors of 333637377? 3, 41, 347, 7817 List the prime factors of 16560423. 3, 11, 37, 137 List the prime factors of 1658305544. 2, 7, 29612599 List the prime factors of 5996347061. 36919, 162419 List the prime factors of 4985562967. 7, 11, 1321379 List the prime factors of 230684994. 2, 3, 12815833 List the prime factors of 584731022. 2, 73, 139, 28813 List the prime factors of 229244568. 2, 3, 7, 47, 29033 What are the prime factors of 427420224? 2, 3, 7, 11, 23, 419 List the prime factors of 1054071737. 8429, 125053 List the prime factors of 2412183672. 2, 3, 11167517 List the prime factors of 593271260. 2, 5, 29663563 What are the prime factors of 4737364967? 37, 41, 3122851 List the prime factors of 334621697. 334621697 What are the prime factors of 87919253? 977, 89989 List the prime factors of 1636978350. 2, 3, 5, 7, 109, 14303 What are the prime factors of 124101357? 3, 1867, 22157 List the prime factors of 324720543. 3, 7, 1153, 13411 What are the prime factors of 46014212? 2, 11503553 List the prime factors of 1444062018. 2, 3, 7, 29, 1185601 What are the prime factors of 4995234? 2, 3, 277513 What are the prime factors of 380486805? 3, 5, 211, 239, 503 What are the prime factors of 739350108? 2, 3, 7, 653, 4493 List the prime factors of 79588273. 113, 704321 What are the prime factors of 1910067078? 2, 3, 29, 271, 40507 What are the prime factors of 222650938? 2, 17, 47, 277, 503 List the prime factors of 1830286820. 2, 5, 91514341 What are the prime factors of 509575289? 17, 29975017 What are the prime factors of 4236303428? 2, 7, 2999, 7207 List the prime factors of 52361961. 3, 23, 41, 83, 223 What are the prime factors of 1128608? 2, 13, 2713 List the prime factors of 157924194. 2, 3, 26320699 What are the prime factors of 679673003? 223, 3047861 List the prime factors of 3573501826. 2, 1786750913 List the prime factors of 41849145. 3, 5, 13, 71537 List the prime factors of 37654896. 2, 3, 47, 16691 List the prime factors of 40926637. 23, 1087, 1637 List the prime factors of 279881073. 3, 59, 193, 2731 List the prime factors of 23976451. 499, 48049 What are the prime factors of 718804599? 3, 19, 1283, 9829 What are the prime factors of 30996071? 4283, 7237 List the prime factors of 104341449. 3, 29, 109, 11003 List the prime factors of 11317040. 2, 5, 7, 2887 List the prime factors of 408577550. 2, 5, 2309, 3539 List the prime factors of 1745017543. 347, 5028869 What are the prime factors of 1219712348? 2, 304928087 List the prime factors of 108575598. 2, 3, 113, 160141 What are the prime factors of 315894939? 3, 105298313 List the prime factors of 328516989. 3, 109505663 What are the prime factors of 3034543097? 31, 97888487 What are the prime factors of 1327611272? 2, 13, 981961 What are the prime factors of 358437621? 3, 41, 89, 137, 239 What are the prime factors of 2373543188? 2, 593385797 What are the prime factors of 47674386? 2, 3, 67, 13177 What are the prime factors of 106875865? 5, 21375173 List the prime factors of 181243025. 5, 311, 23311 What are the prime factors of 198330880? 2, 5, 11, 7043 List the prime factors of 30200477. 41, 163, 4519 List the prime factors of 60531285. 3, 5, 23, 175453 What are the prime factors of 287994147? 3, 7, 83, 165229 List the prime factors of 732488967. 3, 7, 3875603 List the prime factors of 3283964893. 11, 6367, 46889 List the prime factors of 575134202. 2, 43, 107, 62501 List the prime factors of 3245262839. 7, 13, 35662229 List the prime factors of 546266200. 2, 5, 2731331 List the prime factors of 4144899495. 3, 5, 11, 19, 1322137 List the prime factors of 1322290650. 2, 3, 5, 1787, 4933 What are the prime factors of 208208881? 43, 4842067 What are the prime factors of 4167955502? 2, 37, 56323723 What are the prime factors	{ "pile_set_name": "DM Mathematics" }
Round z to seven dps. -0.0000002 Let q = -282.9999807 + 283. What is q rounded to 6 dps? 0.000019 Let t = 187.059 + -0.059. Let q = -56 + t. Let b = q + -130.939. Round b to two dps. 0.06 Let m(s) = -3433s - 7. Let b be m(21). Round b to the nearest 10000. -70000 Let v = -2105 - -5974. Let c = v - 2031. Suppose -h = -4u - c, 4u = u - 3h - 1386. What is u rounded to the nearest one hundred? -500 Let w = -2.5 - -3.05. Round w to 1 decimal place. 0.6 Suppose 4g + 2o - 20 = o, 8 = g + o. Suppose 3t - 18000 = -2b, gt + 4b - 757 - 23243 = 0. Round t to the nearest one thousand. 6000 Suppose -3p = 2f + 299996, p = 4f - 30260 - 69748. What is p rounded to the nearest one million? 0 Let w(m) = 2 + 1 + 573332m + 1. Let s be w(3). What is s rounded to the nearest one hundred thousand? 1700000 Let z = -24746 - -11406. Let j = z + 13340.18026. Let l = 0.18 - j. Round l to 4 dps. -0.0003 Let d(i) = -3i2 - 2i - 4. Let c = 5 - -2. Let a be d(c). What is a rounded to the nearest ten? -170 Let a be (722124/(-8) - 0)-226. Suppose t = 5 - 1. Suppose z - 3v = -3z - a, -2v + 20400002 = -tz. What is z rounded to the nearest 1000000? -5000000 Let x = -103.7 - -91.07. Round x to the nearest integer. -13 Suppose 0 = -3i - 20127 + 1695. Let x be -21 + i/8. What is x rounded to the nearest one hundred? -800 Let d = -125 - -125.49. What is d rounded to one dp? 0.5 Let g be (-7)/(28/8) + -12. Let t be (-2588)/(-18) + g/(-63). Round t to the nearest 10. 140 Let k = 156662.98000033 - 156663. Let p = k + 0.02. Round p to 7 dps. 0.0000003 Let g = 2 - -3. Let z = g - 4.9992. What is z rounded to four dps? 0.0008 Suppose -6t + 41401 + 37199 = 0. What is t rounded to the nearest one thousand? 13000 Suppose 5i - 1 = 14. Suppose o + 0 = i. Suppose 3414672 = oq + 33414672. Round q to the nearest one million. -10000000 Let l = 7 - 7.01. Let o = -0.05 + l. Let t = o - -0.61. What is t rounded to 1 dp? 0.6 Let q = -2.46 - 139.54. Let h = q - -141.9999943. What is h rounded to 6 decimal places? -0.000006 Let j = -5.4 - -5.82. Let l = j + 2.98. What is l rounded to the nearest integer? 3 Let g = 23 - 23. Let y = g + -0.16. Round y to 1 decimal place. -0.2 Suppose 40644324 = -4r + 8r. Suppose -k - 4800004 = 2v, 3v + r = -5k + 2961061. What is v rounded to the nearest one million? -2000000 Suppose 0 = w + 3w - 9520. What is w rounded to the nearest 100? 2400 Suppose o + 4o - 30 = 0. Suppose 2 = 4s + o. Let f be (76001 + s)/((-10)/(-25)). What is f rounded to the nearest 100000? 200000 Let h = 0.0299996 - 0.03. What is h rounded to 7 dps? -0.0000004 Let n = 669 - 668.99998442. What is n rounded to six decimal places? 0.000016 Let d = 34 + -34.0017. Round d to two decimal places. 0 Let s = -773 - -1124. Round s to the nearest ten. 350 Let s be (-1308)/416/24. What is s rounded to the nearest ten? -220 Let x = 3.269 + 0.031. Let t = 4.6 - x. What is t rounded to zero dps? 1 Let k = -17 + 16.99991. What is k rounded to 4 decimal places? -0.0001 Let y = 0.225 - 0.1806. What is y rounded to 2 dps? 0.04 Suppose -5n - 3g = -1519988, -3g - 17 + 5 = 0. What is n rounded to the nearest ten thousand? 300000 Let i be 0 - 1 - -3 - -2. Suppose 2a = -3m + a + 3604, -4796 = -im + a. Round m to the nearest 100. 1200 Let y = 5967 - 3567. Round y to the nearest 1000. 2000 Let t = 10.5 - -68.5. Let o = -3327.37 - -3248. Let y = t + o. What is y rounded to one dp? -0.4 Let u(n) = -n3 - 6n*2 - 6n - 2. Let q be u(-5). Suppose -5k - qb - 13703691 = 34796309, -b = -2k - 19400000. Round k to the nearest one million. -10000000 Let r = -0.2560502102 + 123.2560601102. Let s = 123 - r. Round s to 6 dps. -0.00001 Let i(o) = -911o*2 + 15o + 4. Let x be i(12). Round x to the nearest 10000. -130000 Let p = -96089 + 96044.979. Let h = p - -44. What is h rounded to two dps? -0.02 Let l(w) = -219w. Let h be l(-2). Suppose f + 9 = 4f. Suppose 0 = 5j - 15, 2n - fj = 193 + h. What is n rounded to the nearest 100? 300 Let u = 1.328 + 0.032. Let z = -7.66 + u. Round z to zero dps. -6 Let f(j) = -681j*3 + 5j2. Let g be f(5). Round g to the nearest ten thousand. -90000 Let q = 18 + -49. Round q to the nearest 10. -30 Let r = -3270 - -3270.050012. Let a = 38.95 + -39. Let m = a + r. Round m to 5 decimal places. 0.00001 Let y(b) = -b2 + 19000000. Let k be y(0). Round k to the nearest one million. 19000000 Let p = 478.76 + -470. Let b = -10 + p. What is b rounded to one dp? -1.2 Let u(w) = -2w + 4. Let r be u(0). Suppose -36 + 104 = rz. What is z rounded to the nearest integer? 17 Let c = 62502.62067 + -62503. Let x = 0.381 + c. What is x rounded to four dps? 0.0017 Let n = 4445359 + -2145359. What is n rounded to the nearest one hundred thousand? 2300000 Let g = 8.4136 + -1.0078. Let o = g - 7.4. What is o rounded to 3 decimal places? 0.006 Let y = 0.08194 + 0.918252. Let w = y - 1. Round w to 5 decimal places. 0.00019 Suppose 1374 = n - 4i, -4n = n + i - 6975. Let o = -2814 + n. What is o rounded to the nearest one hundred? -1400 Let x = 788.71 + -785. Let h = -1.93 + x. Let k = h + -1.7649. What is k rounded to 3 decimal places? 0.015 Suppose s + s = 2440. What is s rounded to the nearest one hundred? 1200 Let m = 735.8 + -799.11. Let v = m + 63. What is v rounded to 1 decimal place? -0.3 Suppose -v = 2v - 12. Suppose 0 = -2a + 4c + 10360, va = 5c + 1650 + 19082. Let w = a - -40812. Round w to the nearest 10000. 50000 Let n = 2511 + -6811. What is n rounded to the nearest one thousand? -4000 Let f = 0.0068 + -445.0068. Let u = f + 445.191. Round u to 2 dps. 0.19 Let i = -2.43 + -0.07. Let t = i - -14.5. Let n = t + -13.2. What is n rounded to one dp? -1.2 Suppose 0 = -6j + 9j - 24900. What is j rounded to the nearest 1000? 8000 Let r = -9.402447 - -0.107547. Let q = -152 - -161.3. Let y = r + q. What is y rounded to three decimal places? 0.005 Let y = 286179 + -141179. What is y rounded to the nearest ten thousand? 150000 Let o = 198.86942 + -118.86831. Let l = -80 + o. What is l rounded to 4 dps? 0.0011 Let m = 25.9999965 - 26. What is m rounded to six decimal places? -0.000004 Let y = 100.941553 + -182.941447. Let u = -3.5 - -85.5. Let l = u + y. What is l rounded to five dps? 0.00011 Let m = -447.5 + 366. What is m rounded to the nearest 10? -80 Suppose -5t + 7 - 2 = 0. Suppose 0 = v - t + 70. What is v rounded to the nearest ten? -70 Let c = 212.783 + -213. What is c rounded to two dps? -0.22 Let o = 2.925 + -3. Let n = o - -0.06. Let q = n - 0.01. Round q to two decimal places. -0.03 Let a = -91 + 90.99999903. What is a rounded to 7 dps? -0.000001 Let z = -0.07 - 0.13. Let a = z + 0.1999987. Round a to 6 dps. -0.000001 Let t(a) = 4a2 + 6 - 9570a*3 + 13a - 14 + a*2 - 9a*2. Let u be t(8). Round u to the nearest one million. -5000000 Let d = -3.300012 - -3.3. Round d to five dps. -0.00001 Let f = -14.5 - -12.92. Let x = 81 - 81.99. Let z = f - x. Round z to one dp. -0.6 Suppose -f - 2f = -2v - 4498, -3f + 4v = -4496. Round f to the nearest 1000. 2000 Let x(f) = -f2 - 3 - 5f - 4f2 - f3 + 0. Let b be x(-4). Let h be 499998 + b + -2 + 3. Round h to the nearest 100000. 500000 Let a(q) = 11249q3 - q2 - 3q - 10. Let l be a(-2). What is l rounded to the nearest 100000? -100000 Let p = 12 - 12.038. Round p to 2 dps. -0.04 Let u = -0.135 + 78.135. Let d = -78.0000039 + u. What is d rounded to six decimal places? -0.000004 Let v = 5.987 - 6. Round v to 2 decimal places. -0.01 Let d = -19.200000354 - -19.2. Round d to seven dps. -0.0000004 Let x = -0.2 + 0.28. Let u = x - 0.065. What is u rounded to two decimal places? 0.02 Let y = -5319.848 + 5236.848114. Let k = -186 - -103. Let p = k - y. Round p to five dps. -0.00011 Let w = 57 + -56.9954. Round w to 3 dps. 0.005 Suppose -4c + 128 = -232. Let n be 2 + -2 + -1 + c. Let z be n/(-1)(-1 - 0). What is z rounded to the nearest ten? 90 Let b be 55(288/20)/(-6). Round b to the nearest ten. -130 Suppose -3b + 20 = 2b. Suppose b*o = -o. Round o to seven dps. 0 Let q = 156748.1249893 - 156761.725. Let l = q - -13.6. What is l rounded to six decimal places? -0.000011 Let h = 10.5162 + 0.4842. Let c = h + -11. What is c rounded to three dps? 0 Let o = 744 + -735.03. Let m = -0.03 - o. Let	{ "pile_set_name": "DM Mathematics" }
s) = -22s - 89. Let k be o(-4). Let g be -1(3 + -2)-2. Sort k, g, -5 in ascending order. -5, k, g Let l be (-1)/((-14)/4) - 133/(-49). Suppose -4k - 28 = r + 3r, lk + 19 = -2r. Suppose -2s = -3s. Sort k, s, 1. k, s, 1 Let j(r) = -93 - r - 22 + 116. Suppose 0 = 3d + 2d + 2l - 13, 2d - 1 = -5l. Let k be j(d). Put 1, k, 0 in descending order. 1, 0, k Let a = -76.9 - -81.9. Let b = 0.7 - 1. Sort -24, a, b. -24, b, a Let q = -2143 + 2145. Put q, 1, 4, -24 in ascending order. -24, 1, q, 4 Let s = -0.086 + 0.286. Let i be (-6)/9 + (1 - 2). Put s, 0.5, i, -0.5 in increasing order. i, -0.5, s, 0.5 Suppose -60 = -3t - 3t. Suppose 4q = -t - 6. Let x be 26/10 - 12. Sort 2, q, x in decreasing order. 2, x, q Let g = -247 - -240. Put -1/5, g, -2, 0.5 in increasing order. g, -2, -1/5, 0.5 Suppose -2t + 410 = 8t. Let r = t + -39. Sort -4, -3/7, r in increasing order. -4, -3/7, r Let z = -8 + 8.3. Let n(j) be the first derivative of -j4/4 + j2 + 4j - 11. Let p be n(0). Sort p, z, -5. -5, z, p Let t = 0.3 + -0.1. Let l = 76 - 74. Suppose -p = 3m + l, 6 = -m - 2m. Put t, p, 2 in ascending order. t, 2, p Let n = -5 + 11. Let w = -18 + n. Let r = w - -18. Sort r, 3/4, 0.2 in decreasing order. r, 3/4, 0.2 Suppose -73v = -82v + 252. Put 4, v, 0.2 in ascending order. 0.2, 4, v Let g be 16/(-120) + 5/(-525). Put -36, g, 3/2, 2/55 in decreasing order. 3/2, 2/55, g, -36 Suppose 11x - 5x + 6 = 0. Let t(y) = -y. Let b be t(x). Sort -5, b, 4 in decreasing order. 4, b, -5 Let l be 15/(-12) - ((-34)/8 + 4). Suppose 4h - 6 = -22. Suppose 5 = c, 3r - 4c + 40 = 7r. Sort h, r, l. h, l, r Let w be (-1)/(6/(-33) - (-45)/66). Let z be (-9)/4 - 4/32w. Sort -4, 0, z in descending order. 0, z, -4 Let o be ((-3)/2)/((-195)/78). Put -1/7, 1, 2/5, o in decreasing order. 1, o, 2/5, -1/7 Let n = 723 - 724. Let r = 0 - 0. Put r, -4, n in descending order. r, n, -4 Let q(k) = k*3 + 6k*2 - 6k + 9. Let d be q(-7). Suppose -31 = 2v + 59. Put v, 3, d in decreasing order. 3, d, v Suppose -7i = -9i. Suppose 0 = -74u + 32u + 294. Let t be ((-10)/(-4))/((-1)/2). Sort i, t, u in ascending order. t, i, u Suppose 4l + 3 = -5. Suppose -g - 14g + 15 = 0. Sort -3, l, g in descending order. g, l, -3 Let a = 2185 - 2014. Put 2, 0.3, a in increasing order. 0.3, 2, a Let j = -66 - -65. Put -6, j, 4 in increasing order. -6, j, 4 Let z be (20/(-10))/(1/2). Let t be -10z/(-8) + 3. Let w be (-5 - t) + 75/21. Sort -2, 0.1, w in decreasing order. w, 0.1, -2 Let p = -3 + 2.5. Let m = -0.858 - -0.98. Let j = m - -0.378. Sort 5/6, j, p. p, j, 5/6 Let q = -9.1 + 1.1. Let r be 6 + 3(-1 + 0). Put r, q, -0.5 in increasing order. q, -0.5, r Suppose 3j = 5j + 2. Let z(y) = 2y + 22. Let r be z(-11). Suppose -2i + 3 = -x - r, 5x = i - 15. Put -2, j, i in ascending order. -2, j, i Suppose -56 = -13f - f. Put f, 16, 2 in decreasing order. 16, f, 2 Let o = 2 - 1. Let f be (-1 + 1)/((-11 - -5)/6). Sort f, o, -3 in descending order. o, f, -3 Suppose 4p - 132 = -3j, 0 = -5p + 2j - 7j + 170. Let g = -25 + p. Suppose -o - l + 2 = -0, 8 = 3o + 4l. Sort -3, o, g in ascending order. -3, o, g Let v(p) = -p*2 - 9p + 20. Let x be v(-9). Suppose -a - x = -6a + 5s, -5s + 4 = a. Sort 0, a, -34 in descending order. a, 0, -34 Let u be 6 - (4 - -2 - 3). Put 2/3, 1/15, 0.3, u in descending order. u, 2/3, 0.3, 1/15 Let k = 1162 + -1174. Put k, -1, 1 in ascending order. k, -1, 1 Let v = -1725.7 - -1738. Sort -3, -4, v, 0.2 in descending order. v, 0.2, -3, -4 Let p = 3.9476 + 0.0524. Sort 1.9, 2/7, 3/4, p in increasing order. 2/7, 3/4, 1.9, p Let o(h) = -9h + 26. Let t(x) = -19x + 51. Let a(n) = 7o(n) - 3t(n). Let d be a(5). Put 4, d, 0.3 in decreasing order. 4, 0.3, d Let u = -16/75 - 3/25. Let b = 20 - 14. Let t = b + 3. Sort 3/4, t, u. u, 3/4, t Let f = 398 + -400. Sort 2, 4, f, 3 in descending order. 4, 3, 2, f Let w = -0.37 + 0.41. Let g = 0.24 - w. Sort 0, g, -6 in decreasing order. g, 0, -6 Let l be (72/756)/(2/14). Sort -4.1, l, -0.1. -4.1, -0.1, l Suppose -4u + 2z - 4 = -6u, 5u + 3z = 4. Let x be (u + 10/4)/((-14)/(-28)). Let q(v) = -4v - 3. Let p be q(-2). Sort x, 19, p in descending order. 19, p, x Let h = -1.6 - -7.6. Let x = h - 11. Let g = -8370 - -8364. Put x, g, -4 in increasing order. g, x, -4 Let r(d) = d2 - d - 7. Let i(f) = f2 - f - 6. Let x be i(0). Let u be (6/4)/(x/12). Let c be r(u). Sort -4, 7, c. -4, c, 7 Suppose 147 = 5h - 3. Suppose -10 = 5m - h, -m = n - 5. Let v(g) = -7g - 10. Let p be v(-2). Sort p, n, 2 in decreasing order. p, 2, n Let v = -4/5 + 22/15. Let x(w) = w*2 - 5w - 14. Let a be x(8). Let n be (-2 - -1)(a/14 - 1). Sort n, -0.4, v. -0.4, n, v Suppose -16k - 29k + 45 = 0. Put k, -11, 4, 2 in descending order. 4, 2, k, -11 Let s(r) = 4r + 8r - r - 14. Let k(n) = 4n - 5. Let d(v) = 8k(v) - 3s(v). Let c be d(0). Put -0.3, 1/4, c in decreasing order. c, 1/4, -0.3 Suppose -44 = -2b + 5k - 61, -2b - 7 = -3k. Put b, 354, -1 in decreasing order. 354, b, -1 Let q be (3 - 2) + 1/(-5). Let p = 14.93 - 15. Sort p, q, 1/7, 0.2 in descending order. q, 0.2, 1/7, p Suppose -5z + 16 + 34 = 0. Let t be 2 + -3 - z/5. Let x be (-2 + 1)(-2 + 0). Sort 5, x, t. t, x, 5 Let y = -1051 - -1050. Sort y, 16, 11, -3 in decreasing order. 16, 11, y, -3 Suppose -m = 3m - 3a - 11, 5a = 4m - 5. Put m, -2, 1.8 in decreasing order. m, 1.8, -2 Let w be -6 + 231/35 + -1. Put -5, w, -0.2, -4 in descending order. -0.2, w, -4, -5 Suppose -w = -2l + 6 - 4, 4w - 4l = -12. Sort -5, w, 31 in decreasing order. 31, w, -5 Let t(y) = 3y + 14. Let j be t(-3). Let h be (10/4)/((-6)/(-48)). Let p = 17 - h. Sort -5, j, p in descending order. j, p, -5 Let b = -101/276 - -3/92. Let u = 0.7 - -1.34. Let w = -0.04 + u. Put b, -0.3, w in increasing order. b, -0.3, w Let n = 0 + -5. Let h = -335 - -334. Sort 2/9, n, h in descending order. 2/9, h, n Let j = -25 + 22.9. Let h = j - -2.1. Sort h, -3/5, 5, 2. -3/5, h, 2, 5 Let h = 37 - 36.89. Let f = 0.915 - -3.195. Let o = h - f. Sort 0.5, o, 1 in descending order. 1, 0.5, o Let q = -4.18 + 3.5. Let x = q + 0.23. Let f = x + 0.05. Sort -1, f, 8. -1, f, 8 Suppose -4o = -3n + 616, 4n - n + o = 611. Let c = 208 - n. Suppose -35 = 4x - 8x - 5k, -4k = -12. Sort -14, x, c. -14, c, x Let b(g) = g - 2. Suppose s - 16 = -3s. Let d be b(s). Suppose -3h - dh = 5. Sort h, -5, 4 in increasing order. -5, h, 4 Let x be -7(-2)/568. Sort 1, -5, x, -2 in increasing order. -5, -2, 1, x Suppose -2h + 5o - 5 = -3h, -h + o - 1 = 0. Suppose -2w + 4s - 14 = 0, -s = -hw - 2w - 8. Put 2, 5, w, -1 in ascending order. w, -1, 2, 5 Suppose 3d - 2d = 2. Let k = 116 - 116. Suppose 3r + 6 = -3v, -r - 5 = -0r + 2v. Sort d, k, r. k, r, d Let q be (-4)/3 - (-2)/(-3). Suppose 0 = 3f - r + 12, 9f - 6f + 3 = 4r. Sort f, q, 7 in increasing order. f, q, 7 Let g be ((-30)/(-6) + 10)/3. Sort g, 1, 0. 0, 1, g Let z(o) = 3o*3 + 85o*2 - 58o - 1. Let x be z(-29). Sort 1, -60/23, x in descending order. 1, x, -60/23 Suppose 3b = -g + 11, 2b = 5g + 3b - 27. Let r = -1057 - -1052. Sort 3, -3, g, r in decreasing order. g, 3, -3, r Let k = -101.1 - -97. Let y = k + 0.1. Let j = 1469/3 - 490. Sort j, 3/5, y in increasing order. y, j, 3/5 Suppose 8 = -3n - 0w + w, -4n + 3w = 14. Sort 0, -5, n in descending order. 0, n, -5 Let o = 574.2 - 574. Let f = 6.8 - 7. Let y = f - 0.2. Sort o, -1/2, y in increasing order. -1/2, y, o Suppose 12 = -4j - 0. Let u be 4 + -11 - (j - -1). Let z = -8 - u. Sort 0.07, 3, z in decreasing order. 3, 0.07, z Let b = 3 + -5. Let r = -1738 + 1743. Put r, -4, b in increasing order. -4, b, r Let o be ((-48)/8 + 13)-1. Sort 9, -5, o in increasing order. o, -5, 9 Let p = 301 - 300.558. Let x = -0.042 + p. Let i = 2.01 - 0.01. Sort x, -0.3, i in increasing order. -0.3, x, i Let m = -0.09 + -0.11. Let h = -0.27 - 0.03. Let f = h - 0.7. Put 0.1, m, f in decreasing order. 0.1, m, f Suppose -a - 1 = -2. Let n(d) = -d*2 + 5d. Let t be n(4). Let i = 76 - 71. Sort t, a, i in decreasing order. i, t, a Let g = -1.3 - -0.3. Let c = -2 - g. Let u = 3070/3 - 1023. Sort c, -2, u in increasing order. -2, c, u Let y(f) = 24f - 1552. Let a be y(65). Let o(k) = -3k**2. Let m be o(-1). Sort -6, a, m in descending or	{ "pile_set_name": "DM Mathematics" }
ent from pqh? 1/6 What is prob of sequence owoo when four letters picked without replacement from {x: 2, m: 4, o: 5, w: 7}? 7/1224 What is prob of sequence fa when two letters picked without replacement from fajdddadda? 1/30 What is prob of sequence rlq when three letters picked without replacement from {r: 2, q: 1, l: 2, z: 1}? 1/30 What is prob of sequence kmk when three letters picked without replacement from {m: 1, k: 6, t: 3, u: 3}? 5/286 Calculate prob of sequence qp when two letters picked without replacement from {b: 1, g: 3, q: 2, p: 3, r: 1, x: 1}. 3/55 Calculate prob of sequence xnr when three letters picked without replacement from cccccncrnnnnccxnccc. 1/969 What is prob of sequence iiii when four letters picked without replacement from iiiiiiiii? 1 Calculate prob of sequence ly when two letters picked without replacement from sylsyssy. 3/56 Calculate prob of sequence uupf when four letters picked without replacement from ffxfxpfuup. 1/315 Three letters picked without replacement from {t: 1, s: 2, n: 2, d: 1, i: 1, l: 1}. Give prob of sequence tnd. 1/168 Calculate prob of sequence hu when two letters picked without replacement from ufhfulfufuufuff. 1/35 Calculate prob of sequence iqq when three letters picked without replacement from qqqiqqqqiqiii. 70/429 What is prob of sequence yys when three letters picked without replacement from {s: 2, a: 2, y: 2, e: 4}? 1/180 Four letters picked without replacement from mmvvmmvvvmvvvvvv. What is prob of sequence mvvv? 165/1456 Calculate prob of sequence jlj when three letters picked without replacement from jljjlljlll. 1/10 What is prob of sequence qj when two letters picked without replacement from mqqjq? 3/20 Two letters picked without replacement from {y: 2, s: 5, m: 8, g: 4}. What is prob of sequence gy? 4/171 Two letters picked without replacement from sqniniwnqnpnp. Give prob of sequence iq. 1/39 Two letters picked without replacement from tapiroit. What is prob of sequence ot? 1/28 Calculate prob of sequence ya when two letters picked without replacement from {y: 5, j: 3, a: 1, n: 2, h: 7, l: 2}. 1/76 Calculate prob of sequence nh when two letters picked without replacement from {w: 1, h: 8, f: 1, g: 6, n: 4}. 8/95 Three letters picked without replacement from vafvvvvvfvvavvvvaaa. What is prob of sequence vff? 4/969 Three letters picked without replacement from elpececllcgcclc. Give prob of sequence ple. 2/455 Two letters picked without replacement from iiiviviviiiiiiiivii. Give prob of sequence ii. 35/57 What is prob of sequence uu when two letters picked without replacement from uquuuuuuq? 7/12 Three letters picked without replacement from nwenamr. Give prob of sequence wme. 1/210 Three letters picked without replacement from kwwkkkkwkw. What is prob of sequence wwk? 1/10 Four letters picked without replacement from {g: 3, w: 4, v: 9, b: 1, z: 2}. Give prob of sequence zvgb. 3/5168 Calculate prob of sequence ddww when four letters picked without replacement from {w: 2, d: 3, q: 3}. 1/140 Three letters picked without replacement from {u: 5, i: 2}. Give prob of sequence uiu. 4/21 Two letters picked without replacement from pipbidpzdxip. Give prob of sequence bz. 1/132 Calculate prob of sequence fueu when four letters picked without replacement from ffeeeeeufffeue. 5/1716 Three letters picked without replacement from dssssdmmssvo. Give prob of sequence svo. 1/220 Calculate prob of sequence rp when two letters picked without replacement from wpwawapwrhhhwawhpw. 1/102 Calculate prob of sequence ac when two letters picked without replacement from {c: 1, a: 1, e: 2}. 1/12 What is prob of sequence prr when three letters picked without replacement from {p: 5, r: 8}? 70/429 Two letters picked without replacement from cjjjnjmpj. Give prob of sequence jc. 5/72 Four letters picked without replacement from ffdfdfflfddddfgd. What is prob of sequence fgff? 1/208 What is prob of sequence aga when three letters picked without replacement from {y: 3, d: 4, g: 8, a: 2}? 1/255 Four letters picked without replacement from mlolfllbmbmmtmftmom. What is prob of sequence bftl? 1/2907 What is prob of sequence xexe when four letters picked without replacement from {f: 2, x: 15, e: 3}? 7/646 Four letters picked without replacement from gggvgvggvvgvh. What is prob of sequence hvgg? 7/572 Four letters picked without replacement from cmcomccmoscmmmcmmc. Give prob of sequence oscc. 7/6120 Three letters picked without replacement from {p: 9}. What is prob of sequence ppp? 1 Four letters picked without replacement from bmbeveeke. Give prob of sequence kbbv. 1/1512 What is prob of sequence qaq when three letters picked without replacement from {q: 5, a: 8}? 40/429 Two letters picked without replacement from iukuuuiukii. What is prob of sequence ku? 1/11 Calculate prob of sequence ewe when three letters picked without replacement from weewewww. 5/56 What is prob of sequence deee when four letters picked without replacement from {e: 7, d: 12}? 35/1292 Two letters picked without replacement from wgivriiyygiy. What is prob of sequence rw? 1/132 What is prob of sequence ir when two letters picked without replacement from iiriiiriiirririiric? 4/19 Two letters picked without replacement from {a: 2, e: 1, x: 2, v: 1, r: 1, w: 1}. Give prob of sequence wv. 1/56 Two letters picked without replacement from {v: 4, o: 6}. What is prob of sequence ov? 4/15 Four letters picked without replacement from acwamcmimczm. Give prob of sequence wmcm. 1/330 Calculate prob of sequence ssss when four letters picked without replacement from ssss. 1 Three letters picked without replacement from vkt. What is prob of sequence kvt? 1/6 Calculate prob of sequence xj when two letters picked without replacement from {x: 2, j: 6}. 3/14 Calculate prob of sequence pbpb when four letters picked without replacement from {j: 2, b: 7, p: 4}. 21/715 Calculate prob of sequence hhe when three letters picked without replacement from {p: 5, a: 5, e: 2, r: 1, n: 1, h: 2}. 1/840 Two letters picked without replacement from {j: 11, f: 9}. Give prob of sequence jj. 11/38 Four letters picked without replacement from ddpdsvssevs. Give prob of sequence dped. 1/1320 Three letters picked without replacement from {o: 3, h: 3, y: 7, u: 2}. What is prob of sequence huy? 1/65 Two letters picked without replacement from oteooooeoeottooet. What is prob of sequence ee? 3/68 Four letters picked without replacement from {x: 1, n: 1, a: 1, z: 1, u: 1}. Give prob of sequence xzan. 1/120 Two letters picked without replacement from {m: 4, b: 3, o: 4}. Give prob of sequence ob. 6/55 Three letters picked without replacement from dpvddvddvjpdupddud. What is prob of sequence puv? 1/272 Calculate prob of sequence dptd when four letters picked without replacement from tddppttd. 3/140 Four letters picked without replacement from {a: 1, r: 2, u: 5, l: 1}. Give prob of sequence aaru. 0 Three letters picked without replacement from {g: 1, m: 7}. Give prob of sequence gmm. 1/8 What is prob of sequence db when two letters picked without replacement from jdjdobdjgjbdddjjjgd? 7/171 What is prob of sequence bbb when three letters picked without replacement from {b: 5, r: 2}? 2/7 Three letters picked without replacement from {m: 4, i: 3, k: 3, f: 3}. Give prob of sequence mkk. 2/143 What is prob of sequence ai when two letters picked without replacement from {r: 4, s: 1, i: 4, g: 7, a: 2, k: 1}? 4/171 Four letters picked without replacement from {y: 1, s: 3, m: 5, j: 3, q: 1}. What is prob of sequence myjm? 1/286 Calculate prob of sequence gtg when three letters picked without replacement from tgg. 1/3 Four letters picked without replacement from {i: 13, t: 2, a: 1, l: 2, e: 2}. Give prob of sequence tale. 1/14535 Two letters picked without replacement from wxiehewg. What is prob of sequence eh? 1/28 Calculate prob of sequence xjx when three letters picked without replacement from {t: 1, g: 1, x: 1, j: 1, d: 1}. 0 Calculate prob of sequence cgc when three letters picked without replacement from {c: 3, g: 3, e: 2}. 3/56 Four letters picked without replacement from bibiq. What is prob of sequence bbqi? 1/30 Two letters picked without replacement from {n: 2, i: 1, y: 1, b: 1, g: 2, f: 1}. Give prob o	{ "pile_set_name": "DM Mathematics" }
erivative of -239435870p5 + 167665561p*2? -14366152200p*2 Find the third derivative of 74m*3q*4 - 3m*3q - 250755m2q*2 - 423mq4 wrt q. 1776m*3q - 10152mq Find the second derivative of -19418515f2 - 141106f + 40 wrt f. -38837030 What is the derivative of 1742s3 - 210s + 194132 wrt s? 5226s2 - 210 Find the first derivative of -23910753d + 8384784 wrt d. -23910753 What is the third derivative of 28819326c5 + 4628c*2 + 7c + 8 wrt c? 1729159560c2 What is the derivative of -1238l*2x + 3522721l2 + 8371lx wrt x? -1238l*2 + 8371l What is the second derivative of 175769440c2p*3 - 103416cp3 + cp*2 + c - 36p*2 - 3p wrt c? 351538880p3 What is the second derivative of 106098121t*3 - 264103066t? 636588726t What is the second derivative of -236cp2rs - 31939cp2s*2 + 3cpr + 80cp + 106prs2 - prs - 13p wrt p? -472crs - 63878cs2 What is the first derivative of 4783n*3z + 5391026n3 - 138z wrt z? 4783n3 - 138 Find the second derivative of -13014d*2g*3 + 183d*2r*3 - dg*3r*2 - 6dg2r*3 - 6dg + 14dr3 - 14dr2 - 3g*3r*2 - gr wrt d. -26028g3 + 366r*3 What is the second derivative of 1181272p*2 - 845936p + 24? 2362544 What is the third derivative of -91182n5 + 5n*3 + 13896573n*2 wrt n? -5470920n*2 + 30 What is the derivative of -868h*3u - 275h2u - 16015019u wrt h? -2604h*2u - 550hu What is the second derivative of 20n4 - 4979n*3 + 47n*2 + 511559n - 122? 240n2 - 29874n + 94 Find the second derivative of b*5 - 7454426b*3 + 1693980b + 13. 20b3 - 44726556b What is the first derivative of -176636210lru + 115574916ru + u wrt l? -176636210ru Find the second derivative of -228673c*3 + 164c*2 - 8242328c - 5 wrt c. -1372038c + 328 What is the derivative of 4l*2 - 7767575l - 70861517? 8l - 7767575 What is the second derivative of 31893619c*3k - 2ck - 56702c + 121 wrt c? 191361714ck What is the first derivative of -m3q + 6799174m3 + 128680m*2q*2 - 3q2 wrt q? -m3 + 257360m2q - 6q Find the first derivative of 2749p*3 + 15913p - 106813473. 8247p2 + 15913 What is the third derivative of -22567u*4 - 361u*3 - 495044u*2 - 7u? -541608u - 2166 Find the first derivative of -230533410z*3 - 1551345207 wrt z. -691600230z*2 What is the third derivative of -6582i*3pt + 6421i*3p + 2i2p - i*2 - 67ipt + 5840it - p wrt i? -39492pt + 38526p Find the first derivative of 19898921iw3 - 2iw2 + i - 197316881 wrt w. 59696763iw2 - 4iw What is the first derivative of 1329a*2kmy + 3a2k + 2a2m + 6akm - 108am + 2ay - 1269a + my wrt k? 1329a*2my + 3a*2 + 6am Find the second derivative of -298108953t*3 + 2646331t + 93 wrt t. -1788653718t What is the third derivative of -816j*2w*3 - 204j*2w*2x + 3033jw*3x - jw2 + 10997wx wrt w? -4896j*2 + 18198jx What is the derivative of 260551164b*2 + 217587664? 521102328b Differentiate -526291892d4 - 432488282 wrt d. -2105167568d*3 What is the third derivative of 30301970q*3t3 + q3 - 8939q2t*2 + 938t*3 wrt q? 181811820t*3 + 6 What is the third derivative of 12p*6 + 14948975p*5x - p*2x + 337p2 - 16px - 31p - 4 wrt p? 1440p3 + 896938500p*2x What is the third derivative of 10p4 + 239093p*3 - 2p*2 + 130p - 162 wrt p? 240p + 1434558 What is the second derivative of 3915q*2u*2 - 1308q*2u - 3q2 - qu*2 + 6qu + 42q - 15407u2 wrt q? 7830u*2 - 2616u - 6 What is the first derivative of 8299145j - 32829214 wrt j? 8299145 Find the first derivative of 14691984a*2 - 138821210. 29383968a What is the second derivative of 16u5z + 2596440u4z - 69uz - 6u - z + 17830 wrt u? 320u*3z + 31157280u2z Find the first derivative of -239iu*3 - 17503iu + 27031i + 3u3 - 49 wrt u. -717iu2 - 17503i + 9u2 Differentiate 2hmq + 23hm + 600086hqv - 13hv + 27h + 12v wrt q. 2hm + 600086hv Differentiate 688630939b*2c3 - b2c - 1838b*2 + 2b + 44289 with respect to c. 2065892817b2c2 - b2 What is the second derivative of -c*2f*3 + 27c*2f*2 + 197c*2f - 2c2 - 104508cf3 + 39cf2 wrt c? -2f*3 + 54f*2 + 394f - 4 What is the second derivative of 105047728o2s*3 + 2os2 - 7os + 2o - 5s3 - 1388s wrt o? 210095456s3 Find the third derivative of -2j*5 + 14878j*4 + 101j*3 + 153j*2 + j + 57318. -120j*2 + 357072j + 606 What is the third derivative of 13321625c3 + 3966426c*2 wrt c? 79929750 Find the second derivative of 93474378g*4 - 3g - 25205075 wrt g. 1121692536g2 Find the first derivative of 15472518d - 3263986 wrt d. 15472518 Find the second derivative of -4665493u4 + u - 7720966 wrt u. -55985916u*2 Find the second derivative of 12203165m*2v - 409mv + 1184v wrt m. 24406330v What is the derivative of 52189370j2 + 57563190? 104378740j What is the second derivative of -17734883u3 - 4878192u wrt u? -106409298u Find the third derivative of -7129295f*2t*3 - 587f*2t*2 - 8f*2t + ft2 - f + 102 wrt t. -42775770f*2 Differentiate -15191815t*2 + 7807388 with respect to t. -30383630t What is the third derivative of 1230s6 + 2019s*5 + 21604970s*2? 147600s*3 + 121140s*2 Differentiate -15ctv + 2ct - 148593cv - 3tvz - 13263849t + 3z wrt v. -15ct - 148593c - 3tz What is the second derivative of 66cp*2uz + 2cpuz + cpz + 4cp - 69490p*2uz - 11p*2u + 291puz + 494pz wrt p? 132cuz - 138980uz - 22u Find the first derivative of -3245b*2 + 11805b + 93805029 wrt b. -6490b + 11805 Find the second derivative of -6614868do2 + 61do - 31673d wrt o. -13229736d Differentiate 111786647o*2 + 232854947 wrt o. 223573294o Find the first derivative of 8b2k*3 + 12839b*2k + 55b2 + 328k*3 + 106k*2 wrt b. 16bk3 + 25678bk + 110b Find the second derivative of -3m2tx2 - 290m*2t + 4146m2x*3 - 15mtx*2 + 5mtx + 10mt + 2mx + 38m + 2tx3 + 5x*2 wrt m. -6tx2 - 580t + 8292x3 What is the second derivative of -289776bg4 - bg + 6147b + 3g*3 + 31 wrt g? -3477312bg2 + 18g Find the second derivative of -2729207i2 + 2193150i. -5458414 Find the third derivative of -2a3c*2 - 102436a*3v*3 - 43a*2c*2 - 14a*2cv + 14ac2v*3 + 2av2 + c2v*3 + 2cv wrt a. -12c*2 - 614616v*3 What is the third derivative of 27290267o*4 + 38000655o*2? 654966408o Find the second derivative of 1700ou*5 - 114ou2 + ou + 172o - 5u*2 - 3u + 3711 wrt u. 34000ou*3 - 228o - 10 Find the third derivative of -977671099x4 - 16958269x*2 wrt x. -23464106376x Differentiate -255527444x - 294160136 wrt x. -255527444 What is the derivative of 39042t*2 - 72t + 245961997? 78084t - 72 What is the third derivative of 111342f*4t - 2f4 - 4f*3t - 11f2t - 215781ft wrt f? 2672208ft - 48f - 24t What is the derivative of -6jls - 62jl - 3325js3 + 7414ls3 + 922s*3 + 3s*2 wrt l? -6js - 62j + 7414s3 What is the third derivative of 796642m*6 + 23306m*2 - 71? 95597040m*3 What is the derivative of -17641251v3 - v2 - 22052126 wrt v? -52923753v2 - 2v What is the third derivative of -24276w6 + 8w*4 - 31w*3 - 8597456w*2 wrt w? -2913120w*3 + 192w - 186 Differentiate 373f4 + f3 + 3f*2 - 115f - 17161911. 1492f3 + 3f*2 + 6f - 115 Find the third derivative of -3215569z4 + 43751355z*2 wrt z. -77173656z What is the third derivative of -95562317k3m + 16k2m - 10456634k2 wrt k? -573373902m What is the second derivative of -7620618b3 + 31b - 7672 wrt b? -45723708b Find the second derivative of 72763k*2q*3 + 8k*2 - 2kq + 1468k + 114q5 + 1 wrt q. 436578k*2q + 2280q3 What is the third derivative of 13734h*4 - 6732h*3 - 27029455h*2 wrt h? 329616h - 40392 Find the first derivative of 167t2 - 32tv + 32t - 96v + 5000 wrt t. 334t - 32v + 32 Find the third derivative of -4743875l*4 - 4574293l*2 wrt l. -113853000l What is the th	{ "pile_set_name": "DM Mathematics" }
f2 + 40 + 0f. Let v be j(4). Suppose -d = vu - 35, -u = -4d - 2u + 96. Calculate the remainder when d is divided by 9. 5 Let a = -75 + 51. Let f = a + 21. Calculate the remainder when (-1)/f593 is divided by 31. 28 Let x = -1239 + 1419. Calculate the remainder when 371 is divided by x. 11 Let o = -92 + -59. Let g = o + 216. Calculate the remainder when g is divided by 12. 5 Let d be (-23)/2 - (5/(-10) + 2). Let c = d - -23. What is the remainder when 16 is divided by c? 6 Let j = 35 - 21. Suppose 6h + 7h = 715. What is the remainder when h is divided by j? 13 Suppose -2 = p - 3. Let z(i) = -21i2 - i3 + 17 + 27i2 + i - 22i*2. What is the remainder when p is divided by z(-16)? 0 Let y = -90 - -96. Calculate the remainder when 10 is divided by y. 4 Let b = 294 + -139. Suppose 5i = 4o + 220, -5o + 13 = 2i - 42. What is the remainder when b is divided by i? 35 Suppose 0u + 4u - 60 = 0. Let n(h) = 113h - 449. Calculate the remainder when u is divided by n(4). 0 Let h = 10 + 4. Let m = 6181 + -6129. What is the remainder when m is divided by h? 10 Let k = 2689 + -2667. Calculate the remainder when 196 is divided by k. 20 Let x(f) = -7 - 3f + 4f + 3f. Calculate the remainder when x(6) is divided by (-4)/(-3) - 115/(-15). 8 Suppose 4v = -a + 125, a - 33 = 2v + 110. Calculate the remainder when a is divided by 75. 62 Let h(r) = -204r*3 + 2r*2 + 4r + 2. Calculate the remainder when h(-1) is divided by 9. 6 Suppose -422g - 130 = -423g. What is the remainder when g is divided by 45? 40 Let b(h) = -h*3 + 2h + 4. Let a be b(0). Let o = 1 + a. Calculate the remainder when (3/(-9))/((-2)/114) is divided by o. 4 Let m(r) = 2r2 + 1. Suppose -22 = -4j + 14. Let w(z) = z*3 - 10z*2 + 9z + 10. What is the remainder when w(j) is divided by m(1)? 1 Suppose -2r - 32 = -38. Suppose 5z + 5v - 55 = 0, 0 = -5z - 6v + rv + 45. Calculate the remainder when z is divided by (2/6)/((-2)/(-18)). 0 Suppose -k - 15 = -42. Suppose 14h = -28 + 238. What is the remainder when k is divided by h? 12 Let y = 3596 + -3581. Calculate the remainder when 2/(-6)1-87 is divided by y. 14 Let w = -61 + 36. Let y = -3 - w. Calculate the remainder when 86 is divided by y. 20 Calculate the remainder when 126/(-27)-9 + 0/(-3) is divided by 12. 6 Let q be 32/1236/1. Let s = -90 + q. What is the remainder when 26 is divided by s? 2 Suppose -5l + 173 = p, 130 = 4l + 3p + 2p. Calculate the remainder when 205 is divided by l. 30 Suppose 883 = -5k - h, -k - 276 = -2h - 106. Let q = -103 - k. Calculate the remainder when q is divided by 15. 13 Calculate the remainder when (-1 - 1)2/((-4)/249) is divided by 65. 54 Suppose -2n - 2n - a = -32, -a - 32 = -4n. Suppose -7y + ny - 10 = 0. Suppose t + 2 - y = 0. What is the remainder when t is divided by 5? 3 Suppose -5j + 117 + 168 = 0. Let t = j - 32. Suppose 5q - 358 = -2u, q - 71 = -2u - 1. Calculate the remainder when q is divided by t. 22 Let z(h) = h3 - 24h*2 - 27h + 60. What is the remainder when 429 is divided by z(25)? 9 Suppose 4l - 17 = 3d, -d + 6 - 1 = 0. Suppose 3y - 68 = -2r, 8y - 11y + 5r = -40. What is the remainder when y is divided by l? 4 Let w be 3 - (-4)/82. Calculate the remainder when (21/(-1) + w)-1 is divided by 3. 2 Let u = -803 + 827. Calculate the remainder when 67 is divided by u. 19 What is the remainder when ((-3)/5-5)/((-5)/(-25)) is divided by 8? 7 Let g be (-2 - 14/(-6))0. Calculate the remainder when -4 - (g - (1 + 24)) is divided by 12. 9 Let o(x) = 23x*3 + 2x*2 - 2x + 1. Let y = -26 - -31. Suppose -46 = -yt - 3i + 31, -5t = -5i - 45. Calculate the remainder when o(1) is divided by t. 11 What is the remainder when (14 + 7)/((-9)/(-15)) is divided by 14 + -3 + 3 + -1? 9 Suppose -5k + 0k - 20 = 0, 4o = -k + 8. Suppose -2b = -4, 3q - 184 = ob + b. Calculate the remainder when q is divided by 18. 10 Let b(i) = -19i + 15i + 3 + 13 + 8. What is the remainder when b(-7) is divided by 14? 10 Suppose 3w = -4m + 4, -1 - 3 = -4m - 4w. Let y = m - -16. Let a = -8 + 73. What is the remainder when a is divided by y? 14 Suppose -7l = 3l - 1560. What is the remainder when (-4)/26 - (-9072)/l is divided by 10? 8 Let x(j) = -j3 + j2 + j + 1. Let v be x(-1). Let k(l) = -4l - 4 - 6l*2 + 13lv - 4 - l3. What is the remainder when 5 is divided by k(6)? 1 Let n(w) = -12w - 17. Let d(v) = 13v + 2. Calculate the remainder when d(7) is divided by n(-3). 17 Let h = -15 - -41. Suppose 3y - h = 19. Calculate the remainder when ((-58)/(-4)-8)/(-2) is divided by y. 13 Let f(d) = -6d3 - 2d*2 - 2d - 1. Let m be f(-2). Let k = 73 - m. Suppose -3o + 2 + 22 = 0. What is the remainder when k is divided by o? 6 Suppose -195 = 3r - 3l, -r - 5l = -2l + 73. Let m = -54 - r. What is the remainder when 49 is divided by m? 10 Suppose -30 = -3f + 24. What is the remainder when (-23 + 2)(-48)/f is divided by 30? 26 Suppose 0 = 18c + 46 - 406. Calculate the remainder when 317 is divided by c. 17 Let k(i) = 22i + 86. What is the remainder when k(9) is divided by 57? 56 Suppose p = 4r + r - 33, -3r - 4p = -6. Calculate the remainder when 128 is divided by 385/15 + (r/(-9) - -1). 24 Suppose -u - 9 = 4d - 48, 0 = -4u - 4d + 96. Calculate the remainder when (31 + 0 - 1)/1 is divided by u. 11 Let v = 1046 - 568. What is the remainder when v is divided by 96? 94 Let y = -18 + 6. Let t be 252/y - (-2)/1. Let l = -11 - t. What is the remainder when 28 is divided by l? 4 Let w = -92 + 101. Let v = 13 - -3. Suppose f - v = k, -f = 4k - w - 12. Calculate the remainder when 83 is divided by f. 15 Let p = 150 - 138. Calculate the remainder when 33 is divided by p. 9 Let h(n) = -n*3 - 10n*2 - 12n + 17. Let z(f) = -f + 1. Let d(l) = -h(l) + 5z(l). What is the remainder when 40 is divided by d(-9)? 4 Let i(v) = -4v + 219. What is the remainder when 73 is divided by i(50)? 16 Let i = 253 - 149. Suppose 46 = 2r - 2y, 4r - i = -y + 8. Calculate the remainder when 133 is divided by r. 25 Suppose 0t - o - 251 = -4t, 3o = 15. Let c = 72 - t. Calculate the remainder when 22 is divided by c. 6 Let x(q) = 2q + 98. What is the remainder when 645 is divided by x(-13)? 69 Suppose s - 3w - 9 = -0w, 0 = -2w - 4. Suppose p = -s, p - 2p + 102 = 5z. Let v(b) = b + 12. Calculate the remainder when z is divided by v(-1). 10 Let q be 76/6 - 16/(-48). Suppose 0 = 4s + 4u - 44, s + q - 36 = 3u. What is the remainder when s is divided by 4? 2 Let t(l) = -l3 + 4l*2 + 3l. Let v be t(5). Let k = 33 - v. Calculate the remainder when k is divided by 15. 13 Let g(c) be the third derivative of c*6/120 + 7c*5/60 - 3c*4/8 + 11c*3/6 + 8c*2. What is the remainder when 131 is divided by g(-8)? 17 Suppose -38 + 8 = -2y. Let b(u) = 2u3 - 40u*2 + 34u + 117. What is the remainder when b(19) is divided by y? 11 Let x = -419 + 548. Calculate the remainder when x is divided by 17. 10 Suppose 530 = -17s + 2400. Calculate the remainder when s is divided by 29. 23 Let r = 1800 - 1748. Calculate the remainder when r is divided by 51. 1 Let j = 14 - 10. Suppose -j = -3y - y. What is the remainder when 2 is divided by y? 0 Let u be (-72)/(-7) - 2/7. Suppose -2y = -3g - 15, -16y = 5g - 17y + 18. Calculate the remainder when 16 is divided by u + (-3)/g + -2. 7 Suppose 5r - 5x + 181 = -479, -2r = 2x + 268. Let a = 155 + r. Suppose -4i = 2c - 20, c - 2c + 5i = 4. Calculate the remainder when a is divided by c. 4 Let d(u) = 16u - 125. What is the remainder when 67 is divided by d(10)? 32 Let d = 11 - 5. Suppose -2g = d - 16. Suppose 33 = c - gw, 3 = 2w + 5. Calculate the remainder when c is divided by 15. 13 Let p(h) = 9h + 335. What is the remainder when p(-35) is divided by 2? 0 Suppose 3w - 14 = x, 5x - 9x - 1 = -w. Let n(u) = -u3 + 7u*2 + 2u - 9. What is the remainder when n(7) is divided by w? 0 Let u = -244 + 252. Calculate the remainder when 44 is divided by u. 4 Let d be 11 - 7 - (-3 - -2). Suppose 0 = ds - 3j - 328, -s - s = j - 129. What is the remainder when s is divided by 17? 14 Calculate the remainder when 10 - (-7 - -14) - (-1 + -154) is divided by 53. 52 Let g(v) = -v*3 + 4v*2 + 7v - 2. Let b be	{ "pile_set_name": "DM Mathematics" }
-7 + 13. Find the third derivative of 2cs - c6 + 4c*2 + 3c*6 wrt c. 480c*3 Let x(f) be the third derivative of 13f*6/60 - 41f4/24 - f3/6 - 2f2 + 11. What is the second derivative of x(v) wrt v? 156v What is the second derivative of x*3 - x - 2x - 5x3 wrt x? -24x Suppose -6w + 10 = -32. What is the derivative of 2 - 2s*4 - ws + 6s4 + 7s wrt s? 16s3 Find the first derivative of 8n*4 + 0n*2 - 23 - 5n*2 + 5n*2 wrt n. 32n*3 What is the derivative of 6 - 18q - 6q - 12q + q wrt q? -35 Let d(k) be the second derivative of k*3/2 - 2k*2 + k. What is the first derivative of d(l) wrt l? 3 Let j = 0 - -3. Find the second derivative of -4q - q - 3q3 + jq + 2q3 wrt q. -6q Let d(z) = -9z3 - 19z*2 - 5. Let a(f) = 5f*3 + 9f*2 + 2. Let n(y) = 5a(y) + 2d(y). Find the third derivative of n(k) wrt k. 42 Differentiate 2177p + 12 - 2177p - 21p*4 with respect to p. -84p*3 Let d be ((-2)/6)/(8/(-48)). What is the second derivative of 28u*2 - 6u*5 + 6u - 12ud - 16u*2 wrt u? -120u*3 Let f(c) be the second derivative of 5/2c2 + c3 - 3c + 0. What is the first derivative of f(q) wrt q? 6 Let u(a) be the second derivative of 0a*2 + 0a*3 - 1/6a*4 - 3a + 1/20a5 + 0. What is the third derivative of u(y) wrt y? 6 Suppose 0 = v - 0v - 6. Find the third derivative of 0m6 - 4m*2 - vm*6 + 3m*6 wrt m. -360m3 Let i(z) be the second derivative of z8/28 + z*4/12 + z. What is the third derivative of i(w) wrt w? 240w*3 Suppose -4 = -5x + 6. Let h = -2 + x. Find the second derivative of -4t4 + 3t + 7t4 + ht*4 wrt t. 36t*2 Let j be (-1)/2 - (-4)/8. Let g(w) be the second derivative of 0w*2 + 1/3w*3 + w + j - 1/6w*4. Find the second derivative of g(f) wrt f. -4 Let b(w) be the third derivative of 47w5/60 - w4/3 + 9w2. What is the second derivative of b(l) wrt l? 94 Suppose -y + 14 = 4y + w, -3w = -2y - 8. Suppose -yz + s - 7 = -3z, 3z + 5s = 29. Differentiate -4o + 4 - 6 + zo with respect to o. -1 Suppose -24 = 2f - 6f. Suppose -d - 15 = -fd. What is the derivative of -1 + xd + 5 - 4x3 + x3 wrt x? -6x2 Let o be (6/8)/(-3)-4. Let v be (6 - o)(-14)/(-35). Find the first derivative of -1 - h - vh + 1 + 2 wrt h. -3 Suppose -4m + 24 = u, -28 = -4m + 3u - 4. What is the first derivative of md*3 - 5 + 112d*2 - 112d*2 wrt d? 18d*2 Suppose m - 3v - 1 = 0, 2v = -3m - 2v + 3. Let k(l) = 2l. Let h be k(m). What is the second derivative of y*5 - 2y + hy5 + y - 2y*5 wrt y? 20y*3 Suppose 6t - t = 20. What is the second derivative of 3s - ts - 2s + 4s*2 wrt s? 8 Suppose 0r - 5r + 10 = 0. Find the third derivative of 5z*2 - 7z*r + 0z*2 + 4z*3 wrt z. 24 Let q(d) be the third derivative of -2d5/15 - d3 - 6d2. Differentiate q(h) with respect to h. -16h Let w(n) = 6n4 + 2n*3 - 3n*2 + 50. Let k(f) = -11f*4 - 5f*3 + 5f*2 - 101. Let p(v) = 2k(v) + 5w(v). What is the first derivative of p(d) wrt d? 32d*3 - 10d Let d(t) be the second derivative of t7/21 + t3/3 - 6t. What is the second derivative of d(x) wrt x? 40x*3 Find the first derivative of -16 + 12 - 21k2 - k2 wrt k. -44k Differentiate 20t*4 + 9 + 17 + 0 wrt t. 80t*3 Let x = -25 - -29. Let b(y) be the second derivative of 1/20y*5 - 2y + 0yx + 0y*2 + 1/3y*3 + 0. Find the second derivative of b(r) wrt r. 6r Find the second derivative of 4u - 5u + 10u2 + 2u wrt u. 20 Let m(s) be the first derivative of s*8/210 + 5s*4/24 + 8s*3/3 + 4. Let n(f) be the third derivative of m(f). Find the first derivative of n(a) wrt a. 32a*3 Find the third derivative of -40o*2 + 5o*5 - 8o*5 - 3o*5 wrt o. -360o*2 Let g(p) be the first derivative of -12p*5/5 + 25p*3/3 + 9. Find the third derivative of g(a) wrt a. -288a Find the first derivative of 29 - 10 + 5i2 - 9 wrt i. 10i Find the third derivative of 4k2 + 7k*3 + 13k*3 - 12k*2 - 29k*3 wrt k. -54 Suppose u - 2 = 4w, -3u - u = 4w - 28. Find the second derivative of 272 - us - 272 - s5 wrt s. -20s*3 Find the first derivative of -16s*2 + 5 + 14 + 9 wrt s. -32s Suppose 3h = 5i - 22, 2h + 4 = 2i - 4i. What is the third derivative of x2 + 0x*2 + 3x*3 - 3x*i + 5x2 wrt x? 18 Let d(m) = m3 - 9m2 + 2m - 10. Let t be d(9). Find the first derivative of 0v + t - 4v + v - v wrt v. -4 Let a(b) = 5b4 + 7b*3 + 2b + 7. Let v(t) = 3t4 + 3t*3 + t + 3. Let f(q) = -3a(q) + 7v(q). What is the second derivative of f(z) wrt z? 72z*2 Let j be 0/1(-8 + 7). Differentiate 4c2 + 13 + jc*2 - 12 wrt c. 8c Let c(f) = -8f3 - 4f2 + 10. Let j(x) = x2 - 1. Let m(y) = -c(y) - 4j(y). Find the first derivative of m(t) wrt t. 24t*2 Let v(z) be the third derivative of -19z8/336 - z5/60 + 13z2. What is the third derivative of v(f) wrt f? -1140f*2 What is the third derivative of 11m*2 + 5m*2 - 12m*2 + 6m*6 wrt m? 720m*3 What is the third derivative of 193w*2 - 93w*2 - 94w*2 + 4w - 5w3 wrt w? -30 Let q(z) be the second derivative of -1/3z*3 + 0 + 3z + 0z2 - 1/12z*4. What is the second derivative of q(w) wrt w? -2 What is the second derivative of 0s*5 + 4s + 2s - 2s*5 - 2s*5 wrt s? -80s3 Let g(i) be the third derivative of -i6/12 - 5i4/12 + 22i*2. Find the second derivative of g(u) wrt u. -60u Let h(u) be the first derivative of 3 + 0u - 1/6u6 + u3 + 0u4 + 0u*2 + 0u*5. Find the third derivative of h(t) wrt t. -60t*2 Let z = 0 + 2. Find the third derivative of zq*6 - 3q*5 + 3q*2 + 3q*5 - 3q*6 wrt q. -120q*3 Let q(a) be the second derivative of 2a*6/3 - 13a*4/6 + 36a. Find the third derivative of q(g) wrt g. 480g Let o(k) = -21 + 12 + 14 + 10k*4 - 7k*3. Let d(h) = 5h*4 - 4h*3 + 3. Let a(q) = 7d(q) - 4o(q). Differentiate a(y) with respect to y. -20y*3 Let g be 22/8 - (-9 - -4)/20. Let w(k) be the first derivative of -2 - 3k - 3/4k4 + 0k*g + 0k*2. Find the first derivative of w(m) wrt m. -9m*2 Let b = 4 + 1. What is the third derivative of 8c*6 - bc*6 + 4c*2 - 4c*6 wrt c? -120c3 Let h(i) = i3 + 1. Let l(n) be the first derivative of -n*4/4 + 3n*2/2 - 3n - 1. Let r(j) = -3h(j) - l(j). What is the second derivative of r(z) wrt z? -12z Let v(i) = -2i. Let m(r) = 5r - 22. Let k(n) = m(n) - 5v(n). Differentiate k(x) wrt x. 15 Let w be (-4)/20 + 22/10. Find the second derivative of 0v - wv + 5v - 2v4 - v wrt v. -24v*2 Find the second derivative of 0j + 0j4 - 7j*4 + 10j + 0j wrt j. -84j*2 Find the third derivative of 5r*6 + 8r*6 - 5r*6 - 12r*2 wrt r. 960r3 Let f(r) be the first derivative of r3/3 - 3r + 7. What is the derivative of f(v) wrt v? 2v Let f be 7 + -2 + 0/2. Differentiate 2n4 + n4 - fn*4 - 6 + 3 wrt n. -8n*3 What is the second derivative of -15a*2 + 10a - 30 + 30 wrt a? -30 Let l = 4 - 0. Find the third derivative of 0i2 - i2 - 2i4 + i4 + 0il wrt i. -24i Let b be ((-3)/2)/((-15)/70). Let c = -2 + b. What is the second derivative of -cg + g3 + 5g + 2g wrt g? 6g Let r(x) be the second derivative of x6/240 + x5/40 + x*4/4 - 5x. Let n(f) be the third derivative of r(f). Differentiate n(q) wrt q. 3 Let j(l) = -28l3 + 35l - 28. Let q(p) = -3p3 - 3 + 4p + 12p2 - 12p*2 + 0p*3. Let o(k) = 4j(k) - 35q(k). Differentiate o(x) with respect to x. -21x*2 Let j(p) be the first derivative of 3p*2 + 2p + 6. What is the first derivative of j(h) wrt h? 6 Let j = 29 - 19. Suppose -2v + j = -f + 5f, -5v = 4f - 13. Find the third derivative of -p*5 + 3p*2 + fp*5 - 2p*2 wrt p. 60p*2 Let m(b) = -21b*3 - 16b - 3. Let t(v) = 20v3 + 15v + 2. Let a(k) = -2m(k) - 3t(k). Find the second derivative of a(o) wrt o. -108o Let y(k) = -k4 + k3 - 1. Let v(r) = -15r*4 + 27r*3 - 12r*2 - 27. Let z(h) = 2v(h) - 54y(h). What is the third derivative of z(b) wrt b? 576b What is the first derivative of -21i3 + 13i*3 - 5i*3 + 6 - 10i*3 wrt i? -69i*2 What is the second derivative of -14x - 3x + 6x - 11x3 + 28x*3 wrt x? 102x Let c(r) be the first derivative of -7r*	{ "pile_set_name": "DM Mathematics" }
j(i) = -3i3 + 4i*2 - 407. Calculate -9j(z) - 4w(z). -z3 + 403 Let p(w) = -4w*2 - 2. Let i(s) = -4s2 + s - 3. Let t(c) = c2 + 16c - 55. Let h be t(-19). Calculate hi(l) - 3p(l). 4l*2 + 2l Let j(l) = -6l - 1. Let v(h) = -29h + 145. Calculate 5j(g) - v(g). -g - 150 Let a(p) = -15p - 52. Let j(k) = 17k + 53. Determine 7a(l) + 6j(l). -3l - 46 Let d(q) = -6q + 3. Suppose -t - 2a - 3 = a, 0 = -5t - 2a - 2. Let p(m) = t + m - m - 1 + 2m. What is 3d(h) + 8p(h)? -2h + 1 Let k(a) = -23a - 246. Let x(w) = -8w - 82. Calculate -6k(l) + 17x(l). 2l + 82 Let d(c) = c + 1. Let f(l) = l3 + 4l*2 - 3. Let t be f(-4). Let k(o) = -3o + 62. Let a(u) = -u + 25. Let x(w) = 10a(w) - 4k(w). Give td(m) + x(m). -m - 1 Let h(k) = -k2 + 4k + 37. Let v(p) = -p*2 + 10p + 74. Give 5h(o) - 2v(o). -3o2 + 37 Let w(r) = 8r. Let h(d) = -15d. Suppose -2c = 8, 3l + 30 = 4c + 25. Give lw(v) - 4h(v). 4v Let x(t) = 24t - 515. Let c(p) = -10p + 258. Determine 7c(o) + 3x(o). 2o + 261 Let d(n) = -n*3 - n - 1. Suppose -2c = -0 - 6. Let r(u) = 3u2 - u3 + 3u*3 + 0u*3 + 4 + cu. Calculate -3d(s) - r(s). s3 - 3s*2 - 1 Let a(f) = -139f - 14. Let s(z) = -140z - 17. Give -6a(j) + 5s(j). 134j - 1 Let n(u) = 120u - 1. Let i(q) = -121q + 1. Give -4i(c) - 5n(c). -116c + 1 Let i(v) = 56v + 6. Let w(r) = 57r + 7. What is -5i(d) + 4w(d)? -52d - 2 Let z(r) = -r*2 - 4r - 2. Suppose 3n - 3 = 12. Let o = 18 - 20. Let g(h) = -2h - 2h2 - 6h - h - 5. What is nz(d) + og(d)? -d*2 - 2d Let c = 936 + -938. Let j(w) = -w. Let x(o) be the third derivative of -o*5/30 - 11o4/24 + o2. What is cx(r) + 22j(r)? 4r2 Let r be 1 - 12(-7)/(-21). Let d(u) = -6u - 2. Let c(w) = -7w - 2. Determine rd(i) + 2c(i). 4i + 2 Let b(r) be the first derivative of -r2/2 + 2. Let u(g) = 3g*2 + 4g. Let m = -32 + 56. Let f = m - 23. What is fu(a) + 4b(a)? 3a2 Let f(c) = -c + 1. Let u(g) be the first derivative of -g2 + 3g + 218. Suppose -2o = 2o + 16. Give ou(t) + 10f(t). -2t - 2 Let m(a) = -1. Let z(i) = -3i*2 + 6i - 7. Calculate 3m(g) - z(g). 3g*2 - 6g + 4 Let v(o) = 0 + o*2 + 2 + 3o - 17. Let m be v(-6). Let k(c) = -3c3 - 3c*2 + 4c + 1. Let i(d) = 3d3 + 4d*2 - 5d - 2. Determine mi(x) + 4k(x). -3x3 + x - 2 Let i(a) = -11a + 5. Let v(t) = 9t - 4. Let w(n) = -5i(n) - 6v(n). Suppose -5f - 2 = -3f. Let g(j) = -3 + 0 + 3 - 3j + j*2. Determine fg(q) - 2w(q). -q2 + q + 2 Let n(z) = 2z*2 + 3z - 5. Let x(p) = -3p2 - 7p + 11. Suppose 3w + 4d = d - 18, 0 = d - 1. Calculate wn(b) - 3x(b). -5b2 + 2 Let f(u) = -5u - 12. Let s(i) = i + 3. Let h(r) = -f(r) - 3s(r). Let v(p) = 3p + 5. Give 7h(y) - 4v(y). 2y + 1 Let y(i) = -2i*2 + i - 3. Let o(f) = -6f*2 + 6f - 1. Let c(n) = -2n2 + 2n. Let s(k) = -11c(k) + 4o(k). Let t = -263 + 260. Give ty(m) + 2s(m). 2m2 + m + 1 Let o(g) = g + 1. Let l = -269 + 6457/24. Let q(k) be the third derivative of 0 + 2/3k*3 + 4k*2 + 0k + lk4. Calculate -3o(d) + q(d). -2d + 1 Let o(i) = i3 + i2 + i + 1. Suppose 5 = 26j - 25j. Let t(y) = -2y - jy3 - 6y*2 - 8 - 2y + 2y - 4y. Calculate -6o(g) - t(g). -g3 + 2 Let v(r) = r2 + r - 1. Let l(i) = 3i2 + i - 6. Let j(o) = -o3 + 3o2 - 13o + 17. Let a be j(2). Calculate av(z) + l(z). -2z*2 - 4z - 1 Let j(h) = -10h. Let y(m) be the second derivative of -11m*3/6 - 8m - 14. Determine 5j(i) - 4y(i). -6i Suppose -3o = 4p - 4, 8p + 3o - 3 = 5p. Let l(h) = 5h3 + 6h + 6. Let d(y) = y + 1. Give pl(t) - 6d(t). 5t3 Let q(l) = 9l*3 + 5l*2 - 8l - 6. Let v(x) = 19x3 + 11x*2 - 17x - 13. Let j = -1011 + 1017. What is jv(r) - 13q(r)? -3r3 + r2 + 2r Let t(u) = 5 + 3 + 0 + u - 1. Let q(m) be the third derivative of m*4/12 + 10m*3/3 - 2m*2 + 42. Give -3q(y) + 8t(y). 2y - 4 Let s(p) = 2p3 + 2p - 1. Let t(n) = -3n - 52. Let g be t(11). Let f = g - -83. Let b(j) = -10j*3 - 11j + 6. What is fb(r) - 11s(r)? -2r3 - 1 Let z(y) = -20y*3. Let i(g) = 19g*3. Calculate 2i(p) + 3z(p). -22p*3 Let h(w) = 549w*2 - 7. Let p(k) = -274k*2 + 3. What is 3h(a) + 7p(a)? -271a*2 Let r(i) = -2i*2 - 6i - 1. Let d be r(-2). Let m(s) = -1 - 1 + 4s - 2 - 5s. Let b(l) = 2l + 7. Calculate db(p) + 5m(p). p + 1 Let b(c) = 46c*2 + 10c. Let r(o) = 45o2 + 8o. What is -4b(y) + 5r(y)? 41y2 Suppose 4 = 4w - 0. Let q(o) = -o*3 + 3o2 - o. Let t(d) be the third derivative of d6/120 - d*5/60 - 26d*2. Calculate wq(m) + 3t(m). 2m3 - m Let n(c) = c2 - 2c + 3. Let a(g) = -3g*2 + 5g - 7. Give 2a(i) + 5n(i). -i*2 + 1 Let i(v) = 2v*3 - 6v*2 + 5. Let p(u) = 2u*3 - 5u*2 + 4. Calculate -5i(y) + 6p(y). 2y*3 - 1 Let f(o) = 3o. Let l(a) = 357a. What is -630f(v) + 5l(v)? -105v Let r(c) = -17c2 + 14c - 9. Let o(t) = -9t2 + 8t - 5. Calculate 11o(z) - 6r(z). 3z2 + 4z - 1 Let m(n) = 2n. Let o(s) = -5s - 1. Let k(i) = -15i3 + 9i*2 - 5i - 3. Let g be k(1). Give gm(l) - 6o(l). 2l + 6 Let l(w) = -8w2. Let k(h) be the third derivative of h5/60 - 2h2. Suppose 5y = -4x - 4, -3x + 7y = 3y + 3. Give xl(s) - 4k(s). 4s2 Let o(q) = 2q - 1. Let y(x) = 8 + 11 + 10 - 26 - 5x. Let p = -2 + 2. Suppose -f + 3f + 16 = p. Determine fo(j) - 3y(j). -j - 1 Let r be 0 + -3 - 1-4. Let u(x) be the third derivative of -1/6x*3 - 3x*2 + 0x + 0. Let j(p) = p + 5. Calculate rj(c) + 4u(c). c + 1 Let d(p) = -p3 - p2 + p + 1. Let o(l) = -3l3 - 5l*2 + 5l + 6. Let n(b) = b*2 - 65b + 69. Let y be n(64). Calculate yd(r) - o(r). -2r3 - 1 Let m(t) = -t2 + t. Let h(a) = -2a2 + 9a - 5. What is h(k) + 2m(k)? -4k*2 + 11k - 5 Let v(b) = -b*3 - 2b*2 - b + 1. Let w(z) = 7z*3 + 10z*2 + 18z - 6. Calculate -5v(d) - w(d). -2d*3 - 13d + 1 Let a(o) = -7o3 + 4o*2 + 4o. Let t(f) = 3596f2 + 7f*3 - 5f - 1 + 1 - 3601f2. Calculate 5a(m) + 4t(m). -7m*3 Let l(q) = -q - 1. Let x be (-34 + 32)((-1)/1 - 1). Let a(m) = -2m + x - 4 - 6. Suppose 0 = -0s + 2s + o + 3, -5o = 5s + 10. Determine sa(j) + 4l(j). -2j + 2 Let b(m) = -4m2 - 5m + 9. Suppose 26u + 156 = 30u. Let y be (-72)/(-20) + u/(-15) + 3. Let f(s) = 2s2 + 2s - 4. Give yb(g) + 9f(g). 2g2 - 2g Let k(b) = -4b - b2 + 0 + 3b + 1 + b*3. Let t(o) = -7 + 2o + 96o2 - 3o*3 + 5 - 94o*2. Calculate -2k(d) - t(d). d*3 Let x = -9 + 15. Let w(p) = -8p + 1. Let z be 8/(-6) + 605/33. Let j(f) = 4 + 2 - 7 - zf + 3. Calculate xj(g) - 13w(g). 2g - 1 Let r(t) = 3t + 1 + t - 6t - t*2. Let l = -23 - -33. Let k(j) = 2j*2 + 5j - 3. Let u = 26 + -22. Give lr(v) + uk(v). -2v2 - 2 Let p(w) = -31w*3 + 3w*2 + 2w. Let s(g) = g3 - g2. Give p(c) + 2s(c). -29c3 + c2 + 2c Let t(x) = 20x*3 - 3x*2 - 6x + 2. Let j(r) = -21r3 + 4r*2 + 8r - 3. Give 3j(v) + 4t(v). 17v3 - 1 Let c(z) be the first derivative of -3z*4 - 11z - 34. Let n(q) = q*3 + 1. What is 4c(r) + 44n(r)? -4r*3 Let q(b) = -2b*2 + 3b. Let d(i) = -7i2 + 3i - 9. Let j(y) = -y*2 - y. Let f(c) = d(c) - 6j(c). Let h be f(8). Let l(p) = -p. What is hq(u) - 3l(u)? 2u2 Let z(f) = 18f*2 + f - 2. Let o(n) = -40n*2 - 2n + 5. Determine 3o(g) + 7z(g). 6g2 + g + 1 Let f(o) = o2 - 6. Let g(i) = -1. Let u be 30/(-60)21. Calculate uf(q) + 3g(q). -q2 + 3 Let n(s) = -5s*2 + 14s + 64. Let m(l) = l*2 - 6l - 33. What is -7m(o) - 3n(o)? 8o2 + 39 Let b(o) = 1. Let w be (3/2)/((-3)/(-16)). Let f be w + (-4 - -3)2. Let a(y) = -2y - 8. Give fb(z) + a(z). -2z - 2 Suppose q + 12 - 8 = 0. Let t(a) = -a2 + 5a + 4. Let i(j) = -j - 1. Let x(f) = qi(f) - t(f). Let y = 36 - 37. Let z(d) = 2d. Calculate yz(u) - 2x(u). -2u2 Let w(j) = j3 - 7j*2 + 7j + 7. Let r = 175 - 161. Let b(h) = -2h - 3h*2 + 1 + 5h*2 - 3. Determine rb(n) + 4w(n). 4n*3 Let t(a) = 4a3 - a2 + 1 + a + 0a3 - 3a3. Let x = -25 - -31. Let c(m) = -19 + x + 11 + 3 + m. Give c(w) - t(w). -w3 + w*2 Let r(n) = 5n*2 - 2n - 5. Let v(m) be the second derivative of -m5/20 + m4/3 - m*3/6 - 2m*2 - 937m. Calculate -4r(c) + 5v(c). -5c*	{ "pile_set_name": "DM Mathematics" }
c*2 Let u(i) = i + 8. Let t be (24/18)/(1/(-5 + 2)). Let z(n) = 3n + 17. Let c(b) = tz(b) + 9u(b). Let f(o) = 2o2. Give c(f(l)). -6l*2 + 4 Let s(w) = -2w + 24. Let u(o) = 6o - 68. Let k(m) = -17s(m) - 6u(m). Let g(q) = -55q + 3. Calculate g(k(h)). 110h + 3 Let t(i) be the third derivative of i4/4 + 39i2. Let a(m) be the third derivative of m4/24 + 3m2. Calculate a(t(p)). 6p Let y(r) = 6r. Let v = 57 - 57. Let c(x) = vx2 + x2 - 13x + 13x. Calculate y(c(d)). 6d2 Let w(d) = 64d - 44. Let a(q) = -q*2. What is w(a(x))? -64x*2 - 44 Let q(f) = -22f. Let o(m) = -33682m2. What is q(o(h))? 741004h*2 Let b(w) = -37 + 0w*2 + 0w*2 + 17 + 17 + 7w*2. Let g(i) = -9i. Calculate g(b(r)). -63r2 + 27 Let h(j) = 21j. Suppose 4g - 664 = 4p, -4g + 2p - 185 = -839. Let c(n) = 161n - gn - 2n2. Determine c(h(o)). -882o*2 Let f(m) = -3m*2. Suppose 5 = 5u, -16 = 4t + 3u - 119. Let l(j) = tj - 8j - 3j2 - 17j. Determine l(f(p)). -27p4 Let u = 6 + -4. Let y(f) = -8f*2 + 14f*u - 9f*2. Let b(t) = -4t*2 - 2t2 - t2. Calculate b(y(w)). -63w4 Let t(q) = 10q*2. Let g(d) = -10d*2 - 9d*2 - 6 + 8d*2. Let i(k) = 21k*2 + 11. Let n(f) = -11g(f) - 6i(f). Determine t(n(j)). 250j*4 Let v(h) = -4h*2. Let p(y) = 11y + 2. Let d be p(5). Let l(s) = 54 - 6s2 - 111 + d. Give v(l(u)). -144u*4 Let l(h) = -98h*2. Let x(r) = -373r. Determine x(l(f)). 36554f2 Let r(s) = -s2 + 2s. Let y(n) = 237n - 78n - 78n - 82n. What is r(y(w))? -w*2 - 2w Let m(v) = v*2. Suppose -2k + 2p = 3 - 17, 3p = -k - 1. Suppose -2w + 4 = 5j - 15, -11 = -4w - j. Let y(h) = -w + 2 + kh. What is y(m(a))? 5a2 Let v(h) = 5 - 13 + 8h - 2h + 8. Let s(p) = -p2 + p - 1. Let d(j) = -6j*2 + 3j - 3. Let q(z) = -d(z) + 3s(z). Determine q(v(n)). 108n2 Let y(k) = k2 - 5k + 6. Let g be y(8). Let n = -22 + g. Let w(s) = 10s - ns - 4s. Let b(i) = -i*2. What is b(w(l))? -4l*2 Let n(y) = 134y*2 + 12. Let w(q) = 5q. Calculate n(w(s)). 3350s2 + 12 Let u(l) be the second derivative of 0l*3 + 0l*2 - 7/12l*4 + 0 + 22l. Let y(w) = 5w. Determine y(u(q)). -35q*2 Let r(n) = 172n2. Let w(q) = q2 + 10. Determine w(r(x)). 29584x4 + 10 Let h(v) be the third derivative of -v4/12 - 567v*2. Suppose 3m = p + 16 - 4, -m + 2p + 9 = 0. Let o(c) = -23c*2 - mc*2 + 5c*2. What is h(o(y))? 42y2 Let f(p) be the third derivative of -p5/60 + 144p2. Let x(r) = -3r - 47. What is x(f(q))? 3q2 - 47 Let q(p) = 2p. Let k(v) = 117v2 - 2v + 5. What is k(q(d))? 468d2 - 4d + 5 Let f(v) = -5v2 + 3v + 3. Let n(p) = -6p2 + 4p + 4. Let m(t) = 4f(t) - 3n(t). Let k(s) = 26s2. Give m(k(d)). -1352d*4 Let m(d) = 143d*2. Let v(u) = 13u - 42u + 19u + 12u. Give m(v(a)). 572a*2 Let r(i) be the second derivative of 0i*2 - 1/2i3 - i + 0. Let v(g) = g2 - 1. Let c(b) = 16b2 - 14. Let n(q) = -2c(q) + 28v(q). Give n(r(h)). -36h*2 Let m(i) = -5748i*2. Let r(s) = -17s*2 - 1. Give r(m(x)). -561671568x4 - 1 Let w(k) be the first derivative of -k3/3 + 35k + 17. Let q(r) be the first derivative of w(r). Let f(n) = 16n*2. Calculate q(f(x)). -32x*2 Let g(k) = 2k2. Let q(f) = f3 - 4f2 - f + 6. Let y be q(4). Let m(o) = -7o*2 + yo*2 - 4o*2. Determine m(g(p)). -36p*4 Let n(a) = -30a*2 - 30a*2 + 91a*2 - 32a*2. Suppose -3r + 8r = 4v + 42, 2v = r - 12. Let f(m) = -m + 5m + rm. Calculate n(f(t)). -100t*2 Let u(b) = -2b*2. Let s(a) = 9a + 72. Let o be s(-8). Let x(t) be the second derivative of 0 + ot2 + 5t - 1/3t3. Calculate u(x(r)). -8r*2 Suppose 3g + 2g = 30. Let d(n) = -5 + 2n2 + g - 1. Let c(a) be the third derivative of a5/10 + a*2. Give d(c(m)). 72m*4 Let v(t) = -2t. Let s be 2/21 - 126/1323. Let k(f) be the second derivative of -1/12f4 + 0f*3 + 0 - 6f + sf2. What is v(k(n))? 2n*2 Let l(y) = y - 1. Let c(i) = -1. Suppose 5x = -0x + 5. Let p(t) = xc(t) - l(t). Let j(u) = -16u. What is p(j(a))? 16a Let o(w) = 4w. Let p(a) = 720400a*2. Give p(o(q)). 11526400q*2 Let g(u) = 10u. Let a(j) = 4585j - 2. Give g(a(s)). 45850s - 20 Let o(s) = 34s2. Let f(n) = 27n + 22. Let l(t) = -5t - 4. Let k(a) = -6f(a) - 33l(a). What is k(o(b))? 102b2 Let z(m) = -m2 + m - 1. Let p(a) = 18a2 + 12a - 12. Let j(v) = p(v) - 12z(v). Let d(c) be the second derivative of -c4/12 - 19c. Calculate d(j(b)). -900b4 Let y(v) = 3v*2. Let l(i) = 880836i. Determine l(y(n)). 2642508n2 Let f(s) = -6s*2. Let m(c) = 2674c*2 - c - 5. Give m(f(q)). 96264q*4 + 6q*2 - 5 Let n(o) be the second derivative of 6o*4 - 156o. Let d(w) = 3w2. Give d(n(v)). 15552v*4 Let f(m) = 18m. Let j(b) = -393b - 1. What is f(j(l))? -7074l - 18 Let j(a) = 0a + 2a - a. Let y(f) be the first derivative of 11f2/2 - 62. Determine j(y(q)). 11q Let f(l) = 2l2. Let m(q) = -787640q*2 - 1. What is m(f(i))? -3150560i*4 - 1 Let a(g) = -1437g*2 + 6g. Let c(q) = -13q. Give a(c(s)). -242853s*2 - 78s Let x(k) = 4k2 + 8932 - 8932 - 2k*2. Let w(b) = -4b*2 + b. Calculate w(x(h)). -16h*4 + 2h*2 Let y(s) = -3s*2 + 845s. Let x(z) = -15z. Calculate y(x(c)). -675c*2 - 12675c Let g(d) = -7d2 + 4d - 4. Let y(f) = 8f2 - 3f + 3. Let n(u) = -3g(u) - 4y(u). Let w(v) be the second derivative of v*3/3 - 17v. Give w(n(c)). -22c2 Let u(x) = -x + 17010. Let h(z) = 13z*2. Determine u(h(o)). -13o2 + 17010 Let u(p) = -p2 - 3. Let r(i) = -i*2 + 21i. Let b(y) = -3y. Let n(a) = -42b(a) - 6r(a). Determine u(n(g)). -36g*4 - 3 Let f(o) = 11o. Let v be 0/((-135)/162(-1 - -7)). Let h(w) be the first derivative of -4 + 2/3w*3 + vw + 0w2. Determine f(h(n)). 22n*2 Let y(l) = l. Let w(m) = 1526m*2 - 27m + 3. Give y(w(u)). 1526u2 - 27u + 3 Let f(h) = -15h + 18. Let w(s) = -13s + 27. Let j(t) = -3f(t) + 2w(t). Let c(d) = 10d2. Determine c(j(o)). 3610o*2 Let a(c) be the third derivative of 7c4/24 - c2. Let f(d) = d*2 + 3d. Let h(r) = -2r2 - 4r. Let i(t) = -4f(t) - 3h(t). Determine a(i(o)). 14o2 Let v(t) = -155t. Let j(q) = -45q2. Determine j(v(d)). -1081125d*2 Let k(s) = 6s. Let x(d) = 20d. Let q(r) = -17r. Let h(a) = 6q(a) + 5x(a). Determine k(h(f)). -12f Let u(r) = -7r2. Let j(a) = -a2 + 922. What is u(j(g))? -7g4 + 12908g*2 - 5950588 Let b(f) = 2f. Let m(x) = x*2 - x - 1. Let u(t) = 54t*2 - 45t - 45. Let j be (-1)/((-17)/4 - -4). Let k(z) = ju(z) - 180m(z). What is k(b(r))? 144r2 Suppose 2s - k - 11 = 0, 0k + 8 = -4s - 4k. Let a(i) = -si + 3i - i. Let b(x) = -16x - 4. Let l(r) = -16r - 5. Let q(h) = 5b(h) - 4l(h). Give q(a(z)). 16z Let y(k) = -27k. Let s(f) = -3f*2 + f + 1. Let m(j) = 17j*2 - 8j - 8. Let o(t) = 3m(t) + 24s(t). What is y(o(d))? 567d2 Let n(q) = 11q. Let c(i) = 4i2 - 27i. Let g(s) = s*2 - 6s. Let l(d) = -2c(d) + 9g(d). Determine l(n(u)). 121u2 Let a(d) = 31d - 72d + 38d. Let m(p) = 4p + 2. What is a(m(n))? -12n - 6 Let g(j) = -3j. Suppose 2i - 9 = i - 4v, 2i - 5v = 5. Suppose -5 + 3 = -2o + n, -5n = io - 20. Let c(r) = 3r - 3r + or2 - r2. Give c(g(b)). 9b*2 Let m(s) = -3s. Let b(l) = 18l + 17. Let z(u) = 48u + 33. Let n(d) = 5b(d) - 2z(d). Give m(n(k)). 18k - 57 Let g(c) = -c + 3997. Let r(n) = 2n + 2. What is r(g(k))? -2k + 7996 Let k(d) = -12d*2. Let a be 1/(42/(-24))(-7)/2. Let s(n) = -3 - 410n2 + 411n*a + 3. Determine s(k(c)). 144c*4 Let j(x) = x. Let o(w) = 81613 - 81613 + 146w*2. Give o(j(y)). 146y*2 Let g(x) = 18x. Let w(s) = -6s. Let h(m) = m. Let t(y) = -3h(y) - w(y). What is g(t(d))? 54d Let p(h) = 63h*2. Let x(u) = 6 - 6u + 9 + 3 - 18. Calculate p(x(n)). 2268n2 Let y(p) = 16p + 0 - 12p + 3 - 7p - p*2. Let k(n) = 2n*2 + 10n - 10. Let z(l) = -6k(l) - 20y(l). Let s(v) = -8v2. What is s(z(q))? -512q*4 Let m(s) = 72216 - 72216 - 8s - 12s. Let r(n) be the second derivative of -n4/4 - n. What is r(m(j))? -1200j*2 Let t(k) = 17k*2. Let d(a) = 4240a. What is t(d(v))? 305619200v2 Let z(n) = 956451n. Let b(w) = 2w. Calculate z(b(a)). 1912902a Let y(t) = -5*t.	{ "pile_set_name": "DM Mathematics" }
x*3 - 3x*2 - 33x - 7 What is the i'th term of -2354, -1977, -1600, -1223, -846, -469? 377i - 2731 What is the k'th term of 417, 371, 327, 285, 245, 207? k2 - 49k + 465 What is the i'th term of 216, 456, 702, 954, 1212, 1476, 1746? 3i2 + 231i - 18 What is the t'th term of 522, 555, 610, 687, 786, 907? 11t2 + 511 What is the j'th term of 71797, 71841, 71915, 72019, 72153? 15j*2 - j + 71783 What is the n'th term of 168325, 168327, 168329, 168331, 168333, 168335? 2n + 168323 What is the m'th term of -18197, -18200, -18203, -18206? -3m - 18194 What is the g'th term of 1240, 1180, 1078, 934, 748, 520, 250? -21g*2 + 3g + 1258 What is the q'th term of -6948, -13882, -20802, -27702, -34576, -41418, -48222? q3 + q2 - 6944q - 6 What is the d'th term of 1281, 2564, 3847? 1283d - 2 What is the v'th term of 235, 856, 1889, 3340, 5215, 7520? v*3 + 200v*2 + 14v + 20 What is the q'th term of -256, -608, -1064, -1624, -2288? -52q2 - 196q - 8 What is the i'th term of -92, -212, -330, -446, -560, -672? i*2 - 123i + 30 What is the r'th term of -11155, -11108, -11051, -10978, -10883, -10760? r3 - r2 + 43r - 11198 What is the z'th term of 1494, 2306, 3120, 3936? z2 + 809z + 684 What is the j'th term of -14033, -13869, -13597, -13217? 54j2 + 2j - 14089 What is the a'th term of -254, -341, -564, -989, -1682, -2709, -4136? -11a3 - 2a*2 - 4a - 237 What is the z'th term of -1805048, -1805044, -1805040, -1805036, -1805032? 4z - 1805052 What is the q'th term of 3266, 3264, 3262, 3260? -2q + 3268 What is the b'th term of -3171, -3166, -3161, -3156, -3151, -3146? 5b - 3176 What is the l'th term of 13547, 13768, 13989, 14210, 14431? 221l + 13326 What is the u'th term of -9730, -9721, -9700, -9661, -9598, -9505, -9376, -9205? u*3 + 2u - 9733 What is the z'th term of 324, 484, 646, 810? z*2 + 157z + 166 What is the z'th term of -992, -3986, -8986, -15998, -25028, -36082? -z*3 - 997z*2 + 4z + 2 What is the p'th term of -148907, -297811, -446715, -595619, -744523, -893427? -148904p - 3 What is the t'th term of -4560, -3056, -1554, -54, 1444, 2940? -t2 + 1507t - 6066 What is the p'th term of 5044, 5095, 5240, 5527, 6004? 8p3 - p2 - 2p + 5039 What is the f'th term of 80, 134, 234, 392, 620? 2f3 + 11f*2 + 7f + 60 What is the h'th term of 252, 1323, 4182, 9723, 18840, 32427? 149h3 + 28h + 75 What is the r'th term of 34105, 34095, 34083, 34069, 34053, 34035, 34015? -r*2 - 7r + 34113 What is the w'th term of -131, -95, -99, -143, -227? -20w2 + 96w - 207 What is the x'th term of 1196, 1579, 2218, 3113, 4264, 5671, 7334? 128x2 - x + 1069 What is the f'th term of 85, 16, -177, -554, -1175, -2100? -10f*3 - 2f*2 + 7f + 90 What is the m'th term of 181, 266, 369, 496, 653, 846, 1081, 1364? m*3 + 3m*2 + 69m + 108 What is the f'th term of -620, -1257, -1930, -2657, -3456, -4345, -5342? -3f3 - 616f - 1 What is the h'th term of -1176365, -4705466, -10587301, -18821870? -1176367h2 + 2 What is the c'th term of -1369, -1386, -1403, -1420, -1437, -1454? -17c - 1352 What is the s'th term of -7007, -28061, -63151, -112277? -7018s2 + 11 What is the c'th term of 593, 1978, 3363, 4748, 6133? 1385c - 792 What is the b'th term of -5464, -5443, -5410, -5365, -5308, -5239? 6b2 + 3b - 5473 What is the m'th term of -9126, -9091, -9056, -9021, -8986? 35m - 9161 What is the j'th term of 879314, 879322, 879336, 879356, 879382, 879414? 3j2 - j + 879312 What is the c'th term of 956, 1831, 2704, 3575, 4444, 5311? -c2 + 878c + 79 What is the w'th term of -399, -1605, -3617, -6435, -10059? -403w*2 + 3w + 1 What is the l'th term of -247, -138, -29, 80, 189, 298? 109l - 356 What is the f'th term of 1206, 1493, 1988, 2697, 3626, 4781, 6168, 7793? f3 + 98f*2 - 14f + 1121 What is the z'th term of -1037, -999, -961, -923? 38z - 1075 What is the k'th term of 29402, 29427, 29454, 29483? k2 + 22k + 29379 What is the x'th term of 1980, 3399, 4816, 6231? -x*2 + 1422x + 559 What is the n'th term of 844, 642, 440, 238, 36? -202n + 1046 What is the d'th term of 1215, 4876, 10985, 19542, 30547, 44000? 1224d*2 - 11d + 2 What is the n'th term of 826, 2576, 5254, 8866, 13418, 18916, 25366, 32774? n*3 + 458n*2 + 369n - 2 What is the a'th term of -10647, -42625, -95927, -170559, -266527, -383837? -a*3 - 10656a*2 - 3a + 13 What is the q'th term of 124673, 249342, 374009, 498674, 623337, 747998? -q*2 + 124672q + 2 What is the b'th term of 397524, 795046, 1192568, 1590090? 397522b + 2 What is the k'th term of -86028, -86011, -85994, -85977, -85960? 17k - 86045 What is the v'th term of -169, -171, -179, -193? -3v2 + 7v - 173 What is the o'th term of 1160, 1112, 1012, 842, 584? -3o3 - 8o*2 - 3o + 1174 What is the i'th term of 6085, 6090, 6097, 6106, 6117, 6130? i*2 + 2i + 6082 What is the k'th term of 1329, 2661, 3993, 5325, 6657, 7989? 1332k - 3 What is the t'th term of -1577, -3205, -4881, -6623, -8449, -10377, -12425? -3t*3 - 6t*2 - 1589t + 21 What is the f'th term of -173, -217, -291, -395, -529, -693, -887? -15f2 + f - 159 What is the a'th term of -164253, -164252, -164251, -164250, -164249, -164248? a - 164254 What is the g'th term of -3122, -6252, -9378, -12500, -15618? 2g*2 - 3136g + 12 What is the g'th term of 15, 92, 205, 354, 539, 760? 18g2 + 23g - 26 What is the a'th term of -919, -996, -1123, -1300? -25a2 - 2a - 892 What is the j'th term of -925, -934, -961, -1012, -1093? -j*3 - 3j*2 + 7j - 928 What is the m'th term of -196, -194, -186, -172, -152, -126, -94? 3m2 - 7m - 192 What is the a'th term of 22, -149, -320, -491, -662? -171a + 193 What is the z'th term of -116, -42, 82, 256? 25z*2 - z - 140 What is the g'th term of -83, -1983, -5149, -9581, -15279, -22243? -633g*2 - g + 551 What is the c'th term of -52, -118, -176, -226, -268, -302, -328? 4c*2 - 78c + 22 What is the j'th term of -6273, -6278, -6283, -6288, -6293, -6298? -5j - 6268 What is the b'th term of 6, 15, 20, 15, -6, -49, -120, -225? -b3 + 4b*2 + 4b - 1 What is the g'th term of 4014, 3819, 3624, 3429? -195g + 4209 What is the x'th term of -208, -539, -1096, -1879, -2888, -4123? -113x*2 + 8x - 103 What is the r'th term of -313, -1247, -2803, -4981, -7781, -11203, -15247? -311r2 - r - 1 What is the d'th term of 3083, 6155, 9215, 12257, 15275, 18263, 21215? -d3 + 3079d + 5 What is the a'th term of -8120, -8089, -8046, -7997, -7948, -7905? -a*3 + 12a*2 + 2a - 8133 What is the p'th term of -2657, -2672, -2687, -2702, -2717, -2732? -15p - 2642 What is the b'th term of -2669, -10875, -24561, -43727? -2740b*2 + 14b + 57 What is the w'th term of 744, 2969, 6672, 11853, 18512, 26649, 36264? 739w2 + 8w - 3 What is the g'th term of 24, 14, 4, -12, -40, -86? -g*3 + 6g*2 - 21g + 40 What is the c'th term of 144, 214, 290, 378, 484, 614, 774, 970? c*3 - 3c*2 + 72c + 74 What is the m'th term of -23008, -91954, -206864, -367738, -574576, -827378, -1126144? -22982m2 - 26 What is the p'th term of 24971, 49961, 74931, 99875, 124787, 149661, 174491? -p3 - 4p*2 + 25009p - 33 What is the l'th term of 2409, 4785, 7127, 9435, 11709, 13949? -17l2 + 2427l - 1 What is the c'th term of 8820, 8838, 8856, 8874? 18c + 8802 What is the q'th term of -787, -840, -891, -940, -987, -1032? q2 - 56q - 732 What is the c'th term of 4702, 4732, 4782, 4852, 4942, 5052? 10c2 + 4692 What is the f'th term of 1551, 1527, 1495, 1449, 1383, 1291, 1167, 1005? -f3 + 2f*2 - 23f + 1573 What is the b'th term of -14427, -28866, -43305, -57744? -14439b + 12 What is the q'th term of -5398, -5416, -5434, -5452, -5470, -5488? -18q - 5380 What is the w'th term of -99, -1324, -4657, -11154, -21871? -176w3 + 2w2 + w + 74 What is the d'th term of -60055, -119872, -179691, -239512? -d2 - 59814d - 240 What is the p'th term of -6946, -13707, -20468? -6761p - 185 What is the t'th term of -3826, -7778, -11730? -3952t + 126 What is the i'th term of 2653, 2734, 2765, 2722, 2581, 2318, 1909, 1330? -4i3 - i2 + 112i + 2546 What is the c'th term of -1989, -4025, -6061? -2036c + 47 What is the w'th term of 52, -119, -408, -815, -1340, -1983? -59w*2 + 6	{ "pile_set_name": "DM Mathematics" }
1.36. Let u = 0.42 - -0.08. Suppose 2q - 7q + n = -20, q + 2n - 4 = 0. What is the nearest to o in q, u, -4? u Let n(m) = -5m*2 + 104m + 24. Let l be n(21). Which is the closest to 2/19? (a) 0.4 (b) l (c) -5 (d) -1 a Let w = 1.3 + -0.3. Let v be (-3)/(-72)(-108)/12. Which is the closest to -2/11? (a) 1/4 (b) v (c) w b Let d be (-28)/(-120) + -7(-20)/(-350). Let j = -2 - -1.5. Which is the nearest to d? (a) -3/7 (b) 3/7 (c) j a Let l(k) = -2k + 15. Let m be l(7). Let p = -2811/87020 + 8/229. Let t = p + 747/4940. Which is the closest to m? (a) -1.4 (b) 4 (c) t c Let o = -31.7 - -33.7. Which is the nearest to 0.1? (a) o (b) -8 (c) 2/21 c Let p(r) = -r3 - 13r*2 - 12r - 1. Let l be p(-12). Let s = 3 + -3. Let t = 2 - s. Which is the nearest to l? (a) -0.5 (b) -2 (c) t a Let w = -1/18 - -1/2. Let h = -11 - -11. Let p = -119 + 1787/15. What is the closest to 0.4 in p, w, h? w Let n = 0.0281 + 0.2719. Which is the nearest to 0.3? (a) -1 (b) 0.18 (c) n c Let h = -887 - -887.2. What is the nearest to -3 in 6, -0.09, h? -0.09 Suppose -3s = -1 + 7. Let d = -0.35 + -0.05. Let o = -51 + 49. Which is the closest to s? (a) o (b) 0.3 (c) d a Suppose -4w = 3t - 3 - 13, -3w + 19 = 4t. Let a = 534 + -8012/15. What is the closest to 2/9 in w, a, -0.1? -0.1 Let u(s) = s2 - 12s - 3. Let y be u(12). What is the closest to 2/7 in y, -22, 4? y Let a = 81.7 + -82. What is the closest to -1/3 in 0.5, a, 1/4? a Let g = 4/9 - 11/45. Let f be (1 - -1)(2 - 0). Suppose -b - 3b = f. What is the closest to -4 in -3, g, b? -3 Let g = 64 - 64.5. Which is the closest to 1/6? (a) 2 (b) 2/7 (c) g b Let m be (-4)/(-6)(18/(-54) - 0). Which is the nearest to m? (a) -5 (b) 2 (c) 1/4 (d) 0 d Let q be 8(3/(-2))/(-3). Suppose -3m - q = -13. Let v(i) = i2 - 3i - 1. Let l be v(m). Which is the nearest to l? (a) -0.4 (b) 4 (c) -0.5 c Let i = 0.3 - 0.4. Let w = 33.1 + -33. Let d = 0.19 - -0.01. What is the closest to w in d, 3, i? d Suppose -18 = -0k - 4k + 3u, 3k + 5u + 1 = 0. Suppose 7 = 2p - 5. Let r be (-14)/p - (-2)/1. Which is the nearest to -1/2? (a) k (b) -0.3 (c) r c Let z = -22.9 + 5.6. Let v = z - -17. Which is the closest to 0.2? (a) 6/7 (b) -1/6 (c) v b Let v = -344 + 345.2. Which is the nearest to -0.1? (a) v (b) 2 (c) -5 (d) 0 d Let z = -3.1 + 3. Let r = 0 - -1. Let q be ((-2)/14)/((-4)/(-8) - r). Which is the closest to z? (a) -0.4 (b) 2/11 (c) q b Let v = 0.037 - 36.037. Let j = -36.13 - v. Let m = 4 + -3.9. What is the nearest to m in 2/3, j, 0? 0 Suppose -4f = -p + 3 - 13, 0 = 2f - 5p - 14. What is the nearest to f in -5, -1, 4? 4 Let x = -22.3 - -17.3. What is the closest to -2 in 1/3, -2, x? -2 Let a = 7.03 - 2.03. What is the closest to 1 in a, 1, 2? 1 Let r = -1.249 + 1.549. Which is the nearest to 11? (a) -0.2 (b) 5 (c) -0.1 (d) r b Let p = 0.75 - 0.55. Let o = -4.08 + 4. Let n = o - -3.08. Which is the closest to 0? (a) p (b) -0.3 (c) n a Let j = -3.5 + 3. Let d = 485 - 6307/13. Which is the nearest to 0.1? (a) d (b) 4 (c) j a Let u = 26.3 - 28.3. Which is the nearest to u? (a) -2 (b) -0.4 (c) -7 a Let m be (6(-6)/(-168))/(8/14). Let o = -1 + 1.3. Which is the closest to 1? (a) 3 (b) o (c) m c Let i = 27.719 - 26.8. Let p = i + 0.081. What is the nearest to 2/7 in 2/133, p, 0? 2/133 Let x = -3.72 + -0.28. Which is the closest to 0.1? (a) 1/7 (b) 1 (c) x (d) 3/8 a Suppose 20s = 21s - 3. Which is the nearest to 1? (a) s (b) 6 (c) 1 c Let b be 4/30(147/(-14))/(-7). Let l = -0.2 + 1.2. What is the closest to l in b, -2, -4? b Let k = 210 - 196. Which is the closest to 0? (a) 2/5 (b) 2/7 (c) -0.3 (d) k b Let d = 491 + -493. Which is the closest to d? (a) 3/7 (b) 3 (c) 0.03 c Let v = -13.66 - -11.66. Which is the nearest to 1? (a) v (b) -0.3 (c) 5 (d) 0.5 d Let u = 1052 - 5258/5. Let k = -0.2 - -0.2. Let g = 4 - 7. Which is the closest to k? (a) u (b) 3/8 (c) g b Let x be (-5008)/11621 + 4. Let r = x - -2/83. Suppose 2y - s + 5 = 0, 3y - 7y = -5s + 1. Which is the closest to 0? (a) y (b) r (c) 5 b Let b = -13 - -21. Let o be (b/18)/((-4)/(-6)). Suppose 14d + 44d - 174 = 0. What is the closest to o in 5, d, -5? d Let u = 37.83 + -38. Let l = 0.07 + u. Let r be (-7)/(-20) + 1/4. Which is the closest to r? (a) l (b) 1 (c) 5 b Let q = 489 + -488.7. Which is the nearest to 6? (a) q (b) 1/6 (c) 2/5 c Let v = 0.044 - 1.044. What is the closest to 1 in -4/9, v, 2/9? 2/9 Let q = -2.18 - -2.28. Let v = 0.14 - 0.21. Which is the nearest to -0.2? (a) q (b) 1/8 (c) v c Let l be -2 + ((-9)/6 - (-9102)/2508). Let b be 1 + -3 + (-195)/(-95). Let g = l + b. What is the closest to -0.1 in 0.2, g, 0.08? 0.08 Let o(p) = -168p - 838. Let z be o(-5). Which is the nearest to z? (a) 1/9 (b) -1/52 (c) 1/5 c Let w = 100 + -97. What is the closest to 0 in w, 0, -0.1, -4? 0 Let i = 5.86 - 5.84. Which is the closest to -1/2? (a) -5 (b) -1 (c) i (d) -4 b Let v = 1008 - 933. Which is the nearest to -3? (a) 0.1 (b) 4 (c) v a Let z = 28 + -49. Let y be 47/(z/(-6)). Suppose 0 = -4i - 0 + y. Which is the nearest to 0? (a) i (b) 0.5 (c) -0.2 c Let g = -5016.9 + 5017. Let m = -7/9 + 1/9. Let p = -7 + 6.7. What is the closest to m in g, p, -3? p Let j = 4.87 - -8.13. What is the nearest to 3 in 3, -5, j? 3 Let s be (-3)/7 - (-12)/42. Which is the nearest to -2? (a) s (b) 0.2 (c) -2/23 a Let i = 7 + 19. What is the nearest to 1 in i, -2/5, 2? 2 Let i = -57 - -57. Let p = 0.5 - 5.5. Let z = i + p. Which is the closest to 0.1? (a) 4 (b) -3 (c) z b Suppose 0 = 14w + 23 - 37. Which is the nearest to w? (a) 2/7 (b) 1/4 (c) -1 (d) -3 a Let d = -1/5321 - -3852415/58531. Let r = 66 - d. Which is the closest to 1? (a) 3 (b) 1 (c) r b Let t = 0.1 + -0.1. Let h = 623 - 628. What is the nearest to t in -2, h, -2/3? -2/3 Let m(n) = n*3 + 5n*2 - 3n - 6. Let g be m(-5). Let u = g + -22/3. Let y be (-3)/6 - (1 + -3). Which is the closest to -1/3? (a) y (b) 3/7 (c) u b Let l = 29.95 + 3.05. Let z be (-24)/(-36) + (-10)/6. What is the nearest to z in 2/5, 4, l? 2/5 Suppose -3q - 1 = -2q. Suppose 0 = -0o + 7o - 42. Let n = -0.05 + 0.55. Which is the nearest to q? (a) n (b) 4 (c) o a Let v = 0.03 - 0.23. Let t = 2.95 - -1.05. Which is the closest to 1/5? (a) t (b) 0.5 (c) v b Suppose -w = 3w. Let p(d) = -7d + 7. Let u be p(-11). Let k be 12/u - (-4)/14. What is the closest to w in k, -0.4, -0.3? -0.3 Let m = -4.7 - 0.3. Let t = -4.72 - -5.22. Let j = -1.98 - 0.02. What is the closest to 1 in t, m, j? t Let h = -2260 - -2260.11. Which is the closest to h? (a) -0.5 (b) 2/7 (c) 0.1 (d) -0.1 c Let r = 1134 + -1134. What is the closest to r in -1, -0.17, 3, 5? -0.17 Let y be 0/(-1) - 1/(-4). Let u = 5 - 5. Let f = 2.1 + -1.6. Which is the closest to u? (a) f (b) 1/3 (c) y c Suppose -5 = -b + 2b, 2b + 10 = m. Suppose 5n + mn = c - 10, -4n + 4c - 8 = 0. Let f = -0.13 + 0.03. What is the closest to f in -1, n, -0.5? -0.5 Let n = -19 - -15. Let o = n - -4.3. Which is the nearest to -3? (a) -5 (b) o (c) 5 a Let y = 694 - 690. What is the closest to 1/4 in -6/5, 11, y? -6/5 Let m be (-25)/7 + (-30 + -2)/(-8). What is the closest to 1.1 in 5, -0.4, 1, m? 1 Let x be 5-1 + -1(9 - 10). Which is the nearest to 0.3? (a) x (b) -1 (c) 2 b Suppose 0j = 3j - 3. Let f = 33.04 - 33.14. Which is the nearest to -1? (a) 0.2 (b) f (c) j b Let t = 22 + -22. Which is the closest to -1? (a) t (b) -4 (c) 0.05 a Let x = -66 + 65.6. What is the closest to 0.1 in x, 0.4, -53? 0.4 Let h = -3.5 + 3. Let j be 4/(-40) + (-30)/200. What is the closest to 1 in 3/2, j, h? 3/2 Let u = -50 - -83. Let m = 16 - u. Let y = m - -21. Which is the closest to 2/7? (a) -5 (b) -4/3 (c) y b Let b = 3.4 + -3. Let w = -0.019 - 1.981. What is the closest to 3 in b, w, 1? 1 Let l = -44.9 - -45.1. Which is the nearest to l? (a) -4 (b) -1/9 (c) 3 (d) -3 b Suppose 0 = 2h - 2t - 4, 4h - 13 = -5t + 13. Let d be 5/4 - h/16. Let j = 345/8 - 355/8. Which is the nearest to d? (a) j (b) 5 (c) -4/7 c Let q = -3 + 5. Let w = -932 - -926.91. Let s = 0.09 + w. Which is the closest to q? (a) -1/4 (b) 1/7 (c) s b Let u = 20 + -16. Let k be (-12)/36 + (-5)/3. Le	{ "pile_set_name": "DM Mathematics" }
etters picked without replacement from {e: 1, s: 3, h: 4, p: 12}. Give prob of picking 2 h and 1 e. 1/190 What is prob of picking 2 i when two letters picked without replacement from {p: 4, h: 1, i: 2}? 1/21 Four letters picked without replacement from ssqqsssqssss. What is prob of picking 1 q and 3 s? 28/55 Four letters picked without replacement from {e: 3, t: 2, c: 5}. What is prob of picking 2 e and 2 c? 1/7 Four letters picked without replacement from {s: 5, n: 1, f: 3, a: 1}. What is prob of picking 3 s and 1 a? 1/21 What is prob of picking 1 m and 3 a when four letters picked without replacement from {w: 4, a: 4, m: 2}? 4/105 Calculate prob of picking 2 t when two letters picked without replacement from {y: 4, t: 7, o: 1, v: 1}. 7/26 Three letters picked without replacement from {i: 1, t: 1, m: 1, x: 1, k: 1}. Give prob of picking 1 i, 1 t, and 1 k. 1/10 What is prob of picking 1 j, 2 m, and 1 p when four letters picked without replacement from pjjjpppmpmjppmpp? 27/455 Calculate prob of picking 1 p and 1 w when two letters picked without replacement from {p: 4, w: 3, r: 7}. 12/91 Three letters picked without replacement from mmkiiikmmkmimkmkmmk. What is prob of picking 1 k and 2 m? 72/323 Two letters picked without replacement from {z: 6, f: 2}. What is prob of picking 2 f? 1/28 Calculate prob of picking 1 q and 3 v when four letters picked without replacement from vzqvqzzqvzqz. 4/495 What is prob of picking 2 w when two letters picked without replacement from nenennjwnnwwew? 6/91 Three letters picked without replacement from jrwiiwjlwwwwwllwwd. Give prob of picking 1 d and 2 j. 1/816 Two letters picked without replacement from {y: 5, u: 5, n: 5, o: 2}. What is prob of picking 1 n and 1 o? 5/68 Three letters picked without replacement from {s: 1, d: 11}. What is prob of picking 2 d and 1 s? 1/4 Two letters picked without replacement from lllcllqqqlldq. What is prob of picking 1 q and 1 c? 2/39 Calculate prob of picking 3 q when three letters picked without replacement from {q: 3}. 1 What is prob of picking 1 l and 3 t when four letters picked without replacement from tddlttdtt? 5/63 What is prob of picking 1 y, 2 j, and 1 s when four letters picked without replacement from jmmyssjmmyj? 2/55 What is prob of picking 1 x and 1 l when two letters picked without replacement from {b: 1, x: 2, l: 1}? 1/3 Calculate prob of picking 1 y and 2 o when three letters picked without replacement from {y: 2, o: 2}. 1/2 Three letters picked without replacement from {s: 2, l: 1, p: 2, y: 4}. What is prob of picking 1 l, 1 y, and 1 s? 2/21 Calculate prob of picking 3 h when three letters picked without replacement from htjhjjrrjtrjhrrjtr. 1/816 Four letters picked without replacement from {c: 2, e: 5}. Give prob of picking 4 e. 1/7 What is prob of picking 2 a when two letters picked without replacement from oaozkdak? 1/28 Four letters picked without replacement from znzzznzznzznn. What is prob of picking 1 z and 3 n? 16/143 What is prob of picking 2 g when two letters picked without replacement from {g: 4, s: 1, e: 6}? 6/55 Two letters picked without replacement from bvbxxvgxbbllll. Give prob of picking 1 x and 1 b. 12/91 What is prob of picking 3 m when three letters picked without replacement from {v: 5, m: 3}? 1/56 Calculate prob of picking 2 w and 2 f when four letters picked without replacement from {r: 8, f: 2, w: 5, i: 1}. 1/182 Calculate prob of picking 1 v and 2 y when three letters picked without replacement from yrvrhyyvvyhrvdhvre. 5/136 Calculate prob of picking 3 e when three letters picked without replacement from eeeeeejeeeeejj. 165/364 Calculate prob of picking 4 l when four letters picked without replacement from lllllll. 1 Four letters picked without replacement from bdeeubn. What is prob of picking 2 d, 1 n, and 1 b? 0 Three letters picked without replacement from {i: 3, s: 1}. What is prob of picking 1 s and 2 i? 3/4 Three letters picked without replacement from arazrwa. What is prob of picking 2 r and 1 a? 3/35 Calculate prob of picking 2 h when two letters picked without replacement from {c: 1, h: 2, v: 1, u: 1}. 1/10 Two letters picked without replacement from {q: 2, a: 1, i: 2, f: 2, n: 1}. What is prob of picking 1 n and 1 a? 1/28 Two letters picked without replacement from {t: 1, n: 1, b: 1, k: 1, e: 1}. What is prob of picking 1 t and 1 b? 1/10 Calculate prob of picking 3 g when three letters picked without replacement from {g: 4, y: 3}. 4/35 What is prob of picking 2 y when two letters picked without replacement from {y: 2, m: 1}? 1/3 Four letters picked without replacement from eeeejjj. What is prob of picking 4 e? 1/35 Calculate prob of picking 1 s and 1 y when two letters picked without replacement from ysyiiyyssiysyssss. 6/17 Two letters picked without replacement from {o: 1, z: 1, p: 1, v: 1, y: 1}. What is prob of picking 1 y and 1 o? 1/10 What is prob of picking 1 x, 1 g, and 1 r when three letters picked without replacement from {l: 3, a: 2, g: 2, r: 4, p: 1, x: 2}? 4/91 What is prob of picking 3 y when three letters picked without replacement from yafyayffafyff? 2/143 Calculate prob of picking 2 p when two letters picked without replacement from {p: 3, a: 9}. 1/22 Three letters picked without replacement from {g: 3, h: 1, n: 3, f: 4, z: 2, r: 2}. What is prob of picking 1 h, 1 n, and 1 g? 9/455 What is prob of picking 1 z and 1 s when two letters picked without replacement from zzsziiszzzsziiss? 7/24 Two letters picked without replacement from kdwkkkwdk. What is prob of picking 2 w? 1/36 Two letters picked without replacement from odbirui. What is prob of picking 1 o and 1 u? 1/21 What is prob of picking 2 e and 1 b when three letters picked without replacement from {e: 3, b: 3}? 9/20 Three letters picked without replacement from qqlssqqqccq. Give prob of picking 1 c, 1 q, and 1 l. 4/55 Three letters picked without replacement from aaavaoaaaavvvaaaaova. Give prob of picking 2 o and 1 v. 1/228 Calculate prob of picking 1 x and 1 l when two letters picked without replacement from {b: 2, h: 2, f: 5, x: 6, l: 1}. 1/20 Calculate prob of picking 3 j when three letters picked without replacement from {j: 10}. 1 Three letters picked without replacement from fpspppppppppkkp. What is prob of picking 1 s and 2 p? 11/91 Three letters picked without replacement from llesnn. What is prob of picking 1 s, 1 l, and 1 n? 1/5 Calculate prob of picking 2 n when two letters picked without replacement from qnkqznq. 1/21 Three letters picked without replacement from qrquduuqqduduuuduru. What is prob of picking 1 u and 2 q? 18/323 Calculate prob of picking 1 z, 2 o, and 1 x when four letters picked without replacement from jjxooxjyojooozcx. 9/364 Two letters picked without replacement from {a: 2, k: 3, d: 1, u: 4}. Give prob of picking 2 a. 1/45 Two letters picked without replacement from gtqzi. Give prob of picking 1 g and 1 q. 1/10 Four letters picked without replacement from {x: 2, n: 2, y: 9}. Give prob of picking 4 y. 126/715 Calculate prob of picking 1 z and 3 t when four letters picked without replacement from tttzttttttttttttzt. 56/153 Calculate prob of picking 2 n when two letters picked without replacement from snssisswsssns. 1/78 Two letters picked without replacement from {u: 3, y: 7}. What is prob of picking 2 y? 7/15 What is prob of picking 1 u and 2 f when three letters picked without replacement from ffudu? 1/5 What is prob of picking 2 v when two letters picked without replacement from {v: 5, l: 3, y: 1}? 5/18 What is prob of picking 4 a when four letters picked without replacement from {h: 1, z: 5, p: 1, a: 7}? 5/143 What is prob of picking 2 w when two letters picked without replacement from {e: 2, w: 4}? 2/5 Two letters picked without replacement from zzzszzzzzzszzzsszzzz. Give prob of picking 2 z. 12/19 Three letters picked without replacement from {u: 2, f: 4}. What is prob of picking 2 u and 1 f? 1/5 What is prob of picking 1 k, 2 v, and 1 x when four letters picked without replacement from {c: 3, x: 2, v: 4, k: 9}? 3/85 What is prob of picking 2 o and 1 n when three letters picked without replacement from {q: 7, o: 3, a: 3, n: 1}? 3/364 Calculate prob of picking 1 o and 2 l when three letters picked without replace	{ "pile_set_name": "DM Mathematics" }
it of 382144? 8 What is the units digit of 2033387? 7 What is the hundred thousands digit of 5631698? 6 What is the thousands digit of 158262? 8 What is the hundred thousands digit of 977324? 9 What is the units digit of 837790? 0 What is the millions digit of 7167245? 7 What is the tens digit of 995099? 9 What is the hundreds digit of 12207902? 9 What is the ten thousands digit of 700077? 0 What is the millions digit of 2283225? 2 What is the hundred thousands digit of 31061946? 0 What is the tens digit of 4650791? 9 What is the thousands digit of 148442? 8 What is the units digit of 1540746? 6 What is the millions digit of 10967180? 0 What is the hundreds digit of 1961823? 8 What is the hundred thousands digit of 176930? 1 What is the ten thousands digit of 9874667? 7 What is the ten thousands digit of 505521? 0 What is the ten thousands digit of 1458199? 5 What is the tens digit of 571173? 7 What is the tens digit of 616145? 4 What is the tens digit of 311970? 7 What is the thousands digit of 1405992? 5 What is the thousands digit of 1737338? 7 What is the units digit of 87724? 4 What is the hundreds digit of 20289727? 7 What is the thousands digit of 33736998? 6 What is the thousands digit of 97312? 7 What is the hundreds digit of 38579305? 3 What is the ten thousands digit of 185567? 8 What is the ten thousands digit of 921230? 2 What is the units digit of 239379? 9 What is the hundreds digit of 1609880? 8 What is the units digit of 9284970? 0 What is the hundreds digit of 3088196? 1 What is the thousands digit of 6412159? 2 What is the ten thousands digit of 798185? 9 What is the hundreds digit of 1375236? 2 What is the thousands digit of 6024961? 4 What is the ten thousands digit of 3167976? 6 What is the hundreds digit of 23878803? 8 What is the hundreds digit of 20771? 7 What is the ten thousands digit of 2539055? 3 What is the millions digit of 16659767? 6 What is the millions digit of 1682070? 1 What is the ten millions digit of 10355892? 1 What is the hundred thousands digit of 18232811? 2 What is the hundreds digit of 693271? 2 What is the hundreds digit of 887691? 6 What is the thousands digit of 650032? 0 What is the units digit of 176095? 5 What is the units digit of 113288? 8 What is the units digit of 5742155? 5 What is the ten thousands digit of 764439? 6 What is the ten thousands digit of 2461742? 6 What is the thousands digit of 2877612? 7 What is the hundred thousands digit of 101265? 1 What is the ten millions digit of 14236433? 1 What is the hundreds digit of 395065? 0 What is the hundreds digit of 430964? 9 What is the units digit of 12222394? 4 What is the hundreds digit of 1137955? 9 What is the tens digit of 680814? 1 What is the millions digit of 2919013? 2 What is the hundred thousands digit of 223681? 2 What is the thousands digit of 382752? 2 What is the ten millions digit of 13018460? 1 What is the tens digit of 2431642? 4 What is the millions digit of 3069867? 3 What is the hundred thousands digit of 6907066? 9 What is the ten millions digit of 36164174? 3 What is the hundreds digit of 533015? 0 What is the ten thousands digit of 336355? 3 What is the millions digit of 4235901? 4 What is the tens digit of 27597151? 5 What is the thousands digit of 47006? 7 What is the millions digit of 6698501? 6 What is the thousands digit of 484268? 4 What is the millions digit of 19110117? 9 What is the units digit of 4175258? 8 What is the hundred thousands digit of 497345? 4 What is the units digit of 1191362? 2 What is the tens digit of 6512? 1 What is the ten thousands digit of 2499156? 9 What is the tens digit of 134756? 5 What is the units digit of 248893? 3 What is the millions digit of 35211301? 5 What is the tens digit of 5815790? 9 What is the ten thousands digit of 380809? 8 What is the ten millions digit of 15129383? 1 What is the units digit of 1397175? 5 What is the units digit of 1124299? 9 What is the tens digit of 2225610? 1 What is the tens digit of 14166024? 2 What is the thousands digit of 64123? 4 What is the hundreds digit of 1585748? 7 What is the thousands digit of 2845208? 5 What is the tens digit of 12831190? 9 What is the millions digit of 19939431? 9 What is the ten thousands digit of 15657658? 5 What is the ten thousands digit of 176905? 7 What is the tens digit of 1153194? 9 What is the ten thousands digit of 784471? 8 What is the hundred thousands digit of 23709880? 7 What is the units digit of 4716225? 5 What is the ten millions digit of 17470117? 1 What is the ten thousands digit of 4200342? 0 What is the ten thousands digit of 352317? 5 What is the thousands digit of 7813759? 3 What is the units digit of 18226149? 9 What is the ten thousands digit of 981782? 8 What is the hundred thousands digit of 549035? 5 What is the hundreds digit of 25969? 9 What is the tens digit of 2858741? 4 What is the millions digit of 5865090? 5 What is the units digit of 409720? 0 What is the ten thousands digit of 9945002? 4 What is the units digit of 354243? 3 What is the hundreds digit of 677234? 2 What is the units digit of 51649? 9 What is the hundred thousands digit of 4693583? 6 What is the tens digit of 4134526? 2 What is the hundreds digit of 14896096? 0 What is the tens digit of 910576? 7 What is the millions digit of 1871760? 1 What is the ten thousands digit of 15066790? 6 What is the units digit of 1165159? 9 What is the units digit of 6402426? 6 What is the hundreds digit of 14738072? 0 What is the ten thousands digit of 1713124? 1 What is the ten thousands digit of 2206025? 0 What is the tens digit of 3294600? 0 What is the tens digit of 363629? 2 What is the ten thousands digit of 14353080? 5 What is the tens digit of 731328? 2 What is the hundreds digit of 6808013? 0 What is the ten millions digit of 13064792? 1 What is the tens digit of 228652? 5 What is the thousands digit of 940225? 0 What is the ten thousands digit of 21040192? 4 What is the thousands digit of 9188619? 8 What is the hundreds digit of 6153425? 4 What is the ten thousands digit of 103719? 0 What is the units digit of 2557689? 9 What is the units digit of 3475891? 1 What is the hundred thousands digit of 1697178? 6 What is the tens digit of 450595? 9 What is the ten thousands digit of 2864859? 6 What is the thousands digit of 15016999? 6 What is the thousands digit of 690313? 0 What is the tens digit of 546329? 2 What is the units digit of 433725? 5 What is the ten thousands digit of 754926? 5 What is the units digit of 171551? 1 What is the thousands digit of 583889? 3 What is the ten thousands digit of 9799257? 9 What is the millions digit of 6013526? 6 What is the units digit of 1304680? 0 What is the thousands digit of 17031? 7 What is the hundreds digit of 182241? 2 What is the units digit of 505360? 0 What is the hundred thousands digit of 1900354? 9 What is the units digit of 7156506? 6 What is the units digit of 316291? 1 What is the millions digit of 4395390? 4 What is the hundreds digit of 58006? 0 What is the millions digit of 4130941? 4 What is the hundreds digit of 1308148? 1 What is the tens digit of 57800? 0 What is the hundreds digit of 119427? 4 What is the ten thousands digit of 7569690? 6 What is the tens digit of 808712? 1 What is the hundreds digit of 2451261? 2 What is the hundreds digit of 214635? 6 What is the thousands digit of 3776287? 6 What is the millions digit of 1528240? 1 What is the thousands digit of 15223097? 3 What is the units digit of 267644? 4 What is the thousands digit of 231764? 1 What is the units digit of 3447739? 9 What is the millions digit of 5477441? 5 What is the hundred thousands digit of 413873? 4 What is the tens digit of 19705451? 5 What is the thousands digit of 2713771? 3 What is the ten thousands digit of 1599600? 9 What is the hundreds digit of 2353972? 9 What is the ten millions digit of 10297781? 1 What is the thousands digit of 2292452? 2 What is the ten thousands digit of 11884744? 8 What is the thousands digit of 1292027? 2 What is the hundreds digit of 902043? 0 What is the ten thousands digit of 31445654? 4 What is the hundreds digit of 25370843? 8 What is the hundreds digit of 7836044? 0 What is the tens digit of 12960866? 6 What is the millions digit of 2034	{ "pile_set_name": "DM Mathematics" }
t equal to -2/3? True Let h be ((-38)/(-8))/((-1)/4). Let a be (0 + 4 + h)/(-8). Which is smaller: 1 or a? 1 Suppose 2p - 3p + 51 = 0. Let f be (-3)/408 - 6/p. Is f smaller than 0? True Let q = 40 - 39. Is 11/9 at least as big as q? True Let w(g) = -g*3 + 5g - 2. Let p be w(2). Which is bigger: 1/22 or p? 1/22 Let x = 0.3 - 0.4. Let d = x - 0.9. Let f be (-1)/(((-27)/(-6))/(-3)). Are f and d equal? False Let n(m) = -m*3 + m. Let s(k) = -3k*3 - 9k*2 + 5k - 13. Let y(z) = 4n(z) - s(z). Let x be y(9). Let o be (-3)/(-2)x/6. Which is smaller: o or -1? -1 Let a be -4 - (-6)/6357. Is 0 bigger than a? False Suppose -3n + 8 = 2b + 1, 3n - 3b - 12 = 0. Let z = -2 + n. Let i = -2 - -2. Which is bigger: z or i? z Let q(w) = -3w + 1. Let i be q(1). Let o be i/5 - (-32)/(-20). Suppose 0n - 3n = -2f - 15, -5n = 5f. Is o at least f? True Suppose g = 2m - 24, -5m + 3g = -g - 57. Is 35/3 at most m? True Suppose 3m - 1 = -7, 3m + 6 = z. Are z and 3 nonequal? True Let b = 39 - 32. Is 6 != b? True Let g = -54 + 56.1. Which is smaller: 0.1 or g? 0.1 Suppose 20 = -4u + 5s, -2 - 2 = u - s. Suppose i - 3i + 5x = 3, -x = -2i + 1. Let v = i - 1. Is u > v? False Let v(s) = -s3 - 8s*2 - 11s + 6. Let w be v(-6). Which is bigger: 2/99 or w? 2/99 Let i = -0.1 - -1.1. Let s = 1.9 - 0.9. Let y = s + i. Which is greater: -1 or y? y Let p = 2572.99 + -2554. Let w = 19 - p. Is w smaller than 0.1? True Let y = 46 - 16. Is y != 29? True Let a = -29 - -32. Which is smaller: -7 or a? -7 Let h be -32/(-9)3. Suppose -hv - 2v = t + 17, -2v - 16 = -2t. Which is smaller: 4 or t? t Let x = 1.2 - 0.9. Which is bigger: x or 3? 3 Let c be 4/(-2) + (-1886)/(-154). Let j = c + -73/7. Let h(x) = x - 8. Let g be h(8). Which is greater: g or j? g Suppose -2c + 18 = -3v + 6, -2c = -6. Let w(y) = -y3 - 5y*2 - 6y - 4. Let l be w(-4). Suppose 0 = 2o + l. Are v and o equal? True Let v be -39 - (0 + (0 - -1)). Let t be (-216)/v + 2/(-5). Which is greater: t or 11/2? 11/2 Let c = -190/9 - -21. Let f(w) = -w3 - 2w*2 + 2w - 3. Let r be f(-3). Is r not equal to c? True Suppose -k - k + 4 = 0. Let b = 0 + k. Let j = 13 + -41/3. Which is bigger: j or b? b Let d be (-29)/328/(-3). Let v be (-30)/7(3 + -24). Let b = d - v. Is b smaller than 1? True Let o = 1.04 + -0.64. Is o smaller than 4? True Let o(g) = -4g - 23. Let a be o(-6). Is 1/31 greater than a? False Suppose 0 = 4g - u + 1, -3u + 0 + 12 = -3g. Does g = 2/25? False Suppose -7 = 4b - 39. Suppose -2m - b = -4m. Is m <= 2? False Let q = 9 + -5. Suppose qf = 10 + 6. Let y = 0.07 + -0.17. Is y <= f? True Let u(a) = -a*3 - 9a*2 - 14a - 6. Let h be u(-7). Is h at most as big as 2? True Let i = -5 - -6. Let q(c) = -c*2 + 6c - 2. Let g be q(5). Let f = i - g. Which is greater: f or -1? -1 Suppose 5i = -3y - 4, 5y + 20 - 2 = 3i. Let h be 0 + (3 - i) + 1. Suppose -p = -2 + h. Which is smaller: -1/5 or p? p Let t = 26 - 105/4. Is -1 at most t? True Let g(l) = -l*2 - 5l - 3. Let o be g(-5). Let a be 1 - 2 - (8 + o). Which is smaller: a or -8? -8 Let l = 0.01 + -0.13. Let p = 0.02 + l. Is 3 less than or equal to p? False Let h = -0.2 - 0.1. Let j be 2/(-16)12. Is h <= j? True Suppose -52 = -4y - 4k, -2y = -y + 5k - 1. Let g = -10 + y. Suppose -3z = 2t + 2t + 8, 0 = 2t + 4z - g. Is -4 <= t? False Let y = -1.3 - -0.3. Suppose -3o - b = 8, 3o + 2 = 2b + 9. Is o less than or equal to y? True Let r = 13 - 9. Which is smaller: -2 or r? -2 Let r(d) = d*3 + 8d*2 + 7d - 1. Let h be r(-7). Let o = 3347/15 + -223. Is o less than or equal to h? False Let c = 38 - 26. Suppose 1 = -z, -z = -2q + 1 + c. Which is smaller: 7 or q? q Let d = 9 + -8.1. Let j = -1.6 + d. Let n = 3.3 - j. Which is smaller: 1 or n? 1 Let z be (0/(-2))/(20/10). Let n be (-5)/(35/(-6))1. Which is smaller: z or n? z Let l = -11.9 - -14. Is l != -0.2? True Let d = -0.3 + 0.309. Let g = d + 5.081. Let s = -0.09 + g. Which is smaller: s or -0.1? -0.1 Let s = -55/107 + 11177/34026. Let l = s - -1/53. Does l = 1? False Let u = -6 - -14. Let q = 6 - u. Which is smaller: q or 0? q Let z = -2726/3 - -2836/3. Let x = 9866/37 + -178918/777. Let w = x - z. Which is greater: -2/3 or w? w Suppose -3v = -4v + 4. Suppose 2d - vp + p = -6, -p = -5d - 2. Let i be 4 - (3 + 15/10). Which is greater: i or d? d Suppose -a = 4a. Which is bigger: 9/7 or a? 9/7 Let y = -3.1 + 0.1. Is y smaller than -0.1? True Let g = 41 - -34. Is g at least 75? True Let x = 2.11 + -0.11. Let q = 0.01 - -0.39. Let g = 0.5 - q. Which is bigger: g or x? x Let k = 22 - 14. Suppose 3s + 3x = -3 - 9, 4x = -k. Which is greater: s or -3/2? -3/2 Let o = 0.07 + -6.07. Let j = o + 6.8. Let y = 0.83 - j. Is 1 <= y? False Suppose -2i - 25 = -0i - 5u, 0 = i - 3u + 15. Let n be 4/(-6) - (-34)/6. Suppose 0 = -4g - nw + 9, -g + w = -iw. Are g and 0 non-equal? True Let a be 3/((-3)/(-4)) - (-1711)/(-472). Let u(o) = o*2 + 6o + 4. Let b be u(-5). Which is smaller: b or a? b Let i = 4 + -3. Suppose 0 + i = u. Which is smaller: u or -0.03? -0.03 Suppose 0 = -25w + 20w - 15. Let c(b) = -5b + 7. Let k(l) = 6l - 8. Let u(q) = 5c(q) + 4k(q). Let t be u(6). Is w < t? False Let s = -1 + -2. Let m be (5/s)/5-3. Which is smaller: 5/6 or m? 5/6 Let n = 11 + -14. Is n smaller than -1? True Let n = -33 + 37. Is -7 > n? False Let p = 1 + -14. Which is smaller: -12 or p? p Let d(o) = o3 - 2o*2 - 2o - 6. Let g be d(3). Which is greater: -4 or g? g Suppose -g - 3q - 36 = 2g, -5g - 52 = 3q. Let n be 124/g + (-1)/(-2). Let h be ((-2)/n)/((-2)/12). Is h less than -1? False Let y = 0.035 - -0.965. Which is smaller: -29/4 or y? -29/4 Let s(v) = 66v2 - 7v - 7. Let l be s(-1). Does -1 = l? False Let w = 2 + 1. Suppose -5q + 6 = -s, wq + 0q = -s + 18. Is 9 >= s? True Let a(s) = -5s - 3. Let t be a(3). Let p = -3 - t. Suppose 4y - 2r = -3r + p, -3r = 3. Are 5 and y nonequal? True Let w(u) = 5u2 - u. Let a be w(1). Let i be 27/(-63)2/a. Which is smaller: 0 or i? i Let d(t) = 4t + 19. Let i be d(3). Is 29 <= i? True Let y be 6/10 + (-2 - -2). Let d = 1.4 + -1.4. Which is greater: d or y? y Let p = -0.044 + -1.956. Is p less than -67? False Suppose 3n + 0n = 6. Let w be (-2)/n(-3)/(-3). Let i = -1/58 + -109/406. Do w and i have the same value? False Let j(h) = -h*2 - 5h + 5. Let b be j(-5). Let a be (b + -2)/(6/4). Is 4 less than or equal to a? False Suppose 1 = l + 13. Is -12 at least l? True Suppose -4 = -3p + 2p. Suppose -8 = ph + 4m, 0 = -3h + 5m - 2 + 4. Is h bigger than -1/3? False Suppose -11 = -4q + 17. Let o = 5 - q. Which is smaller: -1 or o? o Suppose -5s - 5 = -p, 4s - 3p = 2 - 17. Which is smaller: s or -1? -1 Let v(n) = -4n - 2n - 8 - n + n*2. Let b be v(8). Do b and -2/9 have the same value? False Let j = 78 + -111. Is j greater than or equal to -33? True Let g = 76 + -381/5. Which is greater: g or -1? g Let u = 1 - -3. Let k = -1 + u. Which is smaller: k or 2/7? 2/7 Let o(f) = -10f + 44. Let i be o(6). Which is greater: -17 or i? i Let c = 3 + -21. Is -18 at most as big as c? True Let f = 6 + 8. Let b = 3.8 + -3.8. Which is bigger: f or b? f Let f = 0.25 + -4.25. Is f at most as big as -0.2? True Let k be (-3 - 81/(-12))-4. Let d be (-11)/15 - 6/k. Which is smaller: d or 3? d Let v = -18.1 - -17.9. Let l = -0.1 - -0.2. Let d = -0.1 + l. Which is smaller: v or d? v Let i = 4 + -2. Let j = 3 - i. Let n be 4/j + (5 - 7). Does n = 2? True Suppose -p = -3p - 10. Let b = -1 - p. Suppose -5t + y + b = 17, -5y - 10 = 0. Which is smaller: 1/2 or t? t Let p be 6/(-4)(-4 - 150/(-36)). Is -2.1 smaller than p? True Let n be -3 - (2/11 - 140/44). Is n < 2/21? True Let t = 0 + -0.05. Let q be 3/1 - (1 - 4). Let u be (((-4)/q)/2)/1. Is t greater than u? True Let f(s) = s2 - s + 24. Let c be f(0). Suppose 5i = -20, i + 3i = 5h + c. Let m = h + 7. Which is smaller: m or 1/4? m Suppose 3u + 14 + 0 = -4p, -2u - p - 1 = 0. Let d = -2 + u. Let f(i) = i2 - 5i + 3. Let t be f(4). Is t less than d? True Let z be (-39328)/(-12) + 2/3. Let r be z/(-42) - (-4)/(-14). Let j = r - -77. Is 0 at most as big as j? False Suppose t = -2m - 8, 3t + 3m + 16 = t. Let d = -3 - t. Let s be 14/(-8)(4 - d). Which is greater: 1	{ "pile_set_name": "DM Mathematics" }
2v + 44v - 270v + 42v + 40v + 1. Let w(i) = 16i - 13. Let d(g) = -11g + 9. Let x(r) = -7d(r) - 5w(r). What is -10h(t) + 6x(t)? 2t + 2 Let o(y) = 17y3 + 2y*2 + 15y - 9. Let i(v) = -52v3 - 7v*2 - 53v + 30. What is 2i(x) + 7o(x)? 15x3 - x - 3 Let r(s) = 8s*2. Suppose -3v = -9j, 3v - 22 = 34j - 36j. Let g(c) = c*2. Calculate jr(h) - 44g(h). -28h*2 Let p(r) = 7366r - 98. Let i(u) = -2455u + 28. Calculate 7i(w) + 2p(w). -2453w Let q(b) = 37b - 5 - 7b + 49b2 - 31b - 4b. Let x(f) = 25f*2 - 3f - 3. Give -3q(k) + 5x(k). -22k2 Let j(i) = 94379158i - 60211. Let w(a) = -9405a + 6. Give 6j(b) + 60211w(b). -9507b Let y(j) = j*2 - 3j - 27. Let w(i) = -2i2 + 7i + 55. Let d = -421 + 428. Calculate dy(a) + 3w(a). a*2 - 24 Let m(u) = -9u*3 - 2u*2 - 1. Let b(k) = 8k*3 + 4 - 6 - 82k*2 + 2 + 83k*2. Give 4b(z) + 3m(z). 5z*3 - 2z*2 - 3 Let f(j) = 2j*3 + 3j*2 - j. Let n(c) = 7c*3 - 9c*2 - 3c - 128. Give -3f(p) + n(p). p3 - 18p*2 - 128 Let g(s) = -40s*2 - 7s - 144. Let z(w) = 60w2 + 10w + 209. What is 7g(a) + 5z(a)? 20a2 + a + 37 Let k(j) = 96j. Let n(r) = 2r - 1. What is k(h) - 3n(h)? 90h + 3 Let o(z) = 19z*2 + z - 1. Let s(q) = 378q*2 + 26q - 18. Let y(r) = -20o(r) + s(r). Let c(x) = -x2 + 3x + 1. Give -5c(b) + 3y(b). -b*2 + 3b + 1 Let s(i) be the first derivative of 0i + 1/2i*2 + 3. Let m(d) = -4d. Let b = -25 - -4. Calculate bs(f) - 6m(f). 3f Let l(m) = -2m + 3. Let u(n) = -4821 + 4828 - 2n - n2 - 3n. Suppose 18 = -6f + 6. Give fu(v) + 5l(v). 2v2 + 1 Let p(d) be the second derivative of -d4/24 - 61d3/2 - 3d + 26. Let c(q) be the second derivative of p(q). Let l(g) = -g - 4. Determine -4c(o) + l(o). -o Let u(i) = 26i*3 - 78i2. Let t(n) = -n2. Let k(y) = 58y - 1720. Let w be k(31). Calculate wt(s) - u(s). -26s3 Let g(c) = 4c2 + 3. Let l(b) = b2 - 1. Suppose -13 - 17 = 14a + 16a. Calculate ag(f) + 2l(f). -2f2 - 5 Let x(o) = -o. Let f(d) = -3d - 14. Suppose -64z + 331 = 10z + 257z. What is zx(n) - f(n)? 2n + 14 Let f be -7 - (-36 - (-1 - -6)). Suppose -fh + 41h + 28 = 0. Let i(y) = y2 + 1. Let u(b) = -b3 + 4b*2 + 4. Give hi(t) + u(t). -t*3 Let h(l) = -5l + 1. Let f(b) = -2b - 3. Let t(m) = -f(m) - 3h(m). Let q(u) = 51u. Calculate -3q(d) + 8t(d). -17d Let l(f) = -30f3 - 2f*2 + 2f. Let z(v) be the second derivative of 31v5/20 + v4/4 - v3/2 - 5905v. What is 6l(b) + 4z(b)? -56b3 Let a be (-2)/(1/(-18)3). Suppose -17 + a = 5i. Let d(f) = -2f*2 - 4f - 2. Let c(n) = n + 1. Calculate id(o) - 2c(o). 2o2 + 2o Let a(h) = -213h - 2912. Let u(c) = 116c + 1456. What is -6a(l) - 11u(l)? 2l + 1456 Let f(y) = -16 - y + 57 - 19 - 22. Suppose -11i + 3 = -10i. Let j be 1/i - (-6)/9. Let l(x) = 2x - 4. Determine jl(z) + 3f(z). -z - 4 Suppose -25j - 3766 = -39j. Let n = 289 - j. Let c(w) = 13w - 3. Let h(u) = -90u + 20. What is nc(a) + 3h(a)? -10a Let s(u) = -2u - 1. Let f = -465 + 491. Let a(j) = -fj + 0 + 0 + 16j + 9j + 1. Determine 2a(m) + s(m). -4m + 1 Let p(f) = 7f2 - 200. Let s(h) = -h2 - 3. Give p(a) + 4s(a). 3a*2 - 212 Let o(t) = 2t*3 + 16t*2 + 7. Let z(x) = 2x*3 + 15x*2 + 6. Let w = 1576 - 1582. What is wo(y) + 7z(y)? 2y*3 + 9y*2 Let d(h) = 20h + 92. Let p(j) = 62j + 272. Determine 8d(a) - 3p(a). -26a - 80 Let h(y) = -3y3 - 7y*2 - 4y - 4. Let b = -539 - -542. Let g(n) = n*2 + 136n - 2n3 + 1 - 135n + bn3. Give 4g(i) + h(i). i*3 - 3i*2 Let h(c) = -11c + 2. Let i(r) = 10r + 9r + 9r - 40r + 17r - 1. Let y be (-215)/35 - 1/(-7). Determine yh(p) - 13i(p). p + 1 Let r(o) = 5o - 24. Suppose 13w - 82 + 56 = 0. Let d(i) = i - 6. Determine wr(f) - 9d(f). f + 6 Let z(s) = -2s - 62. Let c(o) = -o - 32. Determine -7c(v) + 3z(v). v + 38 Suppose -3z + 5p - 4 = -0z, -5p = 2z - 39. Suppose 25 = -4d - z. Let h(c) = -3c + 6. Let b(o) = -o + 2. Let l = -17 + 20. What is db(m) + lh(m)? -m + 2 Let f(j) = j - 1. Let v(u) = -342u*2 + 345u*2 - 3u - 1 - 2u. Determine -5f(t) - v(t). -3t2 + 6 Let h(d) = 54d*3 + 6d*2 + 5. Let x(s) = -53s*3 - 5s*2 - 5. Give -5h(b) - 6x(b). 48b*3 + 5 Let d(j) = 11j*2 - 6j + 2. Let l(g) = -2 + 11107g2 + 17g + 11096g2 - 22235g*2 - 1 - 3. Calculate 17d(w) + 6l(w). -5w2 - 2 Let i(p) = -p2 + 32p - 1. Let k(b) = 1720b*2 - 160b + 5. What is -30i(z) - 6k(z)? -10290z2 Let l(d) = 26d + 14. Let q(n) = -9n - 5. Let f be -2 - 1 - 110/22. Let g(p) = fq(p) - 3l(p). Let m(v) = -26v + 2 + 9v - 7 + 0. Give 11g(i) - 4m(i). 2i - 2 Let r(j) = 4j3 - j2 - 2j + 2. Let b = 532 - 532. Suppose -4i = b, -u = -3u + 2i + 4. Let l(p) = p3 + 1. Give ul(s) - r(s). -2s3 + s2 + 2s Let b(w) be the third derivative of 23w4/12 - 8w*2 - 50w. Let j(n) = -138n. What is 11b(u) + 4j(u)? -46u Let l(s) = -42s + 8. Suppose -6u + 22 = 46. Let p(x) = 14x - 3. What is ul(t) - 11p(t)? 14t + 1 Let n(v) = -v + 2. Let x(q) = -11q + 3. Let g(c) = -6n(c) + x(c). Let b(l) = 4l + 8. Calculate 4b(d) + 3g(d). d + 5 Let j(v) = -9v + 37. Let b(l) = -16l + 90. Calculate -4b(n) + 7j(n). n - 101 Let n(x) = -12x*2 - 9x + 3. Suppose -159d + 322 = -73d - 108. Let s(t) = 8t2 + 6t - 2. What is dn(c) + 8s(c)? 4c2 + 3c - 1 Let o(c) = -2c2 - 2c. Let m(q) = q*2 - 6. Let s(w) = -w - 6. Let i(n) = -3m(n) + 3s(n). Calculate -6i(u) + 10o(u). -2u*2 - 2u Let a(i) = -9i + 3. Let c be (12 + (-420)/80)8/6. Let n(d) = 36d - 13. Determine ca(z) + 2n(z). -9z + 1 Let f(g) = -74g2 - 15g + 4. Let q(j) = 150j2 + 34j - 8. What is 9f(y) + 4q(y)? -66y2 + y + 4 Let i(y) = -36 - 43 - 32 + 106 - 5y. Let p(h) = -6h - 6. Give 7i(n) - 6p(n). n + 1 Let d(k) = 0 - 22k - 1 - 11. Let l(a) = 9a + 5. Let z = 726 + 30. Let g = z - 761. Calculate gd(c) - 12l(c). 2c Let s(z) = -2z2 - 2z. Let d be 4/(-10) - 29/(290/(-144)). Suppose -dx + 6 = -15x. Let p(b) = -b*2. Give xp(i) + s(i). 4i2 - 2i Let o(d) = -28d + 1996. Let s(x) = -12x + 999. Give -4o(t) + 9s(t). 4t + 1007 Let o(s) be the second derivative of 1/2s4 + 0 + s2 - 1/2s3 + 29s. Let b(v) = v*2 - v. What is 3b(n) - o(n)? -3n2 - 2 Let y(p) = -7p*3 + 9p*2 - 4p + 27. Let l(a) = -19a3 + 28a*2 - 11a + 73. Determine 4l(k) - 11y(k). k*3 + 13k*2 - 5 Let k(b) = 59b + 29. Let h(r) = -185r - 91. Let y(v) = 7h(v) + 22k(v). Suppose 2 - 12 = -5q + 2w, -9 = -q - w. Let o(x) = 2x. What is qo(z) - 3y(z)? -z - 3 Let s(i) = 10612i3 - 21i*2 - 21i + 21. Let o(q) = -1061q3 + 2q*2 + 2q - 2. Calculate 21o(x) + 2s(x). -1057x3 Let v(x) = -160x*2 - 5x - 5. Let r(h) = -317h2 - 13h - 11. Give 2r(i) - 5v(i). 166i2 - i + 3 Let w(p) = -6p*3 + 446p + 4. Let k(s) = 2s3 - s - 1. Determine -4k(z) - w(z). -2z3 - 442z Suppose 0 = 5m - 35, 4s - 1189 = 4m - 1237. Let a(f) = 11f*3 + 2f*2 - 2f. Let t(z) = -12z3 - 2z*2 + 3z. Determine st(x) - 6a(x). -6x3 - 2x*2 - 3x Let x(f) = 7f3 + 4f*2 + 11f - 4. Let b(j) = 8j3 + 5j*2 + 12j - 5. Let n = -14580 + 14576. Calculate nb(p) + 5x(p). 3p3 + 7p Let b(s) = 7s3 - 4s*2 - 3s + 3. Let u(y) = -5y + 135. Let z be u(26). Let l(p) = 8p*3 - 5p*2 - 4p + 4. What is zb(m) - 4l(m)? 3m3 + m - 1 Let x(s) = 41s*3 - 6s*2 + 15s + 2. Let b(g) = 121g3 - 17g*2 + 43g + 6. Calculate 6b(c) - 17x(c). 29c3 + 3c + 2 Let u(r) = -19r + 17. Suppose -458g - 50 = -5m - 461g, 5g = 4m - 77. Let c(z) = 9z - 8. Determine mc(i) + 6u(i). 3i - 2 Let s(h) = -3h3 + 5h*2 + 4h + 2. Let w(t) = 6t3 - 11t*2 - 9t - 5. Suppose -3b - 186 = -2n - 176, 0 = b + 2n - 2. Give bw(q) - 5s(q). 3q*3 - 3q*2 - 2q Let y(j) = -9j2 - 18j + 22. Let m(z) = 9z2 + 21z - 25. What is -4m(b) - 5y(b)? 9b2 + 6b - 10 Let c(h) = 4276h - 11. Let y(w) = -4283w + 13. What is -7c(b) - 6y(b)? -4234b - 1 Let b(m) be the second derivative of -m4/12 + m3/6 + m2/2 - 1231m. Let f(o) = 46o2 - 22o - 22. Determine 44b(x) + 2f(x). 48x2 Suppose -33m + 403 = -455. Let x(r) = -4r3 - 3r*2 - 2r. Let s(w	{ "pile_set_name": "DM Mathematics" }
are the prime factors of -20((-434)/h + 6/(-27))? 5 Let z = -6122 + 9355. What are the prime factors of z? 53, 61 Let b(p) be the third derivative of p6/120 - p5/15 - 5p4/24 + p3/6 - 5p2. Let d be b(5). What are the prime factors of 1 - d(-72)/3? 5 Suppose 0 = 4w - 6w. Suppose -4f + 3x - 69 = -22, w = f + 4x + 7. Let p = f + 21. What are the prime factors of p? 2, 5 Let r(d) = -d2 - 2d + 8. Let o be r(-4). Suppose 0 = -2x - 4h, -2h = 5x + 3h - 25. Suppose o = 7s - xs + 33. List the prime factors of s. 11 Suppose 0 = -3d - 4f + 429, 287 = -4d + 6d + 3f. List the prime factors of (d/2)/((-4)/(-8)). 139 Suppose i - 5v = 24, -4i + 5v + 21 + 45 = 0. Suppose -1427 + 517 = -iu. List the prime factors of u. 5, 13 Suppose -10954 = -21a + 12923. What are the prime factors of a? 3, 379 List the prime factors of 1324 - 6/55. 2, 659 Let q(l) = l + 304. What are the prime factors of q(-16)? 2, 3 Let x(w) = 21w2 - 24w + 60. Let s(q) = -6q2 + 7q - 17. Let f(d) = -18s(d) - 5x(d). Let l be f(6). Suppose j = -2j + l. List the prime factors of j. 2, 13 Let v(c) = 5c*2 + 3c. Let s be v(6). Suppose -2o + 90 + s = 0. Suppose -i - 2i + o = 0. List the prime factors of i. 2, 3 Let y = 1494 + -910. List the prime factors of y. 2, 73 Suppose -20l - 21l = -53546. What are the prime factors of l? 2, 653 Let p be 2007/(-18) + 10/(-4). Let h = p + 301. What are the prime factors of h? 11, 17 Let c be 0 + -21 - -24. Let m = -79 - -72. Let p = c - m. What are the prime factors of p? 29 Suppose -3z - 2m + 16 = 2z, -z - 3m = 2. Suppose -32 = -0d + zd. Let u = d - -16. List the prime factors of u. 2 Let y = -2 - -7. Suppose 2g - 6 = 0, -yg = -5z + z + 273. List the prime factors of z. 2, 3 Let m(u) = u*2 - u + 40. What are the prime factors of m(-13)? 2, 3, 37 Let v(y) = 120y*2 + 10y. What are the prime factors of v(2)? 2, 5 Let z = 49 + -1. Suppose 2o - 6o + z = 0. Suppose -2s = -o - 6. List the prime factors of s. 3 Suppose 5x = 6 - 16. Let l(r) = -3r3 + 4r*2 + 2r - 1. List the prime factors of l(x). 5, 7 Let p = 137 - 129. Suppose 0 = ph - 556 - 1428. List the prime factors of h. 2, 31 Let v(m) = -12m*2 + 6m + 6. Let j be v(-5). List the prime factors of 2 + 0 + j/(-3) + 3. 113 Let i(h) = -2h + 10. Let y be i(5). Suppose -5l + 16 + 44 = y. List the prime factors of 26(l/8)/3. 13 Suppose -4d + 1 + 7 = 0. Suppose 3g + 2 = dg. Let c(q) = 4q2 + 2q + 3. What are the prime factors of c(g)? 3, 5 Let d(m) = 2m2 - 27m - 9. What are the prime factors of d(-16)? 5, 11, 17 What are the prime factors of (-10 - 6258/(-35))/((-2)/(-5))? 2, 211 Let d = 305 + -187. What are the prime factors of d? 2, 59 Let x(q) = q + 12. Let m be x(0). Let a be (m/(-18))/(1/(-3)). Suppose 51 = al - 29. List the prime factors of l. 2, 5 Let f(x) = 2x*2 + 26x + 4. Let j be f(-14). Let a = j + -32. Suppose 3k - 216 = -ak. What are the prime factors of k? 2, 3 Let p(q) be the first derivative of 17q2/2 - 3q - 10. What are the prime factors of p(2)? 31 Suppose -3m - 49y = -44y - 998, 3y = -m + 338. What are the prime factors of m? 2, 163 List the prime factors of (-14795)/(-22)8/5. 2, 269 Let a be (-6)/(-21) + (-104)/(-28). Suppose 2b - 73 = 3d, -2d = -0d - ab + 38. Let f = -19 - d. What are the prime factors of f? 2 Let w be 0/((-1)/2 - (-5)/(-10)). Suppose -5o - j + 271 = w, -2j = 2o + j - 98. List the prime factors of o. 5, 11 Let g be (-10)/(-4) + 12/8. Let i be g - 2/(-6)-3. Suppose -6h - 4d = -2h - 88, ih + 4d = 69. List the prime factors of h. 19 Let h(t) = 321t*3 + 4t*2 + 5t. List the prime factors of h(2). 2, 1297 Let y = 1 - 5. Let a = y + -2. Let m = a - -20. What are the prime factors of m? 2, 7 Let p be (-3)/(-9) - (-16)/(-12). Let i be p/((-1263)/(-630) - 2). What are the prime factors of i/(-8) - (-2)/(-8)? 2, 13 Suppose -4b + 2t - 72 = 0, 5b - 5t = -75 - 15. Let s be (-4)/8b + -3. Suppose -s = 5q - 7q. List the prime factors of q. 3 Let u(z) = 7z - 2. Let i be u(3). Suppose -4l - 129 = -501. Suppose h = -i + l. List the prime factors of h. 2, 37 Let c be (18/(-8))/(1/28). Let o = 43 + c. Let p = -13 - o. What are the prime factors of p? 7 List the prime factors of (-66)/99 - 4/(-6) - -255. 3, 5, 17 Let c be ((-4)/4 - -3)/((-2)/(-83)). Let q = 32 + -80. Let h = c + q. What are the prime factors of h? 5, 7 Let t(w) = -w3 - 29w*2 - 32w + 59. List the prime factors of t(-28). 3, 19 Let t be 1084/(-28) - 8/28. Let c = -37 - t. Suppose 51 - c = v. What are the prime factors of v? 7 Suppose -5 = -3y + 10, -4l - 3y = 7469. What are the prime factors of 2/(-7) - l/7? 3, 89 Let j be (9/6)/((-15)/(-20)). Suppose a + 2 = -3b, -ja = -7a + 3b + 26. List the prime factors of (204/8)/3a. 2, 17 Suppose 2v + 4264 = c, 12c - 21320 = 7c - 5v. What are the prime factors of c? 2, 13, 41 List the prime factors of 16/(-24) + 5/(-6)-428. 2, 89 Let d = 58 - 47. Let t(g) = 9g - 16. What are the prime factors of t(d)? 83 Let k be (3 - 1)/((-6)/(-9)). Let h be 0/(k/(6/4)). Suppose h = -5a + 4p + 30, 36 + 4 = 3a + 2p. List the prime factors of a. 2, 5 List the prime factors of (55/33)/(5/6375). 5, 17 Suppose -10 = -5w + 25. Suppose wq - 320 = 2q. Suppose 3g + g - q = 0. What are the prime factors of g? 2 Suppose -3g = 5l - 31, g = -g + 5l - 21. Let o(m) = 40m*2 + 2m - 4. What are the prime factors of o(g)? 2, 5 Suppose -4x - 88 = 16. Let p = x + 27. Let s = 58 + p. What are the prime factors of s? 59 Let f(a) = -278a*3 - 3a*2 - 4a - 1. What are the prime factors of f(-1)? 2, 139 What are the prime factors of (-30)/40 - (-6012)/16? 3, 5 Suppose -14t = -15t + 8. Suppose -b = 3 + t. Let m(g) = -g + 26. What are the prime factors of m(b)? 37 Suppose 3439 = 6x + 19. List the prime factors of x. 2, 3, 5, 19 What are the prime factors of -188(12/24)/(2/(-10))? 2, 5, 47 Suppose 0 = 4v - 4u - 836, -v + 7u = 4u - 199. Suppose -4g = -c - c - v, -g - 3c + 71 = 0. What are the prime factors of g? 2, 7 Suppose -2n - 27 = -253. Suppose 0 = -x - 38 + n. What are the prime factors of x? 3, 5 Let b(c) = c3 - 2c*2. Let g(w) = -2w + 6. Let r be g(6). Let o(a) = a*2 + 5a - 3. Let f be o(r). What are the prime factors of b(f)? 3 Let f(l) = -13l3 - 7l - 2. What are the prime factors of f(-5)? 2, 829 Let c = 3 + -1. Let v = 5 - c. Suppose 61 = vb - 23. What are the prime factors of b? 2, 7 Let l = 19 + -12. Suppose -lk = -2k - 30. Suppose -136 = -kn - 34. What are the prime factors of n? 17 Suppose -5n - h = -399 + 5, -4n + h + 317 = 0. What are the prime factors of n? 79 Suppose -83a = -80a - 3012. What are the prime factors of a? 2, 251 Let p(h) = 12h2 - 25. List the prime factors of p(-7). 563 Suppose 103 = -5x - 167. What are the prime factors of x/(-8) + (-4)/(-16)? 7 Suppose -2q - 4z - 512 = -0q, 0 = 3q + 4z + 768. Let b = q - -364. List the prime factors of (6/(-18))/((-3)/b). 2, 3 Suppose -4c = -8 - 0. Suppose -4 = -ch + 2. What are the prime factors of h(0 + 27/3)? 3 Suppose 7q = 10q - 111. Suppose -17x + 99 = -26x. Let d = q - x. List the prime factors of d. 2, 3 Let l(w) = w*3 - 5w*2 - 7w - 3. Let b be l(8). Let n = b - 95. What are the prime factors of n? 2, 19 Suppose -8z + 44 = -4z. Suppose zq - 517 = 1166. List the prime factors of q. 3, 17 Suppose -23p = -32505 + 3870. What are the prime factors of p? 3, 5, 83 Let j = 1100 - 1615. Let p = -278 - j. What are the prime factors of p? 3, 79 Suppose 2i + 8l = 6l + 588, -4i = -4l - 1192. List the prime factors of i. 2, 37 What are the prime factors of 184(434/120 - 2/(-15))? 2, 3, 5, 23 Suppose 2n - 3y - 2 = -7y, -4n + y + 49 = 0. Suppose 0 = nf - 2922 + 623. What are the prime factors of f? 11, 19 Let j be (-12 - -4)3/(-6). Suppose 0 = -jo + g + 4g + 304, -5o + 5g + 375 = 0. List the prime factors of o. 71 Let m(y) = y*3 + 22y*2 + 23y + 17. Let c be m(-21). List the prime factors of (-732)/(-5) - ((-135)/c - 5). 2, 73 Suppose 0 = -2f + 5u + 954, 4f + 3u = 628 + 1306. What are the prime factors of f? 2, 241 Suppose s - 4v = 142, 3s + 5v = -0s + 358. What are the prime factors of s? 2, 3, 7 Let j(p) = -6p + 8 + p2 + 10p -	{ "pile_set_name": "DM Mathematics" }
50k2 Let m(d) = 18d + 4. Let c(p) = -3p - 1. Let u(b) = -4c(b) - m(b). Let o(y) = 279y. Determine o(u(v)). -1674v Let h(a) be the first derivative of 6a2 + 3. Let i(y) = 19y - 13y + 3y + 3y2 - 9y. Give h(i(q)). 36q2 Let o(f) = -4f. Let h(z) = 282172z - 35351. Let l(n) = -1390n + 174. Let k(r) = -6h(r) - 1219l(r). Calculate k(o(s)). -5512s Let j(w) = w. Let a(r) = 9 + 302r - 351r + 175r + 385r + 402r. Calculate j(a(o)). 913o + 9 Let n(m) = -233m*2 - 30. Let o(h) = 293h. Determine o(n(c)). -68269c2 - 8790 Let t(y) be the first derivative of -y2 - 4 - 2 + 12y*2 + 0y2. Let o(l) = l2 + 0l2 - 2l + 2l. Calculate t(o(g)). 22g2 Let a(k) be the third derivative of k4/24 + 4k2 - 16k - 1. Let o(i) = 12i2 - 166. What is o(a(b))? 12b*2 - 166 Let d(r) = -2r. Let x be 2(12 + -1). Let f(i) = i*3 - 14i*2 + 2i - 14. Let m be f(14). Let c(v) = -mv2 + 36v*2 - 11v*x. Give c(d(w)). 44w*2 Let d(x) = x. Let k = -885 + 1498. Let w(c) = 33 - 303c + kc - 309c. Determine d(w(a)). a + 33 Let x(q) = 295739 - 39q2 - 122q*2 - 295739. Let u(t) = t. Calculate u(x(d)). -161d*2 Let s = 71 + -64. Let v(t) = 0t*2 - 2t*2 + 0t*2 + st2. Let w(u) = -u2 + 4u. Let n(i) = i. Let p(k) = -4n(k) + w(k). Determine p(v(g)). -25g4 Suppose -72n + 12 = -66n. Let x(u) = -7u*2 - 4u*2 - 12u*2 - 4u*n. Let z(t) = 15t + 0 + 0 - 16t. What is x(z(b))? -27b*2 Let t(h) = 2h + 3. Let o be (-1 - (-2)/(-3))(-42)/35. Let r(k) = -2 - 2 + 4 + ok. What is t(r(y))? 4y + 3 Let d(c) = 15c*2 - 6. Let s be 2/((140/(-49))/(-10)). Let x(v) = -4v - v + 19v - 5v - sv. Give x(d(f)). 30f*2 - 12 Let q(l) = 3l + 11. Let b(r) be the first derivative of -r*2/2 - 966. Give q(b(i)). -3i + 11 Let q(z) = 115z2 + 2. Let t(x) be the first derivative of -x2 + 634. Determine t(q(o)). -230o*2 - 4 Let w(u) = -5u. Let v(n) be the first derivative of 13n4/12 - 51n*2 + 19. Let p(j) be the second derivative of v(j). Give p(w(d)). -130d Let p(n) = -2n2 + 5n - 5. Let f(q) = 25 - 17 + q*2 - 6 - 2q. Let u(b) = 5f(b) + 2p(b). Let w(k) = -5k - 2. Calculate u(w(l)). 25l*2 + 20l + 4 Suppose 3v - 3x + 6x = 21, -2x = -5v + 21. Let u(r) = vr + 5r + 6r - 18r. Let j(n) be the first derivative of 13n*3/3 - 3. Determine j(u(y)). 52y*2 Let g(h) = -13h. Let n(c) = c*2 - 15c - 52. Let t be n(-3). Let o(a) = -3a. Let q be o(-5). Let f(i) = -21i*2 - qi*2 + 39i*t. What is g(f(j))? -39j*2 Let w(n) = 3n + 7n2 - 3n. Suppose -21j - 86 + 72 = 196. Let t(x) = -4x*2. Let b(a) = jt(a) - 6w(a). Let q(y) = 13y. Give b(q(v)). -338v2 Let u(x) = 4x*2 - 1447x. Let f(k) = 304k2. Give u(f(n)). 369664n*4 - 439888n*2 Let c(w) = -69w*2 - 67w*2 - 16w*2 + 11w*2 - 14w*2 + 15w2. Let r(v) be the second derivative of v4/12 + v. Calculate c(r(i)). -140i4 Let j(s) = -s. Let p(k) = 801k*2 + 31k + 11. Let q(z) = 266z2 + 11z + 4. Let t(a) = 4p(a) - 11q(a). Calculate j(t(l)). -278l2 - 3l Let i(q) = -31q - 2. Let o(p) = 97p + 7. Let v = -737 + 723. Let f(u) = vi(u) - 4o(u). Let g(d) = 6d. Determine f(g(b)). 276b Let s(d) = -d. Let h(o) = -67144940o2. What is h(s(w))? -67144940w2 Let k(l) = -l2 - 5l + 3. Let t be k(-5). Let p(h) = t - 2h - 3. Let b(c) = -13c + 1926624 - 1926624. Calculate b(p(w)). 26w Let y(z) = -4z. Let g(v) = 40v + 50. Let k be (725/15 - 4/12) + 2. Let n(w) = -w - 1. Let b(d) = kn(d) + g(d). Calculate b(y(a)). 40a Let d(z) = -47690z2 + 498z. Let s(k) = 2k. What is d(s(a))? -190760a*2 + 996a Let u(j) = 12j2. Let t be (6/(-5))/(6/(-1785)). Let w(f) = t - 357 + f. Calculate u(w(b)). 12b*2 Let z(q) = -572q - 8 - 7 + 520q. Let d(h) = -25h - 9. Let s(k) = -5d(k) + 3z(k). Let y(o) be the second derivative of o*3/6 + o. What is s(y(u))? -31u Let l(i) = -i + 7. Let t(r) = 84172r2. Determine l(t(a)). -84172a*2 + 7 Let c(h) be the second derivative of 0 + 1/6h*3 - 2h + 0h2. Let q(s) = -10 + 9s*2 - 3 + 13. Give q(c(p)). 9p*2 Let a(f) = -2f. Let t(h) = 214h2 + 1937h. What is a(t(l))? -428l2 - 3874l Let f(c) = -5c2. Let a(r) = -6r*2. Let w(x) = -4a(x) + 5f(x). Let z(b) = -1489b - 2b2 + 3003b - 1515b. Give z(w(n)). -2n4 + n2 Let h(n) be the third derivative of n*5/60 - 2n*2. Let u(x) = -5x*2 + 213x. Let a(i) = -2i2 + 117i. Let l(c) = 5a(c) - 3u(c). Give l(h(s)). 5s4 - 54s*2 Let n(f) = -63f*2 + 23f*2 + 14f*2 + 13f*2. Let d(t) = -24t*2. Calculate n(d(w)). -7488w*4 Let n be 5/22/108. Let j(i) = 157i - 4 - 156i + n. Let f(h) = -68h*2. What is j(f(u))? -68u*2 Let u(b) = -75b - 81b + 325b - 86b - 76b. Let r(o) = 42o2 - 13. What is u(r(q))? 294q*2 - 91 Let x(i) = 7i*2 + 1721i - 1721i. Let l(d) = 25d*2 + 18d*2 - 46d*2 + 4. Give l(x(u)). -147u4 + 4 Let m(y) be the third derivative of -y5/60 + 22561y2. Let x(s) = -3s. Let r(q) = -6q + 4 - 4. Let a(w) = 6r(w) - 10x(w). Give a(m(g)). 6g*2 Let q(p) be the second derivative of -7078p*3/3 + 31p + 230. Let g(r) = -2r2. What is q(g(n))? 28312n*2 Let r(k) = -4k. Let c(x) = 2x. Let o(n) = -7c(n) - 4r(n). Suppose 18 = 2l + 5s, s = -0s + 2. Let g(d) = 2d - 10d + 5d + 8 + ld. What is g(o(t))? 2t + 8 Let a(z) = -2z + 15. Let b(h) = 8h2 + 23h*2 + 26 - 64 + 38. Calculate b(a(i)). 124i*2 - 1860i + 6975 Let i(h) = -593h - 175470 + 175470. Let k(g) = 6g. Give i(k(b)). -3558b Let m(o) = -o3 - 26o*2 - o - 8. Let r be m(-26). Let b(u) = 2u + 7 - r + 11. Let c(a) = -2a - 1. Calculate b(c(i)). -4i - 2 Let y(z) = -20z2 + 401z + 9. Let c(a) = a. What is y(c(b))? -20b2 + 401b + 9 Let k(p) be the first derivative of 3p2/2 - 297. Let z(y) be the second derivative of y4/12 + 28y*3/3 + 2y. What is z(k(a))? 9a2 + 168a Let f(t) be the first derivative of -7t2/2 - 2t - 67. Let b(s) = 4s + 1. Let w(x) = -2b(x) - f(x). Let z(q) = 8q2 + q. Calculate w(z(y)). -8y*2 - y Let s(y) = -y + 6124. Let f(q) = -11q*2 + 5q*2 - 13q*2 + 14q*2 + 3q*2. Calculate f(s(a)). -2a*2 + 24496a - 75006752 Let m(w) = -99w + 135w - 1 + 55w. Let d(x) = -28x. Calculate d(m(y)). -2548y + 28 Let j(x) = 5x. Suppose a - 3 = -m, 3m - 4a = 2m + 8. Suppose 0 = 2u, -mu = 6i - i - 15. Let c(l) = il + 6l - 6l. Give j(c(n)). 15n Let f(n) = -3n2. Let m(c) = 26c + 14. Let u(b) = -b - 3. Let y be u(11). Let p(q) = 8q + 5. Let z(k) = yp(k) + 5m(k). Calculate z(f(d)). -54d*2 Let f(b) = -879b. Let a(u) be the first derivative of -2u2 + 603. What is a(f(v))? 3516v Let u(c) = 255c - 6120. Let z be u(24). Let h(g) be the second derivative of 43g + 0g3 + 5/12g*4 + 0g*2 + z. Let k(w) = -5w*2. Give h(k(s)). 125s4 Let n(l) be the first derivative of l2/2 + 140. Let o(t) = -8t2 + 15t*2 + 0t*2 + 26t*2. Calculate n(o(k)). 33k*2 Let x(i) = -197i. Let s(m) = 98678m2. Calculate x(s(y)). -19439566y*2 Let i(k) = -k - 1. Let z(m) = -7m - 8. Let p(r) = 24i(r) - 3z(r). Let j(s) be the first derivative of 10s2 - 2686. What is j(p(h))? -60h Let q(u) = -4u. Let j(y) = 3y*2 + 164045y - 7. Determine q(j(f)). -12f2 - 656180f + 28 Let a(o) be the second derivative of -6o3 + 1018o. Let r(n) = 2n2 + 4. Give a(r(l)). -72l*2 - 144 Let b(f) = -4f*2 - 1 + 1. Let y(z) be the second derivative of -17z*4/12 + 20z + 151. What is b(y(j))? -1156j4 Let g(u) = -2180u*2. Let v(d) = -16722d. Give g(v(k)). -609583119120k2 Let l = -68 - -70. Let n(b) = 0b*l - 7b*2 - 8b*2 + 8b*2. Let u(j) = 9j*2. Determine u(n(r)). 441r*4 Let m(w) = -138w - 7. Let i(d) = 118d + 6. Let n(u) = 7i(u) + 6m(u). Let o(k) = 2561k*2. What is o(n(g))? 10244g*2 Let f(x) be the first derivative of 0x*2 + 28 + 2/3x*3 + 0x. Let u(s) = 179s2. What is u(f(h))? 716h*4 Let l(z) = -1744z2 + 872. Let t(c) = c2 - 1. Let s(k) = l(k) + 872t(k). Let b(m) = m. Calculate s(b(a)). -872a*2 Let r(q) be the first derivative of 2q*3/3 + 2. Let a(y) = -4y + 224 + 210 - 675 + 224 + 5y. What is r(a(v))? 2v*2 - 68v + 578 Let w(v) = -1788v. Let d(q) = 11q*2 - 1387q. Determine d(w(p)). 35166384p*2	{ "pile_set_name": "DM Mathematics" }
r. Let f(i) be the third derivative of 0i3 - 1/12i*g + 0i + 0 - 5i2. Let x(k) = -3k*2. Calculate f(x(l)). 6l*2 Let u(p) = 2p*2. Let d(l) = 2l*2 + 366. Determine d(u(j)). 8j*4 + 366 Let x(z) = -155z - 2. Let v(j) = -28j. Give x(v(w)). 4340w - 2 Let a(q) = q*2. Let j = 0 - -2. Let u(k) be the first derivative of 0k*j - 2/3k*3 + 0k - 2. What is u(a(b))? -2b4 Let d(m) = 3m. Let x(w) be the second derivative of 0w3 + 1/6w*4 - w + 0w*2 + 0. Give x(d(t)). 18t*2 Let g(a) = 4a + 196. Let p(y) = 4y. What is g(p(i))? 16i + 196 Let u(f) = -f*2. Let x(n) = 8n + 5. Calculate x(u(h)). -8h2 + 5 Let n(s) = 3s. Suppose 3g = 5 + 7. Suppose -gz = 2c - 5 - 7, -c = -3z + 14. Let t(h) = 6h2 + 4h - 4h2 - zh. Determine n(t(v)). 6v2 Let u(r) be the first derivative of 0r*2 - 2/3r*3 + 0r - 1. Let f(y) = 11y - 7. Let q(s) = -6s + 4. Let c(d) = -4f(d) - 7q(d). Calculate c(u(k)). 4k2 Let u(w) = -4w*2. Let y(j) be the second derivative of -5j*3/6 + j. Calculate u(y(p)). -100p*2 Let i(w) = -2w*2. Let m(p) = 3p*2 + 173. Calculate m(i(y)). 12y*4 + 173 Let s(n) = 4n*2 - 5n*2 + 3n*2. Let c(r) = -8r + 2. Let g(a) = 1. Let f(w) = -c(w) + 2g(w). Give s(f(b)). 128b*2 Let s(x) = 65x - 31. Let d(u) = -4u2. What is d(s(o))? -16900o*2 + 16120o - 3844 Suppose -28 = 4m + 12. Let k be (-12)/m20/6. Let d(z) = -kz + 5z + 0z. Let g(i) = -2i. What is d(g(p))? -2p Let k(m) = 1451m + 2. Let g(c) = -5c. Calculate g(k(y)). -7255y - 10 Let q(r) = 6r2. Let y(b) = b2. Calculate q(y(s)). 6s*4 Let s(w) be the first derivative of 2w*3 - 2. Let k(p) be the first derivative of 0p*2 + 1 + 1/3p*3 + 0p. What is k(s(m))? 36m4 Let p(z) = 306z2. Let b(m) = -m2. Give p(b(u)). 306u4 Let r(z) = 3z + 17. Let o(g) = g + 6. Let j(l) = -17o(l) + 6r(l). Let d(s) be the first derivative of 2/3s3 + 0s*2 + 1 + 0s. Determine j(d(h)). 2h2 Let p(c) be the second derivative of -c3/3 - 3c. Let n(w) = -2w. What is n(p(g))? 4g Let f(q) = 211q2. Let t(p) = -13p. Determine f(t(v)). 35659v2 Let o(s) = 20s*2 - 1. Let l(u) = -15u*2. Determine o(l(j)). 4500j*4 - 1 Let n(x) = -x. Let l(t) = -t. Let r(q) = -5q. Let c(w) = -9l(w) + 2r(w). What is n(c(u))? u Let t be -4 + 2 + -4 + 5. Let d(n) = n. Let k(b) = -5b. Let v(p) = tk(p) - 4d(p). Let u(w) = w. Calculate u(v(j)). j Let j(u) = -2u. Let v(c) = 3c2 - 4. Let g(m) = -7m*2 + 9. Let t(o) = 2g(o) + 5v(o). Let w(b) be the first derivative of t(b). What is w(j(q))? -4q Let w(a) = -a*2 - 3. Let p(f) = 4. Let r(g) = 3p(g) + 4w(g). Let m(b) = b. Calculate m(r(v)). -4v*2 Let i(m) be the second derivative of -5m*4/12 - m. Let p(c) = -c + c + 2c. What is i(p(z))? -20z2 Let u(x) be the second derivative of x3/6 + 5x. Let r(f) = 35f - 4f*2 - 35f. Calculate u(r(b)). -4b2 Let o(s) = -s2. Let f be 29/5 - 1/(-5). Let p(i) be the first derivative of -i3 + fi - 6i - 4. Give o(p(n)). -9n*4 Let v(b) = 3b. Let f(a) = 10a2 - 16a. Give v(f(w)). 30w2 - 48w Let f(t) = 30t2 - 35t + 70. Let l(h) = h*2 - h + 2. Let u(r) = 2f(r) - 70l(r). Let y(i) = -i. Calculate y(u(o)). 10o*2 Let u be 6 + 2 + -1 + -2. Let c(v) = -uv + 4v + 2v. Let x(w) = 2w2 + 0w*2 - 3w2. Determine c(x(n)). -n2 Let d(u) = 456u2. Let q(a) = a2. Determine q(d(f)). 207936f*4 Let i(a) = 42a*2 + 3. Let v(q) = -2q. Give i(v(d)). 168d2 + 3 Let o(x) = -15x*2 + 5. Let v(b) = 23b*2 - 8. Let r(w) = 8o(w) + 5v(w). Let l(p) = -2p*2. Calculate l(r(c)). -50c*4 Let p(g) = 12g*2 + 7g. Let i(j) = 4j2 + 2j. Let l(d) = 7i(d) - 2p(d). Let q(z) = z*2. Determine l(q(a)). 4a*4 Let g(h) = 3h - 13h + 8h + 4h. Let n(i) = 9i. Give g(n(u)). 18u Let u(r) = 7r + 2. Let k(v) = 2v2. Give k(u(t)). 98t*2 + 56t + 8 Let i(z) = 3z. Let j(p) = 10p. Let g(o) = 10o. Let t(k) = -2k. Let f(d) = -2g(d) - 11t(d). Let l(u) = -28f(u) + 6j(u). Calculate i(l(m)). 12m Let u(m) = m - 1. Let a(g) = -5g + 9. Let x(r) = -a(r) - 6u(r). Let s be x(-5). Let d(q) = 2q*2 - 4q*s + 4q*2. Let c(v) = -2v. Give c(d(t)). -4t2 Let l(s) = -s. Let b(f) = -5f3 - f2 + f + 1. Let x be b(-1). Suppose -xw = -9w + 20. Let t(v) = wv2 - 3 + 1 + 2. Determine l(t(r)). -4r2 Let c(j) be the first derivative of j2 - 6j - 1. Let q be c(5). Let a(i) = -i2 - i2 + qi*2. Let o(r) = 3r. Determine o(a(z)). 6z2 Let v(b) = 869b. Let a(t) = -t. Determine a(v(h)). -869h Let k(z) = 6 - 5z + 3z2 + 0z + 0z - 11. Let c(h) = h2 - 2h - 2. Let d(f) = 5c(f) - 2k(f). Let n(o) = -o. Calculate d(n(q)). -q*2 Let m(r) = -2r*2. Let i(j) = 4 - 10j - 2j - 4. Determine i(m(x)). 24x*2 Let f(l) = 51l*2 - 1. Let h(p) = p. Determine h(f(o)). 51o*2 - 1 Let m(f) = -f - f - 2f + 2f. Let k(a) = 7a. Let o(n) = 52n + 40n + 28n. Let s(l) = 35k(l) - 2o(l). What is s(m(x))? -10x Let p(q) = 3q. Let n(d) = 3d*2 - 8d + 4. Let x be n(4). Let v = 0 + 3. Let f(z) = -xz + 20z - vz2. Give f(p(s)). -27s*2 Let g be -2 - (-6 + 0)/3. Suppose -3n = -gn - 6. Let s(l) = -l + nl - l - 2l2. Let a(o) = -3o*2. Give a(s(t)). -12t*4 Let c(m) = -120m*2. Let s(o) = -3o. What is c(s(l))? -1080l2 Let i(q) = -2q*2 + 8q*2 - 3q*2. Let h(a) = 2a*2. Let o(r) = -5r*2. Let z(c) = -8h(c) - 3o(c). What is i(z(t))? 3t4 Let y(f) = -f2. Suppose 0 = -n + d + 2 - 0, 0 = 4d. Let b(p) = -4p*2 + 3p2 - pn. What is y(b(o))? -4o4 Let w(u) = -2u + 3u + u. Let s(v) = -715v - 2v2 + 715v. Determine w(s(o)). -4o2 Let o(j) be the second derivative of -5j*3/6 - 57j. Let s(a) be the first derivative of 2a3/3 - 2. Calculate o(s(z)). -10z2 Let x(m) be the second derivative of m3/6 + 11m. Let o(z) = z2. What is x(o(w))? w2 Let o(f) = -2f*2. Suppose 0 = -5r + 4 + 6. Let a(d) = -5dr + d2 + 13d*2. What is o(a(i))? -162i4 Let b(s) be the first derivative of s5/60 + s*3 - 2. Let f(u) be the third derivative of b(u). Let g(r) = 3r. Calculate g(f(a)). 6a Let r(w) = 7w*2. Let h(m) = 4m*2 + 4m - 4m - 2m*2. Calculate h(r(q)). 98q*4 Let b(j) = -7j*2. Let v(o) = -39o. Give b(v(i)). -10647i2 Let o(d) = 7203d. Let i(p) = -p. Give i(o(a)). -7203a Let q(z) = -2z*2. Let w(c) = -25c + 1. Give w(q(r)). 50r2 + 1 Let z be 0 + 1 + 2/2. Let s(a) = 2a. Let g(w) = -18w + 28w - 6w. Let b(v) = zg(v) - 5s(v). Let h(c) = c2. Determine h(b(q)). 4q2 Let z(x) = -x3 - 5x2 - 5x - 2. Let h be z(-4). Let p(u) = -8u - hu*2 + 8u. Let j(q) = 14q2. What is j(p(n))? 56n4 Let w(l) be the second derivative of -l3/6 + l + 19. Let n(s) = s2. Calculate w(n(y)). -y2 Let k(g) = -4g2. Let l(m) = m2 + 1. Let y(h) be the first derivative of 7h*3/3 + 6h + 2. Let i(v) = 6l(v) - y(v). Determine i(k(f)). -16f*4 Let q(z) = z + 1. Let a(x) = 5x + 6. Suppose -2 = 2c + 10. Let m(n) = cq(n) + a(n). Let o(l) be the second derivative of -l*3/3 + 4l. Calculate o(m(f)). 2f Suppose -2n = -0n - 6. Let k(z) = -z - 3z + nz. Let t(g) = -g + 3g + 0g. Calculate k(t(u)). -2u Let y(s) = s*2 + 0s + s - s. Let t(n) be the third derivative of 1/12n4 + 0n*3 + 0n + 0 + 2n2. Determine t(y(v)). 2v2 Let a(r) be the second derivative of r4/12 + 7r + 4. Let k(n) = -20n. Determine a(k(q)). 400q2 Let i = -85 - -87. Let z(l) be the second derivative of 0 - 1/6l*3 + 0l*i - 3l. Let s(u) = 3u2. Calculate z(s(k)). -3k2 Let x(y) be the third derivative of -y5/40 - 2y3/3 - 3y*2. Let o(a) be the first derivative of x(a). Let j(p) = 5p*2. Calculate j(o(q)). 45q*2 Let m(w) be the second derivative of 11w*5/120 - 5w*3/6 + 7w. Let c(f) be the second derivative of m(f). Let j(v) = 2v2. Determine c(j(i)). 22i*2 Suppose 12 = 2l + i, l + 2i = -i + 16. Let b(h) = -2h*2 - 4h + lh. Let x(n) = 3n. What is b(x(z))? -18z2 Let o(p) = 26p - 17. Let z(j) = 2j + 0 + 7j - 6. Let l(g) = 6o(g) - 17z(g). Let m(q) = -5q. What is m(l(v))? -15v Let w(x) be the second derivative of -x*3/2 - 16x. Let g(z) = 2z. Calculate w(g(s)). -6s Let n(k) = 3k2 + 0k*2 - 6k2. Let i(m) be the second derivative of -m3/3 - m	{ "pile_set_name": "DM Mathematics" }
5. Suppose u + t = -0. What is the smallest value in u, 1, 3? u Let w = 12.2 + -12. What is the second biggest value in 3, w, -11? w Let j = 6 - 6.02. Let q = 0.48 - j. Which is the third biggest value? (a) q (b) -0.3 (c) 5 b Let q be 6/10 + (-1 - 0). What is the smallest value in q, -1, -1/2, 0.02? -1 Let o be 4/(-6) - (-35)/30. Let z = 27957/17 - 1645. Let r = z + -10/51. Which is the second biggest value? (a) 4 (b) o (c) r b Let p be -1 - ((-21)/6 - -3). Let j = -0.02 + -4.98. Which is the third biggest value? (a) 3/4 (b) j (c) p b Let k = -3.9 + 2.8. Let v = 0.1 + k. What is the third biggest value in v, 0, 3? v Let y = 288/407 - 6/37. What is the smallest value in 2, 2/5, y? 2/5 Let h = 16/7 - 11/14. Let z = -0.58 + 0.38. What is the biggest value in z, 1/6, h? h Let u be 10/((1 + -2)/5). Let l be ((-8)/u)/(6/(-5)). Let w be -5 - (-5 + (-1)/4). Which is the third biggest value? (a) l (b) 4 (c) w a Let c be (-1)/1 - (1 + -1). Let i be (8/64)/(c/(-2)). What is the second smallest value in 0.3, 5, i? 0.3 Let a be 1/64 + (-2)/4. Let f = 3.94 + 0.06. What is the third biggest value in a, -3/4, f? -3/4 Let d = 90 - 627/7. Let r = -1 - 0. Which is the biggest value? (a) r (b) -5 (c) d c Let b = 1106/5 + -222. What is the third biggest value in 0.3, -5, -3, b? -3 Let l = -0.43 + 0.03. Let n be -1 - ((-30)/100)/((-6)/(-28)). Let u = 15 + -8. Which is the smallest value? (a) n (b) l (c) u b Let z be (-5)/(-6) + (-4)/(-6). Let b = 92/5 - 18. What is the third biggest value in -3/2, z, b? -3/2 Let f = 0.05 - 0.45. Let d = 0.4 - 0.2. Let m = 1 + -1.1. What is the smallest value in d, f, m? f Let n be 3 + 6/(3 - 4) + -5. Which is the third biggest value? (a) n (b) -1/5 (c) 1 a Suppose -j + 5 = -0. Let h = 10 + -12. Let y = 0.45 - 0.05. What is the third biggest value in j, y, h? h Let d = -0.257 + -0.043. What is the smallest value in -2, -6, d? -6 Let j = 63 - 66. What is the smallest value in j, -5, 4/3? -5 Let z = 20 - 21. Which is the smallest value? (a) z (b) -2/9 (c) -3 (d) 2 c Let b = 29 + -88/3. Let p = 9 + -5. What is the third biggest value in -3, p, b? -3 Let d be (-5)/(-3)(1 - -2). Let k = -15 - -7. Let w = 7.7 + k. What is the smallest value in d, -2/7, w? w Suppose -3u - 4y - 6 - 6 = 0, 5u + y = -3. Let l = 0.2 - 1.2. Let v = 1 - l. Which is the biggest value? (a) u (b) v (c) 0.1 b Let s(h) = -h + 13. Let y be s(10). Let q be (-2)/3 + 42/9. Let f be y + -3 + q/14. What is the third smallest value in 2, f, 1? 2 Let g = 0.1 - 0.1. Suppose -2c = 3q - 5 - 12, -3q = -5c + 11. What is the smallest value in 2/5, q, g? g Let j = -243.01 - -245. Let v = j + 0.01. Which is the smallest value? (a) v (b) -0.2 (c) -0.1 b Let q(i) = 29i*2. Let m be q(-1). Suppose 0 = -x + 4x - 5g + m, 8 = 2g. Let v be (x/33)/(1/(-2)). What is the third biggest value in 5, v, 2/3? v Let d = 0.1 - -2.9. Let p be -21/48. Let j = 2 + 0. Which is the third smallest value? (a) p (b) j (c) d c Let c be (-16)/40(0 - 5). Suppose 5 = -3y - 5k, 6 = -2y - 0k - ck. Let f = 0.8 + -1. What is the third biggest value in y, 0.1, f? y Let w(d) = d*3 + 3d*2 - 10d - 10. Let o be w(-5). Which is the biggest value? (a) o (b) 0.3 (c) -2/17 b Let a = 1.06 - 1. What is the biggest value in -4, a, 0.1? 0.1 Let d = 0.03 + -1.03. Let u = -0.3 + 0.4. Which is the smallest value? (a) u (b) d (c) 1/5 b Let n be (-8)/(-5) + 12/(-6). What is the second smallest value in n, -0.3, 3/5? -0.3 Let z = 6.2 + -10.2. Let h = -7 + 2. What is the third smallest value in h, z, 0.4? 0.4 Let s = 11 + -18. Let i = 6.2 + s. Let r = -1 - i. What is the second biggest value in 2, -3, r? r Suppose 0v = 5v + 15. Let d(r) = -4r - 1. Let j be d(0). What is the third biggest value in j, 2, v? v Let u = -3 - -6. Let z be 3/(-6)8/14. What is the second biggest value in u, z, 0.5? 0.5 Let q = 0 + 2. Which is the biggest value? (a) -2/7 (b) 0 (c) -7 (d) q d Let q = 4 + -4. Let u be 0 + q + -2 + 3. What is the third smallest value in u, 3, 0.4? 3 Let t(f) = f + 3. Let m be t(-4). Let r(i) = 2i2 + i. Let w be r(m). What is the smallest value in 4, w, -4? -4 Let v = 26 + -25. Let w be 8/45 - 2/(-9). What is the third smallest value in 2, w, v? 2 Let j = -6/5 + 27/10. Let s = 14 - 14.5. Which is the second biggest value? (a) 1 (b) s (c) j a Let i be (-8)/(-2) - (-42)/(-28). Which is the third biggest value? (a) -4 (b) i (c) 5 a Let h = 2 - 2. Let t = -214/3 - -72. Let i = 11/6 + -4/3. Which is the biggest value? (a) i (b) h (c) t c Let u = 29 - 25.3. Let o = -5.7 - -5. Let y = o + u. What is the second smallest value in 1, -1, y? 1 Let b = 40 + -43. Let a = 1 + 3. Suppose 0 = -am + 2h + 6, -9 = -m + 4h + 10. What is the biggest value in b, m, -0.5? -0.5 Let o be (-956)/(-24) + 2/3. Let x = o + -43. Let q = 0 + -5. Which is the second biggest value? (a) q (b) x (c) 2 b Let z = -34/3 + 11. Let n = -106814275/308 - -346799. Let v = -1/44 - n. Which is the smallest value? (a) -2 (b) z (c) v a Let d be 18/117 - (-417)/78. What is the third biggest value in 0.1, -0.1, d? -0.1 Let s(k) be the second derivative of k*5/20 + 5k4/12 + k3 + 2k2 - 4k. Let v be s(-4). What is the second smallest value in v, -4/3, -3? -3 Let i = -0.041 - -0.541. What is the second smallest value in -3/5, i, 2, 0.4? 0.4 Let i = 17 - 12. Suppose -2 = is - 7. Let n = -11/8 - -41/24. What is the third smallest value in s, 5, n? 5 Let q = -80.4 + 80. Let w = -0.82 + 1.1. Let p = w - 0.3. What is the biggest value in 1, p, q? 1 Let z be 34/(-56) + (-13)/91. Let y be (-2)/(-3) + (-1 - 0). What is the third biggest value in -2, z, y? -2 Let w be 6/24(0 + -6). What is the second biggest value in 2, 26, 5, w? 5 Let g be (-107)/(-7) + (-2)/7. Suppose 3p - 17 = z, -5z - 4p = p - g. Let h = -388/3 - -128. What is the third biggest value in z, h, 0? z Let t = -0.32 - -0.72. Which is the smallest value? (a) -3/5 (b) 2 (c) 5 (d) t a Suppose -8k + 2k = 30. Which is the biggest value? (a) 0.1 (b) 3/5 (c) k (d) -4 b Let z = -6 + 9. Suppose -5i = z + 2. Let r be (-2)/i + (-14)/4. What is the biggest value in -3, -0.2, r? -0.2 Let h be (-5 - 155/(-30))(-1 + 0). Suppose 4k = 7 + 1. Which is the smallest value? (a) k (b) h (c) -0.4 c Let h = 0.2 - -1.8. Let w = 47/2 + -16. Let k = 7 - w. What is the second biggest value in h, 1, k? 1 Suppose 3p - 12 = 0, n - 2p + 19 = 3p. Let o = 14.6 + -15. What is the third biggest value in n, -0.3, o? o Let c = 11.4 - 8.4. What is the biggest value in 4, c, 5, 0.03? 5 Let x be 0 + -2 - (-1 - 3). Let n be (-27)/12x/6. Let y = -0.1 - 0.1. What is the second smallest value in -0.3, y, n? -0.3 Let t = 81 + -57. Let j = t + -27. What is the smallest value in 0.01, j, 1/9? j Let r = 6.5 + -1.5. Which is the second biggest value? (a) 3 (b) r (c) -3 a Let k = 5 + -5.6. Let w = -0.9 - k. Let l = -2/305 + -592/2745. What is the third smallest value in -5, l, w? l Suppose 0 = -2u - 0u + 64. Let t be ((-4)/u)/((-2)/(-12)). Which is the second biggest value? (a) -1 (b) t (c) -0.4 b Let p = -0.1 - -0.1. Let w = -4.5 - -4. Let f = -0.31 - -0.01. What is the biggest value in w, f, p? p Suppose 0 = -4z + s + 65 + 94, z - 45 = -5s. Let n be 32/36*(-6)/z. Which is the biggest value? (a) -2 (b) n (c) 1 c Let k be -2 - 0 - -3 - -2. Which is the second biggest value? (a) k (b) 1/2 (c) 0.7 c Let u = -16.9 - -17. What is the biggest value in u, -1, -0.02? u Let q = -1.6 - -8.6. Let y = -14 - -8. Let a = q + y. What is the third smallest value in -2, 0.4, a? a Let b(d) = d + 9. Let k be (-6)/(1 - 3) - 16. Let q be b(k). Let n = 4 + -5. What is the second biggest value in n, q, 1/5? n Let r = 3 + -15. Let y = r - -11.7. Let v = 4.99 + 0.01. What is the biggest value in -3, y, v? v Let b = -0.07 + 0.09. Let m = b - -0.08. What is the second smallest value in -1, -0.1, m? -0.1 Let k = 0.1 - 0.16. Let l = -3.06 - k. Which is the second biggest value? (a) -1/4 (b) l (c) 1 a Let l = 1 - -9. Let p = l - 14. Which is the smallest value? (a) -1 (b) p (c) 0.3 b Let v = 3 - -2. What is the second biggest value in v, 1/2, -3? 1/2 Let v = -6380193 - -172228159/27. Let l = -1373 - v. Let w = l + 1/27. Which is the third biggest valu	{ "pile_set_name": "DM Mathematics" }
he nearest integer? 332 What is 19787 to the power of 1/3, to the nearest integer? 27 What is 728 to the power of 1/6, to the nearest integer? 3 What is the fourth root of 11048 to the nearest integer? 10 What is the third root of 1747 to the nearest integer? 12 What is 12093 to the power of 1/2, to the nearest integer? 110 What is 17069 to the power of 1/2, to the nearest integer? 131 What is 11789 to the power of 1/2, to the nearest integer? 109 What is the fourth root of 588 to the nearest integer? 5 What is 56439 to the power of 1/2, to the nearest integer? 238 What is 11859 to the power of 1/5, to the nearest integer? 7 What is 2244 to the power of 1/8, to the nearest integer? 3 What is 1912 to the power of 1/7, to the nearest integer? 3 What is the third root of 8140 to the nearest integer? 20 What is the fourth root of 6737 to the nearest integer? 9 What is the square root of 535 to the nearest integer? 23 What is 4244 to the power of 1/5, to the nearest integer? 5 What is the third root of 4398 to the nearest integer? 16 What is 3953 to the power of 1/2, to the nearest integer? 63 What is 3896 to the power of 1/2, to the nearest integer? 62 What is the square root of 29 to the nearest integer? 5 What is 37921 to the power of 1/6, to the nearest integer? 6 What is 76404 to the power of 1/2, to the nearest integer? 276 What is the square root of 5284 to the nearest integer? 73 What is 384 to the power of 1/2, to the nearest integer? 20 What is 1996 to the power of 1/2, to the nearest integer? 45 What is the third root of 23272 to the nearest integer? 29 What is 1883 to the power of 1/3, to the nearest integer? 12 What is the square root of 10062 to the nearest integer? 100 What is 661 to the power of 1/2, to the nearest integer? 26 What is the cube root of 2215 to the nearest integer? 13 What is 43 to the power of 1/9, to the nearest integer? 2 What is the third root of 9640 to the nearest integer? 21 What is 731 to the power of 1/2, to the nearest integer? 27 What is the square root of 1155 to the nearest integer? 34 What is 2776 to the power of 1/9, to the nearest integer? 2 What is 1667 to the power of 1/3, to the nearest integer? 12 What is 5409 to the power of 1/9, to the nearest integer? 3 What is the fifth root of 843 to the nearest integer? 4 What is 12836 to the power of 1/8, to the nearest integer? 3 What is the third root of 10529 to the nearest integer? 22 What is the square root of 3739 to the nearest integer? 61 What is 94591 to the power of 1/6, to the nearest integer? 7 What is the fourth root of 5310 to the nearest integer? 9 What is the third root of 1224 to the nearest integer? 11 What is the cube root of 1768 to the nearest integer? 12 What is 22786 to the power of 1/3, to the nearest integer? 28 What is the cube root of 9507 to the nearest integer? 21 What is the cube root of 69101 to the nearest integer? 41 What is the cube root of 2546 to the nearest integer? 14 What is the cube root of 955 to the nearest integer? 10 What is the seventh root of 26660 to the nearest integer? 4 What is the third root of 2032 to the nearest integer? 13 What is the third root of 1425 to the nearest integer? 11 What is 28124 to the power of 1/2, to the nearest integer? 168 What is 5172 to the power of 1/3, to the nearest integer? 17 What is 12728 to the power of 1/2, to the nearest integer? 113 What is 242 to the power of 1/3, to the nearest integer? 6 What is the square root of 23279 to the nearest integer? 153 What is 421 to the power of 1/7, to the nearest integer? 2 What is the square root of 41888 to the nearest integer? 205 What is 3801 to the power of 1/10, to the nearest integer? 2 What is 35283 to the power of 1/2, to the nearest integer? 188 What is 2056 to the power of 1/4, to the nearest integer? 7 What is the seventh root of 4542 to the nearest integer? 3 What is the fifth root of 1102 to the nearest integer? 4 What is the cube root of 8654 to the nearest integer? 21 What is 1192 to the power of 1/3, to the nearest integer? 11 What is the square root of 7059 to the nearest integer? 84 What is 25508 to the power of 1/2, to the nearest integer? 160 What is the fifth root of 103 to the nearest integer? 3 What is 21210 to the power of 1/5, to the nearest integer? 7 What is 850 to the power of 1/2, to the nearest integer? 29 What is 484 to the power of 1/3, to the nearest integer? 8 What is 1252 to the power of 1/2, to the nearest integer? 35 What is 2556 to the power of 1/3, to the nearest integer? 14 What is 11912 to the power of 1/3, to the nearest integer? 23 What is 30826 to the power of 1/3, to the nearest integer? 31 What is 2234 to the power of 1/10, to the nearest integer? 2 What is the square root of 781 to the nearest integer? 28 What is the third root of 24203 to the nearest integer? 29 What is 192830 to the power of 1/2, to the nearest integer? 439 What is 19860 to the power of 1/3, to the nearest integer? 27 What is the cube root of 30929 to the nearest integer? 31 What is 201 to the power of 1/3, to the nearest integer? 6 What is the third root of 2248 to the nearest integer? 13 What is the cube root of 4304 to the nearest integer? 16 What is 26521 to the power of 1/2, to the nearest integer? 163 What is the third root of 44745 to the nearest integer? 36 What is 2097 to the power of 1/6, to the nearest integer? 4 What is the third root of 1728 to the nearest integer? 12 What is 101374 to the power of 1/5, to the nearest integer? 10 What is 1096 to the power of 1/2, to the nearest integer? 33 What is 3828 to the power of 1/3, to the nearest integer? 16 What is the fourth root of 33359 to the nearest integer? 14 What is the square root of 97294 to the nearest integer? 312 What is the square root of 60311 to the nearest integer? 246 What is the square root of 37699 to the nearest integer? 194 What is 162142 to the power of 1/2, to the nearest integer? 403 What is 18350 to the power of 1/7, to the nearest integer? 4 What is the third root of 386 to the nearest integer? 7 What is the sixth root of 1816 to the nearest integer? 3 What is the third root of 1157 to the nearest integer? 10 What is the square root of 266 to the nearest integer? 16 What is 2639 to the power of 1/7, to the nearest integer? 3 What is the third root of 21696 to the nearest integer? 28 What is 38 to the power of 1/3, to the nearest integer? 3 What is 244 to the power of 1/2, to the nearest integer? 16 What is 8384 to the power of 1/8, to the nearest integer? 3 What is 22922 to the power of 1/7, to the nearest integer? 4 What is the third root of 252 to the nearest integer? 6 What is the cube root of 10294 to the nearest integer? 22 What is 362 to the power of 1/2, to the nearest integer? 19 What is the square root of 3823 to the nearest integer? 62 What is 1649 to the power of 1/2, to the nearest integer? 41 What is the sixth root of 2369 to the nearest integer? 4 What is 103829 to the power of 1/3, to the nearest integer? 47 What is the eighth root of 24730 to the nearest integer? 4 What is the square root of 131114 to the nearest integer? 362 What is the square root of 1286 to the nearest integer? 36 What is the cube root of 100237 to the nearest integer? 46 What is 5421 to the power of 1/2, to the nearest integer? 74 What is the third root of 210 to the nearest integer? 6 What is 4501 to the power of 1/3, to the nearest integer? 17 What is the cube root of 41882 to the nearest integer? 35 What is 18843 to the power of 1/10, to the nearest integer? 3 What is the fifth root of 21737 to the nearest integer? 7 What is the third root of 6305 to the nearest integer? 18 What is 7211 to the power of 1/3, to the nearest integer? 19 What is the sixth root of 5127 to the nearest integer? 4 What is 19415 to the power of 1/2, to the nearest integer? 139 What is the third root of 890 to the nearest integer? 10 What is the cube root of 26137 to the nearest integer? 30 What is the tenth root of 2613 to the nearest integer? 2 What is the cube root of 983 to the nearest integer? 10 What is the cube root of 4016 to the nearest integer? 16 What is 32123 to the power of 1/3, to the nearest integer? 32 What is 5162 to the power of 1/9, to the nearest integer?	{ "pile_set_name": "DM Mathematics" }
49275121q/3 = 0. Calculate q. -49275121, 0 Suppose 506b*3/15 + 48b*2/5 - 24b/5 = 0. What is b? -6/11, 0, 6/23 Find l, given that l*3/7 - 492l*2/7 - 29929l/7 - 85332/7 = 0. -52, -3, 547 Factor -y*3 + 6778878y*2 + 13557759y + 6778880. -(y - 6778880)(y + 1)2 Determine x, given that 3x*2 + 57558x + 183702744 = 0. -15142, -4044 Let -259q4/3 - 107q*3/6 + 4447q*2/6 + 53q = 0. Calculate q. -3, -1/14, 0, 106/37 Find h such that 134h4/13 - 592828h*3/13 - 1186058h*2/13 - 593096h/13 = 0. -1, 0, 296548/67 Suppose z*2/8 - 183029z/8 - 91515/4 = 0. What is z? -1, 183030 Let h*3/8 + 9017h*2/8 + 430559h/8 + 421543/8 = 0. Calculate h. -8969, -47, -1 Let 2d3/17 - 155082d*2/17 + 155076d/17 + 310160/17 = 0. Calculate d. -1, 2, 77540 Find o such that -5o3 - 25030o*2 - 2764545o = 0. -4893, -113, 0 Factor -5y3 - 72150y*2 + 216495y. -5y(y - 3)(y + 14433) Factor 4u*2 + 223468u + 28983240. 4(u + 130)(u + 55737) Factor 2c2/5 - 12010142c/5 + 2402028. 2(c - 6005070)(c - 1)/5 Determine z so that -z*3/2 + 42619z*2/2 - 2232037z + 2210728 = 0. 1, 104, 42514 Solve -4k4 + 45368k*3 - 317408k*2 + 317320k + 680100 = 0. -1, 3, 5, 11335 Find q, given that -7q2 - 421850326q - 120528664 = 0. -60264332, -2/7 Determine l, given that 5l5 - 505l*4 + 5570l*3 + 506990l*2 - 6060775l - 6561685 = 0. -29, -1, 13, 59 Suppose -3g5/4 + 92331g*4/8 - 507699g*3/8 + 115377g*2 - 138447g/2 = 0. Calculate g. 0, 3/2, 2, 15383 Find b such that -b*3/5 + 861b*2/10 - 24337b/10 - 2520 = 0. -1, 63/2, 400 Determine r so that -61215005r4 - 3856615295r*3 + 3913351560r*2 + 4477460r + 1280 = 0. -64, -2/3499, 1 Find i such that -2i4 - 3124i*3 - 64674i*2 + 74056i + 135608 = 0. -1541, -22, -1, 2 Factor -3z2 - 2390139z - 2390136. -3(z + 1)(z + 796712) Factor -3a2 + 2403a - 481182. -3(a - 403)(a - 398) Factor 2o2/9 - 90704o/9 - 60472/3. 2(o - 45354)(o + 2)/9 What is q in 3q2 - 8592q - 286803 = 0? -33, 2897 Let 5f3 - 22098000f*2 + 24416080200000f = 0. Calculate f. 0, 2209800 Factor s*3/5 - 31504s*2/5 + 248440244s/5 - 991242256. (s - 15742)*2(s - 20)/5 Determine v so that 8v5 - 10429v*4 + 504522v*3 - 3856112v*2 + 6240334v - 2878323 = 0. 1, 7, 41, 10029/8 Let -119a3/8 + 4489a*2/8 - 1591a/4 = 0. Calculate a. 0, 86/119, 37 Determine v, given that 27v5 + 2311800v*4 + 102177939v*3 - 187671858v*2 + 59562564v + 23619528 = 0. -85578, -46, -2/9, 1 Let -2p5 - 20178p*4 - 50681412p*3 + 1073408652p*2 + 456132870p - 9659043450 = 0. Calculate p. -5055, -3, 3, 21 Suppose 3z3/5 + 1688094z*2/5 + 1350468z + 6752328/5 = 0. What is z? -562694, -2 Suppose -2v2 - 537302v + 67194000 = 0. Calculate v. -268776, 125 Solve -2v2 + 7448v - 4058886 = 0. 663, 3061 Solve -98p4 + 38881556p*3/3 - 15429096p*2 + 6083460p - 793494 = 0. 1/3, 3/7, 132249 Find t such that 2t2 + 39489922t + 39489920 = 0. -19744960, -1 Solve -f*4/4 + 71f*3/2 - 6159f*2/4 + 38709f/2 = 0. 0, 22, 51, 69 Suppose -5o2 + 1009460o - 110980100 = 0. What is o? 110, 201782 Factor 2i2 + 3113504i + 6227000. 2(i + 2)(i + 1556750) Suppose 20j5 + 17565j*4 + 261770j*3 - 1247415j*2 - 327940j = 0. Calculate j. -863, -19, -1/4, 0, 4 Suppose -108o4 + 2212o*3 + 41120o*2 - 843200o = 0. Calculate o. -527/27, 0, 20 Factor 3x3/7 + 18687x*2/7 - 63128775x/7 + 43899046341/7. 3(x - 1289)2(x + 8807)/7 Find z, given that -2z2 - 2964750z - 23717872 = 0. -1482367, -8 Factor -3b3 - 492330b*2 - 20179361475b + 1617501366000. -3(b - 80)(b + 82095)*2 Let 3h*3/2 + 272679h*2 + 1636035h/2 - 1090698 = 0. Calculate h. -181783, -4, 1 Find h such that -4h3 + 148564h*2 - 529510556h + 497326685900 = 0. 1933, 33275 Suppose 4g4 - 21568g*3 - 108308g*2 + 1985712g + 2072448 = 0. Calculate g. -12, -1, 8, 5397 Factor -2a2/7 - 5081412a - 22593154424526. -2(a + 8892471)2/7 Factor x2/3 + 200755x/3 - 803036/3. (x - 4)(x + 200759)/3 Suppose -2d*3/3 - 3122d*2/3 + 3136d/3 + 6248 = 0. What is d? -1562, -2, 3 Factor -3q2/2 - 34281q/2 + 3683427. -3(q - 211)(q + 11638)/2 Solve o*4 + 1263o*3 - 46440o*2 - 337997200o = 0 for o. -860, 0, 457 Let -2r4/15 - 214r*3/15 + 9506r*2/3 + 31898r/5 + 15984/5 = 0. What is r? -216, -1, 111 Solve 143304841o5 + 16050166134o*4 + 540691846598o*3 + 4817139258652o*2 + 804790161o + 33614 = 0 for o. -49, -14, -1/11971 Let -j*4/2 - 12581j*3/2 + 201537j*2/2 - 188955j/2 = 0. What is j? -12597, 0, 1, 15 Determine l, given that -l*5/6 - 89l*4/6 - 209l*3/2 + 13229l*2/6 + 13994l/3 + 2370 = 0. -79, -18, -1, 10 Find q, given that 4q3 + 2268q*2 + 75456q - 535248 = 0. -531, -42, 6 Determine j so that j*3/7 - 239299j*2/7 - 5265062j/7 = 0. -22, 0, 239321 Factor j*2 + 6294j + 4497984. (j + 822)(j + 5472) Factor -2r*2/5 + 4208256r/5 - 2213677320192/5. -2(r - 1052064)2/5 Determine h so that h4/3 - 21649h*3/3 - 108316h*2 - 259996h/3 + 606592/3 = 0. -14, -2, 1, 21664 What is k in -2k3/7 + 5734k*2/7 + 1348908k/7 - 13309920 = 0? -270, 56, 3081 Determine m, given that 4m3 - 223372m*2 + 102998720m - 11922877184 = 0. 232, 55379 Factor m*3 - 822592m*2 + 822585m + 4935546. (m - 822591)(m - 3)(m + 2) Suppose -2i5/3 - 31798i*4/3 + 106038i*3 - 349974i*2 + 381816i = 0. Calculate i. -15909, 0, 3, 4 Determine a so that -6a4/7 - 14088a*3/7 + 1301898a*2/7 + 1315980a/7 = 0. -2437, -1, 0, 90 Suppose -5y4 - 36074760y*3 - 65069379378110y*2 + 130138866980520y - 65069451527645 = 0. What is y? -3607477, 1 Let 2k3/9 - 1882k*2/9 - 4759858k/9 + 529082 = 0. What is k? -1143, 1, 2083 Factor -v*2/4 + 85255v/4 + 2516763/2. -(v - 85314)(v + 59)/4 Factor -l2/7 - 143334l/7 + 31006800/7. -(l - 216)(l + 143550)/7 Factor 3j*3 - 14184j*2 + 84516j + 2266560. 3(j - 4722)(j - 16)(j + 10) Factor -2k*2/3 - 290642k/3 - 290636. -2(k + 3)(k + 145318)/3 Determine x, given that x*5/4 - 14x*4 - 23747x*3/4 + 207309x*2/2 - 97704x = 0. -138, 0, 1, 16, 177 Find s such that -55s5 + 237760s*4 - 7784040s*3 + 82173910s*2 - 271593985s - 25375350 = 0. -1/11, 7, 13, 4290 Determine r so that r*2/2 - 3121r/4 - 71235/4 = 0. -45/2, 1583 Let 2g3 + 17052g*2 - 27908922g - 27925972 = 0. Calculate g. -9931, -1, 1406 Factor -2923196n2/9 + 2923198n/9 - 2/9. -2(n - 1)(1461598n - 1)/9 What is c in c5/7 + 72664c*4/7 + 1452931c*3/7 + 3704340c*2/7 - 36612144c/7 + 31382208/7 = 0? -72644, -12, 1, 3 Solve -2m2/9 + 68276m/9 - 1974958/3 = 0. 87, 34051 Find g, given that -g*3/5 + 4222g*2/5 - 4452096g/5 - 8921088/5 = 0. -2, 2112 Suppose 5v2 + 491035v - 2455300 = 0. What is v? -98212, 5 Suppose -7p5/6 - 58p*4 + 78538p*3 + 27516952p*2/3 - 21330176p + 5343744 = 0. What is p? -168, 2/7, 2, 284 Solve 45t2 - 2121t - 11388 = 0 for t. -73/15, 52 Solve 2v5 + 642v*4 + 59496v*3 + 1214944v*2 - 1639872v - 7673760 = 0 for v. -146, -30, -2, 3 Factor -4c3/7 + 32104c*2/7 + 116651932c/7 + 12780915536. -4(c - 10892)(c + 1433)2/7 What is d in d4/5 + 76522d3/5 + 229521d*2/5 - 2754652d/5 + 2448608/5 = 0? -76519, -8, 1, 4 Let 3y3 - 1294104y*2 - 40120017y - 38825910 = 0. Calculate y. -30, -1, 431399 Factor o*2/2 + 261330o + 522658. (o + 2)(o + 522658)/2 Solve -j2/7 + 443951j/7 - 887898/7 = 0 for j. 2, 443949 Factor -2k3/3 + 17842k*2/3 - 53472k. -2k(k - 8912)(k - 9)/3 Solve -u2/2 + 2187u + 110600 = 0 for u. -50, 4424 Determine c, given that c*3/3 + 11987c*2/6 + 375637c/6 + 92411/3 = 0. -5962, -31, -1/2 Factor 3a2/4 - 11164122a + 41545873343628. 3(a - 7442748)2/4 Find a such that 15a*4/4 - 17487a*3/4 - 595263a*2/4 - 2204613a/4 - 104313 = 0. -29, -4, -1/5, 1199 Solve 5k3 + 278050k*2 + 21938195k + 191581950 = 0. -55531, -69, -10 Solve -12r4 + 43480r*3 + 290636r*2 - 856824r + 522720 = 0. -9, 1, 4/3, 3630 What is v in 3v4 + 631608v*3 + 44318878758v*2 + 1035982932177648v - 32158080158998017 = 0? -70189, 31 Determine f so that -f*2/3 - 4958180f/3 - 6145887228100/3 = 0. -2479090 Let -5p4/8 - 3007p*3/8 - 2016p*2 - 2682p = 0. Calcula	{ "pile_set_name": "DM Mathematics" }
prime factors of o? 11, 37 Let b(t) = 2t3 - 7t*2 - 32. Let m be b(6). Suppose mc - 145c = 636. What are the prime factors of c? 2, 53 Let m = -5166 + 7575. Suppose 3k + 0k - m = 3i, -5i = -k + 783. What are the prime factors of k? 2, 101 Let k(y) = 5y - 3. Suppose 6x + 9 = i + 3x, -4x + 4 = 0. Suppose 2q - 2 = i. List the prime factors of k(q). 2 Let r = -412 - -630. Let n(m) = -m*3 - 13m*2 - 38m - 135. Let d be n(-8). Let q = d + r. What are the prime factors of q? 67 Suppose -13t = -45238 + 9722. What are the prime factors of t? 2, 683 Suppose -563243 = 205q - 1236596 - 1074887. What are the prime factors of q? 2, 13, 41 Suppose -97862 = 2w - 7w + 2z, 0 = -3w - 3z + 58713. What are the prime factors of w? 2, 3, 7, 233 Let m(n) = n2 + 21n - 26. Let y be m(-22). What are the prime factors of y/(-10) - (-1 - (-1192)/(-20))? 61 Let z(h) = 4h3 + 14h*2 + 16h + 25. Let l(r) = -6r3 - 27r*2 - 32r - 48. Let f(j) = 3l(j) + 5z(j). What are the prime factors of f(8)? 173 Let p = -151 + 153. Suppose v + p - 7 = 0, s = -4v + 194. What are the prime factors of s? 2, 3, 29 Let c = -79 + -82. Let x = -295 - c. Let y = x + 229. What are the prime factors of y? 5, 19 Suppose 928c - 1153360 = 848c. What are the prime factors of c? 13, 1109 Let t be 105/40 + (-3)/(-8). Suppose 3k = 3z - 42, tk - 8z + 32 = -3z. List the prime factors of (-306)/k - 10/95. 2 Let g be (4/10)/((-1)/(-415)). Let z(k) = -44k + 2361. Let d be z(54). Let l = g + d. List the prime factors of l. 151 Let d(q) = 7q*2 + 92q - 2230. List the prime factors of d(27). 11, 487 Let f = -64 + 66. Suppose c + 4c - 141 = -fk, 4c - 2k = 102. List the prime factors of c. 3 Let n(k) = 3 + k*3 - 23k*2 + 3k*2 + 3 - 2k*2 + 21k. Let p be n(21). Suppose pa - 38 = 4. What are the prime factors of a? 7 Let k(g) = -26g*2 + 4. Let a = 11 - 8. Let w be k(a). Let r = -34 - w. List the prime factors of r. 2, 7 Let p(m) = -28m - 126. Suppose 47 = -5z - 4j, -9z + 3j + 2 = -8z. What are the prime factors of p(z)? 2, 5, 7 Let n = 16432 - 8679. List the prime factors of n. 7753 List the prime factors of 644/966(-332)/(-10)-111-5. 2, 37, 83 Suppose 2a - 2436 = -4d, -5a - 18d + 6050 = -16d. Suppose -12m + 9m - 3t = -732, -a = -5m + t. List the prime factors of m. 2, 11 Suppose 3r - 5s - 45 + 10 = 0, -r - 15 = 5s. Suppose 3z - 630 = 3y, rz + 5y = 646 + 424. List the prime factors of z. 2, 53 Let j(h) = 25h - 67. Let g(w) = -6w + 17. Let b(k) = -9g(k) - 2j(k). Let a be b(6). Suppose -a = -5o, n + 0n = 2o + 96. What are the prime factors of n? 2, 7 Suppose -4q + 18 = 6. Let m = 789 - 808. List the prime factors of 1/q(m + 244). 3, 5 List the prime factors of (318/12)/(9/630). 5, 7, 53 Suppose 5n + y = 3y - 2602, 1039 = -2n - y. Let j = 557 - n. What are the prime factors of j? 3, 359 Suppose -2u = -8 + 4. Let d be -3((-4)/3 + u). List the prime factors of (d/4)/(2/(-100)). 5 Let x(t) = 5t3 + 4t*2 + 34t - 226. List the prime factors of x(15). 18059 Let v be 1/(5/20-2)2562. What are the prime factors of 15/25 + v/(-35)? 3, 7 Let r = -80 + 83. Suppose 4t + 399 = n, rn - 2t - 103 = 1084. What are the prime factors of n? 5, 79 Suppose -112c + 111c = f - 3933, c - 2f = 3912. What are the prime factors of c? 2, 13, 151 Let y(s) = -234s + 598. What are the prime factors of y(-5)? 2, 13, 17 Let a(w) = 6w*3 + 36w*2 + 17w + 19. List the prime factors of a(8). 5531 Suppose -41x = -48x + 2534. Let n = x - -66. What are the prime factors of n? 2, 107 What are the prime factors of (-2008)/(-6)(154178/3048 + 1/(-3))? 67, 251 Let q(h) = -6h*2 - 2h + 688. Let c(s) = s*3 + 26s*2 + 26s + 25. Let i be c(-25). List the prime factors of q(i). 2, 43 Suppose -400 = -48x - 16. Suppose xd - 2782 = 962. What are the prime factors of d? 2, 3, 13 What are the prime factors of -1819196(-13)/364 - -3(-4)/42? 3, 7219 Let h(f) be the second derivative of 577f3/6 + 102f + 1. What are the prime factors of h(1)? 577 Let i(f) = -2f3 - 17f*2 - 3f - 8. Let l be 3 + 32/(-12)24. Let s = l - -52. List the prime factors of i(s). 2, 5 Let m be (-108)/(6 - 100/15). Let i = 958 - m. List the prime factors of i. 2, 199 What are the prime factors of ((-4560)/9)/((-5)/4208)? 2, 5, 7, 19 Suppose 22866 + 7478 = k + 2b, 0 = k + 4b - 30342. List the prime factors of k. 2, 15173 Suppose 6c + 2 = 7c. Let v be 1/10/c + 2. Let l(s) = 87s - 10. What are the prime factors of l(v)? 2, 41 List the prime factors of (-12 - -25579) + 13 + 15. 5, 5119 Suppose -10s = 44 - 164. Suppose 0q + 5628 = sq. What are the prime factors of q? 7, 67 Suppose -5 + 29 = 8i. Let w(j) be the third derivative of 25j4/24 + 3j*3/2 + 3j*2. What are the prime factors of w(i)? 2, 3, 7 Suppose -a - 1619 = -2v, 13v + 3v + 4a - 12916 = 0. What are the prime factors of v? 2, 101 Suppose 4m - 32 = 0, m - 34621 = 2a - 126201. List the prime factors of a. 2, 7, 3271 Suppose 81o - 656633 = 695257. What are the prime factors of o? 2, 5, 1669 Let m = 9857 - -9269. List the prime factors of m. 2, 73, 131 Let x(u) = 78u + 1491. Let r be x(-19). Let n(l) = -2l + 2l + 6l - 2. List the prime factors of n(r). 2, 13 Suppose 2h - 2n + 4 = 0, -5n - 5 = -6h + 4h. Let l be 1 + (h/5)/(-1). Suppose -17 = ly - 35. What are the prime factors of y? 3 Suppose s - 64 + 19 = 0. Let d = s + -42. Suppose 6a = da + 285. List the prime factors of a. 5, 19 Suppose 0 = 2p + 7 - 3, -r + 1148 = 2p. List the prime factors of r + 1 - (-19 - -19). 1153 Suppose -26c = -76 + 24. What are the prime factors of 1/c + (-5 - (-18490)/20)? 2, 5, 23 Suppose -4p = 2j - 182, -3j - 2p = 3p - 271. Let a be (-19)/3 - 58/j. What are the prime factors of (a/(-4))/(2/(-1344)-6)? 2, 7 Suppose 2a + 2y + 4500 = 37028, 4a + 3y - 65055 = 0. What are the prime factors of a? 3, 13, 139 Suppose 6i - 11i + 15 = 0. Suppose -ih = 0, 4w = -h + 1407 - 267. List the prime factors of w. 3, 5, 19 Suppose 5k - 10k = -1475. Suppose 291n + 404 = kn. What are the prime factors of n? 101 Let w = 22853 + 10104. What are the prime factors of w? 32957 Let z be (-2)/(-1) + -6 - (14 - 26). What are the prime factors of (5 + (z - -522))(-2)/(-2)? 5, 107 Suppose -u + 437 = k, -2k + 601 = u + 168. Let y be (-338)/(-8) + (-4)/805. Suppose 5m - 989 = q, -3q + u = 2m + y. What are the prime factors of m? 2, 3, 11 Let r = -69 - -77. List the prime factors of 52 + (-13)/104 + (-39)/r. 47 Suppose 0 = -3n - 3u + 988 - 178, 2n + u - 546 = 0. What are the prime factors of n? 2, 3, 23 What are the prime factors of -8 + -9 + 4 + 59116 + -4? 113, 523 Let v(t) = -3t3 + 142t*2 + 41t + 115. What are the prime factors of v(47)? 3, 13, 109 Let r(m) = 2m2 - 7m + 27. Let s be r(4). Suppose -1389 = -3c + 3i, -c + 506 = -4i + s. List the prime factors of c. 3, 17 Let b be (-36)/(-10)65/39. Suppose 4s + 4x = 672, -3x - 671 = -4s - bx. Let z = -88 + s. What are the prime factors of z? 79 Let r be (-3)/(-12) - (-55)/20. Suppose 4a + 2y - 710 = 0, -4y + y + r = 0. Suppose -3x + x - 295 = -5s, 5x + a = 3s. List the prime factors of s. 59 Let h = -2585 - -1153. Let m = -887 - h. List the prime factors of m. 5, 109 Let l = -154 + 238. Let k be ((-1)/(-2))/(9 + (-762)/l). What are the prime factors of 98 - (-2 + 6 + k)? 101 Let x(i) = -659i3 - 3i*2 - 20i - 39. What are the prime factors of x(-3)? 3, 7, 11 Let b be 4/(-5) - (-361)/95. Suppose -4c + 179 = 6o - bo, -5o = 4c - 301. List the prime factors of o. 61 Let v(i) = -28i*3 - 21i*2 - 14i - 50. Let b be v(-10). Suppose 44o = 19726 + b. What are the prime factors of o? 1039 Let o(s) = s2 - 11s + 30. Let a be o(0). Let q(f) = f*3 - 28f*2 - 23f + 12. What are the prime factors of q(a)? 2, 3, 11, 17 Suppose t - 180t = 120t - 5232500. List the prime factors of t. 2, 5, 7 Let u be (-2)/(-6) + 1/6-218. Let p = u - -41. Suppose -2y - y + 681 = ps, 141 = s - y. List the prime factors of s. 2, 3, 23 Let c be ((-9)/(-2))/(2/8). Suppose -2r = r - c. List the prime factors of ((4 - 9) + r)/(1/199). 199 Let v = 303 - 366. List the prime factors of 707/21(v/(-3))/1. 7, 101 Suppose -60 - 202 = -3z + 5j, 5z -	{ "pile_set_name": "DM Mathematics" }
. Let s(o) = -4o3 + 9o*2 + 39o - 52. Let u(v) = 3h(v) + s(v). Differentiate u(x) with respect to x. -12x*2 + 18x Let d(j) be the first derivative of -447j7/7 - j3 + 323j + 1194. Find the third derivative of d(n) wrt n. -53640n3 Find the third derivative of 293a*2 - 21a - 205a6 + 10a - 86a6 + 11a wrt a. -34920a3 Let g(a) be the first derivative of -137 - 17a*2 - 1/5a*5 + 0a*4 + 0a*3 + 119a. Find the first derivative of g(d) wrt d. -4d3 - 34 Let p(q) be the second derivative of 28q*2 + 2q - 38/15q6 + 0q*5 + 53 + 0q*4 + 0q*3. Differentiate p(k) wrt k. -304k*3 Let k be (1/3)/((-3)/(-18)). What is the derivative of -30 - 11u*2 + 4u + 3u2 + u2 - ku wrt u? -14u + 2 Let p(o) = -12o - 9. Let c be p(-2). Suppose -3g + 2u + c = -u, 2g - 3u - 10 = 0. Find the third derivative of 28t2 - 3 + 3 - 84t*5 + 60t*g wrt t. -1440t*2 Let c(d) be the second derivative of 0d*2 + 0 - 13/12d*4 + 0d*5 + 0d*3 + 0d*6 + 0d*7 - 25d + 9/14d8. What is the third derivative of c(f) wrt f? 4320f*3 Let b(x) be the third derivative of 3x*6/20 + 3x5/20 + x4/8 + 463x3 + 2x*2 + 1741. What is the derivative of b(u) wrt u? 54u*2 + 18u + 3 Let j(l) be the third derivative of -853l8/56 - l4/6 - 67l*3/2 + 107l*2 + 2l - 2. Find the second derivative of j(v) wrt v. -102360v3 Let z = -56 - -111. Let k = 60 - z. What is the second derivative of 11 - 12a*k - 24 + 13 + 2a wrt a? -240a3 Let z(u) = -155u*2 - 3u - 11. Let l = 472 + -474. Let k(b) = 155b2 + 4b + 12. Let h(f) = lk(f) - 3z(f). Differentiate h(d) wrt d. 310d + 1 Let m(h) = -1695h*2 + 7372h + 20. Let p(u) = -3391u2 + 14739u + 45. Let s(q) = -9m(q) + 4p(q). What is the second derivative of s(k) wrt k? 3382 Suppose -19t + 675 - 143 = 0. What is the second derivative of 2a - ta4 + 27a*4 + 8a*2 - 17 + 3a*4 wrt a? 24a*2 + 16 Let m(q) be the third derivative of 50q*2 + 0q*5 + 0q + 0 - 1/70q7 - 115/6q*3 + 0q*6 + 7/6q*4. What is the derivative of m(a) wrt a? -12a*3 + 28 Suppose -25p + 28 = -24p. Find the third derivative of -16f*4 - 878f*3 - 5f*2 - pf*2 + 878f*3 wrt f. -384f Suppose 0b + 2b = -10. Let n be 26 + (-5)/(b/1). Differentiate n - 34d2 - 11 - 19d*3 + 34d*2 with respect to d. -57d*2 Suppose -5f - 10 = -2g - 3f, 3g - 11 = f. What is the first derivative of -47 - 51k*g + 2184k - 2184k wrt k? -153k*2 Let j(t) = 6t*2 - 906t + 252. Let z(f) = 2f2 - 306f + 83. Let x(h) = -4j(h) + 11z(h). What is the derivative of x(c) wrt c? -4c + 258 Let m(o) = -3o - 2. Let r(h) be the third derivative of 19h4/6 + 221h*3/6 - 5h*2 - 2h. Let y(p) = 3m(p) - r(p). What is the derivative of y(l) wrt l? -85 Let h be (-1215424)/(-42) + (-3 - 7/(-3)). What is the second derivative of -52r*5 + 2 + 28828r - hr - 54r*5 wrt r? -2120r*3 Let j(a) be the third derivative of -143a*6/10 + 421a*3/3 + 554a*2 + 1. What is the derivative of j(z) wrt z? -5148z*2 Let c be (1 - 2 - -1) + 2 + 0. Suppose -5z + 92 = -4u, -z + cu = -u - 14. What is the second derivative of 14g + 6g + zg3 - 6g + 5g wrt g? 120g Find the third derivative of 21k3 - 82k*4 - 87k*4 - 1061k*2 + 6604k*2 - 30k*3 wrt k. -4056k - 54 Let g(f) = 59f3 + 2f*2 + f - 3. Let t be g(1). What is the second derivative of 132r*3 - 8r*3 + 17 - t - 2r wrt r? 744r Let n(b) = 3b + 3. Let u be n(7). Let d(k) = 3k + 57. Let x be d(-18). Find the third derivative of -77y - 21y2 + 77y - uyx wrt y. -144 Suppose 4c - 118 = 10. Let x(g) = -g*3 - 20g*2 + 3g + 64. Let u be x(-20). Find the third derivative of -6y + 9y*u - 4y + cy2 + 10y wrt y. 216y Let b(f) be the second derivative of -131f + 0f4 - 1/3f*3 + 0 + 7/10f*6 + 3/20f*5 - 2f*2. Find the second derivative of b(h) wrt h. 252h*2 + 18h Let s(d) be the first derivative of -725d6/3 + 70d3/3 + d2/2 + 486. What is the third derivative of s(o) wrt o? -87000o2 Suppose 0 = -0q - 5q + 25. Suppose 6h = qh + 5. What is the third derivative of -246n*h + 2n*4 + 263n*5 - 15n*2 - 2n*4 wrt n? 1020n*2 Let r(m) be the first derivative of -3m*7/7 - 79m5/5 + m4/2 - 7m3/3 + 21m*2/2 + m + 7472. What is the third derivative of r(l) wrt l? -360l*3 - 1896l + 12 Let w(c) = 2c - 8. Let a be w(6). Let i(h) = -h2 + 121h - 570. Let x be i(5). What is the third derivative of am2 + xm*2 - 13m*2 - 3m*3 wrt m? -18 Let i = 43 + -40. What is the derivative of -35 - 23 + 19 - 8y - 38 + 4yi wrt y? 12y*2 - 8 Find the second derivative of -5h - 209 - 1170h4 + 6h - 104h4 + 300 wrt h. -15288h*2 Let d(r) be the second derivative of -5r7/6 + r6/30 - r*4 - 15r*3/2 + 3r*2 - 4r + 902. What is the second derivative of d(t) wrt t? -700t3 + 12t*2 - 24 What is the third derivative of -10l*2 + 154l*2 - 142l*2 - 2800l*3 + 13 + 29l wrt l? -16800 Let g(b) = 38b5 + 7b*4 - 2255b*2. Let k(d) = 18d*5 + 4d*4 - 1127d*2. Let z(o) = -3g(o) + 7k(o). What is the third derivative of z(h) wrt h? 720h*2 + 168h Suppose 3c = 2g - c + 38, 0 = 5g + 2c + 35. Let o = g + 14. Differentiate q - 9q + 10 - q - o wrt q. -9 Let t(s) be the second derivative of 137s*5/20 - 10s*3/3 + 7105s*2 + 192s - 2. Differentiate t(d) wrt d. 411d2 - 20 Let v(x) be the third derivative of 17x*8/336 - 29x4/8 - x3 + 52x2. Let r(j) be the first derivative of v(j). What is the derivative of r(l) wrt l? 340l*3 Differentiate -5483 - 251 - 35 - 11058k*2 + 3085k*2 wrt k. -15946k Let d(r) = 3r3 - 3r*2 + r. Let o(g) = -157g*4 - 8g*3 + 8g*2 - 4799g. Let w(y) = -2d(y) - o(y). Find the second derivative of w(v) wrt v. 1884v*2 + 12v - 4 Let g(i) be the third derivative of 281i7/210 + 9i*5/4 + 997i*2. Find the third derivative of g(r) wrt r. 6744r Let u(y) = -y*3 + 14y*2 + 16y - 11. Let w be ((-9)/(-12) - -3)4. Let m be u(w). Find the second derivative of 19c*m - 5c - c*4 - 13c wrt c. 216c2 Let h(m) = 597m - 73. Let r(v) = -3006v + 364. Let t(j) = -16h(j) - 3r(j). What is the first derivative of t(l) wrt l? -534 What is the third derivative of -201v*2 + 545v*2 + 2v + 286v2 + 938v*2 + 4v*3 + 16v*4 + 20v*3 wrt v? 384v + 144 Let w(a) be the second derivative of -45a3 + 0a*2 + 0 + 190a + 13/6a4. Find the second derivative of w(c) wrt c. 52 Find the second derivative of -667n*3 + 2n - 8n - 392n*3 + 310 - 930n*3 wrt n. -11934n Let r(g) be the third derivative of -2521g6/120 - 287g*4/24 - 2g*3/3 + 21g*2 + 2g. What is the second derivative of r(j) wrt j? -15126j Let l(z) be the third derivative of 121z7/21 + z4/24 + 1058z3/3 - 3095z*2. Find the second derivative of l(c) wrt c. 14520c*2 Find the second derivative of 4 - 3 + 568k - 314k + 2 + 2820k*3 wrt k. 16920k Let h(f) = 19f + 8. Let r be h(-2). Let l = 33 + r. Find the second derivative of -657i*l + 20i + 657i3 + 13i*5 wrt i. 260i*3 Let s(y) be the first derivative of 0y*4 - 139/2y*2 + 91 - 52/3y*3 + 3/5y*5 + 0y. Find the second derivative of s(l) wrt l. 36l2 - 104 Let x(f) be the first derivative of -4883f*2/2 + 10143f - 13737. Find the first derivative of x(l) wrt l. -4883 Let s(o) = 5o - 3o + 4o - 2o - 64o2 - 12. Let y(c) = 64c*2 - 3c + 10. Let w(f) = -3s(f) - 4y(f). What is the first derivative of w(p) wrt p? -128p Let m be ((-8)/6)/(7/(-21)). Let x = -439 + 450. What is the first derivative of 3 + 0 - m - x - 21b wrt b? -21 Let z(u) be the second derivative of -183/2u2 + 0 - 20u - 1/4u4 - 41/6u*3. What is the first derivative of z(g) wrt g? -6g - 41 Let l(c) be the third derivative of 43c9/504 - 9c*7/35 + 52c*5/15 - 5c4/8 - c3/3 - 1315c2. What is the third derivative of l(z) wrt z? 5160z*3 - 1296z Let f(c) be the third derivative of -7c5/60 - 47c*4/24 - 1501c*3/3 + 17c*2 + 9. What is the first derivative of f(o) wrt o? -14o - 47 Let u(m) be the third derivative of -95/24m4 - 2m*2 + 9m - 31/15m5 + 0 + 0m**3. What is the second derivative of u(a) wrt a? -248 Let n be ((-481)/26)/(6/4	{ "pile_set_name": "DM Mathematics" }
1.77613929 and 4. 2.22386071 What is -1 - -6033480? 6033479 Add together -2.497355 and -100. -102.497355 What is 0.024018819 minus 70? -69.975981181 What is 0.2 minus -0.05188244? 0.25188244 -451.5383 + -2380 -2831.5383 Work out -77.43868 - 1. -78.43868 What is 0.11 less than -1687944.8? -1687944.91 What is -899 - 4514? -5413 What is the distance between -1 and 67.7783? 68.7783 What is 2.319 + -16169? -16166.681 What is 2.98628326 + 4.5? 7.48628326 What is -8706.3208 plus -21? -8727.3208 -291822396 - 103 -291822499 What is 135912789 + -0.6? 135912788.4 What is 0.178 take away -83404057? 83404057.178 Sum -1 and -301677127. -301677128 -49.6366 + -18762 -18811.6366 Sum 2522697.4 and -0.3. 2522697.1 Calculate -0.033 + 1800755820. 1800755819.967 Calculate 2486671723 + 0.6. 2486671723.6 0 + -328790998 -328790998 What is -5 less than -11673860? -11673855 What is -14 - 2591499855? -2591499869 Total of -16 and -11140603. -11140619 Calculate -564 - -610.9. 46.9 Add together -9.02 and 11.82. 2.8 Work out -4427.3 - 0.3148. -4427.6148 What is 624395 less than -21008? -645403 Calculate 0.5 + -43114693. -43114692.5 Work out 5.2 + -6542.03. -6536.83 -1 + -7305842 -7305843 865 - 19730 -18865 Add together -5 and 0.047165061. -4.952834939 What is 465.34534 less than -0.42? -465.76534 What is 6359 take away 14333908? -14327549 Put together -0.62 and -5.37486177. -5.99486177 Calculate -1034693 + -6. -1034699 Add 4 and 4745.99902. 4749.99902 Put together 2 and 13198219455. 13198219457 Add 0.20452618884 and -3. -2.79547381116 What is -12.5638 plus -751? -763.5638 Subtract 45614577 from 2. -45614575 207.43989+0.013 207.45289 What is -0.181643376 + 5? 4.818356624 Subtract 1421 from -178054. -179475 -19+171.76068 152.76068 What is the distance between -29549479723 and 1? 29549479724 What is -10620 plus -397? -11017 What is 5.18895635 + 0.052? 5.24095635 Add -1.1 and 623289. 623287.9 What is -30710 plus -2751180? -2781890 Work out 4 + -29.4379855. -25.4379855 Add 85818.2 and -1.7. 85816.5 29755.26 + 32 29787.26 What is 6023.29 - 8.1287? 6015.1613 Work out -725.2 + 0.14508. -725.05492 Sum 0.579 and 3137582. 3137582.579 Add 287539 and -0.0541. 287538.9459 Calculate 2414.1 + 3.06. 2417.16 2.24 + 132517 132519.24 Sum 0.39 and 1.31278. 1.70278 What is the difference between -199310197 and -16? 199310181 What is -1194825.47 plus -8? -1194833.47 Work out -270337 - 150021. -420358 What is -51.39 + -0.61256? -52.00256 Add together -0.8484 and -418221. -418221.8484 What is 66971323 less than -0.5? -66971323.5 Add -207 and -4519161. -4519368 Sum 0.4 and 23001731. 23001731.4 What is -0.102 plus 2387983? 2387982.898 Put together -0.1 and -18369661. -18369661.1 1484408+8 1484416 Calculate 4 + 16237087.889. 16237091.889 Work out -2835891220 - 0.4. -2835891220.4 5786.86+-681 5105.86 Subtract -21.036011 from -0.7. 20.336011 293886 - -0.023991 293886.023991 Calculate -12.6 - 2219792. -2219804.6 What is 0.13 less than -10.8773242? -11.0073242 Calculate -10.939186 - 5. -15.939186 What is 565 minus -3176414? 3176979 Sum -14.397 and 64652. 64637.603 Calculate -58348 + 242.38. -58105.62 Calculate 29932.5 + -5. 29927.5 Sum 1042 and -3640759. -3639717 What is 0.80643 - 332? -331.19357 What is 0.386 less than 2938? 2937.614 Work out -0.8 + 113.12523. 112.32523 Put together 1351516981.8 and -3. 1351516978.8 Put together -30.7 and 36448805. 36448774.3 Put together -0.1 and -46066423. -46066423.1 Subtract -91302 from -41.82. 91260.18 What is 68262548.8 minus -0.3? 68262549.1 Calculate -7.98 - 2378594. -2378601.98 What is 0.03 minus 418443258? -418443257.97 Put together -0.07 and -5374792140. -5374792140.07 5480885.23 - 0.5 5480884.73 What is -0.79 take away 208973? -208973.79 Add 51848386 and 0.06. 51848386.06 Total of 0.6 and -317980.19. -317979.59 What is -13.6 take away 26560? -26573.6 Calculate 0.2 + -0.16710146711. 0.03289853289 Subtract 1124521642 from 0.3. -1124521641.7 0.4+-38009451 -38009450.6 What is -0.15386516 - 4? -4.15386516 What is 1.11051 plus -183.17? -182.05949 What is -72396.6 take away -220? -72176.6 What is -225.649523 minus -0.4? -225.249523 What is -1523944990 minus -0.3? -1523944989.7 Calculate -112214 + -2270. -114484 What is -2727 - -149652? 146925 Subtract 264.26 from -1.501. -265.761 What is 8 take away -157271? 157279 What is 3.295 + 0.99216? 4.28716 What is 786832 - 33? 786799 Calculate -0.061 - -21.6561. 21.5951 Work out 0.3 - 1760273020. -1760273019.7 What is the difference between 5 and -2373704? 2373709 What is the difference between -131292.911 and -6? 131286.911 What is the difference between 0.67 and 37473978? 37473977.33 What is -253 minus 36159? -36412 Add together -0.8 and -2328.5. -2329.3 Sum 2 and -0.1485692933. 1.8514307067 What is 118 plus 16490167.8? 16490285.8 Put together -5 and 201.10878. 196.10878 Add together -0.2 and -1333405886.7. -1333405886.9 What is the difference between 1339.307 and 18? 1321.307 Total of 1 and -14181860. -14181859 Total of -0.1309989 and 11.7. 11.5690011 What is 2567320276 minus -0.6? 2567320276.6 Sum -291 and 191543. 191252 Work out -13 + 1727.2184. 1714.2184 Sum -24137179 and 147. -24137032 Work out -818.73 - -0.3309. -818.3991 -0.28866555106 + 0.1 -0.18866555106 Put together 6211 and -40138. -33927 Work out -0.13 - -3903.206152. 3903.076152 Add together 30.7655 and 913. 943.7655 Calculate 2039892 - -5468. 2045360 99.0819 + -7 92.0819 Calculate -41738.7434 - 3. -41741.7434 Work out 0.532476 - -177. 177.532476 Calculate -169912 - 654. -170566 Put together -162703 and 57810. -104893 Subtract -329.856206 from 0.4. 330.256206 Put together -607308 and -1537.7. -608845.7 What is -0.3 + -14.88658955? -15.18658955 Subtract 0.148951 from 215291. 215290.851049 What is -202319973 minus 0.5? -202319973.5 2424958+2.46 2424960.46 Put together -76.66597 and -157. -233.66597 Total of 7 and -12.97699. -5.97699 Work out -41.69 - -2.357. -39.333 Sum 155.5 and 945101. 945256.5 What is -2561.0874 - -0.61? -2560.4774 What is -78760 less than 5054? 83814 Subtract 659280490 from 0.1. -659280489.9 What is -1 minus 1222861.371? -1222862.371 -3586877 - -0.1 -3586876.9 What is 0.015 take away 207844855? -207844854.985 Work out -962 - -13550.732. 12588.732 0.6276 + -9265 -9264.3724 What is 24 less than -527.534074? -551.534074 Calculate -565.4 - 693. -1258.4 Sum -1014650382 and -1. -1014650383 What is -0.65713 + -44693? -44693.65713 Calculate 9496 - 4.902. 9491.098 Work out -0.7 + 1514082704. 1514082703.3 What is the difference between -0.008 and 1159385? 1159385.008 What is 0.4 + -0.097249569? 0.302750431 What is -0.1 + -1361212075? -1361212075.1 What is the difference between -176 and 13348? 13524 Work out 40.911 - 716. -675.089 Add together 1.58 and -24529962. -24529960.42 What is -5423427 less than 0.19? 5423427.19 What is -0.14 + -20.11315? -20.25315 What is 0.5524 plus -1328.4? -1327.8476 What is 51386 + 114179? 165565 Add 154.1070624 and -0.2. 153.9070624 Work out -7938.58 + -885. -8823.58 Put together -3035.162 and -126.9. -3162.062 What is -3.50472936 less than 61? 64.50472936 What is 1930 - 18622? -16692 What is the difference between 1.113 and 225893? 225891.887 What is -5 less than 95041911? 95041916 What is -3.678378 plus 36? 32.321622 What is 2857 plus 0.27077851? 2857.27077851 What is 43149.308 less than 0.036? -43149.272 Calculate 0.12 - 9458129.9. -9458129.78 What is the distance between 55462 and 183598? 128136 Subtract 396.132 from 0.957. -395.175 Sum -11424.3 and 416. -11008.3 What is -85303 take away -31.4? -85271.6 What is 35944 + 1383.4? 37327.4 Work out 0.5241537346 + -0.3. 0.2241537346 -0.047034008 + 0.5 0.452965992 What is 91 plus 411262169? 411262260 Calculate 736774 + -6.59. 736767.41 What is -36044231 minus -26? -36044205 Sum -2 and -1.04750766. -3.04750766 What is -3 less than 3.9136? 6.9136 Calculate 1647 - 6490. -4843 What is -1492 + 35450926? 35449434 Calculate 0.4743 - 10839. -10838.5257 Sum -5 and 133276907. 133276902 Work out -1819 - 6251. -8070 Subtract 0.03 from 844413. 844412.97 What is 28598 - -26.1507? 28624.1507 What is -58046 - -5247.4? -52798.6 What is 17 - -202.112? 219.112 What is the difference between -0.3 and -14775.7798? 14775.4798 What is -1 plus 1635071607? 1635071606 Put together -5763.548 and 3	{ "pile_set_name": "DM Mathematics" }
348y/3 + 108579096 = 0. What is y? -1418, -162, -1, 3 Factor 4t*3 + 4930836t*2 + 1519445734560t - 77504558097600. 4(t - 51)(t + 616380)2 Solve c5 - 37015c4 + 331170055c*3 + 211958823075c*2 - 851808148560c + 853132236588 = 0. -603, 2, 18807 Suppose -s*3 - 7629767s*2 + 15259537s - 7629769 = 0. Calculate s. -7629769, 1 Find z such that -3z3 + 603z*2 + 41151z + 40545 = 0. -53, -1, 255 Let -45a3/4 + 157a*2/2 + 367a/4 + 2 = 0. Calculate a. -1, -1/45, 8 Factor -5h2 - 225865h - 13984410. -5(h + 62)(h + 45111) Let k*2/6 + 18229k + 1421693/6 = 0. What is k? -109361, -13 Determine d so that -19d5/3 + 47811d*4 - 183099098d*3/3 + 21555986500d*2 - 2268375000d = 0. 0, 2/19, 750, 6049 Suppose 4d5 - 632d*4 - 51584d*3 + 558952d*2 - 1659140d + 1152400 = 0. Calculate d. -67, 1, 4, 5, 215 Suppose s*4 - 835462s*3 + 174500023821s*2 - 348997541260s + 174498352900 = 0. What is s? 1, 417730 Factor -5c2/7 - 20421c/7 + 1311956. -(c + 4493)(5c - 2044)/7 Let -t*2/9 + 8215t/9 - 41050/9 = 0. Calculate t. 5, 8210 Factor -3x3/5 - 891x*2/5 + 320112x/5 - 4093740. -3(x - 114)2(x + 525)/5 What is i in -2i5/11 + 156i*4/11 + 1080i*3/11 - 6128i*2/11 + 6720i/11 = 0? -10, 0, 2, 84 Let -5z5 - 29570z*4 - 57281865z*3 - 36444744700z*2 + 73118853500z = 0. Calculate z. -2486, -1715, 0, 2 Let -3t3 - 755282619t*2 = 0. What is t? -251760873, 0 Let -7p*3/6 - 123300p*2 + 951181p/6 - 35229 = 0. Calculate p. -105687, 2/7, 1 Factor -3c4 - 10997334c*3 - 13437928345284c*2 - 5473384677079832328c. -3c(c + 1221926)3 Factor k2/7 - 2565805k/7. k(k - 2565805)/7 Factor -2j2/3 - 15573116j/3. -2j(j + 7786558)/3 Suppose -f*2/6 - 741065f/6 - 2593703/3 = 0. What is f? -741058, -7 Factor -a*2/4 - 667513a/4 - 166878. -(a + 1)(a + 667512)/4 What is k in -4k*4 - 30740k*3 - 3104061k*2 - 77313242k + 80448047 = 0? -7583, -103/2, 1 Determine s, given that 4s3 - 2180s*2 - 879224s - 4341120 = 0. -266, -5, 816 Determine j so that 35j3 + 463507j*2 + 489956j + 26484 = 0. -13242, -1, -2/35 Let 2g2/7 + 13762g - 578076/7 = 0. What is g? -48173, 6 Solve 6k3/5 + 27456k*2/5 + 1728666k/5 - 17786304/5 = 0 for k. -4512, -73, 9 Suppose -3v2/7 + 2712v/7 + 2351196/7 = 0. Calculate v. -542, 1446 Suppose -2o5 - 732o*4 - 71878o*3 - 2534900o*2 - 26778600o - 79054000 = 0. What is o? -235, -58, -10, -5 Factor 2v2/11 - 202208v/11 - 606642/11. 2(v - 101107)(v + 3)/11 Solve 4n3 - 14640n*2 - 3718572n + 38355400408 = 0. -1462, 2561 Factor -v*3/8 + 537v*2/4 - 296769v/8 + 559682. -(v - 529)*2(v - 16)/8 Find j, given that 4j3 - 39297916j*2 + 96520407270396j - 96520367972484 = 0. 1, 4912239 What is h in -3h4 - 3456h*3 + 105897h*2 - 570906h = 0? -1182, 0, 7, 23 Factor -2t4 - 2607960t*3 - 850168880300t*2 + 8501884401000t - 21254874001250. -2(t - 5)2(t + 651995)2 Factor r4 - 117060r3 + 3447930100r*2 - 1297563276000r + 122868357160000. (r - 58340)*2(r - 190)*2 Solve -12h*3 + 3305709h*2 - 5784963h + 2479266 = 0. 3/4, 1, 275474 Factor -4q4 - 138687160q*3 - 1202133160491248q*2 - 2404265766233888q. -4q(q + 2)(q + 17335894)2 Let 4302g*3 - 619678g*2 + 642546g - 27170 = 0. What is g? 95/2151, 1, 143 Determine v so that v*3 + 3535v*2 - 88954v + 163760 = 0. -3560, 2, 23 Factor -4m2 - 2271300m + 4542616. -4(m - 2)(m + 567827) Factor r*3/2 - 1289r*2 + 961040r - 160709328. (r - 1172)*2(r - 234)/2 Determine a, given that 998a3 - 61880a*2 + 895454a - 3588 = 0. 2/499, 23, 39 What is x in -9x5/4 - 155x*4/4 + 1189x*3/2 + 2879x*2 - 26390x - 6000 = 0? -25, -8, -2/9, 6, 10 Solve -5h5 - 4960h*4 - 943160h*3 + 147070970h*2 - 1507523795h + 1361400950 = 0 for h. -547, 1, 10, 91 Let -z*2 - 17061z - 1442960 = 0. Calculate z. -16976, -85 Factor 564u3 + 152851u*2 - 151511u - 1904. (u - 1)(u + 272)(564u + 7) Suppose -u2/4 - 804417u/2 - 647086709889/4 = 0. What is u? -804417 Find n such that 2n3/3 - 3606734n*2/3 - 252478730n/3 - 4418420650/3 = 0. -35, 1803437 Suppose -405w3/2 + 17194w*2 - 30875w/2 - 1554 = 0. Calculate w. -37/405, 1, 84 Suppose -5c2 + 313270350c - 4906915609456125 = 0. Calculate c. 31327035 Solve 35m5 + 285m*4 - 2865m*3 - 7525m*2 + 14310m + 18720 = 0. -13, -3, -1, 2, 48/7 Let -4g3/7 + 4516g*2/7 + 796080g/7 = 0. What is g? -155, 0, 1284 Solve -3m2 + 231013764m + 231013767 = 0. -1, 77004589 Determine u, given that -1827u2/2 + 1296u + 280 = 0. -4/21, 140/87 Find l such that 5l5/4 - 4170l*4 + 756880l*3 - 61299985l*2/2 + 1486132875l/4 - 683271875/2 = 0. 1, 25, 139, 3146 What is i in 15i2 - 519613i - 69282 = 0? -2/15, 34641 Let 2p4/9 - 6932p*3/9 - 3244898p*2/3 - 321687072p + 1969227288 = 0. What is p? -567, 6, 4594 Factor 2m3/5 - 702202m*2 + 7022014m/5 - 3511006/5. 2(m - 1755503)(m - 1)2/5 Find g, given that g2/6 - 158215g/6 + 28098902/3 = 0. 356, 157859 Determine p so that -4p*4/3 + 100748p*3/3 + 167936p*2 + 806128p/3 + 403072/3 = 0. -2, -1, 25192 Factor 4c2 + 1342995240c + 112727263416416100. 4(c + 167874405)2 Factor y2/3 + 186937y/3 + 10832254. (y + 174)(y + 186763)/3 Determine p, given that -2p*5/7 + 13700p*4/7 - 23254946p*3/7 - 706260872p*2/7 - 6451843840p/7 - 15999027200/7 = 0. -13, -4, 3440 Determine b so that 3987b5/8 - 8849b*4/4 + 27127b*3/8 - 4373b*2/2 + 1115b/2 - 48 = 0. 96/443, 2/9, 1, 2 Find l, given that 4l3 - 2731204l*2 + 131088576l = 0. 0, 48, 682753 Suppose -5j5/4 - 56005j*4/2 - 631331405j*3/4 - 11255324850j*2 - 201944704500j = 0. What is j? -11165, -36, 0 Factor d*3 + 28062d*2 - 56025300d + 27040705000. (d - 950)*2(d + 29962) Determine a, given that a*2 - 16602262a - 16602263 = 0. -1, 16602263 Let -1256733x3/2 - 20107725x*2 - 160861728x + 768 = 0. What is x? -16, 2/418911 Find j such that 15j5 + 845j*4 - 45185j*3 + 193255j*2 - 94330j - 54600 = 0. -91, -1/3, 1, 4, 30 Solve -3m5 - 321m*4 + 8859m*3 + 43629m*2 - 112536m + 60372 = 0 for m. -129, -6, 1, 26 Factor -u*2/3 + 2239u - 20124. -(u - 6708)(u - 9)/3 Solve 2x*4/7 + 2106x*3/7 + 104796x*2 + 84171520x/7 - 12129600 = 0 for x. -380, -294, 1 Determine k so that 3k4 + 11991k*3 - 192729k*2 - 421419k - 216702 = 0. -4013, -1, 18 Factor 3b3 + 63093b*2 - 6849036b. 3b(b - 108)(b + 21139) Determine g so that 4g*3 + 8608g*2 + 187348g - 195960 = 0. -2130, -23, 1 Factor 3d2 + 129012d - 49851663. 3(d - 383)(d + 43387) Factor r*2/3 - 2302r + 2195048/3. (r - 6572)(r - 334)/3 Determine n, given that 3n*5/5 - 231n*4 + 144198n*3/5 - 5686752n*2/5 - 11959584n/5 = 0. -2, 0, 91, 148 Factor 4b2 - 32016b - 14754868. 4(b - 8441)(b + 437) Solve 4u5 - 520u*4 + 9268u*3 + 517760u*2 + 1942864u + 1897280 = 0 for u. -20, -2, 77 Factor 4u4 + 100512u*3 + 445440088u*2 - 2336606182944u + 2161698917117476. 4(u - 1637)2(u + 14201)2 Determine i so that i4 - 232065i3 - 928273i*2 - 696207i = 0. -3, -1, 0, 232069 What is m in 195m4/4 - 3273m*3/2 + 3078m2 = 0? 0, 2, 2052/65 Factor j2/3 + 74663j/3. j(j + 74663)/3 Suppose -223j4 - 299264j*3 - 1786668j*2 - 2367376j + 21376 = 0. What is j? -1336, -4, -2, 2/223 Let f*2 + 9452724f - 18905452 = 0. Calculate f. -9452726, 2 Let 2j4/11 - 259626j*3/11 + 778860j*2/11 = 0. What is j? 0, 3, 129810 Find r, given that 245r*5 - 1131305r*4 + 1187742695r*3 + 278952035905r*2 - 159691933600r + 22826977060 = 0. -197, 2/7, 2407 Let 8a3/11 + 7044558a*2/11 - 1761140a/11 = 0. What is a? -880570, 0, 1/4 Determine o so that o*3/7 - 13416o*2/7 + 6102336o + 15489597952/7 = 0. -328, 6872 Solve 4m4 + 163500m*3 - 163520m*2 - 654000m + 654016 = 0. -40876, -2, 1, 2 Factor m*4/3 - 201m*3 - 3040m2/3. m2(m - 608)(m + 5)/3 Factor v*2/6 - 100328v/3 + 1604864. (v - 200608)(v - 48)/6 Factor 2t*3 - 8004t*2 - 1288982t + 1296984. 2(t - 4157)(t - 1)(t + 156) Let 3j*4 - 2808570j*3 - 22468752j*2 = 0. What is j? -8, 0, 936198 Suppose -5d*3 + 257350d*2 + 4118805d + 3861450 = 0. Calculate d. -15, -1,	{ "pile_set_name": "DM Mathematics" }
n 3, -1/6, 2/11, -2, k? 2/11 Let o = 36.94 - 36.44. Which is the third biggest value? (a) 15 (b) 0.4 (c) o (d) 2 (e) -1 c Let h = 6356 + -6355. Let i = -0.8 - -0.6. Let q be (-5 + (-1 - -3))/7. What is the biggest value in -5, i, q, h? h Let g = -7297 + 7298. Which is the second smallest value? (a) 2/23 (b) 20 (c) 0.4 (d) g (e) -1 a Let z = 3/1486 - 749/2972. Which is the smallest value? (a) 4/7 (b) z (c) 6 (d) 9/8 b Suppose 0 = -652m + 590m + 620. Which is the second biggest value? (a) -3 (b) m (c) 11 (d) 9 b Let i be -4(-5)/(-25)(-5 - (-105)/24). Which is the fifth smallest value? (a) i (b) -2/5 (c) -0.5 (d) 506 (e) -3 d Let u = -22/7 + 67/28. Let s = 6677 + -33393/5. What is the biggest value in 2, s, -2/7, u? 2 Let m = 8 + -11. Let p = 258 + -420. Let n = p - -157. What is the biggest value in n, m, 2/13? 2/13 Suppose 0 = 4m - 28o + 30o + 10, 4o - 7 = m. Let a = -60 - -64. What is the third biggest value in -1/4, a, m? m Suppose 0 = -5j - 15, -35 = -5d - 3j + 1. Let z = 2 - 1. Let q = z + 0. Which is the smallest value? (a) d (b) 5 (c) q c Let d be -5 + -2 + 42 + -54. Let a(n) = 18n - 3n2 + 2n + 4n2 + 21. Let j be a(d). What is the biggest value in 2/15, -4, j? j Let w be (-2)/(-2 + 3) - (-99320)/(-325). Let x = w - -307. Let s = 0 + -2. Which is the third smallest value? (a) -2/9 (b) x (c) s a Let j = 5301.89 - 5302. What is the second smallest value in 4, -26, -0.5, j, 5? -0.5 Suppose 25 = -2o + 5s, 3o - 31 = 8o - 2s. Let q be (10/(-125))/(165/25 + -6). Which is the second biggest value? (a) o (b) 1 (c) q c Let y = 67.72 + -73.72. Let m(n) = n + 6. Let v be m(-7). Which is the fourth biggest value? (a) y (b) 3 (c) v (d) -2/11 a Let v = 1 - 0.6. Suppose 0 = -2g - 8, -3s - 5g = -0g + 692. Let l be -1 + 1/(-3) + s/(-144). Which is the biggest value? (a) v (b) l (c) -3 (d) -1 a Let k = 586.3 + -591. Which is the second smallest value? (a) 5 (b) -1/4 (c) 6 (d) 0 (e) k b Suppose 3q = 10i - 14, 5q + 21i - 2 = 25i. Let g be (0 + -2)/((-8)/16). What is the second smallest value in -2/9, 2/19, g, q? 2/19 Suppose n - 20 = 2g + 3n, 0 = -3g + 3n. Let l = -31/55 - -15/11. What is the second biggest value in l, g, 1? l Let v = 75/673 + 837060/7403. Let m = v + -113. Let o = -0.03 + 0.05. What is the fourth biggest value in o, 0.5, m, -0.5? -0.5 Let q = -0.2 - -0.22. Let m = 27 + 16. Let s = m + -39. Which is the third smallest value? (a) q (b) 5 (c) s b Let p be ((-343)/(-24))/(-7) - -2. Let i(d) = -37d*2 - 1471d + 361. Let q be i(-40). What is the biggest value in 0.12, p, q? q Let c = -0.97 - -0.07. Let g = c - -1. Let a be -1(0 - 2/6). What is the biggest value in g, a, -2/5, -1/4? a Let k = 15999/4 + -3999. Which is the smallest value? (a) 4.89 (b) 4 (c) k (d) -3 d Let t be (-4)/6(-15)/(-4). Let o = 6/91 + -12/13. Suppose -13i + 263 = 19i + 199. Which is the second biggest value? (a) t (b) 0 (c) o (d) i b Let i = -168655/8 + 21082. What is the third biggest value in -4/199, 1, 0, i? 0 Let d = 1.1 + -0.6. Let q = -0.3 + d. Let m be -15 + (-264)/22 + 15. What is the second biggest value in q, m, -2? -2 Suppose 3q - 7 = 5. Let b = 176621/9 - 19624. What is the third smallest value in b, q, 2? q Suppose -532 = 20o + 8o. Which is the biggest value? (a) 0.3 (b) -1 (c) o a Let n = 323.592 + 2.008. Let z = -326 + n. What is the smallest value in -2/7, -2, -3, z? -3 Suppose -2w + 6 = -4m, 0 = m - 0m + 2w - 11. What is the biggest value in 7, 3/5, -5, m? 7 Let r be 0 - (0 - -2)2. Let v = 1.4 - -139.6. Let u = v + -136. Which is the third biggest value? (a) 5/7 (b) r (c) u (d) -5 b Let n = 5.4434 - 0.0134. Let o = -5.03 + n. Which is the biggest value? (a) -0.1 (b) 3 (c) o (d) 6.9 d Let z = -610.3 + 610. What is the third smallest value in z, 0.1, -3, -1, -2.8? -1 Let j(p) = -p3 - p2 + 5p + 4. Suppose 21v - 20v - l = -4, 4v = -l - 6. Let r be j(v). Which is the third biggest value? (a) -8 (b) r (c) -0.5 a Let p = -0.25 + -0.25. Which is the smallest value? (a) -0.08 (b) p (c) 72 b Let d = 0.8589 - -2.1411. What is the third smallest value in d, -1/2, 227? 227 Let w = -115721/1167762 - -1/11562. What is the third biggest value in -1, 3, w? -1 Let d = 12 - 12.3. Let w = -0.49 - d. Let n = 39/56 + -4/7. What is the second biggest value in n, w, 1? n Suppose 5n - 10z + 5z = -10, -n + 2z = 5. Let i be (-11)/(55/10) - n. Let c = -1 + 1.4. What is the second smallest value in c, i, 0.05? 0.05 Let y be ((-84)/(-15) - 4)/(4/10). Let x be 0/(3 - y) + 1/4. What is the fourth biggest value in -0.3, -5, 0, x? -5 Let p = 60.5675 + 0.0325. Let n = p + -51. Let v = n - 9.4. What is the third biggest value in 0.3, v, -0.2? -0.2 Let i be (-217)/(-21)9/(-42). Let z = -5/2 - i. What is the biggest value in z, -0.5, -2.7? z Let m = 35.31 + -35. Let o = 0.04 + m. Let i be (-2)/7 - (543/(-42) - -13)38. Which is the third biggest value? (a) o (b) i (c) 0 b Let f = -42665.2 + 42665. Which is the smallest value? (a) 3/7 (b) 6/25 (c) f (d) 2 c Let l = 52.861 - -0.139. Let r = 5 - l. Let y = -47.5 - r. What is the biggest value in 0.2, 21, y? 21 Suppose -2z + 5z = 12. Let l = 5.755 - 12.755. Which is the fourth biggest value? (a) -1 (b) l (c) 1/2 (d) z b Suppose 9 + 11 = 10h. Let x(n) = 5n*3 + 9 + 6n*2 + 5n*2 - 12n*h + 4n - 2n3. Let m be x(-2). Which is the smallest value? (a) 1 (b) m (c) 0.2 b Let r(x) = 2x + 17. Let h be r(-7). Let n be (-492)/88 - h/6. Let s = 1831/297 + n. Which is the biggest value? (a) s (b) 3 (c) -5 b Let t(l) = -2l2 + 4l + 1. Let y be t(3). Let n be 2/(-4) - y/6. Let i = 6048 - 6045. Which is the biggest value? (a) n (b) i (c) 2/23 (d) 0.5 b Let z(v) be the second derivative of -5v3/6 - 46v*2 - 103v. Let l be z(-19). Which is the fourth biggest value? (a) -1 (b) l (c) -0.1 (d) 1 a Let g = -12272 - -12271.6. Which is the smallest value? (a) -0.5 (b) g (c) -27.5 (d) -8 c Let i = -0.006 + -1.684. Let s = 5.69 + i. What is the fourth biggest value in 0.4, s, 1/3, 1/8? 1/8 Let g = 0.008 - -1.682. Let u = -0.69 + g. Which is the second smallest value? (a) u (b) -11 (c) 3 a Suppose 0 = 4u - 49 + 149. Let t be u/28 - 4/(-28). Which is the third smallest value? (a) 4 (b) 1 (c) t a Let h = -1.2 + 0.2. Let j = 17.36 - 16.86. Let s(g) = 15g + 75. Let p be s(-5). Which is the second smallest value? (a) 6 (b) p (c) j (d) h b Let w = 5 - 3. Let z = -58.041 - -0.041. Let k = z - -73. Which is the second smallest value? (a) 0.3 (b) w (c) -4 (d) k a Let p = 27665.1 - 27665. What is the second biggest value in p, -0.1, -812, 1? p Let w be 11 + -2 - (112 + -98). Which is the third smallest value? (a) -1 (b) w (c) -69 a Let d = -46.7 - 6.8. Let k = -77 + 131. Let y = k + d. Which is the biggest value? (a) 0.3 (b) y (c) 0 b Suppose 0 = 3h + 12, s - 5 = -2s - h. Let f be s + -2 - (5 - 8). Suppose -fq - 12 = -q. Which is the third smallest value? (a) 0.4 (b) 21 (c) q b Let a be ((84/(-70))/(-6))/(28/30). What is the biggest value in a, -1, -1/9? a Let j = 2 + -1.8. Let l = -149 + 1787/12. Let n = 118 - 118. Which is the third biggest value? (a) l (b) j (c) n a Suppose -46 - 43 = -135c + 46. Let v be (1124/(-6))/(6/(-9)). Let x = -1399/5 + v. What is the third smallest value in 0, c, 5, x? x Let l = 6.5 - 7. Let f = -96 - -207. Let i = f + -112. Which is the third biggest value? (a) 0.5 (b) -0.1 (c) l (d) i c Let l = 5.07 + -4.97. Let c = -5.15 - -5. Let m = c + l. What is the biggest value in m, 5, -0.1? 5 Let v be 6/4 + 9/(252/14). Which is the fifth smallest value? (a) -8 (b) -2 (c) v (d) -4 (e) -2/27 c Let i = 12.014 - 11.894. Which is the second smallest value? (a) 13 (b) i (c) 8/9 (d) 4 c Let q = 2983 - 2983. What is the biggest value in q, -5, 96, -2/9? 96 Let v = 2.7 + 10.8. Let c = -70.5 - v. Let o = -87 - c. What is the second biggest value in -2/9, o, 2/5, -0.11? -0.11 Let l = 20.0855 - 20. Let g = -0.0645 - l. Which is the third biggest value? (a) g (b) -2 (c) -0.13 b Let k = -5.933 + 6.333. Which is the fourth smallest value? (a) -2 (b) -22 (c) 10 (d) k c Let k(q) = 2q3 + 39q*2 + 24q + 25. Let v be k(-19). Let b be (-75)/	{ "pile_set_name": "DM Mathematics" }
12k Let m(o) = 5 + 0 - 31o + 5 + 37o + o2. Let a be m(-3). Let d(i) = -i - 1. Let h(b) = 2b - 2. Let r = -200 + 201. Give ah(u) + rd(u). u - 3 Let x = -146 - -148. Let l(v) = 2v + 488v2 + v3 + v + 2 - 484vx - 4. Let b(u) = -2u*3 - 5u*2 - 4u + 3. Give 3b(o) + 4l(o). -2o3 + o2 + 1 Let w(k) = 26k - 3. Let m(a) = 2a3 - 15a*2 - 9a + 11. Let s be m(8). Let l be s/(-6) - (3 - (-82)/(-4)). Let h(q) = -9q + 1. What is lh(v) + 6w(v)? 3v - 1 Suppose 5r + 4a = 167 - 138, -25 = -r - 4a. Let y(t) = -t2 + t. Let l(w) = 6w*2 - 3w + 5. Determine rl(x) + 3y(x). 3x2 + 5 Let g(r) = 2r - 4. Let y be (-4432)/112 - 6/14. Let v be (-3)/(4/y6). Let j(p) be the third derivative of p4/12 - 5p*3/6 - 4p*2. Give vj(d) - 6g(d). -2d - 1 Let g(b) = b*3 + 39b*2 - 38b + 89. Let z be g(-40). Let w(h) = 5h3 - 9h*2 + 9h - 14. Let y(v) = -2v3 + 4v*2 - 4v + 7. What is zy(d) + 4w(d)? 2d3 + 7 Suppose -23l + 2162 = -0. Suppose lq - 21 = 91q. Let h(w) = 4w3 - w2 - 4. Let o(a) = 6a3 - a2 - 6. What is qh(m) - 5o(m)? -2m3 - 2m*2 + 2 Let c(m) = -19m*3 + 22198m*2 + 180m - 15. Let x(l) = -5l3 + 5550l*2 + 48l - 4. Calculate -4c(r) + 15x(r). r*3 - 5542r*2 Let p(m) = 5m*3 + 11m - 6. Let d(l) = -6l2 + 4l - 25. Let g(v) = -v3 - v2 - v - 3. Let h(x) = -d(x) + 6g(x). What is 4h(k) + 5p(k)? k3 + 15k - 2 Let l(o) = 26o + 222. Let t(y) = -13y - 110. Calculate -3l(f) - 7t(f). 13f + 104 Let j(g) = 11g - 76. Let d(w) = -4w + 25. Suppose -181 - 27 = 798u - 824u. What is ud(b) + 3j(b)? b - 28 Let k(q) = -q3 - 15q*2 - 50q - 29. Let v(l) = -7l2 - 23l - 12. What is -3k(t) + 7v(t)? 3t3 - 4t*2 - 11t + 3 Let d(j) = 2j3 - 9j*2 - 6j - 11. Let a(x) = 83 + 124x + 118x - 266x. Let t be a(3). Let f(n) = -n3 + 5n*2 + 3n + 6. Give tf(z) + 6d(z). z3 + z2 - 3z Let r(u) = 3219u + 28. Let d(a) = 6439a + 65. Give -3d(s) + 7r(s). 3216s + 1 Let u(h) be the third derivative of -5h4/12 + 2h*3/3 + 18h*2 - 33. Let r(j) = -5j + 2. Calculate 9r(p) - 4u(p). -5p + 2 Let t(n) = -9n. Suppose 0 = 9l - 7l - 4. Suppose 5d = s + 20 + 3, -4s + d + 22 = 0. Let v(p) = 27p. Determine lv(j) + st(j). -9j Let m(j) = -7j2. Let b(x) = x - 1. Let w(r) = -b(r) + m(r). Let g(c) = c - 1. Let s be (-1)/661. Give sw(n) - g(n). 7n2 Let v(r) = -2r*2 - 3. Let o be (912/(-180))/((-3)/10). Let a(y) = 5 + 10 - 39 - 6yo + 12 + 3. What is -4a(i) + 11v(i)? 2i*2 + 3 Suppose 0 = 34c + 1948 - 1914. Let h(g) = g*2 - g. Let d(x) = 19x. Determine ch(j) + d(j). -j2 + 20j Suppose 0 = 8m - x - 36, 3x + 185 = m + 169. Let h(q) = q. Let z(w) = 2 - 4w - w - 1. Calculate mh(y) + z(y). -y + 1 Let r(c) = 19c3 - 246c*2 + 9c - 15. Let l(q) = -29q3 + 369q*2 - 14q + 24. Give -5l(b) - 8r(b). -7b3 + 123b*2 - 2b Let l(f) = -16f3 - 4f*2 - 5f - 6. Let r(j) = -18j3 - 3j*2 - 4j - 5. Give 4l(i) - 5r(i). 26i3 - i2 + 1 Let c(g) = -g3 - 7g*2. Let v(p) = 3p*3 + 27p*2 + p - 28. Calculate 4c(k) + v(k). -k3 - k2 + k - 28 Let h(a) = 27a + 1248. Let c(b) = -39b - 1877. What is -5c(p) - 7h(p)? 6p + 649 Let s(l) = 380l*3 + 14l*2 - 38l - 5. Let u(f) = -253f3 - 9f*2 + 25f + 3. Determine 5s(r) + 8u(r). -124r3 - 2r*2 + 10r - 1 Suppose -s + 5s = -3h + 25, -3h + 23 = 5s. Let q(v) = 59v2 + 33v*2 - h - 3v - 100v2. Let x(w) = -4w*2 - 2w - 6. Give 4q(b) - 7x(b). -4b2 + 2b - 2 Let c = -13 - -18. Let m(b) = 11b2 - 4b - 5. Let r(o) be the second derivative of -5o4/12 + o3/3 + o2 - 4453o. Calculate cr(y) + 2m(y). -3y2 + 2y Let j(d) = d*3 - 3d*2 + d + 1. Let z(i) = -4i*3 + 17i*2 + 9i - 10. Give -5j(v) - z(v). -v3 - 2v*2 - 14v + 5 Suppose 1348k = 1331k + 17. Let c(o) = o - 1. Let j(g) = g*2 + 5g - 8. Calculate kj(s) - 5c(s). s*2 - 3 Suppose 0 = -68a - 0a + 340. Let s(d) = -2d*2 - 3d - 7. Let n(l) = 3l2 + 2l + 6. Calculate an(h) + 4s(h). 7h2 - 2h + 2 Let f(l) be the second derivative of -l*4/2 - 2l3/3 - l2 - 10861l. Let i(h) = 13h*2 + 9h + 3. What is -9f(o) - 4i(o)? 2o2 + 6 Let y(j) = -2j*2 + 4j + 26. Let b(o) = -6o2 + 13o + 79. Suppose 45c + 8c - 62 = 44. Give cb(f) - 7y(f). 2f2 - 2f - 24 Let v(w) = w*3 + 7w*2 - 13w - 3. Let l(u) = -3u3 - 17u*2 + 27u + 7. Calculate 2l(d) + 5v(d). -d3 + d2 - 11d - 1 Let m(r) = 3239r*2 - 2r - 6. Let o(p) = -p*2 - p - 3. Give m(a) - 2o(a). 3241a2 Let d(r) = -5r - 361. Let s be d(-67). Let y(b) = 10b - 39. Let f(h) = h - 5. Let q(g) = 6f(g) - y(g). Let i(o) = o - 2. Calculate si(x) - 6q(x). -2x - 2 Suppose 3s - 546 = -75s. Let d(q) = 4q + 7q2 - 4q - 5q. Let o(k) be the second derivative of 13k*4/12 - 3k*3/2 + k. Determine sd(a) - 4o(a). -3a*2 + a Let y(t) be the third derivative of 5t4/24 - t3/3 - 35t2 - 67. Let v(c) = -c - 1. Calculate 4v(d) + y(d). d - 6 Suppose -46t + 17t + 273 - 128 = 0. Let a(o) = o + 2. Let c(z) = -z*2 + z + 4. Let d be c(0). Let u(g) = -2g - 3. Determine du(r) + ta(r). -3r - 2 Let f(x) = 9x*2 + 3x - 3. Let b(o) = 18o2 + 5o - 5. Let u be (-23)/(276/(-120)) - 0. What is uf(w) - 6b(w)? -18w2 Let m(l) = -7l*3 - 3l - 5. Let y(f) = 421f + 4 - 419f + 0f3 + 6f*3. Suppose -6v + 168 = 36v. Give vm(p) + 5y(p). 2p*3 - 2p Let d(q) = -160q + 964. Let w be d(6). Let z(g) = g3. Let x(c) = 2c*3 + 2c*2 + 3. Determine wz(o) - x(o). 2o3 - 2o*2 - 3 Let v be 144(-4)/(-32). Let y(q) = 15q*2 - 7q - 7. Let b(w) = 8w2 - 3w - 3. Let n = -1710 - -1707. What is ny(t) + vb(t)? 11t2 Let x(y) = 2113y*3 - 6y + 6. Let n(h) = -65501h3 + 187h - 187. Give -6n(f) - 187x(f). -2125f3 Let z(q) be the third derivative of q3/6 - q2. Let x(y) = 106y + 3075. Let a be x(-29). Let t(n) = -4n3 + 2. Calculate at(f) - 2z(f). -4f*3 Let s(j) = -1636j*2 + 824j*2 + j + 816j*2. Suppose -4x + 3u + 1 = -10, 11 = 3x - 5u. Let c(k) = kx + 17k - 8k - 9k. Determine -5c(w) + s(w). -w2 + w Let d(w) = 1530w*3 - 37w*2 + 11w. Let s(i) = -1147i3 + 27i*2 - 8i. What is 8d(b) + 11s(b)? -377b3 + b2 Let j(y) = -5y*2 - 7y + 47. Let g(n) = -n*2 - n + 5. Give 3g(z) - j(z). 2z2 + 4z - 32 Let d(s) = -3s2 - 3s - 12. Let b(q) = -6q2 - 7q - 25. Let p = -30496 + 30505. Give pd(x) - 4b(x). -3x2 + x - 8 Let c(m) = -15m*3 - 4m*2 + 17m - 9. Suppose 96 = -48a - 96. Let n(b) = -7b*3 - 2b*2 + 8b - 4. Give ac(x) + 9n(x). -3x3 - 2x*2 + 4x Let y(q) = -2q3 - q2 + 247q - 4. Let g(s) = 10s3 + 4s*2 - 1236s + 22. What is 2g(z) + 11y(z)? -2z3 - 3z*2 + 245z Let g(d) = 1. Let i(y) = -2y - 2. Let o(n) = 4n*2 + n + 1. Let c be o(-1). Let l be 46/4(-184)/(-2116). What is cg(q) + li(q)? -2q + 2 Let w(c) = 79c + 23. Let d(r) = 224r + 65. Let z(y) = -6d(y) + 17w(y). Suppose 18 = 4p - p. Let q(v) = 2v2 - 5v + 7. Give pz(s) - q(s). -2s*2 - s - 1 Let x(q) = 84q - 58. Let i(g) = -20g - 1. Determine 4i(u) + x(u). 4u - 62 Let r(l) = -2l - 44. Let k(x) be the third derivative of x*3/6 + 209x*2 + 11. What is 12k(g) - r(g)? 2g + 56 Let k(z) = -18z*2 + 5z. Let d(c) = 25048c2 + 3c - 16c - 11c - 24958c2. Determine 5d(v) + 24k(v). 18v*2 Suppose -22g - g + 132 = 10g. Let r(l) = -3l - 4. Let j(a) = -10a - 11. Calculate gj(f) - 14r(f). 2f + 12 Let b(l) = 3l2 - 2l + 7. Let o(u) = -1. Let a(q) = -b(q) - 5o(q). Let p(m) = -10m*2 + 7m - 7. Let k = 54 - -86. Let n = -133 + k. Give na(y) - 2p(y). -y*2 Let g = -7641 - -7638. Let i(d) = -5d + 4. Let u(l) = -11l + 9. Give gu(s) + 7i(s). -2s + 1 Let k(c) = 281c + 20. Let y(r) = -285r - 19. Give -14k(x) - 15y(x). 341x + 5 Let l(p) = 15p*3 - 3p*2 + 5. Suppose 264j - 200 = 164j. Let u(y) = 8y3 - y2 + 2. What is jl(s) - 5u(s)? -10s3 - s2 Suppose 38b - 35 = -25 + 28. Let p(a) = -1. Let d(q) = -7q2 - 2q + 1. Give bd(z) + 4p(z). -7z2 - 2z - 3 Let i(k) = 35k - 34. Let b(f) = 45f - 33. Calculate 4b(x) - 5i(x). 5x + 38 Let c(k) = 579k - 189. Let r(w) = -340w + 94. What is 4c(m) + 7*r(m)?	{ "pile_set_name": "DM Mathematics" }
are there between 8:24 PM and 4:25 AM? 481 What is 610 minutes after 3:39 AM? 1:49 PM How many minutes are there between 3:15 AM and 10:19 AM? 424 What is 9 minutes after 4:06 AM? 4:15 AM How many minutes are there between 7:27 AM and 4:22 PM? 535 What is 485 minutes after 6:44 AM? 2:49 PM What is 204 minutes before 3:11 AM? 11:47 PM What is 391 minutes after 6:19 AM? 12:50 PM What is 503 minutes before 3:33 PM? 7:10 AM How many minutes are there between 6:16 PM and 11:48 PM? 332 What is 456 minutes before 8:53 PM? 1:17 PM What is 583 minutes before 8:04 AM? 10:21 PM What is 117 minutes before 8:08 AM? 6:11 AM What is 366 minutes before 2:52 AM? 8:46 PM What is 303 minutes before 8:44 AM? 3:41 AM How many minutes are there between 9:43 PM and 12:47 AM? 184 What is 246 minutes after 5:33 AM? 9:39 AM What is 175 minutes before 6:40 AM? 3:45 AM What is 462 minutes after 1:19 PM? 9:01 PM How many minutes are there between 7:14 PM and 12:18 AM? 304 What is 714 minutes before 2:46 PM? 2:52 AM What is 624 minutes before 12:15 PM? 1:51 AM How many minutes are there between 5:38 AM and 6:03 AM? 25 What is 159 minutes after 6:23 PM? 9:02 PM How many minutes are there between 3:55 AM and 11:19 AM? 444 What is 305 minutes before 10:14 PM? 5:09 PM How many minutes are there between 1:44 AM and 8:26 AM? 402 What is 331 minutes after 9:06 AM? 2:37 PM What is 77 minutes before 10:13 AM? 8:56 AM How many minutes are there between 10:03 AM and 7:50 PM? 587 How many minutes are there between 12:11 AM and 2:43 AM? 152 How many minutes are there between 9:54 PM and 7:30 AM? 576 How many minutes are there between 3:03 PM and 12:33 AM? 570 How many minutes are there between 11:00 AM and 12:07 PM? 67 How many minutes are there between 11:24 PM and 7:40 AM? 496 What is 578 minutes before 6:13 AM? 8:35 PM How many minutes are there between 11:05 PM and 7:07 AM? 482 How many minutes are there between 2:17 AM and 12:41 PM? 624 What is 295 minutes before 10:01 AM? 5:06 AM What is 491 minutes after 2:07 AM? 10:18 AM How many minutes are there between 6:57 AM and 9:25 AM? 148 What is 587 minutes before 7:29 AM? 9:42 PM How many minutes are there between 11:19 AM and 4:19 PM? 300 What is 585 minutes after 11:25 PM? 9:10 AM What is 644 minutes after 4:49 AM? 3:33 PM What is 661 minutes before 3:21 PM? 4:20 AM What is 662 minutes after 12:51 PM? 11:53 PM How many minutes are there between 8:08 PM and 3:18 AM? 430 How many minutes are there between 5:03 AM and 12:57 PM? 474 How many minutes are there between 8:55 AM and 4:14 PM? 439 What is 317 minutes after 10:08 PM? 3:25 AM How many minutes are there between 12:57 PM and 10:27 PM? 570 How many minutes are there between 1:14 AM and 6:06 AM? 292 What is 699 minutes before 9:11 PM? 9:32 AM What is 322 minutes after 7:05 AM? 12:27 PM How many minutes are there between 1:00 AM and 11:25 AM? 625 How many minutes are there between 9:28 AM and 6:27 PM? 539 How many minutes are there between 8:21 PM and 10:05 PM? 104 What is 404 minutes before 11:43 AM? 4:59 AM How many minutes are there between 10:38 AM and 1:16 PM? 158 How many minutes are there between 7:41 PM and 2:15 AM? 394 What is 69 minutes after 9:07 AM? 10:16 AM How many minutes are there between 4:25 PM and 7:11 PM? 166 How many minutes are there between 12:30 PM and 3:20 PM? 170 What is 149 minutes after 12:59 AM? 3:28 AM What is 82 minutes after 5:08 PM? 6:30 PM How many minutes are there between 9:24 AM and 7:06 PM? 582 What is 158 minutes after 5:47 AM? 8:25 AM How many minutes are there between 9:48 PM and 4:16 AM? 388 What is 704 minutes before 10:22 AM? 10:38 PM How many minutes are there between 6:49 PM and 1:20 AM? 391 How many minutes are there between 12:39 AM and 11:55 AM? 676 How many minutes are there between 11:42 AM and 3:48 PM? 246 How many minutes are there between 3:06 AM and 5:14 AM? 128 What is 136 minutes before 6:59 AM? 4:43 AM What is 630 minutes before 6:47 AM? 8:17 PM What is 414 minutes after 8:00 PM? 2:54 AM What is 681 minutes before 8:28 AM? 9:07 PM What is 2 minutes before 5:49 AM? 5:47 AM What is 204 minutes before 9:44 AM? 6:20 AM What is 556 minutes before 5:22 PM? 8:06 AM How many minutes are there between 1:09 PM and 1:59 PM? 50 What is 428 minutes before 10:02 AM? 2:54 AM How many minutes are there between 8:42 AM and 4:35 PM? 473 What is 677 minutes after 9:00 PM? 8:17 AM What is 386 minutes before 1:05 PM? 6:39 AM How many minutes are there between 3:52 PM and 9:20 PM? 328 What is 302 minutes after 10:06 AM? 3:08 PM How many minutes are there between 7:14 PM and 8:56 PM? 102 What is 35 minutes after 4:17 PM? 4:52 PM How many minutes are there between 2:09 AM and 3:41 AM? 92 How many minutes are there between 12:06 PM and 9:42 PM? 576 How many minutes are there between 8:41 PM and 11:15 PM? 154 What is 470 minutes before 12:44 PM? 4:54 AM How many minutes are there between 10:17 AM and 10:37 AM? 20 What is 401 minutes before 6:00 AM? 11:19 PM How many minutes are there between 11:53 PM and 1:23 AM? 90 What is 586 minutes before 11:07 PM? 1:21 PM What is 304 minutes after 4:28 AM? 9:32 AM How many minutes are there between 3:35 AM and 6:39 AM? 184 How many minutes are there between 7:26 AM and 11:39 AM? 253 How many minutes are there between 6:04 PM and 10:24 PM? 260 How many minutes are there between 2:57 PM and 1:17 AM? 620 What is 11 minutes before 1:52 AM? 1:41 AM How many minutes are there between 2:52 PM and 10:20 PM? 448 What is 641 minutes after 1:10 AM? 11:51 AM What is 250 minutes after 6:22 AM? 10:32 AM What is 652 minutes after 12:44 AM? 11:36 AM How many minutes are there between 9:30 PM and 6:14 AM? 524 What is 371 minutes after 5:17 AM? 11:28 AM What is 89 minutes before 6:57 AM? 5:28 AM What is 401 minutes before 9:37 PM? 2:56 PM How many minutes are there between 2:24 AM and 12:20 PM? 596 What is 318 minutes after 8:32 AM? 1:50 PM What is 286 minutes before 2:47 PM? 10:01 AM How many minutes are there between 9:41 PM and 8:24 AM? 643 How many minutes are there between 11:02 PM and 11:08 PM? 6 What is 401 minutes after 2:49 PM? 9:30 PM How many minutes are there between 1:14 AM and 10:33 AM? 559 What is 470 minutes after 12:35 AM? 8:25 AM What is 530 minutes before 6:57 PM? 10:07 AM What is 386 minutes before 3:44 AM? 9:18 PM What is 332 minutes before 6:17 PM? 12:45 PM What is 493 minutes before 12:04 PM? 3:51 AM How many minutes are there between 4:43 AM and 2:48 PM? 605 How many minutes are there between 3:20 AM and 3:29 AM? 9 How many minutes are there between 10:04 AM and 12:40 PM? 156 How many minutes are there between 3:46 AM and 3:19 PM? 693 How many minutes are there between 11:03 PM and 8:09 AM? 546 What is 295 minutes before 8:35 PM? 3:40 PM How many minutes are there between 5:19 PM and 1:06 AM? 467 What is 25 minutes after 1:28 PM? 1:53 PM How many minutes are there between 2:23 PM and 5:10 PM? 167 What is 165 minutes after 2:28 PM? 5:13 PM How many minutes are there between 7:38 PM and 3:24 AM? 466 How many minutes are there between 5:30 AM and 12:58 PM? 448 What is 56 minutes after 10:54 PM? 11:50 PM How many minutes are there between 9:58 PM and 3:22 AM? 324 How many minutes are there between 9:55 AM and 5:48 PM? 473 What is 472 minutes after 7:18 PM? 3:10 AM What is 223 minutes after 7:42 PM? 11:25 PM What is 468 minutes before 3:16 PM? 7:28 AM How many minutes are there between 1:46 AM and 9:25 AM? 459 How many minutes are there between 3:12 PM and 8:33 PM? 321 How many minutes are there between 7:11 PM and 9:45 PM? 154 How many minutes are there between 6:59 PM and 2:07 AM? 428 How many minutes are there between 3:16 AM and 5:13 AM? 117 How many minutes are there between 8:56 AM and 1:10 PM? 254 How many minutes are there between 3:14 PM and 4:16 PM? 62 How many minutes are there between 6:04 PM and 11:24 PM? 320 What is 454 minutes after 7:29 AM? 3:03 PM How many minutes are there between 11:11 PM and 8:27 AM? 556 How many minutes are there between 2:46 AM and 10:20 AM? 454 How many minutes are there between 10:09 PM and 8:05 AM? 596 How many minutes are there between 7:21 PM and 9:37 PM? 136 What is 317 minutes before 8:27 PM? 3:10 PM What is 508 minutes after 1:12 PM? 9:40 PM What is 246 minutes	{ "pile_set_name": "DM Mathematics" }
63) assuming l is positive. l*(-24/35) Simplify ((x(x/(x(2/7)/x))/x)20)(15/8) assuming x is positive. x(450/7) Simplify nnnn(-1/12)n*0/n(n/(n*(6/5)nn))/n(2/9) assuming n is positive. n(-91/180) Simplify (v(1/4)vv(-1/2))/(v(-2)/v(-4/11)) assuming v is positive. v(105/44) Simplify ((((ttt1)/t)/t)(-4/5))(-31/2) assuming t is positive. t(62/5) Simplify (i(-15)/(i23i))(-3/2) assuming i is positive. i(117/2) Simplify ((aaa*(-6/11)/aa)/(a/a(1/5)))/(a/a(-3/10)a(6/11)) assuming a is positive. a(-131/110) Simplify (h(-3/7)hh/h(-5/4))/((h/(h(-6/7)h))/(((h*(-3)h)/h)/h)) assuming h is positive. h(-57/28) Simplify k(-3)/k10 assuming k is positive. k(-13) Simplify (((i*(-6)/i)/ii)/(i(-2)/i))(-1/30) assuming i is positive. i(2/15) Simplify (y(-6/5)yy8)(2/41) assuming y is positive. y(78/205) Simplify (g(3/5)/g)(4/11) assuming g is positive. g(-8/55) Simplify ((t(2/29)/t)/t)/t(-4/7) assuming t is positive. t(-276/203) Simplify (s(1/2)/s)*20s*(-2/7)(ss/(ss*(-7)s))/ss assuming s is positive. s(-23/7) Simplify (v(-31)/v)/(v(v/(v/(vv/v(3/7)v))v)/v) assuming v is positive. v(-249/7) Simplify t(-16)t/(tt27) assuming t is positive. t(-43) Simplify (x/x(-6)x/x(1/4))/(x0)(-41) assuming x is positive. x(31/4) Simplify (r/(rr0))(-29)/((rrrr*(-1/4)rr)/r)(2/63) assuming r is positive. r(-5/42) Simplify w(-1/23)/(ww(2/81)) assuming w is positive. w(-1990/1863) Simplify ((hh/(hh*(1/15)h))/h)(-5/11) assuming h is positive. h(16/33) Simplify (i*7/(i(i*4i)/ii))/(ii*(-3)i(-5)) assuming i is positive. i8 Simplify (((m(-1/4)/m)/m)/((m(2/9)/m)/m))/((m/(mmmmm/(mm2)m))/m)7 assuming m is positive. m(739/36) Simplify s*5/ss*(-1/2)/ss*1s/(s*(-2/9)s)s assuming s is positive. s(85/18) Simplify (l/((ll1)/l))(-5/8)/(l*(-2)l(4/3)) assuming l is positive. l(2/3) Simplify (p*(-3/8)/(p/(p/((pp/(p/((p/(p*(1/9)p))/p))pp)/p))))(10/11) assuming p is positive. p(-455/396) Simplify (h/h9)/(h(4/11)h)(((hh/(hhh(-1)))/hhh)/h)(-4/13) assuming h is positive. h(-1383/143) Simplify t(1/14)/(t(-6)t) assuming t is positive. t(71/14) Simplify (l(-2/11)l)(-35/6) assuming l is positive. l(-105/22) Simplify w(www/(w/(w*(2/13)/w)))/ww(-32) assuming w is positive. w(-401/13) Simplify (q(-6))(-24/5) assuming q is positive. q(144/5) Simplify (p(3/17)/pp)/p(-3) assuming p is positive. p(54/17) Simplify (u(8/7)u)12 assuming u is positive. u(180/7) Simplify y*(-1/10)yy15/yyy assuming y is positive. y(169/10) Simplify z(1/4)z*0zz assuming z is positive. z(9/4) Simplify (y(2/27)yy(-6))/(yy0)(-39) assuming y is positive. y(920/27) Simplify z(-35)zz(3/29) assuming z is positive. z(-983/29) Simplify ((u*4u)/u(u/u(-2))/u)/((u(-6)u)/u6) assuming u is positive. u17 Simplify a/((a/(aa/a(-6)))/a)aaa*(-7)/a(a/(a*(2/3)/a))/(a/(aa/(a(a(aaaa2/aaa)/a)/a))) assuming a is positive. a(-2/3) Simplify dd*(1/6)d8 assuming d is positive. d(55/6) Simplify qq((q*11q)/q)/qqq(2/5) assuming q is positive. q(67/5) Simplify (c(-2))(-9)cc/(c*(6/7)c)(c/(c(1/5)c))/c assuming c is positive. c(593/35) Simplify d(2/15)d/((d4d)/d)(d/(d/d1dd))44 assuming d is positive. d(-703/15) Simplify p11/pppp(2/37) assuming p is positive. p(446/37) Simplify n/((nnn/((nn(-5)n)/n)n)/nn)n/n1(n(1/3))1 assuming n is positive. n(-20/3) Simplify ((q(-1/9)/q)/q)/q((qq/q*(-23))/qq)/q assuming q is positive. q(188/9) Simplify (q3)2 assuming q is positive. q6 Simplify (yy4y)/yyyy/y15 assuming y is positive. y(-7) Simplify (s(1/2)/ss*1)/(ss(1/4))(-13) assuming s is positive. s(67/4) Simplify (t1/t)(-13)/((((t(-2/7)tt)/t)/t)/t(-3)) assuming t is positive. t(-19/7) Simplify w/(www*(14/3)/w)w(9/10) assuming w is positive. w(-113/30) Simplify ((l(-1/7))13)(-13/2) assuming l is positive. l(169/14) Simplify x/(x/(x*(1/11)/x))x(5/2) assuming x is positive. x(35/22) Simplify ((vvv/(v*(3/4)v))/(((v/(v*(-10)vv)v)/v)/v))(-14/3) assuming v is positive. v(63/2) Simplify (l/l(-2/15))/l(-1/3)l/(l3/l)l*(-3)l assuming l is positive. l*(-23/15) Simplify ((vv*(-1)v)/v)*(-27)(v/v7)/v(-1/2) assuming v is positive. v*(-11/2) Simplify vv*19v(vvvv((v10/v)/v)/vv)/v assuming v is positive. v32 Simplify o(-17)/o(-17) assuming o is positive. 1 Simplify ((z5/z)/(zzz*(1/2)))/((zz*2z)/z1) assuming z is positive. z(-3/2) Simplify ((s/(ss0/s)s)/(s/s(-2)))(-1/5) assuming s is positive. s*(1/5) Simplify (yy*6)/(yy/(y/y(1/14))) assuming y is positive. y(83/14) Simplify p*(15/4)p(2/31) assuming p is positive. p(473/124) Simplify (b/(b/b42))/(b7/b) assuming b is positive. b36 Simplify (((u/u(-4/3)u)/u)/(uu*(-4)))/(u/(uu(2/9)/u))46 assuming u is positive. u*(-274/9) Simplify g/(gg*(-5/4))g(-1/21) assuming g is positive. g(101/84) Simplify ww34/www(w*(-2/17)/w)/ww assuming w is positive. w*(593/17) Simplify (zzz(-2/9)zzz(1/16))/(z/z1)(4/25) assuming z is positive. z(553/144) Simplify ((x*(-3/4)/xx)/(x/(xxx/x(-2))))/(x(2/11)xx4) assuming x is positive. x(-85/44) Simplify h*15h*(-12)h assuming h is positive. h*4 Simplify f/(ff*(12/7))f(-4/5) assuming f is positive. f(-88/35) Simplify (d(-7/10))25 assuming d is positive. d(-35/2) Simplify (v(1/3))*50v(2/33)/(v(1/4)v) assuming v is positive. v(681/44) Simplify ((l/l37)/l)/(l14/l) assuming l is positive. l(-50) Simplify ((q(-2)/qq)/q)7/(q/q(7/4)qq(4/9)) assuming q is positive. q(-781/36) Simplify (n(1/3))43(n(-2/3)n)(4/7) assuming n is positive. n(305/21) Simplify f*(-3/5)/((ff*(3/11)ff)/f) assuming f is positive. f(-158/55) Simplify ((c(-1)/c)/(c(-7)/c))/(c/c(-2/7))(-36) assuming c is positive. c(366/7) Simplify y(y*(4/11)y)/yy(-5)((y((yy*8/y)/y)/yyyyy)/y)/y(-4) assuming y is positive. y(114/11) Simplify (q/(qq*(1/3)q)qq*2q)10 assuming q is positive. q(80/3) Simplify (c(-5/3))(-44) assuming c is positive. c(220/3) Simplify ((r/(r0/r))/(r*(-7)r))/(rr(-2/7)r)(1/17) assuming r is positive. r(940/119) Simplify (c*2/(c/((cc(-4))/c)))/(c(-5/4)/(c*9c)) assuming c is positive. c(33/4) Simplify (f(-2/7)f(-1)/f)13 assuming f is positive. f(-208/7) Simplify (kk(-7/5))/(k(2/3)/k) assuming k is positive. k(-1/15) Simplify (a(-2/3))(-25) assuming a is positive. a(50/3) Simplify ((z/(z/(z*2zz)))/z5)(-33) assuming z is positive. z33 Simplify zzzzz/z(-2/25)zzz/z*(-2/7)z(z1)(-28) assuming z is positive. z(-3261/175) Simplify (p/((p5p)/p)pp/p*(1/5)p)/((p/(p/p*(-4)))/(pp(-1/4))) assuming p is positive. p(71/20) Simplify t*11/((t/(tt*(-5)/t)t)/t) assuming t is positive. t5 Simplify (z(-47)/z)/z(-8/3) assuming z is positive. z(-136/3) Simplify (j(2/9))36j(-3/5)j(-8) assuming j is positive. j(-3/5) Simplify b(2/11)/b(2/7) assuming b is positive. b(-8/77) Simplify (o/(o(-2)oo))(2/3)/(o/o3o/(oo(-1/6))) assuming o is positive. o(5/2) Simplify (l(-2))0/(l/((ll(-1/5))/l)ll/(ll/(l*9l)ll)) assuming l is positive. l*(-46/5) Simplify ((vvv/v(-1/9))/(v/(v(-14)v)))(3/13) assuming v is positive. v(-98/39) Simplify a7/(a/((a/a(-5))/a)) assuming a is positive. a11 Simplify (v6v)/(vv/(v/(v/(vv(-23)v)))v) assuming v is positive. v(-17) Simplify (p(pp(2/11))/p)(1/21) assuming p is positive. p(13/231) Simplify ((m4m)/mmm(1/3))/((m/m(1/2))/m)(-6/19) assuming m is positive. m(295/57) Simplify (i/(((iiiii*(-2/9)iii)/i)/i)ii/(i/((ii(2/19))/i))iii)48 assuming i is positive. i(896/57) Simplify (ii/(ii/i(1/3)))(-4/19)(i(2/9))40 assuming i is positive. i(1508/171) Simplify (q/q(2/7))(-35)(qq(-2/11))/(qq**4) assuming q i	{ "pile_set_name": "DM Mathematics" }
d*3 + 48d*3 - 31 + 50). -16d*5 + 38d*2 Expand (0 + 0 + 3)(-2 + 2 + 1)(-2q2 - q2 - 2q2) + (-2q + 2q + q)(0q + q - 2q). -16q2 Expand (q + 3q + 0q)(-q*3 - 2 + 2) + (2q - 2q + 2q*3)(-45 - 9q + 45). -22q*4 Expand (-3z + 3z + z)(-16z + 5z*2 + 16z + (-1 - 2 - 1 + 0 + 4 - 3 + (-5 + 1 + 2)(1 + 1 - 3))(-z*2 + 1 - 1)). 6z*3 Expand (1 - 1 + 3t + t + 10t + 0t + (-2 + 2 - t)(-1 + 3 + 0))(2t + 0 + 0)(-t*2 + 2t2 + t2). 48t4 Expand 2k*5 - 6k*5 - 5k5 + (k - k3 - k)(-22k*2 + 5k*2 + 2k*2). 6k*5 Expand (3h + 15h2 - 3h)(1 - 3 + 0 + (-1 + 3 - 1)(2 - 1 - 3) - 2 + 3 - 3 - 3 - 2 + 3). -120h2 Expand (1 - 2 + 0)(1 - z - 1)(0z - z + 0z)(0 - 3 + 0). 3z2 Expand (0v*2 + 2v*2 + 4v*2 + (-2v + 1 - 1)(2 + v - 2) + (2v + 3 - 3)(-40 + 4 - 26)(v - 3v + 3v))(3 - 4 - 1). 240v*2 Expand 3y - 3y - 2y*4 + (-2y*2 + 7y*3 + 2y*2 + (y + 3y - 6y)(-2y2 + 3y*2 - 3y*2))(-y + y + 3y). 31y*4 Expand (n - 4 + 4)(1 - 1 - n) - 46n2 - 6n*2 - 1188 + 1169. -53n*2 - 19 Expand (-5 + 5 + p)(-49 - 34 + 0). -83p Expand 142b - 24b + 242b + (-5b + 2b + 2b)(1 + 1 + 0). 358b Expand (2m*4 - 4m*4 + 0m*4)(1354 + 333 - 49). -3276m4 Expand -4y*2 + 2y2 + y4 - 2y4 + (-y3 + 5y*3 - 3y*3)(12 + 5y - 12) - 5y*3 + 5y*3 - 2y*4. 2y*4 - 2y*2 Expand 10c*4 + 20c*4 - 10c4 + (8 - 21 + 15 + c3)(-3c - c + 3c). 19c*4 - 2c Expand (-2 + 2 - 2h)(2h2 - 4h2 + h2) - h*3 - 2h*3 + 2h*3 + 3h*2 - 2h*3 - 3h*2 - 2 + (-300 - 27h*3 + 300)(3 + 1 - 5). 26h3 - 2 Expand (-2 + 2 + 2v*3)(2 + 4 - 4)(-142v - 690v + 154v). -2712v4 Expand (-2 + q + 2)(2q + 2q + 0q) + 6 - 6 + 4q*2 + (-5q + 4q + 3q)(-q - q + 0q). 4q2 Expand 3j + 2j4 - 3j + (0 - 1 - 1)(1 - 1 + 2j*4) + 18j*4 - 14j*4 + 404j*3 + j - 148j*3. 2j*4 + 256j*3 + j Expand (-2 + 0 + 1)(3l + 4l - 3l)(-212l3 + 109l*3 + 106l*3 + 15l). -12l4 - 60l*2 Expand (w - 2w + 3w)(0w + 5w - 3w)(46w2 - 89w + 89w). 184w*4 Expand (2 - 1 - 2)(f5 + f5 + f*5) + 4f5 + 18 - 18. f5 Expand (23h + 57 - 21 - 31)(-2 + 4 + 2). 92h + 20 Expand (-p2 + p3 + p2)(-82 + 82 + 36p). 36p*4 Expand (-14k + 18k - 72k)(-k3 + k3 - 3k - k*4). 68k*5 + 204k*2 Expand (14j*2 - 5j*2 - 12j*2)(23j - 105j*2 - 50j + 27j). 315j*4 Expand (-8y - 58 + 58)(-y2 + 0y2 - y2) + 6y3 - 8y*3 - 11y*3 - 2y*2 - 2y*3 + 2y*2 - 2y*2 - 2y*3 + 2y2. -y3 Expand (y4 - y4 - 2y4)(-2y + 0y + 3y) - 8y5 - y5 - 3y5 + (-2y*5 + 2y*2 - 2y*2)(-17 - 2 + 10). 4y5 Expand (1085 - 1085 - 119x)(-4x*3 + 10x*3 - 4x*3). -238x*4 Expand 4i - 5i - 4i + (-i - 2i + 2i)(-5 + 3 + 0) + 28i + 3i + 63i. 91i Expand (-59f*3 - 37f*3 + 65f*3)(2f + f2 - 2f) + 0f5 - 4f*5 + 2f*5. -33f*5 Expand (2j*4 + 2j*3 - 2j*3)(-3 - 3j + 3) + 7j5 + 45 - 45. j5 Expand (3t4 - t3 + t3)(-107t - 2 + 2 + 469t). 1086t5 Expand 9j*2 + 5j*2 + 0j*2 + 2j2 + j2 - j*2 + (-2j + 2 - 2)(j + 0j - 2j). 18j*2 Expand (-2f*2 + 0f*2 + 0f*2)((-5 + 2 - 2)(-5f - 7 + 7) - 4f + 0f + 5f + f + 0f + 2f). -58f*3 Expand (-1 + 5 - 2)(x - x - 4x)(16 + 40 - 8). -384x Expand (-2 - 2 + 1)(-1 - p + 1)(256 + 13 - 66). 609p Expand (3 + 2c - 3)(c3 + c3 + 0c3) + 5 - 2c*4 - 5 + (3c - c - 4c)(-20c + 20c - 6c3). 14c*4 Expand (-2a - 2a + 3a)(2 - 1 + 1) + (0 + 4a + 0)(3 + 3 - 4 + 0 + 5 - 3 + (5 + 1 - 5)(1 + 0 + 0)) + 5 + 11a - 5. 29a Expand -2a2 + 3a*2 - 4a*3 + 2a*3 + (-2a + 3a + a)(-3a2 + 10a - 10a). -8a3 + a2 Expand (1 + 0 + 1)(-6m*2 - 10m2 + m2)(-3 - 15m*2 + 16m2 - 2) + 2 - 2 + m4 + (-4 + 4 + 2m2)(-3m2 - 2m*2 + 3m*2) + m + 2m*4 - m. -31m*4 + 150m*2 Expand 0d + 0d - 2d + (-3d + 4d + 3d)(1 + 5 + 2). 30d Expand (-6x - x + 5x)(-3 - 7 - 3). 26x Expand (2 - 4 + 3)(0 + 4 + 0)(-319 + 319 + 22u)(-1 - 3 + 3). -88u Expand (k + 2k - 2k)(-1 + 3 - 4) + 2k - 2k - 4k + k - 3 + 3 + (-4 + 4 - k)(2 - 1 + 0) + 2k - 4k + k - 5k - 2k + 3k. -11k Expand (0 + 1 - 2)(6j - 4 + 4)(14j - 14j + 12j2). -72j*3 Expand -3496u*3 + 3496u*3 + 127u*5 - 4u*5 + 2u*5 + 0u5 + (-u3 - 2u3 + 4u*3)(0u2 - u2 + 2u*2). 126u*5 Expand -2r*2 + 2r - 2r + 5r*2 + 0r*2 - 1 - 3r2 + (-r2 + 4r2 - r2)(-130 - 130 + 224) - r*2 + 0r*2 + 3r*2. -70r*2 - 1 Expand (-31f - 40f - 2f)(-6 + 1 + 4). 73f Expand -145o5 - 145o*5 - 33o*4 + 288o*5 + 2o5 + o5 - o*5 + (-2o + 2o - o3)(2o2 - o2 - 3o*2). 2o*5 - 33o*4 Expand -13a*4 - 6a*4 + 21a*4 + (-3a*2 - 2a*2 + 9a*2)(a*2 + 5a*2 - 4a*2) + (1 - 5 + 2)(-2a4 + 0a*4 + 0a*4). 14a*4 Expand 1 + 29 - 23 + 23j3 + j2 - j2 + j3 + 0j3 + j3 - 2j3 + (-1 + 1 - j2)(2j + 0j + 0j) + 1 - j*3 - 1 + 2j*2 + 2j*3 - 2j*2. 22j*3 + 7 Expand (-2z + 2z + 2z + (-26z - 25z + 15z)(1 - 2 + 4 + (-3 + 0 + 1)(0 - 3 + 5)))(-3z + 3z + 3z). 114z*2 Expand (0f*2 + 3f*2 - 4f*2 + (5 - 4 + 0)(3f2 - 3f*2 + 2f*2))(-6f3 + 3f*3 - 4f*3). -7f*5 Expand (-6b*3 + 6b*3 - 6b*3)(5 + 4 + 0) + (5b - 5b - 2b2)(2b - 1 + 1). -58b*3 Expand -2r - 2r + 6r + 7r - 3r - 3r + (0 + 0 - 2)(1 - 1 - r) + 3r + 3r - 4r - r + 3r - r + 0 + 0 + 2r - 81 - r + 2r - 64 + 60. 11r - 85 Expand (10z - 3z2 - 10z)(-3z + z + 3z) + z3 + z3 + 2z3. z3 Expand (5x2 - 4x*2 - 2x*2 + (-x - 2x + x)(-1 + 1 + 2x) - 2x2 - 5x*2 + 5x*2 - 3x2 + x2 + 3x2)(-9 + 9 - 12) + x*2 + x - x. 73x*2 Expand (2 + 1 + 0)(3 - 3 - 2f)(-7f3 - 8f*3 - 2f*3) + 3f*4 + 0f*4 + 2f*4. 107f*4 Expand (-1 + 1 - 1)(2y + 2y + y) + y - 2y - 4y. -10y Expand 15x*2 + 2x*3 + 2x - 4x3 - 13x*2 + (2x*3 + 2x*3 - 2x*3)(8 - 5 + 6). 16x3 + 2x*2 + 2x Expand (2g + g - 2g)(4 - 4 - 2) - g + g - g - g + 0g - g + (-4 + 6 - 12)(12 - 4g - 12) + (-2g + 2g - 2g)(1 - 1 + 2). 31g Expand -4c*4 - 3c*4 + 5c*4 + (c + 4c + 0c)(3c3 + 3c*3 - 3c*3) - 3c*4 - 4c*4 + 5c*4. 11c*4 Expand (0c*2 + 0c*2 - 4c*2)(2c3 + 0c*3 + 0c*3) - 3c + 3c + 19c*5. 11c*5 Expand (-193k*2 - 227k*2 + 363k*2)(0k + 6k - k). -285k3 Expand -2q*3 + 33q*3 - 8q*3 + (4 + 2 - 4 - 1 - 2 + 2 + 2 + 2 - 5 + (4 + 2 - 4)(2 - 3 - 1) + 4 + 0 - 3)(14q*3 - 8q*3 - 10q*3). 35q*3 Expand (-27m - 14m + 12m)(-15m*4 + 25m*4 - 15m4) + (m4 + 0m4 - 3m*4)(-2 + m + 2). 143m5 Expand (-s3 + 3s*3 - 7s*3)(2923s + 67s*2 - 2923s). -335s5 Expand (2c*2 + 3c*3 + 0c*2 - 2c*4 - 3c*2)(4 - 3 - 6 + (0 - 3 + 5)(1 + 2 - 4)). 14c*4 - 21c*3 + 7c2 Expand (u2 - u*2 - 3u*3)(157 - 157 + 151u2). -453u*5 Expand (-4j*2 + 0j*2 - 4j*2)(16 + 19 - 5). -240j2 Expand 612d*4 + 223981d - 223981d + (-d + 2d + d)(-d3 + 2 - 2) - d4 + d4 + 2d*4. 612d*4 Expand 2m5 - m5 - 3m5 + (3m - 2m - 2m + (-1 + 3 - 4)(2 - 2 + 2m) - 2m + m + 0m)(-5m + 5m + 11m*3)(3m + m - m). -200m*5 Expand 12r*4 + 17r*4 - 10r*2 - 27r*4 + (-4r + 4r + 2r)(2r*3 - 2r*3 + 2r*3). 6r*4 - 10r*2 Expand (3h - h + 1 + 0h)(-58 + 108 + 92). 284h + 142 Expand (-4 + 4 + 2i)(1 + 4 - 4) + 4 - 4 + 2i + 755i - 781i + 1141i + 629i. 1748i Expand 1187s + 1003s - 1860s + (-4 + 3 - 1)(2s + 4 - 4) - 3s + s + 3s. 327s Expand (-19z*2 - 10z*2 - 11z*2)(2z + 4 - 4)(5 + 2 - 5)(-1 - 2 + 0). 480z*3 Expand (-703 + 1400 + 60j - 700)((-j + 2 - 2)(-2 - 1 + 1) + 3 - 3 + 3j). 300j*2 - 15j Expand (5y2 - 2 + 2)(27y + 81y + 125y) + 4y*3 + 3y*3 - 5y*3. 1167y*3 Expand (3q*3 + 2q*3 - 3q*3 + (15q - 7q - 5q)(7q*2 - 42q*2 + 10q*2))(-1 + 1 + 2q). -146q*4 Expand (-5z - 5z + 3z + (1 + 0 + 0)(3z + 3z - 5z))(9 + 5 - 11). -18z Expand (6 + 0 + 2)(4b - 4b - 2 - 20b) + 3b + b - 2b. -158b - 16 Expand (v - 3v - 4v)(3 + 1 - 3)(-v - 29v*4 + 32v*4 + 3v). -18v5 - 12v**2 Expa	{ "pile_set_name": "DM Mathematics" }
4 + -2. Suppose -hl + l = -3. Suppose -4j + lj - 8800002 = o, 0 = 2j + 4. Round o to the nearest one million. -9000000 Let n(h) = -62 + 704451h + 599961h + 513360h - 301095h. Let d be n(6). Round d to the nearest 1000000. 9000000 Let a = -314.7 + -66.3. Let p = -127.4 - a. What is p rounded to the nearest one hundred? 300 Let v be 10/3 - 2(-3)/9. Suppose -999492 + 3887489 = vy + 3g, -1443996 = -2y - 4g. Round y to the nearest 1000000. 1000000 Let o be 15/(7(-5)/(-35)). Let m be (8565 + 0)10/o. Round m to the nearest 1000. 6000 Let w = -3010 + 3009.995672. Round w to four decimal places. -0.0043 Let s = -0.1 + -0.75. Let n = 32405.85193 + -32405. Let l = s + n. Round l to 4 dps. 0.0019 Let n = -2832 + 1216. Let c = n - -1616.0002154. What is c rounded to five decimal places? 0.00022 Let i = 36.135199 - -5.864683. Let o = 31 - -11. Let f = i - o. Round f to five dps. -0.00012 Let r = 75 - 81.7. Let n = -163.3 + r. Let i = -170.142 - n. Round i to two decimal places. -0.14 Let i = 117.59 + 87.26. Let h = i + -194. Round h to the nearest integer. 11 Let o = 45500.60126 - 45493. Let d = 0.1 + 7.5. Let t = o - d. What is t rounded to 4 decimal places? 0.0013 Let r = -1003.4 - -1038.351. Round r to one dp. 35 Suppose -5q = 19 + 6, -2d - q - 110125 = 0. Round d to the nearest one thousand. -55000 Let r = -0.78 + 0.78. Let v = 0.238 - r. Let u = -0.087 + v. Round u to two decimal places. 0.15 Let x = 78.04 - 77.7127. Let f = 0.352 - x. Round f to 3 dps. 0.025 Let r = -2187836.63 - -2187666.630069. Let k = r + 170. Round k to 5 dps. 0.00007 Let b(f) = -f2 + f - 1. Let w be b(1). Let v be 28/(4/w)-162395. Let z = v + -521765. What is z rounded to the nearest one hundred thousand? 600000 Let t = 16885.23 + -16096.231388. Let v = 789 - t. What is v rounded to 4 dps? 0.0014 Let a = 317 + -361.8. Let b = -6.8 - a. Let c = -37.99999876 + b. What is c rounded to seven dps? 0.0000012 Let r = -186.036 + 0.036. Let u = 310 + r. Let a = -123.99647 + u. What is a rounded to four decimal places? 0.0035 Let y = 817.2 + 132.8. Let t = y - 911.7. Round t to the nearest ten. 40 Let o(z) = -z + 5 - 106z2 - 104z*2 + 207z*2 - 89z*3. Let q be o(5). Round q to the nearest 1000. -11000 Let z = 6635.00049545 - 6635. What is z rounded to 6 decimal places? 0.000495 Let y = -27669 + 24176. Round y to the nearest 10. -3490 Let c(z) = -4z*3 - 90z*2 - 57z - 111. Let i be c(-31). What is i rounded to the nearest one hundred? 34300 Let l(b) = -4305b + 8125. Let f be l(37). What is f rounded to the nearest one hundred thousand? -200000 Let s = -10786 + 10785.999969508. Round s to five decimal places. -0.00003 Let g be (-1 + -4)/(1/(-24)). Suppose 3u = 21, 1434t = 1431t + 4u - 16. Suppose g - 644 = -ti. What is i rounded to the nearest 100? 100 Let l = 32066.13121 + -32066. What is l rounded to two decimal places? 0.13 Suppose 60 = 59c - 55c. Let d be (-6558642)/c + 1/(-5). Let b = 12237243 + d. Round b to the nearest 1000000. 12000000 Let l = 2828.04 + -2752. Round l to the nearest 100. 100 Let x be (-109)/((-423)/210 - -2). Suppose -20y = -21y + x. What is y rounded to the nearest 100? 7600 Let k(l) = -62l + 3. Let h be k(-2). Suppose 352 = 15r + h. Suppose -rx - 190664 = 424336. What is x rounded to the nearest 100000? 0 Let k = -381.2 - 86.8. Let w = k + 535.4. Let m = w + -34.6. Round m to the nearest 10. 30 Let y(u) = 3u + 52. Suppose -55 = -2p - 37. Suppose 0 = 2t + 3s + p, -2t - 7 - 7 = 2s. Let m be y(t). Round m to the nearest one hundred. 0 Let v(d) = 2694d - 6. Let t be v(4). Suppose -803775 = 8b + 158065. Let a = b - t. Round a to the nearest 10000. -130000 Suppose -248 + 7 = -3v - 2i, 3i = 4v - 293. Let d = v + -65. Let o be d/((23/13)/(-2000)). What is o rounded to the nearest 10000? -50000 Let p = -14401 + -15979. Round p to the nearest 10000. -30000 Let j = 50 + -45. Suppose 3f = -3i + 48, -2i - 8 = -3i - jf. Suppose -ih + 23h - 1765 = 0. What is h rounded to the nearest 10? 350 Let q = -3851 - -6288. Let m = -1027 + q. What is m rounded to the nearest one hundred? 1400 Let d(k) = -504k - 1539. Let m be d(-13). What is m rounded to the nearest one thousand? 5000 Let u = -634.8 - -634.810208. Round u to four decimal places. 0.0102 Let s = -150 + 142. Let t = s + -10.6. Round t to the nearest integer. -19 Let c = -30302 + 29806.72. Let g = c - -476. Round g to zero decimal places. -19 Let q = 14940 + -14940.0000044898. What is q rounded to 6 dps? -0.000004 Let j = -12.32883 - -13.0905. Round j to 2 dps. 0.76 Let b = -362 + 802. Let o = 439.99557 - b. What is o rounded to 3 decimal places? -0.004 Let a = 1326.114 - 1323. Let w = a - 3.14137. What is w rounded to 3 dps? -0.027 Let q = -3772.005295 - -3772. What is q rounded to 4 dps? -0.0053 Let q = 24114.79843 + -24115. Let g = 0.202 + q. What is g rounded to four dps? 0.0004 Let r = 1138.94 + -0.94. Let o = r - 612.4. Round o to the nearest ten. 530 Let r = -0.59 + 9.59. Let y = r + -9.125. Let u = 0.12666 + y. What is u rounded to four decimal places? 0.0017 Let h = 243.291879 + -0.578379. Let j = 242.1 - h. Let g = -0.6 - j. Round g to three decimal places. 0.014 Let o = 13732.0007158 + -13732. What is o rounded to 5 dps? 0.00072 Suppose h + 4z = 2340, z - 8 = -13. What is h rounded to the nearest one thousand? 2000 Let r be (17 - 7 - 165)/(1/(-129773)). Let s = r + -35584815. What is s rounded to the nearest one million? -15000000 Let n = -124794.5839 - -124789. Round n to one dp. -5.6 Let r = -11433 + 11433.000011111. What is r rounded to 7 dps? 0.0000111 Let f be (2489 - -2(-1)/(-2))/((-1842)/(-40769600)). Round f to the nearest 100000. 55100000 Let p = -0.355 - -182.355. Let r = p - 181.998744. Round r to five decimal places. 0.00126 Suppose -6d = -9940058 + 1684346. Suppose 0z + 5z = v + 1719929, 4z - 3v = d. Suppose -5m - 22 = -7, 4n + z = 5m. Round n to the nearest ten thousand. -90000 Let q = 24824255 - 24824255.15999287. Let s = -0.16 - q. Round s to 6 decimal places. -0.000007 Suppose 0l - 1010 = -5l. Let d = l - 205. Round d to the nearest ten. 0 Let i(r) = r + 7. Let k be i(-5). Let z(w) = kw - 8w*2 - 200000 - 8w2 + w3 + 17w2. Let n be z(0). Round n to the nearest ten thousand. -200000 Let r = 6737 + -6736.982016. What is r rounded to four decimal places? 0.018 Let h = 551.8902 - -0.1098. Let y = h + -552.00061. What is y rounded to 3 dps? -0.001 Let c = 656001 + -656530.929. Let z = c + 462.37. Let p = -0.141 + z. What is p rounded to the nearest ten? -70 Let w(p) = -7p - 1. Let a(j) = -8j - 3. Let o(b) = 2a(b) + 6w(b). Suppose -2u - 3u - 95 = 0. Let y be o(u). Round y to the nearest one hundred. 1100 Let f = 1278 + -1273. Suppose 4r + 3q = 6q + 4145, 2q - 5210 = -5r. Suppose -5a + a - 4160 = fd, -3d = -a - r. Round a to the nearest 100. -1000 Let q = 42000128974 + -42000130212.99998973. Let c = 1239 + q. Round c to 6 dps. 0.00001 Let l = 10.9416 - 2.2601. What is l rounded to one dp? 8.7 Let j = 49.33 - 49. Let l = 254 - 253.807. Let g = l - j. What is g rounded to 2 decimal places? -0.14 Let g = 59 - 60. Let x = g - -13. Let b = x + -12.00000536. Round b to six dps. -0.000005 Let b = 226.4805 - 226.32. What is b rounded to 1 decimal place? 0.2 Let f = -57195.2418 + 57200. Round f to one decimal place. 4.8 Let j = 37502 - 54802. What is j rounded to the nearest one million? 0 Let t = -65822 - -65822.048257. Round t to 2 dps. 0.05 Let p = -54424 - -54327.732. Let f = p + 96. Let z = 0.268159 + f. What is z rounded to five decimal places? 0.00016 Let b = 1.382 + -1.24. Let p = b - 71.142. Let l = 71.51 + p. What is l rounded to one decimal place? 0.5 Let r = 5.602 + 0.098. Let a = 2644 - 2650.036. Let w = a + r. What is w rounded to 2 decimal places? -0.34 Suppose -174 - 78 = 21o. Let l be (-2)/(-6)-6451 + (-4)/o. Round l to the nearest 100. -2200 Let y = 466 - 147. Let h = -318.999911 + y. Round h to 5 dps. 0.00009 Let x be (98 - 46) + 1(-1 - 0). Suppose 2u + x = -69. Let s be u/(-2 - (-677)/340). What is s rounded to the nearest one thousand? 7000 Let t = -27 + 24. Let p be (1 - -2) + (t - -3). Suppose 3r - pk = -612000, -5r - 5k = -3r + 408000. Round r to the nearest ten thousand. -200000	{ "pile_set_name": "DM Mathematics" }
base 5, what is -1214311 - 244? -1220110 In base 6, what is -111445 + -21? -111510 In base 7, what is -25320 + 14? -25303 In base 4, what is -11 - 122000? -122011 In base 2, what is -101001 - 110010001011? -110010110100 In base 16, what is -1 - 376a1? -376a2 In base 5, what is -202342031 + 0? -202342031 In base 14, what is 72b + -d9? 632 In base 8, what is 5101 + 1324? 6425 In base 14, what is -236699 + -4? -23669d In base 16, what is -4f - -71f? 6d0 In base 5, what is -224031 + -3? -224034 In base 12, what is -97 + 5a52? 5977 In base 15, what is -13 - 599d? -59b1 In base 12, what is 1166b5 - 5? 1166b0 In base 11, what is -13a9 + 23? -1386 In base 8, what is -2 - 171071? -171073 In base 4, what is 11 - -3213223312? 3213223323 In base 16, what is 21ff - 15? 21ea In base 3, what is -100 - -10221021222? 10221021122 In base 14, what is -15800 + 1? -157dd In base 13, what is 236ba6 + -2? 236ba4 In base 14, what is 4 + -515a5? -515a1 In base 5, what is -102002133 - -2? -102002131 In base 4, what is 11 + -333212? -333201 In base 12, what is -145 + 314? 18b In base 13, what is 3554 + 12? 3566 In base 10, what is 57845 + 44? 57889 In base 13, what is 43462 - -8? 4346a In base 13, what is -8c87 + 1? -8c86 In base 3, what is -2 + 2122000222011? 2122000222002 In base 3, what is -110000201022 - -1? -110000201021 In base 6, what is -1 - -11130031? 11130030 In base 7, what is 4 - 110032? -110025 In base 7, what is 46246 - -160? 46436 In base 6, what is 0 + -21524435? -21524435 In base 7, what is -2 + 122165? 122163 In base 4, what is -22 - 3313222? -3313310 In base 8, what is 164710 + -11? 164677 In base 12, what is 369 - 202? 167 In base 14, what is 11a + 58d? 6a9 In base 11, what is -301 - 129? -42a In base 2, what is 10000000101111 + 1101011? 10000010011010 In base 9, what is -234 + -1042? -1276 In base 7, what is -44506 - -1022? -43454 In base 7, what is -4504150 + 4? -4504143 In base 9, what is 1461658 - 1? 1461657 In base 11, what is -63a - a4? -733 In base 13, what is 38a1 + -5? 3899 In base 12, what is -9375 + 26? -934b In base 13, what is 6 + 1c7b? 1c84 In base 12, what is -63 + -74? -117 In base 4, what is 0 - 30301323? -30301323 In base 12, what is -4b - 23b4? -2443 In base 4, what is 1200 - 3102312? -3101112 In base 9, what is -35868 + 2? -35866 In base 7, what is -2040634 + 5? -2040626 In base 4, what is -33211021 - -201? -33210220 In base 4, what is -1002 + 23333? 22331 In base 8, what is 16333 + -17? 16314 In base 3, what is -222 + -2222211? -10000210 In base 5, what is 3031 - 21402? -13321 In base 3, what is 2011200 + 2002? 2020202 In base 2, what is 10101011110000 + -1? 10101011101111 In base 11, what is -1047 + 83? -a74 In base 5, what is 203141 - 210? 202431 In base 7, what is 1032466 - 5? 1032461 In base 7, what is 3320046 + -2? 3320044 In base 4, what is -10332 + 2231? -2101 In base 12, what is -22 + 5b? 39 In base 4, what is 200210222 + -1? 200210221 In base 14, what is 17 - 6a6? -68d In base 16, what is 5 + -db46? -db41 In base 2, what is 11000000100001 - -11? 11000000100100 In base 3, what is 1010011020 - -21? 1010011111 In base 6, what is -3330 + -305? -4035 In base 10, what is -685659 + -4? -685663 In base 10, what is 104 - -569? 673 In base 3, what is -10001212 + -2101? -10011020 In base 5, what is 14 + -240124? -240110 In base 16, what is -27f - 139d? -161c In base 9, what is 13 - 11833? -11820 In base 4, what is 1020020 + -101? 1013313 In base 9, what is -261711 - 4? -261715 In base 7, what is 32 + 343416? 343451 In base 13, what is 1458 - -10? 1468 In base 15, what is 46 - 10da2? -10d5b In base 3, what is -12 - 11002202201? -11002202220 In base 7, what is -224424 - -14? -224410 In base 12, what is -21 - 4396? -43b7 In base 4, what is 101021 - 11? 101010 In base 6, what is 2242451 + 3? 2242454 In base 16, what is -8 + 220de? 220d6 In base 2, what is -1011110101101010 + 11? -1011110101100111 In base 3, what is 200010201222 - 11? 200010201211 In base 6, what is 51553 - 0? 51553 In base 9, what is -1712677 + -4? -1712682 In base 10, what is 385 - -34? 419 In base 16, what is 5c + bba? c16 In base 2, what is -100110 + -1111010010? -1111111000 In base 6, what is 1 - 2111052? -2111051 In base 5, what is 440042433 - 10? 440042423 In base 2, what is 1001110100110001000 - 111? 1001110100110000001 In base 8, what is 65564 - -52? 65636 In base 8, what is -34 + 3027? 2773 In base 2, what is 10111110111110 + 1000? 10111111000110 In base 2, what is 110000001010 + 10101000? 110010110010 In base 7, what is -34500 + 3? -34464 In base 11, what is 275436 - -4? 27543a In base 12, what is 30 + 556b? 559b In base 11, what is 1696 + 42? 1728 In base 11, what is 2510 + 142? 2652 In base 8, what is 132262 + 2? 132264 In base 3, what is 212102020 + 10? 212102100 In base 2, what is 10110101 + -1010001100000? -1001110101011 In base 16, what is 10 - -6253? 6263 In base 5, what is -3 + -11203104? -11203112 In base 3, what is -2012 - 22220? -102002 In base 15, what is -533e4 - 0? -533e4 In base 4, what is 11012 - -201230? 212302 In base 6, what is -1231545 + -2? -1231551 In base 3, what is -10102002020 - -100? -10102001220 In base 4, what is -1230 + 1230? 0 In base 8, what is 146 + -2240? -2072 In base 12, what is 60a68 - 5? 60a63 In base 8, what is 151 + 62556? 62727 In base 16, what is d8b + 6? d91 In base 6, what is 4 + 544224? 544232 In base 6, what is 34 + 1413? 1451 In base 15, what is 4 - 20ae? -20aa In base 15, what is -24 - -221? 1ec In base 4, what is 110 + -101021001? -101020231 In base 12, what is -4095 + 10? -4085 In base 16, what is -5 + 8160? 815b In base 3, what is -21020202 - 20? -21020222 In base 16, what is 4 + 100? 104 In base 10, what is 0 + 2033? 2033 In base 11, what is -41 - 4116? -4157 In base 16, what is 49 + -a953? -a90a In base 10, what is 38627 + 25? 38652 In base 15, what is 1eba - b? 1eae In base 9, what is 3 + 23801? 23804 In base 16, what is -56f + -134? -6a3 In base 12, what is -14 - -6b44? 6b30 In base 5, what is -23102422 - -1? -23102421 In base 10, what is 458 + 52? 510 In base 9, what is 2 + 165648? 165651 In base 3, what is -20212 + 22202100? 22111111 In base 6, what is 130132310 - -5? 130132315 In base 12, what is 4 - 1932? -192a In base 4, what is 31322 - 233? 31023 In base 5, what is -110133 + 1340? -103243 In base 10, what is -8983 + -4? -8987 In base 7, what is 5 - 132334? -132326 In base 4, what is 1313 - 1030013? -1022100 In base 7, what is 1451 - 2661? -1210 In base 7, what is -3213643 + -4? -3213650 In base 11, what is 125 + -a147? -a022 In base 11, what is -43 - -1a0? 158 In base 12, what is ba + -8b7? -7b9 In base 16, what is -378 + 503? 18b In base 2, what is -100101 - -10000100? 1011111 In base 2, what is -10 - 1100111001011001? -1100111001011011 In base 15, what is -51b19 - 1? -51b1a In base 6, what is 201012402 - 4? 201012354 In base 13, what is -5 + 353b6? 353b1 In base 13, what is 1815 - -54c? 2064 In base 10, what is -1 + 18214? 18213 In base 9, what is -4 - -37537? 37533 In base 5, what is 224042 - -23? 224120 In base 3, what is -1200 - -21110? 12210 In base 3, what is 11021210102 - 21? 11021210011 In base 7, what is 425 + -436? -11 In base 8, what is -2556 + -276? -3054 In base 16, what is 9 + 844? 84d In base 14, what is -102d6 - 52? -10348 In base 15, what is 2 + 7543? 7545 In base 14, what is 44659 + -3? 44656 In base 8, what is -561113 - -6? -561105 In base 4, what is 10031 - -11231? 21322 In base 14, what is 78b659 + 4? 78b65d In base 16, what is -3c7 - -3d? -38a In base 2, what is 101 + 11101010001001111? 11101010001010100 In base 13, what is 8c - 22c? -170 In base 6, what is -50111 + -1004? -51115 In base 13, what is 1705 - -3? 1708 In base 4, what is 31310230 - -11? 31310301 In base 16, what is 10 + 6c6? 6d6 In base 13, what is -37720 - -4? -37719 In base 8, what is 0 - -230044? 230044 In base 12, what is -92 - 2b? -101 In base 5, what is 4120 + -1244? 2321 In base 9, what is 526 + 26? 553 In base 4, what is 10 + 211303302? 211303312 In base 16, what is 2 - d3c4? -d3c2 In base 6, what is 11 + 104125? 104140 In base 9, what is -147 - -5828? 5671 In base 11, what is -1a873 - -2? -1a871 In base 14, what is 8069 + 0? 8069 In base 2, what is 10100010010010000000 + 10? 10100010010010000010 In ba	{ "pile_set_name": "DM Mathematics" }
39 a composite number? True Is 10275257 a prime number? False Is 375917 prime? False Is 285830731 prime? True Is 9917899 prime? False Is 427313 prime? False Is 3907249 composite? False Is 14446394 composite? True Is 24214273 a composite number? True Is 6072293 a composite number? False Is 311395889 composite? True Is 320559 prime? False Is 83733863 composite? False Is 670531 a composite number? True Is 13160651 prime? False Is 14981651 prime? True Is 24990247 composite? True Is 29700691 composite? True Is 11515367 a composite number? False Is 42986159 prime? True Is 365927 prime? False Is 81329323 prime? True Is 553051 prime? True Is 59338817 prime? True Is 3800411 a composite number? True Is 177320861 composite? True Is 67619141 a composite number? True Is 859631 composite? True Is 84092251 composite? True Is 61196377 prime? False Is 8451293 a prime number? True Is 58987087 a composite number? True Is 1028303 composite? False Is 59961011 composite? True Is 4658957 a prime number? True Is 6332489 composite? True Is 11379163 composite? True Is 535915 a composite number? True Is 99399889 a composite number? False Is 53995463 composite? True Is 65551 a composite number? False Is 65510239 a composite number? True Is 692217335 a prime number? False Is 1284691 a composite number? False Is 1087871417 a composite number? False Is 10106077 a prime number? True Is 1287955 a composite number? True Is 2927297 prime? False Is 799801 composite? False Is 10741483 a prime number? False Is 58583399 a composite number? True Is 2036843 prime? False Is 5317067 prime? False Is 834433 a composite number? False Is 4604839 a composite number? True Is 15089791 prime? True Is 101357 composite? True Is 4051051 a composite number? False Is 161327 composite? True Is 10009777 a prime number? True Is 2598503 a composite number? False Is 102393569 composite? False Is 20043895 a composite number? True Is 1791859 prime? False Is 60683263 composite? False Is 31234471 a composite number? True Is 176591 prime? True Is 17595359 a composite number? False Is 524299447 prime? False Is 1815131 a prime number? True Is 18671063 prime? False Is 2272714 prime? False Is 345133 prime? True Is 79114481 a composite number? True Is 19361857 a prime number? True Is 87952289 composite? False Is 74280223 prime? False Is 3592673 composite? True Is 25907797 a composite number? True Is 207556933 a composite number? False Is 4333265 a composite number? True Is 11475881 prime? True Is 10255205 a composite number? True Is 65778463 a composite number? True Is 2594743 a composite number? True Is 106919257 a prime number? True Is 234518779 a composite number? True Is 77979611 a prime number? False Is 9692899 composite? False Is 4215157 a composite number? False Is 97771 a composite number? False Is 56594479 a composite number? True Is 3271421 a composite number? True Is 1487405 a composite number? True Is 66287623 a prime number? True Is 52463687 a prime number? False Is 8311091 a composite number? True Is 210171931 a prime number? False Is 89152753 composite? False Is 13081981 a prime number? False Is 2367329 prime? True Is 117420731 a composite number? True Is 1163441 prime? True Is 3750293 composite? False Is 115139593 prime? True Is 209728037 prime? True Is 10063619 a prime number? True Is 3337619 composite? False Is 182069243 prime? True Is 5838979 composite? True Is 12169777 a composite number? True Is 23967565 a prime number? False Is 4143101 a composite number? False Is 488567 a composite number? False Is 2614327 a prime number? True Is 42887347 composite? True Is 45542161 composite? True Is 27232307 a prime number? True Is 1399351 prime? True Is 209081557 prime? True Is 9501241 prime? False Is 939151 composite? True Is 49518779 a prime number? True Is 13313033 a prime number? True Is 393947 a prime number? True Is 13971073 prime? True Is 124648369 a prime number? False Is 4669541 composite? True Is 88643 a prime number? True Is 754558529 a composite number? False Is 2452181 a prime number? True Is 246704543 a prime number? True Is 105774329 composite? True Is 8297669 prime? True Is 37348819 prime? True Is 16623133 composite? False Is 15341101 prime? False Is 42831697 prime? False Is 9653437 a composite number? True Is 236809 a composite number? True Is 3967993 a prime number? True Is 10102985 a composite number? True Is 348311 a composite number? True Is 628417 a composite number? True Is 47533303 a composite number? False Is 1748386 a prime number? False Is 31921111 prime? True Is 389153 composite? True Is 866087 a prime number? True Is 1125419 a composite number? False Is 4065113 prime? False Is 18353393 prime? True Is 1173869 a composite number? True Is 8255855 composite? True Is 3484631 a composite number? True Is 299603 composite? False Is 1358437 composite? False Is 192217247 prime? False Is 3764743 a prime number? False Is 4603943 a composite number? True Is 6747029 prime? False Is 11477003 a composite number? False Is 179503759 prime? True Is 32409271 composite? False Is 10923949 composite? True Is 4329581 a prime number? True Is 192312221 prime? True Is 5117899 composite? False Is 68166337 a prime number? True Is 218329549 a prime number? False Is 229959529 composite? True Is 18632129 a composite number? False Is 117699397 composite? True Is 125109539 a composite number? False Is 1475867 a composite number? True Is 11824501 a composite number? True Is 9590723 composite? False Is 119751313 composite? True Is 28062467 a prime number? False Is 696809 a composite number? False Is 15846857 prime? False Is 4413601 a composite number? True Is 9730577 a prime number? True Is 5568961 a composite number? False Is 105811327 prime? False Is 13313393 composite? False Is 99423053 a prime number? False Is 1819367 a prime number? False Is 40126897 composite? False Is 12053281 composite? False Is 149817061 a composite number? True Is 85421233 prime? True Is 16502023 composite? False Is 12286419 a prime number? False Is 203838031 composite? True Is 123052187 prime? False Is 44043697 a composite number? True Is 46751279 a prime number? True Is 75790379 composite? True Is 645453713 prime? False Is 214105841 a composite number? False Is 4436711 a composite number? True Is 324522277 prime? False Is 4148951 a composite number? True Is 1764541 composite? False Is 19205839 composite? False Is 19981867 a composite number? False Is 2210618 prime? False Is 21354715 a composite number? True Is 13425443 prime? True Is 542675417 prime? True Is 50183219 prime? True Is 4903453 a composite number? False Is 19066461 a composite number? True Is 122166419 composite? False Is 1570622 a composite number? True Is 4919615 a composite number? True Is 5298467 a prime number? True Is 2325179 a prime number? False Is 8534039 a prime number? False Is 93549361 a composite number? False Is 3842077 a composite number? False Is 3643599 a composite number? True Is 51189689 composite? True Is 554213302 composite? True Is 8105597 composite? True Is 15365629 a prime number? True Is 1208167 composite? True Is 5776439 a composite number? False Is 2465881 a prime number? False Is 13084601 composite? False Is 78606581 a prime number? True Is 1999423 a composite number? False Is 758845 composite? True Is 4710623 a composite number? False Is 21217943 prime? True Is 2104513 a prime number? False Is 6506537 a prime number? False Is 59602593 prime? False Is 74800805 a prime number? False Is 221514739 composite? True Is 4188617 a composite number? False Is 908993 a composite number? False Is 64349591 prime? True Is 5969501 a composite number? True Is 148483527 composite? True Is 24206887 composite? True Is 5919841 composite? True Is 58393861 a composite number? True Is 490097 a prime number? True Is 26557567 a composite number? False Is 10656571 composite? True Is 2346611 composite? False Is 16164859 prime? True Is 34231 a composite number? False Is 530046139 composite? True Is 1672301 a composite number? False Is 3055043 a prime number? True Is 6358393 prime? False Is 5002837 prime? False Is 81807403 prime? True Is 2739613 composite? False Is 644065 a prime number? False Is 64511627 a composite number? True Is 3048411 composite? True Is 4527554	{ "pile_set_name": "DM Mathematics" }
.21 What is -6793.51 rounded to the nearest 1000? -7000 Round -0.020867686 to 3 dps. -0.021 Round 1174332 to the nearest 10000. 1170000 Round 13108930 to the nearest 10000. 13110000 Round -0.000000433374 to 7 decimal places. -0.0000004 Round 540131.58 to the nearest 100. 540100 What is 0.0025447558 rounded to four dps? 0.0025 What is 117725.1 rounded to the nearest one thousand? 118000 What is -0.000164809 rounded to 6 decimal places? -0.000165 Round 110.0398 to 1 dp. 110 What is 405677 rounded to the nearest one thousand? 406000 Round 0.00001849955 to 7 dps. 0.0000185 Round -2139110 to the nearest 10000. -2140000 What is 0.000028227806 rounded to 6 dps? 0.000028 What is -0.0001740528 rounded to six dps? -0.000174 Round 5.6146722 to 1 decimal place. 5.6 What is -11.681173 rounded to two dps? -11.68 What is 7.903097 rounded to 1 dp? 7.9 What is 6386258000 rounded to the nearest one million? 6386000000 Round 0.203083 to three dps. 0.203 Round 189.1717 to the nearest ten. 190 Round 0.0163256 to five dps. 0.01633 Round -1191310 to the nearest 100000. -1200000 What is -16259.8 rounded to the nearest one hundred? -16300 Round 0.0744828 to four dps. 0.0745 Round -68.42991 to the nearest integer. -68 What is 0.050681 rounded to four dps? 0.0507 Round 0.0018960351 to 4 dps. 0.0019 What is 5640320.3 rounded to the nearest one thousand? 5640000 What is -746695 rounded to the nearest ten thousand? -750000 Round 4508.83 to the nearest 10. 4510 What is 0.000856512 rounded to five dps? 0.00086 Round 51537.46 to the nearest one hundred. 51500 Round -0.00198014 to 3 dps. -0.002 Round -0.883063 to three decimal places. -0.883 What is 1961185 rounded to the nearest 1000? 1961000 What is 0.00319894 rounded to 5 dps? 0.0032 What is 89.88793 rounded to one decimal place? 89.9 Round -10.508865 to the nearest integer. -11 Round 0.66612705 to 3 decimal places. 0.666 Round 13414015 to the nearest 1000000. 13000000 Round 0.0000001441499 to seven decimal places. 0.0000001 What is 2.012848 rounded to three decimal places? 2.013 What is -0.0131138 rounded to 3 dps? -0.013 What is 0.18660149 rounded to 2 decimal places? 0.19 What is -6438137 rounded to the nearest 1000000? -6000000 What is 3.58422 rounded to 2 decimal places? 3.58 Round -329206.8 to the nearest 1000. -329000 What is 0.004820688 rounded to 4 dps? 0.0048 Round 912.97842 to the nearest 10. 910 What is 293.8879 rounded to one decimal place? 293.9 What is 13512.126 rounded to the nearest 100? 13500 Round 6.89 to the nearest integer. 7 What is -64390.43 rounded to the nearest 1000? -64000 Round -8539.773 to the nearest one thousand. -9000 What is -0.0013245431 rounded to five decimal places? -0.00132 What is -0.0455564 rounded to 4 dps? -0.0456 Round -0.000023896234 to six decimal places. -0.000024 Round -0.000255515 to 7 dps. -0.0002555 Round -0.0115896 to 2 dps. -0.01 Round 20688.34 to the nearest 10000. 20000 Round -229794830 to the nearest one million. -230000000 What is -199.0488 rounded to zero decimal places? -199 Round -2.59699 to 1 decimal place. -2.6 What is -0.036357 rounded to 4 decimal places? -0.0364 What is -0.00012806269 rounded to 5 decimal places? -0.00013 Round -61063000 to the nearest 1000000. -61000000 Round 0.000007965079 to six decimal places. 0.000008 Round 0.3626614 to one dp. 0.4 What is -0.00001510178 rounded to six dps? -0.000015 Round -26279700 to the nearest 100000. -26300000 Round -0.0195476 to 3 dps. -0.02 What is -16.1126 rounded to the nearest integer? -16 Round -0.0011285597 to 7 dps. -0.0011286 What is 971.739 rounded to zero decimal places? 972 Round 2386.25 to the nearest one hundred. 2400 What is 0.000110852 rounded to 6 decimal places? 0.000111 What is -0.07620343 rounded to 2 decimal places? -0.08 Round 16195300 to the nearest one hundred thousand. 16200000 What is 680260 rounded to the nearest one thousand? 680000 What is 18861000 rounded to the nearest one hundred thousand? 18900000 Round -1516410 to the nearest one thousand. -1516000 Round 0.000000726254 to seven dps. 0.0000007 What is -296.311 rounded to one dp? -296.3 What is 0.001430149 rounded to 5 dps? 0.00143 What is -0.17834 rounded to four dps? -0.1783 Round 7.57651 to the nearest integer. 8 Round -0.000051141 to 5 dps. -0.00005 Round -1862.712 to the nearest one thousand. -2000 Round 228.0964 to zero dps. 228 What is 385957 rounded to the nearest ten thousand? 390000 What is 17.50733 rounded to zero dps? 18 What is -357.087 rounded to the nearest one thousand? 0 Round 8.9825 to one dp. 9 What is 150626000 rounded to the nearest one million? 151000000 Round 3.82165 to the nearest integer. 4 What is 591071 rounded to the nearest 10000? 590000 What is 9656.344 rounded to the nearest one thousand? 10000 What is -36455030 rounded to the nearest 1000000? -36000000 What is 29734960 rounded to the nearest 100000? 29700000 Round -3584235 to the nearest 100000. -3600000 What is -3.251381 rounded to 1 decimal place? -3.3 Round 4144.28 to the nearest ten. 4140 Round -0.02900484 to 3 decimal places. -0.029 Round -0.00074504645 to 4 dps. -0.0007 Round 2.76531 to the nearest integer. 3 Round -751.329 to the nearest 10. -750 Round 0.00006358544 to 7 decimal places. 0.0000636 What is -5182930000 rounded to the nearest 1000000? -5183000000 What is -48844.3 rounded to the nearest one hundred? -48800 Round -8429.49 to the nearest 10. -8430 What is -8408655 rounded to the nearest 10000? -8410000 What is 95.02844 rounded to two dps? 95.03 Round -0.11928909 to four dps. -0.1193 What is -0.0015354055 rounded to 4 decimal places? -0.0015 What is 0.001228953 rounded to three decimal places? 0.001 What is 0.0002587317 rounded to four dps? 0.0003 Round -26172.81 to the nearest 10. -26170 Round 294.0266 to 1 dp. 294 What is 112.532 rounded to 1 decimal place? 112.5 What is 0.0106023 rounded to 2 dps? 0.01 What is -1102.142 rounded to the nearest integer? -1102 Round -657260 to the nearest 1000000. -1000000 Round -0.000866477 to four dps. -0.0009 What is 15036.5 rounded to the nearest one thousand? 15000 What is -3.9070232 rounded to three decimal places? -3.907 Round 365.78 to the nearest one thousand. 0 What is -0.0000244824 rounded to six dps? -0.000024 Round -276441200 to the nearest one million. -276000000 Round 191.5926 to 1 decimal place. 191.6 Round 180.607 to the nearest ten. 180 What is 7.9794 rounded to two dps? 7.98 What is 28729200 rounded to the nearest one million? 29000000 What is 1.11469 rounded to the nearest integer? 1 Round 2.18011 to 1 decimal place. 2.2 Round -774.696 to the nearest integer. -775 What is -40.5811 rounded to the nearest integer? -41 Round -1.4413 to the nearest integer. -1 Round -1293.369 to the nearest 10. -1290 What is -0.0154456 rounded to two dps? -0.02 Round 88428 to the nearest one thousand. 88000 What is -0.02407647 rounded to 2 decimal places? -0.02 Round -1526.649 to the nearest 10. -1530 What is 0.000465399 rounded to five decimal places? 0.00047 Round -0.0000047420504 to 7 decimal places. -0.0000047 What is -0.000002252883 rounded to 7 decimal places? -0.0000023 Round -13389200 to the nearest one million. -13000000 What is 17394300 rounded to the nearest one hundred thousand? 17400000 Round 35.10861 to the nearest 10. 40 What is 0.00000382608 rounded to five decimal places? 0 What is -0.015713 rounded to five decimal places? -0.01571 What is 1595.086 rounded to the nearest 10? 1600 What is 0.00029064 rounded to 5 dps? 0.00029 What is -171461.34 rounded to the nearest one thousand? -171000 What is -2142.59 rounded to the nearest ten? -2140 What is -0.000853261 rounded to four decimal places? -0.0009 What is -189587800 rounded to the nearest 100000? -189600000 Round -7721774 to the nearest one million. -8000000 What is 45478.11 rounded to the nearest one thousand? 45000 What is 327.687 rounded to zero decimal places? 328 Round 33464.2 to the nearest 1000. 33000 Round -140.7275 to the nearest 10. -140 What is -0.00002493273 rounded to 5 decimal places? -0.00002 What is -0.497778 rounded to one decimal place? -0.5 Round -0.000004649247 to seven dps. -0.0000046 What is 11865.345 rounded to the nearest ten? 11870 What is -40.221 rounded to the nearest 10? -40 Round 43328.2 to the nearest 1000.	{ "pile_set_name": "DM Mathematics" }
a) -0.1 (b) l (c) 211 c Let k = 3 + -2. Let r = 0 - -0.3. Let t = -188 - -193. What is the third smallest value in t, r, k? t Suppose -3q = -4f + 5, 2q + 25 = 4f + 3q. Let n be ((-6)/(-20))/((-3)/(-4)). Let g = -63 - -62.6. Which is the biggest value? (a) f (b) n (c) g a Suppose 0 = -f - f - 20. Let r be (-45)/f + (-3)/2. Suppose -rh = -5h + 4. What is the biggest value in -3, 3, h? 3 Let x = 1327 + -1330. What is the biggest value in -0.02, x, 1/3? 1/3 Suppose 3q = -q + 16. Suppose -8d = -qd - 12. Let l be d - (-28)/(-8) - -2. What is the smallest value in l, -5, -1? -5 Let d = -22.945 - 0.255. Let m = 24 + d. Let q = m + 2.2. Which is the second biggest value? (a) 2 (b) q (c) 0 a Let i = -28 - -19. Let u = i + 7.5. Let j = u + 1. What is the smallest value in 1/5, 2, j? j Let c = -83683/7755 + 516/47. Let j = 3/55 - c. What is the third smallest value in -0.1, j, 1/4, -2? -0.1 Let w be (0 + ((-124)/32 - -4))-1. Which is the second smallest value? (a) w (b) 0.5 (c) -2/7 (d) 4 a Let b = -0.94 - -0.04. Let k = 0.8 + b. Let y = 0.06 + 1.94. What is the third biggest value in k, 0.06, y? k Let q = -50 - -52. Let n = 23 + -23.4. What is the second smallest value in n, q, 0.3, 0.5? 0.3 Let b = 17527/3630 + 3/605. Let t = b - 191/42. What is the third biggest value in -0.2, t, 1? -0.2 Let v = 194.9 + -195. Which is the second smallest value? (a) v (b) 5 (c) -14 a Let d = -13 + 13. Let s = -19.9 + 20. Let i = 4.3 - -0.7. What is the third biggest value in d, s, i? d Let o = 1372.8 - 1373. Which is the second smallest value? (a) -0.8 (b) 0.2 (c) o c Let m be 1 + 5/(-8)1. Let o = -257 + 255. Which is the second biggest value? (a) m (b) 1.6 (c) o a Suppose -r = r + 8, -5w - 100 = 5r. Let l be (w/(-20))/(-4)2. Which is the second smallest value? (a) l (b) -16 (c) 1/4 a Let x = 2689.5 + -2689. Let n = 4 - -1. What is the third biggest value in n, x, -1/4? -1/4 Let k = -0.319 - -0.019. What is the second biggest value in k, 0.5, -0.2, 0.08? 0.08 Suppose 0 = 12h - 470 - 106. Suppose -3f = -4m + 26, -5f + 2m + 0m = h. What is the third biggest value in f, -1, 5, 5/3? -1 Let v be (-2 - 1)2/6. Let k be (3 + v)/(7 + -2). Let i = 396.5 - 396. What is the second smallest value in k, -2/5, i? k Let r = -592 - -591.8. What is the third biggest value in 18, 2, r? r Let g be (126/27)/((-1)/3). Let r(u) = u*3 + 15u*2 + 14u - 4. Let t be r(g). Let b = 0.4 - 5.4. What is the biggest value in -1, b, t? -1 Let s be ((-298)/1043)/((-4)/6). What is the second smallest value in -7, 4, s, -5? -5 Let s = 240.954 + -241. Let h = s + -3.954. Let u be 1/(-3) - (-1)/9. Which is the second biggest value? (a) u (b) 2 (c) h a Let t = 28 - 40. Let c = 2.7 + 0.3. Let d = c - 5. What is the biggest value in d, 2/7, t? 2/7 Let n be (-11)/(-30) + (-602)/516. Which is the smallest value? (a) -0.4 (b) 0.04 (c) n c Suppose -2471 = 122i - 129i. What is the smallest value in 1/5, -4, i? -4 Let m = 449 - 3145/7. Which is the third smallest value? (a) -45 (b) -0.3 (c) m c Let r = 30 - 9. Let i = r + -9. Let h be 9/(-18)(-1 + 1). Which is the third smallest value? (a) -1 (b) h (c) i c Let j be ((-42)/3381)/((-2)/14). What is the third biggest value in j, -10.2, -1, -5? -5 Suppose -3o + 5 = -5j - 12, -5o + 22 = -2j. Which is the second biggest value? (a) -57 (b) 1/5 (c) j c Let r = -0.9 - -11.9. Let x = 10 - r. Which is the third smallest value? (a) -0.04 (b) 5 (c) 2 (d) x c Suppose 2o - 206 = f, -2o - 3o + 5f + 520 = 0. Let x be 3 + (-147)/o2. Which is the smallest value? (a) x (b) -1/8 (c) 1 b Let s = -40 + 43. Let k be (-38)/(-10) + (-1)/(-5). Suppose -kp + 7 = 27. Which is the third smallest value? (a) -0.2 (b) p (c) s c Suppose -2y = -2o + 17 + 1, -5y + 3o = 35. Let x be (-6)/84 + (-58)/(-18). What is the fourth smallest value in 2, y, -3, x? 2 Let j = 1.7 + 0.3. Let v = -2.3 + j. Let x(s) = -32s + 254. Let k be x(8). What is the third biggest value in v, -2/19, k? k Let s = -394.1 - -394. What is the third biggest value in -1, s, 1? -1 Let x = -68 - -98. Let y = x - 19. Suppose 3r - 2 + y = 0. What is the third smallest value in 0.2, -1/2, r? 0.2 Suppose 0 - 5 = 5a. Let p(q) = -q3 + 7q*2 - q + 9. Let r be p(7). Suppose -2s + t = -s, rs + 5t = -28. What is the third biggest value in 1/5, s, a? s Let j = -4 - 0. Let l = -5 + j. Let y be (l/(-42))/((-3)/(-4)). Which is the smallest value? (a) -1/3 (b) -0.5 (c) y b Let j = 689 + -709.78. Let d = j - -3.08. Let k = d - -17. Which is the third smallest value? (a) k (b) 1/3 (c) 2 c Let n = 0 - -1. Let x be (-478)/(-5019)(-1 - (-2 + 0)). Which is the fourth smallest value? (a) 3/4 (b) 5 (c) x (d) n b Let x = -9.943 + 0.043. Let l = x - -10. What is the third biggest value in -4, -10, l? -10 Let i = -230 - -225. Suppose m + 3z + 7 = 0, -m + 6m = -3z + 13. What is the second biggest value in i, m, 1/2, -1/2? 1/2 Let k = 38 - 229/6. What is the biggest value in k, -5/6, 1/3, -5? 1/3 Suppose -3l - 3r - 9 = 0, 5l = 5r - 0r + 25. Let f(u) = 11u*3 - 1. Let b be f(l). Suppose 5o = 5 - b. What is the third biggest value in -5, o, -4? -5 Let g be (2/(-6))/(48/116). Let f = g + -4/9. Let j = -5.28 + 0.28. Which is the second smallest value? (a) f (b) -1/4 (c) j a Let q be 3 + (-436)/26-8. Let k = q + -137. Let p = -1 + 1.06. Which is the second biggest value? (a) p (b) 0.2 (c) k c Let k = -0.392 + 0.192. Which is the biggest value? (a) 0.05 (b) -2.9 (c) k a Suppose 0 = -20j + 37 - 57. What is the biggest value in j, 16, -2? 16 Let k be ((-8)/(-170))/((9 + -12)/30). Which is the third smallest value? (a) -2/5 (b) -3 (c) k (d) -5 c Let t = 64.7 - 65. Let s = -55 + 272/5. What is the second smallest value in 2/19, t, s, 0? t Suppose -54f + 47f + 259 = 0. Suppose 35k - fk = 0. Which is the third smallest value? (a) k (b) -2/5 (c) -0.1 a Let q = 14 - 15. Let v be 133/49 - (2 - q). Let i be -2 - (4 - (-4)/(-4)). What is the second smallest value in v, i, 0.2? v Let m be (-352)/60((-17)/(-6) - 3). Let n = 8/45 - m. What is the biggest value in n, -0.3, 4, -1? 4 Let d(x) = -x3 + 6x*2 + 7x - 14. Let i be d(7). Let b be 2/(-20) - 7/i. Let q = 0 + 4. What is the third smallest value in q, b, 1? q Let h = -345.9 - -346. Let z be -1 - (-1 - (-1 + 0)). Let v be z/(-3) - 32/42. What is the second smallest value in h, v, 2? h Let p = -225 - -479. Which is the biggest value? (a) 4 (b) p (c) 2 b Let n = 7 + -4. Let w be (1/1)/((-13)/91). Let o be 1/w(-7)/(28/32). What is the third smallest value in o, -4, n? n Suppose -11z + 170 = -9z. Suppose z = -3o - 4q, -6q = -2o - q - 95. Let g be (-14)/o - (-13)/30. What is the third biggest value in -3/2, g, 0.5? -3/2 Let g = -4.91 + -0.09. Let f = -6/11 - -35/44. Which is the second biggest value? (a) 2/11 (b) f (c) g a Let o = -1 + 4.3. Let j = 5.3 - o. Which is the biggest value? (a) 1 (b) j (c) -4 b Let t = 0.1 - -0.4. Let n(l) = -l2 + 5l - 2. Let y = 56 - 52. Let g be n(y). Which is the second biggest value? (a) t (b) -0.1 (c) g a Let r = -9.2 - -9. Let i = 5.08 - 0.08. Let s = i + -10. What is the smallest value in r, s, 0.4? s Let o = -2.5 - 5.5. Let y = o - -7.87. What is the biggest value in -0.4, -0.1, y? -0.1 Let h be (-8)/52 - 24/13. Let b = 0 - h. Let j = 22.5 + -23. What is the third smallest value in -3, b, j? b Let z = 3.3 + 7.8. Let o = -11 + z. Let m = -39/2 - -21. What is the biggest value in 0, m, o? m Let a = -259 + 257. What is the second biggest value in 0, -39, a? a Suppose -2l + 222 = -4f - 0f, -f = 5l - 599. Let d = l - 241/2. Which is the third smallest value? (a) 1 (b) d (c) -5 a Let d = 0.001 - 0.101. Let t = -162 + 159. What is the second biggest value in 1/4, t, -1/9, d? d Let z = 1351/8 - 169. What is the fourth smallest value in z, 5, 9, 1? 9 Let o = 160 + -160.3. What is the fourth smallest value in 2/59, 0.2, o, 0.5? 0.5 Let w = 36 + -363/10. Which is the smallest value? (a) -2/11 (b) w (c) -2/19 (d) 2/15 b Let o = 0.2 + -0.2. Let v = o + 1. Let h = 5.731 - -0.269. What is the third biggest value in v, h, 5? v Let n = -0.14 + 0.74. Let g = -11 + 7. Let y be 14/(-12) + g/(-12). Which is the third smallest value? (a)	{ "pile_set_name": "DM Mathematics" }
(-45)/(-6)5/50. 3/4 Evaluate ((-32)/14)/4(-126)/18. 4 What is ((-1)/2)/(-8(-4)/(-64))? 1 (12/21)/((-11)/77) -4 Evaluate ((-11)/(-1))/(((-27)/9)/3). -11 What is (2/1)/(90/135)? 3 (3/9)/(((-24)/(-3))/24) 1 (4/18)/(((-160)/(-42))/(-20)) -7/6 Calculate ((-12)/16)/36/3. -1/2 Calculate 5/748/(-60). -4/7 Calculate ((-18)/(-99))/((-1)/(-11)). 2 What is (((-12)/16)/3)/(-1)? 1/4 Evaluate 2/(-1)(-33)/(-22). -3 What is the value of ((-2)/6)/(9/36)? -4/3 What is (24/(-48))/((-1)/(-2))? -1 ((-2)/(8/12))/((-60)/(-8)) -2/5 6/63/(-3)1 -1 What is 18/8(-28)/21? -3 Calculate (-11)/(-132)-64. -2 3/(7/((-35)/(-25))) 3/5 What is (-43/(6/(-2)))/1? 4 What is (4/((-20)/(-5)))/(-1)? -1 What is (-6)/1211/(165/(-18))? 3/5 What is the value of (51/(-153))/(((-2)/15)/(-2))? -5 What is the value of ((-6)/(-8))/((-168)/(-32))? 1/7 Evaluate 60/(-162)(-7)/((-70)/(-6)). 2/9 Calculate (-40)/(-70)(-5)/(-5). 4/7 What is -9(-2)/378-6? -2/7 What is 7/(-7)28/(12/3)? -7 Calculate (255/(-102))/((1/(-1))/2). 5 (67/(-134))/(1/4) -2 ((5/1)/5)/(4/16) 4 Evaluate 3-229/174. -1 (16/192)/((-1)/3) -1/4 Calculate (-16)/12117/(-52). 3 Evaluate (((-3)/30)/1)/(2/4). -1/5 Calculate 0/(((-27)/2)/9-2). 0 31/9-3 -1 What is the value of ((-138)/(-92))/((-3)/4)? -2 What is (-3)/(-42)49/(-14)? -1/4 What is -117/((-306)/12)? 2/3 23/(138/84)(-1)/(-2) 7 What is the value of (-14)/412/(-14)? 3 Evaluate (-5)/(-20)1(-12)/2. -3/2 6/(1-2)(-140)/(-84) -5 What is (2(-5)/(-70))/(1/(-6))? -6/7 Evaluate ((-141)/282)/(1/(-2)). 1 What is (-51)/(-17)1/5? 3/5 Evaluate ((-34)/102)/(1/3). -1 What is the value of ((-150)/60)/(2/8)? -10 Evaluate 2/((-4)/2)12/8. -3/2 Calculate (-1)/(2/(-4)14/28). 4 (3/(-6))/((-650)/200) 2/13 Calculate (65/10)/(-13)-6. 3 Evaluate (-13)/((-39)/18)(-2)/(-3). 4 Evaluate (-2)/59/((-234)/10). 2/13 Evaluate (76/114)/(-2(-1)/9). 3 What is (((-20)/(-4))/1)/((-20)/(-24))? 6 What is the value of (-174)/(-1740)10/(-6)? -1/6 What is (440/35)/(-11)7? -8 Calculate 76/205212/(-2). -2/9 7/((-105)/(-40))3/(-14) -4/7 Evaluate (2/30)/(51/(-85)). -1/9 9/6-21 -3 ((-38)/342)/((-2)/(-24)) -4/3 Calculate 0/((-7)/21-3-7). 0 What is (-9)/(-1)11/(-33)? -3 Calculate 8((-1)/4)/(-1)-2. -4 Calculate 46/(-48)0. 0 (-84)/(-24)6/(-7) -3 9/((18/3)/((-4)/(-2))) 3 What is (38/76)/(7/(-2))? -1/7 Calculate -62/2415/(-10). 3/4 ((-9)/(-3))/((-1)/(-4)6) 2 Evaluate ((-148)/37)/(181). -2/9 What is 51(-63)/105? -3 Calculate 1/(-2)12/6. -1 What is (1(-4)/4)/3? -1/3 Evaluate (-2)/(-4)(-368)/46. -4 Evaluate 1-2194/329. -4/7 What is the value of (25/(-175))/(2/(-14))? 1 What is the value of ((-3)/(-18)0)/2? 0 (((-21)/(-10))/7)/((-54)/36) -1/5 What is ((-36)/(-48))/((-132)/(-32))? 2/11 Evaluate (-1)/(-4)(-16)/(8/(-2)). 1 What is 206/(-9)57/95? -8 What is (63/6)/(-7)40/12? -5 (120/(-35))/1 -4/7 Evaluate (-212/(-20))/(-2). -3/5 Calculate (2/(-8))/(210/840). -1 What is the value of (-258)/301(-14)/6? 2 Calculate ((-4)/1)/(211/3). -4/7 What is the value of (-64/(-108))/(12/(-9))? -1/6 What is 3/(-95/60)? -4 What is the value of 2(30/(-66))/5? -2/11 What is the value of (1/(-3))/((-5)/2)5? 2/3 Evaluate (1/(-9))/(((-2)/4)/1). 2/9 Calculate ((-6)/4)/3(-90)/(-45). -1 Calculate 8/(-8)42/6. -7 What is the value of ((-5)/70)/((-10)/(-60))? -3/7 Evaluate 10(-5)/202/(-1). 5 Evaluate ((-2)/(-1))/(-756/(-49)). 1/4 Evaluate ((-6)/755)/(8/(-4)). 1/5 4/43/62 1 Calculate -3(-8)/(-36)3. -2 Evaluate 40/561/5. 1/7 Calculate -736/840/(-210). 6 Evaluate 8/(-2)-3616/(-256). -9 Calculate (5/(-925))/((-6)/60). 2/37 What is (1/8)/(-2(-3)/(-36))? -3/4 ((0/(-4))/((-2)/(-2)))/1 0 (41/(861/(-84)))/((-2)/(-2)) -4 What is the value of 2/3(-3)/(-6)6? 2 What is 84/(-49)(-14)/4? 6 Evaluate (4/242)/2. 1/6 Calculate (-105/(-30))/5-6. -2 Evaluate 0(-4)/(-16)(-5)/(-10). 0 Calculate (6/(-3))/((-26)/13). 1 What is the value of (-5)/551? -5 What is the value of (-2)/((-10)/15)2/45? 2/15 What is the value of ((-2)/(-8))/((-49)/(-1372))? 7 (4/14)/((-312)/(-273)) 1/4 What is the value of (1/(-1))/(2/4)? -2 Calculate ((-3)/((-765)/(-5)))/(2/(-12)). 2/17 Calculate 5/14(-8)/(-10)-1. -2/7 What is (-4)/(-24)-412/(-52)? 2/13 Calculate (1/69)/((-10)/4). -3/5 What is 1/(3(-3)/(-18))? 2 (10(-14)/175)/(3/30) -8 6(-3)/(-18)-5 -5 Evaluate (-122/21)/(20/(-70)). 4 Evaluate (5/(-1))/((-675)/54). 2/5 What is (-1)/(-2)-12(-4)/(-6)? -4 Calculate 0(-1)/((-12)/3). 0 Calculate (-16)/25(-25)/10. 8/5 What is the value of (-10)/4(-16)/(-10)? -4 What is 1/((6/12-3)/(-3))? 2 Calculate 1(-14)/18414/1449. -2/9 What is (44/(-32))/(-11)-1? -1/8 What is the value of 4/48-3-6? 3/2 Calculate 9/(-1)((-21)/(-3))/(-105). 3/5 (-27)/(-42)(-70)/120 -3/8 What is 10/(-5)33/22? -3 Calculate -3(-15)/27-3. -5 What is the value of (-1)/((-3)/(-9)3)2? -2 (1/(18/8))/(-21) -2/9 What is ((-3)/(3-2))/((-2)/4)? -1 Evaluate 2(-4)/(304/4). -2/19 What is (6/10)/((-162)/90)? -1/3 Evaluate (4(-2)/4)/(-4). 1/2 -12/(-8)47 7 Evaluate 32/2(-5)/(-75). 1/5 Evaluate 5/15340/8. 5 ((-13)/((-26)/24))/(20/10) 6 What is the value of 145/184/5? 2 Evaluate (-4)/(-5)(-288)/1152. -1/5 What is ((-5)/(225/(-70)))/((-16)/24)? -7/3 What is the value of ((-8)/(-8))/(2/2)? 1 Calculate ((-112)/392)/(24/(-7)). 1/12 Evaluate 12/(-4)10/6. -5 Evaluate -2325/(-30). 5 8/219/(-12) -2/7 Evaluate 12/15(-80)/(-608). 2/19 Calculate (-25)/(25/(-6))-1. -6 Evaluate (2/3)/(60/(-270)). -3 What is (-2)/42/((-3)/3)? 1 (0(-2)/2)/((-42)/21) 0 What is ((-6)/(-52))/(33/44)? 2/13 What is ((-740)/(-2072))/(5/(-2))? -1/7 What is 64/24-2? -2 28/(-14)2/2 -2 Evaluate 1/(38/(-24)). -1 What is -12/16(-18)/(-9)? -1/4 What is the value of (-16)/12(-7)/((-14)/3)? -2 What is (142/(-426))/(3/2)? -2/9 What is the value of ((-12)/10)/(((-9)/30)/1)? 4 What is the value of 1/(((-1)/3)/(19/(-38)))? 3/2 67/(-201)(-9)/8 3/8 What is the value of 35/(-175)5? -3/7 What is the value of ((-30)/(-520))/((-3)/(-8))? 2/13 2(-1)/(8/(-4)) 1 What is -2(-2)/6(-144)/480? -1/5 9/3043/(-9) -2/5 (6(-2)/16)/((-9)/(-16)) -4/3 Evaluate (70/98)/((-5)/2). -2/7 Evaluate 8/(-12)(-12)/2. 4 What is the value of ((-1)/(-1))/(2(-2)/(-8))? 2 Calculate -2(12/3)/(-2). 4 Evaluate (36/(-30))/(((-18)/15)/2). 2 Evaluate (-22)/(-11)6/3. 4 What is the value of ((-2)/61)/((-3)/(-2))? -2/9 What is 20/6(-54)/72? -5/2 -11/1162/(-27) 6 ((-10)/25)/(-21/3) 3/5 Evaluate 1(-56)/14(-3)/(-12). -1 What is the value of -1(4/(-10))/((-72)/45)? -1/4 Evaluate 2/(-12)1/(5/15). -1/2 What is (-7(-18)/(-9))/(-12)? 7/6 What is the value of (2/8)/((-22)/88)1? -1 What is ((-2)/(-14))/((-24)/48)? -2/7 Evaluate ((-34)/(-51))/(-22/30). -5 What is the value of (5/60-15)/(2/8)? -5 What is 3((-96)/(-594))/8? 2/33 Evaluate (27/3)/991. 1/11 Calculate 12/466/11. 3 Evaluate (12/(-16))/(6/(-16)). 2 Evaluate 4/2(-10)/(-60)-15. -5 Calculate (-66)/44(-20)/(-21). -10/7 What is (13/(-15))/((-81)/135)? 1/3 ((-2)/(-25)-1)/((-87)/(-435)) -2/5 What is the value of (-54)/1925(-4)/15? 3/8 (11/110)/((7/4)/(-7)) -2/5 What is the value of -32/241? -1/4 Calculate (-4)/(-70)(-7)/3. -2/15 What is ((-20)/(-210)-9)/(4/(-14))? 3 What is ((-2)/(-20))/(29/((-290)/4))? -1/4 What is the value of ((-6)/(-9)(-3)/(-4))/1? 1/2 What is the value of ((-184)/(-276))/((-2)/3)? -1 What is the value of 85/17(-20)/75? -4/3 Calculate (-2)/((3/(-12))/(3/(-4))). -6 Evaluate (39/91)/((2/7)/1). 3/2 What is (13/((-455)/28))/((-1)/5)? 4 12/2(-2)/3 -4 What is (-58)/(-116)(-2)/(-1)-1? -1 Evaluate ((-20)/(-8))/(-5)2-2. 2 What is 60/(-12)(-4)/(-5)? -4 Calculate ((-1)/(-26))/((-1)/4). -2/13 What is ((-3)/15)/(((-70)/10)/(-35))? -1 Calculate ((-4)/(-10))/(2/20). 4 Evaluate (-26)/(-13)2/4. 1 What is 6/2114/(-10)? -2/5 Calculate ((-1)/2)/(2(-2)/(-24)). -3 Evaluate ((-3)/38)/((-6)/(-72)9). -2/19 Evaluate (9/36)/(((-16)/(-4))/(-16)). -1 What is (-8(-6)/12)/(-1)? -4 What is 1/(-28)-72/1? 1/2 Calculate ((-42)/10)/7(-10)/(-2). -3 What is the value of (-4)/(-20)1-51? -1 Evaluate (49/28-2)/((-3)/(-6)). -7 What is 5((-6)/(-1))/(-18)? -5/3 Evaluate ((-21)/12)/(-56/(-120)). -7 Calculate (1/(-42)3)/(17/34). -1/7 What is the value of (18/120-3)/(9/(-15))? 3/4 (-1)/(-33)2(-42)/(-14) 2/11 7/2*(-8)/(-28) 1 What	{ "pile_set_name": "DM Mathematics" }
- 3h - 4. Let u be o(2). What is k(u)? -17 Suppose 0 = -5a - 154 + 204. Let p(x) be the second derivative of -1/6x3 + 0 - ax - 1/2x2. Give p(0). -1 Let x(k) = 3 - 8 + 3k + 3k - 5k. Let d(s) = -s*3 + 33s*2 - 98s + 246. Let o be d(30). Calculate x(o). 1 Let j(r) = -r*3 - 10r*2 - 8r + 11. Let d = 396 + -311. Suppose -db + 91b + 54 = 0. Determine j(b). 2 Let y be (2/(-4))/(34/476). Let t(u) = u*3 + 7u*2 - 9u - 9. Determine t(y). 54 Let k(g) = 2g2 - 1 - 8g - 4g2 - 1 + 4g. Let a = 524 + -526. Calculate k(a). -2 Let k(p) be the first derivative of -4p2 - 3p - 12. Let b be (4/(-8))/((-21)/(-42)). Determine k(b). 5 Let t(d) = d*3 + d + 2. Let r(j) = -58j*3 + 5j + 2. Let s(f) = -r(f) + 2t(f). Calculate s(1). 59 Suppose -93 = 83h + 64h + 54. Let p(o) = -12o*3 - 2o*2 + 1. Calculate p(h). 11 Let m(i) = -39i - 34. Let y be m(-11). Let k(z) = 391 - 2z - 784 + y. Determine k(-2). 6 Let x(q) = q2 + 26q - 25. Let n be x(-27). Let r(d) = -6d2 + 2d*3 + 0d + 2 - 2d2 + 6d*2 - nd. Let j be r(1). Let a(f) = -f - 1. What is a(j)? -1 Suppose 0 = -4b + 2k, 0 = 4b - 3k + 2k - 2. Let n(j) = j2 + 2j + 1. What is n(b)? 4 Let k(r) = r*2 - r - 4. Let b(x) = -7x*2 + 33x - 25. Let y be b(6). Let p = y - -82. Determine k(p). 2 Suppose 174r = 177r - 39. Suppose 16 = 5b + 4i + 3, -5i + r = 3b. Let o(w) = w - 3. Let v(g) = -2g + 7. Let j(h) = 9o(h) + 4v(h). Give j(b). 2 Let x(t) = 8t*3 + 10t*2 - 2t + 40. Let a(v) = -7v3 - 10v*2 + v - 39. Let n(q) = -7a(q) - 6x(q). What is n(-10)? -17 Let z(h) = h2 + 2h + 67. Let s be z(0). Suppose 5t - s + 7 = 0. Let k be (-32)/t3-1. Let g(u) = u2 - 8u + 2. Give g(k). 2 Let w(u) = -65u + 2. Let t(n) = 64n - 33. Let z(x) = -4t(x) - 3w(x). What is z(2)? 4 Suppose 30w - 27w - 15 = 0. Suppose -4p + d - wd = 28, d = -5p - 35. Let j(b) = -8 + 2 - b2 - 7b - b + 3. Calculate j(p). 4 Let y(k) = 8k + 4. Let h(u) = -2u - 1. Let v(r) = 9r + 4. Let d(f) = -4h(f) - v(f). Let n(p) = 5d(p) + y(p). Let q = -5 + 10. Calculate n(q). 19 Let g(j) = -j - 42. Let s(q) = 4q*2 + 185q - 118. Let h be s(-47). Give g(h). -65 Let g(c) = 14c - 14. Let t(d) = -29d + 25. Let w(z) = 5g(z) + 3t(z). Let f(q) = 13q - 5. Let l(u) = 4f(u) + 3w(u). Give l(8). 3 Suppose -93b + 11b = 99b. Let g(l) = -l*3 + l + 30. Give g(b). 30 Let j(k) = -9k*3 + 2k*2 - 1. Let n(i) = 1016i*2 + 90 - 33 - 1017i*2 + i. Let a be n(8). Give j(a). -8 Suppose 333d - 338d + 75 = 5o, -6 = -2d + 2o. Let h(i) = 5i - 31. Determine h(d). 14 Let m(b) = b2 + 11b + 13. Let s(j) = j*2 - 3j - 23. Let k be s(-4). Suppose 18 = 3h - kh. Give m(h). -5 Let o be 121(-2)/(-4). Let s(g) = 5g2 - 1594g - 5 + 3438g - g3 - 1839g. What is s(o)? -11 Let r(h) be the first derivative of -h*3/3 - 11h*2/2 + 94h - 13353. Determine r(-18). -32 Let i(l) = -28l - 42. Let b be i(-5). Let s(k) = 74k + k*3 + 11 + bk + 10k2 - 163k. What is s(-9)? 11 Suppose -3m + 160 - 34 = 0. Let u = m + -40. Let y(t) = 5t - 12t2 + 24t*2 - 15t*u - 4. Determine y(3). -16 Let l(h) = -15h - 18. Let b(z) = 23z + 28. Let y(s) = -5b(s) - 8l(s). Let q(c) = -2c - 2. Let a(t) = 8q(t) + 3y(t). Calculate a(3). -7 Suppose 27n = -104 - 58. Let w(r) = -4r*3 + 17r*2 - 18r + 34. Let s(t) = 5t3 - 18t*2 + 19t - 38. Let b(f) = nw(f) - 5s(f). What is b(-13)? -14 Let z(c) = -32 - 5c - 33 - 25 - 35 - 22 + 151. Let i = 0 - -2. Calculate z(i). -6 Suppose 9q - 7q + 322 = 25q. Let w(p) = p*3 - 13p*2 - 10p - 69. Determine w(q). -13 Let d(q) be the second derivative of q*6/180 + 2q5/15 + q4/6 - 65q3/6 + q - 273. Let m(r) be the third derivative of d(r). Calculate m(-4). 0 Let v(x) = -x3 + 4x*2 - 2x - 2. Suppose 4 = 5h - 3h. Suppose 0 = j + 5r + 22, -7 = -hj - r - 6. What is v(j)? 1 Let g(d) = 2d2 - 12d + 31. Let k = 4185 - 4178. Give g(k). 45 Let h be (-15)/(-6) + (-246)/(-164). Let k(m) be the first derivative of 2m + m2 + 7 + 1/4m*h - 2m*3. Give k(5). -13 Let x = -370 + 385. Suppose -xh = -16h - 6. Let b(j) = -j - 2j - 7j2 + 2 - 2j3 + j3. Give b(h). -16 Let a(b) be the second derivative of -b4/12 - b3/3 - b*2 + 13b - 6. Suppose -x + 949 = 951. Determine a(x). -2 Let b(q) = -4q - 5 + 3 + 4 - q3 - 8q*2. Let x be (-557 + 573)(-7)/16. Calculate b(x). -19 Let r(x) = 3x2 + 2x + 4. Suppose -52 = -11y + 7y. Suppose 0 = 16i - yi + 9. Determine r(i). 25 Let t(h) = h - 21. Let f be -89/72-4. Suppose -fz - 5x + 32 = 0, 5x = 8z - 3z - 85. Give t(z). -8 Let u be 31/6 + (-4)/24. Let f(k) be the second derivative of 5/2k*2 + 1/6k*3 + 8k + 0. Determine f(u). 10 Let b = 25325/6 - 4220. Let g(s) be the third derivative of -14s2 - 1/8s*4 + 0 + 0s + bs3. Give g(4). -7 Let x(g) = -g3 - g2 - 1. Let a = 663 + -1493. Let s = a + 827. Calculate x(s). 17 Let q(c) = -10c - 26. Suppose -3i + 25 = g, -i = -0i - 2g + 1. Let m(t) = 3t + 9. Let a(d) = im(d) + 2q(d). What is a(-7)? 4 Let o = -16536 + 16526. Let y(h) = -3h2 - 33h - 2. Give y(o). 28 Let i = -13 + 12. Let z(d) be the first derivative of 16d3/3 + d - 2338. Give z(i). 17 Let o = -11 + 17. Let q(y) = 8y - 4. Let t(m) = 9m - 5. Let p(r) = oq(r) - 5t(r). Calculate p(1). 4 Suppose 0 - 5 = s. Let k(l) = 21634l - 1 - 3 - 21635l. Calculate k(s). 1 Let j(r) = -r2 + 6r - 3. Let l = -38 + 43. Suppose -4h = -2k + lk + 51, k = 4h + 47. Let f be (-128)/(-28) + h/21. Calculate j(f). 5 Let l(c) be the third derivative of -1/60c5 - 1/3c*3 + 71c*2 + 0 - 1/12c*4 + 0c. What is l(-3)? -5 Let q(h) = h*3 - 29h*2 + 54h + 13. Let w(p) = -61p - 2169. Let j be w(-36). Give q(j). 13 Suppose 0 = -3x + 6 + 23 + 7. Let i(n) = -4n2 + 51n - 37. Calculate i(x). -1 Let h(c) be the second derivative of -c*5/20 - 11c*4/12 - 2c*3 - 7c*2 + c. Let n be ((-7)/(-28)-2)/(76/(-80) - -1). What is h(n)? 6 Suppose 2f = 396 - 392. Let j(l) = -4870 + l3 + 8l*2 - 14l - 4l2 + 4l*f + 4859. Determine j(-9). 34 Let x(z) = 264z + 4206. Let f be x(-16). Let l(r) = -3r2 - 60r - 113. Give l(f). -5 Let m(k) = -41k2 + 138k + 15. Let j(v) = 13v2 - 44v - 5. Let s(r) = 22j(r) + 7m(r). Let d = 0 - -1. Let b be -5(d - 2/10). Determine s(b). -13 Let o(l) = 3 - 2 - 249l + 260l. Calculate o(-4). -43 Let l(s) = 7s + 959 + 959 - 2871 + 954. Determine l(3). 22 Let d(f) = 86f - 660f*2 + 659f*2 - 88f + 40. Determine d(6). -8 Let n(v) = 7v + 20. Let w = 256 - 260. Let b(q) = 6q + 19. Let x(z) = wn(z) + 5b(z). Give x(-9). -3 Let a be (-27 - -39) + (-8 - 1/(-1)). Let x(j) = -4j - 7 - 8j*2 + 4j*2 - 49j*3 + 50j*3. Determine x(a). -2 Let g(c) be the second derivative of -6 + 0c*2 + 7/6c*3 - c + 1/12c4. Let j(s) = -s3 + 13s2 + 15s - 20. Let i be j(14). Give g(i). -6 Let i(s) = -s*3 + 58s*2 - 67s + 563. Let x be i(57). Let h(v) = -v*3 - 8v*2 - 7v - 5. Calculate h(x). -5 Let f(n) = -33n - 699. Let o(l) = l3 + 39l*2 + 79l + 164. Let a be o(-37). Determine f(a). -6 Let g be (7 - 14)5/(-7). Suppose 0 = 4z - gz + 4. Let m(h) = 3 - 3h + 0h + zh + 2. What is m(4)? 9 Let d(f) = -f*3 - 11f*2 + 11f - 17. Let t(g) = -g*3 + 247g*2 + 3g + g + 12 + 2g3 - 241g2. Let o be t(-6). What is d(o)? -5 Let v(w) = -w3 - 21w2 - 20w - 3. Let a be v(-20). Let h(g) = -8g2 - 2g + 2. Let s(u) = -u*2 + 1. Let d(k) = -h(k) + 5s(k). What is d(a)? 24 Let v(q) = 9q + 83. Let y be v(-12). Let r = 20 + y. Let i(s) = -2s*2 - 6s + 3. What is i(r)? -17 Let u(x) = x3 - x2 + 10. Let a(m) = m*2 + 13m + 31. Let f be a(-10). Suppose 6y + 1 = f. Determine u(y). 10 Let h(y) = -2y*2 - 2y + 5. Let i(q) = q*2 + 220q - 446. Let v be i(2). Determine h(v). 1 Let o(z) = z*3 + 3z*2 + 7z - 2z + 16 - z - 15 - 2z. Give o(-2). 1 Let z(r) = r*2 - 57r - 909. Let t be z(-13). Let d(u) = 7u2 - 29u + 24. What is d(t)? 2 Let n(v) = 6v3 - 2v + 1. Let j be n(1). Let u(o) = 3287o2 - 4o + 5. Let k(s) = 5259s2 - 6s + 8. Let y(z) = -5k(z) + 8u(z). Give y(j). 15 Let c be (1 + 3)/(4/6). Suppose 2z = 6 + c. Let j(v) be the second derivative of -v3/6 + 2v*2 - 145v. Give j(z). -2 Let p(m) = 3m3 - 5	{ "pile_set_name": "DM Mathematics" }
+ 140q2/3 + 679q - 2448. -(q - 153)(q - 3)(q + 16)/3 Factor -x*2 + 4066546x - 4134199092529. -(x - 2033273)*2 Determine y, given that 2y*4 - 78y*3 + 836y*2 - 1992y + 1232 = 0. 1, 2, 14, 22 Find w, given that -23814045124w2 - 6172720w - 400 = 0. -10/77159 Let -5n2 + 1820n = 0. Calculate n. 0, 364 Factor 4p3 + 2160p*2 - 10884p + 8720. 4(p - 4)(p - 1)(p + 545) Suppose 2a*4 - 366a*3 + 4104a2 = 0. Calculate a. 0, 12, 171 Solve -c4/5 + 156c3/5 - 4333c*2/5 + 11922c/5 - 7744/5 = 0 for c. 1, 2, 32, 121 Find x, given that -2x5/11 - 18x*4/11 + 1290x*3/11 + 26066x*2/11 + 14160x + 19800 = 0. -15, -11, -2, 30 Solve q*2/7 - 60q - 844/7 = 0 for q. -2, 422 Determine k so that 5k2/2 - 6105k/2 - 6115 = 0. -2, 1223 Factor -5h3 + 20770h*2 - 21465420h - 216736200. -5(h - 2082)2(h + 10) Determine i so that -i*3/5 + 182743i*2/5 - 1096431i/5 + 1644633/5 = 0. 3, 182737 Suppose 5b2/3 + 1140b + 53440/3 = 0. What is b? -668, -16 Factor v*3 - 15v*2 - 7128v - 199408. (v - 103)(v + 44)2 Suppose b3/3 + 292b*2/3 + 8513b/3 - 8806/3 = 0. What is b? -259, -34, 1 Find h, given that -3h2/5 - 12633h + 442302/5 = 0. -21062, 7 What is s in 19s2 + 2448s - 387 = 0? -129, 3/19 Determine j so that 2j4/11 - 4690j*3/11 + 42078j*2/11 - 70030j/11 - 116800/11 = 0. -1, 5, 2336 Factor -2z4/5 + 4z*3 - 14z*2/5 - 36z/5. -2z(z - 9)(z - 2)(z + 1)/5 Solve 2n4 - 1894n*3 + 271392n2 = 0 for n. 0, 176, 771 Let k5/3 - 725k4 + 78947k*3/3 + 339739k*2/3 + 144644k + 175316/3 = 0. What is k? -2, -1, 41, 2138 Factor -2p4 + 1056p*3 + 4250p*2 + 3192p. -2p(p - 532)(p + 1)(p + 3) Factor -3x2 + 102954x + 411864. -3(x - 34322)(x + 4) Factor 4v2 + 7276v + 29040. 4(v + 4)(v + 1815) Solve -2c5/5 - 474c*4/5 + 194c*3 + 3354c*2/5 + 1912c/5 = 0. -239, -1, 0, 4 Solve 5a3 - 236845a*2 + 2804896120a - 2804659280 = 0. 1, 23684 Find q, given that -16q2/7 - 20164q/7 + 40776 = 0. -5097/4, 14 Factor -c*4 + 776c*3 - 7685c*2 + 19150c. -c(c - 766)(c - 5)*2 Determine w, given that -2w*3/13 + 914w*2 + 11884w/13 = 0. -1, 0, 5942 Factor -5j2 + 74110j - 274614605. -5(j - 7411)2 Determine g so that -2g*2/7 + 202g/7 + 612 = 0. -18, 119 Determine w, given that 3w2/7 - 34584w/7 + 69156/7 = 0. 2, 11526 Let 4w5 + 5032w*4 - 70988w*3 + 310032w*2 - 427248w + 183168 = 0. Calculate w. -1272, 1, 6 Find h such that 2h5/15 + 8h*4/5 - 244h*3/15 + 136h*2/5 - 38h/3 = 0. -19, 0, 1, 5 Factor -2q3/11 - 47838q*2/11 + 47840q/11. -2q(q - 1)(q + 23920)/11 Factor 5f*3/4 + 28775f*2/4 - 403585f/4 + 1413405/4. 5(f - 7)2(f + 5769)/4 Determine j so that 3j2/7 - 14733j/7 + 29454/7 = 0. 2, 4909 Suppose q*3/2 + 91q*2 - 2535q/2 = 0. What is q? -195, 0, 13 Suppose -n*2 - 16487n + 49470 = 0. What is n? -16490, 3 What is s in -2s4/17 - 32s*3/17 + 1178s*2/17 - 8872s/17 + 20160/17 = 0? -36, 5, 7, 8 Factor k*2/2 - 1423k/2 + 711. (k - 1422)(k - 1)/2 Find l such that -l5/3 - 38l*4/3 + 225l*3 - 2680l*2/3 + 3916l/3 - 624 = 0. -52, 1, 2, 9 Let -3x4 - 2814x*3 - 780291x*2 - 53718852x - 52941372 = 0. Calculate x. -418, -101, -1 Find o such that -7o5 - 2917o*4 + 6693o*3 - 4607o*2 + 838o = 0. -419, 0, 2/7, 1 Suppose -21d5 + 741d*4 - 7560d*3 + 19320d*2 - 15504d + 3024 = 0. Calculate d. 2/7, 1, 2, 14, 18 Find d, given that 2d3/9 - 31838d*2/9 + 42241066d/3 - 14076818 = 0. 1, 7959 Factor -3d2/4 - 132d - 3285. -3(d + 30)(d + 146)/4 Determine a so that -a*3/5 + 1086a*2/5 - 294849a/5 = 0. 0, 543 Factor -5x2 + 14595x + 368000. -5(x - 2944)(x + 25) Suppose 28x4 + 2794x*3 + 35100x*2 - 7650x = 0. Calculate x. -85, -15, 0, 3/14 Factor 2r2/9 + 11008r + 136323072. 2(r + 24768)2/9 Determine l so that 3l*4 - 21l*3 - 1980l*2 + 6048l = 0. -24, 0, 3, 28 Solve -3c2/2 - 1182c - 16401/2 = 0 for c. -781, -7 Factor k*2/3 + 32k - 99. (k - 3)(k + 99)/3 Determine q so that -5q*3 + 402405q*2 + 402410q = 0. -1, 0, 80482 Determine t, given that 2t3/9 - 5876t*2/9 + 4315922t/9 = 0. 0, 1469 Factor -3p2 + 145470p - 581832. -3(p - 48486)(p - 4) Find y such that -2y3 - 1728y*2 - 449064y - 36694944 = 0. -468, -198 Suppose 3l2/8 + 393975l/4 + 787947/8 = 0. Calculate l. -262649, -1 Factor -21o3 + 99o*2 + 10965o - 7875. -3(o - 25)(o + 21)(7o - 5) Suppose -5p3 - 267725p*2 - 3584235335p - 10750296615 = 0. Calculate p. -26771, -3 Suppose -i*4/2 - 251i*3/2 + 11753i*2/2 - 63633i/2 + 45990 = 0. What is i? -292, 3, 35 Solve -5v2 + 41880v - 41875 = 0. 1, 8375 Factor -3n3/2 + 240n*2 - 12750n + 225000. -3(n - 60)(n - 50)*2/2 Factor 3p*3 + 4941p*2 + 2056509p + 18110547. 3(p + 9)(p + 819)*2 Factor -6p*2 + 3712p + 42840. -2(p - 630)(3p + 34) Factor 3t*3 - 9t*2 - 1191t + 1197. 3(t - 21)(t - 1)(t + 19) Factor 5c*3 - 1660c*2 + 38375c. 5c(c - 307)(c - 25) Factor 2j*2 - 454j + 20040. 2(j - 167)(j - 60) Solve -4t2 - 868t - 23064 = 0. -186, -31 Suppose 2c4 + 8680c*3 + 9356716c*2 - 132831832c - 142179870 = 0. Calculate c. -2177, -1, 15 Find a such that -2a4/7 + 18a*3/7 + 3036a*2/7 - 6848a + 26880 = 0. -42, 8, 35 Solve -12v4/7 - 1550v*3/7 - 256v*2/7 + 258v/7 = 0 for v. -129, -1/2, 0, 1/3 Suppose -2r5/7 + 558r*4/7 - 36238r*3/7 - 387582r*2/7 + 1017792r/7 + 1368576/7 = 0. Calculate r. -11, -1, 3, 144 Suppose 4r2 - 1177168r + 1177164 = 0. Calculate r. 1, 294291 Factor -m*3/4 + 137m*2/4 + 11649m/4 + 33687/4. -(m - 197)(m + 3)(m + 57)/4 Determine v so that -1755v3 - 727520v*2 - 1394380v + 107280 = 0. -5364/13, -2, 2/27 Suppose -2v5/9 - 92v*4/9 - 422v*3/9 - 164v*2/3 = 0. What is v? -41, -3, -2, 0 Factor 2k*3 + 260k*2 + 10914k + 145656. 2(k + 28)(k + 51)*2 Let 4z*2 - 4344z + 787520 = 0. Calculate z. 230, 856 Find t, given that -5t5 - 545t*4 - 13385t*3 + 28425t*2 - 14490t = 0. -69, -42, 0, 1 Factor -34x2/3 + 61x/3 + 100. -(x - 4)(34x + 75)/3 Determine p so that 12p4 - 3962p*3/3 + 8032p*2/3 - 4322p/3 + 72 = 0. 1/18, 1, 108 Factor -5x3 - 1310x*2 - 65100x - 909000. -5(x + 30)2(x + 202) Suppose -k*3 - 485k*2 + 974k = 0. Calculate k. -487, 0, 2 Find i, given that -i*4 + 1169i*3 - 4664i*2 + 4660i = 0. 0, 2, 1165 Suppose 3m5/5 + 657m*4/5 + 1947m*3/5 + 639m*2/5 - 390m - 1296/5 = 0. Calculate m. -216, -2, -1, 1 Factor 5v4 - 9220v*3 + 4204070v*2 + 42734700v + 107416125. 5(v - 927)2(v + 5)*2 Find w such that -2w*5 - 13938w*4 + 139554w*3 - 181574w*2 - 837552w - 502488 = 0. -6979, -1, 6 Factor 2d4 - 3532d*3 + 1655138d*2 - 84556080d + 1146247200. 2(d - 855)2(d - 28)*2 Factor -1083t*3/2 + 932235t*2/2 + 98148t + 5166. -3(t - 861)(19t + 2)2/2 Factor o3/4 - 45111o*2/2 + 2035002321o/4. o(o - 45111)2/4 Factor -7v*4/5 - 19v*3 - 273v*2/5 + 27v. -v(v + 5)(v + 9)(7v - 3)/5 Find v, given that 5v4 - 875v*3 - 19000v*2 - 97500v = 0. -10, 0, 195 Let 8a2/11 - 58166a/11 - 1322 = 0. Calculate a. -1/4, 7271 Solve j*3 - 16j*2 - 332j + 5040 = 0 for j. -18, 14, 20 Solve -2y2/3 + 3436y/3 + 4592 = 0 for y. -4, 1722 Let -4b4 + 8608b*3 - 934620b*2 + 26503232b - 25577216 = 0. What is b? 1, 56, 2039 Suppose 2l4 - 3302l*3 - 6l*2 + 9902l + 6604 = 0. Calculate l. -1, 2, 1651 Let h*5/9 + 5h*4/3 - 59h*3/3 - 2431h*2/9 = 0. Calculate h. -17, -11, 0, 13 Determine k so that -2k*4/9 + 454k*2/9 - 100k + 448/9 = 0. -16, 1, 14 Factor -2x2 - 494x + 1108036. -2(x - 631)(x + 878) Factor -2r4/19 + 32516r*3/19 - 132096234r*2/19 - 528775192r/19 - 528905288/19. -2(r - 8131)2(r + 2)*2/19 Suppose -407h*3/2 - 15875h*2/2 - 7772h - 38 = 0. Calculate h. -38, -1, -2/407 Factor 5i2 + 55850i. 5i(i + 11170) Find h such that -5h4 + 105h*3 + 65h*2 - 1425h + 1260 = 0. -4, 1, 3, 21 Solve -2c4/15 - 52c*3/15 - 74c*2/5 + 388c/15 + 112/3 = 0. -20, -7, -1, 2 Factor 2x2/7 - 590x/7 + 13500/7. 2(x - 270)(x - 25)/7 What is g in 4g3 - 140g*2 - 964g - 820 = 0? -5, -1, 41 Let 5k4 - 3905k**3 - 19735	{ "pile_set_name": "DM Mathematics" }
rs picked without replacement from pypdddddyypdr. What is prob of sequence pypr? 3/2860 Calculate prob of sequence xxxx when four letters picked without replacement from {x: 6, c: 6}. 1/33 Calculate prob of sequence uuuu when four letters picked without replacement from uuuuuuuuu. 1 Two letters picked without replacement from {m: 9, z: 3}. Give prob of sequence zm. 9/44 Two letters picked without replacement from {z: 2, c: 4}. What is prob of sequence zc? 4/15 Two letters picked without replacement from {j: 1, k: 1, w: 1}. What is prob of sequence wj? 1/6 Four letters picked without replacement from {l: 2, h: 4}. What is prob of sequence hlhh? 2/15 What is prob of sequence eyas when four letters picked without replacement from {e: 1, y: 2, a: 2, s: 1, f: 1}? 1/210 What is prob of sequence tt when two letters picked without replacement from ypnytpppaaatpp? 1/91 Two letters picked without replacement from uuud. Give prob of sequence ud. 1/4 Calculate prob of sequence pp when two letters picked without replacement from pgpppgpppppg. 6/11 Calculate prob of sequence iu when two letters picked without replacement from yinyun. 1/30 Calculate prob of sequence qysq when four letters picked without replacement from qrrsrysrrrzsqqqsy. 1/595 Four letters picked without replacement from {q: 1, w: 1, b: 2, l: 1, o: 2}. What is prob of sequence wbwb? 0 Three letters picked without replacement from {g: 2, t: 1, f: 1, q: 11, l: 4}. Give prob of sequence fgt. 1/2907 Two letters picked without replacement from bvvvb. Give prob of sequence bv. 3/10 Three letters picked without replacement from uquuuqubq. Give prob of sequence uqb. 5/168 Three letters picked without replacement from {v: 3, q: 2, x: 1, s: 3, z: 10}. Give prob of sequence qzv. 10/969 Calculate prob of sequence mnk when three letters picked without replacement from {d: 2, m: 4, n: 2, x: 3, k: 7}. 7/612 Two letters picked without replacement from qfqfqqqqmqqqmqqqf. Give prob of sequence mf. 3/136 What is prob of sequence eeee when four letters picked without replacement from eeeeeeeeee? 1 What is prob of sequence wkq when three letters picked without replacement from {w: 3, q: 4, k: 6}? 6/143 Calculate prob of sequence enn when three letters picked without replacement from {n: 3, e: 3}. 3/20 Calculate prob of sequence lc when two letters picked without replacement from lcicli. 2/15 Calculate prob of sequence vg when two letters picked without replacement from {a: 2, t: 1, v: 6, g: 9}. 3/17 What is prob of sequence fa when two letters picked without replacement from {f: 7, a: 10, b: 1}? 35/153 Two letters picked without replacement from {n: 1, o: 1, c: 1}. What is prob of sequence co? 1/6 Two letters picked without replacement from {t: 8, c: 8, g: 4}. Give prob of sequence gc. 8/95 Calculate prob of sequence hhrr when four letters picked without replacement from rrrrrhrrrrhhrrr. 11/455 What is prob of sequence ikp when three letters picked without replacement from {i: 1, k: 5, t: 2, p: 1}? 5/504 What is prob of sequence alyy when four letters picked without replacement from {a: 3, l: 2, u: 1, y: 3, s: 1, d: 1}? 1/220 Three letters picked without replacement from xttzzxvv. What is prob of sequence xvz? 1/42 What is prob of sequence lae when three letters picked without replacement from {l: 8, a: 1, e: 4}? 8/429 Four letters picked without replacement from {s: 8, r: 2, h: 2, k: 2, y: 1}. Give prob of sequence khkr. 1/4095 Three letters picked without replacement from hxhuutxhuhuxxuxhuh. Give prob of sequence xht. 5/816 Three letters picked without replacement from {a: 10, j: 3, k: 2}. What is prob of sequence kja? 2/91 What is prob of sequence yc when two letters picked without replacement from ccccycyccy? 7/30 What is prob of sequence sooo when four letters picked without replacement from oosbo? 1/20 Four letters picked without replacement from {z: 6, e: 2, t: 1, k: 1, o: 2}. Give prob of sequence zzto. 1/198 Calculate prob of sequence rf when two letters picked without replacement from {r: 5, u: 5, s: 5, f: 2, i: 3}. 1/38 Calculate prob of sequence xbx when three letters picked without replacement from xxbbbbbbbb. 1/45 Three letters picked without replacement from iiwwwwwuiwviiwvij. Give prob of sequence iuj. 1/680 Three letters picked without replacement from {f: 2, v: 1, j: 3, i: 6}. Give prob of sequence jjj. 1/220 Four letters picked without replacement from vvtvtmvgtzmggzzg. What is prob of sequence zvtv? 9/3640 Calculate prob of sequence xx when two letters picked without replacement from xxxvxnxvxx. 7/15 Two letters picked without replacement from uuuv. What is prob of sequence uv? 1/4 Calculate prob of sequence zz when two letters picked without replacement from {i: 3, z: 3, y: 3, q: 6}. 1/35 Four letters picked without replacement from mmogggoo. What is prob of sequence mgog? 3/140 Four letters picked without replacement from ysyddydy. Give prob of sequence ydys. 3/140 Calculate prob of sequence hh when two letters picked without replacement from {r: 12, v: 2, h: 3}. 3/136 Calculate prob of sequence xxx when three letters picked without replacement from xxxxxnxxxxn. 28/55 Calculate prob of sequence ttpp when four letters picked without replacement from {t: 10, p: 10}. 45/646 Three letters picked without replacement from {i: 1, m: 1, y: 1, k: 1, u: 1}. What is prob of sequence yim? 1/60 What is prob of sequence zz when two letters picked without replacement from zzppzpppzzpzzzppzzp? 5/19 Four letters picked without replacement from {q: 9, d: 10}. Give prob of sequence ddqq. 45/646 Calculate prob of sequence ox when two letters picked without replacement from xxxxxoooxxxxxxoxxx. 28/153 Calculate prob of sequence mcmm when four letters picked without replacement from {m: 4, c: 2}. 2/15 What is prob of sequence pee when three letters picked without replacement from {p: 8, b: 1, t: 1, e: 2, u: 3, l: 1}? 1/210 Calculate prob of sequence dk when two letters picked without replacement from wdkdkkwdk. 1/6 Two letters picked without replacement from llzz. Give prob of sequence lz. 1/3 Four letters picked without replacement from amtmmnoktnnmama. Give prob of sequence nkmm. 1/546 Calculate prob of sequence ax when two letters picked without replacement from avkakovxc. 1/36 What is prob of sequence uc when two letters picked without replacement from qpuqcll? 1/42 Calculate prob of sequence jpo when three letters picked without replacement from ppooj. 1/15 Three letters picked without replacement from dzzzkzdd. Give prob of sequence dzz. 3/28 What is prob of sequence qc when two letters picked without replacement from {c: 1, q: 3, j: 3}? 1/14 Two letters picked without replacement from {f: 1, y: 2, v: 1, w: 1}. What is prob of sequence yy? 1/10 Two letters picked without replacement from fqf. What is prob of sequence qf? 1/3 Four letters picked without replacement from {v: 3, m: 6, z: 7, y: 3}. What is prob of sequence zzvy? 21/5168 Calculate prob of sequence jhjj when four letters picked without replacement from jvqnjjjjnjhnj. 7/572 Two letters picked without replacement from {w: 3, h: 1, c: 2, k: 1, s: 2, g: 3}. What is prob of sequence sg? 1/22 What is prob of sequence km when two letters picked without replacement from kkkmmmkkbhjs? 5/44 Two letters picked without replacement from bbubbbbbbububbuubb. Give prob of sequence bu. 65/306 Four letters picked without replacement from eoooozezeoozo. What is prob of sequence ezez? 3/1430 Two letters picked without replacement from thhcchdhbthdcbd. What is prob of sequence ct? 1/35 What is prob of sequence dxd when three letters picked without replacement from {a: 1, l: 5, n: 1, x: 2, k: 2, d: 2}? 1/429 Calculate prob of sequence hh when two letters picked without replacement from cochhcocchoo. 1/22 What is prob of sequence swkw when four letters picked without replacement from {q: 5, k: 1, s: 1, j: 2, w: 3}? 1/1980 Two letters picked without replacement from {p: 6}. Give prob of sequence pp. 1 Calculate prob of sequence wdsu when four letters picked without replacement from {f: 10, d: 1, w: 4, u: 3, s: 1}. 1/7752 What is prob of sequence ll when two letters picked without replacement from {l: 6, b: 4}? 1/3 Calculate prob of sequence fzt when three letters	{ "pile_set_name": "DM Mathematics" }
0.0000003 Let u = -2804.000004 - -2804. Round u to six dps. -0.000004 Let c = -1306.415 - -1310. Let a = -3.5 + c. Let q = a - 0.09. What is q rounded to 2 decimal places? -0.01 Let p = -6556.4295 + 6558. What is p rounded to one dp? 1.6 Let w(p) = p*3 - 13p*2 - p + 21. Let s(x) = 2x*3 - 27x*2 - 3x + 43. Let i(v) = -4s(v) + 9w(v). Let o be i(10). Round o to the nearest ten. 150 Let z = -5.1 + 4.89. Let i = -0.25485 + 0.0449. Let s = i - z. What is s rounded to five dps? 0.00005 Let d = -4913448.000038 - -4913457. Let f = -9 + d. What is f rounded to five dps? -0.00004 Let a = -10387.300086 + 10386.33. Let h = a - -0.97. Round h to 5 decimal places. -0.00009 Let f = 130.9997348 - 131. What is f rounded to four dps? -0.0003 Let q = -19.054 + 0.054. Let j = q + 18.999964. What is j rounded to 5 decimal places? -0.00004 Let w = 1 - 1. Suppose w = -2f - 2f + 6089888. Let g = -1072472 + f. Round g to the nearest one hundred thousand. 500000 Let d = 48.50515 + -48.5. Round d to four dps. 0.0052 Let s(y) = 2y - 3. Let b(z) = -1. Let f(k) = -4b(k) + s(k). Let c be f(2). Let h be ((-36)/c)/(2/2500). What is h rounded to the nearest ten thousand? -10000 Let p = -844.006933 - -844. What is p rounded to four decimal places? -0.0069 Let r = -15080417.9999924 - -15080411. Let g = 7 + r. Round g to six dps. 0.000008 Let c(z) = z*3 - 3z*2 - 6z + 2. Let j be c(4). Let m = 8 + j. Suppose ms + 1800000 = -3s. What is s rounded to the nearest one hundred thousand? -400000 Let w = 718.93 - 2.93. Let y = w - 716.421. What is y rounded to two dps? -0.42 Let z = 18636836 + -18636860.9999944. Let m = -40 + 65. Let q = m + z. What is q rounded to six decimal places? 0.000006 Let a = 2099.2158 - 2099. What is a rounded to 2 dps? 0.22 Let a be (-28)/(-49) + (-115)/(-7). Let r = a + -8. Round r to the nearest integer. 9 Let r = 5661 - 5720.42. Let d = 60 + r. Let n = -0.16 - d. Round n to 1 decimal place. -0.7 Let a = -257.31124 + 0.79524. Let o = a - -257. Round o to 1 decimal place. 0.5 Let p = 30385755541472.81540106 + -30389952677814.8154. Let u = p - -4197136299. Let b = 43 + u. What is b rounded to seven dps? 0.0000011 Let a(x) = -43057x3 - 8x*2 + 7x + 18. Let w be a(-6). Round w to the nearest 1000000. 9000000 Let y = -81077 - -81088.99808. Let q = -17 + 29. Let t = y - q. Round t to four dps. -0.0019 Let o(y) = 2475002y3 - 6y*2 + 6y - 4. Let m be o(2). Round m to the nearest 1000000. 20000000 Let l = -149 - -149.00098. What is l rounded to three dps? 0.001 Let w = 10 + -6. Suppose -wu - 312555 = -u. Let o = -7815 + u. Round o to the nearest ten thousand. -110000 Let x(m) = -19m + 9. Let z be x(3). Let s be 18/z - (-11399991)/(-24). What is s rounded to the nearest 100000? -500000 Suppose 0 = s + z - 135, -z - 145 = -s + 3z. Suppose 0 = 5t - s - 748. Suppose -4r - 5 = -t. What is r rounded to the nearest 10? 40 Let k = -1511.998594 - -1512. What is k rounded to 3 dps? 0.001 Let l = 359 - 359.00000356. Round l to seven dps. -0.0000036 Let s = -518.00379 + 518. What is s rounded to 3 dps? -0.004 Let t = 23 - 23.36. Let c = t - -0.35999898. Round c to 6 dps. -0.000001 Suppose 2c + 18165 + 2461 = 0. Let t = c - -3813. Round t to the nearest 1000. -7000 Let y = -60 - 119. Let a = 239251758.89 + -239251937.89000097. Let m = a - y. What is m rounded to 7 decimal places? -0.000001 Suppose 0 = x - 4f + 14170012, 4x = 3x + 5f - 14170015. Round x to the nearest one million. -14000000 Let d(g) = 1702g2 - 12g + 100. Let y be d(6). What is y rounded to the nearest 1000? 61000 Let t = 0.59 + 4.81. Let m = 1.9 - t. Round m to the nearest integer. -4 Let r = 19249888.67899382 - 19250082.679. Let f = r - -194. Round f to six dps. -0.000006 Let p = 100093 + 64307. What is p rounded to the nearest ten thousand? 160000 Let f(d) = 4d + 2. Let n be f(2). Suppose 14331 = -7r + nr. Let q = r + -3377. Round q to the nearest one thousand. 1000 Let n = 11 - 10. Let h = n - -3. Suppose -371380 = -hl + 868620. Round l to the nearest one hundred thousand. 300000 Let f = 334.88 + -31.18. Round f to the nearest one hundred. 300 Let k = -32.5 + 22. Let h = 3.5 - k. Let l = h - 13.7. What is l rounded to one dp? 0.3 Let k(z) be the second derivative of -z*3 + 5z*2/2 - 159z. Suppose 4p - 4y = -36, 4p = -5y - 0 + 9. Let r be k(p). Round r to the nearest 10. 30 Let q = -18.385 + -0.015. Let l = 15 + q. Round l to the nearest integer. -3 Let m = 50 + -36. Let y = 11.5 - 23. Let z = y + m. What is z rounded to 0 decimal places? 3 Suppose 0 = 3k - 5y - 52282, 4k + 7y - 69721 = 2y. Let q = k + -24739. What is q rounded to the nearest 1000? -7000 Let a(v) = -23v. Let k be a(-5). Let d be (-100)/((-47)/k + 14/35). What is d rounded to the nearest one thousand? 12000 Let o(v) = 0 + 1 + 4v + 15 - 5v. Let w be o(13). Suppose 4k + k = wu + 9905, 0 = 5u + 3k + 16497. Round u to the nearest 100. -3300 Let z = -20.68 - 988.32. Let i = z - -1003.71. Round i to 0 decimal places. -5 Let s = -21.56 + 21.56000072. What is s rounded to 6 dps? 0.000001 Let c = -14225620.8115691 + 14225620. Let y = c - -0.361567. Let p = y - -0.45. What is p rounded to 6 decimal places? -0.000002 Let z = -974.441 - -906.39. Let v = -68 - z. Let q = v + -0.051142. Round q to five decimal places. -0.00014 Let y(t) = -2t2 + 23 + 242t*3 - 23 - 4t. Let v be y(-3). Round v to the nearest 1000. -7000 Let a = -401468752.0000252 + 401468683. Let h = a - -69. What is h rounded to 6 dps? -0.000025 Let i = -1.77 + 1.7699447. What is i rounded to five dps? -0.00006 Let f = 18 - 13. Suppose 0 = fk - 0p + 5p + 565, -3k - 2p - 340 = 0. What is k rounded to the nearest 10? -110 Let z = -0.041203 + 0.041. Round z to five dps. -0.0002 Let d = 0.5 + 11.5. Let s = 1704606.99999 - 1704595. Let i = d - s. Round i to six dps. 0.00001 Suppose 14 = 3s - 10. Let a be (-31188)/s + 3/(-2). What is a rounded to the nearest one thousand? -4000 Let y = 11 - 9.2. Let q = -1.837 + y. Let g = 0.07 + q. What is g rounded to 2 dps? 0.03 Suppose 5j + 5a = -10, 4a = j + a + 6. Let f be -2 + 4 + j + 35395290. Let x = f - 19095289. Round x to the nearest one million. 16000000 Let i = -42 + 62. Let w = 20.000005 - i. Round w to 5 decimal places. 0.00001 Let c(s) = -2036359s + 51. Let d be c(-11). Suppose 3j - 7j + 8 = 0. Suppose 0 = jy + 2y - d. What is y rounded to the nearest 1000000? 6000000 Let g = 9736733 + -4351733. What is g rounded to the nearest 1000000? 5000000 Suppose 9 = 7i - 19. Suppose -h - ih + 46500 = 0. Round h to the nearest 1000. 9000 Let i = 47.71 - 48. Let d = i - -0.2899712. Round d to 6 dps. -0.000029 Let r = 6745.3 - 6464. Let p = -408 - -144. Let q = p + r. Round q to zero decimal places. 17 Let o = -32 + 30. Let l be (o(-72)/20)/(9/262500). What is l rounded to the nearest one hundred thousand? 200000 Suppose -5b + s = -141833, -4s - 130527 = -5b + 11315. Let a = b + -9366. Round a to the nearest ten thousand. 20000 Let h be 48/(-8) - -5 - -15481. What is h rounded to the nearest 1000? 15000 Let p(j) = -j*2 - 6j - 1. Let i be (-1)/(-2)(0 - 14). Let b be p(i). Let n = 14 + b. What is n rounded to the nearest 10? 10 Let t(o) = -41247o*2 + 27o - 76. Let z be t(17). What is z rounded to the nearest 1000000? -12000000 Let p = -12 + 5. Let z = 8 + p. Let u be 1 - z - (-699994 + -6). Round u to the nearest 1000000. 1000000 Let b = 121 - 36. Let n = -29 + b. Let f = n - 56.0029. What is f rounded to 3 dps? -0.003 Let k = 1347 - 947. Let t = k - 193. Let p = 207.000101 - t. What is p rounded to five dps? 0.0001 Let c = 120.84322 - 179.84359. Let a = 59 + c. Round a to 4 dps. -0.0004 Suppose 65669 = 4y + 282817. Let k = -2285713 + y. What is k rounded to the nearest one hundred thousand? -2300000 Let b be -5((-1)/3)/(5/15). Suppose 0 = 3f + bf - 1000000. What is f rounded to the nearest 100000? 100000 Suppose -4p - 76 = -3r, 44 = 9p - 11p + 3r. Let m(g) = -37g + 8. Let d be m(p). Round d to the nearest one thousand. 1000 Let l(g) = g*2 - 7g - 16. Let n be l(9). Let i be 0 - (2050000/12)/(n/192). Round i to the nearest one million. -16000000 Let s = -5.4 + 5.19. Let n = 13.14 + -13. Let j = n + s. What is j rounded to 1 decimal place? -0.1 Let b = -3	{ "pile_set_name": "DM Mathematics" }
e f(-3). Let l = 173/4 + t. Which is the closest to l? (a) -5 (b) -3 (c) 0.4 c Let z = -7.5 - -8. Let v = -0.02 + 0.02. Which is the nearest to 0.1? (a) z (b) v (c) -3 b Let l = 4 - 3. Let p = 11/30 - -3/10. Which is the nearest to p? (a) 3/7 (b) 0.2 (c) l a Let q be (21)/((-20)/50). Let t be (-3 + 1)/((-1)/2). What is the nearest to -1/4 in q, t, 5? t Let r be (1/3)/(-1) + 1. Let f = 41 + -38. Which is the closest to r? (a) f (b) 1/4 (c) -3/2 b Let p = -0.01 + -0.29. Let t = p - -0.2. Let r = -3 - -3.4. Which is the closest to t? (a) -1/4 (b) r (c) 0.5 a Let t be (-3 - -2) + 11/9. What is the nearest to 2 in t, 0.2, -1/11? t Let y = -1154/9 - -128. Which is the nearest to -3/10? (a) y (b) -1/4 (c) -0.4 b Let f = 0 + 1. Suppose 5r = -5u + 20, 3r - 4 = r. Suppose -2x = ul + 3 + 7, 0 = x - 5l + 5. Which is the closest to -2/3? (a) x (b) f (c) -2 c Let u = 4.4 + -0.4. Which is the closest to -3? (a) 5 (b) -2 (c) u b Let y = 219.89 + -221. Let i = 0.11 + y. Which is the closest to i? (a) -1/4 (b) 5 (c) -2 a Let t = 11 - 9. Let b = t + 0. What is the nearest to 1/2 in 1/3, 0.3, b? 1/3 Let o = -20.8 + 21. Which is the closest to 0.2? (a) 0.1 (b) 0.5 (c) o c Let n be (-3 - (-20)/12) + 2. What is the closest to n in 0.12, 4, 5? 0.12 Let c = -2 - -1.5. What is the nearest to 0.1 in 3/4, c, -1? c Let z = -4 - -6. Let v(k) = k2 + 2k + 1. Let n be v(-3). Let g = -6 + 3. Which is the closest to z? (a) 3/4 (b) g (c) n a Let j be (-3)/(-5)80/72. Which is the nearest to -0.2? (a) 0.3 (b) 0 (c) j b Let h = -5 - -10. Let g = -21 + 16.5. Let k = g + h. Which is the closest to 2? (a) -2/3 (b) -5 (c) k c Let l = 12 + -12. Suppose 0 = 4d - 0d - 4. Let p be (-2)/6 - d/6. Which is the nearest to l? (a) p (b) -0.3 (c) 1/4 c Let w = 4 - 0. Let p = -0.12 - -0.22. Which is the closest to 2/7? (a) p (b) w (c) 5 a Let v = 183/4 - 46. Let x = 717/20 + -173/5. What is the closest to -1 in v, 1/3, x? v Let p be ((-34)/(-44) + -1)8/(-10). Let s = -0.1 - -0.12. Let l = -3.02 + s. What is the nearest to 0.1 in p, l, 0? p Let k be (-4)/(-2) - (-10)/(-6). Which is the closest to 4? (a) k (b) -1/5 (c) 3 c Let o(p) = p*3 + 6p*2 - 2p - 6. Let h be o(-6). Let q = 8 - h. Which is the closest to 0.2? (a) 4 (b) q (c) -3 b Let t = -5/8 - -3/4. Which is the closest to -1? (a) -0.3 (b) t (c) -3 a Let x = 27 + -27.4. Which is the nearest to 0.3? (a) 4 (b) x (c) -3 b Suppose -4j - 1 = -5u - 17, 4j + 8 = -u. Which is the closest to j? (a) 0.4 (b) 2/7 (c) 1/3 b Let r(a) = a3 - 2a*2 - 3a - 4. Let n be r(7). Let g = 2862/13 - n. What is the nearest to -2/3 in -1, g, 2/17? -1 Let x = -106.7 + 115. Let t = x + -8. What is the closest to -1 in t, 0.4, 2/7? 2/7 Let u be 321/3. Suppose uf - 3 = -f. Let l = -0.4 + 0.3. What is the closest to l in f, 2/5, -4? 2/5 Let t = 0.08 - 4.08. Let u = -45 - -46. What is the closest to -2 in 3, u, t? t Let k = -0.04 - -0.11. Let y = -4.93 - k. Let j be ((-1)/3)/(4/(-6)). Which is the closest to -0.1? (a) y (b) -0.2 (c) j b Let a = -0.45 + 0.35. What is the nearest to a in -3, 2/13, 0.4? 2/13 Suppose 0 - 3 = -d. Suppose -5i + 5o = 320, -5o - 2 = d. Let x = i + 323/5. Which is the nearest to -0.1? (a) -2 (b) x (c) 2 b Let v = 8 - 8.25. Let l = v + -0.05. Which is the nearest to -2/5? (a) 0.1 (b) l (c) 4 b Let h = -14.1 - -14. What is the nearest to h in -0.02, 3, 2/3? -0.02 Suppose 4z + z = 2a + 10, 4a + 6 = 3z. What is the closest to a in 2/5, 9, -3? 2/5 Let s(n) = -n*2 + 1. Let l be s(-5). Let g be l/(-63) + (-2)/3. What is the nearest to -2 in g, 0, 5? g Let h = 19/7 - 3. What is the closest to -2/5 in -1, h, 1? h Let z = 1 + -1. Suppose q + 0q = -o - 5, 25 = -5o + 2q. Let w be (4/10)/(8/12). What is the closest to z in -1/2, w, o? -1/2 Let n be ((-27)/(-15) - 2)1. Let x = 4 - 2. Let m = 2 - x. What is the nearest to 0 in n, 2/11, m? m Suppose 0 = -3y - 3y. What is the closest to y in -2/7, -5, 1/6? 1/6 Let j = -0.098 - -0.498. Let z = -5 - -10. What is the nearest to 0.2 in j, z, 1? j Let r = -89/126 - -5/18. Let d = -0.37 - 1.63. Which is the closest to 0? (a) d (b) r (c) -0.1 c Let c = -0.4 - -4.4. What is the closest to -1 in -4, -5, c? -4 Let m = -3 - -4. Let y = 0 - -0.2. What is the closest to m in y, 3/5, -0.5? 3/5 Let x = -0.329 - -0.029. Which is the nearest to 3/10? (a) -1/3 (b) x (c) -0.1 c Let t = 2 + 0. Let y = 0.015 + 0.085. Let l = -2 + 3. What is the nearest to y in 5, l, t? l Let n = -2 - -1.5. What is the closest to -1 in 5, n, -0.1? n Let q = -0.1 + 0.1. Let n = 0.06 - 0.16. Let s = -0.5 + 4.5. Which is the nearest to n? (a) -1 (b) q (c) s b Let r be ((-34)/8)/(45/(-36)) + -3. Which is the nearest to -0.1? (a) -1/2 (b) 6 (c) r a Let m = -6 - -3. Let g be (8/3 - 3)/((-2)/4). What is the closest to -3 in m, -0.2, g? m Suppose 7m - 13 = -6m. What is the closest to m in 1, -5, -1/9? 1 Let l be (-10)/(-66) - 2/6. Let c = -12 + 13. Let s be 2 + -2 - (-2)/(-16). What is the nearest to c in 3, s, l? s Let g(j) = -j - 6. Let z be g(-8). What is the closest to 0.1 in -0.3, z, -3? -0.3 Let h = 2/317 - -608/4121. Let v be (-5)/4 - 0 - -1. Which is the closest to v? (a) 3 (b) h (c) -1/8 c Let c = 3.3 - 3.2. What is the nearest to 2/5 in c, 3, 1/4? 1/4 Let w = 31.7 - 32. Which is the nearest to -2/49? (a) -2 (b) -0.1 (c) w b Suppose -z + 0z = 3. What is the closest to -2/3 in z, 0, 1/3? 0 Let u = -25 + 21. What is the nearest to -0.5 in u, 5, -0.3? -0.3 Let t = 41 + -11. Let a = t - 30.2. Let p = 2.7 - 3. What is the closest to a in -5, p, 0? p Let n = -7 + 8. Let v(s) = s*2 - 8s + 10. Let h be v(7). Which is the closest to n? (a) h (b) 0 (c) -2/11 b Let v = 1 + -1.2. Let z = v - 4.8. Which is the nearest to -1? (a) -2/7 (b) z (c) -2/17 a Let l = 120.5 - 97. Let w = 23 - l. Let x = -107/2 - -753/14. Which is the nearest to 1? (a) x (b) 4 (c) w a Let i = 809 - 1619/2. Let o = -1652/7353 + 2/817. Which is the closest to i? (a) o (b) 1 (c) -3 a Let s = 4.5 - 4.5. Which is the nearest to -0.1? (a) 1 (b) s (c) 1/8 b Let v = 33.6 + -34. Which is the nearest to 1? (a) 1 (b) v (c) -2 a Let s(z) = z*2 - 7z + 6. Let u be s(4). Let p be 2(-2 + (-15)/u). Let y be (-4 - -4)1-1. Which is the nearest to y? (a) 4 (b) p (c) 3 b Let o be 0 + (3/12 - 0). Let z = -2.9 + 3. Which is the closest to o? (a) -0.3 (b) z (c) 0.02 b Let k = -1 - -3. Which is the closest to -0.1? (a) -0.1 (b) -2/3 (c) k a Let z = 0.13 + -0.63. Which is the closest to -0.1? (a) -0.1 (b) 1/3 (c) z a Let b = 13.2 - 13. What is the closest to 1 in 0.5, b, -1/14? 0.5 Let j(n) = -3n - 4. Let v be j(-3). Which is the closest to -1? (a) v (b) 2/17 (c) -3 b Let i = -7592113/111 - -68398. Let r = -3/37 - i. Let h = -6 - -5. What is the closest to -2/7 in -0.4, h, r? -0.4 Let y = -1 + -3. Let q = y + 6. Suppose -qm + 3 = -3. Which is the closest to -2? (a) m (b) 1 (c) -1 c Let n be (-3)/(-6)(0 + -2). Let j be 2/5 + (-7)/5. Let f be 30/9 + 4/6. Which is the nearest to n? (a) f (b) j (c) 1 b Let a = 2 - 1.5. Let z = -22 + 13. Let u = 6 + z. What is the nearest to 1 in a, u, 2/15? a Let n be (0 + 2)/((-4)/(-4)). Let l be (-3)/(-6)n8. Let y be (-12)/l + 1/2. What is the closest to y in 2, -0.1, 3? -0.1 Let n = -2030/9 - -226. Which is the closest to -2/93? (a) -3 (b) 0 (c) n b Let k = -2 + 1. Suppose -5 = 2q - 3. Let z = 3.92 - -0.08. What is the closest to q in k, 1, z? k Let x = 2 - -4. Let n = x + -4. What is the nearest to n in -5, 1/2, 0.2? 1/2 Let y be (18/(-15))/(-2) - 22/20. Which is the closest to 0? (a) 5 (b) 0.3 (c) y b Let l be 1(0 + (3 - 6)). Which is the nearest to -0.3? (a) l (b) 3 (c) -2/9 c Let h = -0.83 - -0.81. Let v = 1 + -1.02. Let u = h - v. Which is the nearest to -1? (a) 3 (b) 2/5 (c) u c Suppose 12 = -2h + 60. Let m be 1/(-4) - (-14)/h. Let y = -4 - -4. What is the closest to y in 3, 0.1, m? 0.1 Let s = 1 + -1.2. Let w = 0.1 + s. Suppose -4f - u + 16 = 0, 0 = u + u - 8. Which is the nearest to w? (a) 2/3 (b) -1 (c) f a Let y = 0 - -5. Let t = 0.1 - 0. Let j be 2/4(-36)/(-30). Which is the closest to t? (a) y (b) -5 (c) j c Suppose 0 = 2k - 5*k - 15. Let m = 8 + k. Which is the neares	{ "pile_set_name": "DM Mathematics" }
i3 + i2 - 86 Collect the terms in -1288t - 32 + 32. -1288t Collect the terms in 6962382y - 13924755y + 6962376y. 3y Collect the terms in -2051f*3 - 2050f*3 + 4082f*3. -19f*3 Collect the terms in -9z*2 - 2z*3 - 3065 + 9z*2. -2z*3 - 3065 Collect the terms in 1297c*3 + 1304c*3 - 2618c*3. -17c*3 Collect the terms in 1868h*2 - 550h*2 + 1586h*2. 2904h*2 Collect the terms in -3f + 65488f3 - 65486f*3 + 9f. 2f3 + 6f Collect the terms in 19718 - 19718 - 5f2. -5f*2 Collect the terms in 38 - 20 - 5 + 23i - 13. 23i Collect the terms in -4d*2 - 6231d - 6260d + 5d*2 + 12494d. d*2 + 3d Collect the terms in 29250d2 + 9d - 4d - 5d. 29250d2 Collect the terms in -1884335343 + 1884335343 - 2l*3. -2l*3 Collect the terms in 596418m*3 - 73 + 73 - 596412m*3. 6m*3 Collect the terms in 2w*3 + 906658w*2 - 906658w*2. 2w*3 Collect the terms in 5 + 0 + 4 + 1458o + 17 - 1457o. o + 26 Collect the terms in -59f + 568577 - 568577 + 69f. 10f Collect the terms in 12k3 - 7k*3 + 577k - 577k + 5k*3. 10k*3 Collect the terms in -101 + 101 + 2797w. 2797w Collect the terms in 3125y*2 - 6216y*2 + 3105y*2. 14y*2 Collect the terms in l - 15l + 4l + 13l*2 - 8l. 13l2 - 18l Collect the terms in -174o + 68 - 37 - 31. -174o Collect the terms in 603b2 - 15b*2 - 219b*2 + 772b*2. 1141b*2 Collect the terms in 6 + 129868j - 6 - 129887j. -19j Collect the terms in -29c2 - 31c*2 + 602 + 57c*2 - 602. -3c*2 Collect the terms in -2 + 0 + 1 + 964q - 1010q. -46q - 1 Collect the terms in -111490 + 2q3 + 111490. 2q*3 Collect the terms in -44912 - 241p*2 + 44912. -241p*2 Collect the terms in n + 5n + 9n2 - 6n - 14n2 - 7n*2. -12n*2 Collect the terms in 8f*2 - 48179 + 0f*2 + 48179. 8f*2 Collect the terms in 228h + 9 + 182h - 9 + 156h. 566h Collect the terms in 0 + 110h - 2 - 107h. 3h - 2 Collect the terms in -2106060288g - g2 + 2106060288g. -g*2 Collect the terms in -232f*2 - 203f*2 + 935f*2 - 235f*2 - 183f*2. 82f*2 Collect the terms in -14d + 88d + 133d + 43d. 250d Collect the terms in -98299h2 - 54h*3 + 98299h*2 - 1 + 1. -54h*3 Collect the terms in 195q*3 - 1 - 310q*3 + 154q*3 + 1. 39q*3 Collect the terms in 8k*3 + 13k*3 + 125 + 143 - 268. 21k*3 Collect the terms in -273179g*2 + 819578g*2 - 273196g*2 - 273202g2. g2 Collect the terms in 2973f + 2967f - 5932f. 8f Collect the terms in -158 - 7q + 158 + 16q. 9q Collect the terms in -141 + 141 - 7286t. -7286t Collect the terms in -89b*2 + 21b*2 + 4 + 3 - 3. -68b*2 + 4 Collect the terms in 7a - 1358014 - 5a + 1358014. 2a Collect the terms in 240n3 - 475n*3 + 237n*3 - 36n. 2n3 - 36n Collect the terms in -2365u3 + 3558u*3 - 1903u*3. -710u*3 Collect the terms in -54y*2 - 9y*2 - 1 + 31y + 9y2 - 34y. -54y2 - 3y - 1 Collect the terms in g - 5g2 - 18 + 6g*2 + 7g*2. 8g*2 + g - 18 Collect the terms in 2 - 269d - 374d + 1 - 1. -643d + 2 Collect the terms in 0 + 32z2 + 13z - 4 + 1 + 6. 32z2 + 13z + 3 Collect the terms in 41551a2 - 41551a2 - a3. -a*3 Collect the terms in 7679n*2 + 2n - 3n + 0n + 0n. 7679n*2 - n Collect the terms in 24j - 289j - 12 - 3 + 18. -265j + 3 Collect the terms in -161l - 275l - 3l2 + 2l2. -l2 - 436l Collect the terms in 13g + 4g - 11g + 4g - 12g. -2g Collect the terms in 12a + 73 - 6a2 - 12a - 76. -6a2 - 3 Collect the terms in -3681k + 2651k - 5533k. -6563k Collect the terms in -3l3 + l3 - 2l3 + l3 + l2. -3l3 + l2 Collect the terms in 143p2 + 19p + 0p - 2p + 0 - 2. 143p2 + 17p - 2 Collect the terms in 15q + 2 + 4 - 6 - 11q. 4q Collect the terms in -950u*2 + 104u*3 + 950u*2 - 904u*3. -800u*3 Collect the terms in -139c + 142c - 154 + 154. 3c Collect the terms in 570783o + 12 - 12. 570783o Collect the terms in 709u2 - 773u + 308u2 + 773u. 1017u2 Collect the terms in 61a - 27 + 32 + 993a + 72a. 1126a + 5 Collect the terms in 32d - 10d + 2 - 58d + 35d. -d + 2 Collect the terms in -99g*2 - 31g - 22g + 1 + 8g. -99g2 - 45g + 1 Collect the terms in 13v + 166v + v*2 + 27v. v*2 + 206v Collect the terms in 15723k - 71 + 71 - 15744k. -21k Collect the terms in -4019z + 4019z + z3 + 54z*2 - 54z2. z3 Collect the terms in 10801689 + 33a3 - 10801689. 33a*3 Collect the terms in -1843i + 1924i - 81i - 4i2. -4i*2 Collect the terms in -77j*3 + 87j*3 - 92247 + 92247. 10j*3 Collect the terms in -2x*3 - 18x - 6 - 1 + 5. -2x3 - 18x - 2 Collect the terms in 2 - 2 - 3212q3. -3212q3 Collect the terms in -g2 + 4019g - 4019g + 6g3 - 1. 6g3 - g2 - 1 Collect the terms in -379w3 + 3w*2 + 1146w*3 - 373w*3 - 3w*2 - 380w*3. 14w*3 Collect the terms in -78 - 56 + v + 244 - 52 - 58. v Collect the terms in 88k*3 + 146k*3 - 369k*3. -135k*3 Collect the terms in 21y + 64y + 23y - 107y. y Collect the terms in 25h + 10h + 1858150 - 1858150. 35h Collect the terms in 3x3 + 405x - 197x - x3 + 0x*3 - 174x. 2x3 + 34x Collect the terms in 3d2 - 15d*2 - 229d + 229d. -12d*2 Collect the terms in -4862x + 9722x + 2x2 - x2 - 4860x. x2 Collect the terms in -6b*2 + 280b*2 + 176b*2 - 120b*2. 330b*2 Collect the terms in 2r2 + 1572008174 - 1572008174 + r2 - 2r2 - 2r2. -r2 Collect the terms in 34243 + 3574v2 - 34243. 3574v*2 Collect the terms in 48 - 48 - 9034p. -9034p Collect the terms in 196q*3 - 237 + 235 - 276q*3. -80q*3 - 2 Collect the terms in 23 - 44 + 17 - 5f*3 - f + f + 5. -5f3 + 1 Collect the terms in -22957 + 22957 - z3 + 10z + 3z*3. 2z*3 + 10z Collect the terms in 8107u + 12 - 45 + 19 + 14. 8107u Collect the terms in 167 + 12p + 173 - 341. 12p - 1 Collect the terms in 50v + 45v + 2v + 48v + 4v3 - 145v. 4v3 Collect the terms in 8725r - 11r2 + 14r*2 - 23037r. 3r2 - 14312r Collect the terms in -920 + 461 + y + 459 - 22y3 - y3. -23y*3 + y Collect the terms in -243o - 150 + 302 - 152 + 253o. 10o Collect the terms in -101c - 6c*3 + 55c + c*2 + 46c. -6c3 + c2 Collect the terms in -19j*2 + 19j*2 - 101j*3 + 192j*3 - 30j*3. 61j*3 Collect the terms in -628 - 77z*2 + 628 - 4z + 4z. -77z*2 Collect the terms in -2568z + 982 - 982. -2568z Collect the terms in -2944 + 907w + 2944. 907w Collect the terms in -3504 - 283098m + 283101m + 3504. 3m Collect the terms in -250w - 247w - 245w + 993w - 251w - 4w*2. -4w*2 Collect the terms in 77 - 78b - 79b - 77 - 170b + 324b. -3b Collect the terms in 37k2 - 1417k + 38k2 + 1 - 76k2 - 2. -k2 - 1417k - 1 Collect the terms in 8m - 11m2 + m2 - 5m*2 + 41m. -15m2 + 49m Collect the terms in -2s2 + 14s*2 - 10s*2 + 606s*3. 606s*3 + 2s*2 Collect the terms in -1267177x*3 - 4 + 1267071x*3 + 4. -106x*3 Collect the terms in -710o + 389o + 0 + 0 + 324o. 3o Collect the terms in -d + 17d - 26d + 7d + 8d. 5d Collect the terms in 2614l - 7814l + 2595l + 2598l. -7l Collect the terms in 43m*3 + 7m*3 - 21m*3 - 4m. 29m3 - 4m Collect the terms in 9j + 5j - 27028043 + 27028043. 14j Collect the terms in 129817v*3 - 64910v*3 - 64909v*3. -2v*3 Collect the terms in 95l*2 + 71l*2 - 239l*2 + 76l*2. 3l*2 Collect the terms in -21 + 91 - 26 - 23 + l - 21. l Collect the terms in -16803t - 16802t + 50410t - 16840t. -35t Collect the terms in 60407p2 - 120811p*2 + 60410p2 - p3. -p*3 + 6p*2 Collect the terms in -789u - 803u + 16u*3 + 1592u. 16u3 Collect the terms in -5s - 62s2 + 118s*2 - 57s*2 + 5s. -s*2 Collect the terms in 44437w*2 - 44437w*2 - 9w*3. -9w*3 Collect the terms in -20w - 29 + 27w + 6. 7w - 23 Collect the terms in -25885f + 25909f - 1 + 0 + 1 + 2. 24f + 2 Collect the terms in 540830q*2 + 540826q*2 - 1081659q*2. -3q*2 Collect the terms in 38d*3 + 43d*3 + 26d*3 - 117d*3. -10d*3 Collect the terms in -687t + 687t - 14t*2. -14t**2 Collect the terms in	{ "pile_set_name": "DM Mathematics" }
in -2, x, s? -2 Let h = 177 - 47. Let q = h + -130.1. Let j(d) = d*3 + 4d*2 - d - 4. Let f be j(-4). Which is the biggest value? (a) -2 (b) q (c) f c Let y = 12 - 4. Let l = 0.083748 + -0.083748. Which is the second smallest value? (a) l (b) -11 (c) y (d) 1 a Let l = -4637 + 4636. What is the biggest value in 0, 1/4, 10.2, l, -0.4? 10.2 Let u be 25(18/(-15) - -4). Suppose 21y = u - 7. Which is the biggest value? (a) y (b) -0.1 (c) 46 (d) -2 c Let c = 6.4 + -9.4. Let d = -3594.1 + 3594. What is the smallest value in d, c, 4, 0? c Let o = 1001.599 - 1002. Which is the fifth smallest value? (a) o (b) 2 (c) 0.5 (d) 0 (e) -0.2 b Suppose 0 = 5a - 212 + 132. Suppose ab + 858 = -23b. What is the biggest value in 2, -0.3, b? 2 Let g(o) = -71 - 71 + o*2 - 4o + 42 - 58 + 19o. Let l be g(-22). Let w = 13 + -9. What is the second biggest value in w, l, 38, -1/2? w Let k = 22214.92 - 22215. What is the smallest value in k, 20/3, 4? k Let d be 17/(-3) - ((-28)/(-70))/(2/(-20)). Which is the smallest value? (a) -824 (b) d (c) -2/9 a Let j = -24 - -15. Let t = 5 + j. Let k be -24 + 36 + -8 - (5 + 0). Which is the biggest value? (a) k (b) -2/11 (c) 0.2 (d) t c Let w be (-6)/21 + 0 + (40 - (-2916)/(-84)). Let h = -1.95 - 0.05. Let f = h - -5. Which is the smallest value? (a) w (b) -3 (c) f b Let n = 2.975 + 0.025. Let t = n - 2.7. Which is the fourth smallest value? (a) 0.2 (b) t (c) 5 (d) 3/7 c Suppose -3g - 2 = 2h, -4h + 15g = 10g - 40. Which is the third smallest value? (a) h (b) 0.09 (c) 33 c Let n = -110 - -106. Let g be -3(n/6 + 2). Which is the second biggest value? (a) g (b) 0.1 (c) 2/11 (d) 0.3 c Let k(b) = -b3 + 8b*2 - 6b - 9. Suppose 13i + 4i = 119. Let m be k(i). What is the fourth smallest value in -1/27, -0.5, -1, m? -1/27 Let o = 20718 + -20720. Which is the third smallest value? (a) 0 (b) o (c) -15.2 (d) 1/6 a Let k be ((-1)/8 - 2) + 1. Let q be 8 + 66/(-9) - 42/9. Which is the third smallest value? (a) 0 (b) k (c) q a Let k be (8/(-1100)-11)/((-58)/(-30) - 2). What is the third smallest value in k, -1/3, -2? -1/3 Let z be (-2 - -1) + 3/9. Let i be 1/(-4) + (-580)/(-16). Let k be (-6 - (-232)/i) + 8/(-18). What is the second smallest value in k, 5, 3, z? k Let l = 5.8 + -14.3. Let g = l + -6.5. Let y = g - -10. Which is the second smallest value? (a) -1 (b) 2/3 (c) 0.2 (d) y a Let h = 2 + -6. Let p = h - -9. Let q = -57247 - -57247.4. Which is the second biggest value? (a) -5 (b) p (c) -3 (d) q d Let s = -0.14 + -35.86. Let m = -4.9 - 40.1. Let n = m - s. Which is the third smallest value? (a) -0.5 (b) n (c) -4 a Let v = -939.02 + 938. What is the second biggest value in -0.5, 1/4, v? -0.5 Let l = -4991.6 + 4992. What is the smallest value in 2/27, 5, 0, l, 2/3? 0 Let p be (-15 - (-963)/63) + 2505/(-77). Let m = p - -350/11. What is the second biggest value in 0, -5, m, -9? m Let m = -2237/7 + 321. Let r = -0.02 + -0.18. Let l(q) = -q3 - 62q*2 - 63q - 120. Let j be l(-61). What is the fourth biggest value in j, r, m, 4? r Suppose 0 = 2h + 35 + 109. Let u be 4/(-5) + h/(-180). What is the third smallest value in u, 1, -24? 1 Let q = 4.4 - 27.4. Let m = 0.196 - -103.804. Let b = -104.3 + m. What is the biggest value in -1, -0.5, q, b? b Suppose 5n + 4x - 8 = x, 3x - 1 = 2n. Let j be (6486/33)/((-4)/(-6)). Let z = j - 295. What is the second biggest value in z, n, -2/9, -1/2? z Let j = -33 + 70. Let q = j - 36.5. Suppose 0 = -5d + 5w - 25, -d + w - 5 = -2w. Which is the second biggest value? (a) -0.4 (b) d (c) q a Let l = 509.7 + -510.12. Let j = 164.42 - 162. Let h = j + l. Which is the biggest value? (a) h (b) 0.1 (c) -0.4 (d) -0.1 a Let o(l) = 2l - 85. Let j be o(-16). Let i be j/270 + (-1)/6. Which is the third smallest value? (a) 3 (b) i (c) 0.3 a Let l = -129 + 134.3. Let z = -4.9 + l. Let c = 27/65 + 5/13. What is the biggest value in c, z, 0.7? c Let g = 9 + -14. Let k = -2.929507 + -0.070493. Which is the second smallest value? (a) k (b) g (c) -17 (d) -2 b Let f = -5561 - -5560. Which is the third smallest value? (a) 0.2 (b) f (c) 372 c Let h be (-92)/44 + 2 - 4/(-22). Let u = 0.14 - 0.13. Let z = u - -0.49. Which is the biggest value? (a) 3 (b) z (c) h a Let r = -8829 + 8819. What is the second biggest value in r, -5, 42? -5 Let t be (((-180)/(-8))/(-5))/3. Let n = -1734 + 1734.5. Which is the third biggest value? (a) t (b) -22 (c) n b Let m be (-2)/840/(-70)-1. What is the third biggest value in 0.11, m, -3/2? -3/2 Let t = 28.18 - -1.82. Let f = t + -29.8. Which is the second smallest value? (a) -5 (b) -0.2 (c) 2 (d) f b Let w = -665 + 469. Let z = 195 + w. Let l be ((-4)/6)/((-10)/6). Which is the fourth biggest value? (a) 0.5 (b) -2 (c) z (d) l b Let p = -635/8 - -79. Let y be 369/(-7) - (2 + 48/(-28)). Let q = y - -50. What is the second biggest value in p, -5, q? q Let x = 3229711/171 - 18887. Let r = 8/19 - x. What is the second biggest value in r, 6, 1, 0.3? 1 Let y = 5255 + -68317/13. Which is the fourth biggest value? (a) 0.3 (b) 0.1 (c) -4 (d) y c Let g = 4 - 0. Let y(v) = v3 + 7v*2 - 20v - 21. Let k be y(-9). Let x = -6.37 - 0.63. What is the fourth biggest value in x, g, 0.1, k? x Let q = 35/218 + 113/654. What is the biggest value in q, 0.5, -41? 0.5 Let t be (29309/(-42))/53 - (-10)/(-12). Which is the third smallest value? (a) -21 (b) 0.4 (c) -3/2 (d) t (e) -1 c Let s = 81.8 + -212.55. Let m = s + 136. Let z = -1.25 + m. Which is the third biggest value? (a) z (b) 0.01 (c) -0.04 c Let b be -1 + 2 - (-3)/(-7). Let z = -1.243 - -1.2. Let v = z - 3.957. What is the second smallest value in v, b, 3/7? 3/7 Let n = -23810.5 - -23811. Let m = -1.4 + 1. What is the third biggest value in -0.05, 3, n, m? -0.05 Let m = 19174/133 + -1458/19. What is the second biggest value in -0.5, 2/7, m, 0? 2/7 Suppose -4v - 84 = -2u, -12u = -4v - 14u - 60. What is the second smallest value in v, 0.2, -5? -5 Let o = -982.8 + 1027.8. What is the second smallest value in o, 1, 11? 11 Let v = -165784.9 - -165785. Let m be ((-10)/(-8))/(6/(-8)). Which is the biggest value? (a) v (b) m (c) 21 c Let w = -5 - -5.02. Let r = -0.06 + w. Let x = -0.368 - -0.868. What is the biggest value in 4, x, r? 4 Let r = -40.89 + 0.89. Let f = 39 - 71. Let g = f - r. What is the second smallest value in 0.2, 0, g? 0.2 Let r = -0.3023 + 0.1023. What is the smallest value in -1/645, r, 1? r Let m = -5831 - -5830. What is the fourth smallest value in 0.29, m, -0.3, 0.14? 0.29 Let x be 52((-1)/25 - 0) + 2. Let g = 58/3 - 19. Let o = -0.204 - 0.096. Which is the third smallest value? (a) 1/4 (b) x (c) o (d) g a Let g be (-49)/(-4) + 3/(-12). Let n = 82 - 136. Let q be 9/(6/(-2)) + n/(-12). What is the second smallest value in -0.5, 3, q, g? q Let k = 0.649 + -0.749. Let j be (-29)/(-5) + (-2)/(-10). Let s = j - 43/7. What is the smallest value in 2/25, k, s? s Let x = 981399.962 + -984404. Let t = x + 2998. Let s = 0.038 + t. Which is the biggest value? (a) 1 (b) s (c) 3/4 a Let j = 323.7 - 333.8. Which is the second smallest value? (a) -4 (b) -1 (c) j a Suppose -3t = f + 17, 0 = -18f + 21f - 3t + 3. Which is the smallest value? (a) 4 (b) f (c) 148 (d) -0.1 (e) -4 b Let q = -0.555 - 15.445. Let n(d) = -5d + 53. Let r be n(10). Which is the second biggest value? (a) r (b) -0.1 (c) q b Let f be 48/60 + ((-474)/105 - (-2)/(-7)). What is the fourth smallest value in f, 4, -2, -2561, -3/4? -3/4 Let h = -20034.7 - -20031. Which is the second biggest value? (a) 0 (b) 110 (c) h a Let z = 13239/105848 + -1/13231. Which is the fourth smallest value? (a) -0.3 (b) 0 (c) 23 (d) z c Let z = 18.6 + -18.29. What is the biggest value in 5, -4, z, -9? 5 Let g = 0.1 - 0.2. Let o = g + 0.2. Suppose 5m + l + 19 = m, 2m + l + 9 = 0. Which is the third smallest value? (a) o (b) 4/7 (c) m b Let o = 12266 - 12266.3. What is the biggest value in o, -12/65, -0.2? -12/65 Suppose 4b - 2x + 350 = 0, -5b - 19 = -3*x + 416. Let y be (25/105)/((-25)/b). What is the second smallest value in -3, 5, 0.3, y? 0.3 Let y = -45 - -44.966. Let u = -0.266 + y. Which is the third smallest value? (a) u (b) 4/3 (c) -3/8 (d)	{ "pile_set_name": "DM Mathematics" }
e of -m*4/4 - 10m. Let i(y) = 7y. Give i(p(j)). -21j*2 Let g(j) = -1106j*2. Let a(w) = -w. Calculate a(g(n)). 1106n2 Let w(g) be the second derivative of g5/40 + g*3/2 + 6g. Let l(s) be the second derivative of w(s). Let d(o) = 2o. Calculate d(l(t)). 6t Let y(m) be the second derivative of -m5/60 - m3/3 - m. Let z(v) be the second derivative of y(v). Let p(u) = 2u2 + 742u - 742u. Give p(z(d)). 8d2 Let x(k) be the third derivative of k5/20 + 2k2. Let v(o) = o - 2o - o. Give x(v(y)). 12y2 Let h(o) be the second derivative of 5o4/24 - o2 - 3o. Let r(p) be the first derivative of h(p). Let l(a) = a. Give r(l(f)). 5f Let u(p) = -9p2 + 5p*2 + 2p*2. Let q(t) = -3t - t - 4t2 + 4t. Give u(q(x)). -32x4 Let o(d) = d2. Let n(t) = 27t. Let j(q) = 7q. Let b(u) = 15j(u) - 4n(u). Determine b(o(w)). -3w*2 Let r(a) = 4a. Let p(i) = i. Let z(t) = 2p(t) - r(t). Let u(d) = -12d + 8. Let x(j) = 8j - 5. Let g(b) = 5u(b) + 8x(b). Determine g(z(l)). -8l Let n(d) = 3d2. Let u(o) = 1300o*2. Determine n(u(f)). 5070000f*4 Let r(p) = -p. Let v(u) = 73u + 66u - 157u. What is r(v(k))? 18k Let a(i) = -i. Let g(c) = -c. Let h(d) = d. Let u(m) = -g(m) - 2h(m). What is u(a(w))? w Let v(w) = -3w2. Let a(n) = -859n. Determine v(a(k)). -2213643k2 Let d(u) = 13u. Let j(n) = -2n. Calculate j(d(v)). -26v Let j(v) = 35v. Let o(t) = 2t. Let z(x) = -x. Let r(l) = -3o(l) - 5z(l). Give j(r(b)). -35b Let g(b) = -2b. Let u(m) = -87m. What is g(u(o))? 174o Let m(v) be the second derivative of v6/120 - v4/6 + v. Let s(a) be the third derivative of m(a). Let g(q) = -q. Give s(g(d)). -6d Let m(n) = n2. Let b(l) be the second derivative of l4/12 + 3l. Let h(d) = -5b(d) + 2m(d). Let k(w) = -2w. Give k(h(f)). 6f*2 Let v(o) = -2 + 2 + 2o*2. Let z(u) = 39u*2 + 33u*2 - 69u*2. Calculate v(z(d)). 18d*4 Let o(c) = c. Let w(z) = -7z*2. Let g(u) = 21u*2. Let l(f) = 2g(f) + 7w(f). What is o(l(x))? -7x*2 Let g(n) = 2n. Let y(w) = -w*2 + w + 1. Let i(o) = -4o*2 + 2o + 2. Let q(z) = i(z) - 2y(z). Calculate q(g(b)). -8b2 Let s(d) = -d2. Let o(b) = 11b2 - 9. Let y(v) = 5v*2 - 4. Let p = -13 + 4. Let c(a) = py(a) + 4o(a). Determine s(c(k)). -k4 Let y(j) = -j. Let f(b) = -b2 + 7. Give y(f(g)). g2 - 7 Let w(r) = -44r*2. Let q(l) = 45l*2 + 35l*2 - 81l*2. What is q(w(o))? -1936o*4 Let c(u) = -u + 3u + 0u. Let g be 1/(1 + 0)1. Let l(h) = h*2 - 3h. Let d(t) = -t. Let q(v) = gl(v) - 3d(v). Give q(c(k)). 4k2 Let o(i) = -88i - 32. Let n(k) = -8k - 3. Let a(z) = -32n(z) + 3o(z). Let q(m) = 3m*2. Give q(a(d)). 192d*2 Let a(b) = -2b. Suppose 3t + 15 = 0, 0t - 2t = -5y. Let j(f) = -2f. Let u(v) = -v2 - 11v. Let z(s) = yu(s) + 11j(s). What is a(z(q))? -4q2 Let d(m) be the second derivative of -m5/6 - m2/2 + 6m. Let h(z) be the first derivative of d(z). Let c(r) = -2r2. Determine c(h(v)). -200v*4 Let i(t) = 2t. Let h(s) = -457s2. Determine h(i(w)). -1828w2 Let p(v) be the second derivative of v4/12 + 2v. Let t(w) be the first derivative of 1/3w*3 + 0w - 4 + 0w2. Give p(t(o)). o4 Let t(w) = -241w + 5. Let p(u) = -u. Calculate t(p(o)). 241o + 5 Let q(j) be the first derivative of -j2/2 + 10. Let g(h) = h. Let y(o) = -2o. Let c(m) = 4g(m) + y(m). Give c(q(p)). -2p Let o(a) be the first derivative of 20a3/3 + 4. Let q(n) = -2n. Determine o(q(g)). 80g2 Let t(u) be the second derivative of -u4/24 + u2 + u. Let g(h) be the first derivative of t(h). Let y(z) = 0z + 0z - z2. Determine g(y(j)). j2 Let b(t) = 3t. Let g(x) = 6x2. What is b(g(l))? 18l*2 Let n(w) be the first derivative of 4w*3 + 27. Let x(h) = -2h. What is x(n(d))? -24d2 Let f(b) = 2b*2. Let i(n) = -6n - 1300. Calculate f(i(d)). 72d2 + 31200d + 3380000 Let m(n) = 96n2 + 2n. Let a(x) = 3x - 5. Determine m(a(u)). 864u*2 - 2874u + 2390 Let w(c) = -4c - 6. Let j(l) = -3l - 5. Let y(d) = -6j(d) + 5w(d). Let s(q) be the first derivative of 2 + 0q + 0q*2 + 1/3q*3. Calculate y(s(z)). -2z*2 Let f(g) = 1 - 4g - 1. Let a be (4 + (-4)/2)1. Let w(t) = 2t*2 - 2ta - t2. What is f(w(o))? 4o2 Let y(o) = o. Let r be (-3 + 6)1 + 0. Let h(g) = -rg + 5g + 3g - g. Give y(h(n)). 4n Let b(p) = -2p. Let u(g) = -17g. Calculate b(u(o)). 34o Let l(y) = -y + 9y - 8y + 2y*2. Let v(f) = f. Calculate v(l(o)). 2o*2 Let n(s) = -2s. Let c be (-1)/2 - (-8)/16. Let q(m) = 2m + 2m - m + cm. Calculate n(q(u)). -6u Let b(g) = -3 - 35g2 + 29g*2 + 16g*2. Let j(i) = -i. Give j(b(t)). -10t2 + 3 Let k(v) = v2. Let y(m) be the second derivative of -m*3/2 + m. What is y(k(o))? -3o*2 Suppose -2z + 5z - 3c = 24, 2c = 3z - 20. Let p(u) = -u - 5u + zu. Let l(q) be the first derivative of 5q2/2 + 5. Determine l(p(x)). -10x Let l(x) = -8x2 + 6x*2 - 2x*2 + 5x2. Let c(p) be the second derivative of -p4/6 - p. Calculate c(l(w)). -2w4 Let f(b) = 2b. Let w(i) = -9192i. What is w(f(q))? -18384q Let k(a) = a*2. Suppose 0 = q - 18 + 16. Let d(b) be the second derivative of 0b*q + 0b*3 + 0 + b - 1/6b*4. What is k(d(w))? 4w*4 Let m(y) be the third derivative of -3y*5/20 + 2y2. Let i(p) be the third derivative of p4/12 + 3p2. Calculate m(i(f)). -36f*2 Suppose 1 = -b + 3. Let j(r) = 4 + 3 - 7 + 4r*b. Let a(f) = f. Calculate a(j(l)). 4l*2 Let l(h) = -h. Let m(p) be the third derivative of 13p*5/20 - 7p*2. Calculate m(l(k)). 39k*2 Suppose 0 = -4w - 20, -4s + 2w + 25 = s. Let o(u) = -2u2 + 3u*2 - su*2. Let j(q) = q. Calculate j(o(i)). -2i*2 Let w(t) = -4t3 - t2 - t. Let p be w(-1). Suppose 0r - pr = -8. Let q(x) = -x*r + 1 - 1. Let c(l) = 3l. Calculate c(q(i)). -3i2 Let r(y) = -4y - 3. Let o(a) = 5a + 4. Let p(f) = 3o(f) + 4r(f). Let n(i) = -4i*2. What is n(p(u))? -4u*2 Let h(o) = -26o*2 + 5o*2 + 14o*2 + 5o*2. Let x(r) = 4r + 3. Let u(v) = 2 - 3 + v + 2. Let n(q) = 6u(q) - 2x(q). What is n(h(w))? 4w2 Let k(s) = -6s. Let y(r) = 498r2. Give y(k(u)). 17928u*2 Let d(v) = 13v + 5. Let j(i) = -i. What is d(j(n))? -13n + 5 Let z(l) = -2l*2. Let y(r) = 4r*2 - 10r. Let q(d) = d*2 - 3d. Let b(w) = 10q(w) - 3y(w). Determine z(b(s)). -8s4 Let o(d) = -3d. Let f(j) be the first derivative of -8j3/3 + 18. What is f(o(l))? -72l2 Let p(u) = u2. Let k(o) be the second derivative of 0 + 0o3 - o2 + 0o*4 - 1/20o*5 - 3o. Let i(a) be the first derivative of k(a). What is p(i(v))? 9v4 Let l(i) = i. Let o(k) = k2 - 3k + 3. Let j be o(2). Let n be 6/8 - (-4)/16. Let r(q) = -q - n + j. What is r(l(x))? -x Let m(p) = p. Suppose 5s = -25, 0 = -3q + 5s - 2s + 45. Let j(v) = 3v + q - 10. Calculate m(j(l)). 3l Let u(d) be the first derivative of d*2/2 + 4. Let s(x) = 20x. What is u(s(p))? 20p Let g(u) = -u. Let c(s) be the second derivative of s4/4 + 6s. What is c(g(z))? 3z2 Let u(z) = 41z. Let v(f) = 3f2 - 4. Determine u(v(a)). 123a2 - 164 Let b(v) be the second derivative of -v3/3 - v. Let i(x) be the first derivative of -6x + 3x - 4 + x*2 + 3x. Give b(i(h)). -4h Let a(c) = -116c*2. Let u(k) = -2k. Calculate a(u(f)). -464f2 Let j(b) = -11b. Let r(l) = -15l2 + 20. Determine j(r(c)). 165c*2 - 220 Let a(f) = -2f2 - 151. Let t(n) = n2. Determine a(t(y)). -2y4 - 151 Let p(x) = -3x. Let f(j) = 27 - 27 + 13j - 5j. Let m(o) = 1. Let c(q) = -15q - 2. Let b(k) = c(k) + 2m(k). Let s(t) = -6b(t) - 11f(t). Calculate s(p(a)). -6a Let a(w) = 4w - 4w + 3w*2. Let d(g) be the first derivative of 1/2g*2 + 2 + 0g. What is d(a(q))? 3q2 Let o(q) = 52q. Let v(x) = -47x2. What is v(o(u))? -127088u2 Let m(j) be the third derivative of j4/12 - 4j2. Let o(a) = 17a*2. Determine o(m(x)). 68x*2 Let m(j) = -2j + 3. Let a = 1 - -3. Let c(q) = -3q + 4. Let g(b) = am(b) - 3c(b). Let u(s) be the second derivative of -s4/6 - s. Calculate u(g(l)). -2l*2 Let c(a) = a. Let f(h) = 12h*2 - 5h. Let i(r) = 133r2 - 56r. Let g(x) = 56f(x) - 5i(x). Give c(g(k)). 7k2 Let z(g) = -17g*2. Let y = 20 + -22. Let j(r) = -8r**2 - 9.	{ "pile_set_name": "DM Mathematics" }
1 - -2bd08d? 2bd08c In base 10, what is 18 + 1086535? 1086553 In base 10, what is 22 + 25681418? 25681440 In base 9, what is -12508 - 304378? -316887 In base 4, what is 1012232 + 12220323? 13233221 In base 5, what is -4 - 140210142? -140210201 In base 12, what is -12b3 + -39b? -1692 In base 5, what is -3 + -10202430100? -10202430103 In base 8, what is 24273 - -232? 24525 In base 7, what is -5543264 - -32? -5543232 In base 2, what is -1011101010001100001110 - 11? -1011101010001100010001 In base 5, what is 102142 + -221112? -113420 In base 3, what is -212210200211022 + 202? -212210200210120 In base 5, what is 234441000 + 1200? 234442200 In base 14, what is 70a + 11c3? 18cd In base 10, what is 1 - 64110781? -64110780 In base 2, what is -111111111001111010100 + -11100? -111111111001111110000 In base 15, what is 880a + -979? 7d81 In base 6, what is 3012432 + -255? 3012133 In base 4, what is 3121021 - -2101030? 11222111 In base 9, what is -228656 - -114? -228542 In base 5, what is 22112 + 32412? 110024 In base 11, what is a898968 - 1? a898967 In base 10, what is -8419 - 17839? -26258 In base 15, what is 4 - -2a203a? 2a203e In base 9, what is -284 - 54665? -55060 In base 14, what is -6d - -acb17? aca88 In base 9, what is -4 - -154031024? 154031020 In base 12, what is 324871b + -b? 3248710 In base 8, what is 1205376 - 45? 1205331 In base 12, what is 9925 + 422? a147 In base 16, what is -13dc053 - -49? -13dc00a In base 12, what is -117415a + 3? -1174157 In base 12, what is -405aba + 5? -405ab5 In base 9, what is 16802138 + 4? 16802143 In base 4, what is 23311003212 - 33? 23311003113 In base 9, what is 248816 - -16? 248833 In base 12, what is -65 - -24b4a? 24aa5 In base 16, what is ee56 + 16e? efc4 In base 2, what is -1 + -10011011110000010110011? -10011011110000010110100 In base 14, what is -3 + -800dc8? -800dcb In base 15, what is 16 - -cc8c4? cc8da In base 2, what is -111111 + -10011101000010100110101? -10011101000010101110100 In base 2, what is -1001 + -1100000001001110111000? -1100000001001111000001 In base 3, what is 1222020 - -101220212? 110220002 In base 14, what is bc32791 + 0? bc32791 In base 5, what is 331040 + 102202? 433242 In base 15, what is 27ee + -1c95? a59 In base 9, what is -4 - -160052356? 160052352 In base 2, what is -100011110 + -11010111110000001? -11011000010011111 In base 12, what is -86a - -7831? 6b83 In base 9, what is -2 - -411675175? 411675173 In base 3, what is 21200102 - 120212? 21002120 In base 13, what is 1a3b053 - 31? 1a3b022 In base 13, what is -16cc6 + -13a? -17133 In base 5, what is 4102 + 240424? 300031 In base 4, what is 301 + -101302133? -101301232 In base 12, what is a610 + 4a9? aab9 In base 7, what is 12 - -20462631? 20462643 In base 12, what is -3586b + 664? -35207 In base 15, what is -a + 216ac3? 216ab8 In base 15, what is -5 - 45c4384? -45c4389 In base 4, what is -312121321003 - 102? -312121321111 In base 14, what is 9a99bc - 6? 9a99b6 In base 6, what is -102435400313 - -2? -102435400311 In base 4, what is -1001 - 122022120? -122023121 In base 8, what is 2 - -12045701? 12045703 In base 11, what is 18 - -5816430? 5816448 In base 3, what is -10012021200001 + -121200? -10012022021201 In base 7, what is 25545015422 - 5? 25545015414 In base 16, what is -3 + 261065? 261062 In base 14, what is 1b - 6351a8? -63518b In base 9, what is -188 + -5162355? -5162554 In base 6, what is 1335012 + -3441? 1331131 In base 5, what is 3 + -240312443? -240312440 In base 11, what is -894 + 2076? 1292 In base 5, what is 130430 + 14040? 200020 In base 3, what is -2 + 20010020121220? 20010020121211 In base 2, what is -11110 + 1100111010000010101? 1100111001111110111 In base 10, what is -73005291 - -7? -73005284 In base 9, what is -465582828 + 1? -465582827 In base 4, what is 20123 + 1023023030? 1023103213 In base 4, what is -321 + 3032200313? 3032133332 In base 7, what is 14 + 54354? 54401 In base 10, what is -1946017 - 13? -1946030 In base 9, what is -273654 - -108? -273545 In base 14, what is -198 - 472ad4? -472c8c In base 8, what is -45 - -37727753? 37727706 In base 8, what is -14226445 - -11? -14226434 In base 15, what is 5 - 106459? -106454 In base 15, what is -2427722 + -1? -2427723 In base 11, what is 6 - 1166781? -1166776 In base 14, what is -5ac - 1274? -1842 In base 16, what is 283 - -9fc6? a249 In base 10, what is -27537636 - 11? -27537647 In base 15, what is 28820b - c1? 28813a In base 5, what is -420223 + 401211? -14012 In base 16, what is -219 + 617d3? 615ba In base 3, what is 10102220110110 + 112111? 10102220222221 In base 3, what is 220020200222202 - 11? 220020200222121 In base 9, what is 3 - -31653561? 31653564 In base 6, what is -334 - 2213154? -2213532 In base 2, what is 111 + -1010010110011010111010011? -1010010110011010111001100 In base 14, what is 5 + -2b5296? -2b5291 In base 11, what is 2 + 27635655? 27635657 In base 10, what is -93 - -11376? 11283 In base 4, what is -2323033302100 + 10? -2323033302030 In base 14, what is 1c5 - -3d63? 4148 In base 9, what is 15806 + -11284? 4512 In base 14, what is -2 + 322085? 322083 In base 6, what is 5 - -1050244412? 1050244421 In base 10, what is 15334 - -1497? 16831 In base 3, what is -101122101 + -220111021? -1022010122 In base 6, what is 3103 - -33021524? 33025031 In base 14, what is 2 + 76c7097? 76c7099 In base 12, what is -86 - -4b935? 4b86b In base 13, what is 1a95347 - 2? 1a95345 In base 2, what is -101110011 - 11010110111001? -11011100101100 In base 14, what is 1516 - -11b? 1633 In base 16, what is -29954 - b? -2995f In base 2, what is 1001110000100011010 + -101001? 1001110000011110001 In base 2, what is 101100101010001 - 1100010010100? 100000010111101 In base 12, what is 9 - 7320ab? -7320a2 In base 16, what is 65a5 - c58? 594d In base 16, what is c620 - ac? c574 In base 11, what is -313401 - -45a? -312a52 In base 3, what is -112111 - -102210000210? 102202111022 In base 7, what is 2 + 36351166? 36351201 In base 13, what is -4 - -b3cc80? b3cc79 In base 10, what is 209491 - -130? 209621 In base 9, what is -130747 + -373? -131231 In base 2, what is 100000111000011 + 100111100101000? 1001000011101011 In base 10, what is 30420 - 14735? 15685 In base 11, what is 3a41a99 - -1? 3a41a9a In base 4, what is 1312 - -20233010? 20300322 In base 5, what is -3 + -140331122? -140331130 In base 5, what is -2034440 - -310303? -1224132 In base 10, what is 100037 + 100? 100137 In base 14, what is 402dd - -5d? 4035c In base 3, what is 21020120 + -121020? 20122100 In base 11, what is 3810033 + 4? 3810037 In base 10, what is 778076 + 13? 778089 In base 11, what is -804021a + -6? -8040225 In base 7, what is -25324 - 6315? -34642 In base 3, what is 1 + 2001000200112? 2001000200120 In base 8, what is 5 + 260041471? 260041476 In base 15, what is -c8 - -8843? 876a In base 2, what is -1101111000000 - 1100010? -1110000100010 In base 16, what is -390caef + 3? -390caec In base 14, what is -60 + -51800? -51860 In base 4, what is -12011233 - 100221? -12112120 In base 9, what is 57 + -626851? -626783 In base 8, what is -46 - -2627762? 2627714 In base 10, what is 8 + 25988265? 25988273 In base 14, what is -b763a - -52? -b75c8 In base 4, what is 122000123102 + -211? 122000122231 In base 7, what is 11 + -4134256? -4134245 In base 11, what is -302 + 54a5? 51a3 In base 5, what is 133434341 + -12022? 133422314 In base 12, what is -5aa - -10453? ba65 In base 9, what is -3 + -43725? -43728 In base 11, what is -1 - 46775731? -46775732 In base 12, what is 35ab363 - 21? 35ab342 In base 10, what is 4 - 3169730? -3169726 In base 4, what is -1323010 + 32132? -1230212 In base 12, what is -3b844 + 92? -3b772 In base 14, what is 266774 - 4d? 266725 In base 12, what is 0 - -8672a88? 8672a88 In base 7, what is -53650 + 3645? -50002 In base 4, what is 1103 + 13030112? 13031221 In base 10, what is -4376 + -11604? -15980 In base 6, what is 512045025 + -5? 512045020 In base 3, what is -22202 - 1102002011012? -1102002110221 In base 7, what is -20 - -1432516? 1432466 In base 8, what is -1102527 - 46? -1102575 In base 3, what is 100011 + -1112120022112? -1112112222101 In base 4, what is -10 + -120321221333? -120321222003 In base 15, what is -5 + -16d517c6? -16d517cb In base 12, what is 3865 - 2527? 133a In base 7, what is -	{ "pile_set_name": "DM Mathematics" }
(-2)/28)? -3/40 What is 5/(-1)(3738/(-4450))/((-6)/40)? -28 (189/(-9))/(60/8)(-630)/42 42 Evaluate (837/(-21762))/(((100/(-40))/(2/12))/(-3)). -1/130 What is ((-18)/300)/(-2560/(-400))? -2/125 What is the value of (394/18)/(256/441692)? 13/8 Evaluate ((-43)/38712)/(9/(54/4)). -2 What is the value of 315/(-30)3260/489? -70 What is the value of (((1/(-5))/(13/(-325)))/2)/(110/8)? 2/11 What is ((14/154)/(11/(-66)))/(1065/71)? -2/55 Calculate 2/((8/1932)/((552/276)/(14/1))). 69 What is the value of 309((-220)/(-84))/11-19(-245)/3325? 103 What is 93/(-744)-2(-64)/(-9)? 16/9 ((-5)/(-62))/((-196)/1097635) -4/31 What is the value of (8/10)/((-4)/(-32)108/270)? 16 Evaluate 419(-279)/94248/474. -3/79 What is 119/(-17)(-7)/343377? 37 Evaluate (1-61)/(2742/(-9597))11/3. 77 Evaluate (-66)/(-99)-47/(11256/18). -2/67 Evaluate (-3577)/(-511)(-9)/42. -3/2 Calculate (-3)/2(96/21912-22)/(-3). -4/83 Evaluate (((-9)/(-2))/3)/((-100)/480(-162)/1845). 82 Calculate (-12)/146(49445/(-870))/(-341). -1/73 Evaluate 2/(-18)(-7)/((-133)/(-3)). 1/57 What is the value of (-14)/(-4)1728/43344(42/18)/7? 2/43 (-47)/(1714/(-2571)6/8) 94 (1313/3939)/(4/528) 44 ((-4)/6)/((-5364)/378162) 47 What is (-1)/23/((702/(-2418))/(2-3))? -31 What is the value of (-252)/664180/(-285)? 56 Evaluate 2/123/460-1010. -10 ((-39)/130(-310)/(-8))/(7(-36)/112) 31/6 Evaluate (-504)/266(-38095)/802. 90 What is the value of 5/(-34)1039/10390? -1/68 Evaluate 20/(-26)(-118911)/15245. 6 Calculate (-9(-2)/9)/(248/(-7316)). -59 What is (24/56-1)/(2(-162)/24)? 2/63 (19/(-3857)29)/((-1)/301) 43 ((-102)/(-36))/((-554)/831) -17/4 Evaluate (99/44)/(2/(-3)36/(-96)). 9 Evaluate (18/(-10))/(2016/840(-388)/16). 3/97 (-36)/113/72-6 9/11 Calculate (252/(-19488))/((-3)/(-32)). -4/29 Evaluate ((-49)/4)/(((-10)/((-600)/(-6)))/(6/15)). 49 What is the value of 52605/(-5010)(-2)/(-1)? -21 Calculate ((-5)/2(-2532)/(-2110))/((-15)/(-4))-5. 4 Evaluate ((-18)/15)/(-2)-14600/(-336). 15 What is (14/164)/((31941/54)/169)? 1/41 (12/(-255))/(998/8483) -2/5 Evaluate (-96)/(-6)(54/(-10))/(-3)3400/1360. 72 10/3-216(-60)/532800 3/37 Evaluate (28/(-140))/(1(-4)/620). 31 Evaluate 147/(-81634)-17-7. -3/14 Calculate (128/108(-51)/(-272))/(-394/(-72)). 4/39 What is the value of (-116640)/(-6075)3/4-5? -72 Calculate ((-2412)/(-67))/(1364/1023). 27 Evaluate (-2)/((884/(-1027208))/(1/(-28))). -83 50/(-6)(-532)/(-228)99/77 -25 Calculate (8/(-238))/(95/(1995/2)). -6/17 Evaluate 6816/(-336)406/116. -71 (9/(135/(-24)))/(696/(-2465)) 17/3 What is 451/((-666127)/(-50640))7/(-3)? -80 Calculate ((-207)/(-9))/((763/218)/(((-105)/(-3))/(-5))). -46 ((-756)/486)/(((-16)/15)/8320/48) 7/4 (630/150)/(6972/3735) 9/4 1533/17522/(56/5)18/15 3/16 (((-630)/(-75))/(-42))/((27/306)/3) -34/5 Calculate (-567)/2728/(-12054)-1. -2/41 What is -3(-30)/(-24)(-83)/(-1660)? -3/16 What is the value of (4-119/(-76))/(1(-7)/(-98))? 14 What is the value of -15(-360)/1380023? 9 (-41)/((-6724)/4510)6/(-3)1 -55 What is the value of ((-32)/72)/(73/(4161/38))18/10? -6/5 What is the value of ((-25668)/93)/(1-6)? 46 Evaluate (-2)/((-12)/(-63))(-5825)/489300. 1/8 Calculate (19/((-228)/(-936)))/(710/(-35)). -39 What is the value of 14/(-3)5/(-30)3(-343)/(-1029)? 7/9 (-375)/(-105)(-3213)/459 -25 What is the value of 13615/(-778)(-85)/238? 25/4 What is the value of (17513/30378)/(-211)24? -4/61 What is the value of ((16/72-30)/((-588)/(-4851)))/((-10)/4)? 22 Evaluate ((-104)/52)/(336/19833/57). -19/3 Calculate (636/(-67628))/(2/4180/(-165)). 1/58 Evaluate 2772/1302(-9300)/(-450). 44 What is ((-2)/6-2)/(15270/(-3990))? -1/4 What is 1(-31672)/(-214)2/(32/(-4))? -37 What is the value of ((-125)/(-150))/(520/(-52))? -1/12 What is the value of ((-89001)/310)/99(-60)/3? 58 ((-12)/10)/((-18343)/(-5395)) -6/17 What is the value of ((-1624)/343)/4(-504)/72? 58/7 What is the value of -5368(-20)/880(-1)/42? -61 Calculate (-18(-28)/420)/((-33)/(-110)). 4 (2/(-43))/(((-4)/(-3))/(184/138)) -2/43 -20(-21)/(-1512)16/(-12)3 10/9 What is the value of -8(-12)/321650/(-75)? -66 What is the value of ((-345)/(-92)(-4)/9)/(2/(-36)5)? 6 Evaluate ((-32)/15)/(57638/61755). -16/7 Calculate (16555/120615)/(14/8). 4/51 Evaluate ((-204)/30)/((-15)/((-750)/(-100))). 17/5 What is the value of ((-2)/(-3))/(111330/(-3711))? -1/45 Evaluate (-42)/1029(520/(-16))/(-13)42/(-5). 6/7 What is 1126/39414473/(-18)? -71 Calculate ((-30)/(-1350))/((1248/(-648))/(-13)). 3/20 Evaluate ((-39)/(-20)(-15)/(-12))/((-30258)/(-26896)). 13/6 (((-7)/(-19))/(902/(-451)))/(21/(-36)) 6/19 Evaluate 28/(-420)(8/(-40))/((-3)/175). -7/9 52(-8)/(-24)-3-9(-3)/(-54) 26 Evaluate (-2296)/(-738)(-36)/(-210). 8/15 Evaluate ((-343)/(-98))/(((-84)/(-40))/((-810)/(-75))). 18 Calculate (((-16)/(-14))/(((-810)/105)/(-3)))/((-10)/(-65)). 26/9 Calculate (155/((-27280)/2904))/((54/56)/9). -154 Evaluate (1/(136/(-20)))/(3440/2752). -2/17 Calculate ((-10836)/126)/(-86)5/(-11). -5/11 Calculate ((-3)/(-8))/(279/(-2046)). -11/4 Calculate 38/(-1)(128/208)/((-48)/104). 32 What is -3351/(140/84)(-1)/3? 67 Calculate ((-65)/(2730/(-56)))/((-8)/(-564)). 94 What is (11/8)/(82/(-58384)-89)? 11 What is ((-55)/375(-12948)/11869)/((-146)/5)? -2/365 (8/126)/(5806/26127) 2/7 What is the value of (2142/13923)/((-4)/(-156))? 6 What is 12/24/(144/(-4))(-2418)/(-62)? -26 Evaluate ((-516)/(-1806))/((-54)/(-14))412. 32/9 What is (92/(-32))/((-792)/2112)(-4)/58? -3/29 What is the value of (-58)/(-29)1/(3/(9/1))? 6 Evaluate (((-2436)/140)/(-29))/(4/(-32)4). -6/5 (-6)/(-63)3/(-168)(-39)/(-104)-28 1/56 Calculate ((-11)/((-44)/(-8)))/(((-70)/5)/(-7))-85. 85 Evaluate (-8)/(60/(60/10))11/((-5874)/(-15)). -2/89 What is (154/(-231))/((-110)/2420)? 40/7 Calculate (-1(-2)/2)/((-83)/(435418/43)). -122 Calculate ((-999)/(-6))/((15/2)/(3635/2181)). 37 ((-32)/80)/((-23)/(8280/(-468))) -4/13 171/(-114)(-450)/27 25 Evaluate 271760/2833098(-6)/40. -2/139 Evaluate (-6)/21((-20482)/22)/(-133). -21 What is the value of (-918/(-567))/(24/3864)? 46 What is (1/31510)/(-10(-18)/(-540))? -2/21 What is the value of 107226/(-5957)(2/(-3))/(2/1)? 6 What is ((-66)/(-5))/((-7881)/(-26270))? 44 What is ((-2)/5646/748-11)/(2/(-10))? -19 Calculate ((-180)/8)/3(-2296)/615. 28 Evaluate (-3936/243)/((297/27)/99). -52 Calculate ((-232)/(-696))/(1/24). 8 Evaluate (938/(-335)(-10)/21)/(-1920/30). -2/19 What is the value of (((-35)/15)/((-49)/281))/4? 1/3 Calculate (18/60)/(16/32)310/(-6). -31 Calculate ((-2240)/2100-5)/(2/24-2). -32 What is (208/(-56))/(46/627913)? -39 Calculate ((1/(-2))/(8/(-80)))/((-11255)/(-184582)). 82 Evaluate ((-3192)/(-285))/(84/1201). 16 What is the value of ((192/(-3456))/(2/(-12)))/((-54)/(-4))? 2/81 (220/20)/(3531/25359) 79 What is 28/(((-1)/(119/(-51)))/((-75)/(-700)))? 7 What is (-46(-760)/12236)/(10/28)? 8 What is 28/(-4046)172/(-8)(-6)/1? -3/17 Calculate 729/(-105948)-9818/(-66). -9/11 What is the value of ((-55)/20)/(244/976)? -11 Calculate (6002/153051)/(1/((-12)/4)). -2/17 7/((-63)/(-2))((-7854)/48620)/(14/(-10)) 1/39 Evaluate (-9)/6(-20804)/(-6163185). -2/395 Evaluate ((-126)/(-105))/((924/1330)/(-22)). -38 (83/432)/((3/(-576))/(26/(-78))) 32/9 What is the value of 22/(286/(-299))(-12)/2438? 6/53 What is 200/752/43/(-36)-1? 1/9 (-2)/98406/589 -9/7 What is 69/23(-361)/(-57)? 19 What is the value of ((7200/(-24084))/(-50))/((8/6)/2)? 2/223 What is 73150/(-3325)70/(-22)? 70 (1216/57)/8(-1)/8-174 58 What is ((-240)/400)/((-12)/30)136/(-6)? -34 What is the value of 2491/(-265)(-22)/(374/(-85))? -47 What is the value of (-45)/35(-2128)/5928? 6/13 Evaluate 6(8/6)/(-4)(1008/(-36))/(-2). -28 Evaluate (-34)/(-544)-280(-20)/(-275). -14/11 What is the value of 18(4788/56)/(-57)? -27 ((-18)/(-378))/(53/27825) 25 Calculate (-146)/343111139/(-948). 1/2 ((-32)/14)/(11656/285572) -56 ((-218)/((-37496)/1290))/((230/(-8))/(-5)) 30/23 Evaluate 16390/37251360/88. 68 Evaluate (-218678)/111402-271. 53 What is the value of ((-282)/1833)/(96/23088)? -37 What is the value of ((-4)/(-24)(-84)/(-14))/(((-112)/16)/315)? -45 Evaluate 1076/(-1883)(-742)/(-8). -53 Calculate (-4)/101440/2496. -3/13 Evaluate -14*(-97)/	{ "pile_set_name": "DM Mathematics" }
n5 - n2 + 0n. Factor v(c). (c + 1)*2/3 Suppose 4r = -2k + 16, 0 = 4k + 5r - 6 - 26. Suppose 2o - k = -2o. Factor 7l - l2 + lo - 5l - 2l*3. -2l(l - 1)(l + 1) Factor 0p2 + 0 - 2/5p*3 + 0p. -2p3/5 Let v(k) = 2k*4 + 6k*3 + 3k2 - k + 5. Let q(f) = f4 + 3f3 + 2f*2 + 3. Let y(x) = -5q(x) + 3v(x). Factor y(t). t(t - 1)(t + 1)(t + 3) Let q(k) be the second derivative of 5/33k3 + 1/110k*5 + 2/33k*4 + 2/11k*2 + 0 + 2k. Factor q(a). 2(a + 1)2(a + 2)/11 Let w(s) be the first derivative of 4/9s3 + 4/15s*5 - 1/2s*4 + 8 + 0s - 1/18s6 - 1/6s2. Suppose w(a) = 0. Calculate a. 0, 1 Let s(l) be the second derivative of l6/6 - 3l5/4 - 25l*4/12 + 5l*3/2 + 10l*2 - 23l. Suppose s(n) = 0. What is n? -1, 1, 4 Let f(t) be the second derivative of 1/120t5 + 0 + 0t*2 - 2t - 1/72t4 + 0t3. Factor f(u). u2(u - 1)/6 Find m, given that m2 - 9m*3 + 13m*3 - 5m*3 = 0. 0, 1 Let d be ((-8)/(-3) - 2) + 356/267. Let y be (2/(-5))/(7/(-5)). Factor 0 + 0m*d + ym*3 - 2/7m. 2m(m - 1)(m + 1)/7 Let r(l) be the first derivative of -l4/16 - l3/4 - 3l2/8 - l/4 - 8. Factor r(m). -(m + 1)3/4 Suppose x = -0x - 4u - 8, 0 = -u - 2. Suppose -5b + 3b = x. Let bl4 - 1/4l + 0 + 0l2 - 1/4l*5 + 1/2l*3 = 0. What is l? -1, 0, 1 Suppose -4 = 2p - 0. Let x be 6/4 + (-1)/p. Suppose -2/5bx + 8/5b - 8/5 = 0. Calculate b. 2 Let d = 5 - 1. Let g(x) be the third derivative of 0x - 3/10x*5 + 0x*3 - 1/6x*d - 1/15x*6 + 0 - 2x*2. What is i in g(i) = 0? -2, -1/4, 0 Let l = -32/3 + 227/21. Factor 1/7j*2 + 2/7j*3 - 2/7j - lj4 + 0. -j(j - 2)(j - 1)(j + 1)/7 Let p be -2(-20)/(-8) - -5. Let r be (((-1)/2)/1)/(-1). Factor -rg*5 + 1/2g*3 + 0g + pg2 + 0 + 0g4. -g3(g - 1)(g + 1)/2 Let o = -15/266 - 17925/532. Let m = o + 34. Solve 0 - mq2 + 0q = 0 for q. 0 Suppose 3 = 5s - 12. Factor -1 - n - n - ns + 0n - 3n2 - n. -(n + 1)3 Let k(f) be the second derivative of 9f*5/110 + 7f4/33 + f3/33 - 4f2/11 + 6f + 1. Let k(m) = 0. Calculate m. -1, 4/9 Let b(v) be the third derivative of -v9/9072 + v7/2520 + 7v3/6 - 5v2. Let a(r) be the first derivative of b(r). Suppose a(w) = 0. What is w? -1, 0, 1 Let k(x) be the second derivative of -x4/12 + x*3/2 + 3x. Factor k(l). -l(l - 3) Let g(r) be the third derivative of r8/84 - r7/105 - 7r*6/60 + 7r5/30 + r4/12 - 2r3/3 - 22r2. Suppose g(s) = 0. Calculate s. -2, -1/2, 1 Let i(p) be the second derivative of p5/20 - p*4/4 - 2p*3/3 + 3p. Solve i(m) = 0 for m. -1, 0, 4 Suppose g - 75 = -5f + 4g, -3f = 2g - 45. Suppose 3v - f = -n, 4 = n + v - 1. Solve -2h + 2h2 + n + 1/2h*5 - 2h*4 + 3/2h*3 = 0. -1, 0, 1, 2 Let t = 2/131 - -252/655. Let 0j + 0 + 2/5j2 - tj*5 + 2/5j*3 - 2/5j*4 = 0. What is j? -1, 0, 1 Let v be 6/(-4)4/(-6). Let n(u) = u*2 - 1. Let y be n(v). Factor -8/7m*2 + y - 4/7m*4 + 10/7m*3 + 2/7m. -2m(m - 1)*2(2m - 1)/7 Let b = 6 - 4. Factor -3n + 5n + bn*2 + 4 - 4n*2 + 0n*2. -2(n - 2)(n + 1) Factor 2/3o*2 - 8/3o - 10/3. 2(o - 5)(o + 1)/3 What is y in -3/2y3 - 1/2y*2 + 0y + 0 = 0? -1/3, 0 Let f = -5/11 - -31/44. Let m(k) = k + 9. Let p be m(-9). Solve 1/4o + p + fo*2 = 0 for o. -1, 0 Let r be 42/(-33)-1 + (-2 - -2). What is q in rq4 + 46/11q*3 + 8/11q + 40/11q2 + 0 = 0? -2, -1, -2/7, 0 Suppose -3829u = -3822u - 14. Factor 14/11b - 10/11bu - 4/11. -2(b - 1)(5b - 2)/11 Let s(k) be the second derivative of 7/6k3 + 4k + 1/30k6 + k2 + 0 + 3/4k*4 + 1/4k5. Factor s(w). (w + 1)3(w + 2) Let b = 125 - 119. Let k(g) be the third derivative of 0g + 0g4 + 0g3 - g2 + 1/60gb + 1/30g*5 + 0. Factor k(a). 2a*2(a + 1) Let z = 308/745 + -2/149. Let r(x) be the first derivative of 0x + 0x*2 + zx5 - x4 + 3 + 2/3x3. Factor r(p). 2p*2(p - 1)*2 Let t(z) = 2z*2 - 106z + 676. Let k(l) = l*2 + l. Let j(s) = 2k(s) + t(s). Factor j(p). 4(p - 13)2 Let w be (-8)/(-10)(-690)/(-184). What is h in -2/7hw - 6/7h*2 - 2/7 - 6/7h = 0? -1 Let l = -1016/65 + 744/13. Let p = 42 - l. Find x such that 0x - 1/5x*4 + px*2 + 0x*3 - 1/5 = 0. -1, 1 Let x(u) be the second derivative of -1/96u*4 - 1/12u*3 - 1/4u*2 + 4u + 0. Solve x(j) = 0 for j. -2 Suppose -5l + o + 60 = 0, 39 - 3 = 3l + 5o. Let f be 1/(-2) - (-22)/l. Factor f + 14/3k + 10/3k2. 2(k + 1)(5k + 2)/3 Let z(x) be the second derivative of -x5/180 + x4/72 + x3/9 + x2 - 2x. Let t(o) be the first derivative of z(o). Determine a so that t(a) = 0. -1, 2 Let s(b) be the third derivative of 0b*3 + 0b - 1/30b5 + 0 + 4b*2 - 1/12b*4. Factor s(p). -2p(p + 1) Suppose 4 = -3s + d, 0 = -4s - 2d - 11 - 11. Let v = 5 + s. Factor 4l - 5l*v - 6l + 15l2 - 8l*3. -2l(l - 1)(4l - 1) Let x = -3/23 + 32/69. Solve f2 - 1/3f - f*3 + 0 + xf*4 = 0 for f. 0, 1 Factor 2/13 - 4/13w*3 + 0w*2 - 2/13w*4 + 4/13w. -2(w - 1)(w + 1)*3/13 Let l = -6 + 8. Let 2j - j*3 + l - 6j*2 - 9j*3 + 3j*4 - 7j*4 + 0j = 0. Calculate j. -1, 1/2 Let n = -129/5 + 26. Factor n + 2/5r3 - 1/5r*4 - 2/5r + 0r2. -(r - 1)3(r + 1)/5 Let l(f) be the first derivative of 2f6/15 + 2f5/5 - f4 - 8f3/3 + 8f*2 - 7f + 9. Let s(x) be the first derivative of l(x). Solve s(h) = 0. -2, 1 Factor -2/11h5 + 36/11h*2 + 0 + 16/11h*4 - 42/11h*3 + 0h. -2h2(h - 3)*2(h - 2)/11 Let w = -14 - -13. Let d(y) be the second derivative of y4/3 - y3/6 - y*2 + 2y. Let u(l) = l*2 - l - 1. Let n(r) = wd(r) + 3u(r). Factor n(f). -(f + 1)2 Let r be (-176)/(-99) + 4/18. Factor -4m - 2m3 + 0 - rm*2 + 6m + 2m4 + 0. 2m(m - 1)2(m + 1) Let q(t) = -t*2 - 10t - 1. Let i(l) = -l - 1. Let j(n) = -i(n) - q(n). Let r be j(-11). Factor -2/3 + 1/3p + 1/3p*r. (p - 1)(p + 2)/3 Factor 0 + 27/5q - 1/5q*4 - 27/5q*2 + 9/5q*3. -q(q - 3)*3/5 Suppose 89 = -k + 91. What is p in 0p - 2/3p5 + 0p*k - 4/3p*4 - 2/3p3 + 0 = 0? -1, 0 Let m(z) be the first derivative of z6/420 + 3z5/70 + 9z*4/28 + 9z*3/7 + 9z*2/2 + 9. Let l(j) be the second derivative of m(j). Factor l(a). 2(a + 3)*3/7 Let w = -1 - -1. Let d be (9/42)/(6/8). Factor -2/7 + wa + da2. 2(a - 1)(a + 1)/7 Let -4s*4 + 10s*2 + 4s*3 - 7s*2 + 3s*4 - 7s*2 = 0. What is s? 0, 2 Suppose 0 = m - 11 + 8. Factor 2v - 5v + mv + 2v4 - 4v*3. 2v*3(v - 2) Let q(x) be the first derivative of -x*2 - 7x + 3. Let f be q(-5). Factor -s*3 - 19 - fs*2 + s + 20 + 2s*2. -(s - 1)(s + 1)*2 Solve -2/5l*3 + 0 + 1/5l*4 + 2/5l - 1/5l2 = 0. -1, 0, 1, 2 Suppose -4s = -0s. Suppose 0 = -4i - o + 5, -3i + 0o + o + 9 = s. Find b such that b - 4b2 + 3b*i + 0b = 0. 0, 1 Let d be (-18)/(-45) + (-23)/(-5). Solve -6 - 2u + 2u*2 + du - 7u = 0 for u. -1, 3 Let i(u) be the third derivative of -u7/840 + u6/30 - 2u*5/5 + 8u*4/3 - 32u*3/3 - 4u*2. What is n in i(n) = 0? 4 Let g(b) = 5b*5 - 7b*4 + 4b*3 + 2b*2 - 2b + 2. Let k(x) = -6x5 + 6x*4 - 3x*3 - 3x*2 + 3x - 3. Let h(j) = -3g(j) - 2k(j). Factor h(n). -3n3(n - 2)(n - 1) Let 0 + 1/6b*2 + 0b + 1/6b3 = 0. What is b? -1, 0 Factor 31q*3 + 64q*2 + 20q*4 - 2q + 37q3 + 18q. 4q(q + 1)(q + 2)(5q + 2) Let r be (-6)/(-3) + -3 - 0. Let b be 2/r + -1 + 6. Suppose 8y*3 + 2y*5 - 6y*3 + 8y*2 + 10y*b + 8y*4 + 2y = 0. What is y? -1, 0 Factor -70d3 - 8 + 8d*4 + 32d - 85d3 + 129d*3 + 6d*2. 2(d - 2)*2(d + 1)(4d - 1) Let u(f) be the first derivative of -f*3/3 + 7f*2 - 11f + 2. Let d be u(13). Factor 0 + 2/5c3 + 0c + 2/5cd. 2c*2(c + 1)/5 Let 0g + 0 + g2 - g3 + 1/4g*4 = 0. What is g? 0, 2 Let d be (-39)/(-26) - (-6)/(-4). Let r(p) be the first derivative of 1 + dp + 2/15p3 + 1/5p*4 + 2/25p*5 + 0p*2. Factor r(m). 2m*2(m + 1)2/5 Let v(r) = -r3 + 10r2 - 40r - 6. Let o(c) = 15c3 - 140c*2 + 560c + 85. Let x(a) = 6o(a) + 85v(a). Factor x(g). 5g(g - 2)(g + 4) Let x be 14(3/(-2))/(-3). Let g = 9 - x. Solve 4/11rg + 0 - 6/11r*3 + 2/11r = 0 for r. -1/3, 0, 1 Suppose 3o + 2 = 4s - 5, s + 5	{ "pile_set_name": "DM Mathematics" }
2 - -88. Let f = -105757/10 - -10562. Let i = z + f. Which is the nearest to 3/5? (a) 0.5 (b) i (c) 1 a Let k = -1.68 - 0.32. Let o = 5 - -5. Let q be 4/o + (-65)/(-25). What is the nearest to -1 in q, k, -1? -1 Let t = 0.042 - -0.078. Let d = t + -0.42. What is the closest to 1 in 0, d, 0.4? 0.4 Let o be (-4)/(-5) - 36/60. Let d = 12 - 3. Let l be (-10)/15 - (-8)/d. Which is the closest to 0.1? (a) o (b) l (c) -1 a Let x(t) = -2t - 4. Let l be x(-4). Suppose ly = 21 + 7. Suppose -v + 4j = 2, -j + y = 4v - 2. Which is the closest to -2? (a) v (b) -1 (c) -4 b Let w = 316.94 + -317. What is the closest to 1/3 in 5, 0.5, 1, w? 0.5 Let p = 151 - 149. Let h be -1 + (-7)/(-3) + -1. Let q = -1082/9 + 120. Which is the nearest to p? (a) -2 (b) q (c) h c Let m be (-5)/1 - -257/24. Let i = 0 + 0.1. Which is the nearest to i? (a) m (b) 1/9 (c) -3 b Let i = 8 + -9. Let d = -0.138 + -0.062. What is the closest to d in 1, i, -0.1? -0.1 Let m = -2.5 + 3. Let t = 43 - 45. Let k be 4(-1 + (-28)/(-8))/t. What is the closest to 1 in k, 1, m? 1 Let z(v) = -v*3 + 23v*2 + 22v - 74. Let y be z(24). Which is the closest to y? (a) 4 (b) 3 (c) -0.4 (d) -3 d Let r be (4 - 2)(-1)/(-3). Which is the nearest to r? (a) -0.1 (b) 5 (c) -0.2 a Let h = 0.265 + -1.265. What is the nearest to h in -1/11, -1, 37, -3/4? -1 Let y = 69.4 + -64. Let v = 5.6 - y. What is the closest to 0.2 in 0.3, -5, v? v Let m = 5.7 - 7. Let p = -2.3 - m. What is the nearest to p in -0.07, 1, 0? -0.07 Suppose -9s - s = -40. Which is the nearest to 0.2? (a) s (b) 2 (c) -1 c Let g = 0.3 + 0.2. Let r = -6/85 - -52/255. Suppose -22 = -2m - 5s, -2s + 3s = m + 3. Which is the closest to m? (a) g (b) 5 (c) r a Let r = -141 + 138. Let h be 4/8 + (-66)/84. Which is the nearest to h? (a) 4/5 (b) r (c) 2 a Let w = -459 + 454. Which is the nearest to -0.14? (a) 4/7 (b) -3 (c) w a Let x = -0.3 + -0.7. Let s = 108.82 - 111. Let f = s - -0.18. What is the closest to 1 in 0.02, x, f? 0.02 Let l be (1/(-3))/(50/(-30)). What is the nearest to -7 in -0.1, 2, l? -0.1 Let s = 14 - 13.6. What is the nearest to -40 in 3, -3/8, s? -3/8 Let f be 9/20 + (-2)/8. Let r be ((-2)/1 - 12) + -2. Let p be ((-4)/r)/(3/12). Which is the closest to p? (a) f (b) 1/3 (c) 2/15 b Let n = -1922 + 17300/9. Which is the nearest to 1? (a) -0.4 (b) -2 (c) n c Suppose -2j + 6 = -2z, -4j - 4z = j + 3. What is the closest to 7 in j, -1/7, -1/5? j Let j = 4.817 + -5.117. Let k = -1 - 0. What is the nearest to k in j, -5, 4? j Let s = -2.6 + 0.6. Let c = -1 + 0. Let r be 35/(-7) - (-180)/20. What is the nearest to c in s, r, -0.5? -0.5 Let o = -344 + 345. What is the closest to o in -0.5, 3, 0.2? 0.2 Let r be 169/1092 + 1/(-4). Let s(m) be the first derivative of m*3/3 + 3m*2/2 + 2m + 4. Let d be s(-2). What is the closest to d in -3/5, r, 5? r Let u(y) = -y + 2. Let o be u(5). Let z be (-1)/(-1)(-4 - -3). Let n be ((-3)/(-9) + 0)z. What is the closest to 2/5 in -0.3, o, n? -0.3 Let u be -1 - (-2 + (-2)/(-3)). Let m = -0.4 + -0.4. Let k = m + 0.7. Which is the closest to 0? (a) k (b) 3/8 (c) u a Let i = -0.0516 - -0.5516. What is the closest to -1/2 in -3, -13, i? i Let x = -1.201 - -2.201. What is the closest to 1 in 4, x, 3.3? x Let k = 72 + -73. Let h be (-6)/(-3)k(-2)/(-32). Which is the nearest to 1/2? (a) 1/5 (b) h (c) 1 a Let k = -8.8 + 7.2. Let d = 0.5 + 0.1. Let i = k + d. Which is the closest to i? (a) -0.5 (b) 0.3 (c) -1 c Suppose 8y = 9y - 2. Suppose 6w - y = 7w. What is the closest to -2 in 0.5, w, 1? w Let l = -2.9 - -9.9. Let u = 2 - l. What is the nearest to -1 in 2, u, -1/7? -1/7 Let i = -0.3 + 0.4. Let w = -0.18 + 0.28. What is the nearest to w in 1, -1, i? i Let n be (7 - 1) + -3 + 1. Suppose 0d + nh + 14 = -2d, 4d + 12 = -4h. Let b be ((-4)/3)/((-2)/(-6)). What is the closest to -0.1 in b, d, 1/3? 1/3 Let s be (-1)/(-4) + (-2)/40. Let g = -14 + 22. Let j = g - 6. Which is the nearest to s? (a) 5 (b) j (c) -2/3 c Let s be -9 + 6 - (-30)/933. Let l = 102 - s. Which is the nearest to 0.1? (a) l (b) 4 (c) 14 b Suppose 2o + 0k - 2k + 520 = 0, 4k = -4o - 1064. Let l = 1583/6 + o. Let m = 1 + 3. Which is the closest to -2? (a) 0.1 (b) m (c) l a Let f = 244.8 - 245. What is the closest to 3 in -4/3, -3/2, f? f Let s = 29.4 + -29. Which is the nearest to 0? (a) s (b) 0.2 (c) -51 b Let h be (-6(10 + -11))/((-42)/4). What is the nearest to -6 in -2, -3/7, -4, h? -4 Let q(i) = 2i2 - 14i + 3. Let y be q(7). Let p(l) = l*2 - 6l - 10. Let n = 8 + -1. Let f be p(n). Which is the closest to -2/5? (a) 0.4 (b) f (c) y a Let h = -0.7 - 0.3. Let x = -9 + 8. Let q be 128/(-1088) + (-94)/68. Which is the closest to h? (a) 4 (b) q (c) x c Let n = 26.86 + 1.14. Let d = 27.9 - n. What is the nearest to 0.1 in 4, 1.5, d? d Let u = 0.0201 - -2.9799. Let i = -3.5 + 0.5. Let x = i + 3. What is the nearest to 0.1 in x, -2/7, u? x Let b be ((-6)/10)/(-2 - 85/(-25)). What is the nearest to -1/4 in -2/3, b, 2/9? b Let d = 18 + -17.6. Let z = 0.1 + d. What is the nearest to 0.1 in 1, z, 5/2? z Let o = -160 + 160.2. Which is the nearest to o? (a) -3 (b) 1/6 (c) 134/5 b Let d = -1 + 6. Let i = 9253/30 - 1543/5. What is the nearest to 2 in i, -2/7, d? i Let r(p) be the second derivative of p5/20 + p4/6 - 2p3/3 - p2 + 12p. Let c be r(-3). Let t = 3 + -2.8. What is the nearest to c in -7, 2/11, t? t Let t = -1.762 - 33.238. What is the closest to t in -2/5, -1, 0? -1 Let v = 474.9 + -475. What is the nearest to v in -9/2, -2, 1/7? 1/7 Let b = 340 + -342. What is the closest to 5 in 6/7, -2/17, b? 6/7 Let f = 20.2 - 20. What is the nearest to f in -0.5, -5, -5/2? -0.5 Let m(w) = 3w2 + 6w + 6. Let z be m(-3). Let l be 12/410/z. What is the nearest to l in 5, 2/11, 0.5? 0.5 Let w(r) = r + 3. Suppose 3m + 9 = -n, -1 = -n + m + m. Let s be w(n). Let u be s + 1 - 99/77. Which is the nearest to 0? (a) 0.3 (b) -2 (c) u c Let g be 20/104/(-10). Let k = -1 - -5. Let d = 0.09 + -0.19. What is the nearest to -0.1 in k, g, d? d Let p be 1/(-3)((0 - 0) + -1). Let w be ((-1)/12)/((-3)/(-6)). Which is the closest to p? (a) -5 (b) w (c) -1/2 b Let p be (-5)/2 + 9/(-2) + 4. Which is the nearest to 1? (a) p (b) 54 (c) -0.5 (d) 1/3 d Let h be -13 + 16 + (-2)/(-1). Let g = 189.8 - 190. Which is the closest to -0.7? (a) 0 (b) g (c) h b Let u = -33.3 + 38.3. Let n = 1 + -3/2. What is the closest to -1 in 1/3, u, n? n Let f = -1 + 1. Suppose 0 = u - 124 + 569. Let v = -7563/17 - u. What is the nearest to -1 in v, f, -5? f Let j = 4 - 4.3. Let z be 4/(-6)2/4. Let s = -97/412 + -3/206. Which is the closest to -1/4? (a) s (b) z (c) j a Suppose 18h = 21h - 3. Which is the nearest to h? (a) 0.3 (b) 21 (c) -2 a Let x = 632 + -632. Suppose -1 = -2o - 3q - 0q, 5q = 2o - 41. Let f(i) = i*2 - 8i - 4. Let l be f(o). Which is the closest to x? (a) 3 (b) -1/6 (c) l b Let y = -334 + 329. Let h be (1 + 0)/((-20)/10). Let o = -1166/7 - -167. Which is the nearest to -2/7? (a) h (b) y (c) o a Let h(s) = -2s + 18. Let z be h(9). Suppose 4o = 16o - 36. What is the nearest to z in -7, -1/3, o? -1/3 Let x = -2 - -1.5. Let r = 1.48 - 0.11. Let m = r - -0.63. Which is the closest to 0.2? (a) 4/5 (b) m (c) x a Let p = 44/7 - 227/35. Suppose 2 = -6y + 8. Which is the nearest to 3/5? (a) y (b) p (c) -0.4 a Let r = 145.1 + -145. What is the nearest to r in -1/3, 0.03, 0, 5? 0.03 Let k be ((60/(-63))/5)/((-2)/(-3)). Which is the closest to k? (a) 2/3 (b) -0.8 (c) 0.3 b Let o = 1.1 - 6.1. Let i = -6 - o. Let l = -0.027 + 2.027. What is the closest to i in -3, l, -0.3? -0.3 Let s(r) = -r*2 - 26r. Let f be s(-26). What is the closest to -0.2 in f, -1, 2? f Let l be 76/(-20) - (-2)/(-10). Let h be l/6 + (-40)/(-105). What is the closest to 2 in -3/7, h, -1? h Let u = 1171 - 1175. Let f = -0.2 + 0.3. What is the closest to f in 0, -0.4, u? 0 Let j = -86/345 - -8/69. Suppose 8 = -33t + 35t. Which is the closest to t? (a) 0.3 (b) 3 (c) j b Let u be (6/(-10))/((-14)/1752). What is the closest to -0.1 in 5, -1, u? -1 Let f be 1-3*(1 + 0). Let n = 1/67 - -127/469. What is the closest to n in 0, 3, f? 0 Let i = -2.98323 + -0.01677. Let	{ "pile_set_name": "DM Mathematics" }
to the form ks + ns*2 + x and give k. -4 Rearrange (19x + 105x2 + 13x - 107x2)(-3x - x + 0x) + (-3x2 - x3 + 3x*2)(-1 + 3 - 4) to cx2 + ax + g + px3 and give c. -128 Rearrange -2f + 160f2 - 3 + 175f*2 - 466f*2 + 2f to the form cf + uf*2 + l and give l. -3 Rearrange -265k*2 - 263k*2 - 256k*2 + 771k*2 - 5k to the form lk + jk*2 + a and give j. -13 Express (-3d + 0d + 4d + (-3 + 3 + 2)(-5d + 2d + d) - d - 59d - 35d)(-d*3 - 4d*3 - 2d*3) as p + rd + sd4 + kd*3 + ad*2 and give s. 686 Rearrange (31 + 4 + 4 - 1 + 6)(4h + 2h - 5h) to the form jh + o and give j. 44 Express -366t - 6 + 372t - 8 as vt + p and give v. 6 Rearrange 139z*2 - 51 + 2z - 2z - 142z*2 to the form nz + y + gz2 and give g. -3 Express 3j - 2j - 225 + 46 in the form uj + g and give u. 1 Rearrange -56 + 57 + 4s + 6s - 5s2 + s to x + vs + ms2 and give m. -5 Rearrange -33 - 14y*3 + 58y*2 + 13y*3 - 65y*2 to the form my + oy3 + s + fy*2 and give s. -33 Express -2c - 10c3 + 23c*3 + 18009c*2 - 18008c*2 in the form jc*2 + k + lc*3 + uc and give l. 13 Rearrange -b*3 + 46b - b*2 + 3b*3 - 191b - 2b4 to o + qb*4 + ab + ub3 + tb*2 and give a. -145 Rearrange 17 - 118i - 4 + 8 - 20 to y + ai and give y. 1 Rearrange (940q - 177 + 376 - 199)(2 - 4 + 1) to the form sq + k and give s. -940 Express 5z - 3z + 1151 - 2z2 - 1094 as wz*2 + sz + y and give s. 2 Express o - 482 - 143 - 394 + 338 - 251 in the form ko + i and give k. 1 Rearrange -18i + 31i - 7i*3 - 3i*3 + 0i*2 - 2i*2 - 12i to ui2 + li + ti3 + o and give t. -10 Express -1 - 1 + 145i*3 + i - 4 + 3 + 4 in the form qi*3 + ri*2 + si + t and give q. 145 Express -12s2 - 10s*2 - 5s*2 + 7s*2 - 7s*2 + 4 in the form y + ls*2 + xs and give y. 4 Rearrange 16c + 66c*2 + 0c*4 - 4c*3 - 68c*2 - 18c + 2c4 + 2 to the form dc*3 + a + uc*2 + hc + zc4 and give a. 2 Express 112u*2 + 37u*3 - 113u*2 + 156 - 153 in the form du + i + ou3 + bu*2 and give o. 37 Rearrange -2657u*3 + 2657u*3 - 2u + 0u2 - 1 + 676u*4 + 0u*2 to the form tu*4 + yu + xu3 + k + zu2 and give y. -2 Rearrange (2 - 2 - j2)(0j + j - 3j) + 148j*3 - 64j*3 - 56j*3 to the form zj + gj2 + c + rj*3 and give r. 30 Rearrange (6w*2 + 26w*2 - 2w*2)(23w2 + 16w*2 + 5w*2) to mw*4 + ow*3 + r + fw + jw2 and give m. 1320 Express 12u*2 + 8u2 + u2 + (-2u + 2 - 2)(2 + 0 - 1)(1 + 1 - 8u - 1) in the form lu2 + zu + o and give l. 37 Express (2z2 + 3 - 3)(2z - 2z - z) + 1 - 1 - 2z3 - 53z*3 - 88z*3 + 112z*3 in the form l + uz*2 + tz + iz3 and give i. -33 Rearrange 2z + 1 - 2 - 1 + (356z - 129z + 290z)(-3 - 3 + 4) - 3z + 0z + 4z + (2 - z - 2)(0 + 1 - 3) to the form nz + x and give n. -1029 Rearrange d + 0d*3 + 7d*3 + 69 - 67 to the form qd*3 + gd + f + wd2 and give g. 1 Rearrange (159y - 947 + 184y - 342y)(2 + 2 - 6)(-1 - 2y2 + 1) to sy + gy3 + l + ky*2 and give k. -3788 Express c + c + c + (-14 + 7 - 13)(3 - 3 - 5c) + (1 - 3 + 3)(4c - 3c - 3c) as lc + g and give l. 101 Express (-3 + 5 - 3)(4 + 1 + 1 + (2 + 1 - 1)(2 + 1 - 1) + 4 - 2 - 1)(0 + 18 - 8)(-5d + 2d + d) in the form id + z and give i. 220 Rearrange (-157 + 75 - 59)(0 - 4q - 1 + 3q) + 2q - 3q - 5q - 1 to pq + d and give d. 140 Express 88j2 + 12j*2 + 54j*2 as c + dj + lj2 and give l. 154 Express 0 + 0 - 2l + 160l - 37l + 30l + (1 + l - 1)(-2 - 2 + 2) in the form w + hl and give h. 149 Rearrange 3c*2 + 35c + 2c2 - 67c + 31c - 2c*3 to gc*3 + f + wc*2 + xc and give w. 5 Rearrange -2l3 - 5l + 5l + (2l*2 + 0l2 + l2)(7l + 10l - 65l + (l + 4 - 4)(0 - 2 + 1)) to the form nl*2 + ol*3 + h + vl and give o. -149 Rearrange (-13g3 - 29 + 29 + (-g2 - 3g*2 + 7g*2)(-2g + g + 0g))(-3 + 3 + g) to the form ug*2 + vg + zg3 + jg*4 + q and give j. -16 Express -21 - 34 - 617o + 55 + 218o as g + to and give t. -399 Express -360l - 825l - 344l as r + al and give a. -1529 Express 0c2 - 2c*2 - 45c*4 + 19c*4 + 18c*4 - c in the form mc*4 + pc*2 + ac + kc3 + y and give a. -1 Express 0g*2 - 3g2 + g2 + (-2g - 2g*2 + 2g)(2 - 2 + 2) - 60316g*2 - 2g + 1 - 3 + 60310g2 in the form i + ag*2 + tg and give t. -2 Rearrange (-7 + 7 + 2h)(-1 + 43 + 34) to fh + g and give f. 152 Express -4v - v*2 + 4v*3 + v - 4v*3 + 15v*4 + 9v*4 in the form xv*3 + nv*2 + hv + l + dv4 and give n. -1 Express (3g - 3 + 3 + 2)(-119g*2 + 275g - 275g) as mg*2 + vg*3 + r + ug and give v. -357 Rearrange (-2n - 51 - 43 + 109)(-2n + 5n - 2n)(-3n2 + n2 - 1 + 4) to rn*3 + y + wn*2 + in + hn4 and give h. 4 Express 8t*2 + 5t*2 + 3t*2 - 36t - 5 + 38t in the form n + dt + lt2 and give d. 2 Rearrange 85k - 322k + 73k + 112k + 94k to hk + w and give h. 42 Rearrange (-2l - l + 2l)(-25l + 564 - 40l + 63l + 64) to the form cl + t + dl2 and give c. -628 Express 307859d*2 - 307859d*2 - 541d*3 + (-5d - 2d2 + 5d)(d - 2d + 2d) as ad + h + pd2 + gd*3 and give g. -543 Express -325i + 31 - 78i - 29 - 54i as yi + z and give z. 2 Rearrange -11j*3 + 86j + 4j3 + 15j*3 - 7j*3 - 1 - 2j2 - j4 to gj2 + lj*4 + pj*3 + y + ij and give l. -1 Express (x*3 - 4x4 - x3)(463 + 170 + 84 - 135) in the form b + qx + gx4 + ux*2 + lx*3 and give g. -2328 Rearrange 3b*2 + 3b*2 - 1 - 6b*2 + 2b2 - b3 + b + 2b to s + ib*3 + zb*2 + ab and give i. -1 Express 136 - 136 - 46g as ug + p and give u. -46 Rearrange (-8t - 8 + 11 - 5)(108 - 108 - 44t) to the form n + wt*2 + at and give a. 88 Express 6v - 2v*2 - 8v + 4 - 6v2 - 2v*3 in the form j + wv*3 + yv*2 + fv and give y. -8 Rearrange (-429l + 219l + 254l)(0 - 2 + 0) + (141 - 11l - 141)(-1 - 2 + 2) to jl + f and give j. -77 Express -253h*2 + 254h*2 + 2 + 6h + 2h - 9h*3 in the form zh*2 + oh*3 + g + mh and give o. -9 Rearrange (-2i2 + 13i*2 + 106i*2)(28i - 3i*2 - 28i - 1) to pi4 + ni*2 + ti*3 + xi + o and give o. 0 Express 23k + 28k - k*2 + 120 - 70k + 19k in the form q + tk + gk2 and give q. 120 Rearrange -w2 + 186 - 7 - 153 - 146 - 3w*2 to fw*2 + rw + v and give v. -120 Rearrange -75z + 16 + 109z - 36z to the form s + oz and give o. -2 Express -1213o2 - 12o + 599o2 + 593o*2 in the form lo + uo2 + a and give u. -21 Express 1 - 22c*2 - 72c*3 + 275c*3 + 7c*2 + 10c*2 + 7c*2 as tc + pc2 + mc*3 + q and give p. 2 Rearrange -360 + 16n + 193 + 176 to the form sn + f and give f. 9 Express 644z - 875z + 1524z in the form d + yz and give y. 1293 Express (4r + 0r - 3r + (-6 + 8 + 3)(-2r + r + 0r) - 3r + 4r - 2r + 4r + 11r - 5r)(-3r + r2 + 3r) as cr3 + hr + vr2 + o and give c. 5 Express -19 + 10w - 81w - 10w - 8w + 23 in the form iw + s and give s. 4 Rearrange -31 - r - 4 - 2r2 + r2 - 19r*2 + 10 to nr*2 + c + gr and give n. -20 Express 5g3 - 2g*2 + 51g - 49g + 24 - 3g in the form kg3 + pg + tg2 + m and give m. 24 Express 110i + 16i + 433i + 253i as vi + g and give v. 812 Rearrange 5j4 - 2j*4 - 2j*4 + (-1183j - 1142j + 2 + 2269j)(4 - 2j3 - 4) - j4 - j*4 + 5j*4 to n + yj*3 + fj*2 + tj*4 + zj and give t. 116 Express -6j + j2 + 3j - 5j2 - 2 + (2 - 2 + 2j*2)(-2 + 6 - 2) - j*2 + 0 + 0 in the form c + dj + wj2 and give c. -2 Rearrange 65h*4 - 262h*4 + 117h*4 + (3 - 6 + 0)(5h4 - 2h4 - h4) to lh3 + ph*2 + yh + n + sh4 and give s. -86 Rearrange (4 - 4 + 6v)(-171907 - 923v + 171907 - 464v) to yv*2 + kv + h and give y. -8322 Rearrange 1 - 4 - 6680j2 + 2j*3 - 6j*4 + 6686j*2 + 2 to yj*4 + wj*3 + uj*2 + n + ij and give n. -1 Express -10z2 + 3z*2 + 6z*2 + 3z + 6z as tz*2 + i + qz and give q. 9 Rearrange (12m + m2 - 12m)(57m + 52 - 52) + 3m3 + 3m*3 - 8m*3 to g + hm*3 + xm + nm2 and give g. 0 Rearrange 2f + 2 + f**2 - 28	{ "pile_set_name": "DM Mathematics" }
g(k) = k - 2. Let o(s) = -30s + 15. Let l(j) = -4g(j) - o(j). Is l(m) prime? True Suppose 3y = -137 - 388. Let c = -30 - y. Is c prime? False Let a = 0 + -12. Let j(m) = -9m + 11. Is j(a) a prime number? False Suppose -2w + 36 = -4j, 4w + 3j = 24 + 37. Let u(r) = -r*3 + 17r*2 - 9r + 21. Is u(w) a prime number? False Suppose 23701 = 5p + 2q, 0p = 5p + 3q - 23699. Is p prime? False Let z be 25236/(-30) + 4/(-5). Let w = -461 - z. Suppose 3p - 3u - 381 = 0, -p + 4p = 2u + w. Is p a composite number? False Let d(y) be the second derivative of -2y*2 + 1/3y*3 + 3/4y*4 - 5y + 0. Is d(-5) prime? True Let u(v) = 8v2 + v + 4. Let p = -40 - -29. Let h = -8 - p. Is u(h) prime? True Suppose 2t - 11 + 3 = 0. Let w be 2 + 12/(-4) - -1. Suppose -ts + 2133 = -3u - 1618, w = -5s - 4u + 4650. Is s composite? True Suppose 14j - 18j - w + 4232 = 0, 2j - 2098 = 4w. Is 30/(-75)10/2 + j a prime number? False Suppose 0 = 2n - 671 - 119. Is n a prime number? False Suppose 0 = -50g + g + 6941487. Is g composite? True Suppose 0 = 18f + 34f - 3669692. Is f prime? True Suppose -2b + 9 = -5. Let i(d) = -14d + 19. Let f(t) = -7t + 10. Let o(c) = -13f(c) + 6i(c). Is o(b) prime? False Suppose 5z + 616 - 26 = 0. Let j = -33 - z. Is j composite? True Suppose 10q + 61083 = 19q. Is q composite? True Let z be 4662/147 + (-4)/(-14). Is -3(514/4)/((-24)/z) prime? False Let b(k) = 33 + 21k + 9 - 100k. Is b(-19) composite? False Let h(m) = -m - 175. Let g be h(0). Let o be 0 + 302 + -2 + 6. Let c = g + o. Is c a composite number? False Let x be -3174/36378/(-1). Suppose w - x = -2b, 3w = -2b + 5b - 8226. Is b a prime number? True Let g be (7/21)/(3/351). Suppose 4j - 1 = g. Is j a prime number? False Suppose 2a - 43b = -40b + 3718, -2a = 5b - 3686. Is a a prime number? False Let y = 2802 - 408. Suppose 0 = 4m - 58 - y. Let b = m + -326. Is b composite? True Suppose -4527 = 5s - 4z, 3s - 5z + 2213 = -511. Let f = -556 - s. Is f composite? False Suppose 2p - 518 = 590. Is 3/15 + p/(-20)-4 composite? True Suppose 2a + 34 = -5g, g + 2a - 5a = 0. Let k(o) = 4o*2 + o - 17 - o. Is k(g) a prime number? True Let y = -18 - -18. Let r be y - (-368)/(-4) - 3. Let d = r + 244. Is d composite? False Let r = 8197 - 5427. Suppose -5c - 914 = -l, -r = -3l + c + 14. Is l prime? True Let i be 4/(8/(4/1)). Let y(l) = -i - 1 + 6 + 50l. Is y(4) a composite number? True Let s(f) = -100f + 5. Suppose -3j = 0, 2j + 5 = 5m - j. Let o(c) = -c + 1. Let y(b) = ms(b) + 4o(b). Is y(-5) composite? True Let l be 5 - 12188/12 - (-2)/(-6). Let t = l - -2176. Is t a prime number? False Let n be ((-6)/4)/(9/(-30)). Let b = 21 + -18. Suppose 88 = s + 2i + bi, -ns + 2i = -413. Is s a composite number? False Let a be ((-12)/15)/((-4)/(-70)). Suppose -5f = c - 2358, 0 = 3f + 2f + 5c - 2350. Is 6/a + f/7 a composite number? False Suppose 0 = 29r + 6r - 540435. Is r a prime number? False Suppose -4u - 5l + 16 = 0, -4u - 6l + 7l - 8 = 0. Is 228 - (u - (0 - -1)) prime? False Let n(l) = 106l2 + 8l - 21. Is n(5) composite? True Let z(j) = 6j2 + 3j + 17. Let b(c) = -c*3 - 4c*2 + 6c - 3. Suppose 4m - 15 = 7m. Let n be b(m). Is z(n) composite? True Suppose -3o - 1 = -d, 0 = -3d - 2o + 5 - 2. Let h be d/4 + (-1019)/(-4). Suppose 0f - 3f + h = 0. Is f a prime number? False Let l(m) = -m2 + 9m + 11. Let d be l(6). Suppose 4k - 199 = d. Is k composite? True Suppose 11045 = 3b - t - 3t, 0 = 5b - t - 18414. Is b composite? True Let o be ((-15)/(-21) - 1) + (-62808)/(-14). Suppose -4v - o = -2m, 3m - 6757 = -0v - v. Is m composite? False Let a = -1243 - -3854. Is a a composite number? True Let r be 421/1025. Suppose 5 - 27 = j. Let w = r + j. Is w a composite number? False Let y(q) = 119q + 30. Let p be y(14). Let i = p + -977. Is i a prime number? True Suppose 3q = -5n - q + 18793, -5q - 15059 = -4n. Is n composite? False Let w(i) be the third derivative of 159i6/20 + i5/60 - i4/24 + i3/6 + 13i2. Is w(1) a composite number? True Let p(n) = n2 - 88n - 49. Is p(-30) composite? False Suppose -2r = -7r + 40. Suppose 7 + r = 5a. Let y(v) = -v2 + 7v + 1. Is y(a) a prime number? True Let v = -49142 + 71551. Is v a composite number? False Let f be (22/33)/(2/(-15)). Suppose -c = 2m - 44 - 489, 5m - 1334 = -2c. Let a = f + m. Is a a prime number? True Let j(m) = -3m*3 + 2 + 0m*2 + 3m + 3m2 + 4m*3. Let t be j(3). Suppose -66 = -w + t. Is w composite? False Suppose 47h - 52h + 1265 = 0. Is h composite? True Let y(a) = -19a*3 - 2a*2 + 3a + 2. Let n be y(-7). Suppose -5s = -4j + 12797, 2j - s = s + n. Is j composite? False Suppose 554 - 184 = 5n. Suppose 6g = -n - 124. Let y = 58 - g. Is y a composite number? True Let l(u) = 33u + 9. Let b be l(7). Suppose -4x + 308 = -5s, 5x + s - b = 145. Is x prime? False Let v(x) be the first derivative of -2x*4 + 3x*3 + 6x*2 - x - 5. Let t(p) = -7p*3 + 9p*2 + 11p. Let h(w) = 7t(w) - 6v(w). Is h(5) prime? True Let g(a) be the second derivative of 22/3a3 + 5a - 1/2a2 + 0. Is g(2) composite? True Suppose -2d - 2d - h = 12, -2h = -d - 3. Is -2 + (-8)/d + (-757)/(-3) prime? False Suppose 2h + v = 20512, -5h = -0v + 5v - 51270. Is h/5 + -1 + 6/15 composite? True Suppose 514i - 495i = 773642. Is i composite? True Let t(u) be the first derivative of -10u - 15u*2 - 13 - 1/3u3. Is t(-13) a prime number? True Let b(a) = -a3 + 15a + 493. Is b(0) a prime number? False Let u(t) = 4t*2 + 7t - 128t3 + 4 - 3 - 192t*3. Is u(-2) a prime number? False Let w(i) = 357i - 5. Suppose n + 4n - 37 = -3b, 5n = 25. Let q be w(b). Let a = q - 836. Is a a composite number? False Let t(p) = 3p + 2p2 - p3 + 4p*3 + 3p*3 + 2p*2. Let h be t(5). Let g = h - 378. Is g composite? False Let l(x) = 14x*3 - 9x*2 + 2 + 3 + 8x*2 + 18x - 13x2. Is l(6) a composite number? False Let c be 0/1(-5)/(-10). Suppose c = -2k + 8 + 2. Suppose -j = -3j + 5l + 153, 2j = -kl + 203. Is j prime? True Suppose -53x = 327914 - 1242111. Is x a composite number? True Let x(r) = -r + 2. Let u(t) = 14t - 8t - 10t - 2 - t2. Let l be u(-4). Is x(l) a composite number? True Suppose 6u = 5u - 2. Let t = u - -3. Suppose -t = -y, 808 = 6a - a + 3y. Is a composite? True Let r(i) be the second derivative of -i5/3 + 7i*4/24 + 2i*3/3 + 7i. Let h(l) be the second derivative of r(l). Is h(-7) a composite number? True Let l(t) = -t*2 + 9t - 1. Let g be (-4)/6 + (-46)/(-6). Is l(g) a prime number? True Let l(q) = 13q2 - 11q + 1. Let s be (-1)/(-4) + (-531)/(-36). Is l(s) a composite number? True Let c be (6/4)/(6/8). Suppose -5w + u + 1447 = -cu, 0 = w + 2u - 279. Is w prime? False Suppose 11 = f - 3. Let o = -11 + f. Is -1 + (o - -184) + -1 a prime number? False Let o(t) = -t3 - 10t*2 + 19. Let q be o(-10). Suppose qr - 805 = 14r. Is r prime? False Let q be (-3)/15 + (-5851)/(-5). Suppose 2t = 4t - 4x - 1178, 2t - 2x = q. Is t a prime number? False Let t(x) = 119x + 13. Let b(y) = 238y + 27. Let v(f) = -3b(f) + 5t(f). Is v(-6) a composite number? True Suppose -4d + 13 = -5n + 4n, 18 = 4d - 2n. Suppose -1503 = 2k - 7k - 2y, dk - 590 = 2y. Is k a composite number? True Let a = 1869 + -718. Is a a composite number? False Let i = -6208 - 1486. Is (12/(-8) + 1)i a prime number? True Let l(i) = 14i - 41i + i + 7i - 7. Let k be 124/(-12) + 1/3. Is l(k) a prime number? False Let j = -1690 - -1901. Is j prime? True Let x = -23 + 27. Suppose xz + 2n = 26, 4n + 18 = -z + 3z. Is (1 - 2)(-2737)/z composite? True Let c = -2526 - -15313. Is c a prime number? False Let h(c) be the second derivative of c6/360 + c5/40 - c4/8 + c3/3 - 5c. Let g(f) be the second derivative of h(f). Is g(-6) prime? False Suppose -12p + 16p = 4z - 15216, -18975 = -5z - 4p. Is z a prime number? False Is (-32)/112 - (-563000)/14 a prime number? False Let r = -49 - -49. Suppose -3o + 10o - 5509 = r. Is o a prime number? True Suppose 148 = i - 311. Suppose 0 = 3v - 948 - i. Is v prime? False Let l(w) = -31 + 233 + 2w - 62 + 111. Suppose r = 2d + 4, -5r - 5d - 6 = -2*d. Is l(r) prime?	{ "pile_set_name": "DM Mathematics" }
Suppose -20g - 26g = -33g - 2977. Is h at least g? True Suppose 5k = 4t + 50, k + 10 = 2t + 14. Do k and 375/26 have the same value? False Let d(a) = -a*2 - a - 10. Let i be d(-9). Let x = 60 + i. Is x greater than -22? False Suppose 123895 = 69a + 2a. Is 3489/2 greater than or equal to a? False Suppose -2x + z = -14 - 0, -5z = 3x - 8. Let t be x(-4)/(-18) + (-1190)/825. Which is smaller: t or 0? t Suppose -18 = -4r - 2, -5o + 13 = 2r. Let z be o/2 - ((-1701)/30)/9. Which is smaller: z or 6? 6 Suppose 0 = 2h - 4d - 42, -7h + 2d + 115 = -128. Is h less than 34? False Let z = -0.15 + 0.2. Let x = 3.13591 + -0.13591. Is x > z? True Suppose 3j - 9 = -a, 0 = 4j + 7a - 2a - 12. Let b be 274/(-2 - (5 - j)). Is -37 at most as big as b? True Let l = -121.1 + 114.958. Let v = -6 - l. Let o = -0.205 + v. Which is smaller: o or -2/5? -2/5 Let d = -114.54 + 117. Let j = 1.54 + d. Let h(q) = q2 - 2q + 1. Let w be h(3). Is j < w? False Let u(x) = -6x2 + 124x - 80. Let z be u(20). Which is smaller: z or -10/1243? -10/1243 Let u = -0.222 - 2.778. Let p = 0.02 - 0.06. Let q = 0.03 + p. Which is smaller: u or q? u Suppose 0 = 4h + 5f + 30, -72 = 4h + 2f - 60. Does 1/755 = h? False Suppose -q = -4h - 46 - 8, 4q - 34 = 2h. Let o be -1 - (h/5)/((-12)/(-15)). Is o greater than -0.4? True Let g = -23335.66 + 23336. Let l(i) = i3 - 3i*2 + 2. Let n be l(3). Is g < n? True Let p be (2/(-4) + (-21)/(-18))6. Suppose z - 4z = -pg, 0 = -4z + 16. Which is smaller: g or 9? g Let u = -0.2545 - -23.2545. Which is greater: 2/29 or u? u Let a = 1.267 + -7.097. Let g = a + 5.61. Which is smaller: g or 0.01? g Suppose -54 = -52b + 49b. Suppose 6w = -0 - b. Let m be 2/(-8) - ((-531)/(-228))/w. Is 2 smaller than m? False Let m = 12809 - 13107. Is 2/17 > m? True Let x(b) = b*2 + 2b + 3. Let q be x(0). Let f(l) = 2l2 + 4l - 4. Let z(i) = -5i + 41. Let j be z(8). Let r be f(j). Which is greater: r or q? q Let o = 1361077/43 - 31653. Let q = -7 + 7.12. Which is greater: q or o? q Suppose -974 = -6i + 1024. Suppose 336y = iy - 51. Is y less than -107/6? False Let f be 33/88 + (2 - (-3098)/16). Which is bigger: 197 or f? 197 Suppose 172h - 176h = -60. Let g be (-5)/15 + (-1)/(h/10). Which is bigger: g or -2/383? -2/383 Let l be ((28/24 + -1)/1)/((-2)/12). Which is smaller: l or 2.58? l Let w = 69 + -74. Let y = -32.9 - -35.8. Is w greater than or equal to y? False Suppose 33f = -420 + 2103. Is f != 52? True Let c = -18275 + 1736152/95. Are -1 and c non-equal? True Let q = -107 + 380. Let u = q - 252. Let v(i) = 3i - 7. Let o be v(9). Which is smaller: o or u? o Let d = 1656 - 140762/85. Let r = d + 346/255. Which is smaller: r or 1? 1 Let r be 168/(-98)(-53 - -4). Let y be 7/(r/(-16)) - 340/168. Are y and -3 equal? False Let m = -5816 + 5584. Which is smaller: m or -239? -239 Let y = -599.9 - 52.1. Let i = -752 - y. Is i at most 1? True Suppose 10a - 16 = h + 5a, -3h = 3a - 24. Let t be (3/2)/(3/1)10/1. Is t smaller than h? False Let x = 2777 - 2778. Which is bigger: -2/303 or x? -2/303 Suppose -4f = -167 + 223. Let c(w) = 2w + 42. Let d be c(f). Let j be (4 + -3 + (-3)/2)d. Is j not equal to -9? True Suppose -2a = -3c + 21, -2c + 20a = 21a - 21. Let d(q) = -q + 4. Let z be d(c). Is z at least as big as 53? False Let v be 0 - (7330/45)/(-1). Let k = -163 + v. Which is smaller: -1 or k? -1 Suppose -878 = 4i - 2r, i + 459 = -i + 5r. Let l = -218 - i. Is 86 <= l? False Suppose -26j + 23j = -3. Suppose y = -5x - 2y - j, -3x - 3y = -3. Let b be x/8 + (-3)/164. Which is smaller: 3/11 or b? b Let u = -3/11888 - -61507/8190832. Which is greater: 0 or u? u Let m = 7070485591/164 + -43116016. Let g = m - -3299. Does g = 0? False Suppose 6 = -25l + 28l. Suppose 9y = -18y + 2349. Which is greater: l or y? y Suppose 5v + 4 = 2s, -2s = -2v + 3s + 11. Suppose 4f = -0f - d - 16, 3f = 3d - 12. Let j be (24/(-656))/(v/f). Are 1 and j nonequal? True Suppose -21t + 19t + 36 = 0. Let j(d) = -d3 + 17d*2 + 13d + 39. Let i be j(t). Is -49 bigger than i? True Suppose 807989 + 514167 = 302l. Which is greater: l or 4381? 4381 Let t = 404 + -404.049. Let c = -0.049 - t. Is c bigger than 2/147? False Suppose -2m + 4m = -d + 1277, 0 = -m - 3d + 656. Is 637 not equal to m? True Let q(a) be the second derivative of -a*3/2 - 4a*2 + 23a. Suppose -2z + 2d - 2 = 4, 5d + 12 = -4z. Let b be q(z). Does b = 1/6? False Let z = 36651134/13281 - 8279/3. Which is smaller: z or 0? 0 Let u = -412 + 532. Let f be (-1)/4 + u/912. Which is bigger: 0 or f? 0 Let t = 1207 + -15439/13. Let z = t - 282/13. Is z equal to 2/3? False Let x(a) = -5a + 36. Let w = -68 - -88. Let d be x(w). Is -64 at most as big as d? True Let c be (-5)/(-20) + ((-198)/136)/3. Let d = c + -14/85. Suppose 2u - 2 = 2h, 7 = -2h + 7h + u. Are h and d unequal? True Let g = -4853 - -4853. Let i = 38 - 84. Which is greater: g or i? g Let p = 5 - 0. Suppose 3d - j + 34 - 155 = 0, pd = 4j + 204. Let u be 6/(60/(-25))6/d. Which is smaller: u or 0? u Let i = -245397 + 1717446/7. Let x = -74 - -26. Is x at least i? False Let k(p) = p. Let y(v) = -3v - 1. Let s(l) = -4k(l) - y(l). Let i be s(15). Let x be ((-3)/i)/((-20)/40). Is -2/15 at least x? True Let h(q) = -1075q - 155. Let c be h(-41). Let x be ((-5)/4 - -2)/(648/c). Is 51 bigger than x? True Let x be (-235)/13 + 2-2 + (-1855)/(-455). Is -612/35 < x? False Let r = -18 + 56/3. Suppose -k + 7 - 49 = -a, 4k + 3a + 189 = 0. Let g = k - -45. Is r >= g? True Let r be 2/(-8) + 498/1928. Suppose -5w - 645 = -595. Let p be (-30)/w - (-8)/(-4). Is p <= r? False Suppose 309 = -2g - 1977. Do g and -1144 have the same value? False Let w = -167 - -143. Let s be (-15)/(-9) - 494/w. Which is smaller: s or 23? s Let p = 299 - 297.85. Let j = 0.39 - p. Is -0.1 at least as big as j? True Let b = 100 - 93.9. Let l = -5.8 + b. Suppose -3t + p = -22, 4p + 0 = -16. Which is bigger: t or l? t Let j(s) = 7s*2 + 34s - 11. Let d(q) = 6q2 + 35q - 12. Let k(f) = 4d(f) - 3j(f). Let w be k(-13). Which is greater: -12/5 or w? w Let q be (-489426)/(-11170) + (-63)/(-9). Let z = 18/1117 - q. Which is smaller: z or -51? -51 Suppose 0 = -2x + 5g - 11, 6 = -3x - g - 2. Let l be (x/2)/(4/184). Is l != -70? True Let f = -619/27 - -15583/675. Let b = -13 - -21. Suppose 0 = 5k - b + 3. Which is smaller: k or f? f Suppose -n + 4p - 9 = 0, 14 - 110 = 4n + 4p. Let m be (4/n)/(36/(-42)). Let l be ((-105)/18)/(2/(-12)). Which is greater: m or l? l Let o be (6/(-33))/(2/(-348)). Let r = -12810/407 + o. Suppose 0 = -1070t + 1063t. Is r smaller than t? False Let j(w) = 2w + 1. Let m be j(4). Let g = 0.23 - -18.77. Let o = 18.6 - g. Is o equal to m? False Let r = 6 - 7. Let h = -0.135 - -0.265. Let n = 1.87 + h. Is n != r? True Let z = -109 - -38. Suppose -364 = 5h - 3s, 72 = -2h - 2s - 80. Which is greater: h or z? z Suppose 2q + 0q + 64 = -2d, 3d = -5q - 104. Let i be 76/8d/21. Is -12 smaller than i? False Let g be (-3)/(((-14)/(-78))/(-7)). Let v be ((-3)/g)/((-7)/(105/(-8))). Let w = v + -15/26. Which is smaller: w or -1? -1 Let g = -117 + 120. Suppose gf = 2l - 40, -10l + 48 = -8l + f. Is 21 smaller than l? True Suppose 58i + 3548 = 56i - 3f, -4i = -5f + 7140. Which is greater: -1779 or i? -1779 Suppose 5x + 8 + 2 = 0. Let g be (-1)/(-3) + x/6. Suppose -213q - 53q - 2 + 2 = 0. Are q and g equal? True Let h = 36.2 - 36.1475. Let u = 28.0525 - h. Which is smaller: -2 or u? -2 Let m be (2/(-3))/((-1)/3). Let n = 481 - 490. Let z be 2/(2/n - 720/(-1782)). Which is bigger: z or m? z Let h = 231/2 - 112. Let x = -902 + 1372. Let v = x + -470.1. Is v > h? False Let u = -558902 - -558830. Let f be 1 + -1 - (0 - 20). Let n be (-6)/f5/(-6). Are n and u nonequal? True Let z(s) = 34s*2 - 9s*2 - 11 + 23s*2 + 4s. Let u be z(2). Which is bigger: u or 2? u Let c be (-4)/51539/12. Let t = c - -103. Which is greater: t or -0.36? t Let r = 16109 + -58040728/3603. Are r and 0 equal? False Let z(q) = -q3 + 19q*2 - 15q - 62. Suppose 2k - g - 8 = 32, 0 = 4g + 16. Let n be z(k). Which is smaller: -10 or n? -10 Suppose -194l = -248l + 2376. Let n = 6 - 13. Let u be ((n + 1)/(-2))/((-5478)	{ "pile_set_name": "DM Mathematics" }
*2 - 2q + 4. Let o(h) = -h*2 - h + 1. Determine zs(y) - 2o(y). -2y3 + 2 Let l(b) = b2 - 4b - 2. Let t(h) be the first derivative of h3/3 - 7h*2/2 - 3h - 1. Let s = -3 - -8. Give sl(i) - 3t(i). 2i2 + i - 1 Let z(x) = 5 + 11x*2 - 4x*2 + 1 + 5x. Let s(m) = 2m2 + 7m + 2. Let o(l) = 3l2 + 11l + 3. Let j(a) = -5o(a) + 8s(a). Give -5j(c) + z(c). 2c*2 + 1 Let f(g) = 6g3 - g2 + 4g - 5. Let h(t) = 5t*3 + 3t - 4. Give 2f(i) - 3h(i). -3i3 - 2i*2 - i + 2 Let a(o) = o - 5. Let d(v) = 4v - 19. Determine 22a(x) - 6d(x). -2x + 4 Let u(t) = 4t*2 + 2t - 3. Let p(c) = 5c2 + c - 4. Give -3p(o) + 4u(o). o2 + 5o Let y(g) = 4g - 2. Suppose 3o + 59 - 53 = 0. Let v(m) = 9m - 5. What is ov(x) + 5y(x)? 2x Let o(u) = 6u - 3. Let x(w) = 5w - 3. Determine -3o(t) + 4x(t). 2t - 3 Let m(a) = 3a*2 + a + 2. Let x(b) = -158b + 158b + b2. Let z = -25 + 24. Determine zm(c) + 4x(c). c2 - c - 2 Let q(m) = m3 - 3m*2 - 3m - 1. Let h(u) = 2u3 - 8u*2 - 10u - 2. Give -3h(j) + 8q(j). 2j3 + 6j - 2 Let o(v) = -3v3 + 2v*2 - 2v + 2. Let y(j) = -2j3 + 2j*2 - 3j + 3. Calculate 3o(u) - 2y(u). -5u3 + 2u2 Let i(d) = d2 - 2d + 5. Let l be i(5). Let m be l/88/10. Let f(h) = 2h + mh2 - 2 + h2 + 2. Let c(x) = -10x2 - 7x. Calculate 2c(q) + 7f(q). q*2 Let m(b) = -4b*2 + 5b + 4. Let o(w) = w*2 - w - 1. Determine 4m(v) + 20o(v). 4v*2 - 4 Let z(w) = 4w*3 + 9. Let x(y) = 7y*3 + 19. Calculate -4x(b) + 9z(b). 8b3 + 5 Let n(h) = -h2 + h. Let d(b) = -b*3 + 34b*2 - 4b + 3b - 35b2. What is -d(a) - n(a)? a3 + 2a2 Let i(j) = -11j*2 + 71j + 7. Let w(c) = 5c2 - 36c - 3. Calculate -3i(t) - 7w(t). -2t2 + 39t Let u(w) = -w - 1. Suppose -4z = -2i + 50, -5z - 61 = -4i + 2i. Let y(d) = -2d - 3. What is zu(b) + 4y(b)? 3b - 1 Let b(a) = 3a*2 - 4a*2 - 5a*2 - 4a3. Let l(m) = m3 + 2m2. Suppose 26h - 6 = 24h. Calculate hb(w) + 10l(w). -2w*3 + 2w*2 Let z = -12 - -6. Let k(q) = 23q. Let l = 32 + 2. Let t(x) = 4x. What is lt(f) + zk(f)? -2f Let k(a) = 7a + 7. Let m(f) = -4f - 4. Suppose 5d + 3i - 15 = 0, -2d + 1 + 5 = -3i. Determine dk(b) + 5m(b). b + 1 Let z(t) = -t - 1. Let o(a) = -6a + 2. Suppose -d + 3 = -2d. Let u(j) = -5j + 1. Let n(h) = do(h) + 4u(h). Determine -4n(w) + 6z(w). 2w + 2 Let a(o) = -11o3 + 4o*2 - 3o. Let s(r) = 10r3 - 3r*2 + 2r. Give -4a(x) - 6s(x). -16x3 + 2x*2 Let g(a) = -20a - 6. Let n(o) = 119o + 35. Give 35g(j) + 6n(j). 14j Let n(a) = -a*2 - 3a + 7. Let j(q) be the first derivative of -q3/3 - q2 + 6q - 4. Calculate 5j(h) - 4n(h). -h2 + 2h + 2 Let y = 15 - 22. Let l(o) = 4o + 7. Let i(s) = -6s - 10. What is yl(w) - 5i(w)? 2w + 1 Let w(q) = q3 - q2 + q - 1. Let r(c) = -5c*3 + 4c*2 - 3c + 2. Let v = 2 - 7. Let j = -3 - v. Suppose -ju - 3u = -5. Determine ur(z) + 4w(z). -z3 + z - 2 Let l(x) = -x2 - x + 13. Let r be l(0). Let w(m) = -m + 15. Let k be w(r). Let u(z) = -kz - 2 - 6z + 6z. Let o(q) = -q. Calculate o(g) - u(g). g + 2 Let m(z) = 5z*2 + z - 2. Let j(u) = -25u*2 - 5u + 10. Determine -2j(o) - 11m(o). -5o2 - o + 2 Let l be 24/10 + 2/(-5). Let m(t) = -2. Suppose 0k = k. Let z(b) = -3 - b*2 + kb*2 + 0. What is lz(q) - 3m(q)? -2q*2 Let z(u) = -4u*3 - 6u*2 + 6u. Let y(x) = 8x3 + 11x*2 - 11x. What is 6y(k) + 11z(k)? 4k3 Let y(p) = -10p*2 - 10p - 7. Let r(n) = 5 + 2n2 + 7n - 2n2 + 7n*2. Suppose 3l - l = 5t + 14, 0 = 2t. Calculate lr(g) + 5y(g). -g*2 - g Suppose -85 = -15i + 80. Let g(o) = 4o - 2. Let u be 2/(-4) - 3/(-2). Let t(s) = s - 3s - u + 4s. Determine it(x) - 6g(x). -2x + 1 Let l(y) be the third derivative of -y4/6 + y3/6 - 6y2. Let f(z) = 9z - 2. Calculate -6f(d) - 13l(d). -2d - 1 Let m(g) = g3 + 7g + 7. Let l(c) = c + 1. Give 42l(j) - 6m(j). -6j3 Let g(j) = -7j - 2j3 + 0j*3 - 3j*3 + 10j*3 + 7j*2. Let x(n) = 4n*3 + 6n*2 - 6n. Determine -6g(h) + 7x(h). -2h3 Let n(w) be the third derivative of -w6/20 - w5/20 - w4/12 + 2w*3/3 + 6w*2. Let h(j) = -5j*3 - 2j*2 - 2j + 3. Determine 4h(z) - 3n(z). -2z3 + z2 - 2z Let g(k) = k. Let a(s) be the third derivative of -s*4/8 + 2s*2. Let f(h) = -2h - 4. Let l be f(3). Let j be (-24)/15l/4. Give jg(r) + a(r). r Let y(d) = -12d - 2d + 0d + 14. Let w(r) = -2r - 4. Let a(n) = -n - 3. Let x(v) = 3a(v) - 2w(v). What is -12x(c) - y(c)? 2c - 2 Let w(s) = -2s - 2s - 5 - 1 + 8. Let a(u) = 9u - 4. Let t(v) = v3 + 7v*2 + 8v + 3. Let k be t(-5). Determine kw(o) + 6a(o). 2o + 2 Let s(l) = 5l*3 - 4l*2 + 4. Let k(m) = -39m*3 + 33m*2 - 33. Calculate 4k(n) + 33s(n). 9n*3 Let q(d) = 4d + 1. Let x(l) = -11l - 2. What is -8q(w) - 3x(w)? w - 2 Let n(m) = -m2 + 15m + 1. Let x be n(15). Let c(b) = 3b2 + 2. Let h(t) = -t2 - 1. Calculate xc(a) + h(a). 2a2 + 1 Let o = -3 + 2. Let q(x) = -5x - 5. Let n(j) = -11j - 11. Let w(i) = -4n(i) + 9q(i). Let d(a) = -3. What is od(t) + 2w(t)? -2t + 1 Let d(f) = f*3 + 2f2 - f + 5. Let g(p) be the first derivative of p4/4 + p3 - p2/2 + 7p - 17. Determine 7d(y) - 5g(y). 2y3 - y2 - 2y Let s(h) = -3h - 2. Let w(k) = 16k + 7. Let x(n) = -n. Let o(l) = w(l) + 6x(l). Suppose -q + 8 = -2f, -3f - 22 = -5q + f. Determine qo(i) + 7s(i). -i Let a(g) = g - 5. Let n(f) = 2f - 4. Let l(j) = -3j - 2. Let w be l(0). Calculate wa(t) + 3n(t). 4t - 2 Let f(h) = -7h - 1. Let k(i) = -8i - 1. Give 6f(r) - 5k(r). -2r - 1 Let a(w) = -3w - 28. Let g be a(-10). Let t = 1 - 1. Let b(y) = ty + 0y - y + 1. Let r(x) = x*3 + 7x - 7. Give gr(o) + 14b(o). 2o3 Let l(j) = -4j + 2 - 3j + 5j. Let a(q) = 10q - 10. What is -3a(o) - 16l(o)? 2o - 2 Let o(z) = 4z + 4. Let x = -2 + 3. Suppose -x = -5p + 19. Let d(u) = -4 - 2 - 3u + 3. Determine po(m) + 5d(m). m + 1 Let i(q) = -q. Let s be i(2). Let u(a) = -10a*3 + 3a*2 - 10. Let w(m) = -3m3 + m2 - 3. Let o = 25 - 41. Let g = o + 23. Determine gw(j) + su(j). -j3 + j2 - 1 Let u(a) = 10a + 14. Let q(j) = -2j - 3. Let k(m) = 11q(m) + 2u(m). Suppose 3r - 5 = 5y, -4r + 2y - 3 = 9. Let t(p) = -p - 3. Give rk(s) + 8t(s). 2s + 1 Let q(l) = 7l - 2. Let d(o) = o3 + o2 + o - 2. Let n be d(0). Let w(g) = -3g + 1. What is nq(v) - 5w(v)? v - 1 Let h(j) be the second derivative of j3/3 - 7j. Let g(a) = 2a. Calculate 6g(k) - 4h(k). 4k Let i(v) = -8v2 + 8v - 8. Let p(b) = 7b2 - 7b + 7. Give 5i(c) + 6p(c). 2c2 - 2c + 2 Let z(h) = 8h3 + 2h. Let n(i) = i*3 - i. Calculate 2n(j) + z(j). 10j3 Let b(i) = 63i*3. Let l(u) = -253u*3. Determine -9b(g) - 2l(g). -61g*3 Let u(g) = 3g*2 + 4g + 4. Let j(x) = -3x2 - 3x - 3. Let q(a) = a*2 + 3a + 4. Let z be q(0). What is zj(y) + 3u(y)? -3y2 Let w(x) = -x + 1. Let l(h) = -h3 - 3h + 1. Let d(j) = -l(j) + 2w(j). Let o(t) = -3t*3 - 4t - 1. Determine -4d(y) - o(y). -y3 - 3 Let b(q) = -29q. Let c(l) = 58l. Calculate 13b(k) + 6c(k). -29k Let a(d) = -5d2 - 3. Suppose 6m - 3m = -2k + 14, 0 = 5k - m - 52. Let w(c) be the first derivative of 16c*3/3 + 10c + 1. Calculate ka(x) + 3w(x). -2x2 Let a(u) = 4u - 2. Let m(r) be the third derivative of -r*4/24 + 6r*2 - 2. Suppose 3q - 13 - 2 = 0. What is qm(d) + a(d)? -d - 2 Let g(d) = 11d + 1. Let b(m) = -44m - 5. Give -2b(t) - 9g(t). -11t + 1 Let c(t) = 6t - 6. Let h(a) = 6a - 5. Give -3c(i) + 4h(i). 6i - 2 Let u(g) be the first derivative of 5g*2/2 + 11g + 1. Suppose 0 = 5f - 2z - 9, 3z - 9 = -f + z. Let d(i) = -2i - 5. Calculate fu(h) + 7d(h). h - 2 Let n(d) = -26d2 - 5d - 4. Let b(s) = s*2 + s + 1. What is 4b(u) + n(u)? -22u2 - u Let q(m) = m2 + 7m + 6. Let c be q(-6). Suppose 10t - 5t - 5 = c. Let r(x) = -x2 - 1. Let u(a) = a3 - 2a2 - 2. What is tu(l) - 2r(l)? l3 Let k(q) = -q2 - q + 1. Let p(g) = -4g*2 - 3g + 3. Give 3k(d) - p(d). d2 Let i(c) be the third derivative of c6/15 + 7c4/24 + c3/2 - 31c2. Let h(b) = 15b*3 + 13b + 5. Give -6h(m) + 11i(m). -2m*3 - m + 3 Let c(w) =	{ "pile_set_name": "DM Mathematics" }
multiple of q and 72. 360 Suppose -5k - 4 = 4o, k = 3o + 15 + 7. Calculate the common denominator of 32/9 and (o/(-20))/((-36)/1070). 36 Suppose -3n + 8n - 35 = 0. What is the smallest common multiple of n and 9/12(-2 - -6)? 21 Let n = 8353883/420 + -19890. What is the common denominator of -79/15 and n? 420 Let w = -5096 - -81495/16. Let m = 279061 + -2514275/9. Let y = 22681/72 + m. What is the common denominator of y and w? 16 Let l = 22 + -12. Suppose 0 = 2y + 7 - 9. Let d(s) = s + 1. What is the smallest common multiple of l and d(y)? 10 Let c = 19 + -15. Suppose -h + 15 = 2j, 0 = -5j + h + ch + 75. Let m = -26 - -28. Calculate the least common multiple of j and m. 10 Suppose 5l + a = -2, 3l - 7l = 4a + 8. Suppose -4g + 7g - 15 = l. Calculate the lowest common multiple of g and (-3 - -1) + -1 - -9. 30 Let n = -7770803/165 - -47096. Calculate the common denominator of n and 71/20. 660 Find the common denominator of -6 - (90/(-288))/(6/86) and 37/54. 432 Suppose -3o - 12836 = -7o. Let n = 35273/11 - o. Find the common denominator of n and (-22 - 21)(12/(-10) + 1). 55 What is the common denominator of (22/60)/(318/(-567)) and 67/80? 80 Calculate the smallest common multiple of 78 and (1/(-2))/(2 + 579/(-288)). 624 Suppose -13 = -2f - 13. Suppose f = -2h - 58 + 78. Calculate the smallest common multiple of h and 32. 160 Suppose g - 52 = -5i, -3i - 9g + 5g = -21. Calculate the least common multiple of 34 and i. 374 Let q = 63073/12960 - 1/12960. Calculate the common denominator of q and 22/507. 2535 Let f = -563897/56 - -10069. Find the common denominator of -113/40 and f. 280 Let j = -1970/1519 - -75/31. What is the common denominator of j and 21/16? 784 Let f = 1 - -3. Suppose -52 = -6a + 92. Suppose 0 = h + 3h - a. Calculate the least common multiple of h and f. 12 Let u(m) = -m*2 + 3m + 1. Let l be u(3). Let t(n) = 11n2 - 1. Calculate the least common multiple of t(l) and 20. 20 Suppose 0 = -3p + 5g + 28, -3p = 4g - g - 36. Let f = 6 + -4. What is the lowest common multiple of f and p? 22 Let j be (-117)/206 + (-1)/2. Let f = j + -5307/721. Calculate the common denominator of (-4)/(-6) + 75/144 and f. 112 Let r be -1 + 9/11 - 598/(-143). Suppose -5n = -4j + 5j - 191, 0 = 4n + rj - 140. What is the smallest common multiple of 4 and n? 156 What is the common denominator of 35/48 and 1065/(-198) - (-4 - 3)? 528 Let w = 34736 - 2188421/63. Find the common denominator of w and -25/161. 1449 Let t = 34 - 33. Let h(x) = -2x + 35. What is the lowest common multiple of t and h(16)? 3 Let q = -71 + 78. What is the least common multiple of q and 287? 287 Let w = 1/3982 + 120454/5973. What is the common denominator of 161/30 and w? 30 Let v = -3 - -4. Let m(q) = -2q - 1 + 0q + 4 - v. What is the least common multiple of 8 and m(0)? 8 Suppose -54 = -4v - 14. Calculate the lowest common multiple of v and 12. 60 Find the common denominator of -95/6 and (-447)/42 - 3-1. 42 Let r = -11 - -13. Suppose 3g = x + 6g + 3, 5g + 3 = -rx. Suppose 0 = -6b + 9b - x. Calculate the smallest common multiple of 6 and b. 6 Suppose 0m - 3 = -3m. Calculate the common denominator of m - (0 + 5) - 8 and 41/12. 12 Suppose 5b = o + 9, -3o - 6 + 9 = 0. What is the lowest common multiple of b and 18? 18 Let r = -19345459/212 - -91252. Find the common denominator of -91/18 and r. 1908 Let d = -140 + 145. Suppose -dg + 5m + 135 = -0g, g = -5m - 3. What is the lowest common multiple of 12/(-5)(-20)/6 and g? 88 Suppose -t = -2 - 9. Suppose x - 15 = -t. What is the lowest common multiple of x and 18? 36 Find the common denominator of -17/30 and (-6)/(-8) - ((-355)/(-150) + 1). 60 Let v = 2197871/236 + -9313. What is the common denominator of v and -63/44? 2596 Let a = -191 - -217. Let q be (-430)/(-6) + 1/3. Let x = q - a. Calculate the smallest common multiple of x and 12. 276 Let u = -501535612/765 + 655602. What is the common denominator of -109/30 and u? 1530 Let y = 38462 + -2961524/77. What is the common denominator of 29/42 and y? 462 Calculate the common denominator of 81/16 and 11 - (-33)/(-3) - 43/(-22). 176 Let t be ((-2)/(-3))/(6/279). Let y = 35 - t. What is the least common multiple of y and 98? 196 Suppose -2b + y - 6y = 1, 4y = 4b - 12. Suppose -2g = ba - 6g - 16, -2a - 4 = g. Find the common denominator of 126/40 + 0 + a and -59/4. 20 Let h(q) = q*2 - 11q + 38. Let x(k) = k*3 - 13k*2 - k + 19. Let a be x(13). Calculate the lowest common multiple of 3 and h(a). 24 Let u be (-1)/3 + (-436373)/210. Let n = 2076 + u. Find the common denominator of n and 44/3. 30 What is the common denominator of 222/(-88) - (-13 + 3 + 7) and 25/472? 5192 Let g = -2 - -16. Suppose 2n + 5o = 4 + 10, 0 = 2n - 2o. Calculate the least common multiple of g and n. 14 Let d(h) = 2h*2 - 97h - 262. What is the smallest common multiple of d(52) and 24? 408 Let g(v) = -v*3 + 7v*2 - 2v + 17. Let a be g(7). Suppose 0p + 2z = -p + 24, 2p - 41 = az. Calculate the lowest common multiple of 315/99 - 4/p and 3. 3 Let g be 32/3 - 34. Let v = g + 16. Let s = v + 23. Calculate the lowest common multiple of s and 4. 28 Let h be (-18)/(-36) + (-7)/(-2). Suppose 2m = hl - 6, 4m - 1 = l + 1. What is the least common multiple of 6 and l? 6 Let s be -5378 + 2 - (2 - 5). Let b = s - -429851/80. What is the common denominator of b and 83/10? 80 Let c = 2 - -13. Let u = c - 5. Calculate the least common multiple of 24 and u. 120 Let f = 943 - 2107. Let z = 5791/5 + f. What is the common denominator of 2/3 + (-347)/30 and z? 10 What is the smallest common multiple of (26 - -267)/(1/22) and 6? 1758 Let j = 19270/7 + -1039537/378. Calculate the common denominator of 29/(-4)15/(-10) and j. 216 Let h = 75949/149055 + -2/2615. What is the common denominator of h and -52/15? 285 Let o = -143/21 - -82/35. Calculate the common denominator of o and -17/15. 15 Let a = 30 + -23. Suppose 60 = -3s + as. What is the lowest common multiple of s and 6? 30 Let g = 12009/7 - 1722. Let l = 144/5 - 777/40. What is the common denominator of l and g? 56 Let i = -24 + 23. Let l = 17 + i. What is the lowest common multiple of 20 and l? 80 Let d = -36501/16 - -2280. Calculate the common denominator of d and -51/28. 112 Let x(w) = -2w2 + 7 - 1 + 0w2 - w + w2. Let f = 4 - 4. What is the least common multiple of x(f) and 3? 6 Let d = 0 - -4. Suppose 3u + 5c - 41 = -u, 0 = -dc + 20. Suppose -o + 2 = -2. Calculate the least common multiple of u and o. 4 Let r be 4181276/(-47064) - 1. Let g = r + -1/1961. Find the common denominator of (4/(-24))/((-4)/376) and g. 3 Let x(z) = 8z3 - 2z*2 - 2z - 3. Let o be x(-2). What is the common denominator of o/55/2 and ((-33)/72)/((-2)/6)? 8 Let c = -2/9691 - -678472/494241. Let l = -4105/204 + c. Find the common denominator of l and 1077/252 - 2/(-14). 12 Find the common denominator of 6/7 + (-3 - 16476/(-8512)) and -139/96. 1824 Let f = -37 + 118. What is the least common multiple of f and (39/117 + 2/(-3))-3? 81 Suppose 2n - 25 = -3n. Suppose -95 = -5z + 50. Suppose 3v + 2q = z, -2v - 2q = -17 - n. Calculate the least common multiple of v and 10. 70 Suppose -14 = -4i + 2a, 4a - 5 = -4i + 3a. Find the common denominator of ((-955)/(-240) + -4)/((-1)/3) and 0 + 180/(-232) + i. 464 Let d = -5244 + 8030. Let y = d + -80786/29. Let p = 239/290 + y. Find the common denominator of p and -33/14. 70 Suppose -5l - 2758 = -2k, 0 = -l + 3l + 4. Let m = -2495 + k. Let q = m - -8885/8. What is the common denominator of q and 9/56? 56 Let g = -8 + 34. Let x(t) = -3t + 3t2 - 4t*2 + 0t*2 + 2t*2 + 4. What is the smallest common multiple of x(5) and g? 182 Suppose -7l + 12l = -4600. Let i = -4557/5 - l. Calculate the common denominator of 95/8 and i. 40 What is the common denominator of 3/200 and 4/(-480)(-609)/14? 400 Suppose -3i = -d + 7 - 0, -2d = 5i + 8. Find the common denominator of (i/80)/((-18)/(-54)) and 71/2. 40 Calculate the common denominator of -144 + 142 - (170/24)/1 and -29/148. 444 Let q be 1 - (-723)/3068/14. Let x = q + -2/119. Find the common denominator of x and (-6)/2170/36. 6 Let z(t) = 4t3 + t2 + 2*t - 1. Let c be z(-2). Let u = c - -46. Calculate	{ "pile_set_name": "DM Mathematics" }
thout replacement from bbcbzbkzzc. Give prob of sequence ck. 1/45 Three letters picked without replacement from {a: 3, k: 3, m: 6, h: 2, b: 1}. Give prob of sequence kba. 3/910 Three letters picked without replacement from {i: 3, l: 4}. What is prob of sequence lll? 4/35 What is prob of sequence mmee when four letters picked without replacement from {y: 4, u: 2, m: 12, e: 2}? 11/4845 What is prob of sequence rw when two letters picked without replacement from {j: 1, r: 2, o: 4, w: 1, e: 4, c: 8}? 1/190 What is prob of sequence qqx when three letters picked without replacement from xxxxxxxxqq? 1/45 Three letters picked without replacement from {o: 3, g: 12}. What is prob of sequence ooo? 1/455 What is prob of sequence cccc when four letters picked without replacement from {c: 11, a: 3}? 30/91 Two letters picked without replacement from hdgddxglhgdhxlhgxhg. Give prob of sequence hg. 25/342 Two letters picked without replacement from {p: 3, s: 4, n: 1, u: 2, o: 1}. What is prob of sequence np? 3/110 Three letters picked without replacement from pekiepeepp. Give prob of sequence eke. 1/60 Two letters picked without replacement from {s: 2, v: 3, l: 7, i: 7}. What is prob of sequence lv? 7/114 What is prob of sequence jx when two letters picked without replacement from {r: 2, x: 1, j: 2, g: 9, a: 3, u: 1}? 1/153 What is prob of sequence pmm when three letters picked without replacement from {p: 2, m: 3}? 1/5 Calculate prob of sequence vv when two letters picked without replacement from {v: 5, r: 2, i: 2, d: 1, m: 8}. 10/153 Three letters picked without replacement from yyyyyyyydyyryyyrrydy. Give prob of sequence rdd. 1/1140 Calculate prob of sequence vuv when three letters picked without replacement from {z: 4, v: 3, j: 4, l: 1, o: 3, u: 2}. 1/340 Calculate prob of sequence kv when two letters picked without replacement from qjjvjjjkjjkkjjj. 1/70 What is prob of sequence eie when three letters picked without replacement from {e: 2, i: 1, a: 1}? 1/12 Two letters picked without replacement from {z: 6, i: 4, c: 7}. What is prob of sequence zi? 3/34 Two letters picked without replacement from {y: 3, t: 6, q: 3, h: 3}. Give prob of sequence tt. 1/7 Three letters picked without replacement from {n: 3, k: 4, j: 2, o: 3, h: 2, b: 4}. Give prob of sequence bnh. 1/204 What is prob of sequence ust when three letters picked without replacement from {u: 1, a: 2, t: 1, s: 1}? 1/60 What is prob of sequence rrsz when four letters picked without replacement from {r: 2, s: 7, z: 2}? 7/1980 Two letters picked without replacement from utrutzwtcuz. Give prob of sequence zz. 1/55 Four letters picked without replacement from {c: 2, p: 2, z: 3, w: 3, g: 10}. What is prob of sequence wpzp? 1/6460 Calculate prob of sequence uxe when three letters picked without replacement from uekxeuxexxxxkxxxxxxx. 13/1140 What is prob of sequence iii when three letters picked without replacement from {h: 4, i: 3}? 1/35 Calculate prob of sequence wck when three letters picked without replacement from {h: 8, a: 3, w: 1, f: 4, c: 2, k: 2}. 1/1710 What is prob of sequence ii when two letters picked without replacement from {j: 8, i: 3}? 3/55 Calculate prob of sequence jyjy when four letters picked without replacement from nqjqyyjnyqyqjyq. 1/273 What is prob of sequence qgg when three letters picked without replacement from gwgggwggqwwgg? 14/429 What is prob of sequence spsp when four letters picked without replacement from ppsps? 1/10 Two letters picked without replacement from {j: 1, b: 1, t: 3, s: 1, o: 1}. What is prob of sequence to? 1/14 Three letters picked without replacement from {j: 1, g: 4, l: 1, z: 3, r: 6, o: 5}. What is prob of sequence rgr? 1/57 What is prob of sequence gb when two letters picked without replacement from {u: 2, b: 6, l: 1, v: 1, g: 3}? 3/26 Three letters picked without replacement from {p: 8, l: 5}. What is prob of sequence pll? 40/429 Four letters picked without replacement from jnjj. Give prob of sequence jjnn. 0 Calculate prob of sequence fxx when three letters picked without replacement from {x: 1, w: 2, f: 3, r: 2, h: 9}. 0 Two letters picked without replacement from riuuiirurrirrririi. What is prob of sequence ur? 4/51 Three letters picked without replacement from www. Give prob of sequence www. 1 Calculate prob of sequence xgqx when four letters picked without replacement from {z: 4, x: 6, q: 1, l: 2, g: 2}. 1/546 What is prob of sequence xx when two letters picked without replacement from xxnxnsxnxn? 2/9 Three letters picked without replacement from emullmeulle. What is prob of sequence eml? 4/165 Calculate prob of sequence xys when three letters picked without replacement from rrrysszxyrsyysryrsy. 5/969 What is prob of sequence dd when two letters picked without replacement from {l: 5, s: 7, i: 1, d: 3}? 1/40 Three letters picked without replacement from {g: 14, o: 5, v: 1}. What is prob of sequence oov? 1/342 Two letters picked without replacement from {a: 2, h: 2, o: 1}. What is prob of sequence aa? 1/10 Four letters picked without replacement from {v: 4, z: 16}. Give prob of sequence vvzz. 8/323 Calculate prob of sequence mg when two letters picked without replacement from {t: 12, g: 2, m: 3, f: 3}. 3/190 Calculate prob of sequence bbb when three letters picked without replacement from {b: 9, u: 11}. 7/95 Two letters picked without replacement from {s: 1, w: 2, u: 1, m: 2, e: 1, i: 1}. Give prob of sequence mw. 1/14 What is prob of sequence ll when two letters picked without replacement from {u: 2, a: 1, l: 2}? 1/10 Calculate prob of sequence een when three letters picked without replacement from ofeownooeeeefewf. 1/112 Two letters picked without replacement from {k: 4, j: 7, h: 4}. What is prob of sequence jh? 2/15 Two letters picked without replacement from {i: 4, x: 6, a: 7}. Give prob of sequence ax. 21/136 Three letters picked without replacement from lmzmzlzzzzmzmllzzzkl. What is prob of sequence kml? 1/342 Two letters picked without replacement from {h: 2, e: 3}. Give prob of sequence eh. 3/10 Calculate prob of sequence cc when two letters picked without replacement from {c: 3, p: 2, v: 3}. 3/28 What is prob of sequence bue when three letters picked without replacement from {e: 2, b: 2, a: 1, u: 8, s: 1}? 4/273 What is prob of sequence vi when two letters picked without replacement from {v: 4, d: 2, i: 4, h: 5}? 8/105 Two letters picked without replacement from zyfywyfyyyfz. What is prob of sequence yf? 3/22 What is prob of sequence mtxl when four letters picked without replacement from llmttllltllllttllxl? 5/7752 Four letters picked without replacement from ffnreeesvrfv. What is prob of sequence vnrf? 1/990 What is prob of sequence cn when two letters picked without replacement from {x: 1, v: 2, n: 1, r: 1, c: 4}? 1/18 Four letters picked without replacement from {m: 2, t: 1, c: 7, z: 4, h: 1}. What is prob of sequence htcm? 1/2340 Two letters picked without replacement from {p: 1, z: 2, x: 2, r: 1, j: 1, a: 1}. Give prob of sequence zj. 1/28 Calculate prob of sequence ey when two letters picked without replacement from {r: 1, k: 2, m: 1, w: 6, e: 2, y: 3}. 1/35 Three letters picked without replacement from qgguqgugqgu. What is prob of sequence gqu? 1/22 What is prob of sequence rrww when four letters picked without replacement from {p: 3, r: 4, j: 7, z: 1, w: 3}? 1/1020 What is prob of sequence el when two letters picked without replacement from {w: 7, e: 2, l: 2}? 2/55 Four letters picked without replacement from {h: 3, q: 2, x: 1, y: 1}. What is prob of sequence xhhh? 1/140 What is prob of sequence zd when two letters picked without replacement from ddassddzaddnsa? 3/91 Two letters picked without replacement from {b: 1, m: 4, g: 2, i: 2, e: 1, q: 4}. What is prob of sequence mb? 2/91 Calculate prob of sequence al when two letters picked without replacement from wiwllllaalwaalw. 4/35 Four letters picked without replacement from {d: 4, h: 6, k: 1, r: 2, v: 2}. Give prob of sequence rrdh. 2/1365 Calculate prob of sequence hnwh when four letters picked without replacement from nhhnwhnhhhwwh. 63/2860 Three letters picked without replacement from dkkokzkzkkzotkkotk. Give prob of sequence zko. 9/544 What is prob of sequence iap when three let	{ "pile_set_name": "DM Mathematics" }
. Let c = 7 + x. What is the units digit of c? 7 Let l(z) = 9z2 - 17z - 157. What is the tens digit of l(-8)? 5 Let w = -720 + 1120. What is the hundreds digit of w? 4 Suppose 3999 = 8c - 3049. What is the tens digit of c? 8 Let q(a) = -299a + 361. What is the tens digit of q(-6)? 5 Let y = 1457 - 842. What is the units digit of y? 5 Let k(g) = g*3 - 6g*2 + 5g - 4. Let v(n) = 4n2 + 1. Let o be v(1). Let y be k(o). Let u(i) = -10i + 12. What is the tens digit of u(y)? 5 Let h be (-1 - 2/(-6))3 + -61. Let b = -33 - h. What is the tens digit of b? 3 Let h be 0/2 + (-2 - -6). Suppose 6a - ha - 190 = 4i, -20 = 5i. What is the tens digit of a? 8 Let a(p) = p2 - 6p - 2. Let l be a(-6). Suppose -x = 4x - l. What is the tens digit of x? 1 Let c be 0 + 7 - (-3 + 6). Let j be (-2)/c + 6/(-4). What is the units digit of (-1 + 2)/(j/(-10))? 5 What is the hundreds digit of (-22510)/(-8) - (-2 + (-176)/(-64))? 8 Suppose -7r = -4200 - 2814. What is the units digit of r? 2 Suppose 1 = -3x + 2x - 3s, 13 = 5x - 3s. Suppose xk - 4d - 7 = 27, 0 = -4k - 5d + 120. What is the tens digit of k? 2 Let x(w) = -w + 17. Let y be x(14). Suppose 0 = -4a - 2k + 154, 0 = -4a + 8k - yk + 189. What is the units digit of a? 1 Let q be -2(1 - -4)/(-5). Let i(s) = 6s*2 - 4s + 5. What is the units digit of i(q)? 1 Let v = 767 - 607. What is the units digit of v? 0 Suppose 464k - 484k = -19620. What is the hundreds digit of k? 9 Let b(a) = 11a2 + 17a - 11. What is the hundreds digit of b(-11)? 1 Suppose -21b + 6267 + 4989 = 0. What is the hundreds digit of b? 5 Suppose -4g + 3l + 400 = -2l, -4g - l = -424. What is the tens digit of (1 + g)(-3)/(-2)? 5 Let z(i) = -2i3 - 12i*2 - 4i*3 + 29i*2 + 9i + 9 + 5i3. What is the tens digit of z(17)? 6 Suppose 4p + 5f + 7 = 3, p + f + 1 = 0. Let r be 116 - 2 - 2/p. Suppose 0 = 3y - r - 1. What is the tens digit of y? 3 What is the tens digit of (-36)/(-48)-26100/(-3)? 5 Let o = -13 - -10. Let p be (-2)/4(-7 - o). Suppose -pt + 5z = -42 - 15, -2z = 10. What is the units digit of t? 6 Suppose -l = -2c + 23 + 7, -5l - 59 = -3c. Suppose -2d + c = -63. What is the tens digit of d? 3 Let r = -12 + 157. Suppose r = -106t + 111t. What is the units digit of t? 9 Suppose 5o - 18 = -k + 12, 0 = 5o - 5k - 60. Let p(i) = 2i - 16. Let z be p(o). What is the units digit of (14/4-4)/z? 7 Suppose 6p + 5660 = 10p. Suppose 15w - p = 730. What is the tens digit of w? 4 Let v(b) = -b - 1. Let y be v(-4). Suppose -84 = -2f + f + 4g, 119 = f + yg. Suppose 260 = 6a + f. What is the units digit of a? 6 Let w(l) = 4l + 22. Let a be w(-8). Let t(k) = k2 - 3k + 14. What is the units digit of t(a)? 4 Let f = -56 - -32. Let b = f - -35. What is the units digit of b? 1 Suppose -2b - 2b + 8 = 0. Suppose 3q - 4 = -5l + b, 4l = -3q + 6. Suppose -qt + 30 = -0t. What is the tens digit of t? 1 Let o(q) = 7q3 + q2 + q + 4. Let t be o(-2). Let b = 82 + t. What is the tens digit of b? 3 Let c(r) = -9 - 12r - 43r2 + 47r*2 + 10. What is the tens digit of c(7)? 1 Let f(p) = 31p*2 + 8p - 1. What is the hundreds digit of f(-3)? 2 Suppose -3w - 5d - 2 = 0, -5w - 2d - d = -2. What is the tens digit of 5445/81 - ((-4)/(-18))/w? 6 Suppose -o = -3c + 1, 4o + 8c = 4c + 12. Let m(y) = -6 - oy - y - 1 - 2. What is the units digit of m(-4)? 3 Let n be 4/(-14) - 191/(-7). Suppose l + 2s = -0s + 15, n = l + 5s. What is the units digit of l? 7 Let q(z) be the first derivative of 5z2 - 13z - 5. What is the tens digit of q(8)? 6 Let n = 138 - -290. What is the tens digit of n? 2 Let c = 248 + -436. What is the tens digit of (c/(-6))/((-6)/(-9))? 4 Let s be (12/(-4) - -22)3. Let y = s - 39. What is the units digit of y? 8 Let m(q) = -q3 - 7q*2 - 27. Let p be m(-8). Let y = 57 + p. What is the tens digit of y? 9 Suppose 774 = -4l - 2l. What is the units digit of l(-3)/2731? 3 Let s = -225 - -99. Let u = s - -86. Let f = u + 89. What is the units digit of f? 9 Suppose -2a + 65 = 11. Let d = a + -4. What is the units digit of d? 3 Let x = 310 - -252. What is the hundreds digit of x? 5 Suppose 2q = -5b + 1966, -3b + 3q + 685 + 503 = 0. What is the tens digit of b? 9 Let q(t) = -t3 - 12t*2 - 20t - 8. Let j be q(-10). What is the hundreds digit of j/14 - (11472/14)/(-6)? 1 Suppose -b = 5u + 42, 0u = -4u - 2b - 36. Let k(z) = -z + 16. What is the units digit of k(u)? 4 Let c = -1947 - -4045. What is the thousands digit of c? 2 Let l = 62 - 34. Suppose 4n - 4y - l = 0, -2n + 22 - 5 = -3y. Suppose 4q = nt - 96, -5q - 54 = -3t + t. What is the units digit of t? 2 Let b be -4 - (-6 + 4 + 74/(-2)). Suppose 0 = t - 1 - b. What is the tens digit of t? 3 Suppose -38m = -16m - 92466. What is the tens digit of m? 0 Let q be (14/(-35))/(-3 + (-58)/(-20)). Suppose 0 = 5j - qj - y - 175, -j + 3y = -185. What is the hundreds digit of j? 1 Suppose 0 = -v + 3m + 1197, -43v + 45v - m = 2379. What is the hundreds digit of v? 1 What is the tens digit of (-3 - 4/1) + 630? 2 Let r(x) = -x*3 - 11x*2 - x - 5. Let a(h) = 2h*2 + 10h - 12. Let d be a(-8). Suppose 5c + d = -19. What is the units digit of r(c)? 6 Let x = 1040 + -32. What is the thousands digit of x? 1 Let u be 16/3 - (-8)/(-24). Let i be 2/u + (-4)/10. What is the units digit of (i - -1)/(2/14)? 7 Let s(a) be the first derivative of a4/4 - 4a*3/3 - 3a2 + a - 2. Let k be s(5). Let j(v) = v3 + 5v2 + 3v + 3. What is the units digit of j(k)? 7 What is the tens digit of 6/(-9) - (-4 + 6047/(-3))? 1 Suppose -3t = 6, -3t - 965 - 763 = -2g. What is the units digit of g? 1 Let d = 2069 - 256. What is the hundreds digit of d? 8 Let c(x) be the third derivative of 0x*4 + 3/2x*3 - 1/120x*6 + 2x*2 + 0 + 0x + 1/4x5. What is the units digit of c(15)? 9 Suppose -5x = h - 6952, -1635 = -3x - 5h + 2523. What is the tens digit of x? 9 What is the hundreds digit of 43 - -1166 - (0 - 7)? 2 Suppose -994 = -14i + 23562. What is the hundreds digit of i? 7 Suppose -2q - 2 = 2u, -19 = 3q - 3u + 8. Let v be 0 + (-2 - q) - 1. Let y(h) = 12h*2 + h - 1. What is the units digit of y(v)? 9 Let r(h) = 858h*2 + 7h + 7. What is the tens digit of r(-1)? 5 Let v be (-1)/3(-38 + -4)/(-1). Let z = -37 - -54. Let a = v + z. What is the units digit of a? 3 Let d(r) = -84r3 - r2 - 8r - 10. What is the units digit of d(-2)? 4 Let n = 663 - 433. What is the units digit of n? 0 Let x(s) = -48s*3 + s + 1. Let a be x(-1). Let j be (1 - -1)/(32/a). Suppose c = -5d + 37, 0 = -jc - d - 0d + 153. What is the units digit of c? 2 Let w = -9 + -3. Suppose 14k - 238 - 56 = 0. Let f = w + k. What is the units digit of f? 9 Suppose -4l - 14 + 66 = 0. What is the units digit of l? 3 Suppose 3b + 68 - 443 = -3l, 4b - 140 = -l. What is the tens digit of l? 2 Let i(z) = z2 + 11z + 26. Let y be i(-6). What is the hundreds digit of (25)/(y/(-40))? 1 Suppose 26 + 4 = 5a. Let t(y) = -5y + y3 + 4y*3 - 4 - 4y*3 - 3y*2. What is the units digit of t(a)? 4 Let v(q) = -6q*2 - 5q*2 + 21q - 6 + 14q2. What is the units digit of v(-9)? 8 Suppose -3y + 4y = -4z - 12, -5z - 2y = 15. What is the hundreds digit of z + 0 + (-1 - -256)? 1 Let p be -1 - -50 - (-2 - -2). Let f = -21 + p. What is the tens digit of f? 2 Suppose 14g - 6108 = 2g. What is the tens digit of g? 0 Let j(n) = 4n*2 - 4n + 2n2 + 3 - n - 3n*2. Let d be j(3). What is the tens digit of 6/d + 416/10? 4 Let r be (25/(-10) + 4)2. What is the units digit of r(-111)/9-1? 7 Suppose -2s - 2n + 181 = -119, -2n - 153 = -s. What is the tens digit of 4/4s/1? 5 Let m = 2 + 3. Suppose -2t = -mv - 1, 0 = -2t - 2v + 6v + 2. Suppose r - to = 14, -r - 4o = -0o + 7. What is the units digit of r? 5 Let y = 4 + -16. What is the tens digit of 408/y-3? 8 Let i(o) = -o*2 + o. Let s(y) = -7y*2 - 6y - 1. Let q(d) = -3i(d) - s(d). Suppose z = 3z + 4. What is the tens digit of q(z)? 3 Let c(p) = -7p + 10. Let f be c(1). Suppose -5x + 285 = 2d, -d - x + 579 = fd. What is the hundreds digit of d? 1 Suppose 0 = 4h + 5v - 2, -h - 5 + 16 = -4v. Let c = 70 + -65. Suppose -cr + 2t + 77 = 5, hr - 44 = 2*t.	{ "pile_set_name": "DM Mathematics" }
7v - 18. Determine 4f(w) + 7x(w). -8w*3 - 11w*2 - 2 Let x = 15 - 25. Let u(f) = -3f. Let t(o) = 2o. Let w(v) = 150v*2 - 157v*2 - 3v - 4 + 2. Let a be w(-1). What is au(r) + xt(r)? -2r Let y(u) = -19 + 42 - 22 - u. Let m(w) = -3w + 4. Give 5m(k) - 20y(k). 5k Let b(m) = 8m*3 + 5m*2 - 15. Let f(q) = 8q*3 + 5q*2 - 12. Let l(y) = 4b(y) - 5f(y). Let x(g) = 4g*3 + 2g*2. Calculate 2l(a) + 5x(a). 4a*3 Let k(t) = -20t*2 + 2t + 7. Let y(m) = -13m2 + m + 5. Determine -5k(g) + 7y(g). 9g*2 - 3g Let o(q) = -3q - 7. Suppose -4n - 4 = -5z + 2, 0 = 4n - 3z + 10. Let t(h) = -h - 1. Give nt(g) + o(g). g - 3 Let r(a) = -29a - 24. Let d(z) = -41z - 35. Calculate 5d(v) - 7r(v). -2v - 7 Let l(x) = -4x*2 - 2x - 2. Let q be ((-2)/(-5))/(7/35). Suppose 2i = b - 5, -5i - qb - 8 = -0i. Let f(w) = w + 1. Determine if(c) - l(c). 4c*2 Let h(g) = -6g + 9. Let w(v) = v - 1. Suppose 0n = -n + 7n. Suppose n = k - 3p + 21, 4k + p + 0p + 32 = 0. Calculate kw(t) - h(t). -3t Let q(t) = -3t*2 + 2t + 13. Let a(x) = 9x2 - 6x - 41. What is -2a(m) - 7q(m)? 3m2 - 2m - 9 Let b(l) be the second derivative of 15l3/2 + 5l. Let a(n) = 5n. Calculate -55a(c) + 6b(c). -5c Let h(x) = x. Let r(k) = 25k - 106k + 24k + 31k + 32k. Determine 2h(y) + r(y). 8y Let v(m) = -166753m. Let t(d) = -579d. Determine -577t(r) + 2v(r). 577r Let h(g) = -g3 + g2 - 2. Let b(l) = l*3 + 9l*2 + 5. Let i be b(-9). Let y = -3 + i. Let k(s) = 1 + 0 - 2s*2 + 2sy - s2. Give h(c) + k(c). -c*3 - 1 Let a = -8010 + 8009. Let c(y) = -3y. Let p(u) = 3u. Let m(s) = -s. Let d(i) = 7m(i) + 2p(i). Give ac(z) + 6d(z). -3z Let h(o) = -91o - 16. Let m(a) = -46a - 7. Give 2h(u) - 5m(u). 48u + 3 Let j(m) = 25m*3 - 13m*2 + 13m - 1. Let u(o) = -6o3 + 3o*2 - 3o. What is 2j(f) + 9u(f)? -4f3 + f2 - f - 2 Let w(y) = y3 - y2 - 1. Let t(z) = 24z*3 - 32z*2 - 32. Let f be 4/12 - 36/27. Determine ft(i) + 32w(i). 8i*3 Let y(a) = 362a + 6. Let s(w) = 182w + 3. What is 11s(p) - 6y(p)? -170p - 3 Let f(w) = 10w - 3. Let z be f(2). Suppose 12d = 2d + 170. Let u(k) = k + dk*2 - z - k - 5k. Let m(b) = 6b2 - 2b - 6. What is 11m(x) - 4u(x)? -2x2 - 2x + 2 Let s = 95 - 92. Let f(a) = s - 2 - 6 + 3 + 4a2. Let u(m) = -1. Give f(j) - 2u(j). 4j2 Let t(s) = -96s*2 + 7s + 6. Let a(u) = 95u2 - 4u - 4. What is 3a(y) + 2t(y)? 93y2 + 2y Let a(b) = 5b2 - 2b - 5. Let h(m) be the first derivative of 5m3/3 - m2 - 6m - 37. What is 7a(u) - 6h(u)? 5u2 - 2u + 1 Let w(k) = -21k3 + 4k*2 - 11k + 38. Let c(b) = -10b3 + 2b*2 - 5b + 18. Determine -13c(i) + 6w(i). 4i3 - 2i2 - i - 6 Let a(b) = -b2 - 2b - 1. Let x(k) = k2 + 3k + 1. Determine -5a(l) - 6x(l). -l*2 - 8l - 1 Let g = -691 + 696. Let w(k) = 2k2 - 13k + 9. Let r(d) = 3d2 - 20d + 14. What is gr(h) - 8w(h)? -h*2 + 4h - 2 Let y(l) = 5l + 2l + 7l2 + 4 + 2l - 5l. Let w be 14/(-4) + -11/2. Let n(t) = 8 + 25t2 + 32t*2 + 33t + 25. Calculate wn(a) + 33y(a). 3a2 Suppose 2u - 30 = -4o, 6 = -o + 2u + 2u. Let b(p) = p2 - 7p - 1. Let x(i) = -11 + 1 + 5i2 - 6i - 4i2 + 9. Calculate ob(d) - 7x(d). -d2 + 1 Let v(q) = 19q + 7. Let k(f) = -16f - 8. Calculate -6k(u) - 5v(u). u + 13 Let u(n) = -n2 - 3n. Let v = 3 - 6. Let i(b) = -b - 12. Let w(a) = -2a - 20. Let l(r) = -5i(r) + 3w(r). Determine vl(f) + u(f). -f*2 Let c(d) = 4d + 6. Let g(z) be the third derivative of -z*4/8 - 2z*3/3 + 11z*2 + 1. Determine 5c(o) + 7g(o). -o + 2 Let o(p) = 6p + 5. Let t be 4/10 + 216/60. Suppose 0 = td - 0 - 20. Let a(g) = 5g + 4. Calculate da(v) - 4o(v). v Let b(g) = 2g. Let n(y) = -2y*2 - 73y - 175. Let t be n(-34). Let u(f) = 7f. Give tu(a) + 21b(a). 7a Let j(z) = 9z2 - 21z. Let p(s) = -s*2 + 2s. Let f = -38 + 47. Let v be (16/(-12))/(6/f). Let r(m) = 21m. Let g be r(-1). Calculate gp(o) + vj(o). 3o*2 Let x(m) = -2m*2 - 3m + 1. Let p(i) = 2i2 + 2i - 1. Let q be 2 - (4 + (-3 - -3)). Let r(g) = -5g - 6. Let a be r(q). Give ax(z) + 5p(z). 2z*2 - 2z - 1 Let d(g) = -g*3 - 2g*2. Suppose 12v = -26v + 76. Let p(j) = 6j*3 + 11j*2 + j. What is vp(h) + 11d(h)? h3 + 2h Let d(r) = r3 - r2. Let a(u) = 13u3 - 9u*2. Give a(y) - 6d(y). 7y3 - 3y*2 Suppose -3v - 2q - 2 = 18, 3q = 5v + 27. Let w(g) = -g - 1. Let p(i) = 4i + 3. Let z(t) = t*3 - 8t - 5. Let u be z(3). What is up(d) + vw(d)? -2d Let g(o) = -7o*2 + 3o + 6. Let p(m) = 15m2 - 7m - 13. Let l(y) = -y*2 - 13y - 18. Let n be l(-12). Determine np(r) - 13g(r). r*2 + 3r Let y(v) = 2v3 + 11v*2 - 2v + 13. Suppose -67k - 66 = -78k. Let b(p) = p*3 + 5p*2 - p + 6. What is ky(l) - 13b(l)? -l3 + l2 + l Let b(z) = -42z - 9. Let j(x) = -44x - 10. Give -5b(i) + 4j(i). 34i + 5 Let s(z) = z2 + 3. Let u(k) be the second derivative of -k4/12 - k2 + k. Let a(i) = -i2 + 3i + 51. Let t be a(-6). What is tu(y) - 2s(y)? y2 Let n(j) = -j - 1. Suppose p + 3 - 2 = -y, -11 = -3y + 4p. Let m(d) = -5d - 1075. Let u(w) = w + 172. Let o(g) = 4m(g) + 25u(g). Determine yo(i) + 3n(i). 2i - 3 Let r(b) = 13b*3 + 333b*2. Let w(j) = 7j*3 + 166j*2. Calculate -6r(k) + 11w(k). -k3 - 172k*2 Let t(v) = 8v*3 - 5v*2 + 5v + 29. Let u(h) = 4h3 - 2h*2 + 2h + 15. Give -2t(s) + 5u(s). 4s3 + 17 Let o(p) = -5p*3 - 11p*2 - 4. Let z = -28 - -31. Let c(m) = -19m*3 + 4m*z + 5m*3 - 1 - 2m*2 + 9m*3. Determine -11c(b) + 2o(b). b3 + 3 Let k(a) = -190a*2. Let w(b) = 7b*2. Suppose 24n - 39n + 1200 = 0. Calculate nw(l) + 3k(l). -10l*2 Let z(h) = 2h + 6. Let q be 2(-2)/45. Let o(k) = 0 - 8 + 1 - 3k. Determine qo(s) - 6z(s). 3s - 1 Let a be (1 + 9/(-15))(-105)/(-42). Let b(g) = g2. Let i(s) = -2s*2 + s. Determine ai(h) + 3b(h). h2 + h Let g(y) = y2 + 2y - 3. Let s(v) = -v*2 - 2v + 2. Let k = 517 + -513. Calculate ks(t) + 3g(t). -t*2 - 2t - 1 Let b(g) = 2g2 - 1. Let d be b(-1). Let m(k) = -3 + 1 + 1. Let w(i) be the first derivative of i2 + 6i - 8. Calculate dw(n) + 6m(n). 2n Let d(g) = -g2 + g. Suppose -2q = 10 - 2. Let w = q + 10. Let m(l) = 2l2 - 4l + 9l - wl*2. What is -5d(f) + m(f)? f*2 Let q(l) = 55775l*3 + 575l*2 + 575l. Let b(z) = 581z3 + 6z*2 + 6z. Determine 575b(y) - 6q(y). -575y3 Let k(o) = -1. Let j(u) be the third derivative of u5/60 + u4/8 - u3/2 + 10u*2. Let l(n) be the first derivative of j(n). Give -4k(t) - l(t). -2t + 1 Let r(d) = 6d*2 - 10d + 11. Let u(h) = 3h2 - 5h + 5. Calculate -4r(y) + 9u(y). 3y2 - 5y + 1 Let n be (16/20)/((-10)/25). Let r(b) = -35b. Let t(y) = -7y. Give nr(m) + 11t(m). -7m Let p(d) = 2d + 1. Let a(h) = -3h - 4. What is 3a(l) + 5p(l)? l - 7 Let r(w) = -5w - 47. Let s(n) = 66n + 618. What is -27r(u) - 2s(u)? 3u + 33 Let n(y) = 7y2 - y - 2. Let o(l) = -7l*2 + 2l + 1. Let c(z) = z*2 + z - 1. Let u(a) = -c(a) + o(a). Calculate 5n(k) + 4u(k). 3k*2 - k - 2 Let i(w) = 24w*2 - 11w - 11. Let p(z) = 12z2 - 6z - 6. Let u(d) = 2d2 + 14d + 11. Let k be u(-7). Calculate kp(g) - 6i(g). -12g2 Let m(n) = -n - 1. Let j be (1/2)/((-7)/(-56)). Let g(i) = -j + 8 + 0 - 4i - 7. What is g(r) - 3m(r)? -r Let l(t) = 3t + 5. Let f = 2248 - 2249. Let z(j) = -j - 1. Give fl(p) - 4z(p). p - 1 Let t(g) = -116g2 - 6g + 3. Let h(s) = -s*2 - 2s. Determine 3h(w) - t(w). 113w*2 - 3 Let c(r) = -233r*3 - 2r*2 + 4r - 4. Let m(t) = 467t3 + 3t*2 - 7t + 7. Give 7c(s) + 4m(s). 237s3 - 2s2 Let h(m) = -m2 + 3m. Let l(y) = 2278 + 24y*2 - 2278 - 68y. Give -136h(t) - 6l(t). -8t2 Let b(p) = 13p + 2. Let a(u) = -64u - 12. Give -2a(l) - 11b(l). -15l + 2 Let w(h) = 8h2 + 2. Let u(c) be the first derivative of 3c*3 + 3c - 295. Give -2u(a) + 3w(a). 6a2 Let o(v) = 3v*2 - 3v - 6. Let b(a) = -3a2 + 4a + 9. Let h(q) = -3b(q) - 4o(q). Let r(i) = 3i2 + 2. Calculate -2h(d) - 3r(d). -3d2 Let n(g) be the second derivative of -g4/12 + g3/6 - g2/2 - 6g - 1. Let k(f) = -6f**2 + f - 2. What is k(z) - 4	{ "pile_set_name": "DM Mathematics" }
the units digit of 4/10 + 790/25? 2 What is the tens digit of (4 + 93 + -4)(0 + 1)? 9 Let l(u) = -11u - 3. What is the units digit of l(-4)? 1 Suppose -3z = -4z + 25. What is the units digit of z? 5 Suppose m = -4n, 4n = -4m + 2n. Suppose m = 3w - 4w + 6. What is the units digit of 10/6 + 2/w? 2 What is the units digit of (1/3)/((-6)/(-36))? 2 Let r(c) = 2c2 + 4c - 2. Let u be r(3). Let d be (-8)/28 - 30/(-7). Suppose -dh - u = -3n - 2h, 3n = 3h + 27. What is the tens digit of n? 1 Suppose 0 = -3p - 3 + 9, -p = -2a - 2. Suppose i + i - 26 = a. What is the units digit of i? 3 Let h be (2/(-4))/((-1)/(-20)). Let z = -7 - h. Suppose -z = -3a + 15. What is the units digit of a? 6 Let z(w) = w*3 + 8w*2 + 4w + 8. What is the tens digit of z(-7)? 2 Suppose 2q - 19 = 3. Let h = q - -27. What is the units digit of h? 8 Let z = 4 + 33. Suppose 32 = 3j - z. What is the units digit of j? 3 Let d = -4 - -6. Suppose 5x - 35 = 3w, 3w - 1 = -dx - 2x. What is the units digit of x? 4 Let c = -13 + 34. What is the tens digit of c? 2 Let x(l) = -l2 - 3l - 1. Let z be x(-3). Let d(n) = -12n - 1. What is the tens digit of d(z)? 1 Let j(f) = -4f*3 - 4f*2 - 5f - 2. Let r(w) = -w*3 - w. Let v(s) = -j(s) + 5r(s). What is the units digit of v(4)? 2 Let p be (-622)/6 + (-2)/6. Suppose -2t + 3t - 5 = 0, -t - 7 = f. What is the units digit of p/f + (-4)/6? 8 Let m = 17 - 12. Suppose 0 = -mh + 3g + 163, -16 = -3g - g. Suppose 0 = -3z + 4 + h. What is the tens digit of z? 1 Let r(b) = -2b2 - b. Let z be r(-1). What is the units digit of (z - 0)/(10/(-10))? 1 Let l(k) = k - 5. Suppose 4b - 24 = -8. Suppose 4y - 6 = -3j, -j + by = 8 - 26. What is the units digit of l(j)? 1 Suppose -3i + 879 = 3n, -n + 1157 = 4i - 2n. What is the hundreds digit of i? 2 Suppose 0i + 3i = 5z + 9, 4i + 17 = -3z. Let r be 162/(-45)5/i. Let s = -7 + r. What is the units digit of s? 2 Let q = 140 + -79. What is the units digit of q? 1 Suppose 96 = 6n - 36. What is the tens digit of n? 2 Suppose 0 = 5d + 3u - 2 + 3, 5u + 14 = 4d. Let z = d - -8. What is the units digit of z? 9 Suppose -5t + t = -144. What is the units digit of t? 6 Let a(l) = 17l - 37. What is the tens digit of a(10)? 3 Let q be (-1 - 0) + (7 - -1). Let a be (-2)/(-4)(-1 + 3). Let f = q - a. What is the units digit of f? 6 Suppose 17 = 5x - 3l, x - 5 = -0x + l. Let t = 20 + x. What is the tens digit of t? 2 Let x(k) = k*3 + 9k*2 + 7k - 7. Let q be x(-8). Let m = q - -13. What is the units digit of m? 4 Let n(s) = 9s3 - s2 + 2. What is the units digit of n(2)? 0 Suppose 0 = 4l + 4, -3k + 3l = -653 + 59. What is the hundreds digit of k? 1 Let j be 5/212/(-15). Let f be 16(-7)/j + 1. Suppose 42 = 4k + 2i, 4i + i - f = -4k. What is the units digit of k? 8 Suppose 2 = -3l + 29. What is the units digit of l? 9 Suppose -4u + 9u = -5y + 870, 0 = y - 5u - 204. What is the hundreds digit of y? 1 Let w be 2/((2/4)/1). Suppose -5p + 3s = 2s - 5, 5p + 20 = -ws. What is the units digit of -3 + p + (17 - 1)? 3 What is the tens digit of (-5 - -28) + (-9)/(-3)? 2 Suppose 2u = 216 - 34. What is the tens digit of u? 9 Let d(l) = 2l - 2. Let u be d(5). Let m = 3 + u. What is the units digit of m? 1 Suppose 569 = -7r + 1493. What is the units digit of r? 2 Suppose -6d + 196 - 58 = 0. What is the tens digit of d? 2 Let h(r) = 8r. Let s be h(1). Let y = s + 0. What is the units digit of y? 8 Suppose 0c = -2c + 280. What is the hundreds digit of c? 1 Let v be (-576)/(-27) + (-2)/(-3). Suppose 5l + v = 2u, 3u + 3l = -2l - 17. What is the units digit of u? 1 Suppose g = -2g. What is the units digit of 0 - g - (2 - 5)? 3 Let d = -19 + 31. Let s = 15 - d. What is the units digit of s? 3 Let m(w) = -w - 3. Suppose 0 + 12 = -2p. Let l be m(p). What is the units digit of 0 + l/315? 5 Suppose 0 = -4k - y + 49, k + 5y = -3k + 69. Let w(u) = u*3 - 12u*2 + 12u - 6. Let j be w(k). Suppose 0 = -jl + 20 + 15. What is the units digit of l? 7 Suppose 0 = -3l - l - 216. Let c = -23 - l. What is the units digit of c? 1 Let j be 2/6 + 2/(-6). Suppose 0 = 4a - 4i - 24, 3i = 4a - ji - 28. What is the units digit of a? 0 Let h(x) = 0x - 11x2 - 7 - x + 2x + x*3. What is the units digit of h(11)? 4 Suppose 712 = 3t + 136. Suppose 0y + 4y = t. What is the units digit of y? 8 What is the tens digit of -3((-304)/(-12))/(-4)? 1 Let s = 438 - 257. What is the units digit of s? 1 Let g(k) = k2 - 4 + 0k*2 + 3 + 6k + 3. What is the units digit of g(-6)? 2 What is the units digit of (-18)/30(-30)/3? 6 Suppose -2o - 1792 = -9o. What is the units digit of o? 6 Let s = -32 - -81. What is the units digit of s? 9 Let i(s) = -s + 31. What is the tens digit of i(12)? 1 Suppose -5w + 910 - 175 = 0. What is the units digit of w? 7 Let z be (-3)/(6/(-4) + 1). Suppose -2g - 5f - 6 - z = 0, -3g + 3f - 18 = 0. What is the units digit of 90/4g/(-9)? 5 Let y(a) = -4a2 + a3 - 4a2 + 3 + a2 + 8a. Let j be y(6). Let b = j - 9. What is the units digit of b? 6 Let h = -12 - -14. Suppose 5o - 3s = 55 + 12, -ho - 3s = -31. What is the tens digit of o? 1 Let p = 82 - 41. What is the tens digit of p? 4 Suppose 4o - 50 + 10 = 0. What is the tens digit of o? 1 Let w = -6 - -8. Suppose -2h + 3h - w = 0. What is the units digit of h? 2 Let s(v) = -v + 1. Let r(q) = 6q - 8. Let z(x) = r(x) + 3s(x). What is the tens digit of z(6)? 1 Let s = -3 + 12. Let v = 15 - s. Suppose -3w = -o - v + 16, 8 = o - w. What is the units digit of o? 7 Suppose 0f = 4f - 12, -5q + 2f + 119 = 0. Suppose 3 = 5b + 78. Let y = b + q. What is the tens digit of y? 1 Let b(t) = -3t*2 + 8t - 3. Let c be b(5). Let j = c + 71. What is the tens digit of j? 3 Suppose 5z + 184 = -v + 478, -3z - 4v = -190. What is the tens digit of z? 5 Let t = -16 - -19. Suppose tg + 3k - 115 + 25 = 0, 150 = 5g - k. What is the tens digit of g? 3 Let i(v) = 6v + 1 - v3 + 0v*3 + 3 + 5v*2. Suppose 0s - s = 2n - 9, 0 = -4n + 5s + 39. What is the units digit of i(n)? 4 Let p(o) = -o3 + 5o*2 - 3. Let z be p(5). What is the units digit of 1/3 - 17/z? 6 Suppose -q = 24 + 7. Let d = q + 66. What is the units digit of d? 5 Suppose 4d - 5r = -9, -2d + 7d - 35 = -3r. Let j = d + -1. What is the units digit of j? 3 Let u(p) = -p*3 + 9p*2 - 3p + 7. Let c be u(9). What is the units digit of (3 + c/4)/(-2)? 1 Let s(p) = 57p2 - p. Let c be s(-1). Let a = 98 - c. What is the units digit of ((-16)/a)/((-2)/80)? 6 Let h be 4/(0 - (-3)/3). Let j = 2 + h. What is the units digit of j? 6 Let o(u) = u3 - 8u*2 - 5u - 9. Let z(a) = -5a3 + 40a*2 + 24a + 45. Let v(j) = 11o(j) + 2z(j). What is the units digit of v(9)? 9 Suppose 0 = 102m - 110m + 920. What is the hundreds digit of m? 1 Let w = 10 - 6. Let y be ((-8)/w)/(-11). Suppose -10 = -4b + yb. What is the units digit of b? 5 Let n be 0 - (-4 - (2 + -1)). Suppose -n - 2 = -q. What is the units digit of q? 7 Let i(n) be the third derivative of -n5/60 + n4/4 - n3 + 2n2. Let c be i(4). Let u = -1 + c. What is the units digit of u? 1 Let l(v) = -v2 + 10v + 5. What is the tens digit of l(5)? 3 Let b(v) = -v + 3. Let g be b(2). Let z(n) = 26n*2 - 3n + 2. What is the units digit of z(g)? 5 Suppose 2c - i = i, -5c - 5i = -30. Suppose -2 - 4 = cy. Let d = y + 9. What is the units digit of d? 7 Suppose -4u + 9 - 2 = -v, -3v - 7 = -5u. What is the units digit of ((2/1)/v)/2? 1 Let p = -9 + 12. Suppose pd - 20 = 7d. What is the tens digit of (-2)/(3 + 16/d)? 1 Let f(g) be the first derivative of 2g*3/3 + 2g*2 + 4g + 3. What is the tens digit of f(-3)? 1 Let d(t) = 60t - 22. Let r(h) = -20h + 7. Let b(x) = 5d(x) + 16r(x). Let k be b(-2). Suppose -y = -4y + k. What is the tens digit of y? 1 Let v be (3/(-5))/((-6)/30). Suppose 0 = f - 3u + 13, -3u - v = -2f - 14. What is the units digit of f? 2 Let l(z) = 14z - 14. Let q(y) = 5y + 4 - 9 + 0y. Let j(n) = 6l(n) - 17q(n). What is the units digit of j(-2)? 3 Let s = -32 - -15. Let o = -29 - -61. Let w = o + s. What is the tens digit of w? 1 What is the units digit of (45/(-3))/(1 + 38/(-35))? 5 Suppose 1161 = -t + 10t. What is t	{ "pile_set_name": "DM Mathematics" }
2/(-10)). Solve -ob = -7b + 10 for b. 2 Suppose -9u + 30 = u. Solve 2r = -ur - 15 for r. -3 Let a(j) be the first derivative of -1/4j*4 + 0j - 2 + 4/3j3 - j2. Let s be a(3). Solve sb + b = 8 for b. 2 Let i(l) = 2l3 + 99l*2 - 151l + 117. Let d be i(-51). Solve y = 4y + d for y. -5 Let s(u) = u2 - 3u - 10. Let w be 19/38(11 - 1). Let v be s(w). Suppose -2p + 5p - 6 = v. Solve 0 = 3b + pb for b. 0 Let c(o) = o - 1. Let x be c(5). Let q(b) = -5b3 + b2 + b + 1. Let h be q(-1). Let w(y) = 109y + 547. Let j be w(-5). Solve -h - j = xz for z. -2 Let i = -3 - -35. Let m = i + -32. Let w = 0 + 0. Solve wx - x - 3 = m for x. -3 Let g(t) = 2t*2 + 14t + 14. Let d be g(-6). Solve -dy = 4y for y. 0 Let x = -24 - -8. Let l = -7 - x. Solve l = 5g - 2g for g. 3 Suppose -5b + 8b - c - 203 = 0, 0 = -4b - 2c + 264. Let t = -64 + b. Solve 0 = -tx + x for x. 0 Let r be (-2)/6(-12 + 0). Suppose -h - 2 = -3h, rl - 50 = -2h. Let z be l/(-36)(1 - 7). Solve -zo = o - 15 for o. 5 Let n = 207 - 203. Solve -5l = -l - n for l. 1 Let y(a) = a*2 - 15a - 46. Let q be y(18). Solve 6f - 4f - q = 0 for f. 4 Let q(f) = f*3 + 3f*2 + 3f + 6. Let o be q(0). Solve o + 78 = -21d for d. -4 Let k(f) = -f + 13. Let g be k(7). Let l be (1 - 10/15)g. Solve -4y + 2 = -ly for y. 1 Let a(d) = 5d2 + 40d - 39. Let q be a(1). Solve 2l - ql = 12 for l. -3 Let x(h) = h*3 + 7h*2 + 7h + 11. Let p be x(-5). Solve 27i = pi + 1 for i. 1 Let k(y) = 4y + 3. Let n be k(2). Suppose 0 = 12b - nb + 2. Let z be (-2)/(((-6)/b)/(-6)). Solve -zm + 6 = -14 for m. 5 Let y = 5 - 2. Suppose yj = 2q - 3, 3q - 4q - 2 = 2j. Suppose 0 = -t - qt. Solve -u - 1 - 1 = t for u. -2 Suppose 4f = 2m + 12, 0 = -4f + 28 - 8. Let x(b) = -b. Let n(i) = 2i + 2. Let r be n(-2). Let h be x(r). Solve -hs + ms = 0 for s. 0 Let o = 227 + -160. Let j = o + -67. Solve 5 = -h - j for h. -5 Suppose -5v + 4w + 66 = -10v, -2v + 4w - 4 = 0. Let g(y) = 2y*2 + 20y. Let t be g(v). Solve t = 2x + 5 - 3 for x. -1 Let v(q) = 2q*3 + 54q*2. Let j be v(-27). Solve 0 = -2c + 6 - j for c. 3 Let f be (4/(-1))/(-2) - (-11 - -8). Let k be -5f/10-2. Solve 4p - k = 7 for p. 3 Suppose 8w - 19 = -3. Let y(d) = 2d - 6. Let m be y(5). Solve -m = wt + 4 for t. -4 Suppose -5u - f + 0f + 64 = 0, 0 = 3f + 3. Suppose 0 = um - 8m - 25. Solve 0 = -0w - w - m for w. -5 Suppose 2g + 2r = 6, 5g + 3r - 30 + 9 = 0. Let o = -3 + 2. Let l = g + o. Solve 0 = -0u - lu for u. 0 Let k be ((-16)/(-6))/(4/6). Let j be -6(-1)/k2. Suppose z + 3w + j = 0, 0z = -3z + 5w + 33. Solve z = -2f - f for f. -2 Suppose -3l = 2l - 40. Let u(v) = -6v + 2. Let p be u(-3). Let i be (-3)/16 - (-11055)/2640. Solve -ia = -p + l for a. 3 Suppose 5f = 2s - 66, 2s - 113 = -s + 4f. Solve 0 = -45k + sk + 6 for k. 3 Suppose -2b + 42 = b - 3n, -82 = -5b - n. Solve 0 = 18m - bm for m. 0 Let y be 4/(14/(-4) + 3). Let j(x) = -x*2 - 4x + 34. Let u be j(y). Solve ud - 4d + 6 = 0 for d. 3 Let r = 1092 + -1084. Solve 9q - r + 26 = 0 for q. -2 Let b(l) = l + 8. Let x be b(-6). Let f(r) = -r2 + 3r + 1. Let m be f(x). Suppose -3g + g + 14 = d, -mg = -3. Solve -d + 4 = 2o for o. -4 Let l(z) = 3z + 20. Let q be l(-6). Suppose 0 = -0c - qc + 18. Let j be c/(5/10 + 1). Solve 4w + j + 6 = 0 for w. -3 Suppose -7m = -6m - 2. Let d be 3/m - (-2)/4. Suppose 9i = 5i + 8. Solve -2x + i = -d for x. 2 Suppose -2q + 10 = y, 5y - 11 = 9. Let h(k) = -4k - 3k + qk. Let a be h(-5). Solve 0 = -2j - 2j + a for j. 5 Let h = 14 + -11. Suppose -h = -5z + 4z. Let q be 2 + (z - (3 - 0)). Solve 3 + q = -y for y. -5 Let v(n) = -2n - 3. Let o be v(-3). Let d = -9 - -14. Suppose -7f - dj - 13 = -5f, f = -4j - 14. Solve -og - f = 9 for g. -5 Let w = 382 - 346. Solve 13t - t = w for t. 3 Let m = 2 - 2. Let o(s) = 4s3 + 2s*2 - 4s + 3. Let t be o(1). Suppose m = -ta - f + 5, -3f + 5f = -a + 10. Solve -2 = 2w - a for w. -1 Let a be 100/(-36) + 6/(-27) + 15. Suppose -2 - 10 = -3m, -5o - a = -3m. Solve o = -2b - 1 + 11 for b. 5 Let o(w) = 5w2 - 1. Let x be o(-1). Suppose xu - 2 = 10. Solve 16 = uy + y for y. 4 Let l(x) = x - 12. Suppose -2y + 28 = -3d - 2, 5y - 75 = -2d. Let k be l(y). Suppose q + 3 = -c, 2c - kq - 8 = 1. Solve c = 4v + v + 15 for v. -3 Let n be 24 + (-118)/(-2). Solve -63o + no + 8 = 0 for o. -2 Suppose 12m + 30 = 15m. Let k be 72/m + (-8)/(-10). Solve 3j = -j - k for j. -2 Let q = 789 - 789. Let j = 5 - 2. Solve -v - j = -q for v. -3 Let a(j) = -j*3 - 6j*2 - 5j - 29. Let m be a(-6). Solve 5 - m = -4f for f. -1 Suppose -8 = 4s - 4x, 0s - 14 = s - 4x. Let k be ((-8)/12)/(2/(-3)). Solve 0 = -o + so - k for o. 1 Let q(f) = -3f3 + 2f - 1. Let u be q(-2). Solve 0 = -6d + u + 11 for d. 5 Suppose -8 = -9t - 8. Solve tp - 1 = -p for p. 1 Let t(k) = -9k + 4. Let p be t(-8). Suppose 3b = q - 19 - p, 0 = -5b + q - 161. Let g be (-16)/(-6) - (-22)/b. Solve r = -0 + g for r. 2 Let j = -56 - -64. Suppose -12 - 13 = -5g + 2a, a + j = g. Solve 2c + g = -1 for c. -2 Let w be (16/(-12))/(8/12). Let x be ((-40)/(-24))/(w/(-6)). Suppose 3u - 5b - 24 = -2b, 0 = -u + xb + 24. Solve -p + 5 = up for p. 1 Let i = 1351 + -1306. Solve -4j + i = -19j for j. -3 Let r be (1 - 0)-2 - -2. Let o = -1754 + 1762. Solve -4k = o - r for k. -2 Let n(f) = 12f2 + 2f - 1. Let t(o) = 11o2 + 3o - 2. Suppose 6a - 2a + 8 = 0. Let c(b) = at(b) + 3n(b). Let j be c(1). Solve -4p - p + j = 0 for p. 3 Suppose -709 = -v - 706. Solve -j = vj - 20 for j. 5 Let u(j) = 17j3 - j2 + 4j - 4. Let f be u(1). Solve l + 3l = -f for l. -4 Suppose -2i = 18 + 18. Let w = i + 33. Solve 2g - w = 7g for g. -3 Suppose -65 = -4t - y + 105, 0 = -3t - 3y + 123. Let o = t - 41. Solve 0 = r - or + 1 for r. 1 Let a = -27 + 23. Let z be (-10 - a)(0 + 1). Let l = 9 + z. Solve 0 = -lb + 3 for b. 1 Let l(q) = -q*2 - 6q + 2. Let p be l(-8). Let j = -14 - p. Solve -h - 2 + 3 = j for h. 1 Let h = -98 - -106. Solve m = -h + 4 for m. -4 Let v(y) = y*2 + 17y + 36. Let k be v(-16). Suppose -h + 6h - k = 0. Solve 6 = -ho - 6 for o. -3 Let d = -30 + 37. Suppose 4l = 4k - 20, -5k = 6l - 5l - d. Solve -w = kw for w. 0 Let z(q) = 17q2 + 13q - 25. Let k be z(2). Solve -39 + k = 6p for p. 5 Suppose 0 = 8a + 74 - 114. Solve -ap + 16 = -9 for p. 5 Let z(t) = -30 + t3 - 11t*2 + 41t*2 - 18t - 5 + 72t. Let x be z(-28). Solve 5 = -4d + x for d. 4 Suppose 152v - 2 = 148v - 2y, -2y + 2 = -2v. Solve -c + 1 + 0 = v for c. 1 Let c = 13 - 12. Let y = -1 + c. Suppose -2s = -ys - 10. Solve -2d + s = -5 for d. 5 Let s be (1 - 20/16)-20. Suppose sf = 3b - 5, -2b + 8 = -2f + 2. Suppose 1 - 3 = -g. Solve -3i = g - b for i. 1 Let i(f) = 3f2 + 11f - 6. Let w be i(-8). Let t = -92 + w. Solve 0 = -3q - t + 3 for q. -1 Let y be 120/50(2 + (-3)/(-6)). Solve -q + yq = -20 for q. -4 Suppose 0 = 17x - 22x - 150. Let d = x - -30. Solve dn - 1 = n for n. -1 Suppose -5n = 675 - 1745. Let r be -3 - (8/28 + n/(-14)). Solve -r = -2w - w for w. 4 Let y = 4 + -2. Let j be (0 - 1)/(1/(-4)). Suppose 196q - 203q + 56 = 0. Solve -yl + q = -jl for l. -4 Let n be (-20)/(-30) - (-4)/(-6). Suppose -4v + nv = 8. Let o = v - -7. Solve p = 2 - o for p. -3 Suppose -5m - 5t + 51 = -9, 2t = -5m + 45. Let k be (-61)/(-4) - m/28. Solve k = -0y + 5y for y. 3 Suppose 5x - 4 = 3h, 4x - 27 = -3h + 2h. Suppose hn = 1 + 55. Solve -5u + nu = -12 for u. -4 Let h(i) = i*2 + 23i + 65. Let w be h(-20). Solve -wd + 16 = -9d for d. -4 Suppose 0 = 8n - 33 + 1. Solve 4g = -2g + ng for g. 0 Let u = 159 + -155. Solve 5x + u = x for x. -1 Let r(a) = a - 15. Let i be r(16). Suppose -f - i - 11 = -5p, 3p = 2f + 3. Solve f - 15 = 3x for x. -4 Suppose 0 = 5r + d - 51, -d - 9 - 30 = -4r. Solve rh - 6h = -12 for h. -3 Let u = -31 + 38. Let i(l) = -l2 + 7l + 4. Let t be i(u). Solve b = tb for b. 0 Let j(k) = -k3 - 15. Suppose 3s - 3z + 15 = 0, 0s - 3s + 2z = 10. Let d be j(s). Let q = -12 - d. Solve -f - 2f = -q for f. 1 Let q = -28 - -35. Solve -q = k - 10 for k. 3 Let h = 46 + -26. Let z = h - 16. Suppose -p + zp = 0. So	{ "pile_set_name": "DM Mathematics" }
4 + 4i4 + (-10i*3 + 5i3 + i3)(-3 - 3i + 3). 19i4 Expand -60r*3 - 41r*3 + 37r*3 + (-2r - 5 + 5)(2r*2 + 0r2 - r2). -66r3 Expand (0 + 2 - 1)(s - 1 + 1) - 2s - s + 4s + 12s - 17 + 17 + 0 + 0 + s + (-3 + 2 - 2)(-5s + 4s + 0s). 18s Expand (-12 + 3m - m - 107)(m*2 - 2m2 - m2). -4m3 + 238m*2 Expand -1707b*3 + 18b*4 + 3415b*3 + 137b*4 - 1708b*3 + 4b*2 - 2b*4 - 4b*2 + (2b + 0b - b)(b3 - b3 + b*3) - 1 - 3b*4 + 1. 151b*4 Expand -8 + 8 - 4i + (-12i - 13i - 11i)(-1 + 1 - 2)(3 - 2 - 2). -76i Expand 3y4 + 0y4 - y4 + (2 + 0 + 0)(-5y*4 - 22y + 22y) + 1 - y - y4 + y. -9y*4 + 1 Expand (-2o*2 + 2o*2 + 6o*3)((-4 + 3 + 0)(5o + 0o - 3o) + 7o + 20o - 7o). 108o4 Expand (1 - 1 - q3)(2q*2 - 2q2 + q2) + (37q2 - 34q*2 + 23q*2)(-3q3 + q3 - 2q*2 + 3q*3 - 3q). 25q5 - 52q*4 - 78q*3 Expand ((1 - 1 - 2)(-2l + 2l + 2l) + 2l - 3l + 0l + 4l - 2l + 0l)(2l3 - 10l*3 + 18l*3). -30l*4 Expand (5c - 3c - c)(1 + 0 + 0) + 15 - 4c - 15 + (5 - 5 + 2)(2c - c + 3c) + 0c - 2c + 4c + (-2 - 1 - 2)(3c + c - 5c). 12c Expand (-3 - 3m*2 - 1317m + 1317m)(2 - 2m3 - 2). 6m*5 + 6m*3 Expand 48c*3 - 83c*3 + 43c*3 + (3c + 0c - c)(0c2 + 0c*2 + 2c*2) - 2c*3 - 1 + 1. 10c*3 Expand (-4p*3 - 6 + 16 + 0)(13 - 2p2 - 13). 8p*5 - 20p2 Expand f5 + 5f3 - 86f*4 + 86f4 + f5 - f*5 + 4f*5 + (1 - 3 + 3)(-2f3 - 2f*5 + 2f3) - f5 - f*5 + 3f*5. 4f*5 + 5f*3 Expand (5 - 4h*2 - 5)(-57 - 108 + 110)(5h*3 + 0h*3 - 2h*3). 660h*5 Expand (2 + 0 - 1)(-783f2 + 396f*2 + 507f*2). 120f2 Expand -a4 + 9a - 9a + (4 - 2 + 0)(4a*4 - 6a*4 + 3a*4) - 17a*2 + 26a*4 + 17a*2 - 2a*4 + 2a4 + a4. 28a4 Expand (0k - 3k + 2k)(k - 2k - 2k)(6 - 7 + 7)(8 + 9 - 11). 108k*2 Expand 783p*5 + 2 - 390p*5 + 6p*4 - 395p5 + (-p4 + p*4 + 3p*4)(-2p - 3p + 2p)(0 - 3 + 2). 7p5 + 6p*4 + 2 Expand (18p*2 + 18p - 18p)(-8p + 0p + 0p)(4 - 4 - 2p). 288p4 Expand -i4 - 7i3 + 7i*3 + (-i + 31 - 31)(1 + i*3 - 1) + (-4i + 4i + i)(-1 + 1 + 2i3) - 5i*4 + 13i*4 - 5i*4. 3i*4 Expand ((-1 + 0 + 2)(-j + 1 - 1) - 3 + 3 - 2j - 7 + 7 + 4j - 3j + 4j + 2j)(0 + 0 + 4j2). 16j*3 Expand (-1 + 1 + r)(r*3 - 2r*3 - 5r*3) + (2r3 - r3 - 2r3)(-2r - 3 + 3). -4r*4 Expand 3j*4 - 6j*4 + 4j*4 + (-10j*4 - 8j*4 - 12j*4)(2 - 3 + 2) + (j*4 + 2j*4 + 0j*4)(1 - 8 + 3). -41j4 Expand c2 - 5c*2 + 2c*2 + (0 + 6 - 3)(-c + 2c - 4c)(3c - 2c + 3c). -38c2 Expand (0 - 6 - 2)(-2y3 - 5y + 5y + (5y2 - y2 - 2y2)(-5y + 0y + 4y) + 0y3 - y3 + 2y3 + 2y*3 - 2y*3 + 2y*3). 8y*3 Expand (-1 - 3 - 6u + 3)(-4u*2 + 2u*2 - 2u*2). 24u*3 + 4u*2 Expand (2m + m - 2m)(0m + 5m - 4m) + 0m*2 - 4m2 + m2 + (4m - 3m - 2m)(-3m + 5m + m). -5m2 Expand (2 - 2 - v)((-4v + 0v + 2v)(2 - 6 + 3) - v + 2v + 0v + 14v + 9v - 11v + (2v - 3v + 0v)(1 + 2 - 2)). -14v*2 Expand (12p*4 + 19p*4 + 29p*4 - 4p*4 + 5p*4 + 0p*4 + (0p - 4p + 3p)(1 - 2p*3 - 1))(2 + 1 + 0p - 2p). -126p5 + 189p*4 Expand (-s - 2 + 2)(19 + 2 + 6)((1 + 1 - 4)(5 - 2 - 1) + (1 + 2 - 4)(-2 + 4 + 1)). 189s Expand 0c4 + 8c*4 + 4c*4 + (3c*4 - 4c*4 + 0c*4)(0 - 2 + 3) - 15 + c*4 + 15 - 5c*2. 12c*4 - 5c*2 Expand (-4f - 2f + 0f)((5f - 3f - 11f)(f + f + 0f) - 4f2 + 3f*2 + 0f*2). 114f*3 Expand (-6 + 0 - 7)((-4j + 2j + j)(-3 + 4 + 1) - 2j - j + 2j) + 0j - 5j + 3j. 37j Expand (-3g*2 - 2g*2 + 3g*2)(2g - g - 3g) + (0 + 0 - g*3)(1 - 5 + 1) + 3g3 - 4g*3 + 3g*3 + (2 - 2 + 2g*2)(g - 4 + 4). 11g3 Expand (61 + 63 - 50)(0z + 0z - z*3). -74z*3 Expand -2b4 + b4 - 5b4 - 6b + (-2b2 - 5b*2 + 6b*2)(0b2 + 3b*2 - 5b*2) + 6b*2 + 2b*4 - 6b*2. -2b*4 - 6b Expand (3p - 1 + 0p - 1)(3 - 3 + 2)(-4p + 7p + 6p). 54p*2 - 36p Expand (49 + 75 - 59)(-s + s - s)(3s - s - 6s). 260s2 Expand -4 + 4 - 3r + (41r - 6r - r)(1 - 1 + 1). 31r Expand (2t2 + t2 + 4t*2 + (-2t - 4 + 4)(-5t + 6t + t))(-289 + 4t + 291 - 2t). 6t3 + 6t*2 Expand (30 + 7k - 28 + 9k)((3 - 3 + 2)(0 - 1 + 0) - 2 + 1 + 3 + 2 + 1 - 2 - 3 + 2 - 1). -16k - 2 Expand (-3 + 5 - 1)(2y2 - y2 - 3y2) + (1 - 1 + 2y)(0 - 2y + 0) + y*2 - 3 + 3 + (13y - 4y + 6y)(3y - y + 0y). 25y*2 Expand (-19x + 9x + 58x)(-2 + 6 - x + 3x). 96x2 + 192x Expand -21 + 6b2 + 21 + (3b - 3b + b)(-1 + 1 - 2b) + 2b*2 + 13b - 13b. 6b*2 Expand (1 - 1 + 2i*2)(2i2 - i2 - 13i2) + (i2 - 2i2 + 0i*2)(33i + 28i*2 - 33i) - 4i4 - i4 + 6i*4. -51i*4 Expand (4z*4 - 4z*4 + 2z*5)(-88 + 164 + 6). 164z5 Expand (3l + 2l - 4l)(-3 - 2l + 3) - 4l2 - 4l*2 + 9l2. -l2 Expand (-s*3 + 0s + 0s + (-s + 0s + 3s)(4s2 - 3s2 + s2) - s + s*3 + s)(-5s2 - s2 + 3s*2 - 3). -12s*5 - 12s*3 Expand ((-3a + 3a + 2a)(0 + 3 - 5) - 16a + 161 - 161)(3a - 3a + 2a). -40a2 Expand (-1 + 2m + 1)(0m*2 + 3m2 - m2) - 4m3 + 2m*3 + 19m*3 - 50m*2 + 0m*3 + 51m*2 - 5m*3. 16m3 + m2 Expand (0 - 2 - 4)(2j - 2j - 1436j*2 + 1202j*2). 1404j*2 Expand (0 + 0 + 1)(10u - 10u + 22u2) + 2u2 + u2 - 4u2 - 6u*2 + 2u*2 + 2u*2. 19u*2 Expand -133w - 346 + 173 + 173 + 9 - 9 + 2w + 0w - 2w + w + (2 - 2 + 2)(w + 2w - 4w) + 0 - w + 0 - 2w + 0w + 0w. -137w Expand (d + 2d2 - d - 3d + 3d - 2d*2 + (0d - 3d + d)(d - 6d + 3d))(3d + 2d2 - 3d) + 15d4 - 3d*4 + 33d*4. 53d*4 Expand 13s + 18 + 2s - 13 - 3s + 3s + 2s + (2 + 0 - 4)(1 - 2s - 1). 21s + 5 Expand -c - 2c + 4c + (c + 10c - 4c)(-2 - 2 + 0) - 4c + 5c + 0c + (-2 + 1 + 3)(-4c + 2c + 0c) - 4c - 2c + 4c. -32c Expand (g - 2g - g)(0 - 5 + 4 + (-85 - 23 + 175)(4 - 1 - 4))(6 + 3g*2 - 6). 408g*3 Expand 2x + 0 + 0 + (0x + 3x - x)(-2 + 3 + 1) + x + x + 0x + 6x - 2x - 3x + 2x - x - 2x - 5x - x + 2x + (-8 - 5 + 11)(3x - 5x - x). 10x Expand (4 - 2 + 0)(0 - 2w + 0)(305 + 118 + 694 - 110). -4028w Expand (-3 + 6 + 1)(22 - 6n - 22)(-6 - 10n2 + 6) + 0 + 0 + n3. 241n3 Expand -x5 + x*5 + 2x*5 + (0x + 2x - x)(-x + 3x - 3x - x4). x5 - x*2 Expand 1 - 3w - 1 + 4 - 4 - 2w + (-2w + 0w + 4w)(1 - 3 + 0) - 3w + 0 + 0 + (-1 + 0 - 1)(4w - 29w - 4w). 46w Expand (-781f*2 + 1380f*2 - 768f*2)(f*2 + 3f*2 - 3f*2). -169f*4 Expand (4 - 5 + 2)(-126 + 126 + 9v)(0v + 7v + 2v). 81v*2 Expand (-3 - 3 - 1 + (5 - 5 + 1)(3 - 3 - 1))(10 - 38 + 18 - 2a). 16a + 80 Expand -4 - m + 4 + (3 + 2 - 2)(5m + 5m - 7m) + (-4m - 2m + 4m)(2 + 0 + 0) + m + 0 + 0 + 1 - 1 + 2m - 3 + 2m + 3. 9m Expand (-4n3 + 2n*3 + 4n*3)(13n - 13n + 62n) + (-2n*2 + 2n*2 + 2n*2)(0 + n*2 + 0). 126n*4 Expand (47i - 47i - 24i)(-4i + 4i + 2i*3). -48i4 Expand (d2 + 6d2 + 2d*2)(3 - 2d - 3) + (10d - 3d - 3d)(-6d*2 + 5d*2 + 2d*2). -14d*3 Expand (0 - 5 - 1)(3z - 6z - 3z) - 4z - z + 2z + 2z + 2z - 2z. 35z Expand -4p - 2p + 4p + (-2 + 4 + 0)(1 - p - 1) + 2p + 0p - 3p + 2p + 2p - 2p - 2p - p + 5p + (-31 - 33 + 47)(-p + p + p). -18p Expand (0 + 3 - 2)(151226 - 1545n - 151226). -1545n Expand (-45p - 17p + 30p)(-7p + 0p - 2 + 6p + (-2p + p - 2p)(-2 + 6 - 3)). 128p2 + 64p Expand (-2y + 3y - 2y + (-2 + 1 + 3)(-y + 0y + 0y) + y - 5y + 2y)((-3 + 3 - 3)(2 + 2 - 5) - 6 - 2 + 3)(1 - 1 - 2y*2). -20y*3 Expand (-202s + 25s - 4s)(3 - 3 - s2). 181s*3 Expand (-1 + 3 - 1)(3n - 14n - n) + 5n + 0n + 2n. -5n Expand (0z2 - 3z*2 + 0z*2)(71z2 - 76z*2 + 38z*2 + (6 - 2 - 2)(-2z2 + 4 - 4)) + (2z2 + z2 - z*2 + 1)(z*2 - 2z + 2z). -85z4 + z2 Expand (4z4 + 0z*4 - 2z*4)(-3z - 4z + 5z)(-38 - 46 + 59). 100z5 Expand ((-1 - 1 + 3)(-3 + 1 + 3) + 0 + 1 + 2 + (-5 + 0 + 4)(3 + 0 + 0) - 3 + 1 + 13)(7a5 - 2a*5 - 3a*5). 24a*5 Expand -6r**2	{ "pile_set_name": "DM Mathematics" }
rmine o(10). 112 Let o(g) = g*2 + 4g + 2. Determine o(-2). -2 Let g(x) = -x + 23. Determine g(-4). 27 Let n(m) = m*3 - 4m*2 + 4m - 8. Calculate n(4). 8 Let k(t) = -6t + 15. Give k(0). 15 Let v(a) = -7a + 104. Give v(6). 62 Let n(m) = m*2 + 9m + 6. What is n(-8)? -2 Let x(n) = 5n + 57. Calculate x(-2). 47 Let i(f) = f2 - 2f + 5. Determine i(3). 8 Let a(f) = 4f - 177. Give a(33). -45 Let l(y) = -y - 1. Determine l(-1). 0 Let w(f) = f2 - 10f + 10. What is w(5)? -15 Let s(d) = -5d - 2. Give s(1). -7 Let q(m) = m3 + m2 - 4. Give q(-3). -22 Let k(t) = -t + 16. Determine k(8). 8 Let y(n) = 2n*2 - 24n + 27. What is y(11)? 5 Let v(h) = -h*3 - 9. Give v(0). -9 Let f(l) = 16l + 373. Give f(-23). 5 Let n(j) = j*3 + 21j*2 - 22j - 9. Determine n(-22). -9 Let b(j) = -j*3 + 4j*2 + 3j - 24. Calculate b(4). -12 Let d(z) = -z*2 - 13z + 39. Give d(-16). -9 Let x(r) = -r2. Determine x(0). 0 Let m(t) = -t2 + 28t - 46. Calculate m(26). 6 Let t(b) = 7b - 95. What is t(22)? 59 Let g(m) = -3m + 43. Give g(19). -14 Let r(o) = 33o*2 + 1. Calculate r(1). 34 Let l(c) = 9c - 225. Determine l(28). 27 Let y(q) = -16q + 8. Give y(1). -8 Let p(c) = -3c*2 - 26c - 57. Give p(-2). -17 Let d(f) = 5f + 2. Calculate d(-5). -23 Let x(i) = 2i*2 + 34i - 15. What is x(-18)? 21 Let y(z) = z*2 + 12z + 17. Give y(-4). -15 Let b(u) = 2u + 19. Give b(-8). 3 Let g(l) = 6l + 9. Determine g(-5). -21 Let u(i) = -18i - 2. Determine u(-3). 52 Let d(k) = -k2 + 5k + 1. Determine d(5). 1 Let w(f) = 14f + 5. Give w(-2). -23 Let b(n) = n - 7. Give b(10). 3 Let z(l) = -18l - 8. Calculate z(-2). 28 Let b(i) = 2i - 86. Calculate b(41). -4 Let d(k) = k3 - 17k*2 - 19k + 26. Determine d(18). 8 Let s(h) = h*3 - 2h*2 + 14h - 49. What is s(3)? 2 Let t(f) = -2f2 - 7f. Calculate t(-5). -15 Let p(a) = 6a3 + 6a - 5. Determine p(1). 7 Let s(a) = a*2 - 8a + 1. Calculate s(6). -11 Let j(t) = t - 14. Give j(2). -12 Let p(m) = -27m - 5. Determine p(-4). 103 Let c(t) = 5t + 3. Calculate c(-4). -17 Let s(m) = -3m2 + 3m + 1. Determine s(-4). -59 Let g(l) = l*2 - 12l + 13. Calculate g(8). -19 Let k(g) = -g*2 + 17g. Determine k(17). 0 Let d(t) = -t*3 - 6t*2 + 3t - 17. Calculate d(-7). 11 Let a(j) = -j*3 - 5j*2 - 7j - 37. Determine a(-5). -2 Let p(h) = 2h - 3. Determine p(2). 1 Let w(s) = s2 + 35s + 249. What is w(-24)? -15 Let w(k) = -k*2 + 12k + 11. Determine w(12). 11 Let y(s) = -s*2 - 15s - 13. What is y(-13)? 13 Let o(n) = 5n2 + 3n + 15. Give o(-5). 125 Let i(u) = u*3 + 8u*2 + 6u - 4. Give i(-7). 3 Let c(a) = -a*2 - 3a + 139. Determine c(10). 9 Let n(q) = 2q2 - 6q - 4. Determine n(5). 16 Let j(o) = 11o - 332. Determine j(30). -2 Let d(r) = 8r + 31. Calculate d(-6). -17 Let x(d) = d*3 + 5d*2 - 15d - 1. What is x(-7)? 6 Let n(g) = -3g - 45. Determine n(-10). -15 Let d(v) = -4v - 6. What is d(2)? -14 Let i(s) = 30s2 - 10s + 8. Give i(1). 28 Let p(c) = -c2 + 4. Give p(3). -5 Let b(n) = n + 24. Give b(-20). 4 Let d(n) = -n3 + 8n2 - 8n + 12. Calculate d(7). 5 Let n(w) = -w*2 - 11w - 12. Determine n(-10). -2 Let u(s) = s*3 + 4s*2 - 7. Determine u(-4). -7 Let f(h) = h - 2. Determine f(0). -2 Let w(a) = -a - 1. Calculate w(2). -3 Let r(n) = -2n*2 + 18n + 1. What is r(10)? -19 Let a(y) = -y3 - y + 11. Determine a(0). 11 Let r(b) = b2 + 3b - 7. Determine r(-5). 3 Let g(p) = -p - 1. Determine g(0). -1 Let y(x) = 5x - 17. Calculate y(8). 23 Let j(q) = -2q2 - 36q - 9. Calculate j(-18). -9 Let a(v) = -7v2 - 2v - 2. Determine a(-1). -7 Let t(n) = -n*2 + 12n + 7. What is t(5)? 42 Let s(x) = x*2 + 10x - 19. Calculate s(-12). 5 Let h(x) = -x*3 + 8x*2 - 9x + 6. Calculate h(7). -8 Let d(l) = l*3 + 12l*2 + 2l - 1. Determine d(-12). -25 Let a(q) = 6q + 1. Calculate a(1). 7 Let m(g) = -7g + 19. Calculate m(-4). 47 Let t(g) = 43g2 - 1. What is t(1)? 42 Let z(r) = 39r + 307. Give z(-8). -5 Let s(u) = u*3 - 8u*2 + 9u - 5. Give s(7). 9 Let h(l) = l*3 - 3l*2 - 2l - 5. Determine h(4). 3 Let r(g) = g*3 + 8g*2 - 12g - 31. Give r(-8). 65 Let r(h) = h*3 + 16h*2 + 13h - 16. Determine r(-15). 14 Let u(x) = 2x2 - 19x + 7. What is u(10)? 17 Let g(z) = z*3 - 15z*2 - 15z - 10. What is g(16)? 6 Let k(d) = d*3 + 5d*2 + 6d + 4. Give k(-3). 4 Let o(g) = 15g2 - 5g + 4. Calculate o(3). 124 Let o(q) = -2q - 21. Calculate o(-12). 3 Let w(g) = 7g*3 + 38g*2 + 15g + 2. Calculate w(-5). 2 Let k(f) = -f*2 + 15f - 52. Determine k(8). 4 Let c(i) = i + 45. Calculate c(0). 45 Let f(r) = -2r2 + 8. Give f(6). -64 Let k(a) = a3 + 5a*2 + 2a - 1. Calculate k(-4). 7 Let z(c) = -c2 + c - 23. Calculate z(-6). -65 Let b(c) = -c2 - 22c - 25. Give b(-20). 15 Let u(b) = -b2 + 11b - 7. What is u(10)? 3 Let y(p) = p*2 - 7p - 21. What is y(9)? -3 Let w(j) = -42j2 - j + 1. Give w(-1). -40 Let b(s) = -2s*2 - 45s + 145. What is b(3)? -8 Let b(j) = 134j + 273. What is b(-2)? 5 Let o(k) = 12k - 30. Give o(3). 6 Let v(g) = 2g3 - 3g*2 + 2g - 1. Determine v(2). 7 Let n(d) = -d*3 - 3d*2 + 2d - 2. Give n(-4). 6 Let m(c) = c*3 + 5c*2 - 23c - 30. Give m(-6). 72 Let k(d) = 16d2 + 7d - 6. Calculate k(1). 17 Let w(d) = -d*2 + 3d + 42. Calculate w(-6). -12 Let o(j) = -j*2 + 3j. Give o(3). 0 Let j(u) = -u*2 + 16u + 16. Give j(17). -1 Let z(q) = -12q2 - 110q - 8. Calculate z(-9). 10 Let i(u) = -2u + 9. Give i(7). -5 Let x(z) = -z3 + 5z*2 - 6z + 6. Give x(5). -24 Let o(i) = 2i2 + 12i + 13. What is o(-6)? 13 Let f(x) = x + 5. Give f(13). 18 Let b(w) = -w*3 - 6w*2 - 4w - 7. What is b(-2)? -15 Let n(d) = d*2 - 6d - 2. Give n(0). -2 Let g(m) = -m*3 - 7m*2 - 11m - 3. Determine g(-5). 2 Let d(l) = -13l + 25. Determine d(2). -1 Let m(w) = -10w + 184. What is m(0)? 184 Let j(c) = 12c + 62. What is j(-5)? 2 Let x(w) = -w + 2. Determine x(-12). 14 Let a(s) = -s + 20. Determine a(11). 9 Let i(v) = -9v + 83. Calculate i(8). 11 Let o(q) = -8q + 4. Determine o(5). -36 Let y(t) = 2t*2 + 20t + 18. Determine y(-13). 96 Let w(n) = 6n + 9. Determine w(-8). -39 Let m(x) = -x3 + 2x*2 + 2x - 4. Determine m(3). -7 Let x(i) = 40i - 3. Determine x(2). 77 Let q(j) = -3j*2 + 3j - 2. Determine q(2). -8 Let o(j) = j*2 + 19j + 12. Give o(-18). -6 Let n(v) = 13v + 34. Give n(-2). 8 Let l(q) = -q2 - 25q - 146. Determine l(-10). 4 Let b(w) = w*2 - 3w - 12. Calculate b(6). 6 Let r(c) = c*3 - 14c*2 + 14c - 8. Determine r(13). 5 Let f(h) = h*3 - 25h*2 + 66h + 52. Determine f(22). 52 Let j(l) = -l*3 + 11l*2 - 29l + 95. Determine j(9). -4 Let n(y) = y*3 - 15y*2 + 12y + 8. Give n(14). -20 Let x(b) = 6b2 + 9b + 27. Determine x(-5). 132 Let s(j) = -2j2 + 11j + 8. Determine s(9). -55 Let o(x) = x2 + x - 1. What is o(-2)? 1 Let r(f) = f3 - 10f2 - 26f + 8. What is r(12)? -16 Let y(k) = -k3 + k2 + 9k + 7. Calculate y(-3). 16 Let p(z) = -2z*2 + 56z - 17. Calculate p(28). -17 Let d(f) = -7f + 9. Give d(7). -40 Let p(f) = 3f*3 + 3f*2 - 2f + 1. Determine p(-2). -7 Let x(u) = u - 15. Calculate x(4). -11 Let n(b) = -260b + 256. What is n(1)? -4 Let u(m) = -m3 - 30m*2 - 27m + 62. Give u(-29). 4 Let m(d) = -2d - 8. What is m(-7)? 6 Let x(l) = -2l - 19. Determine x(-10). 1 Let x(u) = -3u + 14. What is x(6)? -4 Let h(c) = 4c*2 - 11c + 9. Calculate h(5). 54 Let z(r) = 3r + 4. Give z(-1). 1 Let f(o) = 4o*2 + 8o + 14. Determine f(-2). 14 Let p(u) = 2u - 32. Determine p(15). -2 Let l(q) = -q3 - 3q*2 + 7q + 7. Give l(-5). 22 Let u(m) = 2m + 6. What is u(3)? 12 Let i(r) = r3 + 2r + 3. What is i(-1)? 0 Let d(o) = o*2 + 18o - 192. Calculate d(8). 16 Let s(v) = v*3 - 16v*2 + 45v - 8. What is s(4)? -20 Let l(s) = -2s - 5. Give l(6). -17 Let p(z) = z3 + 15z*2 + 14z - 14. What is p(-14)? -14 Let g(s) = -s*3 + 5s*2 + 4s + 4. Determine g(6). -8 Let y(m) = -2m2 + 2m. Calculate y(2). -4 Let t(m) = -m*3 + 2m*2 + 4m - 1. Calculate t(3). 2 Let r(c) = c*2 + 28c + 47. Determine r(-23). -68 Let y(q) = -4q3 + 3q*2 + 2q - 2. Calculate y(-2). 38 Let f(i) = 36i + 23. Give f(-3). -85 Let k(h) = h - 4. What is k(2)? -2 Let f(y) = 2y**3 - y - 2. Give f(-1). -3 Let	{ "pile_set_name": "DM Mathematics" }
'th term of 34, 26, 16, 4, -10? -b*2 - 5b + 40 What is the o'th term of -3, -3, -1, 3, 9, 17, 27? o*2 - 3o - 1 What is the m'th term of 3, -14, -43, -84? -6m2 + m + 8 What is the g'th term of 0, 170, 636, 1548, 3056, 5310, 8460? 25g*3 - 2g2 + g - 24 What is the p'th term of 96, 150, 192, 216, 216? -p3 + 61p + 36 What is the f'th term of 717, 1390, 1969, 2406, 2653, 2662? -8f3 + f2 + 726f - 2 What is the g'th term of 970, 966, 960, 952, 942? -g2 - g + 972 What is the g'th term of 46, 46, 52, 70, 106, 166, 256? g3 - 3g*2 + 2g + 46 What is the d'th term of 33, 100, 209, 360? 21d2 + 4d + 8 What is the h'th term of 102, 164, 226, 288? 62h + 40 What is the s'th term of -134, -259, -384, -509, -634, -759? -125s - 9 What is the f'th term of -17, 0, 35, 94, 183? f*3 + 3f2 + f - 22 What is the v'th term of 163, 165, 179, 211, 267, 353? v3 - 5v + 167 What is the w'th term of 22, 29, 12, -41, -142? -2w*3 + 21w + 3 What is the x'th term of -35, -36, -29, -8, 33, 100? x*3 - 2x*2 - 2x - 32 What is the w'th term of 4, 15, 34, 61, 96, 139? 4w2 - w + 1 What is the b'th term of 537, 1056, 1561, 2046, 2505? -b3 - b2 + 529b + 10 What is the y'th term of 7, 63, 217, 517, 1011? 8y3 + y2 - 3y + 1 What is the v'th term of 860, 837, 812, 785, 756? -v*2 - 20v + 881 What is the m'th term of 17, 30, 37, 26, -15? -2m3 + 9m*2 + 10 What is the x'th term of 34450, 34448, 34446, 34444? -2x + 34452 What is the q'th term of 247, 250, 253, 256, 259? 3q + 244 What is the u'th term of 4062, 8134, 12208, 16284, 20362, 24442, 28524? u2 + 4069u - 8 What is the h'th term of 154, 309, 464, 619, 774, 929? 155h - 1 What is the d'th term of 182, 373, 564, 755, 946, 1137? 191d - 9 What is the b'th term of -576, -2274, -5096, -9036, -14088, -20246, -27504, -35856? b*3 - 568b2 - b - 8 What is the f'th term of -34, -66, -96, -124, -150, -174, -196? f2 - 35f What is the p'th term of 338, 335, 332? -3p + 341 What is the l'th term of 127, 225, 333, 457, 603, 777, 985? l3 - l2 + 94l + 33 What is the g'th term of 35, 14, -7? -21g + 56 What is the d'th term of -39, -100, -209, -372, -595? -d*3 - 18d2 - 20 What is the m'th term of -97, -97, -95, -91, -85, -77? m2 - 3m - 95 What is the p'th term of -13, -50, -167, -412, -833, -1478? -8p*3 + 8p*2 - 5p - 8 What is the o'th term of -335, -331, -325, -317, -307, -295? o2 + o - 337 What is the l'th term of 16, 30, 38, 34, 12, -34? -l3 + 3l2 + 12l + 2 What is the p'th term of 234, 407, 580? 173p + 61 What is the q'th term of -115, -149, -181, -211, -239? q2 - 37q - 79 What is the d'th term of -59, -112, -165, -218, -271, -324? -53d - 6 What is the a'th term of -372, -370, -368, -366? 2a - 374 What is the s'th term of -31, -42, -17, 62, 213? 3s3 - 32s - 2 What is the m'th term of -16, -46, -76, -106? -30m + 14 What is the u'th term of 11, 27, 43, 59? 16u - 5 What is the r'th term of -1374, -1380, -1390, -1404, -1422, -1444, -1470? -2r2 - 1372 What is the i'th term of 146, 196, 236, 260, 262, 236? -i3 + i2 + 54i + 92 What is the y'th term of 140, 153, 162, 161, 144, 105, 38, -63? -y*3 + 4y*2 + 8y + 129 What is the o'th term of -44, -19, 52, 193, 428, 781, 1276, 1937? 4o3 - o2 - 47 What is the m'th term of 65, 63, 59, 53? -m2 + m + 65 What is the n'th term of -316, -641, -980, -1339, -1724, -2141, -2596? -n3 - n2 - 315n + 1 What is the y'th term of -16849, -16852, -16857, -16864? -y*2 - 16848 What is the x'th term of 382, 384, 386, 388, 390, 392? 2x + 380 What is the q'th term of -10146, -20292, -30438, -40584, -50730, -60876? -10146q What is the l'th term of -5, -5, 3, 25, 67, 135? l3 - 2l*2 - l - 3 What is the p'th term of -1892, -1890, -1888, -1886, -1884, -1882? 2p - 1894 What is the b'th term of -528, -1064, -1624, -2220, -2864, -3568, -4344? -2b3 - 522b - 4 What is the j'th term of 160, 150, 118, 52, -60, -230? -2j3 + j2 + j + 160 What is the w'th term of 901, 896, 889, 880, 869? -w2 - 2w + 904 What is the h'th term of 42, 43, 44, 45, 46, 47? h + 41 What is the k'th term of 31, 66, 125, 208? 12k2 - k + 20 What is the q'th term of -8, -15, -44, -107, -216, -383? -2q3 + q2 + 4q - 11 What is the d'th term of 58, 59, 60? d + 57 What is the a'th term of -69, -54, -27, 18, 87? a3 + 8a - 78 What is the x'th term of 19, 42, 73, 112? 4x2 + 11x + 4 What is the b'th term of 56, 39, 22, 5? -17b + 73 What is the g'th term of -13523, -13524, -13525? -g - 13522 What is the g'th term of -47, -33, -7, 31? 6g*2 - 4g - 49 What is the s'th term of -288, -282, -274, -264, -252, -238? s*2 + 3s - 292 What is the o'th term of -619, -1232, -1829, -2404, -2951? o*3 + 2o*2 - 626o + 4 What is the d'th term of -6130, -6132, -6134, -6136, -6138, -6140? -2d - 6128 What is the v'th term of 65, 68, 63, 44, 5, -60, -157? -v3 + 2v*2 + 4v + 60 What is the t'th term of 2794, 2796, 2798, 2800? 2t + 2792 What is the v'th term of 66, 75, 84, 93, 102? 9v + 57 What is the a'th term of 26, 36, 32, 14, -18? -7a2 + 31a + 2 What is the a'th term of -4, -2, 2, 8, 16, 26? a*2 - a - 4 What is the a'th term of 3, -20, -67, -150, -281, -472, -735, -1082? -2a*3 - 9a + 14 What is the g'th term of -636, -647, -672, -717, -788, -891? -g3 - g2 - g - 633 What is the f'th term of 12, 9, -16, -75, -180, -343? -2f3 + f2 + 8f + 5 What is the a'th term of 54, 106, 158? 52a + 2 What is the t'th term of -24, -51, -100, -183, -312, -499? -2t3 + t2 - 16t - 7 What is the d'th term of 149, 264, 379, 494? 115d + 34 What is the r'th term of 328, 625, 922, 1219, 1516, 1813? 297r + 31 What is the h'th term of 123, 130, 139, 150, 163? h2 + 4h + 118 What is the p'th term of -205, -205, -207, -211, -217? -p*2 + 3p - 207 What is the h'th term of -20, -32, -42, -50? h*2 - 15h - 6 What is the h'th term of 45, 61, 89, 129, 181? 6h2 - 2h + 41 What is the h'th term of 512, 524, 558, 626, 740? 2h3 - h2 + h + 510 What is the f'th term of -1614, -3227, -4840, -6453, -8066, -9679? -1613f - 1 What is the x'th term of -150, -644, -1466, -2616, -4094, -5900, -8034? -164x2 - 2x + 16 What is the c'th term of 29, 65, 105, 149, 197, 249? 2c2 + 30c - 3 What is the o'th term of -271, -1093, -2457, -4357, -6787? o*3 - 277o*2 + 2o + 3 What is the s'th term of 42, 35, 32, 39, 62? s*3 - 4s*2 - 2s + 47 What is the p'th term of 13, -43, -137, -269? -19p2 + p + 31 What is the z'th term of 9, 24, 63, 138, 261, 444, 699? 2z*3 + z + 6 What is the j'th term of -101, -123, -149, -179? -2j*2 - 16j - 83 What is the h'th term of -82, -85, -100, -133, -190, -277, -400? -h*3 + 4h - 85 What is the y'th term of -33, -119, -263, -471, -749, -1103? -y*3 - 23y*2 - 10y + 1 What is the x'th term of 76, 71, 66, 61? -5x + 81 What is the b'th term of -76, -160, -258, -376, -520, -696, -910? -b3 - b2 - 74b What is the p'th term of -25, 32, 183, 476, 959, 1680, 2687? 8p3 - p2 + 4p - 36 What is the x'th term of -22, -35, -48, -61, -74, -87? -13x - 9 What is the g'th term of 17, 55, 131, 257, 445? 2g*3 + 7g*2 + 3g + 5 What is the s'th term of -121, -163, -205, -247? -42s - 79 What is the p'th term of -61, -104, -145, -184, -221? p2 - 46p - 16 What is the v'th term of -55, -119, -203, -313, -455, -635? -v*3 - 4v*2 - 45v - 5 What is the t'th term of -148, -313, -500, -709, -940? -11t2 - 132t - 5 What is the a'th term of 506, 510, 514, 518? 4a + 502 What is the n'th term of 64, 127, 190, 253, 316? 63n + 1 What is the q'th term of -1, -27, -65, -109, -153, -191, -217? q*3 - 12q*2 + 3q + 7 What is the z'th term of 167, 178, 195, 218, 247? 3z2 + 2z + 162 What is the i'th term of -1412, -1408, -1394, -1364, -1312? i3 - i2 - 1412 What is the q'th term of 69, 57, 31, -15, -87, -191, -333? -q3 - q2 - 2q + 73 What is the o'th term of -10, -12, -18, -28? -2o*2 + 4o - 12 What is the h'th term of -6751, -6751, -6749, -6745, -6739, -6731? h*2 - 3h - 6749 What is the c'th term of -533, -512, -467, -386, -257, -68, 193, 538? 2c3 + 7c - 542 What is the f'th term of -6, -40, -100, -186, -298, -436? -13f2 + 5f + 2 What is the q'th term of -92, -181, -270, -359,	{ "pile_set_name": "DM Mathematics" }
plify (t/(tt/((ttt/t(-6))/t))t*3(tt(-9))/t10)(-19) assuming t is positive. t152 Simplify (a(-16)a8)/(a(-5/6)/aaa/(a(a/(aa*5a))/a)) assuming a is positive. a*(-85/6) Simplify (bb/(((b/b*(9/4))/bb)/b)(b(bb/((b(b*(-17)b)/b)/b))/b)/bb)/(b7)(-1/4) assuming b is positive. b25 Simplify (zz(-4/9))/z(-1)(z/z(1/2))(14/3) assuming z is positive. z(35/9) Simplify (mm/(m/m(-5/4)))/(m/(m(1/4)/m))(m/m1)(3/7) assuming m is positive. m(-2) Simplify ((x15/x)/(x(-13/5)/xx))/(x(1/5))44 assuming x is positive. x(39/5) Simplify ((k(-4))(5/11))(-5/3) assuming k is positive. k*(100/33) Simplify (mm*(28/9)/mmmm)/mm/m32m(-1/17)/(m/m(-31)) assuming m is positive. m(-8866/153) Simplify (m(-12)m)/mm*15((((m*(-2/13)m)/m)/m)/mmmm)/(((m10m)/mm)/m) assuming m is positive. m(-80/13) Simplify ((v(3/7))22)50 assuming v is positive. v(3300/7) Simplify (f(1/14)f*(1/6))/(((ff*(-13))/f)/ff*(5/6)f) assuming f is positive. f*(521/42) Simplify ((u/(u/(u((u/u*(2/103)u)/u)/u)))/u(-13/5))(3/17) assuming u is positive. u(5532/8755) Simplify (((t/t1)/t(1/3))(-44))(-7) assuming t is positive. t(-308/3) Simplify (q/q(-13/2))/q(-3/5)(q/q(2/33))/qq(-19) assuming q is positive. q(-3617/330) Simplify ((nn17)/n)/n(4/9)nn(-18)/nn(-1/2) assuming n is positive. n(-35/18) Simplify (aa(2/11)/aaa(15/2)/a)/((aaa/a(3/11))/a6) assuming a is positive. a(241/22) Simplify (n(-13)/n)/n(-9)n(6/11)/n4 assuming n is positive. n*(-93/11) Simplify (a/(aa(2/47)))(3/10)/((a*(-5)aa)/(a(a/((aa(-2/25)a)/a))/a)) assuming a is positive. a(3604/1175) Simplify ((f(-20)/ff)/((f20/ff)/f))/(f(-2/17))(1/28) assuming f is positive. f*(-9281/238) Simplify (nn*(-1/2)n)(-1/16)/(n/n(-1/2))(4/25) assuming n is positive. n(-267/800) Simplify (v3/v)(-23)(v(-1/4)/v)(-2/115) assuming v is positive. v(-2115/46) Simplify (o(-5)/(oo/((o/(oo(2/9)o)oo)/o)o))/(((o/((o(-1/3)/o)/oo))/oo)/(o(o*(1/17)o)/oo)) assuming o is positive. o(-1300/153) Simplify (k/(kk*2/kk))*(2/147)(k*(-7)k)/(k7/k) assuming k is positive. k(-1768/147) Simplify (o*(2/51)/ooo9oo)/((o/o(-3/7))/o)11 assuming o is positive. o(2258/357) Simplify ((i(ii(-2/7))/i)/i(4/7)i/i*(-1)i/((i/(i/(i/i(1/2))))/i))23 assuming i is positive. i*(1173/14) Simplify r/(rr/r*12)r*(-1/9)(rr(3/2))/rr2 assuming r is positive. r(259/18) Simplify ((j/j(-1/2))(2/83)/(j/(j/j*(-2))jj8))4 assuming j is positive. j(-2312/83) Simplify ((hhhh*(-1/7)/hh)/h)*(-3/10)(h0)(2/123) assuming h is positive. h(-39/70) Simplify (m(-3))*23((m*1/mm)/m)(13/5) assuming m is positive. m(-69) Simplify (((q*2qqq)/qq)(-2/29)/(q(2/3)/(q5/q)))(-3/5) assuming q is positive. q(-52/29) Simplify ((pp*(-9)pp(2/21))/(p(-2)p)40)(-36) assuming p is positive. p(-8340/7) Simplify ((j(1/3))*(1/9)/(jj*(2/7)j)(6/13))(-22) assuming j is positive. j*(55022/2457) Simplify ((o/(o(oo/(o/(o/(o(-23/4)o))))/o))/o*(-1/27))/(o(oo(1/37))/oo(-18)) assuming o is positive. o(44995/3996) Simplify l*8l(((l/(lll(-9))l)/l)/ll)/ll*(8/5)ll/(l(l/l*(-1/12)l)/l) assuming l is positive. l(1051/60) Simplify (s(-2/9)/ss(-4)(s(ss*(-2)s)/s)(-2/79))(7/12) assuming s is positive. s(-329/108) Simplify (y12/y)/(yy/y(-13))(y/((y*16/yy)/y))/y13 assuming y is positive. y(-31) Simplify (i*(1/8)i*(-10/11)i)/(i(-24))(-34) assuming i is positive. i(-71789/88) Simplify ((m/m(2/33))/(m*(-8)m))/(m/m*22(mm(1/17))/m) assuming m is positive. m(16202/561) Simplify (((m(1/3))(2/51))(-22))(-43) assuming m is positive. m(1892/153) Simplify (w(2/7))(-20)(w/(w(w1/w)/w)w)/w(-9/4) assuming w is positive. w(-41/28) Simplify ((((pp(2/37))/p)/(p/(pp*(1/13))p))/(pp(-1)pp/(p1p)))(8/5) assuming p is positive. p(-3344/2405) Simplify (m10)5/(m(-25)/((((m/m(1/10))/m)/m)/m)) assuming m is positive. m*(729/10) Simplify ((rr*(-10)r)/rrr/r(-12))/(r/(r(-1/15)r)rrrr/r(2/29)) assuming r is positive. r(436/435) Simplify (w(-14)/ww)/(w((w/(w(3/11)/w))/w)/w)(w(3/2)/w)(-2/133) assuming w is positive. w(-21557/1463) Simplify (y6/y)*(-1/23)/((((y/(y(y/(yy(-1/12)))/y)y)/y)/y)/(y/((yy(-1)/yy)/y))) assuming y is positive. y(515/276) Simplify v(-15)/v*(-20)(v(-14))(2/47) assuming v is positive. v(207/47) Simplify ((w8w(-2/7))/(w(-9)/((w(w/(ww(4/5))ww)/w)/w)))(-1/3) assuming w is positive. w(-592/105) Simplify (j(-3)j/j(-22))/(j(-20)j(j/(jj(-5/4)j))/j) assuming j is positive. j(159/4) Simplify s(2/15)/s*(-1/8)(s0)20 assuming s is positive. s(31/120) Simplify (z(-3/7))(-9)/(z(-8))39 assuming z is positive. z(2211/7) Simplify (g/(g/g*(-13)))/((gg*(-9)/g)/g)(g5)(7/3) assuming g is positive. g(26/3) Simplify (f(-4))*(-3/31)/(((f/(f/((ff*(-8/3))/f))f)/f)/(f/f11)) assuming f is positive. f(-646/93) Simplify u*9(u/(uu(-3/22)u))/u(u/u(-1/10))(-2/7) assuming u is positive. u(5253/770) Simplify ((oo1)(-2/61)/(o/(o/((ooo0)/o)))(6/7))27 assuming o is positive. o(-10638/427) Simplify ((vv(5/2))/v(-20))/(v(-19)vv/v(-24)vv) assuming v is positive. v(29/2) Simplify mm*(2/17)mmm*(-1/6)m(m(6/11)/m)31 assuming m is positive. m(-11377/1122) Simplify a/a(-6)aaaa(-2/13)((aaa*9aa)/a)/((a(-1/2)aa)/a) assuming a is positive. a(555/26) Simplify q(qq(3/4))/qqqqqqqqq/(q/(q((q(qq(qq*3)/q)/q)/qq)/q))qqqq5/q(-1/16) assuming q is positive. q*(349/16) Simplify ((mm/m*36mm)(5/13))(-46) assuming m is positive. m(7360/13) Simplify ((ff(1/4))40/(f(-1/3))(-40))(10/11) assuming f is positive. f(100/3) Simplify x(-1/4)/x(-32)x/(x(1/15)/x)x(10/7)/x assuming x is positive. x(14327/420) Simplify (((rr(-3/5))/r)/(rr/(r/(r*4rr))))/(r(-1/5))26 assuming r is positive. r(-12/5) Simplify ww/w*(2/13)(ww13)/ww/(ww(-11/5))w(-20) assuming w is positive. w(-192/65) Simplify ((m(-1))25/((m*(-2/23)m)/((mm(mm(-1/5))/m)/m)))(15/8) assuming m is positive. m(-1083/23) Simplify (m(-1))(12/5)(m(2/33)/m)/m(3/7) assuming m is positive. m*(-4352/1155) Simplify (ss/s*(1/9)s*(3/11)s(s(-2/3))(-1))39 assuming s is positive. s(4927/33) Simplify (k(k*(-30)/k)/kk)/(((kk24)/k)/k)(k/(k8/k))/k(-6/5) assuming k is positive. k(-289/5) Simplify (n(1/6)/n)/n*(-2/7)(n/n*3n)(-5) assuming n is positive. n(187/42) Simplify ((f*(-4)f)/f*(-3)(f*(-1/4)/ff)/(f/f(1/9)))43 assuming f is positive. f(-1763/36) Simplify (a(-4/13)/(a/(aa(-1)/a)))/((a(2/9)aa)/a)(2/75) assuming a is positive. a(-20536/8775) Simplify (l(-1)/(l/(ll*(-22)ll)))/(l/(lll(-14)/l)l(ll(12/5))/l) assuming l is positive. l(-192/5) Simplify (g(1/4)/(g1gggg)g(g/(ggg*(4/9))g)/ggg(1/5))(-36) assuming g is positive. g*(719/5) Simplify ((uu/(u*1u)u)27(u(1/8)/u)/(u(-6)/u))(-3/10) assuming u is positive. u(-159/16) Simplify ((z/z*(1/16))/(((zz/(z/(z/(zzzz(1/7)zz)))z)/z)/z))/((z/(z(zz/((z/(z(z/(zz(1/15)))/z))/z))/z))/z(-2)) assuming z is positive. z(6743/1680) Simplify (u/((u(1/4)/u)/u))26/(u(-4/9))47 assuming u is positive. u(1663/18) Simplify ((ii14ii)/(i(2/11)i))/(i*(-5/8)i(-25)) assuming i is positive. i(3647/88) Simplify (((t*(-1)t)/(t/t(-2)))19)(12/17) assuming t is positive. t(-684/17) Simplify (r/(rr/((r(1/40)r)/r)))*38/(((rr(-21))/r)/r)(-17) assuming r is positive. r(-8221/20) Simplify ((p/(p/p(-10)))/p*(-22))/(p/(p/(pp*(-2/43)))p7) assuming p is positive. p(174/43) Simplify ((k/(k(k/k(-6/7)k)/k)k6)(-12))(16/3) assuming k is positive. k(-1856/7) Simplify xx*(1/6)/xxx(-4)xx1x/(xx/(x/(((x5/x)/x)/x))x) assuming x is positive. x(-23/6) Simplify ((k(5/4)k7)/((k(11/4)k)/(k/k**(	{ "pile_set_name": "DM Mathematics" }
- f - 21 with respect to f. 7 Let i(b) be the first derivative of 1/7b7 + 0b*2 + 0b*5 + 1 + 0b4 + b3 + 0b6 + 0b. What is the third derivative of i(m) wrt m? 120m3 Let t(o) = o2 - o. Let q(z) = -25z*3 + 2z*2 - 2z + 42. Let x(u) = -q(u) + 2t(u). Differentiate x(n) wrt n. 75n*2 Differentiate 9 - 4p*3 + 2p*3 - 3p*3 + 7 with respect to p. -15p2 Let v(n) = -n4 - n*3 - n. Let l(s) = 71s*5 - 3s*4 - 3s*3 + 20s - 2. Let h(r) = -l(r) + 3v(r). Find the second derivative of h(o) wrt o. -1420o*3 Let x(i) = 44i*4 - 6i*2 + 7i. Let u(d) = -d4 + d2 - d. Let n(c) = 6u(c) + x(c). Find the second derivative of n(v) wrt v. 456v2 Let t(d) be the second derivative of d3/6 + d*2/2 + 2d. Let p be t(3). Find the first derivative of -h*4 + 2h*4 + 0h*p - 2 wrt h. 4h*3 Let f be (-20)/(-36)-3 + 2. Let i(a) be the first derivative of fa3 - a2 + 0a + 1. What is the second derivative of i(d) wrt d? 2 Let u(k) = -k6 - k4 - k2 - k - 1. Let c(w) = -w6 + 2w4 - 8w*2 + 2w + 2. Let z(n) = c(n) + 2u(n). Find the third derivative of z(r) wrt r. -360r*3 Suppose -1 = 2c - 5. Find the second derivative of r*2 + r + 0r + 0rc wrt r. 2 Let h(g) be the first derivative of 6g*5/5 + 2g - 7. Find the first derivative of h(r) wrt r. 24r3 Find the second derivative of 75w*5 - 4w - 41w5 - 39w*5 wrt w. -100w*3 Let z be (-2 + 1)/(1/2). Let r be (5/15)/(z/(-18)). What is the second derivative of q - 2q + 3q - rq*4 wrt q? -36q*2 Let m(l) be the first derivative of -2l7/21 + l4/3 - 4l - 8. Let g(i) be the first derivative of m(i). Find the third derivative of g(j) wrt j. -240j*2 What is the second derivative of -5l + 2l2 + l2 + 2l2 - l2 wrt l? 8 Let l = -6 + 11. Suppose -lq + 0h = -5h, 36 = 4q + 5h. Find the second derivative of 4g + 8 + 5 - 13 - qg2 wrt g. -8 Let p(u) be the first derivative of -32u*3/3 - 2u*2 + 4u - 39. Find the second derivative of p(l) wrt l. -64 Let i(p) = 76p4 + 7p*3 - 13p + 7. Let d(o) = 51o4 + 5o*3 - 9o + 5. Let c(k) = 7d(k) - 5i(k). What is the second derivative of c(w) wrt w? -276w2 Let n = 5 - 1. Let q = 7 + -7. Differentiate 2j*n + 1 + 1 + q with respect to j. 8j3 Let q(f) be the first derivative of -f6/30 + f*2/2 - 3f - 3. Let a(p) be the first derivative of q(p). Find the first derivative of a(j) wrt j. -4j3 Let i(k) = 10k5 - k4 - k2. Let m(z) = z5 - z4 - z2 + z. Let h(q) = i(q) - m(q). Find the second derivative of h(j) wrt j. 180j3 Let w(y) be the third derivative of -y8/21 - y5/10 - 15y*2. Find the third derivative of w(v) wrt v. -960v*2 Find the second derivative of 139 - 4z + 7z5 - 139 wrt z. 140z*3 Suppose -g + 20 = 4o, o = -2g - 6 + 18. Suppose 19 = l - oq - 3, -3l - 9 = 3q. Differentiate 0p3 + 0p*3 + 1 + lp*3 wrt p. 6p*2 Let g(i) = i - 5. Let x be g(7). Find the second derivative of 8v + xv4 - 10v*4 + 2v*4 wrt v. -72v*2 What is the first derivative of 2128 + 8g*4 - 2160 - 45g*4 wrt g? -148g3 Let i(p) be the third derivative of p10/75600 - p6/180 - p5/30 - p*2. Let l(c) be the third derivative of i(c). Differentiate l(u) with respect to u. 8u*3 Suppose -3i = -4i - 4k - 16, -2i = -3k - 23. Differentiate -1 + 0 - 1 + 1 - 3pi with respect to p. -12p*3 Find the second derivative of 3r*4 + 4r - 1 + 1 wrt r. 36r2 Let x(j) be the first derivative of 7j*5/60 + 5j3/6 - j2/2 - 2. Let f(g) be the second derivative of x(g). What is the first derivative of f(h) wrt h? 14h Let x(o) = -o2 - 6o + 2. Let t be x(-6). Find the second derivative of -4g2 + 6g3 - g3 + 4gt + 3g wrt g. 30g Let o = 157 - 97. Find the second derivative of -60d*3 - d - 4d*5 + od*3 wrt d. -80d*3 What is the derivative of 7c - 8 + 4c - 3 wrt c? 11 Find the second derivative of 10r - 7r2 + 5r*2 - 6r*2 wrt r. -16 Suppose -5c = x - 7, -5x + c + c = -8. Find the third derivative of -2m*2 + 5m*x + 0m*3 + 0m*3 - 2m*4 wrt m. -48m Find the second derivative of 12c2 - c2 - 34c + 22c2 wrt c. 66 Suppose -3u = -4 - 2. Let t be (-10)/(-6) - 4/(-12). Differentiate tp - 2p - 2 - up with respect to p. -2 Let n(r) be the third derivative of 8r*2 + 0r + 0r4 + 4/105r*7 + 0r*6 + 0r*5 - 2/3r*3 + 0. Find the first derivative of n(c) wrt c. 32c*3 Let p(v) be the third derivative of -3v7/70 - v4/8 + 8v2. Find the second derivative of p(q) wrt q. -108q*2 Let y(m) be the third derivative of 7m*6/30 + 7m*3/2 - 20m*2. Differentiate y(x) wrt x. 84x*2 Let m(d) be the first derivative of -34d*3/3 + 13d*2 - 2d - 45. Find the second derivative of m(x) wrt x. -68 Let q(v) be the first derivative of -3v4/2 + v + 8. What is the first derivative of q(t) wrt t? -18t2 Let r(y) be the second derivative of y9/252 + y5/60 - y2 - y. Let o(z) be the first derivative of r(z). What is the third derivative of o(h) wrt h? 240h3 Let i = 10 + 0. Suppose -5l + i = -5t, 8 = 2l + 2l - 5t. What is the derivative of 2 + 0g2 - 4g*2 + l wrt g? -8g Suppose -4h = -4i - 76, -2i = h - 4i - 23. Let n be (6/h)/((-1)/(-5)). What is the first derivative of 2c2 + c2 - 4c*n - 2 wrt c? -2c Find the first derivative of -4 - 5n2 + 7 - 4 wrt n. -10n Let u(n) be the third derivative of -n*7/30 - 2n*5/15 + 6n*2. Find the third derivative of u(o) wrt o. -168o Let s = -91 + 343. What is the first derivative of 2x4 - x2 - s + x2 + 253 wrt x? 8x3 Let c(u) = u2 + 9u + 11. Let a be c(-8). Find the third derivative of -5t*2 - 6t*3 + 2t*3 + 6t*a wrt t. 12 Let a be (-10)/(-6) + (-5)/(-15). Suppose 3s - a = 2s. What is the third derivative of -c4 + 2c*4 - 5cs + c2 + 0c4 wrt c? 24c Let p = -12 - -14. Let j(l) be the first derivative of -2 + 0lp + 3/4l*4 - l + 0l*3. Differentiate j(v) with respect to v. 9v*2 Find the third derivative of -14b*2 - 3b*2 - 4b*3 + 8b*2 wrt b. -24 Let c(z) = 6z*3 - 5z*2 + 13z - 5. Let j(x) = -9x3 + 8x*2 - 20x + 8. Let y(k) = -8c(k) - 5j(k). What is the second derivative of y(t) wrt t? -18t Let m(w) = w2 + w. Let n(u) = 3u. Suppose 0 = -2h + 5b - 23, -h - b = 4h - 10. Let d(g) = hn(g) + 3m(g). What is the second derivative of d(c) wrt c? 6 Let v(p) = 3p*2 - 5p. Let q be v(2). What is the third derivative of -k*2 + 7k*q + 6k*6 - 4k*6 wrt k? 240k3 Let k(p) be the first derivative of -p5/15 - p*3/6 - 2p*2 - 2. Let i(b) be the second derivative of k(b). Differentiate i(g) with respect to g. -8g Let j(a) = -2a3 + 1. Let b(q) = 8q*3 + 33. Let t(u) = b(u) + 6j(u). What is the derivative of t(s) wrt s? -12s2 Suppose 5 + 1 = -2d - 2v, 2v = -10. Suppose 14 + 0 = 4w - 2q, 2q = 5w - 16. What is the first derivative of y - y + d + y*w wrt y? 2y Differentiate 7 - 6v + 6v - 5v wrt v. -5 Let l be (-1)/(-1) - (0 + 1). Let b(j) be the second derivative of 1/4j*4 + 1/2j*2 + l - 2j + 0j3. Differentiate b(q) wrt q. 6q Let r(w) = -w*2 + 6. Let i be r(0). Suppose 2j - 8 = 2s, -4j - s + 26 = -0j. Find the third derivative of d6 - d2 - 4di + dj wrt d. -240d3 What is the second derivative of 7h*5 - 6h*5 - 9h - 9h5 wrt h? -160h*3 Let o(n) = 4n*3 + 3n*2 - 3n - 3. Let t(m) = -m*2 + m. Let s(w) = o(w) + 3t(w). Find the first derivative of s(a) wrt a. 12a2 Suppose -2f + 14 = -0f + 3m, -2m + 12 = 4f. Find the first derivative of 4 - 3l - 1 - f wrt l. -3 Let m(z) be the first derivative of -6z*2 + 10z + 4. What is the first derivative of m(q) wrt q? -12 Let g(n) be the first derivative of n8/112 - n5/15 - 3n2 - 1. Let w(p) be the second derivative of g(p). What is the third derivative of w(q) wrt q? 180q2 Let a(g) be the third derivative of -g7/210 + 47g3/6 - 28g*2. What is the first derivative of a(q) wrt q? -4q*3 Let a(n) = -2n + 1. Let q be a(-1). What is the derivative of -2c2 + 0 + 6c*2 + q wrt c? 8c Let c(z) = -24z5 - 6z*4 - 15z. Let x(q) = 49q5 + 13q*4 + 30q. Let k(m) = 13c(m) + 6x(m). What is the second derivative of k(i) wrt i? -360i*3 Let n(c) be the third	{ "pile_set_name": "DM Mathematics" }
a litre in millilitres? 6800 How many grams are there in 1153.919ug? 0.001153919 What is 1270.573 nanometers in meters? 0.000001270573 What is 0.1262414 litres in millilitres? 126.2414 What is 2192708.1ns in minutes? 0.000036545135 Convert 5931.394 kilometers to nanometers. 5931394000000000 Convert 1343.157kg to nanograms. 1343157000000000 What is 15.9682 millimeters in centimeters? 1.59682 How many millilitres are there in 52/5 of a litre? 10400 What is 615.4185 milligrams in kilograms? 0.0006154185 How many litres are there in 152.3136 millilitres? 0.1523136 How many litres are there in 705312.6ml? 705.3126 How many months are there in 19/4 of a century? 5700 What is 466.1513ml in litres? 0.4661513 Convert 3175.32 millimeters to centimeters. 317.532 What is 502400.4 litres in millilitres? 502400400 How many millilitres are there in twenty-seven fifths of a litre? 5400 How many micrograms are there in 12/25 of a milligram? 480 What is 11/8 of a microgram in nanograms? 1375 What is 21/4 of a milligram in micrograms? 5250 How many millilitres are there in 7/4 of a litre? 1750 How many grams are there in 2/125 of a tonne? 16000 Convert 2844.394 micrograms to milligrams. 2.844394 What is 3/5 of a century in months? 720 Convert 0.2795668g to micrograms. 279566.8 What is 29/5 of a millennium in decades? 580 What is 3/25 of a litre in millilitres? 120 How many minutes are there in 32/9 of a day? 5120 Convert 54440.26 millimeters to meters. 54.44026 How many nanometers are there in 13/5 of a micrometer? 2600 What is thirty-two fifths of a milligram in micrograms? 6400 How many minutes are there in 731312.1 seconds? 12188.535 What is seventeen quarters of a litre in millilitres? 4250 Convert 2.581419ng to grams. 0.000000002581419 What is 5/8 of a litre in millilitres? 625 How many months are there in seventeen halves of a decade? 1020 What is seven quarters of a litre in millilitres? 1750 How many decades are there in 33/10 of a millennium? 330 How many grams are there in 5518.655 nanograms? 0.000005518655 How many milliseconds are there in 77064.86 microseconds? 77.06486 What is 3/16 of a kilometer in centimeters? 18750 How many milliseconds are there in 1/24 of a minute? 2500 Convert 728.268 decades to years. 7282.68 What is five eighths of a milligram in micrograms? 625 How many millilitres are there in 17/2 of a litre? 8500 Convert 14.0523um to millimeters. 0.0140523 What is 8/15 of a hour in seconds? 1920 How many months are there in 68555.64 decades? 8226676.8 How many months are there in 3/10 of a century? 360 How many micrograms are there in 3/25 of a milligram? 120 How many months are there in 3/5 of a decade? 72 How many microseconds are there in 461.1232 days? 39841044480000 What is 7/6 of a millennium in months? 14000 What is 117.5848um in millimeters? 0.1175848 How many microseconds are there in seven quarters of a millisecond? 1750 How many meters are there in three fifths of a kilometer? 600 How many millimeters are there in twenty-nine halves of a meter? 14500 What is 81.52171 millennia in years? 81521.71 How many millimeters are there in 6/5 of a meter? 1200 How many tonnes are there in 0.8422477ug? 0.0000000000008422477 What is six fifths of a day in minutes? 1728 What is 1/4 of a kilometer in centimeters? 25000 What is 19821.645us in days? 0.0000002294171875 What is 0.0713853cm in millimeters? 0.713853 How many grams are there in 81/2 of a kilogram? 40500 What is 829.6728 seconds in milliseconds? 829672.8 Convert 0.7406859 kilometers to nanometers. 740685900000 How many millilitres are there in eleven eighths of a litre? 1375 What is three fifths of a millennium in years? 600 What is seventeen halves of a litre in millilitres? 8500 What is 0.4066192ng in grams? 0.0000000004066192 What is 0.2698648um in kilometers? 0.0000000002698648 Convert 857.9439l to millilitres. 857943.9 What is 5798.076 months in millennia? 0.483173 Convert 96616.02 days to microseconds. 8347624128000000 What is 3/40 of a litre in millilitres? 75 What is 2.4723099 milliseconds in minutes? 0.000041205165 How many micrograms are there in 9464.089 milligrams? 9464089 How many millilitres are there in 922988.6l? 922988600 Convert 6.325324 kilograms to milligrams. 6325324 Convert 8061.594cm to kilometers. 0.08061594 How many millilitres are there in seventy-three quarters of a litre? 18250 Convert 3526.516 nanometers to kilometers. 0.000000003526516 How many millilitres are there in twenty-one halves of a litre? 10500 How many micrometers are there in one quarter of a centimeter? 2500 How many millilitres are there in 17.73304 litres? 17733.04 How many millilitres are there in 11/2 of a litre? 5500 How many millimeters are there in 37/5 of a meter? 7400 What is 21/4 of a meter in centimeters? 525 Convert 9502.208 centuries to years. 950220.8 Convert 0.7343497 nanograms to micrograms. 0.0007343497 Convert 0.4440193 millennia to years. 444.0193 How many days are there in 104842.755s? 1.2134578125 What is 1/5 of a microgram in nanograms? 200 How many millilitres are there in 7/2 of a litre? 3500 What is 0.8499851m in micrometers? 849985.1 What is twenty-seven fifths of a litre in millilitres? 5400 What is one fifth of a micrometer in nanometers? 200 What is thirty-one fifths of a millisecond in microseconds? 6200 What is one tenth of a day in minutes? 144 Convert 0.4701652 millennia to months. 5641.9824 What is 21/4 of a micrometer in nanometers? 5250 How many millennia are there in 1529105.1 months? 127.425425 How many millimeters are there in 26/5 of a centimeter? 52 How many seconds are there in 3/40 of a hour? 270 Convert 59934.21ml to litres. 59.93421 What is 114313.7 micrometers in nanometers? 114313700 How many milligrams are there in 17/4 of a gram? 4250 How many centuries are there in 21/5 of a millennium? 42 What is three fifths of a tonne in kilograms? 600 What is nineteen tenths of a millennium in months? 22800 What is 226918.1ml in litres? 226.9181 What is two sevenths of a week in minutes? 2880 What is 269326.5 millennia in decades? 26932650 Convert 218.5948kg to micrograms. 218594800000 What is 55/4 of a gram in milligrams? 13750 How many kilograms are there in fourty-five quarters of a tonne? 11250 What is 91.46603 years in months? 1097.59236 How many decades are there in five quarters of a millennium? 125 Convert 1853.521 hours to milliseconds. 6672675600 How many years are there in 6952.5 decades? 69525 How many months are there in 4/3 of a millennium? 16000 What is twenty-nine fifths of a litre in millilitres? 5800 What is one sixteenth of a gram in micrograms? 62500 How many minutes are there in 37/5 of a hour? 444 What is 13/4 of a microsecond in nanoseconds? 3250 What is 5/6 of a millennium in months? 10000 What is 58.70752 years in centuries? 0.5870752 How many milligrams are there in 21/5 of a gram? 4200 What is one tenth of a second in milliseconds? 100 How many weeks are there in 30.10014us? 0.00000000004976875 How many nanograms are there in 1/5 of a microgram? 200 What is 60527.73l in millilitres? 60527730 What is 25/2 of a century in years? 1250 How many minutes are there in 4/3 of a day? 1920 What is 44/5 of a milligram in micrograms? 8800 How many milliseconds are there in 565477.1 weeks? 342000550080000 What is seventeen halves of a hour in seconds? 30600 What is 2164.4403s in minutes? 36.074005 Convert 4432.677s to nanoseconds. 4432677000000 Convert 2503.686 hours to days. 104.32025 How many months are there in four fifteenths of a millennium? 3200 What is 5/4 of a microgram in nanograms? 1250 Convert 7.041141 centuries to years. 704.1141 How many milligrams are there in 5.775705 nanograms? 0.000005775705 What is one twentieth of a hour in seconds? 180 How many months are there in 10/3 of a century? 4000 Convert 0.692639 nanometers to kilometers. 0.000000000000692639 How many milliseconds are there in five eighths of a minute? 37500 Convert 1204.2153 months to centuries. 1.00351275 How many micrograms are there in 3/25 of a milligram? 120 How many months are there in 1/30 of a millennium? 400 How many kilograms are there in 21/4 of a tonne? 5250 How many hours are there in 0.3026463 minutes? 0.005044105 Convert 15329.01 nanometers	{ "pile_set_name": "DM Mathematics" }
from rrhx. What is prob of sequence xr? 1/6 Three letters picked without replacement from pprrp. Give prob of sequence prp. 1/5 Three letters picked without replacement from {q: 5, v: 9}. What is prob of sequence qvq? 15/182 Two letters picked without replacement from {w: 2, i: 2, q: 1}. Give prob of sequence iq. 1/10 Calculate prob of sequence crah when four letters picked without replacement from hcyyaraawyayyawca. 1/4760 Two letters picked without replacement from rlfvxfvd. What is prob of sequence fr? 1/28 Calculate prob of sequence gmb when three letters picked without replacement from bmtgm. 1/30 What is prob of sequence vv when two letters picked without replacement from {f: 5, i: 2, v: 4, u: 2}? 1/13 Calculate prob of sequence bxx when three letters picked without replacement from {c: 2, x: 7, b: 3}. 21/220 Two letters picked without replacement from vsvaxet. Give prob of sequence sa. 1/42 What is prob of sequence hnhz when four letters picked without replacement from {h: 2, z: 1, n: 2}? 1/30 Two letters picked without replacement from {q: 8, t: 10, j: 1}. What is prob of sequence tj? 5/171 Three letters picked without replacement from ykk. Give prob of sequence kky. 1/3 What is prob of sequence xppx when four letters picked without replacement from {x: 5, p: 3}? 1/14 Calculate prob of sequence pp when two letters picked without replacement from uzppw. 1/10 Four letters picked without replacement from {o: 4, u: 3, z: 2, m: 2, f: 1}. Give prob of sequence mzuf. 1/990 Calculate prob of sequence ttht when four letters picked without replacement from {h: 9, t: 9}. 21/340 Three letters picked without replacement from {y: 7}. What is prob of sequence yyy? 1 Four letters picked without replacement from {h: 2, e: 2, n: 2}. What is prob of sequence nnhe? 1/45 Calculate prob of sequence pffs when four letters picked without replacement from {l: 2, a: 1, s: 1, x: 3, f: 5, p: 1}. 1/858 Four letters picked without replacement from {o: 3, z: 5}. Give prob of sequence zooo. 1/56 What is prob of sequence lx when two letters picked without replacement from {y: 1, x: 4, z: 3, l: 2, t: 1}? 4/55 Calculate prob of sequence mm when two letters picked without replacement from mqmmmmmqqmpmmmp. 3/7 Four letters picked without replacement from {y: 2, t: 2, r: 3, i: 1, d: 2, a: 4}. What is prob of sequence iaar? 3/2002 What is prob of sequence cb when two letters picked without replacement from {b: 4, q: 6, u: 1, c: 4}? 8/105 Two letters picked without replacement from gwggggwggwggwgwg. Give prob of sequence gw. 11/48 What is prob of sequence gj when two letters picked without replacement from {g: 5, r: 1, s: 1, j: 7, e: 1}? 1/6 Three letters picked without replacement from vvskvvkvsvvvskvvvksv. Give prob of sequence vvk. 22/285 What is prob of sequence xfx when three letters picked without replacement from {l: 1, f: 2, c: 2, x: 1}? 0 Calculate prob of sequence hrhr when four letters picked without replacement from hhhrhhhhhhhhri. 5/546 Four letters picked without replacement from crgccyycc. Give prob of sequence ygcc. 5/378 What is prob of sequence yvyv when four letters picked without replacement from {y: 4, v: 2}? 1/15 Three letters picked without replacement from {d: 3, e: 11}. Give prob of sequence dde. 11/364 Two letters picked without replacement from {y: 10, o: 2}. What is prob of sequence oy? 5/33 Two letters picked without replacement from {i: 10, t: 2}. Give prob of sequence it. 5/33 Two letters picked without replacement from oooyooyoyyoooyoooo. Give prob of sequence yo. 65/306 Two letters picked without replacement from {a: 3, j: 2, f: 6, x: 1}. Give prob of sequence xj. 1/66 What is prob of sequence ll when two letters picked without replacement from lllllll? 1 What is prob of sequence tt when two letters picked without replacement from {t: 5, y: 1, l: 11}? 5/68 What is prob of sequence eett when four letters picked without replacement from eeedetqddtetettffq? 5/612 Three letters picked without replacement from uguguuuuuuguuruur. What is prob of sequence ugu? 33/340 Two letters picked without replacement from {o: 1, j: 1, i: 1, r: 1, a: 1, u: 2}. What is prob of sequence ur? 1/21 Four letters picked without replacement from jywwyyywwwwywwjw. Give prob of sequence wyjj. 3/1456 Calculate prob of sequence aas when three letters picked without replacement from aqqqaqqaqqsqqqq. 1/455 What is prob of sequence oye when three letters picked without replacement from {s: 7, o: 4, e: 1, w: 4, y: 2, q: 2}? 1/855 What is prob of sequence vv when two letters picked without replacement from uvouqvtqouvoooqovpqo? 3/95 Calculate prob of sequence bmm when three letters picked without replacement from dddymmbbmmbm. 1/22 Three letters picked without replacement from vrgnrg. Give prob of sequence ngv. 1/60 Four letters picked without replacement from {g: 1, j: 4, e: 4, q: 2, r: 6, y: 3}. Give prob of sequence geyr. 1/1615 Calculate prob of sequence ll when two letters picked without replacement from hfllf. 1/10 Calculate prob of sequence kkk when three letters picked without replacement from {k: 8, p: 6, a: 3}. 7/85 Calculate prob of sequence mbbb when four letters picked without replacement from bbmbmmbmbmbmbbbbbbb. 143/1292 Two letters picked without replacement from ppccc. What is prob of sequence pc? 3/10 Three letters picked without replacement from {i: 2, j: 2}. What is prob of sequence iij? 1/6 Two letters picked without replacement from {q: 1, l: 2, b: 1}. What is prob of sequence ql? 1/6 Four letters picked without replacement from {z: 2, g: 7, p: 4, x: 2, e: 2}. What is prob of sequence gpgg? 1/68 Calculate prob of sequence mvr when three letters picked without replacement from gmmmtqrqmqqmv. 5/1716 Three letters picked without replacement from {x: 1, e: 1, c: 3, w: 1, j: 1}. Give prob of sequence wcc. 1/35 What is prob of sequence svas when four letters picked without replacement from vvasavalsasmssa? 5/546 Calculate prob of sequence eeq when three letters picked without replacement from {q: 2, l: 2, e: 2}. 1/30 Calculate prob of sequence csb when three letters picked without replacement from cbccs. 1/20 Calculate prob of sequence oxn when three letters picked without replacement from {n: 1, o: 8, q: 1, h: 2, v: 6, x: 2}. 2/855 Three letters picked without replacement from cavaxcwtatt. Give prob of sequence txv. 1/330 Two letters picked without replacement from {u: 1, e: 2, a: 8, x: 5}. Give prob of sequence ee. 1/120 Two letters picked without replacement from ixfxvffxmfxfifcvf. What is prob of sequence mv? 1/136 Calculate prob of sequence hh when two letters picked without replacement from {m: 14, h: 1}. 0 Calculate prob of sequence yt when two letters picked without replacement from {f: 3, y: 1, t: 1, q: 4, p: 8}. 1/272 Calculate prob of sequence my when two letters picked without replacement from {y: 3, x: 2, b: 1, v: 4, m: 2}. 1/22 Calculate prob of sequence vmv when three letters picked without replacement from vmmmmvvm. 5/56 Two letters picked without replacement from wqqvqww. What is prob of sequence vw? 1/14 Four letters picked without replacement from atfffattt. What is prob of sequence ftaa? 1/126 Calculate prob of sequence eia when three letters picked without replacement from {e: 1, i: 1, a: 1}. 1/6 Calculate prob of sequence xlzw when four letters picked without replacement from lwzwwxlww. 5/1512 Calculate prob of sequence yxyy when four letters picked without replacement from {x: 1, y: 18}. 1/19 What is prob of sequence vvvv when four letters picked without replacement from vvvvviivvvviviivvv? 143/612 Three letters picked without replacement from {i: 8, l: 3}. Give prob of sequence ill. 8/165 Two letters picked without replacement from {d: 1, r: 1, p: 1, w: 1, e: 1, f: 2}. What is prob of sequence wr? 1/42 Calculate prob of sequence xd when two letters picked without replacement from {d: 7, m: 1, r: 4, x: 6}. 7/51 Four letters picked without replacement from {t: 5, q: 3, f: 3}. What is prob of sequence ftfq? 1/88 What is prob of sequence vfv when three letters picked without replacement from {f: 11, v: 9}? 11/95 Two letters picked without replacement from {e: 2, g: 1}. Give prob of sequence eg. 1/3 What is prob of sequence zceo when four	{ "pile_set_name": "DM Mathematics" }
2? -6 12 + -9 - -4 - 7 - (-3 - 0) 3 Calculate -3 + -2 - (-25 + 23). -3 Calculate -8 - (-4 + (-10 - -20) + (-15 - -9)). -8 What is -3 + -7 + (-4 + (6 - -1) - -3)? -4 Evaluate 0 - (-1 + 0) - (60 - 86 - -7). 20 Evaluate 7 - 5 - (9 - 0) - 0. -7 What is the value of (13 - 1) + (-19 - -12) - (-5 - -28)? -18 What is the value of 1 - -8 - (-13 - (-40 - -4))? -14 What is -11 + 6 - -24 - 48? -29 What is 0 - (14 + 0 + -3)? -11 24 - (17 - (25 - 29)) 3 -3 - 10 - (-4 - (-3 - (5 + -10))) -7 (-21 - -8) + 13 - -13 13 What is 7 + (48 - 38) - (-16 + 0)? 33 Calculate 48 - 42 - (0 - 0 - (3 + -3)). 6 -8 - 6 - (-5 + (-4 - -3)) -8 What is 2 + (18 - 18) + -19? -17 What is 1 - (1 + -1 + 10)? -9 Evaluate ((18 - 14) + -13 - -6) + 6. 3 Calculate -3 - (-19 + (19 - 19)). 16 Calculate 0 + 3 + -23 + 6. -14 What is the value of -2 + 25 - (352 - 317)? -12 2 - (5 - 0 - (-7 - 1)) -11 Evaluate (-2 - (1 + 9 + (4 - 22))) + 19. 25 What is 97 + -87 + (3 - 10)? 3 Calculate (21 - 32 - 5) + 4. -12 What is the value of 0 + -10 - (6 + (21 - 15))? -22 What is 14 + (-11 - (-4 + 10)) + 0 + 16? 13 Evaluate 14 + 14 + -18 + 6 + 4. 20 What is -8 - (-18 + (8 - -20))? -18 Calculate 8 + -9 + -7 + -13 - 2. -23 What is the value of -1 - (-11 + 25 - (4 - (-1 - -2)))? -12 Evaluate -9 + 11 + 9 + -3. 8 Calculate -1 + 0 - (17 - -6 - 14). -10 Calculate -11 + (-9 - -12) - -15. 7 What is -2 + (-21 + 23 - (11 - 1))? -10 What is the value of (18 - 19) + -19 + 16 + -3? -7 What is the value of 1 + 1 + 1 + -11 + 12 + 4? 8 Evaluate 36 + -3 - (0 + (7 - 3) - -3). 26 Calculate 12 + (-14 + 7 - -2 - -2). 9 What is -9 + (3 - 4) - -4? -6 (0 - 8) + 1 - (-1574 + 1565) 2 Calculate -28 + -12 + 37 - (-2 - 15). 14 Calculate (-2 - 39) + 45 + (5 - 0). 9 Evaluate -1 + -5 + 3 + (-2 - -2 - -2). -1 Calculate 15 - 30 - -5 - (-1 - 3). -6 Evaluate -9 + (-9 - -35) + -26. -9 Calculate 1 - (-36 + 86 + -22). -27 Calculate 1 + (9 - 18) + -1. -9 Evaluate -18 + (6 - -11) - (0 + -1 + 9). -9 What is 4 + (-12 + (5 - -1) - -2) + -5? -5 What is the value of 8 + -26 + 5 + 18? 5 Evaluate (3 + 9 - 27) + 22 + (0 - 9). -2 Evaluate -11 + 20 + -5 - (3 - 1). 2 What is -5 + 1 - (-17 - (-6 - 2))? 5 -10 + (-19 - (-52 + 14 + 15)) -6 Calculate 14 - (-32 + 17 - -36). -7 13 + -6 - -5 - (3 - 2) 11 What is 7 - (-1 - (-3 - (4 + 1)))? 0 2 + -1 + -1 + 3 + 1 + 3 7 What is -3 + (-5 - -11) - (-3 + -3)? 9 -196 + 146 - (-23 + -1) -26 Evaluate (18 - 28) + 23 - (23 - -3). -13 -3 + 10 + -1 + -6 + -1 + -1 -2 -4 + (-16 + 18 - 11 - -11) -2 What is -4 - -1 - (43 - 57)? 11 What is the value of (-1 - (6 + -37)) + -49? -19 Evaluate 3 + 6 + 27 + -26 + 2 + -6. 6 What is the value of -2 + -1 - (-12 + 6 + (-3 - -1))? 5 Calculate -4 - -13 - (129 - 102). -18 What is the value of (-14 - (-1 + 3) - (-30 - -28)) + 0? -14 Evaluate (5 - 2 - (-31 - -41)) + 14 - 7. 0 Calculate (-22 - (-5 - 2)) + (-3 - -6 - -1). -11 What is (2 - (-3 - (2 + -14 - -1))) + 1? -5 Evaluate -3 + 35 + -8 + (-2 - 1 - 6). 15 What is 3 + (-27 + -2 - (-13 + (-10 - -22)))? -25 What is the value of (-2 - -14) + (-1 - 1) + (1424 - 1444)? -10 -20 - ((-10 + 6 - (-2 - -5)) + 5) -18 What is the value of 31 - 3 - (-4 + -9 - -14 - -11)? 16 What is the value of (-9 - 13) + (3 - 0) + 1 + 4? -14 -9 + (7 + -10 - 4) + 1 + 4 -11 (-6 - -16) + -3 + (2 + 1 - 37) -27 -14 - (-5 + 3) - (18 + -4 + 4) -30 What is 6 - (25 + -14 + 7 + -3)? -9 Calculate 23 + -28 + 29 - (0 + 5). 19 What is (-2 - -19) + -14 + -7 + (-2 - -3)? -3 What is the value of 0 - (-3 + -6 - -3)? 6 What is 44 - 43 - (3 + 1 - (1 + 25))? 23 8 + (37 - 66) + 13 -8 2 + -2 - 6 - (42 + -57) 9 What is 17 - 7 - (-10 + 6)? 14 Evaluate 4 + -9 + (22 - 45). -28 -7 - (-1 + 1 - (-24 + 13)) -18 Calculate -78 + 75 - (-13 - -2) - (2 - 5). 11 Calculate 31 - 26 - (8 + 15). -18 Calculate 8 + 5 - (1 + 0 + 0 + -5). 17 -4 + (16 + -25 - 2) + 1 -14 Calculate (1 - -1) + 22 + (6 - 15). 15 What is the value of (-5 - 3) + 8 - (1 + -4)? 3 -207 + 200 - (-1 - -15) -21 Evaluate 31 - (4 + -12) - 57. -18 What is the value of 29 - (11 - -12) - 9? -3 What is the value of (-17 + 46 - 32) + 16? 13 Evaluate 0 + (-2 - -2) + (109 - 105) + 12. 16 Calculate (-10 - -16) + -19 - -9. -4 What is (8 - 0) + (-2 - -12) + -17? 1 What is (4 - 20) + 0 + (-3 - -8)? -11 What is the value of -13 + (63 - 64) - (-1 - 14)? 1 (10 - 2) + -4 - (-12 + 4) 12 Evaluate -8 + -12 + (42 - 35). -13 What is (6 - -21) + -25 - (2 + 20)? -20 Calculate (-8 - 0) + (-70 + 96 - (-2 + -1)). 21 Evaluate 7 + 5 + -19 - (2 - -2). -11 What is the value of (0 - -8) + -8 + 21 + -7 + 9? 23 What is the value of -6 + 7 - (34 - 36)? 3 What is the value of (-8 - -4 - -11) + (-28 - -20)? -1 What is 9 + 23 + -10 - 22? 0 What is the value of -27 + 17 + 0 + 12? 2 Evaluate 3 + -11 + -20 + 26 + 0. -2 What is the value of (7 - (-2 - -9)) + 1 + 5 - -2? 8 Calculate -16 - -4 - 10 - -18. -4 Calculate 12 + (-6 - (-4 + -12 + 9 - -4)). 9 Calculate (-23 - -36) + -5 + 16 + 1. 25 -4 + 30 - 5 - -1 - (19 + -12) 15 Calculate -8 + (4 + -3 - (-34 - -48)). -21 What is -11 + -21 + 25 + 0? -7 What is (2 - 1 - -7) + -13 + 11 - -10? 16 (-1 - 8) + 45 + -47 - -6 -5 What is (-7 - -20) + -3 + -10 + 0? 0 Evaluate (-16 - -31) + -13 - -5. 7 What is the value of 1 - (-2 + -5 + -2) - (14 - -26)? -30 What is the value of (-25 - -17) + 10 + 2 + -14 + -3? -13 Evaluate -11 + 4 - -11 - (-4 - -8). 0 What is the value of 0 - 6 - (-3 + 17 + 135 + -150)? -5 Calculate (-1 - -10) + (5 - (0 + 3)) + 0. 11 Calculate 205 + -218 - (2 - -7 - (3 + 1)). -18 Evaluate (-110 - -119) + (-2 - -2) + -7 - -5. 7 What is 944 - 918 - (41 + 1)? -16 What is -1945 + 1980 - (25 - 0)? 10 (36 - -18) + -21 + -4 29 (22 - (-21 + 42)) + -19 -18 Calculate (-1 - (-4 - -1)) + 5 + -4. 3 Evaluate 1 + -3 - (201 + -149 - (22 + 4)). -28 (-41 - -32) + (2 - -16) 9 19 + -35 - ((-2 - -3) + -1 + -2) -14 What is the value of 5 + (-36 - -17) - -4 - -23? 13 Evaluate -11 - ((20 - 2) + -12 + -9). -8 Calculate (5 - (-6 - 0 - -14)) + 0. -3 Calculate -11 + (-1 - 3) - -3. -12 What is -2 + -6 + 11 + -25? -22 (0 - 3) + 8 - (2 + 7) - -5 1 Evaluate (650 - 646 - (0 - -6)) + (24 - -1). 23 9 + -4 - (2 + -13 + 18) -2 Evaluate 63 + -66 - (-12 + 6). 3 Calculate -9 - (-11 - -9 - -6). -13 39 - (13 - (9 - 16)) 19 What is (-2 - 15) + 21 + 4 + -7? 1 Calculate 11 - -3 - (82 - 70). 2 Evaluate (-34 - -33) + (1 - 2) - (1 + -7). 4 Evaluate -25 + 15 + -14 + -4 + -2 + 10. -20 What is the value of (3 - (0 - 7)) + -17? -7 What is -10 + -2 - (-80 + 79)? -11 Evaluate -95 + 84 - (1 + 0 + -5). -7 Calculate -6 + 2 + (10 - 3 - (1 + -1)). 3 -10 - -4 - (-6 + (-12 - -9)) 3 3 + (2 - 4) - (20 + 20) -39 What is the value of 4 + -1 - (1 - -1 - 4)? 5 Calculate (2 + -1 - 1) + -29 + 48 + -30. -11 Calculate 1 - (-1 + (4 - 7) + 16). -11 2 - 1 - (12 + 3 + -3) -11 Calculate -10 + (6 + 2 - 16) - 5. -23 Evaluate -1 + -5 + 5 + 5. 4 Evaluate -3 + (-2 + (-9 - -7) - -19). 12 What is -11 - (-14 + 13 + 9)? -19 Evaluate -21 + 15 - (1 + 1) - (4 - 1). -11 What is the value of 1 + (2 - 16) + (-11 - -4) + 13? -7 Evaluate 48 - 26 - 33 - -15. 4 What is the value of -7 + -8 + 3 - (-31 + -1)? 20 Calculate (-273 - -275) + -1 + (0 - 8). -7 What is 0 + -9 + -9 + 11 + 2? -5 Calculate 4 - (7 + 11 + -22 + 6). 2 Evaluate -28 - (3 - 21 - (-5 - 1)). -16 What is the value of -5 - (-4 - (-2 - 8 - -12)) - -25? 26 Evaluate -3 + (-2 - (-6 + -2 + 7)) + 9. 5 Calculate 287 + -281 + 1 + 3. 10 Evaluate 30 + -17 + (-16 - 3) - (0 - -9). -15 144 + -146 - ((3 - 1 - 2) + 14) -16 (10 - 8) + -9 + -5 + -1 -13 Calculate -27 + -2 + 16 + 1. -12 Calculate (-24 - (-15 + 8)) + 13. -4 What is (14 + -14 - -17) + -2? 15 -23 - ((-26 - 7 - (1 - 13)) + 11) -13 Evaluate 3 + 8 - 10 - -9 - 7. 3 Calculate 6 + (-1 + 4 + -30 - (55 + -59)). -17 What is -1 + -2 - (-87 + 97)? -13 Calculate 4 + 23 - 49 - -51. 29 Evaluate -12 + -9 + (-14 - -28 - 11). -18 Calculate 8 - (1 - -14 - (11 + -9)). -5 15 + 6 - (-3 + (-8 - -17)) 15 -15 - 3 - (-133 - -124) -9 Calculate 9 + 19 + (-10 - -8). 26 What is 7 - (-4 - -4 - 4 - -7)? 4 What is the value of (285 - 260 - (-1 + 0)) + -10? 16 Calculate -20 - (-20 + -14 + 16). -2 Evaluate 40 - (66 - (-24 + 9)). -41 What is the value of -25 - ((-18 - -17) + 0 + -3 + -1)? -20 Calculate 6 - (-16 + (2 - 2) - -6) - 2. 14 What is 2 + -8 + 4 + (-3 - 10) + 9? -6 What is -7 + (-14 + 9 - 1) + 11? -2 What is (7 - 1) + -57 + -39 + 105? 15 49 + -57 - (1 - 4	{ "pile_set_name": "DM Mathematics" }
is the derivative of fq3 + fy + 50f + 5q*3 + 5qy wrt f? q3 + y + 50 Find the third derivative of -57m5 - m3 + 4m2 - 8m wrt m. -3420m2 - 6 Differentiate -384s*4 - 297. -1536s*3 Find the first derivative of 2f*2h*2r + 7f2r - 2f2 + 3fr + 103h*2 wrt r. 2f*2h*2 + 7f*2 + 3f Find the second derivative of 6g2i*2 - 59g*2n*3 + 2gi2n*3 - gi*2n*2 - 59gin*3 - 9g wrt g. 12i2 - 118n*3 Find the third derivative of -2d*5r + 7d4r*3 + 17d*3 + 735d*2r*3 + 2d*2r wrt d. -120d2r + 168dr*3 + 102 What is the derivative of 3p*2 - 6p + 59? 6p - 6 Differentiate -21j*3 + 36j*2 + 1248 wrt j. -63j*2 + 72j What is the second derivative of -8b3s - 52b2s - 744bs + 7s + 1 wrt b? -48bs - 104s Find the second derivative of q*3 - 1866q*2 + 4q - 157. 6q - 3732 What is the third derivative of -256a*3 - 5a*2 + 6 wrt a? -1536 Find the second derivative of 3o*3 + 3o*2w*2 - 921o*2w + 3ow - 79o + w2 + 1 wrt o. 18o + 6w2 - 1842w What is the second derivative of 27g2qsv*2 + 2g*2sv2 + g2sv - 7gqs - 3gqv + sv2 - v2 wrt g? 54qsv2 + 4sv2 + 2sv Differentiate -296g*3u - 2g3 - 198 wrt u. -296g*3 What is the third derivative of 54o5 + o4 + 121o2 + 2? 3240o*2 + 24o Differentiate m*4 + 69m*3 + 3m + 5561. 4m3 + 207m*2 + 3 What is the second derivative of 6g*3r*2 - 4g*3rs + 3g*3s + 15gr*2s - 36gs wrt g? 36gr*2 - 24grs + 18gs Find the first derivative of -108x + 68. -108 What is the third derivative of 674i*5 + 2i*3 + 1048i*2? 40440i*2 + 12 Differentiate -133cj - 2c - j*3 + 674 with respect to j. -133c - 3j2 What is the third derivative of -430g*3 - 22g*2 + 3g + 19? -2580 What is the second derivative of -282s2 + 69s + 2? -564 What is the third derivative of 94f4 - f3 - 1995f*2? 2256f - 6 What is the first derivative of -7fp*3 + 4fp2 + 6fp + 3f - 85 wrt p? -21fp*2 + 8fp + 6f What is the third derivative of aw4 + 109aw2 - 5a + 498w4 - 2w*3 wrt w? 24aw + 11952w - 12 Find the third derivative of -249w6 - 207w*2 wrt w. -29880w*3 Find the third derivative of -20656f*4 - 5897f*2. -495744f What is the derivative of 75m - 288 wrt m? 75 What is the second derivative of 3n*2s*2 + 39n*2sv3 + 2ns2v - ns2 + 6sv3 wrt n? 6s*2 + 78sv3 Find the second derivative of -5t*4 + 78t*3 - 106t + 3. -60t2 + 468t Find the third derivative of -101ab*3 - 6ab2 - 10a - 12b4 + b2 wrt b. -606a - 288b Find the second derivative of 27255b*3 + 5984b + 1. 163530b What is the derivative of 199r*3 + 2r*2 - 926 wrt r? 597r*2 + 4r Find the second derivative of -54dk*3 - 12dk - k5 + 7k wrt k. -324dk - 20k3 What is the first derivative of 20464w - 28966? 20464 What is the derivative of -gmv - gt3v - 8gt*2v*2 + 2mtv - mv2 - 555t*3v wrt g? -mv - t3v - 8t2v*2 Find the third derivative of -574q*3x - 2q2 - 4q + 69x wrt q. -3444x Find the second derivative of 223c2 + 24c + 1 wrt c. 446 Find the second derivative of 2a2gqy*2 - 8a*2gy2 - a2y + 2agqy - 10ag - 2aqy2 + 8gq wrt y. 4a*2gq - 16a*2g - 4aq What is the second derivative of -fo2s - 2fo - fs + 4o*2sv2 + 3o*2v*2 - ov*2 + 25o wrt o? -2fs + 8sv*2 + 6v*2 What is the first derivative of 417u*2 - 75? 834u Find the second derivative of -2bi*3 - 2bi + 8b - 2174i3 + 13i wrt i. -12bi - 13044i Find the third derivative of -274m*6 + 4m*5 + 3m*3 + 10m*2 - 11m - 47 wrt m. -32880m3 + 240m*2 + 18 What is the third derivative of -12877o*3 + 11766o*2 wrt o? -77262 Find the first derivative of 54i*3 - 3i*2 + 193. 162i*2 - 6i Find the second derivative of -2j2u*2v - 2j2u*2 - 88j*2uv2 + 4ju2 - 9jv + 3u*2v*2 wrt v. -176j*2u + 6u2 Find the third derivative of 57i*5v*3 + 2i*2v + 2iv*3 + 91v wrt i. 3420i2v*3 Find the first derivative of 853w - 816. 853 Find the second derivative of 2pw*4 - 7pw3 - 59pw2 - 233pw - 2p wrt w. 24pw*2 - 42pw - 118p What is the second derivative of -2f3h*3 + 36f*3h + 2f3 - 3f*2h + 243fh*4 wrt h? -12f*3h + 2916fh*2 What is the second derivative of 2i*2mw - 6i*2m + 872i2w - i*2 - 5im - 11iw + 2mw + 2w - 2 wrt i? 4mw - 12m + 1744w - 2 What is the derivative of 444h4 + 2583? 1776h*3 Find the second derivative of -3d*3x + 12d2x*2 + 2d + 409x2 wrt d. -18dx + 24x*2 Find the third derivative of 7b*4 + 3b*3 - 9b*2 + 18b. 168b + 18 What is the second derivative of 291d*4 + 7d3 - d2 - 3d + 4056? 3492d*2 + 42d - 2 Differentiate -4g3q*2 - 1722g*3 + 2g*2 + 4gq2 - 21q*2 wrt q. -8g*3q + 8gq - 42q What is the first derivative of 3l*3 - 163l*2 - 632 wrt l? 9l*2 - 326l What is the third derivative of -58l3mr3 + 2l*3mr2 + 8l*2m + 2l2r3 - l2r2 wrt l? -348mr3 + 12mr2 Differentiate -22861gl2 + 24057l*2 wrt g. -22861l*2 What is the first derivative of -2o*3v + 50o3 + 3o*2v - 234v wrt o? -6o*2v + 150o2 + 6ov Differentiate 8k*3 - 304k + 3286 with respect to k. 24k2 - 304 Find the second derivative of -33h*4 + 6h*3 - 1417h wrt h. -396h2 + 36h Differentiate -9g3q*2 + 22gq2 - 857q*2 with respect to g. -27g*2q*2 + 22q*2 Find the first derivative of -3t*2x - 29t2 + 2tx - 9x - 10 wrt t. -6tx - 58t + 2x Find the third derivative of -212u5 - 234u*2. -12720u*2 What is the first derivative of -23u*3 - 2u*2 - 2u - 6437 wrt u? -69u2 - 4u - 2 What is the third derivative of -6057v6 - 5v*2 - 338v? -726840v3 Find the second derivative of -d3j*3l - 8d3 - d2l - 140dj*3l - 6j wrt j. -6d*3jl - 840djl Find the third derivative of -46b3ku - b3k - b*3u*2 + 4b*2ku2 + 4b*2u*2 + 2b*2 + 5k wrt b. -276ku - 6k - 6u*2 Find the second derivative of 1719l*3 + 6103l wrt l. 10314l What is the second derivative of -202x*5 + 729x? -4040x3 What is the first derivative of 4g*2n2 - g2 + 167gn + 1406 wrt n? 8g2n + 167g Find the third derivative of -22902b*5 - 20166b*2. -1374120b*2 What is the third derivative of -6d*2f*3u*3 + 2d*2f*3u2 - d2u - 2df3u - 5f3u3 - f2u2 wrt u? -36d*2f*3 - 30f*3 What is the first derivative of -4j*2k - 6jk*2 + 84k*2 wrt j? -8jk - 6k*2 Find the second derivative of -2f*3i3 - f3i - 2f*3 + 6350f*2i*4 - 58fi - 10i wrt i. -12f3i + 76200f2i*2 What is the third derivative of 8o*5 - 6o*4 + 77o*2 wrt o? 480o*2 - 144o What is the second derivative of -93p2 - 101p? -186 What is the third derivative of -425n4 + n2 - 76 wrt n? -10200n Find the second derivative of 2u2w2 + u2w + 126u*2 - 69uw4 - w3 wrt w. 4u*2 - 828uw2 - 6w What is the derivative of -f*4k*3 + 49f*4k + 157k3 wrt f? -4f*3k*3 + 196f*3k What is the second derivative of k*5 - 722k*3 - 292k - 5 wrt k? 20k3 - 4332k What is the third derivative of 5cj*4w*2 - 479cj4w - 11cj*2w*2 - cj*2w - 8cw*2 wrt j? 120cjw*2 - 11496cjw Find the second derivative of z*3 - 1823z*2 + 1683z. 6z - 3646 Find the third derivative of 3n*4o*2 - 10n*3o*2 - 6n*2 + no*2 - 2n wrt n. 72no*2 - 60o*2 What is the third derivative of -34l*6 + 2l*4 + 325l*2? -4080l*3 + 48l Differentiate 2m2q + 33m2 + mq - 16m + q + 2873 wrt m. 4mq + 66m + q - 16 What is the derivative of 1504w3 - 1608? 4512w*2 Find the third derivative of 7152o*3 - 2444o*2 wrt o. 42912 What is the third derivative of 2h*2r*4 + 27h*2r + 15hr*4 - 3hr2 wrt r? 48h*2r + 360hr Find the second derivative of 42m2p*3 - 2m*2pv + 172m*2 - 2mp3 + 15mp2v - mv wrt p. 252m*2p - 12mp + 30mv Differentiate 5jo*2 - 389jo + 3899j wrt o. 10jo - 389*j What is the se	{ "pile_set_name": "DM Mathematics" }
on divisor of s and k. 7 Let p(u) = -u + 49. Let s be p(-39). Let c = 15 - 4. Calculate the greatest common factor of s and c. 11 Let j be 2 - (1 + 2/2). Let u(b) = b - 5. Let t be u(5). Let p be j - (t + 1)-2. Calculate the highest common divisor of 14 and p. 2 Suppose l + 2 = 0, -5y - 2l = -4 - 2. Suppose 7 - y = 5h. What is the highest common divisor of 9 and h? 1 Let k(i) = 31i - 9. Let c be ((-12)/(-10))/((-10)/(-75)). Let f be k(c). Calculate the highest common divisor of f and 30. 30 Let y(v) = 2v*2 - 8v - 3. Let o be 2/(-4) - (-75)/10. Let p be y(o). Calculate the highest common divisor of p and 13. 13 Let k be 110/15 - 1/3. Let j be 14/k - 1-11. Let o be (-1 + 4)/((-3)/(-117)). Calculate the highest common factor of o and j. 13 Let r(i) = 4i - 17. Let h = 12 + -9. Suppose -4o - 3t = -58, ho + o = 4t + 44. Let w be r(o). Calculate the greatest common factor of 7 and w. 7 Let o(q) be the first derivative of q*3/3 + 2q*2 + q + 3. Let a be o(-3). Let v = 0 - a. What is the greatest common divisor of 3 and v? 1 Let z = 128 - 76. Let j(w) = -w. Let b be j(1). Let v be (-1 - b) + 10 + 3. Calculate the greatest common divisor of v and z. 13 Let f(c) = 3c*2 + 5c - 22. Let n be f(3). Suppose 11 = 2p + 3. Calculate the highest common divisor of p and n. 4 Suppose 4c = 2c + 24. What is the highest common factor of c and 9? 3 Suppose -3j = 7j - 600. Suppose 0 = -3v + 4v - 3. Suppose -4 = -vd + 26. What is the greatest common divisor of j and d? 10 Let d(w) = -w - 1. Let y be d(-4). Let b = y - 1. Calculate the greatest common factor of b and 5. 1 Let o = 136 + -76. Suppose 2a = -0a + 28. Let t be -12 + a/1. Calculate the greatest common factor of o and t. 12 Suppose 0 = -s + 2s, -3s + 63 = u. What is the highest common divisor of u and 7? 7 Let f(q) = -q3 - 6q*2 + 8q + 13. Let s be f(-7). Let y = 18 - s. Calculate the highest common factor of y and 6. 6 Suppose 0 = 5b - 7 - 43. Let w be (-150)/(-3) + -1 + 1. What is the greatest common divisor of b and w? 10 Suppose -g + 17 = 2. Let c be ((-294)/15)/((-3)/g). Calculate the greatest common factor of 14 and c. 14 Let d be 30((-88)/(-12) - 4). Calculate the greatest common factor of 20 and d. 20 Suppose 0 = -5k - 5 + 20. Let f(j) = j2 - 3j + 1. Let n be f(k). Calculate the greatest common divisor of 8 and n. 1 Let a(b) = b*3 + 20b*2 - 15b - 12. Let h(g) = 10g2 - 7g - 6. Let k(y) = 2a(y) - 5h(y). Let c be k(6). What is the greatest common factor of c and 12? 12 Let s = 69 + -41. Calculate the greatest common factor of 308 and s. 28 Let v be (-34)/(-17)(-70)/(-4). Suppose 0 = u - 0 + 1. Let k be 7 + (-4)/((-2)/u). Calculate the greatest common factor of k and v. 5 Let t(x) = -4 + x - 3x + 0 + 15x. Let n = 5 + -2. Let p be t(n). Calculate the greatest common divisor of p and 7. 7 Let v = -11 - -18. Let t = -94 - -143. Calculate the highest common factor of v and t. 7 Let t(s) = -s2 - 5s. Let x be t(-3). Suppose w = 2w - x. Suppose 130 = wk - k. What is the greatest common factor of 65 and k? 13 Let c(l) = l3 + l2 - l + 1. Let y be c(0). Let o be 1/y(-6)/3. Let k be 146/12 - o/(-12). What is the highest common divisor of k and 132? 12 Let x = 87 - 60. Let k = 34 - 19. Suppose -f - 4f + k = 0. Calculate the greatest common factor of x and f. 3 Suppose -6z - 55 = -11z. Suppose 3i - 2c = 4, 1 = -4c - 7. Let a be (1 + i)(13 - 2). What is the greatest common divisor of z and a? 11 Let f(l) = 2l2 + 3l - 2. Let v be f(-4). Let w = -2 + 4. Suppose -4b = -q - 3q + 64, q - 4 = -wb. What is the greatest common factor of v and q? 6 Suppose 3y - 140 + 50 = 0. Suppose -5q = -0i + i + 336, -3i - 124 = 2q. Let o = q + 143. What is the greatest common factor of o and y? 15 Let y = -4 - -6. Let s be (y - 1) + 1 + 43. Calculate the greatest common divisor of 9 and s. 9 Let s = -1 + 21. Let w = s + -16. Let y(l) = 28l. Let m be y(1). What is the greatest common factor of m and w? 4 Let w(t) = 2 - t + 0 - 5. Let u be w(-7). Calculate the greatest common factor of 32 and u. 4 Let c(q) = -q2 + 22q - 8. Let y be c(9). Suppose -2w + y - 1 = 0. Calculate the highest common divisor of w and 18. 18 Let s(r) be the first derivative of 2 - 5/2r*2 - 1/3r*3 - 3r. Let c be s(-4). What is the highest common factor of 1 and c? 1 Suppose 0 = w - 1 - 20. Let x(j) = 6j2 - 6j + 9. Let u be x(6). Calculate the highest common factor of u and w. 21 Let q(j) = 11j - 6. Let d be q(4). Suppose -3v = -5v + 62. Suppose -3r = -26 - v. What is the greatest common divisor of d and r? 19 Suppose -6a + 3a + 20 = 4p, -20 = 5a. What is the highest common factor of 1 and p? 1 Suppose -2l + 16 = 2l. Let i = -2 - -7. Suppose -1 = -ih + 9. Calculate the greatest common divisor of l and h. 2 Let q be ((-2)/6)/(2/(-6)). Suppose 3c - 3 = 3. Calculate the highest common divisor of c and q. 1 Let r(p) = 76p - 20. Let n be r(5). Calculate the greatest common divisor of n and 45. 45 Let o = -5 + 9. Let a(w) = w - 3. Let n be a(7). What is the greatest common factor of o and n? 4 Let k(p) = 44p + 2. Let t be k(-1). Let i be t/(-35)(-20)/(-6). What is the greatest common factor of 4 and i? 4 Let h be -6(-3)/6 - 10. Let q be 2/h - 710/(-35). Let t be 2 - 78/(2 + -3). Calculate the greatest common divisor of q and t. 20 Let p be -2 + -1 - 180/(-9). Calculate the greatest common factor of p and 272. 17 Suppose 180 = -0t + 4t. What is the greatest common factor of t and 15? 15 Let b be 6/(-4)8/(-6). Suppose -4t + bw = 0, -3t + 3w = -2w - 14. Let z(j) = 2j2 + 3j. Let o be z(t). What is the highest common divisor of o and 10? 2 Let n = -16 + 28. Calculate the highest common divisor of n and 108. 12 Suppose 0 = 2b + a - 495, b - 2b = -3a - 230. Calculate the greatest common divisor of b and 49. 49 Suppose 4w = 15 - 3. Suppose -70 = -4b - b + 2t, -14 = -b - wt. Let a(f) = f2 + f + 154. Let s be a(0). What is the greatest common factor of s and b? 14 Let f = 19 + -16. Let c be 7/1 - f - -2. Calculate the highest common factor of c and 48. 6 Suppose -2n + 256 = 2l, -3l - 3n + 4n + 376 = 0. Suppose 0 = c - 2 + 65. Let j = l + c. Calculate the greatest common divisor of 7 and j. 7 Let g be 3215(-2)/(-8). Let s = 15 - 0. Calculate the highest common factor of s and g. 15 Let c(v) = v*3 + 4v*2 - 6v - 4. Let u be c(-5). Suppose 0 = -7i - 20 + 27. What is the greatest common divisor of i and u? 1 Let x(k) = -k3 + 7k*2 - 2k - 6. Let q be x(6). Let l = 117 + -115. Calculate the highest common factor of l and q. 2 Suppose 6 + 19 = 5g. Suppose ga - t - 58 = 0, -2t - 3t = 4a - 58. Let x = -5 - -8. Calculate the highest common factor of x and a. 3 Suppose -2r + 20 = -0r. What is the highest common factor of 40 and r? 10 Let u(c) = c3 + 2c*2 - 4c - 3. Let j be u(-3). Suppose -2p + 4 = -j. Let b = p - 1. What is the highest common divisor of 3 and b? 1 Let m(q) = -q2 + 16q + 18. Let u be 2/7 - (-89)/7. Let h be m(u). Calculate the greatest common divisor of h and 38. 19 Let j(h) be the third derivative of h*5/60 + 5h4/24 - h3 - 4h2. Let l be 30/9-3 - -3. Let n be j(l). What is the highest common factor of n and 1? 1 Suppose -4k + 2k + 14 = 0. Calculate the highest common factor of k and 77. 7 Let x(i) = 8i2 - 68i*3 - i + 3i*3 - 10i*2. Let y be x(-1). What is the highest common factor of 16 and y? 16 Let r(o) = -17o - 1. Let g be r(-8). What is the highest common divisor of g and 15? 15 Let q(f) = -13f - 1. Let v be q(-1). Calculate the highest common divisor of 6 and v. 6 Suppose 0 = 10h + 2h - 288. Calculate the greatest common divisor of 96 and h. 24 Let i(y) = 2y*2 + 10y - 4. Let p(a) = 2a2 + 11a - 5. Let n(u) = -2i(u) + 3p(u). Let m be n(-10). What is the greatest common factor of m and 9? 9 Let p(o) = -o3 - o2 + o + 24. Let z be p(0). Let y be (z/10)/(8/20). Calculate the highest common divisor of y and 12. 6 Let w(q) = q*3 - 4q*2 + 6q - 7. Let a be w(5). Let d(b) = -7b - 24. Let z be d(-8). What is the highest common factor of a and z? 16 Let k(l) = l - 3 + 0l - 2 - 4. Let m be k(8). Let s be (14/10)/(m/(-5)). What is the highest common factor of 21 and s? 7 Suppose -14*n	{ "pile_set_name": "DM Mathematics" }
t -395830 (base 10) to base 14. -a4378 2421544 (base 8) to base 9 1222364 What is -10d5cb (base 16) in base 4? -10031113023 Convert 1423044 (base 6) to base 7. 455143 -211232301 (base 5) to base 7 -10336442 -194986 (base 10) to base 12 -94a0a What is 1005521 (base 6) in base 12? 238a1 What is 12110214 (base 7) in base 4? 10013032032 What is -4674a9 (base 12) in base 2? -100010100100000000001 Convert -25221510 (base 6) to base 15. -110783 What is 4a364 (base 11) in base 6? 1314431 -e546 (base 15) to base 13 -19083 What is -110111001111100100 (base 2) in base 10? -226276 Convert -3c4f6 (base 16) to base 4. -330103312 -1377573 (base 13) to base 12 -208b059 What is 10222102201012 (base 3) in base 4? 20010100322 What is -357a0 (base 11) in base 5? -3122120 Convert 26411036 (base 8) to base 12. 1b88026 What is -2b550b (base 13) in base 15? -16194d Convert 8a6092 (base 12) to base 5. 1031132434 What is -3152727 (base 8) in base 16? -cd5d7 -bb3346 (base 12) to base 10 -2970918 What is -123323313 (base 4) in base 5? -12130143 What is 2478142 (base 10) in base 15? 33e3e7 Convert -2532b7 (base 12) to base 9. -1124524 Convert db75 (base 14) to base 4. 21100223 Convert -512a87 (base 11) to base 16. -c9237 -11561 (base 8) to base 16 -1371 2060314 (base 7) to base 15 4e077 -60a137 (base 11) to base 7 -11220331 Convert d5a9 (base 16) to base 12. 277a1 -53322 (base 12) to base 2 -11010101100001010 Convert 114258 (base 9) to base 11. 47712 What is 330b2 (base 12) in base 5? 4130101 Convert -1200212122 (base 3) to base 15. -9d98 What is -3a7541 (base 11) in base 4? -2130020222 -110110100101101011 (base 2) to base 9 -370638 What is -9407588 (base 10) in base 5? -4402020323 What is -48442 (base 11) in base 3? -10112200001 9a655 (base 11) to base 9 242072 What is -120234543 (base 6) in base 2? -1000100111110000011111 Convert -26254456 (base 8) to base 3. -102000111021122 b0dea (base 15) to base 5 120410040 Convert 213398 (base 12) to base 14. d9020 What is 2d24b (base 14) in base 3? 12201221211 Convert -1055320 (base 6) to base 8. -152100 Convert -304457 (base 8) to base 12. -4a2bb What is 5330212 (base 6) in base 4? 333213200 Convert d7881 (base 15) to base 5. 133334141 Convert 58148 (base 9) to base 12. 1a522 What is -32311212 (base 4) in base 15? -13019 -424301421 (base 5) to base 12 -724465 -11101001101101101101101 (base 2) to base 16 -74db6d Convert 68071 (base 13) to base 11. 11a02a 891c (base 14) to base 11 16924 Convert -100010120 (base 5) to base 8. -1374165 What is -65666 (base 14) in base 8? -737352 Convert 11144122 (base 6) to base 13. bbc79 -1046551 (base 8) to base 15 -58826 What is 689046 (base 10) in base 9? 1260166 What is 11148712 (base 9) in base 8? 24476641 Convert 690bd (base 14) to base 3. 110222021202 What is -2476689 (base 10) in base 6? -125030053 Convert -414450 (base 9) to base 10. -246042 289978 (base 10) to base 12 11b98a What is -3435500 (base 6) in base 7? -1332522 -208847 (base 11) to base 13 -b8bc7 -51430300 (base 6) to base 14 -2a7c4c -91740 (base 10) to base 12 -45110 Convert 1022012101022 (base 3) to base 2. 10101001001001011100 -23312130 (base 6) to base 14 -14c2a2 Convert -12134050 (base 6) to base 13. -1067b5 What is 1140be6 (base 16) in base 13? 3995530 Convert -58aa6 (base 15) to base 6. -10020003 What is -3176053 (base 8) in base 11? -5313a5 10eb4e (base 15) to base 9 1462872 Convert -4512015 (base 9) to base 3. -11120102000112 What is 400102044 (base 5) in base 16? 17e4cb What is -232230 (base 6) in base 9? -30340 Convert 10121110210 (base 3) to base 15. 160c3 What is 3071a (base 12) in base 11? 4356a -11010000010110110 (base 2) to base 5 -11403203 45213511 (base 6) to base 16 14ea53 4b58a7 (base 13) to base 14 3523d7 What is 202437 (base 9) in base 13? 42772 Convert -1031661 (base 7) to base 8. -365134 What is 34c93a (base 13) in base 7? 13450655 Convert -a75911 (base 16) to base 9. -22565283 1682272 (base 9) to base 2 11100101011110000100 -1501104 (base 6) to base 12 -41794 777073 (base 9) to base 14 c1383 What is -622453 (base 8) in base 15? -41118 Convert 5584065 (base 10) to base 12. 1a53629 What is a67c8 (base 14) in base 4? 1202023330 Convert 1053333 (base 7) to base 9. 218443 What is 3126682 (base 9) in base 10? 1671428 -23564310 (base 8) to base 4 -103232203020 1021011 (base 5) to base 6 210422 1881204 (base 9) to base 14 1d73d6 What is 279397 (base 10) in base 9? 465231 Convert 49578d (base 14) to base 3. 11201122011120 -11d54 (base 14) to base 10 -43782 1676878 (base 10) to base 9 3135217 -25402071 (base 8) to base 9 -11541670 What is 100101120002 (base 3) in base 10? 184844 -2c54980 (base 13) to base 14 -1c73916 201788 (base 11) to base 9 543857 What is 41055413 (base 6) in base 5? 300032423 What is 1445728 (base 9) in base 3? 1111112210222 2055835 (base 10) to base 15 2a920a -20cc13 (base 15) to base 14 -2c9332 What is 4d8cab (base 15) in base 13? a0593b -3578145 (base 13) to base 6 -1350453433 -201020321 (base 4) to base 2 -100001001000111001 Convert 18853 (base 13) to base 11. 32804 What is -8c1cf (base 16) in base 2? -10001100000111001111 What is 130000032 (base 5) in base 9? 1152323 Convert c8309 (base 13) to base 10. 360824 Convert -1352789 (base 10) to base 9. -2481608 Convert -83b7 (base 16) to base 2. -1000001110110111 What is -1220230031 (base 4) in base 3? -210210012222 Convert -21254540 (base 6) to base 8. -2315574 Convert -8a268 (base 13) to base 6. -5213254 Convert -82638 (base 10) to base 14. -2218a 340028 (base 10) to base 4 1103000330 -36d9b9 (base 14) to base 5 -440202232 What is 2100200033 (base 4) in base 10? 591887 -1010101000101000111110 (base 2) to base 11 -1634657 -20002014310 (base 5) to base 2 -1001010101000010010111001 -15b8239 (base 14) to base 13 -2294950 What is 2530a (base 15) in base 8? 350032 Convert 14c9945 (base 13) to base 3. 110120011211122 Convert 358170 (base 9) to base 4. 310231320 What is 2117863 (base 9) in base 16? 114edc -a432c (base 13) to base 11 -191660 What is -10675 (base 14) in base 13? -150b6 272030 (base 12) to base 15 cb773 -11434634 (base 7) to base 14 -1c6a54 1129620 (base 10) to base 13 30721b Convert 220122111 (base 5) to base 13. 26cab7 Convert 5403 (base 13) to base 16. 2d90 Convert 13222454 (base 6) to base 4. 1223012002 -18000b (base 13) to base 10 -599792 Convert 52548 (base 13) to base 3. 21112011100 What is 17a188 (base 14) in base 13? 232aa9 -16494 (base 11) to base 7 -124452 What is 33c735 (base 15) in base 8? 11334275 -48597 (base 13) to base 7 -1062066 -101a43a (base 12) to base 5 -1233241442 100220201020221 (base 3) to base 6 304535211 What is -302334223 (base 5) in base 3? -2021201120201 Convert 5011e6 (base 15) to base 12. 1333583 -281a52 (base 11) to base 3 -211110002000 -14e8fa (base 16) to base 3 -2120121210011 -122222211022 (base 3) to base 7 -3003362 What is -110000111111110010 (base 2) in base 9? -335258 -13100300 (base 5) to base 7 -1042522 What is -41302113 (base 6) in base 5? -301041310 -115541315 (base 7) to base 3 -111200101120022 What is 13287081 (base 9) in base 13? 1485961 -342010200 (base 5) to base 6 -52255524 What is 49956 (base 12) in base 9? 161873 -101222012222 (base 3) to base 13 -773a2 What is -10c95d5 (base 15) in base 9? -24564732 1011100111000010001001 (base 2) to base 14 5931c5 -3129b3 (base 12) to base 13 -21059a What is 6615124 (base 7) in base 8? 3057647 10300414 (base 5) to base 13 30b52 Convert -6353a (base 12) to base 2. -11111110100111110 22010210323 (base 4) to base 14 4ca24b 2457605 (base 9) to base 8 5064205 Convert -10001010000110010111 (base 2) to base 16. -8a197 Convert -46a164 (base 12) to base 10. -1137244 Convert 131123300 (base 4) to base 2. 11101011011110000 What is -1100001000000001001010 (base 2) in base 15? -42bbea What is -2311700 (base 8) in base 15? -c5e83 114365113 (base 7) to base 16 6cba25 Convert 1580a9 (base 12) to base 2. 1011001011110000001 What is -5003263 (base 7) in base 3? -1002221112021 What is 321213431 (base 5) in base 2? 101001001110111001100 13101313221 (base 4) to base 6 104522133 Convert 635561 (base 8) to base 2. 110011101101110001 What is -58fa3 (base 16) in base 11? -2298aa 4141815 (base 9) to base 15 2da818 Convert -347bce (base 16) to base 8. -15075716 -9656d0 (bas	{ "pile_set_name": "DM Mathematics" }
132 Divide -40 by -8. 5 3 divided by -43 -3/43 Divide -284 by 71. -4 -2 divided by -51 2/51 -18 divided by 7 -18/7 Divide 6339 by 1. 6339 What is -14100 divided by -6? 2350 Calculate 7 divided by -8. -7/8 Divide 592 by -8. -74 What is -16884 divided by 201? -84 Divide -207 by -3. 69 Calculate -322 divided by -161. 2 -655 divided by 5 -131 Divide -8705 by -5. 1741 Calculate 14 divided by -2. -7 Divide 0 by 125. 0 Calculate 0 divided by -737. 0 Divide -132 by -4. 33 What is -2 divided by 194? -1/97 Calculate -90 divided by 3. -30 10096 divided by 1 10096 Calculate -1 divided by 38. -1/38 133 divided by -2 -133/2 -30 divided by 4 -15/2 3796 divided by 292 13 Calculate -7 divided by -219. 7/219 -11 divided by 62 -11/62 -2660 divided by 5 -532 Calculate 2496 divided by 16. 156 -1464 divided by -3 488 -3434 divided by -2 1717 Divide -4355 by -13. 335 Calculate 3044 divided by 4. 761 Calculate -115 divided by 115. -1 What is -460 divided by -92? 5 Calculate 14000 divided by 4. 3500 What is 942 divided by -471? -2 What is -150 divided by 2? -75 What is 4 divided by 17? 4/17 Calculate 262 divided by 98. 131/49 Divide -72 by -4. 18 What is 22 divided by 8? 11/4 -8 divided by -2911 8/2911 What is -46 divided by -12? 23/6 What is 3 divided by -156? -1/52 What is -204 divided by -102? 2 -11 divided by -13 11/13 3 divided by -105 -1/35 What is 56 divided by -56? -1 Divide -784 by -196. 4 3 divided by 450 1/150 Calculate -295 divided by -5. 59 Divide -1435 by 1435. -1 Divide 210 by 6. 35 -100 divided by 1 -100 What is 168 divided by -4? -42 456 divided by -3 -152 Calculate 58 divided by -1. -58 Calculate 192 divided by 12. 16 What is -5 divided by -40? 1/8 2 divided by 2 1 Calculate -8141 divided by -7. 1163 -64 divided by 4 -16 Divide -83 by -83. 1 74 divided by 10 37/5 -216 divided by 18 -12 Calculate -6390 divided by 355. -18 Divide -1408 by -11. 128 What is -1421 divided by 203? -7 37121 divided by 4 37121/4 Divide -711 by 1. -711 Divide 51 by -3. -17 164 divided by 3 164/3 Divide 6732 by -306. -22 What is 337 divided by -2? -337/2 Divide 9 by -9. -1 Divide 3 by -7. -3/7 294 divided by 3 98 Divide 344 by 86. 4 Calculate -94 divided by 22. -47/11 What is 7490 divided by 107? 70 4 divided by -38 -2/19 Divide -8 by 37. -8/37 -300 divided by 20 -15 What is -582 divided by -4? 291/2 Divide 4536 by -6. -756 What is -198 divided by 99? -2 1612 divided by -26 -62 What is -7772 divided by -4? 1943 Divide 723 by 2. 723/2 Calculate 282360 divided by -6. -47060 6 divided by -539 -6/539 Calculate -2 divided by -1. 2 -7 divided by -56 1/8 -17468 divided by 4 -4367 What is -692 divided by 2? -346 What is 1084 divided by 2? 542 Divide -3 by -42. 1/14 Divide 5 by -3552. -5/3552 What is 55 divided by -1? -55 Divide -178 by -2. 89 What is 3135 divided by 165? 19 -4490 divided by -10 449 Divide 1792 by -1. -1792 Divide -143 by 11. -13 Divide 8 by 20. 2/5 Calculate 19 divided by -67. -19/67 Calculate -1368 divided by 342. -4 526 divided by 2 263 Divide 936 by 156. 6 464 divided by -8 -58 1491 divided by -21 -71 What is 30 divided by 86? 15/43 What is 4 divided by -472? -1/118 Calculate -832 divided by -2. 416 Calculate 9 divided by -128. -9/128 Calculate -14572 divided by -2. 7286 Calculate -23286 divided by 1. -23286 What is -6 divided by 1983? -2/661 What is 9380 divided by -5? -1876 Calculate -276 divided by -6. 46 Divide -290 by 2. -145 Calculate 364 divided by 91. 4 Divide 150 by 7. 150/7 0 divided by -135 0 Calculate 6 divided by 3. 2 What is 69 divided by 4? 69/4 Calculate 1720 divided by -40. -43 -675 divided by -5 135 Divide -93 by 153. -31/51 Divide 8 by -7. -8/7 What is -3 divided by -314? 3/314 260 divided by 6 130/3 Divide 323 by 323. 1 -11 divided by -1 11 Divide -583 by 3. -583/3 What is -23300 divided by 2? -11650 2100 divided by 60 35 What is -164 divided by -82? 2 Divide 1 by 265. 1/265 What is 165 divided by 55? 3 -604 divided by -6 302/3 Calculate -207 divided by -3. 69 Calculate -55 divided by 7. -55/7 Calculate -50 divided by -28. 25/14 Divide 12104 by -1513. -8 -928 divided by 232 -4 56 divided by -2 -28 Divide 90 by -30. -3 -7164 divided by 1791 -4 -22 divided by 755 -22/755 241 divided by 21 241/21 Divide -1210 by -121. 10 What is 328 divided by 164? 2 What is -8809 divided by -383? 23 Calculate 3410 divided by -682. -5 531 divided by -6 -177/2 What is 7444 divided by -1861? -4 What is -906 divided by 3? -302 Divide -312 by -8. 39 Calculate 168 divided by -7. -24 Calculate 0 divided by -7947. 0 Calculate -3848 divided by -52. 74 What is 3884 divided by 1942? 2 What is 3 divided by 11? 3/11 Divide 2 by 9. 2/9 Divide -489 by -4. 489/4 Calculate 20 divided by -11. -20/11 Divide -1713 by 571. -3 Calculate -300 divided by 2. -150 What is 4 divided by 8354? 2/4177 Divide 4047 by -1349. -3 Divide -2979 by -3. 993 Divide 96 by 6. 16 396 divided by -198 -2 Calculate -6 divided by 1. -6 Divide -534 by -2. 267 What is -1 divided by 182? -1/182 Divide 1002 by 6. 167 Calculate 1005 divided by -13. -1005/13 214 divided by -4 -107/2 Calculate -13186 divided by 6. -6593/3 Divide -4 by 208. -1/52 Calculate 2460 divided by -492. -5 Divide 22290 by -4458. -5 Calculate 73 divided by -73. -1 What is -1 divided by -2? 1/2 What is 25950 divided by 5? 5190 What is -3 divided by 10? -3/10 What is -28410 divided by 6? -4735 Calculate 2917 divided by 5. 2917/5 16320 divided by 102 160 975 divided by -325 -3 Calculate 119 divided by -7. -17 Divide -7889 by 49. -161 -4 divided by 69 -4/69 Calculate -3 divided by -362. 3/362 Divide 441 by 1. 441 Calculate -7332 divided by -6. 1222 What is 9959 divided by 1? 9959 Divide 5 by 2732. 5/2732 What is 5 divided by 3042? 5/3042 Divide 57 by 5. 57/5 11208 divided by 5604 2 Calculate 8 divided by -219. -8/219 Divide -5 by -142. 5/142 Divide -606 by 202. -3 Divide 7610 by -2. -3805 What is -674 divided by 2? -337 Calculate 22815 divided by -135. -169 Calculate 4210 divided by 10. 421 Divide -120 by -40. 3 What is 120 divided by 22? 60/11 0 divided by -1240 0 What is 4629 divided by 4629? 1 -864 divided by -4 216 Divide 544 by 136. 4 Divide 26 by -6. -13/3 What is 4 divided by 79? 4/79 What is 5849 divided by 6? 5849/6 -5 divided by -36 5/36 Divide -596 by 149. -4 What is -8904 divided by 371? -24 What is 206 divided by -12? -103/6 -3 divided by -222 1/74 What is -5 divided by -191? 5/191 Calculate 39 divided by 6. 13/2 Calculate 12867 divided by 4289. 3 0 divided by 19 0 What is 1940 divided by -4? -485 -210 divided by -14 15 Divide 50 by -10. -5 What is -1690 divided by 1? -1690 -154 divided by 87 -154/87 Divide -606 by -101. 6 What is 8 divided by 55? 8/55 Divide -526 by -263. 2 Calculate 265 divided by 6. 265/6 Divide 16330 by -2. -8165 What is -275 divided by -55? 5 What is -5800 divided by 290? -20 What is -360 divided by 2? -180 What is 8 divided by 33? 8/33 Calculate -1974 divided by 282. -7 Calculate -210 divided by -3. 70 Divide -1836 by 4. -459 What is -123 divided by -5? 123/5 What is -2 divided by 402? -1/201 Calculate -5 divided by 1077. -5/1077 Divide -3 by -28. 3/28 106 divided by 106 1 What is -37 divided by 5? -37/5 Divide -26 by 183. -26/183 872 divided by 436 2 Calculate 180 divided by 6. 30 Calculate -544 divided by 272. -2 Divide -162 by -27. 6 Divide 0 by 150. 0 What is 1302 divided by -93? -14 What is 228 divided by -57? -4 97 divided by 97 1 Divide -256 by 4. -64 Divide 1 by -72. -1/72 What is -298 divided by 2? -149 What is 250 divided by -10? -25 What is -29 divided by -343? 29/343 What is -1748 divided by -4? 437 217 divided by 7 31 Divide -336 by -8. 42 What is -13 divided by 541? -13/541 630 divided by 2 315 Calculate -2739 divided by 2. -2739/2 -66 divided by -1 66 What is -3288 divided by -4? 822 Divide 253 by 5. 253/5 Divide -300 by 4. -75 What is -494 divided by -5? 494/5 What is 477 divided by 159? 3 What is 13079 divided by -41? -319 Divide -5 by 191. -5/191 What is 6448 divided by 3224? 2 What is -1275 divided by 5? -255 What is -36 divided by -4? 9 Calculate -4 divided by -106. 2/53 Calculate -348 divided by -4. 87 Calculate -214 divided by 3. -214/3 -1875 divided by -5 375 -3 divided by -1291 3/1291 Calculate -29 divided by -4. 29/4 Divide -10153 by -1. 10153 Calculate 546 divided by 3. 182 Calcula	{ "pile_set_name": "DM Mathematics" }
Which is the third smallest value? (a) 4 (b) -0.0376 (c) -1 (d) 0.01 (e) 5/2 (f) 1/4 d Which is the second smallest value? (a) -807 (b) -1/3 (c) 1/4 (d) -494 (e) 0 d What is the fourth smallest value in 6, -0.6, -4, 1.07, -232, 2, 1? 1 Which is the third smallest value? (a) -2 (b) 0.0587 (c) 209 (d) -22 b What is the second biggest value in 0, 2.2, 11369/193? 2.2 What is the second biggest value in 8, -1607, -1/3, 10, 0, 3? 8 Which is the biggest value? (a) -3/2 (b) -1 (c) -0.008 (d) 5/2 (e) 0.95 (f) 11 f Which is the third biggest value? (a) -968 (b) 5 (c) 148 (d) -10 d Which is the fourth biggest value? (a) -3/10 (b) -0.06 (c) -0.24716 (d) -1 d What is the smallest value in 2, 4/152851, -23/2, -4/7? -23/2 Which is the third biggest value? (a) 4 (b) 73 (c) 0.85 (d) 0 c What is the third smallest value in 2288500/11, -3, -1/4? 2288500/11 Which is the smallest value? (a) 84/5 (b) -9 (c) -240 (d) -7 c Which is the fourth biggest value? (a) -12 (b) 3 (c) -4 (d) -5.65 (e) -5 (f) -148 d Which is the third biggest value? (a) 15 (b) 3808/293 (c) -2/37 c What is the second smallest value in -1, 3252, -4/3, 2, -2/11, 5, 1? -1 What is the second biggest value in 1/9, -4, -533, -779? -4 Which is the fifth biggest value? (a) 3/2 (b) 0.2 (c) 2 (d) -2 (e) -198 (f) 18/5 d What is the fifth biggest value in -19, -10/13, 4, 1.1, 130? -19 What is the third biggest value in 1, 652, 33048.6? 1 What is the second smallest value in -4, 2, 4318726, 0.1? 0.1 What is the third biggest value in -1, -190256, 0, 2/11? -1 Which is the sixth biggest value? (a) 4/5 (b) 4/13 (c) -1/4230 (d) 1/4 (e) -5 (f) -3 e Which is the sixth smallest value? (a) 2 (b) -1 (c) -0.8 (d) -0.3 (e) -50/177 (f) 0.5 (g) -16 f What is the fifth biggest value in 3/2, -28/13, -0.5, -616, -3, 2/5? -3 What is the smallest value in 1/5, -1/43, -2, -3, 109? -3 Which is the fourth smallest value? (a) 15 (b) 13368 (c) -15 (d) 0.5 b Which is the third biggest value? (a) 3/8 (b) -2/9 (c) -2 (d) 3 (e) 122 (f) 1.806 (g) -3/5 f Which is the third biggest value? (a) -248 (b) -3/31 (c) -3 (d) 67 c What is the fifth biggest value in -47, 11, -0.5, -1/5, 382.92? -47 What is the third biggest value in 2.4, -3, 1/12, 80? 1/12 Which is the second smallest value? (a) -30/9809 (b) 2 (c) -20 a Which is the sixth smallest value? (a) 3 (b) -0.3 (c) -14/19 (d) -2 (e) 6 (f) -0.0227 e What is the fourth biggest value in 38, -2, 0.05, -1440, -50? -50 Which is the third smallest value? (a) 1 (b) -1 (c) 12 (d) -4 (e) -3 (f) -0.5 (g) 134 b What is the fifth smallest value in -4/7, 1, 0.3, 1/4, 3/20, -0.0459? 0.3 What is the second smallest value in 4, 6/25, 11, 1/8, 2/179, 0.23? 1/8 Which is the fourth biggest value? (a) 50/11 (b) -4 (c) -0.8 (d) -1/11 (e) -30 (f) 0.2 (g) 1 d What is the second smallest value in 0.2, 0, 11135, 0.12, 4? 0.12 Which is the fourth biggest value? (a) -1/8 (b) 130 (c) 0.98 (d) 1/3 (e) 0.1 e What is the fourth biggest value in -1/4, 11126, -3/7, 5? -3/7 What is the second smallest value in -2, -0.5, -16, 0.5, -0.2, 3/5, -14699? -16 What is the third smallest value in -419.38, -0.13, 31? 31 Which is the second smallest value? (a) -2/3 (b) 5.9 (c) 15700/7 b Which is the third smallest value? (a) 16 (b) -4/3 (c) 27 (d) -1 (e) -9 (f) 3/2 (g) -17 b What is the third smallest value in 16481, -36/5, 1/26? 16481 Which is the fourth smallest value? (a) -0.1 (b) 0 (c) 0.125 (d) 3/5 (e) 2/7 (f) -2/169 (g) 3 c What is the biggest value in -2610, -79, -5, 189? 189 What is the sixth smallest value in 35, 3/5, -0.3, -0.6, 4/11, 3? 35 Which is the fourth smallest value? (a) -1 (b) -2/23 (c) -8 (d) -7118192 b Which is the second smallest value? (a) -18 (b) 1/6 (c) 786 (d) -0.5 (e) -4 (f) 0.4 (g) 1 e What is the fifth smallest value in 0.3, 1.3, -0.099, -0.2, -4, -1? 0.3 Which is the third biggest value? (a) 0.039 (b) 5 (c) -1 (d) 0.1 (e) 3.3 (f) 3 (g) 4 e Which is the second biggest value? (a) 39/2 (b) 5 (c) -35/936 b Which is the fourth biggest value? (a) 0 (b) -0.265 (c) 63 (d) -5 d What is the second smallest value in -532, -26/3, -0.13, 2, -0.3? -26/3 What is the smallest value in 1.44, 4, 0, 592? 0 What is the second biggest value in -0.2, 2, 122.74155? 2 What is the second biggest value in 5, 0, -1/1471, 4, 0.4, 6.29? 5 Which is the third biggest value? (a) 8.136 (b) -1/10 (c) 2/9 b What is the third biggest value in 1.3, -1, -2, 1, -13, -7/4, -0.1? -0.1 Which is the second biggest value? (a) 4/5 (b) -9.768398 (c) -2 c What is the third smallest value in -2/15, 405125, 12? 405125 Which is the second biggest value? (a) -151/998 (b) 1/11 (c) -17 (d) -3 a Which is the smallest value? (a) -22/29 (b) -12 (c) 1.12 b What is the second smallest value in 265/3, -1, -0.2, -0.4, -0.17, -3? -1 Which is the smallest value? (a) 0 (b) 58.6875 (c) -6 (d) 2/17 (e) -3/5 c What is the third smallest value in -1, 27, -7/4, 1, -10030? -1 Which is the fifth smallest value? (a) 0.23 (b) 2/9 (c) 0.3 (d) -0.072 (e) 12 (f) -7 c Which is the third smallest value? (a) 4 (b) 2/5 (c) 5 (d) -0.3 (e) 33 (f) 14368 a What is the sixth biggest value in 2/3, 0.2, 2/9209, -5, -1, -1.7? -5 What is the fourth smallest value in 5, 4, 212, -10, 0.2, -2? 4 Which is the smallest value? (a) 60 (b) 12/17 (c) -3 (d) -1.5 c Which is the smallest value? (a) 2/337 (b) -0.27 (c) 1 (d) 6 (e) -4/7 e Which is the sixth biggest value? (a) -8302 (b) -59/4 (c) -2 (d) -1 (e) -0.5 (f) -5 a Which is the fifth biggest value? (a) 3 (b) -2.68 (c) -27 (d) 2 (e) 15 (f) -3.4 f What is the biggest value in -15/11, 1/4, -244, 70? 70 Which is the fourth biggest value? (a) 0.1 (b) -0.1 (c) 2/17 (d) -411 (e) -2 (f) -62/21 (g) -0.4 g What is the second smallest value in -5, 1/22, 11763.1? 1/22 What is the third smallest value in -2, -176.2, 0, -5, -9? -5 What is the second biggest value in 6732, 0.4, 28, 13, -4? 28 What is the second smallest value in 3/4, 0.2, -3780, -0.3, 0.3314? -0.3 What is the fourth smallest value in 0.13, -0.3, -7/50, -3/8, -0.1, -0.5? -7/50 What is the third biggest value in -30, -43897, -5? -43897 What is the third biggest value in -334.7, 46/5, 8/5? -334.7 What is the biggest value in -0.0466, -0.2, -0.36171? -0.0466 Which is the fourth smallest value? (a) 0.4 (b) -4/7 (c) -7 (d) 28 (e) -67 (f) 0.3 f Which is the biggest value? (a) 2/18325 (b) -16 (c) 1/3 c Which is the second biggest value? (a) 1/2 (b) 364.378 (c) -0.03 (d) 2/3 d What is the third biggest value in 2, -0.1, -0.2, -1, -145? -0.2 Which is the third biggest value? (a) 5 (b) -0.798853 (c) -3/7 (d) -1/11 (e) -48 c Which is the third smallest value? (a) -173/2 (b) -5 (c) 2 (d) -4 (e) -10/93 d What is the biggest value in -422.9, -11/148, 1.1? 1.1 Which is the biggest value? (a) 0.4 (b) 437 (c) -3 (d) 0.5 (e) -2/7 (f) -2/113 b Which is the sixth smallest value? (a) -0.8 (b) -21191 (c) 0.1 (d) 0 (e) 1 (f) -2 e Which is the second biggest value? (a) 2/7 (b) -2/9 (c) -1 (d) -4/61 (e) 127 a What is the sixth biggest value in 1/6, 0.1, 1/4, 0.5, 1.8, 48.467, 4/7? 1/6 Which is the second smallest value? (a) 5 (b) 16 (c) 85622/17 b What is the smallest value in -5, 0.4, 8713383, 3/5? -5 Which is the second smallest value? (a) 0.5 (b) -5/2 (c) -9 (d) -1523.7 (e) -0.5 c What is the second biggest value in 0.5, 3/2, 537.164? 3/2 Which is the second biggest value? (a) -295.7 (b) -2 (c) 1/3 (d) 0.09 d Which is the smallest value? (a) -0.00432 (b) -1.01 (c) -5 (d) -2 c Which is the third biggest value? (a) -633 (b) 17 (c) -2 (d) -1 (e) -7/11 d Which is the biggest value? (a) -8.729 (b) 24 (c) -10/7 b Which is the fourth biggest value? (a) 0 (b) 1/93 (c) 33 (d) -3 (e) 0.5 (f) 2/9 (g) 13 f Which is the second smallest value? (a) 1/5 (b) 0.14 (c) -5 (d) -207.81 (e) -0.1 (f) 1/8 c What is the smallest value in -0.859, 0, 0.1, -1, -533, 0.2? -533 Which is the biggest value? (a) 1/23 (b) -2/5 (c) 18 (d) 1 (e) -1/187 (f) 0.4 c Which is the fifth smallest value? (a) -42.9 (b) 3 (c) -8/7 (d) 1/10 (e) -4/5 (f) -4 (g) 6/5	{ "pile_set_name": "DM Mathematics" }
ime factors of z. 47 Let l = -629 - -904. Suppose 3v - l = -2d, -2d = -d + 2v - 139. What are the prime factors of d? 7, 19 Suppose -6d + 3d - 192 = 0. List the prime factors of 24/(-16)(-2 + d). 3, 11 Let j(z) = z2 - 4. Let d(i) = -3i*3 + 2i*2 + i. Let x be d(-1). Suppose -xc - 12 = -6c. What are the prime factors of j(c)? 2 Suppose -4s = -5m, 3m = -0m + 4s. List the prime factors of (m + 1 - 1) + 51. 3, 17 Suppose 0 = -4c + 11 + 5. Let u(n) = 9n + 2 - 7n2 - cn*2 + 10n*2. List the prime factors of u(9). 2 Let c = -524 - 530. Let v be c/16 - (-4)/(-32). Let s = v + 126. List the prime factors of s. 2, 3, 5 Let o(v) = -91v - 102. List the prime factors of o(-6). 2, 3, 37 Suppose 0 = 6w - 10w + 20, 20 = -g + 4w. Suppose 0 = 5j + q - 1611, -5j + q + q + 1623 = g. List the prime factors of j. 17, 19 Suppose 2b - b + 19 = x, -b = 5x - 77. What are the prime factors of 4396/x - (3/4 + 0)? 2, 137 Suppose -119 = -5o - 34. Let v = o - 16. Suppose -5n + i = -54, -2i = -v - 1. What are the prime factors of n? 11 Suppose -t + 4 = -0t. What are the prime factors of 10 - (t + -4 - 2)? 2, 3 Let g be (4/120)/(-2). Suppose -y + 1 = -4, g = 5h - 5y - 225. Suppose 0 = 2o + 3o - h. What are the prime factors of o? 2, 5 Suppose y + 0y - w = 7, 4y - 3w - 26 = 0. Let x be ((-4)/y)/((-42)/2415). What are the prime factors of x/(-69) - 50/(-3)? 2 Let i(s) = -s3 + 10s*2 + s - 10. Let w be i(10). Suppose 2k - 202 = -2k - 5d, w = -4k - d + 210. List the prime factors of k. 53 Suppose -4x - 7 = -g - 4, 3g = -x + 22. Suppose 2c - g = -3. List the prime factors of c. 2 Let k = 856 + 2679. What are the prime factors of k? 5, 7, 101 Let w = -22 + 58. Let x = w + -30. List the prime factors of x. 2, 3 Suppose -432 = 5n - 7n. Suppose d = l + 28 + 52, 3l = -5d - n. Let x = -46 - l. What are the prime factors of x? 31 Let g be 5/2(-26)/(-13). Suppose -gj + a = -j - 353, 351 = 4j + a. What are the prime factors of j? 2, 11 What are the prime factors of 2/(4/2)(2 - -364)? 2, 3, 61 Suppose -5k = 4f - 2116, 3k - 11f = -6f + 1240. List the prime factors of k. 2, 3, 5, 7 Suppose 4p - 4b - 80 = 0, -2b = b - 3. Suppose z = -4s - 4z + p, -s + 5 = z. What are the prime factors of (-78)/(-2) + (6 - s)? 41 Let n = 38 - 25. Let g(x) = x*3 - 14x*2 + 17x - 8. Let b be g(n). Let u = b + 2. What are the prime factors of u? 2, 23 Let l = 695 + -162. Let x = l - 294. What are the prime factors of x? 239 Let v = 12 - 8. Suppose -d + 4 = d + vp, 13 = 3d - p. Suppose 15 = t + dt. List the prime factors of t. 3 What are the prime factors of 3795(64/(-336) - 18/(-21))? 2, 5, 11, 23 Suppose 21 + 19 = 8i. Suppose 6 = iu - 304. What are the prime factors of u? 2, 31 What are the prime factors of 405/(15/14 + 63/147)? 2, 3, 5 Let t be 6/(-2 - -3 - 2). Let k = 8 + t. Suppose 7l = -ka + 2l - 7, l = 3a - 32. What are the prime factors of a? 3 Suppose 2p + 51 - 13 = 0. List the prime factors of p/133 - 358/(-7). 3, 17 Let b(r) = 42r + 17. Let m be b(-4). Let l = m - -296. What are the prime factors of l? 5, 29 Let j be 10/(-35) + (-86)/(-7). Let l(h) = -11h2 + 9h + 16. Let c be l(j). What are the prime factors of c/(-50) + (-2)/10? 29 Let x be 15/6(-40)/(-25). List the prime factors of (-5)/(-10) - (-50)/x. 13 Let d = 1193 - 758. What are the prime factors of d? 3, 5, 29 Let r(u) = -u3 + 5u*2 + 8u - 2. Let k be (-33)/(-6) - (-1)/2. Let w be r(k). Let f = 1 + w. What are the prime factors of f? 11 Let w = 8 + -7. Let n(f) = -2f2 + 6f*3 - 7f*3 - f + 2f*3 + w. What are the prime factors of n(4)? 29 Let t(b) = 3b*2 - 18b - 61. List the prime factors of t(17). 2, 5 Let x(o) = -130o - 289. List the prime factors of x(-15). 11, 151 What are the prime factors of ((-3693)/9)/(3/(-9))? 1231 Let a = -13 - -196. What are the prime factors of a? 3, 61 Let f = 1290 + -718. List the prime factors of f. 2, 11, 13 Suppose 0 = -3z + 4f + 163, 0f + 179 = 3z + 4f. Let d(s) = 5s3 - 1. Let v be d(2). Let t = z - v. List the prime factors of t. 2, 3 Let z(b) be the second derivative of b5/20 + b4/6 + 2b*3/3 + 7b. Let t(l) be the second derivative of z(l). List the prime factors of t(2). 2 What are the prime factors of 7/(-35) - 13072/(-10)? 1307 Let s(k) = -7k2 - 77k + 11. List the prime factors of s(-8). 179 Let i(p) = 3p + 17. Let q(h) = 3h + 16. Let y(f) = 3i(f) - 4q(f). Let a = 8 - 20. What are the prime factors of y(a)? 23 Let s be (5 - 1) + 0 + -13. Let y be 204(-2 - 21/s). What are the prime factors of 3/(-2)y/(-6)? 17 Let y = 3 - 11. Let z be 4 - 1 - (y - 1). List the prime factors of (6/z)/((-1)/(-44)). 2, 11 Let y = -16 - -25. Let o be -3(-15)/y - 2. Suppose 1 = -4g - o, -3q = -5g - 71. List the prime factors of q. 2, 11 Let r(p) = -p*3 + 10p*2 + 12p + 32. Let s be r(11). Let m be (4/5)/(4/10). Suppose -4o + s + 26 = t, mt + 96 = 5o. What are the prime factors of o? 2, 3 Suppose -5w + 145 = 20. Suppose -3z = 5l - w, -2z = -2l + 3z - 21. What are the prime factors of 19 - l - -4 - -1? 2, 11 Let m(g) = 3g + 12. Let x(v) = -1. Let l(n) = -m(n) - 4x(n). List the prime factors of l(-8). 2 Suppose -2y = y - 366. Let q = y - 45. List the prime factors of q. 7, 11 Suppose 0 = -5c - 0c + 1035. Suppose -4a + c - 27 = 0. List the prime factors of a. 3, 5 Let q(z) = 3z*3 + 3z*2 - 4z + 3. List the prime factors of q(3). 3, 11 Suppose -8 = -4s, 3t + 38 + 41 = 2s. Suppose -9 = 3p, 3d - p = -2p - 48. Let q = d - t. What are the prime factors of q? 2, 5 Suppose 2 = -5z - 18. Let k(y) = -2y*3 - 4y*2 - 4y. What are the prime factors of k(z)? 2, 5 Suppose -t - 2b = t - 180, -t = -2b - 87. What are the prime factors of t? 89 Let o(h) = 3h2 + 24h - 48. List the prime factors of o(-21). 3, 257 Let a = -2957 - -4363. List the prime factors of a. 2, 19, 37 Let m = 14 + -11. List the prime factors of ((-17)/1)/(-1) + m. 2, 5 Let o(n) = 2 + 6n3 + 5n*3 + n - 2 - 1. What are the prime factors of o(1)? 11 Suppose 3t - 118 = 5t - d, 4t + 5d + 264 = 0. Let r = 18 - t. What are the prime factors of r? 79 Suppose -4m + 7m = 0. Suppose 2g = v - mv + 2, 0 = 3v - 5g + 1. Suppose -17 = -t - v. What are the prime factors of t? 3 Suppose 5p + 21 = 4u, -3p = -4p - 1. Suppose -g + 94 = o + uo, -2g - o + 143 = 0. What are the prime factors of g? 3, 23 Let c(l) = -8l + 13. Suppose 2j + 64 = -0j. Let s(r) = 52r - 84. Let a(q) = jc(q) - 5s(q). What are the prime factors of a(-6)? 2, 7 Let d be (-2)/(-6) - (-141)/9. Suppose -4l = -8 - d. Let s = l + 7. List the prime factors of s. 13 Let n = -10 + 12. Suppose nv + 3o - 1 = 0, v - 5o - 11 = -2v. Let r(w) = 5w3 + 4w*2 - 3w + 1. List the prime factors of r(v). 3, 17 Let s(y) = y - 6. Let v be s(6). Suppose -5r - 3x + x = -35, -2x = v. Let d(k) = k3 - 7k*2 + 3k + 5. List the prime factors of d(r). 2, 13 Let p be (((-2)/3)/(-1))/(4/1506). Suppose 2j - 6c + c - 159 = 0, -p = -3j - 5c. What are the prime factors of j? 2, 41 Let g(u) = -u*2 + 15u + 20. Let i be g(16). What are the prime factors of ((-1)/i)/((-7)/6412)? 229 Suppose 4s + 3a = 772, 2s + a - 87 = 301. Suppose -36z = -32z - s. What are the prime factors of z? 7 Let b(d) = -d2 - 24d - 40. Let i be b(-20). Suppose 4m = -m + 30. What are the prime factors of m/(4/i3)? 2, 5 Let n(z) = -222z - 201. List the prime factors of n(-8). 3, 5, 7 Let v(x) = x2 + 5x + 5. Let y be v(-5). Suppose -6 = -t - 5, 20 = 3d + yt. List the prime factors of d. 5 Let q(z) = -4 - 15z + 1 + 2z*2 - 3z*2 - 5. List the prime factors of q(-9). 2, 23 What are the prime factors of ((-490)/15)/7-21? 2, 7 Let y(m) be the third derivative of -m*6/120 - 7m5/60 - m4/24 + 17m3/6 + m2. List the prime factors of y(-7). 2, 3 List the prime factors of (1 + 42/(-15))170160/(-72). 2, 3, 709 Suppose 0 = 4l + 3o - 3664, 2l - 3o = -602 + 2434. What are the prime factors of l? 2, 229 Let v = 284 - 105. Suppose -537 = 2a + v. List the prime factors of a/(-14) + 6/14. 2, 13 Let g(y) = -100y + 122. What are the prime factors of g(-7)? 2, 3, 137 Suppose 3 - 28 = 5w, 0 = i - 2w - 30. List the prime factors of ((1236/i)/(-3))/((-1)/5). 103	{ "pile_set_name": "DM Mathematics" }
i. 0 Suppose 3b + 23 = 2s, 41b + 10 = 43b. Solve -12g + s = 43 for g. -2 Let v = 325 + -262. Suppose 0 = -va + 61a + 16. Solve a = 6q - 22 for q. 5 Let m be (3/(-5))/((-8)/200). Suppose 4y = g + 3g - 20, 2y + 3g - m = 0. Suppose 0 = -3i - 2i + 5l + 45, 5i + 4l = 45. Solve y = 5u - iu - 16 for u. -4 Suppose -68 = -4y + 2h - 7h, -5h = -3y + 16. Let z be ((-2)/y)/((-6)/252). Let v = 17 - 11. Solve -vj + 4 = -zj for j. -4 Let l(y) be the second derivative of y4/12 - y3/3 + 5y2/2 - 34y. Let q be l(0). Solve -qb = -3 - 22 for b. 5 Suppose 8k + 1814 = 2318. Solve 147 = 70o - k for o. 3 Let s be (-2)/(1 + -3)(22 - 401). Let l = -379 - s. Solve l = -t - 6t for t. 0 Suppose -22m = -51m + 1653. Solve -m = -30a + 33 for a. 3 Suppose -2o - 3r - 1 = 0, -2r - 3 = -8o + 9o. Let x be 8/(560/370) - 2/o. Suppose -g + 12 = -3z - 5g, 5z - 5g = 15. Solve z = -xl - 3 - 7 for l. -2 Suppose 0 = 4q + p - 6, 3p + 0p + 8 = q. Suppose -qn = n - 2j + 16, n - 4j + 2 = 0. Let z be ((-4)/n)/((-1)/(-6)). Solve 0y + 20 = zy for y. 5 Suppose 5q = 5l - 235, 134 = 3l + 187q - 183q. Solve -12f + 10 = l for f. -3 Let d(m) = -m*3 + 8m*2 + 3m - 8. Let f be d(8). Suppose 0 = fw + 2 - 2. Solve -4k + 0k + 4 = w for k. 1 Let d = 2 - 2. Let a(g) = g3 + 4g*2 - 5g + 1. Let h be a(-2). Suppose 3c = -dc + 4s + 5, -4s + h = 5c. Solve -13 - c = 4r for r. -4 Let j(u) = -5u3 + 3u*2 + 14u - 17. Let c be j(-2). Let f(g) = 2g2 - 4g + 4. Let b be f(4). Suppose 2o = -3o + b. Solve or = -5 - c for r. -3 Suppose 23g - 585 = -6g + 459. Solve -10 = -34w + gw for w. -5 Let m = -643 + 663. Let i be 159/265m/6. Solve iu = -24 + 32 for u. 4 Let n = 120 + -90. Suppose 3s + 3j = 15, -4j + 0j - n = -s. Solve -5 - s = -5c for c. 3 Let h = -388 - -397. Suppose -hc + 817 = 277. Solve -5k = -c + 35 for k. 5 Suppose 13c + 7075 = 7725. Solve -o - co - 153 = 0 for o. -3 Let h be (-1 + -5 - (-50)/10)66. Let j be h/(-12) - 21/6. Solve -jb = 2b + 20 for b. -5 Let o be 0/31/(-2). Suppose -c - 75 = -oc. Let z = c + 77. Solve zn + 0n = 0 for n. 0 Let f(h) = -h - 6. Let p = -25 + 19. Let x be f(p). Suppose x = 2t - 1 - 3. Solve -tj = 3j for j. 0 Let y = 2848 + -2740. Solve -12j - 15j = y for j. -4 Suppose -5z - 7z = -288. Solve -18i = -6i + z for i. -2 Let k(t) = -11t + 74. Let b be k(6). Solve 70 - 38 = -bq for q. -4 Suppose 9l + 0l = -783. Let s = -81 - l. Suppose -si + 9i + 2 = 4b, 5i + 3b - 16 = 0. Solve 8 = iw + 2w for w. 2 Let i be 0((-15)/(-18) - 3/9). Suppose i = 11n - 55 - 209. Suppose c - 2 = -0c - 2z, 3z = 3c - n. Solve -3a + c = -0a for a. 2 Let w be (-704)/44 - -13 - (0 + 1)-3. Solve w = -0k + 8k - 8 for k. 1 Let i be 2(3 - (-3 + (-22)/(-4))). Let k be (-1)/i(13 + -21). Solve -j = 3j - k for j. 2 Let m be ((-10)/2 + 9 + 8)/2. Let j(q) = -q. Let l be j(-5). Suppose -2b - m = -lb. Solve b + 2 = -h for h. -4 Let t = -14 - -22. Let x(v) = 20 - v - t + 9. Let z be x(19). Solve -5 = zb - 1 for b. -2 Let x be 1/(-7) + 297/21. Suppose 2i - 14 = 4k + x, 3i + 3k - 51 = 0. Solve i - 4 = -4p for p. -3 Suppose -4z + 28 = -0c - 2c, z = 3. Let t = 12 - c. Solve 3g = 7g + t for g. -5 Suppose 0 = -3v + 6v. Let n(g) = 2g2 + g + 2. Let x be n(v). Suppose -xi - 6 = -4i. Solve -a = -ia + 6 for a. 3 Let c(r) = 18r - 46. Let o be c(3). Suppose -ol + 64 = -0l. Solve 0n - 2n + l = 0 for n. 4 Suppose -31x + 84 = -3x. Suppose 4y = -2z + 42, -4y - xz - 6 = -53. Solve -26u - y = -24u for u. -4 Let h be 4/14(-4 - -18). Suppose -6 = 2a, -ha = 2r + 63 + 7. Let i = r + 34. Solve -1 - 9 = -ij for j. 2 Let b(g) = g + 1. Let v(c) = -5c + 3. Let z(x) = -2b(x) + v(x). Let d(p) = -p. Let q(m) = 2d(m) - z(m). Let s be q(1). Solve -su - 10 = -9u for u. 2 Suppose -3 = z - 8. Suppose -5i - zm = -8i - 9, -3i - 3m = -15. Solve 12 = iw + 18 for w. -3 Let w be (12/(8 + -4) - 0)66. Suppose -8j - 14j + w = 0. Solve r = -2r - j for r. -3 Let p be (-45)/25 + 8/(-40). Suppose -3y = -3z - 2 - 4, 3y = -3z. Let m be p - y - (13 + -19). Solve 2b + mb = 0 for b. 0 Let d = -97461 + 97466. Let x(a) = -a - 8. Let c be x(-8). Suppose 2u + 2v + v + 4 = 0, 2u - v - 12 = c. Solve d = ui - 7 for i. 3 Let f be (-6)/9-72 - (21 - 1)/5. Solve 37s - 67 = f for s. 3 Suppose -m = -17m + 48. Let k be (-3)/(m/2) + 8 + -4. Solve -k - 3 = -p for p. 5 Let u(o) = 8o + 83. Suppose 8 = -4a - 2g - 24, -a + 3g - 8 = 0. Let l be u(a). Solve 6z + l - 49 = 0 for z. 5 Suppose 0 = 5k - 10. Let u(b) = -6 - b + 3b - 3b - 9b - bk. Let q be u(-9). Solve -4l + l = q for l. -1 Let y(d) = 9d + 18. Let a be y(-4). Let r = a + -24. Let k = r + 45. Solve -2g - g = -k for g. 1 Let c = -175 + 183. Suppose -44 = 4a - ca. Solve -4 = 9s - as for s. 2 Suppose -5m + 9 + 31 = 0. Let h = -1047 - -1057. Solve -m = -hl + 8l for l. 4 Suppose 0 = 27z - 4y - 30, 4z - 4y + 23 = 7. Solve 251 - 257 = zj for j. -3 Suppose -4r = -0 - 8. Let w = 29 - 40. Let y be (-8 - w)/((-6)/(-10)). Solve -a = r - y for a. 3 Let f = 789 - 545. Let j = f - 230. Solve -5c - j = -39 for c. 5 Suppose 293 - 299 = -z + 4g, -4z - 5g = -87. Solve -82h + 88h = -z for h. -3 Let h be ((-30222)/230)/((-2)/(-10)). Let w = h + 659. Solve wu = -9 - 1 for u. -5 Suppose 3g + 2s - 33 = 0, 2g - 4s + 0 = 6. Suppose 5o = go. Suppose -4h + 4r - 8 + o = 0, 3r = h + 12. Solve -2l = 11 - h for l. -4 Let u = 970 + -673. Let r = u + -289. Solve r = -2l + 2 for l. -3 Suppose -3w = -681 + 246. Suppose -6 = -2r + g, wr + 3g = 147r - 6. Solve 7 = -4x - rx for x. -1 Let t = -9965 + 10046. Solve -tv + 77v = 16 for v. -4 Suppose -21z + 751 + 488 + 63 = 0. Solve -362 = -zg - 858 for g. -8 Let h(x) = 2x - 11. Let i be h(7). Suppose 2r - 10 = -4q, -r + 16 - i = 4q. Suppose -2k + 2 = -2n - 6, 0 = qk + n - 11. Solve -kc + 3 = -12 for c. 5 Let y(n) = -n*2 + 11n - 4. Let x be y(9). Suppose -103 + 75 = -xm. Solve 7q + 10 = mq for q. -2 Let g be 4970/10 + (2-1 - 1). Suppose 3t + 23t - g = 0. Solve -t = 3y - 13 for y. -2 Suppose -55a + 1409 - 85 = -436. Solve -28z - 4z = a for z. -1 Suppose 4p + 125d - 120d - 162 = 0, -5d + 66 = 2p. Solve -5v - 3v = p for v. -6 Let k be (-66)/(-24)4(3/(-1) + 4). Solve 60 = km + 5 for m. 5 Let i(g) = 3g2 - 13g + 15. Let b = 163 - 160. Let r be i(b). Solve rk - 8k - 10 = 0 for k. -2 Suppose -924 = -7k - 15k. Suppose -43t + kt + 3 = 0. Solve -1 - 11 = tq for q. -4 Let n(w) = -36w + 27. Let u be n(0). Suppose 7r - 4r + 3q - u = 0, 5r - 38 = 2q. Solve -4 = rc - 4 for c. 0 Let m be ((-81)/21 - -1)(-105)/6. Let q = -546 + 557. Solve k + m = qk for k. 5 Let r(y) = -y*3 - 26y*2 + 27y + 63. Let x be r(-27). Suppose -55w - 16 = -xw. Let m(j) = j - 2. Let b be m(5). Solve -ws = -bs - 3 for s. -3 Let q be 6 + 6/(-3) + 38. Let k = -37 + q. Suppose -ko + 0 = 25, -2d = -5o - 41. Solve -1 = 3s + d for s. -3 Suppose 521262 = 20y + 177y. Solve 2t = 2658 - y for t. 6 Let c = 433 - 371. Suppose cg - 53g - 126 = 0. Solve -22 = 9v + g for v. -4 Let y be (82/205)/((-1)/(-10)) - -1. Solve -yt + 118 - 143 = 0 for t. -5 Let v be (57/(-5))/((24/(-28))/((-690)/(-483))). Solve -vj + 100 = 6j for j. 4 Let n(z) = 1116z*2 - 374z - 375. Let m be n(-1). Solve mt - 1109t + 24 = 0 for t. -4 Let x(d) = 221d + 2007. Let k be x(-9). Solve c = -17c - k for c. -1 Let p = -3691 + 3728. Solve 41f - pf = 8 for f. 2 Let f be (18/8)/(72/2304). Suppose 23z - f = 43. Solve zk + 16 = 11 for k. -1 Let c(q) = 3q3 + 23q*2 - 8q + 4. Let n be c(-8). Let g(a) be the first derivative of -a*2/2 - 3a + 12. Let z be g(-6). Solve -nw - z = 17 for w. -5 Let z be (-2)/4(-87 + 1). Suppose -4m + 141 - 35 = v, -2m + 44 = 5v. Let a = z - m. Solve 5q = q + a for q. 4 Suppose -5a = -w - 17, 0 = -a + 17w - 15w - 2. Suppose as - 20 = 5m, -s + 8m + 20 = 3m. Solve s = -38f + 34f for f. 0 Let a be (-4)/(-26) - (-14)/((-910)/(-4085)). Solve -a = -21m + 42 for m. 5 Let b = 29 - 19. Suppose -104m + 327 = 119. Solve 0 = -7w + mw - b for w. -2 Let t(v) = 148v + 5 + 32 + 125 + 17 - 126v. Let x be t(-7). Solve -y + x = -6y for y. -5 Let f be -1 -	{ "pile_set_name": "DM Mathematics" }
w be (3 + -4 - 0)/1. Let r = -2.7 - -3.2. Which is the nearest to w? (a) r (b) -3/2 (c) q b Let u = 7658.05 - 7658. Which is the closest to 2/7? (a) -0.03 (b) u (c) 0.02 b Let u = 4.922 - 4.896. Which is the closest to 4/7? (a) 2 (b) u (c) -0.5 b Let j = -681/7 - -97. Let c = -157.4 - -13.4. Let p = c - -146. What is the closest to j in p, -2/3, -0.5? -0.5 Let u = -490 - -485.21. Let g = u - -5.4. Let z = 0.81 - g. What is the nearest to 1 in z, 0.1, -3? z Let l = -26413/2 - -13208. Which is the nearest to 0? (a) -1 (b) -127 (c) l a Let s = -3 + 3. Let w = -56613.8 - -56614. Which is the nearest to s? (a) -168 (b) -4 (c) w c Let v = 3.4 + -0.4. Suppose 4i + 86 = -2h - 42, 2h = -3i - 98. Let m be (-4)/(-16) + i/40. What is the nearest to -3 in m, v, -1? -1 Let c = 187.14 - 187.64. What is the closest to -1 in -0.1, 5, -2/7, c? c Let t = -66.6 + 66.4. Which is the closest to -98? (a) 3/7 (b) t (c) -5/3 (d) 0.1 c Let h = -474.06 - -474. Let x = h - -0.12. What is the nearest to 2/3 in 0.2, x, -1? 0.2 Let z = -0.004 + 1.004. Let g = -12/37 + 34/333. Which is the nearest to 1.6? (a) 3 (b) z (c) g b Let u = 19.9 - 15.9. Suppose 10 = 2o, -3o = -4v - 8o + 13. What is the closest to v in 3, u, -1/2? -1/2 Let v = -0.631 + -77.869. Let k = 79 + v. Which is the nearest to 2/5? (a) k (b) 4 (c) -3 a Let z = -1965 - -1946. What is the closest to 0.1 in -4, z, 1? 1 Let k(r) = -r*3 + 14r*2 - 9r - 31. Let s be k(13). Let q = 24 - s. Which is the closest to 0.1? (a) 4/5 (b) q (c) -1 a Let a = 17329/43510 - -15/8702. Let c = 2/131 - -240/1441. What is the closest to 4/9 in a, c, -2/5? a Let z = -16 - -16.7. Let g = 115 + -114. Let m = g - z. Which is the closest to -1/2? (a) m (b) 0.2 (c) -0.3 c Let z(i) = i + 33. Let v be z(26). Let x = v - 73. Let h be x/(-77) - (-538)/66. Which is the closest to h? (a) 0.1 (b) 4 (c) 2 b Let v = 773.9529 - 774. Let y = 0.4529 - v. Let r = 0 + -0.1. Which is the nearest to r? (a) -3 (b) y (c) -13 b Let k be 203/(-42) - -5 - 20/(-144)-3. What is the closest to k in -0.5, -0.2, 0.2, 1? -0.2 Let a = 551 + -549. What is the closest to -8 in a, -5, -0.194? -5 Let n = 3077 + -3073. What is the nearest to -1/6 in -3, 0.3, n, 6/7? 0.3 Let l = -0.05739 + -0.44261. Let q be (2/(-6))/(4/(-18)). What is the nearest to q in l, 0.5, 1? 1 Let z = -0.3447 + 0.0447. Let f = 317 - 322. Let j = 0 + 0. Which is the closest to 1? (a) f (b) j (c) z b Let y be (2/(-5))/(17/((-935)/(-88))). Let v = -17 - -33. Let x = 16.1 - v. Which is the closest to x? (a) y (b) 14 (c) 3 a Let w be (-4)/((-8)/(-6))1/1. Let t = -8073/4 + 2019. Which is the closest to -0.1? (a) t (b) 3 (c) 2/17 (d) w c Let j = 1.24 + -1.64. Let f = 1.7 - 1.8. Which is the nearest to j? (a) f (b) 0.4 (c) 1 a Let r = 4.796 + -4.996. Let h = 0.17 - 0. Which is the nearest to h? (a) -2/7 (b) r (c) 4 b Let l = 70 - 69.971. Let u = -0.429 + l. Let k = -45 + 49. What is the closest to -5 in k, -4, u? -4 Let t = -28 + -3. Let c = -0.92516 + 1.02516. What is the closest to -4 in c, 2, 1, t? c Let r = 15.1 + -26.1. Let v = -5 + r. Let s be (-2)/(-5) - (-72)/(-105). What is the nearest to -1 in s, 0.5, v? s Let x = 3395 + -3390. Which is the nearest to 5? (a) x (b) 1/5 (c) 2 (d) -0.32 a Let q = 26 + -22. Let v = -4257.03 + 4257. What is the nearest to 1 in -5, v, q? v Let x be 160/(-48) - 8/(-2). Let b = 539/4 - 537/4. What is the closest to x in 7/3, b, -0.2? b Let u be ((-135)/50)/34/(-6). Let p = -532 - -531. Which is the closest to -0.1? (a) u (b) p (c) -5 a Let s = -244 - -1224/5. Let y = 223705/11 + -20337. Which is the closest to -0.5? (a) s (b) y (c) 0.5 b Let v be ((-1)/5)/(2(-12)/40). Let t = -2030.85 - -2031. What is the closest to 1 in -2, t, v? v Let l = -9.838 + 5.838. What is the closest to 1 in 14, l, 2/33? 2/33 Let i = 1.04 - 1. Let j = 2.04 - i. Let k = j - 1.89. Which is the closest to 0? (a) k (b) -2/7 (c) 4 a Let k = -8.62 + -337.38. Let t = k + 341. Which is the nearest to 3? (a) 1 (b) 2/3 (c) t (d) 2 d Let p(z) = z*2 + z - 3. Let u be p(0). Suppose -11l + 47 = -30. Suppose 51s - 44s = -l. What is the nearest to s in 0.2, u, 3/10? 0.2 Let s = 0.7497 + -0.0317. Let q = -0.678 + s. What is the closest to 1 in -1, -4, q? q Suppose -5q = 15w - 18w - 54, -5q = 2w - 39. Let s be 3/15 - 3/(-135). Which is the nearest to 2/7? (a) s (b) w (c) 27 a Let d = -0.05 + 0.11. Let q = 1341410 + -1341405. Suppose 4x = 4j, j + 5x = 3x - 3. What is the nearest to q in d, j, 3? 3 Let v = -177.6 + 177. Let d = -18 - -18. Suppose d = 3t - t + 3f + 14, 24 = -4t - 5f. What is the closest to 1/3 in 2/19, t, v? 2/19 Let n = -73359 - -73359. Suppose 0 = -5q + y + 12, -4q - y + 15 = 0. Let i = 5 - 4.7. Which is the closest to q? (a) n (b) -0.5 (c) i c Let c = -125914/11 + 11447. What is the nearest to c in -1, 11, 0? 0 Let j(m) = m3 + 21m*2 + 6m - 7. Let g be j(-21). Let x = g - -267/2. Let k = -2.84 + -0.16. Which is the closest to 1? (a) 1.4 (b) x (c) k a Let f be (11 + 5 + -17)(-481 - 1). Let m = 482 - f. Let z(y) = -y3 + 4y*2 + y - 5. Let u be z(4). Which is the closest to u? (a) m (b) -4 (c) -11 a Let w be ((-234)/(-2457))/(6/(-63)). Let u = 10.1 + 0.9. Let q = 6 - u. Which is the closest to w? (a) 0.2 (b) q (c) 8 a Let r be 14/(-343) + 208/637. What is the closest to -39 in 8, r, 2/13? 2/13 Suppose 4t = 259 - 128 - 127. What is the closest to 1 in t, -5/2, 0.2? t Let s = 56470.9 + -56471. Let w be 4/(-9)(-3)/2. Which is the closest to s? (a) w (b) 6 (c) 0 c Let a = 432.48 - 2.48. Let f = a - 430.03. Let c = -6 - -4. What is the closest to 0 in f, -5, c? f Let z = 0.2 + -0.24. Let v = 205924 + -205925. What is the closest to 3 in -1/5, v, z? z Suppose -2k + 2f = 16, -10k = -5k - 4f + 35. Which is the closest to 20? (a) 0 (b) 0.4 (c) k b Let q = -173 + 173.02. Let a = 838.5 + -838. What is the closest to 0 in q, 5, a, -4? q Let l = -169 - -178.3. Let r = 9.4 - l. Let j = 0.81 + -80.81. Which is the nearest to r? (a) 0.2 (b) -3 (c) j a Let x = -2669927/8076 - 886/673. Let m = 332 + x. Which is the nearest to m? (a) 0.1 (b) -5 (c) 1/3 a Let n be (-4 - (-28)/6)/((-2)/(-15)). Suppose -2o - 3s + 6 = 0, 2s - ns + 6 = 5o. Let a be (-60)/14 + 4/14. What is the closest to o in 3, a, -2? -2 Let f = -8.512 - -8.452. Which is the closest to f? (a) 1 (b) 0.5 (c) 2/13 (d) 0.1 d Let p = 1.0462 - 0.5462. Let j = 13.9 + -14. What is the closest to j in p, -4, 4/13? 4/13 Suppose 32h + 17 = 81. Which is the closest to -9? (a) 0 (b) 2/15 (c) 3 (d) h a Suppose 4u - z - 4343 = 9u, -z = -4u - 3478. Let p = 872 + u. What is the closest to -2 in -10, p, 2, -4? -4 Let d = -782 + 779. Let u = -4847/15 + 323. What is the nearest to u in -4/11, d, 4? -4/11 Let o = -0.02 + 0.03. Let i = -52.99 - o. Let w = i - -53.2. What is the closest to 0.01 in w, -4, -1/7? -1/7 Let o = -17.709 + 1.709. Which is the closest to -0.1? (a) 2/3 (b) 2 (c) -5 (d) o a Let r be -3(18/99)/((-2)/(-22)) + 6. Let o = 0.5 + -0.3. Which is the nearest to o? (a) r (b) 0.3 (c) -1/2 b Suppose 2q - 4y = -223 + 205, y = -3q + 15. Which is the closest to -0.4? (a) q (b) 2 (c) -2 (d) 1/3 d Let b = -249.2 + 249.3. Let o = -13 + 16. What is the closest to 0 in o, b, -10/7? b Suppose z + i = 2z - 2, 0 = -5*z - i - 2. Let v = -193426501/3111460792 + 3/1118024. Let p = v - 3/121. Which is the closest to 0.3? (a) z (b) p (c) 2/13 c Let x = 8556 - 8554. Which is the closest to 0.01? (a) 1/8 (b) -0.3 (c) 1/2 (d) x a Let g = -85020/7 - -680167/56. Let q = -0.1 - -0.1. What is the nearest to 0 in g, q, 0.9, 2/13? q Let u = 1.6 - -7.4. Let h = 5.55 + -10.55. What is the nearest to 0.1 in u, h, 0.3? 0.3 Let p = -105.13 - -5.33. Let s = -99.885 + -0.115. Let r = s - p. Which is the nearest to -1/3? (a) r (b) 2 (c) 0 a Let k = -0.8 - -0.7. Let y = -949 + 951. Which is the nearest to -0.7? (a) y (b) 2/5 (c) k c Let l = -3.5755 + -1.4245. Which is the closest to 0? (a) -1029 (b) -2/11 (c) -0.5 (d) l b Let t = 3.16 + -4.15. Let o = t + 0.59. Let b = -20.2 - -22. What is the nearest to 1/4 in -5, o, b? o Let z be ((-408)/1088)/((-3)/(-16)). What is the nearest to -2110 in z, 3, 0.	{ "pile_set_name": "DM Mathematics" }
f -300, -1195, -2674, -4731, -7360, -10555, -14310, -18619? y*3 - 298y*2 - 8y + 5 What is the f'th term of -1244, -4982, -11212, -19934? -1246f2 + 2 What is the d'th term of 1494, 1346, 1096, 738, 266, -326, -1044, -1894? -d3 - 45d*2 - 6d + 1546 What is the n'th term of -64, -120, -236, -430, -720, -1124? -3n3 - 12n*2 + n - 50 What is the h'th term of 21, 88, 199, 354, 553? 22h*2 + h - 2 What is the p'th term of 196, 187, 180, 187, 220, 291, 412? 2p*3 - 11p*2 + 10p + 195 What is the d'th term of 173, 609, 1327, 2327, 3609, 5173, 7019? 141d2 + 13d + 19 What is the x'th term of 669, 1353, 2023, 2673, 3297? -x3 - x2 + 694x - 23 What is the q'th term of -60, -120, -178, -234? q2 - 63q + 2 What is the k'th term of -145930, -145921, -145886, -145813, -145690, -145505, -145246, -144901? 2k3 + k2 - 8k - 145925 What is the o'th term of 524, 4003, 13410, 31709, 61864, 106839, 169598, 253105? 494o3 + 21o + 9 What is the i'th term of -96, -98, -92, -78, -56, -26? 4i2 - 14i - 86 What is the l'th term of 303, 1225, 2793, 5013, 7891? l*3 + 317l*2 - 36l + 21 What is the t'th term of 46, 335, 858, 1609, 2582? -t*3 + 123t*2 - 73t - 3 What is the z'th term of -10550, -10439, -10248, -9971, -9602, -9135, -8564, -7883? z*3 + 34z*2 + 2z - 10587 What is the b'th term of 21, -889, -1801, -2715? -b*2 - 907b + 929 What is the f'th term of 105, 209, 307, 399? -3f2 + 113f - 5 What is the r'th term of 3288, 2813, 2334, 1851, 1364? -2r2 - 469r + 3759 What is the v'th term of -80416, -80379, -80332, -80269, -80184, -80071, -79924, -79737? v3 - v2 + 33v - 80449 What is the w'th term of -100, -217, -332, -445, -556, -665? w2 - 120w + 19 What is the j'th term of -10792, -10866, -10940, -11014? -74j - 10718 What is the y'th term of 8107, 16226, 24349, 32476? 2y*2 + 8113y - 8 What is the j'th term of -43, -20, 115, 410, 913, 1672, 2735, 4150? 8j3 + 8j*2 - 57j - 2 What is the x'th term of 63383, 126754, 190125, 253496, 316867, 380238? 63371x + 12 What is the f'th term of 53, 97, 143, 191? f2 + 41f + 11 What is the z'th term of -11190, -11167, -11106, -10989, -10798, -10515, -10122? 3z3 + z2 - z - 11193 What is the c'th term of -1624, -2748, -3874, -5002, -6132, -7264, -8398? -c2 - 1121c - 502 What is the n'th term of -2068, -8287, -18650, -33157, -51808? -2072n2 - 3n + 7 What is the m'th term of -633, -2552, -5741, -10194, -15905? m*3 - 641m*2 - 3m + 10 What is the h'th term of 266813, 533627, 800441, 1067255, 1334069, 1600883? 266814h - 1 What is the w'th term of 1934, 1808, 1682, 1556, 1430, 1304? -126w + 2060 What is the y'th term of -85, -212, -315, -382, -401? 2y3 - 141y + 54 What is the t'th term of 7556, 7554, 7552? -2t + 7558 What is the n'th term of -1320, -5386, -12162, -21648? -1355n*2 - n + 36 What is the a'th term of 208237, 416479, 624721? 208242a - 5 What is the r'th term of 367, 1059, 2219, 3853, 5967? r*3 + 228r*2 + r + 137 What is the t'th term of 37373, 37366, 37355, 37340, 37321, 37298? -2t*2 - t + 37376 What is the a'th term of -198, -394, -590? -196a - 2 What is the o'th term of -1181, -2505, -3829, -5153, -6477? -1324o + 143 What is the t'th term of -1140, -1715, -2290, -2865, -3440? -575t - 565 What is the f'th term of 4061, 8141, 12215, 16283, 20345, 24401? -3f2 + 4089f - 25 What is the g'th term of -2492, -3033, -3574? -541g - 1951 What is the d'th term of 38055, 38052, 38049, 38046, 38043? -3d + 38058 What is the s'th term of -35581, -71171, -106761? -35590s + 9 What is the g'th term of 105189, 105188, 105187, 105186, 105185? -g + 105190 What is the x'th term of -16829, -16825, -16819, -16811, -16801, -16789? x2 + x - 16831 What is the l'th term of 52375, 104745, 157115, 209485? 52370l + 5 What is the q'th term of -363, -1528, -3497, -6270, -9847? -402q2 + 41q - 2 What is the u'th term of 150, 236, 374, 558, 782, 1040, 1326, 1634? -u*3 + 32u*2 - 3u + 122 What is the v'th term of -4377, -4381, -4389, -4407, -4441? -v*3 + 4v*2 - 9v - 4371 What is the h'th term of 3265, 26160, 88315, 209362, 408933, 706660, 1122175, 1675110? 3272h3 - 2h*2 - 3h - 2 What is the a'th term of -213928, -213934, -213944, -213958? -2a2 - 213926 What is the y'th term of 287, 729, 1313, 2033, 2883, 3857, 4949? -y3 + 77y*2 + 218y - 7 What is the w'th term of 11, -291, -799, -1513, -2433? -103w2 + 7w + 107 What is the c'th term of 1077708, 2155414, 3233120? 1077706c + 2 What is the b'th term of 563, 1115, 1619, 2075? -24b*2 + 624b - 37 What is the g'th term of -9095, -9046, -8997, -8948, -8899? 49g - 9144 What is the k'th term of -182, -339, -492, -641, -786, -927? 2k*2 - 163k - 21 What is the b'th term of -422, -882, -1370, -1886, -2430, -3002? -14b2 - 418b + 10 What is the u'th term of -10573, -21139, -31705, -42271, -52837? -10566u - 7 What is the m'th term of 787, 2039, 3291, 4543, 5795? 1252m - 465 What is the g'th term of 3166, 3168, 3168, 3166, 3162? -g*2 + 5g + 3162 What is the x'th term of 3527, 3579, 3639, 3713, 3807, 3927, 4079? x*3 - 2x*2 + 51x + 3477 What is the y'th term of 6058, 12229, 18400, 24571, 30742? 6171y - 113 What is the c'th term of -10320, -10314, -10308? 6c - 10326 What is the z'th term of 647, 2603, 5867, 10439, 16319? 654z2 - 6z - 1 What is the l'th term of -62244, -62247, -62250, -62253? -3l - 62241 What is the q'th term of -11006, -22015, -33024, -44033, -55042, -66051? -11009q + 3 What is the z'th term of -288, -1302, -3044, -5514? -364z2 + 78z - 2 What is the i'th term of -41737, -41738, -41739? -i - 41736 What is the b'th term of -35, 127, 565, 1417, 2821, 4915, 7837, 11725? 23b3 + b - 59 What is the k'th term of -114, -8, 256, 756, 1570? 13k3 + k2 + 12k - 140 What is the z'th term of 19055, 38295, 57535, 76775, 96015, 115255? 19240z - 185 What is the p'th term of -708090, -708091, -708092, -708093, -708094? -p - 708089 What is the i'th term of -9838, -19669, -29504, -39343, -49186, -59033, -68884? -2i2 - 9825i - 11 What is the u'th term of -192, -216, -252, -300, -360, -432, -516? -6u2 - 6u - 180 What is the i'th term of -18469, -18478, -18509, -18574, -18685, -18854, -19093? -2i3 + i2 + 2i - 18470 What is the g'th term of 16289, 16282, 16271, 16256, 16237, 16214, 16187? -2g2 - g + 16292 What is the v'th term of -105, -175, -209, -141, 95, 565, 1335, 2471? 11v*3 - 48v*2 - 3v - 65 What is the l'th term of -5543, -5556, -5569, -5582? -13l - 5530 What is the h'th term of -62, 184, 626, 1258, 2074? -h3 + 104h*2 - 59h - 106 What is the q'th term of 2042317, 2042315, 2042313? -2q + 2042319 What is the b'th term of 2846, 5654, 8462, 11270, 14078? 2808b + 38 What is the r'th term of 447, 1032, 1759, 2628, 3639, 4792? 71r2 + 372r + 4 What is the l'th term of 289726, 579446, 869166, 1158886? 289720l + 6 What is the y'th term of 76762, 76759, 76756, 76753, 76750, 76747? -3y + 76765 What is the h'th term of -755514, -755522, -755530, -755538, -755546, -755554? -8h - 755506 What is the y'th term of 370, 387, 404, 421, 438, 455? 17y + 353 What is the g'th term of 14, 6, -8, -28, -54? -3g2 + g + 16 What is the q'th term of -157590, -157591, -157592, -157593? -q - 157589 What is the o'th term of -57277, -57267, -57255, -57241, -57225? o2 + 7o - 57285 What is the p'th term of 351504, 351521, 351552, 351603, 351680, 351789, 351936? p3 + p2 + 7p + 351495 What is the q'th term of 77455, 77459, 77465, 77473? q2 + q + 77453 What is the s'th term of -89184, -89209, -89234? -25s - 89159 What is the y'th term of 1726, 1813, 1900, 1987, 2074, 2161? 87y + 1639 What is the z'th term of -162200, -162197, -162194, -162191, -162188? 3z - 162203 What is the m'th term of -2326, -9240, -20764, -36898, -57642? -2305m2 + m - 22 What is the z'th term of -95525, -95530, -95537, -95546, -95557? -z2 - 2z - 95522 What is the l'th term of 149, 595, 1339, 2381, 3721? 149l2 - l + 1 What is the o'th term of -2147, -3001, -3855, -4709, -5563, -6417? -854o - 1293 What is the y'th term of -156, -189, -240, -315, -420? -y*3 - 3y*2 - 17y - 135 What is the n'th term of -1628, -1642, -1682, -1760, -1888, -2078, -2342, -269	{ "pile_set_name": "DM Mathematics" }
= -6c + 509 for c. -7 Solve 12w - 1374 + 1278 = 0 for w. 8 Solve -4i + 80 = 12i for i. 5 Solve -137y + 139y = 4 for y. 2 Solve 0 = -5u + 857 - 832 for u. 5 Solve -46 = -p - 52 for p. -6 Solve 80g - 45 = 71g for g. 5 Solve 0 = -4c + 11c for c. 0 Solve -12w + 32 = 68 for w. -3 Solve 0 = 3c + 24 - 12 for c. -4 Solve 4 = 43q - 39q for q. 1 Solve 4t = 24 - 32 for t. -2 Solve 19j = 30j for j. 0 Solve 0 = 8g + 26 - 10 for g. -2 Solve -255k + 16 = -253k for k. 8 Solve 0 = -h - 3h for h. 0 Solve 22t = 20t + 8 for t. 4 Solve 7f - 9f - 2 = 0 for f. -1 Solve 360b + 63 = 369b for b. 7 Solve 3r - r = 8 for r. 4 Solve -6c + 567 = 75c for c. 7 Solve i - 4 = 2i for i. -4 Solve 27m - 24m + 21 = 0 for m. -7 Solve 9a = 6a - 9 for a. -3 Solve h - 35h - 204 = 0 for h. -6 Solve -11d - 11 + 0 = 0 for d. -1 Solve 0 = 18f - 2f for f. 0 Solve 8q = 10 - 2 for q. 1 Solve -23 = 20n + 37 for n. -3 Solve 0 = -22u + 27u - 10 for u. 2 Solve -26 = 15v + 34 for v. -4 Solve -10a = -11a + 1 for a. 1 Solve 28p + 15 = 31p for p. 5 Solve 4u = u - u for u. 0 Solve -25l = -20l - 20 for l. 4 Solve -4q - 389 = -385 for q. -1 Solve 3i = -0i for i. 0 Solve -41c + 37c = -16 for c. 4 Solve 0 = 4j + 5 - 17 for j. 3 Solve 0 = 3p + 3 - 12 for p. 3 Solve 36 = 6h + 3h for h. 4 Solve 9b + 261 - 279 = 0 for b. 2 Solve 11 = 3w + 14 for w. -1 Solve 0y = 6y - 12 for y. 2 Solve 12j + 8 = 20j for j. 1 Solve 0 = -31k + 64 - 126 for k. -2 Solve -16f + 389 = 517 for f. -8 Solve -7u = 7 + 7 for u. -2 Solve 54x - 7 = 61x for x. -1 Solve -r = -4r + 12 for r. 4 Solve 1296s + 14 = 1289s for s. -2 Solve -89m + 87 = -714 for m. 9 Solve 7p - 6p = -5 for p. -5 Solve -10a = -11a - 4 for a. -4 Solve -10j + 4 = -11j for j. -4 Solve 27c = 37c - 10 for c. 1 Solve 16w + 18 = -78 for w. -6 Solve -6g - 3g = 9g for g. 0 Solve 12n = -3n + 45 for n. 3 Solve 2t - 40 = -8t for t. 4 Solve 32m + 499 = 179 for m. -10 Solve -28 = -26y + 102 for y. 5 Solve -10z - 43z = 53 for z. -1 Solve -7k = -12k - 5 for k. -1 Solve 142 + 104 = -41l for l. -6 Solve 2n - 62 = -68 for n. -3 Solve 11 = -4f + 7 for f. -1 Solve -50s + 96 = 146 for s. -1 Solve 848 - 830 = 9y for y. 2 Solve 72l = 69l for l. 0 Solve l = -2l + 3 for l. 1 Solve -8l + 0l - 2l = 0 for l. 0 Solve -29d + 13d = 0 for d. 0 Solve 509f - 520f - 44 = 0 for f. -4 Solve 22z = 55z for z. 0 Solve -49 = 2q - 39 for q. -5 Solve 0b = -23b - 69 for b. -3 Solve 85 = -28q - 27 for q. -4 Solve 2993n - 3003n + 110 = 0 for n. 11 Solve -2 = 3z - 11 for z. 3 Solve -7a + 27 = 13 for a. 2 Solve -11u + 85 = -28u for u. -5 Solve -15 = 10i - 7i for i. -5 Solve 87 = 25q - 54q for q. -3 Solve 18w - 196 = -31w for w. 4 Solve 389 = -10g + 419 for g. 3 Solve 0 = 4i - 4i - 12i for i. 0 Solve 9l = -13l + 22 for l. 1 Solve 5t + 29 = 9 for t. -4 Solve 9n - 9 = 18 for n. 3 Solve -40 = 39b - 47b for b. 5 Solve 0 = 6w - 6w - 6w for w. 0 Solve 0 = -3b - 2b + 20 for b. 4 Solve -11s + 10s + 4 = 0 for s. 4 Solve h = 2h for h. 0 Solve 28a - 124 = -40 for a. 3 Solve 8m + 20 = 3m for m. -4 Solve -16d = -15d + 1 for d. -1 Solve 0 = -43i + 142 + 288 for i. 10 Solve -69 = 5l - 69 for l. 0 Solve 0 = -28l + 20l - 24 for l. -3 Solve 54m - 48 = 30m for m. 2 Solve -20 = h - 18 for h. -2 Solve 52x - 48x + 8 = 0 for x. -2 Solve -39h = 90 + 66 for h. -4 Solve 0 = v + 16v - 17 for v. 1 Solve 30p = -107 - 13 for p. -4 Solve -20s = 24s - 44 for s. 1 Solve -71 = 21t + 13 for t. -4 Solve -11a + 56a + 180 = 0 for a. -4 Solve 5o = 1 + 14 for o. 3 Solve 6a - 190 = -178 for a. 2 Solve 4 = 3d + 7 for d. -1 Solve -2x = -206 + 202 for x. 2 Solve 9a + 41 = 14 for a. -3 Solve 14 = 48u - 34 for u. 1 Solve -37p = -41p for p. 0 Solve 0 = 4d - 2 + 14 for d. -3 Solve 1 = -2l + l for l. -1 Solve 0r + 15 = 5r for r. 3 Solve 389 = -6p + 377 for p. -2 Solve -16r + 40 - 24 = 0 for r. 1 Solve -3r - 715 + 715 = 0 for r. 0 Solve 1560g = 1556g - 32 for g. -8 Solve 2n = 19n + 51 for n. -3 Solve -1 = 15u - 46 for u. 3 Solve -3g + 180 = -48g for g. -4 Solve 61z + 1130 = 174z for z. 10 Solve 10n - 26n = 2n for n. 0 Solve 10y - 6y = 12 for y. 3 Solve -23 = 2a - 19 for a. -2 Solve 0 + 0 = 10c for c. 0 Solve 0 = 20z - 15z - 5 for z. 1 Solve 68g = 58g + 40 for g. 4 Solve -218 = -79s - 929 for s. -9 Solve 504f = 511f + 14 for f. -2 Solve -46 = -4t - 66 for t. -5 Solve 114m - 112m = 0 for m. 0 Solve -77v - 10v = 870 for v. -10 Solve -11 = -2d - 1 for d. 5 Solve 0 = -10g + 41 - 11 for g. 3 Solve 13g = 7g + 24 for g. 4 Solve -364 = -68f + 16f for f. 7 Solve -37u = -39u - 10 for u. -5 Solve 61 = 25u + 11 for u. 2 Solve -414 = 22w + 24w for w. -9 Solve o + 21 = 16 for o. -5 Solve 3g = -g + 5g for g. 0 Solve 5 = 3u + 17 for u. -4 Solve 15 = -5y - 0y for y. -3 Solve 0 = 10f - 8f + 4 for f. -2 Solve 0 = -32r + 144 + 48 for r. 6 Solve -27 + 3 = 6r for r. -4 Solve 108j = 81j - 27 for j. -1 Solve 8l + 66 = 26 for l. -5 Solve -18 = -3j + 3 for j. 7 Solve 0 = -0m + 16m + 48 for m. -3 Solve -9y = 43 - 7 for y. -4 Solve 4 = 40g + 4 for g. 0 Solve 12h = -7h + 38 for h. 2 Solve -109 = -4m - 97 for m. 3 Solve -i - 37 = -41 for i. 4 Solve -6q + 10 = -8q for q. -5 Solve 44 = 52z - 30z for z. 2 Solve 110 = -21r + 5 for r. -5 Solve 0 = 6u + 46 - 16 for u. -5 Solve 0 = 15i + 872 - 887 for i. 1 Solve 0u + 6u + 12 = 0 for u. -2 Solve 29z + 20 = 33z for z. 5 Solve 18 = 3x + 24 for x. -2 Solve 0 = -28o + 27o - 1 for o. -1 Solve 0 = -86o - 232 + 60 for o. -2 Solve 579h - 6 = 577h for h. 3 Solve 4q - 296 + 288 = 0 for q. 2 Solve -3d = 9d for d. 0 Solve -3b = -0 + 3 for b. -1 Solve -6q + q - 25 = 0 for q. -5 Solve -10 = 46f - 10 for f. 0 Solve 0 = -221w + 206w - 45 for w. -3 Solve -1352 = -9y - 1397 for y. -5 Solve 46d - 10 = 41d for d. 2 Solve -26h + 38h = 60 for h. 5 Solve -8x = -7 + 23 for x. -2 Solve 13i = 15i - 8 for i. 4 Solve -75j = 300 + 225 for j. -7 Solve 21 = -16x + 5 for x. -1 Solve -250 = 11l - 228 for l. -2 Solve 37h - 33 = 48h for h. -3 Solve 0 = -4o - 6 - 10 for o. -4 Solve 31k = 35k for k. 0 Solve 0 = 844y - 842y - 12 for y. 6 Solve -43 + 35 = -2v for v. 4 Solve -2 = 7b - 9 for b. 1 Solve -1796q = -1788q - 40 for q. 5 Solve z = -2z - 2z for z. 0 Solve 2u + 8 = -2 for u. -5 Solve 4v - 12 = 8v for v. -3 Solve -11c + 19 = -30c for c. -1 Solve 0 = -2f - 108 + 98 for f. -5 Solve 0 = -13r + 6 - 84 for r. -6 Solve 172u = 178u + 12 for u. -2 Solve 7k - 39 = -95 for k. -8 Solve 0n = -47n for n. 0 Solve 11p - 29 = -117 for p. -8 Solve 4w + 420 = 440 for w. 5 Solve 161p - 20 = 157p for p. 5 Solve -88b = -81b - 35 for b. 5 Solve 1 = m + 6 for m. -5 Solve 0 = 6p + 62 - 44 for p. -3 Solve -20s = -8s - 12 for s. 1 Solve 6c = -39 + 15 for c. -4 Solve -16r = -5r - 55 for r. 5 Solve 3o = 25 - 19 for o. 2 Solve 25 = -23a + 28a for a. 5 Solve -13x = -5x - 8 for x. 1 Solve -25v = -18v + 49 for v. -7 Solve -25r + 29r = 20 for r. 5 Solve -24 = 13n - 16n for n. 8 Solve 93 = -30u - 27 for u. -4 Solve -1556b = -1548b - 24 for b. 3 Solve 7 - 1 = 2p for p. 3 Solve 0 = -11h + 2h + 18 for h. 2 Solve -33d + 40d + 21 = 0 for d. -3 Solve 231 = 54k + 555 for k. -6 Solve 38b = 36b - 4 for b. -2 Solve 333 = -7f + 340 for f. 1 Solve 0 = -29x + 365 - 75 for x. 10 Solve 74a + 25a = -198 for a. -2 Solve 0 = -2561x + 2555x + 60 for x. 10 Solve -54n - 224 = 208 for n. -8 Solve -9o - 643 + 688 = 0 for o. 5 Solve 0 = -4d + 3d + 5 for d. 5 Solve 18i + 12 = 14i for i. -3 Solve -4f - 42 = -14 for f. -7 Solve 0 = 8b - 11b - 6 for b. -2 Solve -10o + 17 = -63 for o. 8 Solve -305 - 25 = 66v for v. -5 Solve 9f - 10f = -5 for f. 5 Solve -11l + 7l = -8 for l. 2 Solve -93z = -113z + 20 for z. 1 Solve 7o - 45o = -38 for o. 1 Solve 19p + 6p + 175 = 0 for p. -7 Solve 6y - 12 = 12 for y. 4 Solve 0 = -401x + 394x - 28 for x. -4 Solve 2f - 15 = 5f for f. -5 Solve -8q = -26 + 18 for q. 1 Solve s - 3s = 4 for s. -2 Solve 3g = 8 - 14 for g. -2 Solve -5 = 151f - 146f for f. -1 Solve 2m - 3m - 5m = 0 for m. 0 Solve 6o + 57 = 25o for o. 3 Solve 256z - 250*z = 12 for	{ "pile_set_name": "DM Mathematics" }
- rt = -16. Let f(s) = tw(s) + 11l(s). Solve f(i) = 0. 1 Let l(q) be the third derivative of q8/10080 + q7/2520 + q5/12 - 9q*2. Let c(w) be the third derivative of l(w). Factor c(x). 2x(x + 1) Let i(r) be the first derivative of -r7/70 - r6/20 + r4/4 + r3/2 + r2 - 6. Let w(z) be the second derivative of i(z). Solve w(j) = 0 for j. -1, 1 Let z(s) = -s - 1. Let c(y) = -y2 - 5. Let r(n) = -c(n) + 5z(n). Factor r(d). d(d - 5) Let t be -2-1(-6)/(-4). Suppose -9c = -8c. Factor -2v + 3 + cv - t - v2. -v(v + 2) Let f(i) be the third derivative of i5/270 + i4/36 + 2i3/27 + 6i*2. Solve f(p) = 0. -2, -1 Solve -3k + 3/2k2 + 0 + 3/2k*3 = 0 for k. -2, 0, 1 Suppose -4q - 2s = 8, -3q = 2s - s + 4. Let v be 2 + 3 - 2/4. Factor vd3 + d2 + 0d + 7/2d4 + q. d2(d + 1)(7d + 2)/2 Suppose -3d - 4 = -2m - 3, 2d - 11 = -m. Find z, given that -8z2 + 12z*d + 6z*5 - 2z*5 - 8z*5 = 0. -2, 0, 1 Let x = 47 + -47. Find n, given that 1/5n + x - 1/5n2 - 2/5n*3 = 0. -1, 0, 1/2 Let y(j) be the second derivative of -1/60j*4 - 1/15j*3 - 1/10j*2 + 0 - 2j. Factor y(b). -(b + 1)*2/5 Let h be (-7 - -10) + (0 - (-11)/(-4)). Factor -1/4s + 0 + 3/4s4 - 3/4s*2 + hs*3. s(s - 1)(s + 1)(3s + 1)/4 Let d be (-24)/(-15) + 2/5. Suppose -du + 0u = -6. Factor 0w - 2/7w2 - 2/7w*u + 0. -2w*2(w + 1)/7 Let i be 8-1 + 25 + -15. Factor 0 + 2/5y*i + 2/5y. 2y(y + 1)/5 Suppose m = 5m. Suppose m = -3z + 6z - 12. Factor 15p*2 + 0p*3 - zp - 10p3 - p2. -2p(p - 1)(5p - 2) Let g(x) be the first derivative of -2/3x + 1 + 2/9x3 + 0x*2. Factor g(a). 2(a - 1)(a + 1)/3 Let a(s) be the third derivative of 1/108s*4 + 0 + 2/945s*7 + 0s + 0s3 - 1/1512s*8 + 3s*2 - 1/135s*5 + 0s*6. Factor a(i). -2i(i - 1)3(i + 1)/9 Let a be (0 + 1/(-2))16. Let b = a + 10. Let 1/4o + 0 + 1/4ob = 0. Calculate o. -1, 0 Let t(i) be the third derivative of i8/6720 + i7/3360 - 2i3/3 + i2. Let d(q) be the first derivative of t(q). Factor d(j). j*3(j + 1)/4 Determine j so that -13j2 + 5j*5 + 82j*4 - 6j - 81j4 - 7j*3 - 4j5 = 0. -2, -1, 0, 3 Let k(w) be the second derivative of -w2 - w*3 - 1/10w*5 + 0 + 2w - 1/2w4. Find o such that k(o) = 0. -1 Let a be -6 + (-9)/((-3)/1). Let x be (-20)/8a/15. Solve 7/4b - x - 7/4b*3 + 1/2b*2 = 0 for b. -1, 2/7, 1 Factor 4v*3 - 5 - 7v*3 - 7v*3 + 10v + 5v4. 5(v - 1)*3(v + 1) Let u(b) be the second derivative of b5/60 - b4/24 - b*3/3 - 3b*2/2 + 3b. Let c(i) be the first derivative of u(i). What is h in c(h) = 0? -1, 2 Let n(x) be the third derivative of x6/30 + x5/5 + 11x2. Determine l so that n(l) = 0. -3, 0 Let m be 2/8 - (-2)/8. Find x such that 0x - 1/2x2 + m = 0. -1, 1 Let c(v) = v3 - v - 1. Let d(z) be the first derivative of 3z4/2 + z3 - 3z2/2 - 5z - 7. Let h(r) = 5c(r) - d(r). Factor h(x). -x(x + 1)(x + 2) Let y = -636/7 - -1915/21. Factor -1/6u*4 - 1/3u + 1/6 + 0u2 + yu3. -(u - 1)3(u + 1)/6 Let i(k) be the second derivative of 0k*3 - 1/80k*5 - 1/48k*4 + 1/168k*7 + 1/120k*6 + 2k + 0k2 + 0. Determine s, given that i(s) = 0. -1, 0, 1 Suppose 3 - 2 = t. Let v be 1/t - (-1)/3. Factor -2/3h*2 - 2/3h + v. -2(h - 1)(h + 2)/3 Let w(a) be the first derivative of a*3 + 12/5a - 3/20a4 - 12/5a*2 + 6. Factor w(l). -3(l - 2)*2(l - 1)/5 Let n(v) be the first derivative of -v*6/24 + 5v*5/4 - 125v*4/8 + 625v*3/6 - 3125v*2/8 + 3125v/4 + 16. Solve n(a) = 0. 5 Let s be (-1)/6 - (-76)/24. Suppose -4u + sp - 7 = 0, 3p = 7 + 8. What is j in 0 + 1/3j*u + 0j - 1/3j3 + 1/3j*5 - 1/3j4 = 0? -1, 0, 1 Let d(s) = s2 - 11s - 9. Let p be d(12). Let y3 - 2y2 - y + yp - 3y3 = 0. Calculate y. -1, 0 Find b, given that -1/5b + 3/10b4 + 0 + 9/10b2 - b3 = 0. 0, 1/3, 1, 2 Suppose -2x + 8 = 2m, -m + 3x = 6x - 8. Factor -1/2k + 0 + 1/2k*m. k(k - 1)/2 Solve -2n3 + 0n + 10n + 2n*2 - 2 - 8n = 0 for n. -1, 1 Let j = -25 - -29. Factor 0r + 0 + 2/7r*3 - 4/7r*j + 0r*2 + 2/7r*5. 2r*3(r - 1)*2/7 Let y be -1(-4)/(-16)(-3 - -1). Factor o2 + 5/4o + y + 1/4o3. (o + 1)2(o + 2)/4 Let y be (1/2)/(3/(-36)). Let a be (3/y)/((-2)/12). Factor r*2 - 3r*2 + ar*2 - 4 - 4r + 8. (r - 2)*2 Let v be 1 + 2/(-2) + 2. Factor -6s*2 + 0s*2 + 7sv. s2 Let t = 101/210 - -2/105. Solve r*3 - 1/2r - 1/2 - tr4 + r2 - 1/2r*5 = 0 for r. -1, 1 Factor 4d*2 + 4d*2 + 4d*2 - 10d*2 + 4 + 6d. 2(d + 1)(d + 2) Let w(l) be the second derivative of l7/2520 + l4/12 - 2l. Let b(k) be the third derivative of w(k). What is r in b(r) = 0? 0 Let q = 1/169 + 329/1521. Factor 2/9t*2 + 2/9t*3 - q - 2/9t. 2(t - 1)(t + 1)2/9 Let f(t) be the second derivative of -t5/20 + t4/18 + t3/18 - 21t. Factor f(c). -c(c - 1)(3c + 1)/3 Let x(j) = 36j5 - 99j*4 + 99j*3 - 15j + 15. Let c(l) = 5l5 - 14l*4 + 14l*3 - 2l + 2. Let v(n) = -15c(n) + 2x(n). Solve v(q) = 0. 0, 2 What is v in 21v3 + 3v*4 + 21v*3 - 42v*3 + 3v*5 = 0? -1, 0 Factor 0 - 5/4r*5 + 5/4r*2 + 0r + 5/4r3 - 5/4r*4. -5r*2(r - 1)(r + 1)2/4 Let c be 5 - 7/((-7)/(-3)). Let g(s) be the second derivative of 0 + cs - 1/18s4 + 1/90s*6 + 1/6s*2 + 0s*5 + 0s*3. Find b, given that g(b) = 0. -1, 1 Let z be 1/(-5)(-25)/90. Let p(k) be the first derivative of -2/45k5 - 2 + zk*4 + 0k*3 + 0k*2 + 0k. Determine t, given that p(t) = 0. 0, 1 Suppose -a + 17 = 3c + 7, -8 = -4a + 4c. Let t(f) be the first derivative of 1/16f*a + 1/4f + 1 + 1/4f3 + 3/8f2. Factor t(r). (r + 1)3/4 Let u(z) = 3z5 + z4 - 2z*3 - 11z*2 + 9z. Let j(k) = 5k5 + k4 - 3k*3 - 17k*2 + 14k. Let r = -8 + 16. Let y(s) = ru(s) - 5j(s). Factor y(v). -v(v - 2)(v - 1)*2(v + 1) Let s = -8/3 - -4. Suppose s + 2/3h2 - 2h = 0. What is h? 1, 2 Let z(g) be the first derivative of -g3/6 + g2/4 - 10. Factor z(o). -o(o - 1)/2 Let b(a) be the second derivative of -a4/138 + 4a*3/23 - 36a*2/23 - 40a. Factor b(v). -2(v - 6)2/23 Let h(d) = 3d - 3. Let f be h(3). Let k = f - 4. Let 0o + 0 + 0o*3 + 1/2o*k - 1/2o*4 = 0. What is o? -1, 0, 1 Let i be (8/32)/((-1)/(-8)). Let -8b*2 - 3b - 5b3 + 2 - 3b*3 + ib + 3b3 = 0. Calculate b. -1, 2/5 Let d(f) = -4f*2 - 61f - 253. Let m(u) = -u - 1. Let p(g) = -d(g) - 3m(g). Let p(v) = 0. Calculate v. -8 Let o = -5 + 1. Let w be (-9)/o + (-1)/4. Factor -8/3 - 8/3s - 2/3sw. -2(s + 2)2/3 Let u(m) = m3 + m2 - 2. Let o(z) = z3 - z - 3. Let k(v) = -2o(v) + 3u(v). Factor k(n). n(n + 1)(n + 2) Let q = 13 + -13. Let z(a) be the second derivative of 1/60a5 + qa*2 - a + 0a*4 + 0 - 1/18a3. Find g such that z(g) = 0. -1, 0, 1 Let n(j) be the first derivative of -j7/70 - j6/40 + j5/20 + j*4/8 + 2j*2 + 5. Let z(a) be the second derivative of n(a). Solve z(b) = 0. -1, 0, 1 Suppose -4a = 3z - 371, a - 5a + 5z + 331 = 0. Let y = a + -443/5. Determine u, given that 2/5u + 2u2 - y + 6/5u*3 = 0. -1, 1/3 Suppose -n = -5o - 0o + 31, n - 17 = -3o. Let q be (15/6)/(10/o). Factor -qd2 + 0 - 1/2d. -d(3d + 1)/2 Let o(y) = 7y2 - 3y - 15. Let g(h) = -h*2 - h + 1. Let x(v) = 10g(v) + 2o(v). Factor x(t). 4(t - 5)(t + 1) Let g(y) = 4y - 99. Let m be g(26). Let a(q) be the first derivative of 3 + q*3 - 3/5qm + q6 + 3/2q2 + 0q - 9/4q4. Determine z so that a(z) = 0. -1, -1/2, 0, 1 Let d(h) be the second derivative of -h4/12 - 5h*3/3 - 25h*2/2 - 13h. Factor d(b). -(b + 5)*2 Factor 1/3k*3 + 1/3k*4 + 0 - 1/3k*2 - 1/3k. k(k - 1)(k + 1)*2/3 Let b(x) be the second derivative of -3x + 1/16x4 + 0 + 0x*2 - 1/8x*3. Factor b(k). 3k(k - 1)/4 Let y be 343/(-9). Let c = y + 7. Find o such that 1 + 3 - 6 + o2 + 2o + c = 0. -1 Let k(n) be the second derivative of -1/6n3 + 0n*2 - 5n + 0 + 1/6n4 - 1/20n*5. Solve k(v) = 0. 0, 1 Let k be (-2)/(-3) + 8/(-30). Let t be 1 + (-56)/35 - -1. Let 0 + tf*3 - 4/5f + kf2 = 0. What is f? -2, 0, 1 Let c(b) = -b + 1. Let r(g) = 3g*2 + 5g + 3. Let u(l) = -l*2 + l + 1. Let h(d) = r(d) - 6u(d). Let j(t)	{ "pile_set_name": "DM Mathematics" }
u + 4n = -244, 4u - 49 = 5u - 5n. What is the tens digit of -4 - (u - (-2 - -1))? 5 What is the units digit of (-12)/(-42)7(4 + 1159)? 6 Let j(t) = 17t*2 + 3t - 3. Suppose 16o = 17o - 2. What is the units digit of j(o)? 1 Suppose -2g - 4c + 4 = 0, 15 = 4g - 5c - 32. Suppose -5i = -i - g. Suppose ib - 225 = -3b. What is the tens digit of b? 4 Let f(d) = d2 + 4d + 3. Let s be f(-3). Let l be (s - 1) + 10/5. What is the units digit of 11 - (l + 0)3? 8 Suppose -7y = -4y. What is the tens digit of ((-2)/(-4) + y)230? 1 Suppose -2p + 35 + 153 = 0. Let r = p - -70. What is the hundreds digit of r? 1 Let s be (-40)/50(-25)/2. Suppose 0 = q - 3q - s. What is the units digit of (q/(-10))/(2/132)? 3 Suppose 2214 = 4y - p, -y + 0y + 552 = -p. What is the tens digit of y? 5 Let c(w) = -w + 1. Let n(i) = -3i + 4. Let b(d) = 5c(d) - n(d). Let k be b(-2). Suppose -kf + 17 = y - 16, -f = -1. What is the units digit of y? 8 Let k(q) = -q*3 + 2q*2 - 6q - 8. What is the hundreds digit of k(-4)? 1 Let k(p) = -4p3 + 3p*2 + 14p - 7. What is the tens digit of k(-3)? 8 Let t be 1153/62. Let o = t + 4. Let q = 80 - o. What is the units digit of q? 5 Let j(t) = t + 6. Let x be j(-2). Suppose 0 = -4r - 3q + 8, -2r - 3q + 2 = x. Suppose -3d + 12 = 0, 0d + 7 = -ry + 3d. What is the units digit of y? 1 Suppose -5y + 9y + y = 0. Suppose y = o + 4f - 81, 4f + 443 = 3o + 120. What is the tens digit of o? 0 Let u = 2272 - 1473. What is the tens digit of u? 9 Let w(f) = f3 - 25f*2 + 86f + 14. What is the tens digit of w(22)? 5 Suppose 5p = 2o + 3o - 135, 2o = -p + 57. Let r be 26/7 + 8/o. Suppose 0 = rm - 2m - 14. What is the units digit of m? 7 Let k = -504 - -1151. What is the hundreds digit of k? 6 What is the hundreds digit of (3 - 2)/((-36456)/(-9112) - 4)? 1 Let a(x) = 2x3 - 73x*2 + 40x + 97. What is the units digit of a(36)? 1 Let d = 1946 - 579. What is the tens digit of d? 6 Suppose 2 = -z - z, 2c - z + 19 = 0. Let a be 4/c - 8/(-20). Suppose 7t - 6t - 23 = a. What is the tens digit of t? 2 Let b(p) = p - 4. Let j(f) = 5f - 15. Let w(t) = -18b(t) + 4j(t). Let y = 0 + 5. What is the tens digit of w(y)? 2 Let b(j) = 3j + 31. Let x be b(-12). What is the tens digit of 276 + (-4 - (x - 4))? 8 Let h be 3 - (1/(-3) + (-96)/9). Let j(v) = v3 + 5v*2 + v - 3. Let n be j(-4). Let g = h + n. What is the units digit of g? 3 Suppose -n = -3n + 5m + 23, 5n = -5m + 75. What is the tens digit of 5794/30 + n/(-105)? 9 Suppose 0 = -15l + 11l + 304. Suppose -l = -4u - 0u. Suppose ub - 150 = 14b. What is the units digit of b? 0 What is the thousands digit of (-1 - (-45)/21)/(20/19670)? 1 Let f be ((-8)/((-64)/(-6)))/((-6)/16). Let o(d) be the third derivative of d5/20 - d4/12 + d3/3 - d2. What is the tens digit of o(f)? 1 Suppose 151o = 143o + 26872. What is the units digit of o? 9 Suppose 3a + 5m - 21 - 16 = 0, 0 = 2m - 10. Suppose i - 4t = -i + 106, at + 47 = i. What is the units digit of i? 9 Let l = 1414 - 568. What is the hundreds digit of l? 8 Let y(l) = -2l - 11. Let b be y(-5). What is the units digit of b(-2)/2 - -34? 5 Suppose -5r + g + 815 = 0, 2g - 2 = -12. What is the units digit of (3 - r/3)/(-1)? 1 What is the hundreds digit of 189/((-1166)/795 - 10/(-6))? 9 Let c be (2/(-3))/(2/(-18)2). Suppose -cy + 834 = w, 3y + 545 = 5y - 3w. What is the hundreds digit of y? 2 Let q = -31 - -17. Let c = -9 - q. Suppose -15 = cp, 4f - 1 + 9 = -4p. What is the units digit of f? 1 Let v(k) = 1179k2 - 2k - 1. What is the tens digit of v(-1)? 8 What is the units digit of -17(6 - 3 - 4)? 7 Let b = -670 - -738. What is the tens digit of b? 6 Let h(v) = 6v*2 - 23v + 24. Let k(t) = 5t2 - 22t + 24. Let n(c) = 6h(c) - 7k(c). What is the tens digit of n(-18)? 1 Suppose 39o = 30o + 35055. What is the units digit of o? 5 Suppose -6k + 4k = 0. What is the tens digit of 4 + k + 3 + 53? 6 Suppose -3o = -15, -4a - 4o - 2 = -18. What is the units digit of a/(-4)-1(-2864)/4? 9 Suppose 882 = j + 5j. Let m = j - 33. What is the hundreds digit of m? 1 Let d(o) = 2o2 + 55o - 267. What is the units digit of d(-47)? 6 What is the units digit of 18(-1 - (-7674)/36)? 9 Suppose 0 = -y - 4j - 8, 5j + 2 = 3y + 43. What is the units digit of (1/(12/(-32)))/(2/y)? 6 Let x(c) = -3c + 6. Let p(n) = n. Let d(b) = -2p(b) - x(b). Suppose -3j = -5g - 7j + 61, g - 5j + 11 = 0. What is the units digit of d(g)? 3 What is the units digit of (608/(-12))/(4/(-222))? 2 Let s(h) = 8h2 + 6h - 7. What is the tens digit of s(5)? 2 Let i(g) = g + 17. Let k(l) = -1. Let z(m) = 2i(m) + 22k(m). Let w be z(-5). Let s = w + -1. What is the units digit of s? 1 Let f(v) = 7v2 + 9v - 4. Let g = -21 - -17. What is the units digit of f(g)? 2 Let q = -1310 - -2631. What is the thousands digit of q? 1 Suppose 2j = -3j, 4m + 4j - 196 = 0. Let i = -41 + m. What is the units digit of i? 8 Let t(b) = 360b + 219. What is the units digit of t(12)? 9 Let p = 0 + 2. Let o be 4/((7/(-24))/(-7)). Suppose -pc = -o + 30. What is the tens digit of c? 3 Suppose 0 = -w - 5h + 904, 0w - 2h = 4w - 3580. What is the units digit of w? 4 Let k = -244 + 425. What is the hundreds digit of k? 1 Let i(z) = -z + z - 2 - 3z + z + 19z2. What is the units digit of i(2)? 0 Let t(m) = -m3 - 26m2 - 38m - 113. What is the units digit of t(-26)? 5 What is the units digit of (14540/32 - 0) + (-36)/96? 4 Let z = 0 + 8. Suppose -zo + 4o + 16 = 0. Suppose os = s + 129. What is the units digit of s? 3 Suppose 1022 + 854 = 4j. What is the hundreds digit of j? 4 Let b(u) be the second derivative of 1/12u4 + 0u*2 + 5u + 0u3 + 3/4u*5 + 0. What is the tens digit of b(1)? 1 Let v(t) = -17t - 26. Let a be v(-4). Suppose -10i + 13i = a. What is the units digit of i? 4 Let h be -2(10/4)/((-3)/153). What is the hundreds digit of (-3)/(6/(-4)) + h? 2 Let i = -375 + 423. What is the units digit of i? 8 Suppose 40p - 39p = 24. Suppose -2 = -2k + p. What is the tens digit of k? 1 Let i(j) = -j*3 - 5j*2 - j - 3. Let o be i(-5). Suppose -3k + 13 = u - 6, -3u + 24 = -ok. Suppose 12t = ut + 60. What is the tens digit of t? 3 Let i = -305 - -508. Suppose -3t + 4f = -i, 315 = 5t - f - 46. What is the units digit of t? 3 What is the hundreds digit of 1137 - (12 + (-6 - 1))? 1 Let s = 19 + -29. Let g be (-36)/s - 4/(-10). Suppose -3p - 10 = -gp. What is the units digit of p? 0 What is the tens digit of (-6)/(-57) + (-86345)/(-95)? 0 Let y(f) = 4f + 2. Let g be y(-1). Let x be (g + (-8)/12)-3. Suppose 0 = xw - 5w - 18. What is the units digit of w? 6 What is the thousands digit of 162/10(-48645)/(-621)? 1 Let d(g) = 15 - 10 - 14g - 11 - 7. What is the hundreds digit of d(-10)? 1 Let q = -548 - -1175. What is the tens digit of q? 2 Suppose 3r + 0r - 14 = -4b, 0 = b + 4r - 10. Suppose 3j - 32 = p, -16 - 2 = -bj - p. What is the tens digit of (j/4)/((-11)/(-66))? 1 Suppose r - 4p + 6p = 345, -r - 5p + 357 = 0. What is the hundreds digit of r? 3 Suppose -q + 20 - 8 = 0. Suppose -1968 = -0f - qf. What is the hundreds digit of f? 1 Suppose 5y - 124 = 716. What is the units digit of y? 8 Suppose -26 - 766 = 9l. Let t = l + 176. What is the units digit of t? 8 Let v(j) = -7j2 + j. Let x be v(-1). Let z(s) be the third derivative of -3s*4/8 - 9s*3/2 - 3s*2. What is the units digit of z(x)? 5 Suppose -14a + 25612 = 1882. What is the thousands digit of a? 1 Let y(s) = -343s - 3 + 337s + 11. What is the tens digit of y(-5)? 3 What is the tens digit of 198/(-4)(-8)/2055? 8 Suppose 17z = 24z - 364. Let v = 32 + z. What is the tens digit of v? 8 Let n = 17 - 12. Let k(m) be the first derivative of m4/4 - m3 - m*2/2 + 3m + 31. What is the units digit of k(n)? 8 Let i be (2/(-1) - -1) + 7. What is the units digit of (-4)/i - 48/(-18)? 2 Let a(o) = -3o - 8. Let c(f) = f + 4. Let y be c(-4). Suppose y = -4u + 16, -4z + u - 13 = 15. What is the units digit of a(z)? 0 Let y = -181 + 266. What is the units digit of y? 5 What is the units digit of (-3)/4(29 - 1993)? 3 Let y(x) = -142x - 66. What is the units digit of y(-4)? 2 Let n(i) = i3 - 7i*2 + 21i -	{ "pile_set_name": "DM Mathematics" }
r of 89/227632 and 119/20. 1138160 What is the least common multiple of 51 and 1759517? 5278551 Find the common denominator of -7/5060 and -117/220. 5060 Calculate the smallest common multiple of 14 and 188952. 1322664 Calculate the smallest common multiple of 82 and 205048. 8406968 What is the least common multiple of 3678 and 153? 187578 What is the least common multiple of 240 and 7600? 22800 What is the smallest common multiple of 854 and 10? 4270 Calculate the lowest common multiple of 1340173 and 1074. 8041038 Calculate the lowest common multiple of 18 and 1207044. 1207044 What is the smallest common multiple of 20034 and 14310? 100170 What is the smallest common multiple of 17600 and 2596? 1038400 What is the common denominator of 9/44170 and 109/37860? 265020 Calculate the lowest common multiple of 7267 and 215. 36335 Find the common denominator of -79/2856 and 39/3304. 168504 Calculate the least common multiple of 3593 and 42. 150906 Calculate the common denominator of 105/70058 and -109/260. 9107540 What is the common denominator of 103/2682 and -65/11324? 101916 What is the smallest common multiple of 1725 and 58581? 1464525 Calculate the least common multiple of 8024 and 136. 8024 Calculate the common denominator of 69/88 and 39/880. 880 Find the common denominator of 92/6675 and 9/27590. 413850 What is the smallest common multiple of 1312990 and 525196? 2625980 Find the common denominator of -145/504 and 11/9450. 37800 What is the lowest common multiple of 15 and 86133? 430665 What is the common denominator of -53/91712 and 113/192? 275136 What is the smallest common multiple of 6848 and 146376? 1171008 What is the smallest common multiple of 115818 and 115818? 115818 Find the common denominator of -145/914976 and -37/2304. 7319808 Calculate the least common multiple of 108 and 6882. 123876 Calculate the common denominator of 73/2606559 and 99/10. 26065590 What is the least common multiple of 91698 and 25296? 733584 What is the common denominator of 95/8452 and 89/38? 160588 Calculate the least common multiple of 238616 and 18. 2147544 Calculate the common denominator of 59/12 and 47/2400711. 9602844 What is the least common multiple of 14656 and 72? 131904 Calculate the least common multiple of 19912 and 5502. 418152 Calculate the common denominator of 19/115056 and 163/920448. 920448 Find the common denominator of 61/1527 and 149/12216. 12216 What is the common denominator of 19/44424 and 79/49360? 444240 Find the common denominator of -38/143 and 19/8411. 92521 Calculate the least common multiple of 8 and 433884. 867768 Calculate the common denominator of -51/242536 and -21/69296. 485072 Calculate the common denominator of 15/1316 and -79/392. 18424 What is the common denominator of -61/64 and -61/118? 3776 Find the common denominator of -59/543966 and -47/9. 1631898 Find the common denominator of 13/372 and -8/7905. 31620 Calculate the common denominator of 16/12965 and -87/57046. 285230 Find the common denominator of 79/333450 and 1/66690. 333450 What is the common denominator of -83/844 and -9/14348? 14348 Find the common denominator of -65/523824 and -127/108. 4714416 What is the common denominator of -139/99000 and -83/680? 1683000 What is the lowest common multiple of 70 and 22170? 155190 Find the common denominator of -29/14 and -33/214. 1498 What is the smallest common multiple of 2301851 and 68? 9207404 What is the lowest common multiple of 32565 and 1755? 293085 Calculate the common denominator of 93/754390 and -40/678951. 6789510 Calculate the common denominator of -43/184 and -35/58098. 232392 What is the least common multiple of 1029556 and 44? 1029556 Calculate the lowest common multiple of 123270 and 29350. 616350 Find the common denominator of -11/34 and 145/65334. 1110678 What is the common denominator of -58/3 and 85/469034? 1407102 What is the smallest common multiple of 289850 and 202895? 2028950 What is the least common multiple of 7038 and 1564? 14076 Calculate the least common multiple of 34343 and 58. 1991894 Calculate the smallest common multiple of 886 and 2546364. 2546364 Calculate the lowest common multiple of 620502 and 12. 1241004 Find the common denominator of -62/7005 and -101/692094. 3460470 What is the common denominator of 79/11544 and -3/1628? 126984 Calculate the lowest common multiple of 10108 and 40. 101080 What is the smallest common multiple of 554064 and 5? 2770320 Find the common denominator of -105/17212 and -71/25818. 51636 What is the common denominator of -97/3186 and 49/28674? 28674 Calculate the smallest common multiple of 3 and 1255149. 1255149 Calculate the smallest common multiple of 29221 and 121. 3535741 What is the smallest common multiple of 146160 and 13398? 1607760 Find the common denominator of -63/225950 and 45/18076. 451900 Calculate the common denominator of 97/15488 and 81/64. 15488 What is the common denominator of -81/43840 and 133/8220? 131520 Calculate the common denominator of 3/2356 and -131/11780. 11780 What is the smallest common multiple of 16 and 384112? 384112 Find the common denominator of -59/9902 and -37/28. 138628 Calculate the common denominator of 113/14634 and -43/53658. 160974 Calculate the common denominator of 61/40 and 119/384. 1920 Calculate the smallest common multiple of 3810266 and 11. 41912926 What is the common denominator of -77/3152 and -25/16548? 66192 Calculate the least common multiple of 13032 and 2496. 1355328 Calculate the least common multiple of 7726763 and 5. 38633815 What is the common denominator of 87/10 and 13/1555094? 7775470 What is the least common multiple of 3161 and 288? 910368 What is the common denominator of 99/394 and -6/17? 6698 Calculate the common denominator of 73/21060 and -2/61425. 737100 Calculate the lowest common multiple of 81624 and 192. 652992 Calculate the lowest common multiple of 1149552 and 10. 5747760 What is the least common multiple of 247464 and 1848? 2722104 What is the least common multiple of 630 and 383670? 383670 What is the lowest common multiple of 28 and 509432? 509432 Find the common denominator of 121/5304 and -131/156. 5304 Calculate the least common multiple of 13680 and 5760. 109440 Calculate the common denominator of -163/600 and -77/5960. 89400 Calculate the least common multiple of 61205 and 330507. 1652535 Find the common denominator of -133/11232 and 173/9282. 1336608 What is the smallest common multiple of 1080 and 29700? 59400 What is the least common multiple of 7231 and 77? 79541 What is the least common multiple of 643932 and 12? 643932 What is the smallest common multiple of 8466 and 102? 8466 Calculate the least common multiple of 176 and 924396. 3697584 What is the common denominator of -83/670 and -89/201536? 1007680 Calculate the common denominator of -74/42783 and -37/39. 42783 What is the smallest common multiple of 8 and 132639? 1061112 Calculate the common denominator of -131/9420 and -107/10080. 1582560 Find the common denominator of -73/12544 and 151/17472. 489216 Calculate the common denominator of -129/1078 and 82/357. 54978 Calculate the lowest common multiple of 10860 and 3620. 10860 Calculate the common denominator of 8/13905 and 113/59946. 2697570 What is the common denominator of -13/330 and -68/616869? 6168690 What is the least common multiple of 199752 and 95120? 1997520 What is the least common multiple of 222 and 5268? 194916 Find the common denominator of 61/77245 and 79/532. 5870620 What is the smallest common multiple of 102668 and 154002? 308004 Calculate the smallest common multiple of 3681 and 4908. 14724 Find the common denominator of 151/998952 and 133/14004. 2996856 Find the common denominator of -56/195 and -5/20007. 100035 What is the least common multiple of 42924 and 126? 128772 What is the common denominator of -9/260 and 19/10140? 10140 Find the common denominator of 79/1330 and 101/2394. 11970 What is the smallest common multiple of 6678 and 21? 6678 Calculate the common denominator of -29/63580 and -123/40460. 445060 Calculate the least common multiple of 2304 and 513. 131328 Calculate the least common multiple of 268 and 5494. 10988 Calculate the least common multiple of 33 and 33154. 99462 What is the smallest common multiple	{ "pile_set_name": "DM Mathematics" }
2 + 57. Let z(v) = v2 + 29. Let o(m) = 3y(m) - 5z(m). Let a(x) be the first derivative of o(x). Determine a(w(q)). 68q2 Let q(p) = -2p*2. Let l be ((-4)/6)/((-2)/(-6)). Let k be 0/(0 + -1 - l). Let s(j) = 5j - j - 3j + kj. Give s(q(i)). -2i2 Let j(f) = 2f. Let y(m) be the third derivative of 185m4/24 + 2m*2 + 37m. Calculate j(y(r)). 370r Let h(l) = -4l. Let s(m) = 3m2 + 5m - 5. Let k be -9 + 5 - (1 + 0/(-1)). Let n(j) = -j*2 - 2j + 2. Let y(c) = kn(c) - 2s(c). Calculate y(h(f)). -16f2 Let v(d) = -21d. Let s(o) be the first derivative of -1/3o3 + 0o*2 + 4 + 0o. Calculate v(s(i)). 21i2 Let c(d) = -2d*2. Let k be (21 - 16)(-47)/(-5). Let u(h) = kh + 42h - 96h. What is c(u(l))? -98l*2 Let c(v) = 16v - 4. Let f(s) = s - 1. Let g(p) = c(p) - 4f(p). Let k(r) = 472 - 2r + r - 472. Calculate g(k(t)). -12t Let a(c) = 2c*2 + 3c - 1. Let t(n) = -11n2 + 135n + 6. Let j(b) = 6a(b) + t(b). Let y(d) = 2d*2. Give j(y(o)). 4o*4 + 306o*2 Let n(g) be the first derivative of 0g - 7 + 4/3g3 + 0g2. Let m(i) be the third derivative of -i5/60 - i*2. What is m(n(s))? -16s*4 Let s(o) = 5o*2. Let u(a) be the first derivative of 3/2a*2 - 20 + 0a. Give s(u(b)). 45b2 Let f(o) = -332o. Let t(w) = 2w2 + 10. Let c(y) = -3y*2 - 14. Let g(r) = -5c(r) - 7t(r). Give f(g(s)). -332s*2 Let n(t) = -2t. Let y(r) = 38r2 + 3r + 3. Let j(g) = -39g2 - 2g - 2. Let s(k) = -3j(k) - 2y(k). Give n(s(o)). -82o2 Let j be 2/(-2) + 1 + 2. Let x(r) = 0r*j + 2r*2 - 7r*2 - 2r*2. Let a(y) = 3y. Give x(a(f)). -63f2 Let c(x) = -20x*2. Let w = 26 + -18. Let s(p) = 0p + wp - 18p + 9p. Give s(c(u)). 20u*2 Let n(q) = 2q. Let u(l) = 273l. Suppose 11 = i - 4. Let m(j) = 14j - ij + 18j. Let y(r) = -65m(r) + 4u(r). Calculate y(n(k)). -26k Let y(q) = -28q*2 - 2. Let f(r) = -5r*2 - 15r + 5. Let c(x) = 5x2 + 18x - 6. Let o(a) = 5c(a) + 6f(a). What is y(o(z))? -700z4 - 2 Let z(m) = 34985m - 34985m + 3m*2. Let c(n) be the third derivative of 7n4/24 + n2. Give c(z(o)). 21o2 Let u(t) = 34t2. Let o(d) be the third derivative of d5/30 - 50d2. Give u(o(q)). 136q*4 Let k(b) be the first derivative of 2b*2 + 10. Let f(x) be the third derivative of 0x*3 + 1/12x*4 + 0 + 0x - 3x2. Give f(k(y)). 8y Let y(w) = -25w - 7. Let r(k) = 13k + 3. Let j(z) = -7r(z) - 3y(z). Let s(h) = 22h. Calculate s(j(f)). -352f Let n(g) = -3g + 3. Let o(z) = -7z - 115. Calculate n(o(i)). 21i + 348 Let c(i) = -i2. Let o(f) be the third derivative of -89f*4/24 - 44f*2 + 5. Calculate o(c(n)). 89n*2 Let y(q) = 74447q + 8q2 + 16q*2 - 74445q. Let a(m) = 4m. Calculate a(y(t)). 96t*2 + 8t Let w(f) = -2f. Let l(j) = 24j - 9. Let x(b) = 21b - 10. Let a(i) = 7l(i) - 6x(i). Give w(a(r)). -84r + 6 Let p(i) = -4 + 0 + 4 - 4i2. Let b(o) = 21o*2 - 10o*2 - 20o*2. Give b(p(r)). -144r*4 Let a(h) = 19h*2 - 3h + 3. Let p(t) be the first derivative of -19t3/3 + 2t*2 - 4t + 14. Let m(b) = -4a(b) - 3p(b). Let q(y) = 2y2. Give m(q(c)). -76c4 Let r(h) be the second derivative of h6/36 + 5h3/6 - 11h. Let v(s) be the second derivative of r(s). Let z(y) = 2y2. What is v(z(q))? 40q*4 Let z(r) = -7r*2. Let o(s) = s - 445s*2 + 440s*2 - s. Determine o(z(a)). -245a*4 Let t(r) be the second derivative of 4r*3/3 - 899r. Let n(c) = 15c. Let b(j) = 8j. Let s(h) = 5b(h) - 3n(h). Determine s(t(q)). -40q Let h(k) = -2. Let o(j) = j2 - 5. Let n(d) = 10h(d) - 4o(d). Let s(r) = -4r - 5. Give n(s(x)). -64x2 - 160x - 100 Let o(z) = 39z2. Let s(h) = -32277h*2. Calculate s(o(m)). -49093317m4 Let r(f) be the second derivative of -f4 - 7f3/6 - 420f. Let p(a) = -a*2. Determine p(r(z)). -144z*4 - 168z*3 - 49z*2 Let z be (3 + 2 + -2)/1. Let p(m) = -2m + zm + m. Let l(n) be the third derivative of n4/2 + 3n*2 - 13n. Give p(l(x)). 24x Let j(r) = 83782r - 83782r - r2. Let k be 8/28 - (-24)/14. Let u(i) = -4i2 - ik + i*2. Calculate j(u(w)). -16w*4 Let o(x) = -286x + 195. Let j(z) = 13z - 9. Let b(h) = -65j(h) - 3o(h). Let t(i) = -17i*2. Give b(t(v)). -221v*2 Let z(c) = -c. Let l(o) = 2o - 12. Let w(d) = d + 2. Let i(t) = -l(t) - 6w(t). Give i(z(n)). 8n Let o(u) = -9032u + 9032u + 3u2. Let c(t) be the first derivative of 3t*3 - 1. Give o(c(l)). 243l*4 Let t(i) = -123i + 21. Let r(m) = -12m + 2. Let w(d) = 21r(d) - 2t(d). Let o(c) = -9c. Calculate w(o(k)). 54k Let l(u) = -10u*2 + 5u. Let n(v) = 5v2 - 2v. Let a(z) = 6l(z) + 15n(z). Let p(t) = 7t. Determine a(p(c)). 735c2 Let z(f) be the first derivative of f2 + 58. Let p = 47 - 26. Let t(g) = -pg + 7 - 7. What is z(t(c))? -42c Let k(d) = -d. Let m(h) = 75588h2. Determine m(k(p)). 75588p*2 Let g(h) = -3h*2. Let y(u) = -6912u*2. What is g(y(c))? -143327232c*4 Let t(y) = 57y*2. Let q(s) = 22s*2. Let x(k) = 8q(k) - 3t(k). Let w(r) = -106r*2. Give w(x(u)). -2650u*4 Let k(d) be the first derivative of -9d*2 - 2895. Let l(x) = 6x*2 + 4x + 4. Let q(j) = -7j2 - 5j - 5. Let a(b) = -5l(b) - 4q(b). What is a(k(t))? -648t2 Let p(d) = -84d*2. Let x(k) = 28k - 6k - k2 - 22k. Give x(p(b)). -7056b4 Let p(c) be the first derivative of -3c*2/2 + 510. Let t(g) = -g - 4. Calculate p(t(f)). 3f + 12 Let s(y) = y. Let v(l) be the third derivative of -13l5/30 - 67l*2. Determine s(v(x)). -26x*2 Suppose 1 = -d + 2d. Let l(a) = a. Let m(h) = 17h. Let s(u) = dm(u) - 4l(u). Let y(c) be the first derivative of -c2/2 - 12. What is s(y(v))? -13v Let w(b) = -2b2. Let l(f) = 2f + 13f + 7f*2 - 15 + 0f2 - f2. Let y(k) = -k*2 - 2k + 2. Let g(m) = 4l(m) + 30y(m). What is w(g(c))? -72c4 Let x(v) = 23v*2 + 4v + 4. Let b(k) = -21k2 - 3k - 3. Let u(f) = 4b(f) + 3x(f). Let c(q) = q + 18. What is c(u(d))? -15d2 + 18 Let p(x) be the second derivative of -x3/3 + 63x - 1. Let v(n) = -124n. What is p(v(a))? 248a Let a(w) = -31w. Let v(l) be the third derivative of l5/15 - 55l*2. What is v(a(p))? 3844p*2 Let r(h) be the first derivative of 47h*6/360 - 14h*3/3 - 19. Let p(g) be the third derivative of r(g). Let c(i) = -2i. What is c(p(t))? -94t2 Let q(s) = 7s. Let m(y) = -y*2 + 2y - 13837. Give q(m(g)). -7g2 + 14g - 96859 Let q(m) = -2m. Let i(b) = -7b. Let u(p) = -3p + 2. Let d(y) = y - 1. Let l(v) = 2d(v) + u(v). Let t(s) = 6i(s) - 51l(s). Calculate t(q(h)). -18h Let f = 174 - 153. Let z(j) = -7j - 6j + fj - 4j. Let g(a) be the second derivative of 7a*4/12 + a. What is z(g(n))? 28n*2 Let w = 165 - 165. Let h(f) be the first derivative of -2/3f*3 + wf + 0f2 - 5. Let d(p) = 2p*2. Give d(h(c)). 8c4 Let b(p) = p3 + 8p2 + 6p - 5. Let w be b(-7). Let i(s) = -310s + 310s - 2sw. Let v(f) = -3f + 2f + 2f. Calculate v(i(d)). -2d2 Let c(z) = 2z*2 + 4z - 4z. Let m(x) be the second derivative of -x3/6 - 2x - 35. What is m(c(t))? -2t2 Let n(t) = 810t*2 + 2. Let w(o) = -30o. Give n(w(d)). 729000d2 + 2 Let y(u) be the second derivative of -5u*4/12 + 7u + 2. Let p(w) = 13w. Calculate p(y(q)). -65q*2 Let u(q) = -2q. Let n(g) = -30g. Let w(r) = -r. Suppose 4 = v - 2. Let y(p) = vn(p) - 234w(p). Determine y(u(b)). -108b Let i(t) be the first derivative of -5t2/2 - 68. Let c(l) = l + 1. Let m(p) = -p - 3. Let g(u) = 3c(u) + m(u). Calculate g(i(y)). -10y Let w = 941/11004 - 2/917. Let o(h) be the second derivative of -wh*4 + 0 + 0h*3 + 0h*2 - h. Let i(g) = -9g. Determine i(o(q)). 9q2 Let i(f) be the third derivative of 0f*4 + 0f + 1/20f5 + 7f*2 + 0 + 0f*3. Let a(k) = -2k*2 + 3k*2 + 0k*2. Calculate a(i(w)). 9w*4 Let p(c) = -3c*2 + 19c*2 - 8c*2. Let v(n) = 4n - 5. Let s(j) = -12j + 16. Let h = 60 - 76. Let x(a) = hv(a) - 5s(a). What is p(x(m))? 128m*2 Let y(f) = -8f*2. Let p(x) = 13x - 4. Let r(w) = 30w - 9. Let b(s) = 9p(s) - 4r(s). What is y(b(z))? -72z*2 Let r(z) = -3z*2. Let n(o) = -80o - 179. Determine n(r(x)). 240x2 - 179 Let o(u) = 15u*2. Let w(i) = -83i + 3 - 3 + 159i - 84i. What is w(o(l))? -120l*2	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.