Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
7 Calculate the remainder when 362 is divided by 121. 120 Calculate the remainder when 502 is divided by 41. 10 Calculate the remainder when 335 is divided by 11. 5 Calculate the remainder when 189 is divided by 33. 24 What is the remainder when 73 is divided by 16? 9 Calculate the remainder when 309 is divided by 62. 61 Calculate the remainder when 372 is divided by 71. 17 What is the remainder when 62 is divided by 1? 0 What is the remainder when 1196 is divided by 239? 1 Calculate the remainder when 962 is divided by 479. 4 Calculate the remainder when 1117 is divided by 39. 25 What is the remainder when 556 is divided by 62? 60 Calculate the remainder when 106 is divided by 22. 18 Calculate the remainder when 2647 is divided by 437. 25 Calculate the remainder when 902 is divided by 14. 6 Calculate the remainder when 686 is divided by 23. 19 What is the remainder when 54 is divided by 23? 8 Calculate the remainder when 43 is divided by 16. 11 What is the remainder when 701 is divided by 11? 8 What is the remainder when 9601 is divided by 9? 7 What is the remainder when 943 is divided by 16? 15 Calculate the remainder when 21137 is divided by 5. 2 Calculate the remainder when 1278 is divided by 107. 101 Calculate the remainder when 5 is divided by 5. 0 What is the remainder when 33 is divided by 3? 0 What is the remainder when 166 is divided by 42? 40 What is the remainder when 5413 is divided by 95? 93 What is the remainder when 53 is divided by 40? 13 What is the remainder when 78 is divided by 8? 6 What is the remainder when 102 is divided by 18? 12 What is the remainder when 806 is divided by 58? 52 What is the remainder when 19029 is divided by 26? 23 What is the remainder when 241 is divided by 27? 25 What is the remainder when 923 is divided by 906? 17 What is the remainder when 719 is divided by 60? 59 What is the remainder when 1082 is divided by 84? 74 Calculate the remainder when 883 is divided by 143. 25 What is the remainder when 156 is divided by 35? 16 What is the remainder when 3103 is divided by 774? 7 Calculate the remainder when 183 is divided by 62. 59 What is the remainder when 811 is divided by 269? 4 What is the remainder when 174 is divided by 32? 14 What is the remainder when 974 is divided by 65? 64 What is the remainder when 643 is divided by 34? 31 Calculate the remainder when 129 is divided by 19. 15 What is the remainder when 814 is divided by 24? 22 Calculate the remainder when 502 is divided by 133. 103 What is the remainder when 136 is divided by 63? 10 Calculate the remainder when 794 is divided by 165. 134 What is the remainder when 901 is divided by 128? 5 Calculate the remainder when 405 is divided by 112. 69 Calculate the remainder when 2671 is divided by 869. 64 Calculate the remainder when 62 is divided by 14. 6 Calculate the remainder when 557 is divided by 16. 13 What is the remainder when 247 is divided by 87? 73 Calculate the remainder when 399 is divided by 60. 39 Calculate the remainder when 173 is divided by 16. 13 What is the remainder when 357 is divided by 37? 24 Calculate the remainder when 930 is divided by 464. 2 What is the remainder when 139 is divided by 25? 14 What is the remainder when 65 is divided by 22? 21 What is the remainder when 1367 is divided by 38? 37 What is the remainder when 2644 is divided by 48? 4 Calculate the remainder when 1662 is divided by 42. 24 What is the remainder when 221 is divided by 208? 13 What is the remainder when 1424 is divided by 31? 29 Calculate the remainder when 401 is divided by 67. 66 Calculate the remainder when 101 is divided by 49. 3 Calculate the remainder when 173 is divided by 29. 28 Calculate the remainder when 3951 is divided by 1973. 5 What is the remainder when 969 is divided by 5? 4 Calculate the remainder when 59 is divided by 17. 8 What is the remainder when 148 is divided by 141? 7 What is the remainder when 2053 is divided by 2035? 18 Calculate the remainder when 206 is divided by 59. 29 Calculate the remainder when 137 is divided by 7. 4 Calculate the remainder when 350 is divided by 116. 2 Calculate the remainder when 67 is divided by 46. 21 Calculate the remainder when 3821 is divided by 294. 293 What is the remainder when 872 is divided by 8? 0 What is the remainder when 34 is divided by 33? 1 What is the remainder when 79 is divided by 17? 11 Calculate the remainder when 223 is divided by 38. 33 Calculate the remainder when 413 is divided by 38. 33 What is the remainder when 959 is divided by 160? 159 What is the remainder when 883 is divided by 213? 31 Calculate the remainder when 2141 is divided by 119. 118 What is the remainder when 393 is divided by 136? 121 What is the remainder when 5248 is divided by 15? 13 Calculate the remainder when 198 is divided by 44. 22 Calculate the remainder when 473 is divided by 235. 3 What is the remainder when 130 is divided by 3? 1 Calculate the remainder when 1464 is divided by 35. 29 What is the remainder when 24 is divided by 2? 0 What is the remainder when 36 is divided by 11? 3 What is the remainder when 39 is divided by 5? 4 Calculate the remainder when 21 is divided by 18. 3 Calculate the remainder when 2721 is divided by 25. 21 Calculate the remainder when 173 is divided by 157. 16 What is the remainder when 859 is divided by 24? 19 Calculate the remainder when 115 is divided by 59. 56 Calculate the remainder when 158 is divided by 54. 50 What is the remainder when 145 is divided by 49? 47 Calculate the remainder when 31 is divided by 3. 1 What is the remainder when 129 is divided by 46? 37 Calculate the remainder when 137 is divided by 68. 1 Calculate the remainder when 108 is divided by 57. 51 Calculate the remainder when 77 is divided by 9. 5 What is the remainder when 406 is divided by 210? 196 What is the remainder when 224 is divided by 58? 50 What is the remainder when 2293 is divided by 5? 3 What is the remainder when 527 is divided by 33? 32 Calculate the remainder when 272 is divided by 46. 42 What is the remainder when 1010 is divided by 92? 90 Calculate the remainder when 594 is divided by 292. 10 What is the remainder when 179 is divided by 26? 23 Calculate the remainder when 2799 is divided by 255. 249 What is the remainder when 89 is divided by 9? 8 Calculate the remainder when 194 is divided by 49. 47 Calculate the remainder when 776 is divided by 250. 26 What is the remainder when 253 is divided by 245? 8 Calculate the remainder when 200 is divided by 68. 64 Calculate the remainder when 53 is divided by 8. 5 Calculate the remainder when 4291 is divided by 159. 157 What is the remainder when 115 is divided by 66? 49 Calculate the remainder when 2961 is divided by 76. 73 Calculate the remainder when 275 is divided by 84. 23 What is the remainder when 333 is divided by 16? 13 What is the remainder when 123 is divided by 52? 19 Calculate the remainder when 3262 is divided by 250. 12 Calculate the remainder when 549 is divided by 11. 10 Calculate the remainder when 303 is divided by 20. 3 Calculate the remainder when 955 is divided by 60. 55 What is the remainder when 182 is divided by 61? 60 What is the remainder when 8458 is divided by 15? 13 Calculate the remainder when 1955 is divided by 49. 44 What is the remainder when 114 is divided by 29? 27 What is the remainder when 35 is divided by 26? 9 What is the remainder when 763 is divided by 11? 4 What is the remainder when 362 is divided by 14? 12 Calculate the remainder when 2140 is divided by 63. 61 Calculate the remainder when 2341 is divided by 69. 64 What is the remainder when 349 is divided by 47? 20 What is the remainder when 271 is divided by 189? 82 Calculate the remainder when 27 is divided by 5. 2 What is the remainder when 4264 is divided by 18? 16 Calculate the remainder when 281 is divided by 70. 1 Calculate the remainder when 7 is divided by 6. 1 Calculate the remainder when 2675 is divided by 20. 15 What is the remainder when 1203 is divided by 157? 104 Calculate the remainder when 231 is divided by 48. 39 What is the remainder when 1034 is divided by 4? 2 What is the remainder when 193 is divided by 102? 91 Calculate the remainder when 1699 is divided by 1695. 4 What is the remainder when 1874 i	{ "pile_set_name": "DM Mathematics" }
late the remainder when l(z) is divided by 11. 9 Suppose -4u + 6u - 40 = 0. Suppose -3j + 71 = -43. Calculate the remainder when j is divided by u. 18 Let b = 31 + -5. Let r(k) = k. Let c(m) = 4m - 2. Let f(o) = c(o) - 6r(o). What is the remainder when b is divided by f(-8)? 12 Suppose -c + 7 = -a + 22, c + 63 = 4a. Suppose -16n = -15n - 9. What is the remainder when a is divided by n? 7 Let q(s) = s + 1. Let h be q(4). Suppose -60 = hm - 8m. Calculate the remainder when 57 is divided by m. 17 Let z(m) = -m*3 - 12m*2 - m. Let f(q) = 4q + 5. Calculate the remainder when f(4) is divided by z(-12). 9 Suppose 0 = 5a - 4j - 10, 7a + 3j + 19 = 5a. Let r be 3/(-6) + (-21)/a. Let s = r - -4. Calculate the remainder when 26 is divided by s. 12 What is the remainder when (9/(-3) + 14)3 is divided by 17? 16 Let p(c) be the second derivative of c5/20 + c4/2 + 7c3/6 + 2c*2 - 2c. Let u = 4 + 11. Calculate the remainder when u is divided by p(-4). 7 Suppose -h = 43 - 62. Suppose 3i - 15 = -0i. Calculate the remainder when h is divided by i. 4 Let q = -2 + 9. What is the remainder when 18 is divided by q? 4 Suppose 6v + 0v - 990 = 0. Calculate the remainder when v is divided by 42. 39 Let j(l) = -l - 5. Let m be j(-8). Suppose -21 = -p - 2k, 0 = -4p - p - mk + 70. What is the remainder when 20 is divided by p? 9 Let f = -10 - -29. Calculate the remainder when f is divided by 8. 3 Let c be (-2)/7 + 4/14. Suppose 2y = 4y - 4. Suppose c = -yh - 5 + 19. What is the remainder when h is divided by 5? 2 Let g(q) = 21q + 2. Calculate the remainder when 91 is divided by g(1). 22 Let r(u) = -2u*2 + 26u + 5. Calculate the remainder when r(11) is divided by 17. 15 Let g = -11 + 15. Suppose 40 = 3y + g. What is the remainder when 33 is divided by y? 9 Suppose -3m + 2x = -2m - 4, -5m + 5x = -15. Let c(r) = -r*2 + 9r - 5. What is the remainder when c(6) is divided by 14/(-4)(-4)/m? 6 Suppose 4p + p = 0. Suppose p = -5r + 2 + 23. What is the remainder when (-126)/(-9)(0 + 1) is divided by r? 4 Let j(y) = y*3 - y. Let k(h) = -2h3 + h2 + h - 4. Let w(r) = 3j(r) + k(r). Calculate the remainder when w(3) is divided by 0 + 1 + 1 - -12. 12 Let j = 17 - 9. Suppose -u - 2 + 0 = 0. Calculate the remainder when 11 is divided by (j1-1)/u. 3 Let m = -45 + 48. What is the remainder when (2/6)/((-3)/(-63)) is divided by m? 1 Suppose -8g + 7g = -19. Calculate the remainder when g is divided by 1/1 + (-4 - -8). 4 Let c be (-12)/(-4)(-4)/(-3). Suppose 0 = -5m + cm. Suppose 53 = 4y - y + d, y - d - 15 = m. Calculate the remainder when y is divided by 5. 2 Let u be (-15)/20(0 + -4). Calculate the remainder when ((-36)/u)/((-2)/3) is divided by 5. 3 Suppose 2k = -0 + 4. Suppose 4j - ky - 18 = 0, 0 = -2j - 5y + 35 + 4. Calculate the remainder when 2/(-7) - (-184)/j is divided by 14. 12 Let n(o) = o2 - 5o. Let u(t) = 2t - 13. What is the remainder when u(11) is divided by n(6)? 3 Let j(f) = -f. Let h(k) = 3k + 26. Let l(t) = h(t) + 4j(t). Let v(p) = -p2 - p + 9. What is the remainder when l(0) is divided by v(0)? 8 Let y(n) = n2 - 17n + 23. What is the remainder when y(18) is divided by 7? 6 Let f = 147 + -28. What is the remainder when f is divided by 41? 37 Let p(s) = -2s - 8. What is the remainder when (-5 - -2)(-69)/9 is divided by p(-8)? 7 Let f(v) = v*2 - 7v + 6. Let y be f(5). What is the remainder when 10 is divided by 1/y - 68/(-16)? 2 Let x be -1 + 1 + 0 - 1. Let i be -28((-40)/28)/5. What is the remainder when 22 is divided by i + (-2)/x - -2? 10 Let h(q) = q2 + q - 2. Let v be h(0). Let y be 1/((-3)/24v). Let u = y - -15. Calculate the remainder when 37 is divided by u. 18 Let j(m) = 5m2 + m. Let n be j(-1). Suppose 2u - 2b = 12, 5u - 31 = nb - 5. Calculate the remainder when 3 is divided by u. 1 Let h = 4 + -1. Suppose i - 2d = -hi + 8, -5d = -i - 16. Suppose -io + 3 = 5v, -1 = -5o + 2o - 5v. What is the remainder when 3 is divided by o? 1 Let h(t) = -12t + 4. Let j be (-5)/10 + (-5)/2. Calculate the remainder when h(j) is divided by 14. 12 Let l(z) = -z*2 - 4z + 7. Let w be l(-5). What is the remainder when w(1 - (-87)/6) is divided by 11? 9 Suppose 5o - 12 = -2t, 5o - 5 = 5t - 0t. Let h(p) = p*3 + 7p*2 + 6p + 5. Let d be h(-6). Let g = d + -2. What is the remainder when g is divided by o? 1 Let v(j) = -j*2 + 27. Let u be (-2 + 2)/(0 - -1). Let a be v(u). Suppose 0 = -4b + 13 + a. What is the remainder when 29 is divided by b? 9 Let f be ((-1)/1)/(2 - 1). What is the remainder when 54 is divided by (20 + f)(-4)/(-4)? 16 Let v be (-3)/6-2 + 0. Suppose -o + 1 = -v. Suppose 2s = s + o. Calculate the remainder when 2 is divided by s. 0 Suppose 2n = 10 - 68. Let w = -21 - n. What is the remainder when ((-1 - -23) + 1)1 is divided by w? 7 Let i = 85 - 34. Calculate the remainder when i is divided by 6. 3 Suppose -2w + 4 + 4 = 0. Let b be 4 + (-2 + w - 4). Suppose -4k = 2r - 16, br - 5r + 14 = 4k. What is the remainder when 9 is divided by k? 4 Let f = 54 - 28. Let h be -2(-1)/(-4)6. Let c(i) = -2i*3 - 5i*2 - 2i - 1. Calculate the remainder when f is divided by c(h). 12 Let c(u) = -2u + 12. Let z be c(10). Let q = -5 - z. Calculate the remainder when 13 is divided by (1 + -15)q/(-6). 6 Calculate the remainder when 49 is divided by 2/9 - (183/(-27) - 6). 10 Let v(m) = m*2 + 3m + 3. Let l be v(-3). Suppose lg = 63 + 18. Calculate the remainder when g is divided by (-1 - (-3 + 3))-7. 6 Let j = 17 + -2. Suppose -2u = -68 + 12. What is the remainder when u is divided by j? 13 Suppose -3u + 8u = 115. What is the remainder when u - (-1 + 1)/3 is divided by 12? 11 Suppose -5i + 3o + 7 + 72 = 0, o = -i + 19. Calculate the remainder when 32 is divided by i. 15 Suppose 2g - 78 = -5p, -2g - 2g = 4p - 60. Let h(d) = 10d - 1. Calculate the remainder when p is divided by h(1). 7 Suppose 2r - 5c = 182, -2r + 101 = -r - 5c. Suppose 5n - 4t = -1, 0 = -4n + 5t - 2t. Calculate the remainder when (r/1)/n + 2 is divided by 10. 9 Let n = 66 - 113. Let c(y) = -18y + 2. Let p be c(6). Let o = n - p. Calculate the remainder when o is divided by 20. 19 Suppose 2j - 48 = 4o, -o = 4j - 2o - 82. Calculate the remainder when j is divided by 12. 8 Calculate the remainder when 29 is divided by -4((-5)/2 + 0). 9 Let a(y) = 2y2 - 2 + 5 + 2y - 4. Calculate the remainder when (-21 - -1)-31 is divided by a(2). 9 Let x = -33 - -41. Suppose b - 63 = -2b. Calculate the remainder when b is divided by x. 5 Suppose 3n = l - 98, 5n - 430 = l - 6l. Suppose -2f - 61 = -4f + z, 2z + l = 3f. What is the remainder when f is divided by 12? 9 Let h(m) = 2m2 + 4m - 6. Suppose -42 = -3x + 3d, 6 + 5 = x + 2d. What is the remainder when h(-7) is divided by x? 12 Let d(h) = 4h*2 - 5h*2 + 0h3 + h3 - 1. Calculate the remainder when (-8)/(-92) - (-912)/92 is divided by d(2). 1 Suppose 0 = h + 3h + 16. Let c = h - -7. Let d = 2 - -6. What is the remainder when d is divided by c? 2 Suppose -4d - 3i = -14, -4d = -2i - 3i - 30. Suppose 0 = -5a + 4r + 98, dr = r - 8. What is the remainder when 35 is divided by a? 17 Let i(q) be the second derivative of 0q*3 + 0 - 2q + 7/6q4 - 1/2q*2. What is the remainder when i(1) is divided by 7? 6 Let o(q) = q + 9. Let j be o(-4). Suppose 4g = ji + 131, 3g + 3i + 58 = 190. Let y = -7 + 27. Calculate the remainder when g is divided by y. 19 Let y = 160 - 111. Suppose 3s = y + 17. What is the remainder when 64 is divided by s? 20 Suppose -3z + 1285 = 2z. Suppose 0 = -4w - 41 + z. What is the remainder when w is divided by 11? 10 Let t be 352/(-3)-3. Suppose -z + 30 = 4v, 4z - 11 = -3v + t. Suppose -2w = -s + 15, -w + 3w = 2s - 22. What is the remainder when z is divided by s? 4 Let z = 48 + -7. What is the remainder when z is divided by 11 + -3 + (-2 - -8)? 13 Suppose 0 = 3q - 5w - 95, -3q + 94 = -3w - w. Let a = 190 + -101. Calculate the remainder when a is divided by q. 29 Let g = 12 + 20. Calculate the remainder when 36 is divided by 2(-52)/g-4. 10 Suppose 4h - 6k + k - 27 = 0, 4k = 3*h - 19. Let j = h - 8. What is the remainder when 19 is divided by j? 4 Calculate th	{ "pile_set_name": "DM Mathematics" }
3 What is 416 minutes after 2:26 AM? 9:22 AM How many minutes are there between 4:34 AM and 9:29 AM? 295 What is 92 minutes before 9:38 PM? 8:06 PM How many minutes are there between 4:54 PM and 2:49 AM? 595 How many minutes are there between 7:53 PM and 4:17 AM? 504 How many minutes are there between 12:39 AM and 12:29 PM? 710 What is 644 minutes before 6:39 PM? 7:55 AM What is 132 minutes before 2:14 AM? 12:02 AM What is 98 minutes after 7:46 PM? 9:24 PM What is 408 minutes before 8:10 AM? 1:22 AM What is 103 minutes after 12:53 PM? 2:36 PM How many minutes are there between 10:06 AM and 12:42 PM? 156 How many minutes are there between 4:25 PM and 7:54 PM? 209 How many minutes are there between 9:20 AM and 11:45 AM? 145 How many minutes are there between 10:53 AM and 10:14 PM? 681 How many minutes are there between 3:23 AM and 8:18 AM? 295 How many minutes are there between 5:48 AM and 12:32 PM? 404 How many minutes are there between 11:55 PM and 2:19 AM? 144 How many minutes are there between 12:00 PM and 1:11 PM? 71 What is 77 minutes before 12:18 AM? 11:01 PM What is 51 minutes after 9:08 AM? 9:59 AM What is 359 minutes after 3:48 AM? 9:47 AM How many minutes are there between 5:53 AM and 2:01 PM? 488 What is 101 minutes before 2:59 PM? 1:18 PM How many minutes are there between 5:49 PM and 3:38 AM? 589 What is 387 minutes after 1:31 PM? 7:58 PM How many minutes are there between 6:37 PM and 4:44 AM? 607 How many minutes are there between 10:42 AM and 2:40 PM? 238 How many minutes are there between 5:18 AM and 3:28 PM? 610 What is 591 minutes after 11:10 AM? 9:01 PM What is 194 minutes before 8:51 AM? 5:37 AM How many minutes are there between 5:18 PM and 11:32 PM? 374 How many minutes are there between 7:30 PM and 11:25 PM? 235 How many minutes are there between 9:00 AM and 2:21 PM? 321 How many minutes are there between 7:09 AM and 12:26 PM? 317 How many minutes are there between 10:52 AM and 9:49 PM? 657 What is 616 minutes after 3:58 PM? 2:14 AM How many minutes are there between 11:40 AM and 8:53 PM? 553 What is 96 minutes after 8:22 AM? 9:58 AM What is 91 minutes after 12:10 AM? 1:41 AM How many minutes are there between 8:12 PM and 12:22 AM? 250 How many minutes are there between 5:47 PM and 7:28 PM? 101 What is 366 minutes after 5:43 AM? 11:49 AM What is 293 minutes after 5:17 AM? 10:10 AM How many minutes are there between 6:57 AM and 12:01 PM? 304 What is 714 minutes after 6:12 PM? 6:06 AM What is 60 minutes after 3:28 PM? 4:28 PM What is 324 minutes after 6:20 AM? 11:44 AM How many minutes are there between 7:35 PM and 9:17 PM? 102 What is 391 minutes before 10:23 AM? 3:52 AM How many minutes are there between 10:58 AM and 5:57 PM? 419 How many minutes are there between 10:57 AM and 2:11 PM? 194 What is 25 minutes after 10:01 PM? 10:26 PM How many minutes are there between 3:10 PM and 10:22 PM? 432 How many minutes are there between 1:27 PM and 12:43 AM? 676 How many minutes are there between 2:31 PM and 7:35 PM? 304 How many minutes are there between 3:36 PM and 5:23 PM? 107 How many minutes are there between 1:57 AM and 12:28 PM? 631 How many minutes are there between 11:53 PM and 7:02 AM? 429 How many minutes are there between 2:37 AM and 8:04 AM? 327 What is 424 minutes after 12:04 AM? 7:08 AM What is 337 minutes before 3:22 AM? 9:45 PM How many minutes are there between 4:32 AM and 2:13 PM? 581 What is 274 minutes after 2:17 PM? 6:51 PM What is 53 minutes after 4:18 AM? 5:11 AM How many minutes are there between 5:21 AM and 11:48 AM? 387 What is 687 minutes after 8:57 PM? 8:24 AM What is 341 minutes before 6:42 AM? 1:01 AM How many minutes are there between 9:21 AM and 3:15 PM? 354 What is 676 minutes before 7:11 AM? 7:55 PM How many minutes are there between 8:27 AM and 7:27 PM? 660 How many minutes are there between 11:50 PM and 6:28 AM? 398 How many minutes are there between 9:06 PM and 6:23 AM? 557 How many minutes are there between 5:40 AM and 6:29 AM? 49 What is 473 minutes before 4:29 AM? 8:36 PM What is 473 minutes before 5:35 PM? 9:42 AM How many minutes are there between 11:22 AM and 1:30 PM? 128 How many minutes are there between 5:37 AM and 1:49 PM? 492 How many minutes are there between 8:06 PM and 4:50 AM? 524 How many minutes are there between 8:49 PM and 3:53 AM? 424 What is 525 minutes after 8:27 PM? 5:12 AM How many minutes are there between 8:58 AM and 5:44 PM? 526 How many minutes are there between 10:56 AM and 12:53 PM? 117 What is 547 minutes after 10:56 PM? 8:03 AM What is 217 minutes before 12:35 AM? 8:58 PM What is 592 minutes before 11:49 AM? 1:57 AM What is 705 minutes after 3:28 PM? 3:13 AM How many minutes are there between 8:11 AM and 9:07 AM? 56 How many minutes are there between 5:37 PM and 10:37 PM? 300 What is 317 minutes before 10:07 AM? 4:50 AM How many minutes are there between 2:04 AM and 6:17 AM? 253 How many minutes are there between 8:01 AM and 4:09 PM? 488 How many minutes are there between 2:27 PM and 12:12 AM? 585 What is 490 minutes after 6:43 PM? 2:53 AM How many minutes are there between 1:46 PM and 11:42 PM? 596 How many minutes are there between 11:40 PM and 1:11 AM? 91 How many minutes are there between 1:53 AM and 6:51 AM? 298 What is 634 minutes before 9:50 PM? 11:16 AM How many minutes are there between 4:46 AM and 5:53 AM? 67 How many minutes are there between 7:37 PM and 4:02 AM? 505 How many minutes are there between 1:05 PM and 6:07 PM? 302 How many minutes are there between 11:51 PM and 11:30 AM? 699 What is 283 minutes before 7:52 AM? 3:09 AM How many minutes are there between 5:31 PM and 6:33 PM? 62 How many minutes are there between 5:17 AM and 3:04 PM? 587 What is 144 minutes after 3:43 PM? 6:07 PM How many minutes are there between 8:34 AM and 2:40 PM? 366 How many minutes are there between 6:38 AM and 11:47 AM? 309 How many minutes are there between 10:29 PM and 10:18 AM? 709 What is 587 minutes after 9:37 AM? 7:24 PM What is 11 minutes before 1:36 AM? 1:25 AM How many minutes are there between 3:05 PM and 2:51 AM? 706 How many minutes are there between 8:16 PM and 2:01 AM? 345 How many minutes are there between 7:25 PM and 4:41 AM? 556 What is 493 minutes after 3:55 PM? 12:08 AM What is 359 minutes after 10:57 AM? 4:56 PM What is 586 minutes after 8:09 PM? 5:55 AM How many minutes are there between 3:25 AM and 11:25 AM? 480 How many minutes are there between 11:00 PM and 12:09 AM? 69 How many minutes are there between 2:06 PM and 2:50 PM? 44 What is 697 minutes before 4:43 PM? 5:06 AM How many minutes are there between 6:32 PM and 10:41 PM? 249 What is 56 minutes before 10:07 AM? 9:11 AM How many minutes are there between 10:06 PM and 4:20 AM? 374 What is 402 minutes after 9:49 PM? 4:31 AM How many minutes are there between 4:36 PM and 7:31 PM? 175 How many minutes are there between 8:55 PM and 3:53 AM? 418 What is 625 minutes before 3:48 PM? 5:23 AM What is 618 minutes before 8:08 AM? 9:50 PM What is 444 minutes after 10:37 AM? 6:01 PM What is 667 minutes before 6:29 PM? 7:22 AM How many minutes are there between 12:51 PM and 10:33 PM? 582 What is 111 minutes before 12:12 PM? 10:21 AM How many minutes are there between 12:14 PM and 7:12 PM? 418 How many minutes are there between 3:56 AM and 2:14 PM? 618 What is 664 minutes before 9:54 PM? 10:50 AM How many minutes are there between 10:06 AM and 8:03 PM? 597 How many minutes are there between 12:04 AM and 12:58 AM? 54 How many minutes are there between 10:49 AM and 1:54 PM? 185 How many minutes are there between 2:21 PM and 4:03 PM? 102 What is 508 minutes before 5:28 PM? 9:00 AM What is 675 minutes before 4:57 PM? 5:42 AM What is 126 minutes after 2:13 AM? 4:19 AM How many minutes are there between 12:49 AM and 10:40 AM? 591 What is 507 minutes before 12:08 PM? 3:41 AM How many minutes are there between 12:55 AM and 5:51 AM? 296 What is 137 minutes before 5:55 PM? 3:38 PM How many minutes are there between 9:05 PM and 6:08 AM? 543 How many minutes are there between 3:39 AM and 8:59 AM? 320 How many minutes are there between 3:43 AM and 9:37 AM? 354 How many minutes are there between 12:35 PM and 4:30 PM? 235 What is 91 minutes before 6:22 PM? 4:51 PM How many minutes are there between 12:09 PM and 12:53	{ "pile_set_name": "DM Mathematics" }
56. Round y to one decimal place. -0.8 Suppose -265v - 4012896 = -909481. Round v to the nearest one thousand. -12000 Let g = 0.1257 - -654.8743. Let j = g + -380. Let d = j - 275.189. Round d to 1 dp. -0.2 Let l = -3492.4702 + 3493. Round l to 2 decimal places. 0.53 Let t = -1556.2 - -1353.94. What is t rounded to the nearest ten? -200 Suppose -88 = 4x - 2x. Let o be x/(-3) - (-1)/3. Suppose -5k + 1 = -n + o, -3n = -2k - 3. Round k to the nearest 10. 0 Let n = -170.7 + 170.69897575. What is n rounded to four dps? -0.001 Let n = -74142899101.5 - -74134965139.49379. Let u = n + 7933328. Let z = -634 - u. Round z to three decimal places. 0.006 Let y = -57.618488 + 1.617978. Let n = 623 - 567. Let o = y + n. What is o rounded to four dps? -0.0005 Let d = 64.825 + -0.625. Let f = 103 - d. What is f rounded to zero dps? 39 Let y = -9612325 + 15053602. Let m = y - 3651277. Round m to the nearest one million. 2000000 Let a = -1259.605 - -19.805. What is a rounded to the nearest one thousand? -1000 Let v be ((-1012)/12)/(5/15). Let l(k) = -9k3 - 3k*2 + 13k + 12. Let g be l(-4). Let q = g + v. Round q to the nearest 100. 200 Let o(j) = -276539843j - 157. Let q be o(1). What is q rounded to the nearest 1000000? -277000000 Let v(f) be the third derivative of f6/120 + 13f5/60 + f4/12 + 5f3/3 + 26f*2 - 2. Let p be v(-17). What is p rounded to the nearest one hundred? -1200 Let a be 2/(-1 + 5)14. Let y be ((-3)/(-36)8931)/(5/260). Let b be y/91 - 2/a. What is b rounded to the nearest one hundred? 400 Let h = -5.062 - 0.238. Let v = h - 17. Round v to the nearest integer. -22 Let r = 227.82 - 229. Let a = r + 1.1905. Round a to 3 decimal places. 0.011 Suppose -543788 = 4z + 56224. Let x be 1/4((-9 - 6) + 3). Let t be (6 - x)/3 - z/(-1). Round t to the nearest 100000. -200000 Let i = 38289 - 38288.9992617. What is i rounded to 4 dps? 0.0007 Let u = -114 - -110. Let s(q) = q2 + 2q - 8. Let h be s(u). Suppose -l - 7l - 2008000 = h. What is l rounded to the nearest 10000? -250000 Let j = 201474.500085 + -201475. Let c = 0.16 + -0.66. Let n = c - j. What is n rounded to 5 dps? -0.00009 Let d(f) = -2062093f - 2572682f + 21 - 685218f. Let l be d(-3). Round l to the nearest 1000000. 16000000 Let i = -1.4782 - -3.523. Let k = 4.35 - 6.44. Let r = i + k. What is r rounded to 3 dps? -0.045 Let p = 0.83 + -4.83. Let c = -45 - p. Let u = c - -40.575. What is u rounded to two dps? -0.43 Suppose t + 70961 = -60029. What is t rounded to the nearest one thousand? -131000 Let y = 9654835 + -3444298. Let f = y + -4030537. Round f to the nearest one million. 2000000 Suppose -127m + 1454136 = -409081. What is m rounded to the nearest 1000? 15000 Let v = -4246.5 + 4029.31. Let r = v + 215. Round r to 0 decimal places. -2 Let l = -40143.99997647 - -40144. What is l rounded to 6 dps? 0.000024 Let n = 41096 - 41096.85142. What is n rounded to two dps? -0.85 Suppose 187 = 3v - 80. Let b = v + -84. Suppose bo - 14180 = 4i + o, 5o = -5i - 17675. Round i to the nearest 100. -3500 Let s = -0.1682 - -0.1752252. What is s rounded to three decimal places? 0.007 Let j = -7625.843688041 + 7951.92804116. Let g = j + 38.915645211. Let b = -365 + g. What is b rounded to 7 dps? -0.0000017 Let b = -759387 + 2831887. What is b rounded to the nearest one hundred thousand? 2100000 Let r = 1609 + -1644. Let d = -33.858 - 0.342. Let j = r - d. Round j to one decimal place. -0.8 Suppose -8j + 13j - 3285405 = -2l, -4l + 2j = -6570798. What is l rounded to the nearest one hundred thousand? 1600000 Let y = -0.279 - 34.721. Let s = y - -34.97519. What is s rounded to 3 decimal places? -0.025 Let w(p) = -304p*3 + 5p*2 + 14p + 14. Let s be w(-3). Round s to the nearest ten thousand. 10000 Let p = -203.911848254 + -1.088219346. Let x = -205 - p. Round x to 6 dps. 0.000068 Let n(u) = 5u2 - 2u - 8. Let p be n(2). Let m(z) = 182z2 + 6z - 96. Let q be m(p). Round q to the nearest ten thousand. 10000 Let o = 287.14 + -283. Let s = o + -4.13817. What is s rounded to 3 decimal places? 0.002 Let u(j) = -2j - 16. Let y be u(0). Let p = 17 + y. Let g be 192(p - 7012/12). What is g rounded to the nearest 10000? -110000 Let h(v) = -8 - 38784v + 43 - 3. Let o be h(23). What is o rounded to the nearest 100000? -900000 Let j = -234.21 + 155.951. Round j to one decimal place. -78.3 Let f = 270.059 + -270. Let h = f - 0.709. What is h rounded to 1 decimal place? -0.7 Let y = 0.17 + -0.088. Let o = -1217.28200111 - -1217.2. Let x = y + o. Round x to 7 decimal places. -0.0000011 Let w = -197947 - -197948.75014. Let b = w - 1.75. Round b to 3 decimal places. 0 Let r = 0.096 + 0.214. Let w = r + -0.30999135. What is w rounded to 6 decimal places? 0.000009 Let h = 7902 - 7901.999995851. Round h to 7 decimal places. 0.0000041 Let n = 0.797 - -0.7526. Let z = 1.53 - n. Round z to 3 dps. -0.02 Let k = 7 + -7. Suppose j - 3j + 8059 = q, -2q - 5j + 16115 = k. Suppose q = -5l + 2508065. Round l to the nearest one million. 1000000 Let c = 0.288 - 1.044. Let a = -0.755999394 - c. Round a to 7 dps. 0.0000006 Let r = -269370 + 269302.0189. Let f = 37 - 105. Let d = r - f. Round d to three decimal places. 0.019 Let a = 87 + -87.97. Let k = a + -0.39. What is k rounded to 1 dp? -1.4 Suppose -5v - 4518947 = -r + 4915558, -3773785 = 2v + 3r. Round v to the nearest one hundred thousand. -1900000 Let q(t) = -244t2 - 14t + 29. Let m be q(2). What is m rounded to the nearest one hundred? -1000 Let s = -199003 - 8139167. Let t = -8338165.9000076 - s. Let o = t - 4.1. What is o rounded to 6 decimal places? -0.000008 Suppose -2r + 447999 = -k, -662559 - 9438 = -3r + 3k. Let m be (18/4)/((-6)/r). Round m to the nearest 10000. -170000 Let b be (18809 - 0)3660/(-14). Let h = b - -2577210. What is h rounded to the nearest 100000? -2300000 Let i(f) = 306f3 + f2 - 7. Suppose -d - 2d + 190 = b, d = b + 66. Let v = -57 + d. Let w be i(v). Round w to the nearest 10000. 110000 Let g = 0.10387537 - 0.1038. What is g rounded to six decimal places? 0.000075 Let b = -0.0199300798399 + 10913370.0200380798399. Let r = -10913295 + b. Let t = 75 - r. What is t rounded to 5 decimal places? -0.00011 Let u(p) = 451p + 22. Let n be u(1). Let z = 709 - n. What is z rounded to the nearest 10? 240 Suppose -133a + 33997494 - 65751320 - 315881574 = 0. Round a to the nearest ten thousand. -2610000 Let j = 44922045 - 44922029.2998382. Let w = -15.7 + j. Round w to five decimal places. 0.00016 Let b = 19414 + -19413.9999992207. Round b to seven decimal places. 0.0000008 Let w(y) = 43549y + 2270. Let a be w(-10). What is a rounded to the nearest one thousand? -433000 Suppose -4j + 4g - 40 = 0, 4g = -j + 6j + 46. Let m(u) = -96506u - 36. Let f be m(j). What is f rounded to the nearest one hundred thousand? 600000 Let h = -8.024 + 8.02437639. Round h to 5 decimal places. 0.00038 Let f be (4 - (-10)/(-5)) + 33. Suppose -fk = -26k - 1107. What is k rounded to the nearest ten? 120 Let k(u) = 51u2 - 7 + 14 + 6u + 2. Let v be k(9). Suppose -5q = -41094 + v. What is q rounded to the nearest one hundred? 7400 Let w = -53.46 + 53.4600053417. Round w to seven dps. 0.0000053 Let p = -0.0826 + 1039.0826. Let z = 2852.1 + -1866.4. Let s = p - z. What is s rounded to the nearest 10? 50 Suppose z = 2t + 1028259, z - 3t - 2056520 = -z. Let p = 591263 - z. What is p rounded to the nearest ten thousand? -440000 Let v = 2681.8 + -14742.6. Round v to the nearest one thousand. -12000 Let k = -21470.00101123 + 21470. What is k rounded to 4 dps? -0.001 Let j = 71.02 - 397.42. Round j to the nearest 100. -300 Let k(m) = -2m*3 + 3m*2 + 14m - 4. Let v be (28/21)/((-2)/(-9)). Let w be k(v). Round w to the nearest one hundred. -200 Let j = 618.5 + -758. Round j to the nearest ten. -140 Let d = 181924079.744 - 179934559. Let z = d + -1989546.74400062. Let x = -26 - z. Round x to seven decimal places. 0.0000006 Let t = 90578 - 90581.9001. Let g = 3.9 + t. Round g to five dps. -0.0001 Let j = 58.5 - 60. Let z = j - 9.5. Let w = -7.52 - z. Round w to 1 dp. 3.5 Let h = -349.71 + 349.71000128696. What is h rounded to seven decimal places? 0.0000013 Let a = -1676868 + 1677088.0762. Let v = -220 + a. Round v t	{ "pile_set_name": "DM Mathematics" }
+ 13h wrt c? 650040c*3h*3 + 240c*3h What is the second derivative of -21c3r*2 - 21c*2r*3 - 7cr3 + r3 wrt c? -126cr2 - 42r*3 Find the third derivative of 114iq3s*3v*2 - 4iq3s*3 - 3iq2s*2v*2 + 4iqsv - iqs - 33q*2s*3 - 3s*3 wrt q. 684is3v*2 - 24is3 Find the first derivative of 2633cx2 + 6341x*2 wrt c. 2633x*2 Find the third derivative of -707w*4 + 70w*2 + 10. -16968w Find the third derivative of -s4 - s3 - 7s2 + 5s. -24s - 6 Find the second derivative of 15d3 + d2p3 + 10dp2 + 3dp + p3 wrt d. 90d + 2p3 Find the third derivative of 678z*3 + 872z*2. 4068 What is the first derivative of 5m*2w + 28mw + 2m - 1535w wrt m? 10mw + 28w + 2 Find the second derivative of a2i*3r + a*2i*2r*2 - 4a*2i*2r - 7a2r + 4a2 - ai*2 + 12855i*3r*2 wrt r. 2a*2i*2 + 25710i*3 What is the third derivative of -37g*3y*2 + 30g*2y2 + g2 + 2gy*2 wrt g? -222y*2 What is the third derivative of or*4 - 101or3 + 4o - 5r4 - 56r*2 - r wrt r? 24or - 606o - 120r What is the third derivative of 2h*4 - 185h3 - h2 + 1690 wrt h? 48h - 1110 What is the derivative of -15c*4 + 39c*2 - 3047 wrt c? -60c*3 + 78c What is the derivative of r*3wz3 + r3wz2 - 14r*3z3 - r3z2 - 7rw + 2 wrt w? r3z3 + r3z2 - 7r What is the first derivative of pz3 - 4609p + 1753z3 + z wrt z? 3pz2 + 5259z*2 + 1 Find the third derivative of 404a*6 + 590a*2 - a wrt a. 48480a*3 Find the third derivative of -3c*2h*4 + 120c*2h + 5ch*4 + 2ch2 - 26h*3 wrt h. -72c*2h + 120ch - 156 What is the third derivative of -4y6 - 285y*4 + 1461y*2 wrt y? -480y*3 - 6840y Find the second derivative of -11jp - 4jt*2 - jt + 40pt*5 + pt*4 - 4t wrt t. -8j + 800pt3 + 12pt2 What is the first derivative of -6h*2 + 82h - 1868? -12h + 82 What is the second derivative of 2a*2b*2y + a*2bc + 2a*2by + acy - 2ay + 46b*2cy - 6b*2c + 3bc wrt b? 4a2y + 92cy - 12c What is the third derivative of -t5 + 405t*4 + 934t*2? -60t*2 + 9720t What is the third derivative of -6m2n*4 - 2m*2n2 + m2 - 2mn*4 - 41m + 2n4 wrt n? -144m*2n - 48mn + 48n What is the third derivative of -18g*5 + 5g*4 + 23g*3 - 112g*2 + 7g? -1080g2 + 120g + 138 What is the second derivative of -4a3k - 611a3 - 2ak - 1754k wrt a? -24ak - 3666a What is the second derivative of -3259q*3 + 2q*2 - 3q - 397 wrt q? -19554q + 4 What is the third derivative of 8t*5y - 15t4y*2 + 39t*2 - ty*2 wrt t? 480t*2y - 360ty*2 What is the third derivative of -73d*6 + 2d*3 + 375d*2 wrt d? -8760d*3 + 12 Find the second derivative of 222d*4 - 5d + 20. 2664d2 What is the third derivative of -12ab3v*2 + 3ab3v - 15ab*2v*3 - av*2 - 2b*3v3 + b3v2 - b2v*3 wrt v? -90ab2 - 12b*3 - 6b*2 What is the second derivative of 13882n*2 + 984n - 6 wrt n? 27764 Find the second derivative of -83g2t*2 - 10gt2 + 7g wrt g. -166t2 What is the derivative of 487k + 2072 wrt k? 487 Find the second derivative of -5l3o*3 + 116l*3o - 3l2o + 2lo3 - o3 wrt o. -30l3o + 12lo - 6o What is the second derivative of -3p*2x*3 - 314p*2x*2 - px*3 + 26px2 - x3 wrt p? -6x*3 - 628x*2 Differentiate -sw + 146s - 14w - 6 wrt s. -w + 146 Find the second derivative of -429a3k*2 + 23a*3k - 7a2k wrt k. -858a3 What is the second derivative of 29y5 - y3 - 8y - 4? 580y*3 - 6y Find the third derivative of -8c3p*3 + 56c*3p*2 - 2c*3 - 98c*2p*3 - 2c*2p*2 + 2c*2p + 4p wrt c. -48p*3 + 336p*2 - 12 What is the second derivative of -20331r*4 + 16813r wrt r? -243972r2 Differentiate 19c*3 - 20c*2 + 1542 wrt c. 57c*2 - 40c What is the first derivative of -dk3 + 4dk2 - 3dw - 2k*3w - 429k3 + 289kw + k wrt w? -3d - 2k3 + 289k Find the third derivative of -198g2l*5 + 4g*2 - 43l*2 wrt l. -11880g*2l*2 Find the first derivative of 811ju3 + 9u*3 + 15 wrt j. 811u*3 What is the third derivative of 2a*4 - 4a*3cs2 + 11a*3s*2 - 4a*2cs - a2c - 2as*2 + 15cs2 wrt a? 48a - 24cs*2 + 66s2 What is the second derivative of -g5 - 158g2 + 12g + 21? -20g3 - 316 Differentiate -3y*4 - 30y*2 + y - 808 with respect to y. -12y*3 - 60y + 1 Find the third derivative of 2697l4 - 7l*2 - 90 wrt l. 64728l What is the second derivative of 2566m2 + 6125m? 5132 Find the second derivative of -f*3u*2 + 2f*3 - 48f*2u*2 - 27f - 9u wrt u. -2f*3 - 96f*2 Find the second derivative of -3f*2l*3z - 33f2 + 7fl3 + 3f + lz wrt f. -6l*3z - 66 Find the third derivative of k*3m - 159k3 + 11k*2 + 4km wrt k. 6m - 954 Differentiate 2a3f + 698a3 + 16af4 + 2a with respect to f. 2a3 + 64af3 Find the first derivative of 23dk2 + 20dk - 33k*2 - 3 wrt d. 23k*2 + 20k What is the third derivative of 42p6x + 2p4x*2 - 4p*2x*2 - 28p*2 wrt p? 5040p*3x + 48px*2 Differentiate 149g*3v + 8gv*2 - 9v*2 + 20v + 2 with respect to g. 447g2v + 8v2 What is the second derivative of 389v*2 - 80v? 778 What is the third derivative of c*3w*4 - 13c*3w*2 + 2c*3w + 71w6 + w4 + 6w*2 wrt w? 24c*3w + 8520w3 + 24w What is the second derivative of -1812h2 + 2260h wrt h? -3624 What is the first derivative of 1452j3w - 2j3 - 7j*2 wrt w? 1452j*3 What is the first derivative of 351y*3 - 181 wrt y? 1053y*2 Find the second derivative of -423r*2 - 151r. -846 Find the third derivative of -2g6m + 9g3mq - 18g*2mq + g2 - 4q wrt g. -240g3m + 54mq Differentiate -6m3s - 2215m3 - 187ms wrt s. -6m*3 - 187m What is the first derivative of -36hz*3 - 122z*3 wrt h? -36z3 Find the second derivative of o5 + 23o2 - 9o - 7 wrt o. 20o3 + 46 What is the second derivative of 431i*3k*2 + 327ik2 wrt i? 2586ik2 Find the second derivative of 2h*2j*2n*2z + h*2jn2z + 3h2n - hn2z - 17j2n*2z + 2jn*2z wrt j. 4h2n*2z - 34n2z Find the third derivative of -2636g4 + 2g*3 - 46g*2. -63264g + 12 What is the third derivative of 91v4 + 20v*3 + 31v*2 - v + 10 wrt v? 2184v + 120 What is the derivative of 11051i2l + l + 3220 wrt i? 22102il What is the third derivative of 61f6 - 4f*3 - 690f*2? 7320f*3 - 24 Differentiate -108j*4 - 351 with respect to j. -432j*3 What is the third derivative of -680h*3r*3 - 158h*3r*2 + 2hr2 wrt r? -4080h*3 What is the second derivative of 26cd5 + 18cd + c + d5 + 2d*2 + 6d wrt d? 520cd*3 + 20d*3 + 4 What is the second derivative of 2h*3r - 2h3 + 67h*2 + 181hr + r wrt h? 12hr - 12h + 134 What is the second derivative of -1856y2 - 6261y? -3712 What is the first derivative of 3580l - 3273? 3580 Find the second derivative of -224v*2 - 2v + 12. -448 Differentiate -19mw - 7my*2 + 6my - 530wy2 - 2y*2 + 2 with respect to m. -19w - 7y2 + 6y Differentiate 4656r4 - 7917 with respect to r. 18624r*3 Differentiate -97k*2sx + 6k*2 + 5kx3 + 2sx3 + s with respect to s. -97k*2x + 2x3 + 1 What is the first derivative of -6l*4v + 10lv*2 - 276v*2 wrt l? -24l*3v + 10v2 Find the third derivative of -9820h*3 - 9h*2 - 75h wrt h. -58920 Differentiate -8u3 - 18u*2 + 515 with respect to u. -24u*2 - 36u Differentiate gh2 + 116gh + 146g + h with respect to h. 2gh + 116g + 1 What is the second derivative of -162f*2m*3p*3 - fp + 425m3p*3 wrt f? -324m*3p*3 Find the second derivative of 47l*3 - 2l*2 - 45l + 2. 282l - 4 Differentiate -2872hi3 - 2hi2 - 17i*3 + 162 wrt h. -2872i*3 - 2i*2 Find the second derivative of 3359t*2 - 2721t wrt t. 6718 Find the third derivative of 3149w4 + w2 - 268. 75576w Find the second derivative of 21a5 - a4 + 79a*3 - 785a + 1. 4	{ "pile_set_name": "DM Mathematics" }
king 1 j and 1 l when two letters picked without replacement from lzjxiaxizailxl? 3/91 Three letters picked without replacement from smjmwwissm. What is prob of picking 1 i, 1 s, and 1 j? 1/40 What is prob of picking 2 l when two letters picked without replacement from {l: 2, h: 3}? 1/10 What is prob of picking 1 x, 1 a, and 2 k when four letters picked without replacement from {q: 3, k: 4, j: 4, x: 1, a: 4, s: 1}? 6/595 What is prob of picking 2 d and 2 z when four letters picked without replacement from vvvzvdzvdzvddzdvzv? 5/153 Three letters picked without replacement from xxdxdczdcx. What is prob of picking 2 c and 1 z? 1/120 What is prob of picking 1 c and 1 d when two letters picked without replacement from {m: 9, d: 3, c: 4, e: 4}? 6/95 Two letters picked without replacement from ttpppp. What is prob of picking 1 t and 1 p? 8/15 Two letters picked without replacement from wwxvlwv. What is prob of picking 2 w? 1/7 Calculate prob of picking 1 k and 1 n when two letters picked without replacement from {d: 2, n: 6, a: 2, k: 1}. 6/55 What is prob of picking 1 g and 1 c when two letters picked without replacement from {g: 2, c: 5}? 10/21 What is prob of picking 2 d when two letters picked without replacement from {y: 4, d: 5, u: 2}? 2/11 Three letters picked without replacement from hgzghyhhhhhzgg. Give prob of picking 2 z and 1 y. 1/364 Three letters picked without replacement from {e: 1, n: 4, j: 6, m: 6, x: 1}. What is prob of picking 1 e and 2 x? 0 What is prob of picking 1 o and 1 q when two letters picked without replacement from cvooooqvcd? 4/45 Four letters picked without replacement from {r: 8, b: 3, n: 7}. Give prob of picking 2 b and 2 r. 7/255 Three letters picked without replacement from clboooob. What is prob of picking 2 o and 1 l? 3/28 Four letters picked without replacement from {m: 12, d: 7}. Give prob of picking 4 m. 165/1292 Calculate prob of picking 1 a and 1 q when two letters picked without replacement from {a: 1, q: 1, y: 1}. 1/3 What is prob of picking 1 a and 1 h when two letters picked without replacement from {w: 6, h: 7, a: 1}? 1/13 Calculate prob of picking 1 j and 1 n when two letters picked without replacement from {g: 4, n: 1, j: 2, a: 1, y: 1}. 1/18 Four letters picked without replacement from {s: 9, v: 1, t: 5, a: 3}. What is prob of picking 3 a and 1 v? 1/3060 Calculate prob of picking 1 o and 3 l when four letters picked without replacement from oxlllol. 8/35 Two letters picked without replacement from otuootoooussooouusu. What is prob of picking 1 o and 1 s? 3/19 Two letters picked without replacement from atkksaassaassak. Give prob of picking 2 a. 1/7 Calculate prob of picking 1 r and 1 h when two letters picked without replacement from {h: 11, r: 3}. 33/91 What is prob of picking 3 n when three letters picked without replacement from {n: 5, f: 4, h: 1}? 1/12 Calculate prob of picking 3 c and 1 u when four letters picked without replacement from cucucuuucurucrcuucc. 42/323 Four letters picked without replacement from {b: 1, q: 2, c: 2, p: 1, j: 4}. What is prob of picking 1 p, 2 q, and 1 c? 1/105 Calculate prob of picking 3 h when three letters picked without replacement from qeqhehehhhhh. 7/44 What is prob of picking 2 g when two letters picked without replacement from {k: 3, r: 4, y: 6, g: 2}? 1/105 Three letters picked without replacement from {t: 2, x: 2, o: 2, a: 4, u: 2, v: 3}. Give prob of picking 2 t and 1 a. 4/455 Three letters picked without replacement from ssssqq. What is prob of picking 1 s and 2 q? 1/5 Two letters picked without replacement from hhvtidhihh. Give prob of picking 1 i and 1 d. 2/45 Two letters picked without replacement from hrhhirhxffnnh. Give prob of picking 1 h and 1 n. 5/39 What is prob of picking 1 o, 1 c, and 1 m when three letters picked without replacement from fqqfoqnofmocqf? 3/364 Calculate prob of picking 2 p and 1 k when three letters picked without replacement from {t: 1, k: 3, p: 2, b: 7, m: 5}. 1/272 Two letters picked without replacement from {p: 3, y: 1, n: 1, w: 7}. Give prob of picking 1 n and 1 y. 1/66 Four letters picked without replacement from jjxxxjjxmjjjljjjjlm. Give prob of picking 3 j and 1 x. 55/323 Four letters picked without replacement from ulaslululslsusullsu. What is prob of picking 1 a and 3 s? 5/1938 Two letters picked without replacement from cccbfccnbecccfe. What is prob of picking 1 b and 1 c? 16/105 What is prob of picking 1 d and 1 m when two letters picked without replacement from deymdgmdeddfydd? 2/15 Four letters picked without replacement from cscssscs. Give prob of picking 1 s and 3 c. 1/14 Calculate prob of picking 1 k, 1 o, and 1 w when three letters picked without replacement from {w: 1, k: 5, o: 1, m: 3, f: 1}. 1/33 What is prob of picking 3 b when three letters picked without replacement from {b: 3, u: 15}? 1/816 Two letters picked without replacement from {m: 1, b: 1, o: 3, y: 2, i: 5}. Give prob of picking 1 i and 1 b. 5/66 Calculate prob of picking 2 u when two letters picked without replacement from uuauxyuujapyjya. 2/21 Four letters picked without replacement from mxxmfxxmx. Give prob of picking 1 f and 3 m. 1/126 Three letters picked without replacement from jakjxhac. Give prob of picking 1 k, 1 h, and 1 x. 1/56 Three letters picked without replacement from {y: 3, d: 7, u: 3, b: 1}. What is prob of picking 1 y, 1 d, and 1 u? 9/52 What is prob of picking 1 b, 1 w, and 1 i when three letters picked without replacement from nsibw? 1/10 What is prob of picking 1 q and 1 g when two letters picked without replacement from {q: 1, g: 2}? 2/3 Three letters picked without replacement from atzttmcmaxza. What is prob of picking 2 m and 1 t? 3/220 Calculate prob of picking 1 u and 1 g when two letters picked without replacement from cpguvgvvvv. 2/45 Three letters picked without replacement from sbbbsbbbbbsbsbbbbbbb. Give prob of picking 1 b and 2 s. 8/95 Four letters picked without replacement from rrrhphrprrfarp. Give prob of picking 1 f, 2 p, and 1 h. 6/1001 Two letters picked without replacement from eodvzezzdedydvd. Give prob of picking 1 y and 1 e. 1/35 What is prob of picking 4 a when four letters picked without replacement from {w: 14, a: 5}? 5/3876 Two letters picked without replacement from {w: 3, x: 5, t: 1}. What is prob of picking 2 x? 5/18 Calculate prob of picking 1 v, 1 c, and 1 j when three letters picked without replacement from jivycic. 2/35 What is prob of picking 3 s when three letters picked without replacement from {s: 9}? 1 Four letters picked without replacement from dgddwdddddddddd. Give prob of picking 1 w, 1 g, and 2 d. 2/35 Three letters picked without replacement from czzzzccmcczcczczz. What is prob of picking 3 z? 7/85 Two letters picked without replacement from fyfffiqliiqliliild. What is prob of picking 1 q and 1 f? 8/153 What is prob of picking 1 q and 1 u when two letters picked without replacement from cuscsuuucuuucqqcsuu? 2/19 What is prob of picking 1 d, 1 o, and 1 g when three letters picked without replacement from dmogdgdgggomddgog? 21/136 Calculate prob of picking 1 p and 2 g when three letters picked without replacement from pppgggp. 12/35 Four letters picked without replacement from aiaaaiaaaaaaaaaaaaa. What is prob of picking 3 a and 1 i? 20/57 What is prob of picking 1 e and 1 d when two letters picked without replacement from {v: 2, d: 4, e: 8}? 32/91 What is prob of picking 1 s, 2 h, and 1 k when four letters picked without replacement from {g: 1, k: 4, s: 1, h: 4, v: 3}? 24/715 What is prob of picking 1 e and 1 q when two letters picked without replacement from {y: 4, e: 10, w: 2, u: 1, q: 1}? 10/153 Calculate prob of picking 1 z and 1 k when two letters picked without replacement from {z: 2, k: 2, m: 3, v: 2, n: 1, h: 10}. 2/95 Four letters picked without replacement from {j: 3, t: 5, d: 1, h: 1, m: 2}. What is prob of picking 1 h, 1 m, and 2 j? 2/165 Calculate prob of picking 1 y, 1 r, and 1 k when three letters picked without replacement from {p: 7, y: 3, i: 5, k: 2, r: 1}. 1/136 What is prob of picking 4 u when four letters picked without replacement from wuwunnwweuwuww? 1/1001 Two letters picked without replacement from ttttttttttttttotot. What is prob of picking 1 o and 1 t? 3	{ "pile_set_name": "DM Mathematics" }
Let y(m) = -112m + 4. Let s(x) = 12g(x) - 3y(x). Let z(f) = 2f. Calculate z(s(q)). 696q Let n(u) = u + 3. Let q(y) = y. Let b(c) = 7c + 2. Let j(i) = b(i) - 6q(i). Let a(h) = -3j(h) + 2n(h). Let o(m) = 7m. What is o(a(p))? -7p Let b(j) = j2. Let z(w) be the third derivative of -11w*7/1260 - 23w*5/30 + 4w*2. Let n(p) be the third derivative of z(p). Determine n(b(k)). -44k*2 Suppose 0u = 2n + 4u - 6, 3u - 15 = -5n. Let c be 264/21 - n/(-7). Let t(v) = c - 13 + 13v. Let a(h) = 2h. Calculate a(t(b)). 26b Let a(s) = -13s. Let w(r) = -2r2 - 275r + 4. Determine w(a(n)). -338n2 + 3575n + 4 Let f(s) = -12s + 6s + 4s + 0s. Let g(z) be the third derivative of 5z4/24 + 2z*2. Calculate g(f(m)). -10m Let x(c) = 9c. Let i(q) be the third derivative of -4q*5/5 + 72q*2. Give x(i(m)). -432m*2 Let i(o) be the first derivative of 2 + 0o - 3/2o2. Let k(s) = s. Calculate k(i(j)). -3j Let v(h) = 2h. Let p = 910 - 908. Let b(d) be the first derivative of 5/3d*3 + 5 + 0d + 0dp. Give b(v(u)). 20u*2 Let w(t) = -61t. Let k(c) be the second derivative of -c*3/2 + 11c + 1. What is k(w(a))? 183a Let u(q) = -q. Let c = -6 + 9. Suppose 4b + s = 7, -cb + 2s = 2b - 12. Let p(r) = -3r*2 + 5r*b - 2r*2 + 5r*2. What is u(p(t))? -5t*2 Let z(b) = 32b*2. Let d(i) = 8283i*2. What is z(d(g))? 2195458848g4 Let p(w) be the third derivative of w4/24 + w*2 - 208. Let i(c) = -142c. Determine p(i(l)). -142l Let o(n) = 2778n*2. Let r(l) = 13l*2. Give r(o(z)). 100324692z*4 Let k(m) = 8m*2 - 3m + 3m. Let l be (-2)/(-8) - (-1 + 333/(-12)). Let s(r) = -11r - 11r - 6r + lr. What is s(k(p))? 8p*2 Let i(b) be the second derivative of 0b*3 + 16b + 0b2 + 1/12b*4 + 0. Let a(z) = -3z*2. Give a(i(g)). -3g*4 Let l(u) = -2491u. Let f(r) = 21r2. Calculate l(f(w)). -52311w*2 Let l be (-82)/(-287) + (1 - (-36)/21). Let k(h) be the third derivative of 0h + 9h2 + 0 + 1/12h*4 + 0hl. Let r(q) = q2. Calculate k(r(u)). 2u2 Let l(g) = 6g. Suppose -5u - 4 + 19 = 0. Suppose 0 = -5s + us + 4. Let y(q) = -2q2 + q2 + 3qs + q2. Calculate y(l(m)). 108m*2 Let g(p) = 5p*2. Let o(y) be the second derivative of 37y*4/4 + 4y - 28. Calculate o(g(r)). 2775r4 Let j(h) = -333h*2 + 133h*2 + 126h*2 + 103h*2. Let k(n) = 0n + 5n - 3n. Give j(k(b)). 116b2 Let q(a) = 7a*2 + 8a + 8. Let d(m) = -m*2 - m - 1. Let f(s) = 24d(s) + 3q(s). Let o(y) = -5y - 16y + 8y. Calculate f(o(i)). -507i2 Let l(s) = -41s*2 - 12s - 3. Let x(w) = 41w2 + 8w + 2. Let h(c) = -2l(c) - 3x(c). Let i(a) = 7a2. Determine h(i(y)). -2009y*4 Let i(q) = 3q - 4 + 5q - 2. Let p(f) = 161f - 119. Let l(o) = -119i(o) + 6p(o). Let g(h) = 2h2. Calculate l(g(r)). 28r*2 Let f(w) = -3w*2. Let p(h) = h + 2630. Determine p(f(t)). -3t*2 + 2630 Let t(z) = -z + 2z + 12 - 9. Let j be t(-3). Let k(w) = -w*2 + jw2 - w2. Let u(c) = -3c. Determine u(k(f)). 6f*2 Let k(j) = 8j*2. Let w(t) = -32t - 45 - 9t - 5t + 44t. Give k(w(r)). 32r*2 + 1440r + 16200 Let n(o) = 5o2. Let u(l) = -6 - 24l*2 - 22l*2 + 4 + 2. What is n(u(d))? 10580d*4 Let n(j) = -15j. Let t(q) = q*3 - 10q*2 + 6q + 16. Let c be t(10). Let h(i) = -ci2 - 76i*2 + 156i*2. Determine n(h(v)). -60v*2 Let p(j) = -10j2. Let g(k) be the second derivative of k6/720 - 11k4/6 + k2/2 + 7k. Let o(z) be the third derivative of g(z). Give p(o(v)). -10v2 Let n(y) = y2. Let f(g) be the second derivative of 337g*4/6 - 451g. Determine f(n(r)). 674r4 Let b(i) be the first derivative of 2i*3/3 - 228. Let d(v) = -938v. Calculate d(b(y)). -1876y2 Let u(s) = -5041s. Let a(y) = 5y2. Calculate u(a(h)). -25205h*2 Let w(p) = 7p*2 + 2. Let f(r) = -r - 28 + 28. What is f(w(i))? -7i*2 - 2 Let w(r) = 72r*2 + 27. Let c(t) = -6t - 3. Calculate c(w(b)). -432b2 - 165 Let m(k) = k2. Let n(j) = 6972j*2. Determine n(m(i)). 6972i*4 Let y(u) = -2u*2. Let f(d) = 2730d + 998. Determine f(y(m)). -5460m2 + 998 Let x be ((-165)/(-6))/(-11)8/(-10). Let j(l) = 0l2 - 4l*2 + 6l*x + 6l*2. Let w(k) = -6k. Calculate j(w(r)). 288r2 Let x(o) = -4o2 + 2. Let j(b) be the second derivative of -b4/6 - 155b. What is x(j(z))? -16z*4 + 2 Let q(j) = -j - 4407. Let g(d) = -d. Determine q(g(l)). l - 4407 Let m(q) be the third derivative of 19q*5/4 - 9q*2. Let o(w) = -w. What is m(o(v))? 285v*2 Let q = 77/166 + 3/83. Let j(g) be the second derivative of -3g + 0 + 0g2 - qg*4 + 0g3. Let h(l) = -l2. Give h(j(w)). -36w4 Let y(b) = -26b. Let q = 76 - 70. Let j(m) = m. Let i(g) = 7g. Let n(z) = qj(z) - i(z). What is y(n(v))? 26v Let c(s) = -3s. Let v(o) = 10o2 - 112176o. What is c(v(d))? -30d2 + 336528d Let x(n) = n*2. Let m(w) be the second derivative of 17w*4/6 + 114w. Calculate m(x(o)). 34o4 Let x(v) = -89v - 1. Let q(c) be the third derivative of -c*5/15 - 253c*2. Determine q(x(j)). -31684j*2 - 712j - 4 Let t(i) = -3i2 + 5i*2 - 17i*2 + 10i*2. Let g(c) = -3c*2. Give t(g(m)). -45m4 Let a(t) be the third derivative of t6/720 - t*4/2 + 3t*2. Let n(i) be the second derivative of a(i). Let u(r) = -11r*2. Give n(u(o)). -11o*2 Let y(s) = -43s*2. Let n(z) = 3711z*2. Calculate n(y(j)). 6861639j*4 Let c(h) = -3h*2 + 3h. Let w(f) = 249f. Give w(c(l)). -747l*2 + 747l Let k(c) be the first derivative of -32/3c3 - 1 + 0c*2 + 0c. Let i(z) = z. Determine k(i(m)). -32m2 Let n(w) = w. Let l(m) = -3080 + 19m + 3080. Calculate l(n(f)). 19f Let n(a) = 3a*2 + 5a - 5. Let h(i) = 8i2 + 12i - 12. Let o(y) = 5h(y) - 12n(y). Let z(p) = p - 3p + 3p. Calculate z(o(x)). 4x2 Let w(u) = 254u*2. Let h(l) = 3l + 9. Calculate h(w(t)). 762t2 + 9 Let g(b) = 2b*2. Let r(v) be the third derivative of -103v*4/12 - 74v*2 - 2. Determine g(r(z)). 84872z2 Let n(l) = l. Let h(a) be the third derivative of -a5/60 + a*4/4 + 18a*2. Let y(q) = h(q) - 6n(q). Let w(s) = 6s2. Determine y(w(j)). -36j4 Let s(v) = -v2 - 2 + 2. Let x(b) = 11b - 5. Let k(y) = 6y - 2. Let a(m) = 5k(m) - 2x(m). Let q(p) = p. Let c(l) = -a(l) + 6q(l). Calculate c(s(h)). 2h2 Let l(x) be the second derivative of -x3/2 + 461x. Let q(k) = -3k*2 + 4k*2 + 4k*2. Give l(q(d)). -15d2 Let b(c) be the first derivative of -c2/2 + 1. Let r(i) = 5 - 5 - 12i + 14i. Give b(r(l)). -2l Let j(q) = -122q. Let f(t) = -22662t2. Give f(j(v)). -337301208v2 Let z(f) = f + 2. Let x(a) be the third derivative of -a4/24 - 5a3/6 - 6a*2. Let d(g) = 6x(g) + 15z(g). Let k(u) = 3u*2. Give d(k(r)). 27r*2 Let h(v) = -4v*2. Let a(x) = 11491x*2. Give a(h(n)). 183856n4 Let r(f) = f2 + f + 1. Let o(t) = 15t2 + 4t + 4. Let q be 4/(-14) - 60/(-14). Let h(b) = qr(b) - o(b). Let v(d) = 2d*2. Calculate v(h(a)). 242a4 Let v(l) = -l. Let r(a) = -a2 + a + 1864. What is v(r(p))? p*2 - p - 1864 Let l(t) = 8t + 1. Let k(u) = 12u + 821 - 821. Give k(l(h)). 96h + 12 Let o(p) = -128p2 + 1. Let y(w) = -18 - 6w + 6w + 4w*2 + 18. Give o(y(q)). -2048q*4 + 1 Let s(o) = -14o - 12. Let l = 7 + -8. Let h(j) = j + 1. Let m(z) = ls(z) - 12h(z). Let y(d) be the first derivative of 9d2/2 - 8. Calculate y(m(p)). 18p Let d(u) = -11u2 - 5u. Let o(f) be the first derivative of -4f3/3 - 326. Give d(o(t)). -176t*4 + 20t*2 Let b(i) = 7i*2 - 22i - 2. Let r(p) = 3p. What is r(b(j))? 21j*2 - 66j - 6 Let t be -21(2 - 3). Let h(s) = -s*2 + 2st + s2. Let k(d) = 23d - 23d + 7d2. Give k(h(c)). 28c*4 Let y(h) = -13h. Let x(m) be the third derivative of m*7/2520 - 35m4/24 - m2. Let i(a) be the second derivative of x(a). What is i(y(b))? 169b2 Let z(q) = 140q + 2. Let v(x) = x*2 + 6x - 2x + 2x - 6x. What is v(z(k))? 19600k*2 + 560k + 4 Let m(i) = -31417i - 2. Let a(d) = 3d. What is m(a(h))? -94251h - 2 Let r(k) be the second derivative of k5/120 + k3/3 - k. Let h(o) be the second derivative of r(o). Let s(b) = -23b - 14b + 34b. Determine h(s(q)). -3q Suppose 4m - 4 = 2m. Let r(c) = 15c*m - 17c*2 - 19c2. Let a(z) = z2. Calc	{ "pile_set_name": "DM Mathematics" }
3/5, -1/2? q Let p = -133 + 86. Let d = 46.8 + p. Let u = 3.1 + 0.9. Which is the nearest to -0.04? (a) -0.1 (b) d (c) u a Let p = 22799/4 + -5663. Let o = p - 36. Which is the nearest to -1? (a) -15 (b) -0.4 (c) o b Let k be (1 - -2) + (-5 - 0) + -1. Let v(b) = b - 12. Let a be v(11). Let x be a2 + (-68)/(-32). What is the closest to -0.1 in 2, k, x? x Let q be 180/(-75) + 196/70. What is the nearest to -4 in -1, -0.3, 0.18, q? -1 Let n be 3(6/(-63))/2. What is the closest to -0.1 in n, -2/5, 3, 54? n Let l(z) = -z*2 + 4z + 46. Let j be l(9). Let g be 8/16 - (1 + j). Let f(h) = h - 7. Let n be f(5). What is the nearest to 2/3 in n, 3/5, g? 3/5 Let j = -617 + 617. Let a = 7 - 8. What is the nearest to j in 0, 2, a? 0 Suppose 0 = 4w - 5w - 19. Suppose -110 = 25z - 135. What is the closest to 1 in 4, z, w? z Let j be (0 - (-10)/(-2))(2 + -1). Let m be ((-3)/j)/(11/55). Let x be ((4/(-16))/(-1))/((-3)/4). Which is the nearest to x? (a) m (b) -0.5 (c) 5 b Let p = 95/2 - 46. Let c = 10104.03 + -10104. What is the nearest to -0.06 in p, c, 3? c Let w = -2.04 - -2.44. Let d = -1 + 0. Let p = d + 0.64. What is the nearest to 0.1 in 1, w, p? w Let n = 0.05 + -0.35. Let s = -67.4155 - -77.4155. Which is the closest to 1/4? (a) s (b) 1 (c) n (d) -1 c Let h = -2 + 5. Let j be (-2)/3(-3)/(-2). Let p = 13565 + -13563. Which is the nearest to p? (a) j (b) 6 (c) h c Let f = 4.43 - 4.2. Let n = f - 0.03. Let y = 292/1015 + -2/1015. What is the nearest to -2/17 in y, -0.2, n? -0.2 Let v = -4.1 - 125.9. Let s = v - -132. Which is the nearest to 3? (a) 0 (b) s (c) -2 b Let m = 0.11202 + 0.08798. What is the closest to 0.04 in -0.08, -1, m, -5? -0.08 Let a = -1766/1029 - -2/1029. Let g = -4.3676 + 3.9676. What is the nearest to 0.3 in g, -1/2, a? g Let c = 131.1 + -18. Let y = -113 + c. Let l = 10.97 - 11. What is the closest to y in -1, -0.3, l? l Let y = 9559.1 + -9559. Suppose -2w = -2b + 8, 11 = -4w - 0w + 3b. Let t be w/((0 - 1)/1). What is the closest to 0.1 in 4, y, t? y Let g be 24/(-10)(-295)/(-177). What is the nearest to 1 in g, 2/169, 0? 2/169 Let l = -15166 - -15165. Let x be 40/24 + -12. What is the nearest to l in 19, -0.2, x? x Let l be (-16)/(-108)((-7)/((-14)/8))/8. Which is the nearest to -0.99? (a) 4 (b) 1/2 (c) l c Let y = -13.2046 - -13.3046. Suppose 3k + k = 0. Which is the closest to y? (a) -2/3 (b) k (c) -4/7 (d) -3/8 b Let p = 0.105 - -0.195. Which is the nearest to -0.2? (a) 9 (b) -1 (c) p (d) -2 c Suppose -2x - w = -3w + 4, 0 = w - 2. Let j be 3 - (5 + x/3). What is the nearest to j in -0.1, -5, -15/2? -0.1 Let j(v) = -v*3 - 28v*2 - 77v - 33. Let h be j(-25). Suppose hp = 29p + 36. What is the nearest to 0.3 in 4, p, -2/3? -2/3 Let m = -1.455 + -0.545. Let a be 93/(-14) + 1 + 2. Let r = a - -589/154. What is the nearest to 0 in m, r, 1? r Let b be (-1)/(-10)(62 + -42 - 21). What is the closest to 2/5 in b, -3, 0.4, -2/9? 0.4 Suppose -168j + 77j = -35j + 448. Which is the closest to -2? (a) j (b) 6 (c) -3 (d) 2/21 c Let u be -3 - ((-4872)/1224 + (-1 - -2)). What is the nearest to -2/3 in 3, -2/45, u? -2/45 Suppose -168 = -45f + 31f. Suppose fu + u = -u. What is the closest to u in -2/13, -5, 3/5, -3? -2/13 Let t = -4081/2 - -2042. What is the closest to -1 in t, -23, -11? t Let y be 0/((-2 - -5)/(12/8)). What is the closest to -14 in -4/3, y, 4? -4/3 Let h = 22848 + -22848.12. Which is the closest to -2/5? (a) 1/3 (b) h (c) 9 (d) -4 b Let g(j) = -79j + 27. Let t be g(-11). Let f be 6/57 + t/(-3458). Which is the nearest to 0? (a) 1 (b) f (c) -0.5 b Let g(u) = 130u + 1820. Let s be g(-14). What is the nearest to 2/5 in 2/9, s, -2/51? 2/9 Let g = 2926 + -2929. Let z be 3 - 31033/21. Let k = z + 145. Which is the nearest to -1/2? (a) 4 (b) k (c) g b Let x = -76/155 - 367742/465. Let c = 791 + x. What is the nearest to c in 9, 2, 4, -2/5? -2/5 Let k = -1189/4 - -297. Let a be 12/33/16. Let r = 89.7 - 90. What is the nearest to k in -1, a, r? r Let m(t) = -6t - 8t - 20 + 22t - 14t - 30. Let j be m(-8). Which is the closest to -0.1? (a) 2/15 (b) j (c) 3 (d) 1/5 a Let z = 41.6 + -35. Let q = -83.1 + 76. Let x = z + q. Which is the nearest to 0.02? (a) x (b) -1 (c) 0.3 c Let z be ((-3)/(-2))/(39/(-4)). Let g = -0.3 - 2.7. Let w be ((6/(-1))/54)/(12 - 13 - -2). What is the nearest to w in 2/9, g, z? z Let x = -3.5 + 3. Let c be (22 - 30)2/16. What is the nearest to -0.01 in x, 2, 1/4, c? 1/4 Let x = -3157/9 - -351. Let k = -585 - -584. Which is the closest to k? (a) x (b) -1/4 (c) -8 (d) -1/6 b Let i = 527/8 - 66. Let v = 250/3 + -416/5. Suppose -33z + 2 = -31z, 0 = 4q + 2z - 2. What is the closest to v in i, q, 2? q Let p = -1514 - -1515. Which is the closest to p? (a) -0.4 (b) -5 (c) 0.3 (d) 0.0675 c Let i = 0.2 - 0.3. Suppose -5n + 9 = 4q - 46, 38 = 5q - 4n. Suppose -a + 4a - 4h + q = 0, 0 = -4a - 3h - 30. What is the closest to 1/4 in 2, a, i? i Let m be 9412/14 - 2/7. Let n = m - 11427/17. Which is the nearest to n? (a) -0.5 (b) 0.4 (c) -1 a Suppose 57k + 38 = -54k + 130k. What is the closest to -0.4 in 11, -0.4, -17, k? -0.4 Let z = 4.66 + -0.66. Suppose 5t + 10p - 13p = -14, 5t = 4p - 17. Let u(m) = m*3 + m + 1. Let x be u(0). Which is the closest to t? (a) x (b) z (c) 1/2 c Let h = -1.86 - 0.46. Let g = h - 0.48. Let t = -3 - g. Which is the nearest to 0.6? (a) -1/6 (b) t (c) 2 a Let k = -4.143 - -7.143. What is the closest to 1 in k, 1, 5.1? 1 Let u = -3980 + 19942/5. Which is the closest to 0? (a) -3 (b) u (c) -1/6 c Suppose 615g + 20 = 620g - 2o, -g + 4o + 4 = 0. Which is the closest to 1? (a) 3.3 (b) g (c) 5 a Let z be ((-3)/(-3))/(3/(-15)). Suppose 13738i = 13731i. Let s = -0.03 + 2.03. Which is the closest to i? (a) z (b) 0.4 (c) s b Let h = -14.9 - -15. Let x = 5.5 + -2.31. Let g = 0.19 - x. Which is the closest to -2/11? (a) g (b) 4 (c) h c Let l = 0 - -2. Let s(j) = -j - 2. Let p be s(l). Suppose 43 = -9m + 61. What is the nearest to 1/4 in m, 4, p? m Let d = 0.8 - 0.9. Let l be (-8)/(-2)16/(-32). Let w be 2 - 1(-1 + l). Which is the nearest to d? (a) w (b) 0 (c) 3 b Let f = -17845 + 17841. What is the closest to 2/3 in -0.13, f, 4? -0.13 Let g = -46/5 + 44/5. Let j = -139 + 143.9. Let u = -4.95 + j. What is the nearest to 0 in u, 2, g? u Let y = -1.4 - -0.4. Suppose -39j + 40j - 5 = 0. Suppose 5l = -js - 20, -2s - 3 = 4l + 7. Which is the closest to l? (a) 2 (b) y (c) 1 b Let g = -1872 - -1039. Let n = g + 833.1. Let r = 1/60 + -4/15. Which is the closest to n? (a) r (b) 4 (c) -12 a Let c = -6357 - -6356. What is the closest to -2/3 in c, -4, -1/20, -0.04? c Let f = -32806 - -32805.8. What is the closest to -2/3 in 3, f, -2/11, 0.4? f Let l = -11428/9 + 1270. What is the closest to 2 in 0.1, -3, -9, l? l Suppose -5m = 2l - 13, 195l - 194l = 2m + 2. Which is the closest to m? (a) -2/1991 (b) 0.5 (c) -1/6 b Let f be (3 - -11) + 3939/(-273). Which is the nearest to 1.9? (a) -21 (b) 3 (c) f b Let s = 76615/3 + -25538. What is the nearest to -6/77 in 5, s, -1/4? -1/4 Let n = -29 + 29. Let o be (-12)/21(-714)/1836. Which is the nearest to 1/2? (a) o (b) 2/7 (c) -2/7 (d) n b Let o = -7.289 + 8.289. Which is the closest to o? (a) 4 (b) 1 (c) -5/4 b Let k be -1 + 2 + 25/(-15). Let i be 7 + (-1)/1 + -2. What is the closest to 2 in k, 5, i? i Suppose -936v + 907v = 0. Suppose -3q - 9 = -0q. Let y be -10q/122. What is the nearest to 0.1 in y, v, -0.4? v Let f = -154301/3 + 51434. Let h = 5.1 - 0.1. Which is the closest to 0? (a) -0.4 (b) f (c) -3 (d) h b Suppose 978k + 12 = 488k + 493k. Let i be (-32/18)/1. Which is the closest to i? (a) -0.4 (b) k (c) 3 (d) -3 a Let p = 112.1 - 107. Let u = p + 0.9. Suppose 0 = -44i - 21i. Which is the nearest to -1? (a) u (b) i (c) 4 b Let d = 0.2 + 0.3. Let v = 37005 - 37005.1. Let w = -26 - -44. What is the closest to v in d, 0.4, w? 0.4 Let v = 96.5 - 89. Let r = -9.5 + v. Suppose -15 = 5p - 3f, f = -p + 7 - 2. Which is the closest to p? (a) -1/5 (b) 0.3 (c) r a Let r = -8854 + 61976/7. What is the closest to 0.3 in 1, -5/2, r, -4/5? r Let x = -6951 + 6946. What is the nearest to -2/5 in	{ "pile_set_name": "DM Mathematics" }
2, 3, 5, 509, 1867 What are the prime factors of 100395718? 2, 1607, 31237 What are the prime factors of 4122147833? 4122147833 List the prime factors of 2768913950. 2, 5, 11, 5034389 List the prime factors of 114024463. 7, 16289209 List the prime factors of 1740453550. 2, 5, 11, 1117, 2833 What are the prime factors of 3762185753? 3762185753 What are the prime factors of 1614422784? 2, 3, 13, 101, 1601 List the prime factors of 27485766. 2, 3, 7, 11, 2833 What are the prime factors of 1901898366? 2, 3, 19, 2203, 7573 What are the prime factors of 113749613? 3323, 34231 What are the prime factors of 408962654? 2, 89, 2297543 List the prime factors of 135081683. 11, 53, 231701 What are the prime factors of 43486160? 2, 5, 617, 881 What are the prime factors of 15711840? 2, 3, 5, 3637 List the prime factors of 1656299841. 3, 7, 967, 81563 What are the prime factors of 2737490718? 2, 3, 8117, 56209 What are the prime factors of 54981914? 2, 13, 23, 91943 List the prime factors of 6435088613. 47, 136916779 What are the prime factors of 180138458? 2, 31, 2905459 What are the prime factors of 142007604? 2, 3, 431, 27457 List the prime factors of 348496941. 3, 13, 8935819 List the prime factors of 88807681. 41, 2166041 What are the prime factors of 1086494756? 2, 163, 1666403 What are the prime factors of 68992369? 127, 239, 2273 What are the prime factors of 3780495187? 7, 29, 2660447 What are the prime factors of 405385895? 5, 3163, 25633 List the prime factors of 67268360. 2, 5, 19, 61, 1451 List the prime factors of 2549903569. 19, 43, 3121057 What are the prime factors of 39412416? 2, 3, 233, 881 List the prime factors of 32719610. 2, 5, 7, 11, 3863 List the prime factors of 2147351688. 2, 3, 199, 49957 What are the prime factors of 177498232? 2, 22187279 What are the prime factors of 276163393? 11, 139, 180617 List the prime factors of 2659613317. 37, 71881441 What are the prime factors of 486832356? 2, 3, 1502569 List the prime factors of 2618837591. 2618837591 List the prime factors of 944259285. 3, 5, 29, 491, 4421 What are the prime factors of 378999222? 2, 3, 7, 61, 3019 List the prime factors of 6421313. 37, 173549 What are the prime factors of 37765796? 2, 163, 57923 What are the prime factors of 11963334? 2, 3, 31, 64319 List the prime factors of 221149011. 3, 3307, 22291 What are the prime factors of 73715697? 3, 11, 248201 List the prime factors of 1025426271. 3, 341808757 What are the prime factors of 873171521? 251, 3478771 What are the prime factors of 106740805? 5, 21348161 What are the prime factors of 269145157? 269145157 List the prime factors of 129086166. 2, 3, 11, 23, 85037 List the prime factors of 211685894. 2, 7, 15120421 What are the prime factors of 2867704434? 2, 3, 7, 22759559 What are the prime factors of 353182350? 2, 3, 5, 211, 11159 What are the prime factors of 17052523? 37, 641, 719 What are the prime factors of 226524657? 3, 31, 2435749 What are the prime factors of 1319548867? 7, 13, 367, 39511 What are the prime factors of 44662303? 7, 149, 42821 What are the prime factors of 290074167? 3, 331, 97373 List the prime factors of 310336720. 2, 5, 239, 16231 What are the prime factors of 33423068? 2, 7, 137, 8713 List the prime factors of 186863511. 3, 409, 152293 What are the prime factors of 1071391448? 2, 133923931 What are the prime factors of 3857994142? 2, 43, 44860397 List the prime factors of 75767058. 2, 3, 4209281 List the prime factors of 1670026985. 5, 11, 677, 44851 What are the prime factors of 18194357? 23, 421, 1879 What are the prime factors of 2801819? 2801819 List the prime factors of 2484576135. 3, 5, 19, 53, 54829 What are the prime factors of 11413981? 11413981 List the prime factors of 95810965. 5, 19162193 List the prime factors of 511991535. 3, 5, 11, 282089 List the prime factors of 28654964. 2, 13, 19, 23, 97 List the prime factors of 181539119. 71, 367, 6967 What are the prime factors of 6700224960? 2, 3, 5, 11, 13, 17, 29 What are the prime factors of 80793869? 13, 1907, 3259 What are the prime factors of 558533084? 2, 139633271 What are the prime factors of 76469943? 3, 11, 1741 List the prime factors of 811432266. 2, 3, 135238711 What are the prime factors of 63193705? 5, 12638741 List the prime factors of 1124124260. 2, 5, 7, 271, 29629 What are the prime factors of 4794598? 2, 2397299 What are the prime factors of 2466582019? 11, 67, 967, 3461 What are the prime factors of 1034283632? 2, 101, 640027 What are the prime factors of 2791489321? 71, 1069, 36779 List the prime factors of 121560408. 2, 3, 41, 41179 What are the prime factors of 680747115? 3, 5, 45383141 List the prime factors of 244999076. 2, 7, 29, 31, 9733 What are the prime factors of 4392902515? 5, 37, 23745419 List the prime factors of 23648988. 2, 3, 11, 97, 1847 List the prime factors of 2310297277. 21661, 106657 List the prime factors of 429082240. 2, 5, 761, 881 List the prime factors of 7272748762. 2, 233, 2753, 5669 What are the prime factors of 3549782280? 2, 3, 5, 11, 23, 116923 List the prime factors of 560223322. 2, 19, 317, 46507 List the prime factors of 19213679. 19213679 List the prime factors of 435349958. 2, 353, 616643 List the prime factors of 818545016. 2, 191, 535697 List the prime factors of 2389572270. 2, 3, 5, 823, 32261 List the prime factors of 483254901. 3, 53, 823, 1231 What are the prime factors of 506340032? 2, 11, 23, 31271 List the prime factors of 116969023. 41, 149, 467 What are the prime factors of 991822241? 61, 16259381 What are the prime factors of 46923712? 2, 11, 66653 List the prime factors of 29572209. 3, 365089 List the prime factors of 872626067. 872626067 List the prime factors of 644142319. 883, 729493 What are the prime factors of 1250384958? 2, 3, 23155277 What are the prime factors of 97283191? 103, 944497 List the prime factors of 32116064. 2, 1003627 What are the prime factors of 264181597? 31, 151, 56437 List the prime factors of 874281345. 3, 5, 7, 431, 19319 List the prime factors of 230988070. 2, 5, 23098807 What are the prime factors of 81141415? 5, 31, 523493 What are the prime factors of 2355473? 31, 75983 What are the prime factors of 2059943989? 7853, 262313 What are the prime factors of 1110053140? 2, 5, 7, 23, 59, 5843 List the prime factors of 60182663. 60182663 What are the prime factors of 3627497187? 3, 23, 61, 287281 List the prime factors of 168926236. 2, 42231559 What are the prime factors of 6686418848? 2, 7489, 27901 What are the prime factors of 178454855? 5, 271, 131701 List the prime factors of 4370577407. 7, 211, 2959091 List the prime factors of 66268811. 7, 9466973 List the prime factors of 316030900. 2, 5, 3160309 What are the prime factors of 89044749? 3, 9893861 What are the prime factors of 1016050862? 2, 661, 768571 What are the prime factors of 151347509? 139, 1088831 What are the prime factors of 718722490? 2, 5, 71872249 List the prime factors of 25750109. 7, 11, 137, 2441 List the prime factors of 3703447423. 13, 113, 2521067 What are the prime factors of 31539593? 31539593 What are the prime factors of 1342941544? 2, 7, 23981099 What are the prime factors of 108745457? 1697, 64081 What are the prime factors of 3980991123? 3, 442332347 List the prime factors of 893343206. 2, 7, 373, 24439 What are the prime factors of 327584558? 2, 7, 683, 34259 List the prime factors of 54031788. 2, 3, 593, 2531 List the prime factors of 32945517. 3, 11, 30253 What are the prime factors of 46285441? 17, 59, 46147 What are the prime factors of 38461735? 5, 13, 17, 34807 List the prime factors of 1150012563. 3, 7, 19, 101, 28537 What are the prime factors of 165925861? 73, 2272957 What are the prime factors of 3314885540? 2, 5, 19, 83, 227, 463 What are the prime factors of 48462292? 2, 12115573 List the prime factors of 191201437. 7, 29, 941879 List the prime factors of 210264433. 210264433 List the prime factors of 1159614925. 5, 7, 1747, 3793 List the prime factors of 1015681986. 2, 3, 11, 79, 5903 List the prime factors of 2709041788. 2, 53, 12778499 List the prime factors of 77614978. 2, 7, 5543927 List the prime factors of 226378445. 5, 19, 43, 151, 367 List the prime factors of 2799744791. 19, 147354989 What are the prime factors of 18724	{ "pile_set_name": "DM Mathematics" }
he power of 1/4, to the nearest integer? 4 What is the fourth root of 5054 to the nearest integer? 8 What is 6548 to the power of 1/3, to the nearest integer? 19 What is the cube root of 43532 to the nearest integer? 35 What is the third root of 17484 to the nearest integer? 26 What is the tenth root of 26609 to the nearest integer? 3 What is the square root of 42355 to the nearest integer? 206 What is 41 to the power of 1/2, to the nearest integer? 6 What is 35113 to the power of 1/5, to the nearest integer? 8 What is 29932 to the power of 1/3, to the nearest integer? 31 What is the square root of 977 to the nearest integer? 31 What is 1149 to the power of 1/3, to the nearest integer? 10 What is the eighth root of 782 to the nearest integer? 2 What is 8125 to the power of 1/2, to the nearest integer? 90 What is 13251 to the power of 1/3, to the nearest integer? 24 What is the square root of 157289 to the nearest integer? 397 What is the square root of 344 to the nearest integer? 19 What is the fifth root of 327 to the nearest integer? 3 What is 25795 to the power of 1/2, to the nearest integer? 161 What is the third root of 130 to the nearest integer? 5 What is 4753 to the power of 1/4, to the nearest integer? 8 What is 11698 to the power of 1/7, to the nearest integer? 4 What is 7535 to the power of 1/5, to the nearest integer? 6 What is the third root of 17058 to the nearest integer? 26 What is 258 to the power of 1/10, to the nearest integer? 2 What is 4510 to the power of 1/5, to the nearest integer? 5 What is 8897 to the power of 1/8, to the nearest integer? 3 What is 612 to the power of 1/4, to the nearest integer? 5 What is the square root of 143 to the nearest integer? 12 What is the cube root of 805 to the nearest integer? 9 What is 1341 to the power of 1/3, to the nearest integer? 11 What is the cube root of 532 to the nearest integer? 8 What is the ninth root of 42741 to the nearest integer? 3 What is the eighth root of 1450 to the nearest integer? 2 What is 2141 to the power of 1/8, to the nearest integer? 3 What is the square root of 12164 to the nearest integer? 110 What is the square root of 13965 to the nearest integer? 118 What is 5081 to the power of 1/4, to the nearest integer? 8 What is 1483 to the power of 1/6, to the nearest integer? 3 What is 76021 to the power of 1/3, to the nearest integer? 42 What is 134 to the power of 1/4, to the nearest integer? 3 What is 12136 to the power of 1/6, to the nearest integer? 5 What is the ninth root of 12637 to the nearest integer? 3 What is the square root of 896 to the nearest integer? 30 What is the cube root of 13537 to the nearest integer? 24 What is the eighth root of 652 to the nearest integer? 2 What is the square root of 253 to the nearest integer? 16 What is 1040 to the power of 1/6, to the nearest integer? 3 What is 62 to the power of 1/3, to the nearest integer? 4 What is 950 to the power of 1/4, to the nearest integer? 6 What is 1427 to the power of 1/2, to the nearest integer? 38 What is the third root of 369 to the nearest integer? 7 What is the square root of 71160 to the nearest integer? 267 What is the cube root of 27394 to the nearest integer? 30 What is the square root of 47793 to the nearest integer? 219 What is 803 to the power of 1/3, to the nearest integer? 9 What is 7018 to the power of 1/3, to the nearest integer? 19 What is the sixth root of 8567 to the nearest integer? 5 What is the fifth root of 2465 to the nearest integer? 5 What is 670 to the power of 1/5, to the nearest integer? 4 What is 7486 to the power of 1/2, to the nearest integer? 87 What is the third root of 634 to the nearest integer? 9 What is the third root of 10327 to the nearest integer? 22 What is the seventh root of 961 to the nearest integer? 3 What is 3731 to the power of 1/7, to the nearest integer? 3 What is the third root of 6034 to the nearest integer? 18 What is the cube root of 5737 to the nearest integer? 18 What is the fourth root of 400 to the nearest integer? 4 What is 28018 to the power of 1/2, to the nearest integer? 167 What is 37915 to the power of 1/2, to the nearest integer? 195 What is the third root of 9869 to the nearest integer? 21 What is the square root of 21010 to the nearest integer? 145 What is the square root of 1929 to the nearest integer? 44 What is 4536 to the power of 1/6, to the nearest integer? 4 What is the square root of 872 to the nearest integer? 30 What is 11143 to the power of 1/3, to the nearest integer? 22 What is the cube root of 23753 to the nearest integer? 29 What is 17387 to the power of 1/9, to the nearest integer? 3 What is the square root of 63185 to the nearest integer? 251 What is the third root of 11072 to the nearest integer? 22 What is the third root of 2408 to the nearest integer? 13 What is 260 to the power of 1/7, to the nearest integer? 2 What is 382 to the power of 1/2, to the nearest integer? 20 What is the square root of 192658 to the nearest integer? 439 What is 11868 to the power of 1/7, to the nearest integer? 4 What is the fifth root of 820 to the nearest integer? 4 What is 61251 to the power of 1/2, to the nearest integer? 247 What is 170 to the power of 1/2, to the nearest integer? 13 What is the third root of 7968 to the nearest integer? 20 What is the square root of 37485 to the nearest integer? 194 What is the cube root of 78314 to the nearest integer? 43 What is 326 to the power of 1/2, to the nearest integer? 18 What is 44432 to the power of 1/3, to the nearest integer? 35 What is the square root of 6507 to the nearest integer? 81 What is the sixth root of 37337 to the nearest integer? 6 What is 165946 to the power of 1/3, to the nearest integer? 55 What is the third root of 14497 to the nearest integer? 24 What is the seventh root of 13112 to the nearest integer? 4 What is 1006 to the power of 1/7, to the nearest integer? 3 What is 5318 to the power of 1/2, to the nearest integer? 73 What is 705 to the power of 1/6, to the nearest integer? 3 What is 112737 to the power of 1/6, to the nearest integer? 7 What is 34165 to the power of 1/2, to the nearest integer? 185 What is the fourth root of 2231 to the nearest integer? 7 What is 11749 to the power of 1/3, to the nearest integer? 23 What is 5224 to the power of 1/4, to the nearest integer? 9 What is 19307 to the power of 1/5, to the nearest integer? 7 What is 35543 to the power of 1/8, to the nearest integer? 4 What is the square root of 18305 to the nearest integer? 135 What is the sixth root of 92516 to the nearest integer? 7 What is 4430 to the power of 1/2, to the nearest integer? 67 What is the square root of 429 to the nearest integer? 21 What is the fourth root of 6544 to the nearest integer? 9 What is 1434 to the power of 1/3, to the nearest integer? 11 What is the square root of 17544 to the nearest integer? 132 What is the square root of 1007 to the nearest integer? 32 What is 4999 to the power of 1/3, to the nearest integer? 17 What is 9540 to the power of 1/2, to the nearest integer? 98 What is 2470 to the power of 1/2, to the nearest integer? 50 What is 8399 to the power of 1/6, to the nearest integer? 5 What is the cube root of 432 to the nearest integer? 8 What is the fourth root of 12518 to the nearest integer? 11 What is the eighth root of 7732 to the nearest integer? 3 What is the cube root of 951 to the nearest integer? 10 What is 3098 to the power of 1/10, to the nearest integer? 2 What is the third root of 4252 to the nearest integer? 16 What is the sixth root of 126 to the nearest integer? 2 What is 1749 to the power of 1/3, to the nearest integer? 12 What is the fifth root of 154676 to the nearest integer? 11 What is the tenth root of 13624 to the nearest integer? 3 What is the fifth root of 370 to the nearest integer? 3 What is the cube root of 6067 to the nearest integer? 18 What is the third root of 197583 to the nearest integer? 58 What is the third root of 8856 to the nearest integer? 21 What is the square root of 4862 to the nearest integer? 70 What is the square root of 41798 to the nearest integer? 204 What is the fifth root of 1401 to the nearest integer? 4 What is 19217 to the power of 1/2, to the nearest integer? 139 What is th	{ "pile_set_name": "DM Mathematics" }
vveveeevvlvfv. What is prob of picking 1 e and 3 v? 28/143 Two letters picked without replacement from {u: 5, b: 5, l: 5, s: 1}. What is prob of picking 1 u and 1 l? 5/24 Two letters picked without replacement from jhgjgbgihhhhjj. Give prob of picking 1 j and 1 b. 4/91 Three letters picked without replacement from kkhhmkk. Give prob of picking 2 k and 1 m. 6/35 What is prob of picking 1 z and 3 s when four letters picked without replacement from szsssssssssssssssss? 4/19 Calculate prob of picking 1 t, 1 s, and 1 i when three letters picked without replacement from {s: 1, i: 2, r: 1, n: 1, y: 1, t: 1}. 2/35 Calculate prob of picking 1 t and 3 h when four letters picked without replacement from hhathhahahhhhaahhah. 55/969 Four letters picked without replacement from hhhhhhhhh. What is prob of picking 4 h? 1 What is prob of picking 2 o, 1 a, and 1 d when four letters picked without replacement from {o: 2, a: 2, q: 5, i: 7, d: 2}? 1/765 Calculate prob of picking 1 u, 2 i, and 1 a when four letters picked without replacement from {u: 1, a: 1, k: 2, i: 2}. 1/15 Two letters picked without replacement from {f: 2, g: 9, p: 5}. What is prob of picking 1 g and 1 f? 3/20 Two letters picked without replacement from wttwtgtgwwwwtww. What is prob of picking 1 w and 1 g? 16/105 Four letters picked without replacement from oojmaonjnjjmjj. What is prob of picking 2 j and 2 o? 45/1001 Four letters picked without replacement from {t: 1, a: 2, k: 1, w: 2, x: 2}. What is prob of picking 1 t and 3 k? 0 What is prob of picking 3 v when three letters picked without replacement from vvvnvvrmvnbrvv? 2/13 Calculate prob of picking 3 o and 1 p when four letters picked without replacement from ooooopooooooo. 4/13 Three letters picked without replacement from {i: 1, j: 1, k: 2, o: 1}. Give prob of picking 1 o and 2 k. 1/10 What is prob of picking 2 m and 2 s when four letters picked without replacement from sssssssssmmssmssss? 7/68 Two letters picked without replacement from {d: 1, z: 1, y: 2, m: 1, x: 1, u: 1}. Give prob of picking 1 z and 1 u. 1/21 Calculate prob of picking 1 t and 3 a when four letters picked without replacement from fjgtfgigajtaagjt. 3/1820 Calculate prob of picking 4 l when four letters picked without replacement from llllllllxllllllllxll. 12/19 Four letters picked without replacement from crrbi. Give prob of picking 2 r, 1 i, and 1 c. 1/5 Calculate prob of picking 2 w when two letters picked without replacement from {w: 6, u: 13}. 5/57 What is prob of picking 1 g and 1 i when two letters picked without replacement from igq? 1/3 What is prob of picking 1 r, 1 i, and 2 a when four letters picked without replacement from {a: 3, i: 6, r: 4}? 72/715 Calculate prob of picking 1 p and 2 u when three letters picked without replacement from pupuupuuuu. 21/40 Calculate prob of picking 2 z and 2 m when four letters picked without replacement from {z: 2, m: 7}. 1/6 Two letters picked without replacement from ubbnuuuuuu. Give prob of picking 1 u and 1 b. 14/45 Three letters picked without replacement from sfssfsssss. Give prob of picking 3 f. 0 Three letters picked without replacement from giigiggg. Give prob of picking 1 g and 2 i. 15/56 Two letters picked without replacement from {y: 7, z: 1, s: 10, x: 1}. What is prob of picking 1 y and 1 z? 7/171 What is prob of picking 1 m and 2 j when three letters picked without replacement from mjjjjjjj? 3/8 Calculate prob of picking 1 t and 1 w when two letters picked without replacement from {c: 4, o: 4, w: 1, r: 3, t: 2}. 2/91 Four letters picked without replacement from {o: 1, z: 2, y: 7, h: 4, s: 3}. What is prob of picking 3 h and 1 y? 1/85 Four letters picked without replacement from yyyyyyyyyccyyyycccyy. Give prob of picking 1 y and 3 c. 10/323 Four letters picked without replacement from tcbtatbggaatbbgtba. What is prob of picking 2 b, 1 g, and 1 t? 5/102 Three letters picked without replacement from {t: 2, d: 1, p: 1, e: 1, n: 1, k: 1}. What is prob of picking 1 k, 1 t, and 1 p? 2/35 Calculate prob of picking 3 z and 1 u when four letters picked without replacement from uzzuuzuuuzuzzuuzzzuu. 308/1615 What is prob of picking 1 b and 2 m when three letters picked without replacement from mbmafpmmmbmmbmmmmmpa? 33/190 Four letters picked without replacement from {y: 5, l: 3, e: 4}. Give prob of picking 2 l and 2 y. 2/33 What is prob of picking 2 c and 2 x when four letters picked without replacement from {s: 1, c: 3, x: 11, d: 4}? 55/1292 Calculate prob of picking 2 x and 1 s when three letters picked without replacement from {x: 5, s: 2}. 4/7 Two letters picked without replacement from {d: 1, s: 1, k: 2, x: 2, t: 1}. What is prob of picking 1 s and 1 d? 1/21 What is prob of picking 2 d when two letters picked without replacement from {j: 2, d: 4, r: 10}? 1/20 Three letters picked without replacement from {j: 5, n: 7}. What is prob of picking 1 j and 2 n? 21/44 Four letters picked without replacement from {g: 4, q: 6, e: 1, r: 5}. Give prob of picking 1 q and 3 r. 3/91 What is prob of picking 4 k when four letters picked without replacement from {k: 9, j: 4, f: 1}? 18/143 Two letters picked without replacement from {a: 5, t: 2, i: 1, j: 7, c: 1}. What is prob of picking 1 c and 1 i? 1/120 Two letters picked without replacement from ezczcbzcccczecc. Give prob of picking 1 z and 1 e. 8/105 Two letters picked without replacement from auqrarxarvaa. Give prob of picking 1 a and 1 u. 5/66 Three letters picked without replacement from {g: 1, q: 2, j: 3, w: 4, m: 3, t: 4}. What is prob of picking 1 g, 1 w, and 1 q? 1/85 Two letters picked without replacement from {c: 3, t: 5, p: 1, y: 2, e: 5}. What is prob of picking 1 y and 1 c? 1/20 Four letters picked without replacement from {c: 3, k: 2, a: 2, s: 2}. Give prob of picking 3 c and 1 k. 1/63 Three letters picked without replacement from uuuggutuuuuguagugaua. Give prob of picking 1 g, 1 a, and 1 t. 1/76 Three letters picked without replacement from {q: 4, b: 6}. Give prob of picking 3 b. 1/6 What is prob of picking 2 z when two letters picked without replacement from {x: 4, z: 8, s: 5, l: 1}? 28/153 Calculate prob of picking 2 o when two letters picked without replacement from grgojooqojgof. 5/39 Three letters picked without replacement from {n: 1, v: 3, z: 1, l: 1, b: 3, p: 2}. Give prob of picking 1 l, 1 z, and 1 n. 1/165 What is prob of picking 2 a when two letters picked without replacement from rslaabsbbs? 1/45 What is prob of picking 1 i, 1 b, and 1 c when three letters picked without replacement from {c: 3, y: 1, i: 2, b: 1}? 6/35 Four letters picked without replacement from {o: 6, i: 4}. Give prob of picking 4 o. 1/14 What is prob of picking 2 r and 1 e when three letters picked without replacement from rbeugrtrurrutrt? 3/91 Three letters picked without replacement from {h: 2, m: 1, q: 4, t: 1}. What is prob of picking 1 t, 1 h, and 1 q? 1/7 What is prob of picking 1 o and 2 a when three letters picked without replacement from aoooooaoooaaoooooooa? 5/38 Four letters picked without replacement from {z: 7, p: 12}. Give prob of picking 4 p. 165/1292 Calculate prob of picking 1 c and 1 g when two letters picked without replacement from ccrrrrccrhrycgryhr. 5/153 Four letters picked without replacement from uruuuur. What is prob of picking 2 u and 2 r? 2/7 Two letters picked without replacement from llululu. What is prob of picking 2 u? 1/7 Calculate prob of picking 2 t when two letters picked without replacement from {t: 3, p: 5}. 3/28 Calculate prob of picking 3 n when three letters picked without replacement from nnannenaa. 5/42 Calculate prob of picking 3 j when three letters picked without replacement from {j: 8, u: 4, v: 2}. 2/13 Two letters picked without replacement from {h: 10, k: 3, w: 2}. Give prob of picking 2 w. 1/105 Two letters picked without replacement from xnxxoxxeooooxxggxo. What is prob of picking 1 e and 1 n? 1/153 Calculate prob of picking 1 u, 2 g, and 1 p when four letters picked without replacement from {g: 3, z: 4, p: 3, u: 1}. 3/110 What is prob of picking 2 m and 2 i when four letters picked without replacement from iiimimimmiiiimiiimm? 231/646 Calculate prob of picking 2 g and 1 f when three letters picked without replacement from {g: 4,	{ "pile_set_name": "DM Mathematics" }
mposite? False Let i = 243 - -88. Is i a prime number? True Let y be ((-18)/10)/((-6)/30). Suppose 0 = yu - 7u - 284. Is u a composite number? True Let i be 222/24 + (-2)/8. Let a be (2 + (-2)/(-3))9. Is (-1)/(-3) + a/i prime? True Let i be 1/(-4)(-1 + -19). Suppose -5c + 520 = iv, -5v + c + 560 = -2c. Is v composite? False Let d(s) = -3s. Let k be d(0). Is (-24)/12 + (k - -55) a prime number? True Let q(c) = -942c3 + c2. Is q(-1) a composite number? True Let k = -299 + 444. Is k composite? True Let l(d) = 6 - 3d - 6 + 2d + 310d2. Let a be l(-1). Suppose 197 = 4y - a. Is y a prime number? True Suppose 0 = -2x + x + h + 451, -4h = 5x - 2246. Suppose 2d - 5r - x = 0, -5r - 515 = -3d + 170. Is d a composite number? True Suppose 4s - 2r + 4 = s, 5s - 30 = -4r. Suppose -5j + 120 = 2o, 0 = j - so - 2o - 2. Is j composite? True Let u be 3594/15 - (-2)/5. Let a = 613 - u. Is a a prime number? True Suppose -4x + 17 - 5 = 0. Let o = x + -1. Suppose 225 = os + 3v, v = -s - 0v + 112. Is s prime? False Let h be (-5307)/(-9) + (-2)/(-6). Let j = 849 - h. Is j a composite number? True Suppose 5389 = 4q - 5s + 2s, -3q - 4s = -4023. Is q prime? False Let c = 6874 + -4403. Is c prime? False Suppose -5t + 5n = -1305, 518 = 2t + 4n - 2n. Suppose 0 = m + 2r - 3r - 129, 2m - 3r - t = 0. Is m prime? True Suppose 0c = 2c + 18. Let a = c - -7. Is (127-1)/(2/a) composite? False Let z be 0/(-2) + -2 + 340. Suppose 3t - z = 169. Suppose 116 = 2g - o, 3g + 0o = 4o + t. Is g a prime number? True Suppose 4p - 11 = 3x + 2x, p + 16 = -5x. Let w(u) = u2. Let q(g) = -11g + 9. Let s(b) = pw(b) + q(b). Is s(-8) a composite number? True Let a(y) = -y3 - 7y*2 - 9y + 6. Is a(-7) a prime number? False Suppose 0 = -13b + 8b + 385. Is b a prime number? False Suppose 0 = 13k - 15k. Suppose 5w + kw - 815 = 0. Is w composite? False Let a(c) = -c*2 + 5c + 2. Let o be a(5). Let q(r) be the second derivative of 3r4 + r3/3 - 3r*2/2 + 22r. Is q(o) prime? False Is 3787/14(-2)/(-1) a composite number? False Let j be 6/(-8) - (-3)/(-12). Let s be j + -2 + (82 - 3). Is s + 6 + (1 - 4) a prime number? True Let f be (-2)/(-8) - (-22)/8. Suppose y + 156 = 4y + fb, -2b - 43 = -y. Is y composite? True Let j(w) = 3w - 1 - w + 3w - 2. Let k be j(4). Is (k - 1) + 2 + 1 composite? False Is (2174/(-3))/(8/(-12)) composite? False Suppose v = 4c + 251, 2v - 3c - 251 = v. Is v a prime number? True Suppose 2p = p + 126. Suppose 5r = -31 + p. Is r a prime number? True Let w(v) = -v2 + 13v + 1. Is w(6) prime? True Let r(h) = -197h - 14. Is r(-11) prime? True Suppose -4z - 179 = 3y, -4z + 10 = -9z. Is 3 - (2 + 3) - y composite? True Is (-10804)/(-12) - (-2)/3 a prime number? False Is 0(-2)/(-8) + 14 prime? False Let i(v) = 2v + 5 + v3 + 2v - 2v + 1 + 10v*2. Suppose 6o - 3o - 4r + 7 = 0, -5o + 3r = 30. Is i(o) prime? False Suppose 0 = -3h + 9 + 6. Suppose 5o - 2619 = 2f - 591, 5f = 5o - 2025. Suppose -hj + 3j = -o. Is j composite? True Let j be (-7 - -2)(-2)/5. Suppose jt - 5 = 1. Is t a composite number? False Suppose 5 = -q + 2. Let y(j) = -4j*3 - 3j*2 - 2. Is y(q) a composite number? False Let i = -12 - -17. Suppose 0 = ig - 0g - 25. Suppose q = c - q - 9, gc = -5q + 75. Is c composite? False Let h(f) = 6f*2 + 8f - 9. Let g be h(6). Suppose -1223 = -4w + 5m, w - 3m - g = 49. Is w a prime number? True Let o = 16 - 10. Let i(j) = -j2 + 5j + 5. Let y be i(o). Is (-230)/(y - -3)-1 composite? True Let u(i) = 2i + 1. Let r be u(1). Suppose 6y - 28 = 2y + 4n, 4n = -12. Suppose -yf + 10 = -rf. Is f a composite number? True Suppose 2p + 5817 = 9p. Is p prime? False Suppose -b + 5x = 79 + 9, x + 1 = 0. Let n = -60 - b. Is n prime? False Let s = -70 + 107. Suppose -z + 92 = -s. Is z a prime number? False Suppose 10 = -w + 79. Suppose 52 = l - w. Is l prime? False Suppose -p + 767 = -0g + 4g, -5g = 3p - 964. Is g a prime number? True Let a(d) = 3d + 9. Let h be a(-5). Is (316/h)/(18/(-27)) a composite number? False Let y(v) = 293v - 2. Is y(11) a composite number? False Let n(m) = m3 + m2 + 56. Let l be n(0). Suppose -l = -6x + 4x. Suppose 0u = -2u + x. Is u prime? False Suppose -5w = 5s - 20, -3w + 15 = w + 3s. Suppose q - 10 = wq. Let b = q - -11. Is b composite? True Let v(b) = 2b - 28. Let d be v(16). Let m(u) = 2u*2 - 5u + 2. Let n be m(3). Suppose 81 - 264 = -np - z, 0 = p - dz - 45. Is p a composite number? False Let y(c) = c*3 - 3c - 3. Is y(3) a prime number? False Let d = 85 - 0. Is d a composite number? True Suppose 5q + 28 = 713. Suppose a = x + 6a - 117, -x + q = -5a. Is x a prime number? True Let t(y) = -y2 + 317. Let s(u) = u + 11. Let q be s(-11). Is t(q) a prime number? True Suppose -4w - 50 = -2h, -5h + 60 = 5w - 2w. Suppose -4d = -325 - h. Is d a composite number? True Let s = -7 + 4. Let j be (-3 - s)/(-1) + 123. Let o = j - 56. Is o composite? False Suppose -2o + 2 = 44. Suppose 0 = 4k - 3k + 5, f - 27 = 5k. Is (f + o)/(1/(-2)) composite? True Let h be (0/(-1))/((-6)/(-6)). Is -2 - (h - (-270)/(-2)) a prime number? False Let r = 121 - -66. Is r a prime number? False Let r(c) = 7c*2 - c + c + 0c - c - c*3 + 1. Is r(6) a prime number? True Suppose 3c = -4y + 8, -4c = -c + 3y - 9. Let k(h) be the third derivative of 7h*4/24 - 5h*3/6 - 2h2. Is k(c) a composite number? False Let i(f) = f3 - f + 53. Let y(o) = o*3 + 5 - 1 - 5. Let n be y(1). Is i(n) a prime number? True Let x = 7 + -3. Suppose -53 = xm - 193. Is m a composite number? True Suppose 0 = -j - 3l + 172 + 204, -4j + 1494 = 2l. Is j prime? True Let d(u) = -56u + 10. Is d(-6) a composite number? True Let z = 85 - -58. Is z prime? False Suppose 5h - 3k = 1888, 0 = 5h - 0h - k - 1886. Is h composite? True Suppose 100 = -2m + 3m. Suppose 3o - o = m. Suppose -4g = -6 - o. Is g a composite number? True Let i = -8 + 12. Let c = i - 1. Is c/(-12) - 231/(-12) composite? False Let d be (-2)/2 + 382 + 5. Is d/26 + (-2)/(-13) prime? False Let n = 16 - -279. Let g = -186 + n. Is g a composite number? False Suppose -j + 8 = 3j. Is j/(-2)(-14 - 23) a prime number? True Suppose -9 = -4x + 3. Suppose 3 = 2k - 11. Is ((-44)/(-2) - x)k prime? False Suppose 5473 = 3k - 3i + 4i, -i + 9119 = 5k. Is k prime? True Suppose -2j + 11 = 1. Suppose 2u + 23 = -3d, 5u = 2d + d - j. Is (-46)/u - 1/2 a prime number? True Let i = 27 - 42. Let g = -5 - i. Is g a composite number? True Let z(q) = 2q3 + 5q*2 + 5q + 4. Suppose -3c + 2 - 11 = 0. Let n be z(c). Let x = 39 + n. Is x prime? True Let v = 241 + -459. Let p = 403 + v. Is p prime? False Is (-3 + 194)(1 + 0) composite? False Let h(j) = -j + 18. Let p be h(0). Let r be (-142)/9 - 4/p. Is 36/16r/(-6) a composite number? True Let p(c) = -213c*3 - 2c*2 - 2c - 1. Let s be p(-1). Suppose -s = -7n + 243. Is n a prime number? False Let a(b) = -7b - 7. Let h(r) = 20r + 22. Let o(g) = 17a(g) + 6h(g). Let f be o(-7). Is 4/6 + 38/f prime? True Let k = 1331 - 258. Is k composite? True Is (-34368)/(-42) - 2/7 a prime number? False Suppose -6 = -y + 137. Is y composite? True Is ((-6)/9)/((-10)/11265) composite? False Let t = 520 + -213. Is t a prime number? True Let p = 11 + -9. Is p9/(-6) - -121 composite? True Suppose -7m = -2m. Suppose m = -2u + 32 + 198. Is u composite? True Let v(g) = 10g*2 + 3g + 2. Let u be v(-4). Suppose -193 = -5r - 4k, r + k = -3r + u. Is r a prime number? True Suppose -3i + 5m + 1059 = 0, 3i - 4m = -m + 1059. Is i a prime number? True Suppose -a = 4a. Suppose -2u = -au - 14. Let x(l) = l*2 - 3l + 6. Is x(u) prime? False Let q = 1008 - 500. Suppose 0 = -h + 5h - q. Is h prime? True Let l be (-2)/6 + (-57)/(-9). Suppose -2c + l = 2. Suppose 0 = -5v - cz + 147, -v - z + 27 = -0v. Is v a prime number? True Is 41 - (-3 - 1960) composite? True Suppose 0v = -4v + 1068. Is v a prime number? False Let n be ((-273)/(-6))/(-7)-18. Suppose -2s + 65 = -n. Is s composite? True Is ((-3941)/(-5) - -1)(-20)/(-8) a prime number? True Let c = -29 - -21. Is 3 - c(1 + 1) a prime number? True Let g = -4 + 28. Let r = 33 - 4. Let f = r + g. Is	{ "pile_set_name": "DM Mathematics" }
99 = 0, 2x = -5p + 593. Suppose 8c = -33 - p. Are -61/3 and c equal? False Suppose -45z + 11192 + 12433 = 0. Let k be 630/z + (-1)/5. Which is smaller: -2 or k? -2 Suppose -14d - 110 = -614. Suppose -3x = 4y + 8, -7y = -5x - 8y - d. Is -1/6 greater than or equal to x? True Let d = 2981/1704 - 43/24. Let b = d - 1159/1136. Which is smaller: b or -1? b Let c = -5 + -3. Let d(t) be the third derivative of -t*4/12 - 13t*3/6 + 14t*2. Let g be d(c). Which is smaller: g or 0.4? 0.4 Let d be (3 + 18/(-4))((-206880)/(-18))/5. Which is bigger: -3449 or d? d Suppose -15q - c - 230 = -10q, q + 46 = -3c. Let u = 0 - 0. Which is bigger: q or u? u Let y(j) = -j3 + 54j*2 - 51j - 17. Let t be y(53). Does 70 = t? False Let j = -53 - -42. Let t = -9 - j. Let l be 3/29(10/6 - t). Are 1 and l nonequal? True Let m(d) be the second derivative of -d3/6 + 183d*2/2 + 118d - 2. Let i be m(0). Is 183 at most i? True Let c = 12214 - 7530. Is c at most -1? False Suppose -3s - 1 = -4. Let p be -1 + (6 - s) + -3. Let g be (66/(-5940))/((-14)/(-10) + -1). Which is smaller: g or p? g Let t = 2332 + -2326. Let x = -170 + 159.07. Let b = x + 11. Is b <= t? True Let n be ((-1825)/(-10))/((-2)/(-4)). Let y = 326 - n. Which is smaller: -38 or y? y Let h(v) = -116v - 2319. Let f be h(-20). Let l = -2619307/319 - -8211. Which is smaller: f or l? l Suppose 47 = 2r + n + 2n, 4n - 73 = -3r. Suppose -rp - 46 - 16 = 0. Let m be (-6)/(-21) - (-20)/28. Which is bigger: p or m? m Suppose g + 3g - 3 = 5w, 0 = -2g - 3w + 7. Suppose -2x - 4 = gh + 2x, -3h = 3x - 9. Which is smaller: 29/4 or h? 29/4 Suppose 2p + 6 = 12. Suppose -v = 3v + pr - 39, 3v = -3r + 27. Let w be 1 - 5/(30/v). Which is greater: 4/23 or w? 4/23 Suppose 2p + 6p - 1056 = 0. Suppose c = p - 143. Is -93/8 >= c? False Let r(q) = 3q*3 + 21q*2 - q - 16. Let c be r(-11). Is c equal to -1457? True Let d = 8.08 - -0.02. Let w = 9 - d. Let q = w + 8.1. Is 3 less than q? True Suppose -15 = 6p - 4p + 3k, -k - 5 = -2p. Suppose -17w + 22w = 60. Let m be (-6)/2 - 54/w. Are p and m equal? False Suppose 26n - 21n - 100 = 0. Let h be 4/707(0 + n). Let c = 7 + 2. Which is bigger: h or c? c Let j be 9 + 1225/(-625) - (-3)/((-9)/21). Let c(g) = -g2 - 8g - 8. Let v be c(-7). Which is smaller: j or v? v Let h be (138/(-667))/((1/(-2))/1). Suppose -5k - 41 - 44 = 0. Let y = k - -18. Does h = y? False Suppose -3a = -23 - 4. Let v be (-3 - a)6/(-2). Suppose -4z - v = -8z. Is 9 at most z? True Suppose 2k + 19478 = -4r, 12k = 2r + 16k + 9724. Are r and -4870 unequal? True Let h be 3 - 193/(-225) - 4. Let t = h + -2/25. Are -32 and t non-equal? True Suppose -45v + 19v + 13v = 0. Is 0.3353 greater than or equal to v? True Suppose -3p = -z - 6, 3z + 54p - 24 = 49p. Let l be (-38)/(-14) - 4/(-14). Suppose -ld - z = -0. Which is smaller: d or -0.18? d Let p be (-1026)/(-1869) - (-440)/(-770). Suppose -3 = -7o - 10. Which is greater: o or p? p Let u be (18/36)/((-1)/(-2)). Let g be u/(-24/48). Which is smaller: g or -54/11? g Let y = 6.26 - 289.26. Let c = y - -275. Let n = -0.2 - -0.3. Is n != c? True Let v(p) = -p*3 - 8p*2 + 32p - 17. Let k be v(-11). Let w be (-39)/(-52)-8 - (k - -1). Let q = -1/934 + -11183/23350. Which is smaller: w or q? w Suppose 3m = 4m + 30. Let y be (0 - -1)(-2922)/(-2 - 4). Let l = y + -517. Is m less than l? False Let v = -2338/27945 + -4/1215. Let x(d) = -d + 5. Let n be x(4). Which is smaller: v or n? v Suppose -y + 2h + 40 = 0, -3y - 9 + 119 = -4h. Let l = y - 28. Suppose 2g = 3g - l. Which is greater: g or 3? 3 Let u = 0.3 - 0. Let z = 0.844 - 24.644. Let n = 23 + z. Is u equal to n? False Let v(l) = 41l - 5. Let o be v(1). Let w be ((-27)/o)/(3/(-8)). Suppose 70 + w = 3a. Which is smaller: 25 or a? a Suppose 35a = 30a. Suppose 2w = -4u - 6 + 50, u - 4w - 20 = a. Let p(k) = k*2 - 13k + 13. Let g be p(u). Are g and -2/99 equal? False Let l(u) = -u*3 + 9u*2 + 26u - 161. Let a be l(10). Is a <= -26/271? True Let u be (-26904)/13453 + 5 + (-39)/13. Which is smaller: u or 0? 0 Suppose -60 - 67 = -d + 3l, 15 = -3l. Let z be (-32)/d - (-312)/14. Which is greater: z or 19? z Let m(y) = y*2 - 2. Let l be 1 + 1(-3)/3. Let c be m(l). Let i be -21(-3)/724. Which is smaller: c or i? c Suppose 3l = -3b + 24 - 21, 2b - 2l - 10 = 0. Suppose 2n + v + b = 0, 0n + n - 4 = 5v. Which is smaller: n or -1/95? n Let q = 13289 - 5244. Which is bigger: 8044 or q? q Suppose -182w - 2568 = -206w. Which is smaller: w or 105? 105 Let w(v) be the second derivative of v3/6 - 5v*2 - 4v. Suppose 5d = -59 + 104. Let y be w(d). Which is bigger: y or -4? y Let t be 34/(-16) + 14/112. Is t less than -52/51? True Let c = 1646 - 1647.0012. Is c greater than or equal to -1? False Let d = 10/159 + 89/1113. Let p = -10 + 6. Which is bigger: p or d? d Let m = 132971/780 - 37/260. Is m less than or equal to 170? False Let n(s) = -174s3 + s2 - 32s - 62. Let t be n(-2). Is 1397 less than or equal to t? True Let o = 94/5 - 7486/395. Suppose v - 1 = s, 3s + 1 = -2. Are o and v non-equal? True Suppose 0 = 2d + 2r + 144, -5d - 64 - 281 = 2r. Is d bigger than -28? False Let j = -5.379 - -3.379. Is j greater than or equal to 5067? False Let x = -6336 + 5206. Which is smaller: -1129 or x? x Let d = 372 + -439.3. Let j = 3.3 + d. Let p = j - -63. Which is greater: -9 or p? p Let z be 1/12 - 7497/(-756). Suppose 0 = 5x - z + 5. Is x less than -1/206? False Let x be (6/(-4))/(16/((-226336)/33)). Let m = x + -12215/19. Which is smaller: m or -12? -12 Suppose -y + 818 = 141x - 144x, -y = -5x - 812. Is y at most as big as 828? True Let y(b) = b*2 + 4b + 3. Let z be y(-2). Suppose -369q - 10 = -374q. Let d be ((-20)/490)/(q2/(-6)). Is d at most z? False Let o(m) = -m3 + 72m*2 - 64m - 501. Let v be o(71). Which is greater: 510 or v? 510 Let z = -25309/5 - -5064. Is 2 > z? False Let k(b) be the second derivative of -101b3/6 - 15b*2/2 - 143b + 1. Let u be k(3). Is u at most as big as -319? False Suppose 5y - 3n = -1587, 11y - 16y = -2n + 1583. Let f = y + 276. Which is smaller: -38 or f? f Let k = 283 - 515. Let s = 234 + k. Let o = 0.025 - 0.235. Which is smaller: o or s? o Let n(a) = a3 + 3a*2 + 2a + 10. Let r(x) = -x*3 - 10x*2 - 10x - 9. Let z = -36 + 27. Let u be r(z). Let b be n(u). Which is bigger: 31/3 or b? 31/3 Let i(t) = 5t2 - 10t + 37. Let y be i(-20). Let u = 42490/19 - y. Do u and -2 have the same value? False Let j(l) = -49l3 - l2 + 1. Let u be j(-1). Let x = -23 + u. Let q be (-222)/(-8) - 0 - 236/(-944). Does q = x? False Let d(g) = g3 - 17g*2 + 2g - 27. Let q be d(17). Let b be ((-6)/q)/((-4)/48). Is b != 11? True Let s = -2.1116 - -0.1116. Let d = -18.7 - -18.25. Which is smaller: s or d? s Suppose 0 = -16u - 23u + 78. Suppose ux + 115 = 181. Is 32 at least as big as x? False Suppose -22 = -3t - 16. Suppose y + 32 = 2c + ty, -c + 16 = -3y. Is 8 not equal to c? True Suppose -5i - 154 = -2s, -3s + 5i = -97 - 134. Let t be (186/217)/(-24/(-168)). Let a be t/70 - (-11)/s. Is -29 less than or equal to a? True Let i(p) be the second derivative of -p*3 - 19p*2 + 6p. Let w be i(-18). Let f = -72 + w. Which is greater: 2 or f? 2 Let k = 6.0819 + -57.9479. Let c = k + -0.134. Let h = c - -57. Which is smaller: h or 0? 0 Let j = -91 + -6. Let a = 118 + j. Is 21 at least a? True Let c = -5168 + 25838/5. Is c less than or equal to -70? False Let f = -324 - -324. Let h be (-42)/9(-27)/6. Let k be ((-6)/52)/(h/(-112)). Which is smaller: k or f? f Let o = -5275/2 + 2795. Let q = o + -126. Which is smaller: q or 32? q Suppose 156u = 158u - 8. Let h be (2 + 4)/((-14)/u + 5). Which is smaller: h or -39? -39 Let d = 235 + -234. Let n be ((-1476)/(-24))/(d/(-2)). Which is greater: n or -122? -122 Let n = -4201 - -37895/9. Let a = n + -31/18. Is a greater than 7? True Let p be 32/368 + 16036/6555. Does 4 = p? False Suppose 3o = 15*o + 1440. Let x be 7725/(-65) - (-8)/(-52). Is x <= o? False Let r = -0.053321 + 0.143321. Let y = -0.18 + -1.62. Let t = 1.87 + y. Is r less than t? False Let o = 167 - -104. Let q = o + -271.052. Let k = 0.3 - 0.2. Which is smaller: k or q? q Let	{ "pile_set_name": "DM Mathematics" }
+ 10 = g for l. 5 Suppose -130 = 29c - 42c. Let f(i) = 12i + 53. Let k be f(-4). Solve -km - c = -0 for m. -2 Let v(u) = -8u + 75. Let z be v(6). Let s be (3(-3)/z)/(7/(-147)). Solve a = -sa for a. 0 Let u(t) = -69 - 36 + 23t - 68. Let b be u(8). Solve -4s - 3 + b = 0 for s. 2 Let n(o) = -o2 - 6o - 2. Let p be n(-5). Let q be (-31/(-5))/(73/1460) + 270 + -271. Solve 0 = pt + q - 5 for t. -2 Suppose -26v + 327 - 65 = -414. Solve -3u + 115 = -vu for u. -5 Let i be 1/4 - (-30)/8. Let s be 25/3018 - 12. Solve -iy + s = 23 for y. -5 Suppose 8h = 12h - 12. Suppose 0 = g - b - 6, 1 = -hg - 2b - 1. Suppose -5w - 2q + 15 = 0, w + 3 = 2w + 2q. Solve -wf = -4f + g for f. 2 Let b(c) = -1534c - 7559. Let j be b(-5). Solve -662 - 337 = -jk for k. 9 Let x be 1/(-2) - 11/(-22). Suppose 4o = 12, g - o + x = 3. Suppose -l = gl - 84. Solve l = v + 2v for v. 4 Let h(f) = f*3 - 12f*2 + 20f + 10. Let w be h(9). Suppose -135 = -2j - 21. Let q = w + j. Solve 2n - 6 = qn for n. -3 Suppose -13w + 267 = 926 - 3454. Solve wu + 40 = 223u for u. 5 Suppose -2y = 5z - 372, -3z = -7y + 6y - 221. Solve 29 = 15i + z for i. -3 Suppose -11 = -10f + 19. Let x = 24 - 24. Suppose 2c = -u + 2u + 2, -2u - 2c = -14. Solve -fp + p + u = x for p. 2 Let f = 5 - 1. Let x(o) = o3 - o2 + 156o - 156. Let i be x(1). Solve i = -r - f + 8 for r. 4 Let v(k) = -2k*2 + 53k + 422. Let x be v(-6). Solve x = 4l + 32 for l. 0 Suppose -3b + o - 13 = -3, -3o + 3 = 0. Let u be 3 + -1 + (-3)/b. Suppose 5t = 4t + u. Solve -n - t = -4 for n. 1 Suppose 71f - 13f - 21f = 33337. Solve q = f - 892 for q. 9 Suppose 0 = -3j - 13j + 224. Solve -jo + 15o = 0 for o. 0 Let d(x) = -x*3 + 6x*2 - 4x - 5. Let r be d(5). Let f = 86 - 82. Solve rv - fv = -16 for v. 4 Let a(q) = 4q2 + 19q - 22. Let s be a(-6). Suppose -4g - s = -5m, g = 4m - 4g - 1. Solve 1 = -3y + my for y. 1 Let m be 3(-327)/155/(-3). Solve mi - 112i = -9 for i. 3 Suppose -z = -2n + 13, -14n + 10n = -16. Let d(w) = -w3 - 4w*2 + 6w + 8. Let b be d(z). Solve -4x - 5 = -bx for x. -5 Let x(h) = h*2 - 85h + 1130. Let f be x(69). Solve 40l = 174 + f for l. 5 Suppose c = -11 + 5. Let y be 4(-6)/(-56) - 908/28. Let g be c/18 + (y/(-6) - -1). Solve -gi + i = 20 for i. -4 Let b = 118184 + -118167. Let z be 10 + (2 - 6/2). Solve 19 = -zn - b for n. -4 Let m(f) = -20f2 - 44f. Let j(y) = -15y + 6y2 - y2 - 12y2. Let c(n) = 17j(n) - 6m(n). Let k be c(-10). Solve q - k = -4q for q. 2 Suppose 0 = 232o - 237o + 10. Suppose 0 = -i + 6 + 3. Suppose i = -2h + 17. Solve 0 = -od + 2 - h for d. -1 Let r = 16595 - 16177. Solve 423u - 5 = ru for u. 1 Let b(z) = 51z + 223. Let t be b(-3). Suppose t = 231x - 217x. Solve 0 = xf - 10f for f. 0 Let i be 37/((-168)/(-64)). Suppose -27y + 76 = -iy. Solve 13 = -yb + 17 for b. 1 Let o be 43 + -13 - (-2 - -9). Solve -o + 5 = -18q for q. 1 Suppose 2n + 0j = j + 6, -5j = 0. Suppose -2b + m = 6m + 12, -b - 8 = 3m. Solve -o = -no + b for o. 2 Suppose -5k + 5w + 1600 = 130, -4w + 299 = k. Solve k = -3a + 295 for a. 0 Let o(j) = 2j*3 - 9j*2 + 2j - 8. Let d be o(5). Solve -7s = -16s + d for s. 3 Let z(c) = 5c + 56. Let d be z(-8). Suppose 2i = di - 14. Solve 2h + 3 = -i for h. -2 Suppose 0 = -7h - 2494 + 2522. Let k(m) = m + 10. Suppose 5r - 10 = -50. Let n be k(r). Solve -2 - n = hf for f. -1 Let c be (15 + 1)(-4)/(-8). Let x(l) = -l*2 + 8l - 10. Let q be x(c). Let m be (-2)/(((-25)/q)/(-5)). Solve 2 = md - 2d for d. 1 Let g be 19 - -20 - -6(-6)/4. Solve 14u = gu + 32 for u. -2 Suppose -6n = -2n - f - 32, n - 8 = 3f. Suppose -3z + 23 = 2r, -7z + 5r - 25 = -nz. Solve zp + 4 = 14 for p. 2 Let m = -7243 - -7254. Solve -mu = 15 + 51 for u. -6 Suppose 4q = 4, -6 = 21j - 22j - 4q. Suppose -2s - 2w + 2 = -4, 2s - w = 18. Suppose b = 4m + s + 15, -4b + 40 = -4m. Solve -jd - b = -0d for d. -3 Suppose 2 = l + 2m - 1, -l + 5m = -3. Suppose 28o - 7o = -lo. Solve o = 3q - q + 6 for q. -3 Let v(w) = -13w - 32. Let k(h) = 23h + 63. Let q(a) = -6k(a) - 11v(a). Let j be q(6). Solve 8n - jn = 12 for n. 3 Let o be ((-29)/(-2))/((-2205)/738 + 3). Solve -5t = -1209 + o for t. 4 Let h(j) be the first derivative of 1/2j2 + 5 - 11j. Let l be h(15). Solve li = 5i + 1 for i. -1 Let m be (4 - (-3 - -8))-3. Solve -mh - 44 = -14h for h. 4 Let n(u) = -6u*2 + 50u - 56. Let b be n(7). Solve -33p - 40p = b for p. 0 Suppose -5p = -10, 4n = -n + 3p + 24. Let j = 20 + -23. Let u be j - 316/(-6). Solve -nl + l = u for l. -1 Let l(a) = 5a*2 + 26a - 31. Let b be l(-13). Let q = b - 474. Solve 25 = -3m - qm for m. -5 Suppose 0 = 24z - 43z + 4f - 16, 5z = -f + 4. Solve z = -5575c + 5576c + 6 for c. -6 Let z be 413 + (5 - 70/7). Let w be (-6)/51 + 48/z. Let l = 1 + -1. Solve -5q + wq = l for q. 0 Let d(c) = 5c - 5. Let x(y) = -5y + 3. Let s(j) = 8d(j) + 9x(j). Let p(t) = t*2 - 8t - 3. Let a be p(8). Let v be s(a). Solve -3z = -2z - v for z. 2 Let p be -1((-1)/8 - (-161)/(-56)). Suppose 8c = -pc + 132. Solve -16 = cs - 16s for s. 4 Suppose -9k + 8 - 8 = 0. Let b(t) = -t + 11. Let d be b(6). Suppose -3p = -4x - 2, dx - 1 = 4. Solve 0 = -pz - kz + 8 for z. 4 Let t(b) = 18b + 271. Let d be t(26). Suppose -d + 109 = -21x. Solve x - 6 = -6a for a. -4 Suppose -1155 + 225 = -31l. Solve 3b = 12 - l for b. -6 Let l = -14340 - -14727. Solve -l = 24p - 243 for p. -6 Suppose -2v - 14 = -2c, -1600c - 5v = -1601c + 35. Solve -25t - 163 + 238 = c for t. 3 Suppose 4m = 2z - 28, -12z + 13z + 5m + 21 = 0. Suppose -zb + 12 = -b. Solve 0p = bp for p. 0 Let v = 22741 + -22253. Solve 0 = -2i - 506 + v for i. -9 Let s(i) = -7i3 - 22i*2 + 28i - 64. Let p(l) = l3 - l2 + 1. Let n(u) = -6p(u) - s(u). Let m be n(-29). Solve 1 = -mr + 28r for r. -1 Let b(h) = h3 - 3h*2 - 9h - 1. Suppose -14 = 4m - 34. Let s be b(m). Suppose 4p = 6p. Solve pc - s = -c for c. 4 Let d(y) be the third derivative of -y5/30 + y4/6 - y3/3 - y2. Let o be d(2). Let c = 0 - o. Solve -c = -u - 0 for u. 2 Let y(n) = 11n2 + 350n - 64. Let u be y(-32). Let c = 0 - -3. Solve -cw = -uw + 15 for w. -5 Suppose 2t - 39 + 3 = 0. Suppose a + 5q + t = q, -3q - 21 = -3a. Suppose 4m - 3 + 0 = u, 0 = -5u + 3m + a. Solve -u = -4f + 3f for f. 1 Suppose 0 = 2d - r - 10, -2r - 3 = -d - r. Suppose -2o + 85 = -5k - do, -29 = 2k + o. Let g = k - -12. Solve g = p - 4 for p. 4 Let n be (33/3)/((-3 + 1)/(-6)). Suppose 3k + 7 = -2x + x, -5k = -x + n. Suppose xp - 6 - 18 = 0. Solve -5b - 4 = -pb for b. -2 Suppose 70c - 4 = 4b + 66c, 3c = -b + 35. Suppose -3a + 3z + 9 = 0, 3a = -z - 4z + 17. Solve -b = -2j + aj for j. -4 Let i(y) be the third derivative of y4/24 - y2. Let f be i(2). Suppose 473c - 134c - 905 = -227. Solve f = -2w - c for w. -2 Let j = -3 + 8. Let k = 545 - 542. Suppose 0 = -3c + ku - 3, -c - 3c + ju = 8. Solve -2m = -3m - c for m. -3 Let m(n) = 2n + 1. Let a be m(2). Suppose -aj + 49 = 29. Suppose jb + 20 = 9b. Solve 4h = -0h - b for h. -1 Let b be (32/20)/4 + (-8)/(-5). Suppose -5o - 15 = -bo. Let i be ((40/(-14))/o)/((-4)/(-14)). Solve -iv + 16 = 2v for v. 4 Suppose 15j - 43 = -4y + 10j, 2y + 2j = 18. Solve -425 = -ym - 441 for m. -8 Let o(c) = -c*3 - 20c*2 - 71c - 10. Let q be o(-11). Let i = q - -326. Solve 5b - b + i = 0 for b. -2 Let n be 13 - (6 + 6)-1. Let m = 15 - n. Suppose -3v + 2x + 18 = -m, -3v - 3 = 5x. Solve -vf + 1 + 7 = 0 for f. 2 Let s = -221 - -118. Let r = -81 - s. Suppose w - r = -22. Solve w = x + x for x. 0 Let d = -10984 - -11021. Solve -13i - di = 300 for i. -6 Let q(m) = 2m3 - 21m*2 + 13m - 7. Let d be q(10). Solve dl - 51 = 18 for l. 3 Suppose 0 = -j - n + 95, -364 = -1439j + 1435j - 2n. Solve -70v = 403 + j for v. -7 Suppose 0 = 3s - 21, 0 = 5j + 6s + 127 - 214. Solve -jx = 23 + 4 for x. -3 Suppose 4g = 16 + 40. Let l = -29 + g. Let v be l/(-120) - 39/(-8). Solve -d - v = -1 for d. -4 Suppose -85m = 304 - 899. Let o(n) = n3 + 21n*2 + 21n + 25. Let u be o(-20). Solve u = -4b - m for b. -3 Let o(i) = 1219i + 8813.	{ "pile_set_name": "DM Mathematics" }
-2 for i. -5 Let q(f) = 32f3 + f2. Let c be q(1). Suppose 3m - 44 = o + o, -c = -2m + 5o. Solve -t - 5 = -2j, -2t - m = -5j - t for j. 3 Let p(z) = -18z - 11. Let y be p(-1). Suppose -13s + 3m = -14s - 1, -3m - y = -2s. Solve -3h + sf + 8 = 0, 0 = 2h - 0h - f - 4 for h. 0 Let a(p) = 17p + 612. Let k be a(-36). Solve 5o + 3y + 29 = k, 2y - 6 = -0o + 3o for o. -4 Suppose -2i - 5j - 29 + 7 = 0, 3i + 4j = -47. Let g = i + 35. Let p be (-297)/(-108) - (-1)/4. Solve 5s + 33 = -2w, -ps - 5 = w + g for s. -5 Suppose 4z + 8 = -2a, 2a - 4 = -3a - 4z. Solve 2f - 16 = 2m, am + 0f + 3f + 11 = 0 for m. -5 Let m = -58 + 34. Let v = -19 - m. Suppose -vu + 16 = -3u. Solve -u = 4l, 20 = -h + 3h - 5l for h. 5 Let j = 15 + -11. Suppose 37c = 303 + 437. Solve -4i - c = ja, -a + 4 = -4i + 3a for i. -3 Suppose 10n - 102 = 7n - w, 5n + 4w = 170. Suppose -81p + n = -79p. Solve -2h - h + p = -4i, 11 = -h - 2i for h. -1 Let b(f) = -f2 - 9f - 5. Let i be b(-9). Let k = i + 8. Suppose ka - 10 = -2a. Solve -4w + 3o = -0w + 5, -w - 5 = -ao for w. 1 Suppose 8h - 209 = 199. Solve o + 5w - 28 = 0, -4w - 16 = 5o - h for o. 3 Suppose 224 = -2s + 9s. Suppose 0a = -z + a + s, 4z = a + 143. Suppose 127 - z = 3t. Solve 4u + 28 = -2y, -y - t = 4y + 2u for y. -4 Suppose 55k - 52k + 123 = 5b, 4b = -3k + 120. Solve -5h + 0 + 5 = t, -5t + h - b = 0 for t. -5 Let u be (-5)/((-1 - 3 - -14)/(-4)). Solve 0 = -n + 1, 2 - 3 = d - un for d. 1 Let l(v) = 2v + 8. Let k be l(6). Let b = -18 + k. Solve -3x + br + 6 = -5, -2x + 2r = -6 for x. 5 Let a = -6 - -10. Let y(q) = -3q + 2. Let u be y(-6). Let i = 32 - u. Solve -j - 4l - i = 0, -4l + 10 = -aj + 22 for j. 0 Let d(z) = z*3 + 4z*2 + 6z + 11. Let o be d(-3). Suppose -h - 5 = 5t - oh, 3h - 15 = -t. Solve 3b + 11 = 4m, -4m + 2b - b + 17 = t for m. 5 Let m = 50 - 47. Solve 5w = 0, 0 = -2v - 4w + mw - 2 for v. -1 Let y(b) = -b + 23. Let k be y(8). Let a be (-11)/(-3) - 1/(-3). Solve aj = -3c + k, c - j + 4j = 5 for c. 5 Let s be (5/2)/((-37)/(-74)). Solve 4p = -5c + 40, 5c + p = 4p + s for c. 4 Let r = 39 - 36. Let c be -3 - 2(3 - 27/6). Solve 3k + 5b + 9 = c, -12 = 4k - rb + 2b for k. -3 Let c = -315 + 318. Solve m + c = z, 4z + 0m = -2m - 6 for z. 0 Let d be 0/1 + (3 - 2)5. Suppose 3w - 11 = 3i + 19, -5i + 10 = 0. Solve 0 = -dc + c - w, 0 = 2x - 5c - 23 for x. 4 Let b = 7 - -5. Solve -4l + 2a - b = -9l, 4l = a + 20 for l. 4 Let v be 6 - ((-12)/(-2) - 0). Solve 0 = -2m - d + 1, 3m + 6d - 5d - 3 = v for m. 2 Suppose -3z - 2 = -o, 2o - 4z = 3 + 3. Suppose 2g - 23 = -ov, -4v + 4g - 31 = -9v. Solve vc = 5w - 2w - 6, -5w + 12 = -3c for w. 3 Suppose -13r = 2r - 75. Solve 5l = -4s - r, 3l + 5 = 2s - 2l for s. 0 Let u = -8 + 11. Let z = 62 + -35. Suppose -j = 2v, -v = 5j - 0j - z. Solve -5y - 3h = 0, 21 - j = -uh for y. 3 Suppose 1 = 3c - 8. Suppose 5x - 33 = 7. Suppose 3j - 2j - cz = x, 8 = j + z. Solve 0 = -4a - j, 2 = -3i - a + 6 for i. 2 Suppose -3z + 86 = -2t - 17, 2z - 5t - 87 = 0. Suppose z = 2r - 61. Suppose -r = -6p + 2. Solve 0 = 5n - 15, -5s + 0n - 4n = p for s. -4 Suppose 2j - 5 = -s + 4, 0 = -3s - 5j + 25. Solve sm - 25 = 2n - 6n, m = 5 for n. 0 Let q = -299 + 302. Solve -qc - b = -0c - 13, 0 = -2c - b + 10 for c. 3 Let z(k) = -k*3 - 9k*2 - 9k. Let h be z(-7). Let n = h - -40. Solve nf - 20 = -5q, 3q + q - 4f = 0 for q. 2 Suppose -3v = -5 - 7. Let c = 2562 + -2558. Solve 4y + c = g, 2g = 3y + g + v for y. 0 Suppose -3h + 16 = 5j, -2h - j = j - 4. Let y = 6 + h. Suppose yf - 5f + 28 = 0. Solve 0 = -g + 4o - f - 0, -8 = -2o for g. 2 Let s(o) = -3o + 7. Let k be s(1). Solve 0 = -4f + 5x + 4, f + x - 5 = -kf for f. 1 Let u(x) = x2 - 14x - 29. Let p be u(16). Suppose -6 = -py - 5c - 15, 2c - 2 = -4y. Solve -3d + yk - 1 = 1, d + 4 = 4k for d. 0 Let h(i) = 3i + 30. Let l(r) = -8r - 91. Let b(c) = -7h(c) - 2l(c). Let f be b(-6). Suppose 6 = -4k + 6k. Solve 4o + 15 = -g, 5 = kg + fo - 0 for g. 5 Let n(m) = 10m - 286. Let d be n(29). Let u = 10 + -3. Solve -2w - w - 27 = 4a, -da = -w + u for w. -5 Let m(r) = -r*2 - 8r + 16. Let l be m(-10). Let c be (2 - 11)/((-2)/l-2). Let t = 1 + 1. Solve 0 = -b - 3q - 3 + 15, -b - tq = -c for b. 3 Let x = 2315 + -2300. Solve 0 = -4b - 5q + 22, 14b - xb = q - 5 for b. 3 Let a(t) = 5t + 7. Let j(i) = 21i + 29. Let n(f) = -26a(f) + 6j(f). Let c be n(-5). Suppose 11k + 3 = ck. Solve -3q + 3 = -3r, kq + 0r - 11 = r for q. 5 Let y = 41 - 36. Suppose 1 = 4m - 3m + b, -yb - 3 = 3m. Solve -10 = 2j + mg, j + 4j + g = -25 for j. -5 Let d(v) = -2v3 - 116v*2 + 120v + 121. Let f be d(-59). Let y = -5 - -7. Solve 5l - 9 = fm, -yl = -3m - 5l - 9 for m. -3 Let a = 69 + -65. Suppose 2w + 6 = -3v, av + 5 = 3w + 5v. Solve -wb + 12 - 2 = m, -3b + 40 = -5m for m. -5 Suppose -15v + 11 = -10v + w, 4w = 5v - 6. Solve 10 = 5u, 2z - 3u + v = -14 for z. -5 Let r be (-63)/14(-20)/45. Solve -4g + 3x = 2x + 11, 5g + 16 = rx for g. -2 Let w = 54 + -51. Let m be 0/(((-2)/w)/((-2)/12)). Solve -1 = o - mo + 2i, -o - 5i + 2 = 0 for o. -3 Suppose 3a = -2i + 19, 2a + 4 = 4i - 10. Solve 0 = -3q - 1 + 13, 4g - iq = -40 for g. -5 Let t = 118 - 86. Solve 0 = 4a - 4z - t, -6a + z = -3a - 16 for a. 4 Let t(j) = j + 5. Let h = 15 - 20. Let c be t(h). Suppose 5w - 7w = c. Solve w = 4u - m - 5, 2 - 16 = -u - 4m for u. 2 Let z(h) = 2h + 21. Let f be z(11). Let p = -43 + f. Solve p = 2n - 2b, -b + 1 = -0n - 2n for n. -1 Let s(v) = v3 + 5v2. Let n be s(-5). Let d(c) = -c3 + 6c2 + 10c - 13. Let y be d(7). Solve 5k - 4z = -z - y, k + 2z - 1 = n for k. -1 Let f be 14 - (6 + 9/(-3)). Suppose -s + f = 2n, 5n - 2 - 15 = s. Solve 0m - 23 = nm - 3q, 0 = -2q + 10 for m. -2 Suppose 7 - 3 = w. Suppose 12 = 4d + 3u, -5u + 4 + 6 = 5d. Solve wf = -d - 6, -3z - f = -6 for z. 3 Let v(a) = -a - 1. Let t be v(0). Let p be 2 - (-10 + (0 - t)). Suppose 5f = 19 + 6. Solve f = 2c + 6n - pn, 5c = 4n + 21 for c. 5 Suppose 53 = -4n + 5l + 50, -2n + 21 = 5l. Solve -d = -0s + ns, -3s + 2d = 9 for s. -1 Let z be -1 + 4/2 - 34. Let h be -2 - -2 - 3 - (-132)/(-3). Let a = z - h. Solve -2x = -2o + a, 0 = -x - 2o + 6 + 2 for x. -2 Let p = -874 + 892. Solve 4x = -3j + p, -x + 3 = -0 for j. 2 Let r(b) = 5b - 70. Let w be r(0). Let h = -66 - w. Solve -10 = 2x + 3x - 3l, -3x + hl = 17 for x. 1 Suppose -9b - 6b + 60 = 0. Solve 0 = f + 3, -m - bf - 11 = -1 for m. 2 Let n be 546/(-27) - 4/(-18). Let k(z) = z3 + 11z*2 - z - 6. Let q be k(-11). Let b be 17/q + (-12)/n. Solve bg + 5t = 0, 41 = 5g - t - 3t for g. 5 Let w = -45 - -50. Solve -v - 4 = 3a + 13, -wa - 19 = -3v for v. -2 Let z = -1697 - -1702. Solve -27 = 4f + 4s - 9s, f + zs = 12 for f. -3 Suppose -4r = -3v + 78, 4 - 13 = -3r. Let p = 43 - v. Solve 2s = -4d - 3s + 33, 4d - p = -s for d. 2 Suppose -3v - o + 2 + 9 = 0, v - 4o + 5 = 0. Solve -c + vh = -6c + 14, -10 = -3c - h for c. 4 Let x be -33/(36/(-8)). Suppose -u = xw + 5, -5u + 3u = -4w - 22. Suppose -r = 5, -4r = -uk - 7r. Solve kh - 26 = -4v, v - 3v + 16 = 4h for h. 2 Let u(l) be the first derivative of -l*4/4 - 5l*3 + 17l*2/2 + 21l - 1. Let q be u(-16). Solve qs - s - 2x = -4, s = 3x - 6 for s. 0 Let o(t) = -t + 3. Let l be o(0). Let m(g) = -g + 7. Let f be m(10). Let j be ((-12)/(-16))/(f/(-36)). Solve 3 + j = -li - 5x, 5i = -2x - 1 for i. 1 Suppose -3m = -15, m + m - 2 = 4v. Let t = -1062 + 1068. Solve -vg + 0g = -a, -2g - 2a = t for g. -1 Let j = 37 + -35. Suppose -8 = -u - 4y, y + 0y - j = -u. Solve 4k + 12 = 2w - 5w, u = 3k - 3w + 9 for k. -3 Let o be (-7 + 1)43/(-24). Solve o = z + 4r, z - 4z = r + 13 for z. -5 Suppose 30 = 18y - 12y. Solve -3d - 7 = -4z, 2d = -yz + 6d + 10 for z. -2 Suppose 5v - v + x - 14 = 0, 0 = -4v + 4x + 24. Let s(q) = q*2 - 5q - 9. Let n be s(7). Solve -vl - 2g + 26 = 0, n = 4l - 4g - g for l. 5 Suppose 5t = 9t - 23t. Suppose 4p - p - 12 = 0. Solve 2s + 1 = 3s, -pb - 4s - 16 = t for b. -5 S	{ "pile_set_name": "DM Mathematics" }
? 12 What is the remainder when 73 is divided by 5? 3 What is the remainder when 115 is divided by 36? 7 Calculate the remainder when 58 is divided by 9. 4 Calculate the remainder when 501 is divided by 42. 39 Calculate the remainder when 11879 is divided by 220. 219 Calculate the remainder when 479 is divided by 72. 47 What is the remainder when 1398 is divided by 78? 72 What is the remainder when 1645 is divided by 233? 14 What is the remainder when 3292 is divided by 34? 28 What is the remainder when 691 is divided by 121? 86 Calculate the remainder when 163 is divided by 61. 41 Calculate the remainder when 592 is divided by 27. 25 What is the remainder when 471 is divided by 84? 51 What is the remainder when 2018 is divided by 81? 74 Calculate the remainder when 424 is divided by 91. 60 What is the remainder when 20 is divided by 11? 9 What is the remainder when 5228 is divided by 24? 20 Calculate the remainder when 1807 is divided by 597. 16 Calculate the remainder when 216 is divided by 57. 45 What is the remainder when 1026 is divided by 14? 4 Calculate the remainder when 10368 is divided by 11. 6 Calculate the remainder when 54 is divided by 2. 0 Calculate the remainder when 84 is divided by 19. 8 Calculate the remainder when 390 is divided by 41. 21 What is the remainder when 294 is divided by 50? 44 Calculate the remainder when 2964 is divided by 149. 133 What is the remainder when 4802 is divided by 209? 204 What is the remainder when 340 is divided by 31? 30 Calculate the remainder when 863 is divided by 87. 80 Calculate the remainder when 2645 is divided by 42. 41 Calculate the remainder when 130 is divided by 123. 7 Calculate the remainder when 29 is divided by 14. 1 What is the remainder when 4283 is divided by 58? 49 What is the remainder when 896 is divided by 25? 21 Calculate the remainder when 897 is divided by 100. 97 Calculate the remainder when 452 is divided by 113. 0 What is the remainder when 168 is divided by 61? 46 What is the remainder when 21 is divided by 8? 5 What is the remainder when 2044 is divided by 409? 408 Calculate the remainder when 293 is divided by 174. 119 Calculate the remainder when 13 is divided by 12. 1 What is the remainder when 1305 is divided by 119? 115 Calculate the remainder when 681 is divided by 57. 54 What is the remainder when 53 is divided by 15? 8 What is the remainder when 3465 is divided by 68? 65 What is the remainder when 547 is divided by 79? 73 Calculate the remainder when 506 is divided by 35. 16 Calculate the remainder when 227 is divided by 40. 27 Calculate the remainder when 10692 is divided by 17. 16 Calculate the remainder when 115 is divided by 12. 7 What is the remainder when 14 is divided by 9? 5 What is the remainder when 671 is divided by 96? 95 What is the remainder when 50 is divided by 30? 20 Calculate the remainder when 177 is divided by 58. 3 What is the remainder when 39 is divided by 10? 9 What is the remainder when 476 is divided by 181? 114 Calculate the remainder when 2734 is divided by 16. 14 What is the remainder when 760 is divided by 370? 20 What is the remainder when 171 is divided by 36? 27 What is the remainder when 521 is divided by 25? 21 Calculate the remainder when 294 is divided by 30. 24 What is the remainder when 30087 is divided by 177? 174 Calculate the remainder when 432 is divided by 31. 29 What is the remainder when 688 is divided by 78? 64 What is the remainder when 25 is divided by 5? 0 What is the remainder when 122 is divided by 102? 20 Calculate the remainder when 281 is divided by 246. 35 What is the remainder when 114 is divided by 30? 24 Calculate the remainder when 2852 is divided by 948. 8 What is the remainder when 136 is divided by 3? 1 What is the remainder when 51 is divided by 13? 12 Calculate the remainder when 130 is divided by 36. 22 What is the remainder when 1219 is divided by 13? 10 Calculate the remainder when 302 is divided by 32. 14 Calculate the remainder when 1146 is divided by 9. 3 Calculate the remainder when 151 is divided by 17. 15 What is the remainder when 952 is divided by 94? 12 What is the remainder when 289 is divided by 7? 2 Calculate the remainder when 1444 is divided by 578. 288 Calculate the remainder when 447 is divided by 195. 57 Calculate the remainder when 172 is divided by 4. 0 Calculate the remainder when 62 is divided by 49. 13 What is the remainder when 313 is divided by 15? 13 Calculate the remainder when 549 is divided by 56. 45 What is the remainder when 209 is divided by 14? 13 What is the remainder when 1787 is divided by 130? 97 Calculate the remainder when 646 is divided by 155. 26 What is the remainder when 71 is divided by 56? 15 What is the remainder when 402 is divided by 113? 63 What is the remainder when 84 is divided by 17? 16 Calculate the remainder when 45 is divided by 10. 5 What is the remainder when 1269 is divided by 252? 9 Calculate the remainder when 24 is divided by 11. 2 Calculate the remainder when 896 is divided by 20. 16 Calculate the remainder when 53 is divided by 15. 8 Calculate the remainder when 7 is divided by 3. 1 Calculate the remainder when 2128 is divided by 13. 9 Calculate the remainder when 153 is divided by 26. 23 What is the remainder when 259 is divided by 74? 37 Calculate the remainder when 209 is divided by 42. 41 Calculate the remainder when 1449 is divided by 11. 8 Calculate the remainder when 5734 is divided by 441. 1 What is the remainder when 714 is divided by 181? 171 Calculate the remainder when 980 is divided by 142. 128 Calculate the remainder when 158 is divided by 48. 14 Calculate the remainder when 794 is divided by 82. 56 Calculate the remainder when 222 is divided by 32. 30 Calculate the remainder when 5323 is divided by 15. 13 What is the remainder when 483 is divided by 149? 36 Calculate the remainder when 2463 is divided by 11. 10 Calculate the remainder when 312 is divided by 54. 42 Calculate the remainder when 148 is divided by 42. 22 What is the remainder when 4683 is divided by 22? 19 What is the remainder when 37644 is divided by 7? 5 Calculate the remainder when 2613 is divided by 14. 9 What is the remainder when 153 is divided by 53? 47 What is the remainder when 2013 is divided by 38? 37 Calculate the remainder when 37 is divided by 7. 2 Calculate the remainder when 24 is divided by 15. 9 Calculate the remainder when 514 is divided by 54. 28 What is the remainder when 2118 is divided by 130? 38 Calculate the remainder when 55 is divided by 15. 10 Calculate the remainder when 4847 is divided by 97. 94 What is the remainder when 133 is divided by 15? 13 What is the remainder when 1797 is divided by 75? 72 What is the remainder when 5905 is divided by 19? 15 What is the remainder when 235 is divided by 123? 112 Calculate the remainder when 270 is divided by 87. 9 What is the remainder when 47 is divided by 10? 7 Calculate the remainder when 1730 is divided by 193. 186 Calculate the remainder when 63 is divided by 35. 28 Calculate the remainder when 31 is divided by 4. 3 What is the remainder when 6215 is divided by 230? 5 What is the remainder when 190 is divided by 46? 6 What is the remainder when 46 is divided by 9? 1 What is the remainder when 49 is divided by 34? 15 What is the remainder when 272 is divided by 47? 37 Calculate the remainder when 684 is divided by 16. 12 Calculate the remainder when 1726 is divided by 173. 169 What is the remainder when 357 is divided by 179? 178 What is the remainder when 6664 is divided by 31? 30 What is the remainder when 52 is divided by 5? 2 What is the remainder when 638 is divided by 40? 38 What is the remainder when 105 is divided by 37? 31 What is the remainder when 704 is divided by 47? 46 What is the remainder when 388 is divided by 76? 8 What is the remainder when 5989 is divided by 1992? 13 What is the remainder when 6227 is divided by 9? 8 Calculate the remainder when 567 is divided by 16. 7 What is the remainder when 688 is divided by 32? 16 What is the remainder when 344 is divided by 23? 22 Calculate the remainder when 449 is divided by 90. 89 Calculate the remainder when 158 is divided by 61. 36 Calculate the remainder when 705 is divided by 265. 175 Calculate the remai	{ "pile_set_name": "DM Mathematics" }
14a2 + 399 - 1190. -2(a - 1)*3(a + 20) Let s(w) = 3w3 - 11w*2 + 20w + 4. Let g(c) = -3c3 + 10c*2 - 22c - 5. Let d(a) = -4g(a) - 5s(a). Find z, given that d(z) = 0. 0, 1, 4 Let z(h) be the second derivative of -5h4/24 + 13h*3/12 + 3h*2/2 + h - 7. Factor z(w). -(w - 3)(5w + 2)/2 Let j(c) = c4 - c3 - c2 - c. Let g(r) = -12r*4 - 16r*3 - 18r*2 - 2r. Let u = -10 + 9. Let n(a) = ug(a) - 6j(a). Determine q, given that n(q) = 0. -2, -1, -2/3, 0 Let u be (-39)/26(-2 - -4). Let y be (-2)/(((-3)/(-9)u)/1). Factor 3/4 + 3/2m + 3/4m*y. 3(m + 1)*2/4 Suppose 153 = 28x + 23x. Factor 0t*4 - 8/7t*x + 6/7t - 4/7 + 2/7t5 + 4/7t*2. 2(t - 1)*3(t + 1)(t + 2)/7 Let i(r) be the first derivative of 0r - r*2 + 2/3r*3 + 39. Factor i(u). 2u(u - 1) What is l in 128/5 + 9/5l*4 + 14/5l*3 - 56/5l*2 - 96/5l + 1/5l5 = 0? -4, 1, 2 Let q be (-2)/7 + (-561)/(-2233). Let x = 33/116 + q. Factor 0v + 0 + 3/4v3 - 1/2v*4 - xv2. -v2(v - 1)(2v - 1)/4 Let w be 2/8 + 5(-55)/(-100). Let n be -3 + ((-90)/(-6))/w. Factor 2/7 + 8/7y + 8/7y*n. 2(2y + 1)2/7 Let f be 24/(-18)(-1 - 2). Suppose fm - 7m = 0. Factor mk - 2/7k*4 + 0k*2 + 0 + 4/7k*3. -2k*3(k - 2)/7 Let s(i) = 12i - 117. Let q be s(10). Let v(l) be the second derivative of 0 - 1/72l*4 - ql + 0l3 + 1/12l*2. What is y in v(y) = 0? -1, 1 Let b be (-20)/(-30)(-3)/(-10). Suppose 9h = 36 - 9. Factor 1/5r*2 - br*h + 0 + 0r. -r*2(r - 1)/5 Suppose 4g - 12 = 2w, -g + 3 = w + w. Let j(t) be the first derivative of -3/20t5 + 0t*2 + 0t*g - 2 + 0t - 1/16t4. Let j(m) = 0. Calculate m. -1/3, 0 Let s(i) be the third derivative of -i5/60 - 15i*2. Let v(k) = -25k*2 - 10k - 5. Let a(b) = 20s(b) - v(b). Factor a(q). 5(q + 1)*2 Let a(j) be the third derivative of -1/24j*4 - 1/3j*3 + 0j + 17j2 + 0 + 1/60j*5. Suppose a(w) = 0. What is w? -1, 2 Suppose 81 = -6f + 11f - 2o, -3f + o = -48. Suppose -g = 2a - f, -20 = -5a + a. Factor -4/7d*3 + 0d*4 + 0d*2 + 2/7d + 2/7dg + 0. 2d(d - 1)2(d + 1)*2/7 Let y(v) be the second derivative of 5v*7/7 + 134v*6/15 - 321v*5/10 + 36v*4 - 44v*3/3 + 2v - 5. Solve y(x) = 0 for x. -11, 0, 2/5, 2/3, 1 Let c(f) be the second derivative of 0f3 + 1/25f*5 + 0f*2 - 1/45f*6 + 3f + 5 - 1/90f4. Factor c(k). -2k*2(k - 1)(5k - 1)/15 Let o be 9/(-270)10/(-10). Let y(g) be the first derivative of -1/4g*2 + 1/18g*3 + og*5 - 1/3g - 1 + 1/8g4. Factor y(h). (h - 1)(h + 1)*2(h + 2)/6 Let c(q) be the first derivative of 4q2 - 64q - 44 - 1/12q3. Suppose c(r) = 0. Calculate r. 16 Let y(s) be the third derivative of 0s*3 - 1/36s*4 - 1/60s*5 - 1/360s*6 + 0 + 6s*2 + 0s. Determine j, given that y(j) = 0. -2, -1, 0 Let y be 13/(-845)-13(-30)/(-9). Factor -1/3j - y + 1/3j*2. (j - 2)(j + 1)/3 Let d(k) be the first derivative of -125/7k4 + 14 + 400/7k*3 - 480/7k*2 + 256/7k. Factor d(m). -4(5m - 4)*3/7 Suppose -4c = -12b + 10b - 6, -b = -5c + 9. Let r(a) be the first derivative of -32/3a*3 - 11a*c - 2 - 7/2a*4 - 4a. Factor r(d). -2(d + 1)2(7d + 2) Let b(m) be the second derivative of -m5/80 - m4/48 + m3/24 + m2/8 - 6m - 1. Factor b(l). -(l - 1)(l + 1)2/4 Determine r so that -2r*4 - 231r*3 - 4r - 4r2 + r2 + 223r*3 - 7r*2 = 0. -2, -1, 0 Let u(z) = -5z*2 - 17z. Let s(c) = c*3 - 16c2 - c + 7. Let y be s(16). Let w(m) = -m2 - 4m. Let v(r) = yw(r) + 2u(r). Let v(n) = 0. Calculate n. 0, 2 Let h(j) = -2j*2 + j + 3. Let k(z) = -5z*3 + 640z*2 - 26465z + 370425. Let l(v) = -5h(v) - k(v). Factor l(n). 5(n - 42)*3 Suppose 2f + h - 2h - 5 = 0, -4 = -4h. Suppose 9 = q + f. Solve -u*3 + 3u*3 - 4u + 0u2 + 6u*4 - qu*2 + 2u5 = 0. -2, -1, 0, 1 Let r(x) be the third derivative of -x5/120 - 89x4/12 - 7921x*3/3 + 19x*2. Suppose r(y) = 0. Calculate y. -178 Suppose -4/9 - 4/9f*5 - 8/9f*2 + 4/3f + 4/3f4 - 8/9f*3 = 0. Calculate f. -1, 1 Let s(j) be the third derivative of 2j*7/525 + 7j*6/120 - 49j5/300 + j4/12 - 3j2 + 4j. Factor s(q). q(q - 1)(q + 10)(4q - 1)/5 Let l be ((88-25)/(-4))/1. Let o be l/143 - 2/(-13). Determine u so that 8 + 0u*2 + 4u*3 - ou*2 - 4u - 4u2 + 0u = 0. -1, 1, 2 Let a(m) = -34m3 + 25m*2 + 6m - 3. Let x(w) = -172w3 + 126w*2 + 30w - 16. Let y(r) = -16a(r) + 3x(r). Factor y(c). 2c(c - 1)(14c + 3) Suppose 0s = -3s + 9. Suppose -sy - 2y = -15. Factor -yv4 - v3 + 4v3 + v3 + v*5 - 2v3. v3(v - 2)(v - 1) Let u(v) = -4v2 - 42v + 28. Let w(n) = -n*2 - 10n + 7. Let q(b) = 2u(b) - 9w(b). Find g such that q(g) = 0. -7, 1 Solve -1 + 3k - 5/4k*2 = 0. 2/5, 2 Let t(u) be the first derivative of -11 + 0u + 5/48u4 - 1/3u*3 + 1/6u*2. Factor t(r). r(r - 2)(5r - 2)/12 Let s(y) be the first derivative of -y*8/168 - 2y*7/105 + 8y*2 + 14. Let w(k) be the second derivative of s(k). Factor w(i). -2i*4(i + 2) Let x = 21 + -18. What is g in -2g3 + 5g*3 - 9g*3 + 5g + 5g5 - 4gx = 0? -1, 0, 1 Let h(w) be the second derivative of w6/270 - 7w5/90 + 4w*4/9 + 7w*3/27 - 49w*2/18 + 309w. Suppose h(y) = 0. Calculate y. -1, 1, 7 Suppose -9f = 6f - 30. Let o(a) be the second derivative of -1/4af + 0a*3 + 1/24a*4 + 9a + 0. Determine p, given that o(p) = 0. -1, 1 Determine b so that -23/4b2 + 15/2b*3 - 2b*4 + 1 - 3b = 0. -1/2, 1/4, 2 Find q such that -92/11q2 + 0 + 1058/11q + 2/11q3 = 0. 0, 23 Let h(q) be the second derivative of q5/130 - 3q*4/26 - 7q*3/13 - 11q*2/13 - 54q. Let h(f) = 0. What is f? -1, 11 Let q(c) be the third derivative of -1/7c3 + 41c*2 + 0 + 0c - 1/210c5 + 1/21c*4. Factor q(m). -2(m - 3)(m - 1)/7 Let r = -4333/12 - -1471/4. Solve rv + 4/3 - 20/3v3 - 4/3v*2 = 0. -1, -1/5, 1 Let c(g) be the third derivative of 13g*2 - 1/315g*7 + 0 - 1/9g*3 + 1/36g*4 - 1/90g*6 + 0g + 1/45g5 + 1/504g8. Suppose c(p) = 0. What is p? -1, 1 Let z(u) be the first derivative of -u7/560 - 3u6/80 - 4u*3/3 + 16. Let t(x) be the third derivative of z(x). Find n such that t(n) = 0. -9, 0 Let u(x) be the first derivative of -3x*4/20 + 8x*3/5 - 3x*2/2 - 42x/5 - 38. Find c such that u(c) = 0. -1, 2, 7 Let b be 0(1/6 + -1)285/475. Let 0s + 0s*4 + b - 2/5s*2 + 1/5s*5 - 3/5s3 = 0. Calculate s. -1, 0, 2 Let x(o) be the second derivative of -o5/10 - 4o4 - 64o*3 - 512o*2 + 153o. Factor x(l). -2(l + 8)3 Find r, given that 20/7r*4 - 64/7r + 0 - 2/7r5 - 72/7r*3 + 16r*2 = 0. 0, 2, 4 Factor -16/11y - 10/11y2 + 0. -2y(5y + 8)/11 Suppose -2j4 + 60j + 32 + 10j5 - 4j*4 + 3j*2 - 5j*2 + 36j*3 - 82j3 = 0. What is j? -1, 8/5, 2 Let a(l) be the first derivative of l4/4 - 5l3 + 27l*2/2 - 13l + 105. Factor a(h). (h - 13)(h - 1)2 Find a such that 0 + 4/5a*4 + 4/5a + 14/5a2 + 14/5a3 = 0. -2, -1, -1/2, 0 Let m(n) = n2 - 9n - 12. Suppose -35 = -5f + 20. Let b be m(f). Factor -4y3 + 13y*3 - 8y*5 - by*4 - 3y - 2y4 - 4y*5 + 6y*2. -3y(y + 1)2(2y - 1)2 Let q be (-1 - (-13)/(-3))3. Let x = q - -19. Factor -3b + xb - 1 - 2b + b + 2b2 - b4 - b*5 + 2b3. -(b - 1)2(b + 1)3 Suppose p - 19 = -4u - 5, 0 = 5u + 3p - 21. Let f(j) be the first derivative of 8/5j5 + 0j + j*2 + 4 - 1/2j*4 - 8/3j*u. Find t such that f(t) = 0. -1, 0, 1/4, 1 Suppose 0 = a - 8a + 42. Suppose ao - 7 = 11. Solve -2/5v*5 + 0v + 6/5v4 - 4/5v*o + 0 + 0v*2 = 0. 0, 1, 2 Suppose 102y - 2 = 101y + 2q, y = -5q + 9. Solve 0w*3 + 1/9w*y + 0 - 2/9w - 1/3w2 = 0. -1, 0, 2 Let b be (3/(-6))/((-567)/2592). Factor 2/7n*4 + bn*2 - 8/7n + 0 - 10/7n3. 2n(n - 2)2(n - 1)/7 Let q(u) be the first derivative of -6u4 + 45/2u*3 + 32 - 12u - 21/10u5 - 21/2u*2. Determine a so that q(a) = 0. -4, -2/7, 1 Let -2r*3 + 0 + 2/3r*5 + 2/3r*2 + 4/3r - 2/3r4 = 0. Calculate r. -1, 0, 1, 2 Suppose 8u*2 - 2u*2 - 4u*2 + 5u - 60 - 3u = 0. Calculate u. -6, 5 Let q(p) = 3p*4 + 6p*3 - 6p*2 - 4p + p*2 + 5p*2 + 3p*2. Let n(b) = 4b*4 + 7b*3 + 4b**2 -	{ "pile_set_name": "DM Mathematics" }
+ -17? -9 14621/(-294) + 6/14 -10 Calculate ((-200)/(-140))/((-2)/7). -5 What is the value of 0 + 0 + -3 + 3 + -1? -1 What is the value of (-128)/(-48) + 1/3? 3 Calculate 1-5 + (15 - 11 - 0). -1 What is 18/15 + -1(0 + 1)? 1/5 What is the value of (256/48)/4(-3)/28? -1/7 -33 + 35 - (0 - 0 - 1) 3 What is the value of -15/((-60)/(-3))4? -1 What is ((-33)/(-209))/((-6)/(-4))? 2/19 What is the value of (11 + 3)(9/18 + -1)? -7 What is the value of (1/2)/((-6)/(-4))? 1/3 Evaluate -5 + (-6 - (-8 + 3)) + -4. -10 What is 630/135 - (-1)/3? 5 Evaluate -2 + ((-16)/136 - 166/34). -7 What is (-2)/15 + 7062/990? 7 What is 6(5/10 + 0)? 3 What is the value of (12 + (-13 - -5))/(2/(-3))? -6 What is the value of ((-56)/16)/((-10)/12) - 4? 1/5 What is -4 - 104/(-17) - 2? 2/17 What is the value of (-24)/10(-1150)/345? 8 What is the value of 11/(-3) - (8 - (15 + -5))? -5/3 540/(-3213) + (8/(-68) - 0) -2/7 What is (-231)/1261/11? -1/6 What is the value of 3 + (-4)/1611? 1/4 Calculate 45/36 - (-3)/(-2). -1/4 Evaluate 0/2 - -7 - 8. -1 ((-50)/(-45))/((-140)/(-84)) 2/3 What is (5/(-4))/(805/(-56))? 2/23 10/(-8)1038/(-865) 3/2 What is (-28)/280(-10)/22? 1/22 What is 4/1010(-5)/(-4)? 5 Calculate 72/(-324)(1 - (-1)/2). -1/3 (4/6)/(1/3-2) -1 Evaluate (-51)/595 - ((-12)/(-14))/(-3). 1/5 What is ((-18)/(-4))/(-3)(-112)/84? 2 (-16)/3 + 4 + 4/2 2/3 What is 1 + ((-23)/(-69))/((-1)/(-27))? 10 Evaluate (23/16)/((-3)/(-2)). 1/4 What is 1((-21)/28)/(2/8)? -3 Evaluate (-8)/(-36) - 11/9. -1 Evaluate (28/(-105))/(18/(-15)). 2/9 (-189)/(-495) + (-2)/10 2/11 (-2)/(-4 + 2) - (-2 + 4) -1 Calculate (-4)/(7 - -5) - (-136)/12. 11 What is the value of -1 + (-27)/(-25) - (-16992)/(-2400)? -7 What is the value of (-35)/25 + (-6)/(-15)? -1 -5 + -3 - (-1 - (-510)/(-78)) -6/13 What is 1 + -2 + (252/20)/7? 4/5 What is (-1)/4 + ((-305)/(-60) - 5)? -1/6 Calculate -1 + (-15)/(-18) + (-7)/84. -1/4 Calculate 7 - (-3 + (-370)/(-35)). -4/7 What is the value of (2/5)/(24/30)? 1/2 Evaluate (1/(-2))/(-212/(-16)). -1/3 Calculate 1 + (-26)/30 + 236/2655. 2/9 ((-96)/128)/(1/(2/(-12))) 1/8 Evaluate ((-264)/(-130) + -2)/(7/(-35)). -2/13 Evaluate (-1 + -1)/((-6)/9). 3 What is the value of -2 - -9 - 14 - -3? -4 1122/297 + (-5 - -1) -2/9 Calculate (-116)/(-928) + 1/(-8). 0 Evaluate ((-2 - -1) + 11)(-6)/(-15). 4 Evaluate 6/39 - 63/156. -1/4 ((-1)/418 + 5)6 3 38/(-80) + (-9)/(-15) 1/8 3/(-1) - -5 - 0 2 Calculate (-2 + (-20)/(-6))6/8. 1 Calculate 0 - 1 - 365/(-219). 2/3 680/840 - 2/14 2/3 Calculate (-2)/(42/6 - 8). 2 Evaluate (-1)/8 + (1 - -3) + -4. -1/8 Calculate -33/(117/(-65)). 5 (-17)/(935/(-6))(0 - 5) -6/11 (3 + -1)/((-28)/(-20) - 1) 5 What is the value of 2(-5)/(-20) - 4? -7/2 What is (6/9)/(((-160)/(-12))/5)? 1/4 What is the value of (-1)/1 + 270/(-55) + 6? 1/11 What is the value of (-42)/36 + -2 + (-5)/(-3)? -3/2 What is -11 - -143/2? 10 Evaluate 2 + -1 - (20 - 17). -2 Calculate (-6)/(-8)2(-60)/18. -5 Evaluate (-167)/(-668) - 3/(12/17). -4 Evaluate ((-18)/(-126))/((-2)/(-4)). 2/7 Calculate -3(-30)/(-18) + 9. 4 Evaluate ((-13)/39)/(1/5). -5/3 20/12 - 4/6 1 5 + -4 - (1 + -8 + 4) 4 (45/360)/((-10)/(-16)) 1/5 Evaluate 29/(-66)10/15. -2/11 Calculate 6/(-14) + -2 + (-10)/(-7). -1 What is the value of 4 + (2/7 - 304/84)? 2/3 What is the value of (-133)/210 - 12/(-15)? 1/6 ((-1)/(-1))/((-5)/(-10)) 2 Evaluate (-120)/(-18) - (-14)/(-2). -1/3 What is (-5 - 24/(-42)) + 10 + -5? 4/7 What is the value of 30/51 + (2 - 0)? 8 6/(-39) - (-846)/936 3/4 Evaluate 91/441 - (-4)/18. 3/7 What is the value of (0 + (1 - 2/4))-4? -2 Calculate 4/14 + (5200/(-70))/(-20). 4 What is the value of ((-5676)/72)/(-11) + (-15)/(-18)? 8 What is the value of (-45)/5020/24? -3/4 Calculate ((-68)/(-12) + -1)(-39)/26. -7 What is the value of 30/12 - 4/(-8)? 3 What is the value of (-4)/(52/(-3))(-46)/(-69)? 2/13 Evaluate -1 + (-2)/(-5) - 6/15. -1 (-59 - -62) + 0 + -3 + -7 -7 Calculate 1/((-12)/176 - (-16)/(-88)). -4 Calculate ((-91)/(-112) - 1)(-6)/(-9). -1/8 What is the value of (20/120-2)/((-2)/3)? 1/2 Calculate ((-12)/48)/(6/(144/20)). -3/10 Evaluate ((-6)/60)/(5/10). -1/5 What is the value of ((-6)/9 - (-2)/30)/(-1)? 3/5 What is the value of 0 - ((-86)/16 - 18/(-48))? 5 24/(-110) - 4/(-10) 2/11 What is ((-3)/(-24))/((-14)/(-28))? 1/4 What is the value of (-32)/14 + 21? -2/7 Calculate (0 + 3)/610/(-5). -1 What is the value of (-280)/(-63) + -10 + 6? 4/9 What is the value of (-204)/(-2550) - 96/(-50)? 2 Evaluate (-132)/33070/4. -7 Evaluate 2 + (-26)/6 + 56/42. -1 Calculate 55/(-22) + (-6)/(-4). -1 What is the value of ((-224)/(-84))/((-10)/(-15))? 4 Calculate 5 + -4(-16)/(-12). -1/3 Calculate -1 - (-34)/12 - 45/30. 1/3 2((-30)/(-4))/3 5 Evaluate 5 - (3/2 + 26 + -24). 3/2 What is 10/(-4)(-910)/(-325)? -7 Calculate 5 - 21/6(-6)/(-7). 2 What is the value of 2(-5)/6755? -2/27 Evaluate ((-36)/(-108))/(2/8). 4/3 What is the value of 0 + (-6)/(-33) - (-60)/33? 2 156/27 + -6 - (-44)/(-45) -6/5 (-24)/378 - (0 - (-2)/(-7)) 2/9 What is the value of (9 + -15)(-2)/90? 2/15 Evaluate (-1)/(-2) - (-2 - 13/(-6)). 1/3 (-12)/10(-36)/144 3/10 Evaluate ((-15)/6 - (-33)/6) + 1. 4 What is (0 + -6)(-13)/26? 3 What is 0 + (30/5)/(-6)? -1 What is ((-38)/(-57))/(5/18) + -2? 2/5 What is the value of (8 + -10 + 1)18/(-2)? 9 What is (0 + -1)2 - -3? 1 Calculate 20/6121/10. 4 What is the value of (2/(-6))/(53/(-106))? 2/3 Calculate (-153)/60 - 12/(-15). -7/4 Evaluate (-86)/(-12) - (6 + 175/(-30)). 7 Evaluate (-7)/11 + 3. -4 What is the value of ((-5)/(-50))/(39/130)? 1/3 What is the value of (3794/420 - 9)3? 1/10 Evaluate 6/(-36)(15 - 9). -1 What is 6/((-18)/15) - -10? 5 Evaluate (-3 - (-45)/40)/(18/(-8)). 5/6 3-2-36/(-36) -3 Calculate 5/((-35)/(-44)) + -6. 2/7 What is the value of (-1653)/(-319) + 2/(-11) + -4? 1 Calculate (5/3 - 2) + 588/(-126). -5 (-9)/7 - -25/10 -2/7 (-5)/((-75)/6)20/32 1/4 (16/(-12))/(2/3) - -1 -1 What is the value of (-6)/(-21)84/108? 2/9 What is (-114)/764/6? -1 Evaluate (-2 + 1)-12. 2 Evaluate (-232)/(-72) - 2/91. 3 3/18 + 5/(-30) 0 Evaluate 0/((-7)/49-7) + -2. -2 What is (-3)/2714/(-153)? 7 What is the value of ((-20)/40)/(0 + (-3)/30)? 5 Evaluate 195/(-325) + 14/(-10). -2 Evaluate 5((-12222)/1750 + 7). 2/25 What is (16/64 - (-25)/(-4))/(-11)? 6/11 What is the value of (-85)/(-34)(-4)/10? -1 Calculate 148/(-28) - 2/(-7). -5 What is 3/((-6)/10)(-9 - -10)? -5 What is the value of -1-92/6? 3 Calculate (-6)/(-27) + (-280)/45. -6 What is the value of (2 - 1) + -5 - -2? -2 What is the value of (5(-4)/(-40))/2? 1/4 Evaluate (-18)/(-12)(-7)/(42/8). -2 Evaluate (-184)/44 - (2 + (-18)/3). -2/11 What is the value of 1/1 - (-27)/(-36)? 1/4 What is the value of -6 - (8/(-10))/((-30)/(-450))? 6 What is the value of 1(-6 - (-11 + 0))? 5 Calculate (39/(-48) + 1)-2. -3/8 ((-12)/(-8))/((-15)/(-40)) - 5 -1 What is ((24/27)/(14/(-21)))/(-2)? 2/3 Calculate (-8)/16 + (-2)/4 + -4. -5 -3 - ((-230)/(-35))/(-2) 2/7 Calculate (-4 + 6/9)(-6)/(-5). -4 Evaluate -4 - (-2 + 14)/(-2). 2 What is (-72)/(-16)(-1)/(-6)? 3/4 Calculate (10 + -8 + 0)/(9 - 0). 2/9 Calculate ((-2)/(-6))/(((-9)/3)/36). -4 Evaluate ((-22)/55)/((-12)/15). 1/2 Evaluate ((-4)/(-56))/(24/336). 1 Calculate 45/9(12/(-6) + 3). 5 Evaluate (-51)/(-90) - (54/10 - 5). 1/6 What is 24/(-156) + 55/(-65)? -1 What is (-9)/((-198)/4) + (-27)/(-33)? 1 What is ((-10)/(-15))/(12/(-18))? -1 Calculate 2/(6 - 0)24/(-32). -1/4 Calculate 2((-55)/10 + 6 + 0). 1 Evaluate (12(-7)/(-105))/((-1)/5). -4 Calculate (-2)/8 - (-65)/20. 3 What is the value of 40/(-20) - (0 + 0 + -1)? -1 What is (-7(-18)/(-63))/((-2)/(-3))? -3 What is ((6 - 11)/5)/(6/18)? -3 (-1)/(-5)200/180 2/9 69/72 - (-50)/(-60) 1/8 Calculate (2 + (-124)/56)/(2/4). -3/7 19/76 - 3/12 0 What is the value of 3/(3 - 3 - 1)? -3 What is (-1 - (-12)/(-3)) + 363/66? 1/2 What is the value of 1/(-3) - (-16)/(-384)-38? 5/4 What is (-25 - -23) + 8/2 + 1? 3 (-3)/18 + (-4)/(-24) 0 Evaluate (-4)/48-9 - 6/(-24). 1 What is (-10)/(-4)9/(-45)? -1/2 Calculate 9/((-342)/4) + 2/19. 0 Evaluate 1/(-6)(4 + 3/(-3)). -1/2 Calculate (-20)/215/30. -5 What is 18/(-40) - (-10)/50? -1/4 Calculate ((-20)/(-35))/(20/564). 2/5 What is the value of ((-24)/(-20))/(6/(-15))? -3 Calculate 21/(-14)(-4)/27. 2/9 Calculate 1/(	{ "pile_set_name": "DM Mathematics" }
17)) + -6sqrt(117)2)). -11217 + 117sqrt(13) Simplify ((-2sqrt(405)/sqrt(9)3 + sqrt(10)/sqrt(2)5 + sqrt(30)/sqrt(54))-6)2. 28880 Simplify ((-2sqrt(80)1 - (0 + sqrt(80) + 1 - sqrt(80)))-36 + 2)2. 5760sqrt(5) + 104080 Simplify (((sqrt(30) + sqrt(120)/(sqrt(4) - (sqrt(4)-2 + sqrt(4))))/((sqrt(3) + sqrt(27))2))/(1sqrt(22)/(sqrt(99)/(sqrt(9) + sqrt(9)1))))*2. 45/1024 Simplify ((sqrt(2736) + 3)1)*2 + -2 - (3 + (sqrt(2736) + sqrt(2736)1 + sqrt(2736) + sqrt(2736))*2)2. -84815 + 72sqrt(19) Simplify 0 + -1 + (sqrt(1216) - sqrt(1216)-11) - (2 + (3 + sqrt(1216))-2 + 1). 2 + 32sqrt(19) Simplify (-6(sqrt(3) - sqrt(12)/sqrt(4)) - (sqrt(42)/sqrt(2))/sqrt(7))*21 + sqrt(336)/(sqrt(448)-1). -sqrt(3)/2 + 3 Simplify 1(1(0 + sqrt(272))2 - ((-5 + (-2sqrt(272) - sqrt(272)))*2 + sqrt(272)))-21. 248sqrt(17) + 4402 Simplify ((sqrt(704)-2 - sqrt(704)) + sqrt(704) + 4 + 2)2 + (sqrt(539) + sqrt(539) + 0)2 + sqrt(539) + 3 + -5. -185sqrt(11) + 5006 Simplify 4 + (-3-4(sqrt(288) + 0) + 0)*21. 41476 Simplify 2(sqrt(76)/sqrt(4) - sqrt(19))2 + (4sqrt(152))/sqrt(8) + -1((sqrt(76)/sqrt(64))2 - (3 + sqrt(38)/sqrt(2))). 29/16 + 5sqrt(19) Simplify (6((-2sqrt(378) - sqrt(378)) + sqrt(378))5)/(3(sqrt(216) + sqrt(216)4)4). -sqrt(7)/2 Simplify (sqrt(27) + sqrt(27) + 3sqrt(27))2 + sqrt(27)/(sqrt(9) + sqrt(18)/sqrt(2)) + (3 + -1sqrt(243) + 5(1 + sqrt(243)))2. 1153sqrt(3)/2 + 4627 Simplify ((-2-2sqrt(147))/(4(sqrt(7) + -2sqrt(7))))/(((sqrt(132) + (sqrt(132)-2 - sqrt(132)))/sqrt(4))/(-5sqrt(99))). -15sqrt(7)/2 Simplify 5(-5(sqrt(288) - (-3 + sqrt(288) - sqrt(288)))-4 + (sqrt(50) - (sqrt(50) + 2))4 + -4)2. 115200sqrt(2) + 587520 Simplify 3 + (4(sqrt(448) + 2 - sqrt(448)) + 5 - (-1 + (-3sqrt(448)2)2)). -16111 Simplify (((-1sqrt(2156) - sqrt(2156))/(sqrt(288)2))/((sqrt(1100) + 3sqrt(1100)2 + sqrt(1100))3))*2-2. -49/2073600 Simplify ((-3(sqrt(162) + 1 + 4 + sqrt(162) + sqrt(162) - sqrt(162)) + 5 + -2 + sqrt(162) + 3)4 + -2)*2. 13680sqrt(2) + 66244 Simplify -5 + (2sqrt(2299)-1 - ((sqrt(152) + 1sqrt(152))/sqrt(8) + sqrt(76) + -1))2 + 5 + -5. -52sqrt(19) + 12840 Simplify 6(-5 + sqrt(325) + -1 + -4 + sqrt(325) + sqrt(325))2 + (3(3 + sqrt(325)) - (-2 + (-1 + sqrt(325))*2)). -1775sqrt(13) + 17835 Simplify 5(-3 + 1sqrt(11)2 + -5 + 6((sqrt(1584) - sqrt(1584)-1)2 + -3)). 10sqrt(11) + 189950 Simplify -4(sqrt(704) + 0 - -1sqrt(1584) - -6(1 + -3 + sqrt(11)))2-1 + -3. -2496sqrt(11) + 30317 Simplify 0 + -6(1sqrt(4235)2)/(sqrt(1008) + (-1sqrt(1008) - sqrt(1008)) + sqrt(56)/sqrt(32))-4. -1056sqrt(5)/23 Simplify (-1-3sqrt(22) - (sqrt(220)/sqrt(5))/sqrt(2))/((sqrt(330)/sqrt(6))/sqrt(5) + 3sqrt(275)). sqrt(2)/8 Simplify (5(1(sqrt(432) - (sqrt(432) + 2)) + sqrt(432))-1 + (-2 + sqrt(432) + 2 + sqrt(432) - sqrt(432) - (-2 + sqrt(432) + 2)))2. -1200sqrt(3) + 10900 Simplify -5 + ((5 + -2sqrt(99) + -3 + -3)2 - (3-3((sqrt(99) - sqrt(99)2) + -5))*2). -9652 - 2418sqrt(11) Simplify -2 + (2 + sqrt(7))*2-2 + 5 + 3 + 3 + 2 + -1sqrt(252) + 3. -14sqrt(7) - 8 Simplify (2((sqrt(720) + -2sqrt(720)-5 - (sqrt(720) + -1sqrt(720))-1) + 4 + (1sqrt(720) + 4 + sqrt(720) + (sqrt(720) + -1)5)5))*2. -4416sqrt(5) + 6094084 Simplify ((sqrt(260) + (-1sqrt(260) - sqrt(260))4)/(sqrt(5) - sqrt(605)1) - -3(3 + (1 + sqrt(832) - sqrt(832))))*26. 1008sqrt(13)/5 + 25422/25 Simplify (5 + -4(sqrt(425) - 5(1 + sqrt(425)))-1)*2 + 5. 2400sqrt(17) + 109030 Simplify -4 + (sqrt(605)2-3)*2-64 + 4((sqrt(605) - 2sqrt(605)) + sqrt(605))-6-5. -522724 Simplify (sqrt(81) - 4(-2sqrt(81) - sqrt(81)) - sqrt(81))/(sqrt(27)/((sqrt(90)-3 - sqrt(90))/sqrt(10)))2. -288sqrt(3) Simplify 1 + (-3 + sqrt(125)-2 - (2(sqrt(720) + -1) + sqrt(720)))*2 + (2sqrt(320) + 0)-45. -228sqrt(5) + 10582 Simplify (sqrt(2268) + sqrt(2268)2 + sqrt(189)/sqrt(48))/(sqrt(72)/(-2sqrt(8)) - (sqrt(729) + -1sqrt(729))). -73sqrt(7)/2 Simplify 1 + (0 + (-1-1sqrt(57)4)/(sqrt(75) + sqrt(75) + sqrt(75)1-1))*2. 329/25 Simplify (-2(-3(-1sqrt(392) + sqrt(392)))/sqrt(7))/(sqrt(40)/(-3sqrt(5) + sqrt(5)) - -5(sqrt(8)-2 + sqrt(8))). 0 Simplify (sqrt(243) + sqrt(243) + -3sqrt(243) + sqrt(243) + (-3sqrt(36))/sqrt(12))2 + (sqrt(27) + -5 - (sqrt(3) - (4 + sqrt(147))2)). 58sqrt(3) + 185 Simplify -3(1 + (sqrt(931) + 2 + sqrt(931) + 1 + sqrt(931) + sqrt(931) + 2 + -2)2)4. -178872 - 2016sqrt(19) Simplify ((sqrt(88) + sqrt(88)-3-2)/(-6(sqrt(72)-1 + sqrt(72)) + sqrt(72))4)*2 + 1. 8633/9 Simplify (4(sqrt(99) + sqrt(99) + (-1sqrt(99) - sqrt(99) - sqrt(99)) + sqrt(99)))/(sqrt(144)/sqrt(4)) + (2-1(sqrt(1100) - sqrt(1100)-4))*2. 110000 Simplify ((1sqrt(100)2)/(1sqrt(30)/sqrt(3)))/((sqrt(2160)2)/(sqrt(108)-2)). -sqrt(2) Simplify ((43sqrt(190) - 4sqrt(190)-3)-3)/((sqrt(160) + (sqrt(160) - (sqrt(160)-2 + sqrt(160))) + sqrt(160) + sqrt(160) + (-1sqrt(80))/sqrt(2))-2). 2sqrt(19) Simplify -2 + ((4 + sqrt(1377) + 0)2 - sqrt(1377)) + 3 + 0 + -1 + sqrt(1377) + 1 + -2. 72sqrt(17) + 1392 Simplify (-6sqrt(2112)2)/(-2sqrt(275) + sqrt(396)-2). 48sqrt(3)/11 Simplify (((sqrt(440)-1 + sqrt(440))/sqrt(8))/sqrt(5)-6 + 4 + (sqrt(891) - 6-3sqrt(891)))2. 1368sqrt(11) + 321667 Simplify (4(sqrt(16) + -2sqrt(144)/sqrt(9))2)/((6sqrt(64))/sqrt(8) + sqrt(8) - sqrt(56)/(sqrt(63)/sqrt(9))). -4sqrt(2)/3 Simplify ((sqrt(500) + 2 + -5)2 + 5)-1 + 3(-1(sqrt(500) - (sqrt(500) + 3)) + sqrt(500) + -2)*2. 120sqrt(5) + 989 Simplify (1(sqrt(5082) + (sqrt(5082) + 1sqrt(5082) - sqrt(5082))) - 2(sqrt(5082) - sqrt(5082)1))/(-25sqrt(864)1). -11sqrt(7)/60 Simplify ((sqrt(102) - (sqrt(102)2-3 + sqrt(102))) + 3sqrt(102)-2)/(sqrt(150) - -32sqrt(150))5 + -5. -5 Simplify (4sqrt(75)-222 - (sqrt(24)/(2sqrt(8))3 - (sqrt(24)/sqrt(72) + 5)))2. -4835sqrt(3)/3 + 935389/12 Simplify ((sqrt(2268) + -2(4sqrt(2268) - sqrt(2268)) + sqrt(2268))/(sqrt(36)/(sqrt(144)2)))2 + -3. 580605 Simplify ((-5 + 0 + sqrt(1053) + 3 + 2(sqrt(1053) + 0)-6)-5 + 4)*2. 13860sqrt(13) + 3185521 Simplify ((sqrt(209)-1-3 - (sqrt(209)2-2 + sqrt(209) - sqrt(209) - sqrt(209)))-1)/((sqrt(77) - (sqrt(77)-22 + sqrt(77)))/(sqrt(252)/sqrt(4))). -6sqrt(19) Simplify -5 + -1(-5 + sqrt(343) + (sqrt(343) - (sqrt(343) + 1))2 + 5)-2-2. -28sqrt(7) - 9 Simplify -3 + ((sqrt(77) - sqrt(77)12) + 2(sqrt(77)-1 - sqrt(77)))/(4(-1sqrt(66))/sqrt(6)). -3 + 5sqrt(7)/4 Simplify 5-3(-5(sqrt(77) - -5(sqrt(77) + -2sqrt(77))))/((sqrt(99)-1)/sqrt(9) + sqrt(704)-2)3. 900sqrt(7)/17 Simplify -2 + (6(3sqrt(85) - sqrt(85))2)/((sqrt(250)/sqrt(1210))/sqrt(5)). -2 + 264sqrt(17) Simplify (-1(3 + ((sqrt(84)/sqrt(3))/sqrt(4))2 + sqrt(7)) - ((2sqrt(77) - sqrt(77))2)/(sqrt(44)-4))-4. 3sqrt(7) + 40 Simplify (-2sqrt(18)3)/(sqrt(81)-3) - (sqrt(40)/sqrt(160))/(sqrt(288) + sqrt(288)2). 95sqrt(2)/144 Simplify 4(((sqrt(180)-14)/sqrt(6)-1)/(-1sqrt(360)-5-5))*2. 16/1875 Simplify (1sqrt(144)3 - (sqrt(144) + (sqrt(144) - -2-1sqrt(144))))/(6((2sqrt(72) + sqrt(72))-2)/sqrt(9)). -sqrt(2)/4 Simplify -3((-2(sqrt(432) + sqrt(432) + -4 + 4 + -3 + sqrt(432) + 3))*2 + -5). -46641 Simplify -1 + (1 + sqrt(52) - sqrt(39)/sqrt(27)) - (2 + (1sqrt(1300))*2 + (2sqrt(13))*24). -1510 + 5sqrt(13)/3 Simplify ((((sqrt(5) - (sqrt(30)/sqrt(6) + -4)) + -4)3 - (-4 + sqrt(5) + sqrt(80) + -5)6)-2)*2. -12960sqrt(5) + 29664 Simplify (((sqrt(675) - sqrt(27))6 - 2sqrt(27)-1) + (sqrt(75) + -5 + 3 + sqrt(75) - (-1 + 1sqrt(75))))*2. -166sqrt(3) + 20668 Simplify (((sqrt(98) - -2sqrt(98))2 - sqrt(2)) + sqrt(6)/(-4sqrt(3)) + (3 + sqrt(18) + -4)-3)-3. -2655 + 123sqrt(2)/4 Simplify (-4-5(sqrt(720) + sqrt(720)-1)1 - -4(((-1 + sqrt(720) + sqrt(720))-6)2 + (-5(1 + sqrt(720)))*2)) + 4. -4512sqrt(5) + 486968 Simplify ((-1 + (sqrt(1216) - (sqrt(1216) + -5sqrt(1216))) + 1 + 1)-3 + 4)*2. -240sqrt(19) + 273601 Simplify (-4 + -2((sqrt(1539) + (sqrt(1539) + sqrt(1539) + 0 + -5 - sqrt(1539) - sqrt(1539)) - sqrt(1539)) + (sqrt(1539) + 0 + -2 - sqrt(1539)) + -3))2. 256 Simplify 5(-4 + (sqrt(684) + 1sqrt(684)-1 - (sqrt(684) + 1)3) + 0 + (2sqrt(684) - sqrt(684))3)2. 245 Simplify (4((-3*(-1 + sqrt(53	{ "pile_set_name": "DM Mathematics" }
Let a(s) = 35s2 - 4s - 1. Calculate -6a(m) - 4t(m). -66m2 - 2 Let p(l) = 5l. Let i(t) = 17t. What is -5i(u) - 35p(u)? -260u Let l(i) = 2i3 - 7i*2 - 3i - 4. Let a(f) = -2f3 + 6f*2 + 2f + 3. Calculate -6a(b) - 5l(b). 2b3 - b2 + 3b + 2 Let z(g) = -4g - 22. Let d(j) = 11431 - j + j - 11420 + 2j. What is 9d(i) + 4z(i)? 2i + 11 Let v(t) = -8t. Let s(b) = 31b. Let f = -923 + 949. What is fv(r) + 6s(r)? -22r Let q(x) = -x*2 - x - 1. Let l(r) = 7r*2 - 6r - 7. Calculate l(b) - 6q(b). 13b2 - 1 Let y(c) = c2 + 3c + 1. Let g(s) = -2s*2 - 18s - 63. Calculate -g(j) - 6y(j). -4j*2 + 57 Let r(x) = 1 - 4x*3 + x + 1 + 5x*2 - 5. Let g(n) = -7n*3 + 9n*2 + n - 5. Suppose -3k = -35k + 160. What is kr(v) - 3g(v)? v3 - 2v*2 + 2v Let j = -187 - -190. Let s(g) be the third derivative of 0g + 5g*2 + 1/24g*4 + 0 - 1/6g*j. Let u(v) = v - 1. What is 4s(f) - 3u(f)? f - 1 Let l(t) = -4. Let u(y) = -y. Let o be (-2)/(-1) + 12 + -44. Let z = 28 + o. Calculate zu(v) - l(v). 2v + 4 Let a(q) = -3q*3 - 2q - 6. Let i(p) = -81 + 41 + 41 + p. What is a(r) + 2i(r)? -3r*3 - 4 Let f(s) = -3s. Let z(h) be the second derivative of -3h + 0 + 4h*2 - 1/6h*3. Let g be z(5). Let r(w) = -4w. Calculate gf(l) - 2r(l). -l Let z(w) = 30w - 10. Let v(h) = -6h + 1. Determine -6v(m) - z(m). 6m + 4 Let z(j) = -4j3 - 2j*2 + 5j - 2. Let y(l) = -8l2 - l2 + 0l*2 - 30l*3 - 9 + 21l + 13l3. Calculate -2y(i) + 9z(i). -2i*3 + 3i Let q(z) = -z + 1. Let t be (-4)/(-14)-1 + 400/28. Let l be (-2)/(7/(t/4)). Let h(d) = 3d - 3. Calculate lh(f) - 2q(f). -f + 1 Let w(q) = -7q3 - 4q*2 + 7q + 7. Let h(f) = 2f3 - f - 1. Let u(r) = 3h(r) + w(r). Let o(c) = c*3 + 3c*2 - 3c - 3. What is 4o(j) + 3u(j)? j*3 Let d(j) = -15j*2 - 24j - 37. Let p(h) = -8h2 - 13h - 19. Give -6d(x) + 11p(x). 2x2 + x + 13 Let s(u) be the first derivative of 3u*2/2 + 2u - 35. Let k(c) = 3c + 3. Determine -2k(i) + 3s(i). 3i Let o(x) = 6x2 - 93x + 4. Let h(m) = -10m2 + 95m - 5. Calculate -2h(s) - 3o(s). 2s2 + 89s - 2 Let d(c) = 81c2 + 33c + 33. Let r(i) = -4 - 11i2 - 10i*2 + 20i*2 - 9i*2 - 4i. Give 4d(x) + 33r(x). -6x2 Let o(p) = -5p - 2. Let q be o(-1). Suppose i = 2g + 12, qi + i + 43 = -5g. Let w(j) = -10j - 7. Let s(n) = -7n - 5. Determine gs(c) + 5w(c). -c Let c(o) = -2o*3 + 4o*2 - 4o + 1. Let s(v) = -v*3 + 3v*2 - 4v + 1. Suppose 8 = 4q - 4t, 3q - 4t - 6 + 2 = 0. Determine qs(w) - 3c(w). 2w3 - 4w + 1 Let b(p) = 0p3 - 2p*3 - 26p + 23p + 2. Let o(g) = -5g*3 - 6g + 4. Determine 9b(l) - 4o(l). 2l3 - 3l + 2 Let j be (-3)/9-3 + 4. Let t(z) = -3z*3 + 5z + 1. Let u(o) be the second derivative of -o5/5 + o3 + o*2/2 + 55o. Determine jt(m) - 4u(m). m3 + m + 1 Let d(g) be the third derivative of -g5/20 + g*4/12 + 5g*3/6 - 224g*2. Let u(n) = 9n*2 - 5n - 14. Calculate 8d(x) + 3u(x). 3x2 + x - 2 Let h(a) = -47a - 1. Let p(u) = -46u - 1. What is 2h(y) - 3p(y)? 44y + 1 Let t(g) = 131g3 + 2g2 + g + 1. Let l(p) = p3 - 2p2 - 1. Give l(a) + t(a). 132a*3 + a Let l(f) = -261f*3 - 27f2. Let r(s) = -s2. Give -l(t) + 27r(t). 261t*3 Let w(s) = -5s*3 + 2 - 2 + 3 + 3s. Let r(j) = -11j3 + 7j + 7. Let b be ((-6)/9 + (-12)/18)/((-22)/99). Calculate br(m) - 14w(m). 4m3 Let b(h) = 22h. Let u(k) = -k*3 + 10k*2 - 8k + 7. Let t be u(9). Let l(p) be the second derivative of 7p3/6 - 552p. What is tl(x) - 5b(x)? 2x Let t(f) = -11f - 5. Let n(m) = -5m - 3. Suppose i = 3i + 2l - 14, -4l + 8 = 0. Determine in(j) - 3t(j). 8j Suppose -p = -92 + 97. Let k(b) = 20b*3 + 2b*2 + 6b*2 - 8 - 16 + 24b + 16b2. Let h(v) = -4v*3 - 5v*2 - 5v + 5. Determine pk(o) - 24h(o). -4o3 Let j(w) = w3 - 4w*2 + 2w + 4. Let f be j(3). Let n(d) = -d - 1. Let u(v) = 1280 - 2562 + 1279 - 4v. What is fn(g) - u(g)? 3g + 2 Let z(l) = 2. Let w(s) = -5. Let x(r) = 6w(r) + 14z(r). Let g(a) = -4a - 5. Let i(q) = 3q + 3. Let m(k) = 5g(k) + 7i(k). Give -2m(v) + 5x(v). -2v - 2 Let z(s) = -127s - 2. Let l(d) = 64d + 1. Determine 9l(b) + 4z(b). 68b + 1 Suppose 3l - 2r = -14, -l - 2r - 20 + 10 = 0. Let x(y) = 2y2 - 5y. Let c(q) be the second derivative of q*3/3 + 3q. Determine lc(v) - 2x(v). -4v2 - 2v Let w(l) = 6l3 + 5l*2 - 894. Let j(n) = -5n*3 - 4n*2 + 893. What is 5j(m) + 4w(m)? -m3 + 889 Let m = 580 - 582. Let b(n) = 3n*2 - n + 2. Let h(x) = 13x*2 - 3x + 8. What is mh(j) + 9b(j)? j*2 - 3j + 2 Let s(w) = -4w3 - w2 + 3w. Let i(r) = r3 + r2 - r. Suppose 0 = 4v + 1 + 3. Suppose 2m - 17 + 19 = 0. Give ms(t) + vi(t). 3t3 - 2t Let a(s) = s*2 - s + 1. Let l be 534/(-8) - (-14)/(-56). Let x = l - -68. Let b(m) = -3m*2 + 5m - 8. Give xb(r) + 5a(r). 2r2 - 3 Let p(j) be the second derivative of 5j*4/12 - 2j*2 - 10j. Let r(y) = -y*2 + 1. Give -p(d) - 4r(d). -d*2 Let m(b) = -b + 1. Let k be (-12)/(-18) + 39/9. Let d(a) = 3a - k - 9 + 10. Determine d(p) + 2m(p). p - 2 Let n(a) = 3a*2 + 5a + 5. Let t(u) be the second derivative of -u*4/2 - 3u*3/2 - 9u*2/2 - 28u + 1. What is 7n(k) + 4t(k)? -3k2 - k - 1 Let r(a) = 3a*2 + 3a - 6. Let q(h) = -h*2 - 17h + 164. Let l be q(7). Let m(i) = -1. Give lm(y) + r(y). 3y*2 + 3y - 2 Let m(q) = 2q2 + 2q. Suppose -3h + 17 - 4 = r, -5r = -20. Let f(y) = -y*2 + 3y*2 - 5y*2 - 3y + 0y. What is hf(o) + 4m(o)? -o2 - o Let a(q) = 51q - 26. Let u(m) = -33m + 17. Calculate 5a(r) + 8u(r). -9r + 6 Let k be 52/6 + 10/(-15). Let n(g) = 15g + 3 - 2g + k. Let r(j) = -179 - 4j - 2j + 174. Determine -4n(u) - 9r(u). 2u + 1 Let d(c) = -14c*3 - 5c*2 - 3c + 8. Let b(x) = -5x3 - 2x*2 - x + 3. Suppose 75 = -2q + 7q. Let h be 10/q - 21/(-9). Give hd(f) - 8b(f). -2f3 + f2 - f Let h(x) = -1. Let b(u) = -2u + 1. Let r = -132 + 131. Calculate rh(g) + b(g). -2g + 2 Let v(k) = 3k*2 - 2k. Let l be v(1). Let i(n) = -2. Let j(c) = c + 3. Let q(d) = -6i(d) - 2j(d). Let z(h) = -1. Calculate lq(a) + 4z(a). -2a + 2 Let r(w) = 1259w*2 + 8w - 8. Let l(a) = 419a2 + 3a - 3. Give 8l(u) - 3r(u). -425u2 Let d(q) = -9q + 4 + 5q - 5 + 3q. Suppose a - 3 = -2. Let g = -2 + a. Let o(n) = -n*2 - 3n - 2. Give go(v) + 3d(v). v*2 - 1 Suppose -2t = 3k + 2, -t + 0 = 4k + 1. Let m(j) = -j*3 - j + 1. Let q(b) = 3b*3 - 3b*2 + b - 1. Determine tq(l) - m(l). -2l3 + 3l*2 Let x(o) = 6o*2 - 3o - 3. Suppose -4b + 2v + 2v + 32 = 0, 0 = -2v - 10. Let c(w) = 13w2 - 7w - 7. What is bc(n) - 7x(n)? -3n2 Let z be 6 + 0/(-13)(-1)/(-2). Let x(c) be the second derivative of c*3/3 + 3c*2 - c. Let b(f) = -1. What is zb(i) + x(i)? 2i Let q(r) = -9r + 2. Let l(n) = 46n - 11. Determine -6l(y) - 33q(y). 21y Let h(l) = l*3 + 2l + 2. Let q = -22 - -16. Let y(f) = -966f3 + 483f*3 + 11 + 11f + 489f3. Give qy(w) + 33h(w). -3w*3 Let u(q) = 24q*2 + 13q - 25. Let h(o) = -13o2 - 7o + 13. Calculate 11h(d) + 6u(d). d*2 + d - 7 Let r(q) = 17q*2 + 5q - 18. Let l(a) = 17a2 + 4a - 13. What is 3l(n) - 2r(n)? 17n2 + 2n - 3 Let m(y) = 25y - 15. Let o(i) = -2i. Calculate m(f) + 6o(f). 13f - 15 Let x(r) = 7r2. Suppose 5s = -10b + 8b + 37, -3s + 4b = -17. Let w(d) = -d + 8d2 + 8 + s - 15. Determine -2w(i) + 3x(i). 5i*2 + 2i Let h(o) = -9o2 + 2o. Let y(w) = 7w2 - 72w - 9w - 66w*2 + 419w*2. Determine 81h(v) + 2y(v). -9v*2 Let x(c) = -1 + 1 + 23c - 22c. Let t(d) = -2d - 1. Let k(j) = t(j) + 3x(j). Let y(b) = -2b*2 - 2b + 6. Give -4k(o) - y(o). 2o*2 - 2o - 2 Let x(f) = 68f - 9. Let k(t) = 23t - 3. Calculate 11k(w) - 4x(w). -19w + 3 Let o(f) be the third derivative of -f6/30 + f5/60 + f4/12 - 18f*2. Let j be (-15)/10(-8)/(-12). Let b(g) = -g*3 + g. What is jo(k) + 2b(k)? 2k3 - k2 Let p(x) = -35x - 7. Let a(o) = -35o - 10. Determine 2a(g) - 3p(g). 35g + 1 Let d(i) = 4i - 6. Let h(c) = -c3 - c2 - 1. Let x = -24 - -24. Let o be h(x). Let t(f) = 1. Determine od(q) - 6t(q). -4q Let d(w) = w2 + 4w - 5. Let h(r)	{ "pile_set_name": "DM Mathematics" }
to base 11. 547 Convert 21354 (base 6) to base 4. 232012 213111 (base 4) to base 6 15353 111100010000001 (base 2) to base 4 13202001 -10841 (base 10) to base 7 -43415 What is -5181 (base 13) in base 5? -330014 Convert 95d (base 15) to base 13. c67 Convert -1120010 (base 3) to base 16. -471 -145 (base 15) to base 3 -101202 -1810 (base 11) to base 8 -4406 -12032 (base 5) to base 3 -1020001 Convert 33772 (base 9) to base 2. 101011111100110 -1012011 (base 3) to base 9 -1164 -11232 (base 6) to base 10 -1604 Convert 111111101 (base 2) to base 5. 4014 d8 (base 16) to base 5 1331 -4b (base 13) to base 16 -3f What is -10000001001 (base 2) in base 3? -1102021 1900 (base 15) to base 12 3160 Convert -1001003 (base 4) to base 15. -1378 -264 (base 8) to base 7 -345 Convert 130131 (base 4) to base 14. 941 Convert 1136 (base 11) to base 4. 113103 What is -36627 (base 10) in base 9? -55216 What is 6f31 (base 16) in base 3? 1110001021 What is -1846 (base 10) in base 6? -12314 203454 (base 7) to base 9 52753 What is -102 (base 8) in base 7? -123 -125 (base 7) to base 5 -233 33b (base 16) to base 4 30323 -242 (base 13) to base 8 -610 Convert -244132 (base 5) to base 10. -9292 Convert 18c6 (base 15) to base 5. 132421 -c10b (base 14) to base 10 -33135 What is 303221 (base 4) in base 7? 12431 -10012 (base 5) to base 14 -332 What is -126175 (base 9) in base 16? -12b96 Convert 21c (base 14) to base 13. 262 Convert -10305 (base 9) to base 12. -3b35 Convert 39b (base 14) to base 5. 10400 -150243 (base 8) to base 3 -2201021012 -10796 (base 12) to base 14 -7d74 -10402 (base 5) to base 9 -887 Convert 11101031 (base 4) to base 9. 32538 Convert -12a0 (base 14) to base 13. -1650 Convert -1111442 (base 6) to base 15. -1195e 519 (base 12) to base 10 741 -2db (base 14) to base 11 -492 Convert 95b1 (base 15) to base 14. b77c 2200012121 (base 3) to base 6 1043411 Convert -22121 (base 3) to base 16. -e8 762 (base 9) to base 16 26f -11ccc (base 13) to base 2 -1000000010111010 Convert 116 (base 12) to base 5. 1122 -31 (base 14) to base 8 -53 What is -163b (base 15) in base 8? -11255 2524 (base 7) to base 14 4bb What is -4234 (base 9) in base 4? -300211 What is -10100110111100 (base 2) in base 11? -8033 What is 2033 (base 5) in base 14? 152 Convert -4817 (base 12) to base 10. -8083 Convert -1514 (base 8) to base 16. -34c What is -513440 (base 6) in base 12? -1b880 -110411 (base 6) to base 7 -35614 Convert 1202 (base 8) to base 11. 534 -76450 (base 8) to base 11 -22088 Convert 456 (base 8) to base 10. 302 378 (base 9) to base 16 13a Convert 130052 (base 6) to base 2. 10110110110000 What is 1a31 (base 12) in base 7? 12226 -8026 (base 12) to base 13 -63c9 What is -a5a (base 11) in base 13? -771 2456 (base 11) to base 6 22503 -26757 (base 10) to base 9 -40630 Convert 51117 (base 9) to base 12. 17567 What is -1232342 (base 5) in base 8? -57041 Convert 6609 (base 14) to base 10. 17649 What is 4d5 (base 14) in base 11? 803 What is 317 (base 8) in base 2? 11001111 Convert -2363 (base 10) to base 3. -10020112 Convert 383 (base 15) to base 6. 3410 -63 (base 7) to base 12 -39 What is -1206 (base 7) in base 2? -110111111 Convert 11a4 (base 13) to base 15. b1a What is 9ec1 (base 16) in base 11? 28597 What is -3592 (base 14) in base 2? -10010001111100 What is 718a (base 11) in base 10? 9536 1309 (base 10) to base 6 10021 What is 1060 (base 11) in base 13? 836 112120 (base 4) to base 15 657 Convert 11000110101 (base 2) to base 11. 1215 What is 27560 (base 8) in base 12? 7040 Convert 3654 (base 16) to base 14. 50d6 What is 72 (base 9) in base 16? 41 1895 (base 10) to base 4 131213 -30a6 (base 16) to base 2 -11000010100110 Convert 101011000100 (base 2) to base 9. 3702 What is -101000110111 (base 2) in base 5? -40430 What is 33021 (base 8) in base 16? 3611 What is 32 (base 15) in base 16? 2f What is 2231110 (base 4) in base 6? 123204 4122 (base 9) to base 4 233021 3066 (base 9) to base 5 32442 -1ed8 (base 16) to base 15 -2516 Convert -22037 (base 8) to base 11. -6a47 What is -11310002 (base 4) in base 8? -56402 What is 0 (base 10) in base 7? 0 -3744 (base 10) to base 13 -1920 -3586 (base 11) to base 7 -16452 What is -2111 (base 3) in base 16? -43 Convert 464 (base 7) to base 16. f2 -aa20 (base 14) to base 15 -8abd Convert 336 (base 10) to base 8. 520 Convert 1a15c (base 13) to base 6. 1031025 What is -420 (base 11) in base 8? -772 What is 1011010100 (base 2) in base 13? 439 Convert 8181 (base 11) to base 15. 333d What is 2033 (base 7) in base 12? 4b2 Convert 1426 (base 7) to base 11. 469 4dc (base 14) to base 15 453 -4977 (base 13) to base 2 -10100010100111 Convert -15b (base 13) to base 5. -1440 What is -1b9e (base 15) in base 7? -23330 -331b (base 15) to base 5 -321301 -1000220 (base 3) to base 10 -753 -15219 (base 11) to base 4 -11100312 What is -100110 (base 2) in base 9? -42 -14457 (base 9) to base 3 -111111221 Convert 4475 (base 8) to base 14. c0d What is -30c (base 13) in base 5? -4034 Convert -27067 (base 10) to base 16. -69bb Convert 144 (base 13) to base 7. 441 What is 68562 (base 9) in base 5? 2430114 Convert -ca2 (base 13) to base 8. -4160 What is -1620 (base 8) in base 14? -492 What is 1b64 (base 13) in base 15? 135d Convert -211020201 (base 3) to base 12. -9477 What is -324a (base 14) in base 3? -102220212 Convert -13a5d (base 14) to base 16. -be33 -1011110001 (base 2) to base 16 -2f1 What is 29b (base 12) in base 16? 197 41c (base 14) to base 16 32a -38 (base 12) to base 9 -48 What is -22461 (base 10) in base 9? -33726 Convert -234232 (base 5) to base 13. -3c58 What is -220202 (base 3) in base 14? -35a Convert 356 (base 9) to base 15. 149 Convert 135 (base 14) to base 11. 201 -33052 (base 6) to base 5 -121233 What is 5d1 (base 14) in base 12? 80b What is 3014 (base 9) in base 3? 10000111 What is -51b6 (base 12) in base 11? -6781 8a6 (base 14) to base 3 2100111 Convert 1213101 (base 4) to base 13. 3015 Convert -1232112 (base 4) to base 2. -1101110010110 -116cf (base 16) to base 4 -101123033 Convert -48820 (base 9) to base 13. -11b98 -1202212 (base 3) to base 5 -20132 What is -22111100 (base 3) in base 10? -6192 What is 195 (base 13) in base 5? 2131 What is -12466 (base 9) in base 13? -3a95 Convert 3044121 (base 5) to base 14. 14291 What is 701 (base 11) in base 16? 350 Convert -2164 (base 13) to base 14. -199b Convert -2492 (base 10) to base 15. -b12 -15744 (base 8) to base 11 -5401 1227 (base 15) to base 4 330112 -10100010111 (base 2) to base 16 -517 What is -23744 (base 10) in base 5? -1224434 Convert 2042 (base 5) to base 9. 332 Convert 10300 (base 7) to base 8. 4764 What is -1121221 (base 5) in base 13? -925a Convert 440 (base 12) to base 6. 2520 Convert -421335 (base 6) to base 2. -1000010011111011 What is 69a2 (base 13) in base 12? 8703 What is -41204 (base 6) in base 7? -21652 What is -369 (base 14) in base 6? -3053 -653 (base 14) to base 7 -3433 Convert 13356 (base 7) to base 13. 1854 What is -da9 (base 16) in base 8? -6651 Convert 7471 (base 9) to base 13. 2665 -11200220 (base 3) to base 12 -1b96 What is 340 (base 13) in base 5? 4214 What is -38 (base 13) in base 11? -43 What is -2100003 (base 4) in base 5? -243334 10264 (base 7) to base 13 120a What is -11078 (base 13) in base 3? -1120022212 -2203 (base 12) to base 14 -1519 -407 (base 13) to base 4 -22223 What is 101101100001 (base 2) in base 5? 43123 Convert 10143 (base 10) to base 2. 10011110011111 What is -d63 (base 14) in base 5? -41020 What is -12 (base 14) in base 15? -11 558 (base 11) to base 16 29c What is 1112220022 (base 3) in base 14? b1bb -1121 (base 5) to base 16 -a1 Convert 1e (base 15) to base 16. 1d Convert -14300 (base 5) to base 6. -5320 12400 (base 6) to base 16 750 2400143 (base 5) to base 13 16c21 -1000111011011 (base 2) to base 7 -16220 Convert -13db (base 15) to base 7. -15260 Convert 376 (base 11) to base 4. 12332 Convert 1339 (base 14) to base 2. 110100110111 What is 1cd9 (base 15) in base 3? 22121120 38b5 (base 14) to base 16 26e7 Convert -1132112 (base 4) to base 14. -22b4 What is -184 (base 14) in base 16? -138 What is -104401 (base 5) in base 10? -3726 Convert -7711 (base 8) to base 16. -fc9 Convert -220120 (base 5) to base 6. -54515 What is 200 (base 16) in base 7? 1331 What is -4442 (base 5)	{ "pile_set_name": "DM Mathematics" }
(l) = -r(l) + 10u(l). Let z(v) = 7v*2 - 5v. What is 5h(i) - 16z(i)? -2i2 Let i(v) = 11 - v3 + 5v*3 - 5v*2 + 16v*2 - 4v*2. Let t(w) = 2w*3 + 3w*2 + 5. Give -6i(o) + 14t(o). 4o*3 + 4 Let y(r) = -2r*2 + r + 1. Let x(m) = 138m*2 - 4m - 2. Determine x(p) + 4y(p). 130p*2 + 2 Let z(v) = -37v*3 - 7v*2 - v - 2. Let j(n) = 19n*3 + 3n*2 + 1. Give -5j(l) - 2z(l). -21l3 - l2 + 2l - 1 Let o(n) = -13n*3 + 28n*2 - 23n - 14. Let l(y) = -9y3 + 19y*2 - 15y - 10. What is -7l(q) + 5o(q)? -2q3 + 7q*2 - 10q Let d(v) = -2v - 3. Let q(t) = 98t + 536 - 533 - 96t. Determine 5d(f) + 4q(f). -2f - 3 Suppose -3f + 6 = -3. Suppose -fd = 20 - 8. Let w(i) = -21i3 + 27i - 27. Let g(r) = -3r3 + 4r - 4. Give dw(o) + 27g(o). 3o3 Let s(x) = x2 + 1. Let p(b) = 6b*2 - 2. Let d = 722 + -720. What is ds(w) + p(w)? 8w2 Suppose 5w + 20 = 5l, -4w - 22 + 0 = 2l. Let a(c) = -c. Let t(d) = -d2 + 4d - 1. Determine wa(z) - t(z). z2 + z + 1 Let q(r) = r. Let b(v) = -6v. Let y(p) be the second derivative of -p*3/3 - 31p*2/2 + 9p. Let g be y(-13). Give gq(d) - b(d). d Let m = -1029 + 1016. Suppose -r = 4r - 10. Let w = r + -8. Let z(c) = -c*2 - 7c - 1. Let k(j) = 2j2 + 15j + 2. Calculate mz(v) + wk(v). v2 + v + 1 Let i = 132 - 127. Let o = 1 - 4. Let r(g) = -g3 - 4g2 + 3g - 3. Let m(v) = -v*3 - 7v*2 + 5v - 5. Calculate ir(k) + om(k). -2k3 + k2 Let i(f) = 3f. Let w(d) = 1. Let h = 140 - 141. Calculate hi(n) + 2w(n). -3n + 2 Let s(u) = 2u*2 + 2u + 1. Let b be 34/(-10) - 302/(-755). Let w(q) = -4q2 - 5q - 3. Let y = 14 - 21. Determine bw(k) + ys(k). -2k2 + k + 2 Let c(o) = 32o + 9. Let p(j) = -j - 6. Give -c(d) - p(d). -31d - 3 Let u(y) = -63y + 190y + 15 - 54y - 64y. Let g(f) = -1. What is -15g(h) - u(h)? -9h Let c(f) = 423f - 51. Let k(n) = 211n - 29. What is -4c(i) + 7k(i)? -215i + 1 Let p(m) = m*3 - 5m. Let g(l) be the third derivative of -l4/6 - l2. Let o = -491 + 495. What is op(k) - 5g(k)? 4k3 Let c = 576 + -573. Let b(h) be the second derivative of 13h*3/3 - 5h*2 - 2h. Let z(j) = -5j + 2. What is cb(a) + 16z(a)? -2a + 2 Let s(i) = 2i + 1. Let v(a) = -3a - 5. Let o(t) = s(t) + v(t). Let w(l) = 3l + 9. Give -13o(n) - 6w(n). -5n - 2 Let b(d) be the third derivative of d5/10 - d4/4 + 11d3/6 - d2 - 134. Let k(v) = v2 - v + 2. Give -2b(h) + 11k(h). -h2 + h Let x(r) = 4r*3 - 6r + 5. Let i(q) = 2q3 - 3q + 2. Suppose 4o + 2 = 4j - 14, 2o - 6j = -4. Calculate oi(u) + 2x(u). -2u3 + 3u Let g(i) = -i*2 + i + 2. Let k(j) = -6j*2 - 2j + 16. What is 8g(x) - k(x)? -2x*2 + 10x Let q(y) = y*2 + 2y. Let g(l) = l*2 + 3l + 1. Suppose 14 + 2 = -4v. What is vq(s) + 3g(s)? -s2 + s + 3 Let j(p) = -47p*2 - p + 2. Let y(l) = 189l*2 + 2l - 10. What is 9j(h) + 2y(h)? -45h2 - 5h - 2 Let j(r) = -r + 1. Let h = 1 - -1. Let i(g) = 7 - hg - 2g + g + g. What is -i(t) + 3j(t)? -t - 4 Let h(r) = 5r*3 + 6r*2 + 6r + 6. Let g be 192/15 - (-117)/(-65). Let d(o) = -10o3 - 11o*2 - 11o - 11. Give gh(b) + 6d(b). -5b3 Let y(p) = -11p - 141. Let m(i) = 4i - 3. Give -4m(t) - y(t). -5t + 153 Let r(d) = -2d*3 - 1. Let v(t) = 33t*3 + 18. Determine -18r(p) - v(p). 3p3 Let z(o) = -16o*3 + 22o*2 - 26o - 4. Let m(s) = -4s3 + 5s*2 - 6s - 1. Determine -18m(v) + 4z(v). 8v3 - 2v*2 + 4v + 2 Let x be (-20)/(0 - -4)9-1. Suppose 0n = -n - x. Let v(d) = -155d + 45. Let z(c) = -7c + 2. Determine nz(i) + 2v(i). 5i Let c(r) be the first derivative of -3r4/4 + 2r3/3 - r2/2 - 5r + 453. Let j(n) = 4n*3 - 3n*2 + n + 6. Calculate -6c(f) - 5j(f). -2f*3 + 3f*2 + f Let n(h) = -2h*2 - 228h - 11. Let c(d) = -d*2 - 117d - 5. Determine -5c(a) + 2n(a). a*2 + 129a + 3 Let q(g) = 4g2 - 5g - 6. Let f be 3 - -2 - 0/(-1). Suppose -3b = -8b + f. Let d(y) = y*2 - y - 1. Let t be 224/(-36) + 2/9. Calculate bq(i) + td(i). -2i2 + i Let n(h) = 1 - h2 + 2h3 - 161h + 156h + 4. Let b(m) = m + 2. Let t be b(3). Let v(i) = i3 - 3i + 3. Determine tv(k) - 3n(k). -k*3 + 3k*2 Let w(h) = 1. Let v(u) = -2u3 + u + 2. Let l(g) = g3 - 6g - 3. Let i be l(-2). Determine iv(s) - 2w(s). -2s3 + s Let b(s) = s3 - s - 1. Let l(y) = -9y3 + y2 + 4y + 5. Give 4b(c) + l(c). -5c3 + c2 + 1 Let i(m) be the second derivative of -2m - 1/2m*2 - 1/3m*4 - 5/6m*3 + 4. Let z(g) = g. What is -i(x) - 5z(x)? 4x2 + 1 Let b(i) = -8i*2 + 5i - 525. Let u(o) = -13o2 + 8o - 788. Determine 8b(d) - 5u(d). d*2 - 260 Let i(m) = 301m*3 - 5m*2 - 10m. Let d(z) = -36873z3 + 612z*2 + 1224z. Determine -5d(b) - 612i(b). 153b3 Let n(w) = 9w*2 - 56w. Let f(c) = -18c2 + 109c. Give 3f(j) + 5n(j). -9j2 + 47j Let s(w) = -2w2 - 4w - 2. Suppose -7z - 17 + 45 = 0. Suppose n + zn - 5 = 2x, -4x = n - 23. Let a(k) = 3k2 + 7k + 4. Determine xs(j) + 3a(j). -j*2 + j + 2 Let m(s) = -2s*3 + 3s. Let v(a) = -7a3 + 11a. Let j be -54/10 + (-4)/1. Determine jv(d) + 22m(d). -2d*3 Let t(s) = -15s*3 - 20s*2 - 3s. Let l(f) = -11f3 - 20f*2 - 2f. Give 3l(j) - 2t(j). -3j3 - 20j*2 Let g(c) = 10c*2 + 12c. Let z be (2/6)/((-17)/(-153)). Suppose 2b = zl - 14, 0 = 3b + 3l - l - 5. Let f(d) = d*2 + d. Give bg(r) + 12f(r). 2r*2 Let t(l) = 42l - 7. Let s(m) = -42m + 6. Give -6s(w) - 5t(w). 42w - 1 Let k(c) = 238c3 - 5c*2 + 8c - 4. Let d(m) = 2m2 - 2m + 1. Determine -4d(f) - k(f). -238f*3 - 3f*2 Let j(k) = -1144k*2 + 88k + 44. Let i(c) = 127c2 - 10c - 5. Determine 44i(h) + 5j(h). -132h2 Let b(o) = o2 - o. Let f(r) = 39r*2 + 9r. Calculate -5b(p) - f(p). -44p*2 - 4p Let m(t) = t. Let o = 119 + -124. Let j(f) = -f + 1. What is om(l) - j(l)? -4l - 1 Let u(m) = m*3 + m - 1. Let c(b) = -3b*3 + 70b + 1. Determine c(h) + u(h). -2h3 + 71h Let z(h) = -h*3 + 10h*2 + 44h - 5. Let x(r) = r*3 - 12r*2 - 46r + 6. Calculate -5x(f) - 6z(f). f*3 - 34f Let b(n) = n*2 + 23n + 4. Let f(k) = -k*2 - 11k - 2. Calculate 4b(p) + 9f(p). -5p2 - 7p - 2 Let h(f) = 11f2 + 4f. Let j(r) = r*2 - r - 1. Let n be j(3). Let i = 7 - n. Let x(d) = 5d*i + 83d - 40d - 41d. Determine 6h(l) - 13x(l). l*2 - 2l Let a(c) = -5c + 2. Let h(o) = 4o - 3. Give -4a(x) - 3h(x). 8x + 1 Let t(p) = -3785 + 3785 + 10p*2 - 7p*2. Suppose j - 40 = -3j. Let l(n) = 2n2. Let w be (7 + -3)/(4/(-6)). Calculate jl(x) + wt(x). 2x*2 Let p(j) = -j - 1. Suppose 0 = 1384m - 1409m + 50. Let n(t) be the second derivative of -t5/20 - t3/6 - t2 - 2t. Give mp(o) - n(o). o3 - o Let v(g) = 2g - 3. Let w(q) = -q*3 - 5q*2 - 5q + 6. Let c be w(-3). Let u(b) = -1. Determine cu(z) - v(z). -2z Let d(l) = 4l + 1. Let i = 27 - -10. Suppose -i = -5h + 13. Suppose 4c + 2v = -0 + h, c - 2v = 15. Let q(s) = -2s. Give cq(p) + 3d(p). 2p + 3 Let i = -11 + 10. Let k = i + -3. Let q(r) = 2r*2 + 5r. Let d(h) = -3h2 - 6h. Give kq(v) - 3d(v). v*2 - 2v Let t(o) = 5o2 - 4o - 4. Let q(s) be the first derivative of -s3/3 + s2/2 + s - 578. Let w = -2 - -3. Determine wt(v) + 4q(v). v*2 Let i(y) be the first derivative of 6y - 6y2 + 30 + y2 + 11y*2 - 5y*2. Suppose 0 = -5f - 21 - 4. Let g(b) = 3b + 7. Determine fi(c) + 4g(c). 2c - 2 Let k(s) = -2s. Let x(v) = -2v - 28. Let i(z) = 3z + 47. Let w(y) = -3i(y) - 5x(y). What is k(t) + w(t)? -t - 1 Let z(i) = 2i*2 + 6i - 10. Let p be z(-5). Suppose -42 = -pn + 3n. Let v(d) = -d*3 - 1. Let l(q) = 5q3 + q2 - 2q + 6. Calculate nv(o) + l(o). -o3 + o2 - 2o Let g(s) = -2. Let x(p) = -1. Let t(m) = -2g(m) + 5x(m). Suppose -15f = -10f + 30. Let b(q) = 3q*2 + 2q + 5. Calculate ft(j) - b(j). -3j*2 - 2j + 1 Let v(c) = -2c3 - 187c2 + 3. Let n(o) = -o3 + o*2 + 1. Calculate 4n(t) - v(t). -2t3 + 191t*2 + 1 Suppose 0 = 3g + 4c - 29, g - 6 = -2c + 7. Let r(u) = -4 - 4 - 3u + 0 - 5u*g + 4. Let s = -5 + 9. Let x(k) = -4k*3 - 2k - 3. Determine sx(v) - 3r(v). -v3 + v Let u(r) = -r3 - 508r2. Let w(c) = -c3 - 3c**2. What is	{ "pile_set_name": "DM Mathematics" }
) = -1. Let b(n) = lm(n) + 3g(n). Give b(-5). -8 Let f(b) be the first derivative of -b*2/2 + 6b + 36. Give f(6). 0 Let c(o) = o + 1. Let v(y) = 4y + 5. Let q(b) = 9c(b) - 2v(b). Give q(-3). -4 Let j(z) = -2z*2 + 9z - 7. Let n(k) = -k*2 + 5k - 4. Let w = -1 - -1. Suppose -o + w = 7. Let t(a) = on(a) + 4j(a). Determine t(0). 0 Let u(l) = l*2 + 12l - 6. Let v be u(-13). Let h(t) = t*3 - 8t*2 + 7t - 6. Determine h(v). -6 Let r(n) = -2n - 3. Suppose 5q - 5x + 25 = 0, -5x + 12 = -3q - 7. What is r(q)? 3 Let p(t) = -t. Let n = -19 + 14. Give p(n). 5 Let u(y) = -y3 + 11y2 - 1. Let j = 20 + -9. Let c be u(j). Let g(n) = -n3 - 2n3 + 2n3 - 1. Calculate g(c). 0 Let n(v) = -v3 - 14v2 - 12v + 17. Let u be n(-13). Let q(h) = 3h - 3h + h - 3h + u. Let y be ((-6)/(-4))/(3/8). What is q(y)? -4 Let t(l) = -l3 - l2 - 1. Suppose -7i - 23 = -3i - p, -4p = 4. Let q be (2/i)/(2/12). What is t(q)? 3 Let i(f) = -f*3 + 3 - 2 + 22f + 2f2 - 19f. Suppose -5p - 5w = -35, p - 5w = -p - 14. What is i(p)? 1 Let y(j) = j3 + j2 - j - 1. Let o(i) = -5i*3 - 5i*2 + 5i + 11. Let k(h) = -o(h) - 6y(h). Determine k(0). -5 Suppose 32 = 4g + 2n - 0, g + 4n = 1. Suppose 2a - 9 = -3a + 4m, m - g = -a. Let b(v) = -v + 4. What is b(a)? -1 Suppose -17 = 4s - 1. Let b(w) be the third derivative of -1/6w3 + 0w + 1/24w4 + 2w*2 + 0. What is b(s)? -5 Let z(m) = -m + 3. Let i(p) = 0p*2 - 7p + 2p2 + 8 - p2. Let b be i(6). Suppose 2j = -bo + 2, j + o = -3j + 1. Calculate z(j). 3 Let l be (-1)/(-5) + 12/(-10). Let n(z) = 8z2 + 2z + 1. Calculate n(l). 7 Let o(q) = -9q3 + 4q*2 + 4q. Let d(t) = t*3 - t. Let b(u) = 6d(u) + o(u). Calculate b(2). -12 Let w(y) = y*3 - 3y*2 - 5y + 5. Let m(a) = -2a3 + 6a*2 + 9a - 10. Let s(o) = 2m(o) + 5w(o). What is s(4)? -7 Let x(u) = -u*2 - 8u + 10. Suppose -2k - 2 = 16. Let b be x(k). Let m(r) = r2 + r3 - 2r + r - 1 - b. Calculate m(-2). -4 Let t(m) be the second derivative of -m4/12 - m3/6 - 5m2/2 - 3m. What is t(0)? -5 Let q be ((-4)/(-6))/((-2)/9). Let b(y) = -5y + 1. Calculate b(q). 16 Suppose 10 = -r - r. Let o = -11 - -13. Let k(n) = n2 + 3n + 4n + 0n*o + 2. Determine k(r). -8 Let z(o) be the second derivative of 1/12o*4 + 5/2o*2 + 4o - 1/3o3 + 0. Calculate z(4). 13 Let a(h) = h2 + h + 1. Let x(z) = z3 + 3z2 + 3. Let t(c) = -a(c) + x(c). Let n(r) = r3 + 2r2 + r - 1. Let f be n(-2). Determine t(f). -4 Let r = -29 + 36. Suppose 3d = 5s + 25, 3s + 23 = 5d + 4s. Let b(y) = 4 - ry - d + 1 - 1. Give b(-1). 6 Suppose 5o + 5v = 40, -v - 2v - 11 = -4o. Let i(w) = 5w + 2. Determine i(o). 27 Suppose 0 = -0u + u. Suppose 4p - 2m - 4 = -3m, -3p + 2m + 14 = u. Let z be -1 + (0 - p) + 0. Let n(b) = -b*3 - 5b*2 - 2b + 4. What is n(z)? -8 Let m(g) = g*3 - 3g*2 + 2g - 4. Let s be m(3). Suppose -5r + 2 = -13, 0 = 2z + sr - 4. Let b(a) = 0a - a - 2a. Give b(z). 3 Suppose -4v + 2u = -14, 2u = -3v - 2v + 13. Let t(r) = -5r - 1 + 3r + vr + 0r. What is t(5)? 4 Suppose 0 = 2u + 2u - 8. Let p(j) be the third derivative of -j5/60 + j4/24 - j*2. Give p(u). -2 Let f(j) = -j - 3j*2 + 3 - 3j - j2 + j3. Let c be (-2 + 4)2/4. Let x(m) = 6m3 - m2. Let a be x(c). Determine f(a). 8 Let t(l) = l*3 + 2l*2 - 2l + 1. Let b(q) = q*3 - 3q*2 - 3q - 2. Let j be b(4). Suppose 1 = jd + 7. Give t(d). -2 Let l(j) = 9j*2 - 2j + 1. Let z(f) = -17f2 + 3f - 2. Let s(r) = 5l(r) + 3z(r). Let d be 0 - 1 - (-1 + 1). Calculate s(d). -6 Let l(i) = 6i3 - 3i*2 - 3i + 10i3 - 15i*3 + 2. Give l(3). -7 Let w(c) = 3 - 5 - 6c2 - c3 + 4 - 1. Let y be w(-6). Let v(z) be the second derivative of 3z4/4 + z3/6 - z2/2 + 7z. Determine v(y). 9 Let f(b) = -b*2 + 7b - 8. Let a(i) = -7i3 - i2 - 2i - 2. Let w be a(-1). Give f(w). -2 Let j(l) = l + 3. Let r = 33 + -36. What is j(r)? 0 Suppose 10 = 3j - 8j. Let u(m) = -m*2 + 2m + 2. Give u(j). -6 Suppose 3h - 3x + 6 = 2x, 0 = -4h + 3x + 3. Let q = -2 - h. Let i = 4 + q. Let u(t) = 8t - 1. Determine u(i). -9 Let z = -4 + 2. Suppose 2t + 2t - 8 = 0. Let f(v) = 0 - tv - 1 + 5v. Determine f(z). -7 Let b(s) be the first derivative of s*3/3 + 6s + 4. Suppose 2o = -4k + 12, -o - k = 3k - 14. Let j be (0/(-2))/(o/(-2)). What is b(j)? 6 Let c(q) = q3 + 14q*2 + 12q - 17. Let v be c(-13). Let u(y) = 7y2 - 1 + 2y + y*3 - 3y*2 + 0y. Give u(v). -9 Let k(j) = -1. Let t(u) = -3u + 12. Let n(x) = -18k(x) - t(x). Determine n(-4). -6 Suppose 109 = -4r + 129. Let a(l) = l3 - 5l*2 - l + 2. Calculate a(r). -3 Let s(f) = 3f + 4. Let g(p) = -3 + 2p + 3p - 7p. Let t(h) = -7g(h) - 5s(h). Give t(5). -4 Let k(p) = 4p + 1. Suppose 0 = -3o + 6, 3c - 3o + 1 = -2. What is k(c)? 5 Let y(v) = v3 - 3v2 + v + 2. Let i be y(2). Let c(s) be the third derivative of s2 - 1/3s3 + 1/12s*4 + 0 + is. Give c(-4). -10 Let n(r) = 2r. Suppose -4g - 4b = -0g - 20, 0 = -4g + 2b + 8. Determine n(g). 6 Let y be (-10)/(-3)(432/(-40))/(-6). Let o(d) = -5d - 12. Let t = 10 - 15. Let l(w) = 4w + 11. Let j(q) = to(q) - 6l(q). Determine j(y). 0 Suppose 4j = -0j. Suppose -4b - 2i = -b - 12, b - 4i - 18 = j. Let n(m) = -m*3 + 5m*2 + 6m + 2. Give n(b). 2 Suppose -2s - s + 12 = 0. Let p(j) = -j3 + 5j*2 - 3j + 2. What is p(s)? 6 Let y = 5 + -2. Let r(m) = m - 2. Calculate r(y). 1 Let p(r) = -r*2 - r + 2. Let h(v) = 3v*2 + 2v + 1. Let z be h(-1). Determine p(z). -4 Let r(u) = 7u + 5. Let j(b) = -6b - 4. Let y(c) = 4j(c) + 3r(c). What is y(-1)? 2 Let a(o) = o*3 - 4o*2 + 3o - 3. Suppose z - 13 = 3w + 3z, -2z = -2. Let m be ((-15)/w)/(2/2). Suppose -12 = mj - 7j. Give a(j). -3 Let b(j) = -4j*2 - 9j - 13. Let x(k) = -k*2 - k - 1. Let h(o) = -b(o) + 5x(o). Give h(6). -4 Let k(m) = m + 3. Suppose 2 = -d + 2p, 4 = 5d + 2p + 2p. What is k(d)? 3 Let m be 20/(-18)3(-12)/10. Let t(i) = -2i3 + 13i*2 - 5i - 1. Let k(z) = z*3 - 7z*2 + 3z + 1. Let y(u) = 7k(u) + 4t(u). Determine y(m). -9 Let x(h) be the first derivative of h*2 + 4h - 11. What is x(3)? 10 Let n(p) = -p3 + p2. Let y be n(0). Let q(j) = yj - 1 - 2 - 2j*2 + 2j + 1. Determine q(2). -6 Let b = 26 + -207/8. Let y(s) be the third derivative of 1/6s3 - 1/60s*5 - 3s*2 + bs*4 + 0 + 0s. Calculate y(4). -3 Let m(z) be the first derivative of z5/20 - z4/6 + z3/6 - z2/2 - 2z + 2. Let q(r) be the first derivative of m(r). Determine q(2). 1 Let x be (-2)/(-6)0 - 3. Let r(o) be the third derivative of 0 + o*2 + 1/24o*4 + 0o - 1/6o3. What is r(x)? -4 Let c(g) = g3 - g2 - 3g + 1. Let o(x) = 0x2 - x + 0x2 + 2 - x2. Let f be o(-2). Let i be 3 + f - 1/1. Give c(i). -1 Let l(y) = -2y2 + 4y + 4. Suppose 5q = 3h + 35, -11q + 6q = h - 15. Determine l(q). -12 Let a(d) = 10d3 + 13d*2 - 5d + 10. Let u(v) = 7v3 + 9v*2 - 3v + 7. Let w(g) = 5a(g) - 7u(g). Give w(-3). 4 Let q(z) = -z + 8. Suppose -x + 2g - 2 = 3x, g + 3 = 4x. Suppose u - 3l + 10 = 0, 3l - 8 = xu - 0l. Suppose uj - 10 = -0. Determine q(j). 3 Let w(m) = 0m2 + 0m + 5m - m2 - 1. Let u be ((-8)/(-3))/(1(-8)/(-12)). Determine w(u). 3 Let l(w) = w + 1. Let m(t) = -3t + 0t - 2 - 3t + t. Let o(u) = 4l(u) + m(u). Determine o(-4). 6 Let v = 13 - 8. Let o(h) be the third derivative of -h6/120 + h5/10 - 5h4/24 - h3/6 - 2h*2. Determine o(v). -1 Suppose 0 = -4m - n + 8, 0 = 4m + 2n + 3n - 8. Let u(x) = 5x*2 - 2x*2 - 22x + 10x + 9x. Give u(m). 6 Let w(i) = i3 + i + i2 + i*3 - 3i2 + i2 + 2. Give w(2). 16 Let g(r) = -5r + 8r + 4r - 17. Let c(q) = -11q + 26. Let w(i) = -5c(i) - 8g(i). Suppose -3k + 3 = -2f - 1, -10 = 5f. Determine w(k). 6 Let r(b) = 10b - 3. Suppose 5x = 2l + 11, -3l = 5x - 10 - 11. What is r(x)? 27 Let l(g) = g*3 - 7g*2 + 6g - 3. Suppose -p + 2 = d, 5p - 4d = 2p - 8. Let c(z) = z + 6. Let h be c(p). Calculate l(h). -3 Let m(q) = q2 + 2q + 3. Let p(f) = f*2 - 8f + 10. Let y be p(7). Let r(a) = 2a - 3. Let h be r(y). Suppose -hz - 2 = 7. Give m(z). 6 Let d(h) be the first derivative of -h**2/2 - h + 7. What is d(-1)? 0 Supp	{ "pile_set_name": "DM Mathematics" }
10:01 PM? 274 What is 355 minutes before 3:44 PM? 9:49 AM How many minutes are there between 10:27 PM and 5:06 AM? 399 What is 652 minutes before 11:41 PM? 12:49 PM What is 676 minutes before 10:27 PM? 11:11 AM What is 420 minutes before 1:54 AM? 6:54 PM What is 345 minutes after 8:39 PM? 2:24 AM How many minutes are there between 5:40 AM and 6:31 AM? 51 What is 488 minutes before 8:07 AM? 11:59 PM How many minutes are there between 4:26 PM and 5:43 PM? 77 What is 631 minutes after 12:27 AM? 10:58 AM How many minutes are there between 4:13 AM and 6:42 AM? 149 What is 404 minutes after 10:30 AM? 5:14 PM What is 195 minutes after 2:26 AM? 5:41 AM What is 353 minutes before 3:39 PM? 9:46 AM How many minutes are there between 2:49 PM and 4:05 PM? 76 How many minutes are there between 11:37 AM and 6:21 PM? 404 How many minutes are there between 5:25 PM and 4:08 AM? 643 How many minutes are there between 3:10 PM and 7:22 PM? 252 What is 175 minutes after 2:47 AM? 5:42 AM How many minutes are there between 9:51 PM and 4:54 AM? 423 How many minutes are there between 10:48 PM and 9:00 AM? 612 How many minutes are there between 3:51 PM and 4:41 PM? 50 How many minutes are there between 7:37 AM and 11:34 AM? 237 What is 591 minutes after 10:06 AM? 7:57 PM How many minutes are there between 5:07 AM and 6:01 AM? 54 What is 655 minutes after 1:02 AM? 11:57 AM How many minutes are there between 11:13 PM and 2:18 AM? 185 What is 530 minutes before 11:07 AM? 2:17 AM What is 359 minutes after 2:01 AM? 8:00 AM How many minutes are there between 9:58 AM and 3:43 PM? 345 What is 202 minutes before 2:17 AM? 10:55 PM How many minutes are there between 11:57 PM and 3:28 AM? 211 How many minutes are there between 9:52 PM and 6:00 AM? 488 How many minutes are there between 12:48 PM and 6:47 PM? 359 How many minutes are there between 5:50 PM and 10:20 PM? 270 What is 167 minutes before 5:35 PM? 2:48 PM How many minutes are there between 9:20 AM and 5:45 PM? 505 How many minutes are there between 3:55 PM and 4:58 PM? 63 What is 300 minutes before 1:15 PM? 8:15 AM What is 136 minutes after 5:10 PM? 7:26 PM What is 270 minutes after 12:51 PM? 5:21 PM How many minutes are there between 8:00 PM and 10:36 PM? 156 How many minutes are there between 2:17 AM and 4:45 AM? 148 What is 466 minutes after 3:31 PM? 11:17 PM What is 10 minutes before 3:26 PM? 3:16 PM How many minutes are there between 4:04 AM and 4:39 AM? 35 How many minutes are there between 8:11 PM and 1:28 AM? 317 What is 355 minutes before 6:00 PM? 12:05 PM What is 344 minutes before 4:25 PM? 10:41 AM How many minutes are there between 4:24 PM and 3:24 AM? 660 What is 448 minutes after 3:59 PM? 11:27 PM What is 624 minutes after 12:59 PM? 11:23 PM What is 706 minutes before 11:47 PM? 12:01 PM How many minutes are there between 9:02 PM and 12:06 AM? 184 How many minutes are there between 5:18 AM and 10:41 AM? 323 How many minutes are there between 4:40 AM and 6:23 AM? 103 What is 252 minutes after 8:21 AM? 12:33 PM What is 238 minutes after 11:15 AM? 3:13 PM What is 697 minutes before 12:38 PM? 1:01 AM How many minutes are there between 1:53 PM and 9:35 PM? 462 What is 166 minutes after 11:04 AM? 1:50 PM What is 302 minutes before 4:08 PM? 11:06 AM How many minutes are there between 2:27 AM and 5:06 AM? 159 What is 153 minutes after 6:09 AM? 8:42 AM What is 581 minutes before 1:49 PM? 4:08 AM What is 373 minutes after 5:19 PM? 11:32 PM What is 681 minutes after 5:33 AM? 4:54 PM How many minutes are there between 10:31 PM and 12:15 AM? 104 How many minutes are there between 5:39 PM and 9:43 PM? 244 How many minutes are there between 4:46 PM and 1:34 AM? 528 How many minutes are there between 8:43 PM and 5:38 AM? 535 What is 303 minutes after 5:03 PM? 10:06 PM How many minutes are there between 12:23 AM and 11:45 AM? 682 How many minutes are there between 10:03 AM and 1:26 PM? 203 What is 14 minutes before 1:58 AM? 1:44 AM How many minutes are there between 5:29 PM and 8:56 PM? 207 What is 130 minutes after 8:19 AM? 10:29 AM How many minutes are there between 4:04 PM and 1:37 AM? 573 How many minutes are there between 11:55 AM and 7:07 PM? 432 What is 10 minutes before 11:33 PM? 11:23 PM How many minutes are there between 9:34 AM and 7:30 PM? 596 What is 171 minutes before 8:46 AM? 5:55 AM How many minutes are there between 2:13 PM and 12:33 AM? 620 How many minutes are there between 7:09 AM and 7:58 AM? 49 How many minutes are there between 12:50 PM and 8:42 PM? 472 How many minutes are there between 3:06 AM and 7:18 AM? 252 What is 391 minutes before 4:19 PM? 9:48 AM How many minutes are there between 2:13 AM and 2:55 AM? 42 How many minutes are there between 12:01 PM and 10:44 PM? 643 What is 98 minutes before 5:17 AM? 3:39 AM What is 507 minutes before 3:37 PM? 7:10 AM How many minutes are there between 12:04 PM and 4:28 PM? 264 How many minutes are there between 5:37 PM and 6:12 PM? 35 How many minutes are there between 6:57 AM and 6:07 PM? 670 What is 63 minutes before 8:05 PM? 7:02 PM What is 254 minutes after 1:10 AM? 5:24 AM How many minutes are there between 4:15 AM and 1:05 PM? 530 What is 367 minutes before 9:54 PM? 3:47 PM What is 246 minutes before 5:26 PM? 1:20 PM What is 543 minutes before 2:10 PM? 5:07 AM What is 719 minutes before 6:20 AM? 6:21 PM How many minutes are there between 8:01 PM and 4:12 AM? 491 What is 715 minutes before 11:52 AM? 11:57 PM How many minutes are there between 5:41 AM and 12:53 PM? 432 How many minutes are there between 1:12 AM and 5:55 AM? 283 What is 376 minutes before 7:48 AM? 1:32 AM What is 291 minutes after 3:31 PM? 8:22 PM What is 286 minutes before 6:06 PM? 1:20 PM How many minutes are there between 5:40 AM and 11:24 AM? 344 What is 203 minutes after 10:25 PM? 1:48 AM What is 388 minutes before 4:47 PM? 10:19 AM How many minutes are there between 12:54 AM and 1:29 AM? 35 What is 528 minutes after 8:56 PM? 5:44 AM What is 121 minutes before 4:08 AM? 2:07 AM What is 331 minutes after 6:39 AM? 12:10 PM How many minutes are there between 5:02 PM and 7:37 PM? 155 How many minutes are there between 8:47 PM and 7:03 AM? 616 How many minutes are there between 11:35 PM and 5:03 AM? 328 How many minutes are there between 6:56 PM and 6:51 AM? 715 What is 623 minutes before 12:40 PM? 2:17 AM What is 366 minutes before 12:23 AM? 6:17 PM How many minutes are there between 7:22 AM and 9:22 AM? 120 How many minutes are there between 10:25 AM and 1:39 PM? 194 How many minutes are there between 8:59 AM and 5:36 PM? 517 How many minutes are there between 6:16 PM and 3:46 AM? 570 What is 584 minutes after 10:29 AM? 8:13 PM What is 714 minutes before 7:16 AM? 7:22 PM How many minutes are there between 2:29 AM and 12:40 PM? 611 How many minutes are there between 1:19 PM and 2:10 PM? 51 How many minutes are there between 1:15 AM and 5:29 AM? 254 How many minutes are there between 8:26 PM and 3:59 AM? 453 What is 98 minutes before 3:45 PM? 2:07 PM What is 304 minutes after 10:05 PM? 3:09 AM How many minutes are there between 5:28 PM and 7:40 PM? 132 What is 588 minutes after 12:58 AM? 10:46 AM What is 322 minutes after 6:58 AM? 12:20 PM What is 63 minutes after 10:01 PM? 11:04 PM How many minutes are there between 9:03 PM and 3:41 AM? 398 How many minutes are there between 5:08 AM and 5:33 AM? 25 What is 432 minutes before 10:02 PM? 2:50 PM What is 530 minutes after 10:20 PM? 7:10 AM What is 690 minutes before 8:04 AM? 8:34 PM What is 207 minutes after 1:55 AM? 5:22 AM What is 11 minutes after 3:01 PM? 3:12 PM What is 660 minutes after 7:50 PM? 6:50 AM What is 111 minutes before 11:44 PM? 9:53 PM What is 405 minutes before 2:02 AM? 7:17 PM How many minutes are there between 7:47 PM and 7:03 AM? 676 How many minutes are there between 9:53 AM and 10:13 AM? 20 What is 410 minutes before 7:27 PM? 12:37 PM What is 719 minutes after 5:50 PM? 5:49 AM How many minutes are there between 10:27 PM and 3:48 AM? 321 What is 703 minutes before 4:18 AM? 4:35 PM How many minutes are there between 3:07 PM and 11:31 PM? 504 What is 467 minutes before 2:41 PM? 6:54 AM What is 82 minutes after 10:45 AM? 12:07 PM How many minutes are there between 11:56 AM and 11:23 PM? 687 How many minutes are there betwe	{ "pile_set_name": "DM Mathematics" }
2g = -2v + 4. Let f be -1(g - -2)-1. Find o such that 0 + 3o2 + 0o + 5o + f + 0o = 0. -1, -2/3 Factor -2/3m2 + 16/3m + 0. -2m(m - 8)/3 Let i(z) be the first derivative of 0z - 1/3z*2 + 7 - 1/9z*3. Determine d, given that i(d) = 0. -2, 0 Let w(u) be the second derivative of -u + 0u*3 + 0 - 3/40u*5 + 1/12u*6 - 1/12u*4 + 0u2. Factor w(g). g2(g - 1)(5g + 2)/2 Let 3/5v*4 - 21/5v*3 + 12/5 + 9v*2 - 39/5v = 0. What is v? 1, 4 Suppose -w*4 + 5w*5 + 6w4 - w2 + w*3 - 2w*5 = 0. Calculate w. -1, 0, 1/3 Let k(d) be the first derivative of 5d*4/4 - 5d*3/3 - 5d*2 - 1. Find a such that k(a) = 0. -1, 0, 2 Let u be (-6)/24-4 - 4/(-8). Let 0 + 1/4j5 - j2 - j4 + 1/4j + uj3 = 0. Calculate j. 0, 1 Let t(h) = -h3 - 7h*2 + h + 9. Let o be t(-7). Factor 2m + 2mo + 2m - 2m2 - 6m*2 + 2. -2(m - 1)(3m + 1) Factor 4/7f2 - 24/7f*4 + 0 + 0f + 2f5 + 6/7f*3. 2f*2(f - 1)*2(7f + 2)/7 Let o be (-64)/(-32)(-3 + (-25)/(-8)). Factor 1/4 - 1/4u3 + 1/4u - ou2. -(u - 1)(u + 1)*2/4 Let p be (87/(-58))/((-33)/4). Factor -2/11h + 0 + ph2. 2h(h - 1)/11 Let u = 12 + -10. Let s(w) be the first derivative of -4w + 2/3w3 - wu - 3. Factor s(t). 2(t - 2)(t + 1) Let g(l) be the third derivative of -l6/720 + l5/180 - l4/144 + 9l*2. Suppose g(w) = 0. Calculate w. 0, 1 Let m be ((-127)/6)/(7/39). Let p = 237/2 + m. Factor 0 - pi*2 - 2/7i - 2/7i3. -2i(i + 1)2/7 Let a(p) = -p3 - 4p*2 + 5p + 3. Let w be a(-5). Suppose 0 = j + 4k + 13, -5j - k - wk - 1 = 0. Factor j + 4h + h*2 - 2h - 2. (h + 1)*2 Let f(t) be the second derivative of -3t*5/130 - 2t4/39 + t3/3 - 6t2/13 + 26t. Suppose f(v) = 0. What is v? -3, 2/3, 1 Suppose -h + 0 = 2d + 1, 0 = 3h + 15. Factor 30qd - 52q + 0q3 - 7q*3 + 16q + 0q3 + 8. -(q - 2)2(7q - 2) Let y(u) = -9u - 52. Let a be y(-6). Let p(d) be the first derivative of -ad - 3/2d*2 + 1 - 1/3d3. Determine o so that p(o) = 0. -2, -1 Let t(x) be the third derivative of x8/1176 + x7/735 - x6/420 - x*5/210 - 2x*2. Factor t(j). 2j*2(j - 1)(j + 1)2/7 Factor 1/3m*3 - 1/3m + m*2 - 2/3 - 1/3m*4. -(m - 2)(m - 1)(m + 1)2/3 Let k(s) be the third derivative of 0s + 1/18s5 - 2s*2 + 1/180s*6 + 4/9s*3 + 2/9s*4 + 0. Factor k(n). 2(n + 1)(n + 2)2/3 Suppose 3l = -l. Let g be (-6)/(-4) - -10(-7)/84. Suppose -gi + l - 2/3i2 = 0. Calculate i. -1, 0 Let r be -1 - 10/24-3. Find b, given that 0b - 1/4b*2 + r = 0. -1, 1 Let p = -1 + 3. Let j = p + 0. Factor 8/3b*3 + 2/3 + 4b*j + 2/3b*4 + 8/3b. 2(b + 1)4/3 Let u(h) be the first derivative of h5/5 + h4/6 - h3/9 + 1. Solve u(b) = 0 for b. -1, 0, 1/3 Factor 2/9o - 2/9o2 + 2/9 - 2/9o*3. -2(o - 1)(o + 1)2/9 Suppose 18 = 3s - 3f, 2f = -5s - 0 - 5. Let k(b) be the first derivative of 0b + 1/16b4 + 1/4b*2 + 1/4b*3 + s. Factor k(m). m(m + 1)(m + 2)/4 Let d = 3 + 23. Let f be d/(-10) + 1 - -2. Find v, given that 9/5v*2 + fv + 7/5v3 + 0 = 0. -1, -2/7, 0 Let v(t) be the third derivative of -t5/210 - t4/21 - 4t*3/21 - 6t*2. Suppose v(z) = 0. Calculate z. -2 Factor 20a*3 - 944a*2 - 20a + 13a4 + 908a*2 + 15a*4 + 8. 4(a - 1)(a + 1)2(7a - 2) Factor 0d*2 + 0d + 0 - 3/5d4 + 3/5d*3. -3d*3(d - 1)/5 Let y(f) be the third derivative of -f*6/24 + 2f*5/3 - 35f*4/8 + 15f*3 + 12f*2 + 1. Factor y(s). -5(s - 3)*2(s - 2) Let f(w) = -w*3 + 5w*2 + 6w + 2. Let j be f(6). Factor -4l3 + 6l + 27l4 - 23l*j - 4l*2 - 2l*3. 3l(l - 1)(l + 1)(9l - 2) Determine f, given that 0 - 41f3 + 24f*2 + 21f - 7f3 + 3 = 0. -1/4, 1 Determine f so that 7f*3 - 7f3 + f4 + 4f2 - 7f*2 - 2f = 0. -1, 0, 2 Suppose -5s = 4c - 12 - 6, 5s = -3c + 16. Find m such that -10/3m3 - 2/3m*4 + 16/3 - 4m*s + 8/3m = 0. -2, 1 Let b(c) be the second derivative of -c8/1680 - c7/420 - c6/360 - c3/6 + c. Let z(q) be the second derivative of b(q). Factor z(j). -j*2(j + 1)2 Let n(s) be the third derivative of -s7/1365 + s6/780 + s5/195 + 6s2. Suppose n(v) = 0. Calculate v. -1, 0, 2 Let o = 0 - 1. Let i(l) = 7l*3 + 8l2 + l - 6. Let x(c) = -c3 - c*2 + 1. Let d(n) = oi(n) - 6x(n). What is f in d(f) = 0? -1, 0 Let 0 + 1/6i*2 + 0i + 1/6i3 = 0. Calculate i. -1, 0 Factor -13/3z - 7/3z3 - 17/3z2 - 1. -(z + 1)2(7z + 3)/3 Let d(n) = -8n2 + n - 1 + 16n*2 - 7n*2. Let m(s) = 2s*3 - 2s*2 + 10s - 6. Let v(p) = 4d(p) - m(p). Factor v(a). -2(a - 1)3 Let n(u) = -u3 - 7u2 - 5u + 6. Let g be n(-6). Let -1/4 + 1/2d - 1/2d*3 + gd*2 + 1/4d*4 = 0. What is d? -1, 1 Suppose -x + 5 = 5v, -4v = x - 6x - 4. Let b be (x + -2)/(-16 + 11). Factor b + 1/5h2 + 3/5h. (h + 1)(h + 2)/5 Suppose -d + 173 + 118 = 0. Factor 291m*2 - dm*2 - 2m*3 + 2m. -2m(m - 1)(m + 1) Let d = -4 + 7. Determine k, given that 3k + dk - 15k*4 - 3k*2 + 11k*2 - 6k*3 + 7k*2 = 0. -1, -2/5, 0, 1 Let j be 2((-6)/2 - (2 - 6)). Solve 0h + 2/5h*j + 4/5h*4 - 1/5h5 + 0 - h3 = 0 for h. 0, 1, 2 Let o = -76 - 8. Let g be 3/(-12) + (-77)/o. Factor gf3 - 2/3f*2 - 2/3f + 2/3. 2(f - 1)2(f + 1)/3 Suppose 0 = 5u - 9 - 6. Let c = 739/14 + -105/2. Find w such that 2/7w*u + 0 - cw + 0w2 = 0. -1, 0, 1 Suppose 0o = 3o + 3. Let s be 32/(-3)o. Factor -1/2m*s - 3m - 9/2. -(m + 3)*2/2 Let u = 79 + -155/2. Let v = 40 - 79/2. Factor 1 - 1/2s*2 - vs*4 + 3/2s - us3. -(s - 1)(s + 1)*2(s + 2)/2 Let p(i) = -2i + 2. Let m be p(2). Let b be (m + 1)2-2. Factor -9/5o*b - 6/5o*3 + 0o*2 + 0 + 0o. -3o3(3o + 2)/5 Suppose -a2 + 4a*4 - 7a*2 + 2a*3 + 2a*3 = 0. Calculate a. -2, 0, 1 Let f be (4 - (-20)/(-6)) + 3 + -3. Determine x, given that 0x + fx3 + 2/3x*4 + 0 + 2/9x*2 + 2/9x*5 = 0. -1, 0 Suppose -u = -2u + 5n + 32, 4u - 3n - 60 = 0. Determine c so that -14c*4 - uc + 6 + 28c3 - 12c*2 + 2 + 2c*4 = 0. -2/3, 1 Let h be (-1)/3 + (-11)/((-792)/56). Factor 2/9l*4 - 2/9 + hl*3 + 0l*2 - 4/9l. 2(l - 1)(l + 1)3/9 Let h(y) be the second derivative of -y5/10 + 2y4/21 + y3/7 + 31y - 2. Determine b so that h(b) = 0. -3/7, 0, 1 Let w(i) be the first derivative of 1/3i4 - 1/15i*5 - 1/3i + 2/3i2 - 2/3i3 + 1. Factor w(v). -(v - 1)4/3 Let b(k) be the second derivative of k7/14 + k6/5 - 3k5/10 - k4 + k3/2 + 3k*2 + 2k. Determine g, given that b(g) = 0. -2, -1, 1 Let -10s2 - 3s*4 - 3s*3 - 4s*5 + 13s*2 + 7s5 = 0. What is s? -1, 0, 1 Let r(u) = u - 16. Let m be r(13). Let z(w) = w2 + 4w + 3. Let t be z(m). Factor tk + 0 + 2/7k2. 2k*2/7 Factor 2 + 9l*2 + 0 - 3l - 8l2. (l - 2)(l - 1) Let y(a) be the third derivative of a5/450 - a4/90 + 5a2. Find r such that y(r) = 0. 0, 2 Let j(n) be the second derivative of -n4/6 - n3 - 2n*2 + 16n. Factor j(z). -2(z + 1)(z + 2) Factor 10i3 - 2i*4 - 2i*4 - 6i*2 - 30i*2 + 14i*3. -4i*2(i - 3)*2 Let 2 + 5/2z*2 + 4z + 1/2z3 = 0. Calculate z. -2, -1 Let x = -3 + 19. Suppose o + x = 5o. Factor -l*2 - ol*3 - 3l*2 - 2l*4 + 2l*2. -2l*2(l + 1)*2 Let t(r) = r - 2. Let m be t(4). Let x be 1/(((-10)/15)/((-12)/45)). Factor xi*m - 4/5i + 2/5. 2(i - 1)2/5 Let r(i) = i4 - 128i*3 - 2178i*2 - 15968i - 43923. Let w(k) = 2k4 - 127k*3 - 2178k*2 - 15967k - 43923. Let m(v) = -5r(v) + 4w(v). Factor m(l). 3(l + 11)4 Suppose 0 = -4u - g + 8, -3g - 6 = -3u + g. Let b = -82/3 - -28. Factor 0t + 0 + bt*u. 2t*2/3 What is x in 0x + 0 + 0x3 - 2/9x*4 - 2/9x*5 + 0x2 = 0? -1, 0 Let k(q) = -q2 - 20q - 33. Let x be k(-18). Solve 9/4z*x + 0 - 9/4z*2 - 3/4z*4 + 3/4z = 0 for z. 0, 1 Let x(m) be the first derivative of -m4/12 + m3/6 + 7m - 5. Let t(i) be the first derivative of x(i). Factor t(h). -h(h - 1) Let h(x) = 4x4 - 6x*3 - 5x2 - 7. Let i be ((-4)/6)/((-1)/(-3)). Let v(y) = y4 - y3 - y2 - 1. Let f(t) = ih(t) + 14v(t). Factor f(m). 2m2(m - 1)(3m + 2) Let o(m) be the third derivative of -m5/45 - m4/9 + 9m2. Factor o(p). -4p*(p + 2)/3 Let y = 2 + -15. Let x = 13 + y	{ "pile_set_name": "DM Mathematics" }
- 4 - 2a. Calculate t(-5). 4 Let y(q) = q3 - 7q*2 + 3q + 3. Let u(v) be the third derivative of v*6/120 + 13v*5/60 - 7v4/12 + v3 - 6v2. Let r be u(-14). What is y(r)? -15 Suppose 4u - 2q - 12 = 0, -2u = -0q - 5q - 14. Let h(r) = -r2 + ru - 5r2. Give h(1). -5 Let z(n) = -7n*2 - n. Let y be z(-1). Let g = y + 9. Let l(u) = -2u*2 + 3u. Calculate l(g). -9 Let f(d) = 12d - 1. Let n be (2 - -1) + (2 - (-3 - -7)). Give f(n). 11 Let y(j) be the first derivative of 7j2/2 - j + 21. What is y(1)? 6 Let h = 1 - 1. Let w(g) be the first derivative of -g4/4 + g3/3 - g2/2 - g - 6. Calculate w(h). -1 Let r(k) = -4k - 4 - 3k + k + 5k. Let t(s) = s2 - 4s - 3. Let m be (-4)/(-3)(1 - -2). Let q be t(m). What is r(q)? -1 Suppose -p - 3p + 5t = -7, -3p - 9 = t. Let n(w) = 2w2 + w - 2. Calculate n(p). 4 Let i be ((-70)/15 + 5)0. Let v(p) be the first derivative of -p*3/3 + 3p - 1. What is v(i)? 3 Let o(n) = n*2 + 3n - 1. Let k(j) = -7j + 45. Let i be k(7). Give o(i). 3 Let i(p) = 7p*2 + 15p - 13. Let j(g) = -11g2 - 23g + 20. Let r(n) = -8i(n) - 5j(n). Let v be -15 + -11. Give r(v). -2 Let g(t) = 4t + 1. Let p = -5 - -4. Calculate g(p). -3 Suppose 4 + 1 = -5m. Let b(r) = r2 + r - 1. Let k(v) = v3 - 9v2 - 13v + 10. Let f(c) = mk(c) - 4b(c). Calculate f(6). 12 Suppose 19 = 4h + 3. Let f be h/(-2(-2)/8). Let q = f - 5. Let l(n) = -n*3 + 4n2 - n - 4. Give l(q). 2 Let o = 56 + -60. Let q(k) = -k3 - 5k2 - 6k - 6. What is q(o)? 2 Let n = 1 - -1. Suppose 0 = nj + 5c - 3, 2j - 4c = c - 7. Let y(b) = -5b2 - 3b + 4. Let l(g) = g*2 - 1. Let d(u) = jy(u) - 4l(u). Give d(-3). 0 Let m(n) be the third derivative of -n5/10 - n4/24 - 52n*2. Give m(-1). -5 Let d(y) = -2y*2 - 2. Let q(z) = -5z + 6. Let h(c) = c. Suppose 6 = n - 2k, -3n + 5k + 26 = 9. Let o(i) = nh(i) + q(i). Let g be o(4). Determine d(g). -10 Suppose -3s = -3i + 84, 0 = -2i + 5s + 53 + 15. Let b be i/11 + 8/(-44). Suppose 0 = -0m + m - b. Let z(k) = -2k*3 + 3k*2 - 2k + 3. Determine z(m). -5 Let x(b) = -b*3 - 5b*2 + 4. Let r be x(-5). Let k = r + -1. Let c(d) = 4 - 4 - d + k. Determine c(-3). 6 Let y(a) = 3a*2 + 3 - 2a*2 + 410a - 415a. What is y(3)? -3 Suppose -d + 3 = 2. Let x(f) be the first derivative of -f7/840 + f6/360 - f4/24 - 7f*3/3 + 1. Let c(p) be the third derivative of x(p). Give c(d). -1 Suppose 2i = -3i + 2n + 48, 2i = n + 20. Let a be i/6(-3)/1. Let g(q) = -3 + 11 + 2q - q. What is g(a)? 4 Let i(s) be the second derivative of -7s4/12 + s2/2 + 5s. Let t = -1 - 0. Give i(t). -6 Let r(q) be the second derivative of -q4/12 + 7q3/6 - q2 + 9q. Calculate r(5). 8 Suppose p = 6p - 10. Let d(y) = -3y + 7. Let m(r) = r - 2. Let v(q) = 2d(q) + 7m(q). Determine v(p). 2 Let q(y) = -14y*2 + 6y + 15y2 - 3y + 2y. Calculate q(-6). 6 Let d = 7 - 5. Let m(u) = -u3 + 2u*2 + u. Let x be m(d). Let i(a) = 2a2 - 5 + a3 + 0a2 + 4 - 3a*2. Determine i(x). 3 Let v(s) = -5s + 0s + 6s + 1. Determine v(-1). 0 Let n(u) = -u*2 - 3u + 3. Let x be 6/27 - (-446)/18. Suppose 0 = -4i - i - 5j, -x = 3i - 2j. Give n(i). -7 Let f(k) = 19k3 + 2k + 1. Let t be (-2)/(-4)36/(-18). Calculate f(t). -20 Let a be 4/(-6) - 4/3. Let d = 3 - a. Let p(r) = -3r*2 - r - 3r + dr - r3. Determine p(-2). -6 Let f = 13 + -11. Let g(z) be the second derivative of -z7/840 - z5/60 + z4/12 + z3/3 - 2z. Let y(a) be the second derivative of g(a). Calculate y(f). -10 Let n = -1 + 6. Let w(b) = b*3 - 3b*3 + 5b*3 - 2b*3 + n - b. What is w(0)? 5 Let n(x) = 3x + 3 + 2x - 2x. Suppose 8 = 5l - l, -2k = -l + 10. What is n(k)? -9 Let z(f) = -2f - 5. Let h be (-3)/7 - (-3)/7. Suppose h = y + 3y + 20. Calculate z(y). 5 Suppose 14 = -x + 4c, -2x - c = 3x - 14. Let u(v) = -2v + 3. What is u(x)? -1 Let d(v) be the first derivative of -v*3/3 - 3v2/2 + 1. Calculate d(-3). 0 Let h(c) be the first derivative of c4/2 + c*2/2 - c + 8. Determine h(1). 2 Suppose -4j = 2d - 14, 2d + 6 = -d + 3j. Let y be d + -9 + -2 + 5. Let k(g) = g3 + 5g*2 - 3. What is k(y)? -3 Suppose r = 2r - 3b - 18, -5b - 44 = -4r. Suppose -11y + 8y = -r. Let k(m) = 14m - 5. Let q(l) = -9l + 3. Let c(i) = -5k(i) - 8q(i). What is c(y)? 5 Let l(v) = -v3 + 10v*2 - 7v - 15. Let o be l(9). Let h(n) = n + 1. Calculate h(o). 4 Let i(t) = -t*3 + 1 + 3t + 0 - 4t + t2 + 0t*3. Suppose -3p = 4 - 1. Let f = 2 + p. Determine i(f). 0 Let v(l) be the third derivative of l6/120 - l5/15 + l*3/6 + 5l2. Calculate v(4). 1 Let t(u) = -u3 + 5u2 - u - 5. Let q be 2/(-3)(0 + -6). Determine t(q). 7 Let h(c) = c*3 - 7c*2 + 6c - 1. Let b(z) = 3z - 15. Let d be b(7). Calculate h(d). -1 Let o(h) be the second derivative of -h5/20 - h4/12 + h3/6 - h2 + h. What is o(2)? -12 Let j(t) = -t2 - 8t + 3. Let d be j(-8). Suppose -1 = dv - 7. Let r(x) = -2x*2 + 2x + vx2 + x2 - 4x. Determine r(1). -1 Let z(q) be the first derivative of q*2 - 7q - 23. Determine z(5). 3 Let l be (10/1)/(-5) - -7. Let o(v) = v*2 - 2v - 2. What is o(l)? 13 Let v(i) = i - 9. Let n(g) = g - 8. Let s(l) = 5n(l) - 4v(l). What is s(3)? -1 Let g(c) be the second derivative of 3/2c2 + 0 - 1/20c*5 - 1/4c*4 + 0c*3 - 8c. Calculate g(-3). 3 Let a(w) = 6w. Let t(m) = -m - 1. Let s(h) = -a(h) + t(h). Let l(j) = -6j - 2. Let q(o) = -6l(o) + 5s(o). Let r(i) = i - 21. Let b be r(15). Give q(b). 1 Let m(v) be the second derivative of -v3 - v2/2 + 3v. Let a(z) = 5z + 1. Let r(w) = -3a(w) - 4m(w). What is r(1)? 10 Let w(i) be the second derivative of -i*4/12 - 11i*3/6 - 4i*2 - 39i. What is w(-11)? -8 Let i(o) = o3 - o2 - 2o + 3. Let d be i(3). Suppose -12c + dc - 3 = 0. Let a(z) = -5z*2 + 4z*2 + 5z2. Calculate a(c). 4 Let q(c) = -c2 + 5c. Let u = 9 - 5. Let s(n) be the first derivative of -n3/3 + 5n*2/2 - 5. Let l(m) = us(m) - 3q(m). Calculate l(5). 0 Let p be -4(4 + -2)/(-2). Let f(k) = 9k - 17. Let h(s) = -22s + 42. Let t = 13 - 8. Let o(z) = th(z) + 12f(z). Determine o(p). -2 Let v(y) = -2y + 4. Let i = 4 + -9. Let a(s) = s + 2. Let h be a(i). What is v(h)? 10 Let l(p) = -9p - 11. Let o(h) = h*2 + 5h - 8. Let c be o(-7). Let j(f) = 4f + 5. Let u(v) = cl(v) + 13j(v). Determine u(1). -3 Let h be 15/5 + (-1 - -2). Let c = h - 4. Let t(n) = cn*2 - 5n*2 + 4n*2 + 1 - 5n*3. What is t(-1)? 5 Let l(n) = 4n*2 + n. Suppose t = 3m + 10 - 0, -3t - 5m = 12. What is l(t)? 5 Let g(u) = 21u - 12. Let f(w) = -7w + 4. Let l(i) = 8f(i) + 3g(i). Determine l(3). 17 Let x = -3 - -3. Let a(p) = p - 1. Let o(s) = 3s - 3. Let j be -15((-8)/6 - -1). Let y(n) = ja(n) - 2o(n). Give y(x). 1 Let u(w) = -7w. Let m be u(3). Let d be 2/(-14) - (-81)/m. Let r(y) = y - 3. Determine r(d). -7 Let i(q) = -q2 - 1. Let k(z) be the third derivative of -z5/60 + z4/6 + 4z*3/3 - 10z2. Let c be k(6). Calculate i(c). -17 Let n(y) = y - 7 - 8 + 14. Determine n(8). 7 Let m(g) be the first derivative of g4/24 + g3/2 + g2/2 - 1. Let s(p) be the second derivative of m(p). Let r = 3 + -6. What is s(r)? 0 Let m(n) = n*3 - 7n*2 + 8n - 9. Let a = 2 + 4. Let u be m(a). Let y(g) = g - 4. What is y(u)? -1 Let w(g) = g*3 - 2g*2 - 3g - 3. Let c(p) = 0p - 7 - 2 + 2p. Let m be c(8). Let q = m - 4. Determine w(q). -3 Let z(v) = v + 24 + v - 32 + 5v - v2. Let y(g) = -g3 - 2g*2 + 2g + 3. Let i be y(-3). Determine z(i). -2 Let l(i) be the second derivative of -i*5/20 + 5i*4/12 - 2i3/3 - i2/2 + 21i. Calculate l(4). -1 Let x(s) = s + 5. Let r be x(-4). Let j(l) be the third derivative of -l5/6 + l3/6 + 2l*2. What is j(r)? -9 Suppose 4p - 13 = -3b, -4p + 2 = -2p. Let r(z) = -4z2 - z3 + 5z2 - b + 5z + 0z3. Calculate r(3). -6 Let u = -3 + 1. Let y be 30/(-5)u/3. Let q(r) = -r*2 + 5r. Determine q(y). 4 Suppose 4y - y + 9 = 0. Let z(d) = -d3 - 3d*2 - 2d + 4. What is z(y)? 10 Suppose -7d + 14 = -3d + 2k, -5 = -5k. Let q(p) be the third derivative of 0p + 1/8p*4 + 2/3p*3 + 0 - 1/60p5 - p2. What is q(d)? 4 Suppose -3y = -5u + 32, 0 = -5u + y + 4 + 20. Suppose 0 = 3t - u*a -	{ "pile_set_name": "DM Mathematics" }
vative of g*7/840 - 13g*6/360 + 13g*5/120 - 5g4/24 - g3/6 + g. Let a(m) be the second derivative of v(m). Is a(12) prime? True Let z(l) = 81l + 2. Is z(1) a composite number? False Suppose 4t = 11 + 5. Suppose tm - 162 = -2f, f - 9m = -4m + 95. Is f a prime number? False Suppose 5y - 6680 + 1785 = 0. Is y composite? True Let n = 632 - 285. Is n prime? True Is 97 - (-3)/((-9)/12) a prime number? False Let q be (280/30)/((-2)/(-3)). Is q/21(-423)/(-2) composite? True Let b(k) = -k*2 + 6k - 2. Let v be b(5). Suppose vm + 0m = 6. Suppose 0 = -mn - 0n + 30. Is n a prime number? False Let g be 170/(-3) - 1/3. Suppose 352 = z + 3z. Let h = g + z. Is h a composite number? False Is (0 + 69/6)74 a composite number? True Suppose -4f + m + 207 = 0, -f + 3m + 29 = -9. Is f prime? True Is (8/6)/(6/(-33237)-3) composite? True Let v = 2 + 3. Suppose -vn - 2t = -3n - 232, n - 3t = 132. Suppose -b + n + 49 = 3k, -2k = b - 114. Is k a composite number? True Suppose -3 = q - 1. Is 1 - (94 + q)/(-1) composite? True Suppose o = -3o + 16. Suppose -op = r - 17, -r = 5p + 4r - 40. Suppose -2z + 74 = -4x, -2z - 4x - 41 = -pz. Is z prime? False Suppose 119 = -3f - 2t + 439, -2f = -3t - 209. Is f composite? True Suppose -2d = d - 6, -o = -2d. Let g = o - 1. Suppose -u = gu - 44. Is u prime? True Let u be (2/2)/((-4)/412). Let j be u - (1-4 + 3). Let b = j + 157. Is b a prime number? False Suppose 4r - r = -5v + 997, r - 3v - 323 = 0. Is r a prime number? False Suppose -3i - 312 - 138 = -3m, -2m + 301 = -3i. Is m a composite number? False Let m be ((-7)/2)/((-8)/(-16)). Is 4/m + (-999)/(-21) prime? True Suppose -4r - 2 = -a, 0 = 3a - 2 - 4. Suppose 2z = -r - 4. Let h = 9 + z. Is h composite? False Suppose -2n + 566 = 52. Is n a composite number? False Suppose 0g = -g + 463. Let f = -206 + g. Is f prime? True Let a(r) = r*3 + 5r*2 + 6r + 6. Let i be a(-4). Let f = 39 + i. Is f composite? False Suppose w - 3 = -6. Let g = w - 1. Let h = 11 + g. Is h prime? True Suppose 76 = 2l + 3a, 3a + 46 + 123 = 5l. Is l composite? True Suppose 2u - 10 = -6w + w, w - 2 = 2u. Suppose u = q - 69 - 0. Is q a prime number? False Let d = -10 - -14. Let j = 4 - d. Suppose -4q + jz + 353 = z, -2q + 181 = -z. Is q a composite number? False Let m(g) = -g3 - g2 + g + 304. Let x be m(0). Let r = x - 183. Is r composite? True Suppose 0 = o - 2b + 2 - 12, 0 = 4o + 3b + 15. Suppose -2m + om = -170. Is m composite? True Suppose 4a = -4, -2t + 2a = 3a - 901. Is t a prime number? False Let f(s) = s2 + s. Let l(k) = k3 - 6k - 2. Let i(z) = 5f(z) - l(z). Let c be i(11). Let x = -316 - c. Is x prime? False Suppose 3x + 4 - 198 = -2u, 0 = 4u - 5x - 410. Let j = 174 - u. Suppose 0s + s = j. Is s prime? False Let h(j) = 64j + 4. Let d be h(6). Suppose -n - 3n + d = 0. Is n prime? True Let n = -670 + 1655. Is n a prime number? False Let z(w) = -28w - 9. Let a(q) = 141q + 46. Let x(t) = -2a(t) - 11z(t). Is x(4) composite? True Let o = -158 - -3111. Is o a prime number? True Let o = 13483 + -6714. Is o composite? True Let f(w) = -2w3 - 7w*2 - 8w + 1. Is f(-8) composite? False Let x(d) = 6 - 6d - 5d + 2 - 4. Let a be -5 - 6/(-31). Is x(a) composite? False Let r(n) = -n2 - 8n. Let m be r(-8). Suppose l + mh - 62 = 2h, 0 = -3l - h + 172. Is l a composite number? True Suppose 3 = -4m + 15. Let d = m + -7. Is (-3 + (-178)/d)2 a prime number? True Let c be (-171)/6(-2)/3. Suppose -2h = -2f + 2, 2f - f = 5h - c. Let w(k) = -k*3 + 7k*2 + 6k - 7. Is w(f) composite? True Let q(w) = w*3 + 12w*2 - 12w + 10. Is q(-11) composite? False Suppose -3l + 177 = -0l. Is l prime? True Let t(r) = 1672r + 1. Is t(1) composite? True Let i(h) = 2h*2 - 4. Is i(-9) composite? True Let m(c) = 253c - 7. Is m(6) composite? False Let b be (-1 - 5)/(54/(-6228)). Let a = b + -475. Is a composite? True Let k = 1028 + -357. Is k composite? True Let w = 3 + -1. Suppose 0 = -wm + 3b + 583, -m + 4b = -289 - 0. Is m a composite number? False Let c(q) = q - 3. Let l be c(-3). Let v = l - -8. Suppose -vn - 110 = -4n. Is n a composite number? True Let i(v) = v2 - 6v + 4. Let o be i(5). Let t be -1 - 1/o - -2. Suppose -3x = -tl - 11, -4x = -5x + 5. Is l composite? False Let u(z) = 214z2 - 4z - 3. Let r be u(-3). Suppose -2g - g = -r. Suppose -2j + g = 5s, -2s + 0s + 244 = -2j. Is s prime? True Let w(v) = 8v3 + v2 - v + 1. Let u be w(2). Let g be (0 + 2)/1 + 32. Let h = u - g. Is h a composite number? True Let s = 6 - 1. Let t(k) = 24k + 3. Let r be t(s). Suppose 2x - 4w = 42, -4x - 29 = 2w - r. Is x a prime number? True Suppose -17396 + 5558 = -6o. Is o composite? False Let z(r) = r3 + r - 2. Let m be z(2). Let y be 39/12 - 2/m. Suppose 0 = o + yl - 4l - 56, 5l = -5. Is o composite? True Let a(t) = 25t2 + t + 7. Let g(z) = 50z*2 + 3z + 15. Let m(w) = -7a(w) + 3g(w). Let r be m(-3). Is (r + -2)(-4)/12 composite? False Suppose -b - 4m + 2 = 0, -2b + 4 = -0b - 5m. Suppose -h + bh - 37 = 0. Is h composite? False Let o(g) = 155g2 - 8g - 11. Is o(4) prime? True Let x be (-2)/((-1)/(-3) + -1). Is ((-2)/x)/(2/(-1038)) a composite number? True Suppose 0 = -8m + 2m + 6522. Is m a prime number? True Suppose 14 = 2y - 6. Is 248/y(-55)/(-22) prime? False Let w(a) be the first derivative of -2a3/3 - 2a*2 - 4a - 2. Let i be w(-3). Is (i/(-5))/(4/74) prime? True Suppose -3f = -4z + f + 2596, -3z = -f - 1947. Is z a composite number? True Let h be -2 - 525 - 6/(-2). Let i = -333 - h. Is i a prime number? True Let f(z) = 3z - 23. Let o be f(9). Let j(h) = -h*3 + 2h*2 - h + 2. Let p be j(2). Suppose -212 = -ox - px. Is x a composite number? False Suppose k + 0 - 7 = 3l, -4k + 14 = 2l. Suppose -r = kr + 80. Let o = r - -53. Is o composite? False Let i = 173 + -117. Suppose -5v + 2j = -v - i, 3v = 5j + 35. Is v a composite number? True Let o = -4 - -7. Suppose i - 8 = -4t - oi, 2i = -5t + 22. Is t composite? True Let j(k) = k + 6 - 3k - 5k. Let h be j(4). Let c = h - -45. Is c a prime number? True Let p = 10 - 2. Suppose -2h + 7b = 2b - 1, -4h = -4b - p. Suppose hq - q = 74. Is q prime? True Suppose 10t = 9t + 2901. Is t a composite number? True Let n(w) = -50w - 5. Suppose -k + 2y + 2y - 11 = 0, -3k - 13 = -2y. Is n(k) prime? False Is 1254/8 + 9/36 a prime number? True Suppose -4f - s + 3691 = -2f, -3f = -5s - 5504. Is f prime? False Let x(a) = -a*3 + 4a*2 - a + 4. Let h be x(4). Suppose 4z - 3 - 13 = h. Suppose 2t = -n + 131, 5t = t - zn + 264. Is t a composite number? True Suppose 3f + 3a = 2a + 1120, 5a = 4f - 1506. Is f + 2(-12)/(-8) prime? False Suppose -4v + 4n - 126 = -6v, -5v - n = -342. Is v prime? False Suppose u = -2u. Suppose u = -2s + 553 + 189. Is s composite? True Suppose -4u = -4h - 72, u + 2u + 3h = 84. Is u a composite number? False Let c(h) = -42h*3 + 5h*2 - h - 1. Let s(q) = -43q*3 + 6q*2 - q - 1. Let i(r) = 6c(r) - 5s(r). Is i(-1) a composite number? False Let d(b) = b - 6. Let a be d(7). Is a(3 + 158/1) composite? True Suppose -3p - 131 = -4p. Is p prime? True Let i(c) = -1099c - 24. Is i(-5) composite? False Let v be 9/(2 - -1) + -1. Suppose vm - 5m + 93 = 0. Is m prime? True Is ((-9)/((-54)/3052))/(6/9) prime? False Suppose 3c - 8c + 167 = k, 4c = k - 176. Suppose -h + 3h - k = 3u, -4h + 4u = -336. Suppose 2r = -4t + h, 2r - 3r - 93 = -5t. Is t composite? False Let d = 18 + -11. Suppose 0 = -ds + 3s + 12. Suppose -2x - x - sq = -108, -172 = -5x + 3q. Is x a prime number? False Let r = 147 - 251. Let k = 341 + r. Is k prime? False Is (24/24)/(2/20) a prime number? False Let l(b) = 18b*2 - 9b + 2. Is l(11) prime? True Let t = -30 + 6. Let u = 187 + t. Is u a prime number? True Let u = -1 - -1. Suppose u = 4i - 5i + 15. Is i prime? False Let y(v) = v*3 + 4v*2 - 8v - 8. Let a be y(-6). Is (-2 + 1)(-5 + a) composite? False Let q be (-1)/(-7) + (-78)/(-42). Suppose -s - 110 = -5r - qs, 89 = 4r + s. Is r a composite number? True Let d(s) = 6s + 21. Is d(30) a prime number? False Suppose 2p - 3 = a - 0a, 5a = 4p + 3. Suppose -5s + 4*w	{ "pile_set_name": "DM Mathematics" }
closest to 3 in -1/4, -2393, 0.1, 5? 5 Which is the nearest to -1/4? (a) -335 (b) -5 (c) 7 b What is the nearest to -11 in -2/7, -2/5, -1/22436? -2/5 Which is the nearest to 2/3? (a) 1 (b) -3/4 (c) 10331 a Which is the nearest to 9? (a) -4/5 (b) 1 (c) -186 (d) 2 d What is the closest to -1/4 in -343, 0, 0.3, -5, -0.1? -0.1 Which is the closest to 3? (a) -21/5 (b) 0.66 (c) -1/3 b Which is the nearest to -4/11? (a) 2443/10 (b) 0.2 (c) -3 b What is the closest to 85 in 4/167, 4, -2/11? 4 Which is the closest to 29? (a) -3 (b) 0.06 (c) 9 (d) -22 (e) 0.4 c What is the nearest to 38/3 in 50, 4, 31? 4 Which is the nearest to 0.3? (a) 1 (b) 0 (c) 178 (d) 10 b What is the nearest to -2/9 in -0.06, 21, -55? -0.06 Which is the closest to -3/4? (a) 4 (b) -4 (c) 128 (d) -1 (e) 0.2 d What is the closest to 3/10 in 0.3, 1.5, 0.8, 0.1, 2/5? 0.3 What is the nearest to 0 in -0.5, 254, -1/10, -0.2, -5? -1/10 What is the nearest to -66/5 in -15, -9/5, -2, 2/17? -15 Which is the nearest to -169/6? (a) 0.8 (b) 2 (c) -0.2 (d) -5 d What is the nearest to 1 in -2, -9, -3, 0.4? 0.4 Which is the nearest to 5/6? (a) 9 (b) 6 (c) -5/6 c Which is the nearest to 2? (a) 0.23 (b) -84/5 (c) -4 (d) 2 d Which is the closest to 0.1? (a) 208/5 (b) 12 (c) -1/8 c Which is the closest to 4/3? (a) -2/97 (b) 0 (c) 0.2 (d) 16 c What is the closest to -24 in 317, -0.4, -2? -2 What is the closest to 1 in 5, -1.3, 4, 3, -38? 3 What is the closest to -7 in 2, 3, -0.4? -0.4 Which is the closest to 9? (a) 0.23 (b) -0.02 (c) -2/29 a What is the closest to 0.1 in 4, -4876, -2/15, 5? -2/15 What is the closest to 6/19 in -11, -5, -2/15? -2/15 Which is the nearest to -1? (a) -2/5 (b) 2 (c) -3/136 (d) -2/13 a Which is the closest to -870? (a) 1/6 (b) 4/5 (c) -2 c What is the nearest to 0 in -2, 4634, 1, 0, -5? 0 Which is the nearest to 4? (a) 259 (b) -55 (c) -0.4 (d) 2 (e) -1/6 d What is the closest to -2/13 in 1.5, 3/4, -0.3, -3/5, -8? -0.3 What is the nearest to 1/4 in -3/2, 1, -123? 1 What is the nearest to 0.27 in 2, -0.01397, 0.02? 0.02 What is the closest to 18 in -0.12, 3/4, -0.58, -3/5, -2/7? 3/4 What is the closest to 1.3 in 4, -262, -28? 4 What is the nearest to 2/5 in 1347.3, -0.2, -3/8? -0.2 Which is the nearest to 5? (a) 2/11 (b) 564 (c) -0.3 (d) -2 (e) -5 a What is the nearest to 0.1 in -0.2, 2.6, 40, 29? -0.2 What is the nearest to -1/3 in 0, -15/2, -30, -6? 0 What is the closest to -2/5 in -3/4, 1/5, 2/13? -3/4 What is the closest to -1/2 in 11, -1/2, 2254? -1/2 What is the closest to -2/15 in 2/7, 932, -2? 2/7 Which is the closest to 0? (a) 13/38 (b) -0.5 (c) -1 (d) 0.2 (e) 29/7 d Which is the nearest to 147? (a) 5 (b) 2 (c) 3 (d) -7 (e) 0.4 a What is the closest to 49818 in -5, 5, 2/17? 5 Which is the closest to 5134? (a) 4/5 (b) 0 (c) -2 a Which is the closest to 0? (a) -3 (b) 1 (c) 1/4 (d) -4 c Which is the nearest to 9? (a) -2/17 (b) -16 (c) 1/13 (d) -1/2 c Which is the nearest to 1345/2? (a) -5/3 (b) 0 (c) -3 (d) -0.08 b What is the nearest to 5930 in 3/5, 4, 2/11, 0.1, 5? 5 Which is the closest to -5? (a) 3 (b) 6/5 (c) -1.45 c What is the nearest to -0.1 in 0.2, 10/363, -0.1? -0.1 What is the nearest to 0 in -0.5, 1, -1/11, -1/2059? -1/2059 What is the nearest to -1 in -34801, 0, -2/15, 2/19? -2/15 Which is the nearest to 17? (a) -0.2 (b) -3.337 (c) -1 (d) 3 d Which is the nearest to -0.3? (a) 2 (b) -0.08 (c) -3 (d) 2/21 (e) 0.1 b What is the closest to 0.03 in 7, -4.9, 104? -4.9 What is the nearest to 0.01 in 4, -0.3, -13726? -0.3 What is the nearest to -139 in 3, 3/5, 19? 3/5 Which is the nearest to -0.2? (a) 0.69 (b) -1/3 (c) 4/3 (d) 470 (e) -1/2 b Which is the nearest to 2/5? (a) 4/7 (b) -1/213 (c) -2 (d) -2/11 (e) -27/5 a Which is the closest to -12? (a) 0.3 (b) -297 (c) 1/4 (d) -2/67 d What is the closest to 36/5 in 0.9, 28, 0.4? 0.9 Which is the nearest to 10/17? (a) 1/3 (b) 3.34 (c) -1.3 a Which is the closest to -5/314? (a) 0.2 (b) -4 (c) 0.1 c What is the closest to -0.2 in -5, -1/3, -29, 1, -22? -1/3 Which is the closest to -2? (a) 2/5 (b) 1/3 (c) 17944 b What is the closest to 1 in -5, -2/5, -2/25, -0.5, 4.1? -2/25 Which is the closest to -0.3? (a) -85 (b) 0.1 (c) 0.12 b What is the closest to -331 in 4, 0.4, -1/3? -1/3 What is the closest to 0.38 in -28, -5, -2? -2 What is the closest to -5 in -3/5, 184, 0.4? -3/5 Which is the nearest to -0.42? (a) -4 (b) -11 (c) -0.114 (d) -2 c Which is the nearest to -21? (a) 1 (b) -2 (c) 18/17 (d) -3/4 b Which is the closest to -1/3? (a) 831 (b) -0.1 (c) 1/9 (d) -1/2 d Which is the closest to -10? (a) 3 (b) -19/4 (c) -5 (d) -4/5 c What is the closest to 6/59 in 1.877, -2/9, 1? -2/9 What is the nearest to -0.1 in -2/11, 3, 21, 329, -1/6? -1/6 What is the closest to -48 in -1, -2/123, 2/13? -1 What is the nearest to 3 in 67, -8, 3, 1? 3 What is the nearest to 0.3 in -19/2, -24, -0.6? -0.6 What is the nearest to 850 in -0.2, -32, 1/2? 1/2 Which is the nearest to -133? (a) 17 (b) -0.5 (c) -0.2 (d) -34 (e) 0.3 d Which is the closest to 2/3? (a) -3/7 (b) -76 (c) -3 (d) -5/4 a Which is the nearest to -0.1? (a) 0 (b) -3 (c) 1/57 a What is the closest to 5 in 23, 0, -3/8, -47? 0 What is the nearest to 2/13 in -0.16, -6.2, -0.02? -0.02 What is the closest to -1/3 in 2, 4/9, 0.09, 81? 0.09 Which is the closest to 6/7? (a) -0.4 (b) -23 (c) -2/7 (d) -26 (e) -4 c Which is the closest to 0? (a) -23033 (b) -0.5 (c) -32 b Which is the nearest to 1? (a) -2/5 (b) -5 (c) 0.204 c Which is the nearest to 262/3? (a) -4 (b) -2/11 (c) 3/4 (d) 2 d What is the closest to -0.2 in -46, -3.1, -10, -0.3? -0.3 What is the nearest to -1 in 0.4, 0.145, -1, -4? -1 Which is the nearest to -0.03? (a) -3 (b) 16 (c) 5 a What is the closest to 2/5 in -1, 828, 25, -1/3? -1/3 What is the nearest to 0 in -72, -10, 0.07, 0.5, 1? 0.07 What is the closest to 14/11 in -0.1, -4, -1, 0.5, 5? 0.5 Which is the nearest to -7? (a) -2 (b) 4 (c) -1/17 (d) 2/21 a Which is the closest to 12? (a) -9 (b) -1/5 (c) 23 (d) 5 d Which is the nearest to -259? (a) -3 (b) -3/4 (c) 2/7 a What is the nearest to -3 in 1/1016, -0.2, -19? -0.2 What is the nearest to -2/9 in 5, 0.5, -48, -10, 0.06? 0.06 Which is the closest to -1/144? (a) -32 (b) 2/11 (c) -2/7 b Which is the closest to 50? (a) 0.5 (b) -35 (c) -1 (d) -5 (e) 3 e Which is the closest to -0.2? (a) 2/33 (b) 2 (c) 31.5 a What is the closest to -0.1 in -3, 51, 0, -7, -0.32? 0 What is the nearest to -40.7 in -3/2, 3, 0, 0.5? -3/2 Which is the closest to -10776? (a) -5 (b) 1 (c) -2/11 (d) -0.3 (e) -3/5 a What is the nearest to -5 in -0.3, 3, 0.2, 0.1, 5/198? -0.3 What is the closest to -1/4 in -4/7, 2/7, -2/7, -3, -31486? -2/7 Which is the nearest to -0.4? (a) -0.507 (b) -5 (c) -2/21 (d) -3 (e) 5 a Which is the nearest to -0.08? (a) -0.5 (b) 352 (c) -24 a What is the nearest to -5/17 in -0.34, 0.2, -7? -0.34 What is the nearest to 1 in -0.2, 3, 6, -0.044? -0.044 Which is the nearest to -2/3? (a) -1 (b) -3 (c) 1/3 (d) -106 (e) -17 a Which is the closest to -1? (a) 1 (b) -0.523 (c) -1/5 (d) -1 (e) 3/2 d Which is the nearest to 3/10? (a) 5 (b) 1/619 (c) -0.5 b Which is the closest to 2? (a) -0.2 (b) -21 (c) -5 (d) -28 a Which is the closest to 5? (a) 12 (b) 0 (c) 3 (d) -3 c Which is the closest to -0.1? (a) 19 (b) 4 (c) 28.3 b Which is the closest to -16/3? (a) -1/4 (b) 150 (c) 0.1 a What is the nearest to 2/3 in -63.6, 0.7, -4/5? 0.7 What is the nearest to 0.1 in 2, -1/5, 3, 0? 0 Which is the nearest to -3/7? (a) -16 (b) -2/53 (c) -0.2 c What is the closest to 2285/8 in 2, 3, -0.5? 3 Which is the nearest to 2/59? (a) 4 (b) -13 (c) 72 (d) -1 d Which is the nearest to 0? (a) 3/238 (b) 0.5 (c) 1.9 (d) 5 a What is the closest to -2/7 in 111/7, -0.04, 0.2? -0.04 Which is the closest to 2/7? (a) -2/7 (b) -2 (c) -843 a What is the closest to -1.35 in 2, -4, -16? -4 Which is the closest to -3? (a) -4 (b) -0.2 (c) 0.4 (d) 3 (e) -7182 a Which is the closest to 0? (a) 0.7 (b) -0.33 (c) -0.47 (d) -2/9 d What is the nearest to 2/5 in -3, 23, 2, -3.3, -3/5? -3/5 What is the nearest to -0.44 in 0	{ "pile_set_name": "DM Mathematics" }
eters? 300 Convert 2.046993 years to centuries. 0.02046993 What is 6.143802 seconds in milliseconds? 6143.802 What is 166503.1 millennia in years? 166503100 What is 79.6112 years in decades? 7.96112 How many seconds are there in 0.7966313 days? 68828.94432 How many months are there in 17/4 of a decade? 510 What is 0.3379904mg in micrograms? 337.9904 How many litres are there in 0.8472379ml? 0.0008472379 What is thirteen quarters of a gram in milligrams? 3250 How many years are there in 15/4 of a millennium? 3750 How many nanograms are there in 494087.5 kilograms? 494087500000000000 How many millilitres are there in fifty-three quarters of a litre? 13250 What is 393.2281 millennia in centuries? 3932.281 Convert 7.961314 litres to millilitres. 7961.314 Convert 189.513081ms to days. 0.0000021934384375 How many years are there in 63766.11 decades? 637661.1 What is 292.9925 weeks in milliseconds? 177201864000 What is 1/20 of a kilometer in meters? 50 How many millilitres are there in five quarters of a litre? 1250 How many kilograms are there in 11/10 of a tonne? 1100 How many litres are there in 0.6613045ml? 0.0006613045 How many milligrams are there in 3/32 of a kilogram? 93750 What is 78298.75l in millilitres? 78298750 How many millilitres are there in six fifths of a litre? 1200 What is 60692.24km in millimeters? 60692240000 What is 5/8 of a milligram in micrograms? 625 What is 6189.356m in nanometers? 6189356000000 What is seven quarters of a litre in millilitres? 1750 What is 32/5 of a microgram in nanograms? 6400 What is 0.4354828t in micrograms? 435482800000 What is twenty-one fifths of a litre in millilitres? 4200 Convert 5395.968ml to litres. 5.395968 What is one fifth of a kilogram in grams? 200 What is 1259.156 nanometers in kilometers? 0.000000001259156 What is 333068.7 litres in millilitres? 333068700 Convert 691.2556 nanograms to milligrams. 0.0006912556 What is 958.345 litres in millilitres? 958345 How many grams are there in 96.46264ug? 0.00009646264 How many milliseconds are there in eleven halves of a second? 5500 What is thirty-seven halves of a decade in years? 185 What is 3884.105 centimeters in nanometers? 38841050000 How many decades are there in six fifths of a millennium? 120 How many milliseconds are there in 6224.9 hours? 22409640000 What is 3.107426 milligrams in tonnes? 0.000000003107426 How many nanograms are there in 273235.3ug? 273235300 Convert 0.189591l to millilitres. 189.591 How many weeks are there in 11444.35068s? 0.0189225375 What is 59/4 of a litre in millilitres? 14750 Convert 6018318.9 seconds to days. 69.65646875 What is 41/2 of a tonne in kilograms? 20500 What is 3/5 of a microgram in nanograms? 600 How many millilitres are there in twenty-seven halves of a litre? 13500 What is 2/125 of a gram in micrograms? 16000 What is 9957.752kg in grams? 9957752 What is fourty-two fifths of a micrometer in nanometers? 8400 Convert 271098.5l to millilitres. 271098500 What is twenty-nine fifths of a millennium in months? 69600 What is 2.962677 months in millennia? 0.00024688975 How many millilitres are there in one quarter of a litre? 250 What is 7564.856 litres in millilitres? 7564856 What is 17/2 of a tonne in kilograms? 8500 What is fifty-two fifths of a meter in millimeters? 10400 What is 1/4 of a decade in months? 30 What is 0.908213kg in micrograms? 908213000 What is twenty-one fifths of a litre in millilitres? 4200 What is 331.115 decades in years? 3311.15 How many minutes are there in seven eighths of a day? 1260 What is 3.226849 meters in centimeters? 322.6849 Convert 7.604238ml to litres. 0.007604238 How many years are there in twenty-five halves of a decade? 125 How many millimeters are there in one tenth of a meter? 100 How many millilitres are there in 9/10 of a litre? 900 What is 4.659211g in tonnes? 0.000004659211 How many decades are there in thirty-two fifths of a millennium? 640 Convert 4.802169 decades to centuries. 0.4802169 What is 5.908804ug in grams? 0.000005908804 How many decades are there in 1/10 of a millennium? 10 What is seven sixths of a decade in months? 140 Convert 956917.5l to millilitres. 956917500 How many hours are there in seven quarters of a day? 42 What is 6/25 of a litre in millilitres? 240 What is 13/4 of a centimeter in micrometers? 32500 Convert 194827.05 minutes to days. 135.2965625 What is thirteen quarters of a litre in millilitres? 3250 How many kilograms are there in 579.537 milligrams? 0.000579537 What is 0.4325081km in nanometers? 432508100000 Convert 83.2562km to centimeters. 8325620 How many years are there in 28.55282 decades? 285.5282 How many months are there in seven sixths of a decade? 140 What is 911.0772 millilitres in litres? 0.9110772 How many nanometers are there in 7/4 of a micrometer? 1750 What is five eighths of a litre in millilitres? 625 What is one quarter of a tonne in kilograms? 250 What is seventeen halves of a litre in millilitres? 8500 What is twenty-one halves of a century in months? 12600 What is 7/4 of a millisecond in microseconds? 1750 Convert 475518.3 meters to micrometers. 475518300000 What is two sevenths of a week in days? 2 How many nanograms are there in 8/25 of a microgram? 320 How many litres are there in 2383.269 millilitres? 2.383269 What is three eighths of a kilometer in centimeters? 37500 How many milliseconds are there in 928.5977 weeks? 561615888960 How many meters are there in 7/4 of a kilometer? 1750 What is 6/25 of a milligram in micrograms? 240 How many weeks are there in 1538200.692 seconds? 2.54332125 How many minutes are there in twenty ninths of a week? 22400 What is five eighths of a day in hours? 15 How many minutes are there in five eighths of a week? 6300 How many nanograms are there in twenty-five quarters of a microgram? 6250 How many kilograms are there in 165886.4 nanograms? 0.0000001658864 What is 118985.4ng in grams? 0.0001189854 How many micrograms are there in 6.79905g? 6799050 What is 7/3 of a year in months? 28 How many micrometers are there in 13/8 of a centimeter? 16250 Convert 159594.9 weeks to minutes. 1608716592 Convert 2004.677 kilograms to grams. 2004677 Convert 88.99881t to grams. 88998810 Convert 148693.3308 nanoseconds to weeks. 0.000000000245855375 Convert 2820.776ml to litres. 2.820776 How many millimeters are there in seven halves of a meter? 3500 What is 1481.4423 months in millennia? 0.123453525 What is 1992.26kg in milligrams? 1992260000 What is 7.467057 decades in months? 896.04684 How many milligrams are there in fourty-six fifths of a gram? 9200 How many months are there in 83.77962 years? 1005.35544 How many micrometers are there in 4.089245 kilometers? 4089245000 How many millilitres are there in 66.6947l? 66694.7 Convert 92.1188m to centimeters. 9211.88 How many kilograms are there in seventy-three fifths of a tonne? 14600 How many nanograms are there in 31/5 of a microgram? 6200 How many millennia are there in 92224.37 years? 92.22437 What is eleven quarters of a microgram in nanograms? 2750 Convert 3.503976l to millilitres. 3503.976 How many decades are there in 8460.55 millennia? 846055 What is 15/4 of a centimeter in micrometers? 37500 Convert 51800.2 centuries to decades. 518002 What is 496.3333ml in litres? 0.4963333 What is 11/8 of a millimeter in micrometers? 1375 What is 3/10 of a hour in minutes? 18 What is 17/4 of a microsecond in nanoseconds? 4250 What is thirteen fifths of a litre in millilitres? 2600 How many hours are there in 11/4 of a week? 462 What is 6/25 of a kilometer in centimeters? 24000 Convert 16161.17 kilometers to centimeters. 1616117000 How many milligrams are there in 21/4 of a gram? 5250 What is thirty-one fifths of a century in months? 7440 Convert 59.01233g to nanograms. 59012330000 What is fourty-six fifths of a decade in months? 1104 What is sixty-seven fifths of a litre in millilitres? 13400 What is 2.068384m in kilometers? 0.002068384 How many nanometers are there in 1/20 of a millimeter? 50000 Convert 248428.2 micrograms to kilograms. 0.0002484282 What is 0.7682546 millennia in months? 9219.0552 How many minutes are there in 3/5 of a week? 6048 What is three fifths of a millennium in centuries? 6 What is 918.48 centimeters in micrometers? 918	{ "pile_set_name": "DM Mathematics" }
2 + 43j + 30. Let h be i(23). Let f = q + h. Which is smaller: f or -3? f Let o be -7 - (13770/(-4))/15. Which is bigger: 222 or o? o Let y = -10.222 - -0.022. Let l = y - -10.6. Is l bigger than -9? True Let r(o) = o*2 + 8o - 1. Let t be r(-10). Suppose p + 18 = t. Which is greater: -2 or p? p Suppose 116p - 22 = 127p. Let g be (-2 + 3 + 2)-1. Is p smaller than g? False Suppose -z - 4n + 27 + 33 = 0, 4z + 2n = 282. Let q be 9/(-2)z/(-27). Let x be ((-27)/6)/(q/32). Which is bigger: -13 or x? x Let k = -0.2 + -0.01. Let i = 0.89 - k. Are i and -1 unequal? True Let m(i) be the first derivative of -i3/3 + 3i*2 - 4i + 2. Let g be m(5). Are g and 3 unequal? True Let n = 15 - 14. Let j be n21/((-10)/(-25)). Which is bigger: j or 7? 7 Let k = 267131/8 - 33345. Let r = -4967/104 + k. Does -2 = r? False Let t(g) = 7g2 - 15g - 21. Let p(s) = -4s2 + 8s + 10. Let v(f) = 5p(f) + 3t(f). Let d be v(7). Which is greater: d or 1/288? d Let l = -2.73 - -0.03. Let f = 2.8 + l. Let m be (-10)/(-112) + 4/14. Which is greater: m or f? m Let v = 1.9 - 2. Suppose -4h - 5y = -273, h + 2y - 23 = 46. Let z = h + -336/5. Which is bigger: z or v? v Let w(k) = k3 + 19k*2 + 3k + 59. Let y be w(-19). Which is smaller: y or 32/19? 32/19 Suppose -71z + 5965 = -11572. Which is greater: 245 or z? z Let w(v) be the third derivative of v6/8 - v5/30 + v4/6 - v3/6 + v2. Let c be w(1). Is 18 at most as big as c? False Suppose 5b + 760 = -3b. Let c = 95 + b. Are -3/8 and c equal? False Let p = 92 - 275/3. Which is greater: 13 or p? 13 Let z be (16/(-6))/((-10)/(-45)). Let p = z + 15. Let w = -4 + p. Is -3/2 at most as big as w? True Suppose 3z - 5h = -h + 8, -2h - 4 = 5z. Suppose -g = -5j - 10, z = -3j - 2j - g. Which is smaller: j or -6/5? -6/5 Let i = 221.062 + -0.062. Which is bigger: 0 or i? i Suppose -52u + 51u = 852. Let k be (1/3)/(-3 - u/270). Do 3 and k have different values? True Let k = -0.18 + 2.38. Let p = k - 13.2. Let i = -10.3 - p. Which is smaller: i or -1? -1 Suppose -2u - 332 = -4u. Let k be -12 - -8 - u/(-41). Which is bigger: 1 or k? 1 Let v be 1/3 + 73/(-30)52. Let g = v + 7061/55. Which is smaller: 3 or g? g Let a be (0 + 5)2/(-4). Suppose 2g - 4y + 803 = 5g, 3y = 4g - 1079. Let x = g - 1880/7. Is a less than x? True Let a be (-6)/(-3) + 0 - -2. Let t = 13 + -11. Suppose aw - 8 = 0, -2k - t = -6k - 5w. Which is bigger: -4 or k? k Suppose 120 = 3y - 66. Suppose 4n + y = -2. Let h = -18 - n. Is h greater than -6/11? False Let v be (-4)/(-26) - (-273093)/1677. Is 166 bigger than v? True Let a = 1887/4 - 458. Which is bigger: 13 or a? a Let a = 1151 + -386. Is -2/7 equal to a? False Let q be (97 - 30) + (-6)/1. Is q at most 58? False Let l = -3513 - -2363. Is l less than -1149? True Suppose m - 4m = 3. Let l be 110/(-42)(6 - 3). Are m and l unequal? True Let z be 2(-5790)/(-48) - (-10)/(-8). Is z smaller than 241? True Suppose 5j + 5 = -4l, 2j - 1 = 3l - 3. Let q be 48/(-27) + 3 - 2/9. Let g be 1/(-11)(1 + -5q). Which is greater: j or g? g Let q = -66077/15 - -4409. Which is smaller: 5 or q? q Let p(h) = h3 - 3h*2 - 3h - 6. Let i be p(4). Is i greater than 1.02? False Suppose -4x - 290 = -h + 462, 4x - 5h = -768. Let t be (-231)/85 - 22/x. Is t bigger than -3? True Suppose -31c - 2 = 4h - 34c, -2h - 4 = -3c. Let p = 18150/17 + -1068. Is h greater than p? True Let d be -75(-3)/(-15)5. Is -74 <= d? False Suppose 3r + 11 = -5w + 3, -3r = w + 4. Is w at least as big as -1/203? False Let o = -1067988/127903 + 12/5561. Is -8 at most as big as o? False Let t = 4760521130/19198319 - 1/662011. Let y = t - 248. Which is greater: y or 0? 0 Let r = 23 - 21. Let b = r + 0.1. Let h = 2 - b. Which is smaller: h or 2/13? h Suppose -5y = 2s + 28, 0y = 3y - 5s - 8. Let b = 35 + -33. Let f be 8/(-5) - b/5. Do y and f have different values? True Let t(q) = -q*2 + q - 12. Let m be t(0). Which is bigger: m or -15? m Let n(j) = -2j*3 - 8j*2 + 11j - 14. Let h be n(-7). Is 203 greater than h? False Let p = 78 - 74. Let w be (-1 + 5/p)/((-2)/8). Is -12 at most as big as w? True Let v be 38/36 - (-2)/(-9). Suppose -4j + 12 = 8j. Is j smaller than v? False Let i = 396 + -13465/34. Let a = i - 31/102. Which is smaller: -20 or a? -20 Let i be (3/28)/(8/(-32)). Let u(v) = v - 7. Let a be u(9). Suppose -4g = 4y, 5g - 3 = -0y - ay. Which is bigger: y or i? i Let j be ((-86)/14 - 108/(-18))-461. Which is smaller: 67 or j? j Let h be 78/(-8)132/(-18). Which is greater: h or 72? 72 Suppose -65x + 69x - 16 = 0, 2a = 2x - 6. Is a >= -2/495? True Let u = -140 - -139.31. Let a = u - -0.79. Suppose s = -5m + m - 6, -5s - 4m = 14. Which is bigger: a or s? a Let r = 347 - 351. Is -1 less than r? False Let d = -5753 - -5751. Let h = -2 - -2. Suppose -t + 4a = 0, -2t - 3t + 4a = h. Is d equal to t? False Let s be ((-3)/4)/(5/18005). Which is greater: -56 or s? s Let d(v) = v2 + 8v + 11. Let g(h) = -h*2 - h. Let s be g(2). Let b be d(s). Let l = -4383/13 + 337. Is b at least l? False Let w be (-1 - 0)/((-231)/(-1323)). Are -5 and w non-equal? True Let w = 463/3 - 3549/23. Is -1/9 greater than w? False Let a = 15 + -15. Let t = a + -0.03. Let i = 6.03 + t. Is 2 less than i? True Suppose 6w - k - 1077 = 2w, -3w + 804 = -2k. Which is smaller: w or 271? w Suppose -i = -l - 32, -4i = 5l + 6 + 163. Let b be (l/(-7))/((-3)/10). Let p = -1416/91 - b. Do p and -1 have different values? True Let i(v) = 54v + 9. Let g be i(1). Is 61 smaller than g? True Suppose -2 + 29 = q. Let v(f) = -f*2 + 28f - 22. Let o be v(q). Let z be (-6)/(-3)1/(-2). Which is smaller: o or z? z Let z be (4/2)/((-16)/(-40)). Suppose -z = 13t - 8t. Which is greater: t or -7/16? -7/16 Let f = 1.92 - 2. Let q = -13 + 4.8. Let a = q + 8.4. Which is smaller: f or a? f Let b = -20 + 22. Which is bigger: b or 13/10? b Let s(y) = -y - 1. Let o be s(-6). Suppose om = 16 - 1. Let v be 12/(-16) + m/(-12). Which is greater: v or 2/13? 2/13 Let r = 1156 - 1094.9. Let x = r + -62. Is x bigger than 3? False Let t(n) = -n*3 - 11n*2 - 5n + 21. Let p be t(-10). Let y = -23 - p. Suppose 25 = 4q + 1. Are y and q nonequal? False Suppose 0t - 6 = -2t. Suppose -h = th + 4. Is -1/7 equal to h? False Let s = 180 + -187. Which is smaller: s or -16? -16 Let y = -3144 + 933769/297. Which is smaller: -1 or y? -1 Suppose -2 = -4a - 6. Let u be 1 + (-8)/(a - 1). Let b(q) = -q3 + 4q*2 + 8q - 11. Let w be b(u). Is w != 6? True Let f be (8/14)/(2/35). Let c be -5 + f - 71/5. Is c at least as big as 0.1? False Let p = 328/91 + -45/13. Is p at least -1? True Let o = 0.053 - 41.053. Which is smaller: -0.1 or o? o Let i = 0.1112 - 14.1812. Let u = 14 + i. Let j = 2.93 - u. Which is bigger: -1 or j? j Suppose -7b = -3b - 5m - 10, 3m = -2b + 16. Suppose -7 = -j + b. Suppose 2f + 2x - j = 6x, 3 = -f + 5x. Does 11 = f? False Let x = 0.2 + -0.1. Let i = -47.2274 + -0.7726. Which is smaller: x or i? i Let j = -12 - -16. Suppose -45 = -jc - c. Suppose 0 = -cf + 2f + 14. Is f <= 1? False Let z be ((-10)/7 - -1) + 1. Let w be 5(-5)/5 + 0 + -1. Let t be (-8)/(-6) - w/9. Is t <= z? False Let i = 82/5 - 412/25. Let a(s) = 3s - 4. Let v be a(2). Let t be (1 + (1 - v))/(-2 - 0). Is i != t? True Let l be (-15)/6((4 - -6) + -2). Which is smaller: l or 19? l Let q be (-17)/(204/(-780)) - 2. Is 437/7 greater than or equal to q? False Suppose -5g - 11 = -3t + 2, 5t + 5g = -5. Let n be -4t - 43/(-1). Suppose -27b = -30b - n. Is -14 greater than b? False Let u = -171 + 91. Let x = u + 84. Which is bigger: -29 or x? x Suppose -16 = -8g + 6g. Let a be 18/48/6. Let p = g - a. Is p smaller than -1? False Let m = 2 + -1. Is -5/128 >= m? False Let n = 4 + -74. Let d = 127/86 - 42/43. Is n != d? True Suppose -3t - 111 = -h, -5h = 2t - 6t - 577. Is 117 at most h? True Let k = 7.854 - 0.054. Let w = k - -0.2. Let t = -8 + w. Which is greater: t or 1? 1 Suppose z = -3f + 58, 0z + 5f = -2z + 118. Which is greater: z or 65? 65 Suppose 5a - 2h = -0a + 510, -3a + 2h + 302 = 0. Is a at least 102? True Suppose -p - 6 = -4l + 2p, -5p + 13 = l. Suppose -d + ld - 4 = 0. Suppose -17 = d*h - 1. Are h and -8 unequal? Fa	{ "pile_set_name": "DM Mathematics" }
e of -10k3/3 - 19. Let c(i) = -9i - 7. What is c(p(w))? 90w2 - 7 Suppose 25 = 5j, 3j = -5r - 2j + 40. Let i(p) = 46p + r - 47p - 2. Let t(q) = -3q + 1. Let m(s) = -i(s) + t(s). Let k(b) = 19b2. Give m(k(d)). -38d*2 Let y(r) = 6r*2 - 2818109r + 2818107r + 2r*2. Let h(t) = 2t + 6. Calculate h(y(g)). 16g2 - 4g + 6 Let y(j) = -13j2. Let m(k) = 3996719k. Determine m(y(w)). -51957347w2 Let b(c) = 4547c*2 - 10c + 2. Let q(u) = 117u. What is q(b(j))? 531999j*2 - 1170j + 234 Let o be 6/9 + 7/((-42)/(-8)). Let c(f) = 30fo - 27f*2 - 6 - 11f*2. Let n(r) = 2r. Give n(c(v)). -16v2 - 12 Let f(m) = 344912m - 7. Let s(v) = -2v2. Calculate f(s(i)). -689824i*2 - 7 Let m = 43 - 38. Let t(q) = mq*2 + 1146q - 1146q. Let i(k) = -9 - 11 + 6k + 20. Calculate i(t(o)). 30o2 Let x(r) = 1. Let c(f) = 154f + 2. Let b(v) = c(v) - 2x(v). Let q(i) = 4i - 8. Let d(w) = -w + 4. Let u(t) = 2d(t) + q(t). Give b(u(j)). 308j Let x(i) = -2i2. Let a(o) = 29o*2 - 7o - 229. Let s(u) = 45u2 - 11u - 354. Let q(d) = -8a(d) + 5s(d). What is q(x(z))? -28z4 - 2z*2 + 62 Let i(d) = 987d*2 + 56. Let x(w) = 52w*2 + 3. Let l(j) = 3i(j) - 56x(j). Let p(c) = 25c - 1. Give p(l(f)). 1225f2 - 1 Let l(c) = 69215c*2 + 3706c - 3706. Let k(i) = 112i2 + 6i - 6. Let v(m) = 1853k(m) - 3l(m). Let d(t) = -39t2. What is d(v(u))? -463359u*4 Let y(g) = -3 - 7230g*2 + 3622g*2 + 3612g*2 + 3. Let n(x) = -1078x*2. What is n(y(a))? -17248a*4 Let j(s) = 12s - 4. Let b = -49 + 54. Let l(y) = -13y + 5. Let v(t) = bj(t) + 4l(t). Let k(w) be the third derivative of -w4/8 + 6w*2. What is v(k(m))? -24m Let y(v) = -v. Let c(i) be the second derivative of -1631i4/6 - 763i. What is y(c(l))? 3262l2 Let s(x) = -x. Let h(n) = 39n + 66207. Give s(h(f)). -39f - 66207 Let s be 7/1 + 10 + -11. Let r(o) = so*2 - 2o*2 + 5o*2. Let a(h) = -7h + 1052494 - 1052494. Determine r(a(q)). 441q2 Let u(w) = 3w - 8w - 22w + 7w - 14w. Let h(f) = 42f2 + 8f - 16. Let a(o) = -28o2 - 5o + 10. Let j(q) = 8a(q) + 5h(q). Calculate u(j(y)). 476y2 Let y(i) = -i2. Let d(s) = 5927s - 13. Let q(f) = -1975f + 4. Let o(u) = -4d(u) - 13q(u). Give y(o(w)). -3869089w*2 Let o(q) = -2q2 + 54. Let t(a) = a2 - 24. Let k(d) = 4o(d) + 9t(d). Let n(z) = -4934z. Calculate k(n(f)). 24344356f*2 Let v(b) be the first derivative of 0b*2 - 22b + 141 - 1/3b3. Let c(z) = -2z*2. Determine v(c(m)). -4m*4 - 22 Let n(w) = 17w*2 - w. Let u(t) = 5359 - 2t*2 - 5359. Give u(n(k)). -578k*4 + 68k*3 - 2k2 Let m(x) be the third derivative of x4/12 + 3x2. Let q(a) be the first derivative of -39a*2/2 + 5a + 11974. Give m(q(i)). -78i + 10 Let z be 6/57 + 468/(-114). Let t(r) = 5r*2 + 8r + 4. Let h(m) = -4m2 - 6m - 3. Let y(s) = zh(s) - 3t(s). Let c(j) = -9j. What is y(c(o))? 81o*2 Suppose -25 + 46 = 7z. Let x(t) = t - 9t - zt - 3t. Let y(w) = 13w. Calculate x(y(l)). -182l Let x(h) = 16h. Let o(v) be the second derivative of -v*4/4 + 27v + 26. What is x(o(r))? -48r2 Let h(y) = -303917y. Let a(r) = -1002r. Determine a(h(s)). 304524834s Let w(d) be the second derivative of 6361d4/6 + 3d + 555. Let n(h) = -h*2. Determine w(n(f)). 12722f*4 Let s(j) = 2213603j*2. Let p(x) = x. Calculate s(p(u)). 2213603u*2 Let v(t) be the third derivative of 0t + 0t4 + 13t*2 + 11/60t*5 + 0 + 1/6t*3. Let d(j) = -8759 + 8759 + j. What is v(d(q))? 11q*2 + 1 Let i(g) = 3g*2. Let l(j) be the first derivative of 0j + 0j2 - 102 + 44/3j*3. What is i(l(x))? 5808x*4 Let r(k) = 2k*2. Suppose n - 10n = -3627. Let z = -202 + n. Let b(u) = 101u - zu + 106u. What is r(b(y))? 72y*2 Let h(l) = -23l*2. Let v(b) = 81251 - 5b - 81251. Give h(v(o)). -575o2 Let f(s) = 2s. Let z = 58 - 53. Let o be (-53)/(-11) + 6/33. Let m(g) = -z + 10g2 + o. What is m(f(l))? 40l*2 Let s be 10/15(-1203)/(-2). Let h(k) = -402k + 6 + sk - 6. Let x(w) be the third derivative of w*5/12 - 2w*2. What is h(x(u))? -5u*2 Let w(l) be the second derivative of -553l*3/6 + 2l - 564. Let a(m) = -2m2. What is a(w(z))? -611618z*2 Let t(f) = 17f - f - 12f. Let z(q) = 4q*2 + 28q + 28. Let p(o) = o*2 + 6o + 6. Let m(s) = -14p(s) + 3z(s). What is t(m(u))? -8u2 Let t(x) = -3x. Let z(y) = -15y - 11y - 10y + 94y. Determine t(z(j)). -174j Let w(j) = 10j. Let o(h) be the second derivative of 0h2 + 155h + 0 - 29/6h3. Determine o(w(d)). -290d Let m(x) = -66x2 + 22x + 11. Let r(s) = -13s2 + 4s + 2. Let i(p) = -2m(p) + 11r(p). Let g(q) = q + 6q - 5q + 2q. What is g(i(t))? -44t*2 Let r(c) = -69c*2 + 4c. Let j(p) = -5934p2 + 345p. Let l(h) = 4j(h) - 345r(h). Let i(f) = -2f - 47 - 5 + 96 - 44. Give i(l(s)). -138s*2 Let x(y) = 9y*2 + 6y. Let p(n) = -130n - 129n - 138n - 129n + 525n. What is x(p(f))? 9f*2 - 6f Let c(m) = -4m2. Let y(a) = -3877718a. Determine c(y(o)). -60146787550096o2 Let s(x) = -3208x + 1602x + 1593x. Let j(w) = w*2 - 8. Give s(j(t)). -13t*2 + 104 Let p(r) = 3r. Let k(c) = 492923c2. Determine k(p(g)). 4436307g2 Let r(g) be the third derivative of -g4/24 + 2g2 - 110. Let w(f) be the third derivative of f4/4 - 3f3/2 + f2. What is w(r(t))? -6t - 9 Let m(o) = -377o + 7. Let q(j) = -22305j2. Give m(q(l)). 8408985l*2 + 7 Let g(v) be the first derivative of 175 + 0v2 - 182 + v2. Let s(m) be the second derivative of m*3/6 - 82m. Give g(s(x)). 2x Let b(t) = -6t + 22. Let n(p) = -97p2 - 19p + 1. Calculate b(n(r)). 582r2 + 114r + 16 Let d(s) be the second derivative of s*3 - s - 2686. Let t(i) be the first derivative of -7i*3/3 + 1. What is d(t(y))? -42y*2 Let r(a) = 4067a*2 + 8a. Let d(v) = -4v. What is d(r(c))? -16268c*2 - 32c Let l(v) = -6v2. Let u(r) be the second derivative of r - 37 + 0r*2 - 11/6r*3. What is u(l(z))? 66z*2 Let h(q) = -2q - 30766. Let n(k) = 457k. Calculate h(n(d)). -914d - 30766 Let v(u) = 2u2. Let m(d) = -d2. Let g(c) be the second derivative of 1/3c*4 + 0c*3 - 24c + c*2 + 0. Let i(p) = -g(p) - 6m(p). Determine i(v(j)). 8j4 - 2 Let a(p) = 5p. Let y(z) be the third derivative of 0z + 1 + 10z*2 - 1/3z*4 + 0z*3. Determine a(y(i)). -40i Let u(g) = 1735g. Let c(q) = 9106q*2. Give c(u(n)). 27411108850n2 Let w(u) = -u2 - 16. Let t(x) = 15x2 - 11x - 11. Let m(c) = 3c2 - 2c - 2. Let i be 40 + -42 + 22. Let r(d) = it(d) - 11m(d). Determine r(w(y)). -3y*4 - 96y*2 - 768 Let y(a) = -2a*2. Let q(h) = -12174059h*2. Determine q(y(r)). -48696236r*4 Let l(v) = -8v. Let c(m) be the third derivative of -205m5/12 - 191m*2 - 11. Calculate c(l(z)). -65600z*2 Let v(y) be the first derivative of 0y*2 - 262 + 0y + 23/3y3. Let t(l) = -2l. Calculate t(v(x)). -46x2 Let f(c) = -2c. Let x(q) = 72q2 + 27. Calculate x(f(k)). 288k*2 + 27 Let j(h) = -333 - 360 - 6h + 730 + 14h. Let s(w) = 2w*2. Calculate j(s(t)). 16t*2 + 37 Let c(z) = z + 35. Let d(m) = -3m*2 - 29m - 34. What is c(d(l))? -3l2 - 29l + 1 Let y = -199 - -205. Let x(w) = -2w - yw + 3w. Let o(u) be the second derivative of 5u*3/6 + 2u. What is x(o(z))? -25z Let a(t) be the third derivative of -t4/12 + 13t*2. Let o(w) = -27w*2 - 11w*2 + 18w*2. Calculate a(o(j)). 40j*2 Let q(b) = 2b*3. Let n be q(1). Let y(c) = 3c - 132c2 - 3c + 131cn. Let r(s) = 588s*2 - 582s*2 - 2 + 2. What is r(y(f))? 6f*4 Let f(y) be the third derivative of 0y - 6y2 + 0y*4 + 6/5y*5 + 7 + 0y3. Let w(i) = -i2. Give w(f(z)). -5184z4 Let g(n) = 3n. Let s(h) = -9h - 12. Let l be (-1 + 19)(-3)/93. Let a(k) = -k - 2. Let t(r) = la(r) + 3s(r). Give t(g(p)). -27p Let c(o) = -25o. Let g(j) = -266976j*2. Give g(c(i)). -166860000i*2 Let i(a) = 298a*2. Let q(l) be the first derivative of -3l*2 + 9397. Give q(i(x)). -1788x2 Let b(r) be the second derivative of -r3/3 - 139777r. Let y(p) be the second derivative of -13p*4/2 + p. Give y(b(z)). -312z*2 Let k(y) = 422y*2. Let q(r) = 14707r*2. Determine q(k(o)). 2619081388o*4 Let w(k) = 89k. Let x(h) = -50	{ "pile_set_name": "DM Mathematics" }
2 - 5d - 1. Let x be z(3). What is the third derivative of 1 + 48o4 + 4o*2 - 65o*4 - 50o*4 + 12o*x wrt o? -1608o Find the third derivative of -88i + 1033i*2 - 343i*3 + 183i + 1040i3 - 95i wrt i. 4182 Let v = -189 - -266. Let m = 102 - v. Find the first derivative of 18 + 3 + m - 12 - 9i wrt i. -9 Let p(n) = -n3 - 284n*2 + 14n + 35. Let u(h) = -280h2 + 13h + 35. Let a(v) = -2p(v) + 3u(v). Find the second derivative of a(c) wrt c. 12c - 544 Let s(q) be the first derivative of 13/2q*6 + 0q*4 - 10q - 3/2q2 + 0q*3 - 89 + 0q*5. What is the second derivative of s(y) wrt y? 780y*3 Let c be (-16)/96 - (-47)/(-6). Let v be 12/c - 9/(-2). Find the second derivative of 3j*4 - 7j*5 - vj*4 - 15j - 15j5 wrt j. -440j*3 Let w(y) = -y - 1. Let f(x) = -2225x - 1572. Let h(c) = f(c) + 4w(c). Differentiate h(g) wrt g. -2229 What is the second derivative of -519 - 1211w*3 + 147w*5 + 256 - 1667w + 260 - 149w5 wrt w? -40w*3 - 7266w Find the first derivative of 3111 + 248w + 984 - 2189w - 2119w wrt w. -4060 Let q = 91 + -79. Differentiate -63 - 23z*2 + qz*2 + 0z*2 + 2z3 - z2 wrt z. 6z2 - 24z What is the second derivative of 16 + 2601d + 256d*4 + 881d*4 - 263d*4 - 16 wrt d? 10488d*2 Suppose -7p = -5p - 6. What is the third derivative of 26i*4 - 65i*2 - 63235i*p + 63235i*3 wrt i? 624i Suppose 8g = -40g + 2832. What is the first derivative of -38q + gq - 21q + 32 + 11q*3 + 17q*3 wrt q? 84q*2 Let c(y) = -72y + 248. Let s(m) = 3. Let a(z) = 4c(z) - 176s(z). What is the first derivative of a(v) wrt v? -288 Let m be (-1)/(-2)(79 - 79). Let s(l) be the second derivative of -l2 + ml*3 + 0 - 16l + 1/12l4. Find the first derivative of s(v) wrt v. 2v Let n(i) = 7i2 + 29i - 68. Let a(j) = -2j2 - j. Suppose 5l = 0, 2l + 7 + 8 = -5d. Let s(x) = da(x) - n(x). Differentiate s(q) wrt q. -2q - 26 Let z be 3 - -7 - 2 - 6. What is the third derivative of -33fz + 32f*6 + 75f*2 - 43f*6 wrt f? -1320f*3 Let m(u) = -3u - 11. Let x be m(-4). Let z = 20 - x. Find the second derivative of zo + 64o*5 + 57o*5 - 126o*5 wrt o. -100o*3 What is the second derivative of 483i + 2763 - 1498i3 - 481i + 8182i3 wrt i? 40104i Let o = -46 - -55. Find the first derivative of og2 - 209g*3 - 8g*2 + 62 + 402g*3 - 119g*3 wrt g. 222g*2 + 2g Let o be 38/(-5)(-2660)/4256. Let f(k) be the first derivative of 15 - 21/2k*2 + 0k + 0k3 - ok*4. What is the second derivative of f(p) wrt p? -114p Let o(t) be the first derivative of -10336t7/7 + 332t*3 - t - 8705. Find the third derivative of o(z) wrt z. -1240320z*3 Let l(i) be the third derivative of -1763i5/60 - i4/6 + 130i3/3 - i2 - 438. Find the second derivative of l(s) wrt s. -3526 Suppose 24a - 36a + 588 = 0. Differentiate -133 - t - at*2 - 38t*2 + 60t*2 with respect to t. -54t - 1 Let x(y) = 9744y3 + 25y*2 - 9y - 29. Let i(f) = 48719f3 + 126f*2 - 42f - 142. Let m(s) = 3i(s) - 14x(s). Find the third derivative of m(a) wrt a. 58446 Let c be (3 - (-18 - -20)) + 2 + 0. Let a be 1/(-1) + 3 - -5. Find the first derivative of a + 3b3 - 13b*3 - 3b*c wrt b. -39b*2 Find the second derivative of -8434q*5 - 4q*2 - 191 + 4047q*5 + 4141q*5 + 2q + 3q wrt q. -4920q*3 - 8 Let a(l) be the third derivative of 2159l*8/336 - 191l*5/10 + 561l*2. What is the third derivative of a(j) wrt j? 129540j*2 Find the third derivative of 2868u*3 - 6 - 259u*2 - 223u*3 - 958u*3 - 859u3 wrt u. 4968 Let b(z) = -z3 + 10z2 + 5z - 22. Let k be b(10). What is the second derivative of -38u4 + 21 - 114u*4 - 8 + ku*4 + 13u wrt u? -1488u2 Let m(j) = -4331j*3 - 2j*2 + 522j + 24. Let h(n) = 2162n3 + n2 - 258n - 12. Let s(d) = -5h(d) - 2m(d). Find the third derivative of s(y) wrt y. -12888 Let x(i) = -299i2 + 2i - 1139. Let u(j) = -897j2 + 7j - 3418. Let y(t) = 2u(t) - 7x(t). What is the derivative of y(a) wrt a? 598a Let s(a) be the third derivative of 2663a7/210 + a4/8 + 499a3/6 + 1635a*2. Find the second derivative of s(c) wrt c. 31956c*2 Let i(g) be the first derivative of -7g*4/4 + 17g*3/3 + 3g*2/2 - 2717g + 2883. What is the derivative of i(q) wrt q? -21q2 + 34q + 3 Let d(c) be the second derivative of -643c7/14 + 749c*4/6 + 8c + 176. Find the third derivative of d(i) wrt i. -115740i2 Suppose -2t - 4p = -458, 2t = 5t + 5p - 686. Differentiate -tl + 8 + 137 + 25 + 549l wrt l. 322 Let c(p) = -p*3 - 13p*2 + p + 17. Let a be (16/(-6))/4(-78)/(-4). Let g be c(a). Find the first derivative of 13 - gm3 - 13m*3 - 3m*3 wrt m. -60m*2 What is the first derivative of -7k - 484 - 131k2 - 638 - 329 + 2k - 184 wrt k? -262k - 5 Let k = -819 - -828. Find the first derivative of 22p*2 + 49p - 41 - 2p4 - 13p*2 - kp*2 - 181p wrt p. -8p3 - 132 Let h(w) be the first derivative of -w5/5 + 89w*4/4 - 3020w + 614. What is the derivative of h(d) wrt d? -4d3 + 267d*2 Let u(a) be the first derivative of -5593a*2/2 - 905a + 3832. Differentiate u(d) wrt d. -5593 Let s(o) be the first derivative of 166 + 2/3o3 + 0o*4 + 214/5o*5 + 0o*2 + 40o. Find the third derivative of s(y) wrt y. 5136y Let g(o) be the third derivative of 0o*6 + 10o*2 - 1/70o*7 - 1/15o*5 + 0 + 0o + 0o4 + 4/3o*3. Find the first derivative of g(b) wrt b. -12b*3 - 8b Let z(h) be the first derivative of 0h + 0h*5 - 11/3h*3 + 1/3h6 + 34 + h2 + 25/4h4. Find the third derivative of z(t) wrt t. 120t*2 + 150 What is the third derivative of -25r + 9800r2 + 9519r*4 - 40r - 2311r4 + 65r wrt r? 172992r Let f(r) = 374r*2 - 2231r + 20. Let o(n) = 375n2 - 2231n + 16. Let p(z) = 4f(z) - 5o(z). What is the second derivative of p(d) wrt d? -758 Let d be (-4)/(3 - -9) + 457/3. What is the first derivative of d - 880t2 - 869t*2 - 2t + 1727t2 wrt t? -44t - 2 Let o(p) = -1485p2 - 2725p - 60. Let g(s) = 496s2 + 908s + 21. Let f(q) = -20g(q) - 7o(q). What is the second derivative of f(i) wrt i? 950 What is the derivative of -7108 + 661j3 - 201j*3 + 6447 wrt j? 1380j*2 What is the first derivative of 1989 - 10q*2 + 826557q*4 + 10q*2 - 823573q*4 wrt q? 11936q*3 Let c be (-9)/(-2) + (-1)/(-2). Suppose -154 + 39 = -ck. What is the first derivative of -k - 167l4 + 139l*4 + 0 wrt l? -112l*3 Let z(o) = -622o*3 - 9o - 2489. Let k(s) = 311s3 + 4s + 1244. Let t(x) = 5k(x) + 2z(x). What is the first derivative of t(m) wrt m? 933m2 + 2 Let p(f) = 3075f*4 - 6058f*2 + 16f. Let l(y) = 15379y4 - 30290y*2 + 78y. Let t(n) = 8l(n) - 39p(n). What is the third derivative of t(g) wrt g? 74568g What is the derivative of -153 + s - 708s*2 + 368s*2 + 340s*2 - 757s*4 wrt s? -3028s*3 + 1 What is the third derivative of 318v + 24v3 + 136v*5 - 138v*5 - 72v - 2v2 wrt v? -120v*2 + 144 Let u = -2 - -10. Suppose 10 = t + 2k, 3k = 20t - 18t - 20. Differentiate -14a*3 - u + 32 + t wrt a. -42a*2 Let r(j) be the third derivative of 0j*4 + 137/60j*5 + 1/3j*3 + 3j + 26j2 + 0 + 199/120j6. What is the third derivative of r(k) wrt k? 1194 Let l(u) = u3 - 7u2 - 4u - 16. Let k be l(8). Let r(d) = -5 + k - 10 - d*3. Let g(w) = 11w*3 + 3. Let o(j) = -g(j) - 6r(j). Differentiate o(x) wrt x. -15x2 What is the derivative of 213892q*2 - 427822q*2 + 12q + 213903q2 + 175 wrt q? -54q + 12 What is the second derivative of -7 + 12f2 - 12f*2 - 73f*3 - 481f*3 + 139f + 14 wrt f? -3324f Let w(y) = -y2 - 8y + 55. Let x be w(-8). Find the first derivative of 39n3 + 136n*3 + 48 + 113n*3 - xn*3 + 12n*3 wrt n. 735n*2 Suppose -90 = -3k + 5z, 2k + 4 = -3z + 64. What is the third derivative of 149r*4 - 21r*3 - 16r*3 + 54r*2 + 36r*3 - kr*4 wrt r? 2856r - 6 Let x(g) be the second derivative of -25g + 0g*5 + 0g*4 + 0g*6 - 7/6g*3 + 281/42g*7 + 7/2g*2 + 2. What is the second derivative of x(w) wrt w? 5620w*3 What is the third derivative of -16m*5 + 2010m*5 - 7779m*2 + 221m*5 wrt m? 132900m**2 Supp	{ "pile_set_name": "DM Mathematics" }
3n + 12 + 1. Let f be (25 - i)(-2)/(-5). Calculate the highest common divisor of f and 36. 12 Suppose t - 2x = -3t + 56, -t - 5x + 25 = 0. What is the highest common divisor of 45 and t? 15 Let y = -11 + 139. What is the highest common divisor of 4 and y? 4 Let j(x) = 4x*3 - 2 - 3x*3 - x - 2x*2 + 4x. Suppose -m = -1 - 1. Let h be j(m). What is the highest common divisor of 4 and h? 4 Let x be (-2)/6 + 4/3. Suppose -5b = -4f - 25, -f = b + x - 15. Let v = -3 - -6. Calculate the greatest common divisor of v and b. 3 Suppose 2z + 328 = 4j, -3z + 6z = -3j + 228. What is the highest common divisor of j and 10? 10 Let q(n) = 3n*3 + 2n*2 - 2n - 3. Let t = 12 + -9. Let i be q(t). Let y(d) = 10d2. Let s be y(1). What is the highest common divisor of s and i? 10 Suppose -5i = 4r - 788, 7r + 458 = 3i + 2r. What is the greatest common divisor of i and 52? 52 Suppose s + 1 = 3. Let y be ((-90)/24)/(s/(-8)). Let a be (2/(-4))/(2/(-20)). Calculate the greatest common factor of a and y. 5 Let k(s) = -s*3 - 5s*2 - 5s - 4. Let p be k(-5). What is the greatest common factor of 21 and p? 21 Let v(n) = n*2 - 2n - 5. Let q be v(-7). Calculate the highest common factor of q and 87. 29 Let k be (-10)/15 + 13/(-3). Let v = k + 11. Calculate the greatest common divisor of v and 6. 6 Let l(s) = 3s2 - 8s - 11. Let o be l(8). Calculate the greatest common factor of o and 13. 13 Let t = 5 + 34. Calculate the highest common divisor of t and 13. 13 Let t(x) = -2x + 5. Let z be t(-8). Suppose -v + z = 1. Calculate the greatest common divisor of v and 5. 5 Let v be 59/7 - 9/21. Let x = 6 - -6. What is the highest common divisor of v and x? 4 Suppose 48 = 4k + 2k. Let r = -10 - -22. What is the highest common divisor of k and r? 4 Let r be (-286)/(-6) + (3 - (-56)/(-21)). What is the highest common divisor of 32 and r? 16 Let f = 3 - 1. Suppose -28 = -9i + 17. What is the greatest common factor of i and f? 1 Suppose -15 = k - 4k. Suppose -2r - k = 3. Let b(x) = -x*2 - 8x - 2. Let n be b(r). Calculate the greatest common divisor of n and 112. 14 Suppose 10 = 5o, -3s = 5o - 27 - 16. What is the highest common divisor of s and 55? 11 Suppose 0f + 4f = 0. Suppose f = 3z + 7 - 25. Suppose u = -0u + z. What is the highest common factor of u and 4? 2 Let i(j) = 2j*2 + 3j + 1. Let m be i(-2). Let x be 25/m - (-1)/(-3). Calculate the highest common factor of x and 72. 8 Let w be -3(-5 + 186/(-9)). Calculate the greatest common factor of 7 and w. 7 Let i be 4/((-48)/567)-4. What is the greatest common divisor of i and 7? 7 Let i be (2 + -1)/((-1)/(-17)). Let r(j) = i + 5 - 2j + j. Let s be r(0). Calculate the highest common factor of 2 and s. 2 Let u(s) = -26s - 11. Let t(n) = 9n + 4. Let v(w) = -17t(w) - 6u(w). Let p be v(2). Calculate the highest common factor of p and 28. 4 Let z be (-3)/((-1)/11). Suppose 11 = j + 2f - 2, -zj - 1 = -2f. What is the highest common divisor of 1 and j? 1 Let l = -123 - -130. Calculate the greatest common factor of 28 and l. 7 Suppose -4u - 12 = -32. Suppose us + 9 = -16. Let n be 345/25 + (-1)/s. What is the highest common factor of 28 and n? 14 Suppose -m + 2m - 5h - 23 = 0, -3h - 12 = 0. Let d = 141 + m. Let f = -33 - -51. What is the greatest common divisor of d and f? 18 Suppose -1 = -2n + 9. Let x(c) = c3 - 5c*2 + 5. Let l be x(n). Suppose -k + 2a = -72 - 71, -la = 20. What is the highest common divisor of 15 and k? 15 Let l(d) = 2d*2 - 6d. Let z be l(5). Let w be 105/3010/7. What is the highest common factor of z and w? 5 Suppose -4q - 3 = -23. Suppose 0 = -qo + 63 - 3. Calculate the highest common factor of o and 3. 3 Suppose -2r + 74 + 4 = 0. What is the greatest common divisor of r and 3? 3 Suppose -4k = 2y - 64, 95 = 3y - 0k + 5k. What is the greatest common divisor of 15 and y? 15 Suppose 5r = 5b - 0b - 445, -5b + 2r + 442 = 0. Suppose 2v = n - 16, 2n + n - b = -4v. Calculate the greatest common divisor of n and 8. 8 Let x = 143 - 71. Suppose -z - 2z + x = 2a, -3z = 3a - 108. Calculate the greatest common divisor of 12 and a. 12 Let k = -16 + 42. Calculate the highest common factor of 130 and k. 26 Suppose 2g - 7g = -20. Let a be (-32)/(-14) - g/14. Calculate the greatest common divisor of a and 14. 2 Suppose 0 = 3u - 3g - 159, u = -g - 5 + 60. Suppose b = -2b + u. Calculate the greatest common factor of b and 9. 9 Suppose -4x - 58 = 22. Let m = 35 + x. Suppose 4y - 83 = 37. What is the highest common factor of y and m? 15 Suppose -2j + 7 = 9, 5j = r - 9. Calculate the greatest common factor of 44 and r. 4 Let t = 4 - 5. Let f be 3 + t - -11. Let c be 6(2 - (-10)/(-6)). What is the greatest common divisor of f and c? 1 Suppose 0y - 2x = 4y - 254, 3x = -5y + 317. What is the highest common factor of y and 8? 8 Let f be (-15 - -20)/(1 + 0). Calculate the greatest common divisor of 180 and f. 5 Suppose 0 = -5w + 1253 - 403. Suppose w = 2g + 50. Suppose 4o - 8r - 80 = -3r, -4o + r = -64. What is the highest common factor of g and o? 15 Let b(u) = -u3 + 10u*2 - 8u + 3. Let p be b(9). What is the highest common divisor of 228 and p? 12 Suppose 2p = -7p + 108. Calculate the highest common factor of p and 9. 3 Suppose 0 = o + 3o - 4. Suppose o = -s + 9. What is the highest common factor of s and 8? 8 Let u(i) = -2i - 4. Let g be u(-3). Let d be (1 - 9/g)-2. Calculate the greatest common factor of d and 28. 7 Suppose 3j - 7j = -12. Suppose 2p = -5o + 9, o + j = -0p - 2p. What is the greatest common divisor of o and 3? 3 Let s(w) = -w2 + 7w + 3. Let o be s(7). Suppose -68 = -oq - 4v, q + 2q - 71 = -v. Suppose 2n = -0n + q. What is the highest common factor of n and 8? 4 Let d be 126/(-12)(-12)/9. What is the greatest common divisor of d and 14? 14 Let q(v) = -v*3 + 8v*2 - 5v + 7. Let k(w) = -4 + 1 - 4w - w. Let r be k(-2). Let b be q(r). What is the highest common factor of 147 and b? 21 Let d be (-8)/(-3)(-9)/(-6). Suppose -17 = -du - 5. Let k(l) = l3 + l2 + 2l - 2. Let o be k(u). Calculate the highest common divisor of 60 and o. 20 Let g(f) = -f*3 - 2f*2 + f - 15. Let h be g(-5). Calculate the greatest common factor of 11 and h. 11 Let b(g) be the third derivative of 4/3g*3 + 0 - 1/24g*4 + 0g + 2g2. Let o be b(7). Calculate the greatest common divisor of 7 and o. 1 Let n = 105 - 63. Calculate the highest common divisor of 14 and n. 14 Let l = 38 + 10. What is the highest common divisor of 24 and l? 24 Suppose 12n = 3n + 153. Calculate the highest common divisor of 289 and n. 17 Let p be (1 + 1)/((-6)/(-9)). Let h = 13 - p. What is the highest common factor of 110 and h? 10 Let l = 11 + -7. What is the greatest common divisor of l and 4? 4 Let l(m) = 32m*2 + 3m - 2. Let o be l(1). What is the greatest common divisor of 297 and o? 33 Suppose -6m + 10 = -m. Suppose -5v + 2o = -8, -o - m = -v + 2. Suppose 6 = -vk + 2k. What is the highest common divisor of k and 33? 3 Suppose 23 = 5d + 3. Let l be 15(d - 1)/(-3). Let g = l + 29. Calculate the highest common divisor of g and 112. 14 Let b(v) = v3 - 7v*2 + 8v + 6. Let d be b(6). Let m be (3 - 0)/((-54)/(-36)). Calculate the highest common divisor of d and m. 2 Let d(r) = -r*3 - 5r*2 + 11r + 6. Let o be d(-8). Let n = 34 + -24. Calculate the greatest common factor of n and o. 10 Let j(w) = w*3 + 5w*2 - 5w + 7. Let i be j(-6). Suppose -5u = -26 + 1. Calculate the highest common divisor of u and i. 1 Let h be (-392)/(-12) - (-1)/3. Let j = -13 + 18. Suppose -2q = -jv + 43 + 14, 3q - 30 = -3v. What is the greatest common divisor of v and h? 11 Let k(x) = -2 + 0 + 1 - x. Let r be k(-4). Suppose u = 4c + 17, 2c = -3u + rc + 18. What is the highest common divisor of u and 1? 1 Let y(w) = 0w*2 - 3 + 5w + 1 - w2 - w2 - w*3. Let f be y(-6). Calculate the greatest common factor of 14 and f. 14 Let c = 55 - 11. Calculate the highest common divisor of 44 and c. 44 Let t = 12 + 25. What is the greatest common factor of t and 148? 37 Let q be ((-5)/(-2))/((-2)/(-48)). Let i = 11 + 9. Calculate the highest common divisor of i and q. 20 Let f(a) = 84a. Let k be f(2). What is the highest common factor o	{ "pile_set_name": "DM Mathematics" }
2 What is the highest common divisor of 145020 and 660? 60 What is the highest common factor of 813 and 5335719? 813 What is the greatest common divisor of 14150 and 14825? 25 What is the greatest common divisor of 15657 and 124335? 921 What is the highest common divisor of 469 and 930295? 67 Calculate the highest common divisor of 612 and 1569168. 612 Calculate the greatest common factor of 234 and 79586. 26 Calculate the greatest common factor of 261 and 899. 29 Calculate the greatest common divisor of 1341 and 972. 9 Calculate the greatest common divisor of 240 and 141528. 24 What is the highest common factor of 1571620 and 6265? 895 Calculate the greatest common divisor of 19572 and 8. 4 Calculate the greatest common factor of 614358 and 8074. 734 What is the highest common factor of 25637 and 31? 31 What is the greatest common divisor of 257 and 238753? 257 What is the highest common divisor of 6 and 368547? 3 What is the highest common factor of 20009 and 1111? 11 Calculate the greatest common divisor of 2000 and 685. 5 What is the greatest common factor of 24 and 38856? 24 Calculate the greatest common factor of 731211 and 52. 13 What is the highest common divisor of 137924 and 58? 58 What is the greatest common factor of 3036 and 5704? 92 What is the highest common divisor of 6777 and 114? 3 Calculate the highest common divisor of 578400 and 16629. 723 Calculate the highest common factor of 171 and 94509. 9 What is the greatest common factor of 68 and 158? 2 What is the greatest common divisor of 55 and 672529? 11 What is the greatest common divisor of 10706 and 707? 101 Calculate the highest common divisor of 24376 and 1012. 44 Calculate the greatest common divisor of 4725 and 850. 25 Calculate the greatest common divisor of 30972 and 14703. 87 Calculate the highest common divisor of 200 and 31300. 100 What is the highest common factor of 339684 and 12? 12 What is the highest common divisor of 884 and 635324? 68 What is the highest common factor of 28092 and 12? 12 Calculate the highest common factor of 75284 and 20119. 649 Calculate the highest common divisor of 5372 and 1632. 68 Calculate the greatest common divisor of 667664 and 176. 16 Calculate the greatest common factor of 12 and 29578. 2 What is the greatest common divisor of 246 and 1074? 6 What is the highest common factor of 360 and 423? 9 What is the highest common factor of 3300 and 1217100? 300 What is the highest common divisor of 75040 and 1675? 335 What is the highest common divisor of 33631 and 9751? 199 What is the greatest common factor of 75 and 78675? 75 What is the greatest common factor of 301 and 4613? 7 What is the greatest common divisor of 95382 and 238? 14 What is the highest common divisor of 26307 and 777? 111 Calculate the greatest common factor of 78 and 17928222. 78 What is the highest common factor of 343635 and 155? 155 What is the greatest common divisor of 53295 and 765? 255 Calculate the highest common divisor of 10095811 and 583. 583 Calculate the highest common factor of 37760 and 10880. 640 What is the greatest common factor of 1316 and 14852? 188 What is the greatest common divisor of 9759407 and 19? 19 What is the greatest common divisor of 1340 and 78055? 335 Calculate the highest common divisor of 4992 and 3108. 12 Calculate the greatest common factor of 1154677 and 487. 487 What is the highest common factor of 118 and 23659? 59 What is the greatest common factor of 225264 and 16848? 624 What is the highest common factor of 77 and 46123? 77 What is the greatest common divisor of 1314 and 2718? 18 What is the greatest common divisor of 1130 and 860608? 226 Calculate the highest common divisor of 35271 and 63. 9 Calculate the highest common factor of 57151 and 69093. 853 What is the greatest common factor of 200 and 14312? 8 What is the highest common factor of 68747 and 1449? 161 What is the highest common divisor of 4828 and 1156? 68 Calculate the greatest common divisor of 90 and 38470. 10 Calculate the greatest common factor of 6366 and 18. 6 What is the greatest common divisor of 2037 and 60237? 291 What is the highest common factor of 42950 and 1350? 50 Calculate the highest common divisor of 119124 and 108. 108 Calculate the highest common factor of 102 and 46512. 102 What is the highest common divisor of 800 and 3275? 25 Calculate the greatest common divisor of 1680 and 868. 28 Calculate the greatest common divisor of 175412 and 4. 4 Calculate the greatest common factor of 98238 and 42. 42 Calculate the greatest common factor of 7015 and 4636. 61 What is the highest common divisor of 3900 and 96? 12 Calculate the highest common factor of 2697 and 1023. 93 Calculate the greatest common divisor of 695 and 77006. 139 What is the greatest common factor of 2070875 and 75? 25 Calculate the highest common divisor of 26418 and 1998. 222 Calculate the highest common divisor of 3508 and 24. 4 What is the greatest common divisor of 365000 and 73? 73 Calculate the greatest common divisor of 41934 and 174. 174 Calculate the greatest common factor of 536922 and 2282. 326 What is the greatest common factor of 377 and 3567? 29 What is the greatest common factor of 24254 and 536? 134 Calculate the highest common factor of 49098 and 16464. 294 What is the greatest common divisor of 9 and 3308427? 9 What is the highest common divisor of 12210 and 825? 165 Calculate the greatest common factor of 3484 and 14204. 268 Calculate the greatest common divisor of 724 and 289781. 181 What is the greatest common divisor of 134 and 280060? 134 Calculate the highest common divisor of 30584 and 104. 8 What is the highest common divisor of 12270 and 60? 30 What is the highest common factor of 10640 and 349790? 1330 Calculate the highest common divisor of 486 and 96. 6 What is the highest common divisor of 108513 and 45? 9 What is the greatest common factor of 326368 and 104? 8 What is the highest common divisor of 5221 and 6463? 23 Calculate the highest common factor of 4340 and 1820. 140 What is the greatest common divisor of 1167997 and 47? 47 Calculate the greatest common factor of 2331037 and 37. 37 Calculate the highest common divisor of 503 and 9017784. 503 What is the greatest common factor of 122 and 1274107? 61 What is the highest common factor of 2329 and 33286? 17 Calculate the greatest common factor of 1690 and 51714. 338 What is the greatest common factor of 44034 and 3? 3 What is the greatest common divisor of 7 and 86345? 7 Calculate the highest common factor of 410 and 142. 2 Calculate the highest common factor of 11 and 281743. 11 What is the highest common divisor of 134 and 43081? 67 Calculate the greatest common divisor of 31036 and 16. 4 What is the greatest common factor of 1652864 and 1745? 349 Calculate the highest common factor of 6187 and 1016282. 269 Calculate the greatest common divisor of 6580 and 7420. 140 Calculate the highest common divisor of 132 and 265155. 33 Calculate the greatest common factor of 67458 and 18. 6 Calculate the highest common factor of 1484 and 230762. 742 What is the highest common factor of 3161 and 2929? 29 What is the greatest common factor of 354060 and 35? 35 What is the greatest common divisor of 22358 and 14? 14 What is the greatest common factor of 4374512 and 101? 101 Calculate the greatest common divisor of 351 and 12363. 39 What is the greatest common divisor of 31 and 92969? 31 Calculate the greatest common factor of 15 and 3273. 3 Calculate the greatest common divisor of 1002825 and 10. 5 Calculate the highest common divisor of 15 and 214860. 15 What is the greatest common factor of 22374 and 1287? 99 Calculate the greatest common divisor of 468780 and 7020. 780 What is the greatest common divisor of 92966 and 73186? 1978 What is the highest common factor of 2071 and 14117? 19 What is the highest common divisor of 27 and 128484? 9 Calculate the highest common divisor of 7707028 and 28. 28 Calculate the highest common factor of 2880 and 1201680. 720 Calculate the greatest common divisor of 123 and 78720. 123 Calculate the greatest common divisor of 4752 and 342. 18 What is the greatest common divisor of 189 and 567252? 63 What is the highest common factor of 264 and 395472? 264 Calculate the greates	{ "pile_set_name": "DM Mathematics" }
.9 Let d = -0.04 + 0.0832. Let j = -0.04 + d. Round j to 3 decimal places. 0.003 Let l = 81 - 51. Let p = l + -30.00152. Round p to four dps. -0.0015 Suppose 0w + 3w = 12. Suppose -5g - wo - o = -2749985, -2g + 1100015 = -5o. Round g to the nearest 100000. 600000 Let v = 10 + -6. Suppose -5633 = vf + 4767. What is f rounded to the nearest one thousand? -3000 Let t = -54 - -53.9933. What is t rounded to three dps? -0.007 Let l = 0.1100012 + -0.11. What is l rounded to 6 dps? 0.000001 Let b = 36 - 10. Round b to the nearest 10. 30 Let g = -33 - -32.87. Let w = 26.646449 + -26.5163. Let c = w + g. Round c to 5 dps. 0.00015 Let x(c) be the third derivative of -1949c4/24 - c3/3 + 3c2. Let p be x(2). What is p rounded to the nearest 1000? -4000 Let g(u) = u3 - 6u*2 - u + 4. Let b be g(5). Let m be (-6 - b)/(1/(-4)). Let w be (m/3)/(2/(-750)). Round w to the nearest ten thousand. 10000 Let z = 0 - 0.0007. What is z rounded to three decimal places? -0.001 Let c = -94 - -95.02. Let w = 5.84 + -6. Let j = c + w. Round j to 1 decimal place. 0.9 Let t(i) = 24501i*3 - 9i*2 - 10i. Let l be t(10). What is l rounded to the nearest one million? 25000000 Let h = 606514 + -606506.000006. Let q = h + -8. What is q rounded to six dps? -0.000006 Let s = -25.99932 - -26. Round s to four dps. 0.0007 Let t = 37.999824 - 38. What is t rounded to five dps? -0.00018 Let g = 67 - 15. Let w = g - 51.9943. What is w rounded to 3 dps? 0.006 Let c = 1949762 + -1949767.000004. Let h = 5 + c. What is h rounded to 5 decimal places? 0 Suppose -4o - 333516 = s - 21514, 2o = -5s - 156010. Round o to the nearest 10000. -80000 Let f = 4434 + 1221. Let i(u) = fu + 0 - 5 + 346u. Let o be i(5). Round o to the nearest ten thousand. 30000 Let g = 151.51721 - -12.90489. Let b = 0.3221 - g. Let v = b - -156. What is v rounded to the nearest integer? -8 Let f = -304125.3 - -304144.299985. Let w = 19 - f. Round w to 6 dps. 0.000015 Let c = 3478338853 - 3478338832.19999901. Let t = c + -20.8. What is t rounded to seven decimal places? 0.000001 Suppose 5y + 3o + 46 = 0, 4y - o + 3o = -36. Let x be y/(-28) - 649/(-7). Round x to the nearest ten. 90 Suppose 2j - 4l - 2326546 = -0l, 2l = 3j - 3489823. Let c = 563275 - j. Round c to the nearest one hundred thousand. -600000 Let p = -158.0174 + 158. What is p rounded to 2 dps? -0.02 Let p = 27.38 - 27. Let l = -0.16 + p. What is l rounded to 1 decimal place? 0.2 Let w = -73 - -283. Round w to the nearest 100. 200 Let w = -11.029 + -0.271. Let z = 11.30000061 + w. Round z to 7 dps. 0.0000006 Let x = -2 + -3. Let h = 4.92 + x. What is h rounded to two decimal places? -0.08 Let u(z) = -z - 7. Let q be u(-10). Suppose 362425 + 2397575 = -qi. Round i to the nearest one hundred thousand. -900000 Suppose -l = -p - 6600002, 4l - 11 + 3 = 0. What is p rounded to the nearest 1000000? -7000000 Let x(u) = -71741u3 + 9u*2 - 8u + 10. Let a be x(-9). Round a to the nearest 1000000. 52000000 Let c = 19 + -11. Let l = 59 - c. Let t = l + -51.00058. Round t to four dps. -0.0006 Let o = -21.0000085 + 21. Round o to six dps. -0.000009 Let p = 19.71 + -20. What is p rounded to one decimal place? -0.3 Let x = -2.9 + 2.9227. What is x rounded to 3 decimal places? 0.023 Let h = -308179.240177 + 308245.24. Let i = -66 + h. What is i rounded to five dps? -0.00018 Let m = -171.99999853 - -172. Round m to seven dps. 0.0000015 Let v = 4 - 3.94. What is v rounded to 2 decimal places? 0.06 Suppose -948 = m - 5o + 227, 4m = o - 4605. What is m rounded to the nearest 100? -1200 Let v = 1014.99999433 + -1015. Round v to 6 decimal places. -0.000006 Let b = -0.0697664 + -22.6311636. Let v = -22.7 - b. What is v rounded to 4 decimal places? 0.0009 Let u = -0.41 - -0.01. Let d = -18.6 + u. Let k = 21.4 + d. What is k rounded to 0 dps? 2 Let d = -24 - -9. Let u = d - -14.9989. What is u rounded to three decimal places? -0.001 Let c(i) = 519999i - 1. Let h be c(-1). Round h to the nearest one hundred thousand. -500000 Let s = 43 + -43.641. Let v = s - -0.67. Round v to two decimal places. 0.03 Let t be (-133554)/(-15) - 2/(-5). Let g be t/27 - (-4)/18. Round g to the nearest one hundred. 300 Let i = 21.06023 - 20.91022952. Let j = -0.15 + i. What is j rounded to seven dps? 0.0000005 Let f(r) = 799r + 5. Let d(g) = g3 + g2 - 2g - 1. Let s be d(-1). Let h be s/(-3 - (-16)/5). Let i be f(h). What is i rounded to the nearest 10000? 0 Let t = 0.05601382255 - 125.84162364255. Let h = t + 125.48561. Let q = 0.3 + h. What is q rounded to seven decimal places? 0.0000002 Let q = -11.028 - -10.8. Round q to 2 decimal places. -0.23 Suppose 6b - 14415 = 3b. Suppose -q = 5d - b, -2q + 12244 = 3d + 2641. What is q rounded to the nearest 1000? 5000 Let w = -218 - -326. Let y = w + -108.00061. Round y to four decimal places. -0.0006 Let k = 137.3 - 144. What is k rounded to 0 dps? -7 Let u be 435/(-2) - 4/8. What is u rounded to the nearest ten? -220 Let z = 4 + -3.999997. Round z to five dps. 0 Let g = 13 + -12.05. Let i = g + -1. Round i to 2 decimal places. -0.05 Let l = -1.599 - -1.6. Let y = 3.5 + -3.50142. Let j = l + y. What is j rounded to 4 decimal places? -0.0004 Let p be (3 + (-63)/15)/(1/(-25000)). Round p to the nearest one hundred thousand. 0 Suppose -1 = -j - a, -5j = -j + 5a - 5. Suppose -3q + j = -3. Let f be q-1344(2 + 3123). What is f rounded to the nearest 1000000? -4000000 Let z = -20.4 - -11.1. What is z rounded to 0 decimal places? -9 Suppose 16 = -2d + 12. What is d rounded to 0 dps? -2 Let n = 2 - -11.3. Let q = n - 14. What is q rounded to 1 decimal place? -0.7 Let i = -24004.8067 + 23973.8. Let y = 31 + i. Round y to 3 dps. -0.007 Let j = -3 + 3.000221. Round j to 5 dps. 0.00022 Let a = -72 + 71.99768. Round a to 4 decimal places. -0.0023 Let m = 62 - 43.9. What is m rounded to zero decimal places? 18 Let l = -3 - -3. Let y = -1 - l. Let r be (-2 - y) + 9198/(-2). What is r rounded to the nearest 1000? -5000 Suppose -5y + 9 = a - 3y, 4a + 3 = 5y. Let n be 2 + 147 - a/(-3). What is n rounded to the nearest 100? 200 Let b(g) = -3g - 1. Let j(d) = d2 - 2d + 1. Let z be j(2). Let w be b(z). Round w to the nearest ten. 0 Let s = 5 + -5. Suppose -5c - 51145 + 556145 = s. Round c to the nearest 10000. 100000 Let l = -138.09093818 - -137.97594. Let c = l + 0.115. Round c to 7 decimal places. 0.0000018 Let a be (-3 + 11)(-4 + -1). Let v be 4(-5)/(a/402). What is v rounded to the nearest 10? 200 Let c(v) = -52v - 2. Let x(h) = -104h - 4. Let b(a) = 5c(a) - 3x(a). Let n = 5 - 1. Let w be b(n). Round w to the nearest one hundred. 200 Suppose -2m + 4j - 604 = 0, 4j + 497 = -2m - 99. Round m to the nearest one thousand. 0 Let b = -1.0006 - -1. Round b to 3 dps. -0.001 Let d = 15.91 - -0.49. Let p = -143.4 + d. Let l = 127.0000079 + p. Round l to six decimal places. 0.000008 Let v = 33323963.00181 - 33323541. Let d = -422 + v. What is d rounded to four dps? 0.0018 Let g = 5.9 + -5.833. What is g rounded to two dps? 0.07 Let y = 292.000000346 - 292. What is y rounded to seven decimal places? 0.0000003 Let u = 68.6 - 90. Let t = u + 21.634. What is t rounded to two dps? 0.23 Suppose 2x - 12800000 = 4b, 3b - 5x + 6400000 = b. Round b to the nearest one million. -3000000 Let u = 3.8 + -3. Let v = 444 + -443.244. Let h = u - v. Round h to 2 dps. 0.04 Let m = -0.317 - -0.5. What is m rounded to 2 dps? 0.18 Suppose -5z + 4n + 7158 = 45836, -2n - 30932 = 4z. Let r = z + 4634. What is r rounded to the nearest one thousand? -3000 Let s = 7 + -7.12. Let r = 0.1186 + s. What is r rounded to three decimal places? -0.001 Let m = 6.7 + 1.3. Let d = -8.003 + m. What is d rounded to two decimal places? 0 Let q be (-290946636)/21 - (-4)/(-14). Let b = q - -19854602. What is b rounded to the nearest 1000000? 6000000 Let g(i) = -474999i*3 - 3i - 2. Let b be g(-1). Round b to the nearest ten thousand. 480000 Let s = -0.15 - 5.85. Let y = s + 6.023. What is y rounded to two dps? 0.02 Let d = 637672 + 2071685. Let u = 2709355.019913 - d. Let x = u + 1.98. What is x rounded to 5 dps? -0.00009 Let r = -0.6 - -2.3. Let j = r + -1.7000069. What is j rounded to 6 dps? -0.000007 Let w(t) = -42t3 + 7t*2 - 7t - 8. Supp	{ "pile_set_name": "DM Mathematics" }
9 millennia? 960610800 What is 59364.86 litres in millilitres? 59364860 How many grams are there in eleven eighths of a kilogram? 1375 Convert 14071.11 months to years. 1172.5925 Convert 9127.824 litres to millilitres. 9127824 How many micrograms are there in 89.75557t? 89755570000000 Convert 859616.2 years to centuries. 8596.162 How many hours are there in 6.4989945ns? 0.00000000000180527625 What is 7/2 of a gram in milligrams? 3500 How many years are there in 1035.777 millennia? 1035777 What is 4.912909 centuries in months? 5895.4908 How many millilitres are there in 0.7259004 litres? 725.9004 What is 774.2966l in millilitres? 774296.6 Convert 83.44341ms to nanoseconds. 83443410 How many meters are there in 4.038797nm? 0.000000004038797 Convert 152.7098km to nanometers. 152709800000000 Convert 675645.6 days to hours. 16215494.4 How many millilitres are there in 57/5 of a litre? 11400 What is 55.8575kg in grams? 55857.5 What is 64554.7ml in litres? 64.5547 What is 62.44985 decades in millennia? 0.6244985 How many millilitres are there in 1/4 of a litre? 250 How many grams are there in 0.5874805ng? 0.0000000005874805 What is 0.7211012l in millilitres? 721.1012 What is 6.65492 days in milliseconds? 574985088 How many seconds are there in three tenths of a hour? 1080 How many millimeters are there in 6/5 of a meter? 1200 What is 51/4 of a gram in milligrams? 12750 How many days are there in 14044.3524ns? 0.000000000162550375 What is 0.2765272 millennia in decades? 27.65272 Convert 234394.7 days to milliseconds. 20251702080000 Convert 86441.79 years to months. 1037301.48 What is 889305.8 nanometers in meters? 0.0008893058 How many hours are there in seventeen halves of a week? 1428 Convert 0.1463599 weeks to seconds. 88518.46752 What is fourty-two fifths of a millimeter in micrometers? 8400 How many days are there in 41195.394 minutes? 28.6079125 What is 3/5 of a milligram in micrograms? 600 How many years are there in 3/50 of a millennium? 60 Convert 45250.79ng to micrograms. 45.25079 How many micrometers are there in seventy-six fifths of a millimeter? 15200 How many millilitres are there in thirteen fifths of a litre? 2600 Convert 47021.72 minutes to microseconds. 2821303200000 How many micrometers are there in 26/5 of a centimeter? 52000 What is 4.21909cm in micrometers? 42190.9 How many micrometers are there in 1/4 of a millimeter? 250 What is two ninths of a day in seconds? 19200 What is six fifths of a litre in millilitres? 1200 What is eleven quarters of a kilogram in grams? 2750 Convert 2.417756 milliseconds to nanoseconds. 2417756 How many nanograms are there in 33593.83 kilograms? 33593830000000000 What is 34/5 of a century in years? 680 Convert 45259.45 hours to minutes. 2715567 How many micrometers are there in 5729.715 millimeters? 5729715 How many decades are there in 89.05736 millennia? 8905.736 What is 79/2 of a decade in months? 4740 What is 468.6562km in meters? 468656.2 What is 0.15611 millennia in years? 156.11 What is 899.7859mm in centimeters? 89.97859 What is 81431538.3us in weeks? 0.00013464209375 What is 3/25 of a litre in millilitres? 120 What is 6/25 of a litre in millilitres? 240 Convert 7569.5319 seconds to hours. 2.10264775 What is 72/5 of a millennium in centuries? 144 How many micrometers are there in 21/2 of a millimeter? 10500 What is 0.6626547 centuries in years? 66.26547 What is seven halves of a litre in millilitres? 3500 How many milliseconds are there in 6/5 of a second? 1200 What is 7681.923 milliseconds in minutes? 0.12803205 What is 1/10 of a decade in years? 1 How many months are there in seven quarters of a millennium? 21000 How many months are there in 32/5 of a century? 7680 Convert 559428.4 kilograms to milligrams. 559428400000 How many millennia are there in 283.8122 centuries? 28.38122 How many millilitres are there in 11.05475l? 11054.75 What is eighteen fifths of a gram in milligrams? 3600 What is three fifths of a tonne in kilograms? 600 What is 26.85042ml in litres? 0.02685042 How many nanoseconds are there in 27/5 of a microsecond? 5400 How many decades are there in 3/10 of a millennium? 30 What is 39.64462ml in litres? 0.03964462 What is 2851.933 centimeters in millimeters? 28519.33 What is 17/10 of a century in years? 170 Convert 438.9141ns to microseconds. 0.4389141 How many meters are there in 312.4133 centimeters? 3.124133 Convert 393.9271 litres to millilitres. 393927.1 Convert 601.4064ml to litres. 0.6014064 What is thirty-one halves of a millennium in decades? 1550 How many months are there in 7/8 of a decade? 105 Convert 72171.95nm to kilometers. 0.00000007217195 How many centuries are there in three tenths of a millennium? 3 What is 18/5 of a kilogram in grams? 3600 How many years are there in 9/10 of a decade? 9 How many kilograms are there in 6.669104 milligrams? 0.000006669104 What is 25/2 of a litre in millilitres? 12500 What is seventeen halves of a centimeter in micrometers? 85000 Convert 0.5463344 years to centuries. 0.005463344 What is 8.35305ng in tonnes? 0.00000000000000835305 What is 0.219355 centuries in months? 263.226 What is 52/5 of a microgram in nanograms? 10400 What is 0.2164631 nanometers in micrometers? 0.0002164631 How many grams are there in 21/8 of a kilogram? 2625 Convert 74.38187 litres to millilitres. 74381.87 How many years are there in 59675.41 millennia? 59675410 What is 523.559 litres in millilitres? 523559 How many millilitres are there in 5645.066l? 5645066 Convert 24102.01km to millimeters. 24102010000 How many kilograms are there in five quarters of a tonne? 1250 What is twenty-nine sixths of a decade in months? 580 What is 2/7 of a week in days? 2 How many months are there in four thirds of a year? 16 How many micrograms are there in thirteen fifths of a milligram? 2600 How many micrometers are there in 15/4 of a millimeter? 3750 What is 679903.8nm in kilometers? 0.0000006799038 How many minutes are there in one ninth of a week? 1120 What is 51519.94 centuries in millennia? 5151.994 Convert 4.038253 kilometers to millimeters. 4038253 How many litres are there in 0.5951618 millilitres? 0.0005951618 How many millilitres are there in 5576.915l? 5576915 What is 33/5 of a centimeter in millimeters? 66 Convert 0.6619888 nanoseconds to microseconds. 0.0006619888 What is 8.914508 litres in millilitres? 8914.508 How many years are there in 43/2 of a decade? 215 Convert 4951.876 kilograms to micrograms. 4951876000000 Convert 956.3883 minutes to seconds. 57383.298 Convert 917.9947 micrograms to grams. 0.0009179947 How many months are there in 7/3 of a year? 28 Convert 6715.429 decades to months. 805851.48 How many litres are there in 0.4845395 millilitres? 0.0004845395 What is 57/2 of a gram in milligrams? 28500 Convert 5.954852 weeks to hours. 1000.415136 What is seven sixteenths of a kilometer in centimeters? 43750 How many months are there in 31/6 of a decade? 620 How many grams are there in one fifth of a kilogram? 200 Convert 453026.1l to millilitres. 453026100 How many years are there in 4404.72 centuries? 440472 How many decades are there in 11/2 of a millennium? 550 What is seven halves of a minute in seconds? 210 What is 0.6952945 litres in millilitres? 695.2945 Convert 6297.666 grams to micrograms. 6297666000 Convert 99.09819km to millimeters. 99098190 What is 3822.652nm in kilometers? 0.000000003822652 How many months are there in 1/5 of a century? 240 What is 4.816448km in centimeters? 481644.8 How many minutes are there in two ninths of a week? 2240 How many litres are there in 86.5533ml? 0.0865533 Convert 5165.16 centuries to decades. 51651.6 Convert 125481.7494 milliseconds to weeks. 0.0002074764375 How many millimeters are there in 43/2 of a centimeter? 215 What is 7/4 of a millimeter in micrometers? 1750 Convert 5.256498l to millilitres. 5256.498 How many centimeters are there in 87.12772 micrometers? 0.008712772 What is 0.6280591 kilometers in meters? 628.0591 Convert 959.343021s to weeks. 0.0015862153125 How many millimeters are there in 0.8695448m? 869.5448 What is 77/2 of a litre in millilitres? 38500 How many seconds are there in four thirds of a hour? 4800 How many years are there in 9865.205 decades? 98652.05 What is thirteen fift	{ "pile_set_name": "DM Mathematics" }
- (1 + -9)) + (-188460)/21060 2/39 What is 362((-5402)/(-1095) - 5)? -24/5 Evaluate ((-36)/6)/((-630)/(-7665)). -73 What is the value of (-765)/1020224/120? -7/5 -30(-6279)/299(-4)/36 -70 Evaluate ((-21)/2)/(-28 + (-5198)/(-184) - 10/16). 28 What is the value of (((-272)/4284)/(1/(-9)))/(2/14) - -10? 14 (10/3050)/(-6(-17)/510) 1/61 What is the value of ((-80)/(-28))/((-194025)/(-146265))? 28/13 What is the value of ((-188)/12 - (268/12 + -21))1? -17 56 + (40 - 36) + (1 + -3)(6 - 1) 50 Evaluate -1211/(-22) - (-60 + (1 - -10)). 55 What is 17822/(-737) - -24 - (-1610)/143 - (14 - 2)? -12/13 What is 6/1 - 0 - 37? -31 (-234)/432-54 + (-50)/200 29 Calculate (-92 + (175 - 77))(-1)/(-195). 2/65 What is 59 - 25 - 9300/275? 2/11 Evaluate (-34 + 552/18)/((170/345)/17). -115 (-8)/10 - (190/1235 - (-7152)/(-1365)) 30/7 What is the value of ((-2)/19)/((-2680)/114570)? 9/2 What is the value of (2/36)/((-3915)/(-2700) + (-4)/(-30))? 2/57 64/208 + (1780/(-20995) - 104/884) 2/19 Calculate ((-17)/(-13))/((-1975)/(-25675)). 17 What is ((-76)/513)/((-114)/171)? 2/9 What is the value of (34/((-20672)/(-19)))/((-42)/24)? -1/56 What is 2378/3567(-1 - (-254)/(-4))? -43 Evaluate (-18)/(-189) + 1/9(28 + (-53874)/2142). 7/17 Calculate -3(-24)/16(-79)/1896. -3/16 ((-6930)/1323)/(86/(-903)) 55 (600/(-660))/(19/(-1045)) 50 What is the value of (0 - 12/10)409/((-5108001)/(-1810))? -4/23 What is (-3981)/57 - -114(-150)/108300? -70 What is (-615)/5 - (-4516611)/36686? 3/26 What is (-4248)/(-64782) - 1125/(-2379)? 7/13 Evaluate (81 - 62767/621) + 20 + 0. -2/27 Evaluate (-288)/(-648)(-6 - 1/(-118)711). 2/177 What is the value of ((-11289)/(-1278) + 42/(-12))/((-4)/42)? -56 Evaluate (-811356)/(-11145) + 142/(-2). 9/5 What is the value of 480/23 - (1840 - 1819)? -3/23 (-12 - 5) + 3 - (-59064)/3531 30/11 Calculate (2/(-8))/(-7(-75)/(-50400)). 24 What is (-4)/1((-343)/(-28) + -14)1? 7 23/((-3381)/6) - 2070523/20923 -99 Calculate 60/4 + -223166/3120. 3/20 ((-1292)/(-28))/((-38522)/(-4532)) 38/7 What is (-218 - -263 - (-914)/(-18)) + 6 + -1? -7/9 (-7)/(357/108) + (-14819 - -14821) -2/17 What is 322/(-690)(-30393)/385 + -37? -4/25 What is the value of (-3444)/2660 + ((-980)/(-50))/14 - (-1296)/(-38)? -34 What is the value of (2464/84)/(-44) - ((-175)/(-3) - 6)? -53 What is (-348)/(-84) + 2/(-4) + (-234)/1638? 7/2 What is the value of ((-1308)/77826)/(8/(-510))? 15/14 What is the value of (860/(-220))/(15/9) - 621/(-345)? -6/11 Calculate (-1115)/(-2520) - (792/84 + -46 + 37). 1/72 Evaluate ((-8)/(-140) - (-2108)/1085)/(4/10). 5 What is the value of 4/(-12) - (-29)/(-12) - ((-406420)/2800 - -153)? -53/5 What is the value of ((-20)/(-14))/(43605/(-1190) - -42)? 4/15 Evaluate 22 + 2806/(-92) - (-22)/(-4). -14 42 - -1 - (6/36)/(43/14964) -49 Calculate ((-24 - (-194)/8)/(15/48))/((-18)/2745). -122 What is the value of (-116)/(-2494) + (18586/(-215) - ((-2147)/(-95) + -22))? -87 What is (-1 + (-776)/(-78) - (5749 + -5740))(-21)/2? 7/13 What is the value of 39/((-1599)/2255) + 17? -38 What is ((-2178)/(-165))/(84/(-420))? -66 What is (123 - 24) + 54900/(-540)? -8/3 Calculate (33450/(-1550) + 21)-124. 72 ((-28000)/96)/(-5)(-2 - 3 - -11)/(-5) -70 What is the value of ((1/((-12)/9))/(39/(-1924)))/(-30 + 29)? -37 What is the value of 1220/195266/55 + (0 - (-410)/8)? 52 Calculate 536/(-12060)972/(-8) - -13. 92/5 Calculate (235 + -248 + (-234)/(-16))22/(-3). -13/6 Calculate 4/44 - (-4 - 240/264). 5 Calculate ((-1848)/(-336))/(9/(-18)). -11 12448/384 + -28 + (-7)/6 13/4 Evaluate (-75)/(1200/(-176)) + 5915/(-415). -2/83 Evaluate (72/42 + -2)/((-31)/(-5208)). -48 Calculate 2/18 - ((-4594)/126 + 35200/1100). 32/7 Calculate (192/5)/(6/180 + 306/540). 64 What is (2 + 73/(-35))(-2535)/16731? 1/77 What is 276/8 + (-187)/66 + (-10)/(-30)? 32 What is the value of (34 - -1) + (((-4598)/11)/22 - -10)? 26 What is -41 - (29 + (-29097)/427)? -13/7 (9(-224)/(-420))/(6/(-20)) -16 What is (-2519376)/(-100740) - ((-84)/(-4) + 4)? 1/115 What is the value of (-56532)/673 + (-3 - -125)? 38 (-16665)/808 + 74 + 10/16 54 What is the value of (-7)/(28/240)(137 - 136)? -60 Calculate ((-76)/(-6768) - 17/(-153)) + -14/16. -6/47 What is (240/(-50))/12 - (-20)/((-600)/(-15))? 1/10 What is the value of -10 - (-2 + 8 - (7 - (27/18 - 4)))? -13/2 30(-23 + 12 + (-232)/(-24)) -40 What is the value of 66/(-11) + (1 - -44) + (75 - 83)? 31 Calculate (-36)/2421/((-12432)/32). 3/37 What is (-2)/(-5)267/(-2) + (-65)/(117650/(-724))? -53 What is (-11)/1(-1596 - -1592)? 44 Evaluate -28/56896/2176. -2/17 What is the value of 40/(-405)(-105)/140 + (-18942)/(-162)? 117 Evaluate (-50552)/8378 + ((-16)/(-20))/(4/30). -2/59 Evaluate (-28)/(-12)((-268)/126 - 1000/2250). -6 Calculate (-5)/(-70) + (-120006)/(-3164). 38 0/(-36 - 49 - -81) 0 ((-30)/(-20580)-28)/(-1 - 24/(-14)) -2/35 Evaluate (-3)/((-15)/2 + -9) - ((-12950)/165)/(-10). -23/3 231516/16992 + 5/((-200)/(-55)) 15 What is the value of -1 + ((-17)/14)/((-16)/(-32))? -24/7 Calculate (104 + -122)(1 + (-5)/4)32/960. 3/20 What is 27 + (71 - 38) + -26? 34 Evaluate (49/(-343))/((-156)/(-6852)) + (24/39)/(-4). -45/7 Evaluate -25 + (143/13)/(24/192). 63 What is ((-60)/(-22) - 3)((-11)/(-231))/((-46)/(-966))? -3/11 What is the value of (-2023)/(-119)(-2)/(-289)? 2/17 What is the value of (1(-2)/(-10))/(24104/5423400)? 45 (484/352)/(4/(-14) + (-2613)/(-7504)) 22 Evaluate (6 + (-1140)/475)/(1/(-5)). -18 What is the value of (-1812)/(-13892) + 1191/(-138)? -17/2 What is the value of (-7125)/28504/(-200)? 1/20 Evaluate 10320/1030 - 4490/449. 2/103 What is the value of 17475/(-233)(-136)/(-102)? -100 (-6)/(-44)(-16 + (-1150)/(-69)) + 0 1/11 What is the value of (67/44622-36)/(2/4)? -4/37 Calculate -32 - (-4 - -1 - 20/(-10) - (10 + -2)). -23 What is (-5)/(500/(-8))((-2)/6 + 0)? -2/75 What is the value of (-2642)/1854 + (-1755)/(-1215)? 2/103 (-9)/27 + 214/10272 -5/16 (-2039)/741 + (2 - -1) + (-2061)/8931 1/57 Calculate 26 - (1554496/(-963))/(-64). 7/9 What is (18/(-44))/(42930/495 - 51 - 36)? 3/2 Calculate 1047/30 - (72/(-480))/((-30)/(-20)). 35 Evaluate (-2784)/870 + (-132)/(-10) + 18. 28 3/((-72)/1113) + (-494)/(-208) + -2 -46 What is -59 - (255/1020)/(1/(-116))? -30 Evaluate 335/30(-44)/14. -11 (-63)/8408 - (-159)/90 7/6 2(-3912)/88 + 9 + (-2442)/242 -90 ((-71)/(-5) + -1)/((260829/5475)/397) 110 Evaluate 4/(-14) - ((-4320)/(-70) - 43). -19 (4/(-890))/(6/2884752/495) -2/89 What is the value of ((-15)/(13 + 167)2)/(2 + (-2060)/1032)? -43 Evaluate 2/((-20)/(-18))66(-455)/1001. -54 (1974/208 + 51148/(-5384))4 -1/26 Calculate 30/11440-63 - (12 - (-632)/(-52)). -1/88 Evaluate ((-2)/(-4) + (-2472)/4368)/(1956/(-56) + 35). -12/13 -70(-9352)/57281(-14)/8 -20 What is the value of (1775/175 + -10)/((135/35)/3)? 1/9 Calculate (12/35)/((-83)/(6391/(-22))). 6/5 (((-24)/(-50))/((-6)/15))/(343712/18680) -3/46 Evaluate (8/(-5))/(-49 - (-31902)/650). -20 Evaluate (13 - 14)/((7/((-280)/(-16)))/(8/10)). -2 Calculate 21(-24)/42 - -7. -5 What is (-4)/480 - (-422)/3165? 1/8 What is the value of -2(-7 + -421690/(-12400))? 1/155 What is the value of (-2268)/210450/(-108)? 45 Evaluate (-30)/(32/115254). -20 What is (-10759)/(-4611)10/((-490)/(-399))? 19 Evaluate (15/4012 - 2)/((-226)/3164). -35 What is (23/(-92))/(35/(1330/152))? -1/16 What is 58947/(-567) + 45 + (-36480)/810? -104 What is (297/36)/((-3)/(-12)) - (1 + 44/11)? 28 What is (-12)/10(-18 + 123/6)(-124)/(-12)? -31 Calculate 15 - 31 - (-30 + 5120/368). 2/23 What is the value of 102/12(-32818)/4573? -61 What is -4 + -1(3412/4488 + 67/(-11))? 2 (-9)/(125172/38)12/(-4) 1/122 What is the value of (34 + -36)/(1/((-2)/(-14)) - (-26631)/(-3497))? 13/4 Evaluate (48/132)/((-30)/(-1815)). 22 What is 10132/(-149) + (-3600)/50? -140 What is (-640)/20(6/15)/((-14)/35)? 32 What is the value of 5010/1503(-4 + (-6)/(-8)(-1712)/(-312))? 5/13 What is the value of 32 + -47 + (22 + 11)1? 18 ((-3668)/(-465) - 8) + (178/(-15) - (-250 + 238)) 2/93 What is (-6)/(-4)464/(-3944)? -3/17 What is the value of 39 + (2125/(-17) - -55)? -31 Evaluate -9 - (-1036 - -1063)/((3/2)/((-1)/(-2))). -18 What is the value of (-228866)/1496 - 10/680? -153 Evaluate ((-1540)/(-60))/77*-411. -137 What is 9/(16 - (-23)/((-3381)/	{ "pile_set_name": "DM Mathematics" }
93 less than or equal to 4358442/19? False Which is smaller: 13585/47 or -79? -79 Do 13058406 and 13058407 have different values? True Which is smaller: -5506863 or -5506799? -5506863 Do -4/789 and -2323 have different values? True Which is bigger: 11/186 or -29805? 11/186 Which is bigger: 16445210 or 16445214? 16445214 Is 4429 >= -1/2247? True Is -443610 > 56? False Is -3855540 smaller than -3855512? True Is 85/203951 at most as big as 0? False Is -1056/1656139 > 1? False Do 30/4655209 and 1 have the same value? False Which is smaller: 1471597 or 1471601? 1471597 Do -68 and -32970 have the same value? False Is 77 at most 19843/253? True Which is greater: 2373719 or 2373751? 2373751 Which is smaller: 131 or -264/193? -264/193 Do -635687764/13 and -48899059 have the same value? False Which is bigger: 66402 or 66545? 66545 Is -105367256 at least 2? False Which is greater: 4497899 or 4497903? 4497903 Is -190.94 less than 33582? True Which is greater: -805479 or 1/2? 1/2 Which is smaller: 234804332 or 234804328? 234804328 Do -260770703 and -260770703 have the same value? True Which is smaller: 27556989 or 27556990? 27556989 Is 0 at most as big as -6/449160281? False Which is smaller: -208064 or -9/4? -208064 Are 3236 and 52555 non-equal? True Do 69261832.1 and 2 have different values? True Which is smaller: 35298022 or 458874294/13? 35298022 Does -85919 = -5.8? False Which is bigger: -177523195 or -177523194? -177523194 Is 0.062754 greater than or equal to 12? False Is 3142611 < 3142573? False Which is greater: -522793 or -522822? -522793 Is 17014891 at least as big as 17014887? True Is -10314264 at least as big as -10314266? True Which is smaller: 3 or -16586710/11? -16586710/11 Is 100837489 bigger than 100837490? False Are -0.2 and -9563424 nonequal? True Which is bigger: 5/161000174 or 0? 5/161000174 Which is bigger: -1695 or -4153? -1695 Which is smaller: -157650/7 or 1.2? -157650/7 Is -17126455/74 not equal to -231438? True Is -1/3 > -182/128493? False Which is greater: 442 or 9.373? 442 Which is greater: -1 or -729/595400? -729/595400 Does -1 = -1/1994386173? False Which is smaller: 780156181/5 or 156031236? 156031236 Is -1 less than or equal to -1591/3718? True Is -2589317 less than -7/4? True Is 35695 bigger than 35052? True Which is bigger: 3/51396850 or 1? 1 Which is smaller: -682377 or -681702? -682377 Is 13658/3221 > 5? False Which is greater: -3141928 or -3141936? -3141928 Is 49 smaller than -3253334? False Which is greater: -553 or -3069? -553 Which is greater: 120199 or -43? 120199 Which is greater: 12506298/5 or 2501261? 2501261 Is 129889 less than or equal to -0.7352? False Which is greater: 15061165/3 or 5020388? 15061165/3 Which is smaller: 11637 or -103? -103 Which is smaller: 253441 or 253954? 253441 Is 110/14243 less than 28? True Which is greater: 37 or -2/1818287? 37 Which is greater: -3/1209829 or 0.2? 0.2 Is -21492 at least as big as -14792? False Is -430790 less than -111? True Is -9180432 less than -27541292/3? True Is -54779736 equal to -54779733? False Is 12764734 <= 12764734? True Are 92/5880067 and -1 non-equal? True Which is smaller: 130090 or 19? 19 Is 59845716 not equal to 59845719? True Which is smaller: 8021722/15 or 534780? 534780 Which is greater: 43540951/2 or 21770475? 43540951/2 Which is smaller: 69611/1677 or 41? 41 Is -2535 at most -42? True Which is greater: -2.3196 or 45/41? 45/41 Do 265039538 and -2/3 have the same value? False Which is greater: 10501217 or 10501218? 10501218 Does 34209 = 444715/13? False Is 46 less than or equal to 13367/282? True Is 188/6229821 < -1? False Are 22138888 and 22138888 unequal? False Is -309607 greater than -310680? True Which is greater: -597755/2 or -298878? -597755/2 Which is greater: -15257 or -14306? -14306 Which is greater: -3195108 or -3? -3 Which is bigger: -1/155646 or -52/11? -1/155646 Is -2287537 less than or equal to -0.01? True Which is greater: 45/292273 or -7? 45/292273 Which is greater: 0 or -1048/20523? 0 Which is bigger: -14/11886387 or -1? -14/11886387 Which is greater: -1 or 30413854? 30413854 Is 1 < -587/91382? False Is 17354.38 < -0.1? False Is -3/136524317 at least as big as 1? False Is -5 at most -4/117551? True Is 3314 greater than -199/16? True Which is bigger: 7271846 or 0? 7271846 Which is smaller: 866/7 or 349? 866/7 Is 0 > -372/87865? True Is 1803359 at least as big as -3/7? True Is 303176 at most 303110? False Which is smaller: 311/336185 or 1? 311/336185 Is -164579 bigger than -164559? False Which is greater: -332939 or -333079? -332939 Which is smaller: 275303989 or 275303987? 275303987 Which is bigger: -822834902 or -822834904? -822834902 Which is smaller: -74526 or 42.75? -74526 Which is smaller: -992278/4285 or -233? -233 Which is bigger: -9925/40118 or 0? 0 Which is bigger: 6021902 or 6021904? 6021904 Is -1807/306764 greater than 0? False Which is smaller: 60076 or 58672? 58672 Do 3 and 97195877 have different values? True Is -1 greater than or equal to -2/46151963? False Which is smaller: 20 or -2464132? -2464132 Is -2781069/28 bigger than -99323? False Which is greater: 18 or -16040187? 18 Is 145.22 at least 15195? False Which is smaller: 5/21382 or 7? 5/21382 Which is bigger: -56018 or -40318? -40318 Is -11/15324 not equal to -0.07? True Is -1 <= 60/1772701? True Are 3 and -152090/7 unequal? True Which is bigger: 529351 or 529386? 529386 Is -526536284 not equal to -526536284? False Which is smaller: 0.1 or 3724572/35? 0.1 Which is bigger: -55088763 or -55088764? -55088763 Is -796/4479329 at least -1? True Do -2406533 and -2406532 have different values? True Is 3090581 < 3090593? True Is 438913/514 > 853? True Is 1/5 equal to 38122727? False Which is smaller: 1 or -8/38112331? -8/38112331 Is 425345308 greater than or equal to 425345308? True Which is greater: -4.244 or -1/965? -1/965 Which is smaller: -4657397 or -4657378? -4657397 Is 1216346 <= 234? False Are -5862851 and -5862851 equal? True Which is smaller: 514852 or 1544554/3? 1544554/3 Which is smaller: 58869 or 58701? 58701 Which is smaller: -63/22644947 or 1? -63/22644947 Are 1728.911 and 3 unequal? True Which is smaller: 14366 or 2221? 2221 Does 34 = 100841? False Which is bigger: 6602714 or 6602706? 6602714 Which is greater: -106154 or -106147? -106147 Which is smaller: 12.359 or 67451? 12.359 Which is greater: -932291 or -932289? -932289 Is -13286951 at least 0.3? False Is -0.5 bigger than 421051? False Which is bigger: -120/2938547 or 0? 0 Which is smaller: 2711270 or 2711245? 2711245 Which is smaller: 29897858/7 or 4271124? 29897858/7 Which is smaller: 1950223 or 1950220? 1950220 Which is smaller: 2908 or 669097/230? 2908 Are -230706/7613 and -30 equal? False Is -66676393 less than or equal to 2/7? True Do -1807/61567 and -1 have the same value? False Which is smaller: 1 or 3261/363748? 3261/363748 Which is bigger: 85868 or 85815? 85868 Which is smaller: -5443 or -321070/59? -5443 Is 31 greater than 154620.53? False Which is greater: -21/841 or 1830? 1830 Is -71434 != -71536? True Is -8823043 at least -8823041? False Is -5265747 less than -5265740? True Which is smaller: 12824 or 679714/53? 12824 Is 1059994 smaller than 1059995? True Is 1929/192712 < -1? False Is -180059 <= -180996? False Which is greater: 1 or 1/39652518? 1 Which is bigger: -4777/7 or -901.5? -4777/7 Is -1 bigger than 1749/8497? False Does 572 = 197651? False Is -38739691 smaller than -38739690? True Which is smaller: -2 or -27216/9467? -27216/9467 Which is bigger: 56/87 or -161? 56/87 Which is smaller: -30098/911 or -34? -34 Is -463703 != -463706? True Which is bigger: -23 or 3426/773? 3426/773 Which is bigger: -5 or 72825/37? 72825/37 Is 1422 greater than 8100? False Is 58717930 <= 58717929? False Is -2266482 != -2266623? True Is 135/64 greater than or equal to 7699? False Is 23323 != 23559? True Which is greater: -6628 or 955/8? 955/8 Which is greater: -3170 or 78377/5? 78377/5 Is 7/14508523 at most 1? True Is 338677 <= 338690? True Which is smaller: -1170216 or -1169680? -1170216 Which is bigger: 183329/3340 or 0.1? 183329/3340 Which is smaller: 0.168 or -68/8135? -68/8135 Is -43/92 greater than or equal to 1430? False Is -11.0186539 bigger than 2/5? False Is 1019370.1 less than or equal to -	{ "pile_set_name": "DM Mathematics" }
ator of 145/6 and f? 6 Let b = -44347/8 - -5543. Calculate the common denominator of b and ((-53)/8)/(4 - 3). 8 What is the common denominator of 85/7292 and 193(135/(-44))/27 - -5? 80212 Let c = 644 - 924. Let s = -274 - c. Calculate the smallest common multiple of s and 154. 462 Let f = 200 + -170. Let d(n) = n*3 + 18n*2 + 21n - 14. What is the lowest common multiple of f and d(-16)? 810 Let d be 29 - (3 - 9 - -3). Let b = -12 + d. Suppose 0 = 5s - a + 1 - b, -17 = -4s - a. What is the smallest common multiple of s and 2? 4 Let k(n) = 3n - 1. Let p(x) = -x + 10. Let t be p(-2). Suppose 16v - tv = 72. What is the lowest common multiple of k(1) and v? 18 Let j(g) = g3 - 15g*2 + 27g - 14. Let q be j(13). What is the common denominator of -9/11 and (0 + 1001/126)/(q/(-3))? 66 Let b = -741 - -798. Calculate the smallest common multiple of b and 90. 1710 Suppose -6v + 2v = -16, o + 2v = 20. Calculate the smallest common multiple of o and 666. 1332 Suppose -5f = -3q - 432, -3f - 58 = -2q - 346. Calculate the common denominator of -3 - (-5 + -3) - (-303)/q and -89/120. 240 What is the common denominator of ((-2021)/470)/(((-1)/5)/((-9)/(-36))) and -27/680? 680 Suppose r - 20 = d, -r + 0d = 4d - 35. Let k = r + 15. What is the least common multiple of 8 and k? 152 Find the common denominator of 70/297 and 4 - (-4 - (-15144)/1701) - (-4)/14. 891 Let b(k) = 18k - 14. Suppose 4o - 9o + 15 = 0. Calculate the lowest common multiple of b(o) and 20. 40 Let j(l) = -12l + 207. Let u be j(17). Calculate the common denominator of 47/82 and (-99)/16 + u + -2. 656 What is the common denominator of 131/42 and 0 + (-87)/406(-11)/(-23)? 966 Suppose -5c + 408c - 56376 = 14149. What is the smallest common multiple of 675 and c? 4725 Find the common denominator of 19/3 and 5/(-75)(1955/(-370) + 4). 222 Let s = -169393/1914 + 177/2. What is the common denominator of s and -89/84? 26796 Let a = -2/1429387 - 104344091/829044460. Calculate the common denominator of a and -41/40. 1160 Find the common denominator of -26/119 and ((-6)/168)/(52/5356). 476 Calculate the smallest common multiple of 27 and 4 + (10/3 - 3)777 + 7. 270 Let u = 239/18 + -178049/13410. Let c be ((-2)/(-100))/(5364/(-3050895)). Let b = u + c. Calculate the common denominator of b and -113/10. 40 Let z = -4118 + 210031/51. Let g = 789233 + -5524644/7. What is the common denominator of z and g? 357 Let p = -11726/7 + 35242/21. Let c be (1 - 2) + 2256/(-100). Let b = 3593/300 + c. Calculate the common denominator of p and b. 84 Suppose 0 = -0a - 5a + 210. What is the least common multiple of (-4)/(-5)(22 - 775/(-50)) and a? 210 Let j = -594887415 - -2311137631133/3885. Let w = 382949/555 - 690. Let p = w - j. Find the common denominator of 65/2 and p. 14 Let w(z) = -44z*2 - 24z + 1. Let u be w(-4). Let n = -553 - u. What is the least common multiple of 66 and n? 594 Suppose -6q + 12 = -3q. Suppose -28c + 14 = -2534. Suppose -66z + cz - 1950 = 0. Calculate the least common multiple of z and q. 156 Let v be 4/(((-4)/(-5))/(3/5)). Suppose vw = 5j - 11, -2j + 7w - 7 = 2w. What is the common denominator of (-1 + (-6)/j)(-522)/(-240) and 85/6? 48 Let o = 57/2300 - 15602221/6900. Let b = 2240 + o. What is the common denominator of b and 20/(-10)(-371)/(-588)? 42 Let v = -193 + 207. What is the common denominator of -17/24 and 2652/(-1344) + 4/v? 48 Let n be 290/22 - (-10)/(-55). Calculate the common denominator of n/(-33) - -4(-3)/(-9) and ((-26)/27)/((-12)/99). 198 Let b(w) = -5w + 20. Let r be b(-8). Let t = r + -39. What is the smallest common multiple of 7 and t? 21 Suppose 216128 = 40f - 36f. Let b be f/6 - (-4)/12-1. Let p = -747444/83 + b. Find the common denominator of -25/2 and p. 166 Let p be (-1 - 3)/(2/(-20)). Find the common denominator of ((-39)/75 + 2)/(32/(-20)) and 86/p15/(-6). 40 Calculate the common denominator of -61/10 and (2 - 19 - -16) + (-12087)/(-12126). 20210 Let r be (18/(-63))/(2/(-56)). Suppose ra = 5945 + 615. Calculate the lowest common multiple of 2 and a. 820 Let w be (5 - 6)-2 + -274 + 2. Let x = -207 - w. What is the least common multiple of x and 27? 189 Let k(f) = -f*3 + 153f*2 - 4923f + 122. What is the smallest common multiple of 21 and k(107)? 105 Suppose -2 - 18 = -t. Suppose 2h + 248 = 3w + 164, -3w - h = -93. Calculate the lowest common multiple of t and w. 60 Let r be (-15)/(-12)4(-14)/(-35). Suppose r = w, -w - 14 = -v + 62. What is the smallest common multiple of v and 117? 234 Suppose -24 - 86 = -2w. Let g = -53 + w. Suppose m = -gm + 15. Calculate the lowest common multiple of 10 and m. 10 Let b = 8647025943/1265622490 - 2/11505659. Let g = 2/1815 + b. Suppose -v - 5d = 27, -4d + 164 = -2v - 3v. What is the common denominator of v and g? 6 Suppose -80d + 91d = 88. Suppose -48 = -2w - w. Calculate the least common multiple of d and w. 16 Let w = 143 - 141. Suppose 3o + 2s - 8 = 0, 5o = -4s + 14 - w. Suppose 6 = -2u - ol + 2, 50 = 5u - 5l. Calculate the least common multiple of 11 and u. 66 Let i = 16496 - 16469. What is the smallest common multiple of i and 486? 486 Let q(p) = p*2 + 38p + 189. Suppose 7r + 199 = -32. Calculate the smallest common multiple of 28 and q(r). 168 Let r(a) = 3a*3 + 2 - 88a*2 + 1 - 4a + 85a2. What is the common denominator of r(2) and -30/29? 29 Let t = -3 - -11. Suppose tc + 112 = 12c. Let a = -20 + c. Calculate the least common multiple of a and 22. 88 Calculate the least common multiple of 7221 and (3 - 1)/(24/360 + 0). 72210 Let t be 3/((-6)/(-13670)) + -3. Let g = t - 190. Let o = g + -146169/22. Find the common denominator of o and 97/20. 220 Let y = 30198/5 + -1781651/295. Let u = 1813/8 - 447/2. Calculate the common denominator of y and u. 2360 Let w = 580073531/3312 - 175143. What is the common denominator of -1/1472 and w? 13248 Let l(t) = 13t - 455. What is the lowest common multiple of l(36) and 165? 2145 Suppose 3 + 6 = 3w + 2a, -4w = 2a - 12. Suppose -8c = -wc - 130. Suppose 12n + c - 122 = 0. Calculate the least common multiple of 18 and n. 72 Suppose 502 = 3u + 140 - 82. What is the lowest common multiple of 40 and u? 1480 Let d be (-4888)/117 + (-4)/18. Let p = d + 62. Suppose 2v - 40 + p = 0. What is the smallest common multiple of 36 and v? 180 Suppose -5a + 3u = 5055, 2a + 3u + 2038 = u. What is the common denominator of (6/20)/(54/a) and (0 - 269/(-36)) + ((-558)/(-72) - 8)? 90 Calculate the common denominator of 63/4 and ((-127)/(-635))/(213/220). 852 Let p(m) = -3m - 3. Let w be ((-2)/(-3))/(1/(-3)). Let j be p(w). Calculate the lowest common multiple of 12 and 4 + 0 + -1 + j. 12 Let m(z) = 14z - 68. Let g(j) = 2j - 5. Let n be g(6). What is the smallest common multiple of m(n) and 6? 30 Suppose 0 = k - 4f + 14 - 59, -4k + 120 = 4f. Calculate the least common multiple of 669 and k. 7359 Suppose 405 = 3b - 12b. Let c = b + 43. Calculate the common denominator of (-430)/12 - c/6 and 67/14. 14 Suppose 0 = 4z - 5 - 7. Suppose 2f - 67 = zn - 3, n + 108 = 4f. Suppose f = 4c - 58. What is the lowest common multiple of 6 and c? 42 Suppose 0 = 23z - 34z + 242. Suppose 0 = 2u - 37 - 7. Calculate the least common multiple of u and (27 - 5)/(-11) + (z - 0). 220 Suppose 0 = 4v - 59 + 71. Let w(p) = 12p2 + 7p + 15. What is the lowest common multiple of 48 and w(v)? 816 Let y(i) = 3i2 - 2i*2 + 35i + 8 + 23i - 32i. What is the smallest common multiple of y(-29) and 50? 950 Let n(o) = -83o3 + 3o + 2. Let y = -672 - -675. What is the lowest common multiple of n(-1) and y? 246 Let o(s) = s + 8. Suppose -3g + 2r - 10 = -4g, 6 = g + 3r. Suppose 4t + 0 - 1 = -5a, 2a + g = 3t. What is the smallest common multiple of t and o(6)? 28 Let d = -265153/820 - -1617/5. Let l = d + 2357/492. What is the common denominator of l and 49/153? 306 Let y = -27586 - -27866. Calculate the lowest common multiple of y and 1645. 13160 Let l = 21 + -11. Let x = 813 - 413. What is the least common multiple of (24/(-20))/((-30)/x) and l? 80 What is the smallest common multiple of 9 + 0 - (-4 + (-90)/18) and 282? 846 Suppose 3s = 2d + 38, -3s - 2s = d + 19. Let m = d + 28. Let p(t) = -17*t + 9. Calculat	{ "pile_set_name": "DM Mathematics" }
4r3 + 5784r*2 - 68876r + 63096 = 0. Calculate r. 1, 11, 1434 Factor -5s5 + 45s*4 - 130s*3 + 100s*2 + 120s - 160. -5(s - 4)(s - 2)*3(s + 1) Suppose -8d4/3 + 54348d*3 - 733576d*2/3 + 271684d - 81504 = 0. Calculate d. 1/2, 1, 3, 20376 Let -516j2 + 244j + 272 = 0. What is j? -68/129, 1 Find g such that -4g2 + 4116g - 68816 = 0. 17, 1012 Factor -3i4 + 984i*3 - 981i*2. -3i*2(i - 327)(i - 1) Factor 87n*2/2 + 315n/4 - 33/2. 3(n + 2)(58n - 11)/4 Factor t2 - 2937t - 77038. (t - 2963)(t + 26) Let r2 + 207r - 5800 = 0. Calculate r. -232, 25 Suppose 3x2 - 6385626x + 3398018284323 = 0. Calculate x. 1064271 Suppose 4u5 + 7692u*4 + 91724u*3 - 7692u*2 - 91728u = 0. Calculate u. -1911, -12, -1, 0, 1 Determine d so that d*2/7 + 124770d/7 + 3891888225/7 = 0. -62385 Determine k, given that -2k5/23 + 4k*4/23 + 26k*3/23 - 28k*2/23 - 48k/23 = 0. -3, -1, 0, 2, 4 Solve -v*2 - 674v - 2680 = 0. -670, -4 Solve 10y5 + 1284y*4 - 6358y*3 - 32168y*2 - 33048y - 8512 = 0 for y. -133, -2, -1, -2/5, 8 What is j in -4j4/5 - 808j*3/5 + 14416j*2 + 3190560j = 0? -170, 0, 138 What is p in -4p2 - 84724p + 169464 = 0? -21183, 2 Let -4q5 - 1434q*4 + 2176q*3 + 5766q*2 + 2160q = 0. What is q? -360, -1, -1/2, 0, 3 Factor 12x2/7 - 1846x/7 + 52664/7. 2(x - 116)(6x - 227)/7 Let 4f*5/7 - 26f*4/7 - 656f*3/7 + 4894f*2/7 + 2920f/7 - 2600/7 = 0. What is f? -13, -1, 1/2, 10 Factor 2u2/7 - 369176u/7 + 17036364872/7. 2(u - 92294)2/7 Determine x, given that -5x*5 - 1925x*4 + 2185x*3 + 98005x*2 - 165800x - 675500 = 0. -386, -7, -2, 5 Factor -49j2/4 + 15813j - 5103081. -(7j - 4518)2/4 Let v4 + 204v*3 + 590v*2 - 2628v - 3015 = 0. Calculate v. -201, -5, -1, 3 Factor -3v2/5 + 20127v/5 - 60354/5. -3(v - 6706)(v - 3)/5 Suppose 10z4/3 + 257z*3/2 - 175z*2/3 + 13z/2 = 0. What is z? -39, 0, 1/5, 1/4 Factor -o*2/4 + 1215o/2 - 7281/4. -(o - 2427)(o - 3)/4 Factor -u2/6 - 117076u/3 + 78051/2. -(u - 1)(u + 234153)/6 Suppose 5v*3 + 1085v*2 + 8360v = 0. What is v? -209, -8, 0 What is x in -2x3 + 900746x*2 - 1801486x + 900742 = 0? 1, 450371 Factor -4t3 + 1208t*2 + 2444t - 3648. -4(t - 304)(t - 1)(t + 3) What is t in 3t*5 + 135t*4 + 135t*3 - 10935t*2 - 30618t = 0? -42, -9, -3, 0, 9 Determine r so that 2r2/9 + 644r/9 - 3136/3 = 0. -336, 14 Factor w5 - w4 - 14w3 + 24w2. w2(w - 3)(w - 2)(w + 4) Determine f, given that 2f*3/5 + 96f*2 + 5874f/5 - 6356/5 = 0. -227, -14, 1 Factor 2z3/3 - 60z*2 - 2z/3 + 60. 2(z - 90)(z - 1)(z + 1)/3 Suppose 3s*3/2 + 12312s*2 + 25214904s - 202507968 = 0. What is s? -4108, 8 Suppose 2c2/13 - 207338c/13 = 0. What is c? 0, 103669 Factor -232q2 - 18092q + 312. -4(q + 78)(58q - 1) Factor 3k*5 - 144519k*4. 3k*4(k - 48173) Solve 12x3 - 46011x*2 + 57498x - 11499 = 0 for x. 1/4, 1, 3833 Factor -5t3 - 325t*2 + 44885t - 44555. -5(t - 67)(t - 1)(t + 133) Let o5/3 + 5455o*4/3 + 1818o3 = 0. Calculate o. -5454, -1, 0 Solve -y5/6 + 2y4 + 38y*3/3 - 67y*2 - 345y/2 + 225 = 0. -6, -3, 1, 5, 15 Factor -c*3/3 - 2157c2. -c2(c + 6471)/3 Find d such that -5836d*3/5 - 52518d*2/5 + 58414d/5 - 12 = 0. -10, 3/2918, 1 Find b such that -b*2/3 + 2663b/3 + 16986 = 0. -19, 2682 Suppose q*2 + 304876q + 23237343844 = 0. What is q? -152438 Solve -7s4/4 + 8689s*3/2 - 6823s*2 + 1239s/2 + 7443/4 = 0 for s. -3/7, 1, 2481 Let -3w5/4 - 69w*4 + 72w*3 + 417w*2/2 - 285w/4 - 279/2 = 0. Calculate w. -93, -1, 1, 2 Let -n*3/7 - 1697n*2/7 - 712255n/7 + 6548481/7 = 0. What is n? -853, 9 Let 2t4 + 130t*3 + 78t*2 - 3250t - 3200 = 0. What is t? -64, -5, -1, 5 Factor -2m4 - 54212m*3/5 - 10842m*2/5. -2m*2(m + 5421)(5m + 1)/5 Factor 2l2/11 + 19154l/11 - 19156/11. 2(l - 1)(l + 9578)/11 Solve 2q3/13 - 456q*2/13 + 21118q/13 - 20664/13 = 0. 1, 63, 164 Let 2m3/5 + 268m*2/5 + 1046m/5 + 156 = 0. Calculate m. -130, -3, -1 Factor -3r2/4 - 141639r/2 - 6687202107/4. -3(r + 47213)2/4 Determine o, given that 4o*5 + 21512o*4 + 28922884o*3 = 0. -2689, 0 Factor 3r*3 + 525660r*2 - 2102676r + 2102688. 3(r - 2)2(r + 175224) Factor 2k4 - 202k*3 + 2634k*2 - 4670k + 2236. 2(k - 86)(k - 13)(k - 1)2 Factor -m4 - 260m*3 - 21412m*2 - 539328m. -m(m + 48)(m + 106)*2 Factor -4r*3 - 18408r*2 - 183776r - 440832. -4(r + 4)(r + 6)(r + 4592) Factor -y2/2 - 53y/2 + 2277. -(y - 46)(y + 99)/2 What is a in 2a*4 + 923a*3/2 + 799a*2 - 1151a/2 - 687 = 0? -229, -2, -3/4, 1 Determine u, given that 5u2 - 715525u + 1431030 = 0. 2, 143103 Solve 9o4/4 + 393o*3 + 325o*2 - 1800584o - 7182960 = 0. -346/3, -4, 60 Let 3h2/4 - 1803h/2 + 108903/4 = 0. What is h? 31, 1171 Factor 5z3 - 122835z*2 + 736875z - 1105245. 5(z - 24561)(z - 3)*2 Factor 4y*2 + 10056y + 20096. 4(y + 2)(y + 2512) Factor -4z4 + 8544z*3 - 4484628z*2 - 83514888z. -4z(z - 1077)*2(z + 18) Solve 12c2/25 + 60758c/25 + 10126/25 = 0 for c. -5063, -1/6 Factor i*4/4 - 363i*3/4 + 11676i*2 - 605248i + 9483264. (i - 112)*3(i - 27)/4 Let 2d3/9 + 506d*2/9 + 1004d/9 = 0. What is d? -251, -2, 0 Find g such that -2g3/3 - 30g*2 + 702g + 33462 = 0. -39, 33 Factor -5p4 + 12805p*3 - 8191995p*2 - 8204805p. -5p(p - 1281)*2(p + 1) Solve 2p2 - 1726p + 32072 = 0. 19, 844 Factor 603h4 + 12h*3. 3h*3(201h + 4) Factor -z3 - 6915z*2 - 69050z. -z(z + 10)(z + 6905) Determine k so that -2k5 + 1644k*4/5 - 3846k*3/5 - 6884k*2/5 + 12984k/5 - 3888/5 = 0. -2, 2/5, 1, 3, 162 Factor 3n4 - 66n*3 + 495n*2 - 1500n + 1500. 3(n - 10)(n - 5)*2(n - 2) Find u such that 4u5 - 92u*4 - 536u*3 - 688u*2 + 416u + 896 = 0. -2, 1, 28 Let s*3/4 + 151s*2/4 + 2959s/4 + 15609/4 = 0. What is s? -129, -11 Find z such that -277z5/3 - 4733z*4/9 + 9005z*3/9 + 1045z*2 - 3614z/9 - 112/9 = 0. -7, -1, -8/277, 1/3, 2 Factor 4x2 + 15904x + 79420. 4(x + 5)(x + 3971) Determine b, given that -3b3/7 - 1419b*2/7 - 25980b/7 - 46308/7 = 0. -454, -17, -2 Factor 2d3/3 + 866d*2 + 10366d/3 + 2590. 2(d + 1)(d + 3)(d + 1295)/3 Suppose 42d*5 - 3464d*4/5 + 3562d*3/5 + 17836d*2/5 - 9288d/5 + 144 = 0. Calculate d. -2, 2/21, 2/5, 3, 15 Find g, given that 18g3 + 9597g*2 + 30219g + 4770 = 0. -530, -3, -1/6 What is l in 3l3 + 51l*2 - 7014l + 6960 = 0? -58, 1, 40 Determine v, given that 5v4 - 22780v*3 + 1085760v*2 - 17331200v + 92323840 = 0. 16, 4508 Determine k, given that -4k3 - 240k*2 - 3428k - 3192 = 0. -38, -21, -1 Find v, given that 2v2/3 + 228v + 18154/3 = 0. -313, -29 Factor 5t4 - 505t*3 - 14115t*2 + 1824505t - 1809890. 5(t - 79)2(t - 1)(t + 58) Find z such that -4z*5/5 - 1886z*4/5 - 198032z*3/5 + 5718176z*2/5 - 38235648z/5 + 17713152/5 = 0. -248, 1/2, 12 Factor -58m3/3 + 176m*2/3 - 178m/3 + 20. -2(m - 1)2(29m - 30)/3 Factor -2a*2/5 + 416a/5 - 406. -2(a - 203)(a - 5)/5 Factor 3r2 - 35922r + 538155. 3(r - 11959)(r - 15) Determine d, given that -5d5 - 935d*4 - 8930d*3 - 14160d*2 = 0. -177, -8, -2, 0 Determine p, given that 2p*2/3 - 1146752p/3 + 164380018688/3 = 0. 286688 Factor -w*4/4 + 11w*3/2 + 141w*2/4 - 81w/2. -w(w - 27)(w - 1)(w + 6)/4 Factor -p3/6 + 577p*2/6 - 39368p/3 - 219040. -(p - 296)*2(p + 15)/6 Suppose q*4 - 83q*3 + 672q*2 - 428q - 1184 = 0. What is q? -1, 2, 8, 74 Determine w so that 4w5 + 384w*4 - 1588w*3 + 1216w*2 + 1584w - 1600 = 0. -100, -1, 1, 2 Factor -2w2/5 + 201456w/5 - 5073064992/5. -2(w - 50364)2/5 Factor -g2/5 + 802g/5 + 2119. -(g - 815)(g + 13)/5 Factor 1445k*4 - 1176570k*3 + 239639585k*2 - 56336940k + 3312980. 5(k - 407)2(17k - 2)2 What is q in -q4/5 - 169q*3/5 + 3451q*2/5 + 15961q/5 + 12342/5 = 0? -187, -3, -1, 22 Factor -2v2/15 + 17152v/15. -2v(v - 8576)/15 Factor 2c2/5 - 55058c/5 + 935408/5. 2(c - 27512)(c - 17)/5 Factor f*2/6 + 15763f/3 - 52560. (f - 10)(f + 31536)/6 Let -4o*5/7 + 38o*4/7 + 526o*3/7 - 3968o**2/7 +	{ "pile_set_name": "DM Mathematics" }
l*2 - 4l + 5. Let x be z(4). Let s be (52/(-65) + 384/(-45))(-6)/4. Solve y = -xw + 15, -w - 5y = -s + 35 for w. 4 Let g be (-2 + 5)/((-6)/(-8)). Let w(y) = -4y. Let c be w(2). Let i be 7/(28/c)-10. Solve -gp = -2l - 2l - 16, 0 = 5p - i for l. 0 Suppose 9x = 3o + 8x - 40, -5x = -o - 10. Solve -2a - a - o = -3f, -9 = 5a + 3f for a. -3 Suppose 0 = -18c - 21c + 39. Solve 8 = -4j, t - 6j + 4j + c = 0 for t. -5 Let l(r) = -12r + 171. Let m be l(13). Solve -6x = -x - m, -a - 4x + 15 = 0 for a. 3 Suppose 160 = 6y + 484. Let c = y + 73. Solve -23 = -2z + 5f, -4z - 3f - c = -0z for z. -1 Let f = -22 - -30. Suppose -fw - 24 = -7w. Let a = 28 + w. Solve -4c - 16 = 5q, -5q - a - 15 = c for c. 1 Suppose 80d = 84d - 8. Suppose 0 = -0w + 2w + 22. Let i = w + 17. Solve q + 4 = 3l, 5l - dq - i = l for l. 1 Suppose 4x - 2y - 16 = 0, 9 = 2x - 2y + 3. Solve -xa + 40 = -5n, -8n - 2a - 2 = -4n for n. -3 Suppose -56 = -9t - 20. Solve 5i = tb - 40, 0 = 3i + b + 4b - 13 for i. -4 Let y(a) = -30a + 64. Let i be y(2). Solve 30 = -4h - 2j, -5j + j - 40 = ih for h. -5 Let a = 43 - 40. Let u be (-1 + -5)/(a/6 - 2). Solve 4f = -us - 4, -2s + 4s - 5f = 26 for s. 3 Suppose -k = 3k + k. Let j = -310 + 322. Solve -5q + i + j = -i, k = q - 4i + 12 for q. 4 Let h(f) = -5f + 55. Let m be h(10). Solve 8 = -3d - 5y, -md + 0d - 6 = y for d. -1 Let k(p) = p + 8. Suppose -s - 17 = -4t, 5t - 13 - 2 = 0. Let i be k(s). Suppose -4g = -2 - 10. Solve -o - gx = o + 17, 0 = 5o - ix + 11 for o. -4 Suppose 38m + 24 = 44m. Solve 5g - 6 = -mk - 21, 2k + 15 = -5g for k. 0 Suppose -2q = 3b, -3q = q + 5b. Suppose 0 = -4u, -5l - 3u + q = -5. Solve -i - 14 = 3z, 3 - l = -z + i for z. -4 Let h = -5 + 10. Let m be (45/10 - 4)(-14 + 40). Solve -hw - b = -18, 5w + 1 = -4b + m for w. 4 Suppose -20 = -3p + 5x, -8 = -2p + 2x - 4x. Let n be 1/p(-25)/(-5) - 1. Solve n = 3w - 6w - 3, -4y - 9 = -3w for y. -3 Let f = 1300 - 1293. Solve -3d = -6, 2t = -3t + d - f for t. -1 Let q(x) be the second derivative of -x*3/6 - 9x*2/2 - 9x. Let b be q(-11). Suppose bs = -2s. Solve -4t - 8 = 5y, t - y + s = 7 for t. 3 Let u = 59 + -43. Suppose -10 + 250 = us. Solve -3z + s = 4a - 4z, 5a + 5z - 25 = 0 for a. 4 Let q = 217 + -215. Solve 2j = -5k + 7 + 8, qk - 6 = j for j. 0 Suppose -2i + 3q - 2 = 0, -2i + 5q = -3i + 25. Let s be (-8)/(-2)i/4. Solve 0 = 4o - 3b + 5, 0b + 30 = -so - b for o. -5 Suppose 2g = -2g + 8. Suppose -43 = -2k + 5l - 1, gk + 4l = 24. Let c be (288/(-56))/((-6)/28). Solve 4f - 4d = -c, -5f - 5 = 4d + k for f. -5 Suppose -5 = -6h + 1. Let q(n) = n*2 - 1. Let v be q(h). Let y = -8 - -12. Solve -20 = -5r - yc, vr - 2c + 10 = 5r for r. 0 Let k(c) = c*3 - 9c*2 + 15c - 2. Let d be k(7). Solve 3z - 2w + 3 = w, -dw = -10 for z. 1 Let t(w) = -5w - 33. Let d = -21 + 14. Let p be t(d). Solve 0 = -4u - f, 3u - 3 = pu - f for u. -1 Let n(a) = -a2 - 4a + 13. Let x be n(-6). Let l be (x + -1 - 2)2/(-2). Solve y + 5b = 29 - 11, 0 = lb - 6 for y. 3 Suppose -2 = -3o - 4x, 3o = 4o - 3x - 5. Suppose ov - 3v - g = 3, 0 = -2g - 6. Solve -c - 4k - 1 = 0, 6 = -c - vc + k for c. -5 Let h = -148 + 154. Let f be (-5)/(-1) - (0 - -1). Suppose -f + h = g. Solve -gt + 0k = 2k + 4, k + 11 = -4t for t. -3 Suppose -2m + 2 + 2 = 0. Suppose 4a - 8 = -ml + 6a, 3l + a = -4. Suppose l = -4t + 3t. Solve c = -3p - tc + 18, -5c = -15 for p. 5 Let h = -340 - -343. Solve 2s + 3s = -3n + 12, 2n = -hs + 7 for s. 3 Let s(j) = j*3 + 29j*2 - 31j - 2. Let x be s(-30). Solve 2f - 6f - 8 = 4d, f = 5d + x for f. 3 Let y(x) = x + 9. Let h be y(-5). Let k be 7 - (-4 + h) - 2. Suppose 5t - 56 + 11 = -5b, -25 = -kb. Solve 5d = -ta + 13, 2a - 2d = 6 - 4 for a. 2 Let a be (-230/(-5))/2. Solve 5t + 5h - 5 = 0, 5h = at - t - 5 for t. 1 Suppose -4q - 4 = -2b, 2 + 0 = b + 5q. Let t = 5 - b. Suppose 2j - t = j. Solve -10 = -jy - 4v, -2y + 4v - 11 - 9 = 0 for y. -2 Let r = 294 + -282. Solve -2c = -4p - r, -2p + 2c = 3c + 6 for p. -3 Suppose 9s = 17s - 8. Solve -4n = 3c - 3, -3n - 3c + 4c - s = 0 for n. 0 Let s = -1 + 10. Let r(i) = i*2 - 8i - 7. Let f be r(s). Let l be (-8 - -10)/(2/2). Solve 4k = p - 0p - 13, -fp + 6 = lk for p. 5 Suppose 24 + 26 = -10p. Let v be -1(-4 - p - 3). Solve -12 = -4h, -vs - 7 = -3h - 0 for s. 1 Let m = 57 - 22. Let o = m + -34. Solve -f = -r + 8, 2r + o = -5f - 18 for r. 3 Let r be ((-6)/(-9))/((-2)/3). Let u be 0/(6 - (4 + r)). Let z = -5 - -9. Solve u = -4c + 8, 2f - 10 = -zc - c for f. 0 Suppose 0 = 29b - 42b + 91. Solve 0 = g - 5g - 4, -b = -3n - 5g for n. 4 Let k = 127 - 127. Let s = 123 - 119. Solve si = i - 4v - 12, k = v for i. -4 Let w be (104/6)/(-13)(-9)/1. Solve -3v + 3g = 18, w = -v - 0v + 3g for v. -3 Suppose 2t + 19t = 126. Solve -2s + 5o = 16, -5 = 3s + to - 4o for s. -3 Let a be (6/8)/(6/16). Solve -3n - 5k - 2 = n, 0 = -3n - ak - 5 for n. -3 Let h = 12 - 3. Let s(w) = -2w + 5. Let j be s(6). Let p = h + j. Solve 10 = -2g, -5z - pg = 2g + 40 for z. -4 Suppose 0 = -5m + 4v - 4, -2m - 5 = -0v - 5v. Solve -3r + mt - t = -15, 0 = -3t for r. 5 Let p be (-12)/(-15) + (6/5 - -2). Suppose -2f = -o + 6, po - 8 = -f - 2. Solve 4 = -a, oy - 5a - 8 = 2 for y. -5 Suppose 3n - 2r = 4, -10n + 20 = -9n + 4r. Solve o = h - n, 5h - 3 = -4o - 19 for h. 0 Let r be -3 + -1 + (-59)/((-1121)/114). Suppose 3o - 1 - 11 = 0. Let m = 11 + o. Solve f - 4 = rf, x = 5f + m for x. -5 Suppose m - 42 = -13m. Solve 0 = g - b + 8, -g + 4b + m = 20 for g. -5 Suppose 0 = -3y - 2b - 0b - 282, 3y - 4b + 300 = 0. Let k = -93 - y. Solve 2p - 5 = 3z, 0 = 5z + kp + 31 - 10 for z. -3 Suppose 25k - 2f = 29k - 14, -4k + 3f = -19. Solve 2r = -5c, 6r - kr + 4c = 0 for r. 0 Let i = 29 + -32. Let k = 5 + i. Let w be (-4)/(-2)22/4. Solve -g + k = -2x + w, -x - 4g - 18 = 0 for x. 2 Let h(s) = s*2 - 3s. Let z be h(4). Let g be 3/((2/12)/((-4)/(-36))). Solve gi = -3t - 19, 4t + 27 = -zi - 5 for i. -5 Let h(p) = p*2 + 3p - 5. Let a be h(-4). Let d = 4 + a. Let x be (-30)/8-1 + (-12)/16. Solve x = i, -18 = du + 4i - 5i for u. -5 Suppose 4h - 5c - 4 = 0, -3h - 2h = -5c. Let m be 2/(-13) - 264/143. Let z = m - h. Solve -n + 6 = 2q, 3n + 21 + 1 = zq for q. 5 Suppose 4i - k - 2k - 2 = 0, -2i + k + 2 = 0. Solve 4 = -4p - ia, p + 19 = 3a + a for p. -3 Suppose 4p + 4l + 4 = 0, 4l - 3l = -5p + 15. Solve 0 = -0k + 5k + pi + 22, 0 = 2k - 4i - 8 for k. -2 Let u = 2 - -1. Let q be ((-15)/2)/(u/(-4)). Suppose -2s - s = -21. Solve sn - 5z + q = 2n, 3z = 4n + 9 for n. -3 Let n(h) = h + 4. Let z be n(-4). Suppose -8d + 110 = -3d. Let w = -18 + d. Solve -3v - 3 = z, -wq = -2q + 3v - 7 for q. 5 Suppose 2h + 3h = 0. Let y(l) = 12l - 20. Let g be y(2). Suppose -k = gk + t - 165, h = 3t. Solve -3c + 10 = -5z + k, 20 = 5z for c. -1 Let s be (2/6)/((-6)/(-36)). Suppose 0 = 4b - 9 - 7. Suppose 11 = -h + 4d - 3, 0 = -3h + 2d - 2. Solve ba - ha = 4w, 0 = w - s for a. 4 Suppose 0 = -4v - g - 14 + 132, 5v = 3g + 139. Suppose 4u + m - 12 = 0, -2m + 4m = 5u - 2. Solve v = 5r + us, -2r + 4s + 1 = -1 for r. 5 Suppose -10 = -5f + 45. Let u = -11 + f. Suppose u = -a + 5r - 10, 2a + 2r = 4 - 0. Solve -s - 4g + 13 = 0, ag = 5s - g - 23 for s. 5 Suppose -4m + 0m = 2d - 186, 5m - 234 = -2d. Suppose 0 = 2t + 4f - m, 78 = 4t + f + 3. Solve t = 7z - 3z + 2k, 3k = z - 1 for z. 4 Let x = 87 - -76. Let g = 173 - x. Solve -3z - z = -3f - g, -2f - z - 3 = 0 for f. -2 Let n be 10/2 + (6 - 9). Solve 3x + 2 + n = -4l, -l = -x + 8 for l. -4 Let p = 4 + -2. Suppose -17 - 13 = -ph. Let c = 18 - h. Solve -c = 5k + 12, 3f - 5k = 18 for f. 1 Let v be ((-38)/5)/(6/(-15)). Suppose t + 17 = v. Solve 0w = 2w + tq - 14, 5w - 21 = 2q for w. 5 Suppose n + 15 = -0n. Let f be n/104/(-3). Suppose 4q - 7 - 9 = 0. Solve 3a + f = -qb, -6b - 4a = -b + 2 for b. -2 Let i be (2 + 0)15/10. Let x(w) be the first derivative of 3w*3 + w + 2. Let h be x(1). Solve 5p + h = -2u, ip + 4 = -2*u + p for u. 0	{ "pile_set_name": "DM Mathematics" }
7 (b) f (c) -2/7 c Let q = -93 - -73. Let o = q - -22. What is the nearest to o in 5, 3, -0.5? 3 Let w = -403.8 - -404. Let t(x) = x3 + x2 - 4x - 3. Let m be t(-2). Let r(l) = l2 + l. Let n be r(m). Which is the closest to w? (a) 0.4 (b) n (c) 5/2 a Let i(f) = 10f*2 + 2f - 4. Let r be i(3). Suppose -4y + r + 4 = 0. Let x be (2/y-3)/1. Which is the closest to -0.1? (a) 1/3 (b) x (c) -1 b Let t be (-300)/(-90)(-9)/12. Which is the closest to 0.15? (a) t (b) 3 (c) 1 (d) 2 c Let n = 393 - 430. What is the nearest to -1 in -0.5, -0.1, n? -0.5 Let y = 78 + -74. Let d be (-2 - 4) + y + -1 - 1. Let l = -3 - -2.7. Which is the closest to 0.6? (a) l (b) 5/3 (c) d a Let v be (-223)/(-91) + 4/(-28). Let f = v + -236/91. Which is the nearest to 0.1? (a) f (b) 7 (c) 3/2 a Let d = 122/9 + -110/9. What is the closest to -1 in -2/7, 2/5, -3/5, d? -3/5 Let c be (-9 - 2 - -7)/6. What is the closest to -2 in 1/7, -2/7, c, 0.3? c Let c = -2141/28 + 307/4. Let r = -0.1 + 0.1. What is the closest to -0.1 in -4, c, r? r Let f(h) = 87h3 + h2. Let b be f(1). Let l = b + -442/5. Let o = -13 + 13.2. What is the closest to 2/5 in 2, o, l? o Let z = 1/41 + 367/82. Let g = z + -41/10. What is the closest to g in 4, -1/12, -0.1? -1/12 Let x be ((-3)/(-9)-9)/(45/(-6)). What is the closest to -3 in -1/18, x, 2/15? -1/18 Let i = 0.164 - -0.036. Which is the closest to 1/4? (a) 2/7 (b) 1 (c) -0.1 (d) i a Let j = -44.2 - -44.2. Which is the nearest to 1/18? (a) j (b) 0.2 (c) 5/3 a Let q = -0.1033 - 1.8967. Let h = -0.1 + 0.3. Which is the closest to -6? (a) h (b) -3 (c) q b Let r = 9602/7 - 1400. Let m = r - -28. Let a be 2/(-2)3/6. What is the closest to 0 in 2/13, a, m? 2/13 Suppose 0 = 5m - 3r - 30, -r + 24 = -2m + 6m. Let l be (m + -6)/(2 + 1). What is the nearest to 0 in l, -3, 0.02? l Let q = -31 - -31. Let f = 15 + -16. Which is the closest to q? (a) -2 (b) 2/63 (c) f b Let q = 1.97 - -0.03. Let o = 268 - 268.3. What is the nearest to 2/3 in q, o, -0.5? o Let k = -0.08 + 0.58. Let x(h) = -3h + 14. Let l be x(5). Which is the nearest to l? (a) k (b) -0.2 (c) 4 b Let p = -6 - -2. Let f be (-45)/20 - 6/8. Let s be f/5 + (-18)/(-45) - -1. What is the nearest to -1/2 in 4, p, s? s Let u be 30/(-315)62/8. Which is the nearest to -2/9? (a) u (b) 0.4 (c) -0.3 c Let r = 36.1 - 37. Let s = r + -1.1. Let b = 8 + -8.5. What is the closest to -2 in b, s, 4? s Let r(y) = -2y*3 + y. Let o be r(-1). Let c be 3/3o-1. What is the nearest to -1 in -0.5, -2/15, c? c Let o(q) = q - 4q - 23 + 0q. Let n be o(-8). Which is the closest to 0? (a) 0 (b) 3/7 (c) n a Let w = -0.976 - -0.956. What is the nearest to -1 in -13, 4, w? w Let t = 6 - 5. What is the nearest to t in -4/3, -3, -1? -1 Suppose 0 = -4q - 0q + 8. Let m = 1623 - 1622. What is the nearest to m in 1, q, -5? 1 Let y = -91 + 90.3. What is the closest to 0 in -1, 6, y, -0.2? -0.2 Let w = -0.4 + 0.8. Let o = 3 + -2.4. Let c = w - o. What is the closest to -1 in -0.3, -4, c? -0.3 Let p = -928/3 - -308. Let k be ((-5)/(-45))/(3/(-9)). Let f = -2/405 - 796/2835. What is the closest to f in p, k, 5? k Let g = -49 + 48. Let s = 9 + -3. Let j = -11 + s. Which is the nearest to -2/7? (a) 0.4 (b) j (c) g a Let v = 7.8 - -34.4. Let h = 42 - v. Which is the closest to h? (a) 0.2 (b) 0.4 (c) 2/15 c Let q = 0.05243 - -2.98057. Let o = q + -0.033. Let c = 0.1 - 4.1. What is the nearest to -1 in c, o, -0.1? -0.1 Let l = 0.5 + -2. Let z = -1.5 + l. Which is the nearest to 1? (a) z (b) 0.7 (c) -1 b Let l be (20/10)/((-1)/2). Let o = l + 5. Let r = -6.5 + 6. Which is the closest to o? (a) -1 (b) r (c) 2 c Let g(k) = -k + 11. Let w be (-54)/(-12) + (-1)/(-2). Let u be g(w). Let p = 8 - u. Which is the closest to 1? (a) p (b) 1/7 (c) 1/2 c Let z = -18.6 + 20. Let h = z - 1.2. What is the closest to -2/3 in -3, h, 4? h Let m be -3 + 7/2 - (-10 - -3 - -7). Let w = -8 - -13. What is the nearest to -6 in w, 4, m? m Let d be -3 + 76/4 + 1. Suppose 0 = y + d - 15. What is the closest to -0.1 in y, 0.5, -0.1? -0.1 Suppose -9b - 5 = -10b. Suppose -3w = -3j - j + 17, -2j + bw = -19. What is the nearest to j in 0.2, 0.4, -1/5? 0.4 Let b = -0.9 - -1. Let c be (-48)/6424/(-162). What is the closest to 1 in b, -3, c? c Let y be (-2)/(-7) - 16/(-42). Let m be 1774/820 + 1/(2/(-6)). Let n = 3/82 + m. What is the nearest to 0 in -4, n, y? y Let c be 14/(-3) - 6/(-9). Let p be (-3930)/450 + 14/10 + 7. What is the nearest to -2 in 0.04, c, p? p Let r be 26/(-12) + (-2 - 35/(-10)). What is the nearest to -1 in r, -2/9, 13? r Let d = -0.3 + -0.2. Let h be (-6)/46/54-6. Let i be (-5 - -5)(1/2)/h. Which is the nearest to i? (a) d (b) 2 (c) 3 a Let r be (1 + -1)/(9 + -12). Let y = 4 - 0. What is the closest to 0.1 in r, 3, y? r Let y = -120.914 - -121. Let u = 8.086 - y. What is the closest to 1 in u, -1/3, -0.2? -0.2 Let r = -0.1 - -0.1. Let i = -36 - -26. Let n = 10.5 + i. Which is the nearest to r? (a) 4 (b) 0.3 (c) n b Let q be (-5740)/(-8050) - (-4)/46. Let s = 0.08 - 0.08. What is the nearest to s in -0.5, q, -0.2? -0.2 Let s = -37.2 - 3.8. Let y = -41.6 - s. Which is the closest to -0.2? (a) y (b) 0 (c) -2 b Let g = 3/47 + 67/423. What is the closest to -0.2 in -1, 0.3, g? g Let n = 1.75 - 111.75. Let x = n - -109.8. Suppose -3g - 38 = 4z, 0g = 5z - 2g + 36. Which is the nearest to x? (a) 0 (b) z (c) 1/2 a Let f be -2 + (48/14)/2. Let g = -793.5 + 794. What is the nearest to 1/4 in -11, g, f? g Let t = 479 - 500.3. Let l = 21 + t. Which is the closest to 0.5? (a) -0.2 (b) 1 (c) l b Let q = -2.73 + -0.27. Let s = -0.069 - -2.069. What is the nearest to q in -0.06, s, -0.2? -0.2 Let r be ((-8)/40)/((-26)/5). Let d = 6/13 + r. Let v be ((-5)/2)/(8/(-16)). Which is the closest to -1? (a) d (b) -0.4 (c) v b Let f = 0.08 - -0.22. Let i = 62.1 + -62. What is the nearest to f in 2, -5, i? i Let c = 9/11 - 67/55. What is the closest to 2/3 in 2, -17, c? c Let z = -41/24 + 11/8. Which is the nearest to 3? (a) 5 (b) z (c) 1/3 (d) -2 a Let p = -6136/11 + 558. Which is the nearest to -30? (a) p (b) 0.3 (c) -3 (d) -0.5 c Suppose -b + 2b = 6. Let j(h) = h - 3. Let s be j(b). Let g be ((-2)/6)/((-10)/6). What is the closest to 0.1 in g, s, 5? g Let g = 338 - 341. Which is the nearest to -0.2? (a) -0.33 (b) g (c) -0.4 (d) -2/9 d Let l be (-123)/(-9) - (-1)/3. Suppose -3n - 45 = -3g, -3g + 31 + 10 = n. Let u = g - l. What is the nearest to u in 0.2, 2, 0.4? 0.2 Let k = -5 - -5. Let c = -116 - -116. What is the nearest to c in k, -2/11, -2/13? k Let g = 8913 + -8917. Let u = -2.1 + -1.4. Let p = 3 + u. What is the nearest to 1 in g, 3, p? p Let o = -1.63 - -5.63. What is the closest to -7 in 1/7, o, 0? 0 Suppose 0 = u + 2d + 3d - 20, 16 = 3u + 4d. What is the nearest to u in 4, -5, 4/9? 4/9 Suppose -2y + 8 + 8 = 0. Let j = -51.09 - -52.09. Which is the closest to 0? (a) y (b) 4 (c) j c Let o = -0.035 - -0.081. Let h = o + -0.056. Which is the closest to h? (a) 1/6 (b) 1 (c) 3 a Let u = 19.66 + -19.96. What is the nearest to -2 in 0.2, -3/4, u, -0.4? -3/4 Let q = 130.064 - 129. Let x = q - 0.064. What is the closest to 0.1 in 3, 2, x? x Let i = -81 - -111. Let o be 3/(-3) - (-2 + 34/i). Let d = 4/7 - 54/119. Which is the closest to -1? (a) o (b) -2/5 (c) d b Let m = -0.0579 - 47.7421. Let k = m + 48. Which is the nearest to 1? (a) k (b) 4/13 (c) 2/5 c Let k be 6/(-2)(-1)/(-1). Let h = -233.5 - -233. Let u = 20 - 15. Which is the nearest to -2? (a) u (b) k (c) h b Let m = 2 - 2.2. Suppose -2g + 0g - 1 = -s, 0 = 2g - 4s - 14. Let k = -11.22 + 12.22. Which is the closest to 1? (a) g (b) m (c) k c Let j be 4/26 - 14/91. Suppose 2z - 3z = 0. Let h = 5/8 + -47/24. What is the closest to z in h, j, 0.5? j Let j = -909/2360 - -3/295. Which is the nearest to -1/3? (a) j (b) -0.2 (c) -0.1 (d) 51 a Let q = 1.4 - -0.6. Let s be (15/20)/(1/((-16)/(-66))). Which is the closest to q? (a) s (b) 0.2 (c) 2/13 b Let c = -0.4 + 1.4. Suppose 0 = -13*p - 60 - 5. What is the closest to 0.4 in c, p, -1? c Let s be (54/5)/((-6)/(-20)). Let d = 0.60743 + -0.10743. Which is the nearest to -0.1? (a) s (b) d (c) 5 b Let b = -0.003 + 0.103.	{ "pile_set_name": "DM Mathematics" }
Is -1/4979 greater than or equal to 1? False Is -163 <= -18? True Which is smaller: -510/7 or -72? -510/7 Are 2 and 54 nonequal? True Are -1 and -1/2700 nonequal? True Which is smaller: -479 or -491? -491 Is -8 <= 23? True Is 171 not equal to 119? True Do -1180 and -1/3 have the same value? False Which is smaller: 1 or 15? 1 Do 532 and 532 have the same value? True Is -0.03 less than 10? True Is 7/2761 not equal to 0? True Is -1/910 <= -1? False Which is greater: 121/6 or 21? 21 Which is smaller: 15/463 or 1? 15/463 Is -947 bigger than -948? True Is 26 equal to 33? False Which is smaller: 1 or 25/124? 25/124 Which is smaller: 0.006 or -0.29? -0.29 Which is smaller: 0 or 2/1083? 0 Is -7 greater than -40? True Is -2/4491 smaller than 1? True Are 1/358 and 0 unequal? True Is 3 less than -334/9? False Is 46 != 45? True Which is smaller: -500 or -2494/5? -500 Is 1 at most as big as -19/276? False Which is greater: 6 or -269? 6 Which is smaller: -63 or -62? -63 Is 1136 greater than 1136? False Are -1362 and -1361 non-equal? True Is -14/2017 at least as big as 0? False Does -1946 = -1952? False Which is greater: 0 or 7/2819? 7/2819 Which is bigger: 7399/4 or 1851? 1851 Which is bigger: 0.39 or -11/2? 0.39 Is 1 less than or equal to -5/121? False Which is greater: 35/12 or 3? 3 Do -2/59565 and 0 have the same value? False Which is smaller: -1447 or -1446? -1447 Is 40 equal to 37? False Which is smaller: 0 or -53/179? -53/179 Is -2157 greater than -2157? False Which is greater: -88 or -18? -18 Which is smaller: -15/37 or -6? -6 Is -4163 greater than -4163? False Is -3/46 at least -0.1? True Is -84 equal to -1268/15? False Which is smaller: -348 or -333? -348 Which is bigger: -6657 or -6652? -6652 Which is greater: -362 or -363? -362 Is 2.2 smaller than 0.028? False Which is smaller: -1576 or -1574? -1576 Is -10 at least as big as -148/17? False Which is smaller: 1 or 85/86? 85/86 Which is greater: 10 or 12? 12 Is 12 greater than or equal to 11? True Does 6 = 17? False Are 2.8 and -32 nonequal? True Which is smaller: -1/14375 or 1? -1/14375 Do 553/5 and 110 have the same value? False Which is greater: 2/2391 or -1? 2/2391 Is -2525 at least as big as -2524? False Is -1548 greater than -7742/5? True Are -10/499 and 0 equal? False Does -6/307 = 1? False Which is smaller: -63/8 or -7? -63/8 Is -18 <= -0.09? True Which is smaller: -2/81 or 0.05? -2/81 Are -240/17 and -13 unequal? True Which is bigger: 3/3248 or -1? 3/3248 Which is greater: -0.1 or -70/27? -0.1 Which is smaller: -131 or -133? -133 Is -134 < -132? True Is -1 >= -3/6422? False Which is bigger: 1860 or 1861? 1861 Does -2 = -1/217? False Do 2/1357 and 0.3 have different values? True Which is smaller: 19 or 25? 19 Which is greater: 4 or 3? 4 Is -1 at most as big as 67.8? True Which is bigger: 3753 or 3752? 3753 Are 503 and 503 equal? True Which is greater: -2520/17 or -149? -2520/17 Is -9/178 greater than or equal to 0? False Which is smaller: 5 or 106/25? 106/25 Is -1562 equal to -1561? False Which is smaller: 10/147 or 1? 10/147 Which is greater: 800 or 796? 800 Is -853/4 < -213? True Which is bigger: 1/72 or -2? 1/72 Which is bigger: -7/129 or -2? -7/129 Is -28/1157 bigger than 0? False Which is smaller: -0.2 or -2388? -2388 Which is smaller: -12431 or 2/5? -12431 Which is bigger: -168/11 or 36? 36 Is -85 equal to -32? False Which is smaller: -180 or -0.2? -180 Which is bigger: -1 or -6/865? -6/865 Which is greater: -1050 or -5252/5? -1050 Is 1734 less than or equal to 12130/7? False Are -1 and 1/752 nonequal? True Is -313 at least -310? False Are -191 and 0 unequal? True Which is smaller: -1 or -74/5? -74/5 Which is smaller: -110/19 or -5? -110/19 Is -8/5 at most as big as 0.002? True Which is smaller: 264/17 or 17? 264/17 Are 642/13 and 50 nonequal? True Which is smaller: 1 or -18/133? -18/133 Is 2/121 > 0? True Is -1 less than -9/9481? True Which is greater: -7 or -108/13? -7 Which is smaller: 25 or 21? 21 Which is greater: 1 or -1/29947? 1 Which is smaller: -19 or 0.002? -19 Is -10 at most as big as 117? True Which is smaller: 76 or 79? 76 Is 1 smaller than -3/6644? False Is 662 at least as big as 1984/3? True Which is greater: -20 or -1/43? -1/43 Which is smaller: -242 or -243? -243 Are -1 and -4/311 nonequal? True Is -106 <= -23? True Does -5 = -0.00455? False Which is bigger: -32/3 or -10? -10 Is -9/4720 at least 0? False Are 0.2 and -1013 non-equal? True Which is smaller: -12/43 or -1? -1 Are 1 and -326 unequal? True Which is smaller: 1/21381 or 0? 0 Is -2/21 < 1? True Do -759 and -758 have the same value? False Which is bigger: 11 or 6? 11 Is 65 < 841/13? False Is 94 less than or equal to 1044/11? True Is 1/26 not equal to 1? True Does 0.38 = 3.12? False Which is smaller: 9021 or 9022? 9021 Is 0.09 at most 3/11? True Are 36 and -12 non-equal? True Are -10/13 and -0.109 unequal? True Which is greater: -46/15 or -4? -46/15 Is -80 less than -81? False Which is smaller: 771 or 804? 771 Is 1 at least as big as 55/54? False Which is greater: 1/436 or 0? 1/436 Which is smaller: 1574 or 1575? 1574 Which is smaller: -2769 or -2764? -2769 Is 1747 less than or equal to 1748? True Which is smaller: 1 or -14.426? -14.426 Is 0.1 != 0? True Is -6 <= 0.22? True Which is greater: -7 or -11? -7 Which is smaller: 43 or 149? 43 Which is greater: -20.3 or -1.2? -1.2 Is 327 >= 2.4? True Which is smaller: -38 or 6? -38 Is 0 at most as big as 3/20764? True Is 29 less than 7? False Is 0 < 53/66? True Is 170 at most 170? True Are 2524 and 2525 nonequal? True Are -465 and -466 equal? False Is 1 > -40/7? True Which is smaller: -10 or -50.9? -50.9 Do 0 and 28/941 have the same value? False Do -2/5851 and 0 have the same value? False Which is smaller: -1 or -15/241? -1 Does -10421 = -10421? True Is 438 > 438? False Which is smaller: -4/3 or -61? -61 Which is smaller: -8099 or -32401/4? -32401/4 Is 619 less than 615? False Are -1244 and -1243 nonequal? True Which is bigger: -616 or -621? -616 Do 3/2 and -21 have the same value? False Which is smaller: 0 or 370? 0 Which is smaller: 86 or 88? 86 Which is greater: 23/3 or -1? 23/3 Is 3 >= -47? True Which is smaller: 8 or 9? 8 Is -40/109 bigger than 1? False Are -1677 and -1677 unequal? False Is 718 at most as big as 717? False Is 2 greater than or equal to -1/807? True Is -12/7 at least 1/3? False Do -4014/23 and -176 have the same value? False Which is greater: -1/917 or -0.1? -1/917 Is 0 greater than -1/932? True Which is smaller: -695 or -697? -697 Which is smaller: 1/6 or -0.02? -0.02 Is 6 bigger than 473/89? True Is 84 > 84? False Which is bigger: 1/3 or 651/8? 651/8 Is -257 not equal to -256? True Which is greater: -95 or 2.7? 2.7 Which is smaller: -4 or -41/15? -4 Which is greater: 206 or 247? 247 Are 138 and 137 unequal? True Is -235 less than or equal to -13? True Which is greater: 0 or 1/401? 1/401 Which is smaller: 1692 or 1? 1 Which is smaller: 96/5 or 1/3? 1/3 Which is smaller: -352 or -0.5? -352 Do 0 and 2/1017 have different values? True Which is bigger: 134 or -3? 134 Which is bigger: 1/3 or 414/5? 414/5 Are 0.6 and 1.519 equal? False Which is bigger: -2435 or -2436? -2435 Is -20/49 < -1? False Do -552 and -553 have the same value? False Which is smaller: 0 or 6/7321? 0 Which is smaller: -13/496 or 1? -13/496 Which is greater: 0 or 3/644? 3/644 Is -30 less than 3? True Which is smaller: 34 or -41? -41 Which is greater: -608 or -603? -603 Is 10986 equal to 10986? True Which is smaller: 18.9 or 0.12? 0.12 Which is smaller: 2/215 or 1? 2/215 Which is greater: 11/3 or -36? 11/3 Does 3/12433 = -1? False Is 10952 at least 0? True Which is greater: 137 or 136? 137 Is 2 bigger than 81/106? True Which is smaller: -6 or -85/13? -85/13 Is -1320/13 smaller than -103? False Is 1/331 < 0? False Which is smaller: -945/13 or -1? -945/13 Which is greater: -1407 or -1409? -1407 Is -1/78 < -1? False Is 1 smaller than 945? True Is -5913 at most -1? True Does -567 = -2831/5? False Which is greater: -19 or -5? -5 Is -335 at most as big as -323? True Is 13 at least 324? False Is -0.9 <= 2/39? True Is -522 >= -522? True Is -0.2 at most as big as 0.1? True Is -4/1969 at most -1? False Does -44/15 = 1? False Which is smaller: 4 or 1/1893? 1/1893 Do -752 and -763 have differ	{ "pile_set_name": "DM Mathematics" }
prob of sequence frxd? 1/756 Four letters picked without replacement from {r: 1, h: 6, d: 4, m: 4}. What is prob of sequence mhhr? 1/273 What is prob of sequence fc when two letters picked without replacement from cffccccccc? 8/45 Three letters picked without replacement from {k: 2, f: 1, n: 6, g: 1, p: 2}. Give prob of sequence fpn. 1/110 What is prob of sequence loq when three letters picked without replacement from qqoqooqqlqoql? 14/429 Four letters picked without replacement from {k: 2, l: 7}. Give prob of sequence kllk. 1/36 Four letters picked without replacement from hvyrhhvyvhrv. What is prob of sequence rryy? 1/2970 What is prob of sequence ekk when three letters picked without replacement from ekekeeeeee? 1/45 Calculate prob of sequence cw when two letters picked without replacement from {c: 2, g: 8, w: 1, m: 4}. 1/105 Three letters picked without replacement from xgggxg. What is prob of sequence gxx? 1/15 Three letters picked without replacement from npnbbbbpn. Give prob of sequence bpb. 1/21 Three letters picked without replacement from fqqwehf. What is prob of sequence feh? 1/105 Calculate prob of sequence zz when two letters picked without replacement from jrrjjrjrzzrzrzrr. 1/20 Four letters picked without replacement from {q: 5, i: 2, h: 4, n: 4}. What is prob of sequence iqhi? 1/819 What is prob of sequence did when three letters picked without replacement from ddiiddiiidiii? 40/429 Calculate prob of sequence ggzz when four letters picked without replacement from {z: 3, g: 7}. 1/20 Two letters picked without replacement from lwfcljcewlweefcl. Give prob of sequence cj. 1/80 Two letters picked without replacement from {e: 4, n: 11, t: 1, f: 1}. What is prob of sequence fe? 1/68 Two letters picked without replacement from wwrvwrrrvwvkvvvrw. Give prob of sequence rw. 25/272 Calculate prob of sequence rrzz when four letters picked without replacement from rzrrrrczcrmczrcrrczr. 3/323 What is prob of sequence jp when two letters picked without replacement from rrjjrpryy? 1/36 Calculate prob of sequence jxjx when four letters picked without replacement from xqqjx. 0 Calculate prob of sequence dndd when four letters picked without replacement from xxddddnnn. 1/42 What is prob of sequence rb when two letters picked without replacement from brbbbbbrbbbbbbbbrb? 5/34 Calculate prob of sequence xbm when three letters picked without replacement from bxbmbbmbmmxbbm. 5/156 Four letters picked without replacement from {q: 2, g: 1, m: 1, u: 2}. Give prob of sequence mqgu. 1/90 Two letters picked without replacement from zzqzzziizisz. Give prob of sequence is. 1/44 What is prob of sequence qxxx when four letters picked without replacement from xxxqxxqxqxxxxxx? 11/91 Four letters picked without replacement from {e: 3, c: 7}. What is prob of sequence ccec? 1/8 Calculate prob of sequence ww when two letters picked without replacement from wfwwwwwwwwwf. 15/22 Three letters picked without replacement from zzzzzznzzzzzszsszn. Give prob of sequence snz. 13/816 Calculate prob of sequence lkkg when four letters picked without replacement from kknklnxkkkkgxxllkxn. 7/3876 Calculate prob of sequence tt when two letters picked without replacement from {p: 2, t: 2}. 1/6 Calculate prob of sequence fww when three letters picked without replacement from swswscsfgsgwssw. 2/455 Two letters picked without replacement from {g: 3, h: 3}. What is prob of sequence hg? 3/10 Three letters picked without replacement from mmcggmmqggmqcqcqm. What is prob of sequence gqq? 1/85 Three letters picked without replacement from {r: 4, p: 15}. Give prob of sequence prp. 140/969 Four letters picked without replacement from uwjnjuuwwjuwnuwwjjw. Give prob of sequence wwun. 35/7752 What is prob of sequence xffl when four letters picked without replacement from xlfwxlffxfx? 2/165 Three letters picked without replacement from ypppuubbpybff. Give prob of sequence pbu. 2/143 Two letters picked without replacement from vzzmmb. Give prob of sequence mb. 1/15 Calculate prob of sequence cc when two letters picked without replacement from lllmmllllllclxlclj. 1/153 Calculate prob of sequence me when two letters picked without replacement from {e: 5, m: 4, t: 1, l: 5}. 2/21 Four letters picked without replacement from {j: 2, s: 2, d: 11}. Give prob of sequence jsdd. 11/819 Four letters picked without replacement from {k: 2, a: 2}. What is prob of sequence akak? 1/6 What is prob of sequence jbv when three letters picked without replacement from biibjiiiijvvibi? 2/455 Two letters picked without replacement from ffffffsfffffffffff. Give prob of sequence ff. 8/9 Two letters picked without replacement from {w: 2, r: 2}. Give prob of sequence rr. 1/6 Three letters picked without replacement from llllll. What is prob of sequence lll? 1 What is prob of sequence vqv when three letters picked without replacement from vqqqqqvqqqvqqq? 11/364 Three letters picked without replacement from {l: 6, f: 1, r: 5, u: 1, m: 1}. Give prob of sequence rum. 5/2184 What is prob of sequence oocs when four letters picked without replacement from rocslroscvcs? 1/660 What is prob of sequence nuz when three letters picked without replacement from {u: 2, z: 1, n: 1, o: 1, m: 2}? 1/105 Calculate prob of sequence lqqs when four letters picked without replacement from qaaqqalaoqasa. 1/1430 Three letters picked without replacement from zzzzzziizzzzizzz. What is prob of sequence zzz? 143/280 Four letters picked without replacement from {w: 5, g: 6, h: 3, p: 1}. Give prob of sequence hggw. 5/364 Two letters picked without replacement from xdyulpyp. What is prob of sequence dx? 1/56 Three letters picked without replacement from {t: 3, r: 1, g: 6, m: 1, y: 4, l: 3}. What is prob of sequence mtm? 0 Three letters picked without replacement from jlldtel. Give prob of sequence tdl. 1/70 Four letters picked without replacement from jjkjjkjjihkckhj. What is prob of sequence kkhj? 1/195 What is prob of sequence kj when two letters picked without replacement from kkljklllkjkklkll? 7/120 Calculate prob of sequence nyn when three letters picked without replacement from {b: 1, o: 4, w: 2, y: 2, x: 1, n: 2}. 1/330 Two letters picked without replacement from {a: 2, c: 3, m: 11, j: 1, b: 2}. Give prob of sequence bc. 1/57 Four letters picked without replacement from {y: 5, w: 1, l: 14}. Give prob of sequence lyll. 91/969 Calculate prob of sequence hnh when three letters picked without replacement from hhonhoohohhohnvhoov. 56/2907 Three letters picked without replacement from {s: 18, b: 1}. Give prob of sequence sbs. 1/19 Two letters picked without replacement from ggaaa. Give prob of sequence aa. 3/10 What is prob of sequence zty when three letters picked without replacement from zovvoytvvvyv? 1/660 What is prob of sequence iww when three letters picked without replacement from wwiii? 1/10 Two letters picked without replacement from iptpktvkkk. What is prob of sequence tp? 2/45 What is prob of sequence wp when two letters picked without replacement from {w: 1, g: 2, p: 2}? 1/10 What is prob of sequence wbb when three letters picked without replacement from {b: 7, w: 3}? 7/40 Two letters picked without replacement from {o: 4, i: 6, r: 3, z: 6}. What is prob of sequence oz? 4/57 Calculate prob of sequence jt when two letters picked without replacement from tzucuzj. 1/42 Calculate prob of sequence rj when two letters picked without replacement from bkkbkbrbzjkbkb. 1/182 Four letters picked without replacement from {m: 2, l: 3, a: 4}. Give prob of sequence llal. 1/126 Two letters picked without replacement from loooppoololooolooolo. Give prob of sequence ol. 13/76 Three letters picked without replacement from okokjjrfojgg. Give prob of sequence kro. 1/220 Three letters picked without replacement from {d: 3, q: 3, u: 2, g: 1, x: 3, i: 1}. Give prob of sequence ddq. 3/286 What is prob of sequence czz when three letters picked without replacement from {c: 6, k: 4, z: 9}? 24/323 What is prob of sequence uuii when four letters picked without replacement from {i: 14, u: 4}? 91/3060 Calculate prob of sequence sfb when three letters picked without replacement from ysfysyyzsbds. 1/330 Three letters picked without replacement from rpurdp. Give prob of sequence	{ "pile_set_name": "DM Mathematics" }
1 What is the square root of 10786 to the nearest integer? 104 What is the cube root of 146857 to the nearest integer? 53 What is the third root of 872 to the nearest integer? 10 What is the square root of 40880 to the nearest integer? 202 What is the fifth root of 1855 to the nearest integer? 5 What is the third root of 1193 to the nearest integer? 11 What is the sixth root of 1062 to the nearest integer? 3 What is the square root of 3349 to the nearest integer? 58 What is the square root of 2086 to the nearest integer? 46 What is 19876 to the power of 1/3, to the nearest integer? 27 What is 175 to the power of 1/3, to the nearest integer? 6 What is 391 to the power of 1/3, to the nearest integer? 7 What is the cube root of 46712 to the nearest integer? 36 What is the seventh root of 10574 to the nearest integer? 4 What is the square root of 3245 to the nearest integer? 57 What is 383 to the power of 1/3, to the nearest integer? 7 What is the square root of 18181 to the nearest integer? 135 What is the fifth root of 35938 to the nearest integer? 8 What is the square root of 104 to the nearest integer? 10 What is 6318 to the power of 1/4, to the nearest integer? 9 What is 433 to the power of 1/2, to the nearest integer? 21 What is the cube root of 56222 to the nearest integer? 38 What is the third root of 50988 to the nearest integer? 37 What is 399 to the power of 1/3, to the nearest integer? 7 What is 2563 to the power of 1/7, to the nearest integer? 3 What is the square root of 84948 to the nearest integer? 291 What is the fifth root of 85585 to the nearest integer? 10 What is 2400 to the power of 1/8, to the nearest integer? 3 What is the square root of 1804 to the nearest integer? 42 What is the cube root of 72539 to the nearest integer? 42 What is 42034 to the power of 1/2, to the nearest integer? 205 What is 696 to the power of 1/2, to the nearest integer? 26 What is the square root of 4778 to the nearest integer? 69 What is the fourth root of 177 to the nearest integer? 4 What is 6403 to the power of 1/2, to the nearest integer? 80 What is the ninth root of 114184 to the nearest integer? 4 What is the square root of 13500 to the nearest integer? 116 What is the fourth root of 10132 to the nearest integer? 10 What is 2032 to the power of 1/5, to the nearest integer? 5 What is 16024 to the power of 1/6, to the nearest integer? 5 What is 3508 to the power of 1/5, to the nearest integer? 5 What is the square root of 69609 to the nearest integer? 264 What is the cube root of 972 to the nearest integer? 10 What is the cube root of 6420 to the nearest integer? 19 What is 1464 to the power of 1/2, to the nearest integer? 38 What is the square root of 10114 to the nearest integer? 101 What is the cube root of 131620 to the nearest integer? 51 What is the sixth root of 3654 to the nearest integer? 4 What is the ninth root of 648 to the nearest integer? 2 What is 584 to the power of 1/7, to the nearest integer? 2 What is 951 to the power of 1/2, to the nearest integer? 31 What is the square root of 883 to the nearest integer? 30 What is the tenth root of 154279 to the nearest integer? 3 What is the third root of 3452 to the nearest integer? 15 What is the square root of 1617 to the nearest integer? 40 What is 12125 to the power of 1/2, to the nearest integer? 110 What is the tenth root of 3196 to the nearest integer? 2 What is the eighth root of 2257 to the nearest integer? 3 What is the seventh root of 877 to the nearest integer? 3 What is the eighth root of 34902 to the nearest integer? 4 What is the third root of 196552 to the nearest integer? 58 What is the fourth root of 6379 to the nearest integer? 9 What is the seventh root of 13330 to the nearest integer? 4 What is the ninth root of 1187 to the nearest integer? 2 What is 771 to the power of 1/3, to the nearest integer? 9 What is the cube root of 30317 to the nearest integer? 31 What is the tenth root of 1406 to the nearest integer? 2 What is 792 to the power of 1/2, to the nearest integer? 28 What is the square root of 4953 to the nearest integer? 70 What is the square root of 923 to the nearest integer? 30 What is the fourth root of 856 to the nearest integer? 5 What is 23169 to the power of 1/2, to the nearest integer? 152 What is 814 to the power of 1/3, to the nearest integer? 9 What is 45001 to the power of 1/4, to the nearest integer? 15 What is the cube root of 12373 to the nearest integer? 23 What is the square root of 209 to the nearest integer? 14 What is 10247 to the power of 1/2, to the nearest integer? 101 What is 20004 to the power of 1/3, to the nearest integer? 27 What is 42289 to the power of 1/3, to the nearest integer? 35 What is 578 to the power of 1/2, to the nearest integer? 24 What is the square root of 2060 to the nearest integer? 45 What is the tenth root of 1201 to the nearest integer? 2 What is the ninth root of 4578 to the nearest integer? 3 What is 35774 to the power of 1/10, to the nearest integer? 3 What is 4 to the power of 1/9, to the nearest integer? 1 What is the fourth root of 9405 to the nearest integer? 10 What is the square root of 788 to the nearest integer? 28 What is 2952 to the power of 1/6, to the nearest integer? 4 What is 3529 to the power of 1/8, to the nearest integer? 3 What is the fifth root of 25302 to the nearest integer? 8 What is 3116 to the power of 1/9, to the nearest integer? 2 What is the cube root of 221 to the nearest integer? 6 What is the ninth root of 25591 to the nearest integer? 3 What is the ninth root of 1877 to the nearest integer? 2 What is 181 to the power of 1/6, to the nearest integer? 2 What is 3518 to the power of 1/8, to the nearest integer? 3 What is the eighth root of 121 to the nearest integer? 2 What is the sixth root of 723 to the nearest integer? 3 What is the tenth root of 710 to the nearest integer? 2 What is the square root of 2171 to the nearest integer? 47 What is the tenth root of 885 to the nearest integer? 2 What is 294 to the power of 1/2, to the nearest integer? 17 What is 161151 to the power of 1/10, to the nearest integer? 3 What is the third root of 30960 to the nearest integer? 31 What is 14344 to the power of 1/2, to the nearest integer? 120 What is the fifth root of 454 to the nearest integer? 3 What is 1583 to the power of 1/7, to the nearest integer? 3 What is 4642 to the power of 1/8, to the nearest integer? 3 What is 1363 to the power of 1/3, to the nearest integer? 11 What is the third root of 4654 to the nearest integer? 17 What is the sixth root of 7489 to the nearest integer? 4 What is 44761 to the power of 1/3, to the nearest integer? 36 What is 802 to the power of 1/10, to the nearest integer? 2 What is the sixth root of 23218 to the nearest integer? 5 What is the sixth root of 16430 to the nearest integer? 5 What is 1143 to the power of 1/8, to the nearest integer? 2 What is the cube root of 62127 to the nearest integer? 40 What is the cube root of 928 to the nearest integer? 10 What is 4672 to the power of 1/6, to the nearest integer? 4 What is 22917 to the power of 1/2, to the nearest integer? 151 What is 2506 to the power of 1/2, to the nearest integer? 50 What is 2108 to the power of 1/2, to the nearest integer? 46 What is the square root of 2378 to the nearest integer? 49 What is the square root of 1373 to the nearest integer? 37 What is the tenth root of 2648 to the nearest integer? 2 What is the square root of 19704 to the nearest integer? 140 What is 81308 to the power of 1/3, to the nearest integer? 43 What is 4988 to the power of 1/4, to the nearest integer? 8 What is 444 to the power of 1/4, to the nearest integer? 5 What is 2998 to the power of 1/2, to the nearest integer? 55 What is the cube root of 2381 to the nearest integer? 13 What is the cube root of 784 to the nearest integer? 9 What is 512 to the power of 1/3, to the nearest integer? 8 What is 11472 to the power of 1/7, to the nearest integer? 4 What is the ninth root of 2798 to the nearest integer? 2 What is the cube root of 1243 to the nearest integer? 11 What is the ninth root of 101486 to the nearest integer? 4 What is the ninth root of 572 to the nearest integer? 2 What is 52929 to the power of 1/3, to	{ "pile_set_name": "DM Mathematics" }
a3/7 - 15a*2/7 - 690. Suppose w(z) = 0. Calculate z. -2, -1, 0, 5 Suppose 0 = -3u + w + 11, 3 = 2u + 4w - 9. Suppose -j + 11 = 4. Solve 4y3 - 4y*2 - uy5 - y4 - 2y4 + jy*4 = 0. -1, 0, 1 Let g be ((3/2)/(-3))/((-6)/48). Suppose 2h - 2h = -gh. Factor -2/9r2 + h - 4/9r. -2r(r + 2)/9 Let k(s) be the third derivative of 3/20s5 + 43s*2 + 0s*4 - 1/20s*6 - 1/70s*7 + 0s*3 + 0s + 0. Solve k(o) = 0 for o. -3, 0, 1 Let q(f) = 3f2 - 11f + 10. Let v be q(7). Factor -v + 80 + d*2 - 4d3. -d2(4d - 1) Let b(c) = -3c - 767 + 10c + c*2 + 689. Let r be b(6). Solve 3/2p*3 - 6 + rp + 9/2p2 = 0 for p. -2, 1 Let j(b) be the third derivative of b8/120960 - b7/6048 - b6/720 - 11b*5/20 + 12b*2. Let k(u) be the third derivative of j(u). Factor k(d). (d - 6)(d + 1)/6 Let s(o) be the third derivative of -o6/1980 - o5/132 - o*4/22 - 8o*3/3 + 5o*2. Let q(n) be the first derivative of s(n). Find w, given that q(w) = 0. -3, -2 Let a = -1174 - -1178. Let b(d) be the second derivative of 0d*2 - 1/12d*a + 0 - 1/24d*3 - 5d. Factor b(f). -f(4f + 1)/4 Let d be ((60/(-175))/(2/(-5)))/(45/42). Solve -6/5f3 - 1/5f + df2 + 4/5f*4 + 0 - 1/5f5 = 0. 0, 1 Let x(c) be the third derivative of -c7/280 - c6/20 - c5/8 - 13c3/3 - 29c2. Let y(s) be the first derivative of x(s). Let y(k) = 0. Calculate k. -5, -1, 0 Let y(u) be the first derivative of u6/100 - u5/30 + u4/60 + u*3/15 + 4u2 + 11. Let l(f) be the second derivative of y(f). Let l(a) = 0. Calculate a. -1/3, 1 Let i(w) be the first derivative of w6/36 - 61w5/30 + 235w*4/4 - 825w*3 + 21375w*2/4 - 16875w/2 + 304. Find f such that i(f) = 0. 1, 15 Let v(p) = -p*3 + 4p*2 + 8p + 4. Let o be v(6). Let y be (0 + 8/o)-15. Find m such that 5 - y - 2m*2 + 1 - 4m = 0. -2, 0 Let n = -29609/9 + 3291. Factor nl - 8/9 - 2/9l*2. -2(l - 4)(l - 1)/9 Let l(n) be the first derivative of -n4/10 + 4n3/15 - n2/5 - 313. What is k in l(k) = 0? 0, 1 Let q(r) be the first derivative of 2r6/15 - 8r5/25 - r4/5 + 8r3/15 - 20. Find n, given that q(n) = 0. -1, 0, 1, 2 Suppose -132p - 7p + 292 = 7p. Factor -19/3y - 5/3 + 4/3y*p. (y - 5)(4y + 1)/3 Let p(c) be the third derivative of -c5/20 - 7c*4/8 + 4c*3 - 4c2 - 3. Let p(k) = 0. Calculate k. -8, 1 Let n(i) be the first derivative of -i6/6 + 3i5/5 + 5i*4/2 + 2i*3/3 - 9i*2/2 - 5i - 36. Find y such that n(y) = 0. -1, 1, 5 Let d be (0 - 40/(-780))/(2/6). Suppose dw2 - 6/13 + 4/13w = 0. Calculate w. -3, 1 Let g = -43/2 - -23. Let a be (0/(17 - 9))/2. Determine s, given that 9/4s3 + gs*2 + as + 0 + 3/4s4 = 0. -2, -1, 0 Suppose 3c - 7c + 60 = 0. Suppose -cl + 19l = 12. Factor -11v - lv3 + 10v*2 - 5v + 8 + v*3. -2(v - 2)*2(v - 1) Let j(l) be the first derivative of l*4 - 112l*3 + 4704l*2 - 87808l - 100. Factor j(f). 4(f - 28)3 Let y(o) be the second derivative of 1/30o*5 - 1/3o*4 + o + 7/2o*2 + 0 + 4/3o*3. Let x(a) be the first derivative of y(a). Factor x(f). 2(f - 2)*2 Let b = 401/111 - 72/37. Find z such that -1/3z*2 - 2z - b = 0. -5, -1 Suppose 15/4p2 - 45/4p + 25/4p3 + 0 + 5/4p*4 = 0. Calculate p. -3, 0, 1 Let t(d) be the first derivative of -11 - 3/4d*4 + 3d + 1/4d6 - 3/5d*5 + 4d*3 - 21/4d*2. Suppose t(i) = 0. Calculate i. -2, 1 Suppose 151f + 96f = 988. Factor 1/6p - 1/6p2 + 1/6p*f + 0 - 1/6p*3. p(p - 1)*2(p + 1)/6 Let i be 9/20 - 8/32. What is r in 1/5r - 2/5 + ir*2 = 0? -2, 1 Suppose -304h*4 + 60 + 34h + 545h3 - 28h*4 - 58h*4 + 406h - 360h5 + 955h*2 = 0. What is h? -1, -2/3, -1/4, 3/2 Let q(g) be the second derivative of -11g + 0 - 2g2 + 1/5g*5 + 1/3g*4 - 2/3g*3. Factor q(k). 4(k - 1)(k + 1)2 Suppose 3a - 7a + 12 = 0. Let b be -1 - (-1 - 1)/((-15)/(-30)). What is r in -r4 + 6r*4 - br + r*4 + 9r*a = 0? -1, 0, 1/2 Let z(a) = -6a - 29. Let c be z(-12). Let 85t2 - 44t*2 - ct*2 - 4t = 0. What is t? -2, 0 Let g = 24 - 18. Factor -k*2 - 2 + 28k*3 + 4k + 10k4 - 16k*2 - gk*2 + 47k*2. 2(k + 1)*3(5k - 1) Let t(n) be the second derivative of 0 - 3/2n*2 + 7/6n*3 + 1/20n*5 - 5/12n*4 - 14n. Find g, given that t(g) = 0. 1, 3 Let z(h) be the first derivative of -h*4/5 + 188h*3/15 - 230h*2 + 2116h/5 - 197. Factor z(l). -4(l - 23)2(l - 1)/5 Let c(p) = p*2 - 11p + 18. Let j be c(9). Let r(o) be the second derivative of 0o3 + 1/4o*5 + jo*2 + 3o - 5/12o4 + 0. Factor r(w). 5w*2(w - 1) Let h be -6 - (720/(-42) + 8/2). Solve -12/7 - hd + 18/7d*2 = 0. -2/9, 3 Factor -3/7r*4 - 24/7r*3 - 30/7r + 0 - 51/7r2. -3r(r + 1)(r + 2)(r + 5)/7 Suppose 4i - 8i = -32. Suppose -14s = -18s + i. Factor -3/2m*s - 1/2m*3 - 1/2 - 3/2m. -(m + 1)*3/2 Let g = 197/600 - -1/200. Factor -1/6p*5 + 1/6 + 1/3p*3 - gp*2 + 1/6p*4 - 1/6p. -(p - 1)*3(p + 1)*2/6 Let h be -27 + 21 + (-62)/(-10). Let y(i) be the third derivative of 7/3i*4 + 8/3i*3 + 1/15i*7 + 0i + 0 - 19/60i6 + 10i*2 - hi*5. Factor y(c). 2(c - 2)*2(c + 1)(7c + 2) Let m(n) be the first derivative of n*4/8 - 26n*3/3 + 621n*2/4 + 729n - 91. Factor m(j). (j - 27)*2(j + 2)/2 Suppose -49s2 + 152s - 297s2 + 8 + 823s*3 - 1033s*3 = 0. Calculate s. -2, -1/21, 2/5 Suppose 12/7m - 2/7m3 + 0 - 2/7m*2 = 0. What is m? -3, 0, 2 Let q be (-263 - -273) + 158/(-16). What is r in 0 - 1/4r + 1/8r3 - qr*2 = 0? -1, 0, 2 Suppose -3m - 16 = h - 71, 5m = h + 97. Factor 3f + 18f2 - mf*2 + 5 + f. -(f - 5)(f + 1) Suppose -6a - j = -3a - 11, -15 = -4a - j. Let m be 2/a(-16)/(-24). Factor mw2 - 1/3w + 0. w(w - 1)/3 Let p = 4/6379 + 89270/57411. Determine u, given that 4/9u*4 - pu + 2/3u3 - 2/3u*2 - 2/3 = 0. -1, 3/2 Suppose -3l = u + 23 + 18, u = 4l + 57. Let h be (-28)/l(-191)/(-2). Factor -4q2 - h + 4q + 191. -4q(q - 1) Let p(t) be the first derivative of t*5/330 - 3t*4/22 + 27t*3/11 - 3t*2 + 13. Let l(y) be the second derivative of p(y). Factor l(g). 2(g - 9)*2/11 Let q be 21/36(7 - -5) - 10/4. Find l, given that -13l3 + 105/2l + 17l4 - 9 - 52l*2 + ql5 = 0. -3, 2/9, 1 Let u(a) be the third derivative of -a5/30 + 95a4/3 - 36100a*3/3 - 3a2 + 58. Determine b so that u(b) = 0. 190 Let h(f) be the second derivative of -f8/10080 + f7/3780 + f6/540 - 5f4/3 - 50f. Let k(x) be the third derivative of h(x). Factor k(z). -2z(z - 2)(z + 1)/3 Let x(n) = -2n*4 - 7n3 + n2 + 2n + 6. Let d(t) = -2t*4 - 6t*3 + 2t*2 + 2t + 4. Let j(f) = -5d(f) + 4x(f). What is k in j(k) = 0? -2, -1, 1 Let u(v) be the second derivative of -v*5/90 + 5v4/27 + v3/27 - 10v2/9 - 289v. Let u(s) = 0. Calculate s. -1, 1, 10 Let r(i) be the second derivative of i*2 + 4i + 1/45i5 + 32/9i*3 + 4/9i*4 + 0. Let d(h) be the first derivative of r(h). Find c, given that d(c) = 0. -4 Let h(i) = i + 8. Let y be h(-5). Factor -3t - 9t - y + 3t*2 + 12. 3(t - 3)(t - 1) Let j(y) = y2 - 329y + 328. Let c(h) = -h*2 + 164h - 163. Let n(z) = 9c(z) + 4j(z). What is w in n(w) = 0? 1, 31 Let j be (-21)/1012-5. Let a be 0 + ((-18)/j)/((-4)/14). Factor -az + 0 - 1/2z*2. -z(z + 1)/2 Let j be 5(-14 + 3091/220). Factor 0 + jv*3 + 0v - v2. v2(v - 4)/4 Let c(y) be the third derivative of -9y8/4480 + y7/840 + 5y4/12 - 5y*2. Let v(j) be the second derivative of c(j). Suppose v(w) = 0. Calculate w. 0, 2/9 Let l(i) = -2950i*3 + 850i*2 + 1725i + 365. Let v(d) = 983d3 - 283d*2 - 575d - 122. Let g(f) = 3l(f) + 10v(f). Solve g(h) = 0. -5/14, 1 Let r(c) be the third derivative of 0c4 - 1/20c*5 - 1/40c*6 + 0c*3 + 0 - 12c*2 + 0c. Solve r(s) = 0. -1, 0 Let u(x) be the third derivative of x6/60 - x5/15 - 13x4/12 - 10x*3/3 - 21x*2 - 4x. Factor u(h). 2(h - 5)(h + 1)(h + 2) Let a(l) be the first derivative of -2l*5/15 - 10l*4/3 + 44l*3/3 - 68l*2/3 + 46l/3 + 98. Factor a(f). -2(f - 1)3(f + 23)/3 Let d(x) be the first derivative of x6/660 - x5/165 + x*4/132 - 9x*2/2 - 29. Let u(s) be the second derivative of d(s). Factor u(t). 2t(t - 1)*2/11 Suppose	{ "pile_set_name": "DM Mathematics" }
(c) -29 b Which is the nearest to 1/4? (a) 2/11 (b) 1 (c) -0.09 a Which is the nearest to -1? (a) 0 (b) -18 (c) 20 a Which is the closest to -2/9? (a) -33 (b) -2 (c) 4/9 c Which is the nearest to 1? (a) -1/2 (b) 3/2 (c) -5 (d) 2 b Which is the closest to 0.4? (a) 2 (b) 0.7 (c) 0.2 c What is the closest to -27 in 2/9, 0.2, -2/5, -1? -1 Which is the closest to -4/5? (a) -5 (b) 1/3 (c) 3 (d) 0.1 d Which is the nearest to 2? (a) -4 (b) -5 (c) 47/2 (d) -2/15 d Which is the closest to 0.54? (a) -0.2 (b) 5 (c) -1 a Which is the nearest to 1? (a) -8 (b) 1 (c) -3 (d) -1/6 b What is the nearest to -2/7 in 0, -0.06, 0.3? -0.06 What is the nearest to 6 in -0.09, 1/3, 0.3, -1? 1/3 Which is the closest to -2/7? (a) 2 (b) 0 (c) 0.08 (d) -3 b What is the nearest to 2/7 in 35, -0.3, -2, -1? -0.3 What is the closest to -4 in -5, 3, -2, -4? -4 Which is the nearest to 1? (a) 0.3 (b) 1/2 (c) -0.4 (d) -1 b Which is the closest to 26/3? (a) -2 (b) -2/3 (c) -5/4 (d) -1/3 d Which is the nearest to 0.1? (a) -0.1 (b) 0.1 (c) 179 (d) 3 b What is the nearest to 1 in -28, 0.14, -0.5? 0.14 Which is the closest to 0? (a) -2 (b) 0 (c) -1/2 (d) -20 b Which is the closest to -1? (a) -26 (b) 1 (c) -0.4 (d) 0.1 c What is the closest to -3 in -0.4, -2/11, -9/5, 8? -9/5 What is the closest to 0 in 4, 2, -0.01, 4/3? -0.01 What is the nearest to -61/3 in 0.4, -0.4, 5, -3/2? -3/2 Which is the nearest to -0.01? (a) -2 (b) 0.4 (c) -0.3 (d) 2/7 c What is the closest to 2.6 in -1, 5, 0.4? 0.4 Which is the closest to -5? (a) 5 (b) -11 (c) -3/11 (d) 0.4 c Which is the closest to -1? (a) -3 (b) -23 (c) -1 (d) 2 c What is the closest to -0.043 in 2/9, -2/5, 5? 2/9 What is the closest to 0 in -1, -2, 28? -1 Which is the closest to -0.2? (a) -2/11 (b) 0.04 (c) -0.4 (d) 1 a What is the nearest to 2/5 in -5, 33, -4, -12/7? -12/7 Which is the closest to 1? (a) 0.2 (b) -21 (c) 0.12 a What is the nearest to 3/2 in -0.024, -3/8, 1.6? 1.6 Which is the nearest to -2/3? (a) -4/7 (b) 0.2 (c) -354 a What is the closest to -11 in -2/5, 0, -0.2, 9/13? -2/5 Which is the nearest to 0.1? (a) -1 (b) 2/3 (c) 4 (d) 0.4 d Which is the closest to -2/7? (a) -20 (b) -74 (c) -0.3 (d) -2/11 c What is the closest to 10 in -5, 1/13, 2/9, -0.08? 2/9 Which is the nearest to 2/7? (a) -0.3 (b) 0.039 (c) 1/5 c What is the closest to -1/5 in -0.3, 0.1, 2/277? -0.3 What is the nearest to -9 in 2, -18, -4? -4 What is the closest to -1 in 3/16, -8, -0.4, 0.1? -0.4 Which is the nearest to -2? (a) -0.1 (b) 0 (c) 1 a What is the nearest to 1 in -0.2, 2/51, 6? 2/51 Which is the closest to -2/3? (a) 4 (b) -5 (c) 2/25 (d) -2/67 d What is the closest to -126 in 39, -2/9, -0.1, -5? -5 What is the closest to -2 in 3/7, -1, -0.4, -4? -1 What is the closest to -1/2 in 0.4, -4, 2/3, -47? 0.4 What is the closest to -1 in -0.5, 0.4, -0.21? -0.5 Which is the nearest to 1? (a) -3 (b) -1.2 (c) -1 (d) 4/5 d Which is the closest to -0.2? (a) 3 (b) 19 (c) 2 c What is the nearest to 1 in 5, -6, -2/9, 3? -2/9 Which is the closest to -1/2? (a) 2 (b) 4 (c) -0.5 (d) 3 c What is the closest to 0.2 in 4, -1, -5, -6? -1 Which is the nearest to 0? (a) 2/5 (b) -2/9 (c) -147 (d) 0.5 b Which is the nearest to -1? (a) -3 (b) 232 (c) 0.2 c Which is the nearest to 5? (a) 0.22 (b) 44 (c) 5 c Which is the nearest to 3/11? (a) 4 (b) 0 (c) -2 (d) 13 b What is the nearest to 5 in -2, -0.5, -1/3, -14? -1/3 Which is the nearest to -0.2? (a) -2/23 (b) 0.1 (c) 4 (d) 0.4 a What is the nearest to 0.1 in -1, 4, -2/7, -73? -2/7 Which is the closest to -0.1? (a) 5 (b) -4.12 (c) 1 (d) -0.4 d What is the nearest to -2/7 in -3, -5/4, 2/15, 4/5? 2/15 Which is the nearest to 3/5? (a) 22 (b) 3 (c) -1 (d) 4 c Which is the nearest to 3? (a) 2 (b) 5 (c) -2 (d) -2/3 a What is the closest to 2/3 in -1/5, 0, 0.2, 3/14? 3/14 What is the nearest to 25 in 2/5, -2/3, -12? 2/5 Which is the nearest to 34? (a) 1 (b) 2 (c) 10 c Which is the closest to 3/2? (a) -2 (b) -3 (c) -1 (d) -6 c What is the closest to -1/4 in 2/3, 5, 3, -3/5? -3/5 Which is the nearest to -4/31? (a) 0 (b) 1/5 (c) -2/5 (d) 5 a Which is the closest to 0.1? (a) -1/2 (b) 4 (c) -21/4 (d) 9 a Which is the nearest to 0.2? (a) 5 (b) -15 (c) 3 (d) 4 c What is the nearest to -0.1 in 14/13, 1/6, 1/4, 0.2? 1/6 Which is the nearest to -1? (a) -3/5 (b) 0.07 (c) 0.7 (d) -0.1 a Which is the nearest to 2? (a) -5 (b) -4/73 (c) 2 c Which is the closest to 0.1? (a) -1/7 (b) 18 (c) -5/3 a What is the nearest to -3 in 1/4, -4/5, -4, 5/4? -4 Which is the nearest to -2/5? (a) -0.3 (b) -55 (c) 7 a What is the nearest to 2 in 0.2, -2/15, -0.53? 0.2 What is the nearest to 0 in 1, 1/4, -1/7, 2/11? -1/7 What is the nearest to -1/2 in 0.1, 10/11, -5? 0.1 Which is the nearest to 0? (a) -72 (b) -0.5 (c) -1 b What is the nearest to 2/3 in -5, -2/3, 0, -1/3? 0 Which is the nearest to -1/5? (a) 1.32 (b) -0.2 (c) 1 (d) 4 b What is the nearest to 0 in 7/3, -2/5, 2, -5? -2/5 What is the closest to -0.3 in 5, -0.3, -79? -0.3 What is the nearest to -0.5 in 1/6, -2/5, -13, 0.5? -2/5 Which is the nearest to 2/5? (a) -0.5 (b) -0.3 (c) 19 b What is the closest to -6 in 1.8, 1/4, 0.7? 1/4 What is the closest to -3 in 3/7, -0.2, -1, 30? -1 What is the closest to -50 in 5, 0.4, -1, 4? -1 Which is the closest to 3? (a) -1 (b) 1 (c) 0.06 b What is the nearest to 4 in -3, 1/7, 1? 1 Which is the nearest to 2/9? (a) 297 (b) 3 (c) -4 b What is the closest to -1 in -1/9, -5, -2/183? -1/9 Which is the nearest to -1? (a) 11 (b) -0.01 (c) -1/6 c What is the nearest to 43 in 4, 12, 3, 0.4? 12 Which is the nearest to 2? (a) 2 (b) 148/17 (c) -2/5 a What is the nearest to 2/9 in 0.2, -3, 1, 1/8? 0.2 What is the closest to 3/4 in 11, -4, -2/5? -2/5 What is the nearest to 2/7 in 4, -2, -5, 11.9? -2 Which is the nearest to -2/7? (a) 0.09 (b) 16 (c) 0.3 (d) 3 a Which is the closest to -5? (a) 2 (b) 1.4 (c) 0.1 (d) -2/5 d What is the nearest to -1/4 in 2/5, -2/5, 1? -2/5 Which is the nearest to 0.3? (a) 0.2 (b) 0.7 (c) 24 a What is the nearest to 0 in -225, -24/5, -2? -2 What is the closest to 5 in 1/5, 2, 6, -2? 6 Which is the nearest to 5? (a) 3 (b) -2/5 (c) 5 c Which is the closest to 2/3? (a) -4/9 (b) 5/41 (c) 1/2 c What is the closest to -0.2 in 2, 0.1, -229? 0.1 Which is the nearest to 1/2? (a) -59 (b) -2 (c) -2/15 (d) 5 c What is the closest to -1 in -0.5, 0.5, -1.7, -4? -0.5 Which is the closest to -0.3? (a) 1 (b) 5/3 (c) -1 (d) -4 c Which is the nearest to -1/3? (a) 6 (b) 0 (c) -0.006 c What is the closest to 3 in -6, -2/7, -4/13, 0? 0 What is the closest to -1/16 in -1/3, -5, 0.8? -1/3 What is the closest to 193 in 2, -3/7, -3? 2 What is the nearest to -1/2 in 3, 1, 0.1? 0.1 What is the closest to 0 in -7, 3, -1, 5/3? -1 Which is the nearest to 1? (a) 0.5 (b) -4 (c) 0.4 (d) 3 a Which is the nearest to 1/3? (a) -0.1 (b) -4 (c) 0 c What is the nearest to -29 in 2, -3, 7/5? -3 Which is the closest to 2? (a) -1 (b) -81 (c) -2 (d) -6 a What is the nearest to -11 in -5, 4, -19? -5 What is the nearest to 0.007 in 0, -2/21, -4, -2/7? 0 What is the closest to -2/3 in -1/2, -1/5, -265? -1/2 Which is the nearest to -1/4? (a) 4 (b) 29 (c) -1 (d) 5/3 c Which is the closest to -2.3? (a) 0 (b) 0.1 (c) -2 c What is the nearest to 110 in -1, -9, -0.5? -0.5 Which is the closest to 0? (a) 0.4 (b) -267 (c) 0.1 c Which is the nearest to 1/6? (a) 0.1 (b) 2/9 (c) -3/8 (d) -1.3 b Which is the closest to 2/5? (a) 8 (b) 367 (c) -2/13 (d) 5 c Which is the closest to -23/3? (a) 2/9 (b) -3/11 (c) 2/3 b What is the closest to -2/7 in 0.2, -2/17, 1/2, -0.1? -2/17 Which is the nearest to 3/5? (a) -5/6 (b) -3/5 (c) -2 b Which is the nearest to 0.1? (a) -5 (b) -5/3 (c) -0.5 (d) 2 c Which is the nearest to -2/15? (a) 2/5 (b) 2/7 (c) -6 (d) -0.4 d Which is the nearest to -2/5? (a) -3/2 (b) -2/33 (c) -5/4 (d) 0.5 b Which is the closest to 1/2? (a) -0.4 (b) 7 (c) 78 (d) -4 a What is the nearest to 185 in 4, -0.8, -2, 5? 5 Which is the nearest to 0.1? (a) 7 (b) -2/9 (c) 37 b What is the closest to 0.1 in 5/2, -0.2, -0.82? -0.2 Which is the clos	{ "pile_set_name": "DM Mathematics" }
Calculate the common denominator of -83/14 and 60/(-16)(-42)/(-9). 14 Suppose 4j - 32 = -2b, 3j - 3b - 2b = -2. Let q = -60 + 67. Calculate the smallest common multiple of q and j. 42 What is the least common multiple of 12 and 5/1524/2? 12 Let c be 0 - (0 - (-12)/339). Let j = c - 311/791. What is the common denominator of 137/8-1 and j? 56 Let c(b) = 3b*2 + 5b + 2. Let j be c(-3). Let o = 9 + 5. Calculate the smallest common multiple of 4/3147/j and o. 14 Suppose 9 = 3c + 3n, -4n - 2 = c - 5. Suppose -4x + 117 - 659 = -2t, -5x = -ct + 675. Calculate the common denominator of (5/(-5))/((-16)/x) and 5/4. 8 Let s(a) = -2a2 - 2a - 2. Let t be s(-2). Let y be (23067/10)/(t/(-5)). Let n = y - 1945. Find the common denominator of n and -19/3. 12 Let v be 1 - 3 - (-818)/585. Let j = v - -868051/16380. Let m = j + -309/7. What is the common denominator of 52/7 and m? 28 Let y = -59656869/232 - -257141. Let g = -219/29 - y. What is the common denominator of -149/6 and g? 24 Let r = -15 - -24. Let b = -169 - -179. What is the lowest common multiple of b and r? 90 Let s(x) = 23x2 + 2x - 1. Let k be s(1). Calculate the common denominator of 2-11(-26)/k and (-138)/32 - (0 + 0). 48 Suppose -4d + 18 = 2i, d - 1 - 5 = -i. Let r = 21 + -18. Calculate the least common multiple of r and i. 3 Let a = 4 - 3. Calculate the lowest common multiple of 0/3 + 8 + -2 and a. 6 Suppose -5v = -7v + 6. Let b be 99/(-15) + v/5. Calculate the smallest common multiple of 11 and 10/15 - 2/b. 11 Let c(d) = d*2 - 10d + 8. Let a be c(8). Calculate the common denominator of (a/(-24))/((-16)/(-474)) and -107/12. 24 Let h = -1/149 + 751/894. Find the common denominator of h and -115/12. 12 Let o = 2/14829 - 79318/1705335. Let m = 1069/138 + o. Find the common denominator of 129/270 + 4/18 and m. 10 Let b be (-20)/50 + (-24)/(-10). Suppose -c - 1 = -bc. Suppose 0v - 3v = w - 17, -4w + 3v = -38. Calculate the lowest common multiple of c and w. 11 Calculate the lowest common multiple of (-90)/225 - (107/(-5) - 0) and 15. 105 Let m = 3173 - 101547/32. Let y = m + 909/224. What is the common denominator of 39/2 and y? 14 Let u(o) = 2o*2 - 8o - 2. What is the lowest common multiple of 14 and u(6)? 154 Let n be (-462)/60(-1035)/(-2). Let v = 4009 + n. Find the common denominator of (1/(-3))/(40/(-102)) and v. 20 What is the lowest common multiple of 3((-220)/15)/(-2) and (-8)/(-6)(1 - -2)? 44 Let b be (-1 - -3) + (-2242)/(-156). Let a = 49/3 - b. What is the common denominator of 85/14 and a? 182 Suppose 3v - 4v + 2 = 0. Suppose 4 = 2d + 2d + 4h, 2d - vh = 22. What is the least common multiple of d and 8? 24 Let o(r) = -2r + 6. Let h be o(5). Let t = 14 + h. Calculate the smallest common multiple of 26 and t. 130 Let b(y) = 24y + 2. Let x be b(-5). Let t be (-4)/(-30)(-12)/x. Let h = -18593/590 + t. Find the common denominator of 19/3 and h. 6 Let b(z) = z2 + 9. Let l(g) = -g3 - 6g2 - g - 1. Let s(o) = -o3 - 5o2 - 6. Let n be s(-5). Calculate the smallest common multiple of l(n) and b(0). 45 Let d be (1 - -20)/3 - 3. Find the common denominator of 8/(-12)69/d and 103/22. 22 Suppose -22 + 4 = -3y. Suppose -5n - y = -6n. Calculate the least common multiple of 11 and n. 66 Let q be 670/4 + (-2)/(-4). Let u be -13(-10454)/q. Let l = u - 1480/7. What is the common denominator of -43/11 and l? 44 Let p(w) = -w + 4. Calculate the least common multiple of p(0) and (-3)/(-6) + (-34)/(-4). 36 Let z = -3747 + 44903/12. Find the common denominator of z and -19/10. 60 Let z = -14 - -33. Let k = -13 + z. Calculate the least common multiple of k and 4. 12 Let r = 603931/32 - 18875. Calculate the common denominator of r and -103/20. 160 Let b = -94 - -103. Suppose 0d + 5d = 55. Calculate the least common multiple of b and d. 99 Let w be 1465/((-3 + 0)/(-9)). Let u = w + -43871/10. Calculate the common denominator of 11/8 and u. 40 Let o(k) = k2 + 6k + 4. Let f be o(-4). Calculate the lowest common multiple of 1 and (-42)/f - (-2)/(-4). 10 Suppose 28 = 7r - 56. Let x = -14 + 28. Calculate the lowest common multiple of x and r. 84 Find the common denominator of 215/(-88) + (12 - (-134)/(-11)) and (-4)/6261/32. 16 Calculate the common denominator of -4 - 5/(120/164) and 107/6. 6 Let f(q) = -q*3 - 4q*2 - 3q + 3. What is the lowest common multiple of 2 and f(-3)? 6 Let t = 55255/24282 - -3/1349. Find the common denominator of 5/9 and t. 18 Let a = 30959/52 - 22524/13. Let j = 1159 + a. What is the common denominator of j and -6? 4 Suppose 5f - 19 = -2t + 19, 0 = 2t - 8. What is the lowest common multiple of 14 and f? 42 Let d be (-6)/(13/(-4) + 3). Let p be 4(-4)/(d/9). Let t = 7 + p. Calculate the smallest common multiple of 5 and t. 5 Let y = -1/107542 - 2046013433/268855. Let u = y - -7617. Calculate the common denominator of u and (-1)/2083 - (-12)/(-6). 20 Suppose -r - 4r - s - 7 = 0, s = -3r - 5. Let v(x) = 8x*2 - 1. Calculate the smallest common multiple of v(r) and 1. 7 Let t be (11/3)/(3/9). Let f = t - 10. Calculate the smallest common multiple of f and 8. 8 Suppose 0f + 10 = f. Calculate the lowest common multiple of 4 and f. 20 Let z(f) = 3f + 4. Let k be z(6). Suppose -5w - 2 = -k. Suppose 0 = -4t + x + 36, -4t - x = -0x - 44. Calculate the least common multiple of t and w. 20 Let d = 105 - 38. Suppose 70 + d = w - k, 107 = w + 5k. Suppose -5m - 3 = -3n - w, 0 = 3n - m + 129. Find the common denominator of n and 143/6. 6 Let l be 6 - -2 - (-1 + 1). Let p = -68/3 - -37. Find the common denominator of (-616)/(-60)(-10)/l and p. 6 What is the common denominator of -26/9 and 292/881? 99 Let x(j) = j*3 + 4j*2. Let q be x(-3). Calculate the common denominator of -51/14 and ((-237)/4)/(q/2). 42 Let u = 3 + -24. Let i = 22935/4264 - 2/533. What is the common denominator of i and -2 - u/3614? 24 Let l = 80 - 129. Let b = -21875/18 + 1213. Find the common denominator of b and (-15)/5l/54. 18 Suppose 4 + 6 = 5m. Let a = 1 + m. What is the lowest common multiple of 4 and a? 12 Let p = 1949 - 3971/2. Find the common denominator of 87/8 and p. 8 Let c = 1897 + -3022. Let i = -24813/22 - c. What is the common denominator of i and (-2)/4 + 78/8? 44 Let h be 116/(-51)(-12)/8. Let d = 1221/34 - h. What is the common denominator of d and -137/6? 6 Let p = -106873/90 - -3563/3. What is the common denominator of -11/4 and p? 180 Suppose 0p = -5p - 3335. Let u = p + 2655/4. Find the common denominator of 65/4 and u. 4 What is the common denominator of (4/(-16)17)/((-6)/10) and 137/18? 36 Suppose -3x - 2 = -5x. Calculate the lowest common multiple of x and 6. 6 Let h = -1347 - -615. Let w = h - -5865/8. Find the common denominator of w and 5/6. 24 Let z = 12613/144 + -835/9. Find the common denominator of z and 27/7. 112 Suppose 0 = 5b - 43 - 2. Calculate the least common multiple of b and 2. 18 Calculate the common denominator of -65/22 and (-47)/4 + (3/(-9))/(-1). 132 Let g(z) = -z2 - 7z - 3. Let d = 2 - 7. Let r be g(d). Calculate the smallest common multiple of 4 and ((-60)/42)/((-1)/r). 20 Let h = -85591/50 + 1712. Let x = -2423/150 - h. Calculate the common denominator of x and 12/7. 21 Let h(a) be the second derivative of -a*5/20 + 5a*4/6 - 5a*3/6 + 7a*2 - 4a. What is the common denominator of h(10) and -17/9? 9 Let v = -29 - -40. Let u = v - 7. Calculate the least common multiple of u and 14. 28 Suppose -7 + 3 = 2c, 16 = u - 4c. Calculate the least common multiple of 8 and u. 8 Suppose -2j = -3b - 749, 2j - b = 838 - 91. Let u = j + -2233/6. What is the common denominator of u and 51/10? 30 Suppose -4w - 5c + 23 = -w, 4 = -4w + 2c. Calculate the smallest common multiple of 7 and w. 7 Calculate the common denominator of 13/14 and (10/30)/((-2)/135). 14 Let f = 275373/20 + -13763. What is the common denominator of -73/2 and f? 20 Suppose 4x + 49 = -19. Let w be (-6)/36(-7 - -1). Find the common denominator of (w/3)/((-3)/x) and 29/9. 9 Let w(f) = f2 - 6f + 4. Let i be w(4). Let m = i - -2. What is the least common multiple of m + (211)/3 and 6? 30 Let t = 9 - -16. Suppose 3v + 2v = -t. Let i = 7 + v. Calculate the lowest common multiple of i and 2. 2 Suppose 3h -	{ "pile_set_name": "DM Mathematics" }
8? 2, 7, 19, 719, 1567 List the prime factors of 76827002. 2, 7, 419, 1871 List the prime factors of 2666158726. 2, 7, 11, 163, 106213 List the prime factors of 1615379142. 2, 3, 13, 20709989 List the prime factors of 2120604348. 2, 3, 823, 214723 What are the prime factors of 321303762? 2, 3, 13, 103, 13331 What are the prime factors of 369647016? 2, 3, 53, 71, 4093 List the prime factors of 146944384. 2, 107, 10729 What are the prime factors of 762818238? 2, 3, 7, 13, 465701 List the prime factors of 16781780. 2, 5, 127, 6607 List the prime factors of 62595593. 349, 179357 What are the prime factors of 2412328062? 2, 3, 1811, 222007 List the prime factors of 264522970. 2, 5, 26452297 List the prime factors of 2238494536. 2, 89, 3143953 What are the prime factors of 209676382? 2, 4651, 22541 List the prime factors of 128263499. 7, 13, 1409489 List the prime factors of 5633440. 2, 5, 137, 257 List the prime factors of 1149343747. 29, 39632543 List the prime factors of 900443251. 139, 6478009 List the prime factors of 131996703. 3, 43998901 List the prime factors of 1076704907. 43, 1201, 20849 List the prime factors of 136904282. 2, 68452141 List the prime factors of 10168479. 3, 1129831 List the prime factors of 255703031. 3593, 71167 What are the prime factors of 1302014470? 2, 5, 3049, 42703 What are the prime factors of 376624192? 2, 7, 120097 List the prime factors of 4120432961. 37, 137, 812869 What are the prime factors of 352419375? 3, 5, 7, 11, 2441 List the prime factors of 3976679631. 3, 1325559877 What are the prime factors of 70700625? 3, 5, 12569 List the prime factors of 16148908. 2, 43, 93889 List the prime factors of 1461771158. 2, 29, 47, 536233 What are the prime factors of 222012351? 3, 11, 2242549 List the prime factors of 208721812. 2, 13, 4013881 What are the prime factors of 254418821? 17, 83, 180311 What are the prime factors of 291362032? 2, 13, 239, 5861 List the prime factors of 84871810. 2, 5, 8487181 List the prime factors of 1971006481. 131, 15045851 List the prime factors of 39946777. 13, 3072829 What are the prime factors of 34010889? 3, 11, 149, 6917 List the prime factors of 55889688. 2, 3, 197, 11821 What are the prime factors of 4556812097? 4201, 1084697 What are the prime factors of 133554659? 7, 19079237 List the prime factors of 2742966017. 11, 249360547 What are the prime factors of 47328551? 29, 1632019 List the prime factors of 6734198874. 2, 3, 13, 86335883 List the prime factors of 117900315. 3, 5, 13, 37, 419 What are the prime factors of 30540207? 3, 37, 73, 3769 List the prime factors of 1316857676. 2, 37, 8897687 What are the prime factors of 6799793263? 17, 12823, 31193 List the prime factors of 2775649. 2775649 What are the prime factors of 4529208520? 2, 5, 61, 1856233 List the prime factors of 310483174. 2, 9719, 15973 What are the prime factors of 1841022048? 2, 3, 31, 71, 8713 What are the prime factors of 2061119588? 2, 11, 2909, 16103 List the prime factors of 2084483402. 2, 29, 1123, 32003 List the prime factors of 7869810551. 7869810551 List the prime factors of 162605951. 162605951 What are the prime factors of 74490828? 2, 3, 6207569 List the prime factors of 108375786. 2, 3, 2006959 List the prime factors of 74028454. 2, 2887, 12821 What are the prime factors of 226093430? 2, 5, 22609343 List the prime factors of 391979614. 2, 13, 19, 67, 911 What are the prime factors of 737540588? 2, 184385147 List the prime factors of 6613058988. 2, 3, 37, 653, 7603 What are the prime factors of 433009968? 2, 3, 59, 152899 What are the prime factors of 16663779? 3, 11, 19, 2953 List the prime factors of 40121995. 5, 8024399 List the prime factors of 939221881. 13, 72247837 List the prime factors of 49563151. 11, 4505741 List the prime factors of 407810481. 3, 13, 10456679 List the prime factors of 676283483. 4523, 149521 What are the prime factors of 20187280? 2, 5, 252341 What are the prime factors of 5660619246? 2, 3, 314478847 List the prime factors of 3188228877. 3, 118082551 List the prime factors of 253511941. 253511941 List the prime factors of 201438347. 11, 23, 199, 4001 What are the prime factors of 643740000? 2, 3, 5, 10729 What are the prime factors of 260796177? 3, 151, 191903 List the prime factors of 227229216. 2, 3, 41, 57731 What are the prime factors of 2449970028? 2, 3, 11, 17, 23, 15823 List the prime factors of 254528023. 1993, 127711 What are the prime factors of 4354827497? 1031, 1999, 2113 What are the prime factors of 42053407? 11, 23, 166219 What are the prime factors of 67464206? 2, 139, 242677 What are the prime factors of 94452981? 3, 7, 4497761 What are the prime factors of 36789390? 2, 3, 5, 11, 4129 What are the prime factors of 5435525? 5, 217421 What are the prime factors of 41087290? 2, 5, 2027 List the prime factors of 538061734. 2, 7, 47, 817723 List the prime factors of 94543128. 2, 3, 421, 3119 List the prime factors of 133655818. 2, 31, 41, 52579 List the prime factors of 165231281. 165231281 What are the prime factors of 31549823? 19, 1660517 List the prime factors of 4846941279. 3, 22433, 24007 What are the prime factors of 124309934? 2, 7, 8879281 List the prime factors of 351606192. 2, 3, 7, 1046447 What are the prime factors of 138303874? 2, 17, 503, 8087 What are the prime factors of 444953015? 5, 13, 223, 30697 List the prime factors of 34284565. 5, 7, 19991 List the prime factors of 1372033026. 2, 3, 7, 13, 39887 List the prime factors of 6444428. 2, 17, 94771 What are the prime factors of 2202884072? 2, 17, 103, 157259 List the prime factors of 861488921. 861488921 List the prime factors of 337277987. 19, 197, 251, 359 What are the prime factors of 372346061? 372346061 List the prime factors of 124162624. 2, 1940041 List the prime factors of 9624182. 2, 83, 57977 List the prime factors of 4030884402. 2, 3, 671814067 List the prime factors of 391008858. 2, 3, 65168143 What are the prime factors of 492882042? 2, 3, 23, 3571609 What are the prime factors of 157827829? 37, 4265617 List the prime factors of 27788321. 11, 2526211 What are the prime factors of 562991843? 562991843 List the prime factors of 78665554. 2, 11, 3575707 What are the prime factors of 63050420? 2, 5, 103, 127, 241 What are the prime factors of 4844439061? 7, 11, 62914793 List the prime factors of 38315822. 2, 229, 269, 311 What are the prime factors of 1523510545? 5, 71, 191, 22469 List the prime factors of 120653698. 2, 11, 79, 6311 What are the prime factors of 194517415? 5, 67, 101, 5749 List the prime factors of 435216420. 2, 3, 5, 191, 12659 List the prime factors of 228174159. 3, 457, 166429 List the prime factors of 87500794. 2, 67, 652991 What are the prime factors of 872851234? 2, 157, 2779781 What are the prime factors of 1707646368? 2, 3, 73, 243671 What are the prime factors of 4257209659? 4937, 862307 List the prime factors of 101928402. 2, 3, 1887563 List the prime factors of 943008138. 2, 3, 29, 163, 11083 List the prime factors of 1446768397. 1446768397 List the prime factors of 28908534. 2, 3, 17, 29, 337 What are the prime factors of 260770654? 2, 130385327 What are the prime factors of 476390178? 2, 3, 11, 881, 2731 What are the prime factors of 57239389? 57239389 List the prime factors of 59853824. 2, 58451 What are the prime factors of 573627661? 573627661 What are the prime factors of 1752277689? 3, 107, 1819603 List the prime factors of 22638456. 2, 3, 314423 What are the prime factors of 1133784482? 2, 83, 6830027 List the prime factors of 432751026. 2, 3, 23, 3135877 List the prime factors of 59834371. 31, 43, 44887 List the prime factors of 676908560. 2, 5, 31, 73, 3739 What are the prime factors of 124395583? 13, 397, 24103 List the prime factors of 877062280. 2, 5, 283, 77479 List the prime factors of 718266139. 19, 37803481 List the prime factors of 12269985. 3, 5, 7, 13, 89, 101 List the prime factors of 4629393. 3, 19051 What are the prime factors of 1760585960? 2, 5, 7, 17, 59, 6269 What are the prime factors of 1721876? 2, 13, 33113 What are the prime factors of 353665759? 29, 12195371 List the prime factors of 154390977. 3, 13, 571, 2311 List the prime factors of 54365513. 54365513 List the prime factors of 14945890. 2, 5, 17, 87917 List the	{ "pile_set_name": "DM Mathematics" }
r) = 35 - 66 + 2r + 109 + 108. Calculate the remainder when n(3) is divided by 44. 16 Suppose 29u + 18 = 35u. Suppose 122 = 3d + 5i, -d - ui = -27 - 19. Calculate the remainder when 336 is divided by d. 30 Suppose -26a = -10a - 64. Suppose -g - 3 - a = -i, -4g - 1 = 5i. What is the remainder when 27 is divided by i? 0 Suppose 5t + 3s = -2s + 30, 18 = 3t - s. Suppose t = 3x - 21. What is the remainder when 78 is divided by x? 6 Suppose -4m - 4q = 52, -5m - 65 = -0m - 2q. Let x = 76 - m. Let j = x - 54. Calculate the remainder when j is divided by 18. 17 Let i(o) = -16o. Let s = -36 - -6. What is the remainder when i(-4) is divided by 35 - ((-4)/30 + (-64)/s)? 31 Suppose 3u + 5z - 409 = 0, z - 21 = u - 144. Let r = 13474 + -13409. What is the remainder when u is divided by r? 63 Let g = 1562 - 756. What is the remainder when g is divided by 159? 11 Let o(c) = -263c + 803. What is the remainder when 5162 is divided by o(3)? 10 Suppose -5d - 205 = 365. Let t = 63 + d. Let x = t - -102. What is the remainder when 150 is divided by x? 48 Let j(r) = -r3 - 4r*2 + 5r + 3. Let p be j(-5). Calculate the remainder when (2/p)/(2/111) is divided by (-19)/(-9)315/5. 18 Suppose -21t + 17t = -96. Let u(s) = 6s - 25. Let o be u(8). Suppose -oi + 1120 = -7i. What is the remainder when i is divided by t? 22 Let w(t) = 193t - 5014. Calculate the remainder when 2598 is divided by w(26). 2 Suppose 4u = 18 + 82. Let c(q) = q2 - 2q - 32. Calculate the remainder when u is divided by c(-5). 1 Let v(f) = -f*2 + 6f - 1. Let g be v(4). Let j(p) = -2p + 64. Let w be j(19). Let s = w - g. What is the remainder when s is divided by 11? 8 What is the remainder when (-435)/40 + 11 - (-169336)/64 is divided by 4? 2 Suppose 0 = 2x - 26i + 24i - 948, 0 = 4x - i - 1905. Calculate the remainder when x is divided by 21. 15 Let t(u) = 4u*2 + 2u - 2. Suppose 4c - 50 = -k, -3k + c = -100 - 37. Let v = 170 - k. What is the remainder when v is divided by t(2)? 16 What is the remainder when 578 is divided by -4 - (-159 - 24/(2 + -8))? 125 Let i(d) = 55 - 11d3 + 0d*2 - 2d*2 - 54. Let p be i(1). Let g = 16 - p. Calculate the remainder when 80 is divided by g. 24 Let u be (-10)/(-4)-512/30. Calculate the remainder when 36/45(-32)/2u is divided by 13. 12 Let h = 44 - 41. Let x be (h/2(-9 - -3))/(-1). Suppose 0 = 8z - xz + 42. Calculate the remainder when z is divided by 15. 12 Calculate the remainder when 3464 + 306/(-32 + 14) is divided by 23. 20 Let y = 58 + 110. Let w = y + -30. Calculate the remainder when w is divided by 35. 33 Let g(z) = 90z - 55. Let o(u) = -u2 - 87u + 56. Let v(i) = 3g(i) + 2o(i). Calculate the remainder when 131 is divided by v(47). 8 Let j(n) = 135n2 + 909n - 1823. Calculate the remainder when j(2) is divided by 252. 31 Suppose 40t - 455 + 1495 = 0. Let k = 577 - t. What is the remainder when k is divided by 55? 53 Let j(c) = -19c*2 - 37c + 1316. Let u = -3 + 64. Calculate the remainder when j(-9) is divided by u. 49 Suppose -4a = i - 9a - 145, -3i + 5a + 405 = 0. Let l = 189 - 145. Calculate the remainder when i is divided by l. 42 Suppose 89t = 101t - 9348. Calculate the remainder when t is divided by 36. 23 Calculate the remainder when 1697 is divided by ((-72)/15)/((-11)/4 + (-6206)/(-2320)). 33 Let a = 18336 - 18184. What is the remainder when a is divided by 32? 24 Suppose -v = -4c - 9 - 11, -2c - 82 = -5v. What is the remainder when 441 is divided by v? 9 Let q = -1426 + 1887. Calculate the remainder when q is divided by 31. 27 Let f = 1080 - 129. Calculate the remainder when f is divided by 4. 3 Let p be (56/(-10))/((-4)/20). Suppose 50 + 10 = 2s - k, -k - p = -s. Let x = -809 + 816. What is the remainder when s is divided by x? 4 Suppose 3i = 0, -18i = -4k - 23i + 2616. Let z = -623 + k. Let d(h) = h*2 + h - 1. Calculate the remainder when z is divided by d(-3). 1 Let f(r) = -41r - 381. What is the remainder when f(-18) is divided by 122? 113 Let h be 244/6 + 112/48. Suppose -hf = -63f + 160. Calculate the remainder when f is divided by 4. 0 Let u(z) = 3z + 101. Suppose -4x = 2q - 82, -q - 13 = -2x + x. Calculate the remainder when u(x) is divided by 12. 11 Suppose -26g = -24g + 1204. Let v(h) = h*2 - 3h - 2. What is the remainder when (-145)/(-11) + (-8 - g/77) is divided by v(4)? 1 Calculate the remainder when (-1)/(2 + -1)(-13)/(78/15732) is divided by 25. 22 Suppose -n + 81 = 2n + p, n = -5p + 13. Suppose 38 - 178 = 2y. Let q = y + 264. What is the remainder when q is divided by n? 26 Suppose -315a - 4606 = -202a - 162a. Calculate the remainder when 19081 is divided by a. 93 Suppose -106j + 29546 = -89j. What is the remainder when j is divided by 37? 36 Suppose -43573 = -178k - 17469 + 26050. Calculate the remainder when 1122 is divided by k. 243 What is the remainder when -2(-66 + (-20 - -10)) is divided by 40? 32 Let t = 46 - 14. Suppose 12y + 3p = 13y - 292, -3y - 3p = -852. What is the remainder when y is divided by t? 30 Let u(a) = -99a. Let p = -98 + 105. Suppose 90 = 2b + pb. Calculate the remainder when u(-1) is divided by b. 9 Let m = 15341 - 15315. What is the remainder when 1684 is divided by m? 20 Suppose o + 3 = -0. Let w be 1512/o. Calculate the remainder when 50 is divided by 2/(-5) + (-134)/w. 11 Let t(u) = 4u*2 + 17u + 69. Calculate the remainder when t(-12) is divided by 113. 102 Let x(t) = -t*2 + 392t - 2296. What is the remainder when (52/(-6))/(4/(-18)) is divided by x(6)? 19 Suppose v - 3p = 268, -6p + 1147 = 4v - 3p. Suppose 6r = 119 + v. What is the remainder when r is divided by 20? 7 Let r(t) = 62t*2 + 4t + 5. Let w = 347 - 260. Let u = w - 25. What is the remainder when r(-2) is divided by u? 59 Suppose 2u = 3t + 74 - 386, -5t - 2u + 520 = 0. Calculate the remainder when t is divided by 62. 42 Suppose 1074 = 131q - 128q. Calculate the remainder when q is divided by 46. 36 Suppose 4h + 16 = 0, 2v - 4h = 9 + 9. Suppose 0 = 7n + 34 + v. Calculate the remainder when (-4 + (-76)/n)5 is divided by 16. 8 Let d = 15317 + -15218. Calculate the remainder when d is divided by 30. 9 Let w = -1786 + 1802. Calculate the remainder when 28 is divided by w. 12 Suppose 24 - 9 = s. Let p = 539 + -362. Calculate the remainder when p is divided by s. 12 Suppose -41j + 7j = 10547 - 95343. What is the remainder when j is divided by 104? 102 Let f = 1617 + -1085. Calculate the remainder when f is divided by 181. 170 Suppose -3r = -10 + 1. Suppose -rd = p - 134, 0d + 5p = -d + 54. Calculate the remainder when d is divided by -2 + (8 - 3) - -12. 14 Let y = 457 - 424. What is the remainder when 8018 is divided by y? 32 Suppose -445 = -12c - 157. Calculate the remainder when 279 is divided by c. 15 Suppose 4f = -5r + 50, 3f = -45r + 49r + 22. Calculate the remainder when 1472 is divided by f. 2 Suppose 0 = 88775o - 88784o + 423. Calculate the remainder when 356 is divided by o. 27 Calculate the remainder when 66 is divided by 20/5 - (-10)/(-110)11. 0 Suppose -46h + 984 + 948 = 0. What is the remainder when 399 + ((-10)/6 - h/(-63)) is divided by 80? 78 Let j be (16/(12/3))/(4/16). What is the remainder when j/9 + -2 - (-11862)/162 is divided by 26? 21 Suppose 4b - b = 39. Let p = b - 66. Let m = -43 - p. Calculate the remainder when 49 is divided by m. 9 Let w be (0 - 1/2)-98. Suppose -44a = -wa + 275. Let i = a + -22. What is the remainder when i is divided by 9? 6 Suppose 0 = 55q - 59q + 20. Suppose b - 95 - 194 = 3n, -b + 321 = qn. Calculate the remainder when b is divided by 16. 13 Suppose 40u + 250 = 44u - 5m, -u + 4m = -79. Calculate the remainder when 786 is divided by u. 16 Suppose -2w = -0w - 136. Suppose -5f - 7k = -1341, 1975 - 1698 = f - 3k. Calculate the remainder when f is divided by w. 67 Suppose 5b + 17b = 30b - 16152. What is the remainder when b is divided by 44? 39 Suppose 140 = -0v + 2v. Suppose r - 82 = v. What is the remainder when r is divided by ((-1)/(-2)-17)/((-16)/32)? 16 Let d = 41 + -20. Let w(t) = 15*t - 12. Let u be w(0). What is the remainder when ((-1)/(8/(-52)))/((-2)/u) is divided by d? 18 Let d = 6841 - 6759. Calculate the rem	{ "pile_set_name": "DM Mathematics" }
is v rounded to one dp? -6 Let u = -2.5 - -4.5. Let t = u + -1.902. Let d = 0.09799995 - t. Round d to 7 decimal places. -0.0000001 Let k = -4849.259 - -4879.3. What is k rounded to the nearest ten? 30 Let n = 44.779992861 + -44.78. Round n to six decimal places. -0.000007 Let y(h) = -39570h - 10. Let r(q) = q + 20. Let i = -38 + 25. Let t be r(i). Let c be y(t). What is c rounded to the nearest 10000? -280000 Let s(f) = -2f - 5. Let y be s(-9). Let b be ((-31986)/39)/1 - (-2)/y. Let k be (12 - 312)/((-2)/b). Round k to the nearest ten thousand. -120000 Let q = -0.019 - -0.0464. Let h = -0.6924 + q. What is h rounded to one dp? -0.7 Let p = -146 + 89. Let q be 9(2020/170 + (-4)/(-34)). Let w = q + p. What is w rounded to the nearest 10? 50 Let o = -4.8563392 + 5.16634. Let w = 0.73 - 0.42. Let h = o - w. What is h rounded to 7 dps? 0.0000008 Let r = 1997.998761 + -1998. Round r to four decimal places. -0.0012 Let u = 27.2 - -660. Let h = u + -633. Let z = -46 + h. What is z rounded to the nearest integer? 8 Let n = -584.1 + 584.01442. What is n rounded to 2 decimal places? -0.09 Let k = -469 - -1301. Let o = -809.65 + k. Let g = -22 + o. What is g rounded to 1 dp? 0.4 Let i(z) = 3658z*2 + 7z - 1. Let d be i(-5). Suppose 0 = 15h - 54386 - d. Round h to the nearest one hundred. 9700 Suppose 82w = -75w + 785157. Round w to the nearest one hundred. 5000 Let z = -817.312957 - 5.775243. Let h = 823 + z. Round h to 3 dps. -0.088 Let y = -4868 - 6502. Let g = 2770 + y. Round g to the nearest 10000. -10000 Let o = 1248 + -2066. Let i = o + 392. Let p = -426.251 - i. What is p rounded to 2 decimal places? -0.25 Let q = 3103 - 3103.000000368. Round q to 7 decimal places. -0.0000004 Suppose -63b = -13b - 1708000. What is b rounded to the nearest one thousand? 34000 Let q = -65 - -111. Let n = -126 + q. Round n to the nearest one thousand. 0 Let w = -7598364.235 - -7631685.69523. Let v = w + -33321. Let u = v - 0.46. Round u to five dps. 0.00023 Suppose -2i - 5t + 590100020 = 0, -4t + 484126822 + 991123194 = 5i. Round i to the nearest 1000000. 295000000 Let s = 1.72 + 7.93. Let a = 10.111 - s. What is a rounded to 1 decimal place? 0.5 Let c = 11302 + -11302.05111. What is c rounded to three decimal places? -0.051 Let o = -0.51 - -102.51. Let l = 70 - o. Let z = 31.933 + l. Round z to 2 dps. -0.07 Let z = -223.33593 - -344.62172. Let u = 121.3 - z. Round u to 3 dps. 0.014 Let i = 15544.022491 + -15544. What is i rounded to 4 dps? 0.0225 Let q(d) = -7d + 644. Let p be q(0). Let y be (2 + -1 - 6)p/(-230). Suppose 0 = 5i - s - 2694, -i + 534 = -19s + ys. What is i rounded to the nearest 10? 540 Let b = 17969.6320057 + -17968.612. Let g = b - 1.02. Round g to 5 decimal places. 0.00001 Let t = -8.07498754 + 8.075. What is t rounded to 7 decimal places? 0.0000125 Let k = -1437 - -1440.574. What is k rounded to 1 decimal place? 3.6 Suppose x - 113434 = -g, -6 = -3x + x. Suppose 0 = -j - g - 3081519. Let f = j - -5454950. What is f rounded to the nearest one hundred thousand? 2300000 Let s = -0.1614 - 0.0332. Let p = -0.8964 + s. Let z = p - -0.061. What is z rounded to 1 dp? -1 Let p = -17596 - -17596.0024905. What is p rounded to 4 dps? 0.0025 Let n = 17288776331284411.00000082 - 17288776599266107. Let d = -267981691 - n. Let q = 5 - d. Round q to 7 decimal places. 0.0000008 Let b(o) = o2 - o + 2. Let q be b(1). Suppose t - q = h, 16 = 2t + 4h - 0. Suppose -5g - 2k = -16 - 344, -tk + 276 = 4g. Round g to the nearest 10. 70 Let j(l) = 16679l*2 + 110l - 2201. Let u be j(43). Round u to the nearest one hundred thousand. 30800000 Let l be (-6951)/(-2)((-11336)/(-56) + -31). Round l to the nearest one hundred thousand. 600000 Let h = -16006 - -44366. Suppose -2r - 2u = h, 5r - 3u = -24410 - 46490. What is r rounded to the nearest ten thousand? -10000 Let q(s) = -8984s*3 - 16s*2 + 12s - 14. Let w be q(2). Round w to the nearest 100. -71900 Suppose 0 = -30k - 11463 + 535143. Let h = -138156 + k. What is h rounded to the nearest ten thousand? -120000 Let m = 29137.944567 - 29138. What is m rounded to three decimal places? -0.055 Let v = 1837246 - 1837254.91117. Let d = v - -0.00517. Let l = 0.106 + d. What is l rounded to zero decimal places? -9 Let a be 1/2(5 - -61277). Suppose 0 = 3i - 0i - 2971923. Suppose -4t - i = -a. What is t rounded to the nearest 10000? -240000 Let b = -9691220230 - -9691220280.99999997. Let p = -51 + b. Round p to 7 dps. 0 Let t = 870.7 - 870.69994648. What is t rounded to 6 decimal places? 0.000054 Let p = -40460 - -40561.908. Let l = -102 + p. Let t = 0.092000365 + l. What is t rounded to seven decimal places? 0.0000004 Let z = -33 + 55. Let i = z + -82. Let y = i - -59.99878. Round y to 4 decimal places. -0.0012 Let p = 0.23467 + -0.234684846. What is p rounded to 6 decimal places? -0.000015 Let a = -0.0356 + 0.03548636. What is a rounded to 6 decimal places? -0.000114 Suppose -11i - 86955600 = -244i. What is i rounded to the nearest one thousand? 373000 Let y = 4.60718447 + -4.607. Round y to six decimal places. 0.000184 Suppose -n = 3i - 24, -i = -0i + 3. Suppose n = -3f + f + 5t, 16 = f + 4t. Let u be 2499997 + f + 2 + 5. Round u to the nearest 1000000. 3000000 Suppose -14026023 - 9282129 = -21b. Let n = b + -651912. What is n rounded to the nearest 10000? 460000 Let k = -69927.66124 - -69926. Let t = 0.21414 + k. Let x = t + 1.44. Round x to 3 dps. -0.007 Let f = 0.4246 + -0.4228005. Round f to 5 dps. 0.0018 Suppose 148b = 147b + 34302 - 5554. Round b to the nearest 1000. 29000 Let z = 82527286 + -82527286.146082422. Let a = -36.146098922 - z. Let f = -36 - a. What is f rounded to six decimal places? 0.000017 Let n = 2.816866084 - 2.8169. What is n rounded to 6 decimal places? -0.000034 Let u = 1138 + -1070.52. Let n = u - -3.72. Let q = 71.2000311 - n. Round q to six decimal places. 0.000031 Suppose -23l + 20440000000 = 72l + 185l. Round l to the nearest 1000000. 73000000 Let x = 0 + 1. Let f be x + 50 + (-1 - 1). Suppose -fo = -42o - 49000000. Round o to the nearest 1000000. 7000000 Let n(s) = 2662s2 + 3s - 8. Let k(z) = -2663z2 - 4z + 8. Let h(w) = -6k(w) - 7n(w). Let y be h(-8). Round y to the nearest ten thousand. -170000 Let d = -5.245142 + 5.42514121. Let z = 3.82 - 4. Let p = z + d. Round p to 7 decimal places. -0.0000008 Let n = -250.193 - -251.9. Let t = 0.007 - n. Let a = -10 + t. Round a to 0 dps. -12 Let i = 0.002 - 4.902. Let y = -0.06288 - 4.73712. Let f = i + y. What is f rounded to zero decimal places? -10 Let p be (-1496876)/(-72) + 8/144. Suppose -209c = -212c + p. Round c to the nearest 1000. 7000 Let i = -2146833 + 2146863.30167. Let n = i + -30.3. Round n to three decimal places. 0.002 Let w = -220.033 - -220. Let i = -0.02705 - w. What is i rounded to three decimal places? 0.006 Let t = 28.586197 - -0.228003. Round t to one dp. 28.8 Let i = 23370.000088675 + -23370. What is i rounded to 7 dps? 0.0000887 Let x = -53.073 + 34.0786. Let b = -2.1 - 16.9. Let v = x - b. Round v to 3 decimal places. 0.006 Suppose 5r = -3x + 6237925, -173r = 5x - 177r - 10396480. Round x to the nearest 100000. 2100000 Let v = 37170.9999936307 + -37171. What is v rounded to 6 decimal places? -0.000006 Suppose -2029k - 1275517 = -2034k + 1051283. What is k rounded to the nearest 1000? 465000 Let l = -1998.4 + 2633. Let s = 565 - l. Round s to the nearest ten. -70 Let n(f) = -104480f*3 + 8f - 8. Let d be n(1). What is d rounded to the nearest 10000? -100000 Suppose h + p = -0p - 9, -p = 2. Let w(t) = 4373t*3 + 5t - 26. Let c be w(h). What is c rounded to the nearest 100000? -1500000 Let d = -721.517 + 726.1. Round d to zero decimal places. 5 Suppose 2c + 192962 = -2k, -21c + 20c = -5k - 482393. Round k to the nearest 10000. -100000 Let u = -0.0355 - 0.08616. Round u to two decimal places. -0.12 Suppose 24x - 45 = 9*x. Let k be 6359998/x + (60/18)/5. What is k rounded to the nearest one hundred thousand? 2100000 Let o = 174.6 + -159. Let g = o - 9. Round g to the nearest ten. 10 Let u = -16602978 + 33842978. What is u rounded to the nearest 100000? 17200000 Let p = 31.3 - 31.3521. Let w = p + -129.4479. What is w rounded to the nearest 10? -130	{ "pile_set_name": "DM Mathematics" }
d Let n be (3/(-7) - (-450)/70) + -2. Let z be n/(-18) + 35/441. What is the closest to -0.05 in z, -5, -3, -2/17? -2/17 Let r = -1.025 + 1.225. What is the nearest to 1 in 3, r, 149? r Let l = -0.9 - -0.88. Let h = -89.3 - -89. Suppose 6t = 4t - 4. Which is the closest to t? (a) h (b) -4/7 (c) l b Let k = 7727 + -7732. Let t = 0.09 - 0.59. Let b = -0.1 + -0.9. What is the nearest to b in k, t, -1? -1 Let x = 10015 + -10011. Which is the nearest to 0.157? (a) 1/8 (b) -0.5 (c) x a Let b = 3006 - 3006. What is the closest to 2 in 2/3, b, 76, -1/4? 2/3 Let k = 104 - -49. Let d = 174.9 - k. Let q = d + -22. Which is the closest to q? (a) -0.05 (b) 1/6 (c) -2 a Let w = -9331 + 9330. Which is the closest to 1/4? (a) 57 (b) w (c) -0.3 c Suppose 0 = 84h + 106 + 146. What is the nearest to -15 in -5, 2/9, 2, h? -5 Let s be 2/2(-2)/(-3). Let g = -512.24 + 512.54. Which is the nearest to 4? (a) s (b) -1 (c) g a Suppose 18 = 266g - 248g. What is the closest to -0.1 in g, 363, 4? g Let j = 3899 + -3421. Which is the closest to 1? (a) 4/3 (b) j (c) -3 a Let i = 47146/5 - 9430. Suppose 5m = -2u - 2u - 10, 2u + 5m = -10. Let p = 0.1 + 0.1. What is the nearest to 0 in p, i, u? u Let m = 3639 - 3638. Which is the nearest to -13? (a) m (b) 2/5 (c) 1/2 b Let u(q) = q2 + q - 10. Let v be u(-6). Let j be 2/30(v - 15). Which is the closest to j? (a) -0.03 (b) 1 (c) 17 a Let h = 37 + -36.97. Let w = h - 0.13. What is the nearest to w in 1, -5, 1/4? 1/4 Let c = 44/3 - 14. Let r(o) = -o*2 - 11o - 6. Let i be r(-10). Suppose -z = b + 2z - 12, -ib + 24 = 4z. What is the closest to c in -4, 1/4, b? 1/4 Let y = -143.948 - -3.048. Let w = -141 - y. What is the closest to 2/7 in 0, -2, w? 0 Let l be (2/(5 - 4))/(49 + -50). What is the closest to l in 1, 2/3, -2/9, -13? -2/9 Suppose 29w + 2201 = 2143. Which is the closest to -2/93? (a) 0.5 (b) -18 (c) w (d) 2/3 a Let r be (-19)/7672/351. What is the closest to r in 3/5, -5, 3? 3/5 Suppose 5s + u + u + 59 = 0, 0 = 5s + u + 62. Suppose -21 = -395p + 374p. Which is the closest to -2/5? (a) p (b) 4 (c) s a Let j = -15211 + 15211.2. Which is the closest to -98? (a) 0 (b) -2 (c) -0.3 (d) j b Let r be (1166/(-5610))/((-4)/(-3)). Let n = -3/68 + r. Which is the closest to 0? (a) 4 (b) n (c) 0.4 b Let g = -0.31 - 67.69. Let o = 66 + g. Let j = 0.33 - 0.03. What is the closest to o in j, 0.5, 0.1? 0.1 Let w = -6352 + 298547/47. What is the nearest to 15 in 0, w, -4? w Suppose 25y - 15 = 20y. Suppose -5c + 8 = yu, -c + 3u = u + 1. What is the closest to c in -4, -0.07, -0.5? -0.07 Let k be 7/(21/2) + 2168/(-4878). Suppose o - 3 - 4 = 0. Which is the closest to o? (a) 0.2 (b) k (c) 0.3 (d) 0 c Let j = 27143 - 27142.9. Which is the nearest to 1? (a) j (b) -9 (c) 4 (d) -266 a Let g = -2/23 - 17/69. Let i be -9 + 357/(-35)10/(-12). Which is the nearest to 0? (a) 0 (b) i (c) g (d) -6 a Let w = -126 - -45. Let t = w + 83. Let z = -2 + -2. Which is the closest to 2? (a) t (b) z (c) -5 a Let w be (18/(-30))/((-1)/(-165)). Let p be 66/w6/(-14). Which is the closest to 4? (a) -0.5 (b) -0.4 (c) p c Let z = -5/1683 - -311/1683. Which is the closest to -0.1? (a) 2/3 (b) -2 (c) z (d) 3/13 c Let q(h) = h*2 + 4h - 24. Let d be q(-8). Let i be (40/32)/(20/d). What is the closest to 0 in -3, i, 3/2? i Let a be ((-6)/(-28))/(6/8). Let h(j) = -119j - 949. Let s be h(-8). Let q be -8(-3)/24s. What is the closest to a in 1/2, 0.03, q? 1/2 Let l = 6 + -4. Let m = l + 0. Let x = 4097 - 4097.3. What is the nearest to -2 in 1/4, m, x? x Let s = 298447/35 - 8527. Which is the closest to 0? (a) 26 (b) s (c) -5 b Let r = 157.47 - 157.27. What is the nearest to -0.01 in -2/25, -1/5, -1/4, r? -2/25 Let v = -5483 + 5405. Which is the nearest to -2/7? (a) 4 (b) 2 (c) 3 (d) v b Let o be 4/(-9)2/(-8). Let v be (-4)/(-3)8/(-16). Suppose 3i + 24 = -3w, 16 = 3w + 6i - 11i. Which is the nearest to -1/4? (a) v (b) o (c) w b Let i be -16 + 2 + (-1122)/(-85). What is the closest to 11 in -2, 0.3, -5, i? 0.3 Let u = 0.221 - 0.421. Let x be (-1344)/256 - -16. Let g = 0.1 + 0.4. Which is the nearest to u? (a) 4 (b) x (c) g c Let u = 11/538 - 895/4304. Which is the closest to 0? (a) u (b) -1 (c) -0.04 c Let x(r) = -325r + 11. Let z be x(-1). Let q be (-272)/z + 2/14. Which is the closest to q? (a) -5 (b) 3 (c) 4 b Let h = -28937/48245 + -2/9649. What is the nearest to 13 in -3/2, -0.1, h? -0.1 Let j = -9974/9 + 1108. What is the closest to 4 in 1, 0.4, -0.9, j? 1 Let g be (3/2)/(9 - 15). Let x be ((-5)/(90/(-16)))/((-240)/(-180)). Which is the closest to g? (a) x (b) -3 (c) 5 a Let j = -0.02 - -0.08. Let m = -196.055 - -194.055. Let u = 0.9 - 1. Which is the closest to u? (a) j (b) m (c) 1 a Let v(m) = -m*3 + 23m*2 - 23m + 26. Let r be 25 - ((-1 - 20/5) + 8). Let k be v(r). What is the nearest to 0 in k, 0.1, 4/27? 0.1 Suppose 3p + 1 = 2r - 17, 2p = -3r + 1. Let k be (-1 - 1)/(1/(-2)) - 1056/288. What is the nearest to k in 2, 12, r? 2 Let i = 3694 - 14597/4. Let p = -44 + i. Let s be -1 + ((-3)/(-6) - 0). What is the nearest to s in -0.2, -3, p? -0.2 Let x = 25/84 - 137/84. Let y = 873/13 - 67. Which is the nearest to 0.21? (a) x (b) 0 (c) y c Let q = 21094 + -21071. What is the closest to 30 in 2/15, q, -1, -4? q Let z = -6 - -5.94. Let k = 279/1108 - 1/554. Which is the nearest to z? (a) -0.2 (b) k (c) -0.1 c Let d = 0.58 - 0.567. Let v = d + 0.287. Let r = 106/7 - 332/21. Which is the closest to 1? (a) v (b) r (c) -3/4 a Let t = 54131 + -54157. Let n = 1.9 - 2. Which is the nearest to 0.1? (a) n (b) -1/7 (c) t (d) 3 a Suppose 365i = 370i - 5d - 45, 35 = -5d. Let r = -1.8 + 1.1. Let j = r + 7.7. Which is the nearest to i? (a) j (b) 2 (c) 4/5 b Let y = -0.293 + -0.197. Let u = y - -0.49. Let o = -29/3 + 139/15. Which is the nearest to -16? (a) 4/7 (b) u (c) o c Let z = 2692.9 + -2692. Which is the closest to 1/4? (a) -7 (b) 12 (c) z c Let f = 2209 + -2208.4899. Let n = -0.0101 + f. What is the closest to -0.1 in n, 23, 2/13, -3? 2/13 Let d = -9690 - -9687. What is the closest to d in 2, 4, 2.5? 2 Suppose -15 = -y + 5x + 21, -4y + 93 = -3x. What is the closest to 5 in y, -0.4, 0.1, -1? 0.1 Let b = -1485.9 + 1490.9. What is the nearest to 0 in b, 2/3, -41/3? 2/3 Let r = 0.54 + 59.46. Let m = r + -60.05. Let n = m + -0.03. Which is the closest to -1? (a) 2 (b) -2 (c) n c Let t = 10733/49 - 219. Let k = 116/441 - t. Which is the closest to -5? (a) -0.1 (b) 4/5 (c) k a Let k = 68 - 164. Let t = -98 - k. Let x = -1 - t. Which is the closest to 1? (a) 4 (b) -4 (c) x c Let p = 0.084 - -238.916. Let y = -233 + p. Which is the closest to 1? (a) 0.5 (b) y (c) -2 a Suppose -186 = -27h + 58h. Let t be 1/h - 5/(-4 + -26). What is the nearest to 0 in -2/15, 0.5, t, -5? t Let h = 3.598 - -0.982. Let d = 8.58 - h. Let u = 0.3 + -0.1. Which is the closest to 2/9? (a) d (b) u (c) -3 b Let d = 144.0388 - 144. Let n = -38.1388 + d. Let p = 38 + n. What is the nearest to -1 in -1/6, -5, p? -1/6 Suppose 115n - 5952 - 19948 = -33n. What is the nearest to n in 0.16, 6/7, -1/7? 6/7 Let l = 3353.8 + -3344.8. Let j(h) = h - 2. Let d be j(2). What is the closest to -1/3 in 2, d, l, -1? d Let j be (1 - 15) + -6 + 11. What is the nearest to 1 in j, -0.4, -4? -0.4 Let r = 147.8 + -148. Let q = -7/6 - -2/3. Let w = 0.693 + 0.307. Which is the closest to w? (a) 1 (b) r (c) q a Let q = 39299 + -61313. What is the closest to -1/3 in q, 0, -4? 0 Let k = 107059 - 107061. Let s = -12 + 64/5. What is the closest to -1/2 in k, -0.5, s, -2/5? -0.5 Let w be (-19)/(190/20) + (3 - 465/468). What is the nearest to -4/11 in w, -0.1, -0.4? -0.4 Let a = -498287 + 498290. Let s = 0.3 + -0.2. What is the nearest to a in -0.1, -1, s? s Let r = 24 + -24. Let v = 0.236 + 3.764. Which is the nearest to -1/14? (a) r (b) v (c) -3 a Let l be 5/(-2)2 - (-3934)/14. Suppose 4t = -t - 2j - l, -t = -4j + 64. Which is the closest to 1/2? (a) 0.4 (b) 5/6 (c) t a Let q be ((-48)/(-8) + -1)/((-15)/(-36)). Suppose q = 11l + l. Which is the closest to l? (a) -1/3 (b) 3 (c) 0.1 (d) -0.5 c Let t = 15/742 + -1859/18550. Which is the closest to	{ "pile_set_name": "DM Mathematics" }
). -74 Let k(y) = 3y2 + 56y - 16. What is k(-19)? 3 Let b(y) = y*3 + 2y*2 - 10y - 51. Give b(4). 5 Let f(i) = -240i2 - 699i + 5. Calculate f(-3). -58 Let r(a) = -a*3 - 13a*2 + 1679a - 36. What is r(-48)? 12 Let u(s) = s + 72. Give u(10). 82 Let k(o) = -o*2 + 91o + 3040. What is k(-26)? -2 Let a(g) = g*2 - 14g + 40. Give a(3). 7 Let w(f) = -56f2 + 9f + 1. What is w(-1)? -64 Let x(c) = 3c3 - 62c*2 + 88c + 121. Give x(19). -12 Let s(v) = -161v - 2083. Give s(-13). 10 Let f(t) = 27t + 1070. What is f(-38)? 44 Let k(g) = -g*3 - 19g*2 + 79g + 1712. Give k(-19). 211 Let l(r) = -r*3 - 95r*2 - 2051r - 319. Give l(-62). -9 Let d(h) = -4h2 + 171h + 347. Give d(-2). -11 Let l(r) = 331r + 1667. Calculate l(-5). 12 Let y(q) = 37917q + 75835. Determine y(-2). 1 Let y(s) = -s - 89. Determine y(8). -97 Let j(w) = w*2 - 38w + 123. What is j(35)? 18 Let b(v) = -5v2 - 34v + 21. What is b(-10)? -139 Let b(d) = -d*2 + 82d + 856. Determine b(-9). 37 Let m(y) = 392y - 5499. Give m(14). -11 Let g(a) = -a3 + 10a*2 + 157a + 112. Calculate g(-8). 8 Let v(r) = 6r3 - 343r*2 + 56r + 52. What is v(57)? -5 Let o(z) = -2z2 - 110z - 25. Give o(-54). 83 Let w(j) = -27j + 131. Calculate w(4). 23 Let c(g) = 81g - 281. Give c(4). 43 Let g(x) = -11x + 73. What is g(4)? 29 Let m(b) = 6b*2 - 2543b - 5077. Calculate m(-2). 33 Let j(f) = -23f2 - 3f - 7. Calculate j(5). -597 Let t(o) = -o*2 - 81o + 7. Give t(0). 7 Let g(f) = f*2 - 45f + 219. Calculate g(40). 19 Let w(r) = -492r + 4182. What is w(9)? -246 Let y(l) = -4l*2 - 206l + 324. Determine y(-53). 6 Let d(g) = g*2 + 471g + 20695. Determine d(-49). 17 Let j(k) = -k*3 + 7k*2 + 13k - 130. Give j(10). -300 Let d(k) = k*3 - 19k*2 + 60k - 196. Determine d(16). -4 Let c(o) = 6o3 + o2 + 4o - 7. Determine c(-3). -172 Let i(f) = 193f - 594. What is i(3)? -15 Let u(q) = -45q - 92. Give u(-5). 133 Let b(u) = u*3 - 34u*2 + 379u - 863. Determine b(3). -5 Let l(n) = n*2 + 740n - 19903. What is l(26)? 13 Let m(l) = 103l + 656. What is m(-6)? 38 Let v(t) = 2t*3 + 85t*2 - 230t - 235. What is v(-45)? -10 Let c(z) = 5z2 - 29z - 11. Give c(10). 199 Let b(k) = -k*2 + 37k - 313. Determine b(14). 9 Let v(t) = 144t + 1159. What is v(-8)? 7 Let r(s) = 27s - 241. Calculate r(9). 2 Let w(y) = 5y2 - 221y - 174. Determine w(43). -432 Let o(w) = 8w2 - 17w + 54. Give o(4). 114 Let y(m) = m*3 - 28m*2 - 10m - 608. Give y(29). -57 Let o(n) = -n*3 - 12n*2 + 5n - 34. Determine o(5). -434 Let l(b) = -b*2 - 167b + 12772. What is l(-224)? 4 Let b(d) = 2422d + 12099. Calculate b(-5). -11 Let w(f) = 45f*2 + 9f + 7. Calculate w(-1). 43 Let m(p) = 225p - 1614. What is m(7)? -39 Let o(j) = 116j + 146. What is o(-1)? 30 Let g(m) = 12m - 149. Calculate g(-18). -365 Let x(y) = -66y*3 + 7y*2 + 2y - 5. Calculate x(-1). 66 Let q(i) = 1008i - 4000. Give q(4). 32 Let i(r) = r3 + 110r*2 + 1003r + 293. What is i(-100)? -7 Let r(u) = u*3 - 38u*2 - 29u + 169. Give r(38). -933 Let v(u) = 1527u - 25967. Give v(17). -8 Let s(b) = -2b*3 + 130b*2 - 124b - 273. Determine s(64). -17 Let k(p) = -p*3 - 133p*2 + 399p - 1239. Determine k(-136). -15 Let u(a) = -1592a + 12723. Calculate u(8). -13 Let z(h) = -h3 + 8h*2 - 33h + 63. What is z(7)? -119 Let o(q) = q*3 - 18q*2 + 23q - 26. Give o(15). -356 Let k(h) = h*2 - 11h - 170. Give k(-7). -44 Let o(b) = 3b3 + 28b*2 + 174b + 688. Give o(-6). 4 Let z(d) = 37d2 - 68d + 3. Give z(2). 15 Let p(o) = -75o + 466. Determine p(6). 16 Let s(b) = -b3 + 27b*2 - 123b + 130. Determine s(21). 193 Let c(m) = -m*2 - 23m - 32. Calculate c(9). -320 Let c(l) = l*3 - 9l2 + l + 2. Determine c(9). 11 Let x(r) = r2 + 264r + 8184. Calculate x(-36). -24 Let q(d) = 38d - 373. Give q(17). 273 Let g(c) = c*2 + 56c - 251. What is g(4)? -11 Let k(i) = -10i - 356. What is k(-27)? -86 Let t(o) = -3o*2 + 26o + 25. Calculate t(10). -15 Let n(k) = 124k - 4094. What is n(33)? -2 Let g(k) = 4k*3 + 261k*2 + 64k - 101. What is g(-65)? -36 Let x(j) = -j*2 + 52j - 449. Give x(41). 2 Let x(t) = t*3 - 27t*2 - 27t - 31. Calculate x(28). -3 Let v(o) = -155o + 11938. Calculate v(77). 3 Let t(g) = 2g*3 - 98g*2 - 3g + 98. What is t(49)? -49 Let x(p) = -p*3 + 49p*2 - 137p. Determine x(46). 46 Let j(c) = -63c - 2779. Determine j(-48). 245 Let r(q) = -4q*2 + 21q - 35. Calculate r(7). -84 Let a(k) = -98k + 992. Calculate a(10). 12 Let v(q) = 2q*3 - 18q*2 - 26q + 117. Calculate v(9). -117 Let d(j) = j*3 + 21j*2 - 178j - 3432. Give d(-22). 0 Let b(q) = 217q - 1508. Determine b(7). 11 Let w(x) = 5x*3 + 9x*2 + 12x - 16. What is w(-5)? -476 Let u(n) = 56n + 341. Calculate u(-6). 5 Let s(p) = -66p + 207. Determine s(3). 9 Let d(w) = w*3 - 17w*2 + 9w - 166. What is d(17)? -13 Let f(b) = -4b2 + 15b - 5. Calculate f(3). 4 Let r(y) = -y*3 + 34y*2 + 69y - 24. Determine r(36). -132 Let x(r) = 2r2 - 443r + 24326. Give x(121). 5 Let a(v) = 17v + 413. What is a(-26)? -29 Let p(i) = i3 - 19i*2 + 71i + 86. Determine p(7). -5 Let f(t) = t*2 + 94t - 1614. Determine f(16). 146 Let l(v) = -v*2 + 45v - 92. What is l(43)? -6 Let k(r) = -588r - 4079. What is k(-7)? 37 Let m(k) = -209k - 3783. Calculate m(-18). -21 Let j(y) = 6y3 + y2 - 12y + 575. Give j(0). 575 Let w(a) = a*3 - 9a*2 - 31a - 82. Calculate w(12). -22 Let o(k) = 5k2 - 351k - 136. Determine o(71). 148 Let a(k) = -8k - 625. Give a(-77). -9 Let v(k) = -7k*2 - 72k - 29. Give v(-11). -84 Let n(b) = 56b + 86. Calculate n(-2). -26 Let l(t) = -849t - 2. Determine l(0). -2 Let j(k) = k*2 + 5k - 38. Determine j(8). 66 Let y(d) = -74d2 - 276d + 12. Calculate y(-4). -68 Let m(w) = -6w2 + 421w - 813. What is m(2)? 5 Let s(c) = -4c2 - 76c - 380. What is s(-7)? -44 Let m(a) = -a*2 - 55a - 343. Give m(-51). -139 Let h(y) = -4y3 + 15y + 5. What is h(3)? -58 Let b(q) = -3q2 - 205q - 61. Give b(-68). 7 Let o(g) = 2g2 + 19g + 52. What is o(-14)? 178 Let l(m) = m - 51. What is l(17)? -34 Let t(b) = 48b - 58. Give t(-1). -106 Let g(u) = -u3 + 18u*2 + 41u - 23. Calculate g(20). -3 Let a(i) = -i*3 - 12i*2 + 5i + 170. Calculate a(-11). -6 Let z(r) = -r*3 - 20r*2 - 75r - 179. Give z(-16). -3 Let v(k) = k*3 - 97k*2 + 1704k - 45. Give v(74). 103 Let k(s) = s*3 + 50s*2 - 100s + 329. What is k(-52)? 121 Let s(g) = 5g3 + 309g*2 - 63g - 81. Give s(-62). -19 Let c(t) = 276t2 - 39t - 1. Give c(-1). 314 Let s(h) = -12h - 431. Give s(-37). 13 Let c(u) = -u3 - 30u*2 - 60u - 116. What is c(-28)? -4 Let b(q) = 838q + 9222. What is b(-11)? 4 Let i(k) = 45k - 8102. Determine i(180). -2 Let v(i) = -65i - 2005. Determine v(-31). 10 Let f(w) = w3 - 9w*2 + 83w - 274. What is f(4)? -22 Let q(n) = -5n2 + 187n - 216. Determine q(36). 36 Let g(y) = -y*3 + 9y*2 + 12y + 8. What is g(11)? -102 Let x(g) = -3g2 - 259g - 530. What is x(-84)? 58 Let y(f) = -2f2 - 43f - 310. What is y(-9)? -85 Let x(l) = -180l - 10300. What is x(-58)? 140 Let j(r) = -32r + 1793. Give j(54). 65 Let v(x) = -6x2 - 62x - 278. Calculate v(-4). -126 Let i(q) = -2011q + 12154. Calculate i(6). 88 Let d(w) = w3 + 23w*2 - 27w - 66. Calculate d(-24). 6 Let g(y) = -y*3 + 20y*2 + 28y - 155. What is g(21)? -8 Let m(u) = 474u + 76. Determine m(1). 550 Let f(i) = -i3 - 3i*2 + 11i - 11. Calculate f(0). -11 Let k(y) = -y*3 + 31y*2 + 6y - 1845. Give k(29). 11 Let d(g) = -35g2 - 369g + 175. Calculate d(-11). -1 Let a(f) = 28f - 2455. What is a(88)? 9 Let z(x) = x2 - 15x - 10016. What is z(108)? 28 Let w(l) = 916l + 1832. Give w(-2). 0 Let n(r) = r3 + 6r*2 - 82r - 536. Calculate n(-8). -8 Let t(s) = -s*3 + 21s*2 + 2496. What is t(25)? -4 Let l(v) = -249v + 10704. Calculate l(43). -3 Let t(v) = -127v + 1912. What is t(15)? 7 Let q(b) = b2 - 244b + 1435. Give q(238). 7 Let m(i) = -3i3 - 158i*2 + 155i + 2. Determine m(1). -4 Let l(x) = x*3 - 15x*2 - 3x + 26. Determine l(15). -19 Let j(g) = -g*3 + 55g*2 + 238g - 110. What is j(59)? 8 Let q(o) = 15o2 + 28o + 123. Give q(-7). 662 Let o(q) = -q**3 +	{ "pile_set_name": "DM Mathematics" }
What is the b'th term of -69597, -69603, -69609, -69615, -69621? -6b - 69591 What is the b'th term of -599462, -599464, -599466, -599468, -599470? -2b - 599460 What is the t'th term of 359915, 359918, 359933, 359966, 360023, 360110, 360233, 360398? t*3 - 4t + 359918 What is the j'th term of 208346, 416693, 625040? 208347j - 1 What is the z'th term of -25905, -103669, -233293, -414777, -648121? -25930z*2 + 26z - 1 What is the x'th term of 926, 1894, 2918, 4028, 5254, 6626, 8174? 5x3 - 2x*2 + 939x - 16 What is the m'th term of -5875, -11892, -17909, -23926, -29943? -6017m + 142 What is the j'th term of -1096, -4340, -9748, -17320, -27056, -38956? -1082j*2 + 2j - 16 What is the s'th term of -1504148, -1504146, -1504144? 2s - 1504150 What is the a'th term of 93, 176, 249, 312, 365, 408, 441? -5a*2 + 98a What is the q'th term of -87, -159, -225, -291, -363, -447? -q*3 + 9q*2 - 92q - 3 What is the w'th term of -1715, -3410, -5105, -6800, -8495, -10190? -1695w - 20 What is the n'th term of -3386, -6542, -9704, -12878, -16070, -19286, -22532, -25814? -n3 + 3n*2 - 3158n - 230 What is the f'th term of -1606, -1149, -386, 683, 2058, 3739? 153f2 - 2f - 1757 What is the n'th term of 3002, 6007, 9012, 12017, 15022, 18027? 3005n - 3 What is the s'th term of -270, -1192, -2768, -4998, -7882, -11420, -15612? -327s*2 + 59s - 2 What is the o'th term of 79624, 79625, 79630, 79639, 79652? 2o2 - 5o + 79627 What is the q'th term of 3826, 3560, 3294, 3028, 2762, 2496? -266q + 4092 What is the i'th term of -198, -211, -232, -267, -322? -i3 + 2i*2 - 12i - 187 What is the h'th term of 2254, 2263, 2276, 2293? 2h2 + 3h + 2249 What is the p'th term of 5257, 5148, 5039, 4930? -109p + 5366 What is the m'th term of -1055, -2126, -3197, -4268? -1071m + 16 What is the n'th term of 2523, 2598, 2715, 2868, 3051, 3258? -n*3 + 27n*2 + n + 2496 What is the o'th term of -164, -405, -662, -947, -1272, -1649, -2090, -2607? -2o*3 + 4o*2 - 239o + 73 What is the o'th term of 1908, 3879, 5852, 7827? o*2 + 1968o - 61 What is the y'th term of -65, -60, -73, -128, -249? -4y3 + 15y*2 - 12y - 64 What is the t'th term of 517, 530, 557, 604, 677, 782, 925? t3 + t2 + 3t + 512 What is the w'th term of 10000, 19548, 29096? 9548w + 452 What is the l'th term of -87, -101, -133, -189, -275, -397, -561? -l*3 - 3l*2 + 2l - 85 What is the j'th term of -350, -3021, -10238, -24275, -47406? -379j3 + j2 - 21j + 49 What is the i'th term of 17823, 17825, 17827, 17829? 2i + 17821 What is the z'th term of -2886687, -2886688, -2886689, -2886690, -2886691, -2886692? -z - 2886686 What is the x'th term of -201, -364, -527, -690? -163x - 38 What is the z'th term of -1727, -7025, -15897, -28343, -44363, -63957, -87125? -1787z2 + 63z - 3 What is the c'th term of 7901, 31619, 71149, 126491? 7906c2 - 5 What is the q'th term of -5, 16, 41, 70, 103, 140? 2q*2 + 15q - 22 What is the j'th term of -5050, -10097, -15144? -5047j - 3 What is the b'th term of 17484, 17481, 17478? -3b + 17487 What is the s'th term of 1748, 3385, 5044, 6737, 8476, 10273, 12140, 14089? 2s3 - s2 + 1626s + 121 What is the j'th term of -28, -124, -432, -1072, -2164, -3828, -6184, -9352? -20j3 + 14j*2 + 2j - 24 What is the p'th term of -53, -87, -179, -359, -657, -1103, -1727? -5p3 + p2 - 2p - 47 What is the p'th term of -27384, -27377, -27370, -27363? 7p - 27391 What is the f'th term of 1294, 4907, 10924, 19339, 30146? -f3 + 1208f*2 - 4f + 91 What is the f'th term of -710, -831, -948, -1061? 2f2 - 127f - 585 What is the o'th term of -126365, -252732, -379099? -126367o + 2 What is the v'th term of -1140, -3671, -7890, -13797, -21392, -30675? -844v*2 + v - 297 What is the d'th term of 41374, 41433, 41532, 41671, 41850? 20d*2 - d + 41355 What is the d'th term of -233, -496, -759, -1022? -263d + 30 What is the o'th term of -53212, -53209, -53206? 3o - 53215 What is the r'th term of -33, -52, -27, 60, 227, 492? 3r*3 + 4r*2 - 52r + 12 What is the n'th term of -84481, -168964, -253447, -337930? -84483n + 2 What is the n'th term of -130, -1139, -3892, -9265, -18134, -31375, -49864, -74477? -146n*3 + 4n*2 + n + 11 What is the t'th term of 562, 453, 344, 235, 126, 17? -109t + 671 What is the s'th term of 7974, 7877, 7784, 7695? 2s2 - 103s + 8075 What is the w'th term of -307682, -615357, -923032? -307675w - 7 What is the p'th term of 692, 1383, 2080, 2783, 3492, 4207, 4928? 3p*2 + 682p + 7 What is the a'th term of -877, -994, -1109, -1222, -1333? a*2 - 120a - 758 What is the t'th term of 221, 509, 867, 1289, 1769, 2301, 2879? -t*3 + 41t*2 + 172t + 9 What is the b'th term of 49547, 49543, 49537, 49529? -b*2 - b + 49549 What is the u'th term of 574, 1010, 1446, 1882, 2318, 2754? 436u + 138 What is the i'th term of -892, -1787, -2682, -3577? -895i + 3 What is the z'th term of -1317945, -1317947, -1317949, -1317951, -1317953, -1317955? -2z - 1317943 What is the n'th term of -1579, -3155, -4731, -6307, -7883? -1576n - 3 What is the k'th term of -9592, -9560, -9524, -9484? 2k*2 + 26k - 9620 What is the m'th term of 340702, 681400, 1022098? 340698m + 4 What is the c'th term of -992, -1979, -2950, -3899, -4820, -5707, -6554, -7355? c3 + 2c*2 - 1000c + 5 What is the q'th term of 22, -149, -510, -1061, -1802, -2733, -3854? -95q2 + 114q + 3 What is the q'th term of 13360119, 13360120, 13360121? q + 13360118 What is the u'th term of -367, -751, -1135, -1519, -1903, -2287? -384u + 17 What is the j'th term of -96, -71, -36, 9, 64? 5j*2 + 10j - 111 What is the f'th term of 963, 3418, 7497, 13194, 20503, 29418? -f*3 + 818f*2 + 8f + 138 What is the q'th term of -14, 8, 34, 58, 74, 76, 58, 14? -q*3 + 8q*2 + 5q - 26 What is the k'th term of -2003, -8027, -18075, -32147, -50243, -72363, -98507? -2012k2 + 12k - 3 What is the x'th term of 376442, 376451, 376474, 376517, 376586, 376687? x3 + x2 - x + 376441 What is the n'th term of 7860, 7825, 7758, 7653, 7504? -n*3 - 10n*2 + 2n + 7869 What is the j'th term of -51863, -51873, -51883, -51893, -51903, -51913? -10j - 51853 What is the d'th term of 361, 1221, 2655, 4657, 7221, 10341, 14011, 18225? -d3 + 293d*2 - 12d + 81 What is the n'th term of -1749, -1735, -1717, -1695, -1669, -1639? 2n2 + 8n - 1759 What is the b'th term of -2129, -4716, -7303, -9890, -12477? -2587b + 458 What is the n'th term of 73693, 73685, 73667, 73633, 73577? -n3 + n2 - 4n + 73697 What is the k'th term of -238, 262, 1484, 3788, 7534, 13082? 60k3 + k2 + 77k - 376 What is the o'th term of 684, 2828, 6440, 11520? 734o2 - 58o + 8 What is the f'th term of -35934, -35932, -35930, -35928, -35926, -35924? 2f - 35936 What is the l'th term of -47208, -94415, -141622, -188829, -236036, -283243? -47207l - 1 What is the s'th term of 845, 1653, 2471, 3299, 4137, 4985, 5843? 5s2 + 793s + 47 What is the f'th term of 2360, 2365, 2382, 2417, 2476, 2565? f*3 - 2f + 2361 What is the r'th term of -9829, -9878, -9929, -9982, -10037, -10094? -r*2 - 46r - 9782 What is the y'th term of 102, 181, 222, 219, 166? -y*3 - 13y*2 + 125y - 9 What is the o'th term of -102, -132, -208, -342, -546? -2o3 - 11o*2 + 17o - 106 What is the s'th term of 4991, 10153, 15311, 20465, 25615, 30761, 35903? -2s2 + 5168s - 175 What is the v'th term of -675, -1017, -1357, -1695, -2031, -2365? v*2 - 345v - 331 What is the x'th term of -251, -263, -271, -275, -275? 2x2 - 18x - 235 What is the m'th term of 226, 423, 582, 703, 786, 831? -19m2 + 254m - 9 What is the r'th term of -3564, -14271, -32122, -57123, -89280? -r*3 - 3566r*2 - 2r + 5 What is the j'th term of 546, 1024, 1504, 1986, 2470? j*2 + 475j + 70 What is the x'th term of -14537, -14533, -14541, -14567, -14617, -14697, -14813, -14971? -x*3 + 11x - 14547 What is the n'th term of -227336, -227339, -227342, -227345, -227348, -227351? -3n - 227333 What is the y'th term of -278, -542, -810, -1088, -1382, -1698, -2042? -y3 + 4y*2 - 269y - 12 What is the q'th term of 651, 1119, 1401, 1503, 1431? q*3 - 99q*2 + 758q - 9 What is the u'th term of -176756, -176755, -176754, -176753? u - 1	{ "pile_set_name": "DM Mathematics" }
/(-154). Suppose 2t - 36 = -3q, 2q - w = -t - 1. What is the remainder when 212 is divided by t? 14 Suppose 4o - 3t = 8, -5o + 4t - 634 = -641. Suppose i + 4m - 25 = 0, -3m - 41 - 53 = -2i. Calculate the remainder when i is divided by o. 8 Suppose -26f - 55 - 49 = 0. Calculate the remainder when 56 is divided by f/(-10) + (5 - (-522)/45). 5 Let q(u) = 3u*2 + u. Let h be q(-2). Calculate the remainder when 5/(h/(-4)) - -33 is divided by 60/6(-2)/(-1). 11 Let r = 296 - 103. Let o = r + -190. Calculate the remainder when 1 + 0 + 52 is divided by o. 2 Suppose 0 = 28x - 130 - 38. Suppose xb = -9b + 60. What is the remainder when 6 is divided by b? 2 Suppose 9 = 6o - 39. Let s(k) = k3 - 7k*2 - 5k - 25. Let z be s(o). Let m = 17 + z. Calculate the remainder when 47 is divided by m. 15 Let o = 262 - 160. What is the remainder when o is divided by 26? 24 Suppose z + 6 = 3h, 3h = 5z + 2h - 12. Let w be 4 + (-8 + z - -3). Let i = w + 15. Calculate the remainder when 101 is divided by i. 16 Let o be (-3 - (5 + -5))(-2 + 1). Suppose -14i - 194 = -4j - 12i, 0 = j - oi - 56. What is the remainder when j is divided by 20? 7 Let w be 13 - 21/(13 - 6). Suppose -i = 4f - 8, wf = 2i + 11f - 9. What is the remainder when i is divided by 2? 0 Let h = 2168 - 1464. What is the remainder when h is divided by -94(1/(-16))/(473/3784)? 46 Suppose -8g - 111 = -303. Let t = g + 7. Suppose 0 = -3x + 6x - 2w - t, 5x + 2w = 57. What is the remainder when 14 is divided by x? 3 Let u = 80 + 23. Let z = u - 93. What is the remainder when 277 is divided by z? 7 Let u = 2660 - 2544. Calculate the remainder when 166 is divided by u. 50 What is the remainder when 30 is divided by -31/7 - ((-152)/28 - 0)? 0 Suppose -4y + 1560 = -30y. Let a = y + 88. Calculate the remainder when 249 is divided by a. 25 Let q(p) = -243p - 2125. Calculate the remainder when q(-10) is divided by 108. 89 Suppose 5u + 53 = 3j, 5j - j - u - 65 = 0. Suppose x - 47 = -50. What is the remainder when x + (-897)/(-18) - (-13)/78 is divided by j? 15 What is the remainder when 433 is divided by (3/27 - (-7952)/(-126))-1? 55 Let z be 89/6 + 4/(-120)-5. Suppose 2561 - 869 = 18r. What is the remainder when r is divided by (72/z)/(9/60)? 30 Suppose 61z + 3o - 1668 = 60z, -z - 2o + 1670 = 0. What is the remainder when z is divided by 17? 8 Suppose -160t = -167t + 525. Calculate the remainder when t is divided by -3 + (28 - 26)/(1/9). 0 Suppose l + 2h - 171 = 0, l - 252h - 192 = -251h. Calculate the remainder when l is divided by 95. 90 Let v be 20/70 + 3/((-42)/2020). Let n = v - -193. Calculate the remainder when 389 is divided by n. 46 Suppose -2614 - 13770 = -64u. What is the remainder when u is divided by 15? 1 Let x(c) be the second derivative of -34c - 17/2c*2 + 0 - 1/6c*3 + 1/12c*4. Calculate the remainder when 51 is divided by x(-5). 12 Let u(f) = 4f*2 + 10f + 10. Let z be u(-6). Let q = 264 - z. Suppose -2h + 12h - q = 0. Calculate the remainder when 31 is divided by h. 14 Let d = 2207 + -2162. What is the remainder when d is divided by 34? 11 Let q(j) be the second derivative of -5j3/3 - 44j*2 - 2j + 12. Calculate the remainder when q(-14) is divided by 10/(-4)154/(-35). 8 Let n = -529 + 549. What is the remainder when 41/(-3)(-240)/n is divided by 15? 14 Let i = 7943 - 5620. Calculate the remainder when i is divided by 97. 92 Calculate the remainder when (-17654)/(-10) + 2 + ((-705)/75 - -9) is divided by 10. 7 Let z = 1365 - -2776. Calculate the remainder when z is divided by 148. 145 Suppose 5y + 40 = -i - i, -100 = 4i + 5y. Calculate the remainder when (-410)/i + (4/(-6))/1 is divided by 2. 1 Let d = -96 + 132. Calculate the remainder when 45 is divided by d((-24)/9)/(-4). 21 Suppose 308 = -3k - 4k + 882. What is the remainder when k is divided by 42? 40 Let u(q) = 256q + 70. Let w be u(2). Let j = -343 + w. Calculate the remainder when j is divided by 30. 29 Suppose 4v - 495 = -13q + 8q, -4v - 3q = -497. Suppose -2d + x = -66, 5d - v - 40 = -2x. What is the remainder when 362 is divided by d? 32 Suppose -4i + 434 = -35f + 38f, 2f - 320 = 5i. Calculate the remainder when 1925 is divided by f. 125 Suppose -3r + 480 = -0r. Suppose -5f + 5i + 2 - 27 = 0, 3i + 3 = 0. Calculate the remainder when r is divided by 14 - (13 + f + -16). 22 Let t = 243 + -287. Let q = t - -75. What is the remainder when 106 is divided by q? 13 Suppose 0 = d - 5x - 139, 29x = 5d + 27x - 672. What is the remainder when d is divided by 68? 66 Let g(x) = -x2 - 71x + 1425. Calculate the remainder when g(-81) is divided by 202. 9 Suppose m = -4b + 6849, 6249b - 6245b - 20539 = -3m. Calculate the remainder when m is divided by 107. 104 Let t(k) = -17k - 104. Let w be t(-9). Suppose -w = -5u - 4a, -a = -9 + 8. What is the remainder when 159 is divided by u? 6 Suppose 73u = 31157 + 35784. Calculate the remainder when 2751 is divided by u. 0 Let h = -6 + -93. Suppose 0 = -a - 4, -2a + a = 5m + 629. Let u = h - m. What is the remainder when u is divided by 9? 8 Let v = 309 - 273. Suppose -4c - c = -105. What is the remainder when v is divided by c - -1(3 - 3)? 15 Suppose 2g = -3r + 63, -3g - 2r + 68 = -g. What is the remainder when 853 is divided by g? 34 Let p(d) = -11d3 + d + 2. Let i(m) = -m2 - 9m - 21. Let h be i(-5). What is the remainder when (-20)/(-5) + 57/3 is divided by p(h)? 11 Suppose -8b = -5b + 18. Let i(k) = 3k2 - 25k + 9 + 54k - 13k. What is the remainder when i(b) is divided by 8? 5 Let n be -2 - (-49 - (-1)/((-2)/4)). What is the remainder when ((-61)/(-4))/(n/196) is divided by 38? 23 Suppose -18397 = -362l + 17803. What is the remainder when 899 is divided by l? 99 Suppose -3y = 2t - 16, y - 20 = -4y. Suppose -v - 14 = -h, -5v + 0 = -h - t. Calculate the remainder when h is divided by (10/6)/(1/6). 8 Suppose 2x = 4a - 1882, 2x = -13a + 10a + 1429. Suppose 0 = 9m - a - 364. Calculate the remainder when m is divided by 20. 13 Suppose -20y = 19y - 1404. Calculate the remainder when 1146 is divided by y. 30 Let y be (-3)/284/18. Let i(j) = -4j + 6. What is the remainder when i(y) is divided by (9/12 + 0)/(6/144)? 16 Suppose -4k = 4u - 25128, -83k + 87k - 25116 = -2u. Calculate the remainder when k is divided by 23. 20 Let c(f) = f*3 - 51f*2 + 100f - 67. What is the remainder when (-2 + 1)324/(-4) is divided by c(49)? 19 Let g(l) = -23l - 2. Let m(w) = 370w - 5874. What is the remainder when g(-4) is divided by m(16)? 44 Let b = -5851 + 5888. Let q = 47 - -42. What is the remainder when q is divided by b? 15 Let m = 838 - 807. Calculate the remainder when 211 is divided by m. 25 Let h be 16 - 8/(24/(-15)). Suppose -hq + 132 = -18q. Calculate the remainder when 174 is divided by q. 42 Let b be (35/(-25))/((-4)/(18 - -2)). Let u(c) = -c3 + 5c*2 + 17c - 6. What is the remainder when 73 is divided by u(b)? 13 Suppose -3b = -12, -4w - 12760 + 13116 = -3b. Calculate the remainder when w is divided by ((-44)/2)/((-14)/21). 26 Suppose -7h = -3h + 3z - 6, 5z = h + 10. Suppose 15y + y - 112 = h. What is the remainder when y is divided by 3? 1 Let d(c) = -3c3 - c2 - 23c - 3. Let z(k) = -2k3 - k2 - 11k - 2. Let s(i) = 3d(i) - 5z(i). What is the remainder when s(4) is divided by 1? 0 Let o(n) = 47n2 + 693n + 6. What is the remainder when o(-16) is divided by 27? 5 Let v(o) = -o + 20. Let y be v(11). Let w(g) = -6g - 11 + yg2 + 11 - 1 + g3. What is the remainder when w(-4) is divided by 21? 19 Suppose 52p + 12711 = -42p + 151p. What is the remainder when p is divided by 108? 7 Let p(r) = -187r + 1161. What is the remainder when p(6) is divided by 31? 8 Suppose 0 = -m - w + 23, 3m - 45 = 12w - 9w. Suppose -383 = -mu + 168. Calculate the remainder when 144 is divided by u. 28 Suppose 0 = -4g - 2o + 88, 0 = 5g - 1317o + 1314o - 110. What is the remainder when 2837 is divided by g? 21 Let u be (-2)/(-3) - (-11)/(-3). Let k be (-9 + 9)/(2 + u). Suppose -5p = -3j - 66, -p + kj + 2*j = -16. Calculate the remainder when 93 is divided by p. 9 Let r = -11804 - -12406. What is the remainder when r is divided by 16? 10 Let v	{ "pile_set_name": "DM Mathematics" }
, 0 Sort 7/4, -2/11, 0 in decreasing order. 7/4, 0, -2/11 Sort 0.3, -78/19, 5 in ascending order. -78/19, 0.3, 5 Put 1/3, 0, -5, 5, -0.05 in decreasing order. 5, 1/3, 0, -0.05, -5 Sort -1, 48, -3, 1/5, 1. -3, -1, 1/5, 1, 48 Sort -4/31, -3, -0.4, 0 in decreasing order. 0, -4/31, -0.4, -3 Sort -64, 3/2, -0.1 in decreasing order. 3/2, -0.1, -64 Sort -14, -4, 2/9 in descending order. 2/9, -4, -14 Sort -5, 111, -18 in descending order. 111, -5, -18 Sort 1, 19, 6. 1, 6, 19 Put -1/5, -0.0857, 0 in descending order. 0, -0.0857, -1/5 Put 3, -2, 6/11, -3/7, -4 in descending order. 3, 6/11, -3/7, -2, -4 Put -5, -4, -23, -9 in decreasing order. -4, -5, -9, -23 Put -2/7, -8/3, -0.4 in increasing order. -8/3, -0.4, -2/7 Sort 0, -3.9, 0.4 in descending order. 0.4, 0, -3.9 Put -1/6, -5, 0.3 in ascending order. -5, -1/6, 0.3 Sort -61, -2, 5, 4 in descending order. 5, 4, -2, -61 Put -0.197, 3, -5, -4/5 in decreasing order. 3, -0.197, -4/5, -5 Put 7, 9, 4, 3 in decreasing order. 9, 7, 4, 3 Sort 1/28, 0, 3/5, 5. 0, 1/28, 3/5, 5 Sort 2/5, -10, -7 in decreasing order. 2/5, -7, -10 Sort -5, 3, 0.4, -3/91 in ascending order. -5, -3/91, 0.4, 3 Put -2.3, 2/3, 2, -20 in descending order. 2, 2/3, -2.3, -20 Sort 0.05, 2, 1/4. 0.05, 1/4, 2 Sort -3/2, -0.4, -0.5, -4, 23.1 in descending order. 23.1, -0.4, -0.5, -3/2, -4 Put 2, 4, 354 in descending order. 354, 4, 2 Put 0.4, -0.06, -1.7, -3/4 in ascending order. -1.7, -3/4, -0.06, 0.4 Put 12, -2, 2, 9 in descending order. 12, 9, 2, -2 Sort 1, -2, 2/9, -1. -2, -1, 2/9, 1 Put -4, 6, 0 in increasing order. -4, 0, 6 Sort -1, 480, 0 in descending order. 480, 0, -1 Sort -0.055, -1/4, -8, -0.4 in decreasing order. -0.055, -1/4, -0.4, -8 Sort 49, -1, -4, -22 in decreasing order. 49, -1, -4, -22 Put -9, 7, -4 in descending order. 7, -4, -9 Put 3, -3, -2, -111, 1 in ascending order. -111, -3, -2, 1, 3 Put -5, 124, -10 in decreasing order. 124, -5, -10 Put 2, 4, 145 in ascending order. 2, 4, 145 Sort -2, -0.8, -5/29. -2, -0.8, -5/29 Sort -2, -3, -0.5, -0.05. -3, -2, -0.5, -0.05 Put 5, 0.02, -3, -11, 0.3 in increasing order. -11, -3, 0.02, 0.3, 5 Put -4, -5, -16, -1, -6 in ascending order. -16, -6, -5, -4, -1 Put 2/9, 16, -5, -52 in descending order. 16, 2/9, -5, -52 Sort -5, -4, 4, 1, -9. -9, -5, -4, 1, 4 Sort 51, 1, 2/7 in descending order. 51, 1, 2/7 Put -0.5, -1, 2/5, -0.04 in decreasing order. 2/5, -0.04, -0.5, -1 Sort 4, -4, 8. -4, 4, 8 Sort -428, 3, -3. -428, -3, 3 Put -4, -17, 3 in increasing order. -17, -4, 3 Put -2/9, 29, -1, 1, 6/5 in increasing order. -1, -2/9, 1, 6/5, 29 Sort -1/8, 0.1, 0, 13. -1/8, 0, 0.1, 13 Put -2/13, 13, -0.1, 2/345 in decreasing order. 13, 2/345, -0.1, -2/13 Sort 2, 14, -7, 1 in increasing order. -7, 1, 2, 14 Sort -25, -3, -19, 4 in descending order. 4, -3, -19, -25 Sort 9664, 0, -1 in decreasing order. 9664, 0, -1 Sort 0, 2, 7, 0.276. 0, 0.276, 2, 7 Put -8, -98, 5 in decreasing order. 5, -8, -98 Put -0.5, -670, 0, 5 in descending order. 5, 0, -0.5, -670 Sort -8, 120, -4, 4. -8, -4, 4, 120 Sort -4, 6, -2, 182 in increasing order. -4, -2, 6, 182 Sort 4, 13, -0.09 in increasing order. -0.09, 4, 13 Sort 371, -27, -2 in decreasing order. 371, -2, -27 Sort -15, 0.3, -4. -15, -4, 0.3 Sort 4, -4, 66 in decreasing order. 66, 4, -4 Put -17, -5, 2/3, 2/7 in descending order. 2/3, 2/7, -5, -17 Sort 9, -3, 36, -4. -4, -3, 9, 36 Put 0, -8, -3, 5, 10 in increasing order. -8, -3, 0, 5, 10 Sort -2, 14, -20 in descending order. 14, -2, -20 Sort 8, 17, 1, 10 in increasing order. 1, 8, 10, 17 Sort 11, 3, 0, 2. 0, 2, 3, 11 Put -1, 1, 47, 2 in decreasing order. 47, 2, 1, -1 Sort -2397, 5, -5 in descending order. 5, -5, -2397 Put 3, 0, -49 in ascending order. -49, 0, 3 Put 5, 111, -1 in decreasing order. 111, 5, -1 Sort 22, -4, 5, 3 in descending order. 22, 5, 3, -4 Put -5/3, -0.015, -0.07 in decreasing order. -0.015, -0.07, -5/3 Sort -3, -265, 0.2, 0, 5 in ascending order. -265, -3, 0, 0.2, 5 Sort 2, 0.05, 62 in decreasing order. 62, 2, 0.05 Sort -1, 4, 862, -5, 5. -5, -1, 4, 5, 862 Put 0.1, 5, 1/33, 0 in decreasing order. 5, 0.1, 1/33, 0 Sort 1, -12, 540, -4 in descending order. 540, 1, -4, -12 Sort 0.1, 43, -15, 3. -15, 0.1, 3, 43 Sort -3/4, 0.7, -7, -1, -3/19 in decreasing order. 0.7, -3/19, -3/4, -1, -7 Sort 3, -2, -8, -4, -15 in ascending order. -15, -8, -4, -2, 3 Sort 0, 0.01, -23. -23, 0, 0.01 Sort 4, 13, 2, -4, 0 in ascending order. -4, 0, 2, 4, 13 Sort 4, -4, 46, -1, -3 in decreasing order. 46, 4, -1, -3, -4 Put 1, 38, 28 in decreasing order. 38, 28, 1 Put -113, 3, -3/8, 0.5 in descending order. 3, 0.5, -3/8, -113 Put -0.3, 3.7, 2/5 in ascending order. -0.3, 2/5, 3.7 Put -4, -11, 0, -22, -5 in ascending order. -22, -11, -5, -4, 0 Sort -5, -2, 4, -6 in ascending order. -6, -5, -2, 4 Put -13/5, 2, 1/8 in descending order. 2, 1/8, -13/5 Sort 10/19, -4, -136 in increasing order. -136, -4, 10/19 Sort -5, -1, -4, 0, -2. -5, -4, -2, -1, 0 Sort 0.2, -4, -1, 5 in decreasing order. 5, 0.2, -1, -4 Put -0.2, 3, -10/29 in ascending order. -10/29, -0.2, 3 Sort 4, -10, -8. -10, -8, 4 Sort 34, 0.9, -1/9, -4 in increasing order. -4, -1/9, 0.9, 34 Sort 2, 11, -1. -1, 2, 11 Put -5330, 0.2, 4 in decreasing order. 4, 0.2, -5330 Put -2/3, 1, 0.34, -14 in ascending order. -14, -2/3, 0.34, 1 Sort -5/6, 0.3, -5, 0.4, -3. -5, -3, -5/6, 0.3, 0.4 Put 3, -47, -3 in increasing order. -47, -3, 3 Sort -232, -1, 0 in decreasing order. 0, -1, -232 Sort -1, 2/1325, 2/9 in descending order. 2/9, 2/1325, -1 Sort 1, 19, -1, 0 in ascending order. -1, 0, 1, 19 Put 6.8, 1/3, 4 in decreasing order. 6.8, 4, 1/3 Sort 2, -28, -1 in descending order. 2, -1, -28 Put -115, 2, 1, -3 in increasing order. -115, -3, 1, 2 Sort -2, -5, -27 in descending order. -2, -5, -27 Put 33, -0.4, -0.2, 3, 2 in decreasing order. 33, 3, 2, -0.2, -0.4 Put 22, 5, 2 in ascending order. 2, 5, 22 Put 39, -3, 4 in descending order. 39, 4, -3 Sort -3, 30, -2, 4 in ascending order. -3, -2, 4, 30 Put 2/15, 1/12, 7, 2, -3 in descending order. 7, 2, 2/15, 1/12, -3 Put 10, 40, -3 in descending order. 40, 10, -3 Sort 0, 2, 43, -5, 4 in decreasing order. 43, 4, 2, 0, -5 Sort -3, 8, -6, 0 in decreasing order. 8, 0, -3, -6 Sort -0.12, 59, -4 in descending order. 59, -0.12, -4 Sort -1/2, -5/3, 25 in decreasing order. 25, -1/2, -5/3 Put -3, -2, 1, 150 in decreasing order. 150, 1, -2, -3 Put 5, -29, -1 in increasing order. -29, -1, 5 Put -2, -5, -1/3, 3, -2/23 in decreasing order. 3, -2/23, -1/3, -2, -5 Sort -8, -4, 5, 1 in increasing order. -8, -4, 1, 5 Put -3/14, 0.01, -1, 1/6 in decreasing order. 1/6, 0.01, -3/14, -1 Sort -1, 0, 3, 90 in decreasing order. 90, 3, 0, -1 Put -5, -2, -3, 94 in decreasing order. 94, -2, -3, -5 Sort 4, -8, -19 in descending order. 4, -8, -19 Put -4, 0.2, 2/21, 2/11 in increasing order. -4, 2/21, 2/11, 0.2 Sort -82, 2, 4, -3 in increasing order. -82, -3, 2, 4 Put -18, -1, -5, 0.07 in increasing order. -18, -5, -1, 0.07 Sort 6, -5, 222 in descending order. 222, 6, -5 Put 3, 4, 24, -1 in descending order. 24, 4, 3, -1 Put -3, -5, -7, -2 in decreasing order. -2, -3, -5, -7 Put -79, -1, -5, 3, 2 in increasing order. -79, -5, -1, 2, 3 Sort 4, -2, 6, -1 in decreasing order. 6, 4, -1, -2 Sort -4, -2/9, -1243 in decreasing order. -2/9, -4, -1243 Sort 5, 1/3, -0.4, 0.1. -0.4, 0.1, 1/3, 5 Put -87, -4, 0, -3 in decreasing order. 0, -3, -4, -87 Put -5, 5, -1, 0.3, -817 in descending order. 5, 0.3, -1, -5, -817 Put -1, -3, 3, -107 in increasing order. -107, -3, -1, 3 Put 5, -29, -6 in descending order. 5, -6, -29 Sort 5, -0.1, -0.17, -0.5 in descending order. 5, -0.1, -0.17, -0.5 Put -11, 2/15, 0, 0.3, 2/5 in descending order. 2/5, 0.3, 2/15, 0, -11 Put 14, -1, -67 in descending order. 14, -1, -67 Put -5, 2, -1625 in decreasing order. 2, -5, -1625 Sort 4, 2/3, 8.8, -2/7 in increasing order. -2/7, 2/3, 4, 8.8 Sort 1, -1, -1/6, -1/2 in decreasing order. 1, -1/6, -1/2, -1 Sort -4, 11, -2.8, 0.4 in decreasing order. 11, 0.4, -2.8, -4 Sort 1776, 5/3, -1, -0.1 in ascending order. -1, -0.1, 5/3, 1776 Put 24, -5/7, 1/5, 2/3 in ascending order. -5/7, 1/5, 2/3, 24 Sort 3, -3, 4, -5, -7 in decreasing order. 4, 3, -3, -5, -7 Sort -4, 1, -5. -5, -4, 1 Put -1110, -0.5, 5 in decreasing order. 5, -0.5, -1110 Sort -12, -3, 2. -12, -3, 2 Sort -13, 4, 1 in ascending order. -13, 1, 4 Put -4, -5, -1	{ "pile_set_name": "DM Mathematics" }
i(h) be the third derivative of -1/12h4 - 3h*2 + 0h*3 + 0 + 0h. Let k(u) = -3u. Calculate i(k(l)). 6l Let s(h) be the first derivative of -4h3/3 - 11. Let y(q) = -5q*2. What is s(y(w))? -100w4 Let y(h) = h2. Let k(i) = -4i. Let a(u) = u. Suppose 3j + 97 = -3z + 10, 3j = -5z - 139. Let r(p) = za(p) - 6k(p). Determine y(r(s)). 4s*2 Let j(b) = b. Let l(h) = 2h*2 - h - 1. Let w(y) = 40y*2 - 16y - 16. Let p(v) = -16l(v) + w(v). What is p(j(c))? 8c*2 Let d(x) = -43x - 203 - 201 + 404. Let z(o) = -2o2. Give z(d(b)). -3698b*2 Let v(i) = -2i. Let w be (-3 - (-6 + 4))/(-1) + 1. Let g(l) be the first derivative of 0lw + 2 + 0l + 2/3l3. Give g(v(r)). 8r*2 Let z(w) be the second derivative of -5w*3/6 - 3w. Let h(f) = -f*2 - 1. Let y(x) = 7x*2 + 4. Let k(l) = 4h(l) + y(l). What is k(z(p))? 75p2 Let b(l) = -2l*2. Let v = -1 - -6. Let j(r) = -r + 4r - vr + 3r + 2. Let y(m) = -1. Let q(c) = -j(c) - 2y(c). Calculate q(b(x)). 2x*2 Let j(q) = -5q. Let a(c) = 568c - 2. Give j(a(g)). -2840g + 10 Suppose x + 30 = 5c, -15 + 0 = 3x. Suppose -5d + o + 11 = 2o, cd - 9 = o. Let r(m) = -md + m2 - 2m2. Let g(v) = -v2. What is g(r(s))? -4s4 Let s(w) be the first derivative of w4/24 + w2/2 + 2. Let j(t) be the second derivative of s(t). Let x(f) = -f2. Determine j(x(b)). -b2 Let x(m) be the first derivative of m3/3 + 5. Let f(u) = -9u + 4. Let h(p) = -125p + 55. Let l(s) = -55f(s) + 4h(s). Calculate x(l(y)). 25y2 Let r(d) be the second derivative of -d3/6 + d + 9. Let f(m) = -6m2 - 17. Let x(o) = -2o*2 - 6. Let z(v) = -6f(v) + 17x(v). What is r(z(t))? -2t2 Let t(k) = k2. Let j(s) be the first derivative of s4/2 + s3/3 - s + 1. Let q be j(1). Let p(l) = -ql + 2l - 2l. Give t(p(z)). 4z*2 Let i(m) = -4m. Suppose 3z + 4g - 36 = -z, g - 5 = 0. Let f(l) = 0l - zl + 4l + 3l. Give i(f(j)). -12j Let s(b) be the third derivative of -b5/60 + 13b*2. Let m(y) = 17y*2. What is s(m(t))? -289t*4 Let b(a) = -317a*2. Let w(m) = 5m*2. Give w(b(z)). 502445z*4 Let y(i) = 2i*2. Suppose -5p = v - 0v - 10, p - 2 = 4v. Let m(n) = 6 + p - 8 + 3n. Give m(y(j)). 6j2 Let d(s) = s2 + 6s2 - 6s*2. Let r(j) = -26j*2. What is d(r(a))? 676a*4 Let p(b) be the third derivative of 0b*3 - 1/60b*5 + 0b + 0b4 - 3b*2 + 0. Let w(r) = -4r + 0r + 3r. Determine p(w(u)). -u2 Let h(m) be the third derivative of -m4/24 + 2m2. Let n(v) = -7v. What is h(n(j))? 7j Let i(v) = v2 - v + 1. Let a(m) = 18m*2 - 21m + 21. Let g(s) = -2a(s) + 42i(s). Let l(u) = -u. What is g(l(z))? 6z2 Let h(z) be the second derivative of 0z*2 + 1/4z*4 + 0 + 0z*3 - z. Let k(q) = 2q + 242 - 242. What is k(h(y))? 6y2 Let p(j) be the third derivative of j4/24 + j2. Let y(k) = -7k + 4. Suppose -2b = 2b + 4. Let h(l) = -l + 1. Let i(d) = by(d) + 4h(d). What is p(i(o))? 3o Let f(x) be the first derivative of -8x*3/3 + 8. Let b(c) = -2c*2. Give f(b(m)). -32m*4 Let o(y) = 13y. Let m(z) = 14z - 8. Let c(w) = -9w + 5. Let l(s) = 8c(s) + 5m(s). What is o(l(q))? -26q Let c(z) be the third derivative of -z5/20 - 14z2. Let b(q) = q2 - 1. Let a(f) = -4f2 + 6. Let h(k) = a(k) + 6b(k). Give h(c(v)). 18v4 Let w(i) = -5i*2 + 4i2 - i2. Let s(o) = -4o + 13 - 30 + 17. What is w(s(q))? -32q*2 Let k = 7 - 2. Let c(x) = x + kx + 5x - 15x. Let o(i) = 1. Let f(s) = -s + 1. Let p(w) = f(w) - o(w). Give c(p(q)). 4q Let x(l) = l2 + 262l. Let q(u) = -2u2. What is x(q(y))? 4y*4 - 524y*2 Let x(j) = 3j + 4. Let s(i) = 5i + 7. Let u(m) = -4s(m) + 7x(m). Let g(z) = -3z - z + 3z + 5z. Calculate u(g(f)). 4f Let o(k) = 5k*2. Let i(z) = -15z. Determine i(o(h)). -75h2 Let y(d) = -d2. Let m(o) be the first derivative of -o4/4 - 5o*3/3 - 3o*2 - 6o - 3. Let c be m(-4). Let b(i) = -9 + 9 - ci. What is b(y(s))? 2s*2 Let c(k) be the third derivative of 0k - 1/24k4 + 0 - 3k*2 + 0k*3. Let m(q) = -5q. Let d(x) = x. Let g(h) = -6d(h) - m(h). Give g(c(s)). s Let l(t) = -9t - 42. Let z(m) = -20m. Determine z(l(n)). 180n + 840 Let p(m) = -5m2 + 3m - 3. Let g(f) = -6f2 + 4f - 4. Let b(w) = -3g(w) + 4p(w). Let q(j) = -4j2. Give b(q(s)). -32s*4 Let x(b) = 2b*2. Let d(u) = 11823u. Calculate x(d(j)). 279566658j2 Let s(y) = y. Let v = 3 - 1. Let k(r) = -vr + r - 2r. Calculate k(s(n)). -3n Suppose q + 0q - 2n - 8 = 0, 2q - 5n = 19. Let t(x) = -2x - x + qx. Let y(a) = -2a2. Give y(t(m)). -2m*2 Let r(g) = 8g*2. Let h(f) = 343 + 4f - 343. Calculate r(h(y)). 128y2 Let c(k) be the first derivative of -12k*2 - 14. Let s(a) = -2a*2. Calculate c(s(d)). 48d*2 Let l(n) = 338n*2. Let p(g) = -g. Give l(p(i)). 338i*2 Let g(d) = -630d + 75. Let a(v) = 17v - 2. Let h(c) = -150a(c) - 4g(c). Let r(f) = f. Calculate r(h(y)). -30y Let m(s) be the first derivative of -13s2/2 - 8. Let o(l) = 2l*2. Calculate o(m(r)). 338r*2 Let c(d) = 5d*2. Let t(l) = 39l*2 + 24. Let y(p) = 8p*2 + 5. Let z(b) = -5t(b) + 24y(b). What is z(c(j))? -75j*4 Let l(n) = -5n*2 + 6n*2 + 3n*2. Let t(q) = -3q + 1. Let i be t(-2). Let p(c) = 6c2 + ic*2 - 12c*2. Calculate l(p(h)). 4h*4 Let g(o) = 5o*2. Let r(p) = -7p. Give g(r(l)). 245l2 Let h(m) = 0m - 3m - m + 2m. Let g(k) = 7k. Give g(h(i)). -14i Let f(d) = 6d + 4d - 5d. Let j(b) be the second derivative of -4b + 0b3 - 1/12b*4 + 0 + 0b*2. What is f(j(t))? -5t2 Let d(o) = -o2. Let r(i) be the second derivative of -5i3/3 - i. What is r(d(p))? 10p*2 Let s(n) = 24n*2 - 10n*2 - 16n*2. Let q(b) = -17b. Give q(s(v)). 34v2 Let m(j) = -j2 - 1. Let v(d) = -1. Let l(y) = -m(y) + v(y). Suppose -z = -4c + 10, -4c - c + 15 = 0. Let w(u) = 0u*z - 3u*2 + 2u2. Calculate l(w(t)). t4 Let m(j) = -11j - 15j - 11j + 34j. Let h(s) = -12s + 16. Let v(u) = -u + 1. Let z(i) = h(i) - 16v(i). Calculate m(z(b)). -12b Let l(c) be the first derivative of 2c*3/3 + 3. Let g(u) = -20 + 10 + 10 - 3u. Calculate l(g(z)). 18z2 Let l(x) = 130x. Let z(c) = 2c2. What is z(l(p))? 33800p*2 Let p(o) = 6o. Let g(a) be the second derivative of -a*4/6 - 13a. Determine p(g(k)). -12k2 Let d(j) be the third derivative of 11j5/60 + j2 + 4j. Let p(z) = 3z. Give p(d(i)). 33i2 Let i(z) = z2. Let n(s) = 772 + 15s*2 - 772. Give n(i(v)). 15v*4 Let l(z) = 1759z*2. Let u(v) = v. Calculate u(l(s)). 1759s2 Let z(f) be the first derivative of f3/3 + 6. Let c(k) = -k2. Calculate c(z(d)). -d4 Let p(y) be the second derivative of y*6/180 - 5y*3/6 - 7y. Let f(u) be the second derivative of p(u). Let d(i) = 6i. What is f(d(x))? 72x*2 Let h(j) = -2j*2. Let i(z) = 6z - 3z - 4z. Let y(p) = p. Let l(t) = i(t) + 2y(t). Calculate h(l(a)). -2a*2 Let f(o) = 4o. Let r(g) be the third derivative of g4/24 + g3/3 + g*2. Let c(j) = 20j - 9j - 4j - 3 - 8j. Let w(p) = 2c(p) + 3r(p). Give f(w(v)). 4v Let f(t) be the second derivative of 2t6/45 - 7t*3/6 - 5t. Let q(k) be the second derivative of f(k). Let n(d) = -d*2. What is q(n(h))? 16h*4 Let z(q) be the second derivative of 0 + 1/12q*4 + 3q + 0q2 + 0q*3. Let i(w) = -51w. Let t(g) = 5g. Let k(c) = -2i(c) - 21t(c). Determine k(z(h)). -3h*2 Let t(i) be the second derivative of 0 + 0i*2 - 2i + 0i3 + 1/12i*4. Let g(u) = -3u*2. Calculate g(t(p)). -3p*4 Let n(t) = -t - 6t + 3t + 6t. Let b(k) = 8k. What is b(n(l))? 16l Let c(i) = 7i2 + 6. Let j(z) = z2 + 1. Let o(d) = c(d) - 6j(d). Let l(f) = 7f2. What is l(o(n))? 7n*4 Let h(x) = -14x. Let p(f) = 8f. Determine h(p(j)). -112j Let r(v) = 0 - 4 - 52v + 55v. Let j(g) = g*2. Determine j(r(x)). 9x*2 - 24x + 16 Let o(j) = j - 109. Let s(z) = z. Calculate o(s(w)). w - 109 Let s(m) = 4m2. Let r(c) be the second derivative of c3/2 - 6c. Determine r(s(q)). 12q2 Let z(t) = 3t*2. Let h(j) = 2j*2 - 1566. What is h(z(d))? 18d*4 - 1566 Let c(t) be the third derivative of 0t + 0t3 + 0t4 + 0 + t2 + 1/15t5. Let i(u) = 2u. Calculate i(c(g)). 8g2 Let h(s) be the first derivative of 5 + 0s + 1/3	{ "pile_set_name": "DM Mathematics" }
t = -467 - -17749/38. What is the common denominator of 6/16 - 1521/(-360) - 2 and t? 190 Suppose 308 + 106 = 23j. What is the lowest common multiple of 42 and j? 126 Suppose 13i - 8i = 140. Calculate the lowest common multiple of 20 and i. 140 Suppose -c - 49 = -1231. Calculate the least common multiple of c and 6. 1182 Let y be ((-350)/6)/((-1)/51). Let k = -29791/10 + y. What is the common denominator of (-4)/(-14) - (-2 - 97/28) and k? 20 Suppose 4f + 20 = 5r, -r - r + 8 = 4f. What is the common denominator of 7/4 and -1(f + (-10)/4)? 4 Let r be 2 - ((-10)/(-75) - (-11042)/660). Let c = r + 115/11. Find the common denominator of -21/76 and c. 836 Suppose 92 = a + 3a. Suppose t + 5c + a = 0, -2t = c - 1 + 11. Calculate the lowest common multiple of 14 and (t - 0)(-32)/6. 112 Let l(v) = -58v + 20. What is the smallest common multiple of 169 and l(-1)? 1014 Let v = 4458 - 26623/6. Calculate the common denominator of -39/41 and v. 246 Let d = 7 - -43. What is the smallest common multiple of 150 and d? 150 Let g be 6/39 + 44/52. Let h be (10 + -1)/(g/5). What is the common denominator of (-89)/9h/30 and 107/10? 30 Let s(a) = 363346a. Let k be s(-1). Let j = -6905338/19 - k. Let t = -32569/342 - j. Find the common denominator of t and -17/14. 126 Calculate the least common multiple of 3 and -10(1/((-1)/9) + -5). 420 What is the smallest common multiple of 4 and (0 - -52)(-16 - -14)-1? 104 Suppose 0 = -4h - 2a - 2a + 8, -10 = -2h + 4a. Suppose -3d + h = -0. What is the least common multiple of d and ((-6)/10)/((-2)/(-30)-3)? 3 Suppose 0 = 46l - 313 - 147. Calculate the lowest common multiple of (-22)/(-2) - (-2 - -2) and l. 110 Let p be (0 - 92/(-5))-10. Let j = p - -101. Let m = j - -118. What is the smallest common multiple of 9 and m? 315 Let w = -2/3971 + -111170/35739. What is the common denominator of -97/2 and w? 18 Let n(u) = -u*3 - 10u*2 + 8u + 14. Let l(f) = f - 3. Let t be l(-8). What is the common denominator of -49/4 and n(t)? 4 Let u = -1456 - -1631. What is the smallest common multiple of 70 and u? 350 Find the common denominator of 15/28 and 3542/132 + 2-3. 84 Suppose -3k + k = 5t - 201, 4t + k = 159. Suppose 4v = 8, -4z - 4v - 53 + 169 = 0. Calculate the smallest common multiple of t and z. 351 Let o(k) = 108k - 396. What is the smallest common multiple of o(5) and 32? 288 Let p be (-4)/(-5)24585/22. Find the common denominator of (-6)/(-21) + p/56 and -4 + (-415)/(-70) + 0. 28 Calculate the common denominator of 12/19 and 9(-8)/(-396) + 334/220. 190 Let f = -48/23 - -2411/483. Find the common denominator of f and ((2 - -16) + (-15680)/420)/(-4 - -1). 63 Suppose 0 = -0n - n - 4y + 4, 12 = 3n - 4y. Calculate the lowest common multiple of 292 and n. 292 Let p = -379/11280 + 3/235. Let c = 61/528 - p. What is the common denominator of c and 115/14? 154 Let w(n) = n + 18. Let x(k) be the second derivative of k4/12 + k3 + 7k2/2 - 3k. What is the lowest common multiple of w(-13) and x(-5)? 10 Let w be 456015/90 - (-1)/6. Let l = 70909/14 - w. Calculate the common denominator of l and -85/16. 112 Let l = -56 + 36. What is the common denominator of -101/4 and -6((-75)/l + -3)? 4 Let p(j) = 6j - 8. Suppose 4s + 3m + 7 = 0, -s + m + 23 = 16. What is the lowest common multiple of p(3) and s? 10 Let m = 1921/1736 + 89/744. What is the common denominator of m and 41/42? 84 Let t = 91599766564389232 + -202533953856366724559564/2211075. Let f = -4/245675 + t. Let o = -4440 - f. Find the common denominator of o and -51/10. 90 Let b = -64 - -150. Calculate the least common multiple of 18 and b. 774 Let i be 1 + 3 + (-38937)/(-3). Let y = i + -493381/38. Find the common denominator of y and -69/22. 418 Let s(m) = -m*2 + 6m + 7. Let l be s(8). Let c(r) = 328r - 1. Let u be c(l). Let f = u - -17659/6. What is the common denominator of f and -1/8? 24 Let n = 18 + -29. Calculate the common denominator of -27/14 and (-166)/(-40) - (-22)/n. 140 Let s = -4/1257 + -3643/40224. What is the common denominator of s and -45/8? 32 Let h = -742 - -6017/8. Calculate the common denominator of 141/88 - 2/4 and h. 88 Calculate the common denominator of 4/2 + (-78)/8 and (300/315)/(-5)93/(-8). 28 Suppose -5a + a + 60 = 0. Calculate the common denominator of (-2)/(8/(-10))25991/(-16590) and (a/126)/(2/78). 84 Let q = -8 - -15. Let a(x) be the third derivative of x6/120 - x5/10 - 5x4/24 - 5x*3/6 - 32x*2. Calculate the least common multiple of a(q) and 6. 18 Find the common denominator of 1 + -6 + (-1428)/(-324) and 76/21. 189 Find the common denominator of -39/23 and (4/(-56)-2)/((-7)/(-217)). 161 Let q = 47 - 20. What is the lowest common multiple of -5 + -59(-2)/4 - 42/12 and q? 189 Let a(i) be the second derivative of i4/12 - i3/6 + i2 - 9i. Calculate the least common multiple of 10 and a(3). 40 Let u = -2049 - -94195/46. Find the common denominator of 375/20 + (-4 - -1) and u. 92 Suppose 0 = -2z + 5z - 36. Let b(a) be the second derivative of -a*4/12 + 7a*3/3 - 11a*2/2 + a + 12. What is the common denominator of 25/3 and b(z)? 3 What is the lowest common multiple of (16/10)/(8/80) and 222? 1776 Suppose 2n = -y + 3y - 4, -22 = -2y - 4n. Suppose -4 = -4i, 0 = -yk - 4i + 223 + 191. Find the common denominator of 2 + 1 + k/36 and 23/2. 18 Let q = 10776385/8 + -1344866. Let c = q - 2172. Find the common denominator of c and 38/57 + (-717)/(-18). 8 Let k be (-1018)/(-3450)(0 - (-1045)/50). Let r = k - 1/2875. Calculate the common denominator of r and -15/(-8)-10. 12 Let f = 240091/30 - 7997. Find the common denominator of f and -47/70. 210 Let s = 14 - 11. Suppose -13 = -0y - y - k, 45 = sy + 5k. Let m = 3 + 6. Calculate the smallest common multiple of m and y. 90 Suppose 45h - 54 = 42h. What is the smallest common multiple of 4 and h? 36 Let j be ((-1872)/8)/(28/(-1453)). Let o = j - 12151. What is the common denominator of o and (-5 + 4 + 2)/(14/(-40))? 14 Let s = 747 + -1052. Find the common denominator of 26/21 and 2/(-9) + 0 + s/(-90). 42 What is the common denominator of -9/4 and 1052/(-429) + (-84)/(-36)? 572 Suppose -6q = 86 + 34. Calculate the common denominator of -61/14 and ((-3)/q)/(72/690). 112 What is the common denominator of 101/20 and (-93071)/(-15246) - 56/5? 13860 Let c(f) = f*3 - 19f*2 + f - 20. Let s be c(19). Suppose -i = -3i + 6. What is the lowest common multiple of (-50)/(-15)(s + (-33)/(-15)) and i? 12 Suppose -2a + r + 31 = -33, 8 = r. Suppose -2f + f + 18 = 0. What is the least common multiple of f and a? 36 Suppose 4q + q = 4k - 560, 5k - 2q - 700 = 0. Let r = k - 130. Let x = -6 + 8. Calculate the smallest common multiple of r and x. 10 Let q = 11965/1023 + -10/341. Find the common denominator of 590/(-4)(-1)/30 and q. 12 Let p(k) = -k*3 - 5k*2 - 3k + 6. Let m be p(-5). Suppose -f - 6f = -m. What is the least common multiple of f and 1? 3 Suppose -2x + 0x = -2p + 10, p = 3x + 9. Let d(h) = -h3 - h2 + 4h. Calculate the smallest common multiple of d(-3) and p. 6 Suppose 0r = 3r. Let q(m) = 9m2 + 12m + 3. Calculate the common denominator of q(-2) and (-5 + r)-8 + -2. 1 Let w = -42 + 66. Suppose 31z - wz = 28. What is the lowest common multiple of z and 6? 12 Let f = 23363/7 - 3345. What is the common denominator of -28/521 and f? 3647 Suppose -18 = -12b - 66. What is the lowest common multiple of 210/25 - (0 + b/(-10)) and 12? 24 Suppose -w + 3w + 301 = z, 3z - 897 = 3w. Calculate the smallest common multiple of z and 1. 297 Let o = 54833/18 - 3050. Let z = -230 + 248. Calculate the common denominator of z/63 + (-4885)/(-420) and o. 36 Let u = 74877/40 - 1869. Calculate the common denominator of 139/120 and u. 120 Let k = 615676/5 - 13524697/110. Let l = 23151/44 - k. Let m = -6747/20 + l. Calculate the common denominator of 34/3 and m. 15 Let n be (1 - 58) + (-16)/(-4). What is the common denominator of 13/12 and 5 + -9 - n/22? 132 Suppose -3z + 0d + 2d + 14 = 0, 0 = d + 4. Let f = 7247/444 + -8/111. Find the common denominator of f and (-1469)/1287 - z/9. 44 Let f = 8 + 2. Find the common denominator of 97/18 and 372/(-32)2(-4)/f. 90 Let d(c) = -6*c + 16. Let j be d(-7). Let k = j - 268/5	{ "pile_set_name": "DM Mathematics" }
2. 22 Calculate the greatest common divisor of 63 and 692433. 63 Calculate the highest common divisor of 13 and 28691. 13 What is the highest common divisor of 4002 and 8832? 138 What is the highest common divisor of 14180 and 90? 10 Calculate the greatest common divisor of 43309 and 79355. 269 What is the highest common divisor of 7657 and 57? 19 What is the highest common factor of 25496 and 40? 8 What is the greatest common divisor of 28 and 8449? 7 What is the highest common divisor of 837670 and 1055? 1055 Calculate the greatest common factor of 184352 and 224. 224 Calculate the greatest common factor of 3796 and 208. 52 What is the highest common factor of 553 and 21409? 79 What is the greatest common divisor of 18 and 9963? 9 What is the greatest common factor of 313725 and 188? 47 What is the greatest common factor of 1292 and 6800? 68 Calculate the highest common divisor of 140 and 1230810. 70 Calculate the greatest common divisor of 73 and 88841. 73 What is the highest common factor of 3560 and 343985? 445 What is the highest common factor of 1050548 and 601? 601 What is the greatest common factor of 3725013 and 9390? 939 Calculate the highest common factor of 286 and 15262. 26 Calculate the greatest common factor of 49 and 11652200. 49 What is the highest common divisor of 4383966 and 213? 213 What is the highest common factor of 9 and 1996281? 9 What is the greatest common divisor of 1552 and 968? 8 Calculate the highest common divisor of 567 and 145719. 567 Calculate the greatest common factor of 150 and 6275. 25 What is the greatest common divisor of 3315 and 238? 17 What is the greatest common factor of 39903 and 96786? 849 What is the greatest common factor of 2571 and 687? 3 Calculate the highest common divisor of 4131 and 15. 3 Calculate the greatest common factor of 4898 and 7742. 158 Calculate the greatest common factor of 76 and 25726. 38 What is the greatest common factor of 16 and 113416? 8 What is the highest common factor of 26207 and 2117? 73 What is the highest common factor of 75103 and 70? 7 What is the highest common factor of 380 and 105830? 190 Calculate the highest common divisor of 36 and 291123. 9 Calculate the highest common divisor of 40650 and 15900. 150 What is the greatest common divisor of 2597 and 40439? 371 Calculate the highest common divisor of 204607 and 403. 13 What is the highest common divisor of 6182 and 33? 11 Calculate the highest common factor of 12915 and 17325. 315 Calculate the highest common divisor of 278348 and 28. 28 What is the highest common factor of 29556 and 252? 36 What is the highest common factor of 100 and 362760? 20 What is the highest common divisor of 54700 and 500? 100 What is the highest common factor of 321 and 314473? 107 Calculate the highest common factor of 255 and 49045. 85 Calculate the greatest common divisor of 133 and 742273. 133 Calculate the greatest common divisor of 189 and 63423. 27 What is the greatest common factor of 4671 and 81? 27 What is the highest common factor of 308 and 93544? 44 What is the highest common divisor of 13775 and 493? 29 Calculate the greatest common divisor of 303 and 198162. 303 Calculate the highest common divisor of 7 and 232351. 7 What is the greatest common divisor of 70 and 2261630? 70 What is the highest common factor of 239679 and 538? 269 What is the highest common factor of 121077 and 18? 9 Calculate the highest common divisor of 178512 and 144. 48 What is the greatest common factor of 85734 and 990? 198 Calculate the highest common divisor of 16 and 6124. 4 Calculate the greatest common factor of 150836 and 252. 28 Calculate the highest common divisor of 2788 and 476. 68 Calculate the highest common factor of 9947 and 27811. 203 Calculate the greatest common divisor of 101 and 431876. 101 Calculate the highest common factor of 1032 and 30573. 129 What is the highest common divisor of 58 and 94801? 29 What is the greatest common divisor of 800 and 120? 40 Calculate the highest common factor of 293 and 11588736. 293 What is the highest common factor of 7040624 and 16? 16 What is the highest common divisor of 120 and 974928? 24 Calculate the greatest common divisor of 11711 and 196. 49 Calculate the greatest common factor of 344923 and 131. 131 What is the greatest common divisor of 2198 and 352936? 314 What is the greatest common divisor of 50398 and 67123? 223 Calculate the highest common divisor of 120 and 9624. 24 What is the highest common divisor of 836 and 1896884? 836 What is the greatest common divisor of 42300 and 195? 15 Calculate the highest common factor of 4944 and 1096. 8 Calculate the highest common divisor of 21007 and 42. 7 Calculate the highest common factor of 434 and 80766. 14 What is the highest common factor of 186315 and 15? 15 What is the highest common divisor of 1368 and 14478? 114 What is the greatest common divisor of 16065408 and 384? 384 What is the greatest common divisor of 13592 and 8? 8 Calculate the highest common divisor of 45 and 143145. 45 What is the highest common divisor of 8544648 and 12? 12 Calculate the greatest common factor of 13462 and 7102. 106 What is the highest common factor of 5687100 and 54? 18 What is the greatest common divisor of 33 and 1189023? 33 Calculate the greatest common factor of 150178 and 1071. 119 What is the greatest common factor of 11745 and 207? 9 What is the greatest common divisor of 26818 and 12826? 1166 Calculate the highest common divisor of 7536 and 83424. 48 What is the highest common divisor of 17152 and 67? 67 What is the highest common factor of 10650 and 1200? 150 Calculate the highest common factor of 76 and 895204. 76 What is the highest common factor of 333630 and 550? 110 Calculate the greatest common divisor of 26244 and 23814. 486 Calculate the highest common divisor of 2642150 and 14. 14 Calculate the highest common divisor of 1296 and 189. 27 Calculate the greatest common factor of 57324 and 3091. 281 Calculate the greatest common factor of 16170 and 51810. 330 Calculate the greatest common divisor of 2106 and 1248. 78 What is the highest common divisor of 780286 and 52? 26 Calculate the greatest common factor of 3876 and 39780. 204 Calculate the greatest common divisor of 218684 and 92. 92 Calculate the highest common factor of 8959 and 30634. 289 Calculate the highest common factor of 110747 and 91. 91 What is the highest common factor of 1280 and 6560? 160 What is the greatest common divisor of 9210 and 1905? 15 Calculate the greatest common divisor of 18666 and 1326. 102 What is the highest common factor of 1157 and 56782? 89 Calculate the greatest common divisor of 400 and 64. 16 What is the greatest common factor of 423927 and 1008? 63 Calculate the highest common divisor of 396 and 133364. 44 Calculate the greatest common factor of 148 and 57091. 37 Calculate the greatest common factor of 121595 and 996. 83 Calculate the greatest common factor of 35844 and 2266. 206 What is the greatest common factor of 3090 and 2220? 30 Calculate the greatest common factor of 117 and 85111. 13 What is the greatest common factor of 489356 and 196? 28 What is the greatest common divisor of 183813 and 21? 21 What is the highest common divisor of 11398 and 24436? 82 What is the highest common factor of 72 and 4347? 9 What is the highest common divisor of 13 and 4301687? 13 Calculate the greatest common factor of 6456350 and 100. 50 What is the highest common factor of 175 and 8850? 25 Calculate the greatest common factor of 16 and 1279048. 8 What is the greatest common divisor of 58 and 938? 2 What is the highest common factor of 80 and 1707? 1 Calculate the highest common divisor of 36103 and 1264. 79 What is the highest common factor of 165066 and 65758? 1342 What is the highest common factor of 312500 and 10? 10 What is the greatest common divisor of 307232 and 176? 16 Calculate the greatest common divisor of 1893 and 27. 3 What is the highest common divisor of 889 and 1169? 7 Calculate the highest common divisor of 842570 and 2180. 1090 Calculate the highest common factor of 7024 and 76. 4 What is the greatest common factor of 14 and 131194? 14 What is the greatest common divisor of 871 and 4043? 13 Calculate the highest common factor of	{ "pile_set_name": "DM Mathematics" }
2). -38 What is the value of 97 + 9 + (2 - -23) + -37? 94 What is the value of (18 + 0 - (-3 - -24)) + 73 + -2 + -4? 64 Evaluate -42 + (-70 - (-100 - -51)). -63 Evaluate -38 - (5 + -8 + 32 + -7). -60 Evaluate -9 + -31 + 153 + -170. -57 11 - ((252 - 315) + (18 - -1)) 55 What is -7 - -13 - (-77 - -39 - (11 + -1))? 54 Calculate 72 - (26 + 40 + 60). -54 Evaluate 4 + -22 - -2 - (2230 - 2257). 11 What is the value of (-93 - (-52 + -24)) + 1 + -4 + -32? -52 Calculate (20 - (4 + 0)) + (-291 - -291). 16 -58 + -6 - 1 - (66 - 37 - 51) -43 What is the value of 10 + 39 + -40 - 51? -42 11 + (57 - 59) - -5 14 (41 - -43) + -196 + (0 - (-16 - -4)) -100 What is (15 - 2 - 16) + (2 - 13)? -14 What is the value of -1 - 1 - (0 - 4 - (-1 + (9 - 11)))? -1 Calculate -5 + 69 + -47 + (-30 - 5). -18 What is -2 + -2 + 2 + -1 + (-2064 - -2118)? 51 Calculate 45 - (37 - (-132 - -41)). -83 What is -13 + 62 + -53 + 38? 34 Evaluate -26 + (-57 + 106 - 45). -22 (0 - ((-1 - (1 - 9)) + -9)) + -3 + 8 7 What is -1 + 0 + 13 + -13 + 4? 3 Evaluate 63 + (12 - 32) + -43. 0 68 - (3 - 8 - 0 - (-12 - (-36 - -24))) 73 (-2 - (48 + -59)) + 0 + -28 - 15 -34 What is -3 + 2 + -2 + -58 + -12 + (23 - -14)? -36 0 + -7 + 1 - (38 - (6 - 11 - -7)) -42 Calculate (56 + -1 - 9) + -53. -7 What is the value of 735 + -689 - (1 + -2)? 47 What is 77 + -80 + (-3 - (61 + 6 + -5) - 0)? -68 What is the value of -2 + -16 - (1222 + -1173)? -67 What is the value of -6 - (8 + -9 + 25 + -166 + 4)? 132 36 + (2029 - 2154 - (-25 + -1)) -63 Calculate (2 - 0) + (4 + -20 - (95 + -6 + -8)). -95 Evaluate 71 - 153 - -92 - (46 - -3). -39 Calculate -134 + (139 - 15) - (2 - 124). 112 What is the value of 0 + (-1 - 87) + (2 - -42) + (-1268 - -1237)? -75 What is the value of 4 + 35 + -20 + -54 - 4? -39 What is the value of -69 + 53 - (8 + -12 + 40)? -52 Calculate 8 - 10 - -18 - (-10 + -4). 30 Calculate (4 + -19 - 5) + (53 - 37). -4 Evaluate 59 - (136 + (-108 - -128)). -97 Evaluate (-8 - -26 - 54) + (12 - (16 + 3) - 6). -49 (-47 + 15 - -75) + -16 27 What is the value of -54 + (86 + -123 - 10)? -101 What is the value of 13 - ((-1145 - -1169) + 1 + 51)? -63 What is 54 - -20 - 43 - (59 + 5)? -33 Evaluate 69 + (71 - 132) - (11 + -5 - -120). -118 Calculate -867 - -835 - (10 - 1). -41 Calculate -4 - (10 - (15 - (-32 + (5 - -8)))). 20 Calculate 32 + -19 - (-8 + 20 + -48). 49 What is the value of -15 + 67 + 25 + (-10 - -3) + -1? 69 Calculate -35 + -3 + (2 - -8) - (-7 + 11 + 1). -33 What is -13 + 4 + 2 + 2 + -5 - (-187 - -149)? 28 -10 - (22 - (-11 - -27) - (8 - 0)) -8 Calculate -89 + (3 - (5 + -16)) - (26 - 45). -56 Calculate (-1 - -7) + (43 - 88) + 32 + 60. 53 Calculate 44 - (36 - 80 - -71). 17 What is 1 + ((-23 - (0 - 7)) + 9 - (-10 - 2))? 6 What is the value of 78 + -78 - (25 - (-1 + (-4 - -5 - 4)))? -29 17 - 23 - (16 - 37) - (3 + 35) -23 Calculate 0 + 1 + 5 + 2 + 0 + -438 + 377. -53 -156 - (-44 + -32 + 69 - 27) -122 What is the value of 0 - 1 - ((-31 - -8) + 56 + -21)? -13 What is the value of 129 - (97 - 38 - -5)? 65 Evaluate 41 - (-24 - (-71 - -16)) - -74. 84 Calculate (-2809 - -2754) + (3 - 21). -73 Evaluate 89 - (71 - -7) - -66. 77 Evaluate -1 + (-11 - (-41 + 43)) + (-1 - -11). -4 What is the value of 15 + 0 - (2 + 88 - 71)? -4 What is -33 - (15 + -29 + -44)? 25 What is the value of (6 - 20) + 15 + 8 + -10? -1 What is 33 - (7 + -25 + 21)? 30 What is the value of 0 + -11 - (-35 + (2 - -8))? 14 Calculate (628 - 676) + 4 + (3 - 2). -43 Calculate (8 - (17 - -2)) + 1 + 14. 4 -5 + 16 + 12 + (21 - (0 + 21)) 23 Evaluate -6 - (57 + (-8 + (8 - 5) - -2 - -1)). -61 What is the value of 14 + 11 + (-10 - (4 + 1)) - 3? 7 What is the value of -13 + (-3 - (-2 - (-4 + 7) - 5))? -6 Calculate 23 + 1 + -3 + (-46 - -28). 3 What is the value of -401 - -447 - (-5 + (4 - -3 - 3))? 47 (2 - 44) + 10 - -55 23 -9 + -15 + 15 + 14 + (-3 - (58 + -2)) -54 What is 105 + -126 - (-17 - 1) - -20? 17 What is 47 + -151 - (7 + (29 - 15))? -125 What is the value of (3 - 37) + (495 - 439)? 22 Evaluate (-16 + (13 - -9) - 26 - -32) + (-3 - -41). 50 Calculate (-1 - 55) + -5 + 5 + (31 - (-48 - -76)). -53 What is -12 - (-19 - (-26 + 14)) - (-2 + -10)? 7 Calculate 54 + 12 + -14 + 11 + (-2 - 4 - 3). 54 Calculate -149 + 205 - (99 - -79). -122 What is the value of -7 + (103 - 104) + (-2 - 17)? -27 (-1 - (55 - 1)) + 3 - (23 - (5 - -17)) -53 What is the value of 9 + 2 + -47 + (19 - (-18 - -16 - -27))? -42 Calculate (-114 + 107 - (1 + (3 - 5) - 0)) + -46. -52 90 - (-221 + 185 - (-5 + -50)) 71 Evaluate 1 - (9 + (-7 - -7) - (3 + 7)). 2 Calculate (-1 - 9) + 5 - (186 + -175). -16 What is 12 - (41 + 13 + 9 + -8 + -25)? -18 Evaluate (19 - 3) + -3 - 17 - -2 - -15. 13 2 - 45 - (88 - (-43 - -111)) -63 What is the value of (17 - 19 - (-2 + -1)) + -79 + 33? -45 Evaluate -17 + 27 + (17 - (0 - -3) - 10). 14 Calculate -320 + 410 + -46 + 8. 52 What is 0 - 0 - 5 - (-25 + -131 + 146) - -63? 68 Calculate -29 + 14 + 42 - (-2 + (-2 - 8)). 39 -187 + 204 + (5 - 74) + -21 -73 -45 + -1 + (8 - (-27 + (-37 - -72))) -46 What is the value of -32 + (809 - 812 - (10 + 0))? -45 Calculate (-6 + 2 - 98) + (2 - (6 - 5)) - 3. -104 What is (-1161 - -1072) + (-3 - -199)? 107 Calculate 5 - 0 - -19 - -18 - -5. 47 Evaluate (413 + -363 - ((0 - -2) + 10)) + -7. 31 What is the value of -39 + -11 + (-52 - -112)? 10 Calculate (-1031 - -1052) + (2 - 42). -19 Evaluate 367 + -305 + 1 + (4 - 1) + -5 + -6. 55 Evaluate 7 + -14 + 11 - (4 - -10 - 6). -4 What is the value of (2 - (-46 - -2)) + (-12 - -2 - (35 + -50))? 51 Evaluate -5 - (-15 + -6 + 4 + 12). 0 Calculate (-64 + -4 - (-17 - -10)) + 5. -56 (-13910 - -14121) + -116 + -1 94 What is the value of -37 - (66 + -84 + -22)? 3 Calculate -330 + 148 + 207 + (-1 - -24). 48 Calculate (-399 - -382 - (-8 - 0)) + 7 + -9. -11 Evaluate (13 - -54 - 41) + -3. 23 Calculate -1 + -19 - (89 + -37 + 40 + -40). -72 Calculate 11 - 103 - (-125 + 67). -34 What is the value of (-23 - 2) + 1 + (-322 - (88 - 361))? -73 Evaluate 110 - ((-1 - -11) + 17 - 32). 115 Evaluate -30 + -85 + 125 - (0 - 24). 34 Calculate 0 - ((24 - -7 - -4) + -12) - (6 - 4). -25 What is (-15 + 8 - 8) + (101 - 128)? -42 Evaluate -94 + 60 + 42 - 27. -19 What is -2 + -80 - (524 - 670)? 64 Evaluate 45 + (-44 - -50) + 10. 61 Evaluate -94 + (-12 - -66) - -78. 38 What is the value of 4 + (17 - 3) + -154 + (3 - -4) + 8? -121 Calculate -2 + 1 + 12 + -12 - (50 + -2). -49 Evaluate (-4 - 64 - ((6 - -4) + -7)) + -8. -79 What is the value of -59 - (30 + 28 + -44) - 14? -87 What is the value of -54 + (59 - (-83 - 0))? 88 -18 + -4 + 21 - (-4 + 48) - 14 -59 What is 3 - (-21 + (1 - 4) + 22) - 79? -74 What is the value of 80 + -60 + 30 - 19 - 119? -88 What is -881 + 899 - (51 - -1)? -34 What is (5 - 15 - -5 - (-78 + 63)) + (1 - -23)? 34 5 - -1 - (29 + (-49 - -33)) - (10 + -18) 1 Calculate 0 + -21 + 42 + (-34 - -35). 22 -7 + -3 + 202 + -141 + (0 - 9) 42 What is the value of -9 + -2 + -2 + (-18 - -27) + -37? -41 Calculate 42 - 36 - (40 + -46 + (10 - -1)). 1 (-39 - (17 + -7)) + -73 + (-1 - -19) -104 What is the value of -6 + (6 - -55) - 56? -1 Calculate -36 + (130 + 9 - 54). 49 Evaluate 17 + (631 - 614 - (2 - (-3 - 23))). 6 What is 111 - ((-8 - ((2 - 11) + -6)) + 9 - 4)? 99 Evaluate -109 - (81 + -236 + 76). -30 (112 + -122 - (-6 - (6 - 10))) + -2 + -95 -105 Evaluate -80 + (-35 - 29 - -76). -68 Calculate 222 - (155 - 3) - 114. -44 What is the value of -31 - (-107 + -20 + 58)? 38 -23 + -1 - -8 - -34 18 What is the value of -10 + (28 - 8) + (-11 + 3 - -2 - -4)? 8 What is 16 + 9 + (17 - 5 - 16 - 65)? -44 Evaluate (0 - -8) + (22 - (-9 + -10 - -54)). -5 What is the value of -24 + 0 + (-277 - -353) + 43? 95 What is (-5 - 0) + 21 + -1 + -17 - -12? 10 -11 + (9 - (8 - -132)) - (-6 - -2 - -7) -145 Evaluate -13 - ((83 - 292) + 219 - (1 + 58 - 0)). 36 (158 + -47 - 205) + 118 24 3 + 12 + 1 + -71 -55 Calculate -1257 - -1228 - (-4 + 29 + -3). -51 What is -317 + 313 - (-78 + -7)? 81 Evaluate (1 + -5 + -60 - -4) + 5 - (-223 - -209). -41 Evaluate -79 - -75 - (2 + -10 + 122). -118 -33 + -73 + 132 - (21 + -1) 6 3 + (-8 - -14 - (0 + 10)) + 25 24 -340 + 253 + (2 - (2 + 2) - (6 + 2)) -97 What is 42 + -50 + -17 + (3 - -39)? 17 What is 1 + 3 + -6 + -3 - ((9 - 47) + 46)? -13 What is the value of -262 + 255 - (5 + -7)? -5 Evaluate (-7 - -48) + -3 + -10 + 29. 57 What is the value of -	{ "pile_set_name": "DM Mathematics" }
is the remainder when 481 is divided by 11? 8 Calculate the remainder when 1432 is divided by 144. 136 What is the remainder when 143 is divided by 69? 5 What is the remainder when 40 is divided by 22? 18 What is the remainder when 103 is divided by 12? 7 What is the remainder when 144 is divided by 15? 9 What is the remainder when 8740 is divided by 31? 29 What is the remainder when 188 is divided by 39? 32 What is the remainder when 65601 is divided by 28? 25 What is the remainder when 39 is divided by 20? 19 What is the remainder when 314 is divided by 7? 6 What is the remainder when 649 is divided by 437? 212 What is the remainder when 18619 is divided by 196? 195 What is the remainder when 652 is divided by 9? 4 Calculate the remainder when 944 is divided by 9. 8 Calculate the remainder when 429 is divided by 36. 33 What is the remainder when 609 is divided by 201? 6 What is the remainder when 3509 is divided by 293? 286 What is the remainder when 41 is divided by 17? 7 What is the remainder when 589 is divided by 67? 53 Calculate the remainder when 1804 is divided by 9. 4 What is the remainder when 1385 is divided by 329? 69 What is the remainder when 1003 is divided by 53? 49 What is the remainder when 58 is divided by 17? 7 What is the remainder when 313 is divided by 182? 131 What is the remainder when 48 is divided by 18? 12 What is the remainder when 220 is divided by 25? 20 What is the remainder when 260 is divided by 19? 13 What is the remainder when 54 is divided by 15? 9 Calculate the remainder when 261 is divided by 57. 33 Calculate the remainder when 107 is divided by 41. 25 What is the remainder when 36 is divided by 36? 0 Calculate the remainder when 2254 is divided by 141. 139 What is the remainder when 5142 is divided by 245? 242 Calculate the remainder when 555 is divided by 62. 59 What is the remainder when 348 is divided by 14? 12 Calculate the remainder when 4587 is divided by 62. 61 What is the remainder when 834 is divided by 49? 1 Calculate the remainder when 1556 is divided by 38. 36 What is the remainder when 79 is divided by 4? 3 Calculate the remainder when 158 is divided by 5. 3 Calculate the remainder when 297 is divided by 108. 81 Calculate the remainder when 676 is divided by 61. 5 What is the remainder when 3905 is divided by 18? 17 Calculate the remainder when 70 is divided by 40. 30 What is the remainder when 1645 is divided by 409? 9 What is the remainder when 123 is divided by 36? 15 What is the remainder when 607 is divided by 13? 9 Calculate the remainder when 717 is divided by 12. 9 What is the remainder when 425 is divided by 14? 5 Calculate the remainder when 825 is divided by 18. 15 Calculate the remainder when 620 is divided by 48. 44 What is the remainder when 1325 is divided by 51? 50 Calculate the remainder when 299 is divided by 76. 71 Calculate the remainder when 444 is divided by 45. 39 Calculate the remainder when 120 is divided by 21. 15 What is the remainder when 29 is divided by 14? 1 What is the remainder when 4677 is divided by 260? 257 What is the remainder when 277 is divided by 49? 32 Calculate the remainder when 38 is divided by 3. 2 What is the remainder when 7874 is divided by 35? 34 Calculate the remainder when 162 is divided by 33. 30 What is the remainder when 489 is divided by 201? 87 Calculate the remainder when 610 is divided by 349. 261 Calculate the remainder when 15 is divided by 9. 6 Calculate the remainder when 393 is divided by 133. 127 What is the remainder when 2336 is divided by 19? 18 Calculate the remainder when 541 is divided by 31. 14 Calculate the remainder when 448 is divided by 46. 34 What is the remainder when 5270 is divided by 21? 20 What is the remainder when 105 is divided by 44? 17 Calculate the remainder when 282 is divided by 60. 42 What is the remainder when 1341 is divided by 48? 45 What is the remainder when 3333 is divided by 145? 143 What is the remainder when 753 is divided by 248? 9 What is the remainder when 42199 is divided by 211? 210 Calculate the remainder when 263 is divided by 14. 11 Calculate the remainder when 155 is divided by 51. 2 Calculate the remainder when 12142 is divided by 46. 44 What is the remainder when 36 is divided by 31? 5 What is the remainder when 229 is divided by 229? 0 What is the remainder when 1085 is divided by 13? 6 What is the remainder when 842 is divided by 298? 246 Calculate the remainder when 3670 is divided by 27. 25 What is the remainder when 78 is divided by 27? 24 What is the remainder when 136 is divided by 45? 1 Calculate the remainder when 161 is divided by 13. 5 Calculate the remainder when 82 is divided by 41. 0 Calculate the remainder when 216 is divided by 69. 9 Calculate the remainder when 772 is divided by 119. 58 What is the remainder when 80 is divided by 33? 14 What is the remainder when 168 is divided by 25? 18 Calculate the remainder when 1325 is divided by 337. 314 Calculate the remainder when 41 is divided by 40. 1 Calculate the remainder when 641 is divided by 19. 14 Calculate the remainder when 15 is divided by 8. 7 Calculate the remainder when 464 is divided by 11. 2 What is the remainder when 174 is divided by 36? 30 Calculate the remainder when 158 is divided by 110. 48 Calculate the remainder when 106 is divided by 30. 16 Calculate the remainder when 179 is divided by 36. 35 What is the remainder when 489 is divided by 121? 5 What is the remainder when 640 is divided by 72? 64 What is the remainder when 518 is divided by 130? 128 Calculate the remainder when 9501 is divided by 13. 11 What is the remainder when 3475 is divided by 58? 53 Calculate the remainder when 121 is divided by 62. 59 What is the remainder when 787 is divided by 19? 8 Calculate the remainder when 1799 is divided by 24. 23 What is the remainder when 1714 is divided by 498? 220 What is the remainder when 177 is divided by 130? 47 Calculate the remainder when 6334 is divided by 35. 34 What is the remainder when 199 is divided by 30? 19 Calculate the remainder when 1091 is divided by 91. 90 What is the remainder when 649 is divided by 21? 19 What is the remainder when 6875 is divided by 20? 15 What is the remainder when 363 is divided by 82? 35 What is the remainder when 7018 is divided by 17? 14 What is the remainder when 2264 is divided by 11? 9 What is the remainder when 28 is divided by 21? 7 Calculate the remainder when 138 is divided by 53. 32 What is the remainder when 43 is divided by 22? 21 What is the remainder when 1463 is divided by 211? 197 What is the remainder when 1050 is divided by 38? 24 Calculate the remainder when 242 is divided by 36. 26 What is the remainder when 789 is divided by 66? 63 Calculate the remainder when 164 is divided by 39. 8 What is the remainder when 2040 is divided by 14? 10 Calculate the remainder when 90 is divided by 27. 9 What is the remainder when 1729 is divided by 59? 18 What is the remainder when 565 is divided by 18? 7 What is the remainder when 820 is divided by 168? 148 Calculate the remainder when 824 is divided by 75. 74 Calculate the remainder when 17278 is divided by 384. 382 What is the remainder when 39 is divided by 25? 14 What is the remainder when 156 is divided by 53? 50 Calculate the remainder when 987 is divided by 16. 11 Calculate the remainder when 340 is divided by 175. 165 Calculate the remainder when 246 is divided by 18. 12 Calculate the remainder when 6610 is divided by 2197. 19 What is the remainder when 278 is divided by 48? 38 What is the remainder when 208 is divided by 42? 40 What is the remainder when 19568 is divided by 38? 36 Calculate the remainder when 168 is divided by 59. 50 What is the remainder when 273 is divided by 85? 18 Calculate the remainder when 240 is divided by 83. 74 What is the remainder when 8200 is divided by 28? 24 What is the remainder when 574 is divided by 69? 22 What is the remainder when 512 is divided by 163? 23 Calculate the remainder when 3382 is divided by 94. 92 What is the remainder when 7503 is divided by 14? 13 Calculate the remainder when 5623 is divided by 148. 147 Calculate the remainder when 250 is divided by 53. 38 Calculate the remainder when 121 is divided by 4. 1 What is the remainder when 3	{ "pile_set_name": "DM Mathematics" }
hich is greater: 25 or -0.172? 25 Which is smaller: 2 or 162/127? 162/127 Is -4735 >= -4735? True Is 2 > 14? False Are -56.9 and -0.14 unequal? True Is -128 <= -140? False Are 12/59 and 0 unequal? True Which is greater: -29 or -491? -29 Is -136 greater than or equal to -139? True Is -42/19 less than or equal to -3? False Is 87 <= 98? True Is -84 bigger than 0.06? False Do -19003 and -19003 have the same value? True Is -3/53 not equal to 4? True Does -1 = -3/40? False Is 297 smaller than 595/2? True Which is smaller: -26/135 or -0.1? -26/135 Which is smaller: -2/49 or -168? -168 Is -1784 less than or equal to -1784? True Is -5/151 <= -1? False Which is greater: 4 or 0.0185? 4 Is 383/4 <= 97? True Is 2335 > 2333? True Is 0.9 less than or equal to -1/7? False Which is bigger: 0 or -11/51? 0 Which is greater: 43 or 38? 43 Does -4147 = 0.2? False Is 362 less than 361? False Are -1043 and -1042 unequal? True Which is smaller: -8 or -14? -14 Is -50174 greater than -50174? False Which is greater: -23 or -8? -8 Which is greater: -755 or -758? -755 Which is bigger: -1500 or -1502? -1500 Which is smaller: 280 or 281? 280 Which is smaller: -1 or 5/14? -1 Is 27 equal to 6? False Which is bigger: 101/2 or -2? 101/2 Which is greater: 0 or -0.08073? 0 Which is bigger: -19 or 3? 3 Is -4 < -29? False Which is bigger: -2/1683 or 0? 0 Which is greater: -373 or -332? -332 Are -300 and -300 unequal? False Is -0.1 bigger than 37/4? False Which is smaller: 28 or 32? 28 Is 24 < -7? False Which is bigger: -76 or 0? 0 Which is greater: -353/8 or -43? -43 Which is smaller: -4/7479 or 0? -4/7479 Which is smaller: 1537 or 1535? 1535 Which is smaller: 33/28 or 1? 1 Which is bigger: 62 or 12? 62 Which is smaller: -7 or -410? -410 Are -14188 and -14188 nonequal? False Is -12 less than -12? False Is 19 bigger than 38? False Which is smaller: 172 or 1? 1 Which is smaller: -22 or 151? -22 Do -1236 and -1236 have the same value? True Is 11 less than 9? False Which is smaller: -1 or -1/2188? -1 Is -38 greater than -37? False Are 0.2 and -73 unequal? True Is -1391 smaller than -1389? True Is 3 greater than or equal to -0.3414? True Is 144 >= 146? False Which is smaller: -69 or -68? -69 Is -1/6171 at most as big as 0? True Which is smaller: -1 or -28/983? -1 Which is smaller: 1 or 15/1508? 15/1508 Which is smaller: 1675 or 1674? 1674 Is -170 at least as big as 17? False Is -279 >= -1948/7? False Is -472 not equal to -467? True Is -1 greater than 10/423? False Which is smaller: 3/5 or -5/3? -5/3 Which is smaller: -300 or -67? -300 Is -1 at most -814? False Which is smaller: -13752/11 or -1251? -1251 Which is bigger: -30 or -0.0139? -0.0139 Which is smaller: -5/16 or -2? -2 Which is smaller: -12/121 or 0? -12/121 Are 1950 and 1950 unequal? False Is -1 smaller than 2/217? True Are 6 and 63/11 equal? False Which is greater: -23 or -4? -4 Do 264 and 265 have the same value? False Which is bigger: -3/1255 or -1? -3/1255 Which is smaller: 1421 or 2/3? 2/3 Which is greater: 128 or -2/19? 128 Is -2/957 < -3? False Which is smaller: 0 or 2/181? 0 Which is bigger: -11/786 or 1? 1 Which is greater: 0 or -2/31851? 0 Are 12 and -3 equal? False Which is bigger: 1 or 1/13765? 1 Are -768 and -3077/4 nonequal? True Which is bigger: -2/933 or 1? 1 Is 110 at least as big as -18? True Is -248 not equal to -249? True Which is smaller: 2/6253 or 1? 2/6253 Is 1720 greater than 1720? False Which is smaller: 2/5931 or 1? 2/5931 Which is bigger: -127 or -1640/13? -1640/13 Do 0 and -3/4 have different values? True Is -35 smaller than -34? True Which is smaller: 162 or -10? -10 Are 0 and 5/131 equal? False Which is bigger: -2068/3 or 2/9? 2/9 Which is bigger: 9568 or 9570? 9570 Which is smaller: -1033 or -1034? -1034 Is 1 < -1/1389? False Which is greater: 263/14 or 20? 20 Which is bigger: 91 or 85? 91 Which is bigger: 14 or -7? 14 Is 1010 less than or equal to 1006? False Which is smaller: 1/13 or -0.3? -0.3 Is -2/35 smaller than -1? False Which is smaller: 11/127 or 1? 11/127 Is 3/871 >= -1? True Is -34 at most 4? True Which is smaller: 1 or 2/1995? 2/1995 Which is bigger: 180 or 179? 180 Which is greater: -37/23 or -1? -1 Which is smaller: 18 or 71? 18 Do 0 and 64/2273 have different values? True Which is smaller: 0.6 or -1/30? -1/30 Is 12082 at most 12082? True Which is bigger: 2479 or 2480? 2480 Which is bigger: -5492/7 or -786? -5492/7 Is -11/1284 smaller than 0? True Is -4.2 not equal to 0.033? True Which is greater: -0.01023 or 4/3? 4/3 Is -10 bigger than 14? False Is -145 <= -0.05? True Is -58 > -55? False Is 6172/17 smaller than 362? False Which is smaller: -0.053 or -14? -14 Is -250 < 1? True Which is smaller: -19 or 7? -19 Which is greater: 62 or 0.2? 62 Does 363 = 367? False Which is greater: -239 or -1664/7? -1664/7 Which is greater: 855 or 872? 872 Is -2/57 less than -19? False Is -1 less than or equal to -1915? False Is 148 != 148? False Is 6 at most 49/30? False Is -0.1 less than -0.09385? True Which is bigger: 31 or 25? 31 Which is greater: -761 or -759? -759 Which is smaller: -1/3 or -6.4? -6.4 Which is smaller: 277 or 279? 277 Is 263 <= -0.04? False Which is greater: -484/73 or -7? -484/73 Is 57 < -2/395? False Which is bigger: 0 or 1/1200? 1/1200 Does -127 = -127? True Which is smaller: -88 or 0.09? -88 Which is greater: 0.06 or -14? 0.06 Which is smaller: -13 or -10? -13 Which is smaller: -10 or 5/4? -10 Is -1053 greater than or equal to -1052? False Which is bigger: -47 or -15? -15 Which is greater: -283 or -253? -253 Which is greater: -2/1041 or -1? -2/1041 Are -260/3 and -3 non-equal? True Which is greater: 55 or 1? 55 Is 18 at most as big as -0.6? False Which is bigger: 80 or 79? 80 Which is smaller: 19 or -269? -269 Which is greater: -58 or -12? -12 Are 3/488 and 0 equal? False Is -904 bigger than 0.1? False Is -0.3 <= 1676? True Which is greater: -1 or 24/875? 24/875 Is -3.89 at least -1? False Is 5869 bigger than 5868? True Which is smaller: -20 or -4/9? -20 Is 2233 != -1? True Which is greater: -2/14451 or 1? 1 Is 7/12 smaller than 2? True Is -2320/39 less than -60? False Is -1 <= -24/13? False Which is bigger: -19 or -8? -8 Are -3/13 and -98 nonequal? True Is -96/19 != -5? True Which is bigger: 130 or 1701/13? 1701/13 Is 4008 less than 4008? False Do 84 and -46 have different values? True Does -12 = -10? False Which is smaller: 1.1 or 89? 1.1 Which is greater: -70 or -65? -65 Which is greater: 0 or 13455? 13455 Which is smaller: -1.401 or -1/7? -1.401 Which is smaller: 10 or 2897? 10 Is -0.2 greater than -142? True Are -201 and -200 non-equal? True Which is greater: 0 or 265? 265 Which is smaller: 24/1639 or 1? 24/1639 Which is greater: 2 or 54? 54 Is 44 less than or equal to -24? False Is -890 > -886? False Which is smaller: 1 or -2/2505? -2/2505 Is 643 > 644? False Is -1 smaller than -2/5? True Is -433/2 at most as big as -217? False Which is greater: 1/972 or 0? 1/972 Which is smaller: 20 or 255/13? 255/13 Which is bigger: 9552 or 9550? 9552 Which is greater: 0 or -3.04? 0 Which is smaller: -137 or -135? -137 Which is smaller: 0 or 9/61? 0 Which is bigger: 1 or -4/3155? 1 Which is greater: -51 or 68/7? 68/7 Which is greater: -119 or -113? -113 Is 1/2 at most 675? True Does 418 = 419? False Which is smaller: 832 or -0.11? -0.11 Which is bigger: -155 or -154? -154 Is 277 at most 279? True Is 1184 bigger than -7? True Which is bigger: -161 or -163? -161 Is 3 bigger than 149/40? False Which is bigger: 1.7 or -3.1? 1.7 Which is greater: -11 or -480/41? -11 Which is bigger: 1 or -1050? 1 Which is bigger: 2 or 99? 99 Is 3/50 bigger than -1? True Which is smaller: -314 or 120? -314 Which is smaller: 233 or 234? 233 Is -28359 less than -28358? True Which is smaller: -2 or -40/49? -2 Is -6/7 greater than or equal to 4165? False Which is greater: 6223 or 6222? 6223 Which is smaller: 33 or 780/23? 33 Is -524 at most -525? False Are -1/2 and 1203 unequal? True Is 23197 greater than 23198? False Does -433/5 = -87? False Which is smaller: 6 or 23/3? 6 Which is smaller: 1 or -2/573? -2/573 Is 3243 less than 16219/5? True Is 7290 equal to 7289? False Is 456 at least 2282/5? False Are 4/229 and 1 equal? False Which is bigger: -806 or -798? -798 Is -50 smaller than -37? True Which is bigger:	{ "pile_set_name": "DM Mathematics" }
or a. -2 Let r(v) = v*2 + 11v + 2. Let n(o) = -o + 1. Let l(x) = -4n(x) - r(x). Let u be l(-6). Let f = 16255 - 16249. Solve u = -c + fc - 25 for c. 5 Suppose 10 = -218f + 219f. Suppose -fj + 11j = 0. Solve -l + 4l - 15 = j for l. 5 Let n be (0/(-6))/1 - 25. Let g be (24/(-20) - -4) + (-5)/n. Solve 3i + 12 = g for i. -3 Let q = 124 - 97. Let h be 6/q - ((-5936)/(-63))/(-8). Solve 0 = 2c + h - 2 for c. -5 Let i(s) be the third derivative of s5/60 + s2. Let y be i(-2). Solve -25 = -yu - 29 for u. -1 Suppose 3n - 12 = 0, -4v + 3n = -n + 4. Suppose 5z + 2q = -90 + 116, 3z = 5q + 28. Solve zu = v + 3 for u. 1 Suppose -14p + 420 + 70 = 0. Suppose -130 - p = -15d. Solve d - 7 = -r for r. -4 Let m = -1880 + 1914. Solve 36 = 22v - mv for v. -3 Suppose -8q = -270 - 138. Solve -16h + 13 = -q for h. 4 Let f(v) = v + 1. Let p be f(-1). Suppose p = -2t - 4t + 18. Let w = 129 + -129. Solve 3d + w - t = 0 for d. 1 Let i(g) = -2g*2 + 18g + 44. Let u be i(-2). Solve u = -19o + 56 - 18 for o. 2 Let k = -12821 - -12834. Solve 530 = ka + 517 for a. 1 Suppose 0 = 46p + 108p - 2625 + 777. Solve pk + k = -2k for k. 0 Suppose 0 = 5d - 263 + 63. Suppose -2k + d = 4z, 2k - 5k = z - 5. Let n be 567/81 - (1 - 0). Solve -nl = -zl + 15 for l. 3 Let n(u) be the second derivative of -u4/12 + 2u*3/3 + 393u. Suppose -k + 0 = -3. Let l be n(k). Solve -4 = -b - l for b. 1 Let k = 266 - 266. Suppose -c - 3q - 5 = -21, 5q - 15 = k. Solve -3o + co + 4 = 0 for o. -1 Suppose 4w = 2z - 20 - 72, -z - 3w = -31. Let v be (2/4)/((-301)/(-3010)). Solve -z + 15 = vu for u. -5 Let q = 258 + -247. Let z(l) = 10l - 104. Let a be z(q). Solve -1 = -7c + a for c. 1 Suppose 64r + 2y = 63r + 20, 5r - 2y = 52. Solve 31z + 229 = r for z. -7 Suppose 3i - 393 = 2t, -t - 131 = 5i - 6i. Solve i = 45v - 184 for v. 7 Let j = -31661 - -31888. Solve 0 = -35i - 52 + j for i. 5 Let i be 162/30 - 35/5016/28. Solve -18 + 28 = ih for h. 2 Let m be 2 + 4 - 4 - -2. Let j be (63/6)/(3/m). Let f = j - 9. Solve f = -2v - 5 for v. -5 Suppose k = -h + 9, -8h + 2k = -4h. Suppose -5p + 0 = 2y - 44, -2p + 22 = 3y. Solve -hg = -g - p for g. 4 Suppose 285 = 421f - 1654 - 587. Solve 0 = -fm - 4192 + 4192 for m. 0 Let m = -673 + 685. Suppose 5u - m = -2r, 3r + 5 = 8. Solve 7v - uv = 20 for v. 4 Let q be 7(23 + (-110)/70). Solve 39o + 11o - q = 0 for o. 3 Let l = 40153 - 40106. Solve 36h + 77 = lh for h. 7 Suppose -19h = -21h + 288. Suppose -16f + h = -16. Solve j = -13 + f for j. -3 Let u(h) = -h*2 - 7h - 6. Let k be (3 + -2)/(2/(-12)). Let g be u(k). Let p(b) = 186b2 + 13948b - 145. Let o be p(-75). Solve oa = -ga for a. 0 Suppose -4g + 72 = 4g. Suppose gz - 4z = 20. Suppose -zc + 36 = j + 3j, 19 = 3c + j. Solve f = cf for f. 0 Suppose -2i + 5o - 215 = 0, i + 34 = -3o - 79. Let u = i + 120. Solve 9y = uy for y. 0 Let b = 147 - 113. Suppose bf - 12f - 220 = 0. Solve -8p + 6 = -fp for p. -3 Let z(q) = -2q*2 + 106q - 858. Let l be z(43). Suppose 28 = 6f - 2f. Suppose 3y = -m + 7y + 8, m - 8 = -4y. Solve mn = fn - l for n. -2 Let u(z) be the third derivative of z5/60 + 7z*4/24 + 2z*3 + 23z*2. Let d be u(-5). Solve dr + 0r = 8 for r. 4 Suppose -q = -0q + 2f, -3f = 2q. Solve q = 22v - 19v + 3 for v. -1 Let y be 3/(37/(-98)-7). Let w be 47 + 3 - (y - 2). Solve 0 = 3r - w + 53 for r. -1 Let o(d) = -d*2 + 6d + 10. Let q = -3 - -10. Let b be o(q). Let z = 2563 + -2559. Solve -z + b = t for t. -1 Let r(n) = 6n2 - 14n - 3. Let d(h) = h*2 + 1. Let l(w) = 4d(w) - r(w). Let s be l(7). Suppose sg = 9 + 19. Solve 2p - g = 4 for p. 4 Let z(b) be the third derivative of b5/15 - b4/6 - 2b2 + 39b. Let v be z(2). Solve -vg - 2 = 30 for g. -4 Let d be 1310/(-14) - (-116)/203. Let c = 97 + d. Solve cy - 10 = 9y for y. -2 Suppose 3v - 7v = -48. Let q be (-2)/5(-40 + -5). Suppose 0 = 5h - 3z - 83 + q, -h - 4z = 10. Solve -6w - v = -hw for w. 3 Let f(o) = -3o - 22. Let w be f(-10). Let t(h) = 2h2 + 494h + 3828. Let g be t(-8). Solve -w = v - g for v. -4 Let n(t) = -t*3 + 7t*2 - 8t + 12. Let g be n(6). Suppose 2f + 3 = 3v, -5v - 5f + 22 + 8 = g. Solve vx - 6x - 12 = 0 for x. -4 Let z be 2/(-9) + (-580)/(-180). Suppose 0 - z = -j. Solve jq - q = 4 for q. 2 Let d = 9140 + -9105. Solve dw - 44 - 131 = 0 for w. 5 Suppose -5o = -39513 + 38593. Solve -26y + o = 54 for y. 5 Let q(t) be the third derivative of -t*6/60 + 13t*4/24 + 13t*3/6 + 15t*2. Let v be q(-1). Solve 0 = -2g - 7g + vg for g. 0 Let h = -202 + 216. Suppose 0 = -14g + 16g - h. Solve gr - 36 + 1 = 0 for r. 5 Let s(i) = i3 - i2 - i + 7. Suppose -3v = -n - 4, 4v - 7n = -6n + 4. Let d be s(v). Solve b + 3 = d for b. 4 Let p be (-7 - (-2 + 0))/((-35)/42). Suppose 0 = -15f + pf + 135. Let d = 20 - f. Solve 6 = dg + 1 for g. 1 Suppose 98g = 183g - 680. Solve -gl = 27 - 3 for l. -3 Let f(p) = p3 + 6p*2 + 5p - 1. Let g be f(-3). Suppose 1 = a, c = 2c + 2a - 8. Solve gt = 14t + c for t. -2 Suppose 4k = 2z, 20z + 3k - 1 = 21z. Let j(s) = s3 - 3s*2 + 3s - 2. Let d be j(2). Suppose -2r + 1 + 3 = d. Solve -4i - z = r for i. -1 Suppose 2r = 4z - 8, 5z = 4r + 10 + 6. Solve -2w + 12w = z for w. 0 Let i = -3488 + 3533. Solve i = -59n - 368 for n. -7 Let r be 580/28 - 45/(-35). Solve rd - 13 = -57 for d. -2 Let m(b) = -b*3 - 22b*2 - 20b - 27. Let i be m(-20). Let l = -425 - i. Solve f - l + 6 = 0 for f. -4 Let a be (20/6 + (-234 - -231))24. Solve a = -40b - 112 for b. -3 Suppose 923 = -68k + 3303. Solve 43b = kb - 48 for b. -6 Suppose 2b + 8 = -0b, -f + 97 = -4b. Let p = f + -69. Suppose -21g = -19g - p. Solve 0 = gn - 2n - 4 for n. 1 Let m be (-2)/(-6)((-2 - -2) + -6). Let y(z) = 2z*2 - 4z + 4. Let u be y(m). Solve -16q = -uq + 8 for q. 2 Let c(x) = -27x2 - 4x - 67. Let m be c(-5). Let j = m + 726. Let i = 11 - 8. Solve -j = in - 19 for n. 5 Let j(g) = 0g*2 + g - 2g*3 - 6g*2 - 7 - 6g*2 + 3g*3. Let u be j(12). Let o be 0(0 - (-5 - (-42)/9)). Solve o = -2n + u + 5 for n. 5 Suppose -367n + 2160 = -286 - 5995. Solve -42 = -nu + 4 for u. 2 Suppose -60 = -2z - 3n + 131, 276 = 3z + n. Solve -85u + zu - 6 = 0 for u. 1 Let a(h) = h*3 + 12h*2 - 5h - 54. Let i be a(-12). Suppose t + 5f - i = 1, -3t - f = -7. Solve -t = -2r + 4 for r. 3 Suppose -q = 4c - 102, -4q + 133 = 8c - 3c. Solve 11d = -14d + c for d. 1 Let y be (-75)/20(-104)/39. Let s(h) = 6h + 3. Let r be s(0). Solve -5 = -rn + y for n. 5 Let v = -258 - -40. Let g = -210 - v. Solve gk - 6k = 10 for k. 5 Suppose -74w - 11w + 381 = -44. Solve wg - 120 = -15g for g. 6 Let a(t) be the second derivative of -t*4/3 + 3t*3 + 5t*2 + 47t. Let z be a(5). Suppose -10 = -2n - 2. Solve zm = -4m + n for m. 1 Let p(j) = -9j + 102. Let n be p(11). Let r = -39 - -73. Let x = r - 33. Solve -m - n = x for m. -4 Let m be 7135/20 - -315/(-36). Solve -mf = -55f for f. 0 Let g(a) = 11a + 354. Let y be g(-32). Let d(h) = -h2 + 5h. Let v be d(4). Suppose 58 = vb - 0w - w, 5w - 25 = -b. Solve -yp + b = p for p. 5 Suppose 7w + 2175 = 12w. Suppose 0 = -7l - 400 + w. Solve l = -3d - 4 for d. -3 Let m(k) = -k*2 - 2k + 55. Let h(o) = o*3 + 2o*2 - 8. Let s be h(0). Let x be m(s). Let y = 4 - 3. Solve -2q + x - y = 0 for q. 3 Suppose 10 = -2p, -2c - 2p = p + 11. Suppose 3l + 20 + 14 = ch, -5h = 2l - 104. Suppose 3x - 4x + 2 = 0. Solve -xm + 6m + h = 0 for m. -5 Let d be -56/4512/8. Let v be 1 - 43(2 + -3). Let a be (2/d)/((-8)/v). Solve -14 = 5o + a for o. -5 Let v(c) = 121c - 2. Let a be v(-1). Let s be (-4)/24-2a. Let x = 47 + s. Solve x = 3k - 0k for k. 2 Let f = -1679 - -1693. Solve -16 = -18u + fu for u. 4 Let p(d) = d*2 + 5d - 1. Let a be p(-6). Suppose -14 = -av + 66. Suppose 4s - 1 - 15 = 0. Solve v = -3b + s for b. -4 Let m(w) = 2w*3 - 13w*2 + 2w - 45. Let x be m(8). Solve 25u = -x - 12 for u. -7 Let l(r) = r2 - 195r + 2210. Let o be l(12). Solve -4f = 26 - o for f. -3 Suppose 8 = -2k + 3k. Suppose 4w + 4b + 1239 = 1215, -2w + 53 = -3b. Solve w = kj + 47 for j. -5 Let t = 2937 + -2917. Solv	{ "pile_set_name": "DM Mathematics" }
5c - 6, 6 = -3c. Let a(h) = -3h2 - 26h - 6. Is a(m) a multiple of 9? False Let x(i) = 328i + 6027. Is 25 a factor of x(-11)? False Suppose 2d = -m + 1, -3m + 10 = -5d - 8m. Suppose 0 = dp - 320 - 430. Is 16 a factor of p? False Suppose -5f - 19356 = 2c - 52972, 3c = -2f + 13442. Is 10 a factor of f? False Suppose -5r = 26 - 46. Suppose -5w - l + 2026 = 0, 0l = -rl + 4. Suppose v = -5j + 974, 0 = 3j - 3v - w - 165. Does 25 divide j? False Let m(r) = -r3 + r2 + 5r + 4. Let n be m(3). Is 49 a factor of 20(n - (-642)/24) + 6? False Let l = -9465 - -18761. Does 14 divide l? True Let d(z) = 889z + 62. Let q be d(2). Suppose -6k + 428 = -q. Is k a multiple of 9? True Let j = 22905 + -13493. Is 52 a factor of j? True Let f = -2433 + 19862. Is f a multiple of 235? False Suppose -41z + 48990 = -210910 - 22385. Is z a multiple of 57? False Suppose 0 = -2l + 9l. Suppose -2t + 4 = l, -2v = -v + t - 691. Is 13 a factor of v? True Let w(x) = -7x2 - 2x - 2. Let q(z) = -29z2 - 9z - 8. Let f(v) = 4q(v) - 18w(v). Let y be f(-2). Suppose 43n = yn - 54. Is n a multiple of 9? True Let k = -98 - -126. Suppose 35w = kw + 189. Let b = 242 - w. Is 12 a factor of b? False Let g(a) = a + 21. Let d be g(-16). Suppose n - 4b - 9 = d, 0 = -n + 3b + 11. Suppose 0 = -5i - 4l + 799, -3i - 3l + 482 = nl. Does 29 divide i? False Suppose 3594 = 9u - 231. Let f = u + 199. Is f a multiple of 26? True Let a(b) = 9b2 - 15b + 34b - 8b - 23b + 3. Let u be a(-11). Suppose 26n - 9n - u = 0. Is 18 a factor of n? True Let j = 221 + -216. Suppose 4h = -h + 4z + 3136, -jh - 3z + 3108 = 0. Does 48 divide h? True Suppose -10i + 6664 + 4116 = 0. Suppose 32t - 3690 = i. Is t a multiple of 4? False Suppose 0 = -42a - 34a + 87252 + 47800. Is a a multiple of 16? False Suppose 11h - 10h - 1044 = -4d, 2d - 8 = 0. Is 2 a factor of h? True Suppose 0 = -3k - 5o + 9370, -3o + 2596 = 5k - 13010. Suppose -16q = -24q + k. Is q a multiple of 15? True Let g = 4704 + 7407. Is 33 a factor of g? True Suppose 573y - 20 = 578y, 3y = -5l + 38738. Does 31 divide l? True Suppose 5t - t + 4 = 0. Let i be 6(-3 + (t - -6) - 3). Is 14 a factor of 18/i(-28)/6? True Let v = -345 - -348. Suppose 4k - 328 = -r - 3r, 218 = vr - 4k. Is 26 a factor of r? True Suppose 68r - c = 63r + 35625, 28499 = 4r - c. Does 81 divide r? False Suppose 3i - 19163 = 2n, -6n = -7n - 4. Is i a multiple of 105? False Suppose 4c = -d + 2c, 2d - 20 = c. Suppose 16 = 6j - d. Suppose jt - 40 = 140. Is 15 a factor of t? True Let c(t) = 3t + 90. Let s be c(20). Is s(-9 + 6)/(0 - 3) a multiple of 10? True Let g be 6/8 - 1503/36. Let w = -36 - g. Suppose -2p + 124 - 394 = -5j, 249 = 4j + wp. Is j a multiple of 7? True Let l be (-2)/8 + (-100)/(-16) + -6. Suppose -4h + g + 632 = l, 3g + 632 = 4h + g. Is h a multiple of 33? False Suppose 55s - 210010 - 195440 = 38s. Is s a multiple of 30? True Let y = 59 - 46. Suppose -y = 9o + 113. Let z(p) = -p*3 - 14p*2 - 18p - 9. Does 27 divide z(o)? True Let h = -86 - -172. Let p = 226 - h. Does 24 divide ((-10)/(0 - 2))/(5/p)? False Let g = -2204 - -3162. Suppose -g = -3v + 5h, 45v - 44v = h + 320. Does 20 divide v? False Let j(u) = -61u + 2087. Does 17 divide j(-14)? True Let j(l) = -l2 - 19l + 24. Let a(m) = -m - 24. Let u be a(-4). Let r be j(u). Suppose 3w - 392 = 2v + 55, -rw + 5v + 603 = 0. Is 40 a factor of w? False Let d(k) = -13k3 - 51k + 38. Is 171 a factor of d(-9)? False Suppose 9j + 2 = 38. Suppose -2o = -f + 92, -jo + 151 = 2f - 1. Does 6 divide 28/f(36 + 1 + -1)? True Suppose -55n + 179176 = 21n - 686236. Is 18 a factor of n? False Suppose 0 = -5k + 46l - 42l + 23921, 0 = k + 4l - 4789. Does 20 divide k? False Let g be (2754/15)/3 - 1/5. Let m = 57 - g. Is 39 a factor of (m/(-22) - 5196/264)-2? True Let k = 583 - 508. Suppose -k - 29 = -g - 3s, -104 = -g + 3s. Is g a multiple of 29? False Suppose -3d + k - 1 = 0, 0 = 2d - 4d - 5k - 12. Does 5 divide ((-2)/9)/d - 4923/(-81)? False Let p = 655 - 563. Suppose -ph - 580 = -96h. Does 5 divide h? True Suppose 5f - 8 = 4q, 3f + 2q = f + 14. Suppose -fs + 608 = t - 0t, -3s = -4t - 437. Is s a multiple of 23? False Let y be (-11 + (3 - 7))-129. Let g = y - 1080. Is g a multiple of 57? True Let f = -607 - -678. Is 7 a factor of f? False Let b(d) = -529d - 881. Does 42 divide b(-5)? True Suppose 7a - 120 = -3a. Suppose 3 = -5r - a. Does 17 divide 150/1 - (45/5)/r? True Suppose -9f = -0f - 18. Let j be (f/3)/((-1)/(-18)). Is (j/16)/(-3) + 207/12 a multiple of 17? True Suppose -5a - 49 - 1 = 0. Let o(q) = 4q3 + 11q*2 + 9q + 6. Let v(z) = 3z3 + 11z*2 + 10z + 9. Let s(h) = 2o(h) - 3v(h). Is s(a) a multiple of 4? False Let o(t) = 2t2 - 13t - 26. Let z be (-6)/(-2) + (8 - -3). Is o(z) a multiple of 34? False Suppose -64 = -12p - 100. Let h(w) = -156w - 18. Is h(p) a multiple of 11? False Let a(v) = 569v + 1888. Is a(34) a multiple of 26? False Let s(o) = 81o*2 - 131o - 1248. Is s(-9) a multiple of 20? False Let m(h) = -4h + 3h*2 + 4h - 15h - 2h*2 + 23. Let p be m(14). Is 27 a factor of p/(-2)60/(-5)? True Let v(s) = 2090s2 + 9s - 9. Let x be v(1). Suppose -x = -11l + l. Does 11 divide l? True Let k = 5330 + -2810. Suppose 31t - k = 24t. Does 36 divide t? True Suppose -4a + 5x + 4641 = 0, 0 = -0a + 2a - 2x - 2322. Suppose -3i - 32 + 47 = 0. Suppose d = -ih + a, 3d - 1167 = -5h + 5d. Is 27 a factor of h? False Let q = 45 - 4. Suppose 0u + 4u - 54 = 3p, -2p = -3u + q. Is (-102)/(u/10 - 3) a multiple of 34? True Let u = -322 + 327. Suppose 0 = -h - uq + 30, 5q + 90 = 3h - 0h. Is h a multiple of 4? False Suppose 12 = -6v + 12v. Suppose b = 2a + 83, -vb - 3a + 0a = -152. Suppose 8 - 152 = -4l + 3k, -5k = 3l - b. Is l a multiple of 11? True Let s = -141 + 412. Suppose -s - 242 = -9f. Does 57 divide f? True Let g = 678 - 246. Suppose 3o + 4m - 643 = 0, -5m + 4m + g = 2o. Is 31 a factor of o? True Suppose 2j + 342 = -7j. Let k = j - -53. Suppose 3 + k = m. Is 2 a factor of m? True Suppose 39h - 43h + 4j = -70716, 4h = 3j + 70719. Is 19 a factor of h? False Suppose 0 = -2y + 2a - 0 + 12, 3a = -12. Let o be y/(-19) + (-18)/(-171). Suppose 2l + ol - 100 = 0. Does 25 divide l? True Let g(m) = -1141m - 6118. Let n(z) = 30z + 161. Let w(v) = -2g(v) - 77n(v). Is 37 a factor of w(-9)? False Let o be (-57)/(-12) - (26/(-8) - -3). Suppose ox - 4x - 119 = 5z, 0 = 3x + 3z - 339. Is x a multiple of 6? True Let b be 10/(-3)(-2 + 32/10). Does 21 divide -7-132 + b/(-1)? False Let m = -457 - -459. Suppose -q + 6 = 4o - m, -3q + 3o = -99. Is q a multiple of 7? True Suppose 12j - 36 = 3j. Suppose -w = -5m + jw + 2270, -w - 2274 = -5m. Is 26 a factor of m? False Suppose 5d - 8 = f, 0 = 2f + 5d - 0 - 44. Does 4 divide (f/(-7))/((-28)/4214)? False Let l(d) = -2d*2 - 6d + 11. Let k be l(4). Let p = 53 + k. Suppose -4m = 5s - 805, ps - 5m = 3s + 760. Does 12 divide s? False Suppose -d = -48q + 47q + 15453, 0 = -5d - 10. Does 8 divide q? False Let q(j) = -7j3 - j2 - j + 8. Let i(y) be the third derivative of -y6/40 + 2y*3/3 + 8y*2. Let w(x) = -5i(x) + 2q(x). Does 4 divide w(4)? True Let h = 162 + -102. Is (1728/h)/(-2(-9)/60) a multiple of 6? True Let s(u) = -10u + 309. Let l be s(37). Is 4 a factor of (-4)/(48/(-1251)) + l/244? True Let s(i) = -78i*3 + 8i*2 + 32i + 57. Does 43 divide s(-5)? True Let b(i) = -i*3 + 10i*2 + 13i + 14. Suppose 0 = 4h - 1 - 19. Suppose hg - 21 - 34 = 0. Is b(g) a multiple of 9? True Suppose -t - 389 = 2w, 5t - t = 2w - 1526. Let s = 430 + t. Is s a multiple of 5? False Let k = 121 - -15. Suppose v - 153 = k. Suppose -276 - v = -5i. Does 28 divide i? False Suppose 117f + 5041 = x + 118f, 0 = 4x + f - 20140. Does 2 divide x? False Let s be 2/((-108)/(-20) + -5). Suppose 5d = -2n + 573, 0 = -sn - d + 958 + 509. Is n a multiple of 21? True Suppose -3h + 4w = -21, -2h - 3w - 2w = 9. Does 9 divide (-9)/(-27) + h + 260/3? True Let r = -15 - -111. Let t = 344 + -387. Let j = r + t. Is 7 a factor of j? False Let k = -67 + 78. Is (k/(-2) - -7)316/	{ "pile_set_name": "DM Mathematics" }
ided by 2130. 2129 Calculate the remainder when 5565044 is divided by 327355. 9 Calculate the remainder when 1250944 is divided by 7131. 3019 Calculate the remainder when 36932 is divided by 986. 450 Calculate the remainder when 1132098 is divided by 9201. 375 Calculate the remainder when 1548407 is divided by 1486. 1481 What is the remainder when 8605459 is divided by 805? 9 Calculate the remainder when 719463 is divided by 35969. 83 What is the remainder when 436289 is divided by 62? 57 Calculate the remainder when 14754059 is divided by 57859. 14 Calculate the remainder when 2639980 is divided by 85. 50 What is the remainder when 430244 is divided by 166? 138 What is the remainder when 4780717 is divided by 7? 4 What is the remainder when 54812623 is divided by 46? 35 Calculate the remainder when 34425 is divided by 2144. 121 What is the remainder when 1903963 is divided by 261? 229 What is the remainder when 7087342 is divided by 220? 42 What is the remainder when 990773 is divided by 11937? 2 What is the remainder when 27648 is divided by 13692? 264 Calculate the remainder when 842481 is divided by 1889. 1876 What is the remainder when 10114029 is divided by 1298? 13 What is the remainder when 28712 is divided by 1842? 1082 What is the remainder when 45216 is divided by 7? 3 Calculate the remainder when 715436 is divided by 2572. 420 What is the remainder when 16860 is divided by 6903? 3054 What is the remainder when 44767729 is divided by 301? 300 What is the remainder when 1502360 is divided by 4739? 97 Calculate the remainder when 8441804 is divided by 7. 0 What is the remainder when 252506 is divided by 50392? 546 Calculate the remainder when 14906229 is divided by 29. 26 Calculate the remainder when 147506256 is divided by 17. 10 What is the remainder when 133284 is divided by 10249? 47 What is the remainder when 782421 is divided by 173? 115 What is the remainder when 739302 is divided by 63? 60 What is the remainder when 560406 is divided by 559990? 416 What is the remainder when 19567 is divided by 5213? 3928 Calculate the remainder when 13495347 is divided by 275415. 12 Calculate the remainder when 1175566 is divided by 9230. 3356 Calculate the remainder when 454290 is divided by 90854. 20 What is the remainder when 2587217 is divided by 62? 19 What is the remainder when 4328072 is divided by 1594? 362 Calculate the remainder when 14496506 is divided by 778. 32 What is the remainder when 27969744 is divided by 2769? 75 What is the remainder when 11601402 is divided by 1657338? 36 Calculate the remainder when 20926562 is divided by 130791. 2 What is the remainder when 2793976 is divided by 69? 28 Calculate the remainder when 3313197 is divided by 15. 12 What is the remainder when 393050721 is divided by 56150103? 0 What is the remainder when 107812 is divided by 7700? 12 What is the remainder when 8960 is divided by 8527? 433 What is the remainder when 2045091 is divided by 5396? 7 Calculate the remainder when 4395173 is divided by 170. 163 Calculate the remainder when 12381 is divided by 4561. 3259 What is the remainder when 31638 is divided by 13368? 4902 What is the remainder when 621974536 is divided by 6? 4 Calculate the remainder when 1796478 is divided by 566. 560 Calculate the remainder when 219910989 is divided by 178. 177 Calculate the remainder when 274731 is divided by 380. 371 Calculate the remainder when 63507 is divided by 880. 147 Calculate the remainder when 3051355 is divided by 3120. 3115 Calculate the remainder when 8304054 is divided by 8. 6 Calculate the remainder when 233746 is divided by 490. 16 What is the remainder when 3472233 is divided by 20? 13 What is the remainder when 703741 is divided by 58606? 469 Calculate the remainder when 796248 is divided by 1355. 863 What is the remainder when 1916934 is divided by 382? 58 Calculate the remainder when 207692 is divided by 4876. 2900 Calculate the remainder when 509729 is divided by 8256. 6113 What is the remainder when 114419 is divided by 1838? 463 Calculate the remainder when 337789 is divided by 3882. 55 What is the remainder when 3883120 is divided by 2911? 2757 Calculate the remainder when 1350707 is divided by 71087. 54 Calculate the remainder when 171179588 is divided by 3362. 3358 Calculate the remainder when 43481685 is divided by 21740838. 9 What is the remainder when 63251 is divided by 3124? 771 Calculate the remainder when 28036 is divided by 27450. 586 Calculate the remainder when 77023 is divided by 2877. 2221 Calculate the remainder when 2843823 is divided by 710657. 1195 Calculate the remainder when 54629 is divided by 2331. 1016 What is the remainder when 407802 is divided by 891? 615 What is the remainder when 33826831 is divided by 13? 12 What is the remainder when 17131 is divided by 14963? 2168 What is the remainder when 151120 is divided by 636? 388 Calculate the remainder when 2625835 is divided by 42. 37 What is the remainder when 14172361 is divided by 1929? 1927 What is the remainder when 292394 is divided by 31071? 12755 What is the remainder when 1629161 is divided by 541844? 3629 What is the remainder when 22559 is divided by 9486? 3587 Calculate the remainder when 33991269 is divided by 33991248. 21 Calculate the remainder when 87323171 is divided by 29107702. 65 Calculate the remainder when 31256343 is divided by 27636. 27 What is the remainder when 2387990 is divided by 49749? 38 What is the remainder when 620669 is divided by 634? 617 Calculate the remainder when 11821179 is divided by 137. 134 What is the remainder when 3332051 is divided by 105? 86 What is the remainder when 421332 is divided by 16168? 964 What is the remainder when 4215156 is divided by 81? 78 What is the remainder when 15384138 is divided by 395? 73 What is the remainder when 148127 is divided by 677? 541 Calculate the remainder when 4463566 is divided by 9128. 9102 What is the remainder when 23339816 is divided by 35? 31 Calculate the remainder when 1141180 is divided by 1. 0 Calculate the remainder when 27845418 is divided by 36. 30 What is the remainder when 503015 is divided by 83834? 11 What is the remainder when 159871 is divided by 1150? 21 Calculate the remainder when 1577727 is divided by 788819. 89 Calculate the remainder when 4642781 is divided by 5789. 3 Calculate the remainder when 19669 is divided by 3266. 73 Calculate the remainder when 106225 is divided by 334. 13 What is the remainder when 19954893 is divided by 1428? 21 Calculate the remainder when 10498318 is divided by 5249155. 8 Calculate the remainder when 1606929 is divided by 114776. 65 Calculate the remainder when 152011 is divided by 121. 35 Calculate the remainder when 911498 is divided by 27621. 5 What is the remainder when 15575401 is divided by 1020? 1 What is the remainder when 464789 is divided by 16? 5 Calculate the remainder when 300341548 is divided by 6199. 6197 What is the remainder when 1203172 is divided by 601381? 410 Calculate the remainder when 3577712 is divided by 149069. 56 What is the remainder when 3703270 is divided by 9? 4 What is the remainder when 52985708 is divided by 137? 136 What is the remainder when 7990 is divided by 347? 9 Calculate the remainder when 2381055 is divided by 170073. 33 Calculate the remainder when 413040 is divided by 75. 15 What is the remainder when 575880 is divided by 33? 30 Calculate the remainder when 134326 is divided by 4178. 630 What is the remainder when 10667620 is divided by 2683? 12 What is the remainder when 8091886 is divided by 8091710? 176 What is the remainder when 8410333 is divided by 1263? 16 What is the remainder when 1839533 is divided by 459809? 297 What is the remainder when 477021 is divided by 1136? 1037 What is the remainder when 798158 is divided by 20450? 608 What is the remainder when 15411863 is divided by 4311? 38 What is the remainder when 6722722 is divided by 75536? 18 Calculate the remainder when 106040823 is divided by 256. 247 Calculate the remainder when 198607 is divided by 28352. 143 Calculate the remainder when 1662829 is divided by 2001. 1999 Calculate the remainder when 237254 is divided by 751. 689 What is the remainder when 365731 is divided by 1589? 261 What is the remainder whe	{ "pile_set_name": "DM Mathematics" }
of 6989880? 2, 3, 5, 31, 1879 List the prime factors of 11830981. 47, 211, 1193 List the prime factors of 443084. 2, 110771 What are the prime factors of 122560? 2, 5, 383 What are the prime factors of 279277? 317, 881 List the prime factors of 76886. 2, 37, 1039 What are the prime factors of 6997028? 2, 1749257 List the prime factors of 176295. 3, 5, 7, 23, 73 List the prime factors of 72734. 2, 41, 887 List the prime factors of 4525594. 2, 79, 28643 What are the prime factors of 547556? 2, 136889 List the prime factors of 2964456. 2, 3, 11, 19, 197 What are the prime factors of 530979? 3, 379, 467 What are the prime factors of 3058056? 2, 3, 42473 List the prime factors of 146190. 2, 3, 5, 11, 443 List the prime factors of 117978. 2, 3, 7, 53 List the prime factors of 9091648. 2, 142057 What are the prime factors of 6971780? 2, 5, 359, 971 What are the prime factors of 7497563? 23, 181, 1801 What are the prime factors of 559756? 2, 139939 List the prime factors of 303028. 2, 11, 71, 97 List the prime factors of 1062235. 5, 212447 List the prime factors of 10188422. 2, 67, 139, 547 What are the prime factors of 307128? 2, 3, 67, 191 What are the prime factors of 1625392? 2, 29, 31, 113 What are the prime factors of 3904? 2, 61 What are the prime factors of 239601? 3, 79867 What are the prime factors of 478758? 2, 3, 7, 11399 List the prime factors of 8552930. 2, 5, 855293 What are the prime factors of 4317138? 2, 3, 7, 47 What are the prime factors of 321660? 2, 3, 5, 1787 What are the prime factors of 292234? 2, 146117 What are the prime factors of 5464835? 5, 31, 35257 What are the prime factors of 9706613? 7, 1386659 List the prime factors of 7956068. 2, 17, 23, 5087 What are the prime factors of 47980? 2, 5, 2399 List the prime factors of 202925. 5, 8117 What are the prime factors of 693031? 43, 71, 227 What are the prime factors of 1797703? 23, 47, 1663 List the prime factors of 2634976. 2, 67, 1229 What are the prime factors of 1099607? 23, 47809 What are the prime factors of 1853922? 2, 3, 7, 37, 1193 List the prime factors of 7394812. 2, 1109, 1667 List the prime factors of 811261. 11, 73751 List the prime factors of 527535. 3, 5, 19, 617 What are the prime factors of 352172? 2, 17, 5179 What are the prime factors of 7541032? 2, 163, 5783 List the prime factors of 6735502. 2, 17, 397, 499 What are the prime factors of 8289026? 2, 1069, 3877 What are the prime factors of 211020? 2, 3, 5, 3517 What are the prime factors of 388159? 388159 List the prime factors of 2608444. 2, 67, 9733 What are the prime factors of 1519040? 2, 5, 47, 101 What are the prime factors of 244347? 3, 79, 1031 What are the prime factors of 23658909? 3, 1163, 6781 List the prime factors of 111822. 2, 3, 18637 What are the prime factors of 286787? 23, 37, 337 List the prime factors of 199372. 2, 49843 List the prime factors of 736478. 2, 19, 19381 List the prime factors of 8661753. 3, 962417 List the prime factors of 1734735. 3, 5, 109, 1061 List the prime factors of 335248. 2, 23, 911 List the prime factors of 2904565. 5, 580913 List the prime factors of 4834027. 11, 113, 3889 List the prime factors of 545016. 2, 3, 22709 List the prime factors of 11019551. 2207, 4993 List the prime factors of 50211. 3, 7, 797 List the prime factors of 3462988. 2, 865747 What are the prime factors of 8961644? 2, 1213, 1847 List the prime factors of 3528132. 2, 3, 41, 71, 101 What are the prime factors of 1382603? 443, 3121 List the prime factors of 455265. 3, 5, 67, 151 List the prime factors of 1865166. 2, 3, 310861 List the prime factors of 7990202. 2, 11, 179, 2029 List the prime factors of 53295. 3, 5, 11, 17, 19 List the prime factors of 165475. 5, 6619 List the prime factors of 2366382. 2, 3, 521, 757 What are the prime factors of 331524? 2, 3, 9209 List the prime factors of 6877610. 2, 5, 647, 1063 What are the prime factors of 456507? 3, 50723 List the prime factors of 1058152. 2, 29, 4561 What are the prime factors of 11340323? 173, 65551 List the prime factors of 516288. 2, 3, 2689 List the prime factors of 3697101. 3, 410789 List the prime factors of 2971873. 2971873 List the prime factors of 2463701. 2463701 What are the prime factors of 7197870? 2, 3, 5, 239929 List the prime factors of 2026899. 3, 7, 32173 List the prime factors of 8899282. 2, 7, 71, 1279 What are the prime factors of 158712? 2, 3, 17, 389 List the prime factors of 8668284. 2, 3, 43, 107, 157 List the prime factors of 238921. 238921 List the prime factors of 65748. 2, 3, 5479 List the prime factors of 26057372. 2, 11, 67, 8839 List the prime factors of 16235090. 2, 5, 1229, 1321 What are the prime factors of 1776385? 5, 13, 27329 List the prime factors of 15135911. 7, 2162273 List the prime factors of 340279. 179, 1901 List the prime factors of 20876658. 2, 3, 11, 37, 83, 103 List the prime factors of 13175865. 3, 5, 32533 What are the prime factors of 120438? 2, 3, 6691 What are the prime factors of 1171839? 3, 167, 2339 What are the prime factors of 10980289? 79, 131, 1061 What are the prime factors of 280259? 7, 40037 List the prime factors of 5516726. 2, 19, 145177 What are the prime factors of 10790004? 2, 3, 89, 10103 What are the prime factors of 20829165? 3, 5, 7, 17, 1667 What are the prime factors of 12865218? 2, 3, 499, 4297 List the prime factors of 20191516. 2, 23, 41, 53, 101 List the prime factors of 4559910. 2, 3, 5, 17, 8941 What are the prime factors of 1290736? 2, 80671 List the prime factors of 253090. 2, 5, 25309 List the prime factors of 4894844. 2, 17, 71983 List the prime factors of 4423335. 3, 5, 7, 103, 409 List the prime factors of 2271796. 2, 567949 List the prime factors of 3416835. 3, 5, 227789 List the prime factors of 3805364. 2, 951341 What are the prime factors of 10797257? 43, 251099 List the prime factors of 19413175. 5, 71, 10937 List the prime factors of 89923. 89923 List the prime factors of 1611631. 7, 230233 List the prime factors of 4664099. 11, 29, 14621 What are the prime factors of 30984? 2, 3, 1291 List the prime factors of 413174. 2, 19, 83, 131 List the prime factors of 6755340. 2, 3, 5, 112589 List the prime factors of 679005. 3, 5, 79, 191 List the prime factors of 1227057. 3, 13, 73, 431 List the prime factors of 392396. 2, 263, 373 List the prime factors of 10201180. 2, 5, 11, 89, 521 List the prime factors of 1649523. 3, 19, 43, 673 What are the prime factors of 25662993? 3, 173, 197, 251 What are the prime factors of 153813? 3, 11, 59, 79 What are the prime factors of 12038970? 2, 3, 5, 19, 21121 List the prime factors of 1085597. 131, 8287 List the prime factors of 639007. 639007 List the prime factors of 600681. 3, 200227 List the prime factors of 39577211. 563, 70297 What are the prime factors of 42066964? 2, 10516741 What are the prime factors of 152238? 2, 3, 25373 What are the prime factors of 98961? 3, 32987 List the prime factors of 1030103. 73, 103, 137 What are the prime factors of 16256192? 2, 254003 List the prime factors of 8396731. 7, 197, 6089 List the prime factors of 2410753. 17, 109, 1301 What are the prime factors of 30908302? 2, 31, 498521 What are the prime factors of 83138? 2, 11, 3779 List the prime factors of 2217815. 5, 443563 What are the prime factors of 855817? 19, 31, 1453 List the prime factors of 334819. 113, 2963 What are the prime factors of 878272? 2, 13723 What are the prime factors of 3110869? 1699, 1831 List the prime factors of 87779. 61, 1439 List the prime factors of 628418. 2, 7, 44887 What are the prime factors of 53076? 2, 3, 4423 List the prime factors of 396598. 2, 59, 3361 What are the prime factors of 229848? 2, 3, 61, 157 What are the prime factors of 83933? 83933 List the prime factors of 6619563. 3, 27241 List the prime factors of 264123. 3, 29347 List the prime factors of 1222605. 3, 5, 101, 269 What are the prime factors of 1930746? 2, 3, 83, 3877 What are the prime factors of 349889? 73, 4793 List the prime factors of 272219. 137, 1987 What are the prime factors of 4633247? 71, 65257 List the prime factors of 1614207. 3, 7, 79, 139 What are the prime factors of 6778118? 2, 257, 13187 What are the prime factors of 670780? 2, 5, 11, 3049 List the prime factors of 340985. 5, 47, 1451 What ar	{ "pile_set_name": "DM Mathematics" }
)? 0 Let o be 547 + (5 - (-6 - -14)). Calculate the remainder when 269 is divided by (0 + o)/8 + 0. 65 What is the remainder when 311 is divided by ((-254)/(-4))/((5/30)/(15/45))? 57 Suppose -h + 33 = g, -5h - 1 = -2g + 58. Let k = -11 + 74. Let s = k + -1. What is the remainder when s is divided by g? 30 Let u = 280 + -248. Suppose -2g = 4v - 38, 2g - 5v = 6g - 70. Suppose 3n - x - g = 6, 14 = 2n - 2x. What is the remainder when u is divided by n? 4 Suppose -13b + 807 = -1585. Suppose 3j + 14d = 19d + b, 0 = 2j - 3d - 122. Calculate the remainder when j is divided by 12. 10 Let q be (-4)/30 + 32/240. Suppose q = 4m - 2371 + 22195. Calculate the remainder when 2/9 + m/(-54) is divided by 24. 20 Let d(s) = s2 + 63s + 234. Let c be d(-4). Suppose -j + 29 = 2k, -j + 3k - 8k = -20. Calculate the remainder when (-2 - -2)/c + j is divided by 21. 14 Let w(c) = -c2 - 91c - 993. What is the remainder when 1209 is divided by w(-13)? 12 Let t = 4282 - 3731. Calculate the remainder when t is divided by 33. 23 Calculate the remainder when 498 is divided by 104/91 + 50175/105. 19 Let u(z) = z*2 - 10z - 53. Let v be u(19). Let o be (v/8)/(8/(-32)). Let m = o - -60. What is the remainder when m is divided by 1? 0 Suppose -13h = -5h - 40. Suppose hq + 229 = 979. Calculate the remainder when q is divided by 26. 20 Suppose -t + z = 6z - 81, 0 = 4t + 2z - 324. Suppose 1108p - 136 = 1100p. What is the remainder when t is divided by p? 13 Suppose v + 974f = 970f + 893, -v = -2f - 887. Calculate the remainder when v is divided by 76. 53 Suppose 12l - 70 = -4n + 13l, 0 = 5l - 10. Let q = 9 + -7. Suppose -2s + 100 = -qf, s - 5f = 6s - 260. Calculate the remainder when s is divided by n. 15 Let r = 330 + -326. Suppose ru + v - 518 = 3v, -3v = 4u - 513. Calculate the remainder when u is divided by 23. 14 Let z(y) = y3 + y2 - 4y + 5. Let c be z(-3). Calculate the remainder when 43 is divided by 105/7 - 1 - c. 13 Let t = -5623 - -5640. Suppose 2n - 57 = 37. What is the remainder when n is divided by t? 13 Suppose -5o + 1 = 16. Let g(r) = 67r + 6. Let s(q) = q + 1. Let b(n) = os(n) + g(n). Calculate the remainder when b(1) is divided by 14. 11 Suppose 1591n - 91 = 3166n - 1588n. What is the remainder when 2162 is divided by n? 6 Let z = -6592 - -6663. Let j(d) = -d2 - 1. Let i(n) = 3n*2 + 4n + 5. Let g(p) = i(p) + 2j(p). What is the remainder when z is divided by g(-6)? 11 Suppose 4z - 5z = -9. Calculate the remainder when (20 - 14 - (-6)/(-1)) + 54 + -1 is divided by z. 8 Let o = 2534 - 2522. Let n(c) = -7c + 5. What is the remainder when n(-5) is divided by o? 4 Let r = -98 - 85. Let h = r + 765. Suppose 0 = 4l + 2l - h. What is the remainder when l is divided by 14? 13 Suppose 57t = 48t + 113238. What is the remainder when t is divided by 29? 25 Let a = -270 + 186. Let z = a - -197. Let k = -93 + z. Calculate the remainder when 96 is divided by k. 16 Suppose -1459i + 48906 = -1393i. What is the remainder when i is divided by 38? 19 Let b = 31 - -10. Suppose -406 = 57q - 59q. Calculate the remainder when q is divided by b. 39 Calculate the remainder when 4/26 + 1008/1560 + (-381)/(-5) is divided by 35. 7 Let r be (-1 + 1)(-6)/12. Suppose 15g - 11g = r. Suppose j - 4 - 85 = g. What is the remainder when j is divided by 23? 20 Suppose 4b + 10 = 3z - z, -5b + 5 = 0. Let o(c) = 29c + 60. What is the remainder when z is divided by o(-2)? 1 Suppose 2f + 5w = 39, 30 + 16 = 3f - 5w. Let o(i) = -2i2 - 4 + i2 - 8i + f + 12. Calculate the remainder when o(-6) is divided by 7. 2 Suppose -139k + 4773 = 129k - 231k. Calculate the remainder when k is divided by 79. 50 Let p = -23229 + 23607. What is the remainder when 2273 is divided by p? 5 Calculate the remainder when 5/10 + (-3693)/(-6) + 2 is divided by 25. 18 Calculate the remainder when 736 is divided by 20/50 - 11575/(-125). 85 Suppose 961 + 392 = 11d. Calculate the remainder when 368 is divided by d. 122 Let k be 1 - (1 - (4 - -3)). Suppose 0 = kg - 49 - 140. What is the remainder when g is divided by 24? 3 Calculate the remainder when (-5)/3 - (-247)/285 - 18078/(-10) is divided by 201. 199 Suppose -5d + 5v = 25, 0 = 5d - 3d + 3v. Let b be -20 + (-3 - -8) - d1. Calculate the remainder when 1242/14 - -5b/(-210) is divided by 46. 43 Let f(v) = 3v + 12. Let o be ((-91)/5 - -2) + 12/60. Let m be o/(-40) - 18/(-5). What is the remainder when 118 is divided by f(m)? 22 Let m(x) = -164x2 - 7x - 8. Let d be m(-1). Let u = d - -394. Calculate the remainder when u is divided by 33. 31 Let b = 50 + -52. Let l be 2/(-2 + 48/22) - b. Suppose 97 - l = 12p. What is the remainder when 34 is divided by p? 6 Let y = 11 - -74. Suppose 0 = 165b - 86b + 238b - 106829. What is the remainder when b is divided by y? 82 Suppose -7j = -11j - 4q + 56, 4q - 44 = -3j. Calculate the remainder when 15 is divided by (-1 + 3)18/j. 0 Let l(r) = -r*2 - 29r + 88. Let g be l(-31). Let p(f) = f*2 - 31f + 187. Calculate the remainder when p(g) is divided by 29. 28 Let o(a) = -a - 3. Let i be o(0). What is the remainder when 12 is divided by (i - 0) + (-30)/(-5)? 0 Suppose -s - 3w = 2s + 276, w + 3 = 0. Let z = -94 - s. Let r = 32 + z. Calculate the remainder when r is divided by 14. 13 Let j = 7535 - 7304. What is the remainder when 12704 is divided by j? 230 Suppose -2d - 5v - 5 = 0, 5d - 2d = -5v - 5. Suppose -a + 4a + 6 = 3p, 5p - a - 26 = d. Calculate the remainder when 40 is divided by p. 4 Let k(d) = -2d2 - 11d + 13. Let t be k(-6). Let w = t - -4. Suppose 2p = -3l + 31, -l - 5p = -3l - w. Calculate the remainder when 32 is divided by l. 4 Let k = -6 + 11. Suppose 4a - 128 = -0a + kq, q + 33 = a. What is the remainder when a is divided by (-2)/(-2)(15 + 5)? 17 What is the remainder when 21 + (6/2 - 0) is divided by (17/(-4))/((-6 - (-78)/(-24)) + 9)? 7 Suppose v = -5x + 3v + 866, 0 = -5x - v + 857. Let m be ((-48)/(-24))/(3(-4)/186). What is the remainder when x is divided by -15/2(17 + m)? 32 Let y(a) = -a*2 - 132a + 16. Let p(m) = 2m2 - 1. Let x(z) = -p(z) + y(z). Calculate the remainder when 115 is divided by x(-44). 13 Suppose -47857 = -56b + 173735. Calculate the remainder when b is divided by 4. 1 Suppose 0 = -j + 4, 4h + 5j - 24 = 3j. Suppose 5i - 118 = -n, -hi - 4n + 88 = -0i. What is the remainder when 46 is divided by i? 22 Let f(d) = 27d + 359. Let h(y) = 31y + 359. Let k(v) = 3f(v) - 2h(v). Calculate the remainder when k(0) is divided by 20. 19 Let v(s) = -934s + 171. What is the remainder when v(-4) is divided by 91? 85 Suppose 100r - 16290 = 21610. Calculate the remainder when 1517 is divided by r. 1 Let c(g) = 35g - 1. Let f(z) = 5283z + 42464. Calculate the remainder when f(-8) is divided by c(1). 30 Let d be 18/(-63) + 279/21. Let p(i) = -9i - 8. Let q be p(d). Let m = -70 - q. What is the remainder when m is divided by 19? 17 What is the remainder when (-13)/(78/(-1452)) + (-4 - -8) is divided by 16? 6 Let t(b) = 2b2 + 14b + 23. Let n be t(-5). Calculate the remainder when (-11 + (3 - -4))/(2 - n) is divided by (-2)/(-4) - (-10)/4. 1 Suppose -442a = -36a + 41838 - 890378. What is the remainder when a is divided by 696? 2 Let i be ((-6)/4)/((-39)/(-208)). Calculate the remainder when (101)/(i + 225/27) is divided by ((-3)/12)/(3/(-132)). 8 Suppose 4f - 49 = 3i, 29 = 5i + 4. Let o = -274 + 303. Suppose 0 = -oh + 34h - 305. What is the remainder when h is divided by f? 13 Suppose 2q = -q + 48. Let p(d) be the third derivative of -41d*4/24 - 146d*3/3 + 571d2. What is the remainder when p(-9) is divided by q? 13 Let h(y) = -y3 + 17y2 + 19y - 14. Let d be h(18). Suppose -j + 168 = db, -3j = 5b - 243 + 40. Calculate the remainder when 162 is divided by b. 33 Let a = 1304 - 563. Suppose 15t - 2t = a. Calculate the remainder when t is divided by 10. 7 Suppose -7703o - 4824 = -7712o. Calculate the remainder when o is divided by 57. 23 Suppose 0 = k - 2x - 173, 3k = -33x + 29x + 549. Calculate the remainder when k is divided by 58. 5 What is the remainder when 447 is divided by 5362/383-214/(-8)? 6 Suppose 7r - 20 = 2*r. Let t be (r/	{ "pile_set_name": "DM Mathematics" }
/j*(6/7))jj))/j(j/(j/(j/(j/(j/(jj/((j/j(-23)jj)/j)j))))jj))/j) assuming j is positive. j(-226/7) Simplify (x/(x/x(-5)))46/(x(-1/11)/xx(1/3)/x) assuming x is positive. x(-7532/33) Simplify (hhh15hh/((hh1)/h))/(h(1/2)h/h(-2/31)) assuming h is positive. h(1019/62) Simplify w(-1/16)w*(2/19)w/(w/((((w/(w*11/w))/w)/w)/w))ww7 assuming w is positive. w(-1203/304) Simplify ((b/b(-7)b(1/3)/b)(-38))(-2/7) assuming b is positive. b(1672/21) Simplify (((b5)(1/5))2)(-4/15) assuming b is positive. b(-8/15) Simplify z(-7/3)z(4/3)(zz/z(1/3)z)/(z/((zz/(z(-10)/z)z)/zz)) assuming z is positive. z(44/3) Simplify (k(-1/9)k)/k*(-1)k*(-1/20)k(-10) assuming k is positive. k(-1469/180) Simplify (s/(s*0s))*(5/7)s*(2/3)/(ssss*(-8)s) assuming s is positive. s(14/3) Simplify (c(-4/3))*(2/9)/((cc/c(3/19))/c(-30)) assuming c is positive. c*(-16487/513) Simplify (vv(-1)/v)(-43)/(v*(1/14)vvv(1/6)/v) assuming v is positive. v(877/21) Simplify m(-11)/(m/((m(-30)/m)/m))m15m/(mm/(mm24)) assuming m is positive. m(-5) Simplify ((y*6y(y2/yy)/yy)(-42))(-2/27) assuming y is positive. y28 Simplify (vv*8/v(v*(3/8)v)/v)/((vv3v)/v)(4/13) assuming v is positive. v(743/104) Simplify (a((a(1/17)a)/aa)/a((((a/(a/a*0a))/a)/a)/a)/aa)/(a3a(1/6)) assuming a is positive. a(-623/102) Simplify c(-3)/(c15cc)(c/(((c19/c)/cc)/c))(1/27) assuming c is positive. c(-556/27) Simplify (((a/(a/(a/a*0)a))/a*(-3/4))/(a/(a/(aa/(a*(-2)/aa))))(-22))(9/7) assuming a is positive. a(3195/28) Simplify i(-15/2)i6((i*(1/12)/i)/ii)/i(((i1/i)/i)/iii)/i assuming i is positive. i(-53/12) Simplify (((x/(xx*(9/5)))/xx)/(x(xx*(-3/14)x)/x))/(x26/x(5/2)) assuming x is positive. x*(-948/35) Simplify (f(f/((f/f*(2/3)f)/f))/ff)(-1/32)/(f/(f/(ffff/f*(1/15)f))(f/f(-2))/f) assuming f is positive. f(-3353/480) Simplify ((x/(xx*(4/3)/xx))/x)/(x*3x)(x(-1/17)/x)/(xx*19x) assuming x is positive. x(-1448/51) Simplify (d/d4dd5)(-3/14) assuming d is positive. d*(-9/14) Simplify (qq/(q(((q9/qq)/q)/q)/q))(-2/35)/((q/(q(1/30)/q))/qq(3/8)) assuming q is positive. q(-887/840) Simplify (v(-10)v(-38))25 assuming v is positive. v(-1200) Simplify ((u/((u1/u)/u))/(u/u*(2/21))(u*(-2/5)u)(-49))(-32/5) assuming u is positive. u*(95104/525) Simplify (y/(y((y/y*12)/y)/yy))/y*1y*(-1/11)yy(-4/3) assuming y is positive. y(349/33) Simplify y7/yy*(-16)(y(-1/2))42 assuming y is positive. y(-31) Simplify (((w(-4)w)/www)/wwww9)(-7/2) assuming w is positive. w*(-28) Simplify (k/(k/(kk*3kk)k))/((k/(kk/(kk*(-6/7)/kkk)k))/k)k(2/3)k5 assuming k is positive. k(263/21) Simplify (((ss(4/5)/s)/s)/(sss(-12/7)s))/(ss((ss(1/2)/s)/s)/sss/(ss3)) assuming s is positive. s(1/70) Simplify ((n(-1))(-2/103)/(n(4/7)/(n(9/4)n)))(-9/7) assuming n is positive. n(-70029/20188) Simplify (f(-8)/fff/f(3/4)f)/(f(f/((f(1/4)f)/f))/f)(-21) assuming f is positive. f9 Simplify ((oo(13/5)o)/(oo(-1/15)o))/(o*(-1/2)o(2/33)) assuming o is positive. o(205/66) Simplify (l(-6)/l(-5))/(l2)(-2/123) assuming l is positive. l*(-119/123) Simplify ((k/(kk*(-1/14)/k)k)/kkk(-1/6))/(k/k(3/5)k(k/k(4/9))/k) assuming k is positive. k(299/315) Simplify (f/(f*(1/10)f)ffff(3/14))37 assuming f is positive. f(4033/35) Simplify (k(1/7))*(1/2)/(k((k(1/7)/k)/k)/k)(-31) assuming k is positive. k(-115/2) Simplify (w(-1/5)w/((ww*19)/w))/(w/(w((www*(-3)www)/w)/w))(-3) assuming w is positive. w(-91/5) Simplify (v*(-2/55)v)*(-2/3)/((vv(4/11))/(v/((v/v(-20))/v))) assuming v is positive. v(-3466/165) Simplify (c(-1/5)/((c/c*(-16))/c))/((ccc/c(-13)cc)/(cc/((c(c/c(-2/23))/c)/c))) assuming c is positive. c(-3713/115) Simplify ((yy*(-8)y)/(yy/(y/(y/(y/(yy(-11)/y))))))(-3/5) assuming y is positive. y*(-12/5) Simplify (oo(-9))/(o/(o/(o/(o(-26)o))))(o(o/o(-4/5)o)/o)(2/39) assuming o is positive. o(-6602/195) Simplify (((y(-1/7))(-1/26))41)(2/81) assuming y is positive. y(41/7371) Simplify ((d0)*42(d1)(-2/135))(-30) assuming d is positive. d(4/9) Simplify ((n/n*4n/n(6/13))/(n0)(-3/19))29 assuming n is positive. n*(-928/13) Simplify (aaa(-1/47)aaa/a*(-1))/(aa*(-2)aaaa(aa(-5/2)a)/a) assuming a is positive. a*(421/94) Simplify (a/((aa0)/a))23a/(a10/a)a*6a assuming a is positive. a22 Simplify (k/(k/(k/(k(-4/7)/k))))/(k/(kk(-3/10)))(k1)(1/8) assuming k is positive. k(671/280) Simplify ((r(1/2)/rrr/(r/((r/(r(rr*(8/3)rr)/r))/r)))(11/2))(1/15) assuming r is positive. r(-341/180) Simplify (((n/(nn/((n*1nn)/n))n)(47/3))22)(-44) assuming n is positive. n(-90992/3) Simplify (f(f(2/37)/f)/f)/f(-2/21)(f*(-1/15)f)(1/5) assuming f is positive. f(-12899/19425) Simplify ((vv(-3))(-2/15))(-38/3) assuming v is positive. v(-152/45) Simplify (q/((q/q(-1))/q)qq)(-2/5)/(q(1/6)q(-2/57)) assuming q is positive. q(-177/190) Simplify (b*(-8/5)b/(bb2b))/(b(-1/3))41 assuming b is positive. b(136/15) Simplify (x11/xxx*9)/(xx9)(-38) assuming x is positive. x*400 Simplify (jj*(-2/13)/jj)/(j*(-6)/j)jj(-6)/jj(j(j*(-10)/j)/jj)/j assuming j is positive. j*(-106/13) Simplify (bb(2/5))(2/15)/(b*6/(bb10)) assuming b is positive. b(389/75) Simplify ((y*(-1/5)yy(-8)y)(-1))(-42) assuming y is positive. y(-1302/5) Simplify g28g/g(-3/11)gggg(g(g(-2/19)g)/gg)/(g/(g11/g)) assuming g is positive. g(9231/209) Simplify (j(-7/5)j/(j*(12/7)j)j)/((j(-2/41)/j)/j16) assuming j is positive. j(21431/1435) Simplify (((w12w)/w)/(w*21w))/(w(-6/13)/w(2/55)) assuming w is positive. w(-6794/715) Simplify (((v/(v/(((v(2/7)/v)/v)/v)v)v)30)(9/5))(-12) assuming v is positive. v(12312/7) Simplify (k/(k*0k)k)(10/9)(k/(k/k*(-12))kk)/(k(-21)k) assuming k is positive. k(100/9) Simplify ((o(-6)/(oo/o(3/7)))/(o/(o/(oo/(o*1o)o)o)o(-12)))(-8) assuming o is positive. o(-248/7) Simplify ((bb(-1/3))(2/53)((bbb(b/(bb(-1)))/b)/b)45)(-45) assuming b is positive. b(-214710/53) Simplify (z(2/83)zz)(3/16)/((z/(z/(z(z*(-8/15)z)/zz)))/((zzz(15/8)z)/z)) assuming z is positive. z(27767/9960) Simplify x/((x6/x)/x)xxx(7/6)(xxx/((x*(8/7)/x)/xx)x)/(x/(xx*4x)) assuming x is positive. x*(379/42) Simplify (c/(c/(cc*(-3/5))))/(c/(cc*(-13)))(c/((c/c*(-1/5))/ccc))/(c(-1)/c) assuming c is positive. c(-59/5) Simplify (h/h(2/19))/((h/(h(h/(h/h*(-18)))/h))/h)((h/h*(2/3))/hh)(-22) assuming h is positive. h(-1393/57) Simplify (mm(mm/m(-3/2))/m)(-1/11)/(m(-2/3)/((m/(m/(m(m/((m*(-2/33)m)/m)m)/m)m))/m)) assuming m is positive. m(7/22) Simplify (f(-25)f/((((f(2/13)/fff)/ff)/f)/f))32 assuming f is positive. f(-9632/13) Simplify (a(-2/75)/(a(-5/3)/aa))/((a24a)/a2) assuming a is positive. a(-534/25) Simplify p*(5/9)/(p((pp39ppp)/p)/pp)(p*19p)5 assuming p is positive. p(518/9) Simplify (y5/y(1/7))/(y/y*(-12/5)y/((y(-4/3)/y)/y)) assuming y is positive. y(-302/105) Simplify (ss/(sss/(s/s4)ssss))(-1/20)/(s(1/6))(-31) assuming s is positive. s(167/30) Simplify (t(-5))(-1/5)/((t(-9)t)/(t/(t/(t(2/13)/t)))) assuming t is positive. t(106/13) Simplify (z*(-8)zz(-14)zz)/((((z/((z/z(1/4))/z))/zz)/z)/z(2/3)) assuming z is positive. z(-223/12) Simplify l*(-14)(l/(lll/(l/(l*(-6/11)l))))/ll(l*(-4)ll)(16/5) assuming l is positive. l(-1202/55) Simplify ((s(s/(s/(s/(((s/s*(-11))/s)/s))s))/s)/(sss(-9/7)))(2/29) assuming s is positive. s(-150/203) Simplify (h(-1/3))(-7)/((h/h(-4/9))/((h/(hh/h(-2/7))h)/h)) assuming h is positive. h*(-25/63) Simplify ((hh1)/h)22/(h*(14/3)hhh/(h/h(1/6))) assuming h is positive. h(91/6) Simpli	{ "pile_set_name": "DM Mathematics" }
208w - 77. What are the prime factors of m(29)? 619 Let l = -13 - -16. Let f = l + 0. List the prime factors of f((-230)/(-3))/5. 2, 23 List the prime factors of 8/(-22) - (-349700)/572. 13, 47 Suppose -4n + 11 = 3g, -3n - 3g + 9 = -0n. Suppose -4o = -5c + n, 3c + 2o + 0 = -12. Let x = 6 + c. What are the prime factors of x? 2 Let p(r) = 11r + 4081. What are the prime factors of p(0)? 7, 11, 53 Suppose -3c + 677 = l, -5l - 12c = -13c - 3433. What are the prime factors of l? 2, 7 Let h(f) = f*3 + 7f*2 - 18f - 6. List the prime factors of h(-8). 2, 37 What are the prime factors of (582(-56)/(-42))/((-2)/(-5))? 2, 5, 97 Let i(g) = g3 - 11g*2 + 6g + 19. Let b be i(10). List the prime factors of 203((-48)/b - 2). 2, 29 Suppose 2l - 16 = -5r, 4 = l - 3r + 7. Suppose z = -lz + 16. Suppose -5n + z = 5j - 21, 4n = -j - 4. List the prime factors of j. 2 List the prime factors of ((-24)/16)/(5/20) + 2146. 2, 5, 107 Let v(t) = -29t + 2. Let x be v(-1). Let o = x - 29. Suppose 66 = od - d. List the prime factors of d. 2, 3, 11 Suppose -9f + 27888 = -2f. Suppose 20v - 4v = f. What are the prime factors of v? 3, 83 Suppose -2z - 4 = 5v, -v - v - 16 = -4z. Suppose 231 = zs - 129. List the prime factors of s. 2, 3, 5 Let y(s) be the first derivative of s*6/360 - 7s*5/120 - 3s*4/4 - 3s*3 - 8. Let d(u) be the third derivative of y(u). List the prime factors of d(10). 2, 3 What are the prime factors of (-472)/(-177)(1 + 146)? 2, 7 Suppose -4h + 6063 = -5513. What are the prime factors of h? 2, 1447 Suppose -m = -v - 4, -3v - 14 = -2m + m. Let z(s) = s3 + 10s*2 - 5s + 4. List the prime factors of z(v). 2, 7, 11 Let w be (-8)/((-8)/(-2))-2. Suppose -2d + 2 = -2l, -3l + 11 = wd - 0l. List the prime factors of d. 2 What are the prime factors of (-1)/(2/1852)1491/(-426)? 7, 463 Suppose y + 3y = -2r + 916, -5r - y = -2263. What are the prime factors of r? 2, 113 Let w(z) = 24z2 + 7z - 62. List the prime factors of w(5). 3, 191 Suppose -32 = -3g - g. Suppose 12 + g = 4j. What are the prime factors of j? 5 Let w = -4728 + 8372. List the prime factors of w. 2, 911 Let q be 2 + 96/((-8)/(-2)). Let n = -24 + q. Suppose 2d + 3o - 54 = 0, nd = -4o + 3o + 54. List the prime factors of d. 3 Let c = 4970 - 1127. What are the prime factors of c? 3, 7, 61 Suppose -3u - 4 = -10. Suppose 2f + uf - 100 = 0. What are the prime factors of f? 5 Let a = 345 + -244. Let r = 90 - 158. Let x = r + a. What are the prime factors of x? 3, 11 Let z(o) = o*3 + 11o*2 + 13o - 3. Suppose 13h - 8h = -45. List the prime factors of z(h). 2, 3, 7 Suppose -340 = -3d - 2d. Let m = d - 9. List the prime factors of m. 59 Let y = 701 + -360. What are the prime factors of y? 11, 31 Suppose 0 = -9s + 362 + 3292. List the prime factors of s. 2, 7, 29 Let x = 24 + -49. Let d be 30/x(1 - -9). List the prime factors of (28/(-6))/(2/d). 2, 7 Suppose 18c + 6c = 4c. Let h = 0 + 5. Suppose -5y - x - 28 = -178, c = -hy + 5x + 120. What are the prime factors of y? 29 Suppose 1484 = -45x + 49x. List the prime factors of x. 7, 53 Let j(k) = 2k3 - k2 + k - 2. Suppose 9m = 4m + 10. Let n be j(m). Suppose 85 = nt - 7t. What are the prime factors of t? 17 Suppose 14k - 17k - 1951 = -2s, -s + 1003 = 4k. List the prime factors of s. 983 Let n(g) = g2 + 17g + 169. What are the prime factors of n(31)? 1657 Let o(i) = -205i - 144. List the prime factors of o(-4). 2, 13 Suppose -48p + 49p = 4l + 1774, 0 = 5p + l - 8765. What are the prime factors of p? 2, 877 Suppose 3b - 13 = -43. Let l be ((-1)/(-2))/(b/(-60)). Suppose c = -lc + 192. List the prime factors of c. 2, 3 Suppose -2b + 3b = 45. Suppose 0 = -4t - 5p + 46 + 66, -3p - b = -t. List the prime factors of t. 3, 11 Let k(l) = -2l3 + 5l*2 - 3l. Let a be k(5). Let w = -81 - a. Suppose 3s + 5 = c, 5c = 2s - 4s + w. What are the prime factors of c? 11 Suppose 19 = 2k - 1. Suppose 5w + k = 0, -o + 0o + 138 = 4w. List the prime factors of o. 2, 73 Let d be ((-5)/10)/((-453)/(-454) - 1). Let s = d - 11. What are the prime factors of s? 2, 3 Let m(i) = -i - 2. Let t be m(-10). Let o = t - 12. Let b(z) = z*3 + 4z*2 - 2z - 6. List the prime factors of b(o). 2 Let i(q) = 6q + 24q*2 + 2q*2 - 4 - q. What are the prime factors of i(2)? 2, 5, 11 Let b(a) = -29a - 8. Let n be b(-7). List the prime factors of (-4)/((-5)/(n/2)). 2, 3, 13 Suppose 3r = 4r. Suppose -t - 4f = 3t - 52, -5t + 2f + 79 = 0. Suppose 2g - 13 - t = r. List the prime factors of g. 2, 7 Let f(l) = -8l*3 + 5l*2 - 4l - 2. Let h be f(5). Let j = h + 185. List the prime factors of j/(-40) + (-1)/(-5). 2, 3 Suppose 2h + 3c = -135, 92 = -h - 4c + 22. Let z = 101 + h. Suppose -2l - 47 = -3v + 3l, 3v = 2l + z. What are the prime factors of v? 3 Let a be 1/(-12/(-12)). Let j be 96/(-12)18/(-8). List the prime factors of 2/a + 372/j. 3, 7 Let a(r) = -286r - 170. List the prime factors of a(-5). 2, 3, 5, 7 List the prime factors of 2 + 485 + (69 + 1)/10. 2, 13, 19 Suppose 0z - 2z + 208 = -2y, -4y - 4z - 376 = 0. Let l = 157 + y. List the prime factors of l. 2, 29 Let j(w) = w*3 - 29w*2 - 30w + 102. What are the prime factors of j(30)? 2, 3, 17 Suppose -386 = -5t - 116. Suppose -4n + t = -10n. What are the prime factors of 104/(-6)n/6? 2, 13 Let j = -385 + 2954. List the prime factors of j. 7, 367 Let u(w) = -w*3 + 13w*2 - 11w - 5. Let z(k) = -2k + 4. Let g be z(-4). Let x be 1/(((-7)/g)/(-7)). List the prime factors of u(x). 7 Let o(d) = d3 + 10d*2 - 8d - 5. Let g be o(-9). Suppose -2u - 4v = -g, 6 = 3v + 18. What are the prime factors of u? 2, 41 Suppose 0 = 3i + 3q + 18, -2i + 3i = 5q + 24. Let n(j) be the first derivative of -5j2/2 - j + 1. List the prime factors of n(i). 2 Let m(a) = -2a*2. Let p(s) = 3s*2. Let k(u) = 8m(u) + 5p(u). Let t(w) = 2w*2 + 10w + 14. Let o(f) = 3k(f) + t(f). List the prime factors of o(10). 2, 7 Suppose -5o + 1086 = f - 151, 3o = 4f - 5040. What are the prime factors of f? 3, 419 Let r = 9 - 16. Let n(y) be the first derivative of -y*3/3 - 9y*2 - 6y - 83. What are the prime factors of n(r)? 71 Let k = 765 - -403. What are the prime factors of k? 2, 73 Let v(a) = a*2 - 12a + 6. Let y be v(12). Suppose yq = -0q + 378. What are the prime factors of q? 3, 7 Suppose 0 = -5x + a - 0a + 148, -x - a + 32 = 0. Suppose m - 21 = x. What are the prime factors of m? 3, 17 Suppose 2k + 3n - 930 = -113, 3k + n - 1229 = 0. List the prime factors of k. 2, 5, 41 Let u(w) be the third derivative of 3w*4 + 2w*3 + 9w2. List the prime factors of u(2). 2, 3, 13 Let z(w) = -w3 + 32w2 + w + 38. List the prime factors of z(32). 2, 5, 7 Let y(o) be the third derivative of -7o*4/24 - 7o*3/6 + 4o*2. Let v be y(-5). Let j = v - -3. What are the prime factors of j? 31 Let n = -12 + 15. Suppose 2z - nq = 317, -3z - 2z - 4q + 827 = 0. Suppose 4x - 99 = 2f + z, -x = -f - 68. What are the prime factors of x? 3, 7 List the prime factors of ((-2358)/(-2))/((-3)/(-3)). 3, 131 Let y be (-65)/(-25) + 9/(-15). List the prime factors of y/(-4) + (-2676)/(-24). 3, 37 Let l = -45 + 25. What are the prime factors of (45/(-10))/(3/l)? 2, 3, 5 Suppose 2r + 2 + 1 = f, r = 3f - 4. List the prime factors of f31(0 - -4). 2, 31 Let i(s) = s - 4 + 3s + 8 - 7s + 2s2. List the prime factors of i(3). 13 Let b = 1138 - -3178. What are the prime factors of b? 2, 13, 83 Let o = 73 + -79. List the prime factors of (551/57)/((-1)/o2). 29 Suppose -35g - 4728 = -43g. What are the prime factors of g? 3, 197 Let y = -560 + 2024. What are the prime factors of y? 2, 3, 61 Let g(s) = 4s2 - 1. Let y be g(1). Let i be 1/44 - -2. Suppose yv = 15, il + 3v - 27 = 33. List the prime factors of l. 3, 5 Suppose 0s = -3s - 9, -c + 2s = -339. List the prime factors of c. 3, 37 Suppose -136p + 5s = -133p - 4574, 4p - 5s = 6102. What are the prime factors of p? 2, 191 Suppose m + 8 = 5t - 1, 3m = t - 13. Let q be t/(-5) + 612/(-15). Let f = -22 - q. What are the prime factors of f? 19 Suppose -3p + 32 = p. What are the prime factors of 774/p + 15/(-20)? 2, 3 List the prime factors of -2*(-	{ "pile_set_name": "DM Mathematics" }
the closest to 1? (a) u (b) -1 (c) 0 (d) -10 c Let h = 264 - 257. Let i(y) = -y*2 + 6y + 9. Let p be i(h). Which is the nearest to 2/7? (a) 11 (b) p (c) -0.1 c Let j = -564 - -559. Let d = 8.1 + -7.7. Which is the closest to d? (a) 1.4 (b) j (c) -0.5 c Suppose 4n + 0n + 8 = 0. Let v be ((-256)/(-42) - 6)/(1/3). Let g = 0.0592 + 0.2408. Which is the closest to n? (a) v (b) g (c) 0.5 a Let b be 1 - (-44)/(-14) - -2. Let i = 223 - 94. Let p = 125 - i. What is the nearest to -2/3 in 3, b, p? b Let l = 1.3 + 3.7. Let k = -19/3 - -20/3. Suppose -u = 14w - 9w - 31, -4u - 30 = -2w. Which is the closest to l? (a) -5 (b) u (c) k c Let j = -62.866 - -63. Let f = j - 0.034. What is the closest to f in 4/9, -0.1, 4? -0.1 Let v = -1 - -1.3. Suppose -17u + 35 = -20 - 30. Which is the nearest to u? (a) -5 (b) v (c) 2 c Let a = 0 + 0.4. Let u = -0.5201 + 0.1461. Let x = 3.374 + u. What is the closest to -0.1 in x, 0.1, a? 0.1 Let r be 45/(-126) - 30/(-35). Let u be ((-2704)/(-20) - 3)1. Let z = u - 133. What is the nearest to 2/5 in z, 1, r? r Let g = 4434 + -4432. What is the closest to 0.7 in 1/5, -3, g, -2/13? 1/5 Let u = 8 + -7.5. Let n be (-24)/(-11 - -5)1. Suppose -4i + 4g = n, -6i + g = -i - 3. Which is the closest to -13? (a) i (b) 3 (c) u c Let v = 672 - 672.2. Let s be 16/60 - (-4)/(-6). Let r = 8.5 + -3.5. Which is the closest to v? (a) r (b) s (c) -2 b Let u be 78/208 - (-63)/24. Let x = 12.8 + -13. Which is the closest to x? (a) -1/3 (b) 3/5 (c) u a Let o = -1635.7 + 1636.2. Which is the closest to 0.1? (a) -227/2 (b) 2/3 (c) -3 (d) o d Let t = -4 + 9. Let j be (-56)/126(-13)/(-4). Let c = j + 17/18. What is the closest to 0.1 in -2, t, c? c Suppose 2z - 9 = -75. Let y be 12/60 - -2z/30. Which is the nearest to -2? (a) y (b) -0.1 (c) -4 a Let k = 23/5 - 24/5. Let h be 131/36 - (45 - 20604/459). What is the closest to -2/7 in -5, h, k? k Let y(v) = -v*2 - 2v - 2. Let j be y(-3). Let d = -0.412 - 7.408. Let r = d + 8.12. Which is the nearest to r? (a) -2 (b) 1/4 (c) j b Let m = 2395 - 2398. Which is the closest to m? (a) 0.1 (b) -5 (c) -0.5 (d) 2/23 b Let w = -63/278 - 38/139. What is the nearest to -3 in 1/12, w, 5, -2? -2 Let p = -3.16 + 5.16. Which is the closest to p? (a) 18 (b) 0.4 (c) -5 (d) 3 d Let u = -0.109 - 0.004. Let o = u - -5.113. Which is the nearest to 0? (a) -1 (b) -7 (c) o a Let x = 1628/12255 - -2/4085. What is the closest to x in -4, 1.5, -0.05? -0.05 Let j = 85/3172 - -31/244. Which is the nearest to 0.1? (a) 35.9 (b) 0.5 (c) j (d) -0.5 c Suppose 5s - 5h - 17 = -7, 4s = -3h - 13. Which is the closest to s? (a) -2/25 (b) -7 (c) -3 a Let a = 22828.9 - 22832.9. Let w = 0.016 - -2.884. Let p = -2.1 + 2. What is the closest to p in -0.4, w, a? -0.4 Let l = -199 - -427. Let j = l - 1138/5. Let x be (-40)/702/4. Which is the closest to j? (a) -4 (b) -0.5 (c) x c Let y = -0.046 - -2.046. Let v = -588 + 588. What is the nearest to v in -5, y, -0.04? -0.04 Let p = 32715 - 32712.6. Which is the closest to 3/4? (a) -0.1 (b) p (c) -0.2 a Let o = -3182 - -3183. What is the closest to o in -4/5, -5, 17, 1.5? 1.5 Let t = -23.65 + 23.55. What is the nearest to -1.3 in 21, -2, t, 5? -2 Let t = 9473/28464 + 5/9488. Which is the nearest to t? (a) -2 (b) 1/3 (c) -1/73 (d) 4 b Let w = -1.06 + 0.06. Let x = -0.077 + -89.923. Let y = 89.6 + x. What is the closest to w in -1/4, -12, y? y Let h be 14/((-42)/9) - -2. What is the nearest to h in 2, -1/9, -14, -1/7? -1/7 Suppose -3a - 20 = -x, a + 16 = -2a - x. Suppose -4g = -5q + 7, 0g + q = -2g - 7. Let p be g/(-18)12/8. What is the nearest to -0.2 in a, p, -1/6? -1/6 Suppose -8u + 20 = 68. Let c be ((-4)/u)/(26/(-3) + 0). Let n be ((-2 - -2) + -1)(10 - 9). What is the nearest to n in -3, c, -4/5? -4/5 Let y be (2/(-20))/((-442)/48705). Let h = y + -140/13. Which is the nearest to h? (a) -0.5 (b) 5 (c) 0.4 (d) -1/7 c Let c = 1474.72 + -1474.6. What is the nearest to -0.01 in 3, -1, c, -4? c Let f = -545 - -563. Suppose -fo + 22 = 4. What is the nearest to o in 2/5, -3, -5, 0? 2/5 Let n be 100(-2 - (-42)/35). Let r be -6 - (-4 + n/36). Let w be (-2)/(-6)2/(-6). Which is the nearest to r? (a) -4 (b) w (c) -3 b Let x = 1342/4277 - 2/329. What is the nearest to -1 in 4, x, -1/3? -1/3 Let d = -0.222 + -129.778. Let c = -77 - d. Let s = -58 + c. What is the closest to -1/4 in s, -1/5, 4? -1/5 Let j = 876745/328 + -2673. Let a = j + 161/984. What is the closest to 3/5 in -1/11, a, 2/9, 2? 2/9 Let q = 37 + -36.8. Let y = -3.7 - q. Let w = y + 3.8. What is the closest to 2 in 2, w, -4? 2 Let u(s) = -3s - 60. Let m be u(-28). Suppose 5i + m = z, 5 = 2i - 4i + 5z. What is the nearest to i in -7, -1/2, 2/9, 2/15? -7 Suppose -2f - u + 30 - 37 = 0, 5f - u = -21. Let w = -1.1 + -2.9. Which is the nearest to f? (a) w (b) -5 (c) 2/7 a Let t = -0.1308 - -0.1508. Let z = -79 + 242/3. What is the nearest to 1 in z, 5, -4, t? z Let h = 4.74 - 4.2. Let t = 15.82 - 15.38. Let m = t - h. What is the closest to -0.1 in -2, -2/7, m? m Let l = 914 + -913. Let f be 3/((-15)/6 - -1). Let m be -13/2f. Which is the nearest to m? (a) 4/5 (b) -1 (c) l c Let q = 913.593 - -17.407. What is the nearest to 2/7 in 0.5, 0, 4, q? 0.5 Let f = -3110 + 3110. What is the closest to -13 in -5, 4, f? -5 Let x = -1.353 + -1.647. Which is the closest to 1? (a) x (b) 1/15 (c) 2/21 (d) 3 c Let v = 0.388 + 218.612. Let f = v + -218.5. Let d = -1.94 + -0.06. Which is the nearest to d? (a) -4 (b) f (c) 1/5 a Suppose -2m = 3n + 13, -2m - 5 = -11n + 6n. Suppose -65 = -7w - 79. Which is the nearest to n? (a) -3/10 (b) -1 (c) w b Let l be ((-404)/336 + (-15)/(-12))/(-1). Which is the nearest to -1/8? (a) l (b) -1 (c) 5/4 a Let v = 5748 - 9098. Let q be 1 - (1/(-170))/((-40)/v). Let s = 1/136 + q. Which is the nearest to s? (a) 0.2 (b) 0 (c) 2/5 c Let v = 20.549 - 27.549. Which is the closest to -153? (a) 0 (b) -0.5 (c) v c Let q be 2/4 + 6/4. Let x = -702.6 - -627. Let w = -76 - x. Which is the closest to -1? (a) -3 (b) q (c) w c Let h be 12091/2260 + (-2)/(-30). Which is the nearest to 0.1? (a) -2/9 (b) h (c) 0.3 c Let t = 104.5 + -7.5. Let m = t - 97.14. Which is the nearest to -0.2? (a) m (b) 4 (c) -3 a Let p = 8923 + -8927. What is the closest to 79 in -2, 59, p? 59 Let b = -0.0921 - 0.4079. What is the nearest to 2/3 in b, 0.05, 0.5, -4? 0.5 Let l = 53759/268745 + -2/53749. What is the closest to -414 in 0, -0.3, l? -0.3 Let d = -3 - -2. Let m = 218 - 142. Let h = -79 + m. Which is the closest to -0.2? (a) d (b) h (c) -5 a Suppose 2n = 7n. Suppose -v - 10 + 5 = n. Let p = 0.1051 - 4.1051. What is the nearest to -6 in v, p, 2/3? v Let g = -2512.6 + 2513. Let n be 2(-1)/(-12)(-3)/(-2). What is the nearest to n in g, -4, -0.08, -2? g Let u = 1528 + -6111/4. Which is the nearest to 7? (a) 0.3 (b) u (c) 0.5 (d) 0.8 d Let x = -75 - -79.3. Let s = x - 4. What is the closest to s in -1, 4, -0.1? -0.1 Let z = 5.307 - 5.1. Let t = 25.993 + z. Let v = 26 - t. What is the closest to 2/7 in 0.3, v, -2/3? 0.3 Let d be (-21292)/(-9954) + -8(-12)/(-432). Let u = 16/79 - d. Which is the closest to -2? (a) -1 (b) u (c) -0.2 b Let t be (2/3)/(1/(-2)). Let i be (20/6 - 4)(-5)/10. Suppose 0 = 26h - 27h - 19. Which is the closest to -1? (a) h (b) i (c) t c Suppose -4f - 41h + 37h + 28 = 0, 9 = 3f - 3h. Let l = 8.3 - 8. What is the nearest to 0.1 in f, l, 1? l Let k(h) = -2h*2 - 26h - 1. Suppose 0 = 3x + 25 + 14. Let p be k(x). Let s be (p - -5)6/(-228). Which is the nearest to -0.1? (a) -4 (b) s (c) 0.1 b Let k = -51368/559 - -1194/13. Which is the nearest to k? (a) -4 (b) 4 (c) 0.5 c Let c = 7424 + -7426. What is the nearest to 0.11 in 1, -4, c? 1 Let z = -154.646 - 1.954. Let r = z + 157. Which is the nearest to -0.1? (a) r (b) 5/14 (c) 4 b Let j be (6/(-15) + (-290)/(-100))238/35. Which is the closest to 0? (a) -0.1 (b) 0.2 (c) j a Let x = -7/10 + 1/2. Suppose 148t = 132t. What is the nearest to 12 in 5, t, x? 5 Let l be 10/(-26)6/(-15). Let y be 9 + 10 + (-61)/2 - -11. What is the nearest to y in 0, 3, -1/5, l? -1/5 Let h = -674 + 931. Let n = 256.4 - h. Which is the	{ "pile_set_name": "DM Mathematics" }
4 AM? 1:10 PM How many minutes are there between 6:49 AM and 11:51 AM? 302 What is 51 minutes before 10:55 AM? 10:04 AM What is 48 minutes after 11:44 PM? 12:32 AM How many minutes are there between 9:13 PM and 2:26 AM? 313 What is 488 minutes before 9:09 AM? 1:01 AM How many minutes are there between 1:58 AM and 1:00 PM? 662 What is 252 minutes after 11:06 PM? 3:18 AM How many minutes are there between 5:23 PM and 8:45 PM? 202 What is 167 minutes after 9:20 AM? 12:07 PM What is 539 minutes after 8:35 PM? 5:34 AM How many minutes are there between 9:34 AM and 8:20 PM? 646 How many minutes are there between 6:55 PM and 2:04 AM? 429 How many minutes are there between 10:02 PM and 1:45 AM? 223 How many minutes are there between 9:42 AM and 11:59 AM? 137 What is 636 minutes after 7:30 AM? 6:06 PM How many minutes are there between 4:18 AM and 1:34 PM? 556 How many minutes are there between 10:20 PM and 12:04 AM? 104 What is 399 minutes after 12:30 PM? 7:09 PM How many minutes are there between 1:06 AM and 11:26 AM? 620 How many minutes are there between 11:07 PM and 6:05 AM? 418 What is 402 minutes after 7:27 PM? 2:09 AM How many minutes are there between 10:52 AM and 10:22 PM? 690 How many minutes are there between 3:30 AM and 12:36 PM? 546 What is 264 minutes before 1:26 AM? 9:02 PM How many minutes are there between 3:14 PM and 8:29 PM? 315 What is 679 minutes before 10:56 PM? 11:37 AM What is 560 minutes before 8:38 PM? 11:18 AM How many minutes are there between 8:41 AM and 12:52 PM? 251 What is 251 minutes before 10:56 AM? 6:45 AM How many minutes are there between 8:54 AM and 10:54 AM? 120 What is 149 minutes before 2:45 AM? 12:16 AM What is 611 minutes before 4:46 AM? 6:35 PM What is 90 minutes after 9:18 AM? 10:48 AM How many minutes are there between 4:26 PM and 9:24 PM? 298 How many minutes are there between 2:11 PM and 8:42 PM? 391 How many minutes are there between 5:05 AM and 4:42 PM? 697 How many minutes are there between 6:28 AM and 2:04 PM? 456 How many minutes are there between 11:06 PM and 2:07 AM? 181 How many minutes are there between 11:12 PM and 2:02 AM? 170 How many minutes are there between 11:15 AM and 7:40 PM? 505 What is 607 minutes before 11:45 AM? 1:38 AM How many minutes are there between 5:13 PM and 6:45 PM? 92 What is 639 minutes before 7:03 PM? 8:24 AM What is 186 minutes after 2:21 AM? 5:27 AM What is 665 minutes before 9:39 PM? 10:34 AM What is 586 minutes after 7:39 AM? 5:25 PM How many minutes are there between 1:00 PM and 3:35 PM? 155 How many minutes are there between 12:02 PM and 9:45 PM? 583 What is 612 minutes after 11:41 PM? 9:53 AM How many minutes are there between 3:45 PM and 12:22 AM? 517 What is 387 minutes before 8:59 PM? 2:32 PM What is 279 minutes before 6:44 AM? 2:05 AM How many minutes are there between 7:57 PM and 3:05 AM? 428 How many minutes are there between 12:49 AM and 11:16 AM? 627 What is 89 minutes before 5:52 PM? 4:23 PM What is 618 minutes before 10:46 PM? 12:28 PM What is 680 minutes after 11:39 PM? 10:59 AM What is 665 minutes after 10:09 PM? 9:14 AM How many minutes are there between 3:55 PM and 10:01 PM? 366 How many minutes are there between 11:01 AM and 9:53 PM? 652 How many minutes are there between 11:14 AM and 10:36 PM? 682 What is 302 minutes after 11:12 AM? 4:14 PM What is 401 minutes before 10:59 PM? 4:18 PM How many minutes are there between 12:14 PM and 1:06 PM? 52 How many minutes are there between 9:22 PM and 7:19 AM? 597 What is 572 minutes after 3:21 PM? 12:53 AM How many minutes are there between 11:26 AM and 4:18 PM? 292 How many minutes are there between 1:56 PM and 9:42 PM? 466 How many minutes are there between 4:40 AM and 12:03 PM? 443 How many minutes are there between 6:58 AM and 11:09 AM? 251 What is 12 minutes after 7:28 PM? 7:40 PM How many minutes are there between 1:25 PM and 12:40 AM? 675 What is 697 minutes before 4:43 AM? 5:06 PM How many minutes are there between 1:56 PM and 12:59 AM? 663 How many minutes are there between 3:42 PM and 2:21 AM? 639 How many minutes are there between 3:17 AM and 12:41 PM? 564 How many minutes are there between 11:54 AM and 2:04 PM? 130 What is 373 minutes after 6:52 PM? 1:05 AM What is 468 minutes after 7:41 AM? 3:29 PM What is 705 minutes after 8:22 PM? 8:07 AM How many minutes are there between 8:59 AM and 10:46 AM? 107 What is 399 minutes after 1:42 PM? 8:21 PM How many minutes are there between 9:26 PM and 2:15 AM? 289 How many minutes are there between 8:18 AM and 6:36 PM? 618 How many minutes are there between 5:35 PM and 12:00 AM? 385 What is 154 minutes before 11:25 PM? 8:51 PM What is 597 minutes before 9:28 AM? 11:31 PM How many minutes are there between 8:54 PM and 3:20 AM? 386 What is 305 minutes after 8:48 AM? 1:53 PM How many minutes are there between 6:35 AM and 10:50 AM? 255 How many minutes are there between 2:55 PM and 6:24 PM? 209 How many minutes are there between 5:40 AM and 9:53 AM? 253 How many minutes are there between 11:02 PM and 6:00 AM? 418 What is 508 minutes before 6:01 PM? 9:33 AM How many minutes are there between 12:54 AM and 6:36 AM? 342 What is 130 minutes after 7:47 PM? 9:57 PM What is 482 minutes before 4:02 PM? 8:00 AM How many minutes are there between 7:32 AM and 7:20 PM? 708 How many minutes are there between 11:33 PM and 6:45 AM? 432 How many minutes are there between 8:58 AM and 11:54 AM? 176 What is 418 minutes after 6:19 AM? 1:17 PM What is 547 minutes after 3:25 AM? 12:32 PM What is 372 minutes after 4:16 AM? 10:28 AM How many minutes are there between 7:30 AM and 12:50 PM? 320 What is 676 minutes after 10:00 PM? 9:16 AM What is 321 minutes before 11:10 PM? 5:49 PM How many minutes are there between 11:12 PM and 7:23 AM? 491 What is 458 minutes after 7:19 AM? 2:57 PM How many minutes are there between 10:56 PM and 8:51 AM? 595 What is 496 minutes after 9:30 PM? 5:46 AM What is 485 minutes before 10:29 PM? 2:24 PM How many minutes are there between 12:12 PM and 3:26 PM? 194 What is 172 minutes before 5:51 PM? 2:59 PM What is 672 minutes before 1:50 AM? 2:38 PM How many minutes are there between 8:36 PM and 10:13 PM? 97 How many minutes are there between 1:04 PM and 10:16 PM? 552 What is 605 minutes after 4:46 PM? 2:51 AM How many minutes are there between 10:37 PM and 10:57 PM? 20 How many minutes are there between 3:20 PM and 10:02 PM? 402 What is 371 minutes after 2:01 AM? 8:12 AM What is 530 minutes after 9:58 PM? 6:48 AM How many minutes are there between 2:09 PM and 4:19 PM? 130 How many minutes are there between 12:57 AM and 10:48 AM? 591 What is 88 minutes before 2:34 PM? 1:06 PM What is 171 minutes before 6:27 AM? 3:36 AM What is 132 minutes before 8:40 AM? 6:28 AM What is 405 minutes before 3:03 PM? 8:18 AM What is 194 minutes after 9:00 PM? 12:14 AM What is 337 minutes before 8:48 AM? 3:11 AM How many minutes are there between 2:59 AM and 9:59 AM? 420 How many minutes are there between 11:59 PM and 10:40 AM? 641 How many minutes are there between 6:56 PM and 12:05 AM? 309 How many minutes are there between 12:29 AM and 5:21 AM? 292 How many minutes are there between 8:06 AM and 1:26 PM? 320 What is 589 minutes before 10:05 AM? 12:16 AM How many minutes are there between 8:12 AM and 10:24 AM? 132 How many minutes are there between 1:33 PM and 3:02 PM? 89 What is 448 minutes after 8:57 PM? 4:25 AM How many minutes are there between 5:08 AM and 3:15 PM? 607 What is 457 minutes after 8:50 AM? 4:27 PM How many minutes are there between 10:27 AM and 11:21 AM? 54 How many minutes are there between 11:34 PM and 12:36 AM? 62 How many minutes are there between 1:32 AM and 11:31 AM? 599 What is 39 minutes before 1:19 PM? 12:40 PM What is 332 minutes after 2:56 PM? 8:28 PM How many minutes are there between 10:43 PM and 12:21 AM? 98 How many minutes are there between 7:15 AM and 6:31 PM? 676 How many minutes are there between 12:13 AM and 10:04 AM? 591 How many minutes are there between 1:30 PM and 10:22 PM? 532 How many minutes are there between 10:07 AM and 4:35 PM? 388 How many minutes are there between 5:02 AM and 8:31 AM? 209 What is 616 minutes after 1:20 AM? 11:36 AM What is 92 minutes after 10:02 PM? 11:34 PM How many minutes are there between 12:10 AM and 10:53	{ "pile_set_name": "DM Mathematics" }
ggest value in 0.16, -0.2, -15? -0.2 What is the second biggest value in -4, -2/3, 0.67, 3? 0.67 Which is the third smallest value? (a) 3 (b) -3 (c) 19 (d) -5 a Which is the second smallest value? (a) 16 (b) -8 (c) 0 c What is the second biggest value in 1.1, 5, 0.5? 1.1 Which is the third biggest value? (a) 1/3 (b) 0.04 (c) 77.9 b What is the third smallest value in -1/6, -0.5, 8, 0? 0 Which is the fourth biggest value? (a) -12 (b) 4 (c) 0.2 (d) -2 (e) 5/3 d What is the second smallest value in 0.003, 1/2, 2? 1/2 Which is the smallest value? (a) -2 (b) 3 (c) -28 c What is the biggest value in 0.3, -1, 1/5, -2, -10? 0.3 What is the fourth smallest value in 3, -5, -1, 3/2? 3 Which is the third smallest value? (a) 0.3 (b) 0.15 (c) 102 (d) 0.1 (e) -3/4 b What is the third biggest value in -0.1, 0.4, 19? -0.1 Which is the third smallest value? (a) -0.3 (b) -21 (c) -0.2 (d) 1/3 c Which is the third smallest value? (a) -1 (b) -0.4 (c) 6 (d) -3 b Which is the second biggest value? (a) -4 (b) 3 (c) 9.2 (d) 0 (e) 2/7 b Which is the second biggest value? (a) -1/2 (b) 2.8 (c) -11 (d) 3 (e) 0 b What is the smallest value in -40, 3.2, -0.1? -40 What is the third smallest value in -3/4, 4/5, 0.345? 4/5 Which is the third smallest value? (a) -2 (b) -0.1 (c) -4 (d) 0.6 (e) 2/23 b What is the smallest value in 0.1, 0.731, -0.2? -0.2 What is the second biggest value in 16/113, 2/9, 5? 2/9 What is the third biggest value in 2, 3, 0.4, 2/23? 0.4 Which is the second biggest value? (a) 2/15 (b) -3 (c) -0.4 c Which is the smallest value? (a) 4 (b) 1.69 (c) -1/3 c What is the third biggest value in 1/5, 0.5, 23.1, 4? 0.5 What is the second smallest value in -3, -3/5, 67? -3/5 What is the biggest value in 0, -3/5, -0.4, -7, -47? 0 Which is the second biggest value? (a) -5 (b) -0.39 (c) 4 (d) -1 b What is the second smallest value in 4/3, -0.1, 2, -343? -0.1 What is the second smallest value in 18/7, 2, 0.4, -2/13? 0.4 Which is the smallest value? (a) -11/15 (b) -5 (c) 1/2 (d) 1 b What is the third biggest value in -2/7, -2/3, -175, -3/7? -2/3 What is the third smallest value in 3, 3/8, 3/251, 1/2? 1/2 Which is the third smallest value? (a) -56 (b) 5 (c) 1 b Which is the biggest value? (a) -10730 (b) 1 (c) -0.1 b Which is the smallest value? (a) 5 (b) 2/31 (c) 47 b Which is the fifth biggest value? (a) -2 (b) -29 (c) -4 (d) -6 (e) 0.1 b Which is the fifth smallest value? (a) -2/7 (b) 2/5 (c) 0.9 (d) 3 (e) 1 d What is the third smallest value in 1/4, 102, -2? 102 What is the biggest value in 0.1, 289, -3, -2/7, 3/7? 289 Which is the fourth smallest value? (a) -0.3 (b) 0.6 (c) -1/2 (d) 0.8 (e) -2/11 b What is the second smallest value in -70, 3/5, 4? 3/5 Which is the biggest value? (a) -0.06 (b) 1/4 (c) 2/11 b What is the third smallest value in 4, -2/11, -1, -0.17? -0.17 Which is the second biggest value? (a) 1/546 (b) 3/2 (c) -1/8 a Which is the third biggest value? (a) -0.1 (b) 1/4 (c) -2/13 (d) 3 a What is the fourth smallest value in 0.2, -2, 0.28, 5? 5 Which is the third smallest value? (a) -1.55 (b) 1/6 (c) -1 (d) 2 (e) 1/11 e What is the fifth biggest value in 2/7, 1/9, -28, 0.7, -2/5? -28 What is the third biggest value in 2/3, -1.87, 5? -1.87 What is the fifth biggest value in 2, 14, 5, -4, -1/3? -4 What is the second smallest value in 45, 0.5, -5? 0.5 Which is the second biggest value? (a) -175 (b) 5/4 (c) 0.1 c What is the biggest value in -1, 2/15, 0.025, 3, 0.01? 3 What is the smallest value in 0.05, 0.13, -0.3, -1? -1 Which is the fifth smallest value? (a) 0.3 (b) 1/8 (c) 6 (d) -4 (e) 4 c Which is the third biggest value? (a) -0.1 (b) -2/7 (c) -22.8 (d) -1/2 d What is the biggest value in -105, -0.1, -0.2? -0.1 Which is the fourth smallest value? (a) 4 (b) 3/2 (c) 5 (d) -25 c What is the second biggest value in -2/9, 1, 4, -5? 1 Which is the second smallest value? (a) -0.2 (b) -0.5 (c) 0 (d) -3/4 b Which is the smallest value? (a) -14 (b) 4/5 (c) -0.3 a Which is the fourth biggest value? (a) 3 (b) -0.3 (c) 1 (d) -33 d Which is the third smallest value? (a) 0 (b) -0.3 (c) -5/11 (d) 5 a Which is the third biggest value? (a) -5/3 (b) 2/11 (c) 0.4 a Which is the fifth biggest value? (a) -13 (b) 0.08 (c) 4 (d) -1/4 (e) 3/7 a What is the third smallest value in 1, 69.6, -1? 69.6 Which is the third smallest value? (a) 3 (b) -0.3 (c) 0 (d) 81 (e) 4 a What is the third smallest value in 0.7, -20, -0.2? 0.7 Which is the second smallest value? (a) -1/3 (b) 34 (c) 12 c Which is the third smallest value? (a) 0 (b) 7 (c) -1/9 b What is the third biggest value in 1/8, -2, 20, -55? -2 What is the third biggest value in -1076, 1, -1? -1076 Which is the smallest value? (a) 1 (b) -0.04 (c) -5 (d) -1 c Which is the second biggest value? (a) 2 (b) -0.1 (c) -28 b What is the second smallest value in 0.3, -845, 0.2? 0.2 Which is the third biggest value? (a) 0.3 (b) 0.4 (c) -10/3 (d) -2/11 d Which is the fifth smallest value? (a) 3/5 (b) -13 (c) -0.5 (d) -1 (e) -0.2 a What is the second smallest value in -2, -17, -29? -17 Which is the biggest value? (a) 0.1 (b) -1/2 (c) -2 (d) 0 (e) -89 a Which is the smallest value? (a) -1/6 (b) -7/5 (c) -34 c What is the biggest value in 1.4, -0.2, 14, -2? 14 What is the smallest value in 1/2, -11, -5, 0? -11 Which is the third smallest value? (a) -0.3 (b) -1417 (c) -0.2 c Which is the third biggest value? (a) -1 (b) 2 (c) 32/31 (d) -2 a Which is the fourth biggest value? (a) 2 (b) 0.1 (c) 0.04 (d) 1 c What is the second smallest value in 2, 2/13, 0? 2/13 What is the third biggest value in 0, 0.04, 1, 3, -5? 0.04 Which is the third smallest value? (a) 20 (b) -5 (c) 0.2 (d) -1/7 (e) 0 e Which is the third smallest value? (a) -25 (b) -0.2 (c) 0 c Which is the third smallest value? (a) -0.2 (b) -277/4 (c) -2/9 (d) 2 a What is the biggest value in 19, -326, -0.4? 19 What is the second biggest value in -0.04, 2/7, 0.1, 5, -2/45? 2/7 What is the smallest value in -0.6, -0.8, -0.002, 2, -0.5? -0.8 Which is the smallest value? (a) -8 (b) 0 (c) 3/4 (d) -5/4 (e) 0.07 a Which is the third smallest value? (a) -1 (b) -0.3 (c) 4/3 (d) 16/7 c Which is the fourth biggest value? (a) -2/11 (b) 2/9 (c) 6 (d) 2/13 (e) 2/21 e Which is the smallest value? (a) -3/4 (b) 11/3 (c) 1 a Which is the smallest value? (a) -0.06 (b) 3/2 (c) 1.1 (d) -1 d Which is the third biggest value? (a) -4 (b) -4.86 (c) -3/2 b What is the fourth biggest value in -2/25, 0.7, 4/5, 1/4? -2/25 Which is the second smallest value? (a) 4 (b) -2.9 (c) -1/14 (d) 1/7 c What is the biggest value in -2/5, 4/9, 1/3, 0? 4/9 What is the second biggest value in 0.23, 97, -0.2, 2/7? 2/7 What is the biggest value in -3, 5, 0.1? 5 Which is the second smallest value? (a) -5 (b) -3 (c) -6.8 (d) 2/19 a What is the smallest value in -260, -1, -3, 3/7? -260 Which is the third smallest value? (a) -0.3 (b) -0.5 (c) -193 (d) 0.1 a What is the biggest value in -5, 0.3, -0.2858? 0.3 Which is the second biggest value? (a) 6 (b) -1/34 (c) 18 a Which is the smallest value? (a) -3/7 (b) -1275 (c) 3 b Which is the biggest value? (a) -8 (b) -5 (c) 2/11 c What is the third smallest value in -2/5, 54, 6? 54 Which is the smallest value? (a) -2/9 (b) 13/2 (c) -4 c What is the second smallest value in 4, -0.4, -299? -0.4 Which is the fifth biggest value? (a) 3/2 (b) 0.04 (c) 3 (d) -0.08 (e) 0.4 d Which is the second smallest value? (a) 2 (b) 1596 (c) 5 c Which is the third smallest value? (a) 0 (b) 0.4 (c) 1/3 (d) 1/4 c What is the third biggest value in 2/15, 4, -23, 10? 2/15 What is the second biggest value in -3.2, 5, 0.4, -1, 2/3? 2/3 Which is the fourth smallest value? (a) 0.4 (b) 109 (c) 1/4 (d) 2/15 b Which is the fifth biggest value? (a) 0.4 (b) -2.59 (c) 0.5 (d) -3 (e) 1 d Which is the third biggest value? (a) -5 (b) -32/3 (c) 4 (d) 0.1 (e) 11 d Which is the third biggest value? (a) 111/2 (b) 3 (c) 0.1 c What is the smallest value in 2/7, 6, -7, -4, 0.2? -7 Which is the biggest value? (a) -7 (b) 4/7 (c) -1/6 (d) 0 b Which is the biggest value	{ "pile_set_name": "DM Mathematics" }
v for p. 1 Let x = 2802 + -2798. Solve 2z + 16 = -xu, 2z + 21 - 17 = 2u for z. -4 Let h(l) = 6146 + 34l - 6136 + 6l*2 - 14l. Let n be h(-3). Solve f - q = 0, 3f - 2f = 3q + n for f. -2 Let b(m) = 10m - 209. Let q(a) = -2a + 41. Let l(w) = -2b(w) - 11q(w). Let s be l(19). Solve 0 = sj - 2r + 11, 2 = 5j - 10j - r for j. -1 Let w(z) = -6z*3 - 3z*2 - 9z - 7. Let t be w(-1). Solve -n + 1 = -ti, 5n = 4n + 4i for n. -4 Let r be (-1)/3 + 778/126. Solve -ri + 8 = -4g, 3g + 4 = 2i - g for i. 2 Suppose 42h - 76h + 3162 = 0. Suppose -72 - 280 = -4m + 4t, -2m + 5t = -164. Let d = h - m. Solve 5s + d = y, 5s + 8y - 3y + 25 = 0 for s. -1 Let q(d) = -2d*3 - 71d*2 - 33d - 29. Let n be q(-35). Let u be n/362-2. Solve -3s - 4z = -4 + u, -5s - 5 = 5z for s. 3 Let s(y) = 257 - 68 - 2070y + 2093y. Let w be s(-8). Solve wn - 4u = -40, -2n = 3u - 7u + 28 for n. -4 Let r(l) = -l3 - 20l*2 - 37l + 2. Let b be r(-18). Solve -b = 4c, -k - 15 = -6k + 4c for k. -1 Let j(g) = 5g*2 - 3g - 2. Let i be j(-1). Suppose l - 4c - 22 = c, 3c = -3l - i. Solve 0 = 4r - v - 6, -l - 2 = r - 3v for r. 2 Suppose 2v = 2o + 8, -99 = 4o - 91. Solve -2c = vp - 6, 10 + 5 = -5c + p for c. -2 Suppose -5g = 5d - 4g, 4g = 4d. Suppose 3x + 3r = 8x + 6, -2x - 2 = -r. Suppose x = -du - u - u. Solve -2a = -4, n + 4a + 0a - 11 = u for n. 3 Let u = -787 - -1343. Let f = 561 - u. Solve -5q - 2t = -29, -fq + 4t = 2t - 21 for q. 5 Let y = -3448 - -3455. Suppose -3z + 30 = 3x, -z - 14 = -4x - x. Let r be (-7 - -4)/((-6)/4) + 2. Solve -3f + yf = 4i, ri = 2f + z for f. 3 Suppose -10h - 312 = -5d - 11h, 68 = d + h. Solve d - 66 = -2t - n, 3n = 15 for t. 0 Suppose 1 = 3y + 4t - 7, 6 = 3t. Suppose -17n + n + 80 = y. Solve z + 2i - n = -0z, 0 = 3i - 6 for z. 1 Let k be ((-159)/6)/(-1) + -1 - (-69)/46. Solve 8a - 13a - 2d = -21, -4a - 5d + k = 0 for a. 3 Let x be 5(-4)/((-8 - 82)/9). Solve 5n + 6 = -y - 21, -5n = xy + 29 for y. -2 Let f(b) = -64b2 - 506b + 51. Let v be f(-8). Solve -vm - 6 = -l, 5m + 7 = l - 5 for l. -3 Let g(v) be the first derivative of -3v4/4 - 7v*3 - 3v*2/2 - 18v - 156. Let m be g(-7). Solve o + mu - u + 8 = 0, 4o = -3u - 22 for o. -4 Let r = 15355 - 15347. Solve 5l + 3b = -r, 157 - 158 = 5l - 4b for l. -1 Suppose 0s = s - 3, 0 = 5l - 3s - 691. Suppose 136 - l = -4b. Solve 3o + 3c - 4 + b = 0, -7 = 2o + 5c for o. 4 Suppose h - 15 = 6h, 4m + 3h = 15. Let g = -2 + m. Suppose -4t - 89 = -3n, gn - t - 110 = -0t. Solve -5i - x - x = -n, 5i + x = 26 for i. 5 Let v be (0/(-47))/(6 + -11). Solve 2m + 6 = v, -c - 18 + 3 = 4m for c. -3 Let m be (-11)/(-33)(-6 + 45). Solve 4z + 3 = -3w, 0 = 5z + m + 2 for w. 3 Suppose 6299k = 6289k + 70. Solve -2f = -kf - 20, 3f = -y - 10 for y. 2 Suppose -5f + 5b - 266 = 134, -2b = f + 74. Let r = -62 - f. Suppose rm + 4 = 17m. Solve -mp - 4 = -4u, 7p - 4p - 32 = -4u for u. 5 Let o(s) = -s3 + 18s*2 - 10s - 115. Let g be o(17). Solve 12l - 5w + 13 = 16l, gl + 4w - 8 = 0 for l. -3 Let n(p) = -49p - 4. Let l be n(-2). Suppose -91 = -5u + l. Let r = -32 + u. Solve -5z - 22 = g, rg - 6 = 9 for z. -5 Let x = 17006 + -16804. Solve -5m = 4p - 39, xm - 4p + 18 = 200m for m. 3 Let t = -41 - -104. Let z be (-1)/1 + (t - 8) - 2. Suppose z = 5c - 8. Solve 4n - c = 3g, -2g - 2 = -4n + 6 for g. -4 Suppose 4u = -o + 13, -7o + 3o = -2u + 2. Suppose 0 = -5d + m + 10, 5d = m - 4m + 30. Solve -2z - uz - 21 = -i, -di - 13 = 4z for z. -4 Suppose -10 - 2 = -3k. Suppose -5f + 29 = 4r, 2r + k = 2f - 4. Suppose 6 = -x - 0z - 5z, 24 = 4x - 4z. Solve 3d + x + f = 2h, 20 = -4d for h. -3 Let n(p) be the third derivative of p*6/120 + 7p*5/15 + 13p*4/6 + 4p*3 + 131p*2. Let s be n(-26). Solve 16 + 9 = -5c + d, c = 4d - s for c. -4 Suppose 6 = -3g - 2d, -d = -13g + 60 - 57. Solve -4l - 20 = g, -3n = -0n - l + 4 for n. -3 Let c be 27/12 + -43/48. Solve 0v = -z - 5v + 21, z + 14 = cv for z. -4 Let m(k) = -80k + 962. Let i be m(12). Solve 0 = 2x + 3u - 8, -4u = -4x - iu for x. 1 Let z(u) = -2u*2 - 19u - 35. Let p be z(-7). Let i(q) = 5q + 8. Let j = 8 - 4. Let x be i(j). Solve 0 = b - 2w + 12, -4b - x = -pw - 3w for b. -4 Suppose 96z + 1167 = 1359. Solve 0 = zf + 5p + 12, -5f - 5p + 50 = 65 for f. -1 Suppose 0 = 5c - 625 - 390. Let x = c + -201. Solve b - 2b - 2l = -x, 6 = -3b - 2l for b. -4 Let g = -4500 + 4502. Solve -5u = t + 8, -11t + u = -10t + g for t. -3 Let m(q) = -2q3 + 3q*2 + 12q - 6. Let c be m(3). Solve cl + 17 = 5n + 2, 0 = l - 2n + 6 for l. 0 Let c = -1394 + 1395. Let w be 0 - 7/(21/(-18)). Let i be w/2 + -1 + 0. Solve ih - 3 - c = 4v, 0 = 4v + 2h - 12 for v. 1 Let a = 30 + -26. Suppose -4c + 26 = 2h - 0h, -c = -ah + 7. Solve -3d = 5q - 15, 0d = d + q - h for d. 0 Suppose 85g - 89g = -16. Suppose -8r = -10r. Suppose -gp + rp = -72. Solve -35 = -4t - 5z, 0t - z + p = 3t for t. 5 Let h = -12049 + 12054. Solve -hc = -3t + 6, -5c + 7c + t - 2 = 0 for c. 0 Suppose -440 = 31s + 8s - 94s. Solve p + 6 = 11w - 6w, 0 = -4w + 4p - s for w. 2 Let o(q) = q2 - 15q + 35. Let l be o(4). Let f be (-2 - -2)/((l + 7)1). Solve -4r + 4m - 24 = f, -3r + m = r + 15 for r. -3 Let l(u) be the first derivative of -u*2/2 + 10u + 11. Let s be l(3). Suppose 2j - sj = -5. Solve -2y = -4f + 6, -4y + 5f = 16 - j for y. -5 Suppose 0 = 19k - 8k - 44. Suppose -2r + 5f = -kr - 15, -4f = 12. Solve w + a + 0a + 6 = r, -3a - 17 = 2w for w. -1 Suppose t + 1 - 138 = 0. Suppose -152 = -5p - t. Solve pz = 3m + 1 + 8, 3 = -3m for z. 2 Let q(f) = -f2 - 59f - 98. Let s be q(-57). Solve 3t - 7t = -3h + s, t - 5h + 4 = 0 for t. -4 Suppose -8j + 3j = 9590. Let n be j/(-8) + (-1)/(-4). Let b be ((-4)/(-5))/(16/n). Solve 3 = 3m, 5m = -4w + b - 3 for w. 1 Let q be ((-32)/(-56) - 4/7)(-19)/38. Solve 0 = -2v + 4h + 12, 3 = 2v - qv + 5h for v. 4 Let y be (36/54)/((-2)/48). Suppose 4u = -0k - 4k - 12, 5u = -2k - 9. Let h be (-6 + 7)/(k/y) - 1. Solve 0 = -2w + hw - 1, 2w = 5g - 18 for g. 4 Let c be ((-30)/(-4))/((-6)/12). Let i be 39/5 + 12/c. Let m = i + -3. Solve 0 = d - 5k + 23, -5d = -5k + m + 11 for d. 2 Let n = 314 + -350. Let b be (-16)/n + (-113)/(-9). Suppose 15 = -3v + 8v. Solve 0 = q - vk - 15 + 1, 2q - 3k = b for q. -1 Let q = 40 - 30. Let t(z) = -2z*2 - 24z - 4. Let m be t(-12). Let k be q/((16/m)/(-2)). Solve 4p + kl + 1 = -0, 2l = -2 for p. 1 Let i(s) = 0s*2 + 17s3 - s - s2 + 0s2. Let m be 11/23137/1. Let w be i(m). Solve 0 = 5h + g + w, 2g - 36 = 4h - 2g for h. -4 Let q be (4032/18)/(-16) - -18. Solve -s + 13 = 4m, qs + 6m = 3m for s. -3 Let m be ((-1470)/175)/((-3)/10) + -7. Solve i + 1 = 0, 4s - 4i = -3i + m for s. 5 Suppose 4g - 7 = 5. Suppose 0 = 41x - 15x - 572. Suppose -g = -23s + xs. Solve -b - 10 = -sb - w, 10 = 2b - w for b. 5 Suppose -h = -4h - 2b - 17, 0 = 2h + 5b - 7. Let n = -6 - h. Suppose 4s + 4a - 4 = 3s, -12 = -3s + na. Solve -st = -3m - 3, 5t - 5m + 0 = 10 for t. -3 Let k(d) = -d*2 - 8d + 2. Let i be k(-7). Let b = 11 - i. Suppose 2703 = -6p + 2733. Solve 3 = a - t, -b - 4 = -2a - pt for a. 3 Let r(z) = -3z - 47. Let u(i) = -5i - 49. Let o(h) = -4r(h) + 3u(h). Let q be o(11). Solve -3j + s - 4 = 0, j + 3s = -0j - q for j. -2 Let w(r) = 13r - 68. Let b be w(6). Let c be 3 - (-45)/(-20) - b/(-8). Solve -5g + 18 = -cn, -2g - 4n + 16 = g for g. 4 Suppose -3g - 857 = 3p - 4g, -274 = p + 2g. Let d = 287 + p. Let x(m) = -2m - 9. Let k be x(-7). Solve 0 = 3u + 2s + 2, -5u + du = -ks + 14 for u. -2 Suppose 5k = 13k - 88. Suppose -u - ku = 0. Suppose u = 3a + 9 - 24. Solve 2x = -4m + 14, m = 4m - ax - 17 for m. 4 Suppose 19l - 8 = 49. Suppose -4v - 7 = 4d - 35, -lv - d = -27. Solve 2o = -v, -q + 5o = -0q - 30 for q. 5 Let j be ((-6)/(-3) - 2) + 2. Let m be (-4)/(-24) + j/(-12). Suppose -5 = 5g - m, g = t - 3. Solve -5r - 10 = w, -tr - w - 3 - 4 = 0 for r. -1 Suppose -14m - 9 = -17m. Suppose mc + 13 = 4c. Suppose -26 + 91 = cr. Solve -4*f +	{ "pile_set_name": "DM Mathematics" }
.08 + -0.08. What is the nearest to -0.1 in b, r, -0.2? -0.2 Let o be 2/10 + 1/(-5). Let v be 22/(-8) + 3 + o. Let p = 25/3 + -29/3. Which is the nearest to v? (a) 3/7 (b) p (c) -0.1 a Let h = -5.3 - -0.3. Let n = -4.96 - h. Which is the nearest to n? (a) 2/9 (b) 3 (c) -4 a Let s = 5.8 + -6. Let l = -14.8 - -14. Let g = s + l. Which is the nearest to g? (a) -2/7 (b) -5 (c) -2/5 c Let w be (-14)/142/(-10). Which is the nearest to w? (a) -0.3 (b) 0.5 (c) 0 c Let n = 1247.9 + -1248. What is the closest to -0.2 in 4, n, 1/7? n Let f = -809/7 - -117. Let d = f + -44/21. Which is the nearest to -2? (a) d (b) -1/2 (c) 0.2 a Let z = 1712/3 + -571. Which is the closest to -3/7? (a) 2 (b) 0.2 (c) z (d) 1/38 c Let f = 1339/2168 - -2/271. Let z = -241.4 - -241.3. What is the closest to z in f, 0, -1/6? -1/6 Let i = 33.939 + 0.061. Let k = i + -34. What is the closest to -1/3 in k, -1/7, -3? -1/7 Let i = 0.184 + 0.816. Which is the nearest to -3? (a) -4 (b) i (c) 1.1 a Let p be 1428/(-170) + (5 - -3). What is the nearest to 0.2 in 1/6, -1, p, -5/4? 1/6 Let p be -11 + (-14)/(-16). Let u = -883 - -878. What is the closest to -0.2 in u, p, -2/11? -2/11 Let n = -2.74 - -0.66. Let y = n + 0.08. Let r = 11/3 + -4. What is the nearest to r in 1, y, 0? 0 Let j = -0.098 + 0.012. Let m = j - -2.086. Which is the nearest to 0? (a) 4 (b) m (c) 2/5 c Let b = 11/24 - 1/8. Let a be (-26)/(-3) + 6/(-9). Let z be a/(-3)1/12. What is the nearest to b in z, -3, 4? z Let w be 8/(-16) - 1-1. Suppose -3h + 3k = 2h - 30, 0 = -4h - 4k - 8. Let v be 1/3 - 2/h. Which is the nearest to 1? (a) -1 (b) w (c) v b Let j(r) = -r3 + 8r*2 - 9r + 16. Let k be j(7). Let q be ((-4)/12)/((-1)/k-2). Let g be 4/(-6)(-6)/10. Which is the closest to q? (a) -2/7 (b) 1 (c) g a Let a = 49/4 - 12. What is the nearest to -69 in 2/3, a, 3? a Let p = -16.08 + 17.58. Which is the closest to -2? (a) 1/10 (b) 3 (c) p a Let z = 58 - 35. Let x = 57 - 80. Let l = z + x. What is the nearest to 0 in -0.4, -0.3, l? l Let g = 1.225 - 1.025. What is the closest to 2/7 in g, 5/4, -0.5, -5? g Let i be (81/21 - 3)(-98)/(-21). Which is the closest to 1? (a) -1/6 (b) 6 (c) i a Let z = 147 + -1325/9. Let n = 0.16 - 0.22. Let d = n + 3.06. Which is the closest to -1? (a) z (b) -1/4 (c) d b Suppose 4y = 97 - 81. What is the closest to 1 in 1/7, y, 1, -0.03? 1 Let g = 77 - 73. Let v = 1.8 + -1.7. What is the closest to v in g, -5, 6/11? 6/11 Let d = -983 + 980. What is the closest to -3 in 2, d, -1/53? d Let h(y) = 73y + 1. Let s be h(2). Let l be 14/(-8)(-126)/s. Let u be (2 - 18/8) + 0. Which is the closest to l? (a) -0.4 (b) u (c) 3 c Let x = -188 - -206.8. Let s = -19 + x. What is the closest to -1/3 in 3, 2/11, s? s Let g = 0.02 - -1.98. Let t = -0.4164 - -0.3164. What is the nearest to t in 5, g, 0? 0 Let j = -1.111 + 0.111. What is the closest to j in 5, -0.5, 0.5, -4? -0.5 Let r be 1 + ((-330)/(-50))/(-11). Which is the closest to 1? (a) -0.07 (b) -2/9 (c) r (d) -2 c Suppose -3s - 1 - 13 = -5o, -3o = -s - 2. Let f = 1/45 + -16/45. What is the closest to 2 in s, f, 4? 4 Let w = 769/2 - 386. What is the nearest to 0 in -8, -1/4, w? -1/4 Let c = -0.01 + 2.51. Let k = 2.8 - c. Let a be 14/(-6) + 6/3. What is the closest to -1/2 in a, k, 1? a Let g = -337 + 337.3. Which is the nearest to g? (a) -2/5 (b) 5 (c) 0.3 c Let g(z) = -z3 - 3z*2 + 2. Let x be g(-3). Let d be (-36)/(-28) - (3 - x). Which is the nearest to 2/3? (a) -0.5 (b) 0 (c) d c Let q = -0.7 - -5.7. Let o = 523/4 + -130. Let y = 3035 - 3034. What is the closest to y in 0.5, q, o? o Let i = 144 + -144.2. What is the closest to 3/2 in 4, -5, i? i Suppose j - 2j = 523. Let v = 2051/4 + j. Let d = -35/4 - v. Which is the closest to -1? (a) 0.3 (b) -1/7 (c) d b Let p = 50 + -81. Let n = 35 + p. Which is the closest to 2? (a) 3 (b) 5 (c) n a Let f = 33/53 + -1949/2279. Let a = 176/387 + f. Let o = 0.1 - 0.6. What is the nearest to a in 0.5, o, -1? 0.5 Let x be ((-11)/(-5 - -49))/1. Let w = 0.01 + 1.99. Which is the closest to -0.2? (a) w (b) x (c) -0.2 c Let o = -42 + 337/8. What is the nearest to -11 in o, -0.5, 4? -0.5 Let l = 6 + -5.5. What is the closest to -0.1 in 2, 0.3, 0, l? 0 Let l = 1 - 0. Suppose -10v = -682 + 692. What is the closest to v in 4, 0, l? 0 Let b = -1001.13 + 997. Let k = b - -0.13. What is the closest to 0.1 in k, 0.4, 1? 0.4 Let w = -12.61 + 12.51. Which is the nearest to w? (a) -9 (b) 2 (c) 4 b Let j = 24.3 + -24. Let o = -8 + 7.3. Let f = o + -0.3. Which is the nearest to f? (a) -2 (b) 1 (c) j a Let w = -199 + 198.9. What is the nearest to -1 in w, 1, -1/4, 4? -1/4 Let c = 10/33 + -67/330. What is the closest to -0.4 in 6, -5/3, c? c Let y = -1.26 + 1.66. Suppose 3h = 8h - 10. Suppose r + 2k = -k + 14, hk = r + 11. Which is the nearest to r? (a) y (b) 2/21 (c) -1/4 c Let k = 121.5 - 121. What is the closest to 2 in 2, k, 8? 2 Let w be (2140/272 + -8)/((-6)/(-32)). Which is the closest to 2/5? (a) 3/5 (b) -1/3 (c) -0.04 (d) w a Let g(x) = 3x - 19. Let l be g(-9). Let a = l + 229/5. What is the nearest to -0.2 in a, -1/4, 2/3? a Let g = 7.3 + -4. Let t = g + -3. Which is the closest to 0.2? (a) t (b) 2/9 (c) 0.4 b Let v = 4 - 15. Let k = v - -11. Let n = 0.05 - -0.15. What is the nearest to k in 0.5, n, -2/7? n Suppose -9l + 302 = 410. Which is the closest to -2/3? (a) l (b) 0.2 (c) -2 (d) -2/3 d Let s = -127 - -509/4. Let g = 7 - 14. Let o = 7.4 + g. Which is the closest to o? (a) 5/4 (b) -1 (c) s c Let w(x) = x3 - 12x*2 + 12x - 12. Let v be w(11). Let h be (-2)/3 + (-24)/(-9) + v. Which is the nearest to -20? (a) -4 (b) h (c) 0 a Let w = 9.4 + -13.4. Let x = -2.9 - -3. Let h = 4 - 2. Which is the nearest to x? (a) -0.4 (b) w (c) h a Suppose -3v = v - 12. Let g = -0.039 - -1.039. What is the closest to v in -2/15, g, 0.1? g Let n = 0.1444 + -3.1444. Which is the nearest to 7/109? (a) n (b) -0.4 (c) 0.5 c Let s be (5 - 8)/(-6) - (-3)/(-4). Let x = -5 - -5.5. What is the nearest to s in 4/3, 4, x? x Let n = -41 - 38. Which is the closest to 0.1? (a) -2 (b) 2/3 (c) n (d) 1 b Let z = 423/5 - 85. Let p = z + 1/15. Which is the nearest to -2/3? (a) 1 (b) -3/2 (c) p c Let q = -4276 + 4274. Let p = 0.8 + -0.5. Let r = 3 - 0. Which is the closest to q? (a) p (b) r (c) -5 a Suppose 5 = 11l - 10l. Which is the nearest to 1/2? (a) -10 (b) 4 (c) 0.4 (d) l c Let n = 0.03 - 3.03. Let r = -95/374 + 3/22. What is the closest to 2/3 in -0.1, r, n? -0.1 Suppose 2j + 2j + 7 = 5i, 0 = -2i + 3j + 7. Let t be (0 + -1 + 2)i. Let n(l) = -24l + 581. Let k be n(24). What is the closest to t in k, -0.4, 1/4? -0.4 Let v = -0.43 + 21.43. Let y = v + -19. Let t be ((-1)/2)/(28/(-16)). Which is the closest to t? (a) 0.5 (b) y (c) 0.2 c Let m = 16.13 + -15.63. Let h = 1 - -2. Let f be (h/(-9))/((-7)/(-6)). What is the closest to f in -3, m, 3? m Let h be ((-10)/168-6)/((-6)/(-21)). Which is the nearest to 1/2? (a) 0.3 (b) h (c) 21 (d) -5 a Let o be (-2)/2 + 4 + -8. Let n = -9/7 + 15/28. What is the nearest to 1 in -0.03, o, n? -0.03 Let v = 98 - 101. What is the nearest to v in -2, -6, -0.3? -2 Let c = -3.91 - 0.09. Let f = c - -2. Let y = 1.3 + -4.3. What is the nearest to -2/7 in f, y, -3/2? -3/2 Suppose 0t - 9t - 216 = 0. Let u = 0.14 + 0.06. What is the nearest to t in 4, -5, u? -5 Let l = 5.42 + -7.42. What is the nearest to l in -1, 0.3, -1/41? -1 Let n = -31 + 153/5. Let f = -1013/3 + 3043/9. What is the closest to n in f, 5, -2/11? -2/11 Let t = -76.5 + 80.5. Which is the nearest to -1? (a) 2 (b) -0.2 (c) t (d) 3 b Let x be (-6)/(-3 + 7 + -2). Let o be 60/35 - (x + 5). Which is the nearest to 1? (a) 1 (b) 5 (c) o a Let t = 21/4 - 223/44. Which is the closest to t? (a) -0.2 (b) 3 (c) 0 c Let u = 7.7 - -4.3. Which is the closest to 2? (a) 1/7 (b) u (c) 0.3 c Let g = -0.056 - -94.056. Let h = g + -89. Suppose 6y - 2y = -5r - 14, y = -2*r - 5. What is the nearest to -1 in h, y, -3? y Let d be (6/32)/((-3)/1596). Let j = -101 - d. What is the nearest to -5 in -2, j, 0? -2 Let w = 0.0653 - 0.0053. Which is the nearest to w? (a) -4 (b) -2 (c) 5 b Let z = 0.43 + -0.03. Let r = z - 0.4	{ "pile_set_name": "DM Mathematics" }
. 2, 3, 37 What are the prime factors of 2952? 2, 3, 41 What are the prime factors of 35752? 2, 41, 109 What are the prime factors of 2810? 2, 5, 281 List the prime factors of 4766. 2, 2383 List the prime factors of 445. 5, 89 List the prime factors of 12735. 3, 5, 283 What are the prime factors of 1788? 2, 3, 149 What are the prime factors of 955? 5, 191 List the prime factors of 17112. 2, 3, 23, 31 What are the prime factors of 1879? 1879 List the prime factors of 8944. 2, 13, 43 What are the prime factors of 3157? 7, 11, 41 List the prime factors of 1003. 17, 59 List the prime factors of 26870. 2, 5, 2687 What are the prime factors of 1180? 2, 5, 59 What are the prime factors of 2817? 3, 313 List the prime factors of 1145. 5, 229 What are the prime factors of 7908? 2, 3, 659 List the prime factors of 2165. 5, 433 What are the prime factors of 1359? 3, 151 What are the prime factors of 337? 337 List the prime factors of 20520. 2, 3, 5, 19 What are the prime factors of 78712? 2, 9839 What are the prime factors of 9097? 11, 827 What are the prime factors of 534? 2, 3, 89 What are the prime factors of 11636? 2, 2909 List the prime factors of 803. 11, 73 List the prime factors of 1158. 2, 3, 193 List the prime factors of 8533. 7, 23, 53 What are the prime factors of 3763? 53, 71 What are the prime factors of 909? 3, 101 What are the prime factors of 9? 3 What are the prime factors of 9468? 2, 3, 263 List the prime factors of 100971. 3, 13, 863 List the prime factors of 36633. 3, 12211 What are the prime factors of 17089? 23, 743 List the prime factors of 307. 307 What are the prime factors of 54675? 3, 5 What are the prime factors of 2612? 2, 653 What are the prime factors of 23842? 2, 7, 13, 131 What are the prime factors of 1942? 2, 971 List the prime factors of 7287. 3, 7, 347 What are the prime factors of 7313? 71, 103 What are the prime factors of 8050? 2, 5, 7, 23 What are the prime factors of 3322? 2, 11, 151 What are the prime factors of 379? 379 List the prime factors of 5168. 2, 17, 19 What are the prime factors of 31364? 2, 7841 What are the prime factors of 9318? 2, 3, 1553 What are the prime factors of 1190? 2, 5, 7, 17 List the prime factors of 50647. 50647 List the prime factors of 879. 3, 293 List the prime factors of 52525. 5, 11, 191 What are the prime factors of 1290? 2, 3, 5, 43 List the prime factors of 12862. 2, 59, 109 What are the prime factors of 2062? 2, 1031 What are the prime factors of 725? 5, 29 What are the prime factors of 15172? 2, 3793 What are the prime factors of 30490? 2, 5, 3049 List the prime factors of 139486. 2, 97, 719 List the prime factors of 20009. 11, 17, 107 List the prime factors of 1878. 2, 3, 313 List the prime factors of 29378. 2, 37, 397 What are the prime factors of 88925? 5, 3557 What are the prime factors of 404? 2, 101 What are the prime factors of 36836? 2, 9209 What are the prime factors of 18513? 3, 11, 17 List the prime factors of 496. 2, 31 List the prime factors of 4716. 2, 3, 131 List the prime factors of 163544. 2, 20443 List the prime factors of 8753. 8753 What are the prime factors of 1433? 1433 List the prime factors of 4274. 2, 2137 What are the prime factors of 78484? 2, 7, 2803 What are the prime factors of 515? 5, 103 What are the prime factors of 682? 2, 11, 31 What are the prime factors of 40242? 2, 3, 19, 353 List the prime factors of 164270. 2, 5, 16427 List the prime factors of 46442. 2, 11, 2111 List the prime factors of 53182. 2, 26591 What are the prime factors of 20121? 3, 19, 353 What are the prime factors of 94803? 3, 31601 List the prime factors of 98314. 2, 49157 What are the prime factors of 7803? 3, 17 List the prime factors of 141749. 23, 6163 List the prime factors of 554. 2, 277 List the prime factors of 4108. 2, 13, 79 List the prime factors of 2790. 2, 3, 5, 31 What are the prime factors of 576? 2, 3 List the prime factors of 125338. 2, 29, 2161 List the prime factors of 66326. 2, 13, 2551 What are the prime factors of 22200? 2, 3, 5, 37 List the prime factors of 32869. 32869 What are the prime factors of 399? 3, 7, 19 List the prime factors of 1385. 5, 277 What are the prime factors of 913? 11, 83 What are the prime factors of 647? 647 List the prime factors of 45042. 2, 3, 7507 What are the prime factors of 19052? 2, 11, 433 List the prime factors of 30458. 2, 97, 157 List the prime factors of 1684. 2, 421 What are the prime factors of 17352? 2, 3, 241 What are the prime factors of 578? 2, 17 What are the prime factors of 15720? 2, 3, 5, 131 What are the prime factors of 80? 2, 5 What are the prime factors of 1062? 2, 3, 59 List the prime factors of 16. 2 What are the prime factors of 397? 397 List the prime factors of 63574. 2, 7, 19, 239 What are the prime factors of 4871? 4871 List the prime factors of 3555. 3, 5, 79 What are the prime factors of 581? 7, 83 What are the prime factors of 1533? 3, 7, 73 List the prime factors of 56335. 5, 19, 593 What are the prime factors of 5719? 7, 19, 43 List the prime factors of 30. 2, 3, 5 List the prime factors of 25420. 2, 5, 31, 41 What are the prime factors of 15608? 2, 1951 List the prime factors of 8366. 2, 47, 89 List the prime factors of 9871. 9871 List the prime factors of 62987. 62987 What are the prime factors of 16750? 2, 5, 67 List the prime factors of 35265. 3, 5, 2351 List the prime factors of 7574. 2, 7, 541 List the prime factors of 110538. 2, 3, 23, 89 List the prime factors of 417. 3, 139 List the prime factors of 4872. 2, 3, 7, 29 List the prime factors of 285. 3, 5, 19 List the prime factors of 6785. 5, 23, 59 List the prime factors of 56631. 3, 43, 439 What are the prime factors of 33334? 2, 7, 2381 What are the prime factors of 3024? 2, 3, 7 What are the prime factors of 175583? 71, 2473 List the prime factors of 7470. 2, 3, 5, 83 List the prime factors of 931. 7, 19 What are the prime factors of 895? 5, 179 What are the prime factors of 1907? 1907 List the prime factors of 14986. 2, 59, 127 What are the prime factors of 17635? 5, 3527 List the prime factors of 32923. 11, 41, 73 What are the prime factors of 935? 5, 11, 17 List the prime factors of 32029. 32029 What are the prime factors of 9611? 7, 1373 What are the prime factors of 36298? 2, 18149 What are the prime factors of 2623? 43, 61 List the prime factors of 28655. 5, 11, 521 List the prime factors of 2505. 3, 5, 167 List the prime factors of 10263. 3, 11, 311 List the prime factors of 14325. 3, 5, 191 List the prime factors of 980. 2, 5, 7 List the prime factors of 928. 2, 29 List the prime factors of 527. 17, 31 What are the prime factors of 65604? 2, 3, 7, 11, 71 What are the prime factors of 6308? 2, 19, 83 What are the prime factors of 3110? 2, 5, 311 What are the prime factors of 6917? 6917 What are the prime factors of 8285? 5, 1657 What are the prime factors of 853? 853 What are the prime factors of 45835? 5, 89, 103 What are the prime factors of 3179? 11, 17 List the prime factors of 3784. 2, 11, 43 What are the prime factors of 103055? 5, 20611 What are the prime factors of 89426? 2, 61, 733 What are the prime factors of 946? 2, 11, 43 List the prime factors of 480. 2, 3, 5 What are the prime factors of 44079? 3, 7, 2099 List the prime factors of 104607. 3, 59, 197 What are the prime factors of 2872? 2, 359 What are the prime factors of 1460? 2, 5, 73 What are the prime factors of 36208? 2, 31, 73 What are the prime factors of 101364? 2, 3, 8447 What are the prime factors of 291? 3, 97 List the prime factors of 20347. 20347 What are the prime factors of 2601? 3, 17 What are the prime factors of 5576? 2, 17, 41 List the prime factors of 1138. 2, 569 List the prime factors of 3240. 2, 3, 5 What are the prime factors of 28921? 28921 List the prime factors of 20323. 20323 List the prime factors of 3709. 3709 What are the prime factors of 29923? 23, 1301 What are the prime factors of 981? 3, 109 What are the prime factors of 8907? 3, 2969 List the prime factors of 1858. 2, 929 What are the prime factors of 927? 3, 103 What are the prime factors of 13047? 3, 4349 List the prime factors of 26468. 2, 13, 509 List the prime factors of 14459. 19, 761 What are the prime factors of 6588? 2, 3, 61 List the prime factors of 10353.	{ "pile_set_name": "DM Mathematics" }
rt h. -15 What is the second derivative of -13t + 73 + 91t*4 + 3 + 12t wrt t? 1092t2 Find the third derivative of 12s*5 + 7s*3 - 10s5 + s5 - 7s2 + 117s*2 wrt s. 180s*2 + 42 Let k(c) be the second derivative of 0c*3 + 0 + 0c*4 - 19/10c*6 + 0c*5 - 49c - 51/2c2. What is the derivative of k(p) wrt p? -228p*3 Differentiate -182d - 113 - 22 - 358d - 14 + 28d with respect to d. -512 Let c(n) = -317n2 - 198n - 2. Let u(x) = 634x2 + 390x + 4. Let y(t) = -7c(t) - 4u(t). Find the second derivative of y(g) wrt g. -634 What is the second derivative of 3g - 2g - 8g2 + 52 + g2 - 103 wrt g? -14 Let o(w) be the first derivative of 106w3/3 + w2 + 3w + 368. Find the second derivative of o(t) wrt t. 212 Let q be 8/14(-21)/(-2). Let n(p) = 55p3 - 33p*2. Let m(g) = -27g*3 + 17g*2. Let i(d) = qn(d) + 13m(d). What is the third derivative of i(r) wrt r? -126 What is the third derivative of 10k*2 + 34k*5 - 51k*5 - 120k*2 wrt k? -1020k*2 What is the third derivative of 289g*2 - 71g2 + g4 - 3g6 + 3g*4 + 24g*5 - 4g*4 wrt g? -360g*3 + 1440g*2 Let s(z) be the first derivative of -3z*5/10 - 27z*2/2 + 11z - 7. Let v(m) be the first derivative of s(m). What is the first derivative of v(q) wrt q? -18q2 Let w(n) be the second derivative of 8n6/3 + n5/5 - 145n3/3 - 472n. What is the second derivative of w(j) wrt j? 960j2 + 24j Let g be (-1)/(-1) + 18 - 0. Let k = 25 - g. What is the third derivative of c*2 + 10c*k - 13c*2 + 4c*6 wrt c? 1680c*3 Suppose 30 = -0p + 3p. Let r be (-2586)/(-30) - 2/p. Find the second derivative of 86 + 3g*4 + 10g - r wrt g. 36g2 Let d(o) be the second derivative of 0o*2 - 1/4o*4 + 0o*3 - 2/21o*7 + 22o + 0o6 + 0o*5 + 0. What is the third derivative of d(h) wrt h? -240h2 Let y(t) = t3 - t*2 + t. Let p(r) = -9r*3 - 7r*2 + 19r*3 - 9r*3 + 7r + 7. Let h(o) = -2p(o) + 14y(o). What is the first derivative of h(a) wrt a? 36a2 Let o(m) be the third derivative of -1/6m*5 - 1/30m*6 + 0m - m*2 + 0m*4 + 0 + 0m*3. Find the third derivative of o(w) wrt w. -24 Suppose 0a + 4a + 20 = 0. Let f be 10/2 + 15/a. Find the first derivative of -7 + 11 + 0z2 - zf wrt z. -2z Let i(h) = -9h*6 + 15h*2 - 2h - 6. Let b(z) = z6 - z2 - 1. Let t(k) = 6b(k) - i(k). Find the third derivative of t(d) wrt d. 1800d*3 Let h(p) = -10p. Let q(s) = -s*2 + 9s. Let b(r) = 0 - 1 + 5 - 2 - 2r. Let m be b(3). Let d(w) = mh(w) - 5q(w). Find the second derivative of d(j) wrt j. 10 Let d(q) be the first derivative of 9q8/560 + q4/6 + 16q3/3 - 19. Let y(r) be the third derivative of d(r). Find the first derivative of y(b) wrt b. 108b*3 Let c(d) = -6d + 8d2 + 3 - 7d*2 - d. Let t be c(6). Let g(l) = l. Let v(b) = b + 5. Let o(r) = tg(r) - v(r). What is the derivative of o(i) wrt i? -4 Let s(p) = -1403p3 - p2 - 65p - 7. Let x(t) = 702t3 + t2 + 32t + 3. Let i(g) = 3s(g) + 7x(g). Find the third derivative of i(r) wrt r. 4230 Suppose -3l + 1 = 4h - 0l, -3l - 19 = -h. Differentiate 3 + 2r4 + 9 - 6r*h - 27 with respect to r. -16r*3 Let m(i) be the third derivative of -5i*6/4 + 5i*4/8 - 2i3/3 + i2 + 4i. Find the second derivative of m(d) wrt d. -900d Let a = 9 + -4. Suppose u - o - 2 = -3o, -4u = -ao - 8. Find the third derivative of -7j*4 - 33j*2 - 35j*u + 58j*2 wrt j. -168j Suppose 0 = -4o - 8 + 28. Suppose 5q + 5k - 10 + 5 = 0, -3q + 1 = ok. What is the second derivative of 14c + 4c4 - 12c + qc4 wrt c? 72c2 Let g(c) = c3 + 13c2 - 15c - 10. Let k be g(-14). Find the third derivative of -10vk - 5v*2 + 0v*4 - 3v*4 - 4v*2 wrt v. -312v Differentiate 42b - 268 - 419 - 106 + 151 + 18b wrt b. 60 Let f = -10 + 16. Suppose -j = 4q - 13 - 0, 3 = 3q + 3j. What is the derivative of 1 - f - qo3 - 2 - o3 wrt o? -15o2 Suppose 0 = -4x - 2 + 18. What is the second derivative of 4b4 - 11b + 5b4 + 4b*4 + 7b*x wrt b? 240b*2 Find the third derivative of 275s - 89s - 96s + 285s3 - 90s + 230s2 wrt s. 1710 Suppose 35r - 30r = 15. What is the derivative of -6c*2 + 0c*3 - 2c*r - 103 + 79 wrt c? -6c*2 - 12c Let k(u) = u*2 - 10u + 26. Let j be k(6). What is the second derivative of -7y3 + 10y*3 - 24y*3 - jy wrt y? -126y Let p(l) be the third derivative of -l6/60 - 77l*4/24 - 36l*3 - 2l*2 - 123. What is the first derivative of p(r) wrt r? -6r*2 - 77 Let t = 731/168 + -29/7. Let o(c) be the third derivative of 0c - 5c2 + 7/60c*5 + 0 + 0c*3 + tc4. What is the second derivative of o(i) wrt i? 14 Let f(z) = z2 + 3z - 14. Let l be f(3). What is the third derivative of 5h*6 + 0h*6 - lh*2 + 2h*2 + 3h*6 wrt h? 960h3 Let i(o) be the second derivative of o4/6 - 2o3/3 + 3o*2 - 13o. Let q(w) = 2 - 4 + 3 - w. Let u(a) = -i(a) + 4q(a). Differentiate u(s) wrt s. -4s Let j(x) = x*3 - 2x*2 - 3x + 3. Let c be j(2). Let b = c - -5. Find the first derivative of 6w4 - 1 - 4w*2 + 4 + 4w*b wrt w. 24w3 Find the third derivative of -7 + 21 - m3 + 34m2 - 8m*4 - 21 - 2m*3 + 47m*4 wrt m. 936m - 18 Let l(k) be the first derivative of -k*2/2 + 3k + 2. Let t be l(1). Find the third derivative of 6 + tf2 + 2f*3 - 6 + 2f*2 wrt f. 12 What is the first derivative of -306q*3 - 9 + 61q*4 + 9q*4 + 170q*3 - 5q + 136q3 wrt q? 280q3 - 5 Let v(k) be the second derivative of -k6/60 + 2k3/3 - k2 + 5k. Let y(x) be the first derivative of v(x). What is the derivative of y(w) wrt w? -6w2 Let q(v) be the first derivative of -12v*5/5 + 173v - 330. Differentiate q(y) wrt y. -48y3 Let z(j) be the second derivative of -73j*3/3 - 775j*2/2 - 3j + 18. What is the derivative of z(d) wrt d? -146 Let o(a) be the first derivative of -783a2/2 + 490a + 181. Differentiate o(s) with respect to s. -783 What is the derivative of 10f - 103f - 5f + 1256 - 390 - 116f wrt f? -214 Let k(a) = -5a5 - 4a*4 - 19a - 2. Let h(x) = -2x5 + x4 - x + 1. Let g(s) = 4h(s) + k(s). Find the second derivative of g(v) wrt v. -260v3 Let f(y) = -250y3 - y2 - 27. Let c(h) = 750h3 + 2h*2 + 81. Let l(w) = -4c(w) - 11f(w). Find the third derivative of l(q) wrt q. -1500 Find the first derivative of -6 + 2y*2 - 3 + 257y - 319y - 8 wrt y. 4y - 62 Suppose 2x - 24 = -4j, -2x + 13 = -3x + 3j. Find the third derivative of v4 + 0v + 0v - 16v*x + 7v*4 wrt v. 192v Let m(a) = 913a3 + 14a*2 - 691a + 21. Let b(c) = 457c3 + 8c*2 - 346c + 12. Let d(y) = -7b(y) + 4m(y). What is the second derivative of d(j) wrt j? 2718j What is the third derivative of -121a*3 + 55a + 205a2 - 21a*3 - 55a wrt a? -852 Suppose -25 = 7k - 12k. Find the third derivative of -23i2 + 32i*2 + 0ik - i5 wrt i. -60i2 Let z(f) = 65f*2 + 12f + 6. Let y(s) = 65s2 + 11s + 4. Let w(g) = -4y(g) + 3z(g). What is the second derivative of w(l) wrt l? -130 Let p(b) be the third derivative of -433b4/12 - 26b*3/3 - 671b*2. Find the first derivative of p(q) wrt q. -866 Let n(c) = -4c - 7. Let h(a) = 8a + 15. Let r(o) = -16o - 30. Let d(y) = -7h(y) - 4r(y). Let u(s) = 2d(s) + 5n(s). What is the derivative of u(p) wrt p? -4 Let v(o) be the first derivative of -o*4 - 17o*3/3 - 83o*2/2 + 66. What is the second derivative of v(s) wrt s? -24s - 34 Let k(c) = -26c3 - 14c*2 - 32c - 2. Let s(t) = t3 - t2 - t + 1. Let l(j) = -k(j) + 5s(j). Find the second derivative of l(w) wrt w. 186w + 18 Let n(c) be the first derivative of 2c3/3 - 11c*2 - 524c + 21. Differentiate n(x) wrt x. 4x - 22 Let c(l) = -l + 21. Let q be c(14). Find the third derivative of q - 43d*4 + 11012d*3 - 11012d*3 - 4d*2 wrt d. -1032d Let a(o) = -1 - 5 + 0. Let m(l) = l - 6. Let x(c) = c*2 - 15c - 14. Let k be x(16). Let s(p) = ka(p) - 3m(p). Find the first derivative of s(y) wrt y. -3 Let w(n) be the first derivative of -21n5/20 + 19n*4/6 + 28n - 27. Let q(x) be the first derivative of w(x). What is the third derivative of q(p) wrt p? -126 Let x(z) be the third derivative of -125z*4/2	{ "pile_set_name": "DM Mathematics" }
1)*2 - (sqrt(44)3 + (sqrt(11) - sqrt(44)/sqrt(4))1)) + -5. -1334 + 13sqrt(11) Simplify sqrt(27)/sqrt(9) + 0 - (2 + sqrt(3) - sqrt(3))*25 - ((sqrt(168)/sqrt(8))/sqrt(7) + sqrt(192) + -2). -18 - 8sqrt(3) Simplify 2 + sqrt(648) + 3 + (sqrt(18)-15)/(sqrt(36)-4). 5 + 149sqrt(2)/8 Simplify (2(0 + sqrt(300) + sqrt(300) + -6sqrt(300) + -5 + sqrt(300) + sqrt(300) - (-4 + -4(sqrt(300) + (sqrt(300) - -2sqrt(300))))))2. -1120sqrt(3) + 235204 Simplify (2 + -1(sqrt(128) - (sqrt(128) + 0 + -4)) + 4)3 + 2. 8 Simplify -3 + -1 + (3sqrt(605) + 4 - ((sqrt(605) - (sqrt(605)-2)*2) + 4)) + 0. 22sqrt(5) + 2416 Simplify (2 + sqrt(13) + -4 + sqrt(26)/sqrt(2)-5 + sqrt(13))2 + (sqrt(130) - (sqrt(130) - sqrt(130)1)-4)/(sqrt(1000) + 1sqrt(1000)). 241sqrt(13)/20 + 121 Simplify -4(sqrt(112) + -2 + -2 - (2 + -1 + sqrt(343)))-6. -72sqrt(7) - 120 Simplify ((sqrt(432) - (3 + sqrt(432))) + sqrt(432) - (sqrt(27) + (sqrt(27)2 - sqrt(27)))) + ((sqrt(192) + -3)2 - (-2 + sqrt(300))2). -106 - 2sqrt(3) Simplify (-61(sqrt(95) + 23sqrt(95) + sqrt(95)))/(-2sqrt(405) + (-1sqrt(20))/sqrt(4)). 48sqrt(19)/19 Simplify -5 + (-4(-1(1 + sqrt(76)))2 - (2(-1sqrt(76) + 2))2) + 0. -633 + 16sqrt(19) Simplify (-2(sqrt(140) + (sqrt(140) - -1sqrt(140)))/sqrt(4)6)/(-5((sqrt(7) + (sqrt(7) - sqrt(7)-1))5 - (sqrt(7) - sqrt(21)/(sqrt(12) + sqrt(3))))). 108sqrt(5)/215 Simplify 6(-2 + (sqrt(112) - sqrt(112)3))2 + 2 + -26(sqrt(112)-2 + 0). 288sqrt(7) + 2714 Simplify (sqrt(486)/sqrt(3) + sqrt(18) + sqrt(54)/sqrt(3)-1)/(4sqrt(324)-1)-5. 5sqrt(2)/8 Simplify -33(-3(sqrt(26) + sqrt(286)/(-2sqrt(11) + sqrt(11)) - sqrt(26)))/(sqrt(18)1 - (sqrt(54)/sqrt(3))/sqrt(9)). -27sqrt(13)/2 Simplify (1(sqrt(2736)-1 + -3 + sqrt(2736)) + 0 + -4 + 1sqrt(2736)4 + -2)*2 + 5. -864sqrt(19) + 43862 Simplify (((sqrt(187) + -2sqrt(187))-5 - sqrt(187) - (sqrt(187) + -3-1sqrt(187)))-1)/(-6(sqrt(1100) - (sqrt(1100) - (-1sqrt(1100) - sqrt(1100))))-1). 0 Simplify ((sqrt(209) + sqrt(209) + (sqrt(209)2 - sqrt(209))-6 - (sqrt(209) - -2sqrt(209))3)-5-2)/((sqrt(176)/sqrt(4)6 + sqrt(220)/(sqrt(15)/sqrt(3)))3). -65sqrt(19)/21 Simplify ((-3sqrt(2016) - 1sqrt(686))/(sqrt(288)2 - ((4sqrt(22))/sqrt(11) + sqrt(2))))2 + -4. 11499/361 Simplify -4 + ((sqrt(112) + 0 - sqrt(112))-6 - (-1 + sqrt(112)2))2 + (4(-3 + sqrt(847)) - (sqrt(847) - 5sqrt(847)-4)). -203sqrt(7) + 433 Simplify 1 + (sqrt(2057)-1 + 3 - -1sqrt(2057)-1) - (-2 + (sqrt(34)/(-1sqrt(2)))2 - ((1sqrt(2448) + sqrt(2448))-2)2). -22sqrt(17) + 39157 Simplify -2 + (sqrt(192) + 6(sqrt(192) + (sqrt(192) - sqrt(192)-2))*2 - (1sqrt(192) + 3)) - (-5(4 + sqrt(192) + -1 + sqrt(192)))25. -78698 - 12000sqrt(3) Simplify -4((-1 + (sqrt(448) - (1 + sqrt(448) + 5)))*2 - (1 + -1 + sqrt(847) + 1)). -192 + 44sqrt(7) Simplify (-4sqrt(180)/(sqrt(16)/sqrt(4))-1)/(sqrt(18)/sqrt(18) - 2sqrt(9)4). -12sqrt(5)/23 Simplify -2(sqrt(132)/sqrt(12))*2 + -2 + (sqrt(11) - sqrt(99)/sqrt(9)) - (((-6sqrt(88) + sqrt(88))/sqrt(8))*2 + (sqrt(11) - (4 + 5sqrt(11)))). -295 + 4sqrt(11) Simplify -5(0 + -1 + sqrt(242) - sqrt(242) - (-1 + -1sqrt(242))) + 3((2sqrt(98) - sqrt(98)) + sqrt(98))-2 + -4. -139sqrt(2) - 4 Simplify (-2 + (1sqrt(242) + (sqrt(242) - -1sqrt(242)) + sqrt(242) - (-2 + sqrt(2) + sqrt(2) + 3 - (sqrt(2) - sqrt(288))))-3)*2. -186sqrt(2) + 17299 Simplify (5((((sqrt(66) - sqrt(66)1) + sqrt(66))1 - sqrt(66)) + 4sqrt(66)-2))/((-1sqrt(3456))/(sqrt(8)/sqrt(2)-4)). -40sqrt(11)/3 Simplify ((3(sqrt(252) - -4sqrt(252)1) - (sqrt(252)-1 + 1 + sqrt(252) - (sqrt(252) + 1 + -2sqrt(252))))-52)2. 4939200 Simplify (-2 + (1(sqrt(80) + 1) - 2(sqrt(80) + 1))2)-5-46-2. -18960 - 1920sqrt(5) Simplify ((6(sqrt(315)-1 - sqrt(315))/sqrt(7)5)/(-5-2(sqrt(9) - 5sqrt(36) - sqrt(9))))*2 + -1. 4/5 Simplify (6(sqrt(1200) - -1sqrt(1200))6)/((sqrt(12) - (sqrt(12) - sqrt(36)/(sqrt(9)/sqrt(3) + sqrt(3))))/(sqrt(108)/sqrt(4))). 4320sqrt(3) Simplify ((sqrt(84)/((sqrt(35)2)/sqrt(5))-6)/(3(sqrt(12) + -1sqrt(1200))/sqrt(3)))2. 1/27 Simplify (-1sqrt(2058) + (-6sqrt(2058) - sqrt(42)))/(6-1sqrt(600)5). sqrt(7)/6 Simplify (35(sqrt(110) + (sqrt(110) - -1-1sqrt(110))))/((sqrt(120) - (sqrt(120) - sqrt(120)2)2)/(-1sqrt(972))). -45sqrt(11) Simplify (sqrt(1700) + 2 + sqrt(17) + -3sqrt(153))2 + ((2sqrt(68) - sqrt(68))*2 - sqrt(17) - sqrt(17) - (sqrt(2057)1 - sqrt(2057))*2)-3 + -3. -135 + 14sqrt(17) Simplify (2 + 0 + (-1(-2 + sqrt(180)) - 6(sqrt(720) + sqrt(720)1)))*2. -1200sqrt(5) + 112516 Simplify (6(sqrt(152) + (sqrt(152) + (-3sqrt(152) - sqrt(152)) + sqrt(152))-2 + sqrt(152)))/((sqrt(968) - (sqrt(968) + sqrt(968) + 3sqrt(968)))-1). 9sqrt(19)/11 Simplify (4 + -3sqrt(931) + 0 - (-2 + -3sqrt(931) + 0))*2 + 4. 40 Simplify ((-1sqrt(3630) - sqrt(3630)) + sqrt(3630) - sqrt(270)/(sqrt(9) - -1sqrt(9)))/((sqrt(640) - (-45sqrt(640) - sqrt(640))) + sqrt(640)). -sqrt(3)/16 Simplify 1 + (((sqrt(308)/sqrt(176))/sqrt(4) - -2(sqrt(175) + -2sqrt(175)))3)*2 + 5. 95919/16 Simplify ((sqrt(5) - (-4 + sqrt(5) + sqrt(5)-2)) + -2 + sqrt(20) - (2 + ((sqrt(160)/sqrt(4))/sqrt(8) - sqrt(45)4)))2. 1125 Simplify (-3 + 1 + sqrt(1088) + -3 + (sqrt(1088)-2 - sqrt(1088)) + sqrt(1088) - (-4 + -2 + sqrt(272)2 + 3))2. 64sqrt(17) + 4356 Simplify ((sqrt(121)/(-3sqrt(11)2) + 1)*2 - (sqrt(99)2-1 + sqrt(99) + sqrt(99) - sqrt(99) - sqrt(99) - sqrt(99))/(sqrt(1296)-1)) + 4. -7sqrt(11)/12 + 191/36 Simplify 6(4 + (6(5 + sqrt(252) + -1))2 - -4(5(sqrt(252) + 0) + -2)). 11088sqrt(7) + 57864 Simplify -5 + (sqrt(1100) + -1(sqrt(1100) - (0 + sqrt(1100))))2 + ((-4 + 2sqrt(1100) - sqrt(1100)) + 1 + sqrt(1100) + 1)*2 + 1. -80sqrt(11) + 5500 Simplify -1(-5 + -2 + sqrt(1088))-6 + (sqrt(204)/(sqrt(1200)1) - (-1 + -1 + sqrt(17) + 3 + sqrt(17))). -43 + 461sqrt(17)/10 Simplify ((sqrt(675)2)/((sqrt(24)/sqrt(2))/sqrt(4)))/(sqrt(147)-2-5 - sqrt(147)-14). 5sqrt(3)/49 Simplify ((3 + -3 + (5 + sqrt(1053)-1 - sqrt(1053)) + (sqrt(1053) - (sqrt(1053) + -2 + (-2 + sqrt(1053) - sqrt(1053)))) + 4)3)*2. -4212sqrt(13) + 39429 Simplify (sqrt(608)2)/((sqrt(12)/sqrt(6)4 - sqrt(2)) + sqrt(2)) - (-5 + (-1 + (sqrt(76) + sqrt(76) + 0 + sqrt(76)-1 + sqrt(76) - sqrt(76)))2). -72 + 6sqrt(19) Simplify -4(sqrt(99)/sqrt(44))/(sqrt(192)1 - sqrt(3))6 + 5. -12sqrt(3)/7 + 5 Simplify (2(-1(sqrt(396) + sqrt(396)-2))/sqrt(12))/((sqrt(108)1)/(sqrt(44)/(2sqrt(11)))). sqrt(11)/3 Simplify 4 + 2((sqrt(128) + -1)3)2 + 1-5(sqrt(128) + -2)2. -128sqrt(2) + 1666 Simplify -4 + (3((sqrt(192) + sqrt(192)2)-1 - 1(4 + (sqrt(3) - sqrt(12)))) + 5)*2. 966sqrt(3) + 14328 Simplify -4(0 + -4 + 3((sqrt(1700)3 + 5 - sqrt(1700)) + (sqrt(1700) + (sqrt(1700)2)*2 + sqrt(1700) - sqrt(1700))-5)). 360sqrt(17) + 407956 Simplify -2(sqrt(51) + sqrt(51) + sqrt(204)2 + sqrt(51))/sqrt(3) + (sqrt(17) + 1)2 + -1 + -2sqrt(102)/sqrt(6). -14sqrt(17) + 17 Simplify -2 + ((-2(2sqrt(65) + sqrt(65) - sqrt(65)))/sqrt(5)-1 - 1((-1sqrt(104))/sqrt(8) + sqrt(52)/(sqrt(64) - sqrt(4)))). -2 + 14sqrt(13)/3 Simplify (3 + (0 + (sqrt(1100) + (sqrt(1100) + -1)6)3)-3)*2 + 4. -71820sqrt(11) + 4369153 Simplify (0 + sqrt(3) + 0 - (sqrt(42)/sqrt(7))/sqrt(2)) + (sqrt(432) + 2 + 0)*2 + 3. 48sqrt(3) + 439 Simplify 0 + -4(0 + sqrt(448) - sqrt(448)) + (sqrt(448) - (-2sqrt(448))*2) + -5 + (-5 + sqrt(448)2 - (-4sqrt(448)1 + sqrt(448) + sqrt(448))*2). -3594 + 24sqrt(7) Simplify (((sqrt(130) - -1sqrt(130))6 + -5sqrt(130)-1)6)/(32sqrt(810)2)-1. -17sqrt(13)/18 Simplify 4-55(sqrt(75) - (sqrt(75) + 1 - sqrt(75))2) - (-2 + (sqrt(48)/sqrt(4)1 + 4 + (sqrt(12) + 0 - sqrt(12)))*2). -516sqrt(3) + 74 Simplify -1((6-1sqrt(180) - sqrt(180))/(sqrt(1089)-1 - sqrt(1089)))/((sqrt(4) + sqrt(8)/sqrt(2))6 - ((-2sqrt(32))/sqrt(8) - sqrt(4))). -7sqrt(5)/330 Simplify (-1 + sqrt(288) + 2 + sqrt(288) + -2 + sqrt(288) + 3 + 5sqrt(20)/(sqrt(360)-2)5)*2. 407sqrt(2)/3 + 165937/72 Simplify (-5sqrt(112)/sqrt(4) + 3sqrt(2800))/(-43sqrt(324)-5). 5sqrt(7)/108 Simplify (-6(sqrt(1088) + sqrt(1088)-1 + sqrt(1088)) - (1 + sqrt(1088))5 - -2(-5 + 1sqrt(1088))6)*2. -1040sqrt(17) + 5313 Si	{ "pile_set_name": "DM Mathematics" }
6855, 8571, 10287? 12003 What is the next term in 87, 85, 83, 81? 79 What is next in 6, 8, 8, 6, 2, -4? -12 What is the next term in 54, 94, 134, 174, 214, 254? 294 What is the next term in 7, -12, -65, -170, -345? -608 What is next in 1478, 2959, 4452, 5963, 7498, 9063, 10664, 12307? 13998 What is the next term in 34, 144, 328, 586, 918, 1324, 1804? 2358 What is next in 1201, 2406, 3611, 4816, 6021, 7226? 8431 What is next in 7, 14, 31, 64, 119, 202? 319 What comes next: 35752, 35750, 35748, 35746, 35744? 35742 What comes next: -21, -40, -59, -78, -97? -116 What is the next term in 1032, 1033, 1034? 1035 What is next in -39, -54, -93, -168, -291? -474 What is next in -19, -11, 3, 23, 49, 81? 119 What is next in 20, 44, 74, 110, 152, 200, 254? 314 What is the next term in 129, 257, 385, 513, 641? 769 What is the next term in 717, 719, 721, 723? 725 What is next in 50, 99, 142, 179, 210? 235 What comes next: -605, -606, -607, -608, -609? -610 What comes next: 333, 337, 341, 345, 349, 353? 357 What is next in -23, -43, -61, -77, -91, -103? -113 What comes next: 77, 147, 207, 251, 273, 267, 227? 147 What comes next: -352, -701, -1048, -1393? -1736 What comes next: 112, 219, 334, 463, 612, 787, 994, 1239? 1528 What comes next: 386, 384, 382, 380, 378? 376 What is the next term in 1296, 2594, 3878, 5142, 6380, 7586, 8754? 9878 What comes next: 105, 212, 321, 432, 545, 660, 777? 896 What comes next: -44, -57, -70, -83, -96, -109? -122 What comes next: -85, -123, -63, 143, 543, 1185? 2117 What comes next: 2157, 2158, 2159, 2160? 2161 What comes next: -2169, -4325, -6481, -8637, -10793, -12949? -15105 What is next in 8, 17, 26, 29, 20, -7? -58 What is next in -4, -18, -32? -46 What is next in -74, -262, -576, -1016, -1582? -2274 What comes next: 1065, 2130, 3195, 4260, 5325? 6390 What is the next term in -18, -35, -50, -63, -74? -83 What is next in 70, 66, 62, 58, 54, 50? 46 What is the next term in 26, 35, 56, 95, 158, 251, 380? 551 What comes next: 1361, 1363, 1363, 1361, 1357, 1351, 1343? 1333 What comes next: -5, 20, 53, 88, 119, 140? 145 What comes next: 829, 816, 779, 706, 585, 404? 151 What is the next term in 4, -3, -16, -35, -60, -91? -128 What comes next: 1641, 1646, 1653, 1662? 1673 What is the next term in 206, 330, 440, 530, 594? 626 What comes next: -36, -79, -124, -171, -220? -271 What comes next: -5, 6, 15, 22, 27? 30 What comes next: 62, 84, 106, 128, 150? 172 What is next in -1618, -3234, -4850? -6466 What is next in 42, 35, 40, 63, 110? 187 What is the next term in 46, 47, 48, 49, 50? 51 What is next in 28, 111, 256, 469, 756? 1123 What is next in 88, 177, 266, 355, 444? 533 What comes next: 118, 120, 114, 94, 54, -12, -110? -246 What is next in 85, 114, 143? 172 What is the next term in 562, 564, 568, 574, 582, 592, 604? 618 What is next in -22, -29, -40, -55, -74? -97 What comes next: -21, -45, -87, -153, -249, -381? -555 What is next in -3, -11, -55, -153, -323? -583 What comes next: 464, 945, 1436, 1943, 2472, 3029, 3620, 4251? 4928 What is next in 6, 83, 298, 723, 1430, 2491, 3978? 5963 What is the next term in 2, -18, -64, -148, -282, -478, -748? -1104 What comes next: -1171, -1177, -1183? -1189 What is the next term in 3531, 3535, 3541, 3549, 3559, 3571? 3585 What is next in 445, 891, 1337? 1783 What comes next: 2, 27, 88, 203, 390? 667 What is next in 2004, 1982, 1934, 1848, 1712, 1514, 1242, 884? 428 What is next in 8350, 16699, 25048, 33397, 41746? 50095 What is the next term in -22, -39, -54, -67? -78 What comes next: -27, -75, -167, -315, -531, -827? -1215 What is next in 111, 237, 381, 549, 747? 981 What is next in -124, -488, -1094, -1942, -3032, -4364? -5938 What is the next term in 78, 159, 240, 321, 402? 483 What is next in -6, -21, -52, -105, -186, -301, -456? -657 What is next in 47, 66, 83, 98? 111 What comes next: -9, -12, -35, -90, -189, -344, -567? -870 What comes next: -162, -340, -518, -696? -874 What comes next: -21, -17, -3, 27, 79, 159? 273 What is next in -708, -1360, -2012, -2664, -3316, -3968? -4620 What is the next term in 8, 17, 40, 83, 152, 253, 392? 575 What is next in 230, 233, 236, 239, 242? 245 What is next in -382, -761, -1142, -1525, -1910, -2297? -2686 What is the next term in 120, 244, 368, 492? 616 What comes next: 4800, 9598, 14396, 19194, 23992, 28790? 33588 What comes next: 258, 264, 268, 264, 246, 208, 144? 48 What comes next: -561, -561, -571, -597, -645, -721? -831 What is the next term in -165, -328, -489, -648, -805, -960, -1113? -1264 What is the next term in -360, -362, -364, -366, -368, -370? -372 What is the next term in -6630, -6626, -6622? -6618 What comes next: 331, 673, 1017, 1363, 1711, 2061? 2413 What comes next: -37, -66, -95, -124, -153? -182 What is next in -26, -31, -36, -41, -46? -51 What is next in -21, -28, -23, 0, 47, 124, 237, 392? 595 What is next in -6, -23, -30, -21, 10, 69, 162? 295 What is next in -15, -1, 49, 147, 305, 535? 849 What is next in -232, -456, -672, -874, -1056, -1212? -1336 What is the next term in 77, 79, 81, 83? 85 What is next in 63, 92, 129, 174, 227? 288 What comes next: -2, -26, -66, -122, -194, -282, -386? -506 What comes next: -1439, -2872, -4305, -5738, -7171? -8604 What comes next: 212, 241, 312, 443, 652, 957, 1376, 1927? 2628 What is the next term in -26967, -26966, -26965? -26964 What comes next: -337, -338, -339, -340, -341, -342? -343 What is next in -62, -271, -626, -1133, -1798, -2627, -3626, -4801? -6158 What is next in 18, 86, 274, 642, 1250, 2158? 3426 What comes next: 128, 262, 396? 530 What is the next term in 45, 49, 53, 57, 61? 65 What is next in 538, 1078, 1618, 2158, 2698, 3238? 3778 What is the next term in -11, -22, -45, -86, -151, -246, -377? -550 What comes next: 29, 22, 13, 2, -11, -26? -43 What is the next term in -56, -61, -68, -77, -88, -101? -116 What is the next term in 198, 192, 186, 180, 174? 168 What comes next: -7, 11, 55, 137, 269, 463, 731? 1085 What is the next term in -56, -64, -106, -200, -364, -616? -974 What is next in 167, 347, 527, 707? 887 What is next in -2, -22, -60, -122, -214, -342? -512 What is the next term in -126, -256, -386? -516 What is the next term in -191, -187, -181, -173, -163, -151? -137 What is next in 228, 226, 224, 222, 220? 218 What comes next: 11, -4, -21, -34, -37, -24, 11, 74? 171 What is the next term in -2208, -4416, -6626, -8838, -11052, -13268? -15486 What is the next term in 81, 161, 241, 321, 401? 481 What comes next: 15, 24, 23, 12, -9, -40? -81 What is the next term in -20, -92, -214, -386, -608, -880, -1202? -1574 What is the next term in 269, 540, 811? 1082 What comes next: -67, -268, -605, -1078, -1687? -2432 What is next in -377, -370, -363, -356, -349, -342? -335 What is the next term in 34, 74, 118, 166, 218, 274? 334 What is the next term in 12, 31, 62, 111, 184, 287? 426 What is next in 1070, 1071, 1072, 1073, 1074? 1075 What is next in 31, 66, 101, 136, 171, 206? 241 What comes next: 63, 193, 453, 909, 1627, 2673? 4113 What is next in 35, 39, 53, 83, 135, 215, 329? 483 What is next in 270, 272, 274, 276, 278, 280? 282 What is next in 226, 243, 272, 313, 366, 431, 508? 597 What comes next: 135, 130, 125? 120 What comes next: -716, -718, -720, -722, -724, -726? -728 What is next in -2870, -2865, -2856, -2843, -2826? -2805 What is next in 1839, 3671, 5505, 7341? 9179 What is the next term in 23, 39, 53, 65, 75, 83, 89? 93 What comes next: 20, 59, 124, 227, 380, 595, 884? 1259 What is next in -16, -138, -466, -1102, -2148, -3706, -5878, -8766? -12472 What is next in 14, 36, 86, 176, 318? 524 What is the next term in 39, 78, 133, 210, 315? 454 What is the next term in -5, 4, 29, 76, 151, 260, 409, 604? 851 What is the next term in 15, 32, 55, 84, 119, 160, 207? 260 What comes next: 69, 140, 213, 288? 365 What is next in 90, 72, 54, 36? 18 What is next in 102, 85, 80, 93, 130, 197? 300 What is next in -189, -222, -275, -348, -441, -554, -687? -840 What comes next: 281, 569, 857, 1145? 1433 What comes next: 43, 178, 409, 742, 1183? 1738 What is the next term in 2747, 5487, 8227, 10967, 13707? 16447 What comes next: 2576, 2574, 2570, 2564, 2556, 2546, 2534? 2520 What is the next term in -9, -13, -27, -57, -109, -189? -303 What is next in 19, 101, 243, 445, 70	{ "pile_set_name": "DM Mathematics" }
ctors of p? 5, 23 Let g(v) = -49v3 - 4v*2 - 14v + 2 + 3v2 + 9v + 7v. Let z be g(-2). Suppose 3t = -t + 3q + z, 2t = 4q + 198. List the prime factors of t. 5, 19 Suppose 0 = -3w + 3z + 96531, 44z = -2w + 47z + 64361. What are the prime factors of w? 2, 5, 3217 Suppose 11155 = 3m - 2y, 30m = 26m + y + 14870. List the prime factors of m. 3, 7, 59 Suppose -85 = 2w - 4z + 19, 0 = -3w + 5z - 153. Let o = -293 + w. Let i = o - -586. List the prime factors of i. 13, 19 Let p(x) = 17x3 - 12x*2 + 81x - 1353. List the prime factors of p(15). 3, 7, 53 Let m(a) = 8 - 2a3 - 25a*2 + 396a - 410a + a3. Let w be m(-24). Let c = w + 365. List the prime factors of c. 7, 19 Let y(r) = 12r*3 - 10r*2 + 40r + 3. What are the prime factors of y(8)? 5827 Let s = -14011 - -23550. List the prime factors of s. 9539 Let y(g) = g3 + g2 + g + 60. Let o be y(0). Let p = 63 - o. Suppose -5v = w - 612, -w - 370 = -3v - pw. List the prime factors of v. 2, 61 Suppose 56 = -10b + 17b. List the prime factors of (-3)/2 + -4 + 908/b. 2, 3 What are the prime factors of (-11 + 6 - 17104045/(-525)) + (-4)/30? 2, 3, 61, 89 Suppose o - 3643 = 33g - 37g, -3g + o + 2741 = 0. What are the prime factors of g? 2, 3, 19 Suppose -1628 = -p + 1338. List the prime factors of p. 2, 1483 What are the prime factors of (2502865/40 - -2) + 2/(64/12)? 2, 3, 10429 Let a(r) = 152r2 + 2r - 26. Let m(g) = 182g2 + 3g - 25. Let b(h) = 6a(h) - 5m(h). Let t be 222/4 + -1. List the prime factors of b(t). 139 Let a(v) = 2815v - 303. List the prime factors of a(5). 2, 11, 313 Let s be 2/((-12)/(-546)7). List the prime factors of s/(-26)(-62 - -2). 2, 3, 5 Let w(y) be the second derivative of -143y3/6 - 139y*2/2 + 4y + 7. What are the prime factors of w(-8)? 3, 5, 67 Let j be 5 + 5 + -4 - 4. Suppose jl = 14l - 4188. List the prime factors of l. 349 Let i(l) = 611l2 + 35l + 175. List the prime factors of i(-6). 21961 Let k be (172/(-3))/(-2)(13 + -10). Let s = -17 + k. Suppose -s + 2 = -u. What are the prime factors of u? 67 Let d(w) = 181w*3 - 2w*2 - 17w + 18. List the prime factors of d(1). 2, 3, 5 Suppose -h - 25s + 27s + 103 = 0, -2s = 5h - 515. Let r = 15 + -22. Let a = h + r. What are the prime factors of a? 2, 3 Suppose 0 = -t + 3k + 6, -5t - 3k - 11 + 23 = 0. Suppose -4f = to - 1264, 2f + 5o - 1272 = -2f. What are the prime factors of f? 313 Let k(a) = 116 + 67a + 55 - 44 + 37a. List the prime factors of k(10). 3, 389 Let t(z) = -z*2 + 3z + 439. Suppose 3b - 3s = 2 + 1, 0 = -3b - s - 1. Let f be t(b). Suppose 0 = -5x + f + 526. List the prime factors of x. 193 Suppose -6t = -4t - 4l - 8, 0 = -5t + 3l + 13. Suppose -1612 = -ti - 5g, 3168 = i + 3i - 4g. What are the prime factors of i? 2, 199 Let b = 157105 - 89153. What are the prime factors of b? 2, 31, 137 Suppose -4c + 11 = -3k - 14, -8 = c + 4k. Suppose 0 = cw - 6 - 2. Suppose 195 = wr + j, 87 = -r + 2r + 4j. List the prime factors of r. 3, 11 Let i = 8185 - 3911. What are the prime factors of i? 2, 2137 Suppose -740370 + 165570 = 427g - 452g. List the prime factors of g. 2, 3, 479 Let g = 407 + -405. Let d be (-3)/(-1)(-17)/(-3). Suppose 0 = -u + gb + d, -41 = -2u - 6b + 3b. List the prime factors of u. 19 Let i be 20/(-12)(2 - 15/3). Suppose 3n - 2z + 62 - 829 = 0, -in - 3z = -1310. What are the prime factors of n? 7, 37 Suppose 404x = 134x + 16652250. List the prime factors of x. 5, 2467 Let m be (119/(-28) - 16/(-4))-12. Suppose 3s - 3r - 2219 = -r, -2239 = -ms - 2r. List the prime factors of s. 743 Suppose t + 5t + 62055 = 11t. List the prime factors of t. 3, 7, 197 Suppose 4m - 3y - 51182 - 96234 = 0, -4y + 184270 = 5m. What are the prime factors of m? 2, 18427 Let w(o) = o2 + 44o + 194. What are the prime factors of w(-62)? 2, 5, 131 Let z(g) = -g*3 - 10g*2 - 3g - 6. Let d be z(-10). Suppose -2k + 94 = -3h, d = h + 20. List the prime factors of k. 53 Suppose 0 = -3t - 15, 3k - 56469 = 39t - 36t. List the prime factors of k. 2, 97 Let o = -49 + 57. Suppose -2c = 3h - o, -2h + h - 4c + 6 = 0. What are the prime factors of -2 - -115 - h - (-3 - -1)? 113 List the prime factors of (0 - 2016/(-40)) + 4079. 61, 67 Let y(b) = 109b + 106. Let w = -314 + 320. List the prime factors of y(w). 2, 5, 19 Suppose -83d + 1025285 = -10d. What are the prime factors of d? 5, 53 List the prime factors of 110 + -102 + 112/(-2) - -21288. 2, 5, 2129 Suppose 4l + 5p = -127, p = 6l - l + 137. What are the prime factors of 8/l - (-2634)/7? 2, 47 Suppose -1517486 = -38h - 541304. What are the prime factors of h? 3, 8563 Let x(o) = 10o*2 + 8o + 73. Let q(k) = -5k2 - 3k - 36. Let c(n) = 5q(n) + 3x(n). List the prime factors of c(-6). 3, 5, 11 Let t = 8099 + -7589. What are the prime factors of t? 2, 3, 5, 17 Suppose -h - 44h + 319338 = -175842. List the prime factors of h. 2, 3, 7, 131 Suppose -4a = 3p - 1121, p = 4a + 107 + 240. Let g = -107 + p. List the prime factors of g. 2, 5, 13 Suppose -o - 3 = 2w + 2, -4o + 4w + 16 = 0. Let v(r) be the first derivative of 90r*2 + 4r + 101. What are the prime factors of v(o)? 2, 23 Let l(d) = -d*2 + 3d + 6. Let y be l(4). Let s be y/(9 - -1) + 72/15. Suppose 0 = -v + 16 - s. List the prime factors of v. 11 Let a be -4 + (4/(-5))/(18/(-135)). Suppose -3v = -4f + 825, -f + 825 = av - 5v. Let n = v + 481. What are the prime factors of n? 2, 103 Let p = 33 + -29. Let t be (p + (4 - 1))(-2 - -3). Suppose -ty = -197 + 8. List the prime factors of y. 3 Suppose -31y + 50 + 74 = 0. Let r = 40 + 25. Suppose 0m - 5m + r = 4v, yv + m - 61 = 0. List the prime factors of v. 3, 5 Let b = 266 + -179. Let q be 22/77 + 453/7. Let y = b - q. What are the prime factors of y? 2, 11 Let f = -160 - 70. Let u be 10/70 + f/(-7). List the prime factors of ((u/(-4))/(-1))/((-189)/(-504)). 2, 11 Suppose 21h + 26 = 20h. Let s = h - -1165. List the prime factors of s. 17, 67 Let l = 30 - 28. Suppose 0 = -lc - 92 + 14. What are the prime factors of (-2736)/(-39) + 6/c? 2, 5, 7 Let o(m) be the second derivative of 17m3/3 - 225m*2/2 + 103m - 1. List the prime factors of o(30). 3, 5, 53 Suppose 0 = 16m - 24m - 280. List the prime factors of 6/15 - 0 - 4326/m. 2, 31 Let j(t) = t*3 + 9t*2 - 12t - 16. Let f be j(-10). Let y be (2-2)/(f + -2). List the prime factors of -8(y - 235/10). 2, 3, 17 Let s(a) = -a*3 - 42a*2 - 30a - 22. What are the prime factors of s(-42)? 2, 619 Let l(c) = -18c + 8. Let i be (-6)/((-8)/(-8) + (-1)/(-2)). Let s be l(i). Suppose 9j - 541 - s = 0. List the prime factors of j. 3, 23 Suppose 6u + 918 = 9u. Let c = -91 + u. What are the prime factors of c? 5, 43 Let d(l) = l*2 + 20l. Let n be d(-20). Suppose n = t - 7t + 18. Suppose 0 = -tw + 126 + 90. What are the prime factors of w? 2, 3 Let k(j) be the first derivative of j*3/3 + 11j*2/2 - 78j + 50. List the prime factors of k(-19). 2, 37 Let b = -12458 + 20830. What are the prime factors of b? 2, 7, 13, 23 Suppose 0 = -4q + 3b + 24, -5q + b + 30 = 3b. Let l(f) = -f*3 + 5f*2 + 2f + 21. Let u be l(q). Let t = u - -21. List the prime factors of t. 2, 3 Let s = -21990 + 45747. List the prime factors of s. 3, 7919 What are the prime factors of ((-920)/200)/(-23) + ((-268158)/(-10) - -1)? 3, 7, 1277 Let h(u) = u*3 + 8u*2 - 5u + 5. Let q be h(-9). Let a = q + 33. Suppose m + aj - 35 = 0, 2m + j = -m + 80. List the prime factors of m. 5 Let c(g) = 2g3 + 29g*2 + 19g + 4. Let i be c(-15). What are the prime factors of 3/(-3) + (-6 - i)? 499 Let i(k) = -13k - 411. Let u be i(-31). Let l(q) = 11q - 3. Let r be l(5). Let t = r + u. List the prime factors of t. 2, 11 What are the prime factors of ((-2120)/159)/(2/(-3387))? 2, 5, 1129 Let b(g) be the first derivative of g*4/4 + 2g*3 - 2g*2 - 17g - 87. List the prime factors of b(-4). 31 Let k = -5351 - -8951. Suppose -k = -16t + 1712. List the prime factors of t. 2, 83 Suppose 4v = t + 4, -2v - 9t = -11t - 2. Let k(b) = 323b*2 + 2b - 3. What are the prime factors of k(v)? 2, 7, 23 Suppose -5v - b + 15239 + 10419 = 0, 5v = -5*b + 25650. What are the prime factors of v? 2, 1283 What a	{ "pile_set_name": "DM Mathematics" }
Express -l*3 + 0l*3 + 0l + 761 - 759 + 2l4 + 2l in the form yl2 + s + tl*4 + kl*3 + gl and give s. 2 Rearrange (-2j2 - 2j2 + j2)(-4 - 1 + 4)(-4 + 4 - 1) to i + dj + tj*2 and give t. -3 Rearrange (-4w + w + 4w)(0w3 + w3 - 2w3) - w4 - 2w4 + 6w*4 to the form iw*4 + zw*3 + l + mw + xw2 and give i. 2 Rearrange (-d3 + 2d*3 + 2d - 3d3 - 1)(33 - 33 - 4d) to the form vd*4 + nd*2 + md*3 + b + sd and give n. -8 Rearrange 0b3 - b2 - b4 - 3 + 0b*2 + 1 - 4b*3 to wb + jb2 + s + qb*3 + vb*4 and give j. -1 Express -12 - 96j*2 + 3j*3 + 96j*2 as q + bj*2 + uj*3 + cj and give u. 3 Express 0s - 6s - 14s + 8s as ys + l and give y. -12 Rearrange k2 - 14k3 + k3 + 0k3 to the form q + fk*3 + xk + gk2 and give g. 1 Express (4 - 2 - 3)(-1379 - 67s + 1379) as j + cs and give c. 67 Express (4j - 2j - 3j + (-4 + 2 + 1)(-2j + 4j - j))(8j - j - j) as ij2 + y + qj and give i. -12 Rearrange 2d2 + 2d*2 + 3d*2 + d - 2d*2 to md*2 + xd + g and give x. 1 Rearrange -4p - 5p*3 + 4p*3 + 20p*4 - 15p*4 to the form bp*3 + sp*4 + f + cp + ap2 and give b. -1 Rearrange (-17j + 7j + 5j)(-1 + 3 + 0) to i + tj and give t. -10 Express -29n2 + 0 - 6 + 6 as tn + i + an2 and give a. -29 Rearrange -9n + 5n3 - 6n + 12n to sn*3 + fn*2 + u + on and give s. 5 Express (3n3 - 5n*3 - 3n*3)(1 + 1 - 1)(-2 + 3n + 0 + 0n) in the form kn*2 + tn + a + in3 + gn*4 and give g. -15 Express 1 - 1 + 2a + (0 + 1 - 2)(1 + 2a - 1 + (a + a + 0a)(1 + 2 + 12)) as r + ma and give m. -30 Express 133 - 68 - 65 - 46t*2 in the form lt*2 + qt + u and give l. -46 Express (2d - 5d - 3d)((0 + 4 - 2)(-3d + 0d + 4d) + 5d - 2d - d - 3d - 2d + 6d) in the form wd*2 + qd + g and give w. -30 Express -25i + 3i*2 + 3i*2 - 8i*2 as w + ni*2 + zi and give w. 0 Rearrange -3t + t - 9t to the form jt + n and give j. -11 Rearrange (-4j*2 + 2j*2 + 0j*2)(4j + 3j + 2j)(-3j - j + 2j) to c + zj + uj*2 + ij*3 + aj*4 and give a. 36 Rearrange 22j + 39j4 - 22j + (4j3 - j3 - j3)(1 + 2j - 1) - j4 + 3j*4 + 0j*4 to the form vj*3 + yj*2 + uj + c + sj4 and give s. 45 Express (-y3 + 0y3 - y3)(-2 + 0 + 0) + 4y*3 - 16 - 7 + 19 in the form x + uy*3 + ny*2 + py and give u. 8 Express (1 + 2r3 - 1)(4 - 1 - 6)(0r - 3r + r) in the form ir + or4 + vr*2 + kr*3 + s and give o. 12 Rearrange 7m + 18m - 7m + 33m to the form jm + x and give j. 51 Express 9 - 4h + h - 4h - 14 in the form rh + v and give v. -5 Express (3 - 3 - v2)(-1 - v*2 + 1) + 6v*4 - 3v4 - v4 + (0v + 2v*3 + 0v)(0 + v + 0) as xv*4 + yv + kv3 + bv*2 + s and give x. 5 Express -2x*2 + 56x*3 + 1 - 132x*3 + 63x*3 in the form y + sx*3 + mx*2 + gx and give s. -13 Express (-k - 2k + 2k)(2 - 2 + 1) - 4k + 4k - 2k - 897 + 3k - 5k + 868 as a + jk and give a. -29 Rearrange (3c + 6 - 6)(4 - 19 - 33) to y + uc and give u. -144 Express 0 + 54a2 + 4 - 68a*2 + (-1 + 1 + a)(-2a + a - a) as za + ha2 + j and give z. 0 Express (17 + 34 - 22)(0k - 3k - 2k) in the form q + hk and give h. -145 Express (5 - 2 - 5)(2c + 10c - 4c)(-2c*2 + c - c) as rc*2 + v + yc + fc3 and give f. 32 Rearrange ((-3 + 0 + 2)(3 - 1 - 4) - 8 + 0 + 7)((4 - 2 - 3)(0x + 2x + 0x) + 3x + 5x - 4x + 2x - 5x + 4x)(4 - 3 - 3) to h + fx and give f. -6 Express (-2h + 0h + 3h)(30 - 18 + 57) in the form c + dh and give d. 69 Rearrange (2 + 6q + 5q + 6q)(2 - 2 - q) to hq + x + gq*2 and give h. -2 Express (-2i*2 - 4i*2 + 4i*2)(4 + 4 - 4) - i*2 - 5i*2 + 4i*2 as xi*2 + v + di and give x. -10 Rearrange 179n - 86n - 90n + n3 - 9n*2 to zn*2 + w + on + cn3 and give z. -9 Rearrange -4v*2 - 7v*2 + 3v*2 - 10v*2 to the form xv*2 + av + b and give x. -18 Rearrange (-2c3 + 0 + 0)(-2c + 4c - c) + (31c3 - 16c*4 - 31c*3)(-3 + 1 + 0) to the form wc2 + yc*3 + uc + k + mc4 and give m. 30 Express (3v - 6v - 2v)(-v + 43 + v + v) in the form k + tv + lv2 and give l. -5 Express 0 + 3m*2 + 4 + 5m - 1 - 2m2 in the form zm*2 + f + bm and give b. 5 Express 10u + 8u*3 + 3u*2 + 13u*3 - 19u*3 in the form yu*3 + ru*2 + cu + f and give r. 3 Express -16b3 + 18b*3 - 2b*2 - 4b*2 in the form cb*2 + wb*3 + l + sb and give w. 2 Express -4j4 + 4j*3 - 1 - j + 0j + 3j4 + 2j*4 as lj + kj3 + cj*4 + t + mj*2 and give t. -1 Rearrange 5i - 7i - 15i to x + qi and give q. -17 Express (1 - 1 - o)(-3 - 2 + 4) - o - 4o + 3o + 0o + o - 3o - o + 3o + 2o - 3 in the form w + jo and give j. 1 Express -o2 - o2 + o2 + (o - 3o + 3o)(0 + 0 - o) + o*2 + 4o*2 + 0o*2 + (2 - 2 - o)(-2o + 2o + 2o) as g + yo*2 + lo and give y. 1 Rearrange j + 2j - 5j + j + j + 0j + (j + 3 - 3)(3 + 2 - 4) - 23j - 1 + 24j - 29j to the form tj + o and give t. -27 Rearrange (-5x4 - x2 + x2)(4 - 4 + 2)(-1 - 4 + 3) to r + wx + zx4 + ox*3 + vx*2 and give z. 20 Rearrange (3c - 4c - c)(-c + 4c - 6c)(0 + 0 + 7c)(-c + c - c) to xc*3 + pc*2 + nc*4 + b + mc and give m. 0 Express 428 - 428 + 36n in the form b + sn and give s. 36 Rearrange (3j2 - 3j*2 + 2j*2)(107 + 74 - 19) to tj2 + cj + d and give t. 324 Express (-3 - 2 + 4)(2 - 2 + 1)(z*4 - 5z*4 + 3z*4) as tz*4 + az*3 + rz + pz2 + x and give t. 1 Express ((2 - 2 - 2m)(0 + 1 + 0) + m + 2m - 2m - 6m + 2m + 3m)(-49 + 23 + 25 + 51m*2) as h + gm*2 + am + sm3 and give s. -102 Express -a3 + 2a - 6a2 + 3a*2 + 0a*2 in the form wa*2 + ca + ga3 + m and give g. -1 Rearrange o4 + 0o2 - o4 + o*4 - 1 - 6o*2 to yo*2 + co + ho4 + w + ao*3 and give y. -6 Express (-3u3 + u3 + u*3)(-112 + 174 - 233 - 280) as qu2 + cu*3 + a + mu and give c. 451 Express (0q4 + q4 - 6q*4)(2 - 3 - 2) as lq4 + rq*2 + tq + uq3 + f and give u. 0 Rearrange 3 + q2 - 2q*4 - 80q*3 + q - 4 + 81q*3 to s + cq*4 + bq + gq3 + zq*2 and give c. -2 Rearrange (-3p + 3p - 2p)(6 + 0 - 4) - 5p + 14p + 22p to the form hp + w and give h. 27 Express (-2z2 + z2 - z*2)(17z - 57z - 44z) in the form h + xz*2 + kz*3 + az and give k. 168 Express (6h2 + 0h*2 - 5h*2 + (6h - 2h - 3h)(h - 3h + 3h))(2h2 + 3 - 3) in the form ah*2 + o + ih*4 + kh + sh3 and give i. 4 Express s4 + 2 - 17s*2 - 2s + 18s2 - 2s*3 + 0s*3 as ks*3 + ms*2 + b + ys*4 + us and give m. 1 Rearrange -29 + 12d + 29 to the form a + pd and give p. 12 Rearrange ((-29m - 19m + 53m)(-2 + 3 + 0) + 1 + 2m - 1)(1 + 2m - 1) to the form c + rm + nm2 and give n. 14 Rearrange (7n - 3n + 16n)(-n - 3n + 2n) to the form qn + t + zn2 and give z. -40 Rearrange (2 + 0 + 0)(-6a + 2 + 5a - a) + (-a - 1 + 1)(13 - 8 + 2) to v + ja and give v. 4 Express 10d2 + 8d*2 - 21d*2 + 0d4 + d4 + 4d3 in the form hd*4 + gd*3 + c + jd*2 + kd and give h. 1 Rearrange (1 + 4 - 2)(-1 - 1 + 1)(2m + 0 + 0) to f + hm and give h. -6 Rearrange s*4 - 4s*4 + 4s*4 + (-11 + 11 - 17s*3)(-2s + 3 - 3) to zs*3 + hs*2 + cs*4 + ls + r and give c. 35 Express 2012 - 2012 - 28i in the form l + ai and give a. -28 Express (3l2 + 0l2 - l2)(71l + 539 - 539) as o + ul + nl*2 + xl*3 and give x. 142 Express 20 + 15m - 13m + 14 as im + v and give v. 34 Rearrange -5 - 321m + 481m + 5 + (-1 - m + 1)(-4 + 1 + 1) - 3m - 1 + 1 to the form x + rm and give r. 159 Rearrange 2o*2 + 4o*2 - 53o + 59o to to*2 + y + lo and give l. 6 Express -13z - 4 - 4z2 + z2 + 16z in the form sz*2 + h + az and give s. -3 Express -6j - 3j - 2j + 0j - 3j + 4j + (0j - 2j + 3j)(6 - 3 - 2) - 4j + 4j + j as x + kj and give k. -8 Rearrange (10h*2 + 9h*2 + 2h*2)(-h - 2h + 0h) to the form jh2 + bh*3 + qh + t and give b. -63 Rearrange (-2t + 2t + t)(-1 + 2 + 1)(48 - 7t2 - 48)(1 + 0 + 2) to the form mt3 + ft*2 + yt + x and give m. -42 Rearrange -18v*2 +	{ "pile_set_name": "DM Mathematics" }
7)xxx(-2)xx(-3/7) assuming x is positive. x(197/357) Simplify (a(2/19))(-42) assuming a is positive. a(-84/19) Simplify (pp/(p/((pp(1/2)p)/p)p))(-34/5) assuming p is positive. p(-51/5) Simplify ((pp(-1/6))/p(2/7))/(p*(-2/3)/pp)(-25) assuming p is positive. p(-677/42) Simplify (l*(-10/11)lll)/ll(l(-9)/l)/l assuming l is positive. l(-98/11) Simplify (k*9k/k0)(4/5) assuming k is positive. k8 Simplify k(-25)k(1/10)/k assuming k is positive. k(-259/10) Simplify s((ss/s(1/3)s)/s)/ss(4/9)sss/s*(1/4)s3/s assuming s is positive. s(247/36) Simplify (h*(3/7)h)(-2) assuming h is positive. h(-20/7) Simplify (ff8)/(f/((f/((f(-2)/ff)/f))/f)) assuming f is positive. f11 Simplify (w(2/5)w)/w15 assuming w is positive. w(-68/5) Simplify (w(2/33)w8)/(w/w1)(1/3) assuming w is positive. w(266/33) Simplify ((qqq(-1/4)/q)/q)10(q(-2)/q)/q(-1/5) assuming q is positive. q(-53/10) Simplify (bb(-2/9))49 assuming b is positive. b*(343/9) Simplify (n(nn/n(-13)nn)/n)19 assuming n is positive. n323 Simplify ((g(-1)/g)/g)(-1/25)gg/(g(1/3)/g)g(gg/(g/(g((g8/g)/g)/g)))/g assuming g is positive. g(734/75) Simplify ((t/t(4/13))/t)/(t(-1/4)t) assuming t is positive. t*(-55/52) Simplify ((qq(-4/5))/(q/q(-4/7)))/((q/(q*(-4/9)q))/q(-7)) assuming q is positive. q(-2777/315) Simplify (l*0l(-6))/(l(2/7))24 assuming l is positive. l(-90/7) Simplify (n(n(n/((nn/n(-2/7))/n))/n)/n)8/(n/n(-3/2)n(-5)/n) assuming n is positive. n(17/14) Simplify ((aa(-4)a)/a(-3))/(a(-4/9)/(aa(3/4))) assuming a is positive. a(115/36) Simplify (w(-1/5))49 assuming w is positive. w(-49/5) Simplify w/(w/w(-2/17))w*(1/6)w assuming w is positive. w(107/102) Simplify (k1k)(-2/107)k(-3/7)/k5 assuming k is positive. k(-4094/749) Simplify ((m/(m/(m/m1m)m))/(mm/(mm*3m)))/(mm/m(-3)m*5mm) assuming m is positive. m(-9) Simplify (v/(v/v8v)vv/(v2/v))/(v/v6v(-2/9)) assuming v is positive. v(119/9) Simplify ((j(-1))(-10/3))(-2/39) assuming j is positive. j(-20/117) Simplify (l(3/8)/(l/(lll(-6)/l)))/(l(1/3))19 assuming l is positive. l(-287/24) Simplify (w(-1))(-33) assuming w is positive. w33 Simplify (m/(m(-1/2)m))(1/13)/(m10mm*(-2/11)m) assuming m is positive. m*(-3369/286) Simplify (ppp(1/3))/(p(-6)p)(p(-2/5))(-16/3) assuming p is positive. p(142/15) Simplify (r/r(3/4)r)/rr(-1)((r(r(2/17)/r)/r)/r)/r8 assuming r is positive. r(-723/68) Simplify ((m(-1)mmm)1)(2/79) assuming m is positive. m(4/79) Simplify (c(-3)(c(3/8)c)/c)/(c*(-6/7)cc/(c(1/2)/c)) assuming c is positive. c(-239/56) Simplify (z/(z/(z(zz(-6))/z)))/(zz*(-1/2))(z/(zz0))(-1/9) assuming z is positive. z(-11/2) Simplify (x(-2/5)xxx6)(-3/31) assuming x is positive. x(-114/155) Simplify (b2)*(-21)b*(-4)b6 assuming b is positive. b(-40) Simplify ((h(6/5)/h)/h)(-32) assuming h is positive. h*(128/5) Simplify (zz0/z)43/(z*(-4)/zz/z*(-3/2)zz) assuming z is positive. sqrt(z) Simplify (k(k/k*(1/2))/kk)*(-25)k*5k*(-3)k assuming k is positive. k*(-69/2) Simplify ((a/((aa(2/3))/a))(-10/7))28 assuming a is positive. a(-40/3) Simplify (l/(ll(2/17)l))/l(-11) assuming l is positive. l(168/17) Simplify (w*(-6/7)w*(-6/7))/(ww*(2/9)(w(w/(ww/w*(-4/9)))/w)/ww) assuming w is positive. w(-94/63) Simplify (g(-1)g(2/9))/((g(1/4)/gggg)/(g/(((g*(-2)g)/gg)/g))) assuming g is positive. g(-1/36) Simplify (l(-11)ll(llll(-6/11))/l)36 assuming l is positive. l(-2988/11) Simplify (u(1/4)u)16/((u/u(-3))/u(2/3)) assuming u is positive. u(50/3) Simplify (z*(-1/7)/(z/(zz/(z(-2/23)/z))))(-36) assuming z is positive. z*(-11268/161) Simplify (z/(zz*(-1/7))z(-5/3))39 assuming z is positive. z(-416/7) Simplify (g(2/25)/g)/g*(4/3)(g/g10)/((g(-8/7)g)/g) assuming g is positive. g(-5308/525) Simplify u(-1/5)uu(u/((uuu/u(2/37))/u))/u assuming u is positive. u(-27/185) Simplify (f/(f(-1/51)/f))/(f/(f(-12/11)f)f) assuming f is positive. f(-40/561) Simplify z(-12)z(4/17) assuming z is positive. z(-200/17) Simplify n/(n16n)n33 assuming n is positive. n17 Simplify (f((f*(-8/3)/f)/ff)/f)22 assuming f is positive. f(-242/3) Simplify b/(bb(-1/2))b*(-1)((b3/b)/b)/(b/b(-5)) assuming b is positive. b(-11/2) Simplify (l(-8)l(5/6))/(l3/llll/(ll0)l) assuming l is positive. l(-73/6) Simplify (l(2/7))*(-31)/((ll/l(-3/8))/(l(-2)l)) assuming l is positive. l(-685/56) Simplify z/(z/z9)z(z(3/2)z)/z assuming z is positive. z(23/2) Simplify (y/y(2/13)yyy(y/(yyy(yy/(y/(y/(y*(-2/11)/y))y))/yy))/y)/(y(3/2)/((yy4)/y)) assuming y is positive. y(333/286) Simplify w*(-23)/www/w(-23) assuming w is positive. w Simplify ((zz(-7)/z)(-2/3))(-12/11) assuming z is positive. z(-56/11) Simplify (l*(2/27)l/((l*4ll)/l))/((((l/(((l/((l(4/9)/l)/l))/lll)/l)l)/l)/ll)/l8) assuming l is positive. l(152/27) Simplify ((p(-2/3)/p)(13/2))34 assuming p is positive. p(-1105/3) Simplify (d(2/3)/(d/(d/(d(-10)d))))2 assuming d is positive. d(58/3) Simplify ss0s*7/s(s*(-1)s)13 assuming s is positive. s7 Simplify k/k*(-12)k10 assuming k is positive. k23 Simplify iiii(-5/4)iiii(1/8)(i/(i/i*(-6)))/ii*2i assuming i is positive. i(7/8) Simplify (x2)41/(x(-9)/(x/(((x(x(-2/29)/xx)/xxx)/xx)/x))) assuming x is positive. x(2641/29) Simplify (t/(t(((tt(-2/7))/t)/t)/t)t)/((t/((tt/(ttt(4/7)))/t))/tt)((t(-6)/t)/t)/(t(3/2)t) assuming t is positive. t(-137/14) Simplify (r/(r/(r(1/4)r)r)r)/(r/r(-4))r*4r(1/7) assuming r is positive. r(11/28) Simplify ((l/((l*(-5/3)/l)/l))/(lll(-6)l))/((l*(-1/4)/lll)/l)(3/34) assuming l is positive. l(3137/408) Simplify (b/(((b/b(-1/4)bbb)/b)/b))*(-9)/((((bb*(-5)bb)/b)/b)/(b/(b/((b/(bb(-2/3)))/b)))) assuming b is positive. b(179/12) Simplify (m/(m/((m/(m*26m))/m)))(-30) assuming m is positive. m810 Simplify (l/(llll5)l3)/(l/(l(-1)/lllll))(-2/91) assuming l is positive. l(-366/91) Simplify (x/(x/x(2/45)))/(x/(x(-19)x)x) assuming x is positive. x(-898/45) Simplify ((k/(k/(k/k3)))/kkk*(-2/7)k)/(k*(-2/11)/(kk*(-1/7)k)) assuming k is positive. k(58/77) Simplify (g3/g6)(-12) assuming g is positive. g36 Simplify (c(-1/12)c/(c/(cc(-5))))/(c/c(-1/2))(1/50) assuming c is positive. c(-617/150) Simplify ((f(1/5)/f)/f1)(-26) assuming f is positive. f(234/5) Simplify i*4i(-2/15) assuming i is positive. i(58/15) Simplify (qq(-2/21)q)/q*(-5/3)(qq(-2)q)/(qq(-2)) assuming q is positive. q(32/7) Simplify (ll(-21))(-2/147) assuming l is positive. l*(40/147) Simplify (cc/(c*9c)c)/c6 assuming c is positive. c(-13) Simplify mm/(m/((m/((m/m*(2/27))/mm))/m))mm(1/5) assuming m is positive. m(172/135) Simplify i*4iii*(-2)i(i1)(-7) assuming i is positive. i(-2) Simplify (h5/h(2/5))(5/7) assuming h is positive. h(23/7) Simplify (o(2/5)/o)(5/7) assuming o is positive. o(-3/7) Simplify (ww/(www*4/ww))/((w*4/w)/w)(w(-2/5)/w)(-1/8) assuming w is positive. w(-233/40) Simplify (i/(i/(i/i(-3/8)))(((i/((i/(i/(((ii*(2/17))/i)/i)))/i))/i)/i)/ii)(13/3) assuming i is positive. i(3991/408) Simplify (b/b12)/(b/(b19b)) assuming b is positive. b8 Simplify (((vv/(v/(v/(v*1/v)))vv)/v)/(vvvv/(vv/v3)))/(v(-1))(2/91) assuming v is positive. v(-180/91) Simplify (ssss(-6))/s5s(-2)s6 assuming s is positive. s(-4) Simplify (k(-1/8)/(k(-8)/kk))/(kk*6k(-4/7)) assuming k is positive. k(81/56) Simplify ((k/(k/k*(-13)))/kkkkk2)(-2/5) assuming k is positive. k(18/5) Simplify ((h(-1/3)/h)(-5/4))(-39) assuming h is positive. h(-65) Simplify (u(1/3))(2/43)/(uu/(u*(2/7)/uu)(u/(u*(-2/15)/u))/u) assuming u is p	{ "pile_set_name": "DM Mathematics" }
ide -1 by -375511. 1/375511 Divide -81 by -1528. 81/1528 -14685 divided by 15 -979 Calculate 1563450 divided by -104230. -15 Calculate -171936 divided by -3. 57312 39558 divided by -13186 -3 Calculate -700629 divided by -233543. 3 -39692 divided by 33 -39692/33 279 divided by -837 -1/3 What is -5 divided by 10622? -5/10622 What is 3157056 divided by -16? -197316 -990819 divided by -3 330273 What is -177 divided by -6? 59/2 Calculate -3 divided by -24395. 3/24395 -67287 divided by 4 -67287/4 Divide -2781 by 438. -927/146 What is 2046 divided by 31? 66 Calculate -5 divided by -40020. 1/8004 What is 28529 divided by 27? 28529/27 127428 divided by 3108 41 Divide 30369 by 3. 10123 Calculate 19 divided by -108022. -19/108022 What is 1158 divided by -8? -579/4 Calculate 2520598 divided by -5. -2520598/5 Divide -63216 by -3512. 18 Divide -2 by 2969. -2/2969 Divide 1165 by 61. 1165/61 Divide 6 by -4137. -2/1379 -2711877 divided by 73 -37149 Divide 1078 by 71. 1078/71 What is 14032 divided by 4? 3508 -244 divided by 41 -244/41 Calculate 319 divided by 386. 319/386 Divide -4800 by 600. -8 -5 divided by -11787 5/11787 Divide -699 by -405. 233/135 Calculate 123725 divided by -24745. -5 Divide 8948 by -4. -2237 Calculate -32422 divided by 1. -32422 Calculate -69795 divided by 5. -13959 Calculate -4 divided by 908275. -4/908275 Calculate -7150 divided by 25. -286 What is -36214 divided by 953? -38 Calculate 64773 divided by 2399. 27 Calculate 78958 divided by 8. 39479/4 Divide -9674 by -691. 14 99322 divided by 49661 2 Divide -2759 by -12. 2759/12 Divide 112 by -11. -112/11 87547 divided by 1 87547 18688 divided by 7 18688/7 Calculate 15480 divided by -3096. -5 Calculate -468325 divided by -143. 3275 -44 divided by 16453 -44/16453 Divide -679965 by 65. -10461 Divide -117 by 635. -117/635 Divide -29784 by -29784. 1 Calculate 2981349 divided by -3. -993783 What is -9 divided by 8978? -9/8978 Calculate 0 divided by -19135. 0 -21472 divided by -1 21472 -6 divided by -51864 1/8644 548 divided by -14 -274/7 Divide 4 by 12095. 4/12095 Calculate -103960 divided by 1. -103960 -163155 divided by 5 -32631 Calculate -1280 divided by 256. -5 Calculate 12178 divided by -2. -6089 What is 11732 divided by -11732? -1 Divide 2 by -562032. -1/281016 What is 520 divided by -1750? -52/175 Divide 4580 by -73. -4580/73 What is 360 divided by -64? -45/8 Calculate -73369 divided by 5. -73369/5 What is 5 divided by -9906? -5/9906 Divide 1861771 by -43. -43297 726338 divided by -363169 -2 -73319 divided by 157 -467 Divide 149720 by 4. 37430 What is 13464 divided by -4? -3366 What is 185688 divided by -72? -2579 Divide -283 by -1744. 283/1744 Divide -6048 by -2. 3024 96537 divided by -3 -32179 676 divided by -801 -676/801 What is 35760 divided by -3? -11920 Divide 5 by 1764. 5/1764 -450 divided by 46 -225/23 What is 159 divided by -16652? -159/16652 -2 divided by -9136 1/4568 Divide -585816 by 3. -195272 -223084 divided by 1 -223084 136080 divided by -60 -2268 Divide -1853 by 758. -1853/758 Calculate -687831 divided by 229277. -3 Calculate -2 divided by 353734. -1/176867 Calculate 11450 divided by -11450. -1 Calculate 0 divided by -277407. 0 Calculate -770 divided by -717. 770/717 Divide -63519 by 21173. -3 Calculate 816 divided by 246. 136/41 Calculate -7978 divided by 3989. -2 -277164 divided by 46194 -6 41 divided by -7681 -41/7681 What is -794952 divided by 264984? -3 -38 divided by 13991 -38/13991 Calculate 23316 divided by 268. 87 Calculate -1 divided by -624548. 1/624548 What is 1059 divided by -25? -1059/25 Divide 389 by -2591. -389/2591 Divide -176 by 1693. -176/1693 12 divided by 3639 4/1213 Divide -436672 by 13646. -32 9 divided by 14496 3/4832 3803330 divided by 5 760666 Calculate -4919761 divided by 447251. -11 11972 divided by -82 -146 1 divided by 33451 1/33451 Calculate -6793 divided by -3. 6793/3 What is 66 divided by 20132? 33/10066 Calculate -7070 divided by 70. -101 What is -2 divided by 9138? -1/4569 Divide -68 by 17142. -34/8571 What is 464 divided by -5308? -116/1327 31088 divided by -3 -31088/3 Calculate 2962 divided by -63. -2962/63 -1646510 divided by 164651 -10 Divide 17095 by 3419. 5 Calculate 116 divided by -51. -116/51 What is 431407 divided by -1? -431407 65310 divided by 14 4665 Divide -14879 by 10. -14879/10 What is -198236 divided by -1? 198236 Divide 44618 by -3. -44618/3 Calculate -4 divided by 124516. -1/31129 Divide -155628 by 25938. -6 Divide 119816 by -4. -29954 Calculate 64 divided by 1166. 32/583 What is 82301 divided by 51? 82301/51 What is -396506 divided by 36046? -11 1243092 divided by -6 -207182 59698 divided by -29849 -2 What is -3 divided by 11990? -3/11990 What is -12745 divided by 4? -12745/4 -1474 divided by -132 67/6 What is -2 divided by 144124? -1/72062 What is -46 divided by 53? -46/53 708210 divided by 236070 3 Calculate -349563 divided by -327. 1069 2 divided by -5316 -1/2658 1428648 divided by -104 -13737 Calculate -2462456 divided by -1231228. 2 Divide -3 by -51324. 1/17108 Divide 21110 by -10. -2111 Calculate 10400 divided by 16. 650 What is -272792 divided by 5246? -52 Calculate 309 divided by 309. 1 -186864 divided by -1 186864 What is -47691378 divided by 6? -7948563 What is -43 divided by 3699? -43/3699 Calculate -3659 divided by -11. 3659/11 Calculate 3 divided by 17044. 3/17044 Calculate 164137 divided by -1. -164137 1 divided by -27385 -1/27385 Divide 17752 by -14. -1268 What is 1 divided by -7115? -1/7115 Divide -3 by 1420548. -1/473516 305487 divided by -6 -101829/2 Divide 92312 by 12. 23078/3 Divide 178375 by -5. -35675 Divide -483 by 44. -483/44 What is -11 divided by -1819? 11/1819 Calculate -250399 divided by 9. -250399/9 Calculate 23164 divided by -61. -23164/61 What is 7891 divided by -1? -7891 What is -47697 divided by -1223? 39 What is 6336 divided by 36? 176 283 divided by 16190 283/16190 What is 45704 divided by -7? -45704/7 Calculate 263505 divided by -7985. -33 -274356 divided by 18 -15242 290134 divided by 145067 2 Divide -862004 by -11. 78364 Divide -36495 by 5. -7299 2151000 divided by 8604 250 Calculate -35562 divided by 6. -5927 Divide 0 by -230546. 0 39702 divided by -26 -1527 Calculate -90882 divided by -6. 15147 Divide 0 by -29854. 0 What is 33590 divided by 16795? 2 What is -27484 divided by -11? 27484/11 Calculate 319856 divided by 159928. 2 2168487 divided by -1 -2168487 Calculate -214368 divided by 6. -35728 What is 0 divided by 28? 0 8 divided by -690 -4/345 Divide -424116 by -15147. 28 Calculate -319 divided by 253. -29/23 -24626 divided by -3518 7 Calculate 0 divided by 6892. 0 Divide 1 by -8563. -1/8563 What is 142761 divided by 69? 2069 Divide 45586 by 23. 1982 What is 31688 divided by -68? -466 34328 divided by 56 613 Divide 1 by 76956. 1/76956 Divide 26625 by -355. -75 Divide 223944 by 62. 3612 Divide 368 by -587. -368/587 Calculate -156087 divided by -52029. 3 What is -39 divided by -7841? 39/7841 What is -425 divided by -108? 425/108 36 divided by -855 -4/95 What is -4639 divided by 17? -4639/17 Divide 771408 by -6. -128568 328840 divided by -6 -164420/3 Calculate -48591 divided by -16197. 3 Divide 25437 by 417. 61 -53000 divided by 200 -265 79345 divided by -15869 -5 What is 4087 divided by 28? 4087/28 Calculate -3 divided by -31056. 1/10352 Calculate -190690 divided by 95345. -2 198828 divided by -54 -3682 Divide -2 by 14688. -1/7344 Calculate -4 divided by -172323. 4/172323 Divide 12614 by 66. 6307/33 Calculate -49950 divided by 5550. -9 Divide 152720 by -830. -184 -5 divided by -147313 5/147313 Divide 56 by 5144. 7/643 Divide 430644 by -2. -215322 380622 divided by 66 5767 Calculate 0 divided by -1017113. 0 -15 divided by 96285 -1/6419 What is 2102 divided by -150? -1051/75 What is 0 divided by -18343? 0 Divide 69 by -5527. -69/5527 -64200 divided by 30 -2140 Calculate 40080 divided by 13360. 3 Divide 17185 by -3437. -5 Calculate -8 divided by 47440. -1/5930 Calculate 94 divided by -1513. -94/1513 Divide -158618 by -2. 79309 Calculate -71744 divided by 4484. -16 -6897265 divided by -1379453 5 Divide -94202 by 19. -4958 What is 1072 divided by 16? 67 Calculate -285196 divided by 4. -71299 -648 divided by -250 324/125 -30776 divided by -15388 2 -88 divided by -4716 22/1179 Calc	{ "pile_set_name": "DM Mathematics" }
-1115/6 5/7 Calculate 723/72 - 24 - -114. 1/24 Evaluate ((-4)/10)/((-15)/((-900)/8)). -3 What is the value of ((-1925)/(-1575))/((-1)/(-9))(1 + 0)? 11 Evaluate (1926/(-749))/(2/(-14)). 18 What is the value of (-1665)/45 - (-19 + 1)? -19 What is the value of 14/(-110) + (336/(-240))/(42/(-12))? 3/11 What is (-2)/(-36) - ((-3743)/342 + 19)? -8 Calculate (-6)/(-9) + (-14 - (-2336)/176). -2/33 Evaluate (-8 + 25)/(5 + -6). -17 (-6)/(-22)34/(-85)-5 6/11 Calculate ((-75)/(-9))/(255/153). 5 What is the value of -9 + (-574)/(-378)6? 1/9 What is (-65)/(-364) - 23/(-322)? 1/4 What is the value of 6/42 - 142/14 - -3? -7 Evaluate (65/(-13) + 14 + -10)/(-1). 1 What is (-10 + 11 + 4)-2? -10 Calculate -95/3 - -22 - (-96)/(-9). -11/3 Calculate ((-3)/4)/(274/3288). -9 Calculate ((-17)/((-10404)/24))/(-5 + 46/9). 6/17 What is the value of (-39)/(-6552)-2872 - (-13 + -4)? -2/21 What is 33 + ((-1155)/175 - (-12)/20)? 27 Evaluate 21/(-162) - ((-4123)/(-228) + -18)-2. 1/27 Evaluate ((-5)/(-6) - 0)(3/(-2))/1. -5/4 Calculate (-14)/(-18) + -1 - 64/(-180). 2/15 What is (-1 - 1)-27(-10)/180? -3 What is the value of -7(-1 + 0) + 30192/(-4440)? 1/5 What is 6/2 + -1 + 1 + (14 - 27)? -10 Evaluate (-2177)/1281 - 38/(-1159). -5/3 What is the value of (-75)/10 - 13/((-130)/45)? -3 What is 12/(-57) - 24684/17765? -8/5 What is (((-116)/(-261))/(8/(-6)))/(6/8)? -4/9 Evaluate (304 - 308) + (1 - 14). -17 (-67/(-21))/(210/5 + -3) 2/39 What is the value of (-17)/(-34) + 10 + (-1980)/189? 1/42 Calculate ((-155)/(-35) + -5)((-21)/(-12) + -2). 1/7 (-65)/(-5) + 125/(-10) 1/2 Calculate (-30)/(-1445)136/16. 3/17 What is -41/10 - 432/(-30)? 14 What is (8 - (-250)/(-20))/(21/(-6) - -4)? -9 What is (-488)/(-44) + 114/(-38) - (0 - -8)? 1/11 Calculate ((-48)/(-240))/(56/(-20)). -1/14 What is the value of ((-1)/(-2))/(-230 - -226)? -1/8 Evaluate (36/(-22))/3 + ((-27916)/(-924) - 30). -1/3 What is the value of (8 + (7 - (-738)/(-50)))10/(-4)? -3/5 What is the value of 9/(99/(-14))(154/(-56) + 0)? 7/2 Evaluate ((-14)/6 - (-42)/(-9)) + (-62)/(-6). 10/3 8/24 + 5 + (-168)/18 -4 (-2)/6231/(-7) 11 Calculate (3 - 10) + (-8)/12(-527)/51. -1/9 Calculate ((-1)/4 + 33/(-12))2. -6 Evaluate 135/(-24) + 3 + 17(-18)/(-153). -5/8 What is ((-9)/(-48))/(5/(-20)) + 0/4? -3/4 Evaluate (-4)/(-36) + 1372/(-441). -3 What is (-65)/(-99) - (-132)/(-242)? 1/9 Evaluate 1296/126182/52. 36 Evaluate ((-2350)/423)/50 + (-1)/(-3). 2/9 What is 19 + ((-76)/(-11) - 1/(-11))? 26 What is 2890/425 - (2 + 12/(-10))? 6 What is the value of (2 - 5)31/90 - (-276)/(-2070)? -7/6 What is (-83)/8 - 42/(-112) - -9? -1 What is the value of (-9)/45 - (-12)/88/12? 4/5 What is (13 - (-2475)/(-200))((-8 - -4) + -4)? -5 What is 2/(-6)(-39 - (-2691)/39)? -10 What is (-37)/((-5439)/42)(-2 - -1)? -2/7 Evaluate (3 + 8)1/11 - (-154)/110. 12/5 Evaluate (12/(-16))/((-10)/(-56)) - (62 - 65). -6/5 Evaluate ((-350)/20)/(392/(-448)). 20 15 - (621/189 + (-2)/7) 12 Evaluate (-1)/4(-60)/4275-76. -4/15 Evaluate (-5 + (-9)/3)2745/(-1220). 18 Evaluate 30/(-4080)-64. 3/17 What is 188/12080/(-616)-7? 12/11 Calculate (-14 - 1) + (-29 + 21)/((-12)/6). -11 (6/16)/(522/(-36) + 10) -1/12 What is the value of 624/(-4212) + (-410)/(-945)? 2/7 What is the value of (1316 - 1315)(119/9 - (-2)/(-9))? 13 Evaluate 4/((-6060)/255 + 24). 17 What is the value of (9 - 513/45)11/(-22)? 6/5 What is the value of -24 - -36 - ((-2)/(-6))/(2/30)? 7 Calculate ((-4)/14 - (-16)/7)/(500/1750). 7 What is 156/(-6) - (-140 + 125)? -11 What is (1 + 1)(-20)/(1800/63)? -7/5 ((-2)/(-12) - 147/(-126))(-18)/(-24) 1 Calculate (-8)/3288/110. -1/5 What is the value of 1415/720 + (-6)/36? 1/8 5 + -1152/40 -3/4 What is the value of (-11)/(-21) - (12/16 + (-650)/600)? 6/7 5 + (1 - (8 + -7)) - 8 -3 What is ((-10)/(-6))/(39 - 236/6)? -5 Evaluate (62 - 65)/(9/30). -10 (-13)/((100/(-250))/(4/50)) 13/5 16/88 + 10965/495 - 15 22/3 What is (1 - -3 - 4)/(-1) + 45/30? 3/2 Evaluate ((-244)/8296)/(21/(-6) - -3). 1/17 What is (-55)/(154/14)(-1 + (-3)/(-15))? 4 Calculate 1 - (-6)/(-9) - ((-240)/(-18))/(-5). 3 -531/(527/(-51)) 15 Evaluate (0/((-420)/(-14)))/1. 0 Evaluate -10 + (-7 - -43) - (4 + 0). 22 (15/(-1890)7)/(-4 - 93/(-24)) 4/9 (51 + (-606)/12)/((-19)/2 + 2) -1/15 What is the value of 2/18(-23 + 474/21)? -1/21 Evaluate (1/3 - (-40)/(-24))/(2/(-21)). 14 7 + 51 + -2 + -20 36 Evaluate 5(-6)/60(-1)/2. 1/4 What is the value of (40/12)/(6/(-54)(5 - 14))? 10/3 What is 92/4(88 + -89)? -23 83/(5312/320) + (-137)/27 -2/27 Evaluate 3 + -7 - (-4 - 126/(-18)). -7 What is the value of 144256/(-45080) - (-1 + (-837)/385)? -2/77 What is 406/(-174)360/(-35)? 24 Evaluate -316/(-360)(-9)/(-2). 3/5 What is (7/(-3))/(70/210)? -7 (5/5)/(-1)(-7)/(42/(-13)) -13/6 What is the value of 16/786/(-8) + (-6432)/3484? -2 Calculate ((-32)/(-168))/(48/224). 8/9 ((-84)/(-63))/((32/108)/(-4)) -18 (6(-14)/(-84) - 0)/(-2) -1/2 1(((-570)/(-80))/(-19))/3 -1/8 What is the value of (-9 - (3 + -14))(-44)/48? -11/6 (-13)/(208/32)(-18)/(-2) -18 What is the value of (-30)/(-250) - 6831/675? -10 (15/(-30))/(-15/6) 3/5 (528/616)/(20/(-7)) -3/10 Evaluate 4/((-8360)/300 + 28). 30 What is the value of (-1)/(3/(-12)) - (244 + -252)? 12 15(102/21 - 5)/((-12)/28) 5 What is 258/18 + -11 + (24/9 - 3)? 3 Calculate (-1744)/(-80) + -13 + -7. 9/5 What is (1406/(-228) - -6)/(2/(-6))? 1/2 Calculate (4/(-5) + (-4200)/(-5125))345/(-138). -2/41 -5 + (-918)/(-36) + -18 5/2 What is 42(2 + 4/(-3) + -1)? -14 Calculate 7/(-11)(47 - (-3972)/(-84)). 2/11 What is ((530176/(-96))/109)/(8/(-6))? 38 ((-315)/(-30) + -8)(-544)/(-765) 16/9 Calculate (-86)/(-1075) - (-84)/(-425). -2/17 What is 27/(-30)1536/(-576) - 2/(-10)? 13/5 What is (-2)/21 + (54/630)/(63/40)? -2/49 20/33 + 65/(-195) 3/11 What is the value of ((-12)/22 - 49/11) + 3? -2 What is the value of (-3 - -28)(9 - (-9 - -17))? 25 What is (-40)/(-13125)7123/48? 2/125 Calculate -1((-440)/(-30))/(4/3). -11 Calculate (1 - -2) + 2 + (-99)/(-5 - 6). 14 What is 15/3(-608)/(-266) + -10? 10/7 -39(-5 + (-1917)/(-351)) -18 Calculate 8/30 - 394/1182. -1/15 Calculate (-24(-11)/220)/(11/110). 12 Calculate 24/21 - (-885)/(-413). -1 Calculate 188/24 - 13. -7 What is ((-288)/800)/(((-192)/40)/(-8))? -3/5 What is ((-3978)/198 - -18) + 18/9? -1/11 Calculate ((-40)/(-4))/(-1) + -2 - 1566/(-132). -3/22 Calculate (-25)/(700/8) + 34/70. 1/5 What is ((-1)/(-2))/(6 + -7) + (-10)/(-35)? -3/14 What is -6 + -2 - ((-412)/1133 - (-2195)/(-286))? 1/26 Evaluate 102/85 + 22/(-5) - -2. -6/5 What is ((-60)/(-225)(-12)/(-296))/((-2)/(-10))? 2/37 Calculate (-2)/5(295/420 - (-9)/(-54)). -3/14 What is (3/3 - -3) + -19 + 12? -3 What is the value of (-3532)/928 + 4 - 2/16? 2/29 Evaluate (-1946)/(-81) - (-1576)/(-63828). 24 What is (-1001)/(-21)150/550? 13 Evaluate (308/(-2156))/((-1)/(-7)). -1 -7 - 0 - 4/107597/(-428) 1/10 What is the value of 109/209 + 2688/(-17024)? 4/11 Calculate 1-6 + (-10 - (-14752)/928). -3/29 Calculate -5(21/5 - 3) - (4 - 2). -8 What is the value of (-152)/(-9) + ((-186)/(-54))/31? 17 Calculate 9860/414126/25. 2/35 Evaluate (-25)/(-225) - ((-545)/(-45) + 3). -15 7 + -6 + -25 + 8 + (4 - 8) -20 What is 18/(-24)(0 + -2)4/(-63)? -2/21 Calculate (-130)/(-715)(-2640)/(-15). 32 Calculate (-14 - -26)/12 + 4 + 2. 7 Calculate ((-73)/(86870/(-102)))/((-6)/5). -1/14 Evaluate 284/710 + 0 + (-249)/(-15). 17 What is ((-154)/(-3465))/((-3)/27)? -2/5 Evaluate ((-410)/(-123))/2-9. -15 Calculate 9384/7395 + 84/(-70). 2/29 -122(395 + -394) -24 What is the value of 2274/174 - (-16)/(-232)1? 13 Evaluate ((-2)/360/120)/((-7)/(-189)). -9 Evaluate 56/(-70) + (232/10)/(-4) + 7. 2/5 What is the value of 25631/8664 + (-40)/12? -3/8 What is (-19749)/(-34958) + (-3)/22? 3/7 Calculate -7 + 275/15 + -18 + 80/10. 4/3 Calculate (-10640)/(-111720)(10/3 - 1). 2/9 What is ((-6)/10)/((51/75)/(-17))? 15 Evaluate ((-300)/(-51))/(-1) + (-8)/68. -6 What is the value of 15/(-4)(27 + -17 + -1 + -8)? -15/4 -1 - 19 - (-178)/9 -2/9 Calculate 0 - ((-352)/60 + 6). -2/15 Evaluate (-16)/7867/268. -2/39 What is (-7)/(5 - 1/(-2) - 10/2)? -14 Evaluate (-57)/(-33)-2 + 4 + (-189)/(-77). 3 (-9)/(-6)4 + 37 + (-20 - 3) 20 Calculate (-66)/(-8)-106(-188)/4982. 33 (-12)/22 + (-2378)/2255 -8/5 6/(-33) + 34	{ "pile_set_name": "DM Mathematics" }
the units digit of 90238? 8 What is the ten thousands digit of 25770? 2 What is the tens digit of 44459? 5 What is the thousands digit of 15549? 5 What is the hundreds digit of 48717? 7 What is the units digit of 6513? 3 What is the thousands digit of 3113? 3 What is the tens digit of 17506? 0 What is the units digit of 825? 5 What is the hundreds digit of 21254? 2 What is the units digit of 1668? 8 What is the tens digit of 36984? 8 What is the units digit of 3387? 7 What is the units digit of 2778? 8 What is the hundreds digit of 4965? 9 What is the ten thousands digit of 22871? 2 What is the tens digit of 4361? 6 What is the thousands digit of 7107? 7 What is the thousands digit of 7177? 7 What is the ten thousands digit of 29195? 2 What is the hundreds digit of 1270? 2 What is the tens digit of 21563? 6 What is the units digit of 10737? 7 What is the tens digit of 414? 1 What is the ten thousands digit of 84409? 8 What is the units digit of 17460? 0 What is the thousands digit of 2874? 2 What is the thousands digit of 4247? 4 What is the hundreds digit of 1421? 4 What is the units digit of 1541? 1 What is the ten thousands digit of 68599? 6 What is the units digit of 78? 8 What is the units digit of 18584? 4 What is the units digit of 325? 5 What is the units digit of 1355? 5 What is the ten thousands digit of 14135? 1 What is the hundreds digit of 1919? 9 What is the units digit of 2483? 3 What is the units digit of 431? 1 What is the units digit of 1760? 0 What is the thousands digit of 3773? 3 What is the hundreds digit of 164563? 5 What is the thousands digit of 4138? 4 What is the tens digit of 604? 0 What is the tens digit of 1449? 4 What is the units digit of 142331? 1 What is the thousands digit of 27324? 7 What is the tens digit of 675? 7 What is the units digit of 1089? 9 What is the units digit of 7834? 4 What is the units digit of 1717? 7 What is the hundreds digit of 1119? 1 What is the tens digit of 675? 7 What is the thousands digit of 12128? 2 What is the tens digit of 531? 3 What is the ten thousands digit of 50517? 5 What is the hundreds digit of 2294? 2 What is the units digit of 715? 5 What is the hundreds digit of 4967? 9 What is the tens digit of 301? 0 What is the hundreds digit of 1915? 9 What is the units digit of 805? 5 What is the hundreds digit of 2651? 6 What is the tens digit of 1277? 7 What is the units digit of 9721? 1 What is the thousands digit of 2368? 2 What is the units digit of 2757? 7 What is the tens digit of 5141? 4 What is the ten thousands digit of 23826? 2 What is the tens digit of 29199? 9 What is the ten thousands digit of 49028? 4 What is the ten thousands digit of 108812? 0 What is the hundreds digit of 2625? 6 What is the units digit of 254? 4 What is the tens digit of 84768? 6 What is the units digit of 4776? 6 What is the thousands digit of 17293? 7 What is the hundreds digit of 5360? 3 What is the thousands digit of 33593? 3 What is the units digit of 40258? 8 What is the tens digit of 1076? 7 What is the thousands digit of 12866? 2 What is the thousands digit of 18602? 8 What is the units digit of 11856? 6 What is the thousands digit of 15562? 5 What is the hundreds digit of 12672? 6 What is the tens digit of 38483? 8 What is the units digit of 1318? 8 What is the thousands digit of 190494? 0 What is the thousands digit of 13919? 3 What is the units digit of 1952? 2 What is the tens digit of 2474? 7 What is the units digit of 46300? 0 What is the tens digit of 38406? 0 What is the hundreds digit of 8027? 0 What is the tens digit of 33800? 0 What is the hundreds digit of 3088? 0 What is the hundreds digit of 2108? 1 What is the ten thousands digit of 69920? 6 What is the units digit of 23? 3 What is the ten thousands digit of 21505? 2 What is the tens digit of 47353? 5 What is the tens digit of 1196? 9 What is the hundreds digit of 4691? 6 What is the tens digit of 2773? 7 What is the tens digit of 10129? 2 What is the hundreds digit of 7622? 6 What is the units digit of 1142? 2 What is the units digit of 8811? 1 What is the tens digit of 30523? 2 What is the hundreds digit of 34415? 4 What is the thousands digit of 4089? 4 What is the tens digit of 8120? 2 What is the tens digit of 9219? 1 What is the ten thousands digit of 16078? 1 What is the units digit of 3665? 5 What is the tens digit of 4328? 2 What is the units digit of 1168? 8 What is the ten thousands digit of 97116? 9 What is the ten thousands digit of 11282? 1 What is the units digit of 1649? 9 What is the thousands digit of 23157? 3 What is the thousands digit of 1693? 1 What is the hundreds digit of 1599? 5 What is the thousands digit of 7933? 7 What is the units digit of 12443? 3 What is the tens digit of 5722? 2 What is the ten thousands digit of 54219? 5 What is the tens digit of 85155? 5 What is the units digit of 162? 2 What is the units digit of 1103? 3 What is the thousands digit of 59798? 9 What is the tens digit of 746? 4 What is the thousands digit of 150487? 0 What is the hundreds digit of 6649? 6 What is the tens digit of 1786? 8 What is the units digit of 3402? 2 What is the units digit of 218? 8 What is the thousands digit of 1888? 1 What is the ten thousands digit of 42927? 4 What is the thousands digit of 37274? 7 What is the hundreds digit of 689? 6 What is the hundreds digit of 3933? 9 What is the hundreds digit of 5384? 3 What is the hundreds digit of 87950? 9 What is the tens digit of 45115? 1 What is the tens digit of 88246? 4 What is the hundreds digit of 889? 8 What is the hundreds digit of 44775? 7 What is the thousands digit of 1285? 1 What is the units digit of 93? 3 What is the units digit of 7238? 8 What is the units digit of 3750? 0 What is the hundreds digit of 528? 5 What is the units digit of 5312? 2 What is the tens digit of 1135? 3 What is the tens digit of 680? 8 What is the hundreds digit of 6860? 8 What is the thousands digit of 5924? 5 What is the ten thousands digit of 28785? 2 What is the units digit of 7279? 9 What is the units digit of 1710? 0 What is the hundreds digit of 75751? 7 What is the hundreds digit of 874? 8 What is the ten thousands digit of 151753? 5 What is the hundreds digit of 1327? 3 What is the tens digit of 50773? 7 What is the thousands digit of 2897? 2 What is the thousands digit of 3152? 3 What is the hundreds digit of 11005? 0 What is the hundreds digit of 28952? 9 What is the units digit of 4554? 4 What is the units digit of 70451? 1 What is the thousands digit of 71102? 1 What is the thousands digit of 36254? 6 What is the tens digit of 134? 3 What is the tens digit of 112069? 6 What is the ten thousands digit of 10984? 1 What is the tens digit of 1066? 6 What is the hundreds digit of 2358? 3 What is the hundreds digit of 82915? 9 What is the units digit of 1573? 3 What is the ten thousands digit of 36598? 3 What is the hundreds digit of 6076? 0 What is the thousands digit of 2635? 2 What is the hundreds digit of 16706? 7 What is the tens digit of 2538? 3 What is the hundreds digit of 52883? 8 What is the tens digit of 764? 6 What is the units digit of 694? 4 What is the tens digit of 92? 9 What is the thousands digit of 6199? 6 What is the ten thousands digit of 25636? 2 What is the hundreds digit of 144132? 1 What is the thousands digit of 36157? 6 What is the tens digit of 1652? 5 What is the hundreds digit of 2023? 0 What is the thousands digit of 37327? 7 What is the thousands digit of 32353? 2 What is the units digit of 153886? 6 What is the tens digit of 742? 4 What is the units digit of 2413? 3 What is the thousands digit of 1316? 1 What is the units digit of 10236? 6 What is the hundreds digit of 6334? 3 What is the ten thousands digit of 15553? 1 What is the thousands digit of 1419? 1 What is the units digit of 10491? 1 What is the tens digit of 1606? 0 What is the tens digit of 2717? 1 What is the hundreds digit of 1709? 7 What is the thousands digit of 30376? 0 What is the units digit of 10865? 5 What is the hundreds digit of 363? 3 What is the hundreds digit of 914? 9 What is the tens digit of 962? 6 What is the units digit of 4812? 2 What is the thousands digit of 1737? 1 What is the tens digit of 14273? 7 What is the tens digit of 1396? 9 W	{ "pile_set_name": "DM Mathematics" }
n divisor of v and 1. 1 Let j be (272/(-56))/(2/(-14)). Calculate the highest common factor of 2 and j. 2 Suppose 4p = -2p + 126. What is the greatest common divisor of p and 483? 21 Let b be (12/10)/((-12)/(-160)). Calculate the greatest common factor of b and 304. 16 Suppose 51h + 7943 = 64h. What is the highest common divisor of 13 and h? 13 Let b(j) = 41j + 780. Let n be b(-19). What is the greatest common divisor of n and 3? 1 Suppose -27x + 95x = -1360. Let b(t) = t2 + t + 5. Let y be b(-6). Let g = x + y. What is the highest common factor of 75 and g? 15 Let u be 1 + (0 - (-2 - -30)). Let w = u - -76. Calculate the greatest common divisor of w and 7. 7 Suppose -4a - 864 = -g, 4g - 2g + 225 = -a. Let h = -67 - a. What is the highest common factor of 15 and h? 15 Let n be 4/26 + (3 - (-17850)/78). What is the highest common factor of 12 and n? 4 Let j = 77 + -19. Let z = j - -6. What is the highest common factor of z and 32? 32 Suppose 4z = y + 5510 + 2000, y - 3758 = -2z. What is the greatest common divisor of z and 6? 6 Let b be -4 + 1 - (-3 - -2)7. Suppose -bi + 4w = -104, -4w - 11 = 3i - 54. What is the highest common divisor of 147 and i? 21 Suppose -923p + 920p + 480 = 0. Calculate the highest common factor of p and 40. 40 Let f be (-2 - 7)220/(-30). What is the highest common divisor of f and 6? 6 Let z = 573 + -555. What is the greatest common divisor of 126 and z? 18 Let a(b) be the second derivative of 3b3/2 + 16b*2 + 12b. Let q be a(5). What is the highest common factor of 7 and q? 7 Suppose z - 11 = -k, -9 = z + 5k - 4. Calculate the greatest common divisor of 25 and z. 5 Let b be ((-1)/(-3))/((-1)/(-21)). Suppose 58 = -0f + 2f. Let r = 36 - f. Calculate the highest common divisor of b and r. 7 Let k be ((-816)/120)/((-3)/105). Suppose 2a = a + 34. What is the greatest common factor of k and a? 34 Let m be (-7 + 1 - -2)4. Let y = m - -8. Let f(h) = -h3 - 8h*2 - h + 4. Let i be f(y). What is the highest common divisor of i and 18? 6 Suppose -3x + 5z + 162 = 0, 2x + 4z - 13 = 95. Calculate the greatest common factor of x and 1944. 54 Suppose -y + 11 = g + 5, -4g - 2y + 16 = 0. Let t be -2 - (26 + 2)/g. Let w = t - -22. What is the highest common factor of 3 and w? 3 Suppose -3d + 8d - 30 = 0. Suppose -a + da = 4v - 155, 0 = -2v + 5a + 75. Calculate the greatest common factor of 10 and v. 10 Let r = -14 - -21. Suppose 3 = k + 3s + 8, 2s = 3k - r. Let x be ((-12)/8)/((-9)/30). Calculate the highest common factor of k and x. 1 Let h(k) = -k*3 + 4k*2 - 4k + 6. Let z be h(2). Calculate the highest common divisor of 4 and z. 2 Let u = 4 - 2. Let k = 42 - u. Let l be (-30)/k(1 + -57). Calculate the highest common divisor of l and 28. 14 Let u(b) be the second derivative of b4/12 + 5b*3/6 - 4b*2 + 33b. Let a be u(-7). Calculate the greatest common factor of a and 114. 6 Let l be 338 + -2 - 696/58. What is the greatest common factor of l and 288? 36 Let n(y) = -19y + 38. Let t be n(1). Calculate the highest common factor of t and 2. 1 Let j be (-10)/(-15) + 16/3. Suppose 2q = -r + 35, -5q + 2q - 5r + 49 = 0. What is the greatest common factor of q and j? 6 Let h = -12 + 12. Suppose -105 = -3k - 3b, hb + 15 = 3b. Suppose 5d + k - 80 = 0. What is the highest common divisor of d and 15? 5 Let z be (1/2)/(1/(-124)). Let g = 46 + -82. Let o = g - z. What is the highest common factor of 65 and o? 13 Suppose -3c + 8 = -85. What is the greatest common divisor of c and 124? 31 Suppose 20p = 17p + 99. Calculate the highest common divisor of 429 and p. 33 Let c be (-1)/((-4)/(4 + 88)). Suppose -157 = -3k + c. What is the greatest common factor of 15 and k? 15 Suppose -15c + 770 = -4c. Let n(k) = 4k3 - 2k - 1. Let z be n(-1). Let p be (-2)/z - (-168)/18. What is the greatest common factor of p and c? 10 Let z(q) = -3q3 + 17q*2 + 4q + 29. Let c be z(6). What is the greatest common factor of 833 and c? 17 Suppose 5d - 915 = -5x + 1180, x - d = 421. What is the highest common divisor of x and 56? 28 Let k(p) = 4p + 22. Let i = 19 + -19. Let b be k(i). What is the greatest common factor of 88 and b? 22 Suppose 0 = 5w - 3r - 3230, 0 = -2w - 82r + 77r + 1323. Calculate the greatest common factor of w and 33. 11 Let h = 37 - 25. Suppose -10r = -hr + 70. Suppose 0f - f - 3g + 1 = 0, 0 = -5f - 5g + r. What is the greatest common factor of f and 2? 2 Let c = 496 + -456. Calculate the greatest common factor of c and 10. 10 Suppose -17j - f = -21j + 756, 567 = 3j + 5f. Calculate the greatest common factor of j and 1197. 63 Suppose -14h - 878 = -3g - 16h, 3g + h = 883. Calculate the highest common factor of 16 and g. 8 Let u(v) = 9v3 - 5v*2 + 6v - 7. Let b be u(4). Calculate the highest common factor of 57 and b. 57 Let q(i) = 27i2 + 2. Let b be q(2). Let z be (4 - -16)/(0 + 1 + 1). What is the greatest common factor of b and z? 10 Suppose 3j = 4o + 711 - 219, -15 = 5o. Calculate the highest common divisor of 10 and j. 10 Let a(f) = 7f2 - 2f - 1. Let h be a(-1). Let s = -14 + 16. Suppose -10o + s = -9o. Calculate the highest common factor of o and h. 2 Suppose 190 = 4k + 34. Let v(h) = h3 - 9h*2 + 10h + 10. Let o be v(8). Calculate the highest common factor of o and k. 13 Suppose 3f - 11 - 4 = 0. Let o be 28 - 6/(-12)-10 - -2. What is the highest common factor of o and f? 5 Let z(q) = -40q - 190. Let v be z(-6). Calculate the greatest common divisor of v and 380. 10 Suppose -5l + 2l = -117. Suppose 0 = 5h - 244 - 16. Let z be (-3 - -2)/((-2)/h). What is the highest common divisor of l and z? 13 Let v = 1476 - 1411. Calculate the highest common divisor of 455 and v. 65 Let f(t) = -t + 4. Let m be f(0). Suppose mo - 529 = 1167. Suppose 0 = 3u - o + 61. Calculate the greatest common factor of 11 and u. 11 Let t be ((-240)/56)/10 - 1238/(-14). What is the greatest common factor of t and 11? 11 Let i(u) = -u*3 - 5u*2 + 2u - 12. Suppose 0 = 3h - 0h + 3b + 30, 2b = -3h - 26. Let z be i(h). Calculate the greatest common divisor of 4 and z. 4 Let q = 2 + 2. Suppose -4z = 4a - 32, -a = z + qz - 8. Let k(b) = b*2 + 15b - 98. Let h be k(-22). What is the greatest common factor of h and a? 8 Let c(y) = 2y2 - 64y + 111. Let b be c(32). What is the highest common factor of 4551 and b? 111 Let y = 39 + -35. Let d be 3 + (y - -10) - 3. Calculate the greatest common divisor of 70 and d. 14 Let k(m) = 35m - 470. Let t be k(14). What is the greatest common factor of t and 68? 4 Suppose 0 = 8f - 3f - 20. Calculate the highest common divisor of 236 and f. 4 Let x be (1-5)/(((-104)/(-304))/(-13)). What is the highest common divisor of 10 and x? 10 Let z be -4((-1710)/(-40))/(-9). What is the highest common divisor of 95 and z? 19 Let v(r) = -3r + 15. Let x(b) = -3b + 14. Let i(j) = -2v(j) + 3x(j). Let h be i(-6). Calculate the greatest common factor of 45 and h. 15 Let q be (16/(-8))/(12/14)15. Let d be 1/((-146)/(-462) - (-10)/q). What is the highest common divisor of d and 11? 11 Suppose -2n - 12 = -42. What is the greatest common factor of 60 and n? 15 Let t(j) = 2j*2 - 88j + 36. Let o be t(46). What is the highest common divisor of o and 132? 44 Suppose 3b + h = 604, -4h = -3b + 649 - 35. Let w(m) = m + 2. Let n be w(6). Suppose -2j + b = -n. What is the highest common factor of j and 15? 15 Let g = 1190 - 935. What is the highest common factor of 17 and g? 17 Let x be 12/(-10)(-36 - -6). Let o(u) = -u3 - 3u2 + u. Let i be o(-4). Calculate the highest common factor of x and i. 12 Let v(m) = -m2 - 15m - 8. Let b be v(-14). Suppose -2d - a + 17 = 0, -3d + 25 = -0a + 2a. Calculate the highest common factor of d and b. 3 Let q be (1 + 7)/((-14)/(-49)). Suppose -c - 25 + 277 = 0. Calculate the greatest common factor of c and q. 28 Suppose -2n + 54 - 316 = 3d, -3d - 274 = -n. Let q be (-2 + 6/(-9))/(3/d). What is the greatest common divisor of 16 and q? 16 Let x = 711 - 555. What is the highest common divisor of 520 and x? 52 Let a = 113 - 90. Let j = a + -3. Let v(h) = h*3 - 5h*2 - 4h - 2. Let q be v(6). Calculate the highest common divisor of q and j. 10 Suppose 3c - 8i = -5*i + 23	{ "pile_set_name": "DM Mathematics" }
e prime factors of (-1)/k(-12)/3? 2 Suppose 0 = x - 31 + 8. Suppose -a - x = 2h, 0h - 4a = 5h + 59. What are the prime factors of (79/1)/(h + 12)? 79 Let w(n) = -14n - 19. Let b be w(-2). Let u(z) = z*2 + 3z + 60. List the prime factors of u(b). 2, 3, 7 Suppose 4373n - 4431n + 618918 = 0. What are the prime factors of n? 3, 3557 Suppose 8o + 232 = -728. List the prime factors of (342/(-27))/(3 + 362/o). 2, 5, 19 Suppose -i - 30 = 5u - 18, 5u = -4i - 3. Suppose 2q = -4h - 124, -q = -h - h + 54. List the prime factors of -1 + 5 - ((-1 - u) + q). 2, 3, 5 Let f(o) = -3o2 - 22o - 13. Let m be f(11). Let d = m + 911. List the prime factors of d. 293 Let j(t) = t*3 - 7t*2 - 4t - 25. Let o be j(8). Suppose -ob + 1435 = -3731. What are the prime factors of b? 2, 3, 41 Suppose -83087 = -16k + 27265. List the prime factors of k. 3, 11, 19 Suppose 5f = 7f - 152. Let n = f + -28. Let d = n + -17. List the prime factors of d. 31 Let l(n) = 62n2 - 59n + 584. What are the prime factors of l(10)? 2, 19, 163 Let m(i) = -i*3 - 11i*2 - 21i - 13. Let u be m(-9). Suppose -uy + 8y + 3186 = 0. List the prime factors of y. 3, 59 Let o = 53027 - 34075. Let v be o/40 + (-2 - (-11)/5). Suppose v + 247 = 7z. What are the prime factors of z? 103 Let k = 59893 - 25443. List the prime factors of k. 2, 5, 13, 53 Let i(u) = -3u*2 - 12u + 2. Suppose 8v = 4v - 24. Let t be i(v). Let w = t - -65. What are the prime factors of w? 31 Let f = 16466 - 7277. List the prime factors of f. 3, 1021 Suppose 4t + 0t = 4120. Suppose 9h = 4h + t. What are the prime factors of h? 2, 103 Suppose -87 = t - 92. Suppose 1470 = tc + 5v, c + c - v = 576. What are the prime factors of c? 2, 5, 29 Let n = -30309 + 80971. What are the prime factors of n? 2, 73, 347 Let n(b) = 375b - 97. Let l be n(13). Suppose -29 - l = -11k. What are the prime factors of k? 19, 23 Suppose 4u - 8u = -20. Let f be (-16)/(-2) + u + -8. Suppose q - fi = -0i + 86, -5q + 2i = -476. What are the prime factors of q? 2, 3 Suppose i + 26w - 6226 = 30w, -6218 = -i + 2w. List the prime factors of i. 2, 3, 5, 23 Suppose 0 = 2w - 4s - 18, -4w = -w - 4s - 17. What are the prime factors of w + (-12)/(-21) + 3706/7? 23 Suppose -m - 5r = -0m, 0 = -2m + 5r. Suppose 6h + 0h - 30 = m. Suppose hy - 3n = 66, -16 = 5y - 7y - 4n. List the prime factors of y. 2, 3 Suppose 281 = -4j + 101. Let r be 2/(-20)-2 + (-2016)/j. Let c = 77 - r. List the prime factors of c. 2 Let d be (-1)/(-11/6). What are the prime factors of ((-9)/d)/(6/(-2872))? 2, 359 Let j(r) be the first derivative of -3r - 24 + 1 + 13r2 + 15r*2. What are the prime factors of j(2)? 109 Let q(z) = -21z3 + z2 + 5z + 22. Let s be q(-8). Suppose 29d - 2832 = s. What are the prime factors of d? 2, 5, 47 Let k(g) = -8g2 + 315g - 387. Let v be k(38). Let j(a) = -3a3 + 3a*2 + a + 4. Let z be j(-3). Let i = v + z. What are the prime factors of i? 2, 5, 7 Let g = 9 + -67. Let l = 58 + g. Suppose -d = d + k - 231, -4d - k + 467 = l. List the prime factors of d. 2, 59 Suppose -2k = -16k + 280. Suppose 18p = kp + 4i - 670, 0 = 4p - 5i - 1301. What are the prime factors of p? 7, 47 Let j be (-66)/44(-125 + 1). Suppose -j + 29 = -b. What are the prime factors of b? 157 Let s(z) = z*2 - 17z + 19. Let d = -18 - -34. Let a be s(d). Suppose 2p = -2x - 6, x + ap + 2p = -23. List the prime factors of x. 2 Suppose -5h + 3w + 1250 = -920, -2h = -w - 867. Suppose h + 289 = 2m. Suppose 0 = 4r + 72 - m. What are the prime factors of r? 2, 3 Suppose -2i - 109 = -3s, 2i + 187 = 6s - s. Suppose -32 = -l + 4y, 0l = l - y - 35. Suppose -309 = -so + lo. What are the prime factors of o? 103 List the prime factors of (6 + -4 + 2)/((-548344)/54836 + 10). 13709 Let p = -369 + 379. List the prime factors of 822p/105 - (-10)/(-35). 2, 3, 13 Suppose -5u + 40 = 15. Let j(y) = -2y*3 - 5y*2 + 3y + 8. Let o(m) = 3m3 + 6m*2 - 3m - 8. Let c(d) = 4j(d) + 3o(d). List the prime factors of c(u). 2, 7 Let g(s) = 10s2 - s. Let y be g(-1). Let i be 3307 + -15 + y. Suppose -4b - 249 + i = 0. What are the prime factors of b? 167 List the prime factors of (1865 - -664)/((-6)/(-4)2/8). 2, 3, 281 Let o be (-112)/((-17)/561). Let x = o - -253. Suppose -8w = -x - 935. List the prime factors of w. 2, 3, 11 Suppose -1355264 = -81w - 395495. What are the prime factors of w? 17, 41 Suppose 0 = -5h - 20, 0 = 3c - 19h + 21h + 5. List the prime factors of ((-4)/(-8))/(c/334). 167 Let v(q) = -94q + 7402. What are the prime factors of v(0)? 2, 3701 Let i(p) = p*2 - 9p + 10. Let w be i(8). Suppose 0 = 21h - 34h + 3783. Suppose -h = -2j - wj - 3g, -5g = -2j + 113. What are the prime factors of j? 3, 23 Suppose 0 = 113g - 111g - 7594. What are the prime factors of g? 3797 Let a(i) be the third derivative of -53i*4/6 - 27i*3 - 94i*2 - 1. List the prime factors of a(-5). 2, 449 Let a(i) = -15i*3 + 16 - 2i + 16i3 + 12i*2 - 2i*2. What are the prime factors of a(-7)? 3, 59 Let k = 67 + -91. Let g = 29 + k. Suppose -gr = 2t - 273, 8r = 5r - 3t + 171. What are the prime factors of r? 53 Let p = -58 - -155. Suppose 3u - 3a - p - 1526 = 0, -4a - 541 = -u. List the prime factors of u. 541 Let w be (11 - 23)(1 + (-82)/8). Let v = 271 - w. What are the prime factors of v? 2, 5 Let r(x) = x*3 + 8x*2 + 17x + 13. Let d be r(-12). Let h = d + 1109. List the prime factors of h. 2, 3, 19 Suppose -5g + 4p = -g, -4p = 5g - 45. Suppose gn - 1144 = -3a + 1903, 2n = -3a + 1217. What are the prime factors of n? 2, 5, 61 Let q be (-3)/27 - 614/(-18). Let h = q + -22. Let i(z) = z*3 - 10z*2 - 16z - 16. What are the prime factors of i(h)? 2, 5 Let b(w) = 3w2 + 2w - 6. Let p be 4/((-8)/(-6))1. Suppose -pl = 5v + 22, -2l + 0l - 2v - 12 = 0. List the prime factors of b(l). 2, 17 Suppose 0 = 77j - 87023 - 28246. What are the prime factors of j? 3, 499 Suppose -8 = -5g + 7. Suppose f - 4w - 87 = -2w, 2f - 160 = -gw. Suppose -543 = -10i - f. What are the prime factors of i? 2, 23 Let h = -4695 - -2931. Let q = -890 - h. List the prime factors of q. 2, 19, 23 Let g(t) = -8t*3 - 3t + 1. Let b be g(2). Let s = -1 + b. List the prime factors of 66/7s/(-15). 2, 11 Let n(x) = 41x*2 - 52x - 362. What are the prime factors of n(-21)? 13, 1447 Suppose -18s - 685 = 215. Let z = -5 - s. What are the prime factors of z? 3, 5 Let c(g) = g3 - 8g*2 + 4g + 6. Suppose -6r + 72 = -0r. Let k be 7 + (1/3 - (-8)/r). List the prime factors of c(k). 2, 19 Suppose 0 = 4x - p - 45280, 10x + 4p = 11x - 11320. Suppose -x = 7r - 15r. What are the prime factors of r? 5, 283 Let o be 9/(-45) + (-11)/(-5) + 2. Let f(q) = 4q3 - 2q*2 - 7q - 7. List the prime factors of f(o). 3, 7 List the prime factors of (-5720)/(-208)2512/10. 2, 11, 157 List the prime factors of ((-84)/(-112)-4)/((-1)/19806). 2, 3, 3301 Let w(h) = h + 13. Let a be w(-10). Suppose u - 4 = -a. Let x(n) = 122n - 2. What are the prime factors of x(u)? 2, 3, 5 Let r(b) = b2 + 6b - 45. Let o be r(-11). Let h(u) = u*3 - 8u*2 + 44u + 8. List the prime factors of h(o). 2, 3 Suppose -2t - 6 = 0, 3t + 46 = o - 285. Suppose 4l - o - 302 = 0. Let v = -40 + l. List the prime factors of v. 2, 29 Let k(v) = 46v + 2. Let u be k(1). Let b be (6/(-8))/((-4)/u). Let g(p) = -p*3 + 10p*2 - 6p - 7. List the prime factors of g(b). 2, 5 List the prime factors of 28968/(-476)(-112 - (1 - 1)). 2, 3, 71 List the prime factors of (-2155 + 16194)/(1(1 - 0)). 101, 139 Suppose 4o + 4719 = 255. Let t = 465 - o. Suppose -t - 183 = -7i. List the prime factors of i. 2, 3, 7 Suppose -5k + 2z + 164053 = 0, 26z = 28z + 8. What are the prime factors of k? 7, 43, 109 Let c(n) = -9n2 - 92n - 15. Let k be c(-10). Suppose -ku + 1352 = 797. List the prime factors of u. 3, 37 Suppose -2y = o - 1553, 32o = 2y + 27o - 1547. Suppose -2b - 4 = 0, -4v + 5b = b - y. List the prime factors of v. 2, 3 Suppose 3w + 0 + 8 = -5j, 2j = w - 12. Suppose -2h + 3x = -546, -wx = 3h - 6h + 820. What are the prime factors of h? 2, 3, 23 Let z(p) be the third derivative of p*5/120 + 11p*4/8 + 2p*3/3 + 8p*	{ "pile_set_name": "DM Mathematics" }
g order. 19/6, 1/4, -0.16, -0.4 Sort -13/11, 4, -5.1, -3/4, 1. -5.1, -13/11, -3/4, 1, 4 Sort 5, -2/643, 11, -1. -1, -2/643, 5, 11 Put 3/11, -1093, 3 in increasing order. -1093, 3/11, 3 Sort 3, -287, -2/13137 in ascending order. -287, -2/13137, 3 Sort -8, -1, 5, 159. -8, -1, 5, 159 Sort -11, -2, 5, 3, 224 in increasing order. -11, -2, 3, 5, 224 Put 1417898, 2, -0.1 in decreasing order. 1417898, 2, -0.1 Put 96, 50, -8 in decreasing order. 96, 50, -8 Sort -5, 3, 5, -3, 113, -4 in descending order. 113, 5, 3, -3, -4, -5 Sort 3, -13616, 1/6 in descending order. 3, 1/6, -13616 Put 0, -7, 110, -40 in increasing order. -40, -7, 0, 110 Sort -25, -1, 110 in decreasing order. 110, -1, -25 Put 2, -22, 581 in increasing order. -22, 2, 581 Sort -5/413, -4, 5, 0.4 in ascending order. -4, -5/413, 0.4, 5 Sort -5, -3, -2088, -30 in decreasing order. -3, -5, -30, -2088 Sort -2, -5, 2, 13, -4, -52 in increasing order. -52, -5, -4, -2, 2, 13 Sort 11595, -3, 0, 1 in descending order. 11595, 1, 0, -3 Sort -1, -4/3, 0.16, -41, -0.077 in descending order. 0.16, -0.077, -1, -4/3, -41 Put -0.5, 19444.7, -3 in increasing order. -3, -0.5, 19444.7 Put 3679, -1, -2, 0 in decreasing order. 3679, 0, -1, -2 Sort 5, -670, -1/3, -0.4, 10 in descending order. 10, 5, -1/3, -0.4, -670 Put -34, 4, -275 in descending order. 4, -34, -275 Sort 13181, 4, -5 in decreasing order. 13181, 4, -5 Sort -4, -2, 164. -4, -2, 164 Sort 47, 1, 60 in descending order. 60, 47, 1 Sort 2113, -4, 3, 4 in increasing order. -4, 3, 4, 2113 Put -4, -11, 0.3, 4, 5, -2 in ascending order. -11, -4, -2, 0.3, 4, 5 Put 0.04, 24/17, -0.4, -20 in ascending order. -20, -0.4, 0.04, 24/17 Put 5, 26, -2379 in decreasing order. 26, 5, -2379 Put 4, -5, 0, 207/179 in ascending order. -5, 0, 207/179, 4 Put 2/7, 47, 0.3, 5, 4 in increasing order. 2/7, 0.3, 4, 5, 47 Put 5, -2, 9, -2854 in decreasing order. 9, 5, -2, -2854 Sort 4, 2, 3, -1299, 1 in ascending order. -1299, 1, 2, 3, 4 Put 4/3, -3, 3, -2.3 in decreasing order. 3, 4/3, -2.3, -3 Put -0.02, -1, -0.13, -28 in increasing order. -28, -1, -0.13, -0.02 Put -1, 91, 5, -4, -5, -18 in decreasing order. 91, 5, -1, -4, -5, -18 Sort -7, 37, -6, -3, 2. -7, -6, -3, 2, 37 Put -20, -3, 0.5, 42/13 in decreasing order. 42/13, 0.5, -3, -20 Put -2/3, -1/3, -1.95883 in ascending order. -1.95883, -2/3, -1/3 Sort -4, 55, 2, 1, -9 in descending order. 55, 2, 1, -4, -9 Sort -1, -2, -40/2659 in increasing order. -2, -1, -40/2659 Sort -5, 1, -1, -11, 48, 16 in decreasing order. 48, 16, 1, -1, -5, -11 Sort -12, -9, -5, 1, -1. -12, -9, -5, -1, 1 Put 44, -3, -21, 0, 7 in increasing order. -21, -3, 0, 7, 44 Sort 2, 307, 4, 0, -5 in decreasing order. 307, 4, 2, 0, -5 Put 0, -79, -5, -8, -2, 5 in ascending order. -79, -8, -5, -2, 0, 5 Put 0.24, 2/107, -0.2, 4, -1, -0.5 in descending order. 4, 0.24, 2/107, -0.2, -0.5, -1 Sort 1046, 13, 5 in decreasing order. 1046, 13, 5 Sort 4, -4, 1005, -5, -1. -5, -4, -1, 4, 1005 Put -0.3, -203, 3, -14 in decreasing order. 3, -0.3, -14, -203 Sort -3, -62, 2/9, -0.3, 789 in descending order. 789, 2/9, -0.3, -3, -62 Put 1399, -10, 2/15, 0.5, 0.3 in increasing order. -10, 2/15, 0.3, 0.5, 1399 Sort -5, 132, 119 in descending order. 132, 119, -5 Put 5, -15, 0.5, 9 in decreasing order. 9, 5, 0.5, -15 Sort 0.01, 1, 0.4, -0.055, -2 in decreasing order. 1, 0.4, 0.01, -0.055, -2 Sort 2, 200, -0.5, 254. -0.5, 2, 200, 254 Sort 9, -4, 4, 35, 1 in increasing order. -4, 1, 4, 9, 35 Sort 5/4, 53/5, -22, 1 in increasing order. -22, 1, 5/4, 53/5 Put 6, 1127, 1 in increasing order. 1, 6, 1127 Sort -1, -5, -12, 5. -12, -5, -1, 5 Sort -4, 1, 159, 32 in ascending order. -4, 1, 32, 159 Sort 3, -2/9, -7/11, -239, -2/3, -1 in decreasing order. 3, -2/9, -7/11, -2/3, -1, -239 Sort -0.3, -5, -3/4, 0.00642 in decreasing order. 0.00642, -0.3, -3/4, -5 Sort 588, -2, -3, 2 in ascending order. -3, -2, 2, 588 Put -384, -0.4, -0.2, 3, -5/6, -21 in ascending order. -384, -21, -5/6, -0.4, -0.2, 3 Sort 2, -930, 230 in decreasing order. 230, 2, -930 Sort -2, 0.2, -2/7, 2/3, -76, -38 in descending order. 2/3, 0.2, -2/7, -2, -38, -76 Sort 15, -3, 52. -3, 15, 52 Sort 2, -21.02, 0.5, 1/4 in decreasing order. 2, 0.5, 1/4, -21.02 Sort 2, 0, -1, -5747 in descending order. 2, 0, -1, -5747 Put 1570/9, -5, 1, 4 in descending order. 1570/9, 4, 1, -5 Put 6, 5, -419, 2, 1 in decreasing order. 6, 5, 2, 1, -419 Put 1707, -3, -8 in decreasing order. 1707, -3, -8 Put -5, 1, -3, 5, -2, -21 in ascending order. -21, -5, -3, -2, 1, 5 Put 1, 2, 11, 5, -1, -25 in decreasing order. 11, 5, 2, 1, -1, -25 Sort -17, 103, 5, -3/7 in decreasing order. 103, 5, -3/7, -17 Sort -5, 0, -47030 in descending order. 0, -5, -47030 Put -5, 31/5, 3/43, -2/5 in descending order. 31/5, 3/43, -2/5, -5 Sort 3, -2, 1/3, -3.6, 0.9, -9. -9, -3.6, -2, 1/3, 0.9, 3 Sort -5/4, -136, -0.3, -0.1, 1/9 in decreasing order. 1/9, -0.1, -0.3, -5/4, -136 Put -2, 4, 50824 in increasing order. -2, 4, 50824 Put -87, -3, 3, 2.8, -2, 4 in decreasing order. 4, 3, 2.8, -2, -3, -87 Sort 4682, 4, 5 in decreasing order. 4682, 5, 4 Sort -1, 504, 12 in decreasing order. 504, 12, -1 Put 1, 120, -26, -1 in increasing order. -26, -1, 1, 120 Sort -0.4, 1789, 3, -1/57 in increasing order. -0.4, -1/57, 3, 1789 Sort 5, -5, -1, 92 in decreasing order. 92, 5, -1, -5 Put 0, 5, -197, 3, 0.03 in decreasing order. 5, 3, 0.03, 0, -197 Sort -11, -1, 0, -627 in decreasing order. 0, -1, -11, -627 Sort -4/5, 1/4, 8, 998, 3 in decreasing order. 998, 8, 3, 1/4, -4/5 Put -2/3, -210, 2, 2/5, 11 in ascending order. -210, -2/3, 2/5, 2, 11 Put -0.25763, -9, 0.4 in increasing order. -9, -0.25763, 0.4 Sort 5, 144, 4, -36 in descending order. 144, 5, 4, -36 Sort 3, -2, -39, -5, -14 in increasing order. -39, -14, -5, -2, 3 Sort -3, -0.3, -1012, 3, -1.3. -1012, -3, -1.3, -0.3, 3 Sort -1, -3996, -21, -16 in decreasing order. -1, -16, -21, -3996 Put -5, 1, -4, 6, 69 in decreasing order. 69, 6, 1, -4, -5 Sort 0.2, -1, 2/7, 2/315, -0.01 in increasing order. -1, -0.01, 2/315, 0.2, 2/7 Put -35, -5, 7, -11, -1 in descending order. 7, -1, -5, -11, -35 Sort -2, 0, 4, -5, -4, 37. -5, -4, -2, 0, 4, 37 Sort -10, -56, -5, 38, 0. -56, -10, -5, 0, 38 Sort -75, 3/8, 70, 2/3, 3 in increasing order. -75, 3/8, 2/3, 3, 70 Sort 104, -0.15, 3, 0.16. -0.15, 0.16, 3, 104 Put 1314.4, 5, -1/4 in decreasing order. 1314.4, 5, -1/4 Put 18496, -2, -3 in descending order. 18496, -2, -3 Sort 0.3, -4, -8712 in ascending order. -8712, -4, 0.3 Sort 4.4, -597, 1/5 in ascending order. -597, 1/5, 4.4 Sort -1/3, -2.7, -2, 0, -6/13 in ascending order. -2.7, -2, -6/13, -1/3, 0 Sort -1, -3, -18337. -18337, -3, -1 Sort -1, -0.1, -8, 3, -2711 in increasing order. -2711, -8, -1, -0.1, 3 Put -1, 1, 13, -2, 1083, -4 in decreasing order. 1083, 13, 1, -1, -2, -4 Sort 0, -9250, -2 in ascending order. -9250, -2, 0 Put 5, 2/15, -181, -4 in descending order. 5, 2/15, -4, -181 Put -4, 5, -20, 4, 10 in decreasing order. 10, 5, 4, -4, -20 Put -3, -1828584, -0.2 in descending order. -0.2, -3, -1828584 Sort -4, -3, -2/179, -27027 in decreasing order. -2/179, -3, -4, -27027 Sort -31/48, -0.2, 0.4 in descending order. 0.4, -0.2, -31/48 Put -2, -5, 25, -3, -1 in decreasing order. 25, -1, -2, -3, -5 Sort -5, 461, -3/5, -1/8, -0.11. -5, -3/5, -1/8, -0.11, 461 Sort 1/4, -0.54, -204, -1/2, -2 in decreasing order. 1/4, -1/2, -0.54, -2, -204 Put 8, -3, 1041 in decreasing order. 1041, 8, -3 Put -2, -16, 303, 5, -1 in descending order. 303, 5, -1, -2, -16 Sort 1, 5689, 4, -1/2. -1/2, 1, 4, 5689 Sort -4/525, -86, 3, -4 in increasing order. -86, -4, -4/525, 3 Sort -3, -1.37, 1/4, -79, 5 in descending order. 5, 1/4, -1.37, -3, -79 Put 810, -6, 5 in ascending order. -6, 5, 810 Put 9, -5, -1, -2, -4, -25 in decreasing order. 9, -1, -2, -4, -5, -25 Put -0.5, -2/3, 7, -1/37, -2 in decreasing order. 7, -1/37, -0.5, -2/3, -2 Sort -1854, -1, 102 in descending order. 102, -1, -1854 Sort -1/10, 0, 1/9, 0.1, 67. -1/10, 0, 0.1, 1/9, 67 Sort 117, 18, 0.4, -2 in decreasing order. 117, 18, 0.4, -2 Put -3, 1, 798 in decreasing order. 798, 1, -3 Sort 8, 10, 245 in ascending order. 8, 10, 245 Put 864, 1, -2, 2 in increasing order. -2, 1, 2, 864 Sort -39, -3, -1838. -1838, -39, -3 Put -4, -2, 4, -10, 23, -5 in increasing order. -10, -5, -4, -2, 4, 23 Put 2/9, -1, -1897 in increasing	{ "pile_set_name": "DM Mathematics" }
7236246481 a prime number? True Is 37506097103 composite? False Is 143641413319 a composite number? True Is 47926709479 a prime number? False Is 51533879 a prime number? True Is 1843037611 a prime number? True Is 1893875471 prime? True Is 14057783 a composite number? False Is 45147970839 prime? False Is 824723047 a prime number? True Is 15271530891 prime? False Is 6762875569 a composite number? False Is 210965851 a prime number? True Is 575777989 a prime number? True Is 2236445045 composite? True Is 179115577 a prime number? False Is 1981107587 a composite number? True Is 61260499621 prime? True Is 4102803557 prime? True Is 487311631 a composite number? False Is 61650460279 a composite number? False Is 24636287191 a composite number? True Is 5031956539 a composite number? True Is 2754156823 a composite number? True Is 233917961 prime? True Is 2486768959 composite? True Is 23684960335 composite? True Is 18877128731 a composite number? True Is 5761662241 a prime number? False Is 102788471 a prime number? True Is 1142526067 a prime number? False Is 41721887 a composite number? True Is 2034374171 a prime number? True Is 8840157073 composite? True Is 1247358593 a prime number? False Is 3057532109 a prime number? False Is 4434933235 a composite number? True Is 9623546537 prime? False Is 70969111 a composite number? False Is 88902790378 a prime number? False Is 964570547 prime? True Is 2749880695 composite? True Is 36288650191 composite? True Is 1264205771 prime? True Is 176049409 a prime number? False Is 1370247167 prime? True Is 644191963 composite? True Is 1161373123 a prime number? True Is 3384140707 composite? False Is 12805424153 prime? False Is 118333819405 a composite number? True Is 12731460851 composite? False Is 73038812281 a prime number? True Is 2185848779 a composite number? False Is 350920489 a composite number? True Is 7603136803 composite? False Is 376676437 prime? True Is 146859269591 composite? True Is 15251078317 a prime number? True Is 34155263423 a composite number? True Is 15339711197 prime? True Is 4012781867 prime? False Is 5978230067 a composite number? False Is 2732965141 prime? True Is 17026831531 prime? False Is 444379471 prime? False Is 288443373 a prime number? False Is 55769897 a prime number? True Is 236490193 a prime number? True Is 18322252787 a prime number? True Is 11483270297 prime? True Is 92811157763 a composite number? True Is 153048677 composite? True Is 11810155661 prime? True Is 2158631999 composite? False Is 198465199 a composite number? False Is 17104283561 prime? True Is 6293291551 a composite number? False Is 2505358853 a prime number? True Is 23159662397 prime? True Is 72626405 a composite number? True Is 5617826839 a prime number? False Is 13661055049 prime? True Is 2659503097 prime? True Is 46315635451 a prime number? False Is 58958582105 a prime number? False Is 20529153031 prime? True Is 146761962023 prime? True Is 47262865133 prime? False Is 41916825409 a prime number? False Is 7169030017 a prime number? True Is 491399917 composite? False Is 360099669 a composite number? True Is 3682092599 a prime number? False Is 2276263697 composite? False Is 13078628041 a prime number? True Is 4489610471 a prime number? True Is 5455353073 composite? False Is 7719511961 prime? False Is 1371228511 composite? False Is 692188433 a prime number? True Is 268715933 prime? True Is 807838693 prime? False Is 79911827 composite? True Is 5551909907 prime? True Is 807536701 a prime number? False Is 1777110241 a prime number? True Is 7591813309 a prime number? True Is 3427026919 a prime number? False Is 27335817011 a prime number? True Is 52665827 a prime number? False Is 561484405 a prime number? False Is 10659293 a prime number? False Is 194366911 a prime number? True Is 5223393183 a composite number? True Is 1125983531 a composite number? False Is 4967685887 a composite number? True Is 11235969123 a composite number? True Is 25620251911 a prime number? False Is 2985171857 composite? True Is 4474143319 a composite number? True Is 1167459449 a prime number? False Is 71492780159 a composite number? True Is 2102201861 a composite number? True Is 766151093 composite? True Is 1182382595 a prime number? False Is 55617836821 composite? True Is 504917603 a composite number? False Is 560842201 composite? False Is 230972527 prime? True Is 7857869891 a prime number? False Is 1534527935 composite? True Is 342847787 a composite number? False Is 40169797 prime? True Is 417231301 composite? False Is 9999290729 prime? False Is 26323380341 a composite number? False Is 1136737409 composite? True Is 101004564893 composite? True Is 341954551 a composite number? True Is 94857126031 a prime number? False Is 60471140399 a composite number? False Is 3884610061 a prime number? False Is 980252927 prime? True Is 560311223 a prime number? True Is 75805031711 a prime number? True Is 3216330827 a composite number? True Is 19768930159 prime? False Is 94026997487 composite? False Is 7328287601 composite? False Is 8739763763 prime? True Is 2020677601 a prime number? True Is 710378807 a composite number? True Is 961122763 a prime number? False Is 159696671 prime? False Is 161890849513 prime? False Is 619114333 a prime number? True Is 2004138911 composite? False Is 95059679477 a composite number? True Is 5233764901 prime? True Is 39074570167 composite? False Is 3107095561 a composite number? True Is 51941275561 a composite number? True Is 1520832351 prime? False Is 119067456353 a prime number? False Is 31632105677 a composite number? False Is 406772059 a composite number? True Is 12034606231 composite? False Is 6071731153 composite? True Is 11435069813 composite? True Is 1666064083 a composite number? True Is 2293577557 prime? False Is 14878145743 a prime number? False Is 1436332165 prime? False Is 36668174 prime? False Is 10307938999 composite? True Is 998686401 a prime number? False Is 17324385913 composite? False Is 2514923333 composite? True Is 546397781 prime? False Is 514723571 a composite number? False Is 321056259 prime? False Is 171527720107 a prime number? True Is 470153407 prime? False Is 5062431967 a composite number? True Is 2094921821 a prime number? True Is 7352878417 a composite number? False Is 85403332367 a composite number? True Is 87106048411 a prime number? True Is 47199863 prime? True Is 6923907217 composite? False Is 1109466661 a composite number? True Is 3461608817 composite? False Is 5544427235 composite? True Is 1438196367 composite? True Is 520642883 prime? False Is 1098031201 prime? False Is 353563079951 a composite number? True Is 2423159093 composite? False Is 32693703641 a composite number? False Is 68611020739 composite? False Is 899729257 composite? True Is 11301722301 a composite number? True Is 1140572821 composite? False Is 3304695073 composite? False Is 5645916631 composite? True Is 1464258451 prime? True Is 144893899 a composite number? False Is 498458063 prime? False Is 14184151001 composite? True Is 6447178831 composite? False Is 2367703567 prime? False Is 10769906843 a prime number? True Is 20730060443 prime? False Is 11576783909 a composite number? True Is 51314717 a composite number? True Is 921285479 composite? False Is 2351967841 a composite number? False Is 1224585202 composite? True Is 1869427387 composite? False Is 4491625231 prime? False Is 2342697041 prime? True Is 4537111927 a composite number? True Is 12941876245 a composite number? True Is 24774623 composite? False Is 2289169823 prime? False Is 977041139 a prime number? True Is 227595307 a prime number? False Is 13637605181 a composite number? False Is 4329388157 a prime number? False Is 4049631697 prime? True Is 316168211 composite? False Is 213782264789 a composite number? True Is 1903289 composite? False Is 15214396217 prime? True Is 4384879329 prime? False Is 1839634939 composite? True Is 126258981 prime? False Is 44789984509 a composite number? False Is 19433624383 prime? False Is 3534832859 a prime number? True Is 7237995409 a prime number? True Is 1446976021 prime? True Is 7164103721 prime? True Is 9837081691 a composite number? False Is 30269237491 prime? True Is 142535381 composite? False Is 255111049 prime? False Is 140911835 a composite n	{ "pile_set_name": "DM Mathematics" }
75, 21212? 24749 What comes next: -103542, -103555, -103568, -103581, -103594, -103607? -103620 What comes next: -20986, -41975, -62964, -83953? -104942 What is the next term in 496, 517, 538? 559 What is next in -843, -3451, -7797, -13881? -21703 What comes next: -3832, -3952, -4072? -4192 What is the next term in -9766, -9795, -9842, -9907, -9990, -10091? -10210 What is next in -337, -1402, -3193, -5710, -8953, -12922, -17617? -23038 What is next in -3790, -7638, -11544, -15508, -19530, -23610? -27748 What comes next: 1854, 3709, 5564, 7419, 9274, 11129? 12984 What comes next: -1976, -1055, -134, 787, 1708, 2629? 3550 What is the next term in -96, -815, -2854, -6897, -13628, -23731, -37890, -56789? -81112 What is the next term in 65538, 65539, 65540, 65541, 65542, 65543? 65544 What is the next term in 1203622, 2407242, 3610862, 4814482, 6018102? 7221722 What is the next term in 5449, 5453, 5465, 5491, 5537, 5609, 5713, 5855? 6041 What is next in 97635, 97638, 97639, 97638? 97635 What is next in 1342, 1373, 1404, 1435, 1466, 1497? 1528 What is the next term in -10, -18, -52, -124, -246, -430? -688 What is the next term in 7108, 14208, 21308? 28408 What comes next: 21, 55, 121, 225, 373, 571, 825, 1141? 1525 What is the next term in -88987, -88990, -88993, -88996, -88999, -89002? -89005 What comes next: -128, -334, -678, -1160? -1780 What comes next: -8465, -15736, -23017, -30314, -37633? -44980 What comes next: -36, -17, 86, 315, 712, 1319, 2178, 3331? 4820 What comes next: -433007, -433008, -433011, -433016, -433023, -433032, -433043? -433056 What is the next term in -24, -27, -34, -45? -60 What is next in 669, 2718, 6153, 10980, 17205? 24834 What is next in -4592, -4686, -4772, -4844, -4896? -4922 What comes next: 103, 618, 1467, 2644, 4143, 5958, 8083? 10512 What is the next term in -218, -722, -2090, -4754, -9146, -15698, -24842, -37010? -52634 What is next in 240, 259, 288, 327, 376, 435, 504? 583 What is the next term in -109, -256, -639, -1372, -2569, -4344? -6811 What is the next term in -8066, -8218, -8370? -8522 What is next in -4343, -4384, -4449, -4538? -4651 What comes next: -13, -1372, -2731, -4090, -5449? -6808 What is the next term in 10165, 20312, 30463, 40618, 50777, 60940? 71107 What comes next: -1063, -901, -625, -241, 245? 827 What comes next: -2995, -6017, -9039, -12061, -15083? -18105 What is next in 1100, 2154, 3134, 4034, 4848, 5570, 6194, 6714? 7124 What is next in 12007, 23942, 35875, 47806? 59735 What is next in 29802, 59610, 89418, 119226, 149034, 178842? 208650 What is next in -80, -176, -282, -398, -524, -660, -806? -962 What is next in 873, 1592, 2327, 3084, 3869, 4688, 5547, 6452? 7409 What is the next term in 92478, 92477, 92476, 92475, 92474? 92473 What is the next term in -3327, -6469, -9613, -12759, -15907? -19057 What is next in -1503, -3023, -4541, -6051, -7547, -9023? -10473 What is the next term in 1929, 7692, 17295, 30738, 48021, 69144? 94107 What is next in 780, 1402, 1698, 1506, 664, -990, -3618, -7382? -12444 What comes next: -51823, -51824, -51825, -51826, -51827? -51828 What is next in 39086, 39102, 39118? 39134 What is the next term in 408, 1413, 2418, 3423, 4428? 5433 What comes next: 6098, 6096, 6102, 6122, 6162? 6228 What comes next: 116, 265, 510, 845, 1264, 1761, 2330, 2965? 3660 What is next in 97, 200, 353, 580, 905, 1352? 1945 What is next in 4026, 7886, 11746, 15606, 19466? 23326 What is the next term in 211, 1439, 4697, 10999, 21359, 36791, 58309, 86927? 123659 What comes next: -4206, -16777, -37722, -67041? -104734 What is the next term in 469845, 469846, 469847? 469848 What is next in -5279, -5246, -5199, -5138, -5063? -4974 What is next in 28, 28, 42, 76, 136, 228? 358 What is the next term in -7438, -7443, -7450, -7459, -7470? -7483 What is the next term in -236, -459, -682? -905 What is the next term in 293, 425, 559, 695, 833? 973 What is next in -6889, -27644, -62241, -110674, -172937? -249024 What comes next: -3424, -13699, -30824, -54799, -85624, -123299? -167824 What comes next: -17, -12, 27, 106, 231, 408, 643, 942? 1311 What comes next: 30494, 30495, 30496, 30497, 30498? 30499 What comes next: -1048630, -1048632, -1048634, -1048636, -1048638, -1048640? -1048642 What is next in 3344, 3358, 3394, 3464, 3580, 3754, 3998, 4324? 4744 What is the next term in 3069, 12272, 27627, 49134? 76793 What is next in -175, -400, -625? -850 What is the next term in 396, 357, 318? 279 What is the next term in 388, -468, -1886, -3860, -6384? -9452 What is next in -693, -615, -537, -459, -381, -303? -225 What is next in -5296, -10577, -15858, -21139? -26420 What is next in 29, 259, 883, 2099, 4105, 7099, 11279? 16843 What comes next: -3692, -7379, -11084, -14819, -18596, -22427, -26324, -30299? -34364 What is the next term in -3515, -3509, -3503? -3497 What comes next: 12502, 12498, 12492, 12484, 12474, 12462? 12448 What is next in 43352, 43333, 43316, 43301, 43288, 43277, 43268? 43261 What comes next: 57783, 57778, 57771, 57762, 57751? 57738 What is the next term in 163, -543, -2459, -6191, -12345, -21527, -34343, -51399? -73301 What is the next term in 606, 726, 846, 966? 1086 What is the next term in -28, -169, -422, -793, -1288, -1913? -2674 What is the next term in -20562, -20542, -20508, -20460, -20398, -20322? -20232 What comes next: 343, 706, 1091, 1498, 1927? 2378 What comes next: -1238, -9955, -33620, -79709, -155698, -269063, -427280, -637825? -908174 What is next in -354, -1442, -3272, -5850, -9182, -13274? -18132 What comes next: 175, 200, 203, 172, 95, -40, -245? -532 What comes next: 3758, 7494, 11206, 14888, 18534, 22138? 25694 What is the next term in -112279, -112287, -112299, -112315? -112335 What is the next term in -42, -154, -408, -858, -1558, -2562, -3924? -5698 What is next in -38463, -38483, -38527, -38607, -38735? -38923 What comes next: 8, 12, 40, 104, 216, 388? 632 What is next in 2722, 2766, 2894, 3148, 3570? 4202 What is next in -1140, -4713, -10670, -19011, -29736, -42845, -58338? -76215 What is next in -597, -4712, -15885, -37644, -73517, -127032, -201717? -301100 What is the next term in 484, 466, 450, 436? 424 What is next in 811, 939, 1151, 1447, 1827? 2291 What is the next term in 23, 156, 453, 980, 1803, 2988, 4601, 6708? 9375 What comes next: -890, -3385, -7548, -13385, -20902, -30105? -41000 What is next in 3617, 5004, 6391, 7778, 9165? 10552 What is next in 187, 139, 91, 43, -5? -53 What is next in -7778, -15538, -23276, -30992, -38686, -46358? -54008 What is next in 325, 744, 1443, 2422? 3681 What is the next term in 133, 363, 597, 835, 1077, 1323, 1573? 1827 What is next in 2187, 2191, 2195, 2199? 2203 What is the next term in 29236, 29244, 29266, 29308, 29376, 29476, 29614, 29796? 30028 What is next in 124, 959, 3222, 7627, 14888, 25719, 40834? 60947 What comes next: 18, 256, 906, 2172, 4258? 7368 What comes next: 247, 339, 401, 427, 411, 347? 229 What is the next term in 2339, 4557, 6775, 8993, 11211, 13429? 15647 What comes next: 10964, 10921, 10876, 10829? 10780 What is the next term in -14915, -29827, -44739, -59651, -74563? -89475 What is the next term in 1724, 6869, 15446, 27455? 42896 What comes next: -7618, -7594, -7570? -7546 What is next in -40719, -40733, -40747, -40761, -40775, -40789? -40803 What is the next term in -6928, -13860, -20778, -27676, -34548? -41388 What is next in -626, -1338, -2028, -2690, -3318, -3906? -4448 What comes next: 452, 656, 860, 1064, 1268? 1472 What is the next term in -11193, -11156, -11107, -11040, -10949? -10828 What comes next: -2078, -4133, -6186, -8237, -10286, -12333? -14378 What comes next: 2522, 5058, 7592, 10124, 12654? 15182 What is next in -854, -1660, -2460, -3254? -4042 What is the next term in -5941, -5951, -5961, -5965, -5957, -5931? -5881 What is next in -2145, -8633, -19467, -34641, -54149? -77985 What is the next term in -19, -164, -529, -1216, -2327, -3964, -6229, -9224? -13051 What is next in 3148, 12582, 28312, 50344, 78684? 113338 What is next in -78267, -78239, -78211, -78183? -78155 What is next in 596784, 596785, 596786, 596787, 596788? 596789 What comes next: -2818, -11096, -24848, -44080, -68798, -99008, -134716? -175928 What is next in 2406304, 2406312, 2406332, 2406370, 2406432	{ "pile_set_name": "DM Mathematics" }
2180741 by -30. -2180741/30 What is 8145102 divided by 6537? 1246 -82798312 divided by -21079 3928 What is 7198898 divided by 211? 34118 Divide 2319174 by 5247. 442 Divide -10048536 by -2. 5024268 Divide -42644116 by 2. -21322058 Calculate -68134 divided by 138. -34067/69 Divide -487047 by 853. -487047/853 Divide 26 by -2668471. -2/205267 Divide 3463612428 by -4. -865903107 Divide 113458 by 92. 56729/46 What is 9558912 divided by -4818? -1984 What is 1413945366 divided by 235657561? 6 -352147544 divided by 2 -176073772 What is 4562 divided by 29687? 4562/29687 0 divided by 3459421 0 -8343403 divided by -1 8343403 Calculate -22 divided by 266210. -11/133105 Calculate -1448 divided by -10310. 724/5155 Calculate 527555613 divided by 39. 13527067 What is -23940180 divided by -10? 2394018 Calculate -100701588 divided by 1291046. -78 -157 divided by -76193 157/76193 What is 4332983 divided by -4332983? -1 Calculate -17 divided by -6790654. 17/6790654 What is 3172518 divided by 352502? 9 Calculate -6357790 divided by 5. -1271558 Divide 1907781 by 1907781. 1 Divide -9819512 by -8984. 1093 Calculate -63 divided by 1663879. -9/237697 Divide -137 by 3035. -137/3035 Divide -167563 by 2246. -167563/2246 What is 7559 divided by -815? -7559/815 Divide -193 by -74583. 193/74583 Calculate -543101 divided by -364. 41777/28 What is 18509244 divided by 5? 18509244/5 What is 414427839 divided by 1281? 323519 What is -5 divided by 404081010? -1/80816202 -14720750 divided by -106 138875 Calculate -87411432 divided by -84701. 1032 Calculate 425673531 divided by -4. -425673531/4 What is -48605 divided by -269? 48605/269 Calculate -5 divided by -61000103. 5/61000103 -4383288 divided by 365274 -12 11397406 divided by -2146 -5311 Divide -420805 by -24. 420805/24 What is -6777751 divided by -7? 6777751/7 Divide 626685318 by 3. 208895106 0 divided by -219025561 0 308611 divided by 64 308611/64 3388207 divided by -109297 -31 39601224 divided by -27 -1466712 -3320000 divided by -5000 664 Calculate 309834653 divided by 6. 309834653/6 Divide -8712824 by 2. -4356412 What is -1726405 divided by -37? 1726405/37 Calculate -3572851 divided by -4. 3572851/4 What is 15953728 divided by 284888? 56 88598 divided by 328 44299/164 What is 1 divided by 68718743? 1/68718743 Calculate -8090 divided by -461. 8090/461 Divide -128040220 by 20069. -6380 What is -244308438 divided by 22? -11104929 Divide -41198455 by -103. 399985 -6044090 divided by 159055 -38 What is -1335282 divided by 17119? -78 What is -40053594 divided by 5754? -6961 -4475 divided by 307 -4475/307 Calculate -424094490 divided by -9424322. 45 -445230 divided by -117 49470/13 Divide -2928511 by -1. 2928511 What is -2474538 divided by 114? -412423/19 Divide 247 by 28838. 247/28838 Calculate 467957860 divided by -2. -233978930 Calculate -35602200 divided by -13880. 2565 Calculate -139005 divided by 2278. -139005/2278 Calculate 0 divided by 18207838. 0 Divide 22621704 by 2238. 10108 Divide 12441545 by 1. 12441545 What is 3518004 divided by 18914? 186 What is 11 divided by -252844? -11/252844 -182977408 divided by -472 387664 33782467 divided by 19 33782467/19 What is -89 divided by -106920? 89/106920 Calculate 2534076 divided by -86. -29466 What is 624818 divided by -47? -13294 What is 119200860 divided by -4? -29800215 -2889873 divided by -137613 21 What is -321840811 divided by 1? -321840811 What is 4 divided by 5504763? 4/5504763 Divide -16829280 by -6. 2804880 Divide -111205 by 7771. -111205/7771 -131 divided by -190259 131/190259 Calculate 7322920 divided by -19580. -374 Divide 115694450 by -5. -23138890 Calculate -2835500 divided by -113420. 25 Calculate -1273 divided by -47008. 1273/47008 -28889272 divided by -152 190061 What is 24416765 divided by -5? -4883353 Calculate 27608919 divided by 111777. 247 Calculate -5438520 divided by 75535. -72 Calculate -34 divided by 46608. -17/23304 2863468 divided by 2863468 1 What is -2 divided by -1073176? 1/536588 Calculate -48189162 divided by -21446. 2247 What is 10 divided by 29418165? 2/5883633 Divide -148791370 by 5. -29758274 -450862690 divided by -427358 1055 8109794 divided by -98 -82753 Calculate -1737500 divided by 12500. -139 Divide 1536652 by 7. 1536652/7 477363324 divided by 687 694852 Divide 3 by -43080631. -3/43080631 -353110 divided by -9 353110/9 Divide 642 by 184. 321/92 2 divided by -817165 -2/817165 Divide 255774552 by -2. -127887276 What is -154783420 divided by -38695855? 4 -1139436 divided by 1 -1139436 Calculate 4 divided by 60604393. 4/60604393 71 divided by -80281 -71/80281 What is -186157154 divided by -73? 2550098 Calculate -86007350 divided by -11506. 7475 133510900 divided by 26702180 5 What is 63 divided by 3097467? 7/344163 -6658 divided by 19207 -6658/19207 What is 134478 divided by 83? 134478/83 Divide 19 by 147874. 19/147874 Divide -605 by 4270. -121/854 Divide 383242536 by 3. 127747512 8515908 divided by -473106 -18 Calculate 20 divided by 6972. 5/1743 What is -16646112 divided by 4? -4161528 -986247 divided by 8 -986247/8 -110534 divided by 17 -6502 -43544 divided by 917 -43544/917 -176644540 divided by -8832227 20 Calculate -154665 divided by -26. 154665/26 Divide -422823 by 149. -422823/149 Divide 2287236 by -15666. -146 Calculate -528 divided by 6997. -528/6997 Divide -474527979 by 52725331. -9 402149688 divided by -17 -23655864 -45716230 divided by -9143246 5 Calculate 176465037 divided by 3329529. 53 Divide 1650874 by -53254. -31 What is 933092228 divided by -233273057? -4 What is 326145354 divided by -2? -163072677 What is 479 divided by 1373331? 479/1373331 What is 13435440 divided by 90780? 148 Divide -3896 by -487. 8 95854232 divided by -6 -47927116/3 What is 48997190 divided by 383? 127930 96339860 divided by -24084965 -4 -1818 divided by 385 -1818/385 Divide -121002276 by -4. 30250569 Divide 6691442 by 6691442. 1 Divide 92460515 by 47. 1967245 Calculate -7892185 divided by 225491. -35 -16416 divided by -92 4104/23 What is 98563102 divided by -2? -49281551 Calculate -14587836 divided by 28271. -516 Calculate 3231 divided by -29342. -3231/29342 What is -1 divided by -2642166? 1/2642166 What is 34398 divided by 880? 17199/440 What is 41276 divided by -66? -20638/33 What is 26623754 divided by -2? -13311877 Divide 422488872 by 234. 1805508 Divide 2953882 by 2. 1476941 -6136299 divided by 20 -6136299/20 94414195 divided by -110945 -851 Calculate 312466 divided by 295. 312466/295 Calculate -31222210 divided by -6. 15611105/3 Divide 178899 by -454. -178899/454 What is 1331077 divided by 1331077? 1 -49 divided by 40453 -7/5779 3218802 divided by 1072934 3 Calculate 127338850 divided by 12733885. 10 -19787940 divided by -4946985 4 Calculate 1481357150 divided by -105811225. -14 Calculate 3687 divided by 37459. 3687/37459 Calculate 58785370 divided by 9. 58785370/9 Calculate -4904785965 divided by 5. -980957193 What is -1468 divided by 270? -734/135 6770 divided by 458 3385/229 Calculate -14589340 divided by 6. -7294670/3 -25983 divided by -19695 8661/6565 -4 divided by 29796986 -2/14898493 Divide -411634810 by -19. 21664990 Calculate 1246286765 divided by 167. 7462795 Calculate -53864758 divided by 118. -456481 Calculate 55910749 divided by 15247. 3667 Divide 742564260 by 4583730. 162 9437 divided by 295 9437/295 Divide 792120730 by -71. -11156630 What is -40778147 divided by 26531? -1537 Divide -37956696 by -24504. 1549 Calculate -382068084 divided by 6. -63678014 Divide -1377129 by -28. 1377129/28 Calculate -62266555 divided by 6019. -10345 Divide -98114850 by -83502. 1175 Calculate -1981675 divided by 1. -1981675 630813450 divided by 6 105135575 Calculate 340659 divided by -1023. -333 What is -2861842 divided by 1430921? -2 Calculate 1 divided by -3519099. -1/3519099 324 divided by -1227 -108/409 What is -419862 divided by 381? -1102 -24713 divided by 3160 -24713/3160 Divide 65 by 38189. 65/38189 Divide -960 by -1163257. 960/1163257 136181273 divided by 1 136181273 Divide -5 by -1427645. 1/285529 Divide -8 by -43258. 4/21629 Calculate -275253062 divided by -5193454. 53 -92794256 divided by 23198564 -4 37 divided by -1704320 -37/1704320 Divide 1564290893 by 142208263. 11 Divide 58537690 by 3. 58537690/3 Calculate 11030688 divided by -324	{ "pile_set_name": "DM Mathematics" }
(0v5 + v5 - 3v*5 + 3v*5 - 2v*5 - 2v*5 + (4v - 3v + v)(-2v4 + v3 - v3) + v3 - 2v5 - v3)(23 - 2 - 5). -144v*5 Expand -389 + 389 + 53t*3 + 7t*3 - 2t*3 - 3t3 - t3 + 3t3 - 3t*3 + (-4t + t + t)(1 + 2t*2 - 1). 50t*3 Expand (15u - 3u - 9u + 2)(u - 2u - u). -6u2 - 4u Expand (l + l + l)(2l*3 + l - l) + (-4 + 4 + l)(-2l3 - 5 + 5). 4l*4 Expand (-6x + 2x + 6x + 5x2)(-2x - 3x + 3x). -10x*3 - 4x*2 Expand (3 - 3 - o)(8o - 12o + 7o)(-3 + 5 - 4)(-4o*2 + 3o*2 + 0o*2). -6o*4 Expand (-68 - 3j + 56 + j)(-4j*3 + 0j*3 + 5j*3). -2j*4 - 12j*3 Expand (3 - 3 + 2l)(-4 + 3 - 1 + (0 + 1 + 8)(5 - 3 - 1)). 14l Expand (-2 + 6 - 3)(0 - 2u + 0)(1 - 3 + 1)(-5u*2 + 2u*2 + 6u*2). 6u*3 Expand (11o*3 + 0o*3 + 6o*3)(-6o2 + 6 - 6). -102o*5 Expand (3q*3 - 2q*4 - 5q*3 + 3q*4 + 2)(-3 + 3 + 1). q*4 - 2q*3 + 2 Expand (0p - 4p + 6p)(7 - 7 - 9p). -18p2 Expand (6m - 5 + 5)(-2m - 3m + 7m) - 3m2 + 2m*2 + 0m*2 + (-1 + 1 + 2m)(2 - 2 - 2m). 7m2 Expand (-3 - 2r + 3 + (0 + 1 - 7)(-2r - 2r + 3r))(2r - r + r). 8r2 Expand (-12 - 17 + 31 + 52v)(-3 + v + 3). 52v*2 + 2v Expand (6 + 0 - 5)(15m*3 - 6m3 - m3). 8m3 Expand (-3m - 3m + 3m)(5 - 3 + 0)(0 + 1 + 0)(9 - 63 + 6). 288m Expand (-3y - 11y - 42y)(-y*2 + 3y*2 - 4y*2 + (-2y + 0y + 0y)(-3y + 3y + 2y) - 1 + 1 - 2y2 + 2y*2 - 4y*2 + 0y*2). 560y*3 Expand 5y - 5y - 2y*5 + (-2y*2 + 0y + 0y)(-4y3 - y3 + 4y*3) - 6y*5 + 3y*5 + 2y*5 - 2y*2 + 2y*2 + 2y5. y5 Expand (0v2 - v2 - v2 + (v2 + 2v2 - v2)(-2 + 0 + 1) + 2v*2 - 1 + 1)(v + 0v - 2v). 2v3 Expand -2 + 2 + 3o + (1 + 1 - 3 - 2 + 1 + 0 + (-5 - 2 + 4)(-3 + 1 - 2))(-o - 3o + 6o). 23o Expand (-2 - 5 + 4)(2 + 3 - 4)(0c + c - 4c). 9c Expand 28x + 2x + 6x + 2x - x - 3x + (-1 - 1 + 0)(-2x + 5x - 2x) - x + x - x + 2x - 4 + 4. 33x Expand (0 - 10 + 0)(3i2 - 6i2 + i2). 20i2 Expand (-4s*2 + 2s*4 + 4s*2)(13s + 13s + 2s) - 4s*3 + 3s*5 + 4s*3. 59s*5 Expand ((0 + 2 + 0)(-6 + 4 + 4) - 3 + 0 + 1 - 3 + 3 - 3)(2d - 3d2 - 2d + (d + 2d - d)(2 - 2 - d) + 0d2 - 2d*2 + 0d*2). 7d*2 Expand (-s + 0s + 2s)(0 + 0 - s) - 4 + 4 - s*2 + (43s + 75s - 56s)(-3s + 6s - s). 122s*2 Expand -3 + 1 + 0 - 4x + (-3 + 1 + 4)(0x - 3x + x) + 2 - 2x - 2. -10x - 2 Expand (-m + 2m + m)(2m3 - m2 + m*2 + (-3m + 0m + 0m)(0m + 0m + m2)). -2m4 Expand (0 + 0 + k3)(-k + k - k)(1 - 1 + k). -k*5 Expand (0 - 3 + 4)(-2i4 + 2i4 - i5) + i*5 + 14i*5 + 26i*5 + (-2i*3 + 2i3 - i5)(0 + 3 + 0). 37i*5 Expand -4s*4 - 3s4 + s4 + (s - s - 2s2)(-s*2 + 2s*2 + 2s2) - s4 + 0s2 + 4s*2 - 5s*2. -13s4 - s2 Expand 3n - 2n - 3n + (-4 + 1 + 1)(-18 + 18 - 3n) + 0n + n + n. 6n Expand (-m + 0 + 0)(6m2 - 3m*2 - 5m*2) + (-3m*2 + 6m*2 - 2m*2)(m + 2 - 2). 3m3 Expand 3p + p - 3p + 3p + 0p - 5p + (1 - 2 + 3)(0p - 2p + 0p) - 4p - 2p + 7p + (p - 4p + 2p)(-1 + 3 + 0) - 2p - 3p - p. -12p Expand (0u + 5u - 4u)(-4u*2 + 3u*2 + 3u*2) + 12u*3 + 9u*3 - 3u*3 + 0u*3 - 2u3 + u3. 19u3 Expand 2w*2 - 2w + 2w + (-4w - 2w + 4w)(1 - 1 + 2w) + w*2 - w + w - 3w*2 + 6 - 2w*2 + 3w*2. -3w*2 + 6 Expand 2b - 12b + b + (1 + 1 - 1)(6b + 0b - 4b) + 0b + 0b + b + b - 2b + 2b + 0b + b + 2b. -2b Expand 5w - 4w + 3w + (-5 - 9 + 2)((-w + 4w - 4w)(-4 + 2 + 0) - w + w - w - 4w + 4w + w - 3w + 4w + w). -44w Expand (3h3 + h3 - 6h*3)(h + 0h - 2h + (0 + 2 - 3)(-2 + 2 + 2h))(h - 10h + h). -48h5 Expand (4 + 2x + 0 + 7)(2 - 1 + 1). 4x + 22 Expand (-3t3 + 2t*3 + 5t*3)(-3 + 4 - 4). -12t3 Expand (7o - o - o + (-5 + 3 + 0)(-o + 3o - 3o))(0o4 + o4 + o4). 14o*5 Expand (2a*2 - 3a2 - a2)(-2 - 5a + 2) + 5a3 + 0a*3 - 3a*3 + (-3a + 2a - a)(-2a2 + 2a2 - a2). 14a3 Expand (4f3 + f3 + 2f + 6f*3)(-1 - f + 1). -11f4 - 2f*2 Expand (5i + 3 - 3)(-4 + 4 + 4i*3). 20i*4 Expand (-6 + 2 + 2)(-2 + 2d + 2)(0 + 0 + 1)((d + 0d + 0d)(-d - 1 + 1) - 8d2 - 4d*2 - 5d*2). 72d*3 Expand (-2z - 2 + 2)(-1 + 5 - 3)(-3z + 2z - z). 4z2 Expand -m - 1 + 1 + (2 - 2 + m)(3 + 3 - 4) - 4m + 6m - 12m + 0m + 3m + 0m. -6m Expand -2u*3 - 3u*3 + 3u*3 + 4u*3 - 6u*3 + 10u*3 + (-3u*2 - 4u*2 + 5u*2)(2u + u - 4u) + 0u3 + u3 - 2u*3. 7u3 Expand (-s4 + 34 - 28 - 5s4)(s - 5s + 5s)(1 - 4 + 4). -6s*5 + 6s Expand -4a3 - 4a*3 + 6a*3 + (3a*3 + 0a*3 + 0a*3)(2 + 2 - 1). 7a3 Expand (5f - 4f + 4f)(1 + 1 + 1)(-3f - 2f + 7f). 30f*2 Expand 4h*3 - 2h*3 - 3h*3 + (-2h - 1 + 1)(-2h2 + h2 + 0h2). h3 Expand 2o*3 - 5 + 5 + (3o*2 - 12 + 12)(2o + 2o - 6o). -4o*3 Expand (-9 - 15 + 0)(3t3 + t3 - 5t*3). 24t*3 Expand (0 + 2 + 0)(1 + 0 - 2)(-4 + 0 + 2)(2y + 2y - y). 12y Expand (-3 + 3 - 3x)(0 + 3 - 1 + (2 + 2 - 2)(1 + 3 - 3)). -12x Expand (4m + 6m - 11m + 1)(-1 + 1 + 3)(0m3 + 0m*3 + 2m*3). -6m*4 + 6m*3 Expand (1 + 3 - 2)(-5v + 2v + 6v + (5 - 1 - 2)(-2v + 4 - 4) - 3v + 5v + v). 4v Expand (5k3 - 2k*3 - 2k*3 + (-1 - 1 + 1)(4k3 + k3 - 6k3) - k3 + 0k3 + 2k*3)(12 + 17 - 22). 21k3 Expand (3n - 4n - n)(0n - 1 + 2n + n) - 2n2 + 7n - 7n. -8n*2 + 2n Expand -2v - 2v*2 + 2v + (-5 + 0 + 2)(-4v2 - v2 + 0v2). 13v*2 Expand 2c3 - c4 - 2c3 + c4 - 17c*4 + 4c*4 - 3c*4 + 4c4 + c4 + (4 - 4 + 2c3)(2c + c - 2c) + c*4 - 4c*4 + 2c*4. -10c*4 Expand 4l5 + l5 - 24l5 + (-2l*2 - l + l)(0l3 - 3l*3 + 4l*3). -21l*5 Expand (0v + 0v + 2v*2)(2v + 9v - 6v) - v3 + 0v + 0v. 9v*3 Expand 2z - 2z + z3 + (-z - 4z + 7z)(3z - 3z + 2z2 + (-5z + 3z + 3z)(-z + z + 2z)). 9z3 Expand -2 + 2 - 3i*5 + 15i*4 - 15i*4 - 3i*5 + (-5i*3 + 5i3 + i3)(-i2 + 3i - 3i). -7i*5 Expand (-3x*4 - x + x)(-2x + 3x - 2x) - 2 - x5 + 2 + 0x*5 - 4x*5 + 12x*5. 10x*5 Expand ((-1 + 4 + 0)(2 + 1 + 0) - 3 + 0 + 4)(3k - 4k - k). -20k Expand (1 + 3 - 1)(-2y - 5y + 2y + (-2 + 2 + 2)(-1 + 1 + y))(-3 + 5 + 1)(-3y + y + 3y). -27y*2 Expand -4a + 21a2 + a - 6a*2 + (-a - 2a + 4a)(-a - 1 + 1). 14a2 - 3a Expand (r + 3r - 2r)((1 - 1 + 2)(1 - 1 - 3r2) + 11r*2 + 25r*2 - 20r*2). 20r3 Expand -c3 - 2c4 + c3 + (3c - 4c + 0c)(-c3 - 8c*2 + 2c*3 + 7c*2). -3c4 + c3 Expand (-3 + 2 + 0 + (4 - 3 + 0)(-5 + 1 + 3))(-60u + 60u - 9u4). 18u*4 Expand (-2 + 0 - 2)(l + 0l - 2l) + 3 - 3 - 2l. 2l Expand (3 - 6 - 1)(0s3 - s3 + 0s3) - s3 - 2s3 + s3. 2s3 Expand (1 - 12 - 3)(i2 - i2 + i*2). -14i*2 Expand (a - 2a + 0 - 2)((1 + 3 - 5)(-2 + 1 - 1) + 3 - 5 + 4 + 2 + 0 - 4 + 3 + 2 - 6 + 5 + 1 - 5). -2a - 4 Expand k2 - 2k*2 + 0k*2 + 0k + k*2 + 0k + (k - 3k + 4k)(1 + k - 1) + 0k*2 - 3k*2 + 8k - 7k. -k2 + k Expand 0a*5 - 2a*5 + 4a*5 - 2a + a*5 + 2a + (-1 - a*3 + 1)(0a2 - 2a2 - a2). 6a5 Expand (-o + 0o + 2o)(1 - 1 + 1) + (-2 + 2o + 2)(2 - 4 + 0) + 2o - 3o + 3o + 7o - 6o - 5o + (2 - 1 + 1)(0 - 3o + 0). -11o Expand -3 - 2q - 2 + 4 + 2q - 2q - 2q - 3q + 4q + 0q + q - 2 + 2 + (5 - 3 - 4)(2q - 5q + q). 2q - 1 Expand (-3f - 2 + 0 + 11f)((-4f*2 + 0f*2 + 5f*2)(-2 - 4 + 4) - 6f2 + 4f2 - f2). -40f3 + 10f*2 Expand (-1 + 1 - 1)(13 - 13 - 4l + 1 + 2l - 1 + 3l - 5l + 4l + (-2l + 0l + l)(1 - 1 - 1)). -l Expand (-21 + 5 + 10)(2 - 1 - 2x + 0x). 12x - 6 Expand (4 - 1 - 4)(-34u*5 + 7u*5 - 25u*5). 52u*5 Expand 0p2 + p2 - 3p2 + (-p - 4 + 4)(11p + 16p + 4p). -33p*2 Expand (-3g*2 + 2g*2 + 2g*2 - 1)(2 + 0 + 1). 3g2 - 3 Expand (22m*2 - 23m*2 - 5m - 8m)(-m*2 + 0m + 0m). m4 + 13m*3 Expand a - a - a + (2 - 2 - a)(-3 + 4 - 2) - 4a + 0a + 5a + 9a + 2 - 7 + 6. 10a + 1 Expand (-2q + 3 - 3)(-5q*4 + 0q*4 + 4q*4) + 2q**	{ "pile_set_name": "DM Mathematics" }
-12). Is c(y) composite? False Let q be 0 - -2 - 288/3. Let s = q - -191. Let g = 0 + s. Is g prime? True Let w(o) = o*3 + 8o*2 + 1. Let q be w(-8). Let k be (4 - 1)/q - 3. Suppose k = -d - 106 + 395. Is d a composite number? True Suppose 104 = -4g + 3h + 2076, -4g - 3h + 1996 = 0. Suppose 3s - 531 - g = -b, -1356 = -4s + 2b. Is s composite? True Let d be (-51)/(-12) + (-2)/8. Suppose da = 12a - 568. Is a a prime number? True Suppose -4r - 3u - 40 = 0, -5u + 0 - 20 = 2r. Let k(l) = 60l - 6. Let h be k(r). Let w = h + 1147. Is w composite? False Let h(b) = b3 + 6b*2 + 2b + 12. Let l be h(-6). Suppose o + 8 - 396 = l. Suppose 3u - 7u + o = 0. Is u a prime number? True Is 2630/(-25)10/(-12)33 composite? True Let k = -2803 + 11304. Is k a composite number? False Suppose 0 = 5r + 4i + 1713, -i + 4 = -3i. Let s = r + 738. Suppose 0b = -3b + 5a + s, -263 = -2b + 5a. Is b a composite number? True Let y(n) = n*3 - 4n*2 + 3n + 2. Let c be y(3). Suppose cq - 889 = 3f, -13q - f = -9q - 1771. Is q prime? True Suppose d + 3b - 574 = 0, 0d = -4d - 4b + 2320. Is d composite? True Suppose -99726 = -69g + 47175. Is g a prime number? True Suppose 0 = -14m - 12m + 593242. Is m composite? False Let i be -3 + 10 + 9/(-3). Suppose 2m - 718 = -is, -m - s = 4s - 356. Is m prime? False Let k(q) = q + 8. Suppose 3 = 4d - 4h - 1, -18 = 2d + 3h. Let m be k(d). Suppose -mr + y + 2500 = 0, -2042 + 570 = -3r - 5y. Is r prime? True Let c be (-1 - (0 + 2)) + -455. Let t = c - -669. Is t a prime number? True Let n be 14 - (2 - (-1 - -1)). Suppose -3p = n, -2t = -3t - 2p - 659. Let k = t - -2492. Is k a composite number? True Let u be 0 - (-11 - -5) - (-1 + 0). Let v(q) = -2q - 8 + q - 2q + 3q*2. Is v(u) prime? False Suppose -2v + f = -36, -4v = -v - 4f - 64. Suppose 11c - vc + 7355 = 0. Is c composite? False Let h(w) = -65w2 + 63w*2 + 0 - 76w*3 + 1. Let n be h(1). Is 4189/11 + (-14)/n a composite number? True Let v be (-2 - (-32)/12)/(3/25902). Suppose 2d - v - 6186 = 0. Is d composite? True Let r = 2434 + -3594. Let b = 1629 + r. Is b a composite number? True Suppose -32245 = -5f + 2m, -4f - 6674 + 32470 = -5m. Is f prime? True Is (-5848)/340(0 - (-1905)/(-6)) a prime number? False Let l(q) = -q2 - 5q + 4. Let h be l(-5). Suppose -hc + 2c - 2d + 1672 = 0, c = d + 842. Is c prime? True Let v = 23 + -19. Suppose -151 = -y + 3l, -660 = -4y + 2l - vl. Is y a prime number? True Let m(w) = w2 + w + 1. Suppose 8 = 4q - 3q. Let y = -3 + q. Is m(y) a prime number? True Let r be (216/90)/(4/10). Let m = r - 1. Suppose 4h + 0k + mk - 466 = 0, -347 = -3h - 5k. Is h a prime number? False Let f = -9385 + 35052. Is f prime? True Suppose 0 = o - 4h - 1351, -5o - 4h + 1682 + 5097 = 0. Suppose 2s - g = 2719, -s + 6g = 4g - o. Is s a composite number? False Is -5 - ((-4)/38 + 8966914/(-209)) a composite number? False Let m(c) = -c*2 + 218. Let l be m(0). Suppose 3r - r = l. Suppose 2a - 4q + 5q - 71 = 0, 0 = -3a - 2q + r. Is a a prime number? False Let b = -37 + 33. Let o be (-6)/(-24) - 23/b. Suppose -ol + 179 = -5l. Is l a composite number? False Let k(l) = 38l - 7. Let f(i) = 115i - 20. Let o(b) = 4f(b) - 11k(b). Is o(7) prime? False Suppose 2f = -4t + 32, -2t + 2f - 2 + 6 = 0. Suppose 474 = tn - 0n. Is n a composite number? False Let l = -2679 - -10376. Is l composite? True Suppose 7v - 1772 + 14365 = 0. Let f = v - -2886. Is f composite? False Let n = -12 + 18. Let f be (n/(-21))/(2/(-14)). Suppose -2i - fi + 1699 = 3d, 2i + 4d = 842. Is i a composite number? True Suppose -2n + 6 = 3s - 3n, 3s = 2n + 3. Suppose -sa = -5w - 0a - 6, 0 = w + a + 6. Is (-1 + 75)w/(-6) composite? False Let q(j) = -j*3 - 9j*2 - j + 13. Let h be q(-9). Suppose 15 = p - h. Is p a composite number? False Is (-28)/266 - (-51612)/76 prime? False Let b = 14 + -12. Let x be (18 + 3254)b/4. Suppose 5v - v - x = 0. Is v prime? True Suppose 0 = 6w - 10w + 28. Let m(y) = -y2 - wy + 3y2 + 7 + 0y*2. Is m(6) composite? False Let w = 17 + -16. Let u be w/(((-65)/2910)/(-13)). Suppose 0 = 9p - 7p - u. Is p a prime number? False Let t(s) = -3s*3 + 2s*2 + 7s + 5. Let l(b) = b*2 - 9b + 14. Let h(a) = -2a - 6. Let m be h(-6). Let q be l(m). Is t(q) a prime number? False Let b = 3604 - -451. Is b a composite number? True Suppose 4t = 6 + 10. Let y be 2/(8 - t)-4. Is (243/(-2) + 3)y a prime number? False Suppose -428 - 80 = -4a + 4q, 2a - 256 = 4q. Suppose -128 = -2k + a. Let y = k - 78. Is y prime? False Suppose -4i = d - 6039, -3i = -3d - 1180 - 3368. Is i a prime number? True Let z = -4654 + 7935. Is z composite? True Let f = -41 + -594. Let c = -256 - f. Is c composite? False Let s(c) be the first derivative of -c*3/3 - 3c*2 + 3c - 1. Let o be s(-6). Is 8/(-12) + 1673/o prime? True Let f(a) = 159a3 - a2 - 4a - 17. Is f(5) a composite number? False Let a = 58 + 46. Let j = -155 + a. Let z = 82 + j. Is z prime? True Suppose 5i - 2u - 8609 = 0, 5u + 1 + 9 = 0. Is i a prime number? True Suppose 2085 = 2v + z, -4v + 4z + 676 = -3476. Is v a composite number? True Suppose -2f = 2m - 2890 - 11108, -35011 = -5m - f. Is m composite? True Let o(x) = -55x + 2. Let l be o(4). Let a = l - -82. Let z = -89 - a. Is z a composite number? False Let d be (-1 - 14/(-4))72/60. Suppose -5v + 21623 = n - 5n, -12990 = -dv - 3n. Is v composite? False Suppose -m + 2m - 18 = 0. Suppose 22h - 12h = 1930. Suppose 5x + m = 4f - h, 0 = 5f + 4x - 315. Is f composite? False Let t(i) be the first derivative of 7i3 + 9i*2/2 + 21i - 3. Is t(-13) composite? True Is 24275 + (-5 - -1 - -10) a composite number? False Suppose -280 = -4h + 4s, 3h - 164 = -5s + 22. Is h prime? True Let o = 7623 - 4324. Is o a composite number? False Suppose -5l + 14h + 42075 = 9h, 8423 = l + h. Is l a prime number? True Suppose 6k = 15k - 4o - 604875, 3k = -4o + 201609. Is k prime? False Suppose -5o + 107976 = 3g - 87074, -195030 = -5o + g. Is o a composite number? True Suppose 208 = 7g - 6g. Is (39/(-12))/((-4)/g) prime? False Let y = 48853 - 29480. Is y a prime number? True Suppose 0 = 2k + 3 + 1. Let w = k + 16. Let j = w - -8. Is j a composite number? True Let i(p) = p*2 + 1. Let h be (-10)/(-15)3/(-2). Let d be i(h). Suppose -dr = 84 - 530. Is r a composite number? False Let f = -15 + 20. Suppose 5p + 5w - 580 = 2350, fp = 3w + 2962. Suppose 2y + 0y - p = 0. Is y a prime number? False Let m(p) = 53p*3 - 2p*2 + p - 5. Let j be 1/(33/18). Is m(j) a composite number? True Let t(r) = 57r2 - 29r + 223. Is t(-23) prime? False Let u = -41 - -44. Suppose ul + 38 = 5l. Is l prime? True Suppose 0 = 8n - 52 + 20. Suppose -ny + 2y - 541 = -5j, -4j - y = -438. Is j composite? False Suppose 355g - 314g - 212749 = 0. Is g composite? False Let y = 1147 - -5. Suppose 0 = 3l + 2p - 3451, l + p = -0p + y. Is l a prime number? False Let j(q) be the second derivative of 4q4 - 17q*2/2 - 24q. Is j(-4) a composite number? False Suppose 31a - 393745 = 20a. Is a composite? True Let k = 37 + 382. Is k composite? False Let w be (-104)/(-1) - (-6 - -8). Let c = -19 - -10. Is ((-21)/c)/(2/w) a prime number? False Let z = 2243 - 1347. Suppose -861 - z = -7x. Is x a composite number? False Let z(g) = 1664g + 19. Let i be z(2). Let y = i - 1300. Is y a prime number? False Let r be (-10)/345/10. Let n = 332 + r. Is n a prime number? True Let o = 3 + 1. Suppose f - 5g = 88 + 58, -f + og = -149. Suppose -f = -5r + 114. Is r a composite number? True Let m(c) = 43c2 + 91c - 515. Is m(6) composite? False Suppose 0 = -2z + 4, 2s + 5z - 15 + 1 = 0. Suppose 0v + sv = 1370. Is v prime? False Is 2 - -2 - (-579)/(-1)-1 composite? True Let j be 4 + -3 - (-1 + -4). Let r = 59 + 506. Suppose f + r = jf. Is f a composite number? False Is (-12)/3(-5)/20571 composite? False Suppose -16 = -6v + 2v. Suppose vq - 13 = 7. Suppose qf - 136 = 469. Is f prime? False Is ((-11030)/(-15))/(6/9) composite? False Let a = 2223 + -253. Let d = a - 1057. Is d composite? True Let o(u) = 3256u + 773. Is o(27) prime? False Let u = -2196 + 3937. Is u a co	{ "pile_set_name": "DM Mathematics" }
8)/(-2). Let d = 117 - s. What are the prime factors of d? 83 Let k(s) = -32s + 97. What are the prime factors of k(-27)? 31 Suppose -10f = -5089 + 339. What are the prime factors of f? 5, 19 What are the prime factors of (-30)/(-4)(-1768)/(-26)? 2, 3, 5, 17 Let w(j) = -j3 - 10j2 - j + 24. Let i = -31 + 21. List the prime factors of w(i). 2, 17 Let d = -29 + 23. Let p(t) = t3 + 5t2 - 12t + 1. List the prime factors of p(d). 37 Let p(s) = 55s - 7. Let f be p(-7). Let c = f + 568. List the prime factors of c. 2, 11 Suppose 4x + 30 = -70. Let w = 47 + x. Suppose -o = -w - 1. What are the prime factors of o? 23 Let f be (-1 + 0)/((-4)/8). Suppose 0q + 488 = fq. List the prime factors of q. 2, 61 Suppose -4f - 3h = -8, -4f + 5 = -2h - 23. Suppose fz + 18 - 73 = 0. Let i = 6 + z. What are the prime factors of i? 17 Let d(k) be the second derivative of -k4/12 - 5k*3/6 + 3k*2 - 6k. Let r be d(-9). List the prime factors of (-251)/(-11) - r/165. 23 Suppose 5y = -r + 1034, 5214 = -0r + 5r + 3y. List the prime factors of r. 2, 3, 29 List the prime factors of 2702/((-80)/(-24)). 2, 3 Let b(u) = u3 + 18u*2 - 5u - 31. Let v be b(-18). Let c = -23 + v. List the prime factors of c. 2, 3 Let k(n) = 12n2 - 4n - 14. What are the prime factors of k(-4)? 2, 97 Let r = -898 - -1114. List the prime factors of r. 2, 3 Let x be 2/8 - 2193/(-12). Suppose -5h = -x - 207. Suppose 3r + 4c + 27 = h, 2c = r - 27. List the prime factors of r. 3, 7 Suppose -p = -992 + 368. List the prime factors of p. 2, 3, 13 Let k(a) = 418a + 111. What are the prime factors of k(4)? 1783 Suppose -35 = 10p - 3p. List the prime factors of 0 + 5 + 53 - p. 3, 7 Let y(o) = -o + 1 - 3 + 19o*3 + 4 - 1. Let c be y(2). Suppose -3p + 7w = 2w - 105, -c = -4p + 3w. List the prime factors of p. 2, 5 Suppose 2i + 2i - 80 = 0. Let g = -17 + i. Suppose s + s + 218 = 5o, -gs = 12. List the prime factors of o. 2, 3, 7 Let k(w) = 5w2 - 13w - 15. What are the prime factors of k(-8)? 409 Suppose 2o + 4k = 1498, 2k - 90 = -3o + 2165. What are the prime factors of o? 3, 251 Suppose 0 = 2k - g - 967, -2k = -4k - 2g + 970. Let m = k + -341. List the prime factors of m. 11, 13 Let j = 31 + 102. Let g = -231 + 143. Let u = j + g. What are the prime factors of u? 3, 5 Let x be (-2)/(-10) + 76972/140. What are the prime factors of (x/(-15) - 0)-6? 2, 5, 11 Let m = 3092 - 1267. List the prime factors of m. 5, 73 Let x be 1-1 - 45/(-5). Suppose xa - 5a - 108 = 0. List the prime factors of (-9)/a + (-29)/(-4). 7 Let c = 51 - 101. Let r = 153 + c. List the prime factors of r. 103 Let i = 350 + -147. Suppose 6n - 265 = i. Let v = n + -54. What are the prime factors of v? 2, 3 Suppose 15 = 12l - 33. Suppose -3k = -11 + 5, lk - 1193 = -5q. What are the prime factors of q? 3, 79 Let r(m) = m2 - 8m - 6. Let i be r(9). Suppose 0 = -2n + 4, -4q + 4n + 23 = i. Suppose -489 = -qj - 76. What are the prime factors of j? 59 Let g(f) = 1890f2 - 2f - 2. List the prime factors of g(1). 2, 23, 41 Let u = -36 + 498. What are the prime factors of u? 2, 3, 7, 11 Let m = 5036 - 2820. What are the prime factors of m? 2, 277 Let y(k) = 8k + 4k + 3k + 9k + k*2 + 5. List the prime factors of y(-29). 2, 3, 5 Let g be ((-9)/6)/(2/(-16)). Suppose -a + u = g, -6a = -2a + 2u + 36. List the prime factors of (a - -5)/(1-1). 5 What are the prime factors of (15/(-2))/((-5)/10)? 3, 5 Suppose -2n = -4z - 32, -2n + 25 = z + 2z. Suppose -13y = -ny + 47. List the prime factors of y. 47 Suppose -5 = -t - 2. Suppose -3a - 5l + 16 = -22, 5a = 2l + 22. Suppose -5s - 68 = -af + tf, 2s = f - 24. What are the prime factors of f? 2 Let b = 194 + -109. Suppose 0 = 4d + 39 + b. Let u = d - -77. List the prime factors of u. 2, 23 List the prime factors of 2/(-5) - (-5 + (-47763)/45). 2, 13, 41 List the prime factors of ((-6548)/(-24))/(5/30). 1637 Let m(j) = 165j2 + 3j - 44. What are the prime factors of m(5)? 2 Let f = 16 + -13. Suppose z - 8 = -f. Suppose -a = zg - 133, g = 3a + 5 + 12. What are the prime factors of g? 2, 13 Let q(s) = -s*3 - 13s*2 + 10s - 1. Let x be q(-15). Suppose 0 = 4k - x - 233. What are the prime factors of k? 7, 19 Suppose -3q + 3168 = 978. Suppose 5c - 5n = q, 2c + 4n - 294 = 7n. What are the prime factors of c? 2, 3 Let x(q) = -2q - 6. Let t be x(-5). Suppose 0 = g + 3w - 259, -3g + tw - 342 + 1080 = 0. List the prime factors of g. 2, 5 Suppose -k = 4k. Suppose k = -5r + 8r - 21. Let v(c) = c*3 - 7c*2 + 5c + 4. What are the prime factors of v(r)? 3, 13 Suppose -5s + 15775 = 3t + 2656, 0 = t - 3. List the prime factors of s. 2, 3, 19, 23 Let t = 163 - 83. Let o be (t/6)/((-11)/(-33)). Suppose -o = -5x + 3x. What are the prime factors of x? 2, 5 Let y(t) = -6t2 - 167t + 16. List the prime factors of y(-11). 7, 23 Suppose -8o = -13o + 9485. What are the prime factors of o? 7, 271 Suppose 4o - 619 - 751 = -2u, -3o - 2u + 1029 = 0. What are the prime factors of o? 11, 31 Let g = -34 - -25. Let a(j) = -1 - j - 10j - j2 + 0j*2. What are the prime factors of a(g)? 17 Suppose 4u = -3r + 293 + 217, r - 170 = -3u. List the prime factors of r. 2, 5, 17 Suppose -3g = -2d - 3386, 104g - 100g + 5d = 4553. What are the prime factors of g? 2, 283 Suppose 0 = -12r + 18298 + 8582. What are the prime factors of r? 2, 5, 7 Suppose 224 = -a + 2r + r, -a = -2r + 224. Let t = -152 - a. What are the prime factors of t? 2, 3 What are the prime factors of (1-6 - (21 - 36))399? 3, 7, 19 Let v = -4 - -8. Let s be -4v/(4-2). Suppose 5 = sg - 3. List the prime factors of g. 2 List the prime factors of 4/(-6) + 14944/24. 2, 311 Suppose 11w - 574 - 229 = 0. List the prime factors of w. 73 What are the prime factors of 2 + 136/(-56) + 6166/14? 2, 5, 11 Suppose 5i - 9 = 4c, 8 = -i - 5c + 33. Suppose iz - 4z = 5. What are the prime factors of z? 5 Suppose -2t - 117 + 651 = 0. List the prime factors of t. 3, 89 Let d = 20 + -20. Let s be (4 + 4)(d + 2). List the prime factors of (3 - 3) + s/2. 2 Suppose 9n = 4n + 4m + 5354, 4292 = 4n - m. What are the prime factors of n? 2, 3, 179 Suppose 4p - 14 = o - 3o, -2p + 6 = 2o. Suppose -8m + pm = -2r - 328, -m + 73 = 4r. List the prime factors of 1/(31/m). 3 Let l = -70 + 78. Suppose -2n = 4q - 572, -3n = -3q - ln + 429. List the prime factors of q. 11, 13 Suppose 5j + 20 = j. Let d = -5 - j. Suppose o - 9 = -do. What are the prime factors of o? 3 Let g be (-14)/(-105) - 4508/60. Let k = 169 + g. List the prime factors of k. 2, 47 Suppose -76 = -4u - 0u. Suppose 4i - u - 1121 = 0. List the prime factors of i. 3, 5, 19 Suppose -u + 88 = -83. Let m = -62 + u. What are the prime factors of m? 109 Suppose -70 = -10s + 100. Suppose -7k + 584 = s. List the prime factors of k. 3 Let k = 31 + -35. List the prime factors of 5-25k/10. 2, 5 Suppose -7c = -4c - 4r - 2269, 0 = -c + 5r + 749. What are the prime factors of c? 3, 11, 23 Suppose 22m + 573 = 6799. List the prime factors of m. 283 Suppose 5y - 12410 = -3c, 4c - 10721 = -4y - 785. What are the prime factors of y? 37, 67 List the prime factors of 428 + -1 + (-55)/(-11). 2, 29 Let x = -32 - 9. Let n = x - -72. List the prime factors of n. 31 Suppose 37s = 19353 + 1737. List the prime factors of s. 2, 3, 5, 19 Suppose 443g = 431g + 31788. What are the prime factors of g? 3, 883 List the prime factors of (-1174 - -1)/(198/(-264)). 2, 17, 23 Let h(s) = -95s + 17. List the prime factors of h(-4). 397 Suppose -5q + 7 = -3c - 46, 0 = -4c + q - 48. Let o = 10 - 12. Let t = o - c. What are the prime factors of t? 3 Let k = 3861 + -2132. What are the prime factors of k? 7, 13, 19 Let j(p) = -9p + 4. Let a be j(-3). Let v be a - 0 - (-2 - 0). List the prime factors of 24/9v/4. 2, 11 Let w be (-9 + 0)2/(-6). Suppose -z - 42 = -d, 2d + 66 = wd + 5z. What are the prime factors of d? 2, 23 Let q(y) = y2 - 22y - 184. List the prime factors of q(-25). 991 Let l = -75 + 59. Let p(k) = -13k - 4. What are the prime factors of p(l)? 2, 3, 17 Let n(x) = 56x*2 + 19x - 20. What are the prime factors of n(4)? 2, 7, 17 Let u = 1538 + -1291. What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
-1, m, 2 in decreasing order. 2, -1, m Let l be (4/(-10))/((-88)/(-55)). Let j be 1-2 + (-56)/(-26). Put -11, l, j, 4 in ascending order. -11, l, j, 4 Let x = -79 - -89. Let v be ((-4)/(-6))/(x/(-15)). Put v, -4, 5, 2 in decreasing order. 5, 2, v, -4 Let a = 1563 - 1566. Sort 908, a, 0 in decreasing order. 908, 0, a Let a = 228 - 228. Put a, -3, -5/9 in increasing order. -3, -5/9, a Suppose 9n - 41 = -23. Suppose -3a + 8 = a. Let w = a - 4. Sort w, 5, n in increasing order. w, n, 5 Let d = 141.851 + -142. Let s = 8.259 + d. Let v = s + -0.11. Sort v, -1, -3 in ascending order. -3, -1, v Let r(t) = -6t*2 + 5t + 1. Let g be r(1). Sort 4, g, 2, -3 in decreasing order. 4, 2, g, -3 Let f be (12/(-15))/((-2)/(-10)). Let y = 33 + -35. Sort 0, f, y. f, y, 0 Let k(v) = -v*2 - 8v - 7. Let n(x) = -x*2 - 2x + 8. Let t be n(-5). Let q be k(t). Suppose 3a + 15 + q = 0. Put 0, -2, a in decreasing order. 0, -2, a Let m(w) = -3w + 0w - 1 - 6 - 2. Let h be m(-4). Sort -0.3, -2/3, h. -2/3, -0.3, h Suppose -k - 3 = -2. Let o be (-2)/40/10. Put 3, 1, o, k in descending order. 3, 1, o, k Let i = 0.6 - -0.4. Suppose -5g + 4 = -h - 1, -4h = -3g - 14. Suppose hf + 10 = -b, 2b + 1 = -3f + 2. Sort i, 0.1, f. f, 0.1, i Suppose -79 = 3q + 128. Let b = 67 + q. Sort 2, b, -18. -18, b, 2 Let r = -421 - -407. Put r, -5, -1, 0 in ascending order. r, -5, -1, 0 Let w = -7.8 + 7.24. Let n = -0.16 - w. Let f = -0.1 - -0.2. Put f, -5, n in decreasing order. n, f, -5 Let a be (1 + 11/(-14))8/(-6). Sort 16, a, 1/5 in ascending order. a, 1/5, 16 Suppose -12n - 72n - 26n - 330 = 0. Let h = 5 - 3. Suppose i + h + 0 = 0. Put n, i, -5 in descending order. i, n, -5 Let w = 0.011 - 0.211. Sort w, 0.4, -2, -84 in increasing order. -84, -2, w, 0.4 Let s = 387496/21 + -55669/3. Let b = 104 + s. Let q = 1.7 + -1.6. Sort 3, b, q in increasing order. b, q, 3 Let z(l) = l + 14. Let n be z(-9). Suppose nu = -19 - 26. Put -2, u, -5 in decreasing order. -2, -5, u Suppose 410 = 5q + 395. Put -3/2, -3.7, q, 0.5 in ascending order. -3.7, -3/2, 0.5, q Suppose 0 = -0r + 2r - 18. Let w = r + -9. Let f be w/(-1 - 0) + 2. Put -1, f, -4 in decreasing order. f, -1, -4 Suppose -77 = 32u - 39u. Sort u, -1, -5, 3 in ascending order. -5, -1, 3, u Let c = 0.76 - 0.36. Put -0.4, -0.18, 2/11, c in decreasing order. c, 2/11, -0.18, -0.4 Let l(f) = 2f + 2 - 11f + 138f*2 + 0f - 143f2. Let c be l(-4). Put -3, c, 0 in decreasing order. 0, -3, c Suppose -2k + 15 = k. Let d be ((-45)/10)/((66/(-4))/11). Suppose -ky + 7 = -d. Put -3, y, -1 in increasing order. -3, -1, y Suppose -5x - 32 = -3i, 0 = -2x - 7 - 1. Suppose 0 = 3t + 3. Suppose -z + 16 = -5w, w + 5z = -2w - 32. Put t, i, w in decreasing order. i, t, w Suppose -t = 2c - 14 + 1, 0 = -3c + t + 32. Suppose j + 14 = -2r - 6, 5j = 0. Let g = r + c. Sort g, 4, 0. g, 0, 4 Suppose 0 = 5n + g - 16, -2g = 3n - 2n - 5. Suppose 0i + 3i + nb = 21, 5b + 75 = 5i. Sort 4, i, -1. -1, 4, i Let m = -169 - -1523/9. Sort m, -5, -2/9, -0.4. -5, -0.4, -2/9, m Let n = 156.58 - 156. Sort 0.1, n, 0.5 in descending order. n, 0.5, 0.1 Let q = 8.88 - 8.38. Sort -7/8, q, 2. -7/8, q, 2 Let j = 185.8 - 180.8. Put j, -0.3, 1.1, 4/15 in decreasing order. j, 1.1, 4/15, -0.3 Let n(h) = -h3 + 11h*2 + 24h + 21. Let t = -122 + 135. Let d be n(t). Sort d, -4, 1. d, -4, 1 Let d(x) = -x*3 + 4x*2 + 8x. Let c be d(5). Sort c, -2, -3, -1 in ascending order. -3, -2, -1, c Let d(t) = -2t + 1. Let l be d(1). Let x(k) = k3 - 45k*2 - 140k + 7. Let y be x(-3). Sort 4, y, l, -17 in ascending order. -17, y, l, 4 Let b(t) = 4t - 13. Let s(k) = 5k - 14. Let i(o) = -6b(o) + 5s(o). Let d be i(-6). Suppose -2 = -c - 5. Put 5, d, c in decreasing order. 5, d, c Let u be (2(-6 + (-55)/(-10)))/(-5). Put 1, u, 2, 9 in descending order. 9, 2, 1, u Let w = -0.1 - 0. Let m be 52 + (2 - 2 - -1). Let c = -585/11 + m. Sort w, 0.5, c in ascending order. c, w, 0.5 Let y = 601 - 602. Sort 4, -283, y in ascending order. -283, y, 4 Let v = -324 - -319. Put v, 2, -4 in ascending order. v, -4, 2 Let n(g) = -4g*2 - 7g + 8. Let i be n(1). Put i, -2, 3 in decreasing order. 3, -2, i Let b be (2 - -2)/((-3)/6). Let f be (b/6)/4 - 0. Sort 5, 0.2, f in increasing order. f, 0.2, 5 Let u = 3798 + -3797.5. Let b = -1.1 - -6.1. Sort 1, b, u in increasing order. u, 1, b Suppose 6k = 3k - 2j + 211, 0 = -4k - 2j + 280. Let w = k + -67. Put 1, -3, w, -3/8 in decreasing order. w, 1, -3/8, -3 Let y = 151 + -155. Sort -0.2, y, 2 in decreasing order. 2, -0.2, y Let v be 9(-11)/(165/(-10)). Put -4, v, 4 in ascending order. -4, 4, v Let p = 50 - 30. Suppose -1 - p = 7g. Sort -4, -13, g, -2. -13, -4, g, -2 Suppose -19o = 8 + 30. Sort 0, 2, -3, o in descending order. 2, 0, o, -3 Let s = -83 + 88. Put 19, 2, s in decreasing order. 19, s, 2 Let m = -10.2 - -5.2. Let c = 0.22 + -11.22. Let y = c + 3. Put y, m, -4 in descending order. -4, m, y Suppose 0 = 9b - 51 + 15. Let a be b3/16-4. Sort 0, 2, a in descending order. 2, 0, a Suppose 5o = 5f, 2f + 4o - 7 = -o. Sort f, -21, -3 in decreasing order. f, -3, -21 Suppose 3m - 2m = 0. Suppose -5z = -2n + 11, 0 = 3n + 3z - 8 - 19. Put m, 2, 4, n in descending order. n, 4, 2, m Let d = 111 - 331/3. Let c = -7122/1403 - -116/23. Sort c, -1/5, 1/4, d in decreasing order. d, 1/4, c, -1/5 Let s be ((-10)/3)/(4/(-6)). Suppose 27 = -m - 0l + 5l, 2m - 16 = -4l. Put 4, s, m, -3 in descending order. s, 4, m, -3 Let i = 916 - 916. Let o = 6 + -9. Sort -0.5, o, -4, i in descending order. i, -0.5, o, -4 Let m(x) = -x + 9. Let p be m(4). Sort 9, p, 3, -17 in ascending order. -17, 3, p, 9 Let x = -3.9 - -3.94. Let p = x + -2.04. Let g be ((-3)/(-2))/((-33)/4). Put 0.01, g, p in descending order. 0.01, g, p Let l = 3572 + -3572.3. Let d = -0.3 + 1.3. Sort -3/4, l, d in increasing order. -3/4, l, d Let l be (4 - (-50)/(-13)) + (-315)/(-65). Sort 2, l, -17. -17, 2, l Let x(c) = c3 - 4c*2 - 11c - 4. Let g be x(6). Let z be (1/g)/((-2)/(-4)) - -4. Sort 3, 4, z, 1 in increasing order. 1, 3, 4, z Suppose -1 + 0 = o. Let q be (-1)/(3(-6)/90). Sort -4, -5, o, q in descending order. q, o, -4, -5 Let l be ((-4)/4 - -9)/2. Let m be l/(-21)(-12)/8. Let v = -0.56 + 0.06. Sort 0.1, m, v in increasing order. v, 0.1, m Let z be (1 + (-5)/3)3. Let m be 38/152 - 10/324. Sort z, m, 8 in decreasing order. 8, m, z Let g = -733 - -721. Put 5, g, 0.5 in ascending order. g, 0.5, 5 Suppose 36 = 47j - 38j. Sort j, 3/8, -11, -1. -11, -1, 3/8, j Let q = 6316.9 + -6830.13. Let m = -509 - q. Let y = m + -0.23. Sort -1/4, y, -2/9 in decreasing order. y, -2/9, -1/4 Suppose 2p = -p - 3. Let f = -60 - -61. Let w = -14 + 9. Sort f, w, p in ascending order. w, p, f Let p = 1.53 - 0.13. Let q = 0.46 - -0.64. Let l = q - p. Put 0.2, -4, l in descending order. 0.2, l, -4 Let a(v) = v2 - 14v - 28. Let k be a(16). Suppose -4p - 5u + u = -32, -5p - ku + 35 = 0. Put 0, -5, p in decreasing order. p, 0, -5 Let w be ((-4)/(-10))/(53/(-265)). Let z = -1.2 - -0.7. Let d be 40/(-69) + 2/3. Sort w, d, z in descending order. d, z, w Let y = -13/4 + 15/4. Let c = -33.16 - -31. Let z = c + 0.16. Sort 1, z, y in decreasing order. 1, y, z Suppose 5u = 10u + 75. Suppose 24 = 50q - 74q. Put u, 1, q in ascending order. u, q, 1 Let c = -8 + 30. Suppose c = 5k + 3a - 2a, 2 = k - a. Suppose -6u = -5u - 1. Sort u, k, -2. -2, u, k Let g be 225/10962 - 1/(-6). Let t = -7/29 - g. Put 2/5, 1/4, 5, t in increasing order. t, 1/4, 2/5, 5 Let s be (-7 - (-39)/6)/(-1 - 0). Sort 0.4, 20, s. 0.4, s, 20 Suppose g - 7 - 1 = 5z, 4g + z - 11 = 0. Suppose -2f - 3o + 0 = -9, -4o = -gf + 5. Let w = -2.12 + 0.12. Sort f, 5, w in ascending order. w, f, 5 Suppose -v + 9 = 4l, 4v + 0v = 4l - 4. Suppose t - 2g = 2g - 21, -lg = 5t + 17. Suppose -7 = -7a + 14. Sort t, a, -4 in descending order. a, -4, t Let q = 0 - 2. Let t = -382.6 + 423. Let m = t - 40. Put m, -0.07, q in increasing order. q, -0.07, m Suppose -6 = -5a - 1. Suppose -15 = 3i, -3p + i - a = -p. Sort p, -2, 2 in descending order. 2, -2, p Let l = -264 + 268. Sort 5, -9, l, -2 in ascending order. -9, -2, l, 5 Let k = 21 + -13. Suppose 4 = -l + k. Suppose -lt = t. Sort -8, t, -2 in decreasing order. t,	{ "pile_set_name": "DM Mathematics" }
True Which is bigger: -446/39 or 1? 1 Is -4 at least -5360? True Are -304839 and 1 nonequal? True Which is smaller: 10 or 879/98? 879/98 Which is bigger: -18/1867 or 0? 0 Which is greater: 26377 or 26382? 26382 Which is smaller: -2030 or -2031? -2031 Is -554/73 greater than -8? True Which is bigger: -24305 or -24319? -24305 Is -719 greater than -742? True Which is smaller: 136709/3 or 45569? 45569 Is -15 less than or equal to -143923? False Is -2842559 equal to -2842559? True Which is bigger: 866 or 887? 887 Is 4 at most 3394/891? False Are -0.9 and 2860 nonequal? True Is -1 equal to 1/7484? False Which is greater: 2076770 or 2076767? 2076770 Are 55884 and 55885 nonequal? True Is -733 greater than -1040? True Which is bigger: 75/6077 or -1? 75/6077 Which is smaller: -1 or -2/4969? -1 Do -8589171 and -8589170 have different values? True Is -278160 greater than -278159? False Is 716654 smaller than 716653? False Which is smaller: 1707 or -140? -140 Is 11.88 at least as big as 11? True Is -3/66062 bigger than 1? False Is 65.09 equal to -34? False Are -1 and 1908/157 equal? False Is -2051 at least -2058? True Which is smaller: -27942 or -363244/13? -27942 Which is bigger: -174026 or -174039? -174026 Is 616/39 bigger than 17? False Is 5 at least -823094? True Are 3166/95 and 34 equal? False Do 3/5 and -1330/3827 have different values? True Are 5597 and 302 nonequal? True Which is smaller: -3454/433 or -8? -8 Is -2251135 at least 1? False Which is smaller: -96036 or 1? -96036 Is 1363856 >= 1363859? False Which is bigger: 10910 or 10912? 10912 Which is smaller: -1 or -87/254? -1 Which is smaller: -939 or -14066/15? -939 Is 24089 less than 24043? False Are -11 and -21780 unequal? True Which is smaller: 0 or -11124? -11124 Is 82/10539 < -0.4? False Does 1 = -47677/10? False Is -1 equal to -34/27577? False Which is smaller: -12773 or -12764? -12773 Is -95874 at least -95872? False Which is greater: 235 or -33? 235 Which is smaller: 599 or 541? 541 Is -3/93149 >= 1? False Is -1/30311 smaller than -1? False Is 832 at most as big as 170? False Is 33 >= 1596? False Which is bigger: -13 or -9273? -13 Which is smaller: 0 or 17/33307? 0 Does 118499/10 = 11850? False Is -4228/9 less than or equal to -47? True Which is smaller: -13174/649 or -20? -13174/649 Is -7598 not equal to 2? True Is -5504 equal to -5484? False Which is greater: 79208 or 79212? 79212 Which is bigger: -163782 or -655129/4? -163782 Which is smaller: 0.250794 or 1? 0.250794 Which is smaller: 268236 or 268235? 268235 Which is greater: -712151 or -2/3? -2/3 Is 13322 smaller than 13318? False Is -1422 less than -1401? True Which is smaller: 1 or -3/74? -3/74 Which is smaller: -1 or 136/89433? -1 Is -15 less than 16.11? True Is 409 bigger than 103486/253? False Is 1 greater than 104333? False Is -360808 bigger than -360811? True Which is bigger: 0 or -21/3602? 0 Does 1/35029 = 0? False Which is bigger: -3.81651 or 1/3? 1/3 Are -3778 and -3779 unequal? True Which is smaller: 1088742 or 1088741? 1088741 Are -106 and -110 unequal? True Which is greater: -34942 or -34981? -34942 Which is smaller: -43 or -8596/197? -8596/197 Is -85062 smaller than -85061? True Is 117.9748 equal to -1? False Is 598453 less than or equal to 598452? False Which is smaller: 431 or -19/12? -19/12 Which is greater: -2/849093 or -1? -2/849093 Is -1075 less than or equal to -1205? False Is -685211/15 greater than or equal to -45682? True Are 15459 and 2 nonequal? True Is 1359909 <= 1359912? True Is 606/61 >= -1? True Do 5/1647582 and 0 have the same value? False Which is greater: -2/5865451 or -1? -2/5865451 Is 78213 > 78212? True Which is smaller: 1253 or 9? 9 Which is smaller: 198514 or 198517? 198514 Which is smaller: 21081/59 or 357? 357 Do -20.985 and -6 have different values? True Is -14354/289 != -49? True Is 0 != 266/1035? True Is -231332 at most as big as 1? True Which is smaller: -48862 or -48853? -48862 Is -2 greater than -11/60? False Is -132 greater than -369? True Which is bigger: -0.091 or 37065? 37065 Do -8 and -4177/571 have different values? True Which is smaller: 16/5547 or -1? -1 Which is greater: -10511 or -10508? -10508 Is 1/8238 greater than or equal to 1? False Is 16291 greater than or equal to 16273? True Which is bigger: 291865 or 291861? 291865 Which is smaller: -9436 or -9550? -9550 Which is bigger: 30 or 8146? 8146 Which is bigger: 14720 or 14725? 14725 Which is bigger: 3222 or 19333/6? 19333/6 Which is bigger: 5 or 13851? 13851 Is 0.05 greater than or equal to -51.8749? True Is -38/447 less than 1/4? True Which is smaller: 0.1 or 294/55? 0.1 Is -11 > -978? True Are 10228 and 0.18 equal? False Which is greater: 7768/53 or 148? 148 Which is smaller: 553 or -3.65? -3.65 Is 2/256249 < -1? False Are 1 and 2157.6 nonequal? True Is -95/786 > 0? False Do -162 and -181 have the same value? False Which is greater: 16 or 71941? 71941 Is 339019/2 less than 169511? True Which is bigger: 10867 or -0.125? 10867 Which is smaller: -907 or -1/547? -907 Which is bigger: 7124/85 or 83? 7124/85 Is -1 bigger than 5/338479? False Which is smaller: -593 or -84? -593 Is -58977 less than or equal to -1/4? True Which is greater: 98 or 2636/27? 98 Is -933 at most -585? True Is 4693586/7 < 670512? False Which is smaller: 764 or -1/188? -1/188 Which is smaller: -4/21019 or 1? -4/21019 Is 0 bigger than -0.00672? True Is -220826 <= -220826? True Is -651379 at most as big as -651380? False Is -460 bigger than -477? True Which is greater: 3528/1889 or 2? 2 Is -86625/8 smaller than -10827? True Is 1042436 > 1042437? False Do -0.076 and 2.584 have different values? True Which is greater: 10847 or 10898? 10898 Which is smaller: 6 or -0.114548? -0.114548 Are -1772 and -25/4 nonequal? True Do 3247370 and 3247369 have the same value? False Which is greater: 2/7893 or -11? 2/7893 Which is bigger: -2 or 57698? 57698 Is -4345 greater than -4351? True Which is smaller: -26739 or -26743? -26743 Which is bigger: -151/3278 or 0? 0 Which is greater: -614 or -2443? -614 Are -9956 and -9959 non-equal? True Is -13/42 > -504? True Which is smaller: -1/271 or -0.89? -0.89 Is 292042 < 292042? False Which is greater: 147/358 or 0? 147/358 Which is greater: 200405 or 14/9? 200405 Which is smaller: -1 or -54/64043? -1 Is -407906 smaller than -407907? False Which is smaller: 950 or 321? 321 Which is smaller: -1 or -2/27606141? -1 Is 0 smaller than 3/20228? True Is -40 at most 0.79? True Which is greater: 153026 or 153022? 153026 Which is smaller: -1 or -9/3958? -1 Which is smaller: -200.306 or 0.1? -200.306 Is 74531 at least 74533? False Which is greater: -4299760 or -4299759? -4299759 Which is smaller: 177754/9 or 19749? 19749 Is -393515/7 less than or equal to -56215? True Which is bigger: -1/4 or 2452493? 2452493 Is 760/43 bigger than 2/3? True Which is greater: 245 or 184? 245 Which is greater: -2718/155 or -17? -17 Which is greater: -12267 or -12401? -12267 Which is greater: 378705 or 1? 378705 Which is smaller: -676 or -50632/75? -676 Is -1 bigger than 7/162114? False Which is bigger: 0 or -72/1313? 0 Is 2 less than or equal to -621.1? False Does -180 = -43? False Which is greater: 0.296 or 24.3? 24.3 Which is greater: -7/1122456 or 1? 1 Which is smaller: 65024 or 65084? 65024 Which is smaller: -2635 or -2628? -2635 Are 4227/103 and 40 nonequal? True Is 3551 != 273446/77? True Which is smaller: -2/35355 or 1? -2/35355 Which is smaller: 6280 or 6269? 6269 Are -938/79 and -11 nonequal? True Is 1887 equal to 1888? False Which is smaller: 12 or 5960/457? 12 Is -214 less than or equal to -308? False Which is greater: 27/5147 or 1? 1 Which is bigger: -5/132877 or 1? 1 Are 79594 and 238778/3 nonequal? True Is 5664 not equal to 0.06? True Which is bigger: 5211 or 5212? 5212 Do 3/9215 and 16 have different values? True Which is smaller: -2175 or 4? -2175 Which is smaller: 4046 or 4045? 4045 Which is smaller: 17610 or 17600? 17600 Is -135 smaller than -3.25? True Which is greater: 91462 or 91460? 91462 Are -15/1777 and -1 non-equal? True Do 3 and 91475 have the same value? False Which is smaller: 76295 or 76297? 76295 Is 1/154587 at most -3/2? False Is 137123 at most 137123? True Which is smaller: -3025334 or -3025333? -3025334 Which is bigger: 1439/8	{ "pile_set_name": "DM Mathematics" }
be the third derivative of d6/15 + d5/20 + d4/12 - d3/2 - 19d2 + 17d. Determine -5a(x) - 3l(x). 5x3 + 2x Let b(h) = -h - 1. Let u(r) = -2 + 17 - 2 + 337r - 335r. Calculate 3b(y) + u(y). -y + 10 Let j(m) = m3 - m2 - m + 1. Let f(u) = 322u*3 - 3u*2 - 3u + 3. What is -f(b) + 3j(b)? -319b*3 Let w(x) = -160x + 53. Let l(t) = -4t + 2. What is 10l(f) - w(f)? 120f - 33 Let v(q) = -181q - 350. Let c(g) = -60g - 123. Give -17c(z) + 6v(z). -66z - 9 Let a(r) = r + 1. Let c(o) = 16679o - 7 - 16667o + 9 + 8. Let x be (-13)/(-2) - 3/(-2). Determine xa(l) - c(l). -4l - 2 Let m(y) = 97y + 50. Let r(t) = -36t - 17. Determine 3m(f) + 8r(f). 3f + 14 Let u(j) = 56j3 + j2 - 7j - 8. Let c(y) = -2y3 - y2 + y + 1. Determine 5c(f) + u(f). 46f*3 - 4f*2 - 2f - 3 Let l(o) = -3o2 - 2 + 5o*3 - 2 + 6. Let a(y) = 89y - 799. Let s be a(9). Let x(j) = 0j3 + 0j2 + j2 - j*3 - 1. What is sx(f) + l(f)? 3f3 - f2 Let w(j) = 4j*3 - 9j*2 - 9j + 7. Let d(b) = -2b2 + 2b - 2. Determine 3d(i) + w(i). 4i*3 - 15i*2 - 3i + 1 Let x(c) = -1026c2 - 6c - 193. Let z(r) = -1025r2 - 4r - 191. Let t(s) = -2x(s) + 3z(s). Let l(q) = -33q2 - 6. Determine 187l(o) - 6t(o). -33o*2 Let m(t) = 8t - 5. Let b(k) be the second derivative of k*2/2 - k + 7. Calculate 4b(n) + m(n). 8n - 1 Let a(l) = 958l - 66. Let i(s) = 479s - 36. Calculate 6a(z) - 11i(z). 479z Let q(m) = 13m3 - 9m*2 + 13. Let j = 457 - 454. Let i(f) = -3 + 10760f*3 - 10757fj + f2 + 6 - 3f2. What is 9i(o) - 2q(o)? o3 + 1 Let t(a) = -733a*3 + 10a*2 - 14a + 10. Let l(c) = 367c3 - 4c*2 + 6c - 4. Determine -10l(s) - 4t(s). -738s3 - 4s Let u(y) = y*2 + 3y - 17. Let a(i) = -2i3 - 85i*2 + 133i + 47. Let g be a(-44). Let j(d) = 3d2 + 6d - 35. Give gj(h) - 7u(h). 2h2 - 3h + 14 Suppose -2f + 20 = 2f. Let q(o) = o*2 + 2o + 2. Let h(j) = -j*2 - 5j + 7 + 3 - 15. Let u = 96 + -94. Determine fq(i) + uh(i). 3i2 Let z(j) = 47j*2 + 16. Let g(r) = 47r*2 + 15. Give 7g(h) - 6z(h). 47h*2 + 9 Suppose 0 = 1163b - 1161b - 4. Let u(z) = z - 9. Let f(d) = d. Calculate bf(l) - u(l). l + 9 Let j(i) = 1718i2 + 12i + 23. Let l(p) = -574p2 - 4p - 7. Give 2j(n) + 7l(n). -582n2 - 4n - 3 Let d be (-392)/(-42) + 2/(-6). Let l(p) = 2 - 3p2 - 2p + p*2 + 3p + 3p - 3p*2. Let o(z) = -11z*2 + 9z + 5. What is dl(h) - 4o(h)? -h*2 - 2 Let i(t) = -2t*3 + 5t*2 + 12t - 3. Let d be i(4). Let k(x) = -x3 - x2 - 1. Let m(n) = -4n3 + 2n*2 + 2n - 3. Give dk(u) + m(u). -u3 + 5u*2 + 2u Let h(i) = 13i3 + 4i + 4. Let q(d) = 18d2 + 594d + 4. Let o be q(-33). Let a(g) = g*3 - g - 1. What is oa(v) + h(v)? 17v3 Let p(b) = b + 1. Let q(c) = 49c + 19. Let h(x) = 9p(x) - q(x). Let j(g) = 8g + 2. Calculate 3h(v) + 16j(v). 8v + 2 Suppose 373 - 281 = 4o. Suppose op + 217 = -8p. Let a(l) = 3l2 + 7l - 7. Let n(m) = -m*2 - 2m + 2. Determine pn(q) - 2a(q). q*2 Let r(h) = -252h*3 + 11h*2 + 17h + 2. Let s(l) = 126l3 - 6l*2 - 10l - 1. Determine 4r(o) + 7s(o). -126o3 + 2o*2 - 2o + 1 Let j(c) = -c*2 + c + 1. Let l be (((-1)/3)/1)/(32(-10)/(-960)). Let y(z) = -3z2 + 11z. Determine ly(x) + j(x). 2x*2 - 10x + 1 Let z = -335 - -340. Let j(h) = -4h2 - 7h. Let b(t) = -10t - 5t*2 - 2t*2 + 0t2 + t2. Determine zb(o) - 7j(o). -2o2 - o Let b(v) = 425v + 5. Let p(t) = 4t - 1. What is b(q) + 6p(q)? 449q - 1 Let d(r) = 346 - 689 + 4r + 346. Let k(p) be the first derivative of -3p2/2 - 2p + 1. Let y(t) = 2t2 + t. Let x be y(1). Give xk(l) + 2d(l). -l Let b(k) be the second derivative of -11k5/20 + k4/3 - 2k - 6. Let p(m) = 32m*3 - 7m*3 - 4m*3 - 7m*2. What is -7b(n) - 4p(n)? -7n*3 Let w(m) = 25m*3 + 178m*2 + 3m - 2. Let l(x) = 18x3 + 118x*2 + 2x - 1. Give -7l(d) + 5w(d). -d*3 + 64d*2 + d - 3 Let p(g) = -2g*3 + 77g*2 - 27g - 431. Let r be p(38). Let k(d) = -d. Let h(t) = -7t + 21t - 11t. Give rk(m) - 6h(m). -5m Let h be (72/48)/(2 - (-65)/(-30)). Let x(k) = 125k2 - 9k. Let t(z) = -62z2 + 4z. Calculate ht(g) - 4x(g). 58g2 Let u(o) = 260o + 8. Let r(q) = 18q + 1. Determine -2r(w) + u(w). 224w + 6 Let l(o) = 42o*3 + 13o*2 + 13o - 17. Let w(a) = -2a2 - 2a. Let u(v) = -21v3 - 12v*2 - 12v + 8. Let z(i) = -u(i) + 3w(i). Give -6l(g) + 13z(g). 21g3 - 2 Let j(o) = -o3 - o + 1. Let a(s) = -12s3 - 18s + 18. Let n be (4 + -5)(-6 + -1). Let k be (-5)/n - 2/7. Determine ka(v) + 18j(v). -6v*3 Suppose -d - 5 = 0, 181 + 414 = -4j - 3d. Let o = j + 148. Let h(f) = -2f*3 - f + 1. Let b(g) = 3g*3 + 2g - 1. What is ob(p) + 4h(p)? p*3 + 2p + 1 Suppose 2d + 3t = 16, 2708d - t = 2710d - 8. Let a(k) = 28k - 1. Let x(v) = -56v + 3. What is dx(l) + 5a(l)? 28l + 1 Let r(k) = 14k*2. Let g(f) = -2f*2 + 4f*2 + 0f*2 - 61f3 - f2 + 62f3. What is -2g(v) + r(v)? -2v3 + 12v2 Let h(l) = l2 - 169l + 6. Let t be h(0). Let s(o) = 5o*3 + 3o*2 + 9o + 7. Let d(m) = -4m3 - 3m*2 - 8m - 6. Determine ts(g) + 7d(g). 2g3 - 3g*2 - 2g Let t(s) = s - 1. Suppose 0 = -7u + 10u - 12. Suppose 156 = 4n + r - ur, 2n + 5r - 78 = 0. Let h = n - 33. Let x(z) = z - 1. Determine hx(j) - 7t(j). -j + 1 Let u(z) = -4z3 - 82z*2 - z - 2. Let x(t) = 6t3 + t2 + t + 1. What is u(o) + x(o)? 2o3 - 81o*2 - 1 Let p(v) = 3097v - 5. Let o(r) = 5r + 3. Calculate -2o(a) - p(a). -3107a - 1 Let o(n) = 16880n*3 + n - 1 + 0n + n*2 - 16881n*3 + 2n. Let q = 2 + 2. Suppose 2h = q + 2. Let i(g) = g3 - 2g. Determine hi(m) + 2o(m). m*3 + 2m*2 - 2 Let f(i) = -592i*2 + 12. Let m(v) = -5328v*2 + 111. What is 37f(u) - 4m(u)? -592u*2 Let s(p) = 5p - 3. Let l(r) = 19r - 12. Let v(z) = 2l(z) - 9s(z). Suppose 43q - 490 + 60 = 0. Suppose 4 = -b + 8. Let m(j) = 3j - 1. Give bv(c) + qm(c). 2c + 2 Let z(k) = 6k2 - k - 5. Let d(c) = -7c*2 + 4. Suppose -96 = -1090m + 1114m. Determine md(p) - 3z(p). 10p*2 + 3p - 1 Let z(s) = -6s - 23401 + 4s + 46804 - 23405. Let b be -2 - (0 + -18). Let u(g) = -4g - 7 - 4 - 6g + 0g. What is bu(y) - 33z(y)? 6y Let d(w) = 6w + 3. Let j(b) = -201b + 2 + 103b + 101b. Give -6d(z) + 11j(z). -3z + 4 Let r be 3/2 + (-7)/1461. Let u be 2(-38 - r)2/12. Let k(y) = 13y*2 - 7. Let z(d) = -6d*2 + 3. Determine uk(q) - 7z(q). 3q2 Let q(t) = -t3 - 6t2 - 1. Let l(y) = -y2 - 1. Suppose 440o = 439o - 5c + 24, 0 = o - 3c + 16. What is oq(m) + 6l(m)? m3 - 5 Let i(h) = -8h*2 - h - 6. Let f = -18961 + 18966. Let x(g) = -9g*2 - g - 7. Calculate fx(t) - 6i(t). 3t2 + t + 1 Let h(z) = z2 + 2z. Let k(q) = q - 2. Suppose 2i + 81 = 75. Let x(o) = -o*2 - 4o + 6. Let a(g) = ik(g) - x(g). Calculate -10a(d) + 5h(d). -5d*2 Let j(z) = 3z*3 + 7z*2 + 2z. Let q be (-4)/(-6)(7 + -5 + 4). Let m(s) = 1 + s - 1 + qs*2 + 2s*3. Let u be (7/(-3))/(1/3). What is um(f) + 4j(f)? -2f3 + f Let u(x) be the second derivative of x4/12 + x3/6 + x2/2 - 33x. Let b(f) = -3f + 3 - 4f - 11f - 5f2 + 10f*2 + 24f. Calculate b(p) - 4u(p). p2 + 2p - 1 Let v(h) = 9h + 433. Let u(f) = -96f - 4330. Calculate -2u(q) - 21v(q). 3q - 433 Let s(f) = -5f*2 + 14f - 19. Let c be s(2). Let y(o) = 15o3 - o2 - 15. Let h(q) = 3q*3 - 3. What is ch(a) + 2y(a)? -3a*3 - 2a*2 + 3 Let g = -46 + 45. Let f(s) = -4s - 1. Let q(d) = d. Let k(t) = -9t + 3. Let u be k(-3). Let r = 27 - u. Determine gf(v) + rq(v). v + 1 Let f(l) = 56l. Let i(j) = 3441j. Let k(u) = -23u. Let d(h) = i(h) + 148k(h). Give 8d(t) - 5f(t). 16t Let o(h) = -96h3 - 3h*2 - 10h - 2. Let d(j) = 97j3 + 4j*2 + 14j + 2. Calculate 3d(i) + 4o(i). -93i3 + 2i - 2 Let r(d) = d + 3. Let f(t) = t + 190. Determine -f(p) - 2r(p). -3p - 196 Let l(i) = 25i2 - 20. Let x(p) = 1624p*2 - 1305. Let o(n) = -261l(n) + 4x(n). Let b(m) = -14m*2. Calculate -5b(q) + 3o(q). -17q*2 Let j(v) = -2 - 14 + 1 + 7v - 6. Let s(t) be the first derivative of t*2 - 5t - 185. Calculate -5j(f) + 21s(f). 7f Let h(g) = 3909g**3 +	{ "pile_set_name": "DM Mathematics" }
((b3/b)/b)32/(b(-2)/b(-8/3)) assuming b is positive. b(94/3) Simplify (r0r)(4/13)(rrr/r*0r)39 assuming r is positive. r(2032/13) Simplify n*(-31)/(nn/(n/n(-2/3))) assuming n is positive. n(-94/3) Simplify a/(a/(a*11/a))aa10 assuming a is positive. a21 Simplify (w/w(1/4))(28/3)/(((w/w(5/4))/w)/(w/(w1/w))) assuming w is positive. w(37/4) Simplify (aaa/(a/(a6a))aa3)/((a/(a(-1/5)a))/(a(-6/7)/a)) assuming a is positive. a(383/35) Simplify o(1/22)o(-8/5) assuming o is positive. o(-171/110) Simplify (uu1)(-32)(u1)(-2/59) assuming u is positive. u*(-3778/59) Simplify ((u/(uuu2u))/uu(-5))/(u(2/7))(2/51) assuming u is positive. u(-3574/357) Simplify ((ddd/(d/(d/(d/d(4/7)))d)ddd)/(dd/d*(-14)ddd))(-42) assuming d is positive. d606 Simplify (q*(-2)q8)(2/47) assuming q is positive. q(12/47) Simplify (g(-10)/g)(-40) assuming g is positive. g440 Simplify p(1/2)/p(-2/27) assuming p is positive. p(31/54) Simplify (y/(y(1/3)y))(-2/7)y*(-1/4)y(-6) assuming y is positive. y(-517/84) Simplify (r/r*(-15)r)(-20/3) assuming r is positive. r(-340/3) Simplify (l*(-4)l(4/11))(5/6) assuming l is positive. l*(-100/33) Simplify (qq/q(-2/7))(-2/157) assuming q is positive. q(-32/1099) Simplify ((k0)34)(2/35) assuming k is positive. 1 Simplify (s*(2/23)/((s/(sssss7))/s))(3/38) assuming s is positive. s(765/874) Simplify ((x(-2/3))22)(-1/14) assuming x is positive. x(22/21) Simplify g(1/10)/g11 assuming g is positive. g(-109/10) Simplify (l(-1/2))9(ll(-4))/(((l(ll(2/5))/l)/l)/l) assuming l is positive. l(-69/10) Simplify ((f(-5)f)/(fff*(-4/5)ff))/(((f/(f/f(-1/4))f)/ff)/f)(-44) assuming f is positive. f(-91/5) Simplify r(-1/18)/rrrr*(2/19)(r(-2))(9/8) assuming r is positive. r(-821/684) Simplify (f(-5)f(-1/7)f)/(f*(1/4)f6/f) assuming f is positive. f(-263/28) Simplify z*(-1/3)/((zz*(-3)z)/z)zz*(-5/4)z(-5) assuming z is positive. z(-43/12) Simplify (w6)(-3/11) assuming w is positive. w(-18/11) Simplify (l(-1/12)l/l(1/10))/(l(5/6)/(ll(-1/2))) assuming l is positive. l(29/60) Simplify (v31)(-14/3) assuming v is positive. v(-434/3) Simplify f/f(-1/20)fff(-23) assuming f is positive. f(-399/20) Simplify f(2/13)/((f(-8)/f)/f)(f/(f/(f*(-2/7)f)))(-26) assuming f is positive. f(-766/91) Simplify dd(-3/2)d*37d assuming d is positive. d(75/2) Simplify (r8rr/r5)/(r(-2/9)r/(rr*(2/15)rr)) assuming r is positive. r(331/45) Simplify g(-6)g(-19) assuming g is positive. g(-25) Simplify f*(1/2)f*(-1)f8/(f(-1/2)/f) assuming f is positive. f9 Simplify a(-22)a(7/3) assuming a is positive. a(-59/3) Simplify (t(-1/3)t)*(-4/13)((t(tt(-1/3))/t)/t)(-2/19) assuming t is positive. t(-42/247) Simplify u(-38)u(-2/19)/u assuming u is positive. u(-743/19) Simplify (s(-1/3)/(ss(12/7)))(15/2) assuming s is positive. s(-160/7) Simplify (z(-13)/z(1/20))(17/4) assuming z is positive. z*(-4437/80) Simplify ((g/(gg*(-5)ggg))/g)37 assuming g is positive. g37 Simplify qqqqq*0q(-2/21) assuming q is positive. q(82/21) Simplify i*0i/i*4i(i(2/7))(8/11) assuming i is positive. i(-138/77) Simplify (b1/b)4/(b/((b/(b(3/5)bb))/b)b*(3/8)b) assuming b is positive. b(-199/40) Simplify (q(3/5)q/(q/q(3/13)))(-16) assuming q is positive. q(-864/65) Simplify ((ii/i1)(15/7))(-3/11) assuming i is positive. i(-45/77) Simplify (v*(1/46)vv)(-39) assuming v is positive. v(-3627/46) Simplify dd/(dd/(d/(d(dd/(d/(d/((dddd(ddd/(dd*30d))/d)/d)))dd)/d)))dd(d(-24)d)/d assuming d is positive. d(-52) Simplify (k1/(kk(6/5)))/(k(-8)/(k/(k/k10))) assuming k is positive. k(84/5) Simplify (qqqq*(6/11)q)/q*(-7)q(-3)/(q/(q/q(2/5))) assuming q is positive. q(448/55) Simplify ((a/a(-1/16))/aa(4/9))(-29/4) assuming a is positive. a(-2117/576) Simplify ((zz(-8))/z)/z(-2/7) assuming z is positive. z(-54/7) Simplify (y0/(y/(y*(3/10)y)))(-27) assuming y is positive. y(-81/10) Simplify ((m(-1/2))(-2/7))22 assuming m is positive. m(22/7) Simplify ((hh(-1)/h)(3/26))34 assuming h is positive. h(-51/13) Simplify (x2/xx)/x14 assuming x is positive. x(-12) Simplify ((vv2)/v)(12/13)v/(v*(-6)v)vv(-1/7) assuming v is positive. v(792/91) Simplify ((ii/(i/i(1/5)))(5/8))(-4) assuming i is positive. i(-3) Simplify ((j(-2)jj)/j(2/25))17 assuming j is positive. j(-34/25) Simplify (m7/m4)(9/5) assuming m is positive. m(27/5) Simplify (i(-3))30/(i(-2)/i)(-7/3) assuming i is positive. i(-97) Simplify ((i(2/15)/i)/(i1/i))/((i/i4)/(i/((ii/i0)/i))) assuming i is positive. i(32/15) Simplify ((t/(tt(-3)/t))(5/9))(2/11) assuming t is positive. t(40/99) Simplify a9a*6a(aa*0a)(6/25) assuming a is positive. a(412/25) Simplify (h(2/7)/h)25/(h*(-6)(hhh(-4/3))/h) assuming h is positive. h(-242/21) Simplify (q/q(-7))/((q/q0)/q)((qq*6q)/q)/q7 assuming q is positive. q8 Simplify z(-3)/(z/z(-5/2))(zz0/z)(3/17) assuming z is positive. z*(-13/2) Simplify (o((o/(oo(-3/8)/oo))/o)/oo(o*5o)/o)(-1/7) assuming o is positive. o(-43/56) Simplify (d*(-9)dd(3/2))25 assuming d is positive. d(-325/2) Simplify ((ww*(-1/8)w)/((w*(-9)ww)/w))(-32) assuming w is positive. w(-316) Simplify v(-8)/v(2/7)v*(2/5)v(-1/14) assuming v is positive. v(-557/70) Simplify (kk(1/3))(1/77)(kk/k(-1/3))/k(k/k(-4/9))/k assuming k is positive. k(1244/693) Simplify q(-28)/(q/q(-3/4)) assuming q is positive. q(-119/4) Simplify h(-4/7)/(h*(3/32)h) assuming h is positive. h(-373/224) Simplify (i(-2/5))*(5/7)(iii/((ii(i/(i*(-5)i))/i)/i)ii)/i(-1/4) assuming i is positive. i(-1/28) Simplify r(3/8)/(r(-8)/rrr) assuming r is positive. r*(59/8) Simplify (s/(sss(1/5))ss)/s(-1/4)s*(-1/7)sss(-8) assuming s is positive. s(-713/140) Simplify ((h((hhh(-3/7)/h)/h)/h)/h)(-34/3) assuming h is positive. h(340/21) Simplify (k(4/3)k(((k/(((k/(k/(kkk(5/7)k)))/k)/k))/k)/k)/k)(-17) assuming k is positive. k(493/21) Simplify (h/(h/(hh(h/h(5/3))/h)))(-2/15) assuming h is positive. h(-2/45) Simplify l/l(-3/8)l/((l26/l)/l) assuming l is positive. l(-173/8) Simplify h(3/5)h(-14) assuming h is positive. h(-67/5) Simplify (x/(xx2)x)(-39) assuming x is positive. x39 Simplify (c(1/3)/c(-4))/(cc/(ccc1))(-8) assuming c is positive. c(-11/3) Simplify (h(-2/15)/(hh*(-8)))/(hh*1/hh)31 assuming h is positive. h(-827/15) Simplify s*(2/3)sss*(-6)(s*(-2/5)s)45 assuming s is positive. s(71/3) Simplify ((((r/(r/r*(-9)))/r)/r)/r)/(r/(rr*10rr))(r*(2/3)rr)/r(4/11) assuming r is positive. r(76/33) Simplify (v1)(15/4)/(v/v1vvv)(1/70) assuming v is positive. v(519/140) Simplify (u*0/uu*3)/(u/(((uuuu(-1/2))/u)/u))(-14) assuming u is positive. u*9 Simplify ((hh*(-6/11))/(h/(hh(-2/17))))(-31) assuming h is positive. h*(-1953/187) Simplify (d/(dd(-1/2)))(4/3)/(d1)(-31) assuming d is positive. d(95/3) Simplify p(-2/33)/p(-27) assuming p is positive. p(889/33) Simplify (((((ww(-6/7))/w)/w)/ww)/w(-19))(-4) assuming w is positive. w(-480/7) Simplify (g/g23gg)/(g*(-1/2)g) assuming g is positive. g(-41/2) Simplify (w/(w/(w(-6)/w))w(w*2w)/w)(-5) assuming w is positive. w20 Simplify (x(-1))22x/(x2/x)(x/x*(3/2)xx)/x assuming x is positive. x(-43/2) Simplify ((x/(xx/x(-1)))(-18/13))(7/3) assuming x is positive. x(84/13) Simplify (dd(1/12)/d)/d6 assuming d is positive. d(-71/12) Simplify ((x(-9)xx)/(xx/(x/x(-1/4))))(2/27) assuming x is positive. x(-31/54) Simplify (l/(l/l(-1/9)))(-10) assuming l is positive. l(10/9) Simplify (s4)(1/10) assuming s is positive. s*(2/5) Simplify ((pp(-1))(-35))**(2/25)	{ "pile_set_name": "DM Mathematics" }
4g - x. Is 6 a factor of g? True Let y(z) = z2 - z - 3. Let i be y(5). Let d(u) = u3 - 15u*2 - 32u - 10. Let h be d(17). Let n = h - i. Is n a multiple of 2? False Let z = 374 + -91. Let x = -166 + z. Is x a multiple of 15? False Let v = -3 + 13. Suppose -4w + v = 50. Is (-194)/(-4) + 5/w a multiple of 15? False Let i(l) = 6l*2 + 10l. Let u be i(-9). Suppose 3f + 25 = 4c - 505, u = 3c - 3f. Suppose -4m + 30 = -c. Does 11 divide m? False Suppose 9v - x - 1 = 12v, -3x + 6 = 0. Suppose 0p = -4p + 16. Is v27p/(-6) a multiple of 12? False Suppose 3z = 12, i - 6 = -2z + 13. Let n = i + 33. Does 11 divide n? True Let a = 2958 - -1970. Is 34 a factor of a? False Let n be (-9)/(2/8-6). Suppose -nf = -5f - 36. Is 23 a factor of f? False Let r(g) = -51g + 188. Does 5 divide r(-2)? True Let w(u) be the first derivative of u6/45 - u5/120 + u*4/8 - 2u3/3 + 5. Let y(q) be the third derivative of w(q). Does 24 divide y(3)? True Let f(d) = d3 - d*2 + 4d + 2. Let p be f(-5). Is 2 a factor of p/(-30) + (-4)/(-10)? True Suppose 25 = 3u - 2f - 0f, 5 = u - 4f. Suppose -i + 71 - u = 0. Is i a multiple of 8? False Suppose 4w + 3l - 38 = 0, -4l = -2w + w. Is 9 a factor of (-3 + 5 - (-2)/8)w? True Let r(m) = 914m*2 - 17m - 42. Does 8 divide r(-2)? True Suppose d - 2x = -3, 3d - 4x + 7 = -0x. Let w be d/((-1)/10) - 2. Let g(m) = 4m + 3. Is 29 a factor of g(w)? False Is 70 a factor of (-773 + 1)/(-1) - 0 - 2? True Suppose -3c - 5418 = -12c. Is 14 a factor of c? True Let o(c) = c3 - 13c*2 - 13c - 2. Let d be o(14). Let y = 31 - d. Is y a multiple of 19? True Let i = 82 + 516. Does 18 divide i? False Suppose -4a + 3v + 0v = -14, -a = -4v - 10. Suppose -2r - r = -2q - 242, 3r + aq - 238 = 0. Is 16 a factor of r? True Suppose 0y = -2y - 40. Let m be y/(-6)36/24. Let d = m + 51. Is d a multiple of 14? True Let g = 2255 + -1480. Does 9 divide g? False Let i(l) = 39l. Let c be 1/((-2)/(-6)) + -2. Let b be i(c). Suppose 2s - b = -3g, -3s + s = -2g - 34. Does 9 divide s? True Let k be -2 + (15 + -13)/((-1)/(-13)). Suppose -27v + kv = -51. Is v a multiple of 10? False Let z = -21 + 25. Suppose -zk + 0k + 268 = 4b, 3b = -k + 69. Does 15 divide k? False Let s = 10770 + -7538. Is 101 a factor of s? True Let u(a) = 6a2 - 7a - 16. Let g = -109 - -117. Is 24 a factor of u(g)? True Let f = -161 + 233. Does 7 divide f? False Suppose -5k + 3412 = -4j, -5k - 5j = -2j - 3391. Suppose -5h = 3p - 0h - k, -4h = -p + 238. Is p a multiple of 46? True Let z be (-2)/5 - (16/10 + -3). Let k = z - -51. Is k a multiple of 5? False Suppose 4c - 51 = 69. Suppose -3q - 5v = -c, -4v - 68 = -4q + 4. Does 8 divide q? False Suppose -6499 = -10x - 749. Does 13 divide x? False Suppose -4p = -2f + p + 23, -4p - 23 = 3f. Let h be (-2 - 0)4f. Suppose 0 = -5g + hg - 189. Does 24 divide g? False Suppose 0 = -2x - 4x - 18. Is 3 a factor of x - 1 - 32/(-2)? True Let m(x) = x3 - 21x*2 - 21x - 22. Let v be m(22). Suppose v = -26w + 20w + 504. Is 21 a factor of w? True Let h be 300 - 01/5. Suppose h + 12 = 3c. Let k = -63 + c. Does 19 divide k? False Let a be 30/80 + 250/16. Suppose 4o = -9q + 4q - 12, 4q + a = 0. Does 7 divide o - -34 - (6 - 6)? False Suppose 2w + 768 = -0w. Let v = 642 + w. Is 8 a factor of 8/(-28) - v/(-21)? False Let o(b) = -3b + 38. Let q be o(14). Does 40 divide (-801)/q + 4/(-16)? True Suppose 2g + 3g - 5v - 225 = 0, -g - 2v + 30 = 0. Let m = -36 - -64. Suppose 2y + 2z = 5y - m, z = -3y + g. Does 3 divide y? True Suppose -42w = -49w - 1323. Let d = -114 - w. Is 15 a factor of d? True Let g(r) = -r3 + 22r*2 + 16r - 8. Is 27 a factor of g(22)? False Let g(n) = 4n + 2. Let p be g(-2). Let z = 105 + -109. Is -20p(-2)/z a multiple of 15? True Suppose -2j + 538 = -2u, 3u - 2j = 2u - 266. Let x = -154 - u. Does 14 divide x? False Suppose -n = 4q - 740, 14q - 15q = 0. Does 77 divide n? False Let y be ((-262)/(-2))/((-30)/(-90)). Let i = -261 + y. Does 11 divide i? True Let j = -7 + 5. Let c(v) = 17v*2 + v + 1. Let h(s) = -35s*2 - 2s - 1. Let y(p) = -5c(p) - 3h(p). Is 30 a factor of y(j)? False Let a = 0 + 17. Let j = 181 - a. Suppose -2q + 6q - j = 4d, -2q = -d - 77. Does 18 divide q? True Let k = -24 - -16. Let x = k + 17. Suppose xz = 4z + 440. Does 25 divide z? False Suppose 40j + 6 = 42j. Is j/(-5 - (-1063)/212) a multiple of 38? False Let g be (-24)/(-4) + -4 + -6. Let c(t) = -25t - 16. Is c(g) a multiple of 12? True Suppose 1210 = 7r - 1114. Is r a multiple of 13? False Suppose -2c + 4 = 0, -3n + 2n = -c - 38. Suppose -279 = -4o + 5b - 77, -n = -o - 4b. Does 12 divide o? True Suppose -27 = -4h + a, -2h + 3a + 13 = 2a. Suppose 4p - 5p - 3m - 7 = 0, -m = 5p - h. Suppose -x + p = -3. Is 5 a factor of x? True Let f = 116 + 154. Is f a multiple of 54? True Let a = 1773 - -388. Is 69 a factor of a? False Suppose -7n = -0n - 287. Let i = n - -52. Is i a multiple of 20? False Is (-38)/(-8)4/(-8)-8 a multiple of 2? False Suppose -8r + 278 = 110. Let v = 21 - 14. Is 2/v - (-603)/r a multiple of 11? False Let r(i) = 25i + 3. Let j be r(3). Let o = -54 + j. Does 12 divide o? True Let d(u) = -63u3 + 4u*2 - 3u - 35. Does 29 divide d(-3)? True Suppose 9s = 10s + 2. Is 17 a factor of 4/8249(-4)/s? False Does 74 divide -6(-2 - (-608)/(-24))? False Suppose 0i - 2i = -244. Suppose -24t + 193 = 73. Suppose 3v + tj - i = 0, 3j = -2v + 6j + 94. Is 6 a factor of v? False Suppose 0 = -2g - 3c + 2103, -4g + 3c + 5252 - 1037 = 0. Is g a multiple of 39? True Suppose -2s = -2t - 12, -2t - 7 = -1. Suppose z + so - 10 = 0, 8z = 3z + 4o + 12. Suppose -4j - z = -24. Does 5 divide j? True Suppose 3y - y - z = 459, 3y = -4z + 672. Is y a multiple of 19? True Let r(m) = m*3 + 11m*2 + 14m + 18. Suppose -3b = 7 + 20. Let j = 0 + b. Does 16 divide r(j)? False Let l(c) = -97c*3 - 5c*2 - 14c + 3. Is l(-3) a multiple of 18? False Let q(i) = i*2 - 11i + 20. Let l be q(9). Let t = 16 - l. Does 14 divide t? True Suppose -1050 = 3s - 10s. Does 25 divide s? True Let a(n) = n*3 + 17n*2 + 9n + 155. Does 6 divide a(-16)? False Suppose 0 = w + w - 12. Suppose 4o - s = -2s + 50, -s + 24 = 2o. Let y = o - w. Is y a multiple of 5? False Suppose 17o - 10084 = 5284. Is 8 a factor of o? True Suppose -279 = -4r + 297. Let g = r - 82. Does 2 divide g? True Let n(u) = 6u*3 - 9u*2 + 3u + 11. Is 11 a factor of n(6)? True Let a(t) = -t*3 + 27t*2 - 36t + 24. Does 3 divide a(25)? False Let g be 110/(-44)(-79 - 1). Suppose 2f - 3f = -g. Does 50 divide f? True Let m(w) = 29w + 67. Does 27 divide m(7)? True Let v(h) = -h*3 - 39h - 32. Is 22 a factor of v(-6)? True Suppose -7v - 968 + 3404 = 0. Is v a multiple of 22? False Is 37 a factor of -1(-2331)/(-14)(-8)/6? True Suppose -3x - 3y + 6y + 3 = 0, -5x = -3y - 9. Does 29 divide (-60)/18 + x - 296/(-6)? False Does 20 divide 2(35/(-5) + 297)? True Suppose -3o = -225 + 60. Suppose -m + 3q = -0m - o, q - 165 = -3m. Is 11 a factor of m? True Let i(t) = 48t. Let g be i(-1). Let k = -26 - g. Is 8 a factor of k? False Let f(d) = 4d + 67. Suppose -8m = -11m. Does 18 divide f(m)? False Let s be (4/(-3))/((30/(-9))/5). Suppose -sl - 5r = 2l - 293, 2r = 2. Is 9 a factor of l? True Let f(h) be the second derivative of -3h*4 + 7h3/6 - h2 + 3h. Let m be f(4). Is 4 a factor of 2/7 + m/(-35)? True Let j(g) = 3g*2 - 14g - 12. Suppose 4 = -s - 3p, -3p - 7 = -4s + 37. Does 4 divide j(s)? True Let u(y) = -y3 + 7y*2 + 6y + 19. Let m be u(8). Suppose -b - mb = -t - 390, 2t - 287 = -3b. Does 18 divide b? False Let v(g) = -15g - 49 - g + g. Does 42 divide v(-20)? False Let v(n) = -15n2 + 2n - 4. Let h be v(-4). Is 8 a factor of 2/9 - 3976/h? True Is -1 - 11 - (-79 + -19) a multiple of 21? False Suppose 2g - g + 5o + 34 = 0, g - 5o = 16. Let d = 63 + g. Is d a multiple of 9? True Suppose 9 = 4w + 4r - 3r, -3w + 2r + 15 = 0. Suppose -5z + 240 = 5u, -wu - z = -u - 95. Is 24 a factor of u? False Let f(m) = 43m + 6. Let j(p) = -21p - 3. Let t(s) = 4f(s) + 9*j(s). Let o be 7/(-2) - (-3)/6. Is t(o) a multiple of 12? T	{ "pile_set_name": "DM Mathematics" }
lest value in g, -0.2, 2/5, 0? 0 Suppose -90 = 5u - 40. Let v be (-63)/(-140)u/(-12). What is the second biggest value in -2/7, 2, v, 1/7? v Let v = -3.03 - -0.03. Suppose -q + 300 = 5q. Let k = q + -52. What is the biggest value in k, v, -0.5? -0.5 Suppose -3h + 3x - 4 + 19 = 0, -24 = -4h + 5x. Which is the second biggest value? (a) -2 (b) -0.05 (c) -4 (d) h b Let j be 2(-40)/28 + (-6)/(-2). Let w = 26 + -25.9. Which is the fourth smallest value? (a) w (b) 6 (c) j (d) 3 b Let q = -4/15 + 16/15. Suppose 0 = -a - 4a + 5i + 15, 4a = -4i - 4. What is the second biggest value in q, a, -2? q Suppose 3i - 380 = -128. Let f = i - 251/3. Which is the second smallest value? (a) f (b) -2/13 (c) 4/9 a Let z = 0.11 - -1.89. Let g = -6 + 4.2. Let i = z + g. Which is the second biggest value? (a) -5 (b) i (c) 2/7 b Let l = -4.411 - 0.589. Which is the third smallest value? (a) -4 (b) l (c) 0 (d) 0.6 c Let k be (2/(-11))/((-64)/(-704)). What is the second smallest value in -78, k, 2/9? k Let v be (-2)/1 - (-40)/18. Let f = 0.057 - -12.243. Let t = -12.4 + f. Which is the second biggest value? (a) v (b) -8 (c) t c Let j be (-295)/(-90) + 7 + 183/(-27). What is the third smallest value in -1/4, 2, j? j Suppose -26p + 31p + 25 = 0. Which is the second biggest value? (a) -1 (b) p (c) -41 b Let w = 38.2 + -36. Let s = w + 1.8. Let t = -4.3 + s. Which is the third biggest value? (a) 3 (b) t (c) -3 c Suppose 144 = -4v + 556. Let j = -101 + v. Which is the third smallest value? (a) 0.5 (b) j (c) 0.2 (d) -2 a Let n = 22 - 19.3. Let h = -5.7 + n. What is the biggest value in 0.5, h, 2/7? 0.5 Let t be 2/(-6) + (-9)/54. Which is the second smallest value? (a) -1 (b) 4 (c) 100/7 (d) t d Let r be (-3)/(-6)(-2)/5. Let v = -9.41 + -0.09. Let s = v - -10. What is the third smallest value in r, s, -2? s Let j = 1230 - 4917/4. What is the smallest value in -0.3, j, -4? -4 Let s be (2/24)/(6/36). What is the second biggest value in 5, -5, -0.2, s? s Let s = -391 - -384. Which is the biggest value? (a) s (b) 2 (c) 0.21 b Let m = -253 - -251. Let a = 2.8 + -3. What is the third smallest value in -3/5, a, m? a Let q = -17.6 - -22. Let j = 3.4 - q. Which is the biggest value? (a) j (b) -2/7 (c) 1/5 c Let o = -3 + 3.5. Let i = 0.009 - 0.123. Let s = 0.114 + i. Which is the third biggest value? (a) s (b) o (c) -8 c Let h = 40.3 - 41.3. What is the third smallest value in 0, h, 3, 1? 1 Let z be ((12/(-40))/(-1))/(48/(-64)). Let w = -16 + 16.9. Which is the second smallest value? (a) -1/2 (b) w (c) z c Let l = 3 + -4. Let u = -0.03 + -2.97. Let b = 290 - 285. What is the second biggest value in l, b, u? l Let b = 0.412 + -0.812. Let p(k) = k2 - 4k + 5. Let f be p(6). What is the smallest value in -2/7, b, f, 2/11? b Let y = 14.7 - 0.2. Let u = -3.5 - y. Let z = u + 17.9. What is the biggest value in 3, z, -2? 3 Let n be (-14)/(-6) + (-5)/104. What is the second biggest value in n, 3, 1, 2? 2 Let v = -2.07 + 2.37. Let b be -1 + (-72)/42 + 6/2. Let p = -2 - -5. What is the biggest value in v, b, p? p Let q = 9.4 + -9. Let h = -0.04 - -1.04. Let l = -2/49 + 55/147. Which is the second biggest value? (a) h (b) q (c) l b Let l = -0.144 - -0.156. Which is the second biggest value? (a) -3 (b) -1 (c) 5 (d) l d Let i = 305 - 919/3. Let x = -17.4 - -17. Which is the fourth biggest value? (a) 4 (b) x (c) i (d) 5 c Let x = -76 + 25. Let f = x + 54. Let n = 0.1 + -0.1. What is the second biggest value in f, n, -2/11? n Suppose -3l + 0l = 12. Let b = -3.24 + 3.14. What is the second biggest value in l, -2/9, 1/11, b? b Suppose 5q = -2o - 49, q - 1 - 13 = o. Let s(g) = -3g - 58. Let p be s(o). Which is the second smallest value? (a) 0.4 (b) -3 (c) p b Suppose 7z - 88 = -137. Which is the second biggest value? (a) 0.1 (b) -3 (c) z (d) 3/7 a Let y = 69 + -69. Let x = -1.57 - 0.23. Let h = -2.2 - x. Which is the second smallest value? (a) 0.7 (b) y (c) h b Let w = -1 + 3. Let g be 2/16 - (3860/672 + -3). Let n = g - -7/3. Which is the third biggest value? (a) n (b) -2/5 (c) w b Suppose 4d + 142 = -38. Let v be -1 + (-32)/(-5) + 18/d. Which is the biggest value? (a) v (b) 9 (c) 3 b Let y = -66 + 66.4. Let x = 1 - -4.4. Let v = y - x. Which is the second biggest value? (a) -3/4 (b) v (c) 2/5 a Let h = 71 - 70.944. Let j = 1.056 - h. Let b be 2/(-8)40/(-6). What is the biggest value in 1/2, b, j? b Suppose 8 = x + 5. Suppose -2u = -xu - 1. Let k = 0.2 + 0.3. What is the second smallest value in 2, u, k? k Let k = -4.2 + -0.8. Let g = 176.1 - 176.4. Which is the smallest value? (a) k (b) 0.2 (c) g a Let q = -0.005 - 138.995. Let p = q - -136. Which is the second biggest value? (a) 1/3 (b) 0.5 (c) p a Let f = -2046.5 - -2046. Let g(m) = m3 - 7m*2 + 6m + 1. Let j be g(6). Which is the smallest value? (a) f (b) 3 (c) -2/17 (d) j a Let l be ((-28)/(-126))/((-3)/(-3)). What is the second smallest value in 1, -7, l? l Let d be -5((-48)/18)/(-8). What is the fourth biggest value in -1/5, d, -0.5, 3/7? d Let u = 5.7 - 2.4. Let y = -2.9 + u. What is the third biggest value in 3/4, y, 1? y Let p = -52 - -56. Let j be p((-21)/6 + 3). What is the third biggest value in j, 2, 0, 5? 0 Let n = -12.6 + 15. Let o = -2 + n. Let r = o - 1.4. What is the third biggest value in -2, 5, r? -2 Let c = -73 - -73. Suppose 5p - 4p = -5z + 29, -4p = 4z - 20. Suppose -2t + 2j + 16 = 0, c = 5t + j - z - 10. What is the biggest value in t, 0.01, -1? t Let y be -109(-10)/492 + (-24)/(-72). Let t = y + -2/41. What is the biggest value in -2/19, t, 5, -3? 5 Suppose -4h = -2h - 8. Suppose m + i = -1, 3m + hi - 1 = -6. Let o = -7/6 - -5/3. What is the third smallest value in 0.04, o, m? m Suppose -4p + 32 = 4x, -5p + x + 6 = -10. Suppose pi = i + 72. Let q be i/(-64) - (-31)/40. What is the smallest value in 3, 4, q? q Suppose -40 - 285 = -13c. Let x be (4/(-6))/(c/10)12. What is the biggest value in -5, 1, x, -5/2? 1 Let x = -343 + 2405/7. Let m be (4/(48/54))/(-12 + 21). What is the biggest value in 1/20, m, x, 4? 4 Let z = -0.708 - -0.708. What is the second biggest value in 0.082, z, 1? 0.082 Let h be 0 - (-8)/6 - 1. Suppose -n - 5u = -24, 4n - 41 = -5u - 5. Suppose 2y = 6y - n. Which is the third smallest value? (a) y (b) -3/4 (c) h a Let f = 3.72842 - -0.27158. Let o = 0.1 - 0. Which is the biggest value? (a) 19 (b) f (c) -1/2 (d) o a Let d = -15.5 - -14.5. Which is the second biggest value? (a) -51 (b) 3 (c) d c Let p = -16 + -27. Let c = 41 + p. What is the biggest value in 1/6, c, 0? 1/6 Let z = 9 - 5. Suppose v = -4x - zv, 5x - 45 = 5v. Let m = -1592/20525 - 2/821. Which is the third smallest value? (a) m (b) x (c) 3 b Let d be 4/8(-4)/6. What is the biggest value in -0.3, d, 0? 0 Suppose 6n - t = 11n + 565, n + t = -113. What is the fourth smallest value in -1, 0.3, n, -0.4? 0.3 Let z = 17.9 + -17.52. Let v = 0.1 + -0.02. Let p = v - z. What is the second biggest value in -0.4, -1/11, p? p Let w = 0.2 - 0.1. Suppose 17 - 14 = 3r. Which is the third smallest value? (a) w (b) r (c) 0 (d) 5 b Let p = -273/8 - -3533/104. Let n be (1 + 1)(-2)/(-36). What is the second biggest value in p, n, 5? n Let d = -275.1 + 261. Let l = d - -13.7. Which is the biggest value? (a) 10 (b) l (c) -4 a Suppose 0 = s - 4s - 21. Let l = 12 + s. Suppose -14m = -13m + 2. What is the smallest value in m, l, -1/3? m Let n = -0.3 + 0.96. Let f = n + -0.26. What is the third smallest value in 4, 0.1, f? 4 Let l = -211.1 + 211. Let k = -17 - -16. Which is the fourth smallest value? (a) k (b) 4 (c) -2 (d) l b Let u = 0.28424 + -0.08424. Let j = 0 - -0.02. Which is the second biggest value? (a) u (b) 1 (c) j (d) 2/7 d Let p be (-2)/2(-4)/(-38). Let y = -3692 + 47994/13. What is the second smallest value in 3, -0.04, p, y? p Let d = 89 + -84. Let p = 27 - 245/9. What is the fourth biggest value in p, d, 0.3, -5? -5 Suppose -3b - 9 = -0b. Let d = -938 + 937.9. What is the third smallest value in -1/3, d, b? d Let n = -3.6 - 0.4. Which is the second smallest value? (a) n (b) -10 (c) 5 a Suppose -5n = -4h + 17, -2n + 47 = 4h + 3n. Suppose -2q + 2g = -3q + 5, h = 4	{ "pile_set_name": "DM Mathematics" }
-57 Rearrange (4 - 2f + 6 + 3)(3f + f - 2f) to the form tf + x + rf*2 and give t. 26 Express (-2 + 6 - l - 2)(-56 + 26 + 26) in the form z + yl and give y. 4 Rearrange 61a*2 - 16a*2 + 68a*2 to the form ka*2 + n + va and give k. 113 Rearrange 10c2 + 3c4 - c3 - 13 - 9c2 + 11 to the form pc*4 + zc*2 + l + wc + yc3 and give p. 3 Rearrange (4 - 3 + 1)(-46p + 16p + 6 - 6) to the form q + ip and give i. -60 Express 7i - 7 - 7i - 2i3 + i4 in the form bi2 + xi*4 + vi*3 + oi + l and give b. 0 Rearrange ((-g - 3g + 2g)(0 + 4 - 3) + g + 5g + 0g)(-5g - 2g + g) to the form zg + sg2 + q and give s. -24 Rearrange (-u + u + u2)(5u - 2u - 2u)(7 + 15 + 2) to l + iu*2 + ru*3 + mu and give m. 0 Express (-5q + 3q + 0q)(q - 4 + 4) - 6q2 - 12 + 12 in the form zq*2 + y + xq and give z. -8 Express 42s + 5s + 46s - 31s as fs + j and give f. 62 Rearrange 18 - 25 + 24 + j to the form k + oj and give k. 17 Express (-2 + 2s2 + 2)(2 - 2s - 2) + 9s - 4s3 + 0s*3 - 11s - 4s3 + 3s*3 + 2s*3 in the form fs*2 + ps*3 + qs + v and give q. -2 Rearrange 2 + 2o4 - 3o*4 + 4o4 - o3 - 5o4 to the form mo + q + zo2 + go*4 + wo*3 and give g. -2 Rearrange (-21 - 40u + 20 + u)(-2u - 3u + 2u) to xu2 + su + b and give x. 117 Express -14g2 - 42g*2 + 5g*2 in the form sg*2 + qg + f and give s. -51 Rearrange (17u + 13u - 14u)(-u - u + 3u)(-1 + 1 + 1 + (0 + 1 - 3)(-2 + 5 + 0)) to the form a + tu*2 + pu and give t. -80 Rearrange (1 - 6 + 4)(f + 2f - 4f) - 99f - 74f - 130f + 17f to tf + b and give t. -285 Rearrange h*2 + 4h*2 + 2h*4 + 4h - 2h + 2h*2 to b + ih*3 + dh*2 + uh*4 + ch and give u. 2 Express 0l - 3l*2 - 7l*2 - 2l - l*2 as t + wl + il2 and give i. -11 Express 273 - 273 - 88o in the form f + yo and give y. -88 Rearrange (0a - 2a - 2a*2 - 3a*2)(-5 + 5 - a) to qa2 + k + fa*3 + la and give q. 2 Express 205 - 205 - 8k + (0 + 0 - k)(-2 - 3 + 3) + 0k - 6k + 5k - 1 + 1 + 2k as mk + i and give m. -5 Rearrange 2 - 19c*2 - 2 + 4c*2 to the form xc*2 + f + gc and give x. -15 Rearrange (3o3 - 3o + 3o)(-3o + 3o + 7o)(-3 + 0 + 1)(1 - 5 + 2) to the form mo*4 + co*2 + po + zo3 + r and give m. 84 Express (2w - w + 2w)(0 - 1 + 3)(1 + 1 - 6) as j + nw and give n. -24 Express 12k2 + 5k - 2k - 3k - 1 as hk2 + pk + m and give m. -1 Rearrange (2t + 3t - 7t)(0t + t + t) to the form ot*2 + k + jt and give o. -4 Express -11 + 0o2 - o2 - o2 + 0o*2 as bo*2 + uo + h and give u. 0 Express 18 + 14 - 2w + 0 - 7 in the form cw + n and give c. -2 Express -112x3 + x4 + 114x*3 + 1 + 3x - x in the form mx + f + kx*3 + ix*2 + zx*4 and give k. 2 Rearrange (-2 + 2 + 3)(4 - 4 - 3g)(-97 + 4g + 97) to the form o + mg + zg2 and give z. -36 Rearrange -2w + 1 - 2w3 - 6w - 5w to the form hw*2 + gw*3 + bw + m and give m. 1 Express 2z + 1 + 2z3 + z3 - 5z3 + (-z2 + 2z - 2z)(-z + 1 - 1) as qz + jz*2 + m + fz3 and give f. -1 Express (r2 - r*2 + 2r*2)(2r2 - 2r*2 - 2r*2) - 2r*4 - 22r*4 - 3r*4 in the form gr*2 + pr*4 + fr*3 + a + ur and give p. -31 Express -297 + 297 - 9b + b2 as i + kb + lb2 and give i. 0 Express (-3h + 7h - 2h)(5h*3 + 10h*3 + 2h*3) as mh*2 + fh*4 + s + wh + jh3 and give w. 0 Rearrange (-7 + 2 + 2)(-4f + 6f + 0f) + f + 0f + 2f to t + wf and give w. -3 Express -3h - 2h - h*2 + 0 - 1 - 13h as dh + r + yh*2 and give d. -18 Rearrange (0 + t + 0)(-16 + 17 - 8t + 11t) to pt + st*2 + f and give p. 1 Rearrange -1 + 6w*3 - 2w*2 - 4w*3 - 3w*4 - 4w*3 to mw*2 + kw*4 + tw + j + zw3 and give k. -3 Rearrange (3 - 3 - 2w*2)(4 - 14w2 - 4) + (2w*3 - 3w*3 + 3w*3)(w - 6w + 4w) to yw3 + l + tw*2 + pw*4 + hw and give p. 26 Express -4m2 + 3m*2 - 2m*4 + 3m*3 + 2m - 3m3 - 1 in the form bm*2 + hm + um3 + l + vm*4 and give v. -2 Rearrange 248f*3 - 2 + 0f + 5f2 - 2f - 252f3 to qf*3 + kf*2 + rf + s and give k. 5 Rearrange -3x + 3x - x*3 + (0x + 0x2 - x2 - x)(122x + 108x - 367x) to the form yx + zx3 + ix*2 + a and give i. 137 Rearrange (9 - 8 + 20)(5 - 5 + 2q)(0 - 3 + 1) + (-2q + 3q + q)(1 - 5 + 3) + 0 + 0 + q to t + zq and give t. 0 Express 5h - 13h + 11h as nh + f and give n. 3 Rearrange 22y - 5 - y3 + 0 - 24y to the form gy + v + ry*2 + oy*3 and give o. -1 Rearrange 2f*4 + 0 + 0 + 3f*4 + 4f*4 - 6f*4 + (23 - 18f*4 - 23)(-4 + 2 + 4) to a + sf4 + tf*2 + hf*3 + zf and give s. -33 Express -2 + 10n - n2 - 9n + 25n3 - 4n*3 in the form y + ln*2 + an*3 + mn and give y. -2 Express 2i2 - 6i*3 + 9i*3 + 3i*3 in the form ti*2 + vi*3 + hi + x and give v. 6 Express 4u + 2 - 3u - 2u3 - 5u*2 + 6u*2 + 7u as bu3 + qu*2 + z + lu and give z. 2 Rearrange (1 + w2 + w2 + 23w2 + 2w)(-2w + 2w - 2w*2) to ow*3 + bw + pw4 + jw*2 + f and give j. -2 Rearrange -2l2 - l2 + 2l2 + (2 + 2l - 2)(-2l + 0l + l) to the form nl*2 + d + xl and give n. -3 Express -s2 + s3 + 1 - 7 - 2s4 - s2 - 12s + 10s in the form bs + us2 + ns*3 + q + ls*4 and give q. -6 Rearrange 21a - 9a + 3a*3 + 7a to the form ca2 + p + la*3 + ba and give l. 3 Rearrange t*2 - 3 + 3 + 4t*2 to the form a + xt + ct2 and give c. 5 Rearrange (-1 + 3 - 4)(-2l2 + 0l*2 + 0l*2) + 16l*2 + 134 - 134 to the form x + kl + ul2 and give u. 20 Rearrange (-14p + 5p + 7 + 7p)(-3 + 6 - 4)(p + 3p - 2p) to the form mp2 + u + rp and give r. -14 Express 2f2 + 3 + 22f + 8f - 16f + (-4f + 3f - f)(3f - 2f - 3f) in the form l + nf2 + bf and give l. 3 Rearrange (-3 + 3 + s*3)(7 - 5 + 2) + 9s - 9s + 8s3 - 5 + 5 + 2s*3 to the form ws + gs2 + cs3 + i and give c. 14 Rearrange -4 + p4 + p + 3 + 3p4 + 2p4 + p3 to l + gp3 + mp*4 + jp + yp2 and give g. 1 Rearrange 4s + 0 + 4 + 6s2 - 4s to the form ts + ys*2 + g and give y. 6 Express (-430 - 492 + 681)(2s - 3s + 2s) as js + h and give j. -241 Rearrange w*2 + w - 4w*3 + 6w*3 - 456w*4 + 459w4 + w2 - 3 to uw2 + fw + yw4 + ow*3 + i and give y. 3 Express t - 4t + 4t as m + zt and give z. 1 Express (12 - j - 12)(2j + 16j + 4j) in the form rj + yj*2 + c and give y. -22 Rearrange -110 + 5h*4 + 110 + 2h*4 - 2h*4 + 3h4 + (1 - 1 + h3)(-4h + 3h + 3h) to ih3 + th + nh4 + g + ah*2 and give n. 10 Express -z + 3z + 7z + (5 - 2 - 1)(-2z + 3z + z) - 7z + 13 - 13 in the form lz + p and give l. 6 Rearrange 9 + 2n2 + 5 - 8 to dn*2 + fn + j and give j. 6 Rearrange -2i2 - 15 + 14i*4 + 2i - 43i4 + 13 to the form ji*2 + x + yi + pi3 + oi*4 and give o. -29 Express 3c*2 + 0 + 0 + (2c + c - 5c)(0c + 0c + c) + (-c + 0c + 0c)(c - 2c + 6c) as ic*2 + zc + n and give i. -4 Express 3n - 2n + n*2 + 27n*4 - 2n*3 - 24n*4 in the form g + sn*4 + on*2 + ln + fn3 and give o. 1 Rearrange -2g*3 - 16g - 2g2 + g3 - 15g - 10g to the form vg*2 + k + rg*3 + yg and give y. -41 Express (11j3 - 4j*2 - 3j*2 - 10j*3)(0j - j + 2j - 2) in the form ij3 + cj*2 + fj + bj4 + l and give b. 1 Rearrange -3 - 28w + 1 - 45w to the form rw + n and give r. -73 Express -38j2 + 5j*4 - 3j4 - j3 - 2j + 41j*2 as oj*3 + xj + uj4 + q + cj*2 and give o. -1 Rearrange -16z*2 - 19z*2 + 8 + 2 - 8 to s + az + yz2 and give y. -35 Express (0n + 0n - n)(-3 + 3 - n*3)(-3 - 8 + 5) in the form un2 + kn + ln4 + rn*3 + c and give l. -6 Express 13m - 3 - 12m + 56m in the form lm + k and give l. 57 Express (1 - 2j - 1)(3j*2 - 9j*2 - 7j2 + j3) as nj2 + fj*4 + hj + k + uj3 and give u. 26 Rearrange -2a + 1 + a*3 + 7a*2 - 8a*2 + 3a*2 to ma*2 + fa + wa3 + q and give q. 1 Rearrange (-3u + 2u - u)(-1 + 1 - 1)(4 + 0 - 3) to the form nu + f and give n. 2 Express 19 - 10 - 19k - 11 in the form y + pk and give y. -2 Express (4 - 3	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.