Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
+ 461. Let p = n + 485. Calculate j(p). -9 Let t(j) = j - 4. Suppose 0 = -201s + 215s - 112. Give t(s). 4 Let z(q) be the first derivative of 2q3/3 + 7q*2/2 + 5q - 7. Suppose 2o = 3v + 12, 4v + v - 5o = -20. What is z(v)? 9 Let s = -10435 + 10430. Let i(k) = -k. Let q(a) = -5a + 1. Let d(r) = -4i(r) + q(r). Let m(l) = 2l - 2. Let b(w) = d(w) + m(w). Calculate b(s). -6 Let b(a) = 6a - 240. Suppose -o = 1, -84o = -2w - 78o + 86. Determine b(w). 0 Let y(v) = -v2 - 5v + 16. Let k(b) = -2b3 + 46b*2 - 44b + 5. Let u be k(22). Calculate y(u). -34 Suppose -9 = -3z + 243. Let v(y) = -9 - 92y + 11 + zy. Let w be (-1)/1 - (3 + -2). Give v(w). 18 Let o(x) be the second derivative of 2x*3/3 - 21x*2/2 - 3x + 13. Determine o(10). 19 Let v(f) = 3f - 1. Let m(n) = 97n + 40. Let g be m(-10). Let r = g + 927. Give v(r). -10 Suppose -22s = 6s - 55 + 307. Let r(b) = -b*3 - 10b*2 - 7b + 14. What is r(s)? -4 Let g(u) = -u*3 + 9u*2 + u - 9. Let v be g(9). Let x(t) = -3404t - 3396t + 6801t - 16. Give x(v). -16 Suppose 0 = 3a - 3b + 39, -5a - 74 = -21b + 25b. Let g(k) = -k2 - 21k - 30. Give g(a). 68 Let l(a) = -2a2 - 33a + 38. Let y(u) = u*2 + 46u + 431. Let c be y(-14). Calculate l(c). 21 Let k(o) = -15o + 35. Let q(p) = -4p. Let h(w) = 7k(w) - 28q(w). Determine h(-35). 0 Let o(w) be the first derivative of -20w3/3 + w - 5. Suppose 0 = h - 4u - 13, 2h = u + 2u + 36. Suppose 15 - h = 6r. Determine o(r). -19 Suppose 2n - 6 = -0n. Let t(s) = -83010s + 4s2 + 0s3 - s3 + 83007s. Give t(n). 0 Let i(p) = 5p + 62. Let c be i(-12). Let y(n) = 253nc - 6n + 2 - 254n2 - 7 - 13n + 3n. Give y(-16). -5 Let c(x) = x2 - 2x - 60. Let r(m) = -m*3 + 86m*2 - 326m - 171. Let z be r(82). Calculate c(z). 3 Let f be (-2)/(-3) - 4/6. Suppose -s + f + 2 = 0. Let p(c) = 6c + 55. Let z(u) = u + 10. Let w(o) = -2p(o) + 11z(o). Determine w(s). -2 Let k(o) = 2o*3 - 58 + 5o - 10o3 + 0o*3 - 10 + 63. What is k(2)? -59 Let f(r) = 3r*3 - 4678r*2 - 2r + 4681r2 - 4r*3. Suppose 11 = 5o - 2u + u, 7 = 2o - 3u. What is f(o)? 0 Let a(p) = 2p + 3. Let g(v) = 8v - 132. Let q be g(19). Suppose 27l - ql - 28 = 0. What is a(l)? 11 Let r(v) = -8v - 47. Let t be r(-8). Let z(p) = -1 - 3p2 + tp*3 - 13p*3 + 2p - 3p3. Suppose 0 = 2i - 10 + 4. Give z(i). 5 Suppose -4t - 3h = -19, 8t + 25 = -2h + 3h. Let x(a) = 10a3 + a2 - 2a - 5. Calculate x(t). -77 Let n(w) = -w2 - 20w - 18. Let m be n(-19). Suppose 0 = -h + t - m, -t - 4t + 21 = -h. Let d(q) = -q + 1176 - hq - 2q2 - 1178. What is d(-3)? -5 Suppose 37 = -5s - i, 4s = -s - 5i - 45. Let u(g) = -33g2 + 18g + 27. Let o(p) = -53p2 + 27p + 41. Let z(q) = -5o(q) + 8u(q). Give z(s). -3 Let t = -1589 + 1595. Let w(f) = -f*3 + 7f*2 + 2f - 8. What is w(t)? 40 Let s = -41023/8 - -5128. Let w(p) be the third derivative of -sp4 - 11p*2 + 0 + 0p + 1/2p3 - 1/120p*6 + 1/30p*5. Determine w(2). -3 Let o(d) = 4d - 2d2 + 479 + 31d - 413. Calculate o(19). 9 Let q be -1 - (4 + -1 - 4). Suppose qa - 2a - 12 = 0. Let k(b) = -2b2 + 6b - 3b2 + 3 - 94b*3 - 11 + 93b*3. What is k(a)? -8 Let h(c) = -4192c + 96 - 4190c - 4188c + 52 + 12608c. What is h(-4)? -4 Let v(j) = -j2 + 63j - 64. Let s be v(1). Let m(k) = 2k2 + 2k - 3k3 + 5k3 - k3 + 4. Calculate m(s). 0 Let b(u) be the second derivative of -13/2u2 - 1/2u*3 + 0 - 8u. Determine b(-6). 5 Let q(t) = 3t3 + 508t*2 + 172t + 498. Let v be q(-169). Let k(f) = -2f + 9. Let p(w) = w + 1. Let j(i) = k(i) + 3p(i). Give j(v). 3 Suppose o = 2b - 10 + 48, 5o + 5b - 130 = 0. Let z(q) = 5 - oq - 19q + 48q. Determine z(-7). 12 Let s be ((-16)/(-21)(-9)/(-6))/((-77)/(-1078)). Let b(w) = w2 - 14w - 24. Give b(s). 8 Let q(r) = 4r - 29. Let h(m) = -12m + 86. Let b(c) = 6h(c) + 17q(c). Give b(4). 7 Let d(i) = -2i2 - 2i*2 - 3 + 6i*2 + 2 + 3i - 3i2. Suppose 2 = -5x - 23. Let t = 7 + x. Give d(t). 1 Let p(v) = v*2 - 13v + 6. Let b = 553 - 325. Suppose 0 = j - b + 219. Determine p(j). -30 Let b(c) be the second derivative of c5/20 + c4/2 - 5c3/3 - 7c2/2 + c. Let w(u) = u2 - 7u - 1. Let l be w(6). Determine b(l). 14 Let f(d) = d2 + 7d + 5. Suppose 2h = 4h - 18. Let g = h - 9. Suppose g = -p - 5, 0 = -5x + 3x + p - 11. Give f(x). 13 Let i(r) = r3 - r2 - 4r - 8. Suppose 52l - 45l - 33l = 78. What is i(l)? -32 Let q(n) = -12n2 - 48n - 97. Let w(i) = -2i2 - 8i - 16. Let o(r) = 3q(r) - 19w(r). Determine o(-8). 77 Suppose -14 - 6 = -5d. Let a = 236 - 242. Let t(l) = l3 + 1. Let h(z) = 5z*3 + 3z*2 - 2z + 10. Let b(f) = at(f) + h(f). Calculate b(d). -20 Let d = 102 - 98. Suppose 0 = -dc - 5u - 9, -c = -5u + 7 + 14. Let y(i) = 3i - 5. Let q(p) = 4p - 6. Let x(t) = 2q(t) - 3y(t). Give x(c). 9 Let i(a) = a*3 + 49a*2 + 8a + 388. Let q be i(-49). Let n(s) = s - 5. Give n(q). -9 Let q(w) be the second derivative of w4/6 - w3 - 7w2/2 - 797w - 24. Let m = 2 + 3. What is q(m)? 13 Suppose -86 = -5i - 81. Suppose 0 = -22a + i + 109. Let q(j) = j*3 - 4j*2 - 2j - 5. What is q(a)? 10 Let j(o) = o + 16. Suppose 2k - 1936 = 4c, -3c - 1438 = 16k - 21k. Let t = 471 + c. Give j(t). 1 Let y(b) = b3 + 12b*2 + 33b + 7. Let g = -18522 - -18518. What is y(g)? 3 Suppose 0 = -5k + s + 79, 4k - k - 4s - 44 = 0. Let h(o) be the first derivative of ko + 1/4o4 + 11/3o*3 - 5 - 11/2o*2. Give h(-12). 4 Let k(o) = -2o*2 - 7o - 3. Let i be ((-66)/6 + 21)(-33)/5. Let b(h) = -4h - 9. Let p be b(13). Let a = i - p. Determine k(a). -18 Let v(h) = h*3 - 5h*2 + 7. Suppose 88j - 94j = -6. Let o be ((-2 + j)/(-1))/((-13)/(-65)). Calculate v(o). 7 Let d(o) = -32o - 61. Let n = -4872 + 4870. Determine d(n). 3 Let q(g) = g*3 + g - 4. Suppose -3l = 2i + 237, l = -3i - 62 - 10. Let r = -78 - l. Determine q(r). 26 Suppose 3x = -5 - 10. Let k = 86 + -52. Let p(j) = kj*2 - 68j*2 + j + 35j*2. Calculate p(x). 20 Let i(a) = -244a*2 - 14 + 198a2 + 21 + a3 - 96a. Calculate i(48). 7 Let b(i) = 4i - 31. Let j be (-5)/(35/14) + 6. Give b(j). -15 Let g be (-7)/(14/(-18))2/6. Suppose -5y = 2w - 37, -6y + y - gw + 33 = 0. Let q(f) = 3f - 12. Give q(y). 15 Let l = -52 - -135. Suppose i - l = -84. Let j(h) = h*3 - h. Calculate j(i). 0 Let p(z) = -23z - 6. Let j = -11571 - -11573. Calculate p(j). -52 Let y(f) = 1 - 8f + f - 8f + 17f - 6f. Let j be 4/(-10) - (-67)/5. Suppose 0 = -3b + b + 10, -j = -3m - 2b. Give y(m). -3 Let t(s) = s3 + 8s*2 + 5s + 2. Suppose 6k = k - 750. Let n = k - -147. What is t(n)? 32 Suppose -5t = -2h - 18, 5t - 5 = 3h + 17. Let n(k) = k3 - k2. Let w(a) = -2a*3 + 2. Let p(l) = -n(l) - w(l). What is p(t)? 10 Let r = -23101 - -23101. Let d(t) be the third derivative of -1/3t*3 + r + 0t - 21t2 + 5/24t*4 + 1/60t5. Calculate d(-5). -2 Let b(w) be the third derivative of w5/60 - 5w4/24 - 5w*3/6 - 3w*2 - 44w. What is b(5)? -5 Let b(x) = 4x3 + 3x*2 - 2. Let z = -5748 - -5749. Give b(z). 5 Let c(f) = -14f + 48. Let l(w) = -128w + 1283. Let v be l(10). What is c(v)? 6 Let v(a) = -9a + 11. Let i(k) = -k*2 - 24k + 341. Let g be i(-34). Determine v(g). 2 Let x be 40/140 - (-206)/14. Suppose -x - 34 = -7d. Suppose -3i + d = -20. Let s(k) = k*2 - 8k - 8. Determine s(i). 1 Let p(t) = -6t - 107733 + 0t2 + 107750 - t2. What is p(0)? 17 Let m(s) be the second derivative of -2s3/3 + s2 + 6s. Let h(u) = -7u + 5. Let w(v) = -3h(v) + 5m(v). Let r be 6/9 - 57/(-9). What is w(r)? 2 Let q(w) = w2 - 10w + 30. Let f = -2538 - -2541. Determine q(f). 9 Let i(p) = -2p2 + 9p - 2. Let r(o) = -3o2 + 9o - 3. Let y(t) = 4i(t) - 3r(t). Let k = -30 + 20. Let h = k + 2. Calculate y(h). -7 Suppose 5p + 171s - 18 = 172s, -3p - s + 14 = 0. Let o(i) = -i*3 + 3i*2 + 10i - 27. Calculate o(p). -3 Let c(r) = -1628r - 1637r + 4887r - 1627r + 53. Calculate c(7). 18 Let n(t) = 8t - 1. Let y(m) = -3m - 22. Let v(x) = 3x + 21. Let g(i) = -6v(i) - 5y(i). Let p = -7608 - -7602. Let f be g(p). Give n(f). 15 Let q be (-1305)/290(-10)/(-45)*3. Let s(n) be the second derivativ	{ "pile_set_name": "DM Mathematics" }
en four letters picked without replacement from {x: 4, m: 2, q: 1, k: 1, o: 3}. 2/165 What is prob of picking 2 s when two letters picked without replacement from spssssss? 3/4 Two letters picked without replacement from zaeehahbhezbhhehh. What is prob of picking 2 z? 1/136 Calculate prob of picking 2 x when two letters picked without replacement from {e: 2, f: 6, v: 1, c: 2, x: 7, z: 1}. 7/57 What is prob of picking 1 p, 1 y, and 1 s when three letters picked without replacement from {p: 1, y: 1, s: 1, x: 1, b: 1}? 1/10 Two letters picked without replacement from xhhkoppojpohkokpk. What is prob of picking 2 o? 3/68 Two letters picked without replacement from {p: 10, g: 6, w: 4}. Give prob of picking 2 g. 3/38 Four letters picked without replacement from {i: 7, k: 3}. Give prob of picking 4 i. 1/6 Three letters picked without replacement from {c: 3, t: 1, d: 1, q: 1, m: 5, y: 1}. What is prob of picking 2 c and 1 y? 3/220 Three letters picked without replacement from amkabsknbbaabmabab. What is prob of picking 1 b, 1 n, and 1 k? 1/68 What is prob of picking 2 p when two letters picked without replacement from {p: 3, o: 1, h: 1}? 3/10 Calculate prob of picking 1 j and 1 t when two letters picked without replacement from jgtggggjt. 1/9 What is prob of picking 2 f when two letters picked without replacement from kkefffefe? 1/6 What is prob of picking 3 o when three letters picked without replacement from ihhhootothtohooo? 1/16 Two letters picked without replacement from {c: 3, o: 1, p: 1, w: 5}. Give prob of picking 2 w. 2/9 Four letters picked without replacement from tvhrhrtvrhhd. Give prob of picking 2 v, 1 t, and 1 d. 2/495 Three letters picked without replacement from prngrnggnonoegn. What is prob of picking 1 r and 2 n? 4/91 Three letters picked without replacement from kkkgkkgkk. Give prob of picking 1 g and 2 k. 1/2 Calculate prob of picking 1 b and 1 l when two letters picked without replacement from {l: 1, q: 14, b: 5}. 1/38 Calculate prob of picking 2 n and 2 u when four letters picked without replacement from nunnuunuuuuuuu. 270/1001 What is prob of picking 2 o and 1 n when three letters picked without replacement from {n: 4, c: 2, o: 2}? 1/14 Four letters picked without replacement from {h: 1, e: 19}. Give prob of picking 1 h and 3 e. 1/5 Three letters picked without replacement from eerxi. Give prob of picking 2 e and 1 i. 1/10 Calculate prob of picking 2 t and 1 o when three letters picked without replacement from roritttruor. 2/55 Three letters picked without replacement from dhddddddddhd. What is prob of picking 2 d and 1 h? 9/22 Three letters picked without replacement from ebetbeebttte. What is prob of picking 3 e? 1/22 Two letters picked without replacement from {e: 3, o: 2, z: 1, b: 4}. What is prob of picking 1 e and 1 o? 2/15 Three letters picked without replacement from {e: 5, o: 13}. What is prob of picking 1 e and 2 o? 65/136 Calculate prob of picking 2 b and 1 f when three letters picked without replacement from {f: 3, b: 3}. 9/20 Calculate prob of picking 1 l and 1 w when two letters picked without replacement from hhhlmhhhhhlhhlwwl. 1/17 What is prob of picking 1 s, 1 u, and 2 p when four letters picked without replacement from upsppspm? 6/35 Calculate prob of picking 2 w and 1 p when three letters picked without replacement from wwppppppppp. 3/55 Calculate prob of picking 1 v and 1 w when two letters picked without replacement from {w: 3, v: 5}. 15/28 Calculate prob of picking 1 r and 1 p when two letters picked without replacement from rgpgxdpddop. 3/55 Three letters picked without replacement from {c: 3, q: 3, m: 2, p: 8}. What is prob of picking 1 m and 2 q? 3/280 Calculate prob of picking 1 r and 2 x when three letters picked without replacement from xristsix. 1/56 What is prob of picking 1 k, 2 m, and 1 z when four letters picked without replacement from {m: 3, k: 6, z: 1, l: 3, t: 1}? 18/1001 Two letters picked without replacement from {f: 7, c: 2, n: 3, w: 5}. Give prob of picking 1 n and 1 f. 21/136 Calculate prob of picking 1 q, 1 d, and 1 e when three letters picked without replacement from qesxqxffeexxdxf. 6/455 Calculate prob of picking 1 q and 1 l when two letters picked without replacement from {s: 1, b: 3, p: 4, q: 1, t: 1, l: 2}. 1/33 Three letters picked without replacement from nknkkkkkk. Give prob of picking 1 n and 2 k. 1/2 Two letters picked without replacement from qqqqqqaqqqaa. What is prob of picking 1 a and 1 q? 9/22 Calculate prob of picking 1 p and 1 t when two letters picked without replacement from lbplltbnglptnnlln. 1/34 Three letters picked without replacement from llqlllqqlqlqqlqqlllq. Give prob of picking 3 l. 11/76 Calculate prob of picking 1 l and 1 v when two letters picked without replacement from lvwvvwvlwlwvvwvwvw. 8/51 Calculate prob of picking 2 d when two letters picked without replacement from {v: 2, e: 1, t: 1, p: 1, d: 2, j: 2}. 1/36 Calculate prob of picking 2 c when two letters picked without replacement from {g: 1, f: 3, b: 5, c: 6}. 1/7 Three letters picked without replacement from aagaabgaabbybaagbb. What is prob of picking 1 y, 1 a, and 1 g? 1/34 What is prob of picking 4 k when four letters picked without replacement from kkiikkkkkkkikkkikikk? 91/323 Three letters picked without replacement from {g: 1, j: 1, p: 2, t: 3, m: 3}. What is prob of picking 1 m, 1 t, and 1 p? 3/20 Two letters picked without replacement from yydafwdywwhyyhy. Give prob of picking 2 h. 1/105 What is prob of picking 3 b and 1 u when four letters picked without replacement from {b: 5, e: 2, u: 3, a: 9}? 5/646 What is prob of picking 1 u and 2 d when three letters picked without replacement from {u: 2, e: 6, a: 2, d: 2}? 1/110 Calculate prob of picking 2 s, 1 v, and 1 a when four letters picked without replacement from {a: 3, v: 5, s: 3}. 3/22 Two letters picked without replacement from {p: 1, i: 14, o: 5}. Give prob of picking 2 o. 1/19 Four letters picked without replacement from lqlbaal. What is prob of picking 3 l and 1 q? 1/35 What is prob of picking 1 k and 1 i when two letters picked without replacement from {e: 1, i: 2, n: 1, z: 1, r: 1, k: 1}? 2/21 What is prob of picking 2 b when two letters picked without replacement from lllblb? 1/15 Three letters picked without replacement from {v: 7, w: 12, r: 1}. What is prob of picking 3 v? 7/228 Calculate prob of picking 1 g, 1 t, and 1 i when three letters picked without replacement from {i: 4, t: 1, g: 2, c: 1, d: 1}. 2/21 Calculate prob of picking 1 k, 1 u, and 1 j when three letters picked without replacement from {z: 1, u: 2, j: 3, k: 3, i: 2, n: 3}. 9/182 Four letters picked without replacement from {z: 1, q: 3, j: 4}. Give prob of picking 4 j. 1/70 Three letters picked without replacement from vwwvwvpppwwppvw. Give prob of picking 2 p and 1 v. 8/91 Three letters picked without replacement from xrqxrxxxrmrxtxrrm. Give prob of picking 3 r. 1/34 Three letters picked without replacement from {o: 3, v: 1}. Give prob of picking 1 v and 2 o. 3/4 Three letters picked without replacement from utuijdu. Give prob of picking 2 u and 1 i. 3/35 What is prob of picking 2 y and 1 m when three letters picked without replacement from xmmimyymimix? 1/44 Calculate prob of picking 1 o and 1 i when two letters picked without replacement from immeeieomiioeooimefe. 2/19 Three letters picked without replacement from {c: 4, s: 1, a: 3, p: 6, l: 3, m: 1}. What is prob of picking 1 l and 2 p? 15/272 Four letters picked without replacement from aiaataaatatta. Give prob of picking 1 a, 1 i, and 2 t. 48/715 Three letters picked without replacement from {x: 6, c: 4, k: 1, t: 1, o: 1}. What is prob of picking 1 c and 2 t? 0 Two letters picked without replacement from tbwmmwhmhw. Give prob of picking 1 w and 1 t. 1/15 Three letters picked without replacement from {e: 4, c: 2, w: 1, j: 5, o: 2}. What is prob of picking 1 o and 2 j? 5/91 Calculate prob of picking 1 d, 1 j, and 1 k when three letters picked without replacement from dnkdjnkjddsknjp. 36/455 Calculate prob of picking 1 e and 1 n when two letters picked without replacement from {r: 1, e: 1, n: 1, x: 1, y: 3}. 1/21 Calculate prob of picking 2 x when two letters picked without replacement from uuxuzzxxzzxuuzz	{ "pile_set_name": "DM Mathematics" }
ainder when l(3) is divided by 10. 9 Suppose 5l + 5n = 810, -2l + 0l + 317 = -5n. Let o = l - 81. What is the remainder when o is divided by 41? 39 Let z = -491 - -525. What is the remainder when 90 is divided by z? 22 Let j(y) = y2 - 3y + 15. Suppose w - 5w = -w. What is the remainder when 42 is divided by j(w)? 12 Suppose 5r + 8 = -4n, -2r + 8 = 2n - 6n. Suppose -p - p + 6 = r. Suppose 0 = pu + u - 4. Calculate the remainder when 1 is divided by u. 0 Suppose -309y + 312y - 78 = 0. What is the remainder when y is divided by 11? 4 Let g(b) = 16b - 4. Let r(l) = -4l + 12. Let a be r(15). Let t = -32 - a. Calculate the remainder when g(4) is divided by t. 12 Let h(w) = 16w3 - w2 + 1. Let u be 2 + (3 + -3)/4. Suppose -3c + c + u = 0. Calculate the remainder when 31 is divided by h(c). 15 Suppose 659 - 81 = 17s. Let d(g) = 33g2 + 3g - 5. What is the remainder when d(2) is divided by s? 31 Suppose 18 = 2h + 4. Let y(b) = 2b + 10. Let a be y(-5). Suppose 0c + 3r = -c - 2, -2c - r + 21 = a. Calculate the remainder when c is divided by h. 6 Let b = -19 - -9. Let g(p) = p2 - 6p. What is the remainder when g(8) is divided by b(-1 + 0) + -1? 7 Let x(o) = -o2 + 29o - 26. Let y be x(17). Let q = y - 111. What is the remainder when q is divided by 18? 13 Let a(s) = s*2 - 16s + 72. What is the remainder when 26 is divided by a(6)? 2 Let a = -65 - -74. Suppose a + 9 = p. Let u = -56 + 126. Calculate the remainder when u is divided by p. 16 Let j = 30 + -31. Let f = j - -17. What is the remainder when 30 is divided by f? 14 Let g be (-1 - -1)/(-18 - -19). Suppose -w + 4w + p - 134 = g, 0 = -p - 1. Calculate the remainder when w is divided by 16. 13 Let l(d) = 6d*2 - 35d - 87. What is the remainder when 358 is divided by l(-3)? 70 Calculate the remainder when -2 + (-16)/(-9) + (-9810)/(-405) is divided by 10. 4 Let l(s) = -6s - 1. Let k = 117 + -59. Let g = 64 - k. Calculate the remainder when l(-3) is divided by g. 5 Let w = 1525 - 1514. Calculate the remainder when 525 is divided by w. 8 Let s(v) = -v2 + 6v + 6. Let m be s(6). Suppose mp + 24 = -0p. Calculate the remainder when 23 is divided by (-16)/(-2) + (p - -2). 5 Let m = 34 - 32. Suppose mc - 12 = 40. Calculate the remainder when 49 is divided by c. 23 Let m = 1441 - 1416. Calculate the remainder when 107 is divided by m. 7 Let p(j) = 8j*2 + 2j - 15. What is the remainder when 208 is divided by p(2)? 19 Let r be (-10)/15 - (1 - (-69)/(-9)). Suppose -rq + 10q - 280 = 0. What is the remainder when q is divided by 36? 34 Let u(z) = z*3 - 20z*2 - 35z + 117. What is the remainder when u(22) is divided by 80? 75 What is the remainder when 28(-1 - -1 - 364/(-98)) is divided by 21? 20 Let v = -94 + 140. Suppose 5s - 2s - v = 5g, -5g = -s + 2. What is the remainder when 64 is divided by s? 20 Let q(o) = 2o + 0 + 2o3 + 1 + 2o - 3o - 2o*2. What is the remainder when q(2) is divided by 3? 2 Let d = 292 - 126. Calculate the remainder when d is divided by 8. 6 Suppose -l + 42 = -5d, 2l - d = 7l - 80. Suppose -lt + 3t + 420 = 0. Suppose 0 = -2c + 14 + 2. What is the remainder when t is divided by c? 6 Suppose -871 = -40b + 2009. Calculate the remainder when b is divided by 35. 2 Suppose -v + 9 = 2v. Suppose 2i + 10 = m - vi, m - 10 = -3i. Calculate the remainder when m is divided by 3. 1 Calculate the remainder when 7956/27232/6 is divided by 42. 30 What is the remainder when (4 - -3) + (9 - 9) + 238 is divided by 32? 21 Suppose -14 = -3w + t, 58w = 61w - 4t - 11. What is the remainder when 128 is divided by w? 3 Suppose -1473 = -5x - 587y + 584y, 3x - 3y - 903 = 0. Calculate the remainder when x is divided by 50. 47 Calculate the remainder when (-1050)/(-8) - (-342)/456 is divided by 48. 36 Let x(f) = f*2 - 3f - 6. Let u(j) = j*2 + 7j + 6. Let p be u(-5). Calculate the remainder when x(p) is divided by (-330)/(-27) + 2/(-9). 10 Let g(l) = -l*2 - 4l + 10. Let t be g(-6). Let s(u) = 4u2 + u - 4. Calculate the remainder when 12 is divided by s(t). 2 Suppose 3l = -2o + 11, -3o + 2o - 2 = -l. Suppose 4s + 47 = lc, -2s + 46 = 2c - s. Calculate the remainder when 38 is divided by c. 17 Let f(w) be the second derivative of -w5/20 + 7w*4/6 + 10w*2 - 7w. Calculate the remainder when f(14) is divided by 7. 6 What is the remainder when (-25)/(-8 + 7)27 is divided by 68? 63 Let h(d) = d2 + 3d + 5. Let o be h(-2). What is the remainder when 89/2 + o/(-2) is divided by 9? 7 Let v(m) = 13m2 - m - 2. Let t be v(3). Suppose 20 = 4r - t. What is the remainder when 65 is divided by r? 32 Suppose 2n - 10 = -0. Suppose -16 = m + 4d, -4m + 5d + 15 + n = 0. Let i = 18 - m. Calculate the remainder when 53 is divided by i. 17 Suppose -38 = -7h + 116. Calculate the remainder when 108 is divided by h. 20 Suppose -91 = -x - 72. Calculate the remainder when 60 is divided by x. 3 Let m(h) = 5h*2 + 4h + 3. Let s = 8 + -63. Let x = s - -78. What is the remainder when m(-4) is divided by x? 21 Let i(k) = -k - 7. Let f be i(4). Let w(m) = -m. Let r = 2 - -1. Calculate the remainder when w(f) is divided by r. 2 Let a = 6 + -3. Suppose -3t - 5u = -60, at - 41 = -3u + 13. Calculate the remainder when 38 is divided by t. 8 Let f(o) be the second derivative of o5/10 - o3/6 + o*2 + 2o. Suppose 6 + 21 = 9i. Calculate the remainder when f(i) is divided by 11. 9 Let u = -551 - -564. Calculate the remainder when 43 is divided by u. 4 Suppose -115 = -3g - v, 6g + 33 = 7g + 3v. Calculate the remainder when g is divided by 13. 0 Suppose -10 = -7c + 676. Calculate the remainder when 299 is divided by c. 5 Let w = 16 + -12. Suppose -wi + 32 = 12. Suppose -2v - 8 = -6v, 0 = -iq + 2v + 271. What is the remainder when q is divided by 14? 13 Suppose -148s + 150s = -10, -914 = -4u - 2s. Calculate the remainder when u is divided by 78. 75 Let o = 58 - 58. Suppose o = 21s - 14s - 749. Calculate the remainder when s is divided by 11. 8 What is the remainder when ((-2076)/8)/((-69)/92) is divided by 10? 6 Let m(d) = -15d - 101. What is the remainder when m(-29) is divided by 48? 46 Let n be (-8)/16 - (-5127)/6. Calculate the remainder when 120 is divided by (-2)/(-6) + n/21. 38 Suppose -5h - 5r + 210 = 0, -2h = -134r + 130r - 102. What is the remainder when 1394 is divided by h? 44 Suppose 5z + 2 = 17. Let m be z/(-2 + (-603)/(-300)). Suppose 5w - m = -20. What is the remainder when w is divided by 19? 18 Let f be 2 - ((-8)/(-4) + -2). Suppose -8 - 14 = 3c + 5r, -f = -2r. What is the remainder when ((-3)/c)/((-4)/(-1044)) is divided by 15? 12 Let q = -187 + 195. Let h be (-4)/(-6)(2 + 1). Suppose -5k + hp = -149, p + p = -3k + 99. What is the remainder when k is divided by q? 7 What is the remainder when 19/((34/20 - 2)/(-3)) is divided by 60? 10 Let l = -63 + 158. Calculate the remainder when l is divided by 25. 20 Let t be -33/3 - -3. Suppose t = -x + 5x + 2h + 32, -3h - 28 = 4x. Let i = x + 31. What is the remainder when i is divided by 11? 10 Suppose 21 = r + i, r + i - 71 = -2r. Suppose 0 = -3z + z + 102. Suppose u - 3u - 55 = -5x, -2x - 5u = -z. What is the remainder when r is divided by x? 12 Suppose 8n - 836 = -36n. Calculate the remainder when (-99)/4(-40)/15 is divided by n. 9 Calculate the remainder when 6/(-27) + (-5365)/(-45) + -2 is divided by 100. 17 Suppose 0 = -3v - 5s + 7s + 153, -2v - s + 109 = 0. What is the remainder when 526 is divided by v? 49 Let r = -441 + 497. What is the remainder when 445 is divided by r? 53 Suppose -5b = -10b + 150. What is the remainder when 75 is divided by b? 15 Suppose 3h = -8h + 33. Suppose 4o = i - 33, 9 = -0o - ho. Calculate the remainder when i is divided by 12. 9 Let u be (2/2)/(4/92). Let j = u + -23. Suppose 3z - 82 + 19 = j. What is the remainder when z is divided by 6? 3 Let a(w) = -5w + 2. Let v be a(3). Let y = -15 - v. Calculate the remainder when (-11)/y + (-1)/2 is divided by 2. 1 What is the remainder when ((-2 + 4)18 - -3)5 is divided by 49? 48 Let k(u) = 2u*3 - 4u*2 - 2u - 3. Suppose -3t + 104 = 5o, 33t = 38t - o - 136. What is the remainder when k(5) is divided by t? 25 Let q be -4 - 1*(-2	{ "pile_set_name": "DM Mathematics" }
en three letters picked without replacement from iuuuiiiuiuuuuuiuiuu. 154/969 Two letters picked without replacement from eogyzjg. What is prob of sequence jg? 1/21 Three letters picked without replacement from hrrkrhrkrrrhrrkwhrr. Give prob of sequence hwr. 22/2907 What is prob of sequence um when two letters picked without replacement from {j: 3, m: 2, s: 8, u: 4}? 1/34 Two letters picked without replacement from {x: 1, k: 4, v: 4, z: 3, w: 7}. What is prob of sequence kz? 2/57 What is prob of sequence pipk when four letters picked without replacement from pkiipikii? 5/756 Three letters picked without replacement from eeaeeeeeeeea. Give prob of sequence eae. 3/22 Calculate prob of sequence cd when two letters picked without replacement from cccccccccccccdcccc. 1/18 What is prob of sequence immu when four letters picked without replacement from doueomemieei? 1/2970 Calculate prob of sequence pp when two letters picked without replacement from {f: 1, q: 1, t: 3, p: 2, s: 3, n: 1}. 1/55 What is prob of sequence kpn when three letters picked without replacement from knkpllklknkpn? 5/286 Three letters picked without replacement from wjwjjjx. Give prob of sequence xwj. 4/105 Two letters picked without replacement from {o: 1, x: 1, g: 1, l: 1, z: 2, u: 1}. Give prob of sequence zz. 1/21 Three letters picked without replacement from eouiu. Give prob of sequence uoi. 1/30 Three letters picked without replacement from ypppqyy. What is prob of sequence yyq? 1/35 What is prob of sequence jr when two letters picked without replacement from rrtjjtrjj? 1/6 Calculate prob of sequence ljgl when four letters picked without replacement from {g: 5, j: 3, l: 7, d: 2, m: 3}. 7/1292 What is prob of sequence tiz when three letters picked without replacement from {e: 7, i: 2, a: 2, t: 2, z: 4}? 1/255 Three letters picked without replacement from fvvfvvvffvfvvvwvfv. What is prob of sequence fwf? 5/816 What is prob of sequence sss when three letters picked without replacement from ssssss? 1 What is prob of sequence viv when three letters picked without replacement from snhnnnnhhvnhhnivn? 1/2040 Four letters picked without replacement from {f: 1, w: 1, k: 2}. Give prob of sequence kkff. 0 What is prob of sequence iiu when three letters picked without replacement from {i: 3, u: 1}? 1/4 Four letters picked without replacement from {x: 2, m: 8, r: 4, e: 1}. What is prob of sequence xrex? 1/4095 Four letters picked without replacement from {n: 3, h: 1, g: 7, b: 1, r: 3, t: 3}. What is prob of sequence rgrt? 7/4080 Three letters picked without replacement from jcncrnjjcccrrrccrj. What is prob of sequence jrr? 5/306 Calculate prob of sequence uu when two letters picked without replacement from {r: 5, u: 3}. 3/28 What is prob of sequence gm when two letters picked without replacement from {m: 1, v: 4, n: 1, l: 1, g: 2}? 1/36 What is prob of sequence nn when two letters picked without replacement from nibbiknakpna? 1/22 Calculate prob of sequence zzzb when four letters picked without replacement from {z: 5, d: 3, m: 2, b: 1, o: 1}. 1/198 Two letters picked without replacement from {m: 7, z: 3, f: 2, j: 1, c: 1}. What is prob of sequence fz? 3/91 Two letters picked without replacement from apmmhfuf. Give prob of sequence pu. 1/56 Calculate prob of sequence cpu when three letters picked without replacement from xjcpcuuj. 1/84 Calculate prob of sequence ltt when three letters picked without replacement from ttttttll. 5/28 Two letters picked without replacement from {x: 5, i: 2}. Give prob of sequence xx. 10/21 Three letters picked without replacement from {j: 2, z: 1, f: 1}. Give prob of sequence jjf. 1/12 What is prob of sequence hzz when three letters picked without replacement from zzzzzhzzzozzzzzzo? 91/2040 Four letters picked without replacement from {a: 6, n: 6}. What is prob of sequence nana? 5/66 Three letters picked without replacement from tujqulv. What is prob of sequence tvj? 1/210 What is prob of sequence thh when three letters picked without replacement from hhhtthhhhhthth? 15/91 Three letters picked without replacement from {c: 15, i: 3}. Give prob of sequence cii. 5/272 What is prob of sequence vzvv when four letters picked without replacement from vvvzvvvv? 1/8 What is prob of sequence ed when two letters picked without replacement from {w: 1, u: 4, e: 1, j: 1, d: 1}? 1/56 What is prob of sequence in when two letters picked without replacement from tttintwgi? 1/36 Two letters picked without replacement from {t: 4, w: 4, a: 6}. What is prob of sequence aw? 12/91 Four letters picked without replacement from ssgenssbsnn. What is prob of sequence ensb? 1/528 Calculate prob of sequence aa when two letters picked without replacement from itavivvvtivav. 1/78 Calculate prob of sequence ymn when three letters picked without replacement from {y: 2, m: 9, n: 7}. 7/272 Calculate prob of sequence jeje when four letters picked without replacement from eeeejjejeejeeeje. 55/1092 Four letters picked without replacement from {v: 1, r: 1, b: 1, x: 2, j: 2}. What is prob of sequence xbrx? 1/420 Calculate prob of sequence ddm when three letters picked without replacement from fmmfmhfffdjfmfmfd. 1/408 Calculate prob of sequence yybb when four letters picked without replacement from yyyyybyybybyybbyyby. 65/1292 Four letters picked without replacement from {e: 11, f: 2, c: 1, n: 2}. What is prob of sequence fcen? 11/10920 Three letters picked without replacement from ajlkxga. Give prob of sequence jxk. 1/210 Calculate prob of sequence vv when two letters picked without replacement from dvvdddddvddd. 1/22 Two letters picked without replacement from gcgggggglc. What is prob of sequence cc? 1/45 What is prob of sequence qvt when three letters picked without replacement from {y: 1, t: 11, q: 1, p: 1, a: 2, v: 2}? 11/2448 Calculate prob of sequence rq when two letters picked without replacement from {r: 2, b: 1, d: 1, q: 2}. 2/15 Calculate prob of sequence qzzh when four letters picked without replacement from {z: 4, d: 2, k: 4, r: 1, q: 2, h: 2}. 2/1365 Three letters picked without replacement from rauaqaabbqpbpaaaqa. What is prob of sequence abb? 1/102 Calculate prob of sequence uusu when four letters picked without replacement from {s: 1, u: 18}. 1/19 Calculate prob of sequence xdhk when four letters picked without replacement from {d: 1, g: 1, h: 2, k: 2, x: 2}. 1/210 Calculate prob of sequence covo when four letters picked without replacement from {v: 1, k: 6, c: 2, o: 2}. 1/1980 Three letters picked without replacement from uueiuauneaium. Give prob of sequence imn. 1/858 Four letters picked without replacement from {a: 3, t: 7, y: 1, s: 2, d: 5}. What is prob of sequence dysd? 1/1836 What is prob of sequence abaa when four letters picked without replacement from rvrvarvbavrakb? 1/2002 Four letters picked without replacement from xqvxqlqkxkxvuuk. Give prob of sequence kkqu. 1/910 Calculate prob of sequence of when two letters picked without replacement from eeosaeeafsosf. 1/39 Two letters picked without replacement from uuyuyy. What is prob of sequence yu? 3/10 What is prob of sequence pp when two letters picked without replacement from piiizzzpzizpppzziz? 10/153 Three letters picked without replacement from nwnwtnn. Give prob of sequence tww. 1/105 What is prob of sequence vw when two letters picked without replacement from {p: 1, v: 3, k: 1, w: 4, t: 2}? 6/55 Three letters picked without replacement from ussxysusyyvs. What is prob of sequence yxs? 1/88 Two letters picked without replacement from {z: 1, q: 3, x: 1, y: 3, t: 2}. Give prob of sequence yz. 1/30 Calculate prob of sequence nmn when three letters picked without replacement from mnmnmmnmnmmmn. 40/429 Two letters picked without replacement from {d: 2, r: 4, e: 3, v: 1, u: 7}. Give prob of sequence ve. 3/272 Four letters picked without replacement from {k: 1, g: 6, f: 4}. What is prob of sequence ggkg? 1/66 What is prob of sequence jjw when three letters picked without replacement from {w: 1, j: 1, f: 1}? 0 Two letters picked without replacement from fxffooxffxfaoxffaafo. What is prob of sequence fa? 27/380 Three letters picked without replacement from {t: 1, g: 7, m: 2, y: 1, d: 8}. Give prob of sequence mdg. 56/2907 What	{ "pile_set_name": "DM Mathematics" }
Work out -114091 * 0.044. -5020.004 Multiply 6 and -16069. -96414 What is 0.03877 times -0.949? -0.03679273 What is the product of -90.8 and 772? -70097.6 Calculate -0.1-91938. 9193.8 Calculate 0.310721. 3216.3 -33916 * 70 -2374120 What is -27.22 times -2? 54.44 Product of 0.8321 and 0.3. 0.24963 What is 0.35 times -76.2? -26.67 0.4 times -200027 -80010.8 2940339 996660 Calculate -3.5182.5. -8.795 What is 1.23 times -437? -537.51 What is the product of 200231 and 0? 0 Work out -1 * -436595. 436595 Calculate 14.25392.5. 5593.125 16269 -0.078 -1268.982 -0.1429-357 51.0153 Multiply -10873.7 and -0.2. 2174.74 Calculate -57-140. 7980 -0.1517.37 -2.6055 2.582 times 19 49.058 Multiply -1.4463 and 0.16. -0.231408 Product of 0.6 and -118.8. -71.28 0.052 146 7.592 1.9191 * 0.1 0.19191 -1.799419 * 0.4 -0.7197676 Work out 3 * -36.449. -109.347 -31.4 times -53 1664.2 Multiply 0.05637 and -7. -0.39459 Work out 22.8 * 314. 7159.2 What is 71.1 times 0.317? 22.5387 Work out 403 * -76. -30628 Work out 0.12665 * -0.039. -0.00493935 17.611 * 1 17.611 What is 1493 times 0.24? 358.32 Product of -379 and 30. -11370 What is -2 times -15.647? 31.294 Multiply -355 and -198. 70290 Work out -35074 * 0.6. -21044.4 -27740.73-0.5 13870.365 6.35 times 0.378 2.4003 What is -16420765 times -0.2? 3284153 -153 0.14 -21.42 What is -1508137 times -5? 7540685 Multiply 471937 and 5. 2359685 What is the product of 20 and 13713? 274260 Product of -291.7 and 33. -9626.1 What is the product of -663.9 and 0? 0 What is the product of 0.5 and -115729? -57864.5 -2.9 * 18493 -53629.7 What is the product of 0.0602 and -0.112? -0.0067424 Calculate -0.0161.4342. -0.0229472 -35 2725.1 -95378.5 Product of 215 and -0.2636. -56.674 Multiply 0.96 and -43. -41.28 Calculate -1.852.5. -4.625 Multiply 0.0207 and 4.16. 0.086112 What is 270 times 4.52? 1220.4 Multiply 0.0796 and 0.072. 0.0057312 Calculate 0.04853-0.18. -0.0087354 Product of 3393.24 and 4. 13572.96 Multiply 886 and -2.196. -1945.656 Work out 2268 * 2. 4536 0.1 times 13704.7 1370.47 12.33 times -0.0495 -0.610335 What is -0.4 times -1578456? 631382.4 What is 84107 times 0.4? 33642.8 Multiply -6.161 and 31. -190.991 Calculate 6983.1-4. -27932.4 Work out -0.03902817 -2. 0.07805634 -44 times 1533 -67452 Multiply 0.5 and -70917. -35458.5 65.7 times 0.05 3.285 4.195177 times -0.1 -0.4195177 Work out 1.467 * -5. -7.335 Work out -4 * 79554. -318216 What is 0.09 times -308733? -27785.97 Calculate -3753.89. -1458.75 Calculate -0.00707880.2. -0.00141576 Multiply -17906 and -4. 71624 0.1468 * -201 -29.5068 Calculate 20119-0.5. -10059.5 Work out 63 -364. -22932 What is 468 times -83? -38844 What is 0 times 0.072274? 0 Work out 298 * -2. -596 Multiply 69 and -217. -14973 Multiply 23.4 and -9. -210.6 Calculate -0.1-70.81. 7.081 Work out -3 12585. -37755 0.151802 270.3 What is the product of -0.7675 and -116? 89.03 0.02694358-0.1 -0.002694358 Work out -4 * -25790. 103160 Multiply -3079 and 191. -588089 Work out -2 * 0.15272. -0.30544 -0.4-1.763 0.7052 Multiply -8972 and 6.8. -61009.6 Product of 1501.7 and 0.07. 105.119 Work out -37521 0.06. -2251.26 1.226-0.041 -0.050266 Multiply 1130 and -2.6. -2938 What is -16 times 26.6513? -426.4208 -0.3 -84.061 25.2183 Product of -0.2 and -1314036. 262807.2 Work out -1.446 * -56. 80.976 4.9-173 -847.7 Multiply -15175 and 0.2. -3035 Product of 0.23 and 20929. 4813.67 What is -0.6 times -178? 106.8 -12 -112 1344 Product of 54685 and 0.06. 3281.1 -3791-0.078 295.698 -432544 -130176 Work out 427 * -69. -29463 What is the product of 10481 and 0.08? 838.48 What is the product of -15742 and -4? 62968 -606.0761 -606.076 Calculate 6.3172.9. 1089.27 Work out -0.1004 * 574. -57.6296 Calculate -1195.129. -195.129 11.718 times -6 -70.308 -0.05 times -14096 704.8 What is the product of 7460 and 7? 52220 Calculate 3930575. 1192425 What is the product of -8 and 6364? -50912 What is the product of -1076 and -0.3? 322.8 Multiply -257 and -31. 7967 Calculate -682620.5. -34131 Work out 0.8 -3386. -2708.8 14.77-0.29 -4.2833 0.07101 35 2.48535 0.07855.2 4.3056 Work out -0.2 20111. -4022.2 Product of 1159596 and -0.3. -347878.8 What is the product of -0.5 and 0.244222? -0.122111 0.269.003 13.8006 Product of -1746 and -0.2. 349.2 What is -0.21 times 37.625? -7.90125 Product of 0.096 and 1502. 144.192 2148590 times -0.3 -644577 What is the product of 624 and -38.5? -24024 What is 2 times 37.3856? 74.7712 29.5 19 What is the product of -0.5 and -12434? 6217 1.7 times -3501 -5951.7 Work out 0.3157 * -493. -155.6401 Work out 1326.6 * 0.3. 397.98 0.27969 * -4 -1.11876 Product of 147.33 and -0.3. -44.199 4.22827 * -0.1 -0.422827 -729.92 * -0.2 145.984 143 times 0.2 28.6 Product of -122 and -148.1. 18068.2 -12133 * 14 -169862 Work out 335805 * 0.02. 6716.1 Work out 312 * -95. -29640 Calculate 30989.8-0.5. -15494.9 What is the product of 1.8 and -63414? -114145.2 Product of 0.06137 and 0.03. 0.0018411 Work out 92.089 0.5. 46.0445 -43.9 * -224 9833.6 What is 0.2031 times -2255? -457.9905 Product of 11 and 1.949. 21.439 Multiply 4 and 358443. 1433772 Multiply -21.9 and 2917. -63882.3 What is the product of 45 and 4526? 203670 Work out -0.18 * 26398. -4751.64 Work out -0.06 * 118633. -7117.98 What is -115 times 76? -8740 Work out 0.48 * 51.9. 24.912 Work out 1009 * -45. -45405 Work out 0.16 * -14. -2.24 6-0.6304 -3.7824 Calculate -66-94. 6204 Calculate -1.1-3567. 3923.7 What is the product of -0.4 and -0.040677? 0.0162708 -130668 times -0.5 65334 What is the product of -0.1 and -210.86? 21.086 What is 110.0403 times 0.07? 7.702821 -0.4 times 40159 -16063.6 What is 0.05462 times 0.7? 0.038234 Calculate 45.18058. 20.72232 -4402518 -1107920 Calculate 83717. 14229 Calculate 0-743.72. 0 What is -0.5 times 2194.2? -1097.1 24959 5 124795 0.69 * 2395 1652.55 What is -87.8 times 34.6? -3037.88 What is -6 times -25321.2? 151927.2 What is the product of 20 and -0.0149? -0.298 What is 154039 times 0? 0 4.5 * -932 -4194 Calculate -1.3935740.5. -0.696787 Work out 84.9 4901. 416094.9 What is the product of -18513 and 8? -148104 Multiply 4946 and -27. -133542 Work out -305.6384 * 0.2. -61.12768 -0.03885 * -3.4 0.13209 -2.121.1036 -2.339632 Multiply 860 and 948. 815280 What is 5.551 times -0.4? -2.2204 Product of 39839 and -0.02. -796.78 Work out -320117 -2. 640234 What is the product of -8 and -1.076? 8.608 Multiply 1.1 and -0.04568. -0.050248 Work out -2.896 * -0.7. 2.0272 2886 * 0.0562 162.1932 What is -0.252032 times 28? -7.056896 Product of 2164 and -0.12. -259.68 What is 0.3 times 197.81? 59.343 14 * -33490 -468860 Work out 0.5 * 7813.7. 3906.85 -539100.5 -26955 83307 26456 What is the product of -0.16 and 75977? -12156.32 What is the product of 12.63 and 0.9? 11.367 217.144.7 9704.37 What is the product of -239 and 13210? -3157190 Calculate 17.28-349. -6030.72 What is 0.5 times -6.26022? -3.13011 What is -2190 times 0.056? -122.64 -9022.15 times 2 -18044.3 178971 127019 Work out 10 -28443. -284430 -0.1 * -12200 1220 Calculate 0-751352. 0 What is the product of -0.5 and -662368? 331184 What is -0.038 times 19.437? -0.738606 Product of 1272 and -162. -206064 What is 2 times 2.9024? 5.8048 Calculate 153-2677. -409581 Work out 0.14 * 2.516. 0.35224 Product of -0.6 and 1.0231. -0.61386 Work out -26 * -0.02433. 0.63258 Work out 0.14 * -196. -27.44 Work out 11 * 8953. 98483 What is 0.4 times -7859? -3143.6 0.026258 times 2 0.052516 -50.153956 -0.76978 -0.2458.4 -91.68 Calculate -0.18-39.7. 7.146 1.468742 61.6854 What is 16 times -796? -12736 Multiply 0 and 0.03031. 0 -0.9140.2 -0.1828 111.39-168 -18713.52 What is the product of 769 and -0.2? -153.8 Product of 9850 and -5. -49250 Calculate -15.98272. -31.9654 Product of 1772 and 19. 33668 What is the product of 60 and -1.4414? -86.484 390.637 24.843 Work out 0.3103939 * -4. -1.2415756 Work out 33921 * -7. -237447 Work out -184.31 * -15. 2764.65 -0.003 times 0.045 -0.000135 -0.02-0.05569 0.0011138 Work out -0.37 0.043881. -0.01623597 Multiply 0.17 and 289684. 49246.28 Multiply 0.12 and 9669. 1160.28 -88.072*1 -88.072 Multiply -23 and -18098. 416254 What is -1 times 10289? -10289 Multiply 6.1 and -0.01002. -0.061122 Calc	{ "pile_set_name": "DM Mathematics" }
04300000 Round -0.998371 to 3 dps. -0.998 Round 610.10901 to 1 dp. 610.1 What is 0.01494232993 rounded to 5 dps? 0.01494 What is 290189.2968 rounded to the nearest 1000? 290000 What is -0.0025643808243 rounded to five dps? -0.00256 Round -0.00077352421 to six decimal places. -0.000774 What is -0.000117588046 rounded to five dps? -0.00012 Round -0.0025251343 to six dps. -0.002525 What is 221213864.7 rounded to the nearest 10000? 221210000 What is -0.00515300282 rounded to six dps? -0.005153 Round 407745970 to the nearest one hundred thousand. 407700000 Round 0.0000163465379 to seven decimal places. 0.0000163 What is -132042.1948 rounded to the nearest 10? -132040 Round 4111.00111 to 0 decimal places. 4111 Round -0.000000070340927 to seven decimal places. -0.0000001 What is -0.0579346793 rounded to three dps? -0.058 Round -203671.45 to the nearest one thousand. -204000 Round -826390.65 to the nearest 10. -826390 What is -0.000017803804 rounded to five decimal places? -0.00002 Round 7080.05227 to the nearest integer. 7080 What is 337.484091 rounded to the nearest one hundred? 300 What is -120.915162 rounded to the nearest ten? -120 Round 700902270 to the nearest one million. 701000000 Round 0.00000741222588 to seven dps. 0.0000074 What is -0.0000164600086 rounded to 7 decimal places? -0.0000165 What is 0.125797473 rounded to 2 decimal places? 0.13 What is -411691.39 rounded to the nearest 100? -411700 What is -0.0037970376 rounded to 6 decimal places? -0.003797 Round 0.0000132394743 to five decimal places. 0.00001 Round -0.0000137379452 to 7 dps. -0.0000137 What is -0.00004014994296 rounded to seven decimal places? -0.0000401 What is 13.0369398 rounded to 1 dp? 13 Round 0.9985577751 to four decimal places. 0.9986 Round -0.9350678 to zero dps. -1 Round -53.7196818 to three dps. -53.72 Round 874938858.3 to the nearest 100000. 874900000 Round -0.000011904559686 to six dps. -0.000012 Round 0.24693905 to two decimal places. 0.25 Round -0.0260693719 to 5 dps. -0.02607 What is 1.0067529495 rounded to 4 decimal places? 1.0068 Round -0.0005383351234 to seven dps. -0.0005383 What is -0.000245841243 rounded to 6 dps? -0.000246 What is -0.00000118357763 rounded to 6 dps? -0.000001 Round 1830.2608 to the nearest 1000. 2000 Round -0.0029368995 to four dps. -0.0029 Round 24964.8044 to the nearest 10000. 20000 Round 2.469810727 to 2 decimal places. 2.47 Round -0.663533153 to 3 decimal places. -0.664 What is -0.022869822 rounded to 2 decimal places? -0.02 What is -97896.7077 rounded to the nearest 1000? -98000 Round -0.0000000307024706 to seven dps. 0 What is 27803.7976 rounded to the nearest ten thousand? 30000 What is 0.000238599021 rounded to seven dps? 0.0002386 Round 76361997.1 to the nearest 100000. 76400000 Round -3727.175 to the nearest 10. -3730 What is -0.007370641459 rounded to four dps? -0.0074 What is 0.568269725 rounded to three dps? 0.568 Round 0.062819044 to 4 decimal places. 0.0628 What is -0.00070393182 rounded to five decimal places? -0.0007 Round -1.50127125 to two dps. -1.5 Round 260905440 to the nearest one hundred thousand. 260900000 Round 107191982.5 to the nearest one hundred thousand. 107200000 Round -9240656.511 to the nearest 100000. -9200000 Round 0.001335803524 to 4 dps. 0.0013 Round -13.1550531 to the nearest 10. -10 Round -0.0001792966196 to 6 dps. -0.000179 Round 0.0000175926416 to 4 decimal places. 0 What is 0.00000244564565 rounded to 6 dps? 0.000002 Round -0.03322564488 to 2 dps. -0.03 What is 0.0021334834 rounded to 4 decimal places? 0.0021 Round 0.0357700899 to five decimal places. 0.03577 Round -1173274073.2 to the nearest one hundred thousand. -1173300000 What is 0.219335718 rounded to 3 decimal places? 0.219 Round -1257.6507979 to two decimal places. -1257.65 What is -362621.2809 rounded to the nearest one hundred? -362600 Round 8.13510671 to 3 dps. 8.135 What is -1581.216917 rounded to the nearest 10? -1580 Round 0.00000040830999 to 7 decimal places. 0.0000004 What is -28.46696507 rounded to 1 decimal place? -28.5 What is 20238032700 rounded to the nearest 1000000? 20238000000 What is 4.277516402 rounded to one decimal place? 4.3 What is 0.92319708 rounded to four dps? 0.9232 What is -0.000457975343 rounded to 6 dps? -0.000458 Round -7.565209 to 3 dps. -7.565 Round -0.0000437069975 to six decimal places. -0.000044 Round -239354.3139 to the nearest one hundred. -239400 Round 0.154801184 to 2 dps. 0.15 What is -140.9264251 rounded to the nearest 10? -140 Round -0.000162510676 to 5 dps. -0.00016 Round -240029 to the nearest 100000. -200000 Round -116621.3122 to the nearest integer. -116621 What is 322187851 rounded to the nearest 100000? 322200000 What is 0.02299609086 rounded to 4 dps? 0.023 Round 5481.80901 to the nearest 100. 5500 What is 2418012.167 rounded to the nearest one hundred? 2418000 What is -1187176.79 rounded to the nearest 1000? -1187000 What is 0.668776261 rounded to two decimal places? 0.67 Round -0.01391918686 to 7 decimal places. -0.0139192 Round -614.901085 to 2 decimal places. -614.9 Round 38311770 to the nearest 1000000. 38000000 What is -44105.8 rounded to the nearest 1000000? 0 What is 0.002203247917 rounded to five decimal places? 0.0022 What is -21836.551 rounded to the nearest 10? -21840 Round 2278.1951 to the nearest 1000. 2000 Round 168220.261 to the nearest 100. 168200 What is -5370.8409 rounded to the nearest 1000? -5000 What is -2632892.26 rounded to the nearest 100? -2632900 What is -10008.302 rounded to the nearest one thousand? -10000 What is -3186.78801 rounded to the nearest one hundred? -3200 What is -67849.075 rounded to the nearest 10000? -70000 Round -68911709 to the nearest one million. -69000000 Round 0.02313020266 to 5 decimal places. 0.02313 Round -2.3175002 to 2 dps. -2.32 Round -2592545300 to the nearest one million. -2593000000 What is -5888.5185 rounded to the nearest one hundred? -5900 What is -700959 rounded to the nearest one hundred? -701000 Round 0.255978354 to one decimal place. 0.3 What is -203.88441 rounded to the nearest 10? -200 What is 0.0004462011962 rounded to four dps? 0.0004 What is 2186852.361 rounded to the nearest one hundred thousand? 2200000 What is -0.000030094392 rounded to six decimal places? -0.00003 Round 127135.1442 to the nearest 100. 127100 What is 1731.698411 rounded to the nearest one hundred? 1700 What is -0.0451539959 rounded to 5 dps? -0.04515 What is -6.109470283 rounded to three dps? -6.109 Round 0.0061692976 to three dps. 0.006 What is -1017325.619 rounded to the nearest 100000? -1000000 What is 11802839.14 rounded to the nearest 10000? 11800000 Round 27.2360274 to two dps. 27.24 What is 106584.9102 rounded to the nearest ten? 106580 What is -1.67808259 rounded to four decimal places? -1.6781 What is -164.0980995 rounded to the nearest 10? -160 What is -0.00361690376 rounded to three decimal places? -0.004 Round -0.0044108148 to three dps. -0.004 Round -0.0000013556417 to seven decimal places. -0.0000014 What is -11.90560606 rounded to 3 decimal places? -11.906 Round 838.225744 to the nearest 10. 840 Round -34517.90011 to zero decimal places. -34518 What is 62172185.2 rounded to the nearest ten thousand? 62170000 Round 7325122400 to the nearest 1000000. 7325000000 What is -15.1101473 rounded to 0 dps? -15 Round 0.0039060429 to five decimal places. 0.00391 Round -1032751.698 to the nearest 100. -1032800 What is -54811.31 rounded to the nearest 100? -54800 Round -0.0003844730244 to five decimal places. -0.00038 Round -0.00253618765 to 4 decimal places. -0.0025 Round 293.70494 to 1 decimal place. 293.7 Round -166849.434 to the nearest ten. -166850 Round -34509251.7 to the nearest 1000000. -35000000 Round 164744629200 to the nearest 1000000. 164745000000 What is 0.000535436219 rounded to 7 dps? 0.0005354 Round -0.4182980128 to 3 decimal places. -0.418 Round -27012.4144 to the nearest 1000. -27000 Round -506.045497 to 0 decimal places. -506 What is 14418.9581 rounded to the nearest 10? 14420 Round 0.00009949493706 to seven decimal places. 0.0000995 What is 0.000000662981816 rounded to 7 dps? 0.0000007 Round -2.7193217 to three decimal places. -2.719 Round 2717.950345 to 1 dp. 2718 Round 0.00000132860072 to seven dps. 0.0000013 Round -0.0000	{ "pile_set_name": "DM Mathematics" }
/(2090/570). What is the biggest value in 2, 4/7, 0.008, t, -3/7? 2 Let q be (-16)/(-21)(-474)/(-632). What is the second smallest value in 4, q, -15/11? q Let f = 274 + -263. Let z = -11.2 + f. What is the third biggest value in 3, -3/4, z, 2/3? z Let l(u) = u3 + 3u*2 + 3. Let v be l(-3). Let z be 2/4v/6. Suppose 2q = 2h + h + 21, -4h = -3q + 30. Which is the smallest value? (a) 2 (b) q (c) z c Let u = -1.5854 + 0.5854. What is the third biggest value in 162, u, 0.7, 0? 0 Let m = 0.732 + 85.668. Let r = 126.7 - m. Let s = r + -40. What is the biggest value in 0, -0.3, s? s Let b = 0.46 + -0.28. Let u = 0.55 + -0.8. Let w = b + u. What is the second smallest value in 5, w, 3? 3 Let f = 0.299 + -328.299. Let g = 327 + f. Let w = -2 + 15. Which is the biggest value? (a) g (b) 3 (c) w c Let o = 0.11 - -0.03. Let g = 1.147 - 1.107. Let r = g - o. Which is the fourth smallest value? (a) 0.2 (b) r (c) -3 (d) 2/7 d Let v(x) = x*2 + 10x + 24. Suppose 0p + 29p = -145. Let t be v(p). Which is the second smallest value? (a) 2/5 (b) t (c) -2/17 c Let i be (0 - -1)/(17/68). Let n = -0.81 - 0.19. Let m = 0.09 - 3.59. What is the biggest value in i, n, m? i Let o = 92.99 - 92.59. Which is the third biggest value? (a) o (b) -2 (c) -3/2 (d) -6 (e) 1/7 c Let q = -92.76 - -92.96. What is the second smallest value in 0.8, -5/6, q? q Let r = 0.4 + -2.91. Let m = -3.51 - r. Which is the third biggest value? (a) 3 (b) -1/7 (c) 3/8 (d) m b Let b = 16.034 - 16.834. What is the smallest value in 0.1, b, 2/7? b Let x be (-75)/(-18) + (-3)/67/21. Suppose l + 40 = -w + 6l, -2w = -4l + 50. Which is the smallest value? (a) 1/9 (b) x (c) w c Let b = -205 - -371. Let r = 171 - b. Let x be 1 + (-1 - (-2)/(-2)). What is the smallest value in 0, x, r? x Suppose a - 7 = 3. Let b be a + 10 + -14 + 67/(-11). What is the second smallest value in -55, 1, 3/4, b? b Let j = 90 - 130. Let k(o) = -3o2 + 25o + 109. Let y be k(-4). Let r = j - y. Which is the third smallest value? (a) r (b) -4/5 (c) -1/3 c Let x be 12/(-70)((-68)/(-12) + 1). What is the third biggest value in x, -0.3, 5, 2/3? -0.3 Let j be (((-1)/(-4))/(56/42))/(45/60). What is the second biggest value in j, 0.3, -4, 0.5, -39? 0.3 Suppose 0 = -76k + 32k + 88. Let r = 1.2 - 1.5. What is the third biggest value in k, r, -30/13? -30/13 Let o be 24/(-84) - 298/(-14). Suppose 5s = 6 - o. Let k be (-3 + 7 + -5)(s + 2). Which is the biggest value? (a) -0.5 (b) -9 (c) 4 (d) k c Let m = 0.03494 + -77.03494. Let s = 6.5 + -86.5. Let t = s - m. Which is the third smallest value? (a) -2 (b) t (c) 0.4 c Let g = 19.97 + -19.77. Let x = -14 - 33. What is the second smallest value in -4, -2, x, g? -4 Let a = -39280/3 + 13093. Let l = -27.3 + -117.7. What is the second smallest value in a, -4, 5, l? -4 Let f be ((-1)/10)/((504/(-4704))/(3/(-7))). Let o = -1 - -2. Which is the fourth smallest value? (a) 0.1 (b) o (c) f (d) 0.32 b Let t = -74 + 74.4. Let h = -2.1 + 59.1. Let n = 57.3 - h. Which is the biggest value? (a) -3 (b) 2/9 (c) t (d) n c Let d = -3 + 6. Suppose 4f + 5u = 57 - 9, -u = 0. Let p be 58/f + 15/(-3). What is the second biggest value in p, 2, d? 2 Let d be ((-4)/66)/((-10)/(-15)). Let t be (((-4)/(-16))/((-8)/(-32)))/(-1). Which is the smallest value? (a) 1/3 (b) d (c) t c Let j = -65.6 + 361.6. Let o = -295 + j. Let x = 7 - 4. Which is the third biggest value? (a) x (b) o (c) 5 b Let n = 18.4 + -3.4. Let r = 1.27 - 27.27. Let i = r - -25.7. What is the biggest value in 0, i, n? n Let q = 3 - 4. Let l = 53491/35 - 10694/7. Which is the second smallest value? (a) 4 (b) q (c) l c Let w = -2 + 6. Let f = -15013.8 - -14993.8. Which is the biggest value? (a) -0.1 (b) w (c) f b Let z = 23553 - 23522. What is the smallest value in z, -13/6, -5, -2/5? -5 Let i = 0.22 + -0.3. Let d = i - 2.92. Let l = -12790 - -12785. Which is the third biggest value? (a) l (b) -1/3 (c) d a Let o = 80 - 157/2. Suppose g - 3y = -6y - 27, g - 3y - 15 = 0. Which is the second biggest value? (a) o (b) -1/4 (c) g (d) -3/7 b Let m = -1689.7 + 1686.7. Let i(w) = -w*3 + 2w*2 + 2w + 3. Let k be i(3). What is the biggest value in -6/11, m, k? k Let z = -11553/5 + 2311. Which is the biggest value? (a) -4/7 (b) -34 (c) z c Let p = -0.06892 - -0.56892. Which is the second biggest value? (a) -0.14 (b) p (c) 100 b Let l = 13.054 + -17.78. Let u = 0.274 - l. What is the biggest value in -3, -1/3, -5, u? u Let l = 226 - 313. Let u = -87.1 - l. Which is the second smallest value? (a) -2/17 (b) -0.5 (c) u a Suppose 76p + 792 = 5580. What is the smallest value in p, -2, -1/3, 3? -2 Suppose 5t + 5 = -l, l + 5 = -0. Let o = 96 + -63. Which is the fourth smallest value? (a) 2/17 (b) o (c) t (d) -1/2 b Let q be (-3174)/33626 - 2/86. What is the fourth biggest value in 0.2, -0.13, 0.01, q, -1? -0.13 Let r = -3 - -8. Let t be 6/(-8) - (-16 - -41 - 27). Let h be ((-5)/(25/2))/1. Which is the second biggest value? (a) 3/2 (b) t (c) h (d) r a Suppose -68 = -4y - 7r, -34 = -2y - 339r + 342r. Let d be ((-3)/2)/((-12)/(-16)). What is the second smallest value in y, d, -2/13? -2/13 Suppose -m = -4r - 2 + 4, 0 = -2m + 5r + 2. Suppose x - 4g = m, -3x - 16 + 1 = -g. Which is the fourth smallest value? (a) -0.4 (b) x (c) 1/3 (d) -5 c Let i be (3/12)/(125/(-40)). Which is the third biggest value? (a) -1.2 (b) i (c) -5 c Let j = 4920 + -25093/5. Let x = -99 - j. Which is the third biggest value? (a) x (b) -1 (c) 2 b Let i be (-4 - 65/(-16))/(5/30). Let y = 10 - 9.8. Which is the third biggest value? (a) -2/7 (b) y (c) i (d) 0 d Let v = -1 - 0. Let h = -31 - -23.5. Let z = h - -11.5. What is the third biggest value in z, -4, v? -4 Let l be 16/(-12) - (-446)/6. Suppose 0 = ln - 72n. Which is the fourth biggest value? (a) -2/21 (b) n (c) -3 (d) 0.2 c Let x = 4.1 - 4. Let h = -22 - -21.94. Let b = -11.06 - h. What is the third smallest value in b, x, -2/5? x Suppose -19g - 3g - 45g - 536 = 0. What is the third biggest value in 2, -0.04, g? g Suppose 0 = 50o - 68o + 10800. Let h be (92/105)/2 - (-80)/o. Which is the third biggest value? (a) 2 (b) -3/49 (c) h b Let q = 248.7 + -238. Let o = q - -0.3. Suppose -49v + 905 - 660 = 0. Which is the biggest value? (a) o (b) 0.1 (c) 0.2 (d) v a Suppose -o + 5 = -c + 1, 0 = -o - 5c + 4. Let t be 2/(-4)(-552)/((-20)/(-5)). Let q = 70 - t. What is the third smallest value in o, 0.5, q? o Let n = 33.395 + -35.395. Suppose -5v - 60 = -0v. Let m be (-3)/v + (-22)/(-8). Which is the fourth smallest value? (a) 0.4 (b) m (c) n (d) 1/6 b Let c be ((-8)/(-20))/(2 - 164/80). Let l(r) = 2r2 + 23r + 38. Let v be l(c). What is the third biggest value in v, -2/11, 2/7? v Suppose i + 34 = 2i + 2c, -i + 3c + 14 = 0. Suppose 4n + 9n = i. What is the fourth biggest value in n, 5, 0.08, -3? -3 Let s = -4598 + 4594.957. Let w = -0.057 + s. Let d = w + 7.1. What is the second smallest value in 0.1, d, -5/2, -1? -1 Let d = 405 + -385. Suppose dl + 1680 = -l. What is the biggest value in -2/11, 4, l? 4 Let a = 0.99 + 84.01. Let k = -82 + a. Suppose -6s = -9s - 15. What is the smallest value in s, 0.02, k? s Let t = -61.051 + 0.051. Let j = 0.48 - 62.48. Let u = t - j. What is the biggest value in -7, -0.3, u? u Let b = 1.01 - 0.51. What is the fourth biggest value in b, 10/189, -5, 2/3? -5 Let m be (15/5)/(-162)-4. Let i = 0.05 + -1.65. Let h = i + -0.4. Which is the third biggest value? (a) -5 (b) m (c) -4 (d) h c Let j be 7/(-6) + (-1 - -3)/4. Suppose 80 + 96 = 44l. What is the second smallest value in l, j, 0.07? 0.07 Suppose 3z + 625 = 8z. Let p = 623/5 - z. Let u = -489 - -488.9. Which is the smallest value? (a) 0.4 (b) p (c) 2 (d) u b Let p = -39 + 65. Let q = p - 27. Let y = 0.52 - 0.72. What is the second smallest value in q, 5/11, y, -1/3? -1/3 Let b = 2025 - 2885. What is the biggest value in -1, b, -2? -1 Let a = 11 + -22. Suppose 4m + 7x = 47, m - 3x = -0m - 12. Let t = 0.29 + 0.01. What is the smallest value in t, a, m? a Let c = 2868.6 + -2869. What is the third biggest value in -13/2, -1/6, 3/8, c, 1/6? -1/6 Let j = 2668 + -2840. What is the second biggest value in	{ "pile_set_name": "DM Mathematics" }
/(-6) - (-6)/(-9). Suppose t = -0k + k - 25. What are the prime factors of k? 5 Let s be 1 + 9 + (2 - 3). Let g(m) = -m3 + 8m*2 + 9m + 2. Let h be g(s). Suppose -110 = -4f - hj + j, 3f = 4j + 92. What are the prime factors of f? 2, 7 Let t(r) = r*3 + 15r*2 - 2r + 40. List the prime factors of t(-15). 2, 5, 7 Let k(o) be the second derivative of 7o4/6 - o3/6 + o2/2 - 2o. List the prime factors of k(2). 5, 11 Let l(s) = -s*3 + 33s*2 - 157s + 12. What are the prime factors of l(22)? 2, 941 Let b(f) = 14f - 64. Let d be b(6). Suppose 356 = 4y + d. List the prime factors of y. 2, 3, 7 Suppose -2453 = -5v - 6v. List the prime factors of v. 223 Let r be (-40)/50 - 8/(-10). Let o(z) = -2z + 30. Let p be o(r). List the prime factors of p - (-1 + 1)/(-1). 2, 3, 5 Let f be 34(-20)/8. Let t = f + 56. List the prime factors of t. 2, 13 Let a = -8 + 2. Let r be 3/((-9)/a) - 1. Let i(p) = 62p*2 - 4p + 3. List the prime factors of i(r). 61 Let o(n) = n*3 - 5n*2 + 9n + 2. List the prime factors of o(9). 11, 37 Let c(x) = -2x3 - 5x*2 - x. Let l be c(-2). What are the prime factors of (l/(-5))/(3/150)? 2, 5 Suppose -2v + 1142 = 3b, 2v = 4b - 0v - 1532. List the prime factors of b. 2, 191 Suppose -7r + 210 = -4r. Suppose 22 - r = -2u. Suppose o + 14 = 5l - 25, u = 4l + o. What are the prime factors of l? 7 Let n(l) = 4l - 17. Let h be n(6). Let r(f) = f*2 + 2f - 7. What are the prime factors of r(h)? 2, 7 Suppose 3v - 3 = 12. Suppose -vg = -g - 176. Let w = -16 + g. What are the prime factors of w? 2, 7 Suppose -2 = -a + 2a + l, 0 = -4a - 2l. Suppose 4y - ac - 1292 = -406, c + 5 = 0. List the prime factors of y. 3, 73 Let x(o) = -o3 - 5o*2 + 7o + 3. Let c be x(-6). Let t = c + 9. Let v(z) = -z*2 + 8z + 6. List the prime factors of v(t). 2, 3 Suppose 22y = 43y - 16695. List the prime factors of y. 3, 5, 53 What are the prime factors of (71 - 2)1496/66? 2, 17, 23 What are the prime factors of 56/(-140) - 7217/(-5)? 3, 13, 37 Let r(d) = d3 + 450. What are the prime factors of r(0)? 2, 3, 5 Let g = 93 + 21. What are the prime factors of g? 2, 3, 19 Let k be -138 + 0 + (-124)/31. Let z = k + 399. What are the prime factors of z? 257 Suppose 0 = -4z + 2p + 68, 4z - 4p = -p + 72. Suppose -k = 2k - z. Suppose l + k = 38. What are the prime factors of l? 3, 11 Let w(p) = 2p2 - 8p - 1. Let v be w(-3). Let u(k) = -42k - 2 + 13 + vk. What are the prime factors of u(-5)? 2 Let l = 19 - -1439. What are the prime factors of l? 2, 3 Suppose 3 + 1 = 2d. Suppose 0 = 5t + q - 222 - 293, 183 = dt + 5q. Suppose 0 = 5h, 4s - t = -0s - 2h. What are the prime factors of s? 2, 13 Suppose -w - 5 = 0, -y - 3 = 2w + 4. Suppose -ym + 10 = -5. Suppose -54 = mi - 169. What are the prime factors of i? 23 Let y = 5 - 0. Suppose yw - 2l + l = 65, -w - 2l = -24. Let f = w + 3. List the prime factors of f. 17 Let q(o) = -o*2 + o - 11. Let p be q(0). Let n be 0 + -4 - (15 + 4). Let g = p - n. List the prime factors of g. 2, 3 Suppose 5q - 6j = -11j + 3445, 2750 = 4q + j. What are the prime factors of q? 3, 229 Suppose -4l - 12 = -8l, 0 = -3p - 3l. List the prime factors of (-15)/(-4)(-12)/p. 3, 5 Let s be (-2 + 8/7)/(10/70). List the prime factors of 1/((-2)/30)(s - 1). 3, 5, 7 Let y(d) = -26d + 1. Let o(k) = 5k. Let r(m) = 11o(m) + 2y(m). Let w be r(0). Suppose wa - 3a + 19 = 0. List the prime factors of a. 19 Let j = -187 - -228. List the prime factors of j. 41 Let r be 35/21 - (-1)/3. Suppose 0l + l = 0, -2t = rl - 60. List the prime factors of t. 2, 3, 5 Let b = 12 + 2. Suppose -15u + 24u - 279 = 0. Suppose -b = -3j + u. What are the prime factors of j? 3, 5 Let f be (-6)/((-3)/(2 - (-3 - -1))). Suppose -176 - 128 = -fg. What are the prime factors of g? 2, 19 Let s(b) = b*3 + 4b*2 + 3b + 1. Let a be s(-3). Suppose v - a = 1. Suppose 2q - 3o = 50, 2q = 3o + vo + 58. What are the prime factors of q? 19 Let n(z) = 74z + 89. What are the prime factors of n(6)? 13, 41 Let q(y) be the first derivative of 4y3/3 + y2/2 - 2y + 17. What are the prime factors of q(5)? 103 Suppose 114996 = -12w + 33w. What are the prime factors of w? 2, 37 Suppose -5k + 155 = -5s, 4k = -s - 0s + 119. Suppose -5t + 63 + 27 = -3w, w + 5t = -k. What are the prime factors of (2/(-3))/(4/w)? 5 List the prime factors of 7485/27 + 50/(-225). 277 Let w = 243 - 93. Let f = w - 103. What are the prime factors of f? 47 Suppose 0 = 7m - 8119 - 2899. List the prime factors of m. 2, 787 Let w(a) = -a*3 - 15a*2 - 3a - 22. Suppose 4g + 5v = 12 + 2, -2v - 1 = -5g. Let i be (-24 - -8) + 0 + g. List the prime factors of w(i). 23 Let s be (-16)/(-28)(-7)/(-2). Let m(b) = -7b3 - b2 - sb + 0 - 1 + 4b. List the prime factors of m(-2). 47 Suppose 5a = -2v - 24, 7 = -3v - a - 3. What are the prime factors of (-4026)/(-495) - v/(-15)? 2 Let a(f) = -66f - 4. Let z be a(-4). Suppose 3h - 7h - 5k = -z, -4h + 260 = -k. What are the prime factors of h? 5, 13 Suppose 3p - 1622 = -326. List the prime factors of p. 2, 3 Let l be ((-48)/(-20))/(-4)-5. Suppose 3k = y + 99, -lk + 4y = -126 + 18. List the prime factors of k. 2 Let v(b) = 32b + 58. Let c(o) = -16o - 29. Let q(x) = -13c(x) - 6v(x). List the prime factors of q(5). 109 Let s = 109 + -78. Let w = s + -19. List the prime factors of w. 2, 3 Suppose 2f + n + 96 - 22 = 0, 0 = 4f - 3n + 128. Let l = f + 47. List the prime factors of l. 2, 3 Let z = 997 - 249. List the prime factors of z. 2, 11, 17 Suppose -r + 5g = -16 - 7, -2g - 10 = 0. Let m be 18/3 + (r - 1). Let w = m - -13. List the prime factors of w. 2 Let h be (0 - -1) + -25 + -2. Suppose -40 = d - 31. Let q = d - h. List the prime factors of q. 17 Let l(c) = c + 1. Let f be l(5). Let j = f + 69. List the prime factors of j. 3, 5 Let z(x) = -x - 45. Let q be z(0). Let y = 105 + q. Suppose -a = 2a - y. List the prime factors of a. 2, 5 Let h(z) = 0z*3 - 3z + z - z - 3z2 + 2 + z3. Let u be h(4). What are the prime factors of (-3)/u + (-38)/(-4)? 3 List the prime factors of -4 + (-15834)/(-15) + (-4)/(-10). 2, 263 Let w(o) = o3 - o + 2. Let h be w(1). List the prime factors of 40 + 4/((-8)/h) + 0. 3, 13 Let q be (-1 + 9/15)45/(-3). Suppose 2f - q = 0, 2z - 4z - 5f + 113 = 0. What are the prime factors of z? 7 Suppose 0 = y + 5g - 2801, 5g - 3225 - 2372 = -2y. List the prime factors of y. 2, 3, 233 Suppose 0 = -3a + 7a - 112. Suppose -2k = -5f - 137, 0 = -2k + 4f - 7 + 139. Suppose -3x + k + a = 0. List the prime factors of x. 2, 7 Let t = -27 + 39. Let q = 9 - t. List the prime factors of q/(-12) - (-87)/4. 2, 11 What are the prime factors of (-2 - 24/(-16))-4542? 3, 757 Let l(d) be the second derivative of -4d*3/3 - 29d*2/2 - 2d. What are the prime factors of l(-14)? 83 Let l be (-13088)/(-96) + 4/6. Suppose r - l = 86. List the prime factors of r. 223 Let b(c) = -4c - 37. Let j(n) = 9n + 73. Let o(k) = -11b(k) - 6j(k). What are the prime factors of o(-16)? 3, 43 Suppose -5078 - 19572 = -25c. What are the prime factors of c? 2, 17, 29 Let h = -25 - -66. Suppose 0 = q - 3v - 28, -2q = -0q - v - h. What are the prime factors of q? 19 Let u = -419 - -1388. What are the prime factors of u? 3, 17, 19 Let t be (-8)/(-32)136/2. Suppose l = -12 + t. What are the prime factors of (-14)/(-35) + 128/l? 2, 13 Suppose 0 = -4v + 4k, -5k - 7 = 2v - 0v. Let z = 3 - v. Let r = 12 + z. List the prime factors of r. 2 What are the prime factors of (-5 - -4)(-1386 + 1)? 5, 277 Suppose -4b - 45 = -a + 53, -b + 320 = 3a. Suppose 15p - 75 = 510. Let u = a - p. List the prime factors of u. 67 Suppose -k + 3x + 1 = 0, 0 = 2k + x - 15 - 8. Suppose 86 = ky - 54. What are the prime factors of y? 2, 7 Let i(b) be the third derivative of b6/120 + 2b*5/15 + 7b4/24 - b3/6 + 4b2. Let v be i(-7). What are the prime factors of (13 - -9)v/(-2)? 11 Suppose -4s = 5q - 3035, 0q = -5s + 4q + 3804. List the prime factors of s. 2, 5, 19 Let g(r) = -60r - 137. What are the prime factors of g(-24)? 1303 Let t = -6 + 14. Let n(r) = -r*2 + 7r + 8. Let k be n(t). Suppose k = 2*o + 3 - 7. List the prime factors of o. 2 Let z(g) be t	{ "pile_set_name": "DM Mathematics" }
tor of -59/9 and -7/16407? 16407 What is the common denominator of -59/54335 and -14/67? 3640445 What is the smallest common multiple of 440 and 13790? 606760 Calculate the lowest common multiple of 895554 and 10. 4477770 What is the least common multiple of 374 and 1547? 34034 What is the common denominator of -101/12 and 77/3048? 3048 What is the common denominator of -67/154 and -193/1386? 1386 Calculate the common denominator of 44/1755 and -31/780. 7020 Calculate the lowest common multiple of 24 and 29316. 58632 Calculate the least common multiple of 5301 and 186. 10602 What is the common denominator of -59/184860 and 43/523770? 3142620 What is the common denominator of -137/5952 and -17/24960? 773760 What is the common denominator of -111/14 and -31/2786? 2786 Calculate the common denominator of -33/511277 and -29/8. 4090216 Calculate the smallest common multiple of 655272 and 38799. 5897448 What is the smallest common multiple of 11690 and 140280? 140280 Calculate the least common multiple of 3968 and 20. 19840 Find the common denominator of -137/69708 and -1/3108. 487956 What is the common denominator of -43/1393 and -45/796? 5572 What is the lowest common multiple of 20 and 3400? 3400 What is the least common multiple of 308148 and 2? 308148 Calculate the common denominator of -17/32 and -55/1043076. 8344608 What is the smallest common multiple of 9779 and 26543? 185801 Find the common denominator of -23/3330 and -95/1998. 9990 Find the common denominator of -32/9555 and 115/294. 19110 Calculate the common denominator of 11/21072 and 47/48. 21072 Find the common denominator of 71/27 and 2/60351. 543159 What is the lowest common multiple of 25368 and 280? 126840 What is the lowest common multiple of 252720 and 832? 1010880 What is the least common multiple of 3 and 105327? 105327 Find the common denominator of 93/45436 and -45/148. 45436 Calculate the lowest common multiple of 948480 and 1280. 948480 Find the common denominator of -64/35 and 28/262495. 1837465 Calculate the common denominator of -137/103842 and -133/57690. 519210 Calculate the lowest common multiple of 10 and 147884. 739420 What is the common denominator of -13/22 and -23/15966? 175626 Calculate the lowest common multiple of 560 and 19152. 95760 Calculate the lowest common multiple of 32 and 96294. 1540704 Calculate the lowest common multiple of 45 and 14400. 14400 What is the common denominator of 20/24633 and -31/27? 73899 What is the lowest common multiple of 6840 and 102? 116280 Calculate the common denominator of 9/1241512 and 121/9980. 6207560 What is the smallest common multiple of 103008 and 103008? 103008 Calculate the lowest common multiple of 114 and 47274. 898206 What is the smallest common multiple of 3767001 and 9? 11301003 Find the common denominator of -8/9 and 81/910. 8190 Find the common denominator of -81/1272392 and 11/925376. 10179136 What is the smallest common multiple of 102064 and 18? 918576 What is the common denominator of 139/12 and 57/13874? 83244 What is the least common multiple of 184 and 335685? 2685480 What is the lowest common multiple of 67804 and 4623? 203412 What is the least common multiple of 1 and 3476571? 3476571 Calculate the smallest common multiple of 323349 and 195. 1616745 Find the common denominator of -107/238 and -15/115787. 231574 Calculate the common denominator of -15/8 and -29/625159. 5001272 Find the common denominator of 23/163 and 21/64385. 64385 Find the common denominator of 71/45288 and -79/14688. 543456 Calculate the common denominator of 23/8520 and -9/143. 1218360 What is the common denominator of -22/17 and -51/98? 1666 What is the least common multiple of 144 and 693? 11088 What is the common denominator of -74/6159 and -36/1455577? 4366731 What is the lowest common multiple of 812206 and 10? 4061030 What is the common denominator of 83/145080 and 181/90? 145080 What is the common denominator of 17/2112 and 103/2178? 69696 Find the common denominator of -67/110 and 51/11. 110 Calculate the lowest common multiple of 2160 and 4. 2160 Calculate the lowest common multiple of 510 and 3120. 53040 Find the common denominator of -31/1472212 and 101/1261896. 8833272 Calculate the lowest common multiple of 63616 and 143136. 572544 Calculate the smallest common multiple of 5376 and 25536. 102144 What is the common denominator of 32/505 and -62/5645? 570145 What is the smallest common multiple of 1225 and 43659? 1091475 Calculate the smallest common multiple of 7236 and 7437. 267732 Calculate the smallest common multiple of 16088 and 18099. 144792 Find the common denominator of 39/65960 and 131/1224. 593640 Calculate the smallest common multiple of 45 and 301495. 2713455 What is the common denominator of -61/301920 and -53/981240? 3924960 Calculate the smallest common multiple of 35787 and 107361. 107361 Find the common denominator of -15/2 and 1/15037. 30074 What is the common denominator of -77/41850 and -31/10? 41850 What is the common denominator of 19/10530 and -151/108? 21060 Calculate the least common multiple of 32 and 4904. 19616 Calculate the least common multiple of 19845 and 1960. 158760 Calculate the lowest common multiple of 211850 and 127110. 635550 Calculate the lowest common multiple of 573 and 3172. 1817556 Calculate the smallest common multiple of 49076 and 134959. 539836 Calculate the common denominator of -71/3344 and -125/6624. 1384416 Calculate the least common multiple of 92 and 25100. 577300 What is the least common multiple of 48644 and 16? 194576 Calculate the least common multiple of 45612 and 162. 410508 What is the common denominator of -57/7640 and -65/92? 175720 Find the common denominator of -35/1051842 and -5/21. 7362894 Calculate the common denominator of 83/876 and 117/16960. 3714240 Calculate the least common multiple of 782 and 3570. 82110 Find the common denominator of 121/105180 and 67/108. 946620 What is the common denominator of -61/67632 and -149/338160? 338160 Calculate the smallest common multiple of 1414 and 28. 2828 What is the common denominator of -41/6034 and -8/133? 114646 Find the common denominator of -82/189 and 71/81284. 2194668 Calculate the least common multiple of 312368 and 78092. 312368 Calculate the lowest common multiple of 249 and 18011. 54033 What is the common denominator of -129/30856 and 31/3192? 92568 Calculate the least common multiple of 8656 and 6. 25968 Find the common denominator of -71/2625 and -167/1512. 189000 What is the lowest common multiple of 5088 and 180? 76320 What is the common denominator of 97/10 and 49/3670? 3670 Find the common denominator of -55/1352 and -67/4. 1352 What is the least common multiple of 216 and 1680? 15120 Calculate the lowest common multiple of 425682 and 425682. 425682 What is the least common multiple of 4140 and 163530? 327060 Calculate the common denominator of 87/30944 and -101/1732. 13398752 Calculate the smallest common multiple of 4275 and 30. 8550 Calculate the common denominator of -8/39 and -101/15912. 15912 Calculate the common denominator of -32/1593 and -31/3009. 27081 Find the common denominator of 3/6704 and -85/192. 80448 Calculate the common denominator of 83/5154 and 71/60. 51540 What is the least common multiple of 7952 and 7384? 103376 Find the common denominator of -47/17446 and 137/14274. 157014 What is the common denominator of -97/26408 and -77/118836? 237672 What is the lowest common multiple of 489 and 489? 489 What is the common denominator of 28/393 and -41/9825? 9825 Calculate the common denominator of -61/689112 and 59/95710. 3445560 What is the common denominator of -55/876 and -17/11121? 3247332 What is the common denominator of 55/4462 and -49/2369? 459586 Find the common denominator of -71/16050 and -119/9630. 48150 Find the common denominator of 67/35612 and -27/15544. 4772008 What is the smallest common multiple of 3034 and 30996? 1146852 Calculate the common denominator of 93/125170 and -43/20. 250340 What is the common denominator of -91/666 and 119/652310? 5870790 Calculate the smallest common multiple of 484435 and 622845. 4359915 What is the lowest common multiple of 81496 and 3? 244488 Calculate the common denominator of 2/11 and -19/200273. 2203003 Find the common	{ "pile_set_name": "DM Mathematics" }
pose -oj + p = -j. Is j prime? True Is ((-2)/(-6))/(45/(-135)) - -41670 composite? False Let j = -12 - -113. Suppose 0 = -4l + 5p - 189, 0l + l + 2p = -44. Let n = j + l. Is n prime? False Let q be 3/2 + (-1)/2. Let i(h) be the first derivative of 80h*3/3 - h - 92. Is i(q) prime? True Is 10 + 138/(-12) + (-28282)/(-4) prime? True Let d(f) = 2f - 9. Let z be d(0). Is (-3210)/(-18) - (-12)/z composite? True Suppose -i + 2i + 17 = -2b, 4b - 5i + 13 = 0. Is b/(14/8) - -255 a composite number? False Let d(v) = 19v2 + 23v - 25. Is d(-12) prime? False Suppose 4b + 122 = 698. Let v = -87 + b. Is v prime? False Suppose -2c + 0c = 2c. Suppose cm - 2001 = -3m. Is m a prime number? False Suppose c + 2c - 28 = 4g, -16 = -4c. Let p(m) = 23m - 3. Let f be p(4). Let t = f + g. Is t prime? False Let w = -2112 + 3655. Is w prime? True Suppose 19 = 4g - 61. Is 685 - (4 - g/5) a composite number? True Let i(f) = f2 + 9f - 8. Let v be i(-10). Suppose -n + v = -1, 488 = r + 3n. Is r a prime number? True Let w(n) be the third derivative of -n6/120 - n5/30 + 641n*3/6 + 6n*2. Is w(0) a composite number? False Suppose -2g = -x - 51497, -2g + 11x = 7x - 51482. Is g a composite number? True Let t(y) be the second derivative of -y5/20 + y4/12 + 2y*2 - 5y. Let l be t(2). Is (l + -1 + 0)-53 a prime number? True Suppose 8z = -2w + 3z + 1360, -z = 3w - 2053. Suppose 0x + 5x = 25. Suppose -w = 4v - xv. Is v prime? False Suppose -8748 - 9982 = -5n. Is n a composite number? True Suppose n - 5b = 303, 0 = 4b + 9 - 25. Suppose -4h = 20, 0 = 3s + h - 53 - n. Is s a composite number? False Let b = -37 - -62. Let i be (10 + -5)/(0 - -1). Is (-5)/b - (-1116)/i prime? True Let x(j) = -j*2 + 1. Let w be 26/(-143) + (-9)/11. Let a(q) = -27q*2 + 2q. Let k(y) = wa(y) - 5x(y). Is k(-2) prime? True Let a(b) = 21b + 10. Let l = -12 + 5. Let z be ((-16)/10)/(l/35). Is a(z) composite? True Is (-39723)/244-6 a composite number? True Suppose -4k + 22 = -k - 2f, -f + 15 = 5k. Let u(a) = a*3 - 5a*2 + 4a + 3. Let z be u(k). Suppose l + 746 = zl. Is l a composite number? False Suppose 4z - 2f + 4f = 18, 4 = -3z + 2f. Suppose -12 = zi - 14, 2i + 895 = 3o. Is o a prime number? False Suppose -2b + 0b = -2. Let d be (-1632 + (0 - b))1. Let y = d - -2522. Is y a prime number? False Let p = -7776 + 14533. Is p composite? True Suppose 4h + 37 = -15. Let w(c) = -9c + 40. Is w(h) a composite number? False Let c(n) = -484n + 95. Is c(-8) composite? False Is (-916296)/(-28) + 8/7 composite? True Suppose -3r = -2i - 7, 2i + 4r = 7i + 21. Is -2 + (-12)/i - (-63581)/35 a prime number? False Let y(c) = c*2 - 22c - 69. Let h be y(24). Let g = -36 - -62. Let w = g - h. Is w composite? False Let d be 12/(-1)((-20)/15 - -1). Suppose -m - 3869 = -ds, 5s - 2m - 3952 = 885. Is s a composite number? False Let m be (-46)/(-14) + 4/(-14). Let t(p) be the second derivative of 7p4/6 - 5p*3/6 + 2p*2 - 40p. Is t(m) a composite number? True Let b(v) = -18v - 17 - 23 + 78v + 39v. Is b(23) composite? False Suppose 8453 = 11u + 1512. Is u composite? False Let s be (5/3)/((-8)/(-96)). Let t = -11 + s. Is 6(78/t + -3) a prime number? False Is 46/(-23) - (-3)/(15/49475) prime? False Let g be (-378)/35 + 1/(-5). Let p = -10 - g. Is p/(-4) - (-663)/12 a composite number? True Suppose 5q = -u + 20 - 1, 8 = 2u. Is (15/(-2))/q(-13512)/60 a prime number? True Suppose 0 = t - 794 - 557. Is t a prime number? False Suppose 3z = 5y - 1, 0 = 3y - 2z + 6z - 18. Suppose yl + 158 = 5f, 297 + 19 = -4l + f. Is l/((-3)/(3 - 0)) a prime number? True Let s = -143 + 3790. Is s prime? False Let o be ((-3)/6)/((-2)/48). Suppose -7i = -oi. Suppose ix + 3x = 2901. Is x a prime number? True Let v = -26 + 11. Let x = v - -20. Suppose c - 80 = -xg, -6g + 185 = 3c - 2g. Is c composite? True Let d be (-39)/(-1(-4)/(-12)). Suppose -d = 3u - 591. Is u a composite number? True Let l = 1613 - 936. Is l prime? True Let z be 1/(2/(-898)) + -2. Let k(l) = -21l2 - 4l - 36. Let b be k(-6). Let w = z - b. Is w prime? True Suppose 0 = -2m - t + 156, 2m = -0t + t + 160. Let i(a) = a2 - 6a + 4. Let d be i(5). Is m + -22/d prime? True Let k(c) be the first derivative of 8c*2 + 13c + 10. Is k(15) a prime number? False Suppose 3m - 3w + 3 = 0, 0m + 4m - 20 = -4w. Suppose -mo = -4q - 1494, -4o + 2q + 2q = -2992. Is o composite? True Suppose -c - 6 = -3c. Suppose 0 = -cy + 4x + 9, -5y - x + 4x = -15. Suppose yf - 111 = -0f. Is f a prime number? True Let c = -34 - -142. Let i = c + -256. Let s = 235 + i. Is s prime? False Let n(i) = 1464i*2 - 171i + 508. Is n(3) a composite number? False Suppose -95v + 725241 = -62v. Is v a prime number? True Suppose 4i - 3b - 12 = 0, -4b - 3 = -i - 0i. Let n be 68 + (-6)/i + 4. Let w = n - 36. Is w a composite number? True Suppose 0 = 4w - 8, -18j = -20j + 2w + 7522. Is j composite? True Let n be (3 + -6)1 + -1. Let r be -42n/16. Suppose -t + rk = t - 230, -t + 123 = -5k. Is t composite? False Let u(n) = 3n - 1. Let c be u(2). Suppose -m - o + 6 - 3 = 0, -3m - co + 5 = 0. Is (6 - (m + -2)) + 288 a composite number? True Suppose -4l + 2700 = 4s, -30s + 1348 = -28s + l. Is s prime? True Suppose t = -4y + 3, 0 = -5t + y - 57 - 12. Let r = t + 176. Is r a prime number? True Let w(d) be the third derivative of 13d2 - 1/12d*4 + 0d - 1/6d3 + 1/3d*5 + 0. Is w(-2) composite? False Let x = -28 + 24. Let d = 351 + x. Is d composite? False Let s be 2535 + -4 + (-2 - 1). Suppose 4m = 2l - s, 3l - 4m + 9m - 3748 = 0. Let f = l + -813. Is f prime? True Suppose 2l = l - 2, -2p = -3l - 40. Suppose b - 14 - p = 0. Suppose 2t - t - b = 0. Is t composite? False Let g be -51-316/36. Suppose g + 387 = 5x. Is x a prime number? False Let u = -64 - 253. Let k = 515 + u. Let i = k + 13. Is i a composite number? False Let o(x) = 4257x*2 - 3x - 2. Is o(-1) prime? False Suppose -6108 - 50170 = -19q. Is q a prime number? False Let j be ((-1899)/12)/(3/12). Let m = j - -1371. Suppose -3u + m = 249. Is u composite? False Suppose -2l = l + 5i - 113, 109 = 3l + i. Let y(k) = 4k + 3. Let j be y(-2). Let t = l + j. Is t a composite number? False Suppose 2g - 3d = -g + 2106, 0 = g + d - 696. Let f = g + -1878. Is (4/(-6))/(6/f) a prime number? True Let d(m) = -2m3 + 33m*2 + 16m + 3. Is d(14) a prime number? False Let t = -116 - -176. Let r = 115 - t. Is r composite? True Suppose 0 = 18o - 530665 + 60235. Is o prime? False Let u be (58 + -1)(-1)/(-1). Let b = 112 - u. Suppose -3r + 2c = -1 - b, -4r + 4c + 68 = 0. Is r a composite number? True Let x be (24/9 + -1)3. Suppose xv - v + 48 = m, 2m + 3v - 107 = 0. Suppose 0 = 2u + 4j - 24, -4u + j + m = 5j. Is u a composite number? True Let w(m) = -1097m + 0 + 0 + 897m + 1. Is w(-9) a composite number? False Suppose 4x - 7552 = 4l, 4x + 5l + 1384 - 8981 = 0. Is x composite? True Let x = 14569 - -1222. Is x prime? True Suppose 0 = 4r - 11r - 7189. Is r/((6 - 5)/(-1)) a composite number? True Is (-2)/6 - (-6)/(-9)-19484 prime? False Let d = 97 - 79. Is (-4)/d - (-6884)/36 composite? False Suppose 3x - 57946 = -4n, -20x - 8 = -24x. Is n composite? True Suppose h + 2 = -m, -5h - 2m = -5m - 22. Suppose -hg + 4g + 308 = 0. Let y = -87 - g. Is y composite? False Let j be 1 + 2/4-2. Suppose -x - x + 10 = j. Suppose -xz + 42 - 8 = 2m, 0 = 3m + 5z - 56. Is m a prime number? False Let n = 187 + 52. Is n a prime number? True Suppose 34b - 243174 - 132560 = 0. Is b composite? True Suppose 56 + 0 = -2b. Let c be (b/(-12))/(-7)-9. Suppose 29 = cq + 2. Is q a prime number? False Let p = -32 + 83. Suppose o + k - 2k = 9, 0 = -4o - k + 26. Suppose 6l = ol - p. Is l composite? True Let s(c) = -5c + 11. Let a be s(1). Suppose 3t - 12 = 0, 4t + 3564 = 4b + at. Is b a prime number? False Let j(h) = 12h3 + 1. Let b be j(-1). Let k be b + 13 - (-1 + -2). Suppose -5u = 4l - 261, -3l - 102 = -ku - 254. Is l a prime number? True Let f(t) = -11t*3 + 13t*2 - 3t + 13. Let q(o) = 11o3 - 12o*2 + 2o - 12. Let n(j) = -3f(j) - 2q(j). Is n(6) a prime number? False Let j	{ "pile_set_name": "DM Mathematics" }
e the remainder when 191598 is divided by 70. 8 What is the remainder when 7838 is divided by 3911? 16 What is the remainder when 133150 is divided by 146? 144 What is the remainder when 15825 is divided by 2063? 1384 Calculate the remainder when 11815 is divided by 2902. 207 Calculate the remainder when 41808 is divided by 20. 8 Calculate the remainder when 1505 is divided by 726. 53 What is the remainder when 1165 is divided by 109? 75 Calculate the remainder when 2115 is divided by 430. 395 Calculate the remainder when 13098 is divided by 1015. 918 Calculate the remainder when 31974 is divided by 164. 158 Calculate the remainder when 1723066 is divided by 664. 650 Calculate the remainder when 3489 is divided by 859. 53 Calculate the remainder when 5128 is divided by 59. 54 Calculate the remainder when 8352 is divided by 8345. 7 Calculate the remainder when 27379 is divided by 13682. 15 Calculate the remainder when 26563 is divided by 19. 1 What is the remainder when 1446 is divided by 144? 6 What is the remainder when 495575 is divided by 20? 15 What is the remainder when 5731 is divided by 523? 501 What is the remainder when 326493 is divided by 456? 453 Calculate the remainder when 45957 is divided by 15303. 48 Calculate the remainder when 155050 is divided by 236. 234 What is the remainder when 21702 is divided by 157? 36 Calculate the remainder when 75775 is divided by 587. 52 What is the remainder when 434267 is divided by 27? 26 What is the remainder when 9183 is divided by 3705? 1773 What is the remainder when 451396 is divided by 150462? 10 What is the remainder when 2350 is divided by 940? 470 What is the remainder when 3559 is divided by 973? 640 What is the remainder when 80030 is divided by 15997? 45 Calculate the remainder when 1117194 is divided by 1050. 1044 What is the remainder when 311015 is divided by 24? 23 What is the remainder when 12983 is divided by 4227? 302 What is the remainder when 22637 is divided by 2515? 2 What is the remainder when 525 is divided by 166? 27 What is the remainder when 16696 is divided by 6? 4 What is the remainder when 2350 is divided by 478? 438 What is the remainder when 9435 is divided by 9395? 40 What is the remainder when 6575823 is divided by 41? 38 What is the remainder when 2726 is divided by 197? 165 Calculate the remainder when 287945 is divided by 1047. 20 What is the remainder when 30793 is divided by 36? 13 What is the remainder when 72260 is divided by 260? 240 What is the remainder when 119285 is divided by 151? 146 What is the remainder when 66758 is divided by 8? 6 What is the remainder when 9380 is divided by 17? 13 What is the remainder when 75821 is divided by 337? 333 Calculate the remainder when 198166 is divided by 8. 6 Calculate the remainder when 4297 is divided by 50. 47 Calculate the remainder when 11976 is divided by 1. 0 What is the remainder when 4515 is divided by 565? 560 Calculate the remainder when 382408 is divided by 478. 8 Calculate the remainder when 2537 is divided by 159. 152 Calculate the remainder when 18485 is divided by 86. 81 What is the remainder when 76791 is divided by 244? 175 Calculate the remainder when 104671 is divided by 34882. 25 Calculate the remainder when 2805 is divided by 1026. 753 Calculate the remainder when 2833 is divided by 931. 40 Calculate the remainder when 7911 is divided by 528. 519 What is the remainder when 2595 is divided by 280? 75 What is the remainder when 7135 is divided by 359? 314 What is the remainder when 408933 is divided by 92? 85 Calculate the remainder when 216144 is divided by 661. 658 Calculate the remainder when 22404 is divided by 5587. 56 Calculate the remainder when 3969 is divided by 1118. 615 What is the remainder when 178435 is divided by 13? 10 What is the remainder when 71377 is divided by 13? 7 What is the remainder when 111438 is divided by 11142? 18 Calculate the remainder when 163167 is divided by 40776. 63 Calculate the remainder when 1455 is divided by 98. 83 Calculate the remainder when 2593 is divided by 200. 193 Calculate the remainder when 42314 is divided by 3846. 8 What is the remainder when 761183 is divided by 10? 3 Calculate the remainder when 712 is divided by 186. 154 Calculate the remainder when 18716 is divided by 750. 716 What is the remainder when 13936 is divided by 12686? 1250 What is the remainder when 607 is divided by 276? 55 Calculate the remainder when 679 is divided by 555. 124 Calculate the remainder when 1234455 is divided by 92. 91 What is the remainder when 76582 is divided by 38223? 136 Calculate the remainder when 81270 is divided by 110. 90 What is the remainder when 121890 is divided by 121877? 13 Calculate the remainder when 79741 is divided by 205. 201 Calculate the remainder when 4895 is divided by 223. 212 Calculate the remainder when 7618 is divided by 31. 23 What is the remainder when 138874 is divided by 496? 490 Calculate the remainder when 17198 is divided by 3150. 1448 What is the remainder when 1861 is divided by 188? 169 What is the remainder when 28020 is divided by 3979? 167 What is the remainder when 7273 is divided by 512? 105 What is the remainder when 16501 is divided by 62? 9 Calculate the remainder when 579 is divided by 110. 29 What is the remainder when 16323 is divided by 3264? 3 Calculate the remainder when 106442 is divided by 53199. 44 What is the remainder when 2426 is divided by 94? 76 What is the remainder when 1918 is divided by 317? 16 What is the remainder when 9219 is divided by 98? 7 What is the remainder when 24991 is divided by 555? 16 Calculate the remainder when 9722 is divided by 10. 2 What is the remainder when 11162 is divided by 114? 104 What is the remainder when 503358 is divided by 10? 8 Calculate the remainder when 844388 is divided by 10. 8 Calculate the remainder when 654 is divided by 647. 7 Calculate the remainder when 47251 is divided by 696. 619 What is the remainder when 4921 is divided by 2450? 21 Calculate the remainder when 272686 is divided by 138. 136 Calculate the remainder when 325302 is divided by 148. 146 What is the remainder when 3648039 is divided by 8? 7 What is the remainder when 762 is divided by 70? 62 Calculate the remainder when 841263 is divided by 75. 63 Calculate the remainder when 1082 is divided by 84. 74 Calculate the remainder when 70803 is divided by 414. 9 Calculate the remainder when 41366 is divided by 161. 150 Calculate the remainder when 233094 is divided by 116539. 16 What is the remainder when 13181 is divided by 26? 25 What is the remainder when 897 is divided by 814? 83 Calculate the remainder when 12534 is divided by 132. 126 Calculate the remainder when 26754 is divided by 637. 0 What is the remainder when 1373 is divided by 156? 125 What is the remainder when 1040 is divided by 2? 0 Calculate the remainder when 119955 is divided by 52. 43 Calculate the remainder when 13412 is divided by 21. 14 What is the remainder when 11660 is divided by 11634? 26 Calculate the remainder when 81759 is divided by 5. 4 Calculate the remainder when 229198 is divided by 29. 11 Calculate the remainder when 5854 is divided by 1939. 37 Calculate the remainder when 964866 is divided by 16. 2 Calculate the remainder when 37977 is divided by 20. 17 Calculate the remainder when 15439 is divided by 644. 627 Calculate the remainder when 5183 is divided by 12. 11 Calculate the remainder when 1357 is divided by 92. 69 What is the remainder when 103847 is divided by 335? 332 Calculate the remainder when 4696 is divided by 859. 401 Calculate the remainder when 565 is divided by 130. 45 What is the remainder when 47903 is divided by 460? 63 What is the remainder when 555 is divided by 464? 91 What is the remainder when 7897 is divided by 1578? 7 What is the remainder when 3655702 is divided by 13? 11 Calculate the remainder when 2218672 is divided by 29. 27 Calculate the remainder when 70089 is divided by 133. 131 Calculate the remainder when 818 is divided by 535. 283 What is the remainder when 134989 is divided by 216? 205 What is the remainder when 665 is divided by 74? 73 What is the remainder when 4823 is divided by 26? 13 What is the remainder when 338 is divided by 19? 15 Calculate the remainde	{ "pile_set_name": "DM Mathematics" }
= 3u2 + 8u - 7. Determine qt(f) - 6s(f). -3f2 + 2f - 1 Let m(g) = 6 - 6 + 6g + 15g*3 + 6. Let n(i) = -121688i*3 + 4 + 1 + 5i + 121702i3. What is -5m(p) + 6n(p)? 9p*3 Let k(l) = -11l - 3. Let t(o) = -5o - 1. Let j = -9248 + 9250. What is jk(n) - 5t(n)? 3n - 1 Let g(l) = -9l3 - 470l*2 + 2l. Let c(q) = -q3 - q2. Calculate 10c(r) - g(r). -r3 + 460r*2 - 2r Let h(u) = 751 - 750 - 12u2 + 13u2 + u + u3. Let n(x) = 3x3 + x2 - 6. What is -h(i) + n(i)? 2i*3 - i - 7 Suppose -288u - 6804 = -306u. Let v be (-54)/u + 58/14. Let c(s) = -15s*3 + 9s. Let d(j) = -7j3 + 4j. Give vc(o) - 9d(o). 3o3 Suppose -10a = -21 + 81. Suppose 2q - 3q + 4 = 0. Let f = q + a. Let c(y) = -4y3 + 3y*2 - 3y. Let n(u) = -3u3 + 2u*2 - 2u. Give fc(g) + 3n(g). -g3 Let v(x) = x + 1. Let a = -20 + 12. Let m(i) be the third derivative of i4/2 + 4i3/3 - 3i*2 + 4i + 217. What is av(r) + m(r)? 4r Let q(v) = -v*3 - 5v*2 + 8v + 7. Let o(j) = -2j3 - 10j*2 + 18j + 15. Give 4o(c) - 9q(c). c*3 + 5c*2 - 3 Let t(q) = -2530q*2 - 38q + 14. Let m(j) = -1686j2 - 24j + 9. Give 8m(w) - 5t(w). -838w2 - 2w + 2 Let m(p) = 268p2 - 11p + 19. Let l(b) = 266b2 - 12b + 13. What is 3l(o) - 2m(o)? 262o2 - 14o + 1 Let w(k) = 2k + 19. Let p = -1858 - -1871. Let a(c) = -c - 9. Calculate pa(f) + 6w(f). -f - 3 Let r(q) = -6q*2 - 12q - 5. Let x(m) = 9m2 + 21m + 6. Let o(j) = 8r(j) + 5x(j). Let l(y) = -y*2 + 5y - 5. What is 7l(b) - 4o(b)? 5b2 - b + 5 Let v(c) = -46c + 2. Let f(a) = 23a - 1. Let i(b) = -105b + 197. Let l be i(2). What is lf(x) - 6v(x)? -23x + 1 Let h(y) be the second derivative of 11y4/6 + y2 - 110y + 19. Let l(x) = -33x*2 - 3. Determine -8h(w) - 5l(w). -11w*2 - 1 Let v(y) = 317y*2 + 14y + 43. Let u(c) = 634c2 + 33c + 97. Determine -4u(o) + 9v(o). 317o2 - 6o - 1 Let h(f) = 4f2 + 5f + 181. Let y(p) = -p*2 - 3p - 95. Calculate -3h(j) - 5y(j). -7j2 - 68 Let k(h) = -207h - 81. Let a(b) = -105b - 51. Calculate -11a(s) + 6k(s). -87s + 75 Let d(a) = -139a - 3. Let p(u) = u. Calculate d(m) + 3p(m). -136m - 3 Let n(r) = 2224r. Let g(j) = -2j2 - 2j. Calculate -1112g(l) - n(l). 2224l*2 Let v(q) = -79q + 5. Let o(h) = 2203h - 163. Let r(g) = 2235g - 159. Let z(k) = -3o(k) + 4r(k). What is 147v(a) + 5z(a)? 42a Suppose 4d = 598k - 602k - 12, k - 45 = 5d. Let s(b) = -2b*3 + 7b*2 + 5b + 7. Let p(a) = a*2 + a + 1. Calculate kp(h) - s(h). 2h3 - 2h*2 - 2 Let x(u) = 388u + 9. Let c(z) = 57z - 1. Calculate 2c(f) + x(f). 502f + 7 Let r be 7(-2 + 0 - -3). Let t(q) be the first derivative of 3q4/2 - 2q*3 - 3q*2/2 - 194. Let v(d) = -5d*3 + 5d*2 + 2d. Give rv(p) + 6t(p). p3 - p2 - 4p Let u(w) = 14w. Let d(f) = -69f - 492. What is -d(x) - 5u(x)? -x + 492 Let t = -221 + 221. Suppose t = -16a - 4a - 120. Let r(q) = -2 + 2q2 + q3 + 2. Let k(h) = h3 + h2. What is ak(i) + 3r(i)? -3i*3 Let o(y) = -13y*2 + 17y - 4. Let m be (-6 + 0 + 5)(-3 + -6). Let r(x) = 3x*2 - 4x + 1. Calculate mr(b) + 2o(b). b*2 - 2b + 1 Let s(l) = -36l - 2. Suppose -3a + 3 = 0, 2o + 1414a - 13 = 1411a. Let p(m) = 37m + 2. Calculate op(u) + 4s(u). 41u + 2 Let r(p) = 16304p + 30. Let q(t) = 33194950t + 61095. What is 2q(z) - 4073r(z)? -16292z Let a(t) = -4t + 3. Let u(r) = 5r - 2. Let s(h) = -h*3 + 81h*2 - 154h - 314. Let b be s(79). Calculate ba(k) + 3u(k). 7k Let i(s) = -4s. Let x(a) = 6a - 4. Let t be -7 - (3 + -1 - 4). Let h be 6 + 10/(-2) + 0. Let u(k) = k - 1. Let o(c) = hx(c) + tu(c). Give -i(r) - 3o(r). r - 3 Let o(i) = 5i2 - 5i. Suppose 468 = -7g + g. Let p = -83 - g. Let f(s) = s3 + 6s*2 - 6s. What is pf(v) + 6o(v)? -5v3 Let r(n) be the first derivative of n4/2 - 2n*3 + 4n*2 - 5n + 778. Let f(q) = -4q3 + 11q*2 - 15q + 9. Give -6f(y) - 11r(y). 2y3 + 2y + 1 Let t = 1 - 6. Let l be (-1)/19 + (-525)/133. Let i(c) = -2c2 + 4c + 2. Let j(h) = 3h2 - 5h - 3. Calculate lj(v) + ti(v). -2v2 + 2 Let l(c) = -21c*2 + 5c - 1. Let w(p) be the first derivative of 0p + 4/3p*3 - 1/2p*2 + 33. Suppose 15g - 16g = 11. Calculate gw(m) - 2l(m). -2m2 + m + 2 Let w = -8365 - -8370. Let g(p) = -p3 - 2p2 - 6p + 5. Let y(n) = -n*3 - 2n*2 - 7n + 6. Give wy(j) - 6g(j). j*3 + 2j*2 + j Let s(z) = -53 + 666z*2 - 122 - 30 + 188z*2 + 23. Let l(q) = 14q*2 - 3. Give 364l(i) - 6s(i). -28i*2 Let j(b) = -30b - 1984. Let i(d) = -17d - 993. What is 7i(s) - 4j(s)? s + 985 Let v(j) = 915j - 9. Let y(x) = -900x + 11. Determine -5v(t) - 4y(t). -975t + 1 Let p(u) = 1481u3 + 4u*2 - 2u. Let m(d) = -14275358d3 - 38558d*2 + 19279d. Calculate -2m(f) - 19279p(f). -1483f3 Let r(o) = -4o*3 + 8o2 + 8. Let w(n) = -n3 + n*2 + 1. Let d = 1363 + -1403. Calculate dw(a) + 5r(a). 20a*3 Let c(k) = -k - 1. Let p(v) = 797 - 13v - 817 + 3v. Give -12c(h) + p(h). 2h - 8 Let g(b) = b3 - b2 + 1. Let o(q) be the third derivative of -13q6/120 - q5/15 + 2q3/3 - 2q*2 + 517q. Give -4g(h) + o(h). -17h*3 Let b(j) = -4j*2 + 3j - 6. Let p(a) = 5a2 - 2a + 5. Let l(k) = -12k2 - 49k - 42. Let i be l(-3). What is ip(n) - 2b(n)? -7n2 - 3 Let d(l) = -2l*3 + 4l*2 - 4l + 9. Let t(x) = x + 8x - 11 - 9x*2 - 10x*2 - 8 + 3x*3 + 10x*2. Calculate 9d(u) + 4t(u). -6u*3 + 5 Let i(t) = -3358516t*3 + 4484t*2 - 2242. Let k(m) = -4496m*3 + 6m*2 - 3. Give -3i(x) + 2242k(x). -4484x3 Let q(i) = -i - 11. Let k(n) = -n2 + 10. Let c(m) = 6k(m) + 5q(m). Let l(z) = 5z2 + 4z - 4. Let s be 43/(1118/(-78)) + -5 + 3. What is sl(j) - 4c(j)? -j*2 Let v(k) = 8k*2 + 2k - 1. Let x(f) = -14f2 - 63f + 2. Let b(n) = -55n2 - 281n + 8. Let o(g) = 2b(g) - 9x(g). What is 2o(h) - 5v(h)? -8h2 + 1 Let y(p) = 26p3 - p2 + 12p + 4. Let c(j) = 51j*3 - 2j*2 + 22j + 7. Determine 6c(h) - 11y(h). 20h3 - h2 - 2 Let g(y) = 5 + 4 + 2 - 9y - 7 + 4 + 7y2. Let u(x) = -3x*2 + 4x - 4. Give -2g(b) - 5u(b). b*2 - 2b + 4 Let f(h) = 31h + 2813. Let v(g) = -43g - 4212. Give 7f(o) + 5v(o). 2o - 1369 Let i(h) = -8h*2 + 10h + 24. Let j(b) = -2b2 + 1. Let a(w) = i(w) - 3j(w). Let f be a(-2). Let k(x) = 3x + 2. Let c(y) = y + 1. Give fc(u) + 3k(u). 2u - 1 Let n(q) = 26q3 + 12q*2 + 7q - 75. Let i(c) = -25c3 - 12c*2 - 5c + 56. Calculate -4i(o) - 3n(o). 22o3 + 12o*2 - o + 1 Let g(v) = 4743v*3 + 9v*2 - 6v + 4. Let b(i) = -4745i3 - 6i*2 + 4i - 3. Give 3b(w) + 2g(w). -4749w3 - 1 Let o(g) = -87g*2. Let f(c) = 25c*2 + 2. Let m(l) = 107l*2 + 12. Let u(r) = 6f(r) - m(r). Give -3o(j) - 5u(j). 46j2 Let o(v) = 427v + 9. Let m(a) = -416a - 9. What is 6m(n) + 7o(n)? 493n + 9 Let l(j) be the second derivative of -5j3/6 + j2/2 + 7j + 5. Let a be 1(40/10 + (4 - 6)). Let h(i) = -10i + 3. Give ah(y) - 5l(y). 5y + 1 Let v(q) = 15q*2 + 904q - 11. Let p(m) = -5m2 - 308m + 4. Calculate -11p(t) - 4v(t). -5t2 - 228t Suppose 0 = m + 3q + 1 - 15, -q = m - 8. Let c(j) = 5 - 249j - 177j + 428j. Let n(r) = 9r + 24. Determine mn(f) - 24c(f). -3f Let u(y) = -y*2 - 24y - 351. Let d(x) = 3x2 + 55x + 704. Determine -4d(h) - 9u(h). -3h2 - 4h + 343 Let q(n) = -9n - 7. Let c(p) = 38p + 22. Let b(w) = -40w - 22. Let g(y) = 5b(y) + 6c(y). Determine -5g(z) - 16q(z). 4z + 2 Let u(d) = d*3 + 13d*2 - 69. Let y(s) = -3s*3 - 34s*2 + 138. What is 5u(h) + 2y(h)? -h3 - 3h*2 - 69 Let i(s) = s - 19. Let q(t) = -3t + 39. Let n = -13179 - -13181. Give nq(p) + 5i(p). -p - 17 Let f(z) = 16z - 29. Let h(v) = -19v + 35. Let b(a) = 6f(a) + 5h(a). Let o(r) = -r + 3. What is 4b(j) + 2o(j)? 2j + 10 Let q(p) = 6547p*3 + 40p*2 + 20p. Let v(s) = 4365s3 + 28s*2 + 14s. Calculate -7q(w) + 10v(w). -2179w3 Let l(c) = 5c*3 + 4c*2 - 4c + 4. Let z(q) = 6q3 + 5q*2 - 3q - 4q + 5 + 2q. Let t = -29 - -145. Let b = t + -111. What is bl(g) - 4z(g)? g*3 Let m(u) = 5u. Let f = 2 - 3. Let q(i) be the first derivative of i*3/6 - 31i + 39. Let h(	{ "pile_set_name": "DM Mathematics" }
ositive. i*(16/3) Simplify (ww*(-6)w)*32(w(-5))48 assuming w is positive. w*(-368) Simplify ((rr(-11/5))/r)/r(1/7)r1/(r(r*(-7)r)/rr) assuming r is positive. r(128/35) Simplify (kk(2/9))(-2/49)(k/(k/((k(-2)k)/k)))12 assuming k is positive. k(-10606/441) Simplify (w(-2/27))(-7)/(w(-26)/w(-9)) assuming w is positive. w(473/27) Simplify (k(-6/25)k(-30))/(((k(1/27)k)/k)/k(-2/5)) assuming k is positive. k(-20707/675) Simplify (z/(z/(z(z(-1/2)z)/zz))z)*(-13/4)/(zz*(1/5)zzz)4 assuming z is positive. z(-997/40) Simplify (b/(b*(3/5)b))(-9/4)/(((b/(b/b(-5)))/b)/b)(-14/5) assuming b is positive. b(-73/4) Simplify (n/n(5/11))(7/2)n6nn/(nn(-14)/n) assuming n is positive. n(263/11) Simplify (w4)(-1)w(1/4)/ww/(w/(ww/w(-5/3))) assuming w is positive. w(-13/12) Simplify ((f/((f(-2/9)f)/f))*(1/2)f(2/11)/f(3/5))(-7/11) assuming f is positive. f(-1337/10890) Simplify ((b0)(-35)b5/(b(2/13)bb))(-39) assuming b is positive. b(-111) Simplify ((c(1/4))(10/7)/(cccc(2/3))(-1))(2/75) assuming c is positive. c(169/1575) Simplify (m/(m/(m*6m)))/(m*3/m)(m/(mm(2/5)m))(-12/7) assuming m is positive. m(37/5) Simplify f*0f/(f/(fff*(-2/9)/ff))(f(-3/2))(-14) assuming f is positive. f(205/9) Simplify ((h(3/4)/h(-3))(-37))(-15) assuming h is positive. h(8325/4) Simplify ((f9/f)/f(4/11)ff(-11)/ff4/f)2 assuming f is positive. f(-8/11) Simplify (d4d)(-9/4)/(d(-4))(16/7) assuming d is positive. d(-59/28) Simplify (j(-7))(4/17)/(j(-7)/(jj/j*(-9)jj)) assuming j is positive. j(312/17) Simplify ((k/(k(1/2)/k))(-2/55)k*(-6)k/((((k/k*8)/k)/k)/k)k)(-38) assuming k is positive. k(-12426/55) Simplify g(-2/83)/g22g(gg/((g15/g)/g))/ggg(-12)g assuming g is positive. g(-3571/83) Simplify (d(7/3)d)/((dd*(2/11))/d)d11/(d/((((d/(d/d(-11)))/d)/d)/d)) assuming d is positive. d(-28/33) Simplify s(-10)(s/s(-1/5))/ss11/((s/((s/s(-1/19)s)/s))/s) assuming s is positive. s(214/95) Simplify (h(-2/21)/(hh/(h/((h/((h*(-2)/h)/h)hhhh)/h)))(h(2/3))(-39))(-37) assuming h is positive. h(27269/21) Simplify (((o*(4/3)o)/(o/(oo(-3/7)o)))/(o(-3)/((o7/o)/o)))(12/11) assuming o is positive. o(916/77) Simplify s*(3/5)ss(-2/23)sss*(-14)s(4/9) assuming s is positive. s(-10394/1035) Simplify (i*(-19)i)*47i25/i22 assuming i is positive. i(-843) Simplify (x(1/5))*(1/6)(xx(3/8)/xxx)(-14) assuming x is positive. x(-1993/60) Simplify (d/(ddd(2/81))d(3/11))/((d/d0)/(d(-2/7)/d)) assuming d is positive. d(-18946/6237) Simplify (g2)(-12)/(g*(-13)gg(14/5)) assuming g is positive. g(-74/5) Simplify (g/(gg*(-1)/gg)g)(-1)/(g(-3/5))21 assuming g is positive. g(53/5) Simplify (x9)(-4/17)(x(1/9))(-1/15) assuming x is positive. x*(-4877/2295) Simplify (ff*(-2/7)f*(4/5)f*3ff(-4/7))15 assuming f is positive. f(519/7) Simplify ((n(-1))(-23)n*(-1/5)/nn(-5/4))(1/8) assuming n is positive. n(411/160) Simplify (q/(q/q(-3/8))q(1/6)q(5/3)/q(-2))5 assuming q is positive. q(415/24) Simplify (((g/g(6/5))/g)/(g(1/12)/gg))/((g/g(-13))/(g(-3/7)g)) assuming g is positive. g(-6179/420) Simplify ((b/b17)(-2/7))(5/11) assuming b is positive. b(160/77) Simplify (d(-3)d)43/(d7/(dd(4/3)/d)) assuming d is positive. d(-275/3) Simplify (c*(-4/17)c(1/15))/(c(-2/13))(-18) assuming c is positive. c(-9739/3315) Simplify (a15/a(-2/17))/(a/(aa(-2/33))a/(a*(-1)/aa)) assuming a is positive. a(7325/561) Simplify (v/(v/v(-1/4))(v/((v/(vv*(-1/5)))/v))/v(v/(((v/v*1v)/v)/vv))(-11/3))(14/9) assuming v is positive. v(-1309/270) Simplify ((w/(w(2/7)/ww))(7/6)/(w/(w/w(-5))ww(-3/5)))(-2/117) assuming w is positive. w(-163/1755) Simplify (p(-6/17)pppppp*(-23)p)(-2/23) assuming p is positive. p(590/391) Simplify ((ff/f(-2/3)f(f/f3)/f)(9/5))(-28) assuming f is positive. f(-168/5) Simplify (((tt(-4))/t(-11))(3/8))28 assuming t is positive. t84 Simplify (x(1/7)/x)/((xx(1/14))/x)(xx/(x17x))/x8 assuming x is positive. x(-349/14) Simplify (m(-14))30(mm*37)/(m/(m/(m(mm23)/mm))) assuming m is positive. m(-407) Simplify (((n/n(-3))/n)/(nn13n))/(n*(-6)n(-1)) assuming n is positive. n(-5) Simplify (ss(2/5))/(s/(s/((s/(s(s*(4/3)/s)/s))/s)))(s*(-1)s)(-3) assuming s is positive. s(26/15) Simplify (n((nn/n*(1/5)n)/n)/n)*40n*3/nn13 assuming n is positive. n87 Simplify (y*(-17)/(((yy/y*15yy)/y)/y))/(y(-1/3))(-16/5) assuming y is positive. y(-76/15) Simplify (((b/(b/b(3/7)))/b)/b2(b*1/bb)(-34/7))(-6) assuming b is positive. b(312/7) Simplify f(2/7)f(7/6)(((ff(1/2)ff)/f)/f)(-32) assuming f is positive. f(-1955/42) Simplify (j/j(1/26))(2/109)(jj5)(-47) assuming j is positive. j(-399569/1417) Simplify ((r/r(1/12)rrrr3)(-24/11))23 assuming r is positive. r(-3818/11) Simplify (l6)13/((ll/(ll22)l)/ll20/l) assuming l is positive. l80 Simplify ((i19/ii)/ii)/(ii*(-15))(i(-2/13))(-8/5) assuming i is positive. i(2161/65) Simplify (a(2/13))(-10)/(a10a(-4)) assuming a is positive. a(-98/13) Simplify (((l(-6)l)/((ll/l(4/5))/l))7)(-20/11) assuming l is positive. l(728/11) Simplify ((i(-1/4))(-14)/(i(-1/2)/(ii7/i)))(-15) assuming i is positive. i*(-165) Simplify ((ii8/i)(-43))(6/5) assuming i is positive. i(-2064/5) Simplify (m*(-3/7)/mm*1(((m*7m)/m)/mm)/mm(1/3))(-29) assuming m is positive. m*(-3596/21) Simplify (((n/(nn*2)n)/n)*(3/5)n*(2/33)/nn((n/(n9n))/n)/n)3 assuming n is positive. n(-2003/55) Simplify tt/(((t(26/3)t)/t)/t)t(-18)(t/(t/(t*(-2/13)t)))/((tt34/tt)/t) assuming t is positive. t*(-2216/39) Simplify (q/((q(q/(q/(qq(-4/7)q)))/qq)/qq))*(2/11)/((qq*(-3/13))/(qq/(q/q1))) assuming q is positive. q(972/1001) Simplify (((((z/(z*(-3)z))/z)/z)/z)/zzzzz13)(1/7) assuming z is positive. z*(15/7) Simplify ((p/(p/(pp*(-2/5)p)))/(p(pp*(1/17)p)/p))/(p*(5/6)p*(-18)p) assuming p is positive. p(8011/510) Simplify (((u/(u/(u/(u/u(4/5)))))/u*(-2/9))/(uu/u*(1/5)uuu(u/(u(-1/4)/u))/u))47 assuming u is positive. u(-8507/36) Simplify ((b5/(b/(bbbb/b1)))/(b(-3/8)/b(3/2)))25 assuming b is positive. b(1775/8) Simplify (v3)*(5/8)v*(-7)/(vv(-5/2)) assuming v is positive. v(-29/8) Simplify (s*0s(-8))/(s0)12 assuming s is positive. s(-8) Simplify c*8cc4c*(-13)c*(6/7)c assuming c is positive. c(13/7) Simplify (f(1/6)/f*8)/(ff*(-8)(ff(11/2)/ff)/f) assuming f is positive. f(-19/3) Simplify (((q/((q/((q/(q(-16)qqq)q)/qq))/q))/(q/q19))(-10/3))(3/10) assuming q is positive. q(-34) Simplify (m/((m/(mm/(m/((m*(-16)m)/m))m))/m))/(mm*16)m*(-3/11)m*4/mm assuming m is positive. m(-289/11) Simplify ((((g/g(-38)g)/g)/g)/(gg10))/((g(-14)/g)/g(4/25)) assuming g is positive. g(1054/25) Simplify (w*(-2/3)/ww)*(6/19)/(((w/((w(w(ww*(-18))/w)/w)/ww))/w)/w1) assuming w is positive. w(-308/19) Simplify (x*14xx9)/(x(4/9)x(-2/35)) assuming x is positive. x(7438/315) Simplify (y/(yy/y1)y)/(y*11/y)y*(-8)y(-1/4) assuming y is positive. y(-69/4) Simplify (nnn*5)/nn/(n*8n)n(n/(n/(n(n(-8)/nn)/n)))/(n*(4/5)nnn) assuming n is positive. n(-64/5) Simplify i/(i/i(-5/2))i/(i/i(-4/5))(i*(-3)i)(2/57) assuming i is positive. i(-1921/570) Simplify ((w*(-2/5)/ww)*(2/33)(ww(-5)/w)/(w/w(-5/6)))(-1/8) assuming w is positive. w(2263/2640) Simplify ((j/j(2/19))/j(-14))/(jjj17jjjjj(4/3)) assuming j is positive. j(-538/57) Simplify (ww(2/53))(-48)((w/(w(w(ww(-29)w)/w)/w))/w)/w(-6) assuming w is positive. w(-891/53) Simplify (q*(-2/13)q)/(q*(1/13)/q)(q/((q*2/q)/qq))(2/83) assuming q is positive. q(23/13) Simplify ((xx(2/9))	{ "pile_set_name": "DM Mathematics" }
z. 2 Solve 3a + 9a = 7a for a. 0 Solve 14f - 33 + 5 = 0 for f. 2 Solve 0 = 13b + 33 + 45 for b. -6 Solve -15x = -27x - 72 for x. -6 Solve -20l = -21l + 1 for l. 1 Solve 0 - 5 = -b for b. 5 Solve -4b + 10 = -2b for b. 5 Solve -8 = 9p + 10 for p. -2 Solve 657c - 55 = 646c for c. 5 Solve -10b + 15 = -5b for b. 3 Solve 94w - 78w = -32 for w. -2 Solve 16 = 62g - 70g for g. -2 Solve 0 = -45g + 53g + 16 for g. -2 Solve 10d + 19 + 11 = 0 for d. -3 Solve 90p = 91p + 9 for p. -9 Solve -51 = -19p + 63 for p. 6 Solve -50n + 35 = -15n for n. 1 Solve -664t + 48 = -670t for t. -8 Solve -34v - 53v + 174 = 0 for v. 2 Solve -41f + 43f - 10 = 0 for f. 5 Solve 18 = 31u - 34u for u. -6 Solve 5f = -7f + 60 for f. 5 Solve -2 = -6w + 4 for w. 1 Solve -65 = -12f - f for f. 5 Solve 7z + 4 = -31 for z. -5 Solve x + 15x = 32 for x. 2 Solve 10t - 124 = -84 for t. 4 Solve -6s - 20 = -14 for s. -1 Solve 21 = 11a - 34 for a. 5 Solve 0n = 18n - 54 for n. 3 Solve -6b + 33 - 9 = 0 for b. 4 Solve 3x + 72 = -15x for x. -4 Solve 0 = -4f + 19 - 7 for f. 3 Solve 0 = -y - 27y - 112 for y. -4 Solve 31 = -97g + 225 for g. 2 Solve 7u - 104 = -111 for u. -1 Solve -48 + 16 = -4a for a. 8 Solve -22u = 3u - 200 for u. 8 Solve -50 = 84l + 34 for l. -1 Solve -14r + 1 = -13r for r. 1 Solve 4k - 102 = -114 for k. -3 Solve -19q + 11 = -8 for q. 1 Solve 0 = -8t - 10t - 18 for t. -1 Solve 6x = -0x - 6 for x. -1 Solve 9m - 9 - 27 = 0 for m. 4 Solve -101j = -93j - 8 for j. 1 Solve 23 = 3w + 32 for w. -3 Solve 47w + 393 - 64 = 0 for w. -7 Solve -10 = -661d + 666d for d. -2 Solve 15w - 8 = 19w for w. -2 Solve 11l + 82 = 60 for l. -2 Solve 0 = 173x - 192x for x. 0 Solve -9q + 106 = 142 for q. -4 Solve 0a - 2a = -8a for a. 0 Solve 101o - 71 - 30 = 0 for o. 1 Solve 11z - 67z = -560 for z. 10 Solve 62v - 18v = -308 for v. -7 Solve -70o - 1 = -71o for o. 1 Solve -1 = 7q - 8q for q. 1 Solve 2n + 3n = 25 for n. 5 Solve -40n + 41n + 3 = 0 for n. -3 Solve -123o = -112o - 22 for o. 2 Solve -32z - 5z = 37 for z. -1 Solve 14k = 8k for k. 0 Solve -423t + 428t = 15 for t. 3 Solve 0 = 2d + 73 - 57 for d. -8 Solve -120 = -52y + 28y for y. 5 Solve 46 = -2l + 34 for l. -6 Solve 15s + 1 = 14s for s. -1 Solve 10t - 12t = 4 for t. -2 Solve 54 = 7b + 61 for b. -1 Solve -10x - 9x = 19 for x. -1 Solve 0 = 32z - 40z for z. 0 Solve 66 = -4n + 78 for n. 3 Solve 0 = -4z + 16 for z. 4 Solve 0 = -3h + 9 + 6 for h. 5 Solve 18g - 2g + 80 = 0 for g. -5 Solve -777z + 40 = -769z for z. 5 Solve -28b + 98 = 14 for b. 3 Solve -15q = 1004 - 974 for q. -2 Solve -303 = 61r - 59 for r. -4 Solve -2 = 4q - 14 for q. 3 Solve -12u - 7 = 17 for u. -2 Solve -9 = -10l + 7l for l. 3 Solve -29j + 16 = -37j for j. -2 Solve -21 = 545o - 548o for o. 7 Solve -367h = -405h - 266 for h. -7 Solve 20v = 17 + 83 for v. 5 Solve 12 = 3s + 15 for s. -1 Solve -73 + 91 = -9r for r. -2 Solve 0 = -13u + 101 - 140 for u. -3 Solve 11o - 8 = -74 for o. -6 Solve 3p + 6p + 18 = 0 for p. -2 Solve 8z + 43 - 3 = 0 for z. -5 Solve 0 = 43c + 99 - 56 for c. -1 Solve 78 = j + 38j for j. 2 Solve 71b - 68b = 18 for b. 6 Solve -19s = -166 + 90 for s. 4 Solve 7o - 342 = -50o for o. 6 Solve 40 = 7w - 9 for w. 7 Solve 19j = 1 + 56 for j. 3 Solve -17s + 23s = 0 for s. 0 Solve -12037a = -12043a + 60 for a. 10 Solve 5f + 0f = 3f for f. 0 Solve -2j = -12 + 12 for j. 0 Solve 0 = 3z + 12 + 6 for z. -6 Solve x = 1007 - 1009 for x. -2 Solve 0 = 24a - 4a - 140 for a. 7 Solve -203 = -8a - 147 for a. 7 Solve 76 - 13 = 9z for z. 7 Solve 195s - 201s = -30 for s. 5 Solve 42 = -5x + 52 for x. 2 Solve 2r = -0r for r. 0 Solve 140s = 144s for s. 0 Solve -16 = 40d - 44d for d. 4 Solve 203w - 200w - 9 = 0 for w. 3 Solve 13i + 613 = 509 for i. -8 Solve -2v + 6v - 8 = 0 for v. 2 Solve 289 = -5h + 314 for h. 5 Solve -45 + 13 = -8l for l. 4 Solve -8 = -2h - 2 for h. 3 Solve n + 20 = 16 for n. -4 Solve 30 = 4p - 14p for p. -3 Solve 12c - 70 = 62 for c. 11 Solve 0 = 11t - 7t - 20 for t. 5 Solve 9a - 21a = -36 for a. 3 Solve -4p + 4 = -12 for p. 4 Solve 1080 = -5v + 1110 for v. 6 Solve 11b - 33 = 22b for b. -3 Solve 0n + 2n = -3n for n. 0 Solve 3k + 4 = 16 for k. 4 Solve -25 = 24j + j for j. -1 Solve 19s = 21 + 169 for s. 10 Solve -6q = -10q + 16 for q. 4 Solve 62z - 20 = 66z for z. -5 Solve 0 = -5p + 168 - 138 for p. 6 Solve -3 = -81u + 84u for u. -1 Solve -13f + 94 = 68 for f. 2 Solve -5q + 4q = 9q for q. 0 Solve -13y = -9y + 12 for y. -3 Solve 68 = -42l + 59l for l. 4 Solve 4z = 45 - 1 for z. 11 Solve 10m + 29m - 273 = 0 for m. 7 Solve -107 = -96q + 661 for q. 8 Solve -24v + 56v = 0 for v. 0 Solve 871 = -6j + 847 for j. -4 Solve 4m - 8 = 4 for m. 3 Solve -d + 9 - 5 = 0 for d. 4 Solve 0 = -111b + 112b - 6 for b. 6 Solve 0 = 91d - 100d - 45 for d. -5 Solve -28f + 103 = -121 for f. 8 Solve -49z - 440 + 97 = 0 for z. -7 Solve 17a - 14a = 3 for a. 1 Solve 3 = -1376u + 1377u for u. 3 Solve -15 = 4b + 1 for b. -4 Solve 49b = -40 - 9 for b. -1 Solve -28h = -22h - 42 for h. 7 Solve -8b + 13b + 20 = 0 for b. -4 Solve 21f = 21 - 84 for f. -3 Solve 15 - 15 = 44u for u. 0 Solve 0 = 11i - 52 + 8 for i. 4 Solve -6v = 8v - 14 for v. 1 Solve 140w - 130w - 20 = 0 for w. 2 Solve -13o + 9o = 20 for o. -5 Solve -31t = -29t - 16 for t. 8 Solve 5p + 2 = 7 for p. 1 Solve 1707 = 11y + 1718 for y. -1 Solve 0 = 88o - 102o - 14 for o. -1 Solve 477 = 55y - 2y for y. 9 Solve -5f - 59 = -24 for f. -7 Solve 8u - 4581 = -4637 for u. -7 Solve 0 = 31o - 37o for o. 0 Solve -274 + 224 = -5p for p. 10 Solve -4w - 5w = 27 for w. -3 Solve -130x + 5 = -125x for x. 1 Solve -10w + 1 = -11w for w. -1 Solve -2i + 3 = 7 for i. -2 Solve -6072d = -6057d for d. 0 Solve p = 3p + 4 for p. -2 Solve -42 = 2f - 38 for f. -2 Solve 103h - 48h + 605 = 0 for h. -11 Solve 26 = -5h + 6 for h. -4 Solve 6r - 3r = -15 for r. -5 Solve 1011g + 45 = 1002g for g. -5 Solve -4l + 11 = -1 for l. 3 Solve -2q - 86 = -102 for q. 8 Solve -16 - 2 = -6l for l. 3 Solve 10n - 58 = -28 for n. 3 Solve -15b = 35b - 250 for b. 5 Solve 0 = q - 4 + 6 for q. -2 Solve 58h - 31h + 162 = 0 for h. -6 Solve 2j + 1 = 5 for j. 2 Solve 0 = c - 14 + 13 for c. 1 Solve 0 = 133b - 130b - 3 for b. 1 Solve 15j = 1890 - 1800 for j. 6 Solve 104 = 30b + 22b for b. 2 Solve 0 = -34o + 103o + 207 for o. -3 Solve 15 - 3 = 4k for k. 3 Solve 336b - 340b - 40 = 0 for b. -10 Solve 23b - 56 = 36 for b. 4 Solve 2f + 2f + 8 = 0 for f. -2 Solve 261f = 256f - 15 for f. -3 Solve 0s = -15s - 45 for s. -3 Solve 60b - 57b = 0 for b. 0 Solve 81v - 283 - 122 = 0 for v. 5 Solve 108q + 35 = 113q for q. 7 Solve 86 - 53 = -3n for n. -11 Solve 127k = 120k - 7 for k. -1 Solve 196 = 44r - 244 for r. 10 Solve 69t + 66 = 58t for t. -6 Solve 15n - 64 = -17n for n. 2 Solve 0 = 3p - 8 + 20 for p. -4 Solve -710s + 692s = -108 for s. 6 Solve 139x - 131x = -40 for x. -5 Solve 114q - 112q - 2 = 0 for q. 1 Solve 221c - 228c = -28 for c. 4 Solve 150 - 155 = 5g for g. -1 Solve 0 = 14o - 8 - 20 for o. 2 Solve -73l + 75l = -4 for l. -2 Solve 16y = 44 - 12 for y. 2 Solve 145l = 151l - 18 for l. 3 Solve 6m - 50 = -14 for m. 6 Solve -347 - 129 = 68i for i. -7 Solve 59 = -28c + 171 for c. 4 Solve w = -45 + 42 for w. -3 Solve 118 = -17o + 237 for o. 7 Solve -6p - 12 = -0 for p. -2 Solve 36 = 86m - 74m for m. 3 Solve 20g = 6g + 70 for g. 5 Solve -25 = 43w - 48w for w. 5 Solve -37t + 4 = -33t for t. 1 Solve -27s - 35 = -22s for s. -7 Solve -3s = 17 - 5 for s. -4 Solve -7643o = -7633o + 10 for o. -1 Solve 10d + 24 = 14 for d. -1 Solve 20 - 55 = -7c for c. 5 Solve 0 = -51i + 55i + 12 for i. -3 Solve 15b + 2 = -13 for b. -1 Solve -10h + 5h - 25 = 0 for h. -5 Solve 597t - 594t = 15 for t. 5 Solve k = 3k - 6 for k. 3 Solve 125 = 24x - 49x for x. -5 Solve -2y = -7y for y. 0 Solve 4j + 69 = 81 for j. 3 Solve 12 + 4 = 4u for u. 4 Solve 27v - 42 = -177 for v. -5 Solve 7r = 40 + 9 for r. 7 Solve 8h = -10h + 108 for h. 6 Solve -227c = -223c + 12 for c. -3 Solve 39q = 24q - 45 for q. -3 Solve	{ "pile_set_name": "DM Mathematics" }
7. Solve -5b - 2 = 2g - rb, -2g = -5b + 2 for g. -1 Let t = 14 - 7. Let p = t - 4. Solve 0 = -3j - j - 4, 3z - 3j = p for z. 0 Let r(d) = -d + 2. Let b be r(-3). Solve -2n - 1 = bw, n + 3w + w = 1 for n. -3 Let q(d) = d2 + 8d + 2. Let w be (-4)/(-10) + (-168)/20. Let g be q(w). Solve 2c = -4b + 30, -b + 3c - gc = 0 for b. 5 Suppose 0 = -k + 6k - 55. Let c = -2 + -4. Let h be (9/(-6))/(c/8). Solve -3d - h = -k, -d + 3 = -3l for l. 0 Suppose 5q + 0q = 15. Suppose -22 = -3a - 4x, -9 = -3a + x + 8. Suppose -2o + a = 2. Solve ow = -w + 12, 5p = -qw - 3 for p. -3 Let j be (-192)/(-20) + 2/5. Solve l - 3l = -3x + 7, -j = -4x + 2l for x. 3 Let z = -10 + 23. Suppose 13 = 3v - 4m + 2, -3m + z = 2v. Solve vg = -2a - 18, -4g = -g + 6 for a. -4 Suppose -2p + 3z = -4, 4p + 0z - 16 = 2z. Let q = p + -5. Let w(d) = d*2 + 5. Let g be w(q). Solve 0 = -6k + 2k + 4y - 8, -3k - gy = 14 for k. -3 Let j = -2 + 4. Solve 4u - 1 = -5y, y + u - ju - 2 = 0 for y. 1 Suppose u = -3y + 28, 6y - 16 = 4y + 2u. Solve -35 = 5j + 4t, -4t = -yt - 25 for j. -3 Let x be 1/(-2) - (-225)/6. Let v = x - 24. Solve 8 = -4t + 2p - 5p, 3t + 4p + v = 0 for t. 1 Let o(z) = -z*3 - 21z*2 - 19z + 23. Let n be o(-20). Solve 4u - 8 = -f, -2u + 2f = nu + 3 for u. 1 Let l = 9 - 19. Let m = -7 - l. Suppose 0g + 2 = -3g - 2v, 1 = mg - v. Solve 4k - 2c + 28 = g, 3c = -k + 2k + 17 for k. -5 Let c(n) = -n3 + n2 + n + 3. Let a be c(0). Let q be 1 - (-3)/(3/19). Solve -3j - 3 = 4g + 1, -aj + q = -2g for j. 4 Let a be -1 + 11 - 0/(-2). Suppose 5v = 15 + a. Solve -7u = -4u + 12, vb - u = -1 for b. -1 Suppose -4d = -4d + 4d. Solve -5r - 5u - 14 - 11 = d, -2 = 2r - 2u for r. -3 Let x = 1 + 2. Solve -11 = -xa + 2w, -13 = -a + 2w - 4 for a. 1 Let v(l) = l*2 + 5l - 5. Let a be v(-8). Suppose 0s + 4 = 2s. Suppose -4m - 12 = -36. Solve sb - mb - 40 = -5p, 3b + a = p for p. 4 Let h(u) = -u2 + 5u + 6. Let v be h(6). Suppose v = 5r - 22 - 3. Solve rj + d = -2d - 14, d = -3j - 6 for j. -1 Suppose -5y = 2u + 25, 2y + 6u + 31 = u. Let f(k) = k*2 + 2k - 3. Let l be f(y). Solve -3i - 6b + b + 37 = l, -i = b - 9 for i. 4 Let t be 1/((6/(-10))/(-3)). Suppose -4u = -4g - 28, -tu - 6 = 4g + 4. Let s be 5((-21)/(-12))/(-7)-20. Solve 10 = 2q, s = -b + 4b + uq for b. 5 Let u = -39 - -135. Suppose -4z - u = -7z. Solve -q = -5l + 2l - 16, -4l + 4q - z = 0 for l. -4 Let m = -11 + 26. Suppose 0 = 2i + i - m. Solve w - 2a + 4 = -4a, iw = 5a - 5 for w. -2 Let a = -84 - -88. Let d be 2 + 0 - (1 - 1). Solve -b + 7 = ab + 3o, -b + do = -4 for b. 2 Let q(o) = o2 + 9o - 6. Let x be q(-10). Solve 2i = xi + 5k + 14, 3k + 6 = 0 for i. -2 Let i be 28/(-8) + (-2)/4. Let a be -2(-2 + i/(-4)). Solve -ar - 4n + n = 22, -4r + 2n = 12 for r. -5 Let t(w) = -2w + 13. Let p be t(5). Solve 4u = -pn + 10 - 33, 3u + 1 = n for u. -2 Let x = 3 - -1. Let h be 4/1 - (7 - 5). Suppose 7n = 4n - hi + 13, 0 = 5n + xi - 21. Solve -6w + 5b + 35 = -2w, 3w = nb + 30 for w. 5 Suppose -13 = -4j + 3. Suppose 0 = 2s - p + 3 - 17, 0 = -p - 4. Let q = s - 2. Solve 0 = -5a + jm - 3, -3a - m = -2 - q for a. 1 Let w be 4 - 12/4 - -27. Solve 4 - 3 = 2g + m, -g + 5m + w = 0 for g. 3 Let n be -4 - -4 - (-1 + -2). Suppose -ng = -5g. Solve g = 5s + h - 7, 3h = -4s + 5 + 5 for s. 1 Let l(i) = 2i - 6i + 3i + 2i - 4. Let j be l(8). Suppose -j = -k - 2. Solve ku - 3u = 4a + 7, 2a + 7 = 3u for u. 1 Suppose -4 = h - 4y, 4 = y - 1. Solve 3z - 3u - h = -u, -4u = 5z + 10 for z. 2 Let f(j) = 3j - 4. Let q be f(-3). Let i = 18 + q. Solve -4d = -il + 3l - 6, 3d = 3l for l. 3 Suppose j + 2 - 5 = 0. Solve 12 = jo, 3w - o + 4o - 9 = 0 for w. -1 Let i be 1/((7/4)/7). Solve id = -2c - 24, -4c - 21 = -c + 3d for c. -2 Suppose 2v + 4v = 450. Suppose -2k + v = 3k. Solve -4b + k = -3a, -5a - b = -3b + 11 for a. -1 Let p = 14 - -9. Solve 0 = 5k + y + 1 + 22, -5y = 2k + p for k. -4 Let h = -1 - -6. Let y = h - 3. Solve -l = 5i + 18, 3 = -2i - yi + 3l for i. -3 Let p = -3 - -1. Let y be 1 - (8/1)/(-2). Let k = p + y. Solve -2h = -kr + r + 20, -h - 5r = -20 for h. -5 Let h = -2 - -2. Suppose h = -6t + t. Solve ta - 3a = -4j - 1, -a + 3j + 2 = 0 for a. -1 Suppose 2l + 3l = 35. Let b be (-4)/(-14) - (-12)/l. Solve -w + 3 + 2 = -q, bq + 10 = 3w for q. -5 Let d be 32(-1)/(-2). Suppose -h + 4 = 2i, dh = h - 8. Let a be 2/1 + (2 - 0). Solve z - 6 = iz - 3u, -az - 2u + 10 = 0 for z. 1 Let y be (-1)/1(10 - 6). Let s be y/(-14) - 235/(-35). Solve 4n = b, n - s = -b - 2 for b. 4 Let i(s) = 5s*2 + 2s + 1. Let a be i(-1). Suppose -u - 2 = -a. Solve 0 = -5h - ur - 11, -5 = 2h - 3r + 7 for h. -3 Suppose 2 = i - 1. Suppose 0 = -il + 9. Solve 3d + 0 - 12 = -3k, lk - 17 = -4d for d. 5 Let l = -2 + 2. Let p = l + 2. Solve 3n = -pn - q - 2, 4 = -4n - 2q for n. 0 Let k(x) = -4x - 4 + 4x2 - 2 - 3x*2 + 1. Let n be k(5). Solve h - 13 = -nq - 2q, 5h - 15 = 0 for q. 5 Let h = 5 + 0. Suppose -ht - k + 3 = -4k, -2t - 2 = 2k. Solve 0 = -5x + 25, tn - 4n - 5x = -25 for n. 0 Let s = -2 + 5. Suppose 4r - 50 = 5a + r, 5r - 25 = 0. Let b = a - -12. Solve -sw = -5l - b, 2l + 10 = 5w - 11 for w. 5 Suppose 5 = -w - 2g, 15 = w - g - g. Solve 2r = r + 2z + w, -8 = 5r + z for r. -1 Let u = -22 + 25. Solve h + 3 = -r, -uh - 10 + 3 = 5r for h. -4 Let d = 1 + 4. Suppose 4s = 4f + 1 + 3, 0 = 5f + d. Suppose s = -5z - 2v + 10 + 22, 0 = -4z - v + 25. Solve a = za - 3r, -4r + 23 = a for a. 3 Let d be (-8 - -6) + (1 - -5). Suppose -4c + 36 = -ds, 0 = c + 5s - 7 + 22. Solve 5y - 4k = 19, cy = -0y + 5k + 20 for y. 3 Suppose 0 = -4x + h - 49, 0 = 3x - 3h + h + 43. Let q = -7 - x. Let k(w) = -4w - 19. Let l be k(-5). Solve -5p + l = -qf - 1, 0 = 2f - 4 for p. 2 Let p be ((3 - 3)/(-1 - -2))/2. Solve p = -5f - 2r - 14, -4 + 2 = r for f. -2 Let b(f) = f3 - f2 + 2f + 2. Let n be b(3). Let j = -13 + n. Suppose 3r + 5a - 7 = 0, 3r + a = j - 2. Solve 3i - 34 = -5d, -2i + rd - 15 = -1 for i. 3 Let m be 6/(6/(-3)-1). Solve 4w = mp - 10 + 29, 4w - 13 = -3p for w. 4 Let x = 0 + 2. Let p(g) = -4 + 10g - 2g2 + gx + 0g2. Let w be p(7). Solve 7 = -f + 2, 4o + w = -f for o. -3 Suppose 24l = 4l + 60. Solve 2n - 12 = lb, -13 = -7n + 2n - b for n. 3 Let o = -46 + 50. Solve 2n = 2k - ok, 4k + 3n = -1 for k. -1 Let j be 4/(-2) + 2 + 0. Suppose jn - 106 = -2n. Let q = n + -29. Solve -q = 4h - 2z - z, h + 4z = 13 for h. -3 Let s(r) = 0r - 5r - r*2 - 9 + 0r + 13. Let l be s(-4). Solve -l = 3d + x - 4, 3d = -3x + 6 for d. -3 Let i = 2 - 2. Suppose -v + 4v - 24 = i. Let m = 12 - v. Solve 0 = -h + 5q - 9, -2h - 4q - m = -0q for h. -4 Let i be (-1 - 5)(-2)/4. Suppose 2t = 1 + 3. Solve -il - 3a - 17 = l, -10 = tl + 2a for l. -2 Suppose -135 = -8c + 3c. Suppose -26 = -2s - 3d, c = -s + 2s + 5d. Solve 4o = -4b + 16, -5b + 16 + s = 2o for b. 5 Let v(p) = 2p. Let q be v(2). Solve -3t + o = -7, qt - 6o = -o + 2 for t. 3 Suppose 0 = -4s + 3s + 3. Let n(l) = -l - 1. Let g(t) = 2t + 7. Let j(f) = -g(f) - 4n(f). Let c be j(s). Solve -w = -q + 2, w = cq + 6 - 2 for w. -5 Let q(z) = -z2 - 6z + 9. Let o be q(-7). Let r be ((-12)/o)/3 - -6. Solve 2a = -a + g, 0 = -4a - rg for a. 0 Let t = 62 + -34. Solve -4s - t = 5i, -4i - 14 = -3s + i for s. -2 Let h(r) = r2 + 5r + 6. Let l be h(-5). Suppose -lf = -2f. Suppose f = -o + 2o - 1. Solve 0 = -3t, -5t - o = 3i + 14 for i. -5 Suppose 2d = 7d - 20. Solve s - ds = 2c + 10, 4c + 5s = -18 for c. -2 Let n be 51/3446/3. Solve 3j = -3t + 6, 3j - 5t + 1 - n = 0 for j. 4 Let n be (-7)/((16/(-4))/4). Suppose -6s - 27 = -ns. Solve 3o = 3q - s, -2q = 2q + 5o for q. 5 Suppose -3p + 10p - 28 = 0. Suppose -4d = 5o - 32, 5o + 2d - 26 = -0. Let b = 12 - o. Solve pt + 26 = 5r, 0t + t = 2r - b for t. -4 Let g = 17 + -13. Suppose -3k - 2k = 5f - 45, 0 = -2f - gk + 28. Solve -fc - 4b = 8, -3b + 17 = -c - 7b for c. 3 Let q = 10 + -13. Let a = q + 6. Solve c + 8 = -ac + 3v, c + 17 = -3v for c. -5 Suppose 5*z +	{ "pile_set_name": "DM Mathematics" }
-480820. -1/120205 Calculate 901849 divided by -5213. -173 Divide -70744630 by 47995. -1474 Calculate 73800243 divided by 9. 8200027 What is -56888216 divided by 2338? -24332 What is -912717 divided by 29? -31473 Calculate -2237940 divided by -36. 62165 -41864205 divided by 5 -8372841 What is -19907780 divided by 236? -84355 What is -1716173 divided by 6? -1716173/6 Calculate 144386584 divided by 1760812. 82 Calculate -5618076 divided by 5. -5618076/5 Divide 1 by 3295048. 1/3295048 -9296414 divided by 58 -160283 Calculate -514683 divided by -35. 514683/35 What is 8944805 divided by -19? -8944805/19 What is -565629396 divided by 4? -141407349 What is -3570275 divided by -251? 3570275/251 Calculate 27058772 divided by 4. 6764693 Calculate 530941418 divided by 34571. 15358 Divide 0 by -120181890. 0 Calculate -221543 divided by 688. -221543/688 What is -1638 divided by -745? 1638/745 Calculate -292 divided by -56835. 292/56835 -5 divided by -1115259 5/1115259 -405 divided by 147398 -405/147398 Divide -1246194 by -10. 623097/5 Calculate 13154416 divided by -5. -13154416/5 What is 2780998 divided by 3? 2780998/3 Calculate -882 divided by 3055. -882/3055 -4274300 divided by 25 -170972 What is 41794 divided by 930? 20897/465 What is -1553203 divided by 2? -1553203/2 Calculate 1052796354 divided by 59. 17844006 Divide 4 by 573762. 2/286881 0 divided by -23859749 0 Divide -5 by 2307488. -5/2307488 Divide -35623494 by 11874498. -3 Divide -2645699 by -7. 377957 Divide -2336851 by -1199. 1949 10865520 divided by 18 603640 Calculate -1275854 divided by -1275854. 1 Calculate -19004 divided by 2368. -4751/592 Divide -5937 by 190. -5937/190 -34019517 divided by -26557 1281 Divide -5476 by 23836. -1369/5959 Calculate -28 divided by -4848905. 28/4848905 Calculate -22883 divided by -2004. 22883/2004 Calculate 217694718 divided by 265158. 821 -223399811 divided by 1699 -131489 What is -294237352 divided by -4? 73559338 1338225 divided by 75 17843 Calculate 40991652 divided by -39. -1051068 What is 5 divided by -13308994? -5/13308994 -122644760 divided by -7 17520680 What is -4 divided by -4095904? 1/1023976 What is 661 divided by -13234? -661/13234 What is 28556556 divided by -6? -4759426 8995012 divided by -4497506 -2 Divide -3115752 by 3115752. -1 Calculate -18377456 divided by 12. -4594364/3 Divide 6534929 by 19. 6534929/19 Divide 5 by -8807119. -5/8807119 Calculate 0 divided by 26696036. 0 Divide -84445 by 196. -84445/196 Divide -38249820 by 63. -607140 136416986 divided by 58 2352017 Divide 6824206 by 3412103. 2 What is -831617 divided by 1? -831617 What is -24770952 divided by 688082? -36 111217498 divided by -2 -55608749 Calculate -89430663 divided by 80351. -1113 Divide -78878727 by -26292909. 3 Calculate -3 divided by 7894439. -3/7894439 Divide 2 by 1693839. 2/1693839 Calculate 69 divided by 469677. 23/156559 Divide -17 by -5562458. 17/5562458 Calculate -80270866 divided by -26. 3087341 -148136640 divided by -6960 21284 24317226 divided by -54 -450319 Divide 39326682 by -6554447. -6 Divide 7488 by -3197. -7488/3197 -409295154 divided by 204647577 -2 -1354333890 divided by -992186 1365 Calculate -21424200 divided by 280. -76515 What is -294261 divided by -9? 98087/3 What is 12647418 divided by 1806774? 7 Divide -8307848 by 6. -4153924/3 -1242073371 divided by 26427093 -47 Divide 37470325 by 9. 37470325/9 Calculate 1731762 divided by -36846. -47 -728201926 divided by -227 3207938 Calculate 334 divided by -158. -167/79 What is -31 divided by -4929429? 31/4929429 28225758 divided by 22 1282989 Calculate -68 divided by 30440. -17/7610 What is 47 divided by -60843? -47/60843 Calculate -297145652 divided by -1727591. 172 Calculate -67938003 divided by -63. 1078381 Divide 2907072 by -6. -484512 17 divided by 5315590 17/5315590 -6 divided by 10496653 -6/10496653 Divide 33058900 by -11620. -2845 Divide -183115980 by -18311598. 10 Calculate 4234032 divided by -529254. -8 Divide 38 by -620785. -38/620785 21667300 divided by -27850 -778 What is -4884852 divided by -1? 4884852 Calculate 16672792 divided by 4. 4168198 Calculate 525241890 divided by -42807. -12270 Divide -4768302 by -48. 794717/8 Calculate 222 divided by 5380. 111/2690 Calculate -71574893 divided by 1. -71574893 Divide 17596 by -598. -8798/299 Divide -1434 by 131. -1434/131 Divide 0 by 3362360. 0 What is -3766560 divided by -2280? 1652 499809872 divided by 21730864 23 Calculate 1 divided by -44921766. -1/44921766 Divide -71263599 by 43. -1657293 What is -21795641 divided by 1147139? -19 10021 divided by 76 10021/76 Divide 1750 by 166539. 1750/166539 Divide 47 by 57615. 47/57615 4 divided by -233387 -4/233387 -344 divided by 2156 -86/539 What is -1513308 divided by -46? 32898 Calculate 422 divided by 227851. 422/227851 Calculate 395491320 divided by -21. -18832920 Calculate -36141 divided by 12. -12047/4 -520587 divided by 9 -57843 15153152 divided by -4 -3788288 Divide 48635966 by 5582. 8713 Divide 178 by -662. -89/331 -1186048 divided by 18 -593024/9 Divide 5 by 1523653. 5/1523653 Divide 43192032 by 276872. 156 What is -22 divided by -75654? 11/37827 Calculate 11673198 divided by 3891066. 3 What is 0 divided by -128158? 0 Calculate 151070095 divided by 30214019. 5 Calculate -1904496 divided by 158708. -12 Divide 17662 by 626. 8831/313 Divide -681645789 by -16083. 42383 Divide -4914096 by 264. -18614 Calculate -8731592 divided by 2042. -4276 1 divided by -38157387 -1/38157387 Calculate -23764 divided by 2179. -23764/2179 What is 138449166 divided by 6? 23074861 10584 divided by -819 -168/13 -89 divided by 386506 -89/386506 Divide -88 by 200063. -88/200063 Calculate -55253819 divided by 3. -55253819/3 Calculate 1285280 divided by 80330. 16 What is -7476065 divided by 5? -1495213 What is 96105 divided by -225? -6407/15 Calculate 4 divided by 7193443. 4/7193443 Calculate -744555657 divided by -8558111. 87 Calculate -253220580 divided by -28135620. 9 21667 divided by 31412 21667/31412 What is 6730100 divided by 25885? 260 What is 20991001 divided by 1? 20991001 Calculate 14 divided by 350938. 1/25067 What is -241268405 divided by 48253681? -5 Calculate 28962102 divided by -6. -4827017 Calculate -17111600 divided by -5. 3422320 What is -9021 divided by 3508? -9021/3508 What is -3 divided by 21567492? -1/7189164 What is 14073339 divided by -3? -4691113 294555824 divided by 1 294555824 Calculate 104511 divided by -241. -104511/241 Calculate -5186 divided by -2189. 5186/2189 Divide -4735696 by 676528. -7 Calculate 2026202 divided by -8926. -227 What is 41547984 divided by -19? -2186736 What is -1658169 divided by 9? -184241 Calculate -11543748 divided by 3847916. -3 Calculate -84763355 divided by -5. 16952671 Calculate -159392 divided by 4472. -19924/559 Divide 8835060 by -78. -113270 -18 divided by -7288 9/3644 Divide 98508 by -768. -8209/64 -1366724 divided by -129 1366724/129 Divide -19 by 12116. -19/12116 23 divided by -34803044 -23/34803044 Divide -115636850 by -4. 57818425/2 Calculate 8103726 divided by -162. -50023 Calculate -401482250 divided by -42575. 9430 Divide -3752236 by 3. -3752236/3 What is 5 divided by 4295408? 5/4295408 Divide 778016 by 204. 194504/51 Calculate 19707695 divided by -35. -563077 What is 905098709 divided by -6? -905098709/6 What is -106312 divided by -399? 106312/399 -40293 divided by -76 40293/76 Calculate -2739494 divided by -1. 2739494 Calculate 3 divided by -10661835. -1/3553945 Divide -617 by 56197. -617/56197 What is -14473988 divided by -1? 14473988 What is 702840 divided by -234280? -3 Divide 542032 by -542032. -1 -10427900 divided by -417116 25 122809 divided by -25 -122809/25 Divide -1769 by -9011. 1769/9011 What is 0 divided by -192332778? 0 Divide 195262272 by -176868. -1104 123628458 divided by 6 20604743 -104788856 divided by 1 -104788856 -12182230 divided by -3305 3686 Calculate 38768 divided by -126. -19384/63 What is 31692 divided by -580? -7923/145 Calculate -6 divided by 269974. -3/134987 Divide 6176469 by 39. 158371 Divide 127748 by 152. 31937/38 11993155 divided by 15 2398631/3 Divide 812146 by -812146. -1 What is 941295 divided by -111? -313765/37 33 divided by 845337 11/281779 Calculate 1040574626 divided by 2. 520287313 Calculate 24586 divided by -134	{ "pile_set_name": "DM Mathematics" }
2 Express -3i + i - 14i - 5 + i - 10i as si + f and give f. -5 Rearrange 7f2 - 81 - 81 + 242 - 80 + 23f to the form tf2 + zf + p and give t. 7 Express -48b + 192b - 361b - 542b as qb + h and give q. -759 Rearrange (3q - 5q - 2q)(2 - 2 - 2)(18 - 149 + 51)(-2 + 7 - 1) to the form b + oq and give o. -2560 Rearrange 47 + 9c - 5c + 3c - 2c to f + xc and give x. 5 Rearrange 3u*3 + 2u*4 + 3877u*2 - 3877u*2 + 7 - 2u to z + su3 + tu + ku2 + qu*4 and give t. -2 Express 3z - 5z + 5z - 4 + 11 + z*3 - 4z - z*4 - 52z*2 as sz + b + yz2 + qz*3 + vz*4 and give s. -1 Rearrange (4d - d - 2d)(-218d - 292 + 114d + 102d) to s + od*2 + vd and give o. -2 Express -o*2 - 4o*2 + 4o2 - o2 + 0o2 + 3o*2 + (1 - 1 - 2o)(2o - 4 + 4) + 0 - 272o2 + 268o*2 + 3 in the form g + jo*2 + no and give n. 0 Rearrange 154 - 155u - 154 + (2u + u - 4u)(2 - 1 - 4) + 1 + 2u - 1 - 7u + u + 4u + (1 - 2 + 3)(-u + 5u - 5u) to mu + w and give m. -154 Express -19 - 12 + 19 - 10 + 2h in the form th + a and give t. 2 Express -66g + 586 - g*2 - 5g*2 + 66g + 4g2 in the form kg*2 + i + og and give k. -2 Rearrange -19z + 2z*4 - 22z - 2 - 18z - 3z*2 + 52z to the form oz + yz*2 + p + xz*4 + jz*3 and give x. 2 Rearrange -72o*2 - 12o - 70o2 + 181o*2 to the form n + ro + vo2 and give r. -12 Express 12 - 12 - 4k*3 - 80k*4 + 78k*4 - 8k in the form mk2 + hk*4 + ok*3 + yk + l and give o. -4 Express 2t + 1434 - 718 - 727 in the form ot + r and give o. 2 Express (s*2 - 164 - 414205s + 414202s + 0s*2)(6 - 5 - 3 + (-2 + 5 - 1)(1 + 1 + 0) + 1 - 3 + 1) in the form us*2 + r + ls and give u. 1 Rearrange -5y4 + 33y*4 - 141y*4 + (0y*2 - 3y*2 + 5y*2)(y - y - 3y2) to the form g + ny*4 + cy + by3 + ly*2 and give n. -119 Rearrange (c - 5c + 0c)(-1 + 44c3 - 27c*3 - 52c*3) to m + gc*2 + xc*3 + tc + nc4 and give t. 4 Rearrange (-2n - 11n + 40n)(-22n + 13 - 13 + n*2) to a + xn + sn3 + gn*2 and give a. 0 Express -2 - 20l - 38l + 12l - 2l3 as pl + gl2 + q + rl*3 and give q. -2 Rearrange (2 - 3 - 2)(2 + 4z - 2) + 3 - 3 + 2z + (-1 + 0 - 1)(2z - 6z + 2z) to hz + n and give h. -6 Rearrange 2b - 6 + 24b + 15b + (-4 + b + 4)(6 - 4 - 3) + 6b - 5b - 2b to the form nb + y and give n. 39 Rearrange 3n*2 + 6 + 35n*3 + 5n - 6n - 2n*2 - 4 + 4n to the form kn + rn*2 + i + fn*3 and give k. 3 Rearrange 2k + k*2 - 3k*4 + 22k + 2k3 - 23k to vk + ik*2 + jk*3 + pk*4 + u and give p. -3 Rearrange (-3 - 2 + 3)(-4 - 2 + 2)(4s + 2s4 - 4s + (4 + 2s2 - 4)(-19s2 - 12s*2 + 21s*2)) to cs*2 + rs*4 + h + ps + bs3 and give r. -144 Rearrange 111x + 32x + 57x + 310x to vx + m and give v. 510 Express (1 + 2 - 2)(-1 - 9 + 0)(67 - 37 - 111j - 30) as bj + i and give b. 1110 Rearrange -3064a - 15a*2 + 1530a - 2 + 1533a to the form ua*2 + c + xa and give c. -2 Rearrange (-1777u + 67 + 1773u + 19)(1 - 1 + 2 + (1 + 1 - 3)(-5 + 1 + 3))(1 + 0 - 3) to r + ku and give r. -516 Rearrange -59 + 86p3 + 24 + 2p*2 + 35 - 2p to jp + g + qp*2 + tp*3 and give t. 86 Express (273 - 352 - 876)(-h - 3h + 2h) - 5h + 6h - 2h + (-3h - h + 6h)(0 + 1 + 1) as s + qh and give q. 1913 Rearrange -116x - 152x + 17x - 80x + 1 + 11x to the form b + zx and give b. 1 Rearrange 4 - 2v*4 - 4 + (v - v - 2v*3)(66v + 69v - 143v) to the form av*4 + x + qv + gv2 + kv*3 and give x. 0 Rearrange (5k*2 + 15k*2 + 50k*2)(-5k + 2k - 2k) to the form sk*3 + zk + a + bk2 and give s. -350 Express 3 - 2q*2 + 4q3 + q2 + 2q - 6q + 0q2 as oq*3 + zq*2 + a + xq and give x. -4 Rearrange -2q3 - 1 + 89q + 1 - 9q4 - 90q + q*2 to the form aq*4 + s + bq*2 + iq*3 + rq and give b. 1 Rearrange 3u - 3u + 2u2 + (-1 - 1 + 1)(-3u2 + u2 + 0u2) + u2 - 3u2 + 0u*2 + 1335 - 245u*2 - 1335 to ku*2 + n + qu and give q. 0 Rearrange -5q + 3q + 0q + 2q - 4q + 3q + 1 - 1 + q + 7q + q - 2q + 0 + 0 - q + (0q + 0q - q)(0 + 0 + 1) - 2 + 2 + q to cq + k and give k. 0 Rearrange -18354k2 + 18369k*2 + 7k + 16k to ak*2 + s + jk and give a. 15 Express (2 - 5 + 2)(-2m - m + 4m) + (-2 + 19 - 29)(2m - 4m + 3m) in the form p + qm and give q. -13 Express -7u + 10u + 6u + (4u + 3u - 5u)(0 - 2 + 0) + 5u + 10 - 10 + 0u + 2u - u + (-3 - 2u + 3)(-1 + 0 + 2) in the form r + ju and give j. 9 Rearrange (-301i*2 + 105i*2 + 113i*2)(-2 + 0 + 4)(4 - 2 + 0) to gi*2 + hi + n and give g. -332 Express -36a2 - 24 - 1 - 2 + 13 as n + ta + oa2 and give n. -14 Express -13 - 32 - 11y - 18 + 25 as v + xy and give x. -11 Rearrange (38 + 62 - 38)(18x + 36 - 36) to the form gx + k and give g. 1116 Rearrange -161 + 288 + 340m2 - 129 + 2m*3 to the form pm*2 + tm + v + gm3 and give p. 340 Express 30m*2 - 23m + 7m + 19m in the form pm + cm*2 + z and give p. 3 Express (-2o*3 + 0o3 - o3)(-21o + 0o + 7o) - 7o4 - 10o*4 - 5o*4 as wo*2 + fo + zo3 + uo*4 + d and give u. 20 Rearrange (-2j + 1 - 1)(291 + 2j - 291 - 164j2) to l + cj*3 + bj + rj2 and give c. 328 Rearrange -30u + 8u + 2 - u2 - u3 + 2u*4 + 20u to the form ju4 + gu*3 + qu + yu2 + x and give y. -1 Express 4 + 0 + 11 - 191n - 17 as yn + q and give q. -2 Express 62 + 21 + h + h3 - 437 as th*2 + xh*3 + kh + j and give j. -354 Rearrange 2g2 - 5g*4 + 0g*2 + 2g2 - g2 - 47g3 - 2g*2 + g to the form wg*2 + rg*3 + tg*4 + zg + k and give w. 1 Rearrange (2 + 0 + 0)(9 + 18 - 14 - j)(5 + 3 - 3) to the form fj + y and give y. 130 Rearrange -3t + 3t + 3t*3 + (-4t*3 - 3t*3 + 4t*3)(-6 + 3 + 4) + 53t3 - 14t*3 + 34t*3 to i + dt*2 + st + qt3 and give q. 73 Express 17 - p - p2 + 2p*2 + 0p + 2p in the form gp*2 + jp + c and give g. 1 Express 17d2 - 19d*2 + 69 - 71 - 47d as g + od2 + wd and give o. -2 Express q3 - q3 + q*4 + (-2q2 - q2 + 2q2)(-118 - 12q2 + 118) - q - 2q*4 + q in the form lq*4 + rq*3 + sq*2 + xq + d and give d. 0 Rearrange 63r - 33r + 56r + 125r to the form qr + x and give q. 211 Rearrange -2i*3 + 11 + 1 - 7i*3 - 3i*2 - 3 + 8i3 + i4 to ni2 + ki + bi3 + ci*4 + u and give c. 1 Express 0w - 24 - 725w3 + 25 + 0w - w*4 as tw + nw2 + mw*3 + rw*4 + k and give k. 1 Rearrange 123 - 108 - 176 - 2w - 299 to b + aw and give b. -460 Express (1 + 3 - 2)(2w + 0w + w) - 8w - 3 + 3 + (-4 + 4 - 2)(0w - 4w + 2w) + 2 - 2 + 3w in the form f + dw and give d. 5 Express 24k - 26k - 3 + 67k + (-2k - k + 2k)(3 - 1 + 0) in the form hk + x and give x. -3 Express ((-2 + j + 2)(-2 - 1 + 1) + 20j - 2j + 9j)(2 + 2 - 3)(-22j + 10j + 10j) as yj + t + dj2 and give d. -50 Rearrange ((1 + 1 - 1)(2s - 3s + 2s) + (-2s + 3 + 3s - 2s)(-7 + 2 - 8))(s - 4s + 2s)(-2 - 1 + 2) to ns*2 + os + x and give n. 14 Express ((1 - 1 - v*2)(0 + 2v + 0) - 11v + 8v3 + 11v)(3v - 8v - 5v) in the form ov4 + kv + s + mv3 + tv*2 and give o. -60 Rearrange (-3i + i + i)(3i - 5i + i) - i2 + 0i*2 - 2i*2 - 3 + 3 - 2i*2 - 15i + 9i - 34i*2 + 8i*2 to the form wi*2 + a + zi and give z. -6 Express (-3 + 0 + 7)(13 - 1323u - 62 + 27 + 22) as tu + a and give t. -5292 Express (3 + r - 3)(70 - 207 - r - 155) - r*2 + 3r2 - r2 + (-1 + r + 1)(1 - r - 1) + 0r - 2r2 + 0r in the form w + xr2 + tr and give x. -3 Rearrange 59q - 26q - 33q - 30q*3 + 2 to the form jq*3 + xq*2 + a + zq and give j. -30 Express 0 + 3 - 2 - 1 + 184t2 as it*2 + vt + u and give i. 184 Rearrange 9 - 13 + 43y2 + 3 to j + zy*2 + my and give j. -1 Express (-25g2 - 162g + 162g)(9g - g2 - 9g) in the form xg3 + sg*2 + fg*4 + ag + b and give f. 25 Express 7f4 + 23f*4 - 16f*4 + (2f*2 - 4f*2 + 3f*2)(0f + 0f - f*2) + 2f*4 - 8f + 8f as jf*3 + cf + if2 + d + rf*4 and give d. 0 Rearrange 871a - 34 - 2 + 549a + 36 to y + ma and give m. 1420 Express 71m - 209m - 94*m	{ "pile_set_name": "DM Mathematics" }
Factor 92b2 - 385/2b - 8b3 + 225/2. -(b - 9)(4b - 5)2/2 Suppose 564/17 + 2254/17j - 8/17j2 = 0. Calculate j. -1/4, 282 Let p(w) be the third derivative of -1/130w*5 - 1/260w*6 + 0w*3 + 0w + 65w2 - 1/156w*4 + 1 - 1/1365w*7. Factor p(q). -2q(q + 1)3/13 Let i be 3367/(-91) + (-995)/(-20). Solve -io + 63/2 + 3/4o2 = 0. 3, 14 Let w(v) = -18v*2 - 178v - 152. Let x(s) = -s*2 - 9s. Let k(i) = w(i) - x(i). Factor k(q). -(q + 1)(17q + 152) Find d, given that 641d - 4d*2 - 3348 + 1232d + 493d - 688d + 2d2 = 0. 2, 837 Let j(a) be the third derivative of 0 + 0a + 1/14a3 + 1/42a*4 + 45a*2 + 1/420a*5. Solve j(z) = 0 for z. -3, -1 Let a(u) be the first derivative of -3/4u*4 + 0u - 316 - 13/3u3 + 5u2 + u5 + 1/6u6. Factor a(m). m(m - 1)*2(m + 2)(m + 5) Let o(z) be the first derivative of -z5/9 - 11z4/36 - z3/9 - 3z2 - 1. Let h(r) be the second derivative of o(r). Factor h(p). -2(p + 1)(10p + 1)/3 Let h be (9/19640/30)/(927/2163). Factor 36/7 + hz*2 + 12/7z. (z + 6)*2/7 Let j = 197 - 193. Factor -68o*2 - 2o*j + 63o*2 + 7o*4. 5o*2(o - 1)(o + 1) Factor 94w*4 - 2w*5 + 1230w*3 - 1230 + 2970w*2 - 3w*5 + 90w + 45w - 3225 + 31w*4. -5(w - 33)(w - 1)(w + 3)*3 Let a be (-22 + 1)(-9)/(-81)-3. Let s be 0/((a - 1)/6). Factor -15/8d*2 + 3/4d - 3/8d4 + 3/2d*3 + s. -3d(d - 2)(d - 1)*2/8 Factor 3/2a*2 + 747a + 0. 3a(a + 498)/2 Let l(r) = -r*2 + r. Let j = 135 - 134. Let v(u) = 6u*2 - 45u + 147. Let d(s) = jv(s) + 3l(s). Factor d(i). 3(i - 7)2 Let d(y) be the first derivative of y5/10 - 5y*4/6 + 2y*3/3 + 8y*2 - 5y + 20. Let x(p) be the first derivative of d(p). Suppose x(m) = 0. What is m? -1, 2, 4 Let h(l) be the first derivative of 3l5/20 - 13l*4/14 - 4l*3/7 - 97l - 25. Let n(f) be the first derivative of h(f). Factor n(j). 3j(j - 4)(7j + 2)/7 Let j(r) = -13r3 - 3r*2 - 2r - 3. Let t be j(3). Let z = t - -389. Find k such that -24/7 + 4/7kz + 4/7k = 0. -3, 2 Suppose 8j - 6j = 72. Let y = 39 - j. Let 0c - 4c*y - 3c*3 + 11c*3 - 2c*5 - 2c = 0. Calculate c. -1, 0, 1 Suppose -5l + 65 = -3l - 3c, 2l - 2c - 60 = 0. Solve 80m - 270 - 300 + 510 + lm3 + 165m*2 = 0. -6, -1, 2/5 Let s be (-49)/14(((-2448)/(-135))/(-16) + 2/(-30)). Factor 0 - sz3 - 114/5z - 81z2. -3z(z + 19)(7z + 2)/5 Let w(d) = -d3 - 60d*2 + 188d - 24. Let b be w(-63). Let k(c) be the first derivative of 4/3c3 - 10c*2 + 24c + b. Factor k(n). 4(n - 3)(n - 2) Let r(u) = 6u3 + 32u*2 - 134u + 16. Let v(n) = -7n3 - 31n*2 + 136n - 20. Let a(t) = -5r(t) - 4v(t). Factor a(x). -2x(x - 3)(x + 21) Let f(s) be the first derivative of -s3/12 - 127s*2/24 - 7s/2 + 714. Factor f(k). -(k + 42)(3k + 1)/12 Factor -2/11s2 - 5488/11s - 3764768/11. -2(s + 1372)2/11 Let h(l) = -10l*2 - 96 - 4l - l*3 - 4l - 10l + 80. Let b be h(-8). Determine q so that -1/3q*4 + 1/3q*2 + b + 2/3q - 2/3q3 = 0. -2, -1, 0, 1 Determine o so that -5/4o*4 + 2065/4o + 375/4o2 + 775/2 - 145/4o*3 = 0. -31, -2, -1, 5 Let u(x) be the second derivative of -1/20x*4 - 6/5x*2 + 164x - 1/2x3 + 0. Let u(r) = 0. Calculate r. -4, -1 Let t(l) be the third derivative of -106l*2 + 8/3l*3 + 0 + 0l - 1/60l5 + 0l*4. Suppose t(u) = 0. Calculate u. -4, 4 Let r(j) be the first derivative of -47524j*3/21 - 436j*2/7 - 4j/7 - 891. What is x in r(x) = 0? -1/109 Let s = -270009 + 1890067/7. Factor -4b3 - 4/7b*4 + 4b + sb2 + 0. -4b(b - 1)(b + 1)(b + 7)/7 Let k(g) = -g2 + 10g + 56. Let u be k(14). Suppose -a + 5c - 10 = u, -4c + 8 = 4a - 7a. Let 0z - 2/11z*4 - 4/11z*3 - 2/11z*2 + a = 0. What is z? -1, 0 Let t be 8 + (-2)/1 - (-1 - 0). Suppose -4b = 9b + tb. Factor 1/3s2 - 4/3 + bs. (s - 2)(s + 2)/3 Factor 10w*2 + 44w*3 + 3w*2 + 2w*2 - 49w*3. -5w*2(w - 3) Let g(y) = y*2 - 3y - 2. Let l be g(-3). Suppose 0 = -5s + r + 399, 0r - 4r = l. Factor -s - 60q*2 - 4q*3 + 151q - 451q - 421. -4(q + 5)*3 Suppose 136 - 11 = 5x. Suppose -10 - 22h2 - 27h*2 + 15h + 69h2 - xh*2 = 0. Calculate h. 1, 2 Suppose -4 = -6u + 4u. Factor 115t*2 + 2t*3 + ut - 4t - 6 - 109t*2 + 0t. 2(t - 1)(t + 1)(t + 3) Let h(t) be the second derivative of t4/9 - t3/18 - 5t*2/6 - 454t - 1. Factor h(c). (c + 1)(4c - 5)/3 Factor -438x2 + 232x*2 + 68 + 5x + 65x + 208x*2. 2(x + 1)(x + 34) Determine t so that -14t*3 + 0t - 12t2 + 0 - 2/3t*5 - 16/3t*4 = 0. -3, -2, 0 Let m be 1/(-8) - 1936/(-128). Factor 14q*2 - 46q*2 - m + 9 - 18q3 + q5 - 2q4 - 23q. (q - 6)(q + 1)4 Let l(f) be the second derivative of -f6/24 + f5/6 - 35f*2/2 + 2f - 20. Let k(i) be the first derivative of l(i). Solve k(s) = 0 for s. 0, 2 Let p(v) be the first derivative of -6/5v + 1/5v*2 - 122 - 1/10v*4 + 2/5v*3. Suppose p(h) = 0. What is h? -1, 1, 3 Let j(s) be the second derivative of -7/12s*4 - 5/6s*3 - 5 - 3s + s2. Suppose j(x) = 0. Calculate x. -1, 2/7 Let x(o) be the third derivative of -o7/3780 - o*6/1620 + 11o*4/24 - 23o*2. Let b(g) be the second derivative of x(g). Factor b(q). -2q(3q + 2)/9 Let h(p) be the first derivative of 2p5/5 + 131p*4/2 - 266p*3/3 - 131p*2 + 264p - 9585. Factor h(u). 2(u - 1)2(u + 1)(u + 132) Let r(l) be the first derivative of -2350/3l*3 + 5/6l*6 + 3190l*2 + 16l*5 - 4840l + 5/4l4 + 220. Factor r(g). 5(g - 2)*3(g + 11)2 Let g(f) = f3 + f*2 - 2f + 1. Let c(j) = 3j + 27j*2 + 13j*2 - 39j + 20j3 - 32j + 32. Let d(q) = c(q) - 24g(q). Factor d(w). -4(w - 2)(w - 1)2 Let k = -5878869/354004 - 9/25286. Let h = k + 118/7. Factor ho*2 - o + 3/4. (o - 3)(o - 1)/4 Let y(b) = -b*2 + 59b + 22b - 1 - 8b*2 - 9b*2 + 21b*2. Let w(z) = -2z*2 + z - 1. Let h(u) = w(u) - y(u). Factor h(q). -5q(q + 16) Find c, given that -2c + 0 + 1/3c2 + 19/9c*3 - 1/3c*4 - 1/9c*5 = 0. -6, -1, 0, 1, 3 Factor 11/2u*2 - 1/8u*3 - 288 - 48u. -(u - 24)*2(u + 4)/8 Let q(m) be the first derivative of 8m + 45 - 2/3m*3 - 4/5m*2 + 1/10m*4. Solve q(k) = 0 for k. -2, 2, 5 Suppose 204 = -4i + 5g + 384, 216 = 5i - 7g. Factor 3/5h*2 - 12h + i. 3(h - 10)2/5 Suppose -18v + 3o + 128 = 14, -5o = 10. Let 1/3g3 - 1/6g*4 + 11/6g*2 - 2g - v = 0. Calculate g. -2, 3 Let k(b) be the first derivative of 4/3b3 + 261 + 3364b + 116b2. Factor k(t). 4(t + 29)*2 Find h such that -50134 - 39h - 50145 + h*2 - 50025 + 150502 = 0. 6, 33 Let n be ((-48)/(-12) - 4)(-1)/2. Factor 11 - z - 5z - 7 + nz*2 + 2z*2. 2(z - 2)(z - 1) Find k such that 1995k - 107k3 - 99k*3 + 2205 - 205k*2 - 108k*3 + 319k3 = 0. -1, 21 Let a(s) = -s2 + 4s - 14 + 13 - 2s + s. Let c(x) = -27x + 26. Let b(u) = 5a(u) + 5c(u). What is g in b(g) = 0? -25, 1 Let x(r) be the third derivative of r7/735 + r6/84 - r5/35 - 8r*4/21 + 32r3/21 - r2 + 58r - 25. Factor x(o). 2(o - 2)(o - 1)(o + 4)*2/7 Let t be 1236/(-42) + 6/14. Let q = 17 - t. Factor 39y*2 - 4y*5 - 8y - 36y3 - 21y*2 - qy*2 - 20y*4. -4y(y + 1)3(y + 2) Suppose 1328k2 - 143k*4 - 168k*4 - 1324k*3 + 307k*4 = 0. What is k? -332, 0, 1 Let n(k) be the second derivative of 18k + 0 - 7/2k3 - 1/8k*4 - 39/4k*2. Let n(v) = 0. Calculate v. -13, -1 Let o(r) = 6r*2 + 4r + 4. Let d be (-6)/(-1) + (4 - 7). Let j be o(d). Factor -2t2 + j - 139 + 69 - 2t. -2t(t + 1) Let n(y) be the second derivative of y*5/10 + 1909y*4/6 - 3821y*3/3 + 1911y*2 - 757y + 6. Solve n(f) = 0. -1911, 1 Let w(t) be the first derivative of 1331/5t - 128/5t*4 + 704/5t*3 - 116 - 1452/5t*2. Find r such that w(r) = 0. 11/8 Let t(q) be the first derivative of 2q*3/3 - 248q*2 - 498q + 3336. Factor t(r). 2(r - 249)(r + 1) Let a(w) = 2w + 14. Let n(o) = -2o - 14. Let l be n(-4). Let u be a(l). Let -8r2 - 3r*4 - 3 - 12r*3 - 12r + 0 - 14r2 + 4r*u = 0. What is r? -1 Let u(j) be the second derivative of -4/3j*3 + 2/5j*5 + 6 - 8j*2 + 5/4j*4 + 3j + 1/30j6. Suppose u(o) = 0. Calculate o. -4, -1, 1 Factor -1269/5w + 1/5w*2 - 2542/5	{ "pile_set_name": "DM Mathematics" }
i + 20i + 12i as xi + j and give x. 36 Express -4 + 4 - 17i - 16i in the form ti + g and give t. -33 Express 0h + h3 - 9h - 5h + 1 as sh + xh2 + wh*3 + i and give w. 1 Rearrange 85 - 5v - 81 + 0v to jv + s and give s. 4 Express -1 + 5w4 + 2w*4 + 2w*2 + 2w*3 + 4 - 4 as qw*4 + o + xw*3 + kw*2 + gw and give k. 2 Rearrange (-2f + 0f + 4f)(3f3 - 1 + 1 + (f3 - 2f3 - f3)(-5 + 2 + 2)) to the form cf + h + kf4 + xf*2 + wf*3 and give k. 10 Express -2 + 4 + 2s + 5 as w + hs and give h. 2 Rearrange 15p*2 + 2p*2 - 1 + 42p*2 to the form vp + y + up2 and give y. -1 Express (1 - 3 + 1)((-1 + 0 - 1)(-4 - 2k + 4) - 4k - 2k + 5k - 11k + 11k + 8k + k + k - k) in the form n + yk and give n. 0 Express -29y + 29y - 2y*2 as dy*2 + g + py and give d. -2 Express 0 + p + 8p2 + 4p2 - 1 - 1 - p3 as sp3 + vp + m + qp2 and give m. -2 Rearrange -5j + 2j - 15j - j + 2j + 3j + (-4j + 2j + 0j)(-2 - 1 + 2) - j + 0j + 0j to the form yj + s and give y. -13 Rearrange (-m + 10m - m)(0 + 0 - 2) + (-1 + 1 - 2m)(-2 + 4 - 1) + 2m + 4m - 5m to n + bm and give b. -17 Express (-1 + 2b + 1)(0 + 0 - 2b + (-5b + 5b - 6b)(-9 - 8 + 1)) in the form nb + v + qb2 and give q. 188 Express -t3 - 2t2 + 2t*2 + 2t - t*2 in the form nt*3 + ot + u + bt2 and give b. -1 Express (3k - 4k + 0k)(-5k*2 - 13k*2 - 21k*2) in the form sk*3 + w + pk*2 + bk and give s. 39 Rearrange 20w2 - 3w*4 - 22w*2 + 0w*4 + 8 + 2w*3 + 5w*4 to hw + s + qw2 + zw*4 + xw*3 and give x. 2 Rearrange -4f*2 + 13f*2 - 2f + 6f2 to h + zf + pf2 and give z. -2 Rearrange (3 - 3v + 4v + 0v - 5v + 0v + 3v + (-2 + 3 + 0)(v + 5v - 2v))(3 + 1 - 2) to the form n + sv and give s. 6 Rearrange (3n2 + n2 + n2 - 1)(n - 6n - 3n)(1 + 3 - 3) to k + sn + bn3 + ln*2 and give b. -40 Express (25i + 13 - 8 - 4)(-3 + 6 - 2) in the form di + v and give d. 25 Rearrange -9g2 + 1 - 6g*2 + 14g*2 - 3g*2 to the form ig*2 + s + mg and give s. 1 Express 14y3 - 4y*3 - 2y*3 - 2y*4 + 1 in the form j + xy*2 + wy*3 + vy*4 + zy and give v. -2 Express -j*3 - 6j*3 + 0j*3 + 6j*3 - 15 as nj*2 + ij*3 + k + qj and give k. -15 Express -2 + 7z4 - 2z*2 - 5z*4 - 4z*4 as jz + k + pz3 + oz*2 + az*4 and give o. -2 Rearrange -1 + 229a - 33a + 1 to the form z + va and give v. 196 Express 0v - 11v*4 + v - 1 - 4v*2 - 7v*4 + 22v*4 in the form lv*2 + uv*3 + cv*4 + bv + t and give t. -1 Express -2z2 - 4 + z2 + 0 - 5z*2 in the form xz*2 + dz + r and give r. -4 Express -51d - 3d*2 + 51d in the form bd2 + fd + i and give b. -3 Rearrange (-2 + 2 + 13)(5p + 0p - 3p) to the form o + zp and give z. 26 Rearrange 2g4 + g2 - 19g - 2g*2 + 2g*3 + 0g*3 + 18g to the form s + yg2 + lg + cg3 + xg4 and give c. 2 Rearrange (2 - 2 + r2)((-r - 5r + 4r)(-3 + 2 + 2) + 11r - 12r + 22r) to the form dr*3 + kr + v + tr2 and give d. 19 Rearrange (5y + y + 34y + 1)(2 - 2 - 2) to the form uy + r and give r. -2 Rearrange (8 - 5n - 8)(n2 + 0n*2 + 2n2) - n2 + n*2 + 4n*3 to the form vn + fn3 + x + hn*2 and give f. -11 Express -5 - 17m + 6 - 1 as b + am and give a. -17 Express (-u + 2u + u)(4 + 3 - 5)(16u - 12u - 12u) as xu*2 + y + cu and give y. 0 Rearrange 5c2 + c3 - 3c*2 - 2c*3 + 10c to the form tc + lc*3 + fc*2 + o and give t. 10 Rearrange 20s + 5s + 12s to n + bs and give b. 37 Rearrange 12u*2 - 1 - 9u*2 + 2 to t + wu + au2 and give a. 3 Rearrange (s2 - 2s2 - s2)(-4 + 3 - 2 + (-3 + 3 + 2)(3 - 3 - 1)) to o + ls2 + ts and give t. 0 Rearrange 3w + 0w - 2w + (-2w + 7w - 3w)(1 + 2 - 4) + 3w - 4w - 4w + (0 + 1 + 2)(0 + 0 - w) to zw + a and give z. -9 Rearrange 1 + 12i2 - 3i*3 + 0i*2 - i - 7i*2 to n + wi*3 + ui + qi2 and give q. 5 Rearrange 9i*2 + 8i - 3i - 5i to hi2 + li + x and give h. 9 Express -2l2 - 3l*4 - 9 + 2l + 9 - 3l as xl*2 + tl*3 + rl*4 + o + dl and give d. -1 Express -3k + 0 + 3 + 4k - 8k3 in the form ck + wk2 + jk*3 + g and give j. -8 Express (5 - 2 + 2)(h + 0 + 0)(-1 - 1 + 4) in the form kh + c and give k. 10 Rearrange (-4u + 4u - 4u4)(3 + 0 - 2)(2 - 4 + 1) to gu + pu4 + lu*3 + yu*2 + s and give y. 0 Rearrange -5r + 0r - 47r - 15r to the form g + lr and give l. -67 Rearrange j*2 + 10 + 2j*2 - 9 + (j + 0j - 2j)(-j + 3j + 0j) to hj + nj*2 + c and give n. 1 Rearrange 25p*2 + 43p*2 - 103p*2 to qp*2 + wp + x and give x. 0 Rearrange -45s + 4s - 50s - 2 to m + js and give m. -2 Rearrange -1 + 18x2 - 1 - 13x*2 to the form qx + b + lx2 and give b. -2 Express (3 - 3s*2 + 2s*2 - 2)(-8 - 15 + 4)(-2s - 2s + 6s) as t + ws3 + js + cs2 and give j. -38 Express -1 + 14o*2 - 2o*2 + 1 as ho*2 + a + xo and give a. 0 Express (-3 + 3 - q)(2 - 5 + 1)(-q + 0q - 5q) in the form m + dq + kq*2 and give k. -12 Rearrange (2 + 2 - 2)(24 - 45 - 16a + 22)(-2a2 - a2 + a2) to the form l + xa*3 + ha + da2 and give d. -4 Express (-2y - 4y + 8y)(16 - 9 - 5) in the form iy + k and give i. 4 Rearrange -4d - 5d - 5d - d2 + 16d to md2 + s + jd and give m. -1 Express (-1 - 2 + 2)(-9 - 7i*2 + 9) + (i - 4i + 2i)(1 - 1 - i) in the form gi + pi*2 + j and give p. 8 Rearrange (j - 5 + 5)(0 - 2j + 0)(0j2 + 2j2 - j2) to the form o + nj + lj*4 + vj*2 + bj*3 and give l. -2 Rearrange (0 + 2 - 1)(0d3 - 4d3 - d3)(-d - 3d + d) to the form c + yd4 + sd*2 + jd*3 + pd and give y. 15 Rearrange (r - r - 2r + (-3 - r + 3)(0 - 5 + 3) + 5r - 5r + r)(25r*2 + 5r*2 - 5r*2) to the form wr*3 + cr*2 + n + ur and give w. 25 Express (-z + z3 + z3 - 6z)(-3 + 5 - 1)(4 - 1 + 0)(1 - 3 + 0) as gz + fz*2 + wz*3 + a and give w. -12 Rearrange 11y + 2 - 4 - 3y3 + 1 + 4y*3 to ty*3 + oy*2 + ay + m and give m. -1 Rearrange (-3 + 6 - 2)(0u - u + 0u) + 1 - u - 1 - u - u + 0u - 3u + 3u + u + (-5u + u + 2u)(-4 + 1 + 1) + u + 5u - 3u to the form r + ou and give o. 4 Express -1 + t*2 + 1 + (0 - t + 0)(-t - t + 0t) + 142t*2 + 83t*2 - 339t*2 as zt + mt2 + i and give m. -111 Rearrange (2 - 2 + k)(-73k3 + 4k + 137k3 - 65k*3 + 2k*2) to the form lk*3 + yk*2 + ck + q + ak4 and give l. 2 Rearrange -5g*3 - 2g*3 + 2g*2 + 0g2 - g3 to the form zg + ag*3 + dg*2 + l and give a. -8 Express -11t*2 + 1 - 4t*2 + 6t*2 as at + i + st2 and give i. 1 Rearrange (-1 + 1 - 4y)(19 - 26 + 9)(4y - y - 2y) to the form jy2 + ly + n and give j. -8 Rearrange -26d + 26d - 4 + d*2 + 26 to the form cd + hd2 + q and give h. 1 Rearrange (4h - h - 2h)(4 - 2 - 3) + 0 + 18008h + 0 - 17692h to vh + y and give v. 315 Express (-i + 3i - i)(5 - 4 - 3)(0i - i - 3i) in the form oi + wi*2 + h and give w. 8 Rearrange 2n + 10 - 11n2 - 10 + 7n*2 to yn + v + on2 and give o. -4 Rearrange -23i*2 - 10 + 33i*2 - 15i*2 to the form ti*2 + ui + r and give t. -5 Rearrange 0 - 3y3 - y3 + 0 + 3 - 2y*2 to the form oy*3 + gy*2 + d + cy and give c. 0 Rearrange -5n3 + 3n*3 - 3n2 + n2 to f + cn3 + on*2 + tn and give c. -2 Express (1 - 1 - 1)(j + 1 - 2j - 3j) as p + bj and give p. -1 Express u*2 + 4u*2 - 4u*2 + 11u as t + pu + vu*2 and give p. 11 Rearrange (15a - 7a + 10 - 5a)(6 - 4 - 3 + 0 - 3 + 4 + (-6 + 0 + 4)(3 + 3 - 4)) to n + ma and give n. -40 Rearrange -8s*2 + 11s + 6s2 + s2 to os*2 + js + u and give o. -1 Rearrange -6f2 + 0f4 - f2 + 9f4 + 2 + 8f*2 to qf*3 + of*2 + s + lf + xf4 and give x. 9 Express z + 6 + 2z3 - 7 + z2 - 5z3 in the form w + kz*3 + yz + nz2 and give y. 1 Express -3 + 6r*3 + 4r*3 - 4r*3 + (-r + 3r + 0r)(2r - 2r*2 - 2r) in the form h + kr + cr*3 + sr2 and give c. 2 Rearrange (-2 - y2 + 2)(-3 - y + 3) + (2y + 2y - 6y)(0y*2 - 6y*2 + 0y*2) to j + ty*3 + ny*2 + ay and give t. 13 Express 4z + 5z - 8*z in the form	{ "pile_set_name": "DM Mathematics" }
5uw*2 - 13 wrt w. -9821982u*2 + 30u Find the second derivative of 135575330z2 - 135941665z. 271150660 Find the second derivative of -878462dq*2v + 15dq*2 - 1221dqv - 20dq + dv - q2 - 2qv + q - 2v + 5 wrt q. -1756924dv + 30d - 2 Find the second derivative of -45901r*4 - 4374r*3 - 306394831r. -550812r2 - 26244r Find the third derivative of 241823766a5 - 2a*2 - 14102758a + 7. 14509425960a2 What is the first derivative of 106963753k*4 + 244471699? 427855012k*3 Find the second derivative of -7152231h*2 + 126286h + 5. -14304462 What is the second derivative of -254032l4 - 50l3 + l2 - 1748992l? -3048384l*2 - 300l + 2 Find the third derivative of 87n3t*4 - 66929n*3t*3 + 1257n*3t*2 - 2n*3 - 11 wrt t. 2088n*3t - 401574n3 What is the third derivative of -26604220q*6 - 852q*2 - 2q - 10375? -3192506400q3 Differentiate 442316422jm2 + 302686537m*2 with respect to j. 442316422m*2 Find the third derivative of 288516jv3 + 54407jv2 - 4jv - 557j + 3v4 wrt v. 1731096j + 72v What is the third derivative of 256415029m*3 + 2m*2 + 126353660m wrt m? 1538490174 What is the first derivative of -29293523ar*3t - 2ar*3 + 17884a + r*3 - 318r*2 wrt t? -29293523ar3 Find the second derivative of 32795118w*2 + 9w + 51292. 65590236 Find the second derivative of -2i2x*3 - 425i*2 + 11513x*3 - 98x*2 + 3022x wrt x. -12i2x + 69078x - 196 Find the second derivative of -18o*3 - 9802091o*2 - 38698o + 3555. -108o - 19604182 Find the third derivative of 1790682m*3 + 19426m*2 - 12 wrt m. 10744092 What is the third derivative of 765898g*2z*5 + 893083g*2z*2 + 7gz + 3z*6 wrt z? 45953880g*2z*2 + 360z*3 What is the third derivative of -20702779u*3 - 22439963u*2? -124216674 What is the third derivative of 8981254d*2o3 + d2o2 - 3909d*2o - 2do + 2d + 6o wrt o? 53887524d2 Differentiate -2340d*2 + 18783d - 102980230. -4680d + 18783 What is the second derivative of 5882175g*2 + 44106666g? 11764350 Find the third derivative of 35980o4 + 94o3 - o2 + 327478. 863520o + 564 What is the first derivative of 284181a*2 - 11ag3 - 10487470g*3 wrt a? 568362a - 11g3 Find the third derivative of -12863168m*4 - 1702552m*2 - 2. -308716032m What is the second derivative of -246713004w2 - 9441324w? -493426008 What is the second derivative of 252620v4 - 240v*3 - 8793v + 56 wrt v? 3031440v2 - 1440v Find the second derivative of 87580577d5 - 95279260d. 1751611540d3 What is the derivative of 3389486o*3u + 2ou*3 + 702u*3 + 2u - 926 wrt o? 10168458o2u + 2u3 What is the third derivative of 61365t*4 + 801t*3 + 13924853t*2? 1472760t + 4806 Find the second derivative of 21009062p2 - 40062098p. 42018124 Differentiate -3238350t + 3589226. -3238350 What is the first derivative of -1515p*2 - 4329p - 19567341? -3030p - 4329 Find the third derivative of 609946903i*6 + 5i*2 - 9i - 2856621. 73193628360i3 Find the third derivative of 1305t*4 + 2552t*3 - 14t*2 - 19354t + 3 wrt t. 31320t + 15312 What is the second derivative of 30042281j*4 - 7434j + 1482? 360507372j2 What is the second derivative of 5297589p*3z - 2p2z - 26pz + 12z - 3840 wrt p? 31785534pz - 4z Find the third derivative of -24501747p4 - 4452710p*2 wrt p. -588041928p What is the third derivative of 8458096g3n - 638g2 + 3gn - 2g + 2n + 90 wrt g? 50748576n What is the first derivative of 6467072r + 7716566? 6467072 What is the second derivative of -72270l*3 - 11l*2 - 20292408l? -433620l - 22 Find the second derivative of -37535793y*2 + 43982057y wrt y. -75071586 What is the derivative of -5b3h*2 - 1045360b3 - b2 - 2b - 26260657h*4 - 3 wrt h? -10b*3h - 105042628h3 What is the third derivative of -20351165u*6 + 6u*5 + 405171629u*2 wrt u? -2442139800u*3 + 360u*2 Find the second derivative of 23592v*3 + 4840v*2 + 7v - 5865099. 141552v + 9680 Find the second derivative of -34u*3 + 62039u*2 + 10189293u wrt u. -204u + 124078 Find the second derivative of 1143b*5 - 27b*3 + 1842b*2 - 5845182b - 11 wrt b. 22860b3 - 162b + 3684 Differentiate 127dq*3 - dq*2 - 3389d + 2q3 - 106140q*2 - 3q wrt d. 127q3 - q2 - 3389 What is the derivative of -136842r*4 + 39r*3 - 3r*2 + 617602352? -547368r*3 + 117r*2 - 6r What is the first derivative of 30666467ix*2 - 10259577i wrt x? 61332934ix What is the third derivative of 7695n5 + 413n4 - n2 + 10n - 3582999? 461700n*2 + 9912n What is the third derivative of -53w4 + 19239w*3 - 5w*2 + 946703w? -1272w + 115434 Find the second derivative of -61t*4 - 963898t*3 + 725721561t wrt t. -732t2 - 5783388t Find the third derivative of -438333755h4 + 2h*3 - 1030h*2 - 5h - 2161. -10520010120h + 12 Find the second derivative of 2251962q*2 + 34345q + 58 wrt q. 4503924 Differentiate -19379910g3 + 6612826 wrt g. -58139730g*2 What is the second derivative of -24nq2tv + 224nq2 + 3145nqt - 116nqv - ntv - 89q*2t + 3qt - qv - 4t wrt q? -48ntv + 448n - 178t What is the derivative of -21731337jk2 + 6486534k*2 wrt j? -21731337k*2 Differentiate 178876642u*4 + 136473440 wrt u. 715506568u*3 What is the second derivative of 24373y*3 - 351y*2 - 361706067y wrt y? 146238y - 702 Find the first derivative of -553969025j*2 - 283144643 wrt j. -1107938050j What is the second derivative of -8636435g4 - 8316096g wrt g? -103637220g2 What is the third derivative of 128769958h*5 + 11h*2 + 5201418h? 7726197480h2 What is the third derivative of 5879734k*3 - 3331075k*2? 35278404 Find the second derivative of -11744d*3 + 58d*2 + 483898175d. -70464d + 116 What is the second derivative of -17616184u*3 - 2u - 120828? -105697104u What is the third derivative of 7451733d*3r*2 - 6d*2r*2 + 7d*2r - 34d + 506 wrt d? 44710398r*2 What is the third derivative of 2135j*6 - 511j4 + j2 + 89398j - 7 wrt j? 256200j*3 - 12264j What is the third derivative of -2iv*4 + 61856482iv3 + 77iv2 - 53iv - 1712v wrt v? -48iv + 371138892i Find the second derivative of 8044498h*2 - 13h - 1562 wrt h. 16088996 What is the third derivative of 1155615d5 - 499744d*2 - 5d - 2 wrt d? 69336900d2 What is the third derivative of 7dnt*5 + 84dnt*2 - 20dnt - 257dn - 41965223dt*4 + d wrt t? 420dnt*2 - 1007165352dt What is the derivative of -136d*2 + 298730d - 64884347 wrt d? -272d + 298730 What is the first derivative of 724607t + 14402716? 724607 Find the second derivative of -163972704v5 - 6v - 7220113. -3279454080v3 What is the first derivative of -2ipr - 9848ip + 494ir + 4i + 212p - 3932r - 3 wrt p? -2ir - 9848i + 212 Differentiate 16148876h + 56261874. 16148876 What is the second derivative of 623n*2r - 20719n2 + 2104nr - 2r + 2882 wrt n? 1246r - 41438 What is the second derivative of -11r*3 + 208274r*2 + 146r + 41329 wrt r? -66r + 416548 What is the derivative of 1720674q*4 + 5q*3 + 123489139 wrt q? 6882696q*3 + 15q*2 Differentiate -4166912m*4 + 5741393. -16667648m*3 Find the second derivative of 42c*3q*2 + 1032c*3 - 7c*2h + 9chq2 - 24281chq + 79cq*2 wrt c. 252cq2 + 6192c - 14h Differentiate 1283739bv2 - 2bv - 114625v*2 + 1 wrt b. 1283739v*2 - 2v Find the third derivative of 328136643d3m*3 + 62711d*2m*3 - 4d*2m*2 - 3d*2m + 8d2 wrt d. 1968819858m*3 What is the first derivative of -154408690r - 253108424? -154408690 What is the third derivative of 325315h3 + 18304214h*2 wrt h? 1951890 What is the second derivative of -49843001u*5 + 2837u - 638 wrt u? -996860020u3 Differentiate -25968805qz3 - 2q - z*4 - 198815802 with respect to z. -77906415qz2 - 4z*3 Differentiate -2l*2 + 251628l + 43897809 with respect to l. -4l + 251628 Find the third derivative of 2t*4 - 347119t*3 - 2t*2 - 682811t - 2. 48t - 2082714 What is the first derivative of -196o*4 - 15327o**	{ "pile_set_name": "DM Mathematics" }
33891, 33892, 33893? o + 33887 What is the j'th term of 444, 1205, 1950, 2673, 3368, 4029? -j*3 - 2j*2 + 774j - 327 What is the n'th term of -1214, -1215, -1210, -1199? 3n2 - 10n - 1207 What is the o'th term of 35, -257, -743, -1423? -97o2 - o + 133 What is the p'th term of 50481, 50560, 50639, 50718? 79p + 50402 What is the q'th term of -722, -1496, -2270, -3044? -774q + 52 What is the q'th term of 10035, 20084, 30139, 40200, 50267, 60340, 70419? 3q*2 + 10040q - 8 What is the t'th term of -30, 108, 326, 618, 978? -t*3 + 46t*2 + 7t - 82 What is the k'th term of 676047, 676049, 676051, 676053? 2k + 676045 What is the a'th term of 1605015, 1605016, 1605017? a + 1605014 What is the l'th term of 17940, 71752, 161438, 286998, 448432? 17937l2 + l + 2 What is the a'th term of -367, -447, -525, -601, -675, -747, -817? a2 - 83a - 285 What is the a'th term of 1203, 2359, 3471, 4539, 5563, 6543? -22a*2 + 1222a + 3 What is the y'th term of 9, -221, -849, -2073, -4091, -7101, -11301? -33y3 - y2 + 4y + 39 What is the m'th term of 140, 448, 912, 1532, 2308, 3240? 78m2 + 74m - 12 What is the j'th term of -287411, -574826, -862241, -1149656? -287415j + 4 What is the c'th term of 580, 544, 508, 472? -36c + 616 What is the g'th term of -90, -569, -1440, -2703, -4358, -6405, -8844? -196g2 + 109g - 3 What is the l'th term of 53782, 107565, 161348, 215131, 268914? 53783l - 1 What is the f'th term of -7559, -7392, -7225, -7058, -6891? 167f - 7726 What is the p'th term of 3501, 14012, 31531, 56058, 87593, 126136, 171687? 3504p2 - p - 2 What is the v'th term of -325, -655, -995, -1345, -1705? -5v*2 - 315v - 5 What is the b'th term of -1011, -2026, -3041, -4056? -1015b + 4 What is the z'th term of -6939, -27709, -62325, -110787, -173095, -249249? -6923z2 - z - 15 What is the k'th term of -53521, -53522, -53523? -k - 53520 What is the h'th term of 9502, 9505, 9510, 9517, 9526? h2 + 9501 What is the o'th term of 95980, 96034, 96072, 96088, 96076, 96030? -o*3 - 2o*2 + 67o + 95916 What is the t'th term of -70321, -70322, -70323, -70324, -70325, -70326? -t - 70320 What is the d'th term of -28, -96, -322, -784, -1560, -2728, -4366? -13d3 - d2 + 26d - 40 What is the c'th term of 82, 307, 528, 745? -2c2 + 231c - 147 What is the t'th term of -722, -696, -624, -482, -246, 108? 4t3 - t2 + t - 726 What is the s'th term of -283, -558, -829, -1096, -1359, -1618? 2s*2 - 281s - 4 What is the j'th term of 3874, 4342, 4810, 5278? 468j + 3406 What is the i'th term of -7196, -28846, -64938, -115478, -180472, -259926, -353846, -462238? -i3 - 7215i*2 + 2i + 18 What is the m'th term of -752, -1693, -2636, -3581? -m*2 - 938m + 187 What is the y'th term of -27657, -110645, -248961, -442605? -27664y2 + 4y + 3 What is the i'th term of 111, 868, 2907, 6864, 13375, 23076, 36603? 106i3 + 5i*2 What is the t'th term of 151, -554, -1741, -3410, -5561? -241t*2 + 18t + 374 What is the a'th term of 1011, 1990, 2937, 3852, 4735? -16a2 + 1027a What is the z'th term of 2762, 2777, 2792, 2807? 15z + 2747 What is the d'th term of 2, 7, 4, -19, -74? -2d*3 + 8d*2 - 5d + 1 What is the n'th term of -124, -483, -1102, -1999, -3192? -3n3 - 112n*2 - 2n - 7 What is the h'th term of -14036316, -14036318, -14036320, -14036322, -14036324, -14036326? -2h - 14036314 What is the i'th term of -98, -528, -1284, -2372, -3798, -5568, -7688, -10164? -i3 - 157i*2 + 48i + 12 What is the t'th term of 739, 875, 1011, 1147? 136t + 603 What is the z'th term of -65, -72, -105, -194, -369? -5z*3 + 17z*2 - 23z - 54 What is the p'th term of 1437, 2872, 4307? 1435p + 2 What is the q'th term of -1780, -1767, -1750, -1729, -1704, -1675? 2q*2 + 7q - 1789 What is the o'th term of 633, 2067, 4455, 7797, 12093, 17343, 23547? 477o2 + 3o + 153 What is the z'th term of 12041, 12058, 12109, 12212, 12385, 12646, 13013? 3z3 - z2 - z + 12040 What is the k'th term of 17099, 34175, 51229, 68261? -11k*2 + 17109k + 1 What is the m'th term of -1569, -3196, -4823, -6450, -8077, -9704? -1627m + 58 What is the q'th term of 7767, 7762, 7753, 7740, 7723, 7702, 7677? -2q*2 + q + 7768 What is the g'th term of -137, -323, -487, -617, -701? 2g3 - g2 - 197g + 59 What is the q'th term of 809, 1918, 3025, 4130, 5233, 6334, 7433? -q2 + 1112q - 302 What is the t'th term of 142, 302, 582, 994, 1550? 2t3 + 48t*2 + 2t + 90 What is the r'th term of -2188, -2924, -4150, -5866, -8072, -10768? -245r2 - r - 1942 What is the n'th term of 389, 722, 1005, 1238, 1421, 1554, 1637? -25n*2 + 408n + 6 What is the f'th term of -18, -76, -168, -294, -454, -648, -876? -17f2 - 7f + 6 What is the n'th term of -565, -1169, -1769, -2365? 2n2 - 610n + 43 What is the v'th term of 965, 1926, 2883, 3836, 4785? -2v2 + 967v What is the p'th term of -591, -1698, -3543, -6126, -9447, -13506? -369p2 - 222 What is the j'th term of -722, -1420, -2124, -2840, -3574? -j3 + 3j*2 - 700j - 24 What is the x'th term of -2340, -18705, -63116, -149595, -292164? -2337x3 - x2 - 3x + 1 What is the r'th term of 84040, 84037, 84034? -3r + 84043 What is the w'th term of 329, 574, 775, 938, 1069? w3 - 28w*2 + 322w + 34 What is the p'th term of -811, -1518, -2227, -2938? -p*2 - 704p - 106 What is the h'th term of -588, -1171, -1728, -2259, -2764, -3243? 13h2 - 622h + 21 What is the b'th term of 156, 184, 224, 270, 316? -b*3 + 12b*2 - b + 146 What is the k'th term of -1726170, -3452340, -5178510? -1726170k What is the y'th term of -68206, -272805, -613802, -1091197, -1704990? -68199y2 - 2y - 5 What is the v'th term of -127076, -254149, -381222, -508295, -635368? -127073v - 3 What is the i'th term of -4216, -16803, -37768, -67105, -104808? i3 - 4195i*2 - 9i - 13 What is the v'th term of -696, -647, -568, -459, -320, -151, 48? 15v2 + 4v - 715 What is the u'th term of 1068, 1072, 1076? 4u + 1064 What is the l'th term of -266, -2179, -7378, -17507, -34210, -59131, -93914? -274l3 + l2 + 2l + 5 What is the h'th term of -33830, -33857, -33888, -33923, -33962, -34005, -34052? -2h*2 - 21h - 33807 What is the k'th term of 3398, 6918, 10442, 13970, 17502, 21038? 2k2 + 3514k - 118 What is the s'th term of -18177, -18164, -18141, -18102, -18041, -17952, -17829? s3 - s2 + 9s - 18186 What is the r'th term of -4384, -8763, -13142, -17521, -21900, -26279? -4379r - 5 What is the w'th term of 7685, 7755, 7827, 7901, 7977? w*2 + 67w + 7617 What is the i'th term of -334, -629, -922, -1213, -1502, -1789, -2074? i*2 - 298i - 37 What is the g'th term of 4748, 4757, 4764, 4769? -g*2 + 12g + 4737 What is the v'th term of -1809, -14592, -49297, -116886, -228321, -394564, -626577? -1827v3 + v2 + 3v + 14 What is the y'th term of -8139, -8250, -8361, -8472, -8583, -8694? -111y - 8028 What is the g'th term of 7517, 7495, 7473? -22g + 7539 What is the u'th term of 1289, 2587, 3893, 5207, 6529, 7859? 4u2 + 1286u - 1 What is the l'th term of -33, -395, -1357, -3213, -6257, -10783, -17085, -25457? -49l3 - 6l2 - l + 23 What is the g'th term of 3478, 6980, 10470, 13942, 17390, 20808? -g3 + 3509g - 30 What is the i'th term of 2553, 2572, 2591? 19i + 2534 What is the x'th term of -16908, -33811, -50714, -67617, -84520? -16903x - 5 What is the o'th term of -102, -334, -590, -882, -1222, -1622, -2094, -2650? -2o*3 - 218o + 118 What is the z'th term of -107, -184, -255, -314, -355? z*3 - 3z*2 - 75z - 30 What is the d'th term of 180, 213, 246, 279, 312? 33d + 147 What is the y'th term of 1794, 3901, 6028, 8181, 10366, 12589, 14856? y3 + 4y*2 + 2088y - 299 What is the a'th term of 17504, 17502, 17498, 17492? -a*2 + a + 17504 What is the g'th term of 1472, 2974, 4476? 1502g - 30 What is the w'th term of -122619, -245231, -367843? -122612w - 7 What is the g'th term of 6660, 7070, 7466, 7842, 8192? -g3 - g2 + 420g + 6242 What is the z'th term of -651557, -1303109, -1954649, -2606171, -3257669, -3909137? z*3 - 651559z + 1 What is the p'th term of 640, 654, 666, 676, 684? -p*2 + 17p + 624 What is the g'th term of -152, -712, -1640, -2930, -4576? g*3 - 190g*2 + 3g +	{ "pile_set_name": "DM Mathematics" }
w. Calculate the greatest common divisor of 9 and z. 9 Suppose -10n + 72 = -28. What is the highest common factor of 2200 and n? 10 Suppose 4b + 6b = 690. What is the greatest common divisor of 1173 and b? 69 Suppose -s - 6 = -t, 6 - 1 = -5s. Suppose c = o + 196, -2c - to - 150 = -556. Calculate the highest common factor of 22 and c. 22 Suppose -12z = -x - 11z + 396, -796 = -2x + z. Calculate the greatest common factor of 32 and x. 16 Let x be 80/(-32) - (-155)/2. Calculate the highest common divisor of x and 15. 15 Suppose 972 = -68b + 80b. Calculate the greatest common factor of b and 18. 9 Suppose 4p = q - 40, -2q + 3p = 2p - 59. Suppose 2j + 17 = -5z, 2z = 6j - 4j - 18. What is the highest common factor of q and j? 4 Suppose 2g - 9m - 19 = -8m, -m + 29 = 2g. Calculate the highest common divisor of g and 564. 12 Suppose 0 = -4m - 16, -5o + 4m + 3 = -3. Let i be 3/18o - (-1123)/3. What is the highest common factor of 34 and i? 34 Let g(l) = 2l2 - 5l + l*3 + 4l*2 + l + 2l*2 + 3. Let s be g(-6). Calculate the highest common divisor of 11 and s. 11 Suppose v - 33 - 42 = 0. Let n = -16 + 21. Suppose -v = -nw + 60. Calculate the highest common divisor of 189 and w. 27 Suppose 0 = a - 6 + 1. Suppose at = 57 + 328. Suppose -b = -3b + 22. What is the greatest common divisor of b and t? 11 Let a = 15 - 9. Let x be 2 + 6 + (7 - 11). Calculate the greatest common factor of a and x. 2 Let q(a) = -77a - 14. Let x be q(-8). Suppose -9m + 7m + x = 0. What is the greatest common factor of m and 43? 43 Let r be (156/(-15))/((-6)/30). Let o = 46 - 20. What is the greatest common factor of o and r? 26 Let u = -2 + 4. Suppose -10s + 168 = 18s. Suppose 176 = sv - uv. What is the greatest common divisor of v and 4? 4 Let i = 72 - 10. What is the greatest common factor of 589 and i? 31 Let j(h) = -h3 + 12h*2 - 10h - 7. Let o be j(11). Suppose -3l - 2x - 12 = -7l, 5l - 2 = -ox. Calculate the greatest common divisor of l and 10. 2 Let k(b) = -3b - 41 + 15 + 8b + 2b. Let r be k(6). What is the highest common factor of r and 8? 8 Let n = -78 + 12. Let g = -16 - n. What is the highest common divisor of g and 75? 25 Let a = -31 - -94. Suppose 0 = 25u - 56u + 217. What is the highest common factor of a and u? 7 Suppose -v + 26c + 731 = 22c, -c = v - 711. What is the greatest common divisor of v and 165? 55 Let g = -22 - -14. Let k be (-4030)/g - (-11)/44. Calculate the highest common factor of k and 56. 56 Suppose 0 = 12i - 11i - 55. What is the greatest common divisor of i and 11? 11 Let j be 101 + (8/28 - (-32)/(-14)). Let w = j - -97. What is the greatest common divisor of 28 and w? 28 Let z = 26 + -43. Let h = z - -81. Calculate the highest common divisor of 8 and h. 8 Let m(l) = l*2 - 5l + 1. Let k be m(6). Let j be (126/6)/(k/2 + -2). Calculate the highest common factor of j and 154. 14 Let x = 65 - 28. Suppose 4y - 4p - 91 = -7p, -y + 4p = -x. Let l be 1/(0 - 1/(-5)). What is the greatest common factor of l and y? 5 Suppose 2r = 4n - 66, -18r + 48 = 3n - 19r. Calculate the highest common divisor of n and 20. 5 Let y be 4/1 + (6 - 3). Suppose -2x + yx - 15 = 0. Suppose -xm - 3s + 7 = -8s, 5s = -5m + 65. Calculate the greatest common factor of m and 6. 3 Suppose -3a = 2n + 3n - 34, -5a + 5n + 30 = 0. Suppose -2b = 2d - 12, d + 3b = 3 - 1. What is the greatest common divisor of a and d? 8 Suppose -153d = -191d + 38380. What is the greatest common factor of 40 and d? 10 Let k(n) = 11n2 - n + 1. Let f be k(2). Suppose m + 3r = f, -4m + 2r = -2m - 118. What is the greatest common factor of m and 11? 11 Suppose -34i = -38i - 2g + 74, 4i - 69 = -g. Suppose -m - 3m + 12 = 4j, -3j - m = -11. Calculate the greatest common factor of j and i. 4 Let x = 28 + -25. Suppose -165 = -5a - 5t, 3 = a + xt - 30. What is the highest common factor of a and 11? 11 Let l = 384 - 176. Calculate the greatest common factor of l and 78. 26 Suppose 5j - h - 1531 = 2h, -912 = -3j + 4h. Suppose -f + j = 66. What is the highest common factor of 22 and f? 22 Suppose r - 390 = -14r. What is the greatest common divisor of r and 299? 13 Let r be 15(3 + -1 - -2). Let n be 0/(1/3(9 + -12)). Suppose -4l + r = c + 2c, n = 4c - l - 80. Calculate the greatest common divisor of c and 180. 20 Let p = 894 - 502. What is the greatest common divisor of p and 294? 98 Let i = 1662 + -1059. What is the greatest common factor of i and 9? 9 Let w be 334/4(0 + -3)-2. Suppose -651 = -8c + w. Calculate the greatest common factor of c and 18. 18 Let f(w) = w*2 - 5w - 4. Let g be f(6). Let d(l) = -l + 18. Let n be d(0). What is the greatest common divisor of g and n? 2 Let o = 2 - 10. Let f = o + 13. Suppose -fa - 2d = -90, -68 = -4a + 3d + 27. What is the greatest common factor of a and 8? 4 Suppose 17h - 12h = 140. Suppose 4f + 3i - 436 = 0, -2i = 6f - f - 552. Calculate the highest common factor of f and h. 28 Let c(n) = 3n3 - 4. Let z(p) = p3 - 1. Let m(i) = -c(i) + 4z(i). Let r be m(0). Suppose o = -ro + 18. Calculate the greatest common factor of o and 27. 9 Let a = -396 - -456. Calculate the highest common factor of 330 and a. 30 Suppose 5c - 33 = 25b - 23b, 0 = c + b - 8. Let h(l) = -l - 3. Let i be h(-4). What is the greatest common divisor of c and i? 1 Let i(w) = w*3 - 2w*2 - w - 6. Let l be i(3). Suppose -4m - 5k = -65, 3m - 4k - 46 + 5 = l. What is the greatest common factor of m and 5? 5 Suppose -21q + 25q - 1488 = 0. What is the greatest common factor of q and 48? 12 Let i be (-170)/(-12) - (99/(-54))/(-11). Calculate the greatest common divisor of 483 and i. 7 Let q be 6(7 - (1 - 0)). Suppose -3l = q + 72. Let r = l - -55. Calculate the greatest common divisor of r and 152. 19 Let d(z) = 18z3 - z2 + z - 1. Let w be d(1). Let n = w - 13. Suppose j + 13 = nh, -3h - 2j - 7 = -3. What is the highest common factor of 14 and h? 2 Let r be 0 - 1 - 132/(-22). Suppose 0x + 10 = rx, 3g - 35 = -4x. Calculate the greatest common divisor of g and 15. 3 Suppose -2f + 54 = 2z, 3z + 13 = 4. Let b = f + -10. What is the highest common divisor of b and 160? 20 Let s be (-29)/(-1) - (2 - 2). Suppose 17 = 6q - 13. Suppose -1282 = -qa + 3b - 113, 0 = a + b - 229. What is the highest common divisor of s and a? 29 Suppose -39 + 139 = 4o. Calculate the highest common divisor of o and 475. 25 Let m(o) = 3o2 + o - 15. Let j be m(-5). Suppose -8d + 6d = -30. Let s = d - 4. What is the greatest common factor of s and j? 11 Let b(c) = -c3 + 8c*2 - 3c - 7. Let o = -85 + 92. Let l be b(o). Calculate the highest common factor of l and 84. 21 Suppose 5p - 19 = j, 3p + 2j = -4 + 18. Suppose 0 = -3y - 5m + 10, 2y - m - 8 = -pm. What is the greatest common factor of y and 130? 10 Suppose -368 = 121v - 125v. Calculate the highest common divisor of 92 and v. 92 Suppose 2v - 1 = 3. Suppose 0 = -vz - 3k + 2k + 70, -3z - 2k = -107. What is the greatest common factor of z and 11? 11 Let z = -814 + 1219. What is the greatest common factor of z and 9? 9 Let d(z) = -11z - z*2 + 26z - 14 + 3z2. Let c be d(-10). What is the greatest common factor of 4 and c? 4 Let d(n) = -6n*2 + 12. Let r be d(0). Suppose -2l + 136 = 2a, -4a = -4l + 258 + 46. Suppose -4h = -2h - l. What is the highest common factor of r and h? 12 Let z = -5 + 8. Let m = 3184 - 3181. Calculate the highest common factor of z and m. 3 Let w(j) = -j2 + 3j - 3. Let n be w(2). Let b be 3(n - -42/4). What is the greatest common divisor of b and 2? 1 Let g = 1967 + -1642. Calculate the greatest common divisor of 13 and g. 13 Let t = 232 + -176. Calculate the greatest common divisor of 232 and t. 8 Suppose w = 17 - 12. Let z be (-114)/(-8) - 7/28. Suppose -j + 8 = -o, 0 = -3o - w + z. What is the highest common divisor of 22 and j? 11 Suppose 2x - x - 17 = -4a, a = -4x + 98. Suppose xv - 4v = 84. What is the greatest common divisor of 72 and v? 4 Let v = -37 + 50. Suppose -16w + vw + 48 = 0. Calculate the greatest common factor of 128 and w. 16 Let k = -169 - -105. Let h = -41 - k. What is the greatest common divisor of h and 253? 23 Let x(j) = j - 3j + 4j - 27 +	{ "pile_set_name": "DM Mathematics" }
d 6020? 215 What is the greatest common divisor of 3798 and 2392951? 211 What is the greatest common divisor of 91007180 and 26492? 716 What is the greatest common divisor of 78937 and 118201? 409 What is the highest common divisor of 168 and 1123256? 8 What is the greatest common divisor of 9217832 and 24? 8 Calculate the highest common divisor of 83416902 and 762. 762 What is the greatest common factor of 106584975 and 3100? 775 What is the greatest common factor of 216712856 and 36584? 2152 What is the greatest common divisor of 87 and 2497487569? 29 Calculate the highest common factor of 513 and 418419. 27 What is the highest common divisor of 481 and 2192731? 37 Calculate the highest common factor of 223410 and 5181081. 2031 Calculate the highest common factor of 360615509 and 17. 17 Calculate the greatest common divisor of 637875 and 124125. 375 What is the highest common factor of 264456 and 6192? 72 Calculate the greatest common divisor of 291 and 162451623. 291 Calculate the greatest common divisor of 9 and 4199319279. 9 What is the highest common divisor of 40689 and 31866885? 3699 What is the highest common divisor of 58862 and 5542322? 3098 What is the highest common divisor of 28860 and 1099020? 780 Calculate the greatest common factor of 243 and 33414201. 243 Calculate the greatest common factor of 8412 and 31627718. 1402 What is the highest common divisor of 84591129 and 942? 471 What is the greatest common factor of 775 and 2391250? 25 What is the greatest common divisor of 298345375 and 625? 125 What is the greatest common divisor of 5176673 and 2292? 191 What is the greatest common factor of 2376938503 and 139? 139 Calculate the greatest common divisor of 30327951 and 747. 249 What is the highest common factor of 11243230 and 1150? 10 What is the highest common factor of 21854402 and 27334? 158 Calculate the greatest common divisor of 1506 and 513546. 1506 What is the greatest common factor of 273941535 and 20? 5 What is the highest common divisor of 58538802 and 56? 14 Calculate the greatest common divisor of 340 and 182218070. 170 Calculate the greatest common factor of 13554 and 352413036. 4518 Calculate the greatest common divisor of 392 and 680948002. 98 Calculate the highest common factor of 3002 and 61009646. 3002 Calculate the greatest common factor of 3743214 and 24. 6 Calculate the highest common divisor of 2358444 and 3927. 561 Calculate the highest common divisor of 77 and 48859580. 77 What is the greatest common factor of 4160855 and 45? 5 Calculate the greatest common divisor of 1000 and 2761250. 250 What is the greatest common factor of 10440 and 192960? 360 Calculate the highest common divisor of 13737 and 63669. 57 What is the greatest common factor of 192 and 255904080? 48 What is the greatest common divisor of 14718277 and 952? 119 Calculate the highest common factor of 261246000 and 24. 24 What is the highest common factor of 133 and 1946056? 133 Calculate the highest common factor of 1952 and 130280. 8 What is the greatest common factor of 72038 and 20815? 181 Calculate the highest common factor of 227197 and 15300192. 3391 What is the highest common factor of 60 and 151817820? 60 Calculate the highest common factor of 2096 and 58224784. 2096 What is the highest common divisor of 2126187 and 1260? 63 Calculate the greatest common divisor of 116 and 13722176. 4 What is the highest common divisor of 3127434 and 83085? 573 What is the highest common factor of 12515 and 133505014? 2503 What is the greatest common divisor of 14610528 and 12125? 97 What is the highest common factor of 111 and 5814957? 111 Calculate the greatest common divisor of 5020309 and 146771. 463 What is the greatest common factor of 483012 and 5841? 9 Calculate the highest common factor of 64213 and 618423. 157 Calculate the greatest common factor of 28925 and 417950. 325 Calculate the greatest common divisor of 36546760 and 80. 40 What is the highest common factor of 312275 and 38450? 25 Calculate the greatest common divisor of 112 and 6921166. 14 Calculate the highest common factor of 2078265472 and 128. 128 What is the greatest common factor of 1762484388 and 644? 644 Calculate the highest common divisor of 40 and 781856. 8 Calculate the greatest common divisor of 69417558 and 35070. 7014 What is the greatest common factor of 5040 and 521073? 63 Calculate the highest common factor of 1231 and 293. 1 Calculate the greatest common divisor of 3942 and 14692345. 73 What is the highest common divisor of 715 and 2741794? 11 Calculate the greatest common divisor of 47474264 and 223096. 2824 What is the highest common factor of 10985951 and 24987? 8329 Calculate the highest common divisor of 26221767 and 858. 429 What is the highest common divisor of 5136 and 926192? 1712 What is the greatest common divisor of 15249 and 16107? 39 Calculate the greatest common divisor of 5837240 and 3480. 40 Calculate the greatest common factor of 12882 and 49708926. 678 What is the highest common divisor of 76792779 and 9352? 1169 What is the greatest common factor of 114 and 1377462? 114 What is the highest common divisor of 16354982 and 1148? 574 What is the greatest common factor of 780646 and 314? 2 What is the highest common divisor of 2011046 and 99992? 862 What is the greatest common divisor of 1207566902 and 58? 58 Calculate the greatest common divisor of 16118 and 166410291. 8059 What is the greatest common factor of 924 and 10795246? 154 Calculate the highest common factor of 147900 and 4764. 12 What is the greatest common factor of 1506848 and 42336? 1568 Calculate the highest common factor of 5370 and 44229110. 1790 Calculate the highest common divisor of 351050 and 694960. 1190 Calculate the greatest common factor of 12580172 and 4092. 1364 What is the greatest common factor of 152 and 787211192? 152 What is the highest common divisor of 274138073 and 957? 319 Calculate the greatest common factor of 5251081 and 74041. 583 Calculate the greatest common factor of 23727 and 2177901. 33 Calculate the greatest common divisor of 1353 and 28601067. 1353 Calculate the greatest common divisor of 375 and 3095550. 75 What is the greatest common divisor of 106690580 and 51021? 5669 What is the highest common divisor of 434015520 and 288? 96 What is the greatest common factor of 24389055 and 315? 45 What is the highest common factor of 20 and 135562730? 10 Calculate the greatest common divisor of 1416 and 155016. 24 Calculate the greatest common divisor of 20774 and 1047982. 442 Calculate the highest common divisor of 336 and 266196. 84 What is the greatest common factor of 2015318238 and 387? 129 Calculate the highest common divisor of 1666 and 39948538. 238 What is the greatest common factor of 4959236 and 1177? 107 Calculate the greatest common divisor of 27683040 and 214. 214 What is the highest common factor of 44 and 21074548? 44 Calculate the highest common factor of 7 and 1654625. 7 Calculate the highest common factor of 641388 and 1569414. 2838 Calculate the highest common divisor of 1070 and 65266576. 214 Calculate the greatest common divisor of 69614272 and 16. 16 What is the highest common divisor of 89251628 and 652? 652 What is the greatest common factor of 559 and 10011131? 559 What is the greatest common divisor of 7232 and 1584712? 904 What is the highest common divisor of 1985 and 164096377? 397 What is the greatest common divisor of 196900 and 11139528? 716 Calculate the highest common divisor of 2315760 and 15690. 30 What is the highest common factor of 300 and 512112? 12 What is the highest common divisor of 111741451 and 3838? 1919 Calculate the highest common divisor of 62421255 and 2535. 195 What is the highest common divisor of 278333157 and 477? 159 Calculate the greatest common divisor of 5407978 and 58. 58 What is the highest common factor of 216632925 and 258? 129 Calculate the highest common factor of 122865 and 17295. 15 What is the highest common factor of 136110 and 2770170? 390 What is the highest common divisor of 1146 and 22305935? 191 What is the greatest common factor of 114390 and 1885590? 3690 What is the greatest common factor of 1512675 and 10790? 415 What is the greatest common factor of 6616 and 2272? 8 Calcula	{ "pile_set_name": "DM Mathematics" }
l + 2l. What is rz(b) - 4i(b)? b3 Let n(r) = 2 + 2 + 5 - 18 + 4r. Let k = 3 - 1. Let o(u) = -u + 2. Calculate kn(g) + 9o(g). -g Let b(w) = 2w2 - 5w - 2. Let s(f) be the second derivative of f4/6 - f3 - f*2 - 5f. Suppose 3l = o + 10, 14 = -2o + 5l - 1. Give ob(a) - 4s(a). 2a*2 - a - 2 Let r(h) = -7h*2 - 5. Let s(p) = -3p*2 - 2. What is 2r(a) - 5s(a)? a2 Let h be (2/3)/((-2)/6). Let b(r) = -67r + 1 - 1 - 63r + 135r. Let j(v) = -v. Determine hb(p) - 11j(p). p Let w(g) = 71g2 + 2g + 2. Let x(z) = -4048z2 - 115z - 115. What is -115w(t) - 2x(t)? -69t2 Let x(t) = -9t*3 + 3t*2 + 3t. Let g(h) = -9h3 + 2h*2 + 2h. Calculate 9g(m) - 6x(m). -27m3 Let c(a) = 7a + 5. Let d(y) = 6y + 4. Calculate 5c(k) - 6d(k). -k + 1 Let g(f) = -f3 + f - 1. Let o(m) = 2m*3 + 6m*3 - 2m - m*3 - 5m + 3. What is -6g(k) - o(k)? -k3 + k + 3 Suppose 0 = -4q + 8q + 52. Let y = q + 9. Let x(s) be the second derivative of -s3/3 - s. Let c(l) = -2l. What is yx(n) + 5c(n)? -2n Let k(s) be the first derivative of -s4/2 + s3 + 3. Let z(p) = 3p*3 - 5p*2 - 1. Determine -5k(n) - 3z(n). n3 + 3 Let c(p) = -3p + 6. Suppose -2d + 16 = -0d. Let z = d + -5. Let q(y) = -1 - 3 - z + 0 + 4y. Determine 5c(v) + 4q(v). v + 2 Let b(o) = 51o. Let f(z) = 5z + 142 + 137 - 279. What is -2b(d) + 21f(d)? 3d Let f(n) = 35n2 + n - 2. Let w be f(1). Let v(b) = 10b. Let i(p) = -p. Let z(c) = -36i(c) - 4v(c). Let m(k) = -23k. What is wz(o) - 6m(o)? 2o Let g = 10 + -7. Let a(b) = b*2 - b - 1. Let j(l) be the first derivative of -2l*3/3 + 3l*2/2 + 3l + 15. Calculate ga(m) + j(m). m2 Let i(m) = 4m*3 - 6m*2 - 5m. Let f(n) = -5n3 + 7n*2 + 6n. Let k be ((-10)/2)/(0 + -1). What is kf(z) + 6i(z)? -z3 - z2 Suppose 0 = 2u - 43 + 31. Let z(l) = 3l*2 - 6l + 2. Let r(a) = 4a2 - 7a + 2. Calculate ur(c) - 7z(c). 3c2 - 2 Let o(c) = 5c2 + 2. Let f(v) = v2 + v. Determine -f(m) + o(m). 4m2 - m + 2 Let z(v) = v3 + v2 - 1. Let s be (-4)/6 - (-1)/(-3). Let f be 2(15/(-10) + 1). Let o(a) = -a*2 + 2a + 3. Determine fz(t) + so(t). -t*3 - 2t - 2 Let j(q) = -8q - 1. Let z(h) = -h - 1. Calculate j(s) - 3z(s). -5s + 2 Let s(g) = 6g*3 + 9g*2 + 5g. Let y(l) = 3l3 + 5l*2 + 3l. Determine -4s(k) + 7y(k). -3k3 - k2 + k Let t(i) = -2i*2 - 3. Let l(g) = 3g*2 + 6. What is -4l(q) - 7t(q)? 2q*2 - 3 Let c(h) = 4h*3 - 9h*2 + 10. Let d(m) = -2m*3 + 4m*2 - 5. Determine 4c(i) + 9d(i). -2i*3 - 5 Let d(z) = 5z. Let j(r) = -6r. Give 5d(o) + 4j(o). o Suppose -2x + 14 = 5h, x + 0h + 11 = 2h. Let j(q) be the first derivative of q3/3 - q2/2 + 1. Let t(u) = -u2 + 2u. Calculate xt(i) - 4j(i). -i*2 - 2i Let w(y) be the first derivative of 3y2/2 - 2. Let q(m) = m. Calculate 6q(p) - w(p). 3p Let s(a) = -59a - 2 + 59a + a2. Let n(q) = q2 - 3. What is 2n(z) - 3s(z)? -z2 Let o(q) = q - 7q*2 + 4q*2 + 4q - 4q. Let y be -1 - (3 + 1) - -2. Let g(r) = -4r*2 + 2r + 1. Give yo(d) + 2g(d). d*2 + d + 2 Let x(v) = -7v*3 + 2v*2 + 2v - 2. Let o(c) = 15c3 - 5c*2 - 5c + 5. Give 6o(f) + 15x(f). -15f3 Suppose 4h + 24 = 3r - 0r, r = 3h + 13. Let o(n) = -4. Let c(v) = v + 4. Calculate ro(z) + 4c(z). 4z Let z(p) = 2p + 2. Suppose -3v + 5v - 4f = 4, 0 = v + 3f + 13. Let r(b) = -2b - 2. Calculate vr(a) - 5z(a). -2a - 2 Let x(p) = 24p*2 - 15p + 24. Let f(y) = y*2 - y + 1. Let o(t) = -18f(t) + x(t). Let v(m) = -13m2 - 7m - 13. Determine -9o(q) - 4v(q). -2q2 + q - 2 Let p(v) = 25v*3 + 5v*2 - 2v + 5. Let f(b) = 74b3 + 16b*2 - 6b + 16. Calculate -5f(d) + 16p(d). 30d3 - 2d Let n(j) = j + 8. Let z(i) = 4i + 24. Give -7n(c) + 2z(c). c - 8 Let p(x) = -2x + 6. Let l(y) be the third derivative of -y*4/12 + 5y*3/6 + 42y*2. Suppose -2g = -0g + 6. Give gp(w) + 4l(w). -2w + 2 Let p(y) = 2y2. Suppose 0 = -5z + 4l - 3, 11 + 0 = 5z + 3l. Let i(u) = 3 + 0 + u2 - 3. What is zp(b) - 4i(b)? -2b*2 Let l(y) = y - 1. Let j(m) = -2m - 1. Give j(r) - 2l(r). -4r + 1 Let y(t) = -4t. Let m(f) = -11f + 31 - 18 - 13. Give 3m(u) - 8y(u). -u Let z(h) = -h*3 + h - 1. Suppose 4n - 5 = -29. Let k(g) = 5g3 - 6g + 6. What is nz(r) - k(r)? r3 Let r = -31 + 32. Let t(n) = -n. Let i(a) = 3a - 2. What is ri(m) + 5t(m)? -2m - 2 Let i(f) = 198f*3 + 45. Let l(h) = -9h*3 - 2. Determine 2i(o) + 45l(o). -9o*3 Let r(z) = -8z*3 - 6z*2 - z - 8. Let u(h) = -15h*3 - 11h*2 - 2h - 15. What is -11r(q) + 6u(q)? -2q3 - q - 2 Let r(m) = -m - 1. Suppose -4q - 10 + 0 = 3f, 2q - f = -10. Let a(p) be the second derivative of p*3 + 3p*2 - 2p. Determine qr(u) - a(u). -2u - 2 Let p(b) = -9b2 + 11b - 11. Let h(c) = 0c2 + 4 - 4c + c*2 + 2c*2. Let m(r) = -6r + 19. Let s be m(5). What is sh(o) - 4p(o)? 3o2 Let n(t) = -3t + 1. Suppose -1 = -4k - 9. Let y = 6 - 7. Let g be (y1)/(1/9). Let q(j) = 13j - 4. What is gn(b) + kq(b)? b - 1 Suppose 0f + 2j = -4f + 6, -3f + 5j = -11. Let x(w) = 3w2 + 3w - 1. Let b(t) = 10t2 + 10t - 3. Suppose 21 = -0c - 3c. Determine cx(g) + fb(g). -g*2 - g + 1 Let m(p) = -5p*3 + 6p*2 + 6p + 4. Suppose -j = 2 - 4. Let d(s) = 0 - 5sj + 5s*2 + 4s*3 - 5s - 3 - 5s2. Determine -4d(o) - 3m(o). -o3 + 2o*2 + 2o Let w(a) = 4a2 + 6a - 9. Let g(u) = 2 - 2u2 - 2 - 3u + 3 + 1. Determine 5g(v) + 2w(v). -2v2 - 3v + 2 Let r(q) = 390q2 - 91. Let j(c) = -13c*2 + 3. Determine 182j(k) + 6r(k). -26k*2 Let a(i) = -2i + 81 - 38 - 40. Let b(h) = -4h + 7. Calculate -9a(p) + 4b(p). 2p + 1 Let m(w) = -3w + 5. Let j(i) = 2i - 3. Determine -7j(z) - 4m(z). -2z + 1 Let f(x) = -5x + 7. Let r(k) = 6k - 6. Give 5f(i) + 6r(i). 11i - 1 Let i(q) = 8q3 - 9q + 10. Let w(l) = -l3 + l - 1. Let y(g) = -g3 - 12g2 - 11g - 2. Let c be y(-11). Give ci(b) - 18w(b). 2b3 - 2 Let c(o) = -10o - 4. Let u(k) = 11k + 5. Let q(i) = 7c(i) + 6u(i). Let f(j) be the third derivative of j4/24 - j3/6 + j2. What is 2f(l) + q(l)? -2l Let x(u) be the third derivative of u4/24 - 55u*2. Let n(w) = -3w - 1. What is -n(f) - 2x(f)? f + 1 Suppose -5w - 3l = -0 + 15, 4w + 3l = -9. Let s(j) = -4j - 1. Let u(m) = m - 5. Let d(y) = y - 6. Let n(b) = -5d(b) + 6u(b). Calculate wn(x) - s(x). -2x + 1 Let p(k) = 7k2 - 3k + 3k2 + k2 + 7. Let v(q) = q3 + q. Let c be v(1). Let b(a) = -2a*2 - 4 - 9a*2 - 7a*2 + 12a*2 + ca. Give 7b(h) + 4p(h). 2h2 + 2h Let d(b) = -2b2 - 2b - 3. Let t(w) = -8w2 - 8w - 13. What is 9d(k) - 2t(k)? -2k2 - 2k - 1 Let r(w) = 14w + 4. Let z(o) = -28o - 7. What is -7r(u) - 4z(u)? 14u Let j(c) = 15c - 12. Let b(z) = -z + 1. Suppose -3 = 3a - 2q, 2a - 6a + 2q - 2 = 0. Calculate aj(g) + 12b(g). 3g Let s(j) = -10j3 + 22j*2 - 8j - 22. Let y(o) = -4o3 + 9o*2 - 3o - 9. Calculate 5s(d) - 12y(d). -2d3 + 2d*2 - 4d - 2 Let j(x) = x*2 - 4x + 2. Let w be j(3). Let h(d) = -1 - 4d + 14d - 9d. Let l(f) = 3f - 6. Give wl(z) + 5h(z). 2z + 1 Suppose 0 = 3w + z + 10, -5w + 4w - z - 2 = 0. Let u(h) = 2h2 + 4h + 4. Let r(y) = y3 - y2 - y - 1. Determine wr(b) - u(b). -4b*3 + 2b*2 Let x(c) = c + 2c2 + c2 - 1 - 2c2. Suppose 2k - 5 - 15 = 0. Let m(j) = 12j2 + 10j - 10. Calculate kx(b) - m(b). -2b*2 Let w(x) = -4x*2 - x + 2. Let d(g) = -4g*2 + 2. Calculate -2d(j) + 3w(j). -4j*2 - 3j + 2 Let q(y) be the first derivative of 5y2/2 + 3y - 2. Let i = 8 - 15. Let g(h) = 6h + 3. Give iq(x) + 6g(x). x - 3 Let b(j) = -17j*3 - 11j*2 - 17j - 11. Let d(y) = -9y3 - 6y*2 - 9y - 6. What is 6b(q) - 11d(q)? -3q3 - 3q Let f = -6 + 7. Suppose 3i - z = 2i - f, i + 7 = 3z. Let k(v) = -6v*2 + 11v + 10. Let w(d) = d*2 - 2d - 2. Give ik(x) + 11w(x). -x*2 - 2 Let w(n) = -15n*3 - 2n*2 + 2n. Let h(r) = r3 - r2 + r. Calculate -2h(p) + w(p). -17p3 Let i(f) be the first derivative of -f2 + 4f + 3. Let b(n) be the first derivative of n - 7. Let r be (1/(-2))/((-2)/4). Determine ri(l) - 4b(l). -2l Let x(v) be the second derivative of	{ "pile_set_name": "DM Mathematics" }
and c. 30 Find the common denominator of (-2)/(-12)1551/110 and 47/18. 180 Let w be 13291283133/(-7888470) - (-6)/4. Let u = w + 1/262949. Let a = u + 1677. Calculate the common denominator of 32/11 and a. 55 Let o(w) = w2 + 6w + 2. Suppose 41 = 3n + 4y, 3y + 4 = 4n - 9. What is the lowest common multiple of n and o(-7)? 63 Let v(r) = 3r2 + r - 1. Suppose -2f + 7f - 10 = 0. Let n be f/2 - 3 - 0. Calculate the lowest common multiple of v(n) and 9. 9 What is the common denominator of ((-2)/(-45))/(6/780) and 125/12? 36 Suppose 0 = 5h + 5 - 35. Calculate the lowest common multiple of 15 and h. 30 Suppose -5r = 2p - 8 - 1, p - r + 6 = 0. Let a(f) = -f*3 - 8f*2 - 8f + 9. Calculate the smallest common multiple of a(-7) and 17 + 0/(-3) + p. 112 Let n = -5 + 9. Find the common denominator of (n - 5) + 34/8 and 1/4 + 71/6. 12 Calculate the common denominator of (-3)/27 - (-4745)/1800 and -95/4. 40 Suppose 2 - 10 = -2w. Let i(k) = 2k - 4. Let t(a) = -3a + 4. Let p(b) = -4i(b) - 3t(b). What is the least common multiple of p(7) and w? 44 Suppose -20 = -5z + z. Let r be (2 - -2) + -21. Suppose 0l - 3b - 5 = rl, -4b = 20. Calculate the smallest common multiple of l and z. 5 Let s = 27 + -20. Calculate the least common multiple of 3 and s. 21 Suppose 2c + 2b - 11 = -3b, 4c = 4b + 8. Calculate the smallest common multiple of c and 9. 9 Let m = 2857 + -88552/31. Let z = -1064/341 + m. Find the common denominator of 25/6 and z. 66 Let f = -116561/20 + 5823. Find the common denominator of 21/10 and f. 20 Let x(h) = -h*2. Let g be x(0). Suppose -5t + 0t + 90 = g. Calculate the smallest common multiple of 4 and t. 36 Suppose 3h - 42 = -3q + 6, 0 = -4q + 16. Let w = h + -8. What is the lowest common multiple of 14/33/2 and w? 28 Let k = 76091/4422 + -30/737. Find the common denominator of (-254)/36 + (-6)/(-9) and k. 18 Suppose 3o - y + 9 = 48, y = 5o - 65. Suppose 3i - 5 - o = 0. Calculate the least common multiple of 1 and i. 6 Let j be (2 + -3)/((-2)/4). Suppose -21942 = -jc + 7c + i, -4c - 17560 = 4i. Let h = c + 52691/12. Find the common denominator of h and -151/18. 36 Let o = -109 - -127. Calculate the lowest common multiple of o and 22. 198 Let z(t) = t*2 + 2t + 7. What is the least common multiple of z(-3) and 9? 90 Let t(f) = f. Let k be t(-1). Find the common denominator of (-7)/(-5) + (-1)/k and -27/11. 55 Let x = 8263/3048 + 42/127. Find the common denominator of x and -131/30. 120 Let o be ((-5)/(-3) - 1)12. Calculate the common denominator of (50/28)/((-4)/16) and (-2)/o - 161/44. 77 Suppose -d = -h + 19, h + 82 = 5h + 2d. Calculate the lowest common multiple of 12 and h. 60 Suppose -3 = -i + 5g, -2g = i + 5 - 1. Suppose 4h - q = 73, -4h - 5q = -h - 49. Let w = h + i. What is the lowest common multiple of 22 and w? 176 Suppose 0s - 2r = 3s - 5, 14 = 4s - r. What is the least common multiple of 8 and s? 24 Suppose -1992 = -4w + 8w. Let v be (-6)/(-4)(-5950)/18. Let o = v - w. Find the common denominator of -85/4 and o. 12 Find the common denominator of -4 - (4521/36)/(-11) and 101/2. 12 Let r = -52 - -63. Suppose 2i + 11 = 5y, 14 = 2i + 2i + 2y. Calculate the lowest common multiple of r and 0/i + -1 - -4. 33 Find the common denominator of -125/6 and (78/(-15))/((-84)/75). 42 Let g = -3/59 + 2139/295. Calculate the common denominator of g and 0 + 3 + (-8)/11. 55 Let g = -7 - -5. Suppose 5o - 3 = 67. Calculate the lowest common multiple of -2(g + 1) - -12 and o. 14 Let i(x) = 2x2 - 12x - 20. Let q(w) = w*2 - 4w - 7. Let v(p) = -5i(p) + 14q(p). What is the smallest common multiple of v(-2) and 12? 60 Let z(o) = -410o - 3. Let d be z(5). Let t = 24655/12 + d. Let p = 328093/20 - 16400. What is the common denominator of p and t? 60 Let i = 59488 + -3807307/64. What is the common denominator of 71/28 and i? 448 Suppose -y + 697 + 366 = 0. Suppose 3z + 4b = -799, 5z + 3b + y = z. What is the lowest common multiple of 6/8 - z/20 and 10? 70 Suppose 0w + 2w = -k + 65, 4k - 167 = -5w. Calculate the common denominator of 34/9 and w. 9 What is the least common multiple of (-10)/75-6120/1 and 18? 288 Let t = -430/9 + 3575/72. Let v = 14/45 + -1603/90. Find the common denominator of t and v. 8 Let p be 18(1 + 32/12). Let v = p - 40. Calculate the least common multiple of 18 and v. 234 Let m be 2107 - 4/4-2. What is the common denominator of -89/14 and m/(-234) - (-2)/(-13)? 42 Suppose -m + 26 = 23. What is the smallest common multiple of 3 and m? 3 Let f = -459 + 4631/10. Find the common denominator of f and -46/3. 30 Suppose -w - 5b - 161 = -10b, 3w = 2b - 496. Let a = -96307/14 + 6875. Calculate the common denominator of a and ((-19)/(-20) - 1)w. 70 Calculate the least common multiple of 18 and 2201/12 + (-6)/4. 288 Let y be (7 + -12)28/5. Let t = y - -33. Calculate the lowest common multiple of t and 4/14 - (-52)/14. 20 Let j = -194520760785359/3465 - -56138748430. Let u = -137/693 + j. Let i = u - 50683/70. Calculate the common denominator of i and 73/20. 140 Let z = -4 - -6. Let y = -2 + 8. Calculate the smallest common multiple of y and z. 6 Suppose 4p - 2p = 0. Suppose 2z + 0z = -4. Calculate the common denominator of -13/9 and 1(z + -24) + p. 9 Let a = 5427 - 86793/16. What is the common denominator of 97/62 and a? 496 Let t be 7/((-35)/(-96))-5. What is the smallest common multiple of (26/4 + -1)4 and (2/4)/((-4)/t)? 132 Suppose -2i + 0 = 2c - 2, 4i - 28 = 2c. Suppose -iv + 2v + 27 = 0. What is the smallest common multiple of 10 and v? 90 Let g = 26458 - 187212/7. Let h = g - -18278/63. Let d = -1189 + 2333/2. Find the common denominator of d and h. 18 Let t(c) = -c3 + 4c*2. Let f be t(4). Let u = 3 + f. Suppose 0p - 3p - 3 = 2q, -3q + u = 3p. What is the lowest common multiple of q and 8? 24 Suppose -3o + 46 - 19 = 0. Calculate the least common multiple of 16 and o. 144 Let n = 12 - 3. What is the smallest common multiple of n and 9? 9 Let b(s) = s2 + 4s - 5. Let y be b(-4). Let g be 5/y - (4 - 1). What is the common denominator of -41/12 and 2/g + (-10)/(-32)? 48 Let v = 4 - 2. Suppose 4c + 3n - 34 = 0, vn = c - 5 + 2. Calculate the smallest common multiple of c and 6. 42 Let p(q) = q2 + 10q + 20. What is the least common multiple of p(-8) and 1? 4 Suppose 0 = 4w - 603 - 1929. Let k = w + -1305/2. Calculate the common denominator of k and 5/8. 8 Let p = -35 + 86. Calculate the common denominator of (-18)/3037/2 and 3/(-6) - p/(-5). 10 Let j = -187/120 + 11/24. What is the common denominator of (-209)/18 + 2 + 3 + -1 and j? 90 Suppose 5y - 24 = 2y. Suppose -6p = -12p + 120. What is the least common multiple of y and p? 40 Let t = 18 + 54. What is the smallest common multiple of 7 and t? 504 Calculate the lowest common multiple of 24 and (-4)/30 - (-184)/30. 24 Calculate the smallest common multiple of 1 + 2 + 12 + -1 and 22. 154 Suppose 2n - 10 = -0n - 2s, 2n - 4s = 10. Calculate the smallest common multiple of 8 and n. 40 What is the common denominator of 6/10 + (-1098)/380 and -23/22? 418 Suppose -4y + 3f = -33, -2y = 3y + 4f - 18. What is the least common multiple of 2 and y? 6 Let v = 155691/22 - 7080. Let z = -22903455/92 + 248954. Let y = 15/23 - z. What is the common denominator of y and v? 44 Let i be 7/(2 - (-9)/(-6)). Let c = -5161 + 31087/6. What is the common denominator of c and (10/(-12))/(1/i)? 6 What is the common denominator of 57/22 and (174/6)/(1 - -7)? 88 Suppose 0 = -3p - 6 + 30. Suppose -c + 3x = x - 17, 30 = 3c + x. Calculate the smallest common multiple of p and c. 88 Let b = -4 + 12. Let j(h) = -h3 - 13h*2 + 14h + 10. What is the lowest common multiple of b and j(-14)? 40 Suppose -34 = -2p + 2x, -5p - 5x + 55 = -0x. Let m(k) = -k3 + k + 2. Let y be m(0). Suppose 4c - 8 = yc. What is the least common multiple of c and p? 28 Suppose 3o + 14 = 2x, -2o - o - 8 = 4x. Let n = 3 - x. What is the smallest common multiple of 2 and n? 2 What is the common denominator of -31/98 and ((-426)/(-144))/((6/8)/(-1))? 882 Let a(s) = 15s - 16s + 2 + 6. Let q be a(7). What is the least common multiple of 5 + 0/q + 1 and 18? 18 Let k be (4 + -7)/(2/2). Let w(f) = 6f**2 + f + 3	{ "pile_set_name": "DM Mathematics" }
)(-154w*2 - 3w*3 + 154w*2). -6w*5 Expand 19v*3 - 5v*3 + 13v*3 + (-1 + v + 1)(2v2 - 2v*2 - 2v*2). 25v*3 Expand (1 + j - 1)(2j3 + 2j + 2j - 2j). 2j4 + 2j*2 Expand (-3 + 5 - 4 + 1 - 3 + 1 + (-4 + 4 + 1)(-2 + 0 + 0))(0 + 2 - 1)(11 + 3b - 11). -15b Expand (2 - v*2 - 2 + (-1 + 2v + 1)(4v - v - v) - v + v + 2v2)(94 - 16v - 94). -80v*3 Expand (2k + k - 4k + 3 + k - 3 + (2 - 2k - 2)(3 - 6 + 2) + 0k - 3k + 4k - k + k + 2k)(-169k - 3k*3 + 2k*2 + 169k). -15k4 + 10k3 Expand -a5 - 6a5 - a5 + (-4a*2 + 2a*2 + 0a*2)(-2 + 2 + 2a3) - 3a - 2a5 + 3a - 3a5 + a5 + a5. -15a*5 Expand (0i3 - i3 - i*3)(2i - i - 2i) + (-2 - 1 + 5)(4i*4 + 7i*2 - 7i2) + (i2 - 2 + 2)(2i*2 - i + i). 12i*4 Expand (-13r - 10 + 10)(2 + 0 + 0)(2r - 6r + 2r + (0 + 0 + 2r)(-3 + 1 + 0)). 156r2 Expand (u2 + 2u2 - u2)(0u + 0u + u + 3 - 3 + u + (2 + 2u - 2)(3 - 3 - 2) + 2u - u - 2u). -6u3 Expand 2v*5 + 1 - 1 + (-8v*2 + 8v*2 + 13v*3)(-1 - 2v2 + 1). -24v*5 Expand ((2 + 5 - 1)(3 - 2 + 3) + 2 + 0 - 1)(2u - u*2 - 2u). -25u2 Expand 2z*5 - 2z5 + z5 + (5z5 - 2z*5 - 2z*5)(-3 + 6 - 2) + z*5 - 4z + 4z + 3z*4 + 4z5 + z5 - 5z4. 8z*5 - 2z*4 Expand (-4 + 4 - 2l)(-3l*4 - 8l*4 + 3l*4). 16l*5 Expand (1 + 4 + 2)(-4y + 3 + 1 - 3). -28y + 7 Expand (r + 4r3 + r - 3r*3)(-5r2 + 7r - 7r). -5r*5 - 10r3 Expand (v4 + v*4 + 0v*4)(-1 - 4 - 2)(2 - 5 + 1) + 2v*4 - 3v*4 + 2v*4. 29v*4 Expand (4a3 + a3 - 4a3)(2 - 7 - 4 + (2 - 2 - 1)(4 + 3 - 6)). -10a*3 Expand (-1 + 0 - 1)(2 + 2p - 2) - 2p + 2p - 2p + (-1 + 2 - 2)(-2p - 2p + 3p) - p + 2p + 0p. -4p Expand 7o5 - o5 - 2o5 + 5o*5 - 4o*5 - 3o*5 + (2 + 2 - 3)(0o3 + 0o3 + o5) - o*5 - 2 + 2o5 + o5. 5o5 - 2 Expand (-2h*2 + 2h*2 + 3h*2)((-4 + 4 + 1)(3h - h - 4h) + 1 - h - 1 + (4 - 2 - 5)(h + 0h + 0h)). -18h3 Expand (a - a - a3)(22a + 735 - 735). -22a*4 Expand (-17o*4 + 4o*4 - 10o*5 + 14o*4)(2 + 2 - 3). -10o5 + o4 Expand -4h*5 + 3h*3 + 3h5 + h3 + (h*5 - 4h5 + h5)(0 + 3 - 2) - 2h*5 + 2h5 - h5 - 3h5 + h5 + 0h*5 - 2h*5 - 3h*5 + 3h*5. -8h*5 + 4h*3 Expand ((4u - u - 2u)(5 - 3 - 1) + 6u - 2u - 3u)(-2 + 1 - 1)(-14u*4 - 317u*3 + 317u*3). 56u*5 Expand (-2 + j + 2)(43 - 25 - 17). j Expand (-f*4 + 0f*4 + 3f*4)(6 - 23 + 11). -12f4 Expand -2x*5 - 3x + 3x + (-x + 4x - 2x)(-3x4 - x4 + 2x*4) - 2x5 + x5 - x*5 - 71x*3 - 69x*5 + 8x*5 + 69x*3. -67x*5 - 2x*3 Expand ((-2f + 6f - 2f)(1 + 0 + 1) + 5f - 5f + 5f)(4f + 2f - 4f). 18f2 Expand (-3 + 3 - 2m - 2 + (-1 - 4 + 3)(0m + m + m) - 4m + 2m + 0m)(-4m + 2m + 8m). -48m*2 - 12m Expand -3y + 7y - 3y + (2 + y - 2)(-2 + 0 + 0) - 53y + 20y + 19y. -15y Expand (-b*2 + 3b*2 - 3b*2)(-2 - 4 + 2). 4b2 Expand (2c + 3c - 3c)(5 + 1 + 3) + 4c - 2c - c + (c - 2c - 2c)(3 - 5 + 4). 13c Expand 3t4 - t3 + t*3 + (8t - t - 3t)(5t - 3t - t)(t2 + 3t*2 - 5t2). -t4 Expand 4h2 + 5h*2 + 8h*2 + (-h + 2h + h)(0h + 2h + 0h). 21h2 Expand 8h + 16h - 2 + 8h - 2 + 2 - h + (3h - 3h - h)(1 + 4 - 4). 30h - 2 Expand -3w3 + 4 - 4 + (-2w - 2w + 6w)(-2w*2 - 3w2 - w2) - 1 + 2w3 + 1 - 2w*3 - 3w*2 + 3w*2 + (7w*2 - 3w*2 - 3w*2)(-w - w + 0w). -17w*3 Expand -4j - 3j - 3j + 2j + 3j - 4j - j + 0j + 3j + 3j - 6j + j + (-2 + 1 + 0)(-2j - 2j + 3j) - 3j + 3j - 2j - j + 0 + 0. -11j Expand (0f - 2f + 3f)(-1 - 8 - 2). -11f Expand (-3h - 2h + 7h)(-2 + 3 - 3) + 0h + 0h - h + 0h - 2h + 3h - 3 + 17h - 7h - 5h. h - 3 Expand 3b2 + 0b*2 - 5b*2 + (0b + 0b + 2b)(b - b - b). -4b*2 Expand (-6u + 11u + 2u)(3u*3 - 3u3 - u3) + (-u + 0u - u)(-3u3 + u3 + 0u*3). -3u*4 Expand (4u + 3u - 5u)((2u - 2u - u)(-5u + 2u + u) + u*2 - 4u*2 - 2u*2) - 78u*2 + 78u*2 + 16u*3. 10u*3 Expand (-4 - m + 4)(-m - m + 0m) + (-m - 3m + 0m)(6m - m - 2m). -10m2 Expand (22h*2 + 57h*2 - 11h*2)(-4 + 5 - 3)(-1 + 2h*3 + 1). -272h*5 Expand (1 - 3 + 3)(-k + k + 2k) - k - 3 + 3k - 3k. k - 3 Expand (-d - d + 4d)(-2d + d - 4d). -10d*2 Expand (-1 + 1 + 4)(2 - 2 - 1)(1 - 1 + b) - b + b + 2b. -2b Expand (-126b + 25 - 47 + 22)(b + 0b - 2b). 126b*2 Expand (2y + y*2 - 3y + 0y)(y - y - 3y) - 3y2 - y3 + 3y2 + (0y - 2y + 0y)(2y*2 + 0 + 0) + 2y*3 - 4y*3 + 4y*3. -6y*3 + 3y*2 Expand (-5y - 2y + 5y)(3y + 3y - 3y) + (3y + y - 3y)(2y + y - 4y). -7y*2 Expand (-2t - 2 + 2)(-4t + 0t - 25t). 58t2 Expand (4 - 2 - 5)(14 - 31 + 11)(-3 + 3 - p4). -18p*4 Expand (2l + 2l - 8l)(-l - 3l + 3l - 2l*2). 8l*3 + 4l*2 Expand (-r + 0r + 2r)(5 - 5 - 4r). -4r*2 Expand (2m + 2m - m - m3)(0m + 0m - 14m). 14m*4 - 42m*2 Expand 0r5 + r2 + 2r5 - 2r2 - r5 - 4r5 + 3r*5 + (-2r2 + r5 + 2r2)(0 + 2 + 2) + 5r5 - r5 - 3r*5. 5r5 - r2 Expand -123p + 5 + 237p - 5 + (-2 + 3 + 0)(1 + 2p - 1) + 1 + 2p - 1 - 4p - 3p + 6p - 2p - 2p + 3p. 116p Expand -5n5 - 2n*5 + 3n*5 + (-3n2 - n2 + 3n2)(-4n2 - n3 + 4n*2). -3n*5 Expand (3 - 1 - 1)(0 + 0 - 1)(0 - 1 + 5)(-s - 3 + 3). 4s Expand (-s3 - 3 + 3)(2s2 + 1 - 1) + 22s*5 + 2 - 4 - 19s5. s5 - 2 Expand (-2t2 + 2t2 + t2)(3t3 - t3 - 4t3) - 6t5 - t4 + 3t4 + 4t*5. -4t*5 + 2t*4 Expand (c + c + 0c)(12c + 7c - 16c). 6c2 Expand (-f4 - 14f*4 + 3f*4)(2f + 0f + 0f). -24f*5 Expand (39p - 21p + 4 - 21p)(-2 + 2 - 2p). 6p2 - 8p Expand (3z - 4z + 3z)((0z + 3z + z)(-2z - z + z) + (-7z + 2z + 3z)(-4z + 2z - z)). -4z3 Expand (-2 + 2 - 2t*2)(2t + t2 - 2t) - 2t3 + 2t*3 - 6t*4. -8t*4 Expand (6 - 13 + 7g + 5)(1 + 4 + 0). 35g - 10 Expand (6h4 - h4 - h4)(5 + 0 - 3) + h*4 - 4h*4 + 6h*4 - 4h*4 + 2h*4 + 3h*4 + (3h - h + 0h)(-3h3 + 3h*3 + 2h*3). 16h*4 Expand (-5i - 7i + 3i)(-1 + 1 - 1) + 3i - i + 0i + (i + i + 0i)(-1 + 2 - 2). 9i Expand -2q4 - 4 + 4 + (-1 - 2q + 1)(-q3 + 0q*3 + 3q*3) - 6q*4 - 6q*4 + 9q*4. -9q*4 Expand (4f*3 + 0f*3 - 2f*3)(2f2 - 2f2 + f2)(2 + 6 + 0). 16f*5 Expand 4g*2 - 11g*2 + 4g*2 + (2g - 3g + 0g)(-2g - 3g + 4g). -2g2 Expand -4w*2 + 4w*2 + 2w2 - 3 + 3 + w2 + (w - w - w)(1 + 2w - 1) + (-2w + 0 + 0)(0 + 0 - 2w). 5w*2 Expand -8g*3 - 2g*3 + 7g*3 + (-4g3 + g3 + 2g3)(3 + 0 - 4). -2g3 Expand (-3w*4 - 4w*4 + 4w*4)(5w + w - 11w + 3w - w - 3w + (1 - 5 + 3)(0w + 0w - w) - 3w + 2w + 2w). 12w5 Expand (-16t - 35 + 35)(2 - 2t*3 - 2) + (-3t2 + t2 + 4t2)(3t2 - 2t*2 + 0t*2). 34t*4 Expand (-3 - 1 + 8)(16i - 3i - 4 + 3). 52i - 4 Expand (-1 + 0 + 5)(0 + 1 - 2 - 6 + 4 + 1 + (2 - 5 + 2)(2 - 5 + 2))(-3n + 0n + n)(3n*4 - 4n4 - n4). -16n5 Expand (9 + 8 - 3)(-2k4 + 2k4 - k5 - 4k5 + k5 + 2k*5 + (-2k*2 + k - k)(2k3 + k - k)). -84k*5 Expand (6 + 17 - 6)(2y - 5y + 2y)(-2y - y2 + 2y). 17y3 Expand (57u - 882 + 882)(5u*3 - 3u*3 + 0u*3 + (1 + 0 - 2)(-2u3 + u - u)). 228u*4 Expand (1 - 1 + 2o)(4 - 1 - 2) + (-4 + 3 - 1)(o + 3o + o). -8o Expand 3y + y5 - 3y + (0y2 + y3 + 0y*2)(-4y - 2y + 2y)(-2y + 2y + 2y). -7y*5 Expand (-2y*2 - 2 + 2 + (2 - 2 + y)(3y + 3y - 5y) + y2 + 0y*2 + 2y*2)(11y + 62 - 62). 22y*3 Expand (-1 + 0 + 4)(3 + 0 + 0)(0z*4 + 0z*4 + 2z*5). 18z*5 Expand (2 + 1 - 1)(h + 3 - 3) + 0h + 5h + h. 8h Expand (-5f*2 + 5f*2 + 5f*2)(-2f - 4 + 4). -10f*3 Expand (0x2 + x2 + x*2)(-3x + x + 0x) + 3x3 + 123 - 123. -x3 Expand 4h - 4h - 7h2 + 2 - h2 - 2 + (h + 2h - 2h)(0h + 3h - h) + 0h*2 + 3h*2 - 5h2 + (h2 - h*2 - 2h*2)(1 - 3 + 4) + h*2 - 1 + 1. -11h*2 Expand 4a*3 - 2a*4 - 4a*3 + (-4a + a + a)(0 + 0 + 2a*3) - 3a*4 - 6a + 12*a -	{ "pile_set_name": "DM Mathematics" }
Let q(s) = 7s2 + 19. Let m(u) = -3u*2 - 9. Let a(z) = -9m(z) - 4q(z). Let v be a(0). Let h(n) = -n2 + 2n + 1. What is h(v)? -14 Let n(p) = 4p2 + 14p + 5. Let x(s) = 2s2 + 7s + 2. Let t(v) = 4n(v) - 7x(v). Calculate t(-4). 10 Let t(r) = r*3 + 6r*2 + 5r + 1. Let d = -595 + 591. Determine t(d). 13 Suppose 4p = m + 6 + 6, -m + p = -3. Let k(j) be the second derivative of j4/12 - 3j*3/2 + 6j*2 - 2j. Determine k(m). 4 Let u(p) = -p*2 - p - 1. Let b be 31/(-93)(1 - -8). Give u(b). -7 Let t(n) be the third derivative of -n4/6 + n3 + 8n2. Let g(h) = -7h + 12. Let r(l) = 3g(l) - 5t(l). Let c be 4/22 + (-10)/55. Give r(c). 6 Let k(i) = i*2 + 6i - 5. Suppose m - 2 = 2v - 0, 0 = -m. Let x be (-27)/(-12) + v/4. Suppose -a = xa + 15. Determine k(a). -10 Let o be (-4)/(-10) - 2/2014. Let g(x) = x2 + x - 1. Calculate g(o). -1 Let l(a) = a3 + a + 6. Let b = -16 + 34. Let j be ((-27)/b)/(6/32). Let o be j/24 - 3/(-9). Give l(o). 6 Let v(b) = -b2 + 1. Let u(m) = -m2 + 5m + 5. Let d = 9 - 3. Let z be u(d). Calculate v(z). 0 Let g(t) = -t*2 - 8t - 7. Let w(u) = -u*3 - 11u*2 + 16u + 42. Let z be w(-12). What is g(z)? 5 Let o(v) = -v3 - v2 + v + 2. Let r(q) = -28q - 20. Let c be r(-4). Let s = c + -90. What is o(s)? -8 Suppose -q = -6q. Let b = 80 - 77. Let t(f) = -5 + f*2 + bf - 2f - f. Calculate t(q). -5 Let r be (-7)/(-2) + (-9)/(-6). Suppose 3 - 25 = 3z - 5x, -3x = -rz - 42. Let u(s) = s3 + 9s2 + 11. Calculate u(z). 11 Let o(w) = w3 + 13w2 + 20w - 16. Let n(x) = x*3 + 15x*2 - 14x + 21. Let q be n(-16). Calculate o(q). 6 Let r(m) be the first derivative of -m*4/4 - 10m*3/3 - 7m*2/2 + 12m + 16. Suppose 0 = -5k - 35 - 10. Calculate r(k). -6 Let d(i) = i3 - 7i*2 + 6i - 6. Suppose 4t + 0 - 48 = 0. Suppose 5k - 7k = -t. Determine d(k). -6 Let k(t) = t3 - 4t*2 + 2t + 2. Suppose 8z - 39 = -7. Determine k(z). 10 Let r = 11 + -15. Let l = r + 6. Let y(w) = -3w2 + 7 + w3 + 0wl - 2 - 4w + 0w2. What is y(4)? 5 Let w be (-1)/2-10. Let f = 40 + -36. Let k(p) = -5 + f - 5 + w + p. Give k(6). 0 Let b(u) = -u3 + 9u*2 + 10u + 3. Suppose 10z = -648 - 192. Let w be 2/(-4) - z/8. Determine b(w). 3 Let k(c) be the first derivative of 1/4c*4 + 2c*3 - 7c + 1/2c2 - 20. Determine k(-6). -13 Let g(s) = 7s + 2. Let b(z) = -39z - 11. Let p(q) = -2b(q) - 11g(q). What is p(-4)? -4 Let s(o) = o2 + 2 - 10o - 3 + 8o. Determine s(2). -1 Let a(s) = s3 - 7s*2 - 3s + 7. Suppose -2c + 13c = 616. Suppose 8t = 16t - c. Calculate a(t). -14 Suppose -4l = -q - 12, -2l - 2q + 5q + 16 = 0. Let w(j) = 12 + j*l - 7 - 9 + 4j. Give w(-6). 8 Let d(q) be the second derivative of q4/12 + q3/6 - 6q2 + 99q. Give d(0). -12 Let c(u) be the first derivative of -u*2/2 + 6u - 181. Determine c(7). -1 Let p(v) = -v + 1. Let k = 81 + -73. Suppose -21f = -19f - k. Calculate p(f). -3 Let d(w) be the first derivative of w*3/3 + 3w*2/2 - w - 4. Suppose 14 = 2q - 2n, 3q - 3 + 0 = -3n. Suppose 2c - qf = -22, 5f - 15 = c + 8. Give d(c). -1 Suppose 3j = 5z + 2j - 32, -4z - 4j + 16 = 0. Let l(n) be the third derivative of 0 - zn*2 - 1/60n*5 + 1/24n*4 + 2/3n*3 + 0n. Give l(5). -16 Let k(s) = -75s - 3. Let i(x) = 31x + 2. Let j(q) = 5i(q) + 2k(q). What is j(-1)? -1 Let n(g) = -g + 1. Let h be (18/27)/(2/18). Let r(l) = -l*2 + 6l + 4. Let y be r(h). What is n(y)? -3 Let x(n) = 1276n2 - 646n*2 - 636n*2. What is x(-3)? -54 Let b(p) = 8p + 4p3 - 7 + 9p*3 + 7p*2 - 19p*3 + 5p*3. What is b(8)? -7 Let p be (115/35 - -5) + 2/(-7). Let f(n) = 7 + 3n - 4n - p. Give f(4). -5 Let p(x) = 5x*3 - 5x - 4. Let m be p(-1). Let u(y) = -y - 3. Determine u(m). 1 Let z(k) = 0k2 - 2k*2 - 3k + 0k2 + 1. Let a(w) = -6w + 4w + 4w - w + 2w3. Let i be a(-1). Give z(i). -8 Let q(j) be the first derivative of j4/4 + 16j*3/3 + 5j + 132. Give q(-16). 5 Let h(k) = -8k2 + 6k - 7. Let d(a) = 2a2 - a + 2. Let l(j) = 3d(j) + h(j). Let g = -1 + 4. Give l(g). -10 Let m(v) = -v3 + v + 2. Let p be m(0). Let b(c) = -3 - c3 + 4c2 - pc + 6 + 0 + c*2. Calculate b(4). 11 Let w(m) be the second derivative of -19m4/12 - m2/2 + 36m. Calculate w(-1). -20 Suppose 0 = -10g + 6g + 4i + 56, 4i + 4 = 0. Let c(a) = -a3 + 12a*2 + 12a + 25. Give c(g). 12 Let c(z) = 70199z + 6 - 4 - 70197z - 4. Give c(3). 4 Let m(n) = n*2 + 34n + 11. Let j(q) = 35q + 21. Let b(g) = 2j(g) - 3m(g). What is b(-11)? -2 Let h(c) be the third derivative of c6/120 - c5/12 - c3 - 24c*2 + c. What is h(5)? -6 Let l(x) = -x. Let y(z) = -4z. Suppose -12 = -10n + 4n. Let d(b) = ny(b) - 7l(b). Let h(w) = -12w - 6. Let r(v) = 9d(v) - h(v). What is r(-6)? -12 Let g = -17 + 26. Suppose 5m - 12 = -4k, -g - 1 = k - 2m. Let l(x) = -4x + 2. Calculate l(k). 10 Let l(c) be the second derivative of -1/12c4 - 9/2c*2 + 17c + 0 + 3/2c3. Calculate l(9). -9 Let b(w) = 7 - 3w + 16 + 6 - 2w3 + 4w*2 - 28. Determine b(2). -5 Let t(k) = -11k3 + k2 - 2k + 1. Let j(g) = -5g*3 - g + 1. Let w(a) = -13j(a) + 6t(a). Let r be (-1)/(-3) + 7/(-3). Let l = 4 - r. Calculate w(l). -1 Let p(k) = 3k - 1 + 0 + k + k - k. What is p(1)? 3 Let d(y) = -13y - 2. Let q(p) = 15p. Let k(n) = 6d(n) + 5q(n). Calculate k(10). -42 Let a = -19 + 22. Suppose g + 2g - 27 = 0. Let u = a - g. Let d(s) = -s2 - 8s - 9. Give d(u). 3 Suppose -5 = -6x + x. Let q = -1 + x. Let s(l) be the third derivative of l6/120 + l5/60 - l4/24 + 155l2 + 1. What is s(q)? 0 Let i = -5 - -3. Let w = 6 + i. Let u(d) be the first derivative of -d4/4 + 4d3/3 + d2/2 - 4d + 7. Calculate u(w). 0 Let a(i) = 12i - 4i + 3 - 2. Suppose 0 = 3k + w - 4, -5w + 30 + 6 = -k. Give a(k). -7 Let h(p) be the second derivative of p*5/20 - 5p*4/6 + 5p*3/3 - 3p*2 + 11p. Suppose -4d + 19 + 19 = s, 4d - 34 = s. Determine h(d). 3 Let a be (-18)/728/2-1. Let l(m) = 2m3 + a - 2m*2 - 8m + 7m - m3. Give l(2). -1 Suppose -35 = 4x + 1. Let b(v) be the first derivative of v*2/2 + 10v - 317. What is b(x)? 1 Let d be (-80)/(-15) - (-6)/(-18) - 11. Let u(a) = a*2 + 9a + 13. What is u(d)? -5 Let t(c) = -3 - 2c - 3 + 3 + c. Calculate t(-9). 6 Let x(w) be the first derivative of 1/3w*3 + 11 + 2w + 7/2w2. What is x(-6)? -4 Let n(a) = -11a - 17. Let b(t) = 4t + 6. Let x(d) = -8b(d) - 3n(d). Let l be 2 - 4/1221. Determine x(l). -2 Let j(v) = 3v3 - 5v*2 - 2v - 9. Let i(s) = 7s3 - 9s*2 - 4s - 17. Let l(m) = -4i(m) + 9j(m). Let p be (54/(-21))/((-8)/(-28)). Give l(p). 5 Let n(p) = -p. Let w(u) = -2u2 - 6u - 1. Let h(x) = -3n(x) + w(x). Let c = 10 - 7. Suppose -2d - 4a + 0a = 4, -d + ca = 2. Give h(d). -3 Let q(r) = -r - 1. Let f(w) = -2w - 13. Let m be f(-10). Let j be (m/(-7))/(2/(-10)). Calculate q(j). -6 Let s(n) = n*3 + 0n2 - n2 - 3n2 + 2n - 4. Let i(q) be the second derivative of -q5/4 + q4/12 + q*3/3 - 4q. Let l be i(-1). Calculate s(l). 4 Let q(l) = 2l - 3. Suppose -8i + 12 = -5i. Suppose 0 = 5a, -5z + 3a + 20 = ia. Give q(z). 5 Let x(p) = p2 - p. Let r(a) = 3a*2 - 9a - 9. Let b(w) = r(w) - 2x(w). Let j be (-1)/(-1) + 224/32. What is b(j)? -1 Let w(c) be the third derivative of -c6/120 - 3c*3/2 + 180c*2. Calculate w(0). -9 Let v = 53 + -50. Let c(a) = 2a - 1. Determine c(v). 5 Suppose 15o + 36 = 11o. Let m(j) = j*3 + 10j*2 + 10j + 8. What is m(o)? -1 Let f(d) = 3d3 - 2 + 0 - d2 + 3d*2 - 5d - 2d3. Suppose -2i + 1 = 7. Determine f(i). 4 Let u = -66 - -69. Suppose -8g = -u - 29. Let q(x) = -x3 + 4x*2 - 3x + 4. Determine q(g). -8 Let r(q) = -6q - q3 + 11q - 6q - q + 6q*2. Suppose h - 20 = -3h. Calculate r(h). 15 Suppose -4t + 6 - 3 = -5b, 3b - 5t = -7. Let v(n) be the second derivative of -4n3/3 + n2/2 - 228n. Calculate v(b). -7 Let i(b) = b - 8. Let v be i(17). Let p(s) = 5s - 2 + 5 - vs - 2. Give p(-2). 9 Let q(t) = 3t - 7. Let w be q(6). Let h(s) = -s + w + 3 - 15. Give h(4). -5 Let b(q) be the third derivative of q6/120 + 2q5/15 + q4/12 + 4q3/3 + 19q**2 - 3. Give b(-8). -8 Suppose 1 = -r + 3. Let p(j) be the first derivati	{ "pile_set_name": "DM Mathematics" }
ed without replacement from {k: 3, i: 1, v: 1, h: 2, q: 4}? 2/55 Calculate prob of picking 2 l, 1 h, and 1 j when four letters picked without replacement from {j: 1, l: 2, y: 2, h: 1}. 1/15 Three letters picked without replacement from {l: 1, v: 1, g: 1, y: 2, o: 2, n: 2}. Give prob of picking 1 o and 2 y. 1/42 What is prob of picking 2 g when two letters picked without replacement from {g: 3, d: 5, h: 5}? 1/26 Three letters picked without replacement from zcccceczeezecz. What is prob of picking 1 z, 1 c, and 1 e? 24/91 Calculate prob of picking 1 f, 1 s, 1 a, and 1 b when four letters picked without replacement from {b: 4, a: 1, f: 5, s: 1}. 2/33 What is prob of picking 2 e and 2 d when four letters picked without replacement from efddfceg? 1/70 Two letters picked without replacement from {j: 2, r: 2, e: 4}. Give prob of picking 2 e. 3/14 What is prob of picking 1 a and 1 y when two letters picked without replacement from ywnwnnnwwnyary? 3/91 What is prob of picking 1 b and 1 k when two letters picked without replacement from bhkhbbhbbbkhh? 2/13 What is prob of picking 3 j and 1 v when four letters picked without replacement from {j: 5, d: 5, w: 1, u: 4, v: 1}? 1/182 Calculate prob of picking 1 g and 1 v when two letters picked without replacement from gvgvkvxguvu. 12/55 Three letters picked without replacement from {l: 3, f: 3}. Give prob of picking 1 l and 2 f. 9/20 Three letters picked without replacement from eeaeaa. Give prob of picking 1 e and 2 a. 9/20 Two letters picked without replacement from jacfckcc. Give prob of picking 1 c and 1 f. 1/7 What is prob of picking 2 c and 1 q when three letters picked without replacement from cdqccqcdcdqqqcqcy? 63/340 What is prob of picking 1 k and 1 u when two letters picked without replacement from {u: 4, e: 4, a: 3, k: 6}? 3/17 Calculate prob of picking 1 a and 3 n when four letters picked without replacement from {n: 12, t: 1, a: 1}. 20/91 What is prob of picking 1 k and 2 t when three letters picked without replacement from ttkktk? 9/20 Two letters picked without replacement from nnnnnndnndn. Give prob of picking 2 n. 36/55 What is prob of picking 2 n and 1 y when three letters picked without replacement from {e: 1, y: 1, b: 4, n: 5}? 2/33 Three letters picked without replacement from gwttvettgwgttwwttt. Give prob of picking 1 v, 1 t, and 1 g. 9/272 Two letters picked without replacement from {n: 1, x: 3, t: 6, y: 4}. What is prob of picking 1 n and 1 x? 3/91 Calculate prob of picking 3 v when three letters picked without replacement from {v: 3}. 1 Three letters picked without replacement from {f: 2, k: 3, t: 2, c: 5}. Give prob of picking 2 t and 1 k. 3/220 Calculate prob of picking 3 n and 1 w when four letters picked without replacement from {w: 9, n: 11}. 99/323 What is prob of picking 1 f and 1 l when two letters picked without replacement from lfffffffffflfffl? 13/40 What is prob of picking 3 l and 1 k when four letters picked without replacement from {l: 9, k: 3}? 28/55 Three letters picked without replacement from {q: 4, f: 4, g: 2}. Give prob of picking 1 q and 2 g. 1/30 Calculate prob of picking 1 p and 1 o when two letters picked without replacement from pppoo. 3/5 Three letters picked without replacement from {i: 4, d: 3}. What is prob of picking 1 d and 2 i? 18/35 Calculate prob of picking 1 e and 1 x when two letters picked without replacement from cixtiiixictiiieiitx. 1/57 Three letters picked without replacement from {e: 2, d: 4, c: 1, r: 4}. What is prob of picking 1 r, 1 e, and 1 c? 8/165 Calculate prob of picking 1 w and 2 e when three letters picked without replacement from {w: 1, h: 1, e: 3}. 3/10 Two letters picked without replacement from {a: 4, o: 2, x: 3, m: 1, i: 2}. What is prob of picking 1 x and 1 i? 1/11 Two letters picked without replacement from mibiiimiiiiiyibiiiid. Give prob of picking 1 b and 1 i. 14/95 Three letters picked without replacement from kkkhkkkkhhkdkkkhkdkd. Give prob of picking 3 k. 143/570 Three letters picked without replacement from {z: 1, h: 1, m: 1, c: 4, g: 1}. What is prob of picking 1 h and 2 c? 3/28 Four letters picked without replacement from aaaallalaaaaalaaala. Give prob of picking 4 l. 5/3876 Two letters picked without replacement from jdprl. What is prob of picking 1 r and 1 j? 1/10 What is prob of picking 2 z and 1 m when three letters picked without replacement from {z: 7, m: 2}? 1/2 Two letters picked without replacement from {i: 5, f: 1, s: 3, k: 2, l: 1}. Give prob of picking 1 k and 1 s. 1/11 Calculate prob of picking 3 w when three letters picked without replacement from {w: 7}. 1 Three letters picked without replacement from rnhrhhnhrnrnhhhrnh. Give prob of picking 3 h. 7/102 Three letters picked without replacement from {p: 2, a: 7}. Give prob of picking 3 a. 5/12 Calculate prob of picking 1 h, 1 j, 1 f, and 1 g when four letters picked without replacement from ccmjjmjgmghcmffg. 9/910 Three letters picked without replacement from bazydazb. What is prob of picking 1 a and 2 z? 1/28 Four letters picked without replacement from {a: 2, k: 7, p: 1, y: 5, e: 1, s: 4}. Give prob of picking 1 y and 3 k. 35/969 What is prob of picking 1 b and 1 v when two letters picked without replacement from mblmmllmmblmmvtmxlll? 1/95 Four letters picked without replacement from {p: 3, z: 11, w: 3, x: 2}. What is prob of picking 2 p and 2 w? 3/1292 Calculate prob of picking 1 q, 1 c, and 1 w when three letters picked without replacement from ggaaqwcwgwgwgcrwq. 1/34 Two letters picked without replacement from xxxfxxxrexxxx. What is prob of picking 1 x and 1 f? 5/39 Four letters picked without replacement from iizzbzwlibbiilbi. Give prob of picking 1 i, 2 b, and 1 z. 27/455 Two letters picked without replacement from pqnwdtp. What is prob of picking 2 p? 1/21 What is prob of picking 2 d when two letters picked without replacement from ddddd? 1 What is prob of picking 1 h and 1 g when two letters picked without replacement from ghgghhhhhh? 7/15 Calculate prob of picking 1 m and 1 n when two letters picked without replacement from {f: 2, n: 3, m: 5}. 1/3 What is prob of picking 2 q when two letters picked without replacement from qsqvqsqsqshrvqqs? 7/40 Three letters picked without replacement from cggccggccccgcc. What is prob of picking 3 g? 5/182 What is prob of picking 4 a when four letters picked without replacement from {a: 7}? 1 What is prob of picking 2 p, 1 f, and 1 g when four letters picked without replacement from {p: 2, f: 1, d: 1, v: 2, g: 2}? 1/35 Two letters picked without replacement from zffazzffitit. Give prob of picking 2 z. 1/22 Four letters picked without replacement from {a: 1, r: 3, f: 1, w: 2}. What is prob of picking 2 w, 1 r, and 1 f? 3/35 Two letters picked without replacement from qdrqmspr. What is prob of picking 2 r? 1/28 What is prob of picking 1 d and 1 s when two letters picked without replacement from dsshsdhhs? 2/9 Three letters picked without replacement from {j: 7, z: 5}. Give prob of picking 2 j and 1 z. 21/44 Calculate prob of picking 1 a and 1 f when two letters picked without replacement from {a: 1, y: 1, f: 1, z: 1, s: 1}. 1/10 Two letters picked without replacement from oxsx. Give prob of picking 1 o and 1 s. 1/6 Three letters picked without replacement from ojjjjqqxjq. What is prob of picking 2 j and 1 o? 1/12 Three letters picked without replacement from {n: 1, l: 2, h: 3, t: 3, a: 1}. What is prob of picking 1 a and 2 l? 1/120 Three letters picked without replacement from {q: 2, u: 11}. What is prob of picking 3 u? 15/26 Four letters picked without replacement from eweweewwweewaeewwwwe. Give prob of picking 3 w and 1 a. 8/323 Calculate prob of picking 2 i when two letters picked without replacement from {b: 11, i: 2, z: 1}. 1/91 What is prob of picking 3 g when three letters picked without replacement from {a: 2, g: 4}? 1/5 What is prob of picking 1 k and 1 n when two letters picked without replacement from {a: 1, n: 5, i: 1, w: 2, k: 2, x: 2}? 5/39 Calculate prob of picking 1 h and 1 q when two letters picked without replacement from {e: 2, y: 5, o: 4, q: 1, j: 1, h: 2}. 2/105 Two letters picked without replacement from xnn. What is prob of picking 1 n and 1 x? 2/3 What is prob of picking 2 h when two	{ "pile_set_name": "DM Mathematics" }
44 What is prob of sequence ff when two letters picked without replacement from cckqffffkkkfckfkf? 21/136 Two letters picked without replacement from hffffhhfhhfff. What is prob of sequence ff? 14/39 Two letters picked without replacement from {t: 1, m: 3, e: 1, v: 5, f: 4, h: 1}. What is prob of sequence vm? 1/14 Calculate prob of sequence zrg when three letters picked without replacement from zgkrghzzrggg. 1/44 Three letters picked without replacement from pvhpvk. Give prob of sequence pkh. 1/60 Calculate prob of sequence ylhk when four letters picked without replacement from {l: 1, x: 6, y: 5, k: 1, h: 2}. 1/3276 Calculate prob of sequence dd when two letters picked without replacement from {k: 5, e: 2, d: 13}. 39/95 What is prob of sequence rn when two letters picked without replacement from {r: 6, j: 8, o: 3, n: 2}? 2/57 Calculate prob of sequence pmpm when four letters picked without replacement from {m: 8, n: 5, p: 5}. 7/459 Three letters picked without replacement from {b: 1, a: 11, p: 6, j: 1}. Give prob of sequence abp. 11/969 What is prob of sequence wr when two letters picked without replacement from {r: 1, x: 1, k: 1, w: 2}? 1/10 Two letters picked without replacement from {y: 9, i: 2}. Give prob of sequence yy. 36/55 Two letters picked without replacement from {y: 1, e: 8, o: 2, h: 2}. What is prob of sequence ey? 2/39 What is prob of sequence yc when two letters picked without replacement from yssyyssyusyc? 5/132 What is prob of sequence uu when two letters picked without replacement from {u: 2, a: 18}? 1/190 Four letters picked without replacement from qqqssqqssssqqsss. Give prob of sequence ssss. 9/130 Calculate prob of sequence vzzv when four letters picked without replacement from vvvvzz. 1/15 Two letters picked without replacement from {p: 3, k: 4, d: 4, g: 3, y: 2}. Give prob of sequence dk. 1/15 Four letters picked without replacement from {v: 1, a: 4, k: 1, c: 2, u: 2}. What is prob of sequence auca? 1/105 Three letters picked without replacement from tnzpnznzutpnuzv. What is prob of sequence nuv? 4/1365 Calculate prob of sequence qocc when four letters picked without replacement from {c: 3, o: 3, i: 6, q: 3}. 3/1820 Two letters picked without replacement from xxghjhjgjhggxhhhhhjh. Give prob of sequence jh. 9/95 Calculate prob of sequence nnny when four letters picked without replacement from ynynnnynnynnnnnnynn. 455/3876 Four letters picked without replacement from {c: 2, z: 4, j: 1, q: 1, w: 1}. Give prob of sequence zzqz. 1/126 What is prob of sequence uktt when four letters picked without replacement from ttkuuttkuututtkut? 3/170 Calculate prob of sequence ly when two letters picked without replacement from {n: 4, y: 1, s: 1, l: 5}. 1/22 Three letters picked without replacement from cfkqf. What is prob of sequence qck? 1/60 What is prob of sequence vi when two letters picked without replacement from {g: 4, v: 1, y: 1, i: 2, n: 1}? 1/36 Calculate prob of sequence sp when two letters picked without replacement from ypseeyjayeesay. 1/91 Four letters picked without replacement from mjjfaanjmfjjmmj. What is prob of sequence ajjf? 1/273 What is prob of sequence cr when two letters picked without replacement from {n: 5, b: 2, i: 3, r: 1, e: 3, c: 1}? 1/210 Four letters picked without replacement from {i: 2, e: 3, t: 4}. Give prob of sequence tiee. 1/63 What is prob of sequence lndn when four letters picked without replacement from tntlltnltlnlltttdtt? 1/2584 Two letters picked without replacement from {o: 1, m: 2, v: 3, w: 1}. What is prob of sequence vv? 1/7 What is prob of sequence aaaa when four letters picked without replacement from yyyaaaaaaya? 7/66 Two letters picked without replacement from qzlzqrqerz. What is prob of sequence zz? 1/15 What is prob of sequence pfp when three letters picked without replacement from fpp? 1/3 Three letters picked without replacement from vmdhd. What is prob of sequence ddh? 1/30 Two letters picked without replacement from {p: 3, w: 2, j: 1, k: 1, f: 1, n: 3}. What is prob of sequence pp? 3/55 Two letters picked without replacement from {l: 3, d: 1, p: 3}. What is prob of sequence pd? 1/14 Two letters picked without replacement from csdyydddscxy. Give prob of sequence dc. 2/33 Two letters picked without replacement from oyyyykyip. What is prob of sequence oy? 5/72 Three letters picked without replacement from {t: 1, m: 4, b: 2, f: 1, i: 1}. Give prob of sequence fbt. 1/252 Two letters picked without replacement from uvuuuuuuuuuuuuuuvu. What is prob of sequence uv? 16/153 Calculate prob of sequence iii when three letters picked without replacement from iiiixiiiiiili. 15/26 Two letters picked without replacement from {u: 1, w: 3, o: 2, b: 3, c: 4, s: 3}. Give prob of sequence oc. 1/30 Calculate prob of sequence pppp when four letters picked without replacement from {p: 6}. 1 Two letters picked without replacement from {c: 1, m: 3, o: 1, r: 6, w: 3}. What is prob of sequence wo? 3/182 What is prob of sequence fxjt when four letters picked without replacement from rxjxfnnt? 1/840 Four letters picked without replacement from xyyqyfhzhxx. What is prob of sequence zqyh? 1/1320 Three letters picked without replacement from kpdkiiiapbdpdpa. Give prob of sequence iap. 4/455 What is prob of sequence cxlx when four letters picked without replacement from wwwwxwlwvxlxlvclx? 1/1190 Two letters picked without replacement from {r: 8, m: 1, n: 1, x: 3, z: 1, a: 2}. Give prob of sequence ma. 1/120 What is prob of sequence sq when two letters picked without replacement from {m: 1, e: 1, q: 3, s: 4, v: 7, h: 2}? 2/51 Three letters picked without replacement from {b: 3, m: 5}. Give prob of sequence bmb. 5/56 Two letters picked without replacement from kburakbqbuuq. What is prob of sequence qk? 1/33 Calculate prob of sequence tzft when four letters picked without replacement from {z: 3, t: 2, f: 1, v: 7, y: 1}. 1/4004 Calculate prob of sequence rk when two letters picked without replacement from {k: 1, r: 1, q: 1}. 1/6 Three letters picked without replacement from {p: 1, s: 3, d: 4}. What is prob of sequence sss? 1/56 Two letters picked without replacement from {y: 4, t: 10, m: 2}. Give prob of sequence ym. 1/30 Four letters picked without replacement from bknwx. What is prob of sequence xwbn? 1/120 Three letters picked without replacement from {g: 3, l: 2, z: 7}. What is prob of sequence lgl? 1/220 Four letters picked without replacement from uuxxux. Give prob of sequence xuuu. 1/20 What is prob of sequence xll when three letters picked without replacement from tlxassnl? 1/168 Three letters picked without replacement from uuu. What is prob of sequence uuu? 1 Calculate prob of sequence ummh when four letters picked without replacement from {u: 3, z: 1, m: 6, h: 2}. 1/66 What is prob of sequence we when two letters picked without replacement from {w: 4, a: 1, i: 5, e: 1}? 2/55 What is prob of sequence pd when two letters picked without replacement from {d: 2, s: 3, p: 6, j: 1, r: 3}? 2/35 Three letters picked without replacement from sassvaaccva. Give prob of sequence csc. 1/165 Calculate prob of sequence zog when three letters picked without replacement from ooozogggoogooggzggg. 8/323 What is prob of sequence lhaa when four letters picked without replacement from {h: 3, l: 3, r: 8, a: 2, i: 3}? 1/5168 Calculate prob of sequence dd when two letters picked without replacement from dzdzdzz. 1/7 Two letters picked without replacement from {g: 2, l: 2}. Give prob of sequence gg. 1/6 What is prob of sequence lw when two letters picked without replacement from {w: 14, l: 1}? 1/15 Three letters picked without replacement from viqvvqvvviiiivvvi. What is prob of sequence vvq? 3/85 Two letters picked without replacement from {h: 2, u: 3, l: 2, n: 2}. Give prob of sequence nn. 1/36 Three letters picked without replacement from {u: 5, b: 2}. Give prob of sequence ubu. 4/21 Two letters picked without replacement from elelllllllllllllllle. Give prob of sequence ee. 3/190 Four letters picked without replacement from iuhphhpixuucpc. Give prob of sequence xcpp. 1/2002 Calculate prob of sequence hj when two letters picked without replacement from {d: 6, m: 3, j: 3, n: 1, h: 1}. 3/182 Calculate prob of sequence tz when two	{ "pile_set_name": "DM Mathematics" }
x = -168 + 166. What is the smallest value in x, 3, 1, f? x Let z be (380/133)/((-6)/(-21)). Let k be (27/(-7) + 5)/(z/(-35)). What is the second biggest value in 3, -5, -1/4, k? -1/4 Let d = -231 + 230.67. Let j = 4.67 - d. Let h = 11 - 8. What is the third biggest value in j, h, -0.1? -0.1 Let z be (6/9)/(8/(-48)). Let y be ((-6)/z)/(((-100)/(-24))/(-25)). What is the second biggest value in -3, -0.5, y? -3 Let x = -15084/5 + 3016. Which is the second smallest value? (a) -0.023 (b) 3 (c) x (d) 2 a Let q = -5.1 + 56.1. Let t = q + -13. Let w = -37.5 + t. Which is the biggest value? (a) w (b) 0 (c) -2/9 a Let u = 1807.3 - 1769. What is the third biggest value in -3, u, 2/7? -3 Let p(w) = 137w - 15. Let d be p(-3). Let m = d - -8944/21. What is the second biggest value in -2/7, m, 1? m Let q = -11.62 + 5.85. Let j = q - -5.67. Suppose -3m + n - 9 = 0, m = -0m - 5n - 19. Which is the smallest value? (a) -0.03 (b) 2/15 (c) m (d) j c Let o = -45 + -277. Let v = o + 324. Let u = 0 - -1. Which is the second smallest value? (a) v (b) -1 (c) 0 (d) u c Let v = -9.5 - -3. Let p = v + 7. Suppose -19k - 152 = -38k. Which is the biggest value? (a) p (b) -2 (c) k (d) -3/8 c Let x = 11 - 9. Suppose xh - h = 0. Let f be 6/4 - -5(-1)/5. Which is the third biggest value? (a) 0.1 (b) h (c) f b Let f = 0.04 - 66.04. Let n = f + 66.009. Let i = n - -0.041. Which is the fourth biggest value? (a) 5 (b) i (c) -1 (d) -2/3 c Let g = -0.0119796 - 92.6604204. Let p = g - -0.0724. Let q = p - -93. Which is the second biggest value? (a) q (b) -2 (c) -1 c Let l = -43.05 + 41. Let x = l - -2.1. Which is the smallest value? (a) -5 (b) -0.4 (c) x a Let v = -0.86 - 18.14. Let t = 0.02 + -0.05. Let r = t - 2.97. Which is the second biggest value? (a) 0.1 (b) r (c) v b Let q = -1.8 + 1.736. Let u = -248 + 247.536. Let j = u - q. Which is the third smallest value? (a) -0.12 (b) j (c) 0 (d) -4 a Let n = -5023 + 5029. Which is the third smallest value? (a) n (b) -5 (c) 16 (d) 2/13 a Let j = 89125/12 - 7427. Which is the biggest value? (a) 0.042 (b) -11 (c) j c Let r be 1840/(-180) - (-16 - -6). Let s = 5.7 - 0.7. Let a = -32.7 + 33. What is the third smallest value in s, r, a? s Let v(g) = -3g3 - g2 + 6g. Let m be v(2). Let z be m/240 + 1/5. Which is the second smallest value? (a) 4 (b) -2 (c) z c Let c = 1802 + -1851.12. Let m = c - -0.12. Let v = -51 - m. What is the biggest value in 5, -0.3, 1.3, v? 5 Let x = -0.23 - -0.1. Let q be (71 - 56)1/(-3). Which is the second biggest value? (a) 1 (b) x (c) 0.2 (d) q c Let h = 355/104 - 27/8. Let x = -41/286 - h. Let u = 772/4367 - -2/397. Which is the smallest value? (a) x (b) 2 (c) -3 (d) u c Let z = 482 - 443.52. What is the second biggest value in -0.3, 2/15, z? 2/15 Let f = -40 - 2. Let w = -7 + f. Let q = -45 - w. Which is the smallest value? (a) -1 (b) q (c) 0.04 a Let p(y) = -y + 8. Let x be p(-2). Suppose 9u - 44 = xu. Let g be ((-6)/u)/((-15)/20). What is the second smallest value in g, -0.12, -0.3? g Let x = -0.05 - 1.95. Let v = -0.7 - -2. Let n = 0.435 + 0.565. Which is the third smallest value? (a) n (b) x (c) v c Suppose 10z - 13z + 21 = -6t, 0 = -3z + 3t + 18. What is the fourth smallest value in 2, 13, -1/2, 1/7, z? z Let k be (6/45)/((-11)/(-55)). Suppose 4v - 2v - 10 = 0. Let q be (-32)/200v/(-2). Which is the fourth biggest value? (a) 0.2 (b) -3 (c) k (d) q b Let c(n) = n3 - 2n*2 + n - 2. Let k be 3/5 + 3 + (-102)/(-5). Let y = -22 + k. Let v be c(y). What is the biggest value in 1/75, 0.4, v? 0.4 Let k = 0.1 - -0.9. Let g = 1842 - 1840. Let m = -19.3 - -19. Which is the biggest value? (a) m (b) g (c) 0.1 (d) k b Let s = 164 + -164. Let g be (-2)/5 + 19/((-190)/(-534)). Which is the fourth biggest value? (a) s (b) -4 (c) 2/3 (d) g b Let p = 2662.8 + -2670.8. Which is the smallest value? (a) -1/4 (b) 0 (c) -1 (d) p (e) 2/5 d Let d = 164/47 - 539/141. Let n(a) = 19a + 2. Let y be n(4). Let z = 392/5 - y. What is the second smallest value in d, 3, z, -3? d Suppose -1387 = 108t - 2021 + 5602. Which is the second biggest value? (a) -2 (b) 0 (c) t a Let q = -316.7 - -161.6. Let w = q - -155. Which is the second biggest value? (a) w (b) -2/9 (c) -4/7 (d) -2/31 a Let l = 326/3 + -109. Let r = -0.2273 + 0.1273. Let y = -1.7 - 0.3. What is the fourth smallest value in -3/7, l, y, r? r Let n = 12 - 22. Let t be ((-3)/(-9))/(2 - 80/48). Which is the biggest value? (a) n (b) 2 (c) -5/4 (d) t b Suppose -31m - 9 = -34m, 4c + 6m + 2 = 0. What is the second smallest value in 0.2, -29, -5/4, c? c Let d = 4.383 - 8.383. Let p = -3 + 0. Let x = p - -1. Which is the second biggest value? (a) d (b) x (c) -0.4 b Suppose -32 - 2 = -17k. Which is the third biggest value? (a) -5 (b) k (c) -4/29 a Let i = 14 - -1. Let k = i - 24. Let t = -3.1427 + 0.1427. Which is the third smallest value? (a) -1 (b) k (c) t a Suppose -c = 115m - 116m + 19, 0 = -3m + 5c + 69. What is the second smallest value in m, 23, 1, 5, -2/13? 1 Suppose -3r - 3 = -k - 11, 0 = 4k + 3r + 2. Suppose 917 = 15z + 1067. Which is the biggest value? (a) -3 (b) k (c) 2 (d) z c Let o = 219 - -228. Let b = o - 448. Let p = -0.3 + 0.35. What is the third smallest value in b, -4, p? p Suppose -5y = -9y - 312. Let m be 44/(-154) - 550/(-7). Let c = y + m. What is the third biggest value in c, -0.03, -1/2? -1/2 Let t be (-29)/((-899)/(-155))17/5. What is the fourth biggest value in -0.5, t, 4/7, 1/3, 16? -0.5 Let f = 0.3 + 0.7. Let v = 26.3 - -7.7. Let m = v + -35. What is the smallest value in f, 1/3, -0.3, m? m Let w = -49 + 51. Let g = -88 - -103. Let h be 12/g(-60)/72. What is the smallest value in h, 0, w? h Let s(x) = -x*3 + 4x*2 - x + 6. Let v be s(4). Let b = -1.43 - -8.83. Let c = b + -7.8. What is the biggest value in c, v, 4, -5? 4 Let y be (0 - -15)/(4/124). Let r = y + -11627/25. Let q = 29.2 - 29. Which is the third smallest value? (a) r (b) q (c) -5 b Let h(a) = 19a - 71. Let u be h(4). Let f be 803/572 - u/4. What is the fourth smallest value in -2/11, 10, -5, f? 10 Let n = -16 + -52. Let w = -68.3 - n. Which is the smallest value? (a) 0.54 (b) w (c) -5 c Let d = -53 + 53. Suppose -3 = -h + 3z - 1, d = -4z. Let r(k) = -4k + 5. Let w be r(h). What is the smallest value in -4, 1/5, 4/5, w? -4 Suppose -f + 11 + 7 = 5c, 3c = 9. Let h be (7/4 - f)/(9/12). What is the third smallest value in -95, h, 1/3? 1/3 Let w = -492 + 6. Let l = w - -485.7. Let b = 0.24 + -0.2. What is the third smallest value in b, 0, l, -1? 0 Let o = -8041 - -8041.04. Let t = 0.05 - 2.05. Which is the biggest value? (a) 0.09 (b) t (c) o a Let v = -2 + 6. Let d = 0 - v. Let o be ((-44)/62)/((-758)/23498). What is the second biggest value in d, -1/2, o? -1/2 Suppose -5n = 2n + 35. Let c = 25.1 - 23.8. What is the third smallest value in 4, n, c, 2/9? c Let x be (-124)/476 - (-4 + (-198)/(-51)). Let u(o) = -16o - 97. Let g be u(-6). Let k = 1 - -2. Which is the third smallest value? (a) k (b) g (c) x a Let y = 3217.96 - 3218. What is the third smallest value in y, 7, -0.4, -4? y Let s = -2.20256 + 3.20256. Let y = -1 + -1. Let k = -58 - -58.31. What is the second biggest value in k, -1/3, y, s? k Let u = -0.105 - 0.095. Let r = -0.044 - -6.044. Which is the third smallest value? (a) 5 (b) r (c) u (d) -4 a Let y = -138.5 + 138. Let s be (2/(-10))/(12/(-10)). Let x = 260 - 260. Which is the third biggest value? (a) s (b) x (c) y c Let g = -122.3 + 117. Let f = g + 5. Let z = -843 + 842.2. What is the third smallest value in z, f, 4? 4 Let c(h) = -h*3 + 6h*2 + 8h - 4. Let t be c(7). Suppose -4n - 5 = -9n + 6n. What is the smallest value in t, 7, n? n Let m = -5042 + 5044. Let q be -6((-6)/99)/(12/9). What is the second biggest value in m, -1/4, q? q Let z be ((-50)/420 - 30/(-105))/(4/(-6)). What is the second smallest value in -2/5, -761, z, -0.1? -2/5 Let u = -6746 + 6745. Which is the third biggest value? (a) u (b) -3 (c) 3 (d) 0.01 (e) 12 d Let t = -0.44 + -0.06. Let q be 88/114 - 4/6. What is the second biggest value in t, 4, q, -25? q Let t be (-81)/(-18) + (4 - (-6 - -14)). What is the third smallest value	{ "pile_set_name": "DM Mathematics" }
or n(x). -4(x - 176)2 Suppose 10 = -565c + 566c. Let b(x) = -39x + 392. Let s be b(c). Suppose 1/12 + 1/6g - 5/4g*s - 3g*3 = 0. What is g? -1/3, 1/4 Suppose -4x + 4q + 32 = 0, 2x - 21 = 74q - 71q. Suppose 0 + 1/5tx + 0t + 1/5t2 = 0. What is t? -1, 0 Suppose 37c*2 - 20c*2 + 1257c - 417c - 13c*2 + 1196c = 0. What is c? -509, 0 Let r(p) be the third derivative of -p*6/1260 + 19p*5/630 + 13p*4/252 - 169p*3/9 - 1305p*2. Factor r(j). -2(j - 13)*2(j + 7)/21 Let 222514 - 4u3 - 222514 - 80u*2 + 896u = 0. What is u? -28, 0, 8 Let k be 30/32108/810. Let r(y) be the first derivative of 5 - 1/8y*2 + 3/40y*5 + 0y + 1/48y6 - ky*3 + 1/32y*4. Factor r(h). h(h - 1)(h + 1)2(h + 2)/8 Let s be (2/5)/((-3)/((-30)/4)). Let b(u) = -7u2 + 4u - 9. Let c(a) = a*2 + 4a - 1. Let q(v) = sb(v) - 5c(v). Let q(z) = 0. What is z? -1, -1/3 Let y(j) be the second derivative of -j*6/30 + 19j*5/10 + 55j*4/4 + 21j*3 + 3144j - 1. Suppose y(c) = 0. What is c? -3, -1, 0, 42 Let k(s) be the second derivative of s*5/90 - 2s*4/9 - 148s*3/27 - 80s*2/3 - 140s + 3. Factor k(y). 2(y - 20)(y + 2)(y + 6)/9 Let h(d) be the third derivative of d7/1260 - d6/180 + d5/90 + 17d*3/3 - 34d*2 + 2d. Let m(p) be the first derivative of h(p). Factor m(s). 2s(s - 2)(s - 1)/3 Let a = -4573/132 - -382/11. Let f(n) be the third derivative of 1/60n*6 + 0 - an*4 - 1/12n*3 + 0n + 12n2 + 1/120n*5. What is x in f(x) = 0? -1, -1/4, 1 Suppose 0 = 4q + 5c + 16, -2q = -4q - 2c - 6. Let l(a) = a*3 + 10a*2 - 24a + 6. Let j be l(-12). Factor 5s2 - js*2 + q + 8s - 8s. -(s - 1)(s + 1) Solve -806y2 + 810y*2 - 304y - 688y = 0. 0, 248 Suppose -3k = -k - 40. Find h such that h*2 + k + 93 + 28h + 83 = 0. -14 Let z(a) be the second derivative of -a6/60 - a5/20 + 11a4/24 + a3 - 1051a. Solve z(b) = 0. -4, -1, 0, 3 Let m(l) be the third derivative of -17/240l6 + 1/420l*7 - 7/12l*4 + 0l*3 + 0l - 131l2 + 0 + 11/30l*5. Solve m(d) = 0 for d. 0, 1, 2, 14 Factor 0 - 2/7w*3 + 512/7w*2 - 32768/7w. -2w(w - 128)*2/7 Let f(t) be the first derivative of -6t*3 - 1/10t*5 - 11/2t - 67 - 17/2t2 - 7/4t4. Factor f(y). -(y + 1)3(y + 11)/2 Let n(y) be the first derivative of 5y9/3024 - y7/21 + 2y5/3 + 20y*3/3 + 7. Let w(f) be the third derivative of n(f). Factor w(z). 5z(z - 2)2(z + 2)*2 Let g = 133 + -97. Factor 2j*4 + 61j - 17j5 - 10j*5 + 26j*5 + 18 + gj*3 + 74j*2 + 2j*4. -(j - 9)(j + 1)*3(j + 2) Suppose -35 = 2b - 7b. Find p, given that -63p2 + 25p*2 - bp*2 - 30 - 145p = 0. -3, -2/9 Let j(y) = y*3 - 19y*2 - 39y - 86. Let l be j(22). Let k = l - 506. Factor 2/3s3 + 1/3 - 5/6s + 1/3sk - 2/3s*4 + 1/6s*5. (s - 2)(s - 1)*3(s + 1)/6 Let v(q) be the third derivative of 0q3 - 1/420q*8 + 0q - 6/175q7 + 0q*4 + 1/15q*6 - 116q*2 + 0 + 0q*5. Factor v(x). -4x*3(x - 1)(x + 10)/5 Suppose u + 2o - 4o = -501, 2u + 4o = -1026. Let b = u - -510. Let 6/7s*2 + 0 + 2/7s*b - 6/7s*4 + 2/7s*5 - 4/7s = 0. Calculate s. -1, 0, 1, 2 Let z(h) be the third derivative of 1/50h5 - 1/175h*7 - 55h*2 + 0h + 0h3 + 1/90h*4 + 0 - 1/450h6. Let z(k) = 0. Calculate k. -1, -2/9, 0, 1 Let a(p) be the third derivative of -p5/12 + 15p4/2 - 175p*3/6 + 1672p*2. Let a(o) = 0. What is o? 1, 35 Factor 1/3f*2 + 14/3f - 95/3. (f - 5)(f + 19)/3 Let g(o) = o3 - 2o*2 - 1. Let z(d) = 67d*2 + 1088d + 1025. Let v(r) = g(r) + z(r). Factor v(c). (c + 1)(c + 32)2 Let r(j) be the third derivative of j6/24 + 59j*5/30 - 2j*4 + 287j*2 + 8j. Determine d so that r(d) = 0. -24, 0, 2/5 Suppose -2o - 3 = 5g, 6o + 69 = -0o - 3g. Let h be o/(-42) - 24/(-9). Let -2/9f*h + 2/9f + 2/9f2 + 0 - 2/9f*4 = 0. Calculate f. -1, 0, 1 Let j(l) be the second derivative of 2 + 2/5l*2 - 1/5l*3 + 8l + 0l4 + 1/50l*5. Find p such that j(p) = 0. -2, 1 Let c(b) be the third derivative of -1/10b*5 - 16 + 0b - 5/6b3 - 11/24b*4 + 3b2. Solve c(w) = 0 for w. -1, -5/6 Let z(r) be the first derivative of r4/14 + 34r3/21 + 79r*2/7 + 18r + 3278. Factor z(i). 2(i + 1)(i + 7)(i + 9)/7 Let s(c) be the third derivative of 0 + 0c*3 - c + 7/15c*6 + 0c*4 - 49c*2 - 1/7c*7 + 2/15c*5. Solve s(h) = 0 for h. -2/15, 0, 2 Let n(f) = 257f - 161f - 168f + 66 + 9f2. Let z(b) = b2 - 9b + 8. Let w(s) = 4n(s) - 33z(s). Find t, given that w(t) = 0. -3, 0 Let b be (-5 - -3) + -11 - -1. Let p = -10 - b. Find h, given that h*3 + 3h*3 - 7h*p + 16 - 16h + 4h3 - 5h*2 + 4h*4 = 0. -2, 1 Factor 0v - 344/7v3 - 92/7v*4 - 2/7v*5 + 0 - 48v*2. -2v*2(v + 2)*2(v + 42)/7 Let j = -14856 - -74292/5. Let a(l) be the first derivative of jl5 + 0l*3 + 7l*4 - 8l*2 + 0l + 18. Factor a(o). 4o(o + 1)(o + 2)(3o - 2) Factor -307y*2 + 238y + 412y - 105625 - 309y*2 + 615y2. -(y - 325)2 Let v(s) be the second derivative of -s*6/270 + 11s*5/180 + 25s*4/108 + 13s*3/54 - 309s + 2. Factor v(i). -i(i - 13)(i + 1)*2/9 Let q = -18198 + 18203. Let x(a) be the second derivative of -5/6a*3 + 0a*2 + 0 - 3/2a*q + 2/3a*6 + 5/3a*4 - 12a - 5/42a7. What is i in x(i) = 0? 0, 1 Let n be ((-21)/(-42))/((-5)/(-20)). Suppose 5p = 4y - 28, -ny + 2 = 3y + 2p. Let 0 + 2/3g3 - 1/3g*5 + 0g*y + 0g*4 - 1/3g = 0. What is g? -1, 0, 1 Find a, given that -3/5a2 - 348 + 204/5a = 0. 10, 58 Determine u, given that -2u5 - 246u*3 + 360u*2 + 7u*4 + 38u + 610u + 5u*4 + 6u*4 + 22u4 = 0. -1, 0, 6, 9 Let t(i) be the third derivative of i5/20 - 21i4/8 - 176i*3 + 811i*2 + i. Factor t(h). 3(h - 32)(h + 11) Let n(g) be the second derivative of g6/150 - 14g*5/25 + 53g*4/60 + 11g*3/3 - 3741g. Factor n(m). m(m - 55)(m - 2)(m + 1)/5 Let u be (-12)/(-13)20384/16464. Factor -u + 6/7p4 - 2/7p*3 + 2/7p*5 - 22/7p*2 - 24/7p. 2(p - 2)(p + 1)*3(p + 2)/7 Let r(i) be the first derivative of -i*4/18 - 352i3/27 + i2/9 + 352i/9 + 6898. Factor r(k). -2(k - 1)(k + 1)(k + 176)/9 Factor 2/7s2 + 4s + 0. 2s(s + 14)/7 Suppose -5p + 4p - 3b = -3, 5b = 4p + 73. Let k be (-7)/((-105)/4)p/(-8). Suppose 2/5i3 - ki*4 - 2/5i + 0 + 2/5i2 = 0. Calculate i. -1, 0, 1 Let s be ((-2)/206)/((-2)/10). Let r(c) = 6c2 + 22c*4 + 3c*5 - 11c*4 + 17c3 - cs. Let n(j) = j4 - j3. Let y(v) = -n(v) - r(v). Factor y(a). -3a2(a + 1)*2(a + 2) Solve 32/9 - 2/9s4 + 14/9s*3 - 8/3s*2 - 8/9s = 0. -1, 2, 4 Let o(h) be the first derivative of 2h3/27 + 11h*2/3 + 60h - 1650. Factor o(m). 2(m + 15)(m + 18)/9 Find o, given that -360 - 3/7o3 + 2526/7o - 3/7o2 = 0. -30, 1, 28 Let g(q) be the third derivative of -121q*5/570 + 2387q*4/57 - 188356q*3/57 - 3q*2 + 6q - 79. Find f such that g(f) = 0. 434/11 Let r(n) be the first derivative of -n*5/5 - 5n4/4 + n3 + 17n2/2 + 10n - 6565. Factor r(d). -(d - 2)(d + 1)2(d + 5) Let w(u) be the second derivative of 3u + 0u*2 - 1/48u*5 + 5/24u*4 + 29/6u*3 - 1/144u*6 + 0. Let m(n) be the second derivative of w(n). Factor m(q). -5(q - 1)(q + 2)/2 Let x(a) = 5a3 - a2 - a + 2. Let p be x(2). Let q be (4(-5 + 184/p))/2. Factor 10/9w*4 + 16/9w + 0 - qw5 - 4/3w*3 - 8/9w*2. -2w(w - 2)3(w + 1)/9 Let y = -3912 + 3924. Let h(w) be the second derivative of -23w - 7/10w*6 - yw*2 - 14w*3 + 3/2w*4 + 0 + 57/20w*5. Suppose h(c) = 0. Calculate c. -1, -2/7, 2 Let a = -566866/3 + 189157. Determine f, given that -440f + af2 + 240 = 0. 12/11 Let q = 78116/321 + -25468/107. What is z in qz*2 + 61/6z + 1/6z3 + 5 = 0? -30, -1 Let t = -38 - -19. Let m = 24 + t. Suppose 10 + g2 + mg*2 + 4 + 16g - 4g2 = 0. Calculate g. -7, -1 Let p(g) be the second derivative of 1/3g*4 + 1/21g7 - g2 - 50g - 1/5g*5 - 1/15g*6 + 1/3g*3 + 2. Factor p(o). 2(o - 1)*3(o + 1)*2 Suppose -11120k + 10881k + 1195 = 0. Let 86/11l*3 + 0 + 14/11l*k - 60/11l*4 + 8/11l - 48/11l2 = 0. What is l? 0, 2/7, 1, 2 Suppose 0 = -5v + 1 - 6. Let i be v/(5/10 - (-3)/(-4)). Let 0b3 - 1/6b**i + 0	{ "pile_set_name": "DM Mathematics" }
of 11979549? 3, 443687 What are the prime factors of 143918? 2, 227, 317 List the prime factors of 590389. 590389 List the prime factors of 1248215. 5, 31, 8053 What are the prime factors of 932248? 2, 116531 What are the prime factors of 4423381? 4423381 What are the prime factors of 3917010? 2, 3, 5, 59, 2213 What are the prime factors of 14544670? 2, 5, 7, 29683 What are the prime factors of 13583? 17, 47 What are the prime factors of 519318? 2, 3, 59, 163 What are the prime factors of 6988751? 7, 11, 17, 19, 281 What are the prime factors of 3816321? 3, 19, 23, 41, 71 List the prime factors of 80848. 2, 31, 163 What are the prime factors of 4941429? 3, 853, 1931 List the prime factors of 191273. 19, 10067 What are the prime factors of 1395783? 3, 155087 List the prime factors of 1137165. 3, 5, 47, 1613 What are the prime factors of 690253? 23, 30011 List the prime factors of 8384620. 2, 5, 419231 What are the prime factors of 7582873? 7582873 What are the prime factors of 60159? 3, 11, 1823 What are the prime factors of 756713? 19, 39827 What are the prime factors of 6805144? 2, 383, 2221 What are the prime factors of 243885? 3, 5, 71, 229 List the prime factors of 230622. 2, 3, 7, 17, 19 What are the prime factors of 170074? 2, 85037 List the prime factors of 13529749. 47, 287867 What are the prime factors of 3992583? 3, 7, 31, 6133 What are the prime factors of 7952625? 3, 5, 7069 List the prime factors of 163423. 13, 967 List the prime factors of 1041363. 3, 38569 What are the prime factors of 402718? 2, 201359 What are the prime factors of 956765? 5, 191353 List the prime factors of 2143181. 19, 112799 List the prime factors of 15883142. 2, 11, 721961 List the prime factors of 1730283. 3, 673, 857 List the prime factors of 4608025. 5, 184321 List the prime factors of 254384. 2, 13, 1223 List the prime factors of 370303. 367, 1009 List the prime factors of 5608495. 5, 1121699 List the prime factors of 155039. 197, 787 List the prime factors of 979909. 7, 139987 List the prime factors of 2376383. 23, 277, 373 What are the prime factors of 5411052? 2, 3, 29, 71, 73 List the prime factors of 15171210. 2, 3, 5, 101, 1669 List the prime factors of 344636. 2, 29, 2971 List the prime factors of 2743523. 2743523 List the prime factors of 1748788. 2, 53, 73, 113 List the prime factors of 13071874. 2, 2447, 2671 What are the prime factors of 5198724? 2, 3, 144409 What are the prime factors of 28771198? 2, 73, 197063 What are the prime factors of 961831? 13, 241, 307 List the prime factors of 367653. 3, 11, 13, 857 List the prime factors of 308313. 3, 19, 601 What are the prime factors of 74437? 11, 67, 101 List the prime factors of 13025. 5, 521 List the prime factors of 6281706. 2, 3, 1046951 List the prime factors of 530942. 2, 265471 What are the prime factors of 227992? 2, 28499 List the prime factors of 592107. 3, 197369 List the prime factors of 20646433. 23, 897671 What are the prime factors of 385341? 3, 11, 11677 What are the prime factors of 224933? 43, 5231 List the prime factors of 289600. 2, 5, 181 What are the prime factors of 589577? 17, 79, 439 What are the prime factors of 2006860? 2, 5, 100343 List the prime factors of 1131757. 11, 137, 751 What are the prime factors of 110789? 7, 17, 19 List the prime factors of 35966. 2, 7, 367 List the prime factors of 213100. 2, 5, 2131 What are the prime factors of 614075? 5, 7, 11, 29 What are the prime factors of 253565? 5, 13, 47, 83 What are the prime factors of 95635? 5, 31, 617 What are the prime factors of 760627? 7, 19, 43 List the prime factors of 28163202. 2, 3, 109, 43063 What are the prime factors of 3146288? 2, 196643 What are the prime factors of 484938? 2, 3, 29, 929 What are the prime factors of 3659604? 2, 3, 13, 23459 What are the prime factors of 670195? 5, 134039 List the prime factors of 2042344. 2, 59, 4327 List the prime factors of 1295067. 3, 41, 10529 What are the prime factors of 505689? 3, 59, 2857 List the prime factors of 667186. 2, 13, 67, 383 List the prime factors of 439370. 2, 5, 53, 829 What are the prime factors of 7068407? 521, 13567 List the prime factors of 2657723. 31, 85733 List the prime factors of 27897528. 2, 3, 23, 50539 What are the prime factors of 1847789? 1847789 What are the prime factors of 1698271? 1698271 What are the prime factors of 3082039? 71, 83, 523 What are the prime factors of 72950? 2, 5, 1459 What are the prime factors of 804139? 7, 16411 What are the prime factors of 595554? 2, 3, 99259 What are the prime factors of 3913722? 2, 3, 217429 List the prime factors of 134753. 134753 What are the prime factors of 4942265? 5, 988453 List the prime factors of 11920361. 2791, 4271 What are the prime factors of 2141020? 2, 5, 7, 41, 373 List the prime factors of 1088213. 7, 83, 1873 List the prime factors of 21969039. 3, 7323013 List the prime factors of 132763. 132763 What are the prime factors of 768390? 2, 3, 5, 7, 3659 List the prime factors of 969631. 13, 74587 List the prime factors of 6055751. 13, 29, 16063 What are the prime factors of 6226025? 5, 13, 19157 List the prime factors of 112101. 3, 11, 43, 79 List the prime factors of 10501195. 5, 2100239 What are the prime factors of 2822637? 3, 940879 What are the prime factors of 457628? 2, 114407 List the prime factors of 17255930. 2, 5, 1725593 List the prime factors of 10982871. 3, 45197 What are the prime factors of 6705776? 2, 7, 11, 5443 What are the prime factors of 20774526? 2, 3, 31, 61, 1831 List the prime factors of 3484877. 11, 41, 7727 What are the prime factors of 22782465? 3, 5, 17, 1103 What are the prime factors of 3986078? 2, 1993039 What are the prime factors of 247760? 2, 5, 19, 163 What are the prime factors of 630507? 3, 210169 What are the prime factors of 545237? 7, 11, 73, 97 What are the prime factors of 85383? 3, 53, 179 What are the prime factors of 53382? 2, 3, 7, 31, 41 What are the prime factors of 21703641? 3, 7234547 What are the prime factors of 1998822? 2, 3, 7, 47591 What are the prime factors of 882505? 5, 13, 13577 List the prime factors of 4984148. 2, 13, 73, 101 What are the prime factors of 139902? 2, 3, 7, 3331 What are the prime factors of 1573099? 11, 83, 1723 List the prime factors of 220709. 220709 What are the prime factors of 5828955? 3, 5, 11, 35327 List the prime factors of 185753. 185753 List the prime factors of 18636201. 3, 281, 7369 What are the prime factors of 3223426? 2, 19, 84827 What are the prime factors of 2309377? 7, 173, 1907 What are the prime factors of 329913? 3, 4073 List the prime factors of 5037230. 2, 5, 11, 23, 181 List the prime factors of 4962960. 2, 3, 5, 61, 113 What are the prime factors of 229951? 227, 1013 List the prime factors of 2975737. 127, 23431 List the prime factors of 3015249. 3, 769, 1307 What are the prime factors of 5192606? 2, 2596303 What are the prime factors of 689211? 3, 76579 What are the prime factors of 11129777? 701, 15877 What are the prime factors of 197056? 2, 3079 List the prime factors of 234372. 2, 3, 19531 What are the prime factors of 208237? 53, 3929 What are the prime factors of 717986? 2, 358993 List the prime factors of 2751486. 2, 3, 499, 919 What are the prime factors of 166433? 149, 1117 What are the prime factors of 10194112? 2, 47, 3389 What are the prime factors of 329644? 2, 7, 61, 193 List the prime factors of 1566396. 2, 3, 13, 3347 What are the prime factors of 12180787? 12180787 List the prime factors of 140517. 3, 13, 1201 What are the prime factors of 196503? 3, 17, 3853 List the prime factors of 3057965. 5, 23, 26591 List the prime factors of 4465. 5, 19, 47 List the prime factors of 3564344. 2, 7, 63649 List the prime factors of 13845432. 2, 3, 281, 2053 List the prime factors of 2005010. 2, 5, 7, 28643 List the prime factors of 3378763. 3378763 List the prime factors of 27920. 2, 5, 349 What are the prime factors of 231014? 2, 7, 29, 569 List the prime factors of 2322110. 2, 5, 7, 677 List the prime factors of 7060701. 3, 23, 102329 What are the prime factors of 124480? 2, 5, 389 What are the prime factors of 1877188? 2, 89, 5273 What are the prime factors of 19788382? 2, 29, 341179 What are the prime factors of 640957? 640957 List the prime factors of	{ "pile_set_name": "DM Mathematics" }
e -242 = -3b - b - 5a, 122 = 2b + xa. Suppose -b = -3y + 81. Does 8 divide y? True Let x be (-8)/(-10) + 3785(-144)/(-200). Suppose 18j - 10846 - x = 0. Does 59 divide j? False Suppose 15s - 122808 = -48468. Let i be s/(-70)(-20)/(-6). Let o = -130 - i. Is 10 a factor of o? False Let v be (-1)/(-5) + (-59)/(-5). Let w be (8 - 0)/(13 - v). Let o(t) = -t + 18. Is 10 a factor of o(w)? True Suppose 2y - 1614 = 4v, -v + 146 = -4y + 560. Let i = -234 - v. Is 12 a factor of i? True Let h(q) = -5q - 18. Let z = 172 + -192. Does 7 divide h(z)? False Suppose -67x + r - 162850 = -70x, 3r = -3x + 162864. Does 50 divide x? False Let l = -26 + 31. Suppose s - 2 = -x, -s + l = -2x - 3. Suppose -m = -4 - 1, sy + 5m - 249 = 0. Does 25 divide y? False Let n be (-3)/4(-7)/((-7)/12). Let i(c) = -c3 - 6c*2 + 8c + 5. Let h be i(n). Does 23 divide 4 - ((-4)/2 - h)? False Suppose -14 = 2k + 3w - 1, 0 = -2k + 3w + 17. Let c be (3 - (k - -2)) + 242. Let n = c + -88. Does 13 divide n? False Suppose 3u = 9p - 13p + 10485, -5p - 13918 = -4u. Does 12 divide u? False Let f = -22 + 0. Let r = f + 25. Suppose 2x - 89 = -4q + 113, 0 = 4q + rx - 207. Is 17 a factor of q? False Let r be -4 + 4 - 4/((-4)/3). Suppose 0 = 2h - 0j - 5j + 10, -3h - rj = -27. Suppose 5o - hk + k - 60 = 0, 3k = -4o + 79. Is 8 a factor of o? True Let u(h) = -h*3 + 3h*2 + 6h - 1. Let p be u(7). Let q be (16/12)/1213. Let l = q + p. Does 12 divide l? False Suppose -3q - 96993 = 51h - 56h, -3q = 3h - 58239. Is 28 a factor of h? True Suppose 0g - 10g + 20 = 0. Let t = 1 + g. Is -201(-4)/(-2)(-1)/t a multiple of 18? False Suppose -4r = 50 - 158. Let w(i) = -i2 + 26i + 29. Let v be w(r). Is -1(-39)/v2 a multiple of 39? True Suppose 5k - 15 = -3l, -1 = 4k - 4l - 13. Does 4 divide k/162/6? False Let b(s) = s3 + 29s*2 - 27s - 32. Let h be b(-28). Suppose -f = -g + 819, -3g + 4f + h = -945. Does 38 divide g? False Let a be 37636/(-16) + (-5 - (-126)/24). Let w = -1287 - a. Is w a multiple of 71? True Suppose 20724 + 20517 - 7851 = 42d. Does 14 divide d? False Let d be 6/1(-3)/(-6). Suppose dq - 69 = 12. Suppose 0 = -2n - q + 91. Is 16 a factor of n? True Let g(h) = 5h2 - 11h - 116. Let i be g(-7). Let z = 1193 - i. Does 21 divide z? True Let i(x) = x*3 + 8x*2 + 10x + 15. Let v be i(-6). Let a = v + -79. Let s = 163 + a. Is 12 a factor of s? False Suppose -635 - 1734 = -23m. Suppose 0 = 2t + 4w - 70, -t + 16 = -5w - 47. Let k = m + t. Does 18 divide k? False Suppose 0 = -47f + 34179 + 19113 + 24540. Is 12 a factor of f? True Let n(a) = -26a + 24. Let w be n(-6). Suppose -wq - 220 = -185q. Is q a multiple of 4? True Suppose -o + 4g + 10 = 0, 0 = -4o + 3g + 1 + 39. Let d = o + 30. Let y = d + -33. Does 2 divide y? False Let l = -13951 - -18197. Is l a multiple of 2? True Suppose -4c = 4b - 41564, -b + 41579 = -166c + 170c. Is c a multiple of 23? True Let g be (-21)/(-4 + -3) - (-2 - 2). Does 54 divide ((-5508)/(-119))/(1/g)? True Suppose 52l - 53l - 4 = 0. Let w = -3140 - -1778. Is 22 a factor of l/(40/w) - 8/(-10)? False Let i(g) = -5g*2 - 7g + 22. Let a be i(-8). Let n = a - -1355. Is n a multiple of 19? False Let m(t) = -490t + 110. Let o(k) = -44k + 9. Let v(q) = -4m(q) + 45o(q). Let l be ((-7)/3)/((-2)/(-6)). Does 21 divide v(l)? True Let y(j) = 50j2 - 13j + 16. Suppose -3z - m - 1 = -5, 0 = 5z + 5m. Is y(z) a multiple of 46? False Let f(s) = s3 - 9s*2 + 7s + 8. Let l be f(8). Let t be 12/((0 - l) + 1). Suppose 0 = tu - 11u - 199. Is 22 a factor of u? False Let b = -7383 - -13447. Is b a multiple of 63? False Is -2 + (-529235)/(-28) - (-42)/56 a multiple of 225? True Let z(s) = s*3 + 43s*2 - 159s + 50. Is z(-23) a multiple of 13? True Let n be (12/(-8))/((-21)/112). Suppose -nw + 4w = 3h - 466, -5w - 25 = 0. Is 21 a factor of h? False Let l = 688 + 478. Let m = l - 528. Does 29 divide m? True Suppose 1134 - 40890 = -12b. Is b a multiple of 11? False Let k be (-13)/26(-1194 + 0). Is 11 a factor of (1 - -5(-6)/30) + k? False Let r be (35/40)/((-1)/(-56)). Is (-7)/(r/(-21)) - -555 a multiple of 18? True Suppose 0 = 3s - 5i + 3 - 7, 8 = 2s + 2i. Let z be (16/10)/(1/5) - s. Suppose 0 = zf + 4t - 112, -2t - 5 = -1. Does 4 divide f? True Let l = 2542 - 2536. Let s = -14 + -25. Does 8 divide s(-4 + 22/l)? False Suppose -4c + 4p = -12, -5p = -0c + 5c - 45. Suppose co - o = 5s - 20, -s = 4o - 9. Suppose 165 - s = 8i. Is i a multiple of 6? False Let b be 8 + -442 + (61)/(-2). Let g = b - -739. Let u = g - 208. Is 9 a factor of u? False Let z(i) = 3i*3 + 3i*2 - 38i + 468. Is z(12) a multiple of 42? True Suppose 389p - 166518 = 378p. Is p a multiple of 11? False Suppose -39y = -42y + 18. Let i(r) = -y - 636r + 22 + 635r. Is i(-7) a multiple of 12? False Let k = 269 - 270. Suppose -5g - i = i + 200, 0 = g + i + 43. Does 55 divide (351/54)/(k/g)? False Let t be 14 + -2 + -1(-3 - 2). Suppose tn - 20n = 483. Let i = -17 - n. Is 22 a factor of i? False Let u(v) = -11v - 2. Let s be u(-3). Let r = s + -62. Let p = r + 129. Does 19 divide p? False Let b = -19401 - -30927. Does 102 divide b? True Suppose y + l + 4 = 0, -2y + 4 = y - 5l. Let r be -5 - 3/y-2. Is 64/(2 - (-12)/r) a multiple of 18? False Suppose -23z + 12z - 1870 = 0. Is 1804/10 + -1 + 68/z a multiple of 15? False Let h be 12(-2)/96. Is (133)/(31/h + 2) a multiple of 33? True Suppose -4w - 4f + 7 = 31, 5w = 2f - 2. Suppose -4i + 46 = -5p - 40, 5p + 50 = -5i. Is 18 a factor of (-270)/w + p + 11? False Let r(l) = -8l*3 - 23l*2 - 63l + 81. Let g(b) = -3b3 - 8b*2 - 21b + 27. Let z(k) = -11g(k) + 4r(k). Is z(8) a multiple of 23? True Does 24 divide (-4 - -116)/8(1916 + 16)? True Let v(k) = k2 - 3k - 16. Let o be v(6). Suppose -5b = -5q - b - 638, ob = -q - 136. Is 13 a factor of ((-62)/155)/(1/q)? True Does 4 divide 10/(-3) - (-22 + (-30226)/3)? False Let z be (2 - (-24)/(-15)) + (-426)/(-10). Let p = -38 + z. Suppose -4x = -2x + 2a - 8, -20 = pa. Is x a multiple of 3? False Is (616/126)/(-11) + (-3919)/(-9) - 3 a multiple of 9? True Suppose -r + 29 = 25. Suppose -rl - 19 + 445 = f, 2f = 5l + 813. Does 69 divide f? True Suppose 5s = -5q + 13108 - 4408, -s = 5q - 1724. Does 218 divide s? True Let m(b) = b3 - 16b*2 + 21b + 8. Let k be (1 - 2)/((-2)/4). Let i be ((-3)/k)/((-5)/50). Is m(i) a multiple of 38? False Let g(u) = -7u - 83. Let n be g(6). Does 50 divide (336/20)/(-7)n? True Let q = 155087 - 86519. Does 56 divide q? False Suppose 13n - 4m = 14n, 4m = n - 8. Suppose -nu = 3k - 3481 - 548, -3k = -3u + 3027. Suppose -6t = t - u. Is 24 a factor of t? True Let h be (24/15)/(2/(-5)). Let w be (287/(-28))/(1/h). Let z = w + -5. Is 9 a factor of z? True Let n(x) = 722x - 1521. Is n(8) a multiple of 115? True Let f be (-3 + -2 + 2)(-7)/(-21). Is 7 a factor of 8/(-3)(-345)/(-10)f? False Let h(p) = -p3 + 7p*2 + 2p - 9. Let c be h(7). Let l = 1252 + -692. Suppose 3q + 700 = 5x, -cq = -0x + 4x - l. Is 19 a factor of x? False Is 8/((-176)/77)((-12410)/14 + -1) a multiple of 18? False Suppose 4m - 5p - 34086 = 0, -11m + p = -7m - 34062. Is 66 a factor of m? True Let u(p) = -1170p - 976. Does 22 divide u(-2)? True Let l(j) = 203j + 2132. Is l(18) a multiple of 8? False Let n = 435 + 299. Let g = n - 354. Suppose k = 6k - g. Is 38 a factor of k? True Suppose -11w - 622 = -2239. Let u(p) = -7p - 8. Let g be u(-6). Suppose w + g = j. Is j a multiple of 13? False Let s(v) = -29v + 439. Let p be s(15). Suppose -1413 = -3t + 9o, 0 = 2t - po - 269 - 663. Is t a multiple of 22? False Let d(l) = -l*3 - 9l*2 + 28l + 389. Does 19 divide d(-21)? False Suppose 1138 = -49d + 3098. Let p = 272 + d. Is 12 a factor of p? True Let n(z) = 12z - 444. Let g be n(30). Let l be 2/3(-966)/(-4). Let i = g + l. Is 7 a factor of i? True Let m(i) = 11i - 147. Let o be m(15). Suppose 0 = ob - 9580 - 5936. Does 35 divide b? False Let g = 195 + -190. Suppose -c + 2 = 0, -5h + 0c + 1060 = gc. Does 14 divide h? True Suppose -4o = -16, -2k - 2194 = -4k - 2o. Let z = k + -594. Does 25 divide z? False Let b(k) = -84 + 48k + 43k - 6*k -	{ "pile_set_name": "DM Mathematics" }
5) - 1. 25 2 + (-5 - (3 - 10)) - 9 -5 Calculate -4 + -1 + 1 + 5 - -16. 17 Calculate -2 + -5 + (52 - 51). -6 Evaluate 9 - ((-6 - (-6 - -2)) + -34 + 33). 12 -7 + 45 + (-211 - -212) 39 What is the value of 17 + (-15 + 5 + -6 - -6)? 7 4 - ((3 - -7) + -14) 8 What is the value of (-67 - -50) + 25 + (-29 - (-2 + 1))? -20 What is -7 - 1 - (10 + (18 - 14) - 28)? 6 2 + -2 - (218 + -214) -4 Evaluate 14 + (-32 - -8) + 0. -10 What is 5 - (21 + -31 + 24)? -9 Evaluate (6 - (7 - -7) - 3) + 11 + -2. -2 What is -13 - -16 - (-4 - (-9 + (3 - 1)))? 0 (20 - 20) + (-2 + -5 - -27) 20 -6 + (1 - -3) + 1 + 19 + -9 9 Calculate 37 - (-33 + 68 - -28). -26 Calculate -5 - (9 + -11 - 5). 2 Calculate -14 + 12 + (18 - 12). 4 Evaluate (9 - (-13 - 27)) + -29. 20 Calculate 3 + (8 - (12 + (-8 - -4))). 3 -1 - (-1 - 1) - (413 + -418) 6 (3 + -2 - -2) + -6 -3 Evaluate (12 - -4) + (-7 - -3). 12 Calculate 12 + -1 - (-22 - -41). -8 What is the value of -14 - 2 - (47 + -68)? 5 Calculate (9 + -14 - (-7 + 0)) + -6 + -6. -10 What is (175 - 149) + 2 + -27? 1 Evaluate (-5 - (2 + -1)) + 0 + -2. -8 What is the value of 20 - (-4 - (4 - 19 - -15))? 24 -3 - ((31 - 1) + -64) 31 Evaluate -5 - 0 - (12 + -18). 1 What is (-9 - -7) + (-12 - (13 - -1))? -28 Calculate (-6 + -2 - -4) + 6 + -6. -4 Evaluate -32 + -1 + (0 - (-19 + (38 - 14))). -38 Calculate -32 + (62 - 24) - ((-2 - -1) + 5). 2 What is the value of 11 - (18 - 0) - -7? 0 Evaluate 6 - -1 - (6 + (-2 - 5 - 7)). 15 Evaluate -3 + 18 - (-3 - (-9 + 2 + 1)). 12 Calculate -19 + (-1 - 3 - -34) + -1 + 9. 19 (-40 - -8) + (-25 + 19 - -6) -32 What is the value of -3 + (-11 - (15 - 17))? -12 What is -1 - (-9 - (6 + 0))? 14 What is -103 + 110 - (-2 - -7)? 2 What is -223 + 236 - (8 + -1)? 6 -446 + 474 - (-5 + 6) 27 What is 6 - ((0 - (6 + -3)) + 6 - 8)? 11 What is the value of (2 - (5 + 1) - 10) + 5 - 4? -13 What is the value of 2 + (-1 - -2) + (49 - 53)? -1 Evaluate 1 - (7 + 7) - -2 - -20. 9 What is (4 - (1 - -3)) + (13 - 23)? -10 Calculate (-86 - -109) + (1 - (-4 + 2 - -4)). 22 Evaluate -11 - (1 - ((6 - 22) + 13)). -15 What is the value of -4 + -5 + -9 + 6 - 13? -25 What is (2 - (-2 + 9)) + (97 - (109 + -53))? 36 Evaluate -1 - ((-18 - 4) + 4 + 2 - -7). 8 Calculate -6 + (5 - (-9 + 19) - -8). -3 Evaluate (-8 - -4) + 0 + (-24 - -9 - -5). -14 What is the value of (-5 + (-4 - -2) - (53 + -38)) + 3? -19 What is (31 - 16) + -3 + -14? -2 What is (-121 - -116) + (2 - 0 - -6)? 3 Calculate (8 - 3) + (34 - 40). -1 2 + (-1 - 1) - (6 + (-21 - -16)) -1 What is (-1 - 6) + 9 + -2 + 2? 2 (3 - 1) + (-10 - -1) - (3326 - 3359) 26 What is the value of -15 + -2 + 9 + 4 + 1? -3 Calculate (-4 + 8 - 3) + (6 - (-9 + 8)). 8 Evaluate (8 - (3 + (3 - 5))) + -48 + 45. 4 Evaluate (5 - (-7 - (6 - 10))) + -4 - -8. 12 (-2 - (6 + 1 + -8)) + (3 - 0) 2 Evaluate 18 + -18 + 5 + -17. -12 What is 10 + -4 - ((6 + -2 - -1) + -10)? 11 -18 + (-14 - (-25 + 4)) + (-1 - 4) -16 Calculate -21 - (-10 + (-3 - -2)). -10 Evaluate 7 + (-3 + 16 - 3 - 6) + -6. 5 What is the value of (-1 - -4) + (-503 - -515 - (-1 - 1))? 17 (5 + -24 - -8) + 15 + -12 + 3 -5 270 - 282 - (0 - 25) 13 Evaluate 37 - 0 - (417 + -401). 21 Calculate 6 + (15 - (6 - 1)) - 15. 1 Evaluate -2 + (-3 - 5) + 4. -6 Calculate (-18 - (-25 - -7)) + (-1 - -5). 4 Calculate 0 + (-16 - -19 - 16). -13 Evaluate 1 - ((-9 - (-21 - -5)) + -11). 5 Calculate -9 - -5 - -1 - (-7 + -3 + 26). -19 What is the value of 7 + 5 - (-23 + 17)? 18 Calculate 22 + -14 + -12 + -16. -20 Calculate -7 + -1 + (0 - (11 + -21)). 2 What is 0 + (12 - (-9 - -27))? -6 Calculate -7 + (-7 + (9 - -2) - -5). 2 What is 11 + -14 + -3 - 1? -7 Evaluate -599 - -586 - (3 + 2 + -8). -10 (12 - 7 - -11) + -2 + -6 8 Calculate 8 - 18 - (-23 - -13) - 4. -4 What is 23 + 3 - (-201 - -238)? -11 14 + 12 + -18 + 16 + 0 24 What is the value of (-8 - 22) + (45 - 16)? -1 Calculate (4 - 12) + (11 - 3) - -7. 7 Calculate 5 - 0 - (7 + 1 - (-16 + 30)). 11 14 - (12 - (-4 + 7)) 5 3 - ((32 - 3) + -23) -3 What is the value of -2 - (1 + -10 + -10)? 17 Calculate 1 + -6 - (-1 + 2 - (32 - 32)). -6 What is -10 + 3 + 2 - (6 + -5 + 17)? -23 What is (9 - 28 - 21) + 22? -18 5 - (-22 + 23 + -10 + -2) 16 Evaluate 7 - -1 - ((-6 - 2) + 6 + -6). 16 What is 8 + -16 + 1 + -5 + 0? -12 What is 4 - (4 + 0) - (34 + -27)? -7 Evaluate (-2 - 5) + (1 - (8 + 8 + -28)). 6 Calculate 5 + -3 + -8 + -2 + -10. -18 10 - (15 - 1) - -18 - -11 25 (-6 + 1 - (7 + -21 - -16)) + -3 -10 Evaluate 24 + -22 - (15 + 1). -14 Calculate -7 - -14 - 6 - -8. 9 Evaluate -17 - (-26 + 8 + 1). 0 Evaluate -27 + (-21 + 73 - 26). -1 What is the value of (43 - (13 - 19 - -23)) + (2 - -9)? 37 Calculate 12 - ((-3 - -15 - -10) + -3). -7 Evaluate -14 + 1 - (25 + -9 + -11 - 1). -17 Calculate 8 + -5 + -31 + 20. -8 What is the value of -12 - (-1 + 6 + -16)? -1 Evaluate 20 + 0 + -1 - (-40 - (0 - 44)). 15 What is the value of (-14 - -22) + 4 - 13? -1 What is the value of -23 - (-5 + 3) - (-11 + 17 + -5)? -22 Evaluate 3 + -13 - -11 - 12. -11 Evaluate 0 + -10 - (-4 + 1 - (-3 - -4)). -6 Evaluate 1 - -6 - (283 + -260). -16 What is -1 - (0 + (2 + -1 - 7))? 5 What is -17 - (-11 + 16 + -12)? -10 50 - 107 - -47 - (1 + (-1 - -2)) -12 Evaluate (27 + -15 - 7) + 2. 7 What is (-32 - -10) + 11 - (-2 - 11)? 2 -5 - ((3 - 13) + -8) 13 Evaluate -7 + 5 + 9 + -2 + -8. -3 What is the value of (1 - (8 + 3)) + 2? -8 -112 - -111 - (1 + 0) -2 Evaluate -576 + 556 + (-3 - -8) + -1. -16 What is the value of -13 + -5 - (0 + 0 + -8)? -10 What is 13 + (4 - (1 - -13)) + 4? 7 Calculate (0 + 1 - 20) + 81 + -1 + -73. -12 Calculate -4 + 4 + 2 + 10 - (-262 - -298). -24 (0 - 5) + -3 + 9 + 1 + -1 1 Evaluate -2 + -7 + (20 - (22 - 14)) + -33. -30 Calculate (-15 - (10 - (11 - -13))) + 1 + 0. 0 What is the value of -5 + 8 + 10 + -2? 11 21 + -45 + 9 + 10 - (-5 - 1) 1 What is the value of (4 - -5) + 11 + -25 + -1? -6 What is the value of (-23 - -1) + 22 + (1 - 1)? 0 Evaluate -13 + (-2 - -10 - 1) + 11. 5 What is the value of 4 - (-4 + 14 + -14 + 10 + -2)? 0 Evaluate (2 - -1) + 273 + -283. -7 What is (-15 - -24 - (35 - 7)) + 7? -12 What is the value of (27 - 10) + -29 + 18? 6 What is the value of -8 - (-11 - -1 - (54 - 53))? 3 Evaluate (197 - 69) + -126 + (1 - 2 - -8). 9 Calculate -3 - 14 - (-7 + 7 + (-4 - -6)). -19 What is the value of 13 - (-8 - (-18 + 3)) - 3? 3 What is the value of -57 - -49 - (-1 + -13) - -9? 15 Evaluate (10 - ((-145 - -143) + -1 + 15)) + 9. 7 What is the value of (11 - (9 + -13)) + 7 - 5? 17 Calculate 19 + (-18 - -6) - (-4 + 13 + -4). 2 Calculate (53 + -20 - 23) + 7. 17 What is (-18 - ((-8 - 1) + 5)) + 4? -10 Evaluate (-216 - -219) + -1 + 1. 3 2 + (2 - (-1 - -5) - -7 - -14) 21 Evaluate 9 + (-22 - (-6 - 18)). 11 21 + 1 + -1 + -30 -9 (-30 - -20) + 8 + 0 + 30 28 Evaluate -2 + 13 - 0 - (-7 - 24) - 11. 31 What is the value of (-1 - -20) + (3 - 6)? 16 -8 + 4 - 0 - (-12 + -6) 14 Evaluate 3 - (2 - -7 - -2). -8 What is (-3 - 9 - -20) + (-8 - -3) + -8? -5 Calculate -142 - -126 - (-5 + -1) - (1 - -5). -16 -9 + -8 + (6 - (1 + -5)) + 7 0 What is the value of 15 - 1 - (-34 + 156 - 111)? 3 What is the value of 19 + -8 + -22 + 29? 18 Evaluate -1 - -3 - ((34 - 20) + -8) - 1. -5 Calculate 12 + 33 + -9 + -9. 27 Evaluate 9 - 1 - (-2 + (2 - -9)). -1 (-29 - (-28 - -14)) + 13 -2 Calculate (-16 - -5 - -9) + (-2 - -3). -1 Calculate 1 + (1 - 8) + -11 + -15 + 28. -4 What is the value of -4 - 13 - (14 - 30)? -1 17 - (24 - (20 - 24)) -11 Evaluate (-13 - -24) + -3 + 4. 12 Evaluate 2 + 12 + -2 + -22 - (19 + -1). -28 What is the value of 18 + -4 + 7 + -14 - (11 + 2)? -6 What is the value of -50 + (69 - 33) - (-21 - 1)? 8 What is the value of 5 - (0 - (-4 + -1))? 0 Calculate (24 - 34) + -16 + -1. -27 What is (-14 - (20 + -4)) + (14 - 2)? -18 Evaluate (-12 - -4) + 36 + -15. 13 What is 28 - ((23 - 17) + 9)? 13 Evaluate -4 + 10 + -3 - (5 + -10). 8 Calculate 27 - (15 + (-16 - -5) - -5). 18 What is the value of (15 - 1) + 12 - (-22 + 22)? 26 -16 + (8 - (-3 - 0)) + -3 -8 (-1 + 4 - 9) + -2 -8 -18 - (0 - (-23 - -39)) -2 What is the value of (3 + -7 - -8 - 0) + (-10 - -12)? 6 (-20 + 12 - -12) + -26 -22 Evaluate -32 + -1 - (15 + -38). -10 What is 24 - -1 - (-1305 - -1308)? 22 What is the value of 0 + 2 - (4 - 6 - -5 - -12)? -13 What is (3 - (2 - (-6 + 4))) + 0? -1 What is -9 + (4 - 0) + -7 + 3? -9 3 - ((4 - 1) + 0 - -4 - 18) 14 What is the value of (-	{ "pile_set_name": "DM Mathematics" }
Calculate 3.249155. 16.24575 Work out -0.4 -19.722. 7.8888 Work out 0.5 * 45093. 22546.5 Multiply -0.05 and -71.7. 3.585 What is 0.80342 times 3? 2.41026 -0.5 times 260 -130 674254 * 0.2 134850.8 -9.25 times -0.2 1.85 Work out 22 * -5376. -118272 0.023-17363 -399.349 201 -123.7 -24863.7 21 * 0.004226 0.088746 What is 8 times -54710? -437680 Calculate -0.57-0.03038. 0.0173166 Product of 3.70843 and 0.1. 0.370843 -0.29-64 18.56 Calculate 20-653. -13060 What is the product of 0.07597 and 31? 2.35507 Calculate -0.187196. -1.12314 Calculate -0.1-100.063. 10.0063 1 22.923 22.923 -1503642 -300728 0.21523 304.6 Calculate -5.8803590.1. -0.5880359 Product of -55.81 and -159. 8873.79 What is the product of -68.98 and 0.19? -13.1062 Multiply 3439.2 and -6. -20635.2 Work out 529 -1.24. -655.96 Multiply -0.1 and -73.82. 7.382 What is -1567 times -0.881? 1380.527 Calculate 220200. 40400 Calculate 40.0330.2. 8.0066 What is the product of 6 and 5018.07? 30108.42 -0.5 * 0.390905 -0.1954525 -10.2-0.0312 0.31824 -6 times 3.175 -19.05 What is 1.07 times -331? -354.17 0.4-379.342 -151.7368 Multiply -3 and -27025. 81075 Multiply 2079 and -10. -20790 Product of -0.9 and 10660. -9594 Multiply 2.024 and 0.5. 1.012 Multiply 0.9447 and 22. 20.7834 Multiply 6 and 0.0404625. 0.242775 Calculate -120-57. 6840 Work out -15767 -11. 173437 Work out 0.015 * 65. 0.975 Work out -1.321 * 0.125. -0.165125 What is 3985 times -1.72? -6854.2 What is the product of -0.009 and -0.01348? 0.00012132 8.72 * 0.237 2.06664 Work out 353.7 * 15. 5305.5 -275 times 1845 -507375 What is 0.3 times -288778? -86633.4 Work out 4 * 0.1117. 0.4468 0.5 times -15.9932 -7.9966 Calculate 0.21265.02. 55.6542 Work out 4295 0.03. 128.85 Calculate 11170.1648. 184.0816 -0.3954.46 -1.7617 193.0734 772.292 Work out -0.158 32. -5.056 -381775 -286275 Multiply -19 and 14151. -268869 Product of -3 and -1186.3. 3558.9 0.5 times -6.0412 -3.0206 What is 0.5 times 55340? 27670 163517 times -0.5 -81758.5 Work out 190 -406. -77140 Multiply 29 and 21379. 619991 223 * -9514 -2121622 -0.4762 * -4 1.9048 Calculate 0.1-37825. -3782.5 What is -355422 times 0.5? -177711 Calculate 12-20606. -247272 -215819 -122199 What is -5.6679 times -3? 17.0037 Work out 813 175. 142275 What is 7.7 times 8.487? 65.3499 Calculate -1.47-3779. 5555.13 What is 0.07 times -325058? -22754.06 3 0.083762 0.251286 Work out -0.3 * -140077. 42023.1 Product of -579.841 and 0.3. -173.9523 0.06390.4 0.02556 Product of -180 and 25. -4500 3 -113.427 -340.281 Product of -2314 and 0. 0 What is -0.394905 times -0.6? 0.236943 0.2 times -50.8219 -10.16438 335720.063 2115.036 Multiply -3 and 5.5807. -16.7421 Product of -2581 and -11. 28391 -0.34 3 -1.02 What is the product of -2 and -32219? 64438 What is -4 times 0.519516? -2.078064 Multiply 152 and -1.09. -165.68 Calculate -134.665. -673.3 What is 36913 times -25? -922825 Product of 7 and 143. 1001 What is -26 times 0.49? -12.74 Multiply 0.3 and -1170435. -351130.5 0.108 times -0.0003 -0.0000324 -0.25 -0.738 0.1845 What is -792.1 times 5.4? -4277.34 What is -98.79 times -10? 987.9 -844-441.9 372963.6 224.4837 times 3 673.4511 -0.5-168393 84196.5 What is 178 times -16782? -2987196 Multiply 6668.9 and -1.7. -11337.13 -5 times 0.58134 -2.9067 What is 1.44 times -17.18? -24.7392 What is 0.2 times 519.47? 103.894 What is the product of -959 and -26.7? 25605.3 Work out -4 * -53898. 215592 -36 * -4300 154800 Calculate 0.01-6.96198. -0.0696198 What is the product of 0.5 and -17387? -8693.5 0.1 times 15040 1504 280 times 0.05595 15.666 Work out -5 129320. -646600 Work out 39251 * 0.5. 19625.5 -781052 times -3 2343156 617730 * -3 -1853190 Multiply 182 and -0.12461. -22.67902 -42844 -18832 6070.5-4 -24282 4.19 * -1439 -6029.41 -57.1 times 49 -2797.9 Work out 1 * 2304.7. 2304.7 Work out 0.2 * 14497. 2899.4 What is 0.1 times -4179.6? -417.96 -9866 times -0.1 986.6 19587 * -0.115 -2252.505 13590 times -0.016 -217.44 Product of -19742 and 118. -2329556 471262 times 1 471262 Calculate 0.3-0.049015. -0.0147045 Work out 0.0171 -218. -3.7278 -74803 -33621 0.75 46.59 34.9425 What is -4 times -15.666? 62.664 What is -9 times 296819? -2671371 What is -169.8377 times 0.2? -33.96754 What is the product of -15366 and -0.2? 3073.2 Work out -10 * 2554. -25540 What is the product of 6.29 and -42? -264.18 -7 * -68426 478982 Calculate 0.5-257546. -128773 What is 2 times 15549? 31098 Product of -13 and 0.092448. -1.201824 -4.41066 times 0.1 -0.441066 Work out 376227 0.3. 112868.1 What is the product of -77834 and -3? 233502 -15 times 0.31414 -4.7121 Product of -28736 and 0.4. -11494.4 Calculate -0.049488-0.1. 0.0049488 Product of -0.3625 and 3.2. -1.16 0.839 0.3306 0.2773734 What is the product of 0.12 and -30424.8? -3650.976 What is 130 times -0.2895? -37.635 0.048 * 36554 1754.592 Calculate -0.93-9.962. 9.26466 32-0.07677 -2.45664 35039 times 0.2 7007.8 What is the product of -3663 and -63? 230769 What is the product of 103671 and 0.08? 8293.68 Work out -22.16 * -0.31. 6.8696 Multiply -1.91282 and 9. -17.21538 Calculate 45932-0.5. -22966 What is the product of -2 and 43695? -87390 3313.71 3313.7 86.9292 173.858 -57-541.1 30842.7 What is 10 times -3.64046? -36.4046 19.9 * 1.63 32.437 What is -109 times 8437? -919633 What is the product of -0.168 and -154.84? 26.01312 Multiply 4531 and -18. -81558 -442 times -87.37 38617.54 Product of 42378 and -6.3. -266981.4 73872 * -0.2 -14774.4 -0.218 times -1067.1 232.6278 Calculate 2.6-0.03675. -0.09555 What is the product of -0.060565 and 3? -0.181695 Work out -0.0015 0.065. -0.0000975 483 times -2617 -1264011 What is the product of -170145 and -3? 510435 Work out 109 * 0.138. 15.042 Product of 1.2 and 398.46. 478.152 Multiply 3.24 and -0.753. -2.43972 Work out -0.2 * 0.070537. -0.0141074 Product of -12.219 and 0.14. -1.71066 -0.03 times 22791 -683.73 What is the product of 1.6 and -385? -616 -100295.5 * -0.3 30088.65 Work out 41338 * -1.02. -42164.76 -28330.04 -113.32 Calculate 5-13660. -68300 Work out -132 * -46. 6072 Product of -4296 and -0.09. 386.64 What is the product of 653930 and -2? -1307860 Product of -12 and -0.026763. 0.321156 Multiply 0.07 and -0.1138. -0.007966 Product of -339 and 258. -87462 What is the product of -3 and 1457.33? -4371.99 -37 * -5204 192548 0.033 * 8.061 0.266013 Calculate 799628-0.4. -319851.2 Product of 3.82 and 20.5. 78.31 -0.5 16924 -8462 2444.6 times -9 -22001.4 Work out -13 * -471. 6123 81108.61 8868.88 Calculate -250.4-121. 30298.4 What is the product of 51.003 and -0.4? -20.4012 What is the product of 1.8405 and 0.09? 0.165645 -8 * 0.018547 -0.148376 -32019.8 -6059.4 What is the product of 78 and -2659? -207402 Multiply 5.63 and -43. -242.09 Product of -397 and -359.3. 142642.1 2796.4 -9 -25167.6 11.09-356 -3948.04 Work out 875583 5. 4377915 Multiply -334 and 1894.3. -632696.2 What is 0.017 times -68? -1.156 -0.075847 times 0.5 -0.0379235 What is the product of -7043.5 and -0.3? 2113.05 What is 2.859 times 40? 114.36 Product of 2181 and 0.13. 283.53 Multiply 0.02 and -40211. -804.22 -88 * 0.778 -68.464 What is the product of -341 and -149? 50809 -411987 -47948 82635 0.5 41317.5 Work out 5 * -565476. -2827380 Multiply 32.24 and -0.5. -16.12 Calculate 16306.134. 65224.52 22365 times 0.2 4473 1073.32-0.02 -21.4664 Multiply -0.465297 and -4. 1.861188 -0.5599-0.21 0.117579 What is 1235437 times -6? -7412622 Multiply -0.53904 and 2.3. -1.239792 Work out -5 48677. -243385 -72 * -0.6751 48.6072 623 * -4769 -2971087 -46805 * -5 234025 What is the product of -118 and -3696? 436128 What is the product of 40278 and -3? -120834 What is the product of 1 and 478.94? 478.94 -1286732 -1040784 Product of -374 and -1448. 541552 What is 1.1 times -0.25872? -0.284592 Product of -0.02 and 2.654. -0.05308 Multiply -73114 and -5. 365570 28824.15 144120.5 Work out -0.072376 * -5. 0.36188 Multiply 9 and -0.6645. -5.9805 Product of 9 and -6997. -62973 Multiply -0.190974 and -2. 0.381948 2-96994 -193988 What is the product of -0.010363 and -39? 0.404157 What is the product of -121702 and -0.05? 6085.1 -24314.7 -3572.1 Product of 537 and -3894. -2091078 6205*-2 -12410 What is 10 times -6	{ "pile_set_name": "DM Mathematics" }
Evaluate 4847/(-2882) + 3 + (-21)/6. -24/11 Calculate (-35629)/(-4059) + (0/2 - 2/(-9)). 9 What is the value of -3 - ((-133)/14 - -9) - 6/(-4)? -1 What is 22/((-242)/99) - (-1 + 0)? -8 Evaluate (6/25)/(120/200). 2/5 (-56)/(-60)740/(-518) -4/3 What is 550/(-110) + (-12)/(-2) - (2 - 2)? 1 (22/(-4))/((12/8)/3) -11 5/((-582)/(-36) - 12) - 76/55 -2/11 (-8)/(-2) + (-7)/91-143 15 What is the value of 1298/(-11033) + 2(-166)/68? -5 Calculate 5/(-25)3 + (-132)/30 + 6. 1 What is -13 + (54/144)/(60/2128)? 3/10 What is -1 + (-13 - 0) + 1368/36 + -38? -14 Calculate (-7 - 9) + (-414)/(-26). -1/13 (-237 - -203)3/6 -17 (-1027)/143 + 7 - (6870/(-1122) - -6) -1/17 What is ((-50)/15)/((-790)/90 - -9)? -15 What is the value of 2(2 + 5 + -3) + -11? -3 Evaluate 32((-14432)/1599 - -9). -2/13 (19/(-5) - (-48)/12)/(-1) -1/5 What is the value of 6((-32 - -15) + 16)? -6 Evaluate (-14)/(-21) + 112/120. 8/5 What is the value of 2/9 + (-112)/28 + 6/(-27)? -4 Evaluate 21 + -49 + 17 + 170/14. 8/7 Calculate -5 - (0 - -8) - 630/(-48). 1/8 What is the value of (-9)/13(-9880)/22800? 3/10 What is 139 + -138 + (-41)/(-2) - -6? 9 Evaluate 6 + -15 + 686/56. 13/4 What is the value of (0 + 4)(1 - 0) + 3? 7 Calculate (0 - 9/(-12))/((294/(-24))/7). -3/7 What is -2(10/(-6))/(55/(-66))? -4 Calculate -3 + 10 - (-369)/(-41)(-6)/(-27). 5 Calculate (-1(-1 + 2))/((-3710)/(-1590)). -3/7 Calculate (-1534)/1239 - 12/(-21). -2/3 Evaluate ((-7)/28 + (-266)/(-8))17/51. 11 What is 38/95 + 146/10? 15 Evaluate 140/40(-1 + 3) + 1-3. 4 What is 4/6 + (28/(-35))/(63/75)? -2/7 Evaluate (-24)/728010-13. 3/7 Calculate (7 - 737/110)/((-11)/((-990)/(-24))). -9/8 Calculate 14 - (-15 + 6) - 2. 21 Calculate 92/7084 - 3/(-11). 2/7 Evaluate (19 + 7230/(-380))(4 - 0). -2/19 (-10 - 780/(-96))-4 15/2 What is the value of (550 - 551)(1 - 24)? 23 What is the value of ((38/(-10) + 4)25/15)/8? 1/24 Evaluate 3/(-6)(-21)/((-210)/100). -5 Evaluate 4350/(-10150) - (-178)/350. 2/25 Calculate (32/(-24))/((-76)/(-114)). -2 What is the value of ((-9307)/(-246) + -37)63/15? 7/2 What is 6/8 + 2125/500? 5 Evaluate ((-4)/(-5))/((-1240)/11625). -15/2 What is -16 + -6 + (-49)/(-7)? -15 What is the value of -4 - 176/(-56) - 1/355? -1 345/(-345)1/(-6) 1/6 What is the value of -11 + 837/(-45) - -28? -8/5 -4(143/52 + -5) 9 What is (-11 + -2)/((-9 - -6) + 2)? 13 Calculate (-9)/((900/(-55))/20). 11 What is ((-583)/(-44) + -12)(-40)/(-15)? 10/3 Calculate (147/30)/(-7)((-989)/(-69) - 16). 7/6 Evaluate 153/21 + (13 - (-1116)/(-84)). 7 What is (-60)/(-5) - 3/((-438)/(-1756))? -2/73 Calculate 74/(-325) + (952/221 - 4). 2/25 What is 493/(-170) + (16/(-4))/40? -3 (-8188)/623 + 1/7 -13 What is the value of (-1)/(9/2) + (-8)/((-288)/332)? 9 What is ((-174)/(-12) + -7)/(0 - 6/8)? -10 What is the value of 168/(-20)(-785)/471? 14 (-2146)/185 - (-5 - 6) -3/5 (-9)/(378/(-6))-2(-45)/(-10) -9/7 ((-4)/14)/(9 + (-4850)/525) 6/5 50/(1500/(-405)) - -13 -1/2 ((-8)/294)/((-3074)/10759) 2/21 Evaluate (-19 - (-1591)/74) + (-198)/76. -2/19 78/(-9) - (-53)/(-159) -9 Calculate ((-10)/27)/(((-50)/60)/1). 4/9 Evaluate 18((-40)/(-5) - 90/12). 9 Calculate (-225)/(-189) + 3/(-63) + 21/147. 9/7 What is -5 + 0 + -13(-8 + 28/4)? 8 Evaluate 19 + (-31 - -7) + (-15)/3. -10 What is (-2)/235((-1200)/15)/16? 2/47 What is the value of 70/1960((-588)/(-16))/(-7)? -3/16 Calculate 319/(-145)45/(-9). 11 Evaluate -21 + 96/6 + (392/7)/(-7). -13 Calculate 663/21 + (-7974)/3101. 29 1/2 - (68/24 - 3)-57 -9 Evaluate 9/(900/20)-2. -2/5 33/(-4)(676/(-507) - (-10)/6) -11/4 What is 945/90(-16)/56? -3 What is ((-4)/(-26) - (-39650)/5915)294/63? 32 What is ((-10)/(-8))/(5/(-20)) + (-6 - -10)? -1 Evaluate (-4)/((22/2)/(4/(-1))). 8 What is the value of (-8)/76 - (-7920)/(-31977)? -6/17 Calculate ((-360)/27)/20(630/(-12))/(-7). -5 What is 415/(-255) - (-69 + 74)(-2)/6? 2/51 What is the value of (-288)/12 + 50 - (2 - -9)? 15 What is (-48)/28588/(-378)? 8/3 Calculate (-232)/(-80) - (-2 - -5 - (2 - 2)). -1/10 (-3 + (-8)/(-3))/(22/(-12)) 2/11 Evaluate -15 + (-332)/160-8. 8/5 What is (-86)/(-22) + 2 + -2 + -4? -1/11 What is (-9)/(-6)(-1)/66(-68)/34? 1/22 24/228152(7/(-2) - -2) -24 -2((-2)/(-4) + -1)2 2 (-1998)/216 - 119/(-28) -5 Evaluate 26/65 - (-18)/5. 4 What is (91/182)/((-14)/(-4))? 1/7 Calculate (-112)/(-21) + 85/(-17) - 7/9. -4/9 What is (-8)/44 - (1029/(-154) + -5)? 23/2 What is the value of (4 + (-33)/6)(-44)/594? 1/9 Evaluate (25 - 153/85) + -24. -4/5 What is ((-16)/(-720)-9)/(12/45)? -3/4 Calculate (-14)/4(-468)/126. 13 Evaluate 14 + 4 + (-1767)/95. -3/5 What is ((-26)/325)/((-72)/60)? 1/15 What is 84295/2932 - (-4)/(16/(-3))? 28 Calculate (1 - (-92)/(-144)) + (-61)/244. 1/9 Calculate -3-515/(-25). -9 Evaluate -25 - (9 - 20) - (-47)/3. 5/3 (32/(-22))/4(-3)/(-18) -2/33 9/(-15)2440/1098 + (-62)/3 -22 What is 36/(-32)2660/(-630) - (-5)/4? 6 Calculate (224/(-1232) + 79/495)(-63)/42. 1/30 What is the value of ((-6)/(-63))/(244/(-1281))? -1/2 24/40(5 + 2) - 0/(-365) 21/5 Calculate (16 - 14) + (-3 - (-17)/15). 2/15 What is the value of (-10)/((-80)/(-6))(-110)/231? 5/14 Evaluate 8 - -12 - 38406/1924. 1/26 What is ((-65)/(-10) - 7)45? -10 Calculate ((-2)/1)/(5-310/75). 1 Evaluate -240/4028019. -2/53 -10(-12 + (-28)/(-14) + 11) -10 8/(-80)-6 + (-14)/(-35) 1 Evaluate (124/50 - 2)/((-78)/(-130)). 4/5 What is (-6)/(-6)(-15)/(-9) + 18 + -21? -4/3 What is 20(144/40)/(-9)? -8 What is the value of (4/(-40))/((-12)/(-80)10)? -1/15 What is the value of ((-8)/(-60))/((-4)/(-3)45/100)? 2/9 What is the value of 8/88 + 765/55? 14 What is the value of ((-12)/(-18))/((-1)/(-18))? 12 (-1)/(-2) + (70/4 - 18) 0 What is (-6(-18)/(-189))/(5/(-70))? 8 Evaluate 414/(-2184) - 34/(-221). -1/28 Evaluate (-120)/28 - -2(-6 - -8). -2/7 Calculate (-99)/252 - (2 + 45/(-21)). -1/4 What is the value of 3/(-30)(-2 - 0) - (-25)/(-125)? 0 (-9)/(-5)5 + (-171)/21 6/7 What is the value of (2(-1)/(-2))/(3(-22)/(-12))? 2/11 Evaluate 170/50 + -18 + 16. 7/5 10 + 44 + -3 + -25 26 Evaluate (14/(-154))/(16/(-792)3). 3/2 What is ((-6)/26)/(14 - 13 - -2)? -1/13 What is 2/(-9) + (24/(-48))/((-27)/66)? 1 What is ((-12033)/840 - (-3)/15) + 14? -1/8 Evaluate (((-4)/(-10))/((-54)/135))/(20/(-32)). 8/5 What is the value of 15/(-10)85/102-8? 10 (34(-6)/30)/((-4)/10) 17 What is (-8)/(-1845) - (-39 - 1753/(-45))? 2/41 Evaluate (31 + 16/(-40)15)(4 + -3). 25 115/69 - 62/(-6) 12 What is ((-12)/5)/((-6424)/(-5840))? -24/11 Evaluate 16/(-136) + 64/(-34) + 35 + -43. -10 What is the value of (25 + (-2336)/96)15? 10 Calculate (-2972)/185755/2. -2/5 What is (-196)/(-147) - (-490)/(-345)? -2/23 What is the value of 11/77 - (48/6 + -8)? 1/7 940/(-94)24/(-70)(-7)/2 -12 What is the value of (-1 - (-4 - 1)) + 294/(-77)? 2/11 Evaluate (567/243 - (-2)/(-6)) + -13. -11 (-5678)/835(0 + 3/(-6)) 17/5 What is 76/((-4)/8 + (-225)/(-50))? 19 What is (4/(-6)1/2)/(-4 - 0)? 1/12 What is the value of (-6 - (-14 - -12))3(-1)/6? 2 Evaluate 166/(-415)410/36 + 16/4. -5/9 What is (-222)/1482/5? -3/5 Evaluate 69/(-21) - -2 - (-140 - -139). -2/7 What is the value of 2/((-108)/(-9))12? 2 Evaluate 30 + 168/(-28) + 10. 34 Calculate 70/(-8)(-24 + (-17 - (-207)/5)). -7/2 Evaluate (-1 + 276/168)(-8)/4. -9/7 Evaluate (2870/(-4305))/((-2)/102). 34 What is the value of ((-6)/9 - (-652)/888)382/(-955)? -1/37 Calculate -82/477/(-14). 22 -1 + ((-3)/(-36)3)/(364/2080) 3/7 Evaluate ((-242)/33)/(2/5418). -11 What is -6 + 92/(-69) + 10? 8/3 What is the value of 935/(-10)-11(-16)/(-44)? 34 Evaluate (1(-5)/(-30))/((-10)/1204). -1/2 What is the value of ((-186)/70)/(11/55) - -12? -9/7 30/6 + -14 - (48/(-3) + -3) 10 What is the value of (-801)/(-534)2/(-4) - 10/8? -2 What is the value of (-3 - 98/26) + -777 + 784? 3/13 What is the value of (-1 - 8) + 569/42? 3 Evaluate ((-7)/14)/(83/(-996)). 6 Evaluate 3 + (59/19 - 26/247 - -4). 10 What is ((-32)/16)/((-16)/(-56))? -7 What is the value of (9 + 245/(-28))(-13488)/(-372) + -9? 2/31 Evaluate -15((-145)/(-15) + -8) + 8 + 0. -17 Calculate 16/(-6) + ((-441)/27 - -16). -3 (-3 + 0)(24/180 + (-48)/(-15)) -10 Evaluate 45 - 50 - ((-4)/(-1) + -12). 3 What is the value of -3*(10 + 11 - 11)? -30 Evaluate -6 + ((161/21)/(-1) - (-1)/(-3)). -14 Calculate ((-9)	{ "pile_set_name": "DM Mathematics" }
- 1. Let i be u(-1). Suppose h - 3 = 4o + i, -3h - 12 = 5o. Suppose 0m + m = 0. Put m, 2, o in decreasing order. 2, m, o Let t = -14.7 - -14. Let o = -0.4 - t. Let a = -0.0096 + -1.9904. Put a, -5, o in increasing order. -5, a, o Let z = -43 - -42. Put 7, 4, z in descending order. 7, 4, z Suppose 1 = b - 3x, 0x - 6 = 2b - 2x. Suppose 6h - 12 = 2h. Put b, h, -2 in descending order. h, -2, b Let v = -3.15 - -0.15. Let s = 1 + -0.9. Put -2/7, v, s in descending order. s, -2/7, v Let i = 0 + -2/9. Let u = -0.06 - 0.04. Sort i, -5, u in descending order. u, i, -5 Let l(f) = 4f + 1. Let g be l(1). Suppose 0 = 2o + 184. Let b = o - -553/6. Put b, g, -2 in decreasing order. g, b, -2 Let l be (6 - 7)/((-1)/5). Sort l, 0, 16 in decreasing order. 16, l, 0 Let q(x) = -3x2 + 10x + 1. Let u be q(5). Let m be 4/3u/16. Put 3, m, -3 in ascending order. -3, m, 3 Let t(c) = -c3 + 4c2 - c + 4. Let q be t(4). Let x(a) = a3 + 2. Let b be x(0). Sort -1, q, b in ascending order. -1, q, b Suppose 11y - 12 = 7y. Suppose -y = -3i - 6. Let a be 15/64/5. Sort i, a, -2 in decreasing order. a, i, -2 Let i = -157/56 + 19/8. Let b = -4.271 - -0.271. Sort -1/5, b, i in decreasing order. -1/5, i, b Let p(m) = -m*3 - 8m*2 + 10m. Let f be p(-9). Sort f, 3, -0.2 in increasing order. f, -0.2, 3 Let j(o) = o*2 + 9o - 10. Let i be j(-10). Let b be (-6)/(-12)(1 + i). Let r = -0.9 - -0.7. Sort -0.3, b, r in descending order. b, r, -0.3 Let x = 1 + -2. Let t = x - 0. Let j = 3.6 - 3.9. Sort -4, t, j in descending order. j, t, -4 Let u = -28 + 30. Put 0, u, -3 in descending order. u, 0, -3 Let b be 5/(-5 - 18/(-4)). Sort b, 1, 3. b, 1, 3 Let b = -103 + 108. Sort -4, 3, b, 2 in decreasing order. b, 3, 2, -4 Let t(u) = 8u*2 - 2u + 2. Let d be t(3). Suppose -2r + 61 + 9 = 2f, -2f - 4r = -d. Suppose -11 = -5z - f. Put 1, 4, z in descending order. 4, 1, z Let w(d) = -d2 - 3d + 12. Let z be w(-5). Put -4, z, -2, -1 in descending order. z, -1, -2, -4 Let y = -13/3 + 5. Put -5, y, 1 in descending order. 1, y, -5 Let b = 86 - 77. Put -2/9, -2, b, 2 in increasing order. -2, -2/9, 2, b Let v(p) = p*3 - 7p*2 + 8p - 9. Let c be v(6). Let j = 6 - c. Let g = -5 - -10. Sort g, j, -3 in decreasing order. g, j, -3 Let c = -40 + 40. Sort -96, -4, c in decreasing order. c, -4, -96 Let u be (-4)/(-18) + (-6)/27. Suppose u = -w + 1 + 2. Let h be ((-2)/92)/14. Sort 5, h, w in decreasing order. 5, w, h Let s be (-111)/21 + 2/7. Suppose 2 = q - 2d - 7, 3d = 2q - 16. Let g be 2/(1/((-6)/(-4))). Sort q, g, s in decreasing order. q, g, s Let d be ((10/21)/5)/(5/(-15)). Put -0.1, 0, d, 2 in increasing order. d, -0.1, 0, 2 Let u be 1514(21/(-22) + 1). Let q = -69 + u. Sort 2, q, 0.5 in descending order. 2, 0.5, q Let s(g) = g - 2. Let f be s(4). Let c = 3 - 6. Suppose -3u - 7 + 10 = 0. Put u, f, c in descending order. f, u, c Let y = 2 - 7. Let z(n) = n + 7. Let h be z(-4). Suppose 0 = 3u + h. Sort 2, u, y. y, u, 2 Suppose -3z + 7 = c, c = -z - z + 3. Let n(w) = -w*3 - 4w*2 + 4w - 3. Let p be n(-5). Let u = 2 - p. Put 3, c, u in descending order. 3, u, c Suppose -5i - 7 = -0q - 3q, 5 = -i. Let k(z) = -z3 + 4z*2 - 2. Let r be k(4). Put q, -4, r in increasing order. q, -4, r Let w(g) = -5g. Suppose 5t + 0t = 15. Suppose -ty + 4 = y. Let l be w(y). Sort -2, 0, l in decreasing order. 0, -2, l Let v be (-2)/7 + (-66)/14. Let c = 25 - 21. Sort c, v, -2 in descending order. c, -2, v Let f = -0.22 - -0.36. Let d = 4.14 - f. Put d, 0.2, -2 in descending order. d, 0.2, -2 Suppose 0 = 2z + 3z - 45. Let n = -7 + z. Put n, 4, -3 in ascending order. -3, n, 4 Let k be ((-3)/9)/((-3)/9). Sort 0, 4, 3, k in decreasing order. 4, 3, k, 0 Let f = -10 + 13. Suppose 5j - 5 = 3n - 21, 5n + 25 = -2j. Sort j, f, 5. j, f, 5 Let p = -2 - 0.5. Let s = -3 - p. Put s, 3, 1 in ascending order. s, 1, 3 Let m(r) = -r2 + 4r + 2. Let b be m(3). Let q be 6/15b1. Put 1, q, -3 in decreasing order. q, 1, -3 Let w = 6 - 23/4. Let l = 0 - 3. Put w, l, 0.3 in descending order. 0.3, w, l Let i = -3.85 + -0.15. Suppose 4z + 8 = y - 3, 0 = y + 4z + 21. Sort i, -4/5, y in decreasing order. -4/5, i, y Let j = 40 - 37. Sort 5, j, -2, -0.08 in increasing order. -2, -0.08, j, 5 Let g = -0.1 + 4.1. Let u = 4.4 - g. Let z = 2 - 0. Put z, -1/2, u in ascending order. -1/2, u, z Suppose 3v - 6 - 7 = 2g, 4v + 11 = -3g. Put 4, g, -1 in increasing order. g, -1, 4 Let g = 97/7 + -14. Sort g, 2, -0.2 in increasing order. -0.2, g, 2 Suppose 0 = 4s + h - 8, -5s - h = -0h - 10. Suppose -5t + 14 = -0t + 3g, -5t + g + 2 = 0. Sort 0, s, t in descending order. s, t, 0 Let j = 0.04 - 0.1. Sort -1/3, -5/4, j. -5/4, -1/3, j Let q = 66 - 69. Put -1, -4, q in ascending order. -4, q, -1 Let l = 2/177 - -694/1239. Let d = -0.1 + 0.6. Let k = 80.4 + -80. Sort l, k, d. k, d, l Suppose 2 = m + 4x - 6, 3x - 6 = -5m. Suppose m = -4q - 16 - 4. Let f = -56 + 277/5. Sort 3, q, f in ascending order. q, f, 3 Let s = -5.65 + 6. Let y = 0.05 - s. Let q = 4.064 - 0.064. Put q, y, 0 in descending order. q, 0, y Suppose -3b + 6 = -5o, 4o = b + 2b - 6. Suppose -bx - 8 = -4x. Sort 0, 3, x. 0, 3, x Let o(a) = a. Let k be o(-2). Suppose 0 = 2n + n - 5c - 8, -5n + 3c = 8. Let r = n - -4. Sort r, 1, k in descending order. 1, r, k Let y(c) = -c2 + c + 1. Let r be y(1). Let g = 2.03 + -0.03. Let f = 1.9 - g. Sort 3/5, f, r in ascending order. f, 3/5, r Let x = -14 + 10. Sort 1, x, -0.4 in decreasing order. 1, -0.4, x Let n be 10/(-12)18/(-120). Sort 10, -0.1, n in ascending order. -0.1, n, 10 Let a = 0 - -0.9. Let v = a - 0.6. Let k = 25.5 + -25. Sort k, 5, v in ascending order. v, k, 5 Let k = -146 - -150. Sort k, -1, 0, -8 in descending order. k, 0, -1, -8 Let c be (1 + -3)25/10. Let i be 2/c - (-18)/(-5). Let y(h) = 2h - 3. Let b be y(4). Put i, 1, b in ascending order. i, 1, b Let f = -1.67 - 20.13. Let c = 22 + f. Sort -4, c, 0.1. -4, 0.1, c Let v(j) = -j*2 - 4j - 4. Let t be v(-3). Let c = -1 + 1. Let d = 44 + -40. Put t, c, d in increasing order. t, c, d Let y = -0.14 - -0.14. Put -1, y, 5, 12 in increasing order. -1, y, 5, 12 Let b = 0.7 + -0.2. Let z = -4.1 - -6. Let u = z - 2. Put 4, b, u in increasing order. u, b, 4 Let h be (-3 - -1) + 5 + -3. Let m be (-11)/5 + 4/20. Put h, -5, m in descending order. h, m, -5 Let m = 17 - 6. Suppose 3 = 2b + m. Sort 2, 0.2, b. b, 0.2, 2 Let c(o) = o2 + o + 3. Suppose -l + 4 = -1. Let x = -5 + l. Let h be c(x). Put -1, h, 5 in descending order. 5, h, -1 Let h = 36 - 24. Let g = 1.71 - -0.29. Sort h, g, 5 in descending order. h, 5, g Let l = -112 + 107. Sort 12, -3/2, l in decreasing order. 12, -3/2, l Let s = -7.61 + 8. Let a = -0.11 - s. Sort -4/5, 0.1, a. -4/5, a, 0.1 Suppose 0p + 2 = -p. Let r = p - -5. Suppose 2l = 4u + 14, -3u = -2l + 2u + 18. Sort r, l, 5. l, r, 5 Let a(x) = x3 - 5x*2 + 4x - 5. Let b be a(4). Let r be 6-1(-3)/6. Let h be ((-2)/4)/(r/6). Sort h, b, 3 in increasing order. b, h, 3 Let s be (-4)/(-6)(-5 - 1). Put -8, s, 3 in increasing order. -8, s, 3 Let l(v) = 2v + 1. Let p be l(11). Suppose -4d - p = 5m, 0 = 2m - m + 3d + 9. Let b(k) = k*2 - 13k - 4. Let f be b(13). Sort f, m, 5. f, m, 5 Let a be (-134)/(-46) + (-15)/5. Put 0.5, -2/11, a in increasing order. -2/11, a, 0.5 Suppose 3n + n - 12 = 0. Let s = 81 + -80. Suppose -5m + 5t - 2 = 13, 4m + 28 = -4t. Sort s, m, n in ascending order. m, s, n Let r = 6.59 - 7.1. Let h = -0.01 - r. Sort -1/2, 3/4, h in descending order. 3/4, h, -1/2 Let t = 10 - 15. Let h(v) = -v3 - 7v*2 + 4. Let f be h(-7). Let n = 0 - 0.3. Sort t, n, f in decreasing order. f, n, t Let m = -64 - -69. Sort -5, -1, m. -5, -1, m Suppose -24 = 4t - 3y, t - 3 = -2y + 2. Suppose -5d + 2 + 119 = 4k, -20 = -5k. Suppose -22u + du - 2 = 0. Sort t, u, 3 in increasing order. t, u, 3 Suppose 0 = 3r + 5w - 1, 0r + r + 3w - 3 = 0. Let k = r + 2. Suppose -9 = -l - 4. Put -2, k, l in descending order. l, k, -2 Let v = -131 + 136. Sort v, 0.4, 0.3, 0.07 in descending order. v, 0.4, 0.3, 0.07 Let w = 2.4 + 0.6. Let g = w - 6. Let u = g - -1. Put u, -0.4, -4/3 in descending order. -0.4, -4/3, u Let d(p) = p3 - 3p*2 - 10p + 1. Let m be d(5). Put 0, m, -4 in descending order. m	{ "pile_set_name": "DM Mathematics" }
)? 6 Let f be (1 - (-8)/(-2))/(18/(-60)). Suppose u - 2c = f, 2u - 53 = -2u - 5c. Suppose -uy = -14y + 248. What is the hundreds digit of y? 1 Suppose -13f + 0 = -0. Suppose f = -5u + 4r + 562, -2r - 211 = -2u - 5r. What is the hundreds digit of u? 1 Suppose -6h + 4p = -4h - 129038, 322550 = 5h - p. What is the ten thousands digit of h? 6 Let q(t) = 19t2 + 5t + 5. Let j be q(-4). Suppose -4p + j = -191. Suppose 60 = 6b - p. What is the units digit of b? 0 Let z be (-11)/4 - -3 - 43/(-4). Suppose -3s - 5g = z, -s = -3s - 4g - 10. What is the units digit of (990/75)/(s/20)? 8 Suppose -18p + 10 = -23p. Let y be (-3)/(-3) - (p + 4 + -1). Suppose yd = 2d - 6. What is the units digit of d? 3 Suppose -213u + 199u = -501522. What is the hundreds digit of u? 8 What is the hundreds digit of (-2026)/((2/10-3)/(402/335))? 0 Let l(m) be the third derivative of m6/120 + 2m5/15 - m4/12 - 17m3/6 - 70m2. What is the tens digit of l(6)? 7 Let z(n) = n3 - 13n2 + 13n + 26. Let d be z(11). Let b = d + 75. Suppose s + 105 = bs - 2k, 2s = 2k + 202. What is the tens digit of s? 9 Let d(u) = u*2 - 2u - 13. Let q(o) = 105o2 - 3o + 3. Let j be q(1). Let l = j - 95. What is the tens digit of d(l)? 6 Suppose 0 = -26i + 39i - 21840. Suppose -32l = -42l + i. What is the hundreds digit of l? 1 Let w = -37 + 40. Suppose -4b - 623 = 5h - 0h, -b = wh + 378. Let g = -12 - h. What is the hundreds digit of g? 1 Suppose -w + 15h - 14h = -30348, -14 = 2h. What is the hundreds digit of w? 3 Let m(q) = 6q*3 + 3q*2 + q + 31. Let l be m(9). Suppose -19x = -19534 + l. What is the hundreds digit of x? 7 Let q be (-5 - -1)/(-18 + 19). Let i(y) = -351y - 114. What is the tens digit of i(q)? 9 Suppose -3d - 285 = 3z + 426, 5d - 703 = 3z. Let i = z + 513. What is the tens digit of i? 7 Suppose 99 = -4z - p, 0 = -5z + 4p - 432 + 324. Suppose -2f + 1000 = y + y, 0 = -4y + 3f + 1972. What is the units digit of 3/(-2)y/z? 1 What is the units digit of -5((-162)/(-15))/(11/(-803))? 2 Suppose 0 = -298j + 295j + 11961. What is the thousands digit of j? 3 Suppose -2f = 4m - 44476, -m = 47f - 51f + 88907. What is the units digit of f? 8 Let c(i) = -4i*3 - 2i*2 - 7i - 12. Let d be c(-2). Suppose 10w + 4576 = dw. What is the hundreds digit of w? 2 Let h = -2309 - -6088. What is the tens digit of h? 7 Let n = -361 - -621. Let q(d) = 123d2 + 24d + 23. Let b be q(-1). Suppose 4u - n = -4w, w + 4u = -w + b. What is the tens digit of w? 6 Suppose 13j - 14 + 1 = 0. What is the tens digit of (2 + 425)1 - j? 2 Suppose -z + 24 - 20 = 0. Suppose 5c = -3s + 339, -zs + 481 = -3c - 0c. What is the hundreds digit of s? 1 Let q(a) = -12a - 46. Suppose 14u - 68 = -3u. Suppose -2b = -uy - 12, 7 = -5y - b - 15. What is the units digit of q(y)? 2 What is the tens digit of ((-2)/((-2)/(-25171)))/((10 - -9) + -20)? 7 Let s(t) = 6t2 - t + 15. Let g(x) = 8x*2 + 16. Let p(i) = -2g(i) + 3s(i). What is the tens digit of p(10)? 8 Let o = -48 + 68. Suppose -202i = -225i + 161. Suppose 5n = in - o. What is the tens digit of n? 1 Suppose -6 + 14 = 4u - 5l, -4l = 0. Suppose 1134 = 9m - um. What is the units digit of m? 2 Suppose 0 = 2l + 5j + 6 - 34, 16 = 4j. Suppose lw - 3v - 654 = 0, 0w - w + 167 = v. What is the units digit of w? 5 Let j be (-101/(-8))/((-1)/(-4)). Suppose -jc = -4c - 2. Suppose cy + 2l = 156, 0y - 2y = -2l - 152. What is the tens digit of y? 7 Let h be ((-7837)/(-17))/(15/(-18) + 1). Suppose 3m = 2q + h, 3m = 4q - 1174 + 3940. What is the units digit of m? 2 Let k(z) be the second derivative of -z*4/12 + 9z*3/2 - 20z*2 + 8z. Let q be (38/(-8))/((-2)/8). What is the units digit of k(q)? 2 Let q = 639 + -376. Let b(m) = -4m - 3 - 5m*3 - 265m*2 - 2m*3 + qm*2. What is the tens digit of b(-2)? 5 Suppose -56w = -38w + 13878. Let t = w + 1436. What is the units digit of t? 5 Suppose -5g - 99231 = -16g. Suppose -36r = -87 - g. What is the units digit of r? 3 Suppose -20 - 15 = -7j. Suppose 3u = -9, -u + 4u + 309 = jo. What is the units digit of o? 0 Suppose -3c - 5p + 29406 = 0, 69p = -4c + 65p + 39200. What is the units digit of c? 7 Suppose -4c = 15w - 155003, -5c - 17w + 18w + 193813 = 0. What is the ten thousands digit of c? 3 What is the units digit of (-7155)/2535/(-21)? 7 Suppose 4s - 1332424 = -147s. What is the tens digit of s? 2 What is the thousands digit of (-4)/6394818/(-23)? 1 Let r(x) = -x*3 + 19x*2 - 36x + 26. Let q be r(15). Let p = 723 - q. What is the units digit of p? 7 Suppose 6l - 818 = -3680. Let t = 335 - l. What is the tens digit of t? 1 Let o(d) = -628d + 8130. What is the units digit of o(-37)? 6 Let g = 59652 - 35674. What is the tens digit of g? 7 Suppose 41472 = 2m - 8304. Suppose -35q + m = -q. What is the hundreds digit of q? 7 Let w be (7 + -6)/(2/(-30)). What is the units digit of w/(75/20) + (0 - -470)? 6 Let h(c) = -4c - 19. Let t be h(-4). Let f be (t - -28) + 0 - 3. Suppose -19w = -fw + 144. What is the units digit of w? 8 Suppose 6l = 3974 + 3364. Suppose 373 = 2p - l. What is the tens digit of p? 9 Suppose 1141293 + 1542395 = 136j. What is the hundreds digit of j? 7 Let n = -94 - -94. Suppose -3f + r + 37 = -200, 3f - 2r - 237 = n. Suppose -2m + f = -3i - 189, -3m + 4i = -400. What is the hundreds digit of m? 1 Suppose -206s + 134s + 448200 = 0. What is the hundreds digit of s? 2 Suppose 27f = 20f. What is the tens digit of (f - -157) + 1 + 104/(-26)? 5 Suppose -5a + 79485 = 5d, 26468 = 2a + 3d - 5320. What is the thousands digit of a? 5 Let a(v) = 1502v*2 - 15v - 10. What is the tens digit of a(-2)? 2 What is the thousands digit of (-144)/421079463/(-44)? 4 Let p(a) = 2a*2 - 4a - 6. Let u(v) be the third derivative of -v*4/24 - 5v3/6 - v2. Let q be u(-10). What is the tens digit of p(q)? 2 Let g(i) = -3i2 + 16 + 4i + 2i3 - 2i*2 - 13 - 6i. Let d be g(3). Suppose dl - 3l = 345. What is the units digit of l? 5 Suppose -790 = -l - 215. Let o = l + -9. Suppose -6n + o + 214 = 0. What is the units digit of n? 0 Let d(z) be the third derivative of -z4/8 + 5z*3/2 + 13z*2. Let t be d(-9). What is the units digit of (t - (-9)/(-3))2? 8 Suppose -16l + 171377 + 137263 = 0. Suppose -l = 77d - 107d. What is the tens digit of d? 4 Let d(a) = 129a*3 + 10a*2 + 12a - 5. What is the units digit of d(4)? 9 Suppose -a - 3 = -z, 4z - 9a = -7a + 22. Suppose 0 = -32k + 30k + z. Suppose -kc + 256 = -368. What is the hundreds digit of c? 1 Suppose 7o - 7579 - 78104 = 57985. What is the thousands digit of o? 0 Suppose -3y - 2n + 3n + 43870 = 0, -5n + 73070 = 5y. What is the thousands digit of y? 4 Let d(j) = 3j + 49 + 9j + 9j + 0j. What is the tens digit of d(11)? 8 Let l = -691 + 590. Let x = l - -1448. What is the thousands digit of x? 1 Let l(u) = -20u - 100. Let y be l(5). Let p = 727 + y. What is the hundreds digit of p? 5 Let p(h) = 46h*3 + 3h*2 - 5h - 6. Let l be p(4). Let v = l + -1790. What is the units digit of v? 6 What is the hundreds digit of (-1 - (-2 - -1)) + (-66879)/(-27)? 4 Let j(h) = 6h2 + 35h - 27. Let u be j(-15). Suppose -268r - u = -271r. What is the units digit of r? 6 Let r = -28 + 30. Suppose -rz + 19 = -883. What is the tens digit of z? 5 Suppose -2 = -14b + 16b, f - 3b = 25204. What is the hundreds digit of f? 2 Let i(m) = 18m + 6. Let h be i(4). Suppose -2w + 3w - h = 0. Suppose w = s + 2s. What is the units digit of s? 6 Let c(z) = -20z + 1. Let j be c(1). Let b be (j/5 + 3)-45. Suppose 35y - by = -9. What is the units digit of y? 9 Suppose p = -2x + 10112, 2x = 6p - p - 50524. What is the tens digit of p? 0 Let b(p) = 3p*3 - 3p*2 - 4p - 11. Let u be b(-4). Let k = -18 - u. What is the units digit of k? 7 Let m = 893 + 183. Suppose 2b - 714 = -2n, -5n + 2n - 2b + m = 0. What is the tens digit of n? 6 Let h be (-1662)/(-4) - (4 + 66/(-12)). Let i = -145 + h. What is the hundreds digit of i? 2 Let n be ((-57)/72 + 2/16)-18. Suppose 0z + nz = 9912. What is the hundreds digit of z? 8 Let g be -79 + 8 + -10 + -3. What is the hundreds digit of (-92728)/g + (-16)/(	{ "pile_set_name": "DM Mathematics" }
183, -4339, -4671, -5269, -6223, -7623, -9559? -12121 What is next in 339152, 677364, 1015578, 1353794, 1692012, 2030232? 2368454 What is next in 26748, 27135, 27518, 27897, 28272, 28643? 29010 What is the next term in 1569134, 3138276, 4707418, 6276560, 7845702? 9414844 What is the next term in -607711, -1215456, -1823201? -2430946 What comes next: -78925749, -157851497, -236777249, -315703005, -394628765, -473554529, -552480297? -631406069 What comes next: 3694, 4372, 5050? 5728 What is next in 1915, 3671, 5413, 7147, 8879? 10615 What is the next term in 24877859, 99511428, 223900709, 398045702, 621946407, 895602824? 1219014953 What comes next: -4514, -4544, -4572, -4598? -4622 What is the next term in -50627030, -50627031, -50627034, -50627039, -50627046, -50627055? -50627066 What is the next term in -8000, -8027, -8022, -7955, -7796? -7515 What is the next term in -8437000, -8436966, -8436944, -8436940, -8436960, -8437010, -8437096, -8437224? -8437400 What is the next term in -81416, -161836, -242256, -322676, -403096? -483516 What comes next: -705805, -705784, -705763, -705742? -705721 What is next in -1078, -2732, -4994, -7864, -11342, -15428? -20122 What is next in 10249653, 10249668, 10249683, 10249698? 10249713 What comes next: -2529026, -2529031, -2529040, -2529053? -2529070 What is the next term in 155280, 310658, 466036, 621414? 776792 What comes next: 5001788526, 5001788525, 5001788524, 5001788523, 5001788522, 5001788521? 5001788520 What is next in 3433272, 3433277, 3433284, 3433293, 3433304, 3433317? 3433332 What comes next: -4282794, -17131162, -38545106, -68524626? -107069722 What comes next: -246, -474, -654, -762, -774, -666, -414, 6? 618 What is next in 664, 812, 1212, 1990, 3272, 5184? 7852 What is next in 66, 181, 388, 735, 1270, 2041, 3096? 4483 What is next in -1043299, -1043291, -1043277, -1043257, -1043231, -1043199? -1043161 What is the next term in 16329, 65357, 147095, 261543, 408701, 588569, 801147? 1046435 What comes next: -22643, -45255, -67861, -90461, -113055, -135643, -158225? -180801 What comes next: 507, 1063, 1661, 2301, 2983, 3707, 4473? 5281 What is the next term in -3804, -3885, -3972, -4065? -4164 What is next in 193339, 192848, 192025, 190876, 189407, 187624, 185533? 183140 What comes next: 23807, 23949, 24185, 24515, 24939, 25457? 26069 What is the next term in -159185713, -318371423, -477557133, -636742843, -795928553, -955114263? -1114299973 What comes next: -50934, -410157, -1385158, -3283827, -6414054, -11083729? -17600742 What is next in 151567385, 303134769, 454702153, 606269537, 757836921, 909404305? 1060971689 What is the next term in 2, 619, 1666, 3155, 5098, 7507, 10394? 13771 What is next in -73, -71, -25, 89, 295, 617, 1079, 1705? 2519 What is next in 1756120, 3512088, 5268058, 7024030, 8780004, 10535980, 12291958? 14047938 What comes next: 58441, 116807, 175209, 233665, 292193, 350811, 409537, 468389? 527385 What is next in -18891721, -18891705, -18891689, -18891673, -18891657? -18891641 What is next in 4755295, 4755292, 4755289? 4755286 What comes next: 44932, 44988, 45070, 45190, 45360, 45592, 45898? 46290 What is the next term in -133712, -261249, -388786? -516323 What comes next: 32540, 33246, 33954, 34664, 35376? 36090 What is the next term in 75021008, 75021015, 75021028, 75021047? 75021072 What is next in -16140822, -16140915, -16141008, -16141101? -16141194 What is next in 4790, 9663, 14620, 19655, 24762, 29935? 35168 What is next in -1016, -8011, -27028, -64103, -125272, -216571? -344036 What is the next term in -149644, -299653, -450028, -600769, -751876, -903349? -1055188 What comes next: 4944, 19868, 44808, 79818, 124952, 180264, 245808? 321638 What is next in -127045, -128483, -129919, -131353, -132785, -134215, -135643? -137069 What comes next: 41609241, 41609237, 41609233, 41609229? 41609225 What is the next term in 385683, 771356, 1157013, 1542654? 1928279 What is next in -3779, -12898, -27523, -47654? -73291 What is the next term in -31007, -30934, -30739, -30362, -29743, -28822, -27539? -25834 What is next in -524432087, -524432093, -524432103, -524432117? -524432135 What is the next term in -5833763, -5833767, -5833771, -5833775, -5833779, -5833783? -5833787 What is the next term in -505, -859, -1461, -2311, -3409, -4755, -6349? -8191 What comes next: 21614, 20813, 20018, 19223, 18422? 17609 What is the next term in -115531, -231674, -347817? -463960 What is the next term in -3495170, -3495244, -3495440, -3495818, -3496438, -3497360, -3498644, -3500350? -3502538 What is next in -29973, -59691, -89153, -118359, -147309? -176003 What comes next: 161946358, 161946376, 161946396, 161946418, 161946442, 161946468, 161946496? 161946526 What is next in -5101, -6554, -8007, -9460? -10913 What is next in 473, 2688, 8397, 19346, 37281? 63948 What is next in -46132, -92266, -138402, -184546, -230704, -276882, -323086, -369322? -415596 What comes next: -2078, -2304, -2726, -3410, -4422, -5828, -7694? -10086 What is the next term in 474275, 948655, 1423035, 1897415, 2371795? 2846175 What is the next term in 361, 471, 879, 1585, 2589? 3891 What comes next: 12699, 50450, 113297, 201240, 314279? 452414 What is next in 507071, 505703, 504337, 502973, 501611, 500251? 498893 What comes next: -32528, -31359, -30188, -29015, -27840? -26663 What comes next: -35025, -70034, -105025, -139998, -174953, -209890? -244809 What is next in -4446, -10004, -16670, -24444, -33326, -43316? -54414 What is the next term in -172526, -172521, -172502, -172463, -172398? -172301 What is the next term in 6371, 24911, 55707, 98759, 154067? 221631 What is the next term in -66383672, -132767339, -199151004, -265534667? -331918328 What is the next term in -28385914, -28385915, -28385916, -28385917? -28385918 What is the next term in 6, 307, 1120, 2703, 5314? 9211 What comes next: 15130888, 15130886, 15130882, 15130876, 15130868, 15130858? 15130846 What is next in 159282, 159321, 159396, 159519, 159702, 159957? 160296 What is next in 2623, 4884, 7145? 9406 What comes next: -1064, -457, 150, 757, 1364? 1971 What is next in -829, -1237, -1929, -2911, -4189, -5769, -7657? -9859 What is the next term in -10857, -43708, -98521, -175308, -274081, -394852? -537633 What is next in 265848, 531675, 797502? 1063329 What is next in 12818, 39524, 84042, 146372, 226514, 324468? 440234 What comes next: 153253806, 306507619, 459761432, 613015245, 766269058? 919522871 What is next in 18127, 36482, 54827, 73162, 91487, 109802? 128107 What comes next: -3396, -3344, -3186, -2868, -2336, -1536, -414, 1084? 3012 What is next in 5972543, 5972534, 5972525? 5972516 What is the next term in 288, 1001, 1970, 3015, 3956? 4613 What is next in 147, 281, 463, 681, 923, 1177? 1431 What is the next term in 27431083, 27431078, 27431073, 27431068? 27431063 What is next in 4601402, 9202801, 13804200, 18405599, 23006998, 27608397? 32209796 What comes next: -34939, -70051, -105149, -140227, -175279, -210299, -245281, -280219? -315107 What comes next: -3980, -4100, -4250, -4430, -4640? -4880 What is the next term in 5047, 40334, 136097, 322570, 629987, 1088582? 1728589 What is next in -4757536, -9515074, -14272612, -19030150, -23787688, -28545226? -33302764 What comes next: 2270, 9746, 22206, 39650, 62078, 89490? 121886 What is the next term in 3067, 14424, 42401, 95308, 181455, 309152, 486709, 722436? 1024643 What is next in -26937, -108175, -243573, -433131? -676849 What is the next term in -1023436, -1023348, -1023260, -1023172, -1023084, -1022996? -1022908 What comes next: -47471332, -47471332, -47471330, -47471326, -47471320, -47471312? -47471302 What is next in -548, -6049, -11548, -17045? -22540 What is next in -8083, -17580, -27377, -37480, -47895, -58628, -69685? -81072 What is next in -1904758, -1904762, -1904764, -1904764, -1904762, -1904758, -1904752? -1904744 What is the next term in -932425, -932427, -932431, -932437? -932445 What comes next: -1353, -1878, -757, 2832, 9711, 20702, 36627? 58308 What is next in 17907, 17984, 18077, 18186, 18311, 18452? 18609 What is next in -12886, -103233, -348474, -826057, -1613430, -2788041, -4427338, -6608769? -9409782 What is next in -7406, -44894, -135330, -301586, -566534, -953046, -1483994, -2182	{ "pile_set_name": "DM Mathematics" }
alculate a(i) - 6d(i). 10i3 Let y(s) be the third derivative of s6/40 + s5/60 - s4/12 - s*3/3 - 26s*2. Let l(g) = -g - 1. Give -2l(h) + y(h). 3h3 + h2 Let j(b) = 5b - 3. Let n(u) = -6u + 3. Let z(c) = -c3 - 7c*2 + 19c + 7. Let l be z(-9). Calculate ln(v) - 3j(v). -3v + 3 Let h(g) = g2 + 10g - 17. Let r be h(-11). Let f(w) = 23w - 14. Let j(z) = -8z + 5. What is rf(x) - 17j(x)? -2x - 1 Let s(p) = -5p*3 - 2p + 4. Let g = -1 + 7. Let q(i) = -11i3 + i + 2i*3 + i - 6i + 3 + 4. Give gq(y) - 11s(y). y*3 - 2y - 2 Let h(m) = m - 2. Suppose 48g = 60g - 24. Suppose s + 20 = -3s. Let f = s - -12. Let l(c) = -3c + 7. What is fh(i) + gl(i)? i Let u(v) be the third derivative of -2v5/15 + v4/6 + 7v*3/6 - 231v*2. Let d(f) = -17f*2 + 9f + 15. Determine -4d(t) + 9u(t). -4t2 + 3 Let w(c) = -1. Let x(p) = -24p*2 + 3. What is 5w(d) + x(d)? -24d2 - 2 Let z(s) = -10s*2 - 5s + 6. Let h(k) = -9k2 - 3k + 5. Determine -3h(w) + 2z(w). 7w2 - w - 3 Let v(h) = -30h*2 + 24h - 9. Let r(a) = 6a2 - 5a + 2. Calculate -24r(u) - 5v(u). 6u2 - 3 Let q(h) = h2 + h. Let n(l) = 179l*3 + 2l*2 + 2l. Calculate n(f) - 2q(f). 179f*3 Let l(v) = -810v*3 + 8v - 16. Let n(q) = q*3 - q + 2. Give -l(p) - 8n(p). 802p3 Let g(r) = -r2 + r2 - 2r - 3r3. Let b be 80/13 + 8/(-52). Let q be b/4-3-2. Let z(p) = -13p*3 - 9p. Give qg(x) - 2z(x). -x*3 Let r be 19/7 - (-6)/21. Suppose 2m + 11 = -3b, 3b - rm + 6 = -0m. Let j(t) = -t2 - 4. Let q(w) = w2 + 5w - 3w - 2w + 5. Determine bj(z) - 2q(z). z2 + 2 Let t(g) = 32g*2 + 85. Let m(b) = 8b*2 + 21. Determine -9m(k) + 2t(k). -8k*2 - 19 Let r(g) = 110g*3 - 5g*2 + 1. Let l(u) = -55u*3 + 3u*2 - 1. Give 5l(b) + 3r(b). 55b*3 - 2 Let z(y) = y - 3. Let a(m) = -328m - 15. Determine a(u) - 5z(u). -333u Let m(n) = 5n2 - 5n - 9. Let b(i) = -i*2 + i + 2. Let f(h) = 9b(h) + 2m(h). Let k(v) = -4v*2 + 7v + 2. Give 6f(t) + k(t). 2t*2 + t + 2 Let i(k) = 9k*2 + k + 2. Let n(d) = -8d*2 - d - 2. Suppose a - 2 = 3. Suppose ar = 4g + 29, -1 = -3r + 2r. Give gi(j) - 7n(j). 2j*2 + j + 2 Let g(b) = 13b*3 + 3b*2 - 8. Let y(u) = 38u*3 + 8u*2 - 25. What is -8g(f) + 3y(f)? 10f*3 - 11 Suppose 4q - 4 = -44. Let y = q - -16. Let n(v) = -v*3 - 2v*2 + 6v - 8. Let s(p) = -3p3 - 6p*2 + 17p - 23. Calculate ys(k) - 17n(k). -k*3 - 2k*2 - 2 Let v be (10/(-5) - -4) + 1. Let z(q) = 4 - v - 2. Let d(y) = -y + 8. Determine d(r) + 6z(r). -r + 2 Let h(c) = -4c2 - 5c - 7. Let l(a) = 2a2 + 2a + 3. Let w = -759 - -763. Give wh(x) + 9l(x). 2x2 - 2x - 1 Let g(m) = -m + 1. Let t(d) = -30 + 25 - d + 6d. Determine 3g(s) + t(s). 2s - 2 Let l(y) = -70y*2 + 4y + 20. Let c(p) = -69p2 + 3p + 17. Determine -6c(x) + 5l(x). 64x2 + 2x - 2 Let s(k) = -15k + 1. Let o(t) = -5t. What is 17o(c) - 6s(c)? 5c - 6 Let m(i) = -166i*3 - 3i*2 + 2i - 2. Let z(w) = -165w3 - 4w*2 + 3w - 3. Determine -3m(k) + 2z(k). 168k3 + k2 Let a = 51 - 46. Let c be ((-64)/10)/(11/a + -2). Let v(j) = 13j*3 - 5j*2 - 5j + 5. Let w(f) = 84f3 - 32f*2 - 32f + 32. What is cv(g) + 5w(g)? 4g3 Let s = -1 - -5. Let x(c) = c - 4. Let b(m) be the third derivative of -m4/24 + 2m*3/3 - 1292m*2. What is sb(r) + 3x(r)? -r + 4 Let k(w) = 6w*2 + 5w + 38. Let v(y) = 20y2 + 17y + 115. Give 7k(q) - 2v(q). 2q2 + q + 36 Let h(m) = -10m - 4. Let c be 2124/(-413) + (-2)/(-14). Let a(j) = -7j - 3. What is ch(q) + 7a(q)? q - 1 Let u(f) be the third derivative of f4/24 - f3 + 11f*2. Let v(k) = -4k + 18. What is -10u(z) - 3v(z)? 2z + 6 Let w(u) = -u2 + 2. Let s(q) = 2q*2 + 5q - 10. Give s(y) + 5w(y). -3y*2 + 5y Let c(g) be the third derivative of 0g + 1/24g*4 - 2/3g*3 + 0 - 7g*2. Let z(w) = 3w - 12. Determine -11c(r) + 4z(r). r - 4 Suppose -2 = g - 5. Let q(w) = 8w3 - 7w*2 - 7w. Suppose 7r = 108 + 39. Let j(v) = -v3 + v2 + v. Calculate gq(b) + rj(b). 3b*3 Let j(t) = -15265t*3 - 213t*2 + 213t - 2343. Let r(x) = 144x3 + 2x*2 - 2x + 22. Give 2j(z) + 213r(z). 142z3 Let y(c) = 8c - 5. Let i(b) = -7b + 3. Let r(v) = -4i(v) - 3y(v). Let q(k) = -2k - 1. What is 5q(m) + 2r(m)? -2m + 1 Let s(z) = 5z*3 - 1 - 8z*3 + 2 + 4z*3. Let g(q) = 4q*3 + 6. Give -g(u) + 6s(u). 2u3 Let g(q) = 5q*2 + 3q + 7. Suppose -3x - 5 = -4t - 33, 0 = -5t + 2x - 28. Let s(c) = 3c2 + 2c + 4. Calculate tg(r) + 7s(r). r*2 + 2r Suppose -2x = 3 + 23. Let o be (x + 10)(-4)/(-6). Let w be 2o/(4/(-3)). Let r(f) = f2 + f - 1. Let i(y) = y3 + 3y*2 + 4y - 5. Calculate wr(k) - i(k). -k3 - k + 2 Let g(x) = 9x*3 + 13x*2 - 13x. Let q(u) = 4u3 + 6u*2 - 6u. Let j = 77 - 35. Suppose 4n = 3h - 27, -3h - 4n + 3n + j = 0. Give hq(f) - 6g(f). -2f*3 Let v(y) = -22y*3 + 7y - 7. Let o(n) = n - 111n3 + 68n*3 + 50n*3 - 3n + 2. What is -14o(s) - 4v(s)? -10s3 Let c(v) = 593v*2 - 48. Let i(x) = 592x*2 - 56. Give 7c(p) - 6i(p). 599p*2 Let y(z) = z + 9. Let u be y(-7). Let d(a) = -4a*2 - 3a + 2. Let t(j) be the second derivative of -j4/12 - j3/6 + j*2/2 + 2j. What is ut(b) - d(b)? 2b*2 + b Let g be (-6)/(-18) - 46/(-12)2. Let c(o) = 2 - 2o + g - o2 - 7. Let m(h) = 2h*2 + 3h - 4. What is 4c(i) + 3m(i)? 2i2 + i Suppose -c + 4 = 3x - 1, 0 = 4x + 4c - 20. Let h(n) = xn2 - 23 + n - 10n - 4n - 4n*2. Let y(t) = 2t*2 + 6t + 11. Calculate 6h(l) + 13y(l). 2l2 + 5 Let c(d) = -2d - 9. Let t = -2120 + 2114. Let h(z) = 3z + 18. Determine th(y) - 10c(y). 2y - 18 Let b = 18 + -10. Suppose 2f - 5 = -3s + b, -19 = -4f + s. Let o(k) = k2 - 5k + 9. Let y(g) = 2g2 - 8g + 14. Give fy(r) - 8o(r). 2r2 - 2 Let q(j) = 2 + 2 - 16j*2 - 12j*2 - 5j + 30j2. Let p(s) = -5s*2 + 7s*2 + 0s*2 + 4 - 6s. Give 4p(n) - 5q(n). -2n2 + n - 4 Let m(z) = -4z - 2. Let a(s) = 2s + 51. What is -a(d) - m(d)? 2d - 49 Let u(l) = l - 14. Let j(w) = 5w - 334. Calculate -j(t) + 4u(t). -t + 278 Let r(o) = o3 - o2 - o - 1. Let s(u) = -26u3 - 2u*2 - 3u - 1. Give -3r(l) + s(l). -29l3 + l2 + 2 Let n be (8/12)/((-2)/(-183)). Let m(t) = -10t - 62t*3 + 130t*3 - nt*3 + 3t. Let r(h) = -13h3 + 13h. What is -11m(g) - 6r(g)? g*3 - g Let f(y) = -18y*3 - 2y*2 - 2y. Let v(h) = 35h3 + 5h*2 + 5h. Give 5f(p) + 2v(p). -20p3 Let x(s) = 3s + 3s - 7s + 5 - 3. Let o = -41 - -85. Suppose 0l - 4l - o = 0. Let f(h) = 5h - 10. Determine lx(q) - 2f(q). q - 2 Let k(n) = -3n*2 - 6n - 2. Let j(i) = 20 - 7 - 7 - 3i2 - 7i + 4i2. Let f be j(7). Let h(o) = -o. Determine fh(g) - k(g). 3g2 + 2 Let x(u) = 8u*2 + u - 1. Let p = 741 - 748. Let j(v) = 9v*2 + v - 1. Calculate px(z) + 6j(z). -2z*2 - z + 1 Let g(x) = -5x - 6. Let f(o) = -10o - 11. Calculate -2f(m) + 5g(m). -5m - 8 Let d(s) = s*2. Let t(z) = -2z*3 - 4z*2 - 2z. What is -5d(p) + t(p)? -2p*3 - 9p*2 - 2p Let t(i) = -5i2 + 9i - 9. Let p(q) = 9q2 - 17q + 16. Calculate 3p(b) + 5t(b). 2b2 - 6b + 3 Let p = -2 + 1. Let a(k) = 49. Let i(o) = 24. Let d(l) = -a(l) + 2i(l). Let z(m) = -3m - 1. Give pz(n) + 3d(n). 3n - 2 Let r(c) = -c + 8. Let m be r(4). Suppose -13 + 25 = -mg. Let b(j) = j - 1. Let n(i) = -5. Calculate gb(s) + n(s). -3s - 2 Let c(f) = -5f. Suppose -o = -a - 6, 5a = -5o + 4a + 24. Let m(g) = g*2 + g + 11. Let r be m(0). Let p(y) = 12 - 12 - ry. Calculate oc(v) - 2p(v). -3v Let r(g) = -g2 + 6g + 2. Let n(m) = m*2 - 3m - 1. Calculate -5n(h) - 3r(h). -2h2 - 3h - 1 Let o(y) = 4y3 - 4y*2 + 4. Suppose 4k - 20 = -4t, 2t - 4t = k - 9. Suppose 27 = 9l - 0l. Let a(w) = -4w*3 + 3w*2 - 3. Give lo(f) + ta(f). -4f*3 Let r be 2/(-1 + 201/33 + -5). Let y(g) = -20g - 4. Let j(c) = -5c - 1. What is rj(l) - 6y(l)? 10l + 2 Let p(u) = -u*3 + 4u*2 - 5u + 7. Let h(y) be the first derivative of -1/2y2 + 32 + 1/3y*3 + y. Give -5h(c) + p(c). -c3 - c2 + 2 Let v(k) = -3k + 18. Let p(z) = -z + 9. Suppose 23o + 5j - 9 = 21o, 8 = o - j. Determine op(d) - 3v(d). 2*d + 9 Let g(u	{ "pile_set_name": "DM Mathematics" }
, -131, -198, -277? -6c2 - c + 24 What is the o'th term of -132, -124, -102, -60, 8, 108? o3 + o2 - 2o - 132 What is the y'th term of -18, -27, -24, -3, 42, 117? y*3 - 16y - 3 What is the b'th term of 274, 273, 282, 307, 354? b3 - b2 - 5b + 279 What is the o'th term of 7, -2, -13, -26, -41? -o2 - 6o + 14 What is the x'th term of 4, 21, 72, 175, 348, 609, 976? 3x3 - x2 - x + 3 What is the n'th term of -7, -11, -13, -13, -11, -7? n2 - 7n - 1 What is the d'th term of -209, -819, -1835, -3257, -5085, -7319? -203d2 - d - 5 What is the j'th term of 222, 250, 278, 306, 334, 362? 28j + 194 What is the w'th term of -278, -557, -836, -1115, -1394? -279w + 1 What is the c'th term of -199, -160, -83, 50, 257, 556, 965, 1502? 3c3 + c2 + 15c - 218 What is the t'th term of 35, 33, 31, 29? -2t + 37 What is the r'th term of -45, -107, -201, -327? -16r2 - 14r - 15 What is the p'th term of -59643, -59644, -59645, -59646, -59647, -59648? -p - 59642 What is the j'th term of -25, -30, -41, -64, -105, -170, -265, -396? -j*3 + 3j*2 - 7j - 20 What is the u'th term of 8, -2, -58, -184, -404, -742, -1222? -4u3 + u2 + 15u - 4 What is the d'th term of 4, 1, -2? -3d + 7 What is the d'th term of -339, -1217, -2689, -4761, -7439, -10729, -14637, -19169? -d3 - 291d*2 + 2d - 49 What is the k'th term of 59, 34, -9, -70, -149? -9k2 + 2k + 66 What is the c'th term of -206, -415, -624, -833? -209c + 3 What is the d'th term of 262, 522, 782? 260d + 2 What is the u'th term of 192, 773, 1742, 3099, 4844, 6977? 194u2 - u - 1 What is the r'th term of -1350, -1348, -1344, -1338, -1330, -1320? r2 - r - 1350 What is the j'th term of 25, 51, 79, 109, 141? j2 + 23j + 1 What is the q'th term of 22, 4, -16, -38? -q*2 - 15q + 38 What is the o'th term of 97, 194, 291, 388, 485, 582? 97o What is the h'th term of -37, -38, -39, -40, -41, -42? -h - 36 What is the n'th term of 1230, 1229, 1228, 1227, 1226? -n + 1231 What is the q'th term of -26, -40, -54, -68, -82, -96? -14q - 12 What is the q'th term of -12, -52, -88, -120, -148, -172? 2q2 - 46q + 32 What is the f'th term of 22, 90, 204, 364? 23f2 - f What is the o'th term of 1255, 5033, 11331, 20149? 1260o*2 - 2o - 3 What is the b'th term of 42, 154, 348, 630, 1006? b*3 + 35b*2 + 6 What is the p'th term of 331, 1317, 2961, 5263? 329p*2 - p + 3 What is the h'th term of -302, -306, -310, -314? -4h - 298 What is the i'th term of -64, -67, -70, -73, -76? -3i - 61 What is the j'th term of 1071, 1448, 1813, 2160, 2483, 2776, 3033? -j3 + 384j + 688 What is the a'th term of 83, 342, 773, 1376, 2151? 86a2 + a - 4 What is the f'th term of -171, -168, -163, -156, -147, -136? f2 - 172 What is the r'th term of 16, 53, 108, 187, 296, 441, 628, 863? r3 + 3r*2 + 21r - 9 What is the f'th term of 909, 910, 911, 912, 913? f + 908 What is the g'th term of 1134, 1132, 1130, 1128, 1126? -2g + 1136 What is the u'th term of -365, -727, -1089, -1451, -1813, -2175? -362u - 3 What is the y'th term of -5069, -5071, -5073, -5075, -5077? -2y - 5067 What is the y'th term of 1870, 1868, 1866? -2y + 1872 What is the o'th term of -11645, -11634, -11609, -11564, -11493? o3 + o2 + o - 11648 What is the t'th term of 41, 47, 53, 59, 65, 71? 6t + 35 What is the i'th term of -139, -348, -555, -760, -963, -1164, -1363? i2 - 212i + 72 What is the u'th term of -3050, -3048, -3060, -3092, -3150, -3240, -3368, -3540? -u3 - u2 + 12u - 3060 What is the o'th term of -12, -21, -44, -87, -156, -257? -o3 - o2 + o - 11 What is the i'th term of -274, -275, -276, -277? -i - 273 What is the i'th term of -22, -78, -162, -274, -414? -14i*2 - 14i + 6 What is the w'th term of 240, 245, 260, 291, 344, 425, 540, 695? w3 - w2 + w + 239 What is the b'th term of 63, 83, 117, 165? 7b2 - b + 57 What is the f'th term of -9, -14, -23, -36? -2f*2 + f - 8 What is the t'th term of 63, 133, 247, 405? 22t*2 + 4t + 37 What is the j'th term of 3718, 7431, 11142, 14851? -j*2 + 3716j + 3 What is the r'th term of 1352, 1337, 1334, 1349, 1388? r*3 - 22r + 1373 What is the w'th term of 5629, 5633, 5637, 5641, 5645, 5649? 4w + 5625 What is the y'th term of 48, 184, 410, 726? 45y2 + y + 2 What is the u'th term of -23, -32, -27, -2, 49, 132? u3 + u*2 - 19u - 6 What is the i'th term of 249, 244, 237, 228, 217, 204? -i*2 - 2i + 252 What is the w'th term of 303, 634, 991, 1386, 1831, 2338, 2919? 2w3 + w2 + 314w - 14 What is the r'th term of 52, 86, 120, 154? 34r + 18 What is the p'th term of -73, -326, -759, -1384, -2213, -3258, -4531, -6044? -2p*3 - 78p*2 - 5p + 12 What is the h'th term of -372, -357, -332, -297, -252? 5h2 - 377 What is the s'th term of 2, 10, 38, 98, 202, 362? 2s*3 - 2s*2 + 2 What is the t'th term of -129, -258, -387, -516, -645? -129t What is the f'th term of 44, 110, 196, 308, 452, 634? f*3 + 4f*2 + 47f - 8 What is the q'th term of -17510, -17512, -17516, -17522, -17530, -17540, -17552? -q2 + q - 17510 What is the u'th term of 5715, 5715, 5717, 5721, 5727? u2 - 3u + 5717 What is the d'th term of -3711, -3715, -3729, -3759, -3811? -d3 + d2 - 3711 What is the y'th term of -221, -426, -631? -205y - 16 What is the r'th term of 187, 162, 133, 100, 63, 22? -2r2 - 19r + 208 What is the p'th term of 1580, 3166, 4750, 6332, 7912, 9490, 11066? -p*2 + 1589p - 8 What is the m'th term of 79, 165, 255, 349, 447? 2m2 + 80m - 3 What is the k'th term of -432, -451, -484, -531, -592, -667, -756? -7k2 + 2k - 427 What is the o'th term of 24, 50, 76, 102, 128? 26o - 2 What is the i'th term of 20, 95, 222, 401, 632? 26i*2 - 3i - 3 What is the u'th term of 45, 58, 87, 138, 217, 330, 483? u*3 + 2u2 + 42 What is the z'th term of 1749, 3502, 5257, 7014? z2 + 1750z - 2 What is the u'th term of -3, -34, -135, -342, -691, -1218, -1959, -2950? -6u3 + u2 + 8u - 6 What is the r'th term of 10943, 10945, 10947, 10949, 10951, 10953? 2r + 10941 What is the v'th term of -6533, -13068, -19603, -26138, -32673? -6535v + 2 What is the c'th term of -202, -222, -268, -352, -486, -682, -952, -1308? -2c3 - c2 - 3c - 196 What is the o'th term of 375, 762, 1161, 1578, 2019, 2490, 2997? o3 + 380o - 6 What is the d'th term of -171, -174, -179, -186, -195, -206? -d*2 - 170 What is the g'th term of 6, 14, 30, 54, 86, 126? 4g*2 - 4g + 6 What is the f'th term of 10, 58, 166, 358, 658, 1090, 1678, 2446? 4f3 + 6f*2 + 2f - 2 What is the t'th term of 1968, 1970, 1980, 2004, 2048, 2118? t*3 - 2t*2 + t + 1968 What is the u'th term of 192, 207, 222, 237, 252? 15u + 177 What is the o'th term of -25, -81, -139, -199, -261, -325? -o*2 - 53o + 29 What is the i'th term of -137, -144, -161, -194, -249, -332? -i3 + i2 - 3i - 134 What is the q'th term of -1340, -5331, -11984, -21299, -33276, -47915? -1331q*2 + 2q - 11 What is the v'th term of 25, 5, -29, -77, -139, -215? -7v2 + v + 31 What is the r'th term of -503, -998, -1493, -1988, -2483? -495r - 8 What is the j'th term of -5491, -5488, -5475, -5446, -5395, -5316, -5203? j3 - j2 - j - 5490 What is the j'th term of 2134, 4280, 6426, 8572, 10718, 12864? 2146j - 12 What is the k'th term of 255, 252, 249, 246, 243, 240? -3k + 258 What is the j'th term of -120, -312, -632, -1080, -1656? -64j2 - 56 What is the u'th term of 439, 403, 365, 325, 283, 239, 193? -u2 - 33u + 473 What is the s'th term of -365, -369, -373, -377, -381, -385? -4s - 361 What is the j'th term of 8, 16, 26, 38, 52? j2 + 5j + 2 What is the a'th term of -18, -26, -34, -42, -50? -8a - 10 What is the c'th term of -104, -99, -94, -89? 5c - 109 What is the o'th term of 118, 118, 108, 82, 34, -42? -o3 + o2 + 4o + 114 What is the v'th term of -1683, -1690, -1697, -1704? -7v - 1676 What is the a'th term of 108, 99, 90, 81, 72? -9a + 117 What is the k'th term of -90, -129, -168, -207, -246, -285? -39k - 51 What is the b'th term of -65, -128, -193, -260, -329, -400, -473? -b*2 - 60b - 4 What is the h'th term of 175, 315, 441, 547, 627, 675, 685, 651? -h3 - h2 + 150h + 27 What is the a'th term of -1887, -3775, -5661, -7545, -9427, -11307? a2 - 1891a + 3 What is the k'th term	{ "pile_set_name": "DM Mathematics" }
1179 -245/1179 Calculate 218985 divided by 43797. 5 Calculate 52 divided by -1453. -52/1453 Calculate -155 divided by 2333. -155/2333 Calculate 34680 divided by -8670. -4 Calculate -26448 divided by -8. 3306 800738 divided by 400369 2 Calculate -197345 divided by -197345. 1 Divide -342040 by -8551. 40 -28344 divided by 3 -9448 Calculate 3 divided by -12353. -3/12353 Calculate -9958215 divided by 5. -1991643 Calculate 4524 divided by 11. 4524/11 Calculate -24 divided by -3718. 12/1859 Calculate 8434 divided by -2. -4217 Calculate -202568 divided by 1. -202568 Calculate -995125 divided by 19. -52375 -1374 divided by 138 -229/23 -90234 divided by 6 -15039 Divide -55040 by -320. 172 Divide -26554 by -1207. 22 What is 12656 divided by -12? -3164/3 What is -330 divided by -630? 11/21 Calculate 9 divided by -138394. -9/138394 Calculate 1 divided by -103436. -1/103436 726880 divided by -4 -181720 What is -462570 divided by -46257? 10 Calculate -833481 divided by 3. -277827 Divide 65537 by 10. 65537/10 5 divided by -242332 -5/242332 Divide -117260 by -2860. 41 What is -353882 divided by -59? 5998 86769 divided by 1 86769 Divide -147408 by -18426. 8 What is -683220 divided by 170805? -4 Calculate 487515 divided by -6. -162505/2 Divide -1039065 by 207813. -5 What is -2 divided by 22768? -1/11384 -1095123 divided by 6 -365041/2 Calculate -12 divided by 6929. -12/6929 Divide -2460 by 2. -1230 What is -126960 divided by 24? -5290 -150 divided by 759 -50/253 Divide -4 by 36867. -4/36867 -401202 divided by -2 200601 What is -69454 divided by 1694? -41 Divide 5 by 42402. 5/42402 44344 divided by 11086 4 Divide -2 by 20912. -1/10456 Divide 2068 by -6. -1034/3 What is -120708 divided by 4? -30177 What is -1 divided by -6051? 1/6051 128284 divided by -9868 -13 Divide 16210 by -5. -3242 -1286 divided by 646 -643/323 What is 468 divided by -954? -26/53 Calculate 2159135 divided by -407. -5305 What is -1233312 divided by 616656? -2 -2 divided by -612750 1/306375 -50170 divided by -173 290 What is -395 divided by 66? -395/66 Divide -1643 by -53. 31 What is 13357 divided by -13357? -1 What is 126318 divided by -1? -126318 Divide -160 by 249. -160/249 What is -3 divided by 60997? -3/60997 What is -29 divided by -1325? 29/1325 -3 divided by 134790 -1/44930 Calculate 446 divided by 17. 446/17 What is 3015581 divided by 28183? 107 176944 divided by 16 11059 Divide -1664188 by 416047. -4 What is -29 divided by -2636? 29/2636 Calculate 28272 divided by 248. 114 What is -1761 divided by 3? -587 Divide 1140867 by 4179. 273 Calculate -8 divided by 167206. -4/83603 What is 1683 divided by -1? -1683 What is 2 divided by -168233? -2/168233 What is 98110 divided by 19622? 5 Divide 99170 by 19834. 5 Divide 27720 by -35. -792 Divide 3 by -337476. -1/112492 Divide 5 by 1636811. 5/1636811 Divide 668 by -7. -668/7 Divide 3206 by -315. -458/45 -2 divided by -8221 2/8221 Calculate -2161 divided by -203. 2161/203 -6975 divided by 75 -93 What is 134742 divided by 6? 22457 29404 divided by 3 29404/3 Calculate 131 divided by 21. 131/21 Calculate 80454 divided by -6. -13409 Divide -4807 by 7. -4807/7 619542 divided by 8046 77 Divide -2597940 by -6. 432990 What is -1 divided by 3278? -1/3278 -22908 divided by 9 -7636/3 Divide 7 by -4013. -7/4013 -586729 divided by -13 45133 What is -8973 divided by 3? -2991 -42395 divided by -17 42395/17 5 divided by 1730488 5/1730488 3954 divided by -314 -1977/157 412075 divided by 5 82415 34713 divided by -5 -34713/5 What is 654076 divided by 327038? 2 Divide -77882 by 5. -77882/5 -30359336 divided by -4 7589834 What is -559 divided by -323? 559/323 -728 divided by 3168 -91/396 Divide -152424 by 24. -6351 Divide -59 by -2075. 59/2075 What is 0 divided by 37721? 0 Divide -4500 by -1125. 4 -20978 divided by 34 -617 What is -682573 divided by 6? -682573/6 2422 divided by 105 346/15 What is -49 divided by 13637? -49/13637 What is -4 divided by -2961? 4/2961 Divide -52599 by -1. 52599 What is -248766 divided by -17769? 14 -8172 divided by -2 4086 What is -269486 divided by 6? -134743/3 What is 1087944 divided by 1? 1087944 34080 divided by -4 -8520 -687687 divided by -13 52899 Divide -4002152 by -803. 4984 Divide -141 by -235. 3/5 Divide -89325 by -3573. 25 25480 divided by -392 -65 What is 36961 divided by -10? -36961/10 What is -471 divided by 105? -157/35 15207 divided by 5069 3 -1499069 divided by -143 10483 What is 640 divided by 320? 2 Divide -516045 by 172015. -3 What is -4 divided by 41480? -1/10370 -591232 divided by -124 4768 5398740 divided by -12132 -445 What is -4 divided by -212100? 1/53025 Calculate 2 divided by 43392. 1/21696 402140 divided by 10 40214 What is -66562 divided by 33281? -2 Calculate -2 divided by -70. 1/35 What is -5 divided by 4782? -5/4782 Divide 870 by -15. -58 -160097 divided by 160097 -1 Divide 54512 by 3. 54512/3 Calculate 2 divided by -32749. -2/32749 Calculate 890 divided by -4199. -890/4199 Calculate -1216 divided by 7. -1216/7 Divide -35 by 180004. -35/180004 What is 0 divided by -135894? 0 -10 divided by -58024 5/29012 Calculate 1175447 divided by -4. -1175447/4 508432 divided by 127108 4 Divide -1056944 by -264236. 4 48786 divided by 6 8131 What is -181250 divided by 125? -1450 Calculate 3 divided by -80133. -1/26711 Divide -77 by 6895. -11/985 Divide 1287767 by 5827. 221 What is -1 divided by -594556? 1/594556 What is -198065 divided by -5? 39613 Calculate 2782 divided by 42. 1391/21 Divide -529392 by 132348. -4 Divide -321300 by -315. 1020 -211827 divided by -2 211827/2 -358 divided by 2365 -358/2365 What is 168646 divided by -1961? -86 Divide -536 by -67. 8 Calculate 3 divided by -248996. -3/248996 What is -5 divided by 83689? -5/83689 What is -43775 divided by 43775? -1 What is 129 divided by 5? 129/5 6304552 divided by -4 -1576138 Divide 384848 by -8. -48106 -2 divided by 529605 -2/529605 -54 divided by -9085 54/9085 What is 346 divided by 751? 346/751 What is -526 divided by 255? -526/255 Calculate -34 divided by -129. 34/129 What is -17064 divided by 2133? -8 -52623 divided by 21 -17541/7 -5 divided by 97204 -5/97204 Divide 143 by 93. 143/93 Calculate 128995 divided by 5. 25799 Divide -77452 by -77452. 1 Calculate 653 divided by 146. 653/146 What is 3 divided by -10652? -3/10652 -175 divided by -2154 175/2154 Calculate 1779118 divided by 104654. 17 -2 divided by -9269 2/9269 -3109600 divided by -80 38870 What is 239454 divided by -6? -39909 334 divided by 209 334/209 359631 divided by 9 39959 Divide -40 by -188. 10/47 Divide 82426 by -4. -41213/2 Calculate 43040 divided by -5380. -8 What is 44 divided by 33454? 22/16727 Calculate -12623724 divided by 2. -6311862 5 divided by -6124 -5/6124 Divide 2509632 by -288. -8714 Calculate -644766 divided by -214922. 3 -12991 divided by 70 -12991/70 Divide -268567 by 73. -3679 -69440 divided by -2480 28 Calculate 566 divided by -18. -283/9 What is -46500 divided by 5? -9300 Calculate 47204 divided by -1. -47204 Divide -490809 by 3. -163603 What is 281888 divided by 70472? 4 Calculate -75696 divided by -1328. 57 Divide 2 by 171623. 2/171623 Calculate 71573 divided by 3. 71573/3 2579059 divided by -1 -2579059 What is -713709 divided by -3? 237903 Calculate 784235 divided by -5. -156847 1448788 divided by -22 -65854 Calculate -47368 divided by 4. -11842 What is -727320 divided by 174? -4180 -87320 divided by -740 118 -28021 divided by -25 28021/25 -10156098 divided by 6 -1692683 Divide 32994 by -39. -846 Calculate -24387 divided by 739. -33 Divide -715 by -27. 715/27 -267806 divided by 133903 -2 Divide -1112766 by -370922. 3 Divide 33276 by 118. 282 Calculate -8 divided by -5254. 4/2627 Calculate 8106 divided by 168. 193/4 Divide -6909705 by 2115. -3267 Divide -133 by -6317. 133/6317 Calculate -2274632 divided by -1718. 1324 -205 divided by 54 -205/54 Calculate -603548 divided by -58. 10406 What is -2140256 divided by -535064? 4 -3385605 divided by -543 6235 Divide 0 by -5277. 0 What is 1210013 divided by 1? 1210013 Divide -1517615 by 7403. -205 Calculate 312 divided by -8. -39 Divide 32922 by -177. -186 Divide 16 by 2737. 16/2737 What is -329718 divided by -179? 1842 What is -11 divided by -6217? 11/6217 Calculate -40340 divided by 2. -20170 Calculate 9667 divided by 4. 96	{ "pile_set_name": "DM Mathematics" }
e 1494 = 4r - 5t, 6t = 3r + 2t - 1121. Calculate the remainder when r is divided by s(5). 30 Suppose 210g - 212g + 16 = -o, 0 = -3g - 4o + 24. Suppose 6a - 790 = a. What is the remainder when a is divided by g? 6 Let x = 301 - 276. Let g(c) = 9c - 26. Let f(j) = -5j + 13. Let i(d) = 5f(d) + 3g(d). What is the remainder when x is divided by i(11)? 7 Let a(w) be the first derivative of 17w3/3 + 51w*2/2 - 3w - 259. Calculate the remainder when a(-4) is divided by 21. 2 What is the remainder when 179 is divided by ((-7)/49)/(1/(-295)) + 1/(-7)? 11 Let m(w) = -w + 468. Let l be m(0). Let q = -241 - -249. Suppose 0 = 2r - qr + l. What is the remainder when r is divided by 27? 24 Suppose 12j - 660 = -0j. Calculate the remainder when 293 is divided by j. 18 Suppose 2d + 67 = 273. Let i be 20/(-3)(-1512)/(-105). Let u = i - -111. What is the remainder when d is divided by u? 13 Let m(z) be the first derivative of 102z2 + z + 12. Let w be m(1). Let r = -87 + w. Calculate the remainder when r is divided by 30. 28 Suppose 0 = -2131r + 2089r + 1386. What is the remainder when 64 is divided by r? 31 Suppose -2z + 87 = 5y, -2z + 106 = -y + 25. Suppose 58 - z = f. Suppose fl = 7l + 250. Calculate the remainder when l is divided by 9. 7 Let w(q) = 10q2 - 12q - 170. Calculate the remainder when w(-8) is divided by 41. 33 Suppose -10a - 2a + 48 = 0. Suppose -ad = -2j - 6, -4d + 18 = 2j - 0j. What is the remainder when 3(3/3 + 3) is divided by d? 0 Let k = 2500 + -1257. Let x = k + -814. Calculate the remainder when x is divided by 12. 9 Let d = 826 + -934. Let z = d - -119. What is the remainder when 60 is divided by z? 5 Suppose -5c - 13c = 43c - 3294. What is the remainder when 130 is divided by c? 22 Let q = -25336 + 35601. Calculate the remainder when q is divided by 58. 57 Suppose -180 = -2q - 2l, 10l - 5l = -25. Let a = q + -90. Calculate the remainder when 74 is divided by a. 4 Suppose 4l = 5s + 35, -s = -144l + 142l + 25. Let b = -6 + 29. What is the remainder when b is divided by l? 8 Let i(b) = 72b. Let j be i(-2). Suppose -245 - 95 = -5k. Calculate the remainder when k is divided by (1/2)/((-6)/j). 8 Suppose 5l = 20 + 135. Let c be (l/(-4))/(5/(-20)). Let m = c - 2. What is the remainder when m is divided by 10? 9 Let b = -137 + 237. Let r = -95 + b. What is the remainder when r is divided by (3/(-6) - -1)8? 1 Suppose -4008n + 3997n + 1386 = 0. Calculate the remainder when 738 is divided by n. 108 Suppose -117o - 254730 = -797610. Calculate the remainder when o is divided by 21. 20 Let k(o) = -2o3 - 15o*2 + 8o - 120. What is the remainder when k(-10) is divided by 17? 11 Suppose -a = r - 2r - 4, 4a - 17 = 3r. Suppose 4k - 67 - 388 = -p, -2p = -ak + 585. Calculate the remainder when k is divided by 42. 31 Suppose 200 = 12g - 484. What is the remainder when 282 is divided by g? 54 Suppose 75d - 15d = 2700. Calculate the remainder when d is divided by (32/(-6))/(2/(-9)). 21 Let u(l) = -2l + 5. Let p be (-4)/6 - 2/9-1380. Suppose -16i + 22i = p. Calculate the remainder when i is divided by u(-4). 12 Let f(j) = 7j + 21. Suppose 0 = 8w - 11w - 3. Suppose i - 164 = -i. Calculate the remainder when i is divided by f(w). 12 Let b(s) = 2s2 + 14s + 8. Suppose 18q + 11 - 227 = 0. Calculate the remainder when q is divided by b(-7). 4 Let a = -15 - -28. Suppose 0 = -ab + 40b - 1269. Calculate the remainder when b is divided by 33. 14 Suppose 2s - 4s = -6, -s + 107 = 2k. Suppose kx - 25 = 47x. Suppose 0w + 159 = 3w - 3c, -xw + 283 = c. Calculate the remainder when w is divided by 19. 18 Let k = 2104 + -184. Calculate the remainder when k is divided by 13. 9 Let i(n) = 24n + 3. Let a be i(0). Suppose -4s + 2t + 120 = -0t, -2s + at = -68. Calculate the remainder when (-1)/(-3) + (-323)/(-3) is divided by s. 24 Let g(p) = -p*2 - 32p + 264. What is the remainder when 422 is divided by g(-38)? 26 Let i(w) = -w*3 + 10w*2 + 2w - 8. Suppose -8 = -y + 1. Let t(x) = x*2 - 6x - 17. Let g be t(y). What is the remainder when 21 is divided by i(g)? 9 Let m = -28138 + 29929. Calculate the remainder when m is divided by 356. 11 Let t(d) = -15d2 - 99d + 71. What is the remainder when ((-47)/(-2))/((-4)/(-24)) is divided by t(-7)? 25 Suppose -5l + 11y = 8y - 247, 4l + 8y = 156. What is the remainder when 467 is divided by l? 44 Let k(s) = 34s + 10. What is the remainder when (-1188)/(0 + -6) + 2 is divided by k(1)? 24 Let u be (-18)/1280/(-6). What is the remainder when 51 is divided by 6(-60)/80u/(-6)? 6 Let v = 10315 + -10161. Calculate the remainder when 303 is divided by v. 149 Let u(o) = -2o*2 - 67o + 14. Let r be u(-30). Let f = 267 - r. What is the remainder when f is divided by 17? 9 Let o be 12/7116459/254. Let n = o - 645. What is the remainder when n is divided by 77? 64 Let c(n) = n3 + n2 + 2n - 1. Let b = -42 + 44. Suppose 0 = 9a - 789 + 6. What is the remainder when a is divided by c(b)? 12 Let i(k) = k + 6. Suppose -3b + 3q = 9q + 27, 5q = -35. What is the remainder when b is divided by i(-5)? 0 Let y = 11674 - 11563. What is the remainder when 435 is divided by y? 102 What is the remainder when (-2 + 0)(-767)/(-65)-5 is divided by 57? 4 Let w = -166 - -178. Suppose -5s = i - 87, 69 = 4s - 3i - w. Calculate the remainder when 122 is divided by s. 14 Let q = 609 + -569. What is the remainder when q is divided by 1/7 - ((-1940)/(-28))/(-5)? 12 Let d(p) = 159p + 183. Suppose 5c - 4q = 1421, 0 = 4c - 2q - q - 1137. Calculate the remainder when c is divided by d(-1). 21 Suppose -2 = r, 0l + 6l = -3r + 1464. Calculate the remainder when l is divided by 25. 20 Suppose 0p - 176 = -2p - 2m, -4p + 346 = -2m. Suppose 0 = x + p + 12. Let r = x - -114. Calculate the remainder when 41 is divided by r. 11 Let n = 1920 + -1883. Calculate the remainder when 75 is divided by n. 1 Let u(r) be the third derivative of r5/60 - r4/12 + 23r*3/6 + 3r*2 - 5. Calculate the remainder when u(5) is divided by 20. 18 Suppose w - 200 - 463 = 0. Suppose 27p + 204 - w = 0. Calculate the remainder when (2 + 0)/2 + 39 is divided by p. 6 Let q be (-2 + 2095)/(-7) - 2. Let x = -163 - q. What is the remainder when x is divided by 28? 26 Suppose 0 = 3y + 3d + 3, -15y - 12 = -13y + 4d. Suppose 361 = -2b + yb + 3a, b = -2a + 178. Calculate the remainder when b is divided by 43. 16 Let q = 3532 + -2038. Calculate the remainder when (-107)/(6/(-2) + 0 + 2) is divided by q/72 - (-5)/4. 19 Let l(m) = 7m*2 + 40m - 234. What is the remainder when l(21) is divided by 66? 63 Let y(o) = 8o + 2 + 2o*2 - 2o + 0. Suppose -2g = -3f - 290, 4g - 353 = 3f + 239. What is the remainder when g is divided by y(-6)? 37 Let k(d) = -d*2 + 4d + 37. Let g be k(-4). Suppose 0 = -gf + 30. Suppose f + 6 = -3j, -z = -2j - 28. Calculate the remainder when z is divided by 8. 4 Suppose -4l + 76 = -192. Let b = -41 + l. Calculate the remainder when b is divided by 10. 6 Let u(j) = -j*2 - 19j - 39. Let p(v) = -v - 6. Let t be p(10). What is the remainder when (-17)/24-1 is divided by u(t)? 7 Let h = 277 + -77. What is the remainder when h is divided by 1 + 5 - ((-4)/30 + (-1254)/45)? 30 Suppose -75p + 980 = -57p + 350. What is the remainder when p is divided by 11? 2 Suppose -612b + 2048 = -604b. Suppose -44v + 60v = b. What is the remainder when 61 is divided by v? 13 Let r = -4 + 4. Let a = r - 18. Let g = 29 + a. What is the remainder when 43 is divided by g? 10 Let q be 223-4(-3)/72. Suppose -qv - 320 = -16v. Suppose -27 = -m - 10. Calculate the remainder when v is divided by m. 13 Calculate the remainder when 1431 is divided by (-13)/(-2)(-21720)/(-7059). 11 Let q(m) = 123m - 1804. What is the remainder when 993 is divided by q(15)? 9 Calculate the remainder when (10/((-420)/(-63)))/((-1)/(-398)) is divided by 15. 12 Suppose -3w + 2s = -36, -2w + s + 17 + 7 = 0. Calculate the remainder when 2351 is divided by w. 11 Suppose -c - 4j + 122 = 0, -3c - 131j + 133j = -464. Calculate the remainder when c is divided by 79. 71 Suppose 3i = 3y - 687, 4y - 8y - 4*i + 916 = 0. What is the remainder when 466 is divided by y?	{ "pile_set_name": "DM Mathematics" }
ts digit of 37058906? 6 What is the hundred thousands digit of 8977683? 9 What is the ten thousands digit of 2605191? 0 What is the ten thousands digit of 292568? 9 What is the tens digit of 149818? 1 What is the hundreds digit of 1567250? 2 What is the ten thousands digit of 4591657? 9 What is the thousands digit of 14480004? 0 What is the thousands digit of 310891? 0 What is the ten thousands digit of 1046642? 4 What is the ten thousands digit of 1077897? 7 What is the thousands digit of 2231388? 1 What is the millions digit of 19311619? 9 What is the thousands digit of 6576289? 6 What is the tens digit of 273911? 1 What is the ten thousands digit of 410270? 1 What is the hundreds digit of 1214490? 4 What is the thousands digit of 3301843? 1 What is the hundreds digit of 3601237? 2 What is the hundred thousands digit of 296458? 2 What is the hundred thousands digit of 367420? 3 What is the units digit of 257191? 1 What is the ten thousands digit of 165120? 6 What is the ten thousands digit of 189252? 8 What is the tens digit of 2923820? 2 What is the ten thousands digit of 374718? 7 What is the units digit of 602113? 3 What is the ten thousands digit of 719408? 1 What is the millions digit of 3009374? 3 What is the ten thousands digit of 17608176? 0 What is the units digit of 201089? 9 What is the units digit of 81020? 0 What is the millions digit of 2322199? 2 What is the hundred thousands digit of 127294? 1 What is the tens digit of 11098567? 6 What is the ten thousands digit of 3190496? 9 What is the tens digit of 106105? 0 What is the thousands digit of 268892? 8 What is the hundred thousands digit of 3440832? 4 What is the ten thousands digit of 161212? 6 What is the units digit of 18838326? 6 What is the units digit of 21763125? 5 What is the ten thousands digit of 6082323? 8 What is the units digit of 544252? 2 What is the thousands digit of 80195? 0 What is the hundreds digit of 554857? 8 What is the tens digit of 4926738? 3 What is the hundred thousands digit of 147332? 1 What is the tens digit of 21035? 3 What is the ten thousands digit of 172512? 7 What is the tens digit of 203414? 1 What is the ten thousands digit of 10274293? 7 What is the units digit of 988276? 6 What is the millions digit of 9422090? 9 What is the hundreds digit of 293102? 1 What is the millions digit of 1347415? 1 What is the hundreds digit of 23434015? 0 What is the tens digit of 71149? 4 What is the hundred thousands digit of 231294? 2 What is the hundred thousands digit of 1266148? 2 What is the tens digit of 1004700? 0 What is the units digit of 660553? 3 What is the tens digit of 3164010? 1 What is the hundred thousands digit of 317357? 3 What is the hundred thousands digit of 2540235? 5 What is the tens digit of 83754? 5 What is the hundreds digit of 1837661? 6 What is the hundreds digit of 4998294? 2 What is the hundreds digit of 2089247? 2 What is the units digit of 212205? 5 What is the tens digit of 6349801? 0 What is the ten thousands digit of 1005526? 0 What is the units digit of 1776662? 2 What is the ten thousands digit of 325466? 2 What is the tens digit of 2278696? 9 What is the thousands digit of 323705? 3 What is the units digit of 24398905? 5 What is the units digit of 3694055? 5 What is the hundreds digit of 419305? 3 What is the ten thousands digit of 805595? 0 What is the ten millions digit of 13378941? 1 What is the tens digit of 16605201? 0 What is the thousands digit of 210676? 0 What is the tens digit of 5841661? 6 What is the thousands digit of 3253508? 3 What is the hundred thousands digit of 195153? 1 What is the hundred thousands digit of 169604? 1 What is the thousands digit of 514117? 4 What is the hundreds digit of 724035? 0 What is the thousands digit of 326218? 6 What is the millions digit of 2041757? 2 What is the hundreds digit of 3021330? 3 What is the hundred thousands digit of 887422? 8 What is the units digit of 1014179? 9 What is the units digit of 3982495? 5 What is the thousands digit of 141280? 1 What is the tens digit of 274717? 1 What is the hundreds digit of 46226? 2 What is the thousands digit of 6266278? 6 What is the thousands digit of 103785? 3 What is the thousands digit of 12696402? 6 What is the thousands digit of 161427? 1 What is the ten millions digit of 22455054? 2 What is the tens digit of 265083? 8 What is the tens digit of 4217335? 3 What is the tens digit of 63368? 6 What is the ten thousands digit of 11618169? 1 What is the hundred thousands digit of 4666159? 6 What is the hundreds digit of 1088477? 4 What is the ten thousands digit of 16309638? 0 What is the ten thousands digit of 1547377? 4 What is the units digit of 82525? 5 What is the hundreds digit of 230925? 9 What is the hundreds digit of 38735851? 8 What is the thousands digit of 180772? 0 What is the ten thousands digit of 7163244? 6 What is the hundreds digit of 15442913? 9 What is the ten thousands digit of 784160? 8 What is the ten thousands digit of 3478876? 7 What is the tens digit of 1219894? 9 What is the hundreds digit of 584765? 7 What is the tens digit of 4217553? 5 What is the units digit of 18002067? 7 What is the tens digit of 2689204? 0 What is the ten thousands digit of 304177? 0 What is the ten thousands digit of 1158363? 5 What is the ten millions digit of 26844654? 2 What is the hundreds digit of 155933? 9 What is the tens digit of 2123511? 1 What is the ten thousands digit of 756991? 5 What is the units digit of 210299? 9 What is the thousands digit of 2536289? 6 What is the units digit of 596424? 4 What is the tens digit of 1615114? 1 What is the thousands digit of 566222? 6 What is the tens digit of 12528784? 8 What is the tens digit of 2990505? 0 What is the ten thousands digit of 124316? 2 What is the units digit of 131451? 1 What is the hundred thousands digit of 2639191? 6 What is the hundreds digit of 16288190? 1 What is the hundreds digit of 364141? 1 What is the hundred thousands digit of 242869? 2 What is the thousands digit of 18625? 8 What is the units digit of 25175875? 5 What is the tens digit of 173766? 6 What is the thousands digit of 2956202? 6 What is the millions digit of 1905183? 1 What is the ten thousands digit of 2009412? 0 What is the hundred thousands digit of 2121725? 1 What is the units digit of 221028? 8 What is the tens digit of 696817? 1 What is the hundreds digit of 754261? 2 What is the millions digit of 1454098? 1 What is the hundred thousands digit of 1342723? 3 What is the units digit of 5159084? 4 What is the hundreds digit of 242224? 2 What is the tens digit of 1850239? 3 What is the hundreds digit of 406588? 5 What is the tens digit of 2749643? 4 What is the tens digit of 7321194? 9 What is the units digit of 442853? 3 What is the ten thousands digit of 23282? 2 What is the tens digit of 301254? 5 What is the thousands digit of 1716744? 6 What is the tens digit of 14918119? 1 What is the tens digit of 1570113? 1 What is the units digit of 2597997? 7 What is the millions digit of 1071827? 1 What is the ten thousands digit of 2189925? 8 What is the ten thousands digit of 589420? 8 What is the millions digit of 3012510? 3 What is the ten thousands digit of 4804543? 0 What is the hundreds digit of 292604? 6 What is the thousands digit of 234876? 4 What is the thousands digit of 3325439? 5 What is the hundred thousands digit of 1964915? 9 What is the units digit of 19129816? 6 What is the tens digit of 89294? 9 What is the hundreds digit of 8349436? 4 What is the tens digit of 118482? 8 What is the tens digit of 1485273? 7 What is the ten thousands digit of 441220? 4 What is the hundreds digit of 329496? 4 What is the hundreds digit of 663908? 9 What is the hundred thousands digit of 228654? 2 What is the units digit of 5896822? 2 What is the thousands digit of 584592? 4 What is the tens digit of 295693? 9 What is the units digit of 1176334? 4 What is the hundred thousands digit of 9237202? 2 What is the ten millions digit of 15422384? 1 What is the ten thousands digit of 3549263? 4 What is the tens digit of 744919? 1 What is the ten thousands digit of 601941? 0 What is the units digit of 2374436? 6 What is the hundred thousands digit of 6702273? 7 What is the thousands digit of 1	{ "pile_set_name": "DM Mathematics" }
-21040. Suppose 0 = -8g + 3g - 3u - 8, -5u = g + 6. Which is the closest to -6? (a) 0.2 (b) y (c) g c Let i = -1.21 + 61.31. Let q = -70.1 + i. Which is the nearest to 1? (a) -1/2 (b) 0.5 (c) q b Let n = 0.2 + 0.1. Let r = 7963/5 + -1593. Let s = 10 + -14. Which is the nearest to -1? (a) s (b) r (c) n b Let r = 0.05 - -4.95. Let f = -822.2 + 822. What is the nearest to 2/3 in -0.03, f, r? -0.03 Let j = -1.469 - -0.969. Let i be -3(2 + (-132)/81). Let h = i - -17/18. Which is the nearest to -2? (a) h (b) -0.4 (c) j c Suppose 26 = -3l + 17. Let i be 8/(-10)(75/(-70))/l. What is the closest to i in 1/3, 11, -4? 1/3 Let g be (-53504)/297792 - 6/141. Suppose q + 4r = -r, -2r = 5q - 23. Which is the nearest to -1? (a) -5 (b) q (c) g c Let x = -14465.95 + 14466. What is the nearest to -2/11 in 0, 2/269, x? 0 Let v = 11.733 - 10.063. What is the closest to -0.7 in v, -5, 0? 0 Suppose -81i - 166 - 1206 = 262i. What is the closest to i in -5, -3/11, 2/37? -5 Let v(m) = -m*3 + 6m*2 - 5m + 1. Let n be v(6). Let w be (50 - 59)/(6 - 3). What is the closest to 0.1 in -2, w, n, 2/7? 2/7 Suppose -3k + 59 - 104 = 0. Let r be (-12)/152(140/k)/(-7). What is the closest to 1/23 in 4, 5, r, 0? 0 Let d = 0.04229 + 6.95771. What is the nearest to d in -1/4, -18, 1/4? 1/4 Let n be (-56)/(-6) - (-4)/6. Suppose nr - 30 = 20r. Let m be r + 10/45 + 3. What is the nearest to m in -3/2, 4, 2? -3/2 Let f = 0.04431 + -0.44431. What is the closest to 3 in 4, 2/3, -2, f? 4 Suppose -6l = -5l. Let t = -1231.6 - -1231.1. Let a be -2 - 1(-2)/6. What is the closest to t in -3, l, a? l Let r(w) = w2 + 37w - 108. Let a be r(-42). What is the nearest to a in 4, 2, 3/4, -2? 4 Let c = -8 - -2. Suppose 1 = -19z + 1 - 0. What is the closest to -2 in 0.4, c, -5, z? z Let q = 140/153 - 8/17. Let l = -0.59 - -0.6. Which is the closest to 0? (a) 5 (b) 1/5 (c) l (d) q c Let h = 0.4 + -0.2. Suppose 32586 = 105y + 31746. Which is the nearest to 0? (a) -0.4 (b) h (c) y (d) -0.5 b Let k = 4/337 + 313/2022. What is the closest to 0.6 in k, 1, -0.06? 1 Let m = -3975 - -19869/5. Which is the nearest to -1/5? (a) -1 (b) 2/9 (c) 3 (d) m b Let t(g) = -g*2 - 205g - 6219. Let q be t(-37). Which is the closest to -1/2? (a) -3/17 (b) -10 (c) q a Let r = -13.3149 + 0.3149. What is the nearest to r in -1/8, -0.5, 1, 2? -0.5 Let s = 591 - 153. Let t = 439 - s. Which is the closest to t? (a) 1 (b) -2 (c) -1 a Let j = -29874/687631 + -1/29897. What is the nearest to 0 in -3/5, j, 1/55? 1/55 Let m = 0 - 1. Let y = -6.75 - -5.977. Let v = 0.673 + y. Which is the closest to v? (a) -7 (b) m (c) -0.1 c Let l be -6 - (-1 + 4)/(1 + (-7 - -5)). Let w = -0.87 - 0.13. What is the closest to 2 in l, -0.4, w? -0.4 Let x = 1540.8 + -1544.8. Which is the closest to -36? (a) x (b) 0.3 (c) -44 c Let n = -227.27 - -20.27. What is the closest to 0.2 in n, -0.3, -0.4, 5? -0.3 Let v = -46.81 + 2.11. Let z = 38.7 + v. What is the nearest to 3 in z, 4, 0.2? 4 Let q = -115/4 + 29. Let g = -4686 + 4687. What is the closest to q in g, -0.01, 2? -0.01 Let c = 5 - 10. Suppose -2n = -5j + 2n - 442, -3j - 278 = 4n. Let q be (-4)/10j/144. What is the closest to 0 in -4, c, q? q Let d be 4/(-3) - (-10 + -1)/(-173 - -170). What is the nearest to -2 in 13, -0.2, d, -24? -0.2 Let f = 80.048 + -80. Let w = f + -3.048. Which is the closest to 0.1? (a) -1/3 (b) w (c) 0 c Let s = 0.937 - -1.063. Let a = -1.98 - 0.02. What is the nearest to s in a, 1, -0.37? 1 Let x = -1/7186 - -14379/50302. Which is the closest to x? (a) -0.3 (b) 4 (c) 1 (d) 52 a Let f = 148742 + -148741. Let x be 1/(2(-2)/12). Which is the closest to f? (a) 0 (b) x (c) -6 a Let s = -84.05 - 15.95. Let o = 2464.3 - 2364. Let r = o + s. What is the closest to -1 in -0.1, 5, r? -0.1 Let f = -0.02 - -1.02. Let t = 12244 - 12246. Which is the closest to -2? (a) 8 (b) f (c) t (d) -2/3 c Let f = -1627.9 - -1628. Which is the closest to f? (a) 8 (b) 9 (c) -0.2 (d) 0 d Let u = 230.9 + -231. Let d be 518/555 - 8/10. Let f = -3.2 - -3. What is the closest to 1 in f, d, u? d Let v = 0.7 - 3.7. Let m(y) = -25789y + 180518. Let q be m(7). Which is the closest to 2/7? (a) v (b) -1 (c) q (d) 5 b Let b = -26607 + 26607.4. What is the closest to 0 in -7, -6, b, 1? b Let u be (-88)/(-33)1/36. Let q = -56 - -47. Let k be ((-3)/(-2) + -2)/(q/(-12)). Which is the closest to k? (a) -1/4 (b) u (c) -4 a Suppose 5r - 270 = 5d, -5r - 106 = 2d + 9. Let z = d + 109/2. Which is the closest to 4? (a) z (b) -5 (c) -3/8 c Suppose 222 - 591 - 192 = 33w. What is the nearest to w in 0.3, -5, -1/2, -3? -5 Let i = 15 + -36. Let q = 13 - -10. Let o = i + q. Which is the closest to o? (a) 2/5 (b) 2 (c) -3/5 b Let q = -81 - -43. Let h = q - -33.5. Let y = h - -0.5. Which is the nearest to 1/3? (a) y (b) 0.5 (c) -5 b Let y = -11 + -20. Let d = y - -86. Let c = d - 54.7. What is the closest to 2/5 in -5, 5, c? c Let n = 1 - 0.9. Let x(d) = d*3 + 22d*2 + 18d - 64. Let j be x(-21). Let h be (30/(-24))/5j. Which is the closest to 5? (a) h (b) 1/2 (c) n b Suppose -8b + 10 = 7b - 5. What is the closest to 1/4 in b, -2, -0.28? -0.28 Let p = -234.02 - -236. Let l = 0.02 + p. Let t = 0.056 - 0.016. Which is the nearest to l? (a) t (b) 2/5 (c) 0.2 b Let t = -1453.58 + 1429. Let g = t + 25. Let m = -0.02 + g. Which is the closest to 9/5? (a) -2/3 (b) m (c) -5 b Let o = -6971 - -6725. Which is the closest to -0.1? (a) -0.2 (b) o (c) -1 a Let g = 995 - 995.05. What is the nearest to -0.2 in g, 2, 0.5, -1/4? -1/4 Let y = 1392.5 + -1392.5. Let k = 3.1 - 3. Which is the nearest to y? (a) -4/3 (b) 2/5 (c) k c Let v = -23328 + 209950/9. What is the closest to 2 in 0.4, -0.41, v? 0.4 Suppose m - 6 = -2s, -m + 26s = 25s. Which is the nearest to 0? (a) m (b) -31 (c) -2/7 c Let y = -53.087 + 0.087. Let o = y - -51. Let d(k) = -2k3 + 7k*2 - 4k + 2. Let h be d(3). Which is the closest to h? (a) 5 (b) o (c) -2/15 c Let h = 651 - 655. Let m = 113/8 - 7555/536. Let a = m - -187/469. What is the nearest to -4 in a, -3, h? h Let m = -25/8 - -7/2. Let z = -7/40 + m. Let d = -16 - -16. Which is the nearest to d? (a) -4 (b) z (c) 0.5 b Let s = 239 - 238. Let g = 5 - s. Which is the nearest to 0.6? (a) -2 (b) g (c) -2/9 c Let q = 12.91 - 12.11. Which is the closest to 0.2? (a) q (b) -3 (c) 3 (d) 0.4 d Let d = 0.04113 - 0.14113. Which is the closest to d? (a) 0.3 (b) -0.02 (c) -39 b Let i = -680.63 + -5.37. Let l = i + 674. Let r = -1.2 + 0.2. Which is the closest to -1? (a) l (b) r (c) -2 b Let i be (-72)/(-40) - (-7 - (-3 - 6)). Which is the nearest to 4? (a) i (b) 2/13 (c) -3 (d) 3 d Let n = -454 + 455. Let z be (484/24)/(-11) - n/6. Let u = 0.3 - 0.8. What is the closest to 1 in u, 2, z? 2 Let k = -13 + 9. Let j = 2/82185 - 164404/1397145. What is the closest to j in -2/5, k, -3? -2/5 Let n be 64(-168)/(-9408). Which is the nearest to -0.07? (a) -2 (b) n (c) 0 (d) -48 c Let d = 0.1 - -0.9. Let v be 46/((-96)/(-1028)). Let w = -253 + v. Which is the closest to d? (a) -0.3 (b) w (c) 0.5 c Let o = -0.6 + -2.4. Let r be (-24)/282(-98 + 51). Which is the nearest to 0? (a) r (b) 0.3 (c) o b Let k(c) = -2c + 18. Let i be k(8). Suppose -z - i = 0, 3l - 4 = 2z - 12. Let m = 434 + -434. What is the closest to m in 12, 0, l? 0 Suppose 3v = 2p - 3p - 10, 6p - 30 = 0. Which is the closest to -5? (a) v (b) -10 (c) 4/5 a Let v = 15/4 - 87/20. Suppose 4b - 85 = 21*b. What is the closest to v in b, 2/5, -9? 2/5 Let a = -1261/20 - -8787/140. Let k be 6/(-9) + 0 - 0. What is the closest to -11 in k, 1/4, a? k Let d be (3/2)/((-39)/(-4)). Let l = 265 + 70. Let b = 334 - l. What is the nearest to 2/5 in d, 1/4, b? 1/4 Let x = -9199.9 - -9200. Which is the nearest to x? (a) 9/43 (b) 1/2 (c) -1 a Let s = 1277.5 - 1278. Which is the nearest to -10? (a) s (b) -1 (c) 46 b Let i be (-15)/28 - 4/(-14). Let y = -12991 - -12994. Which is the closest to i? (a) 0.2 (b) 3/10 (c) y a Let f = -0.03 - 0.47. Let u = -0.036 - 5.664. Let o = -10.7 - u. What is the closest to 2/7 in f, o, -0.1? -0.1 Let x be 2 - (30/(-40) - (-10)/(-8)). Which is the nearest to x? (a) -1/4 (b) -1	{ "pile_set_name": "DM Mathematics" }
at most -1? False Are 32744 and 32746 nonequal? True Is 2/9 at most -28941? False Is -1661929 < -1661927? True Is 593 < 207? False Are -76458 and -76458 equal? True Which is smaller: -102/31 or -4/185? -102/31 Which is smaller: 0.28 or -178.6? -178.6 Do 1 and 92/1931 have different values? True Which is smaller: -0.1494547 or -2? -2 Is 43273 bigger than 302914/7? False Which is bigger: 1 or -42.50226? 1 Which is smaller: -2.3 or -11010? -11010 Which is bigger: 2/11805 or 0? 2/11805 Which is smaller: 24678 or 24680? 24678 Which is smaller: 95799 or 95797? 95797 Is -38228/13 at most -2942? False Which is smaller: 388737/11 or 35340? 388737/11 Is 32237 greater than or equal to 32282? False Which is bigger: -1069258 or -1069260? -1069258 Is -3426811 at most -0.1? True Which is smaller: 0 or -80/6491? -80/6491 Is -522 smaller than -862? False Is 4168 >= 179246/43? False Is -8564 greater than -8570? True Which is smaller: 1610 or 1640? 1610 Is 1064336 smaller than 1064336? False Which is bigger: 2217048 or 2217047? 2217048 Which is greater: -2717 or -2716? -2716 Which is smaller: -4693 or -14078/3? -4693 Does -7 = -12179/1582? False Does -1 = 17/30641? False Are 1.7 and -3.04 nonequal? True Which is greater: 0.2 or 111557? 111557 Is -8951554 < -8951555? False Which is smaller: 56/96737 or -1? -1 Which is bigger: -18235 or -18237? -18235 Are -42428 and -42428 non-equal? False Which is smaller: -14498 or -188478/13? -188478/13 Which is smaller: 6/723103 or 0? 0 Which is bigger: 966 or 1034? 1034 Which is smaller: 299393 or 299394? 299393 Which is greater: -81528 or -81527? -81527 Is -18727 at least as big as -18719? False Is 17002 >= 17000? True Is 540293 bigger than 540293? False Is -5 <= 952.03? True Which is smaller: 476111 or 0? 0 Is -34123 at most as big as -34123? True Which is bigger: 145366 or 145365? 145366 Which is greater: -2 or -12979? -2 Which is greater: 379/3440 or -1? 379/3440 Which is smaller: -23792/7 or -3400? -3400 Do -80144/19 and -4218 have the same value? False Is 0.4691 <= -170? False Do 120609 and 120610 have different values? True Is 384 greater than -6392? True Which is smaller: -1 or 7/12403? -1 Is 2/612385 at most -1? False Which is smaller: 1/17 or -388/7? -388/7 Which is greater: -18874 or -18869? -18869 Is 2 <= -1014/1661? False Are -8118 and -8107 equal? False Which is bigger: 0 or 254/3363? 254/3363 Which is greater: -1.962 or -1585? -1.962 Are -59267 and -11 nonequal? True Which is smaller: 234 or -160? -160 Which is smaller: -1 or -1/10350284? -1 Is 667 != 787? True Which is smaller: 55 or 3/337? 3/337 Which is smaller: -11/211182 or 0? -11/211182 Which is greater: 1559/4 or -358? 1559/4 Are 6835 and -1.5 unequal? True Which is smaller: -16797/2 or -8400? -8400 Is -295826 less than -295829? False Is 134 at least as big as -3? True Is 1 greater than or equal to -4/22839? True Is 54643 >= 54643? True Which is smaller: -2/21 or 0.754? -2/21 Is 1991 > 1976? True Is 8 less than 5649/701? True Is 311.71 greater than -1? True Is -245224 not equal to -245192? True Which is smaller: -4037 or -4062? -4062 Is 0.03593 less than or equal to -119? False Which is smaller: 822 or 22977/28? 22977/28 Is 5/96756 less than -1? False Is -0.058 > -6/557? False Which is bigger: -28.8 or 0.106? 0.106 Which is greater: -2.3022 or -23.6? -2.3022 Which is greater: 6506 or 6507? 6507 Which is bigger: -0.6 or 6/43747? 6/43747 Is 1073 bigger than 1070? True Is -0.3 equal to 293260? False Which is bigger: 1 or 2/6411955? 1 Is -11 greater than -2550/241? False Which is smaller: 69117 or 69116? 69116 Is -11/5 < 852? True Which is smaller: -1128 or -10? -1128 Is 0 bigger than 2/59735? False Is 12969 bigger than 12968? True Is 186 at least 217? False Which is bigger: 15864 or 31725/2? 15864 Which is smaller: 1 or -47/7750? -47/7750 Is 13 >= -19.916? True Are -4399516 and 0.1 equal? False Which is smaller: -1 or 30/17567? -1 Is -50176 less than or equal to -50175? True Which is greater: 552/55 or 9? 552/55 Which is bigger: 112475 or -0.4? 112475 Which is bigger: 368 or 8484/23? 8484/23 Which is smaller: -9/10 or 62? -9/10 Is 1276/19 >= -1.3? True Which is greater: 688244 or 2064736/3? 2064736/3 Which is greater: 599263 or 599265? 599265 Is -1 < -6/809935? True Are -68746/15 and -4584 unequal? True Which is smaller: -13/182453 or 1? -13/182453 Is -1693 equal to -1705? False Which is smaller: -807444 or -807443? -807444 Do 125 and -3412/9 have the same value? False Which is bigger: 70650 or 70649? 70650 Do -92364 and -92364 have different values? False Which is smaller: 4/73 or -0.78987? -0.78987 Which is smaller: -18/265649 or 0? -18/265649 Is -1149 less than or equal to -9? True Which is bigger: -2262062/7 or -323151? -323151 Is -43/4 < -14.1? False Which is smaller: -0.1 or -71482? -71482 Which is greater: -13023 or -1/3? -1/3 Which is smaller: 2980 or 2978? 2978 Is 1 less than or equal to -88/2789? False Which is smaller: -4864.9 or -5? -4864.9 Which is bigger: -35 or -1675? -35 Is 8300 at most as big as 8302? True Which is greater: -2/2551 or 26.7? 26.7 Is 2/1071185 > 0? True Which is smaller: 757.9 or 66? 66 Is -0.069 smaller than -265/4? False Do -198/22687 and -1 have the same value? False Which is bigger: 62206 or -2/3? 62206 Which is smaller: 422 or 1089? 422 Which is greater: 113501/2 or 56752? 56752 Is 2/23 > 5.1? False Which is greater: 2866/1521 or 3? 3 Which is bigger: 5759 or 92161/16? 92161/16 Which is greater: -8542 or -8544? -8542 Which is smaller: -26 or -6772/255? -6772/255 Which is smaller: -14/1399 or 3/11? -14/1399 Is 67 less than 1229/18? True Which is smaller: 8866 or 8863? 8863 Which is smaller: -2/125 or -16.6? -16.6 Are 261106 and 261104 unequal? True Which is smaller: -25122 or -25123? -25123 Which is greater: -97540 or -97536? -97536 Is 467/9 > 2/23? True Is 7866334 less than or equal to 0.1? False Is 7792/33 != 236? True Which is smaller: -84183/4 or -21047? -21047 Is 720/5111 less than or equal to 1? True Do -721/1012 and -1 have the same value? False Which is greater: 30337 or 30331? 30337 Which is bigger: -53/3 or -36/13? -36/13 Which is smaller: 228300 or 228297? 228297 Is -5/210598 not equal to 1? True Which is smaller: 13122 or 13125? 13122 Is 119976 equal to 0? False Is -4128/223 smaller than -19? False Is 0 greater than 10/360311? False Is -10/4759 > -1? True Is 0 equal to 215/31619? False Which is smaller: -13069 or -22? -13069 Which is smaller: -11183 or 163? -11183 Is -2 less than 0.88359? True Is -12644 equal to -12646? False Which is smaller: -193048 or 0? -193048 Are -0.10396 and 2.9 non-equal? True Which is smaller: 564/1333 or 1? 564/1333 Are -43839 and -43835 equal? False Which is greater: -5/646 or -95? -5/646 Which is greater: -106227 or -106222? -106222 Do 11/622 and -2 have different values? True Do 3/32287 and 1 have the same value? False Does -3/2 = 2032/13? False Which is bigger: 1 or 20/233999? 1 Is 1 < 2/391259? False Is 10823 <= 10839? True Do -39324 and -39322 have different values? True Which is smaller: -1 or -1659/2635? -1 Is -89744/3 smaller than -29914? True Which is smaller: -0.199 or 18890? -0.199 Which is smaller: -29107 or -378392/13? -378392/13 Are -1 and 12/1186835 equal? False Is -110/68301 equal to 0? False Which is greater: -1 or -4.71371? -1 Are -104413 and -104414 nonequal? True Is -1409144 at least -1409144? True Which is greater: 0.4311 or 0.01? 0.4311 Which is greater: -301 or -167? -167 Which is smaller: 1/143074 or -1? -1 Is -59 bigger than -1537/26? True Is -832049 not equal to -832048? True Is 5985 bigger than 5991? False Is -620697 at least -0.1? False Which is smaller: 8764 or 8760? 8760 Which is smaller: -88224 or -88225? -88225 Which is bigger: 15/191138 or 0? 15/191138 Which is bigger: 126/58507 or 0? 126/58507 Which is smaller: 51.06355 or -1/2? -1/2 Which is smaller: -7544 or -7541? -7544 Are 12 and 66 non-equal? True Which is smaller: -106683/79 or -1351? -1351 Which is smaller: 8 or 3755.96? 8 Is -138856 > 17? False Does -364/18441 = -1? False Which is bigger: -2.4744 or 6? 6 Which is smaller: 137210 or 0? 0 Is 0.19 less than 1203? True Which is smaller: 240 or 6439? 240 Is 8/364973 > 0? True Which is smaller: -5/2 or -376123? -376123 Is -1709 at least -153	{ "pile_set_name": "DM Mathematics" }
24 or 132? 132 Is 1426 less than or equal to 1426? True Which is smaller: -0.2 or -643? -643 Which is smaller: 142 or 141? 141 Which is greater: -4483 or -4482? -4482 Is -225 less than -223? True Which is greater: -3/338 or 0? 0 Which is smaller: -2/11 or 1.02? -2/11 Is -35 >= 35? False Which is smaller: 58 or 54? 54 Are 1175 and 10585/9 equal? False Which is smaller: -36 or -35? -36 Which is greater: -1/1456 or 0? 0 Which is smaller: 2/3 or 4.11? 2/3 Is -74 smaller than -521/7? False Is -101 > -0.15? False Is 0 at most as big as -3/491? False Do -6208 and -6208 have the same value? True Which is smaller: -0.1 or 2885? -0.1 Is -0.02 at most as big as 33? True Is 1 less than -1/240? False Which is smaller: 4 or -11? -11 Is -6/35 > 1? False Which is greater: 351/56 or 7? 7 Which is smaller: 70 or 1? 1 Is -1724 <= -1726? False Which is smaller: -7 or -292/45? -7 Is 1 at least as big as -375? True Are -383 and -372 unequal? True Which is bigger: -1/52 or -0.2? -1/52 Is 48.5 smaller than 0.1? False Which is bigger: 3650 or 3652? 3652 Which is bigger: 0 or -7/16? 0 Is 281 at most -0.3? False Which is smaller: 264/469 or 0? 0 Do 0 and 1/3224 have different values? True Which is bigger: 931/3 or 310? 931/3 Which is bigger: -2/1041 or -1? -2/1041 Is -4 equal to -71? False Which is bigger: 36 or 39? 39 Which is smaller: -14 or -2? -14 Which is smaller: 180/19 or 9? 9 Which is greater: -132 or -135? -132 Which is smaller: 5.021 or -1? -1 Is 152 greater than or equal to 1/2? True Which is smaller: 34466 or 34465? 34465 Is -222/13 less than or equal to -17? True Which is bigger: -154 or -1069/7? -1069/7 Is 2/443 > -65? True Which is greater: -67644 or -67643? -67643 Is -60 >= -4/3? False Which is bigger: 248.6 or 0? 248.6 Are -20 and -1144/59 non-equal? True Is -202/33 <= -5? True Do 4247 and 4250 have the same value? False Which is smaller: -389 or -392? -392 Which is smaller: 2 or -9? -9 Which is smaller: 971 or -1/11? -1/11 Does -2749 = -10991/4? False Is 3538 > 3530? True Which is bigger: -2/9 or 8? 8 Which is bigger: 3 or 168? 168 Is -3/131 at least as big as 3? False Are -2.14 and 3 equal? False Which is smaller: -851/3 or -285? -285 Is -3552 less than -3553? False Which is smaller: 69 or 277/4? 69 Is 2 equal to -60? False Does -16/17 = -5/2? False Is 71 at most as big as 121? True Which is smaller: -10 or -78/7? -78/7 Are -1 and -2/3261 equal? False Which is smaller: 10.2 or 0.1? 0.1 Which is bigger: 2 or 44/41? 2 Which is smaller: -10 or -197/21? -10 Which is smaller: 1 or -3/48722? -3/48722 Which is smaller: -1076 or -1078? -1078 Which is smaller: 72 or 31? 31 Which is bigger: -3096 or 1? 1 Which is smaller: 1181/4 or 294? 294 Are -0.1 and 0.7 unequal? True Which is smaller: 697/2 or 348? 348 Which is smaller: 296 or 297? 296 Is -0.36 less than or equal to -3? False Do -1/32 and 2/193 have the same value? False Is -1155 <= -3464/3? True Which is smaller: -347 or -344? -347 Is -337/2 greater than or equal to -169? True Which is smaller: -90 or -177/2? -90 Which is greater: 2314 or 2317? 2317 Which is greater: 14 or 2/11? 14 Is -3 less than or equal to 1? True Which is smaller: 186 or 119? 119 Is 29.8 smaller than 0.1? False Is 1895 smaller than 1895? False Which is greater: -23 or -1.4? -1.4 Which is bigger: 3/7 or -52.9? 3/7 Do -240/13 and -19 have the same value? False Is 0.0102 smaller than 4? True Which is bigger: 0 or -13/639? 0 Which is greater: 0.1069 or 0.3? 0.3 Which is smaller: -59 or -57? -59 Which is smaller: -228 or -218? -228 Is -46 at least as big as -50? True Which is smaller: -5 or -9? -9 Which is smaller: -32/19 or -3? -3 Is -15 bigger than -296/19? True Is -8 at most as big as -1? True Is -3 at least -12/7? False Is -126 < -132? False Which is smaller: -6/13205 or 0? -6/13205 Which is bigger: 0 or -49/164? 0 Which is greater: 1549 or 1552? 1552 Which is bigger: -265 or -258? -258 Which is greater: 2354 or 2353? 2354 Is -0.09 <= -0.2? False Is -238/3 greater than -80? True Is -1340 > -1340? False Which is smaller: 244 or 1? 1 Is -1521 at most as big as -1521? True Is -146 < -3/4? True Which is bigger: -2/13 or 2.582? 2.582 Do 445 and 442 have the same value? False Which is bigger: 2 or 43/22? 2 Which is greater: -0.1 or -9541? -0.1 Which is smaller: -0.1 or -1/3? -1/3 Is 43 > 51? False Is 686/27 > 24? True Which is greater: -9/32 or -1? -9/32 Which is smaller: 2/7 or -59? -59 Are -39/4 and -10 nonequal? True Is -0.6299 smaller than 2/3? True Is 23367 greater than or equal to 23367? True Which is greater: 3822 or 3821? 3822 Which is greater: -10/9329 or -1? -10/9329 Which is smaller: 375 or 376? 375 Which is smaller: 50 or 49? 49 Is -327 greater than or equal to -328? True Is 14/1425 at most 0? False Which is smaller: 385/31 or -1? -1 Is 1 <= 3/23? False Which is smaller: 3170 or 3168? 3168 Is 18525 at most as big as 18524? False Which is bigger: 1 or 22/69? 1 Which is smaller: -1 or -27/571? -1 Which is smaller: -7350 or -7349? -7350 Is 11/17 > 2? False Which is bigger: 166 or 146? 166 Is 4390 <= 4390? True Which is smaller: -76/833 or 1? -76/833 Is 2 < 24/23? False Is 1582 not equal to 1580? True Which is bigger: -63 or -4? -4 Is 25 greater than 9? True Is -150 greater than or equal to 21? False Is -55 less than or equal to -54? True Which is smaller: 25/31 or 2? 25/31 Which is greater: 60 or 31.4? 60 Is 87 <= 175/2? True Which is smaller: -2420 or -2418? -2420 Which is greater: -27 or -172? -27 Which is smaller: -8 or 12? -8 Is 2.3 > -4/7? True Is 409 at most 410? True Which is smaller: -1 or 13/47? -1 Is 2/12781 <= -1? False Which is bigger: 17/5 or 5/97? 17/5 Is -1/1272 less than 0? True Which is smaller: -206 or -210? -210 Is 18 bigger than 18? False Does 558 = 5? False Which is bigger: 3369 or 3370? 3370 Is 83 bigger than -3? True Which is bigger: -37213 or -37212? -37212 Is 3/1096 equal to 1? False Which is greater: 1072 or 1074? 1074 Is 4 smaller than 181/7? True Which is greater: 3 or 148/79? 3 Is -4762 less than or equal to -4762? True Are 147 and 148 equal? False Which is smaller: 0.7 or 1.51? 0.7 Which is greater: -46/191 or -1? -46/191 Is 1/5 less than or equal to -3.4? False Is -2/5 at most as big as 197? True Is -1971 < 1? True Which is bigger: 93 or 88? 93 Is 21 >= 552/25? False Which is smaller: -406 or -361? -406 Is -26.3 greater than 2? False Which is bigger: -0.1 or -2182? -0.1 Which is greater: 56 or -4? 56 Which is smaller: 516 or 4123/8? 4123/8 Is -6 != 52? True Is 1/2 smaller than 29965? True Which is greater: -79 or -80? -79 Which is smaller: 0 or 1.742? 0 Which is smaller: -1 or 22/1887? -1 Is 0.01 smaller than 28.2? True Which is smaller: -1 or -1/111? -1 Which is smaller: 2/9 or 9721? 2/9 Which is smaller: 514 or 512? 512 Which is smaller: 3/134 or 2? 3/134 Is 34/97 greater than 0? True Which is smaller: 1 or 4/7? 4/7 Which is bigger: -1 or 1/874? 1/874 Which is smaller: -718 or 1/5? -718 Do -21/50 and 0 have the same value? False Which is smaller: 169 or 167? 167 Is -723 at most 2? True Is -394 at least -397? True Which is bigger: 560 or -0.2? 560 Which is smaller: -1 or -4/37067? -1 Is -198 bigger than -53? False Which is greater: -1167 or -15190/13? -1167 Which is smaller: -65 or -74? -74 Which is smaller: 12/155 or -1? -1 Is 163 greater than 141? True Is 4368 > 2? True Is 2300 > 2291? True Which is greater: 1/4997 or -1? 1/4997 Is 7 less than 1109? True Is 2/441 bigger than 1? False Are 36 and 36 non-equal? False Which is smaller: 1 or 2/1635? 2/1635 Which is smaller: 1 or -13/62? -13/62 Which is greater: -46/3 or -16? -46/3 Is -2/393 equal to -2/3? False Is -6965 greater than -6964? False Do 4/8783 and 0 have the same value? False Which is smaller: -1 or -1/772? -1 Are 1/9561 and 1 unequal? True Which is smaller: -130 or -1039/8? -130 Is -193 at least -194? True Which is smaller: -141/5 or -29? -29 Which is smaller: -11/171 or -1? -1 Which is greater: 3006 or 0.1? 3006 Is 2288 > 2290? False Is -1420/3 > -472? False Is -3/46 smaller than -17? False Is -228 != -232? True Which is smaller: -52 or 0? -52 Which is smaller: 31 or -0.066? -0.066 Which is smaller: 73 or 510/7? 510/7 Is 711 at least as big as 0.1? True Is 558 bigger than 568? False Which is greater: 0 or -3/113? 0 Which is smaller: -3/	{ "pile_set_name": "DM Mathematics" }
i2 and give t. -1 Rearrange -2q - 2q + 6q + (-2q + 2 - 2)(-4 + 1 + 1) + (-86q + 45q + 58q)(0 + 3 - 2) to the form f + bq and give b. 23 Express 36d2 + d4 + 2d3 + 3d - 29d2 - 3d as yd4 + hd*3 + z + ld*2 + vd and give v. 0 Rearrange -50z2 + 142z*2 + z - 18z*2 + (-5z + 3z + 0z)(-3 + 2z + 3) to kz2 + gz + p and give g. 1 Express (-4 + 4 + 4p)(2p - 2p - 2p) - 10 + 10 - 8p*2 in the form k + rp + vp2 and give v. -16 Express (-3l + 2l + 3 + 0l)(0 - 4 - 7)(4 - 3 - 2) in the form m + wl and give m. 33 Express -2n2 + n3 + 4n3 + 101n - 101n in the form in*2 + xn*3 + wn + z and give i. -2 Express t + 2t3 - t + (-76t + 9t2 + 76t)(-2t + 2t + t) + 2t*3 - 3t*3 + 3t*3 as wt*3 + lt*2 + mt + f and give w. 13 Rearrange -7 - 47z2 + 13 - 5 - 10z*2 to the form wz*2 + mz + q and give w. -57 Rearrange 0m - 4m*3 + m + 2m*3 + (-2m - 2m + 2m)(-3m*2 + 3m2 - m2) + 3 - 3 - m*3 to pm*2 + h + ym + nm3 and give y. 1 Express 124 + 45 - 234 + y as by + k and give k. -65 Express (-3 - 228k + 230k + 6)(-5 - k + 5) in the form qk + dk2 + p and give d. -2 Rearrange 20y*2 + 89 - 89 to the form qy*2 + ty + r and give r. 0 Rearrange -2b2 - 4 - 9 + 0b*2 - 2b + 3 - 2b3 to the form a + hb*2 + kb + ib3 and give h. -2 Rearrange (-2t - 2 - 5 + 6)(6t*2 + 10t*2 - 6t*2) to the form h + yt + mt3 + ot*2 and give m. -20 Express 0s2 + s2 - 8s2 - 6s*2 in the form vs + is2 + u and give i. -13 Express (7 - 8 - 3a*2 - 9)(4 + 2a - 4) in the form fa*2 + q + ka + sa3 and give s. -6 Express (2 - 5i - 5i - 2i)(-3 + 1 + 3) in the form gi + j and give g. -12 Rearrange (1 - 3 + 0)(p - 3p + 0p) - 59p + 9p + 5p to the form vp + o and give o. 0 Express -3 + 3 - 33o*2 in the form zo + b + lo2 and give l. -33 Express 2r*2 - 47 + 7r*3 + 47 - 3r*3 in the form kr + xr2 + q + sr*3 and give x. 2 Rearrange -7q + 8q + 7q + 6q to uq + c and give u. 14 Express 5q3 + 3q + 2 - 7q3 - q3 in the form hq + jq3 + sq*2 + a and give a. 2 Rearrange ((2 + 1 - 5)(2 - 2 - 1) + 2 - 2 + 2 + 1 + 1 - 1 - 3 + 2 - 1)(5 - 2s - 5) to the form w + us and give u. -6 Express (b2 + 2b2 - b2)(-16b + 19b + 16b + (-2b + 0b - b)(1 - 1 + 2)) as qb + zb2 + k + fb*3 and give f. 26 Express (2v - 2 + 2)(-65v*2 + 2v*2 + 9v*2) as uv + jv3 + kv*2 + d and give j. -108 Express 6s + s*4 - 3s4 + 1 + s3 + 1 in the form ls4 + os + ys2 + xs*3 + i and give i. 2 Express 49s - 13s + 89s in the form m + ns and give n. 125 Express 17c + 18c + 30c - 9c in the form hc + f and give h. 56 Express 2h2 + 8h*3 + 4h*2 - 4h*2 in the form mh*3 + ch + ah2 + x and give m. 8 Express -5q + 6q + 20q in the form mq + a and give m. 21 Express -25t*2 + 26t*2 - 2 - 5t + 4 as f + pt2 + zt and give z. -5 Express 18v - v2 - 32 - 4v - 2v3 + 32 as rv*3 + mv*2 + bv + j and give b. 14 Express (-2 + 0 + 4x + x)((5x - 5x - 2x)(3x + 0x - 4x) - 2x*2 - 3x*2 + 4x*2) as g + lx + bx3 + zx*2 and give b. 5 Rearrange 2d*3 + 0d*3 + 0d*3 + 3d - 3d2 + 0d to ld2 + nd*3 + cd + j and give n. 2 Express (-4n3 + n3 + 5n*3)(6 - 3 + 0) + 4n3 - n3 + 3n*3 in the form v + xn*3 + in*2 + cn and give x. 12 Rearrange -3f - 49f*3 + 96f*3 - 46f3 - f2 to nf3 + mf + lf2 + s and give s. 0 Rearrange (-8 + 1 + 2)(2 - 2 - 2n) + (-4n - 2n + 4n)(-5 + 2 + 5) - 5n - 3n + 5n to the form u + mn and give m. 3 Express -2s - s + 2s + (-s + 3s - 3s)(1 + 0 + 0) - 3 + 3 - 4s - 6 + 6 - 4s in the form ms + k and give m. -10 Rearrange (-31f - 30f + 25f - 83f)(2f - 2f - 2f) to nf + xf2 + u and give x. 238 Express -1 + 135a*4 - 129a*4 - 2a*2 + 1 + 2a*3 in the form ha*2 + ca*4 + qa*3 + ua + p and give q. 2 Express (-3 - 1 + 3)(0h + 5h - 3h) - 36h - 22h + 9h as ch + z and give c. -51 Rearrange (6b2 - 8 + 8)(3b2 + 2b*2 - 7b*2) - 3 + 5b*4 + 3 to a + pb*4 + gb + ub3 + sb*2 and give p. -7 Rearrange (5 + 5 - 1)(2r + 0 + 0) + (-1 + 2 - 2)(-2r - 4r + 4r) to f + ir and give i. 20 Express 10 + 4g4 + 7 - 16 + (2g*3 + 0g*3 - 3g*3)(-1 - 2g + 1) as yg*4 + vg + kg2 + pg*3 + n and give n. 1 Rearrange 6b - 8b + 5b4 + b2 + 2b3 - 3b*4 + 2 to the form ab*2 + hb*4 + fb*3 + mb + c and give a. 1 Express 3x2 + 2x*2 + 12x*2 as rx*2 + k + ax and give r. 17 Express 6t2 - 15t2 + t2 + 3t - t as o + vt + jt2 and give j. -8 Express 5d*4 - 3d*4 + 3 + d + 0 + 2d in the form q + gd2 + kd*4 + fd*3 + bd and give b. 3 Rearrange 21k - 14k + 42k - 2k to wk + b and give w. 47 Express b2 + 0b + 7b - 10b as lb + h + qb*2 and give l. -3 Express -7j - 5j3 + 3j + 2j + (-j + j - j3)(-4 + 2 + 4) in the form q + rj2 + dj*3 + yj and give y. -2 Rearrange 3g + 3g + 0g3 + g3 to the form w + bg*3 + qg + kg2 and give b. 1 Express 2d - 4 - 5 - 5 + 6 in the form p + rd and give p. -8 Rearrange -3w*2 - 2w*2 - 2w*2 + (-5w + 5w + w)(5w - w - 3w) to gw + vw*2 + x and give x. 0 Rearrange (2 + 0 + 1)(37f2 + 7f*2 - 10f*2) + (0f - 4f + 3f)(-3 + f + 3) to hf*2 + df + j and give h. 101 Rearrange -53 - d*2 - d + 54 + d to sd*2 + id + z and give z. 1 Rearrange -49u + 18u + 15u to wu + c and give w. -16 Rearrange -17m2 + 11m2 - m3 - 2m - 2 + 4m*2 + 1 to the form k + sm*3 + cm + wm2 and give s. -1 Express -15 - 9 + 34 + 4y2 + y3 - 12 as iy2 + b + xy*3 + cy and give x. 1 Rearrange (-6i3 + 2i*3 + 2i*3)(-4i + 3i + 3i) + (-32i*2 - 238 + 238)(-3 + 3 + i*2) to ui*2 + zi*3 + li + v + yi4 and give y. -36 Rearrange (2x - 10x - 17x + (0 + 2 - 1)(2 - 2 - x))(-3x2 + 0x*2 + 4x*2) to k + qx*3 + lx*2 + hx and give q. -26 Express (o - 3o + o)(-6 + 3 + 2 + (1 - 2 - 2)(-1 + 2 + 1) + 1 + 1 + 0) as no + c and give c. 0 Rearrange (-3t2 + 6t2 - t2)(-4t*2 + 5t2 + t2 - 15t) to the form ht*3 + d + rt*4 + kt*2 + ct and give d. 0 Express 2 + 1190p - 1189p - 1 in the form up + j and give j. 1 Rearrange 23f - 47f - 36f + 2f + 3f - 6f + 3f - f - 3f + 4 - 2f - 4 + (3 + 2 - 3)(4f - 4f - 2f) to the form nf + g and give g. 0 Rearrange (-8i*3 + 3i*3 + 2i*3)(157 - 37 - 12) to the form g + ui2 + pi*3 + mi and give p. -324 Express 143v4 - 2v - 145v4 - 1 + 3 - v2 in the form ov*2 + w + sv*4 + iv*3 + zv and give w. 2 Rearrange 68o2 + 4 - 59o*2 - 4 to b + ho*2 + po and give h. 9 Rearrange (41f + 42f - 82f + 15)(3f2 - 3f2 - f2) - 2f3 + 0f*2 + 0f*2 to the form mf*2 + nf*3 + x + of and give n. -3 Express (7u + 6u - 4u)(4 + 1 - 6) + 0u + 0u + u + 1 + 3u - 1 as lu + k and give l. -5 Express (v - 2v + 3v)(-2v - 4v - 2v) + v*2 + 2v2 - v2 as ov2 + a + qv and give o. -14 Rearrange -4g - g3 - 8g*4 - 11g*4 + 7g - 4g to tg*2 + hg*4 + ag + l + fg3 and give l. 0 Rearrange -5 - 28b - 3 + 8 to m + hb and give h. -28 Express (0 - 2 + 1)(5q + 6q - 4q) as fq + u and give f. -7 Rearrange (2u - 2u - 2u3)(2 + 0 + 4)(3u + 0u - 2u) to the form pu3 + hu + ru4 + d + yu*2 and give r. -12 Express -44a*2 - 11a + 3a + 42a*2 as wa*2 + xa + t and give w. -2 Rearrange (l + 4l - 3l)(l + 2l - l) + (l + 5 - 5)(2l - 2l + l) + 16l*2 - 182 + 182 to the form cl + a + hl2 and give h. 21 Express (-6 + 2y*2 + 2538y - 8y3 - 2538y)(-1 + 0 + 3) as hy*3 + q + ly + py2 and give h. -16 Express (-7z*2 + 2z*3 - 9z*2 + 15z*2 + 2z*4)(-26 - 24 + 11) in the form qz4 + xz*2 + gz*3 + fz + h and give x. 39 Express 14g + 3g*4 - 2g4 - g2 + 4g4 - 6g*4 in the form ug*2 + f + ig*4 + qg*3 + jg and give u. -1 Express 0 - 30w + 31w + 4w2 + 0 in the form iw + h + bw2 and give i. 1 Rearrange -182 + 182 + z to the form x + az and give a. 1 Express (-z - 23z + 11z)(4z + 4 - 3 - 3z)(-1 + 2 + 1) as p + iz2 + lz and give i. -26 Rearrange (6 - 2 -	{ "pile_set_name": "DM Mathematics" }
umber? False Is 998879 a composite number? True Is 423733819 composite? True Is 23504219 prime? True Is 204509401 a prime number? True Is 525869 composite? False Is 944538629 a composite number? False Is 8974811 composite? False Is 35434303 composite? True Is 45595621 composite? True Is 13463581 a prime number? False Is 639960757 a composite number? False Is 31213834 a composite number? True Is 3695257 composite? False Is 2160409 a composite number? False Is 191376737 prime? False Is 12182987 composite? True Is 76716287 a composite number? False Is 3664069 a prime number? True Is 738811 a composite number? False Is 5755003 composite? True Is 1800577 a prime number? True Is 155516233 a prime number? True Is 46595063 a prime number? True Is 1470635 a prime number? False Is 4790699 a prime number? True Is 18552803 prime? True Is 188749807 a prime number? True Is 5362853 a composite number? False Is 5321837 prime? True Is 7673077 a composite number? True Is 549297299 composite? True Is 1748393 a composite number? True Is 3309038 a prime number? False Is 4640717 a prime number? True Is 1224389 composite? False Is 5870813 a prime number? False Is 709133 a composite number? True Is 414364855 prime? False Is 6543535 prime? False Is 4501379 a composite number? True Is 420803767 a composite number? False Is 3138209 a prime number? True Is 82889687 a composite number? False Is 55747481 prime? False Is 10105661 prime? True Is 335965819 composite? True Is 31931617 prime? True Is 92151139 a composite number? True Is 16480433 composite? False Is 8926681 composite? False Is 35174159 a prime number? False Is 65688019 a prime number? False Is 5723951 a prime number? False Is 31472965 prime? False Is 703838 composite? True Is 54695869 a prime number? True Is 1708639 composite? False Is 8262857 a composite number? False Is 490862459 a composite number? False Is 32135369 composite? True Is 198295921 prime? False Is 8449223 composite? False Is 135108667 a composite number? False Is 1157053 a composite number? False Is 9268099 composite? False Is 222615121 prime? False Is 1312352365 composite? True Is 195890557 a composite number? False Is 2161164581 composite? False Is 8770919 a composite number? True Is 13130947 a composite number? True Is 47486057 composite? True Is 111139363 a composite number? False Is 5389022 a prime number? False Is 5966599 a prime number? True Is 19874401 a composite number? False Is 9874313 prime? True Is 38545859 a prime number? False Is 17216971 prime? False Is 4105457 prime? True Is 12410257 prime? True Is 50117603 a composite number? False Is 4866139 composite? False Is 24805919 prime? True Is 19961749 composite? True Is 18397831 prime? False Is 11339633 a prime number? True Is 8464559 a composite number? True Is 26155 a composite number? True Is 3170983 composite? False Is 46313857 a prime number? True Is 12101659 prime? True Is 943879 a composite number? True Is 46575451 a prime number? False Is 257244965 composite? True Is 6735397 a composite number? False Is 50151967 composite? False Is 79885711 a prime number? True Is 1331207 a prime number? True Is 456567 composite? True Is 19359697 composite? True Is 305742067 composite? False Is 473332463 prime? False Is 1581223 composite? True Is 1129971 composite? True Is 61402373 prime? True Is 36564205 a composite number? True Is 142768837 prime? False Is 2593498 prime? False Is 21600613 a prime number? True Is 738233 composite? True Is 16699211 composite? False Is 333817 prime? False Is 12141259 a prime number? False Is 4291817 a composite number? True Is 335047 prime? True Is 3351743 a composite number? False Is 46039253 a composite number? True Is 105327497 prime? False Is 4505993 composite? False Is 132063077 a composite number? False Is 915247 a composite number? False Is 83142853 composite? True Is 3347959 composite? False Is 56574751 a prime number? True Is 18027491 a composite number? False Is 8942513 prime? False Is 1593149 a composite number? False Is 2148161 a composite number? True Is 2402086 composite? True Is 58745177 a composite number? False Is 1194157 a composite number? False Is 15140383 a prime number? False Is 8589167 composite? False Is 2310829 a composite number? True Is 98133733 a prime number? True Is 311806477 a composite number? False Is 20126983 a composite number? False Is 219071893 a composite number? True Is 112473203 prime? False Is 193009397 a composite number? True Is 21129659 a prime number? False Is 15057307 prime? False Is 8786873 a composite number? True Is 179378999 a prime number? True Is 464909 a composite number? False Is 10223 a composite number? False Is 32701453 a prime number? True Is 6647939 a prime number? True Is 6360247 composite? False Is 47779181 a composite number? False Is 2092697 a composite number? True Is 5075453 a composite number? False Is 142078099 a composite number? False Is 5386921 a composite number? False Is 177315373 a composite number? False Is 13177271 a prime number? True Is 10301543 a composite number? True Is 8009783 a composite number? True Is 299679277 a prime number? False Is 154232735 composite? True Is 165457 a composite number? False Is 22328597 a composite number? False Is 102115901 a prime number? True Is 21564001 a composite number? False Is 4947071 a prime number? False Is 40024489 composite? False Is 6576953 prime? False Is 5058917 a composite number? False Is 32616877 a prime number? True Is 59481337 composite? False Is 301701571 a composite number? False Is 396697241 a composite number? True Is 37382467 a composite number? False Is 157507439 prime? False Is 1027943 a prime number? False Is 255082819 a prime number? True Is 426725227 a prime number? False Is 71263271 a prime number? True Is 58114569 a prime number? False Is 4280249 a composite number? False Is 478457 composite? True Is 60220723 prime? True Is 52824413 a composite number? True Is 104247401 a prime number? False Is 1512001 composite? True Is 231405211 a composite number? False Is 2445017 a prime number? False Is 833477 a prime number? True Is 9771763 a composite number? False Is 36408641 a composite number? True Is 30840827 a prime number? False Is 4537909 a composite number? False Is 840019 prime? False Is 263367505 a prime number? False Is 1849565 a prime number? False Is 6906853 a composite number? False Is 473672218 prime? False Is 488077 a composite number? True Is 45039245 composite? True Is 97397 composite? False Is 2036707 a prime number? False Is 25421687 composite? False Is 212983853 composite? True Is 14016203 composite? False Is 27280391 composite? False Is 809987681 a composite number? True Is 890007 a prime number? False Is 59960749 prime? True Is 75867763 prime? True Is 156748723 prime? True Is 390565363 prime? True Is 5817467 composite? False Is 193417886 a composite number? True Is 15990937 a composite number? True Is 3682501 a prime number? True Is 31101541 a composite number? True Is 311533 composite? False Is 623239 composite? True Is 547109687 a prime number? True Is 222269 a prime number? True Is 84730949 prime? True Is 2448851 a composite number? False Is 34735339 a composite number? True Is 867211 prime? True Is 10874231 a composite number? True Is 1297 prime? True Is 86085187 a prime number? True Is 844757 a prime number? True Is 933389 a composite number? False Is 1615259 composite? True Is 10130969 prime? True Is 2617873 a composite number? False Is 4031683 a composite number? True Is 67262066 a composite number? True Is 9866257 a prime number? False Is 8728761 composite? True Is 35982017 prime? False Is 1658711 a prime number? True Is 11789131 a composite number? False Is 121686679 composite? False Is 10867379 a composite number? False Is 354119923 composite? False Is 7687877 a composite number? True Is 1244168671 composite? False Is 3598061 a composite number? False Is 35173661 prime? True Is 131342191 composite? False Is 26550187 prime? True Is 9400103 a composite number? False Is 75172709 a prime number? False Is 1736647 a composite number? True Is 75202339 a prime number? False Is 6834413 prime? False Is 153860851 a prime number? False Is 9931217 a composite number? True Is 181494371 a prime number? True Is 49	{ "pile_set_name": "DM Mathematics" }
suming h is positive. h(-235/2) Simplify d(-6)(dd*(-5)/d)/ddd/(d(-4/3)/d)d/d*(-2/7)d(-1/9)/d(-1/7)(d(1/2))(-2/41) assuming d is positive. d(-16463/2583) Simplify ((t/(t3tt)t)/t*(-2/13)(tt(-1/3)/ttt)40)/((t/t(-1))(-38)t*(-7)ttt*(-1/3)t) assuming t is positive. t*(1874/13) Simplify ((tt*3t*3/tt)/(((t/t*4t)/t)/t(-1/5)))/(t(-1)ttt(t*11tt)/tt)2 assuming t is positive. t(-101/5) Simplify (((t*(1/4)/t)/(((tt*(2/27)tt)/t)/t)t*5/(((t/(tttt*(2/17)tttt))/t)/t))(-3/22))25 assuming t is positive. t(-47125/1224) Simplify z(-2/15)z*(-2/5)/zz(((z(1/4)zz)/z)/zz)*(-3/13)(zz(z/(z/z*5z))/zzzz4)(-13/4) assuming z is positive. z(-14263/390) Simplify (rr(-9/4))36/(r/(r*(4/25)r)rr(-10)/r) assuming r is positive. r(-871/25) Simplify (((y/(yy0)y)/y)*(13/6)/(yyyy(1/4))3)/((y/y*(-4/3))/(yy/((yy(-8))/y)yy))43 assuming y is positive. y(4871/12) Simplify (((f(-2/7)/(f/(f/f(-1))))/((ff/(f*(-8)f))/(f/(f/(f/(ff((f(-3)/f)/f)/f))))))(-12/5))2 assuming f is positive. f(552/35) Simplify (s(1/2))(-1/27)/(s/(s*(2/7)s))*(-43)(s(-5)/s)/(s/(s/s(-3/5)))((s(-1/2)s)/sss)/s(-4) assuming s is positive. s(-11533/945) Simplify (bb1)(-2/15)/(b(1/3))(5/2)(b(2/7)/(b/b(-3)b))/(b3b*(1/2)b) assuming b is positive. b*(-361/35) Simplify (ooo1oooo)3(oo/(oo*2)o)/(oo/((o/o4)/o)o)(o1o(-13))22 assuming o is positive. o(-250) Simplify h(-1)h(hh7hh)/h(h(2/5))48h6h*5h*6/(hh/(h*(-2/3)hh)) assuming h is positive. h(668/15) Simplify (((y(-1/7))13)(2/23))(-12) assuming y is positive. y(312/161) Simplify ((qqq(q(qq*(-1)/qq)/q)/q)/(qq(-2/5)q))*41((qq/q(1/2))/qqqq(-1))(4/11) assuming q is positive. q*(932/55) Simplify ((ggg3)(-4/13))45/((g/(g(gg8)/g)gg((gg(-5))/gg)/g)/(g(3/11)/(g(-5)/gg))) assuming g is positive. g(-7573/143) Simplify (c(-3)/(((c(-1)/cc)/c)/c)c(-1/3)/(cc*5/c))/((cc(-1/3))30/(c/c(-2))(-10)) assuming c is positive. c(-166/3) Simplify (((b(-26)b/(bbb(1/6)))(-49))(9/5))(2/17) assuming b is positive. b(23961/85) Simplify ((k/k8)(-2/81)/((k/k18)/(kk(-11))))(1/17) assuming k is positive. k(581/1377) Simplify ((j/(j/(j(-1/4)/j)))*0(j(1/3))(-1/11))/((j1)18(j/j(1/9))/j(-6)) assuming j is positive. j(-2467/99) Simplify (a(1/4)a)*(10/3)(aa(4/7))/a(-5)(aaa(-2)/a)(3/4)((a(-1)a)/a)(-31) assuming a is positive. a(3443/84) Simplify (g/g*(-5/6)g(gg*3g)/g)/((gg/(g0g))/g)*(1/27)(g4/(g(2/3)/g))/((g*(-1)g)/g(-1/7)) assuming g is positive. g(463/42) Simplify (d*(-1/4)dd1)/(d/d(-36)dd(-16/3)/d) assuming d is positive. d(-359/12) Simplify (w/w(-1/4)w(-6/11))19/((ww/((w/(w(-5)w))/ww)w)/ww/(w1/ww))(-4) assuming w is positive. w(61/44) Simplify ((u*(1/2)u)(6/35))(-48)/(u/(((uu7u)/u)/u)uu(u(3/4)u)/u(u(-4/3)u)/((u*(-2/3)/u)/uu)) assuming u is positive. u*(-4379/420) Simplify (((uu*(-3)(u/(uuu*(-11)u))/u)(-19))(1/4))(4/7) assuming u is positive. u(-114/7) Simplify (((oo/(o0o)oo)/o)/o)(2/19)/(o(-5)oo*(-1))o(-1/3)/o5o(-3)/(o/(o(-2/21)o)) assuming o is positive. o*(-442/133) Simplify (((vv/(v/((v/v*1)/v))v)11/(v(1/2)v3))(2/51))(6/11) assuming v is positive. v(30/187) Simplify (c(-3/7)/(c/(c/c(-5/4))c))(-34)/(c(-1/2)/cc(((cc(-1)c)/c)/c)/c(((ccc4)/cc)/c)/(cc/(cc(2/11)))) assuming c is positive. c(338/77) Simplify ((pp/(p(2/9)/p)p)/(pp(3/7))(p/(pp(9/2)))/ppp/p(2/7))/((p/(pp*0p)p)/ppp(3/2)/pp*(-1)(p(2/9)/p)/p) assuming p is positive. p(53/63) Simplify (v(-2/5)/v)(-27)(v(-1/4)v)*(-28/5)(v*6vv/(((vv(2/3))/v)/v))/((v/v(-6))/(vvvvvv(-1/7))) assuming v is positive. v(4178/105) Simplify (rrr/(r/r(-2/9)))(1/24)/((rrr(2/27))/(r/(r/(r(38/7)r)))) assuming r is positive. r(31/7) Simplify ((h(-1/5)/h*(-2/33))/((h(hhhh(3/10)h)/h)/h)(-2/61))(2/47) assuming h is positive. h*(-628/473055) Simplify ((z(z9/z)/z)(5/8)/(z(-2/11))(-37))(-5/3) assuming z is positive. z(95/33) Simplify (b/(b*(-3)/b)bb3bb(-4)b/b(3/5))/((b/b(-1)b(1/8))/(((bb/b(-1))/b)/b(-1/5))) assuming b is positive. b*(259/40) Simplify ((dd5)/d11(dd/(d*(-2/15)d)dd)(-20))(-23) assuming d is positive. d(4669/3) Simplify ((j(-2/9)/j)/j5)(-14/3)/((j/(j/(j*(-2/7)jj)))(-6))(-22) assuming j is positive. j(-37280/189) Simplify ((k(2/3)k)/((k/k*(-7))/k)k*(3/7)kk3/k)/((k(-1/6)k/k(-1/4))/(k(1/3))(2/21)) assuming k is positive. k(-745/252) Simplify (a(-1/4))(2/65)(a1)(-5/8)((a*(-1/2)a)/a)/a*(2/19)(aa(-1/2))/aaa(-7) assuming a is positive. a(-76451/9880) Simplify ((r(3/10)r)/r*(-2/15)r*6rr(2/67))(-21/2) assuming r is positive. r(-119077/1340) Simplify ((m(-2/13)/m)/(m(-46)/m))/(m(-11))(-2/23) assuming m is positive. m(13422/299) Simplify ((u(-2/5)/u)(-6)((u/u1)/u)(-15/7))/((u/(uuuuu/u*(-5)uuuu))/(u3u)(u1)(-18)) assuming u is positive. u(1594/35) Simplify ((g(-1/4)/g(-1/4)g*(-6)ggg/(g/(gg/g(-4/7))))35)(-8) assuming g is positive. g400 Simplify (((d0)(6/17)/((d/(d/(d/d0)))/d)(-49))(-2/169))(-4/7) assuming d is positive. 1 Simplify (((d/(((d(d/(dd/d(-8/5)))/d)/d)/dd)d(-4/5))(-4/9))(-1/5))46 assuming d is positive. d(3496/225) Simplify (((p4p)/p)(-1))(1/27)/(pp0p(-14/9))(-29) assuming p is positive. p(-439/27) Simplify ((x0)*(-2/35)(x/(x(-5)/x))/(x/(x(-3)/x)))/(x*(2/7)/xxx(-8)x(-8)/(x/x(-6))) assuming x is positive. x(173/7) Simplify (f(-4/5))*(-37/3)/(f/(ff/((f(f(2/13)f)/f)/f))f(-28)) assuming f is positive. f(7549/195) Simplify ((((i(-1/8))(-22))(5/6))(3/10))(-41) assuming i is positive. i(-451/16) Simplify (s(3/2)/s(-9))(3/5)/(s(-4)/(s/s(-8/7)))(-3) assuming s is positive. s(-849/70) Simplify (y(1/9)yy15)(2/15)((yyyy(-4/7))/y(-1))/(y(1/4)/y0) assuming y is positive. y(4027/756) Simplify (k(-3)/k)/(k6k)k6/k2(((k/k3)/k)/(k(-4/3)k))/(kk*5k(k/(k/(k/(kk(-1)))))/k) assuming k is positive. k(-50/3) Simplify (z0)(8/17)z(-2)/(z/(z0z))((zz/(zz(1/6)))/(z6/z))/((zz*(1/4)z)/z)(3/11) assuming z is positive. z(-859/132) Simplify ((l(-2/3)/l)(22/9)(l/(ll/(l/l0)))/l(-2/27))/((l*(1/3)l(2/25))/(l(3/2)lll/(l/(l(-1/2)l)))) assuming l is positive. l(-31/75) Simplify (g5g(3/7))(-8/7)/(g(-4)g/(gg/((gg*(-4)g)/g))ggg5/gg/(gg(-3))) assuming g is positive. g(-353/49) Simplify (((c(-2/9)/(ccc(-4/3)))(-38))(1/13))27 assuming c is positive. c(912/13) Simplify (x6x(x/(xxx5))/x)(-1/71)((x*(4/3)/xx)/((x*(-2/5)/x)/xx))/(x(2/5))(1/15) assuming x is positive. x*(203/75) Simplify ((ww(w/w(-7))/ww/w*(-2))/((w/(w(w*(2/9)w)/w)w)/(w/(w/((ww1)/w)))))/((w(-2))(-39))(6/5) assuming w is positive. w(-3662/45) Simplify (((c(-3)cccc/(((cc7)/c)/c)c)/(c0/c8))(-2/7))(2/79) assuming c is positive. c*(-16/553) Simplify ((pp/(p/p*(-19/3))((pp(-26)p)/p)/p)/((((p/(p*24p))/p)/p)/((p(-23)/p)/p)))(-9/2) assuming p is positive. p(273/2) Simplify (t/t13t(4/3))(-5)/((t/(t(-1)t))(-25)/(t1((t/t(-2/13))/t)/t)) assuming t is positive. t(3061/39) Simplify (v(1/9)/((v/(v(3/5)v))/v))*(-2/91)vv/v(-2/3)v*(3/7)/vvvvv(-1/6)vv6v assuming v is positive. v(105577/8190) Simplify (((h10h(hhh(1/14))/h)/(h2h)(2/5))3)(15/4) assuming h is positive. h(6849/56) Simplify (q/((q/q0q)/q))22/(q/(q/q(4/5))q/(qq*(-3/4)q))((qq/(q*(2/3)/q)q)(5/7))(-2/31) assuming q is positive. q*(-9161/13020) Simplify (((nnn(2/29)nn)/(n/(nn*(1/6)))((nn(2/7))/n)/(n/(n(-6/11)/n)n))23)(-11) assuming n is positive. n(-300725/1218) Simplify ((m4/m)*38m/(mmm	{ "pile_set_name": "DM Mathematics" }
t replacement from xuxuytxuxsx? 1/528 Four letters picked without replacement from sqqttssssstqqsssss. Give prob of sequence qsst. 11/612 What is prob of sequence sshp when four letters picked without replacement from {p: 1, w: 1, d: 1, h: 4, x: 3, s: 2}? 1/1485 Two letters picked without replacement from {b: 1, u: 2, t: 1, i: 2}. Give prob of sequence bu. 1/15 Calculate prob of sequence ni when two letters picked without replacement from {d: 2, w: 8, y: 1, i: 3, n: 1, m: 1}. 1/80 Calculate prob of sequence xb when two letters picked without replacement from xxb. 1/3 Calculate prob of sequence wtcw when four letters picked without replacement from {c: 2, w: 2, v: 2, t: 1, x: 8, o: 2}. 1/14280 Two letters picked without replacement from vrxfvbxrfxxbrbrvxxh. What is prob of sequence hv? 1/114 Two letters picked without replacement from {l: 4, y: 16}. What is prob of sequence ll? 3/95 Four letters picked without replacement from {g: 2, n: 1, w: 3, k: 1}. What is prob of sequence ggng? 0 Three letters picked without replacement from {l: 2, v: 6}. What is prob of sequence vvl? 5/28 Two letters picked without replacement from {f: 1, t: 7, b: 5, s: 3, i: 3}. What is prob of sequence ss? 1/57 Four letters picked without replacement from voookokooo. Give prob of sequence kovo. 1/60 What is prob of sequence tjo when three letters picked without replacement from frzttjrjjjojjj? 1/156 What is prob of sequence dedu when four letters picked without replacement from eueeueeeeedd? 4/1485 Two letters picked without replacement from vvvv. Give prob of sequence vv. 1 What is prob of sequence gq when two letters picked without replacement from {t: 2, q: 1, a: 1, g: 3}? 1/14 What is prob of sequence nn when two letters picked without replacement from {n: 3, m: 3}? 1/5 Four letters picked without replacement from {q: 2, r: 8, c: 3, x: 2}. Give prob of sequence rxxc. 2/1365 Two letters picked without replacement from rrplwmppcllclmccpcml. What is prob of sequence cc? 1/19 Two letters picked without replacement from ylysays. What is prob of sequence sy? 1/7 What is prob of sequence nv when two letters picked without replacement from {g: 2, l: 1, z: 1, v: 2, a: 3, n: 3}? 1/22 Three letters picked without replacement from eeejkjjejjjkeekkkjje. Give prob of sequence jkk. 4/171 Three letters picked without replacement from jijijjixirj. Give prob of sequence ixi. 2/165 Three letters picked without replacement from ggdgggsgsg. Give prob of sequence ggg. 7/24 Two letters picked without replacement from rrrrrrrrrzrzrrrrrz. What is prob of sequence zz? 1/51 Calculate prob of sequence ypbr when four letters picked without replacement from rkpyb. 1/120 Calculate prob of sequence xs when two letters picked without replacement from xxs. 1/3 Calculate prob of sequence yqyq when four letters picked without replacement from yqqqqqy. 1/21 What is prob of sequence smiy when four letters picked without replacement from yvmyvmvmppspi? 1/2860 Three letters picked without replacement from {d: 2, h: 7}. What is prob of sequence hhd? 1/6 Three letters picked without replacement from raaaiarraaruaraff. What is prob of sequence uri? 1/816 Calculate prob of sequence ggv when three letters picked without replacement from {v: 7, g: 4}. 14/165 Three letters picked without replacement from vsvvsvsvvvvsssvvsss. What is prob of sequence svs? 40/323 Four letters picked without replacement from riwvh. Give prob of sequence rwiv. 1/120 What is prob of sequence hh when two letters picked without replacement from hhhhhh? 1 What is prob of sequence nt when two letters picked without replacement from {j: 3, t: 4, q: 1, w: 1, n: 2}? 4/55 Calculate prob of sequence dk when two letters picked without replacement from dkkkdkdkkkkkkk. 33/182 Four letters picked without replacement from {v: 7, g: 4}. What is prob of sequence vgvv? 7/66 Two letters picked without replacement from {x: 8, v: 2}. What is prob of sequence vx? 8/45 Calculate prob of sequence wwwv when four letters picked without replacement from {w: 3, v: 7}. 1/120 Calculate prob of sequence ffq when three letters picked without replacement from {q: 3, r: 1, f: 3, v: 7}. 3/364 Three letters picked without replacement from ggkgk. What is prob of sequence ggk? 1/5 Calculate prob of sequence llnn when four letters picked without replacement from nlllnnl. 3/35 Calculate prob of sequence vhhv when four letters picked without replacement from {h: 9, v: 7}. 9/130 Four letters picked without replacement from {c: 4, r: 2, o: 4, i: 1}. What is prob of sequence ccoo? 1/55 Calculate prob of sequence ye when two letters picked without replacement from {y: 10, e: 9}. 5/19 Three letters picked without replacement from {s: 2, p: 3}. What is prob of sequence ppp? 1/10 What is prob of sequence ybbb when four letters picked without replacement from byyybb? 1/20 Calculate prob of sequence fr when two letters picked without replacement from fyroiri. 1/21 Four letters picked without replacement from eleeeeeleleeee. What is prob of sequence elle? 5/182 Three letters picked without replacement from {i: 5, d: 5, m: 3, q: 1, g: 5, r: 1}. Give prob of sequence mgr. 1/456 Three letters picked without replacement from {n: 4, h: 7, t: 2, s: 3, o: 2}. What is prob of sequence shh? 7/272 Two letters picked without replacement from hhjuhhuuuhuujhu. What is prob of sequence uu? 1/5 Four letters picked without replacement from {r: 5, z: 2, t: 5}. What is prob of sequence trrz? 5/297 Three letters picked without replacement from {a: 1, g: 2}. What is prob of sequence agg? 1/3 Two letters picked without replacement from rererrerrrerrrrrrrre. Give prob of sequence re. 15/76 Calculate prob of sequence beee when four letters picked without replacement from ebeef. 1/20 Two letters picked without replacement from zkkzzzzzzzkkzkzzzz. What is prob of sequence zk? 65/306 Three letters picked without replacement from {k: 6, q: 1, b: 2, s: 7, o: 1, x: 2}. What is prob of sequence kss? 14/323 Three letters picked without replacement from fxfxfxxfxfxxxxxx. What is prob of sequence xfx? 55/336 What is prob of sequence gc when two letters picked without replacement from iczizzzcicizzcizgi? 2/153 Four letters picked without replacement from {p: 2, o: 2, n: 6, e: 3, s: 4}. What is prob of sequence sesn? 9/2380 What is prob of sequence csx when three letters picked without replacement from xxcuxxsxc? 5/252 Two letters picked without replacement from {i: 6, u: 2, n: 1, t: 5, j: 5}. What is prob of sequence ui? 2/57 Calculate prob of sequence ja when two letters picked without replacement from {a: 3, j: 1, s: 1}. 3/20 Two letters picked without replacement from nnngnnngnn. Give prob of sequence gn. 8/45 Three letters picked without replacement from vvhjkcn. Give prob of sequence nkv. 1/105 Calculate prob of sequence kjkf when four letters picked without replacement from {j: 8, f: 2, k: 9}. 4/323 Two letters picked without replacement from {t: 1, m: 1, d: 1, q: 1, w: 1}. Give prob of sequence md. 1/20 Two letters picked without replacement from {n: 3, k: 1, y: 1, d: 1, a: 1}. Give prob of sequence nd. 1/14 Two letters picked without replacement from ndhhuhngunnuwughuhn. What is prob of sequence wn? 5/342 Calculate prob of sequence ul when two letters picked without replacement from luluuulullululululuu. 99/380 Three letters picked without replacement from rtqcsti. Give prob of sequence isq. 1/210 Calculate prob of sequence rrr when three letters picked without replacement from rrrrrrrrr. 1 Calculate prob of sequence ff when two letters picked without replacement from {p: 4, f: 2, q: 7, v: 5}. 1/153 Calculate prob of sequence mmm when three letters picked without replacement from {y: 3, m: 5}. 5/28 Two letters picked without replacement from bhbbhhbbbbwbbwb. What is prob of sequence ww? 1/105 Three letters picked without replacement from {o: 1, h: 1, p: 2, s: 2, k: 1, l: 2}. Give prob of sequence hos. 1/252 Calculate prob of sequence uvue when four letters picked without replacement from {u: 3, v: 1, e: 2, z: 4}. 1/420 Three letters picked without replacement from {q: 5, r: 3, l: 5}. Give prob of sequence qlq. 25/429 Three letters picked without replacement from {y: 1, o: 1, i: 3, k: 1, m: 1}. What is p	{ "pile_set_name": "DM Mathematics" }
180ru + 2079060r wrt u. -339180r Find the second derivative of 433n5 + 20n*4 + 2n*2 + 3262n + 7 wrt n. 8660n3 + 240n*2 + 4 What is the first derivative of 662294o + 296915? 662294 What is the third derivative of -y*6 - 42150y3 - y2 - 4y + 2886? -120y*3 - 252900 Find the second derivative of mu*2 - 39mu - 5m - 13427u2 + u + 8 wrt u. 2m - 26854 Find the first derivative of 19s4 - s3 - 3080s*2 + 6s + 955498. 76s3 - 3s*2 - 6160s + 6 Find the second derivative of -125571m2 + 256m + 1449 wrt m. -251142 What is the third derivative of 376154b6 + 11836b*2 + 2b - 3? 45138480b3 What is the third derivative of -v5 + 12v*4 - 70v*3 - 20541v*2 wrt v? -60v*2 + 288v - 420 What is the derivative of -11686v2 + 98v - 1414148 wrt v? -23372v + 98 Find the third derivative of -3904012f4 - f2 - 161311. -93696288f Find the second derivative of -109h*4x - 3h3x + 140h2x + 548hx - 2 wrt h. -1308h2x - 18hx + 280x What is the third derivative of -454573r*3 - 344985r*2? -2727438 What is the third derivative of 664uz3 + 458uz2 + 11u - 909z3 - 3z*2 - 17z wrt z? 3984u - 5454 Find the third derivative of 51f*3n*3 - 945f*3n*2 - 59fn3 + 18fn2 wrt n. 306f*3 - 354f What is the third derivative of 1493a3d*2 - 2a*3dz + 3a*3z - 3a2d*2z - 41a2dz + 2a*2d + 15ad*2z - adz + d wrt a? 8958d2 - 12dz + 18z What is the second derivative of -2h5 - 584h*4 + 170h + 85 wrt h? -40h3 - 7008h*2 What is the derivative of 2g*3 - 775973g*2 + 1569758? 6g*2 - 1551946g What is the third derivative of 47846o3 + 47239o*2 wrt o? 287076 What is the first derivative of -18405q*2 + 30873 wrt q? -36810q What is the third derivative of 11788iq*4 + 2iq2 + 194875iq - 13q*4 wrt q? 282912iq - 312q Differentiate 23c2d*2 + 27c*2 - 10cv - 3d*2v - dv - 32465 wrt c. 46cd2 + 54c - 10v Find the third derivative of -b3s*2 - 8228b*3s - 2b3 + 1741b*2 - 17s*2 wrt b. -6s*2 - 49368s - 12 Differentiate 1375587z + 333612. 1375587 What is the third derivative of 6207r*4 + 8r*3 + 353r*2 - 29r + 1 wrt r? 148968r + 48 Find the first derivative of 17fq3z - 5fq*3 + 2fz3 + q3 - 18524q*2z*3 wrt f. 17q*3z - 5q3 + 2z3 What is the second derivative of p5 - 15951p3 - 12p*2 - 807001p wrt p? 20p3 - 95706p - 24 Find the third derivative of 873704a6 + 5a*2 + 34942a wrt a. 104844480a3 What is the second derivative of -93t*4 + 244t*3 + 2t*2 - 431939t + 3 wrt t? -1116t2 + 1464t + 4 Find the second derivative of 579987f4 + 212175f wrt f. 6959844f2 What is the third derivative of -27658f*4y - 2f3y + 10f2y - 25fy + f + 4y wrt f? -663792fy - 12y Find the third derivative of -6980941x3 + 72x*2 + 4073x - 1 wrt x. -41885646 What is the second derivative of 2l2mn - 7l*2n*2 - 9lmn*2 - 11lm - 616ln wrt n? -14l*2 - 18lm What is the third derivative of l5n*3 - 9072l5 + l2n3 + 37453ln3 wrt l? 60l*2n*3 - 544320l*2 Differentiate -180263x*2 - 98616 with respect to x. -360526x What is the derivative of 34309h - 7791? 34309 What is the second derivative of -92618b*2g*3n + 2b2n*2 + 2bg3n*2 + bgn2 + 12g*3 + 33g*2n*2 - 1 wrt b? -185236g*3n + 4n2 What is the third derivative of -3422714g*5 + 4911g*2 + 2g + 8? -205362840g2 What is the third derivative of 2256g*4 - 23g*3y*2 - 5g*3 + 166523g*2y - 4gy*2 wrt g? 54144g - 138y2 - 30 What is the second derivative of 124459a*2 + 153769a? 248918 What is the second derivative of -685443l2 + 1491826l wrt l? -1370886 Find the first derivative of 530n + 10200. 530 Find the second derivative of 3c5 - c4 - 3156c2 - 2955c - 5. 60c3 - 12c*2 - 6312 Find the third derivative of 25170v*3 - 35281v*2 wrt v. 151020 What is the third derivative of -11m*5 + 2293m*4 - 210116m*2? -660m*2 + 55032m What is the third derivative of -270309ay*4 - ay*2 + 28ay + 19a - 20y2 + y wrt y? -6487416ay Find the third derivative of 69m*3q*3 + 84m*3 + 2m*2q*2 + 3mq - 35q*3 wrt q. 414m*3 - 210 Find the second derivative of 5v*3 + 982v*2 - 7460v + 1. 30v + 1964 Differentiate -303ft3 - 14ft - 299f - 33 wrt t. -909ft*2 - 14f Find the second derivative of -56985q2 - 1973q - 3 wrt q. -113970 What is the third derivative of -451080s3 + 45655s*2 wrt s? -2706480 Find the third derivative of -31794l*5 + 3l*2 + 4l - 2466. -1907640l2 What is the second derivative of -1349820g*2 + 1487290g? -2699640 Find the second derivative of -2259044v4 - 6v - 12387. -27108528v2 Find the first derivative of 1895930z*3 - 619257. 5687790z*2 What is the third derivative of -7977fk2y*3 + 2fky*2 - 11fy4 - 3640fy - 13k*2y wrt y? -47862fk*2 - 264fy Find the third derivative of -200a*3x*2 + 568a*3x - a*3 - 1029896a*2x*2 + 2x*2 wrt a. -1200x*2 + 3408x - 6 Find the second derivative of -2h2n*2 + 15h*2n + 15h2 - 49hn2 + hn - 31h - 32n*2 - 2 wrt n. -4h*2 - 98h - 64 What is the third derivative of -4h3u*2 + 7h*3u - 789h3 - 7h*2u*2 + 5h*2 - 100 wrt h? -24u*2 + 42u - 4734 Find the second derivative of -148s3 - 250s*2 - 5s - 16133 wrt s. -888s - 500 Find the second derivative of -1066o*3 + 89o*2t - 1772ot - t + 49 wrt o. -6396o + 178t What is the third derivative of 46669v6 + 67v*2 - 359v wrt v? 5600280v3 Differentiate 318flr + 2418fru - 2fr + 28f + 19lru with respect to u. 2418fr + 19lr Find the second derivative of -178l*2p + 158l2 + 43lp - 1725l wrt l. -356p + 316 Find the second derivative of -73c*4 - 84c*2w*3 + 890cw3 - 45c wrt c. -876c2 - 168w*3 What is the second derivative of 449199b*3 + 2b*2 + 9806b - 5? 2695194b + 4 What is the third derivative of -3c*5 + 2c*4 + 3616c3 - c2 + 28637c wrt c? -180c*2 + 48c + 21696 What is the first derivative of 8f4 + 6225ft - 466t + 62 wrt f? 32f3 + 6225t Differentiate -17956d2o - 17683d2 + 3o*2 wrt o. -17956d*2 + 6o Find the second derivative of 3x4 + 137x*3 - 17x*2 + 26524x. 36x2 + 822x - 34 What is the derivative of -6l4 + 313l*3 + 4l*2 - 83870 wrt l? -24l*3 + 939l*2 + 8l Find the third derivative of 382427s3z5 + s3z2 + 1076s*2z*2 + 6s*2 wrt z. 22945620s*3z*2 What is the second derivative of 1996m*3x*3 + 16m*3x*2 - 2m*3x - 2m3 - 759m*2x - 2m2 wrt x? 11976m*3x + 32m3 What is the derivative of 3g*4 - 3113g*2 + 18947 wrt g? 12g*3 - 6226g Find the second derivative of 271089j3 + 2569j + 3. 1626534j What is the first derivative of 1537s*4 - 4s*2 + 2sy3 - 234073y*3 wrt s? 6148s*3 - 8s + 2y3 Find the first derivative of 38x*4 - 5x*3 - 2x*2 - 204x - 4482212 wrt x. 152x3 - 15x*2 - 4x - 204 What is the third derivative of 103s3u*4 + 1128s*3u*2 + 2s*2u + 85su*5 + 3 wrt u? 2472s*3u + 5100su*2 What is the first derivative of hv*2 + 37413h - 25451v2 wrt h? v2 + 37413 Find the second derivative of 2f*2o*3 + 366498f*2o - 3f + 2o*3 + 13o*2 - 61 wrt f. 4o*3 + 732996o What is the third derivative of -102276h3 + 45906h*2? -613656 Find the third derivative of 47x*5 + 178x*3 - 2270x*2 + 48 wrt x. 2820x*2 + 1068 Find the third derivative of -39a*4 - 5247a*3 + 20942a*2 - 2a + 1 wrt a. -936a - 31482 Find the second derivative of 44vx3 - 2vx2 + vx - v - 2x3 - 21x*2 + 28188x + 4 wrt x. 264vx - 4v - 12x - 42 Find the second derivative of 45p5 + 2p*4 - 6p*3 - 3p*2 + 69p + 1919 wrt p. 900p3 + 24p*2 - 36p - 6 Find the third derivative of -8n4r - 2n4 - 51n*3r - 2n3 - 9n*2 + 145nr wrt n. -192nr - 48n - 306r - 12 What is the third derivative of -334827g*3z*2 + 2819g*2z*2 - 151gz2 wrt g? -2008962z*2 What is the second derivative of 16l*2z*2 + 17l*2z + 166lz*2 - 8l + 11 wrt z? 32l2 + 332l	{ "pile_set_name": "DM Mathematics" }
= 7x2 - 2x - 2. Let p be 2 + (0/3)/2. Let u be l(p). Suppose 5h + 5f = 4h + u, 0 = 4h - f - 130. What are the prime factors of h? 2 Let l(p) = -3p2 - 4p - 3. Let v be l(-2). Let o(c) = -c*3 - 6c*2 - 4c + 29. List the prime factors of o(v). 2, 53 Suppose 6h - h + 10 = 0. Let w be -2 - ((-156)/3 + h). Let q = w - -6. What are the prime factors of q? 2, 29 Let z be 6/3 + -2 + -7 + 118. Let w = z - -24. What are the prime factors of w? 3, 5 Let x(l) = 3l*2 + 86l + 64. What are the prime factors of x(-31)? 281 Suppose 2b - 3y - 122 = 0, -5b - 34y = -38y - 305. List the prime factors of b. 61 Let u be (1/2)/((-2)/(-8)). Let g be (-3 - (-62)/10)/(6/15). List the prime factors of (u - 4)(-76)/g. 19 Suppose -3b + 5f - 6 = 0, -b + 5f + 0f - 12 = 0. Suppose 4q + 2o - 38 = 0, q - 30 = -2q - bo. What are the prime factors of q? 3 Let u(n) = 112n2 + 12n - 30. What are the prime factors of u(2)? 2, 13, 17 Let q(z) = -41z + 10. Let c be q(-8). Suppose 3r - c = 5o, 4o - 5o + 221 = 2r. What are the prime factors of r? 3, 37 Suppose 3v = 9v - 3234. What are the prime factors of v? 7, 11 Let v(j) = 27j. Let k be v(2). Let m = k + -6. Let s = m - 24. List the prime factors of s. 2, 3 Suppose 4h + 7 = 87. What are the prime factors of -126(h/(-6) - -3)? 2, 3, 7 Let b be (-4)/14 - 852/(-42). Let n = b + -15. Suppose -105 - 15 = -nf. List the prime factors of f. 2, 3 Suppose 81s = 73s + 11232. List the prime factors of s. 2, 3, 13 Let k(y) = y*3 + 7y*2 + 5y - 15. Let u be k(-5). Suppose -15m = -um - 125. List the prime factors of m. 5 Let r(c) = -c*2 + 69c - 68. List the prime factors of r(24). 2, 11, 23 Suppose -4y + 5n + 7968 = -8018, 3y - 4n = 11990. List the prime factors of y. 2, 1997 Let s be (669/6)/(-35/(-90)). Suppose 85 = -8d + s. What are the prime factors of d? 73 Suppose 2f - 4j - 125 - 21 = 0, 0 = -3f + 3j + 234. Suppose f = 5i - 72. List the prime factors of i. 31 Let z = 4242 + -2496. List the prime factors of z. 2, 3, 97 Let z(a) = -a3 + 15a*2 - 12a + 14. Let v be z(13). Suppose -4b = 2l - v, 5b + l - 235 = 4. What are the prime factors of b? 47 Suppose -19f = -8f - 4873. What are the prime factors of f? 443 Suppose -j + 2 = 4s - 10, -s = 2j + 4. Let f(a) = 3a*3 - 2a*2 - 3a - 4a3 - 2a*2. List the prime factors of f(j). 2, 3 Let h = 26 + -59. Let g = 191 + h. What are the prime factors of g? 2, 79 Let r(v) = 17v*2 + 16v + 3. What are the prime factors of r(6)? 3, 79 Let x(a) = a*2 - 6a - 7. Suppose 0 = 3r + 3f - 27 - 6, 4r = 2f + 32. What are the prime factors of x(r)? 2, 5 Let m(b) = 21b2 + 12b + 30. List the prime factors of m(7). 3, 127 Let s(j) = 448j2 + 11j + 23. What are the prime factors of s(-2)? 11, 163 Let p(x) = x*3 + 9x*2 + 8x + 5. Let w be p(-8). Suppose -w = 5r - 5f, -2r + 2 = -r - 4f. What are the prime factors of (-33)/r + 4/(-8)? 2 Let l = 60 + -28. Suppose -3n = n - l. What are the prime factors of n? 2 Let d(w) = 7w + 27. Let s be d(-4). List the prime factors of s/(31/(-15) - -2)15. 3, 5 Let h(n) = -5 + 39n - 13 + 30n. List the prime factors of h(4). 2, 3, 43 Suppose 2j - 4715 = 21l - 22l, 4j + l - 9435 = 0. What are the prime factors of j? 2, 5, 59 Let k(d) = 2d*3 - 14d*2 + 13d - 21. List the prime factors of k(13). 2, 17 What are the prime factors of (-52605)/(-85) - (20/(-34))/5? 619 Suppose 0w + 104220 = 18w. What are the prime factors of w? 2, 3, 5, 193 Suppose 0 = -3k + 893 + 721. What are the prime factors of k? 2, 269 Let m be (-4 + (-102)/(-18))/((-5)/(-6)). What are the prime factors of 3509/22 - (-1)/m? 2, 5 Let h = -451 + 577. List the prime factors of h. 2, 3, 7 Let z = -541 - -2662. What are the prime factors of z? 3, 7, 101 Let o(u) = -2u*2 - 120u - 13. What are the prime factors of o(-36)? 5, 7 Let n(j) = 27j2 + 24j - 29. List the prime factors of n(-11). 2, 1487 Let w(f) = 14f2 - 5f + 5. What are the prime factors of w(5)? 2, 3, 5, 11 What are the prime factors of 16596/32 - 7/112-6? 3, 173 Let g = 89 - 49. What are the prime factors of (-104)/(-6) + g/60? 2, 3 Let i = 33 + -20. Suppose -2k + 13 = 3d, 5d - 4k - i = -6. What are the prime factors of d? 3 Suppose 4d + 85 = -103. Suppose -3f + 4f + 79 = 0. Let j = d - f. What are the prime factors of j? 2 Let n(f) = -2f - 11. Let l be n(-6). Suppose -p + 2p + l = 0. List the prime factors of (4 - 45)/(-1) + p. 2, 5 Let t = 32 - -42. List the prime factors of t. 2, 37 Let z = -402 + 705. What are the prime factors of z? 3, 101 Let l(j) = -220j + 36. List the prime factors of l(-3). 2, 3, 29 Let j(r) = r2 - 4r - 2. Let b be j(5). Suppose -5 = g, bc - c = -g - 15. Let h = 3 - c. What are the prime factors of h? 2 Suppose -5i = y - 27, 75 = 4y - i - 33. Suppose -yx = -26x - 43. List the prime factors of x. 43 What are the prime factors of (14744/(-114))/((-1)/3) - -1? 389 Let j be 6/(-27) - 2/(-9). Suppose 2n + 2n + 124 = j. List the prime factors of (6 - 7)n/1. 31 Suppose 5u = -2v + 2989, v - 4u - 1493 = -7u. What are the prime factors of v? 2, 751 Let o(x) = 19x3 - x2 + 9x - 12. Let f be o(2). Let b = 202 - f. What are the prime factors of b? 2, 3 Let a(g) = -g*2. Let v(f) = 7f*2 + f - 2. Let o(c) = 5a(c) + v(c). What are the prime factors of o(-2)? 2 Let h(c) = c3 - c2 - 2c + 15. Let t be h(0). Let y(k) be the third derivative of k4/12 - 7k*3/6 - 4k2. What are the prime factors of y(t)? 23 Let d(u) = -u3 + 2u2 + 4u + 8. Let a be d(-6). Suppose a = -3y - 3o - 2o, -4y - 2o - 358 = 0. Let m = -52 - y. List the prime factors of m. 37 Suppose -2x + 517 = 3p, -1039 = -4x + 4p - 5p. What are the prime factors of x? 2, 5, 13 Suppose -4v - 61600 = -44v. List the prime factors of v. 2, 5, 7, 11 Let x = -1129 + 1635. What are the prime factors of x? 2, 11, 23 Let p(z) be the second derivative of -z6/360 - z5/12 + 5z4/24 + z3/2 + 4z. Let o(m) be the second derivative of p(m). List the prime factors of o(-8). 3, 7 Let q be -2(-3)/((-6)/38). Let i = q + 84. What are the prime factors of i? 2, 23 Let y(h) = 9h*2 - 4h + 3. Let m be y(5). Suppose -3i + m = -50. What are the prime factors of i? 2, 43 Suppose x - 5x = n + 7, -20 = 5x. Suppose -ni + 39 = -24. List the prime factors of i. 7 Let p = 53 + -36. Suppose -49 = -2b - a, -b - 4a = -25 - p. Let f = b + -3. List the prime factors of f. 19 Suppose 5r - 5w - 95 = 0, 4r = -7w + 8w + 76. What are the prime factors of r? 19 Let b(m) = -2m - 14. Let g = -28 - -17. Let p be g - (-2 - -2)/1. What are the prime factors of b(p)? 2 What are the prime factors of (-4)/(-26) - (-5 + (-30548)/13)? 3, 5, 157 Let i be 20/90 - (-2635)/9. Suppose 4r - i = 5c, 0 = 2r - 5r - 4c + 181. List the prime factors of r. 67 Suppose -5o - 252 = 4z, -2z + 126 = -4z - 4o. List the prime factors of z/(-6) + 4/8. 11 Let l = -2 + -1. Let g = l - -4. What are the prime factors of (5 + (3 - 4))g? 2 Let q be 2/((-1)/(-26)4). Suppose 0 = 3o + d - 39, -3d - q = -5o + 38. What are the prime factors of o? 2, 3 Let h(v) = -v3 - v2 + 670. What are the prime factors of h(0)? 2, 5, 67 Let s(z) = -5z*3 + 28z*2 + 93z - 9. List the prime factors of s(-4). 3, 43 Suppose -w + 6r = -4w + 3144, 0 = 4w + 3r - 4212. What are the prime factors of w? 2, 3, 11 Let x = -3 + 21. Suppose -2l = -i + 64 - x, l = -i + 40. What are the prime factors of i? 2, 3, 7 List the prime factors of (6130/10)/(-3 + 4). 613 List the prime factors of (3/6)/(50061/(-7152) + 7). 2, 149 Let p be (0/(-3))/((-6)/(-10 + 4)). Let f be 1213(-2)/(-3). Suppose px - 2y + f = 4x, 3x - y - 194 = 0. What are the prime factors of x? 3, 7 Suppose -5p - g = -19, 3g + 7 = p - 0g. Suppose -4k - 36 = -pq, 0 = -2q - 3q + k + 49. What are the prime factors of q/(-4)56/(-20)? 7 Suppose 2j - 5v = 515, -5j + 827 + 373 = 5v. List the prime factors of j. 5, 7 Let k(w) be the second derivative of -5w*4/24 + 5w*3/6 - 5w*2 - 8w. Let o(v) be the first derivative of k(v). What are the prime factors of o(-2)? 3, 5 Suppose 0 = 29d - 7742 - 1016. List the prime factors of d. 2, 151 Suppose -2r = -r, -2r = -3a + 102. Suppose -94 = -2*s - a. What ar	{ "pile_set_name": "DM Mathematics" }
what is -13 - -441? 423 In base 2, what is -100100010 - -1000? -100011010 In base 13, what is 17 - 0? 17 In base 7, what is 450 + -5? 442 In base 15, what is -1 + 8b3? 8b2 In base 14, what is 3 + 23? 26 In base 5, what is 3444 - 121? 3323 In base 11, what is 103 + -1? 102 In base 13, what is -15 + 3? -12 In base 7, what is -1 - -10? 6 In base 10, what is -3664 - -3? -3661 In base 11, what is 0 - 2? -2 In base 16, what is -55 - 4? -59 In base 2, what is -111 + 100100110? 100011111 In base 7, what is 13564 + 2? 13566 In base 15, what is 1126 + -1? 1125 In base 3, what is 11 + 201002? 201020 In base 6, what is 0 + -2034? -2034 In base 16, what is 1c - -b? 27 In base 15, what is 3 - 5c0? -5bc In base 5, what is -33 - 1302? -1340 In base 5, what is -22012 + -2? -22014 In base 2, what is -10010000 - 0? -10010000 In base 10, what is -110 - 2? -112 In base 9, what is -3 - 3311? -3314 In base 11, what is -362 + 1? -361 In base 12, what is -4 - -a26? a22 In base 13, what is -3 + 782? 77c In base 16, what is -5 + 3e? 39 In base 2, what is -10111001001 + 0? -10111001001 In base 14, what is 1 + -1b8? -1b7 In base 8, what is -622 + -52? -674 In base 3, what is 2 - -1100212? 1100221 In base 12, what is -17 + -1? -18 In base 3, what is 12 + -12222? -12210 In base 11, what is -10 + 70? 60 In base 8, what is -162 - 5? -167 In base 14, what is 5c + -1? 5b In base 9, what is -5 - 1288? -1304 In base 3, what is 1011 - -12? 1100 In base 9, what is -2 + -540? -542 In base 6, what is -530 + 2? -524 In base 6, what is -42 - -151? 105 In base 3, what is 102 - -100122? 101001 In base 6, what is 142 + 22? 204 In base 4, what is 1 - 10100? -10033 In base 15, what is -12 - -bc? aa In base 4, what is 1232 - -3? 1301 In base 11, what is 831 - 5? 827 In base 6, what is 4 + -312? -304 In base 10, what is 5 + 213? 218 In base 7, what is -16524 - -3? -16521 In base 15, what is 0 + 2c? 2c In base 16, what is 5 - -233? 238 In base 6, what is -10 + 402? 352 In base 15, what is -27 + -19? -41 In base 13, what is 5 - -29? 31 In base 5, what is 100 - 2? 43 In base 9, what is -4 + 1464? 1460 In base 7, what is 4441 + 4? 4445 In base 13, what is -1 - 56? -57 In base 2, what is 1010111 - 1? 1010110 In base 13, what is 5b + -4? 57 In base 10, what is 0 + 323? 323 In base 13, what is 271 + -1? 270 In base 3, what is 1 - -221? 222 In base 5, what is 2 + -30144? -30142 In base 7, what is 0 - 265? -265 In base 3, what is 1121201 + 0? 1121201 In base 10, what is 2 - -4317? 4319 In base 10, what is 517 - 6? 511 In base 3, what is 1011021 + 22? 1011120 In base 12, what is -25 + 17? -a In base 16, what is 2 + 6? 8 In base 16, what is -24ff - -4? -24fb In base 6, what is 21 - -13534? 13555 In base 15, what is -1c + 40? 23 In base 12, what is 11 + -23? -12 In base 6, what is -3 - 21141? -21144 In base 5, what is -30031 - -4? -30022 In base 14, what is 3 - 30? -2b In base 12, what is -b - -33? 24 In base 14, what is -16 - -28? 12 In base 3, what is 2 - -11? 20 In base 15, what is 49 - -42? 8b In base 14, what is -3 - 131? -134 In base 11, what is 269 - -4? 272 In base 14, what is 48 - 1? 47 In base 2, what is -1010101 - -111? -1001110 In base 15, what is b - -73? 7e In base 11, what is -96 + -4? -9a In base 10, what is -470 - 28? -498 In base 3, what is -1001 + 100? -201 In base 8, what is 1 + -13256? -13255 In base 3, what is 1000 - 2? 221 In base 11, what is 132 + 55? 187 In base 10, what is -5 + 214? 209 In base 16, what is d - -128? 135 In base 9, what is -65 + 0? -65 In base 3, what is -12201 + -11? -12212 In base 3, what is 112 + 2011? 2200 In base 10, what is 46 + 5? 51 In base 12, what is 127 - -2? 129 In base 4, what is 10 - 2221? -2211 In base 2, what is 1011 - -10010000101? 10010010000 In base 13, what is -11a + 0? -11a In base 16, what is 64 + -3? 61 In base 16, what is -5 + c0? bb In base 2, what is -1001 + 0? -1001 In base 16, what is -3a - -33? -7 In base 14, what is -10 - -b? -3 In base 15, what is -1db - 1? -1dc In base 7, what is 204 - -1? 205 In base 12, what is 18 - -8? 24 In base 12, what is -207 + -4? -20b In base 14, what is 3 - 99? -96 In base 6, what is -10 - 141? -151 In base 14, what is -4 + 163c? 1638 In base 9, what is -3 + -168? -172 In base 14, what is 4 + -22? -1c In base 5, what is 3 - 24? -21 In base 4, what is 3313 + 11? 3330 In base 3, what is 0 - -11111? 11111 In base 16, what is df6 + -1? df5 In base 7, what is 3 + 0? 3 In base 5, what is -3240 - 4? -3244 In base 16, what is -3 - 29? -2c In base 12, what is -3455 + 5? -3450 In base 12, what is -4 - -55? 51 In base 2, what is 100110 - 110? 100000 In base 15, what is -13 + 0? -13 In base 3, what is -10110 - 100? -10210 In base 10, what is 3 - 55? -52 In base 9, what is 463 + 17? 481 In base 4, what is -11 - -2120? 2103 In base 11, what is -389 + 2? -387 In base 5, what is -21 + 22? 1 In base 13, what is -57 + 3c? -18 In base 2, what is -100101100 - -1011? -100100001 In base 11, what is -12 + 3? -a In base 2, what is -100 + -1001011? -1001111 In base 3, what is 12 - -1020012? 1020101 In base 2, what is 11 - -11010110? 11011001 In base 2, what is 1010 - 111011001? -111001111 In base 15, what is -d9 - -1a? -be In base 13, what is 4b + -4? 47 In base 6, what is 200 + -1150? -550 In base 13, what is -1 + -a03? -a04 In base 16, what is 6 - 2? 4 In base 9, what is 1 + 124? 125 In base 5, what is -11 + -2002? -2013 In base 4, what is -10 + 12? 2 In base 15, what is -5 + -3eb? -401 In base 4, what is 10 + -11031? -11021 In base 11, what is -2 + 128? 126 In base 6, what is 5 - -1050? 1055 In base 9, what is 2 - 160? -157 In base 3, what is -10111221 + 11? -10111210 In base 11, what is -185 + 4? -181 In base 2, what is -100 + -100100? -101000 In base 6, what is 4 - 25143? -25135 In base 11, what is -14 + -437? -450 In base 14, what is 77 + 7? 80 In base 6, what is -545 - 2? -551 In base 9, what is 1 - 66? -65 In base 14, what is 3c - 0? 3c In base 4, what is -321 + -13? -1000 In base 3, what is 2001 - -212? 2220 In base 2, what is 101 - -10110101? 10111010 In base 2, what is 1100 + -11? 1001 In base 14, what is 5cb - -b? 5d8 In base 11, what is 1 - 1266? -1265 In base 11, what is 33 - 50? -18 In base 16, what is 5 - dd? -d8 In base 16, what is -4 + 890? 88c In base 5, what is 114 - -212? 331 In base 3, what is -22222 - 122? -100121 In base 4, what is 13 + 0? 13 In base 7, what is 424 - -2? 426 In base 10, what is -488 - 0? -488 In base 2, what is 1 + 10000000? 10000001 In base 14, what is -4 + b6? b2 In base 15, what is -134 - 2? -136 In base 15, what is 2 + 65? 67 In base 14, what is -4 + 6? 2 In base 10, what is -1 - -54? 53 In base 5, what is -4 + -323? -332 In base 16, what is 10 - 1? f In base 8, what is -17 - 205? -224 In base 7, what is -23 - 2? -25 In base 8, what is -4 - 2142? -2146 In base 3, what is -2010 + 20021? 11011 In base 12, what is 125 + -5? 120 In base 9, what is -4 + 3? -1 In base 11, what is -141a - -5? -1415 In base 9, what is -2603 + 3? -2600 In base 3, what is -211 - -2020? 1102 In base 12, what is -2 - 1030? -1032 In base 10, what is -562 - -5? -557 In base 16, what is 1010 + -5? 100b In base 7, what is -52 - -140? 55 In base 16, what is 2a - -30? 5a In base 12, what is -2627 + 0? -2627 In base 3, what is 2 + -10122? -10120 In base 16, what is 5 - -79? 7e In base 14, what is 0 - -5? 5 In base 14, what is -1b - -8? -13 In base 7, what is -34 + 2506? 2442 In base 12, what is -190 - 2? -192 In base 7, what is 1520 - -5? 1525 In base 3, what is -102 + -21? -200 In base 16, what is 0 - 15? -15 In base 12, what is -1 - 12? -13 In base 11, what is -1 + -17? -18 In base 13, what is a6 - -14? ba In base 7, what is -252 + 5? -244 In base 14, what is 4 - -23? 27 In base 14, what is 11 - -14? 25 In base 6, what is 1053 + -4? 1045 In base 7, what is -5 + 26664? 26656 In base 6, what is 12 + 1242? 1254 In base 13, what is -4 + 201? 1ca In base 3, what is 0 + -12120? -12120 In base 9, what is 124 - -2? 126 In base 7, what is 0 + 3? 3 In base 3, what is -2111102 + 0? -2111102 In base 10, what is -2 - 86? -88 In base 12, what is -4 + -171? -175 In base 9, what is -84 - -7? -76 In base 11, what is -13a8 - -3? -13a5 In base 4, what is -200 + 22? -112 In base 8, what is 0 - 1067? -1067 In base 12, what is 2 + -4b	{ "pile_set_name": "DM Mathematics" }
((-704)/32 - -32)? 10/9 What is -4((-6)/(-56) + 4/28)? -1 What is the value of 5/440-2-8? 2/11 What is the value of ((-3055)/25)/13 + (-10)/(-25)? -9 What is the value of 2 + 44/(-8) + 3 - (-57)/(-6)? -10 What is the value of (63/12 - 4) + 177/(-84)? -6/7 Evaluate 9 + 28/3220-1030. 1/23 What is the value of 177/(-118) - 132/(-8)? 15 What is the value of (-10 + -1 - 903/(-84))(-21 + 1)? 5 What is the value of 40/16 - (6 - 3) - 143/(-374)? -2/17 What is the value of -11 + -43 + 32 + 17? -5 Calculate (2/1 - -1) + ((-592)/(-36))/(-4). -10/9 5/(-12)(-140)/(-175) -1/3 (1/10)/(489/24450) 5 (33/858)/(30/(-195)) -1/4 What is the value of (196/42 - 0)/((-7)/21)? -14 What is (13 - 98/8)/(9/(-36))? -3 0 + 2 + 7 + -35 + 19 -7 Calculate -1616/(-640)10/12. 1/3 What is 432/(-1872) + 266/26? 10 5240/1048 - (1/(-3) - 242/(-6)) -35 Evaluate (-2)/6((-5597)/261 - 12/(-27)). 7 What is (-9469)/(-15596) + 12/(-14)? -1/4 Calculate (-2)/((10/4)/(-1) - (-64337)/26866). 19 (-4)/2 - 3 - -3(-7)/3 -12 What is (-2)/(-10) - -3524/800? 5/4 What is the value of (-9 + (-350)/(-39))/((-61)/183)? 1/13 What is 7536/3140 + 57/(-5)? -9 Calculate 22/154(-2 - 30)(-19 + 12). 32 Evaluate (8 - 276/42)(1 + -8). -10 What is ((220/(-75))/4)/((-24)/72)? 11/5 (-36)/(-306) + 496/408 4/3 Calculate (-48)/(-12)(76/80 - 1). -1/5 Calculate (-258)/172 - 2/(4/17). -10 Evaluate 444645/(-2892)4/(-15). 41 What is the value of 31/15 + (-1944)/60 + 33? 8/3 What is 4/((-9108)/216 + 42)? -24 What is the value of ((-3)/2)/(-3)944/59? 8 Calculate 22/(-715) - (-24)/(31200/1015). 3/4 Evaluate 6/(-20)(-2)/(-30)(493 + -353). -14/5 Calculate -3 + 16/6(-153)/68. -9 Evaluate 29/((-754)/182)-1. 7 What is the value of 276/(-468) + 22/33? 1/13 56(5889/338 - 17 - (-4)/52) 28 What is the value of -1 + (1352/312)/(268/60)? -2/67 What is the value of (-49)/14 - (-130)/(-52)? -6 (-9 - -8)/((-18)/165 - (-15)/75) -11 Evaluate ((-99)/21)/((-116)/(-203))(-88)/33. 22 -17 - 3152/(-88) - 19 -2/11 What is the value of (89/(-5) + 34/(-170))(1 + -2)? 18 Calculate ((-273)/(-156))/((-3)/(-24)). 14 65 + -119 - -58 - 2/(-4) 9/2 What is the value of (4/68 - 0) + 1088/(-57800)? 1/25 What is ((-2)/3)/(210/(-693)) + -2? 1/5 What is the value of (-2(-4)/12 + 3/9)-14? -14 What is 10(6/(-12))/(1/(-1))? 5 What is the value of (2/20)/(4 - 136/32)? -2/5 ((32/80)/((-8)/10))/(1/52) -26 Evaluate (14/4)/(4 + 90/(-24)). 14 What is the value of (0 - 15)/(-37 - (-35998)/984)? 36 What is ((-972)/(-27) - 31) + 33/(-5)? -8/5 Evaluate (-4 + (-174)/(-42))/2(2 - 10). -4/7 What is 893/(-47) + (-432)/(-20)? 13/5 What is the value of (-2)/5 - (21 - (-3562)/(-130))? 6 What is the value of (-132)/(-3498) + (-5208)/371? -14 Evaluate 12/(-1012/(-60)). 6 Evaluate 153/(-68)(-11)/(22/8). 9 What is 020/(-440) - (0 + -3 + -13)? 16 What is (-25311)/(-1180) - 23 - 3/(-10)? -5/4 Calculate (3/(-9)-6)/(-13 - 952/(-72)). 9 Evaluate 95/(-114)12/(-10)-29. -29 20/(-50) + (-8)/28 + 2445/2800 3/16 3/((1/(-4)-6)/(2024/(-368))) -11 What is the value of -5 - (-280)/(-540)-9? -1/3 Evaluate (-201)/(-30) - 54/(-180). 7 What is 52/182 - (-111)/(-462)? 1/22 (-5130)/(-16146) - 12/52 2/23 (-1540)/(-130) - 12 - -261(-12)/(-78) 40 What is (274/(-66) - (-4)/(-22))/(44/132)? -13 What is the value of (864/7056)/((-9)/42)? -4/7 What is ((-2)/30)/(13056/459 + -29)? 3/25 What is the value of (92/8)/2335/(-90)? -1/12 What is 4/10(-633)/(-422)? 3/5 What is ((-3)/((-5)/(-20) + -1))/(-98)? -2/49 27504/(-13179) - (2 - (4 - 0)) -2/23 805/(897/39) - 8 27 Calculate (1 + -2)(-62)/620-40. -4 What is (6(-7)/14)/(33/44)? -4 Evaluate (-8)/4(-2 - 0)66/(-120). -11/5 Calculate (0 - 9/(-6))/(-1) + (-79184)/(-3232). 23 What is ((8(-4)/(-64))/1)/(-1)2? -1 What is 22 - (472/20 + -2)? 2/5 What is the value of ((-6)/(-3) + -1)(-6 - (-2 + -5))? 1 Evaluate 120/63 - 2 - (-24)/(-756)18. -2/3 What is the value of 108/64812/14? 1/7 Calculate 3904/656 - 12/(-246). 6 What is (212/(-1060))/(-1 - (-21)/15)? -1/2 Calculate ((-24)/(-14))/(-6) + 6336/616. 10 Evaluate ((-7265)/4359)/((2 - 0)/(-2)). 5/3 What is the value of (-3)/(-2)67/(1005/90)? 9 Evaluate (9/(-6))/(-5 - (-62)/12)-1. 9 Calculate 2(21 + -24) - (2 + -13). 5 What is the value of (((-6)/63)/(16/112))/(100/12)? -2/25 (-2)/(-2) - 58/((-1624)/84) 4 42/915/18(-243)/135 -7 What is the value of 405/54-2 - -19? 4 (-1 - (-10)/5)/(28/12 + -1) 3/4 What is ((-19)/38)/(9/(-108))? 6 Evaluate -5 - (((-130)/(-50) - 3/5) + 2). -9 Evaluate 30 - 37 - (-1 + -16). 10 (-23636)/(-76506) - 2/6 -1/41 (-12)/16 - (-5)/4 1/2 What is the value of (-1 - 14)/(353/(-9) + 10)? 9 11/7 - 1 - 1 -3/7 What is the value of 6(122/2379 + -2 + 503/78)? 27 46/(-207) + (9 - 382/36) -11/6 (-50)/9 - (25 + (-85)/3) -20/9 Calculate 537/133 + (-72)/(-84) + (0 - 5). -2/19 Calculate (195/9 + -7)27/36. 11 What is the value of -10(-12)/(96/4)? 5 (109/(-28) + 4)4 - (-4020)/420 10 Evaluate (1 - (-68)/(-80))/(((-3)/(-15))/1). 3/4 What is the value of ((-1)/((-22)/(-121)))/((-1)/(-2))? -11 What is the value of ((-72)/90)/((-5)/2)5/(-2)? -4/5 What is (999/444)/((-117)/12)? -3/13 Evaluate 3 - 196/96 - ((-224)/21 + 12). -3/8 What is (162/216 - (-122)/(-120))/((-44)/(-10))? -2/33 Calculate (-4)/(-30) - 82/1204/13. -1/13 What is the value of ((-1)/10)/(12/(-48)) - 198/45? -4 5 + 4 - ((-8)/(-24))/(3/189) -12 Evaluate 2 + 88/66 + (0 - 4). -2/3 What is (17 - (-845)/(-52))552/(-18)? -23 10 + (520/(-26) - -17) 7 What is the value of (-38)/3 - 53/((-2279)/602)? 4/3 Calculate ((465/24)/(-31))/((540/16)/(-3)). 1/18 Calculate (-2)/15 + ((-8)/(-60) - -5) - -3. 8 What is the value of 34 + -23 - 4 - -4? 11 What is (6/8)/((-12)/8)(-53 - -21)? 16 Evaluate ((-525)/(-50))/7(-28)/9. -14/3 What is the value of (30/(-3) - -13 - 5)(-12)/8? 3 Evaluate 42/4-3(-36)/(-189). -6 Calculate 248 + -271 + 357/15. 4/5 What is the value of (2 - 0)((-26)/8 + 3)? -1/2 Calculate ((-2)/3)/2 - (-20800)/1200. 17 What is 29/10 + -3 - (48/40 + -1)? -3/10 Evaluate (-10)/(-175) + 2288/(-840). -8/3 What is the value of 2((-132)/(-132))/(-82-1)? 1/8 Calculate 14/7 + -12 - 30/(-10). -7 What is (27/24 - 0)(-20)/30? -3/4 What is the value of (12/(-15))/((-161)/(-490) + 9/(-21))? 8 Calculate (-656)/24 - -1113/429. -27 (2 - (2 - 1))-5 + -14 + 7 -12 What is the value of ((1 + 1)36/120)/(21/14)? 2/5 What is the value of (-6)/10 + (-170)/(-200)? 1/4 804/(-5312)(-4)/10 2/83 What is 6902/(-134589)(-598)/4? 23/3 Calculate (-13)/546-356. 5 What is ((-76)/1)/(17/(-2)) + -9? -1/17 Evaluate 66/(-176) + 41/24. 4/3 (7/(-294))/(3/12) + (-60)/(-1008) -1/28 Calculate (-9205)/5786 - 6/(-4). -1/11 Calculate (-1 - 2) + (3 - 5) + (-18259)/(-961). 14 (-18)/45((-18)/63 + 146/(-224)) 3/8 (-570)/(-50) + -12 + (33/5 - -2) 8 What is the value of (14/462)/(4(-2)/(-48))? 2/11 (12 - 8)(15 + -20) -20 What is (-178)/1869 + 2563/231? 11 What is (-45)/180 + 29/52? 4/13 What is (4257/430)/(-33)(2 + 0 + -3)? 3/10 Calculate ((-8)/24)/((-40)/(-45) - 4/18). -1/2 What is the value of (205/82)/(4/8)? 5 What is (1 + -9)/(648 + -647)? -8 Evaluate (5390/84)/7730. 25 ((-42)/(-9)24/(-168))/(10/165) -11 What is ((-3)/2)/(-94 - -100)? -1/4 Calculate ((-8)/12-3 + 22)6/(-9). -16 What is 3 - (4 - 1) - -488/32? 11 Calculate -1(7 - 14) + (-50 - -40). -3 Calculate -2 + (488/(-72) - -8)3. 5/3 What is (-1 - -13) + (-14 - -42) + -28? 12 What is (-66)/(-3) - 80/(-40)? 24 (-28)/(-294) + (-3)/7 -1/3 -14 + (5 - 472/(-56)) -4/7 What is the value of (18/12 - 14/12)/(62/(-12))? -2/31 Calculate (17 - 14) + (-145)/21 + (2 - -2). 2/21 What is ((-536)/(-33500))/(1/1(-3)/(-15))? 2/25 Calculate 1/7 - 10370/854. -12 What is the value of ((2/(-15))/((-36)/(-45)))/((-30)/(-12))? -1/15 Evaluate (20/(-18))/2888/(-740). 2/3 Calculate 22 + 8 + -13 + 1. 18 What is the value of -8 - (57/(-15) - ((-708)/60 + 12))? -4 What is the value of 198387/(-8643) - (-2)/(-43)? -23 Evaluate 3 - ((-91)/(-10) - 6). -1/10 What is the value of (84)/((-919)/919)? -32 What is the value of (-2 + -2 + 1725/450)/3? -1/18 What is ((-95)/(-3))/19*3? 5 What is the value of ((-2745)/(-54))/61 + (-118)/12? -9 46/(-4) + 345/138 + 78/9 -1/3 What is (6/(-56))/((-2625)/1225)? 1/20 Evaluate (3942/495 - 8)/((-4)/5). 1/22 Evaluate 23/(460/32) - (3 - (-1836)/(-1340)). -2/67 Calculate (-64)/43	{ "pile_set_name": "DM Mathematics" }
0453, 3555691, 4740937, 5926191? 7111453 What is next in -1030509, -1030557, -1030623, -1030707? -1030809 What is the next term in 120623, 121244, 121865, 122486, 123107, 123728? 124349 What comes next: 144733, 288763, 432779, 576775, 720745, 864683, 1008583? 1152439 What comes next: -56325, -112996, -169667? -226338 What is the next term in -747934, -1495848, -2243742, -2991616, -3739470, -4487304, -5235118? -5982912 What is next in -306657, -612534, -918423, -1224330, -1530261, -1836222, -2142219? -2448258 What comes next: -3883, -7766, -11609, -15412, -19175, -22898, -26581? -30224 What is next in 73283, 147773, 222265, 296759, 371255, 445753? 520253 What is next in -20150, -23089, -26024, -28955, -31882? -34805 What is next in -59666, -238654, -536966, -954602, -1491562? -2147846 What is next in 15249, 32695, 50155, 67629, 85117, 102619? 120135 What comes next: 95, 35, -693, -2605, -6217, -12045, -20605, -32413? -47985 What is next in -354, -593, -846, -1113, -1394, -1689? -1998 What comes next: -106863, -213910, -320957, -428004? -535051 What comes next: -93, -507, -1511, -3351, -6273, -10523, -16347? -23991 What is the next term in 81655, 163296, 244925, 326542? 408147 What is next in -28813, -28238, -27663, -27088, -26513? -25938 What is the next term in -439034439, -439034433, -439034425, -439034415? -439034403 What is the next term in -474740, -476966, -480676, -485870, -492548? -500710 What is next in -860017, -860795, -861561, -862309, -863033, -863727, -864385? -865001 What is next in 3496626, 3496976, 3497324, 3497670, 3498014, 3498356? 3498696 What is the next term in -50682, -50767, -51038, -51603, -52570? -54047 What comes next: 72884374, 72884376, 72884378, 72884380? 72884382 What comes next: 7748469, 7748470, 7748465, 7748448, 7748413? 7748354 What is the next term in -3869522, -3869541, -3869560? -3869579 What is the next term in -2820, -2836, -2874, -2958, -3112? -3360 What comes next: 5035550, 10071097, 15106642, 20142185, 25177726? 30213265 What is next in 5661, 10855, 16049, 21243? 26437 What is the next term in 49687, 99981, 150881, 202387, 254499? 307217 What is the next term in -2070047, -4140061, -6210075, -8280089? -10350103 What is the next term in 3023, 12154, 27233, 48146, 74779? 107018 What is next in 1322, 2689, 4054, 5423, 6802, 8197, 9614, 11059? 12538 What is the next term in -153, -424, -795, -1260, -1813? -2448 What comes next: 937, 116, -2469, -6818, -12931, -20808, -30449? -41854 What comes next: 14121724, 14121711, 14121698, 14121685? 14121672 What comes next: 61163701, 122327398, 183491095, 244654792? 305818489 What is the next term in 312522, 312373, 312122, 311769, 311314, 310757? 310098 What comes next: 11000969, 11000978, 11001001, 11001044, 11001113, 11001214, 11001353? 11001536 What comes next: -1137856, -2274551, -3411246, -4547941, -5684636? -6821331 What is next in 5678, 6686, 8368, 10724, 13754? 17458 What is the next term in -2207, -4209, -6211? -8213 What comes next: 436, 1802, 4070, 7240, 11312, 16286, 22162? 28940 What comes next: -40660, -33328, -26020, -18748, -11524, -4360, 2732? 9740 What is the next term in -1564991, -3129982, -4694975, -6259970, -7824967? -9389966 What is next in -57625504, -115251008, -172876512? -230502016 What is the next term in -10205, -9707, -9201, -8687, -8165, -7635, -7097? -6551 What comes next: 255826, 511620, 767336, 1022938, 1278390? 1533656 What is next in -699438, -699548, -699658? -699768 What is next in -9011, -18239, -27683, -37343, -47219, -57311, -67619? -78143 What is next in -17113771, -34227539, -51341307, -68455075? -85568843 What comes next: 3795764, 15183135, 34162080, 60732593, 94894668, 136648299, 185993480, 242930205? 307458468 What is the next term in -19566, -77917, -175194, -311391, -486502, -700521, -953442, -1245259? -1575966 What is the next term in 643, 3744, 12121, 28414, 55263, 95308, 151189, 225546? 321019 What is next in -90205, -94657, -99109, -103561? -108013 What comes next: -85898, -171738, -257504, -343184, -428766, -514238, -599588, -684804? -769874 What is the next term in 490404, 490456, 490508, 490560, 490612? 490664 What is next in -52686934, -52686933, -52686932? -52686931 What is next in -25013, -50038, -75087, -100172, -125305, -150498? -175763 What comes next: 18405, 36896, 55549, 74448, 93677, 113320? 133461 What comes next: -24309, -49052, -73795, -98538, -123281? -148024 What comes next: -202341, -404953, -607565, -810177, -1012789? -1215401 What comes next: -19148, -19598, -20048, -20498, -20948, -21398? -21848 What is next in 246363, 245874, 245385, 244896, 244407? 243918 What is the next term in -558667, -1117328, -1675989, -2234650, -2793311, -3351972? -3910633 What is the next term in 5267370, 10534710, 15802050, 21069390? 26336730 What is next in -2216, -8822, -19842, -35282, -55148? -79446 What comes next: 3433, 6319, 8127, 8317, 6349? 1683 What is next in 1410, 1077, -2758, -11847, -27942? -52795 What is the next term in 8537367, 8537366, 8537365, 8537364, 8537363, 8537362? 8537361 What comes next: 7406, 14990, 22742, 30662? 38750 What comes next: -436315, -436329, -436353, -436387, -436431, -436485? -436549 What is the next term in 33015489, 66030986, 99046483, 132061980, 165077477, 198092974? 231108471 What comes next: -3099, -4161, -5925, -8391? -11559 What comes next: -107203, -108113, -109023, -109933? -110843 What is the next term in -747, -2445, -5263, -9195, -14235, -20377, -27615? -35943 What comes next: -12418, -24778, -37206, -49702? -62266 What is next in 153084, 153231, 153490, 153873, 154392? 155059 What is the next term in -5012, -922, 5896, 15442, 27716? 42718 What is the next term in 702, 550, 238, -276, -1034, -2078, -3450? -5192 What is the next term in 51163, 51576, 52265, 53230, 54471? 55988 What comes next: -1649, -1627, -1585, -1523, -1441, -1339, -1217? -1075 What is next in -53069, -53073, -53087, -53117, -53169? -53249 What is the next term in -20317, -20507, -20811, -21229, -21761? -22407 What comes next: 740, 1433, 1996, 2429, 2732? 2905 What comes next: 511850, 512310, 512772, 513236, 513702, 514170? 514640 What is next in -2151958, -2151931, -2151902, -2151871, -2151838, -2151803, -2151766? -2151727 What comes next: 596, 3958, 9562, 17408, 27496, 39826, 54398? 71212 What comes next: 4535, 29022, 69827, 126944, 200367, 290090, 396107? 518412 What is the next term in 1566523, 1566510, 1566497, 1566484, 1566471, 1566458? 1566445 What is the next term in -927040, -3707671, -8342066, -14830231, -23172172, -33367895? -45417406 What comes next: 2784, 6266, 9744, 13218, 16688, 20154, 23616? 27074 What is next in -1520602, -3041224, -4561846, -6082468, -7603090, -9123712? -10644334 What comes next: -211356, -211519, -211682, -211845, -212008, -212171? -212334 What comes next: 35992, 144097, 324272, 576517? 900832 What comes next: -6885, -14077, -21585, -29409, -37549? -46005 What is the next term in -5716, -11504, -17362, -23290, -29288, -35356? -41494 What is the next term in 1821836, 7287296, 16396412, 29149190, 45545636, 65585756, 89269556, 116597042? 147568220 What is next in 106705, 106725, 106775, 106855, 106965, 107105? 107275 What is next in 10298, 9990, 9460, 8696, 7686? 6418 What comes next: -3171, -4683, -4535, -2727, 741? 5869 What is the next term in -6175944, -12351928, -18527912, -24703896? -30879880 What comes next: 88, -621, -2138, -4469, -7620? -11597 What is the next term in 298518, 596992, 895422, 1193808, 1492150, 1790448, 2088702? 2386912 What comes next: 1567, 7196, 12825? 18454 What comes next: -92791, -185595, -278403, -371215, -464031? -556851 What is the next term in 12313392, 24626784, 36940176, 49253568? 61566960 What is next in 43850, 43852, 43856, 43856, 43846, 43820, 43772, 43696? 43586 What is next in 362, -2587, -7500, -14377, -23218? -34023 What comes next: -665728034, -1331456065, -1997184094, -2662912121, -3328640146? -3994368169 What is next in -180, -1447, -4932, -11757, -23044, -39915? -63492 What is the next term in 2396956, 4793911, 7190866, 9587821, 11984776, 14381731? 16778686 What is next in -4146693, -8293382, -12440071, -16586760, -20733449, -24880138? -29026827 What is the next term in 32499240, 32499241, 32499242, 32499243, 32499	{ "pile_set_name": "DM Mathematics" }
en 1411 is divided by 2? 1 What is the remainder when 839 is divided by 210? 209 What is the remainder when 175 is divided by 26? 19 Calculate the remainder when 139 is divided by 49. 41 Calculate the remainder when 2251 is divided by 161. 158 Calculate the remainder when 350 is divided by 9. 8 What is the remainder when 476 is divided by 156? 8 Calculate the remainder when 20 is divided by 8. 4 Calculate the remainder when 383 is divided by 43. 39 Calculate the remainder when 2194 is divided by 36. 34 What is the remainder when 734 is divided by 361? 12 Calculate the remainder when 436 is divided by 73. 71 Calculate the remainder when 35 is divided by 9. 8 Calculate the remainder when 132 is divided by 23. 17 Calculate the remainder when 338 is divided by 52. 26 Calculate the remainder when 1760 is divided by 26. 18 Calculate the remainder when 231 is divided by 22. 11 What is the remainder when 53 is divided by 20? 13 Calculate the remainder when 705 is divided by 692. 13 What is the remainder when 318 is divided by 203? 115 What is the remainder when 114 is divided by 26? 10 Calculate the remainder when 810 is divided by 25. 10 Calculate the remainder when 2042 is divided by 82. 74 Calculate the remainder when 72 is divided by 15. 12 What is the remainder when 569 is divided by 141? 5 Calculate the remainder when 268 is divided by 130. 8 What is the remainder when 2309 is divided by 766? 11 What is the remainder when 8160 is divided by 39? 9 What is the remainder when 48 is divided by 21? 6 What is the remainder when 145 is divided by 56? 33 What is the remainder when 204 is divided by 69? 66 What is the remainder when 546 is divided by 130? 26 What is the remainder when 519 is divided by 136? 111 Calculate the remainder when 289 is divided by 33. 25 What is the remainder when 325 is divided by 247? 78 Calculate the remainder when 654 is divided by 41. 39 Calculate the remainder when 227 is divided by 26. 19 Calculate the remainder when 103 is divided by 9. 4 Calculate the remainder when 1600 is divided by 22. 16 What is the remainder when 1530 is divided by 253? 12 Calculate the remainder when 210 is divided by 102. 6 What is the remainder when 273 is divided by 55? 53 What is the remainder when 525 is divided by 44? 41 Calculate the remainder when 4315 is divided by 8. 3 Calculate the remainder when 117 is divided by 8. 5 What is the remainder when 73 is divided by 26? 21 What is the remainder when 25 is divided by 7? 4 What is the remainder when 138 is divided by 24? 18 What is the remainder when 1763 is divided by 12? 11 Calculate the remainder when 5793 is divided by 161. 158 What is the remainder when 1236 is divided by 321? 273 Calculate the remainder when 716 is divided by 48. 44 Calculate the remainder when 260 is divided by 133. 127 What is the remainder when 140 is divided by 37? 29 Calculate the remainder when 824 is divided by 122. 92 What is the remainder when 2447 is divided by 36? 35 What is the remainder when 329 is divided by 22? 21 Calculate the remainder when 394 is divided by 48. 10 What is the remainder when 533 is divided by 79? 59 What is the remainder when 204 is divided by 42? 36 What is the remainder when 45 is divided by 17? 11 Calculate the remainder when 74 is divided by 68. 6 What is the remainder when 463 is divided by 16? 15 Calculate the remainder when 936 is divided by 60. 36 What is the remainder when 181 is divided by 35? 6 Calculate the remainder when 39 is divided by 15. 9 What is the remainder when 3775 is divided by 31? 24 What is the remainder when 119 is divided by 8? 7 Calculate the remainder when 245 is divided by 16. 5 What is the remainder when 3440 is divided by 855? 20 Calculate the remainder when 1733 is divided by 34. 33 Calculate the remainder when 453 is divided by 12. 9 Calculate the remainder when 358 is divided by 74. 62 What is the remainder when 123 is divided by 25? 23 What is the remainder when 26 is divided by 10? 6 Calculate the remainder when 487 is divided by 29. 23 What is the remainder when 393 is divided by 67? 58 Calculate the remainder when 1284 is divided by 66. 30 Calculate the remainder when 38 is divided by 9. 2 What is the remainder when 101 is divided by 30? 11 Calculate the remainder when 141 is divided by 29. 25 Calculate the remainder when 262 is divided by 44. 42 Calculate the remainder when 424 is divided by 71. 69 Calculate the remainder when 1715 is divided by 570. 5 Calculate the remainder when 136 is divided by 61. 14 What is the remainder when 321 is divided by 133? 55 Calculate the remainder when 793 is divided by 24. 1 Calculate the remainder when 71 is divided by 17. 3 Calculate the remainder when 539 is divided by 68. 63 What is the remainder when 676 is divided by 414? 262 Calculate the remainder when 521 is divided by 216. 89 Calculate the remainder when 2657 is divided by 35. 32 What is the remainder when 432 is divided by 87? 84 Calculate the remainder when 1380 is divided by 3. 0 What is the remainder when 3634 is divided by 182? 176 Calculate the remainder when 77 is divided by 28. 21 What is the remainder when 109 is divided by 14? 11 Calculate the remainder when 11943 is divided by 13. 9 What is the remainder when 609 is divided by 42? 21 Calculate the remainder when 45 is divided by 12. 9 Calculate the remainder when 4865 is divided by 2426. 13 Calculate the remainder when 197 is divided by 31. 11 Calculate the remainder when 2270 is divided by 754. 8 Calculate the remainder when 162 is divided by 4. 2 Calculate the remainder when 52 is divided by 11. 8 Calculate the remainder when 186 is divided by 174. 12 What is the remainder when 680 is divided by 136? 0 Calculate the remainder when 581 is divided by 38. 11 Calculate the remainder when 501 is divided by 101. 97 Calculate the remainder when 730 is divided by 3. 1 Calculate the remainder when 12237 is divided by 17. 14 Calculate the remainder when 1589 is divided by 33. 5 What is the remainder when 269 is divided by 93? 83 Calculate the remainder when 9317 is divided by 10. 7 What is the remainder when 285 is divided by 76? 57 Calculate the remainder when 152 is divided by 17. 16 Calculate the remainder when 2353 is divided by 15. 13 What is the remainder when 475 is divided by 53? 51 What is the remainder when 682 is divided by 235? 212 What is the remainder when 111 is divided by 17? 9 Calculate the remainder when 279 is divided by 38. 13 Calculate the remainder when 4043 is divided by 6. 5 Calculate the remainder when 196 is divided by 22. 20 What is the remainder when 1903 is divided by 4? 3 What is the remainder when 202 is divided by 66? 4 What is the remainder when 626 is divided by 7? 3 What is the remainder when 654 is divided by 170? 144 What is the remainder when 1994 is divided by 74? 70 Calculate the remainder when 110 is divided by 58. 52 What is the remainder when 372 is divided by 25? 22 What is the remainder when 5027 is divided by 43? 39 What is the remainder when 952 is divided by 24? 16 Calculate the remainder when 127 is divided by 42. 1 Calculate the remainder when 170 is divided by 53. 11 What is the remainder when 1667 is divided by 331? 12 What is the remainder when 985 is divided by 43? 39 Calculate the remainder when 693 is divided by 29. 26 Calculate the remainder when 813 is divided by 164. 157 Calculate the remainder when 735 is divided by 253. 229 Calculate the remainder when 971 is divided by 9. 8 What is the remainder when 197 is divided by 72? 53 Calculate the remainder when 79 is divided by 11. 2 What is the remainder when 718 is divided by 163? 66 Calculate the remainder when 733 is divided by 53. 44 What is the remainder when 180 is divided by 68? 44 Calculate the remainder when 908 is divided by 153. 143 Calculate the remainder when 2313 is divided by 122. 117 Calculate the remainder when 254 is divided by 84. 2 Calculate the remainder when 397 is divided by 171. 55 What is the remainder when 91 is divided by 24? 19 Calculate the remainder when 145 is divided by 50. 45 Calculate the remainder when 1124 is divided by 66. 2 What is the remainder when 296 is divided by 34? 24 What is the remainder when 5982 is divided by 105? 102 What is the remainder w	{ "pile_set_name": "DM Mathematics" }
st the prime factors of 2824931. 97, 29123 What are the prime factors of 1296042? 2, 3, 11, 73, 269 What are the prime factors of 23832644? 2, 11, 41, 1201 What are the prime factors of 148876? 2, 7, 13, 409 What are the prime factors of 275663? 181, 1523 List the prime factors of 534882. 2, 3, 239, 373 List the prime factors of 12904383. 3, 4301461 What are the prime factors of 2176797? 3, 7, 103657 List the prime factors of 6289794. 2, 3, 7, 49919 List the prime factors of 170567. 281, 607 List the prime factors of 9567558. 2, 3, 7, 11, 13, 59 What are the prime factors of 254078? 2, 11, 11549 List the prime factors of 261842. 2, 7, 59, 317 What are the prime factors of 726812? 2, 109, 1667 List the prime factors of 354907. 7, 7243 What are the prime factors of 594404? 2, 181, 821 List the prime factors of 25783280. 2, 5, 101, 3191 What are the prime factors of 6434423? 439, 14657 What are the prime factors of 6686634? 2, 3, 233, 4783 What are the prime factors of 2244146? 2, 167, 6719 List the prime factors of 2022058. 2, 1011029 What are the prime factors of 307659? 3, 11, 9323 List the prime factors of 11144062. 2, 29, 271, 709 What are the prime factors of 11970899? 43, 278393 What are the prime factors of 1040145? 3, 5, 17, 4079 What are the prime factors of 12550209? 3, 7, 353, 1693 What are the prime factors of 38264? 2, 4783 List the prime factors of 1255150. 2, 5, 13, 1931 List the prime factors of 8784714. 2, 3, 137, 10687 List the prime factors of 820470. 2, 3, 5, 7, 3907 What are the prime factors of 1100300? 2, 5, 11003 List the prime factors of 1047375. 3, 5, 7, 19 List the prime factors of 573103. 313, 1831 What are the prime factors of 2447329? 2447329 What are the prime factors of 18163051? 433, 41947 What are the prime factors of 1519226? 2, 271, 2803 What are the prime factors of 670026? 2, 3, 7, 43, 53 List the prime factors of 826678. 2, 103, 4013 List the prime factors of 4389807. 3, 1123, 1303 List the prime factors of 870056. 2, 11, 9887 List the prime factors of 23264252. 2, 11, 223, 2371 What are the prime factors of 62395? 5, 12479 List the prime factors of 278197. 29, 53, 181 List the prime factors of 2482760. 2, 5, 7, 8867 What are the prime factors of 350361? 3, 11, 3539 List the prime factors of 381086. 2, 190543 List the prime factors of 660671. 11, 17, 3533 List the prime factors of 747172. 2, 186793 List the prime factors of 2631615. 3, 5, 7, 71, 353 What are the prime factors of 1192812? 2, 3, 99401 List the prime factors of 4694517. 3, 19319 List the prime factors of 9929939. 9929939 What are the prime factors of 1075133? 1075133 List the prime factors of 5545491. 3, 7, 264071 What are the prime factors of 458960? 2, 5, 5737 What are the prime factors of 273145? 5, 54629 List the prime factors of 15952346. 2, 7976173 List the prime factors of 209742. 2, 3, 13, 2689 What are the prime factors of 10571730? 2, 3, 5, 13, 27107 List the prime factors of 25225042. 2, 17, 741913 What are the prime factors of 367252? 2, 91813 List the prime factors of 3133827. 3, 29, 12007 What are the prime factors of 21528476? 2, 5382119 List the prime factors of 35694. 2, 3, 661 List the prime factors of 102112. 2, 3191 What are the prime factors of 475421? 475421 What are the prime factors of 214507? 214507 List the prime factors of 758685. 3, 5, 37, 1367 List the prime factors of 63236. 2, 15809 What are the prime factors of 227391? 3, 75797 List the prime factors of 216590. 2, 5, 11, 179 What are the prime factors of 186993? 3, 79, 263 What are the prime factors of 8962528? 2, 19, 14741 List the prime factors of 134701. 7, 2749 What are the prime factors of 3072433? 7, 13, 19, 1777 What are the prime factors of 7133664? 2, 3, 19, 3911 What are the prime factors of 4955553? 3, 53, 3463 List the prime factors of 1746994. 2, 873497 List the prime factors of 19305. 3, 5, 11, 13 What are the prime factors of 178147? 29, 6143 What are the prime factors of 2115693? 3, 127, 617 What are the prime factors of 33997021? 89, 381989 List the prime factors of 3645480. 2, 3, 5, 17, 1787 What are the prime factors of 2815814? 2, 103, 13669 What are the prime factors of 9311989? 9311989 List the prime factors of 494136. 2, 3, 6863 List the prime factors of 270207. 3, 7, 4289 List the prime factors of 438376. 2, 37, 1481 List the prime factors of 41082878. 2, 383, 53633 What are the prime factors of 90796? 2, 22699 List the prime factors of 2570247. 3, 17, 107, 157 What are the prime factors of 4028695? 5, 11, 6659 What are the prime factors of 32010729? 3, 10670243 List the prime factors of 21585561. 3, 83, 86689 List the prime factors of 130680. 2, 3, 5, 11 List the prime factors of 187771. 179, 1049 List the prime factors of 7093380. 2, 3, 5, 7, 16889 List the prime factors of 1938882. 2, 3, 11, 29, 1013 List the prime factors of 8470841. 8470841 What are the prime factors of 1461377? 61, 23957 What are the prime factors of 277464? 2, 3, 11, 1051 List the prime factors of 9422507. 919, 10253 List the prime factors of 182312. 2, 13, 1753 What are the prime factors of 25591948? 2, 409, 15643 List the prime factors of 15269742. 2, 3, 282773 List the prime factors of 695186. 2, 193, 1801 List the prime factors of 20779861. 1879, 11059 What are the prime factors of 255655? 5, 51131 What are the prime factors of 2348188? 2, 29, 31, 653 List the prime factors of 596052. 2, 3, 5519 List the prime factors of 1453079. 109, 13331 List the prime factors of 6052072. 2, 13, 58193 List the prime factors of 2023430. 2, 5, 202343 What are the prime factors of 383602? 2, 191801 List the prime factors of 359242. 2, 13, 41, 337 List the prime factors of 619964. 2, 154991 What are the prime factors of 1373716? 2, 47, 7307 What are the prime factors of 254755? 5, 50951 What are the prime factors of 9421246? 2, 4710623 List the prime factors of 140289. 3, 101, 463 What are the prime factors of 67146? 2, 3, 19, 31 What are the prime factors of 189302? 2, 94651 What are the prime factors of 324991? 324991 List the prime factors of 6858620. 2, 5, 19, 18049 List the prime factors of 98470. 2, 5, 43, 229 List the prime factors of 871660. 2, 5, 41, 1063 What are the prime factors of 2185182? 2, 3, 73, 1663 List the prime factors of 5750091. 3, 29, 22031 List the prime factors of 1527544. 2, 79, 2417 List the prime factors of 3830344. 2, 7, 68399 List the prime factors of 5068863. 3, 137, 4111 What are the prime factors of 351675? 3, 5, 521 List the prime factors of 83506. 2, 43, 971 What are the prime factors of 4370350? 2, 5, 87407 What are the prime factors of 6146492? 2, 11, 29, 4817 What are the prime factors of 76634? 2, 38317 List the prime factors of 260132. 2, 65033 List the prime factors of 23434745. 5, 53, 191, 463 What are the prime factors of 3511933? 157, 22369 List the prime factors of 496845. 3, 5, 61, 181 List the prime factors of 6720720. 2, 3, 5, 41, 683 What are the prime factors of 16121163? 3, 5373721 What are the prime factors of 3779119? 19, 198901 List the prime factors of 1249273. 1249273 List the prime factors of 798324. 2, 3, 71, 937 List the prime factors of 1249752. 2, 3, 7, 43, 173 List the prime factors of 145326. 2, 3, 53, 457 List the prime factors of 295966. 2, 11, 1223 List the prime factors of 308965. 5, 61, 1013 What are the prime factors of 384768? 2, 3, 167 What are the prime factors of 90190? 2, 5, 29, 311 What are the prime factors of 10259589? 3, 3419863 List the prime factors of 1559630. 2, 5, 23, 6781 What are the prime factors of 616365? 3, 5, 13697 List the prime factors of 63530. 2, 5, 6353 What are the prime factors of 2566082? 2, 17, 71, 1063 List the prime factors of 1397499. 3, 465833 What are the prime factors of 827068? 2, 11, 18797 What are the prime factors of 43323778? 2, 3203, 6763 What are the prime factors of 262027? 262027 List the prime factors of 75454. 2, 31, 1217 List the prime factors of 8543542. 2, 7, 87179 List the prime factors of 63929. 63929 List the prime factors of 12627239. 59, 214021 List the prime factors of 3506872. 2, 557, 787 List the prime factors of 281741. 17, 16573 What are the prime factors of 497031? 3, 29, 197 What are the prime factors of 1232386? 2, 23, 73, 367 What are the pri	{ "pile_set_name": "DM Mathematics" }
1)(7b - 2)/5 Factor -2 - 15l3 + 50l*3 + 2l*2 - 2l - 16l3 - 17l*3. 2(l - 1)(l + 1)2 Let v be (1/4)/(105/(-20) + 6). What is u in 2/3 - vu*3 + 7u*4 - 23/3u*2 + 1/3u = 0? -1, -2/7, 1/3, 1 Let p(b) be the second derivative of -b*4/3 - 16b*3/3 - 32b*2 - b. Let p(m) = 0. Calculate m. -4 Let d be (-1)/((-9)/6) + 10/(-15). Determine r, given that 0r + dr4 + 0 + 0r*2 - 1/3r*3 + 1/3r*5 = 0. -1, 0, 1 Suppose -14 = 3v + 22. Let z(n) = 22n2 - 10n - 20. Let o(y) = -9y2 + 4y + 8. Let t(l) = vo(l) - 5z(l). Factor t(f). -2(f - 2)(f + 1) Suppose 7r = -4r. Factor -1/5b4 + 0b + r - 1/5b3 + 0b2. -b3(b + 1)/5 Let s(w) be the first derivative of 25w*4/14 - 20w*3/7 - 36w*2/7 - 16w/7 - 1. Solve s(t) = 0 for t. -2/5, 2 Factor 65s3 + 9s*5 + 56s*4 + 16s + 96s2 + 0s + 55s3. s(s + 2)*3(9s + 2) Let u = 2/737 - 9665/30954. Let g = 9/14 + u. Suppose -2/3 - 4/3t*2 - gt*3 - 5/3t = 0. What is t? -2, -1 Let b = 26 - 15. Let n = -8 + b. Let -1/3jn - 1/3j + 0 + 2/3j2 = 0. What is j? 0, 1 Let t(c) be the first derivative of -1/2c*3 + 1/12c4 + c2 - 1 - c. Let h(w) be the first derivative of t(w). Solve h(i) = 0. 1, 2 Let z(d) = 5d3 + 2d*2 + d - 4. Let o(p) = 4p. Let k be o(-1). Let s(r) = -6r3 - 2r*2 - r + 5. Let w(b) = ks(b) - 5z(b). Let w(y) = 0. What is y? -1, 0 Let q be 6(-5)/(-165) - (-8)/198. Factor -4/9h2 - 2/9h*3 - qh + 0. -2h(h + 1)2/9 Let s(z) be the second derivative of -z7/42 - z6/10 - z5/20 + z4/4 + z3/3 + 14z. Solve s(b) = 0 for b. -2, -1, 0, 1 Suppose -2q - 6 = -4q. Factor 37 - k4 + 6k*2 - 4k*2 - 12k*q - 5 + 48k + 3k4. 2(k - 4)*2(k + 1)2 Let i(m) be the third derivative of m6/200 - m5/50 - m4/40 + m*3/5 - 2m*2. Solve i(t) = 0. -1, 1, 2 Let g = 612/5 + -122. Suppose -33 = -2m - 5z, -5m = 2z - 6z. Let -6/5y2 - gy*3 - 4/5 + 2y + 2/5ym = 0. Calculate y. -2, 1 Let k be (-24)/48(-7 - -1). Factor 1/4 - 1/4jk - 1/4j*2 + 1/4j. -(j - 1)(j + 1)2/4 Find z such that 2/11z*5 - 2/11z*4 + 2/11z*2 + 0z + 0 - 2/11z3 = 0. -1, 0, 1 Let v(i) be the second derivative of -1/20i*5 + 0i*3 + 0i*2 + 1/30i*6 + 0 - 2i + 1/42i7 - 1/12i4. Factor v(w). w2(w - 1)(w + 1)2 Let t(o) be the second derivative of o4/36 - o*3/2 - 5o*2/3 - 10o + 1. Factor t(a). (a - 10)(a + 1)/3 Factor 10w*2 - 10w*2 - 30w + 5w2 + 45. 5(w - 3)2 Let s(d) be the third derivative of d10/10080 + d*9/5040 + 5d*4/24 + 2d*2. Let i(y) be the second derivative of s(y). Factor i(z). 3z*4(z + 1) Let t be 8/(48/27) + (-3)/2. Let l(n) be the first derivative of 3/5n - 3/20n*4 + 3/5n*t - 9/10n*2 + 2. Factor l(o). -3(o - 1)*3/5 Let v(t) be the second derivative of 1/42t*4 + 0 - 2/21t*3 + 1/7t*2 - 3t. Find l, given that v(l) = 0. 1 Factor -4b - 2b + b*2 + 2b - 3b2. -2b(b + 2) Determine h, given that -3h + 93h2 - h - 12h - 89h2 + 16 = 0. 2 Let a(q) be the third derivative of q5/60 - q3/6 - 3q*2. Solve a(t) = 0. -1, 1 Suppose 70 = 5n + d, -2n + 3d + 28 = d. Find u such that 6u - 2u*2 - 23u*2 - 4 - nu - 12u = 0. -2/5 Let g be (-2)/(-8) - 35/(-20). Determine q so that -2q + g - 2q2 + 2q = 0. -1, 1 Let w be (-21)/11 + (-48)/(-16). Factor -2/11b3 - 16/11 - 24/11b - wb2. -2(b + 2)3/11 Let s(x) = -x2 - 11x - 30. Let z be s(-5). Let -d2 + d4 + 0d*3 - 1/2d + z + 1/2d5 = 0. Calculate d. -1, 0, 1 Factor 21/2o*2 + 0 - 3/2o*3 - 9o. -3o(o - 6)(o - 1)/2 Let o = -1 + 4. Let h be 0/(o1/3). Factor -2/5a2 + 2/5a + h. -2a(a - 1)/5 Let q be -3(-4)/(-3) - -2. Let o be 0/(3 + 0 + q). What is f in 9/4f*5 + 0f + 0f2 - 3/2f*4 + 1/4f*3 + o = 0? 0, 1/3 Let g be ((-20)/(-3))/(8/12). Suppose -3o + g = 4. Let 2/7a3 + 4/7a*o + 2/7a + 0 = 0. What is a? -1, 0 Suppose 3b - 40 = -b. Let q be 16/b + 0. Factor -qf3 + 1/5 - f + 7/5f2. -(f - 1)2(3f - 1)/5 Let a(x) be the second derivative of 2x + 1/3x*6 - 4/5x*5 + 2/3x*4 + 0 - 1/21x*7 + 0x*3 + 0x2. Find p such that a(p) = 0. 0, 1, 2 Let g(d) be the first derivative of -d7/1120 + d5/160 + d3 + 3. Let o(a) be the third derivative of g(a). Factor o(y). -3y(y - 1)(y + 1)/4 Let t(g) be the second derivative of -g5/110 + g4/33 + 4g*3/33 - 8g*2/11 - 4g. What is o in t(o) = 0? -2, 2 Let c(h) = -18h3 + 30h*2 - 9h. Let l(u) = -u4 + u2 + u. Let t(n) = -c(n) + 3l(n). Factor t(r). -3r(r - 4)(r - 1)2 Solve -r2 + 10r - 6r + 3r2 = 0. -2, 0 Let f be ((-10)/15)/((-1)/3). Let h = -2 + 4. Factor 12s + 12 + 4s2 + 0sf - sh. 3(s + 2)2 Let v(l) be the third derivative of 0l*3 + 1/270l*6 + 0l*4 + 0 + 5l*2 - 1/270l*5 - 1/945l*7 + 0l. Let v(r) = 0. Calculate r. 0, 1 Let g(c) be the first derivative of -c7/210 + c5/25 - c4/30 - c3/10 + c*2/5 - 4c - 5. Let s(v) be the first derivative of g(v). Factor s(d). -(d - 1)*3(d + 1)(d + 2)/5 Factor 8d - 15d3 + 8d*2 + 25d*3 - 8d*3. 2d(d + 2)2 Let z(l) be the first derivative of 1/8l*4 + 5/24l*3 + 1/40l*5 + 0l + 1/8l2 - 1. What is n in z(n) = 0? -2, -1, 0 Let n be (-1(3 + 1) - -7)/1. Let l(u) be the first derivative of 1/3u6 + 4 + 2/5u*5 + 0u*2 + 0u*n + 0u*4 + 0u. Factor l(h). 2h4(h + 1) Let u be 10/55 - 14/(-44)1. Let x(r) be the first derivative of -2r - r*4 + 10/3r*3 - 8/5r*5 - ur*2 - 2 + 5/6r*6. Determine o, given that x(o) = 0. -1, -2/5, 1 Let l(p) be the second derivative of -3/10p*6 + 0p*2 - 1/12p*4 + 0p*3 - 3/10p*5 + 0 - 2p. Factor l(o). -o*2(3o + 1)2 Let l(w) be the first derivative of w7/42 - 11w6/90 + w5/4 - w4/4 + w3/9 + 3w + 1. Let z(y) be the first derivative of l(y). What is v in z(v) = 0? 0, 2/3, 1 Let o(i) be the first derivative of i3/6 - 4i - 3. Let y(k) be the first derivative of o(k). Let s(m) = -7m2 - 8m. Let p(g) = s(g) + 6y(g). Factor p(q). -q(7q + 2) Let x = 983/3 - 327. Factor 1/3c*5 - c + xc3 + c4 - 2/3c2 - 1/3. (c - 1)(c + 1)*4/3 Let c(h) = -103h*3 + 350h*2 - 176h + 19. Let v(f) = -310f3 + 1050f*2 - 528f + 56. Let p(j) = -16c(j) + 5v(j). Suppose p(q) = 0. What is q? 2/7, 3 Let n be 2/(20/3 - 6). Factor 1/7r4 + 0r*n + 0 - 1/7r*2 + 0r. r*2(r - 1)(r + 1)/7 Factor -162/19 - 36/19i - 2/19i2. -2(i + 9)*2/19 Factor 48l*2 - 23l*4 + 12l + 2l3 + 4l + 10l3 + 3l*4. -4l(l - 2)(l + 1)(5l + 2) Let l(q) be the second derivative of q6/30 + q5/10 - q3/3 - q2/2 - 8q. Factor l(k). (k - 1)(k + 1)*3 Let d(m) be the first derivative of 3 - 3/4m*4 + 0m + 3/2m2 + 0m3. Let d(u) = 0. Calculate u. -1, 0, 1 Let q(d) be the second derivative of d5/60 - d4/40 - d3/15 + 3d2/2 + 5d. Let v(i) be the first derivative of q(i). Determine w so that v(w) = 0. -2/5, 1 Let a(k) = 63k2 - k + 1. Let p be a(1). Let n = p + -251/4. Factor -1/4 + ny*2 + 1/4y - 1/4y3. -(y - 1)2(y + 1)/4 Let r be 12 + 44 + 0. Let o be (-5)/3 - r/(-24). Find l, given that 1/4l*3 - o - 1/4l + 1/4l2 = 0. -1, 1 Solve 39c - 15c + c4 + 6c*3 + 7c*2 + 2c*2 - 20c = 0. -4, -1, 0 Let p(h) be the second derivative of 3h3 + 0 + 1/4h*4 + 27/2h*2 + 2h. Factor p(r). 3(r + 3)2 Let q(f) be the second derivative of -5f*7/14 - 6f*6/5 - 3f*5/5 + 5f*4/2 + 9f*3/2 + 3f*2 + 2f. What is h in q(h) = 0? -1, -2/5, 1 Suppose 5 = 3w - 7. Let a = w + -1. Solve 1/4 + 1/4d - 1/4da - 1/4d*2 = 0 for d. -1, 1 Let h be (-10)/(-14) - 4/(-14). Let m(b) be the first derivative of 2b - b*2 + 1/6b*3 - h. Find c such that m(c) = 0. 2 Let z = -7 - -50/7. Let w(i) be the second derivative of zi*4 + 4/7i*3 + 0 + 8/7i*2 + 1/70i*5 - i. Factor w(q). 2(q + 2)*3/7 Suppose y = 4k - k + 30, -4k = 4y - 40. Let u be (y/10)/((-3)/(-4)). Solve -2 + hu + h2 + h2 - h2 = 0. -1, 1 Let y(c) = -4c4 + 6c*2 + 6c. Let x(h) = h*2 - 5h - 6h2 + 2h4 + h4. Let k(t) = 6x(t) + 5y(t). Determine v so that k(v) = 0. 0 Let a(l) be the third derivative of l7/1260 - l6/60 + 3l5/20 + l4/24 + l2. Let y(o) be the second derivative of a(o). Factor y(c). 2(c - 3)**2 Let i(l) be t	{ "pile_set_name": "DM Mathematics" }
? 8 Suppose -2m + m + 4 = 0. Let c be -1 - (0/(-1) + 81). Let s = c - -126. What is the highest common factor of s and m? 4 Let k = -15 + -7. Let m be 20/110 + (-260)/k. Let b(j) = j2 + 4j - 2. Let o be b(4). What is the highest common factor of m and o? 6 Let h = -240 - -771. What is the greatest common divisor of 27 and h? 9 Let h = -132 - -251. Suppose 208 = 4a + 140. Calculate the greatest common factor of h and a. 17 Let z = 4 - -13. Let h(a) = -a2 + z + 2 - 12a - 9. Let g be h(-12). What is the greatest common divisor of 2 and g? 2 Suppose -3y + 4y - 3w - 20 = 0, 2w = y - 16. Let d be (y + 2)/(4/8). Calculate the highest common factor of d and 8. 4 Let z = 88 - -8. Let l = -2244 - -2256. What is the greatest common divisor of z and l? 12 Let f be 2020(-30)/(-160)4. What is the highest common factor of 15 and f? 15 Let k(m) be the first derivative of m*2/2 + 17m + 8. Let t be k(0). Calculate the highest common divisor of t and 119. 17 Suppose -6i + 3i - l + 2401 = 0, -803 = -i - 3l. What is the highest common divisor of 25 and i? 25 Let s(j) = 3j*2 + 2j - 1. Suppose -5m + 3 - 28 = 0, -5m = 4u + 57. Let d = u + 9. Let w be s(d). Calculate the highest common divisor of 4 and w. 4 Let l = -113 + 59. Let b be (-126)/l - (-8)/(-6). What is the greatest common divisor of 16 and b? 1 Let a = 36 - 34. Suppose -av + 6v - 76 = 0. Let h = 2 + 17. Calculate the highest common factor of v and h. 19 Suppose 22m + 34m = 4760. What is the highest common divisor of m and 68? 17 Let y be 938/6 - 4/12. Let r = y + -59. Suppose -123 = -5k - 0k + 3z, -3k + r = 4z. Calculate the highest common divisor of 9 and k. 9 Let s(a) = a*2 - 9a + 35. Let c be s(7). What is the greatest common factor of c and 63? 21 Let i(r) = -2r - 7. Suppose 4y + 10 = 2y. Let w be i(y). Let v(j) = j3 + j2 - 3j. Let c be v(3). Calculate the greatest common factor of c and w. 3 Let h be (15/(-12))/(1/(-108)). Suppose h - 5 = 5u. What is the greatest common factor of 39 and u? 13 Let g(r) = -r2 - 10r + 1. Suppose -21 - 6 = 3j. Let o be g(j). Calculate the greatest common divisor of o and 2. 2 Let d = 33 + -9. Suppose g - d = -19. What is the greatest common divisor of 2 and g? 1 Suppose -6d - 30 + 1236 = 0. Calculate the greatest common factor of d and 67. 67 Let y be 1/(-4) + (-1)/(-4). Let j be (1 + 2 - 2) + (-96)/(-6). Let c be -2 + (j - (-3 - y)). Calculate the greatest common factor of c and 6. 6 Let w be 4/18 + 22/(-18). Let p be (-1 - w)(-4)/8. Suppose p = 10m - 6m - 80. Calculate the greatest common divisor of m and 30. 10 Suppose 7l - 65 = 2l. Let y be ((-15)/9)/(5/(-78)). Calculate the highest common divisor of y and l. 13 Suppose 564 = 5t + 2w, -t + 4w - 24 = -150. What is the highest common factor of t and 76? 38 Suppose -17t = -8t - 9936. What is the highest common divisor of t and 24? 24 Suppose -11j = -12j - 8. Let k(c) = -c + 9. Let w be k(j). What is the greatest common divisor of w and 153? 17 Suppose k - 4i - 80 = -3k, -2k - 4i + 40 = 0. Suppose -q = -5q + k. Let c be (2/3)/(10/675). What is the greatest common divisor of q and c? 5 Let u = -356 + 504. What is the highest common factor of 37 and u? 37 Let r = -424 + 1124. Calculate the highest common factor of r and 980. 140 Suppose 3j = 4j - 18. Let r = 567 - 531. Calculate the highest common divisor of j and r. 18 Let l be (-10)/3(-336)/35. Suppose -l = -7s + 3s. Let a = -38 + 102. Calculate the highest common factor of a and s. 8 Let v(x) = 3x. Let h be ((-69)/(-6) - 1)2. Suppose -5n - 1 + h = 0. Let l be v(n). What is the highest common factor of l and 60? 12 Suppose 96p - 94p = 4. Suppose 143 = k + pk + 2o, -o - 221 = -5k. Calculate the highest common divisor of k and 5. 5 Suppose 0 = -229g + 231g - 64. Calculate the greatest common factor of g and 160. 32 Let r = 74 - -90. Calculate the highest common divisor of 205 and r. 41 Let v be 30/9(-3)/(-2). Let p = 971 + -941. What is the greatest common factor of v and p? 5 Let d(p) = 5 - 5 + 2p + 1 + 3p2. Let a be d(-1). Suppose 0 = -5l - 20, 4k + a = -3l - 2. What is the greatest common divisor of 14 and k? 2 Suppose -23p + 20p + 108 = 0. Calculate the highest common factor of 4 and p. 4 Let n(d) = d*3 - 12d*2 + 8. Let t be n(12). Let u = t - -7. What is the greatest common divisor of u and 60? 15 Suppose -18 = 86v - 95v. Calculate the highest common divisor of v and 32. 2 Suppose 55 = -5h + 10h. Suppose 15j - hj - 240 = 0. What is the greatest common factor of j and 6? 6 Suppose 383 = 24h - 1441. Let g = 2 - 0. Let u(p) = 9p + 1. Let n be u(g). What is the highest common divisor of n and h? 19 Let k = -52 - -53. Let c(h) = 59h - 5. Let z be c(k). What is the highest common factor of 324 and z? 54 Let i = 3 + 2. Suppose -id = -2d - 6. Suppose 4z = o + 441, -dz + o = 2o - 219. Calculate the highest common divisor of z and 10. 10 Let s be ((-90)/12)/(2/(-4)). Let o be (-3)/4 - s/(-4). Suppose or = 5r - 8. Calculate the greatest common factor of 2 and r. 2 Let a(h) = -h - 5. Let p be a(-8). Let r be p/7 - 146/14. Let q(v) = -8v + 15. Let o be q(r). What is the greatest common divisor of 38 and o? 19 Let v = 176 + -99. Let r be 33/v - (-134)/14. Let q be (r/(-4))/(9/(-54)). What is the greatest common factor of 15 and q? 15 Let m(i) = -2i - 13. Let q be m(-7). Let l be (-4110)/(-24) + q/(-4). Suppose 4w - 59 = 17. What is the greatest common factor of w and l? 19 Let n(f) = f*3 - 7f*2 - f + 5. Let i be n(7). Let p be (-2 - -3)(-2)/i. Let k be (13 + -2)1/p. What is the greatest common divisor of k and 22? 11 Suppose 5v - 197 = 5k - 2, 2k + 83 = 3v. Let g = 67 + k. Suppose -18 = -m + 4. What is the greatest common divisor of m and g? 11 Let d(v) = -7v + 51. Let q be d(-17). What is the highest common divisor of 527 and q? 17 Let w = 12 - 25. Let f = w + 23. What is the greatest common factor of f and 30? 10 Let c = 34 + -20. Suppose -z + 20 = c. Calculate the highest common factor of 6 and z. 6 Suppose 253m = 245m + 312. Calculate the highest common factor of 819 and m. 39 Let u be (-6314)/(-533) + (-2)/13-1. Suppose -2q = -5k - 130 + 19, 105 = 2q - 3k. What is the greatest common divisor of q and u? 12 Suppose -s - 139 = -r + 5r, 2s = r + 46. Let z = r + 38. Let k be 133/z - 1/2. Calculate the greatest common factor of 6 and k. 6 Let z(n) = -10n + 24. Let v be z(-8). Suppose -14 - 12 = -2o. What is the highest common divisor of o and v? 13 Let f(h) = h3 + 14h*2 + 5. Suppose -3u - 24 = -3l, 3l = -u + 8 - 24. Let v be f(u). Calculate the highest common divisor of 45 and v. 45 Suppose -6l + 5l = 53. Let y = -37 - l. Calculate the highest common divisor of 4 and y. 4 Suppose 38b - 4o = 36b, -5b + 3o = -35. What is the highest common factor of 15 and b? 5 Let m(a) = -2a - 2a3 - 3a*2 - 5a*2 + 4 + 8a. Let r = 12 + -18. Let n be m(r). What is the highest common factor of 14 and n? 14 Suppose 2a - 2p - 126 = -2a, 4p = 3a - 102. Suppose -q + l - 7 = -0, l + 5 = -q. Let f be 1120/aq/(-4). Calculate the greatest common factor of 8 and f. 8 Let t(a) = 44a - 2. Let w be t(1). Calculate the greatest common factor of 42 and w. 42 Suppose -8m - 22 = s - 13m, 0 = -3m + 15. Calculate the highest common divisor of 33 and s. 3 Let g = 3 - -11. Let d be (-1)/2 + 1547/g. Suppose 0 = -2u + 27 + 17. What is the greatest common factor of d and u? 22 Let b(s) = s2 + 1. Let r be b(-1). Let i = r + -14. Let d = -7 - i. What is the highest common factor of 2 and d? 1 Let t be (12/(-10))/((-57)/(-190)). Let d be 52/20 - t/10. Suppose g - 1 = do + 12, 0 = o - 4. What is the highest common factor of g and 5? 5 Let s be -6 + -3 + (67 - 7). What is the highest common factor of 17 and s? 17 Suppose c + 0 + 1 = 0, -3c = 4k - 117. Suppose m + m = 40. What is the highest common divisor of m and k? 10 Suppose 0 = -3k + 15, 5u = -3k - 524 + 2339. What is the greatest common divisor of 90 and u? 90 Suppose 14 = -5h - 11. Let g be (40/h)/(4/(-30)). What is the greatest common divisor of g and 15? 15 Suppose -r + 4s + 14 = -2, 0 = 5r - 4*s - 80. Let d = -1 - -5. Suppose -d = n - r. What is the greatest common divisor of n and 36? 12 Su	{ "pile_set_name": "DM Mathematics" }
) = -q*2 - 3q + 1. Let p be l(-1). Calculate the highest common divisor of p and 12. 3 Suppose 0 = -4y + 2o - o + 898, -2 = -o. Let b be (8/10)/(5/y). Suppose 3f = 18 + b. What is the highest common factor of f and 126? 18 Suppose -300 = -4m + 260. Suppose -1 = -4t + 7. Suppose 5o - 94 + 19 = -4k, 3k = to + 62. Calculate the highest common factor of k and m. 20 Let q = -39 + 47. Calculate the highest common divisor of q and 4. 4 Let h be 111(31 - 0). Suppose 4z - h = -89. Let i(n) = 6n2 + 1. Let w be i(1). What is the greatest common factor of w and z? 7 Let c = -12 + -8. Suppose 2n - 93 = 3t, 5t + 3n - n + 155 = 0. Let z = c - t. What is the highest common divisor of z and 22? 11 Let t(l) be the third derivative of -25l4/24 + l3/6 + 2l2. Let p be t(-1). What is the highest common divisor of 39 and p? 13 Let r be 3 + 4 + (0 - -3). Calculate the greatest common factor of 90 and r. 10 Let c(r) = 4r*3 + 3r*3 - 4r3 + r2 - 2. Let h be c(3). Calculate the greatest common divisor of h and 8. 8 Suppose 2q - 36 = -0q. Let j = 11 - 11. Let b be 147 + j/3 + -3. Calculate the highest common divisor of q and b. 18 Suppose -5q = -56 - 24. Suppose -4a - q = 0, -5p + 2a = -0 - 18. Suppose 3v = 8 - p. What is the highest common divisor of 2 and v? 2 Let k = 16 - 7. Calculate the greatest common divisor of k and 18. 9 Let s be (5 - (-3)/1) + -2. Let z be (-69)/(-4) - (-6)/8. What is the highest common factor of s and z? 6 Suppose -5k = -8k + 12. What is the greatest common divisor of k and 10? 2 Let m(v) = v3 + v2 + v + 24. Let q be m(0). Suppose 0 = 2l + 2l - q. What is the greatest common factor of 18 and l? 6 Let c be (-82)/(-4) + (-12)/8. What is the highest common divisor of 57 and c? 19 Let w = 6 + -4. Let n be 596/20 - w/(-10). What is the greatest common divisor of 10 and n? 10 Suppose 2k = 172 - 22. Calculate the highest common divisor of 15 and k. 15 Suppose -4m - 5z + 2z = -81, 5m - 106 = z. What is the greatest common divisor of 21 and m? 21 Let a(w) = w*3 - 4w*2 + 2w - 1. Let n be a(4). Calculate the greatest common factor of 49 and n. 7 Let c(d) = -2d2 - 5d - 2. Let x be c(-4). Let f = x + 23. Let a(m) = -m3 - m2 - 7m - 13. Let k be a(-4). What is the greatest common factor of k and f? 9 Suppose 5s + 3f - 194 = 0, 3s + f - 125 + 7 = 0. What is the highest common factor of 20 and s? 20 Let y = 0 + -8. Let p be (-179)/(-4) + (-2)/y. What is the greatest common divisor of p and 15? 15 Let o be 3/1830. Suppose 2z + 2z - x - 36 = o, -3x = 0. Let r(c) = c2 + 72. Let t be r(0). Calculate the highest common factor of z and t. 9 Let o(j) = 2j - 3. Let r be o(7). Let b = r - -25. Calculate the greatest common divisor of b and 9. 9 Suppose 4t + 0t = 4g + 20, 5g + 10 = 0. Calculate the greatest common divisor of 3 and t. 3 Let w be 32/(((-8)/20)/(-1)). What is the greatest common divisor of w and 8? 8 Suppose -5x = -p - 17, 3x - 13 = -2x - p. Let y = 58 - x. Suppose 5u - y = -5f, -u - 31 = -3f - 3u. Calculate the greatest common factor of f and 18. 9 Suppose 5j + 3h - 891 = 0, 3j + 5h = 6j - 555. Calculate the greatest common divisor of 12 and j. 12 Let y(j) = -j*2 - 8j - 10. Let q be y(-6). What is the highest common factor of 5 and q? 1 Suppose -22 = -2d - 4o, -3d - 7o = -2o - 30. Suppose -4i = -3z - 0 - 4, di + z - 5 = 0. What is the greatest common factor of 1 and i? 1 Suppose -271 + 31 = -15f. Calculate the greatest common factor of f and 144. 16 Suppose 5w = w + v + 177, 0 = 5w - v - 221. Calculate the highest common factor of 4 and w. 4 Let a be (6/1)/((-9)/6). Let w be 6/a-61. Let d = 13 + w. Calculate the greatest common factor of 2 and d. 2 Let q(l) = 8l + 3. Let m be q(-2). Let d = 22 + m. Suppose -4 = -3n + 5h + d, 0 = 2n - 4h - 10. Calculate the highest common factor of n and 1. 1 Suppose 16 = 2i + 14. What is the highest common divisor of 7 and i? 1 Let t = 5 + -2. Suppose -4s - 34 = -tn, 2n + 0n + s - 41 = 0. Calculate the highest common factor of n and 18. 18 Let r = -7 + 10. Let x = 6 + 6. Suppose -x = -0m - m. What is the greatest common factor of r and m? 3 Let z = -338 + 490. Let q be z/56 - 4/(-14). Let t be 286/8 + q/12. Calculate the greatest common divisor of t and 54. 18 Suppose 4g + 3o = 25 + 25, 0 = 2g + o - 26. Suppose 0 = -4y + g + 14. Let t = 15 + -1. What is the greatest common divisor of y and t? 7 Let w be 1/2 + 22/(-4). Let s be (-1)/(-5) + 1/w. Suppose g - c - 25 = s, -3c + c = 5g - 139. Calculate the greatest common divisor of 3 and g. 3 Let o be ((-2)/4)/((-7)/42). Suppose -24 = -f - of. Let t be 340/f - 3/(-9). Calculate the highest common factor of 19 and t. 19 Let w(g) = g2 - 3g - 4. Let q be w(4). Suppose 4s = -3y + 12, s + qs = -y + 4. Suppose 7n - yn = 3. What is the greatest common factor of n and 7? 1 Let l be (-1364)/(-24) + 3/18. Let n(w) = -14w + 3. Let q be n(2). Let x = q + l. Calculate the greatest common factor of x and 4. 4 Suppose -r + 8 = -0r. Let u = -13 - -10. Let o = u - -11. Calculate the greatest common divisor of o and r. 8 Suppose 0v = -4v + 1672. Calculate the greatest common factor of v and 38. 38 Let b(h) = 6h*2 + h - 2. Let i = -4 + 2. Let w be 2(-2 - (i - -1)). Let p be b(w). Calculate the greatest common divisor of p and 4. 4 Suppose -75 = -6k + k. Let u be (24/(-5))/((-2)/k). Calculate the highest common factor of 24 and u. 12 Let w be (-3)/(12/(-464)) - -1. Calculate the highest common divisor of w and 13. 13 Let k = -31 + 61. Suppose 0 = -0x + x - k. What is the highest common factor of x and 75? 15 Let a = 12 + -7. Suppose -aw + 4n + 37 = -40, -2n = -5w + 71. Let v = -53 - -92. What is the greatest common factor of v and w? 13 Let a be ((-48)/(-15))/(16/(-20) + 1). What is the highest common divisor of 128 and a? 16 Suppose -5h + 17 = -58. Calculate the greatest common factor of h and 45. 15 Suppose 2d - 1 = 3. Suppose 7 - 3 = 4a. Calculate the highest common divisor of d and a. 1 Let f = -45 - -59. Calculate the highest common factor of 56 and f. 14 Suppose -2l + 4a = -6l + 108, -l + 3a + 15 = 0. Suppose 0 = 3r + r - 32. Calculate the highest common factor of l and r. 8 Let l = 89 - 49. Calculate the greatest common divisor of l and 16. 8 Let l(x) = x*2 + 4x + 5. Let n be l(-4). Let y = -5 - -6. Let z be ((-12)/(-15))/(y/n). Calculate the greatest common factor of 8 and z. 4 Let w be 1 - (1 + -3 - 7). Suppose -2g + w = -3i, -g - 5i + 4 + 1 = 0. Suppose 80 = -0j + gj. What is the highest common factor of j and 16? 16 Suppose 2a - c = 20, -2a + 8 = -c + 3c. Suppose -a = -2k - n, -2n + 13 = k + 3n. Suppose 280 = kt - t. What is the highest common divisor of t and 20? 20 Let m(h) = -11h - 4. Let z be m(-2). Calculate the greatest common divisor of 144 and z. 18 Suppose -5l + 0i + 5i = 5, -2i = 5l + 26. Let j be l/10 + 44/10. Suppose 0 = 3d - jd + 25. What is the highest common factor of 10 and d? 5 Let r be (23 - -2) + 5/(-5). Calculate the greatest common factor of 12 and r. 12 Let c(s) = 7 - s*2 + 4 + 4s + 3s. Let y be c(8). Suppose -86 = -5r + 34. Calculate the greatest common divisor of y and r. 3 Let m = -61 - -86. Calculate the highest common factor of 200 and m. 25 Let r be 8/(-36) + 272/9. What is the highest common divisor of r and 3? 3 Suppose -50 + 75 = 5o. What is the greatest common factor of 15 and o? 5 Let i(l) = l2 - l + 30. Suppose m - 15 = 3p + 6m, 2m + 6 = -p. Let r be i(p). Calculate the greatest common divisor of 10 and r. 10 Let x = -163 - -307. Calculate the greatest common divisor of x and 18. 18 Let n(b) = -5b2 + b + b3 - 3 - 4b - 3b3. Let a be n(-3). Suppose -l + 6 = -a. Calculate the greatest common divisor of l and 14. 7 Let v be (-10)/3(-3 + 0). Suppose 0 = -x - x + v. Let p be (-141)/(-9) - 2/3. What is the greatest common factor of x and p? 5 Let t(q) = 3q2 - 2q - 3. Let i = 8 + -5. Let n be t(i). Let k be 150/n + (-1)/3. What is the greatest common factor of k and 56? 8 Let o(y) = y*3 - 5y*2 - y - 3. Let n be o(6). What is the greatest common factor of 297 and n? 27 Let x(v) = 9v - 42. Let j be x(6). What is the highest common factor of 348 and j? 1	{ "pile_set_name": "DM Mathematics" }
et b(k) = -3k - 2. Let g be b(f). Solve -2y - 4u = 16, -2u = -0y + 3y + g for y. -4 Let o = -2 + -2. Let s = 11 + o. Suppose 0 = -sq + 2q. Solve 5y + 15 = q, -4y - 9 = -5x - y for x. 0 Let a be 54/(-30)-3. Let p = 7 + -5. Suppose j - i = 6j - 16, pi - 12 = -5j. Solve 5m = f + 1, 2m + am - jf = -12 for m. 1 Suppose 12r - 11r = 3. Solve 0 = -rk + 5j, k = 4k + 5j for k. 0 Let j(f) = 3f - 3. Let y be j(4). Let a = 13 - y. Let h be a3/31. Solve 0 = -0r + 2r - hm, 4m - 8 = -2r for r. 2 Suppose j + 10 = 22. Solve -6p - 9 = -3p - 5r, 0 = -4p - 3r - j for p. -3 Let x(n) = -n2 + 6n. Suppose 2f = -2, -2z - f = -3z + 7. Let b be x(z). Solve 2a = u + 1, -2u - 3u + 5 = b for a. 1 Suppose 3q = -2c + 22, -c + 2c + 11 = 4q. Solve cp - 3f = -20, 3p - 3f + 7 = -11 for p. -1 Suppose -x = -m - 4, 7x - 2x = -2m + 6. Solve -xw = -3p + 10, 7w - 4w - p + 15 = 0 for w. -5 Let u(k) = 3k*2 + 3k - 2. Let s be u(1). Suppose 5g + s - 29 = -3b, -2b = 3g - 15. Solve -2v - 2 = b, l - 2 = v + 1 for l. 2 Let g = 23 + -18. Solve -2y + d + g = 0, 2y = -2d - 2d - 10 for y. 1 Let s be 2 + 1 - (-32 - 5). Solve 2x - 4u + 0 = 26, 5u + s = 4x for x. 5 Let k = 9 - 7. Suppose 0 = -6u + u - 2h + 19, 4u - 5h - k = 0. Solve -4d + 0q - 2 = 2q, 34 = -ud + 5q for d. -3 Suppose -4d + 7 = -c, -5d + 2c = 8 - 13. Solve 2l - 16 = -4r, 2l - r + 6 = dl for l. 4 Suppose 5v + 0v - 80 = 0. Solve 5y = 15, 5w - 5y - 1 = -v for w. 0 Let b be (3/9)/((-7)/(-63)). Solve 4z - 22 = -l, -12 - 9 = -3z - bl for z. 5 Suppose 3s - 2k - 3 = -7, -3k = 4s - 23. Let i be (5 + -2)(s + -1). Solve 11 = -5r - ig + 2g, 0 = 2g + 2 for r. -2 Let n = 3 - 0. Solve t + n = -2i, 4t - 3t = 3 for i. -3 Suppose 0k + 2k = -8. Let w = k + 7. Suppose -5u - 60 = -10u. Solve 5d + 5s = -15, ws + 0s + u = -4d for d. -3 Let u be 8/48 - ((-22)/12 - 0). Solve -5h - 28 = -h - ug, 4g = -2h + 6 for h. -5 Let n(u) = u*2 + 8u + 11. Let s be n(-7). Solve -sb - 5r + 1 = -0r, 0 = 3b - r - 15 for b. 4 Let f be -4 + -1 + (4 - 0). Let r(z) be the second derivative of 5z4/6 + z2/2 + 4z. Let b be r(f). Solve b = 2o + 3m, -4o - 5m + 18 = -o for o. 1 Suppose 2j - 7 = -l, 0 = -2l + 4l - 4j - 6. Suppose -lw + 34 = -26. Suppose 0 = -8f + 4f + w. Solve 2k = -y - 8, fk - 1 = y + 4y for y. -2 Suppose 0 = z - 4, 5x + 2z - 28 = 0. Solve -9 = xu + i, 4i + 11 = -3u - i for u. -2 Suppose -4i + 25 = i. Let v(u) = u - 1. Let f be v(i). Let j be 8/36/f. Solve 0 = -2g + 2t + 2t + j, 4 = -4t for g. 0 Let o(s) = 21s - 13. Let m be o(9). Let v = -111 + m. Suppose v = 3p + 2p. Solve 5h - p = -4k, 5h - 31 = k + k for h. 5 Suppose 2b - 1 = -5. Let s be 7 - ((3 - 2) + b). Solve -s = -r + 4r - 2u, r = -u - 1 for r. -2 Suppose -2w - 2v = -w, 5w = -4v. Solve -3x + 4q + 2 + 0 = w, -4q - 8 = 0 for x. -2 Let u be 2 + 62/4. Solve 4f + 2p = 5p - 7, -7 = uf - 2p for f. -1 Suppose -5i + q + 14 = 0, -5i = -0q - 2q - 18. Solve -3k - 3 = ij - 5j, 0 = 3k - 9 for j. 4 Let y be -2 + 1 + 21 + 4. Let l = y + -19. Solve n + 4d + 3 = -0, -ln = -4d - 9 for n. 1 Let x be 13/3 + 2/3. Let g = -3 + x. Suppose 2 - 2 = 8o. Solve gc + 45 = -3c - 5v, -2v - 10 = o for c. -4 Suppose -22 + 54 = 4b. Suppose 0 = 5j - b - 2. Solve -jw = -5d - 6, -4d = 2w + 3 - 9 for w. 3 Let f(l) = 3l + 1. Let y be f(1). Suppose 0 = g - 4g. Let s = g + y. Solve -2q + 4 = 0, -3q = 4k - s - 10 for k. 2 Let p = 0 + 5. Solve q - 4r = 2, -pr + 3r - 2 = -q for q. 2 Let m(x) = 3x - 15. Let p be m(6). Solve -3t + 5l + 23 = 0, -5t - pl - 2 = 5 for t. 1 Let t(h) = h*3 + 6h*2 + 5h. Let p be t(-5). Suppose 0 = c - 2, -26 = 2y - 3y + c. Solve 0 = 4q + 5b - y, p = -0q + 5q - b - 6 for q. 2 Let m be -1 + 5 + (-3)/(-3). Let d = -17 - -43. Solve -3l = -mv + d, -v + 2l = 4v - 24 for v. 4 Let o = -35 + 68. Solve 2j = h - 5, -5h - 8 = 2j - o for j. 0 Suppose -3b + v + 4 = 0, 3v + 0 = 4b - 7. Let a be b + 3/(6/2). Suppose 0g - a = -g. Solve -gj = c + 2c + 21, -20 = 4c for j. -3 Let b(g) = -g + 1. Suppose -4d - 11 = -31. Let z be b(d). Let n = -2 - z. Solve v + 7 = nf, -5f + 4v + 15 = -v for f. 4 Let x = -11 + 14. Solve -u + 6 = 2v - x, 0 = -2v + u + 7 for v. 4 Suppose -s - 3 = 0, -7s + 5 = 5w - 2s. Solve -5k - 2g + 2 = 0, k = -3k + wg + 24 for k. 2 Let g be -42(-5)/10. Solve 3i - 3 = gi, 0 = 5n - 3i - 19 for n. 2 Let s(x) = 2x2 - x - 1. Let j(u) = -u2 + u + 1. Let o be j(-1). Let r be s(o). Solve 6g + rc + 15 = g, -g - 25 = -4c for g. -5 Let w(r) = 2r + 30. Let f be w(-13). Solve 3b - 23 = fn, n = b - 0n - 7 for b. 5 Let t(i) = i + 1. Let s be t(5). Let l(q) = q2 - 7q + 9. Let b be l(s). Solve 0 = -m - m + g - 4, -3g = bm + 24 for m. -4 Let x = 36 + -33. Solve 5u + xf = -16, 4u = 3f - f - 26 for u. -5 Let c = -5 - -9. Suppose 4w + 1 - 9 = 0. Suppose -16 = -wy + 44. Solve -2b - 2p + 13 - 33 = 0, 0 = cb + 2p + y for b. -5 Let b(f) = f*3 - 2f*2 - 4f + 4. Let t be b(3). Let d = t - -4. Let r be 209/22 + 2/4. Solve -do - 5s + r = 0, -5o + 4s = 2s - 24 for o. 4 Suppose 4x + 2p = 6, 0x + 9 = 4x - p. Suppose x + 10 = 2k. Let t = k - 2. Solve -h = to - 21, 5h = -0h + o for h. 1 Let d(m) = -m2 - 17m - 25. Let r be d(-15). Solve 5y = rf - 25, 3y + 0 = -2f - 15 for f. 0 Let b(v) = 4v2 - v + 1. Let k be b(1). Suppose -2t + k = -0t. Suppose -3n + 12 = 2w + t, 5n - 5w = 0. Solve -nl = -3c, -5c + 0c + 16 = 2l for l. 3 Let m(r) = r*3 + 4r*2 - 5r - 3. Let n be m(-5). Let o(i) = -13i - 6. Let t be o(n). Solve t = 3j + 5q - 4, -3q + 15 = 0 for j. 4 Let x(b) = -8 - 4b + 0b - 4b - b2. Let m be x(-6). Suppose 5j = 2j - 2o + 54, 3j + 4o - 48 = 0. Solve -3f - 4 = ma, -a + j = a - 4f for a. 2 Suppose -5t = -4j + 25, 3t - j + 22 = -0j. Let r be (-16)/64 + t/(-4). Let z = -1 - -4. Solve -2f + 0n - zn = 11, -rf = n + 1 for f. 2 Let l be 155/55 + (-2)/(-11). Suppose -d + lk = -15 + 5, -3d = k. Solve -d = -2i - y, 4y - 2 = -3i + 3y for i. 1 Let s be (-11 + 2)1/(-3). Suppose -a + 3 + s = 0. Solve -c - 5q + 3 = -a, -4q + 12 = 2c for c. 4 Suppose 4h + 0w = 2w + 10, 1 = h - w. Solve 2i - 6 = hi, 0 = -4z - 5i + 1 for z. 4 Let v(c) = -c*2 + 2c + 3. Let k be v(3). Let h = k - -5. Suppose -hn + 18 = -2. Solve -3d + 2b = 3, 0 = -d - b + 3 - n for d. -1 Suppose 0 = j + 2 - 13. Suppose 9 = -7d + 4d. Let c be -3 - (3 + d + -5). Solve 5t - 4x + j = 0, 13 = 4t + t + cx for t. 1 Let c = -3 + -7. Let o = -7 - c. Solve -4h + r - 3 = 1, 0 = -4h + or + 4 for h. -2 Suppose -5c + 6c - 4 = 0. Solve -3l + 4w = -5l, 0 = -cl + 4w - 24 for l. -4 Let c(b) = 10b - 17. Let u be c(2). Let p be 1 + -2 + 3 - 2. Solve us = 5h + 32, 4s - 3h = -ph + 28 for s. 4 Suppose -10t - 23 = -11t. Solve 3v - t = -5g, 0g = v - g + 3 for v. 1 Let y = 85 - 82. Solve 3o - yl + 3 = 0, -5o - l - 5 = 12 for o. -3 Let y(w) = -w + 1. Let v be y(-3). Suppose 15 = vt + 7. Solve -5u = 5s + 10, ts - 3s - 10 = 5u for u. -2 Let g be (-2)/10 - 168/(-40). Solve 0 = x + 4s + 14, -gs = s + 20 for x. 2 Let q = 74 - 72. Solve -2i = 4, -qi + 5 = 3b - 0b for b. 3 Suppose 3l + 3 = 0, 4l + 4 = -4m + 20. Solve -r = mq + 25, -3r + q - 20 = 5q for r. 0 Let o(c) = c3 - 5c*2 - 3c - 4. Let m be o(6). Let d = m + -10. Solve -h + 4x = -5h + d, -5x = -h - 29 for h. -4 Let t(n) = n3 + 7n*2 + 6n - 1. Let f be t(-6). Let a = -1 + f. Let v = 10 + a. Solve 4q = 5s - 36, 2q - v = 5q + s for q. -4 Let r(s) = -s + 3. Let u be (-10)/(-45) + (-4)/18. Let f be r(u). Solve -3k = -i + 2i + 3, 5i + fk = -3 for i. 0 Suppose -4a + 4 = -5u + 4u, -2a - 16 = -5u. Solve -c - ax + 0 = 2, 0 = -3c - 5x - 4 for c. 2 Let o(c) = c - 1. Suppose -3b = b - 12. Let n be o(b). Solve 13 = -5u - 2y + 5, 2 = ny for u. -2 Let v(x) = x + 8. Let d be v(-5). Solve 0o = -o, 3b - d = -4o for b. 1 Let q be (1/(-1) - 1) + 9. Let r = -3 + 15. Suppose qc - r = 3c. Solve -4u - t - 2t = -4, 8 = 5u + ct for u. 4 Suppose -v + 0v = -7. Suppose -2a + va = 20, 0 = -s + a - 4. Let u be (-4)/(-6) - (-21)/9. Solve k = uh - 8, -k - 1 = 4h - s	{ "pile_set_name": "DM Mathematics" }
) -3/5 (d) -6/13 (e) -2 c Let y = 0.04836 - -0.45164. What is the smallest value in 0.07, 1/18, y, -1? -1 Let v be (-2450026)/(-126) - 14/63. Let q = v - 19556. Let n = -112 - q. What is the third biggest value in -4, n, 0.06? -4 Suppose g = -321u + 324u - 17, 35 = u - 4g. What is the second smallest value in -51/47, u, -3? -51/47 Suppose 41q - 38q + 3i - 891 = 0, 2i + 14 = 0. What is the second smallest value in -0.3, q, -6? -0.3 Let u = 0.0591 + -1.0591. Let p(r) = -r3 + 4r*2 + 2r - 5. Let y be p(4). Let a be 1/y - 42/45. What is the third biggest value in a, u, -3/8? u Let s be ((-13)/(-6 - -32))/(10/(-4)). Let z = -19.13 - -19. Let r = 4.87 - z. Which is the smallest value? (a) -1/6 (b) r (c) s a Let u = -75.7 + 76.2. Let v(s) = s*3 + 8s*2 - s - 8. Let y = 3 - 11. Let d be v(y). Which is the third biggest value? (a) d (b) 4/3 (c) u a Let o = 270465932/252790245 - 14/289565. Let d = 423797/97 - 4369. Let z = o + d. Which is the smallest value? (a) z (b) 5 (c) 3/2 a Suppose 4 = 146d - 144d. Let w(f) = 2f - 7. Let q(t) = t - 8. Let l(i) = -3q(i) + 2w(i). Let k be l(-10). Which is the smallest value? (a) 3 (b) k (c) d b Let c be 0/((-48)/(-96) + 6/(-4)). What is the second smallest value in -16, 0.03, c? c Let x = 3 - 2. Let j = 2.18 - 89.18. Let m = j - -86.5. What is the biggest value in m, x, -2/11? x Let w = -3.724 + -0.276. Let h be ((-15)/20)/(5/20 + -2). Let t = 0.99 + 0.01. What is the fourth smallest value in 0.5, w, h, t? t Let m = 17.423 - 0.023. Let j = m - 17.3. Suppose -5d = y - 0y, -5 = -y. What is the biggest value in j, d, 9? 9 Let a be 2/(-7) + (-3)/63. Let o = -26463 - -26455. What is the second smallest value in o, -6, a? -6 Let o = -5 + 1. Let z = 230 - -93. Let v = 325 - z. Which is the biggest value? (a) o (b) 14 (c) v b Let w = -2939/3 - -20564/21. Which is the biggest value? (a) 4 (b) 9/2 (c) w b Let o = -1.25 - -1.76. Let g = o - 0.91. Let q = 6.7 + -10.7. Which is the third smallest value? (a) q (b) 2 (c) 5 (d) g b Let z = 1279 + -1279.3. Let t = -767/60 + 51/4. Which is the third biggest value? (a) z (b) -3 (c) t b Let n = 55.52 - 6.42. Let m = n - 51.1. What is the second smallest value in 6, 1/4, m, -6? m Suppose 2r - f + 13 = -4f, -f = 1. Let c = 5693 - 17588/3. Let x = 170 + c. What is the smallest value in r, x, -4? r Let p be -6(-1)/3-10. Let h be 86/p - (-2)/(-4). Let v = -187322 - -187323. Which is the second biggest value? (a) v (b) h (c) 3/8 c Let x = -4.254 + 5.254. Which is the second biggest value? (a) 1018 (b) x (c) 0.4 (d) 0.3 b Let u = -7816.24 + 8520. Let h = u + -704. What is the smallest value in h, 0.2, 3? h Suppose 2v - 29 = 3. Let c = v - 18. Let p = -17.2 - -18.2. What is the second biggest value in p, c, -1/4, 4? p Let p = 446.6 - 411. Let j = 36 - p. What is the second biggest value in -0.6, j, 2/17, -2/3? 2/17 Let g = -171.6 + 176.6. Which is the second biggest value? (a) 0 (b) 0.9 (c) g (d) -4/9 (e) -9 b Let m = -63.905 - -60.7. Let w = 0.205 + m. What is the second smallest value in 0.06, w, -0.5, 1? -0.5 Let x = 5513 + -6531. What is the smallest value in 0.4, 1/2, x? x Let p = -242.06 + 242. Suppose 0 = -u - 7 + 5. Let x be u/4 - 46/(-76). Which is the biggest value? (a) 2/7 (b) x (c) p a Let k = -254.2 - -255. Let v = 46 + -46.1. What is the third smallest value in -1, v, k? k Let f(l) = 2l + 20. Let g be f(15). Let y be (1/(-3))/(g/(-270)). Let z = -21 + 21.1. Which is the second biggest value? (a) z (b) -2/9 (c) y a Let q = -4/9 - 7/45. Let t be 6 + 244/(-40) - 8/70. What is the second smallest value in 0.3, q, t? t Let w = 171 - 169. Suppose -wt + 36 = 50. Which is the third smallest value? (a) t (b) 0.3 (c) 1 c Let p = -82 + 210. Let v = p + -127.6. Which is the fourth biggest value? (a) 1.1 (b) 2/7 (c) -5 (d) v c Let m = -2.6587 + -0.3413. What is the second biggest value in 1/4, 1, m, 321? 1 Let p = 72799/3 + -24267. Let g(s) = 3s*3 - s. Let u be g(-1). Which is the biggest value? (a) 4 (b) p (c) 19 (d) u c Let k = -7 + 6.88. Let g = -4.12 - k. Let v = 160/7 + -23. Which is the second smallest value? (a) v (b) 0.3 (c) g (d) 2 a Let z be (-32)/(-256)(8 - 12). What is the smallest value in z, 4/19, 0.2, -4? -4 Let p = -15779.06 - -15779. What is the second biggest value in -1/7, p, -0.2, 2/7? p Suppose -4g - 5h - 2 = 38, -52 = 4g + 2h. What is the third biggest value in g, 2/23, 2/7? g Let g = -0.11 + 1.91. Let u = -2.8 + g. Let p = 1.5 + u. Which is the third biggest value? (a) p (b) 3 (c) -2/7 c Let g = 785/4 + -195. Let w = -2.4 - -8.4. Let p = -6.4 + w. What is the biggest value in -2/3, 2/7, p, g? g Let a be ((-15387)/(-690))/(2/4). Let j = a - 2909/65. What is the third biggest value in j, 0.4, -2, -5? -2 Let g be (-2)/4 - 14/(-30). Let x = 2.970223 + 0.029777. Which is the second smallest value? (a) x (b) g (c) 0.2 c Let t = -9757/5 + 1951. Which is the second smallest value? (a) 0.127 (b) 1/3 (c) -0.1 (d) t (e) -6 d Let b = 19.74 - 19.24. What is the second biggest value in b, -1, -863? -1 Let o = -3.1 - -148.1. Let t = -145.3 + o. Which is the fourth smallest value? (a) t (b) -1 (c) 1 (d) -4/5 c Let f = 13 - 12.8. Suppose -10i - 18 = -8i. Let o be (i - 140/(-16))/((-1)/4). Which is the smallest value? (a) 2 (b) f (c) 4/9 (d) o b Let i = 28092 + -28089. What is the smallest value in i, 12/5, 1.87? 1.87 Let i = 64274 + -64307. Let d be (-2)/(-6)3/4. What is the second biggest value in d, 0.1, i? 0.1 Suppose 133 = -5o - 2h, -3o - 86 = -13h + 8h. Let m be (-492)/(-864) - (-12)/o. Let b = -2 + -3. What is the third biggest value in m, b, 8? b Suppose -4l + 13 = -27. Suppose -2 = -lo + 11o. What is the smallest value in o, 2/55, -0.3, -0.1? o Let s(d) = -d3 - 13d2 - d - 193. Let h be s(-14). Which is the second smallest value? (a) h (b) -10/11 (c) -1 b Let f = -392 + 643. Let g = 253 - f. What is the fourth biggest value in 5, -1, g, -3/4? -1 Let h = -1055.9 + 1060. What is the third smallest value in 2/7, -2, h, 3? 3 Let n(y) = -y2 - 71y + 470. Let i be n(6). What is the third biggest value in i, -3, 1, 81, -1/6? 1 Let s = 15399 + -15401. Which is the fourth biggest value? (a) 3 (b) s (c) -0.3 (d) 4 (e) -215/6 b Let i = 9.09 - 9.5. Let b = i + 0.01. Let q be (3/(-6))/((-36)/(-72)). What is the fourth smallest value in 5, q, -3, b? 5 Let u = -6618 + 6618.5. What is the fifth biggest value in u, -2/13, -1, -0.4, -1.77? -1.77 Let k = 423 + -428.2. Let g(a) = a3 + 3a*2 - 6a - 7. Let l be g(-4). What is the biggest value in l, k, 0? l Let p(m) = -7m + 45. Suppose 0d = -39d + 312. Let x be p(d). Which is the third smallest value? (a) -2/5 (b) 1 (c) x b Let h = 1249 - 4995/4. What is the fourth smallest value in 6, 0.3, h, 2/5, -0.4? 2/5 Let p = -9089 - -9083. What is the fourth biggest value in p, 0.3, -3/19, -0.4? p Let q be (1 + -4 + 2)-2. Suppose -28 + 20 = qi. What is the third smallest value in -1, 2, i, -2? -1 Let o = -2364.1 + 2363.7. Which is the fourth smallest value? (a) -4/5 (b) -5 (c) o (d) -16 c Let m = 27.71 + -29.71. What is the third biggest value in 1, -2/5, 0.03, m? -2/5 Let v = -26 - -22.8. Let m = v - -3. Let l be (1/9)/((-5)/(-15)). What is the third smallest value in -2/13, -0.1, m, l? -0.1 Suppose -2o = 5z - 23, 3z = 107o - 102o - 11. Let q = 477/4 + -120. Which is the second biggest value? (a) q (b) 0.2 (c) 3 (d) o c Let p = -10 + 15. Let w be 28/1 - (-584784)/(-20832). Which is the fourth smallest value? (a) -4/7 (b) w (c) p (d) -1/6 c Suppose -3z = -46c + 48c + 11, -5z = -5c + 35. What is the biggest value in -223, 4, c? 4 Suppose -30q = -66q - 31q - 55q. Which is the fifth biggest value? (a) 9 (b) 0.3 (c) 5 (d) q (e) 3 d Let m = 31.138 + -44.138. Which is the fourth biggest value? (a) m (b) -3/4 (c) 3/11 (d) 0.2 (e) -2/9 b Suppose 9u = 4u + 360. Suppose 56t - u = 54t. Let h be (-24)/(-6) - t/10. What is the second biggest value in h, 1/9, 0.5, 4? 0.5 Suppose 98 = 2o + 3u + 303, u = -3o - 311. Let v = 89 + o. Let n be (-2)/30*45/v. What is the second biggest value in n, 7, -1? n Let m be (2/6)/(3/12). Let j = 109.0271 - 0.1271. Let p = j - 113.9. Which is the	{ "pile_set_name": "DM Mathematics" }
third root of 2605460 to the nearest integer? 138 What is 45446 to the power of 1/5, to the nearest integer? 9 What is 15777100 to the power of 1/3, to the nearest integer? 251 What is the cube root of 2870324 to the nearest integer? 142 What is the square root of 3091955 to the nearest integer? 1758 What is the cube root of 2349559 to the nearest integer? 133 What is the square root of 305897 to the nearest integer? 553 What is 2041446 to the power of 1/2, to the nearest integer? 1429 What is the ninth root of 8193 to the nearest integer? 3 What is the third root of 4320491 to the nearest integer? 163 What is the third root of 4295810 to the nearest integer? 163 What is 169694 to the power of 1/10, to the nearest integer? 3 What is 1423525 to the power of 1/2, to the nearest integer? 1193 What is 79885 to the power of 1/2, to the nearest integer? 283 What is the square root of 200712 to the nearest integer? 448 What is 168974 to the power of 1/7, to the nearest integer? 6 What is 642873 to the power of 1/2, to the nearest integer? 802 What is the third root of 22919852 to the nearest integer? 284 What is the seventh root of 505896 to the nearest integer? 7 What is 384549 to the power of 1/9, to the nearest integer? 4 What is the square root of 3580533 to the nearest integer? 1892 What is 7796349 to the power of 1/6, to the nearest integer? 14 What is the sixth root of 2980438 to the nearest integer? 12 What is 16421446 to the power of 1/3, to the nearest integer? 254 What is 19396 to the power of 1/2, to the nearest integer? 139 What is the tenth root of 7139583 to the nearest integer? 5 What is the eighth root of 119122 to the nearest integer? 4 What is the fourth root of 92222 to the nearest integer? 17 What is the seventh root of 1091347 to the nearest integer? 7 What is the square root of 1140441 to the nearest integer? 1068 What is the seventh root of 363479 to the nearest integer? 6 What is 8914937 to the power of 1/9, to the nearest integer? 6 What is the fifth root of 15202255 to the nearest integer? 27 What is 350044 to the power of 1/3, to the nearest integer? 70 What is 235344 to the power of 1/4, to the nearest integer? 22 What is 3363853 to the power of 1/2, to the nearest integer? 1834 What is the tenth root of 609085 to the nearest integer? 4 What is the cube root of 404632 to the nearest integer? 74 What is 27676018 to the power of 1/2, to the nearest integer? 5261 What is 2965546 to the power of 1/2, to the nearest integer? 1722 What is the sixth root of 3393777 to the nearest integer? 12 What is 11738901 to the power of 1/6, to the nearest integer? 15 What is 3149672 to the power of 1/2, to the nearest integer? 1775 What is 2912790 to the power of 1/2, to the nearest integer? 1707 What is 3686403 to the power of 1/3, to the nearest integer? 154 What is the square root of 598979 to the nearest integer? 774 What is 516000 to the power of 1/3, to the nearest integer? 80 What is the square root of 4153322 to the nearest integer? 2038 What is the square root of 391389 to the nearest integer? 626 What is 18141 to the power of 1/3, to the nearest integer? 26 What is the square root of 415517 to the nearest integer? 645 What is 26570530 to the power of 1/6, to the nearest integer? 17 What is 70241 to the power of 1/7, to the nearest integer? 5 What is the third root of 631408 to the nearest integer? 86 What is the seventh root of 546327 to the nearest integer? 7 What is 24439846 to the power of 1/3, to the nearest integer? 290 What is the square root of 565225 to the nearest integer? 752 What is 157379 to the power of 1/2, to the nearest integer? 397 What is the third root of 3737257 to the nearest integer? 155 What is the square root of 17086582 to the nearest integer? 4134 What is 122943 to the power of 1/2, to the nearest integer? 351 What is 459462 to the power of 1/2, to the nearest integer? 678 What is 3477124 to the power of 1/3, to the nearest integer? 151 What is 46850 to the power of 1/2, to the nearest integer? 216 What is the cube root of 19088519 to the nearest integer? 267 What is the cube root of 17275288 to the nearest integer? 259 What is 4897750 to the power of 1/3, to the nearest integer? 170 What is the square root of 11385200 to the nearest integer? 3374 What is the square root of 315324 to the nearest integer? 562 What is the sixth root of 207004 to the nearest integer? 8 What is the third root of 12355663 to the nearest integer? 231 What is 1894708 to the power of 1/2, to the nearest integer? 1376 What is 133757 to the power of 1/10, to the nearest integer? 3 What is 1657312 to the power of 1/6, to the nearest integer? 11 What is the cube root of 290065 to the nearest integer? 66 What is the eighth root of 9629277 to the nearest integer? 7 What is the square root of 23101615 to the nearest integer? 4806 What is the third root of 1767211 to the nearest integer? 121 What is 179481 to the power of 1/2, to the nearest integer? 424 What is 2174883 to the power of 1/9, to the nearest integer? 5 What is 49534 to the power of 1/2, to the nearest integer? 223 What is 6840269 to the power of 1/2, to the nearest integer? 2615 What is the square root of 157988 to the nearest integer? 397 What is 299088 to the power of 1/3, to the nearest integer? 67 What is the sixth root of 2449138 to the nearest integer? 12 What is 1698524 to the power of 1/9, to the nearest integer? 5 What is 5282624 to the power of 1/4, to the nearest integer? 48 What is the third root of 7585491 to the nearest integer? 196 What is the third root of 228854 to the nearest integer? 61 What is 7478785 to the power of 1/2, to the nearest integer? 2735 What is 10546635 to the power of 1/2, to the nearest integer? 3248 What is the cube root of 279349 to the nearest integer? 65 What is the cube root of 566039 to the nearest integer? 83 What is the square root of 12376879 to the nearest integer? 3518 What is 317828 to the power of 1/4, to the nearest integer? 24 What is the eighth root of 3479574 to the nearest integer? 7 What is 1642276 to the power of 1/3, to the nearest integer? 118 What is 5229110 to the power of 1/2, to the nearest integer? 2287 What is the ninth root of 8374204 to the nearest integer? 6 What is the square root of 13153679 to the nearest integer? 3627 What is 15892759 to the power of 1/10, to the nearest integer? 5 What is 11961329 to the power of 1/2, to the nearest integer? 3459 What is the square root of 303213 to the nearest integer? 551 What is 16136443 to the power of 1/3, to the nearest integer? 253 What is the fifth root of 7311763 to the nearest integer? 24 What is 10808147 to the power of 1/4, to the nearest integer? 57 What is the third root of 16256185 to the nearest integer? 253 What is the ninth root of 1698543 to the nearest integer? 5 What is the sixth root of 5938844 to the nearest integer? 13 What is the fourth root of 25827162 to the nearest integer? 71 What is 12580389 to the power of 1/3, to the nearest integer? 233 What is 1855159 to the power of 1/2, to the nearest integer? 1362 What is the square root of 14444646 to the nearest integer? 3801 What is 754613 to the power of 1/2, to the nearest integer? 869 What is the cube root of 24676 to the nearest integer? 29 What is 5353078 to the power of 1/9, to the nearest integer? 6 What is 768116 to the power of 1/5, to the nearest integer? 15 What is 89544 to the power of 1/9, to the nearest integer? 4 What is the square root of 5242968 to the nearest integer? 2290 What is the fifth root of 892171 to the nearest integer? 15 What is 634743 to the power of 1/3, to the nearest integer? 86 What is the ninth root of 7695944 to the nearest integer? 6 What is the square root of 511329 to the nearest integer? 715 What is the fourth root of 1045808 to the nearest integer? 32 What is 1038816 to the power of 1/10, to the nearest integer? 4 What is the fourth root of 3234336 to the nearest integer? 42 What is 1299682 to the power of 1/10, to the nearest integer? 4 What is the tenth root of 5155909 to the nearest integer? 5 What is 131985 to the power of 1/3, to the nearest integer? 51 What is 162199 to the power of 1/4, to the nearest integer? 20 What is 1747309 to the power of	{ "pile_set_name": "DM Mathematics" }
/(-10))/((-16)/(-4430)). Let u = 334 + h. Is u equal to 3? False Let c = 0.2347 - -2.0953. Which is greater: c or -2? c Suppose 3q - 75o = -80o - 10, -5q = -3o - 6. Is 1/23 >= q? True Let t = 761 - 480. Are 281 and t unequal? False Suppose 0o + 4o = 4. Let q be o/((-30)/(-4)) - (-4)/20. Which is smaller: q or -1? -1 Let i = 0.0652 + -4.3752. Is i > -0.1? False Let f be (-5)/(-13)(-18552)/(-10). Let m = f - 714. Is m greater than or equal to 1? False Suppose 82t - 243 = 85t. Are t and -81 equal? True Let u = -40/3 - -188/15. Let d = -1 - 0. Which is greater: u or d? u Suppose 3t = -5h + 6t + 26, 0 = 5h - 5t - 30. Is 1 greater than or equal to h? False Let b be ((-10)/25)/(5/75). Which is greater: -26/5 or b? -26/5 Suppose -191u = -188u - 30. Is u less than or equal to -1/3? False Let w = 1370 + -39724/29. Which is bigger: w or 1/7? w Let s be 12 - (-440)/(-352). Is 0.11 at least s? False Let w = 407 - 406.84. Which is smaller: w or -1/3? -1/3 Let r = -75 - -174. Let t be (-2)/9 + 814/r. Suppose -2i - 2a + 26 = 0, -2i + 2a + 2a = -t. Is 11 at most as big as i? False Suppose 4 = s + 3. Let j = 474 - 493. Is s less than j? False Let a be (2/(-5))/(2/80). Which is smaller: -7 or a? a Let u = 2053 - 1899. Which is greater: u or 155? 155 Suppose 19 + 6 = -5y. Suppose 5g + 77 = -4u, 0 = -6u + 5u - 5g - 23. Let a be 179/(-36) + (-4)/u. Is a bigger than y? True Suppose -3o - 4s = 1, s = 5o - s - 33. Suppose 15 = 2q - ok, 5k + 12 = -3q - 3. Are 9/11 and q non-equal? True Let o be (11 - (5 - -4))/((-1)/4). Suppose -5n - 23 = -2y, -2n - 3y + 5y = 8. Which is smaller: n or o? o Let x = 945 - 944. Which is smaller: -1/171 or x? -1/171 Let g = 0.178 + 4.822. Which is greater: g or -0.07? g Suppose -g + 2v + 12 = 0, 5g = -0v + 3v + 25. Let f = -1934 + 21288/11. Are f and g nonequal? True Suppose 3t = -t + 4. Let u(v) = 2v - 1. Let j be u(-1). Let g be j/((-3)/14t). Is 14 != g? False Let b = -205 - -202. Let r = 7 + -20. Is b equal to r? False Let j = 1.57 - -12.43. Let w = 18 - j. Let o = 2 + -1.9. Which is bigger: w or o? w Suppose 0 = 4k - m - 110, -k - 134 = -6k + 3m. Suppose 11p - 4p = -k. Are 0 and p nonequal? True Let o be (-71)/36 + 4/18. Let r = 7867/12 + -657. Let p = o - r. Is p less than or equal to 0? True Let x = -15 - -21. Let h be -6((-12)/3)/(-8). Let n = 2 - h. Are n and x equal? False Let w = 8 - 8.3. Let r = -41.7 - -40. Let t = w + r. Is t less than or equal to -0.01? True Suppose 7k + 45 = -2k. Let q(p) = 6p + 31. Let h be q(k). Are h and 12/17 non-equal? True Let v = -0.4 + -0.1. Let o(f) = -23f*3 - 14 + 5f - 7f2 + f2 + 22f*3. Let r be o(-7). Which is smaller: r or v? v Let k be 7/14-94 - -5. Which is greater: 1 or k? 1 Let o = 45 + -145. Let w be (1 - -17)(-2)/(-6). Let x be o/48 + 8/w. Which is smaller: 0 or x? x Let q = 0.2 + -2.2. Let u = 15 - 13. Suppose 0 = -0d - ud. Which is bigger: q or d? d Let n be 2/5 + (-1116)/15. Let a be n4/280 + (5 - 4). Is 1 not equal to a? True Suppose -3j - 4 = 2, -k = j + 3. Is -247 equal to k? False Suppose -2k + 82 = 4x - 0k, 4x + k = 85. Let r be 317/(-11) + -5 - 4/x. Do -34 and r have the same value? True Let d be 4/(-12)2(-5 - -2). Let b(k) = -19k + 4. Let c be b(d). Is c equal to -2? False Let r = 1.9 + -1.8. Let t = -37.1 + 37. Which is smaller: r or t? t Let t = 2 - 1. Let m be -1t(-3 - -2). Let w be 10 + 808/(-220)3 - -1. Which is smaller: m or w? w Let a = 19 + -19.004. Let c = a - -0.104. Which is smaller: c or -3/14? -3/14 Let q = 10 - 5. Suppose 7 = 4i + m, qi + 10 - 35 = 2m. Suppose 0 = -o - 2o + i. Which is greater: 4/5 or o? o Suppose 4j - 3j + 32 = -s, 0 = 3j - 4s + 96. Are -27 and j equal? False Suppose 3p - 4h + 8 = 0, -4p + 1 + 0 = -3h. Suppose -v + 2v + 5 = 4j, -3j + p = -v. Is j at least as big as -11? True Let b = 36 - 13. Let r = b + -22. Which is greater: -2/31 or r? r Let q = -27 - -12. Let g = -21 - q. Which is greater: g or 4? 4 Let d(x) = x*3 - 2x*2 + 2x - 6. Let v be d(0). Let h(r) = -4r + 1. Let o be h(3). Let z = 4 + o. Is v < z? False Let f be (5/6)/(3 + (-17)/6). Let p be 28/(1 - -6)5/4. Does p = f? True Let j = 92 + -70. Let n = j + -65. Does n = -43? True Let u be -2 + (0 - -85) - 1/(-2). Let j = u - 421/5. Is -2 smaller than j? True Suppose -4n = -3t + 46, -t - 4n = -0t - 26. Let f(c) = -3 - 1026c2 - 1025c*2 - 9 + 2052c*2 - 16c. Let a be f(t). Which is greater: 23 or a? a Let q = -45/52 - -8/13. Suppose -3h - 10 = -2d + 8, -2d - h + 2 = 0. Suppose df + 1 = 2f. Is q smaller than f? False Let n = -0.579 - -8.579. Which is bigger: n or -0.13? n Let z(g) = g2 + 6g + 4. Let s be z(-5). Let c = 479/3 - 199. Let d = -39 - c. Which is greater: d or s? d Let g be -3 + (4 - 2) - -9. Let q = 9 - g. Let y = -60/11 + 998/187. Is q bigger than y? True Let p = -0.15 - 0. Let o = p + 0.15. Is -3 greater than or equal to o? False Let c(q) = -17q3 + q2 + q + 8. Let p be c(-2). Is p < 146? False Let d = -1001 - -1000. Is 2/247 greater than d? True Suppose -v = 5h + 4, 5h = 2v + 3 - 25. Suppose v = -2y + 8. Is y not equal to 2/15? True Let o = -25 + 24. Let g be (-4 - -3)-2 - 0. Suppose 8 = 2d - 6d - 5b, d + 2 = -gb. Is d at most o? True Let z = -44 + 30. Let w = -20 - z. Which is smaller: w or -5? w Suppose -5z = -3z + 76. Let o = z - -39. Which is smaller: -4/31 or o? -4/31 Let h be (-7542)/(-6)(4/3 - 1). Let x = 6289/15 - h. Which is smaller: 0 or x? 0 Let o = -262 + 261.9. Let p be -2 - 0 - (-25)/3. Let s = p - 7. Are o and s equal? False Let x = -71 - -14. Let k = x + 56.08. Let u = k - 0.08. Which is greater: -2/7 or u? -2/7 Let g(y) = 8y*3 - 25y*3 - 4y + 9y3 + 4y*2 + 9y3 + 3. Let v be g(-5). Let d be 3/(-2) - 2/(-6). Is v >= d? False Let m = -178 - -1255/7. Let h be 266/76 - 3/((-12)/(-16)). Is h >= m? False Let k(r) be the second derivative of -r4/12 + 4r3 + 51r*2/2 - 28r. Let t be k(26). Which is greater: t or -5/7? -5/7 Suppose 4g + 16 = a - 6a, 0 = -5g - 2a - 20. Let d = 2 - 9. Is d != g? True Let a be 1 + -4 + (-3 - -12). Is a at most as big as 3/16? False Let o = 23 - 32. Suppose 0 = -0r + r, 4a + 3r + 40 = 0. Is o greater than a? True Let b(p) = -3p + 1. Let i be b(-1). Suppose -2r + r = 4f + 22, -4r - 28 = if. Let a = -30 - -34. Is a greater than or equal to r? True Let u be -10 - 15/((-36150)/24104). Which is greater: u or 0? u Let b = 31 + -307/10. Suppose 2s = -3x - 4 + 2, 3x = 4s + 4. Is s smaller than b? True Suppose 2g + 13g - 825 = 0. Suppose 0 = 9w + g - 10. Let b be 6/22-1. Is w > b? True Let u(y) be the second derivative of -y5/20 + y4/3 + 5y*3/2 + 17y*2/2 + 5y. Let v be u(7). Which is greater: 0.2 or v? 0.2 Let z be (35/(-140))/((-4)/(-6)). Are -3/4 and z non-equal? True Let k(p) = -p*2 - 6p + 7. Let m be k(-7). Suppose 0 = -n - mn - 4. Are n and -6 nonequal? True Let w = 0.06 + 0.08. Let i = -344 - -343. Which is greater: w or i? w Let p(i) = 7i*2 + 17i + 23. Let t(b) = 3b2 + 9b + 11. Let y(f) = -2p(f) + 5t(f). Let c be y(-4). Which is smaller: c or -20? -20 Let r = -135 - -134.996. Is r >= 3? False Let s be -1 + (63/15 - 3). Let g = 33 - 35. Are g and s equal? False Let m = -345 + 443. Which is smaller: m or -1? -1 Suppose 14 - 154 = 5q. Let v = q + 31. Let m be 2/(2 + v - 3). Which is bigger: m or 2/3? m Suppose 2270 + 36 = -2k. Let h = 5737/5 + k. Are h and -5 non-equal? True Let r be 16/(-6) - 6/18. Let n = r - 21. Is n less than -23? True Let h(k) = -2k + 19. Let r be h(8). Let j be 8/3 - (-1)/r. Let m be 2/j9/6. Is m <= 1? True Suppose -3z - 3r + 57 = 0, -z - 25r = -28r - 35. Which is smaller: 43/2 or z? 43/2 Let v = 2943851/92 - 31998. Is 0 at most v? True Let m(v) be the third derivative of -v5/60 + v4/12 + 4v3/3 + 16v2. Let c be m(4). Is -2/101 at most c? True Let g = -37/44987 - -20304677/18894540. Let i = 45/28 - g. Which is bigger: 0 or i? i Let n = 1/17 + 83/34. Let a = 20 + -28. Let h(m) = -m3 - 9m2 - 8m + 4. Let i be h(a). Are n and i unequal? True Let c(o) = o + 1. Let x be c(-10). Let u be x/(-6)2/3. Which is smaller: u or 2/5? 2/5 Let f(j) = -j3 + 4j*2 - 1. Let w be f(3). Suppose 2g = 3*z + w - 3, 0 = -g - 2	{ "pile_set_name": "DM Mathematics" }
t p be (0(-3 - (-7)/2))/(-1). Suppose p = -5s + 139 + 36. What is the remainder when 172 is divided by s? 32 Let w(h) = h*2 - 6h + 8. Let u = 40 - -33. Let g = u + -59. What is the remainder when g is divided by w(6)? 6 Let b = -248 + 286. What is the remainder when 112 is divided by b? 36 Suppose -6x + 151 = -5. Calculate the remainder when 68 is divided by x. 16 Let b(q) = -2q*3 + 14q*2 - 9q + 2 + 7 + q*3. Let u be b(11). Calculate the remainder when 42 is divided by 9/(-12) - u/(-12). 20 Let d(g) = 754g. Let s be d(3). What is the remainder when s/24 - 2/8 is divided by 32? 30 Suppose -z = -5q + 174, 2 = -z + 3. Calculate the remainder when 208 is divided by q. 33 Suppose 0 = 138r - 137r - 3d - 19, 3d - 93 = -3r. Suppose -v - 2p + 6 = -4, v - 10 = p. Calculate the remainder when r is divided by v. 8 Let y(f) = -f3 + 4f*2 + 14f - 1. Let o = 18 + -12. Calculate the remainder when y(o) is divided by 2. 1 Suppose 100 = 2p + 5q - 107, -p + 2q = -108. Calculate the remainder when p is divided by 54. 52 Let q = -17 - -19. Let w be 6/(-21) - (-32)/14. Suppose -h = -qh + wr + 83, 0 = 3h - r - 244. Calculate the remainder when h is divided by 21. 18 Let p be 1 + (-6)/(-3)(-2298)/(-12). Let m = 215 - 136. What is the remainder when m is divided by p/(-72)(-3 + 0)? 15 Suppose 0 = -2d - 5x + 29, 3d - 2x = 6d - 60. Suppose d = f + 3. What is the remainder when f is divided by 5? 4 Let f = -1328 - -1502. What is the remainder when f is divided by 12? 6 Let u(l) = l3 + 16l*2 + 13l - 99. Calculate the remainder when 998 is divided by u(-14). 110 What is the remainder when 169 is divided by (38/(-10))/(((-42)/6)/35)? 17 What is the remainder when 686 is divided by ((-10)/3)/10-345? 111 Suppose 13 = 2j - 5k, -2j + 8 = -4k - 0. Let w(c) = -c + 5. What is the remainder when 35 is divided by w(j)? 2 Suppose 600 = -5q + 20q. What is the remainder when 111 is divided by q? 31 Let d(o) = 10o*2 + 4o + 3. Let p = 21 - 45. What is the remainder when d(-3) is divided by (-300)/p - (-2)/(-4)? 9 Suppose -2i + 48 = -4o, 2i - 5o - 20 = 25. Let q(r) = -40r - 1. Calculate the remainder when q(-3) is divided by i. 29 Suppose -2 + 18 = 4k. Suppose -2g + 60 = kv, -2v - 4g + 68 = 2v. Let r = -152 + 214. What is the remainder when r is divided by v? 10 Suppose 16m = 14m + 158. Let v = 31 - 22. Calculate the remainder when m is divided by v. 7 Let u(z) = -z + 1. Suppose 3 = 5g - 27. Suppose -5t - 29 = g. What is the remainder when 29 is divided by u(t)? 5 Let k(s) = 2s - 150. Let i be k(0). Calculate the remainder when 1(0 + (-4 - i)) - 0 is divided by 49. 48 Let g(s) = -4s + 0 + 3 - 2. Let f = 59 + -21. Calculate the remainder when f is divided by g(-3). 12 Let y(z) = -8z - 15. What is the remainder when ((-9126)/36)/((-6)/4) is divided by y(-4)? 16 Let q(j) = -j3 + 11j*2 - 17j + 15. Let x(r) = 5r3 + 2r*2 - 3r + 3. Let o be x(1). Calculate the remainder when q(o) is divided by 25. 17 Let r(i) = 12i - 30. Suppose -2z = m - 146, 0 = -z + 6m - 2m + 55. What is the remainder when z is divided by r(4)? 17 Let t(c) = -2c + 14. Let w be t(6). Let g be (63)/(4 - w). Let f(o) = -o*3 + 10o*2 - 7o + 2. What is the remainder when 38 is divided by f(g)? 18 Suppose -1 = -0h + h. Let c be 0/h(-2)/(-4). Suppose c = 4q - 45 - 75. What is the remainder when q is divided by 8? 6 Let x(z) = 6z*2 + 17z - 117. What is the remainder when x(5) is divided by 28? 6 Let m(o) = -14o - 8. Let q be m(-3). Suppose 0 = -4j + 3j + 5x + q, 2j - x = 23. Calculate the remainder when 17 is divided by j. 8 Let a = 6 - 3. Suppose -2z + au - 29 = -3z, -3z + 147 = -3u. What is the remainder when 174 is divided by z? 42 Suppose -2v = -5v + 942. What is the remainder when v is divided by 3? 2 Let j be (-142)/7 - -2 - (-28)/98. Calculate the remainder when (j/4)/((-13)/182) is divided by 16. 15 Let y = -10 + 17. Suppose 18 = yq - q. Suppose -3r - qt = -66, 7r - 90 = 2r - t. What is the remainder when 30 is divided by r? 13 Let y = -1539 + 3458. What is the remainder when y is divided by 15? 14 Let p(c) = c + 51. What is the remainder when 121 is divided by p(-26)? 21 Let b(u) = u2 - 4u + 8. Suppose g = 3 + 2. Let p be b(g). Let d = p - 9. What is the remainder when 13 is divided by d? 1 Let q = -252 - -958. What is the remainder when q is divided by 101? 100 Let o = 36 - 12. Suppose 5v + 2s + 2s = 9, -11 = -3v - s. Calculate the remainder when o is divided by v. 4 Let o be 1 + 1 - (-67)/(-1). Let a = -91 - o. Let k = a - -96. Calculate the remainder when k is divided by 18. 16 Let q(a) = 3a2 - 8a + 9. Calculate the remainder when 46 is divided by q(3). 10 Suppose -4s + 34 = 2a, 3a - 7s - 101 = -3s. Calculate the remainder when a is divided by 7. 6 Suppose 47 + 181 = 19z. What is the remainder when 23 is divided by z? 11 Suppose 10 = -4d + 9d. Calculate the remainder when 88 is divided by d. 0 Let i(d) = 9d + 202. What is the remainder when ((-14)/(-4))/(2/28) is divided by i(-21)? 10 Suppose 4w = 4f + 135 + 429, -3w + 2f + 420 = 0. Calculate the remainder when w is divided by 28. 26 Let f(m) = m2 + 20m + 177. What is the remainder when f(-26) is divided by 58? 43 Let g = 35 + 276. What is the remainder when g is divided by 13? 12 Let t = 80 + 4. Suppose -2l + 24 = -10. Calculate the remainder when t is divided by l. 16 Let s = 726 + -701. What is the remainder when (12 + -3)/(2/16) is divided by s? 22 Let h(s) = 3s*2 - 8s - 2. Let v be h(6). Suppose -2d = -0d - l - v, -5d + 151 = -l. What is the remainder when 122 is divided by d? 29 Let k(l) = l3 - l2 + 3l - 5. Let i = 41 - 38. What is the remainder when 64 is divided by k(i)? 20 Suppose 30 = -3q - 36. Let c = q + 32. Calculate the remainder when 28 is divided by c. 8 Suppose 52 = 18m - 38. Suppose -o + r = -8 - 7, o + 4r = 20. Suppose -o = -mz + 49. What is the remainder when 36 is divided by z? 10 Let b = -7 + -1. Let c = 20 + b. Calculate the remainder when ((-99)/(-12))/((-3)/(-12)) is divided by c. 9 Let c = 130 + -54. Calculate the remainder when c is divided by 13. 11 Let s(t) = -t*2 - 10t - 21. Let d be s(-6). Suppose du + 4h = 5u - 18, 2u - 21 = 3h. Calculate the remainder when 133 is divided by u. 13 What is the remainder when 42 is divided by (-3)/4(9 + -21)? 6 Suppose o = 4o - 294. Calculate the remainder when o is divided by 34. 30 Let w = 10 - -7. Suppose -255 = -7j + 207. Let a = 98 - j. What is the remainder when a is divided by w? 15 Let t = -1250 + 1449. What is the remainder when t is divided by 50? 49 Suppose 4q + 3r + 0r - 165 = 0, -4r - 183 = -5q. Calculate the remainder when q is divided by 14. 11 Let l(x) = -x3 + 2x*2 + 25x + 143. Calculate the remainder when l(0) is divided by 27. 8 What is the remainder when 393 is divided by (-893)/(-27) - 2/27? 30 Let w = -21 - -15. Let x = 0 - w. Let s(q) = 2q2 - 5q + 3. Calculate the remainder when s(x) is divided by 12. 9 Let w = -15 - -14. What is the remainder when 43 is divided by -47w/3 - (-2)/(-3)? 13 Suppose -6b = -26b + 3060. What is the remainder when b is divided by 13? 10 Let j(f) = -5f*2 - 59f + 7. Calculate the remainder when 68 is divided by j(-11). 17 Suppose 2g = -3d + 70, d - 5g - 18 = -7g. What is the remainder when 259 is divided by d? 25 Suppose -2x = -3n + 185, 4n - x = 194 + 61. Suppose -3f - 264 = f. What is the remainder when n is divided by (8/12)/((-2)/f)? 21 Let n(z) = 2z3 - 24z*2 + z. Let j = 9 + -9. Suppose jq - 105 = -3q. Calculate the remainder when q is divided by n(12). 11 Let q = 14 + -9. Suppose -2p + y = qy - 76, -190 = -5p - y. What is the remainder when 149 is divided by p? 35 Let c(p) = -p*3 - 17p*2 - 21p + 21. Calculate the remainder when c(-16) is divided by 34. 33 Let g(u) = u*2 + 8u - 20. Let d be g(-10). Suppose d = 4y, 0q + 2y = 5q - 180. What is the remainder when q is divided by 19? 17 Calculate the remainder when 1168/(-24)27/(-6) is divided by 28. 23 Let h(r) = 3r - 12r - 6r*2 + 6 - 2 + 5r*2. What is the remainder when ((-4)/(-2)46)/2 is divided by h(-8)? 10 Let a(u) = -2u2 + 6u - 6. Let v be a(1). Calculate the remainder when 140 i	{ "pile_set_name": "DM Mathematics" }
remainder when 1150 is divided by 233. 218 What is the remainder when 168 is divided by 66? 36 Calculate the remainder when 294 is divided by 51. 39 What is the remainder when 14 is divided by 5? 4 What is the remainder when 783 is divided by 129? 9 What is the remainder when 271 is divided by 20? 11 What is the remainder when 117 is divided by 117? 0 What is the remainder when 1133 is divided by 148? 97 What is the remainder when 646 is divided by 187? 85 What is the remainder when 2109 is divided by 16? 13 What is the remainder when 5916 is divided by 97? 96 Calculate the remainder when 6318 is divided by 631. 8 Calculate the remainder when 1635 is divided by 91. 88 Calculate the remainder when 1111 is divided by 256. 87 What is the remainder when 191 is divided by 182? 9 Calculate the remainder when 137 is divided by 133. 4 What is the remainder when 552 is divided by 81? 66 What is the remainder when 164 is divided by 66? 32 What is the remainder when 517 is divided by 74? 73 What is the remainder when 159 is divided by 4? 3 Calculate the remainder when 4715 is divided by 157. 5 Calculate the remainder when 192 is divided by 41. 28 What is the remainder when 2559 is divided by 6? 3 Calculate the remainder when 74 is divided by 21. 11 What is the remainder when 798 is divided by 31? 23 What is the remainder when 537 is divided by 17? 10 Calculate the remainder when 422 is divided by 44. 26 Calculate the remainder when 76 is divided by 23. 7 Calculate the remainder when 1751 is divided by 45. 41 Calculate the remainder when 65 is divided by 30. 5 Calculate the remainder when 174 is divided by 96. 78 Calculate the remainder when 352 is divided by 6. 4 What is the remainder when 82 is divided by 17? 14 Calculate the remainder when 189 is divided by 94. 1 What is the remainder when 2285 is divided by 11? 8 What is the remainder when 5169 is divided by 12? 9 What is the remainder when 245 is divided by 31? 28 What is the remainder when 375 is divided by 7? 4 What is the remainder when 138 is divided by 28? 26 Calculate the remainder when 3346 is divided by 93. 91 Calculate the remainder when 120 is divided by 9. 3 What is the remainder when 1437 is divided by 160? 157 What is the remainder when 79 is divided by 14? 9 Calculate the remainder when 21 is divided by 9. 3 What is the remainder when 302 is divided by 123? 56 What is the remainder when 1977 is divided by 43? 42 Calculate the remainder when 302 is divided by 27. 5 Calculate the remainder when 53 is divided by 24. 5 Calculate the remainder when 1775 is divided by 6. 5 Calculate the remainder when 6906 is divided by 44. 42 What is the remainder when 2394 is divided by 47? 44 Calculate the remainder when 1411 is divided by 79. 68 What is the remainder when 7629 is divided by 72? 69 Calculate the remainder when 8305 is divided by 39. 37 Calculate the remainder when 3289 is divided by 274. 1 What is the remainder when 680 is divided by 36? 32 Calculate the remainder when 4018 is divided by 134. 132 What is the remainder when 444 is divided by 154? 136 Calculate the remainder when 419 is divided by 141. 137 Calculate the remainder when 563 is divided by 72. 59 Calculate the remainder when 42 is divided by 14. 0 Calculate the remainder when 817 is divided by 63. 61 What is the remainder when 17358 is divided by 70? 68 Calculate the remainder when 49 is divided by 30. 19 What is the remainder when 6260 is divided by 174? 170 Calculate the remainder when 3355 is divided by 60. 55 Calculate the remainder when 1089 is divided by 13. 10 What is the remainder when 1345 is divided by 33? 25 Calculate the remainder when 2034 is divided by 28. 18 What is the remainder when 580 is divided by 6? 4 What is the remainder when 9095 is divided by 140? 135 What is the remainder when 1526 is divided by 282? 116 What is the remainder when 229 is divided by 53? 17 What is the remainder when 161 is divided by 55? 51 What is the remainder when 1117 is divided by 20? 17 What is the remainder when 541 is divided by 44? 13 Calculate the remainder when 439 is divided by 7. 5 What is the remainder when 205 is divided by 15? 10 What is the remainder when 257 is divided by 10? 7 What is the remainder when 293 is divided by 61? 49 Calculate the remainder when 83 is divided by 13. 5 Calculate the remainder when 237 is divided by 60. 57 What is the remainder when 216 is divided by 30? 6 What is the remainder when 336 is divided by 148? 40 What is the remainder when 85 is divided by 29? 27 What is the remainder when 778 is divided by 387? 4 What is the remainder when 764 is divided by 24? 20 Calculate the remainder when 575 is divided by 20. 15 Calculate the remainder when 2004 is divided by 1989. 15 What is the remainder when 297 is divided by 54? 27 Calculate the remainder when 93 is divided by 25. 18 Calculate the remainder when 2408 is divided by 11. 10 Calculate the remainder when 5353 is divided by 122. 107 What is the remainder when 398 is divided by 222? 176 What is the remainder when 1077 is divided by 8? 5 Calculate the remainder when 125 is divided by 120. 5 What is the remainder when 5594 is divided by 130? 4 Calculate the remainder when 1983 is divided by 653. 24 What is the remainder when 57 is divided by 21? 15 What is the remainder when 2128 is divided by 239? 216 What is the remainder when 657 is divided by 14? 13 Calculate the remainder when 67 is divided by 3. 1 Calculate the remainder when 336 is divided by 245. 91 Calculate the remainder when 6726 is divided by 29. 27 What is the remainder when 188 is divided by 21? 20 Calculate the remainder when 38 is divided by 14. 10 What is the remainder when 228 is divided by 21? 18 What is the remainder when 205 is divided by 69? 67 Calculate the remainder when 118 is divided by 70. 48 Calculate the remainder when 1979 is divided by 132. 131 Calculate the remainder when 89 is divided by 10. 9 Calculate the remainder when 112 is divided by 94. 18 Calculate the remainder when 111 is divided by 41. 29 Calculate the remainder when 127 is divided by 5. 2 Calculate the remainder when 158 is divided by 4. 2 Calculate the remainder when 247 is divided by 24. 7 Calculate the remainder when 446 is divided by 40. 6 What is the remainder when 2247 is divided by 30? 27 Calculate the remainder when 61 is divided by 36. 25 Calculate the remainder when 731 is divided by 365. 1 What is the remainder when 154 is divided by 148? 6 Calculate the remainder when 464 is divided by 80. 64 What is the remainder when 427 is divided by 103? 15 What is the remainder when 108 is divided by 16? 12 Calculate the remainder when 317 is divided by 80. 77 Calculate the remainder when 1914 is divided by 37. 27 Calculate the remainder when 105 is divided by 19. 10 Calculate the remainder when 549 is divided by 30. 9 What is the remainder when 108 is divided by 29? 21 Calculate the remainder when 136 is divided by 26. 6 Calculate the remainder when 124 is divided by 84. 40 What is the remainder when 1450 is divided by 57? 25 Calculate the remainder when 245 is divided by 80. 5 Calculate the remainder when 44 is divided by 31. 13 Calculate the remainder when 1317 is divided by 6. 3 What is the remainder when 16 is divided by 16? 0 What is the remainder when 369 is divided by 134? 101 What is the remainder when 145 is divided by 35? 5 Calculate the remainder when 180 is divided by 48. 36 Calculate the remainder when 1871 is divided by 12. 11 What is the remainder when 89 is divided by 18? 17 What is the remainder when 4260 is divided by 1414? 18 Calculate the remainder when 2064 is divided by 616. 216 Calculate the remainder when 541 is divided by 272. 269 What is the remainder when 394 is divided by 21? 16 Calculate the remainder when 680 is divided by 187. 119 What is the remainder when 526 is divided by 12? 10 What is the remainder when 109 is divided by 28? 25 Calculate the remainder when 4933 is divided by 103. 92 What is the remainder when 375 is divided by 64? 55 What is the remainder when 2780 is divided by 121? 118 What is the remainder when 269 is divided by 82? 23 What is the remainder when 1608 is divided by 62? 58 Calculate the remainder when 112 is divided by 49. 14 Calculate the rem	{ "pile_set_name": "DM Mathematics" }
7, 88, 125, 158, 187, 212, 233? 250 What is next in 18, 36, 54, 72? 90 What is the next term in -43, -78, -113? -148 What is next in 249, 251, 253? 255 What comes next: -526, -523, -518, -511, -502, -491? -478 What comes next: 1, -30, -73, -128, -195, -274, -365? -468 What is next in 1781, 3560, 5339? 7118 What comes next: -432, -567, -700, -831, -960? -1087 What is next in -7, -16, -27, -40? -55 What is the next term in -60, -233, -532, -963, -1532, -2245, -3108, -4127? -5308 What is the next term in 42, 82, 148, 240? 358 What comes next: 7, -1, -23, -65, -133, -233? -371 What is the next term in 101, 119, 149, 191, 245, 311? 389 What comes next: 6180, 6184, 6190, 6198, 6208, 6220, 6234? 6250 What comes next: -40, -48, -68, -106, -168, -260? -388 What is next in -2052, -2050, -2048, -2046? -2044 What comes next: -140, -135, -126, -113? -96 What is the next term in 344, 340, 342, 356, 388? 444 What is next in -6257, -6258, -6259, -6260, -6261? -6262 What is next in -28, -91, -190, -337, -544, -823, -1186? -1645 What comes next: -159, -362, -565, -768, -971, -1174? -1377 What comes next: -244, -243, -242? -241 What comes next: 22, 78, 166, 280, 414, 562, 718, 876? 1030 What is next in 496, 988, 1480, 1972? 2464 What comes next: 724, 734, 744, 754, 764? 774 What comes next: -7, -6, -3, 2, 9, 18? 29 What is next in -2108, -8439, -18984, -33737, -52692, -75843? -103184 What comes next: -151, -158, -179, -220, -287, -386, -523, -704? -935 What comes next: -2962, -2960, -2958, -2956, -2954, -2952? -2950 What is next in 66, 40, 4, -48, -122, -224, -360? -536 What is next in -81, -96, -115, -132, -141, -136? -111 What is next in 0, -24, -56, -90, -120? -140 What is the next term in 69, 71, 71, 69, 65, 59, 51? 41 What comes next: -40, -52, -72, -100, -136? -180 What is the next term in 507, 510, 513, 516? 519 What is the next term in 24, 38, 52, 66, 80, 94? 108 What is next in -87, -122, -173, -246, -347, -482, -657? -878 What is the next term in 14, 30, 70, 146, 270? 454 What is next in -10, -31, -52, -73? -94 What is the next term in -53, -98, -143, -188? -233 What is next in -64, -125, -184, -241, -296, -349? -400 What is the next term in 9, -10, -49, -114, -211, -346, -525, -754? -1039 What is the next term in -17, -21, -25, -29, -33? -37 What comes next: 907, 909, 911? 913 What is next in -124, -160, -226, -328, -472, -664, -910? -1216 What is the next term in 176, 352, 528, 704? 880 What is the next term in -167, -247, -315, -365, -391, -387, -347? -265 What comes next: 198, 201, 204, 207? 210 What comes next: -226, -215, -192, -151, -86, 9? 140 What comes next: 19, 29, 29, 19, -1, -31? -71 What is next in 14, 68, 158, 284? 446 What comes next: 298, 301, 304? 307 What comes next: 55, 106, 155, 202, 247? 290 What comes next: -29, -23, -17? -11 What is the next term in 2084, 2085, 2086? 2087 What comes next: -645, -2587, -5825, -10359? -16189 What is the next term in 31, 42, 55, 70, 87, 106, 127? 150 What comes next: -2361, -2362, -2363, -2364? -2365 What comes next: 9, 50, 153, 348, 665, 1134, 1785? 2648 What is next in -12, -14, -2, 36, 112, 238, 426? 688 What comes next: -177, -763, -1747, -3135, -4933? -7147 What is next in -227, -226, -233, -254, -295? -362 What is the next term in 6, 9, 12, 15, 18? 21 What comes next: -11, -22, -21, -2, 41, 114? 223 What is next in 267, 275, 287, 303? 323 What comes next: 0, 6, 4, -6, -24, -50? -84 What is next in -9, -26, -53, -90, -137, -194? -261 What comes next: -229, -458, -687, -916? -1145 What is the next term in 2807, 5617, 8429, 11243, 14059, 16877, 19697? 22519 What comes next: -12, -35, -72, -123, -188? -267 What is next in 535, 569, 615, 679, 767, 885? 1039 What is next in -5, 3, 11, 19, 27? 35 What is next in -14, -46, -78? -110 What is next in -271, -537, -801, -1063, -1323, -1581? -1837 What is next in -134, -130, -124, -116, -106, -94? -80 What comes next: -4793, -4795, -4797, -4799? -4801 What is next in -10, -36, -76, -130? -198 What is the next term in -149, -163, -197, -257, -349, -479, -653? -877 What is next in 2690, 2689, 2690, 2693? 2698 What is next in 248, 997, 2246, 3995? 6244 What comes next: -30, -29, -28, -27, -26? -25 What is the next term in -57, -119, -183, -249, -317? -387 What is the next term in -936, -934, -932? -930 What is the next term in 16, 52, 150, 340, 652, 1116, 1762? 2620 What is next in -955, -1908, -2861, -3814? -4767 What is the next term in -29, -40, -55, -74, -97? -124 What comes next: -96, -92, -88, -84, -80? -76 What is next in -586, -585, -584, -583, -582, -581? -580 What is the next term in -56, -75, -98, -125, -156, -191, -230? -273 What comes next: -648, -649, -650? -651 What comes next: 1, -13, -53, -131, -259, -449? -713 What is the next term in -224, -447, -670, -893? -1116 What comes next: -245, -1053, -2407, -4313, -6777, -9805? -13403 What is next in -302, -319, -336, -353, -370? -387 What comes next: -68, -85, -102, -119? -136 What is the next term in -23, -22, 15, 106, 269, 522, 883? 1370 What is next in 93, 160, 221, 276, 325? 368 What is the next term in -16, -26, -42, -64, -92? -126 What is next in 25, 51, 93, 151, 225? 315 What is next in 586, 564, 542? 520 What comes next: -322, -1307, -2954, -5263, -8234, -11867? -16162 What is the next term in -722, -1422, -2120, -2816, -3510, -4202? -4892 What is next in 138, 289, 450, 621? 802 What is next in -37, -100, -209, -370, -589? -872 What is the next term in -10, -13, -24, -49, -94, -165, -268, -409? -594 What comes next: 3513, 7025, 10537? 14049 What is the next term in -174, -171, -168? -165 What is next in 23, 133, 421, 977, 1891, 3253, 5153? 7681 What is next in -10, -15, -22, -31, -42, -55? -70 What comes next: -1042, -1041, -1040, -1039, -1038? -1037 What is the next term in 19888, 39774, 59658, 79540, 99420, 119298? 139174 What is next in -447, -532, -675, -882, -1159? -1512 What is the next term in 38, 62, 88, 116, 146? 178 What is next in -94, -167, -240? -313 What is the next term in -501, -1008, -1515, -2022? -2529 What is the next term in -107, -71, -35, 1, 37? 73 What comes next: -27, -115, -259, -459, -715, -1027? -1395 What comes next: -116, -233, -354, -479, -608, -741, -878? -1019 What is next in 9881, 9867, 9841, 9797, 9729, 9631, 9497, 9321? 9097 What is next in -106, -84, -62, -40, -18, 4? 26 What is the next term in -89, -126, -163, -200? -237 What is next in -154, -595, -1322, -2329, -3610, -5159, -6970, -9037? -11354 What comes next: -106, -100, -94, -88, -82? -76 What comes next: -40, -78, -114, -148, -180, -210? -238 What is the next term in 176, 351, 528, 707, 888, 1071? 1256 What is the next term in 1516, 3035, 4554, 6073, 7592? 9111 What is the next term in -565, -563, -561, -559? -557 What is next in 2126, 4252, 6378, 8504? 10630 What is the next term in 23, 35, 55, 83, 119, 163, 215? 275 What is the next term in -205, -412, -619? -826 What is the next term in 9, 22, 33, 42? 49 What comes next: 35, 34, 33, 32, 31? 30 What is next in 4583, 4577, 4559, 4523, 4463, 4373? 4247 What is next in 614, 1265, 1938, 2645, 3398, 4209, 5090? 6053 What is the next term in 90, 27, -34, -93, -150, -205? -258 What is next in -5, -10, -21, -38? -61 What is next in -1797, -3545, -5281, -6999, -8693, -10357, -11985? -13571 What is the next term in -24, -43, -74, -123, -196, -299, -438? -619 What is the next term in 129, 160, 211, 282? 373 What is the next term in 43, 39, 35, 31? 27 What comes next: -335, -363, -409, -473, -555? -655 What is the next term in -17, -32, -49, -68? -89 What is next in 149, 153, 159, 167? 177 What is the next term in -276, -550, -824, -1098, -1372? -1646 What comes next: 10051, 10050, 10047, 10042? 10035 What is next in -16, -24, -22, -4, 36, 104, 206, 348? 536 What is the next term in 149, 151, 153? 155 What is next in -7502, -7496, -7478, -7442, -7382? -7292 What comes next: 273, 1088, 2447, 4350, 6797, 9788? 13323 What is next in 0, -2, -6, -12, -20? -30 What comes next: -377, -388, -401, -416, -433, -452? -473 What is the next term in -2311, -2315, -2321, -2329? -2339 What comes next: -7, 47, 99, 149, 197? 243 What comes next: 139, 236, 333, 430, 527, 624? 721 What comes next: 2, 3, 2, -1, -6? -13 What is next in -43, -38, -29, -16, 1, 22, 47? 76 Wh	{ "pile_set_name": "DM Mathematics" }
What comes next: 3919725, 3919729, 3919733, 3919737, 3919741? 3919745 What comes next: -918731, -3674943, -8268609, -14699711, -22968231? -33074151 What is the next term in 469, 660, 1175, 2170, 3801, 6224, 9595, 14070? 19805 What is the next term in 9688, 19241, 28666, 37963, 47132, 56173, 65086? 73871 What is next in 468942, 1875759, 4220444, 7502997, 11723418? 16881707 What is the next term in -22059, -22098, -22171, -22278, -22419? -22594 What is next in 7559, 7692, 7929, 8282, 8763, 9384, 10157, 11094? 12207 What comes next: 577625, 576767, 575909? 575051 What comes next: 1402, 1833, 1298, -203, -2670, -6103, -10502? -15867 What is the next term in -105684403, -105684404, -105684405, -105684406, -105684407, -105684408? -105684409 What comes next: -97151071, -97151073, -97151075, -97151077, -97151079, -97151081? -97151083 What is next in 61436, 61464, 61474, 61460, 61416? 61336 What is the next term in -15, -299, -961, -2187, -4163, -7075? -11109 What is next in -889480, -889417, -889352, -889285, -889216, -889145, -889072? -888997 What comes next: 81682, 653449, 2205390, 5227591, 10210138, 17643117? 28016614 What comes next: -137506, -271523, -405528, -539515, -673478, -807411? -941308 What is the next term in -975, -4491, -10337, -18519, -29043? -41915 What comes next: 305, 1012, 2209, 4142, 7057? 11200 What comes next: -66767278, -133534554, -200301830, -267069106? -333836382 What is next in 9735, 18701, 27667, 36633, 45599, 54565? 63531 What is the next term in 877142, 3508562, 7894254, 14034212, 21928430, 31576902? 42979622 What comes next: 4089, 5248, 7171, 9858, 13309? 17524 What comes next: -16160, -64100, -143872, -255476, -398912? -574180 What is the next term in 14769863, 29539709, 44309553, 59079395, 73849235, 88619073, 103388909? 118158743 What is next in 5693, 11397, 17097, 22793, 28485, 34173? 39857 What comes next: 208484, 1667813, 5628846, 13342433, 26059424, 45030669, 71507018, 106739321? 151978428 What is the next term in 32292, 63230, 94182, 125154, 156152, 187182, 218250? 249362 What is next in 8608097, 8608096, 8608095, 8608094, 8608093, 8608092? 8608091 What is the next term in 11748, 24076, 36744, 49746, 63076, 76728, 90696, 104974? 119556 What is the next term in 88233, 353437, 795443, 1414251, 2209861? 3182273 What is next in -26807390, -26807392, -26807394? -26807396 What comes next: -58193, -110323, -162453, -214583, -266713, -318843? -370973 What is the next term in -7946, -12356, -16758, -21152, -25538, -29916? -34286 What is the next term in 10098537, 10098596, 10098657, 10098720? 10098785 What is next in -7412, -14791, -22180, -29585, -37012, -44467? -51956 What is the next term in 1630358, 1630319, 1630270, 1630205, 1630118, 1630003, 1629854, 1629665? 1629430 What is next in -17398, -35063, -52688, -70273, -87818, -105323, -122788? -140213 What is next in 123, 357, 809, 1581, 2775, 4493? 6837 What is the next term in -223384, -446741, -669956, -892957, -1115672, -1338029, -1559956? -1781381 What comes next: 312306, 312184, 312062, 311940, 311818? 311696 What is next in 24599, 24668, 24737, 24806, 24875, 24944? 25013 What comes next: 17017, 34458, 51779, 68920, 85821, 102422, 118663, 134484? 149825 What is next in 437691, 438206, 438721? 439236 What is next in -4418169, -8836417, -13254665, -17672913, -22091161? -26509409 What is next in -516150, -2064606, -4645366, -8258430, -12903798, -18581470, -25291446? -33033726 What comes next: -9361, 305, 16415, 38969, 67967, 103409? 145295 What is the next term in -62803734, -62803733, -62803732, -62803731, -62803730, -62803729? -62803728 What comes next: 120, 961, 3222, 7611, 14836? 25605 What is next in 43104, 84017, 122738, 159273, 193628, 225809, 255822, 283673? 309368 What comes next: 109725, 219557, 329389? 439221 What is the next term in 254, 2902, 10512, 25700, 51082? 89274 What comes next: -5870743, -5870744, -5870745, -5870746, -5870747, -5870748? -5870749 What is next in 644, 1535, 2522, 3605, 4784? 6059 What is next in 7938, 7949, 7960, 7971, 7982? 7993 What is the next term in 38847, 77687, 116519, 155343, 194159? 232967 What is next in 3765, 5574, 7299, 8934, 10473, 11910? 13239 What is the next term in 29995, 25618, 21241, 16864, 12487? 8110 What is the next term in 22688610, 22688603, 22688598, 22688595, 22688594, 22688595? 22688598 What is the next term in -56463678, -112927343, -169390996, -225854631, -282318242, -338781823, -395245368, -451708871? -508172326 What is next in -65375, -130831, -196285, -261737, -327187, -392635? -458081 What is the next term in 10861, 10833, 10817, 10819, 10845? 10901 What comes next: -527, -2143, -4875, -8741, -13759, -19947, -27323? -35905 What is the next term in 38, -1935, -5240, -9889, -15894, -23267, -32020? -42165 What is next in -8495710, -16991420, -25487132, -33982846, -42478562, -50974280? -59470000 What comes next: -5649, -11174, -16677, -22146, -27569, -32934, -38229, -43442? -48561 What comes next: -740, -2615, -5702, -10001? -15512 What is the next term in 6782, 7143, 7512, 7889? 8274 What is the next term in -1197810, -1197749, -1197688, -1197627, -1197566? -1197505 What comes next: 199957, 1599635, 5398763, 12797065, 24994265? 43190087 What is the next term in 51, 351, 1065, 2367, 4431, 7431, 11541? 16935 What is the next term in -73260, -146520, -219780? -293040 What comes next: 8417710, 16835420, 25253130? 33670840 What is the next term in 1366870, 2733736, 4100602, 5467468, 6834334, 8201200? 9568066 What is the next term in 7102, 16940, 26778, 36616, 46454? 56292 What is the next term in -17246038, -17246040, -17246044, -17246050, -17246058, -17246068? -17246080 What comes next: 209066, 208754, 208442? 208130 What comes next: 20239, 40285, 60139, 79801, 99271, 118549? 137635 What is next in 2787105, 2787117, 2787137, 2787165, 2787201, 2787245? 2787297 What comes next: 1828009, 1827987, 1827927, 1827811, 1827621? 1827339 What comes next: -955876, -955800, -955720, -955636, -955548, -955456? -955360 What is next in 561, 996, 1321, 1536, 1641, 1636, 1521? 1296 What is the next term in -374, -963, -2026, -3821, -6606, -10639, -16178, -23481? -32806 What comes next: 3326, 3764, 4486, 5486, 6758, 8296, 10094, 12146? 14446 What is next in 2314, 4563, 6792, 9013, 11238, 13479, 15748, 18057? 20418 What is next in -14593, -14849, -15545, -16903, -19145, -22493, -27169, -33395? -41393 What is next in -23025, -92317, -207875, -369705, -577813? -832205 What is the next term in -6256, -2868, 520, 3908, 7296, 10684? 14072 What is the next term in 636, 1349, 2176, 3117, 4172? 5341 What is next in -2914322, -5828666, -8743010, -11657354, -14571698? -17486042 What is the next term in -1564394, -1564431, -1564492, -1564577, -1564686? -1564819 What comes next: -3956, -14584, -32328, -57200, -89212, -128376, -174704? -228208 What is next in 39314, 156902, 352940, 627476, 980558, 1412234? 1922552 What is the next term in 14395031, 14395039, 14395045, 14395043, 14395027, 14394991, 14394929? 14394835 What comes next: -2068609, -2068612, -2068615, -2068618, -2068621? -2068624 What is the next term in -26154, -55139, -84124, -113109, -142094, -171079? -200064 What is the next term in -28324760, -28324763, -28324766, -28324769, -28324772, -28324775? -28324778 What comes next: 9407, 13994, 18581, 23168, 27755, 32342? 36929 What is the next term in -3827, -7632, -11419, -15182, -18915, -22612, -26267? -29874 What is the next term in -12, 385, 1436, 3459, 6772, 11693, 18540? 27631 What is the next term in 7314943, 7314961, 7314985, 7315009, 7315027, 7315033, 7315021, 7314985? 7314919 What is the next term in -224272, -448528, -672732, -896854, -1120864? -1344732 What is the next term in -66184, -264821, -595910, -1059463, -1655492? -2384009 What is next in 12264089, 24528175, 36792257, 49056335? 61320409 What is next in 2675, 5371, 8087, 10823? 13579 What is the next term in -107771, -108263, -109605, -112223, -116543, -122991? -131993 What is the next term in 2166, 6604, 14000, 24354? 37666 What comes next: -3358, -3334, -3314, -3298? -3286 What is next in -195191, -780764, -1756717, -3123050, -4879763? -7026856 What is next in -6199, -23381, -51565, -90757, -140963, -202189, -274441? -357725 What is the next term in 21,	{ "pile_set_name": "DM Mathematics" }
common factor of v and 286? 26 Let a be 220/3600/500. Let x(t) = -t3 + 6t*2 - 4t - 5. Let m be x(4). Calculate the greatest common factor of a and m. 11 Suppose -2s + 92 = 2h + 2h, -135 = -3s - 5h. Calculate the highest common divisor of 290 and s. 10 Let j be 121 - (6/7)/(26/182). Calculate the highest common factor of 46 and j. 23 Suppose 10c + 3293 - 4093 = 0. Calculate the highest common divisor of c and 3920. 80 Suppose 4v - 1320 = -5h, -4h + 0v + 1056 = 3v. What is the highest common factor of 24 and h? 24 Let l(w) = w2 + 8w - 28. Let u be l(-15). Let o be ((-35)/15)/(1/(-3)). Calculate the greatest common divisor of u and o. 7 Let p be 12/1(-2 - -4). Let z = -56 - -52. Let v = z + 10. What is the greatest common factor of v and p? 6 Suppose 26 + 9 = 5i + w, 5i - 30 = -2w. Suppose c - i = -0c. What is the greatest common factor of c and 40? 8 Let s be 4 + (-2 - -1) + 147. Suppose -2l = -5 - 3. Suppose -lq + 8 = 0, -r = -5q - 29 - s. Calculate the highest common divisor of r and 27. 27 Let f = 207 - 206. Calculate the highest common divisor of 37 and f. 1 Suppose g - 363 = 3o, 0o + 5g - 473 = 4o. Let z = 212 + o. Let r be (0 - 4)z/(-8). What is the highest common factor of 18 and r? 9 Suppose -17t + r + 46 = -15t, -2r = 5t - 115. What is the highest common divisor of 644 and t? 23 Let s be ((-182)/28)/((-1)/2). Let o = 34 + -21. What is the greatest common divisor of o and s? 13 Suppose -10k - 50 = -200. Suppose -i + 24 = -v, 3v + 0 = k. What is the greatest common divisor of i and 29? 29 Suppose -n + 0n + 21 = -2u, -4n = 4u + 60. Let q(s) = -s3 - 13s*2 - 17s - 15. Let i be q(u). What is the greatest common factor of i and 30? 15 Let u = -6 + 11. Suppose z = 9 + u. Let g(m) = -m*2 - 22m - 38. Let f be g(-20). What is the highest common divisor of f and z? 2 Let t be (120/56)/((-12)/(-56)). Calculate the highest common divisor of 345 and t. 5 Let z(v) = v3 + v2 + 3v + 5. Let c be z(3). Calculate the highest common factor of 10 and c. 10 Let s be 4/(-2) + -6 + 12. Suppose -2r - 27 = -5r + 4f, -sf = r + 7. Suppose rk + 3 = 8, -111 = -2l - 3k. What is the greatest common divisor of l and 6? 6 Let h = 779 - 596. Calculate the greatest common factor of h and 305. 61 Let t = 275 - 263. Let w be (-2)/4 + 2/(-4). Let h be w(-2)/(-1) + 14. Calculate the greatest common divisor of t and h. 12 Suppose 0 = -4l - 16 + 104. Let a = -16 + l. Let n be ((-5312)/(-44))/4 - (-4)/(-22). Calculate the highest common divisor of a and n. 6 Let t be (-1 + 3)1/2. Let s(r) = 3r*3 - 2r*2 + 1. Let a be s(t). Suppose -o = 101 - 117. What is the greatest common factor of o and a? 2 Suppose 4f - 13 - 31 = 0. Calculate the highest common divisor of f and 143. 11 Suppose -4k + 0c + 8 = 5c, 0 = 2k - c - 4. Suppose -7 - 1 = -y. Calculate the highest common factor of k and y. 2 Let h(d) = 8d2 - 14d + 44. Let n be h(6). Calculate the greatest common divisor of n and 93. 31 Suppose 5d + 23 + 2 = z, 0 = d - 2. Calculate the highest common divisor of z and 20. 5 Let w be -78(1 - 6/4). Suppose 2b = -3i + b + 8, 2i - 2 = b. Let q be (34 - 9) + (3 - i). Calculate the highest common divisor of w and q. 13 Suppose -19x + 16x = -1326. Calculate the greatest common factor of x and 51. 17 Let l(c) = c + 31. Let s be l(-25). Let b(r) = r2 - 5r - 5. Let p be b(s). Calculate the highest common divisor of p and 1. 1 Let n = -762 + 355. Let g = n + 279. Let l = g - -184. What is the greatest common factor of l and 8? 8 Let t be (-3)/15 + 2684/20. Let i = -101 + t. Calculate the highest common divisor of 55 and i. 11 Suppose -7b + 268 = -229. Let l = 89 - b. Calculate the greatest common divisor of l and 144. 18 Let i be (-16)/82/2. Let j be 48/28(-7)/i. Let b = 21 + j. What is the highest common factor of b and 3? 3 Suppose 4l = -2 + 10. Suppose -4s = -d + 83, 5d - 420 + 115 = -ls. Let y(b) = 2b*2 - 3b. Let m be y(3). What is the highest common factor of m and d? 9 Suppose -4f - 13 = -5f - 4v, -v - 9 = 2f. Let z = f + 11. Suppose -2c - z - 2 = 5h, 5h + 20 = 0. Calculate the greatest common divisor of c and 63. 7 Suppose -g = -45 - 230. Let i(l) = -5l + 140. Let w be i(23). Calculate the highest common divisor of w and g. 25 Let s be 32 + (-5 - (4 - 13)). Calculate the highest common factor of 48 and s. 12 Suppose -19d - 21d + 1200 = 0. Calculate the greatest common divisor of 1665 and d. 15 Let s(r) = -r*2 - 8r - 4. Let f be s(-7). Let l(y) = 2y3 + 4y*2 - 2y - 2. Let x be l(f). What is the highest common factor of 123 and x? 41 Let t = -72 + 78. Calculate the highest common factor of t and 3. 3 Suppose 22n - 169 = 17n - 4t, -181 = -5n - t. What is the highest common divisor of n and 74? 37 Suppose x - 36 - 15 = -2c, -2c + 3x = -47. What is the greatest common divisor of 425 and c? 25 Suppose -4v + 24b - 19b = -491, 0 = -v + 4b + 120. What is the greatest common factor of v and 62? 62 Let y = 19 - -5. Calculate the highest common divisor of 12 and y. 12 Let l = -380 - -674. What is the greatest common factor of 196 and l? 98 Let k(r) = 55r + 110. Let g be k(8). Calculate the highest common divisor of g and 50. 50 Let i = 53 + -49. Suppose g + 1 = 3w - i, 5g = -4w + 32. What is the greatest common factor of w and 3? 3 Suppose -g - 726 = p - 5p, -906 = -5p + 2g. Let l(c) = c*2 - 2c - 9. Let m be l(-5). What is the highest common factor of p and m? 26 Let b = -349 - -395. Calculate the greatest common factor of 2 and b. 2 Suppose 0 = -6l + 55 + 215. Calculate the greatest common factor of 360 and l. 45 Let q(h) = -h3 - 9h*2 - 10h. Let u(y) = 3y + 1. Let r be 3/(-4) + (-27)/12. Let x be u(r). Let n be q(x). What is the greatest common factor of 48 and n? 16 Let c(s) = -s + 14. Let r be (1 - -3)/(-2) + 4. Let p be c(r). What is the greatest common divisor of p and 4? 4 Let p = -30 + 34. Suppose -29 = -r - ps + 13, -95 = -5r + 3s. Calculate the highest common factor of r and 242. 22 Let i be (-47 - -44) + 1 + 0 + 10. Let q(b) = -b - 1. Let x be q(-7). What is the greatest common divisor of x and i? 2 Let o(q) = q*3 - 23q*2 - 19q + 4. Let y be o(25). Calculate the highest common factor of y and 41. 41 Suppose -48 = -10x - 18. Calculate the highest common divisor of 21 and x. 3 Suppose -5p - 9 - 11 = 0. Let l be 1/2 - 26/p. Let w(i) = i*3 - 8i - 2. Let k be w(3). Calculate the highest common factor of k and l. 1 Let x(a) = -a*2 + 7a + 14. Let v be x(6). Suppose 2w - 400 = w. Let z be (18/4)/(v/w). What is the highest common divisor of 36 and z? 18 Suppose o - 2s = 14, 3o + 3s - 4s = 32. Let t be 254/o - (-8)/(280/21). Calculate the highest common factor of t and 26. 26 Let r(x) = 13x + 1. Let t(u) = u*3 - 5u*2 - 7u + 7. Let h be t(6). Let p be r(h). Let o = -542 + 549. Calculate the greatest common divisor of p and o. 7 Suppose -40 + 250 = 5s - j, 5s + 2j = 195. Calculate the greatest common divisor of 369 and s. 41 Suppose 352 = -30y + 742. Suppose 4v - 429 = -3r - 0v, 0 = -r + 2v + 143. Calculate the greatest common factor of r and y. 13 Let g be (1(0 - -2))/1. Suppose 0 = gt + t + 105. Let v = t + 65. Calculate the highest common divisor of v and 12. 6 Suppose 0 = 4g + 5i - 99, 127i = -g + 129i + 15. Suppose 2s + 4j + j = 61, 0 = -2s - 3j + 59. What is the greatest common factor of g and s? 7 Let b = 71 - 49. Suppose -i = -62 + b. Calculate the greatest common divisor of i and 10. 10 Suppose 17 = 4f - 3y - 73, -2y = -4. Calculate the highest common factor of f and 344. 8 Let l = -868 + 876. Calculate the greatest common factor of 4 and l. 4 Let t be (-26)/(-7) - (-4)/14. Suppose -2r + 0g + 34 = -tg, -r - 3g = -32. Let d be (-98)/(-2) + 7/((-14)/6). What is the greatest common factor of d and r? 23 Let y(p) = -84p - 60. Let f be y(-3). What is the greatest common divisor of f and 144? 48 Let a be -9 + 4 + (904 - (-2 - -1)). What is the highest common factor of 36 and a? 36 Let p = 725 + -497. Calculate the highest common factor of 48 and p. 12 Suppose 16h - 23 = 137. What is the greatest common factor of 150 and h? 10 Suppose -5r = -2v - 3v - 30, 2r + 18 = -4v. Calculate the greatest common factor o	{ "pile_set_name": "DM Mathematics" }
6 + 0z. 5z + 11 Collect the terms in -2a + 6a*2 - 9a*2 - 3a. -3a2 - 5a Collect the terms in 4u - 23u*2 - 4u + 21u2. -2u*2 Collect the terms in -2h - 2h - 8h + 3h. -9h Collect the terms in 22z2 - 7z*2 - 7z*2 - 9z2 - z2. -2z2 Collect the terms in 12 + 4 - 16 + g. g Collect the terms in -2a - 56a3 + 0a + 2a. -56a*3 Collect the terms in -5q + 4q + q + 2q*2. 2q*2 Collect the terms in -23 + 3 + 5v + 20 - 8v. -3v Collect the terms in 27l3 - 25 + 25 - 9l*3. 18l*3 Collect the terms in 2r - 2r - 23r*2 + 31r*2. 8r*2 Collect the terms in 10 - 17 - 2y*2 + 7 - 8y*2. -10y*2 Collect the terms in 270d + 265d - 798d + 262d. -d Collect the terms in r2 - 3r*2 - 3796 + 3796. -2r*2 Collect the terms in -46s*3 - 231s*3 - 21s*3. -298s*3 Collect the terms in x + 5x - 6x + x - 3x. -2x Collect the terms in -20v + v - 16v. -35v Collect the terms in -76p2 - 93p*2 - 339p*2 - 9p*2. -517p*2 Collect the terms in 4c + 221c2 + 214c*2 - 4c - 433c2. 2c*2 Collect the terms in 8v + 0v + 8v + v - 2v. 15v Collect the terms in 12l - 2l - 11l. -l Collect the terms in -68z - 7z - 10z. -85z Collect the terms in -9u*3 + 17u*3 - 8u3 - u3. -u3 Collect the terms in s3 + 259 - 26s - 259. s3 - 26s Collect the terms in 11535q - 11535q + 1 - 12q2. -12q*2 + 1 Collect the terms in 0 + 2 - 879b*2 - 5. -879b*2 - 3 Collect the terms in 15m - 15m - 5m*3 - 8m*3. -13m*3 Collect the terms in -9 + 6 - 1 - 17 - 2v. -2v - 21 Collect the terms in 12i*3 - 606285i*2 + 606285i*2. 12i*3 Collect the terms in 2a - a*3 - 2a + 3236a2 - 3236a2. -a3 Collect the terms in -d*3 + 6d3 + d3 - 3d3. 3d*3 Collect the terms in 3q + 2q + 5q - q2. -q2 + 10q Collect the terms in -2 + 31d*3 + 21d3 + d3 + 65d3. 118d*3 - 2 Collect the terms in 166r*2 + 158r*2 - 333r*2. -9r*2 Collect the terms in 368b + 0 - 366b + 0. 2b Collect the terms in 80b + 81b - 157b. 4b Collect the terms in 237q - 2904q + 156q. -2511q Collect the terms in 4y + y + 25y*3 - 5y. 25y3 Collect the terms in -11a*2 - 1746a + 1746a. -11a*2 Collect the terms in 16a*2 - 66a*2 + 24a*2 + 24a*2. -2a*2 Collect the terms in 655b*3 - 712b*3 + 3 - 3. -57b*3 Collect the terms in 106v - 127 + 127. 106v Collect the terms in 2l*2 - 2270 + 2270. 2l*2 Collect the terms in -10o*2 + 3o*2 - 6o*2. -13o*2 Collect the terms in -14n - 22n + 42n. 6n Collect the terms in -3d - 32 + 32. -3d Collect the terms in -22x + 30x - 15x. -7x Collect the terms in 70n*3 - 21n*3 - 25n*3 - 28n*3. -4n*3 Collect the terms in 75248 + 3g - 75248. 3g Collect the terms in r - 5r + 5r. r Collect the terms in 5617 - 5617 + j2. j2 Collect the terms in -27 + 4s2 - s2 - 9s + 27. 3s*2 - 9s Collect the terms in 4 - 55h - 4 + 31h. -24h Collect the terms in -11 - 21 + 2z + 53 - 21. 2z Collect the terms in 39o - 16 + 16. 39o Collect the terms in 8l*3 - 62 + 62. 8l*3 Collect the terms in -1 + 17n + 4 - 3. 17n Collect the terms in 95g + 82g - 4 - 180g + 4. -3g Collect the terms in 67041r - 67041r - 10 + r3 + 10. r3 Collect the terms in -2h*2 - 3h*2 + 8h*2. 3h*2 Collect the terms in -10c*2 - 5c2 - c2 + 9c2. -7c*2 Collect the terms in 3o*2 + 65o - 65o. 3o*2 Collect the terms in 2 - 8l + l - 2. -7l Collect the terms in 27p - p*2 + 3p*2 - 27p - 4p2. -2p*2 Collect the terms in 0c*3 - 14 + 8 + 7c*3 - 3c*3. 4c*3 - 6 Collect the terms in 12c*3 - 2c2 - c3 + 2c2. 11c*3 Collect the terms in -104l*2 + 48l*2 + 408l*2 + 95l*2. 447l*2 Collect the terms in 4f*3 + 0 + 0 - 6f*3. -2f3 Collect the terms in -z3 + 2z3 + z - z. z3 Collect the terms in -6c*3 + 5445c*2 - 5445c*2. -6c*3 Collect the terms in -625153f + 625153f + 6f*3. 6f*3 Collect the terms in f - 35 + 0f - 2f + 0f. -f - 35 Collect the terms in -40t2 - 25 + 25. -40t*2 Collect the terms in -11m + 30m - 15m. 4m Collect the terms in -5 - 18c - 54c + 5. -72c Collect the terms in 203y - 40y + 196y. 359y Collect the terms in -a + 56373 - 56373. -a Collect the terms in -261n3 - 245n*3 + 496n*3. -10n*3 Collect the terms in 11y*2 - 177 + 177. 11y*2 Collect the terms in 265a*2 - 86a*2 - 88a*2 - 93a*2. -2a*2 Collect the terms in 46c*2 + 39c*2 - 84c2. c2 Collect the terms in 66o3 - 14o*3 - 54o*3. -2o3 Collect the terms in -g2 + 4g2 + 29g*3 - 4g*3. 25g*3 + 3g*2 Collect the terms in -54g*2 + 8g*2 - 74g*2. -120g*2 Collect the terms in -6u + 12u2 - 21u*2 - 5u. -9u2 - 11u Collect the terms in -33b - 29b + 67b. 5b Collect the terms in 3330 + 9b2 - 3330. 9b*2 Collect the terms in -49d*2 - 67d*2 - 65d*2. -181d*2 Collect the terms in 4z + 16z - 23z. -3z Collect the terms in 9817 - 9817 - a. -a Collect the terms in -2 - 564v*3 + 54v*2 - 54v*2. -564v3 - 2 Collect the terms in -o2 - 8o2 + 0o*2. -9o*2 Collect the terms in 228i*3 - 120i*3 - 181i*3. -73i*3 Collect the terms in -8o*3 - 4o*3 - 4o*3 + 5o*3. -11o*3 Collect the terms in -4 + 0 + 0 - 2j. -2j - 4 Collect the terms in -110i + 2 - 5 + 3. -110i Collect the terms in 1837 + 4p3 - 1837 - p3. 3p3 Collect the terms in 14392 - 14392 + 14p*3. 14p*3 Collect the terms in -35 + 2p*2 + 104 - 35 - 34. 2p*2 Collect the terms in -5m*3 - 7m*3 + 4m*3. -8m*3 Collect the terms in 20p - 87 + 86 + 16p. 36p - 1 Collect the terms in 4 + 3q3 - 4 + 6q*3. 9q*3 Collect the terms in 15s*2 + 60s*2 - 81s*2. -6s*2 Collect the terms in g - g + 39g*2 - 2g*2. 37g*2 Collect the terms in 38n*3 + 4n*3 - 17n*3. 25n*3 Collect the terms in 2y - 1313670 + 1313670. 2y Collect the terms in 34y*3 - 10y*3 - 12y*3 - 6y*3. 6y*3 Collect the terms in 340276 + o - 340276. o Collect the terms in 9n3 + n3 - 5n3 - n3. 4n*3 Collect the terms in 45q*3 - 5q*2 + 5q*2 - 16q*3. 29q*3 Collect the terms in -3q*3 - 8q*3 + 11q*3 - 9q*3. -9q*3 Collect the terms in -6u*2 + 52u*3 - 15u*3 + 6u*2. 37u*3 Collect the terms in 124o*3 + 133o*3 - 258o3. -o3 Collect the terms in 5v2 + 7v*2 - 10v*2 + 6v*3 + 8v*3. 14v*3 + 2v*2 Collect the terms in -c + 27c - 19c. 7c Collect the terms in 148 - 311 - 3n2 + 163. -3n*2 Collect the terms in 3f*2 - 6f*2 + 5f*2 - 5f*2 + 8f*2. 5f*2 Collect the terms in 276 - 276 - m. -m Collect the terms in -5i*2 - 21i*2 + 23i*2. -3i*2 Collect the terms in -588195 + 588195 + z. z Collect the terms in -19f*2 - 2f*2 + 21f*2 + 3f*3. 3f*3 Collect the terms in 145f*2 - 31f*2 + 84f*2. 198f*2 Collect the terms in -4n*2 - 43 - 40 + 83. -4n*2 Collect the terms in -13y*2 + 2y*2 + 11y2 - y3. -y*3 Collect the terms in -4i*3 + 6i*3 - 22i*3 + 2i*3 - 22i*3. -40i*3 Collect the terms in -27j*2 - 8j*2 + 16j*2 - 15j*2. -34j*2 Collect the terms in -63l*2 + 15l*2 + 0l + 0l. -48l*2 Collect the terms in 26a*2 + 28a*2 + 31a*2 - 113a*2 + 26a*2. -2a*2 Collect the terms in 3f*2 - 2f2 + f2 + 2f2. 4f*2 Collect the terms in 57d - 57d - 4d*3. -4d*3 Collect the terms in -4g*2 - 7g*2 + 17g*2 + g. 6g*2 + g Collect the terms in -98 - 16x + 98. -16x Collect the terms in 13r - 19r - 85r - 26r - 2. -117r - 2 Collect the terms in 3q + q2 - 7q*3 + 7q*2 - 8q*2. -7q*3 + 3q Collect the terms in 33o2 - 90o*2 - 83o*2. -140o*2 Collect the terms in -30q - 52q + 10q. -72q Collect the terms in 0t*3 - 2t*3 - 4t*3 + 2t*3. -4t*3 Collect the terms in 1 + 3g2 - g3 - 1 - g2. -g3 + 2g2 Collect the terms in 2129c*2 + 2152c*2 - 4278c*2. 3c*2 Collect the terms in 13 + 23 - 8a*3 - 36. -8a*3 Collect the terms in 67q - q - 11q. 55q Collect the terms in 174l3 - 356l*3 + 175l*3. -7l*3 Collect the terms in 23t - 1 + 2t2 + 1 - 36t. 2t2 - 13t Collect the terms in 61 + 13r - 6r + 32 - 17. 7r + 76 Collect the terms in 4m + 2*m -	{ "pile_set_name": "DM Mathematics" }
s divided by a? 5 Suppose 4w = -5o + 7w + 150, o = -4w + 30. What is the remainder when (-8)/(-6)87/2 is divided by o? 28 Let z(w) = -w3 - w - 1. Let m be z(-1). Suppose -3n - 3b + 6 = -b, -4b = 4n - 8. Suppose nh - m = 1. Calculate the remainder when 1 is divided by h. 0 Suppose 0 = 5g - 3i - 14 - 15, 4g = 5i + 31. What is the remainder when 10 is divided by g? 2 Let x = 957 - 149. Calculate the remainder when x is divided by 30. 28 Let t be 10/6 + (-4)/(-84)7. Suppose t = h, -4n + 0h = -h - 422. What is the remainder when n is divided by 12? 10 Let q = 919 - 518. Calculate the remainder when q is divided by 26. 11 What is the remainder when (72 - -438)(-2)/(-4) is divided by 30? 15 Let h = 41 + -42. What is the remainder when (1 - h)/((-18)/(-1161)) is divided by 33? 30 Let x(v) = -v*2 + 17v + 1. Let a be x(8). Suppose -3h - z + 0z = -41, 5z = -4h + a. What is the remainder when (-102)/(-4)16/12 is divided by h? 10 Suppose -f + 200 = 61. What is the remainder when f is divided by 16? 11 Suppose -15i + 14i = -w - 8, 76 = 5i + 4w. What is the remainder when 204 is divided by i? 0 Suppose -4m + y - 88 = -269, 5m - 4y = 218. What is the remainder when m is divided by 21? 4 Suppose -4b = 3h - 57, h - 2b = -3h + 98. Calculate the remainder when 160 is divided by h. 22 Let z = -19 - -29. Let d be (-6)/12 + 15/2. Suppose dx - 190 = 2x. What is the remainder when x is divided by z? 8 Let o = -37 + 45. Let w(l) = -5l - 1. What is the remainder when w(-7) is divided by o - ((-3)/3 - 0)? 7 Let w(n) = n2 + 8n + 23. Let g(i) = -i*2 + 8i - 1. What is the remainder when g(5) is divided by w(-3)? 6 Suppose -g = f - 10, 0 = 4g - 4f - 4 - 28. What is the remainder when (6/g)/((-4)/(-330)) is divided by 8? 7 Let i be (4/(-6))/((-5)/(-225)). Let m be i/(-45) + 22/(-6). What is the remainder when 47 is divided by (-2)/(-2) + (6 - m)? 7 Let u = 284 - 245. Let a(l) = -l*2 + 7l. Calculate the remainder when u is divided by a(5). 9 Let q = -56 + 235. Suppose -q = -6g - 41. What is the remainder when 67 is divided by g? 21 Let h(r) = -5r*3 - 3r*2 + 2r + 7. Let l(i) = -4i3 - 2i*2 - 2. What is the remainder when l(-3) is divided by h(-2)? 26 Let s(w) = 103w + 1. Let d = 698 + -677. Calculate the remainder when s(1) is divided by d. 20 What is the remainder when 259 is divided by ((-609)/(98/(-14)))/(2 - 1)? 85 Let k(v) = -v2. Let w(b) = b3 - 6b2 + 3. Let q(p) = -4k(p) + w(p). Let x = -17 - -36. Calculate the remainder when q(4) is divided by x. 16 Let k(r) = -r + 135. Let a be k(0). Let q = a + -18. What is the remainder when q is divided by 17? 15 Calculate the remainder when 21/(-3) + 378/2 is divided by 17. 12 Suppose -8n + 3n + 25 = 0. Suppose -18 = -2h + 2d, 2h - d + 15 = nh. Suppose -hj + 3j + 18 = 0. What is the remainder when 23 is divided by j? 5 Let o be 130/6 - 3/(-9). Suppose 5r + o - 72 = 0. Suppose -4q + 33 = -123. Calculate the remainder when q is divided by r. 9 Calculate the remainder when 15 + 12 - 1/1 is divided by 16. 10 Calculate the remainder when -3 - -2 - 237(-7)/21 is divided by 40. 38 Let a = 54 - 25. Let f = 34 - a. Suppose 0r - ft = 5r - 40, -r + 8 = 2t. Calculate the remainder when 63 is divided by r. 7 Suppose 4b + 4x = -0b + 36, -5b + 47 = 4x. Suppose -13 = -8t + b. Calculate the remainder when (5/(-2))/(2/(-4)) is divided by t. 2 Calculate the remainder when 155 is divided by (1 + (-4)/12)/(16/936). 38 Let s be (-18)/45 - (-12)/5. Let r be (s/(-6))/(6/(-108)). Suppose -68 = 2h - rh. What is the remainder when h is divided by 10? 7 What is the remainder when 4/14 - 245190/(-462) is divided by 13? 11 Let l(f) = 18f + 366. What is the remainder when 113 is divided by l(-19)? 17 Let d be (-13)/(-13) + (-53)/1. Let r = d + 98. Calculate the remainder when r is divided by 12. 10 Suppose -3h + 43 = 2h + 3y, 0 = 5h - 4y - 71. Let d = h - 2. Suppose -2f = 3u - 66, -5 + 59 = 2u - 2f. What is the remainder when u is divided by d? 6 Suppose -247 = 35q - 48q. What is the remainder when 91 is divided by q? 15 Calculate the remainder when 1(3 + -4 + -4)-51 is divided by 29. 23 Let v = 105 + -84. What is the remainder when 37 is divided by v? 16 Suppose 3x = -2x + 3d + 23, -2x + 10 = -2d. Suppose xu - 27 = 17. Let v = 4 + u. What is the remainder when 74 is divided by v? 14 Let h(s) = 4s - 28. Calculate the remainder when 77 is divided by h(10). 5 Let v be (-6)/(-24) + 126/8. Suppose 15w - v = 11w. Suppose -14x = -13x - w. What is the remainder when 5 is divided by x? 1 Suppose 3j = -190 - 14. Calculate the remainder when -4 - (-2 + j - -4) is divided by 13. 10 What is the remainder when 5/(-5) - -4 - (3 - 154) is divided by 34? 18 Let b = -20 - -23. Suppose 2r - 3 - b = 0. Calculate the remainder when 11 is divided by r. 2 Let h be 3(1 - (-1)/3). Suppose -4d - 2l + 20 = 0, -5l + h = 4d - 10. Calculate the remainder when d is divided by 3. 0 What is the remainder when (-6)/9 + 1/(9/492) is divided by 3? 0 Let x = -31 + 31. Let h(d) = 2d + 16. What is the remainder when 61 is divided by h(x)? 13 Let g = -2654 + 2672. What is the remainder when 573 is divided by g? 15 Let g(p) = 8p + 26. Let h(b) = b3 - 16b*2 + 14b + 21. Calculate the remainder when h(15) is divided by g(-3). 0 Suppose 0 = -4p - 1 - 3. Calculate the remainder when p/((-64)/(-65) - 1) is divided by 22. 21 Suppose -s = 3s - 152. Calculate the remainder when s is divided by (-30)/(-8)576/216. 8 Let n be (2/(-3))/(8/(-12)). Let o(y) = 135y. What is the remainder when o(n) is divided by 35? 30 Let b be 3(-2 + 10/(-15)). What is the remainder when 368/b2/(-4) is divided by 14? 9 Calculate the remainder when 6 + -12 - -461 - -13 is divided by 161. 146 Let x be 8/(-4) + 0 + 154. Suppose -5r + x = -103. Suppose -9 = -3s + 2s + 3a, a = -s + 21. What is the remainder when r is divided by s? 15 Suppose v = 3v - 4. Suppose 0 = -vb - 4p + 20, 0 = b + p - 1 - 8. Let y(h) = -h2 - 6h - 5. Calculate the remainder when b is divided by y(-4). 2 Let l = -29 + 50. Let r(i) = -6i2 + i3 + 8i - 24 - 30 + 45. Calculate the remainder when l is divided by r(5). 3 What is the remainder when (-1)/((8/13)/(-8)) is divided by 10? 3 Suppose 42z - 26z = 928. What is the remainder when 106 is divided by z? 48 Suppose 5h - 2f - 25 = 10, -5h + 15 = 2f. Suppose 2p - hb = 6p - 380, 4p - b = 356. What is the remainder when p is divided by 23? 21 Let s be (-10)/25 + (-22)/(-5). Suppose -98 - s = -17n. Calculate the remainder when 23 is divided by n. 5 Suppose 0 = 2t + t + 18. Let g(h) = -h*3 - 7h*2 - 7h + 11. What is the remainder when 30 is divided by g(t)? 13 Suppose -700f + 1188 = -694f. Calculate the remainder when f is divided by 36. 18 Suppose -5t + 1 = -3q, -3q - 5 = -t - 0t. Let i = 22 + t. Let u(k) = -38k + 1. What is the remainder when u(-1) is divided by i? 18 Suppose 10s - 20 = 100. Calculate the remainder when 19 is divided by s. 7 Suppose 0 = 21p - 1986 - 3705. Suppose 0 = 3y - 2i - 100, 0 = 4y - 5i - 103 - 28. What is the remainder when p is divided by y? 33 Suppose -275q + 276q - 23 = 0. What is the remainder when 85 is divided by q? 16 Let d(n) = -n2 + 71n - 345. What is the remainder when 210 is divided by d(65)? 30 Let i(q) = -5q + 8. Let x(k) = -k. Let g(d) = -i(d) + 4x(d). Let p be g(7). Let r = p - -7. Calculate the remainder when 21 is divided by r. 3 Suppose 2v = -2h + 12, 0 = 4h - 3v - 19 + 2. Suppose -u + 312 = hu. Calculate the remainder when u is divided by 11. 8 Let p = -485 + 633. What is the remainder when p is divided by 19? 15 Let w(y) = y3 - 4y*2 + 9y - 43. Calculate the remainder when w(5) is divided by 17. 10 Suppose 2r - 57 = 5x, -r - 29 - 14 = 4x. Let p = x - -44. Suppose 4j = 525 - 1. What is the remainder when j is divided by p? 32 Let c be ((-104)/(-20) - 4)/((-6)/20). Calculate the remainder when 3 is divided by (-46)/(-14) - (c/(-7))/2. 0 Let c be (-2)/2 - (-28)/7. Suppose 8 = y + cy. Suppose 2x - 3a = -0a + 10, 0 = -yx - 4a - 4. Calculate the remainder when 6 is divided by x. 0 Suppose 2u = 6u + 5c + 49, 0 = 3u + 2*c + 28. Calculate the remainder when 27 is divided by (-4	{ "pile_set_name": "DM Mathematics" }
7. What are the prime factors of f? 3 Suppose 54 = 2o - 0o. List the prime factors of o. 3 Let f(a) = -2a3 - 8a*2 - 8a - 5. Let l be f(-5). Suppose -4m + 9 = -r - 106, 3m = 2r + l. List the prime factors of m. 29 Suppose 0 = -5g + 6b - 5b + 168, -g - b + 36 = 0. List the prime factors of g. 2, 17 Let s = 61 + -36. What are the prime factors of s? 5 Let q(a) = 5a + 9. Let k(b) = 14b + 26. Let z(i) = 6k(i) - 17q(i). Let n(r) = -r*2 - 3r - 4. Let m be n(-4). What are the prime factors of z(m)? 11 Suppose 0l - 19 = -2l + s, -2l - 4s - 6 = 0. What are the prime factors of l? 7 Let f(p) = p*2 - 6p + 6. Let g be f(4). Let b = 5 + g. What are the prime factors of b? 3 Let a = 11 - 8. Suppose -3z = -2f + 5f - 48, -4z + af = -50. What are the prime factors of z? 2, 7 Suppose z - 2 = -l - l, -4l - 80 = -5z. Suppose z = 4g - 24. List the prime factors of g. 3 Let s(y) = y*2 - 2y + 1. Let z(o) = -o + 1. Let q(j) = 2s(j) - 4z(j). Let k be q(2). What are the prime factors of (-6)/5(-20)/k? 2 Suppose 11 - 1 = -2z. Let l(y) = y*3 + 4y*2 - 5y + 4. What are the prime factors of l(z)? 2 Let o(t) = -t3 + t2 - t + 11. Let w be o(0). Let q = -1 + w. What are the prime factors of q? 2, 5 Let n(p) = -3 + 0 + 9p - 2p - 2p. List the prime factors of n(11). 2, 13 Let g(o) = 2o*2 - 2o - 3. Let c be g(-2). What are the prime factors of (-37)/(-3) + (-3)/c? 2, 3 Let t(r) = r*3 - 12r*2 + 10r - 14. Let l be t(11). What are the prime factors of (-360)/l + (-2)/5? 2, 7 Suppose -p + 2 = -0p. Suppose 7i - 10 = pi. What are the prime factors of i? 2 Let x be 4/6 + 98/6. Suppose -x = -d + 5. List the prime factors of d. 2, 11 Let u(r) = 3r*3 - 11r*2 + 9r + 5. Let b(l) = -4l3 + 10l*2 - 8l - 5. Let t(p) = -2b(p) - 3u(p). List the prime factors of t(12). 7 Suppose 4h - 9 = 2r - 1, 0 = 3r + h + 5. Let g(j) = -9j*3 - 2. Let c be g(r). Suppose c = 6l - l - 2m, -5l + m + 70 = 0. List the prime factors of l. 2, 7 Let k(o) = -8o + 4. Let h be k(-2). Let d = h - -16. What are the prime factors of d? 2, 3 Let o(a) = -a + 40. List the prime factors of o(20). 2, 5 Let z be 1/(((-9)/(-3))/(-12)). Let a be (-10)/z8/5. What are the prime factors of (a - 1)2/3? 2 Suppose 3d = -5g + 545, 4g = -6d + 2d + 436. What are the prime factors of g? 109 Suppose -5p = -2i + 3i - 84, 5p - 82 = -3i. What are the prime factors of p? 17 Suppose -7 = 2f + 11. Let m = f + 18. Let q = m - -5. What are the prime factors of q? 2, 7 Suppose 3h - 14 + 5 = 0. List the prime factors of h/(-12)-78. 2, 7 Let n = 1 + 4. Let x(a) = -n - 1 + 4a - 2a. List the prime factors of x(5). 2 Let t = -174 - -310. Suppose -13y + t = -9y. List the prime factors of y. 2, 17 Let b(k) = 3 - 4 - 2k + k + 6. Let d be b(-5). Suppose 4q = 2c + 22, 5 + d = -5c. List the prime factors of q. 2 Suppose 0 = -5c + 4w + 2000, 12c = 16c + 3w - 1600. List the prime factors of c. 2, 5 Suppose -7k + 4k = -294. List the prime factors of k. 2, 7 Let b(m) be the first derivative of 4m3/3 + m + 1. Suppose -5 = -5a - 0. What are the prime factors of b(a)? 5 Suppose -10 - 20 = -5w. Suppose wn = 9n - 33. List the prime factors of n. 11 Let c be (4-7)/(2/(-2)). What are the prime factors of 4/(-14) + 540/c? 19 Suppose f - 8 = 4d, 0d - 13 = -4f - 3d. Suppose fo - 23 = -3j, j = 3o - 0o - 1. Suppose jg = 3g + 12. List the prime factors of g. 2, 3 Let d(y) = -y*3 + 5y*2 + 9y - 7. Let s be d(6). Let o be (-2)/s - 48/(-22). What are the prime factors of o/3(-18)/(-4)? 3 Let g(n) = -n2 + 7n - 6. Let a be g(6). Suppose a = -4l - 5p - 0p - 10, -l + 2p = -4. Suppose -4r + 6 + 2 = l. List the prime factors of r. 2 Let x = 141 - 76. List the prime factors of x. 5, 13 Let b = -25 - -10. What are the prime factors of (-310)/b + (-2)/(-6)? 3, 7 What are the prime factors of -1(2 + -181)? 2 Let r be (-12)/(-3) - -2 - 4. What are the prime factors of r/(2/19) + -3? 2 Let i be -1 + 3 + (0 - -3). Suppose -p = -3m + 2m, -12 = -p - im. Suppose 5 = l - p. List the prime factors of l. 7 Suppose -4g = -2v - 70, 4g - 23 - 32 = 5v. What are the prime factors of g? 2, 5 Let b(a) = -a*2 - 38a. List the prime factors of b(-17). 3, 7, 17 List the prime factors of (-1 - -8)(7 + (-3 - 0)). 2, 7 Suppose 0 = 3s + s - 20. Let j be 5/s21. What are the prime factors of 4/j1 - -11? 13 Let m be (-2 - (-2 - -1))-5. Let a = m + 2. What are the prime factors of a? 7 List the prime factors of (5/3)/((-60)/(-72)). 2 Suppose v + 3g - g = 8, -5v + 3g = -53. Suppose -5b + 6b - v = 0. What are the prime factors of b? 2, 5 Suppose -3p = 2 + 1. Let q be (p + 10)/1-1. Let z = 3 - q. What are the prime factors of z? 2, 3 Suppose 3r = -0r - 9. Let f be 5/(-2)12/(-3). Let x = f + r. List the prime factors of x. 7 Suppose 0 = 3p - p - 3c - 364, p = c + 183. List the prime factors of 6/8 - p/(-4). 47 Suppose -418 = -3n + 98. Suppose -n = -0q - 4q. List the prime factors of q. 43 Suppose -l + 425 = 4l. Let o = l - 54. What are the prime factors of o? 31 Suppose -3i + i + 4 = 0. Suppose -4k + ib = -120, 4k - 40 = b + 76. What are the prime factors of k? 2, 7 Suppose -24 = -2g - 0g. Suppose i - g + 1 = 0. List the prime factors of i. 11 Let x(d) = -d*2 + 1 + 2d - 6d - 4d - 6. What are the prime factors of x(-5)? 2, 5 Suppose 3c - 5r = 430, -5c + 316 = -3c + 4r. List the prime factors of c. 2, 3, 5 Let t(n) = -3n + 6. Let f be t(3). What are the prime factors of f + (57 + 0 - -4)? 2, 29 Suppose -332 = -8m + 1004. List the prime factors of m. 167 Suppose 348 = 5w - 102. What are the prime factors of w? 2, 3, 5 Suppose 26 = -0z + z. Let y = -17 + z. List the prime factors of y. 3 Suppose 5x - 56 = x. Suppose -3j - 3 = 18. Let d = j + x. What are the prime factors of d? 7 Suppose 3m + m = 104. Suppose 5q + 4a - 72 = 0, 4q - m = 5a + 7. List the prime factors of q. 2, 3 Let u(c) = 4c + 1. Let y be u(1). Suppose 16 = yv - 59. List the prime factors of v. 3, 5 Let t(j) = 5j3 - 8j*2 - 7j - 2. Let f(a) = 14a3 - 23a*2 - 20a - 6. Let b(d) = -4f(d) + 11t(d). List the prime factors of b(3). 2, 5 Suppose 7m = 3m - 16. Let d be -9 - -10 - 33. What are the prime factors of (-114)/d - (-1)/m? 2, 7 Suppose -4o = 4y + 8, 4y - 2y + 8 = 0. Suppose 2b - 8 = -ob. What are the prime factors of b? 2 Let l = -67 - -153. What are the prime factors of l? 2, 43 Let s be (3 - 3) + 0 + 0. Suppose -5x = z - 8, s = 3z - z - 2x - 40. What are the prime factors of z? 2, 3 Let q(v) = v*3 - 4v*2 + 3. Let s = -9 - -35. Suppose g - 5p = 5 - s, 20 = 4p. What are the prime factors of q(g)? 3 Suppose -14 = a - 3a. Suppose -7 = -w + a. List the prime factors of w. 2, 7 Suppose 4a + 4z = -48, a - 11 = 5z + 1. List the prime factors of (-32)/a + 4/2. 2, 3 Let x = 15 - -14. List the prime factors of x. 29 Suppose 0 = 3q - 18 - 42. Suppose 0 = -4r - q, 3j - 30 = -2j + 4r. What are the prime factors of j? 2 Let b = 3 - 1. List the prime factors of b. 2 Let v(n) = 12n2 - n - 1. Let k = -4 - -3. Let y be v(k). What are the prime factors of (y/(-3))/(-1) - 0? 2 Let x(w) = w2 - 4w - 5. Let t be x(5). Suppose -4d + 6d - 26 = t. What are the prime factors of d? 13 Let k(o) = -o*3 - 2o*2 + 7o - 1. List the prime factors of k(-5). 3, 13 Suppose 10 = -2a - 2. What are the prime factors of (-2)/4(-4 + a)? 5 Let q(i) = i*3 - 5i*2 - 12i + 14. List the prime factors of q(7). 2, 7 Let b be (6/18)/(1/24). Suppose -b = -d + 5. What are the prime factors of d? 13 Let r(z) = z - 8. Let t be 12/20 - (-64)/10. Let k be r(t). What are the prime factors of 1 + k1-2? 3 Suppose -17 = -p + 3i, -29 = -0p - 5p + i. List the prime factors of p. 5 Suppose -8 = 3w + 1. Let v be (-27)/184/w. Suppose -3o - 9 = 5z, -vz + 0 - 2 = 2o. What are the prime factors of o? 2 Let z(m) = m3 + 5m*2 - 11m + 7. List the prime factors of z(-6). 37 Suppose 0 = -0i - 4i. Suppose -4m = -i + 8. List the prime factors of 0 + 2/m - -11. 2, 5 Suppose 133 = 4k - 67. Suppose 5f - k = -0f. What are the prime factors of f? 2, 5 Let l be 147/35 - 2/10. Let k be (1 - 2)/(l/8). List the prime factors of k + 2 + (-14)/(-2). 7 Suppose 0a + 3a	{ "pile_set_name": "DM Mathematics" }
- 1 Let x(t) = -5t3 - 6t*2 - 6t. Let q(j) = 0j + 0j3 + j + j2 + j*3. Suppose -119 + 124 = 3f - 2y, -f = 4y + 17. Calculate fx(i) - 6q(i). -i*3 Let c(f) = 6f2 + 192. Let k(z) = z2 - 1. Calculate -c(w) + 4k(w). -2w2 - 196 Let w(s) = s2 - s - 1. Let n be w(0). Let p(k) = 1. Let f(t) = -3t + 1. Let c = -418 + 420. Determine cp(y) + nf(y). 3y + 1 Let r(d) = -5d3 + d. Let g be r(-1). Let a(n) = n2 + 2n + 4 + n + n. Let u(h) = 2h2 + 9h + 9. What is gu(q) - 9a(q)? -q2 Let b(x) = x2 + x - 1. Let n(c) = -c*3 + 2c*2 + 4c - 2. Determine 2b(a) - n(a). a3 - 2a Let z(g) = 3g - g + 2 + 3g*2 + 0g*2. Let j(u) be the first derivative of 2u*3/3 + 3u*2/2 + 3u + 38. What is -2j(i) + 3z(i)? 5i2 Let u(s) = -1674s - 108. Let r(b) = 4b + 2. Determine -54r(w) - u(w). 1458w Let x(r) = 14r*2 - 5r - 2. Let f(q) = 26q2 - 10q - 5. Give 2f(l) - 5x(l). -18l2 + 5l Let p(t) be the second derivative of t4/12 + t2 - 5t. Let k(x) = -x3 - 4x*2 - 7. Suppose 10m = 5m + 10. Give mk(a) + 7p(a). -2a3 - a2 Let u(j) = j - 14. Let a = 439 - 443. Let q(f) = -5. Give au(m) + 11q(m). -4m + 1 Let r(c) = -4c - 2. Let x = -122 + 119. Let u(s) = 5s + 4. Let w(j) = 15j + 13. Let y(v) = 7u(v) - 2w(v). What is xr(g) - 2y(g)? 2g + 2 Let h(m) = -m + 5. Let g(o) = 3o - 9. Suppose -6f - 655 = -589. Calculate fh(b) - 6g(b). -7b - 1 Let u(t) = t*2 - 16. Let q(c) = 3c*2 - 48. Determine -3q(k) + 8u(k). -k2 + 16 Let k(f) = 2f*3 - 12f*2 - 213f. Let g(a) = 5a3 - 26a*2 - 426a. Calculate -6g(v) + 13k(v). -4v3 - 213v Let f(q) = q*2 + q + 6. Let d(a) = 5. Suppose 124 = 23r + 170. Calculate rf(k) + 3d(k). -2k2 - 2k + 3 Let n(o) = 4o3 - 7o*2 - 63o + 7. Let c(y) = 2y3 - 3y*2 - 32y + 3. What is -7c(i) + 3n(i)? -2i3 + 35i Let j(i) = 14i2 - i - 12. Let l(d) = -5d*2. What is -j(b) - 2l(b)? -4b2 + b + 12 Let h(l) = 14l*3 + 6l*2 - 163l. Let v(j) = 26j3 + 11j*2 - 325j. What is 11h(r) - 6v(r)? -2r3 + 157r Let d(o) = -o*2 + 1. Let v(c) = 1593c*2 - 2124. Give -2124d(i) - v(i). 531i2 Let d(z) = -50 + 4z - 48 + 98 - 3z2. Let l(m) = -12m*2 + 17m + 1. Give -9d(w) + 2l(w). 3w2 - 2w + 2 Let d = -343 - -348. Let c(p) = -10p - 15. Let o(g) = -7g - 10. Determine dc(j) - 7o(j). -j - 5 Let n(j) = -4j + 1. Let f(y) = y3 - 2y*2 - 5y + 3. Let r be f(3). Let c(p) = 4p - 1. Calculate rn(a) - 4c(a). -4a + 1 Let t(y) = -4 - y*3 - y + 8y*3 - 3y3. Let v(c) = -c3 - 2c2 + 2c*2 + 4 - 3. What is 2t(s) + 9v(s)? -s3 - 2s + 1 Let r(g) = 7g2 - 5g - 1. Let z(f) = 16f2 - 12f - 1. What is -5r(j) + 2z(j)? -3j2 + j + 3 Let i(c) = -c3 + 2c*2 + 4. Let p(n) = -2n*3 + 2n*2 + 5. Let r = -150 - -145. What is rp(a) + 6i(a)? 4a*3 + 2a*2 - 1 Let n(j) = -2j + 0j + 3 + 8j - 2 - 9j - j2. Let b(z) = -z2 - z. Give b(m) + n(m). -2m*2 - 4m + 1 Let f(k) = 1375k - 30. Let v(i) = 3i - 3. What is -f(s) + 10v(s)? -1345s Let w(u) = -6u2 + 10u - 5. Let d(y) = -y*2 + 2y - 1. Let c(j) = -5d(j) + w(j). Let k(q) = -q2. Determine -4c(x) - k(x). 5x2 Let k = 23 - 20. Let d(r) be the third derivative of -1/12r*4 + 3r*2 + 0r*3 + 0 + 0r. Let p(b) = b. Give kd(o) + 8p(o). 2o Let w(q) = -515q*2 + 3. Let u(o) = -2574o*2 + 14. Determine -3u(h) + 14w(h). 512h*2 Let f(u) = -5u3 - u2 - 43u + 3. Let x(w) = 2w*3 + 42w - 2. Determine -2f(r) - 3x(r). 4r3 + 2r*2 - 40r Let i(z) = -2z2 + 3z - 3. Let k(m) = -11m2 + 17m - 17. Let a = 54 + -51. Suppose -5v - 4b - 10 = 0, -3b - a = -0v + 3v. Determine vk(u) + 34i(u). -2u*2 Let m(g) = 2g*2 + 5g - 8. Let s(k) = -4k2 - 9k + 15. Let y be (-10 + 1)4/6. What is ys(h) - 11m(h)? 2h*2 - h - 2 Let z(p) = -10p*2 + 6 - 41p + 3p3 - 12p + 48p. Let i(l) = -3l*3 + 9l*2 + 4l - 5. Give 6i(w) + 5z(w). -3w3 + 4w*2 - w Suppose 636s - 99 = 603s. Let z(c) = -c3 - c2 - 5c + 3. Let y(b) = -b - b*3 + 3 - 4 + 2. Give sy(r) - z(r). -2r3 + r2 + 2r Let d(m) = 36m - 401m*2 + 53m - 17m + 68m*2. Let i(w) = -23w*2 + 5w. Give 5d(v) - 72i(v). -9v2 Let f(w) = -7w*2 - 5w - 5. Let v(j) = -j*3 + 2j*2 + 51j - 101. Let y be v(2). Let g(r) = r*2 - r - 1. Determine yf(s) - 5g(s). -12s*2 Let x(t) be the first derivative of 0t + 5/4t4 - 11 - 5/2t*2 - 2t*3. Let c(p) = 4p*3 - 5p*2 - 4p. Give -4c(r) + 3x(r). -r*3 + 2r*2 + r Let g(r) = 72r + 4. Let v(t) = -73t - 3. Give 5g(d) + 6v(d). -78d + 2 Let f(h) = h2 + 1. Let n(w) = w2 - w + 2. Let r be (((-96)/6)/4)/(1-2). What is rf(q) - n(q)? q*2 + q Let w(x) = 3x*3 - 76x. Let o(i) = 4i3 - 75i. What is 2o(b) - 3w(b)? -b*3 + 78b Let z(m) = 23m. Let b(f) = 11f. Suppose 2q - 12 = 4a, -3q - 2a - 15 = -1. What is qz(h) + 5b(h)? 9h Let w = -482 + 480. Let m(j) = -3j*2 - 2. Let u = -4 + 9. Let x(l) = -7l*2 - 5. Calculate um(y) + wx(y). -y2 Let y(r) = -9r + 2. Let q be (2/(-14)-12)/(18/(-63)). Let u(a) = -5a + 1. Calculate qy(j) + 11u(j). -j - 1 Let a(t) = 4t2 + 4t - 1. Let o(z) be the third derivative of z*5/15 + 5z4/24 - z3/6 - z*2 + 7. What is 5a(k) - 4o(k)? 4k*2 - 1 Suppose 6w = 12w + 12. Let b(n) = 3n*2 - 2n - 4. Let p(u) = u*2 + u + 1. What is wp(k) - b(k)? -5k2 + 2 Let i(c) = 4c + 4. Let m(n) = n*3 + 15n*2 - 17n - 11. Let t be m(-16). Let l(p) = -1 - 6p - 6 + 0 + 1. Give tl(j) + 8i(j). 2j + 2 Let o(t) = -3t - 9. Let g(w) = 2w + 5. Let s(n) = n*3 + 14n*2 - 27n + 87. Let c be s(-16). Give cg(x) + 4o(x). 2x - 1 Let n(o) = -15o*3 + 2o*2 - 2o - 4. Let s(p) be the first derivative of -4p4 + p3 - 3p*2/2 - 5p - 138. What is 3n(h) - 2s(h)? -13h3 - 2 Let i(v) = 3v*2 + v - 17. Let b(n) = 2n*2 + n - 9. Give -7b(t) + 4i(t). -2t*2 - 3t - 5 Let h(g) = -16g + 10. Let j(c) = -1195 + 597 + 597 + c. Calculate h(t) + 8j(t). -8t + 2 Let z(v) = -2v + 3. Let d = -135 + 132. Let m(w) = -2w + 4. What is dm(o) + 4z(o)? -2o Let d(y) be the third derivative of -16y2 + 0 + 0y*3 - 1/24y*4 + 0y. Let l(f) = 5f2 - 6f. Calculate -6d(k) + l(k). 5k*2 Let w(q) = 4q - 2. Let s be 78/124/(-2). Let i(b) = 8b - 4. Calculate sw(l) + 6i(l). -4l + 2 Let c(r) = -r2 + 2r + 3. Let u(x) = 3x2 - 3x - 4. What is 3c(i) + 2u(i)? 3i2 + 1 Let j(o) = o - 1. Let l(i) be the third derivative of -i6/80 + i5/10 + i4/8 - i2. Let p(c) be the second derivative of l(c). Give -12j(h) - p(h). -3h Let b(y) = 17 - 4 - 3y - 4y + 4y. Let z(d) = -21 + 4d + 2d - 6 + 0d. Let m(k) = -5b(k) - 2z(k). Let g(l) = l - 5. Give 5g(v) - 2m(v). -v - 3 Let z(n) = -4n*2 - 2n - 8. Let w = -9 - -7. Let v be w/(-3)(-63)/6. Let k = v + 1. Let u(a) = -11a*2 - 6a - 23. What is ku(d) + 17z(d)? -2d2 + 2d + 2 Let s(v) be the third derivative of -v*4/12 + 4v*2. Let x(h) = h. Let b be 10/(-4)(-14 + 12). Suppose -3u = -b - 4. What is us(j) + 4x(j)? -2j Let m(r) = r*2 - 3r + 40. Let k(o) = -o + 2. Calculate 3k(u) - m(u). -u2 - 34 Let s(o) = 2o*3 + 7o*2 - 7o - 3. Let v = -43 + 78. Suppose 0 = -13u + 8u + v. Let k(p) = -p*3 - 3p*2 + 3p + 1. Calculate uk(m) + 3s(m). -m3 - 2 Let n(f) = -f2 + 7f - 4. Let s(a) = -a2 + 8a - 3. Give 3n(b) - 4s(b). b*2 - 11b Let o(j) = -j*3 - 7j*2 + 7j. Let t(k) = -2k2 + 2k. Let s be ((7 - 4) + 11)/2. Calculate st(g) - 2o(g). 2g3 Let z(c) = c3 - c - 1. Let q = -1 + 6. Suppose 4 = a + q. Suppose 15 = 5r, -14 = 2d + r - 5. Let x(o) = -9o*3 + 6o + 6. Determine ax(m) + dz(m). 3m3 Suppose 4l - 16 = 4. Suppose 6r - 31 = l. Let o(m) = 7m + 1. Let s(t) = -6t - 1. Calculate rs(z) + 5o(z). -z - 1 Let u(h) = -h + 3. Let a(f) = -10f - 13f - 12f - 16 - 22f + 63f. Determine 2a(n) + 11u(n). n + 1 Suppose f + 0f = 2. Let g be ((-2)/(-4))/(f/8). Let c(n) = 0 - 7n - 2 + 2n + 7ng. Let h(a) = -a2 + a. What is c(b) + 5h(b)? 2b*2 - 2 Let v(f) = -12f*2 + 23f + 27. Let d(n) = -4n2 + 8n + 9. Give -17d(a) + 6v(a). -4a2 + 2a + 9 Let f(x) = 10x2 - 3x - 4. Let o(c) = -32c2 + 10c + 12. Let d(w) = 10f(w) + 3o(w). Let r(h) = -9*	{ "pile_set_name": "DM Mathematics" }
14bw*2 wrt w. -42b*3w + 28bw Find the second derivative of 83b3 + 3b*2 - 314b - 2 wrt b. 498b + 6 Find the first derivative of -3m*2 - 136m + 319. -6m - 136 Differentiate k4 + 108k - 224 with respect to k. 4k3 + 108 What is the derivative of 78cx2y - 3cy*2 + 11x*2y - 2x2 - 9y*2 wrt c? 78x*2y - 3y2 Find the third derivative of -249i*4 - 299i*2. -5976i What is the first derivative of -274h4 + 1466? -1096h*3 What is the second derivative of 5q*3 - 16q*2 + 171q? 30q - 32 Differentiate -h3 - 33h + 151 with respect to h. -3h2 - 33 Differentiate 2ips*2 - 3ip - 5is2 - 6ps2 - 24p + s + 2 wrt s. 4ips - 10is - 12ps + 1 What is the third derivative of -437n*5v - n*3v - 23n2v - 172n2 wrt n? -26220n*2v - 6v What is the first derivative of k2sw + k2s + 3ksw - 40sw - 410s wrt w? k*2s + 3ks - 40s Find the third derivative of 14hy3 + 71hy2 + 12h - y*4 - 3y*3 + 1 wrt y. 84h - 24y - 18 Find the second derivative of 7355m*5 + 3m + 1651. 147100m3 What is the second derivative of 3dp2x - 2dp*2 - 3dpx + 15p2x + px + 17x wrt p? 6dx - 4d + 30x Find the third derivative of 25a3 + 145a*2. 150 What is the third derivative of -2h*5 - 3h*4u*2 - 4h*3u - 38h2 + 7hu2 wrt h? -120h*2 - 72hu2 - 24u What is the second derivative of -5d2r + 3d2 + 324dr wrt d? -10r + 6 Find the second derivative of 46f3l*2r*2 - 10f*3lr2 + f3r - 3f2l*2 + 54fl2 + 5l*2r + 2r2 wrt r. 92f*3l*2 - 20f*3l + 4 What is the derivative of 13f2j*2 + 28f*2j + fj3 + 2j*3 + 99j*2 wrt f? 26fj2 + 56fj + j3 Differentiate -8u*3vz - 68u*3v - 4018u3z + 1 with respect to v. -8u3z - 68u3 What is the second derivative of 10689k*2 - 3779k wrt k? 21378 What is the third derivative of 181v4 + v3 - 13304v*2? 4344v + 6 What is the second derivative of -4289m2 - 3761m? -8578 What is the first derivative of 2160fp*3 + 7597p*3 wrt f? 2160p*3 Find the first derivative of 909a*2 + a + 2047 wrt a. 1818a + 1 Find the third derivative of 24n2y4 - n2y - 2ny4 + 9ny - 5y3 - y2 wrt y. 576n2y - 48ny - 30 What is the second derivative of -10087l3x*2 - 2281l*3x + 3l2 wrt x? -20174l*3 Find the third derivative of -14g*5l3 + g5l - 2g*2l2 - g2l - 12l*3 wrt g. -840g*2l*3 + 60g*2l What is the first derivative of 1683l + 6851 wrt l? 1683 What is the derivative of -439gv - 5585g - 6v wrt v? -439g - 6 What is the second derivative of 4487c5 + 2c*4 + 70c - 43? 89740c3 + 24c*2 Find the third derivative of os*4t - 4os*2t - 5o - 12s*4t - 6s3t - t wrt s. 24ost - 288st - 36t Find the second derivative of 10k2o*2v*2 - 3k*2ov3 + 6k*2 - 5ko2v*3 - 2kv3 - 85o*2v*2 + 2v*3 wrt k. 20o*2v*2 - 6ov3 + 12 What is the second derivative of 11fqx*2 + fqx + 3fq - 2fx2 + 2fx - 85qx2 - 190qx + 2x wrt x? 22fq - 4f - 170q Find the third derivative of -9m5q - 2m4q + m*2q + 3m - 30q wrt m. -540m2q - 48mq Differentiate 624l2w + lw2 - 754w*2 with respect to l. 1248lw + w2 Find the third derivative of 2af4s + 5794af*4 + 18afs - 2as + 4f2s wrt f. 48afs + 139056af Differentiate 20k*3u - k*2u + k*2 + 29ku - 7u - 1096 wrt k. 60k2u - 2ku + 2k + 29u Find the first derivative of -3d3o3 + d3o - 15d*3 + 102do + 31 wrt o. -9d*3o2 + d3 + 102d Differentiate 107t*2u + 3t2 - 2u*2 + 43 wrt u. 107t*2 - 4u What is the second derivative of 72fk*5 + fk*4 - 8fk - f + k3 + 9k - 6 wrt k? 1440fk*3 + 12fk2 + 6k What is the derivative of -3958k2m - 623k2 wrt m? -3958k*2 Find the second derivative of -2d*3ilr + 5d3i + 52d3l*2r + 3d3l*2 + 2d*3 + il*2 - 3l wrt l. 104d3r + 6d3 + 2i Find the third derivative of -162o5 - o2 + 82o. -9720o2 What is the third derivative of 5b*2d*3w + 2b2d*3 - 6b*2d*2w - 3b2d*2 + 3bdw wrt d? 30b2w + 12b2 What is the third derivative of -144p*3 - 289p*2? -864 Find the second derivative of -2g*2p*4 - 13g*2p + 9g2 + 2gp - 2g + 7669p4 wrt p. -24g*2p*2 + 92028p*2 What is the first derivative of -226y*4 + 177? -904y*3 Find the second derivative of 2930w*5 + 3576w. 58600w3 What is the third derivative of 6m*5 + 101m*4 - 3m*2 - 32? 360m*2 + 2424m What is the third derivative of 161a3ps + 2a*3s - 19a2ps - 2a*2s - 8ps wrt a? 966ps + 12s Find the third derivative of 2f*4 + 13f*3 - 2f*2 + 4f. 48f + 78 Find the third derivative of -3h*5m*2 - 89h*5 - 2h*2 - 155hm2 - 3m*2 wrt h. -180h*2m*2 - 5340h*2 What is the first derivative of 558w*2 + 14? 1116w Find the third derivative of -2g3o*3 + 176g*3 - 149g*2o*3 wrt g. -12o*3 + 1056 What is the first derivative of 2789i*3 - i - 1742? 8367i*2 - 1 Find the second derivative of 85ix2 - 6507ix + 7x*5 + x wrt x. 170i + 140x3 What is the second derivative of -7n*2q*2 - 2n*2 - 4nq - n + 6q*3 wrt q? -14n*2 + 36q Differentiate -2f4m*2 + 129f*3m*2 + 19m*2 - 4 with respect to f. -8f*3m*2 + 387f*2m*2 Find the second derivative of -44l*2 + l wrt l. -88 Find the second derivative of -2o*4r + 182o3r*2 - or*2 + 181or - 1 wrt o. -24o*2r + 1092or*2 What is the third derivative of -518d*5 - 198d*2? -31080d*2 What is the second derivative of 70t*3 - 846t wrt t? 420t Find the third derivative of 8jq4 + 2j + 5q5 - q2 + 19q wrt q. 192jq + 300q2 Differentiate -233t*3 + 843. -699t*2 What is the first derivative of 2v*4 + 1391v + 3624 wrt v? 8v3 + 1391 Find the second derivative of -3417c*2 - 507c wrt c. -6834 Find the second derivative of 233cf*3 + cf*2 - 2136cf + f2 - 2f wrt f. 1398cf + 2c + 2 What is the second derivative of a3b*4 - 2a*3b + 138a3 - 29a*2b*4 wrt b? 12a*3b*2 - 348a*2b*2 What is the first derivative of 206z*3 - 245 wrt z? 618z*2 Find the third derivative of -149x*3 - 17x*2 + 1 wrt x. -894 What is the derivative of 2h*2iw - 26h*2 - 2hi2 + 6hw - i2w wrt w? 2h2i + 6h - i2 Find the second derivative of 9925k*2p + 154kp + 2k - 4p wrt k. 19850p What is the first derivative of -15s4 - s2 - 324 wrt s? -60s3 - 2s Find the third derivative of -25o4 - 4o*2 + 41o. -600o What is the third derivative of -520g*5 + 2g*3 - 4g*2 + 210g? -31200g2 + 12 Find the second derivative of 39j*4z*2 + 2jz2 + jz - 15z2 wrt j. 468j*2z*2 Differentiate -12i*2q*2 + 8i*2q + 7i2 - 1756q*2 + 4 wrt i. -24iq2 + 16iq + 14i Find the third derivative of 5h6y*3 - 32h*4y*3 - 12h*2y*3 - hy*3 + 8hy2 wrt h. 600h*3y*3 - 768hy3 What is the third derivative of -1398h*4 + 1400h*2 + 2? -33552h Find the first derivative of -315o3q - oq3 + 717q*3 wrt o. -945o*2q - q*3 What is the first derivative of 2x*2z*3 - 3311xz3 - 529z*3 + 1 wrt x? 4xz3 - 3311z*3 What is the first derivative of -299u*4 - 1258? -1196u*3 What is the third derivative of 8913r*6 - 11573r*2? 1069560r*3 Differentiate -82d*2w*2 + 11133d*2wz + 2d*2 - dw*2z + w*2 + w wrt z. 11133d*2w - dw2 Find the third derivative of -454k6 - k3 + 1098k2. -54480k*3 - 6 What is the second derivative of 19u*3 + 2u + 26? 114u What is the derivative of 1460y*3 + 1753? 4380y*2 Find the second derivative of 7010v*4 + 13108v wrt v. 84120v2 Find the third derivative of 224g*6wx - g4w2 - g2wx + 4gw + 53g + 2w*2x + 2x wrt g. 26880g*3wx - 24gw2 What is the derivative of -12462fs + 7113s wrt f? -12462s Find the third derivative of -2dn5z - 90dn*3z - 35dn*2 + 8nz wrt n. -120dn2z - 540dz What is the second derivative of 67h4y*3 - 6hy3 + 3hy - h wrt h? 804h*2y**3 What is the second derivative	{ "pile_set_name": "DM Mathematics" }
t 346, -19, 1, -1 in increasing order. -19, -1, 1, 346 Sort -25, 0, -5, -3, -4, 5, 1619 in descending order. 1619, 5, 0, -3, -4, -5, -25 Sort 7, 6153, 3, -7. -7, 3, 7, 6153 Sort 162, -5, 4, -3, 5, 1, -16 in decreasing order. 162, 5, 4, 1, -3, -5, -16 Put 0.2, -245, -1237, -5, 5 in ascending order. -1237, -245, -5, 0.2, 5 Sort -86, 171, 2, -5, -10, -4, 13. -86, -10, -5, -4, 2, 13, 171 Put 0.3, 6, 2143, -4, 26 in ascending order. -4, 0.3, 6, 26, 2143 Sort -8, 30004, 6, 69 in descending order. 30004, 69, 6, -8 Put 0.04, -8, -0.02, -4, 16/223 in descending order. 16/223, 0.04, -0.02, -4, -8 Put 1837, -3, 3, 3058 in decreasing order. 3058, 1837, 3, -3 Sort -39.4, -2/11, 12.7, -233 in increasing order. -233, -39.4, -2/11, 12.7 Sort -15, 2.1881, 1, 2/7 in descending order. 2.1881, 1, 2/7, -15 Sort 2/21, 81, -25, -0.5, -0.01 in decreasing order. 81, 2/21, -0.01, -0.5, -25 Sort -23, 0, 134.88 in descending order. 134.88, 0, -23 Sort -1, 6, 878, 2/13, -1/12 in increasing order. -1, -1/12, 2/13, 6, 878 Sort -2/321, -1.6, -3, 5, -0.2, 86 in increasing order. -3, -1.6, -0.2, -2/321, 5, 86 Sort 5, -3, 198, 7886 in increasing order. -3, 5, 198, 7886 Sort 37, 17, -0.06, 4, -17/2 in decreasing order. 37, 17, 4, -0.06, -17/2 Put -4/7, -5, -0.23, -21/17, -4/13 in increasing order. -5, -21/17, -4/7, -4/13, -0.23 Put 6, 2, -2, 10, -5, 4, 165 in descending order. 165, 10, 6, 4, 2, -2, -5 Sort -6540, -68, -3, 1 in increasing order. -6540, -68, -3, 1 Sort -1, 0, -79, 1, 2, -3, 934. -79, -3, -1, 0, 1, 2, 934 Sort 32, -2, 4, -15, -1, -436. -436, -15, -2, -1, 4, 32 Sort 14, 0, -3019405 in descending order. 14, 0, -3019405 Sort 14, 28963, -36. -36, 14, 28963 Sort -5, -417, -10, -146, -3, 4 in descending order. 4, -3, -5, -10, -146, -417 Sort -1/2, 4, 3034, 0.122 in ascending order. -1/2, 0.122, 4, 3034 Put -0.5, 168, 11, 293.9 in descending order. 293.9, 168, 11, -0.5 Sort 4190, -5, -2, 3, 2, -146 in descending order. 4190, 3, 2, -2, -5, -146 Put -4, 14, 6, 4, -10305 in increasing order. -10305, -4, 4, 6, 14 Sort -0.2, -655, -2/13, -0.022 in ascending order. -655, -0.2, -2/13, -0.022 Put -1/5, -1/8, -14, 3, 9253, 7 in decreasing order. 9253, 7, 3, -1/8, -1/5, -14 Put -4, 1, -3, -702, 145, 2 in decreasing order. 145, 2, 1, -3, -4, -702 Put 1, 113, -34, -7 in decreasing order. 113, 1, -7, -34 Put 4, 0.135, 14443 in ascending order. 0.135, 4, 14443 Put -73, 753/5, 451 in increasing order. -73, 753/5, 451 Put 4, 46, 51, -3, -5, 35 in increasing order. -5, -3, 4, 35, 46, 51 Put 3, 0, -0.03, -5, -99, 0.4, -12 in descending order. 3, 0.4, 0, -0.03, -5, -12, -99 Sort 32, -1279, 0, 44 in descending order. 44, 32, 0, -1279 Sort -26/43, 0.5, 12, 1, 4/7 in increasing order. -26/43, 0.5, 4/7, 1, 12 Sort 5, -2, 223, 182, -4, 0 in descending order. 223, 182, 5, 0, -2, -4 Put 2/3, -1/13257133, 0.1 in decreasing order. 2/3, 0.1, -1/13257133 Sort -2, -92, -30/401, 0, -6 in ascending order. -92, -6, -2, -30/401, 0 Sort -3.7, 3/7, 0.415, -0.3 in descending order. 3/7, 0.415, -0.3, -3.7 Sort -1/7, -0.0297, 0.08, -1, 1/19 in ascending order. -1, -1/7, -0.0297, 1/19, 0.08 Sort 5, -1/4, -10498, 1, 335 in decreasing order. 335, 5, 1, -1/4, -10498 Sort -56, 17, 5, 103, -5 in descending order. 103, 17, 5, -5, -56 Put -1/3, 9, -7, 11405/11 in decreasing order. 11405/11, 9, -1/3, -7 Put -4, -3/2, 7.8, 5, 55/12, 0.001 in decreasing order. 7.8, 5, 55/12, 0.001, -3/2, -4 Put 3, -2, -2380173 in ascending order. -2380173, -2, 3 Put -2, -39, -1, -25, 2, 44, 10 in descending order. 44, 10, 2, -1, -2, -25, -39 Put -0.5, -1/3, -3.47144, 0.03 in ascending order. -3.47144, -0.5, -1/3, 0.03 Put 1, -2, 0, -5, 4, -3303843 in decreasing order. 4, 1, 0, -2, -5, -3303843 Sort -5, -68, -8455, 4, 1 in increasing order. -8455, -68, -5, 1, 4 Put 3, 2, 4, -2419, -5, -6, 24 in increasing order. -2419, -6, -5, 2, 3, 4, 24 Sort 0.3, 6, 3/17, -2, -40, -0.1 in ascending order. -40, -2, -0.1, 3/17, 0.3, 6 Put -4, -2, 20964, -1, 1, 17 in decreasing order. 20964, 17, 1, -1, -2, -4 Put 1, -3838, 17044 in ascending order. -3838, 1, 17044 Put -350, 0, 795, 2/13, 41 in descending order. 795, 41, 2/13, 0, -350 Sort 10, -0.71, -2, 0, -1/2 in ascending order. -2, -0.71, -1/2, 0, 10 Put -13, -0.14, 2, -78, 449, 5 in increasing order. -78, -13, -0.14, 2, 5, 449 Sort 5/4, 0.054, 46.17 in descending order. 46.17, 5/4, 0.054 Put 732, 29, -285, -2/7 in descending order. 732, 29, -2/7, -285 Put -2, -189/143, -0.069, -0.3 in increasing order. -2, -189/143, -0.3, -0.069 Sort -710, -229, 0, -23 in increasing order. -710, -229, -23, 0 Sort -77, 0, -22, 3, -4 in ascending order. -77, -22, -4, 0, 3 Sort 5, 1, -0.2, -0.684, -172. -172, -0.684, -0.2, 1, 5 Put 17.363, -97/3, 3/4 in decreasing order. 17.363, 3/4, -97/3 Put 1955, 1/4, 0.3, 2/110001 in ascending order. 2/110001, 1/4, 0.3, 1955 Sort 1, -114, 268, -13, -3, 3 in decreasing order. 268, 3, 1, -3, -13, -114 Sort 0, 1688, 1, 7 in increasing order. 0, 1, 7, 1688 Sort 5, 14.9, -0.1, -7.811. -7.811, -0.1, 5, 14.9 Sort -6, -239, -4, 0, -3, -9, -72 in descending order. 0, -3, -4, -6, -9, -72, -239 Sort 9, 1478, 1, -3, 5, 4 in ascending order. -3, 1, 4, 5, 9, 1478 Put 66, 0.1, -1/5, -27/16, 113.5 in descending order. 113.5, 66, 0.1, -1/5, -27/16 Sort -1998, 0.3, -0.1, 6, -3/11 in ascending order. -1998, -3/11, -0.1, 0.3, 6 Put -4, 5, 45, 256, -5, 19 in decreasing order. 256, 45, 19, 5, -4, -5 Put 38, 1/4, 517.94, -2/7 in decreasing order. 517.94, 38, 1/4, -2/7 Sort 2655, -46, 57. -46, 57, 2655 Put -10/8147, -2073, -3/2 in descending order. -10/8147, -3/2, -2073 Sort -0.4, 267, -11.4, -4, 4/11. -11.4, -4, -0.4, 4/11, 267 Sort 39, 11, -7, 32, 1 in decreasing order. 39, 32, 11, 1, -7 Put 533, 44, 28, -4, 1 in ascending order. -4, 1, 28, 44, 533 Sort -7, -1, 453, 2, -5, 55 in ascending order. -7, -5, -1, 2, 55, 453 Sort -64979, -23, 4, 6, -2, 5. -64979, -23, -2, 4, 5, 6 Put 2/5, -15688065, 2 in ascending order. -15688065, 2/5, 2 Put -12, 0, -9, -20, -2, 11, -4 in decreasing order. 11, 0, -2, -4, -9, -12, -20 Sort -2/17, 146, 17, 738, -1, -2. -2, -1, -2/17, 17, 146, 738 Sort -19, 204, -336/31 in decreasing order. 204, -336/31, -19 Put 79435, 4, 1, 3, 5 in descending order. 79435, 5, 4, 3, 1 Sort -767, -19081, 4, -5. -19081, -767, -5, 4 Put -1, 2, -558, 12984 in decreasing order. 12984, 2, -1, -558 Sort 1, -23, -479, 0, 5, 4, -1 in ascending order. -479, -23, -1, 0, 1, 4, 5 Sort 651, -204, 107, -4. -204, -4, 107, 651 Sort 143/2, 77/4, -1.8, 3 in decreasing order. 143/2, 77/4, 3, -1.8 Sort 518, 2.984, 0.5, 4, 3/8 in descending order. 518, 4, 2.984, 0.5, 3/8 Sort 0, -341, -2/64969 in increasing order. -341, -2/64969, 0 Sort -3, 1888, 19, -4, 5, 4, -311. -311, -4, -3, 4, 5, 19, 1888 Sort 0, 114198, -8 in increasing order. -8, 0, 114198 Sort -168609, 0, 10 in descending order. 10, 0, -168609 Put 4/9, -1/2, -9, 35, 1/11, 3, 4 in increasing order. -9, -1/2, 1/11, 4/9, 3, 4, 35 Put -4, -237, -3, 781, 4, 5 in decreasing order. 781, 5, 4, -3, -4, -237 Sort 0, 1, -12, -34, -3, -1, 7 in descending order. 7, 1, 0, -1, -3, -12, -34 Put 0.123, 2/19, 14.38583 in decreasing order. 14.38583, 0.123, 2/19 Sort -85, 3174/25, -2/7 in decreasing order. 3174/25, -2/7, -85 Sort -4, 13, 8/1861. -4, 8/1861, 13 Sort -1162.3, -2, 1/18, -5, 0.1. -1162.3, -5, -2, 1/18, 0.1 Sort 6, -5, 3, -3, -1038 in decreasing order. 6, 3, -3, -5, -1038 Put -83, 18293, -1 in decreasing order. 18293, -1, -83 Put 5, -3, -22, 21650, 0 in increasing order. -22, -3, 0, 5, 21650 Sort -2, -35420, 3, -3, -5 in increasing order. -35420, -5, -3, -2, 3 Sort 54/23, -1, 3, -1/5, 105 in decreasing order. 105, 3, 54/23, -1/5, -1 Sort 1584, -1, 3, 2705, -2, -3. -3, -2, -1, 3, 1584, 2705 Sort 0.01, 4/7, -436, -2, -5, 0.5 in descending order. 4/7, 0.5, 0.01, -2, -5, -436 Put -2/3, -58.6, 2/98925 in decreasing order. 2/98925, -2/3, -58.6 Put 3, 76, -6, 4, -1, -2, -19675 in increasing order. -19675, -6, -2, -1, 3, 4, 76 Put 79, -149, -2, -4, 3331 in ascending order. -149, -4, -2, 79, 3331 Put 0.7919, -5, -3, -0.48 in descending order. 0.7919, -0.48, -3, -5 Sort 1, 2, 25, -40, -2, 115149 in descending order. 115149, 25, 2, 1, -2, -40 Put 1/2, 3933, 62.558 in descending order. 3933, 62.558, 1/2 Sort -54, -4.7, -708. -708, -54, -4.7 Sort 18, -114, -3, -1, 0.85, -2 in d	{ "pile_set_name": "DM Mathematics" }
composite? False Is 71897303 a prime number? True Is 5286326071 prime? False Is 16963268599 composite? False Is 320818177 a composite number? True Is 41740275371 a prime number? True Is 395605087 composite? False Is 2681869219 prime? False Is 1475180443 composite? True Is 36793296655 prime? False Is 197565163 composite? True Is 1034239911 prime? False Is 19940374537 composite? False Is 7880295307 composite? False Is 133255909 a composite number? True Is 10109986891 prime? True Is 2276663669 a prime number? False Is 1453852259 prime? False Is 811663561 a composite number? True Is 1515040937 a composite number? True Is 52144547803 prime? True Is 1729199039 a prime number? False Is 66091873931 composite? True Is 3413765221 prime? True Is 16180556551 a composite number? True Is 2902639903 a composite number? False Is 17618203618 a composite number? True Is 85164582571 prime? False Is 596137561 a composite number? False Is 788358367 composite? True Is 1666384933 a composite number? False Is 388574057 a prime number? False Is 2028212191 a prime number? True Is 309590644719 composite? True Is 1798851047 a composite number? True Is 3174710281 a prime number? True Is 116098931461 composite? False Is 14275740721 a composite number? True Is 1913872399 a composite number? False Is 829965905 prime? False Is 248578087 prime? True Is 15497485903 prime? False Is 713242693 a composite number? False Is 9685024819 a prime number? False Is 14162955133 a composite number? True Is 3377315551 composite? True Is 30160015811 a prime number? True Is 5056063553 a composite number? True Is 183514027279 prime? False Is 167350243 a composite number? False Is 4080410303 prime? False Is 138732467 composite? False Is 26098972301 composite? True Is 28669794283 a prime number? False Is 697788439 a composite number? True Is 23043598367 a prime number? False Is 10671407119 prime? True Is 6010351849 composite? False Is 36036702727 a prime number? True Is 4199095391 prime? True Is 1623993409 composite? False Is 88006633255 a composite number? True Is 1325794087 a prime number? False Is 25948061 prime? False Is 1300768621 a prime number? True Is 159421693 a prime number? False Is 11764392929 a composite number? False Is 203207281 a composite number? True Is 554938987 composite? True Is 1538821811 a prime number? True Is 30589589801 prime? False Is 4356369911 composite? False Is 5330497 composite? True Is 152034583 a composite number? False Is 181197740551 prime? True Is 529304557 a prime number? True Is 147331157731 prime? True Is 826487839 a prime number? True Is 95450683 a composite number? False Is 1167649661 a prime number? True Is 2633690206471 prime? True Is 3053288158 prime? False Is 33540033529 a prime number? True Is 51611443907 a composite number? False Is 21316395169 prime? False Is 2795683357 prime? True Is 33330389429 composite? False Is 6267368579 prime? True Is 49927053641 a prime number? True Is 871751731 composite? True Is 8997027661 a composite number? False Is 17902329919 composite? True Is 10173914683 a prime number? False Is 36918050363 composite? False Is 103072102537 composite? True Is 71695697 a composite number? True Is 1946767513 a composite number? False Is 57502903 a prime number? False Is 3010977941 a composite number? False Is 52656772039 a composite number? True Is 3801068554 a composite number? True Is 1159158467 prime? True Is 2154473987 composite? True Is 1210035107 a composite number? True Is 4283589731 a prime number? False Is 12434425513 composite? False Is 6926644381 prime? True Is 17892339943 a composite number? True Is 185750569 composite? False Is 739470917 prime? True Is 11638400329 composite? False Is 1961710433 a composite number? False Is 138641329 a prime number? True Is 35886309769 composite? False Is 8127137959 prime? False Is 137670428801 composite? False Is 461236483 composite? False Is 1981453259 a composite number? False Is 39773758459 a prime number? False Is 580260641 composite? True Is 8604018923 prime? True Is 561775978 a composite number? True Is 4267524247 prime? False Is 179451841 composite? False Is 2296498762 a prime number? False Is 88599077 a prime number? False Is 1793986547 a prime number? False Is 41103571099 a prime number? False Is 9279583 composite? False Is 3551010157 a prime number? True Is 1168788779 a prime number? False Is 14412194099 prime? True Is 1613751811 a composite number? True Is 190886777 a prime number? False Is 4594261993 a prime number? True Is 2171275571 prime? True Is 46325789 prime? False Is 1502964803 prime? True Is 2971415789 a prime number? False Is 1533109093 prime? False Is 1989932849 composite? False Is 61495038953 a prime number? False Is 34877490607 composite? False Is 282712733 a prime number? False Is 323801321 a composite number? False Is 20468059409 a prime number? False Is 4503092029 prime? False Is 7294967377 a prime number? True Is 1934374753 a composite number? False Is 5312432329 prime? False Is 53496131 a composite number? True Is 17711393819 a prime number? False Is 948669061 a composite number? True Is 484437245 a prime number? False Is 14749764717 a prime number? False Is 2450863277 a composite number? False Is 44279055619 composite? False Is 102258288001 a prime number? True Is 20162261373 a prime number? False Is 13943351857 composite? True Is 18862820413 composite? False Is 1153626787 a prime number? True Is 2243753543 prime? True Is 824146651 composite? False Is 6666335941 a prime number? False Is 672399389 a composite number? False Is 2656717127 a prime number? True Is 33711191747 a composite number? True Is 44078009 prime? False Is 19002174567 composite? True Is 73032804193 composite? False Is 76131975961 a composite number? False Is 7081633345 prime? False Is 38539329677 composite? True Is 3770703571 a prime number? False Is 4228592273 composite? True Is 12497579837 a prime number? True Is 906128299 composite? False Is 1796211453 a composite number? True Is 2835374771 a composite number? True Is 7775579473 prime? True Is 38833391 a composite number? False Is 181484733967 a composite number? True Is 3786789829 a prime number? False Is 129222716101 a composite number? False Is 223404561493 prime? True Is 12201973013 composite? True Is 9283347109 a prime number? True Is 46389839897 a prime number? True Is 79340780117 prime? False Is 18291173 a prime number? True Is 22052392393 a prime number? True Is 84254959 a prime number? False Is 335147279 prime? False Is 14998408405 a prime number? False Is 50027883 prime? False Is 1486502887 composite? True Is 34846197359 composite? False Is 206852960477 a composite number? True Is 146448933937 a composite number? False Is 1219332767 prime? True Is 447074761 prime? False Is 59642567539 composite? True Is 247275031 composite? False Is 27007133 prime? True Is 7633256437 a prime number? True Is 3396104599 composite? True Is 3895103803 a prime number? False Is 76167041 composite? False Is 104274289 composite? True Is 971195611 a composite number? False Is 14792283281 a prime number? False Is 1581088469 composite? True Is 1670903437 composite? True Is 1481367967 a composite number? True Is 95584382147 composite? True Is 1132873631 a composite number? True Is 8668381577 composite? True Is 220610297 prime? False Is 602646983 a prime number? True Is 6575556439 composite? True Is 8185900493 prime? False Is 83151581027 a prime number? False Is 1619653253 composite? False Is 1103699647 a prime number? True Is 65040873 a composite number? True Is 764187497 composite? True Is 8824242299 a composite number? False Is 646846567 a composite number? False Is 472734995 composite? True Is 2290046729 a prime number? False Is 16397723471 a composite number? False Is 26346451387 prime? True Is 321278779 prime? True Is 229119221 a prime number? True Is 55625455471 prime? True Is 766408663 prime? True Is 3892593641 prime? True Is 6104813207 composite? True Is 8432370887 composite? True Is 611526701 a composite number? True Is 1661560391 a composite number? False Is 205400027597 prime? False Is 12162189397 composite? False Is 32527245739 a composite number? False Is 1575044831 a prime number? False Is 95288671 a prime number? True Is 39658838239 prime	{ "pile_set_name": "DM Mathematics" }
me factors of 75195? 3, 5, 557 What are the prime factors of 551? 19, 29 List the prime factors of 1510. 2, 5, 151 List the prime factors of 3482. 2, 1741 What are the prime factors of 1258? 2, 17, 37 What are the prime factors of 1911? 3, 7, 13 List the prime factors of 2425. 5, 97 What are the prime factors of 721? 7, 103 What are the prime factors of 472? 2, 59 What are the prime factors of 1282? 2, 641 What are the prime factors of 170857? 170857 List the prime factors of 3070. 2, 5, 307 List the prime factors of 1655. 5, 331 List the prime factors of 12935. 5, 13, 199 List the prime factors of 892. 2, 223 What are the prime factors of 4203? 3, 467 What are the prime factors of 2655? 3, 5, 59 List the prime factors of 2164. 2, 541 What are the prime factors of 790? 2, 5, 79 List the prime factors of 1838. 2, 919 List the prime factors of 5325. 3, 5, 71 What are the prime factors of 1444? 2, 19 List the prime factors of 5514. 2, 3, 919 List the prime factors of 7047. 3, 29 What are the prime factors of 287? 7, 41 List the prime factors of 8903. 29, 307 What are the prime factors of 2551? 2551 List the prime factors of 5684. 2, 7, 29 What are the prime factors of 1919? 19, 101 What are the prime factors of 3367? 7, 13, 37 List the prime factors of 5330. 2, 5, 13, 41 List the prime factors of 2706. 2, 3, 11, 41 List the prime factors of 125851. 11, 17, 673 What are the prime factors of 578? 2, 17 What are the prime factors of 82474? 2, 7, 43, 137 List the prime factors of 65545. 5, 13109 What are the prime factors of 451? 11, 41 What are the prime factors of 727? 727 What are the prime factors of 1164? 2, 3, 97 List the prime factors of 1318. 2, 659 What are the prime factors of 2587? 13, 199 What are the prime factors of 11751? 3, 3917 What are the prime factors of 10106? 2, 31, 163 What are the prime factors of 496? 2, 31 List the prime factors of 3982. 2, 11, 181 List the prime factors of 548. 2, 137 List the prime factors of 9. 3 List the prime factors of 4758. 2, 3, 13, 61 What are the prime factors of 119? 7, 17 List the prime factors of 365. 5, 73 What are the prime factors of 24103? 24103 What are the prime factors of 10762? 2, 5381 List the prime factors of 795. 3, 5, 53 List the prime factors of 5033. 7, 719 List the prime factors of 17993. 19, 947 What are the prime factors of 4278? 2, 3, 23, 31 What are the prime factors of 1555? 5, 311 List the prime factors of 488. 2, 61 What are the prime factors of 30523? 131, 233 What are the prime factors of 1926? 2, 3, 107 List the prime factors of 1551. 3, 11, 47 List the prime factors of 40099. 40099 What are the prime factors of 84008? 2, 10501 List the prime factors of 44261. 7, 6323 List the prime factors of 31455. 3, 5, 233 List the prime factors of 1056. 2, 3, 11 List the prime factors of 311. 311 List the prime factors of 3808. 2, 7, 17 What are the prime factors of 82214? 2, 11, 37, 101 What are the prime factors of 4663? 4663 What are the prime factors of 2231? 23, 97 List the prime factors of 973. 7, 139 What are the prime factors of 25543? 7, 41, 89 What are the prime factors of 10227? 3, 7, 487 List the prime factors of 22992. 2, 3, 479 What are the prime factors of 169171? 167, 1013 What are the prime factors of 32149? 13, 2473 What are the prime factors of 1913? 1913 List the prime factors of 545. 5, 109 List the prime factors of 4952. 2, 619 List the prime factors of 1080. 2, 3, 5 List the prime factors of 18329. 18329 List the prime factors of 10621. 13, 19, 43 List the prime factors of 790. 2, 5, 79 List the prime factors of 5963. 67, 89 List the prime factors of 881. 881 List the prime factors of 60131. 157, 383 List the prime factors of 54556. 2, 23, 593 List the prime factors of 292. 2, 73 What are the prime factors of 143? 11, 13 List the prime factors of 855. 3, 5, 19 What are the prime factors of 427? 7, 61 List the prime factors of 47539. 137, 347 List the prime factors of 2493. 3, 277 List the prime factors of 440. 2, 5, 11 What are the prime factors of 2252? 2, 563 What are the prime factors of 16023? 3, 7, 109 List the prime factors of 5791. 5791 List the prime factors of 7273. 7, 1039 List the prime factors of 673. 673 What are the prime factors of 482? 2, 241 What are the prime factors of 54742? 2, 101, 271 What are the prime factors of 276? 2, 3, 23 What are the prime factors of 138? 2, 3, 23 What are the prime factors of 2231? 23, 97 What are the prime factors of 4803? 3, 1601 What are the prime factors of 1716? 2, 3, 11, 13 List the prime factors of 2367. 3, 263 What are the prime factors of 19960? 2, 5, 499 What are the prime factors of 4821? 3, 1607 What are the prime factors of 8640? 2, 3, 5 List the prime factors of 25661. 67, 383 List the prime factors of 407. 11, 37 What are the prime factors of 7593? 3, 2531 What are the prime factors of 1204? 2, 7, 43 What are the prime factors of 1831? 1831 What are the prime factors of 654? 2, 3, 109 List the prime factors of 1201. 1201 What are the prime factors of 33237? 3, 1231 List the prime factors of 12671. 12671 What are the prime factors of 30599? 37, 827 What are the prime factors of 9446? 2, 4723 What are the prime factors of 1428? 2, 3, 7, 17 What are the prime factors of 10545? 3, 5, 19, 37 What are the prime factors of 13407? 3, 41, 109 What are the prime factors of 857? 857 What are the prime factors of 49648? 2, 29, 107 What are the prime factors of 74764? 2, 18691 List the prime factors of 30555. 3, 5, 7, 97 What are the prime factors of 28684? 2, 71, 101 List the prime factors of 7152. 2, 3, 149 What are the prime factors of 4618? 2, 2309 List the prime factors of 47. 47 List the prime factors of 823. 823 List the prime factors of 7011. 3, 19, 41 List the prime factors of 92. 2, 23 What are the prime factors of 3434? 2, 17, 101 What are the prime factors of 3780? 2, 3, 5, 7 List the prime factors of 11263. 7, 1609 What are the prime factors of 78769? 227, 347 List the prime factors of 46930. 2, 5, 13, 19 List the prime factors of 3921. 3, 1307 List the prime factors of 65328. 2, 3, 1361 What are the prime factors of 3460? 2, 5, 173 List the prime factors of 939. 3, 313 What are the prime factors of 24290? 2, 5, 7, 347 List the prime factors of 1581. 3, 17, 31 List the prime factors of 8211. 3, 7, 17, 23 What are the prime factors of 17501? 11, 37, 43 List the prime factors of 2052. 2, 3, 19 What are the prime factors of 11744? 2, 367 List the prime factors of 50973. 3, 13, 1307 What are the prime factors of 3810? 2, 3, 5, 127 List the prime factors of 451. 11, 41 List the prime factors of 129809. 271, 479 What are the prime factors of 119? 7, 17 List the prime factors of 802. 2, 401 What are the prime factors of 83042? 2, 41521 List the prime factors of 3248. 2, 7, 29 What are the prime factors of 583? 11, 53 What are the prime factors of 16607? 16607 List the prime factors of 600. 2, 3, 5 What are the prime factors of 3935? 5, 787 What are the prime factors of 1166? 2, 11, 53 List the prime factors of 1099. 7, 157 What are the prime factors of 34383? 3, 73, 157 What are the prime factors of 9654? 2, 3, 1609 List the prime factors of 530. 2, 5, 53 What are the prime factors of 60584? 2, 7573 List the prime factors of 37642. 2, 11, 29, 59 What are the prime factors of 40951? 31, 1321 List the prime factors of 69154. 2, 71, 487 What are the prime factors of 164? 2, 41 List the prime factors of 55593. 3, 29, 71 List the prime factors of 128061. 3, 17, 31 What are the prime factors of 3033? 3, 337 What are the prime factors of 6388? 2, 1597 What are the prime factors of 3961? 17, 233 What are the prime factors of 55328? 2, 7, 13, 19 List the prime factors of 97005. 3, 5, 29, 223 What are the prime factors of 10548? 2, 3, 293 List the prime factors of 3946. 2, 1973 What are the prime factors of 1441? 11, 131 What are the prime factors of 2331? 3, 7, 37 What are the prime factors of 3935? 5, 787 What are the prime factors of 2379? 3, 13, 61 List the prime factors of 22342. 2, 11171 What are the prime factors of 10619? 7, 37, 41 What are the prime factors of 6196? 2, 1549 What are the prime factors of 1113? 3, 7, 53 What are the prime factors of 5192? 2, 11, 59 List the prime factors of 162. 2, 3 Lis	{ "pile_set_name": "DM Mathematics" }
- 13ju + 4053859uw - 306u + w + 23 wrt w? j2 + ju + 4053859u + 1 What is the second derivative of 406714f*2y*2 - 28f*2y - 780f2 - 3y - 2 wrt y? 813428f2 Find the third derivative of 13283014h5 + h4 + 52954521h2. 796980840h*2 + 24h What is the derivative of 1509s2x - 32560775s2 + sx - 9209x wrt x? 1509s*2 + s - 9209 What is the second derivative of 81401370o*2 - 280011775o wrt o? 162802740 What is the second derivative of 51c2d*2 + 510087c*2d - 2cd*2 + 25059638cd wrt c? 102d*2 + 1020174d Differentiate 4s2 + 620157s - 16204558 with respect to s. 8s + 620157 Find the third derivative of 2414r*5 + 2r*4 + 815r*3 - 661485r*2 - 14r wrt r. 144840r2 + 48r + 4890 What is the derivative of 31796293k2 - 22210009 wrt k? 63592586k What is the second derivative of 79583279d4 - 277589d + 148? 954999348d2 Find the third derivative of -50346686a*3 - 4157a*2 + 9a. -302080116 Differentiate 11562175g4 + 1001337 wrt g. 46248700g*3 What is the first derivative of -43066921t*4 + 12917596? -172267684t*3 What is the third derivative of -477731f*5 + 16986177f*2 wrt f? -28663860f*2 Find the third derivative of 7545787w*3 - 3999441w*2. 45274722 What is the second derivative of 273743220v*2 - 1495418v - 26? 547486440 What is the third derivative of -304261403a6 + 210891674a*2 - a? -36511368360a*3 Differentiate 5134428g*3j*2 + 539923695g*3 + 11g*2j with respect to j. 10268856g3j + 11g2 Find the second derivative of -40277721k*5 + 641083k + 67 wrt k. -805554420k3 Find the second derivative of -60589643y*2 - 5590721y + 10 wrt y. -121179286 What is the second derivative of 90743j3 - 59j*2 - 77349433j wrt j? 544458j - 118 Differentiate 718u*4 - 2696u - 124593278 with respect to u. 2872u3 - 2696 Find the third derivative of -21036g*4 - 3615g*3 - 299828578g*2. -504864g - 21690 What is the third derivative of 10531f3h*4 + 3f*3h*2 + 3f*3h - 78f3 + 2817f*2h4 + f2 - 41fh*2 + 23h wrt h? 252744f3h + 67608f2h Find the third derivative of -14692937n3 - n2 - 4n - 25818. -88157622 Find the third derivative of -27498g6 - 3670g*3 + 2151g*2 - 70437. -3299760g*3 - 22020 Find the second derivative of 245169299m*3 - 1095627m + 67 wrt m. 1471015794m Differentiate -679141521p + 444055646. -679141521 What is the third derivative of -7490149j4 - 8422883j*2? -179763576j Find the second derivative of -40979849v4 + 9487509v + 3 wrt v. -491758188v2 Find the third derivative of 6154v*6 - 758v*3 - 39609v*2 + 216 wrt v. 738480v*3 - 4548 Find the second derivative of 23x*4 - 2260459x*2 - 493147514x wrt x. 276x2 - 4520918 What is the second derivative of -81702243f*5 + 14650965f? -1634044860f3 Differentiate -gt*2 + 141g + 48755751t3 - 159589 wrt t. -2gt + 146267253t*2 Find the second derivative of -94526417n*3 + 184324n - 123 wrt n. -567158502n Find the third derivative of 4499a*4i + 2434a3i + 576613a2 + 10ai wrt a. 107976ai + 14604i What is the third derivative of 71171739o5 + 13o*2 - 11550o + 3? 4270304340o2 What is the derivative of -287225817n*2 + 430592837? -574451634n Differentiate -25068369s - 69262751 wrt s. -25068369 Find the third derivative of -8x*5 + 688063x*3 + 60314388x*2 wrt x. -480x*2 + 4128378 What is the third derivative of 465483t*6 - 1038t*2 + 936t - 1? 55857960t3 What is the first derivative of 27034384k - 103159083 wrt k? 27034384 What is the first derivative of 2fi*2 + 76fi + 50075681f - 23598i4 wrt i? 4fi + 76f - 94392i3 What is the third derivative of -79641796q*4 + 56q*2 - 286q - 73? -1911403104q What is the third derivative of -15257466v*3 + 42519443v*2 wrt v? -91544796 Find the second derivative of 18500032c*2 - 368946994c wrt c. 37000064 Differentiate 29p3t*2 - 139p*3t - 9p3 - 4p*2 - 116pt2 - 9p + 130 wrt t. 58p3t - 139p3 - 232pt What is the third derivative of 2632ly3 + 40ly2 + 7187l + 167y3 - y - 1 wrt y? 15792l + 1002 What is the derivative of -3945573ap*2 - 51368812a + 2p3 wrt p? -7891146ap + 6p*2 What is the second derivative of 29s*5 - 12588s*4z - s + 506z - 372 wrt s? 580s*3 - 151056s*2z Differentiate 353488072w + 524851895 wrt w. 353488072 Find the second derivative of 21845598v*2 - 17771987v. 43691196 What is the derivative of -3281f2n*3p + 66f2n*3 + 5f*2n*2 + 19fn - 740n*3p + 288 wrt p? -3281f2n*3 - 740n*3 What is the third derivative of -326107346k3 + k2 + 3120k + 2424? -1956644076 Differentiate -3042ov2 - 98o - 3788868v2 with respect to o. -3042v*2 - 98 Find the first derivative of -3r*4 + 2663160r3 - r2 - 46359821 wrt r. -12r3 + 7989480r*2 - 2r Find the second derivative of 535827495u2 - 190341978u. 1071654990 What is the derivative of 739267303x3 - 391258365 wrt x? 2217801909x*2 Find the third derivative of -15n*6 - 247555n*5 + 1730n*2 - 69n + 5. -1800n3 - 14853300n*2 What is the third derivative of 201516259r*3u + 180r2 - 33551ru + u wrt r? 1209097554u What is the third derivative of 289g2x*3 - 7g*2 - 5883gx3 - 4gx2 + 5g + 6820x2 - 2x wrt x? 1734g2 - 35298g What is the third derivative of -975008621k5 - 6267143k*2? -58500517260k*2 What is the second derivative of 703069d*4 + 45d*2 + 1117194083d wrt d? 8436828d2 + 90 What is the first derivative of -2g*4 + 609320389g*2 + 483168630? -8g*3 + 1218640778g Find the second derivative of -274751210r2 - 2r - 76915362 wrt r. -549502420 Find the second derivative of -4245145h4 - 2739401h. -50941740h2 What is the second derivative of 21644345u*3 - 15809u - 593 wrt u? 129866070u Differentiate 293884m*4 + 66m + 421939443. 1175536m3 + 66 Find the first derivative of -s3 + 8s*2 + 39029s - 8599680 wrt s. -3s2 + 16s + 39029 What is the second derivative of lv2z - 4082854lvz2 - lvz - v2z*2 + 11v*2z + 2v2 + 969 wrt z? -8165708lv - 2v*2 What is the first derivative of 152746s*4 + 40s - 40172803 wrt s? 610984s3 + 40 Find the second derivative of 9213942bv2 - 4695bv + 97v - 7 wrt v. 18427884b Find the third derivative of -77557671q*3 - 16867q*2 - 26119 wrt q. -465346026 Find the third derivative of 2t*2x*3 + 5596356t*2x*2 + tx*3 - 42896x*3 wrt x. 12t*2 + 6t - 257376 What is the derivative of -55u4 + 2356432u*3 - 140738950 wrt u? -220u*3 + 7069296u*2 Differentiate -17674199q*3 + 14696520. -53022597q*2 What is the second derivative of -3n*4 + 14290453n*3 - 4n*2 + 1239484n wrt n? -36n2 + 85742718n - 8 What is the first derivative of -140bw*2 - bw - 82482b - 3w*2 + w + 21492260 wrt b? -140w*2 - w - 82482 What is the third derivative of 20755912v*4 - 20971819v*2? 498141888v Find the third derivative of 684m6 + 280m*3 + 9m*2 + 2m - 105112 wrt m. 82080m3 + 1680 What is the third derivative of 422543128w*6 + 801300460w*2 wrt w? 50705175360w*3 What is the third derivative of 78263030b*5 - 25586553b*2 wrt b? 4695781800b*2 What is the derivative of -450828jlq - jl + 36020446jq - 45lq - 7l - 4q - 1 wrt l? -450828jq - j - 45q - 7 Find the first derivative of 951157782q - 604543131. 951157782 What is the third derivative of -5765330d*3f*3r*2 + 3481d*2f*2 + 7df2r*2 + 64f*3r wrt d? -34591980f3r*2 Find the third derivative of -1111px3 + 10996px + 3260x*3 + 15146x*2 wrt x. -6666p + 19560 Differentiate 53q2 + 3995005q - 433286075. 106q + 3995005 What is the first derivative of 94u4 - u3 - 115737u2 + 3990436 wrt u? 376u*3 - 3u*2 - 231474u What is the derivative of 2p2 + 45738683p + 246766725 wrt p? 4p + 45738683 What is the derivative of 111l*2v*2 + 2l*2 + 17252lv + 13108618v*2 wrt l? 222lv2 + 4l + 17252v What is the third derivative of 279239174a*5 - 44a*2 + 2a - 794124 wrt a? 16754350440a2 Find the second derivative of b4 - 6b*3 - 4168611b*2 - 455189629b wrt b. 12b	{ "pile_set_name": "DM Mathematics" }
m + 190, 4h + om - 820 = 0. What is the greatest common factor of 42 and h? 42 Let i = 14 + -6. Suppose -g + i = g. Suppose 0 = gp - 7 - 17. Calculate the greatest common divisor of 2 and p. 2 Let h(j) = 48j + 163. Let a be h(4). Calculate the highest common divisor of 568 and a. 71 Let r be ((-5)/109)/(3/(-4)). Suppose -d + 5 + 0 = 0. Suppose 100 = dc - 170. What is the greatest common divisor of c and r? 6 Let w(h) = 4h2 + 7h - 1. Let t be w(-3). What is the highest common factor of 497 and t? 7 Let d(m) = 2m3 - 4m + 5. Let k be d(3). Let c = -8 + k. What is the highest common factor of c and 13? 13 Let g(p) = 24p3. Let r be g(1). Let w = 123 - -54. Suppose q + 252 = 3f + 71, -3f - 3q = -w. What is the highest common factor of f and r? 12 Suppose 8s - 28 = s. Let j(a) = a3 - 2a*2 - 3a - 1. Let v be j(s). Calculate the highest common divisor of 76 and v. 19 Suppose 3v - v - 6 = 0. Suppose -3m = 4f - 112, 5f + 0m + m - 129 = 0. Let n = f + -24. What is the greatest common factor of v and n? 1 Let s(g) = 19g*2 + 29g - 29. Let u be s(1). What is the greatest common factor of 361 and u? 19 Suppose -71 = -b + 199. Let g(j) = -j + 30. Let v be g(0). What is the highest common factor of b and v? 30 Suppose 0 = 4h + m - 30, 2h = -0h - 2m + 12. Suppose 0u - h = -u. Let b be ((-15)/6)/((-2)/u). Calculate the greatest common divisor of 50 and b. 10 Let h = 28 + 9. Suppose 2o = 3o - h. Suppose -s = 2j - 11, -2s - 2j = -j - o. What is the greatest common factor of s and 7? 7 Suppose -7p - 78 = 125. Let v be (p - -31) + (1 - (-7 - -1)). What is the greatest common divisor of v and 1? 1 Let n = 125 - 122. Suppose -ny - 3 = -6y. Calculate the greatest common factor of y and 3. 1 Suppose q + q - 8 = 0. Let m be (-51)/(-85) - (-2 - (-51)/(-15)). Let u be (-3)/m(-82 + q). Calculate the greatest common divisor of u and 26. 13 Suppose 0 = -25t - 17t + 168. What is the greatest common divisor of t and 32? 4 Let d = -103 + 139. Let q = 242 + -152. What is the greatest common divisor of d and q? 18 Let v(z) = z*2 - 16z + 41. Let c be v(14). Let s(l) = -l*2 + 18l + 19. Let k be s(c). What is the greatest common divisor of 12 and k? 12 Let z be 24 - (1 + 0) - 1. Let b = 13 - -6. Let u = b - 8. Calculate the greatest common divisor of z and u. 11 Let u be -10 + 1 + -12 + 106. Suppose 3t + 73 = 5a, -2t = 2a - 0t - 42. What is the highest common divisor of a and u? 17 Suppose 10 = 5t - 0. Suppose 0 = -tm + 5 - 9. Let g be ((-48)/(-28))/(m/(-21)). What is the greatest common divisor of g and 162? 18 Let x be (-86)/(-11) + (-12)/(-66). Let n = 51 + 5. Calculate the highest common divisor of x and n. 8 Suppose 0 = 2q + 4m - 24, -4q + 5m = -91 + 4. Suppose -3p + 10 = 2p. What is the greatest common factor of p and q? 2 Let s(i) = -i2 + 8i - 21. Let p be s(-15). Let q = -102 - p. What is the greatest common divisor of q and 33? 33 Let f(h) = -3h + 67. Let u be f(19). Calculate the highest common divisor of u and 55. 5 Let d = 1792 + -608. What is the greatest common factor of 16 and d? 16 Let r(i) = -10i + 676. Let s be r(0). What is the greatest common factor of 104 and s? 52 Suppose y + 174 = 5w - 2y, -4y = 4w - 152. Let i = 1340 - 1331. What is the greatest common factor of i and w? 9 Let p(g) be the second derivative of -4g3/3 + 7g*2 + 8g. Let t be p(-7). Let k = 5 + 5. Calculate the highest common divisor of t and k. 10 Let f be 610(-24)/(-80)12. What is the greatest common factor of 36 and f? 36 Let w = 51 - 46. Suppose 0k + wp - 138 = -k, -3p + 3 = 0. Calculate the highest common divisor of k and 7. 7 Let l = 95 + 45. Let w(b) = -15b*3 + 3b + 2. Let r be w(-1). Calculate the highest common factor of r and l. 14 Suppose o = 3q + 4, o - 2q - 3 = -0. Let n be (2 + -1)o/1. Suppose -191 = -4p - 147. What is the greatest common factor of p and n? 1 Let p = 1993 - 1969. Suppose -4h + 224 = -0h. What is the greatest common factor of h and p? 8 Suppose -3t - 21n + 16n + 71 = 0, 3n = -15. What is the highest common factor of t and 28? 4 Let t(z) = 5z2 - 4z - 15. Let u(w) = -w - 3. Let v be u(1). Let c be t(v). What is the greatest common factor of c and 18? 9 Let y(f) = f*3 + 14f*2 + 12f - 10. Let o be y(-13). Suppose -1 = -oq + 8. Suppose -5j = -qj - 120. What is the greatest common factor of 90 and j? 30 Let o be -81 + 864 - (0/(-2) + 0). Calculate the highest common divisor of o and 27. 27 Let w = 1020 - -24. Calculate the highest common divisor of w and 36. 36 Let g be (-2)/7 - (-47)/(-7). Let w = 5 - g. Let f(p) = -2p + 96. Let n be f(0). What is the greatest common divisor of n and w? 12 Let y = 4 + -74. Let h = 126 + y. Suppose 0 = -0w - 3w - v + 24, 3w - v = 18. What is the greatest common factor of h and w? 7 Suppose 11t = 5720 - 2420. What is the greatest common factor of 40 and t? 20 Suppose -y = 3u - 41 - 4, 49 = y - u. Suppose 4p - y = -3t, -2t - p + 16 = -11. Calculate the greatest common divisor of 60 and t. 12 Let o = -313 - -318. What is the greatest common divisor of 1 and o? 1 Suppose 0 = -d + 5, -3h - d - 3d + 38 = 0. Let v be (h/4)/332. What is the highest common divisor of 176 and v? 16 Let t be 2/6(-66)/(-2). Let b be 2/6 + 7440/36. Let h = b - 130. Calculate the greatest common divisor of h and t. 11 Let z(c) = c*3 + 18c*2 + 16c - 15. Let x be z(-17). What is the highest common divisor of 11 and x? 1 Let n = 23 - 22. Let l(w) = w. Let d be l(11). Calculate the greatest common factor of d and n. 1 Let o(b) = -b3 + b2 - b - 347. Let p be o(0). Let m = 594 + p. What is the greatest common divisor of 13 and m? 13 Let u = -116 + 134. Suppose 0q - 11 = -q. Suppose x - 4 = 0, -3a - 4x + 33 = q. What is the greatest common divisor of a and u? 2 Suppose -75 + 363 = 8z. Calculate the greatest common divisor of 234 and z. 18 Let s(o) = -o*3 + 2o*2 + 3o - 27. Let u be s(-10). What is the greatest common divisor of 127 and u? 127 Let i be 5/(30/1929) - (-48)/32. What is the highest common factor of i and 19? 19 Let a = -74 + 130. Suppose 6 - 38 = -4f. Calculate the greatest common factor of f and a. 8 Let h be (112/(-6))/(-7)3/4. Suppose 116 = 2i - 3g - 2g, 0 = hi - 3g - 108. What is the highest common factor of 6 and i? 6 Let n be ((7/7)/1)/((-2)/(-224)). Let c = n + -28. Calculate the greatest common factor of 12 and c. 12 Let h(b) = 9b*2 - 201b - 2. Let f be h(30). What is the highest common factor of f and 44? 44 Let q(k) = -2k2 - 13k - 12. Let w be q(-4). Let z be 1 - (-8)/2-41. Let c = -75 - z. What is the greatest common factor of c and w? 8 Suppose 30s = 17336 + 1984. What is the highest common divisor of s and 168? 28 Suppose 4u = -8 + 32. Suppose w - k - 3k = 5, -2w + u = -4k. Let b be 7 + -8 + (w - -48). Calculate the highest common factor of b and 6. 6 Suppose -d = -5z - 7, -4d + 4z + 40 = -52. Suppose -4m - 2l + 64 = 0, -5m + 25 + 73 = -2l. Calculate the greatest common divisor of d and m. 9 Let q be ((-64)/10)/(96/50 - 2). Let x be (-6)/8 + (-5)/q-1052. What is the greatest common divisor of x and 13? 13 Let d be 4215(-10)/(-105). What is the greatest common factor of d and 300? 60 Let p = -573 + 614. What is the highest common factor of 656 and p? 41 Let w(o) = o*2 + o - 2. Let s be w(12). Let l = -36 - -50. Calculate the greatest common divisor of l and s. 14 Let d(u) = 8u + 23. Let q be d(4). What is the highest common divisor of 10 and q? 5 Suppose 12x - 3c = 8x + 10132, 4c = -x + 2533. Calculate the greatest common factor of 17 and x. 17 Let y = -1037 - -1666. Calculate the greatest common divisor of y and 17. 17 Let o be 40/50-5 - 19-41. Calculate the greatest common factor of o and 31. 31 Suppose 14 = 2d - 3k - 0, 34 = 4d - 3k. Let j be (5/2)/(4/(24d)). Calculate the greatest common factor of 100 and j. 50 Let r = -3 + 5. Suppose 0 = -rm + 5h + 71 + 129, 3h + 414 = 4m. Let t = 4 - -11. Calculate the highest common factor of m and t. 15 Suppose 6h = 348 - 108. What is the highest common divisor of h and 220? 20 Suppose -167 = -3z + b, 4z = -0b - b + 211. Let a(c) = -c2 + 21c + 6. Let o be a(21). Calculate the greatest common divisor of o and z. 6 Suppos	{ "pile_set_name": "DM Mathematics" }
e (-4 + 5 - 2)(-1 + q + 1) + 3q - 4q + 3q - 2q - q + q + ((7 - 1 - 1)(-1 + 1 + 2) + 3 - 5 + 0)(-26 + 26 - 32q) to the form uq + w and give u. -257 Rearrange (1 + 9 - 1)(-2f - 3f + 4f) + (-1 + 2 - f + 1)(-6 - 16 - 3 - 1 - 1 + 3 + (2 + 4 - 4)(0 + 0 - 2) - 5 - 1 + 5) to j + tf and give j. -58 Rearrange -5i2 - 2i*4 - 3 - 10 - 6942i*3 + 6941i*3 + 0 + 5i - 3i2 to the form ai*2 + d + ri*3 + ki + ci4 and give r. -1 Rearrange (-18 - 70 - 46)(1 + 0 - 2)(-2l*3 + 3l*3 + 9l*3)(-3 + 4 + 1) to the form gl2 + a + ql + zl3 and give z. 2680 Rearrange (15 - 10 + 6)(1146j - 396j - 115j) to the form c + ij and give i. 6985 Express (-63731q2 + 14q + 37q + 63735q*2)(-2q + 0 + 3 - 5) as mq*3 + nq*2 + tq + l and give m. -8 Rearrange -32512c + 2 - 4572c - 2 + 357c to k + dc and give d. -36727 Rearrange -2y3 - 1 + 187y*2 + 16y*4 + 201y*2 + 4y + 196y2 - 581y*2 to the form oy*2 + jy*3 + dy + xy4 + k and give j. -2 Rearrange 2933 + 549 + 11v + 7v - 20v + 166 to pv + k and give p. -2 Express -359x*2 - 539x*2 - 1273x*2 + 379x*2 - 383x*2 in the form cx + y + tx2 and give t. -2175 Rearrange -51544v + 16 + 7 + 51534v - 8 + 3v*2 to xv + hv2 + y and give h. 3 Express -13282d - 7847d - 528d as f + vd and give v. -21657 Express (-2 + 1 - 11)((-5s + 5s - 2s)(-3 + 1 + 1) + 4 + 80s - 72s - 2) in the form z + ys and give y. -120 Rearrange (2 - 2 - m2)(-m - m + 4m + (1 - 2 - 1)(78m + 1621 - 1621)) to km*3 + um*2 + gm + b and give k. 154 Rearrange (-4 + 4 - h)(-532h - 4688h - 709h) to jh2 + yh + n and give n. 0 Rearrange (-2 + 1 + 2)(0 + 3 - 5)(28 + 3 + 31)(1 - 2s - 1) - 2s + 2s + 2s - 7s + 0s - s to the form h + ls and give l. 242 Express 11w2 + 134w*2 - 19w*2 - 46w*2 + 19w*2 + 87w in the form fw2 + mw + s and give f. 99 Rearrange -45 + 75 + 60 + 67 + 3r + 19 to the form pr + d and give d. 176 Rearrange (2a4 + a2 - a2)(-44 - 22 + 3) - 5a - a + 6a + 42a4 to the form ma*3 + va + q + ca4 + ya*2 and give c. -84 Express (3x - 3x - 2x*2)(37693x2 - 72307x*2 + 36126x2) - x4 - 2x4 + 5x*4 in the form hx*4 + wx + n + yx3 + dx*2 and give d. 0 Express 3757s + 1855s - 1214s as us + q and give u. 4398 Express 4s3 - 8 + s2 + 2s2 + 4s*4 - 218s + 218s in the form a + gs*3 + xs + vs2 + hs*4 and give g. 4 Express (-8z - 29z + 8z)(4 - 2 - 3) + (13 - 5 + 7)(-2 + 22z - 25z + 17z) as fz + r and give r. -30 Rearrange 5 + 0 + 2v + 8v*2 - 16v*2 + 8v*4 - 8 + 9v*2 + 2v*3 to the form pv*3 + x + wv*2 + sv*4 + kv and give w. 1 Rearrange -13z3 - 152 - 82 + 74 - 31 - 183 to the form lz*3 + nz*2 + u + oz and give u. -374 Rearrange -44h + 8h - 2h + 43 - 43 - 42h + (3h - 5h + h)(3 - 1 - 4) to n + ph and give p. -78 Rearrange 60j - 14j*2 - 64j + 3 + 39j2 + (7 + 11 - 10)(3j2 - 4j2 - j2) to qj2 + vj + t and give q. 9 Express (2g + 0g - 3g)(1 - 6 - 20) + (-3g + 6g - 2g)(-2 - 4 + 5) + 20 - 6g - 20 + (3g - 5g + 0g)(-6 - 4 + 3) in the form vg + h and give v. 32 Express -w + w + w*4 + 0w*4 + 14w*4 + 3w*4 + (1 - 1 + 6w*2)(-w + w - 6w2) as bw*4 + c + ow*2 + gw + vw3 and give b. -18 Rearrange 3556 - 3469 - 45i - 24i + 6i to the form r + di and give r. 87 Express (11t + 8t - 8t)(-142t + 38t + 10t) as h + lt2 + zt and give l. -1034 Rearrange (6b - 5b + 11b)(-1918 + 230b + 1918)(-3b + b + b) to mb + lb3 + zb*2 + a and give l. -2760 Rearrange (5 - 3 + 4)(-4t + 3t + 3t) - 433t - 4t - 94t + 5t - 224t to f + dt and give d. -738 Rearrange (-3 + 3 + 1)(1 - 6 + 0)(-76329 - 72x*2 + 76329) to the form ix*2 + gx + f and give i. 360 Rearrange (-6i2 - 7i*2 + 3i*2)(-2 - 2886652i + 2 + 2901729i) to mi2 + ji + qi3 + u and give q. -150770 Express 6b*3 + 18 + 53b - 27b - 16 - 22b*2 + 6b*3 - 25b in the form ib2 + hb + k + mb3 and give k. 2 Rearrange 245a*3 - 1058a + 1055a - 2 + 0 - a4 + 2 to va*4 + q + na*3 + ua*2 + ya and give y. -3 Rearrange 4k + 2k - 4k + (1 + 1 - 4)(-k + k - 2k) - 1 + 1 + k - 35598k + 1 + 17942k + 17826k to d + nk and give d. 1 Rearrange -l - 237 + 236 + 28213l*4 - 25257l*4 to rl*4 + ol + p + bl3 + nl*2 and give r. 2956 Express -3k2 + k2 - 3k2 + (3k - 2k + 0k)(-758k + 239k + 282k) as hk2 + r + tk and give h. -242 Rearrange (17g2 + 31g*2 - 37g*2)(13g + 19g - 3g + 2g + g - 2g + (2 - g - 2)(5 - 5 + 3)) to the form rg2 + v + fg + sg3 and give v. 0 Rearrange -11 - 7 + 373429h*2 - 373420h*2 - 6h to the form oh + a + ih*2 and give o. -6 Express 8 - 2z*2 + 5 - 79 + 4 - 2z as s + rz + gz*2 and give s. -62 Rearrange -1171222z + 237z3 + 1171222z - 7 to the form wz2 + d + az + mz3 and give m. 237 Rearrange -3a + 1 + 80a2 + 75a*3 + 79a*2 + 77a*2 - 292a*2 + 54a*2 to the form l + ka*2 + na*3 + za and give n. 75 Express -2190q + 42q*3 - 45q*3 + 495q - q*2 - 493q as hq2 + iq + fq3 + d and give f. -3 Rearrange -1938z*2 - 1340z*2 + 727z*2 - 1903z*2 - 763z*2 to the form rz + az2 + f and give a. -5217 Express 5675n + 4343n + 1444n + 2 - 1839n + 1107n as on + g and give g. 2 Rearrange (1 - 1 - 1 + (52 - 95 + 54)(4 - 4 - 1))(5g*3 + 19g*3 - 6g*3) to the form zg*2 + p + kg + sg3 and give s. -216 Express (-16s + 16s + 8s*2)(-2s2 + 2s2 - s2 + (0 - 3 + 4)(36s*2 - 21s*2 + 26s*2)) as zs*2 + a + us + gs3 + ks*4 and give k. 320 Express -8290 - 3i + i*2 - 5i + i + 4152 + 4188 as gi2 + h + si and give s. -7 Express -90s4 - 1457s*2 + 481s*2 + 484s*2 - 3s + 482s2 in the form v + zs*4 + xs + cs2 + is*3 and give x. -3 Express -121263d*3 - 3d*2 - 8d*2 + 121266d*3 + 3 in the form ld*3 + gd*2 + p + ad and give g. -11 Rearrange (6p + 1 - 2 + 3)(2360 + 881p - 2360) to cp*2 + rp + h and give r. 1762 Express -2t2 - 16636397t + 225t3 + 13 + 16636397t as nt3 + jt + at2 + x and give x. 13 Express -25 - 290 - q - 395 + 167 in the form v + tq and give t. -1 Rearrange (1 - 1 + h)(2 - 1 + 1) - h - 2h + 6h + 6h - 3h - 2h + (-12 - 6h + 12)(2 + 3 - 7) to the form n + rh and give r. 18 Rearrange 4a*3 - 69a*4 - 2a3 + a2 + 1810a4 + 9 - 4 - 3 - a to oa*4 + k + qa + ca3 + na*2 and give c. 2 Rearrange (-6 + 3 + 2)(0 - 2q + 0)(-522q - 504q - 4q) to m + uq*2 + tq and give u. -2060 Express (0f + 4f - 3f)(-221 - 51f + 444 - 222)(-4f + 91 + 10f - 7f) in the form af + xf3 + c + lf*2 and give x. 51 Rearrange (2t - 3t + 0t)(-44t + 38 - 43t + 88t) + (6 - 4t - 6)(-3 + 3 + 3t) to the form f + ut + xt2 and give u. -38 Rearrange -359 + 166 + 457n + 193 + 5n2 to the form bn + j + fn2 and give b. 457 Express -5i + 2329i + 2429i + 2325i - 1438i as h + qi and give q. 5640 Express -398m*2 - 13m + 13m + 215m*2 - 714m*2 in the form jm + cm2 + y and give c. -897 Express -113537c + 236298c - 111104c in the form k + vc and give v. 11657 Rearrange 32 - 38 + 24 + 329l to the form k + jl and give j. 329 Express (5 - 1 - 2)(-i*2 + 1 - 1 - 34i*2 + 24i*2 + 33i*2 + (-i + 0i - i)(-i + 0i - i) + 0i + 2i*2 + 0i) as ti2 + pi + s and give t. 56 Express 53 + 21 - 47 - z - 87 - 93 in the form w + dz and give w. -153 Express -7873 + 7866 - 181l*2 - 181l*2 in the form v + hl*2 + fl and give h. -362 Rearrange -31321731 + 15955v + 31321731 + 0v - 2v + 0v + (v + 3v - 2v)(-4 + 3 - 1) to m + uv and give u. 15949 Express 3k2 - 3k*2 - 2k*2 + (0k + 3k - k)(3 - 4 - 11)(52 - 52 + 29k) in the form mk2 + a + rk and give m. -698 Rearrange -3p + 455 - 4p - 245 - 252 to i + cp and give i. -42 Express 8663k*2 - 19965k*2 - 24410k*2 + (-3 + 5 - 1)(-4 + 2k2 + 4) as wk + ck2 + m and give c. -35710 Express (-2m + 7m - m)((-1 + 4 - 4)(-1 - 1 + 1) - 3 - 1 + 3 - 4 + 3 + 0)(-278 + 508 + 57) as wm + x and give w. -1148 Rearrange (-11o - 324 + 324)(-1 - 2o + 1)(-14o - 1334 + 1334) + 7o3 - 5o**3 -	{ "pile_set_name": "DM Mathematics" }
posite? False Is (-2)/(-6) - (-16851604)/231 prime? False Suppose 0 = -2k + 4 - 88. Is ((-28595)/k - -1)6 a composite number? False Let p = 184104 - 77065. Is p a prime number? False Let o = 106647 + -68008. Is o composite? False Let d = 3495 + -1384. Let a = d - 568. Is a prime? True Suppose 0r = 2y + r - 29, -3 = 3r. Suppose -a - 15 = 4z, 0z = 5z + y. Is (1642/4)/(5/(13 + a)) a prime number? True Let n be 88/104 - 1 - 197/(-13). Suppose ng + 4g = 379677. Is g a prime number? False Let r = 74551 + -50901. Is r/6 - (160/(-15))/8 composite? False Suppose 12w - 20 = 7w. Let f(h) = -h*3 + 5h*2 - 3h + 1. Let i be f(w). Suppose -il = -2m + 403, -l = -m + 4l + 189. Is m prime? False Let a = 86 + -59. Suppose -22q - 84895 = -aq. Is q prime? True Let r(y) = 21 - 570y - 20 + 29 + 35. Is r(-20) a prime number? False Let q(s) = 6s2 + 68s - 2129. Is q(-67) prime? True Is ((-7)/4)/(66/(-3084336)) a prime number? False Let m be 5 - (-1164)/9 - 2/6. Suppose -2a - 102 = -3y - 3a, -4y - 2a = -m. Is (y/7)/((-1)/(-79)) composite? True Let x(m) = 938m2 - 13m + 79. Is x(8) composite? True Let w = 9922 + -16150. Let t = 507 + -4682. Let n = t - w. Is n a prime number? True Let w(b) = 3b2 - 102b - 2401. Is w(92) composite? True Let y(g) = 7g - 241664. Let x be y(0). Is 4 + (2/6 - x/12) prime? True Let b(i) = 256i*2 + 56i + 16. Let p be b(15). Is p/20 + 2/10 prime? False Let x(n) = n - 46. Let b be x(-8). Let k = 107 + b. Is k a prime number? True Suppose -5j = -30, -18223 = -118g + 117g + j. Is g prime? True Let m(l) = 0l + 13 - 59l + 10l - 81l. Let j(a) = -389a + 38. Let q(i) = -6j(i) + 17m(i). Is q(4) composite? True Let y(i) = 1 + 68i - 22i + 95i. Let a be ((-342)/1710)/((-2)/10). Is y(a) composite? True Let l be 443844/56 - (-4)/14. Let t = l - 1547. Is t composite? True Suppose 1872k - 1876k = -5v - 11636, -8727 = -3k - v. Is k a prime number? True Let y(g) = -51g3 - 15g*2 - 61g - 1. Let i be y(-8). Suppose -2o + i = 3u, 5o = u + o - 8523. Is u composite? False Let o(s) = 5848s*2 - 3s - 4. Let w be o(-3). Suppose -107 + 267 = 10i. Suppose -ih = 6285 - w. Is h a composite number? False Let u(x) = -3x2 - 197x - 370. Is u(-31) a composite number? True Let g = -1656 + 2246. Let m(t) = t*3 - 9t*2 + 10t - 7. Let k be m(8). Is (-36)/k(2 - g/8) prime? False Suppose -4s + 8829194 - 2251531 = 3a, s - 2a - 1644413 = 0. Is s composite? True Let s be 39/((-6)/(-2) + 2019/(-674)). Suppose 4m = 4810 + s. Suppose 0 = 2t + 375 - m. Is t a composite number? True Suppose 0 = -11j - 25729 - 74195. Is -59/(270/j) a composite number? True Let z(w) = 113w2 + 22w - 53. Let g(h) = -114h2 - 21h + 54. Let r(f) = -3g(f) - 2z(f). Is r(9) a composite number? False Is 2710642/88 + 1 + 12/(-16) composite? False Let n be 12/1505-15. Is (12 - 5 - 1)(-4861)/n prime? True Let x(s) = 3s*2 + 6s*2 - 198 - 16s - 7s2 + 154. Is x(-9) composite? True Suppose 2m + 12234 = 3l - 9783, 5l = 5m + 55035. Let f be (0 - -1)-3-5. Is m/(-15) - (-6)/f composite? True Let g(k) be the third derivative of k6/120 + 13k5/30 + k4 - 13k3/3 - 11k*2. Let o be g(-25). Is (-2 + 1 + o)/(6/(-381)) prime? True Is 1204/258(-28383)/(-2) a composite number? True Suppose 3c = -3t + 6, -3c + c + 5t = -39. Suppose 0 = cs - 3s - 4896. Let i = 2343 - s. Is i prime? False Is (6 - (-112)/(-21))/(24/4183956) composite? True Let p(u) = u*3 - 4u2 - u - 2. Let k be p(3). Let w(z) = z3 + 14z2 - 11z - 24. Let b be w(k). Let t = -72 + b. Is t a composite number? True Let w = -95853 + 273202. Is w prime? False Is (56 - -1479)/(2/178) + 7 a composite number? True Suppose 4c = 17c - 403. Let a(n) = -n*3 + 41n*2 - 5n - 58. Is a(c) a composite number? False Suppose -7330g - 164748 = -7336g. Is g prime? False Let y = -115068 - -671539. Is y composite? True Suppose 42s = 35s + 119. Is 11487/1 - s/(153/18) composite? True Let p = 547180 - 281223. Is p prime? True Let t(y) = -156y3 + 8y*2 + 6y + 5. Let k(a) = 77a3 - 4a*2 - 3a - 3. Let w(s) = 5k(s) + 3t(s). Let h = -11 + 9. Is w(h) a prime number? False Suppose -5c + 27585 = 2m, -2c - 7m = -8m - 11043. Is c a prime number? True Let y = -34536 + 21395. Let a = -6656 - y. Is a a prime number? False Let d be (-5)/(((-22)/(-3236))/(-11)). Suppose 0 = -3i + a + 2856 + 2002, 5i = 3a + d. Is i a prime number? True Let h = -72 + 187. Let i = -90 + h. Is i prime? False Let g = -220 - -227. Suppose gu - 739 = 1004. Is u a prime number? False Let g = -315 + 7. Let i = -234 - g. Is i a composite number? True Is (3 - (-828114)/7) + (-4 - 4) prime? True Let h(y) = -4y*2 + 60y. Let u be h(15). Suppose 0 = -4v - 4x + 32740, -5v + uv = -5x - 40965. Is v composite? True Suppose 0 = -5v - x + 559100, 5v = -60x + 57x + 559090. Is v a composite number? False Is -1 - 1556/(-1) - 1 - (-57 - -52) a composite number? False Let t(p) = -213p*3 - 15p*2 + p - 10. Suppose 0 = 685r - 687r - 6. Is t(r) composite? True Let t(q) = 18q*3 - 35q*2 + 51q - 209. Is t(17) prime? True Let m = 1736053 + 53440. Is m a prime number? True Suppose 0 = -u - 4f - 825, 3f = -u + 2f - 834. Let i = u - -1706. Is i composite? True Let w(k) = 1271k*2 - 50k + 346. Is w(9) composite? True Is 633(5490/54 - -4) composite? True Let c be ((-54)/99)/3 - 43168/(-22). Let t = -1261 + c. Is t prime? True Let s be -2(-624)/15 - 7/35. Let f = s - 86. Is ((4804/f)/2)/((-4)/6) a prime number? True Let y be (-8 - 68/(-8))(-17228)/2. Let u = 11536 + y. Suppose -3s + 4r - 7253 = -4s, -s + 2r = -u. Is s prime? True Let l(a) = -180a + 1266. Let m be l(7). Let p be -632702/(-4). Suppose -mv = -15v + p. Is v composite? True Suppose 5r + 5y - 60 = 0, 2y = -2r - 2y + 30. Suppose -4m - 134 = -w - rm, 0 = 5w - m - 592. Suppose -5 = -o - 5f + 3, 4f = 3o - w. Is o composite? True Suppose -5x + 4g + 1218861 = 0, 6 = 5g + 26. Is x a prime number? True Let p(s) = 524s - 1. Suppose k - 6k = -j - 14, -2j = -5k + 18. Let q(h) = -524h. Let r(l) = jq(l) - 3p(l). Is r(4) a composite number? False Let d = -288 - 62. Let k be (-1)/211/(77/d). Suppose m + 0o - 264 = o, -5o - k = 0. Is m a composite number? True Suppose -2g - 2j = -68, 3g + 2j = j + 112. Suppose 0 = -3p + 2w - 42, -2p = -2w + g - 9. Is (7 + 20046/p)2/(-3) prime? True Let o = 1053247 - 508920. Is o prime? False Let x(c) be the second derivative of -197c*3/6 + 15c*2/2 + 125c. Is x(-2) prime? True Let g = -168186 + 398729. Is g prime? False Let g(o) = -4o - 17. Let w be (0 - 5)/(0 + 1). Let r be g(w). Suppose -rm = 3j + j - 10923, -3628 = -m + 3j. Is m a composite number? False Suppose -2o - 28 = -4f, -2o + 2 = 2f - 0o. Suppose 6r + 2x = 7r - 8559, -4r + 34197 = fx. Is r a prime number? False Suppose 24 = 14j - 11j. Suppose 0 = -0i + ji - 16. Is 838/(-4)(-1)/(i/4) a composite number? False Let z(s) = -8 - 5 - 10s*3 + 14s*3 - 6s*2 + 11s. Let w(r) = -r*3 + 6r*2 - 6r - 3. Let o be w(3). Is z(o) composite? False Let a(b) = 17144b - 5811. Is a(31) composite? True Let h(a) = -21a*2 - 10a. Let i(m) = -22m2 - 9m + 4. Let z(q) = -4h(q) + 3i(q). Let r(c) = 2c2 + c - 4. Let b be r(-3). Is z(b) composite? False Is 205168 - (-6)/(-4)(648/12)/(-27) prime? True Let s(n) = -1. Let w(x) = 18x + 2. Let v(k) = k2 + k - 1. Let f be v(-2). Let c(p) = fw(p) - 3s(p). Is c(7) a prime number? True Suppose -5b - 3k = -10, 4b + 7k - 25 = 8k. Suppose 0 = 2j + 4o - 130118, 2j - bo = 77025 + 53066. Is j a prime number? True Let v be (-6)/(-39) - 1166/(-26). Suppose 2r = 3s + 32 + 61, 0 = r - 2s - v. Let a = r - 29. Is a prime? False Is (-12 + 9 - 38/(-13)) + (-506579536)/(-611) a prime number? False Suppose 24 = 4v - 32. Suppose v = 49o - 50o. Let x(l) = -63l + 25. Is x(o) prime? True Let v be (-4813)/15 - 8/60. Let c = 908 + -322. Let z = v + c. Is z prime? False Let z(b) = -b3 + 3b*2 - 3b + 5. Let l be z(3). Is (-7142)/l(-10)/(-5)1 prime? True Let j be ((-11)/33)/((-2)/156). Suppose -31v + jv + 8665 = 0. Is v prime? True Let k(j) be the first derivative of -j*4/4 + 14j*3/3 - 9j*2/2 + 12j - 17. Let z be k(13). Let b = 195	{ "pile_set_name": "DM Mathematics" }
+ 1. Let v(b) = -3b2 - 2b + 11. Let p(z) = -5z2 - 3z + 16. Let y(t) = -5p(t) + 7v(t). Let s(c) = 3i(c) + y(c). Solve s(f) = 0. -1, 0 Let n be (-2 - -3)(0 - -6). Find s such that 2s2 + 2s + 6 - n = 0. -1, 0 Let l(q) = 39q4 - 105q*3 + 39q*2. Let y(a) = -3a*4 + 8a*3 - 3a*2. Let s(t) = 2l(t) + 27y(t). Let s(r) = 0. What is r? 0, 1 Let i(v) be the first derivative of 0v + 2 + 1/3v6 + 0v*4 - 2/5v*5 + 0v*3 + 0v*2. Factor i(y). 2y*4(y - 1) Let w(m) be the second derivative of 5m7/42 + m6/2 - 5m*4/3 - m. Factor w(f). 5f*2(f - 1)(f + 2)2 Let r(n) = n2 + 1. Let q(f) = -f2 - 2f + 1. Let y be q(-2). Let b(c) = c*2 + c + 2. Let o(x) = yb(x) - 2r(x). Solve o(m) = 0 for m. 0, 1 Let c = -8 + 13. Suppose -5k - h - 1 = 0, -c = -4k - 0h + 5h. Suppose 1/2p*3 + 1/2p*4 + k + 0p*2 + 0p = 0. What is p? -1, 0 Let l(p) be the first derivative of -p5/110 + p4/22 - p3/11 + p2/11 + 3p - 3. Let y(b) be the first derivative of l(b). Factor y(z). -2(z - 1)3/11 Let v be (-10)/(-45) + (-11)/9. Let g(k) = -k2 + k + 1. Let b(s) = -5s2 + 7s + 6. Let i(t) = vb(t) + 6g(t). Suppose i(y) = 0. What is y? -1, 0 Let u = -1289/3 - -433. Factor 2b3 + 0 + 4/3b + ub2. 2b(b + 1)(3b + 2)/3 Let g = -424/45 + 110/9. Factor 4/5 - 14/5i + gi2 - 4/5i*3. -2(i - 2)(i - 1)(2i - 1)/5 Let s(b) be the second derivative of 0 - 5/3b*4 + 3b + b*2 + 3/10b*5 + 4/3b3. Let w(t) be the first derivative of s(t). What is q in w(q) = 0? 2/9, 2 Let z(h) be the third derivative of -h8/47040 + h7/5880 - h6/1680 + h5/840 - h4/24 - 7h2. Let b(y) be the second derivative of z(y). Factor b(k). -(k - 1)3/7 Let y(c) = -2c*2 + 24c - 18. Let b be y(11). Find s, given that -bs3 - 8/3s*2 + 0 - 2/3s*5 - 2/3s - 8/3s4 = 0. -1, 0 Let u(p) be the first derivative of -p7/14 - p6/10 + p + 1. Let d(l) be the first derivative of u(l). Factor d(x). -3x*4(x + 1) Let j be 6 - (2 + (-72)/(-20)). Factor 0 + r*3 + 2/5r*4 + 1/5r*2 - jr. r(r + 1)(r + 2)(2r - 1)/5 Find d, given that -15/4d - 3/2d*4 + 3/2 + 0d*2 + 15/4d3 = 0. -1, 1/2, 1, 2 Let y(v) = -v2 - 8v - 8. Let l be y(-6). Suppose -5r + 26 = 3m, lm - 7m - 3r = -18. Let 2u - 2um - u2 + u2 = 0. What is u? 0, 1 Let k(v) be the first derivative of v4/12 - v*2/6 - 40. Factor k(u). u(u - 1)(u + 1)/3 Let v be ((-6)/(-4))/((-2)/12). Let p be ((-24)/(-80))/(v/(-6)). Factor pw*4 + 3/5w*2 + 0 - 1/5w - 3/5w3. w(w - 1)*3/5 Let j = 265/3 - 88. Suppose -1/2q*4 + 0q + jq5 + 0 + 0q*3 + 1/6q*2 = 0. What is q? -1/2, 0, 1 Suppose 0 = k - 4k. Let q be (k - -1) + 1 + -1. Let v(t) = 1. Let d(a) = -2a2 - 4a + 8. Let o(h) = qd(h) - 10v(h). Factor o(u). -2(u + 1)2 Suppose -6n + 1416 = 336. Let r = n + -892/5. Determine v, given that -r - 2/5v2 + 8/5v = 0. 2 Let x(c) be the second derivative of -2c2 + 3/2c*4 + 0 + 5/3c*3 - 3c - 1/2c5 - 7/15c6. Find k such that x(k) = 0. -1, 2/7, 1 Let h(v) = v3 + v2 - v + 1. Let b(w) = -w4 - 4w3 - 27w*2 + 4w + 44. Let i(f) = -5b(f) + 40h(f). Solve i(k) = 0 for k. -6, -1, 1 Let x(f) be the second derivative of -f6/120 + f4/8 - f*3/2 - 2f. Let d(q) be the second derivative of x(q). Factor d(o). -3(o - 1)(o + 1) Let k(v) = 3v + 7. Let s be k(-6). Let m = 15 + s. Factor 4/7t*3 + 0t + 2/7tm + 0 + 2/7t*2. 2t*2(t + 1)*2/7 Let l(x) = 5x*4 - 3x*3 - 5x2 + x + 2. Let y(m) = -m4 + m3 + m2 - 1. Let k(i) = -l(i) - 2y(i). Factor k(j). -j(j - 1)(j + 1)(3j - 1) Let n = 4337/5 - 867. Factor 4/5o*2 + 0o + 0 - no3. -2o*2(o - 2)/5 Let v(w) be the third derivative of w6/120 - w5/10 + w4/2 + w3/6 - 4w2. Let t(h) be the first derivative of v(h). Determine d so that t(d) = 0. 2 Let w(x) = -2x*2 - 8x - 14. Let f(n) = -1. Let g(l) = -6f(l) + w(l). Factor g(v). -2(v + 2)*2 Let j = -5 - -8. Suppose -jl + 4l - 5 = -2m, 5m = -3l + 13. Solve -3i3 - 3i*4 + mi*4 + 3i4 + i3 = 0 for i. 0, 1 Suppose -3x + 36 = 3y, -5y = -4y + 2x - 16. Let n be (-20)/(-6)y/60. Let 0b3 - 2/9b + 0 + 4/9b2 + 2/9b*5 - nb*4 = 0. What is b? -1, 0, 1 Let o(p) = -7p*5 - 10p*4 - 3p*3 - 4p*2 - 4. Let h(r) = 8r*5 + 11r*4 + 3r*3 + 5r*2 + 5. Let k(i) = 4h(i) + 5o(i). Solve k(l) = 0. -1, 0 Let s(r) be the second derivative of -r6/480 + r5/80 - r4/48 + 3r*2/2 - 2r. Let i(a) be the first derivative of s(a). Factor i(g). -g(g - 2)(g - 1)/4 Suppose -5w + 5 = 2p, 10w - 1 = 11w. Factor 2/3r3 + rp + 2r*2 + 1/3 - 7/3r*4 - 5/3r. (r - 1)*3(r + 1)(3r - 1)/3 Let t(w) = w*5 - 10w*4 - 8w3 + w2 + 5w - 2. Let s(v) = -v5 + 19v*4 + 16v3 - v2 - 9v + 3. Let r(x) = 3s(x) + 5t(x). Factor r(q). (q + 1)4(2q - 1) Let m = 148 - 148. Let b(x) be the second derivative of -1/30x*6 + mx*3 + 0x*5 + 0x*2 + 0x*4 + 0 + x + 1/42x7. Factor b(y). y4(y - 1) Let x(r) be the first derivative of -r4/8 + r2/4 + 5. Suppose x(z) = 0. What is z? -1, 0, 1 Let t be -1(0 + 3) + 4. Factor -4w3 - t + 6w*4 - 2w*4 + 2w3 - w4 - 2w2 - w5 + 3w. -(w - 1)*4(w + 1) Factor 3/4z + 5/4z*2 - 9/4 + 1/4z*3. (z - 1)(z + 3)2/4 Let k(z) be the first derivative of -z3/4 - 9z2/8 - 22. Determine m so that k(m) = 0. -3, 0 Let h be 15/(-6)(-16)/10. Suppose -2u = k - 0u - 11, u + 8 = hk. Find s, given that 2s4 + sk + 4s2 - 7s*2 + 2s*2 = 0. -1, 0, 1/2 Let p be 1278/81 + 4/18. Suppose a = 3x + 12, 3a + p = -3x - x. Factor ar + 0r*2 + 0 - 2/9r*3. -2r3/9 Let f(v) be the second derivative of -v7/42 - v*6/10 - 3v5/20 - v4/12 + 5v. Factor f(k). -k2(k + 1)*3 Let z be -1 - (-33 + 8/4). Let c be (20/z)/(-1 + 2). Solve -2/3l*3 + 2/3l*2 + 2/3l*5 + 0 - cl*4 + 0l = 0 for l. -1, 0, 1 Let w(h) be the first derivative of -h7/70 - h6/30 + h5/30 + h4/6 + h3/6 + h2 + 4. Let y(g) be the second derivative of w(g). Factor y(d). -(d - 1)(d + 1)2(3d + 1) Let u = 55/4 - 27/2. Solve 1/4i*2 - 1/2i + u = 0 for i. 1 Suppose -4 = -v + 2. Factor -10 - 19o - v - 4o*2 + 3o. -4(o + 2)2 Let h = -133 - -133. Determine m, given that hm + 2/9m2 - 2/9 = 0. -1, 1 Let n(y) be the first derivative of y5/5 + y4/4 - y3 - y2/2 + 2y + 42. Factor n(v). (v - 1)*2(v + 1)(v + 2) Let o = 599 - 59899/100. Let a(s) be the third derivative of 4s*2 + 0s + os5 - 1/40s*4 - 1/5s*3 + 0. Suppose a(w) = 0. What is w? -1, 2 Let c = -3 + -2. Let l = c - -7. Factor 2h + 2h2 + 1 + 2h*l - 3h2. (h + 1)2 Let o = 20 - 18. Let y(s) be the first derivative of s + 7/8s4 - 1 + 3/4s*o - 2s3. Suppose y(d) = 0. Calculate d. -2/7, 1 Let s(t) be the first derivative of t5/80 - t*3/24 - 6t - 7. Let v(g) be the first derivative of s(g). Factor v(b). b(b - 1)(b + 1)/4 Let h(g) be the third derivative of -1/60g6 + 1/15g*5 - 1/12g*4 + 0g - 7g2 + 0 + 0g3. Find w such that h(w) = 0. 0, 1 Let b(h) be the third derivative of -h6/120 + h*4/24 - 10h*2. Factor b(x). -x(x - 1)(x + 1) Let k(h) be the second derivative of h7/42 - h6/15 - h5/10 + 2h*4/3 - 7h3/6 + h2 + 5h. Determine b, given that k(b) = 0. -2, 1 Let o(a) be the second derivative of -a7/2520 - a6/720 - a5/720 + 2a*3/3 - 4a. Let h(c) be the second derivative of o(c). Factor h(n). -n(n + 1)(2n + 1)/6 Let x be (-1)/6 - (-2)/(108/117). Factor 8/7g*x + 0 + 0g - 4/7g3 - 4/7g*4. -4g*2(g - 1)(g + 2)/7 Factor -2p - 2p2 - p3 - 2p*4 + 3p*3 + 4p*2 + 0p*3. -2p(p - 1)2(p + 1) Let i be (4/5)/(1/(-5)). Let s be (2/i)/((-7)/28). Factor 2g2 + 3g*2 + 3g - 4g2 + 2g*s. 3g(g + 1) Let x be 17/(408/128) + -4 + 0. Determine v, given that -1/3v*4 + 0v + 0 - 4/3v2 + xv*3 = 0. 0, 2 Let n be 4/(-18) + 52/(-9). Let a be (-3)/n(-24)/(-7). Factor -2/7 + 48/7g3 - ag - 32/7g4 - 2/7g*2. -2(g - 1)*2(4g + 1)2/7 Let c be (-2)/4(-6 + -4). Factor -2z2 + cz*2 - 9z*2 - 9z + 3z3. 3z(z - 3)(z + 1) Let r(o) be the second derivative of 4o7/21 - 6o*6/5 + 14o*5/5 - 3o*4 + 4o*3/3 + 2o - 8. Solve r(k) = 0 for k. 0, 1/2, 1, 2 Let x be (494/76 + (-5	{ "pile_set_name": "DM Mathematics" }
econd smallest value? (a) k (b) 0 (c) 5 c Let u = -21.4 - -21. What is the third smallest value in 2/9, 12, u? 12 Let j = -14 - -1. Let s = j + 8. Let o = 5.09 - 5.05. Which is the smallest value? (a) s (b) o (c) 0.1 a Let v = 0.8 - -0.2. Let l = -4 + 8. Let q = l - 0. What is the second smallest value in q, v, 3/5? v Let m = -3.7 + 3.2. What is the biggest value in m, -2/17, -2/7? -2/17 Let o be (-96)/286 - 4/(-22). Which is the smallest value? (a) -0.3 (b) 2 (c) -1/6 (d) o a Let i = -595/1359 - 1/151. What is the biggest value in -5, i, -2/5? -2/5 Let u = 0 - 4. Let m = -13 - -20. What is the third smallest value in -3, m, u? m Let r = 4837 + -4985.92. Let f = -144 - r. Let d = f - -0.08. Which is the biggest value? (a) -4 (b) -2 (c) d c Let a = -5 - -4.6. Suppose 0 = 4v + i + 5 + 12, -5v + 3i = 34. What is the third smallest value in -2, v, a? a Let f be (2/4)/(-1)12/(-57). Which is the third biggest value? (a) f (b) -3 (c) 0.4 b Let j = -27 - -29. Which is the second biggest value? (a) 1 (b) 3 (c) j c Let x(q) = 3q - 6. Let d be x(4). Suppose 5 = j - 2t, j + dt = 2t - 25. What is the biggest value in -0.3, -0.1, j? -0.1 Let d = 1 + -1.02. What is the smallest value in d, 1/2, -2? -2 Let m = -3.19 + 0.19. What is the second smallest value in -0.3, 0.5, m? -0.3 Let m = -32 - -35. Which is the second smallest value? (a) m (b) 5 (c) 1 a Let i = -55 - -107/2. What is the second smallest value in 0.5, i, 2/3? 0.5 Let m = -0.0728 + 0.0528. Let h = -16 - -4. Let q = h + 8. What is the third smallest value in 1, q, m? 1 Let b = 109 - 110.87. Let y = b + -0.13. What is the third smallest value in 5, 0, y? 5 Let v = -103/6 + 1739/102. Suppose 4q - n + 44 - 16 = 0, 5n = 4q + 12. Let i be (-10)/q2/5. Which is the second biggest value? (a) 0.1 (b) i (c) v a Let u = 0.17 + -3.17. Suppose 9 = 2y + y. Suppose 0v + yv = -15. What is the second smallest value in u, v, 5? u Let h = -59/4 - 187/12. Let g = -30 - h. Let i be (2/3)/1 + 0. Which is the second smallest value? (a) 0.5 (b) i (c) g a Let m(c) = c + 2. Let o(a) = 3a + 7. Let t(x) = 7m(x) - 2o(x). Let y be t(-1). What is the biggest value in -3, y, -0.3? -0.3 Let a = -30 - -29.7. What is the second biggest value in 0.01, 1/9, a? 0.01 Let y = -36 - -27. What is the second smallest value in -3, y, -0.2? -3 Let d = 0 - 0.3. Let p = 5.7 - d. Let t = p + -4. Which is the third biggest value? (a) -0.1 (b) 3 (c) t a Let j = -4 - 0. Which is the second biggest value? (a) 6 (b) 2/3 (c) j b Let g(m) = m*3 + 7m*2 - 5m - 7. Let w be g(-9). Let k = -870/7 - w. What is the second biggest value in -3/4, k, 1/2? k Let g = 5/2 - 9/4. Let w = -18.5 - -18. What is the smallest value in -2/7, w, g? w Let c = -0.8 + -3.2. Let y be 10/3 + 4/(-1). What is the biggest value in c, 12/7, y? 12/7 Let z be (15/2)/3 - (2 + -1). Which is the third biggest value? (a) -5/3 (b) -10 (c) z (d) -0.1 a Let l = -0.2 + 0.5. Let r = -0.2 + l. Let p = -0.2 + -1.8. Which is the third smallest value? (a) 0 (b) r (c) p b Let s be ((-1)/(-4))/(3 - (-20)/(-8)). Let r = -21 - -61/3. Let w be 6/21 - 24/182. Which is the second smallest value? (a) w (b) r (c) s a Let w = 23 + -101. Let k = 29 + w. Let v = k - -243/5. Which is the second smallest value? (a) v (b) -0.1 (c) 1/7 b Let r = 4 + 6. Suppose q + q + r = 0. Let i = -1 + 0. Which is the biggest value? (a) q (b) i (c) 0.1 c Let d = 3 + -6. Which is the third biggest value? (a) d (b) 5 (c) -6 c Let h = 16 - 16.09. Which is the second biggest value? (a) 5/3 (b) h (c) 0.4 (d) -3 c Suppose 5v + 4 = -6. Let i be (2/4)/((-38)/32). Let b = i + 73/38. What is the biggest value in 0.2, b, v? b Let i(f) = f + 3. Let o be i(-7). Let l be 7 + o + 74/(-26). Which is the third smallest value? (a) -1 (b) -0.1 (c) l c Suppose -4h = 3b - 35 - 4, 4b = -5h + 51. What is the smallest value in -1/2, b, -0.1, -3/5? -3/5 Let n = -89 - -93. Which is the smallest value? (a) n (b) -0.1 (c) -5 (d) -0.2 c Let z be 3468/30 + (-9)/15. Let k = 573/5 - z. Let o = -0.2 + -1.8. What is the second smallest value in k, o, 0.4? k Let x = -1/11 + -1/11. Which is the second smallest value? (a) -0.3 (b) 3 (c) x c Suppose 2j + 17 = z, -4j + 4z - 39 = -7. Let g be 2 + 6/j6. Let m = g - -6. What is the biggest value in m, -2, 5? 5 Let v = 292/429 - 2/143. What is the third smallest value in v, 1, -0.1? 1 Let l = -1.7 + 1.6. What is the third biggest value in 2, -1/5, l? -1/5 Let y = -0.1 - -0.2. Let r = 6 - 11. Let f = r - -10. What is the third smallest value in f, y, -5? f Let y be (8/10)/(21/15). What is the second smallest value in -3, y, 4? y Let y = -2.9 + 3.9. What is the third smallest value in -4, 3, y? 3 Suppose 0d = q - d + 3, 13 = -2q - 5d. What is the third smallest value in q, -3/4, 2? 2 Let s = -0.028 + -0.372. Which is the second smallest value? (a) 1/5 (b) s (c) 2/5 (d) -2 b Let r be ((-2)/(-3))/(6/(-54)). Let v be 0 - r/42. Suppose vq - x = -0q + 20, 4q - x = 25. Which is the third biggest value? (a) 1/2 (b) q (c) -3 c Let k = -0.4 + 0.2. Let h = -13 + 9. Let s = -4.5 - h. Which is the third smallest value? (a) k (b) s (c) 3/4 c Let r(d) = -d*3 + 13d*2 + d - 17. Let y be r(13). Which is the third smallest value? (a) 0 (b) -0.5 (c) y a Let f be 546/(-130) + 1/102. Let m be ((-1)/1)/(4/(-2)). Which is the second smallest value? (a) m (b) f (c) 0.2 c Let l be 1 + 26/8 + -4. Suppose 4n - 20 = 0, -3z + 3n = -0z + 24. Which is the second smallest value? (a) 1/6 (b) l (c) z a Let i = 0.02 + 0.08. What is the smallest value in -3, 0, i? -3 Let g = 4 + -4.09. Let r = g - -0.09. Which is the smallest value? (a) -0.3 (b) r (c) 5 a Let l(u) = u*2 + 18u + 3. Let j be l(-18). Let g = -0.04 + 2.04. Which is the smallest value? (a) g (b) -8/3 (c) j b Let i be 1/15(1 - -2). Let m = -0.976 + -0.024. Which is the second biggest value? (a) -4 (b) m (c) i b Let p = -2939/14 + 210. What is the second biggest value in 3/8, 0.1, p, 4? 3/8 Let y = -30 + 30.26. Let r = y - -0.24. Let d = -2.8 + -0.2. Which is the smallest value? (a) -0.1 (b) r (c) d c Let z = -15 + 12. Which is the biggest value? (a) 5 (b) -6 (c) z a Let t be (-20)/(-15) - (6/(-3))/(-6). Which is the biggest value? (a) t (b) -13 (c) 0.3 (d) 4/3 d Let t = 0.02 - 0.04. Let v = -0.18 + t. Suppose 0 = -3i - 9, 2o + 2o + 19 = -5i. Which is the second biggest value? (a) -0.5 (b) o (c) v a Let x = -12/247 - 2/19. Which is the fourth biggest value? (a) x (b) 2 (c) -0.3 (d) -2/5 d Let y = 93 - 91. What is the third smallest value in -5.3, y, 3/2? y Let f be (-5)/(-2)27/(-90). Suppose 0 = n + 2n - 3. Let q be (2 + -4)/(n/(-2)). What is the third smallest value in q, f, 0.4? q Let p = -0.05 + 0.16. Let y = p + -0.01. Which is the second smallest value? (a) -1/4 (b) -1/2 (c) y a Let v be 51/(-105) + (18/14 - 1). Which is the biggest value? (a) 5 (b) v (c) 0.1 a Let n be (-1)/4 - (-102)/(-8). Let m be n/(-11) - 4/4. Which is the second biggest value? (a) -5 (b) m (c) -1/4 c Let f be 1/3 + 2/(-18). Let u be (76/(-78) + 1)2. Let x = u + -28/39. What is the second smallest value in f, 0.5, x? f Let w be (3 - -1)(-10)/8. Let c = 1/9 - -7/18. What is the second smallest value in -0.3, w, c? -0.3 Let h = -7 + 12. Suppose -3m = 5l - 2 - 11, -l + hm - 3 = 0. Let w be 23/1210. Which is the biggest value? (a) 3 (b) w (c) l b Let u = -17.59 + -0.41. Let g = 8 + u. Which is the biggest value? (a) 3 (b) g (c) 4 c Let v = 0.28 - 0.18. Let m be (-6)/(-15) + (-2)/(-20). What is the second smallest value in v, m, -0.1? v Let x = -0.08 + -0.42. Let q = -0.1 - x. What is the smallest value in q, 3, -4? -4 Let h = -86 - -95.1. Let y = -9 + h. What is the second smallest value in y, -4, 6? y Let r = 11.8 + -7. Let w = -11 + 10.2. Let a = w + r. What is the second biggest value in -1/2, a, 3/5? 3/5 Let r = 3 - 0. Let j = 2.8 - r. Let m = 1.9 + -2. Which is the third smallest value? (a) j (b) m (c) -3 b Suppose -3*j + 12 - 3 = 0. What is the smallest value in j, -0.2, -5? -5 Let j = 7 + -13. Let k = j + 9. Let s = -0.09 - -0.06. Which is the second biggest value? (a) s (b) k (c) 4 b Let w = -8.88 - -9. Which is the bi	{ "pile_set_name": "DM Mathematics" }
Find the second derivative of p*2t2 + p2t - 9p*2 + 49p + 24543t2 + t - 57 wrt t. 2p*2 + 49086 Differentiate 161422g - 253127. 161422 What is the first derivative of 3098i3 - 2i*2 - 16657 wrt i? 9294i*2 - 4i What is the second derivative of 44549p3 - 21423p wrt p? 267294p Find the third derivative of -556r*6 - 1351r*3 + 1073008r*2 - 2r. -66720r3 - 8106 What is the second derivative of 14r*2wx + 7r*2w - 31r2x + r*2 - 4rwx + 31rw - 5rx - w + 2x wrt r? 28wx + 14w - 62x + 2 Find the third derivative of 84326t*5 + 385t*2 + 154t wrt t. 5059560t2 What is the second derivative of -7o*4w + o*3 + 422o*2 + 4295ow - 2o - w wrt o? -84o2w + 6o + 844 Find the second derivative of 26460j*2y*2 - 2797jy2 - 5j wrt j. 52920y2 Find the first derivative of 38582b*2 + 6br2 - 24r*2 - r - 4 wrt b. 77164b + 6r2 What is the first derivative of -256187a*4 + 236631? -1024748a*3 Find the second derivative of -349336g*3 - 129444g + 2 wrt g. -2096016g Find the second derivative of 31o*3 - 165o*2 - 13280o - 18 wrt o. 186o - 330 Find the first derivative of 75779j*3 - 2206611 wrt j. 227337j*2 What is the derivative of -4835in2 - 53i + 1 wrt n? -9670in Find the third derivative of 6g6l + 10355g6 + 2g*2l - 16976g2 + 5gl - 3g + l wrt g. 720g3l + 1242600g3 Find the third derivative of 4637f*4 - 7f*3 - 23f*2 - 15f + 16. 111288f - 42 What is the derivative of -15c*3oq + c3o - 15c3q + 566oq - 3712q wrt o? -15c*3q + c*3 + 566q Differentiate -94u2 - 20u - 16765. -188u - 20 Find the second derivative of -1423524l*3n*2 - ln*2 + 37ln - 7n*2 + 4 wrt l. -8541144ln2 Differentiate -139j*4p + 122jp + 10888p - 2 wrt j. -556j*3p + 122p What is the third derivative of 61bu3 - 47bu - 6b + 1144u3 - u2 + 20u wrt u? 366b + 6864 Differentiate -203209m*2r*3 - 293m*2 + 44m + r*3 wrt r. -609627m*2r*2 + 3r*2 Find the first derivative of 3407q*2 - 135q + 775648. 6814q - 135 Find the first derivative of -211660a*4 + 34977 wrt a. -846640a*3 Differentiate -17493q + 73538. -17493 What is the third derivative of -2532641f3 + 188319f*2? -15195846 What is the second derivative of -33310g*2 + 111937g wrt g? -66620 Find the third derivative of 8yz*4 + 3yz3 + 3yz2 + 246z*3 + 5z*2 + 298 wrt z. 192yz + 18y + 1476 Find the second derivative of 80414o3 - 94181o. 482484o Differentiate 1671067b - 5677699 wrt b. 1671067 What is the third derivative of -dv4 + 3dv2 - d - 376v*4 - 7v*2 - 16 wrt v? -24dv - 9024v Find the third derivative of 628125l3 - 466551l*2 wrt l. 3768750 What is the second derivative of 424u*4 + 12u*3 - 20u - 267? 5088u2 + 72u What is the third derivative of 625062f4 - 2f*2 + 2f + 22388 wrt f? 15001488f Differentiate -320238v - 550921. -320238 Find the third derivative of -2ru*5 + 6ru4 - 113ru3 + 2ru2 - 27ru - 9r - 2u2 wrt u. -120ru2 + 144ru - 678r What is the third derivative of -125293j5n3 - j3n3 - 2j*2n + 27jn - 5j - n3 - 50n wrt j? -7517580j2n*3 - 6n*3 Find the third derivative of 29o*3s2 - o3s + 130o3 - o2s2 - os*2 + o - 600s*2 wrt o. 174s*2 - 6s + 780 Find the second derivative of 345200f4 + 12028f. 4142400f2 What is the first derivative of -1103i*2 + 1621i - 4239334? -2206i + 1621 Differentiate -193p*3 + 4p*2 + 31p - 749556. -579p2 + 8p + 31 What is the second derivative of -9954h2 - 228097h wrt h? -19908 Differentiate 2h3m*2 + 18984h*3 - 5724hm + 2m*3 + 5 wrt m. 4h*3m - 5724h + 6m*2 What is the first derivative of -3171l*3z*2 + 341129l*3 + 32lz4 wrt z? -6342l*3z + 128lz*3 What is the second derivative of -3q*3rv + 198q*3v - 3q2v + 2q2 + 5qrv - 48qr - qv - 2q + 2r - 5 wrt q? -18qrv + 1188qv - 6v + 4 Find the third derivative of 149801c*6 - 173096c*2 wrt c. 17976120c*3 What is the first derivative of -547254t*2 + 890513 wrt t? -1094508t Differentiate 77l3 - 45l*2p - 2l - 83872p with respect to l. 231l2 - 90lp - 2 Find the first derivative of 314dh2 + 351dh - d + 2h*2 - 17497h + 4 wrt d. 314h2 + 351h - 1 Find the first derivative of -846kmu3 - 13ku3 + 381ku - 243mu3x*2 + 14u*3x2 + u3x wrt m. -846ku3 - 243u*3x*2 Differentiate 4688pq3 + 2pq2 - 2pq - 2p + q*3 + 417q*2 + 94q with respect to p. 4688q3 + 2q*2 - 2q - 2 What is the derivative of 26445l4 - 52011 wrt l? 105780l*3 What is the second derivative of 10480a*5 + 7a*4l - 2055al - 7a - 2l wrt a? 209600a3 + 84a*2l What is the second derivative of 40893r3 - 5992r? 245358r What is the third derivative of v6 - 15712v*4 - 5v*3 - 2213176v*2 wrt v? 120v*3 - 377088v - 30 Find the first derivative of 39480n2 - 69358 wrt n. 78960n Differentiate -20709nv + 25942n with respect to v. -20709n Find the first derivative of -6037h - 56357. -6037 What is the first derivative of -88528i + 20716 wrt i? -88528 Find the first derivative of 3365c + 198140. 3365 What is the second derivative of -36415no3 - 36no - 2n - 22o - 5 wrt o? -218490no What is the third derivative of -2131w*4 - 2w*3 - 8055w*2 - 1 wrt w? -51144w - 12 What is the second derivative of -6m3p*2 + 2m*3p + 5m3 + 1760m*2p*2 + 3m*2p + 3mp wrt p? -12m3 + 3520m*2 What is the third derivative of 56g*3s + 849g3 - 924g*2s - 7g2 - s + 2 wrt g? 336s + 5094 What is the second derivative of -4l4 - 3245l*2 - 10963l wrt l? -48l2 - 6490 What is the third derivative of -9t*4 - 7173t*3v*2 + 3t*3 - 4214t*2v*2 + 2tv2 + 22v*2 wrt t? -216t - 43038v2 + 18 Differentiate 56940m*2 + 4m + 805619 wrt m. 113880m + 4 Find the first derivative of 4497498y - 1973918. 4497498 What is the second derivative of -31827y4 - y2 - y - 3847 wrt y? -381924y*2 - 2 What is the third derivative of -54621r*4 + 283247r*2 wrt r? -1310904r What is the first derivative of -16m2p*2x + m*2px - 2m*2x - 178m2 - 4mx - m + 129p*2 wrt p? -32m*2px + m2x + 258p Differentiate 9in2y + 6in*2 - 54in - 2iy - 3i - 1787n2y + 9n with respect to y. 9in2 - 2i - 1787n2 Find the second derivative of 805804d*3 + 802230d wrt d. 4834824d Differentiate 851100t - 2955826 wrt t. 851100 Find the third derivative of -553637i5 - 212874i*2. -33218220i*2 Find the second derivative of 217690r*2 + r + 203 wrt r. 435380 Find the second derivative of -8705g*3 - 8g + 2080 wrt g. -52230g Find the third derivative of -55770l3 - l2 - 29l + 164. -334620 Find the third derivative of -83862p*3r - 3p2r + p*2 + 60pr + 31 wrt p. -503172r Find the third derivative of 558453x6 - 5949001x*2 wrt x. 67014360x*3 Find the first derivative of -3h*3u*4 + 2h*3 + 6484h*2 + 4h - 40958u4 wrt u. -12h*3u*3 - 163832u*3 What is the derivative of -1434v*3w + 448v2w3 - w3 - 2104499w2 wrt v? -4302v*2w + 896vw*3 What is the first derivative of -3r*3 + 64r*2 - 103r + 224824? -9r2 + 128r - 103 Differentiate -57s2 - 853s - 585603 with respect to s. -114s - 853 Find the second derivative of -79746y*4 + 2y*3 + 2866y + 1 wrt y. -956952y2 + 12y Differentiate 358i3 + 169i*2 - 660431 wrt i. 1074i*2 + 338i Find the third derivative of -14295t3x + 13184t2x wrt t. -85770x Find the third derivative of 395x*6 + 12x*3 + 324x*2 - 6x + 6. 47400x3 + 72 What is the first derivative of 23o*2w - o*2 + 4165ow + 13004o - 2 wrt w? 23o2 + 4165o Differentiate -329h3m + 52h3 + 15h*2m + hm - 2h + 102 with respect to m. -329h3 + 15h*2 + h What is the second derivative of 409b3 + b2 + 59545b? 2454b + 2 Differentiate -99656j4 - 69815 with respect to j. -398624j*3 Find the first derivative of -79144v*2 - 51579 wrt v. -158288v What is the second derivative of 2cdo3 - 5cdo + 77cd + 37189do*3 - 3o*3 + 2o - 1	{ "pile_set_name": "DM Mathematics" }
t d be 01/2 + 2. Let t be 3/d44/33. Solve 0 = -2f + t + 2 for f. 2 Let a = 226 + -158. Let s be (-2)/(-9) + a/18. Solve -s = 3q - 1 for q. -1 Let w be (-5 + (-36)/(-8))(2 + -2). Solve w = 3h - 2h + 4 for h. -4 Suppose m = -3m. Suppose mi + 2i - 79 = -3l, 5i + 90 = 4l. Solve 8f - 3f = l for f. 5 Let m = 0 + -2. Let u be (4/m1)/(-1). Let b = u - 2. Solve 3c - c = b for c. 0 Let w be (5/4 - 2)/(4/(-16)). Solve -3 = 4z - wz for z. -3 Suppose 5t = 4k + 3, 17 = 3t + 4k - 4. Suppose -6q + 2q = 0. Suppose q = -2h + h - 4u - 3, -5u - 5 = h. Solve -t - h = -4v for v. 2 Let x be (0 + (-30)/(-9))3. Let n be 54/x + 8/(-20). Solve -n = -5j + 10 for j. 3 Let c = 8 + -1. Suppose -cv = -2v + 2t - 44, 2t = 4. Let r(d) = -2d - 6. Let h be r(-4). Solve h = 5j - v for j. 2 Suppose 6 = -0a - a. Let v(i) = -i*3 - 7i*2 - 8i - 9. Let b be v(a). Suppose -2q = g + b, -8 = 6q - 4q + 2g. Solve -4 = z + q for z. -5 Let j(i) = i + 4. Let a = 2 + 0. Let n = -1 - a. Let t be j(n). Solve -2 - t = -s for s. 3 Let k = 1 - -2. Suppose 0z + kz = 3. Solve -3m = -z + 4 for m. -1 Let m(b) = 3b - 31. Let o be m(13). Solve 2h = -2h - o for h. -2 Let r be (0 - 2)-61. Suppose -5w + r + 18 = 0. Solve -5c = 26 - w for c. -4 Let v = -3 + 4. Suppose v - 9 = -4b. Solve 4 = -o + b for o. -2 Let b = 4 + -7. Let c be 0 + 3/b + 3. Solve 4y = 18 - c for y. 4 Let k(c) = -c*2 - 4c. Let d be k(-2). Solve b = -db - 15 for b. -3 Let f = -22 - -29. Suppose 3p = fp. Solve -s + 1 - 4 = p for s. -3 Let d(t) = 2t - 18. Let i be d(9). Let x be 110/6 + (-4)/(-6). Suppose -5c - x = 2r, 5r + 5c - 5 + 15 = 0. Solve -h = r - i for h. -3 Let j(b) = b*3 - 3b*2 + b. Let g be j(3). Suppose -i - 14 = -gi. Solve 0 = -3x + ix + 16 for x. -4 Let d be 11/4 + (-6)/8. Solve dk - 6 = 4 for k. 5 Let n = 98 + -95. Solve -16 = nq - 7 for q. -3 Suppose 5h = -2x + 2h - 12, x = h + 4. Solve -2l - l = x for l. 0 Let a be (-1 + 16)/1. Let f(q) = 2q2 - 7. Let l(d) = -d2 + 3. Let s(u) = -2f(u) - 5l(u). Let p be s(2). Solve p + 7 = -ax for x. -2 Let x = -18 - -20. Solve 0w + xw = 0 for w. 0 Let u = 4 + 11. Suppose -2 = 4l - 5l. Suppose -3r = 2r. Solve r = k + lk - u for k. 5 Let k = -36 + 36. Solve k = -3i - 0i for i. 0 Let n(i) = i*2 + 9i + 14. Let w be n(-7). Solve w = 3s - 3 - 3 for s. 2 Let f be (0 - -1)(-1 + 3). Suppose -f - 2 = -4c. Solve -3n = -4 + c for n. 1 Suppose 5 = 5d + z - 6z, 3z = -4d + 11. Let k be (-2)/(-2) - d - 1. Let c = k + 6. Solve 0 = -4x + 2x - c for x. -2 Suppose 5 = -6i + 35. Solve 0 = 4f - 7 - i for f. 3 Let z be (2/(-6))/((-2)/(-6)). Let g = z + 7. Solve s + g = -2s for s. -2 Let m be 0(2 + 3/(-2)). Suppose mw + w = 0. Solve w = -3x + 7x - 12 for x. 3 Let d(q) = -q2 - q - 30. Let p be d(0). Let a be p/4(-28)/35. Solve -s - 5 = -as for s. 1 Let c = 56 + -52. Solve cn + 5 = -n for n. -1 Suppose 5q = 5 + 5. Suppose 914 = -4d + 18. Let l be d/(-10) + (-8)/20. Solve -l = 4u - q for u. -5 Let i = 5 + 1. Solve 3w = iw for w. 0 Let f = -90 - -98. Solve 0 = 2b + 2b - f for b. 2 Let f(j) = 5j + 8. Let n(z) = -2z - 3. Let t(p) = 3f(p) + 8n(p). Let u be t(1). Let q be (-2 - u) + 1 - 0. Solve q = -4g + 3 - 7 for g. -1 Suppose -3l + 7 = -8. Solve 0 = -b - l for b. -5 Let y = -4 + -5. Let w = y - -12. Solve -2r + 1 - w = 0 for r. -1 Suppose 10r - 32 = 2p + 6r, 0 = 5p - r + 35. Let z(h) = h - 9. Let f be z(0). Let b = p - f. Solve bc + 4 = -5 for c. -3 Suppose 0 = -m - 6 - 9. Let h(o) = o3 - 2o*2 + 2. Let s be h(2). Let u be (-55)/m + s/(-3). Solve uq = -0q + 9 for q. 3 Let x(z) = 2z - 2. Let w be x(1). Suppose -3s + d - 6d + 17 = w, 0 = -3d + 3. Solve -1 = -p - s for p. -3 Suppose -5z + 7 = -m + 2m, -2m = -3z + 38. Let n = 19 + m. Solve -3a - n = 9 for a. -5 Suppose -h = -0 - 2. Suppose -5u = -hc + 3, -2u - 1 = c - 2c. Let m be (4/12)/(u/(-9)). Solve 20 = -mb + 8 for b. -4 Suppose -2r - 5v = -15, 0r = -3r + 4v + 11. Solve -2 - 13 = ru for u. -3 Let r(t) = t3 - 4t*2 + 8t - 15. Let s be r(3). Solve s = -6f + f for f. 0 Suppose -6a + 2a = -s + 8, 3a = 5s + 11. Let q = a - -5. Solve -6 - q = 4x for x. -2 Let k = 106 - 101. Solve k = 2u + 3 for u. 1 Suppose -3k = 11 - 5. Let q be (0 + 0)/(k - 0). Suppose q = 3h - h - 2. Solve 3l - h = -7 for l. -2 Let x be 1 - -11 - (7 + -2). Solve 3s + x - 22 = 0 for s. 5 Let t be (5/(-4))/(8/(-32)). Solve -3o + t = 17 for o. -4 Let v(z) = -2z - 4. Let w be v(-3). Suppose -5j = 2a - 18 - 21, 0 = 3j - wa - 33. Solve -3q = -0 - j for q. 3 Suppose 2m = -2n + 8, 2m + 3n = -0 + 5. Suppose -5q + 13 = 4t, mq + 6 = 3q + 5t. Solve -q + 13 = -3b for b. -4 Suppose 2t - 3 = 7. Suppose 0 = -ta + a. Let z be a/3 - -7 - 0. Solve 2y = -1 + z for y. 3 Suppose 4j = 6 - 2. Solve 3w - j = 11 for w. 4 Let m = -2 + 22. Solve -8r + 3r + m = 0 for r. 4 Let h be (-5)/((-50)/196) - 4/(-10). Solve 3u + 2u = -h for u. -4 Suppose 8o - 3o - 62 = 2i, -5o = 5i - 55. Let g be (-3)/o - (-34)/8. Solve gx = x + 6 for x. 2 Let q(h) = -h3 + 5h*2 - h + 4. Let y(l) = -l. Let n be y(2). Let i be (2 - 0)(0 - n). Let w be q(i). Solve -5b + w = 1 for b. 3 Suppose -2f - 4o = 8, 2f - 5o = -o - 16. Let l(x) = x2 + x - 4. Let b be l(f). Solve 5n + 6 = b for n. 4 Let o = 10 + -5. Suppose 18 + 67 = oy. Suppose -n - y = -4i, -4i + 3i = 4n. Solve -ij + 12 = -0j for j. 3 Let p(i) be the second derivative of -i5/20 - 2i*4/3 + 3i*2/2 + 10i. Let a be p(-8). Solve ar - 3 = -0 for r. 1 Let o(b) = 2b*3 - b + 2. Let s be o(-2). Let i = -7 - s. Solve 0 = -2u + iu + 12 for u. -4 Suppose -2 = 4w - u + 7, -4w = -4u + 12. Let r = -10 - -12. Let d = r + w. Solve d = 4p + p + 20 for p. -4 Let l = -17 - -18. Solve 0 = 4a + 5 - l for a. -1 Suppose -4c + 2c - 3m + 11 = 0, 2 = 2m. Suppose 2j - 5 = 5k, -3k = 4j - 0k - 75. Suppose -j = -ct - 3. Solve ta - 10 = 2 for a. 4 Let s = -7 + 11. Suppose -5n = -2q + 1 - 13, q + sn - 20 = 0. Suppose 3g + 3 = 3r, 5g - 11 = -3r + qr. Solve -ga = a - 20 for a. 5 Suppose -8u - 3u = -44. Solve -4 - u = 2g for g. -4 Suppose -5l - 4p + 151 = 0, -l + 4p + p + 7 = 0. Let t be (-6)/l - (-101)/9. Suppose b = 4a - 12, 2a = 4b + t + 9. Solve 0 = 2s - a - 6 for s. 4 Let o be (1 + -1)/(10/5). Suppose o = -2f + 7f - 15. Suppose fl = 5l. Solve l = 3i + i for i. 0 Let n = -37 - -61. Solve n - 4 = 5q for q. 4 Suppose 6 = -42n + 44n. Solve -nq + 11 = -1 for q. 4 Let l be (-4)/6(-75)/10. Solve 6w = w + l for w. 1 Let w = 10 - 7. Let m(g) = -g - 15. Let b be m(-15). Solve -wz + 11 + 4 = b for z. 5 Suppose -5z = 3f + 13 - 45, 5f - 2z = 12. Solve 0 = fo + o for o. 0 Suppose 0 = -n + 21 - 18. Suppose -2 = -3f + na - 11, -2f = -a + 2. Solve -2u + f = -3u for u. -1 Let h be (1 - -1)(-28)/8. Let i = -2 - h. Solve 3 = -iy - 22 for y. -5 Let b = -16 - -20. Solve -s = 2 - b for s. 2 Let y(v) = v*2 + v - 2. Let p be y(2). Let j(q) = -1 + pq - 7q - 4q. Let d be j(-1). Solve dl = 3l - 15 for l. -5 Let d(u) be the second derivative of -u5/10 - u4/12 + u3/6 - u2 - 5u. Let n be d(-2). Solve -n = t - 5t for t. 2 Let z(j) be the third derivative of -9j4/4 + 2j3/3 - j2. Let o be z(5). Let l be (-4)/(-18) + o/(-18). Solve l + 0 = -5u for u. -3 Let a(k) be the first derivative of k4/4 + 4k*3/3 - 3k*2/2 + 3k + 3. Let d be a(-4). Suppose 0 = 4y - y - d. Solve i - 2 = -y for i. -3 Let o be 17 + 39/(-13). Solve ou = -u for u. 0 Suppose 5m + 5s = 50, -s + 14 = m + 2s. Solve -10t = -12t + m for t. 4 Let n(y) = y*3 + 2y*2 - 5y + 5. Let t be n(2). Let j be 1 + 14/(-2) - 1. Let b = j + t. Solve -bp - 1 - 19 = 0 for p. -5 Suppose l - 8 = -k + 2l, 4k - 3l = 27. Suppose -ko + 6 = -0o. Solve -o + 0 = y for y. -2 Let f be ((-8)/3)/((-4)/6). Let m(j) be the third derivative of -j6/6 + j5/60 - j3/6 - j2. Let w be m(-1). Solve fa = -a + w for a. 4 Suppose 0 = 2v - 13 - 11. Suppose -3n + v = -0n. Solve -3l + 1 - n = 0 for l. -1 Suppose 12 = 2r + 8. Solve b + 3 = rb for b. 3 Let m = 17 - 14. Let c be 15/(-10)(-4)/3. Solve 0 = mb - b + c for b. -1 Suppose -9t + 10t - 2 = 0. Solve 0 = p + tp - 6 for p. 2 Let c =	{ "pile_set_name": "DM Mathematics" }
hird derivative of -x4/24 - x3/6 - 34x2. Let g(r) = r2 - 23r + 41. Let n be g(21). Calculate u(n). 0 Let x(b) = b*2 + 2b + 8. Let q = -192 + 187. What is x(q)? 23 Suppose 2f = j - 1, 5j - 3 = -2f + 2j. Let d(o) = 1 + fo + 2o - 3o. Give d(-3). 4 Let v(k) = -k3 - 3k*2 - 4k - 3. Let x be v(-4). Let p(h) = 17h - 7 + 13h - xh. Calculate p(8). 1 Let z(p) = -p + 8. Let m = -10 - -17. Let b be z(m). Let r(j) = j3 + j + b + 0 + 2j*2 + 0j + 3j2. Give r(-4). 13 Let f(x) = -x - 1. Let l(b) = 2b + 2. Let c(o) = 13f(o) + 6l(o). Let k = 95 + -39. Suppose k = -8q - 0q. What is c(q)? 6 Let k(m) = -7m - 1. Let l = -661 + 667. Calculate k(l). -43 Let d(s) be the third derivative of -s4/6 - 7s3/3 + s2 - 56s. Determine d(-4). 2 Let i(n) = n3 - 18n*2 + 17n + 4. Let l be i(17). Let o(p) = -780 + lp + 388 - p + 391. Give o(4). 11 Let w(c) = -2c*3 - 6c*2 - 2c - 6. Let n(o) = -o*3 - 8o*2 - 20o - 95. Let i be n(-7). What is w(i)? 34 Let q = -18 + 24. Let r(m) = -5m2 - m + 6. Let v(c) = 6c*2 + 2c - 6. Let t(b) = qv(b) + 7r(b). What is t(-5)? 6 Suppose 2k + 2k = -20. Let y(p) be the second derivative of -p4/12 - p3/3 + 7p2/2 - 38p. Determine y(k). -8 Suppose 0 = 3w + v + 15, 7v - 3v = 5w + 25. Let q(t) be the first derivative of -t*3/3 - 3t*2 + 2t + 157. What is q(w)? 7 Let k(x) = -x3 + x2 + x. Let c(g) = -5g2 - 4g + 1. Let z(q) = -c(q) - 3k(q). Give z(2). 33 Let l(j) be the third derivative of 15j*2 + 1/12j*4 + 0j + 0 + 1/3j3. Let x be 0/(-2) + 1 + -3. Determine l(x). -2 Let q = -51 + 58. Let t(v) = -qv*2 - 2v + 6v2 - 1 + 7v + 3v. Calculate t(6). 11 Suppose -5l + 134 = -3w, 2l - l - w - 28 = 0. Let h(c) = 0c + l - 7c + c*3 - 5c2 - 17. Determine h(6). 2 Let u = -30 + 20. Let d = 10 + u. Let x(h) be the third derivative of h4/24 - 5h3/3 - 15h*2. What is x(d)? -10 Suppose 0j - 4j + 12 = 0. Let g = 11 - j. Suppose -4n = 4z + g, 2z = -5n + z + 10. Let h(d) = -d3 + 2d*2 + 3d. Give h(n). 0 Let o(s) = -s + 3. Let q(m) = -m*2 + 33m - 83. Let u be q(30). What is o(u)? -4 Let u(g) be the first derivative of -g4/4 + g3 + g*2/2 + 6g + 15. Calculate u(4). -6 Let p(a) = -2 + 3a - a + 3 - a. Let j = 4 - 1. Suppose -4h = -jh. Determine p(h). 1 Let j(o) = 3o + 38. Let u(p) = 7p + 91. Let h(t) = 5j(t) - 2u(t). Calculate h(3). 11 Let x(s) = -43s*3 + 57s*3 + s + s - 7 - 13s*3 - 5s*2. Give x(5). 3 Let p(q) = 7q*2 + 5. Let v(d) = -13d*2 - d - 10. Let y(k) = 11p(k) + 6v(k). Suppose 4m + 3i = -39, -5i - 38 = 8m - 7i. Give y(m). -5 Let h be 4/(-2) - -2 - 2. Suppose 0 = -g - 3g + 32. Let d(v) = -7v - 13. Let r(k) = -11k - 20. Let o(n) = gd(n) - 5r(n). Determine o(h). -2 Let x(l) = 37l + 4. Let q(r) = -78r + 466. Let t be q(6). Give x(t). -70 Let g(c) = -3c + 13. Let x be g(4). Let r(q) = 53q - 47q + 6q2 + x - 2 - q3. Calculate r(7). -8 Let m(c) be the second derivative of -c5/20 + c4/4 - c3/3 - 2c + 4. Give m(2). 0 Let n(x) = -4x2 + 28x*3 + 0x*2 - 3x + 4x - 27x*3. Suppose 4w + 0w = 16. Suppose q = -0r - r, 0 = wq - 3r - 28. Determine n(q). 4 Let q(t) = 5t - 9. Let u(g) = 9g - 18. Let x(w) = 11q(w) - 6u(w). Let z(l) = 1 + 3 + 0. Let v(f) = 2x(f) - 5z(f). Calculate v(5). 8 Suppose -7o = r - 2o - 12, 0 = -r + 4o - 24. Let y(g) = 3g*2 + 11g + 6. Let u(b) = -4b2 - 12b - 5. Let s(d) = -2u(d) - 3y(d). Determine s(r). 0 Let f(g) = 28g3 - g2 - 2g - 1. Let h(t) = -t*2 - 29t + 61. Let y be h(2). What is f(y)? -28 Suppose 2o = 3r - 9 - 6, -5o - 35 = -5r. Let k be (-25)/(-15) + -1 - (-22)/o. Let x(d) = 3d + 4. Calculate x(k). -5 Suppose 78 = 22j - 10. Let d(u) = 6u + 2. Give d(j). 26 Let u(n) = 7n*2 - 2n - 5. Let j(y) = -12y2 + 2y + 11. Let k(i) = 3j(i) + 5u(i). Let z(l) = l*2 - 5l - 3. Let p be z(4). Give k(p). -13 Suppose -6 = -9h + 7h. Let z(s) = s + 3. Calculate z(h). 6 Let r(u) = u*3 + 38u*2 - 37u + 73. Let m be r(-39). Let a(w) be the third derivative of -w5/60 - w4/6 - w3/6 + w2. Determine a(m). -6 Let v(j) = j*3 + 27803j - 27799j - 16 - 4j2 + j2. What is v(3)? -4 Suppose -4p - 3l = -44, 3p - 3l - l = 8. Suppose -5a = -4i + 61, 2i + 4a + 65 = 7i. Let q(m) = 10m*2 - 15m*2 - i + pm + 6m2. Give q(-9). 0 Let j(a) be the first derivative of a3/3 + a2/2 + 2a + 92. Give j(-2). 4 Let z(k) = -16k2 - 40k + 12. Let w(x) = -7x2 - 19x + 6. Let t(o) = 9w(o) - 4z(o). What is t(7)? -22 Let m be 2 + -2 + (42 - 43). Let u(j) = -3j + 5. Calculate u(m). 8 Let w(m) = 106m*2 - 5m + 2. Let n be w(1). Let h = -103 + n. Let z(s) = s*2 + s + 1. What is z(h)? 1 Let d(m) = 11m*3 - 4m*2 + 14. Let g(r) = -8r*3 + 5r*2 + r - 13. Let l(o) = -3d(o) - 4g(o). Give l(-7). -11 Let n(w) = w2 - w - 23. Suppose 96k = 88k. Give n(k). -23 Let l(r) = -r3 + 28r*2 + 32r - 81. Let c be l(29). Let g(u) = u*3 - 7u*2 + 6u - 7. What is g(c)? -7 Let s(y) be the third derivative of y4/24 - y3/6 - 10y2. Determine s(9). 8 Suppose 4k + 31 = -2y - 3y, -4y - 24 = 3k. Let j be (9/(-4))/(y/(-8)). Let d(m) be the second derivative of -m*3/6 - 2m*2 + 4m - 7. Give d(j). 2 Let q(c) = c*3 + 11c*2 + 11c + 13. Suppose 16p - 9p + 70 = 0. Let d be q(p). Let f(h) = 5h. What is f(d)? 15 Let f(y) = 18y*3 + 1. Suppose 3d + 20 = 5n, -3d - 60 + 47 = 2n. Calculate f(n). 19 Let j be (-14)/(-4)11/((-99)/18). Let b(z) = z*2 + 6z + 5. What is b(j)? 12 Let c(i) = -5i2 + 15i*2 - 5i*2 - 7i*2 + 5 - 4i. Give c(2). -11 Let r(i) = -i*2 + 2i + 5. Let w = -33 - -34. Let l(q) = q + 1. Let y(c) = wl(c) + r(c). Calculate y(6). -12 Let a(w) = -w3 + 3w*2 + 3w - 3. Let f(s) = 5s - 1. Suppose -10 - 1 = j. Let b = -10 - j. Let q be f(b). Give a(q). -7 Let t(k) = k. Let f be (-1 + 5/(-10))4. Let m be t(f). Let c(p) = p - 4. What is c(m)? -10 Let x(i) be the first derivative of -i*2/2 - 7i - 1. Let u(w) = 12w - 28. Let p be u(3). Let h be (-6)/(-12)-1p. Give x(h). -3 Suppose 4p - 7 = 2b - 3, 2b = -5p - 22. Let s(n) = n3 + 5n*2 - n + 4. What is s(b)? -26 Let a = 33 + -33. Let l be (-3)/(-12) + (-23)/(-4). Suppose -lb + 10b - 12 = a. Let h(v) = -2v*2 + 2v + 1. Determine h(b). -11 Let y(x) = 14x3 + 3x*2 - 8x - 1. Let z(r) = -5r3 - r2 + 3r. Let b(j) = -4y(j) - 11z(j). Let c be -2 + 8 + -13 + 7. Calculate b(c). 4 Suppose 0 = 7r - 5r + 8. Let m(q) = -422324 + 2q + q3 + 422323 + 3q + 5q2. Give m(r). -5 Let c(j) = j - 15. Let f(s) = -2s + 30. Let u(i) = 5c(i) + 2f(i). Determine u(0). -15 Let h be (-3 - ((-270)/12)/9)-4. Let l(m) be the first derivative of -1/2m*h - 17m - 6. Calculate l(0). -17 Let y = -432 + 450. Let a(q) = q - 5. Give a(y). 13 Let t(s) = -6s2 + 41s + 10. Let v(g) = g*2 - 8g - 2. Let r(n) = -2t(n) - 11v(n). Give r(-5). -3 Suppose -65 = 3a - 251. Let w(l) = -4 + al*3 + 3 - 49l*3. Determine w(1). 12 Suppose 0 = -4o + 4k + 16, 5o - 26 + 6 = -4k. Let s(w) = -w2 + 2w + 4. What is s(o)? -4 Let w(p) be the second derivative of -p*3 + 9p + p*2 + 1/24p*4 + 0. Let n(s) be the first derivative of w(s). Give n(7). 1 Let p(g) = 18 + 6 + 191055g - 191059g. Determine p(6). 0 Let x(a) = -24a3 + a2 + a. Let b(h) = h*2 - 5. Let s be b(2). Calculate x(s). 24 Let q(v) = -5v - 4. Let g(h) = -11h - 6. Let u(l) = 4g(l) - 9q(l). Let d be u(0). Let n(m) = -m2 + 11m + 11. What is n(d)? -1 Let z(f) = f*3 - 5f*2 - 8f + 4. Let g = 47 + -42. Suppose 2i + g = 17. Give z(i). -8 Let q(s) = -2s - 1. Let n = -10 + 9. Let d(l) = -6l2 + l. Let x be d(n). Let v = x - -3. Calculate q(v). 7 Let y(m) be the third derivative of m5/60 - m4/4 + 2m*3/3 - 26m2. Determine y(7). 11 Let k(u) = -u2 + 7u + 7. Suppose -3y = z + 6, 8 = -4y - 4. Suppose 4x = -s - 3, -2x + 0x - z = s. Suppose 0 = 2m - 14 - x. Determine k(m). 7 Let r be 84/(-15)-1 - 18/(-45). Let l(a) = 3a + 2. Let u(v) = -7v - 3. Let z(g) = 5l(g) + 2u(g). Give z(r). 10 Let l(z) = z*3 - 5z*2 + 2z + 4. Let r(x) = 12x - 6. Let m be r(1). Suppose -m = -3p + p. Give l(p). -8 Let u = 3 - -1. Let t(p) = -4 - p - 3p2 - 4p*2 - 11p*2 + 19p**2. What is t(u)? 8 Let i(n)	{ "pile_set_name": "DM Mathematics" }
3f - o - 4 = -3q. What are the prime factors of q? 3 Let r = 7 - 10. Let a = r - -33. List the prime factors of a. 2, 3, 5 Suppose -2z + 5l - 3 = 0, -2l + l + 6 = 5z. Let b = -1 + z. Suppose bd - 11 = -d. What are the prime factors of d? 11 Suppose -3k - 10 = -5k. Suppose 0 = -3a - 2o + 17, a - 3 = ko - 3o. Suppose 6 + 14 = af. List the prime factors of f. 2 Let c = -149 - -220. List the prime factors of c. 71 Suppose b = 3s - 9, 4b + 3s + 26 = 5s. Let n be (-1 + -14)/(b/4). What are the prime factors of (n/6)/((-3)/(-27))? 3, 5 Let f = -76 - -226. List the prime factors of f. 2, 3, 5 Let f = 95 - -25. What are the prime factors of 2/8 + f/32? 2 List the prime factors of 3 + (-15)/10-34. 2, 3 Let i = 125 + -17. List the prime factors of -4(i/(-16))/1. 3 Suppose 3l = x - 20, 3x + 2l - 1 = 103. Suppose 2m - 33 - 11 = 0. Let y = x - m. What are the prime factors of y? 2, 5 Let c(p) = -p3 - p2 - 3p - 3. Let k be c(-2). Suppose 2y + k = 4y - 3i, -y - 4i + 20 = 0. List the prime factors of y. 2 Let w(d) = -d3 - 2d + 11. Let i(z) = 3z3 + z2 + 6z - 32. Let t(n) = -6i(n) - 17w(n). What are the prime factors of t(-6)? 17 List the prime factors of 276/(-66) - -4 - 3544/(-11). 2, 7, 23 What are the prime factors of (2/4)/(4/272)? 2, 17 Let t = 22 + -1. What are the prime factors of t? 3, 7 Let i be 1/(-3) + 32/6. Suppose c + 86 = 3g + 2g, 4g = ic + 52. What are the prime factors of g? 2, 3 Let k(l) = -l3 + l2 + 67. List the prime factors of k(0). 67 Let o = -20 + 43. List the prime factors of o. 23 Let q = -22 - -57. List the prime factors of q. 5, 7 Suppose -i + 7 = -7. Suppose 0 = 2c + j - 45, 4j + 108 = 6c - 2c. Let x = c - i. What are the prime factors of x? 2, 5 Suppose -75h + 72h = -147. List the prime factors of h. 7 Suppose 3 = -2f + l - 5, 3f + 3l + 21 = 0. Let w = f - -7. Suppose wb - 20 = -0b. What are the prime factors of b? 2, 5 Let u(i) be the third derivative of i5/60 - 7i4/24 - i3/3 + 2i2. Let w be u(7). Let r(z) = 2z*2 - 2. What are the prime factors of r(w)? 2, 3 Let x = 4 - 2. Suppose -z - 3 = -s, 2z = -2s - 0s + 6. Suppose -1 = -q - 2a, -22 = -zq - xq + a. What are the prime factors of q? 3 Let j = -26 - -23. Let t(a) = -9a + 4. What are the prime factors of t(j)? 31 Let a(h) = -h*2 + 10h - 3. Let q be a(6). Suppose -k + 8 = 3k. Suppose -4d + q = 2z + 3z, 5z - 3 = -kd. List the prime factors of d. 3 Suppose -3c + 5m = 14 + 2, -4c - 3m - 2 = 0. Let r(t) = 30t + 2. Let i be r(c). List the prime factors of (-4)/18 + i/(-18). 3 Let a = 3 + -1. Suppose 0 = v + 5r - 2 - a, 0 = -r. What are the prime factors of v? 2 Let m(n) = -2n3 + n2 + 3n + 5. What are the prime factors of m(-3)? 59 Let a(x) = 51x + 1. Let h be a(1). Suppose -3f + h = v - 3v, 0 = 3f + 5v - 17. Suppose 0 = -2k + 6 + f. List the prime factors of k. 2, 5 Let k(z) = -2z. What are the prime factors of k(-9)? 2, 3 Suppose 4j + 12 = 0, -4j + 45 = i - 64. List the prime factors of i. 11 Let b(d) = -d3 - 13d*2 - 3d + 8. What are the prime factors of b(-13)? 47 Let t be ((-16)/6)/((-2)/(-75)). Let u be t/84/(-5). Let c = -6 + u. What are the prime factors of c? 2 Let n = 48 + -68. Suppose -2q = 3z - 0z - 99, 2z - 85 = 5q. Let c = n + z. What are the prime factors of c? 3, 5 Let w = -5 + -6. Suppose -3b - 2 = -b, -5j + 77 = -2b. Let l = w + j. List the prime factors of l. 2 Let j be (-1)/(-3) - 1/3. Suppose -4 = -2i + 2m, 2i = -jm + m + 4. List the prime factors of i. 2 Suppose 4r = 3 + 1, 2u - 3r = -3. Suppose o = 4o - w - 32, -3o - w + 40 = u. What are the prime factors of o? 2, 3 Suppose 0 = -h - b + 6, -3h + 4b - 12 = -4h. Suppose -5m + m + 15 = 3w, 0 = hm + w - 21. List the prime factors of m. 2, 3 Suppose 25 = -2u + 7u. Suppose -ui + 3v + 83 = 0, -2v + v + 61 = 3i. What are the prime factors of i? 19 Let u = 6 + -4. Suppose -5d + 2j + 51 = 0, -ud - 5j + 5 = 2. Suppose -s + 2s = d. What are the prime factors of s? 3 Let u(q) be the first derivative of q3/3 + 2q*2 - 2q - 2. Let x be u(-5). Suppose 0 = xr - a - 32, -3r + 4a + 8 = -r. List the prime factors of r. 2, 3 Suppose -14 - 41 = -5a + o, 2a - 49 = -5o. What are the prime factors of a? 2, 3 Suppose -4g = 4, 4a - 2g = -4g + 606. List the prime factors of a. 2, 19 Let w be (-2 - -1) + 8 - 1. What are the prime factors of 55/3 - (-4)/w? 19 Let h be 3/4 + 690/8. Suppose 3w - g - h = w, 0 = 5w + 4g - 211. List the prime factors of w. 43 Let z = -247 + 592. What are the prime factors of z? 3, 5, 23 Suppose 18 = 3w - 4s, w + 5s = s + 6. List the prime factors of w. 2, 3 Suppose 4q + 2 = -5a, 3q + 11 = 4a + 2q. List the prime factors of (a/5)/((-1)/(-40)). 2 Let v = -52 + 95. What are the prime factors of v? 43 Let y(o) be the first derivative of o4/4 + 11o3/3 - o2 - 11o - 4. List the prime factors of y(-11). 11 Let p be 1/2(-6)/3. What are the prime factors of 11 + (p - -4) + -1? 13 Suppose 7 = 4f - 1. Suppose -2s = -4y - 0y - 14, -4y = fs + 10. Suppose 6 = b + s. List the prime factors of b. 5 Let x = -23 - -344. What are the prime factors of x? 3, 107 Let r = 292 - 205. Suppose 5y + 68 = z, 0 = 5z + 2y + r - 319. Suppose 4o + 0f - z = 4f, -52 = -4o + 3f. List the prime factors of o. 2 Suppose -n - 3s = -21, -n - s + 17 = s. Let z be (9/2)/(n/12). Suppose 3c - zc - 6 = 0, 18 = 2h - c. List the prime factors of h. 2 Let t = 193 - 115. Suppose 5a = 3 - t. List the prime factors of (a + 2)-1 + 0. 13 Let j be 2/4(32 - 8). What are the prime factors of 254/j + (-1)/6? 3, 7 Let s(p) = -p3 + 8p*2 + 3p. Let h be s(8). Let m = -16 + h. What are the prime factors of m? 2 Suppose -z = s - 125, -5s + 5z = -0s - 585. What are the prime factors of s? 11 Suppose 2o + 0z - 3z - 3 = 0, 4z + 2 = 2o. Let b be (-82)/o - (-3)/9. List the prime factors of (-6)/b + 194/18. 11 Suppose l + 5w - 31 = 0, -w + 3 = -2. Suppose -2 = -2t + l. Let q = t - 2. List the prime factors of q. 2 Suppose 3j = -j. Let r be (j2/6)/(-1). Suppose r = -q - 5p, 3q - 6q + 13 = 2p. List the prime factors of q. 5 Suppose -29 = 3n - 5r, -6n + 2n = 5r - 8. Let a be 7 + (3/(-9))/((-3)/9). What are the prime factors of n/12 - (-58)/a? 7 Let v(b) = b2 + 7b + 10. What are the prime factors of v(6)? 2, 11 Let b be (-55)/(-5) + -2 + 1. Suppose -3d + 23 = 5w, -b = -0w - 2w - d. Suppose -27 = -x - w. List the prime factors of x. 2, 5 Suppose 0 = -4s + 7s - 126. Let n = -22 + s. Let r = n - 4. What are the prime factors of r? 2 Let n(r) be the third derivative of -r*4/24 + 5r*3/3 + 2r*2. Suppose 37 = 5t - 3. List the prime factors of n(t). 2 Let f(t) = -t*3 - 9t*2 + 11t + 13. Let h be f(-10). Suppose 0 = 2d - y - 23, 7 = 2d - 5y - 12. Let q = d - h. What are the prime factors of q? 3 Let b = -83 + 107. List the prime factors of b. 2, 3 Let g(b) = b - 11. Let s be g(9). What are the prime factors of 2/s + 0 + 12? 11 Let a = 2 - 4. Let b be (-4)/((-4)/a) - -26. Suppose 0 = 4h - 0h - b. List the prime factors of h. 2, 3 Let i(t) = t2 - 3t - 1. Let z be i(7). Let v = z - 16. List the prime factors of v. 11 Suppose 0 = a - 2 - 1, 3a = -4y - 23. Let f = 5 - y. Suppose d + 5 = f. What are the prime factors of d? 2 Let c = -40 - -61. Suppose 3q - c = 9. What are the prime factors of q? 2, 5 Let l = -6 - -11. Suppose -lw - 4z + 115 = -162, -5w + 274 = 3z. What are the prime factors of w? 53 Let a = -65 - -33. Let q = 0 - a. What are the prime factors of q? 2 Suppose -88 = -3q + 2o, -2o + 5o - 89 = -4q. List the prime factors of q. 2, 13 Let m(o) = -37o - 11. List the prime factors of m(-2). 3, 7 Let q be 4/8(0 + 78). Suppose 2b - q = -b. List the prime factors of b. 13 Let f = 20 - -13. What are the prime factors of f? 3, 11 Suppose 28 + 14 = 2t. Suppose v - 18 = t. List the prime factors of v. 3, 13 Suppose 1 - 62 = 4s - 3q, 3q + 35 = -2s. What are the prime factors of (12/(-2))/(6/s)? 2 List the prime factors of 2/(-8) + (-129)/(-4). 2 What are the prime factors of (-114 - 0)(-15)/30? 3, 19 Suppose 2r - 7r - 16 = -3i, 5i - 3r = 0. List the prime factors of -1*(0 - i) - -35. 2 Let h be (-3 + 4)/(2/4). Let d(l) =	{ "pile_set_name": "DM Mathematics" }
- 2v3 - 3v*3 + 6v*2. What is the units digit of t(-4)? 1 Suppose 275 = 5x - l, -3x + 0l + 4l = -165. What is the units digit of x? 5 Let g(d) = d2 + 5d + 6. What is the tens digit of g(-10)? 5 Let a(l) = 2l3 - 5l*2 - l + 2. Let b be a(4). Let v = b - 32. What is the tens digit of v? 1 Let b = -1 - -6. Suppose -5w = -3y + 4y - 9, -5w - 5y = -b. Suppose wd + 3 = 3d. What is the units digit of d? 3 Let t(g) = -3g2 - 5g + 2. Let j(n) = n*2 + 7n + 6. Let a be j(-5). Let w be t(a). What is the units digit of w/(-6) + 2/(-6)? 4 Suppose d + 4p - 14 = -d, -5p = -5d + 5. Suppose 2o - do - 2 = 0. Let g = -1 - o. What is the units digit of g? 1 Suppose -5j + 31 = -4o, -7j + 2j - 4o - 1 = 0. What is the tens digit of (j + 28/(-8))-94? 4 Suppose -3l - 321 = -3a, -a - 2a = 5l - 321. What is the units digit of a? 7 Let a(i) = -i3 - 4i*2 + 2i - 24. What is the hundreds digit of a(-7)? 1 Let x(d) = 5d2 - 19d + 5. What is the tens digit of x(6)? 7 Suppose 17 - 272 = -5o. What is the tens digit of o? 5 Suppose -4m + 2m = -2g + 314, -5m = 4g - 610. What is the tens digit of g? 5 Suppose 0 = -5a + 4a. Suppose -3k = -ak - 69. What is the tens digit of k? 2 Suppose -3o + u + 10 = 0, -u + 4 = 2o - 6. Suppose 3x = 9, v - 5x + 85 = -ov. Let a = -3 - v. What is the tens digit of a? 1 Suppose 7s = 2s + 55. Let f = 1 - s. Let w = f + 16. What is the units digit of w? 6 Let t(v) = v2 + 5v. Let n be t(-5). Let z = 1 + n. Suppose 0 = -b + 7 + z. What is the units digit of b? 8 Let m = 433 + -285. What is the hundreds digit of m? 1 Let a be 1(-2 + -2 + 11). Suppose -3g + ag - 112 = 0. What is the units digit of g? 8 Suppose 4c - 3c = -v + 27, -2v + 3c = -64. What is the units digit of v? 9 What is the units digit of 560/15 - 6/(-9)? 8 What is the units digit of 58/(-2)3-1? 7 Let o(u) = 2u*2 + u. Let h be o(-2). Let f be h/(-21) - (-2)/7. What is the units digit of 1 - (-3 - f/2)? 4 Let t = -86 - -182. What is the units digit of t? 6 Let r(c) = 2c*2 + c. Let v = -5 + 4. What is the units digit of r(v)? 1 Suppose -3s = s - 340. What is the units digit of s? 5 Let u = 10 + 74. What is the units digit of u? 4 Let o(l) = -l. Let b(j) = 12j - 1. Let g(w) = -b(w) + o(w). What is the units digit of g(-1)? 4 Let q(i) = -3i + 9. Let c be q(6). Let t = c + 10. What is the units digit of t? 1 Let y(s) = -s*2 + 3. Let v be y(0). Suppose 2 + 10 = vj. What is the units digit of j? 4 Let f = -67 - -176. What is the hundreds digit of f? 1 Suppose -7a + 2a = -4y + 110, 0 = -4a + 3y - 87. Let c be 4/a + 1722/(-27). What is the units digit of ((-6)/4)/(12/c)? 8 Suppose 3z + 2w - 33 = 0, 3z = -w + 47 - 11. Let a = -5 - z. What is the units digit of ((-50)/15)/(4/a)? 5 Let f be (-2)/6 - 15/9. Let r be (5 - 1)f1. Let q = r - -13. What is the units digit of q? 5 Let t be 7 + 0 + 3/(-1). Let x(s) = s*2 + s - 4. Let h be x(t). Suppose -3r - v - v + h = 0, 5v = -r + 1. What is the units digit of r? 6 What is the units digit of 57/(-12)(0 - 20)? 5 Suppose 0p = 5p + 5y - 85, 0 = -5y - 5. What is the tens digit of p? 1 Suppose -6 = -4s + 2s. Let m = 6 - s. Suppose -q - m = -2q. What is the units digit of q? 3 Let r(d) = -d + 3. Let k be r(-9). Suppose -7 + k = 5q. What is the units digit of q? 1 Let b be 2/(-11) + 10/55. Suppose -30 = -bf - 5f. Suppose f = -5a + 46. What is the units digit of a? 8 Suppose 2r = -r + 15. What is the tens digit of (-10)/50 + 56/r? 1 Let p(g) = -4g - 13. Suppose 3w + 5 = -v - 0v, -5v + 4w = 82. What is the units digit of p(v)? 3 What is the units digit of 150(-12)/(-54)3? 0 Suppose 3f + 6 - 1 = h, -20 = -4h + 5f. Let w(s) be the second derivative of s4/6 - s3 - 5s2/2 + 2s. What is the units digit of w(h)? 5 Let u = -9 + 3. Let r = 43 - 31. What is the tens digit of 4/u(-234)/r? 1 Let d = 40 - 30. What is the units digit of d? 0 Let m = 1 + -3. Let x be -4 + 6/3 + m. What is the units digit of ((-32)/(-12))/(x/(-6))? 4 Let l(k) = 6k*2 + k + 2. Let s be l(2). Suppose -172 + s = -4v. What is the tens digit of (-3)/(v/(-15))8? 1 Suppose -5k - 6 = -7k. Suppose ka = 11 + 37. What is the tens digit of a? 1 Suppose -2j - 4o + o = -2, -5j + o = -39. Let t(d) = -d + 12. What is the units digit of t(j)? 5 Let i(s) = -40s. What is the units digit of i(-1)? 0 Let k = -32 - -53. What is the tens digit of k? 2 Let i = 1 - -2. Suppose ir - 52 = -r. What is the units digit of r? 3 Suppose -4y + 4w + 28 = 0, -4w = -3y + y + 22. Let p be -11 - (1 - y). Let k = p - -5. What is the units digit of k? 6 Let k(c) = -8c - 25. What is the tens digit of k(-17)? 1 Let v be ((-420)/18)/(4/(-6)). What is the units digit of 259/v + (-2)/5? 7 Let n(q) = q3 + 10q*2 - q - 4. Let t = -1 + -9. What is the units digit of n(t)? 6 Let w = 76 + -16. Let p = w + -35. What is the units digit of p? 5 Suppose 0 = -3x - y + 2, -3x = -7y + 3y + 8. Suppose f + 39 = 3a, -a - f + xf + 17 = 0. What is the tens digit of a? 1 Suppose 0 = -i, -4v + 3v - 2i = -36. What is the units digit of v? 6 Let s = -30 + 62. What is the units digit of s? 2 Let l(q) = q*3 - 8q + 14. What is the units digit of l(4)? 6 Let w(x) = 2x - 7. Let g be w(5). Let j = -1 + 2. What is the units digit of (10/(-1 + g))/j? 5 Let r = 2 + 0. Suppose -6 - r = 4n. What is the tens digit of 1/n(2 - 28)? 1 Let d(m) = m + 11. Let k(f) = -f2 - f. Let n = -3 + 2. Let s be k(n). What is the units digit of d(s)? 1 Suppose -3d = w - 244 - 17, 76 = d + 4w. Let x = -6 + 10. Suppose -xc - 11 = -r - d, 5c - 109 = -3r. What is the tens digit of c? 2 Suppose -w - 3n = n - 4, 0 = -4w - 3n - 23. Let r(y) = y3 + 7y*2 - 8y + 4. What is the units digit of r(w)? 4 Suppose -3c + 2 + 1 = 0. What is the units digit of c? 1 Suppose 0 = 4z + 5c - 576, -5z - 4c = -3z - 282. What is the units digit of z? 9 Suppose 4a = -0 + 12. Suppose 0 = -3u - 4h, -au + 7 = 2h + 1. Suppose u = -0m + 4m. What is the units digit of m? 1 Suppose -5n + 613 = -2h - 2h, -3h = -3n + 369. What is the hundreds digit of n? 1 Suppose 0 = 3y - 8y + 10. Suppose 72 = 6n - yn. What is the tens digit of n? 1 Let l = -9 + -1. Let f(j) = -j*2 - 12j - 1. What is the tens digit of f(l)? 1 Let g be 4 + (-3 - -1) + 0. What is the units digit of 5/10 - (-11)/g? 6 Suppose 165 = i + 11. What is the units digit of i? 4 Let i be (-41)/((36/(-8))/9). Let s = -29 + i. What is the units digit of s? 3 Suppose -3 - 2 = r. Let j = r + 7. Suppose -4c + 60 = -jb, -4c + 1 = 5b - 31. What is the units digit of c? 3 Let t(k) = 2k - 4. Let z(y) = -y + 1. Let m(q) = t(q) + 3z(q). What is the units digit of m(-10)? 9 Let z = 22 - 19. What is the units digit of z? 3 What is the tens digit of 57/2 - 39/26? 2 What is the tens digit of (-14)/(-2(-4)/(-8))? 1 Let q(s) = -2s - 3. Suppose -5d - 24 = 3n, -4n + 6 = -6n. Let l be q(d). Suppose 3h - 3v + l + 6 = 0, -23 = h - 5v. What is the units digit of h? 2 Let d be (-6)/10 + 2/(-5). Let p(j) = -6j - 1. Let z be p(d). Suppose 2 = zr - 3. What is the units digit of r? 1 Let a = -199 - -329. Suppose 119 = 4b + s, -5b + s + 4s = -a. What is the tens digit of b? 2 Let f(y) = -y*3 - 8y*2 - 2y. Let h be 1/(4 - 3)-9. Let v = h - -1. What is the units digit of f(v)? 6 Suppose 5f - 219 = 121. What is the units digit of f? 8 Let t be (-10)/418/(-15). Suppose -5i - 29 = -th, -h - 3h = 4i - 28. What is the units digit of (-2 - -2)/3 + h? 8 Let x be (4/14)/((-2)/(-14)). Let a be (-8)/(-2) + x/(-2). Suppose 0 = -2i + 3k + 19, 28 = ai - k - 3k. What is the units digit of i? 8 Suppose 15 = 2d + z - 0, 4z - 15 = d. Suppose 90 = 4t - 2r, 2t - dr - 93 + 28 = 0. What is the units digit of t? 0 Suppose 9 = -3l + 24. Let r = l + -3. What is the units digit of r? 2 Let m(w) = 5w3 + 5w*2 - 11w + 1. Let u(z) = 11z3 + 10z*2 - 23z + 3. Let d(x) = -13m(x) + 6u(x). What is the units digit of d(5)? 0 Suppose -c + 3 = 3r, 3r - 4c - 16 = r. Suppose 4 = q, -2m - rq + 8 = -4m. Suppose my + 5 = y. What is the units digit of y? 5 Let u be 3(1 + (-160)/(-6)). Suppose 0 = -5*c + 162 + u. What is the units digit of c? 9 Let v = -639 - -899. What is the units d	{ "pile_set_name": "DM Mathematics" }
4 + sqrt(13) + -3 + -3 + -4. -14 + 6sqrt(13) Simplify (((2sqrt(11) + sqrt(11) + sqrt(11))3)2 - (2sqrt(11) + 1)*2) + -5 - (3(sqrt(539) - (sqrt(539)24 - sqrt(539))) + 5). 122sqrt(11) + 1529 Simplify (-1sqrt(85)-3 - (3sqrt(85)-1 + sqrt(85)))/((sqrt(30)/sqrt(2))/sqrt(3) - ((sqrt(40) + sqrt(240)/sqrt(6) + sqrt(40))/sqrt(8) + sqrt(5))). -5sqrt(17)/3 Simplify ((sqrt(363) + (sqrt(363) - -2sqrt(363)) + 1 + sqrt(363) - (-2 + sqrt(363)-2)) + 3(sqrt(363) + -1 + 4 + (sqrt(363) - (sqrt(363) + -1)) + -1))2. 2640sqrt(3) + 36444 Simplify 3(sqrt(85) - -5sqrt(85)3 - (sqrt(85) + sqrt(85)-32 - sqrt(85)))/((sqrt(5) + 2sqrt(40)/sqrt(8) + sqrt(5) + sqrt(5))-3). -22sqrt(17)/5 Simplify (-2 + sqrt(25)/(sqrt(15)/sqrt(3)) - (sqrt(50) + (sqrt(50)-1 - sqrt(50))1)/sqrt(10)) + -5 + -1 + -1. -9 + 2sqrt(5) Simplify (sqrt(1377) + sqrt(1377) + -2 + 0)-6 + (4(sqrt(17) + -1sqrt(17)) - (-5sqrt(170) - sqrt(170))/sqrt(10))2. -108sqrt(17) + 624 Simplify -65(-4(-1sqrt(480) - sqrt(30)))/(-1sqrt(6)13). 200sqrt(5) Simplify (sqrt(605) - (0 + (sqrt(605) - sqrt(605)2) - sqrt(605)) - sqrt(605) - (sqrt(605) + 1)-1)*2 - (3 + 1sqrt(605) - sqrt(605) - -5sqrt(5)-1-3)2. -24sqrt(5) + 4312 Simplify sqrt(125) + sqrt(125)2 + -4 + (-2(sqrt(125) + sqrt(125) + -3) - sqrt(125)) - (sqrt(150)/(sqrt(6)-2))/(sqrt(40)/(sqrt(48)/sqrt(6))). -19sqrt(5)/2 + 2 Simplify (4 + (-1 + sqrt(98))5 + sqrt(98) + -3 + sqrt(98)2)*26 + 3. -2688sqrt(2) + 37731 Simplify ((sqrt(275)/sqrt(20) + -1sqrt(1375))/(6sqrt(15)/sqrt(3) + sqrt(5) + -2sqrt(45)))*2-2-5. 4455/2 Simplify -3 + ((-1 + sqrt(468))-1 + 6-2sqrt(468))*2 + ((sqrt(468) + -3)4-2 + 3)2. -2748sqrt(13) + 109771 Simplify ((sqrt(147) + 1 + -2sqrt(147))2 - (2 + sqrt(147) + 0 + sqrt(147))2) + -1 - ((sqrt(36) + 2sqrt(2304))/(-1sqrt(108)) + 2). -447 - 193sqrt(3)/3 Simplify -4((sqrt(76) - (sqrt(76) + (sqrt(76)-2 - sqrt(76))6 + sqrt(76))) + sqrt(76)2-6)/((-2sqrt(704))/sqrt(11)). 5sqrt(19)/2 Simplify sqrt(432) + (1 + sqrt(432))5 + 2 + -4 + -3(0 + sqrt(432)2 + sqrt(432))-3 + 5. 8 + 396sqrt(3) Simplify 5((sqrt(416)2-1 + -5sqrt(416)-1 + sqrt(416))/(1(sqrt(20)/sqrt(2))/sqrt(5)5))2. 3328/5 Simplify (3 + 2 + sqrt(2) - (sqrt(2) + sqrt(98)-4)*2) + 2(sqrt(160)/sqrt(5) - sqrt(32))-1. -1453 + sqrt(2) Simplify (-6(4sqrt(133)/(sqrt(42)/sqrt(24)) - (sqrt(133) + (sqrt(133)-1 - sqrt(133))-4)/(3sqrt(28)/sqrt(4)))-1)2. 17100 Simplify ((sqrt(228)5 + sqrt(228) + sqrt(228))5 + 3((-3sqrt(228) - sqrt(228)) + sqrt(228)))/(2sqrt(768) - sqrt(972)2). -13sqrt(19) Simplify 3 + (((sqrt(76) - (-2 + sqrt(76))3) + 0 + (sqrt(76) - (sqrt(76) + -3)))4)*2 + -3 + 3. -1152sqrt(19) + 6163 Simplify 4(((sqrt(44)/sqrt(72) - sqrt(22)) + sqrt(1078)3)/((sqrt(250)-5)/sqrt(5)))2. 161051/5625 Simplify ((42sqrt(1000) - sqrt(1000))/(sqrt(45)/(sqrt(9) + sqrt(9) + sqrt(9)2 + sqrt(9) + sqrt(9)) + (-4sqrt(10))/sqrt(2)))2. 352800/529 Simplify (sqrt(891) + sqrt(891) + 0 + 4 + (sqrt(891) + (sqrt(891) - sqrt(891)1))-4 + (sqrt(891)2 - sqrt(891)) + -2 + -1 + 1)*23. -108sqrt(11) + 2685 Simplify (sqrt(36)/(sqrt(18) + sqrt(2)) - ((sqrt(216)1)/sqrt(12) + sqrt(18)))/(sqrt(24)/(sqrt(16)/sqrt(4)) - 6sqrt(6)2). 7sqrt(3)/44 Simplify (-6-3sqrt(9072) + (((-1sqrt(756))/sqrt(12))2 - (sqrt(693)/(sqrt(44)/sqrt(4)))2) + -2)6. -12 + 3888sqrt(7) Simplify -6(3 + (sqrt(180) + 0)2-4 + sqrt(180) + (sqrt(180) - (sqrt(180) - (-1sqrt(180) + 4)2)))2-3. -18756 - 1512sqrt(5) Simplify 2((sqrt(2178)1 - sqrt(2178))6)/(sqrt(96) - -1sqrt(96)-5 - sqrt(96))-15. 0 Simplify (0 + sqrt(243) + -1(sqrt(243) + -1) + (0 + sqrt(243))5)2 - 3(sqrt(75) + sqrt(75) + 0 + 5)*2-4. 1290sqrt(3) + 9976 Simplify (-2 + sqrt(13) + 0 + -1sqrt(13) - (-1sqrt(468)-2)*2) + ((sqrt(117) + -2)-2 - (sqrt(832) + 1 + sqrt(13) - -1sqrt(13)-4)). -1871 - 11sqrt(13) Simplify (2 + 1(4(sqrt(208) + -1 + -2)6 + -2))*2. -13824sqrt(13) + 124992 Simplify ((sqrt(121) - 2-2sqrt(121))-6)/(3sqrt(44)-2)-4 + -2. -10sqrt(11) - 2 Simplify 1(3(-2 + sqrt(475) + 5)-5-5 + 3)2. 171000sqrt(19) + 2723859 Simplify (-1(4 + (-6(sqrt(300)2 + 3) + 4)6))*2. 115200sqrt(3) + 1561600 Simplify (3sqrt(57)/sqrt(3) - (0 + (sqrt(19) - sqrt(171)/sqrt(9))))2 - 1((-4sqrt(684))2 + -1). -10772 Simplify (2(sqrt(96)26-4)/(6(sqrt(108)2 - -1sqrt(432))))*2. 128/9 Simplify ((sqrt(112)3 - sqrt(112)) + 2 + 2 + (-1 + sqrt(112) - sqrt(112)) + sqrt(112) + (-4(sqrt(112) + sqrt(112)2) - -2-3sqrt(112)))*2. -360sqrt(7) + 25209 Simplify (1 + -1 + sqrt(128) + sqrt(128) + ((sqrt(128) - (2(sqrt(128) + 3 - sqrt(128)) - sqrt(128))) + sqrt(128))2 + -1)6. -1632sqrt(2) + 7122 Simplify ((1sqrt(204)-5 - sqrt(204)) + (sqrt(204) + (sqrt(204) - sqrt(204)-1)-4 - sqrt(204)))/((sqrt(192)/(sqrt(20)/sqrt(5)))/(sqrt(324)1)). -126sqrt(17) Simplify -4 + ((sqrt(180) - (sqrt(180) + sqrt(180)1))-1 + 5sqrt(180)1 + sqrt(180) + sqrt(180) + sqrt(180))/(6(sqrt(72)/sqrt(2) - sqrt(225)1)). -4 - sqrt(5) Simplify (5(sqrt(567) - (sqrt(567) + (sqrt(567) - -3(sqrt(567)-1 - sqrt(567))) - sqrt(567)))*2 + -3(sqrt(42)/(sqrt(12)/(sqrt(8)/sqrt(4))))*2)1. 102039 Simplify -3 + (-2(-1(2sqrt(85) + sqrt(85) - sqrt(85)) - (sqrt(85) - sqrt(85)-1-4 - sqrt(85) - sqrt(85) - sqrt(85)))/(6(sqrt(50)2)/sqrt(10))6)*2. 269 Simplify 6((sqrt(76) - sqrt(76)-24) + 22sqrt(76))/(sqrt(20)/sqrt(5)-1 + (sqrt(12)2)/sqrt(3)). 78sqrt(19) Simplify -5 + (4 + (sqrt(234)/(sqrt(54)/(-2sqrt(6))))/((sqrt(126)2)/sqrt(7)))2 + 1. -8sqrt(13)/3 + 121/9 Simplify (-5((2sqrt(80) - sqrt(80)) + -5 + sqrt(80)))*2 - ((sqrt(5) - 2sqrt(5)-1 - (sqrt(10)/sqrt(2) + 5))-5)*2. -1500sqrt(5) + 7500 Simplify -5((sqrt(1700) - 6(sqrt(1700) + sqrt(1700) + (sqrt(1700) - (sqrt(1700) - 2sqrt(1700)))))2 + -2 + (4sqrt(1700)-1 - ((sqrt(1700)2)*2 + 0)) + 3). -4462505 + 200sqrt(17) Simplify (((sqrt(42) - -1sqrt(42))/sqrt(6))23 - (sqrt(847) - (sqrt(847)1 + 0))) + (-5(2sqrt(1008) + -5)4)*2. -96000sqrt(7) + 1622884 Simplify ((-2sqrt(153))2 + sqrt(17) - (2sqrt(1700) + sqrt(17))) + -1(-2 + (sqrt(17) - (sqrt(68) + 0 - sqrt(17))) + sqrt(17))2 + 4. -16sqrt(17) + 595 Simplify ((2 + 0 + -4sqrt(13)3)-3 - (-3 + (sqrt(117) - (sqrt(117)-1 - sqrt(117) - sqrt(117))) + sqrt(117) - (21sqrt(156))/sqrt(12)))*2. -138sqrt(13) + 6886 Simplify 2(2sqrt(1700)4 - sqrt(1700) - (-2 + sqrt(1700)-2) - (1 + 4 + 2sqrt(2448)))2. -792sqrt(17) + 148122 Simplify (sqrt(208) + 0 + 3 + -4)6 + (1 + ((sqrt(117) + (sqrt(117) + sqrt(117)2 - sqrt(117)) + sqrt(117))-1)/sqrt(9))2-3. -633 + 48sqrt(13) Simplify 3(1sqrt(1152) + sqrt(18))/(2sqrt(144) + sqrt(144) - sqrt(144))6. 81sqrt(2)/4 Simplify (((sqrt(304) + 2sqrt(304) + -5)26 - (0 + (-3 + (1 + sqrt(304) - sqrt(304)))5)) + -2)*2. -14976sqrt(19) + 396688 Simplify (-3(2(sqrt(1539) + -4(-2 + sqrt(1539) + sqrt(1539)) - (-6sqrt(1539)1 + sqrt(1539) + sqrt(1539)))-6 + 1))*2-6. -108192726 + 3324240sqrt(19) Simplify -4 + 1 + 1(-5(-2sqrt(1539))*2 + -3) + 2. -30784 Simplify ((-6sqrt(153)33 - (1 + (sqrt(153) + -1)*2)3) + -4)1. -144sqrt(17) - 469 Simplify ((sqrt(76) - (sqrt(76) + 3(sqrt(76) - 1sqrt(76))) - sqrt(76))/(-1sqrt(200)))/((sqrt(600)1)/(sqrt(3) - (sqrt(768) + sqrt(3)))). -4sqrt(19)/25 Simplify (-5((sqrt(1216) - (1 + sqrt(1216))4) + sqrt(1216))13-6)*2. 1036800sqrt(19) + 39528000 Simplify 0 + -2 + (sqrt(2448) + (sqrt(2448) - sqrt(2448)-1) + sqrt(2448) - sqrt(2448)) + sqrt(2448) + (2sqrt(2448) + -4 + -4 + sqrt(2448) + 1)*2 + -5 + -4. -456sqrt(17) + 22070 Simplify (4(-2 + sqrt(176) + 0 + -4) - (-1(sqrt(176) + 1) + 2 + -1sqrt(176))-1)*24. -1472sqrt(11) + 4932 Simplify 2(-1sqrt(196)1)/(4sqrt(2)-63). 7sqrt(2)/36 Simplify 5 + (sqrt(240)-4)/(sqrt(3) + (sqrt(3) + sqrt(36)/sqrt(192) - sqrt(3))) + (-3sqrt(500) - sqrt(500) - sqrt(500))/(-2(sqrt(4) - sqrt(4)-2)). -259sqrt(5)/30 + 5 Simplify (1 + (sqrt(637) - -6(sqrt(637) + 1))*2 + sqrt(637) + 6((sqrt(637)-1)2 + -2))31. 1785sqrt(13) + 105180 Simplify ((sqrt(110) - (sqrt(110) - -3(sqrt(110) + 1sqrt(110)))) + (sqrt(110) - (53sqrt(110) + sqrt(110))))/(-6-1sqrt(640)-5). 7sqrt(11)/80 Simplify 2 + ((sqrt(3) - 3*sqrt(48))	{ "pile_set_name": "DM Mathematics" }
ler: m or 2? 2 Suppose 2a + 0a - 6 = 0. Suppose 5h + a = 33. Is 5 >= h? False Let b(s) = s3 + 11s*2 + 19s + 16. Let z be b(-9). Is 7 at least as big as z? True Let q = 10.923 - 0.123. Let w = 11 - q. Which is smaller: 2 or w? w Let i = 61 - 61. Is i greater than or equal to 1? False Let k = 6 - 5. Suppose -k + 5 = 4c. Suppose 4z + 4 = -4s, -5z + 3s + 2 + 9 = 0. Is z greater than or equal to c? True Let g be 4/(((-6)/2)/(-18)). Suppose -4b = -g - 4. Is b <= 2/3? False Suppose 1 = -a + 4. Suppose -5i + 6 = -ai. Which is bigger: i or 2/3? i Let x be (10/75)/(1 + 2/(-3)). Is 0.039 less than x? True Suppose 2o + 20 = 3a, -o - 3o = 16. Suppose -u = 5v - av - 6, v - 3u + 10 = 0. Is v at least 3? False Let q be 4/(-3)3/2. Let j = -2 - -6. Let k = j - 5. Is q at least as big as k? False Let o(q) = q2 - 3q + 1. Let h be o(3). Let f = h + -3. Are f and -2/3 nonequal? True Suppose -g = -4g + 6. Let x = 0 - g. Let u = 4 + x. Is u at least 3? False Let u = -26 + 26. Is -9/23 less than u? True Suppose -u = -2j + 42, j + 58 = -2u - 26. Let f be u/205/6. Let h = -2 - f. Is 1/3 less than h? False Suppose -k = -6k. Suppose k = 2q + 2q + 3b + 11, 21 = -4q - 5b. Suppose 4h + h - 10 = 0. Is q != h? True Let k = -13 + 8. Let g = k - -7. Is 4 > g? True Let n = 10.5 - 12.5. Which is smaller: -2.3 or n? -2.3 Let v = -41/28 + -2/7. Which is greater: v or -2? v Let t = 1 + 0. Let o be t/((18/4)/3). Are 0 and o nonequal? True Let s = 2/1455797 - -37226653/113552166. Let p = s + -10/39. Is p at least 0? True Suppose 3u = 4q + 26, -u - q - 2q - 13 = 0. Suppose 6g = ug. Suppose 4h = 1 + 3. Which is bigger: g or h? h Let c = -182 + 184. Let a = -7.1 + 0.1. Is c < a? False Let t = -0.19 - 0.17. Let d = t + -0.04. Let p = 21.1 - 21. Which is greater: p or d? p Let j = 0.149 - -4.761. Let r = j - -0.09. Which is smaller: r or 0.1? 0.1 Suppose -2w = -8w + w. Do 1/105 and w have different values? True Suppose w + w = -2z + 8, -2z - 4w = -10. Suppose -2c + 6 = -zc. Let b be (-2)/c - (-2)/3. Is b bigger than 1/5? True Suppose 0 = -w - 5r + 13, 0 = 3w - r - 7. Are w and 2/11 unequal? True Let h be -2 + (-1 - -5) - -1. Suppose 0 = -3f + h. Let m = 2 - 1. Is f != m? False Suppose -24a + 22a = -2. Which is bigger: 0 or a? a Let o(v) = v3 + 5v*2 - 8v - 8. Let u be o(-6). Suppose 13 = us + 5. Suppose -2m = 4t - 14, 2t = -t - 3m + 18. Is t <= s? True Let r = 20.7 - 2.7. Which is smaller: r or -2? -2 Let i = -8 + 10. Suppose ia - 4a = 10. Is -5 at least a? True Suppose 5 = -g + 2. Let i be (-2)/(-4) + g/(-6). Which is greater: i or 0? i Suppose -4v + 3v = 0. Suppose -u - 4 + 7 = 0. Is u >= v? True Suppose -2s - 2 = 5z + 2, -z + 5s + 10 = 0. Suppose z = -2h - h + 6, 0 = 2b - 5h. Is 5 > b? False Let s be 12/(-16) - 44/(-16). Is 2/3 > s? False Let q be -2(-1)/(-2) + 7. Is q >= 6? True Let h = 3 - 2. Which is bigger: -8/7 or h? h Let h = 11 - 10. Let j(g) = -2g + 8. Let c be j(6). Let i be (-1 - 14/c)h. Are i and 3 non-equal? True Let c(w) be the third derivative of w*6/120 + 7w*5/60 + 5w4/24 - w2. Let a be c(-6). Let i be (a/12)/((-1)/(-12)). Is 0 at least as big as i? False Let t(i) = -5i - 23. Let h be t(-5). Is 1 <= h? True Let b = -4 + 8. Let x = b + -3. Let r = 5 + -5. Which is greater: r or x? x Let d = 0.16 + 2.84. Are -0.1 and d unequal? True Suppose -4 = -x - 4g - 7, g = -2x - 6. Let o = 8 + x. Let s be 2/(-5) + 22/5. Is o at least as big as s? True Let g be (320/390)/((-4)/6). Which is smaller: g or 0? g Let j = 5 + -7. Let a = 2.4 + j. Let r = -0.4 + a. Which is greater: 1 or r? 1 Let u = -2/115 - 1031/230. Which is greater: -4 or u? -4 Let m = -3 - -3. Suppose m = -r - 8. Let t be (-4)/(-3)12/r. Which is smaller: 0 or t? t Let x be (1038/20)/(12/(-10)). Let b = x - -44. Which is bigger: 1 or b? 1 Let a = -0.6 - -0.4. Let q = -0.2 - a. Is 0.1 >= q? True Let l = 25 + -523/21. Is l >= 0? True Let y = 2.4 + -8.4. Which is bigger: -2/3 or y? -2/3 Let d be (-6)/9 + -3 - -1. Let k = d - -2. Let c = 0.5 - 0.3. Is k greater than or equal to c? False Suppose 4t - 5 + 1 = 0. Suppose w + 2 = -5y, 0 = 5y - 2w - 5 + t. Which is smaller: -3 or y? -3 Let f = 7 + -7. Is f bigger than 0.3? False Suppose 0 = 5c - 0c. Suppose c = -2k + 4, -2v - 5k = 2v - 6. Let z(t) = t*2 + 2t - 1. Let m be z(-2). Is v > m? False Let p be -152/(-12)4. Suppose p = -7x + 12x. Is x less than 4? True Let t be (-6)/(-21) - 330/28. Let s = -12 - t. Let n be 8/((6/3)/1). Is s equal to n? False Let p = 5 - 8. Suppose -22 = -t + 41. Let w be p/(t/(-6))-1. Is w not equal to 2/3? True Let j = 103/70 + 1/35. Let f = 7 - 6.9. Which is smaller: f or j? f Let b = -0.1 + -0.5. Let l = b + 5.6. Do -1 and l have the same value? False Let i = -27/5 + 923/170. Is i less than 1? True Suppose 4 = 5o - 36. Let q = o - 8. Which is bigger: q or -1/11? q Let x be ((-332)/(-8) + 2)/((-15)/(-20)). Is 57 not equal to x? True Suppose -3y - 1 = -16. Suppose -yk - 6 = k. Which is greater: 5 or k? 5 Suppose -v = -d - 7, v - 3d + 3 = -4d. Let c = -7 + 9. Is c > v? False Suppose -3z + 5g + 52 = 0, -4g - 11 = -z + 2z. Let b be ((-5)/10)/(1/(-20)). Is z at least b? False Let k be (8/10)/((-6)/(-20)). Let x = -6 - -8. Which is smaller: x or k? x Let s = -2 - -3. Let l = 1 - s. Let n = 8 + -5. Which is smaller: l or n? l Let t = -28 + 27.95. Let a = 2.95 - 3. Let x = a - t. Which is smaller: x or 0.6? x Suppose 2n + 2n = -96. Let g be ((-12)/(-16))/((-261)/n). Are 1 and g non-equal? True Let q = 12 + -14. Let w be (-2 - q)2/4. Which is greater: w or 3? 3 Let o = -14 - -6. Let k = o + 2. Let z = k - -6.4. Do z and -1/2 have different values? True Suppose 0 = -2b + c + 7, b + b - 4c - 4 = 0. Let j be 0 + 0 - b/24. Let f(z) = -z3 - 2z*2 + 2z + 3. Let i be f(-2). Which is greater: i or j? j Let l(i) be the second derivative of -i5/20 + i4/12 + i*2/2 - i. Let b be l(0). Which is bigger: b or 2/13? b Let w = -10/9 + 49/36. Which is smaller: -17 or w? -17 Let z be 178/4(-1)/(-11). Let q = z - 6/11. Let m be ((-1)/((-2)/(-10)))/(-2 + 1). Which is bigger: q or m? m Let f(d) = -d*3 - 8d*2 - 2d - 12. Suppose 2c + 6 = -10. Let v be f(c). Suppose h = vh - 30. Which is smaller: h or 9? 9 Let p(g) = g3 - g2 + 2. Let x be p(0). Let u be (-4)/(-8)(x + -2). Which is smaller: u or 2/3? u Suppose 4y - 16 + 4 = 0. Let b be (y/(-2))/(3/(-6)). Suppose u + 1 - b = 0. Is u equal to 1? False Let w = -3534/13 + 272. Are w and -0.06 non-equal? True Let k be (-6)/(-27) + (-8)/9. Let t = -701/44 - -63/4. Which is greater: k or t? t Suppose -2j = 1 - 7. Suppose 0w - 2w - 13 = -ju, 5u + 2w + 5 = 0. Is u greater than -1/3? True Let o(f) = -f*3 - 5f*2 - f - 7. Let v be o(-5). Let i(w) = 3w*2 - w. Let g be i(1). Suppose 0 = -gn - 4. Is v >= n? True Let r(x) = 3x2 + 3x + 1. Let j be r(-2). Let q = -9 + j. Is q equal to -1? False Let q(a) = -a*2 + 4. Let h be 1 - (2 - 1/1). Let x be q(h). Let r = x + -8. Is r smaller than -4? False Let m = -48 + 50. Suppose 0 = -4i - 16, 5b - 5i = -10 + 60. Which is smaller: b or m? m Let n = 30 + -30. Suppose v + 2 = -0v. Let b be (-2 + 24/10)/v. Which is smaller: b or n? b Suppose -q = 5o - 4, -4q - 2 = -o - 60. Let v = q + -9. Let g be 3/v - 96/(-40). Is 4 <= g? False Let z = -0.2 - 1.8. Let r = z - -2.2. Is -1 greater than r? False Let c be (-17)/((5 - 7)/(2-1)). Which is smaller: c or -15? c Let p = -3.57 - -1.55. Let c = -0.02 - p. Are c and -0.1 equal? False Let f = -12 - -16. Let z(w) = w - 1. Suppose 4q - 17 - 5 = -3r, 3q = -r + 14. Let n be z(q). Is n at most f? True Suppose 4b = -v + 6, b - 5 = -4v + 19. Which is smaller: v or 10? v Suppose 0 = -h - 2 + 3. Let o(c) = -2c + 1. Let j be o(h). Is -2 equal to j? False Let m = 121/516 + 2/129. Which is smaller: m or 10? m Let w be ((-6)/8)/((-90)/(-1080)). Let z = 10 - 18. Is z greater than or equal to w? True Let z(i) = -i*3 + 6i*2 - 6i + 7. Let r be z(5). Let y be (-1)/3(1 + r). Suppose 3b - 9 = -4o + 1, -4o + 16 = 0. Which is smaller: b or y? b Let p be (-10)/45 + (-584)/(-198) - 3. Let h be 4/(-18) + (-2)/(-9). Is p less than h? True Let n = -144/35 - -22/5. Is 0.24 at least as big as n? False Let b = -265 - -6093/2	{ "pile_set_name": "DM Mathematics" }
e (0 - -18)/(-1 - -2). Let k be (-10152)/(-2457) - (o/(-39))/3. Solve -b*3 + 8/7 - 36/7b + kb2 = 0. 2/7, 2 Suppose 8 = 3z + 2p, -11p + 8p + 12 = -4z. Let o(i) be the third derivative of 0 + zi - 10i*2 - 2/33i*4 + 16/33i*3 + 1/330i*5. Factor o(x). 2(x - 4)2/11 Let j(v) be the first derivative of v4/4 - 7v3/6 + v2/4 + 5v - 695. Factor j(a). (a - 2)(a + 1)(2a - 5)/2 Let w be 1750/(-147) - -12 - (-72456)/(-63). Let z be (16/340)/((-23)/w). Find a, given that za - 2a2 + 8/17a*3 - 8/17 = 0. 1/4, 2 Let w = 864749 + -2579455/3. Factor -343/3o*5 + 536390/3o*2 - 154628/3o + w - 29204/3o4 - 609007/3o3. -(o + 43)2(7o - 2)*3/3 Suppose 2/9n*4 - 40/9n - 8/3 - 2/9n2 + 2n*3 - 2/9n*5 = 0. Calculate n. -2, -1, 2, 3 Let o be (12/(-66))/(756/891 - (-5)/(-3)). Factor 18 + ov*2 + 4v. 2(v + 9)2/9 Let i(a) be the second derivative of 65/6a*3 + 1 - 30a*2 - 17a - 5/12a4. Factor i(b). -5(b - 12)(b - 1) Suppose -o - 4 = -4o + y, 4 = 4o - 2y. Solve 407 - 2c5 + 2c*3 + 0c*5 - 2c + oc3 - 405 - 4c*2 + 2c*4 = 0. -1, 1 Let b(f) be the first derivative of 1/35f*5 + 1/840f*6 + 0f*2 + 0f - 28 + 28/3f3 + 2/7f*4. Let l(y) be the third derivative of b(y). Factor l(n). 3(n + 4)*2/7 Let c(v) be the second derivative of -5/96v*4 + 7/160v*5 + 2 + 3v + 3/8v2 - 1/240v*6 - 7/48v3. Determine y so that c(y) = 0. -1, 1, 6 Let o(t) be the third derivative of t4/6 - t*3 + 4t*2. Let i be o(2). Factor -9u*i + 6u - 5u + u + 3u*4 - 3u*3 + 6 + u. 3(u - 2)(u - 1)(u + 1)*2 Let j(v) = 31v - 242. Let y be j(8). Let s be y/35260/78. Factor 0o*2 + so*4 + 2/7o*5 + 0o*3 + 0o + 0. 2o4(o + 2)/7 Let x(p) = -99p + 300. Let v be x(3). Let c(o) be the first derivative of -6/13o + 13 - 2/13o2 + 2/39o*v. Factor c(r). 2(r - 3)(r + 1)/13 Factor 2i + 0i3 + 297 - 298 - 5i*4 + 4i*4 + 2i*4 - 2i3. (i - 1)3(i + 1) Determine b, given that -1/5b*4 - 9/5b*3 + 24/5b*2 + 116/5b - 48 = 0. -10, -4, 2, 3 Let f(u) be the first derivative of 25u4/36 - 865u*3/27 - 349u*2/18 - 35u/9 + 12. Factor f(d). (d - 35)(5d + 1)*2/9 Let c = -2/1045589 + 48097112/9410301. Factor -co - 44/9 - 2/9o2. -2(o + 1)(o + 22)/9 Suppose 103a + 16 = 101a. Let k be a + 12/((-48)/(-34)). Factor -ki - 1/2 + 1/2i3 + 1/2i*2. (i - 1)(i + 1)*2/2 Let x(y) = 2y*2 - y + 2. Let z(c) = -2c*2 + 919c - 914. Let s(d) = -x(d) + z(d). Factor s(i). -4(i - 229)(i - 1) Suppose -8x + 54 = -74. Suppose 2c - x = 68. Find f such that 2 + cf3 + 6f*5 - 16f*4 - 34f*3 - 2 = 0. 0, 2/3, 2 Let w = -5776 - -5781. Let o(t) be the third derivative of -1/210t*7 + 0t + 0t3 - 1/120t*6 + 1/336t*8 + 1/60t*w - 18t*2 + 0 + 0t4. Factor o(d). d2(d - 1)2(d + 1) Suppose h + 2 = -2p, 11 = 4h - 2p - 11. Let -446a*h + 6a*3 + 220a*4 + 222a*4 - 2a*5 = 0. What is a? -3, 0, 1 Suppose -3y = -5b + 10, 0 = 2b - y + 3167 - 3172. Let a(z) be the second derivative of 0 + 0z2 + 1/10z*b - 7z - 2/3z4 + 4/3z*3. Factor a(r). 2r(r - 2)2 Let c be 96/2301430/429. Solve 16/23u2 - cu + 0 - 2/23u3 = 0. 0, 4 Find y, given that 3/7y*2 - 500/7 - 748/7y = 0. -2/3, 250 Factor -1/4w2 - 129w - 16641. -(w + 258)*2/4 Suppose -5s + 60 = 5r, 4s - 57 = -9r + 4r. Find a, given that 3/8as - 41/8a*2 + 49/8 + 133/8a = 0. -1/3, 7 Let l be 261/105 + (-110)/50. Factor -146/7w3 - lw*5 - 4w*4 + 0 - 48w*2 - 288/7w. -2w(w + 3)*2(w + 4)*2/7 Let u be 2110(-22)/(-77). Let g be (3(-4)/u)/((-2)/4). Factor gx4 + 2/5x*2 - 6/5x - 4/5 + 6/5x3. 2(x - 1)(x + 1)2(x + 2)/5 What is i in 30i2 + 4i*3 - 3i*3 + 2i*3 + 87i + 262932 - 262872 = 0? -5, -4, -1 Suppose 449v + 14 - 7520v*2 - 111v*3 - 1169v*3 + 506v - 44 = 0. Calculate v. -6, 1/16 Factor 1 - 1/9a2 - a + 1/9a*3. (a - 3)(a - 1)(a + 3)/9 Let q(w) be the first derivative of 98 + 2/3w - 7/9w2 + 10/27w*3 - 1/18w*4. Factor q(t). -2(t - 3)(t - 1)2/9 Let j be (108/(-108))/((-10)/3 - -3). Let z(r) be the second derivative of 0 + 0r*j - 1/12r*4 + r + 1/2r*2. Solve z(q) = 0 for q. -1, 1 Suppose 0l = -2l - 8. Let t(h) = 5 - 499h - 3h2 + 495h - 2. Let k(a) = -3a2 - 5a + 3. Let o(g) = lk(g) + 5t(g). Determine b, given that o(b) = 0. -1, 1 Let t(m) = -2538m + 17768. Let o be t(7). Factor 28/3s - 4/3s4 + 0 - 28/3s*3 + 4/3s*o. -4s(s - 1)(s + 1)(s + 7)/3 Determine j, given that 7328/11j*2 - 400/11j*3 - 46/11j*4 + 2/11j*5 + 51200/11 + 58880/11j = 0. -8, -1, 20 Let p = -17900667463487/22295 - -802900537. Let n = p + -2/4459. Factor na3 - 14/5a*2 + 16/5a + 32/5. 2(a - 4)2(a + 1)/5 Let s(o) = 18o4 + 9o*3 - 30o*2 - 8o + 7. Let a(u) = 8u4 + 4u*3 - 14u*2 - 4u + 3. Let g(f) = -7a(f) + 3s(f). Find h, given that g(h) = 0. -2, -1/2, 0, 2 Let z(p) be the first derivative of -3 + 0p5 + 1/480p*6 + 0p + 0p3 + 0p*4 - 17/2p2. Let n(j) be the second derivative of z(j). Factor n(b). b3/4 Let s(c) be the first derivative of -c*8/168 + 2c7/105 - c6/180 - c*5/30 - 8c*3 - 83. Let q(n) be the third derivative of s(n). What is f in q(f) = 0? -2/5, 0, 1 Suppose 113/2a + 1/2a4 - 77 + 57/2a*2 - 17/2a*3 = 0. Calculate a. -2, 1, 7, 11 Factor 63/4 + 1/4t*5 - 127/4t + 1/2t2 - 65/4t*4 + 63/2t*3. (t - 63)(t - 1)*3(t + 1)/4 Suppose 10k - 43 + 33 = 0. Suppose -2a + k + 3 = 0. Factor 0 + 0p - 1/4p*4 + 1/4p*3 + 0pa. -p3(p - 1)/4 Let w be 1 + (-7)/(-16)2. Let u be 54/10730/3504. Factor -3/8f*3 - wf*2 - uf + 27/8. -3(f - 1)(f + 3)*2/8 Find r, given that -918r - 164272r4 - 246r*3 + 1218r*2 + 328546r*4 - 52r*3 - 164276r*4 = 0. -153, 0, 1, 3 Let j be (66/(-4))/11 - (-1691)/1126. Let w = 558/2815 + j. Factor -2/5 - wo*2 - 3/5o. -(o + 1)(o + 2)/5 Let i = 425825 - 425822. Factor 0 - 1/4r + 1/8ri - 1/8r*2. r(r - 2)(r + 1)/8 Let v(s) = 55s*3 + 573s*2 + 4896s + 52. Let r(l) = -42l3 - 430l*2 - 3672l - 40. Let u(w) = -13r(w) - 10v(w). Let u(g) = 0. What is g? -18, -17, 0 Suppose 5396 = -5z + 3x + 1441, -3z + 5x = 2357. Let s = z + 794. Factor -1/3v5 + 2/3v*3 + sv*4 - 1/3v + 0v2 + 0. -v(v - 1)*2(v + 1)*2/3 Let f = -644 - -647. Let 0y*3 + 48y*2 - 3y*5 + 8y - y*f + 28y + y*4 - 13y*4 + 4y*3 = 0. Calculate y. -3, -2, -1, 0, 2 Let r be (-33)/(-44) + (2/6)/(2272/(-2556)). Determine j, given that 2910897/8 - rj*3 + 891/8j*2 - 88209/8j = 0. 99 Let m be 13/6(-315)/(-21) + -26. Let -5/2s*4 - 1/2s*5 - 5s + ms2 + 0 + 3/2s*3 = 0. What is s? -5, -2, 0, 1 Let a = 35859 - 250962/7. Factor 0 - 3/7o*2 - ao. -3o(o + 17)/7 Let k be (-171)/44416/(-12). Let o = 321/481 - k. Factor 0d + 0d2 - 2/13d*4 + od*3 + 0. -2d*3(d - 1)/13 Let d(v) be the third derivative of -v*5/12 + 45v*4/2 - 1573v*2. Factor d(j). -5j(j - 108) Let y = -283 - -285. Factor 78p + 37p2 + 75 - 70p*2 + 36p*y. 3(p + 1)(p + 25) Let q(y) = -10y*3 - 46y2 - y + 38. Let t(s) = s3 + 5s2 - 4. Let w(r) = -2q(r) - 19t(r). Factor w(u). u(u - 2)(u - 1) Let o(l) be the first derivative of l4 + 100l*3/3 - 52l2 - 3522. Let o(v) = 0. Calculate v. -26, 0, 1 Let x(t) be the second derivative of t4/42 + 16t3/21 + 15t*2/7 - 3t + 58. Solve x(z) = 0 for z. -15, -1 Suppose 9z + 8z - 102 - 68 = 0. Let r(t) be the first derivative of -7/4t4 - 1/5t*5 - 6t*3 + 9 - 8t - zt2. Factor r(b). -(b + 1)(b + 2)*3 Let z(t) be the second derivative of -2t*6/75 + 7t*5/25 - 2t*4/5 - 970t. Determine w so that z(w) = 0. 0, 1, 6 Let k(y) be the first derivative of y*3/12 + 6y*2 + 144y + 429. Factor k(b). (b + 24)*2/4 Let x = -95 + 96. Let j be 7 - (10 - 5)x. Factor 4/5s - 2/5 - 2/5s*j. -2(s - 1)*2/5 Factor 1/2x*3 - 373/2x + 44x2 - 230. (x - 5)(x + 1)(x + 92)/2 Factor -52h*3 - 60h*2 + 73h + 200 - 47h + 109h + 102h3 - 45h*3. 5(h - 8)(h - 5)(h + 1) Let q(f) be the first derivative of f7/1470 - f6/315 - 32f5/105 - 80f*4/21 + 191f*3/3 + 159. Let z(i) be the third derivative of q(i). Factor z(l). 4(l - 10)(l + 4)*2/7 Let u be ((-2086)/(-1788))/(7/	{ "pile_set_name": "DM Mathematics" }
mal places. 0.0000021 Let r = -5113223814496518.09999964 + 5113223966238920. Let a = r - 151742369.9. Let n = a + -32. What is n rounded to 7 dps? 0.0000004 Let u = 36316 - 35510.12. Let n = 789 - u. Round n to the nearest integer. -17 Let z(d) = 4d + 114. Let f be z(-21). Let p be f/(-6) - 28529985/3. Round p to the nearest 1000000. -10000000 Suppose 3i = -2l + 204032, i - 643818 + 235774 = -4l. Round l to the nearest ten thousand. 100000 Let d be (-19)/(-285) - (107699998/(-30))/1. Round d to the nearest one hundred thousand. 3600000 Let w = 21.6 + -21.369. Let c = w - 0.454. Let u = 0.21974 + c. Round u to 4 dps. -0.0033 Let b = 0.0695 + -432.0695. Let x = -497.6 - b. Let j = 113.5 + x. What is j rounded to the nearest 10? 50 Let t = 279.8382 + -279.6. What is t rounded to 2 dps? 0.24 Let m(y) = 294y2 + 7y + 74. Let n(u) = -u*3 - 8u*2 + 40u + 43. Let z be n(-11). Let b be m(z). What is b rounded to the nearest ten thousand? 340000 Let t = -4962.86283 - -4963. What is t rounded to two dps? 0.14 Let z = 8295.8958 - 8114.47. Let m = -181.2 + z. Round m to two decimal places. 0.23 Let o = 0.02748 - 0.0278585. Round o to 5 dps. -0.00038 Let p = 680722.9656 - 680971. Let f = 248 + p. What is f rounded to three decimal places? -0.034 Suppose 4z - 15l = -10l + 3611970, -3z + 2708988 = -2l. What is z rounded to the nearest 100000? 900000 Let r = -2610.52 + 5425.99. What is r rounded to the nearest 10? 2820 Let y = 67008395.0993825 - 67007440.1. Let v = 955 - y. Round v to five dps. 0.00062 Let k = 87 - 85.09. Let n = k - 90.91. Let t = n + 89.0000378. Round t to 5 decimal places. 0.00004 Let h = -3120 - -1520. Round h to the nearest 10000. 0 Suppose 5q = 98698 + 9442. Let x = -11830 + q. Suppose 3p - 9806 = -5i, 5i = -0i + p + x. What is i rounded to the nearest 100? 2000 Let n = -17825473479 + 17825473502.489997591. Let r = -23.49 + n. What is r rounded to seven decimal places? -0.0000024 Let z = -2687 + 2705.87. Let l = z + -7.8. What is l rounded to the nearest integer? 11 Let p = 49895 - 25295. Suppose 0 = -14k + 11k - p. Round k to the nearest one thousand. -8000 Let q(v) be the second derivative of 3074v5/5 - v4/12 + v3 - v2/2 - 82v - 2. Let s be q(3). What is s rounded to the nearest 10000? 330000 Let f = 10625.6195 - 10620. Round f to zero dps. 6 Suppose 5v = b + 14564938, -8v - 3b + 11651958 = -4v. Suppose 5s = -15, 3a + 21s + v = 25s. What is a rounded to the nearest one hundred thousand? -1000000 Let l = -322 - -321.20605. Round l to one dp. -0.8 Let g = 2983 - 2982.999976516. What is g rounded to 7 dps? 0.0000235 Let n = 0.04622 + -32.17622. Let y = n - -1.33. Round y to the nearest 10. -30 Let i = -8951.676 - -8951. What is i rounded to 1 dp? -0.7 Let w = 54.57 + -23.82. Round w to the nearest ten. 30 Let b = -228 + 260. Let y = -31.999596 + b. What is y rounded to 5 dps? 0.0004 Let m(p) = -857903p + 38. Let y be m(6). Let t = 2912380 + y. Round t to the nearest one hundred thousand. -2200000 Suppose -h + 13d = 9d - 137146, 2h - d = 274264. Round h to the nearest 100000. 100000 Suppose 19k - 6 = 16k. Suppose i - 32 = ku, -5u = 5i - 4i - 32. Let o be (3096/i)/((-3)/8). What is o rounded to the nearest ten? -260 Suppose -9232080 = -8g - 0g. Suppose t + 3t = 20, -p + 2t - g = 0. What is p rounded to the nearest 100000? -1200000 Let h = -1100.499992931 + 1100.5. What is h rounded to 7 dps? 0.0000071 Let h = -69630.54801 + 69631. Round h to two decimal places. 0.45 Let k = 0.074 + 51.926. Let y = -324 + k. Let q = -261.1 - y. Round q to the nearest integer. 11 Let u = -7882 - -7845. Let a = -4283808 - -4283770.999984. Let t = a - u. What is t rounded to 5 dps? -0.00002 Let z = -21058 + 21058.0009167. What is z rounded to 5 dps? 0.00092 Let g = -349 - -298.5. Let y = -50.49999492 - g. Round y to 7 dps. 0.0000051 Let j = 4336 - 4335.997067. Round j to three dps. 0.003 Let o = -42089.785 - -41986. Let g = o + 104. Let c = g + -0.1. What is c rounded to 2 dps? 0.12 Let l(d) = -2d3 + 9d*2 - 16d + 6. Let s be l(7). Let r = s + 621. What is r rounded to the nearest 100? 300 Let d = 1.82611548 + -0.6761184. Let m = 1.15 - d. What is m rounded to 7 decimal places? 0.0000029 Let q = -17518.0000183366 - -17518. What is q rounded to seven dps? -0.0000183 Suppose 10c - 12c + 778 = 0. Suppose -5q - 316 = -5m + 319, 3m - 5q - c = 0. Let s = m - 23. What is s rounded to the nearest 100? 100 Suppose -d + 603q - 602q + 21683007 = 0, 4q - 65048972 = -3d. Round d to the nearest one million. 22000000 Let y = -3360724176.99999884 + 3360724115. Let g = -51 - 11. Let z = g - y. What is z rounded to 7 dps? -0.0000012 Let r = 0.0296 + -531.0296. Let z = r + 530.99997912. What is z rounded to 6 dps? -0.000021 Let w = -93 - -33.9. Let t = w - 15.9. Let g = 75.0142 + t. Round g to 3 dps. 0.014 Let x be 1330670/(-60)6. What is x rounded to the nearest one hundred? -39900 Let o = -0.0294 + 1.1961. Round o to 1 dp. 1.2 Let m = -1331 + 1467.6. Let s = -31.5 + m. Let w = 135 - s. What is w rounded to 0 dps? 30 Let z = -63701.0039373 + 63701. What is z rounded to five decimal places? -0.00394 Let y = -0.152 + -0.028. Let b = -1.38 + y. Let g = b - -0.42. What is g rounded to one dp? -1.1 Let m = 0.4714 + -0.475586. Round m to three decimal places. -0.004 Suppose -2333358 + 9691758 = -2u + 4q, -q = -4u - 14716800. What is u rounded to the nearest 1000000? -4000000 Let s(y) = 853125y*3 + 5y*2 - 20y - 60. Let n be s(-2). What is n rounded to the nearest 1000000? -7000000 Suppose 10z = 229 + 91. Let s(l) = -25 - z + 11 + 75l. Let h be s(6). What is h rounded to the nearest 100? 400 Let d = -703 + 495. Let y = 38 + d. Let n = 151.2 + y. Round n to the nearest integer. -19 Let y = 116.3 - -40.14. Let d = y - -3.56. Let p = d + -159.9999846. What is p rounded to six dps? 0.000015 Let d = -1.11 - -3.3. Let l = -1.648 + d. Round l to one dp. 0.5 Let t = -2051.7 - -2051.6990393. What is t rounded to five dps? -0.00096 Let b = 297 + -127. Let q = -188.64772 - 0.05228. Let p = q + b. What is p rounded to the nearest 10? -20 Let u = -47466 - 34596. Let d = -430799 + u. Let k = 277139 - d. Round k to the nearest one hundred thousand. 800000 Suppose 0 = 3866p - 3868p - 21642000. What is p rounded to the nearest 1000000? -11000000 Let t = -26302 - -26298.7262. Round t to the nearest integer. -3 Let d = -9.0376 + -0.1613. Let o = d + 9.26. Round o to 2 dps. 0.06 Let t = 2815631.000272 - 2815682. Let r = t + 51. What is r rounded to five decimal places? 0.00027 Let o = -7.7 + 7.4. Let d = -10.8 - o. Let a = -10.49999906 - d. Round a to 7 dps. 0.0000009 Let o = -1380.3 + 1380.2987273. Round o to four decimal places. -0.0013 Let r = -13.9161 + 13.08. What is r rounded to 0 dps? -1 Let f be (-3 - 181/(-3))/(9/22950). Suppose f = -11l + 9l. Round l to the nearest 10000. -70000 Suppose 5i - 27051283 = -2r, 4r = 3i - r - 16230745. Suppose 0 = 2w - b + 2980001, 5w + 2039747 + i = 2b. What is w rounded to the nearest 100000? -1500000 Let w(i) = 7i*2 - 4i + 1. Let f be w(1). Suppose 1330006 = 5c - 2t, 5t + 473432 + 58583 = 2c. Suppose fo = 2o - c. Round o to the nearest 10000. -130000 Let m = 1193 - 1073.9. Round m to the nearest ten. 120 Let s = 1.532 - 671.632. What is s rounded to the nearest 100? -700 Let b = -98.000002364 - -98. Round b to seven decimal places. -0.0000024 Suppose 17a - 36a = 129a - 1379952. What is a rounded to the nearest 1000? 9000 Let c = 24965068450.340069 - 24966254803. Let g = 1186352 + c. Let y = g + 0.66. Round y to five decimal places. 0.00007 Let x = -348 + 420. Let d = 0.0943764432 - -71.9056304568. Let f = d - x. Round f to 6 dps. 0.000007 Suppose u = -3u + 120. Let r be (-58)/(-15) + 4/u. Suppose 4j + 5l = 3199985, -l - 3199994 = -rj - 3l. Round j to the nearest one million. 1000000 Suppose -9m + 95506 + 104134 = -16m. What is m rounded to the nearest one thousand? -29000 Let j = 26.195 + -0.845. Let u = j - 1.35. Let c = -25.25 + u. Round c to 0 dps. -1 Suppose 5v + 5 = -3j, 29 = -j + 6j - v. Suppose -139 = -jp + 86. Suppose -4i + f = -0f + 45, -5f = -2i - p. Round i to the nearest integer. -10 Let o = -0.014629 + -6388.185371. What is o roun	{ "pile_set_name": "DM Mathematics" }
221. Let c = u + 54. Is c prime? True Let x(a) = -4a3 - 8a*2 + 21a + 22. Let u(k) = -3k3 - 7k*2 + 20k + 21. Let w(y) = 3u(y) - 2x(y). Is w(-13) a prime number? False Let c = 14315 + -7062. Is c prime? True Let c(j) = -194j - 2. Let p be c(-3). Suppose 4y - p = -b + 3y, -b = 2y - 577. Is b a prime number? False Suppose p = 0, w - p + 3109 = -3p. Suppose -4m - m = 10680. Let z = m - w. Is z a composite number? True Let w(l) be the first derivative of l4/4 + l3/3 + l*2 + 481l + 5. Is w(0) a composite number? True Let r(k) be the third derivative of 67k7/5040 + k5/15 + 2k*2. Let x(o) be the third derivative of r(o). Is x(1) prime? True Suppose -4i - 128 = 7a - 2a, 2a = 5i - 38. Let w = 2299 - a. Is w a composite number? True Suppose -3u + 8 = 3a - 2u, -4a = 4u - 16. Suppose 16 = -2m - aq - 2q, -q = 4m + 11. Let n(l) = 4l*2 + 3l + 3. Is n(m) a composite number? False Suppose -5n - 3 + 13 = 0. Suppose -l + 1437 = nl. Is l composite? False Suppose -v - 4y + 18 - 2 = 0, 3y = 2v + 1. Suppose 3u = u - v. Is 1(51 + u + 0) a prime number? False Let s(l) = 16l - 3. Let g(o) = 17o - 4. Let z(i) = -4g(i) + 3s(i). Is z(-9) composite? True Suppose 0 = -2j - 5b - 410, -j - 200 = -0j + 5b. Let k be (-1)/(1/j) - -1. Is (k/(-3))/(3/(-9)) composite? False Suppose r + 59 = 24. Let g = r + 38. Let p(v) = 32v*2 + 3v - 4. Is p(g) prime? True Suppose -5b - s - 9417 = -3s, -2b = 5s + 3790. Let m = -216 - b. Is m a composite number? False Let b be 20/(-40) - 11/(-2). Suppose bm = -c + 2768, 5 - 2 = c. Is m a composite number? True Let n be (-7796)/20 + -3 - 1/5. Let f = n - -1870. Is f composite? True Let o(x) = 48x*2 - 4x - 25. Is o(15) a prime number? False Suppose -3p + 57907 = s, 93p - 19317 = 92p - 4s. Is p a composite number? False Suppose 3g - 95145 = 46o - 49o, 3o = g - 31715. Is g a composite number? True Let x(h) be the third derivative of h*6/60 - 11h5/60 + h4/12 - 5h3/3 + 2h*2. Let p = 141 + -133. Is x(p) a composite number? True Let s = 257 + 14334. Is s prime? True Let o(z) = 54z + 55. Is o(6) a prime number? True Let n(f) = -f*2 - 19f - 21. Let z(l) = l3 - l2 - 3l - 5. Let h be z(-2). Is n(h) prime? True Let f(g) = -g + 4. Let t be f(-3). Let w = t + -3. Suppose 29 - 8 = h - wn, -2h + 2n = -66. Is h prime? True Suppose 426 = -7g + 5g. Let h = 513 + g. Let s = h - -113. Is s prime? False Let k = -571 - -1397. Suppose 3u - 2472 = -3c, u + 0c = -2c + k. Let p = 1637 - u. Is p composite? True Let w(d) be the third derivative of d7/504 - d6/180 + d5/120 - d4/4 - 3d2. Let i(r) be the second derivative of w(r). Is i(6) prime? True Let f(t) = -t2 + 29t - 19. Let b be f(13). Let s(w) = 35w + 2. Let g be s(3). Let n = b - g. Is n a prime number? False Let p(d) = -2d*3 - 8d*2 + 8d - 15. Let k be 101/(-11) + (52/44 - 1). Is p(k) a prime number? False Let d be ((-14)/213-1)/(-2). Is (1 + (-1 - d))457 composite? False Let c = -6777 - -23974. Is c a composite number? True Let m be (-16)/(-88) - 22048/22. Let k = -701 - m. Is k a prime number? False Let t(y) = -1192y - 83. Is t(-36) prime? True Suppose -5w + 51753 = 2k, -163w + 158w = -k - 51741. Is w a prime number? False Suppose -3087 = -2b - j, 8b - 7720 = 3b - 5j. Is b prime? True Let l(i) = 6i2 + 3i - 2. Let j be l(2). Let z(o) = 23o + 0 + 3o*2 - jo - 5. Is z(-5) a composite number? True Suppose -o - 3 = -s, -s - 7 = 3o - 3s. Let u(a) = -22a + 3. Let d(f) = f. Let b(m) = ou(m) - 5d(m). Is b(4) prime? False Suppose o + 1010 = 2o. Let q be (-16)/32 + o/(-4). Let f = 126 - q. Is f a prime number? True Suppose -3j = 4x + 25 + 17, -4j + 3x = 31. Let i be (25/10)/(j/(-8)). Suppose -4l + 3381 = l - id, -l = 3d - 683. Is l a composite number? False Suppose 5t + 10 = -5d, -4d - 6 = 3t - 0. Let p be t/44 - -10. Let c(v) = -v*3 + 9v*2 + 12v - 1. Is c(p) a prime number? False Let s(a) = 33a2 + 11a + 1. Suppose 2j - 7 = -13. Is s(j) prime? False Let i(v) be the third derivative of v5/12 - v4/12 + v3 - 3v*2. Let b be i(4). Suppose b = 5p - 2p. Is p composite? True Let w(x) = x + 22. Let h be w(-21). Let r(a) = 39a*3 - 2a + 4a - 1 + 0a*2 - 2a*2. Is r(h) composite? True Suppose -h + 2h + 5x = 319, 4x + 1653 = 5h. Let n = h + 68. Is n composite? False Let k(t) = -t2 + 5t - 4. Let c = 17 + -9. Let m be k(c). Let q = m + 59. Is q composite? False Let n(s) = s*2 + 5s + 9. Let d be n(-7). Suppose c + 3w + 0w = -d, 2c = -5w - 41. Is ((-2)/c)/((-2)/(-2056)) a prime number? True Let n(f) = -3f3 - 7f*2 + 11f + 11. Let p(r) = -4r3 - 6r*2 + 12r + 11. Let b(g) = -5n(g) + 4p(g). Is b(10) composite? False Let h(c) = -127c2 + 56c - 1. Let x(w) = -42w2 + 19w. Let z(k) = -6h(k) + 17x(k). Is z(9) prime? False Suppose -5n = 25, 25 = 4f - f - 5n. Suppose -4v = -5w + 4735, -3w + fv = v - 2841. Is w a prime number? True Suppose 15u + 22610 - 75065 = 0. Is u prime? False Let o(y) = 30y2 - 6y - 9. Let p be o(-8). Let k = -1292 + p. Is k a composite number? True Suppose 10k - 5664 - 1106 = 0. Is k a composite number? False Suppose -20o - 47792 + 155452 = 0. Is o a composite number? True Suppose -4r = v - 13939, 4v - r - 55756 = 3r. Is v a composite number? True Suppose 5l + 3i + 15 = 40, 2i = 5l - 25. Suppose 3n - 5n = -4. Suppose -2b = 5r - 71, nb = lb - 3r - 138. Is b a composite number? False Suppose 4g - 5u = 59, g + 3u - 99 = -3g. Suppose 0v - 3v = -g. Suppose 2x - vx + 775 = 0. Is x composite? True Suppose -3f = 3u + u + 78, 101 = -5u - 2f. Let w be (131/(-3) + 1)(-3)/2. Let q = w + u. Is q prime? True Suppose 4x + 0x = -b + 4, -x + 1 = 0. Suppose -p + 6p - 265 = b. Is p prime? True Suppose 0 = -5v + 2d + 36, -18 = -v + 3d - 8d. Is 54 - (-4 + v/4)/2 a prime number? False Let c(d) = 298d2 - 32d - 131. Is c(-7) a composite number? True Let k be 1((-8)/12 + 4/6). Suppose 4p - 1969 = s, p + 3s - 502 = -ks. Is p a composite number? True Is 105724/24 + (-2)/12 a prime number? False Suppose 4c + 4j + 16 = 0, 0 = 3c + 2j + 18 - 6. Let g be 2/(3/(c + 226)). Suppose -3m + m = -g. Is m a prime number? False Let b be ((-9)/(-6))/(2506/(-2508) + 1). Suppose -4x - 5x = -b. Is x composite? True Let y = 7 - -1. Suppose yf - 4f = 812. Is f a composite number? True Is (-7)/1 + 1 - -3665 a composite number? False Let j = -354 - -659. Is j a composite number? True Let a = 75 - 27. Let g = a - 5. Is g prime? True Let u(d) = 3d*3 + 5d*2 + 17d - 11. Suppose 17i - 136 = -0i. Is u(i) a prime number? False Suppose z = -3v - 1560, 4v = -8z + 3z - 2080. Let a = v + 109. Let t = a - -856. Is t a prime number? False Suppose 113 = 10p + 23. Suppose pi - 3i = 708. Is i composite? True Let a = 39 + -66. Let g = a + 65. Is g prime? False Is -9827(2/1 - 3) a prime number? False Let a(r) = 8r + 3r3 - 2 + r3 - 4 + 3 + 2r2. Let d = -11 - -16. Is a(d) prime? True Suppose -5w - a = 91, 4w - a - 2a + 88 = 0. Let l = 763 - 371. Let k = w + l. Is k composite? False Suppose -5 = -4h + 15. Suppose 3m = -3p + 5208, 4m + 6912 = -p + hp. Suppose -2013 = -5c + p. Is c a prime number? False Let i(p) = -158p3 - 47p - 17. Is i(-6) composite? True Let a(h) = -h*3 - 2h*2 + h - 1. Let x be a(-3). Let c be 18/(-30) + 843/x. Let y = 247 - c. Is y prime? True Let v(q) be the first derivative of 3q*4/2 + 5q*3/3 - 3q*2/2 - 3q - 2. Suppose -8y + 45 = 13. Is v(y) a composite number? False Let m = -4629 - -7612. Is m a prime number? False Let u(p) = -1 + 3 + 3p - p. Let o be u(1). Suppose ot + 5s - 1267 - 1066 = 0, t + 3s - 578 = 0. Is t a composite number? False Suppose -18f + 27441 + 104337 = 0. Is f prime? True Suppose 4l - 540 = -4y, -4y + 6y - l - 258 = 0. Let w = y - -60. Is w a composite number? False Let n(f) = f*2 - f + 1. Suppose -2s - 10 = -2. Let x(p) = 8p2 - 7p + 2. Let l(u) = sn(u) + x(u). Is l(-4) prime? False Let y be (-231)/(-84) - 6/8. Suppose -3r = yh + 26, r = -2h - 0h - 10. Let g(c) = -242c + 9. Is g(r) a composite number? True Let y(f) = f*2 - 10f + 8. Is y(-7) a prime number? True Suppose 2r + 3v + 16 = -3, 0 = -4*v - 4.	{ "pile_set_name": "DM Mathematics" }
sitive. a*(-91/89) Simplify (t/(t(t/t2)/t))(4/11)/(t2)(-8/9) assuming t is positive. t*(248/99) Simplify ((zz(-2/7))/z)(-9)((z(-1/3)z)/z)/z(-1/5) assuming z is positive. z(256/105) Simplify x(-3/4)/(x2x)(xx/x5)/xx(-1/3) assuming x is positive. x(-97/12) Simplify z*(-2/17)z(2/39) assuming z is positive. z(-44/663) Simplify (qqq(1/3))(11/5)/((q(qq5)/q)/(q(-2)q)) assuming q is positive. q(-28/15) Simplify (((w/w(-27/4))/ww)/w)/(w(-20/11)/w) assuming w is positive. w(421/44) Simplify ((ooo(-1/15))/o(-2))(6/7) assuming o is positive. o(118/35) Simplify (gg(-1/23))/ggg(-9/2) assuming g is positive. g(-163/46) Simplify (qq/(qqq*(-8)q)qq(-3/4))(-32) assuming q is positive. q(-232) Simplify (c3(c/((c/(c/c2c))/c))/c)/(c/c(2/5))(3/11) assuming c is positive. c(156/55) Simplify p(-3/8)/pp23 assuming p is positive. p(173/8) Simplify (x/(x/(x/((xx*(-2/7))/x))x))(-3)/(x(-4)/(x/(x/((xx(-8)/x)/x)))) assuming x is positive. x(-41/7) Simplify q(-1/5)/(q/(q(11/6)q)) assuming q is positive. q*(49/30) Simplify vvvvv/(v/(vv*(1/2)/v))vv/(v19/v) assuming v is positive. v(-23/2) Simplify (q(-2/3)(q(q/q3)/q)/q)/((qq/q(-2/17))/q(-1/2)) assuming q is positive. q(-641/102) Simplify (a(-19)/((a/(a/(a*(-2/17)a)a))/a))(-1/15) assuming a is positive. a(304/255) Simplify f(-4/13)f/((ff(-2/49))/f)f assuming f is positive. f(1104/637) Simplify q(2/45)/(q/(qqq*(-2))q) assuming q is positive. q(-88/45) Simplify (t(-12/5)/t)/(((tt(2/17)t)/ttt)/tt) assuming t is positive. t(-554/85) Simplify (mm1)(-15/7)/((m/m(2/13))/m(-2)) assuming m is positive. m(-649/91) Simplify ((c/c(-6))/(c/(cc14)))(-16) assuming c is positive. c(-336) Simplify ((i1)(2/21))(4/3) assuming i is positive. i(8/63) Simplify ((r/(r(-1/4)rrr))/((r3/r)/r))(-10/17) assuming r is positive. r(55/34) Simplify ((x(-3))47)(-1/30) assuming x is positive. x(47/10) Simplify a/a(-23)a(-25) assuming a is positive. 1/a Simplify (r/(rr/r*(-14/3)r))(-36) assuming r is positive. r240 Simplify ((yyy*(-2/17)y)/y(4/7))/(y(-2/25)/y10) assuming y is positive. y(36863/2975) Simplify ((i*(-2/7)/i)/ii)(1/40)/(i(-1/9)i(1/11)) assuming i is positive. i(-331/27720) Simplify ((l/((l/(l11/l))/l))(1/23))(-3/20) assuming l is positive. l(-33/460) Simplify ((y0)(-3/17))30 assuming y is positive. 1 Simplify r/((rr/(rr(-17)))/r)r(-1/33) assuming r is positive. r(-529/33) Simplify (x8)(-36) assuming x is positive. x*(-288) Simplify (ss/s(-3))/s(-1/3)((s(-3)/s)/s)/((ss(1/8))/s) assuming s is positive. s(5/24) Simplify (f(-2)/f(3/8))(1/31) assuming f is positive. f(-19/248) Simplify ((ppppppp*(-1)p)/p)*(-2/5)(p(2/3))10 assuming p is positive. p(14/3) Simplify (i0/i)/i*0(i(i/i(1/4))/i)4 assuming i is positive. i2 Simplify ((ll*(-1/3)l)(5/9))(-1/18) assuming l is positive. l(-25/486) Simplify p(2/37)p/p(-3) assuming p is positive. p(150/37) Simplify (b(-2/3)/(bb(-3/7)/b))47 assuming b is positive. b(-235/21) Simplify (a(-2/11)aa*(4/5)aa)/(a/(aa*(1/2)/aa))11 assuming a is positive. a(1003/110) Simplify (m10/m4)(10/3) assuming m is positive. m20 Simplify (k*3k*(-7))/(k/(kk/(kk(-2/19))kk)(k*(-1)k)/kk) assuming k is positive. k(-36/19) Simplify s(-26)s(-31)/s assuming s is positive. s(-58) Simplify (qqq(-15))(-1/12) assuming q is positive. q*(13/12) Simplify (mm/m*(-1/2)mm)/mm(m(2/13)m)/m assuming m is positive. m(121/26) Simplify x7/(x/(xx1)x) assuming x is positive. x7 Simplify (w(-1/4)/(w((w/(ww*2))/w)/w))/((w((((ww/(ww*2w))/w)/w)/ww)/w)/(ww(-9))) assuming w is positive. w(-5/4) Simplify (a/(a*(-2)a))/(a*1aa) assuming a is positive. 1/a Simplify k(1/5)(k/(kkk*(-3)))/kk*(-2)/((k/(k((kk/(kk*(-3/5)))/kk)/kk))/k) assuming k is positive. k(9/5) Simplify ((s/((s/(ss*(11/5)ss)s)/s))/s)49 assuming s is positive. s(1029/5) Simplify b*(-12)b/((b*(-7/4)b)/b) assuming b is positive. b*(-37/4) Simplify (s/(ss/(s/s*(-3/7))))/s(ss/s4)/ss/(sss*8ss)s1 assuming s is positive. s(-95/7) Simplify ((u/((uu(18/11)/u)/u))/u)/((uu/(u(-19)/u))/u) assuming u is positive. u(-238/11) Simplify (k(-1))(25/2)k(3/10)k*(-2/13)k assuming k is positive. k*(-738/65) Simplify (k/(k(k*(-12)k)/k))(1/3) assuming k is positive. k4 Simplify d(-12/11)/d(-1/7) assuming d is positive. d*(-73/77) Simplify (((aa19/a)/a)/a)(-21) assuming a is positive. a(-357) Simplify (h/(h(6/31)/h))/((h*(-2/27)h)/h) assuming h is positive. h*(1574/837) Simplify ((yy*(-1)y)11)(-1/45) assuming y is positive. y*(-11/45) Simplify (z/((z/((zzz4)/z))/z)z/(z/(((z*4z)/z)/z)z))(2/47) assuming z is positive. z(16/47) Simplify t/(((tt*(-1/2))/t)/t)(t/(t/(t*(-9)/t)))/t(t/t*(-2/21)tt)/((tt*(-1/8)/tt)/t) assuming t is positive. t(-887/168) Simplify j1/j*(-3)(j(-2/13)/j)/j5 assuming j is positive. j*(-28/13) Simplify pp/((pp(5/6))/p)ppp/(pp/p4)p(pppppp/p*(5/2))/(pp(1/4)/p) assuming p is positive. p(125/12) Simplify (j*(1/7)j(1/3))/(j(-4)/(jj(j/(j/((j*0j)/jj)))/jj)) assuming j is positive. j*(157/21) Simplify (ggg/((g/(gg*(2/3)g)g)/g))(-6)/(g(2/3)g(2/7)) assuming g is positive. g(-608/21) Simplify (u*(-6)u(3/5))/(u1u(-1/2)) assuming u is positive. u(-59/10) Simplify v24vvv(1/9) assuming v is positive. v(235/9) Simplify (s*(-8/5)s)(-26/9) assuming s is positive. s(26/15) Simplify ((ss/s2s)/(s/(s*(-3)/s)s))/(s((s/(s/(s0s)s)s)/s)/ss)(-2/45) assuming s is positive. s(-223/45) Simplify (((bb*(-19/5)bb)/b)/b)/b(3/16) assuming b is positive. b(-239/80) Simplify (m13m)(-2/87) assuming m is positive. m(-28/87) Simplify ((r/(r/r*(-7))r)/((rr(-2/3)r)/r))/((r/(rr/r(2/3)r)rrr)/rr)(-8/11) assuming r is positive. r(-169/33) Simplify (dd(-7))(30/7) assuming d is positive. d(-180/7) Simplify (hh/h(-45))/((h/(h14/h))/h) assuming h is positive. h*60 Simplify (aa*(-21)aaa)(-1/11) assuming a is positive. a(17/11) Simplify (x(1/3))14(x1)(-39) assuming x is positive. x(-103/3) Simplify (sss/(s(2/3)s))*(-6)(sss(-1/4))50 assuming s is positive. s*(159/2) Simplify ((p/(ppp(-1)p))/pp)36/(p(-2/3))16 assuming p is positive. p(-76/3) Simplify ((z/(((z8/zz)/z)/zz)z)/z16)(-19) assuming z is positive. z399 Simplify (((x(-2/7)/x)/x)/x)30/((x(2/7)x)/xxxx/x(-1)) assuming x is positive. x(-720/7) Simplify (y*(-5)y4)37 assuming y is positive. y*(-37) Simplify (x/(((xx/x4)/x)/x))48 assuming x is positive. x*240 Simplify (bb(-6/7))/(b/((b(-1/3)/b)/b)) assuming b is positive. b(-67/21) Simplify ((a(1/6))3)(2/65) assuming a is positive. a(1/65) Simplify (k/(k(-2/5)/kk))(-7/2)/((kk/((k/(k*(-2/11)k))/k)kk)/k(-3)) assuming k is positive. k(-1399/110) Simplify (c*(-5)cc(5/4))29 assuming c is positive. c(-319/4) Simplify (g(1/4)g)14 assuming g is positive. g(35/2) Simplify (((w/(w(-1/2)/w))/w)44)(-13) assuming w is positive. w(-858) Simplify (o(3/5)/o)/((o(-1)/o)/o)o(-1/3)o(-1) assuming o is positive. o(19/15) Simplify (((d/d(-1/2))/d)15)(4/11) assuming d is positive. d(30/11) Simplify ((x(-1))(-4/15))(-3) assuming x is positive. x(-4/5) Simplify (w(-3))(-3/13)((www(3/5))/w)(-10/13) assuming w is positive. w(-7/13) Simplify (x(-6/13)/((((x1xx)/xx)/x)/x))/(x*(-1/3)/xxx/x(-1/15)x) assuming x is positive. x(-623/195) Simplify (m(-1))(-32)/(m6/m(-6)) assuming m is positive. m20 Simplify (p(-7))(-6/11) assuming p is positive. p(42/11) Simplify (z3/(zz5z))(-30) assuming z is positive. z120 Simplify d(d/(dd*(8/7)))/d((d/d9)/d)/d assuming d is positive. d(-78/7) Simplify (a(-1/2))(-25/6)(a/(aa(aa/a*(1/2))/aa))/aaa**1 a	{ "pile_set_name": "DM Mathematics" }
-678017 What is 6a2062 (base 11) in base 13? 300937 36035b6 (base 12) to base 14 1562bd8 Convert -61159 (base 14) to base 12. -b3177 What is -6000642 (base 9) in base 3? -20000000201102 What is -7aebe (base 15) in base 14? -a2930 23133400 (base 5) to base 2 110010111011011000 885634 (base 15) to base 12 22146aa Convert 27470 (base 10) to base 9. 41612 -14386676 (base 9) to base 5 -3312041142 -43023 (base 6) to base 5 -141342 -3639264 (base 10) to base 15 -4bd479 -21021212222020 (base 3) to base 4 -32302020033 What is 1023120231 (base 4) in base 15? 61756 What is 1ae43d (base 15) in base 16? 140c29 997158 (base 14) to base 10 5205642 -140672 (base 8) to base 16 -c1ba 319223 (base 12) to base 2 10111111001011111011 Convert -551a6a (base 13) to base 15. -29884a What is -1011001100011001 (base 2) in base 5? -2431344 What is 220010211121101 (base 3) in base 12? 4368a01 What is -222011222 (base 3) in base 8? -45220 What is 200310300 (base 4) in base 3? 20211102120 71994 (base 12) to base 7 1155220 What is -110112000222 (base 3) in base 15? -4d038 What is 10111000011011101 (base 2) in base 10? 94429 -402413040 (base 5) to base 11 -9a8625 What is -59184 (base 13) in base 2? -100111110000100111 Convert 270ee (base 16) to base 4. 213003232 What is 22242041 (base 6) in base 9? 1237057 What is -100011010101110001001 (base 2) in base 8? -4325611 What is 232334142 (base 6) in base 15? 5a522e -116442 (base 7) to base 13 -9a23 Convert 1123102 (base 4) to base 11. 4431 83386c (base 13) to base 15 407d0a What is -231040302 (base 5) in base 16? -fc663 What is -a5a4 (base 16) in base 3? -2011011112 Convert -10101000111101010 (base 2) to base 5. -10232011 Convert 115239 (base 11) to base 13. 65187 Convert -d0f2c (base 16) to base 14. -183c84 What is -787e4a (base 15) in base 9? -11730037 -288d2 (base 16) to base 12 -80156 100013322 (base 4) to base 3 10100121000 14420045 (base 8) to base 9 6156182 Convert 3491850 (base 11) to base 6. 334332214 What is -4937b (base 15) in base 3? -102212112022 What is -18aa7d (base 15) in base 7? -13126660 Convert -121100220 (base 3) to base 7. -46533 -10332242 (base 6) to base 9 -518048 Convert -24320041 (base 5) to base 2. -111000000000010100 Convert 7433165 (base 8) to base 4. 13203121311 What is -a232 (base 13) in base 12? -10b25 -7a07 (base 15) to base 4 -12110122 Convert 1e000a (base 16) to base 6. 110050134 Convert 8074895 (base 10) to base 5. 4031344040 Convert 205303233 (base 6) to base 15. 4b68a6 Convert a3c9 (base 15) to base 4. 20130312 Convert 13954 (base 12) to base 14. 9d28 230440432 (base 6) to base 7 51000242 Convert -10399 (base 12) to base 15. -6490 -2b4 (base 14) to base 4 -20212 Convert -1142174 (base 9) to base 13. -1885a8 20120002122 (base 3) to base 12 62868 -4eca63 (base 16) to base 2 -10011101100101001100011 Convert 1030763 (base 10) to base 5. 230441023 What is 12510241 (base 6) in base 4? 1210331101 -1ca7c (base 15) to base 4 -112310310 What is -14142432 (base 5) in base 12? -70a21 Convert -166733 (base 8) to base 2. -1110110111011011 -741631 (base 8) to base 10 -246681 What is -725132 (base 9) in base 11? -27425a 244414234 (base 5) to base 7 12641626 What is -132593 (base 10) in base 4? -200113301 What is 2308260 (base 9) in base 15? 19931c Convert 104231 (base 10) to base 7. 612611 Convert 267e8 (base 15) to base 13. 44171 Convert -12201221210 (base 3) to base 4. -123211002 Convert -37a50 (base 12) to base 9. -124876 What is -182498 (base 12) in base 15? -84198 What is 234c24 (base 13) in base 14? 17bb2b 5222421 (base 6) to base 11 162383 What is -2010222 (base 3) in base 12? -aa5 1010111010001011101010 (base 2) to base 7 33210322 Convert -1051566 (base 11) to base 16. -1c2df6 -254dc (base 14) to base 9 -148500 What is -344a93 (base 12) in base 9? -1516343 Convert 2a3492 (base 11) to base 7. 4010162 -1feba2 (base 16) to base 13 -583244 Convert 413423002 (base 5) to base 11. a62504 What is -3a2e62 (base 16) in base 7? -44260336 -338769 (base 11) to base 16 -83816 Convert -114a61 (base 14) to base 16. -8fdcd -11111101110001011 (base 2) to base 6 -2441311 What is -202304 (base 6) in base 4? -3323200 -453164 (base 7) to base 13 -2a764 -202202232 (base 4) to base 3 -21012002020 What is -13032122133 (base 4) in base 7? -22046001 What is 110241033 (base 7) in base 15? 8b0039 Convert -22b335 (base 13) to base 3. -1112212220022 What is -204103 (base 11) in base 8? -1177576 Convert 10110001110100 (base 2) to base 6. 124404 110000011011000111000001 (base 2) to base 12 4302055 What is -66bc (base 16) in base 14? -9828 Convert -125315220 (base 6) to base 13. -696348 Convert 15372762 (base 8) to base 13. 96a836 Convert 1101011110000010000 (base 2) to base 16. 6bc10 Convert -122101022200111 (base 3) to base 6. -525554534 -3421411 (base 6) to base 4 -222133033 Convert -1044045 (base 7) to base 10. -128658 What is 41105200 (base 6) in base 11? 733050 Convert -2264805 (base 10) to base 6. -120313113 Convert b68571 (base 13) to base 16. 4137b6 What is 93903 (base 11) in base 13? 4a3a3 -100003102230 (base 4) to base 3 -21220210000000 Convert -22123200 (base 4) to base 10. -42720 10010010001101011111 (base 2) to base 15 bc6a4 Convert 322922 (base 10) to base 4. 1032311222 -2036636 (base 8) to base 5 -114240222 Convert -11010001100110111 (base 2) to base 16. -1a337 -33223323 (base 5) to base 2 -1000110100110111101 Convert 2010002001101 (base 3) to base 4. 10102101202 What is -1635650 (base 8) in base 16? -73ba8 What is -973141 (base 10) in base 9? -1742807 Convert -415423 (base 9) to base 5. -30343442 84472 (base 10) to base 4 110213320 What is ca4d35 (base 14) in base 11? 395a7a5 Convert -2b0819 (base 13) to base 2. -100000010010101010011 Convert 29391e (base 15) to base 8. 7447772 What is -2c847b (base 15) in base 3? -11001110002122 What is c5aba (base 14) in base 6? 14115324 7c4146 (base 13) to base 16 2d068e -fc0e (base 16) to base 11 -44530 What is 535533 (base 6) in base 14? 120a5 Convert -3a1b53a (base 12) to base 9. -23546811 Convert 152352 (base 6) to base 16. 39ec Convert -22230240 (base 5) to base 10. -195695 -1007744 (base 8) to base 11 -172011 Convert 1020424253 (base 6) to base 5. 10213002413 What is -abbc (base 13) in base 16? -5db0 Convert 100362303 (base 7) to base 4. 112033131000 What is 342401340 (base 5) in base 7? 15663550 What is -10010010110111010001 (base 2) in base 5? -123222203 What is 1424414 (base 6) in base 15? 1919a Convert -20010000111 (base 3) to base 8. -352752 What is 12013032 (base 5) in base 9? 177377 Convert -12010333233 (base 4) to base 12. -64a093 -211000001111 (base 3) to base 11 -276407 What is 12fb5 (base 16) in base 10? 77749 -45415 (base 12) to base 7 -532511 What is 103233220113 (base 4) in base 10? 5175831 What is -12010212011 (base 3) in base 13? -370c9 What is -6896e (base 16) in base 8? -1504556 110660231 (base 7) to base 15 8c6442 301202202 (base 4) to base 11 1294a8 Convert 33123121 (base 4) to base 15. 13acd What is -1021101121010101 (base 3) in base 6? -1451430231 -101110101111101011 (base 2) to base 13 -691c3 Convert -110110011110111010 (base 2) to base 3. -102100010021 -2094b7 (base 12) to base 14 -d5415 2143233 (base 7) to base 11 16a544 What is 111076 (base 8) in base 15? b15d -47649 (base 16) to base 13 -a3143 3b02a (base 12) to base 11 56054 -1140313012 (base 5) to base 3 -12000110221011 Convert -1aa9 (base 12) to base 16. -ce1 2000111002 (base 3) to base 16 9b27 What is 1422132 (base 7) in base 6? 4025353 What is -5001540 (base 6) in base 11? -14a645 Convert 104136 (base 10) to base 4. 121123020 Convert -307418 (base 10) to base 15. -61148 1374568 (base 9) to base 4 2321002022 What is a707 (base 15) in base 13? 1310b 494a50 (base 12) to base 7 13055310 What is 1d48db (base 15) in base 8? 5356656 -565760 (base 9) to base 4 -1102232331 What is -9249915 (base 11) in base 15? -167ac69 What is -4131373 (base 8) in base 6? -35242351 -463566 (base 9) to base 10 -278214 What is 580ca (base 13) in base 2? 100111001100100011 -1101000101101110001 (base 2) to base 15 -87143 What is -4043333001 (base 5) in base 6? -451222325 Convert -1111000010110101 (base 2) to base 13. -22081 Convert -145795 (base 11) to base 12. -ab5b1 What is -2933cc (base 15) in base 4? -13210231113 W	{ "pile_set_name": "DM Mathematics" }
Let l = -101.957 - -102. Let r = 0.5188 + -0.57. Let i = l + r. Round i to three dps. -0.008 Suppose a = 6a + 26855. Let x = a - -13471. Round x to the nearest 1000. 8000 Let j(f) = 6f2 + f + f3 - 1 - 2 + 0f3 - 5. Let x be j(-7). What is x rounded to the nearest ten? -60 Suppose 3d - 277 = -2m, 4m + 3d - 551 = -0m. Round m to the nearest ten. 140 Let l = 150.9999919 + -151. Round l to six decimal places. -0.000008 Let n = 25.4 + -20. Let u = 4 + 2. Let s = u - n. What is s rounded to one decimal place? 0.6 Let r(f) = -12f - 6. Let b be r(-11). What is b rounded to the nearest ten? 130 Let w = -6.5 - -6. Let j = w + 0.5000064. What is j rounded to six decimal places? 0.000006 Let g = 5989567 - 5989594.999855. Let c = 0.09 + -28.09. Let r = g - c. Round r to 5 decimal places. 0.00015 Let o = -2083 + 2313.3. Let c = -241 + o. What is c rounded to 0 dps? -11 Let p(h) = -68h*3 - 3. Let g = 7 + -10. Let f be p(g). Let k = f + -1243. Round k to the nearest one hundred. 600 Suppose -5g - 2z = -507, -3g + 25 = -z - 288. What is g rounded to the nearest 10? 100 Let g = -148.49891 + 3.56191. Let s = 126.9 - -18.1. Let a = g + s. What is a rounded to 2 dps? 0.06 Let g = 60 - 59.996. What is g rounded to three decimal places? 0.004 Let n be 4/(-3)(4 - 1). Let j be n/((-12)/(-49375))480. What is j rounded to the nearest 1000000? -8000000 Suppose -8 = -3l + 4l. Let t = l - -13. Suppose 5n = 5, -td - 109998 = 2n - 0n. Round d to the nearest 10000. -20000 Let n = -1119.3 + -44671.7. Let p = 45791.399976 + n. Let f = p + -0.4. Round f to five dps. -0.00002 Suppose 5s - 5 - 5 = 0. Suppose q = 3w - q - 26, w - sq - 2 = 0. Let u be (-26392)/w - 2/3. What is u rounded to the nearest one thousand? -2000 Let a be 1 + 1/1-4079261. Let w be a/(-14) + 2/7. Let s = 208624 + w. What is s rounded to the nearest one million? 1000000 Let z = 0.12200121 - 0.122. Round z to 7 decimal places. 0.0000012 Let o = 0.062 - 30.062. Let i = o + 29.9993. Round i to three decimal places. -0.001 Let s = 0.08300152 + -0.083. What is s rounded to seven decimal places? 0.0000015 Suppose 4s + 0s = -5t + 15, -2t + 23 = 5s. Let c(l) = 5599l*2 + l. Let v be c(1). Suppose sf - 3f = -v. What is f rounded to the nearest one thousand? -3000 Let x be (-1)/(-2) - (-63)/18. Let u be ((-52)/(-3))/(x/(-12)). What is u rounded to the nearest ten? -50 Let n(z) = -z3 + 16z*2 - 2z + 28. Let t be n(12). What is t rounded to the nearest 100? 600 Let h = -1.403 - -1.48. Let k = h + -0.0770155. What is k rounded to six decimal places? -0.000016 Let q = -1.9 - 27.1. Let h = 28.872 + q. What is h rounded to two decimal places? -0.13 Let t = 44.0000004 - 44. What is t rounded to six dps? 0 Let v = -6.214 - 131.206. Let l = -136 - v. Let k = l + 0.18. What is k rounded to zero dps? 2 Let q = 0.0728 - -320.9272. Let x = q - 320.99833. What is x rounded to four decimal places? 0.0017 Let g = -49 + 16. Let r = g + 36.6. Round r to the nearest integer. 4 Let m = -19.999 + -0.001. Let g = 20.65 + m. What is g rounded to 1 dp? 0.7 Let p = 0.705 + -0.9. Let u = p + -0.015. What is u rounded to one decimal place? -0.2 Let i = -0.07 + 0.13. Let x = -0.05922 + i. What is x rounded to four decimal places? 0.0008 Let l = -20.96 - -24.583. Let g = 0.197 - 0.12. Let t = g + l. Round t to the nearest integer. 4 Let s(c) = 12999c - 4. Let w = -3 + 6. Suppose -wo + 4y - 2y - 6 = 0, -4o + 2y - 10 = 0. Let b be s(o). Round b to the nearest ten thousand. -50000 Let i = -22041 + 340522. Let h = i + -718481. What is h rounded to the nearest 100000? -400000 Let x(b) = -b*2 + 2b + 4. Let g be x(3). Let y be 320((-10)/8 - g). Round y to the nearest 100. -700 Let j = 1 + -1. Suppose 0 = -2n - jn + 8. Suppose nt = -0t - 12400000. Round t to the nearest one million. -3000000 Suppose 0 = -5d + d + 300. Suppose -2o = 2g - 392, -4g + o - d + 879 = 0. Round g to the nearest one thousand. 0 Let q(z) = -874995z - 40. Let n be q(8). Round n to the nearest 1000000. -7000000 Let j(o) = -2o2 + 304000. Let z be j(0). Round z to the nearest ten thousand. 300000 Let o(p) = -3p*2 + 24p - 60. Let x be o(18). What is x rounded to the nearest one thousand? -1000 Let s = 12 + 1. Let g = -18 + s. Let z = g + 5.0000032. What is z rounded to 6 decimal places? 0.000003 Let o = -20.68 - -21. Let d = o + -0.32109. Round d to four dps. -0.0011 Suppose -13 - 47 = -2u + 4k, 5u = -4k + 108. Round u to the nearest ten. 20 Let j = -16397845.999974 + 16397880. Let y = 32.3 + 1.7. Let v = y - j. Round v to 5 decimal places. -0.00003 Let r = 17 - 17.014. Let y = -0.312 + 1.416. Let g = y + r. What is g rounded to one decimal place? 1.1 Let h = -21895 + 21894.30012. Let r = h - -0.7. What is r rounded to 5 decimal places? 0.00012 Let n be 17-1(-1722)/(-3). Let o = 3442 - n. Round o to the nearest 1000. 13000 Let i(d) be the second derivative of 0d2 - 5/6d*3 - 2/3d*4 + 0 - 3/20d*5 - d. Let z be i(-5). Round z to the nearest one hundred. 200 Let k = -0.0530022 - -0.053. What is k rounded to six decimal places? -0.000002 Let c = 3.9 + -3.90000122. What is c rounded to six decimal places? -0.000001 Let z = 0.9 + 1.1. Let t = z - 5. Let r = -3.056 - t. Round r to two dps. -0.06 Let v = 429 + -238. Suppose -4l + v = -53. Let u = -155 - l. Round u to the nearest 10. -220 Suppose 5c + 12 + 8 = 0, 0 = -5o + 2c + 974133. Let f = o + 1225175. Round f to the nearest 100000. 1400000 Suppose -m = 4r - 8 + 266, 814 = -3m - 4r. Let w = 928 + m. Round w to the nearest one hundred. 700 Let l = 164325.84420117786 + 145288582.65579861214. Let y = 145452910 - l. Let o = -1.5 + y. What is o rounded to seven dps? 0.0000002 Let x = 2.918417 - -179.541603. Let s = -182.5 + x. Let y = s - -0.04. Round y to four dps. 0 Suppose 0 = -6b + 2b + 4200000. What is b rounded to the nearest one hundred thousand? 1100000 Let w = -2783417 - -2783430.39779. Let c = w - 13.4. Round c to four dps. -0.0022 Suppose -4k + 3 + 9 = 0. Suppose 2n + 2n = 28. Suppose 32400000 = kj - nj. What is j rounded to the nearest 1000000? -8000000 Let i = -225314.800006 + 225315. Let s = i - 0.2. Round s to five dps. -0.00001 Suppose -2m + 0m + 28 = -3h, 2m + 4 = -5h. Round m to zero decimal places. 8 Let c = 10.6999953 + -10.7. Round c to 6 decimal places. -0.000005 Let s = -0.08 - -6.08. Let o = s + -4.56. What is o rounded to one decimal place? 1.4 Suppose -5j - 541403 = -19258. Let g = j + 173429. What is g rounded to the nearest 10000? 70000 Suppose -6c + 13c - 126 = 0. What is c rounded to the nearest 10? 20 Let q = 41.8 + -64.1. Let i = q + 6.8. Round i to zero decimal places. -16 Let t = 1697077.700001 - 1697077. Let l = 0.7 - t. What is l rounded to 5 dps? 0 Let u = -1293 + 853. What is u rounded to the nearest one hundred? -400 Let c = -143633556565.670091 + 143634959209.3. Let h = c + -1402645. Let g = h - -1.37. What is g rounded to five decimal places? -0.00009 Let d = 3554.932694644 + -3554.93. Let l = -38.002671644 + d. Let w = l - -38. Round w to five decimal places. 0.00002 Suppose 5v + 4179 = g, 2v + 3g + 625 = -1050. Let o be v/(-12) - 6/9. What is o rounded to the nearest ten? 70 Let o = 144.97 + 3.03. Let c = o + -147.99891. Round c to four decimal places. 0.0011 Let b = -7741.928467 + 210005.728461. Let a = -202263 + b. Let c = a - 0.8. What is c rounded to five dps? -0.00001 Let g(t) = 8t3 - 4t*2 + t - 2. Let u be g(3). Suppose -5h - u = -491. What is h rounded to the nearest ten? 60 Let u(w) = -54w2 - 2w + 12. Let h be u(10). Let o = -3408 - h. Round o to the nearest 1000. 2000 Let v(f) = 11496f3 - 1 + 3947f*3 - f + 5557f**3. Let p be v(-1). What is p rounded to the nearest 10000? -20000 Let o = 758854 - 758869.99989. Let m = -16 - o. Round m to 4 dps. -0.0001 Let c = -91.0000152 - -91. Round c to 6 dps. -0.000015 Let w = -97.9883 - -0.3383. Let q = w + -2.35. Let f = 99.9999937 + q. Round f to six decimal places. -0.000006 Let l = -32 + 34.2. Round l to zero dps. 2 Let o = 52.51 + -53. Let z = o + 3.19. What is z rounded to the nearest integer? 3 Let t = -1456739 - 2743261. Round t to the nearest one million. -4000000 Let w = 0.1 - 0.4. Let h = w - -0.29989. What is h rounded to	{ "pile_set_name": "DM Mathematics" }
two letters picked without replacement from {r: 3, x: 2, h: 15}. 21/38 Four letters picked without replacement from {v: 4, r: 4, h: 1, c: 6}. What is prob of sequence hrch? 0 Calculate prob of sequence vsk when three letters picked without replacement from kskeezvkvkvveb. 2/273 What is prob of sequence ttvv when four letters picked without replacement from {t: 1, l: 1, v: 4, b: 1, w: 1}? 0 Four letters picked without replacement from aaeaeaaaaaaeaaaeaae. Give prob of sequence aaea. 455/3876 What is prob of sequence gggh when four letters picked without replacement from {g: 3, h: 1}? 1/4 Calculate prob of sequence jdj when three letters picked without replacement from {y: 4, n: 1, d: 8, j: 5}. 5/153 Calculate prob of sequence itti when four letters picked without replacement from ttiittitirtttt. 36/1001 Calculate prob of sequence ty when two letters picked without replacement from {y: 2, p: 1, o: 2, u: 2, t: 5, f: 1}. 5/78 What is prob of sequence tata when four letters picked without replacement from {t: 4, a: 2}? 1/15 Three letters picked without replacement from {m: 9, r: 7}. What is prob of sequence rrr? 1/16 Three letters picked without replacement from {e: 2, m: 1, q: 2, u: 1, n: 1, s: 1}. What is prob of sequence smn? 1/336 Two letters picked without replacement from {f: 1, b: 1, g: 3, c: 3, y: 7, q: 3}. What is prob of sequence yb? 7/306 What is prob of sequence bb when two letters picked without replacement from {b: 7, u: 5, n: 3, l: 4}? 7/57 What is prob of sequence flfy when four letters picked without replacement from {f: 7, y: 2, l: 1, g: 7, z: 3}? 7/9690 What is prob of sequence fdds when four letters picked without replacement from {s: 3, f: 6, d: 4}? 9/715 Calculate prob of sequence kc when two letters picked without replacement from {c: 1, b: 2, d: 2, z: 1, q: 1, k: 1}. 1/56 What is prob of sequence nb when two letters picked without replacement from adnbdwp? 1/42 Three letters picked without replacement from gphppqqppqttpptpqppt. What is prob of sequence hpg? 1/684 Two letters picked without replacement from {s: 1, u: 1, q: 4, e: 6, b: 1}. What is prob of sequence bq? 1/39 What is prob of sequence sf when two letters picked without replacement from {h: 4, f: 2, t: 1, s: 2, z: 5}? 2/91 What is prob of sequence lkkk when four letters picked without replacement from kklllllmk? 5/504 What is prob of sequence lll when three letters picked without replacement from llll? 1 Three letters picked without replacement from hbelbe. Give prob of sequence eeb. 1/30 Two letters picked without replacement from bbbmbmbbb. Give prob of sequence bm. 7/36 Three letters picked without replacement from yyeymeyemyye. Give prob of sequence emy. 2/55 Calculate prob of sequence gfg when three letters picked without replacement from {g: 8, f: 2}. 7/45 Four letters picked without replacement from {l: 9, y: 6, h: 2}. Give prob of sequence hyll. 9/595 What is prob of sequence abo when three letters picked without replacement from {m: 1, o: 1, a: 2, b: 2}? 1/30 Two letters picked without replacement from {x: 1, w: 3, o: 5, l: 3, s: 6}. What is prob of sequence sx? 1/51 Calculate prob of sequence xxol when four letters picked without replacement from {o: 8, l: 3, x: 7}. 7/510 Two letters picked without replacement from {a: 2, p: 2, f: 1, r: 1}. Give prob of sequence pp. 1/15 Calculate prob of sequence cpjj when four letters picked without replacement from {p: 2, t: 1, j: 6, c: 1, z: 5, s: 5}. 1/1938 Calculate prob of sequence tttt when four letters picked without replacement from {t: 5}. 1 Calculate prob of sequence ppqq when four letters picked without replacement from ppppqqpqqpqpq. 21/286 Four letters picked without replacement from {g: 1, i: 7, y: 2, o: 8}. What is prob of sequence iyog? 7/4590 Three letters picked without replacement from {a: 5, r: 2, m: 2}. Give prob of sequence rmr. 1/126 Four letters picked without replacement from zxhhzzhzbhizkzxxzk. What is prob of sequence hibz? 7/18360 What is prob of sequence mq when two letters picked without replacement from bbbbbbvmnvnvbbfq? 1/240 Two letters picked without replacement from uxuuxxff. What is prob of sequence ff? 1/28 Two letters picked without replacement from {y: 3, z: 9}. Give prob of sequence yz. 9/44 Four letters picked without replacement from {r: 7, l: 4, d: 4}. What is prob of sequence rldd? 2/195 Three letters picked without replacement from aaaanababaaatabtb. Give prob of sequence ttn. 1/2040 Two letters picked without replacement from zgzzggzggg. Give prob of sequence zg. 4/15 Calculate prob of sequence ld when two letters picked without replacement from {b: 1, d: 1, i: 1, a: 1, l: 1}. 1/20 What is prob of sequence bo when two letters picked without replacement from lolbbsotbtqo? 3/44 Four letters picked without replacement from ggagfafffg. Give prob of sequence ffff. 1/210 What is prob of sequence vmmm when four letters picked without replacement from {d: 1, m: 1, v: 2, j: 5}? 0 Two letters picked without replacement from mznmnnsmfnn. What is prob of sequence nn? 2/11 What is prob of sequence rzx when three letters picked without replacement from {z: 1, r: 2, x: 2}? 1/15 Three letters picked without replacement from wxwwwbxxw. Give prob of sequence xwb. 5/168 Calculate prob of sequence zb when two letters picked without replacement from {b: 2, z: 3, s: 10, d: 3}. 1/51 Calculate prob of sequence jqg when three letters picked without replacement from {q: 2, e: 2, g: 4, j: 1, t: 1}. 1/90 Two letters picked without replacement from {j: 1, e: 1, w: 1, p: 1, u: 3, k: 5}. Give prob of sequence uk. 5/44 Four letters picked without replacement from rlrllljr. Give prob of sequence lrrj. 1/70 Two letters picked without replacement from ccccyccccccc. What is prob of sequence cy? 1/12 Three letters picked without replacement from ivyvtbbuu. What is prob of sequence ivy? 1/252 What is prob of sequence ik when two letters picked without replacement from aqaokai? 1/42 Two letters picked without replacement from {p: 3, m: 5}. Give prob of sequence mm. 5/14 Calculate prob of sequence tata when four letters picked without replacement from {t: 7, a: 2}. 1/36 Two letters picked without replacement from {v: 4, p: 3, h: 3, b: 7, s: 2}. Give prob of sequence ph. 1/38 Three letters picked without replacement from yyzbllxblzlzzy. What is prob of sequence xzb? 1/273 Calculate prob of sequence td when two letters picked without replacement from {i: 3, d: 7, q: 1, e: 2, t: 3, g: 3}. 7/114 What is prob of sequence hyss when four letters picked without replacement from {q: 1, y: 6, h: 5, s: 6}? 5/408 What is prob of sequence iw when two letters picked without replacement from wjwuiiz? 2/21 Four letters picked without replacement from {o: 3, l: 4, k: 1}. What is prob of sequence oool? 1/70 What is prob of sequence cccw when four letters picked without replacement from {w: 2, c: 3}? 1/10 Four letters picked without replacement from qaqqqaqaqqqqqqq. Give prob of sequence qaqa. 11/455 What is prob of sequence qx when two letters picked without replacement from {p: 2, o: 1, q: 1, n: 1, a: 1, x: 1}? 1/42 Four letters picked without replacement from ddddppdddddd. What is prob of sequence ppdd? 1/66 What is prob of sequence nw when two letters picked without replacement from {w: 7, n: 1, s: 6, i: 4}? 7/306 Three letters picked without replacement from {m: 1, h: 10, q: 3, j: 2}. Give prob of sequence jmh. 1/168 Three letters picked without replacement from {d: 1, b: 4, c: 3}. What is prob of sequence cbd? 1/28 What is prob of sequence iik when three letters picked without replacement from mqdiikqqikk? 1/55 Four letters picked without replacement from hqmwppqqppwhhh. What is prob of sequence hqmp? 2/1001 What is prob of sequence nj when two letters picked without replacement from ajenj? 1/10 Three letters picked without replacement from zplzzrrllzxlr. What is prob of sequence rzx? 1/143 What is prob of sequence dq when two letters picked without replacement from {d: 3, z: 1, i: 2, o: 6, q: 1}? 1/52 Two letters picked without replacement from hbbbxbbwbblhwxxbl. Give prob of sequence bh. 1/17 What is prob of sequence aaa when three letters picked without replacement from {a: 3}? 1 Four letters picked without replacement	{ "pile_set_name": "DM Mathematics" }
= -k + 8. Suppose 5a - 10 = -0. Calculate the remainder when a is divided by z(6). 0 Suppose 5a + 45 = -5s + 210, -30 = -a + 2s. Suppose -a = -5k + 3y, -4k = 4y + 3 - 35. What is the remainder when 10 is divided by k? 3 Suppose -4s - 10 = -4j - j, 8 = -2j + 4s. Suppose 197 - 1703 = -jo. Calculate the remainder when o is divided by 21. 20 Suppose 2i - 25 = 13. Let h = -6 + i. Let k = -33228 - -33233. Calculate the remainder when h is divided by k. 3 Suppose 5p - 27 = 23 + 20. What is the remainder when 1971 is divided by p? 11 Let a(d) = -10d*2 + 139d - 110. What is the remainder when a(12) is divided by 9? 1 Let g(p) = p*3 + 34p*2 + 16p + 80. Let d be g(-33). Suppose 98 = -634o + do. Calculate the remainder when o is divided by 6. 2 Suppose -3t = 3x, -3t - 1 = 2. Let b(h) = -11h. Let c(d) = 11d. Let f(l) = -6b(l) - 4c(l). Calculate the remainder when 41 is divided by f(x). 19 Let k(y) = -y2 - 11y + 68. Let r be k(-15). Suppose -770 = -27n - rn. What is the remainder when 81 is divided by n? 15 Suppose m - 4 = 0, 3x = x - 3m + 58. Let f = 138 - 27. Calculate the remainder when f is divided by x. 19 Let m be 35/(-28)(-24 - 0). Suppose -mb = -33b + 63. Calculate the remainder when 96 is divided by b. 12 Suppose -m + 122 = h, -5h - 2m + 465 + 148 = 0. What is the remainder when h is divided by 42? 39 Let p = 7 - -12. Calculate the remainder when (-18)/15(-59 + 19) is divided by p. 10 Suppose 0t = -2t + 22. Suppose -302u = -11740 - 642. What is the remainder when u is divided by t? 8 Let h = -421 - -422. Suppose -9 = -5w + h. Calculate the remainder when 17 is divided by w. 1 Suppose -28v = -25v - 18. Calculate the remainder when (2/10)/(10/25)50 is divided by v. 1 Let s = 184 + -34. Calculate the remainder when s is divided by (-147)/(-3) + 4 + -2. 48 Suppose -v + 2 = i - 31, 4v = 4i - 164. Let y(x) = x2 - 146x + 2773. What is the remainder when y(124) is divided by i? 8 Suppose 0 = 5z + 20, -2z + 417 = 3y + 32. What is the remainder when y is divided by 20? 11 Let o(j) = -88j - 2122. Calculate the remainder when o(-29) is divided by 109. 103 Suppose 17g = 14g - 3k + 501, -21 = -3k. What is the remainder when 289 is divided by g? 129 Let a(v) = -2v3 - 21v*2 - 15v + 7. Let i be a(-10). Let g = i - -3. Calculate the remainder when g is divided by ((-9)/5)/((-3)/15). 6 Let a = 65 + -11. Suppose 4i = 6z - 10z + 32, 4z - 5i + 13 = 0. Suppose -zn = 15 - 57. What is the remainder when a is divided by n? 12 Let i = -11392 + 11662. Calculate the remainder when i is divided by 66. 6 Suppose 4n + 4 = 4u, 37u - 39u = -16. Let r(d) = -d - 2. Let y be r(-5). Let b(l) = -l*2 + 3l + 4. What is the remainder when n is divided by b(y)? 3 Suppose -15 = 34i - 35i. Let h be -5(-4)/41. Suppose 0 = -3n + 3u + 141, -hn + 138 = -2n - 2u. Calculate the remainder when n is divided by i. 14 Let a = 65 + -65. Suppose 155 = -4m + x, -2m + am = -5x + 73. What is the remainder when 170 is divided by (-1683)/m - 18/117? 41 Let l(k) = -2k*3 + 55k*2 + 79k + 306. What is the remainder when 750 is divided by l(29)? 10 Let f(w) = 5w2 + 50 + 87w - 3w2 - 1 - 90w. What is the remainder when f(8) is divided by 42? 27 Let q(i) = 3239i + 276. Calculate the remainder when q(2) is divided by 31. 27 Let r(j) be the third derivative of -j4/3 + 11j*3/6 - 9j*2. Let z be ((-36)/30)/(2/15). Calculate the remainder when r(z) is divided by 43. 40 Let w = 719 - 559. What is the remainder when (896/w)/(2/10) is divided by ((-1)/2)/(3/(-12))? 0 Let t(c) = 5c*2 + 7c - 14. What is the remainder when t(11) is divided by 113? 103 Suppose -8k + 68 + 220 = 0. Let s(b) = -18b*3 + 3b + 2. Let q be s(-1). Suppose l = y - 2l - q, 0 = 4l + 12. What is the remainder when k is divided by y? 4 Let x be 5 + (-36)/9 + 54. Suppose -38v - 1513 = -xv. Calculate the remainder when 104 is divided by v. 15 Let v = -6117 + 6545. Calculate the remainder when v is divided by 10. 8 Suppose -118k + 116k + 3196 = 2t, 0 = -5t + 2k + 7948. Calculate the remainder when t is divided by 55. 52 Let m(y) be the first derivative of 3y*2/2 - 13y + 2. Calculate the remainder when 107 is divided by m(15). 11 Calculate the remainder when 194/2 + -1 - ((-7 - 1) + 10) is divided by 19. 18 Let v(p) = -p*2 + 179p + 3116. Calculate the remainder when v(-15) is divided by 80. 46 Suppose -9x + 482 = -589 + 306. What is the remainder when 7649 is divided by x? 84 Suppose 0 = 5f - 2r + 433, -f - 83 = -r - 3r. Let b = 165 - 76. What is the remainder when b is divided by (-10)/(-8) + f/(-4)? 20 Let l = 36 + 10. Let m = -1029 - -1256. What is the remainder when m is divided by l? 43 Suppose -133 = -32b + 561 + 426. What is the remainder when -1 + (38 - (0 - -1)) is divided by b? 1 Let c = 348 + -339. Calculate the remainder when (-8 - 76)c/(-6) is divided by 4. 2 Let d be ((-12)/(-1) - 1) + -5 + -967. Let t = -944 - d. Calculate the remainder when 20 is divided by t. 3 Suppose 5x = -3h + 5314, -2 - 4 = 3h. Calculate the remainder when x is divided by 338. 50 Let s = -74 + 83. Let c be 41/(4 - (1 + (2 - 0))). Let n = 44 - c. Calculate the remainder when s is divided by n. 0 Suppose u - 628 - 574 = 3s, 2s = 3u - 3564. What is the remainder when u is divided by 22? 18 What is the remainder when 2778/4 - ((-2)/(-10))/(2/15) is divided by 112? 21 Suppose 18g - 2 = 17g. Suppose gs = -s + 4s. Let n = s + 23. What is the remainder when 66 is divided by n? 20 Suppose -357 = -352o + 345o. Suppose oj - 234 = 45j. Let w = -50 + 71. What is the remainder when j is divided by w? 18 Let z be ((-44)/(-12))/11 + (-5)/(-3). Suppose 0 = 3k + 5n + 10, -3n - 8 + z = 0. Let b = k + 38. Calculate the remainder when 113 is divided by b. 37 Let l(z) = -z3 + 60z*2 - 3z + 198. What is the remainder when 287 is divided by l(60)? 17 Let z(i) = -26i - 149. Let d(n) = -55n - 297. Let r(h) = -4d(h) + 9z(h). What is the remainder when r(-16) is divided by 36? 35 Let r = -928 - -454. Let t = -407 - r. Calculate the remainder when t is divided by 24. 19 Suppose 0s + k = 3s - 12, -5s = -5k - 20. Let h(i) = 5i2 + 5i + 8. Calculate the remainder when h(s) is divided by 47. 14 Let x(l) = l*2 + 11. Suppose -2j - t = -8 - 27, 13 = j + 5t. What is the remainder when j is divided by x(0)? 7 Let c(r) = -8r + 97. Let m be c(11). Suppose -381 = -ma + 51. What is the remainder when 92 is divided by a? 44 Let i be (1/(-1))/((-1)/5). Suppose -2c = is + 19, 3c - s = -0c - 20. Let k(z) = -z2 - 7z + 8. What is the remainder when 38 is divided by k(c)? 6 Let j(f) = 29f + 282. Calculate the remainder when j(-9) is divided by 6. 3 Let p = 9237 + -9172. Calculate the remainder when p is divided by 65. 0 Let y(c) = 5c - 31. Let z be y(7). Suppose -984 = -zt - 720. What is the remainder when 327 is divided by t? 63 Let i(u) = u2 + 10. Let d be i(0). Let x = 21 - d. Calculate the remainder when (-6 + 69/12)0 - (-41 + 2) is divided by x. 6 Let g be (-2 - -6 - 0/(-7)) + -2. Suppose -4j + 191 = -j + gn, -3j = -5n - 184. Calculate the remainder when j is divided by 22. 19 Let i = -551 + 261. Suppose w = -2k + 34, k - 3k - 38 = -2w. Calculate the remainder when (i/(-3))/(-5)(-72)/16 is divided by w. 15 Let g(p) = 2p + 43. Let h = -6562 + 6587. Calculate the remainder when h is divided by g(-17). 7 Let v(d) = -68d + 52. Let c be v(7). What is the remainder when 1/(-8) + (-71285)/c is divided by 17? 15 Let z = 77 - 17. Let d be (18/10)/(z/200). Suppose 0 = x + 4, dk + 2x = 4k + 90. What is the remainder when k is divided by 19? 11 Suppose 29d - 164 = 9d + 116. Suppose -45 - 3 = -3c. Calculate the remainder when c is divided by d. 2 Let y(a) = 46a - 1137. What is the remainder when 843 is divided by y(25)? 11 Suppose 1066 = 7y - 796. What is the remainder when y is divided by 68? 62 Suppose 0 = -4k + 2i - 15 + 57, -2i = k - 23. Suppose -10907 + 10675 = -2x. What is the remainder when x is divided by k? 12 Suppose -8v = 2d - 6d + 19388, -3v = -4*d + 19408. What is the remainder when d is divided by 1616? 7 Let f = 20 + 5. Calculate the remainder when f is divided by -10 + 9248/918 - 698/(-54). 12 Le	{ "pile_set_name": "DM Mathematics" }
i3 - 5. 4i*3 - 5 Collect the terms in 2x*3 + 7x*3 + 2x*3 + 8x*3. 19x*3 Collect the terms in 0d*2 + 0d*2 - 534d*3 - 783d*3. -1317d*3 Collect the terms in 34 + 31c - 9c + 23c - 32 - 12c. 33c + 2 Collect the terms in 2134 + x*3 - 2134 - 5x*3. -4x*3 Collect the terms in -13d - 10d - 11d + 24d + 9d. -d Collect the terms in -35w - 36w + 102w - 32w. -w Collect the terms in -4r - 7r + 0r + 0r. -11r Collect the terms in 326n*2 + 193n*2 - 125n*2. 394n*2 Collect the terms in 190f*3 + 5 - 184f*3 - 5. 6f*3 Collect the terms in 1600i*2 + 1601i*2 - 3202i2. -i2 Collect the terms in 11d - 8d + 0d + 6d + 8d. 17d Collect the terms in 5u3 - 3u*3 + 7u*3 - 7u*3. 2u*3 Collect the terms in 15k*2 + 2k*2 - 42k*2. -25k*2 Collect the terms in 886c*2 - 46c*2 + 1029c*2. 1869c*2 Collect the terms in 2067i*2 - 2067i*2 - 178i*3. -178i*3 Collect the terms in -68f*3 + 38f*3 + 35f*3. 5f*3 Collect the terms in -2r*2 + 76729r - 76729r. -2r2 Collect the terms in -b2 + 0b2 + 8b*2. 7b*2 Collect the terms in 5y*2 + 1 - 27y + 14y + 13y. 5y2 + 1 Collect the terms in 982 - s2 - 982. -s2 Collect the terms in -106 + 106 - 40s*3. -40s*3 Collect the terms in -4 + 9v*2 - 3 + 7 - 8v2. v2 Collect the terms in -32m3 - 4m*3 - 6m*3. -42m*3 Collect the terms in 4j - 1514 + 1514. 4j Collect the terms in 191a*2 - 191a*2 - 10a*3. -10a*3 Collect the terms in -m - 2m + 2m - 2m. -3m Collect the terms in -3213 - 37q*2 + 3213. -37q*2 Collect the terms in 69439m*2 - 3m*3 - 69439m*2. -3m*3 Collect the terms in 2 - 88m*3 + 42m*3 + 0 - 108m*3. -154m*3 + 2 Collect the terms in 30 + 97x*3 - 14 - 16. 97x*3 Collect the terms in -5 + 3 - 2 + 34k*2 - 37k*2. -3k*2 - 4 Collect the terms in -5r*2 - 9r*2 - 4r*2 - 12r*2 + 33r*2. 3r*2 Collect the terms in -21 + 2s*3 + 43 - 22. 2s*3 Collect the terms in -12o*2 + 837 - 423 - 414. -12o*2 Collect the terms in 17r*2 - 3r*2 - 14r*2 + 11r*3 + 2r*3. 13r*3 Collect the terms in -16q + 46q + 63q. 93q Collect the terms in -1 + 0 - 30d - d + 15d. -16d - 1 Collect the terms in 7c2 - 25c*2 + 2c + 12c2 - 2c. -6c2 Collect the terms in -276j + 134j + 136j. -6j Collect the terms in i3 - 2 + 4 - 2. i3 Collect the terms in 3999r*2 - 3999r*2 + 0 + 2r*3 + 0. 2r*3 Collect the terms in 7d + 6d + 0d. 13d Collect the terms in 2519 + r2 - 2519. r2 Collect the terms in -229 + 229 - d + 2d. d Collect the terms in 6 - 97 + b3 + 91. b3 Collect the terms in 2u - 3 + 3u - 3. 5u - 6 Collect the terms in 4c - 18c3 + 10c - 15c. -18c*3 - c Collect the terms in -2c3 - c3 - 11c3 + 27c*3 - 8c*3. 5c*3 Collect the terms in -51f*3 + 114f*3 - 60f*3. 3f*3 Collect the terms in 2u*3 + 10472u*2 - 10472u*2 + 6u*3. 8u*3 Collect the terms in 7h*2 - 259 - 18h*2 + 259. -11h*2 Collect the terms in 0s*3 + 10s*3 - 6s*3. 4s*3 Collect the terms in -3v - 8v + 12v. v Collect the terms in -232d + 467d + 2d2 - 235d. 2d2 Collect the terms in -3h*2 + 4h*2 - 2h2 - 747. -h2 - 747 Collect the terms in 2 - 2 + 0x + 4 - 6x. -6x + 4 Collect the terms in 1 + 4s - 5s + 15 + 4. -s + 20 Collect the terms in 160 - 2v - 323 + 163. -2v Collect the terms in -2677929 + f3 + 2677929. f3 Collect the terms in 23q - 2 - 40q - 51q. -68q - 2 Collect the terms in -2o + 1548 - 1548. -2o Collect the terms in 2j - 94 - 280 + 374. 2j Collect the terms in -131r - 4 + 4 + 132r. r Collect the terms in -3x*2 - 4x*2 - 9x*2. -16x*2 Collect the terms in -114c*2 + 133c*2 - 99c*2. -80c*2 Collect the terms in -2f2 + f2 - 873f - 4f*2 + 873f. -5f2 Collect the terms in 74q*3 - 54q + 241q3 + 54q. 315q3 Collect the terms in 145 - 5b - 145. -5b Collect the terms in -5149 - 2w*3 + 5149. -2w*3 Collect the terms in -2y - 2y + 0y. -4y Collect the terms in -t + 1794t*2 - 1776t*2 + t. 18t*2 Collect the terms in 0j - 4j - 5j - 2j. -11j Collect the terms in 2 - 19 + 17 + 3f2. 3f2 Collect the terms in -156 + 313 + l2 - 157. l*2 Collect the terms in -16r - 17r + 41r - 16r. -8r Collect the terms in 2z2 + 586 - 586. 2z*2 Collect the terms in 2t*2 + 3t2 - t2 - 7t2. -3t*2 Collect the terms in 469 + 3w - 469. 3w Collect the terms in -8v + 32v - 6v - 21v. -3v Collect the terms in -6r + 4r + 2r - 141r*3. -141r*3 Collect the terms in -q + 1022q*3 - q + 2q - 1018q3. 4q*3 Collect the terms in -19u*3 + 28u*3 + 37u*2 - 37u*2. 9u3 Collect the terms in 1 + h3 - 1 + 11h3. 12h*3 Collect the terms in -63 + 124 - 61 - 13a. -13a Collect the terms in 8n*3 + 17n*3 - 36n*3. -11n*3 Collect the terms in -4k*3 + 425k*2 + 3k*3 - 425k2. -k3 Collect the terms in -67p2 + 127p*2 - 61p2. -p2 Collect the terms in -69 + 69 + 5d. 5d Collect the terms in -4s2 + 17 - 17. -4s*2 Collect the terms in -3p + 508p2 + 3p - 510p2 + 0p. -2p2 Collect the terms in -161w*3 + 76w*3 + 84w3. -w3 Collect the terms in -2g2 + 5g*2 - 2g*2 - 3g*2. -2g*2 Collect the terms in 9s*2 + 12s + 6s - 14s. 9s2 + 4s Collect the terms in -33k2 + 99k*2 + 459k*2. 525k*2 Collect the terms in 16x*3 + 69x*3 - 13x*3. 72x*3 Collect the terms in 2m + 3m + 16m + 13m. 34m Collect the terms in 66591v - 33295v - 33302v. -6v Collect the terms in -17y2 - 12y*2 + 0 + 0. -29y*2 Collect the terms in -338 + 338 + 10j*3 - 9j3. j3 Collect the terms in 22g3 - 39g*3 + 8g*3. -9g*3 Collect the terms in -2b - 8b + 13b. 3b Collect the terms in -3o - 7o + 8o - 6o + 0o. -8o Collect the terms in 23f*3 + 3f + 20f2 - 44f*2 + 24f*2. 23f*3 + 3f Collect the terms in 336 + 2l2 - 336. 2l*2 Collect the terms in -20n*3 + 37n*3 + 12n2 + n2 - 21n3. -4n*3 + 13n*2 Collect the terms in 517t*2 + 10 - 138t*2 - 10. 379t*2 Collect the terms in -2o - 4 + 6 - 87o. -89o + 2 Collect the terms in -512r3 - 511r*3 + 1550r*3 - 526r3. r3 Collect the terms in -2y2 - 2y*2 - y + 10y + 3y2. -y2 + 9y Collect the terms in -11c + 10c + 7c + 8c + 7c. 21c Collect the terms in 2d2 + 13d*3 - 2d*2. 13d*3 Collect the terms in -10a - a + 0a - 8a. -19a Collect the terms in -19h*2 - 11h*2 + 29h2. -h2 Collect the terms in 63w3 - 144w*3 + 79w*3. -2w*3 Collect the terms in -3l*3 + 3l*3 + 2l*3. 2l*3 Collect the terms in 45m*2 + 28m*2 + 36m*2 + 38m*2. 147m*2 Collect the terms in 43j*2 + 2j*3 - 43j*2. 2j*3 Collect the terms in 3a*3 + 2a*3 + 2a3 - a3. 6a3 Collect the terms in 4 - 12j*2 + 4 - 8. -12j*2 Collect the terms in 307r + 4r2 - 307r. 4r2 Collect the terms in 6 - 15g + 13 - 19 + 2g2. 2g*2 - 15g Collect the terms in 17g - 26g + 11g + 7g*3. 7g*3 + 2g Collect the terms in 1 - 2 + 8c - 7. 8c - 8 Collect the terms in -d*2 + 11171d - 11171d + 0d2. -d2 Collect the terms in 242c - 494c + 257c. 5c Collect the terms in -3d + 11 + 23 - 27. -3d + 7 Collect the terms in 0a2 + 3a*2 + 3a*2 - 7a2. -a2 Collect the terms in 2497a - 2497a - 4a2 + 2a*2. -2a*2 Collect the terms in 30 + 3u*2 - 20 - 10. 3u*2 Collect the terms in 167z*2 + 154z*2 - 331z*2. -10z*2 Collect the terms in -4 + 57y*2 + 4 - 59y*2. -2y*2 Collect the terms in 6 - 5w*2 - 2 - 1 - 5w*2. -10w*2 + 3 Collect the terms in 59 - 49o - 59. -49o Collect the terms in 2 - 2 - 265w*2. -265w*2 Collect the terms in -5v*2 + 69 - 146 + 77. -5v*2 Collect the terms in -3801 + 3801 - 5v*3. -5v*3 Collect the terms in -14b*3 + 51b*3 - 15b*3 - 20b*3. 2b*3 Collect the terms in -3 + 15x - 1 + 6 - 4. 15x - 2 Collect the terms in 138p - 153p + 4p*2 + 15p. 4p2 Collect the terms in -46i + 677i + 2i2 - i2. i*2 + 631i Collect the terms in -51t + 23t + 19t. -9t Collect the terms in -24y2 + 52y*2 - 29y2. -y2 Collect the terms in -189r2 - 183r*2 - 187r*2 + 568r**2. 9	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.