Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
ided by 97. 94 What is the remainder when 24474 is divided by 480? 474 Calculate the remainder when 126548 is divided by 63273. 2 Calculate the remainder when 2935 is divided by 406. 93 Calculate the remainder when 7297 is divided by 571. 445 What is the remainder when 110668 is divided by 27645? 88 Calculate the remainder when 5842 is divided by 487. 485 What is the remainder when 3475 is divided by 928? 691 What is the remainder when 44667 is divided by 26? 25 What is the remainder when 22073 is divided by 118? 7 What is the remainder when 106843 is divided by 56? 51 Calculate the remainder when 5432 is divided by 151. 147 Calculate the remainder when 23762 is divided by 928. 562 What is the remainder when 402 is divided by 43? 15 Calculate the remainder when 3727 is divided by 1846. 35 Calculate the remainder when 2676 is divided by 2430. 246 Calculate the remainder when 355802 is divided by 66. 62 What is the remainder when 16201 is divided by 201? 121 Calculate the remainder when 628 is divided by 216. 196 Calculate the remainder when 14177 is divided by 78. 59 Calculate the remainder when 919901 is divided by 608. 605 Calculate the remainder when 10761 is divided by 2689. 5 What is the remainder when 3779 is divided by 635? 604 What is the remainder when 37233 is divided by 21? 0 What is the remainder when 9802 is divided by 9759? 43 What is the remainder when 16040 is divided by 117? 11 What is the remainder when 13418 is divided by 5? 3 Calculate the remainder when 85101 is divided by 12. 9 Calculate the remainder when 5472832 is divided by 31. 30 What is the remainder when 45046 is divided by 22456? 134 What is the remainder when 826243 is divided by 43? 41 What is the remainder when 186795 is divided by 65? 50 What is the remainder when 316 is divided by 39? 4 What is the remainder when 3428 is divided by 377? 35 What is the remainder when 44585 is divided by 22257? 71 What is the remainder when 1700482 is divided by 37? 36 What is the remainder when 414789 is divided by 128? 69 What is the remainder when 42544 is divided by 133? 117 Calculate the remainder when 26309 is divided by 195. 179 Calculate the remainder when 103484 is divided by 2874. 20 What is the remainder when 424237 is divided by 1274? 1269 Calculate the remainder when 4777 is divided by 2285. 207 What is the remainder when 4156 is divided by 66? 64 Calculate the remainder when 668076 is divided by 80. 76 What is the remainder when 647302 is divided by 215759? 25 Calculate the remainder when 1864 is divided by 37. 14 What is the remainder when 3535 is divided by 222? 205 Calculate the remainder when 287831 is divided by 47969. 17 Calculate the remainder when 170736 is divided by 232. 216 Calculate the remainder when 34719 is divided by 61. 10 Calculate the remainder when 10301 is divided by 224. 221 What is the remainder when 6715 is divided by 1020? 595 What is the remainder when 742253 is divided by 5? 3 What is the remainder when 8176 is divided by 3286? 1604 Calculate the remainder when 4399 is divided by 334. 57 What is the remainder when 406411 is divided by 135435? 106 Calculate the remainder when 184503 is divided by 601. 597 Calculate the remainder when 74513 is divided by 35. 33 Calculate the remainder when 9743 is divided by 1604. 119 Calculate the remainder when 692897 is divided by 346426. 45 What is the remainder when 275126 is divided by 54? 50 Calculate the remainder when 208027 is divided by 113. 107 Calculate the remainder when 859 is divided by 739. 120 What is the remainder when 698 is divided by 115? 8 What is the remainder when 9570 is divided by 1592? 18 What is the remainder when 2717 is divided by 663? 65 Calculate the remainder when 23408 is divided by 23407. 1 Calculate the remainder when 55650 is divided by 229. 3 Calculate the remainder when 534463 is divided by 107. 105 Calculate the remainder when 5496 is divided by 331. 200 Calculate the remainder when 1884 is divided by 89. 15 What is the remainder when 36027 is divided by 32? 27 What is the remainder when 1325093 is divided by 50? 43 What is the remainder when 735 is divided by 80? 15 What is the remainder when 18207 is divided by 791? 14 What is the remainder when 365253 is divided by 365245? 8 What is the remainder when 5219 is divided by 240? 179 What is the remainder when 71414 is divided by 8? 6 Calculate the remainder when 3318 is divided by 1450. 418 What is the remainder when 970 is divided by 455? 60 Calculate the remainder when 8407 is divided by 40. 7 What is the remainder when 223998 is divided by 9? 6 Calculate the remainder when 12080 is divided by 529. 442 What is the remainder when 4754 is divided by 316? 14 Calculate the remainder when 7497 is divided by 1070. 7 What is the remainder when 3911 is divided by 1284? 59 What is the remainder when 1782 is divided by 1230? 552 What is the remainder when 3666 is divided by 454? 34 Calculate the remainder when 48733 is divided by 156. 61 What is the remainder when 7769 is divided by 540? 209 Calculate the remainder when 792785 is divided by 273. 266 What is the remainder when 36827 is divided by 33? 32 Calculate the remainder when 1142 is divided by 168. 134 What is the remainder when 33747 is divided by 150? 147 What is the remainder when 2711135 is divided by 37? 34 Calculate the remainder when 88126 is divided by 13. 12 What is the remainder when 353 is divided by 227? 126 What is the remainder when 683 is divided by 119? 88 What is the remainder when 1621891 is divided by 39? 37 What is the remainder when 34683 is divided by 4333? 19 What is the remainder when 11574 is divided by 399? 3 Calculate the remainder when 10078 is divided by 459. 439 What is the remainder when 113845 is divided by 3? 1 Calculate the remainder when 512532 is divided by 251. 241 What is the remainder when 584941 is divided by 2276? 9 What is the remainder when 93917 is divided by 46952? 13 Calculate the remainder when 137520 is divided by 260. 240 What is the remainder when 7181 is divided by 1247? 946 Calculate the remainder when 9883 is divided by 1235. 3 Calculate the remainder when 153472 is divided by 17. 13 What is the remainder when 537912 is divided by 442? 440 What is the remainder when 4259 is divided by 4234? 25 What is the remainder when 487632 is divided by 19? 16 What is the remainder when 40174 is divided by 98? 92 Calculate the remainder when 1704 is divided by 1624. 80 Calculate the remainder when 44473 is divided by 8893. 8 Calculate the remainder when 9488 is divided by 85. 53 What is the remainder when 6900 is divided by 19? 3 Calculate the remainder when 9235 is divided by 287. 51 Calculate the remainder when 625713 is divided by 3346. 11 Calculate the remainder when 364357 is divided by 364357. 0 What is the remainder when 2171 is divided by 177? 47 What is the remainder when 1841 is divided by 160? 81 What is the remainder when 1896 is divided by 78? 24 Calculate the remainder when 3090 is divided by 2755. 335 Calculate the remainder when 9514 is divided by 3167. 13 Calculate the remainder when 109974 is divided by 10. 4 What is the remainder when 94239 is divided by 79? 71 Calculate the remainder when 7357 is divided by 64. 61 What is the remainder when 7339 is divided by 460? 439 What is the remainder when 370575 is divided by 14? 9 Calculate the remainder when 21109 is divided by 502. 25 What is the remainder when 650 is divided by 236? 178 Calculate the remainder when 10317 is divided by 266. 209 What is the remainder when 7747 is divided by 7741? 6 Calculate the remainder when 18478 is divided by 101. 96 What is the remainder when 15806 is divided by 63? 56 Calculate the remainder when 1137 is divided by 370. 27 Calculate the remainder when 12247 is divided by 139. 15 What is the remainder when 6460 is divided by 1418? 788 Calculate the remainder when 34425 is divided by 34382. 43 What is the remainder when 2710 is divided by 220? 70 Calculate the remainder when 7372 is divided by 14. 8 Calculate the remainder when 9198 is divided by 9121. 77 What is the remainder when 543915 is divided by 1292? 1275 What is the remainder when 20873 is divided by 68? 65 What is the remainder when 52178 is divided by 7447? 49 Calcul	{ "pile_set_name": "DM Mathematics" }
. Suppose 4l + n = -2j, -2l + 5j - 25563 = -l. Let a = l - 21457. Round a to the nearest ten thousand. -50000 Let w(j) = j*2 - 8j + 10. Let y be w(7). Suppose yr - 3k - 291 = 0, r = -2k + 24 + 79. Suppose 2f - r = 25. What is f rounded to the nearest ten? 60 Let q = 668 + -667.438. What is q rounded to one dp? 0.6 Let f = -18.08972536 + -0.91027754. Let g = f - -19. Round g to six dps. -0.000003 Let b = 0.31999896 + -0.32. Round b to 7 dps. -0.000001 Suppose -5l = -0l. Suppose -2k - 63058 = -5d + 21434, l = -d - 3k + 16912. Round d to the nearest one thousand. 17000 Let y = 0.1508 + -0.177. Round y to 3 dps. -0.026 Let j = -32273 + -18727. What is j rounded to the nearest ten thousand? -50000 Let h(n) = -1604n*3 + 5n*2 - 9n - 10. Let z be (-12 - 5)-1. Let w be h(z). What is w rounded to the nearest one hundred thousand? -600000 Let g(k) = 3k - 1. Let a be g(1). Suppose -4w - 5h + 3h - 292010 = 0, -ah = 10. Round w to the nearest 10000. -70000 Let a = 6 - 4. Let j(g) = 12g*3 + 2g*2 + 1. Let l be j(a). What is l rounded to the nearest ten? 110 Let v = -19 + -25. Let f = v + 43.963. What is f rounded to two decimal places? -0.04 Let d = -4.39886 + 4.4. What is d rounded to four dps? 0.0011 Suppose 0r - 15 = 3r. Let k be 0 + 70003 - (-2 - r). What is k rounded to the nearest one hundred thousand? 100000 Suppose 2m - 27 = 4a + 7m, 3m + 15 = -2a. Let s be 1452008/(-12) - 2/a. Round s to the nearest ten thousand. -120000 Let s = 67.0000022 - 67. What is s rounded to six dps? 0.000002 Let j = -274.23 - -273. Let q = -0.07 + j. Let d = -1.2999986 - q. What is d rounded to 6 dps? 0.000001 Let o = -1039.9078 - -1040. What is o rounded to 2 decimal places? 0.09 Let r(o) = -8o3 + o2 + 2o + 6. Let k be r(-4). Let x = k - -124. Round x to the nearest one hundred. 700 Suppose -3s = 4m + 23599997, 23599995 = m - 5m - 5s. What is m rounded to the nearest 1000000? -6000000 Let c = 128 - 133.1. Let a = c - -13.8. What is a rounded to 0 decimal places? 9 Let j = 190 - 185.48. Let h = j + 0.76. Let o = h - 5. What is o rounded to 1 decimal place? 0.3 Let t = -489288265 - -489288238.4999849. Let g = 26.5 + t. What is g rounded to 6 dps? -0.000015 Suppose -5a = -4x + 81, 2x - 2a = -4a + 36. Round x to the nearest ten. 20 Suppose 2a - 73 = 147. Let c(r) = -ar3 + 2r + r*2 + r - 2r. Let l be c(-1). What is l rounded to the nearest ten? 110 Suppose -2t - 560 + 90 = q, -4q + 2t - 1880 = 0. Round q to the nearest 100. -500 Suppose 22l - 14l + 27200 = 0. What is l rounded to the nearest 10000? 0 Let f(d) = 60001d + 7. Let x be f(-7). Let m be 1 - (x - (2 - 3)). Suppose 6w = w - m. Round w to the nearest 10000. -80000 Let d = 1.1 + -1.13. Let h = 692290.9700071 - 692291. Let z = d - h. Round z to six dps. -0.000007 Let b = -1.02 + 8.12. Let i = 7.10041 - b. What is i rounded to four decimal places? 0.0004 Let m = -35 + 35.00000003. What is m rounded to seven dps? 0 Let p = 4249.07018 + -4249. Let f = 0.8 - 0.87. Let t = p + f. Round t to four decimal places. 0.0002 Let n = 28 + -16.5. Let k = n + -10. Let y = k - 1.49993. What is y rounded to five decimal places? 0.00007 Let n = 7404977 + -4944736. Let f = 2460249.000006 - n. Let o = f + -8. Round o to 5 decimal places. 0.00001 Let z = -46.214335 - -44.7143. Let s = 0.5 - -1. Let o = s + z. What is o rounded to 5 decimal places? -0.00004 Let h = -0.03003 - 27.95997. Let t = -48.76 - h. Let l = t + 21. Round l to 1 decimal place. 0.2 Let b = -21 - -20.9977. What is b rounded to three dps? -0.002 Let d = -4 + 3.99997. What is d rounded to five decimal places? -0.00003 Let b = -12.29 + 10.8. What is b rounded to 1 decimal place? -1.5 Let d = 348 + -190. Let s = d - 158.00131. Round s to four dps. -0.0013 Let c = -5850 - -5894.0161. Let n = c - 44. Round n to three dps. 0.016 Let m(j) = 402j + 7. Let t be m(7). Let g = t - 1621. Round g to the nearest 100. 1200 Let v = 0.0777 + -0.084. What is v rounded to three decimal places? -0.006 Let n = -270.881 + 271. Round n to two decimal places. 0.12 Let z = 9099486 - 1199486. Round z to the nearest 1000000. 8000000 Let q be (-1953)/28 - (-6)/8. What is q rounded to the nearest 10? -70 Let a = -0.02 - -0.16. Let x = 0.140042 - a. Round x to 5 dps. 0.00004 Let y = 0.07 - -0.06. Let f = -0.1335 + y. Round f to three dps. -0.004 Suppose 2z - 4g = -2, -3z = -0z - 4g - 1. Suppose zv + 14600 = 5v. What is v rounded to the nearest one thousand? 7000 Let c(w) = w2 + w + 71000. Let d be c(0). What is d rounded to the nearest 10000? 70000 Suppose 0 = -6i + 2i - 672000. What is i rounded to the nearest ten thousand? -170000 Let w = 18.5 - 17. Let s = 1.62 - w. Round s to one decimal place. 0.1 Let b = 0.021783 - 0.421799. Let o = 2 + -2.4. Let v = o - b. Round v to 5 dps. 0.00002 Let c = 60.2 + -84.9. Round c to 0 dps. -25 Let j = 117348.9999936 - 117346. Let x = -0.14 - -3.14. Let l = j - x. What is l rounded to 6 dps? -0.000006 Let q(z) = -20z*2 + z + 5. Let k be 51/(-9) + (-2)/(-3). Let l be q(k). What is l rounded to the nearest one hundred? -500 Let v be (-1 + 1)2/4. Suppose d + 3 = -2i - 0d, 4d + 4 = v. What is i rounded to the nearest 10? 0 Let c = 0.7137 - 0.72. Round c to 3 decimal places. -0.006 Let j = -29 + 29.00000127. What is j rounded to 7 dps? 0.0000013 Let l be ((-1600000)/12)/(12/(-774)). What is l rounded to the nearest 1000000? 9000000 Let c(v) = -8v*3 - 7v*2 - 7. Let t = -6 - 0. Let l be c(t). Let z = l - 869. Round z to the nearest one thousand. 1000 Let w = 7 + -4. Let z = 3.0012 - w. Round z to three decimal places. 0.001 Let q = 2061152.9887 + -2061049. Let r = 104 - q. What is r rounded to three dps? 0.011 Let c = -8 - -8.15. Let l = c - 2.95. What is l rounded to the nearest integer? -3 Let u(y) = 15100000y. Let m be u(-1). Round m to the nearest 1000000. -15000000 Suppose 23 + 45 = 2k. Round k to the nearest 10. 30 Let j(h) = -h - 5. Let u be j(-5). Suppose -5o - 10 = -5y, -4y - 16 = 4o - uy. Let v(c) = -2300001c - 3. Let m be v(o). Round m to the nearest 1000000. 7000000 Let z = 67470304 + -67470259.000023. Let j = -42.6 + -2.4. Let k = j + z. Round k to five dps. -0.00002 Suppose 4o - 8000020 = 5z, 6o = 8o + 5z - 3999980. Round o to the nearest 1000000. 2000000 Suppose -3l - 34078942 - 7321058 = 0. What is l rounded to the nearest one million? -14000000 Let g = 50.68 - 71.89. Let t = g - -0.21. Let o = 12.7 + t. What is o rounded to zero decimal places? -8 Let o(s) = -3s + 10900000. Let z(y) = -7y + 21800000. Let h(p) = -9o(p) + 4z(p). Let r be h(0). Round r to the nearest one million. -11000000 Suppose -11 = -z + 1. Let n be (-3)/z - (-33)/(-12). Let y = n + 13. Round y to the nearest one hundred. 0 Let v = 12.8 - 1.8. Let q = 134937.000012 + -134926. Let g = v - q. What is g rounded to 5 dps? -0.00001 Let l = 4076.0085 + -4080. Let v = l - -4. What is v rounded to 3 dps? 0.009 Let p = -30.79 + 31. Round p to two dps. 0.21 Suppose -6 = -4l + 6. Suppose 2u - 1415 = lu - 5y, 3u + 4212 = 4y. What is u rounded to the nearest one thousand? -1000 Suppose 5o + 143836 = 2z, 0z - 5o = -4z + 287662. Suppose 66087 = f - z. Round f to the nearest 10000. 140000 Let m = 0.56 + 0.14. Let q = m - 0.71. Round q to 1 dp. 0 Suppose -4o - 16 = 0, 2i - 27934 = -4o + 32050. What is i rounded to the nearest one hundred thousand? 0 Suppose -n = d + 2d - 1099991, 4n = -2d + 4399994. Round n to the nearest one million. 1000000 Let p = 18976.824982 - 18997.825. Let q = -21 - p. Round q to 5 dps. 0.00002 Let d = -2023094699 - -2023101024.704431. Let c = d - 6376.70443159. Let l = c - -51. Round l to 7 decimal places. -0.0000006 Let l = 0.35 - 0.66. Let j = 0.42 - l. What is j rounded to 1 decimal place? 0.7 Let w = -1979.3835 - -0.3835. Let q = w - -1976.9936. Let c = -2 - q. What is c rounded to 3 decimal places? 0.006 Let v = -192 + 193.66. Let z = 1.66093 - v. Round z to four decimal places. 0.0009 Suppose 7320000 = -9w + 15w. What is w rounded to the nearest 100000? 1200000 Let f = 5826.2 - 5826.059866. Let u = f - 0.14. Round u to 5 decimal places. 0.00013 Let p(z) = -17z3 - 10z*2 - 8z + 3. Let x(n) = -3*n - 1. Let d be x(2). Let j be p(d). Round j to th	{ "pile_set_name": "DM Mathematics" }
mm. Give prob of picking 4 m. 3/476 Two letters picked without replacement from dddwwwdcdddqdd. Give prob of picking 2 w. 3/91 What is prob of picking 3 k and 1 w when four letters picked without replacement from wkkkww? 1/5 Four letters picked without replacement from zzzzbozozbzzczzzzokz. What is prob of picking 2 o, 1 k, and 1 b? 2/1615 Four letters picked without replacement from {l: 8, o: 5, z: 7}. Give prob of picking 3 o and 1 l. 16/969 Two letters picked without replacement from evoqr. What is prob of picking 1 r and 1 v? 1/10 What is prob of picking 3 m when three letters picked without replacement from {l: 3, m: 5}? 5/28 What is prob of picking 1 o, 1 f, and 1 z when three letters picked without replacement from {z: 7, f: 2, o: 2}? 28/165 Four letters picked without replacement from ttkkktkkkktkkk. What is prob of picking 4 k? 30/143 Calculate prob of picking 2 p and 1 z when three letters picked without replacement from {p: 2, h: 1, e: 1, l: 1, m: 1, z: 1}. 1/35 Calculate prob of picking 1 i, 2 o, and 1 z when four letters picked without replacement from poiookzooiqpp. 4/143 Calculate prob of picking 1 s, 1 v, and 1 d when three letters picked without replacement from vvsnzddvkvzn. 2/55 What is prob of picking 4 e when four letters picked without replacement from {e: 4, t: 3, n: 2}? 1/126 Four letters picked without replacement from {e: 3, k: 5, o: 1}. What is prob of picking 2 k, 1 o, and 1 e? 5/21 Four letters picked without replacement from {x: 5, k: 7}. What is prob of picking 4 k? 7/99 Four letters picked without replacement from mmmmmqqqqqmqm. What is prob of picking 2 m and 2 q? 63/143 Calculate prob of picking 3 r when three letters picked without replacement from ssssrrrrssrssrrsrsrr. 2/19 Calculate prob of picking 1 u, 1 a, and 1 x when three letters picked without replacement from {x: 2, w: 3, j: 7, u: 1, a: 4}. 1/85 Calculate prob of picking 1 r and 1 s when two letters picked without replacement from sssssrssssssssrsss. 32/153 What is prob of picking 1 i and 1 w when two letters picked without replacement from {t: 2, w: 1, i: 1}? 1/6 Calculate prob of picking 1 h and 1 a when two letters picked without replacement from sshas. 1/10 What is prob of picking 1 b and 1 f when two letters picked without replacement from fbfbbfffbfffff? 40/91 Calculate prob of picking 1 p, 1 k, and 1 m when three letters picked without replacement from {m: 2, t: 4, i: 2, x: 3, k: 1, p: 3}. 6/455 What is prob of picking 2 i when two letters picked without replacement from iuiuiiiiiiiiiiiuii? 35/51 Calculate prob of picking 1 v and 3 q when four letters picked without replacement from qqqqqvqqqvvqqqqqqqqq. 8/19 Four letters picked without replacement from {i: 4, q: 1, b: 1, e: 2, z: 1}. Give prob of picking 1 b and 3 q. 0 Three letters picked without replacement from {m: 5, z: 4, h: 1, y: 5}. What is prob of picking 1 z and 2 y? 8/91 Calculate prob of picking 1 m, 1 f, and 1 a when three letters picked without replacement from {f: 4, m: 1, k: 1, a: 2}. 1/7 Two letters picked without replacement from nwumowv. What is prob of picking 1 n and 1 v? 1/21 Four letters picked without replacement from pyyppyyy. What is prob of picking 4 y? 1/14 What is prob of picking 2 i, 1 j, and 1 n when four letters picked without replacement from {b: 1, n: 1, j: 3, l: 10, o: 1, i: 3}? 3/1292 Two letters picked without replacement from pmpfsfpfpmpppppsspi. What is prob of picking 1 i and 1 p? 10/171 What is prob of picking 2 k when two letters picked without replacement from {m: 1, c: 1, k: 3}? 3/10 Three letters picked without replacement from iiiuiui. Give prob of picking 1 u and 2 i. 4/7 Two letters picked without replacement from tsskklkusasslas. Give prob of picking 1 s and 1 u. 2/35 What is prob of picking 1 q, 1 c, and 1 g when three letters picked without replacement from qeqcqwgq? 1/14 Two letters picked without replacement from {w: 6, a: 2, t: 7}. What is prob of picking 1 w and 1 a? 4/35 What is prob of picking 3 l when three letters picked without replacement from {l: 7}? 1 Four letters picked without replacement from {u: 7, a: 2}. What is prob of picking 3 u and 1 a? 5/9 Calculate prob of picking 1 v and 2 g when three letters picked without replacement from gggvagvvgggggggagggg. 21/76 Three letters picked without replacement from {b: 1, x: 8, v: 4}. Give prob of picking 3 x. 28/143 What is prob of picking 1 j and 1 l when two letters picked without replacement from {o: 2, l: 4, h: 3, v: 1, t: 1, j: 7}? 28/153 Three letters picked without replacement from shhshss. Give prob of picking 1 h and 2 s. 18/35 Two letters picked without replacement from {g: 3, w: 1, z: 1, e: 1, f: 1}. What is prob of picking 2 g? 1/7 What is prob of picking 2 f and 1 s when three letters picked without replacement from {x: 6, f: 4, n: 2, s: 1, o: 4, i: 1}? 1/136 What is prob of picking 2 l when two letters picked without replacement from lllllcuululuusuu? 7/40 Three letters picked without replacement from cqxcvxfqfcxsfqqqx. What is prob of picking 1 x, 1 f, and 1 v? 3/170 Three letters picked without replacement from {i: 2, q: 2}. Give prob of picking 1 i and 2 q. 1/2 Two letters picked without replacement from oryhyhfo. What is prob of picking 1 h and 1 f? 1/14 Three letters picked without replacement from {a: 2, f: 4, y: 5}. Give prob of picking 2 f and 1 a. 4/55 Two letters picked without replacement from {s: 1, b: 2, d: 4, f: 2}. Give prob of picking 2 f. 1/36 Calculate prob of picking 1 w and 3 o when four letters picked without replacement from {a: 1, p: 1, o: 4, w: 5}. 2/33 Two letters picked without replacement from dqeqnuq. Give prob of picking 1 n and 1 u. 1/21 Two letters picked without replacement from qqmfp. What is prob of picking 1 m and 1 q? 1/5 Calculate prob of picking 2 z and 1 q when three letters picked without replacement from qqqzzz. 9/20 What is prob of picking 1 v and 1 n when two letters picked without replacement from {n: 1, d: 1, v: 2}? 1/3 What is prob of picking 1 w and 1 x when two letters picked without replacement from {k: 2, w: 1, x: 7}? 7/45 Four letters picked without replacement from gggg. Give prob of picking 4 g. 1 Two letters picked without replacement from {j: 1, v: 4, a: 4, l: 1, h: 1, i: 1}. Give prob of picking 1 v and 1 a. 8/33 What is prob of picking 3 v and 1 l when four letters picked without replacement from vclccclllllvlllv? 9/1820 What is prob of picking 2 u and 1 y when three letters picked without replacement from {u: 3, y: 8}? 8/55 Two letters picked without replacement from pvvpv. Give prob of picking 2 v. 3/10 Calculate prob of picking 4 c when four letters picked without replacement from vvvvvvcvvvvvvvvvvvvv. 0 Three letters picked without replacement from {j: 10, m: 2}. What is prob of picking 1 j and 2 m? 1/22 Two letters picked without replacement from llllllllll. What is prob of picking 2 l? 1 What is prob of picking 1 u and 1 p when two letters picked without replacement from xupuxouukk? 4/45 Four letters picked without replacement from uuosgojccuuocco. Give prob of picking 1 g, 1 c, and 2 o. 8/455 Three letters picked without replacement from {p: 3, s: 12}. Give prob of picking 3 s. 44/91 Two letters picked without replacement from rrgggrgggsgrgrgrrg. What is prob of picking 2 g? 5/17 Calculate prob of picking 2 u and 2 q when four letters picked without replacement from uuqququuuuquqquqqquu. 132/323 Four letters picked without replacement from {i: 2, c: 4, d: 2, m: 1, k: 1}. What is prob of picking 1 d, 2 c, and 1 k? 2/35 Calculate prob of picking 1 t and 1 h when two letters picked without replacement from htxiy. 1/10 Calculate prob of picking 1 b and 1 d when two letters picked without replacement from {l: 6, d: 2, f: 3, b: 1}. 1/33 Three letters picked without replacement from {f: 11, j: 5}. What is prob of picking 2 j and 1 f? 11/56 What is prob of picking 2 i when two letters picked without replacement from viiiiiiixiivrii? 11/21 Two letters picked without replacement from {y: 2, l: 7, o: 5, p: 1, c: 3, q: 2}. What is prob of picking 2 l? 21/190 Two letters picked without replacement from {y: 3, s: 2}. Give prob of picking 2 s. 1/10 Calculate prob of picking 1 x, 1 g, and 1 q when three letters picked wi	{ "pile_set_name": "DM Mathematics" }
p + 91 + 17 = -8t + 766p - 98, -4t + 100 = -2p for t. -4 Solve 3f + 6829726z + 36 = 6829722z, 2z - 7z + 1 = -2f for f. -8 Solve -4n + 7f = 26, -3n - 18f + 19f = -0n - 6n - 32 for n. -10 Solve -3j - 8y + 54 = -3y + 16, -151j = -254j + 4y + 1129 for j. 11 Solve 2 + 4 = -2u - 1 - 1, 95p + u = -4u + 1785 for p. 19 Solve 0 = 5d - 5h + 30, -273d = -272d - 7h + 54 for d. 2 Solve -15g = -100n - 17g - 204, 5n + 108 = n + 256g - 254g for n. -3 Solve 4g - 30x - 1 + 5 = -59x + 27x, -4x - 17 = -g for g. 1 Solve -1220t - 4b = -1217t - 16, -1 = 5t - 21b for t. 4 Solve 166 = 4q - 5n, -13q + 22q = 2n - 9 + 105 for q. 4 Solve -19 = -s - 0s - 4k, 9k + 14k = -2s + 25k + 8 for s. 7 Solve -5d = j + 99, 6j - 125040 = 4d - 124954 for j. 1 Solve -3o + 12 = -6294668i + 6294665i, -o + 5i + 36 = 0 for o. -4 Solve -12p - 62614a = -62615a - 596, -3p + 146 = -a for p. 50 Solve -10i + 2i + 22i + 3u - 69 = 0, -146 = -21i + 4u for i. 6 Solve 6153x - 2 = 6154x, 4y - 5x + 2x = 206 for y. 50 Solve 148 - 26 = -21p - 4y, -4p + 3303y - 3300y = 27 for p. -6 Solve -5r = -145, -18r + 46r + 178 = -4a + 16r + 18r for a. -1 Solve -1 = -174r + 175r, -5j = r + 5 + 1 for j. -1 Solve -68 = -2k - 4j, 3k + 35j - 374 - 163 = 0 for k. 4 Solve -243u + 3 = -240u, 36u - 34 = 2o + 2u for o. 0 Solve 0 = -j + 2m + 15, 6585j + 4m = 6590j - 51 for j. 7 Solve -5s - 8w - 219 = 81, -3s - 4w = -371 + 523 for s. -4 Solve -43n + 83n + c = 43n - 82, 0n - 5n + 4c + 125 = 0 for n. 29 Solve 2z = 5p - 42, 382z = 383z + 3p + 21 for z. -21 Solve -62427984k + 62427986k = 36i - 208, i = -5k + 26 for i. 6 Solve -h + 0h + 1 + 12 = -3s, 802h - 17650 = -7s + 5s for s. 3 Solve -7b = -29 + 50, -272b + 54 = 3a - 279b for a. 11 Solve 0 = 10d - 2t - 20, -68494 = -3d + 2t - 68488 for d. 2 Solve -283a = -280a - z - 24, a + 78 = 4a - 3z for a. -1 Solve 16 = -2x - 6h - 82, -504x + h = -501x - h + 169 for x. -55 Solve 3d + 4163369 = -15j + 4163147, 4j = -60 for d. 1 Solve -13f + 318 - 204 = 4t, -8t - 3f + 274 = 0 for t. 35 Solve 2j = 4g + 86, 2j - g - 7375 = -7361 for j. -5 Solve -5q - 4u = 32, -q = -136u + 137u + 9 - 0 for q. 4 Solve z = l - 11, 1484769 = -l - 5z + 1484744 for l. 5 Solve -535624u = -535622u + 2p - 4p - 20, 4u - 14p - 80 = 0 for u. 6 Solve 4z + 19a = 12a + 3a - 32, -5z + 6a - 29 = 0 for z. -7 Solve 18t + 5b - 12b = 23t - 23, -15 = -t - 4b for t. -1 Solve 133s = 135s - 4u - 6, s = -2u + 8 - 1 for s. 5 Solve 5s + 5h + 50 = 0, 1195h - 98 = -1196h + 2398h for s. 4 Solve -2y = -53n + 80, 0 = -y - 4828n + 4826n + 17 for y. 13 Solve 52n - 18n = 4z + 29n - 7, 6 - 8 = -2n for z. 3 Solve 5x = 20, 0 = -3g + 1018x - 1020x + 113 for g. 35 Solve -6n = 4p + 210, 101p + 35 = -n + 53p + 45p for n. -35 Solve 6214945p + 2k = 6214944p - 1, 2p = -5k - 3 for p. 1 Solve 0 = -4q - 38x - 2, 8q + q - 6x = 8q - 16 for q. -10 Solve 0 = -3g - c + 6, 273 = 6g - 4c + 243 for g. 3 Solve -4z = -16647b + 16651b - 52, -5z + 89 = -3b for z. 16 Solve 0 = 7r - 5t - 144, -5r + 558t - 560t - 10 = -124 for r. 22 Solve -12y - w - 254 = 0, 1056w = 2y + 1057w + 44 for y. -21 Solve -i + 5v = -15 + 52, 37v - 62 = 2i + 33v for i. -27 Solve -20f = 2o + 5335 - 5237, 4 = 4o for f. -5 Solve 33137t - 14 = 33134t + 2u, 0 = 16t - 6u - 56 for t. 2 Solve 4136w = -4r + 4135w - 38, 18 = r - w for r. -4 Solve -4l - r = -75 + 75, 17l = 2r + 25 for l. 1 Solve -7633g - 33 = -4b - 7634g, 3g = -2b + 109 for b. -1 Solve -2147f = -2149f + 3w - 100, f + 67 = 2w for f. 1 Solve 0 = -4b + 12, -18577a + 9285a = -9287a - 2b + 106 for a. -20 Solve -3g + 78 = 3v, -32v - 2821 = -3653 for g. 0 Solve -38697f + 6 = -38697f + 3k, -5f + 2k - 15 + 136 = 0 for f. 25 Solve 3h - 35v = -65, 2h = 3v + 3456 - 3479 for h. -10 Solve 4r + 40 = -2h, -59r = -50r - 13h - 85 for r. -5 Solve u - 5v - 48 + 13 = -0u - 3u - 39, -3u + 3v = 6 for u. -6 Solve 0 = 10h - 22h - 3h - 4v - 126, 2h + 28 = -v for h. -2 Solve -311089 = 4w - 12c - 311445, -5w = 3c + 77 for w. 2 Solve 41n + 4q - 291 = 0, 8n - 5n + 9 = 3q + 22 + 5 for n. 7 Solve v + 4z = -22 + 119, -2448z + 2450z = 5v + 21 for v. 5 Solve -11d + 0d - 72 = -2d - 11c + 9, -27 = 3d + c for d. -9 Solve -3x - 3k + 33 = 0, -28 + 112 = -0x + 2x + 3k + 55 for x. 4 Solve -360r + 355r = 15, -2b + 0r + 4r + 7 = -8b + 25 for b. 5 Solve -1 = -5r + a - 7, 172381r - 172386r = 3a + 62 for r. -4 Solve 2u - 2b - 4 = 0, -7b + 390 = u + 372 for u. 4 Solve 0 = -3l - 3, 0 = p - 2p + 3p + l + 126 - 133 for p. 4 Solve h + 4p + 44 = 0, -p = 2h - 0p + 607 - 596 for h. 0 Solve -3y = -38k + 74k - 38k + 31, -3k = -9y - 42 for k. 17 Solve 3d - 61 = -2h, -4d - 54 = 1550h - 1552h for d. 1 Solve 0 = -10y - 3y + 2267c - 2265c - 2 + 9, 3c + 51 = 21 for y. -1 Solve 786v - 4p = 793v - 28, -5p + 25 = 2v - 37 for v. -4 Solve -31317x + 8 = -c - 31319x, 4x + 30 = -3c for c. -14 Solve -701191h + 2r - 16 = -701195h, 18h - 5r - 100 = 0 for h. 5 Solve -3o - 77s + 22s - 9 = -58s, -25 = -5s for o. 2 Solve -s + 15 = v, -72 = 2095s - 2103s + 4v for s. 11 Solve 75 = o + 3b, 304o + 39b = 302o + 816 + 192 for o. -3 Solve 30491s - 30487s - 3j + 98 = 0, 3j - 26 - 60 = -2s for s. -2 Solve 0 = -5t + a + 25 - 0, -3t = -7564a + 7569a + 13 for t. 4 Solve 6 = -3h - 2m + 3, 6m = -3h - 39 for h. 5 Solve 0 = -3z + 27w + 204, -23z - 15z + 36z + 84 = -5w for z. 32 Solve 8z - 6z - 62 = 1995n - 1993n, 35 = z for n. 4 Solve -11d + 4 = -3g - g + 38, 11 = 3g - d for g. 3 Solve 3z + 90 = 9y, -4y + 5z + 96 = 24 + 21 for y. 9 Solve 16k - 9 = s + 18, 124k + 129k - s - 47 = 257k for k. -1 Solve -235r + 213r + f - 2f + 36 = -5f, -2r = 5f - 14 for r. 2 Solve -7282s + 4p + 132 = -7280s, -5s - 22 = -p + 2p for s. 2 Solve 7a - 2a + 3r - 126 = 0, 249a - r + 458 = 268a for a. 24 Solve 15n + 14 + 126 = 2s, -n - 7s = -5n - 393 for n. -2 Solve -5a + 1 = 7n, 0 = -62n + 40n + 3a - 53 for n. -2 Solve -227 + 127 = 4g - 3c - 139, 0 = 2c + 18 for g. 3 Solve 22b = 110, 609b - 303b - 308b - 110 = 4c for c. -30 Solve -w - n = 18, -5n = 12w - 6119 + 6314 for w. -15 Solve 4y = 32, y - 190 = -135p + 113 + 110 for p. 3 Solve 4u - 2c - 4 = -0c, 3u + 42 = 400c - 406c for u. -2 Solve -11f + 13f = 7c - 38c - 17c - 530, -3c + f - 32 = 0 for c. -11 Solve 5k = 3v - 47, 3k + 3v + 28 = -25v + 417 for k. -1 Solve 4g + 57 = 124 + 45, g = 5s + 53 for s. -5 Solve 0 = -z + 2r + 41, 127r = 84z - 85z - 2668 for z. -1 Solve l - 5t = -3l + 72, -3l + 5t + 2558101 = 2558027 for l. -2 Solve 0 = -q + 7y - 11, 0 = -9179q + 9177q - 5y - 3 for q. -4 Solve -63p + 58p + 17f + 143 = 0, 5p - 63 = -3f for p. 15 Solve 66t - 289p + 240 = -285p, -3t + 6 = -3p for t. -4 Solve -322d = -324d - 9f + 98, 54 = -6d + 2f for d. -5 Solve -122l - 123l + 4 + 2 = -246l, 257h - l = 1287 + 4 for h. 5 Solve 61p + 3m = -323, -434p - 3m - 3 = -437p for p. -5 Solve 13z - 5v - 14 + 64 = 0, -202z + 203z + 11 = -2v for z. -5 Solve 177r - 175r = 26, -28 = 49i - 18r + 206 for i. 0 Solve -18c + 174 + 3 = 3d - 156, -8 = 3d + 1 for c. 19 Solve -3y + 5c = 301 - 150 - 132, 2y + 3y - 2c - 23c + 115 = 0 for y. 2 Solve 6a - 14a = 5n + 59, -147a - 3n = -143a + 3n + 54 for a. -3 Solve -107s + 106s = 4, -4p + 2p - 7s + 29s = -86 for p. -1 Solve 4s = 6c + 170, -8c + 5c - 328 + 239 = -3s + 2s for c. -31 Solve -27a - 3535y + 3532y = -855, 4a - 5y = 143 for a. 32 Solve 8 + 29 = 2o - 5y - 10, -3o - 194 = 5y - 127 for o. -4 Solve 5l + 40 = 5a, -4l - 3a - 5465 = -5447 for l. -6 Solve 0 = 7i + 3x - 76, 53 - 7 = 3x - 2 for i. 4 Solve -4j + 3n = -57, -2n + 337 - 327 = 0 for j. 18 Solve 16g - 30 - 14 = -0a + 2a, 14g + 2a = -3g + 24 - 2 for g. 2 Solve -2h = 19m - 0h - 445, 3m + 12 - 6 = 4h + 59 for m. 23 Solve 16v + 321 = 5r + 17v, -26 = 12r + v - 361 - 434 for r. 64 Solve 0 = -3l - 5v + 6, -217l - 4v = -35l + 5l - 2v - 374 for l. 2 Solve -60 = 2t + 7s + 48,	{ "pile_set_name": "DM Mathematics" }
et h(v) = -v*2 - 4v - 1. Let b(p) = 4p2 + 17p + 5. Determine wh(q) + 2b(q). -q*2 - 2q + 1 Let a = 1 + -2. Let l(z) = 5z2 - 6z + 1. Let x(c) be the second derivative of c4/12 - c3/6 + 4c + 12. Determine al(r) + 4x(r). -r2 + 2r - 1 Let v(k) = -1. Let n(h) = h - 1. Suppose t + 5t + 6 = 0. Let g(d) = -d2 - 15d - 16. Let b be g(-12). Let l = b + -19. Determine ln(q) + tv(q). q Let i(m) = 4m + 1. Let n(v) = -13v - 3. Calculate -11i(q) - 4n(q). 8q + 1 Let u(b) = -3b2 - b + 2. Let l = 94 + -92. Let a(q) = q2 + q - 1. What is la(y) + u(y)? -y2 + y Let y = -64 - -67. Let n(w) = 11w*2 - 2w3 + wy - 10w2 + 1 - 2. Let o(b) = -10b*3 + 5b*2 - 5. Calculate -5n(h) + o(h). -5h3 Let r(d) = -5d*3 + 326d - 5. Let t(b) = 6b3 - 329b + 6. Give -5r(o) - 4t(o). o*3 - 314o + 1 Suppose 11 - 3 = 2t. Let q(l) = -l2 + 2. Let i(m) = m2 + m - 2. Give tq(c) + 3i(c). -c2 + 3c + 2 Let i(p) = -p. Suppose -5f + 1 = -3f + d, -11 = -2f - 3d. Let z = 2 + -7. Let s(u) = 2u. Calculate fs(h) + zi(h). h Suppose 3p + 10 = u + 25, -2u - 26 = -5p. Let c(f) = -7f2 + 5. Let m(o) = 4o*2 - 3. Determine uc(a) - 5m(a). a2 Let w(o) = o3 + o2 + o - 1. Let l(g) = 9g*3 + 4g*2 + 4g - 4. Let i = 227 + -231. What is iw(q) + l(q)? 5q*3 Let b(l) = -790l + 1 + 789l + 0. Let a(u) = -u2 + 5u - 6. Calculate a(k) + 6b(k). -k2 - k Let c(n) = 2n*3 + 3n*2 + 7n + 3. Let p(f) = f3 + f2 + f + 5. Let d(x) = -x3 - x2 - x - 4. Let y(b) = 4d(b) + 3p(b). What is c(i) + 3y(i)? -i3 + 4i Let y(b) = -114b + 3. Let g(h) = -115h + 5. Give 2g(z) - 3y(z). 112z + 1 Let f be -4 + (-1)/(-1) + -1. Let b(d) = -7d*2 - 4d. Suppose -4j = 6 - 14. Let w(t) = 6t*2 + 9t + 7tj + 2t*2. Give fw(v) - 9b(v). 3v*2 Let b(h) = -78h*3 + 10h. Let o(p) = 2263p3 - 292p. Calculate -146b(r) - 5o(r). 73r3 Let d(f) = 11f. Let j(k) = -6k. Suppose 5n = 5q - 0q, 3q - 12 = -3n. Calculate qd(t) + 5j(t). -8t Let n(q) = 4q*3 + 5q*2 + 5. Let v(f) = -2f*3 - 3f*2 - 3. Suppose -7t = -68t + 366. What is tn(b) + 10v(b)? 4b*3 Let c(l) = -117l*2. Let s(r) = 585r*2 - 1. What is -11c(q) - 2s(q)? 117q2 + 2 Let t(x) = -x2 + x. Let f = -4 + 14. Suppose 2n + s + 1 = -0n, 4n - 19 = 5s. Let o(w) = 2w3 + 10w*2 - 10w. Give ft(l) + no(l). 2l3 Suppose -15m + 5m + 32 = 92. Let j(y) = -y - 5. Let s(g) = 1. Let b be (3/6)/((-1)/2). Calculate bj(t) + ms(t). t - 1 Let g(q) = -22q - 76. Let k(u) = -10u - 39. Give 2g(z) - 5k(z). 6z + 43 Suppose -k + 13 = 3y, -y + 9 = k + y. Let d(p) = p3 - p2 - p - 1. Let u(n) = n3 - 2n*2 - 7n - 2. Determine ku(r) - 2d(r). -r*3 - 5r Let d(k) = -5k + 23. Let y(g) = -11g + 49. Let n(z) = -13d(z) + 6y(z). Let p(o) = 2o + 9. Calculate -5n(a) - 3p(a). -a - 2 Let v(n) = 13n*3 - 118n*2 - 5n - 2. Let q(k) = -2k3 + k + 1. Give 5q(r) + v(r). 3r3 - 118r*2 + 3 Let q(i) = 123i*3 + 3i*2 - 6i + 7. Let m(a) = 247a3 + 5a*2 - 10a + 12. Calculate -3m(h) + 5q(h). -126h3 - 1 Let w(n) = 7n + 64. Let j(v) = 22v + 192. Calculate 5j(m) - 16w(m). -2m - 64 Let v(t) = -31t3 - 9t*2 - 9t + 9. Let y(z) = 3z + 111. Let k be y(-34). Let l(w) = -8w*3 - 2w*2 - 2w + 2. What is kl(r) - 2v(r)? -10r3 Let w(x) = -5x - 6. Let r(q) = 2q + 2. Let c = 6 - 4. Suppose 5s + 52 = ci + 2, -i + 5 = 0. Let g = -695 - -692. What is gw(a) + sr(a)? -a + 2 Let o be (-3)/2(-10)/(-15). Let k(r) = -r + 1. Let g(h) = -2h3 - 5h*2 + 4h - 2. Calculate og(w) - 2k(w). 2w3 + 5w*2 - 2w Let h(i) = -23i - 6. Let a(m) = -6m + m - 3m - 2. Let z be (-2)/60/(-11). Suppose z = 8v - 6 + 54. What is vh(u) + 17a(u)? 2u + 2 Let s(r) = -3r3 + 2r*2 + r + 19. Let m(b) = -7b*3 + 5b*2 + 3b + 39. Determine -2m(z) + 5s(z). -z*3 - z + 17 Let k(i) = -i + 2. Let l(t) = -10t + 22. What is 18k(r) - 2l(r)? 2r - 8 Let l(s) = -s - 1. Let o = 8 - 5. Let q(k) = ok + 0k - 3k + 7 + 5k. Calculate 6l(v) + q(v). -v + 1 Let l(i) = 2i3 + 2i*2 + i - 1. Let x(t) = -8t*3 - 9t*2 - 21t + 3. Give -3l(w) - x(w). 2w*3 + 3w*2 + 18w Let h(a) = -5a3 - 4a*2 + 4a + 6. Let k(b) = -6b + 7b*2 + 1 - b - 5 + 9b*3 - 7. Calculate 7h(l) + 4k(l). l3 - 2 Let g(o) = -30o*3. Let y(d) = 1. Let t(u) = 2u*3 - 10. Let i(v) = -3t(v) - 30y(v). Let w(n) = 4n - 3. Let f be w(2). What is fg(k) - 24i(k)? -6k3 Let q(z) = 17z - 8. Let t = -25 - -23. Let s be (18/24)/((-2)/(-24)). Let h(i) = 4i - 2. Calculate sh(w) + tq(w). 2w - 2 Let l(r) = -r*2 - 1. Let n be (-7)/(-2) + 2/(-4). Suppose ni = -2i - 5. Let z = 21 - 16. Let d(p) = -p3 - 5p*2 - 5. Determine id(q) + zl(q). q3 Let x(u) = -4. Let m = -9 - -5. Let a(n) = -20n*3 - 17n*2 - 15. Let h(z) = 7z*3 + 6z*2 + 5. Let v(p) = 6a(p) + 17h(p). Calculate mv(b) + 5x(b). 4b3 Let c(b) = -b2 - 19b - 32. Let o be c(-17). Let m(j) = -1. Let r(q) = q + 4q + 3 + 1 - q*3 - 4q. What is om(t) + r(t)? -t3 + t + 2 Let x(y) = y. Let i(o) = -8o - 28. Determine -i(p) - 5x(p). 3p + 28 Let s be (-192)/168 - 2/(-14). Let u(y) = y*3 + y + 1. Let x(i) = 3i*3 - 2i - 1. What is su(w) + x(w)? 2w*3 - 3w - 2 Let a(x) = -4x3 + 2x2 + 5. Let d(z) = z3 - z - 1. Let j be 2/23 + 113/23. Determine jd(k) + a(k). k3 + 2k*2 - 5k Let t(s) = -s*2 - s. Let w(p) = 15p*2 + 7p + 2. Calculate -6t(z) - w(z). -9z2 - z - 2 Let v(s) = s2 - s + 6. Let m = 57 + -57. Suppose 0 = 2l + 3f + 11 - m, 3l + 2f = -14. Let t(q) = -q*2 + q - 5. Give lt(u) - 3v(u). u2 - u + 2 Let k(y) = y + 1. Let w(m) = -1. Suppose -3u = 55 - 70. Give uw(j) + 5k(j). 5j Let n be ((-39)/9)/((-2)/6). Suppose -n = 3c + 2. Let z(p) = p*3 + 4p. Let o(h) = -5h + 2h*3 - 4h3 + h3. Determine cz(g) - 4o(g). -g*3 Let l(v) = 8v. Let k(f) = -56f. Let u(o) be the third derivative of o4/8 + 14o*2. Let b(g) = -4k(g) - 77u(g). Calculate 7b(a) + 6l(a). -a Let y(m) = m2 + m - 1. Let h(c) = -c2 - 2c + 9. Let l(o) = -o*2 - 3o + 301. Let f be l(-19). Calculate fy(v) - h(v). -2v*2 - v - 6 Let j(z) = 7z - 13. Let a(t) = 20t - 38. Let f(r) = 6a(r) - 17j(r). Let c(d) = d - 6. Let g be c(6). Let w(l) = -4 + 2 + 1 + g. What is -3f(s) + 21w(s)? -3s Let w = 0 + 2. Let g(o) = -8o - 293 - 8o + 294 + 17o. Let t(m) = -1 + 3 - 3. Give wg(r) + 2t(r). 2r Let w(t) = 18t + 6. Let o(x) = -6x - 2. Let r(j) = 11o(j) + 4w(j). Let i(a) = 11a + 3. Suppose -5d + p + 15 = 31, 0 = p - 1. Determine di(h) + 5r(h). -3h + 1 Let v(h) be the first derivative of -11h*4/4 - 5h*3/3 + 231. Let p(l) = -11l*3 - 4l*2. Determine -5p(f) + 4v(f). 11f*3 Let m(a) = 44a*2 - 3. Let z(u) = -175u*2 + 13. What is -26m(l) - 6z(l)? -94l*2 Let b(n) = 5n + 14. Let c be b(-5). Let h(s) = -13s + 3s - 4s2 - 7s - 3s2. Let y(o) = -4o*2 - 9o. Determine cy(j) + 6h(j). 2j2 - 3j Let r(a) = -9a3 + 17a*2 - 17a - 23. Let j(p) be the second derivative of 3p5/20 - p4/2 + p3 + 4p*2 - 9p + 3. Determine -17j(t) - 6r(t). 3t3 + 2 Let y(f) = -8f*3 + 2f - 1. Let w be y(2). Let t = -62 - w. Let g(c) = c*2 - 4c - 5. Let n(r) = r*2 - r - 1. What is tg(v) + 4n(v)? 3v*2 + 1 Let m(c) = 29c + 48. Let u(n) = -15n - 25. What is -6m(a) - 11u(a)? -9a - 13 Let x(d) be the second derivative of -d4/12 + d3/6 - d*2/2 + d. Let c(y) = -6y*2 + 6y - 4. Suppose -17b - 3 = -71. What is bx(j) - c(j)? 2j2 - 2j Let f = 102 - 98. Suppose -2k + l - 6 = -k, 2k + fl = -42. Let g(c) = 8c*3 + 11c + 5. Let r(p) = 3p3 + 4p + 2. Give kr(w) + 4g(w). -w*3 - 2 Let u(t) = -5t - 2t + t2 + 0t*2 + 5t*2. Let w(k) = 2k*2 - 2k. Let q(z) = 155z + 779. Let m be q(-5). Give mu(b) - 14w(b). -4b*2 Let j(i) = 14i*2 - 14i + 14. Let l(y) = 5y2 - 5y + 5. Let b(o) = -6o + 32. Let m be b(6). Calculate mj(u) + 11l(u). -u2 + u - 1 Let j(n) = n3 + 1. Suppose 0 = -2u + 14 - 10. Let v(r) = -7 + 2ru + 8 + 4r*3 + 3. Let q be (-8)/6 + (-4)/6. Calculate qj(i) + v(i). 2i3 + 2i*2 + 2 Let x(k) = 988k*2 + 6k - 6. Let m(w) = 259843w2 + 1576w - 1576. Determine 3m(h) - 788x(h). 985h*2 Let l(r) = -4	{ "pile_set_name": "DM Mathematics" }
is the lowest common multiple of (-1)/(-2)f(-15)/5 and 18? 18 Let j(b) = -b*2 + 10b + 15. Let n be j(11). Calculate the least common multiple of (-30)/9(-6)/n and 13 + 1/(3/(-6)). 55 Let w = -28040 + 3701227/132. What is the common denominator of w and -93/44? 132 Suppose 3d - d + 110 = 0. Let p be (44/d)/((-2)/10). Suppose -2j + 0j + pw + 16 = 0, w = -2. Calculate the least common multiple of 6 and j. 12 Suppose -2a - 18 = -134. Let l = a - 52. What is the lowest common multiple of l and 3? 6 Let p be (-3)/(-2)168/(-9). What is the least common multiple of 1 and -4 + 4p/(-16)? 3 Suppose -s = 3v - 49, 0v + 5s - 37 = -2v. Calculate the smallest common multiple of 48 and v. 48 Let l(g) = 12g - 22. Let i(h) = h - 1. Let d(n) = 22i(n) - 2l(n). Calculate the lowest common multiple of 10 and d(6). 10 Let q be 4/127/(-12). Let d be (30/q)/(4/(-6)). What is the common denominator of -19/9 and ((-2)/(-16))/(d/(-348))? 90 Let h be (579/(-24) - -2)/(-6). Let t = h - 961/176. What is the common denominator of t and 83/36? 396 Let x(b) = 139b3 - 2b*2 - 3b + 4. What is the lowest common multiple of x(1) and 60? 1380 Suppose 0 = -x - 3u + 16, 4x + 5u - 42 - 1 = 0. Let z(k) = k3 - 7k*2 - 8. Let h be z(x). Find the common denominator of (-28)/126(-194)/h and 53/20. 180 Calculate the lowest common multiple of (60/(-36))/(5/(-6)) - -10 and 832. 2496 Let n = -207193/69810 + 3/2327. Calculate the common denominator of n and 7/60. 60 Let u(a) = 7a2 - a. Let x = 30 - 14. Calculate the least common multiple of u(-1) and x. 16 Let s(z) be the second derivative of -z5/20 + z4/12 + z3/3 + z. What is the smallest common multiple of 14 + 11/((-66)/12)-1 and s(-2)? 16 What is the common denominator of (47/48 + 6/(-18))4 and -1/10? 60 Let l be (-7 - -6) + (-81 - 2). Let a = -58 - l. Let j = -22 + a. Calculate the least common multiple of 10 and j. 20 Let r(t) = -t3 - 14t*2 - 5t + 29. Let q be r(-13). Let z = -124533/16328 - -4/2041. Find the common denominator of 380/q3/3-5 and z. 24 Let u = -6 + 10. Suppose -8h + 450 = -2h. Suppose -3w = 5g + 28 - h, 0 = w - 3g + 3. Calculate the least common multiple of w and u. 36 Let y(a) = -a3 - 3a*2 + 6a + 6. Let n be ((-2)/5)/((-2)/(-20)). Let p be y(n). Calculate the common denominator of p + -1 - (-180)/(-32) and 63/10. 40 What is the least common multiple of ((45/6)/(-5))/((-24)/704) and 4? 44 Let s = 39 + 11. What is the lowest common multiple of 45 and s? 450 Suppose 4p - 5r + 5037 = -8370, -3338 = p - 4r. Let x = p + 161173/48. Find the common denominator of x and 1/4. 48 Let r(h) = -64h - 308. Calculate the smallest common multiple of r(-5) and 26. 156 Suppose -5u + 15 = 5t, t = 4u - 3t + 28. Let o = 9 + u. Let g(b) = -b*3 + 8b*2 - 8b + 17. What is the lowest common multiple of 23 and g(o)? 230 Calculate the common denominator of 93/308 and (23080/(-2016) - -5) + (6 - -1). 2772 Let u(m) = 2m - 19. What is the smallest common multiple of u(15) and (3 + 10)1 + 4? 187 Suppose 155 = 21y - 286. Calculate the lowest common multiple of 18 and y. 126 What is the common denominator of -79/21 and (2/(-11) + 20/352)/(-7)? 168 Let z be 122/((-64)/410). Let b = -2853/20 - z. Calculate the common denominator of 32/54 + 1/(-1) and b. 270 Calculate the smallest common multiple of 59 and (42/(-84))/((-2)/12). 177 Let q(v) = 5v - v2 + 4 + 3v + 3 + 5. What is the least common multiple of q(6) and 20? 120 Let c(v) = 3v2. Let y be c(1). Suppose 3q = -2z + 14, 3z - 7 = 2q - yq. Calculate the least common multiple of 2 and q. 4 Suppose -4d + 26 = 4i - 14, 2i - 30 = -3d. What is the common denominator of (-5)/d + 126/10 and -109/22? 110 Let r(h) = -2h + 1. Suppose 0 = f + 4f + 2u - 58, 2u + 14 = f. Calculate the lowest common multiple of r(-4) and f((-6)/(-8))/1. 9 Let g = -746530483 + 5058490631567/6776. Let u = 3/1694 + g. Calculate the common denominator of u and (6/(-44))/(-3)27. 88 Suppose 5s = 3s + 114. Find the common denominator of (s - -16)(-2)/(-8) and 7/9. 36 Suppose -5x = -5g + 6 - 61, 3 = -3g. Suppose -5r + o = -316 + 79, 132 = 3r - 4o. Calculate the lowest common multiple of x and r. 240 Let f(v) = v3 - 5v*2 + v - 5. Let d be f(5). Suppose 12 = -di + i. What is the common denominator of 63/8 and (18/i)/((-1)/25)? 8 Let v(a) = -a*3 + 4a*2 + 3a - 5. Let s be v(5). Let z = 15 + s. What is the common denominator of 52/9 and z/2 - 27/(-6)? 18 Suppose 4m + 16 = 0, 4m = 2f + 6m - 2. What is the smallest common multiple of 23/3 + (-8)/12 and f? 35 What is the common denominator of 87/33 + 3/(-4) and -45/28? 308 Let q = -32 - -33. What is the common denominator of 310/48 - 6 - (-1 - q) and 23/6? 24 Calculate the common denominator of 41/78 and (655/(-360))/((-75)/9 + 8). 312 Let v = 1091/4 + -281. Find the common denominator of v and (-30)/954/8. 76 Suppose 5v = -54 + 79. Let c(x) = -x*3 + 10x*2 - 6x - 7. Suppose n = -2n + 27. What is the smallest common multiple of c(n) and v? 20 Let x = -132725/6582 - 2/1097. Find the common denominator of -53/3 and x. 6 Let w(o) = -5o + 4o - 2o - 2 + 5o. Let h be w(-3). Calculate the common denominator of 29/2 and 3 - (-20)/h - -42. 2 Suppose -56 = 8u - 16. Calculate the common denominator of (u - (-365)/75)59/2 and -37/6. 30 Suppose 5g - 4f = -927, 2f + f - 929 = 5g. Let d = g + 131. What is the smallest common multiple of 4 and (-5)/(-2)d/(-70)? 4 Let g = -264/5 + 452/15. Calculate the common denominator of g and 58/(-54)(5 + 1). 9 Let v = -6151/2 + 3077. Find the common denominator of v and 35/326. 326 Let g = 23 - 13. What is the common denominator of 6 + (3 - g) + 131/14 and 97/8? 56 Suppose -2j - 17 + 437 = 0. Calculate the smallest common multiple of (-3)/(-6) + j/12 and 20. 180 Let i(h) = 13h2 - 86h + 9. Calculate the lowest common multiple of 44 and i(7). 44 Let b = -281/90 + 128/9. Let t be (-1 - 3) + 3218/(-2). Let i = t + 4775/3. Calculate the common denominator of b and i. 30 Let w = 3494 - 21047/6. What is the common denominator of -89/1354 and w? 4062 Let o(y) = -y*2 - 6y + 25. What is the lowest common multiple of 4 and o(0)? 100 Let m(w) = -5w - 4. Let q be m(0). Find the common denominator of -43/10 and (-1)/((-105)/(-36))(-50)/q. 70 Let n be 10/(-40) - (-21)/4. Suppose 4l + nr - 27 = 0, 0 = 4l + 4r - 30 + 6. What is the least common multiple of l and 3? 3 Let u = -74 + 119. Calculate the lowest common multiple of 10 and ((-15)/u)/((-1)/18). 30 Suppose 0 = -j - 3j + 80. Calculate the lowest common multiple of (j - 1) + (-4)/1 and 3. 15 Let w = -90381/5 - -18198. Let q = w + -2361/20. What is the common denominator of q and 67/10? 20 Suppose -2 = -12c + 10. Suppose -3q - 4g + 27 = 0, q + c = 2g - 0. Calculate the least common multiple of q and 5. 5 Let p(l) = -56l + 9. What is the least common multiple of p(-1) and 143? 715 Suppose -249221 = 2n + 364383. Let v = n - -1217523/4. Let i = -2440 - v. Calculate the common denominator of i and -121/6. 12 What is the common denominator of (-4)/3(-76)/216 and 88/45? 405 Suppose -16i + 90 = -i. Calculate the lowest common multiple of i and 23. 138 Let c be ((-9)/6 - -1)40. Let o be (-1)/(-7) - c/7. Suppose 2x = -4b + x + 69, 5b - ox - 65 = 0. Calculate the smallest common multiple of b and 10. 80 Let t(w) = 66w + 870. What is the lowest common multiple of 975 and t(-13)? 3900 What is the common denominator of 1/4(-424)/(-188) and -25/12? 564 Let h(u) = u + 4. Let x be h(0). Suppose -q = xi + 161, 421 = -4q - i - 148. What is the common denominator of 2 + (q/(-42) - 2) and -89/16? 112 Calculate the common denominator of (-150)/192-4 + 2 and 53/22. 88 Find the common denominator of 113/24 and ((-5)/(-20))/(153/666). 408 Let a = -2116 + 8415/4. Find the common denominator of 121/6 and a. 12 Calculate the common denominator of 133/24 and (7/24)/((100/(-15))/(-10)). 48 Let l = -34 + -331. Let q = -33 - 9. Calculate the common denominator of -35/8 and (-1)/3 + l/q. 56 Let a(c) = c2 - 3c. Let u be a(4). Suppose -3h - 5k + 30 = 0, 0h + 10 = h - uk. Let t = -11 + 22. What is the smallest common multiple of h and t? 110 Let i = 7 - -7. Calculate the least common multiple of (-10)	{ "pile_set_name": "DM Mathematics" }
- 2r + r. Let i(p) = -2p - 2p + 2p. What is u(i(k))? -4k Let r(q) be the second derivative of 0q*2 + 0 + 2q - 1/3q3. Let f(t) = -t2. Calculate f(r(l)). -4l*2 Let o(k) = -3k*2. Let a(j) = -2j + 7. Let d(p) = 2p - 6. Let s(v) = 6a(v) + 7d(v). Calculate o(s(n)). -12n*2 Let a(w) = -354w*2. Let c(h) = 5h. Give a(c(j)). -8850j2 Suppose -5l - 5 = -0l, i - 63 = -l. Let a(y) = -3y - 64 + i. Let p(r) = -2r - 2r + 2r. Calculate a(p(w)). 6w Let d(k) = -7 + 9k + 4k - 4. Let x(p) be the second derivative of -7p3/6 + 3p*2 + p. Let o(z) = -6d(z) - 11x(z). Let m(u) = u2. What is m(o(l))? l2 Let y(m) be the third derivative of 10m*2 + 0m*4 + 0 + 0m*3 - 1/30m*5 + 0m. Let q(z) = 14z. Calculate q(y(b)). -28b*2 Let o(g) = -12g - 2g2 + 12g. Let d(t) = t*2 + 5t + 5. Let c(y) = y + 1. Let v(u) = 5c(u) - d(u). Calculate v(o(k)). -4k*4 Let b(n) = 14n*2. Let y(c) = -5c*2 - 3c. Calculate b(y(l)). 350l4 + 420l*3 + 126l*2 Let q(p) = -4p*2. Let w(h) = 5h + 4h - 7h. Give q(w(y)). -16y2 Let w(t) = -2t*2 + 4t. Let h(o) = -4o. Give h(w(m)). 8m*2 - 16m Let j(b) = -2b - 3. Let s(v) = 2v + 4. Let u(f) = -4j(f) - 3s(f). Let g(w) = -9w2. Determine g(u(r)). -36r*2 Let k(m) = -5m2. Let t(b) be the third derivative of b5/60 + 14b2. Determine k(t(f)). -5f*4 Let d(c) = -13c. Let u(b) = 5b - 4. Let h(l) = 6l - 5. Let x(m) = 4h(m) - 5u(m). Determine x(d(f)). 13f Let u(m) = -4827m - 1. Let f(l) = 3l. Give f(u(h)). -14481h - 3 Let r(p) = p*2. Let l(c) = 162c*2. Calculate l(r(z)). 162z*4 Let s(l) = 12l + 55. Let o(h) = 2h2. What is o(s(y))? 288y*2 + 2640y + 6050 Let v(h) = -118h. Let z(b) be the third derivative of -b4/12 + 20b*2. What is v(z(g))? 236g Let d(k) be the third derivative of -k*5/15 + 17k*2. Let u(m) = -2m. Determine u(d(t)). 8t2 Let r(q) = 34q. Let l(g) = 45g. Determine r(l(p)). 1530p Let f be (-17 + 9)(-6)/4. Let y(s) = -fs + 20s - 10s. Let q(r) = -2r. Determine y(q(o)). 4o Let g(y) = 890y + 2. Let j(z) = 3z*2. What is g(j(o))? 2670o*2 + 2 Let j(f) = 2f - 2. Let o = -31 + 20. Let g(p) = -10p + 11. Let i(u) = oj(u) - 2g(u). Let n(l) = l2. Calculate n(i(k)). 4k*2 Let u(i) = -4i*2 - 9i. Let b(m) = m*2 + 2m. Let x(h) = -9b(h) - 2u(h). Let a(g) = -4g. Let t(s) = 2s. Let q(c) = 6a(c) + 11t(c). Determine x(q(y)). -4y2 Let r(g) = 7g. Let n(s) = 16s. What is n(r(q))? 112q Let g(t) be the first derivative of t2/2 - 1. Let c(x) be the second derivative of -x3/6 + 18x. Calculate c(g(h)). -h Let u(c) = 4c*2 - 5c*2 - 3c*2 + 2c*2. Let q(h) = -13h + 5. Let j(b) = -7b + 3. Let g(y) = 5j(y) - 3q(y). Give u(g(o)). -32o*2 Let m(w) be the third derivative of 0w - 1/12w4 + 0 - w2 + 0w*3. Let r(n) = 20n + 0 + 0 - 23n. What is r(m(v))? 6v Let s(h) = -2h2. Let i(f) = 3f. Let p(d) be the third derivative of -d*4/24 - 6d*2. Let j(q) = -i(q) - 5p(q). Give s(j(t)). -8t2 Let q(i) = -16i*2. Let d(w) = 4w*2. Determine d(q(u)). 1024u4 Let a(w) be the third derivative of w4/4 - w*2. Let i(o) be the second derivative of -1/6o*3 + 0 + 0o*2 + 3o. Give a(i(n)). -6n Let u(v) = -7v*2 + 17. Let w(a) = 2a*2. Give w(u(x)). 98x*4 - 476x*2 + 578 Let z(v) = -2v*2. Let d(c) be the second derivative of -3c*3/2 - 16c. What is z(d(g))? -162g2 Let p(v) = 5v*2. Let x be (-8)/10(-20)/8. Let c(o) = o2 - ox - o*2. Calculate c(p(q)). -25q*4 Let j(g) = -31g*2 + 18g. Let f(q) = 7q2 - 4q. Let m(k) = -18f(k) - 4j(k). Let o(s) be the first derivative of -s*2 + 1. What is m(o(l))? -8l*2 Let u(w) = -76w*2. Let l(h) = -2h. What is l(u(z))? 152z2 Let y(j) = 79j*2. Let t(c) = -2c*2. Give t(y(h)). -12482h4 Let f(i) = -i2 - 2i + 2i. Let t(x) be the first derivative of -x*3/6 - 2x - 1. Let z(a) be the first derivative of t(a). What is f(z(m))? -m2 Let d(t) = t2 + 1. Let o be (-9)/(-6)(-2)/3. Let x be d(o). Let l(h) = -hx - h2 + h2. Let g(q) = -2q*2. Determine g(l(n)). -2n*4 Let w(x) = 57x. Let j(k) = 2k2. Determine w(j(n)). 114n*2 Let p(o) = -10o. Let k(x) = 3x2 + 23x + 22x - 45x. What is p(k(j))? -30j2 Let b(u) = 5u - 12 + 12. Let f(j) = -j*2. Determine f(b(m)). -25m*2 Let b(v) = -3v. Let w(t) = -2 - t + 2. Calculate b(w(j)). 3j Let r(j) be the third derivative of 0j*3 - 1/24j*4 + 0j + 0 - 5j2. Let s(z) = -3z*2. Calculate r(s(p)). 3p*2 Let j(t) = -3t. Let x(n) = 4n2 - 3. Let z(h) be the second derivative of -h4/4 + h2 - 2h. Let p(v) = 2x(v) + 3z(v). Calculate j(p(y)). 3y2 Let o(m) = -2005m2. Let c(r) = r2. Determine c(o(q)). 4020025q4 Let c(w) = 15w - 5. Let j(k) = k - 1. Let v(f) = -c(f) + 5j(f). Let s(o) = 2o*2 + 2o*2 + 7o*2 - 10o*2. What is v(s(l))? -10l*2 Let g(d) = -2d*2 + 51. Let k(z) = 2z. What is k(g(s))? -4s2 + 102 Let z(f) = f. Let u(o) = o + 103 - 103. What is z(u(k))? k Let r(h) = -17h + 6h + 11h - 6h2. Let b(u) be the first derivative of -2u*3/3 - 1. Give b(r(n)). -72n*4 Let b(n) = 2n. Suppose -2v + 1 - 9 = 0. Let s be (-28)/v + 1 + -3. Let a(r) = r + 3r - sr. What is a(b(g))? -2g Suppose 4v - 58 = -2g, -3v + 41 = 4g + 5. Let f(i) = -vi - 12i + 19i. Let p(a) = 2a. Calculate f(p(w)). -18w Let u = 12 - 8. Suppose -3o - w = -12, uo - 8 = 2o - 2w. Let v(b) = 2b + b - ob. Let f(c) = 4c*2. Calculate v(f(r)). -4r*2 Let q(m) = 9m. Let b(k) = -11k. Calculate q(b(t)). -99t Let h(d) = 11d + 8d - 18d. Let w be 3(11/3)/1. Let p(a) = -4a + 6a - wa. Give p(h(f)). -9f Let u(o) = -5o2. Let x(t) be the third derivative of 11t*5/60 - 8t*2. Calculate x(u(i)). 275i*4 Let y(v) = 156v*2. Let q(p) = 4p*2. Calculate q(y(i)). 97344i*4 Let r(j) be the third derivative of -5j4/24 + j2. Let g(a) be the third derivative of -a*5/60 + 16a*2. Determine g(r(o)). -25o*2 Let o(s) = -2s2. Let h(z) = -4. Let j(c) = -c2 - 7. Let p(t) = -7h(t) + 4j(t). Give p(o(q)). -16q4 Let j(m) be the first derivative of m3 - 1. Let i(x) = -2x. Determine i(j(c)). -6c2 Let y(j) = 11j + 4. Let l(x) = -10x - 3. Let m(v) = 4l(v) + 3y(v). Let q(o) = 8o. What is m(q(f))? -56f Let d(h) = -h. Let n(b) = -4b - 5. What is d(n(q))? 4q + 5 Let f(b) = 1 + 205b*2 - 203b*2 - 1. Let i(j) = -2j*2 - 11. What is i(f(h))? -8h*4 - 11 Suppose 2t + 12 = -0t + 4y, 25 = 5y. Let i = -2 + t. Let x(j) = ji - j2 - j2. Let w(l) = -3l. Calculate x(w(d)). -9d2 Let g(v) = 12v*2. Let w(u) = -25u*2. What is w(g(z))? -3600z*4 Let w(c) = -2c*2. Let b(i) = -i + 97. Determine b(w(a)). 2a*2 + 97 Let a(t) = t - 2. Let k be a(4). Let s(h) = 4 - 2h*k - 4 + 4h*2. Let x(n) = -6n*2. Determine s(x(b)). 72b*4 Let q(h) = 2h*2 + h - 5h*2 - h. Let f(u) = 5u - 3. Let a(d) = 9d - 5. Let w(x) = -3a(x) + 5f(x). What is q(w(m))? -12m2 Let x(f) be the second derivative of f6/360 + f*4/12 - 2f. Let k(i) be the third derivative of x(i). Let r(s) = 2s. Determine k(r(t)). 4t Let c(v) = -v*3 + 7v*2 + 8v + 6. Let k(i) = i*2 + 14i + 8. Let d be k(-14). Let p be c(d). Let q(b) = -6 + b + p. Let u(x) = -x. What is u(q(w))? -w Let a(b) be the second derivative of -b*4/3 - 19b. Let z(i) = 12i. What is a(z(u))? -576u*2 Let q(s) = 0s*2 + 0s2 - s2 - 8s2. Let m(k) = 2k - 3. Let o(p) = -2p + 4. Let r(n) = 4m(n) + 3o(n). Give q(r(b)). -36b2 Let l(w) be the second derivative of -w5/60 - 5w2/2 + 4w. Let k(m) be the first derivative of l(m). Let r(u) = 3u2. Give r(k(v)). 3v*4 Let r(p) be the first derivative of 3p2/2 - 17. Let l(x) be the third derivative of -x4/8 + 2x2. Determine l(r(k)). -9k Let o(s) = -5s2 + 31. Let t(r) = 3r*2 - 32. Let b(q) = -2o(q) - 3t(q). Let f(m) = -2m. Calculate b(f(c)). 4c2 + 34 Let k(j) = 162j. Let s(m) = 3m2. What is s(k(x))? 78732x*2 Let d = -4 + 10. Let t(l) = -d + 3l + 6 + 0. Let i(z) be the third derivative of z4/12 - z2. Calculate i(t(r)). 6r Let o(w) = -w. Let l(s) = 3847s. Determine o(l(c)). -3847c Let q(d) = -128d*2 + 2d + 2. Let b(w) = -w. Give b(q(v)). 128v2 - 2v - 2 Let p(o) = 3o - 5o + 3 - 2*o. Let v	{ "pile_set_name": "DM Mathematics" }
ime factors of f. 2, 7 Suppose 2c = -4a - 6, 0 = -3a - 2a + 3c - 2. Let b be -1 + 0 - (a + 1). List the prime factors of (-15)/(-2 - -5)b. 5 Let n = 232 + -163. What are the prime factors of n? 3, 23 Suppose -3o = 0, 4p + 2o = 3o. Suppose -f + 3f - 10 = p. List the prime factors of f. 5 Suppose -2h = -4v + 20, 2v + 3h + 10 = -h. Let q = v - -3. Suppose 0 = 3j - 4j + q. List the prime factors of j. 2, 3 Suppose 4v + 4 = -2w - 12, 0 = -w + v + 4. Let i be w/(2(-1)/2). Suppose i = j - 0j - 5. What are the prime factors of j? 5 Let d = 64 + -59. Let z be ((-2)/(-3))/((-4)/(-30)). Suppose -dm + zl + 5 = 0, 5m + 4l + l - 45 = 0. List the prime factors of m. 5 Let w = 0 + 3. Suppose -l + 9 + 12 = 2s, -4l - 26 = -ws. List the prime factors of s. 2, 5 Let m(z) = -z + 14. What are the prime factors of m(6)? 2 Suppose 0v + 3 = -3v + 3g, 0 = v - 4g + 16. Suppose -20 = -r + v. List the prime factors of r. 2, 3 Suppose -391 = 5i - 1391. List the prime factors of i. 2, 5 Let u be (-1 - -4)/3 + 0. Let l = u + 21. List the prime factors of l. 2, 11 List the prime factors of (-3 - (4 + 10))-1. 17 Suppose 0 = 2k - 3k, -2k = 2q + 2. List the prime factors of 50/3 - q/3. 17 Suppose -9 = -5d + 46. What are the prime factors of 0/2 + -3 + d? 2 Let i(x) = -x3 + 2x + 13. List the prime factors of i(0). 13 Let g(u) = u*2 - 9u + 2. Let r be g(9). Let l = r + 4. List the prime factors of l. 2, 3 Let s = -11 - -25. Let x(o) = -3o2 - 11 + 5o*2 + 4o + 0o2 + s. List the prime factors of x(-3). 3 Let r(p) = -3p3 + 8 + p3 - 5p2 + 7p + p*3. What are the prime factors of r(-6)? 2 Let j = -15 + 25. Suppose 40 = -5u - y, 3u - 4y + 24 = -y. Let x = j - u. What are the prime factors of x? 2, 3 Let y(z) = 5z2 + 2z + 3. What are the prime factors of y(-2)? 19 Suppose -d = 2d - 5x - 117, d + 5x - 39 = 0. List the prime factors of d. 3, 13 Let c(u) = 3u*3 - 2u*2 + u. Let g be c(1). Suppose 0o = go - 4. List the prime factors of (2 + -4)(-1 - o). 2, 3 Suppose 0j + 20 = 4j. Let t(p) = p*3 - 9p2 - 2. Let x be t(9). Let s = x + j. What are the prime factors of s? 3 Let s(c) = c + 1. Let k(x) = -x3 + x - 1. Let m be k(-2). Let r be s(m). Suppose 3v = -3t - r, 2v = -t + 2 - 8. List the prime factors of t. 2 Let a(o) = 4o - 2. List the prime factors of a(4). 2, 7 Suppose -3s + 3r + 21 = 0, -r = s - 3s + 18. What are the prime factors of s? 11 Let t(g) = g3 + 15g*2 + 18g - 8. What are the prime factors of t(-8)? 2, 37 Let m(q) be the third derivative of 1/2q3 - 5/24q*4 + 0 + 7/60q*5 - 1/120q*6 + 2q*2 + 0q. What are the prime factors of m(6)? 3 Let t(i) = 5i2 + i + 2. Suppose -p - 1 = -3. Let u be t(p). Suppose -u = -4r + r. List the prime factors of r. 2 Let o = 7 - 4. Suppose 124 - 46 = oh. What are the prime factors of h? 2, 13 Let j(h) = -h3 - 9h*2 + 10h - 8. Let w be j(-10). Let f(r) = -r*3 - 8r*2 - 5r - 7. What are the prime factors of f(w)? 3, 11 List the prime factors of 2((-1425)/10)/(-5). 3, 19 Let o = -1 + 4. Suppose 3d - 2d = 2g - 15, -4d = -4g + 28. Suppose -2l - 3w = -10, -2l + g = -w + ow. List the prime factors of l. 2 Let u(n) = n*3 + 2n*2. Let r be u(-2). Suppose rd = -d + 3. Suppose 0t + dt = 5w + 5, w + 4t = 22. What are the prime factors of w? 2 Suppose -4u - 89 = f, -2f - 3f + 2u = 335. Let r be 2/(-3) - f/9. Suppose -c = -x + 2c + r, -x + 13 = 3c. What are the prime factors of x? 2, 5 Suppose 4g + 4 = m, 0 = -4g + 6g. Suppose 5r = 5s + 100, -3r - 2r + 105 = -ms. Let o = r - 17. List the prime factors of o. 2 Suppose -8f + 3f + 80 = 2q, 52 = 4f + 4q. Let r = f - 15. List the prime factors of r. 3 Let h = -117 - -169. What are the prime factors of h? 2, 13 Let o(q) = -q + 1. Let j be o(-10). Suppose 43 = -5p + 2i, i = -2p + 3i - 22. Let t = j + p. What are the prime factors of t? 2 Suppose -l = 7l - 48. List the prime factors of l. 2, 3 Suppose 3d = -5 + 35. Suppose 8 = -5b + 4v, -5v = 5b - 2b - d. Suppose -i + 2i - 6 = b. What are the prime factors of i? 2, 3 Let f(m) = -m2 - 3m - 3. Let i be f(-2). Let j = 1 + i. Let d(a) = a*3 + 9. What are the prime factors of d(j)? 3 Suppose 0 = -2g + 7g - 15. Let j(n) = 6n + 20. Let y(i) = 4i + 13. Let w(v) = -5j(v) + 8y(v). What are the prime factors of w(g)? 2, 5 Let r(g) = g2 + 3g - 1. Let q be (-6)/21 - 86/(-7). Let d = 7 - q. List the prime factors of r(d). 3 Suppose 4j = -20, 55 + 75 = 5k - 2j. Suppose 3y - k = -2o + y, -2y - 9 = -o. List the prime factors of o. 11 Let j = 14 + 40. Suppose 2p = 2, -2g + j = -4p + 18. What are the prime factors of g? 2, 5 List the prime factors of 30((-14)/(-6) + -2). 2, 5 Let t = 1 + 31. Suppose 2w + 2w - t = 0. Suppose -y = -4y - z + 13, -z - w = -4y. What are the prime factors of y? 3 What are the prime factors of (324/8)/(-9)(-6)/1? 3 Let z = -9 + 38. What are the prime factors of z? 29 Suppose -6d + o + 13 = -d, -3d - 3o = -15. Suppose 0 = dp - 5x - 52, -25 = -2p + 4x + 11. What are the prime factors of p? 2, 7 Suppose 0 = -0l - 3l. Suppose lb - b = -3. What are the prime factors of b? 3 Let p = 10 + -5. Suppose -po - 20 = 0, 5r = -2o + 7 + 5. What are the prime factors of r? 2 Suppose i = 2i. Let f = -5 + 9. Suppose 2z - fr - 5 - 3 = i, r = 2z - 5. List the prime factors of z. 2 Suppose 3p + 5 - 11 = 0. Suppose pl - 24 = -l. List the prime factors of l. 2 Let o = -86 + 169. What are the prime factors of o? 83 Suppose -4h + 137 = 4b - 275, 4h = -b + 97. What are the prime factors of b? 3, 5, 7 Let t(o) = 7o*2 + 7o - 11. List the prime factors of t(-6). 199 Let y(d) = -d + 3. Let n(j) = -j - 4. Let r be n(4). What are the prime factors of y(r)? 11 Let s(r) = -r*2 + 7r - 2. Let o be s(6). Suppose -16 = -w + f, -of = 1 + 7. What are the prime factors of w? 2, 7 Let u(l) = l3 - 2l*2 + 7l - 8. What are the prime factors of u(6)? 2, 89 What are the prime factors of -19(-2 - (-5 - -4))? 19 Suppose z - 2n + 194 = 0, 0 = -3n - 2 - 1. What are the prime factors of z/(-35) - 4/(-10)? 2, 3 Let f(t) = -2t*3 - 2t2 - 2. Let l be f(-2). Suppose -6 = -p + l. List the prime factors of p. 2, 3 Let a(g) = g3 + 8g2 + 7g. What are the prime factors of a(-5)? 2, 5 Let q = -45 - -183. What are the prime factors of q? 2, 3, 23 Suppose 0 = -11v + 8v + 558. What are the prime factors of v? 2, 3, 31 Let p(g) = g*2 + 7g + 8. Let t be p(-7). Suppose -i = 2q - 19, tq - 57 = -3i + 3q. What are the prime factors of i? 19 Let a = 5 + 5. Suppose 3x + 3o = 6o + 6, -5x - 3o = -26. Suppose xn + a = 46. List the prime factors of n. 3 Let a = 65 + -35. What are the prime factors of a? 2, 3, 5 Let m be ((-2)/(-10))/((-3)/(-15)). Let p = 0 - m. What are the prime factors of -2(p + 1-3)? 2 Suppose 5i + 3 = b + 28, -2b = 4i - 6. Let d = 8 + b. What are the prime factors of d? 3 Suppose -3c + 94 = 5y - 148, -3y = 5c - 158. Let v = -33 + y. What are the prime factors of v? 13 Suppose 95 = 5b - 0g - 5g, -5b = -g - 95. List the prime factors of b. 19 Suppose 10 = -4h + 3h. Let t = 27 + h. List the prime factors of t. 17 Suppose -v = -6v + 10. Suppose 2 = -vn - 2k, 6n - 3n + 17 = 4k. Let g = 8 + n. What are the prime factors of g? 5 Suppose 2n = -4a + 92, a + a + 3n = 54. Suppose -a = -2g - g. What are the prime factors of g? 7 Suppose -1 + 3 = -v. Let b = 7 + v. Suppose -55 = -5w + bk, -3k + 1 = 13. What are the prime factors of w? 7 Suppose -3k = 3a - 270, 2k = -a - 2a + 178. List the prime factors of k. 2, 23 Suppose -59 = -5s + 201. Suppose s = 2j + 2j. What are the prime factors of j? 13 Let x(t) = -t3 - 6t*2 - 2t + 2. Let h be x(-6). Let a = 0 + h. List the prime factors of a. 2, 7 Let m(p) = 18p2 - 6p - 1. What are the prime factors of m(3)? 11, 13 Let g = 206 - 121. List the prime factors of g. 5, 17 Suppose -1 = 5l - 16. Suppose -5n + ln + 28 = 0. Suppose -3q + 10 = -4y - 0, -4q + 5y + n = 0. What are the prime factors of q? 2, 3 Suppose 3l = -2 + 14. Let i = 8 - l. List the prime factors of i. 2 Let m = -32 + 114. What are the prime factors of m? 2, 41 Let v be (-34)/(-10) - (-4)/(-10). Let m = v + -3. Suppose -3*a	{ "pile_set_name": "DM Mathematics" }
first derivative of x(t) wrt t. 3 Let z be 3 - 1 - (1 + -2). What is the first derivative of cz + 0 - 4 + c3 wrt c? 6c2 Let b be ((-1)/5 + -1)-5. Let w(a) = 7a4 + 6a*2 + 5. Let n(k) = 8k*4 + 7k*2 + 6. Let q(s) = bn(s) - 7w(s). What is the derivative of q(j) wrt j? -4j*3 What is the second derivative of 6g + 6g + 36g*3 + 11g*4 - 36g*3 wrt g? 132g*2 Let q(d) be the third derivative of 0d*3 + 1/12d*4 + 0d + 1/30d5 - 2d*2 + 0. Find the second derivative of q(y) wrt y. 4 Find the third derivative of -4d*2 + 5d*2 - 14d*5 - 7d*5 wrt d. -1260d2 Let c(v) = v3 - 4v2 - 6v + 7. Let o be c(5). Find the second derivative of 5b3 + ob + 0b3 - 5b*3 + 2b*4 wrt b. 24b*2 Find the second derivative of 33 - 33 - 17g - 15g3 wrt g. -90g Let c(r) be the first derivative of -r9/72 + r5/12 + 3r2 - 7. Let s(l) be the second derivative of c(l). What is the third derivative of s(t) wrt t? -840t*3 Let a(k) be the third derivative of -2k*7/105 + 13k*4/24 - 3k*2. Find the second derivative of a(z) wrt z. -48z2 Let s(l) be the third derivative of -l9/126 + l*5/20 + 4l*2. Find the third derivative of s(v) wrt v. -480v3 Let b(c) be the first derivative of -c6/40 - 5c4/24 + c2 + 5. Let m(f) be the second derivative of b(f). What is the second derivative of m(n) wrt n? -18n Let c be (32/12)/((-4)/(-6)). What is the third derivative of -2b4 + 0b*4 + 2b*2 - 3b*c + 2b*4 wrt b? -72b Let b(d) be the third derivative of d4/12 - d3/3 - 3d2. Find the first derivative of b(o) wrt o. 2 Let h(c) = -c3 + 2c*3 + 2c + 4c2 + 0c - 1. Let d be h(-2). What is the second derivative of dx - 4x*4 + 2x*4 - 3x - x wrt x? -24x2 Differentiate -12d*3 - 14d*2 + 14 - 3d*3 + 14d*2 with respect to d. -45d*2 Let r be (18/(-4) - -4)0. Differentiate 1 - 1 + 5 - 3c3 + rc*3 with respect to c. -9c*2 Let n(r) be the third derivative of -1/120r*6 + 0 - 1/24r*4 + 0r*3 + 0r*5 + 0r - 3r2. What is the second derivative of n(m) wrt m? -6m What is the second derivative of 6g + 25g*4 + 13g*4 + 12g + 2g wrt g? 456g2 Let c be (-17)/(-3) - 2/3. Let x(z) = z3 - 3z2 + 2. Let t be x(3). Find the second derivative of w4 - 4w - 2w4 + cw - tw wrt w. -12w*2 Suppose 4 = -k - 2k - 4j, -4k + 4j = -32. Let y = -5 - -8. Find the third derivative of -yw*4 + 5w2 + wk - 3w2 wrt w. -48w Let k(o) = -65o2 + 82o. Let j(v) = -33v2 + 41v. Let g(i) = 9j(i) - 4k(i). What is the second derivative of g(q) wrt q? -74 Let h(o) be the first derivative of 3o6 - 11o*3/3 + 9. What is the third derivative of h(z) wrt z? 1080z*2 Let q(g) = -g + 1. Let x(y) = 12y + 11. Let h(b) = 18q(b) + 2x(b). What is the first derivative of h(m) wrt m? 6 Let j(r) = r*3 + r + 2. Let w be j(0). Suppose 3m = 4m - wy, 2m - 2y - 2 = 0. Find the third derivative of 4x2 - 5xm - x6 + 0x6 wrt x. -120x3 Let z(n) be the third derivative of n2 - 7/6n3 + 0 + 1/4n*4 + 0n. Differentiate z(q) with respect to q. 6 Let p = -13 + 17. Find the third derivative of -7t2 + t2 - pt*3 + 2t*2 wrt t. -24 Let w(g) be the first derivative of -2g*5/5 + 2g*4 - 40g*3/3 + 19. Find the third derivative of w(y) wrt y. -48y + 48 Let y be (0 + -2)(-9)/6. Let m be -13/y-2. Find the third derivative of -21 - 3x*2 + 21 - mx*4 wrt x. -48x Find the third derivative of -12t5 + 14t*2 + 4t*5 - 3t*2 wrt t. -480t*2 Let k(b) = 5b*4 - 3b*3 + 3b. Let m(j) = -6j4 + 4j3 + j2 - 4j. Let u(s) = 4k(s) + 3m(s). What is the third derivative of u(f) wrt f? 48f Let j = -1/16 + 9/16. Let b(g) be the third derivative of jg3 + 1/24g*4 + 3g*2 + 0g + 0. Differentiate b(m) with respect to m. 1 Let j(a) be the second derivative of a*4/2 + 18a*2 - 6a. Differentiate j(l) wrt l. 12l Let q(i) be the third derivative of i7/35 + 3i*5/20 + 7i*2. Find the third derivative of q(o) wrt o. 144o Suppose -6w + 4 = 4. Let n(i) be the second derivative of -1/20i*5 + 3/2i*2 + wi*4 + 0 + 3i + 0i3. What is the first derivative of n(t) wrt t? -3t*2 Let i(d) be the third derivative of -1/6d*3 + 0d - d*2 - 1/8d4 + 0. What is the first derivative of i(p) wrt p? -3 Let d be (6/9)/((-2)/(-9)). Let l(v) = -v2 + v - 5. Let q(x) = -x*2 - 3. Let g(m) = dl(m) - 5q(m). Find the second derivative of g(c) wrt c. 4 Find the third derivative of -17y*2 - 226y + 226y + 15y*4 wrt y. 360y What is the first derivative of -8m2 - 6 + 4 + 4m*2 - 2 wrt m? -8m Let n be (4/(-10))/(1/(-10)). Suppose -9 = -ns + 3. What is the second derivative of -3v*3 + 2v - v*3 + 2v*s wrt v? -12v Suppose 2m - 8 + 0 = 0. Find the second derivative of wm - 2w*4 + 0w*4 - w wrt w. -12w*2 Let b(a) be the first derivative of -3a*3 + 9a + 2. Find the first derivative of b(t) wrt t. -18t What is the second derivative of -15v - 8v4 - 4v*4 + 0v*4 wrt v? -144v*2 Let p(h) = 10h*2 - 5h + 2. Let x(q) = 9q2 - 4q + 1. Let r be 15((-12)/9)/(-4). Let y(m) = rx(m) - 4p(m). What is the derivative of y(f) wrt f? 10f Let d(h) be the second derivative of -h10/1680 - h6/90 + h*3/2 - 4h. Let b(p) be the second derivative of d(p). Find the third derivative of b(q) wrt q. -360q3 Let o(y) = 15y*2 + 6y + 7. Let g(u) = 8u2 + 3u + 4. Let v be (7/(-2))/(2/(-4)). Let m(p) = vg(p) - 4o(p). Find the second derivative of m(s) wrt s. -8 Let g(r) = r3 - r2 - r + 1. Let t be g(2). What is the third derivative of tc2 + 2c3 - c3 - 4c3 wrt c? -18 Suppose -l + 6l = 10. Suppose -8 = lf - 6f. Find the third derivative of 2j5 - fj*5 + 3j*6 + 4j*2 wrt j. 360j3 Let y(a) be the second derivative of -a4/12 + 5a3/6 + 5a. Find the second derivative of y(n) wrt n. -2 Let s(f) = 23f + 61. Let h(q) = -90q - 245. Let w(b) = 2h(b) + 9s(b). Find the first derivative of w(y) wrt y. 27 Let w(f) = 2f - 8. Suppose 4a = -v + 6, a = 3a. Let h be w(v). Differentiate -1 - 3j*h + 4j*4 + 0j*4 with respect to j. 4j*3 Find the third derivative of 8c*4 + 13c*2 - 55c*2 + 24c*2 wrt c. 192c Suppose 5c + 5w + 25 = 0, 4c + w = 5w - 4. Let p be (-62/c)/2. What is the third derivative of 2d2 - d6 + 0dp + 0d*6 wrt d? -120d3 Let h(s) be the third derivative of s6/8 + s*5/60 + 10s*2. What is the third derivative of h(a) wrt a? 90 Let r(t) = t - 2. Let m be r(2). Suppose -p = q - mp - 4, -17 = -5q - 2p. Find the third derivative of -w*3 - qw*2 + 2 - 2 wrt w. -6 Differentiate -2 + 5 + 55s*4 - 56s*4 + 2 wrt s. -4s*3 Find the third derivative of 2u*2 - 5u + 5u - 4u*3 - 3u*2 wrt u. -24 Let v(w) = -w. Let f be v(0). Suppose -2 = -p - f. What is the derivative of -pl + 1 - l + 0l wrt l? -3 Find the second derivative of 5y*3 - 2y*2 + 2y*2 + y + 0y*3 wrt y. 30y Let f = -6 + 8. What is the third derivative of -g + 0g + 2g*3 + g + 4g*f wrt g? 12 Differentiate 6l*4 - 3 + 3l*4 + 4l*4 - 17 with respect to l. 52l3 Let o(f) be the second derivative of -f6/15 + f*3/2 + 11f. What is the second derivative of o(t) wrt t? -24t2 Let l(n) = 3n*2 + 2n + 6. Let y(c) = -3c2 - 3c - 6. Let g(i) = -3l(i) - 2y(i). Differentiate g(s) wrt s. -6s What is the third derivative of 8i*3 - 4i2 - i3 + 7i2 - 6i2 wrt i? 42 Let a = -4 + 5. Let b(n) = -n4 + n*3 - 1. Let h(x) = 12x*4 - 5x*3 + 11. Let t(y) = ah(y) + 5b(y). What is the first derivative of t(l) wrt l? 28l*3 Let y(a) be the first derivative of 5a4/4 - a2/2 - 13. What is the second derivative of y(m) wrt m? 30m Let b(r) be the second derivative of r9/1512 + r5/30 + r3/3 + r. Let i(n) be the second derivative of b(n). Find the second derivative of i(u) wrt u. 40u*3 Let r(k) = -4 - 3 + 6k + 6 - 4k. Let y be r(3). Find the third derivative of -3v*5 + 6v*y + 2v2 + v5 - 3v2 wrt v. 240v*2 Let o(j) be the second derivative of 3j + 1/30j6 + 0j4 + j2 + 0j5 + 0j*3 + 0. Differentiate o(q) wrt q. 4q*3 What is the first derivative of -8 - 11 - 17d + 11 wrt d? -17 Let w be 2/3 + (-25)/15. Let v = w - -6. Find the third derivative o	{ "pile_set_name": "DM Mathematics" }
3 h and 1 a? 165/364 Calculate prob of picking 1 q, 1 b, and 1 c when three letters picked without replacement from {v: 2, c: 2, b: 1, s: 1, q: 2, d: 1}. 1/21 Calculate prob of picking 1 b and 1 a when two letters picked without replacement from {b: 4, g: 7, a: 2}. 4/39 Four letters picked without replacement from mmmmmmmmsmmmsmsssmm. What is prob of picking 4 s? 5/3876 Calculate prob of picking 1 l and 1 b when two letters picked without replacement from edtlblltclctl. 5/78 Calculate prob of picking 1 l and 3 n when four letters picked without replacement from {n: 17, l: 3}. 8/19 Calculate prob of picking 2 k when two letters picked without replacement from {k: 7}. 1 What is prob of picking 2 u when two letters picked without replacement from {u: 2, c: 1, g: 4, i: 3}? 1/45 Calculate prob of picking 1 b and 1 c when two letters picked without replacement from {b: 1, v: 1, x: 5, c: 3, h: 4}. 3/91 Three letters picked without replacement from arrffaraaffrarr. What is prob of picking 2 a and 1 r? 12/91 Three letters picked without replacement from cccmcccmccccc. Give prob of picking 2 c and 1 m. 5/13 Calculate prob of picking 1 d, 1 o, 1 b, and 1 t when four letters picked without replacement from vtdtodttbfdtb. 6/143 Calculate prob of picking 3 w when three letters picked without replacement from nnwwnwnwwwwnnwwnnn. 7/68 What is prob of picking 1 f and 1 h when two letters picked without replacement from pdpedphdddefdldedll? 1/171 Three letters picked without replacement from {c: 1, n: 7}. What is prob of picking 1 c and 2 n? 3/8 Three letters picked without replacement from kaataappkapaak. What is prob of picking 1 k and 2 p? 9/364 Calculate prob of picking 4 n when four letters picked without replacement from {n: 8, h: 5}. 14/143 Calculate prob of picking 3 f when three letters picked without replacement from {v: 4, t: 2, g: 1, f: 3, j: 2, s: 6}. 1/816 What is prob of picking 3 k when three letters picked without replacement from kkkokkkkkkkkkkk? 4/5 Two letters picked without replacement from {g: 1, q: 1, u: 1, v: 5, a: 2}. Give prob of picking 2 a. 1/45 Four letters picked without replacement from xxjyxyjyyyfxyxyy. What is prob of picking 3 y and 1 j? 4/65 Two letters picked without replacement from ziokh. What is prob of picking 1 h and 1 k? 1/10 Four letters picked without replacement from vwwvvvwvvw. Give prob of picking 4 v. 1/14 Three letters picked without replacement from yhsshyssshysshysxh. What is prob of picking 1 x and 2 s? 7/204 What is prob of picking 1 p and 3 s when four letters picked without replacement from {s: 12, o: 1, p: 6}? 110/323 Four letters picked without replacement from zdgrzrrzdwzzrg. What is prob of picking 1 z, 1 d, and 2 r? 60/1001 Three letters picked without replacement from {g: 2, p: 2, h: 2}. What is prob of picking 1 g and 2 h? 1/10 Two letters picked without replacement from ggqebqqoqq. What is prob of picking 1 b and 1 o? 1/45 Two letters picked without replacement from {t: 3, q: 5, e: 1, r: 1, n: 2}. What is prob of picking 1 t and 1 n? 1/11 Two letters picked without replacement from ltlttt. Give prob of picking 2 l. 1/15 Two letters picked without replacement from {g: 1, p: 1, y: 1, e: 1, v: 2, o: 2}. Give prob of picking 1 e and 1 v. 1/14 What is prob of picking 1 b and 1 x when two letters picked without replacement from xbii? 1/6 Four letters picked without replacement from lxxxxlxlxlxl. Give prob of picking 2 l and 2 x. 14/33 Calculate prob of picking 1 o and 2 b when three letters picked without replacement from sissbob. 1/35 Calculate prob of picking 1 r and 2 p when three letters picked without replacement from {r: 1, p: 3, a: 3, m: 3, b: 1}. 1/55 Calculate prob of picking 2 f when two letters picked without replacement from {b: 4, f: 2, z: 2, a: 1}. 1/36 Three letters picked without replacement from mgnnkmfk. What is prob of picking 1 n, 1 g, and 1 m? 1/14 Four letters picked without replacement from bffbfffffb. What is prob of picking 1 f and 3 b? 1/30 What is prob of picking 1 f, 1 v, and 2 c when four letters picked without replacement from cfcvscfscb? 2/35 Three letters picked without replacement from bbubbbbubbbbbbbbbbbu. Give prob of picking 3 b. 34/57 Four letters picked without replacement from gygmg. Give prob of picking 3 g and 1 y. 1/5 Two letters picked without replacement from {k: 1, n: 7, u: 2}. What is prob of picking 2 u? 1/45 Three letters picked without replacement from iqqwi. What is prob of picking 1 q and 2 w? 0 What is prob of picking 2 d when two letters picked without replacement from {c: 2, d: 2, b: 2, f: 3}? 1/36 What is prob of picking 1 y and 3 i when four letters picked without replacement from iiiyiiygcwiwiiiiiygi? 44/323 Calculate prob of picking 2 g when two letters picked without replacement from jwgwjs. 0 Calculate prob of picking 1 h and 1 b when two letters picked without replacement from {b: 1, m: 2, a: 3, q: 1, h: 4, j: 1}. 2/33 Four letters picked without replacement from {r: 5, y: 9}. What is prob of picking 4 r? 5/1001 What is prob of picking 1 r and 2 l when three letters picked without replacement from {r: 4, l: 15}? 140/323 Two letters picked without replacement from eeeeee. What is prob of picking 2 e? 1 Four letters picked without replacement from dwxryyyyxxxxn. Give prob of picking 1 w, 2 n, and 1 x. 0 What is prob of picking 1 c and 2 k when three letters picked without replacement from kccckkcccck? 14/55 Three letters picked without replacement from yydyddyg. What is prob of picking 2 d and 1 g? 3/56 Three letters picked without replacement from {p: 4, e: 1, v: 2, q: 1, i: 3, u: 4}. Give prob of picking 2 u and 1 e. 6/455 Three letters picked without replacement from {r: 1, s: 4, k: 1, a: 2, i: 1}. Give prob of picking 1 a and 2 s. 1/7 What is prob of picking 1 c, 1 j, 1 u, and 1 v when four letters picked without replacement from {j: 1, c: 1, o: 2, v: 1, z: 2, u: 2}? 1/63 Calculate prob of picking 1 l and 3 r when four letters picked without replacement from {l: 5, r: 13}. 143/306 What is prob of picking 3 d and 1 p when four letters picked without replacement from {d: 6, u: 10, p: 2}? 2/153 Two letters picked without replacement from nvnbnnvbvbbnbvsbbnnb. What is prob of picking 1 n and 1 s? 7/190 Calculate prob of picking 2 s and 1 z when three letters picked without replacement from yuezessy. 1/56 Calculate prob of picking 1 b and 1 o when two letters picked without replacement from mbohqdo. 2/21 Two letters picked without replacement from iiiiaiiiaaiiii. What is prob of picking 1 a and 1 i? 33/91 Calculate prob of picking 1 j, 1 x, and 2 s when four letters picked without replacement from xxjyacasyasyyaa. 2/1365 What is prob of picking 2 x when two letters picked without replacement from yvxxyxxbbxyxy? 5/26 What is prob of picking 4 s when four letters picked without replacement from {w: 3, s: 4}? 1/35 Calculate prob of picking 1 x and 2 l when three letters picked without replacement from {l: 7, x: 1}. 3/8 What is prob of picking 1 r and 1 x when two letters picked without replacement from wrxx? 1/3 What is prob of picking 1 q and 1 a when two letters picked without replacement from yilyyqaylgyai? 1/39 Calculate prob of picking 4 f when four letters picked without replacement from {f: 13, z: 6}. 715/3876 Calculate prob of picking 2 d and 1 m when three letters picked without replacement from {m: 13, d: 6}. 65/323 Two letters picked without replacement from {r: 2, j: 1, q: 1, b: 1, k: 1, w: 1}. What is prob of picking 1 r and 1 k? 2/21 What is prob of picking 1 n and 1 y when two letters picked without replacement from kkbhnykknyhn? 1/11 Four letters picked without replacement from {z: 4, l: 6, f: 4}. Give prob of picking 2 z and 2 f. 36/1001 What is prob of picking 2 a when two letters picked without replacement from {s: 1, a: 2}? 1/3 Three letters picked without replacement from ghhcmhc. What is prob of picking 1 m and 2 c? 1/35 Three letters picked without replacement from {g: 1, a: 1, z: 1, h: 1, w: 1}. Give prob of picking 1 z, 1 w, and 1 g. 1/10 Calculate prob of picking 1 o and 1 l when two letters picked without replacement from oioloill. 9/28 Calculate prob of picking 1 m and 1 o when two letters picked without replacement fr	{ "pile_set_name": "DM Mathematics" }
5v(w). Let p be c(-5). Suppose -43z + 5829 = 5356. Is p greater than z? False Let o = -25582 - -25044. Is -0.19 greater than o? True Let r = 5.86 + -3.02. Let a = r - 2.84. Which is greater: a or -0.47? a Let p be 5/2(-3 + 1). Let h be ((-27)/(-6))/9(0 + 0). Suppose -3m - 2m = -5q - 20, h = 2m. Is p less than or equal to q? True Let b be (-12)/(-14)(-8 - -22)-1. Let l be (-8)/48 + (-206)/b. Let z be (-93)/(-9)3/2. Is l less than or equal to z? False Let n(h) = h3 + 22h*2 - 43h - 15. Let u be n(-23). Let d = u - 381. Which is greater: 65 or d? 65 Let j = -1/8008 + -5077/152152. Does j = -1? False Let u = 2448878/416763147 + -2/305769. Let b = u + -1106/652877. Which is smaller: b or 1? b Suppose 0 = -3b + 4b - 55. Suppose -v = -m + v + b, 0 = 2v - 8. Is 63 > m? False Let d be -24/54003/(-2). Let t = d + -3379/1800. Which is bigger: -3 or t? t Let t be -1 + (-1)/((-15)/6). Let k = -83 + 78. Let p be 3(k + 13/3). Which is greater: t or p? t Let x(l) = 5l3 - 9l*2 + 17l - 4. Let g = 17 - 13. Let m(b) = 6b3 - 9b*2 + 18b - 3. Let z(c) = gm(c) - 5x(c). Let r be z(8). Is r equal to -31? False Suppose i + 2k + 163 = 6k, 11k = 77. Are i and -2846/21 unequal? True Let q = -29 - -30.1. Let p = -57.1 + q. Let j = p + 57. Which is greater: 4 or j? 4 Let g be 93423/(-39) - (-366)/793. Is -2398 >= g? False Let c = -2 - -4. Let o = 103 - 94. Let h be -1 - ((-82)/32 + -8 + o). Which is smaller: h or c? h Let x = -141.059 + 141. Let j = -55.941 + x. Let f = 58 + j. Is f greater than 3? False Let v = -10818 - -10483. Which is bigger: v or -3357/10? v Let c be 946/(-4)(-18)/(-24)-8. Let l be 13/((-1001)/c) - (-8)/(-14). Is -19 bigger than l? False Suppose 4d + 140 = w - 61, 5d + w = -240. Let q be 9/(-6)(-4 + -2). Let i be (-7 + 3/q)/((-4)/(-30)). Which is greater: i or d? d Let l be (-3)/(-5)(2 + -1)5. Let s = -1118 + 782. Let y be 6/(-132)s/4. Is y > l? True Suppose 390 = 7i + 4i - 347. Let l(t) = 8t*2 + t. Let b be l(-3). Is b at most as big as i? False Let b(z) = 306z*2 - 81z - 51. Let o(x) = 19x2 - 5x - 3. Let t(l) = 4b(l) - 66o(l). Let y be t(2). Is -115 at most as big as y? True Suppose -3r = 3z + 321, -3r - 204 = -r + 4z. Let y = r - -55. Let s be y/153 - (-2)/6. Is s >= 1? False Suppose 0 = w - 27 + 15. Let r be w/(-8) - ((-1)/(-2) + -2). Is r at least -3/212? True Let w be 22/((-465/(-50))/((-24)/(-5))). Is 19 smaller than w? True Let x(k) = 4k*2 + 95 + 102 - 211 - 3k + k*3. Let h be x(-3). Suppose -h = -3y + 53. Which is greater: y or 18? y Let q be 29(-23)/(-3) + (344/6)/86. Suppose -p + 5o = -234, 23 = 2p + 2o - 421. Is p at most as big as q? False Let x(d) = -2d3 + 20d*2 - d + 6. Let r be x(9). Is r bigger than 479/3? False Let v = 286473/53 + -5405. Let m be 392/91 + -4 - (-28)/(-91). Which is smaller: v or m? m Suppose 565q + 1093081 + 2845064 + 120815 = 0. Which is smaller: -7188 or q? -7188 Let v = 9311 + -8647. Which is bigger: v or 2/9? v Let k = 6.3 + -6. Let s = -10556 + 10585. Does k = s? False Let h(k) = -k2 - k. Let c(y) = -y3 - 2y2 - 2y + 9. Let r(n) = c(n) - 3h(n). Let q be r(0). Suppose m + 8m = -q. Is m at least as big as 2/103? False Let m be (-1)/(-12)8 - (-3230)/42. Let y = m + -3177/35. Which is smaller: -14 or y? -14 Let j(g) = g3 + 29g*2 + 19g - 25. Let l be j(-25). Let w be (12/15)/(70/l). Is w smaller than 23? True Let m be (-15)/50 - 318/(-60). Let r(p) be the first derivative of -3p2/2 + 14p + 1. Let n be r(m). Is n > -1/100? False Let h be 0 + 1/((-2)/(-2)). Let z be 12/918/12. Let j be (8/(-22))/z - 14592/(-72512). Which is greater: j or h? h Let k be -8 - (2150/(-30) - -5)/((-1)/(-3)). Is k bigger than 183? True Suppose 6z - 6 = 12z. Let m = 18099637 - 705833774/39. Let q = -1335 + m. Is z bigger than q? False Suppose p + 2z = 7 + 1, 5p = -2z + 24. Let j be 177/261 + (-2)/p. Let g = -10/29 + j. Which is greater: -4 or g? g Suppose -612 = 47q - 83q. Suppose -5s + 25 = 0, m + 2s + 0s = 48. Is m smaller than q? False Let r = -987 - -1550. Let w = r + -592. Which is greater: w or -10? -10 Let c = -4.147 + 4.447. Is -179 > c? False Suppose 0 = -573u + 579u + 84. Let w be (1/(-2)2)/(14/u). Is w <= 6/247? False Let b(j) = -9j - 20. Let k be b(10). Let f be 341/k - (-1)/10. Let l = 30 + -34. Is f >= l? True Let r = 504 + -970. Let f = r + 293. Is -174 at most f? True Let z = -3474 - -2109. Which is smaller: z or -1366? -1366 Suppose 2j + 3x = 22, 5j - 2j + 4x = 31. Suppose 3q + 129 = -5i, -ji = -0i - 2q + 139. Which is smaller: -26 or i? i Let f(n) = -n3 + 5n*2 - 5n - 4. Suppose q = 2c + 4, 13c - 18c = q - 4. Let l be f(q). Is l bigger than -28/3? True Let r = 847007/36 + -23529. Which is bigger: r or -2? r Suppose 6v - 182 = 40. Suppose -79 = -3l - 4r, 5l + 0r - 4r - 185 = 0. Which is bigger: l or v? v Let j(t) = 4t*3 + 11t*2 - 9t - 2. Let k be j(4). Let q = k - 3548/9. Which is greater: 25 or q? 25 Let d = -12068 + 12065. Is -70.5 <= d? True Let k be (3 - (-9)/(-15))200805/99. Which is smaller: k or 4869? k Suppose -5o + 4c = 116, 3c - 70 = 3o + 2. Let p(i) = i3 + 19i*2 - 19i + 18. Let j be p(o). Let g = -43 + 40. Are g and j nonequal? True Let z be (3 + 10/12)7/(-14). Let p = z + 163/60. Suppose 5b - 14 = y, -b + 4 = y - 0b. Which is bigger: y or p? y Let v(i) = 65i + 3. Let n be v(-7). Let o = n - -14918/33. Let g = 140 + -140. Which is bigger: g or o? o Let x = 38.66 + -40.56. Is 2.8 greater than or equal to x? True Suppose -3 = -4k + 1. Suppose l + 31 - 26 = 0, 3z - 3l = 42. Let r(x) = x3 - 8x*2 - 9x + 1. Let b be r(z). Are b and k equal? True Let g = -13.9 - -14. Let k = g - 0.2. Let l = 4 + -2.8. Which is smaller: l or k? k Suppose 6 = -x + 3y, 2x + 4 = -3y + 10. Let i be 3842/(-111) + 3 + 4. Is i > x? True Let j = -5326 - -5036. Is -297 > j? False Let a be (-72)/252 - (-61)/238. Let j = 24 + -24. Is j bigger than a? True Let b be ((-1 - -2) + -81)(-13)/234. Let m(a) = -10a + 135. Let x be m(13). Which is bigger: b or x? x Let p = 996/29 + -510542/14877. Is 0 at most p? True Let v = 699 - 699. Let t(a) = a*3 - 2a*2 - a - 1. Let h be t(2). Let i be (6/4)/(h/68). Is i greater than v? False Suppose -h - 1 + 3 = 0. Let n be (54 + -50)/(0 - -2). Suppose w + 10 = 3c + c, -4c + 16 = nw. Are w and h equal? True Let y = 2621 + -2496. Which is smaller: 126 or y? y Suppose 20v = 16v + 20. Let n(w) = 2w2 - 10w + 23. Let z be n(v). Let q be (222)/(-5 + 7). Is q greater than z? False Let d = 357638 + -8224081/23. Which is bigger: 70 or d? 70 Let l = 206 + -185. Let u = 2995/154 + 4/77. Do l and u have the same value? False Suppose 0 = 298m - 291m - 203. Is 28 < m? True Let w = 857 - 1680. Is w > -824? True Suppose 4w - 23 = 101. Let n be ((-198)/132)/((-328)/(-2240) + 1/(-5)). Which is bigger: n or w? w Suppose -7k = 5k - 96. Suppose 18z = 22z - k. Suppose 2f - 4f = zx, -4f = 5x. Which is bigger: x or -5/17? x Let i be 4/(-10) - 52/(-130). Let t = 2/1935 - 908/129645. Is i greater than or equal to t? True Let q = -4046/9 - -450. Which is smaller: q or -6/13? -6/13 Let s be (-1)/3(1/(-7) + (-1826)/154). Is s < 71? True Let j = -402 + 268. Let t = j + 100. Which is bigger: t or -35? t Let v be 239 + (-50)/15(-42)/(-35). Let r be 8/v155/62. Which is bigger: 0 or r? r Suppose -q + 5 = -13. Let c be (-15)/(-2)88/(-66). Let b(v) = -2v*2 - 22v - 1. Let i be b(c). Are i and q equal? False Let w be -1 - (-1126)/920 - 9/36. Let q = 639/1955 - w. Let s = -0.62 - 0.38. Is q at least as big as s? True Let g = -81 - -62. Let k = 39 + g. Let i be (-1)/k5/2. Is i greater than -1? True Let i = 69/172 + -13/86. Which is bigger: i or 1890? 1890 Suppose -2i = 3l + 141, 5i + 124 = 5l + 334. Let y be (-2)/8 + l/12 - -3. Which is greater: y or -1/55? -1/55 Let c = -1640 + 1645. Which is smaller: -274 or c? -274 Suppose 9 = u - 0u + 3k, -19 = 4u + k. Suppose 15d = d + 518. Let c = d - 41. Is c != u? True Let k = 1865.3 - 1764. Let t = 102 - k. Is t equal to -8? False Let a = 13.6 - 10.9. Let x = 4.7 - a. Which is bigger: -14 or x? x Suppose y = -3, 0 = -a - 2y - y + 1. Let b be (-4 - 2)-45/a. Does b = 58/5? False Let p(d) = d*2 - 16d - 14. Le	{ "pile_set_name": "DM Mathematics" }
7, -5? -1/28 Which is the fourth biggest value? (a) 1 (b) 59/27 (c) 0.3 (d) -2/31 d Which is the third smallest value? (a) 6.5 (b) -1/5 (c) 16 c What is the sixth biggest value in -1/7, -1, 22, -1/3, 3/8, 5? -1 What is the second biggest value in -5, 3/10, -4, -3, -5/4, 1? 3/10 What is the biggest value in -361, 0.5, -7? 0.5 Which is the second biggest value? (a) -0.9 (b) 4 (c) 2/13 (d) 0.667 (e) 1 (f) -3 e Which is the biggest value? (a) 2/3 (b) 25.5 (c) -0.2 (d) 4 b What is the biggest value in -51, 8, -1, -16, 12, -0.4? 12 What is the fifth smallest value in 842/9, -3/16, -3, 2/7, -2? 842/9 Which is the smallest value? (a) -5 (b) -0.445 (c) 0.18 (d) -0.4 (e) -2 a What is the sixth biggest value in 69, 1/4, 3, 2/3, -0.3, 2? -0.3 Which is the biggest value? (a) -1 (b) 115 (c) 3173 c Which is the fifth smallest value? (a) -0.1 (b) -5 (c) 37 (d) 3 (e) 0.4 (f) 27.5 f Which is the second biggest value? (a) 3 (b) 1/13 (c) -60 b Which is the second biggest value? (a) 11/5 (b) 3/5 (c) -1/4 (d) 4/3 (e) -0.4 (f) -9 d Which is the biggest value? (a) 11 (b) 1/4 (c) -1595 (d) 0 (e) -1 a What is the fourth biggest value in 3/7, 148, 1/7, -18, 0.2, -1? 1/7 Which is the third smallest value? (a) 3 (b) 175 (c) 2/11 (d) -12/11 (e) 1 (f) 2/5 f Which is the second smallest value? (a) -4 (b) 0.1 (c) -2/5 (d) -0.1 (e) 31/3 (f) -3/5 f What is the second biggest value in 718, -26, 5? 5 Which is the third biggest value? (a) -0.4 (b) 6/2873 (c) 0.7 a Which is the fifth biggest value? (a) -0.3 (b) 28 (c) 0.04 (d) 0.1 (e) -3 e What is the second biggest value in 0.3, 0.2, -95/31? 0.2 Which is the sixth biggest value? (a) -1/3 (b) -1/8 (c) 4.6 (d) 18 (e) 4 (f) -0.14 a Which is the fourth biggest value? (a) 1/2 (b) 4 (c) -26699 (d) -3 (e) -4 e What is the second smallest value in 0, -0.4, 0.07, 4, 16/57? 0 Which is the third smallest value? (a) -2 (b) 42 (c) -0.2 (d) 0 (e) 10 (f) 5 d What is the smallest value in 1/510, -8/11, -5, -0.4? -5 What is the sixth smallest value in 68, 2, -1/8, 3, 1, -0.4? 68 What is the third smallest value in -1/270, 3, 6/13, -1/5, 2? 6/13 Which is the second smallest value? (a) -0.1 (b) -11 (c) -1 (d) 1/23 (e) -3 e Which is the biggest value? (a) 0.3 (b) -1/2 (c) -4/7 (d) -2094 a What is the biggest value in -5, -3/5, 45.1, 5, -0.3? 45.1 Which is the third smallest value? (a) 2 (b) -3 (c) -4/59 (d) 89 (e) -1.3 c Which is the fourth smallest value? (a) 1 (b) -19 (c) 3/5 (d) 11/29 (e) -0.02 c Which is the smallest value? (a) 0 (b) -5 (c) -0.3 (d) 24565 b What is the smallest value in -14, 1/3, 106? -14 Which is the third smallest value? (a) -1/115 (b) -5 (c) -0.28 a Which is the fourth smallest value? (a) 3 (b) -3145 (c) 4 (d) 4/7 (e) 2/3 (f) 9 a What is the second smallest value in 0.5, -4/7, -43043, -0.2? -4/7 What is the fifth smallest value in 2/19, 50, 2, 0, -0.1? 50 Which is the smallest value? (a) 0.4 (b) -19.2 (c) -3/4 (d) -33/7 b Which is the fourth biggest value? (a) -1/5 (b) -3/337 (c) 0.5 (d) 4 a What is the second smallest value in 0.05, 0.09, -0.054? 0.05 Which is the third smallest value? (a) -0.3 (b) -25 (c) -55/13 a Which is the second biggest value? (a) 5 (b) 0.1 (c) 3 (d) -79 (e) 4/7 (f) -9 c What is the third smallest value in 0, 46, -60, 0.2? 0.2 Which is the biggest value? (a) 0.3 (b) 30.1 (c) -7 b Which is the smallest value? (a) 0.345 (b) -2823 (c) -5 b What is the smallest value in 0.12, -3/7, -126.5? -126.5 Which is the fourth smallest value? (a) -1/11 (b) 0.5 (c) 1/7 (d) 23 d Which is the second biggest value? (a) 0.4 (b) -48.5 (c) 6 a Which is the second smallest value? (a) 5 (b) -1312 (c) -4 (d) -9 d What is the second smallest value in -1/4, 51, 9/19, 0.3, -3? -1/4 What is the biggest value in 7/6, -20/1037, -4/9? 7/6 Which is the biggest value? (a) 2/7 (b) -4 (c) 3/5 (d) -5 (e) -10 (f) 0.1 c Which is the third smallest value? (a) -0.1 (b) 0.3 (c) 0.2 (d) -1/2 (e) -3/583 e What is the biggest value in 2, 0.05, -5/2, -439? 2 What is the fourth biggest value in -2/5, 3/8, 0.1, -194, -70? -70 Which is the smallest value? (a) -145 (b) -2/3 (c) 11 (d) -3 a Which is the fourth smallest value? (a) 2 (b) 600 (c) 5 (d) 0 (e) -8 c What is the third biggest value in 1/5, 4, -0.5, 4108/9? 1/5 Which is the smallest value? (a) -1312/3 (b) 0.3 (c) 163 a What is the fourth biggest value in 1153, 1/2, -3, -0.3? -3 Which is the biggest value? (a) -0.07 (b) -74293 (c) 4 c What is the second biggest value in -30, -1531/8, 0.2? -30 Which is the second biggest value? (a) 5 (b) -174 (c) -16/5 (d) -1/4 (e) 5/4 e What is the fourth smallest value in 5, 4, -3, -1/4, -2/499? 4 Which is the biggest value? (a) 10/7 (b) 3 (c) -0.1 (d) -0.272 b What is the third biggest value in -4/11, 1297, -0.5? -0.5 Which is the fourth biggest value? (a) 1/2 (b) 0.4 (c) 0.314 (d) 16 (e) 3 b What is the fourth smallest value in -5, -2, -24/11, 5.9? 5.9 Which is the third biggest value? (a) -4/7 (b) 8/21 (c) -311 c What is the fourth biggest value in -2/9, 0, 0.2, -5.082? -5.082 Which is the fifth smallest value? (a) -0.1 (b) 4 (c) 641 (d) -41 (e) -4 c Which is the third smallest value? (a) -3/55 (b) -2/13 (c) 1/6 (d) -9 (e) -0.3 b Which is the smallest value? (a) -1661/10 (b) -1/8 (c) 0.4 a What is the second smallest value in 0.05, -36/37, -4/5? -4/5 What is the third biggest value in 0.148, 0.92, 33, -1? 0.148 Which is the fifth biggest value? (a) 2 (b) -0.078 (c) -2 (d) 28 (e) 0.1 (f) 1/9 b Which is the smallest value? (a) 0.1 (b) -50 (c) -10 (d) -2/29 b Which is the second smallest value? (a) 1/2 (b) 3 (c) 0.00716 a What is the third smallest value in 5, -0.3, 2, -55, 13? 2 Which is the third biggest value? (a) 3 (b) -42/67 (c) -0.5 (d) 0 (e) -2/15 (f) -6 e What is the second biggest value in -6/5, -265/6, -1/2? -6/5 Which is the biggest value? (a) -0.12 (b) 0.06 (c) 27/16 c What is the second biggest value in 1/6, 30/139, 2/17, 0.03, -1? 1/6 What is the second smallest value in -0.4, 0.3, -0.2, -1, -927, 2/9? -1 Which is the third biggest value? (a) 1 (b) -4 (c) 5 (d) -2142 b What is the fifth smallest value in -57, 5, 2, 1/5, 0.06? 5 Which is the third biggest value? (a) -2 (b) 0.006 (c) 1.6 (d) -4 (e) -0.1 e Which is the second smallest value? (a) 2 (b) 1.7042 (c) 3 (d) -0.4 b What is the fourth smallest value in -3/7, -1.4, 2/9, 0.5, -5/3? 2/9 Which is the second smallest value? (a) -1/2 (b) -142 (c) -1 (d) 55 c What is the fourth smallest value in 1, 38, 2/3, -163, 0? 1 Which is the fifth biggest value? (a) 7 (b) 2/13 (c) -3 (d) 1 (e) 1/3 (f) 0.51 b What is the third smallest value in 1.2, -49, -87.5? 1.2 Which is the third biggest value? (a) 0.01 (b) -4.3004 (c) 0.5 b Which is the fourth biggest value? (a) -0.4 (b) 5 (c) 170 (d) -0.091 a Which is the sixth smallest value? (a) -5 (b) 0.5 (c) -3 (d) -0.154 (e) 2 (f) 4/3 e What is the second smallest value in 3/7, -15, -1, 2/45, -5? -5 Which is the second smallest value? (a) 22/13 (b) -0.2 (c) -7 b What is the second biggest value in 0.5, -15, 1/4, 1/38, 2/7, 7.41? 0.5 What is the third smallest value in 46, 7397, -1, -0.2? 46 What is the fourth biggest value in -11, -0.5, -460, 1, -0.4? -11 Which is the fourth biggest value? (a) -1/4 (b) 5 (c) 88 (d) -3 (e) 0.3 a Which is the fourth biggest value? (a) -2.4 (b) 4 (c) 0.09 (d) 6/35 a Which is the second biggest value? (a) 0 (b) -52 (c) -0.1 (d) 182 a Which is the fourth biggest value? (a) -1 (b) 3/17 (c) -29.4 (d) 2/3 c What is the fourth biggest value in 0.288, 8, 1, -0.5, 0.4, -2? 0.288 Which is the smallest value? (a) -20 (b) 2/13 (c) -10 a Which is the fourth smallest value? (a) 1/6 (b) 1/32 (c) 3/2 (d) 40/7 d Which is the second smallest value? (a) 3 (b) 5 (c) -1.4 (d) -89 (e) -6 e What is the smallest value in -0.6, 0.9, 0.1, -1, 0.056, 2? -1 Which is the fifth smallest value? (a) -0.12 (b) 5/4 (c) -0.3 (d) -7 (e) 1.5 e Which is the biggest value? (a) 201 (b) 3/4 (c) 2/13 (d) 3.2 a What is the fifth biggest value in 131/7, 1, -3/4, 3, 2/3? -3/4	{ "pile_set_name": "DM Mathematics" }
Is 302 at most -2/4593? False Is -3/84122 greater than 0? False Is 258415 <= 258422? True Is 3 > 104/69? True Which is bigger: 1480/87 or 17? 1480/87 Is 1040 bigger than 1045? False Which is bigger: -0.02354 or 0.181? 0.181 Which is smaller: -760354 or -1? -760354 Does -165 = -12153? False Which is smaller: -99760/3 or -33252? -99760/3 Which is smaller: -1.2 or -9? -9 Is 1629/2317 less than 2? True Which is bigger: 189 or 1/6? 189 Which is smaller: -128469 or -128468? -128469 Does -13812 = -13808? False Is -72361 not equal to -72360? True Is -34359/4 at most as big as -8590? False Is 68/3095 at most as big as -1? False Is -1013 at least -1043? True Which is smaller: 0.3 or -70.17? -70.17 Which is smaller: 369 or 51937/141? 51937/141 Is -116 > -141? True Is 1169 at most 1158? False Is 1380 less than or equal to 1405? True Which is bigger: -630949 or 2? 2 Is -5104 at most -5103? True Which is smaller: 137/6 or -947.8? -947.8 Which is bigger: 604876 or 604873? 604876 Which is greater: 383 or -4.603? 383 Does -922341 = -1? False Which is bigger: -1/30 or 2200? 2200 Is 15 greater than 1431/14? False Which is greater: 5439454 or 10878905/2? 5439454 Which is smaller: -27/4 or -2/5385? -27/4 Is -18/1515563 smaller than 1? True Is -0.3 at most -1650/13? False Which is smaller: 675 or 72252/107? 675 Which is smaller: -341898 or 1/3? -341898 Which is smaller: -61171 or -61169? -61171 Is -14 > -1? False Which is greater: 38/18135 or 0? 38/18135 Which is smaller: -2862 or -2? -2862 Is 0 greater than or equal to -101/1895? True Is -34/37 less than or equal to -2? False Are -93046 and -93045 equal? False Is 575.513 bigger than 1? True Is -8501 not equal to 67? True Which is smaller: 503755 or -4? -4 Is 297253 not equal to -1? True Is -220 less than or equal to -435? False Is -4356 < -4355? True Are -6 and -38067 non-equal? True Which is greater: 58079 or 174233/3? 58079 Is -4056 bigger than 3? False Do -52671 and -52669 have the same value? False Which is smaller: 3 or 1740/427? 3 Is 829477 less than 4147383/5? False Does -1443155 = -1443154? False Which is bigger: 55 or -0.0087? 55 Does -794 = -606? False Is 1/4 at least -66518? True Which is bigger: 2287360/9 or 254152? 254152 Which is smaller: -2/186743 or -1? -1 Is 3908/17 smaller than 231? True Do 1351098 and 1351102 have the same value? False Which is bigger: -66 or -2082/31? -66 Is 424 < 3399/8? True Do 6973 and 174353/25 have the same value? False Is 25021 smaller than 175142/7? False Which is bigger: 3406 or 3423? 3423 Is 129 greater than or equal to 0.2284? True Which is bigger: 13591 or 2? 13591 Which is smaller: 27030/19 or 1422? 1422 Which is smaller: -3560 or -3554? -3560 Is 856486 less than 856484? False Which is bigger: -1354 or -1360? -1354 Does 6191/299 = 20? False Which is smaller: 2 or 58/33? 58/33 Is -0.4155 greater than or equal to 0.07? False Which is smaller: 0.95159 or -2/9? -2/9 Which is smaller: 2/95 or 41/8? 2/95 Is 3/2403767 less than or equal to 0? False Which is greater: -2 or -12595? -2 Do 75359 and 75374 have different values? True Is 37 at least as big as -6437? True Is 206804 less than or equal to -0.6? False Is 1/571604 bigger than 0? True Which is smaller: 4649/33 or 141? 4649/33 Is 490847 >= 490847? True Which is smaller: 427 or 5979/14? 427 Which is greater: 6028 or 36161/6? 6028 Which is smaller: -797/48 or -18? -18 Are -2759/6 and -461 unequal? True Is 802/105 at most as big as 7? False Is 2.1 >= -105362? True Is -46/6451 != 1? True Which is bigger: -148/15365 or -0.1? -148/15365 Which is bigger: 45867 or 45941? 45941 Is -788423 smaller than -788423? False Which is smaller: -9.5 or -0.0549? -9.5 Is -19359 at most -19357? True Which is smaller: -611 or 91? -611 Which is bigger: 40 or -2288? 40 Is -2/3 at least as big as -14256? True Is -1 != -1/70728? True Which is bigger: 125/509 or -1? 125/509 Does 316587 = 316586? False Which is smaller: -9/9409 or -4/3? -4/3 Is 0.01 at least -2758? True Which is smaller: -2129 or -40? -2129 Is -2 less than 68334? True Is -43385 < 6? True Is 971 at most 958? False Is 13/37301 equal to -1? False Is -619861/6 greater than or equal to -103311? True Is -2558680 at least as big as -1? False Is 12335/69 greater than or equal to 179? False Are 23/8529 and -1 non-equal? True Are -162 and -239 nonequal? True Which is greater: 0 or -2/549385? 0 Which is smaller: -1 or 622/1701? -1 Which is bigger: 0 or -17/6129? 0 Do -1 and -447.96 have the same value? False Is -4 <= -4420? False Is 8212 >= 3/10? True Which is bigger: 58967/30 or 1967? 1967 Is -1729/61 <= -28? True Which is smaller: -2.96 or 12/5? -2.96 Which is smaller: -9598 or -9604? -9604 Which is greater: 130024 or 130026? 130026 Is 3/649 less than or equal to 354? True Is 86153/18 >= 4786? True Is -2255844 != -2255845? True Which is smaller: -153/773 or 1? -153/773 Are 405133 and 405132 equal? False Which is smaller: 1/23 or -1935? -1935 Which is greater: -1 or 143/1525? 143/1525 Are -1 and -6/14731 equal? False Is -4.910779 >= 0? False Which is greater: -197812 or -197818? -197812 Which is smaller: -1429 or -1587? -1587 Which is smaller: 0.065 or 0.0622? 0.0622 Which is smaller: 2790/2071 or 2? 2790/2071 Which is smaller: -84512 or -84511? -84512 Is -2247 less than or equal to -69615/31? True Which is smaller: 123 or -1079? -1079 Is -55 at most -2528/47? True Which is smaller: -7609 or -7611? -7611 Which is greater: 1 or 99/37834? 1 Which is smaller: -7758 or -7732? -7758 Which is smaller: 8.9 or -2/75517? -2/75517 Do 75774 and 75787 have the same value? False Which is smaller: 264 or 21551/82? 21551/82 Are -1/313497 and 1 unequal? True Which is bigger: 122571 or 1348272/11? 122571 Which is greater: 4763 or -173? 4763 Is 35/191 at most as big as 1/6? False Which is greater: 105 or 1.503? 105 Which is greater: 12199 or 12197? 12199 Which is bigger: 334 or 32326/97? 334 Is -5 equal to -8105? False Which is smaller: -8303 or -8304? -8304 Which is smaller: 0 or 44/35137? 0 Is -336/8009 bigger than -1? True Is 2993 at least 3015? False Which is smaller: -17 or 16435? -17 Which is smaller: 111410 or 111431? 111410 Is -179 greater than or equal to -11? False Is -477693 less than -477692? True Which is bigger: -2281/5 or -15? -15 Is -21948 smaller than -21948? False Which is smaller: -57986 or -57987? -57987 Is 14878 smaller than 14882? True Is 2250 <= 245? False Are -1 and 5/815741 equal? False Which is bigger: -1661 or -1441? -1441 Is -49/704 at most as big as 0? True Which is smaller: -101/78452 or -1? -1 Which is bigger: -6387 or -6363? -6363 Is -46170 smaller than -46172? False Which is greater: -20.21 or -11? -11 Is -1 > -17/14097? False Which is smaller: -2/19 or 149.694? -2/19 Is -5599 bigger than -5623? True Which is bigger: -1 or -1/37852? -1/37852 Which is smaller: 7085 or 120438/17? 120438/17 Is -7/4 less than -964? False Which is smaller: -149 or -4918/33? -4918/33 Is -1/2244461 smaller than 1? True Which is smaller: -3453 or -3451? -3453 Is 29 less than 5220/179? True Which is greater: -57454 or -57449? -57449 Which is smaller: 4006 or 3992? 3992 Is -1979553 >= -1979549? False Which is bigger: -1 or -8/49277? -8/49277 Which is bigger: -18552 or -18551? -18551 Is -1 <= 174/791? True Is -90273 at most as big as -90272? True Are 278216 and 278221 equal? False Is -10/433529 greater than or equal to 0? False Is -10351 not equal to -10348? True Which is greater: -89198 or 0? 0 Is 10/3 at least 31952? False Is 1 bigger than 1/1377354? True Is 2/2854419 less than 0? False Is 11029 equal to 34? False Is 1012 bigger than 969? True Which is smaller: -248/473 or -2? -2 Is -193962 equal to -193963? False Is -794593 at least -794591? False Which is bigger: 1308.41 or 49? 1308.41 Is 75772 at least as big as -1? True Is -50318 less than -50311? True Which is greater: -684.922 or 0? 0 Is -183933 < -183933? False Is 1 smaller than -25/6944? False Which is smaller: 0 or -9/881? -9/881 Is -3231 equal to -19/4? False Which is bigger: 506/637 or 1? 1 Which is greater: -3/6968 or -1? -3/6968 Is 3597/17 greater than 211? True Is 46061 < 46061? False Is 1 greater than or equal to -14/5007? True Do -154 and 471 have the same value? False Which is greater: -54496 or -54495? -54495 Do 5 and 0.05542 ha	{ "pile_set_name": "DM Mathematics" }
= -11p - 6. Calculate -4a(w) + 3k(w). 7w + 2 Let p(w) = w + 5. Let u(z) = 5z + 20. Give 9p(q) - 2u(q). -q + 5 Let o(w) = 7w*3 - 3w*2 + 3w + 2. Let n(q) = -q3 + q2 - q. Give 3n(l) + o(l). 4l*3 + 2 Let f(t) = -5t. Let h(u) be the third derivative of u*4/4 + 2u*2. Let m = 3 - 8. Suppose -20 = 3a - 2r, 3r + r = -2a + 8. Determine ah(y) + mf(y). y Let k(f) = 3f*2 + 8f + 3. Let b(i) = 2i2 + 7i + 3. Calculate -6b(y) + 5k(y). 3y2 - 2y - 3 Let o(c) = 4c2 + 5c. Let p(q) = -2q2 - 2q. Determine 2o(a) + 5p(a). -2a2 Let t(u) = 2u*2 + 4u - 4. Let i(k) = k*3 + 3k*2 + 3k + 4. Let y be -61(-1)/(-2). Let x be i(y). Let d(s) = 3s2 + 5s - 5. Give xt(w) + 4d(w). 2w2 Let m(y) = -10y*2 - 1155 + 1152 + 4y*2. Let i(k) = 5k*2 + 2. Let u(c) = c + 7. Let s be u(-5). Give sm(r) + 3i(r). 3r*2 Let h(u) = -3763u*2 + 212u. Let q(l) = -53l2 + 3l. What is -3h(v) + 212q(v)? 53v2 Let l = 5 - 4. Let a(z) = 2z*2 - 4z - 2z + 4z. Let c(t) = -t - 6 + 5 + 1. Give la(x) - c(x). 2x2 - x Let g(r) = r2 + r. Let z(h) = -5h2 - 5h + 4. What is 6g(i) + z(i)? i2 + i + 4 Let x = 3 - 7. Let l be 2/1 + 0/3. Let r(m) = 6ml - m3 + 7m2 - 12m*2 - m. Let n(f) = 5f*3 - 4f*2 + 4f. Calculate xr(b) - n(b). -b3 Let a(s) = 5s*2 + 2 - 2s + 5 - 3s2. Let q(c) = -c2 + c - 3. Let u = 4 + -4. Let b = -2 - u. Calculate ba(d) - 5q(d). d2 - d + 1 Let x(u) = 5u. Let v(d) = -51d. Determine 6v(f) + 63x(f). 9f Let q(i) = -11i2 - 5i - 2. Let o(a) = -4a2 - 2a - 1. Let w(l) = -17o(l) + 6q(l). Let k(m) = -m - 1. Give -5k(r) - w(r). -2r*2 + r Let k(z) = -11z*2 - 6z. Let h(a) = 4a2 + 2a. Suppose -3p = -3, -5l - 3p = p - 44. Determine lh(x) + 3k(x). -x2 - 2x Let a(f) be the second derivative of -f4/12 - f3/6 - f*2/2 - 2f. Let b(k) = -12k2 - 15k - 15. Calculate -15a(x) + b(x). 3x2 Let x(y) = 4. Let c(l) = -l3 + 9. Calculate 6c(n) - 14x(n). -6n3 - 2 Let a(u) = 6u - 3u - 7u + 5 + 2u. Let g(s) = 3s - 8. Let k be 55/11(-2)/(-2). Determine kg(w) + 8a(w). -w Let h(l) = 2 - 14l*3 - 8l + 6 + 0. Let n(c) be the first derivative of 9c4/4 + 5c*2/2 - 5c - 1. Calculate 5h(m) + 8n(m). 2m3 Let f(m) be the third derivative of m5/12 + 11m*4/24 - 7m3/6 + m2. Let b(o) = 2o2 + 5o - 3. Determine 7b(r) - 3f(r). -r*2 + 2r Let k(g) = g*3 - 4g2 + g + 2. Let s(x) be the second derivative of -x5/10 + 3x4/4 - x3/3 - 2x*2 + 3x. What is 9k(z) + 4s(z)? z*3 + z + 2 Let q(f) = 3f + 1. Let l be q(-3). Let c = -6 - l. Let z be ((-12)/21)/(c/(-7)). Let s(t) = t. Let a(h) = -2h. Determine zs(j) + 2a(j). -2j Let t(a) = -10a2 - 8. Let g(u) = -3u*2 - 3. Determine -7g(n) + 2t(n). n2 + 5 Let c(u) = u2 + 4u + 2. Let m(x) = -3x2 + 2x + 7x2 + 3 - 2 - 3x*2. What is -3c(y) + 5m(y)? 2y*2 - 2y - 1 Let y(u) = -2 + u - 5 + 10 - 9. Let w(d) = 2d - 7. What is -4w(v) + 5y(v)? -3v - 2 Let j(p) = -p + 1. Suppose 14s + 105 - 35 = 0. Let h(n) be the second derivative of n3/3 - 5n*2/2 + n. Give sj(b) - h(b). 3b Let v(u) = -3u*3 - 2u + 3. Let k(g) = -10g3 - 7g + 10. Suppose -5m = 2w - 3, -5m = 2w - m - 8. Suppose -18 - 2 = 5p. Give pk(s) + wv(s). -2s*3 + 2 Let s(x) = 80 - 2x + 0x - 81. Let q(a) = 4 + 0a - 3 + a. Give -3q(t) - s(t). -t - 2 Let b(w) = w3 - w2 - w + 1. Let t(m) = 11m*3 - 2m + 3. What is 2b(x) - t(x)? -9x*3 - 2x2 - 1 Let n(h) = h2 - 1. Let y(o) = -2o3 + 2o*2 - 16o - 3. Give -2n(b) + y(b). -2b*3 - 16b - 1 Let v(c) = -5c3 + 4c*2 - 2c. Let z(j) = -14j3 + 11j*2 - 5j. Determine 11v(r) - 4z(r). r*3 - 2r Let w(m) = 13m2 - 6m - 4. Let j(q) = 12q2 - 5q - 3. Calculate -6j(f) + 5w(f). -7f2 - 2 Let v(l) = 3l*3 - 7l*2. Let w(j) = 6j*3 - 13j*2. Give -7v(m) + 4w(m). 3m*3 - 3m*2 Let k be 27/(6(-2)/(-32)4). Let q(j) = 4j*3 - 2j*2. Let o(p) = -17p*3 + 9p*2. Determine kq(c) + 4o(c). 4c*3 Let b(w) = -5w3 - w2 - 5w. Let u(a) be the second derivative of a5/20 + a3/6 - 22a. Calculate b(d) + 6u(d). d3 - d2 + d Let l(f) = -2f*2 - 5f + 5. Let w = -5 - -9. Let z(t) = -4 - t + 4t + t + 8t2. Let j(s) = -s2. Let n(q) = -6j(q) - z(q). What is wl(p) - 5n(p)? 2p*2 Suppose 5y = -3h - 59, 3y - 2y - 4h - 2 = 0. Let n(w) = -2w3 + 5w*2 + 5w + 3. Let l(p) = p*3 - 2p*2 - 2p - 1. What is yl(r) - 4n(r)? -2r3 - 2 Let h(y) = -4y + 4. Let u(x) = -x - 3. Let f(r) = -4r - 10. Let n(t) = -2f(t) + 7u(t). Determine 4h(l) + 14n(l). -2l + 2 Let p(k) = k*2 - k. Let q(b) = -9b*3 - 3b*2 + b. Calculate p(z) + q(z). -9z*3 - 2z*2 Let h(x) = -3x*2 + 5. Let t(r) = -11r*2 + 6r + 8. Let j = 4 - -3. Let l(q) = -12q2 + 7q + 8. Let k(u) = jt(u) - 6l(u). What is 8h(a) - 5k(a)? a*2 Let r(n) = 35n. Let y(u) = -1716u. What is 198r(t) + 4y(t)? 66t Let l(m) = 26m3 + 2m*2 - 2m. Let z(j) = -j*2 + j. Calculate l(b) + 2z(b). 26b3 Let f(x) = 7x*2 - 5x + 3. Let n(h) be the third derivative of 2h5/15 - h4/4 + h3/2 - 6h*2. What is 6f(j) - 5n(j)? 2j*2 + 3 Let z(b) = 2b*3 + 2b*2 - 5b + 2. Let i(j) = j*3 + 3j*2 - 6j + 3. Determine 2i(g) - 3z(g). -4g3 + 3g Let d(p) = -4p - 13. Let q(z) = -5z - 14. Calculate -3d(c) + 2q(c). 2c + 11 Let h(l) = -5l*2 - 3l - 5. Let z(y) be the third derivative of 7y5/30 + y4/3 + 7y*3/3 + 7y*2. Let k be (3/(-2))/(1/2). What is kz(f) - 8h(f)? -2f*2 - 2 Let p(i) = 4i*3 - 5i*2 + i + 6. Let m(u) = -9u*3 + 10u*2 - 2u - 13. Calculate -6m(y) - 13p(y). 2y3 + 5y*2 - y Let q(a) = 8a*2 + 8a + 6. Let g(y) = 7y2 + 7y + 5. What is 7g(o) - 6q(o)? o*2 + o - 1 Let v(q) = -4q*3 + 3q*2 + 6q. Let x(p) = -5p3 + 4p*2 + 6p. Give 4v(j) - 3x(j). -j*3 + 6j Let t(o) be the second derivative of o5/20 - o4/12 + o3/6 - o2/2 + 2o. Let f(m) = m3 - 4 - 2m*2 + 7m*3 + 2m - 4m3. Determine f(c) - 2t(c). 2c3 - 2 Suppose 5u - 20 = 15. Let a(j) = j*2 + j - 2. Let c(l) = 3l*2 + 2l - 5. Calculate ua(k) - 3c(k). -2k2 + k + 1 Let h(p) be the third derivative of 11p*5/60 - 23p4/24 + p2. Let n(s) = 2s2 - 4s. Calculate 6h(k) - 34n(k). -2k2 - 2k Let l(g) = g2 - 6. Let q(x) = -x. Let z be q(5). Let r(y) = -y2 + 5. Let n be (2/4)/((-2)/16). Let i = -2 + n. What is ir(f) + zl(f)? f*2 Let c(f) = -f. Let i(w) = -5w + 1. What is -4c(t) + i(t)? -t + 1 Let l(y) = -3y*3 - 2y*2 + 3y - 3. Let z(r) = -r. What is l(f) + 3z(f)? -3f*3 - 2f*2 - 3 Let f(a) = -84a - 2. Let z(c) = 2604c + 63. Determine 63f(o) + 2z(o). -84o Let n(y) = 6y2 + 5y - 1. Let x(f) = 11f2 + 9f - 3. Give 5n(z) - 3x(z). -3z2 - 2z + 4 Let v(d) = 20d. Let f(j) = 7j. Calculate -20f(b) + 6v(b). -20b Let z(a) = -a - 8. Let x(v) = 2v + 12. Give -5x(h) - 8z(h). -2h + 4 Let f(p) = 5p + 21. Let x(u) = -3u - 10. Calculate -6f(s) - 11x(s). 3s - 16 Let k(d) = d*3 + 27d2 - d + 2. Let p(u) = -u3 - 27u2 + 2u - 3. Calculate -3k(i) - 2p(i). -i*3 - 27i*2 - i Let b(u) be the first derivative of 3u*3 - 5 + 4 + 3. Let z(d) = 5d*2. Give 3b(x) - 5z(x). 2x*2 Let z(m) be the second derivative of -7m*4/6 - 7m*3/3 - 16m. Suppose 4i + i - 25 = 0. Let k(w) = -9w*2 - 9w. Give iz(d) - 8k(d). 2d2 + 2d Let y(r) = 7r - 5. Let n(z) = -z. Calculate 5n(h) + y(h). 2h - 5 Suppose 0 = 5x - 11x - 24. Let w(l) = -5l*2 - 1. Let k(d) = 1 - 6d*2 + 20d*2 + 2. Determine xk(b) - 11w(b). -b2 - 1 Let w(i) = -16i*2 + 9i + 10. Let l(b) = -5b2 + 3b + 3. What is -7l(o) + 2w(o)? 3o2 - 3o - 1 Let d(k) be the second derivative of -k4/12 - k3/6 + k*2/2 - 59k. Let b(g) = -g3 - g2 + g - 1. Let l be b(-2). Let h(i) = -i*2. Give ld(j) - 2h(j). j2 - j + 1 Let c(g) = -7g*2 - 10g - 5. Let p(b) = 8b2 + 10b + 6. Calculate 6c(h) + 5p(h). -2h2 - 10h Let k(i) = -5i3 - 6i - 6. Let g(y) = y*2 - 7y + 6. Let r be g(4). Let o(x) = 4x3 + 5x + 5. What is ro(w) - 5k(w)? w*3 Let q(v) = 4v*2 - 6v + 6. Let u(i) = -i*2 + i - 1. Let n = -45 - -44. What is nq(o) - 5u(o)? o2 + o - 1 Let p = 9 + 7. Let r(t) = t*	{ "pile_set_name": "DM Mathematics" }
en 194 is divided by 39? 38 What is the remainder when 353 is divided by 73? 61 What is the remainder when 45 is divided by 13? 6 What is the remainder when 2690 is divided by 193? 181 Calculate the remainder when 1414 is divided by 19. 8 Calculate the remainder when 3420 is divided by 1140. 0 What is the remainder when 324 is divided by 125? 74 Calculate the remainder when 611 is divided by 68. 67 What is the remainder when 74 is divided by 29? 16 Calculate the remainder when 796 is divided by 100. 96 What is the remainder when 5062 is divided by 83? 82 What is the remainder when 742 is divided by 123? 4 Calculate the remainder when 137 is divided by 50. 37 What is the remainder when 914 is divided by 50? 14 Calculate the remainder when 63 is divided by 36. 27 Calculate the remainder when 1030 is divided by 45. 40 What is the remainder when 160 is divided by 15? 10 Calculate the remainder when 1479 is divided by 4. 3 Calculate the remainder when 637 is divided by 174. 115 Calculate the remainder when 2675 is divided by 380. 15 What is the remainder when 173 is divided by 3? 2 What is the remainder when 569 is divided by 94? 5 What is the remainder when 192 is divided by 30? 12 What is the remainder when 108 is divided by 45? 18 What is the remainder when 205 is divided by 8? 5 What is the remainder when 462 is divided by 84? 42 What is the remainder when 1003 is divided by 260? 223 Calculate the remainder when 105 is divided by 6. 3 What is the remainder when 315 is divided by 46? 39 Calculate the remainder when 248 is divided by 242. 6 What is the remainder when 2216 is divided by 19? 12 What is the remainder when 602 is divided by 50? 2 What is the remainder when 2470 is divided by 8? 6 What is the remainder when 916 is divided by 92? 88 Calculate the remainder when 98 is divided by 17. 13 Calculate the remainder when 55 is divided by 27. 1 Calculate the remainder when 1524 is divided by 707. 110 What is the remainder when 252 is divided by 16? 12 Calculate the remainder when 1007 is divided by 72. 71 Calculate the remainder when 398 is divided by 49. 6 Calculate the remainder when 31 is divided by 6. 1 Calculate the remainder when 240 is divided by 46. 10 What is the remainder when 193 is divided by 126? 67 What is the remainder when 63 is divided by 22? 19 What is the remainder when 1191 is divided by 197? 9 What is the remainder when 1014 is divided by 145? 144 Calculate the remainder when 296 is divided by 13. 10 Calculate the remainder when 249 is divided by 51. 45 Calculate the remainder when 985 is divided by 136. 33 Calculate the remainder when 684 is divided by 49. 47 Calculate the remainder when 84 is divided by 5. 4 What is the remainder when 178 is divided by 82? 14 What is the remainder when 1049 is divided by 44? 37 What is the remainder when 712 is divided by 38? 28 Calculate the remainder when 28407 is divided by 134. 133 Calculate the remainder when 3103 is divided by 23. 21 Calculate the remainder when 61 is divided by 17. 10 What is the remainder when 294 is divided by 99? 96 What is the remainder when 5690 is divided by 73? 69 Calculate the remainder when 1473 is divided by 82. 79 Calculate the remainder when 791 is divided by 15. 11 Calculate the remainder when 155 is divided by 52. 51 What is the remainder when 92 is divided by 64? 28 What is the remainder when 2365 is divided by 26? 25 Calculate the remainder when 886 is divided by 238. 172 What is the remainder when 624 is divided by 93? 66 What is the remainder when 404 is divided by 7? 5 What is the remainder when 248 is divided by 64? 56 What is the remainder when 15 is divided by 11? 4 What is the remainder when 676 is divided by 12? 4 What is the remainder when 76 is divided by 51? 25 What is the remainder when 31 is divided by 8? 7 What is the remainder when 9620 is divided by 283? 281 What is the remainder when 983 is divided by 207? 155 What is the remainder when 2400 is divided by 92? 8 Calculate the remainder when 490 is divided by 46. 30 Calculate the remainder when 305 is divided by 37. 9 Calculate the remainder when 22823 is divided by 24. 23 What is the remainder when 116 is divided by 33? 17 Calculate the remainder when 25020 is divided by 17. 13 What is the remainder when 259 is divided by 105? 49 Calculate the remainder when 59 is divided by 57. 2 Calculate the remainder when 131 is divided by 11. 10 Calculate the remainder when 1057 is divided by 209. 12 Calculate the remainder when 75 is divided by 38. 37 Calculate the remainder when 1090 is divided by 26. 24 What is the remainder when 27 is divided by 15? 12 What is the remainder when 404 is divided by 103? 95 What is the remainder when 486 is divided by 167? 152 What is the remainder when 178 is divided by 63? 52 What is the remainder when 2789 is divided by 134? 109 Calculate the remainder when 317 is divided by 14. 9 Calculate the remainder when 339 is divided by 69. 63 Calculate the remainder when 45 is divided by 4. 1 What is the remainder when 259 is divided by 86? 1 What is the remainder when 4550 is divided by 2271? 8 What is the remainder when 431 is divided by 147? 137 Calculate the remainder when 259 is divided by 44. 39 Calculate the remainder when 17338 is divided by 170. 168 What is the remainder when 138 is divided by 28? 26 What is the remainder when 488 is divided by 163? 162 What is the remainder when 312 is divided by 73? 20 What is the remainder when 1677 is divided by 40? 37 Calculate the remainder when 6685 is divided by 16. 13 Calculate the remainder when 5718 is divided by 130. 128 What is the remainder when 74 is divided by 30? 14 What is the remainder when 207 is divided by 19? 17 What is the remainder when 227 is divided by 62? 41 What is the remainder when 280 is divided by 19? 14 What is the remainder when 153 is divided by 37? 5 Calculate the remainder when 7418 is divided by 225. 218 What is the remainder when 1376 is divided by 342? 8 What is the remainder when 812 is divided by 154? 42 Calculate the remainder when 58 is divided by 10. 8 Calculate the remainder when 167 is divided by 14. 13 What is the remainder when 31 is divided by 19? 12 Calculate the remainder when 1564 is divided by 157. 151 What is the remainder when 21114 is divided by 103? 102 Calculate the remainder when 340 is divided by 172. 168 What is the remainder when 957 is divided by 192? 189 Calculate the remainder when 271 is divided by 7. 5 Calculate the remainder when 527 is divided by 173. 8 What is the remainder when 559 is divided by 536? 23 What is the remainder when 4777 is divided by 26? 19 Calculate the remainder when 276 is divided by 72. 60 What is the remainder when 13 is divided by 11? 2 What is the remainder when 209 is divided by 10? 9 Calculate the remainder when 780 is divided by 98. 94 What is the remainder when 492 is divided by 9? 6 What is the remainder when 364 is divided by 160? 44 Calculate the remainder when 530 is divided by 176. 2 Calculate the remainder when 536 is divided by 192. 152 Calculate the remainder when 504 is divided by 102. 96 Calculate the remainder when 327 is divided by 22. 19 Calculate the remainder when 14641 is divided by 4877. 10 What is the remainder when 202 is divided by 63? 13 Calculate the remainder when 2173 is divided by 75. 73 Calculate the remainder when 9 is divided by 7. 2 Calculate the remainder when 124 is divided by 41. 1 What is the remainder when 12237 is divided by 68? 65 What is the remainder when 1070 is divided by 37? 34 What is the remainder when 4443 is divided by 247? 244 What is the remainder when 2409 is divided by 2404? 5 What is the remainder when 10678 is divided by 60? 58 Calculate the remainder when 24 is divided by 4. 0 What is the remainder when 5223 is divided by 39? 36 Calculate the remainder when 326 is divided by 39. 14 What is the remainder when 2189 is divided by 10? 9 What is the remainder when 44 is divided by 9? 8 Calculate the remainder when 442 is divided by 58. 36 Calculate the remainder when 258 is divided by 15. 3 Calculate the remainder when 5121 is divided by 5121. 0 What is the remainder when 87881 is divided by 254? 251 Calculate the remainder when 663 is divided by 70. 33 What is the remainder wh	{ "pile_set_name": "DM Mathematics" }
3 Expand (4 - c - 4)(1 - 1 - 1) - 204c + 9 - 9 + 47c. -156c Expand (4 - 1 + 0)(-4i*3 + 2i*3 + 4i*3) + 3i*3 + 0i*3 - 7i*3 + 72i*2 - 81i2 - i3 - 2i3. -i3 - 9i*2 Expand -116 + 25 - 43x + 41x + (2x + 2x - 3x)(3 - 4 + 0). -3x - 91 Expand (4b2 + 15b2 + b2)(7b + 16 - 16). 140b3 Expand ((q - 3q + 0q)(-2 + 2 - 1) + q - 2q + 3q)(33q + 54q + 45q + 2). 528q2 + 8q Expand (-69u - 44u + 13u)(-1 + 0 + 2)(0 + 2 + 1). -300u Expand q*3 + 3q*3 - 6q3 + (q2 + 0q + 0q)(-39q + 76q + 17 - 38q). -3q3 + 17q*2 Expand (0u*2 - 4u*2 + 5u*2)(-3 - 2 + 3) - 16 + 16 + 5u2 + 10u - 10u + 2u*2. 5u*2 Expand (0s*2 - 55s - 2s2 - s)(2s - s + 0s). -2s3 - 56s*2 Expand 54n - 44n5 - 54n + (4n5 - 3n5 + n5)(-4 - 3 + 3). -52n*5 Expand (2w*2 - 11 + 11)(-11w - 2w + 2w)(3w + 3 + 12 - 8). -66w*4 - 154w*3 Expand ((3 - 1 - 3)(2b + 2b - 6b) - 3b - 3b + 7b + 195 - 195 - 116b + b + 4b - 3b + (3 + 0 - 2)(-5b + 2b + 5b))(b + 3b - 5b). 109b2 Expand -u4 - u5 + u4 + (-3u*2 + 2u*2 - 5u*2)(95u - 95u + u*3). -7u*5 Expand (5m + 2m - 3m)(1 - 4 + 1)(19m4 - 165 + 165). -152m*5 Expand (s + s - 3s)(-4s*2 + 3s2 - s2) - 9s3 - 5s*3 + 12s*3 + (-2s2 - s2 + 2s2)(3s + s - 2s). -2s3 Expand (0 + 6 - 3)(-6 + 2 + 2)(2 + 1 - 6)(10m - 15 - 11m - 6). -18m - 378 Expand (-8z*3 - 19z*2 + 19z*2)(-1 - 13 - 1). 120z3 Expand (10 - 6 + 11o - 4o)(2 + 0 - 5)(5o*3 - 5o3 - o4). 21o5 + 12o4 Expand d2 - 4d2 + 5d*2 + (-9 + 9 + 15d)(-3 + 2d + 3). 32d2 Expand (-3m*3 + 5m*3 - 4m*3)(5809 + 0m - m2 + m - 5806 + (0 + 0 - 2m)(3m - 3m + m)). 6m*5 - 2m*4 - 6m*3 Expand (5i*3 + 0i*3 - 3i*3)(-512 - 256 - 1700 + 235). -4466i3 Expand 5 + 4n - 5 + (1 - 1 - n)(-3 + 7 + 1) - n - 4n - 2n. -8n Expand -2w + 6w - 2w + (3w - 4 + 4)(-7 + 3 + 2) + 2 - 2 - 2w - 14 + 44 - 5w - 26. -11w + 4 Expand -j - 2j3 + j - 236j + 236j - 55j*3 + (1 - j - 1)(-j*2 + 0 + 0). -56j*3 Expand (-3l*3 + 2l*2 - 2l*2)(-2l + 6l - 2l) + 3071 - 3071 - 16l*4. -22l*4 Expand (-c + 0c + 3c)(-4c2 + 3c*2 + 3c*2) - 14c*3 - 14c*3 - 1 + 13c + 31c3. 7c*3 + 13c - 1 Expand (9y - 8476 + 8476)(3y2 - 2y*2 - 2y*2). -9y3 Expand (w2 + 47w2 + 122w*2)(w*2 + 0w*2 - 3w*2). -340w*4 Expand (-13q - 3q + 54q)(0 + 0 + 3) + 5q - 2q - 4q. 113q Expand (3q - 4q + 3q)(-226 - 129q*3 + 226) + (-q - 2q*2 + q)(q*2 + 0 + 0). -260q*4 Expand -3f*3 + 2f*3 - 2f*3 + (5f + 5 - 5)(5 - f + 1 - 5)(f + 5f + f). -38f*3 + 35f2 Expand (-b5 - 14976b2 + 14976b*2 + 116b*3)(1 + 2 - 2)(3 - 5 - 3). 5b*5 - 580b*3 Expand (-1 - q + 1)(-10q2 + 168q*2 + 19q*2) - 2q - q*3 + 2q. -178q3 Expand (-13 + 8c + 13)(-673c*2 + 673c*2 + 74c*3). 592c4 Expand g4 - 5g4 + 5g*4 + (g - 6g + 4g)(0 + 0 + 2)(-2g*2 + 2g*2 + 2g*3) + (-2g*2 + 3 - 3)(3g2 + g2 + 4g*2). -19g*4 Expand (5 - 5 - 22z*3)(-z + 0z + 2z) + 2z - 2z + z*4 + (-z + 0z + 0z)(-4z3 + 5z*3 - 3z*3). -19z*4 Expand (3m - 5m + 4m)(-20m - 40m - 45m - 27m). -264m2 Expand (y3 - 3y3 + 6y*3)(11 + 13y - 11) + 6y*4 + 13y - 13y. 58y*4 Expand 29t*3 + 45t*3 - 69t*3 - 6t*4 + 3 + (-2t - t*4 + 2t)(-2 + 2 - 1). -5t*4 + 5t*3 + 3 Expand (6a*2 - 6a + 6a)(4a2 + 2a*3 - 4a2) + a5 - 1 + 0 - 2a5 + 3a*5 - 3a + 1 + 3a. 14a*5 Expand (-3d*3 - 3d*3 + 4d*3)(-2d + 4d + 7d) + (-4d*2 + 2d*2 + 4d*2)(-d*2 - 2d*2 + 4d*2) - 5d*4 + 5d*4 - 3d*4. -19d*4 Expand (-g + 3g - g)(1 - 6 + 7)(-4 - g + 4)(-g3 - g3 + 3g*3 + (g + 0g + g)(-g2 - 3g*2 + 6g*2) + 4g*3 - 4g3 - g3 + 0g - g3 + 0g). -6g5 Expand (-3 + 3 + 6a)(3 - 6 - 1)((2 - 7 + 1)(3 - 2 - 3) + 4 + 0 - 5). -168a Expand (2 - 5 + 0)(-6q - 2q + 0q)((-q4 - 2q*4 + 5q*4)(3 - 2 - 6) - 2q4 - 5q + 5q). -288q*5 Expand -6 - 5d*3 + 6 + (-2d*2 + 4d - d + 7d3 - 6d*3)(-1 - 1 + 1). -6d3 + 2d*2 - 3d Expand (2v + 0v - v)(-7 - v + 7) + (v + 0v - 2v)(2v - 4v + 0v) + (1 - 3 + 1)(-410 - 310v2 + 410). 311v*2 Expand (3w + w - 2w)(-4w - w + w) - 2w*2 + 3w*2 - 3w*2 - 2 + 2 + 3w*2 + (2w - 2w + 3w)(-5w - w + 5w) + (-w - 2w + w)(0w - w - w). -6w2 Expand (8 - 2 + 5 + 0)(-2j + 3j - 3j)(-69 - 14 + 10). 1606j Expand -14q*5 + 7q*5 - 8q*5 - 3q*5 + 0q5 + q5 + (q + 5 - 5)(q4 + 0q*4 - 2q4) + (-q2 - 2q4 + q2)(-2q + 4q + 0q). -22q*5 Expand (-y + 0y + 2y)(y*2 + 2y*2 - 4y*2) + 2y3 + 3 - 3 + y3 + y3 + y3. 4y3 Expand (16 - 33 + 13)(0m2 + 2m*2 + 0m*2)(0 + 0 - 3m). 24m*3 Expand (-3m - m + 5m)(67m2 - 123m*2 - 65m*2 + 1). -121m*3 + m Expand 89u*4 - 76u*4 + 106u4 + (u4 - 2u2 + 2u*2)(-3 - 1 + 5) - 2u3 + 2u3 - u4. 119u4 Expand (4j*3 - 5j*3 + 4j*3)(-3 + 3 + j) + 1354j - 1354j - 56j4. -53j*4 Expand (-2d - 2d + d)(-3d3 + 2d*3 + 4d*3) + (0d + d + 0d)(d*3 - 2d*3 + 0d*3). -10d*4 Expand (0y - 2y - 3y)(6y - 6y - y)(-y*3 + 0y + 0y). -5y*5 Expand (9u - 16u - 45u)(6 - 5 + 1). -104u Expand (-1 - x - x + 5)(44 + 24x - 44)(-2 + 3 + 2). -144x*2 + 288x Expand (-2x2 - 34x*2 + 8x*2)(x2 - x2 + x*2)(-x - 2x + 14x). -308x5 Expand (-4n + n + n)(14 + 5n*3 - 14) + (2n*2 - 6n*2 + 3n*2)(4n2 - 2n + 2n). -14n*4 Expand -46 + 46 + 2u + (30 + 14u - 30)(-1 + 1 - 1). -12u Expand (-3w + 4w + 20w)(-5w - 4w + 2w)(-3 + 3 - 1). 147w*2 Expand 3t - t - t + 0t + 2t + 0t - t - t + t + (t - 5t + 3t)(3 - 1 + 0) + t + 0t + t + 0 + 0 + 2t + 23t - 83t - 32t. -88t Expand (10 - 10 - 11o)(-5 + 2o2 - 4o - 4o + 7o). -22o3 + 11o*2 + 55o Expand (-6d - 22 + 22)(-16d + 124 - 124). 96d*2 Expand (-36b + 96b - 50b)(-6 + 8 + 8). 100b Expand (j - 1 + 1)(-2j - 1 + 1) + ((4 - 5 + 2)(-j + 4j - 2j) - 395 + 395 - 11j)(-7 + 6j + 7). -62j2 Expand 4l - 4l + l2 + (-l + 3l - 4l)(-1 - l + 1) + 0l2 + l2 - 2l*2 - 51l*2 + 202l*2 + 364l*2. 517l*2 Expand (0i + i + i)(-i4 + 0 + 0 + (-5i + i + 2i)(-1 + 1 - 2i3) - 8i4 + i4 - 3i4). -14i*5 Expand (8 - 4 - 5 - 19d*2)(3 - 5 + 1). 19d2 + 1 Expand (6 + 2 - 1)(-34r5 + 433r*2 - 433r*2). -238r*5 Expand (0 + 2 + 6)(2t5 + 0t*5 + 2t*5) - 2t*4 + 2t*5 + 0t*4 - 2t*4. 34t*5 - 4t*4 Expand -24 - 28 - 23 + 75 + 800m*3 + (0m + 0m - 2m)(4m*2 + 0m*2 - 3m*2). 798m*3 Expand (-4 + 2 + 1)(-16p4 - 19p*4 + 9p*4)(-3p - 3p + 4p)(5 - 1 - 2). -104p5 Expand (-2 + 0 + 3)(31 + 16 + 6)(2i*2 + 5 + 2i + 2i - 3). 106i*2 + 212i + 106 Expand -530j + 326j - 337j + (1 + 3 - 5)(-j - 3 + 3). -540j Expand -3n*5 + 10n*5 - 4n*5 + (2 - n - 2)(-2n4 - 4n*4 + 4n*4) + (2n2 + n2 + 4n2)(n*3 - 2n*3 + 0n*3). -2n*5 Expand (-24h*3 + 30h*3 + 11h*3)(-2h + 4h + 4 + 1). 34h4 + 85h*3 Expand (-4r*5 + 7r*5 - 4r*5)(-6 + 32 + 70). -96r5 Expand (3y - 2y + 2y)(3y + y - 5y - 11y + 6y - 12y + (3y - 5y + 0y)(-4 + 3 + 3)) + 1 - 1 + 2y2 - y2 - 1 + 1. -65y*2 Expand (-2p + 3p + p)(-2p + 6p - 2p) + (-p + 5p - 2p)(1 + p - 1) + 2 + p*2 - 2 + 1397p + 307p2 - 1397p. 314p2 Expand (1 - 3v*2 - 1)(305 - 48 + 8 - 2 + 4 - 3 + (0 + 1 + 1)(-3 + 2 + 3)). -804v*2 Expand (k - k + 2k*2)(3 - 3 + 2) + (-482k + 486k + 320k)(-4k + 4k + 2k). 652k*2 Expand (3 - 2 + 1)(16h - 28h + 26h)(0 - 2 + 0)((0 + 3 - 2)(-4h + 5h - 2h) + 3h + 0h - h). -56h*2 Expand (8r - 2r + 2r)(-1968 - 65r + 1968)(0 + 0 + r). -520r*3 Expand (2 - 1 + 1)(-9s + 10s - 10s) + (0 - 14 - 7)(2s - s + 0s). -39s Expand (-9a + 2a - 13a)(a + a + 2a) - 2a2 + 0 + 0. -82a*2 Expand ((3 + 2i - 3)(0 - 1 + 0) + 4i + 3i - 3i)(-7i*3 + 5i*3 - 7i*3). -18i*4 Expand (-2r + 2r - 4r)(0 + r2 + 0) + r3 + r2 - r2 + r3 + 4r3 + r3. 3r3 Expand (0j + 5j - 4j)(8j + j -	{ "pile_set_name": "DM Mathematics" }
/(-6)). -1 ((-6)/(-378))/(1/183) 2/21 What is the value of ((-1)/(-2))/((-2)/((-8)/(-3)))? -2/3 What is the value of 4/4860? 0 Calculate 35/(-15)(-168)/(-196). -2 Calculate 15/11013/((-26)/4). -3/11 (-84/(-840))/((-18)/45) -2/21 What is 1/(-4)((-60)/1)/(-6)? -5/2 What is the value of (-2)/(-45/10-1)? -1 Evaluate ((3/5)/((-99)/110))/(-1). 2/3 What is ((-16)/12)/(4/(-15))? 5 What is 6/435/(-21)-2? 5 What is 107/((-98)/14)? -10 ((-2)/5)/((-56)/840) 6 What is 1/(-2)32/8? -2 What is 4/10(-9)/(-27)? 2/15 What is ((-164)/328)/((4/2)/(-16))? 4 Calculate 7/((-294)/12)2. -4/7 Calculate 2(-10)/(80/12). -3 What is 8/132-1-3? 2/11 What is (30/67527)/(1/(-5))? -6 What is the value of (3/3)/(49/(-14))? -2/7 Evaluate (((-28)/(-10))/7)/(7/10). 4/7 What is the value of (1/(-3)-2)/(24/36)? 1 What is 5/(((-182)/13)/(-14))? 5 What is the value of 3/(36/4)-9? -3 Calculate 39/(-26)((-16)/6)/(-2). -2 What is the value of ((48/(-6))/8)/1? -1 (-83/(-36))/(2/9) 3 2(-1)/66-6 2/11 What is 1((-11)/2)/(-11)1? 1/2 What is the value of 8/4(-1)/2? -1 8/106/(-8) -3/5 Evaluate (70/84)/((-2)/3). -5/4 (312/6)/(-14) -3/7 (-5)/22/53 -3 What is -11/6-2? 1/3 What is (((-9)/2)/9)/(-4)? 1/8 1(1-1)/((-12)/(-36)) -3 Calculate (-5)/((-5)/(-1))2. -2 What is 3/(-3)152/6? -5 What is the value of (-1)/2-117/(-51)? -1/6 Calculate ((-2)/20)/(62/(-155)). 1/4 Calculate ((-9)/(405/10))/((-1)/9). 2 Calculate 1(-5)/(-2)(-60)/(-30). 5 ((-2)/(-7))/(117/91) 2/9 (-1(-3)/(-6))/(4/8) -1 Calculate ((-504)/(-224))/((-3)/(-12)). 9 Calculate ((-14)/(-441)7)/((-1)/(-3)). 2/3 What is the value of -2(-6)/660-10? -2/11 Evaluate (75/6)/(-5)16/(-90). 4/9 18/(-81)2/4 -1/9 1/54/((-40)/(-10)) 1/5 ((-54)/12)/(15/(-10)) 3 1-11/((-6)/(-6)) -1 What is (8/(-3))/((-128)/48)? 1 (-4)/(-9)54/6 4 Calculate 112/(-128)6/7. -3/4 What is ((-5)/35)/(6/(-42)5)? 1/5 What is the value of 7((-18)/(-21))/(-3)? -2 Evaluate (4/(-24)2)/((-3)/(-18)). -2 What is (-2)/((5/1)/5)? -2 What is 4/3(-3)/7? -4/7 (2(-2)/(-28))/((-11)/(-22)) 2/7 (-528/35)/14 -2/7 ((-465)/30)/312/6 -1/6 What is the value of 3/(18/10)(-72)/(-60)? 2 (2/4)/(4/8) 1 (-3)/(-7)((-112)/(-21))/(-4) -4/7 ((-2)/6)/((-25)/15) 1/5 9/18213 3 ((-129)/(-43))/(2/(-2)) -3 What is the value of (8/(-20))/(336/210)? -1/4 Evaluate ((-253)/11)/232/(-6). 1/3 (-283)/(-2830)10/(-4)-3 3/4 Evaluate -14(-3)/(-12)50/(-350). 1/2 Evaluate (-3(-3)/(-15))/(231/165). -3/7 Calculate 2/412/15. 2/5 (((-8)/50)/((-18)/(-45)))/(-3) 2/15 What is the value of (3/(-4))/(((-270)/(-48))/(-15))? 2 1/(-8)(-8)/4 1/4 Calculate (-56)/7(-9)/(-24). -3 Evaluate (-3)/((-30)/4)(-15)/(-12). 1/2 Evaluate 2(-24)/20(-145)/58. 6 2((-3)/9)/(34/51) -1 8/((-56)/(-21))(-1)/5 -3/5 Calculate (2/(-18))/((-62)/(-279)). -1/2 Calculate 10/1((-24)/(-105))/4. 4/7 What is the value of ((-48)/(-24))/((-2)/(-1))? 1 (-8)/(-20)5/(-3) -2/3 Calculate 4/(-2)5/(-15)1. 2/3 Evaluate ((-3)/2)/(13/(-26)). 3 What is (1/(-24))/((-161)/1449)? 3/8 Calculate (((-28)/(-16))/(-7))/((-11)/(-22)). -1/2 What is (((-385)/(-22))/7)/((-2)/4)? -5 What is 4/510/(-44)? -2/11 What is 2(-2)/10(-210)/(-196)? -3/7 What is (10/65)/(-12/(-2))? 2/13 What is the value of 6(-2)/(-12)-1? -1 What is (-5)/(-10)48/40-5? -3 120/(-336)(-8)/10 2/7 What is the value of (16/6)/(((-198)/(-27))/(-11))? -4 What is 19/(3/(-1))? -3 What is ((-2)/(-16))/((-12)/(-16))? 1/6 What is the value of (-10)/5(728/16)/(-13)? 7 What is ((-3)/(-9))/(6/36-2)? -1 What is the value of (((-18)/(-60))/(-1))/(3/(-8))? 4/5 What is the value of 33/1820/(-35)? -2/7 (-8)/122/(-6) 2/9 What is -96/(-18)(-1)/(-3)? 1 What is the value of ((-5)/15)/((-1)/(-6))? -2 ((-1)/10)/((12/(-16))/(-3)) -2/5 50/10(-10)/50 -1 46/2312/3 8 Evaluate (-3)/((-9)/(-4))39/(-130). 2/5 What is (-1)/((-3)/(120/(-50)))? -4/5 Evaluate -716/(-7). 6 48/56(-2)/6 -2/7 What is (-8)/(-16)15/54? 6 Calculate 3/(-9)2(-6)/(-4). -1 Evaluate (-72/7)/13. -2/13 What is 3/(-33/9)? -3 Evaluate (4/(-8))/((-2)/(-8)). -2 What is (-10)/((-2)/7(-56)/8)? -5 What is (-1)/(30/(-80))6/4? 4 What is the value of (1/(-4))/((-28)/1008)? 9 What is (28/(-28))/(16/(-2))? 1/8 (12/32-4)/(54/8) -2/9 What is ((-1)/4)/(335/268)? -1/5 Evaluate 57/(-140)-8. 2 Evaluate (((-16)/(-20))/(-2))/(3/(-5)). 2/3 What is the value of ((-2)/(-4))/((-20)/(-24))? 3/5 What is -3(-5)/(-30)12? -6 What is (-8)/(-2)(-5)/5? -4 ((-48)/20)/(((-54)/30)/3) 4 Calculate (67/2010)/(1/3). 1/10 Calculate 6((6/12)/(-1))/1. -3 Calculate (-20)/30(45/(-33))/(-5). -2/11 What is ((-6)/(-10))/(29/(-145))? -3 What is the value of ((-64)/96)/((-6)/(-27))? -3 7(8/6)/((-168)/108) -6 Calculate (((-23)/23)/(2/6))/(-2). 3/2 1/((-4)/1)(-16)/4 1 What is the value of (-50)/6044/(-55)? 2/3 ((-1)/(-10))/((7/(-6))/7) -3/5 What is the value of (1/(-2))/(((-18)/4)/(-3))? -1/3 What is (16/(-84))/(70/(-245))? 2/3 What is the value of ((-26)/(-182))/((-1)/(-2))? 2/7 What is ((-6)/3)/((-1)/2)? 4 What is the value of (32/(-20))/((-7)/(175/(-10)))? -4 (12/(-36))/((-2)/(-24)) -4 What is (6/12)/(-1)4? -2 What is the value of 20/(-4)1/(-1)? 5 What is (((-126)/(-9))/(-42))/((-1)/(-6))? -2 Evaluate 4/(4/3)64/(-96). -2 (5/(-40)4)/(3/(-18)) 3 What is (330/99)/((-4)/6)? -5 ((-4)/(-2))/(32/(-36)-3) 3/4 ((-2)/2)/(-220/32) 4/5 (1/((-6)/(-2)))/(7/(-84)) -4 What is (((-4)/(-5))/(-2))/((-18)/(-6))? -2/15 Evaluate (8/((-64)/14))/((-1)/4). 7 What is the value of (-14)/1224/(-14)? 2/3 What is (1(-1)/(-10))/((-25)/50)? -1/5 ((-1)/1)/(53/53) -1 Evaluate 21/35(-2440)/122. -8/7 Evaluate ((-12)/10)/(28/(-70)). 3 What is the value of (-3)/2(-96)/(-72)? -2 Evaluate ((-4)/4)/(2/8). -4 What is the value of (5/(-15))/((-2)/(12/(-10)))? -1/5 What is (-6)/81/(-28)-14? -3/8 4/(8/5)(-24)/12 -5 Calculate ((-2)/36)/((-17)/(-68)). -2/9 Evaluate (-84)/(-14)1/(-3)1. -2 What is the value of (54/(-75))/310/(-6)? 2/5 What is the value of (8/(-28))/((-5)/((-70)/2))? -2 What is (16/(-84))/(4/(-14))? 2/3 What is the value of -1(4/(-6))/(2/3)? 1 Calculate (140/80)/((-5)/(-20)). 7 What is the value of ((120/(-16))/(-15))/((-2)/8)? -2 What is the value of (2/(-4))/(28/24)? -3/7 Calculate -4((-8)/56)/((-6)/63). -6 What is the value of (3/(-9))/(2/2)? -1/3 -9((-20)/(-45))/2 -2 Evaluate 0/((10/(-1))/(-5)). 0 Calculate ((-4)/24)/((-4)/((-8)/(-1))). 1/3 Calculate (-12)/(-16)(-80)/(-72). 5/6 Calculate ((-1)/(43))/(2/(-4)). 1/6 What is the value of (-2)/4-36/63? 1/7 Evaluate 56/404/3. 1 Evaluate (-428)/2889(-6)/4. 2/9 Calculate (2/(-6))/((-6)/(-6)). -1/3 What is the value of (2/4)/(-333/18)? -1/11 What is (104/(-12))/((-2)/3)? 5 What is (-2)/(-35)(-147)/63? -2/15 What is ((-9)/(-2))/(57/76)? 6 Calculate (((-138)/(-28))/(-23))/(3/4). -2/7 Evaluate 63/(-9)(-8)/(-14). -4 What is ((-25)/(-5)10/25)/2? 1 Calculate 18/(-12)((-40)/(-6))/(-2). 5 What is the value of 3/10226/(-26)? -3/5 Evaluate (-70)/4218/(-5). 6 What is (2/(-6))/(8/24)? -1 What is the value of (-1(-3)/(-30))/((-2)/(-8))? -2/5 10/35/(20/6) 5 What is the value of (-3)/(-2)(16/3)/(-4)? -2 30/5(-2)/6 -2 Evaluate ((-3)/(-2)2)/(15/(-20)). -4 Evaluate (-9)/(-6)(84/(-18))/7. -1 (33/(-264))/(44/64) -1/2 Evaluate 2/(((-225)/(-10))/15). 4/3 Evaluate (-1)/((-4)/93). 3/4 32/8(-3)/(12/4) -4 Calculate 4/(-24)(-10)/(-15). -1/3 What is the value of ((-650)/195)/((-4)/(-3))? -5/2 72/10081/(-1)-4 2/7 Calculate ((-27)/18)/(72/64). -4/3 (128/(-32))/(52/(-2)) 2/13 Calculate (-30)/12(-8)/10-1. -2 Calculate (21/(-35))/(6/(-6)). 3/5 1/1861/((-671)/(-66)) 1/3 What is (-1)/(-18)(-75)/(-5)? 5/6 Calculate ((-6)/(-4))/(39(-1)/4). -2/13 (4/(-60))/(2/(-18)) 3/5 What is the value of (8/2)/(54/9)? 2/3 Evaluate (-2)/4(-28)/21. 2/3 What is the value of (4/10)/(10/254)? 1/4 (372/496)/(3/(-5)) -5/4 Evaluate (5/4)/((96/8)/(-48)). -5 What is the value of 8/(-2)(-6)/(-24)? -1 Evaluate (0/((-143)/(-11)))/(-1). 0 What is 3/(-9)0/9? 0 1/(-2)24/(-2) 6 Calculate 2/(-1)6/((-12)/4). 4 What is the value of (-2)/((4/2)/(-1))? 1 What is 4/(-3)1/((-20)/45)? 3 What is ((-10)/(-3))/(24/(-36))? -5 Calculate (-15)/10(-2)/3. 1 Evaluate (4/5)/((-4)/(-40)-4). -2 What is the value of (3*(-1)/10)/((-42)/112)? 4/5 ((-1)/(1/1))/(10/10) -1 What is the value of ((-3)/(-15))/(18/20)? 2/9 What is the value	{ "pile_set_name": "DM Mathematics" }
rob of picking 1 d and 1 r. 3/40 What is prob of picking 1 a and 2 b when three letters picked without replacement from {a: 3, b: 15}? 105/272 Three letters picked without replacement from {d: 2, i: 7, r: 6}. Give prob of picking 3 i. 1/13 What is prob of picking 2 v when two letters picked without replacement from {v: 3, r: 1, d: 5}? 1/12 Calculate prob of picking 2 t and 1 a when three letters picked without replacement from {a: 4, t: 3}. 12/35 Calculate prob of picking 2 b and 1 v when three letters picked without replacement from {i: 3, b: 10, v: 2}. 18/91 What is prob of picking 2 i when two letters picked without replacement from voibvbvovibjbojiobo? 1/57 Four letters picked without replacement from ggggagggtgtttget. What is prob of picking 3 g and 1 e? 3/65 Four letters picked without replacement from zzssszz. Give prob of picking 3 s and 1 z. 4/35 Two letters picked without replacement from ivvavvvvavvivvv. Give prob of picking 2 a. 1/105 What is prob of picking 1 i and 1 q when two letters picked without replacement from aaaiaivaqvia? 1/22 Calculate prob of picking 1 n and 3 w when four letters picked without replacement from {w: 3, n: 17}. 1/285 Four letters picked without replacement from {g: 1, y: 7, t: 3, k: 3, j: 2, m: 1}. Give prob of picking 1 t and 3 m. 0 Three letters picked without replacement from {l: 13, o: 3}. What is prob of picking 1 o and 2 l? 117/280 Calculate prob of picking 2 w when two letters picked without replacement from {f: 4, w: 2, g: 6}. 1/66 Two letters picked without replacement from uubnyxynpppxyu. Give prob of picking 1 n and 1 u. 6/91 Four letters picked without replacement from {u: 4, w: 6, p: 5}. Give prob of picking 2 w and 2 u. 6/91 Calculate prob of picking 2 p and 2 u when four letters picked without replacement from {u: 2, p: 18}. 3/95 What is prob of picking 1 t, 1 f, and 1 v when three letters picked without replacement from ttvtvft? 8/35 Three letters picked without replacement from {v: 2, a: 5, i: 2}. Give prob of picking 1 a, 1 v, and 1 i. 5/21 Calculate prob of picking 3 b when three letters picked without replacement from ppbbybyy. 1/56 Four letters picked without replacement from wwwwwwwww. Give prob of picking 4 w. 1 Three letters picked without replacement from {l: 4, p: 6, d: 2}. Give prob of picking 1 p and 2 d. 3/110 Four letters picked without replacement from ooohoooohooohooooo. What is prob of picking 4 o? 91/204 Two letters picked without replacement from ficxrnr. What is prob of picking 1 r and 1 f? 2/21 Calculate prob of picking 2 v when two letters picked without replacement from {x: 16, v: 2}. 1/153 Calculate prob of picking 2 j when two letters picked without replacement from {d: 1, j: 7, g: 3, u: 6}. 21/136 What is prob of picking 3 c and 1 h when four letters picked without replacement from {c: 4, b: 1, s: 3, h: 6}? 24/1001 What is prob of picking 1 i and 3 w when four letters picked without replacement from whiwthiwttwt? 8/495 Two letters picked without replacement from {h: 3, q: 2, d: 5}. What is prob of picking 1 q and 1 d? 2/9 Two letters picked without replacement from {a: 5, v: 1, z: 7}. What is prob of picking 1 a and 1 v? 5/78 Two letters picked without replacement from dradrpc. Give prob of picking 1 p and 1 r. 2/21 Two letters picked without replacement from cccjxomjcocojc. Give prob of picking 2 c. 15/91 What is prob of picking 1 u, 2 s, and 1 g when four letters picked without replacement from {s: 2, p: 8, u: 2, g: 1}? 2/715 Four letters picked without replacement from {f: 3, l: 3}. Give prob of picking 4 l. 0 What is prob of picking 1 t and 2 o when three letters picked without replacement from {a: 1, f: 10, t: 3, o: 4}? 3/136 Calculate prob of picking 1 j and 1 c when two letters picked without replacement from cjcccj. 8/15 What is prob of picking 1 v and 2 t when three letters picked without replacement from ttvvvvvvvttvvtvv? 11/56 What is prob of picking 2 g when two letters picked without replacement from {q: 2, g: 10, u: 2}? 45/91 Three letters picked without replacement from zxxtxxxxzzxzz. Give prob of picking 3 x. 35/286 Four letters picked without replacement from ododoo. What is prob of picking 4 o? 1/15 Three letters picked without replacement from vttvvtvtttvt. Give prob of picking 3 v. 1/22 What is prob of picking 4 p when four letters picked without replacement from {d: 2, p: 7}? 5/18 What is prob of picking 1 o, 1 a, and 1 z when three letters picked without replacement from {l: 1, k: 1, a: 1, z: 1, o: 1}? 1/10 Three letters picked without replacement from yyyyywyywyywyw. What is prob of picking 1 w and 2 y? 45/91 Three letters picked without replacement from kvtszqtq. Give prob of picking 1 k, 1 z, and 1 s. 1/56 Two letters picked without replacement from {i: 9, u: 3}. What is prob of picking 1 i and 1 u? 9/22 Calculate prob of picking 1 h and 1 w when two letters picked without replacement from {w: 1, h: 3, u: 1, g: 2}. 1/7 What is prob of picking 2 d and 1 c when three letters picked without replacement from xddcpqt? 1/35 Calculate prob of picking 1 q, 2 w, and 1 x when four letters picked without replacement from {x: 1, w: 5, z: 1, q: 4}. 4/33 Two letters picked without replacement from {f: 4, t: 2, u: 1, y: 6, q: 4}. Give prob of picking 1 q and 1 f. 2/17 What is prob of picking 1 x and 2 q when three letters picked without replacement from {q: 2, i: 4, m: 1, x: 12}? 4/323 Two letters picked without replacement from {u: 3, y: 4, x: 1, r: 2, e: 1}. Give prob of picking 2 u. 3/55 Three letters picked without replacement from llloooooolo. Give prob of picking 3 l. 4/165 Three letters picked without replacement from {h: 1, o: 2, e: 6, q: 2}. What is prob of picking 1 q and 2 o? 2/165 Three letters picked without replacement from {n: 1, i: 1, g: 1, r: 3, t: 1}. Give prob of picking 1 t and 2 r. 3/35 Two letters picked without replacement from {e: 3, z: 15}. What is prob of picking 1 e and 1 z? 5/17 Calculate prob of picking 2 c and 1 i when three letters picked without replacement from {i: 8, z: 1, c: 3, f: 5, y: 3}. 2/95 What is prob of picking 1 n and 1 y when two letters picked without replacement from oooyoooyonoybooyy? 5/136 What is prob of picking 4 n when four letters picked without replacement from nnnnnnn? 1 Four letters picked without replacement from kkkkdkkkkkkkkkkkddnk. Give prob of picking 4 k. 364/969 Four letters picked without replacement from {e: 1, r: 14}. What is prob of picking 3 r and 1 e? 4/15 Three letters picked without replacement from {n: 1, h: 3, o: 2, s: 3, j: 6}. What is prob of picking 2 o and 1 s? 3/455 What is prob of picking 2 g when two letters picked without replacement from gggggggggggp? 5/6 What is prob of picking 1 z and 1 n when two letters picked without replacement from {z: 2, n: 17}? 34/171 Calculate prob of picking 1 w and 1 s when two letters picked without replacement from {j: 4, w: 2, o: 1, s: 1}. 1/14 Calculate prob of picking 3 j and 1 p when four letters picked without replacement from oppzprjporojoj. 4/1001 Two letters picked without replacement from {m: 10, i: 1, b: 1, n: 2, k: 1, a: 3}. Give prob of picking 1 n and 1 i. 2/153 Three letters picked without replacement from {z: 4, b: 3, k: 1, c: 1, i: 8}. Give prob of picking 1 c, 1 z, and 1 b. 3/170 Three letters picked without replacement from {r: 5, q: 5, o: 5, g: 5}. What is prob of picking 1 q, 1 r, and 1 g? 25/228 Three letters picked without replacement from ryrry. Give prob of picking 1 y and 2 r. 3/5 Calculate prob of picking 1 g and 1 o when two letters picked without replacement from {s: 5, m: 1, e: 2, g: 4, o: 2}. 8/91 Three letters picked without replacement from vvdddv. What is prob of picking 1 d and 2 v? 9/20 What is prob of picking 2 d and 1 m when three letters picked without replacement from {m: 13, d: 5}? 65/408 What is prob of picking 1 p, 1 w, 1 t, and 1 n when four letters picked without replacement from {n: 1, t: 1, d: 1, w: 12, p: 2}? 6/595 Two letters picked without replacement from vqvqvjbbjqvaqv. What is prob of picking 1 b and 1 q? 8/91 Calculate prob of picking 1 c and 1 w when two letters picked without replacement from {i: 1, b: 1, c: 2, w: 1, f: 2, v: 1}. 1/14 Calculate prob of picking 1 b and 1 p when two let	{ "pile_set_name": "DM Mathematics" }
*2 - 3t - 1 What is the y'th term of 98, 199, 300? 101y - 3 What is the u'th term of -37, -31, -25, -19, -13? 6u - 43 What is the o'th term of -80, -329, -746, -1331, -2084, -3005, -4094? -84o2 + 3o + 1 What is the m'th term of -232, -445, -658? -213m - 19 What is the m'th term of -7988, -8003, -8038, -8099, -8192? -m3 - 4m*2 + 4m - 7987 What is the k'th term of 242, 228, 206, 176, 138? -4k2 - 2k + 248 What is the k'th term of -3, -18, -57, -132, -255, -438, -693, -1032? -2k3 - k What is the k'th term of 30, 34, 22, -12, -74, -170? -k3 - 2k*2 + 17k + 16 What is the k'th term of -9509, -9510, -9511? -k - 9508 What is the v'th term of -6, -8, -6, 0, 10? 2v2 - 8v What is the f'th term of -350, -348, -346, -344? 2f - 352 What is the g'th term of 215, 431, 647? 216g - 1 What is the p'th term of 33, 64, 123, 216, 349, 528, 759? p*3 + 8p*2 + 24 What is the i'th term of 32, 60, 88, 116, 144, 172? 28i + 4 What is the k'th term of -191, -190, -183, -164, -127, -66, 25, 152? k*3 - 3k*2 + 3k - 192 What is the w'th term of 1, 11, 25, 43, 65, 91? 2w2 + 4w - 5 What is the x'th term of 214, 314, 404, 478, 530, 554, 544? -x3 + x2 + 104x + 110 What is the x'th term of -84, -83, -82, -81? x - 85 What is the d'th term of -587, -619, -653, -689, -727, -767, -809? -d2 - 29d - 557 What is the p'th term of 30, 115, 260, 465? 30p2 - 5p + 5 What is the h'th term of -112, -224, -336, -448, -560? -112h What is the a'th term of -351, -682, -1013? -331a - 20 What is the w'th term of 83, 165, 251, 341, 435, 533? 2w2 + 76w + 5 What is the m'th term of 2136, 2137, 2138? m + 2135 What is the z'th term of -180, -193, -222, -273, -352? -z*3 - 2z2 - 177 What is the p'th term of -927, -928, -929? -p - 926 What is the z'th term of -3, -2, 3, 18, 49? z3 - 4z2 + 6z - 6 What is the q'th term of -88, -73, -58? 15q - 103 What is the o'th term of 34, 32, 34, 40? 2o*2 - 8o + 40 What is the w'th term of -75, -137, -173, -171, -119, -5? 2w3 + w2 - 79w + 1 What is the y'th term of 209, 813, 1821, 3233? 202y2 - 2y + 9 What is the a'th term of 36, 140, 314, 558? 35a2 - a + 2 What is the w'th term of -54, -43, -22, 15, 74, 161, 282, 443? w3 - w2 + 7w - 61 What is the b'th term of 1057, 2119, 3181, 4243, 5305? 1062b - 5 What is the x'th term of 1470, 1473, 1476? 3x + 1467 What is the i'th term of -51, -34, 3, 66, 161, 294? i*3 + 4i*2 - 2i - 54 What is the m'th term of -671, -1345, -2033, -2741, -3475, -4241? -m3 - m2 - 664m - 5 What is the v'th term of 74, 324, 754, 1376, 2202, 3244? 2v*3 + 78v*2 + 2v - 8 What is the b'th term of 109, 428, 959, 1702? 106b2 + b + 2 What is the p'th term of 19, 68, 127, 202, 299, 424, 583? p3 - p2 + 45p - 26 What is the y'th term of -2770, -2768, -2766, -2764, -2762, -2760? 2y - 2772 What is the b'th term of 40, 54, 72, 94, 120? 2b*2 + 8b + 30 What is the i'th term of -29, -33, -51, -89, -153? -i3 - i2 + 6i - 33 What is the a'th term of 34, 268, 906, 2152, 4210, 7284, 11578, 17296? 34a*3 - 2a*2 + 2a What is the w'th term of 655, 653, 651, 649? -2w + 657 What is the s'th term of 7, 37, 87, 157? 10s2 - 3 What is the b'th term of -63, -77, -75, -51, 1, 87, 213? b3 + 2b2 - 27b - 39 What is the c'th term of 34, 137, 308, 547, 854? 34c2 + c - 1 What is the i'th term of 23, 22, 27, 44, 79, 138? i3 - 3i2 + i + 24 What is the y'th term of 338, 332, 332, 344, 374, 428, 512, 632? y3 - 3y2 - 4y + 344 What is the x'th term of -4481, -4467, -4437, -4385, -4305, -4191, -4037? x*3 + 2x*2 + x - 4485 What is the g'th term of 95, 107, 125, 149, 179, 215? 3g*2 + 3g + 89 What is the d'th term of -90, -113, -150, -201, -266? -7d2 - 2d - 81 What is the u'th term of 256, 258, 250, 226, 180, 106? -u3 + u2 + 6u + 250 What is the t'th term of -537, -1042, -1549, -2058, -2569, -3082? -t2 - 502t - 34 What is the l'th term of -168, -175, -184, -195, -208, -223? -l*2 - 4l - 163 What is the k'th term of -175, -167, -159, -151, -143? 8k - 183 What is the y'th term of -283, -570, -859, -1150, -1443, -1738? -y2 - 284y + 2 What is the m'th term of 1606, 6416, 14432, 25654, 40082, 57716, 78556? 1603m2 + m + 2 What is the v'th term of -1889, -1898, -1921, -1964, -2033, -2134, -2273, -2456? -v3 - v2 + v - 1888 What is the r'th term of 8, -55, -180, -379, -664, -1047, -1540? -2r*3 - 19r*2 + 8r + 21 What is the v'th term of -103, -101, -107, -127, -167, -233? -v*3 + 2v*2 + 3v - 107 What is the q'th term of 88, 171, 256, 343? q*2 + 80q + 7 What is the s'th term of -44, -92, -184, -332, -548, -844, -1232, -1724? -2s3 - 10s*2 - 4s - 28 What is the m'th term of -83, -142, -189, -218, -223, -198? m*3 - 66m - 18 What is the y'th term of 368, 361, 350, 335, 316? -2y2 - y + 371 What is the i'th term of 5789, 11580, 17371, 23162, 28953? 5791i - 2 What is the s'th term of 986, 3935, 8850, 15731? 983s2 + 3 What is the p'th term of 72, 107, 142, 177, 212, 247? 35p + 37 What is the d'th term of 33, 142, 329, 600, 961? d*3 + 33d*2 + 3d - 4 What is the j'th term of -239, -479, -719, -959, -1199, -1439? -240j + 1 What is the s'th term of 133, 146, 167, 196, 233? 4s2 + s + 128 What is the v'th term of 125, 125, 117, 95, 53, -15, -115? -v3 + 2v2 + v + 123 What is the x'th term of -17, 22, 131, 346, 703, 1238, 1987, 2986? 6x3 - x2 - 22 What is the h'th term of -39, -93, -161, -243, -339? -7h2 - 33h + 1 What is the q'th term of 207, 224, 243, 264, 287? q*2 + 14q + 192 What is the r'th term of 194, 198, 204, 212? r2 + r + 192 What is the b'th term of 149, 158, 179, 218, 281, 374, 503, 674? b3 + 2b + 146 What is the o'th term of -27, -50, -37, 30, 169? 3o*3 - 44o + 14 What is the k'th term of -136, -271, -406, -541, -676, -811? -135k - 1 What is the o'th term of -5122, -10243, -15364? -5121o - 1 What is the q'th term of 30323, 30325, 30327, 30329? 2q + 30321 What is the z'th term of 34, 105, 296, 667, 1278, 2189, 3460? 10z3 + z + 23 What is the g'th term of 77, 82, 89, 98, 109, 122, 137? g2 + 2g + 74 What is the a'th term of 203, 199, 193, 185, 175, 163? -a2 - a + 205 What is the k'th term of -806, -804, -802? 2k - 808 What is the l'th term of -633, -635, -637? -2l - 631 What is the l'th term of -2716, -2714, -2712? 2l - 2718 What is the x'th term of -17, -27, -43, -65? -3x2 - x - 13 What is the q'th term of -523, -529, -545, -577, -631, -713? -q3 + q2 - 2q - 521 What is the y'th term of 13, 18, 19, 16, 9, -2? -2y2 + 11y + 4 What is the z'th term of -353, -360, -371, -386, -405, -428, -455? -2z2 - z - 350 What is the n'th term of -16, -125, -298, -529, -812? n3 - 38n*2 - 2n + 23 What is the v'th term of -143, -152, -159, -164? v*2 - 12v - 132 What is the j'th term of -553, -558, -563? -5j - 548 What is the v'th term of 5, 10, 19, 32? 2v*2 - v + 4 What is the n'th term of -103, -105, -107, -109? -2n - 101 What is the d'th term of 202, 789, 1766, 3133, 4890? 195d2 + 2d + 5 What is the c'th term of -148, -151, -160, -175, -196, -223? -3c2 + 6c - 151 What is the b'th term of 108, 136, 162, 186? -b*2 + 31b + 78 What is the q'th term of -100, -211, -348, -523, -748? -2q3 - q2 - 94q - 3 What is the q'th term of 43, 179, 407, 727, 1139? 46q2 - 2q - 1 What is the u'th term of -4, 0, 18, 56, 120, 216? u3 + u2 - 6u What is the w'th term of 28, 52, 76, 100, 124, 148? 24w + 4 What is the p'th term of 115, 113, 111? -2p + 117 What is the r'th term of 34, 154, 354, 634? 40r*2 - 6 What is the f'th term of -4496, -4495, -4494, -4493? f - 4497 What is the y'th term of -58, -53, -52, -55? -2y*2 + 11y - 67 What is the k'th term of -5069, -5068, -5067, -5066, -5065? k - 5070 What is the a'th term of -36, -70, -104, -138? -34a - 2 What is the c'th term of -3, -6, -19, -48, -99, -178? -c3 + c2 + c - 4 What is the i'th term of 472, 471, 472, 475, 480? i2 - 4i + 475 What is the p'th term of -16, -35, -68, -115, -176, -251? -7p2 + 2p - 11 What is the l'th term of 26, 37, 60, 101, 166, 261? l*3 + 4l + 21 What is the s'th term of -28, -71, -116, -163? -s*2 - 40s + 13 What is the y'th term of 153, 162, 175, 192, 213, 238,	{ "pile_set_name": "DM Mathematics" }
hat is prob of sequence jbd when three letters picked without replacement from {j: 1, u: 2, b: 6, d: 3, y: 1, w: 2}? 3/455 Calculate prob of sequence sss when three letters picked without replacement from ssnnssss. 5/14 Three letters picked without replacement from {i: 6, k: 4, a: 1, f: 5}. Give prob of sequence fff. 1/56 Two letters picked without replacement from {m: 3, k: 1, g: 4, p: 2, n: 1, z: 1}. Give prob of sequence gg. 1/11 Calculate prob of sequence vq when two letters picked without replacement from {v: 1, q: 1, m: 4, p: 3, d: 2}. 1/110 What is prob of sequence lk when two letters picked without replacement from klo? 1/6 Three letters picked without replacement from {k: 15, u: 5}. Give prob of sequence uku. 5/114 Calculate prob of sequence azp when three letters picked without replacement from {h: 5, a: 1, p: 3, l: 1, i: 2, z: 1}. 1/572 Three letters picked without replacement from {r: 2, u: 1, e: 1, h: 2, b: 1}. What is prob of sequence urr? 1/105 What is prob of sequence qk when two letters picked without replacement from {q: 1, i: 1, k: 2}? 1/6 Three letters picked without replacement from {v: 1, q: 2, t: 1, d: 1, e: 2, m: 1}. Give prob of sequence tee. 1/168 Four letters picked without replacement from {x: 9}. Give prob of sequence xxxx. 1 What is prob of sequence cccc when four letters picked without replacement from ccccctcccctcccct? 11/28 Two letters picked without replacement from {f: 1, j: 5, b: 4}. What is prob of sequence fb? 2/45 Calculate prob of sequence sq when two letters picked without replacement from {s: 4, q: 3}. 2/7 What is prob of sequence yym when three letters picked without replacement from {m: 6, y: 6}? 3/22 Four letters picked without replacement from {m: 1, z: 1, x: 1, o: 11, e: 1, k: 3}. Give prob of sequence kmxx. 0 Calculate prob of sequence yc when two letters picked without replacement from iciicyccccpyycycyyc. 3/19 Two letters picked without replacement from {t: 4, d: 2, v: 1}. Give prob of sequence vd. 1/21 Calculate prob of sequence ydyd when four letters picked without replacement from ydyydyy. 1/21 Two letters picked without replacement from czuhmmhu. Give prob of sequence mm. 1/28 Calculate prob of sequence pf when two letters picked without replacement from hkypzhf. 1/42 Three letters picked without replacement from {w: 2, g: 7, v: 7}. What is prob of sequence gvg? 7/80 Four letters picked without replacement from eedkxnkefkex. Give prob of sequence nefx. 1/1485 Three letters picked without replacement from {u: 2, z: 8, y: 2, r: 1, i: 5, q: 2}. What is prob of sequence ruu? 1/3420 Two letters picked without replacement from vmjvvjmmvmjmmmjmjmm. Give prob of sequence jm. 25/171 What is prob of sequence bhrr when four letters picked without replacement from {b: 5, h: 5, r: 2}? 5/1188 Three letters picked without replacement from glhffhnl. Give prob of sequence gln. 1/168 Calculate prob of sequence cd when two letters picked without replacement from ccddddddcddddddddcdd. 16/95 Four letters picked without replacement from {l: 3, h: 1}. Give prob of sequence hlll. 1/4 Four letters picked without replacement from {e: 1, k: 3, a: 4, j: 2, w: 7, t: 1}. Give prob of sequence tkew. 7/24480 What is prob of sequence hih when three letters picked without replacement from {b: 2, h: 2, i: 1, j: 6, x: 5}? 1/1680 Two letters picked without replacement from kfivfkkufkwi. What is prob of sequence ii? 1/66 Two letters picked without replacement from fkkkfk. Give prob of sequence kf. 4/15 What is prob of sequence bvli when four letters picked without replacement from kivvikivllvkbivv? 1/910 Calculate prob of sequence gege when four letters picked without replacement from egggeggegggggggggggg. 4/285 Two letters picked without replacement from {b: 2, s: 1, v: 6, n: 2, z: 2, m: 4}. What is prob of sequence zs? 1/136 Calculate prob of sequence pe when two letters picked without replacement from {p: 1, e: 1, x: 2}. 1/12 Calculate prob of sequence oo when two letters picked without replacement from {y: 2, o: 18}. 153/190 What is prob of sequence tqd when three letters picked without replacement from {t: 4, q: 1, d: 2, n: 4}? 4/495 What is prob of sequence maam when four letters picked without replacement from {a: 4, u: 2, d: 1, j: 7, m: 3, f: 1}? 1/1020 Three letters picked without replacement from {r: 1, y: 18, d: 1}. Give prob of sequence yyd. 17/380 Two letters picked without replacement from ftfbsvvfuffuvtvfft. What is prob of sequence sb? 1/306 What is prob of sequence nn when two letters picked without replacement from {n: 8, j: 2, b: 3, z: 3}? 7/30 Four letters picked without replacement from vvyvzvvyyaavzvv. Give prob of sequence vzvz. 2/585 Three letters picked without replacement from wwwwwwwwowowowwwuuww. What is prob of sequence wuu? 1/228 Three letters picked without replacement from {l: 1, m: 4, w: 4, h: 6}. What is prob of sequence lhw? 4/455 What is prob of sequence vxv when three letters picked without replacement from vxxv? 1/6 Two letters picked without replacement from {s: 1, r: 5, m: 1, u: 3}. Give prob of sequence ms. 1/90 Three letters picked without replacement from tttdtrqdbdqrdqhrbqbd. Give prob of sequence dqb. 1/114 What is prob of sequence nrlu when four letters picked without replacement from {v: 3, l: 1, t: 1, u: 2, n: 3, r: 3}? 3/2860 Four letters picked without replacement from mgggmggmmmgmmg. What is prob of sequence gmgg? 35/572 Two letters picked without replacement from {s: 5, a: 8, u: 2}. What is prob of sequence au? 8/105 Four letters picked without replacement from {v: 9, a: 5}. Give prob of sequence avaa. 45/2002 Two letters picked without replacement from {a: 4, h: 9, m: 2, x: 1}. Give prob of sequence ah. 3/20 Two letters picked without replacement from {w: 4, q: 1, i: 9, v: 2}. What is prob of sequence vq? 1/120 Calculate prob of sequence ggoo when four letters picked without replacement from {o: 3, t: 1, g: 2, p: 1}. 1/70 Three letters picked without replacement from nugqguh. What is prob of sequence ghq? 1/105 Three letters picked without replacement from ssraarmarrccm. What is prob of sequence rrs? 2/143 Two letters picked without replacement from kkjkjjjjfkkjkjjg. Give prob of sequence gf. 1/240 Three letters picked without replacement from hjjjcnccnj. What is prob of sequence ccn? 1/60 Calculate prob of sequence lnb when three letters picked without replacement from {n: 1, b: 2, l: 6, d: 4, t: 2}. 2/455 Calculate prob of sequence ssss when four letters picked without replacement from ssssgsgs. 3/14 What is prob of sequence hii when three letters picked without replacement from {h: 1, l: 3, q: 4, i: 2}? 1/360 Calculate prob of sequence qrrr when four letters picked without replacement from srssqqq. 0 Four letters picked without replacement from {k: 3, x: 1}. Give prob of sequence kxkk. 1/4 Two letters picked without replacement from bbsrbbblsbl. Give prob of sequence sr. 1/55 What is prob of sequence zrt when three letters picked without replacement from {t: 2, u: 2, r: 4, z: 4}? 4/165 Three letters picked without replacement from kjuoi. What is prob of sequence okj? 1/60 What is prob of sequence pty when three letters picked without replacement from {y: 12, t: 1, p: 1}? 1/182 What is prob of sequence vkvk when four letters picked without replacement from kvkrvvrrrvvvkrvv? 1/130 What is prob of sequence bbby when four letters picked without replacement from kybyybbkybbyytyk? 1/104 Two letters picked without replacement from ueunududu. What is prob of sequence dd? 1/36 Three letters picked without replacement from rlrdite. Give prob of sequence eli. 1/210 Four letters picked without replacement from nhhqghhqbglnhl. What is prob of sequence gghl? 5/6006 Calculate prob of sequence rrux when four letters picked without replacement from rxxxrxuxr. 5/504 What is prob of sequence nnt when three letters picked without replacement from {t: 4, n: 3, m: 7}? 1/91 What is prob of sequence mx when two letters picked without replacement from mmxbxxmxxxbxmx? 16/91 What is prob of sequence odlj when four letters picked without replacement from loodojddjdjodjjol? 25/5712 Calculate prob of sequence bo when two letters picked without replacement from {o: 1, b: 1, h: 1}. 1/6 Calculate pro	{ "pile_set_name": "DM Mathematics" }
. 2, 3, 1217 List the prime factors of 11954. 2, 43, 139 What are the prime factors of 742? 2, 7, 53 What are the prime factors of 113? 113 What are the prime factors of 1367? 1367 List the prime factors of 1669. 1669 What are the prime factors of 9560? 2, 5, 239 What are the prime factors of 117525? 3, 5, 1567 List the prime factors of 2436. 2, 3, 7, 29 List the prime factors of 45950. 2, 5, 919 What are the prime factors of 867? 3, 17 List the prime factors of 19571. 19571 List the prime factors of 4801. 4801 List the prime factors of 38080. 2, 5, 7, 17 What are the prime factors of 85188? 2, 3, 31, 229 What are the prime factors of 41655? 3, 5, 2777 List the prime factors of 585. 3, 5, 13 What are the prime factors of 12242? 2, 6121 What are the prime factors of 930? 2, 3, 5, 31 List the prime factors of 1977. 3, 659 What are the prime factors of 292? 2, 73 What are the prime factors of 12192? 2, 3, 127 What are the prime factors of 1525? 5, 61 What are the prime factors of 2950? 2, 5, 59 What are the prime factors of 60023? 193, 311 What are the prime factors of 473? 11, 43 List the prime factors of 2859. 3, 953 What are the prime factors of 402? 2, 3, 67 List the prime factors of 1278. 2, 3, 71 What are the prime factors of 122242? 2, 61121 What are the prime factors of 58712? 2, 41, 179 What are the prime factors of 46421? 61, 761 List the prime factors of 670. 2, 5, 67 List the prime factors of 7852. 2, 13, 151 What are the prime factors of 3685? 5, 11, 67 What are the prime factors of 45691? 45691 List the prime factors of 130038. 2, 3, 21673 List the prime factors of 117. 3, 13 List the prime factors of 3162. 2, 3, 17, 31 List the prime factors of 2276. 2, 569 List the prime factors of 6555. 3, 5, 19, 23 List the prime factors of 16153. 29, 557 List the prime factors of 1274. 2, 7, 13 What are the prime factors of 2236? 2, 13, 43 What are the prime factors of 21728? 2, 7, 97 List the prime factors of 1013. 1013 List the prime factors of 5619. 3, 1873 What are the prime factors of 15182? 2, 7591 List the prime factors of 116027. 116027 List the prime factors of 2303. 7, 47 List the prime factors of 617. 617 What are the prime factors of 5916? 2, 3, 17, 29 List the prime factors of 52134. 2, 3, 8689 What are the prime factors of 46729? 83, 563 What are the prime factors of 3167? 3167 What are the prime factors of 21380? 2, 5, 1069 List the prime factors of 9162. 2, 3, 509 What are the prime factors of 699? 3, 233 List the prime factors of 1073. 29, 37 List the prime factors of 66039. 3, 22013 What are the prime factors of 5452? 2, 29, 47 What are the prime factors of 31925? 5, 1277 List the prime factors of 3369. 3, 1123 List the prime factors of 10381. 7, 1483 What are the prime factors of 616? 2, 7, 11 What are the prime factors of 3621? 3, 17, 71 What are the prime factors of 8786? 2, 23, 191 List the prime factors of 2544. 2, 3, 53 What are the prime factors of 806? 2, 13, 31 List the prime factors of 22497. 3, 7499 List the prime factors of 31598. 2, 7, 37, 61 List the prime factors of 4896. 2, 3, 17 What are the prime factors of 1039? 1039 What are the prime factors of 1425? 3, 5, 19 List the prime factors of 3777. 3, 1259 List the prime factors of 266. 2, 7, 19 List the prime factors of 26919. 3, 997 What are the prime factors of 78625? 5, 17, 37 What are the prime factors of 3517? 3517 What are the prime factors of 53? 53 What are the prime factors of 2684? 2, 11, 61 What are the prime factors of 511? 7, 73 List the prime factors of 1415. 5, 283 List the prime factors of 7. 7 What are the prime factors of 1191? 3, 397 List the prime factors of 2630. 2, 5, 263 What are the prime factors of 1478? 2, 739 What are the prime factors of 1490? 2, 5, 149 What are the prime factors of 29187? 3, 23, 47 What are the prime factors of 34682? 2, 17341 List the prime factors of 2970. 2, 3, 5, 11 What are the prime factors of 37926? 2, 3, 7, 43 What are the prime factors of 242? 2, 11 What are the prime factors of 1214? 2, 607 List the prime factors of 27693. 3, 17, 181 What are the prime factors of 11619? 3, 1291 List the prime factors of 35928. 2, 3, 499 What are the prime factors of 1507? 11, 137 What are the prime factors of 268? 2, 67 List the prime factors of 2882. 2, 11, 131 What are the prime factors of 14852? 2, 47, 79 What are the prime factors of 2554? 2, 1277 List the prime factors of 429. 3, 11, 13 List the prime factors of 28807. 28807 List the prime factors of 9753. 3, 3251 What are the prime factors of 75546? 2, 3, 1399 What are the prime factors of 11566? 2, 5783 What are the prime factors of 2906? 2, 1453 What are the prime factors of 1185? 3, 5, 79 List the prime factors of 8625. 3, 5, 23 What are the prime factors of 756? 2, 3, 7 What are the prime factors of 17527? 17, 1031 List the prime factors of 58503. 3, 19501 What are the prime factors of 54050? 2, 5, 23, 47 List the prime factors of 10204. 2, 2551 List the prime factors of 323. 17, 19 List the prime factors of 4406. 2, 2203 What are the prime factors of 5117? 7, 17, 43 List the prime factors of 1779. 3, 593 List the prime factors of 4877. 4877 What are the prime factors of 54201? 3, 7, 29, 89 List the prime factors of 629. 17, 37 What are the prime factors of 90814? 2, 17, 2671 What are the prime factors of 3498? 2, 3, 11, 53 What are the prime factors of 747? 3, 83 List the prime factors of 8608. 2, 269 What are the prime factors of 25975? 5, 1039 What are the prime factors of 4220? 2, 5, 211 List the prime factors of 5804. 2, 1451 List the prime factors of 1637. 1637 List the prime factors of 4960. 2, 5, 31 List the prime factors of 1513. 17, 89 List the prime factors of 3732. 2, 3, 311 What are the prime factors of 19431? 3, 17, 127 List the prime factors of 1290. 2, 3, 5, 43 What are the prime factors of 1512? 2, 3, 7 List the prime factors of 60341. 83, 727 List the prime factors of 51712. 2, 101 List the prime factors of 8817. 3, 2939 List the prime factors of 45257. 167, 271 List the prime factors of 4. 2 List the prime factors of 25149. 3, 83, 101 List the prime factors of 9387. 3, 7, 149 List the prime factors of 1967. 7, 281 What are the prime factors of 983? 983 What are the prime factors of 8838? 2, 3, 491 List the prime factors of 18148. 2, 13, 349 What are the prime factors of 1235? 5, 13, 19 What are the prime factors of 21299? 19, 59 What are the prime factors of 10137? 3, 31, 109 List the prime factors of 555. 3, 5, 37 What are the prime factors of 61616? 2, 3851 What are the prime factors of 164? 2, 41 What are the prime factors of 4376? 2, 547 What are the prime factors of 316? 2, 79 What are the prime factors of 1739? 37, 47 What are the prime factors of 4158? 2, 3, 7, 11 What are the prime factors of 227? 227 List the prime factors of 28854. 2, 3, 7, 229 What are the prime factors of 41012? 2, 10253 List the prime factors of 2034. 2, 3, 113 List the prime factors of 5313. 3, 7, 11, 23 What are the prime factors of 109446? 2, 3, 17, 29, 37 What are the prime factors of 22233? 3, 7411 List the prime factors of 488. 2, 61 What are the prime factors of 14410? 2, 5, 11, 131 List the prime factors of 4413. 3, 1471 List the prime factors of 1258. 2, 17, 37 What are the prime factors of 5923? 5923 List the prime factors of 1785. 3, 5, 7, 17 List the prime factors of 130. 2, 5, 13 What are the prime factors of 1391? 13, 107 List the prime factors of 26069. 131, 199 What are the prime factors of 420? 2, 3, 5, 7 List the prime factors of 3157. 7, 11, 41 What are the prime factors of 53402? 2, 26701 What are the prime factors of 2820? 2, 3, 5, 47 What are the prime factors of 1317? 3, 439 What are the prime factors of 1445? 5, 17 List the prime factors of 15558. 2, 3, 2593 What are the prime factors of 1779? 3, 593 List the prime factors of 18198. 2, 3, 337 List the prime factors of 209. 11, 19 List the prime factors of 4241. 4241 List the prime factors of 14374. 2, 7187 List the prime factors of 138426. 2, 3, 23071 List the prime factors of 266. 2, 7, 19 What are the prime factors of 551? 19, 29 What are the prime factors of 51436? 2, 7, 11, 167 List the prime factors of 1453. 1453 What are the prime factors of 2389? 2389 What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
Let w = -3.83 + c. What is w rounded to the nearest integer? -1 Let f = -0.027 - 138.973. Let b = -102.4 - f. Round b to the nearest integer. 37 Suppose 0 = -6o + o + 20. Suppose n + n + oq = 10, -5n - 2q = -9. Let l(t) = 4900000t3 - t + 1. Let z be l(n). Round z to the nearest one million. 5000000 Let j = 838 + -210. Let s = j + -627.99999697. What is s rounded to 7 dps? 0.000003 Let v be ((84806 - -3) + -4)-1. Let f = v + -136195. Round f to the nearest 10000. -220000 Let j = -258 + 262. Suppose -l - 6930 = -5a - 3l, -a + 3l = -1403. Suppose -jg + 4124 = -3q, 2q + 2g = q - a. Round q to the nearest 100. -1400 Let w = 14.03 - 0.03. Let g = w + -21. Let v = -6.9999978 - g. What is v rounded to 6 dps? 0.000002 Let b = 89.47 + -90. Let q = -0.52876 - b. Round q to 4 decimal places. 0.0012 Let f = -2680.9663 - -2681.11629983. Let m = -594 + 594.15. Let l = m - f. What is l rounded to seven dps? 0.0000002 Let l = -125.498527 - -125.5. What is l rounded to 5 dps? 0.00147 Let k = 1 + 5. Let x be k/(-10) - (-138)/30. Let n(l) = -18282l*3 + 2l*2 + 5l - 4. Let c be n(x). Round c to the nearest one hundred thousand. -1200000 Let q = -136 - -140. Let m be (-4 + (-102)/q)30. Round m to the nearest 100. -900 Let r = -631651539679 - -631651539414.999999681. Let a = r - -264. What is a rounded to 7 dps? -0.0000003 Let i be -61 - 0 - (-7 + 3). Suppose 3c + o + 0 = -101, 0 = 2c + 5o + 50. Let k = c - i. What is k rounded to the nearest 10? 20 Suppose -19x - 2 = -17x. Let o be 415/x - (-2)/(-4)2. What is o rounded to the nearest 100? -400 Let k be 6/4 + 6/12. Suppose -km = 4v + 5008, 3m = -0m - 2v - 7504. What is m rounded to the nearest one thousand? -3000 Let s = 39.309 - 86.266. Let u = 107 - 154. Let o = u - s. Round o to 2 dps. -0.04 Let m = -8916079 + 3226079. Round m to the nearest one million. -6000000 Let g(d) be the third derivative of -d5/60 + d4/8 + d*3/2 - 7d*2. Let k be g(3). Suppose -8455 = kh + 90545. Round h to the nearest 10000. -30000 Suppose -3q = -57 - 42. Let k be ((-22)/q)/((-2)/33). Let d(v) = 30v3 + v2 - 6v + 15. Let h be d(k). Round h to the nearest 100000. 0 Let k(r) = -8143r - 15. Let l(a) = -16285a - 30. Let p(d) = 5k(d) - 2l(d). Let z be p(-7). Round z to the nearest ten thousand. 60000 Let g = -15.1 + 15.09428. Round g to three decimal places. -0.006 Let p = -0.033 - -71.033. Let q = p - 116. Let g = -45.00000236 - q. What is g rounded to seven dps? -0.0000024 Let o(v) = -v3 + 4. Let d be o(0). Suppose 26 = -2c - c - 4k, 14 = -dc + 5k. Let i(z) = 481z - 14. Let y be i(c). Round y to the nearest 1000. -3000 Let u(l) = -4339l2 - 86l - 15. Let v be u(-15). What is v rounded to the nearest 10000? -980000 Let k = -69 + 78.75. Let y = 10 - k. Let q = -0.29 - y. Round q to one dp. -0.5 Let b = -0.074 + 0.099. Let n = -780.9647 - -781. Let k = n - b. What is k rounded to three dps? 0.01 Let i = -3.35000133 - -3.35. What is i rounded to 6 dps? -0.000001 Let o = 0.2587 + -60.8687. Let p = o + 61. Let d = -0.24 + p. What is d rounded to one decimal place? 0.2 Let d(s) be the third derivative of -s4/8 - s3/2 - s*2. Let j be d(-2). Suppose -jo = -o - 200. What is o rounded to the nearest 1000? 0 Let i = -2097.641 + 2098. What is i rounded to one decimal place? 0.4 Let t = -21 + 24. Let a = -1 - -1. Suppose -tr - r + 18000 = a. What is r rounded to the nearest 1000? 5000 Let b(o) = o2 - 8o - 7. Let l be b(8). Let i(n) = 100n2 + n + 7. Let s be i(l). What is s rounded to the nearest 1000? 5000 Let r = 9596.4031 - 9597. What is r rounded to two decimal places? -0.6 Let f = -1579 + 2439. Round f to the nearest ten. 860 Suppose -9 = -5a + 1. Suppose 0 = ab - 5b + 879. Suppose -4y - 933 = -b. What is y rounded to the nearest 100? -200 Let c(u) = -5412u*3 - 11u*2 + 23u - 76. Let i be c(-12). Round i to the nearest one million. 9000000 Let g = -76 + 127. Let n = g - 16. Let a = n - 35.0047. What is a rounded to three decimal places? -0.005 Let x = -67.967 - -68. Let h = x - -0.867. Round h to one decimal place. 0.9 Suppose 13262 = 3o + 4f - 38132, 0 = 2o - 4f - 34256. Round o to the nearest one thousand. 17000 Let b = -2057 + 2056.96963. What is b rounded to 3 dps? -0.03 Let f(a) = a*2 - 180. Let k be f(0). Let i be k(12900/9)/2. Round i to the nearest ten thousand. -130000 Let a = 3.5408 + -4.1. Let t = 0.56 + a. Round t to four decimal places. 0.0008 Let y = -274 - -274.00000402. What is y rounded to six decimal places? 0.000004 Suppose -3l + 4l - 4 = 0, -s = 3l - 1934012. What is s rounded to the nearest one hundred thousand? 1900000 Let u = 39.91 - 39.94381. Round u to two decimal places. -0.03 Let z = 123 - 113. Suppose -zt = -14t + 7560. What is t rounded to the nearest 100? 1900 Let y = 209.4 + -152. Round y to zero decimal places. 57 Let c(q) = -2q*2 - 69q + 273. Let x be c(-39). Suppose 0p + 8 = 4p. Let f be ((-40)/30)/(p/x). What is f rounded to the nearest ten? 50 Let r = -5.86 - -6. Let g = -0.96 - r. Let d = g + 1.09999987. Round d to seven decimal places. -0.0000001 Let s = 0.3549878 + -0.355. What is s rounded to five decimal places? -0.00001 Let a = 63.630489 - 63.1504. Let m = a + -0.48. What is m rounded to 5 dps? 0.00009 Let x be (-87926)/14 + (-84)/(-196). What is x rounded to the nearest one hundred? -6300 Suppose -4g = -2a - 0g, 5a = g + 18. Suppose 2m + 4w + 18012 = 0, -aw - 15 = w. Round m to the nearest ten thousand. -10000 Let d = -240.9999628 - -241. What is d rounded to five decimal places? 0.00004 Let y = 272.72 + -1.72. Let g = -271.000483 + y. Round g to 5 dps. -0.00048 Let f(j) = -j3 - 12j*2 + 13j + 4. Let a be f(-13). Suppose -28400000 = -8r + ar. Round r to the nearest 1000000. 7000000 Suppose -2h - 18632 = -3g - 4h, -4g - 3h + 24843 = 0. What is g rounded to the nearest 1000? 6000 Let g = -241 + 42.4. Round g to the nearest ten. -200 Suppose 0 = 4s - 2w + 6, 0w = s - 3w - 6. Let h be 4/(-1 + s) - -5. Let y(b) = b3 - 6b*2 + 8b. Let t be y(h). Round t to 5 decimal places. 0 Let f = -1415 + 1403.22. What is f rounded to 0 decimal places? -12 Let z = 50 + -45.8. Let n = 4.52 - z. What is n rounded to one decimal place? 0.3 Let o = 100 + -52. Let j = 48.00000071 - o. What is j rounded to seven dps? 0.0000007 Let v = -7.562574 + 32.562597. Let h = -25 + v. What is h rounded to 5 dps? 0.00002 Suppose -f + 617 = -1575. Round f to the nearest 100. 2200 Let c = 0.029946 + -5.257746. Let r = -5.18 - c. Let v = -0.052 + r. Round v to three decimal places. -0.004 Suppose 6d = -10d - 3920. What is d rounded to the nearest 10? -250 Let b be (3 + 0)8/6. Let k(h) = -140002h + 8. Let g be k(b). Round g to the nearest one hundred thousand. -600000 Let g = 11.1686 - 11.14. What is g rounded to two decimal places? 0.03 Let v = -10 + 12. Let q = v - -2. Suppose 5l - 139958 = -2h - 454952, -ql - h = 251997. What is l rounded to the nearest 10000? -60000 Let b = -6438.9991534 + 6439. Round b to four dps. 0.0008 Let d = -4714.4393 + 4714. Round d to one dp. -0.4 Let h = -3.9 - -3. Let x = h + -0.5. Let r = x - -1.39952. What is r rounded to four decimal places? -0.0005 Let r(p) = 62p*3 + 3p*2 - 2. Let i be r(1). Suppose 2a + i = -a. Let u be (-280)/a(-186)/(-8). What is u rounded to the nearest 100? 300 Suppose -34t = -18t - 110400. What is t rounded to the nearest 1000? 7000 Suppose 0 = 9y - 12y + 9. Suppose -5k = j - 1470, -5k - 2j = yj - 1470. Round k to the nearest ten. 290 Let d be 18/8 + (-2)/8. Let u be 1000/d(4 + -120). What is u rounded to the nearest 10000? -60000 Let a = 6208.9995711 + -6209. Round a to 5 decimal places. -0.00043 Let y = 6 + -4.5. Let r = 16 - y. Let i = -13 + r. What is i rounded to zero decimal places? 2 Suppose -4f + 2 = -2t, 2 = -f - 7t + 8t. Round f to the nearest integer. 3 Let a = -1292.3 - -1453. Let f = -0.265 - 141.735. Let j = f + a. What is j rounded to zero decimal places? 19 Let w be (132)/120187500/200. What is w rounded to the nearest 1000000? 3000000 Let f = 820 - 829.93. Let c = -0.25 - -10.25. Let i = f + c. What is i rounded to one decimal place? 0.1 Suppose 5k = 2m - 52400000, -5m = -9k + 5*k - 131000000. Round m to the nearest 10	{ "pile_set_name": "DM Mathematics" }
. -3 Let s = 639 - -550. Let a = -1189.0000609 + s. Round a to six dps. -0.000061 Let z(q) = 11705q2 + 29q - 238. Let n be z(17). What is n rounded to the nearest one million? 3000000 Let f = 2132.2063 + -2131.3. What is f rounded to two dps? 0.91 Suppose 11197432 = 7u - 2312568. What is u rounded to the nearest one hundred thousand? 1900000 Let s = -10588.15 + 10049. Let j = 539.290001 + s. Let q = 0.14 - j. Round q to seven decimal places. -0.000001 Let o(f) = f3 + 5f*2 + 3. Let w be o(-5). Suppose wh - 26499 = -3a, 7h = 2h - 3a + 44157. Suppose 0 = 2b - h + 2029. Round b to the nearest 1000. 3000 Let m = 389065073 + -389065145.9999902. Let y = -30 - 43. Let g = m - y. What is g rounded to six decimal places? 0.00001 Let a(f) = f2 - 9f. Let m be 4((-19)/(-4) + -3). Let j be a(m). Let g(s) = s3 + 15s*2 + 9s + 2. Let c be g(j). Round c to the nearest ten. 70 Let s be (-4)/6 + 781/33. Suppose 20x - sx - 12600000 = 0. Round x to the nearest one million. -4000000 Let p = -1.0078 + 1.001943. Round p to 4 dps. -0.0059 Let j = 0.53866 + -0.4812. Let z = -0.063 + j. What is z rounded to three decimal places? -0.006 Let o = -49 - -43.2. Let t = -5.79999945 - o. What is t rounded to seven dps? 0.0000006 Let t = 1.577 + -0.247. What is t rounded to one dp? 1.3 Let j = -326 - -326.221. Round j to one decimal place. 0.2 Let l be 106(101 + -1)(-13 + -3). Round l to the nearest 10000. -170000 Let w = -37 - 157. Let l = w + 193.999999394. Round l to 7 dps. -0.0000006 Let b = -20.65 - -20.65000879. What is b rounded to six decimal places? 0.000009 Let k(n) = 3n - 174. Let o(z) = 4z - 175. Let d(w) = -3k(w) + 2o(w). Let a be d(0). Let q = a - 732. Round q to the nearest 100. -600 Let t = 159.8328 - 173.94. Let d = -14 - t. Let g = -0.1 + d. What is g rounded to three decimal places? 0.007 Let y = -30013.3886 + 30008. Let a = y - -17.3818. Let z = 12 - a. Round z to 3 dps. 0.007 Let w be (-116 + 96)135801. Round w to the nearest one thousand. -272000 Let n = 186.0722 - 186.5. Round n to two decimal places. -0.43 Let n = 30633364652 + -30633364473.00000071. Let z = n + -179. What is z rounded to 7 dps? -0.0000007 Let t = 2483.982 + -2486. Round t to zero dps. -2 Let t = -1764019377 + 283937560. Let c = t + 1480081876.00000092. Let v = c - 59. Round v to seven dps. 0.0000009 Let d = -15786512097968253.00000018 + 15786511649387260. Let o = -448580982 - d. Let b = 11 - o. What is b rounded to 7 decimal places? -0.0000002 Let s be 4790 + (0 + -7 - -7). What is s rounded to the nearest 100? 4800 Let f = -16531.34962 + 16531. Let v = 184 - 183.65. Let t = v + f. Round t to 4 decimal places. 0.0004 Suppose 0 = -3y - 7y + 321640. Let q = -22564 + y. Round q to the nearest 1000. 10000 Let r = -52.29 - -84.62. What is r rounded to the nearest integer? 32 Let z = 1.207639 - 1.207. What is z rounded to 4 decimal places? 0.0006 Let m = -11.6 + 13. Let n = -8.4 + m. Let j = -7.00065 - n. Round j to 4 decimal places. -0.0007 Let v = 3375.7963 + -3376. What is v rounded to 2 dps? -0.2 Let o = -76 - -75.999999746. Round o to 7 dps. -0.0000003 Let t = -994.8128 - -993. Let q = 1.48 + -3.28. Let c = q - t. What is c rounded to 3 decimal places? 0.013 Let s(r) be the first derivative of -424999r2/2 + 2r - 2. Let h = 2 - 4. Let m be s(h). What is m rounded to the nearest one hundred thousand? 900000 Let w = 0.7616 + 60.5784. Let u = -0.34 + w. Let t = 62.59 - u. Round t to 1 dp. 1.6 Let x = -6373 + 10478. Let t = x - 4117.0008. Let y = 12 + t. What is y rounded to four dps? -0.0008 Let h(g) = 254g + 8. Let m(b) = 12b3 + b2 + b. Let x be m(-1). Let u be (21/x)/((-1)/(-4)). Let p be h(u). Round p to the nearest 100. -1800 Suppose -2u + 120c + 512205 = 115c, -2c + 512198 = 2u. What is u rounded to the nearest 100000? 300000 Let v = 1 + -1. Suppose -3m + 2k = k - 5, -5m - k = -11. Suppose -2r = mr, v = -5f + r - 3200. Round f to the nearest 100. -600 Let n = 0.16 - -346.84. Let a = n + -230. Let b = -116.9764 + a. What is b rounded to 3 decimal places? 0.024 Let z = 0.97997672 + -0.98. What is z rounded to six dps? -0.000023 Let q(k) be the first derivative of 0k + 2 - 1/3k3 - 5/2k*2. Let l be q(-6). What is l rounded to 0 dps? -6 Let r = -68.84 + 477.74. Let i = r + -459. What is i rounded to the nearest ten? -50 Let x = -0.3266 - -0.318315. What is x rounded to three decimal places? -0.008 Let h = -0.03154 + -61.34846. Round h to the nearest 10. -60 Let d be (13/4)/((-9)/36). Let w(v) = -315v*3 - 11v*2 + 15v - 1. Let r be w(d). What is r rounded to the nearest one hundred thousand? 700000 Suppose -191801551 = 35o + 104088449. Round o to the nearest 1000000. -8000000 Let w = -116474.900128 + 116506.9. Let j = -32 + w. What is j rounded to five dps? -0.00013 Let p = -11.48 + -45.36. What is p rounded to zero dps? -57 Suppose -10x + 71805 + 330455 = 0. Suppose -5774 = -2z + x. Round z to the nearest one hundred thousand. 0 Suppose -c - 20 = -5c. Suppose -5380 = -s - 3t, cs - 3s - t - 10746 = 0. Suppose 0 = -2j - s - 4626. Round j to the nearest 1000. -5000 Let g(f) = f*3 + 2f*2 - 1451000. Let a be g(0). Round a to the nearest 100000. -1500000 Let r = -1.9110225377 + 1082020.9197225377. Let x = r + -1081923. Let k = x - 96. What is k rounded to three dps? 0.009 Let l = -796.9 + 837. Round l to the nearest ten. 40 Let o = -555.0021 - -555. What is o rounded to three decimal places? -0.002 Let h = 1.79 + -16.59. Let d = 23 + h. Let k = d - 8.20153. Round k to four dps. -0.0015 Suppose 0 = 19z - 20z + 1. Let n be (-66)/396 + (-1790)/(-12) + z. What is n rounded to the nearest ten? 150 Let g = 0.037 - 16.037. Let b = 30.5 + g. What is b rounded to zero dps? 15 Let d be (2 - -14587)(1 - -26). Let r = 113903 - d. Round r to the nearest one hundred thousand. -300000 Let u = 0.5500378 + -0.55. Round u to 6 decimal places. 0.000038 Let c = -224 - -143. Let t = 2166110124.99999939 - 2166110206. Let y = c - t. What is y rounded to seven decimal places? 0.0000006 Let c = 0.24 + 1.36. Let y = 1.6 - c. Let p = y - -0.057. What is p rounded to two dps? 0.06 Suppose -10x = -2x - 24. Suppose 4c - 25333 - 37687 = xv, -4v - 4c - 83980 = 0. What is v rounded to the nearest ten thousand? -20000 Let v = -0.13 - -2.13. Let i = v - 3.16. Let w = i + -0.24. What is w rounded to one decimal place? -1.4 Let b = 34 - 19. Let i be b/5 + 0/(-1). Suppose 4 = -2k, -r + ik = -k + 90992. What is r rounded to the nearest ten thousand? -90000 Let m = 14 + -20. Let h be (-2 + 1 - (-1038)/m)15. Round h to the nearest 100. -2600 Let r = -95778.50958 + 95777. Let s = r + 1.51. Round s to four decimal places. 0.0004 Suppose -21x - 5y = -24x - 28, 2x + 2y + 40 = 0. Let w(g) = -175004g - 64. Let a be w(x). What is a rounded to the nearest 1000000? 3000000 Let f = -1.26 + 0.01. Let o = f + 1.24999933. Round o to 7 dps. -0.0000007 Suppose -6v + 5v + 4h + 144982 = 0, -3v + 435021 = 3h. Suppose 3m - 87002 = -0m + 2i, 5m - 2i = v. Round m to the nearest 10000. 30000 Let c = -3356 - -3355.96898. Let f = c + 0.03. Round f to four decimal places. -0.001 Let y(h) = 254h - 185. Let x be y(12). Round x to the nearest one thousand. 3000 Let u = -133.2 - -123. Let d = 10.2000196 + u. Round d to 6 dps. 0.00002 Let d(f) = 243752f2 - 16f + 8. Let z(h) = 81251h2 - 5h + 3. Let i(r) = 3d(r) - 8z(r). Let s be i(-4). What is s rounded to the nearest 1000000? 1000000 Suppose y + 4s - 94080 = 0, 0 = -2y + 7y + 5s - 470475. What is y rounded to the nearest 10000? 90000 Let a be (10/(-4))/(35/18060). Round a to the nearest 1000. -1000 Let d = -14.381 + -0.019. Let p = -14 - d. Let u = 0.09 - p. Round u to one dp. -0.3 Let z = 59 + -59.000398. Round z to four decimal places. -0.0004 Suppose -52k = -33k + 284430. Round k to the nearest 10000. -10000 Let j = -2.71 + 2.6. Let n = -83517.88999904 + 83518. Let c = j + n. What is c rounded to 7 decimal places? 0.000001 Let v = -11.2 + 11.6. Let z = v + -0.41. Round z to three decimal places. -0.01 Let k = -9.53 - -9.1. Let a = 0.03 - k. Round a to one dp. 0.5 Let m = 1203.02924 + -1203. What is m rounded to three decimal places? 0.029 Let q = -2670 + 2670.6035. What is q rounded to 2 d	{ "pile_set_name": "DM Mathematics" }
+ 2d2 + 16 + 0d*2 + 4 to h + sd*2 + kd and give k. 1 Rearrange -3j - 42j*3 + 4 - 4 + 11j*2 + 41j*3 to the form lj*3 + vj + n + rj2 and give r. 11 Express 4 - 5j - 5j3 - 4 + 8j as lj3 + f + pj + rj2 and give l. -5 Express 3h*2 + 6h*2 - 5h2 + h2 + 0h2 - 2h*2 - 5h - 2h2 + 5h + (-3h + 5h + 0h)(-h + 3h + h) in the form u + kh*2 + xh and give u. 0 Rearrange -2z + 4z + 0z + (-2z + 3z + 0z)(2 - 1 - 2) - 11z + 16z + 12z to the form a + mz and give a. 0 Express z3 + 41 - 3z*3 - 121 as hz*2 + u + pz + nz3 and give n. -2 Rearrange (-4d + 2d2 + 4d + (-2d + 2d - d)(-d - d + d))(-12 + 12 - 2d) to gd*2 + jd*3 + vd + b and give j. -6 Express (-2a + 2a - a)(a - 3a + 4a + (2 - 2 + 1)(0a + 3a - 2a) - 3a + 2a + 5a + 0 + 0 + a)(4 - 3 - 5) in the form da*2 + l + ta and give d. 32 Rearrange (61 - 7 + 1)((1 + 3 - 3)(-2q + 0q + 4q) + q - 3q + 3q) + 6q - 2q - 2q to dq + f and give d. 167 Rearrange 11 - 3 - 6 - 2r*2 + 17r*3 + 3r*2 to ur + tr2 + zr*3 + o and give t. 1 Rearrange (3b - 3b - 4b - 2)((3b - 7b + 3b)(3 - 13 + 4) - 2 + 2 + 4b) to n + sb2 + yb and give s. -40 Express 5y - 5y + 3y as r + hy and give h. 3 Rearrange w*4 - 8w*4 - 2 + 3w*4 + 4w2 + w3 + w*4 to k + lw*3 + jw*2 + qw*4 + pw and give l. 1 Rearrange (-a + 8a - 4a - 2)(-7 - 14 + 15) to the form i + sa and give i. 12 Express (-5 + 1 + 3)(-2v*2 + 2v*2 - 30v*2) as kv + jv2 + a and give j. 30 Rearrange 0x3 - x3 - x*3 + (0x + 4x - 6x)(x2 - 2x + 2x) - 9x*3 - 5x*3 - 3 + 4x*3 to the form dx*3 + s + ux + rx2 and give s. -3 Express (3g*2 + 3g*2 - 4g*2)(2 + 1 - 5) + (-g - 4g + 3g)(4g - 2 + 2) in the form mg2 + v + og and give o. 0 Rearrange -68i + 68i - 397i4 - 273i*4 + (0i*2 + 0i*2 - 2i*2)(2i2 + 2 - 2) to the form bi*4 + yi*2 + mi + xi3 + f and give b. -674 Rearrange 3s*2 + 3 + 5s*2 - 7s*2 to j + ws + bs2 and give b. 1 Rearrange (-4q - 9 + 9)(0 + 15 + 13) to the form b + mq and give m. -112 Express 6h - 9h + 12h as p + zh and give z. 9 Rearrange ((4 - 3 + 1)(1 + 1 - 3) - 3 - 1 - 12)(2v - v2 - 2v) to the form tv + f + wv*2 and give w. 18 Express -32c*2 - 703 + 703 as lc*2 + n + mc and give l. -32 Rearrange -4q2 - 3q*3 + 3q*2 + 2q*3 to the form h + cq*3 + lq*2 + dq and give d. 0 Rearrange -3 + j + 3 + 3j - 4j - 2j + 1 - 1 - j - 2j + 3 - 3 + (-3 - 2 + 3)(-1 - 2j + 1) + (j + 5j + 4j)(0 - 6 + 3) to v + aj and give a. -31 Rearrange 4h4 + 5445h - 5445h + 8h*3 + 1 to the form nh*4 + oh + ch2 + th*3 + r and give r. 1 Express 7z - 19z - 4z - 2z as d + hz and give h. -18 Rearrange (4 - 4 - 1)(9 - 7 + 1 - 4y) to the form ty + f and give f. -3 Express (v + 3 - 3)(-2 - 1 + 0) - 3v + 4v - 3v as zv + t and give z. -5 Express 3z3 - 1090z - 15z2 + 1094z - 2z3 in the form qz + w + bz3 + yz*2 and give b. 1 Rearrange 0 + 108q*3 - 98q*3 - 1 to hq + v + oq2 + gq*3 and give v. -1 Rearrange -4d*3 - 11 - 10 - 7d*3 + 18 to the form vd + t + bd3 + pd*2 and give b. -11 Rearrange -2s*2 + 1742s + s*2 - 1746s + s*4 to ls + j + us4 + vs*2 + ns*3 and give v. -1 Rearrange 7v + 0v + 9v + 16v to bv + a and give a. 0 Express 49h + 0h - 18h + 26h as ch + y and give c. 57 Rearrange 0f - 2f + 5f + 2f + 3 to the form j + sf and give j. 3 Express (162 - 162 + 14a2)(-2 + 3 - 3) in the form ta2 + b + ma and give t. -28 Express 4b4 - b4 - 4b*4 + (2 - 2 + b)(5b - 2b*3 - 5b) + 273b2 - 27b*4 - 273b*2 in the form h + vb*2 + pb + qb4 + yb*3 and give q. -30 Express 2 + 46t + 3 - 5 in the form ct + s and give c. 46 Rearrange -18z*2 + 34 - 2z - 34 - 2z to k + uz + vz2 and give v. -18 Rearrange -2 + 2 + 2l + 9l to the form yl + g and give y. 11 Express (-2l + 2l + 2l2)(7l - 9 + 9) + 4l2 - l3 - 4l2 - l2 + 4l2 - l3 - l*2 as pl*3 + m + wl + ul2 and give p. 12 Rearrange c4 + 2c2 - c3 + 2c3 + 5c*2 to the form oc*3 + hc + yc4 + n + gc*2 and give o. 1 Express (21 + 0 - 3)(-5i4 + 3i - 3i) as oi*4 + yi*2 + gi*3 + ui + f and give o. -90 Rearrange 3n2 - 3n*4 - 11n*3 + 3n*3 + 6 - 8 to sn + yn3 + xn*4 + a + ln*2 and give a. -2 Express 4 + 5r - 5 + 10 - 3r in the form nr + b and give b. 9 Express h*4 + h + 2 - 662h*3 + 662h*3 - 13h*2 in the form ph*4 + gh*3 + sh*2 + rh + z and give p. 1 Rearrange -4 + 5t3 - 13 - t3 - 2t*3 to the form kt*3 + m + pt + wt2 and give m. -17 Express 2 - 4k + 5k + k2 - 1 + 8k as j + nk + tk2 and give n. 9 Rearrange -4 + y2 + 0 + 2 - 2y3 + 7 to the form xy*3 + k + gy*2 + vy and give g. 1 Express (-5h + 2h + h)(-3 - 4 - 6)((-3h + 3h - 2h2)(-2 - 2 + 2) + 0h2 - h2 + 2h*2) as wh*3 + f + rh + qh2 and give w. 130 Express -3 + 2 + 57z*4 + 2z*3 - 58z4 - z2 - 5z3 as sz*3 + iz*4 + t + pz + xz2 and give p. 0 Rearrange h3 + h4 - h4 + 3h4 - h4 + h + 1 to the form vh + z + ah*2 + kh*3 + lh*4 and give v. 1 Express 0t + 59t - 12 + 12 in the form w + vt and give v. 59 Express -1 + 17x4 + x2 - x3 + x3 - 16x*4 as ux*4 + wx*3 + jx*2 + r + hx and give u. 1 Express 0c + 3c - c + (-3 - 1 + 3)(-2c + 3c - 3c) + c - 5 + 5 as w + kc and give k. 5 Rearrange (-3 + 3 + 2)(-z*3 + 3z*3 - 3z*3) + 4z*3 - 32z*3 - 30z*3 to sz + l + az2 + nz*3 and give n. -60 Express 5 - 2h*3 + 0h*3 + 18 + 0h*3 as rh*2 + j + ch*3 + nh and give c. -2 Express (-3x2 + 8x*2 - 20x*2)(-2x2 - 3x + 3x) - 3x*4 - 7x*3 + 7x*3 as zx*3 + wx*2 + f + tx*4 + ux and give t. 27 Rearrange (10 - 4 + 17)(-2 + 2 - 1 + v) to rv + k and give r. 23 Express 6 - 1 - 5 + 1 - 7k2 as z + xk + fk2 and give f. -7 Rearrange 0i*2 + 2 + 59i4 + i3 - i*2 - 58i*4 to li*4 + s + bi + di2 + xi*3 and give s. 2 Rearrange 9s*2 - 6s*2 + 2s*2 + 24s*2 - 2s to the form q + is2 + ks and give k. -2 Express -211 + 15p2 - 112p*2 + 211 in the form jp + ap2 + d and give j. 0 Express (758t - 917t + 525t)(0 + 2 + 0) as c + ot and give o. 732 Rearrange 4b - 10b + 18b + 21b to r + yb and give y. 33 Rearrange 0p4 - p4 + 3 - 1 + 3p2 - 3p2 - p4 + (-p2 + p2 - 2p4)(2 - 2 + 2) to the form hp + np*4 + tp*2 + z + qp*3 and give z. 2 Rearrange 3v*2 - 9v*2 + 2v - 4v2 - 15v*2 to the form av + jv2 + q and give j. -25 Rearrange 3r*2 - 4r*3 - 1 + 2r*3 + 4r*3 to the form tr + lr2 + b + vr*3 and give l. 3 Rearrange -9 - 10 - 30w + 19 to the form yw + x and give y. -30 Express -4o*3 + 31o*2 - 3 - 14o*2 - 17o*2 in the form ao*3 + xo + t + ho2 and give t. -3 Express -5r + 5r - r in the form x + vr and give v. -1 Rearrange (0d - 4d + 3d)(1 + 0 - 3)(1 - 8 - 8) to r + ud and give u. -30 Rearrange (5s + 9s - 2s)(2 - 1 + 0)(s - 3s + 0s)(-7s + 0s - 3s) to is + o + js3 + ns*2 and give j. 240 Express -6b + 3b2 + 6b + (-3b + 4b + b)(2b + 0 + 0) + b*2 + 0b*2 - 3b*2 + (2b - 3b + 0b)(0b + 3b - b) as ab + j + zb2 and give z. 3 Rearrange 4 - 4g2 + g2 - g*4 - 8 - 3g*3 + 2g*3 to the form a + zg*3 + wg*2 + tg*4 + sg and give w. -3 Express -3i2 - 4 - 1 + 10 as pi + ri2 + k and give k. 5 Express 7f*3 - 2 + 350f*2 - 350f*2 as if + t + mf2 + yf*3 and give y. 7 Rearrange -3q*4 + 2q*4 - 4q4 + q4 - q*4 - 2q4 + (1 - q4 - 1)(1 - 4 + 0) to the form bq*3 + r + pq*4 + jq*2 + hq and give p. -4 Express 8c + 20c - 11c + (0 + 1 + 1)(-c - 3c + 2c) + 1 - 1 + 2c - 2c + c + 0c + c - c + 3c in the form yc + j and give y. 17 Rearrange 3p*3 + 3 - 29p*3 - 1 to the form op*2 + z + ip + lp3 and give z. 2 Express d4 - 5d*4 - 4d*2 + 1 + 3d*2 as pd*4 + b + fd*2 + td*3 + yd and give b. 1 Express (0 - 2 + 0 + 2 + 1 - 1 + (0 + 5 - 3)(-5 + 2 + 4))(1 + 3a - 1) as o + ta and give t. 6 Express (-13q2 - 15q*2 + 2 + 25q*2)(-3 + 3 + 2)*(-2 + 4 - 3) a	{ "pile_set_name": "DM Mathematics" }
p - n = 0. Let z = -1 + 1. Solve -2g - hg + 12 = z for g. 3 Let m be -4 + 2/(-6)-93. Let b be (-6)/m - (-249)/27. Solve g = -2g + b for g. 3 Let j be (-72)/24 - -33. Solve -6 + 0 = jh for h. -1 Let s(c) = -5c - 5. Let r(t) = -t - 1. Let x(u) = -11r(u) + 2s(u). Let d be x(4). Solve -dj = -13 - 2 for j. 3 Let a(i) = -i - 2. Let s be a(-4). Suppose -4u + 2g + 46 = 0, -u + 16 = 2g + 2g. Solve -sq - u = q for q. -4 Suppose 0r = -2r + 8. Let m = 7 - r. Suppose -mo + 8 = o. Solve v - o = -5 for v. -3 Let q be ((-5)/15)/(2/(-24)). Solve -qi = -3i - 1 for i. 1 Let l(a) = 2a3 - 2a*2 + 1. Let p be l(1). Let m = 5 - p. Let y(c) = -2c*2 - 12c + 2. Let h be y(-6). Solve -2 - h = -mr for r. 1 Suppose 0 = 2i + i - 18. Solve -6 = -3t + it for t. -2 Let j = -80 + 82. Solve 0 = jy - 4y + 2 for y. 1 Suppose 8 = -2m + 4m. Suppose 4 = 5d - 11. Suppose 5g = 2g. Solve -n + m - d = g for n. 1 Suppose 0 = -h + 4, 0p - p = 4h - 18. Solve pb = -b - 15 for b. -5 Let j = 2 + -2. Suppose -10m + 4m + 24 = 0. Solve 2r = -jr - m for r. -2 Suppose -v - d - 8 = -5d, 4d = -3v + 24. Suppose vr - 22 + 6 = 0. Suppose 5b - 3 = rb. Solve bk = k + 4 for k. 2 Let k be ((-2)/(-1) - 2)/1. Suppose q + 3 - 7 = k. Solve 9p + 5 = qp for p. -1 Let o = 11 - 8. Solve 0i = -i + o for i. 3 Let b = 12 + -7. Solve -4u = -3u + b for u. -5 Suppose 7 = -3z + 7. Solve z = -3x - 4 - 5 for x. -3 Suppose -2b = -2y + 7y + 1, 3b = 5y + 11. Suppose -x - b = 2i, -2 - 4 = i + 3x. Solve -3v = -iv - 3 for v. 1 Let l(b) = b3 + 16b*2 - 18b - 12. Let s be l(-17). Solve sw - 4w + 3 = 0 for w. -3 Suppose -3l - 25 = -5k, 9 + 3 = k - 2l. Suppose kr = -4 - 12. Let b = -8 - r. Solve 4o + 1 - 13 = b for o. 3 Let s(d) = -d. Let t be s(-3). Suppose -3u - 3 = -3i, 3 = 5u + 5i - 2. Suppose -tw - 2w + 35 = u. Solve 2c - wc = 10 for c. -2 Suppose 5x + 3l - 25 = 0, -x - 3x + 20 = -l. Suppose 0 = z - 0 - 2. Suppose -i + 3 + 6 = 2r, 2r - zi - 24 = 0. Solve -8 = -xc + r for c. 3 Let w be (-23)/(-7) - 4/14. Suppose 0 = -i - w + 5. Suppose 12 = -4q - 5y, 3y + 10 = q - iq. Solve qn = n + 2 for n. 2 Suppose -5b = -2 - 3. Let w be (1 - (b - 0))1. Let a(u) = u3 - 5u*2 - 4u. Let j be a(6). Solve 0d + 4d + j = w for d. -3 Suppose 4x - 5x = -14. Let c = 29 - x. Solve 4w + 5 + c = 0 for w. -5 Let c = 45 + -69. Let g = c + 24. Solve t + 2t - 3 = g for t. 1 Let u = -2 - -6. Solve 3 - 23 = -ud for d. 5 Let i = 92 + -89. Solve -4y + 3y = -i for y. 3 Let p(a) = a2 - 5a - 3. Let l be p(6). Let g = -46 + 49. Solve -lh = -0 - g for h. 1 Let c(a) = -a2 - 11a - 19. Let m be c(-8). Suppose -r - 15 = -3o - 3r, -mo = r - 25. Solve 5y - 5 - o = 0 for y. 2 Let p be 4/(-18) + (-504)/(-81). Solve p = -4n + 2 for n. -1 Suppose -4r = -4v - 0v - 64, 0 = -5v - 2r - 59. Suppose 0 = -m + 1 - 7. Let c = m - v. Solve 2q - 1 + c = 0 for q. -3 Suppose 0 = 5y - 15y + 10. Solve 1 + y = 2s for s. 1 Suppose -55 = -4m - 47. Solve -mi = -0i for i. 0 Suppose -3j = j - 40. Let k be (-9)/18 - 10/(-4). Solve kb = -3b + j for b. 2 Suppose 0p - 3 = -p. Let j be p/(-1) - 23/(-1). Suppose -4i + j = -3h + 6h, 0 = i + 2h - 10. Solve -3d = -2d + i for d. -2 Suppose 23 = 3q + 4p + 1, 20 = 4q - 4p. Solve 2y - q = 4y for y. -3 Suppose -2z + 12 = z. Let w be 15/20(-16)/2. Let x = -1 - w. Solve -x = -k - zk for k. 1 Suppose 0 = -4u + 16. Suppose s - u = -s. Suppose 0 = -sq + 3d + 19, -d - 13 = q - 3q. Solve 0 = qv + 10 for v. -2 Let m = -4 + 6. Suppose -5d + 4c - 371 = 0, -4d - mc - 221 - 81 = 0. Let q be (-4)/6d/10. Solve -qr = -3r for r. 0 Let a = 66 - 62. Solve -ay - y = 0 for y. 0 Let w be (-2)/(-6) - 260/6. Let t = 63 + w. Suppose 5s - s - t = -j, 20 = 3j + 2s. Solve 5r = 11 + j for r. 3 Let r be 5 + -1(2 + -1). Suppose 0k - 8 = d + 3k, 0 = -k - r. Suppose -1 = -p - i, di + 0 + 20 = 4p. Solve -7x + 16 = -px for x. 4 Suppose 2c = 6c + 104. Let z be c/(-10) - 6/(-15). Solve 0b - zb = 0 for b. 0 Let j(l) = -l*3 - 2l*2 + 3l - 1. Let z be j(-3). Let y = z - -3. Suppose p = -3x - 2p + 33, -2x + 3p + y = 0. Solve 1 = -2b + x for b. 3 Suppose 2x - 4v + 5 = 1, -4v = -5x + 20. Solve -q - x = q for q. -4 Suppose -3b + 12 = -3j, 4j - 4 = -2b + b. Suppose 12 = bf - 0f. Solve w = 5 - f for w. 2 Let m = 6 + -4. Let v be (-5)/(-10) - 1/(-2). Let g = m + v. Solve -g = 2h - 5h for h. 1 Let m be 0/(2(-1)/(-2)). Solve -2r + 5r = m for r. 0 Let a(v) be the third derivative of v6/120 + v5/5 + 5v4/12 - 11v*3/6 - 4v*2. Let s be a(-11). Let n = s - -3. Solve -nh - 2h + 10 = 0 for h. 2 Let q(g) be the first derivative of g2/2 + 10g + 3. Let i be q(-7). Solve io - 4o = 0 for o. 0 Suppose -a - 3c = 19, -2a - 2a - 5c = 55. Let n = 11 + a. Solve 21 = -5v + n for v. -4 Suppose -4j - 1 - 15 = 0. Let b = j + 4. Solve -2k + 0k = b for k. 0 Let j be (-1 - -4) + 3 + 0. Solve 0 = -ji + 4i for i. 0 Let d(p) be the first derivative of -p*2/2 - 2p + 1. Let u be d(-4). Suppose -2 = -i + u. Solve 0 = -2x - 0 + i for x. 2 Let r = -8 - -11. Suppose -ri + 7 = -m, -i - m - 5 = -2i. Suppose -5x + 16 = 3n, 2n + 26 = 4x - 0n. Solve xs = -9 - i for s. -2 Suppose -5y + 12 = -3. Suppose 0 = -6z + 2z. Let u = z - -3. Solve 0 = -3v + u + y for v. 2 Let w(f) = 8f*2 - 13f - 6. Let a(v) = 7v2 - 12v - 6. Let k(n) = 7a(n) - 6w(n). Let o be k(7). Solve -4j - 5 + o = 0 for j. -1 Let a(q) = 2q - 1. Let b be a(-7). Let s be ((-20)/b)/((-2)/(-3)). Suppose 3k = -n + 5, -14 = -sk + 4n - 6. Solve -j = j - k for j. 1 Let v(m) = 33m + 3. Suppose 5 = 4i - 5i, 5a = -5i - 35. Let d be v(a). Let r be d/(-12) + 1/(-4). Solve -3g + rg = 0 for g. 0 Let p = -22 + 27. Suppose 8 = q + p. Solve 0 = -qr - 0 + 3 for r. 1 Let p = 7 - 5. Suppose 0x - 2q = 3x, -2q = -5x + 16. Let w(y) = 8y2 - y + 1. Let m be w(1). Solve -m = -pz - xz for z. 2 Let t be 2 - (0/(-5) - -2). Solve -1 = -i - t for i. 1 Let z(d) = 2d + 4. Let h be z(-2). Suppose 6q - q = 0. Suppose q = 3f - 6f. Solve h = -3x - fx for x. 0 Let o = -13 + 31. Suppose 3d = -p + o, 3p + 2d + d - 24 = 0. Suppose 4h + 5s - 19 = 0, 5s = -3h - 0s + 18. Solve 4m - p = h for m. 1 Let a(q) = 4q - 14. Let v be a(4). Solve 0 = -vz - 2 for z. -1 Let l be 2/(-4) - (-10)/4. Suppose 0w - ld + 2 = 4w, -5 = -5d. Let m be (-4 - -6) + (-1 - 1). Solve 3h - 3 + m = w for h. 1 Let r(w) = 10w*2 - 1. Let m be r(1). Solve 0 = mq - 5q for q. 0 Suppose 4j + 19 = z - 5, -5j = -2z + 33. Suppose 3s + 2 = -2s + zw, 3s + w - 9 = 0. Suppose 0 = p + b - 7, 5b = 11 + 14. Solve -sq - pq = 0 for q. 0 Let a(q) = q - 5. Let l be a(10). Suppose lp + 3 = x + 2x, 5 = 5x - 3p. Let u(n) = n2 + n - 1. Let t be u(x). Solve 0d = d - t for d. 1 Let z = 9 - 6. Let j = 2 + z. Solve -ji + 4 = -1 for i. 1 Let a = 24 - -5. Let d = a - 12. Suppose 0 = -4i - 8, -i + 8 = 3r - 2. Solve rz = 1 - d for z. -4 Let t(x) = 3x - 10. Let c(v) = 3v - 9. Let l(f) = 3c(f) - 2t(f). Let s be l(7). Solve 4a + s = 2 for a. -3 Let q(w) = -w3 - 28w*2 - 26w + 35. Let b be q(-27). Solve -2f - 2f - b = 0 for f. -2 Suppose -v + 3 + 0 = 0. Solve 2z - 10 = -vz for z. 2 Suppose -5g = 5m - 20, -4g + 10 = g - 5m. Let r(q) = 2 + 0 + gq3 + 5q - 4q2 - 4q*3. Let z be r(-5). Solve v + 2 = zv for v. 2 Let o = 36 + -32. Solve -d + 2 - o = 0 for d. -2 Suppose 0 = 16n + 6n - 176. Solve 0 = -9m + nm for m. 0 Let s(m) = -m3 - m2 + 2m - 1. Let b be s(1). Let d be (1 + b)1/(-2). Solve d = -4l + 4 + 16 for l. 5 Suppose -19t + 26 + 50 = 0. Solve 8w = tw - 20 for w. -5 Let b(f) = 5f2 - 3f*2 - 5f - 6f2 + f3 + 3 + 0f*2. Let l be b(5). Let z be (0 + 1)(2 - 2). Solve z = h - l + 1 for h. 2 Let v(c) = -c*3 + 6c*2 + 13c - 36. Let q be v(7). Solve qr - 11r = 0 for r. 0 Let j be (-3)/(-6)6 + 10. Let g(d) = -3d*2 + 11d + 19. Let c(w) = 2w2 - 7w - 13. Let i(f) = 7c(f) + 5g(f). Let s be i(6). Solve -sk - 7 = j for k. -5 Let h = 118 - 116. Solve -3p = -hp + 3 for p. -3 Let f(q) = q - 1. Let j be f(4). Suppose 0r - r + j = 0. Let s be -2 + 7 + (-6)/r. Solve 0 = sn - 15 - 0 for n. 5 Suppose -7d + 6*d = 10. Let c =	{ "pile_set_name": "DM Mathematics" }
(b) -0.3 (c) 2 (d) -3 b Suppose 0w - w - 1 = 0. Let r(x) = -x2 + 5x + 96. Let n be r(12). Suppose 3t = 5o - n, -2t + 5t + 12 = 0. What is the closest to w in o, 19, -3? o Let s = -355 + 352. What is the nearest to -2 in s, 0.2, -0.5, -4? s Let r be -11/(-87)3. Let x be (-1926)/(-630) - (-16)/(-280). Which is the nearest to x? (a) 1 (b) 0.5 (c) r (d) 0.2 a Let p(d) = 10d - 15d + 5d + 13 + 2d. Let w be p(-5). Let o = -165 + 161. What is the nearest to 1 in o, w, 0.07? 0.07 Let m = 7686 - 7686.2. Which is the closest to -4/3? (a) 5/508 (b) m (c) 2/15 b Let s(c) = 8c - 26. Let v be s(-6). Let b = v - -80. Let g be 1/26(6 + b). What is the closest to g in -1/4, 0.4, -3/2? 0.4 Let i = -336153.996 - -337589. Let z = -1440 + i. Let s = 0.004 - z. Which is the closest to 0.1? (a) s (b) 1.6 (c) -2 b Let h = 102/227 - 1372/2043. What is the nearest to -3 in h, 1/12, -9, -1? -1 Let o be -4 - 231/(-35) - 0 - 12/4. Let d be (-2)/4 - (-5)/(-6). Which is the closest to -1/4? (a) o (b) 2/3 (c) d a Suppose -10 = 5r - 5p, 3r = -4p + 6p - 8. Let q = 10342/5 + -2069. What is the closest to q in r, -5, 2? 2 Let o = 0.817 - 2.817. Let b = 30 - 31. What is the nearest to b in o, 5, -5/3, 1? -5/3 Suppose -6 = 2u - 2c - 14, 0 = -2u + 5c - 4. Let d = 5 - u. Let i = 89 + -88.9. What is the nearest to i in -0.2, 0.01, d? 0.01 Let a = -31.99 + 32.39. What is the closest to a in -3/4, 0.04, 0.3? 0.3 Suppose 0 = -9251q + 9246q + 50. Let o = -4 + 4. What is the closest to -1 in q, 3/4, o? o Let i = -1778 + 7115/4. Which is the nearest to -1? (a) i (b) 17 (c) 2 (d) -5 a Let f = 4 - 3.4. Let d = -669 - -673.55. Let v = -4.15 + d. What is the closest to -2 in v, f, 0? 0 Let b = -2204 + 2206. What is the closest to 1/23 in -0.5, b, -0.04, -2? -0.04 Suppose -2j + 264 = -136. Let w = j + -399/2. What is the closest to -2/3 in 0.3, w, -0.2? -0.2 Let f be (-9)/24 - (-1372)/2464 - 2/(-110). Let m(h) = -h*3 - 6h*2 + h + 6. Let n be m(-6). Which is the closest to -2/7? (a) -2/9 (b) n (c) f (d) 0.06 a Let y be (-3)/16/(-27)6. Let k be 4 - (-3 + (-226)/y). Let n = k - 65. What is the closest to n in -4, 0.1, 0.4? 0.1 Let y = 1024 - 1779. Let o = y - -754.9. What is the closest to o in 3, -1/5, 4/11, -5? -1/5 Let r be 1(21 - (-960)/(-45)). Which is the closest to -1? (a) r (b) 132 (c) -3/5 c Let d = 144.39 - 145. Let q = 0.991 + d. Let s = 0.019 + q. What is the closest to 2/5 in 0.2, s, 3/8? s Let h = 14026.6 - 14027. Let k = -1.1 + 1. Let z(s) = s*2 - 8s - 11. Let m be z(9). What is the closest to -1/3 in k, h, m? h Let s = 68.65 - 68.45. What is the nearest to -1 in 2/3, 5, s, -1/6? -1/6 Let q = -19310 - -19313. Which is the nearest to -0.2? (a) 399 (b) q (c) -2 c Let m = 2.1584 + -0.1584. Which is the nearest to -0.376? (a) m (b) -2/5 (c) 2/3 b Let n = 133 + -132.12. Let h = -3.12 - n. Let t = 21/26 - 4/13. Which is the nearest to -0.4? (a) -0.2 (b) t (c) h a Let l(f) = -f*3 + 18f*2 - 172f + 3639. Let x be l(19). Which is the nearest to 0? (a) -0.1 (b) -39 (c) x (d) 2 a Let l = -793 - -799. Let d be -8 + 6 - -2l/8. Let o = -0.1 - -2.1. Which is the nearest to 7/2? (a) -2/13 (b) d (c) o c Let z = -227.52 - 1.48. Let l = z + 228.9. Which is the closest to l? (a) -0.3 (b) -1 (c) 2 a Let w = -0.2447 - -0.3447. Let p = -187 + 186.6. Which is the nearest to p? (a) -3/2 (b) 23/5 (c) w c Let k = -14 + 9. Let h = 314.1 - 314.5. What is the closest to 2/5 in -1/13, h, 3, k? -1/13 Let a = 168.664 + -168. Let x = 0.164 - a. What is the nearest to -0.1 in -6, -5, x? x Let j = -23 - -39. Let k = j + -15. Let r = 0.104 - 0.204. What is the nearest to r in k, -3, 5/4? k Let j = -23.2 - -24.2. Let q = 7 - 7.3. Suppose 2v = -4t + 8, -v - 1 = 4t - 5. Which is the closest to j? (a) -2 (b) q (c) t c Let j be 2/9 + 1525/(-180). Let v = 8 + j. Let w = -16 + 16.3. What is the closest to v in 3, w, -8? w Let l = 7676 + -53734/7. What is the closest to 0.1 in 1/3, -4, -11, l? 1/3 Let q = 240.4 + -264.4. Which is the nearest to 0? (a) -1 (b) 0.01 (c) 2/5 (d) q b Let r = 232541/576534 - 3/3626. Let f = r + 14/53. Which is the closest to 1? (a) 13 (b) f (c) -0.1 b Let h = 24 - 28. Let y = -0.2 + -0.3. Let w = 5259.1 - 5259. Which is the nearest to w? (a) y (b) h (c) 0 c Let l(f) = 2f3 + 4f*2 + 14f + 20. Let s be l(-2). Let u be ((-7 - s) + -4)/((-3)/(-2)). What is the nearest to 11 in u, 0.5, 1, 3? 3 Let w = -454.56 - -454.9. What is the nearest to w in -3, -2, 5/4? 5/4 Let j be -2 + -1 + (-1369)/1170 + 4. Let q = j + 2/585. Let o = 7 + -4. What is the closest to 0.2 in q, o, -2/5? q Let d be (-7)/3(12/22)/2. Let n = 93/77 + d. Which is the closest to -0.1? (a) 0.5 (b) n (c) -3 a Let j = 57.025 - 0.025. Let v = j - 58. Let t be 57/60 + (1 - 2). Which is the nearest to t? (a) v (b) 0 (c) -5 b Let w(b) = -b2 - 64b - 995. Let v be w(-37). What is the nearest to 1 in v, 0.06, 6? 0.06 Suppose -20 = -5m, 43 = 4k - 3m + 11. Which is the nearest to 0? (a) 0.6 (b) k (c) 1/7 c Let j(f) = -13f - 34. Suppose -16s = -25s - 27. Let v be j(s). Which is the nearest to -4? (a) -2/3 (b) 7 (c) v a Let n = 21.6 + 2.4. Let j = 23.8 - n. Which is the closest to 2/3? (a) j (b) 0.1 (c) -0.5 b Let r be -1 - (15394/(-4464) - -2). Let u = 1/248 - r. Let x = 52043 + -52041. Which is the nearest to 0? (a) u (b) x (c) -5 a Suppose -4x = 5f, -2f + 0f = -2x. Let s be ((-3)/(15-1))/(140/(-25)). Let t = s - 3/14. Which is the closest to t? (a) f (b) 0.1 (c) 2/7 a Let s be (-6)/(-17)2/(-6). Let g = 92003 - 92002. Let w(k) = k + 1. Let v be w(4). Which is the nearest to g? (a) 4 (b) s (c) v b Let x = 0.4 - -4.6. Suppose 9w - 6w = 0. Let t = -6 + 10. What is the closest to w in t, x, -1? -1 Let d(v) = v3 - 11v*2 + 2v - 15. Let w be d(11). Suppose -314 = -wp - 125. Which is the closest to -0.2? (a) p (b) 1 (c) -0.3 c Let v(o) = -34o + 4. Let p be v(-4). Let d = p + -702/5. Let u = 5 - 4.7. Which is the nearest to d? (a) -3 (b) -5 (c) u c Let k = 14885 + -14899. Which is the nearest to k? (a) -1/4 (b) 5/4 (c) 0.18 a Let t = -115.57 - -115.37. Which is the closest to -352? (a) 0.1 (b) 1/3 (c) t c Suppose -4 = -13d + 9. Let l be ((-5 + 2)/(-9))/(d/(-3)). Let t be 3/6 + l/6 + 0. Which is the nearest to -11? (a) -3 (b) 2 (c) t a Let l = -0.122 - 0.478. Let w = -0.9 - l. Which is the closest to w? (a) -3 (b) -0.01 (c) 5 b Let n = 4 + -4. Suppose -6 = 3i + 3c, 6i - 4c = 8i + 2. What is the nearest to n in 0.2, -0.6, i, 7? 0.2 Let r = 1 - -2. Let l = -271.43 - -270.13. What is the closest to -0.1 in -0.2, -1/2, r, l? -0.2 Let r = 8.7 - 9. Let u = -2952 - -2953.6. Which is the closest to u? (a) 0.2 (b) r (c) 2 c Let v = 13754/5 + -2751. Which is the closest to -11? (a) v (b) 3 (c) -0.3 c Let l = -0.34 + -0.06. Let y = -23.35 - -25. Let q = y + -1.25. Which is the nearest to -6? (a) -1/5 (b) q (c) l c Let p = 3315 - 3316. What is the nearest to p in -5/4, -3, -0.7, 1.1? -5/4 Let t = -6 - -6.4. Let g = 6.7 - 6.7. Let z = 1.08 - 0.08. Which is the closest to g? (a) z (b) t (c) -4 b Let d = -1.1 - -0.8. Let u be (92/12 + -5)99/330. What is the nearest to -0.1 in 11, d, u? d Let k = -463.63 - 6.87. Let a = k - -470. What is the closest to 2/5 in 0.1, -4/3, -1/6, a? 0.1 Let g = 30 - 152/5. Let z = -0.0487 + -3.9513. What is the closest to g in z, 2/7, 9? 2/7 Let m = 8371/2 + -4110. Suppose -87 = 12v + 825. Let c = v + m. What is the closest to c in -2/17, -5/4, -0.4? -0.4 Let r = -0.43552 - 0.06448. Which is the closest to -1/3? (a) -1/4 (b) r (c) 2/33 a Let f be 46 + -49 + -2 + 24/5. What is the closest to 2 in 3/106, 1, f? 1 Let z = -321 + 2891/9. Let h = -0.41 + 0.25. Let b = 0.14 + h. What is the closest to b in 0.1, -5, z? 0.1 Let g = -12 + 21/2. Let q = -917 - -916.7. Which is the closest to g? (a) -2 (b) q (c) 0 a Let j be (28/35)/(44/10). Suppose 24p + 220 = 172. What is the nearest to j in 1/4, -0.4, p, 1? 1/4 Let r = 82.2 - 82. Let k be (-10120)/(-680) - (-15)/(-1). Which is the closest to r? (a) 1/6 (b) -0.1 (c) k a Let u = -1344 - -1339. Which is the nearest to u? (a) -0.3 (b) -3 (c) -1/9 b Suppose 0 = 3k + 4o - 161, 166 = 3k - 15*o + 1	{ "pile_set_name": "DM Mathematics" }
(sqrt(13) + sqrt(13)5)2. -4 + 13sqrt(13) Simplify -3 + (2 + sqrt(2)-2)5. -10sqrt(2) + 7 Simplify (sqrt(17) - (sqrt(17) + -1 + sqrt(17) + -2))*2 + sqrt(17) + sqrt(1377) + -1. 4sqrt(17) + 25 Simplify -5(sqrt(3) + sqrt(30)/sqrt(160) - sqrt(3)) + 5. -5sqrt(3)/4 + 5 Simplify 4-2(-3 + sqrt(18)/sqrt(6))*2. -96 + 48sqrt(3) Simplify 0 + (-5(sqrt(76)-3)/sqrt(4))*2. 4275 Simplify (51-3(-2sqrt(121))/sqrt(11))2. 9900 Simplify -1(sqrt(78)/(-2sqrt(6) + sqrt(6)) - (sqrt(13) + -1 + -1))2. -56 + 8sqrt(13) Simplify (sqrt(192) + -2 + sqrt(192)-2)2. 32sqrt(3) + 196 Simplify sqrt(468) + -2sqrt(468) + -4. -6sqrt(13) - 4 Simplify -2 + sqrt(36)/(sqrt(192) - sqrt(12)). -2 + sqrt(3)/3 Simplify (3sqrt(325))2 - (-3 + (sqrt(104)/sqrt(8) - sqrt(13))). 2928 Simplify sqrt(152)/(5sqrt(8)) + sqrt(19) + 0 + -5. -5 + 6sqrt(19)/5 Simplify (-5 + (0 + sqrt(448) + -3)-5)*2. -800sqrt(7) + 11300 Simplify (2 + sqrt(128) + (sqrt(2) - sqrt(242)1))2. -8sqrt(2) + 12 Simplify (-1 + sqrt(3) - sqrt(3))*23-5. -15 Simplify (4 + (sqrt(19) + 2 + sqrt(19) - sqrt(19)) + -4 + sqrt(19)-1)*26. 24 Simplify (3-1sqrt(189))/sqrt(3). -9sqrt(7) Simplify (-4 + sqrt(17) + sqrt(34)/sqrt(2) + 4)2 + 3. 71 Simplify (sqrt(500) + sqrt(500)-3 + -5 - (-1 + 1 + sqrt(500)))*2. 300sqrt(5) + 4525 Simplify (sqrt(100)-1 - sqrt(100))/sqrt(5). -4sqrt(5) Simplify (6(5 + sqrt(5) + (sqrt(5) - (-3 + (sqrt(5)-3 - sqrt(5))))))*2. 3456sqrt(5) + 8784 Simplify -4 + -1 + sqrt(1900). -5 + 10sqrt(19) Simplify 2 + sqrt(891) + (sqrt(110)/sqrt(2))/sqrt(5). 2 + 10sqrt(11) Simplify -2 + (-2sqrt(72)1 + sqrt(72) + 4)*2. -48sqrt(2) + 86 Simplify 4 + ((0 + sqrt(153))-4)2 + (sqrt(153) - (sqrt(153) + (sqrt(153) + 0 + sqrt(153))-3)). 18sqrt(17) + 2452 Simplify (1sqrt(325)1 - 2(2 + sqrt(325)))*2. 40sqrt(13) + 341 Simplify -1(0 + sqrt(200)) + -1. -10sqrt(2) - 1 Simplify (sqrt(187)/sqrt(11) + -2)2 - ((sqrt(1700) + 1 - sqrt(1700))2 - sqrt(1700)). 20 + 6sqrt(17) Simplify (sqrt(119)/(sqrt(14)/sqrt(2) + sqrt(7))-2)*2. 17 Simplify (sqrt(110) + (sqrt(110) - (2(sqrt(110) - sqrt(110)-1) + sqrt(110) + sqrt(110))))/(sqrt(490) - sqrt(490)-1 - sqrt(10)). -4sqrt(11)/13 Simplify (2sqrt(143)-1)/(2sqrt(1331) + sqrt(1331)). -2sqrt(13)/33 Simplify 2 + (sqrt(65) - (sqrt(65) + -2sqrt(65) - sqrt(65))-6)/sqrt(5). -11sqrt(13) + 2 Simplify -2 + (sqrt(11) - sqrt(176)) + -2(sqrt(11) - (0 + sqrt(11)) - sqrt(11))2. -24 - 3sqrt(11) Simplify (sqrt(112)-1 - (-4(sqrt(7) + sqrt(7)-2))2) + -3. -115 - 4sqrt(7) Simplify sqrt(228)/(sqrt(12)-2-1)5. 5sqrt(19)/2 Simplify -1sqrt(405)4. -36sqrt(5) Simplify -1(4 + sqrt(17)-2). -4 + 2sqrt(17) Simplify (sqrt(70) - (sqrt(70)3 - sqrt(70))-6)/sqrt(10). 13sqrt(7) Simplify -3-3((sqrt(6)/(sqrt(3) + (sqrt(3) - sqrt(3)-1)) - sqrt(2)) + sqrt(2)). 3sqrt(2) Simplify sqrt(10)/(2sqrt(45)) + 2. sqrt(2)/6 + 2 Simplify 4 + -3sqrt(38)/(sqrt(2) - sqrt(18)3 - sqrt(2)). sqrt(19)/3 + 4 Simplify 2 + -6(-3(sqrt(70) - 2sqrt(70)))/sqrt(10). -18sqrt(7) + 2 Simplify sqrt(28)/(sqrt(24)/sqrt(6)) + (sqrt(35)/(sqrt(5)-1))2. sqrt(7) + 7 Simplify (5 + sqrt(11)1 - sqrt(11))*2-2. -50 Simplify (0 + sqrt(153))2. 6sqrt(17) Simplify (sqrt(272))*2 + -2 + 0 + 0. 270 Simplify (6(sqrt(91)-1 + sqrt(91)))/(sqrt(175)-5). 0 Simplify (sqrt(84) + ((sqrt(84)1 - sqrt(84) - sqrt(84))2 - sqrt(84)) - sqrt(84))/sqrt(12). -3sqrt(7) Simplify (-1sqrt(2432))/((sqrt(100)/sqrt(5))/sqrt(10)). -8sqrt(19) Simplify -3 + -2sqrt(242) + 5. -22sqrt(2) + 2 Simplify -2 + sqrt(275) - (-5 + (-3 + sqrt(11))2). -17 + 11sqrt(11) Simplify ((sqrt(495) + sqrt(55))-6)/(sqrt(5) + (sqrt(100)/sqrt(5))/sqrt(4)). -12sqrt(11) Simplify 1 + sqrt(76) + (sqrt(190) + -2sqrt(190) + sqrt(190) - sqrt(190))/sqrt(10). 1 + sqrt(19) Simplify (5 + -4 + -2 + -1 + sqrt(1100))2. -40sqrt(11) + 1104 Simplify ((sqrt(324)/(sqrt(18)/sqrt(2)))/sqrt(12)2)2. 12 Simplify -2 + ((sqrt(425) - (-1 + sqrt(425))) + 2 - 6(sqrt(425) + (sqrt(425) - sqrt(425)1 - sqrt(425))))2. 7 Simplify (5sqrt(102)-3 - sqrt(102))/(sqrt(6) + sqrt(726) + (sqrt(726)2 - sqrt(726) - sqrt(726)) + sqrt(726)). -16sqrt(17)/23 Simplify (2sqrt(1664))/(sqrt(40)/sqrt(5)). 8sqrt(13) Simplify (5 + 3 + sqrt(7) + sqrt(175)-1)*2. -64sqrt(7) + 176 Simplify sqrt(38)/sqrt(2)-2 - ((2 + sqrt(304) - sqrt(304)) + sqrt(19))2. -6sqrt(19) - 23 Simplify -3 + sqrt(14)/sqrt(2) + 2. -1 + sqrt(7) Simplify (sqrt(1215) - 2sqrt(1215))/sqrt(3). -9sqrt(5) Simplify 4sqrt(11)2 + 4 + 3. 7 + 8sqrt(11) Simplify sqrt(2299) + (sqrt(2299) - (2 + sqrt(2299))2-1). 66sqrt(19) + 2303 Simplify (sqrt(22)/(sqrt(6)/sqrt(3))-5)*2. 275 Simplify sqrt(20)/(sqrt(4) + (sqrt(36) - sqrt(4))) + ((sqrt(5) + -1)-4)*2. -95sqrt(5)/3 + 96 Simplify (4(sqrt(931) - (sqrt(931) + 1)))2 + -4. 12 Simplify (-1(sqrt(2) - (2 + sqrt(2) - sqrt(2))))2 + (sqrt(50) + 0)2. -4sqrt(2) + 56 Simplify (2sqrt(3146) - sqrt(3146))/sqrt(2). 11sqrt(13) Simplify (-2 + sqrt(1700) - sqrt(1700))2-6. -24 Simplify 2(sqrt(176) + 0)2. 16sqrt(11) Simplify -1(-1sqrt(204)-6)/(sqrt(96)/(sqrt(32) + sqrt(8))). -18sqrt(17) Simplify ((sqrt(627) - (sqrt(627) + sqrt(627) + (sqrt(627) - sqrt(627)-5)) - sqrt(627))/sqrt(11))/sqrt(3). -8sqrt(19) Simplify (-1sqrt(4320) + sqrt(4320) - sqrt(4320) - sqrt(4320) - sqrt(4320))/(sqrt(160)-6). 3sqrt(3)/2 Simplify ((-2sqrt(30))/sqrt(10))2 - (0 + sqrt(27)). -3sqrt(3) + 12 Simplify (sqrt(96)/sqrt(2))*2 + sqrt(3) + sqrt(3) + 1 + 4. 2sqrt(3) + 53 Simplify sqrt(700)16. 60sqrt(7) Simplify 3(sqrt(54)/sqrt(3)-4)/sqrt(9). -12sqrt(2) Simplify (-2 + sqrt(76)/(sqrt(12)/sqrt(3))-2)-4. 8 + 8sqrt(19) Simplify sqrt(39)/(sqrt(3) + -6sqrt(18)/sqrt(6) - sqrt(3)). -sqrt(13)/6 Simplify ((0 + sqrt(176) + -2)*2 + sqrt(176))3. -36sqrt(11) + 540 Simplify (3(2 + sqrt(65)/sqrt(5) + -4sqrt(65)/sqrt(5)))2. -108sqrt(13) + 1089 Simplify 3sqrt(275)1. 15sqrt(11) Simplify (-4 + (sqrt(1331) - sqrt(1331)2-3))2. -616sqrt(11) + 65235 Simplify ((sqrt(245) - (-2sqrt(245) - sqrt(245)) - sqrt(245))2 + -1)-3. -6612 Simplify (sqrt(700)-2 - (1sqrt(77) + sqrt(77))/sqrt(11))*2. 3388 Simplify (2sqrt(832) + sqrt(1573)1)2. 9477 Simplify sqrt(8) + 0 - (sqrt(288))2. -288 + 2sqrt(2) Simplify 2(3 + sqrt(612) + -1 + sqrt(612) + 3). 10 + 24sqrt(17) Simplify -2 + (-1sqrt(363))2. 361 Simplify 5((sqrt(68) - (sqrt(68) + (sqrt(68) - (4 + sqrt(68) - sqrt(68))))) + sqrt(68))*2. 80 Simplify -6(sqrt(363) + 2 - sqrt(363)) + -1. -13 Simplify (sqrt(192) - (sqrt(192) + 1 + sqrt(192)))*2 + sqrt(192) + -4 + 5. 24sqrt(3) + 194 Simplify 3(3 + (-4 + sqrt(242) - sqrt(242))). -3 Simplify (sqrt(342)/(sqrt(6) + 2sqrt(6)))/(sqrt(3) + (sqrt(75) - (sqrt(75) - (sqrt(75)-2 - sqrt(75) - sqrt(75))))). -sqrt(19)/57 Simplify sqrt(153)/(3sqrt(9)) - sqrt(153)/(sqrt(27)/sqrt(3)). -2sqrt(17)/3 Simplify -1 + sqrt(7) + 3sqrt(7)-1 + ((4 + sqrt(28)/sqrt(4) + sqrt(7))2 - 5sqrt(21)/sqrt(3)). 9sqrt(7) + 43 Simplify ((sqrt(490) + sqrt(490) + sqrt(490) + sqrt(490)-4)/sqrt(10))/sqrt(7). -sqrt(7) Simplify -1(-1 + sqrt(108)) + 3. -6sqrt(3) + 4 Simplify sqrt(77)/(3sqrt(22)/sqrt(2))1. sqrt(7)/3 Simplify (sqrt(78) - 3(-2sqrt(78) + sqrt(78)))/sqrt(6). 4sqrt(13) Simplify ((3 + (sqrt(12) - (-2sqrt(96) - sqrt(96))/sqrt(8))/sqrt(4))2)2. 96sqrt(3) + 228 Simplify -52(sqrt(45)/sqrt(3))/sqrt(3). -10sqrt(5) Simplify (sqrt(363) + -2)3 + (sqrt(363) + -1)-2. -4 + 11sqrt(3) Simplify -5(0 + sqrt(171)). -15sqrt(19) Simplify 2-5(sqrt(26)/sqrt(2)-2 + 1sqrt(13) + -3). 30 + 10sqrt(13) Simplify (((-1sqrt(102) - sqrt(102))/sqrt(6))*2 - sqrt(17)) + (sqrt(153) - ((sqrt(153)1)*2 + sqrt(153))). -85 - sqrt(17) Simplify -6(1 + sqrt(304)) + sqrt(304). -20sqrt(19) - 6 Simplify -2 + sqrt(143)/(3sqrt(11)). -2 + sqrt(13)/3 Simplify 3 + 5 + (4-1sqrt(119))/sqrt(7). -4sqrt(17) + 8 Simplify ((sqrt(931))2 + -4)1 + -4. 923 Simplify -2sqrt(539) - ((-1 + sqrt(11))4)*2. -192 + 18sqrt(11) Simplify -2((sqrt(192) - (4 + (sqrt(192) - sqrt(192)-1)))*2 - sqrt(192) - (-5 + sqrt(192) + sqrt(192) + 0)). -426 - 80sqrt(3) Simplify -1 + -6(sqrt(18) + sqrt(2) + sqrt(2)). -30sqrt(2) - 1 Simplify (-2 + (sqrt(19) - (1sqrt(2736) + sqrt(19))))2 + (6(sqrt(19) - sqrt(304)) -	{ "pile_set_name": "DM Mathematics" }
Let r be o + -4 + -1 + -20. Let g = r - -28. What is the units digit of g? 5 Let q(t) = t - 1. Let o be q(2). Suppose -k = -11k + 1040. Suppose 3d + k + 33 = 5l, 0 = d - o. What is the units digit of l? 8 Let c(r) = r2 - 11r + 274. What is the hundreds digit of c(0)? 2 Let z(o) = o*3 - 2o*2 + 30o - 33. What is the tens digit of z(9)? 0 Let i(j) = 2j + 4. Let c be i(4). Suppose 5f + c = 2f. What is the tens digit of 5(-44)/f - 1? 5 Suppose 0 = -3t + 7628 + 958. Let n be t/(-45) - 2/5. Let o = n + 104. What is the tens digit of o? 4 Let c = 122 + -46. Suppose -4d = -3d - c. What is the units digit of d? 6 Let l(c) = c2 + 5c - 7. Let w be l(-7). Suppose -o - 109 = -2d + w, -232 = -4d - 3o. Let x = 89 - d. What is the tens digit of x? 3 Let z(s) = 72s + s*2 - 19 + 73s - 145s. Let q = 14 - 6. What is the tens digit of z(q)? 4 Suppose 468 = -6n + 114. Let y = n - -125. What is the units digit of y? 6 Let u(h) = 3h + h3 + 1 + 19h*2 - 14h - 10h + 1. What is the tens digit of u(-20)? 2 Let k(d) = -4d*2 - 13d + 9. Let j(m) = -9m2 - 25m + 17. Let s(x) = -3j(x) + 7k(x). Let r be s(-13). Suppose v = 4v - r. What is the tens digit of v? 1 Let r(n) be the second derivative of -4n3/3 + n2 - 11n. What is the units digit of r(-11)? 0 Let a be (0/2)/(-3) + 90. Suppose 8c - a - 390 = 0. What is the tens digit of c? 6 Let l(v) = v*2 - 6v + 14. Let f be l(8). Suppose -18 = -d + f. What is the tens digit of (1 - 0) + d + -13? 3 Suppose -14l + 8541 = 1149. Suppose l = -3p + 5p. What is the units digit of p? 4 Let o be (-24)/18(2850/(-4))/5. Let r = o - 56. What is the tens digit of r? 3 Suppose 113p = 120p - 2114. What is the units digit of p? 2 Suppose 5h - 4s = -0s - 978, -3 = s. Let a(z) = z2 + 8z - 34. Let v be a(-11). What is the tens digit of v/(-4) - h/8? 2 Let k be (2 - -3)119. Let w(l) = l + 16. Let p be w(-12). Suppose y + py = k. What is the tens digit of y? 1 Suppose 0 = -2g + t + 16, -40 = -4g - 0g - 2t. Let v(q) = q - 5. Let n be v(g). Suppose -5h + 1 = -2x + 3, -x - nh + 27 = 0. What is the tens digit of x? 1 Suppose 5t = 4t + 9. Suppose -1146 = -15h + th. What is the units digit of h? 1 Suppose 5x = 4f - 10, -4x + x - 6 = -f. Suppose f = q - 2. Suppose -4a - 3w = -3 - q, 50 = 5a - 5w. What is the units digit of a? 5 Suppose 5v = v. Let f(z) = z3 - z2 - z + 13. Let a be f(v). Let l = a - -10. What is the tens digit of l? 2 Let s(v) = -v*3 - 7v*2 - 5v - 10. Let b(l) = 5l - 7. Let n be b(5). Let q be 65/(-9) + n/81. What is the tens digit of s(q)? 2 Let f be (4 + (0 - 9))-28. What is the tens digit of (-5)/(416/f - 3)? 7 Let o be ((-9)/2)/((-9)/24). Let z = o + -6. What is the tens digit of 11/(-3 - (-21)/z)? 2 Suppose 0 = -14s + 17s - 18. Let r(t) = 2t2 + t + 5. What is the tens digit of r(s)? 8 Let f = -14 + 20. Let u be 0 + -4 + f - -22. Let y = u + 6. What is the tens digit of y? 3 Let q(i) = 9i - 9. Let v be q(8). Suppose -3p + 2o + 2o = -v, 5p - 116 = 3o. What is the units digit of p? 5 Let q(a) = -a2 - 7a - 10. Let z be q(-3). What is the units digit of ((-47)/z)/(5/(-20))? 4 Suppose -3p - p + i = -8938, 4474 = 2p + 2i. What is the hundreds digit of p? 2 Suppose 4q + 0q = 0. Let t be (q + 5)/((-1)/(-8)). Let p = 69 - t. What is the units digit of p? 9 Suppose 2g + u - 242 = 138, 4g - 744 = 2u. Suppose 2h + 0h = -w + g, -4h + 386 = -3w. What is the tens digit of h? 9 Suppose 5j - 2 = 13. Suppose -jf + 15 = 3. Suppose w - 149 = h - 6h, 3w = fh - 123. What is the tens digit of h? 3 Suppose 3k + 3d + 106 = 4k, -90 = -k - 5d. Suppose -k = -4v - 24. Let j = -2 + v. What is the units digit of j? 7 Suppose 4p = 2x - x + 54, 4x + 5p = -174. Let z = x - -92. What is the units digit of z? 6 What is the thousands digit of ((-56)/(-1))/(5/(-460)-4)? 1 Suppose 0 = 5u + 4z - 40, 2u = z - 1 + 4. Let m(i) = 16i + 27. What is the tens digit of m(u)? 9 Suppose 0 = 18x - x - 17986. What is the units digit of x? 8 Let t(q) = -q*2 + 5q - 3. Let b be t(3). Suppose 3d + f - 13 = 0, -bd - 2 = 5f + 5. Let l(g) = g + 5. What is the units digit of l(d)? 1 Suppose 2z - 3t - 1331 = 0, z + 2t = 5t + 670. What is the hundreds digit of z? 6 Let f = 1880 - 480. What is the thousands digit of f? 1 Suppose -68t + 65t = -1491. What is the hundreds digit of t? 4 Let z(a) = 195a*3 + 2a*2 - a + 1. What is the hundreds digit of z(1)? 1 Let y(p) = 3p + 6. Let d(w) = w*3 + 12w*2 + w + 12. Let l be d(-12). Let x be y(l). What is the tens digit of 104/x - 16/48? 1 Let s(u) = 6u*2 - 4u - 9. Let d = 92 - 86. What is the units digit of s(d)? 3 Let u(z) be the first derivative of z*4/4 - 2z3/3 - z2 + 8. Let g be u(3). Suppose -6x + 4k = -x - 228, -2k = gx - 150. What is the units digit of x? 8 What is the units digit of 21/49 - (-25465)/35? 8 Let d be ((-18)/3 - -4)/(-1). Suppose 0 = dc - 75 - 43. What is the tens digit of c? 5 Suppose -j + 103 = -o - 201, -5j = -2o - 1520. What is the units digit of j? 4 Let t(a) = -a3 - 12a*2 + 2a + 3. What is the hundreds digit of t(-15)? 6 What is the tens digit of (-8)/(-20)12265/11? 4 Let p be 656/56 + 2/7. What is the units digit of 217/5 + p/20? 4 Let t(l) = l3 - 6l*2 - 7l + 8. Let c be t(7). Suppose 5r - 38 = -c. What is the units digit of r? 6 Suppose -178n = -176n - s - 5849, 0 = -4n + s + 11693. What is the tens digit of n? 2 Suppose -2j = -k + j + 1074, 6 = -3j. What is the hundreds digit of k? 0 Let q = -59 - -58. Let h = 27 + -51. What is the tens digit of (-2)/q - 1h? 2 Let u(q) = q2 + 3q - 5. Let z = 10 - 5. Let h be u(z). Suppose l + 0l = h. What is the tens digit of l? 3 Let b(o) be the third derivative of o4/24 + 10o*3/3 - 3o*2. What is the units digit of b(-8)? 2 Let m = 11 - 13. What is the tens digit of m + 18/12 - 253/(-2)? 2 Suppose -3z + 4z = -3j + 2573, 5j - 4295 = 5z. What is the units digit of j? 8 Let w be (2 + (-16)/5)20/(-6). Let b(q) = -q3 + 4q*2 + 12. What is the tens digit of b(w)? 1 What is the units digit of (21 - -6)/(1/37)? 9 Suppose -4n + 4y + 90 = -34, 4n - 92 = -4y. Let o = -57 + n. What is the units digit of 10(-2)/o6? 4 Suppose 4s - 8s = -2560. Suppose 6p - s = 2p. What is the tens digit of p? 6 Let p(j) = 2j - 42. Let k be p(17). What is the hundreds digit of 128 - 7/((-14)/k)? 1 Let z = -596 + 1660. What is the units digit of z? 4 Let x = 54 + 6. Suppose -8p = -13p + x. What is the units digit of p? 2 Suppose 3 = -2m + 11. Suppose -5j + 21 = -m. Suppose -5w = l - 4l - 119, 0 = -4w + jl + 103. What is the units digit of w? 2 Let p(j) be the third derivative of -j5/60 + j4/2 - 5j3/2 - 5j*2. Let r(b) = 6b*2 - b. Let o be r(-1). What is the units digit of p(o)? 0 What is the units digit of ((-39)/2)/132 + 232? 9 Let l(k) = 386k + 1. What is the tens digit of l(4)? 4 What is the tens digit of (6035 - -88) + (1 - 8)? 1 Let h = -353 + 357. Let v be (-2)/(1(-2)/2). Suppose 2u = -v + h. What is the units digit of u? 1 Suppose -4n + n + 5p = -2192, -4n + 5p + 2921 = 0. Let a = n - 514. What is the hundreds digit of a? 2 Let t(h) = 10h*2 - 20h - 48. What is the units digit of t(8)? 2 Let f be 226/(-8)3 + (-10)/40. Let q = f + 192. What is the tens digit of q? 0 Let v(r) = 6r + 4. Let u(q) = 2q + 10. Let m be u(-3). What is the tens digit of v(m)? 2 Let n = -7 + 13. Let i = 3 - n. What is the tens digit of -6i/2 - -2? 1 Let q be (6/3 - 2)1. Let n = q + 33. What is the tens digit of n? 3 Let x be 20/(-3)3/(-2). Suppose -r + 6 + x = 0. Let p = -8 + r. What is the units digit of p? 8 Suppose -v - 5 = 2. Let a = -64 + 118. Let j = v + a. What is the tens digit of j? 4 Let w(q) = q*3 + 7q*2 - 6q + 10. Let f = -6 + -2. Let p be w(f). Let l = 11 + p. What is the units digit of l? 5 Suppose 0 = -58t + 129018 + 56118. What is the thousands digit of t? 3 Let y(r) = 2r + 6. Let l be y(0). Let o(x) = -x*2 + 7x + 1. Let m be o(l). What is the tens digit of 4/(1 + m)134? 6 Let t = 151 + -220. Let n = t - -190. What is the hundreds digit of n? 1 Let l(i) = -i3 + 4i*2 - i + 1. Let t be l(3). Let s = 2 + t. Let x(b) = 3b - 12. What is the tens digit of x(s)? 1 Let c	{ "pile_set_name": "DM Mathematics" }
and 564/(-70) - o/25. 21 Let t = -136708175/78 + 1752638. Let k = -300/13 - t. Calculate the common denominator of k and 75/14. 42 Let i = 33 + -27. What is the common denominator of (-102)/2015/i and 8/3? 12 Let k(z) = z2 + z - 1. Let f(r) = 4r*2 - 12r - 27. Let v(q) = -f(q) + 5k(q). Calculate the least common multiple of v(-17) and 3/496/4. 198 Suppose n = 3, -1261 = -5t + 5n + 214. Suppose -v + 48 - t = 0. What is the smallest common multiple of 6 and v/(-14) - (-6)/42? 18 Let u = 121733/5830 + 381/265. Let n = u + -1717/55. Let x = -493/2 + 242. Find the common denominator of n and x. 10 Let f(z) = 4z2 + z - 4. Calculate the lowest common multiple of f(-2) and 35. 70 Let h(m) = m3 - 10m*2 + 4. Let q be h(10). Suppose k - q = -0. Calculate the smallest common multiple of 16 and k. 16 Let k = -27 - -25. Calculate the smallest common multiple of (32/(-48))/(k/12) and 98. 196 Let k(b) = 2621b + 21. Let q be k(11). Let c = q + -519203/18. Calculate the common denominator of -23/10 and c. 90 Let y = 2/981 + 15682/6867. Find the common denominator of y and (14/4)/(3/(-10)). 21 Calculate the common denominator of 11/(11088/184) + (-8)/14 and (-546)/(-27)(-15)/(-20). 18 Suppose 0 = 3b - 23 - 49. Let t(x) = -2x3 + 3x*2 + 3x + 2. Calculate the least common multiple of t(-2) and b. 24 Let s = -2 + -4. What is the common denominator of (s/8)/((-8)/(-132)) and 73/6? 24 Let h = -2446 + 21943/9. What is the common denominator of h and -65/192? 576 Suppose j - 60 = -3s, 0 = 2j - 4j - 4s + 112. Suppose -2l = -3g + 34, -2g - 5l = 19 - j. Let o = -10 + 18. What is the least common multiple of g and o? 24 Suppose -5r = 299 - 434. Suppose r = 5z - 23. What is the lowest common multiple of 165 and z? 330 Suppose -2z - 1 + 57 = 0. Let h be z/98 - (-250)/7. Find the common denominator of 89/10 and 435/h8/20. 30 Suppose 20 = -5l + 5i, -6i - 4 = -2l - i. What is the least common multiple of 3/(-6)-8 - -7 and 96/15 + l/20? 66 Suppose -z = 3g - 13 - 5, 4z - 3g - 27 = 0. Suppose 7q - 3q - 50 = -5p, 3q = p + z. Calculate the least common multiple of p and 2. 6 Let p be -3 + (-44)/(-16) - (-15626)/8. Let m = p - 42953/22. What is the common denominator of m and 48/11? 22 Suppose 14w - 39w = -50. What is the least common multiple of (-3)/(-12) - 78/(-8) and w? 10 Suppose 4i = -4x + 36, -22 = -2i + x - 5x. Suppose iv - 126 = 4v. What is the lowest common multiple of v and 10? 210 Let x = 402 + -751/2. What is the common denominator of x and (-169)/(-18) - (0 - -1)? 18 Let c(x) = -x*3 - 14x*2 - x - 18. Suppose 24 + 18 = -3n. Let j be c(n). What is the common denominator of 31/8 and 1/j - 63/8? 8 Let u = -26843 + 2684221/100. Find the common denominator of -107/40 and u. 200 Suppose w + 12 - 20 = 0. Let x = 404/539 + -10/49. Find the common denominator of 2 - 3124/w and x. 22 Suppose -7l + 10l = -52623. Let q = l + 210367/12. Find the common denominator of q and -47/16. 48 Let v be (100/(-35))/((-4)/14). What is the common denominator of ((-2)/v)/(12/(-550)) and 4/30(-144)/(-2)? 30 Let n = -1/3039 - -152965/6078. Calculate the common denominator of -26/9 and n. 18 Let n be -2 - 510/(-9 - -4). What is the common denominator of 63/20 and n/(-720)(-4)/10? 180 Let m(v) = 30v - 132. What is the lowest common multiple of m(9) and 15? 690 Let o = -1/1678 + -1256/4195. Calculate the common denominator of o and -61/40. 40 Let z = -1/1291522 + 31643639/1743554700. Find the common denominator of z and -73/16. 10800 Let b = 1684256/45 + -37426. Calculate the common denominator of 62/5 and b. 45 Suppose -4u + 56 = 2f, -2f + 4u = -0u - 64. What is the lowest common multiple of f and -418/48 + 9/2? 30 Suppose 0 = -5g + 348l - 344l + 34, 0 = -5g - 3l + 27. Calculate the lowest common multiple of 21 and g. 42 Suppose -n = -3n + 8. Suppose 16 = nv - 0. Suppose 5 = vq + q. Calculate the smallest common multiple of q and 11. 11 Let j = -375 + 2191/6. Find the common denominator of j and -139/66. 66 What is the least common multiple of (3 - -1 - 2)10 and 14? 140 Suppose 1 = -g + 11. Suppose 9o = 1 + 44. Suppose 5l - 68 = -3p - 0p, -2l - op = -12. What is the least common multiple of g and l? 80 What is the lowest common multiple of (1715/(-147))/((-3)/9) and 546? 2730 Let w be 1809 + (20/(-5) - -3). Let r = -7151/4 + w. What is the common denominator of -101/22 and r? 44 Let i(p) = -p2 - 4p + 14. Let x be i(-6). Calculate the common denominator of x/4 + 54/(-42)3 and -91/10. 70 Let q = -141679459/18 + 7868877. Let c = q + 2202. Let x = -303/4 + 3299/44. Calculate the common denominator of x and c. 198 Let b = 50 - 30. Let u(c) = 18c + 38. Calculate the least common multiple of u(1) and b. 280 Let t(m) = m*2 + 13m + 47. Let c be t(-6). Suppose 6h - ch - 45 = 0. Calculate the lowest common multiple of 3 and h. 45 Let n = 181 + -171. What is the lowest common multiple of n and 14? 70 What is the lowest common multiple of (-60)/87020/(-75) and 6? 702 Let p = -434 - -441. Let h(b) = 6b - 2. Calculate the least common multiple of p and h(3). 112 Let m = 20641/1251 - -1/2502. Find the common denominator of (-23)/22/14 and m. 14 Let a(j) = -j3 - 5j*2 + 5j - 5. Let t be a(-6). Suppose 0y - 2k + 22 = 4y, -y = -4k - t. What is the least common multiple of 8 and y? 40 Let h(q) be the first derivative of -11q2/2 - 5q - 4. What is the least common multiple of 11 and h(-1)? 66 Let m = 606 - 604. Let f be 2/3 - (-65)/15. What is the least common multiple of (4/(-2))/(f/(-45)) and m? 18 Let o = 2327241/64 - 36364. What is the common denominator of 93/10 and o? 320 Let v(s) = -7s2 + 116s + 63. Calculate the smallest common multiple of 3750 and v(17). 7500 Let a(d) = 309d - 3. Suppose 4 = -0c + c. Let u be a(c). Calculate the common denominator of -25/18 and (u/18)/(-91). 18 Let u(a) = -a3 - 12a*2 + 9a - 20. Calculate the smallest common multiple of 40 and u(-13). 160 Let c = -324 + 335. Calculate the least common multiple of c and 25. 275 Suppose -5z = 3v - 2z - 498, 2z = -4v + 654. Let x = v - 83. Calculate the smallest common multiple of 14 and x. 546 Let i(k) be the first derivative of 7k4/4 - k3/3 + k2/2 - k - 16. Let y(a) = -a2 - 9a - 8. Calculate the lowest common multiple of y(-6) and i(1). 30 Let w be 1/(-6)-33 - 6/4. Suppose 2s + 3o - 4 = 16, 0 = -wo + 16. Calculate the least common multiple of 6 and s. 12 Suppose 48b = 45b + 300. Calculate the lowest common multiple of 100 and b. 100 Suppose 0 = 65m - 62m - f - 36, m + f = 4. Let h(r) = 4r - 6. What is the least common multiple of m and h(6)? 90 Let p(f) = -f*2 + f + 31. Let b be p(0). Let w = b + -16. Let u = w + -4. Calculate the least common multiple of u and 7. 77 Let j be 16/3(-63)/(-6). Let z = 69 - j. Let x = 6/97 - 2746/485. What is the common denominator of x and z? 5 Let v be (4/(-8))/((-1)/6). Suppose -5s + vg + 70 = 0, -33 = -4s - 3g - 4. Calculate the lowest common multiple of s and 46. 506 Suppose -32u = -52 - 76. Calculate the least common multiple of 140 and u. 140 Suppose -26j = -18j - 1512. Calculate the least common multiple of j and 84. 756 Let n be (1324/(-6))/((15/9)/(-5)). Calculate the common denominator of ((-16)/6)/8 - n/120 and 351/(-110) - 6/15. 220 Suppose -3z + 15 = 3. Suppose -4a = 3a - 42. Let t = 0 + a. What is the least common multiple of z and t? 12 Let q = 431 + -145. Calculate the smallest common multiple of q and 286. 286 Let l = 952 - 925. Calculate the lowest common multiple of 2 and l. 54 Let r(s) = s*2 - 12s + 15. Let l(y) = -11y - 1. Let x be l(-2). Calculate the least common multiple of r(11) and x/3 + 2 + 5 + -4. 20 What is the common denominator of 58/9 and (1072/(-48))/(72/(-6))? 36 Suppose -139 - 109 = 4n. Let a = n - -87. Calculate the common denominator of -69/16 and (-8)/20a/24. 48 What is the lowest common multiple of ((-121)/(-22) - 6)/((-2)/4) and 8? 8 Let z = -60960343/511317 + -2/170439. Let a = 62117/522 + z. What is the common denominator of a and -37/22? 638 Let c be 4 - (1 + 0) - 11. Let l(d) = d3 + 8d*2 + 5d. Let x be l(c). What is the least common multiple of ((-36)/15)/(6/x) and 16? 16 What is the lowest common multi	{ "pile_set_name": "DM Mathematics" }
Suppose 4h = 16 + 16. Let v be ((-328)/56 + 7)/((-2)/(-21)). Let r be (4/v)/((-13)/(-117)). Is h at most as big as r? False Let p = -0.10473 + 0.04573. Does 1/14 = p? False Let y = 66.1 + 199.9. Let j = y - 265.91. Which is smaller: 0.8 or j? j Let p(u) = 5u*2 - 2u*3 - 76u - 35 - 8u3 - 3u*3 + 37u*2 + 12u3. Let a be p(40). Is a at least as big as 124? True Let t = 14394 - 14392.29. Let z = -1.6 - -1.4. Which is smaller: z or t? z Let i(c) = -c2 + 7c + 5. Let y be i(8). Let h be 39/13(-2)/(-3). Let g be (-18)/81 - (2 - h/9). Is g greater than y? True Let f = -0.56 + -37.44. Let j = 39.01 + f. Let v = j - 0.01. Is v equal to 1/10? False Let j(n) = n*3 + 8n*2 + 10n - 7. Let b be j(-8). Let t be (-24)/18 + 350/140508/(-15). Is b >= t? False Suppose -9234 + 1734 = 50v. Are v and -138 nonequal? True Let p(x) = 3x2 - 41x + 97. Let t be p(11). Which is smaller: 10 or t? t Suppose -67 = 5y - 4r, 0 = -0y - y + 5r - 5. Let b(j) = -j*3 - 11j*2 + j + 10. Suppose 15 = -7l - 62. Let t be b(l). Are y and t equal? False Suppose -5o = -250 + 5945. Which is bigger: o or -1140? o Let w = -16900 - -15676. Is w less than -1? True Let v = 7353.45 + -7168. Let l = v + -186. Is l at most as big as -0.2? True Let r(u) = u2 - 9u - 33. Let c be r(12). Let a = 3 - c. Which is smaller: a or 1/28? a Let q = 9526 - 9511. Is q smaller than 309? True Suppose 15r - 17r = u + 208, 0 = -2u + r - 381. Is -1165/6 greater than u? False Let u(n) = 58n + 1135. Let q be u(-20). Which is bigger: -259/11 or q? -259/11 Suppose -57p = 45p + 33p + 135. Which is smaller: 8/1005 or p? p Suppose -274v + 26832 = -16v. Let b(y) = 12y + 8. Let t be b(8). Are v and t non-equal? False Suppose -39n = -44n - 2g + 13, 5 = n - 2g. Let z be 3/(0 - n) + 0/7. Let l = 6 - 18. Which is bigger: l or z? z Let s = -271 - -261. Let l be (-1385)/s + 5/2. Which is smaller: l or 142? l Let k = 21189 - 21188.9076. Which is bigger: 4/5 or k? 4/5 Let a(z) = -z*2 + 4z - 21. Let y(w) = -w*2 + 3w - 22. Let n(h) = -5a(h) + 4y(h). Let r be n(4). Which is smaller: r or -2/13? -2/13 Let a = 10076 + -18075. Is a at most as big as -7996? True Let i be 12/8((-6786)/27)/(-29). Are i and 191/15 non-equal? True Let s be ((-62)/(-3))/((99680/48856)/10). Let p = 709/7 - s. Is p bigger than 1? False Let r = 47 + -44. Suppose -3t - 186 = rf, 0f + 4f = 8. Let o = t + 27. Is -38 at most o? True Let c = -1017.8 + 1017. Which is greater: 28.5 or c? 28.5 Let m = 3014 + -3039. Are m and -332/13 nonequal? True Let d = 36296/7779 - -2/2593. Are 16 and d unequal? True Suppose -8b = 5 - 37. Suppose -x + 332 + 320 = 2z, 8 = -bx. Do 327 and z have different values? False Let c(d) = -31d3 - 2d*3 + 32d*3 - 15d*2 - 48 - 17d. Let u be c(-14). Suppose 0 = -3k - 14 + 5. Is u bigger than k? False Let q = -122/9 + 592/45. Let l = -18 + 16. Which is bigger: q or l? q Let r be 0 + (-41210)/24198 - (-45)/135. Let z = r - -50/37. Which is bigger: z or 0? 0 Suppose -57n = 46n - 103. Is n >= -5/369? True Let m = 3982 - 3983. Let k = -50.07 + 50. Is m less than k? True Let j(o) = -o2 + 3o. Let q be j(4). Let t = 214103/7 - 30489. Let a = -97 + t. Is a equal to q? False Let q be -2 + 154/55 - (52/90 + 0). Does 1/481 = q? False Let u(x) = 157x2 - 24x - 24. Let f be u(-1). Which is greater: f or 155? f Let b be 5/(-15) - (-2)/(-6). Let j(s) = 4s + 17. Let h be j(-3). Suppose -6 = v - h. Which is smaller: v or b? v Let b = 613.297 + -0.297. Let i = 608 - b. Which is smaller: -0.3 or i? i Suppose -41d + 32d + 202872 = -33d. Which is bigger: -8452 or d? -8452 Let c = 372152 - 372152. Suppose 0 = -3m - 3l + 30, -l + 46 - 18 = 4m. Let k be (-10)/m - 3/9. Is k equal to c? False Suppose o - 4g = -38, 2g = 2o + 7g + 63. Is 7 smaller than o? False Let k be ((-513)/285)/(6/(-10)). Let i(d) = -d3 - 4d*2 + 3d - 7. Let u be i(-5). Suppose uv - 5g - 36 - 32 = 0, -v + 28 = -kg. Is 15 smaller than v? True Let o = 6416 - 6440. Suppose -2x + 2g + 5 + 11 = 0, 26 = 4x - g. Suppose -f + 5 - x = 0. Is o > f? False Suppose 0 = 5z + 5s + 1498 + 887, 2z = -5s - 951. Let x = z + 1433/3. Which is smaller: 556 or x? x Let v(y) be the third derivative of y*5/6 + 31y*4/12 + 277y*3/6 + 50y*2 - y. Let x be v(-5). Is 217 != x? False Let t be (-2)/(-4)(-32 - 16570). Is 1 at most t? False Let y = -18.07 - -18. Let q = -151.6 + 20.6. Let b = q - -131. Which is smaller: b or y? y Let j be 66 + 07/70. Is -1 at most as big as j? True Suppose -23o - 335 = -358. Is 3/16247 bigger than o? False Let x = 23206 + -32735. Is -9528 less than x? False Let l be ((-14)/(-4))/71341. Let q = -71 + l. Let k = q - -2. Which is greater: k or -8/7? -8/7 Suppose -1492 + 461 = 23a + 3983. Which is greater: a or -2405/11? a Let j = 401 + -399. Let v be (-246079)/(-2915) + j/11. Is 85 at least as big as v? True Suppose 1128 = 76l - 80l. Let y = 2813/10 + l. Let a = -11/10 - y. Which is greater: a or -0.01? -0.01 Let j be ((3 + 2)/5)/4. Let w = 510 + -390. Is j > w? False Suppose 4w + 2036 = 89w - 599. Is w at least as big as -4? True Let v = 453 + -406.7. Let i = v - 46.5. Which is smaller: i or -0.01? i Let g = -259.033 - -259. Let s = g - 0.287. Is s > -0.3? False Let s = -865 - -873.948. Let j = -0.052 - s. Let w = j - -2. Which is smaller: w or 1/4? w Suppose -h + 2 = 4b + 1, -2h - 3 = 3b. Let q be (-7)/14(14 + 1 + h). Let i be q(-5)/300. Do -1/22 and i have different values? True Let a = 856/2997 + -60692245/20979. Let m = 2887 + a. Which is smaller: m or -0.3? m Let i = -20.79 - 0.21. Let w be ((-420)/504)/(((-12)/(-4))/18). Which is greater: i or w? w Let i = -0.1 + 0.07. Let p(w) = w3 + 4w*2 + 3w - 3. Let f be p(-4). Let x be 261/8 + f/5. Is x less than i? False Let i = -12.1 - -12.3. Let k = 205 + -50. Is k smaller than i? False Let z = -585/2324 + 1/581. Is -4/919 < z? False Let r(b) = 183b*2 + 417b + 2457. Let p be r(-6). Which is smaller: p or 6544? p Let b = -407 - -435. Let x(r) = -17 + 2r2 - 21 + 35. Let z be x(-4). Which is smaller: b or z? b Let k(z) = 2z*3 + 61z*2 + 29z - 29. Let q be k(-30). Let f(l) be the third derivative of l*4/24 + 3l*2. Let p be f(2). Is p greater than or equal to q? True Let q = 20.96 + -21.16. Let l be (-7)/595(-4)/(-14). Let g = l + 1236/13685. Which is smaller: g or q? q Let s = 53 + -94. Let m = 1.17 + -42.25. Let u = s - m. Which is smaller: u or -0.1? -0.1 Suppose 11d = 130 + 90. Let i be 198/104 - 11d/1430. Suppose 2q - 7 = l, -2l - 3l - 2q = -13. Which is greater: l or i? i Let g be 6 - (-3 + (-20)/(-4)). Suppose 5m + 50 = -f, -27 = gf + 5m + 233. Let j = f + 69. Is 3/22 less than j? False Let p = 11590 - 11589. Which is bigger: -1/5 or p? p Suppose -107y = -104y + 600. Let x = 164 + y. Which is smaller: x or 1? x Let b = -144 - -144.03. Let u = 44/3 - -83/3. Let m = 42 - u. Which is bigger: b or m? b Let g(y) be the first derivative of 2y*3/3 + 55y*2/2 + 27y - 80. Let c be g(-24). Which is smaller: c or -2? c Let b = -61 + 48. Let y(i) = i*2 + 14i + 7. Let d be y(b). Let p be (d/(-10) - 1)/(32/(-40)). Which is smaller: 23 or p? p Suppose 0 = n - 3h - 267, -5h + 25 = 15. Let d be 135/(-1043) - (-39)/n. Is 1 bigger than d? True Let v be 2/(-4)(-4)/612. Suppose -8p - 174 = -37p. Are p and v equal? False Suppose 244568 = -515k + 496k. Are k and -12872 unequal? False Let x = 1.0769 - -4.9231. Do -2/677 and x have the same value? False Let b be 93/(-11 - (-12 + -2)). Which is bigger: 34 or b? 34 Suppose -3x = 3c + 396, 2x + 0c = 3c - 244. Let j = x - -113. Do j and -6 have the same value? False Let c = -82 + -79. Let a = -26241/163 - c. Let t = 4 - 4. Do a and t have the same value? False Let p = 148 + 47. Suppose 4s - p = -2h + 3h, -2s + 90 = 2h. Let d = -68 + s. Which is smaller: -19 or d? d Let z(n) = -n + 13. Let i be z(-18). Let g(k) be the first derivative of 8k3/3 - k2 + 3k - 15. Let j be g(2). Is i less than j? False Let c(t) = -t*3 - 5t*2 - 3t + 5. Let m be c(-5). Let l be 6/(-30) - (-584)/m. Suppose q - 20 = -i, -l + 124 = 4i + q. Which is bigger: i or 24? i Let x(l) = l3 + 3l*2 - 4l - 3. Let h be x(-2). Let u be ((-324)/(-63))/(4/14). Suppose -6 = -u*f +	{ "pile_set_name": "DM Mathematics" }
he third derivative of o5/60 - o2. Give r(k(m)). -m*2 Let s(w) be the first derivative of 2w*2 - 22. Let a(p) = 22p*2. What is s(a(o))? 88o2 Let a(b) = b. Let w(v) be the first derivative of -v3/3 + 21. Calculate a(w(z)). -z*2 Suppose -m - 2m = -132. Let w be 24/11 - 8/m. Let j(g) = 0g2 + gw + 0g2. Let r(z) = -z. Calculate j(r(h)). h2 Let s(a) = -51a. Let d(l) = -l. Calculate d(s(z)). 51z Let p(k) be the third derivative of 0k + 0 - 1/8k*4 + 0k*3 + 4k2. Let n(o) be the second derivative of o4/12 + o. What is n(p(g))? 9g2 Let r(p) be the second derivative of -p5/60 + p2 - 3p. Let k(n) be the first derivative of r(n). Let o(s) = 6s2. What is k(o(u))? -36u*4 Let m(s) = -16s + 1. Let p(v) = -4v2. Calculate m(p(t)). 64t*2 + 1 Let k(p) = -4p*2 - 28p + 28p. Let n(h) be the third derivative of -h5/30 - 11h*2. What is n(k(t))? -32t*4 Let o(n) = -113n*2. Let j(i) = -41i*2. Determine o(j(s)). -189953s*4 Let g(j) = 65j*2. Let h(y) = 67y. Calculate h(g(i)). 4355i2 Let c(a) = -4a2 + a2 + 0a2. Let p(o) = -3o - 4. Let k(w) = -4w - 5. Let t(n) = -4k(n) + 5p(n). Calculate t(c(q)). -3q*2 Let u(f) = -261f*2. Let j(y) = 6y. Calculate j(u(k)). -1566k2 Let d(s) = s - 2. Let n(f) = -f + 3. Let i(x) = -3d(x) - 2n(x). Let q(o) be the first derivative of -o2 - 5. Determine q(i(b)). 2b Let j(y) = y*2 + y - 1. Let g(h) = 6h*2 + 3h - 3. Let x(b) = g(b) - 3j(b). Let l(o) = o. Calculate l(x(v)). 3v*2 Let k(h) = 32h. Let t(z) = -13z. Let f(d) = -5k(d) - 12t(d). Let v(s) = s. What is v(f(i))? -4i Let l(u) = -4u - 3. Let r(q) = 3q + 2. Let t(z) = -2l(z) - 3r(z). Let f(y) = -2y. Give f(t(j)). 2j Let j(l) = -2l2 + l2 + l2 - l2. Let x(z) = -6z. Give x(j(h)). 6h2 Let l(n) = 50n + 4. Let d(g) = -8g2. Determine d(l(t)). -20000t*2 - 3200t - 128 Let s(a) = -11a. Let c(m) = -25m*2. Calculate s(c(l)). 275l2 Let u(b) be the first derivative of -b6/90 + 2b3/3 + 3. Let a(f) be the third derivative of u(f). Let g(i) = -i2. Give a(g(s)). -4s*4 Let j(s) = -89s. Let g(z) = -z*2. Calculate j(g(h)). 89h2 Let q(f) = -f2. Let h(b) be the first derivative of -13b3/3 - 5. Give h(q(j)). -13j*4 Let x(z) = 20z*2. Let c(w) = 20w*2. Give x(c(u)). 8000u4 Let f(d) be the second derivative of -d4/12 + 13d. Let h(c) = -20c*2. Give f(h(v)). -400v*4 Let b(g) = 42g*2 + 38g*2 + 41g*2 - 122g*2. Suppose o - 5 = 0, 4y + 5o - 8 - 25 = 0. Let r(k) = 3k - 3k + ky. Determine b(r(m)). -m4 Let o(u) = -15u. Let m(d) be the first derivative of -d*3/3 + 20. Give m(o(k)). -225k*2 Let p(w) = 16w - 11. Let r be (4/(-3))/((-2)/3). Let s(k) = -3k + 2. Let x(j) = rp(j) + 11s(j). Let b(v) = -2v*2. Give x(b(l)). 2l2 Let k(z) = z2. Let a(r) = -4 + 3r + 7 - 3 + 6. Suppose 2v - p - 1 = 0, -2p = -3v - 3p - 6. Let n(g) = 1. Let w(m) = va(m) + 6n(m). What is w(k(t))? -3t2 Let y(h) = -h2. Let d(m) = -656m + 18m*2 + 656m. What is y(d(k))? -324k4 Let q(v) = -35846v. Let r(m) = -m. Determine r(q(i)). 35846i Let o(k) be the third derivative of k7/2520 + k4/24 + 5k*2. Let b(y) be the second derivative of o(y). Let p(q) = -13q. Give b(p(x)). 169x2 Let x(g) be the first derivative of -g3 - 5. Let d(i) = -i. Give d(x(u)). 3u*2 Suppose 4k = -0k - 12. Let w be -162/k. Let d(h) = -wh*2 + 3h*2 + 2h*2. Let z(u) = 3u. Give d(z(o)). 9o2 Let h(n) be the third derivative of -n5/30 + 3n*2. Let j(l) = 6l*2 - 2l2 + l2 + 0l2. Calculate h(j(q)). -50q*4 Let a(z) = -2 + 2 + 0 + 4z*2. Suppose 0 = 4u - 2 - 22. Let t(j) = -u + 6 + 2j. Give a(t(w)). 16w*2 Let h(m) = -5m + 19m - 12m. Let u(a) = -9a. Determine h(u(c)). -18c Let k(o) = -1320o. Let n(y) = y. Determine n(k(f)). -1320f Let x(s) = -s2. Let i(n) be the third derivative of -n4/12 - 8n3/3 - 2n*2. Calculate i(x(w)). 2w*2 - 16 Let j = 7 - 2. Let q be j2/(-10)-2. Let n(g) = -g + qg + g. Let z(a) = 4a. What is z(n(c))? 8c Let m(f) = -4f. Let u(b) = b2 - 12b - 15. What is m(u(t))? -4t2 + 48t + 60 Let b(z) = -353z + 2. Let r(i) = -i. Determine r(b(w)). 353w - 2 Let a(r) = 23r - 1. Let d(z) = -2z*2. Give a(d(y)). -46y*2 - 1 Let a(x) = -277x*2. Let h(k) = 2k. Give h(a(j)). -554j2 Let l(u) = -u. Let p(t) = 7t*2 + 6t. Calculate l(p(z)). -7z2 - 6z Let k(l) = 2l2. Let z(g) = 359g. Calculate z(k(u)). 718u2 Let x(c) be the third derivative of c4/8 + 3c*2. Let o(p) = -5p. Determine o(x(d)). -15d Let w(z) = -9z. Let r(c) = -c - c + c + 0. Calculate w(r(o)). 9o Let i(z) = z. Let c(g) = 5g + 3. Let l(h) = -24h - 14. Let a(v) = -14c(v) - 3l(v). Determine i(a(s)). 2s Suppose -5q = -5 - 5. Let t(u) = -3u*2 - 4u*2 + 3u*q. Let j(m) = 5m*2 + 4. Let z(v) = -4v*2 - 3. Let r(g) = -3j(g) - 4z(g). Calculate r(t(s)). 16s*4 Let g(y) = 9y*2 + 3y*2 - 12y*2 + 2y*2. Let h(j) = -4j - 2. Let z(a) = 17a + 9. Let q(f) = 9h(f) + 2z(f). What is q(g(k))? -4k*2 Let n(v) = 23v. Let b(d) = -2d. Calculate b(n(g)). -46g Let t(k) = 5k. Let h(b) = 2b*2 - 8. Determine h(t(w)). 50w2 - 8 Let m(k) = -k. Let y(r) be the first derivative of -r4/6 + 6r - 5. Let t(i) be the first derivative of y(i). Determine t(m(w)). -2w2 Let i(d) = -d2. Let u(s) = -29s + 17 + 17 + 14 - 47. What is i(u(f))? -841f*2 + 58f - 1 Let r(q) = q. Let t(x) be the third derivative of -11x4/24 - 3x*2. Give r(t(n)). -11n Let v(k) = -32k. Let m(t) = -11t. Determine v(m(x)). 352x Let s(f) = 1 + 2f - 1. Let p(b) = -b*2 - 2b + 2. Let o(j) = -j*2 - j + 1. Let w(m) = 2o(m) - p(m). Give s(w(g)). -2g2 Let d(l) = -2l - 3. Let p(x) = 2x + 2. Let y(w) = 2d(w) + 3p(w). Let i(u) be the first derivative of u3/3 + 1. What is i(y(m))? 4m*2 Let y(h) = 2h*2 - h. Let n(q) = 12q*2 - 7q. Let k(s) = 4n(s) - 28y(s). Let w(c) = c*2. What is w(k(p))? 64p*4 Suppose -7o + 11 = -2o + 3n, 3o - 5n = -7. Suppose 5l + 3x + 6 - o = 0, -5l = 5x + 15. Let b(a) = -2a - la + 2a. Let q(p) = 3p. Give b(q(j)). -6j Let y(b) = 10b. Let i(f) = -8f2. Let n(k) = -7k*2. Let h(u) = -6i(u) + 7n(u). What is h(y(t))? -100t*2 Suppose 4v + 36 = 6v. Let h(a) = 18a + 2a2 - va. Let o(w) = 11w2. Give o(h(m)). 44m*4 Let w(k) = 0k + 4k - 2k. Let o(t) be the first derivative of -t*4/6 - 2t - 1. Let l(r) be the first derivative of o(r). Calculate w(l(a)). -4a2 Let m(g) = -9g. Let i(s) = -93s2. Determine i(m(q)). -7533q2 Let t(m) = -m2. Let s be 2/(-6) - (-39)/9. Suppose 4h = 2h + s. Let y(d) = d*2 - 3dh + d2. Calculate y(t(x)). -x*4 Let b be (-2)/5 + (-24)/(-10). Let v(p) = 2p*2 + 2 + 0p2 - b. Let x(a) = a2 + 2. Let h(g) = 2g2 + 5. Let q(k) = -6h(k) + 15x(k). Calculate q(v(f)). 12f*4 Let m be 0 + 1 + -2 + 5. Let s(v) = -4v*2 + mv*2 - 3v*2. Let b(j) = -2j*2. What is b(s(t))? -18t*4 Let h(l) = 4l. Let c(p) = 1313p. What is h(c(r))? 5252r Let b(k) = -k. Let p be 103/6 - 1. Let j(o) = 8o - po - 2o. Calculate b(j(d)). -2d Let a(f) = 8f*2. Let g(t) = -7t*2 - 8t*2 + 13t*2. Determine g(a(w)). -128w*4 Let m = 2 - 0. Suppose 0 = a - 2k - 8, -3k + mk - 14 = -3a. Let g(c) = -2c - 5c + ac. Let w(v) = 2v2. What is w(g(r))? 18r*2 Let f(s) = -2s + 3s + s. Let d(r) = 3r + 5. Let v(m) = -2m - 4. Suppose a = -4q + 8, -q + 4 = -a - 3. Let p(h) = ad(h) - 5v(h). Determine p(f(i)). -4i Let l(h) = 3h. Let x(k) = -8k2. What is x(l(w))? -72w*2 Let v(j) = 50j*2. Let s(x) = 18x - 45x + 10x + 19x. Calculate s(v(b)). 100b*2 Let l(b) = -2b. Let u(n) = 13n. Determine l(u(k)). -26k Let i = 8 - 4. Let s(g) = 43 - 43 - ig. Let t(w) be the first derivative of -w2/2 + 3. What is t(s(a))? 4a Suppose -2h - 2s = -8, -5h + 4s - 3s + 8 = 0. Suppose 0 = -y - y + 6. Let p(q) = -2q - yq + hq. Let u(b) = -b. Determine u(p(a)). 3a Let x(v) = -2v*2. Let z(d) = 0d*2 - 6d*2 + 3d*2. What is x(z(q))? -18q*4 Let f(i) = -i. Let u(n) be the first derivative of 5n*3 + 32. Determine f(u(v)). -15v2 Let o(l) = -l2. Let m(k) = -2k2. Let v(g) = -6g*2. Let u = 1 - -2. Suppose -3a = -uj, 4j + 6 + 6 =	{ "pile_set_name": "DM Mathematics" }
- 2l - 4. Let m(s) = 7s*2 + s + 4. Let h(i) = -6k(i) - 5m(i). Give h(-6). -2 Let k be (-1 - 1)(-4 + 3). Let v(w) = 3 - w*2 - 4w + 0w2 + kw. What is v(2)? -5 Let s(y) = y*3 - 5y*2 - 6y + 5. Let k be s(6). Let x(p) = -p + kp - p + 1 - 2p. Determine x(-4). -3 Let b(w) = -4w2 + 6w - 2. Let l(o) = 3o2 - 4o + 1. Let n(z) = -5b(z) - 7l(z). Let h(y) = 3y2 + 5y - 8. Let d(u) = -3h(u) - 8n(u). Give d(3). -6 Let v(i) be the second derivative of -5i3/3 - 3i*2/2 - 36i. Determine v(-3). 27 Suppose -20a = -21a + 8. Let i(y) = -y*3 + 9y*2 - 8y + 11. What is i(a)? 11 Suppose -2o - 10 = -b + 1, 3b = 15. Let y(g) be the first derivative of 0g2 - 4g + 4 + 1/3g3. Determine y(o). 5 Let s(t) be the second derivative of -4t - 7/2t2 + 0 + 4/3t*3 - 1/12t*4. Give s(5). 8 Let h(o) be the first derivative of -5o2 - 7. Give h(-1). 10 Let p(z) = -z3 - z*2 - z + 6. Let j be (-2)/3 + 1 + 2/(-6). Calculate p(j). 6 Suppose -3p = -2a + 701 + 370, -p = 2a - 1075. Let v(x) = -1 + 537x - ax - 6x2. Determine v(1). -7 Let a(p) = 2p*2 - 1 + 2p*3 + 0 + 6p*3. Suppose -3k - m = 49 + 11, 0 = -m. Let i be 10/k(-1 + 3). What is a(i)? -7 Let u(v) = -v + 3. Let n be u(-2). Let c(w) = w2 - 5w - 6. Give c(n). -6 Let m(r) = -r*3 - 5r*2 - 5r - 4. Let k(w) be the first derivative of -w*2/2 - 2w + 2. Let x be k(2). Let b be m(x). Let o(p) = -p*2 + p + 2. Give o(b). 2 Suppose 5q - 27 = -g, 2g - 2q + 1 = -5. Let r(j) be the first derivative of 2 - 5j - 1/2jg. Calculate r(4). -9 Let h(l) = l3 - 4l2 - 4l. Let a(k) = k*2 + k + 1. Let v(d) = a(d) + h(d). What is v(4)? 5 Suppose 0 = 4y + 3 + 17. Let h(n) = 19n3 - 18n*3 + 4n*2 + 4 - 5 - 3n. Give h(y). -11 Let q(b) = -b*3 + 4b*2 + 2b - 2. Let m be 4/10 + (-26)/(-10). Suppose 4c - 12 = -mk, 0k + c = 2k - 8. Give q(k). 6 Let z(a) = 3a + 4. Let d = -9 - -11. Suppose -dg + 12 = -b + 6b, g - 5b = -24. Calculate z(g). -8 Let p = -6 + 8. Let c(s) = -s*2 - 1 - 1 - ps + 1 - 2s2. Let l be 2/6 - 14/6. Determine c(l). -9 Let n(z) = -z2 + 2z - 1. Suppose 5 = 5f - 10. Give n(f). -4 Let w be 1(-10)/((-6)/3). Let h(t) = 6 - 5t2 + t3 - 3t - 3t + wt - 7t. Determine h(6). -6 Let x = -1 - 2. Let c(u) be the first derivative of u6/180 + u5/24 + u4/12 - 4u*3/3 + 1. Let f(p) be the third derivative of c(p). Calculate f(x). 5 Let b(y) = 2y - 8. Let j(n) = -5n2 - n3 + 36n + 2n3 - 41n. Let x be j(6). What is b(x)? 4 Let v(l) = l*2 - 5l + 5. Suppose -4 = -t - 3t. Let g be t + -2 + 2 - -2. Suppose -gk + 7q = 3q - 20, 3k + q = 10. What is v(k)? 1 Let o(h) = h2 + 5h + 3. Let i = 16 - 10. Let f be (9/i)/(2/(-4)). Let d be 4(f/4 - 0). Determine o(d). -3 Let j(d) be the first derivative of -d2 + 6d + 9. Determine j(4). -2 Let x(w) = -2w + w + 0w + 1. Suppose 3q = q - 10. Let m = 0 - q. Calculate x(m). -4 Let a(o) = -o3 + o + 1. Let y = 8 - 3. Suppose 3w = -ys - 15, -4s - 4w + w - 15 = 0. Suppose s = -3d - 3. Calculate a(d). 1 Let z(g) = -g*3 + g + 81g*2 + 78g*2 - 157g*2. Suppose c + 5m = 5c - 13, 3c - 4m = 10. Give z(c). 2 Let t be (-126)/(-15) + (-12)/30. Let g(p) = -p + 7. Calculate g(t). -1 Let i(t) = -7t + 5. Let p(z) = z2. Let n(c) = -i(c) - p(c). Let q be 680/140 + 1/7. What is n(q)? 5 Let a(v) be the first derivative of -v2/2 + 6. What is a(5)? -5 Let n = 1 - 2. Let o be 5/(15/(-9))n. Suppose 5 = -5z - 5, 0 = ok + 3z + 18. Let y(j) = j - 5. Give y(k). -9 Let u(n) = n*2 - 7n + 6. Let t be u(6). Suppose c = -4b + 4, 2b = -c - 4c - 16. Let d be t/(c + 0 + 1). Let j(h) = -h3 + h2 + h - 3. What is j(d)? -3 Suppose -4 = 4p - 0p. Let t(n) = -5n + 3. Let m(z) = -z - 1. Let l(k) = -2m(k) - t(k). What is l(p)? -8 Suppose 5r + 4x - 3 = -2, x - 1 = -2r. Let w be r/((21/12)/7). Let f(p) = -p*2 + 3p - 2. Give f(w). -6 Let y(o) = o + 3. Suppose -b - b = -6. Calculate y(b). 6 Let o(v) = -v - 3. Let j be o(-5). Let c(r) = -r + 2r2 + rj - r3 + 2 + 2r*2. What is c(5)? -3 Let j(w) = -2w*2 + 25w + 20. Let d(q) be the third derivative of q*5/60 - 13q*4/24 - 5q*3/3 + 7q*2. Let k(z) = -11d(z) - 6j(z). What is k(8)? -2 Let i(f) = f3 - 5f*2 - 6f + 1. Let y(w) = -w + 11. Let d be y(5). Give i(d). 1 Let k(r) = -r*3 + 5r*2 + r - 6. Let w(m) = -m - 5. Let z be w(-4). Let x be 4 - -2z/(-2). Give k(x). -1 Suppose -8 = -3t - 2. Let p(k) = -kt + k + 1 + 1 + 2k. Give p(3). 2 Suppose c + 1 = -0c. Let h be 3 + (1 - c)/2. Let t(y) = -6y*3 - 2y*2 - 6. Let z(j) = 5j3 + j2 - j + 5. Let i(l) = 4t(l) + 5z(l). Calculate i(h). -3 Let x(v) = 9v + 5. Let n(z) = -2z - 1. Let c(d) = 26n(d) + 6x(d). Let o = 1 + -2. Let b = o - 2. What is c(b)? -2 Let r(o) = o*2 - 3o - 4. Suppose 0 = 2g - 3h - 6, -3h = -8g + 3g + 6. Let d be (-5)/(g - 2 - -1). Calculate r(d). 6 Let v = -8 + 14. Suppose -2w + 2 = 4y, 0 = -y + vy - 2w + 20. Let f(j) = -2j + 2j + 4j + 1. What is f(y)? -7 Let b(a) be the second derivative of -a*4/12 - 7a*3/6 + 3a2 + a. Let r = 69 + -76. Determine b(r). 6 Let r = -4 + -3. Let q(g) = g2 + 7g - 6. What is q(r)? -6 Let n(x) = -2x. Let l be n(-1). Let c(m) = 3m - 3 + 3m*3 - 4m*3 + 2m*3 - 3m*l. Calculate c(3). 6 Suppose 2s + 3 = 11. Let j(y) = -2y + 5. What is j(s)? -3 Let w(b) = 10b*2 + 9b - 5. Let j(m) = 7m2 + 6m - 3. Let p(k) = -7j(k) + 5w(k). Determine p(-5). 6 Let m(r) = -5r - 7. Let w(j) = -21j - 28. Let f(d) = -9m(d) + 2w(d). Let i = -26 - -21. Give f(i). -8 Let r(f) = -4f3 - 40f*2 + 27f + 43. Let m(k) = -3k3 - 27k*2 + 18k + 29. Let w(h) = 7m(h) - 5r(h). Determine w(10). -2 Let b(p) = -3p3 - 3p*2 - 3p - 3. Let o(c) = 4c + 14. Let j be o(-4). Determine b(j). 15 Let u(q) = -6q + 9. Let h(i) = 5i - 8. Let s(r) = 4h(r) + 3u(r). Suppose 4x = -3 + 23. Give s(x). 5 Let o(k) = 14k2. Let v = 12 + -11. Give o(v). 14 Let y(s) = s2 - 2s - 2. Let b = -7 + 11. Suppose -4 = 4d - 2d - bz, -3d - 2z - 22 = 0. Let q be (-22)/d + (-4)/6. Determine y(q). 1 Suppose -4h + 2 = -3h, 2h - 10 = -3k. Let q(l) = -4l + l*3 + 2l*k + 2 - 6 + 3. Give q(-3). 2 Let k be (-10)/(-4) - (-1)/(-2). Suppose kl = -5 + 21. Suppose -3g = -l + 2. Let c(b) = 3b*2 - 3b + 2. Calculate c(g). 8 Let n(y) be the second derivative of y*3/6 + 3y*2 - 34y. Calculate n(-7). -1 Suppose 0 = 5f - 17 + 2. Suppose -fv + 3 = -12. Let t(p) = p*3 - 6p*2 + 3p + 2. What is t(v)? -8 Suppose -4 = 2z - 4w, -4z + 4w = -0z + 8. Let o(l) be the first derivative of l + 2 + 1/2l*2 + 1/4l4 + l3. What is o(z)? 3 Let z(j) = -j*2 - 3j - 6. Let s = -171 - -167. Give z(s). -10 Let b = 45 + -50. Let j(c) = 1 + c - 6 + 0. Calculate j(b). -10 Let n(o) = o*3 + o - 1. Suppose -i = -5w + 11, 5i = -5w - 0w + 35. Suppose -3 = x + s, 3 = 4x + ws + 14. Determine n(x). -11 Let b(m) = 4m*2 - 21m*3 + 40m*3 - m + 4 - 18m*3. Determine b(-5). -16 Let i(t) = -t. Suppose 0 = 5u - 2l - 6, -2u - l + 14 = 4l. Let c = -1 - -1. Suppose c = -5p + 3j + 9, p = -j - uj + 9. Give i(p). -3 Suppose -2w + 2y - 9 = 7, 4w = 5y - 34. Let r(l) = -2l + 4. What is r(w)? 16 Let h(b) = -4b + 11b2 - 2b*3 + 5 - 1 - 8b2. Let q(f) = -f3 + f*2 - f + 1. Let c(n) = -h(n) + q(n). Calculate c(3). 15 Suppose 0 = 4i + 2 + 2. Let u(n) = n. Let t(z) = 3z - 9. Let y(q) = -q + 2. Let r(h) = -4t(h) - 18y(h). Let c(s) = r(s) - 2u(s). What is c(i)? -4 Let m(f) = f - 6. Let c = -25 - -30. What is m(c)? -1 Let v(h) = h*3 - 4h*2 - 5h. Let z(y) = y*2 + 3y. Let g be z(-3). Let x be 2(g - (-5)/2). Give v(x). 0 Let g(c) be the third derivative of -c4/24 + 2c*2 + 9c. Calculate g(0). 0 Let l be (((-120)/35)/2)/((-4)/14). Let p(h) = h*2 - 7h - 8. Calculate p(l). -14 Let i be (-7)/14(13 + -1). Let s(f) be the first derivative of f4/4 + 2f3 - f2 - 6f - 1. Determine s(i). 6 Suppose 20 = 4x + 4y, -4x - x = -5y + 5. Let f(w) = -4w3 + wx - 3w3 + 6w*3. Give f(0). 0 Let j(y) = 4y*3 - 8y*2 - y. Let l(p) = 5p*3 - 9p*2 - 2p. Let c(d) = 4j(d) - 3l(d). Let h = -1 + 5. Let n be (2/h)/(2/16). Give c(n). -8 Let y(k) = k*2 - 5k - 3. Let f(o) = -2o - 10. Let r be f(-7). Suppose 0 = -5i -	{ "pile_set_name": "DM Mathematics" }
range (-6a4 - 9a*4 - 17a*4)(3 + 32 + 19) + 2a2 + 11a - 4a4 - 11a to la4 + ja + fa3 + ra*2 + u and give l. -1732 Express 156x*3 + 2x*4 + 0x*4 + 15x*3 - 33x*3 + 12x in the form u + yx4 + lx*3 + px*2 + mx and give y. 2 Express (3u + 9u - u)(-9u + 21 - 21) + 7u2 - u2 - 29u*2 in the form bu*2 + t + mu and give b. -122 Rearrange 8m + 0m2 + m4 - 4m3 - 2 + 3m*3 - 32m - 3m2 + 59m to the form km2 + bm*3 + s + qm + vm4 and give q. 35 Express 188 - 2520f + 1261f + 1261f + f*2 as bf + df2 + i and give i. 188 Express 217l - 398l - 3l*3 - 2 - 4l2 + l4 + 197l as fl*2 + sl + jl3 + ul*4 + p and give u. 1 Express 42 - 28 - 9v - 13 + 88 - 88 - 80v + (0 + 3 - 5)(4 - 4 - 2v) - 2 + 2 - 2v + 4v + 3v - 6v in the form x + tv and give x. 1 Express 31f2 - 2f*2 - 1 - 1889f + 1882f as yf + cf2 + r and give y. -7 Rearrange -682u*2 + 4225u*2 + 382 + 1415u*2 - 382 to the form wu*2 + iu + x and give w. 4958 Express -1309k2 - 37k + 872k2 + 387k*2 - 74k as w + ck2 + tk and give c. -50 Rearrange (40w - 19w - 34w)(0 + 9 - 2)(-6 - 1 - 4) to the form rw + l and give r. 1001 Express (-4d + 5d - 4d)(-33d + 83 + 119 + 38d) as k + pd + td*2 and give t. -15 Rearrange 3 + 3i - 3 + (-65 - 288 - 77)(1 + 2i - 1) to ti + s and give t. -857 Express ((0j + 0j - j)(169 - j - 169) + 3j - 3j - 2j2)(64j - 45j + 59j) in the form mj*3 + pj*2 + z + gj and give m. -78 Rearrange 1096a + 8a*2 + 1103a + 879a3 - 2199a to the form za2 + la*3 + o + ha and give o. 0 Rearrange 1745939s2 - s3 + 14s - 1745940s2 + 4 - 10s*4 - 6s - 5s4 to ks*3 + bs*4 + is*2 + ms + t and give b. -15 Express 0 + 0 + 3g4 + (-4 + 4 + g3)(-60856067 + 60856067 + 4582g) as jg*2 + w + cg*3 + rg*4 + lg and give r. 4585 Rearrange -2 + 8x3 + 5x + 38x2 - 56x*2 + 0x*3 + 17x*2 to c + rx*2 + vx*3 + tx and give v. 8 Rearrange 1878i2 + 768i - 1545i + 776i to the form u + ci2 + pi and give c. 1878 Express -2 + 5p2 + p - 9p*3 + 8 + 43 - 39 as m + vp*3 + qp + cp2 and give v. -9 Express u3 + 26u - 27 + 120u4 - 55u*4 + 66 - 37 in the form au + pu4 + tu*2 + cu3 + o and give a. 26 Express g3 + 0g3 - 672g*4 + 316g*4 + 333g*4 - 18 as tg*4 + m + hg*3 + zg + ag2 and give t. -23 Rearrange (-2l*2 - 1 - 2 + 7)(-2 - 1 + 4)(-l - l - 4l)((0 + 1 + 1)(2 + 1 - 2) + 8 - 3 - 3) to hl3 + q + il*2 + al and give h. 48 Rearrange (-w - 13w + 34w)(-69 + 141 + 293w - 71) to p + iw + uw*2 and give u. 5860 Express (2585510 + 2180r*2 - 2585510)(-r*2 + 4r2 - r2) as cr3 + mr*2 + b + dr*4 + ur and give d. 4360 Rearrange 8a2 + 0 + 0 - 12a*2 + 114a*3 + 13a - 116a3 + 2 to p + ua*3 + wa + da2 and give d. -4 Rearrange 15271p + 14207p - 6047p + 12271p - 3127p to zp + u and give z. 32575 Rearrange -1 - 4398a*2 - 3a*3 + 2 + 4687a*2 + a to the form d + na*2 + sa + ra3 and give d. 1 Express 77v + 18v - 97v - 2294 - 531 in the form c + lv and give l. -2 Express -8y*3 - 10y + 40y2 - 17939 + 17939 as s + cy*3 + ty + jy2 and give j. 40 Express (-2k + 2k - 9k)((-1 + 4 + 2)(k + 20k + 2k) - k - k + k) in the form ik + jk*2 + l and give j. -1026 Rearrange (-4y + 5y + 3y)(11y + 50 + 128 + 8y - 70) to the form g + ny*2 + fy and give f. 432 Express (-3 + 4 - 7)(-1 + 1 - 2r) + (5r - 3r - r)(0 - 2 + 16) + 2r + 2r - 3r + (2r - 2r + r)(1 - 2 + 0) - 3r + 4r + r as ar + d and give a. 28 Rearrange 113 + 244g + 396g - 636g to the form b + rg and give r. 4 Rearrange (2w + 174432 - 65310 - 64647)(-4 + 4 - 2w) to the form yw + a + gw2 and give y. -88950 Rearrange -5d*2 - 10d*2 + 5d*2 + (976 + 624 + 203)(-3d2 + d2 + 4d*2) to z + pd + td2 and give t. 3596 Express (565 + 531 + 8513a - 1096)(4 - 2 - 3) as j + sa and give s. -8513 Express (0b + 10b - b)(10 + 71 + 15) - b + 4b - 2b + (3b - 6b + b)(4 - 1 - 1) - 2b + 6b - 3b as a + db and give d. 862 Rearrange (0z - z - z)(2 - 2 + z) + (-2 - z + 2)(z - 2z + 2z) - 5130898 - 5z + 10z2 + 5130898 to the form xz*2 + nz + f and give x. 7 Rearrange (1 - 3 - 7g + 6g)(-103g - 126g + 415g)(-5g*2 - 3g*2 + 0g*2)(-2 + 1 + 2) to the form o + fg4 + ig*3 + dg*2 + jg and give f. 1488 Express 1136t3 + 12615 - 6303 - 6311 in the form nt*3 + ct*2 + w + dt and give n. 1136 Rearrange (12 + 7x - 12 + (-4 + 3 - 1)(0x + 5x - 4x) - 5 + 5 - 3x)(47x*2 + 32x*2 + 6x*2) to t + rx + bx2 + ax*3 and give a. 170 Rearrange -744 + 2511o*2 + 9002o*2 + 744 to ko + d + xo2 and give d. 0 Rearrange (-3s3 + s3 - 5s3)(0 + 0 + 2s) + (-s - 3 + 3)(-34s3 - 47s*3 + 50s*3) to the form hs*4 + qs + js3 + m + cs*2 and give h. 17 Rearrange 5z*2 - 10z - 2941z3 + 2 + 12z*2 + 2950z*3 - 2 to the form gz + sz3 + w + yz*2 and give w. 0 Rearrange 455g + 398g - 539g + 230g to the form d + jg and give j. 544 Rearrange -10400c + 3689c - 10134c to the form v + nc and give n. -16845 Rearrange 14 + 10074u2 - 10076u*2 + 49 + (0u - 3u + 0u)(2u - u - 2u) + 3u + 2u2 - 3u to i + au2 + mu and give i. 63 Express 1028b3 - 55b - 58b + 4b*4 - 1026b*3 as q + db*4 + ib*2 + pb + vb3 and give d. 4 Rearrange (1289817c*2 - 14887c*3 - 1289817c*2)(-3c + c + 3c) to vc2 + jc + s + qc3 + kc*4 and give k. -14887 Rearrange (-6f*2 - 8 + 14 - 1)(4 - 6 + 0)(-742 + 426 + 378) to nf*2 + r + df and give n. 744 Rearrange 3005 - 208x2 - 1506 - 1501 to the form o + kx + dx2 and give o. -2 Rearrange (-2 - 2 - 1)(-4q - 4 + 4 + 2q - q - 2q - 2q - 2 + 2 + (-2q + 1 - 1)(-1 + 4 - 2)) + (1 - 6 - 1)(0 + 0 - q) to z + kq and give k. 51 Rearrange (70 - 51p2 - 70)(0 + 2 + 0 + (0 - 2 + 3)(2 + 6 - 5) + 3 - 2 - 8)(2p - 4 + 4) to the form w + zp*2 + fp*3 + hp and give z. 0 Rearrange 4x2 - 4x2 + x2 + 3x - 21x3 + x2 + x*2 to the form px*2 + dx*3 + k + ox and give p. 3 Express 6524k - 6527k - 261k2 - 2 + 73k*2 as nk + pk2 + q and give p. -188 Express -4292m*2 - 16 - 12 + 28 in the form bm*2 + v + xm and give b. -4292 Express -2p - 9565 + 4p - p + 143p3 + 9574 + p2 as sp + r + xp3 + zp*2 and give s. 1 Express 1379n + 400 + 1410n - 2804n as an + f and give f. 400 Express -19336b - 17680b + 39143b in the form xb + s and give x. 2127 Rearrange -21i*3 + 2 + i - 16 + 8 - 3 to the form pi + vi2 + ti*3 + q and give q. -9 Express (-1 + 1 + o)(153o2 + 29 - 29) + (-3 - 1 + 6)(-o*3 + 4o*2 - 4o*2) - 4o*3 - 3o + 3o in the form go*2 + m + zo*3 + wo and give m. 0 Rearrange -4278m - 13 + 13 + 1496m to nm + g and give g. 0 Rearrange (4 - 4 + 2f*2)(-82f + 100f - 56f) + (0 + 0 + 1)(-f*3 - 5 + 5) + 12f*2 - 12f*2 - 6f*3 to the form i + kf*3 + jf + lf2 and give k. -83 Express (-16 + 107 + 59)(12 - 2r2 - 13 - r2) in the form a + pr + qr2 and give a. -150 Rearrange 184l*4 + 3767l - 3764l - 4 + 4 + (-3l + 2l + 8l)(4l - 4l + 3l*3) to wl*4 + c + tl*2 + vl*3 + jl and give w. 205 Express 12d2 - 3d*2 - 2453d*3 + 2447d3 - 2 + d4 + 3d4 in the form ud*4 + b + nd*3 + ad + hd2 and give h. 9 Express -573b - 4646b + 1217b - 2352b in the form d + kb and give k. -6354 Express (-2 - 1 + 2)(-141 + 3 - 60)(-9 + 10z + 9) as nz + s and give n. 1980 Express 0p4 + 3p*4 + 0p*4 + (4428 + 529p - 4428)(p2 - 2p*2 + 0p*2)(3 + 2p - 3) in the form wp*3 + n + xp*2 + hp*4 + gp and give h. -1055 Express 9j - 22j - 16j + (-3 + 2 + 2)(-82j - 80j + 46j) as h + uj and give u. -145 Rearrange (-5 + 2 + 4)(-2208r*2 + 13583r*2 + 3070r*2) to br + yr2 + v and give y. 14445 Express 1765l*2 - 872l*2 + 1 + 73l*3 - 897l*2 - 5l as il3 + y + nl*2 + ol and give y. 1 Rearrange 188557i2 - 89 - 3i - i3 - i4 + 4i - 188559i*2 to x + si*4 + li + ri2 + ki*3 and give k. -1 Rearrange 391g + 384g - 350g*3 - 762g - 338g3 to the form wg**2 +	{ "pile_set_name": "DM Mathematics" }
b - 1. What is the first derivative of n(g) wrt g? 3567 Let a be -5 + 9 - (-1 - -20)-1. Find the second derivative of -22n3 - 63n - an + 12n*3 wrt n. -60n Let g be 3/(-15) + (-63)/(-15). Let p = -199 + 199. Find the first derivative of g + 0 - 2i + p + 2 wrt i. -2 Let p(z) = -4886z + 4249. Let j(f) = 4921f - 4250. Let w(a) = 5j(a) + 6p(a). Differentiate w(y) with respect to y. -4711 What is the second derivative of -6f*4 - 1252f*2 + 1999f2 + f3 - 12f - 141 - 980f*2 wrt f? -72f*2 + 6f - 466 Find the second derivative of -1 - 442u + 991u - 1906u4 + 63u wrt u. -22872u2 Let u(b) be the third derivative of -1/42b*7 - 1/6b*3 + 77b + b*2 - 2/5b*5 + 0b*6 - 5/84b*8 + 0 + 0b*4. Find the third derivative of u(x) wrt x. -1200x*2 - 120x What is the second derivative of -851d - 1 + 412d + 252d + 1412d*2 + 556d wrt d? 2824 Let j = 148 + -145. What is the third derivative of -3l3 + 5l*3 + 6l*3 - 8l*j + 248l*6 + 67l*2 wrt l? 29760l*3 Let h = 59 + -56. Suppose hr = -3t + 18, -t = -9r + 4r + 48. What is the third derivative of -7g*2 - 10g*2 + rg*6 - 17g2 + g2 wrt g? 1080g3 Suppose 3i - 5 + 2 = g, i = 3g - 7. Suppose -2y - 5h = -4, -ih + 3h - 8 = -4y. Find the first derivative of yz + 3z + 3z + 2z - 6 wrt z. 10 Let h(d) be the second derivative of -13d4/6 + 5d*3/6 - 765d*2 + 382d. Differentiate h(c) wrt c. -52c + 5 What is the third derivative of 1 + 3i*2 - 3 - 836i*5 - 82i2 - i2 + 6 wrt i? -50160i2 Let j(g) be the first derivative of 2129g*2/2 - 2557g - 1901. What is the derivative of j(y) wrt y? 2129 Let q be (8 - -2) + (10 - 12). Suppose -2k = -w + q, 5k + 18 = 2w - 0w. Find the second derivative of 13d - 11d - 6dw - 4d wrt d. -72d2 Suppose -5w = -4h + 18, -2h = 50w - 55w - 4. Find the second derivative of 12x3 + 282x*4 - 212x - 19x3 + hx*3 wrt x. 3384x2 Let s(r) = r4 - r*2 - 1. Let b(p) = -480p*4 - 2p*2 + 477p - 2. Let t(h) = -b(h) + 2s(h). What is the second derivative of t(v) wrt v? 5784v*2 Let j = 260 - 258. Find the third derivative of 22a*3 - 6 + 196a*2 - j - 3 - 199a*2 wrt a. 132 Let k(x) be the first derivative of -10x*6/3 + 91x*4/4 - 12473x*2/2 - 5969. Find the second derivative of k(l) wrt l. -400l*3 + 546l Suppose 190u + 141 + 174 = 225u. Let p(w) be the first derivative of -uw - 29 + 0w*3 + 0w*2 - 1/4w*4. Differentiate p(i) with respect to i. -3i*2 Let v(t) be the second derivative of 6t*3 - 61t*2/2 + 2t + 32. Let d(r) = -182r + 306. Let p(h) = 2d(h) + 11v(h). Differentiate p(q) with respect to q. 32 Let b = -2645 + 2649. Let h be 0(4/2 + -1). What is the second derivative of hi + 15i - 43i + ib wrt i? 12i*2 Suppose 819 = 203u - 194u. What is the second derivative of -77w + 275w - 69w - 101w5 - uw wrt w? -2020w3 Let o(k) be the first derivative of k5/5 + 156k*4 - 63k*2 - 6k - 3570. What is the second derivative of o(x) wrt x? 12x2 + 3744x Let q be (-4 - -1)1(-28)/6. Let z(o) be the first derivative of -3 + o*2 - 13o + qo2 - 11o - 15. What is the derivative of z(h) wrt h? 30 Let y(n) = 182n4 - 19n3 + n2 + 446n + 3. Let w(d) = d4 + 5d3 - d2 - d - 1. Let h(g) = 3w(g) + y(g). What is the third derivative of h(u) wrt u? 4440u - 24 Let j(u) = -u*2 + 10u + 7. Let w be j(10). What is the first derivative of 85 + wp3 + 2p + 0p3 - 4p*3 - 5p wrt p? 9p2 - 3 Suppose -16 = -5a - 2o, 3o + 9 - 20 = -a. Let c be ((-15)/5 - -9)/a. Find the second derivative of 8q5 - 7q + 74q3 - 74q*c wrt q. 160q*3 Suppose -14t - 25t + t = 0. Let z(u) be the second derivative of tu*4 + 0u*2 + 0 - 13/6u*3 + 7/20u*5 + 7u. Find the second derivative of z(p) wrt p. 42p Let b(z) = 2z*2 - z + 2. Let y be b(1). Suppose -yr + r = -2d - 28, 4d = r - 29. Find the first derivative of -6 - 8 + ra3 + 6 wrt a. 27a*2 Suppose 25b - 68 - 49 = -17. Let v(c) be the second derivative of -1/3c3 + 0 + 3/2c*b + 0c*2 - 21c. What is the second derivative of v(w) wrt w? 36 Let f(a) be the second derivative of 2a3/3 + a2/2 + 26a. Let x be f(9). What is the derivative of xn - 30 - 37n - 21n3 wrt n? -63n*2 Suppose -4c + 2p = -8, -4c + 8 = p - 4p. Find the third derivative of 49j*3 - 64j*2 + 91j*c + 81j*2 + 55j*3 - 43j*3 wrt j. 366 Let l(b) be the second derivative of 51 + 0b*4 + 0b*3 - 221/2b*2 + b - 23/2b*5. What is the derivative of l(x) wrt x? -690x2 Let t(j) = j2 + 2j + 3. Let g(u) = -1421u*2 + 320u - 11. Let a(k) = -g(k) - 3t(k). What is the second derivative of a(y) wrt y? 2836 Suppose -9t + 792 = 3t. Suppose 3c - 8c + 14 = -4g, 3g + 7 = 2c. What is the second derivative of -16b + 69b*2 + tb*2 - 156b*c wrt b? -42 Let m(z) = 4z*3 + z. Let d be m(1). Differentiate 5y + y*2 - 40 - dy*2 + 6y*2 + 6y*2 wrt y. 16y + 5 Suppose -i - 104 + 106 = 0. Find the first derivative of 5j2 + 4j*3 - 861 - 7j*i - 9j*2 + 1065 wrt j. 12j*2 - 22j Let f(j) = 4 + 644j2 - 558j*2 + j + 15j. Let n(r) = 85r2 + 15r + 6. Let x(w) = -3f(w) + 2n(w). What is the second derivative of x(l) wrt l? -176 Let p be (-60)/(-15) - (-2)/(-1). Suppose 0 = 4v + 4n - 92, 0v + pv = 4n + 52. Find the second derivative of 92f*2 + vf*3 - 92f*2 + 19f wrt f. 144f Let f(j) be the third derivative of 32j*2 + 0 + 39/20j*5 + 29/60j*6 - 1/3j*3 - j + 0j4. What is the third derivative of f(i) wrt i? 348 Let u(v) be the third derivative of v7/35 - 13v4/8 + 16v*3/3 - 36v*2. Let c(m) be the first derivative of u(m). What is the derivative of c(a) wrt a? 72a*2 Let q(v) = 6v + 45. Let w be q(-12). Let a = -24 - w. Find the second derivative of m2 - m2 + 11m + 20m*a - 7m*3 wrt m. 78m Let u(n) be the second derivative of -23/10n5 + 1/6n*4 - 24n - 63/2n2 + 0 + 0n*3. What is the first derivative of u(p) wrt p? -138p*2 + 4p Let t(j) be the second derivative of 101j6/6 + 9j3 - j2 - 28j - 30. What is the second derivative of t(b) wrt b? 6060b*2 Let d be (-111)/(-4) + 2 + (-21)/12. Suppose 2i = m + 12, 3m = -3i + d + 8. What is the second derivative of 60q3 + 12q - 60q3 + 3q + iq4 wrt q? 96q*2 What is the second derivative of 74w*5 - 78w*5 + 108w*4 - 719w - 213w4 + 197w - 180w wrt w? -80w*3 - 1260w*2 Let j(a) be the first derivative of 52 + 9/4a*4 + 0a*2 - 18a*3 + 2/5a*5 + 0a. What is the third derivative of j(u) wrt u? 48u + 54 Let c(s) be the second derivative of -1/4s*4 + 21/2s*2 + 0s*3 - 1/10s*5 + 19 + 0s*6 + 1/2s*7 - s. What is the third derivative of c(u) wrt u? 1260u*2 - 12 Let y(l) = 10l - 11l + 37 + 3l. Let o be y(-17). Find the third derivative of -145s2 - s3 + 176s*2 - 28s4 + so wrt s. -672s Suppose -20 = 3u - 194. Find the third derivative of 87n3 + un*3 + 104n*3 + 107n*2 - 20n*2 - 8n*3 wrt n. 1446 Let p = -10 + 13. Suppose po - o = -3o. Find the second derivative of 1 - 1 - 12z + o - 16z2 wrt z. -32 Let l(q) be the second derivative of -2087q*4/6 + 278q3 - q2/2 - 6248q. What is the second derivative of l(y) wrt y? -8348 What is the derivative of -173f*3 - 1171 + 897f*3 + 580 - 199 wrt f? 2172f*2 Let f(k) be the third derivative of 123k*5/20 + 271k4/3 - k2 - 1964k. What is the second derivative of f(b) wrt b? 738 Let t(m) be the third derivative of -m6/60 + 13m*5/2 - 28m*3/3 - 257m*2 - 2. Differentiate t(b) with respect to b. -6b*2 + 780b Let o(t) = -t*3 + 19t*2 - 18t + 18. Let r be o(18). What is the third derivative of -27k4 + 9k*4 + rk*2 - 50k*2 - 15k*4 wrt k? -792k Let r(q) be the second derivative of -q*5/20 + 203q*4/2 + 3q*3/2 - 115q*2/2 - 2285q. Find the second derivative of r(x) wrt x. -6x + 2436 What is the second derivative of 577v*3 - 73 - 363v*3 - 4v*2 - 2v - 489v3 wrt v? -1650v - 8 Find the third derivative of 775l3 + 83 + 795l*3 + 507l*3 - 39l*2 + 22l*2 wrt l. 12462 Suppose 0 = s, 0 = -0b - 2b + 4s. Suppose 4 = -bp + 2p. What is the first derivative of -c*3 - p + 12c*3 - 5 + 0c**3 wrt c? 3	{ "pile_set_name": "DM Mathematics" }
mal places? -58 Round 0.006082 to 3 decimal places. 0.006 What is 63.54 rounded to the nearest ten? 60 Round -1001.97 to the nearest 100. -1000 Round -2.255 to 1 dp. -2.3 Round -64.89 to the nearest ten. -60 Round 340530 to the nearest ten thousand. 340000 What is 247860 rounded to the nearest 100000? 200000 Round -0.1338 to 3 dps. -0.134 Round 4109610 to the nearest 1000000. 4000000 Round -12381000 to the nearest one million. -12000000 What is 0.10857 rounded to two dps? 0.11 Round -6500 to the nearest one thousand. -7000 What is -0.00018883 rounded to 5 decimal places? -0.00019 Round -0.03172 to three dps. -0.032 What is 0.0031342 rounded to four decimal places? 0.0031 What is 0.02509 rounded to three dps? 0.025 Round 738700 to the nearest 100000. 700000 Round 0.0024018 to 5 decimal places. 0.0024 Round 12595700 to the nearest 1000000. 13000000 What is -59000000 rounded to the nearest 1000000? -59000000 What is -0.00029056 rounded to 6 dps? -0.000291 Round 69905000 to the nearest 100000. 69900000 Round -0.00000078501 to 7 dps. -0.0000008 What is 146.4 rounded to the nearest 100? 100 What is -2043.53 rounded to the nearest ten? -2040 Round 1928 to the nearest 10. 1930 Round -0.00432 to three decimal places. -0.004 What is 0.00045702 rounded to 5 decimal places? 0.00046 Round -661000 to the nearest ten thousand. -660000 Round -599.4 to the nearest 1000. -1000 Round 474 to the nearest one hundred. 500 What is 0.000027998 rounded to 5 dps? 0.00003 What is 34933000 rounded to the nearest 1000000? 35000000 What is 152905000 rounded to the nearest one hundred thousand? 152900000 What is -0.0064902 rounded to 3 dps? -0.006 Round -0.41125 to two decimal places. -0.41 Round 0.3473 to three decimal places. 0.347 Round -0.029365 to three dps. -0.029 Round 259000 to the nearest one hundred thousand. 300000 Round 610000 to the nearest 100000. 600000 Round -0.00000022613 to seven dps. -0.0000002 What is -0.0002166 rounded to four dps? -0.0002 Round 0.0001381 to four decimal places. 0.0001 What is 3.84 rounded to 1 dp? 3.8 What is 0.0067697 rounded to 5 dps? 0.00677 Round 0.00048758 to four dps. 0.0005 Round -1837000 to the nearest one hundred thousand. -1800000 Round -3.0814 to one decimal place. -3.1 Round 14700 to the nearest one hundred thousand. 0 What is -0.00000006429 rounded to seven decimal places? -0.0000001 Round -45844.3 to the nearest one hundred. -45800 Round -2.9557 to the nearest integer. -3 What is -134600 rounded to the nearest ten thousand? -130000 What is -0.088229 rounded to 3 decimal places? -0.088 Round -2137000 to the nearest ten thousand. -2140000 What is 0.02072 rounded to two decimal places? 0.02 What is -7394000 rounded to the nearest one hundred thousand? -7400000 Round -2911000 to the nearest 1000000. -3000000 What is 506902 rounded to the nearest ten thousand? 510000 Round 0.000066703 to five decimal places. 0.00007 Round -89588 to the nearest 10000. -90000 Round 80.077 to the nearest ten. 80 What is -0.00005545 rounded to six decimal places? -0.000055 What is -11225000 rounded to the nearest one hundred thousand? -11200000 Round 0.00021806 to 6 dps. 0.000218 Round 78.16 to the nearest 10. 80 What is 178160000 rounded to the nearest one million? 178000000 What is -0.000011984 rounded to five dps? -0.00001 Round 0.00037603 to four decimal places. 0.0004 What is 0.6743 rounded to one dp? 0.7 What is -320.77 rounded to the nearest 100? -300 Round 8277000 to the nearest 100000. 8300000 Round 23.899 to zero decimal places. 24 Round 0.00003448 to five dps. 0.00003 Round -0.001128 to 3 decimal places. -0.001 Round 1206450 to the nearest 1000. 1206000 Round -33.058 to the nearest 10. -30 Round 42.99 to zero decimal places. 43 Round -7.68 to the nearest ten. -10 What is -43.141 rounded to the nearest integer? -43 What is -173840 rounded to the nearest 100000? -200000 Round 0.00245605 to 5 dps. 0.00246 Round -121.36 to the nearest ten. -120 Round -14024400 to the nearest one hundred thousand. -14000000 What is 0.004837 rounded to 4 dps? 0.0048 Round -0.000039321 to seven decimal places. -0.0000393 Round -0.23834 to three dps. -0.238 Round 0.0000005361 to seven decimal places. 0.0000005 Round -88440 to the nearest 10000. -90000 What is -0.000000868 rounded to seven dps? -0.0000009 What is 0.000006847 rounded to six decimal places? 0.000007 What is -0.33224 rounded to two dps? -0.33 Round 0.48016 to 3 dps. 0.48 Round 2.9154 to the nearest integer. 3 What is 0.00023802 rounded to six decimal places? 0.000238 What is -271300 rounded to the nearest ten thousand? -270000 What is 0.00002631 rounded to four decimal places? 0 What is 0.000058541 rounded to six dps? 0.000059 What is -12.748 rounded to 1 dp? -12.7 What is -7679000 rounded to the nearest 1000000? -8000000 Round -72124 to the nearest 1000. -72000 Round -3.6576 to two decimal places. -3.66 What is -834600 rounded to the nearest one hundred thousand? -800000 What is 14000 rounded to the nearest one thousand? 14000 What is -0.0000005979 rounded to 7 dps? -0.0000006 Round 4279400 to the nearest ten thousand. 4280000 What is 32428.2 rounded to the nearest 100? 32400 What is -0.000004967 rounded to 6 dps? -0.000005 What is -9341 rounded to the nearest one hundred? -9300 Round 0.00021862 to five decimal places. 0.00022 Round -23359900 to the nearest one million. -23000000 Round -0.0027313 to four decimal places. -0.0027 What is 11476400 rounded to the nearest ten thousand? 11480000 Round 6065 to the nearest one hundred. 6100 What is 32.18 rounded to the nearest integer? 32 Round 0.5325 to one dp. 0.5 Round 0.32962 to 2 dps. 0.33 What is 3148000 rounded to the nearest one million? 3000000 What is 20856 rounded to the nearest one hundred? 20900 Round -260.62 to the nearest integer. -261 What is -15.8861 rounded to the nearest integer? -16 Round -7972000 to the nearest 1000000. -8000000 Round -0.4797 to one decimal place. -0.5 What is -17705 rounded to the nearest 1000? -18000 Round -0.1062 to two dps. -0.11 Round 407.7 to the nearest ten. 410 What is -40.68 rounded to the nearest integer? -41 Round -156.733 to the nearest integer. -157 Round -540.7 to the nearest 1000. -1000 What is -0.000016954 rounded to seven decimal places? -0.000017 What is 0.1547 rounded to 1 decimal place? 0.2 What is 2187680 rounded to the nearest one million? 2000000 What is -3.058 rounded to the nearest integer? -3 What is 35480 rounded to the nearest 10000? 40000 Round 45400000 to the nearest one million. 45000000 Round 4510 to the nearest one hundred. 4500 Round -4856 to the nearest one thousand. -5000 What is -8.927 rounded to 0 decimal places? -9 What is -0.000010669 rounded to seven decimal places? -0.0000107 Round 0.006308 to 3 dps. 0.006 What is 9768.6 rounded to the nearest 10? 9770 What is 43230 rounded to the nearest ten thousand? 40000 Round -18505 to the nearest 1000. -19000 What is 79.53 rounded to the nearest ten? 80 Round 0.00017449 to six decimal places. 0.000174 Round 888800 to the nearest 10000. 890000 Round -0.0000694 to 6 decimal places. -0.000069 What is 540000 rounded to the nearest 100000? 500000 What is -0.0000241 rounded to five dps? -0.00002 What is 7.135 rounded to the nearest integer? 7 Round 0.00000541787 to seven dps. 0.0000054 What is 2.8471 rounded to two decimal places? 2.85 What is 0.00030734 rounded to 4 decimal places? 0.0003 What is -2436000 rounded to the nearest one hundred thousand? -2400000 What is 0.00062018 rounded to four dps? 0.0006 What is -0.00000162947 rounded to seven decimal places? -0.0000016 Round -4909000 to the nearest 1000000. -5000000 Round -33400 to the nearest 10000. -30000 Round -123800 to the nearest 10000. -120000 Round 0.015257 to 2 decimal places. 0.02 What is 6.473 rounded to zero decimal places? 6 Round 0.000025331 to 6 dps. 0.000025 What is -2781000 rounded to the nearest 100000? -2800000 Round 32.288 to the nearest 10. 30 What is 8 rounded to the nearest 10? 10 Round 0.00064232 to six decimal places. 0.000642 What is -0.0005631 rounded to 5 decimal places? -0.00056 What is -0.05202 rounded to 2 dps? -0.05 What is -0.001292 rounded to 4 decimal places? -0.0013 Round 0.000003349 to 6 decimal places. 0.000003 Round 210375000 to the nearest one mil	{ "pile_set_name": "DM Mathematics" }
1340p3 - 3423996p*2 + 2282608p + 48 = 0. -6/285335, 1, 2 Suppose 3q2/2 + 7564470q + 9536867730150 = 0. Calculate q. -2521490 Find b, given that -4b4 + 45344b*3 - 2124632b*2 + 25966816b - 23887524 = 0. 1, 23, 11289 Find m such that -12m5 - 118m*4 + 3346m*3 - 6606m*2 + 458m + 1012 = 0. -23, -1/3, 1/2, 2, 11 Suppose 4k5 + 445832k*4 + 1783280k*3 + 1783264k*2 = 0. Calculate k. -111454, -2, 0 Let 2t*3 + 15646684t*2 + 30602386964480t + 183613758506688 = 0. What is t? -3911668, -6 Factor 3i3 + 15750i*2 - 3118851i - 6300678. 3(i - 193)(i + 2)(i + 5441) Factor i2 - 157816144i + 6226483826757184. (i - 78908072)*2 Factor 5o*2 + 96930o + 469765120. 5(o + 9658)(o + 9728) Find u such that -2u4 + 6034u*3 - 155166u*2 - 1094130u - 1722816 = 0. -3, 32, 2991 Factor 5s2 + 1207070s - 3621255. 5(s - 3)(s + 241417) Suppose 15u5 + 20313u*4 - 36633u*3 - 28449u*2 + 36618u + 8136 = 0. What is u? -1356, -1, -1/5, 1, 2 Find j such that 80956j2 + 97216j + 16260 = 0. -1, -4065/20239 Find k, given that k*4/3 - 2797k*3/3 - 405031k*2/3 + 2797k/3 + 135010 = 0. -138, -1, 1, 2935 Suppose -w*2/3 + 6784670w/3 - 11507936752225/3 = 0. Calculate w. 3392335 Find r such that r*3/4 - 22755r*2/4 - 227661r/4 + 250415/4 = 0. -11, 1, 22765 What is d in -d*2/4 - 8998267d/2 - 80968809003289/4 = 0? -8998267 Find s such that -5s2/4 - 665s/4 + 108100 = 0. -368, 235 Factor -2n2/11 + 24141820n/11 - 72853434114050/11. -2(n - 6035455)2/11 What is w in -2780w*3 + 88938w*2 + 704w = 0? -11/1390, 0, 32 Find g such that -256g5 + 648768g*4 - 407665904g*3 - 305992756g*2 - 76518468g - 6377384 = 0. -1/4, 1157, 1378 What is b in -b*5/3 - 4637b*4 - 319586b*3/3 - 2250196b*2/3 - 1574040b - 2777600/3 = 0? -13888, -10, -2, -1 Factor -x*2/4 + 395713x/4 - 494635. -(x - 395708)(x - 5)/4 Solve -i3/2 + 2391671i*2/2 - 4783339i/2 + 2391669/2 = 0. 1, 2391669 Find o, given that -4o5/5 + 40764o*4/5 - 3727952o*3/5 + 23294016o*2 - 261809280o + 436276800 = 0. 2, 30, 10099 Let -20c5/9 + 112888c*4/9 - 466268c*3 + 13324424c*2/9 - 12291088c/9 + 338912 = 0. What is c? 2/5, 1, 2, 34, 5607 Suppose 3y2 + 308736y - 4322892 = 0. What is y? -102926, 14 Factor 5x3/4 - 10575x*2/4 + 1863000x - 437416875. 5(x - 735)(x - 690)*2/4 Factor 3a*3 + 812520a*2 + 55294171056a + 37658765201664. 3(a + 688)(a + 135076)2 Factor r2/2 - 10186648r. r(r - 20373296)/2 Factor 2t2/17 + 164030t/17 + 1804088/17. 2(t + 11)(t + 82004)/17 Find h, given that 5h3/3 - 10376h*2 - 2279732h/3 - 302304 = 0. -72, -2/5, 6298 Suppose 5n4 + 1600n*3 + 130305n*2 + 1595930n + 5323360 = 0. Calculate n. -194, -112, -7 Suppose 3f3 + 2643f*2 + 183309f - 185955 = 0. What is f? -805, -77, 1 Determine z so that 92z2/13 - 765330z/13 - 382688/13 = 0. -1/2, 191344/23 Let -33l2/4 + 1293291l/2 + 470292 = 0. What is l? -8/11, 78382 Factor -3z2/5 + 9261987z - 46309932/5. -3(z - 15436644)(z - 1)/5 Suppose -2b4/7 - 2046b*3/7 + 198250b*2 + 2046b/7 - 1387748/7 = 0. What is b? -1489, -1, 1, 466 Factor 2f3 + 22110f*2 - 3079746f + 106579746. 2(f - 69)2(f + 11193) Factor -5h3 + 65598h*2 + 288743h - 196860. -(h - 13124)(h + 5)(5h - 3) Determine c, given that 2c*2/11 + 623276c/11 + 97805034/11 = 0. -311481, -157 Solve 4a4 + 104780a*3 - 1257828a*2 + 2830356a = 0. -26207, 0, 3, 9 Suppose 4b2 - 63135600b + 63135596 = 0. What is b? 1, 15783899 Let v*3/9 - 1456v*2 + 483479v/9 = 0. Calculate v. 0, 37, 13067 Let 5w2 - 2470912210w + 305270357476354205 = 0. Calculate w. 247091221 Factor -4h3 - 80500h*2 - 3774664h. -4h(h + 47)(h + 20078) Factor -2m*3/7 + 355716m*2/7 - 15629777400m/7 - 16674714410000/7. -2(m - 89450)2(m + 1042)/7 Determine p, given that -2p3 - 1428396p*2 - 255036534786p + 1020168993608 = 0. -357101, 4 Let 12g5/5 + 9192g*4 + 45220719g*3/5 + 461468769g*2 - 2341282368g/5 + 117629952 = 0. Calculate g. -1888, -55, 1/2 Solve -2q3/7 - 104990q*2/7 - 1277642750q/7 + 2676740310750/7 = 0 for q. -27155, 1815 What is z in -5z2 - 181945z + 68004150 = 0? -36759, 370 Factor 3r2/5 + 49540458r/5 + 204521414904147/5. 3(r + 8256743)2/5 Factor -2m*2 - 807078m - 99240336. -2(m + 123)(m + 403416) Factor 57a3 + 26618a*2 + 1167007a - 20482. (a + 49)(a + 418)(57a - 1) Factor -u2/3 + 470354u/3 - 1881368. -(u - 470342)(u - 12)/3 Factor -29p*2/9 - 5654918p/9 - 324995/3. -(p + 194997)(29p + 5)/9 Factor b*3/4 + 23715b*2 - 474339b/4 - 664055/2. (b - 7)(b + 2)(b + 94865)/4 Determine b, given that -15b3/8 - 40407b*2/2 + 19580493b/8 + 11864655/4 = 0. -10895, -6/5, 121 Suppose -42t4 - 1858t*3 - 8758t*2 - 6942t = 0. Calculate t. -39, -89/21, -1, 0 Find b, given that -b*3/9 - 1049b*2/9 - 28732b = 0. -653, -396, 0 Determine u, given that -369u4/4 + 30077u*3/2 + 59375u*2/4 - 287u = 0. -1, 0, 7/369, 164 What is d in 2d2/3 + 29760256d/3 - 148801330/3 = 0? -14880133, 5 Factor -2o2/5 + 2526o - 1595988/5. -2(o - 6186)(o - 129)/5 Find p, given that -2p2/11 - 4400566p/11 = 0. -2200283, 0 Find o such that -o*5/7 + 1951o*4/7 - 942787o*3/7 - 8590707o*2/7 - 3696840o - 3704400 = 0. -3, 980 What is h in 4h5 - 916h*4 + 21932h*3 - 167612h*2 + 227376h + 1315440 = 0? -2, 9, 10, 203 Factor -2p2 - 22450360p - 63002333016200. -2(p + 5612590)2 Factor 3p*3 + 163620p*2 - 1145511p - 1309128. 3(p - 8)(p + 1)(p + 54547) Find i, given that 3i*2 + 71758860i + 71758857 = 0. -23919619, -1 Determine n so that -3n3 + 27147n*2 - 2285820n = 0. 0, 85, 8964 Suppose -v*4/2 - 2354v*3 + 390819v*2/2 - 4691119v + 26230040 = 0. Calculate v. -4790, 8, 37 Factor 3b2 - 1581b + 66378. 3(b - 481)(b - 46) Find y, given that y*2/4 + 93756y - 9378100 = 0. -375124, 100 Determine o so that -81o3 - 383286852o*2 - 170349700o - 18927744 = 0. -4731936, -2/9 Suppose -10f5/7 - 6234f*4/7 - 747422f*3/7 - 25019422f*2/7 + 15584040f/7 + 10189048/7 = 0. What is f? -478, -73, -2/5, 1 Suppose -3p3/5 + 1606743p*2/5 - 43016283936p - 14417668690176/5 = 0. Calculate p. -67, 267824 Solve -2p4 + 436p*3 + 50930p*2 - 56548p - 616080 = 0 for p. -85, -3, 4, 302 Let -2n2/3 - 16805582n/3 - 70606896589681/6 = 0. What is n? -8402791/2 Factor 2116640j2/3 - 176392j + 4/3. 4(4j - 1)(132290j - 1)/3 Solve 4n4/5 - 7176n*3/5 + 3092836n*2/5 + 113869776n/5 - 23391088 = 0 for n. -35, 1, 914 Suppose -2x2/3 + 56821532x/3 + 37881024 = 0. What is x? -2, 28410768 Solve l*2/3 + 4183l/3 + 1391670 = 0 for l. -2538, -1645 Factor 19589480838050m2 + 100148960m + 128. 2(3129655m + 8)*2 What is i in 2i*3 + 118i*2 - 62824i + 125160 = 0? -210, 2, 149 Find r, given that -5r5 + 45r*4 + 15895r*3 + 272715r*2 + 707710r + 450840 = 0. -39, -17, -2, -1, 68 Find n such that -5n2/2 - 857048725n - 146906503404825125/2 = 0. -171409745 Solve -2h3/7 - 3314h*2 - 92766h/7 - 69570/7 = 0 for h. -11595, -3, -1 Determine b so that -2434900267947b3 - 121744959342930b*2 + 2702720700b - 15000 = 0. -50, 10/900907 Factor -m*2/3 + 9799m/3 - 806428/3. -(m - 9716)(m - 83)/3 Suppose 2b*5/3 - 1052b*4/3 + 7298b*3/3 - 5544b*2 + 4152b = 0. Calculate b. 0, 2, 3, 519 Factor -2c2 + 1140272c + 78688290. -2(c - 570205)(c + 69) Factor 4n2 - 3841260n - 307326400. 4(n - 960395)(n + 80) Determine v so that -5v5 + 2253520v*4 + 6760600v*3 + 2253550v*2 - 6760595v - 4507070 = 0. -2, -1, 1, 450707 What is g in -4g3/3 - 241544g*2/3 - 1217500032g - 60673881600 = 0? -30168, -50 Find u such that 2u4 + 51268u*3 - 3958104u*2 + 35734940u - 86131850 = 0. -25711, 5, 67 Factor -3d2/2 - 2625016d + 3500024. -(d + 1750012)(3d - 4)/2 Factor -5p3 - 7995p*2 + 252230p - 684600. -5(p - 28)(p - 3)(p + 1630) Factor 5d*3 + 67510d*2 - 1555495d - 1623000. 5(d - 24)(d + 1)(d + 13525) Factor 3d*2 + 7209186d - 14418384. 3(d - 2)(d + 2403064) Suppose -4j4 + 12712j*3 - 6204480j*2 + 1091788288j - 65434710016 = 0. Calculate j. 184, 2626 Let -3o4/5 - 19764o*3/5 - 39492o*2/5 + 158064o	{ "pile_set_name": "DM Mathematics" }
t. -10 Solve -23956r = -24060r + 3224 for r. 31 Solve 325s = 1411 - 787 + 1326 for s. 6 Solve 32 + 400 = -28b + 96 for b. -12 Solve 1182 = -8z + 1102 for z. -10 Solve 0 = 14993r - 14685r + 2772 for r. -9 Solve 12336 - 11855 = 37i for i. 13 Solve -9p - 57p = -726 for p. 11 Solve -4128 - 1038 = -97h + 384h for h. -18 Solve -704p + 670p = 34 for p. -1 Solve -653q + 13284 = -161q for q. 27 Solve -3s - 4s - 2s + 99 = 0 for s. 11 Solve -208l - 245l + 10872 = 0 for l. 24 Solve -25y - 84y + 1090 = 0 for y. 10 Solve -176 = 82z - 60z for z. -8 Solve 117u - 54u - 63 = 0 for u. 1 Solve 0 = 3s - 27 + 5 - 8 for s. 10 Solve 297v = 347v + 650 for v. -13 Solve -88w = -826 - 406 for w. 14 Solve 30 - 69 - 195 = 39j for j. -6 Solve 0 = 191d + 285 + 4299 for d. -24 Solve -1737 + 1074 = 39j for j. -17 Solve 0 = -32r + 125 - 61 for r. 2 Solve 185x = 55x + 910 for x. 7 Solve 0 = 11o + 3662 - 3805 for o. 13 Solve -82h = -81h + 6 for h. -6 Solve 51i + 169 + 636 = -64i for i. -7 Solve -41 = -648n - 8102 - 5547 for n. -21 Solve 174k + 487 = 139 for k. -2 Solve -27 = 62j - 89j for j. 1 Solve -13 + 148 = -64x - 249 for x. -6 Solve -7z + 54z = -25z - 648 for z. -9 Solve 26h - 1116 = 119h for h. -12 Solve 368 = -59c - 952 + 435 for c. -15 Solve 36a + 63 - 94 - 77 = 0 for a. 3 Solve 10 = 2670j - 2665j for j. 2 Solve -113d - 1204 + 2786 = 0 for d. 14 Solve 10277 = 1156q + 42645 for q. -28 Solve -548i = -848i - 300 for i. -1 Solve 37d = 79d - 28d - 196 for d. 14 Solve -91f + 230f = 2085 for f. 15 Solve -16j = -2j + 3j - 34 for j. 2 Solve 7z - 95z + 1936 = 33z for z. 16 Solve 2803 = 214q + 21 for q. 13 Solve -16578 = -1343x + 368x + 15597 for x. 33 Solve -18b - 84 = -246 for b. 9 Solve -345s + 2507 = -253 for s. 8 Solve 119g = -348 - 9 for g. -3 Solve -139b - 919 = 332 for b. -9 Solve -164j + 153j - 66 = 0 for j. -6 Solve 44i - 192 = 10i + 46 for i. 7 Solve -330f = -7f - 4173 - 1641 for f. 18 Solve 88d = -115d + 26d for d. 0 Solve -5779 = 182p - 5233 for p. -3 Solve 0 = -44p - 118p + 2995 - 1051 for p. 12 Solve 2 - 14 + 2 = k for k. -10 Solve 45z + 252z + 5628 = -105z for z. -14 Solve -104v + 647 = 1852 + 875 for v. -20 Solve 116k + 117 + 25 = 26 for k. -1 Solve 19k - 118k = 204k - 6969 for k. 23 Solve 91v - 2744 = 399v - 210v for v. -28 Solve 4 = -31t - 182 for t. -6 Solve 83o - 568 = -80o + 1225 for o. 11 Solve 77j - 33j = -78j - 488 for j. -4 Solve 357567j = 357599j - 992 for j. 31 Solve 1046 = 54l + 506 for l. 10 Solve -112q + 147q = 735 for q. 21 Solve 127 = -18i + 1 for i. -7 Solve -660s + 14310 = 771s for s. 10 Solve 32v - 619797 = -620597 for v. -25 Solve -217g + 1424 + 425 = -4444 for g. 29 Solve -8406k + 1155 = -8329k for k. 15 Solve 118t - 121t + 29 = -16 for t. 15 Solve -11i + 11648 = 437i for i. 26 Solve -8b - 6b + 24 = -2b for b. 2 Solve -19z + 26z = 17z - 219z for z. 0 Solve -578 = -60y + 11 + 11 for y. 10 Solve 16d + 2785 = 133d + 1030 for d. 15 Solve -3312 = 314h + 3282 for h. -21 Solve -1480 = -9h + 83h for h. -20 Solve 1034q = 1317q + 8490 for q. -30 Solve 304c + 7 = 599c - 302c for c. -1 Solve 2017 = -280t - 1376 + 313 for t. -11 Solve -131i - 1082 = -296 for i. -6 Solve 1926i + 17864 + 16804 = 0 for i. -18 Solve 0 = 14r + 118 + 134 for r. -18 Solve -109g - 42g - 3020 = 0 for g. -20 Solve 0 = -134s + 397 + 273 for s. 5 Solve 1550r - 3082r + 440 = -1543r for r. -40 Solve -7033 = -88a - 453a for a. 13 Solve -382p - 3042 = 486p + 1298 for p. -5 Solve -847 = -69d + 395 for d. 18 Solve 353f = 275 - 4511 for f. -12 Solve -44v - 106v = 1650 for v. -11 Solve -8a - 64 + 1 = 25 for a. -11 Solve 7t + 355 = 33t - 269 for t. 24 Solve 48l - 211568 = -211904 for l. -7 Solve -57j - 4424 = 101j for j. -28 Solve -40h + 174 = -82h + 804 for h. 15 Solve -16y - 1070 + 814 = 0 for y. -16 Solve 31j - 3j - 1083 = -29j for j. 19 Solve -2182q + 1061q + 825 = -1088q for q. 25 Solve -114d + 59 - 59 = 0 for d. 0 Solve -19w - 3 - 2 = -24 for w. 1 Solve -480 = -1825b + 1729b for b. 5 Solve 3306w - 380 = 3287w for w. 20 Solve -44j = -84j + 38j - 20 for j. -10 Solve 0 = 872q - 497q + 6375 for q. -17 Solve 179 = 74j + 401 for j. -3 Solve -111d = 30 + 54 + 138 for d. -2 Solve 0 = -90b - 42b + 132 for b. 1 Solve -149f + 6322 = 142f - 80 for f. 22 Solve 399 = 146i - 623 for i. 7 Solve 6u + 33 = 99 for u. 11 Solve -9f = -63463 + 63571 for f. -12 Solve 239h - 146h - 218h = -4750 for h. 38 Solve 318u - 897u + 7777 = -3803 for u. 20 Solve -4k - 24k = 18k - 1288 for k. 28 Solve 104v - 160v = 139v - 1755 for v. 9 Solve 515 = 3m - 14m + 449 for m. -6 Solve 110 = -188u + 18 - 96 for u. -1 Solve -352b - 40b - 2118 = -39b for b. -6 Solve -8960 = -330o - 384o + 394o for o. 28 Solve 473s - 613 + 1050 = 5640 for s. 11 Solve 308w - 2955 = 1778 + 6355 for w. 36 Solve 13k - 36k = -23 for k. 1 Solve -148k + 944 = -240 for k. 8 Solve 391c - 189c - 198c - 52 = 0 for c. 13 Solve 0 = -993w - 736w + 405w + 30452 for w. 23 Solve -4q - 1776 = -8q - 1880 for q. -26 Solve 2n - 2n - 9n = 8n for n. 0 Solve -515o + 166o = -2094 for o. 6 Solve -19z + 116 + 26 = -86 for z. 12 Solve -337o - 120o - 5484 = 0 for o. -12 Solve 569t = 658t + 93 - 538 for t. 5 Solve 2u - 659 = -647 for u. 6 Solve -226c + 761 = 5733 for c. -22 Solve -5366x + 24 = -5354x for x. 2 Solve 854i - 432i - 504 = 386i for i. 14 Solve -1180 = 299f - 5067 for f. 13 Solve 196v - 2085 = 71 for v. 11 Solve -79p = 20p - 24p + 600 for p. -8 Solve 735j - 874j = -2641 for j. 19 Solve 88 - 26 = -14t - 17t for t. -2 Solve -16q - 8q = -384 for q. 16 Solve -103w - 816 = 107 + 1240 for w. -21 Solve -19p + 20 - 2 = 189 for p. -9 Solve 654q - 9406 = -7066 + 9432 for q. 18 Solve -419 + 212 = 109r + 338 for r. -5 Solve 179 + 94 = 8k + 1 for k. 34 Solve 2q - 135224 = -135220 for q. 2 Solve 0 = 48x - 171 - 263 - 478 for x. 19 Solve 1321 + 887 = 10346b - 10277b for b. 32 Solve -396k - 287 - 109 = 0 for k. -1 Solve 22250 - 20698 = -97z for z. -16 Solve -62j + 265 + 585 + 204 = 0 for j. 17 Solve -1068 = -544o - 137o + 414o for o. 4 Solve 84u = -292 + 1132 for u. 10 Solve 0 = 10o + 54 - 94 for o. 4 Solve 3 - 21 = -27x + 9 for x. 1 Solve -9a - 9a + 245 = 11 for a. 13 Solve 1278 = 22h + 24h + 25h for h. 18 Solve 0 = -34u + 237 - 33 for u. 6 Solve 70u - 173u - 981 = 564 for u. -15 Solve -134z + 129z + 10 = 0 for z. 2 Solve -54v - 17v = -905 - 1580 for v. 35 Solve 162j + 3434 = -40j for j. -17 Solve -212s = 196s - 54 + 870 for s. -2 Solve 0 = -98u - 577 + 1206 + 645 for u. 13 Solve -59f = -635 + 45 for f. 10 Solve -7y - 139 = -104 for y. -5 Solve 1346 = -343j + 3108 + 4412 for j. 18 Solve 534 = -63n - 96 for n. -10 Solve 106n = 318n + 980 + 1564 for n. -12 Solve -89a - 82a + 192a = 231 for a. 11 Solve 474h - 418 = 452h for h. 19 Solve -178n = 91n + 7n + 3588 for n. -13 Solve 2982o - 2376 = 2916o for o. 36 Solve 7t - 79 = 21t - 37 for t. -3 Solve 242v - 120v + 50 = 97v for v. -2 Solve 359w + 7880 = 15419 for w. 21 Solve 293s - 345s = -1571s + 31899 for s. 21 Solve -4000w + 4088w + 880 = 0 for w. -10 Solve -199 - 251 = -32r + 7r for r. 18 Solve -131g + 53g = -52g - 754 for g. 29 Solve 1292 = -403i - 1664 - 2283 for i. -13 Solve -2t = -24t - 210 - 54 for t. -12 Solve 0 = 36z + 20518 - 20554 for z. 1 Solve 66 = -37c + 103 for c. 1 Solve 0 = -158g + 659g - 16032 for g. 32 Solve 14828 - 15228 = 25i for i. -16 Solve -128z - 97z - 2010 = 110z for z. -6 Solve 649m - 222m - 263m - 4592 = 0 for m. 28 Solve 9n + 19 = 21 + 52 for n. 6 Solve -10n - 42n + 854 = 70n for n. 7 Solve 2530 - 9819 = -231g + 34g for g. 37 Solve 1 = 23p - 158 - 232 for p. 17 Solve 8i + 678 - 518 = 0 for i. -20 Solve 78o - 157o - 105o + 4048 = 0 for o. 22 Solve -100k = -112k + 8 + 52 for k. 5 Solve -32p - 14p = 69p - 805 for p. 7 Solve -6256 = 3781f - 4172f for f. 16 Solve -33y = -58y - 29y - 54 for y. -1 Solve 71q = -665 + 310 for q. -5 Solve 189 = -4j - 23j for j. -7 Solve 0 = 747p - 717p + 210 for p. -7 Solve -404p + 317p = -1218 for p. 14 Solve -868 = 57c +	{ "pile_set_name": "DM Mathematics" }
d*2 + sd + od3 and give o. 8 Express (2i + 0 + 0)(-i - 2i + 5i) + 7579 + 77i*2 - 326i*2 + 2i - 7577 as l + zi + ni*2 and give n. -245 Express (7h*2 - 5h*2 - 15h*2)(152 + 266 + 232 + 128 - 133 + 44) in the form fh2 + a + sh and give f. -8957 Express -675a2 + 1206a + 1 + 2 + 1217a - 3652a + 1224a in the form ja*2 + ha + n and give h. -5 Express (0p + 0p + 2p)(3 - p - 3)(-592p + 187221 - 187221) in the form dp + w + zp*3 + lp*2 and give z. 1184 Rearrange (-238v*2 + 106v*2 + 119v*2)(-41 + 10 - 32) to the form fv2 + z + qv and give f. 819 Rearrange -38i2 - 2i*3 - 4i*3 - 15220i + 15218i + (i3 - 2i*2 + 2i*2)(-6 + 4 + 1) to the form g + hi3 + ui + pi2 and give p. -38 Rearrange -56r + 14r4 - 8r*3 - 21r*4 + 5r*4 - 5r + 2 to the form pr + cr*3 + tr*4 + wr*2 + a and give t. -2 Express 0 + 1 - 2093o*2 - 4 + 3782o*2 as do*2 + co + u and give d. 1689 Rearrange (-15r + 15r - 8r2)(-4 - 3 + 1) + (3 - 2r - 3)(0r + 14r + 9r) to the form vr*2 + ir + x and give v. 2 Rearrange -72h3 - 69h + 64h - 68h*3 - 134h*3 - 1 to the form uh*3 + rh*2 + fh + j and give j. -1 Rearrange (4 - 1 - 1 + (5 - 5 - 3)(3 - 2 - 3) - 5 + 1 + 2)(11 + 6 - 14)(-1 + 1 - 2o) to the form m + do and give m. 0 Express -8z*2 - 12z*2 - 4090z + 3888z + 22z*2 + 2z*3 + 2 as nz*3 + a + yz + bz2 and give a. 2 Rearrange (-5r*2 - 8r2 - r2)(2 - r - 2)(400r - 60r + 660r) to gr*2 + or*3 + lr*4 + kr + h and give l. 14000 Rearrange (0j + 0j + 3j)(-27 + 55 - 6 + (-1 + 3 + 1)(-40 - 40 + 9)) to r + fj and give r. 0 Rearrange (-18 + 11 - 8)(-c4 - c4 - c4) - 14 + 14 + 4c*4 - 2c + 2c - 2c*4 to the form kc + bc2 + xc*4 + r + jc*3 and give k. 0 Express -2g - 12g3 + 125g*2 - 399g*2 + 2g*4 + 131g*2 + 132g*2 in the form yg + j + fg3 + vg*4 + ug*2 and give f. -12 Rearrange 2 - 2 + 6485m + 6132m - 10719m + 0 + 0 + m + 2m - 6m + 3m + (-m + 2m - 3m)(-3 + 0 + 4) to hm + n and give h. 1896 Rearrange (-43a - 35a + 13a)(475 - 475 + 186a*2) to the form ra + wa2 + p + xa*3 and give x. -12090 Rearrange -119l2 - 2698 + l4 - 2693 - 2l3 - 2697 + 8087 to the form tl*2 + yl*4 + xl*3 + ol + a and give t. -119 Express (2c + 0 + 0)(-1 + 2 - 2)(-6c + 10c - 2c)(-5 + 3 + 4)(-28 + 4 - 111) in the form d + rc2 + mc and give r. 1080 Express -424w2 + 16 - 422w*2 + 72w*3 - 479w*3 - 425w*2 + 1270w*2 as bw + jw3 + lw*2 + g and give l. -1 Express 19q*2 + 41q + 6q2 + 24q*2 + 7q*2 - 77q*2 in the form bq + mq2 + u and give m. -21 Express (12 + 5 - 8)(-9 - 1261p + 635p + 541p) in the form s + mp and give s. -81 Rearrange -25 + 66t + 22t + 19t + 253t + 119t to w + zt and give w. -25 Express (-56f - 20f + 13f)(30 - 26 - 21) in the form k + mf and give m. 1071 Express -d2 + 6d - 48d2 + 2 + 58d*2 as k + bd + vd2 and give b. 6 Express 10301w + 0w2 - 2 - 11993w - w*2 as ow*2 + yw + h and give o. -1 Rearrange -17299a + 10957a + 10195a to c + wa and give w. 3853 Rearrange (-6862 + 3237 - 2335 - 8131 - 1103)(w4 - 5w4 + w4) to gw + cw*3 + vw*2 + o + nw*4 and give g. 0 Rearrange (-24p + 11p - 31p)(-167p - 38p + 15p) + (-p - p + 4p)(-2p + 0 + 1 + 0) to the form dp*2 + tp + z and give d. 8356 Express 440957y2 - 1 - 3 - 441113y2 - 6 - y3 as ay2 + ty + f + zy3 and give f. -10 Rearrange 7r*2 - 4r*2 + 106r - 2r4 + 57 - 94r - 51 to ar3 + g + fr*4 + pr*2 + br and give b. 12 Express -1080n + 2187n + 1 - 1082n in the form f + zn and give z. 25 Express -277r2 + 31 - 58 + 118r*2 + 64r*2 in the form sr + w + ar2 and give a. -95 Express 662z*2 + 127z + 673z2 - 1994z*2 + 684z*2 as q + az*2 + sz and give s. 127 Express (-1690i2 + 295i*2 - 1791i*2 + 161i*2 - 1491i*2)(3 + 2 + 0) in the form xi2 + ji + f and give x. -22580 Rearrange (5 - 1744j + 767j - 5 + (-3j - 2j + 6j)(-3 - 2 + 4))(3j - j + 0j) to q + rj*2 + nj and give r. -1956 Express -2v - v + 4v + (-47v - 48v - 281v)(-2 - 65 - 15) in the form yv + o and give y. 30833 Express 2s + 37s2 - 368 - 365 - 2s*4 + 2s*3 + 1101 - 369 as ds + ks3 + xs*2 + ps*4 + t and give t. -1 Rearrange (3 - 3 - 8 - 4)(-4341x3 - 857418x*2 + 857418x*2) to zx*2 + t + px + ix3 and give i. 52092 Express (-63 - 35 - 52)(1 - 2 + 2)(5v + 0v + 0v) as h + fv and give f. -750 Express 5r + 0r - 10r - r - 20r + 16 in the form mr + d and give d. 16 Express -448 + 9w2 - 335 - 19w*2 - 10w*2 + 18w*2 + w in the form z + uw + yw2 and give y. -2 Rearrange (3 + c - 3)(627c - 44c + 581c)(0 - 3 + 2) to rc2 + yc + q and give r. -1164 Rearrange (-146 + 41 + 27)(-5p + p + 3p) + 2 + 3p - p + p to n + hp and give h. 81 Express (-4 - a2 + 4)(-3a2 + 5a*2 - 5a*2 + (-103a + 22a + 40 + 77a)(0a - 2a + 0a)) as qa2 + z + ta*4 + oa + va3 and give t. -5 Rearrange 3 + 2 - 1854y*3 + 35y + 1864y3 - 37y to the form iy3 + ay + ty2 + q and give q. 5 Rearrange -241 - 207 - 300 - u + 216 - 778 to the form a + iu and give i. -1 Express 8666f - 8665f + 8728 - 1475 as hf + t and give t. 7253 Rearrange 1 + 2x - 1 + (-x - 2x + 6x)(2 - 4 + 4) + 0x - 4x - x + (-x + 4x - 2x)(6 - 3 - 1) - 4x - 10x - 2x to the form u + bx and give b. -11 Express 2i - 10i*4 + 6i*4 - 1 + i + 16i as ji3 + mi*2 + n + pi*4 + qi and give q. 19 Express (v - 4v + v)(-1 - 2 - 1) - 523v - 1360v - 1812v + 5 in the form w + mv and give w. 5 Rearrange -301 + 6a - 8 - 447 - 4a to the form va + c and give c. -756 Rearrange 2d*2 - 2691 - 2681 + 5333 to nd*2 + ad + s and give n. 2 Express -15117o + 113 - 251 - 7882o + 138 in the form io + s and give i. -22999 Rearrange (-u + 3u - 3u)(55244 - 27048 - 27573)(-6 + 2 + 5)(3u + u2 - 3u) to nu3 + du + s + iu2 and give n. -623 Express (0h - 2h + 0h)(13 - 9 + 6) - 10h - 9h + 42h as r + gh and give g. 3 Rearrange (-69i - 44i - 38 + 51i)(-3i + 0i - i) to y + bi*2 + zi and give b. 248 Express ((2y - 5y + 4y)(3 - 2 + 1) + 5y - y - 2y - 2y - 2y - 2y)(-587 - 417 - 193 - 364) in the form l + jy and give j. 3122 Express -8h*4 + 138h - 3h4 + 7h*3 + 10h*4 - 2 + 200h - h*2 - 5h*3 in the form dh*2 + xh*4 + l + ah + yh3 and give d. -1 Rearrange (-3l + 5l - 3l)(5l - 2l + l) - 26l*2 - 7l*2 - 10l*2 + (5 - 5 - 1)(3l2 - 2l2 + l2) to the form xl + ql*2 + k and give q. -49 Express 9115j - 5150195 + 5150195 as m + kj and give k. 9115 Rearrange (1 - 3 + 1 + (3 + 1 - 7)(0 + 2 - 1))(1512s - 124s2 - 1512s + s*3) to the form a + xs*2 + ws + us3 and give u. -4 Rearrange (-717 + 1021 + 444)(-4w + 98 + 2w - 88) to aw + f and give a. -1496 Express 107 - 38 - 50 - 19 + 10265h in the form zh + l and give z. 10265 Rearrange 928c*2 + 92c + 592c2 - 90c to the form uc2 + qc + y and give u. 1520 Express (-2 - 2m + 2 + (-2 - 1 + 2)(2m - m - 2m))(-10341m - 920m - 898m - 11694m) in the form jm*2 + ym + t and give j. 23853 Express 1249w - 3933w - 287w - 5016w as tw + j and give j. 0 Express (11c + 19c - 3c)(-156 - 81 + 44 - 113) as uc + d and give u. -8262 Rearrange (4 - 2 - 1 + (-4 + 0 + 2)(-164 - 14 + 26)(4 + 1 - 6))(-n + 2n + 5 - 3) to l + an and give l. -606 Rearrange 208 - 13y - 101y2 + 98y*2 - 209 - 5y to ry2 + v + qy and give v. -1 Express -2i3 + 37 + 7184i*2 + i - 42 - 7199i*2 as m + fi*3 + xi*2 + gi and give g. 1 Rearrange -4932f + 2607f + 6f2 + 2440f + 7f2 - 2f*2 - 2 to the form pf + zf2 + n and give n. -2 Rearrange 307b*2 - 233b + 468b + 9 - 235b - 4 to vb + pb*2 + c and give p. 307 Rearrange (-3356 - 14429 + 6268 - 25340)(2h + 2 - 2) to r + ph and give p. -73714 Express (0 + 5 + 0)(b + b - 5b) + 389b - 982b - 1403b + (-3b + 4b - 2b)(0 + 4 - 2) as d + nb and give n. -2013 Express (31t2 + 4 - 4t + 37t2 - 67t*2)(561 + 431t2 - 561) as ot*2 + pt*3 + c + nt*4 + wt and give o. 1724 Rearran	{ "pile_set_name": "DM Mathematics" }
Are m and w unequal? False Let y be (-1)/(-4) - 1/(12/377). Let p = -32 - y. Let q(l) = -l*3 - 7l*2 + 8l. Let c be q(-8). Do p and c have the same value? False Let i be 29/((-870)/(-2115))20/(-6). Are -236 and i nonequal? True Let m = 138 + -412/3. Is -19 >= m? False Let w be (-14)/((-14)/5) - (201 + 2). Which is bigger: 0 or w? 0 Suppose 2a = 7a - 5i - 115, -5i - 71 = -3a. Let n be 1/(-2) - a/(-4). Suppose 3l = -2u, -l - nu - 17 = -2l. Is l greater than or equal to 8? False Let b be -6(-4)/(-18) - 11550/99. Which is smaller: b or -233/2? b Let n be (-16)/120 + -174/(-60). Which is smaller: 8/27 or n? 8/27 Let c = -0.6 + 19.6. Let t = c + -8. Let u = t + -17. Which is smaller: 1/4 or u? u Let l = 1/21781 - -413834/108905. Let p(x) = -x - 1. Let y be p(-6). Is l at least y? False Suppose -2j = -5j + 99. Let l = 1843 - 1811. Which is bigger: l or j? j Let k(o) = -o*3 - 5o*2 + 14o - 9. Let a(c) = 2c + 11. Let i be a(-9). Let d be k(i). Is d greater than -12? True Let f be (-3)/12 + 18/8. Suppose -3m + 7 = -fm. Suppose 5l = -m - 3. Which is smaller: l or 1? l Let w be (-1 - 0)15/1. Let j = 7 + w. Which is bigger: j or -51/7? -51/7 Let t be (-2 + -2)-2 - (6 - 2). Let q(a) = 12a - 6. Let x be q(t). Is 42 less than x? False Suppose -7 = b + 6b. Suppose -12c - 35 = -7c. Let a be (18/(-4))/(c/(-2)). Is a <= b? True Let y be (-7)/((-42)/(-5))(-429)/(-172). Let f = -17/8 - y. Are -1 and f equal? False Suppose -g - 9 = 13. Suppose -5t - 19z = -18z + 104, 2t + 5z = -37. Which is smaller: t or g? g Let p(i) = 12i2 - 2i + 1. Let k be p(1). Suppose -3d - 4q = -14, -2d - q + 10 = q. Suppose -dt = -kt + 45. Is t at least as big as 6? True Suppose -21 = -t + 4v, -t + 3v + 0v = -22. Let a = 25 - t. Let k = -39/98 - -30/49. Which is greater: k or a? k Let v = -1.7 - -2.03. Let w = v + -0.13. Let q = 105 - 105. Which is smaller: q or w? q Suppose -105 = -6l + l. Suppose 462 = 14o + 8o. Is o less than l? False Let p = -465/2 - -5811/25. Which is bigger: 0 or p? 0 Let g = 813 + -892. Is g greater than -81? True Let o = 170.4 + -171. Is 0.36 less than o? False Let m = -13 - -14. Let f be (-388)/(-4)(-3)/(-12). Let k = -1253/52 + f. Which is smaller: k or m? k Let p(v) = v3 + v2 + 2v + 2. Let m be p(-2). Let c be (14/8)/7m. Is c <= 0.1? True Let f = 5 + -14.9. Let y = f + 0.9. Let p = y - -10. Is p smaller than -2? False Let b be 0 + (-3)/18-1. Let v = -104/217 + 6/31. Are v and b nonequal? True Let y be (3/(-6))/(33/(-18)). Let j be (-8)/(-28) - (-2)/(-7). Is y <= j? False Let s = -34.5 - -7. Let k = s - -29. Which is greater: -2 or k? k Suppose 4r + 4r - 120 = 0. Suppose 0 = -5u + 5l - r, 2u + 4l + 2 - 8 = 0. Which is smaller: -7/5 or u? -7/5 Let a(w) = 2w + 18. Let b be a(6). Let y be b/(-4)10/(-3). Which is smaller: 26 or y? y Let x(k) = -2 - 6 - 2 - 2k + 1. Let a be x(-6). Suppose 2t + at + 10 = -5w, -12 = 4w. Is t <= 0? False Let x(i) = 4i - 6. Let o be x(4). Let v = 5372/15 - 1048/3. Are o and v nonequal? True Let g be ((-2)/(-6))/((-20)/36). Let r = 0.33 - 0.3. Is r greater than g? True Let g(a) = 9a*2 - 17a - 74. Let u be g(12). Which is smaller: u or 1019? u Let s(i) = 22i2 + 2i - 4. Let y be s(-2). Suppose 0 = -5a + 150 - y. Are a and 17 non-equal? True Let c = 833.1 - 828. Which is smaller: c or -0.01? -0.01 Let i = -33067/94350 + 9/3700. Let b = i + 1/68. Let o be (-1)/(-2)(-4)/2. Is b > o? True Let j(n) = n*3 - 10n*2 - 9n - 10. Let w be j(11). Let t be 144/(-324) + 390/27. Is t less than w? False Suppose 4 = -2m + 2w - 2, 12 = m + 2w. Let k(h) = -m + 7h + 1 - 11h + 0. Let r be k(-2). Is 7 <= r? True Let c = -1323 - -1322. Let z be 2/(26/3) + 0. Is z less than c? False Suppose 27i - 30i + 2x + 1026 = 0, 350 = i + 2x. Is 344 bigger than i? False Suppose 43t - 60t = 14671. Does -862 = t? False Let y(r) = -3r + 6. Let g be y(2). Is g at most as big as -3/26? False Let f = -0.316 + 0.107. Is f smaller than 0? True Let u = -7 + 78. Suppose -355 = -5b + 2y, 3y = b + y - u. Is b at least as big as 71? True Suppose c = 2n + 4c - 17, -4c + 23 = 3n. Let g be ((-6)/8)/((-12)/8). Which is greater: g or n? n Suppose -5n = 15, 118x + 2n = 122x + 418. Is x smaller than -104? True Let l(f) = f3 + 2f*2 + 3f + 4. Let s be l(-6). Let m be (1s)/2 - 2. Let p be 4/(-18) - 180/m. Is p at least as big as -0.1? True Let t = 364 - 365. Which is smaller: 0.1211 or t? t Suppose 0 = -0f + f - 3. Let u(y) = y*3 - 3y*2 - 6. Let v be u(f). Let c be (0 + 3)/((-2)/4). Does c = v? True Let k = 89/4 + -2217/100. Which is smaller: -1 or k? -1 Let u be -4715/(-10) + 0. Let c = 71 - u. Which is smaller: c or -12? -12 Let j = -1.198 + 0.168. Let s = j + 0.03. Let m = -0.4 - -1.4. Which is smaller: m or s? s Let z be (-13)/(-4 + (-26)/(-6)). Let d = z - -41. Which is smaller: d or -1? -1 Suppose l + 32 = 3l. Let k be ((-3)/(-6))/((-2)/l). Let r be k/22 - 69/(-77). Which is smaller: r or 1? r Let q = -3979/2 + 1905. Is q bigger than -84? False Let o be 26/8 - 3 - (-57)/12. Suppose 42 = -k - ok. Is -62/9 equal to k? False Let r be 64 + -60 + (3/(-1) - 0). Which is greater: -16 or r? r Let r = 115 - 2896/25. Which is smaller: r or -2? -2 Let n = 0.02 + -6.02. Let a = n + 5.89. Let c = a - 0.09. Is 0.2 less than or equal to c? False Let j(m) = -m*3 + 13m*2 + 32m - 21. Let n be j(15). Let w be ((-2)/n)/(2/6). Which is smaller: -2/21 or w? w Let f = -175 - -253. Let p = f + -78.04. Let b = -0.8 - -1. Which is smaller: b or p? p Let j = 1/339 - 701/7797. Let h = -8 - -4. Let t = -4.1 - h. Are t and j nonequal? True Let j(z) = -16z2 + 205z - 3. Let l be j(11). Is l bigger than 318? False Let v = -2206/5 + 437. Which is greater: v or -5? v Let d(n) = -5n - 2. Let y(g) = -2g - 1. Let p(w) = -3d(w) + 5y(w). Let i be p(4). Suppose 39 - i = -2q. Which is bigger: -8 or q? -8 Suppose -19 = -g - 23. Let i be 9/18 + (-138)/g + -2. Is i less than 32? False Suppose 0 = 4g + 2403 - 303. Is -525 != g? False Let v = 3 + 1. Let y be (-84)/(-48) - (-342)/(-168). Which is bigger: v or y? v Suppose -6 = 2y - 18. Let u be (5 - 17/3)/((-28)/y). Are 0 and u equal? False Let u be 4/3 - (-1218)/261. Which is bigger: u or 142/25? u Suppose x - 1 = -3d, -2 + 1 = 3d - x. Let w be (d/(-3))/(12). Suppose -3r + 3 + w = 0. Are r and 13 non-equal? True Let g = -1543 - -4628/3. Which is smaller: g or -498? -498 Let c = -0.15 - -1.25. Let v = 5 + -4. Let n = c - v. Which is smaller: -0.4 or n? -0.4 Let y be (-26)/(-30) - (264/45 - 6). Suppose 5 = -2j + 33. Let m be 32/j + (-2)/7. Which is smaller: m or y? y Suppose 10x - 2 = w + 12x, 3x = -3. Let i = -2 - 0. Which is smaller: i or w? i Let i = -0.17 + 55.17. Let l = i - 93. Is l greater than 1? False Let o(m) = m2 - 19m - 36. Let b be o(21). Let w be b/(-33) + (-369)/(-396). Is w at least as big as 0? True Let d be (-8)/(-20) - (2947/1230 + -2). Which is greater: d or -1? d Let i = -10.015 + 0.015. Let x = -43 - i. Which is smaller: x or 1? x Suppose 22f + 9f = 10f. Which is smaller: -4/9 or f? -4/9 Let b(j) = j3 - 3j*2 + 2j + 1. Let o be b(2). Suppose -5l = 2g + 57 - o, -28 = 3l + 4g. Let y be -3(-2 - (-4)/l). Are 3 and y non-equal? True Let j(d) = -114d + 56d + 59d + 11. Let k be j(-12). Is -1 less than or equal to k? True Let k(q) = q*2 + 25q + 56. Let h be k(-18). Let t be ((-30)/h)/((-4)/14). Is t equal to 17? False Let c be (-5)/(35/(-2)) - 50/(-70). Which is smaller: c or -22/85? -22/85 Suppose -k = -1 - 1. Suppose 0 = kc - 3 + 29. Does -11 = c? False Let y(o) = o3 + 2o*2 - 12. Let s be y(-5). Let a = s + 88. Which is smaller: 1/5 or a? 1/5 Let i = 43 - 36. Suppose iw + 15 = 4w, 4l = w + 9. Which is smaller: -3/19 or l? -3/19 Let v(d) = d*2 + 14d + 4. Let g be v(-10). Let r = 86 + g. Is r at least 50? True Let y be (-1)/(4/8) - -8. Let j(w) = w*3 - 7w*2 + 8w - 8. Let i be j(y). Suppose -3b = -5 - i. Is 7 at least as big as b? True Let b be (-112)/342 - 2/(-9). Which is greater: -14 or b? b Let g be (152/3)/(2/363). Suppose 4i + g = 20i. Suppose 0c = 4c - 76. Is c >= i? True Suppose 6b + 222 = 450. Is b not equal to 37? True Let i = -229/177 - 22/59. Suppose 3u + 2 + 1 = 0. Let n = u - 1.	{ "pile_set_name": "DM Mathematics" }
173/2820 and 127/24. 5640 What is the least common multiple of 140755 and 45? 1266795 Calculate the least common multiple of 29406 and 2262. 29406 Calculate the common denominator of 77/60 and 74/49875. 199500 What is the smallest common multiple of 90951 and 77958? 545706 Calculate the lowest common multiple of 739904 and 14. 5179328 Calculate the lowest common multiple of 18 and 902. 8118 Find the common denominator of 107/2039284 and -79/14. 14274988 What is the least common multiple of 22 and 48670? 535370 What is the lowest common multiple of 5826 and 52? 151476 What is the least common multiple of 10624 and 23904? 95616 Calculate the common denominator of -15/988 and -25/412. 101764 Calculate the common denominator of 21/17075972 and -109/6. 51227916 What is the lowest common multiple of 458 and 554? 126866 What is the common denominator of 31/160412 and 45/224? 1283296 Calculate the common denominator of 49/533140 and 17/6118. 3731980 Calculate the smallest common multiple of 271800 and 1800. 271800 Calculate the lowest common multiple of 1126 and 634. 356942 What is the smallest common multiple of 75591 and 36? 302364 What is the common denominator of 42/307075 and 49/1038? 1842450 What is the lowest common multiple of 10305 and 10305? 10305 What is the smallest common multiple of 476026 and 152? 1904104 What is the common denominator of 83/5922 and -29/90? 29610 Find the common denominator of 13/9408 and -33/224. 9408 Find the common denominator of 49/5 and -21/5981162. 29905810 What is the common denominator of -54/7 and 49/1070269? 7491883 Calculate the common denominator of 163/8358 and 113/25074. 25074 What is the common denominator of 50/1323 and -71/51? 22491 Calculate the smallest common multiple of 322000 and 10500. 966000 What is the lowest common multiple of 35521 and 6? 213126 What is the common denominator of 61/4071 and -97/384? 521088 Calculate the common denominator of -43/24 and 59/197392. 592176 Calculate the least common multiple of 201 and 1533. 102711 What is the lowest common multiple of 24 and 1240560? 1240560 Find the common denominator of 103/408102 and -127/36. 2448612 What is the common denominator of 49/13250 and -59/274275? 2742750 Calculate the common denominator of -83/12 and 23/95840. 287520 Find the common denominator of -127/55610 and -107/670. 55610 Calculate the smallest common multiple of 1095010 and 8. 4380040 What is the common denominator of -77/45 and -13/21165? 63495 Calculate the least common multiple of 1226475 and 1226475. 1226475 What is the lowest common multiple of 153322 and 1686542? 1686542 What is the lowest common multiple of 4 and 4329062? 8658124 What is the least common multiple of 2 and 140224? 140224 What is the common denominator of -59/6 and -53/662001? 1324002 Calculate the lowest common multiple of 1080 and 24984. 374760 What is the lowest common multiple of 100576 and 86208? 603456 Calculate the lowest common multiple of 191 and 274. 52334 Calculate the common denominator of 74/3 and 41/2130927. 2130927 Calculate the smallest common multiple of 322 and 4067. 187082 What is the common denominator of -40/26147 and 41/99834? 1098174 What is the least common multiple of 166 and 3735? 7470 Calculate the lowest common multiple of 2136 and 1168392. 1168392 Find the common denominator of -79/66 and 95/454. 14982 Calculate the smallest common multiple of 54 and 765. 4590 Calculate the smallest common multiple of 10524 and 177. 620916 Calculate the common denominator of 51/1811 and -43/3910. 7081010 What is the common denominator of 161/4080 and -57/16040? 1636080 What is the smallest common multiple of 8 and 444509? 3556072 Find the common denominator of 11/2977785 and -109/1985190. 5955570 What is the smallest common multiple of 133 and 5073? 35511 Calculate the lowest common multiple of 12175 and 175. 85225 What is the lowest common multiple of 7238 and 110? 36190 Find the common denominator of 131/3444 and 169/10332. 10332 What is the common denominator of 19/11835 and 16/75? 59175 Calculate the least common multiple of 153 and 701. 107253 What is the smallest common multiple of 143 and 6393? 914199 Calculate the least common multiple of 56295 and 118845. 1069605 Calculate the smallest common multiple of 21210 and 42420. 42420 What is the lowest common multiple of 10 and 145? 290 Calculate the lowest common multiple of 117 and 897. 2691 Calculate the common denominator of -79/2800 and -9/14000. 14000 What is the common denominator of 13/7668 and -107/103356? 7338276 What is the least common multiple of 549540 and 109908? 549540 Find the common denominator of -97/12 and 14/86673. 346692 What is the least common multiple of 2 and 15886? 15886 Calculate the common denominator of -61/3856 and 87/16. 3856 Calculate the least common multiple of 1395 and 4712. 212040 Find the common denominator of 101/96 and 93/11072. 33216 What is the common denominator of 103/112 and 29/5236? 20944 What is the lowest common multiple of 307578 and 30? 1537890 Find the common denominator of 73/446946 and -9/25. 11173650 Find the common denominator of 137/18 and 133/10110. 30330 Calculate the common denominator of -83/1408824 and -191/1761030. 7044120 Calculate the common denominator of -185/207018 and 35/372. 414036 What is the common denominator of 25/177 and -109/11952? 705168 Calculate the smallest common multiple of 6 and 1484554. 4453662 Calculate the common denominator of -77/18468 and -43/15147. 3453516 Find the common denominator of -111/14 and 79/81610. 571270 Find the common denominator of -38/339 and 38/18645. 18645 Find the common denominator of 42/101609 and 47/2924. 406436 Calculate the common denominator of 74/370659 and 40/9. 1111977 What is the smallest common multiple of 33138 and 18410? 165690 Calculate the common denominator of -40/39 and 93/21214. 827346 What is the lowest common multiple of 56321 and 10? 563210 What is the common denominator of -107/24 and 31/19016? 57048 What is the least common multiple of 676336 and 902? 7439696 Calculate the common denominator of -5/8163 and -2/579. 1575459 Find the common denominator of -76/21 and -25/90117. 630819 Find the common denominator of -125/24 and 21/419284. 2515704 Calculate the lowest common multiple of 6 and 1197569. 7185414 What is the lowest common multiple of 4896 and 7218? 1963296 Calculate the smallest common multiple of 872061 and 56262. 1744122 What is the common denominator of 139/9156 and 1/387604? 1162812 Calculate the smallest common multiple of 1185 and 3160. 9480 Find the common denominator of 19/225 and 43/621. 15525 What is the lowest common multiple of 35673 and 6204? 142692 Calculate the lowest common multiple of 8427 and 78. 219102 Calculate the smallest common multiple of 222 and 596070. 596070 What is the common denominator of 13/112 and 167/1596? 6384 What is the smallest common multiple of 9832 and 137648? 137648 What is the smallest common multiple of 24 and 250323? 2002584 Calculate the least common multiple of 126 and 11766. 247086 Calculate the common denominator of 141/560 and -7/174320. 1220240 Find the common denominator of 111/11044 and 5/4016. 44176 Calculate the least common multiple of 358937 and 10. 3589370 Calculate the common denominator of 59/141576 and -179/247758. 991032 What is the common denominator of -3/6532 and -77/13064? 13064 Calculate the common denominator of 11/2418 and -167/5460. 169260 Calculate the least common multiple of 949716 and 360. 9497160 What is the common denominator of 23/412 and -77/6417? 2643804 Find the common denominator of 29/21 and 163/1054320. 7380240 Calculate the common denominator of -169/295200 and -61/4510. 3247200 What is the smallest common multiple of 570 and 32205? 64410 Calculate the common denominator of 87/298 and -51/12836. 1912564 What is the common denominator of 15/1649 and 29/26656? 2585632 Calculate the common denominator of -13/60 and -23/30. 60 Calculate the smallest common multiple of 123010 and 196816. 984080 Calculate the smallest common multiple of 72 and 6732. 13464 Find the common denominator of 179/118680 and 32/473. 1305480 Calculate the lowest common multiple of 30 and 40095. 80190 What is the common denominator of -97/21580 and	{ "pile_set_name": "DM Mathematics" }
Calculate prob of picking 3 w when three letters picked without replacement from {i: 3, r: 12, w: 3}. 1/816 Calculate prob of picking 3 u and 1 s when four letters picked without replacement from gsugnuuguussu. 12/143 Four letters picked without replacement from {e: 5, o: 5, h: 8}. Give prob of picking 2 h and 2 e. 14/153 Calculate prob of picking 2 h, 1 e, and 1 s when four letters picked without replacement from {s: 4, e: 1, d: 1, h: 5}. 4/33 Calculate prob of picking 1 o and 1 t when two letters picked without replacement from {t: 2, g: 7, d: 1, o: 1, v: 7}. 2/153 Two letters picked without replacement from jzttz. Give prob of picking 1 z and 1 j. 1/5 Four letters picked without replacement from {i: 3, x: 5}. Give prob of picking 3 x and 1 i. 3/7 What is prob of picking 1 f and 2 z when three letters picked without replacement from {f: 4, z: 3, t: 4}? 4/55 Calculate prob of picking 1 d, 1 b, and 2 j when four letters picked without replacement from {b: 4, e: 1, k: 2, d: 1, j: 1}. 0 Two letters picked without replacement from {i: 3, a: 1}. Give prob of picking 1 a and 1 i. 1/2 Two letters picked without replacement from {n: 2, e: 5, f: 1, k: 1, i: 2, o: 4}. What is prob of picking 1 e and 1 o? 4/21 Four letters picked without replacement from {h: 2, s: 3}. What is prob of picking 2 s and 2 h? 3/5 Calculate prob of picking 1 v and 2 p when three letters picked without replacement from vvvvpzvpzppv. 9/55 Calculate prob of picking 3 r when three letters picked without replacement from rrrue. 1/10 Calculate prob of picking 1 h, 2 k, and 1 r when four letters picked without replacement from gkakrgrkbagha. 6/715 Three letters picked without replacement from {z: 4, w: 5, t: 1}. What is prob of picking 1 w, 1 t, and 1 z? 1/6 Calculate prob of picking 1 y and 2 v when three letters picked without replacement from yvvvyvj. 12/35 What is prob of picking 1 v and 2 w when three letters picked without replacement from vrcvqlvqrwvlvcvvv? 0 Three letters picked without replacement from {p: 3, i: 1, l: 1}. What is prob of picking 2 p and 1 l? 3/10 Two letters picked without replacement from yyyz. What is prob of picking 2 y? 1/2 What is prob of picking 3 v and 1 u when four letters picked without replacement from {p: 4, u: 2, c: 1, v: 6}? 8/143 What is prob of picking 1 w and 1 i when two letters picked without replacement from hhiwwwwwwiwzw? 8/39 What is prob of picking 1 j, 1 x, 1 b, and 1 k when four letters picked without replacement from xqbbkbjpppkj? 4/165 What is prob of picking 2 m when two letters picked without replacement from zmeezemmm? 1/6 Calculate prob of picking 1 p and 1 l when two letters picked without replacement from pxxxxxpxpxxxxpxlxxxp. 1/38 What is prob of picking 1 r and 1 w when two letters picked without replacement from {w: 7, r: 3}? 7/15 What is prob of picking 2 a when two letters picked without replacement from {z: 3, a: 5}? 5/14 Four letters picked without replacement from {i: 1, d: 3, m: 4}. Give prob of picking 2 m and 2 d. 9/35 What is prob of picking 4 n when four letters picked without replacement from eeeeeeeneeneennenne? 5/1292 Three letters picked without replacement from ydddayadddyysydd. What is prob of picking 3 y? 1/56 Two letters picked without replacement from ttktmmtkmt. What is prob of picking 2 t? 2/9 Two letters picked without replacement from {l: 7, i: 2, a: 1, c: 4, b: 1}. What is prob of picking 1 a and 1 l? 1/15 What is prob of picking 1 l, 1 k, and 1 q when three letters picked without replacement from qqnnknnnnnqnnnkqqlql? 2/95 Four letters picked without replacement from {k: 6, v: 1, h: 3, d: 2, t: 4}. Give prob of picking 1 d and 3 k. 2/91 Calculate prob of picking 2 y when two letters picked without replacement from {o: 4, s: 4, i: 1, y: 6}. 1/7 What is prob of picking 1 h and 1 y when two letters picked without replacement from {h: 6, s: 1, y: 5, z: 4}? 1/4 Calculate prob of picking 1 b and 1 g when two letters picked without replacement from {o: 4, r: 1, b: 2, g: 3, t: 2, p: 8}. 3/95 What is prob of picking 4 p when four letters picked without replacement from {p: 4, n: 1, o: 2}? 1/35 What is prob of picking 1 w and 1 l when two letters picked without replacement from prrpwrrrlprrwrpmr? 1/68 Three letters picked without replacement from qqkqssq. What is prob of picking 3 q? 4/35 What is prob of picking 2 v, 1 g, and 1 r when four letters picked without replacement from {h: 1, v: 3, r: 3, g: 6}? 54/715 Three letters picked without replacement from ddddssddddd. Give prob of picking 2 d and 1 s. 24/55 Two letters picked without replacement from {a: 1, z: 2, t: 1, l: 1}. What is prob of picking 1 t and 1 z? 1/5 Two letters picked without replacement from {t: 1, v: 2, x: 3, l: 5, r: 3, u: 1}. What is prob of picking 1 t and 1 x? 1/35 What is prob of picking 4 c when four letters picked without replacement from kckjcackkc? 1/210 What is prob of picking 3 z and 1 j when four letters picked without replacement from {x: 10, j: 6, z: 4}? 8/1615 Three letters picked without replacement from {z: 5, q: 1, e: 3, w: 4}. What is prob of picking 1 q, 1 e, and 1 z? 15/286 Three letters picked without replacement from {l: 6, q: 12}. Give prob of picking 3 q. 55/204 Two letters picked without replacement from {d: 5, i: 3, b: 1}. Give prob of picking 1 d and 1 b. 5/36 Three letters picked without replacement from ccbccblblyclelcyuub. What is prob of picking 1 e and 2 b? 2/323 Two letters picked without replacement from {k: 1, x: 18}. Give prob of picking 1 x and 1 k. 2/19 Three letters picked without replacement from fafffffffaafaffa. What is prob of picking 2 a and 1 f? 11/56 What is prob of picking 1 a, 1 m, and 1 k when three letters picked without replacement from {a: 8, e: 1, d: 2, m: 2, s: 1, k: 1}? 16/455 Two letters picked without replacement from zyyzzyz. Give prob of picking 2 y. 1/7 Two letters picked without replacement from uuuuuucuccc. Give prob of picking 2 c. 6/55 Two letters picked without replacement from kkkkkkkkk. Give prob of picking 2 k. 1 Three letters picked without replacement from {r: 1, j: 1, h: 14}. What is prob of picking 1 j and 2 h? 13/80 What is prob of picking 1 y, 1 z, 1 a, and 1 e when four letters picked without replacement from {y: 5, k: 2, e: 3, z: 3, a: 2}? 6/91 Calculate prob of picking 3 g when three letters picked without replacement from {g: 4}. 1 Calculate prob of picking 1 o and 2 u when three letters picked without replacement from noondoononnnnooudo. 0 What is prob of picking 1 g and 2 w when three letters picked without replacement from {k: 1, h: 1, g: 1, s: 2, w: 5}? 1/12 Calculate prob of picking 2 e when two letters picked without replacement from mmebeebeeeumeeueb. 9/34 Calculate prob of picking 1 n and 1 v when two letters picked without replacement from nfaaafavxadfaandvv. 2/51 Four letters picked without replacement from mmdmdmmdmdmd. Give prob of picking 3 d and 1 m. 14/99 What is prob of picking 2 q and 1 f when three letters picked without replacement from qqqfqqqqqqqqqqq? 1/5 What is prob of picking 3 n when three letters picked without replacement from ngnngngnnnnnnnnggn? 143/408 What is prob of picking 1 g and 1 e when two letters picked without replacement from hephg? 1/10 Calculate prob of picking 1 h, 1 y, and 1 d when three letters picked without replacement from {j: 2, h: 1, z: 2, y: 1, d: 1}. 1/35 Calculate prob of picking 1 x and 1 q when two letters picked without replacement from {q: 9, x: 3}. 9/22 Three letters picked without replacement from {p: 2, y: 4, j: 3}. What is prob of picking 1 y, 1 p, and 1 j? 2/7 What is prob of picking 1 x and 1 y when two letters picked without replacement from {x: 1, p: 2, n: 9, d: 1, y: 2, h: 3}? 2/153 Two letters picked without replacement from {x: 4, a: 4, m: 9, t: 2}. Give prob of picking 2 m. 4/19 What is prob of picking 2 u when two letters picked without replacement from yuyyyu? 1/15 Calculate prob of picking 3 c and 1 d when four letters picked without replacement from {m: 8, c: 6, d: 3}. 3/119 Two letters picked without replacement from pcybdpp. What is prob of picking 1 d and 1 c? 1/21 Calculate prob of picking 1 h and 1 c when two letters picked without replacement from {w: 2, n: 1, c: 2, h: 1}. 2/15 C	{ "pile_set_name": "DM Mathematics" }
Calculate the remainder when 66 is divided by k/4 - (-102)/4. 16 Let v(b) = -b*2 + 7b - 6. Let a be v(6). Suppose 3j + 3z + 0z + 3 = a, j = 4z - 11. What is the remainder when 50 is divided by 12 + (-4 - -2 - j)? 11 Let l(c) = -c - 5. Let j be l(4). Let o = 19 - j. What is the remainder when 53 is divided by o? 25 Suppose -4 = 3n - 4n. Let a be (14 - n)(-3)/(-5). Suppose 4k = i - a - 7, 0 = 4i - k - 67. What is the remainder when i is divided by 9? 8 Let y = 66 - 70. Let k = 10 + y. Calculate the remainder when 22 is divided by k. 4 Let c be (306/(-30))/((-2)/10). Suppose 2a + c - 93 = 0. Suppose -3d + 15 = -21. Calculate the remainder when a is divided by d. 9 Calculate the remainder when 45 is divided by (-5 - -1)/(-12)69. 22 Let c be (-373)/3 + (1 - (-4)/(-6)). Calculate the remainder when (0 + c)((-4 - 3) + 6) is divided by 42. 40 Let k = -57 + 45. Calculate the remainder when (39/k)/((-4)/32) is divided by 7. 5 Let g = 42 - 15. Suppose -2d - t = -0d - 35, -4d - 4t + 80 = 0. What is the remainder when g is divided by d? 12 Suppose 3f = 8f. Suppose 0 = -0c + 2c - 1090. Suppose 3h - 285 = -5x, -5h - 3x + c - 70 = f. What is the remainder when h is divided by 24? 23 Let x(u) = 9u - 2u + 2u + u. Let i be x(4). What is the remainder when (1 - -44)16/i is divided by 4? 2 Suppose 2c + 4 + 10 = 0. Let k(r) = 2r2 + 3r + 7. Let p be k(c). Suppose 5j + 12 = x, 4j = 3x + j - p. Calculate the remainder when x is divided by 11. 10 Suppose -43v + 114 = -2423. Calculate the remainder when v is divided by 24. 11 What is the remainder when 297 is divided by (1 - -17)4/6? 9 Let p = -67 - -109. Suppose -z = -14 + 6. Let k = z + p. What is the remainder when k is divided by 13? 11 Suppose -20 = 5z, 3w + 119 = -2z + 450. Calculate the remainder when w is divided by 39. 35 Suppose -13o = o - 42. What is the remainder when 140 is divided by o? 2 Suppose -k - 4k = 3i - 70, 0 = 2k - 3i - 28. Let f(d) = -d2 - 34d + 138. What is the remainder when f(0) is divided by k? 12 Suppose -5q = 0, g + 2q - 1 = 3. Suppose -gr - 103 + 7 = 0. What is the remainder when 93 is divided by (-594)/r - 9/12? 21 Let b = 393 + -123. Suppose -3g = 5a - b, 2a - g = 15 + 82. What is the remainder when 101 is divided by a? 50 Suppose 2l - 56 = 2r, -9r = 5l - 5r - 158. What is the remainder when l is divided by 4? 2 Suppose 2l + o - 66 = 0, -27l - 121 = -30l + 4o. What is the remainder when l is divided by 14? 7 Suppose -2j + 47 = 3g, 0 = 5j - g + 3g - 134. Let l = -78 - -159. Calculate the remainder when l is divided by j. 25 What is the remainder when 48 is divided by (3 + 0)-2 + 16? 8 Suppose 0 = -96u + 18u - 248u + 1630. Let h(v) = -v + 5. Calculate the remainder when u is divided by h(4). 0 Suppose 12n - 25n = -962. Calculate the remainder when n is divided by 25. 24 Suppose 342 = 2j + 4j. Let q be (-1)/2 + j/(-6). Let c = -5 - q. Calculate the remainder when 19 is divided by c. 4 Calculate the remainder when -1(1 - -1) + 33 is divided by 16. 15 Calculate the remainder when 148 is divided by (7 + 18 - 4) + -4. 12 Let l(z) = 2z2 - 48z + 15. Calculate the remainder when 319 is divided by l(25). 59 Suppose 0 = 3y + 2b + 13, -5 = y + b - 0b. Let h(z) = 21z*2 + z. What is the remainder when h(y) is divided by 47? 45 Let u(n) = -97n - 1. What is the remainder when u(-1) is divided by 48? 0 Let m(t) = -t3 + t + 26. Let k(c) = -c2 + 13c + 7. What is the remainder when m(0) is divided by k(13)? 5 Let t(v) = -6v*3 - 2v*2 + 4v + 3. Let n be t(-2). Suppose -112 = -7x - n. Calculate the remainder when x is divided by 7. 4 Suppose 9a - 3a = 6. Let g(u) = 6u*2 - u + 1. Suppose -c - 3w + 24 = 0, 4c + 0c - 80 = 4w. What is the remainder when c is divided by g(a)? 3 Suppose 2i + 10u - 94 = 12u, i - 46 = 2u. Calculate the remainder when 225 is divided by i. 33 Let n(s) = -s3 - 13s*2 + 7s - 18. Let t be n(-14). Let u = -67 + t. Let g(d) = d*2 + d + 23. What is the remainder when g(0) is divided by u? 10 Suppose -123 = -2m + m - 3r, 0 = r - 2. What is the remainder when m is divided by 52? 13 Calculate the remainder when 37 is divided by (1 + 33/(-6))48/(-18). 1 Suppose 3p + 3l = 18, 0p - 3p + 11 = -4l. Suppose 0 = pi - 10i + 90. Let x(s) = 6s*2 + 2s. What is the remainder when x(-4) is divided by i? 16 Let l = 135 - 20. Suppose 34 = c - 0k - 3k, 0 = 3c + 4k - l. What is the remainder when 145 is divided by c? 34 Let k(l) = 16l - 22. Let w be (0 + 30/(-9))3/(-2). Calculate the remainder when k(w) is divided by 20. 18 Let b(o) = o*3 - 58o*2 + 114o - 74. What is the remainder when b(56) is divided by 18? 2 Let i = 1 - 5. Let t = i - -42. Suppose 1 = 2n + 451c - 454c, -4n - 2c + 42 = 0. What is the remainder when t is divided by n? 6 Suppose 120 = 4n - 4s, 4n - 5s = 9n - 160. What is the remainder when 48 is divided by n? 17 Suppose 0 = -20j - 52 + 192. What is the remainder when (1 - 0)/((-1)/(-18)) is divided by j? 4 Let d = -31 + 34. Suppose 2y + 182 = 2j, -dy = 2y + 20. What is the remainder when j is divided by 22? 21 Suppose 6 = 2f + 8. Let q(o) = 75o2 - 1. Calculate the remainder when q(f) is divided by 15. 14 Let a = -359 + 363. Suppose 4u = 4w + 28, -2u + 39 = -0w + 3w. Calculate the remainder when u is divided by a. 0 Suppose -19 = -4s + 5. Suppose 0 = -sb + 82 + 38. What is the remainder when 137 is divided by b? 17 What is the remainder when 84 is divided by 1(-4 + (-270)/(-9))? 6 Let v be (-2)/6 - (-77)/(-3). Let s = -13 - v. Suppose 5o - 4o - c = 6, o = -3c + 14. What is the remainder when s is divided by o? 5 Suppose 5g - 2m - 48 = 0, 40 = 4g - 2m + 2. Suppose -3h = -l - l + 84, -3l + h = -133. Let p = -16 + l. Calculate the remainder when p is divided by g. 9 Let k = 46 - 31. Suppose -3s = 4p, -3s - 4p + k = -5p. Suppose 24 = -4m + 80. Calculate the remainder when m is divided by s. 2 Suppose 0 = -3k - 3g + 123, 4g = 4k + 5g - 176. What is the remainder when 176 is divided by k? 41 Suppose 78 = 5a - x - 15, -2a - 3x = -44. Let h = -4413 - -4417. Calculate the remainder when a is divided by h. 3 Let o(d) = -13d + 3. Suppose -2 = -s + 3p, 6 = s + 2p - 6. Suppose -10w + sw - 10 = 0. Calculate the remainder when o(w) is divided by 23. 22 Suppose 3x = 5m + 14 - 0, -38 = -5x + m. Let g = x - 4. Let h(p) = 3p + 11. What is the remainder when h(-2) is divided by g? 1 Let k(b) = -2b - 40. What is the remainder when 214 is divided by k(-38)? 34 Let f(p) = 8p - 10. Let h be f(-8). Let r = h + 137. Suppose 2n + 145 = 5b, -4n + r = 5b - 52. Calculate the remainder when b is divided by 7. 6 Let j = 9 + -15. Let n be 22/6 + j/(-18). Suppose 0c + 4c = -nd + 44, c - 5d = -7. Calculate the remainder when 21 is divided by c. 5 Let w(y) = 13y + 2. Let k be w(-2). Let z be (-90)/k + 1/4. Suppose 2j = -4x + 64, 66 = 3j - 0j - zx. What is the remainder when 51 is divided by j? 25 Let j(k) = k3 - 8k*2 - 22k + 21. Let r be j(10). What is the remainder when 1 + -1 + r - -124 is divided by 21? 20 Let y be (-6 + 14)/(1 + (1 - 0)). Suppose -15 = -3q + 2q + 3c, 2c = -4q + y. Calculate the remainder when 5 is divided by q. 2 Suppose 0 = 3d - 3s - 18, -13 = -3d + 4s + 2. Suppose -y + d = 2. Calculate the remainder when 18 is divided by y. 4 Let t(h) = -h2 - 11h + 14. Let j be t(-11). Suppose u - j = -5. What is the remainder when 23 is divided by (-24)/u(0 - 3)? 7 Suppose -22226 - 44023 = -17c. Calculate the remainder when c is divided by 39. 36 Let k(p) = p*3 + 6p*2 - 4p + 44. What is the remainder when 524 is divided by k(0)? 40 Suppose -2k - 2w - 98 = -3k, 3k - w = 274. Let v = 22 - 16. What is the remainder when (k/(-3))/(0 - 2) is divided by v? 3 Suppose -276 - 126 = -6j. Calculate the remainder when 465 is divided by j. 63 Suppose -2i = 2i - 52. Suppose 5k = m - 6 - i, k = m - 7. Calculate the remainder when 5 is divided by m. 1 Let l be 3/(-6) + 43/2. Let t be (1 + l)/(4/8). Let q = 63 - t. Calculate the remainder when 35 is divided by q. 16 Suppose -j + 463 = 4j + s, -4j + 377 = 3s. Calculate the remainder when j is divided by (-6)/(-4)(-2232)/(-108). 30 Let p(x) =	{ "pile_set_name": "DM Mathematics" }
q = -3732 - -3733.9. Let m = q + z. Round m to 4 dps. -0.0003 Let l = 13380.6 - 13380.361231. What is l rounded to three decimal places? 0.239 Let l(o) = 4o2 - 20o + 20. Let n be l(1). Let t be (2 - (-35)/(-20)) + (-91400001)/n. What is t rounded to the nearest one million? -23000000 Let b = -990 + 1092.3. Let x = b - 190.14. Let d = x - -86. What is d rounded to one decimal place? -1.8 Let r = 5.4 + -5.4597. Let f = r + 302.0597. Let c = -302.0000161 + f. What is c rounded to six dps? -0.000016 Let j = 694 - 326. Let m = -1666846 - -1667213.9807. Let a = m - j. Round a to 3 decimal places. -0.019 Let q = -1.666 + 0.81. Let t = -0.8560738 - q. Round t to 6 dps. -0.000074 Let k be -151933/1468420/6. Let v = k + 29570665. Round v to the nearest 1000000. -13000000 Let z = 221380 - 221460.0116. Let j = z - -80. Round j to two dps. -0.01 Let o = 117 - 124. Let t(v) = 53v3 + 8v*2 - 15v - 18. Let k be t(o). Round k to the nearest 1000. -18000 Suppose 3z + h = -103108945, -10z - 137478587 = -6z - 5h. Let l = z + 18639648. Round l to the nearest 1000000. -16000000 Let j = 0.05008 - 0.042392. Round j to 3 dps. 0.008 Let j = -2002.4511 + 2366.4510848. Let r = j - 364. Round r to five decimal places. -0.00002 Let c = -73.28 + 73.28014107. Round c to 5 dps. 0.00014 Let x = 0.1058 - 0.3415. What is x rounded to 1 dp? -0.2 Let o = 0.4219 + -0.4230389. What is o rounded to 5 dps? -0.00114 Suppose 0 = 2w - k - 33219994, 6797234 = w - 4k - 9812742. Round w to the nearest 1000000. 17000000 Suppose 0 = -5h + o + 141907 + 60709, -4h + 162089 = 3o. What is h rounded to the nearest one hundred? 40500 Let z(y) = -595y*2 - 22y - 68. Let t = 717 + -721. Let g be z(t). What is g rounded to the nearest 1000? -10000 Let v = 2566.9 - 2568.9241. Round v to one dp. -2 Let z = 339.28848568 + 3251565.75931432. Let o = z + -3251518. Let i = o - 387. Round i to three decimal places. 0.048 Let v = -2620.0006512 + 2620. What is v rounded to 5 decimal places? -0.00065 Let m = 826.359 - 826. Let j = m + -11.819. Round j to zero decimal places. -11 Let n = 31369.3 - 33605. Round n to the nearest one thousand. -2000 Let p = -201508.000095531 + 201508. What is p rounded to 5 dps? -0.0001 Let j = -2110.9 - -2110.8990443. Round j to 5 dps. -0.00096 Let n = 14.2 - 103.2. Let h = 70.2 + n. Let f = -26 - h. Round f to 0 decimal places. -7 Let k = -263086 + -327844. What is k rounded to the nearest 10000? -590000 Let v = 39.9 + -7.9. Let q = -1.619 - 30.241. Let k = q + v. Round k to one dp. 0.1 Let l = -0.61 - 21.79. Let v = -40908.197 + 40885. Let u = v - l. Round u to 1 dp. -0.8 Let l = -102.9 - -102.900003918. Round l to 7 decimal places. 0.0000039 Let o = 812 - 1305. Let u = 493.0289 + o. Round u to two dps. 0.03 Let q = -0.0523 + 32.0023. Let s = 0.95 - q. Let l = -31.0123 - s. Round l to two dps. -0.01 Let r = -294.21 + 5.21. Let l = r + 292.97. What is l rounded to 1 dp? 4 Let j = 251621 + -70521. Round j to the nearest 10000. 180000 Let a = 37.8168 + -37.7. Round a to 1 dp. 0.1 Let j = -22.7623427 + -35.2376538. Let i = j - -58. What is i rounded to six dps? 0.000004 Let p be -1093 - (-1 - -9)/(-4). What is p rounded to the nearest one hundred? -1100 Let g = -23730.999883295 + 23731. Round g to 5 dps. 0.00012 Let b(i) = -22i + 70. Let u be b(3). Suppose -ux - 4s = -568012, x + 2s - 145744 = -3738. What is x rounded to the nearest one million? 0 Let a = 0.79 + -38.79. Let y = -6271.27 - -6310. Let u = y + a. What is u rounded to 1 decimal place? 0.7 Suppose -3z - 912112 = 704o - 702o, 456046 = -o + z. Round o to the nearest 1000. -456000 Let f = 6567 + -6905.7. Let m = 403 + f. What is m rounded to the nearest ten? 60 Let y = 364 - 356. Suppose -yz + 15068751 = -13251249. Round z to the nearest one hundred thousand. 3500000 Let v = -6492.71 - -6319. Round v to zero dps. -174 Let s = -2107 - -2107.000001793. Round s to six dps. 0.000002 Suppose -2z + 128 = 3y - 217, -3z = y - 115. Suppose yv - 118v + 1752 = 0. What is v rounded to the nearest 100? 600 Let w = 72620 + -82854.2. Round w to the nearest one hundred. -10200 Let w = 72.49 - -0.51. Let s = 379821.0074 + -379894. Let d = w + s. Round d to three decimal places. 0.007 Let l = -108.6 - 20.4. Let q = 113.4 + l. Let b = q - -21.42. Round b to one decimal place. 5.8 Let g = -8738.9985448 + 8739. Round g to 5 dps. 0.00146 Let n = -1436132 + -429692. Let u = 1865823.6700026 + n. Let v = u + 0.33. What is v rounded to 6 dps? 0.000003 Suppose 2m + 0m - 28008006 = 0. Suppose -5i - 3k + 8k = 17505015, -4i + k = m. Round i to the nearest 100000. -3500000 Let v be -12(-125)/(-5)141078/9. Round v to the nearest one hundred thousand. -4700000 Let x = -295.7 + 295.704071. What is x rounded to three dps? 0.004 Suppose -2i - 18 = -4q, 0 = -3q + q + 5i + 5. Let w(s) = -7s*3 + 3s*2 - s - 6. Let a be w(q). Round a to the nearest ten. -810 Let n = -73 - -76. Suppose -2z - v - 3v = 2, 3z = nv + 42. Suppose -13p - 8 = -zp. Round p to one decimal place. -2 Let m(s) = -54 + 29 + 28 + 3s - s*2 + 0s2. Let j be m(6). Let x(f) = -f3 - 30f2 - 15. Let k be x(j). What is k rounded to the nearest one thousand? -3000 Let m = -623.337 - -618.8. Let i = m + 4.55633. Round i to 3 decimal places. 0.019 Suppose 4w = m - 164940, 6m = 4w + 4m + 164936. Let n = -20480 - w. Let j = n + -14556. What is j rounded to the nearest one thousand? 6000 Let h be (-14)/(-7) + -1215888 + 7. Let u = -8015879 - h. What is u rounded to the nearest 1000000? -7000000 Let l = -22 - -16.02. Let n = l + -0.42. Let c = n - -6.908. Round c to 1 dp. 0.5 Suppose -4u + 9s = 14s - 161976, 162004 = 4u - 2s. Let a be (1 + u)/23772/(-123). What is a rounded to the nearest 100000? -600000 Let t be (-4 + (-3 - -27))/((-2)/(-2)). Suppose a - 56 = -t. Let s be (4125000/a)/(2/480). Round s to the nearest one million. 28000000 Let x = -8.04 - -797.04. Let k = x + -874.4. Round k to the nearest ten. -90 Let c = 538.0258 - 0.0258. Let m = c - 542.27. Let w = m + 68.07. What is w rounded to the nearest 10? 60 Let n be 8/(-3) + (-22)/(-33). Let k(t) = -3t - 6. Let c be k(n). Suppose c = 3p - 4v + 77980, -p + 4v = -3p - 52020. Round p to the nearest 10000. -30000 Let l = -7062.5587 - -7062. Round l to one dp. -0.6 Let z = -6548.81 + 6568. What is z rounded to the nearest ten? 20 Let q = 286 - 276. Let r be ((-16)/10)/(q/270625). What is r rounded to the nearest ten thousand? -40000 Let r = 87583526 + -87583524.41749622. Let d = 1.3925034 - r. Let b = d + 0.19. Round b to 7 decimal places. -0.0000004 Let n(w) = 6w3 + 79w*2 - 95w - 54. Let h be n(-28). Round h to the nearest one hundred thousand. -100000 Let v(p) = -77237p2 + 81p - 2. Let b be v(-1). What is b rounded to the nearest 1000? -77000 Let q = -16434 + 16159.92. Round q to the nearest 10. -270 Let h = 89.019 + -0.019. Let q = h - 92. Let w = q - -1.3. What is w rounded to 1 decimal place? -1.7 Suppose 758t - 561t - 45851750 = 0. Round t to the nearest 10000. 230000 Let t be 2 - (-12)/((-6)/(-2)). Suppose -tw = -w - u + 18, -3 = 5w + 4u. Let h(c) = 111c*2 + 1. Let n be h(w). What is n rounded to the nearest 100? 1000 Let c = -695 + 3450. Let o = -2691.54 + c. Let r = o + -65. What is r rounded to 1 decimal place? -1.5 Let d = -11.2863 + 0.1043. Let q = d + 11. What is q rounded to two decimal places? -0.18 Let y be 1-35715 + 23 + -11. Round y to the nearest 1000. -36000 Let d = -0.04344 + -0.06. Let b = -0.1947 + 0.0937. Let x = b - d. Round x to 4 decimal places. 0.0024 Let a = 0.03053 - 0.030591064. Round a to five decimal places. -0.00006 Let n = 12286 + -12285.9984844. Round n to five decimal places. 0.00152 Let z = 61.4699987716 - 61.47. Round z to seven decimal places. -0.0000012 Let b = 934.1 + -934.0978094. What is b rounded to 4 dps? 0.0022 Let c = -134 + 8. Let i = 79 + c. Let d = i + 44.68. What is d rounded to zero dps? -2 Let v = 85359 + -613159. Let g = v + 527802.700116. Let j = g + -2.7. What is j rounded to five dps? 0.00012 Let q = 2.2287 + -0.0538. Round q to two dps. 2.17 Let u = 558.028972 + -558. Round u to 2 dps. 0.03 Let a = -32 - -39. Let q be a + -4 + (1 - 0). Suppose q*t = -299 - 257. What is t rounded to the nearest 1	{ "pile_set_name": "DM Mathematics" }
t q = 59 - 22. Let p = 63 - 41. Let k = p + -9. Calculate the remainder when q is divided by k. 11 Suppose x - 16 = 7. Suppose 5b + 10 = 0, 169 = 5d + 5b - 51. Let a = d + -2. What is the remainder when a is divided by x? 21 Suppose 3f - 20 = -2f. Let r = f + -10. Let x(q) = -3q - 5. What is the remainder when 38 is divided by x(r)? 12 What is the remainder when 82 is divided by 1 + -5 - ((1 - -2) + -21)? 12 Suppose 3a + 5t - 56 = 0, 118 = -2a + 7a - 4t. Calculate the remainder when 64 is divided by a. 20 Suppose 4f - 3f - 2 = 5o, -3o + 4 = 2f. Let v = f - -7. Calculate the remainder when 26 is divided by v. 8 Let z be -15 + (0/(-4) - 3). Let j = z - -28. What is the remainder when 27 is divided by j? 7 Suppose 3n - 26 = -4c, -78 = -5n - 3c + 5c. Calculate the remainder when n is divided by 5. 4 Let k = 104 + -78. What is the remainder when k is divided by 15? 11 Suppose 2n - 33 = 57. Calculate the remainder when n is divided by 16. 13 Suppose -23 - 11 = -2s. Let v(c) = 7c + 5. Let a = 1 - -3. Calculate the remainder when v(a) is divided by s. 16 Let g(w) = -168w - 3. What is the remainder when g(-1) is divided by 21? 18 Suppose -3h - 5d - 10 = -110, -d = 4h - 122. Calculate the remainder when h is divided by 12. 6 Let n(r) = -r*2 - 15r - 2. Calculate the remainder when 35 is divided by n(-14). 11 Let p be 0/(6/2) + -28. Let b be 1/3 + p/(-6). Suppose z - bz = 0, 3z = -4g + 68. Calculate the remainder when 49 is divided by g. 15 Suppose 0 = -6y + 21 + 21. Let t = 6 + -2. What is the remainder when y is divided by (-2)/t + (-11)/(-2)? 2 Let j be (-4)/14 - (-60)/14. Let i = j + -10. Let o = 9 - i. Calculate the remainder when o is divided by 8. 7 Let n(p) = -2 - 2p + 2 + 6. What is the remainder when 30 is divided by n(-5)? 14 What is the remainder when 28/3 - (-5 - 64/(-12)) is divided by 5? 4 Let j(r) = r2 - 6r + 2 - 7 + r + 1. What is the remainder when 3 is divided by j(6)? 1 Suppose 0 = l - 2l - o + 17, 0 = -2o + 10. Calculate the remainder when 81 is divided by l. 9 Suppose 3 = -3i, -4j = -7j - i + 11. Calculate the remainder when 33 is divided by 17(-2 + (j - 1)). 16 Suppose 16 = 5z + 1. Suppose 5w + 5m - 10 = 0, -zw + 0 + 34 = -4m. What is the remainder when 16 is divided by w? 4 Let h = -2 - -35. Suppose -3v + 14 = m, -3m + 2m = 5v - 20. Calculate the remainder when h is divided by 25/v - (-4)/6. 6 Suppose 0 = -t - t + 6. Let a = t + 1. Calculate the remainder when 14 is divided by a. 2 What is the remainder when (-4)/((-12)/9) - -10 is divided by 9? 4 Let s(v) = v2 - v - 6. Let i be s(5). Suppose i = 5p - 6. What is the remainder when 7 is divided by p? 3 Let l be 14/6 - 1/3. Let p be 0/(-7) + (-2)/(-2). What is the remainder when p/l(64 - 0) is divided by 17? 15 Let i(u) = 11u*2 + u + 1. Let b be (-118)/(-6) - (-1)/3. Suppose 4m - b = 3m. Calculate the remainder when m is divided by i(-1). 9 Let b(p) = -3p + 5. Let l(j) = 2j + 1. Let t be l(2). Let r be b(t). What is the remainder when 5 is divided by (-22)/r - 1/5? 1 Suppose -l - 3s + 11 + 0 = 0, -4s = -3l + 59. Calculate the remainder when 31 + 0 + 2 + -2 is divided by l. 14 Suppose 2l + 3m + 7 - 32 = 0, 3l + 3m - 42 = 0. What is the remainder when 117 is divided by l? 15 Suppose 0 = 4c + 20, 6c - 3c = -i - 4. What is the remainder when 32 is divided by i? 10 Calculate the remainder when 3(5 - 4) + 46/1 is divided by 10. 9 Suppose 2a = -h + 4, 0h - 10 = -h - 5a. Suppose -3o - s = 2s + 3, -4o - 2s + 2 = h. What is the remainder when 4 is divided by 3 + (-2 + 2)/o? 1 Suppose 0 = -4n - 2y + 66, 5n + 7 = 4y + 96. What is the remainder when 30 is divided by n? 13 Suppose 4h - 2c - 3 = 15, 5h - 25 = 3c. Calculate the remainder when 7 is divided by h. 1 Suppose a - 40 = -2w + 5, w + 189 = 4a. Let t = -30 + 5. Let l = a + t. What is the remainder when l is divided by 12? 10 Let r = 9 - 8. Let i = 4 - r. Calculate the remainder when 4 is divided by i. 1 Let i = 43 - 13. Calculate the remainder when (-454)/(-10) + i/(-75) is divided by 23. 22 Let r = 123 - 88. What is the remainder when 4 is divided by (-3)/5 - (-126)/r? 1 Suppose 4c - 5 = -l, 3l - 9 + 2 = -4c. Suppose 3j - 25 = h, -j - 2h + c = -12. What is the remainder when j is divided by 6? 3 Let n = -23 + 24. Let i be (2 - (-10)/(-4))0. Suppose i = -2a + 2 + 4. Calculate the remainder when a is divided by n. 0 Suppose -10 = -4s + s + 2i, s + 3i = -15. Let b(y) = y + s - 2 + 4. Calculate the remainder when b(7) is divided by 5. 4 Let y = 9 + 12. Calculate the remainder when 41 is divided by y. 20 Let m = 27 - -26. What is the remainder when m is divided by 27? 26 Let h = 21 + -4. What is the remainder when h is divided by 7? 3 Let o(l) = -l2 - 2l + 1. Let m be o(-2). Let u = 1 + m. What is the remainder when 0 - -52 - (-3 + u) is divided by 18? 17 Let k(a) = 12a2 - 2a - 1. What is the remainder when (1/(-2))/(3/(-210)) is divided by k(-1)? 9 Calculate the remainder when (-2 - (-168)/(-4))/(0 - 2) is divided by 14. 8 Let j be (-3434)/(-12) + 2/(-12). Suppose 4m - w - 298 = 0, -3m + j = m + 5w. Calculate the remainder when m is divided by 19. 17 Suppose -4 = -2r - 2. Let q be -1 + 0/(-3) + -9. Let w = q + 11. Calculate the remainder when w is divided by r. 0 Suppose 14 = 5b - 1. Suppose -6g = -3g + b, 0 = 5j - 4g - 29. Calculate the remainder when 19 is divided by j. 4 Let o(f) = f3 - 5f*2 - 4f + 1. Let s be o(6). Let t = -1 + s. What is the remainder when (-69)/(-2)(-4)/(-6) is divided by t? 11 Suppose 2p - 3 = 3p. Let l = 3 + p. Suppose 3m = 5u + 2, 2u - 3m - 2m + 16 = l. What is the remainder when 4 is divided by u? 0 Let k(d) = d*2 + 4d + 21. Calculate the remainder when k(-6) is divided by 7. 5 Suppose 2a + 36 = -2q - 2q, a + 3q + 20 = 0. Let i = a + 26. What is the remainder when 21 is divided by i? 9 What is the remainder when 53 is divided by 11/((-11)/(-30)) - 2/1? 25 Let t be ((-2)/(-4))/(-1)-54. Let y(k) = -5k3 + k2 - k + 2. Let p be y(-2). Let g = p - t. Calculate the remainder when g is divided by 11. 10 Let t = 102 + -86. What is the remainder when 28 is divided by t? 12 Suppose 5f - f - 144 = 0. Calculate the remainder when 71 is divided by f. 35 Let m(x) = -2x + 37. What is the remainder when m(11) is divided by 8? 7 Let r = -22 - 0. Let a = r - -35. Calculate the remainder when a is divided by 5. 3 Suppose -g - 4g + 3m + 178 = 0, -26 = -g + 3m. What is the remainder when g is divided by 4? 2 Let h(a) = -a3 + 6a*2 - 4a - 1. Let x be h(5). What is the remainder when 0/x - (-1 + -37) is divided by (-568)/(-28) + (-6)/21? 18 Suppose 2n = -3g + 92, 2g + n - 53 = -2n. Calculate the remainder when g is divided by 2/3 + (-102)/(-9). 10 Let h(x) be the second derivative of x*5/20 + 7x*4/6 - 8x*3/3 + 3x*2 + 3x. Calculate the remainder when h(-15) is divided by 8. 5 Suppose 23s - 315 = 18s. Suppose -s = -3d + 2d. Calculate the remainder when d is divided by 16. 15 Suppose 4m + 4g - 164 = -g, 0 = -2g. Calculate the remainder when m is divided by -1 - -21 - (-2 - 0). 19 Suppose -2 = 2m, -5d + 102 + 519 = -m. What is the remainder when d is divided by 32? 28 Let i = 167 - 23. What is the remainder when i is divided by 29? 28 Let j(x) = 24x - 9. Calculate the remainder when j(3) is divided by 22. 19 Let f(t) = -t*3 - 7t*2 - 8t - 9. Let z be f(-6). Suppose 2l + 4d = 96 - 22, -zl + 99 = 3d. What is the remainder when l is divided by 10? 9 Let i be (4/5)/(12/840). Suppose 2w + y = 87, 0w + w - 2y - i = 0. Let o(g) = g2 + 16. Calculate the remainder when w is divided by o(0). 14 Suppose 0 = -2l - 4c + 14, -15 = 4l - 5c - 4. Let r(x) = 42x + 21x + 40x - 39x. Calculate the remainder when r(l) is divided by 22. 20 Let v be (4/(-3))/((-2)/6). Let q(g) = g3 - 3g - g + 5 + 2 - 2g2 - 2. Calculate the remainder when 62 is divided by q(v). 20 Suppose 5 = x - 19. What is the remainder when 42 is divided by x? 18 Suppose 23 = 2b - 23. What is the remainder when b is divided by 12? 11 Suppose 0 = -2a - 2j + 20, -2j - 37 - 3 = -4a. Suppose 9 = -6k + 9k. Suppose -4 = 2l - kl. Calculate the remainder when a is divided by l. 2 Suppose 4k = 7k -	{ "pile_set_name": "DM Mathematics" }
se u = 2w - 1. Sort -4, 5, w. -4, w, 5 Suppose -5k - 19 = 1. Let o = 4 + 2. Suppose -2c - 2 = -o. Sort k, c, 3 in ascending order. k, c, 3 Suppose u = -4 + 3. Suppose -4h - 16 - 19 = -5x, 5h = 2x - 14. Let k(v) = -v2 + 5v + 10. Let r be k(x). Sort r, 3, u in decreasing order. 3, u, r Let f = -11 + 7. Let p = -4.5 - f. Let q = 2 + 0. Put q, 5, p in decreasing order. 5, q, p Let i(a) = 3a - 18. Let d be i(12). Suppose -4z = 4w - 7z + 23, -2z - d = 4w. Sort w, 2, -3 in increasing order. w, -3, 2 Let h = -18.3 + 18. Put h, -0.4, -1, -1/4 in ascending order. -1, -0.4, h, -1/4 Suppose -4f + 23 - 7 = 0. Let a be 0 + (-4)/(-2) - -3. Suppose 3 = -al - 7. Sort l, -3, f in descending order. f, l, -3 Suppose -2u - 4 = -12. Let i be (3 - 1) + -4 + 5. Suppose io = -0o. Put -1, o, u in ascending order. -1, o, u Let i = -15 - -18. Sort 1, -3, i in increasing order. -3, 1, i Let o be (34/6)/((-11)/33). Let r = 18 + o. Let k(w) = w + 9. Let n be k(-5). Put -5, r, n in increasing order. -5, r, n Let z = 5 - 2. Suppose -12 = -9y + 24. Put y, -1, z in ascending order. -1, z, y Suppose 2m + 4b + 11 = 5b, 0 = -2m - 2b - 8. Let y be (8/(-10))/(1/m). Suppose -2u = 2 + y. Put 4, -0.1, u in ascending order. u, -0.1, 4 Let x = -2/29 - -84/377. Let l = 0.3 + -0.4. Let s = 0.3 + l. Sort s, x, 0.1 in ascending order. 0.1, x, s Let m = 2.2 - 5.9. Let q = -1.3 + m. Put 2, -4, q in decreasing order. 2, -4, q Let k = -0.131 + 4.131. Let m be 4/(-10) + -135 + -2. Let g = -137 - m. Put k, 2/19, g in descending order. k, g, 2/19 Let q = 11 - 10. Put 5, q, -0.6 in ascending order. -0.6, q, 5 Let u = -3131/13 - -241. Let q = 9 - 2. Let s = q - 3. Sort u, s, -2 in descending order. s, u, -2 Suppose -3b + 10 = -v - 3, -3b - 2v + 19 = 0. Suppose 2i - 5 = -3z, 3z - 2i + 7 = -i. Let f be -1 - (1 + z) - -2. Put -5, b, f in descending order. b, f, -5 Let o(j) = 8j + 1. Let q be o(-1). Suppose 0 = -3k - x - 2, -k - 24 = -4x - 6. Let m = k - q. Sort -5, 2, m in increasing order. -5, 2, m Let q(y) be the second derivative of -y5/20 - y4/12 - y3/6 - y2 - 3y. Let m be q(-2). Let c(j) = -j - 2. Let z be c(-5). Sort m, 5, z. z, m, 5 Let g = -65 + 74.3. Let t = 0.04 + -9.04. Let w = g + t. Put 0, -3, w in descending order. w, 0, -3 Let p = 20 + -17. Sort -12, 5, p in decreasing order. 5, p, -12 Suppose 2x = -3x + 5. Let o be -1 + (-6 - -2)x. Sort -4, o, 3 in decreasing order. 3, -4, o Let k be (-1 + (-3)/(-5))/(49/(-245)). Put -5, k, 0, -2 in increasing order. -5, -2, 0, k Let a be 108/(-20) - 4/(-10). Put 1/5, a, 0 in decreasing order. 1/5, 0, a Let b = -15 + 15.05. Sort -5, 0.5, b in increasing order. -5, b, 0.5 Let i(p) = p - 3. Let r be i(-2). Suppose 0 = u - 1, -3x + 7 = -0x + u. Sort r, x, 5. r, x, 5 Let g be (-21)/7 + 1 + -1. Sort 40, 1, -4, g in decreasing order. 40, 1, g, -4 Suppose -5 = 3i - 23. Put 5, -2, i in ascending order. -2, 5, i Let k(w) = -w3 - 6w*2 - w - 5. Let t be k(-6). Let h = -1.977 - 0.073. Let f = 0.05 + h. Sort -0.3, f, t in decreasing order. t, -0.3, f Let r = 919 - 5497/6. Let k = r - 7/3. Let p = -6 - -4. Put k, -4, p in descending order. k, p, -4 Let n(v) = v - 4. Let h be n(7). Suppose 10 = 3y - z - 4, -3z = 6. Suppose 0g = 2p + g - y, -9 = -3p - 3g. Put 5, p, h in decreasing order. 5, h, p Let o = -4.7 - -4.7. Put -0.1, -1/4, 2/19, o in decreasing order. 2/19, o, -0.1, -1/4 Let r(x) = x3 + 11x*2 + 9x - 14. Let i be r(-10). Let h(d) = -d*3 + 10d*2 + 11d - 1. Let p be h(11). Sort p, i, -2. i, -2, p Let i = 0.15 - -3.85. Let a = i + -4.2. Sort -0.4, 1/2, a. -0.4, a, 1/2 Let g = -5 - -12. Suppose 2 = -m, -4r = -gr + m + 11. Sort -1, r, 4 in decreasing order. 4, r, -1 Suppose -j + 1 = -54. Let c be (-11)/(-5) + (-11)/j. Sort -4/3, c, -0.2 in descending order. c, -0.2, -4/3 Let n = 56 + -57. Sort 2, n, -7 in decreasing order. 2, n, -7 Let z(k) = k*2 - 2k + 2. Let l be z(5). Let f = -7 + l. Suppose 5b - f = 2a, 5a + 25 = b - 2b. Sort -2, 0, a in decreasing order. 0, -2, a Suppose 63 + 113 = 4b. Let p = 1 + -5. Let j be b/(-120) + (-2)/p. Put j, -5, -0.5 in increasing order. -5, -0.5, j Let a = 2 + -3. Let y be (a(1 - 0))/1. Suppose p + 16 = 5p. Put p, -0.1, y in descending order. p, -0.1, y Suppose 4w + p = -4, 11 = -w + 4p - 7. Let a be 2 + -4 + (w - -2). Sort -4, -3, a in decreasing order. a, -3, -4 Let m = 163 - 166. Sort 3.5, 3, m. m, 3, 3.5 Let y be (8/5)/(2/5). Suppose yo = o - 21. Let p = -3 - -6. Sort -1, o, p in increasing order. o, -1, p Let n(b) = b*2 + 3b - 3. Let h be n(-4). Let y = -3 + 6. Suppose 5g = yg. Sort g, h, -4 in decreasing order. h, g, -4 Suppose 0 = 4k - 7 - 13. Let r = 15 + -11. Let m be (-2 + 5)/(-3 - -2). Sort r, k, m in increasing order. m, r, k Let t be (3 - -1)/20 + 4/(-20). Sort -5, 2, -18, t in increasing order. -18, -5, t, 2 Suppose -4 = 5q - 4f - 0, 5f = 5q + 5. Put q, -5, 4 in increasing order. -5, q, 4 Let q(g) = g3 + 24g*2 + g + 22. Let v be q(-24). Sort v, 1, 3 in decreasing order. 3, 1, v Suppose 0 = -4s - m + 2m - 11, 5 = -3s + 4m. Sort -5, -2/15, s in increasing order. -5, s, -2/15 Suppose -5a = 16 - 1. Put 4, 0, a in descending order. 4, 0, a Let n(f) = f*3 + 17f*2 - 4f - 11f2 - 5 - 2f*3. Let v be n(5). Suppose 6a - a = 20. Put a, v, -1 in decreasing order. a, v, -1 Let v be (8/(-574))/((-54)/21). Let s be 3279/(-861)(-2)/18. Let t = v + s. Sort 4/3, 2/5, t in decreasing order. 4/3, t, 2/5 Let y = -22 + 17. Let x = 3 + -2.6. Sort x, y, 2/11 in increasing order. y, 2/11, x Let w = 3 - 1. Let b = 4 - 4.4. Sort 3/10, w, b in ascending order. b, 3/10, w Suppose 0 = 55k - 63k + 24. Put k, 4, -3/5, -0.4 in decreasing order. 4, k, -0.4, -3/5 Let x be 14/(-8) + (-2)/8. Suppose 2k - 2r + 14 = 0, 3r - 15 - 14 = 5k. Put x, -3, k in decreasing order. x, -3, k Let a be ((-2)/(-4))/((-6)/(-12)). Sort a, -3, 12. -3, a, 12 Let d = 0 - 1. Let m(h) = -2h + 1. Let s be m(-1). Suppose 0 = sz + z - 20. Sort -2, d, z in descending order. z, d, -2 Suppose 0 = 3m + 3 - 18. Let r = -1.2 + 1.7. Let c = -1 + r. Sort 2/11, m, c. c, 2/11, m Let n(m) = m*3 + 0m*3 + 0m - 2m2 + 1 - 2m. Let t be n(3). Let w be (-3)/2190/57. Put t, -1, w in descending order. t, -1, w Let s = -16 - -19. Put s, 0.3, -4 in increasing order. -4, 0.3, s Let y be 2/(1 + (-3)/2). Suppose 0 = -i - 3i + 4f, -i + 5f = -20. Sort y, i, 5 in ascending order. i, y, 5 Let x(k) = 2 + k + 3 - 2k. Let c be x(7). Sort -3, c, -5. -5, -3, c Let j = 13 - 7. Let p(n) = -2n*3 + 11n*2 + 5n + 5. Let s be p(j). Put s, 4, -4 in descending order. 4, s, -4 Suppose -4s - 3 = -2s + c, 0 = -5s - 2c - 9. Suppose -3 + 11 = 2q. Put -5, s, q in decreasing order. q, s, -5 Let m = -0.066 - -7.066. Put -1, 1/5, m in increasing order. -1, 1/5, m Let k = 0.62 + -0.42. Sort 0.06, k, -3/4. -3/4, 0.06, k Let y(j) = -4j*3 - 2j*2 - j. Let g be y(-1). Let w be (-3 + (g - 0))/(-2). Sort w, -2, 3. -2, w, 3 Let f = 8 + -9. Let t = f + 0. Put t, -2, 2 in ascending order. -2, t, 2 Let m = -0.18 + -0.32. Sort -0.3, m, 1. m, -0.3, 1 Let o = -0.1 + -0.1. Let z = 0.2 + o. Let c = -485/2899 + 3/223. Put c, z, 2/13 in descending order. 2/13, z, c Let g = 3 - -1. Suppose -3q - w = -23, 4q + 2w - 28 = -2w. Let r = q + -13. Put g, -3, r in descending order. g, -3, r Suppose 0 = -3o + 3 - 12. Suppose 5a + 40 = -4g, -3a + 2 = -g + 9. Let n be (1-2 - 0) + 2. Put g, o, n in ascending order. g, o, n Suppose 0 = 5s - 17 + 2. Put 1, 20, s in descending order. 20, s, 1 Let c = -5 - -16. Let y = -8 + c. Suppose d + 20 = -yd. Put d, 3, 0 in descending order. 3, 0, d Let j = -7 - -7. Suppose j = 3k - 6k. Sort 3, 4, k. k, 3, 4 Let q = -2 + 1. Let v = q + 3. Suppose -5 = -2x - 13. Sort x, 3, v in ascending order. x, v, 3 Let t be -3 - (-40)/(-35) - 2/(-14). Put 21, -2, t in decreasing order. 21, -2, t Suppose f - 2 = 3a, -8 = -0f - 4f. Suppose 0 = -ap - 4p + 12, -2b - 4p = 4. Let q be b/(-6)(-12)/(-8). Put -2, 1, q in decreasing order. q, 1, -2 Suppose 0 = 2u - 7u + 15. Put 0, u, -0.1 in descending order. u, 0, -0.1 Suppose 5k + 9 = 2k. Sort -7, k, 5 in increasing order. -7, k, 5 Suppose -a + 28 = -5r, 0a - 3a + 19 = -2r. Let l be (-14)/6 + 1/3. Suppose -484k + 477*k	{ "pile_set_name": "DM Mathematics" }
the nearest one hundred? -20400 Let u = -3765 - -3765.0000006492. Round u to seven decimal places. 0.0000006 Let o(r) = -347r3 + 18r*2 + 12r - 64. Let p be o(-12). What is p rounded to the nearest ten thousand? 600000 Let g = 0.009143 + -0.0085. What is g rounded to four dps? 0.0006 Let z = -94 - -93.947. Let a = 0.11 + z. Let s = a - 0.057127. What is s rounded to 5 dps? -0.00013 Let d(h) = -2176h2 - 12h - 32. Let x be d(-4). What is x rounded to the nearest 1000? -35000 Let q = 14019.976 + -14099. Let r = 79 + q. What is r rounded to two decimal places? -0.02 Let o be 0/(-2)7/(-14). Suppose o = 10w - 6w - 2132. Round w to the nearest ten. 530 Suppose 221n - 140210 = 228n. What is n rounded to the nearest 100? -20000 Let f(c) = 1339c*2 - 18c - 17. Let w be f(-11). Round w to the nearest 10000. 160000 Suppose 46s - 31572049 = 83105951. Round s to the nearest one hundred thousand. 2500000 Let p = 407.755452 + -425.7557. Let d = p + 18. Round d to five decimal places. -0.00025 Let w = 13157.18 - 12675. Let i = 474 - w. Let z = -8 - i. What is z rounded to 1 decimal place? 0.2 Let m be (-16370)/(-5)(0 + -1). Let j = m + 2310. Let x be j/20 + (-4)/(-20). Round x to the nearest 10. -50 Let u = 2066 - 2066.1987. Let f = u + 0.181. What is f rounded to 3 decimal places? -0.018 Let l = -1019.999997704 + 1020. Round l to 7 dps. 0.0000023 Let p = -5.1 + 5.41. Let y = -0.48 + p. Let i = -0.134 - y. Round i to two dps. 0.04 Let w = 3.91 - 3.95. What is w rounded to the nearest 10? 0 Let p(c) = 6c2 - 15 + 15c + 6c2 - 5c + 3c3 - 2c*3. Let b be p(-11). What is b rounded to the nearest 10? 0 Suppose 0 = 3x - a - 6364 - 29338, -5a - 11882 = -x. Round x to the nearest one thousand. 12000 Let j be (27/(-2))/((-5)/(-50)). Let t be ((-61)/(-5) + 2)5. Let u = t + j. Round u to the nearest 10. -60 Let m = -4061449.4000015 + 4061451. Let y = 6 - 4.4. Let n = m - y. Round n to seven dps. -0.0000015 Let s(n) = 6n + n - 2n*2 - 46n*3 + 13 + n + 47n*3. Let q be s(12). Suppose -3i + 2o - 2670 = 0, 3o + q + 1121 = -3i. Round i to the nearest 100. -900 Let x = -314343.55041 + 3310631.550374. Let w = -2996305 + x. Let s = 17 + w. Round s to 5 dps. -0.00004 Let b = -1.658643 - -6.6586342. Let r = b + -5. What is r rounded to 6 decimal places? -0.000009 Let h = 0.33700431 - 0.337. Round h to seven decimal places. 0.0000043 Let s = 0.0379 + -0.038042. What is s rounded to five decimal places? -0.00014 Let x = 61494265 - 42884265. What is x rounded to the nearest one million? 19000000 Let d = 0.54 - -0.17. Let h = d + 0.09. What is h rounded to 1 decimal place? 0.8 Let d = 30 - 30.19. Let r = d - -0.1899978. Round r to 6 dps. -0.000002 Let i = -12.85 - -13. Let z = -0.42 + i. Let c = z + 0.2700006. Round c to six decimal places. 0.000001 Let b = 4 - -9. Let i = -15.25 + 2.46. Let q = b + i. Round q to 2 decimal places. 0.21 Let s(a) be the first derivative of -22000a*3 - 3a*2/2 - 6a + 31. Let d be s(-2). Round d to the nearest 10000. -260000 Let a = -5072204.08698118 - -0.08698118. Let t = -5072133.99933 - a. Let v = t - 70. What is v rounded to four decimal places? 0.0007 Let n(q) = -18389q2 - 19q. Let c be n(4). Round c to the nearest ten thousand. -290000 Suppose -31f = -700771 - 1391729. What is f rounded to the nearest 10000? 70000 Let t = -5335 - -8388. Let h = t - 14653. What is h rounded to the nearest one thousand? -12000 Suppose -3r + 11r + 154400000 = 0. Round r to the nearest 1000000. -19000000 Let d = 33 + -68. Let n = 35.000096 + d. What is n rounded to 5 decimal places? 0.0001 Let b = -944485 - -4161485. Round b to the nearest 100000. 3200000 Let q = 0.349 - 0.37. Let w = 9.141943 + -9.163. Let m = q - w. What is m rounded to five dps? 0.00006 Let m be ((-492)/(-10))/(2/5). Let f = m + -56. Let r = f + -96. What is r rounded to the nearest ten? -30 Let d be ((-860)/(-2))/((4/24)/1). What is d rounded to the nearest 1000? 3000 Let b = 1 - 11. Let j(x) = -x3 - 11x*2 - 6x + 1. Let l be j(b). Round l to the nearest 10. -40 Suppose 2d - 152 = -32. Let f be 72/d20/6. Suppose -fs = 5r + 33600025, 6s = 3s + 5r - 25199975. Round s to the nearest 1000000. -8000000 Let p = -1.19 + 112.19. Let q = p - 133.2. What is q rounded to the nearest integer? -22 Suppose -46 = -v - 3u + u, 5v - u = 285. Let w = v - 27. What is w rounded to the nearest ten? 30 Let b be -85 + 86 - (-6684 + 0). What is b rounded to the nearest 1000? 7000 Suppose 3q + 3y = 1569729, -3q + 0q + 4y + 1569708 = 0. Let p = -43240 + q. What is p rounded to the nearest ten thousand? 480000 Let u = 6.1522 - 6.502176. Let q = -73.65 + 74. Let z = q + u. What is z rounded to 5 dps? 0.00002 Let a = -3340 - -3340.000005073. What is a rounded to 6 decimal places? 0.000005 Suppose -8z = 5r - 6z - 985, -788 = -4r + z. Suppose 2v + 5t - r = -2v, -225 = -5v - 2t. Round v to the nearest 10. 40 Let w(z) be the first derivative of 2z*2 + 15z + 6. Let g be w(-6). What is g rounded to the nearest ten? -10 Suppose 0 = 10z - 1475351 + 13905351. Round z to the nearest one hundred thousand. -1200000 Let t = 16.52329545 + -96.52330075. Let c = t + 80. What is c rounded to six dps? -0.000005 Let t = -13690 + 13318.87. Let o = t + 374. What is o rounded to one decimal place? 2.9 Let q = 784 - 783.99999118. Round q to 7 decimal places. 0.0000088 Let b = 43.55 - -0.45. Let g = -44.036 + b. Round g to two decimal places. -0.04 Let u(x) = 48x + 18. Let s be u(14). Round s to the nearest 100. 700 Let c = -56737.935889 + 56745.35. Let o = 0.414223 - c. Let s = o - -7. What is s rounded to 5 dps? 0.00011 Let n = 1322826 - 375446. Suppose 0 = 2b - 1414241 - 2040519. Let j = n - b. What is j rounded to the nearest 100000? -800000 Let q be 1/((-1 - (-6)/9)-1). Suppose -qy - 2328566 = -171566. What is y rounded to the nearest one hundred thousand? -700000 Let y(s) = -3s*3 - 4s2 - s + 16. Let n be y(6). Round n to the nearest one hundred. -800 Let w = 643.26176 - 604.26175945. Let a = w - 39. Round a to 7 dps. 0.0000006 Let k = -1655.88848 + 1656. What is k rounded to three decimal places? 0.112 Let n = 0.04722 + -76.97622. Let q = n + 77. Let y = q + -0.0710146. What is y rounded to six dps? -0.000015 Let b(w) = w2 - 10w - 63. Let r be b(-17). What is r rounded to the nearest 100? 400 Let k = 13 + -9. Let h = k + -3.92. What is h rounded to two dps? 0.08 Let n = -723.000123 - -723. Round n to four decimal places. -0.0001 Let b(d) be the third derivative of 3d*2 + 0d*4 - 3020/3d*5 + 0d*3 + 0 + 0d. Let l be b(5). What is l rounded to the nearest 100000? -1500000 Let i = 48.12 + 0.88. Let o = i + -3. Let d = 46.092 - o. What is d rounded to 2 decimal places? 0.09 Let r = -701 + 700.99981632. What is r rounded to five decimal places? -0.00018 Let c be 15/((-15)/(-2)) - -520398. What is c rounded to the nearest one hundred thousand? 500000 Let n(v) be the first derivative of -549v3 + 3v2 + 21. Let t be n(-2). Round t to the nearest 1000. -7000 Let z = 975 + -975.0000000413. What is z rounded to 7 decimal places? 0 Let c = -2.4582 - 0.4508. Round c to 1 decimal place. -2.9 Let m(o) = o3 - 31o2 - 176o + 20. Let r be m(43). Round r to the nearest 1000. 15000 Let v = 1.4 + -1. Let x = v + 0.2. Let n = x + -0.60044. Round n to four decimal places. -0.0004 Let p = -978.999902 - -979. What is p rounded to 4 decimal places? 0.0001 Let b = 93 + -71. Suppose -295000 = 17y - by. Round y to the nearest ten thousand. 60000 Let x = 10.956 - 0.056. Let v = -1.83 - -18.63. Let y = x - v. What is y rounded to the nearest integer? -6 Let q = -2759.98050907 - -2695.295514. Let w = q + -0.31501073. Let u = 65 + w. What is u rounded to 6 dps? -0.000006 Suppose -13o = -76o - 452970000. What is o rounded to the nearest one million? -7000000 Let o(m) = 39m - 1. Let y(v) = 78v - 3. Let w(x) = -5o(x) + 2y(x). Let z be w(1). What is z rounded to the nearest ten? -40 Suppose 5228094 = -6v + 55628094. What is v rounded to the nearest 1000000? 8000000 Let o = -46 + 47. Let l be 12o/(6/445000). What is l rounded to the nearest 100000? 900000 Let r(d) = -2197d + 2. Suppose -13i = -12*i - 4. Let v be r(i). Let b = v + 4086. What is b rounded to	{ "pile_set_name": "DM Mathematics" }
term of -13, -24, -29, -16, 27, 112, 251? 2s3 - 9s*2 + 2s - 8 What is the p'th term of 62186, 62187, 62188? p + 62185 What is the w'th term of -3, 52, 203, 498, 985, 1712? 8w3 - w - 10 What is the w'th term of 600, 2398, 5404, 9624, 15064, 21730, 29628? w3 + 598w*2 - 3w + 4 What is the q'th term of -14, -63, -156, -299, -498, -759, -1088? -q*3 - 16q*2 + 6q - 3 What is the f'th term of 37, 63, 67, 37, -39, -173, -377, -663? -2f3 + f2 + 37f + 1 What is the j'th term of 122, 118, 100, 62, -2, -98, -232, -410? -j3 - j2 + 6j + 118 What is the s'th term of 1506, 3026, 4556, 6102, 7670, 9266, 10896, 12566? s3 - s2 + 1516s - 10 What is the t'th term of 56, 117, 178, 239, 300? 61t - 5 What is the x'th term of -188, -173, -148, -107, -44, 47, 172, 337? x3 - x2 + 11x - 199 What is the f'th term of 218, 885, 1990, 3527, 5490, 7873, 10670, 13875? -f*3 + 225f2 - f - 5 What is the v'th term of -96, -158, -204, -228, -224, -186, -108? v3 + 2v2 - 75v - 24 What is the n'th term of 663, 665, 667? 2n + 661 What is the i'th term of 94, 251, 504, 847, 1274, 1779, 2356? -i3 + 54i*2 + 2i + 39 What is the k'th term of 390, 393, 396, 399? 3k + 387 What is the d'th term of 52, 88, 132, 190, 268, 372, 508, 682? d3 - 2d*2 + 35d + 18 What is the f'th term of -34, -66, -100, -136? -f*2 - 29f - 4 What is the u'th term of 47, 192, 433, 770, 1203, 1732? 48u2 + u - 2 What is the k'th term of -9, -71, -241, -573, -1121? -9k3 + k - 1 What is the t'th term of -45, -90, -133, -174? t2 - 48t + 2 What is the p'th term of 65, 107, 103, 29, -139? -4p3 + p2 + 67p + 1 What is the c'th term of -69, -66, -65, -66, -69? -c2 + 6c - 74 What is the u'th term of -119, -239, -359, -479? -120u + 1 What is the x'th term of 2343, 4690, 7039, 9390? x2 + 2344x - 2 What is the i'th term of 26, 62, 98, 134, 170, 206? 36i - 10 What is the x'th term of 50, 152, 264, 392, 542, 720, 932, 1184? x3 - x2 + 98x - 48 What is the t'th term of -9, -33, -57, -69, -57, -9, 87, 243? 2t3 - 12t*2 - 2t + 3 What is the z'th term of 562, 574, 586, 598, 610? 12z + 550 What is the j'th term of 1157, 1159, 1161, 1163, 1165, 1167? 2j + 1155 What is the u'th term of -4, 48, 100? 52u - 56 What is the f'th term of 61, 122, 183? 61f What is the t'th term of -345, -342, -339, -336, -333, -330? 3t - 348 What is the l'th term of -5116, -5115, -5114? l - 5117 What is the f'th term of -79, -161, -243, -325, -407, -489? -82f + 3 What is the a'th term of -38, -33, -28, -23, -18? 5a - 43 What is the q'th term of -25, -28, -31, -34, -37, -40? -3q - 22 What is the m'th term of -30, -158, -372, -672, -1058? -43m2 + m + 12 What is the x'th term of 1, -20, -55, -104, -167, -244, -335? -7x*2 + 8 What is the o'th term of 10, -7, -50, -131, -262, -455, -722, -1075? -2o3 - o2 + 13 What is the r'th term of -2584, -2585, -2586, -2587? -r - 2583 What is the j'th term of 1, 14, 27, 40, 53? 13j - 12 What is the w'th term of -2, -1, -10, -35, -82, -157, -266, -415? -w3 + w2 + 5w - 7 What is the u'th term of -26, -51, -66, -65, -42, 9, 94, 219? u3 - u2 - 29u + 3 What is the n'th term of 45, 26, -11, -72, -163, -290, -459, -676? -n3 - 3n*2 - 3n + 52 What is the i'th term of -3989, -3988, -3987, -3986, -3985, -3984? i - 3990 What is the c'th term of -1172, -1142, -1110, -1076, -1040, -1002? c*2 + 27c - 1200 What is the i'th term of -417, -416, -411, -402, -389, -372, -351? 2i2 - 5i - 414 What is the f'th term of 467, 935, 1403, 1871, 2339, 2807? 468f - 1 What is the i'th term of -29, -25, -25, -35, -61, -109, -185? -i3 + 4i*2 - i - 31 What is the h'th term of 1176, 2355, 3534, 4713, 5892, 7071? 1179h - 3 What is the v'th term of 6293, 6290, 6285, 6278, 6269, 6258, 6245? -v*2 + 6294 What is the k'th term of 26, 30, 38, 50, 66, 86? 2k*2 - 2k + 26 What is the m'th term of 69, 139, 209, 279, 349? 70m - 1 What is the f'th term of -45, -93, -141? -48f + 3 What is the f'th term of 2167, 4334, 6501, 8668? 2167f What is the x'th term of 80, 66, 52, 38? -14x + 94 What is the j'th term of 334, 1291, 2874, 5077, 7894, 11319, 15346? -j*3 + 319j*2 + 7j + 9 What is the o'th term of -27, -22, 7, 72, 185? 2o3 - 9o - 20 What is the m'th term of 107, 219, 339, 473, 627, 807, 1019, 1269? m*3 - 2m*2 + 111m - 3 What is the o'th term of 89, 158, 237, 332, 449, 594, 773, 992? o3 - o2 + 65o + 24 What is the r'th term of 55, 41, 9, -47, -133, -255, -419? -r3 - 3r*2 + 2r + 57 What is the g'th term of -1666, -3334, -5002, -6670, -8338, -10006? -1668g + 2 What is the r'th term of 89, 102, 131, 182, 261, 374, 527? r3 + 2r*2 + 86 What is the b'th term of -207, -814, -1827, -3246, -5071? -203b*2 + 2b - 6 What is the g'th term of -59, -237, -535, -953, -1491? -60g2 + 2g - 1 What is the m'th term of 254, 264, 280, 302, 330, 364? 3m2 + m + 250 What is the v'th term of -15, -45, -95, -165, -255? -10v*2 - 5 What is the k'th term of 1670, 1664, 1658? -6k + 1676 What is the b'th term of -235, -271, -307, -343, -379? -36b - 199 What is the x'th term of 86, 81, 76, 71, 66, 61? -5x + 91 What is the z'th term of -57, -56, -55, -54, -53? z - 58 What is the s'th term of 1451, 1444, 1435, 1424, 1411, 1396, 1379? -s*2 - 4s + 1456 What is the q'th term of -13, -99, -331, -781, -1521, -2623, -4159, -6201? -12q3 - q2 + q - 1 What is the h'th term of 17, 1, -29, -79, -155, -263, -409, -599? -h3 - h2 - 6h + 25 What is the d'th term of -444, -447, -450, -453, -456? -3d - 441 What is the t'th term of 750, 1500, 2250, 3000? 750t What is the q'th term of 5349, 10698, 16047, 21396? 5349q What is the w'th term of 6, -24, -94, -222, -426? -3w*3 - 2w*2 - 3w + 14 What is the n'th term of -22, -20, -20, -22, -26, -32, -40? -n*2 + 5n - 26 What is the l'th term of -67, -87, -119, -169, -243, -347? -l*3 - 13l - 53 What is the l'th term of 27, 51, 75, 99, 123? 24l + 3 What is the j'th term of -75, -90, -139, -240, -411, -670? -3j3 + j2 + 3j - 76 What is the o'th term of 7, -40, -159, -386, -757, -1308, -2075? -6o*3 - 5o + 18 What is the g'th term of 174, 340, 492, 624, 730, 804, 840, 832? -g3 - g2 + 176g What is the m'th term of 93, 79, 41, -33, -155, -337, -591, -929? -2m*3 + 95 What is the c'th term of -222, -459, -696, -933, -1170, -1407? -237c + 15 What is the f'th term of -12, -7, 0, 9, 20? f*2 + 2f - 15 What is the f'th term of -15, -33, -49, -63, -75? f*2 - 21f + 5 What is the g'th term of 349, 422, 495, 568, 641, 714? 73g + 276 What is the b'th term of -28, -34, -40, -46? -6b - 22 What is the j'th term of 11, 24, 23, 2, -45, -124? -j3 - j2 + 23j - 10 What is the u'th term of 64, 53, 34, 7, -28, -71, -122? -4u2 + u + 67 What is the x'th term of -9, -22, -37, -54? -x2 - 10x + 2 What is the j'th term of -5279, -10561, -15843, -21125, -26407? -5282j + 3 What is the y'th term of 14, -10, -44, -82, -118, -146, -160? y*3 - 11y*2 + 2y + 22 What is the x'th term of 620, 619, 616, 611, 604, 595, 584? -x*2 + 2x + 619 What is the j'th term of -891, -1784, -2675, -3564, -4451? j*2 - 896j + 4 What is the k'th term of -171, -173, -175? -2k - 169 What is the f'th term of 1398, 1391, 1384, 1377? -7f + 1405 What is the d'th term of -17622, -17621, -17620? d - 17623 What is the g'th term of -335, -675, -1019, -1361, -1695? g*3 - 8g*2 - 323g - 5 What is the t'th term of 41, 75, 107, 137, 165, 191, 215? -t*2 + 37t + 5 What is the a'th term of -42139, -42137, -42133, -42127? a2 - a - 42139 What is the b'th term of -69, -133, -227, -357, -529? -b3 - 9b2 - 30b - 29 What is the w'th term of -50, -221, -502, -893? -55w2 - 6w + 11 What is the c'th term of 4257, 8515, 12773, 17031, 21289? 4258c - 1 What is the r'th term of -1084, -1098, -1124, -1168, -1236, -1334, -1468, -1644? -r3 - 7r - 1076 What is the q'th term of -375, -385, -395, -405, -415? -10q - 365 What is the x'th term of -9, -10, 5, 42, 107, 206, 345, 530? x3 + 2x*2 - 14x + 2 What is the o'th term of 6, 35, 84, 153, 242? 10o2 - o - 3 What is the g'th term of 50, 210, 480, 860? 55g*2 - 5g What is the b'th term of 128, 110, 80, 38, -16, -82? -6b*2 + 134 What is the j'th term of -	{ "pile_set_name": "DM Mathematics" }
r + 2 Let f(b) = b - 1. Let n(z) = -19z - 16z + 7 - 11z + 43z. Give 4f(d) + n(d). d + 3 Let i(h) = -4h*2 + 9h - 8. Let s(x) = x*2 + x - 3. Determine i(a) - 3s(a). -7a2 + 6a + 1 Let f(n) = -10n3 + 3n*2 + 5n + 7. Let p(y) = -9y3 + 2y*2 + 4y + 6. Determine -3f(t) + 4p(t). -6t3 - t2 + t + 3 Let a(l) = 3l3 + l2 - 12l - 12. Let m(g) = -2g3 - g2 + 6g + 6. Let t(x) = -3a(x) - 7m(x). Let p(o) = -o3 + o + 1. Determine 6p(z) + t(z). -z*3 + 4z*2 Let p(m) = m - 1. Let a(q) = 2q - 2. Let k(r) = 6a(r) - 11p(r). Let i(g) = -5g - 1 + 5 - 1. Calculate i(f) + 4k(f). -f - 1 Let c(p) = 4p3 + 4p*2 + 12p + 6. Let d(x) = 6x3 + 6x*2 + 18x + 9. Determine -7c(w) + 5d(w). 2w3 + 2w*2 + 6w + 3 Let y(s) = -13s - 14. Let a(r) = 2r + 3. Determine 6a(z) + y(z). -z + 4 Let k(l) = -8l*2 - l + 6. Let i(c) = 17c*2 + 6c - 1. Let h(u) = 21u2 + 7u - 2. Let p(f) = 6h(f) - 7i(f). Calculate 5k(z) + 6p(z). 2z2 - 5z Let n(t) = t*2 - 4t + 6. Let z(p) = 5p - 3. Give 2n(r) + 3z(r). 2r*2 + 7r + 3 Let n(s) = -8s2 - 2s - 35. Let x(p) = 13p2 + 3p + 53. Give 8n(r) + 5x(r). r*2 - r - 15 Let r(c) = -5c + 8. Let g(i) be the second derivative of -i3/6 + i2/2 - 67i + 1. Determine -14g(t) + 2r(t). 4t + 2 Let g(t) = -t*3 + 2t*2 + 2t. Let c = -43 + 62. Let h = 21 - c. Let d(s) = s. Calculate hd(b) - g(b). b3 - 2b*2 Let f(o) = 8o - 3o3 + o3 - 3 + 6o*3 + 5o*2 - 11o. Let q(n) = n3 + n2 - n - 1. Calculate -f(r) + 3q(r). -r3 - 2r*2 Let a(f) = -5f - 2. Suppose 9j = 63 + 18. Let p be (-43)/j + 28/(-126). Let l(q) be the first derivative of 9q*2/2 + 3q + 1. Give pa(o) - 3l(o). -2o + 1 Let a(q) = 630q. Suppose -723w = -698w - 50. Let x(y) = 17y. Give wa(s) - 75x(s). -15s Let p(y) be the third derivative of -y5/30 + y4/12 + y*3/2 + 3y2. Let s(x) = x2 - x - 1. Give -4p(t) - 9s(t). -t*2 + t - 3 Let l(s) = -40s - 2. Let q(f) = 47f + 2. Let a(k) = -7l(k) - 6q(k). Let b(w) = w - 2. What is -2a(j) - 3b(j)? j + 2 Let n be ((-24)/9 + 3)6. Suppose 2u + 14 = -2z, -6z - 10 = -nu - 2z. Let h(x) = 2x3 + x2 + 3x. Let p(s) = -s3 - s. Give up(r) - h(r). r3 - r2 Suppose 2a - 6a = 0. Let n(q) = q + aq - 1 - 2q. Let y be 0 + -3 + 1 + -1 - 3. Let r(f) = 7f + 8. Calculate yn(k) - r(k). -k - 2 Let m(y) = 1. Suppose 14 = 3c - 2f, -19c + 16 = -17c + 2f. Let g(h) be the first derivative of h2 - 7h - 2. Give cm(q) + g(q). 2q - 1 Let i(x) = 13x. Let r(u) = -14u. Suppose 96 = -2y + 92. What is yi(j) - 3r(j)? 16j Let s(p) = 705p - 17. Let z(j) = -349j + 8. Calculate -6s(m) - 13z(m). 307m - 2 Let u(v) = 4v - 9 + 2 - 18v + v + 9v. Let g(n) = 5n + 8. Determine -3g(d) - 4u(d). d + 4 Let m(x) = 38x - 78. Let b(d) = 64d - 157. What is -3b(u) + 5m(u)? -2u + 81 Let c(b) = -8b - 5. Let u(d) = 5d + 5. Let g(s) = 3c(s) + 2u(s). Let m(x) = -9x - 3. Give -5g(p) + 8m(p). -2p + 1 Let i(r) = -2r2 - r. Let l(d) = -3d*2 - 5d - 13. Determine -6i(g) + l(g). 9g*2 + g - 13 Let t(k) = 3k - 315. Let h(i) = 2i - 210. Calculate -7h(u) + 5t(u). u - 105 Let q(a) = 3a2 - 23. Let h(g) = -g2 + 8. Let d(m) = -2m3 + 2m*2 - 8m - 23. Let o be d(-2). Calculate oh(u) + 6q(u). u*2 - 2 Let g(s) = -151s - 3. Let o(d) = -1. Determine 2g(j) - 4o(j). -302j - 2 Let d(j) be the third derivative of -j6/24 + j5/12 - j4/6 + j3/6 + j2 + 347j. Let o(z) = z*2 - z. What is -d(m) + 5o(m)? 5m3 - m - 1 Let t(b) = 6b + 3 + 7b - 5b. Let d(h) = -h*3 - h + 4h + 0 - 7 - 5h2 + 0. Let u be d(-6). Let z(m) = -3m - 1. Calculate uz(f) + 4t(f). -f + 1 Suppose 2p + 3p = -15. Let w be 1/(p/9)-1. Let x(f) = -7 + 4 - 6 - 9f + 10fw. Let z(i) = -i3 + i + 1. What is -2x(s) - 18z(s)? -2s*3 Let w(z) be the second derivative of -7z*3/6 + 7z*2/2 - 2z + 65. Let d(p) = -4p + 4. What is -10d(j) + 6w(j)? -2j + 2 Let l(u) = 47u2 + 5u + 5. Let b(k) = 53k2 + 9 - 2 + 17k + 17k2 - 10k. What is 5b(a) - 7l(a)? 21a2 Let h(i) = 2i - 3. Let r(m) = -282m2 - 6m + 9. What is 3h(p) + r(p)? -282p*2 Suppose -2q = -4q - 8. Let t(w) = -2w*2 - 11w. Let c(m) = -m*2 - 5m. Let i be 3/276/6. Let h = -10 + i. Determine hc(f) + qt(f). -f2 - f Let z(y) = -2y*3 + 3y*2 - 3y + 2. Let x(u) = u3 - u2. Determine 3x(i) + z(i). i3 - 3i + 2 Let q(n) = -n - 1. Let j(o) = -2o2 - 10o - 3. What is -j(t) + 5q(t)? 2t*2 + 5t - 2 Let g = -13 + 25. Let r(v) = 5 - 10 - 3v - g. Let h(l) = l + 6. Let k = 60 + -49. Determine kh(c) + 4r(c). -c - 2 Let p(q) = 3q. Let g(t) be the second derivative of t*3/3 - 3t + 14. Determine -6g(b) + 5p(b). 3b Let f(l) = -8l + 6. Let b(x) = 3x2 - 4x + 2. Let w be b(2). Let g(n) = 2. Let s(z) = z + 1. Let v(d) = -6g(d) + 7s(d). Calculate wv(k) + 5f(k). 2k Let j(r) = 2r + 3. Let t = 250 + -251. Let w(x) = -1. Determine tj(b) - 3w(b). -2b Let d(c) = -86c. Let y(z) = -41z. Calculate 6d(v) - 13y(v). 17v Let u(o) = 101o3 - 3o*2 + 17o. Let v(z) = 34z3 - z2 + 6z. Give 6u(c) - 17v(c). 28c3 - c2 Let z(l) = 6l*3 - 3l*2 - 3l - 3. Let d(u) = -7u3 + 2u*2 + 2u + 2. Suppose 4k = 3f - 2, -k = -4f + 4k + 2. What is fz(c) - 3d(c)? 9c3 Let w = 43 - 47. Let y(f) = -f - f + 2f + 4 - f*2. Let q(x) = 3. Determine wq(d) + 3y(d). -3d2 Let r(p) be the second derivative of p5/20 - p4/12 + p3/3 - p*2/2 + 12p + 3. Let k(l) = l3 - l2 + 3l - 1. Give 2k(s) - 3r(s). -s3 + s2 + 1 Let s(k) = 2k3 - k2 - 1. Let i(l) = -198l3 + 2l*2 - l + 1. Determine 2i(d) + 2s(d). -392d*3 + 2d*2 - 2d Let d(u) be the third derivative of u*3/3 + 3u*2. Let p(k) = k - 9. Calculate 18d(y) + 4p(y). 4y Let i(w) = -8w - 1. Let a(b) = 7b + 2. Give 4a(f) + 3i(f). 4f + 5 Let m(z) = -3z - 3. Let b(r) = 2385r + 11 - 2360r + 14. Determine -6b(u) - 51m(u). 3u + 3 Let q(n) = -5n*2 - 9n + 9. Let v(r) = -5r2 - 8r + 8. Determine -6q(m) + 7v(m). -5m2 - 2m + 2 Let v(b) = -12b + 6. Let y(z) = -11z + 5. Let x = 655 - 658. Determine xv(j) + 4y(j). -8j + 2 Let f(k) = -2k - 4. Let o(q) be the second derivative of 3q2/2 + 25q. Let x(u) = 1. Let m(w) = o(w) - 2x(w). Let h = -7 - -6. What is hf(y) - 6m(y)? 2y - 2 Let h(q) = -q*2 + q + 13. Let i(t) = -2t*2 + t + 7. Let k(a) = 3h(a) - 5i(a). Let u(w) = 35w*2 - 11w + 21. Calculate 11k(m) - 2u(m). 7m2 + 2 Let r(q) = -51q*2 + 96q*2 - 48q*2 + 33q. Let m(s) = -s. What is -66m(l) - 2r(l)? 6l2 Let y(v) = -v3 + 16v*2 - v. Let h(a) = -3a*2. Let m = -1969 + 1958. Calculate mh(w) - 2y(w). 2w3 + w2 + 2w Let r(o) = -11o*2 - 3o + 24. Let x(t) = 4t2 + t - 8. Calculate 6r(b) + 17x(b). 2b*2 - b + 8 Let n(p) = 5p + 4. Let a(g) = 5 + 1 - 2 - 3. Let k(r) = -r. Let s(v) = -5a(v) + 6k(v). Give -4n(l) - 3s(l). -2l - 1 Let i be ((-112)/(-12))/((-14)/21). Let p(j) = j2 - 7j + 1. Let y(o) = -o. Calculate iy(d) + 2p(d). 2d2 + 2 Let r(g) = 50 + 44 + 44 - 135 - 3g. Let y(d) = 19d - 14. Let j(f) = 10f - 7. Let z(x) = -5j(x) + 3y(x). Determine -9r(k) - 4z(k). -k + 1 Let f(d) = -6d + 2. Let n be (9 - -3)/4 - 1. Let t(q) = 2 + nq + 3 + 0 - 6. Let o be (5 - 2)/(0 - -1). Give of(l) + 8t(l). -2l - 2 Let s = -5 + 8. Let l(q) = sq + 3q2 - 3q. Let d(t) = -t*3 + 2t*2. Determine -3d(j) + 2l(j). 3j*3 Let l(v) = -19v - 2. Let z(j) = 9j + 1. Let p be (2/(-6))/(3/54). What is pl(f) - 13z(f)? -3f - 1 Let s(c) be the second derivative of 4c5/5 + c3 + 5c*2 + c - 9. Let b(p) = -3p*3 - p - 2. Calculate -11b(d) - 2s(d). d3 - d + 2 Let b(d) = -5d + 7. Let m(k) = 4k. What is -b(y) + 3m(y)? 17y - 7 Let t(f) = -7f*3 - 2f*2 + 2. Let a(n) = -119 + 28 + 50n*2 + 99n*3 + 41n*2 + 216n*3. Give -6a(c) - 273t(c). 21c*3 Let o(w) = 2w*2 - 3w*2 - 3w*2 - 5. Let q be 8/6(-9)/(-6). Let s(n) = -2 + 1 + n*2 + 0n*q + 2. Calculate -o(i) - 5s(i). -i*2 Let h(z) = 9z*2 + z - 1. Let j(u) = 8u*2 - 1. Suppose 4p + 4 = 4c, 4p - 3p = -5c - 7. Calculate ph(g) + 3j(g). 6g2 - 2g - 1 Let c(r) = 487r3 + 2r*2 + 2r - 2. Let d(k) = 486k3 + 3k*2 + 3k - 3. Wh	{ "pile_set_name": "DM Mathematics" }
seconds? 53000530 What is two fifteenths of a hour in seconds? 480 What is 82988.88 millilitres in litres? 82.98888 How many meters are there in 11/4 of a kilometer? 2750 How many months are there in 68/3 of a century? 27200 What is 5/6 of a day in hours? 20 What is 2688.5766 minutes in hours? 44.80961 How many micrometers are there in 374150.9nm? 374.1509 What is 8.134193 litres in millilitres? 8134.193 What is fourty-six fifths of a tonne in kilograms? 9200 How many milliseconds are there in 6.144193us? 0.006144193 What is 2.96176 centuries in years? 296.176 What is seven quarters of a gram in milligrams? 1750 What is 1/5 of a minute in seconds? 12 How many litres are there in 13675.8ml? 13.6758 How many tonnes are there in 5.55653 kilograms? 0.00555653 How many decades are there in 0.3450387 millennia? 34.50387 How many centuries are there in 0.4191852 months? 0.000349321 What is 711.8511l in millilitres? 711851.1 How many nanograms are there in 7.376238mg? 7376238 What is 0.199997 millilitres in litres? 0.000199997 What is 539.0096 litres in millilitres? 539009.6 Convert 76.80691 nanometers to meters. 0.00000007680691 How many meters are there in 1.350853 centimeters? 0.01350853 Convert 8478.434ml to litres. 8.478434 Convert 6.82054 micrometers to nanometers. 6820.54 How many millilitres are there in 12/25 of a litre? 480 Convert 157540.0995 milliseconds to weeks. 0.00026048296875 How many micrograms are there in 1/4 of a milligram? 250 What is 11.2745709 seconds in days? 0.00013049271875 What is 44/5 of a tonne in kilograms? 8800 How many grams are there in 44/5 of a kilogram? 8800 What is one tenth of a microsecond in nanoseconds? 100 What is 1/10 of a kilogram in milligrams? 100000 How many decades are there in 11/10 of a millennium? 110 How many micrometers are there in 3/25 of a millimeter? 120 How many nanograms are there in 3/25 of a microgram? 120 How many millilitres are there in 5/4 of a litre? 1250 What is 45/8 of a microgram in nanograms? 5625 Convert 4898.015us to milliseconds. 4.898015 How many months are there in four fifteenths of a century? 320 How many milliseconds are there in fifteen quarters of a second? 3750 Convert 4273.532 millilitres to litres. 4.273532 What is 3399.875 days in milliseconds? 293749200000 How many hours are there in 29/6 of a day? 116 What is 979591.3 micrometers in millimeters? 979.5913 Convert 19746.141 months to millennia. 1.64551175 Convert 0.0497407 litres to millilitres. 49.7407 How many millilitres are there in 267.1364 litres? 267136.4 How many millimeters are there in one fifth of a centimeter? 2 What is ten ninths of a week in minutes? 11200 What is 5/4 of a litre in millilitres? 1250 How many millennia are there in 2440179.3 months? 203.348275 What is 54255.93 millilitres in litres? 54.25593 Convert 2.3425452 months to years. 0.1952121 How many minutes are there in 0.1571522 days? 226.299168 What is fifteen quarters of a second in milliseconds? 3750 What is 13/4 of a week in hours? 546 Convert 73661.79 minutes to microseconds. 4419707400000 Convert 2502366.6 months to centuries. 2085.3055 What is sixteen sevenths of a week in days? 16 How many nanograms are there in six fifths of a microgram? 1200 Convert 7.06289 millennia to centuries. 70.6289 What is twenty-five halves of a centimeter in millimeters? 125 How many decades are there in 3667.056 millennia? 366705.6 How many millimeters are there in six fifths of a meter? 1200 What is four fifteenths of a millennium in months? 3200 What is twenty-seven quarters of a milligram in micrograms? 6750 What is 72.0487 millennia in decades? 7204.87 How many months are there in 46/5 of a century? 11040 How many milligrams are there in 9.331557 kilograms? 9331557 How many tonnes are there in 7.971157mg? 0.000000007971157 How many kilometers are there in 19.80144nm? 0.00000000001980144 How many micrometers are there in six fifths of a centimeter? 12000 What is 688.3126 years in centuries? 6.883126 How many tonnes are there in 4180.488 milligrams? 0.000004180488 Convert 1974.311 decades to months. 236917.32 What is 6896158.29s in weeks? 11.402378125 How many kilograms are there in 0.0566287mg? 0.0000000566287 Convert 365.9823 years to months. 4391.7876 What is 1/10 of a minute in milliseconds? 6000 What is 6/5 of a milligram in micrograms? 1200 How many millilitres are there in 1/5 of a litre? 200 What is 1/30 of a decade in months? 4 How many microseconds are there in 74.43684 nanoseconds? 0.07443684 How many hours are there in 10/3 of a week? 560 What is one quarter of a tonne in kilograms? 250 What is 3/28 of a week in hours? 18 How many hours are there in 53.568ns? 0.00000000001488 How many nanograms are there in 25/4 of a microgram? 6250 How many kilograms are there in 0.7724444g? 0.0007724444 How many nanograms are there in 8.39321 tonnes? 8393210000000000 How many kilograms are there in nine tenths of a tonne? 900 How many milliseconds are there in 6/5 of a minute? 72000 How many millilitres are there in 3119.434l? 3119434 What is 6920.744 centuries in decades? 69207.44 How many centimeters are there in 18/5 of a meter? 360 How many millilitres are there in 7/25 of a litre? 280 Convert 5711.7kg to nanograms. 5711700000000000 What is 903856.1 litres in millilitres? 903856100 Convert 0.4354425mm to kilometers. 0.0000004354425 What is eleven halves of a micrometer in nanometers? 5500 How many years are there in thirteen quarters of a century? 325 How many nanometers are there in twenty-one halves of a micrometer? 10500 What is four thirds of a decade in months? 160 Convert 27.14334l to millilitres. 27143.34 What is 60.3758 litres in millilitres? 60375.8 How many nanograms are there in 11/10 of a microgram? 1100 What is 2.410881us in minutes? 0.00000004018135 What is 3/10 of a litre in millilitres? 300 Convert 969.6202 millilitres to litres. 0.9696202 What is one sixteenth of a centimeter in micrometers? 625 What is 29196.261ms in minutes? 0.48660435 How many centuries are there in 28.440432 months? 0.02370036 Convert 13.19999 millennia to months. 158399.88 What is 600.9359cm in kilometers? 0.006009359 What is 6/25 of a tonne in kilograms? 240 Convert 66585.74 minutes to microseconds. 3995144400000 How many nanoseconds are there in 5/4 of a microsecond? 1250 How many minutes are there in one sixth of a week? 1680 How many millilitres are there in 11/8 of a litre? 1375 Convert 7.3897038 nanoseconds to hours. 0.0000000000020526955 How many months are there in seventeen sixths of a decade? 340 What is 21/8 of a litre in millilitres? 2625 What is 0.2622076l in millilitres? 262.2076 What is twenty-five halves of a milligram in micrograms? 12500 How many centimeters are there in twenty-one quarters of a meter? 525 How many grams are there in 3/25 of a kilogram? 120 How many minutes are there in eight sevenths of a week? 11520 What is 1/5 of a millennium in decades? 20 Convert 586.0291ml to litres. 0.5860291 How many days are there in 2686.19625s? 0.031090234375 What is 46955.53 litres in millilitres? 46955530 What is 37/5 of a meter in millimeters? 7400 What is 0.0995993mm in kilometers? 0.0000000995993 How many nanometers are there in 74059.91 centimeters? 740599100000 What is thirteen eighths of a centimeter in micrometers? 16250 Convert 17.79887 litres to millilitres. 17798.87 What is 6.609709 kilograms in tonnes? 0.006609709 How many millilitres are there in seventy-four fifths of a litre? 14800 What is 14679.97l in millilitres? 14679970 What is 6.898113 millennia in centuries? 68.98113 How many grams are there in 1/16 of a tonne? 62500 How many millilitres are there in 25/8 of a litre? 3125 How many months are there in seventy-two fifths of a century? 17280 What is 2639.6367 months in years? 219.969725 How many milliseconds are there in 803.4713 days? 69419920320 How many nanometers are there in 34.9191 meters? 34919100000 What is 27/4 of a milligram in micrograms? 6750 How many millilitres are there in 735.5969 litres? 735596.9 How many millilitres are there in 11/8 of a litre? 1375 How many nanograms are there in 9.082628mg? 9082628 How many centimeters are there in fourty-three halves of a meter? 2150 How many centimeters are there in 914.150	{ "pile_set_name": "DM Mathematics" }
23 Suppose 4x + 4r + r = 171, 5x - 2r = 255. Calculate the highest common divisor of 7 and x. 7 Let k = 10 - 8. Let r be k + 18(2 - 0). What is the greatest common factor of r and 19? 19 Suppose 0w = w - 21. What is the highest common divisor of 7 and w? 7 Let i = -6 + 11. Let v(f) = 2f - 1. Let j be v(i). Suppose -y = -3h + 106, 5h = -2y + 14 + 170. Calculate the highest common divisor of j and h. 9 Let v(d) = -2d3 + d2 + 6d + 10. Let t be v(-4). Calculate the greatest common factor of 26 and t. 26 Suppose -2o + 2u + 144 = 2o, 0 = -o + 3u + 41. Calculate the highest common factor of 14 and o. 7 Let p(w) = -w*3 + 7w*2 - w - 5. Let g be p(5). Suppose -2r - g = -c, 5r = -5c + 22 + 103. Calculate the highest common divisor of 45 and c. 15 Suppose -m - 1 + 3 = 0. Let d(g) = -1 + 10gm + 3g - 3g. Let q be d(1). Calculate the highest common divisor of q and 18. 9 Let f(s) = s3 - 20s*2 + 35s + 20. Let i be f(18). Calculate the highest common factor of 28 and i. 2 Let m(f) = -f*2 + 16f - 3. Let u be m(15). Suppose 5k = 3v - 153 - u, 186 = 3v + 2k. What is the greatest common factor of 15 and v? 15 Let h be 256/10 + (-7)/(35/(-2)). Calculate the highest common factor of h and 65. 13 Let v = 3 - 3. Let n be ((v + 0)/2)/1. Suppose t + n = 2. Calculate the highest common divisor of t and 5. 1 Let u(o) = 2o2 - 12o - 6. Let g be u(11). Calculate the greatest common divisor of g and 13. 13 Let j be (2/2 + 1)3. Let d = j + 4. Let o = 2 - -3. Calculate the greatest common divisor of d and o. 5 Let l be (-1)/(-2) + (-45)/(-6). Let i = 4 - 9. Let b(m) = -19m - 7. Let f be b(i). Calculate the highest common factor of l and f. 8 Suppose -4b + 34 = l, 2l = -2b + 6b + 8. What is the highest common factor of 2 and l? 2 Let k be 4/(-8) - 21/(-2). Calculate the greatest common factor of k and 5. 5 Let r(s) = 69s2 - s + 1. Let g be r(1). Calculate the greatest common divisor of g and 46. 23 Let y be 0 - 1 - (-710)/10. Calculate the greatest common divisor of 28 and y. 14 Let j = 9 - 6. Suppose jz - 44 = 76. Calculate the greatest common factor of 60 and z. 20 Let b be 1/(-4) + (-81)/(-4). Suppose -5n = 6 - 56. What is the highest common divisor of b and n? 10 Let k = -74 + 106. Calculate the highest common divisor of k and 48. 16 Let j be (-4)/(-6) + 1/3. Let u be 1/(j/(12 + 3)). Calculate the greatest common divisor of 45 and u. 15 Let d = -2 + 3. Let w be (d - 5)2/(-4). What is the highest common divisor of w and 10? 2 Let j be 128/6 - 3/9. Suppose 0 = 4q + 3q - 1323. What is the highest common divisor of q and j? 21 Let p(c) = -2c - 4. Let x = -12 - -6. Let r be p(x). Calculate the greatest common divisor of r and 4. 4 Suppose -4y - m + 99 = 0, 3y - 57 = 3m + 2m. Suppose 8o = 3o + 40. Calculate the greatest common divisor of y and o. 8 Suppose -5x = -r + 5, -2x - 20 = -r - 0. Suppose 60 = -3p + 6p. What is the greatest common factor of p and r? 10 Let v(p) = -p3 - 7p*2 + 2. Let j be v(-7). Suppose -ja + 22 + 6 = 0. What is the highest common divisor of 14 and a? 14 Suppose 0u - 365 = -3u + 5y, -u - 3y + 117 = 0. Calculate the highest common factor of u and 10. 10 Suppose 4s - 10 - 2 = 0, 5j = 3s + 91. Calculate the greatest common factor of 100 and j. 20 Let r be ((-3)/(-6))/((-2)/(-20)). Suppose -q + 1 = 0, 0l + 4l + rq = 313. What is the greatest common divisor of 7 and l? 7 Let p(o) = -o*3 + 3o*2 + o + 1. Suppose -28 = -0k - k + 5s, -16 = 3k + 5s. Let x be p(k). What is the greatest common factor of x and 2? 2 Suppose -4w = -33 + 201. Let n be (w/(-4))/310. Calculate the highest common divisor of n and 7. 7 Let k(s) = s2 + 4s + 7. Let v be k(-3). Let p be (56/(-3))/(-4)6. What is the greatest common factor of p and v? 4 Let s be (-6)/(4 + -2)-17. What is the greatest common factor of 34 and s? 17 Let u be (4/3)/((-11)/(-396)). What is the greatest common factor of u and 6? 6 Suppose -3t - 2z = 2t - 51, -4 = 2z. What is the highest common factor of 11 and t? 11 Suppose y - 544 = -3t, 0 = -3t + 2y + 3y + 556. Calculate the greatest common divisor of t and 14. 14 Let m be 72/15(20 + -5). What is the greatest common divisor of 8 and m? 8 Let k be (-2)/(-3)(-408)/(-16). Let j = k - 5. Calculate the highest common factor of 3 and j. 3 Let t be 991 - ((-2 - -3) + 0). Suppose 3g - t = g. Suppose 0 = -4j - j + g. Calculate the highest common divisor of j and 11. 11 Suppose -14n + 0n = -3724. What is the greatest common factor of n and 14? 14 Suppose 4w - 17 = -5k, 1 = 2w - w - 2k. Suppose -y - 24 = -2y. Calculate the highest common divisor of y and w. 3 Let t = -8 - -17. Suppose -2l + l = -6. Suppose 2n = n + l. What is the greatest common factor of n and t? 3 Suppose 5 = 8q - 3q, 4q = -3t + 1564. What is the greatest common factor of t and 52? 52 Let t = 7 - 21. Let q be t(-2 - 2/(-4)). Suppose 0 = -6c + 73 + 11. What is the highest common factor of q and c? 7 Let f(o) = 2o*2 + 9o + 2. Let x(q) = -q - 6. Let t be x(0). Let l be f(t). Let p be 2 - (-3 - -3)/2. What is the greatest common divisor of l and p? 2 Suppose -52 = -2j + 2h, -4j + 3h = 8h - 77. Let n = j - 20. Calculate the highest common factor of 9 and n. 3 Suppose 0 = 4f - c - 55, 0 = -5f + 3f - 3c + 45. Calculate the highest common divisor of f and 3. 3 Let l be -222(-4)/16. Suppose -6s - 10 = -ls. What is the greatest common divisor of 22 and s? 2 Let a be (-550)/(-26) + (-2)/13. Let t = 1 + 13. What is the highest common factor of a and t? 7 Let w be 162(45/10 + -4). Calculate the greatest common divisor of 9 and w. 9 Suppose -r + 56 = 3r. Suppose -f = -56 - 58. Suppose -4k = p - 104, f = -2p + 3p - k. What is the greatest common divisor of p and r? 14 Let n be 1/2 + (-1113)/(-14). Calculate the greatest common factor of 60 and n. 20 Suppose -2b + 213 = 83. Suppose -5x - 10 + b = 0. What is the greatest common factor of 99 and x? 11 Suppose -4x - 30 = -5u + x, 0 = -3x - 6. Suppose -5c - 40 = -2k, -u = -k + 5c + 21. What is the highest common factor of 60 and k? 15 Suppose -x + 6 = 5n, 5x = -3n - n - 54. Let r(s) = -s3 - 15s*2 - 15s + 14. Let k be r(x). What is the highest common divisor of k and 14? 14 Let z(t) = -t - 3. Let v be z(-9). Let a be (0 - -2)-15. Let u be (-24)/a40/v. Calculate the greatest common divisor of 112 and u. 16 Let m = 4 - -1. Suppose r - m = -2. Calculate the highest common factor of 9 and r. 3 Let g = 677 - 427. Calculate the greatest common factor of 25 and g. 25 Suppose b = 5f + 5b - 260, -f + 43 = -b. Calculate the greatest common factor of 4 and f. 4 Suppose -3v + 0v = 4p - 48, 5p = -2v + 60. Let j = p - 10. What is the highest common divisor of j and 12? 2 Let s(i) = 2i2 - 17i + 10. Let n be s(11). Calculate the highest common factor of n and 26. 13 Let t = 85 + -49. Calculate the highest common divisor of 108 and t. 36 Let r = -98 + 164. Suppose -n = -0n + 5j + 14, 0 = 2n + 3j. What is the greatest common divisor of n and r? 6 Let m be 1-1 + 74 + -1. Suppose 5 = x + 4l, -3x - 2l + 25 = -0x. What is the highest common factor of x and m? 9 Let y be 116/(6 - 0). Suppose -5k = -3k + 2h - 172, -2k + 4h + 184 = 0. Calculate the greatest common factor of y and k. 11 Suppose -3p + 2p + 1 = 0. Let o be p/((-4)/20-1). What is the highest common divisor of 30 and o? 5 Let v = 12 - 8. Let d(f) = -6f3 - 2f*2 - f + 2. Let l be d(-2). What is the greatest common divisor of l and v? 4 Let d be -3 + 8 - (0 - 1). Suppose dc + 5x - 40 = c, 0 = -2x + 6. Let v(n) = -n*2 - 8n + 10. Let q be v(-8). What is the highest common factor of c and q? 5 Let a(l) = -l*2 - 10l + 1. Let p be a(-7). Suppose -g + p = g. Calculate the greatest common divisor of 1 and g. 1 Let f be ((-98)/(-6))/(2/(-6)-1). Calculate the highest common divisor of f and 7. 7 Let l(z) = z3 - 11z*2 - 12z + 17. Let w be l(12). What is the greatest common divisor of 68 and w? 17 Suppose 3z - 79 = -19. What is the greatest common divisor of 20 and z? 20 Suppose 30 = 5b - 0. What is the highest common factor of 4 and b? 2 Let j(v) = v**2 + v + 2. Let r be j(2). Let c be (6/r)/(5/240). Calculate the greatest common factor of	{ "pile_set_name": "DM Mathematics" }
st integer? 218 What is the fifth root of 604823 to the nearest integer? 14 What is 11453759 to the power of 1/8, to the nearest integer? 8 What is 84163 to the power of 1/2, to the nearest integer? 290 What is the fourth root of 9938176 to the nearest integer? 56 What is 69887 to the power of 1/7, to the nearest integer? 5 What is 2063793 to the power of 1/2, to the nearest integer? 1437 What is 4872010 to the power of 1/2, to the nearest integer? 2207 What is the third root of 100776 to the nearest integer? 47 What is 166308 to the power of 1/3, to the nearest integer? 55 What is 218202 to the power of 1/2, to the nearest integer? 467 What is 6491980 to the power of 1/3, to the nearest integer? 187 What is the cube root of 176532 to the nearest integer? 56 What is 1697029 to the power of 1/2, to the nearest integer? 1303 What is the ninth root of 2228328 to the nearest integer? 5 What is the square root of 23516225 to the nearest integer? 4849 What is 265592 to the power of 1/3, to the nearest integer? 64 What is the sixth root of 79247 to the nearest integer? 7 What is 192154 to the power of 1/2, to the nearest integer? 438 What is the fifth root of 588346 to the nearest integer? 14 What is 788801 to the power of 1/8, to the nearest integer? 5 What is 5777169 to the power of 1/6, to the nearest integer? 13 What is the fourth root of 304988 to the nearest integer? 24 What is the square root of 11571571 to the nearest integer? 3402 What is the third root of 1355033 to the nearest integer? 111 What is the fifth root of 102800 to the nearest integer? 10 What is 345513 to the power of 1/3, to the nearest integer? 70 What is 137240 to the power of 1/2, to the nearest integer? 370 What is 21303 to the power of 1/10, to the nearest integer? 3 What is 3247123 to the power of 1/6, to the nearest integer? 12 What is 2795420 to the power of 1/4, to the nearest integer? 41 What is 21578592 to the power of 1/2, to the nearest integer? 4645 What is 5868673 to the power of 1/2, to the nearest integer? 2423 What is the third root of 1126795 to the nearest integer? 104 What is the fifth root of 239455 to the nearest integer? 12 What is 7209114 to the power of 1/10, to the nearest integer? 5 What is the cube root of 10863433 to the nearest integer? 221 What is the square root of 287019 to the nearest integer? 536 What is the ninth root of 2053104 to the nearest integer? 5 What is the seventh root of 835704 to the nearest integer? 7 What is 5218094 to the power of 1/6, to the nearest integer? 13 What is the cube root of 7803633 to the nearest integer? 198 What is the cube root of 17435507 to the nearest integer? 259 What is the seventh root of 4125185 to the nearest integer? 9 What is the seventh root of 3192196 to the nearest integer? 8 What is 114445 to the power of 1/3, to the nearest integer? 49 What is the third root of 19790329 to the nearest integer? 270 What is the third root of 3055567 to the nearest integer? 145 What is the eighth root of 1994708 to the nearest integer? 6 What is 72782 to the power of 1/4, to the nearest integer? 16 What is the ninth root of 7990528 to the nearest integer? 6 What is the ninth root of 313591 to the nearest integer? 4 What is the tenth root of 584039 to the nearest integer? 4 What is the third root of 968915 to the nearest integer? 99 What is 471115 to the power of 1/10, to the nearest integer? 4 What is the third root of 5124331 to the nearest integer? 172 What is the square root of 1769629 to the nearest integer? 1330 What is 518675 to the power of 1/2, to the nearest integer? 720 What is the square root of 15994 to the nearest integer? 126 What is 379674 to the power of 1/6, to the nearest integer? 9 What is the third root of 1350359 to the nearest integer? 111 What is the ninth root of 1619923 to the nearest integer? 5 What is the square root of 217877 to the nearest integer? 467 What is the tenth root of 2686397 to the nearest integer? 4 What is the fourth root of 2829099 to the nearest integer? 41 What is the cube root of 856275 to the nearest integer? 95 What is 15526439 to the power of 1/3, to the nearest integer? 249 What is 796744 to the power of 1/5, to the nearest integer? 15 What is 815873 to the power of 1/6, to the nearest integer? 10 What is 5785691 to the power of 1/3, to the nearest integer? 180 What is the square root of 1231239 to the nearest integer? 1110 What is 177734 to the power of 1/2, to the nearest integer? 422 What is the tenth root of 181449 to the nearest integer? 3 What is 1094716 to the power of 1/4, to the nearest integer? 32 What is 518574 to the power of 1/8, to the nearest integer? 5 What is the cube root of 237155 to the nearest integer? 62 What is the square root of 762796 to the nearest integer? 873 What is the third root of 132320 to the nearest integer? 51 What is the fourth root of 158168 to the nearest integer? 20 What is 6041565 to the power of 1/9, to the nearest integer? 6 What is the fifth root of 176657 to the nearest integer? 11 What is the cube root of 7208898 to the nearest integer? 193 What is 28188793 to the power of 1/3, to the nearest integer? 304 What is the square root of 1270125 to the nearest integer? 1127 What is the eighth root of 163569 to the nearest integer? 4 What is 361963 to the power of 1/2, to the nearest integer? 602 What is 8015630 to the power of 1/7, to the nearest integer? 10 What is 28130 to the power of 1/3, to the nearest integer? 30 What is 31024025 to the power of 1/3, to the nearest integer? 314 What is the square root of 4291721 to the nearest integer? 2072 What is 7322156 to the power of 1/2, to the nearest integer? 2706 What is the third root of 39963 to the nearest integer? 34 What is the sixth root of 9393462 to the nearest integer? 15 What is the square root of 117576 to the nearest integer? 343 What is 19952792 to the power of 1/2, to the nearest integer? 4467 What is the square root of 4101047 to the nearest integer? 2025 What is the fourth root of 2748336 to the nearest integer? 41 What is 745848 to the power of 1/2, to the nearest integer? 864 What is 1168974 to the power of 1/3, to the nearest integer? 105 What is 465950 to the power of 1/5, to the nearest integer? 14 What is 15216421 to the power of 1/9, to the nearest integer? 6 What is 391486 to the power of 1/3, to the nearest integer? 73 What is 148930 to the power of 1/6, to the nearest integer? 7 What is the third root of 273364 to the nearest integer? 65 What is the ninth root of 396977 to the nearest integer? 4 What is 917511 to the power of 1/2, to the nearest integer? 958 What is the cube root of 3208542 to the nearest integer? 147 What is the cube root of 81568 to the nearest integer? 43 What is the cube root of 5212514 to the nearest integer? 173 What is the cube root of 290460 to the nearest integer? 66 What is the square root of 200344 to the nearest integer? 448 What is the ninth root of 7076516 to the nearest integer? 6 What is the fourth root of 161302 to the nearest integer? 20 What is 1597442 to the power of 1/10, to the nearest integer? 4 What is 11658138 to the power of 1/7, to the nearest integer? 10 What is 196268 to the power of 1/8, to the nearest integer? 5 What is the cube root of 2913494 to the nearest integer? 143 What is 32538595 to the power of 1/3, to the nearest integer? 319 What is the cube root of 8137737 to the nearest integer? 201 What is the third root of 1114553 to the nearest integer? 104 What is 5398365 to the power of 1/2, to the nearest integer? 2323 What is the eighth root of 655426 to the nearest integer? 5 What is the cube root of 20354 to the nearest integer? 27 What is 3670083 to the power of 1/3, to the nearest integer? 154 What is 1406645 to the power of 1/8, to the nearest integer? 6 What is 7984245 to the power of 1/7, to the nearest integer? 10 What is 940503 to the power of 1/3, to the nearest integer? 98 What is 296177 to the power of 1/3, to the nearest integer? 67 What is the cube root of 1047627 to the nearest integer? 102 What is the square root of 23383836 to the nearest integer? 4836 What is the eighth root of 2649771 to the nearest integer? 6 What is the cube root of 7038245 to the nearest integer? 192 What is t	{ "pile_set_name": "DM Mathematics" }
) + (-17 - -18)). -6 What is the value of (5 - 10 - 7) + 4? -8 What is 8 + -2 - -1 - (-29 + (47 - -3))? -14 Calculate -26 + -1 + (-155 - -188). 6 Calculate -6 - (5 + 3 + -20 + 8). -2 2 - (-1 + 5 + 2 + (-9 - -1)) 4 Evaluate (-17 - (-2 + 3)) + (895 - 907). -30 13 + (-11 - 11) + 23 14 Evaluate (10 + 2 - 3) + -4. 5 (3 - -1) + (7 + -38 - -20) -7 Evaluate 21 + -73 + 37 - (-1 - 1 - 1). -12 What is the value of 3 + (-7 - ((-15 + 6 - -8) + -4))? 1 Evaluate (-19 + 40 - -4) + -10 + 2. 17 3 - ((15 - (31 - 18)) + -2 + 0) 3 -12 - -3 - (-6 + (-4 - -7 - 2)) -4 Evaluate -7 + (-1 - 6) - (-15 - (-7 + -2)). -8 What is 20 - (222 - 231 - (-21 - 0))? 8 Calculate 3 - 2 - -4 - (-13 + (-24 - -18)). 24 What is (-3 + 1 - (81 + -82)) + -9? -10 Evaluate 50 - (-41 + 34 - -38). 19 -6 + 4 - (93 - 80) -15 What is the value of (75 - 72 - (9 + -3)) + 18 + -1? 14 What is -29 + 8 - (-3 - 2 - 2)? -14 What is the value of -2 - (-6 + -5) - 18? -9 What is the value of 8 - (-25 - (-22 + 5))? 16 -17 + 1 + 6 + -18 - -5 -23 -3 - ((-1 - -22) + -22) -2 What is the value of -31 + (43 - (23 + -19))? 8 What is -2 + (12 - ((12 - -4) + -6 + -5))? 5 What is the value of (-17 - -19) + 17 + -1? 18 Evaluate -28 - ((-12 - -22) + -3 + (-6 - 2)). -27 What is the value of 7 + (27 + 2 - 17)? 19 Calculate -8 - (-8 + -1 + 12). -11 What is 17 - (-17 - (19 + -54))? -1 Calculate 2 + -1 + -5 + (41 - (62 - 10)). -15 What is (3 - 9) + (0 - 2) + 4 + 22? 18 What is (-2 - 16) + 1 + -13 + (23 - 16)? -23 Evaluate (-2 - 5) + 4 + (-10 - (-9 + 7)). -11 What is -6 - ((7 - 0) + -30 + -1 + 16)? 2 What is -2 - (-1 - 8) - (-18 - (37 - 60))? 2 Calculate 6 - (-6 - -10 - (3 + 3)). 8 8 - (18 - (39 + -27)) 2 Calculate 6 - ((6 - (5 + 2) - -7) + -5). 5 What is 10 + -13 + 10 + -6 - 13? -12 What is -25 + 64 + -20 + -21? -2 Calculate (-1 - -1 - (5 + -9)) + (-3 - -7). 8 Evaluate -4 + 1 + (-17 - -22 - 10) + 4. -4 Calculate (-4 - (-7 - -15)) + 6 + 9 - 7. -4 What is the value of 9 + -9 - 13 - -2 - 7? -18 Evaluate -14 + 7 + 15 + -20. -12 Evaluate -10 + (19 - 1) + -4 + 11. 15 7 - (15 - 5) - 6 - 11 -20 16 - (-24 + 36) - (3 + 24) -23 -10 - 0 - (-56 - (-92 - -31)) -15 -39 + -29 + 70 + (7 - (2 + -1)) 8 What is (5 - (29 + (-1 - -3))) + -4 + 1? -29 Calculate (-1 - -23) + (-108 - -95). 9 What is the value of 14 + (-16 - -6) - 3? 1 What is the value of 3 + -7 + -1 - (8 + (-18 - -10))? -5 -11 - -2 - (-30 + -43 + 47) 17 (36 - 49 - -7) + (1 - 0 - -2) -3 Calculate (26 - 19 - (3 - (4 + -29))) + 5. -16 What is -6 + 5 + -2 + -3 + 2 + -2? -6 Evaluate 2 + 1 + -6 - (-154 + 152). -1 What is (-32 - (-18 - 23)) + -14? -5 What is (7 - 16) + -4 + (-2 - -1) + 7? -7 Evaluate 30 + (19 - 20) - 19. 10 What is (-1 - ((-4 + -4 - -11) + 2)) + 3? -3 Evaluate 9 - 0 - 3 - (4 - (-1 - -3)). 4 Evaluate -14 + 15 - 14 - -27. 14 What is 10 + 9 + 9 + 3 - 13? 18 -63 - 3 - -50 - (-1 - -3) -18 What is the value of (-16 - (-6 + 1)) + 4 - 2? -9 Evaluate 279 - 285 - (-7 - (4 + -4)). 1 5 + (54 - 61) + (0 - (-10 - -3)) 5 What is the value of -26 - -24 - (-14 + -2) - (-6 + 6)? 14 What is the value of -18 + -7 + (16 - (10 - 5 - 1))? -13 What is (-5 - -2 - (-12 + 32)) + (1 - -7)? -15 -5 - (-2 + 7) - (21 + -10) -21 What is 4 + (5 - (-1 + 16 + -6))? 0 Calculate 0 + 1 - (4 - (-2 - -17)). 12 Calculate -23 + 18 - (-8 - (-3 + 1 - 0)). 1 Calculate 5 + 7 + -28 - -16 - (-5 - 2). 7 -29 + -9 - (3 + -10) -31 What is -9 + 18 + -14 - -5? 0 (20 - (-1 - 1)) + 587 + -600 9 (2 - 0 - -5 - 2) + 1 + -1 5 What is the value of 7 - ((7 - (10 - -1)) + -3)? 14 Evaluate -2 + (2 - -3 - (0 + 8)). -5 What is 6 + (-4 + 16 - 7) + -7? 4 What is the value of 1 + 0 - (-2 + 11 + 10 + -8)? -10 9 + -2 - 1 - (-1 + -1) 8 What is 13 - (34 - (-5 + 17))? -9 What is the value of -1 + 5 + -3 + 28 + -41? -12 Calculate 38 + -31 + 12 + -50. -31 Evaluate -6 + 0 + 2 + -2 - (-184 + 194). -16 What is -16 + 4 + 11 + (-1 - 0)? -2 What is 1 + -2 + 5 - (4 + -7 - 1)? 8 2 - (14 - (7 + -13 + (-9 - -13))) -14 Evaluate (-32 - -21) + 3 + 14 + 12. 18 Calculate -7 + 3 - (-5 - 1 - 6). 8 11 - (-6 + 1 + 1 + 21 + -16) 10 What is the value of (-20 - 1) + 326 + -322? -17 Calculate (14 - (20 + -11)) + -2 + 7. 10 Evaluate -1 + -8 + 6 + -18 + 8. -13 What is the value of -33 + 3 + -731 + 742? -19 Evaluate (-19 - 15 - -25) + (-5 - -2). -12 -2 + -3 - (-76 - -49 - -12) 10 What is 337 + -330 + (19 - 0 - 2)? 24 6 + (13 + -1 + 3 + -10 - 3) 8 38 - (53 - 20 - 22) 27 What is (1 - -41) + (-11 + 9 + -7 - -2)? 35 What is the value of -2 - -8 - (39 + -47 - (-2 - 18))? -6 -8 - (-2 + (3 - (-2 + 9)) + -4) 2 What is the value of 5 - (15 - 5 - (-7 + (6 - -2)))? -4 Evaluate 23 + (-20 - -13) + -29. -13 Calculate -2 + 2 + 14 + (345 - 344). 15 Evaluate (18 - 16 - -2) + 7. 11 (27 - 18) + (9 - 8 - -2) 12 Calculate -3 + -1 - (40 + -77 + 37). -4 Calculate 14 + -9 + -1 + -4. 0 What is (0 - 38) + (-6 - -30)? -14 What is the value of (-5 + 9 - 9 - -3) + -2 + 5? 1 What is 41 + 10 + -28 + 7? 30 Calculate (-12 - 1) + -19 + -50 + 61. -21 Evaluate 23 + -7 - (-11 + 20). 7 What is -28 + (-10 - (-89 + 27))? 24 1 + 28 + 0 - (-16 - (11 + -23)) 33 (2 - 9 - -14) + -3 + -2 - -8 10 Evaluate -34 + 42 + -15 + (1 - 0). -6 (3 + -6 - 1) + 3 + -5 -6 What is -7 + (11 + -15 - 5 - -32)? 16 Calculate -20 - 1 - (1 - 18 - -5). -9 What is 274 - 321 - (1 + -20)? -28 Evaluate 2 + 57 + -21 - 28. 10 What is 16 + -25 + 28 + -4? 15 -2 - (2 - (7 + 4 + -1)) 6 Evaluate -6 + -14 + (12 - 6). -14 What is the value of (17 + -11 - (-8 - (-8 - 2))) + -18? -14 Calculate -3 + -5 + 7 + (8 - 3) - -5. 9 Calculate 0 + -5 + 3 + (-6 - -5). -3 Evaluate 0 + 9 + (-8 - 18) - -9. -8 -26 + (6 - (-1 + 4)) - (97 + -101) -19 (0 - -12) + -3 + 12 + -28 + 12 5 Calculate 1 - (-1 - ((7 - -1) + 0)). 10 (6 - ((-12 - -19) + (1 - 0))) + 3 1 (79 - 80) + (17 - (1 - -2)) 13 What is the value of 8 - 11 - ((1 - 1) + -8) - 7? -2 Evaluate 25 - ((1 - -9) + -1 + -6). 22 What is (-1 - -7) + (222 - 246)? -18 Evaluate -57 + 47 - (21 - 1) - -9. -21 -15 - (10 - 19) - (8 + -7) -7 Evaluate -26 - (8 - (11 - 2 - (0 - 3))). -22 What is -4 - -13 - (118 + -121)? 12 What is 0 - -5 - (-6 - (1 + 3 + -6))? 9 Evaluate -2 - 3 - (7 - 3) - 3. -12 Evaluate -1 - (0 - (2 + 2) - (-4 + 1)). 0 What is -115 - -102 - (1 - -1)? -15 Calculate 2 + -1 + (-298 + 277 - (-10 + 0)). -10 What is the value of 13 + (0 + 9 - 16) + 7? 13 What is the value of -13 - (2 + 2 + -36 + 25)? -6 3 + (-2 + -1 - (-8 + 7 - 4)) 5 Evaluate (13 - (17 + -1)) + -18. -21 Evaluate 12 + 3 - (36 + -16). -5 Calculate 25 + -68 + 4 + 21. -18 Calculate (-57 - (9 + -37)) + 24. -5 What is 2 + -5 + (9 - (2 + (1 - -2)))? 1 -22 + -21 + 48 + (1 - -5) 11 Evaluate -6 - (16 + -22) - (0 + 9). -9 What is (-496 - -457) + (2 - (-2 + -10))? -25 What is -42 - (-6 - (5 + 4))? -27 What is the value of -9 + 5 + 24 + -40? -20 What is (20 + 36 - 25) + -13? 18 Calculate -1 + (2 - 1) + (6 - 0 - 6). 0 Evaluate -120 + 106 + (-1 - -12). -3 Calculate 6 + -2 - (-15 + 15). 4 Calculate 11 + -18 + 1 - 0 - (24 - -1). -31 Calculate (-9 + 15 - (2 + -6)) + -15. -5 Calculate (-5 - 32) + 11 - -8. -18 -43 + 13 + (0 - 1 - -13) -18 What is 2 + -1 + 1011 + -1009? 3 What is the value of -26 + 0 + (24 - (18 - 0))? -20 Calculate 12 + (4 - 18) + -32. -34 0 + -7 + -4 - -5 - (4 + 5) -15 (-8 - 0) + (11 - (-1 - -10)) + 30 24 Calculate 14 + (16 - 15) - 11. 4 What is -8 + (-3 - -4 - 2 - (-17 - -11))? -3 Calculate -6 - 4 - -16 - (6 + (3 - 4)). 1 What is 45 + -35 + (-8 - -4)? 6 17 + (21 - 9 - 14) + 1 + 0 16 -9 + 1 + (37 - 35) -6 What is the value of -12 + -5 + 1 + 4 + -8 + 10? -10 Evaluate 0 + 3 - (-6 - (-8 + 4)). 5 Calculate 5 - (-9 - (-2 - (0 + -5 - -39))). -22 5 + -2 + 6 + -3 + 0 6 Calculate ((-5 - 5) + 16 - 12 - -3) + -7. -10 Calculate (56 - 32) + 4 + -44. -16 What is the value of -12 + 15 + -4 + -22? -23 What is 7 - (7 + -1 - (-136 + 132))? -3 -26 - (36 + -8 + -51) -3 What is -7 + -9 - 7 - -19? -4 What is (22 + 0 - 17) + 17? 22 Calculate 42 + 24 + -55 + 11. 22 What is the value of (4 - 21) + 29 + (2 - 5)? 9 What is (144 - 172) + -1 + 3? -26 (3 - (-10 + 8 + -4)) + -19 -10 What is (27 - 39 - (-1 + -9)) + -9? -11 What is the value of -1 - (22 - 9 - 19)? 5 Evaluate (-17 - -27) + -12 + -10. -12 What is 0 + -16 + 8 + (-28 - -31)? -5 -2 + -3 + 0 + (-8 - (5 - 9)) -9 What is 0 + 4 + 2 + -1 + -8? -3 Evaluate -21 + (37 - -4) + -9. 11 Calculate (2 + -1 - (-10 + 16)) + -1 + -11. -17 Cal	{ "pile_set_name": "DM Mathematics" }
)*2(h - 1)(h + 4)/5 Factor 2d*2/9 - 5438d/9 - 5440/9. 2(d - 2720)(d + 1)/9 Find s such that -s*2/7 + 47s/7 = 0. 0, 47 Suppose 270t4 - 15t*3 - 280t*2 + 15t + 10 = 0. What is t? -1, -1/6, 2/9, 1 Find y, given that 2y2/11 + 18y/11 = 0. -9, 0 Factor -4t4 + 14t*3 - 4t*2 - 6t. -2t(t - 3)(t - 1)(2t + 1) Find u such that -2u*4 - 4u*3 + 38u*2 - 56u + 24 = 0. -6, 1, 2 Solve -h*4/5 + 7h*3/5 + 14h*2/5 - 24h = 0 for h. -4, 0, 5, 6 Factor 5y4 + 55y*3 - 5y*2 - 55y. 5y(y - 1)(y + 1)(y + 11) Factor 122m3 + 370m*2 + 256m + 8. 2(m + 1)(m + 2)(61m + 2) Factor 5s3 + 280s*2 - 575s + 290. 5(s - 1)2(s + 58) Factor -y*3/6 + 3y*2/2 - 23y/6 + 5/2. -(y - 5)(y - 3)(y - 1)/6 Factor -f*2 + 94f - 93. -(f - 93)(f - 1) Factor 2f*5/5 + 12f*4/5 + 4f*3/5 - 8f*2 - 54f/5 - 4. 2(f - 2)(f + 1)*3(f + 5)/5 Suppose -b*2 - 726b + 727 = 0. Calculate b. -727, 1 What is x in -2x3/19 + 4x*2 - 10x - 700/19 = 0? -2, 5, 35 Factor n*3/2 + 24n*2 - 50n. n(n - 2)(n + 50)/2 Factor -2g2/7 + 286g/7 + 288/7. -2(g - 144)(g + 1)/7 Factor -m*3/4 - 20m*2 + 507m/4 - 387/2. -(m - 3)*2(m + 86)/4 Factor 2o2/13 - 2o + 44/13. 2(o - 11)(o - 2)/13 Factor 2b3 - 34b*2 - 160b - 168. 2(b - 21)(b + 2)*2 Let 3z*2/2 + 25z/3 - 4 = 0. What is z? -6, 4/9 Suppose -2p5/5 + 52p*4/5 + 234p*3/5 + 36p*2 = 0. Calculate p. -3, -1, 0, 30 Solve -30g*3 - 28g*2 + 6g + 4 = 0. -1, -1/3, 2/5 Factor 2z5 + 384z*4 + 18810z*3 + 36100z*2. 2z*2(z + 2)(z + 95)2 Factor -9c*4 - 319c*3 + 517c*2 - 41c - 148. -(c - 1)*2(c + 37)(9c + 4) Solve -4p3 + 168p*2 + 1980p + 5200 = 0 for p. -5, 52 Factor 4k5 + 16k*4 - 76k*3 + 56k*2. 4k*2(k - 2)(k - 1)(k + 7) Factor 58i3 - 750i*2 - 52i. 2i(i - 13)(29i + 2) Let -2c3 + 1220c*2 + 3674c + 2452 = 0. What is c? -2, -1, 613 Suppose -64o4/3 - 544o*3/3 - 484o*2/3 + 952o - 588 = 0. What is o? -21/4, 1 What is a in a*2/5 - 1256a/5 - 1257/5 = 0? -1, 1257 Suppose -4f3 - 112f*2 + 4f + 112 = 0. Calculate f. -28, -1, 1 Factor f*3 - 23f*2 + 56f + 980. (f - 14)*2(f + 5) Solve 3d2 - 1566d + 204363 = 0 for d. 261 Suppose o*4 + 23o*3 + 128o*2 + 268o + 192 = 0. What is o? -16, -3, -2 Determine i so that i*2 + 30i - 64 = 0. -32, 2 Determine k so that 15k2/4 - 9k - 27/4 = 0. -3/5, 3 Determine b, given that -b*2/5 - 47b/5 - 132/5 = 0. -44, -3 Find d, given that -2d3/7 + 8d*2/7 + 90d + 3564/7 = 0. -9, 22 Factor -3f5 - 156f*4 - 588f*3 - 576f*2. -3f*2(f + 2)*2(f + 48) Let -2j3 + 102j*2 - 384j + 376 = 0. Calculate j. 2, 47 Let -30g4/17 - 8g*3/17 + 8g*2/17 = 0. Calculate g. -2/3, 0, 2/5 Factor -4f*4 - 28f*3 - 32f*2 + 64f. -4f(f - 1)(f + 4)2 Factor 2o*4/7 + 18o*3/7 + 30o*2/7 - 50o/7. 2o(o - 1)(o + 5)2/7 Suppose -3n*5/7 + 6n*4/7 + 24n*3/7 = 0. What is n? -2, 0, 4 What is i in -2i*2 - 46i - 44 = 0? -22, -1 Factor -j*5 + 21j*4 - 137j*3 + 279j*2 - 162j. -j(j - 9)2(j - 2)(j - 1) Solve -5z*2/4 + 45z - 405 = 0. 18 Factor -2f2/5 + 102f/5 - 936/5. -2(f - 39)(f - 12)/5 Determine l so that 2l3/21 - 80l*2/21 - 8l/21 + 320/21 = 0. -2, 2, 40 Factor 15i3 - 24i*2 - 57i/5 - 6/5. 3(i - 2)(5i + 1)2/5 Determine h, given that -3h*4 + 6h*3 + 15h*2 - 18h = 0. -2, 0, 1, 3 Find o such that -375700o3/7 + 444720o*2/7 + 21552o/7 + 256/7 = 0. -2/85, 16/13 Let -2z4/3 + 4z*3 + 10z*2 + 16z/3 = 0. What is z? -1, 0, 8 Suppose -4d4 - 116d*3 + 736d*2 + 1904d = 0. What is d? -34, -2, 0, 7 Factor -w*2 + 33w - 182. -(w - 26)(w - 7) Find n, given that 2n*5 - 38n*4 - 42n*3 + 38n*2 + 40n = 0. -1, 0, 1, 20 Determine z, given that -2z5 - 12z*4 + 1584z*3 + 3232z*2 - 326304z + 627264 = 0. -22, 2, 18 Factor 2j2/5 + 34752j/5 + 150962688/5. 2(j + 8688)2/5 Suppose z4/5 + 2z3/5 - z2/5 - 2z/5 = 0. Calculate z. -2, -1, 0, 1 Factor u4/2 + 9u*3 + 121u*2/2 + 180u + 200. (u + 4)*2(u + 5)*2/2 Determine p, given that -2p*4/11 - 2p*3/11 + 24p*2/11 - 8p/11 - 32/11 = 0. -4, -1, 2 Factor 5i3 - 760i*2 + 1505i - 750. 5(i - 150)(i - 1)2 Determine a, given that a2/10 - 5a/2 - 13/5 = 0. -1, 26 Suppose -v2/4 + 31v/4 = 0. What is v? 0, 31 Factor p*5 + 2p4 + p3. p*3(p + 1)*2 Determine c, given that 3c*4 + 114c*3 + 417c*2 + 306c = 0. -34, -3, -1, 0 Factor x*4/6 + 5x*3/2 - 11x*2/2 + 17x/6. x(x - 1)2(x + 17)/6 Find z, given that z*2 + 2z = 0. -2, 0 Determine q, given that -2q4/3 + 2q*3 - 8q/3 = 0. -1, 0, 2 Determine z so that 6z4/7 + 72z*3 + 492z*2/7 - 72z - 498/7 = 0. -83, -1, 1 Factor 18p4 - 34p*3 + 14p*2 + 2p. 2p(p - 1)*2(9p + 1) Let -c4/5 + 9c*3/5 + 2c*2/5 - 72c/5 - 64/5 = 0. Calculate c. -2, -1, 4, 8 Suppose -h*4 + 7h*3/2 - 5h*2/2 = 0. Calculate h. 0, 1, 5/2 Suppose 4x*4 + 16x*3 - 48x*2 = 0. What is x? -6, 0, 2 Factor -3g*2 + 54g - 243. -3(g - 9)2 Suppose -3q*5 + 9q*4 + 6q*3 - 36q*2 + 24q = 0. What is q? -2, 0, 1, 2 Suppose -m*2/4 - 16m - 63/4 = 0. Calculate m. -63, -1 Factor -r*3/5 - 9r*2/5 + 53r + 273/5. -(r - 13)(r + 1)(r + 21)/5 Suppose 3d4 - 90d*3 - 3d*2 + 90d = 0. What is d? -1, 0, 1, 30 Factor 2q5 - 14q*4 - 6q*3 + 46q*2 - 28q. 2q(q - 7)(q - 1)2(q + 2) Solve -h*5/4 + 29h*4/4 + 81h*3/2 + 67h*2 + 34h = 0. -2, -1, 0, 34 Solve -3b4/2 + 165b*3 - 5166b*2 + 5043b + 2687919/2 = 0. -13, 41 Solve i*2 - 13i - 30 = 0. -2, 15 Factor -3b3/2 + 1335b*2/2. -3b*2(b - 445)/2 Solve 18n3 + 2285n*2 - 127n = 0. -127, 0, 1/18 Find x such that -6x3/7 - 502x*2/7 + 24x = 0. -84, 0, 1/3 Suppose -3t3 - 60t*2 + 276t - 288 = 0. Calculate t. -24, 2 Factor l*2/3 + 59l/3 + 58/3. (l + 1)(l + 58)/3 Determine c, given that c4/4 - 3c*3 + 39c*2/4 - 7c = 0. 0, 1, 4, 7 Factor -3m2/5 - 309m/5. -3m(m + 103)/5 Factor 4z4 + 4z*3 - 8z*2. 4z*2(z - 1)(z + 2) Suppose 12l*3/7 - 20l*2/7 + 8l/7 = 0. Calculate l. 0, 2/3, 1 Factor a*3/3 - 614a*2 + 376996a - 231475544/3. (a - 614)*3/3 Determine o so that -2o*5/11 - 48o*4/11 - 240o*3/11 - 448o*2/11 - 288o/11 = 0. -18, -2, 0 Factor 676k5 + 7176k*4 + 22320k*3 + 21600k*2. 4k*2(k + 6)(13k + 30)*2 Suppose 3h*3 + 23h*2/2 - 3h - 4 = 0. Calculate h. -4, -1/2, 2/3 Let 84v3 + 232v*2 + 140v + 24 = 0. What is v? -2, -3/7, -1/3 Solve -4y3/3 - 1172y*2/3 + 4736y/3 - 1584 = 0 for y. -297, 2 Determine r so that -7r4 + 15r*3 - 8r*2 = 0. 0, 1, 8/7 Factor 2l*2 + 6l - 36. 2(l - 3)(l + 6) Solve -4q5 + 56q*4 + 296q*3 - 5584q*2 + 10076q - 4840 = 0. -10, 1, 11 Factor 5k4 + 55k*3 - 60k*2. 5k*2(k - 1)(k + 12) Solve -l2 - 56l - 784 = 0 for l. -28 Factor -2f4 - 998f*3 - 124998f*2 - 124002f. -2f(f + 1)(f + 249)2 Factor -2l*4 + 254l*3 - 502l*2 + 250l. -2l(l - 125)(l - 1)2 Suppose q4 - 17q*2 + 36q - 20 = 0. Calculate q. -5, 1, 2 What is v in v*3/3 + 540v*2 + 219239v + 1308962/3 = 0? -809, -2 Factor 2k2/5 + 344k/5 + 14792/5. 2(k + 86)2/5 Determine v so that 2v*5/3 - 8v*3/3 = 0. -2, 0, 2 Factor -3c*2 - 5907c. -3c(c + 1969) Factor 4v3 + 496v*2 + 14868v - 31752. 4(v - 2)(v + 63)*2 Determine p, given that 8p*5/23 + 1032p*4/23 + 32746p*3/23 - 35624p*2/23 - 59670p/23 - 16900/23 = 0. -65, -1/2, 2 Solve -4z2/7 + 712z/7 = 0 for z. 0, 178 Solve -4l3 + 40l*2 + 4l - 40 = 0 for l. -1, 1, 10 Let 2j4/3 - 8j*3 - 18j*2 - 28j/3 = 0. What is j? -1, 0, 14 Factor -u*3/3 - 22u*2/3 + 4u/3 + 88/3. -(u - 2)(u + 2)(u + 22)/3 What is s in 5s4 - 85s*3 + 340s*2 - 500s + 240 = 0? 1, 2, 12 Factor -y*2/10 + 121y/5 + 244/5. -(y - 244)(y + 2)/10 Solve -2x*2/9 + 86x/3 + 524/9 = 0 for x. -2, 131 Factor -2y3/11 - 196y*2/11 - 378y/11 + 576/11. -2(y - 1)(y + 3)(y + 96)/11 Find r such that 2r*5/5 - 18r*4/5 + 38r*3/5 - 6r*2/5 - 8r + 24/5 = 0. -1, 1, 2, 6 Solve -7v4/3 + 3v*3 + 4v*2 - 4v/3 = 0 for v. -1, 0, 2/7, 2 Factor 2p3 + 2p*2 - 4p. 2p(p - 1)(p + 2) Factor 2v*3/3 + 2v*2 - 236v/3 - 80. 2(v - 10)(v +	{ "pile_set_name": "DM Mathematics" }
many micrometers are there in 27/4 of a centimeter? 67500 How many seconds are there in 45/2 of a minute? 1350 How many millimeters are there in 8.561594um? 0.008561594 How many millimeters are there in 8.892095cm? 88.92095 Convert 54.37569 milligrams to tonnes. 0.00000005437569 How many nanoseconds are there in seventy-three fifths of a microsecond? 14600 What is 188104.3ml in litres? 188.1043 How many minutes are there in one tenth of a week? 1008 What is seven eighths of a kilogram in grams? 875 How many tonnes are there in 2.167939kg? 0.002167939 How many grams are there in 0.6011741ng? 0.0000000006011741 How many milliseconds are there in nine tenths of a second? 900 Convert 98.0225 millennia to years. 98022.5 How many litres are there in 8774.025ml? 8.774025 How many nanograms are there in 5/8 of a microgram? 625 What is 706830.5 millilitres in litres? 706.8305 What is 7715.451kg in micrograms? 7715451000000 What is 0.6659533 milligrams in micrograms? 665.9533 How many litres are there in 46608.43 millilitres? 46.60843 Convert 344343.9 litres to millilitres. 344343900 What is 7457.23314s in weeks? 0.01233008125 Convert 68.88165 weeks to microseconds. 41659621920000 What is 7/2 of a centimeter in millimeters? 35 How many hours are there in 55/4 of a week? 2310 What is one sixteenth of a milligram in nanograms? 62500 What is eleven tenths of a litre in millilitres? 1100 How many millilitres are there in eleven quarters of a litre? 2750 How many milliseconds are there in 6/5 of a minute? 72000 What is 3/10 of a day in seconds? 25920 What is 3/5 of a decade in months? 72 What is 39435.51m in micrometers? 39435510000 What is 175.1078 decades in years? 1751.078 What is 965950.5 nanograms in milligrams? 0.9659505 How many minutes are there in 68/3 of a day? 32640 What is 338.9504 decades in millennia? 3.389504 How many years are there in 47/4 of a century? 1175 What is 0.6156546 kilometers in micrometers? 615654600 How many micrometers are there in 9/10 of a millimeter? 900 How many millilitres are there in eleven eighths of a litre? 1375 How many centimeters are there in 13/4 of a meter? 325 What is 87.19649 nanometers in centimeters? 0.000008719649 What is 5/8 of a decade in months? 75 How many millimeters are there in 21/2 of a centimeter? 105 How many seconds are there in three fifths of a day? 51840 How many millilitres are there in 98417.27 litres? 98417270 How many hours are there in 721435.41s? 200.398725 What is 32/5 of a litre in millilitres? 6400 How many seconds are there in 19/4 of a hour? 17100 What is 27/2 of a week in hours? 2268 How many minutes are there in ten thirds of a hour? 200 How many micrograms are there in 1.756472t? 1756472000000 What is eleven eighths of a tonne in kilograms? 1375 What is three eighths of a hour in seconds? 1350 Convert 66.98664 milliseconds to hours. 0.0000186074 How many micrograms are there in 7/8 of a milligram? 875 Convert 14182.45ml to litres. 14.18245 Convert 0.1054592 minutes to nanoseconds. 6327552000 What is eighty-seven halves of a litre in millilitres? 43500 How many months are there in 10/3 of a decade? 400 What is 3/5 of a kilometer in meters? 600 What is 0.74692 millilitres in litres? 0.00074692 Convert 1.93053 tonnes to kilograms. 1930.53 How many millilitres are there in seven eighths of a litre? 875 How many centimeters are there in 1/4 of a kilometer? 25000 What is 2/15 of a decade in months? 16 What is 3457.995 milliseconds in seconds? 3.457995 What is 607.3262 micrometers in meters? 0.0006073262 Convert 13.4116 meters to centimeters. 1341.16 Convert 59.445954 nanoseconds to days. 0.000000000000688031875 What is twenty ninths of a hour in seconds? 8000 What is seventy-five halves of a millennium in centuries? 375 What is 1049.574 millimeters in micrometers? 1049574 What is 1/4 of a litre in millilitres? 250 How many milligrams are there in 6/25 of a gram? 240 What is fifteen quarters of a tonne in kilograms? 3750 How many millilitres are there in 1370.904l? 1370904 What is seventeen quarters of a millimeter in micrometers? 4250 How many micrograms are there in one twentieth of a milligram? 50 How many millilitres are there in fourty-three quarters of a litre? 10750 What is 7.73028 years in decades? 0.773028 What is 4.826123 kilometers in nanometers? 4826123000000 What is 32.74452t in micrograms? 32744520000000 Convert 141382.9l to millilitres. 141382900 What is 1/24 of a day in seconds? 3600 What is 21/5 of a kilometer in meters? 4200 How many months are there in 3.30491 millennia? 39658.92 What is 68.81421t in micrograms? 68814210000000 Convert 4939.671kg to tonnes. 4.939671 How many grams are there in 936.7815t? 936781500 How many kilometers are there in 0.5633208um? 0.0000000005633208 How many milligrams are there in fourty-five eighths of a gram? 5625 What is 6.465844 hours in milliseconds? 23277038.4 How many decades are there in twenty-one quarters of a millennium? 525 What is 6.52928 centuries in millennia? 0.652928 How many millilitres are there in seven halves of a litre? 3500 How many millilitres are there in 53/5 of a litre? 10600 How many centimeters are there in 11.89273nm? 0.000001189273 How many millilitres are there in 3/25 of a litre? 120 Convert 4842.849 millilitres to litres. 4.842849 What is 43367.55s in minutes? 722.7925 What is 3/28 of a week in hours? 18 What is 8.804737 hours in minutes? 528.28422 Convert 927.3099 millennia to centuries. 9273.099 What is 10/9 of a hour in seconds? 4000 How many meters are there in 6691.667cm? 66.91667 How many months are there in 1/16 of a millennium? 750 Convert 871256.4 grams to milligrams. 871256400 How many milligrams are there in twenty-seven halves of a gram? 13500 Convert 9360.822 nanograms to micrograms. 9.360822 What is nine tenths of a litre in millilitres? 900 What is 487246.4 millilitres in litres? 487.2464 Convert 992006.6 millennia to years. 992006600 How many millilitres are there in 77/2 of a litre? 38500 How many months are there in 78.62075 millennia? 943449 What is fourty-two fifths of a micrometer in nanometers? 8400 What is 6/25 of a litre in millilitres? 240 Convert 5931.45ml to litres. 5.93145 How many micrometers are there in seven eighths of a centimeter? 8750 How many micrometers are there in 3/5 of a centimeter? 6000 What is 35.45401kg in tonnes? 0.03545401 How many litres are there in 42.72286ml? 0.04272286 What is 55/4 of a tonne in kilograms? 13750 What is 23/6 of a hour in seconds? 13800 Convert 48.10062 milligrams to micrograms. 48100.62 Convert 431.3463 minutes to seconds. 25880.778 How many micrograms are there in 930597.7g? 930597700000 How many minutes are there in 43230.33 seconds? 720.5055 How many grams are there in 205806.2 tonnes? 205806200000 Convert 468714.5 days to microseconds. 40496932800000000 What is 3/25 of a milligram in micrograms? 120 What is 7/4 of a microgram in nanograms? 1750 What is 3042.595 years in centuries? 30.42595 What is sixty-seven fifths of a tonne in kilograms? 13400 How many months are there in thirty-one halves of a century? 18600 What is 1.2708 years in millennia? 0.0012708 How many years are there in fourty-nine quarters of a century? 1225 Convert 223276.5 months to years. 18606.375 Convert 19244.27 hours to microseconds. 69279372000000 How many decades are there in 8035.38 millennia? 803538 What is 327380.4 centuries in months? 392856480 What is 75.23623 meters in kilometers? 0.07523623 Convert 73262.74 meters to kilometers. 73.26274 Convert 980.6829cm to meters. 9.806829 How many millimeters are there in twenty-nine fifths of a centimeter? 58 How many millilitres are there in twenty-one halves of a litre? 10500 Convert 81.44598km to centimeters. 8144598 How many months are there in 5/6 of a year? 10 Convert 39035.3 millennia to decades. 3903530 How many minutes are there in 10502.151ms? 0.17503585 How many years are there in 3769.406 millennia? 3769406 How many years are there in 68.91857 millennia? 68918.57 How many milliseconds are there in 3/8 of a minute? 22500 What is thirty-seven halves of a micrometer in nanometers? 18500 What is eighteen fifths of a millennium in years? 3600 What is 13/4 of a kilogram in grams? 3250 How many years are th	{ "pile_set_name": "DM Mathematics" }
20x2 - 6336x + 12 Differentiate l*3s - 2254l3y*3 - 5s*2y*3 - 7595s*2 with respect to y. -6762l*3y*2 - 15s*2y*2 What is the third derivative of -3z*5 - 2z*4 + 2323z*3 + 17z*2 + 8z + 5 wrt z? -180z2 - 48z + 13938 What is the third derivative of -5p3q*3 - 12p*3q*2 + 4p*3q - pq - 247426q*3 - 15q wrt q? -30p3 - 1484556 What is the third derivative of k2w*3 - 326k*2w*2 + 2kw3 + 9979w*3 + 3w*2 + 4 wrt w? 6k*2 + 12k + 59874 Find the second derivative of -1009682c2f - cf + 664f + 168 wrt c. -2019364f Find the second derivative of -42h*4 - 2h*3 - 27h*2 + 29346h. -504h2 - 12h - 54 Find the first derivative of 14215u4 - 3u*2 - 4u - 3226981 wrt u. 56860u3 - 6u - 4 What is the first derivative of -6452y2 + 22y - 4793352? -12904y + 22 What is the second derivative of 359762x*2 + 6x + 13816 wrt x? 719524 Find the third derivative of -38895c3 - 14672c*2. -233370 Differentiate 1287n*2 + 432n - 2960308 with respect to n. 2574n + 432 Find the third derivative of 2o*4 - 83368o3 + o2 - 840674 wrt o. 48o - 500208 What is the derivative of p4 + 212p*3 - 11p + 13257? 4p3 + 636p2 - 11 What is the second derivative of -j3 - 9854j2 - 414698j wrt j? -6j - 19708 Find the first derivative of -4562493lx2 - 2413238x*2 wrt l. -4562493x*2 Find the third derivative of 1122924n*3 - 270256n*2 wrt n. 6737544 What is the first derivative of 241381i*4 + 245628? 965524i*3 Find the third derivative of -285n*2t*5 + 1322n*2t*2 + 2nt + 72t*5 + 9 wrt t. -17100n*2t*2 + 4320t*2 Find the third derivative of 11a*4m*2 - 2a*4 - 266a*3 + 4a*2m*2 - 97a*2 - 2am - 18m*2 wrt a. 264am2 - 48a - 1596 Find the second derivative of 10891o3u*3 + 1497o*3 + 2o*2u - 16u3 - 317u wrt u. 65346o3u - 96u Find the second derivative of 38nq4 + 178nq2 + 15690nq + 2nw2 + q3w*2 - qw*2 wrt q. 456nq2 + 356n + 6qw*2 What is the first derivative of -44005jlx*2 - jl + 2jx + 262j + 3535 wrt x? -88010jlx + 2j What is the second derivative of 2f*2p*2 - 43412f*2p - 3331fp*2 + 3f - 1 wrt f? 4p2 - 86824p Find the third derivative of -5647h4 + 3h*3 + 7h*2 + 2h - 731. -135528h + 18 Find the second derivative of 1023t*5 - 6t*3 + 12t*2 - 293687t. 20460t3 - 36t + 24 Find the third derivative of 7cw*5 - 3cw4 + 21cw2 - 3cw - 11w*4 + 20w*2 + 4w wrt w. 420cw*2 - 72cw - 264w Find the first derivative of -76a3g - 38624a3 + 55ag wrt g. -76a*3 + 55a Find the third derivative of 2p6 - p5 - 188p*4 + 2727p*2 - 9 wrt p. 240p*3 - 60p*2 - 4512p What is the third derivative of 434071k3w5 + k3w4 - 7k*3 + 92k*2w - 22kw + 2w2 wrt w? 26044260k*3w*2 + 24k*3w What is the third derivative of -53l5 + 159l*3 - 3900l*2 + 2l + 3? -3180l2 + 954 Find the second derivative of 112005r*3 - 54543r + 4 wrt r. 672030r What is the second derivative of 2386486f*2 + 36f - 41662? 4772972 What is the second derivative of 92699q2 + 3q + 151935 wrt q? 185398 Differentiate -25i3 - 135i*2 - 70641. -75i*2 - 270i What is the second derivative of -61l2m*2 - 452l*2m + 2l2 + 2lm2 - 867265lm wrt l? -122m*2 - 904m + 4 Differentiate -67660b3 + 23360 with respect to b. -202980b*2 Find the first derivative of -1639706a*2 - 2a - 2989452. -3279412a - 2 Differentiate -27559o - 7907. -27559 What is the second derivative of 8h5 + 33h*4 - 13h*3 + h - 853000 wrt h? 160h*3 + 396h*2 - 78h Differentiate 708km*2n - 2km*2 + 2kn + 41m*2n + 219882m2 with respect to n. 708km2 + 2k + 41m2 Find the first derivative of r3v + 22r3x + 2r2vx - 133r*2x + 2r2 + 3253rv - 2vx - 2 wrt v. r3 + 2r*2x + 3253r - 2x Find the first derivative of -14i2x + 12493i2 - 1537ix - 5i + 3x wrt x. -14i*2 - 1537i + 3 Find the third derivative of -170246c3 + 3607178c*2 + c wrt c. -1021476 Find the second derivative of -3h*3vy2 - 7h*3vy - h3v - 56h3y*2 + 2hvy*2 - 4hvy - 3hy - 2h wrt y. -6h*3v - 112h3 + 4hv Find the third derivative of w4 - 645w*3 + 291509w*2 wrt w. 24w - 3870 Find the first derivative of 81491a2d*2 + ad*2 + 2428d*2 + d - 4 wrt a. 162982ad2 + d2 Find the third derivative of 2261429i*3 + 3889055i*2 wrt i. 13568574 Find the second derivative of 3231281r*2 - 286288r. 6462562 Find the third derivative of -3095k3t*2w*3 + 5233k*3w + 2kt*2w*2 - 4w*4 wrt w. -18570k*3t*2 - 96w What is the second derivative of 861m5z + 117m3z - 313mz + 100z wrt m? 17220m*3z + 702mz Find the second derivative of 457g3i*2 - 32g*3i + 118g3 - 45i*2 wrt i. 914g*3 - 90 Find the second derivative of -4a*2h*4 - 231a*2h + 2ah + a - 30h4 + 424h*2 - 10h wrt h. -48a2h*2 - 360h*2 + 848 Differentiate 997787o + 43478 with respect to o. 997787 What is the second derivative of 328412p2t*3 + pt*2 + 190pt + 10t3 + t2 + 1 wrt p? 656824t3 What is the third derivative of 2030782r*4 - 916r*2 + 143r? 48738768r What is the second derivative of 2lu2w + 35lu*2 - 2lu - 2246lw - u2w - 264u2 + uw - 12w wrt u? 4lw + 70l - 2w - 528 Find the second derivative of 504602i*5 + 594172i wrt i. 10092040i3 Find the second derivative of 2890b*4 - 189b*3 + b + 1139223 wrt b. 34680b*2 - 1134b Differentiate -18193t2vy - t2y + t*2 + 2tv + 9v - 4y - 1721 wrt v. -18193t*2y + 2t + 9 What is the second derivative of 281246d*4h*2 + dh*2 + 40dh - 34d + 2h2 - 11 wrt d? 3374952d*2h*2 What is the third derivative of -124523l*3 + 31695l*2 wrt l? -747138 What is the derivative of glw2 - 1881glw + 16gw*2 + 406g - 2lw2 + w2 wrt l? gw2 - 1881gw - 2w*2 Find the first derivative of -3n*2u - 704nu*2w + nuw - n - 2u2w - uw + 6996u + 18 wrt n. -6nu - 704u2w + uw - 1 Find the third derivative of -38723w*4 + 1243w*2 + 10w wrt w. -929352w What is the second derivative of 73mpq*2 - 7483mpq + 6239mq*2 + 25mq + q wrt q? 146mp + 12478m Differentiate 155l4 + 204l + 910797. 620l3 + 204 Find the first derivative of 3h*2jx + 3h*2x - 5h2 + 2hj - 22h - 136jx - 85j - 8x + 4 wrt x. 3h2j + 3h2 - 136j - 8 What is the second derivative of -10wz*5 + 1200wz2 + 246689wz - 3w + z*4 - z wrt z? -200wz3 + 2400w + 12z2 Find the second derivative of 2713mn3 + mn*2 + 2mn - 30m + 10n wrt n. 16278mn + 2m What is the second derivative of 2093702i3 + 27067i - 46 wrt i? 12562212i Find the third derivative of -49h*3m*4 - 16h*3m3 - h3m2 + 4h*3 + 3h*2m2 + h2m + 5m*4 wrt m. -1176h*3m - 96h3 + 120m What is the second derivative of 39p5 + 192p*4 + 40396p - 2 wrt p? 780p3 + 2304p*2 Differentiate -2g*2oq - 35543g*2q - 2g2 + go - 5oq + 589o - 4q + 10 with respect to g. -4goq - 71086gq - 4g + o Find the third derivative of -762io*3 + 391io2t - 68it + 2o3t - 76o3 + o2t wrt o. -4572i + 12t - 456 Find the first derivative of -323p4 - 10p3 - p2 + 3271. -1292p3 - 30p*2 - 2p What is the third derivative of 10f4x*2 - 44f*3x*3 + 33f*3 + 22f*2 - 3fx3 - 1221fx + 2x*3 wrt f? 240fx2 - 264x3 + 198 What is the derivative of q4 + 3024q2 - 3q + 129095 wrt q? 4q3 + 6048q - 3 Differentiate 8199q2 + 56321 with respect to q. 16398q What is the third derivative of 58451m6 + 4m*3q*3 + 5m*2q*3 + 3m*2q*2 - 34q*3 - 37 wrt m? 7014120m*3 + 24q*3 Differentiate 34hj + 32066h - 6409j2 - 8 wrt j. 34h - 12818j Differentiate 2l*3 - 174l*2 + 5l - 66596 with respect to l. 6l2 - 348l + 5 Differentiate 326d3rv + 19d*3 + 867d*2rv + 5516r wrt v. 326d3r + 867d2r What is the first derivative of -750317m2 - 1273723? -1500634m Differentiate -647b3 + 4b + 49767 with respect to b. -1941b*2 + 4 Find the	{ "pile_set_name": "DM Mathematics" }
c*(-1/13)c) assuming c is positive. c(-64/13) Simplify (d(-1/5))*0(d(-1/3))(-19) assuming d is positive. d(19/3) Simplify j11((jjj/j(1/3))/j)/j assuming j is positive. j(35/3) Simplify (c/(cc*(-2/19)/c))/cccc(11/3) assuming c is positive. c(329/57) Simplify (ss(5/2))/((s2s)/s)(s/s0)/s(-1/4) assuming s is positive. s(11/4) Simplify (hh(4/7))/(h(1/6)h) assuming h is positive. h(17/42) Simplify (k(-13)k(-2))(-24) assuming k is positive. k360 Simplify (p/p(-2/5)p(pp2)/pp)(6/13) assuming p is positive. p(162/65) Simplify m*(-8)(mm(-2/5))/m(m(2/9))(-10) assuming m is positive. m(-478/45) Simplify ((g8/g)/(gg8/g))/(g(2/3))(4/5) assuming g is positive. g(-23/15) Simplify z(-8)z(6/11) assuming z is positive. z(-82/11) Simplify iii/i*8ii(-2/5)(i/i*(2/15)i)/iii6/i assuming i is positive. i(37/15) Simplify (p*4/(pppp*(1/2)))/((ppp4p)/(p(p(-6)p)/p)) assuming p is positive. p*(-23/2) Simplify kk*(4/3)kkkk(2/9)k assuming k is positive. k*(59/9) Simplify ((zz*(-5)zzz)/(z(4/3)/z))(10/9) assuming z is positive. z(-40/27) Simplify ((o/(o(1/2)/o))/o)/oo20 assuming o is positive. o(39/2) Simplify f/f6fff*(-1/9)f*(-3/4)/(ff*(-1)f) assuming f is positive. f*(-175/36) Simplify ((n/(n/(nn/n*(-8))))/n)/(nn(-1/3)) assuming n is positive. n(25/3) Simplify (i/(iii((iii/((i(((i*(-26)ii)/i)/ii)/i)/i))/i)/i))/(ii(-36/5)) assuming i is positive. i(-114/5) Simplify (mm/m*1(m/m*(-3))/mmm)/(m(-2/11)/(m/((m(3/4)m)/m))) assuming m is positive. m*(283/44) Simplify ii*(-3/16)iii(-13/5)/i assuming i is positive. i(-63/80) Simplify h/h*24h/h(-19) assuming h is positive. h(-3) Simplify (m(9/5)/m)/(m6/m) assuming m is positive. m(-21/5) Simplify i(-10)(i/i(2/67))/i assuming i is positive. i(-672/67) Simplify (p/p(-4/5)p*(6/11)/p)/((p/(p/(p/(pp*(-2)p))))/p)(-30/11) assuming p is positive. p(74/55) Simplify (m*(-1/10)((m/(m*8m))/mm)/m)(-1/8) assuming m is positive. m(91/80) Simplify l(5/2)l(l/(l(-38)/l)l)/l assuming l is positive. l(87/2) Simplify (x(-1/6)x/((x/x(1/3))/x))(2/57) assuming x is positive. x(7/171) Simplify (l(-4/3)/l0)/((ll(-2/9))/(l/((l(-2/15)/l)/l))) assuming l is positive. l(46/45) Simplify (d/(d/d(-2/37)))/(d/d(-1/23)) assuming d is positive. d(-934/851) Simplify q*(-11)/qq(7/3) assuming q is positive. q(-29/3) Simplify (c6)(-26) assuming c is positive. c(-156) Simplify f(-1/5)/f(-13) assuming f is positive. f(64/5) Simplify (r(-2/5))30(r(r/(r(r(1/4)/r)/rrr))/r)(-26) assuming r is positive. r(-11/2) Simplify www(w/(ww/(ww*(5/6))ww))/www/(w/(w8w)) assuming w is positive. w(65/6) Simplify ((u/(u10u))/u)/u(-23) assuming u is positive. u12 Simplify (ccc2c)(3/2) assuming c is positive. c(15/2) Simplify (d(-6)/(d(-1/3)/d))/(d*(-1/6)d0) assuming d is positive. d(-9/2) Simplify b*15/(bb(-6/19)) assuming b is positive. b(272/19) Simplify (a/(a/(a(-3/5)/a)))(-2/111) assuming a is positive. a*(16/555) Simplify (oo*(-4)oo/o1)/(o(-5)o(1/6)) assuming o is positive. o(17/6) Simplify (((oo(3/2))/o)/o)(-3/5)(o2)6 assuming o is positive. o(117/10) Simplify (t/t(-23))(1/91) assuming t is positive. t(24/91) Simplify (r*6/rr(3/2))/(((r2/r)/r)/r(1/3)) assuming r is positive. r(41/6) Simplify ((j(2/3))(-29))(-48) assuming j is positive. j928 Simplify (n*(-1/17)n)(-6/19) assuming n is positive. n(-96/323) Simplify (((o/(o/(o/(o/(oo1/o)))))/o)/(o(o*(-6)o)/o))/((oo(1/4)oo)/((oo(-3/5))/o)) assuming o is positive. o(23/20) Simplify (d/d10)(-23) assuming d is positive. d*207 Simplify ((((gg/g*(-1)g)/g)/gg)/gg)(34/3)/(g/(g(3/2)g)(gg/(gg*(-4))g)/ggg) assuming g is positive. g*(57/2) Simplify o/(o(o/((o*(-7)ooo)/o)o)/oo)o(-13)ooo assuming o is positive. o*(-17) Simplify (mm*5mmm)(-12/7) assuming m is positive. m(-108/7) Simplify n*(-15)/nn(-18) assuming n is positive. n(-34) Simplify (i(((iii(-10/11))/iii)/i)/i)/i(1/17) assuming i is positive. i(193/187) Simplify mmmm*3mm(-11) assuming m is positive. m(-4) Simplify (i(-9/7)i(-2/7))(-1/33) assuming i is positive. i(1/21) Simplify ((i(-1))5)(-3/7) assuming i is positive. i(15/7) Simplify (u(-6)/u*5)/(u/(u/(((((u(uu(-2)/u)/uuu)/u)/u)/u)/uu)u))49 assuming u is positive. u185 Simplify ((b/(b/(bbb(-2/5))))/b(-2))/(b/(b(-1/9)b)bb(-2/7)) assuming b is positive. b(874/315) Simplify (hh3h)/(h/(h/(h*1h))h)(hhh*(-2/7)h)(-17) assuming h is positive. h(-309/7) Simplify (tt12t)35 assuming t is positive. t490 Simplify (i*(-2)i(1/3))/(i1/i)(-3/5) assuming i is positive. i(-5/3) Simplify (jj(5/8)/j)/(j(-1/2)j) assuming j is positive. j(1/8) Simplify a(-18)/aa(3/10)a assuming a is positive. a(-177/10) Simplify (c(1/8)ccc/(c7c))/((ccc/c*(-11)ccc)/(c/c(-3))) assuming c is positive. c(-143/8) Simplify d*(-28)/dd(-28) assuming d is positive. d(-57) Simplify (i/((ii/(i/(i/(i3i))))/i)i(-6)i)22 assuming i is positive. i(-22) Simplify ((v1)(-14/3))(-24) assuming v is positive. v112 Simplify cc10((c/(cc(-7/6)/cc)c)/c)/cc assuming c is positive. c*(73/6) Simplify (nn/(n*1/nn)n)15/(n2/nn)2 assuming n is positive. n26 Simplify ((d/(d(-1/4)/d))(9/8))6 assuming d is positive. d(243/16) Simplify (w1/w)(3/4)/(ww(-2/3)/w)(-32) assuming w is positive. w(-64/3) Simplify h(-6)/h(-4)h*1(hhh*6h)/h assuming h is positive. h*7 Simplify ll*15ll16 assuming l is positive. l33 Simplify i(-1/7)i*(-3/2)i assuming i is positive. i(-9/14) Simplify ((f(2/11)/f)/ff(-1))/(f3/f9) assuming f is positive. f(35/11) Simplify (f/(f/(f0f)))/f(2/21) assuming f is positive. f(19/21) Simplify ((t/(t/(t/(t/(t*(3/5)t)))))/(ttt/(t/(t*(3/5)ttt)t)tt))/(t3/(tt*7t)) assuming t is positive. t Simplify g*7/gg*3((gg2g)/g)/(g(g8/g)/g) assuming g is positive. g5 Simplify (yy/y*(4/7)yy)(-1/4) assuming y is positive. y(-6/7) Simplify b(-2/3)bbb*3/bbbb6/(b(-2)bb) assuming b is positive. b*(34/3) Simplify ((rr(-2))(-10))(-5) assuming r is positive. r(-50) Simplify ((u*(-8)u)/u)(-3/4) assuming u is positive. u6 Simplify (ff2/ff)(-2/5)/(f(-3/8)/(ff(3/5)ff)) assuming f is positive. f(111/40) Simplify (b(2/19)b)/(bbb/((bb1/b)/bb)b)b*1bb(-3) assuming b is positive. b(-55/19) Simplify (y(-2/13)y)/yy4(y(y(1/2)y)/y)/y(-8) assuming y is positive. y(347/26) Simplify i*(-4)/ii*(-3/4)(i2)(-2/13) assuming i is positive. i*(-315/52) Simplify (mm*(2/15)m/(m/((mm(-1/6)/mmm)/m)))/((m/(m/m(2/7)))/(m/(mm*(2/5))m)) assuming m is positive. m*(479/210) Simplify ((c/(cc/(c*(-4)/c)c))/c*(-4))/(((cc*(-3/5)c)/c)/c0) assuming c is positive. c(-17/5) Simplify ((qq16q)/(qqq/q8))17 assuming q is positive. q391 Simplify (l(-2)l)/lll(-8/9) assuming l is positive. l(-17/9) Simplify (r/(rrr(-2/3))r)*(2/73)(r/r(2/3))(-4) assuming r is positive. r(-96/73) Simplify w/w(-2)w(ww(-2/17))/w(w(-1/2)/w)(-1/74) assuming w is positive. w(9819/2516) Simplify ((j(2/7)jj)(9/13))(2/31) assuming j is positive. j(288/2821) Simplify (h(-3/14)h)/h(-20) assuming h is positive. h(291/14) Simplify v7vvvv/v(2/17)v assuming v is positive. v*(202/17) Simplify l(l*(-2/5)/l)/ll/(l/(l*(-7)l))(l2)(18/13) assuming l is positive. l(-301/65) Simplify ((ww*(-2)w)/w4)/(w(-2/5)/ww)(-22/7) assuming w is positive. w(-184/35) Simplify (r(-2/7)r)36/(r(-6/7)/(rr4/r)) assuming r is positive. r(214/7) Simplify ((((rr*(-2))/r)/r)/r)/rr(-11/5)/r assuming r is positive. r(-41/5) Simplify ((f*(-4)/f)/(f((f*(-10)f)/f)/f))(-6) assuming f is positive. f(-30) Simplify ((t/(t*(4/5)/t))/(t/(((t(ttt/t	{ "pile_set_name": "DM Mathematics" }
9) Simplify ((w*(-2/11)w/(w*7w))/(((w/(w*5/w))/www)/(w(-1)w)))/((w0/w)13)(-1/2) assuming w is positive. w(-257/22) Simplify ((q(-2/3))(-2/7)(qq/q(-1))28)/((q*4q*7)/((qq*(3/8))/(((qq(-5))/q)/q))) assuming q is positive. q(13535/168) Simplify ((h/(h*(11/2)/h))/hhhh/(h(hhh9)/h))/(((h/h(3/7))/h)/h(1/26)) assuming h is positive. h(-1095/91) Simplify ((jjj/(j/(j0/j))j)14)(20/7)/(((j/(jj5))/jj/j(5/4))/(j(3/4)/j(-5))) assuming j is positive. j92 Simplify ((z/(z/z(-1/9)))(-1)(zz12)(8/9))27 assuming z is positive. z315 Simplify ((b/(b/(b/((b/(b*(1/6)b))/bb))))/b(1/12))40/(b/(bbb(2/23)/bbb)b*(2/9)(b(-1)/b)/b(-8/7)) assuming b is positive. b(66734/1449) Simplify (p7p(8/11)(p(-4))(-30/11))(10/7) assuming p is positive. p(2050/77) Simplify tt(-1/10)tt4/t(t(-2/3))2(t/t(1/6)t(-1))/(t(-3)/t(-4)) assuming t is positive. t(12/5) Simplify (((d/(d/((d/(d(d(-6)/dd)/d))/d))dd(3/7))/(d(-5)/d6))(1/22))45 assuming d is positive. d(5805/154) Simplify ((u(2/15))(-9)/(u(u(u*29u)/u)/uuuu(2/11)))(-2/21) assuming u is positive. u(1224/385) Simplify (((ttt(3/10))/((t(t/t*(-4))/t)/t)t*(-7)t(1/2))27)36 assuming t is positive. t(-39852/5) Simplify ((i/(i*(-30)i))*(-8/9)i5/i(14/3))(33/4) assuming i is positive. i(-869/4) Simplify ((f1)(-2/3)/(f(2/9)/f(-4/9)))/((f/f*3f/f*(-2/13))/((ff/f6)/(f(-3)/f))) assuming f is positive. f*(-19/39) Simplify (q/((qq/(q*(2/9)q)q)/q)q(1/2))(-26)/((q(1/2))48/(q*(1/3)q/(q/q*(-3/4)q))) assuming q is positive. q*(-1591/36) Simplify ((ww/w(-32))/(w(-22)/w)(ww*(-2/37)/ww)/(ww/(ww26/w)))(-22) assuming w is positive. w*(-66704/37) Simplify (i/(i/(iii29i)))/iii((ii*(-15))/i)/i(i*(3/16)i)/ii/(i((i(-39)/i)/i)/i) assuming i is positive. i(947/16) Simplify (y*1yy(1/2)yyy)*(-17/4)(y(-1))(-24)/(y*(-3/7)yyy/y*(-3)y) assuming y is positive. y*(-333/56) Simplify ((p/(ppp2))(-24))(1/73)/((pp/(ppp*3p)p)/(p/((pp*(-4)p)/p)))(-1/3) assuming p is positive. p(-295/219) Simplify l/l*(-6/11)lll*(-3/2)ll(lll*(-2/9))/ll*2(l*(-2/3)/lll(-3/7))/(ll*(-2/3)/ll)15 assuming l is positive. l(1009/1386) Simplify ((u*7/(uu*(2/7))(u/u*(-2/21))/u(uu(-8)/u)/u)1)0 assuming u is positive. 1 Simplify ((q7/q)/q(-4/3))(-4/11)/((q/(qq4))/q(-2))(-1/17) assuming q is positive. q(-142/51) Simplify ((q*(-11)q)/((q/q*(-5))/q)(q*(-3/5)q)/((q(2/67)/q)/q))(-1/35) assuming q is positive. q(4231/11725) Simplify ((h(-1/14)h/h9h(h(-6)h)/(h/h(1/9)))0)(12/11) assuming h is positive. 1 Simplify (h2hhh(-6)/hh)23/((h/h1)*(-13/4)/((hh*(-1)hh)/h)(-37)) assuming h is positive. h(-83) Simplify (p/p0)41p*4p*(-7)((p/((p(-3)/p)/p))/p(-9))(8/3) assuming p is positive. p78 Simplify ((c*(6/13)cc(-5/13))/(c9)(2/17))0 assuming c is positive. 1 Simplify (m(3/8)m/(mm10m))*(2/109)(m(-2/3))(-31)/(m/m*(-3/4)m(-7)) assuming m is positive. m(8411/327) Simplify (((h(-2/7)/h)/h)(12/5))*(-26)(h/(hh/(h/h3))h9)/(h(-5)hh(-8)/h) assuming h is positive. h(5657/35) Simplify ((u*(-17)u)/(uu(1/17))((u*(-1/8)/u)/u)/(uuu(-2/31)/u))(-39) assuming u is positive. u(3308097/4216) Simplify u5/((((uu*(2/13)u)/uu)/u)/uu)(u(-1))(-40)(uuu/(u/(uu5u))u(-3/5))(-36) assuming u is positive. u(-16806/65) Simplify ((a/a(-4))/aa/(a*(-1/11)a))(-4/25)/(a(-1/5)a/((a5a)/a))(3/10) assuming a is positive. a(333/550) Simplify x*(2/5)x*(3/5)/xx*4/(x(x*(-1)/x)/x)((x(-1/4))38)(-24) assuming x is positive. x234 Simplify ((z(-1/4))(-15))(-4/11)/((z(-1/3)z)36)(-3/5) assuming z is positive. z(717/55) Simplify ((((nn*3nn)35)27)(-1/26))(-11) assuming n is positive. n(31185/13) Simplify (i(-2/11)iii*(-6)ii)(6/23)/(((ii*(-5/4)i)/((ii(-2/3))/i))/(((i/(i/i(-2))i)/i)/(ii/(i/i(-4))))) assuming i is positive. i(-2993/3036) Simplify (j/((j/((j(-3/2)/j)/j))/j))/((jj*1)/j)j*3j/(j/j*(4/9))j(jjj/(j/j(-4))j)/j*(-2)(j/(j(j/j1)/jj)jj)(-4/7) assuming j is positive. j(101/126) Simplify ((i/i38)/i)(-15)/((i(-11)/i)/i)(2/115) assuming i is positive. i*(65576/115) Simplify ((ttt/(t/(t/((t4t)/t))))*(1/17)t11/t(-6))(-11/6) assuming t is positive. t(-528/17) Simplify (((a/(a*(-34)a))42)5)(-2/37) assuming a is positive. a(-14280/37) Simplify (gg(2/7)/gg/(gggg(-1/5)gg)g)*21(g(2/5))7(gg(1/3)/g)25 assuming g is positive. g(-125/3) Simplify (n/n(2/19)n/n21nnn*(-6/5)nnn(-17))(1/19) assuming n is positive. n(-3164/1805) Simplify x(-22)/x(x(-2/23)x)/x(x(5/4))17 assuming x is positive. x(-169/92) Simplify (g(g/g20)/g)(3/46)/((g/g(1/21))/g)(-36) assuming g is positive. g(-951/322) Simplify (((p/p0)/pp(-1)((p(-1/4)/p)/p)22)(-36))49 assuming p is positive. p89082 Simplify (t(-2/9)t(1/6)/tt*(3/4)t/((t/(t6/t))/t))/((t/t(-11/5))/t(-1/5))10 assuming t is positive. t(-1019/36) Simplify ((n(2/3))(-6))(4/7)((n(1/7)n)/(n(1/6)/n))/(n/n(-6)nn/(n*4n)) assuming n is positive. n*(-181/42) Simplify ((aa(1/8)/a)42/((a/((aaa*13/aa)/aaa))/a)(1/27))(-4/11) assuming a is positive. a*(-631/297) Simplify ((ddd/d(-1))17(dd(d(dd*(5/2)d)/dd)/d)/dd(-7))/(d(-6)/(d/d(2/5)))(-1/2) assuming d is positive. d*(316/5) Simplify (((yy*(-2)y)/y(1/7))/(y(-5))21)(-44) assuming y is positive. y*(-32296/7) Simplify (((bb/b*17b)/(b(bb*(-8/7)b)/b))/(b/b*(-1)b(-8)))15 assuming b is positive. b*(-930/7) Simplify ((nn/(n/(((n/(n*(-1)n))/n)/n)))(1/18)/(n1)21)/((n(-1/5)nn/n1)/(n/((n/(n(-3/5)n))/nn)n/(n(-4)/n))) assuming n is positive. n(-77/5) Simplify (j/j(-3/7))/(jjj3)((j2/j)/j)14((jj1)/j)(1/39)j7j/(jj/(jjj(2/3))) assuming j is positive. j(466/91) Simplify ((vv((v/(vv*(1/2)/vvv))/v)/vv)/vv(-3/7))/(v(2/5))(-12)((v/((v/v(-1))/v))/v0)(-20) assuming v is positive. v(201/70) Simplify ((ii/i(-3/4)ii)/i(2/33)i*(-2/11)iii*(-3)ii)(-2/11) assuming i is positive. i(-727/726) Simplify ((((c(-2/11)/c)/c)/(((c/((c/c1)/c))/c)/c))/((c/(c/(c/c(-4/3))))/c(-4)))/(c(-3/8)c(2/5))12 assuming c is positive. c*(-2909/330) Simplify ((jj1)(-2/13)/(j*(-1)j)(9/7))/(j/(j0/j)j/j(1/12))(-42) assuming j is positive. j(3177/26) Simplify ((w(1/4))47(ww(-1)ww)(-4/11))/((ww(-1/3))/(w/w(-4))ww/(w/(ww(1/2)ww))w(www2ww)/www) assuming w is positive. w(377/132) Simplify b/(b4b)b7b(-1)/(b/(b(-3/2)/bb))(b*9b/(b/(b/(b/(bbb/(bb/(b/b1))))b)))(-3/17) assuming b is positive. b(-83/34) Simplify l(-19)/(l/l(2/81))l(16/3)l(ll*(12/5)l)/l assuming l is positive. l(-4148/405) Simplify ((d(-2)/(dd(2/17)/d))/(d(2/3)/d(d/(d/d(2/9)))/d))/(d(-2/9)(d(5/6)d)/dd/d6d(d/d(5/4))/dd) assuming d is positive. d(179/68) Simplify ((q(2/3))(-19))(-1/75)/(q*(-3/14)q9)8 assuming q is positive. q(-110434/1575) Simplify ((((j(-3/13)/j)/jj)/(j((jjj*(-4/5)j)/j)/j))(-1/7))(-2/137) assuming j is positive. j*(-316/62335) Simplify (((n/(n/(n/(nnn(-1)n))))*(-40)n(-2/23)/n(-1/6))(-1/38))(-41) assuming n is positive. n*(226771/5244) Simplify ((oo*(2/11)o)/((o(4/9)/o)/o))8(o(-11)oo8o)35 assuming o is positive. o(-505/99) Simplify ((f(1/11)/f(-3/7))/(ff(2/43)f(-1)))(-3) assuming f is positive. f(-4698/3311) Simplify (f(-8)ff(ff*(-2/5)f)/ff(4/11)/(f2f))/((f(-1))(-28)(ff*(2/7)f)/(ff(-3/8))) assuming f is positive. f(-116107/3080) Simplify (((z(z*(-1/5)/z)/z)/(zz*12z))/(z(-2/29))(11/7))(3/31) assuming z is positive. z(-45954/31465) Simplify ((m/(mm11))/(m(-5/3)/m))(-4/3)/(((m/m(-3/5))/(mm*(-1)m))/(m(-2/9))(1/80)) assuming m is p	{ "pile_set_name": "DM Mathematics" }
-g - 2l. Suppose -2p - g = -258. What are the prime factors of p? 2, 61 Suppose -44 = 2r - 3r. Let x be 8/(-44) - (-96)/r. What are the prime factors of 1/2 - (-45)/x? 23 Let h(i) = 4i2 + 3i + 3i - 4i*2 - 2i*2 - 9. Let o be h(5). Let s = 63 + o. List the prime factors of s. 2, 17 Let m = -808 - -913. Let k be (2/(-5))/(1/165). Let d = m + k. List the prime factors of d. 3, 13 Let s = -7 - -10. Suppose 0 = 5w - 3v - 3, sw - 4v = -0w + 4. Suppose 4n - 5n + 4 = w. What are the prime factors of n? 2 Suppose 73 = -y - 4i - 7, -2i = 4y + 250. Let s = y - -85. Suppose 0 = -3w - l + 26 + s, 84 = 5w + 2l. What are the prime factors of w? 2, 3 Let q(r) be the first derivative of -r*4/2 - 2r*3/3 + 3r*2/2 + 12r - 6. List the prime factors of q(-4). 2, 3 Suppose -f + 37 = 2i, f + 0f = -i + 34. What are the prime factors of f2(-4)/(-8)? 31 Let h(w) = w*2 - 11w + 1. Let n be h(10). Let i be -3((-15)/n + 0). List the prime factors of -2(-4)/i-5. 2 Let m be 2/8-2-6. Let z = m + 3. Suppose 3c - 5d - 108 = 0, 0 = 2c - d + zd - 72. What are the prime factors of c? 2, 3 Let a = 1179 - 682. List the prime factors of a. 7, 71 Suppose 9t + 36 = 13t. Suppose -1716 = -2r - tr. What are the prime factors of r? 2, 3, 13 Let q(k) = 4k + 7. Let b be q(-3). Let z = b - 4. List the prime factors of ((-60)/1)/(z/6). 2, 5 Suppose 4n = 3n + 65. Suppose -k + 5q + 125 = k, 0 = k - 3q - n. What are the prime factors of k? 2, 5 What are the prime factors of ((-10610)/6)/((-330)/198)? 1061 Let j be 33-3(-2)/(-18). Let h = 30 - j. Suppose h = -2u + 3u. What are the prime factors of u? 41 Let j be 0/(0/2 - 2). Suppose j = -u + 6u. Suppose u = -0q + 2q + 5f - 25, 3q - 2f - 85 = 0. What are the prime factors of q? 5 Let j = 16947 + -11679. List the prime factors of j. 2, 3, 439 Let n = -5 + 10. Suppose 3r + 10 = nr. Suppose 38 = a + 5t, -ra - t = -a - 76. What are the prime factors of a? 2, 3 Let c = 70 - -365. What are the prime factors of c? 3, 5, 29 Suppose 497 = 11j - 10j. What are the prime factors of j/9 + (-42)/189? 5, 11 Suppose -3398 = -227y + 225y. What are the prime factors of y? 1699 Suppose 6s = 73s - 344447. What are the prime factors of s? 53, 97 Suppose -4w + 28 = -4t, -5w + 2w = -2t - 19. Let h(k) = k3 - 5k*2 + 7. Let f be h(w). Suppose 67 = 5b + f. What are the prime factors of b? 2, 3 Let p(i) = 21i + 64. Let a be p(-6). What are the prime factors of (-45)/(-9) - (0 + a)? 67 Let a = -21 - -12. What are the prime factors of (-6)/a102/4? 17 Let x(u) = 8u + 54 - 65 + 2u. What are the prime factors of x(14)? 3, 43 Let h be 24/7 - 21/49. Suppose 27 = 3y + h. List the prime factors of y. 2 Suppose -2n + 10 = 0, -65 = -2o + n + 158. What are the prime factors of (o/(-4))/((-3)/16)? 2, 19 Let z = -1 - -3. Suppose 3i = zi. Suppose -4w + if - 3f = -192, 131 = 3w - f. List the prime factors of w. 3, 5 Let n(v) = v3 - 7v*2 - 14v - 2. Let j be n(10). Let k = j + -86. What are the prime factors of k? 2, 3 List the prime factors of (-3)/8 - 53118/(-208). 3, 5, 17 Suppose -4f = -5k + 539, -7k = -2k - 5f - 535. Suppose -2b = b - w - 209, 0 = -2b - 5w + k. List the prime factors of b. 2, 17 Let w be 20/(-9) - (-4)/18. Let s(m) = -3m2 + 13m + 17. Let j(y) = y*2 - 6y - 8. Let n(k) = ws(k) - 5j(k). List the prime factors of n(-4). 2, 3 Let q = 1093 - 40. List the prime factors of q. 3, 13 Let j(p) = -p*3 - 3p*2 - p. Let x be j(-2). Let m(y) = 171y*2 - 4y - 5. Let r be m(x). What are the prime factors of r/21 - (-8)/28? 3, 11 Suppose 0 = -27z + 21z + 1644. Suppose 2g = -5i + z, -5i + g + 268 = -0i. List the prime factors of i. 2, 3 Let m(i) = -i*3 + 19i*2 + 1. Let q be m(19). List the prime factors of 3/96 + q. 3 Suppose 0 = -10o + 12137 + 3903. List the prime factors of o. 2, 401 Suppose u - j + 43 = 0, 2u - 5j + 138 = 55. Let r = -30 - u. What are the prime factors of r? 2, 7 Suppose 6a - 3a + 126 = 0. List the prime factors of (-12)/a - (-12)/7. 2 Let j = 339 + -701. Let o = j - -623. List the prime factors of o. 3, 29 Let a = -3 - -3. Suppose -7r - 107 + 401 = a. What are the prime factors of r? 2, 3, 7 What are the prime factors of (11 - 3 - -5414) + 8? 2, 3, 5, 181 Let m(n) = 54n + 58. List the prime factors of m(6). 2, 191 Let f = 4033 - 2384. What are the prime factors of f? 17, 97 Let p(f) = 12f + 43. Let v = 78 - 62. List the prime factors of p(v). 5, 47 Let w(z) be the second derivative of z*4/12 - 7z*3/6 - 2z*2 + 8z. What are the prime factors of w(8)? 2 Let h = 93 - -21. Let b = h + -75. What are the prime factors of b? 3, 13 Let j = 21 + -18. Let v(u) = 2u2 - 1. Let s be v(2). Suppose sw = jw + 8. List the prime factors of w. 2 What are the prime factors of (-8460 - 60/(-10))(-2)/6? 2, 1409 Let u be (-2)/(-3)15/(-2). Let k = u - -10. Suppose -q + 31 - 70 = -4v, kv = 4q + 57. List the prime factors of v. 3 Let l(x) = 16x2 + 3x. Let s = -5 + 3. What are the prime factors of l(s)? 2, 29 Let x = 53 - 59. List the prime factors of -3 + x/21 + 74/14. 2 Suppose u + u - 1198 = 0. List the prime factors of u. 599 Let r(w) = w*3 + 10w*2 + 7w - 13. Suppose 3o + 45 = -2o. Let g be r(o). Suppose -2c + gq + 22 = 0, c + 3q - 44 = -3c. List the prime factors of c. 11 Let f(j) = -j*3 + 2j + 67. Let r(c) = -c*2 + 2c*2 + 3c + 16c. Let p be r(-19). List the prime factors of f(p). 67 Suppose -3v - 3q + 24 = 2v, -v - 3 = -2q. Suppose 5k = vk + 4d + 32, 0 = -2k - d + 17. Suppose -2g - k + 40 = 0. List the prime factors of g. 3, 5 What are the prime factors of (-26 - -24)-5(-118)/(-4)? 5, 59 Let p be ((-220)/(-33))/((-4)/(-6)). Let y(g) = -g*2 + 12g - 3. List the prime factors of y(p). 17 Suppose -7g = -g + 114. Let f = 11 - g. List the prime factors of f. 2, 3, 5 Suppose -212 = -11d + 9d + 2j, 5d = 3j + 524. List the prime factors of d. 103 Let w(g) = g*3 - 2g*2 - 4g - 4. Let l be w(4). Let j = 27 + -37. Let f = j + l. List the prime factors of f. 2 Let h be (51/12 + -2)16/12. What are the prime factors of 1/((-1)/(-81)) - h? 2, 3, 13 Let p(c) be the first derivative of -c2/2 + 32c + 6. Let r be p(0). Suppose 2t - 2x - 65 = -1, -t + r = -3x. What are the prime factors of t? 2 Let y(v) = 2v*3 - 7v*2 + 6v + 21. What are the prime factors of y(10)? 1381 Let a(f) = -f*3 + 19f*2 + 24f - 39. What are the prime factors of a(15)? 3, 11, 37 Suppose -1035 = l - 2003. List the prime factors of l. 2, 11 What are the prime factors of 113((-16)/48)/((-2)/6)? 113 Let f be 4 - (0/1 + -2). Suppose -3i + 5a = f, -4i = -5a + 5 - 2. Suppose in - 54 = -3n. List the prime factors of n. 3 Let z(w) = 6w + 19. Let j(o) = o*3 + 10o*2 - 2o - 12. Let a be j(-10). What are the prime factors of z(a)? 67 Let q(i) = -7i + 7. Let h(k) = -k3 - 8k*2 - 6k + 1. Let r be h(-7). List the prime factors of q(r). 7 Let l = 806 + -1676. Let b be l/25 + (-2)/10. Let a = 95 + b. What are the prime factors of a? 2, 3, 5 Suppose 0 = 14m - 9m + 4v - 2056, -4v + 424 = m. What are the prime factors of m? 2, 3, 17 Let y(b) = 2b - 4 + b + 2b - 7b. Let a be y(-4). Let i = 0 + a. What are the prime factors of i? 2 Suppose -2u - u = k - 15, 3k = 5u - 11. Suppose 3j - 30 = -5i, 0j - 32 = -ui - 4j. Suppose -g + ig - 26 = 0. List the prime factors of g. 13 Let h be (-148 - -12) + 0 + -4. Let y = -73 - h. List the prime factors of y. 67 Suppose 0 = t - o - 95, -4t + 2o = -o - 376. Let s = t + -73. What are the prime factors of s? 2, 3 What are the prime factors of ((-6)/(-9))/(-44/(-9336))? 389 Let r be 19 - 20 - (-1 + 1 + -6). Suppose -4w = -2p - 57 - 109, rw - 209 = 2p. List the prime factors of w. 43 Suppose 2i = -2j - 22, i + 2j = 3j - 15. Let d = -11 - i. Suppose 5p - 119 = 4u, p + du = -2p + 67. List the prime factors of p. 23 Let d = 8 + -5. Suppose 2 = -dm + 110. Suppose -k = 2q - 6q - 18, -4k - 2q = -m. What are the prime factors of k? 2, 5 Suppose -2v - 16 = -6v. Suppose -vu + 2t = -3u - 41, 2t = 3u - 139. Let g = u - 9. List the prime factors of g. 2, 5 Let x(z) = z2 + 4z + 18. Let p be x(-10). Let a = p + -43. What are the prime factors of a? 5, 7 Let g(k) = -	{ "pile_set_name": "DM Mathematics" }
((b3/b)/b)32/(b(-2)/b(-8/3)) assuming b is positive. b(94/3) Simplify (r0r)(4/13)(rrr/r*0r)39 assuming r is positive. r(2032/13) Simplify n*(-31)/(nn/(n/n(-2/3))) assuming n is positive. n(-94/3) Simplify a/(a/(a*11/a))aa10 assuming a is positive. a21 Simplify (w/w(1/4))(28/3)/(((w/w(5/4))/w)/(w/(w1/w))) assuming w is positive. w(37/4) Simplify (aaa/(a/(a6a))aa3)/((a/(a(-1/5)a))/(a(-6/7)/a)) assuming a is positive. a(383/35) Simplify o(1/22)o(-8/5) assuming o is positive. o(-171/110) Simplify (uu1)(-32)(u1)(-2/59) assuming u is positive. u*(-3778/59) Simplify ((u/(uuu2u))/uu(-5))/(u(2/7))(2/51) assuming u is positive. u(-3574/357) Simplify ((ddd/(d/(d/(d/d(4/7)))d)ddd)/(dd/d*(-14)ddd))(-42) assuming d is positive. d606 Simplify (q*(-2)q8)(2/47) assuming q is positive. q(12/47) Simplify (g(-10)/g)(-40) assuming g is positive. g440 Simplify p(1/2)/p(-2/27) assuming p is positive. p(31/54) Simplify (y/(y(1/3)y))(-2/7)y*(-1/4)y(-6) assuming y is positive. y(-517/84) Simplify (r/r*(-15)r)(-20/3) assuming r is positive. r(-340/3) Simplify (l*(-4)l(4/11))(5/6) assuming l is positive. l*(-100/33) Simplify (qq/q(-2/7))(-2/157) assuming q is positive. q(-32/1099) Simplify ((k0)34)(2/35) assuming k is positive. 1 Simplify (s*(2/23)/((s/(sssss7))/s))(3/38) assuming s is positive. s(765/874) Simplify ((x(-2/3))22)(-1/14) assuming x is positive. x(22/21) Simplify g(1/10)/g11 assuming g is positive. g(-109/10) Simplify (l(-1/2))9(ll(-4))/(((l(ll(2/5))/l)/l)/l) assuming l is positive. l(-69/10) Simplify ((f(-5)f)/(fff*(-4/5)ff))/(((f/(f/f(-1/4))f)/ff)/f)(-44) assuming f is positive. f(-91/5) Simplify r(-1/18)/rrrr*(2/19)(r(-2))(9/8) assuming r is positive. r(-821/684) Simplify (f(-5)f(-1/7)f)/(f*(1/4)f6/f) assuming f is positive. f(-263/28) Simplify z*(-1/3)/((zz*(-3)z)/z)zz*(-5/4)z(-5) assuming z is positive. z(-43/12) Simplify (w6)(-3/11) assuming w is positive. w(-18/11) Simplify (l(-1/12)l/l(1/10))/(l(5/6)/(ll(-1/2))) assuming l is positive. l(29/60) Simplify (v31)(-14/3) assuming v is positive. v(-434/3) Simplify f/f(-1/20)fff(-23) assuming f is positive. f(-399/20) Simplify f(2/13)/((f(-8)/f)/f)(f/(f/(f*(-2/7)f)))(-26) assuming f is positive. f(-766/91) Simplify dd(-3/2)d*37d assuming d is positive. d(75/2) Simplify (r8rr/r5)/(r(-2/9)r/(rr*(2/15)rr)) assuming r is positive. r(331/45) Simplify g(-6)g(-19) assuming g is positive. g(-25) Simplify f*(1/2)f*(-1)f8/(f(-1/2)/f) assuming f is positive. f9 Simplify a(-22)a(7/3) assuming a is positive. a(-59/3) Simplify (t(-1/3)t)*(-4/13)((t(tt(-1/3))/t)/t)(-2/19) assuming t is positive. t(-42/247) Simplify u(-38)u(-2/19)/u assuming u is positive. u(-743/19) Simplify (s(-1/3)/(ss(12/7)))(15/2) assuming s is positive. s(-160/7) Simplify (z(-13)/z(1/20))(17/4) assuming z is positive. z*(-4437/80) Simplify ((g/(gg*(-5)ggg))/g)37 assuming g is positive. g37 Simplify qqqqq*0q(-2/21) assuming q is positive. q(82/21) Simplify i*0i/i*4i(i(2/7))(8/11) assuming i is positive. i(-138/77) Simplify (b1/b)4/(b/((b/(b(3/5)bb))/b)b*(3/8)b) assuming b is positive. b(-199/40) Simplify (q(3/5)q/(q/q(3/13)))(-16) assuming q is positive. q(-864/65) Simplify ((ii/i1)(15/7))(-3/11) assuming i is positive. i(-45/77) Simplify (v*(1/46)vv)(-39) assuming v is positive. v(-3627/46) Simplify dd/(dd/(d/(d(dd/(d/(d/((dddd(ddd/(dd*30d))/d)/d)))dd)/d)))dd(d(-24)d)/d assuming d is positive. d(-52) Simplify (k1/(kk(6/5)))/(k(-8)/(k/(k/k10))) assuming k is positive. k(84/5) Simplify (qqqq*(6/11)q)/q*(-7)q(-3)/(q/(q/q(2/5))) assuming q is positive. q(448/55) Simplify ((a/a(-1/16))/aa(4/9))(-29/4) assuming a is positive. a(-2117/576) Simplify ((zz(-8))/z)/z(-2/7) assuming z is positive. z(-54/7) Simplify (y0/(y/(y*(3/10)y)))(-27) assuming y is positive. y(-81/10) Simplify ((m(-1/2))(-2/7))22 assuming m is positive. m(22/7) Simplify ((hh(-1)/h)(3/26))34 assuming h is positive. h(-51/13) Simplify (x2/xx)/x14 assuming x is positive. x(-12) Simplify ((vv2)/v)(12/13)v/(v*(-6)v)vv(-1/7) assuming v is positive. v(792/91) Simplify ((ii/(i/i(1/5)))(5/8))(-4) assuming i is positive. i(-3) Simplify ((j(-2)jj)/j(2/25))17 assuming j is positive. j(-34/25) Simplify (m7/m4)(9/5) assuming m is positive. m(27/5) Simplify (i(-3))30/(i(-2)/i)(-7/3) assuming i is positive. i(-97) Simplify ((i(2/15)/i)/(i1/i))/((i/i4)/(i/((ii/i0)/i))) assuming i is positive. i(32/15) Simplify ((t/(tt(-3)/t))(5/9))(2/11) assuming t is positive. t(40/99) Simplify a9a*6a(aa*0a)(6/25) assuming a is positive. a(412/25) Simplify (h(2/7)/h)25/(h*(-6)(hhh(-4/3))/h) assuming h is positive. h(-242/21) Simplify (q/q(-7))/((q/q0)/q)((qq*6q)/q)/q7 assuming q is positive. q8 Simplify z(-3)/(z/z(-5/2))(zz0/z)(3/17) assuming z is positive. z*(-13/2) Simplify (o((o/(oo(-3/8)/oo))/o)/oo(o*5o)/o)(-1/7) assuming o is positive. o(-43/56) Simplify (d*(-9)dd(3/2))25 assuming d is positive. d(-325/2) Simplify ((ww*(-1/8)w)/((w*(-9)ww)/w))(-32) assuming w is positive. w(-316) Simplify v(-8)/v(2/7)v*(2/5)v(-1/14) assuming v is positive. v(-557/70) Simplify (kk(1/3))(1/77)(kk/k(-1/3))/k(k/k(-4/9))/k assuming k is positive. k(1244/693) Simplify q(-28)/(q/q(-3/4)) assuming q is positive. q(-119/4) Simplify h(-4/7)/(h*(3/32)h) assuming h is positive. h(-373/224) Simplify (i(-2/5))*(5/7)(iii/((ii(i/(i*(-5)i))/i)/i)ii)/i(-1/4) assuming i is positive. i(-1/28) Simplify r(3/8)/(r(-8)/rrr) assuming r is positive. r*(59/8) Simplify (s/(sss(1/5))ss)/s(-1/4)s*(-1/7)sss(-8) assuming s is positive. s(-713/140) Simplify ((h((hhh(-3/7)/h)/h)/h)/h)(-34/3) assuming h is positive. h(340/21) Simplify (k(4/3)k(((k/(((k/(k/(kkk(5/7)k)))/k)/k))/k)/k)/k)(-17) assuming k is positive. k(493/21) Simplify (h/(h/(hh(h/h(5/3))/h)))(-2/15) assuming h is positive. h(-2/45) Simplify l/l(-3/8)l/((l26/l)/l) assuming l is positive. l(-173/8) Simplify h(3/5)h(-14) assuming h is positive. h(-67/5) Simplify (x/(xx2)x)(-39) assuming x is positive. x39 Simplify (c(1/3)/c(-4))/(cc/(ccc1))(-8) assuming c is positive. c(-11/3) Simplify (h(-2/15)/(hh*(-8)))/(hh*1/hh)31 assuming h is positive. h(-827/15) Simplify s*(2/3)sss*(-6)(s*(-2/5)s)45 assuming s is positive. s(71/3) Simplify ((((r/(r/r*(-9)))/r)/r)/r)/(r/(rr*10rr))(r*(2/3)rr)/r(4/11) assuming r is positive. r(76/33) Simplify (v1)(15/4)/(v/v1vvv)(1/70) assuming v is positive. v(519/140) Simplify (u*0/uu*3)/(u/(((uuuu(-1/2))/u)/u))(-14) assuming u is positive. u*9 Simplify ((hh*(-6/11))/(h/(hh(-2/17))))(-31) assuming h is positive. h*(-1953/187) Simplify (d/(dd(-1/2)))(4/3)/(d1)(-31) assuming d is positive. d(95/3) Simplify p(-2/33)/p(-27) assuming p is positive. p(889/33) Simplify (((((ww(-6/7))/w)/w)/ww)/w(-19))(-4) assuming w is positive. w(-480/7) Simplify (g/g23gg)/(g*(-1/2)g) assuming g is positive. g(-41/2) Simplify (w/(w/(w(-6)/w))w(w*2w)/w)(-5) assuming w is positive. w20 Simplify (x(-1))22x/(x2/x)(x/x*(3/2)xx)/x assuming x is positive. x(-43/2) Simplify ((x/(xx/x(-1)))(-18/13))(7/3) assuming x is positive. x(84/13) Simplify (dd(1/12)/d)/d6 assuming d is positive. d(-71/12) Simplify ((x(-9)xx)/(xx/(x/x(-1/4))))(2/27) assuming x is positive. x(-31/54) Simplify (l/(l/l(-1/9)))(-10) assuming l is positive. l(10/9) Simplify (s4)(1/10) assuming s is positive. s*(2/5) Simplify ((pp(-1))(-35))**(2/25)	{ "pile_set_name": "DM Mathematics" }
ded by 77? 9 Calculate the remainder when 4300 is divided by 287. 282 Calculate the remainder when 28138 is divided by 27. 4 What is the remainder when 7662 is divided by 1523? 47 Calculate the remainder when 3368 is divided by 1112. 32 What is the remainder when 4407 is divided by 50? 7 Calculate the remainder when 54237 is divided by 3613. 42 What is the remainder when 2767 is divided by 62? 39 What is the remainder when 36589 is divided by 5? 4 Calculate the remainder when 22125 is divided by 22116. 9 Calculate the remainder when 5558 is divided by 4494. 1064 Calculate the remainder when 415 is divided by 68. 7 Calculate the remainder when 12028 is divided by 429. 16 Calculate the remainder when 265657 is divided by 267. 259 Calculate the remainder when 1197 is divided by 41. 8 What is the remainder when 13133 is divided by 355? 353 What is the remainder when 638117 is divided by 280? 277 What is the remainder when 10385 is divided by 49? 46 What is the remainder when 180 is divided by 3? 0 What is the remainder when 21795 is divided by 173? 170 What is the remainder when 1262495 is divided by 505? 500 Calculate the remainder when 1160 is divided by 41. 12 What is the remainder when 18039 is divided by 52? 47 What is the remainder when 57652 is divided by 140? 112 What is the remainder when 2539 is divided by 829? 52 Calculate the remainder when 1690 is divided by 382. 162 What is the remainder when 100087 is divided by 16? 7 What is the remainder when 61275 is divided by 7? 4 What is the remainder when 67825 is divided by 95? 90 Calculate the remainder when 100993 is divided by 7209. 67 Calculate the remainder when 33459 is divided by 1397. 1328 What is the remainder when 2781 is divided by 16? 13 Calculate the remainder when 76101 is divided by 718. 711 What is the remainder when 142386 is divided by 126? 6 Calculate the remainder when 731 is divided by 80. 11 What is the remainder when 7536 is divided by 539? 529 What is the remainder when 67103 is divided by 58? 55 Calculate the remainder when 157482 is divided by 14. 10 Calculate the remainder when 5386 is divided by 86. 54 Calculate the remainder when 56177 is divided by 46. 11 What is the remainder when 1163 is divided by 723? 440 What is the remainder when 83930 is divided by 16? 10 What is the remainder when 7688 is divided by 75? 38 Calculate the remainder when 2936 is divided by 53. 21 What is the remainder when 235163 is divided by 3855? 8 What is the remainder when 186591 is divided by 17? 16 What is the remainder when 422944 is divided by 311? 295 Calculate the remainder when 6760 is divided by 106. 82 What is the remainder when 7987 is divided by 2652? 31 What is the remainder when 131663 is divided by 43? 40 Calculate the remainder when 3278259 is divided by 53. 50 Calculate the remainder when 49353 is divided by 99. 51 What is the remainder when 73945 is divided by 73935? 10 Calculate the remainder when 1555 is divided by 1104. 451 What is the remainder when 7002 is divided by 3480? 42 Calculate the remainder when 118596 is divided by 1744. 4 Calculate the remainder when 836 is divided by 8. 4 What is the remainder when 7242 is divided by 1655? 622 What is the remainder when 88072 is divided by 25? 22 What is the remainder when 56164 is divided by 468? 4 What is the remainder when 6667 is divided by 2219? 10 Calculate the remainder when 1488 is divided by 28. 4 What is the remainder when 18601 is divided by 29? 12 What is the remainder when 114603 is divided by 7? 6 What is the remainder when 324195 is divided by 46311? 18 Calculate the remainder when 32850 is divided by 6569. 5 What is the remainder when 5482 is divided by 51? 25 What is the remainder when 366422 is divided by 907? 901 What is the remainder when 2045 is divided by 562? 359 What is the remainder when 5067 is divided by 39? 36 Calculate the remainder when 50901 is divided by 404. 401 What is the remainder when 312557 is divided by 16? 13 What is the remainder when 73000 is divided by 422? 416 What is the remainder when 3320 is divided by 319? 130 Calculate the remainder when 2486 is divided by 41. 26 Calculate the remainder when 60801 is divided by 487. 413 What is the remainder when 18004 is divided by 8946? 112 What is the remainder when 18669 is divided by 6214? 27 What is the remainder when 1017 is divided by 344? 329 What is the remainder when 17183 is divided by 465? 443 Calculate the remainder when 84666 is divided by 209. 21 Calculate the remainder when 753 is divided by 51. 39 What is the remainder when 913571 is divided by 198? 197 Calculate the remainder when 87711 is divided by 198. 195 What is the remainder when 11537 is divided by 296? 289 What is the remainder when 78115 is divided by 180? 175 Calculate the remainder when 137422 is divided by 45788. 58 What is the remainder when 16456 is divided by 59? 54 Calculate the remainder when 636349 is divided by 50. 49 Calculate the remainder when 5552 is divided by 101. 98 What is the remainder when 21102 is divided by 173? 169 What is the remainder when 22788 is divided by 743? 498 Calculate the remainder when 22731 is divided by 7567. 30 What is the remainder when 6090 is divided by 80? 10 What is the remainder when 4199 is divided by 1015? 139 Calculate the remainder when 11967 is divided by 656. 159 What is the remainder when 23570 is divided by 71? 69 Calculate the remainder when 5635 is divided by 125. 10 Calculate the remainder when 11563 is divided by 14. 13 Calculate the remainder when 51944 is divided by 222. 218 What is the remainder when 253399 is divided by 257? 254 Calculate the remainder when 17455 is divided by 727. 7 Calculate the remainder when 227931 is divided by 8. 3 Calculate the remainder when 7443 is divided by 220. 183 What is the remainder when 1268 is divided by 549? 170 What is the remainder when 12085 is divided by 484? 469 Calculate the remainder when 505265 is divided by 1579. 1564 What is the remainder when 2252958 is divided by 250328? 6 Calculate the remainder when 73437 is divided by 180. 177 What is the remainder when 271954 is divided by 260? 254 Calculate the remainder when 73945 is divided by 41. 22 Calculate the remainder when 1087233 is divided by 85. 83 What is the remainder when 101591 is divided by 413? 406 What is the remainder when 2761 is divided by 283? 214 Calculate the remainder when 41423 is divided by 41. 13 Calculate the remainder when 30489 is divided by 4. 1 Calculate the remainder when 7490 is divided by 1461. 185 Calculate the remainder when 47629 is divided by 11. 10 Calculate the remainder when 14297 is divided by 170. 17 What is the remainder when 2884 is divided by 861? 301 Calculate the remainder when 41779 is divided by 1071. 10 What is the remainder when 10556 is divided by 57? 11 What is the remainder when 26407 is divided by 95? 92 What is the remainder when 4522 is divided by 822? 412 What is the remainder when 135972 is divided by 45318? 18 What is the remainder when 67740 is divided by 464? 460 Calculate the remainder when 195748 is divided by 33. 25 Calculate the remainder when 8818 is divided by 2200. 18 What is the remainder when 33451 is divided by 26? 15 Calculate the remainder when 3570 is divided by 1172. 54 Calculate the remainder when 81829 is divided by 835. 834 Calculate the remainder when 110119 is divided by 47. 45 Calculate the remainder when 5292329 is divided by 335. 334 What is the remainder when 9700 is divided by 21? 19 What is the remainder when 10223 is divided by 917? 136 Calculate the remainder when 4881 is divided by 4259. 622 Calculate the remainder when 1163 is divided by 128. 11 What is the remainder when 20571 is divided by 1566? 213 Calculate the remainder when 381639 is divided by 8. 7 What is the remainder when 217352 is divided by 1138? 1132 What is the remainder when 9207089 is divided by 922? 919 What is the remainder when 12478 is divided by 1779? 25 Calculate the remainder when 52871 is divided by 363. 236 Calculate the remainder when 58181 is divided by 34. 7 Calculate the remainder when 54567 is divided by 107. 104 Calculate the remainder when 4606 is divided by 7. 0 Calculate the remainder when 80169 is divided by 153. 150 What is the rema	{ "pile_set_name": "DM Mathematics" }
h + 2739, -4b = h + wh - 2732. Does 12 divide b? True Let f = 138 - 122. Suppose fj = 41j - 3850. Does 14 divide j? True Suppose -5u = -4z + 28157, 0 = 9z - 5u - 33159 - 30213. Is z a multiple of 6? False Let c = -4814 - -8650. Is 125 a factor of c? False Let v be 3/(-15) + (-52)/(-10). Suppose -150 = -t + 4l + 121, v = -l. Is t a multiple of 20? False Suppose 17228 = 491n - 487n. Is 73 a factor of n? True Let l = -24 + 33. Is 34 a factor of (-3)/(-4) + 6993/36 + l? True Suppose 0 = 5p - 3p - 18. Let u = p - 7. Suppose 8y - 4y + q - 289 = 0, -uq = -5y + 358. Does 16 divide y? False Let u = -17 - -36. Suppose 4i = -5t + u, i - 5 = -3t + 5i. Suppose f = -d + 72, -4d - tf - 78 + 365 = 0. Does 17 divide d? False Let a = -5 - -2. Let k be 2/a + 34/51. Suppose kt - 5v = -3t + 284, 4t + 4v = 368. Does 31 divide t? True Let m(x) = 2x + 26. Let j be m(-8). Suppose 5i - 270 = -j. Is i a multiple of 4? True Suppose 15q = 4b + 18q - 6375, 4q = 2b - 3160. Suppose -bm = -1588m - 108. Is m a multiple of 6? True Let s(h) = 352h + 50. Let o be s(3). Let x = o - 700. Is 24 a factor of x? False Let p(j) = j3 - 78j*2 + 10j + 890. Is p(78) a multiple of 35? False Suppose 59d - 979857 = -13d - 9d. Does 10 divide d? False Suppose 2n = -3n + p + 20, -5n = 2p - 20. Suppose 2w - 291 = -v, nv - 524 = -3w + 660. Does 13 divide v? True Is 4033 - (1 + 2/(-10) - (-293)/1465) a multiple of 18? True Let r be (-1)/(-1) - (-13 - -10). Suppose 0 = -2b - 2o + 712, -o = rb - 1517 + 99. Is 31 a factor of b? False Let o(d) = -2d*2 + 4d + 5. Let f be o(7). Let m = f + 67. Is (0 + 4/(-12))/(m/(-90)) a multiple of 5? True Let n(d) = 131d2 + d. Let q be 1/(-6) - (-77)/66. Let o be n(q). Suppose o = -21p + 22p. Does 33 divide p? True Suppose 9i - 34903 = 12i - 22i. Is 39 a factor of i? False Suppose 570h = 564h. Suppose h = 28m - 34m + 8922. Is 18 a factor of m? False Let z = -243 + 469. Suppose 30 = -7o + z. Suppose a = 112 - o. Is a a multiple of 12? True Let t(f) = f3 - 10f*2 + 10f + 6. Let l be t(9). Let y(x) = 2x2 + 19x + 5. Let u be y(-11). Suppose u = n - l. Is 20 a factor of n? False Let u(b) = -b - 13. Let h be u(4). Let g(z) = z*3 + 32z*2 - 18z - 11. Let n(l) = l3 + l2 + l + 1. Let s(d) = -g(d) - n(d). Is s(h) a multiple of 5? True Let a = 53 - 50. Suppose -4w + 637 = al - 262, 5l - 901 = -4w. Is 32 a factor of w? True Is (1960/(-294))/(4/(-714)) a multiple of 34? True Suppose 19f = 24f - 20685. Suppose 878 = m + 2d - 148, 4m - f = 3d. Is 86 a factor of m? True Suppose -y + 768 = -5t, -3t - 391 + 409 = 0. Is 6 a factor of y? True Suppose y + 20 - 19 = 0. Let w(f) = -2f. Let n be w(y). Suppose -4 = -na, 3p = -p + 4a + 236. Does 30 divide p? False Let u = -163 - -152. Let g(k) = k3 + 11k*2 - 5k - 27. Is g(u) a multiple of 3? False Let j(o) = -4o3 + 61o*2 - 5o - 34. Let b(t) = 10t3 - 181t*2 + 15t + 101. Let q(c) = 3b(c) + 8j(c). Is 25 a factor of q(-28)? True Suppose 2x + 4k + 12 + 0 = 0, 3k + 16 = 2x. Does 34 divide -3 + (x + 268 - (-2)/(-1))? False Suppose 3x + 118 - 499 = 0. Let v = -215 + x. Let z = v + 208. Is 24 a factor of z? True Let q = 25124 + -24943. Is q a multiple of 2? False Let t be (-460)/(-207) - (-4)/(-18). Suppose 3j + 3q = 333, 3j + tq - 5 = 329. Is 28 a factor of j? True Is 22 a factor of (-290064)/(-32) - ((-66)/12)/(-11)? True Let n(v) = 156v*2 - 338v + 3143. Is n(10) a multiple of 27? True Let a(p) = -342p - 375. Is a(-24) a multiple of 3? True Let b be 15/2 - 4/(-8). Suppose 13g = 7g + 24. Suppose bt = gt + 480. Is t a multiple of 24? True Let i(z) = 15 + 41z + 17 - 19. Let n = -69 - -72. Does 23 divide i(n)? False Is 91/78 + 259868/24 a multiple of 105? False Suppose 3u = 2n - 1992, n - 4u + 7u = 987. Suppose -231 = -3y + n. Is 34 a factor of y? True Suppose -11a - 101 = -13. Let h(p) = -75p - 55. Let d be h(a). Suppose 0 = -3z + 8z - d. Does 7 divide z? False Let o(j) = -j2 - 74j + 84. Let v(k) = -25k - 147. Let l be v(-4). Is 33 a factor of o(l)? True Suppose 115u - 4361411 + 44426 = 0. Does 97 divide u? True Let i(t) = 7t - 3. Let b be i(-3). Let u be ((-2 - -5) + 0)/(b/(-224)). Is 45 a factor of 173 - (1/(-3) - u/(-12))? False Let c = 984 + -983. Does 20 divide (-7)/2c/((-7)/658)? False Let a = 385 - 49. Let k(h) = -138h - 34. Let d be k(1). Let n = d + a. Does 11 divide n? False Suppose -i - 41 = 14. Let n be (7 + i + -5)(-2 - -1). Is 15 a factor of (-1)/2(-9 - n)? False Let r = 52 - -266. Let w = r + -98. Let d = -34 + w. Does 31 divide d? True Suppose -4a + 10472 = -4q, 2092 = 4a + q - 8375. Does 63 divide a? False Suppose -n - 34 + 22 = 0. Is (-541)/n + 4/(-48) a multiple of 3? True Let r = 15 + -12. Let p be (-1(8 - 7))/((-1)/3). Suppose 4l + 152 = x, pl + 426 = rx + l. Does 28 divide x? True Let i = 221 + -98. Is 20 a factor of 49282/i + (-2)/3? True Let o(s) = -13s3 + 4s*2 + 6s + 1. Let f be o(-5). Let l = f - 2458. Is (-5 + l/(-6))2 a multiple of 50? False Suppose 5g = -3y + 21, 0y + 5y + 2 = 4g. Suppose -yi - 390 = -1948. Is 13 a factor of i? False Suppose -17p + 763 = -10253. Is 18 a factor of p? True Is (-14)/(-6)4287 - -1 a multiple of 63? False Let h = -422 - -1062. Suppose -10z = -5z - h. Is z a multiple of 16? True Suppose 0 = -4j - 538 - 270. Let l = -76 - 9. Let k = l - j. Is k a multiple of 50? False Suppose -4p = -2y - 42, 3p + 33 = -5y + 45. Suppose -137 = -2h - v - 32, 5h - 4v - 243 = 0. Suppose -3z - p + h = 0. Does 13 divide z? False Let l(t) = -6 - 70t - 507t + 214t. Is l(-1) a multiple of 18? False Suppose 27k + 180 = 30k. Suppose 0v - 5n = v, -2v + 5n = -k. Is v a multiple of 7? False Let p(m) = m2 + 3m - 38. Let a be p(-20). Let y = 169 + a. Is 14 a factor of y? False Let z(h) = 2164h3 + 13h*2 - 20h - 1. Is z(2) a multiple of 17? True Let t = 0 - -22. Let a be 4/t + (-5736)/88. Let c = -36 - a. Is 17 a factor of c? False Is 5(-6)/(-135) - (-1 - 60368/18) a multiple of 113? False Let r be (8/28 - 12/(-7)) + 42. Suppose -r = -i + 33. Suppose 0 = -4g + i + 115. Is g a multiple of 8? True Let r be (-12832)/80 - 2/(-5). Let d = r + 198. Does 4 divide d? False Let q(f) be the third derivative of 7f6/20 - f5/10 + f4/2 + f3/3 + f2. Is q(2) a multiple of 29? False Let x(n) = 8 + 14n + 13 - 1 - 4n. Is x(23) a multiple of 25? True Let p(t) = -31 - 4t*3 + 8t - 6t + 32 + 2t*2. Let z be p(-1). Suppose zf = 0, 2i - 610 = -0f - 3f. Does 61 divide i? True Suppose -112 - 78 = -l. Let r = l + 38. Is 19 a factor of r? True Let h be 10 + (-4 - (3 - 4)). Suppose 36i + h = 37i. Suppose ij - 2j = -m + 481, j = 3m + 93. Does 16 divide j? True Let m(b) = -b*3 + 13b*2 - 13b - 2. Let f be m(13). Let y = 198 + f. Does 13 divide y? False Suppose 3r = -3r + 37r - 80135. Does 11 divide r? True Let i(u) = -u3 + 32u*2 + 118u - 250. Does 29 divide i(34)? True Suppose -777b - 210220 = -782b. Is 59 a factor of b? False Suppose -7b - 919 = -2907. Let h = 233 + b. Is 73 a factor of h? False Is (-23)/(((-2)/6)/(11713/159)) a multiple of 221? True Let z(f) = -129f + 2268. Let n(i) = -52i + 907. Let h(p) = -12n(p) + 5z(p). Is h(0) a multiple of 38? True Let m(a) = -31a - 323. Let i be m(-13). Let d be 57/12 + (-1)/(-4). Suppose -3p - z = -p - 65, -3p - dz = -i. Is p a multiple of 26? False Let v be (1480/6)/((-117)/(-4212)). Suppose -f - 14f = -v. Does 19 divide f? False Let p = 29 - 26. Suppose 2d = -w + 849 + 377, -1830 = -pd + 3w. Suppose -v = -6h + 2h + d, 0 = 2v + 8. Is 26 a factor of h? False Let o = -18 - -27. Let d = 14 - o. Does 29 divide (261/15)/((4 + -3)/d)? True Let j = 183 + -178. Suppose -4n - 4346 = -5x, -2x - jn + 1177 = -535. Is 75 a factor of x? False Let l = -205 + 213. Suppose -2x + 390 = -3b, 9x + 3b - 195 = lx. Is 44 a factor of x? False Suppose 1022 = 7b - 5313. Does 40 divide b? False Suppose -5m - k = -1015, -2m + 2k = -2k - 406. Is m a multiple of 35? False Suppose 2r - 22 = -0x - 4x, 0 = x + 3r - 13. Suppose -xo = 3i - 2700, 3i - o = 8i - 4483. Does 16 divide i? True Let o(h) = -h*2 - 12h - 9. Let r be o(-11). Suppose 2z + 3v = 50, -rz + 5	{ "pile_set_name": "DM Mathematics" }
k = y - -5. Let j = -22 - -36. Which is smaller: k or j? k Let g = 77.105 + -0.105. Let k = g - 75. Let q = 3.7 - 4. Which is greater: q or k? k Let g be -1 + 2 - 13/((-585)/1875). Which is greater: 43 or g? 43 Let t = -3.5 + 3.372. Let o = -0.128 - t. Is -1/4 not equal to o? True Suppose -10o - 8 = -2o. Let b be 2 + o - 2/((-14)/(-17)). Which is bigger: -1 or b? -1 Let w be (-1 - -1)/(-8 - -9). Let n be (-24)/(-11) - (5 + -3). Which is bigger: w or n? n Suppose 113v = 103v + 10. Let y = -98 + 2451/25. Which is smaller: y or v? y Let h be ((-6)/8)/((-2)/(-8)). Let g = 116/25 - 1444/225. Is h greater than g? False Let x be -4 + -1(1 + -2). Suppose a + 5u - 145 = 0, 3a - u - 387 = -0a. Let o be (-2 - a/35) + 4. Does x = o? False Let d(w) = 2w2 + 6w + 2. Let b be d(-3). Which is smaller: 0.65 or b? 0.65 Let h be 11011/(-660)8. Which is bigger: h or -7? -7 Let u be (-18)/541/((-4)/24). Which is smaller: -3 or u? -3 Let v = 7 - 12. Let l = v - 1. Let q = 152 + -152. Which is bigger: l or q? q Let x(f) = -f - 1. Suppose 6a - 2a + 4 = 0. Let r be x(a). Let s be (-38 - -33)(-4)/590. Which is smaller: s or r? r Let r = 13 + -22. Let v = r - 12. Are -0.1 and v equal? False Let p = -34 + 152. Let s = p - 117.8. Do 2/7 and s have different values? True Let s = 32 - 29. Suppose -4q - 2k = -sq - 27, -4k = 5q - 111. Which is bigger: q or 18? q Let t(h) = -9h - 54. Let y be t(-6). Which is smaller: y or -2/917? -2/917 Let t(z) = z*2 + 30z - 65. Let o be t(-32). Let u = 8 + -6. Suppose -ub + 6 = -2. Is b < o? False Let l = 479/1360 - -13/272. Let r(p) = p2 - p - 4. Let x be r(-3). Is x at most as big as l? False Let y(l) be the third derivative of l6/120 - l4/24 + l3/6 + 4l*2. Let r be y(2). Suppose -r = -5f + 3. Are 2 and f unequal? False Let h(m) = -2m2 - 38m + 60. Let c be h(-19). Is c greater than 57? True Let k be (11/(-22))/(2/(-96)). Which is smaller: k or 14? 14 Suppose -5l = -15, -2y - 32l + 28l = -12. Which is smaller: y or -11/50? -11/50 Suppose 3h + 0 = 5c + 17, 4c + 13 = 3h. Suppose z - 6z + 10 = 0. Let i be z/6 - 17/60. Is i > h? True Let n be (-4)/3 + 273/117. Which is smaller: n or -7/99? -7/99 Let p be (49708/2616 - 19)6/(-4). Is 0 >= p? True Suppose -3u + 5h - 1057 = 0, -2u = -5h + 7h + 726. Is u < -362? False Let l = 142.4 - 183.35. Let r = l + 41. Does r = -1? False Let m = -5920 - -941279/159. Let n(d) = d3 + 4d2 - d - 4. Let u be n(-4). Is u less than m? False Let r = -89/385 + -11/35. Let s be 5 + 5 + (-1685)/165. Let f = s - r. Is f at most 0.1? False Let u = 10 - 11.5. Let d(o) = o2 + 13o - 1. Let w be d(-13). Is u >= w? False Suppose 15c = -12c. Let t be -1 + (3293/1547 - 1). Let p = t - 1/91. Is c greater than p? False Let c be 2/(-13 - -1) - 1199/(-8382). Which is greater: 1 or c? 1 Suppose -20v = -16v - 8. Let i be (-3 + v)2/(-50)-5. Which is smaller: -14 or i? -14 Let s = 1 + 16. Suppose -3r + 7r = 20. Suppose 3q = rp + 23, 10 = -p + 3p. Which is smaller: q or s? q Suppose 5f + 72 = 4k + 3f, k = -f + 18. Suppose -9i - 36 = -k. Let j be 1 + (0 - (-17)/(-10)). Which is smaller: i or j? i Suppose 0 = 3y - i - 9, -6y + 8y + 4i = 6. Is y equal to 40/9? False Let o = -0.34 + 0.29. Let z = 0.04 - o. Which is smaller: z or 0.1? z Suppose -q = -5l, -4l - 4 = 3q - 23. Do l and 28/115 have the same value? False Let n = -33 + 49. Let f(v) = v3 - 15v*2 - 16v + 2. Let a be f(n). Let k be (-9)/3a/6. Do k and -0.3 have different values? True Let s be 89/138-11 + 3 + 4. Which is bigger: s or 0? 0 Let b(v) = -10v + 46. Let t be b(6). Let h = 11/8 + -9/8. Which is bigger: h or t? h Let g = 2 + -24. Let p be (-2 - -6) + -9 + 8. Suppose 61 = -3i - 0q + q, 71 = -pi - q. Is i at least as big as g? True Suppose 3r - 17 = 5q, -r + 2q = 2r - 23. Let w be 6/(-18) + 3/r. Is -3/46 at least as big as w? False Let f be 80/(-126)3 - -2. Let z(g) = 1. Let x(h) = -h + 6. Let v(q) = -3x(q) + 3z(q). Let a be v(5). Which is greater: f or a? f Suppose 24 + 0 = 24g. Is g less than -2/573? False Let r be (80/(-12))/(-5)6. Suppose 2f - 8 - 2 = 0. Suppose -3y + 42 = 3v, 0y + 3y + fv = 50. Which is greater: r or y? y Let a(q) = 2q - 10. Let p be a(-11). Let o be (-9)/(-12)p/(-60). Is 0 > o? False Suppose 3m = -2c - 17, c - 3m - 14 = -0c. Let h = 16 + -79/5. Is c != h? True Suppose -5 = -z, 3q + 4z = -0q + 83. Let a be (-14)/q(-18)/(-5). Is 0.1 at most as big as a? False Let w(q) = -q3 + 14q*2 + q - 14. Let d be w(14). Let b be 0 + d + 9/3. Is b greater than 24/7? False Let j be (-2 + 3)(48 - 5). Let h = -644/15 + j. Which is smaller: 0 or h? 0 Let y be 4777/68(-2 + -3 + 1). Is y less than 1/4? True Let t = -2.6 - -3. Let r = t - 0.34. Let s = r - -0.14. Is s not equal to 1/5? False Let j(r) = -19r + 734. Let d be j(60). Does d = -403? False Let d = 3/2 - 73/46. Let r = 1666.8 - 1666.9. Is r at least d? False Let k = -112 - -109. Do 1/4 and k have the same value? False Let j = -0.0387 - -0.1387. Is j greater than -598? True Let j = -558 + 6134/11. Let k = 115/286 + j. Let z = -1.5 - -1.6. Is k at most as big as z? True Suppose 11f + 8 = 13f. Suppose 4u - 15 = m, -3m - 23 = fu - 58. Suppose -s + m = 4. Which is greater: s or -3? s Let v(l) = 2l*2 - 6l + 2. Let i be v(5). Let r = -217 + 223. Let y be (-6)/r + -1 - -1. Do i and y have the same value? False Suppose 5d = -23d - 2268. Which is smaller: -83 or d? -83 Let h be 0 - (-42)/(-4 - -7). Let v be 214/14 - 2/7. Let p = h - v. Which is bigger: p or 1/4? 1/4 Let w be ((-24)/20)/(1/(-5)). Suppose 0 = d - 22 + 40. Let p = 24 + d. Is w at least as big as p? True Let p be 4/18 - 572/792. Let w(z) = z*3 + 12z*2 + 12z + 11. Let y be w(-11). Which is bigger: p or y? y Suppose 2 = -3j + 2v, -j - 2v = -4v - 2. Let f be 5/15(j + 1). Is f less than or equal to 0.012? True Let g = 25.9 + -26.4. Which is smaller: g or 0.1? g Let s = 668 - 657. Is 1 <= s? True Let s = -15488.51 + 15399. Let g = 90 + s. Is 0 > g? False Suppose 16p + 254 = 62. Is p bigger than -4/11? False Let o(m) = -3m3 + 4m*2 - 6m + 6. Let l be o(2). Let u be (1 - -1)/(3/((-12)/l)). Which is bigger: 0.2 or u? u Let r = 92 + -93. Let i = 0.6 + -0.6. Which is bigger: i or r? i Let g = 72 - 94. Let z(q) = -77q3 + q2 - 2q + 1. Let v be z(1). Let h be 194/g + 14/v. Is h less than -10? False Let a(n) = -4n2 - 6n + 8. Let s(d) = 7d2 + 11d - 15. Let m(i) = 5a(i) + 3s(i). Let c be m(-4). Which is bigger: c or -4/7? -4/7 Let u = -207/10 - -15101/730. Let c = 21/230 - -4869/33580. Let g = u - c. Is g smaller than -2? False Suppose -2g = 8, 3m - 3g - 1 = 4m. Is 6 bigger than m? False Let g = -58 + 59. Suppose 4 + g = l, -3m - 2l + 13 = 0. Which is smaller: -3 or m? -3 Let p be ((-840)/(-585))/73/4. Do p and 22 have the same value? False Let v = -1373/25 + 55. Which is smaller: 3 or v? v Let a = -29 - -33. Suppose 0 = i + 4i - 3v + 165, -ai - v = 149. Let l = -61 - i. Which is bigger: l or -24? -24 Let i(k) = k*3 - 13k*2 - 3k + 14. Let p = 30 + -17. Let s be i(p). Which is smaller: s or -26? -26 Let f be -8(-20)/480 + (-2977)/8913. Which is bigger: f or -1? f Suppose -z + 0 + 7 = 2q, 5z = 4q + 21. Suppose -3m + q = b, 3m = -8 + 2. Suppose d = 5d, 8 = y + 3d. Which is greater: y or b? y Let l be (2 + -1)(8 + -8). Is l less than 2/709? True Let s = -282 + 282. Which is smaller: s or 24/19? s Suppose -2v - 4p - 18 = 0, -4v - 4p - 21 = -v. Let d = v - -7. Suppose -b = 9 - d. Is 0.1 > b? True Let a = 610.173 + -610. Is a < 1/4? True Let i = 354 - 353. Is i >= 1? True Let k = -462 + 278. Is k != -184? False Let q = -100/3 - -33. Let m = 3 + -3. Which is smaller: m or q? q Let o = 60850/2093497 + 2/15281. Is 1 greater than o? True Let l = 13273/140 + -379/4. Suppose -7c = -2c + 65. Let m(v) = v2 + 14v + 12. Let i be m(c). Is l at least i? True Let w = 92 - 91.8. Are 108 and w non-equal? True Suppose 4s + 5 = -o, -s - 4o - o = 25. Let y be (s + 5)18/(-30). Which is greater: 1 or y? 1 Let b = -940 + 938. Is b less than or equal to -2/123? True Let g = -2.72 - -3. Let i = 5192 - 5191. Which is greater: i or g? i Suppose 16x = 15x - 3. Let k(q) = 3q + 11. Let c be k(x). Let h be 1/(	{ "pile_set_name": "DM Mathematics" }
ive of c*2x*2 + 4c*2x - 3cm*3x - 10cm*2x + 1220m3x*2 - 3x wrt x. 2c2 + 2440m*3 Differentiate 22q*3x*2 + 260q*3 + 67qx3 - 7q with respect to x. 44q3x + 201qx*2 What is the third derivative of -7g5 + g4w - g3w + g*2w - 116 wrt g? -420g2 + 24gw - 6w What is the second derivative of -912n3 - n + 401 wrt n? -5472n Find the first derivative of -79v4 + 33v + 3925. -316v3 + 33 What is the derivative of -24v + 178 wrt v? -24 What is the first derivative of 2r3 - 1219r*2 - 4r - 3649? 6r2 - 2438r - 4 What is the derivative of -5h2 - 6h + 230? -10h - 6 What is the third derivative of -26m*5 + 2m*3 + 22m*2 - m wrt m? -1560m*2 + 12 What is the third derivative of 34j*4 - 3j*3 + 434j*2 - j? 816j - 18 Differentiate 38c + 49 with respect to c. 38 What is the first derivative of 3870i*3 - 675? 11610i*2 Find the second derivative of -1197h*4 + 5947h. -14364h2 Find the second derivative of 49km5 + 20km4 + 332k - m wrt m. 980km*3 + 240km2 What is the second derivative of 7q*3s*2 - 3q*2s*2 - 3q*2s + 9qs*2 - 3qs + 1 wrt q? 42qs2 - 6s*2 - 6s Differentiate 96p3 - p - 127. 288p*2 - 1 What is the first derivative of -12l*2pv2 - 4l*2 - 2lpv*2 + 5p + v*2 - 1 wrt l? -24lpv*2 - 8l - 2pv*2 What is the second derivative of -2715p*2 + 585p + 1 wrt p? -5430 Find the second derivative of -2337l2 - 1464l wrt l. -4674 What is the second derivative of -3m2x*2z + 91m2 + 2mx2 + 8mx - 2mz - x2z + 15x2 wrt x? -6m*2z + 4m - 2z + 30 What is the second derivative of -107b2y + 60by - 2b wrt b? -214y Find the second derivative of 2m2v*2 - 113m*2 + 1584mv2 + 2v*2 + v wrt v. 4m*2 + 3168m + 4 What is the third derivative of 609q5 + q2 + 71? 36540q*2 Find the first derivative of -jrs - 330jr + 2js - 3j + 2rs*2 - 157s*2 - s wrt r. -js - 330j + 2s*2 What is the second derivative of 4j*3 - 961j*2 + 35j + 162 wrt j? 24j - 1922 Differentiate 16l*3q*2 + lq*3 + 130q*3 wrt l. 48l*2q2 + q3 Differentiate -48d4 - 9d*3 + 1286 with respect to d. -192d*3 - 27d*2 Differentiate 369c*3r + 191c3 wrt r. 369c*3 Find the third derivative of -9339r*3 + 4142r*2 wrt r. -56034 Differentiate 727o - 275 with respect to o. 727 Find the first derivative of -8x3y + 221x3 - 2x + 2y4 wrt y. -8x*3 + 8y*3 Find the second derivative of 345r*2 - 271r wrt r. 690 Find the second derivative of -361j2 + 158j wrt j. -722 Find the third derivative of -46t6 - 12t*2. -5520t*3 Find the third derivative of 104d*2o*4 - 40d*2o + 2o6 + 2o*2 wrt o. 2496d*2o + 240o3 What is the third derivative of -3l*5ns + 82l*5s + 12l2ns - ln + 29s wrt l? -180l*2ns + 4920l*2s Differentiate 3t3 - 3t*2 + 201 with respect to t. 9t*2 - 6t What is the third derivative of 15ab*6 - ab*4 + 2ab - b4 - 7b*2 + 3b wrt b? 1800ab*3 - 24ab - 24b Differentiate -199mo*3y - 2mo*2y - 2mo - 4o3y + 2o3 + o - 4y with respect to m. -199o3y - 2o2y - 2o Find the third derivative of 181u*3 - 2615u*2 wrt u. 1086 Find the third derivative of -250l*6 + 16l*2 + 11l wrt l. -30000l3 Find the third derivative of -207i*6 - 2i*4p3 + i2p3 - 2ip3 + 59ip2 wrt i. -24840i*3 - 48ip3 Find the third derivative of -61m*3 - 97m*2. -366 Find the second derivative of -2j*2p*3 - 87j*2p - 2jp + 1184p3 wrt p. -12j*2p + 7104p Differentiate -3b*2nu2 + 150b*2n + 638nu*2 - 2n with respect to b. -6bnu2 + 300bn What is the third derivative of 488a*3d + a3 + a2d - 2a*2 + 12d wrt a? 2928d + 6 What is the second derivative of 493b*3 + 1837b wrt b? 2958b What is the second derivative of 35h*4i*3 + 7h*2i*3 - 14h + 11i3 wrt h? 420h*2i*3 + 14i*3 What is the third derivative of 148d5 - d4 + 8d3l - 2d2l + 18d - 13l wrt d? 8880d2 - 24d + 48l Find the first derivative of 124bl2q - bl2 + 33bl - 2b wrt q. 124bl2 What is the second derivative of p3w3 - 556p*2w*3 - 7pw3 + pw - 2p + 88w*3 wrt p? 6pw3 - 1112w*3 Find the second derivative of -26323x*5 + 112x - 50 wrt x. -526460x3 What is the derivative of -106g*3p - g3 + g2p - 77 wrt p? -106g3 + g2 What is the derivative of -115i2 - i - 204 wrt i? -230i - 1 What is the second derivative of 28q2r + 79q2 - 3qr + 7q + 16r wrt q? 56r + 158 What is the second derivative of 2r4t*2 - 8r*2t*2 + 2rt2 - 108r wrt r? 24r2t*2 - 16t*2 What is the second derivative of -10959v4 - v2 - 632v - 2? -131508v*2 - 2 Find the second derivative of -3805v*3 - 3961v. -22830v What is the third derivative of -7d*6z2 + d5z + d2z2 + d2z - 9d*2 wrt d? -840d*3z*2 + 60d*2z Find the third derivative of -3f6j*2 - 14f*5j*2 - 3f*2j*2 - 18fj2 wrt f. -360f*3j*2 - 840f*2j*2 Find the first derivative of -2kp + 26k - 7p4 + 30p*2 + 4 wrt p. -2k - 28p3 + 60p What is the derivative of 17178m3 + 2m + 2128? 51534m2 + 2 What is the second derivative of 6hp3y*2 + 9hp2y - 2hpy - 42hp - 7hy2 + 10p*3 + 3y wrt p? 36hpy2 + 18hy + 60p What is the derivative of 458p2 + p + 1110? 916p + 1 Find the third derivative of 728u3 + 91u*2 - 5. 4368 What is the second derivative of 6h*2k + 8h2 - 85h - 2k - 5 wrt h? 12k + 16 Find the third derivative of -4k3n*3 + 2k*3n*2s - k*3 - kn*3s + 2kn*2 - 4ns wrt n. -24k*3 - 6ks Find the third derivative of 331j5 + j2 + 292 wrt j. 19860j2 What is the derivative of -131l*3s*2 - 6ls2 + 17s*2 - 117 wrt l? -393l*2s*2 - 6s*2 Find the second derivative of 3j*4py - 16j*4y - j*2p - 6jpy + j + 3py - p wrt j. 36j*2py - 192j*2y - 2p Find the second derivative of 1571f*2 + 422f + 10. 3142 Differentiate 3a2fr - a2f + 12af - 15fr + 27f wrt r. 3a*2f - 15f Find the second derivative of co*5 - 4co3 + 5co2 + 27co + c + 2o wrt o. 20co*3 - 24co + 10c What is the second derivative of 7542w2 - 2w + 1382? 15084 What is the third derivative of -17n3z*2 - 6n*3 - 229n*2 + nz*2 wrt n? -102z*2 - 36 Find the third derivative of 80fk5 - 107fk - k5 - 2k*2 wrt k. 4800fk2 - 60k*2 What is the derivative of 21c*3 - 3c - 185? 63c2 - 3 Find the third derivative of -j2o*3y - j*2o*2 - 2jo2y*2 + 9joy*2 - 2jo + 20o*3y*2 + 6o*3y + 3oy*2 wrt o. -6j*2y + 120y2 + 36y Find the third derivative of 7767g3 + 3g*2 + 869g wrt g. 46602 What is the first derivative of g*2qz - 11g*2z - 3g2 + 2gqz - 10qz + 2z wrt q? g2z + 2gz - 10z Differentiate k2 + 1037k - 3627 with respect to k. 2k + 1037 What is the second derivative of -444b*5 + 5b*4 - 6087b + 2? -8880b3 + 60b*2 What is the derivative of 222l*3 - 3l + 311? 666l2 - 3 Find the third derivative of -686au4 - 938au2 wrt u. -16464au What is the second derivative of -14l*3o + 2l3 + 40l*2 + 3lo - 4l + 666 wrt l? -84lo + 12l + 80 What is the third derivative of -570b*3z*3 + 2b*2 + bz*3 - 140bz wrt b? -3420z*3 Find the first derivative of 122m*2 - 3m - 4143 wrt m. 244m - 3 What is the second derivative of 3060n*3 + 9n - 59 wrt n? 18360n Find the second derivative of 312w*5 - w + 294. 6240w*3 Find the second derivative of 2l*4 - 276l*3 + 4010l. 24l2 - 1656l Find the second derivative of 72f2v*3 - 2f2 + v4 + 444v wrt v. 432f*2v + 12v2 What is the first derivative of 15l*3v + 1763l3 - 26v wrt v? 15l3 - 26 What is the third derivative of -2161n*3o - 22n2 + 53no wrt n? -12966o Differentiate 750b2 - 904 with respect to b. 1500b Find the second derivative of 3c4h + 3c2gh3 - 4c*2h*3 - cgh + gh*3 + 23gh wrt c. 36c*2h + 6gh*3 - 8h*3 What is the third derivative of 408g*5 - 8g*2 + 6? 24480g**2 Find th	{ "pile_set_name": "DM Mathematics" }
4000000 Let d(z) = z*3 + 13z*2 + 22z + 3. Let x be d(-11). Let u = -16 - -22. Let n be (1000/u)/(x/(-4500)). What is n rounded to the nearest 100000? -300000 Suppose -k = 2h - 23603, 14997 = -5h - 3k + 74006. What is h rounded to the nearest 1000? 12000 Suppose -15 + 3 = -l. Suppose 3f = -i + l, 2i = 5i - 2f - 3. Let x be (1 - 0)/(i/(-87)). What is x rounded to the nearest 10? -30 Let z = 24 + -25.5. What is z rounded to the nearest integer? -2 Let y(h) = -338889h*2 - 2h - 8. Let q be y(-6). Round q to the nearest 1000000. -12000000 Let k be 20(-33 + -2 + 1). What is k rounded to the nearest 100? -700 Let l(m) = 3400m + 3. Let h be l(-8). Let s = 42640 + h. Let p = s + -29943. What is p rounded to the nearest one thousand? -15000 Let k = -0.067 + 28.067. Let p = -6 + k. Let a = p + -22.66. Round a to 1 dp. -0.7 Let s = -0.00300204 + 0.003. What is s rounded to 7 decimal places? -0.000002 Let g = -28734345.6213651 - 1.3786349. Let w = g + 28734347.20000009. Let c = 0.2 - w. Round c to 7 dps. -0.0000001 Let f be (2 - 10)/((-2)/(-10)). What is f rounded to the nearest one hundred? 0 Suppose -4s + 1260 = -2s. Let b = s + -960. What is b rounded to the nearest 100? -300 Let g = -17.27431 - -17.33. Let h = -0.056 + g. Round h to four decimal places. -0.0003 Let l = 458352 + -262352. What is l rounded to the nearest 100000? 200000 Let p = 7 - 13. Let c be (-5828)/(-6) - 4/p. Let q = c - 362. What is q rounded to the nearest 100? 600 Suppose -23 = -3q + 3j + 1, -28 = -2q + 5j. Let a(y) = -1687y3 - 3y*2 + 4y. Let k be a(q). Round k to the nearest 10000. -110000 Suppose 5 = 2r - 3j - 1, 0 = 4j - 16. Suppose -2l = -6, rl = -2x + 4l - 8799985. What is x rounded to the nearest one million? -4000000 Let v = -94 - -177. Let h = v + -82.9999957. Round h to six dps. 0.000004 Suppose 5q + 3b + 55 = 0, -3b + 10 = -2q - 12. Let g = -61 + q. What is g rounded to the nearest 10? -70 Let d = 3 - 7. Let q = d - -25. What is q rounded to the nearest ten? 20 Let y = -216.71 + 215. Let n = y - -1. Round n to one dp. -0.7 Let l = -0.6 + -0.4. Let c = -0.9976 - l. Round c to three dps. 0.002 Suppose -4q + 4 = -4. Let a(r) = 606r2 - 3r + 2. Let p be a(q). Round p to the nearest one hundred. 2400 Let f = -28.599204 + 28.6. Round f to four decimal places. 0.0008 Let f = 7.3 - 7. Let o = -362 - -361.694. Let s = f + o. Round s to 2 decimal places. -0.01 Let r = -0.37 - -0.07. Let o = r - -0.27. Let j = 0.0303 + o. What is j rounded to 3 dps? 0 Let r = -1.04 + 0.04. Let t = r + 0.95. Let g = t - -0.049. Round g to three decimal places. -0.001 Let v = 814 - -447. Suppose 6n - 3n = 1563. Let x = n - v. Round x to the nearest 100. -700 Let c = 0.6 - 2.6. Let l = -1.8 - c. Let n = l + -0.25. Round n to 2 dps. -0.05 Let m = -9831 + 19931. What is m rounded to the nearest 1000? 10000 Let r(g) = -7g - 10. Suppose 24 = -i + 3b, b = -5i - 3b - 44. Let v be r(i). What is v rounded to the nearest ten? 70 Let i = -211 - -145. What is i rounded to the nearest ten? -70 Let c = -7.7613515 - -7.694290151. Let i = -13.067056949 - c. Let b = i - -13. What is b rounded to six dps? 0.000004 Suppose 2t - 91005 = 5u + 7t, 3u = t - 54599. What is u rounded to the nearest 1000? -18000 Let y(h) = 2h3 - 4. Let o be y(4). Let m = o + 3. What is m rounded to the nearest ten? 130 Let m = -0.8418 + 0.04186. Let p = 0.8 + m. Round p to five decimal places. 0.00006 Let g = 50.04 + -40. Let o = g + -10. What is o rounded to 2 dps? 0.04 Let w = 99.000372 - 99. Round w to four decimal places. 0.0004 Let h = -21.59999774 - -21.6. Round h to six decimal places. 0.000002 Let x = 12.18 + -13. Let g = x - -9.72. Round g to the nearest integer. 9 Let n = -2 + -4. Let o(m) = -4m*3 + 4m3 - m3 + 7m2 + 2m*3 + 5m - 7. Let v be o(n). What is v rounded to the nearest ten? 0 Let y = -389.00000458 + 389. What is y rounded to 7 decimal places? -0.0000046 Let b = 45.99999937 + -46. What is b rounded to seven dps? -0.0000006 Let g = -3170 + -127830. Round g to the nearest 10000. -130000 Let g = 488444 + -178046. Suppose 2d - 5s - 726627 = g, 2d = -2s + 1037046. Let x = d + -218520. Round x to the nearest one hundred thousand. 300000 Let p be 2 + -3(-2 + 3). Let z be p(0/3 + -5). Suppose 0 = -zx + 3m + 309988, 2x + m = -2x + 248004. Round x to the nearest 10000. 60000 Suppose 8436527 = 5o + 5p - 6563488, -2p - 14999994 = -5o. Round o to the nearest one hundred thousand. 3000000 Let r = -25 - -37. Let n = -12.0006 + r. Round n to 3 dps. -0.001 Let h(s) = s*2 + 8s - 2. Let r be h(-9). Suppose 3x - 5w + 3 = 16, -5w - 7 = 3x. Let o = x - r. What is o rounded to the nearest integer? -6 Let g = -0.22 + -19.78. Let d = -8 - g. Let q = d + -11.99999965. Round q to seven dps. 0.0000004 Let p = 131 - 144.2. What is p rounded to the nearest integer? -13 Let q = 81 - 51. Let v = -30.00000038 + q. Round v to 7 dps. -0.0000004 Let a = 40 - 19. Let f be (1 + -21)(a - 1). Let g be (f/(-3))/(-2)1635. What is g rounded to the nearest 10000? -110000 Let q = 34 - 56. Let a = q - 17. Let o = -38.18 - a. Round o to 1 decimal place. 0.8 Let n = 0.116 - 0.116071. Round n to five dps. -0.00007 Let j = -48.85 - -40.788. Let x = j + 8. Round x to 2 decimal places. -0.06 Let f(c) = c + 8. Let q be f(-6). Let x = 4896384 - 2706384. Suppose -x = -r - qr. What is r rounded to the nearest 100000? 700000 Let p = 2.6347 - 0.0247. Let i = -35 + 37.8. Let c = p - i. Round c to one dp. -0.2 Let a = -0.08 - -0.63. What is a rounded to one decimal place? 0.6 Suppose 3q = 475554 + 454446. Round q to the nearest one hundred thousand. 300000 Let d = -1 - -3. Suppose 5p - dp + 441 = 0. Round p to the nearest ten. -150 Let r = 1.6 + 1.73. Let b = r + -3.3137. What is b rounded to 3 dps? 0.016 Let p = -1299332018 + 1299332109.0000039. Let d = p - 91. Round d to 6 dps. 0.000004 Let p = 7728172 + -7728180.000034. Let g = -8 - p. Round g to 5 dps. 0.00003 Let v = 89945 + -89939.99992. Let s = -1.1 - 3.9. Let c = v + s. What is c rounded to five dps? 0.00008 Suppose -5w - 3s = -242, -5w + s = 6s - 240. Round w to the nearest 100. 0 Let y = -348 + 566. Suppose -y = -4x + k, -x + 2k = 4x - 274. Let g be 12/x - 11700002/9. Round g to the nearest 1000000. -1000000 Suppose 4g - 1889996 = 5s, -2g = s + 2s + 1134002. What is s rounded to the nearest one hundred thousand? -400000 Let w = 0.45 + -0.45000053. Round w to seven dps. -0.0000005 Let r(y) = -y3 + 2. Let x be r(2). Let c(s) = 509s3 - s2 + 2s - 8. Let m be c(x). Round m to the nearest 10000. -110000 Suppose 602482 = 2x + 2f - 531512, 0 = 3x - 3f - 1701009. Round x to the nearest 100000. 600000 Let c(p) = 3249999p*2 + 3p - 2. Let d be c(2). What is d rounded to the nearest 1000000? 13000000 Let b be 3 + -2 + (-2)/(-2). Suppose z + 10 = bz - 2t, 0 = 5z + 4t - 22. Let u be -61600(2 + (-87)/z). What is u rounded to the nearest 100000? 800000 Let f = 490.99 + -485. Let a = 6 - f. What is a rounded to one decimal place? 0 Let v(n) = 3n*3 - 9n*2 + 4n + 8. Let q be v(8). Round q to the nearest ten thousand. 0 Let i be 2/10 - (-556)/(-5). Let s = 33 + i. Round s to the nearest 10. -80 Suppose 0f + 12 = 4t - 2f, 0 = -4t - f + 6. Let r be ((-2637)/6)/(t/(-8)). Let q = -2518 + r. What is q rounded to the nearest 100? -800 Let f = -0.4 + -0.2. Let l = f - -0.5985. Round l to 3 decimal places. -0.002 Let c(y) = y*2 + 6y + 2. Let v be c(-6). Suppose 3s + 3i = vi - 28, -3i = s + 4. Let p be (-55000004)/10 + (-4)/s. Round p to the nearest one million. -6000000 Let b(h) = 2536h3 + 2h*2 + 9h - 9. Let r be b(7). What is r rounded to the nearest 100000? 900000 Let h = 0.27 + -0.11. Let n = h + 0.2. Let i = -0.14 + n. What is i rounded to one decimal place? 0.2 Let n = 1060932 + -5263704. Let a = n + 4202592.9883. Let x = a + 179. What is x rounded to 3 decimal places? -0.012 Let m(k) = 89400k2 + 1. Let p be m(-1). Let a = p + 79699. Suppose -4u - 26900 = a. Round u to the nearest 10000. -50000 Let u = 127 + -126.9911. Round u to three dps. 0.009 Let b = -246635 - -138835. What is b rounded to the nearest ten thousand? -110000 Let b = -130 - -130.0000073. What is b rounded to 6 dps? 0.000007 Let	{ "pile_set_name": "DM Mathematics" }
-14z3 Let d(t) = 131t + 46. Let j(h) = 146h + 47. Let q(p) = -5d(p) + 6j(p). Let c(g) = -13g - 3. Determine 52c(x) + 3q(x). -13x Let i be (-10)/(-3)(-36)/10. Let s be -15(2 + i/3). Let j(b) = 1 + 10 + sb - 41b. Let x(a) = -7a + 7. Give 5j(z) - 8x(z). z - 1 Let l be -26-3230/45. Let v(g) = 377g*2 - 104g - 104. Let u(r) = -18r2 + 5r + 5. What is lu(q) + 5v(q)? 13q2 Let o(u) = -4u*3 - 10u*2 + 18u + 10. Let s(q) = -q3 - q2 + 2q + 1. Let g(v) = 4o(v) - 40s(v). Let h(r) = 16r*3 - 5r. Give -5g(w) + 8h(w). 8w3 Let s(v) be the second derivative of 0 - 2v*2 + 1/2v*4 + v + 0v*3. Let r be (7 - 1)1/2. Let y(k) = 5k2 - 3. Give rs(c) - 4y(c). -2c*2 Let x(t) = -9t - 1. Let c(z) = -z. Suppose -3b + 5f = 8, 16f = 20f - 4. What is bx(r) + c(r)? 8r + 1 Let u(q) = -q + 3. Suppose 0 = -3n - 9, g - 2n - 8 = 3g. Suppose 4m + 102 - 118 = 0. Let c(p) = 1. Calculate gu(h) + mc(h). h + 1 Let s be 16/(-4)21/(-28). Let t(a) = -11a + 9. Let p(g) = 4g - 3. Determine st(m) + 8p(m). -m + 3 Let q(u) = -6u*2 - 7u + 12. Let r(h) = 5h2 + 6h - 11. Determine 4q(z) + 5r(z). z*2 + 2z - 7 Let r(t) = 2t3 + 13t*2 - 280t + 13. Let f(m) = -m*3 - 6m*2 + 139m - 6. Calculate 13f(x) + 6r(x). -x*3 + 127x Let r(h) be the second derivative of -h*2/2 - 74h + 2. Suppose i = -3w + 22, 0 = w - 3w - i + 16. Let q(s) = 2s - 3. Calculate wr(x) - 2q(x). -4x Let a(f) = f*2 + 57f + 701. Let t be a(-39). Let d(g) = 3g2 + 11. Let u(z) = z2. What is tu(s) + d(s)? 2s2 + 11 Let y(d) = 6d3 - d2 + d + 2. Let g(p) = p3 - p2 - p + 2. What is -g(m) + y(m)? 5m3 + 2m Let a(i) = i*2 - 3i. Let h be a(5). Let t(c) = c - 3. Let k(p) be the first derivative of -p*2 + 7p + 6. Give ht(g) + 4k(g). 2g - 2 Let j(w) = -5w*2 + 4w + 1. Let y(f) be the third derivative of 7f5/30 - 11f4/24 - f3/2 + 2f2 + 9f. What is -17j(p) - 6y(p)? p*2 - 2p + 1 Let z(o) = 618 + 82o2 - 80o2 - 623. Let c(r) = -r2 + 4. Let f be (-4)/14 - 60/(-14). Let a = 6 - f. Give az(q) + 3c(q). q*2 + 2 Let q(k) = 17k*3 + 76k - 11. Let t(m) = 3m3 + 15m - 2. What is 2q(j) - 11t(j)? j*3 - 13j Let n(w) = 2w2 + 2w + 2. Let r(h) = h*3 + 9h*2 + 12h + 9. Let z(l) = -l*3 - 9l*2 - 11l - 9. Let o(d) = 3r(d) + 4z(d). Determine -9n(j) - 2o(j). 2j3 - 2j Let p(t) = 6t3 + 3t + 3. Let c(s) be the third derivative of 0s5 - 1/24s*4 - 38s*2 + 0 - 1/6s*3 - 1/120s*6 + 0s. What is -3c(v) - p(v)? -3v3 Let w(d) = d2 - 1. Suppose -3 + 35 = -32s. Let q(z) = 3z*2 + 4z - 4. What is sq(o) + 5w(o)? 2o2 - 4o - 1 Let w(b) = -8b + 7. Let s(h) = -14h + 498. Let y be s(36). Let z(o) = -7o + 8. Give yz(x) + 5w(x). 2x - 13 Let y(t) = -t*2 + 1. Let p(g) be the first derivative of -2g*3 + 7g + 1. Suppose -4x - 32 = -4u, -5x - 7u + 9u = 25. What is xp(c) + 21y(c)? -3c*2 Let u(j) = 7j + 33. Let c(f) = -8f - 33. What is 6c(x) + 7u(x)? x + 33 Suppose 196h - 162h - 136 = 0. Let j(v) = 2v*3 - 2v*2 - v - 4. Let p(y) = 4y*3 - 3y*2 - 2y - 7. Suppose 10 + 4 = -2s. Calculate hp(n) + sj(n). 2n*3 + 2n*2 - n Let l(r) = 3r - 2. Let i(a) = -a + 1. Let v be (-2)/(-6 + 115/20). Calculate vi(t) + 3l(t). t + 2 Let m(w) = -3w2 - 2. Let i be (-3)/(-54)6(-12)/1. Let d(n) = 2n*2 + 2. Give id(t) - 3m(t). t2 - 2 Let p(t) = -t. Let b(o) = -o3 + 6o*2 - 4o. Give b(l) - 6p(l). -l3 + 6l*2 + 2l Let w(x) = 3x. Let u(l) = 2l - 2. Let b(k) = 2k - 1. Let z(n) = -6b(n) + 3u(n). Calculate -7w(d) - 3z(d). -3d Let j(s) = 10s2 - 6s - 5. Let m(p) = -13p2 + 9p + 8. Let y(d) = 14d2 - 10d - 9. Let r(t) = 3m(t) + 2y(t). What is 7j(k) + 6r(k)? 4k2 + 1 Let g(s) = -2s + 6. Let x(q) be the first derivative of 3/2q2 + 6 - 7q. Give 5g(d) + 4x(d). 2d + 2 Let p(h) = 1019h*2 + 2h. Let w(q) = 509q2 + q. What is -3p(v) + 5w(v)? -512v*2 - v Let s(l) = 6l + 7. Let a(v) = -3 + 13v + 8 - 10v - 3 + 1. What is -10a(q) + 4s(q)? -6q - 2 Let y(h) = 13h*3 - 4h + 1. Let p(t) = 4t3 - t. Suppose -5x + 15s + 2 = 11s, -4x + 1 = -3s. Calculate xy(b) + 7p(b). 2b3 + b - 2 Suppose 8t + 6 = 5t. Let j(a) = -10a + 11. Let s(c) = c - 1. Let i(x) = -j(x) - 4s(x). Let w(p) = p - 1. Determine ti(b) + 14w(b). 2b Suppose 2 = 8j - 6. Let u(n) = -7n + 1. Let k(g) = -2g2 - g. Let d(h) = 5h*2 + 3h. Let i(z) = -d(z) - 2k(z). Calculate ju(y) - 2i(y). 2y*2 - 5y + 1 Suppose -2 - 2 = 4f. Let z(k) = -k3 + k2 + k. Let o(r) be the first derivative of -3r*4/2 + 2r3/3 + r2 + 313. What is fo(d) + 2z(d)? 4d3 Let q = -293 - -294. Let w(v) = -7v*3 + 6v2 + 9. Let h(z) = -z3 + z*2 + 1. What is qw(r) - 5h(r)? -2r3 + r2 + 4 Let r(z) = -4z2 - 3. Let l(t) be the second derivative of 5t*4/4 + 11t*2/2 + 13t. Let d be (6 - 7)(6 + 0). Determine dl(k) - 22r(k). -2k2 Let s(t) = t3 - 5t + 5. Let p(x) = 3x*3 - 30x + 9x - 175 + 99 + 97. Let v = -5 - -10. What is vp(q) - 21s(q)? -6q*3 Let b(v) = -v - 9. Let y(s) = -5s*2 - 3s + 8. Let z be y(-4). Let u be ((-4)/(-10))/((-8)/z). Let t(m) = 5. What is ub(w) + 5t(w)? -3w - 2 Let z(q) = -q. Let w(m) = -m. Let s(f) = 2f. Let b(g) = -s(g) - 3w(g). Suppose 3t = -3t - 30. Determine tz(j) - 2b(j). 3j Let t(u) = 2u3 - 8u*2 - 8u - 576. Let b(s) = s*3 - 2s*2 - 2s + 1. Calculate -4b(h) + t(h). -2h*3 - 580 Let p(q) = 1380q*3 - 27q*2 - 54q. Let k(r) = -106r3 + 2r*2 + 4r. Give 27k(w) + 2p(w). -102w3 Let n(i) = 2i + 1. Let d(c) = 7c + 33. Give d(a) - 6n(a). -5a + 27 Let v(r) = 74r + 2. Let s(p) = 78p + 3. Determine 5s(x) - 6v(x). -54x + 3 Let h(o) = 1 + 7 - o - 4o - 4. Let l be 0 + -3(-6)/(-9). Let b be (12/(-30))/(l/(-10)). Let a(g) = 4g - 3. What is bh(n) - 3a(n)? -2n + 1 Let v = -17 - -22. Suppose vw + 28 = -17. Let c(i) = i3 + 5i*2 - 9i + 9. Let z be -2 + 3 + -4 + 1. Let q(r) = -r*2 + 2r - 2. Determine wq(n) + zc(n). -2n3 - n2 Let u(n) = -n2 + 2n. Let w(y) be the second derivative of y5/20 - y4/6 + y*3/2 + 12y + 17. Suppose 0 = 2f - 5f + 12. What is fu(c) - 3w(c)? -3c3 + 2c2 - c Let s(y) be the third derivative of y4/8 - 23y3/6 + 4y2 - 2. Let t(d) be the second derivative of d3/6 - 4d2 - d. Determine 6s(x) - 17t(x). x - 2 Let c(f) = 4f*3 - 9f - 5. Suppose -5s - 5 = r - 0r, -r - 4s = 5. Let u be (6/9)/(r/(-15)). Let l(h) = -3h + 0h + h - 1 + h3. What is uc(n) - 9l(n)? -n3 - 1 Let k(q) = 51q*2 - 4q - 3. Let r(t) = -101t2 + 7t + 5. What is 5k(h) + 3r(h)? -48h2 + h Suppose r = 4, 4j = -j + 5r + 10. Let c(d) = -7d - 11. Let k(w) = -6w + 5w + 23 + 10w + 6w. Calculate jk(x) + 13c(x). -x - 5 Let i(q) = -16q2 - 5q + 5. Let f(z) = -24z2 - 7z + 7. Let h be -1 + 1 - (-5 + 10). Give hf(c) + 7i(c). 8c2 Let i(b) = -119b*3 - 7b2 + 14. Let l(q) = -q3 - q*2 + 2. What is -i(w) + 7l(w)? 112w3 Let t(y) = -1. Let f(w) be the second derivative of 5w*3/6 + 5w*2/2 + 129w. Give f(p) + 2t(p). 5p + 3 Let a(p) = 11p3 - 2p*2 - 2p + 2. Let x(s) = 11s - 154. Let w be x(5). Let q(h) = -540h*3 + 99h*2 + 99h - 99. Give wa(t) - 2q(t). -9t3 Let y(w) = w3 - w2 + w - 1. Let l(z) = 9z*3 - 2z*2 + 6z - 5. Calculate -l(k) + 5y(k). -4k*3 - 3k*2 - k Let h be (-2 - 84/(-7 - -3))5. Let z(t) = -703t3 - 95t*2. Let j(f) = 22f*3 + 3f*2. Give hj(a) + 3z(a). -19a3 Let j(c) = -c2 - c. Let g(m) = 5m3 + 3m*2 + 2m. Calculate -g(a) - j(a). -5a3 - 2a*2 - a Let c(a) = -35a + 41. Let j(y) = 18y - 20. Let s(o) = -6c(o) - 13j(o). Let d(w) = -5w + 1 + 2 + 0w. Determine 14d(l) - 3s(l). 2l Let f(n) = 0 + 2 - n2 - 3 + n. Let h(i) = -i3 + 5i2 - 5i + 5. Suppose 6r - 4r - 2 = 0. Let x be -1 + r + -3 + 2. Calculate xh(u) - 5f(u). u*3 Suppose n - 3j + 16 - 32 = 0, -5n - 4j - 15 = 0. Let q(a) = -9a2 - 2a. Let x(i) = -i. Determine nq(k) - 2x(k). -9k2 Let y(z) = 5z + 1. Let j(u) be the third derivative of 0 + u*2 - 1/6u*3 + 0u - 1/6u4. Let m(a) = -22a + 25. Let n be m(1). Give ny(c) + 4j(c). -c - 1 Suppose -7n + 187 = 10n. Let k(y) b	{ "pile_set_name": "DM Mathematics" }
2 In base 13, what is 250 + 11b26? 12076 In base 2, what is -10011111110000110010 + 11110100111? -10011111010010001011 In base 15, what is 0 - 317507? -317507 In base 5, what is 22 + 4043102? 4043124 In base 7, what is -5052 - 301064? -306146 In base 10, what is 10172 + 18605? 28777 In base 5, what is -103040 - 31424? -140014 In base 3, what is -101 - -10012212101221? 10012212101120 In base 2, what is 1100111100110100111101 + -100001010? 1100111100110000110011 In base 16, what is 4b - 891e? -88d3 In base 13, what is 6772 - 3c4? 637b In base 9, what is 1005 + 16805? 17811 In base 7, what is 5 - -14261312? 14261320 In base 6, what is -1352 + 52154232? 52152440 In base 12, what is -5469 - -a8? -5381 In base 4, what is -10121300 + -1011032? -11132332 In base 14, what is -19b88 - -34? -19b54 In base 7, what is -5312 + -126162? -134504 In base 6, what is -10051101531 - 0? -10051101531 In base 14, what is -9 - 873c47? -873c52 In base 6, what is -120 - -2001142? 2001022 In base 4, what is -12200121201 + -10102? -12200131303 In base 8, what is -3 + 344403? 344400 In base 6, what is -1424130 + -221? -1424351 In base 4, what is 1033001232 - -12323? 1033020221 In base 7, what is -4 - -51426604? 51426600 In base 6, what is 103014223234 + 3? 103014223241 In base 8, what is -11076 - 73607? -104705 In base 7, what is -435653 + -61? -436044 In base 13, what is 21367c3 - -1? 21367c4 In base 16, what is 2a69 + 138? 2ba1 In base 16, what is 13 - 2bca5? -2bc92 In base 16, what is 150874c2 - -4? 150874c6 In base 4, what is -2121 + -101232102? -101300223 In base 16, what is -150733 - 13? -150746 In base 8, what is -3 - 453201706? -453201711 In base 8, what is -61151 + 47142? -12007 In base 10, what is 20091 - 15057? 5034 In base 10, what is -585 - -892? 307 In base 7, what is 350 - -626564? 630244 In base 3, what is 122 + -1212202101201? -1212202101002 In base 8, what is -34 - 755540? -755574 In base 8, what is 13 + 21565574? 21565607 In base 11, what is 294330 - -4? 294334 In base 5, what is -21212444412 - 0? -21212444412 In base 11, what is 0 + -4330a8? -4330a8 In base 7, what is 4 + -26302156? -26302152 In base 14, what is 29137 - 1c55? 272c2 In base 2, what is -1000010111 - -10001100111100? 10000100100101 In base 6, what is -3 + 154353042? 154353035 In base 7, what is -5 + -6112536? -6112544 In base 6, what is 4 - 11522111? -11522103 In base 3, what is 212001212000211111 - 2? 212001212000211102 In base 14, what is -4d1 + -342c? -391d In base 3, what is -1110101101101 + -20? -1110101101121 In base 14, what is -484 - d0? -574 In base 13, what is 55c03c4 - 5? 55c03bc In base 4, what is 0 + -12002022021012? -12002022021012 In base 7, what is -25236 - 11643? -40212 In base 5, what is -30401 - 413233? -444134 In base 7, what is -340136316 + 11? -340136305 In base 5, what is 41041 - 22311? 13230 In base 6, what is -1414310 + 102? -1414204 In base 8, what is -356 + -314371? -314747 In base 15, what is -5 + 602193? 60218d In base 14, what is -4 + -871c33? -871c37 In base 2, what is -10001010000001101110 - -100000101010? -10001001100001000100 In base 9, what is 617604 - -187? 617802 In base 14, what is 8c - -691c? 69aa In base 13, what is -1b53 + 269b5? 24b62 In base 12, what is 2141b68b - -1? 2141b690 In base 6, what is 2 - 2313232213? -2313232211 In base 14, what is -8278 + -22d7? -a571 In base 12, what is 13a5803 + a5? 13a58a8 In base 14, what is 4 - 1a78953? -1a7894d In base 16, what is 5 - -129d356? 129d35b In base 10, what is -12 + -15651534? -15651546 In base 3, what is 10 + -101121102021200? -101121102021120 In base 3, what is 211222 - -120211011122? 120212000121 In base 10, what is -13073 + -6286? -19359 In base 10, what is 5 + -103593011? -103593006 In base 13, what is -731 - 2042? -2773 In base 6, what is 111440430110 + -1? 111440430105 In base 4, what is -1231203 - -13301202? 12003333 In base 5, what is 1 + 223003343? 223003344 In base 5, what is -3140 + -302442? -311132 In base 16, what is 10b66 - 11a? 10a4c In base 6, what is -103352050441 - 1? -103352050442 In base 4, what is 3101132031100 + -20? 3101132031020 In base 3, what is 220001200210 - -211? 220001201121 In base 15, what is 8a5 + -451a1? -447eb In base 9, what is 1006 - 7868? -6862 In base 15, what is 166112b + 7? 1661133 In base 10, what is 53 - -1018075? 1018128 In base 8, what is -5144 + -1532? -6676 In base 3, what is -10002012 - -121002102? 111000020 In base 6, what is 20425 - -101513? 122342 In base 8, what is -55773315 + -10? -55773325 In base 11, what is -24a56666 + 5? -24a56661 In base 6, what is -30252424532 - -4? -30252424524 In base 13, what is 4897937b + 3? 48979381 In base 14, what is 2b7194 - 51? 2b7143 In base 7, what is 266665 + -22? 266643 In base 11, what is 5 - a1a53a25? -a1a53a20 In base 3, what is -12120102112010 - 1021? -12120102120101 In base 2, what is 10100010101000 + 10100011101? 10110111000101 In base 13, what is 241a1c8 - 1? 241a1c7 In base 7, what is 3105325002 + 4? 3105325006 In base 3, what is 2221 - -20210201210? 20210211201 In base 9, what is -4 - 57047178? -57047183 In base 8, what is -55177101 + 2? -55177077 In base 5, what is 232 + -2140203? -2134421 In base 8, what is 1131 - 106757? -105626 In base 16, what is 12928 + -55f? 123c9 In base 13, what is 1cc256b7 + 1? 1cc256b8 In base 2, what is 1011001011100101011111 - 10100011? 1011001011100010111100 In base 3, what is -100 - 112021000010010? -112021000010110 In base 14, what is d1d554 - -d? d1d563 In base 10, what is -28102 + -5511? -33613 In base 16, what is -3e4d + -c67? -4ab4 In base 9, what is -6230 + -153234? -160464 In base 14, what is -3 - 3a9016? -3a9019 In base 15, what is -2b5 + -4686? -494b In base 15, what is -4d61c + -19? -4d636 In base 13, what is 18c250b + -74? 18c2467 In base 2, what is -10101 - -11100010001110010110? 11100010001110000001 In base 7, what is -251614155 - 36? -251614224 In base 14, what is 2802319d + 5? 280231a4 In base 15, what is -dc663 + 4? -dc65e In base 7, what is -22 - -2425165? 2425143 In base 2, what is -1000101000111011001001011 + 10? -1000101000111011001001001 In base 15, what is 2 - -138771? 138773 In base 15, what is -10 - -ade7e2? ade7d2 In base 4, what is 3310 + -13000123? -12330213 In base 6, what is 40500 + 335404? 420304 In base 11, what is -70152 - -1100? -6a052 In base 15, what is -3b223 + -7ad? -3b9d1 In base 11, what is 1098155 - -11? 1098166 In base 3, what is 1001202 - -110000? 1111202 In base 4, what is -120212003313321 - 2? -120212003313323 In base 13, what is 79b - -ac4? 1592 In base 8, what is 41 - 2325344? -2325303 In base 5, what is -3403 + 10101312? 10042404 In base 5, what is 10340421 + -3401? 10332020 In base 12, what is -a207633 + 20? -a207613 In base 9, what is -3 - -28675463? 28675460 In base 10, what is 13652 + 15870? 29522 In base 12, what is 3abaa + 2274? 41262 In base 11, what is -251805 + 284? -251531 In base 11, what is -1 + 107602? 107601 In base 16, what is 0 + 2137d1? 2137d1 In base 15, what is 990d - -178? 9a86 In base 8, what is -10 + 7036050? 7036040 In base 5, what is 4 + 144441333? 144441342 In base 4, what is 32202102020 - 1203? 32202100211 In base 6, what is 120212433 - -11? 120212444 In base 12, what is -5538b - 4a9? -55878 In base 6, what is 44021102141 + -3? 44021102134 In base 7, what is 5 - 11425343? -11425335 In base 10, what is 92743 + -11293? 81450 In base 12, what is a650985 - 1? a650984 In base 11, what is -510a12737 + 1? -510a12736 In base 12, what is -8b9308 + -3? -8b930b In base 12, what is 1291a825 + 4? 1291a829 In base 10, what is -11658 - 37383? -49041 In base 10, what is -5273 - -449? -4824 In base 14, what is 2 + 226c3b? 226c3d In base 8, what is 330 + -61354? -61024 In base 4, what is -100200012 + -3011? -100203023 In base 2, what is -10 - 111110010010000010100? -111110010010000010110 In base 13, what is -7b6b - -32c? -783c In base 7, what is 116540605 + -123? 116540452 In base 13, what is 96 + 4c2c8? 4c391 In base 12, what is -b0251 + -aab? -b1140 In base 5, what is 14440411324 - 11? 14440411313 In base 15, what is cbe2 + -29? cbb8 In base 14, what is 24 - -b266ca? b26710 In base 3, what is -202 + 100111212212210? 100111212212001 In base 12, what is bbb71024 - -1? bbb71025 In base 11, what is 4 - 1235a418? -1	{ "pile_set_name": "DM Mathematics" }
305/(-60) - 7/(-84). Let b be u/t + (-79)/(-5). Solve -a - b = 3a for a. -4 Let n = -104 + 127. Suppose nc - 19c = 0. Solve c = -2i + 9 - 1 for i. 4 Let s be (20/(7 + -9))/((-1)/2). Solve s - 29 = -3x for x. 3 Let c = 2 - -4. Suppose cg - 16 = 2. Solve go - 4 = 5 for o. 3 Let t(z) = 2z + 14. Suppose -15 = 2l - l - 3r, 5r - 5 = -5l. Let y be t(l). Solve -3c + yc = -25 for c. -5 Suppose 0 = 4r + 5p + 2, -2r + p - 6p = 6. Suppose 5 + 11 = -ro. Let z = o - -13. Solve 10u - 5 = zu for u. 1 Suppose -10y - 9 = -13y. Suppose 0n - x + 7 = -n, 2x = yn + 22. Let f = n + 17. Solve -g - 2g = f for g. -3 Let l be (12/36)/((-2)/(-6)). Solve -5y = -6y + l for y. 1 Suppose -y + 3y = -4i + 22, 4y = i + 17. Solve iv - 5 + 2 = 0 for v. 1 Let b(i) = -8i - 8. Let f be b(-1). Suppose -y + fv + 21 = -4v, 5v + 40 = 4y. Solve -y = -3j + 8j for j. -1 Suppose 0 = -5t - 32 - 8. Let m be (-76)/(-28) + t/(-28). Solve 0 = -mr + 3 for r. 1 Let b = 71 - 49. Suppose b = -x + 2z, 4z + 9 = -x - 13. Let f = -20 - x. Solve 0 = fk - 2 - 4 for k. 3 Let s(v) = 4v*2 - 45v + 68. Let f be s(10). Solve 3w = 9 - f for w. -3 Let r(v) = v2 - 16v + 7. Let z(t) = 2t2 - 33t + 14. Let f(d) = -5r(d) + 2z(d). Let s be f(13). Solve 0 = 2q - sq for q. 0 Let m(n) = -n*2 + 7n + 10. Let i be m(8). Suppose -4l - io = -6, 3l - 2o - 5 = 3. Solve lg - 5 = -1 for g. 2 Let r(t) = 7t + 5. Let i be r(5). Solve -16 + i = -8m for m. -3 Suppose 33r + 2r - 140 = 0. Solve 0 = -4b + 6b - r for b. 2 Let h be (-42)/24(-8)/2. Solve -hg = -9g + 6 for g. 3 Let h(m) = 27m3 + m2 - 2m. Let x be h(1). Solve -xb = 14 + 116 for b. -5 Let t(w) = -10w3 + w2 + w - 1. Let z be t(1). Suppose 0 = u - 4m + 21, -4u + 3m - 36 = -u. Let l = u - z. Solve 12 = -4h - l for h. -3 Let i(j) = -j. Let l be i(3). Let a be ((-2)/(-5))/(l/(-30)). Solve -n + 15 = an for n. 3 Suppose -5b - 2n + 104 = 0, -4b + 0n = 5n - 73. Solve -bx + 6 = -20x for x. 3 Suppose 7n = -3n - 10. Let y be -2 + n + 730/42. Solve 3t = -yt - 15 for t. -3 Let z(b) = 3b*2 - 15b - 3. Let c(s) = -s*2 + 6s + 1. Let f(h) = 12c(h) + 5z(h). Let g be f(-2). Suppose -6q + q = -g. Solve y - q = 2y for y. -3 Let n be -9 - 6/9-54. Solve 115 = -4b + nb for b. 5 Suppose 3r - 7 = 2r - g, -r + 5g - 17 = 0. Let m = -137 + 139. Solve -m = ry + 1 for y. -1 Let b(a) = a3 + 28a*2 - 29a + 43. Let y be b(-29). Solve 8c - y = -3 for c. 5 Let o be -4(-37)/3 - (-70)/(-210). Solve -og + 24 = -57g for g. -3 Let b = -33 + 33. Suppose -4x = -23 - 25. Let f be (-2 + 1)/((-2)/x). Solve b = y - fy + 20 for y. 4 Suppose -10 = 5x + 2i, 0i + 10 = 2x - 2i. Solve x = 2q - 0q - 8 for q. 4 Suppose 35a - 37a + 6 = 0. Let t be (60/a)/4 - 1. Solve 0g - tg - 8 = 0 for g. -2 Suppose -5s - 2n + 103 = -58, -5s + 3n + 146 = 0. Solve -4 = -su + 35u for u. -1 Suppose -5o + m + 23 = 0, -4o - 3 = -o + 5m. Let q be (3 + 2-1)9. Let x = q + 11. Solve oa - x = -a for a. 4 Suppose -6h + 17 - 5 = 0. Let z be (3(8 + -7))/(2/h). Solve 11 = zl + 5 for l. 2 Let g = 6794 + -6794. Let v be ((-2)/(-3))/(2/9). Suppose va - 12 + 0 = 0. Solve g = 3d - ad for d. 0 Suppose -2d - 60 = -8d. Solve -3u = 22 - d for u. -4 Let y(c) = 16c + 51. Let v be y(-3). Let p(q) = -q. Let u be p(-1). Suppose -3j + 35 + u = 0. Solve 0a + va = j for a. 4 Suppose 16x + 18x = 19x + 30. Let j be 45/64/6. Let a = j + 1. Solve xt = at - 12 for t. 3 Let f be 1/(18/(-44) - 10/(-20)). Solve f = -6a - 13 for a. -4 Let z be (903/14)/(2/4). Let p be (-6)/8 + z/12. Suppose -pa = -13a + 6. Solve -h = a - 4 for h. 2 Let s = -74 + 20. Let f be ((-72)/s)/(4/6). Solve fv = -0v + 2 for v. 1 Let z = 30 - -18. Suppose z = 6o - 2o. Suppose 3i - 6 = 2i + 5y, 2i + 2y - o = 0. Solve -iu = -u for u. 0 Suppose 18h = 21h + 39. Let w = 2 - h. Solve 0r - 3r = -w for r. 5 Let h be 0/(-31/3). Let z(f) = -f + 4. Let y be z(0). Solve 12 = yq - h for q. 3 Let c = 29 - 29. Let m(t) = -t3 + t2 + t + 12. Let h be m(c). Solve h = 5i - i for i. 3 Let u be 8/5 - 10/(-25). Suppose uh - 2 = 3h. Let l be (-2 - (1 + -2))h. Solve -l + 10 = 2g for g. 4 Let i(h) = -h*3 - 7h*2 - 7h - 6. Let n be i(-6). Suppose 12s - 10s = n. Suppose -m - 3 = -4k, k - 2m - 3m + 23 = s. Solve 0 = -kr - 3r for r. 0 Let f = -7 - -40. Suppose 0 = -4d + f - 17. Let z(t) = 18t2 - 1. Let n be z(1). Solve 3 = dx - n for x. 5 Suppose 5p = -4n + 382, 4p = 2n + 5p - 188. Suppose 4v = 3u + n, -4v - 5 + 97 = -4u. Solve -4 = -5y - v for y. -4 Let l(m) = -m*3 - 5m*2 - 4m + 4. Let v be l(-4). Let x(d) = -4d + 196. Let r be x(49). Let u(a) = 3a - 3. Let z be u(5). Solve r = -o + vo + z for o. -4 Suppose -11k = 22 - 77. Solve y + 3 = k for y. 2 Suppose 4c = 9c + 5d + 10, -2c = -4d - 26. Solve cb = -0b - 3 for b. -1 Suppose -73m = -112m + 195. Suppose 5r = -q + 10, 4 = q - 2r - 6. Solve 0b - mb + q = 0 for b. 2 Let c(l) = l2 + 7l + 6. Let y be c(-6). Suppose y = -3j + 15 + 15. Solve 0 = -0i + 2i + j for i. -5 Let s = 1476 + -1476. Solve -4z + 18z = s for z. 0 Suppose 5g = g - 5t + 40, -2g = -3t - 20. Suppose 12 = 12r - 108. Let b = g - r. Solve 0 = -2q - bq - 6 for q. -3 Let u(y) = 5y - 24. Let x be u(7). Suppose -5a + 4c + c = -45, -x = a - 5c. Let o be 3/(-7) - (-6)/a. Solve om = 3m + 3 for m. -1 Let n = -64 + 92. Suppose -4k - n = -40. Solve -4 = kv + 8 for v. -4 Suppose -59a = -42a - 34. Solve a = -3j + 5 for j. 1 Suppose -2n = -2m + 3m - 109, -3m - n = -302. Let r be m/36 + 1/4. Suppose 3b + rk + 2k + 9 = 0, 0 = 2b - 3k - 13. Solve -l + 1 = b for l. -1 Let k be 3 - 2-10 - 3. Suppose 3r - 5r = k. Let h be -2(2 + r/4). Solve h = -x - 3 for x. -4 Let y(a) = a*3 - 5a*2 - 7a + 8. Let v be y(6). Let t be 1/((40/(-64))/(15/(-6))). Solve vg = g + t for g. 4 Let a be (-16)/(-3) - (6 + -4). Let i be a + 0 - ((-16)/1 + -4). Solve -5d = -d - i for d. 5 Let h = -6 - -4. Let l be (56/8)/((-2)/h). Suppose -5k + l = -3v, -3v = 4k + k - 13. Solve -k + 5 = -j for j. -3 Suppose -h + l = 4h - 655, h = 2l + 122. Suppose 68 = -2r - h. Let v be 24/16r/(-6). Solve i + 4i - v = 0 for i. 5 Suppose 7v + 84 = 14v. Suppose 0 = 4x - 7x + 6. Let g be x/8102. Solve 0 = -gt - 3 - v for t. -3 Let k(m) = m3 + 11m*2 - 27m. Let i be k(-13). Let g be (-4)/(-10) + i/5. Solve 1 = -u - g for u. -4 Suppose 0 = -2j - 4o - 16, 2o + 4 = 4j - 4. Suppose 5d - z = 7, -4d - 3z - 1 - 1 = j. Solve 0 = -2t - d - 5 for t. -3 Suppose -19d + 32 = -3d. Solve 0 = 2h + 4 + d for h. -3 Let f = 247 + -243. Suppose 0 = p - 0 - 8. Solve 3t = -p - f for t. -4 Suppose 45 = -9w + 18w. Suppose -47l + 43l = 0. Solve lt = -wt - 20 for t. -4 Suppose -5d + 7d = 0. Suppose 3a = b - 9, d = 14b - 17b + 4a + 27. Solve -z + 4z - b = 0 for z. 3 Suppose 54t - 57t + 24 = 0. Solve 0 = -19i + 17i - t for i. -4 Let a(z) = -24z - 168. Let i be a(-7). Solve i = -q - 3q - 4 for q. -1 Let x be (3 - -1)(-15)/(-12). Suppose -5a - 3 = -3z, 2 = -3a + xz - 3. Let v(f) = f + 6. Let b be v(a). Solve -m + 5 = -bm for m. -1 Suppose 5k - 35 - 55 = -5y, k + 3y = 12. Let i = k - 21. Solve d + 0 - 5 = i for d. 5 Let v(o) = -5o - 98. Let t be v(-20). Suppose 3w - 7 = 2. Solve 0 = wq - 1 - t for q. 1 Let z = -4 - -7. Suppose -3a + 5p + 44 = 0, 25a - 2p = 20a + 48. Solve 0 = zc - 7 - a for c. 5 Let o = -13 - -7. Let j(t) = -3t - 9. Let f be j(o). Let l be 2 - 6/f-3. Solve 2q - lq - 4 = 0 for q. -2 Suppose -p - 17 = -20. Solve -7x + 31 = p for x. 4 Let l = 139 + -139. Solve 0 = -2m - lm for m. 0 Let x = 86 - 81. Suppose 5 = -3q - 4b - 1, xq - 13 = b. Solve 5z - 6 = qz for z. 2 Let p be 16/(-104) + 279/39. Let l(o) = o - 1. Let f(m) = -3m + 8. Let h(b) = -f(b) - 6l(b). Let q be h(-2). Solve p - 3 = qd for d. 1 Suppose 16f + 15 = 5r + 21f, -2f = -5r + 29. Solve -r = y - 10 for y. 5 Suppose 3r + 25 = 31. Let o = r - 0. Solve 3a - 5 = oa for a. 5 Let r(a) = -a + 1. Let w be r(-9). Suppose 0 = 3g - 4x - 11, -4g - w = 2x + 12. Let j = -3 - g. Solve jz + z = -5 for z. -5 Let a = 4 - 8. Let w = a + 8. Solve 1 + 7 = wb for b. 2 Suppose -2*f + 4 = -f. Suppos	{ "pile_set_name": "DM Mathematics" }
3 + 2s3)(-368s - 30s*2 + 368s). -90s5 Expand (45 + 108 + 19 + 180 + 87)(2v - 4v + 5v). 1317v Expand (6p + p - 5p)(-15p*3 - 7p*3 - 11p*3)(-p + 2p - 2p)(1 + 1 + 0)(3 - 23 - 4). -3168p5 Expand (-2c - 3c + 2c + (2c - 7c + 2c)(1 + 0 + 2))(12c + 1 - c - 7c). -48c*2 - 12c Expand -p + p + p*4 + (3p - p*2 - 3p)(0p*2 - 2p*2 + 0p*2) + 2 - 140p*4 - 5p + 141p4 - 5 - p2. 4p4 - p2 - 5p - 3 Expand (q + 0q + 0q)(889 - 889 - 75q). -75q*2 Expand (-4609d + 43 - 128 + 41 + 44)(1 - 1 + 2). -9218d Expand 24 - 24 - 27l + 3l - 8l + 2l + 2 + (0 - 1 + 0)(-l - l + 0l). -28l + 2 Expand (1 + 6 - 4)(2z2 + 0z*2 - 5z*2)(-1 + 8 - 3)(-1 - 2z + 1). 72z3 Expand -9o*5 + 4o*5 + 6o*5 + (-2o*4 - o + o)(-1 - 9o + 0 + 21o)(4 - 4 - 1). 25o*5 - 2o*4 Expand (6k - k - 3k)(-3k + 16k - 6k) - 3k*2 + 4k*2 - 3k*2. 12k*2 Expand (2 - 2 - 2l*2)(-32 - 77l3 - 35 + 68 - 2l2) + (-l4 - 3l4 + 3l*4)(2 - 2l - 2). 156l*5 + 4l*4 - 2l*2 Expand (-1 + 1 - 4q + 2 + q - 2 + 0q + q + q - 4 + 2q + 4 + (4 + q - 4)(2 - 4 + 3) - 5 - 2q + 5 - 2 + 2 + q - 1 - 2q + 1)(-6q + q - 8q)(0 - 4 + 3). -13q*2 Expand (2 - 9 + 1)(10 - 2 - 2 + 4a). -24a - 36 Expand (3s - 5s + s)(-3s*4 + 3s*4 + 2s*4)(-3 + 0 - 5) + (1 - 1 + s)(14s - 5s4 - 14s). 11s5 Expand (5c*2 - 3c*2 + 0c*2)(-30c + 13c + 103c) - 2c*2 + 2c*2 - 3c*3. 169c*3 Expand (6q - 4q + q - 3q + 2q - q + (q + 0q + q)(-3 + 0 + 5))(178 - 89 - 57q - 91). -285q*2 - 10q Expand (0b + 2b + 0b)(103b + 64b + 26b + 15b). 416b2 Expand (n3 + 0n*3 + 0n*3)(-3n - 3n + 5n) + 117 + 53n*4 - 55n*4 + 2n*2 - 101. -3n*4 + 2n*2 + 16 Expand (a + a + 0a)(-a - 2a - a)(54 + 14 - 5)(-2 - 2 + 2)(-2 + 2 - 2a*2). -2016a*4 Expand (2o*2 + 4o*2 - 4o*2)(-2o3 + 6o*3 - 2o*3) + (0 + 0 - 1)(-2o - o5 + 2o) + (6 - 4 - 3)(0o5 + o5 + o*5). 3o*5 Expand (16l*3 + 3l3 - l3)(-l + l + 3l)(0l + 4l - 2l). 108l5 Expand (2 - 4 + 1)(15d3 - 60d*3 + 17d*3). 28d*3 Expand (-2 - 2 - 4)(97l - 97l + 5l5 + (l2 + 3l*2 - 6l*2)(-l + l - 2l3)). -72l*5 Expand -3 + u + 4u - 3u + (2 - 2 - 4u)(1 + 1 + 0). -6u - 3 Expand (-6 + 1 + 3)(3 - 5 + 4)(13f - 9f + 13f). -68f Expand -777 + 37y3 + 777 - 2y2 + y3 + 2y2 + (-y + 0y + 2y)(-3y + 3y + y*2). 39y*3 Expand ((-4p - 4p + 4p)(-1 + 1 - 2) + 2p - 3 + 3)(-2 + 2 + 6) + (-2p - 2p + 3p)(-1 + 0 + 3). 58p Expand (4p + p - 3p + (-p - p + p)(-2 + 2 - 2) + p + 2p - 5p)(8p - 4p*2 - 8p) + (-2 + 1 + 3)(4p - 4p - p3). -10p3 Expand h3 - h3 + h3 + (-11h2 + 2h*2 + 6h*2)(0h + 4h - 5h). 4h*3 Expand (-1 - 6k + 1)(-2 + 0 + 3 + (-5 + 3 + 0)(1 + 8 - 14))(0 - 3 - 4). 462k Expand (240 - 240 - 4x)(0 - 1 - 1)(-7x - 5 + 5). -56x2 Expand (-2 + i + 2)(-i - 2 + 2) + 2i2 + 3i - 3i + 12i*2 + 9i*2 - 6i*2 - 12i*2 + 2i*2 - 3i*2 + (-2i + 2 - 2)(0i - 5i + 3i). 7i2 Expand (p - 5p - 4p)(4 - 28 - 32). 448p Expand (5 - 4 - 15)(6g5 - 39 + 39). -84g*5 Expand (-1 - 2d + 1)(1 + 3 - 3) + 52 + 649d + 44 - 645d. 2d + 96 Expand (-4 + 4 + k)(-80k - 2 + 80k + 12k*3)(0k - k + 2k + (2 + 1 - 4)(3k - 2k - 2k) + k + 0 + 0). 36k5 - 6k*2 Expand (k + 2k*3 - k)(4 - 11 - 3)(-3k*2 + 3k*2 - 2k*2). 40k*5 Expand (41 - 26u*2 - 41)(u + u - u)((-4u + 2u + 3u)(-2u - 3u + 6u) + 2u - 2u + 3u2). -104u*5 Expand (-34x + 5x4 + 34x)(3x + 0x - 2x) - x5 + x5 - 4x5 + (0x2 + x2 - 2x2)(-2x3 - x3 + 4x*3) + 3x5 + x5 - 2x5. 2x*5 Expand (-7h + 25h + 2h)(-1 + 1 - 1)(-2h + 1 - 1)(3h - 5h - 3h). -200h*3 Expand (86 + 108f + 85 - 171)(0 - 1 + 2). 108f Expand ((1 + 0 + 0)(-2 + 2 - h) + 2h - 1 + 1 + 1 + 2h - 1 + 2h + 6 - 6 + (h + h + 0h)(-2 - 4 + 4))(h + 0h - 16h)(0 + 0 - 2). 30h2 Expand (-2 + 3 + 10)(-3m2 + 9m*2 + 0m*2)((-1 + 1 - m)(4 + 2 - 5) + 0 + 2m + 0)(0m - 2m + 0m). -132m4 Expand (2o - 3 + 1 - o)(-1 + 1 + 5o)(-5o*2 + 0o*2 - 14o*2). -95o*4 + 190o*3 Expand (-2 + 6 + 0)(-38z + 30z - 78z). -344z Expand (2s - 2 + 2)(144 + 123 - 319) + (-3 + 3 + 2s)(-4 + 3 + 3)(5 - 6 - 1). -112s Expand (-x + x + x + (-3 + 3 - 1)(0x + 2x - 4x) + 5x - x - 2x + 7 - 7 + 2x)(-5x2 + 2x2 + x2)(-2 + 5 - 4). 14x*3 Expand (2 - 1 - 3)(0s3 - 4s*3 + 2s*3) + 235 + 547s*3 - 235. 551s*3 Expand (2l3 - l3 - 2l3)(-37l + 17l + 3l)(-2l + 0 + 2 + 5l). 51l5 + 34l*4 Expand (16m - 34m + 8m)(-4 + 2 + 1)(-5 - 1 + 37). 310m Expand (-r2 - r2 + r2)(386 - 386 - 3r)(2 - 2 + 3 - 2r). -6r*4 + 9r*3 Expand (-29v + 78v + 2 + 27v + 18v)(-2 + 2 - 3v). -282v*2 - 6v Expand (-2j + j - j)(-61 - 88 + 130)(6j - 3j + 6j + 2). 342j2 + 76j Expand -2v3 + v2 - v2 - 2v*3 + 3v*3 - 2v*3 + (2 - 4 + 1)(-4v2 + 4v2 + v3) - 21v3 + 4852v*2 - 4852v*2. -25v*3 Expand ((-3p + 0p + 2p)(1 + 5 - 3) - 50p + 25p - 11p)(0 + 1 - 3). 78p Expand (2 - 1 + 1)(-127y + 56y - 56y - 82y). -418y Expand -2u + 0u - 2u - 2 + 2u + 2 + (1 - 2 + 0)(-3u - 1 + 1) - 3 + 3 - 2u. -u Expand 2s*5 - 5 + 5 + (0s*4 - 8s*4 + 0s*4)(-2s - 3s + 3s) + 2s*5 - 2s*5 + 3s*5 + 3s*5 - 6s5 + s5. 19s5 Expand 2o*5 - 6o*5 + 3o*5 + (21 - 11 + 18)(6o5 - 4o*5 - 3o*5). -29o*5 Expand (1 - p - 1)(3p - 2p + 0p) - 23p*2 + 2p*2 - 2p*2 + 4p - 3p2 - 4p + (-5 - 2p + 5)(6p - 4p - 3p) + 2p*2 - 4p2 + p2. -26p2 Expand (0v + 0v - v)(3 + 3 - 2 + (-3 - 1 + 3)(0 + 0 - 1))(7v - 19v + 217v). -1025v*2 Expand (-3 + 3 + 5)(-190k + 112k + 98k). 100k Expand (-3 + 5 + 0)(25 + 2v - 12 + 31)(-46 - 4 - 20). -280v - 6160 Expand (-4v3 - v5 + 4v*3)(1 + 0 + 1) + v*5 + 0v*4 + 8v*4 - 12v4. -v5 - 4v4 Expand (-22t - 6 + 23t - 3)(t*3 + 4t*3 - 3t*3). 2t*4 - 18t3 Expand (b3 + 5b2 - 5b*2)(2b + 15b + 1605 - 1623). 17b4 - 18b*3 Expand (-1 + 1 - 3g)(5g2 - g2 - 3g2) + 16g*3 - 98g + 98g + 28 + 2g*3 - 28 + 4g*2 + (-g + 0g + 3g)(2g2 - 6g*2 + 5g*2). 17g*3 + 4g*2 Expand (6s*2 + 20s*2 - 33s + 31s)(-1 - 6 + 3). -104s2 + 8s Expand (-52h + 138h - 54h)(2 - 6 + 2)(-6 + 2 + 2). 128h Expand (107j - 229j + 442j + 664j)(j2 + 0j + 0j). 984j*3 Expand (1 + 3 - 3)(2 - 2 + 2d) + (-3d - 3d + 4d)(-6 + 0 + 2) - d + 2d + 0d. 11d Expand (-3x + 3x - 2x)(4x + 2x*2 - 4x) + 2x3 - x3 - 3x*3 + 3x + x*3 - 3x + 10x2 + 111x*3 - 10x*2. 106x*3 Expand -6r + 5r + 14r - 2r + 4r - 3r + (2r + r - 2r)(-2 - 2 + 2) + 1 - 4r - 1. 6r Expand (j - j*2 - j)(-218 + 107 + 30j + 106). -30j*3 + 5j*2 Expand ((-3 + 4 - 2)(7b + 3b - 2b) + (0 + 3 - 1)(b - 5b + b))(b + b - 4b). 28b*2 Expand (3 + 0 - 2)(-59 + 15 + 1)(-2a*2 + 2a*5 + 2a*2). -86a*5 Expand (0 + c + 0)(338c - 41c + 69c). 366c*2 Expand (-23b + 17b - 105b)(-1 + 4b + 1)(3b - 4b - b). 888b*3 Expand 6l*3 - 14l*3 - 16l*3 + 4l*3 - 2l*3 + 7l3 + (l2 + 3l2 - 5l*2)(-4l + 3l - l) - 3l3 + 1 - 1. -16l3 Expand (s4 + s - s - s*3)(-10994 + 21641 + s - 11837). s*5 - 1191s*4 + 1190s*3 Expand (-202 + 102 - 2c*2 + 104)(1 + c - 1). -2c3 + 4c Expand (-u + 2u + u)(-2u + 0 + 10 + 5). -4u*2 + 30u Expand (-7s - s2 + 7s + (-3s + 3s - s)(2s - 2s + s) + (0s + 3s - 4s)(s - 5s + s))(6 + 3s*3 - 6). 3s*5 Expand (0v + 2v + 0v)(-3 + 3 + 1)(-8 + 8 - 13v + 1). -26v*2 + 2v Expand (-2s + 0s - s)(-115s + 129s + 431s)(-2s*2 - 1 + 1). 2670s*4 Expand (-2181j + 1090j + 1038j)(0j2 - j2 - 2j2). 159j*3 Expand (-2 + 0 + 4)(a5 - a5 + 2a5) + 2a5 + a4 - a*4 - 20a*5 + 12a*5 - 13a*5 + (3a*2 - 3a*2 - 2a*4)(-7a + 3a + 3a). -13a*5 Expand (-5 + 5 + 4z)(1 - 2 - 1)(-2z + 4 - 4)(-1 + 5 - 2)(-3z - z + z). -96z3 Expand (3 + 3 - 2)(12n - 297n*4 + 295n*4 - n). -8n*4 + 44n Expand (6f4 + 3f*4 - 2f*5 - 4f*4)(7 + 4 - 3). -16*f	{ "pile_set_name": "DM Mathematics" }
te (-550 - -540) + (7 - (1 - 1)) + -4. -7 What is the value of -3 - (19 - (28 - -5))? 11 What is -2 - -17 - (20 + -29 + -9)? 33 Calculate 1 + 1 + (-4 - (-14 - -24)). -12 Evaluate -9 - (-51 + 18 + 4). 20 What is the value of (4 - (-10 + 11) - -3) + 2 + -21? -13 Calculate 38 + 28 + -17 + -27. 22 -29 - (-443 - -454 - (0 + 6)) -34 Evaluate 3 - (-12 + 33) - -23. 5 44 + -16 + 26 + -35 19 What is (10 - -23) + (-1 - 5)? 27 Calculate -122 + 137 + -38 + 0 + 13. -10 What is the value of -11 + (-12 - (-11 - 9)) + 4? 1 Calculate -8 + 10 + (9 - 21). -10 Evaluate 66 - 65 - (-8 - 1). 10 What is 6 + (50 + -41 + 1 + -7 - 10)? -1 What is (-3 + 10 - (61 - 52)) + 1 + -5? -6 Calculate 5 + -27 - -69 - 27. 20 Evaluate 799 + -809 + 0 + -7 + -3. -20 Calculate -72 - -63 - (0 + 2). -11 23 + (24 - 78 - -11) -20 Calculate -18 + (-2 - -3) - -28. 11 What is -27 + 8 + (0 - -3) + 11 + -2? -7 What is the value of 13 + (10 - -1 - (-158 - -164))? 18 What is -16 - (37 - (34 - -26))? 7 What is (17 - 52) + 12 - -16? -7 Evaluate (20 - 17 - 3) + -8 + 1 - 7. -14 What is (-83 - -67) + (6 - 1)? -11 Evaluate -5 - (-4 + 6 - 14) - (28 - 3). -18 -18 + (-10 + (-13 - -20) - -9) -12 -18 + -45 + 33 + 26 -4 What is -1 + 9 + 75 + 8 + -62? 29 Evaluate 8 - (20 + -30 + (-3 - -8)). 13 What is 8 - 0 - (-8 - (37 + -53))? 0 What is -212 + 220 - (0 - -1 - -14)? -7 Calculate 7 + (20 - (-12 + 32)). 7 Calculate 1 + -3 + 11 + -3 + -4 + -3. -1 Calculate (15 - 6) + -2 - (10 + 5) - -16. 8 Calculate -3 + (-15 - (18 + -14 + -6 + -9)). -7 Calculate -9 - (-1 + -1 - (-3 - (4 + -4))). -10 -1 - 1 - (-14 - -28) -16 What is -2 - (0 - 6 - 1 - (-3 - 0))? 2 What is 76 + -73 - (11 + 0 - 3)? -5 What is the value of -25 + 20 + 2 + -6? -9 Calculate ((-17 - -18) + 4 - (11 - -2)) + -10. -18 Calculate (-9 - 4 - (-43 - -34)) + -24 + 1. -27 What is -3 + (2 + 5 - 9) + (1 - -17)? 13 -6 - (1 + 12 + (15 - 20) + 2) -16 What is the value of 6 - (-7 + 6 + 6 + -3 - -3)? 1 Calculate 7 + (1 - 2) - (-650 - -651) - -9. 14 Calculate (17 - 7) + 2 + -2 - (11 - 11). 10 What is the value of -13 - ((37 - 30) + -44)? 24 What is the value of -29 + 10 - -10 - (-7 - (2 - 0))? 0 Evaluate -14 - (5 + -8) - -3. -8 What is the value of -17 - -32 - 47 - -19? -13 What is (50 - 46 - (0 - -5)) + -6 - -7? 0 Calculate 14 - -2 - (1 + 9) - (-1 - -1). 6 (-9 - -15) + 5 - 19 -8 What is the value of (-28 - (31 + -56)) + -1 + 5? 1 -3 + (15 - -2 - -1) + -15 0 Calculate (-16 - (-13 + -22)) + 8. 27 What is -14 + (-15 - -28) + -10? -11 What is -2 + -1 - (-27 + -18 + 52)? -10 What is the value of (-15 + -11 - -19) + 11 + -1? 3 What is the value of 3 - (20 - (10 - -1))? -6 What is the value of (22 - 10) + -20 + (0 - 7)? -15 0 + (4 + 0 - (2 - -4 - 1)) -1 Evaluate 122 + -153 + (4 - (-10 - 0)). -17 What is the value of -4 - (-1 - -16 - 3 - (2 - -7))? -7 Evaluate (9 - -3 - 11 - 6) + -6. -11 What is (0 - (-4 + 2)) + 442 + -472? -28 Calculate 1 + -4 - -18 - (22 - 13). 6 What is (1 - (-18 + 9 - -7)) + -5? -2 Evaluate -16 + -1 + -224 + 257. 16 What is the value of -8 + ((8 - 24) + 11 - (-2 + -9))? -2 (15 - 9) + (-34 + 16 - (1 - 3)) -10 What is (-51 + 46 - (-26 - -5)) + (0 - 8)? 8 Evaluate -20 + 4 + -10 + (-30 - -57). 1 Evaluate -11 - (-1 - -1) - (2125 - 2129). -7 Evaluate (8 - 1 - (-1 + -3)) + (26 - 49). -12 Calculate 59 + -75 + 19 + 0. 3 What is the value of (1 - -1) + (-3 - (-18 + 14)) + 13? 16 What is -6 + 0 + -2 + (5 - 6) + -2? -11 Evaluate 37 + -29 + (7 - (1 + -3)). 17 (2 - -12) + -5 + (53 - 63) -1 What is the value of 1 + 0 + 7 - (1830 - 1829)? 7 Evaluate 5 + 4 + -5 + 17 + -9. 12 Evaluate 21 + -39 + 24 - -9. 15 Calculate 15 + -20 + -8 - -24. 11 What is the value of 27 - 40 - -3 - (4 - (2 - 0))? -12 What is (-20 - -10) + (15 - -8)? 13 What is 5 - 8 - (-4 + (-3 - 6)) - 3? 7 Calculate (-1 - 11 - -2) + 4. -6 What is 5 + 1 - (178 - 171)? -1 What is 14 - 9 - (-9 - (5 + (-13 - -5)))? 11 13 + -16 - (0 + (-4 + 2 - 1)) 0 Evaluate -5 - (-1 + -9) - (3 + -8 + 17). -7 Evaluate -5 - (2 + -1 - (-1 + 1 - -6)). 0 What is the value of (36 - 35) + (-1 - -2) + 0 - -11? 13 What is the value of -27 + -11 + 23 - (4 + -7)? -12 Evaluate 3 + 11 + (158 - 140) - (1 - -7). 24 Evaluate -11 + 4 + (4 - (6 - 3)). -6 Evaluate (10 + 5 - -4) + (-11 - (-14 + 6)). 16 What is the value of (10 - (0 - -12 - 8)) + -5? 1 What is the value of (-10 - 0) + (24 - (51 + -17))? -20 What is the value of 1 + -1 + (-2 - (-2 - 3))? 3 12 + 12 + -25 + 0 + -4 -5 What is the value of (8 - (-6 - -20)) + -2 + (-2 - 1)? -11 -8 - (13 + 7 - 41) 13 Evaluate 187 - 209 - (1 + -24). 1 Evaluate (-143 - -139) + (2 + 6 - 0). 4 Calculate 21 - (37 - 45) - 29. 0 What is the value of 131 + -122 + -2 + -18? -11 Calculate 37 + -39 - (-5 + 3 + 2). -2 Evaluate (-7 + 9 + -6 - -5) + (-12 - 3). -14 0 + -6 - (-48 + 17 + 13) 12 Evaluate 0 + (-6 - -3) + (-21 - -25). 1 Evaluate -4 - (-9 - (6 + -23)). -12 Calculate (-17 - (-1 + -1)) + -35 + 40. -10 Calculate 4 + -3 + (-5 - (11 + -4 - 14)). 3 28 - -16 - (48 - -19) -23 What is 9 - (-23 + 25 + -6 + -1)? 14 Calculate 13 - (-3 + 58 + 44 + -54). -32 Calculate -7 + 4 - -14 - (33 + -16). -6 What is the value of 21 - (-14 - (10 + -13) - -21)? 11 What is the value of -23 - (1 - (20 - 7)) - (5 + 4)? -20 Calculate -263 - -266 - (0 + -5). 8 What is (10 - 19) + (18 - 13 - (22 - 1))? -25 What is 11 + (-1 - -30) - (6 - -9)? 25 Calculate 4 + -7 - -1 - (2 - 15 - -9). 2 -13 - (-13 + 14 + -6 - (1 - -1)) -6 (-15 - -6) + 25 + (-19 - -9 - -2) 8 Evaluate (4 - 4) + 6 + 2 + (-11 - -1). -2 Evaluate 15 - (7 + -16 + 45). -21 Evaluate 9 + (-38 - -7) + -1. -23 What is 29 - (-9 + (53 - 10))? -5 -64 + 64 - (0 + -10) 10 What is the value of (-1 - -1 - (7 - -1)) + -16966 + 16959? -15 What is the value of (-1 - -3) + 77 + -92? -13 Evaluate (-1 - 4) + 21 + (-19 - 5) + -6. -14 What is the value of 2 + (-3 - -7) + (27 - 27)? 6 What is the value of -3 + -7 + 2 - (-58 - -41)? 9 Calculate (51 - 11) + -41 - (-2 - (-2 - -35)). 34 What is (14 - -20) + -24 - 30? -20 What is 524 - 530 - (-8 - 2 - (-2 - -4))? 6 Evaluate -1 - (-3 + -8) - (6 + -33). 37 Evaluate -2 - -16 - (-8 - -12). 10 Evaluate (-31 - (10 + -2 - 1)) + (10 - 3). -31 Calculate 15 + (-52 - -33) + -7. -11 -18 - -27 - 24 - -23 8 (-11 - 6 - -22) + -9 -4 0 + -14 - (143 - 153) -4 What is the value of 66 - 29 - 39 - (-27 + -1)? 26 Evaluate -8 + -10 + 2 + (8 - (-5 - -8)). -11 -21 + -65 + 38 + (15 - 2) -35 Calculate 1 - 5 - (3 + 12 + -11 + 5). -13 Calculate (209 - 214) + (12 - 1) + (1 - -5). 12 Evaluate 2 + 11 + 3 + -12 + -7. -3 -22 + 34 - (11 + -25) - 7 19 What is the value of 49 - 43 - (3 - 10 - (-2 + 2))? 13 What is the value of (-1 - -7 - (-64 - -57)) + -6? 7 Evaluate 1 + (-21 + 10 + -5 - -7) + 1. -7 What is the value of 5 + (-7 + 8 - -2 - 2)? 6 What is -2 + -8 + 10 + -9 + -8 + -7? -24 Calculate -10 - (-8 + (19 - (5 + -22 - -10))). -28 Calculate -2 + 7 + (-9 - 21 - -14). -11 Calculate (-7 - -16) + -1 - (19 - 13). 2 Calculate 778 + -772 - (-1 - (-8 + 1)). 0 Evaluate -2 + 7 - (28 - 32). 9 What is 5 + (-6 - 2) + (6 - 12) - -7? -2 Calculate -12 + 14 + 12 - 17. -3 What is the value of 2 + (-48 + 56 - (1 - 1 - 5))? 15 What is -49 - (-4 + 5) - -26? -24 Calculate -9 + (20 - (21 + -10)) + -4. -4 Calculate -2 + (4 - (-2 + -2 + 9)) + 2. -1 What is the value of -4 - (4 - (5 - (-2 + -24)))? 23 Calculate (35 - 27) + (-9 - 0) + -1 + 0. -2 What is the value of (-8 - -4) + 14 + -19 - -24? 15 What is the value of -3 + (3 - 3 - (-5 - -6 - 1))? -3 What is the value of -14 + 5 + -4 + (111 - 133)? -35 What is (16 + 32 - 20) + -12? 16 Evaluate (1 - -1 - -5) + (5 - 3) - -7. 16 What is -1 - -2 - (-2 + (-8 + 5 - -3))? 3 What is -2 + 6 + -16 + 4 + -6? -14 What is -4 - (3 - -3) - (119 + -132)? 3 What is the value of 0 + -3 + 12 + (-16 - (-3 - 18))? 14 What is the value of -3 + (4 + -3 - 19) + -115 + 117? -19 What is the value of -5 + 2 + (-28 - -44 - (0 - -40))? -27 What is the value of -9 - 1 - -3 - (-5 - (-5 + -1))? -8 Calculate -28 + 36 + -3 + -14 + -4 + 5. -8 (-14 - -1) + (-24 + 14 - (-24 + 6)) -5 2 - ((12 - 9) + -2) 1 -3 - (-33 + 19) - (-2 - -27) -14 Evaluate (9 - (26 - 7)) + 29 - 4. 15 What is the value of -12 - ((3 - 35) + 14)? 6 What is -3 - (12 - -2) - -28? 11 What is the value of 23 + -9 + -31 - -6? -11 Calculate -3 + 13 + 9 + (-7 - (-3 - -3)). 12 Calculate (3 - -19) + -20 - -5. 7 What is (1 - 8) + (-16 - 4 - -12)?	{ "pile_set_name": "DM Mathematics" }
(0). What is the nearest to c in 0.4, -0.3, -3/5? -3/5 Let a = -136 + 950/7. Let i = -177 - -93. Let v be (-34)/i - 1/2. What is the closest to a in 1/4, v, 1/5? v Let i = 17 - 13. What is the closest to -1 in -0.7, i, -1/6? -0.7 Let u = -2.945 + -0.055. Which is the nearest to -1/3? (a) 1 (b) u (c) -4 a Let z be 1/(2 - (-1 + 4)). Let p = -2 + 3. Which is the closest to 0.1? (a) p (b) -2/7 (c) z b Suppose 3v - 2k = -30, 3v - 4k + 44 = -v. Let d = v + 12. Suppose 5m = -2u + 2m + 6, -3m = du. Which is the closest to -2/5? (a) 5 (b) u (c) -2 c Let r = 12 - 11. Let t = 0.15 - -1.85. Which is the closest to r? (a) -5 (b) t (c) 4/3 c Let p = 1.22 - -0.78. What is the closest to 0.8 in p, 4, 0.4? 0.4 Let h = -0.089 + 0.089. Which is the nearest to 1? (a) -3/2 (b) 0.03 (c) h b Let p = 5/6 + 1/2. Let r = 14.9 + 1.1. Let w = r + -15.6. Which is the closest to 1? (a) 2 (b) p (c) w b Let c be (-2)/1421/(-18). Let m be (-2)/(-1) - 14. What is the nearest to -1/5 in m, c, 1/3? c Let w(q) = -3q - 18. Let l be w(-5). Suppose 5i = -r + 2r - 4, -2i = -r + 1. Which is the nearest to i? (a) 0 (b) -0.1 (c) l b Let c be 8/44 - (-28)/(-33). What is the closest to c in -0.2, 2/13, 4? -0.2 Let u = -2463/13 + 189. Let h = u - -56/65. Let m = 27/2 + -41/3. What is the closest to h in m, -4, -1? m Let a be 2/4 - 2/(-4). Let i = -0.01 + -0.39. What is the closest to 1/2 in i, a, 2? a Let p be (-2)/5 - (-12672)/(-70). Let m = p - -181. Which is the nearest to -0.1? (a) 0.4 (b) -0.2 (c) m b Let h = 683/3 + -226. Let f = -2.96 + -0.04. Which is the nearest to 1? (a) f (b) h (c) 4 b Let o = 10/9 + -31/36. Let u = -0.1 - -3.1. Let h = u + -4. Which is the nearest to -1? (a) h (b) -0.5 (c) o a Let l = -7.95 + 8. Let r = l - -0.05. Which is the nearest to r? (a) 1 (b) 3/7 (c) 3/2 b Let t be (-18)/27 + (-1 - (-9)/6). Which is the nearest to 0.2? (a) t (b) -1 (c) -0.5 a Let m = 6 - 5. Let r be 0/4 + (m - -7). Let b be (-2)/3r/12. What is the closest to 0 in b, -5, -0.4? -0.4 Let n = 0.3 + 0. Let j = 5.2 - 5. Which is the nearest to j? (a) -4 (b) -1/5 (c) n c Let a = -1 - -0.9. Let g(v) = -v*2 + 12v - 12. Let y be g(11). Let i = -2 + 2.1. What is the nearest to a in y, -5, i? i Let k = 0 + 0. Let l(d) = -d*3 + 2d2 - d - 1. Let v be l(2). Let t be (-18)/4 + (-9)/v. Which is the nearest to 0.2? (a) t (b) -5 (c) k c Let q = -377/5 + 75. What is the closest to q in 3, -1/2, 0.06? -1/2 Let q(r) = r2 + 4r. Suppose 0 = -g + 3g + 10. Let n be q(g). Let m = 1.5 - 1.5. What is the closest to m in 2/7, -3/2, n? 2/7 Let o be 2/3053. Let w = 17/117 - -1/13. What is the closest to w in -5/4, o, 0.5? 0.5 Let x = 56 - 395/7. What is the closest to -1 in -0.3, x, -3? x Let p be 3 - (-1 + 2 + 55/25). Let k be (-2)/8(-12)/(-9). Which is the nearest to k? (a) 3 (b) 2 (c) p c Let h be 2/6 + 4 - 4. Which is the closest to h? (a) 1 (b) 2/7 (c) -0.1 b Let s(y) = -y2 + 5y + 7. Let l be s(6). What is the closest to 0.2 in -5/2, -1/3, l? -1/3 Suppose -j = -3j - 6. Let v be (-9)/(-6)2/j. Which is the closest to v? (a) -4 (b) 0.4 (c) 1 b Let g = -0.1 + 0.2. Which is the nearest to g? (a) 1/2 (b) 4 (c) 2/3 a Let r be 38/20 - 8/4. Which is the nearest to 2? (a) r (b) 5 (c) -2 a Let r = -0.3 + -1.7. What is the nearest to -0.1 in -5, 0, r? 0 Let w be 0 + (0 + -2)/(-2). Let n = 3.1 - 3. What is the nearest to n in w, -2, -0.5? -0.5 Let l = -0.28 - -3.38. Let n = l + -3. Let k = -52 + 366/7. Which is the closest to -1? (a) k (b) n (c) 4 b Let n = -11 + -2. Let l = -9 - n. Let t = -1 + 1. What is the nearest to -1/3 in 1, t, l? t Let h be ((-2)/2)/((-1)/(-5)). Let y = -0.6 + 0.5. Which is the closest to y? (a) 0.5 (b) 2/19 (c) h b Let s(r) = 4r2 - 2r - 1. Let l be s(-1). Let d = -3 + l. Suppose -5u - m + 11 = -d, 12 = 2u - 3m. Which is the closest to 2/7? (a) 5 (b) u (c) 0.4 c Let g = 10.71 - -0.29. Let v = -14 + g. Which is the nearest to 1? (a) v (b) 0 (c) 0.2 c Let n = 45 + -134/3. Let i = 39/4 - 289/28. What is the nearest to -2/7 in -1, i, n? i Let z = -0.1 + 0.6. What is the nearest to 1/2 in 1/7, z, 3? z Let p = -0.182 - 0.018. Which is the closest to p? (a) 2 (b) 0.2 (c) 0.1 c Let x be 2/42 - (0 + 0). Which is the nearest to x? (a) -2/5 (b) 0 (c) 4 b Let s be (-6852)/153249/102. Let x = 2/289 - s. Let f = x - 108. What is the closest to -1/2 in 3, -4/5, f? -4/5 Suppose -3 = 4d - d. Let v = -62.6 - -57. Let q = v + 6. Which is the closest to d? (a) q (b) -4 (c) 2/9 c Let i be 8/(-20) + (-64)/(-110). Let d = -70 - -70.4. What is the nearest to d in 2/3, -0.4, i? i Let c = 0.8 - 1. Let b = c + 0.2. Let s be -3 + 1 + 0 - -2. What is the nearest to b in s, -0.1, -0.5? s Let v = 0.2 - 0.6. Which is the nearest to -1? (a) 5 (b) -11 (c) v c Let p be 122/363/(-16). Let x = -1/32 + p. Which is the closest to 1? (a) x (b) 2/7 (c) -4 b Let r = 33/215 + 2/43. What is the nearest to 1 in -0.1, r, -5? r Let r = 2.7 - -0.3. Let z = r - 2.7. Let m = -0.3 + 0.2. Which is the nearest to 0? (a) 0.5 (b) m (c) z b Let m = 6 - 8. What is the nearest to -0.2 in m, -5/3, 2/3? 2/3 Let u = -4.96 + -0.14. Let z = 5 + u. What is the nearest to z in -1/9, 3, 0.5? -1/9 Let c = 6 - 2. Let h = c - 3. Let w = 15 - 11. What is the closest to h in -1/6, 1, w? 1 Let g be 28/(-8) + 1 - -3. Let o = 2.3 - 2.3. Which is the nearest to o? (a) g (b) 1 (c) 2/7 c Let p = -83/44 + 18/11. What is the nearest to 0.1 in -2, 4/9, p? 4/9 Let n = -7.05 - -0.05. Let o = n + 7.1. Suppose 3 = -3d + 3l, -d - l = -3d - 4. What is the nearest to o in -2/5, -4, d? -2/5 Let u be 6/32/(-12). Let w = -0.06 - 0.34. Let q = -0.3 - w. What is the nearest to u in 0.3, q, 3/7? q Let m = -9.08 + 14.17. Let d = m + -0.09. Let i be (-1)/((-3)/6) + -1. Which is the closest to i? (a) d (b) 0.3 (c) -2 b Let t = 40 + -35. Which is the nearest to 0? (a) -1 (b) t (c) -10 a Let o = 40 - 43. Let h = -3 - -6. Let k be 21/(-12)2. What is the nearest to k in h, 0.3, o? 0.3 Let l be (-55)/(-50) - 4/(-10). Let n = -62/5 - -13. Which is the closest to l? (a) -3 (b) n (c) -0.1 b Let z be (-1)/6 - (-1)/(-2). What is the nearest to 0 in z, -0.13, 0? 0 Let k = 7.3 - 7. Let t = -0.3 + k. Let d = 0.1 - 1.1. Which is the closest to t? (a) 3 (b) 1/2 (c) d b Let x = -44 + -13. Let o be (4 + -7)/(x/(-2)). What is the nearest to 2/7 in -0.3, o, 3/8? 3/8 Let t = 0 + -1. Let k = 8.8 + -9. Which is the closest to -1? (a) t (b) k (c) -3/2 a Let g = 8.2 + -8. Let n = 2.1 + -2. Let f = 0.8 - 1.8. Which is the nearest to n? (a) f (b) g (c) -2/3 b Let w = 103/3 - 35. Which is the nearest to 1? (a) 4 (b) w (c) 3 b Let u = -0.3 - -1.3. Let y = 2.3 + -2. Let v = y - 0.6. Which is the closest to u? (a) v (b) -3 (c) 0.1 c Let z be (-8)/(-12) - (-10)/(-6). Let b be (-6)/(-14) + (-4 - -3). What is the closest to -1/2 in b, 2, z? b Suppose 5 = -q + 2. Let x be q/(-2) - 1 - 1. What is the closest to -2 in x, 1, 1/4? x Let i be (6/54)/(1/6). What is the closest to i in 0.4, -6, -3? 0.4 Let j = 57/2 + -29. Which is the closest to 0.2? (a) 4/7 (b) 4 (c) j a Let l(g) = 9g*3 + 2g*2 + 2g + 1. Let u be l(-1). Let z be (-6)/(-8)3u. Let h be (-4)/30(-30)/z. Which is the nearest to 0? (a) -1/5 (b) 5 (c) h a Let h be (6/(-4))/(-1) - -1. Let l = -20 + 20.44. Let z = 0.06 + l. What is the closest to 2 in z, 0.3, h? h Let h = -1 + 1.5. Let f be ((-1 - 0) + 0)/(-38 - -39). Let k = 3 + -7. Which is the nearest to f? (a) 0.4 (b) h (c) k a Let g be 0 + (3/(-2))/(-3). Let b be (1 - 8/10)/1. Let c = -409/6 + 68. What is the nearest to g in b, 4, c? b Let q = 0.1 - 0.1. Let g = -15 + 14. What is the closest to g in q, 3, -1/2? -1/2 Suppose -4y + 9y = -10. Suppose -4b + 5n + 14 = 0, 6b - 4b - 6 = 2n. What is the closest to b in 2, y, 0.1? 0.1 Let u = -0.1 - 1.9. Let l = 0 - 0.1. Let w = 1.8 + -0.8. Which is the nearest to w? (a) u (b) -4 (c) l c Let z = 13 + -14. Which is the closest to -2/5? (a) 0.3 (b) 4 (c) z c Let l = 1 + -1.3. Let k = -5 - -9. Which is the closest to -0.1? (a) -4 (b) k (c) l c Let w = -15 + 16. Which is the closest to -1/3? (a) 2 (b) 2/11 (c) w b Let u be (-1)/(1 + -2)*1. What is the nearest to u in 0.2, 2, 1/2? 1/2	{ "pile_set_name": "DM Mathematics" }
q - 4. Let i be (0/d)/((-32)/16). Let c be y(i). Solve 4x - 11 - 1 = c for x. 3 Suppose 51 = a - 2u, 78 + 24 = 2a + 5u. Suppose 9c - a = -8c. Solve -c = 24q - 23q for q. -3 Suppose 3l - 15 + 6 = 0. Suppose lq + 3 = 0, -5r = q - 4q - 28. Let x be (-15)/(-20)(-1 + 5). Solve -b = -x + r for b. -2 Suppose 28t = -35t + 70t - 28. Suppose o = 2s - 5, 3o + 3s = -2o + 40. Suppose 5l + 3a - 24 + 6 = 0, -5a + o = 0. Solve -10 + t = -lr for r. 2 Let w(t) = -7t3 - t2 + t + 1. Let n be w(-1). Suppose 0 = -24i + 3i + 42. Suppose -4y - if = -4, 2f = 3y - 6y + 1. Solve 9 = yc - n for c. 5 Let s be ((-288)/30)/((-120)/200). Suppose 0 = -2a - 3a + 15. Suppose -an + o + 4 = 0, 0 = -n - 3o + 10 + 8. Solve 0 = nk + s - 4 for k. -4 Let q = -87 + 85. Let v be (2q/8)/((-8)/(-192)). Let m be ((-1)/v3)/((-2)/(-8)). Solve -4t = 3 + m for t. -1 Let n be (-4 - 4)/(-16)6. Let q be 10 + (5 - n)-4. Solve -qt - 3 = t for t. -1 Let m(r) = r3 + 20r*2 + 53r + 43. Let x be m(-17). Solve 50d - 41d = -x for d. -1 Let c(x) = 169x - 6244. Let j be c(37). Solve 0 = jw + 4 + 5 for w. -1 Suppose -4d + 1168 = 12d. Suppose d = 21s + 10. Solve sg - 7g = -4 for g. 1 Let o(f) = -f3 + 39f*2 - 40f + 85. Let g be o(38). Suppose -p = -14r + gr + 15, 25 = 5p. Let c = -4 - -7. Solve rq - c = 1 for q. 1 Suppose -5m + 4l + 355 = 0, -9m + 215 = -6m - 2l. Let j = m - 67. Solve 4k + 24 - j = 0 for k. -4 Suppose 2g + 128 = 3j - 5j, 0 = -4g + 8. Let a = -62 - j. Let s(u) = u*2 - 14. Let z be s(a). Solve -2x + x = -z for x. 2 Let n be (35 - 1) + -3 + 0. Suppose 9c - 155 = 4c. Suppose 5h = n - c. Solve -4 + h = q for q. -4 Suppose 4p - 20 = 2x - 0x, 2x = -2p + 10. Suppose -3g + 4g - 4 = x. Solve 0 = -4m + 5m - g for m. 4 Suppose 3w = -3q - w - 26, 2w - 20 = 4q. Let o be (0 - 1/(-6)) + (-29)/q. Solve 0 = -ok + k for k. 0 Let f be 3 + 28/(-10) + ((-1296)/30)/(-4). Solve fi - 15i + 16 = 0 for i. 4 Suppose 14f - 9f - 15 = 0. Suppose 6n - fn - 12 = 0. Suppose -2o = 4w + w - 10, 4o + nw = 8. Solve -2u + 4 = -ou for u. 2 Let s(a) = 18a*2 - 160a - 23. Let m be s(10). Solve 156 = 7r + m for r. -3 Let o be ((-3)/(-9)-2)/(56/(-16380)). Let q = 200 - o. Solve -6d = -qd for d. 0 Suppose -2m + 2 = 0, 3m + 17 = 2z - 22. Suppose -59 - z = -10f. Suppose 4y - fy = -12. Solve 2i + 25 = -yi for i. -5 Suppose 13 + 12 = 5s, -3w + 3s = -966. Solve -wd - 2 = -325d for d. -1 Let f(h) = -h3 + 9h*2 - 8h + 7. Let z be f(8). Let j = 456 + -288. Let q = j + -165. Solve -q + z = -x for x. -4 Suppose -53 = -3c - 0c - 4m, 0 = 4c - 14m - 206. Solve -ch + 23h - 24 = 0 for h. -6 Let i(j) = -2j*2 - 96j - 852. Let f be i(-12). Solve q + f - 14 = 0 for q. 2 Suppose 28b = 4w + 24b - 508, -w + 5b + 139 = 0. Let s = w - 102. Solve 6v = -s - 2 for v. -4 Let o = -763 + 770. Solve 37s - 36s - o = 0 for s. 7 Let d(x) = x2 + 19x + 39. Let h be d(-17). Suppose -3f - 368 = -4i - 93, -2f - 188 = -hi. Let v = f - -97. Solve v = -5u + 3 for u. -1 Let u be 6/(-7)105/(-30). Suppose ut - 8 = t. Suppose 4 = ty - 4. Solve 3d + y - 8 = 0 for d. 2 Suppose 145d - 143d + 277 = 5g, -230 = -4g + 3d. Solve 27y - g = -188 for y. -5 Let z = 61 - 58. Let w be ((-5)/4)/((-1)/(-4)). Let j be (-26)/39(w + -1). Solve z = ju + 15 for u. -3 Suppose 0 = 24l - 0l - 16368. Suppose 6h + 634 = l. Solve -5s - h = -23 for s. 3 Let c be (10/(-9) - 9/(-81)) + 45. Suppose 6 + c = 10v. Solve vq + 17 = -3 for q. -4 Suppose -7m + 2m + j + 11 = 0, 7 = -3m + 4j. Suppose -17f + 70 = -mf. Solve 0 = fc + 18 + 2 for c. -4 Suppose -w = -8, -3j + 53w + 181 = 52w. Solve -68 = 80h - jh for h. -4 Suppose 0 = 2f + 27 - 23. Let x be 3 - 0 - 2/f. Suppose o - x = -o. Solve o + 13 = -3n for n. -5 Suppose b - 3r = 13, -r = 3r + 12. Suppose -bh = 4, 7 = -5v - 3h + 49. Suppose 17 = 3m + 2s - 1, -2s = -6. Solve mi - v = i for i. 3 Let a(b) = -18b - 13 + 4b + 12b. Let w be a(-7). Solve w = u - 4 for u. 5 Suppose -80z = -72z - 1088. Solve 130g + 6 = zg for g. 1 Let a(x) = 4x*2 + 30x + 14. Let j be a(-7). Suppose j = 83h - 84h + 3. Solve -5v = -hv - 4 for v. 2 Suppose 0 = -2a - 3t - 62, -18 = a + 5t + 27. Let q be 120/6(-930)/a. Let k = -120 + q. Solve 2j - 3j = -k for j. 4 Suppose 4c - 545 = 2p - 211, 3p = 5c - 416. Suppose -c = -9a + 5. Suppose 13u - au = 6. Solve ub = -b for b. 0 Suppose -3m - 147 = -5z, -17m + 16m = 4z - 104. Solve z = 13k - 12 for k. 3 Let y(u) = 3u*2 - 5u - 4. Let p be y(-1). Let z(g) = 2g2 + 33g + 18. Let j be z(-16). Solve -jb = -pb for b. 0 Let o be (-63690)/(-45) - ((-104)/12 + 9). Solve -1418f = -of - 18 for f. 6 Suppose 3 = o - 0. Suppose -4d + oa = -0d - 226, -3d = 2a - 161. Let j = -53 + d. Solve -jy - 10 = 3y for y. -2 Suppose 312 = -10r + 16r. Suppose -4w - r + 16 = 0. Let d = w + 10. Solve -4p - d = 15 for p. -4 Let o(a) = a3 - 18a*2 + 33a - 13. Let q be o(16). Let u(b) = -b*3 - 16b*2 - 14b + 8. Let l be u(-15). Let d = l + 10. Solve 0 = dv - 0 - q for v. 1 Let c(y) = 2y*3 - 4y. Let d be c(-2). Let p(n) = -7n - 20. Let u be p(d). Let i = u + -36. Solve -2s = -8 - i for s. 4 Let f(s) = 3s3 - 5s*2 - 12s + 3. Let i be f(-3). Let q = i + 90. Solve -2m = qm - 5 for m. 1 Let n = 6468 + -6461. Solve n = -12z - 41 for z. -4 Suppose f = b + 75, -4b - 226 = -2f - f. Suppose a - f = -72. Solve 0 = -0d + ad + 2 for d. -1 Suppose 49n + 4n - 12n = 1558. Solve -83u - 45 = -nu for u. -1 Let t = -1890 + 1964. Solve t = -50j - 176 for j. -5 Let j = 1785 + -1739. Let c(t) = -t2 + 3t + 6. Let n be c(7). Let i = n + j. Solve -4w + i = 4 for w. 5 Let z be 4/18 + (-175)/(-63) - -39. Solve 34w = 40w - z for w. 7 Let a(x) = -59x + 1298. Let l be a(22). Solve l = -10h + 6 + 14 for h. 2 Let n = -1629 - -1637. Solve nm + 18 = -22 for m. -5 Suppose 4b = 5g - 813 + 298, 5b - 272 = -3g. Let n = 90 - g. Let u be 1/((-3)/n)1. Solve f = uf + 8 for f. -4 Suppose 101c - 74c = 162. Solve -cb + 17 + 1 = 0 for b. 3 Let z be (-88 - 18)2/(-4). Let v = 62 - z. Let c = v + -9. Solve c = -k - k - 10 for k. -5 Let p be 6/(-7) - (-102720)/280. Solve -62f - 6 = p for f. -6 Let w(h) = h2 - 3h + 10. Let p be w(3). Suppose 81 = pg - g. Suppose gf + 9 = 12f. Solve -fq - 12 = q for q. -3 Let b = -4 + 103. Suppose -4j = 5v - b, -5j + 1 = -4. Solve 3n = v - 22 for n. -1 Let k(b) = -19b - 6. Let n(d) = 19d + 4. Let u(s) = -3k(s) - 4n(s). Let q be u(-1). Let y = 25 - q. Solve -yw = -7w - 3 for w. -1 Suppose 0u = u - 5u. Suppose -3g + 0r - 4r + 2 = u, -2g + 5 = -r. Solve -g + 17 = 3q for q. 5 Suppose 4g - 284 = 4r, -15g - 4r + 993 = -7r. Solve -g = -17z + 3 for z. 4 Let o = 90 + 146. Let p = -236 + o. Solve p = 7z - 8 - 6 for z. 2 Suppose 4l - 9 = 11. Let y = -85 - -80. Let r be 26 - (2 - 1y/5). Solve -r + 8 = -lx for x. 3 Let d(n) = -2n + 37. Let j be (-8)/(-12) + 104/24. Suppose 4u - 52 = jb, -u + 22 = -0u + b. Let f be d(u). Solve 3 - f = h for h. 2 Let s(v) = v + 12. Let z be s(-7). Suppose -zl + 140 = 15l. Solve -4w - 5 = l for w. -3 Let y(k) = 5k - 138. Let x be (10 - 39)(4 + -5 + 0). Let n be y(x). Solve n = -4u + 11 for u. 1 Suppose -3h + 5a = a - 10, 3h - 2a = 8. Suppose -2t = 3i - 19 + 5, -i - 2 = ht. Let l = i - 4. Solve 0 = -lv + 3v + 4 for v. 4 Suppose 4x + 4a - 20 = 0, 125x - 5 = 123x + 3a. Solve 0 = -44u + x - 48 for u. -1 Let n be 6 - (-4)/8(2 - 2). Suppose -nf + 4 = -7f. Let o be (-3 + (-14)/f)/(3/6). Solve v + 0v = o for v. 1 Let x(l) = -6l2 - 57l - 18. Let w be x(-9). Solve 5 = wt - 8t for t. 5 Let z = -2190 - -2191. Solve z = -3p + 19 for p. 6 Suppose 4 = 2i - i, 2i = -b + 10. Suppose -3m + 10 = bm. Let j = 8 - 6. Solve -j = -mn - 10 for n. -4 Let d(w) = 2w3 + 29w*2 + 12w + 13. Let i be d(-14). Suppose 4y - i = -25. Suppose 0l + 4l = 2h - 30, -yl = 0. Solve f + 2f = -h for f. -5 Suppose -9a + 6a + 21 = 0. Suppose -3c - 5y + 34 = a, 5c = -y + 23. Suppose j = -0j + cu + 5, u + 17 = j. Solve j = 5z + 1 for z. 4 Suppose 0h = -3h - 5p - 63, -105 = 5h + 3p. Let u = -31 - h. Let q be (-1 - u)(7/21 - 0). Solve 0	{ "pile_set_name": "DM Mathematics" }
- 1 - p - p) to wp2 + c + sp and give c. 0 Express -2z + 5 - 2 - 19 - 29 in the form cz + d and give d. -45 Express (-5o + 2o + 2o)(-7 - 30 - 13) as c + ao and give a. 50 Rearrange (0 - 3 + 1)(13v + 17v + 45v) to the form tv + a and give t. -150 Express (66 - 66 + 14s)(s - s + s*3) in the form u + ns*2 + gs*4 + fs*3 + ds and give g. 14 Rearrange 6r2 - 7r*2 - 8r*2 to qr*2 + g + dr and give d. 0 Express 4 + 21g2 - 11 + 7 as zg + k + qg2 and give k. 0 Express 7i*2 - 10i*2 - 14i*2 in the form x + ti*2 + oi and give t. -17 Rearrange (-2s + s + 3s)(-6 + 1 - 7) to w + os and give o. -24 Rearrange -3g2 + 0 - 3 + 5 to o + mg + kg2 and give o. 2 Express 2w + 2w2 + w3 - 13 + 14 + w3 as qw + ow3 + m + kw*2 and give o. 2 Rearrange 795 + 18p - 795 to the form tp + k and give t. 18 Rearrange 2b*2 - 2 - 1 + 6b*2 + 5 to the form ob*2 + f + nb and give o. 8 Express 3 - 21g2 - 23g*2 + 41g*2 as hg*2 + s + vg and give s. 3 Express -5n - 5n - 6n + 3 - 4 in the form un + y and give u. -16 Express 8b2 - 2 - 3b*2 + 2b*2 as ob + fb2 + m and give f. 7 Rearrange (g + 8g - 2g + (-2 + 2 - 1)(-4g + 2g + 4g))(-4 - 2 + 1) to jg + r and give j. -25 Rearrange 19h*2 + h - h - 2h*2 to wh*2 + qh + i and give w. 17 Rearrange 13g - 9g - 10g - 7g to the form y + dg and give d. -13 Express 5v*4 + 3v*4 + 1 - 2 - 9v*4 + 3v*2 as dv + q + iv3 + tv*4 + jv*2 and give i. 0 Express -4 + 5 + f - 1 - 20f*3 as gf + o + bf2 + af*3 and give g. 1 Rearrange -2r*2 - 7r*2 - 2r*2 to the form d + xr + wr2 and give w. -11 Express ((1 - 1 + 1)(5 - 1 - 2) + 1 + 1 - 3 - 2 - 2 + 3 + 4 - 8 + 3)(2a + 2a - 6a)(-3 + 2 + 0) as la + p and give l. -2 Express (3i3 + i3 + 5i*3)((-5 + 5 - 2)(-1 + 1 + i) - 4 - i + 4) in the form ni*4 + ui*2 + g + ti + di3 and give n. -27 Express 33l + 58l - 5l in the form s + hl and give h. 86 Rearrange 3v - 2v + 2v + (3v + 0v - 4v)(1 + 2 - 9) - 2v + 2v + 3v + 3v + v - 6v to the form lv + y and give l. 10 Rearrange (0 - w*2 + 0)(0w - 2w*2 + 0w) + (0w - 8w - 3w)(0w + 0w - w*3) to xw*4 + u + qw*2 + lw + iw3 and give x. 13 Rearrange -8f + 1 - 11 + 0f + 9f to the form zf + a and give z. 1 Express (-2 + 2k + 2)(0k*3 - 5k*3 + 3k*3) + (0k - k*2 + 0k)(2k*2 + 5k*2 + 2k*2) in the form uk*2 + s + jk*3 + dk*4 + ak and give d. -13 Rearrange (-y + 2y + y)(-59 + 58 - 84) to the form b + fy and give f. -170 Express (z - 3 + 3)(-5z + 0z + 3z)(11z - 17 - 6z - 3z) in the form yz + uz3 + f + jz*2 and give u. -4 Rearrange ((4 - 1 - 1)(p - p + 2p) - 2 + p + 2 + 4 - 4 + 2p - 2 + 2 - p)(-p3 - 5p*3 + 3p*3) to the form cp*2 + h + zp + fp4 + gp*3 and give f. -18 Rearrange (2 + 7 + 0)(5v + 4v - 5v) to the form z + mv and give m. 36 Rearrange (2w - 2w + w)(-131w*3 + 10024w - 10024w) to uw*3 + lw*4 + m + ow*2 + cw and give l. -131 Express -2t2 + 0t + t*2 - 11t in the form h + vt2 + ft and give v. -1 Rearrange (-2k + 3 - 3)(68 + 176 + 28 + 5) to q + sk and give s. -554 Rearrange 2z3 + z2 - 46z - 5z*4 + 3z*4 + 48z + 2 to the form uz3 + oz*2 + j + yz*4 + fz and give f. 2 Express (1 - 2a - 1)(0a2 + 3a*3 + 0a*2) + (-4a2 + a3 + 4a2)(-a + 4a - 15a) as p + wa4 + sa*3 + va*2 + ha and give w. -18 Rearrange 143j2 + 3j - 3j - 137j*2 to cj*2 + mj + h and give c. 6 Express (-3v2 + 6v*2 - 2v*2)(2 + 2v2 - 2) - 4v*4 - 16 + 7 + 7 in the form tv*4 + h + cv*2 + wv*3 + nv and give h. -2 Express (-3k + 14k + 0k)(0 + 0k2 - k2 - 3) in the form dk + bk3 + j + uk*2 and give b. -11 Express (1 - 4 + 1)(1 - 3 + 3)(-2r - 4r + r) as a + or and give o. 10 Express 1 + 0g - 3g - g*3 + 6g + 0g2 - 4g*2 in the form cg + o + jg3 + xg*2 and give o. 1 Rearrange -19v + 3v - 5v + v to rv + u and give r. -20 Express 30g + 18g - 14g as i + ug and give u. 34 Express 25f + 3 - 20f - 3 in the form s + if and give i. 5 Rearrange -18a2 - 19a*2 - 13a*2 + 55a*2 to the form s + ua*2 + xa and give u. 5 Rearrange (-4 - 4 + 7)(-5f - 1 + 1) - 5 + 5 + 2f to the form pf + v and give p. 7 Express -8a - 11a + 0a + 5a as ja + o and give j. -14 Express 15d*2 + 2d*3 + 17d*2 - 31d*2 - 2 in the form pd*3 + j + kd*2 + td and give j. -2 Express y*2 - 7y*2 - 5y*2 + (0y*2 - 2y*2 + 4y*2)(-1 + 1 + 1) + 2y2 - y2 - 2y*2 in the form by + g + oy2 and give b. 0 Rearrange 3f - 226f3 + 118f*3 + 110f*3 + 2f*2 - 2f*4 to mf*2 + vf + uf4 + t + zf*3 and give z. 2 Express -1010u*3 - 7 - 2u*4 + 1 + 1009u*3 as su*4 + au + vu2 + mu3 + o and give o. -6 Rearrange y3 - 5y2 - 4y*2 + 0y - 3y + 6y*2 to ky + qy3 + ny*2 + g and give k. -3 Rearrange 305a + 44a2 - 156a - 149a - 1 to the form ha*2 + da + t and give d. 0 Express -3i2 + 1 + 3i*2 - 3i*3 + 5i*3 as d + mi*2 + yi*3 + ri and give d. 1 Express q*2 + 1 + 2 + 7 in the form kq*2 + n + jq and give k. 1 Rearrange 0n2 - 3n*2 - 17n*2 to the form bn + tn2 + y and give t. -20 Express -23h*2 + 20h*2 + 0h - h + 70h2 in the form m + zh*2 + dh and give d. -1 Express r + 4r + 4r + 3r as tr + z and give t. 12 Express ((22 - 22 - 4d)(-4 + 5 - 6) + 3d - 4d - d)(-2d - 2d + 5d) in the form wd2 + p + fd and give w. 18 Rearrange (0 - 3 + 6)(-2p*4 + 0 + 0)(2 - 5 + 1 + (6 - 2 - 3)(0 + 2 - 3)) to the form sp + gp4 + qp*3 + m + kp*2 and give g. 18 Rearrange (-8n*2 + 0n + 0n)(-2n + 3n + 0n) + (n3 - n3 - 2n*3)(2 + 2 - 2) to the form d + yn2 + cn*3 + an and give c. -12 Rearrange 3 - q*3 + 12q*2 + 1 - 6 to the form pq*2 + w + sq + zq3 and give p. 12 Rearrange -3i3 + i4 - 3i2 + 2i*2 + 1 + 5i*2 - 2i to the form ki4 + li*2 + b + oi + yi3 and give l. 4 Rearrange (-3 + 3 - 1)(l + 2l - 2l) - 4l + 2l + 4l - 9 + 8l + 9 to the form x + al and give a. 9 Express -59q*3 - 2 + 60q*3 + 3q + 3q2 + q2 in the form aq + z + oq3 + xq*2 and give z. -2 Express (-5g + 5g - 2g)(-1 - 3 + 5)(0g + 4g - 5g) as n + zg + dg2 and give d. 2 Express (-6k3 - k3 + 4k3)(-1 + 2 - 3) as g + ok2 + wk*3 + vk and give w. 6 Express -z*3 - 5z*3 + 5z3 - z3 - 46z2 - z4 in the form iz + az4 + jz*2 + w + lz*3 and give a. -1 Express -6 - 2o*3 + 3 + 0 - 12o + 2 as lo3 + q + xo + so2 and give l. -2 Express 5 - 3 + 13j4 + 4 - j3 - 12j4 in the form i + uj*2 + hj*3 + wj*4 + rj and give h. -1 Express -3p3 - 144p*2 - 2 + 0p + 3p4 + 143p*2 + 0p in the form jp + k + np*2 + mp*3 + cp*4 and give n. -1 Express (-9q + 86q + 2q)(-q + q - q) as tq*2 + vq + a and give t. -79 Express -172 + 41z + 172 + (2 + 3 - 4)(4 - 2z - 4) in the form az + t and give a. 39 Express -m2 - m2 - 3m2 in the form cm*2 + n + sm and give n. 0 Express -3l + 7l - l + (5 - 5 + 1)(-19 + 27 - 9l - 10) as kl + x and give k. -6 Express (23w*2 + 80 - 80)(-1 - 2w + 1) as fw + qw2 + g + dw*3 and give d. -46 Rearrange 13j*3 + 3 - j - 11j*3 - 4 to the form lj*2 + u + fj + tj3 and give f. -1 Rearrange 0r*2 + 2r*2 + r - 3r*2 + (2 + 5r - 2)(-3r + r + r) - 2r2 - 3r*2 + 3r*2 to ir + a + cr2 and give i. 1 Express (5 - 5 + k)(-1 + 2k + 1 + 1)(-1112k + 89k*2 + 1112k) in the form jk3 + d + gk + ik4 + sk*2 and give j. 89 Express 2o - 9o3 + 12o*3 - 2o*3 - 9o4 - o2 as bo4 + so*2 + do*3 + y + ko and give k. 2 Express -6a + 7a + 9a + a + 2 - 2 + (a - 4 + 4)(-1 + 2 + 0) + 3a - 4a + 2a + (0 - 2 + 1)(a - a + a) + 0a + 0a - a as va + y and give v. 11 Express 17n - 22n - n2 + 7n + 5n3 in the form pn + x + qn3 + tn*2 and give t. -1 Rearrange -1 - v - v + 1 to the form i + hv and give h. -2 Express 6q2 - 20q*2 + 1 - 16q*2 - 2q*3 - 2 as rq*3 + tq*2 + a + yq and give t. -30 Rearrange -33v2 + 34v2 - v3 - 1 + 0 + 2v3 to r + qv*3 + fv*2 + hv and give r. -	{ "pile_set_name": "DM Mathematics" }
t 0.03 * 0. 0 16-0.39 -6.24 Product of 112.3 and -0.3. -33.69 569 -6 -3414 What is the product of 226 and -0.2? -45.2 What is -8 times 0.13? -1.04 1.3213 3.963 Work out -0.2 88. -17.6 Product of -20.7 and 2. -41.4 What is -2 times -832? 1664 0.815 12 Work out -3.8 -2. 7.6 -5 times -1856 9280 What is the product of 5.3 and 0.4? 2.12 -65.9 times 18 -1186.2 Multiply -0.7 and 172. -120.4 Work out 1.33 * 1. 1.33 What is the product of 28 and 40? 1120 What is 4 times 0.089? 0.356 Product of 6.6 and 0.19. 1.254 What is the product of -41 and 7? -287 Product of 8 and 13. 104 -4 * 705 -2820 Work out -71.5 * -2. 143 What is 493 times 4? 1972 Calculate -364.7. -194.1 Work out 0.3 1.29. 0.387 Work out 34.5 * 42. 1449 What is the product of -15 and -3? 45 0.26811 0.2681 Product of 0.029 and -0.1. -0.0029 1.53-2 -3.06 -0.1 * 9.9 -0.99 What is -7 times -3? 21 3 * -0.115 -0.345 Multiply -0.72 and -0.5. 0.36 Multiply -5 and 2.475. -12.375 Product of -1.246 and -2. 2.492 -0.5 * 71 -35.5 What is the product of -7.81 and 0.5? -3.905 Product of 1061 and -0.01. -10.61 What is -487 times -0.1? 48.7 What is 0.3 times -174? -52.2 Work out -0.193 * -1. 0.193 What is the product of 0.3 and 97? 29.1 4 times -5891 -23564 Calculate -575. -375 Calculate -1.3781. -1.378 0.079 times -7 -0.553 Product of -0.4 and -63.9. 25.56 What is -4798 times -3? 14394 Product of 0.085 and 0.05. 0.00425 0.244 times -6.2 -1.5128 -318 times 38 -12084 1.9-174 -330.6 What is the product of 6 and 901? 5406 -1.2 times 198 -237.6 -0.17-1.5 0.255 0.6-0.2 -0.12 Calculate 1590.2. 31.8 Multiply 10 and -2.3. -23 Multiply -0.064 and -325. 20.8 Product of -8 and -0.25. 2 -2.8 * 21.9 -61.32 2 times 19.4 38.8 0.395 times 1 0.395 Multiply 0.5 and 158. 79 16.7-25 -417.5 1.71 -5 -8.55 Product of -197 and -0.02. 3.94 What is 5 times -432? -2160 What is the product of -0.036 and 16? -0.576 31.3-0.3 -9.39 Multiply -189 and -0.04. 7.56 Multiply 5 and 0.0452. 0.226 Multiply 0.5 and -44. -22 Multiply 3.3 and -0.2. -0.66 0.5-1.4 -0.7 0.562 * 1 0.562 Multiply 5.35 and 22. 117.7 -0.02-83 1.66 Product of 6 and 1.98. 11.88 What is 0.05 times -11? -0.55 What is 7.5 times -21? -157.5 Product of -4 and -1.22. 4.88 47 -7 -329 Multiply 1.4 and 112. 156.8 What is 5 times 677? 3385 Work out -1.1 * -0.5. 0.55 What is the product of 3 and -2? -6 What is the product of -19 and 127? -2413 Product of -813 and -2. 1626 -11.5 -1.5 What is the product of 2665 and -0.4? -1066 -6 -11 66 -0.1-97 9.7 Calculate -361-0.5. 180.5 0.5-1.81 -0.905 What is -0.3 times 0.774? -0.2322 Product of -2 and -57. 114 Multiply 2 and 455.2. 910.4 Work out -4 469. -1876 Product of 0.71 and 1.16. 0.8236 Calculate -61.3. -7.8 What is -0.15 times -11? 1.65 What is 2.3345 times 0.3? 0.70035 Calculate 0.10.22. 0.022 Multiply -13 and 6.39. -83.07 Calculate 11.20.4. 4.48 What is the product of -0.11 and 0.9? -0.099 What is 40 times -2? -80 What is the product of -0.4 and 0.2482? -0.09928 -0.3 times 5 -1.5 What is the product of -377 and 8? -3016 Product of 0.2 and -16. -3.2 Multiply 0.006 and 59. 0.354 Multiply -0.1 and -1302. 130.2 7892 0.5 3946 Multiply 6.1 and 0.4. 2.44 Product of -0.331 and 0.3. -0.0993 -4 times 32 -128 What is the product of -0.074 and 8? -0.592 Product of -0.6 and 0.026. -0.0156 Product of -1 and -321.3. 321.3 Multiply -0.232 and -3.2. 0.7424 Calculate 30.1137. 0.3411 -0.60.045 -0.027 Work out 0 * -2.98. 0 What is -21.99 times 1? -21.99 0.01 * 0.11 0.0011 -28.2 * 9.1 -256.62 Product of 1 and -1033. -1033 0.01-4 -0.04 Multiply -16737 and 0.4. -6694.8 Work out 0.47 0.012. 0.00564 Work out -10235 * -0.5. 5117.5 -2.1 times 133 -279.3 Multiply -28.7 and 4. -114.8 Product of -0.0314 and -3.3. 0.10362 13 times -0.28 -3.64 Work out -0.07 * 0.26. -0.0182 0.54 * 1 0.54 Calculate 1-33.7. -33.7 -5-248.4 1242 -1 * 10.5 -10.5 0.9 times -0.49 -0.441 -0.002 * 0.56 -0.00112 2060.3 61.8 Multiply 0.005 and -3. -0.015 -5 -4.21 21.05 102 times 2.1 214.2 What is the product of 3 and 0.5? 1.5 What is -0.1 times -0.17? 0.017 -454 -180 What is the product of -0.01 and -19? 0.19 -5.08 times 0.4 -2.032 Multiply -0.2 and -306. 61.2 Multiply 42610 and 2. 85220 What is the product of -2 and 30.7? -61.4 -44500.3 -1335 Multiply -10.8 and 0. 0 Work out 0.0268 * -0.2. -0.00536 -3.50.23 -0.805 355.7 times 1 355.7 What is the product of -4 and 33.4? -133.6 What is -0.15 times 0.228? -0.0342 678 0 0 Work out -0.2 * -1.088. 0.2176 -8 times 12 -96 40.108 0.432 0.02618 times -1 -0.02618 2 41 82 0 times 8.18 0 Calculate 30.534. 1.602 Work out -1644.9 -4. 6579.6 -2 * 282 -564 Multiply 4777 and 0.1. 477.7 What is the product of -8 and -252? 2016 -2.34820.5 -1.1741 Calculate -0.12268. -226.8 Multiply -1.6 and -0.1375. 0.22 What is the product of -173 and -0.01? 1.73 What is -3 times 33.89? -101.67 63635 * 0 0 422-0.3 -126.6 0.2 times 0.009 0.0018 1341 134 Calculate -0.03220.46. -0.014812 -11 -0.05 0.55 Work out -138 * 22.9. -3160.2 Multiply 14 and 0.27. 3.78 Product of 0.082 and 0.6. 0.0492 -9-31 279 1.1 times -16.1 -17.71 -456 times -5 2280 7 times 1050 7350 1-16.97 -16.97 Product of 0.1 and -0.18. -0.018 Multiply 0.6 and -1.1. -0.66 What is 0.1 times -39? -3.9 Calculate 1.5030.4. 0.6012 Multiply -0.6 and -0.0833. 0.04998 What is 0.45 times -5? -2.25 Calculate 1.1-565. -621.5 What is the product of 0.042 and -0.0089? -0.0003738 What is -0.05 times 3? -0.15 Multiply 189.2 and 7. 1324.4 Calculate -28.61. -28.6 What is the product of -1.3 and 0.17? -0.221 Product of 0.9 and -498. -448.2 What is the product of 3 and 38? 114 7 times 1 7 What is -0.3 times -5.4? 1.62 What is 0.07 times -0.024? -0.00168 Product of 14 and -118. -1652 Product of 13 and 0.059. 0.767 Multiply 1.075 and 1. 1.075 Work out -6.29 1. -6.29 14 * 8 112 31 * 0.06 1.86 Calculate -280.06. -1.68 What is the product of -0.1 and 19? -1.9 0.8-92 -73.6 Product of 0.7 and -230. -161 -0.3 times 1583 -474.9 Calculate -0.0357. -0.245 Product of 230 and 0.4. 92 Calculate -0.2-205. 41 -12.5-4 50 Multiply -22.29 and 3. -66.87 Product of 0.03 and 0.2241. 0.006723 -7998 times 0.2 -1599.6 Product of 4.691 and -3. -14.073 Product of 0.03 and 0.04. 0.0012 Multiply 1 and -1439. -1439 45.7 5 228.5 5 times -0.33 -1.65 0.11623 * -0.5 -0.058115 -382 -76 Calculate 22.536-0.4. -9.0144 Work out 6 * 3. 18 447 times -4 -1788 Multiply -0.25 and -1.5. 0.375 What is the product of -8149 and -1? 8149 What is -254 times -0.2? 50.8 Multiply 4321 and 3. 12963 -36.6 times 2 -73.2 Work out -0.0604 * -0.8. 0.04832 -308.9 times 0.04 -12.356 Multiply 592 and 2. 1184 Work out 0.2 * 1.49. 0.298 Product of -0.5 and -0.03. 0.015 Multiply 61 and 624. 38064 What is the product of -3 and -45.2? 135.6 Work out -260 * 0.4. -104 -0.1-5738 573.8 Multiply -0.3 and 17.8. -5.34 -39 126 -4914 -143 * 0.6 -85.8 Work out -11.58 * 0.02. -0.2316 Multiply 6910 and 3. 20730 What is 0.4 times 0.055? 0.022 What is -0.01 times -0.09? 0.0009 Calculate -0.160.7. -0.112 What is -4 times 0.614? -2.456 Calculate -0.25.71. -1.142 5 times 0.173 0.865 Product of 18 and -0.3. -5.4 Product of 0.2 and -29.9. -5.98 Product of -9 and 64. -576 Work out -9 * -25. 225 Work out 8 * -2158. -17264 What is -1.58 times 0.1? -0.158 Product of -0.02198 and 0.4. -0.008792 Work out 0.0191 * -0.2. -0.00382 Multiply 5 and -2.91. -14.55 Product of -0.012 and 0.2. -0.0024 Product of -0.01 and 29. -0.29 What is 0.05 times -4? -0.2 What is 16.5 times 0.1? 1.65 What is the product of 0.12 and 40? 4.8 What is the product of 95 and 0.08? 7.6 474 times -15 -7110 0 * -46 0 Work out -0.0151 * -26. 0.3926 Calculate -0.4116.9. -46.76 Work out -2.89 12. -34.68 What is the product of 107 and 17? 1819 -0.1 times 96.1 -9.61 Calculate -0.1-0.91. 0.091 What is the product of 4 and -67? -268 Work out -0.2 -0.128. 0.0256 Work out -6.6 * 88. -580.8 0.21-8 -1.68 What is -0.127 times 0.03? -0.00381 Work out -1556 2. -3112 -0.4 times -21.6 8.64 -5-0.25 1.25 -3 times -125 375 -1334 -532 What is 4 times 2.11? 8.44 What is 1 times 109? 109 Work out 1.7 * 247. 419.9 What is -13.4 times -5? 67 -0.202 * 27 -5.454 What is -10 times 0.017? -0.17 Multiply -0.5 and 0.061. -0.0305 -50 * -158 7900 -2075 * 0.5 -1037.5 What is the product of -	{ "pile_set_name": "DM Mathematics" }
for n. 13 Solve -345h - 384 = -361h for h. 24 Solve -54 = -244q - 221 - 565 for q. -3 Solve 388 - 120 = 268q for q. 1 Solve -17b + 3b - 224 = 0 for b. -16 Solve -15b = 72 - 140 - 82 for b. 10 Solve 113x + 74x - 1396 + 5697 = 0 for x. -23 Solve -69604p = -69578p + 26 for p. -1 Solve 327b - 668b + 310b + 217 = 0 for b. 7 Solve -107i - 1241 = -2311 for i. 10 Solve 0 = -271t + 255t + 169t + 1683 for t. -11 Solve -46930 + 46923 = -x for x. 7 Solve -72l - 26l = 63l - 3381 for l. 21 Solve -369l = -387l + 216 for l. 12 Solve -91n = -35n + 616 for n. -11 Solve 540j = 108j - 132 - 4620 for j. -11 Solve -60b = -143b - 116b + 597 for b. 3 Solve 42v + 176 + 76 = 0 for v. -6 Solve -719j + 34177 - 7574 = 0 for j. 37 Solve -1419u + 706u + 730u = -374 for u. -22 Solve 200s - 102s - 108s - 30 = 0 for s. -3 Solve 10n - 38 = -22 + 44 for n. 6 Solve -56b + 124 = -71 + 27 for b. 3 Solve 4335u + 2666 = 4421u for u. 31 Solve -41i - 186i - 2306 + 6846 = 0 for i. 20 Solve 8x = 266x + 2064 for x. -8 Solve 0 = 37w - 16173 + 15322 for w. 23 Solve 151i + 1761 = 3875 for i. 14 Solve 4991y = 4984y + 14 for y. 2 Solve 178p + 1384 = 2786 + 1624 for p. 17 Solve -94w - 280 = -150w for w. 5 Solve 147b - 74b + 44 + 29 = 0 for b. -1 Solve -7t + 13 = 10t - 4t for t. 1 Solve 257t + 315 = 2885 for t. 10 Solve -424d - 4395 = -3547 - 10600 for d. 23 Solve 289h = 78h + 1108 - 53 for h. 5 Solve 91t - 4t = 20t + 201 for t. 3 Solve -11w - 684 = -629 for w. -5 Solve 128d = -98d - 2486 for d. -11 Solve 49j - 138 + 2 = 403 for j. 11 Solve -20429a + 60 = -20424a for a. 12 Solve 28t + 9t = 6t - 496 for t. -16 Solve -15u - 15 = -0u + 90 for u. -7 Solve 650i = 359i - 502i - 4758 for i. -6 Solve 29s - 10s - 50 = 24s for s. -10 Solve 660 + 9296 = -801a - 1258 for a. -14 Solve -22 - 718 = 74a for a. -10 Solve 3480 - 564 = -112i + 4i for i. -27 Solve 7g - 70 = -7 for g. 9 Solve 333 = -a - 3a + 345 for a. 3 Solve -6t = 57t + 148t - 2743 for t. 13 Solve 26l + 36l + 390 = 23l for l. -10 Solve 43w - 35w - 333 = -29w for w. 9 Solve 385v + 515v + 234 = -666 for v. -1 Solve 469 - 417 + 1250 = 651f for f. 2 Solve 151 + 21 = 21r + 65r for r. 2 Solve 82c + 184 + 1203 = 321 for c. -13 Solve 1599 + 460 = 118s + 53 for s. 17 Solve 34p = 685 - 821 for p. -4 Solve 0 = -56p + 15155 - 14091 for p. 19 Solve 1332 = 78685h - 78648h for h. 36 Solve 104m + 22m = 630 for m. 5 Solve 141b + 525 + 363 = -155b for b. -3 Solve 85 = -24d + 178 + 75 for d. 7 Solve -923 - 709 = -136q for q. 12 Solve -205p = -441 + 199 - 168 for p. 2 Solve -85d + 20 = 840 + 115 for d. -11 Solve 9j + 2475 + 3609 = -329j for j. -18 Solve 87s - 2716 = -1324 for s. 16 Solve 257i = 232i + 350 for i. 14 Solve -213 + 171 = -61n - 896 for n. -14 Solve -4 + 40 = -4l - 8 for l. -11 Solve -11y - 7y - 56y + 1036 = 0 for y. 14 Solve -8r - 9r = 4r - 483 for r. 23 Solve -15a = 9a - 30a + 54 for a. 9 Solve -157 - 72 + 54 = -25h for h. 7 Solve 409v = 5156 - 1475 for v. 9 Solve -151x = -1415 + 2170 for x. -5 Solve 14j - 155j + 55 - 1747 = 0 for j. -12 Solve 0 = 285u - 299u + 112 for u. 8 Solve -43 = -85j + 588 - 36 for j. 7 Solve -34f = -38f + 98f + 1598 for f. -17 Solve -3294f + 3348f - 918 = 0 for f. 17 Solve 787 - 238 = 295f - 336 for f. 3 Solve -117r + 3436 + 4132 = 571r for r. 11 Solve 1046t + 400 = 1071t for t. 16 Solve 252d - 26d - 2320 = 618 for d. 13 Solve -110w - 47 = -9w - 350 for w. 3 Solve -86f + 189 = 2608 + 505 for f. -34 Solve 222 - 18 = 10f + 41f for f. 4 Solve -53q + 326 = 61 for q. 5 Solve 861h - 264h + 17336 - 1814 = 0 for h. -26 Solve -481 = -56t + 135 for t. 11 Solve 98 - 718 = -124i for i. 5 Solve 6a + 4a - 12 = 9a for a. 12 Solve -6644 + 2462 = -29j + 152j for j. -34 Solve 1408 + 1824 = 152v - 112 for v. 22 Solve 100f - 75f + 175f - 1600 = 0 for f. 8 Solve 0 = 388u - 148u - 2709 - 1611 for u. 18 Solve 0 = 1693s - 1692s + 1 - 2 for s. 1 Solve 17 = -77d + 56 + 38 for d. 1 Solve 0 = -31o - 42926 + 43081 for o. 5 Solve -198 = -57v + 11v - 888 for v. -15 Solve -358w + 543w + 1681 = -1649 for w. -18 Solve 1383 - 1437 = 18m for m. -3 Solve -7i + 3i = 15i - 95 for i. 5 Solve 45k + 8177 - 7322 = 0 for k. -19 Solve -259o + 267o + 200 - 80 = 0 for o. -15 Solve 35w = -14w - 33 - 16 for w. -1 Solve 78g = -70g - 1679 - 689 for g. -16 Solve 20g - 1725 = -70g - 555 for g. 13 Solve -184m = 784 - 784 for m. 0 Solve 4 = 2a - 8 - 2 for a. 7 Solve 56k - 42k + 424 = -92k for k. -4 Solve -80v = -1590 - 1130 for v. 34 Solve 30h + 1301 = 911 for h. -13 Solve 581l - 3472 = -12768 for l. -16 Solve -67s + 15s = -3s + 490 for s. -10 Solve 27858v = 27856v + 8 - 44 for v. -18 Solve 16w + 31w + 4w = -357 for w. -7 Solve 68527 - 71038 = 81u for u. -31 Solve -377j - 3240 = 28j for j. -8 Solve 26t = 43t + 53t - 560 for t. 8 Solve 8i + 250 = 418 - 256 for i. -11 Solve 49243u - 49289u = -874 for u. 19 Solve -21 = 2t + 1 for t. -11 Solve 70d + 82 + 198 = 0 for d. -4 Solve 0 = 2244c - 2266c + 66 for c. 3 Solve 0 = 3i - 14014 + 14038 for i. -8 Solve 8d = 29d + 14 - 56 for d. 2 Solve 127o = -198o - 3250 for o. -10 Solve 0 = 10p + 3p + 428 - 597 for p. 13 Solve 2180 - 1820 - 8725 = -239t for t. 35 Solve -20p + 111335 = 111475 for p. -7 Solve 358d - 241d + 332d - 15266 = 0 for d. 34 Solve -2o - 269 = -269 for o. 0 Solve -387y = 62y - 10327 for y. 23 Solve -90o - 33 = 57 for o. -1 Solve 0 = -338o + 170o + 133o + 595 for o. 17 Solve -3k + 69 - 138 + 72 = 0 for k. 1 Solve -13336s + 13338s + 72 = 0 for s. -36 Solve -172j - 619 = -2511 for j. 11 Solve 43j - 511 = -j + 545 for j. 24 Solve 179h + 92 + 118 = 214h for h. 6 Solve -1927 = -18t - 1765 for t. 9 Solve -21p - 69 - 36 = 0 for p. -5 Solve -120u + 474 = -246 for u. 6 Solve 148c + 310 = -277c + 115c for c. -1 Solve 0 = -664v - 11008 - 15043 + 8787 for v. -26 Solve -453z - 249 = -425z + 31 for z. -10 Solve 83w - 81 - 6 = -4w for w. 1 Solve -1065 = -41b - 104b - 50 for b. 7 Solve 5476 = -4c - 10c + 5714 for c. 17 Solve 111k + 71k = 1092 for k. 6 Solve 524v - 280v - 1178 = 282v for v. -31 Solve 22d - 319 = -187 for d. 6 Solve -9i + 225 + 315 = -63i for i. -10 Solve 1420q = 19864 + 2856 for q. 16 Solve 30k + 34k - 71k = -112 for k. 16 Solve 76s + 32s + 680 = 68s for s. -17 Solve -3h + 55 = 9h - 113 for h. 14 Solve 48 = 78d - 30 for d. 1 Solve -135z - 324 = -1404 for z. 8 Solve 122 + 218 = -132r - 452 for r. -6 Solve 277k = 997 + 279 + 109 for k. 5 Solve m + 15m - 594 = -38m for m. 11 Solve 10o + 156 = -7o - 9o for o. -6 Solve 38f - 281 = 61 for f. 9 Solve 1658j - 315 = 1625j + 312 for j. 19 Solve -201s = -50s - 1208 for s. 8 Solve -276 = 62u - 85u for u. 12 Solve 17t - 14t = 12t - 36 for t. 4 Solve -90g - 629 + 772 = 953 for g. -9 Solve -17346d = -17434d - 88 for d. -1 Solve -347z + 498z + 855z = 0 for z. 0 Solve 261w + 24 = 269w - 16 for w. 5 Solve 4999z - 4991z - 80 = 0 for z. 10 Solve -3101 + 3530 = 39j for j. 11 Solve 0 = 50n + 16n + 54 - 1308 for n. 19 Solve 0 = -18u + 528 - 726 for u. -11 Solve 0 = 1063a - 821a - 6534 for a. 27 Solve 3761 - 9333 = 199n for n. -28 Solve 907a - 984a + 1155 = 0 for a. 15 Solve 13n + 0 = 117 for n. 9 Solve 3381 = -124w + 4497 for w. 9 Solve -256 = -j - 259 for j. -3 Solve 3u = 89285 - 89318 for u. -11 Solve -139s + 42s = 106s - 1827 for s. 9 Solve 4889k = 4892k - 57 for k. 19 Solve 152t - 451 + 67 = 528 for t. 6 Solve 11z - 8 + 19 + 55 = 0 for z. -6 Solve -20494p + 20417p = -1001 for p. 13 Solve -2012s + 2698 = -1870s for s. 19 Solve -185p - 813 = -628 for p. -1 Solve 4r - 9r + 4r + 10 = 0 for r. 10 Solve -43t - 5t + 1 = -47 for t. 1 Solve -7v + 2305 = 1095 + 1091 for v. 17 Solve -g + 1528 = -192g for g. -8 Solve 1652j = 1592j + 1140 for j. 19 Solve 16h - 29 - 155 = -7h for h. 8 Solve -10d - 59 = -3d - 3 for d. -8 Solve -5t + 720 = 27t + 88t for t. 6 Solve 37j - 998 = -480 for j. 14 Solve 342t + 1446 = 8970 for t. 22 Solve 197 = 26s + 42s - 143 for s. 5 Solve 90t + 984 = 32t - 24t for t. -12 Solve 4g - 22 + 7 = -59 for g. -11 Solve p - 2373 = 353*p	{ "pile_set_name": "DM Mathematics" }
6m(t). Let x(y) = -y3 - 4y*2 - 5y - 4. Let g be x(-3). Determine h(g). -2 Let c(z) be the third derivative of 0z + 1/6z*3 + 1/120z*6 + 0 - 1/6z*4 - 27z*2 + 1/60z*5. What is c(-3)? -5 Let m(x) be the second derivative of 2/3x*3 + 4x - 1/12x4 + 0 - 2x*2. What is m(3)? -1 Let w = 2 + -3. Let b(v) = -186v - 6v3 + 8v3 + v2 + 18v3 + v2 + 187v. What is b(w)? -19 Let d(v) be the third derivative of -v*6/120 - 2v*5/15 - 7v*4/24 - 4v*3/3 - 7v*2. Suppose 16m + 74 = -38. Determine d(m). -8 Suppose 9 = 3d, 5t = 2d - 3d - 22. Let b(s) = -15s. Let z(v) = 5v + 7v - 4v. Let w(q) = 6b(q) + 11z(q). Give w(t). 10 Let f(n) = -n*2 - 7n + 6. Let c be f(-7). Let u(j) = -5 + j*2 + 4j - cj + 5j. Suppose 3r + 16 = -r. Calculate u(r). -1 Let w be 3-2 - (51/(-17) - -1 - 4). Let l = -2 + 2. Let h(v) = l + 7 + v + 0. Calculate h(w). 7 Let j be 0/2 + -4 + (-42)/(-2). Let v(w) = 10w + 1 - jw + 6w + 3. Give v(5). -1 Let g(b) be the third derivative of b4/8 + b3 + 345b*2. Suppose 0 = 5h + 2r + 29 + 1, -r - 17 = 3h. What is g(h)? -6 Let i(u) = u*3 - 6u*2 + 4u + 1. Suppose -n + 15 = 3y + 1, 0 = -2y - 2n + 12. Give i(y). -15 Let z(k) be the third derivative of -k6/360 - k5/120 - k3/2 + 22k*2. Let a(q) be the first derivative of z(q). What is a(0)? 0 Let o be ((-3)/(-7) - 1)/(22/(-77)). Let n(z) = 5z - 1. What is n(o)? 9 Let v(x) = -x - 4. Suppose 3h + 0h - 4u - 28 = 0, 0 = 5h - 4u - 60. Suppose p = 5p - h. Suppose 0 = -pn - 3i - 17, -3n + 0n = -4i + 19. Give v(n). 1 Let m(x) = -6x - 2. Let r(i) = -2i3 - 31i*2 + 14i - 31. Let y be r(-16). Give m(y). -8 Let l(u) = -3u2 + 7u - 1. Let v(p) = 6p - 1 - 3p - 5p2 + 8p + 0p. Let j(k) = -8l(k) + 5v(k). Give j(3). -9 Let t(r) be the first derivative of -r4/4 - 4r*3/3 + 3r*2/2 + 6r - 128. Give t(-5). 16 Let o be (-2 + 1)-29/6. Let z = o - -2. Let a(j) = j*3 - 4j*2 - 7j - 2. What is a(z)? -12 Let c(h) = 6h + 3 + h3 - 8h + 1. Calculate c(0). 4 Let k(i) = 4i + 27. Suppose 0 = 2v + 4a + 34, -5a = 4v + 14 + 39. Let n be k(v). Let b(q) = -4q3 - q2. Determine b(n). 3 Suppose r = -3g + 3r - 21, -2r + 1 = g. Let w(t) = -5. Let x(k) = k - 24. Let d(f) = 11w(f) - 2x(f). Give d(g). 3 Let l(i) = -i - 3 + 4i - 4i. Suppose 0 = a - m - 7, 0 = 3a + 5m - 4 - 9. What is l(a)? -9 Let s(k) = 9k + 3. Let q(r) = -r*2 - r - 2. Let y(v) = -q(v) + s(v). Give y(-6). -19 Let o(p) = -2p3 + p2 + 2p - 1. Suppose -5d = -5k, 2d - 2 = 2k - 2d. Let y(j) = 2j3. Let c be y(k). Calculate o(c). -9 Suppose -5t = -2t. Suppose t = -5o - 0o + 10. Let i(r) = 2r + r + 2r2 - r3 - 3r2 - 3. Determine i(o). -9 Let l be (4/(-6))/(2/(-3)). Let q(g) be the first derivative of -g4/2 - g3/3 + g2 - g - 94. Determine q(l). -2 Let m(q) = q*2 + 4q. Let v = 0 - -3. Suppose 0 = 2l + 9 + v. Determine m(l). 12 Suppose -3g = -4h + 20, 0 = -4h + 11g - 7g + 16. Let q(t) = 4t + 1. What is q(h)? 33 Let h(l) = 10l + 9684 - 4838 - l*2 - 4819. Determine h(13). -12 Let d = 47 + -45. Let g(a) = 0 + 712a - 715a + 3 + a3 + 4a*d. Give g(-5). -7 Let b(u) = -2u*2 + 16u + 310. Let j be b(-9). Let o(p) = 10p - 5. Give o(j). 35 Suppose w - 10 = -w. Let l = w + -4. Let n(a) = -l + a + 0a + 2 + a. Give n(-2). -3 Let n(l) = -1. Let f(g) = -g*3 - 2g + 5. Let h(j) = -f(j) - 6n(j). Determine h(0). 1 Let z(x) = -4 - 519x*2 + 518x*2 + 5. Determine z(1). 0 Suppose 5f - 8f = 2n + 7, -3n = -4f + 36. Let k(t) = -t*2 - 7t + 3. Calculate k(n). -5 Let q(o) = -o*2 + o + 1. Suppose 55 + 77 = -4i. Let g = i + 34. Let x(w) = -w + 2. Let l(j) = gq(j) - x(j). Give l(2). -1 Let t(d) = -d - 5. Suppose 0 = -5w + 3a, -4w + 8 = -0a - 4a. Let l be ((-2)/(-1) + w)5. Calculate t(l). 0 Let x(n) = 4n - 2. Let q(w) = -10w + 308. Let v be q(31). What is x(v)? -10 Let m be (-6)/(-9)(25/(-2) + 5). Let z(w) be the second derivative of w*5/20 + 5w4/12 + w3/6 + 3w2/2 + 4w. Calculate z(m). -2 Let d = -966 + 972. Let z(j) = -2j + 20. What is z(d)? 8 Let j(o) = -7o*2 - 19o - 1. Let n(r) = 14r2 + 45r + 3. Let x(f) = 7j(f) + 3n(f). Determine x(2). -22 Let a(n) be the second derivative of 13n3/6 + 3n*2/2 + 10n. Let r(z) = 220z + 50. Let d(h) = -50a(h) + 3r(h). Calculate d(2). 20 Suppose 2z - 4 = -12. Let x be (-1)/((-9)/6 - -1). Let a(q) = 4q + 4q*3 + 2 - 11q*2 - 3q*3 - 2q*3 + 8qx. Give a(z). 2 Let v(b) = b2 + 3b + 2. Let t = 59 - 64. Calculate v(t). 12 Suppose -46a + 16 = -30a. Let c(s) = -55s. Give c(a). -55 Let m = -682 - -674. Let v(h) = -h - 1. Let b(l) = -2l + 3. Let s(w) = -b(w) + 5v(w). Give s(m). 16 Suppose 4r - 46 = -38. Let v(p) = -p + 2p + 3p2 - 6p*2 + rp. What is v(2)? -6 Suppose -7 + 37 = 2j. Let o(u) = 4u - u - 19 + j. Determine o(-3). -13 Let p(k) = 5k3 + 6k*2 - 4k - 1. Let f(v) = -v3 - v2 + v. Let d(r) = 11f(r) + 2p(r). Let w be -2(1 + (-15)/6). Determine d(w). -11 Let p(a) = -13a + 4. Let o(k) = -26k + 8. Let x(i) = 3o(i) - 5p(i). Determine x(2). -22 Let f(y) be the third derivative of y6/20 - y5/30 + y4/24 - y2. Let d be 3/15 - (-3)/(-15). Suppose dc - 5c + 8 = 3w, 4c = 4. What is f(w)? 5 Let h(w) = 5w*2 - w - 2. Let t be 2((-4)/(-2) - 1). Suppose 3p = -4d - t, p + d - 6 = 3d. Calculate h(p). 16 Suppose 60 = -9q - q. Let u(t) = t*3 + 6t*2 + 5t + 2. Let h be u(-5). Let x(i) = 2ih - 6 - 9i + i - 3i2. Determine x(q). 6 Let n = -11 + 16. Suppose -18w = -13w - 20. Let h be n(-3)/(-12)w. Let z(y) = y3 - 6y*2 + 5y - 6. Determine z(h). -6 Let n(g) = g - 1. Let a(q) = -4q + 50. Let s be a(11). Calculate n(s). 5 Let a(x) = -13 - 3 + 7x*2 - 2x + 1 + 13. Calculate a(-1). 7 Let j(f) = 2f + 6. Let a(b) = 15b + 13. Let s(n) = 2n. Let k(w) = -a(w) + 6s(w). Let z(p) = -5j(p) - 3k(p). Calculate z(10). -1 Suppose s = -65s + 132. Let h(k) be the third derivative of -7k*s + 0 + 0k - 1/24k4 + 7/6k*3. Calculate h(5). 2 Let v(z) be the first derivative of -2z*2 - 4z + 291. Give v(6). -28 Let s(w) = -6w - 1. Let c = 12 + -11. Calculate s(c). -7 Let a(l) = -l3 + 6l*2 + 4l + 9. Let d(o) = -4o3 + 17o*2 + 12o + 27. Let x(c) = 7a(c) - 2d(c). What is x(-7)? 30 Let w(b) = -2b3 + 5b*2 - 3b + 2. Suppose 10t + 64 - 224 = 0. Let o = -29 - -16. Let x = o + t. Calculate w(x). -16 Let c(m) = -1 - 61m - 59m - 59m + 204m. Give c(-1). -26 Let a be (-4)/(-14) + 69/(-21). Let c(p) = p2 + 5. What is c(a)? 14 Let u(r) = 17r - 69. Let c be u(4). Let x(f) = -19f2 + f. Calculate x(c). -20 Let b(u) = 2u*2 + 4u - 13. Let j be b(2). Let f(a) = -3a2 + 1. Let x(z) = z2 - z. Let g(p) = f(p) + 4x(p). Calculate g(j). -2 Let q = 33 + -30. Let t(p) = 39p + 45p - 1 + p*q - 77p - 6p2. What is t(5)? 9 Suppose -23m - 15 = -38. Let a(j) = -29j + 1. Determine a(m). -28 Let v(o) = -o2 + 25o - 50. Let l be v(23). Let f(j) = -3j - 8. Calculate f(l). 4 Let l(y) = -70y + 58y - 6 + 9y + 2. Let i(h) = -h*2 - 3h + 1. Let o be i(-4). Give l(o). 5 Suppose -38l + 54 = -35l. Let o(v) = -lv + v + 11v. Calculate o(-1). 6 Let x(g) = g*3 - 11g*2 + 11g - 13. Let q(j) = 35j - 585. Let n be q(17). Calculate x(n). -3 Suppose 3c = -4 - 5. Let p = -1 - c. Suppose -3 = -3k - 5z, -pz + 3z = -2k - 5. Let x(m) = -m3 - 3m*2 + 3m - 2. Determine x(k). 2 Let t(k) be the third derivative of -k6/120 - k5/12 + k*4/12 + 5k3/3 + k2 - 108. Calculate t(-5). 0 Let a = 818/3 + -272. Let p(l) be the second derivative of al3 - 6l + 5/2l2 - 1/12l*4 + 0. Determine p(5). 0 Let l(q) = 4q*3 - 20q*2 + 19q - 1. Let y(j) = -7j3 + 39j*2 - 37j + 2. Let b(r) = -5l(r) - 3y(r). What is b(16)? -1 Let s(f) = 2f2 - 3f + 1. Let p = 20 + -22. Let z be (-4 + 5)p/(-1). Determine s(z). 3 Suppose 4o + 40 = -5p, 2o = -3o + p - 21. Let s(b) = b2 + 5b + 3. What is s(o)? 3 Let k = -1 + 5. Let c(s) = 91s2 + s3 + 2 + 3 - 4s - 93s2 - 7. Calculate c(k). 14 Let l(p) = -20p + 29p - 3p2 + 7 - p3 - p3 + p3. What is l(-5)? 12 Let u = 19 + -10. Let v(s) = -u + s + 5 + 0. What is v(4)? 0 Let d(p) = -14p2 + 58p - 5. Let s be d(4). Let r(f) = 2*f. Calculate r(s).	{ "pile_set_name": "DM Mathematics" }
. Is (-8)/((-1)/2 - -2)m a multiple of 9? False Let b(s) = -s - 142. Let c(v) = -2v - 284. Let f(q) = 11b(q) - 6c(q). Let d be f(0). Suppose -3u + d = -5a, -u + 2a + 205 = 4u. Is 13 a factor of u? True Let j(v) = 2v3 - 14v + 22. Is 2 a factor of j(4)? True Suppose -602 = -10d - 4d. Is 6 a factor of d? False Let r = -507 + 1459. Does 68 divide r? True Let c = -10 - -12. Suppose 0 = cf - 8. Let i(a) = 10a + 1. Does 24 divide i(f)? False Let s(u) = -5u - 8. Let i(d) = 11d + 17. Let b(c) = -6i(c) - 13s(c). Let y be b(-4). Suppose -v + j - 103 = -yv, 3j = -3v + 57. Does 7 divide v? True Suppose 0z + 3d = 2z + 8, 3z - 3d + 6 = 0. Suppose 0 = -6n + zn + 64. Suppose -23 - n = -k. Is 13 a factor of k? True Suppose -3r + 573 = -216. Let g = r + -104. Is g a multiple of 29? False Let t be 2946/10 - (-4 + (-90)/(-25)). Suppose -3u - t = -8u + 3h, u - 4h = 76. Is 9 a factor of u? False Suppose -4g - 163 = 4l + l, -27 = g + 4l. Let d = g - -87. Does 20 divide d? True Suppose 2 - 4 = -l. Suppose -3g - l = -8. Suppose -gt - 2t + 4s = -144, 0 = -5t + 3s + 174. Does 14 divide t? False Suppose 343 = -8w - 353. Let x = w + 135. Suppose 8u - 6u - x = 0. Is u a multiple of 12? True Let p(s) = -291s - 10 + 0 - 159s. Let z be p(7). Is 24 a factor of z/(-44) + 4/22? True Suppose 8z = 174 + 4386. Is z a multiple of 10? True Let a(b) = -b*3 - 7b*2 - 6b + 1. Let l be a(-6). Let c be 0/4 - (l - -1). Is 32 a factor of ((-1)/c)/((-1)/(-66))? False Let p = 841 + -380. Does 10 divide p? False Let o = -458 + 809. Is 39 a factor of o? True Let t be 15 + -5 + 3/3. Suppose 0c + tc = 1694. Is 11 a factor of c? True Let g(d) = 541d3 - d2 + 7d - 5. Is g(1) a multiple of 6? False Is 3 a factor of 3/(4/(2472/18))? False Suppose b + 17 = 4c, 7c = 3c + 5b + 21. Suppose 20 = -3t + 2n + 6, cn = 16. Is 5 a factor of 10/2(-10)/t? True Suppose -2k + 3 = -3. Suppose 0 = s + 3z + 27, -z + k = 8. Let d = -9 - s. Is d even? False Let b(n) = 4n3 - 3n*2 - 2n - 1. Let x(z) be the first derivative of -z*3/3 + 3z*2 + 10z + 12. Let j be x(7). Does 29 divide b(j)? False Suppose 2j - 3u - 13 = -2u, 27 = 3j - 3u. Let w = 79 - 77. Suppose 0 = jr + z - wz - 62, -4r + 2z + 60 = 0. Is 11 a factor of r? False Let f = -162 + 290. Let o = 198 - f. Is o a multiple of 18? False Suppose 14 = 5z - 6. Suppose -zg = -2k - 5g + 130, -4k + 240 = -3g. Is k a multiple of 21? True Let o(i) = -401i - 1. Let p be o(-1). Suppose 2d - b + 163 = 0, -3d - p = 2d + 5b. Is (-9)/(d/(-30) + -3) a multiple of 8? False Let h(q) = -q*3 - 12q*2 - 11q - 8. Let z be h(-9). Let m be z/32 + 2/(-8). Is 21 a factor of (m - 16)/(1/(-2))? True Suppose -436f = -399f - 11803. Does 2 divide f? False Let m = -3845 + 7853. Is 12 a factor of m? True Suppose -r + 2z - 6z = -17, 2r + 2 = z. Let q(m) = 37m - 1. Does 12 divide q(r)? True Let r = -92 - -240. Suppose 4k - 5c = -2c + r, 5c = -3k + 82. Is k a multiple of 3? False Suppose -6 = m - 2m. Let w(p) = 5p + 4 - 4p - 3 + m. Is 13 a factor of w(6)? True Is 77 a factor of ((-301)/172)/(2/(-4576))? True Suppose 3k + o - 1382 = 0, -k + 0k - 4o = -446. Is 21 a factor of (2 - k)/(-4) - -4? False Let x(p) = 2p*3 + 59p*2 - 42p - 70. Is x(-29) a multiple of 51? True Suppose -4325 = -163r + 158r. Is r a multiple of 9? False Let z be (0 + -3)/(-3) + 2. Suppose -5q + 64 = zp - p, -p = -2q - 23. Suppose -2s + 3v - 5 = -s, 2v = 5s - p. Does 2 divide s? False Let w = 426 - 397. Is w a multiple of 15? False Let v(q) = 2q + 32. Let i be v(-14). Suppose 0 = -0h + ih - 544. Is 34 a factor of h? True Suppose a - 1 = 3n, 4n + 8 = -2a - 10. Let r = 3 + a. Does 8 divide -6r/((-24)/(-76))? False Suppose 2 + 2 = 2b. Let n = 24 - 22. Suppose -5t = -r - 287, bt + nt - 4r = 236. Does 13 divide t? False Suppose -5f = -3b + 512, 11 - 91 = f + 5b. Let n = 142 + f. Is n a multiple of 21? True Let h = -657 + 1167. Is 7 a factor of h? False Let m(o) = -o. Let x be m(10). Let s = x - -10. Suppose 2d + z = 5d - 156, -5d - 3z + 246 = s. Is 17 a factor of d? True Suppose -2c + 3c - 6 = 0. Suppose -ck = -10k. Suppose 5r + 0r - 90 = k. Is 9 a factor of r? True Let p = 105 + -60. Suppose 7h - 6h = p. Is h a multiple of 9? True Let p = 54 - 49. Let k(z) = -z*3 + 5z*2 + 6z + 3. Does 5 divide k(p)? False Does 24 divide 801/12112/84? False Suppose 75 = m - 2n, 73 = m - 5n + 7. Is m a multiple of 9? True Let k = -97 + 100. Suppose km + 13m = 896. Is m a multiple of 17? False Let b(c) = -2c*3 - 6c*2 - 6c. Is 28 a factor of b(-4)? True Let u = -11 + -69. Is ((-7)/4)/(2/u) a multiple of 10? True Let c = 70 - -217. Does 10 divide c? False Is 33 a factor of ((-2)/3 - 0)10467/(-6)? False Is 5 a factor of 7960/11 + 476/1309? False Let n(t) = -t3 - t2 - 7t - 8. Is n(-8) a multiple of 16? True Is (198/12)/((-6)/(-12)) a multiple of 17? False Suppose -2w - 2w = 40. Let j = 51 - w. Suppose 0 = 3g - j - 53. Does 12 divide g? False Let v(o) = o + 18o - 8o - 36 + 14. Is v(5) a multiple of 3? True Let t = 41 - -1. Does 3 divide t? True Suppose 4r + 4k - 1913 - 215 = 0, 0 = 2r - 5k - 1029. Suppose -4f + r + 537 = 0. Does 34 divide f? False Let l(d) = d*2 - 3d - 164. Is l(-14) a multiple of 2? True Suppose 0 = 5w - w. Suppose -5u - 3z = -wu - 370, 25 = -5z. Is u a multiple of 11? True Let r(m) = -m3 + 4m*2 + 5m + 3. Let t be r(5). Suppose -4n + 4 = -tn. Suppose 0k - 84 = -nk. Does 10 divide k? False Let a = -11 + 12. Does 11 divide (9/(-18))/(a/(-132))? True Suppose 3v - 5x = 13 - 5, -10 = -5x. Suppose -415 = -vu + u. Suppose -u - 67 = -5f. Does 10 divide f? True Suppose -14s = -2596 - 1828. Is s a multiple of 4? True Suppose 0 = -11n + 14n + 195. Let x = n + 91. Is 14 a factor of x? False Let f(v) = 314v2 - v. Let d be f(1). Let j be d - (4 + -2 + -3). Suppose -2b + 192 = 4a, -j = -3b + 3a - 44. Is b a multiple of 22? False Let v = 2060 + -1079. Does 122 divide v? False Let v(f) = f2 + 6f - 2. Let g be v(-7). Suppose gw + 35 + 195 = -5z, -4w = -z + 169. Does 17 divide (w/(-2))/(1/2)? False Let a be ((1 - 0)1)/(9/(-1827)). Let x = a - -379. Does 25 divide x? False Suppose 0 = 53d - 2939 - 44125. Does 10 divide d? False Let r = 54 - 38. Suppose 15h + 27 = rh. Is h a multiple of 7? False Is 286 + -13 + 2 + -8 even? False Suppose -2 = -i + 8. Let l(b) = -b + 12. Let s be l(i). Suppose -31 = -4m - 5p + 103, -sm = -2p - 76. Is m a multiple of 9? True Suppose -5t = -2280 - 430. Is 9 a factor of t? False Let b(u) = -u + 1. Let f be b(1). Suppose -4v = -2z - fz + 12, 2z + 2v = 6. Suppose -2g + 3i = -216, -214 - 218 = -4g + zi. Is 12 a factor of g? True Let m = 134 + -116. Does 35 divide (-2)/(-12) - (-1257)/m? True Suppose 5q = 7q. Suppose -4m = -5f - 298, -3m + qf + 2f = -220. Is m a multiple of 13? False Let d(z) = -z*3 + 7z*2 + z + 2. Let b be d(7). Let l(o) = 2o*2 - 9o + 6. Does 31 divide l(b)? False Let l(n) = -106n - 215. Is 9 a factor of l(-5)? True Let l = 45 - 47. Does 13 divide ((-2)/(4 - l))/((-1)/327)? False Suppose -6f + 103 = -107. Is 7 a factor of f? True Let u = -4 - -14. Let j(p) = p*3 + 7p*2 - p - 6. Let i be j(-4). Let v = u + i. Is 18 a factor of v? False Suppose -a + 1 = -0b + 3b, 5b + 4 = 4a. Let p = 3 + b. Suppose 5m - m = -pr + 26, 3r = -3m + 27. Is 5 a factor of r? True Let z be ((-8)/24)/(2/(-12)). Suppose 0 = zp - 2 - 2, 0 = -4b + 4p + 256. Is 30 a factor of b? False Let i be 2/2 - -5 - 3. Suppose -313 = -2n + ix + 4, 0 = n - 2x - 160. Is n a multiple of 22? True Suppose 7 = -3r - 2. Does 10 divide -1 + 49 + 12/r? False Let t be 18/(-12) - (-6)/4. Let s be 4 + 1 - t - 2. Suppose -u + 4u + 3g - 27 = 0, 0 = -sg - 15. Is 11 a factor of u? False Let d(h) = h3 - 10h*2 + 4h - 15. Let f be d(10). Suppose z + g = -18, -f = z - 4g + 18. Let w = 35 + z. Is w a multiple of 6? True Suppose -108 = -3l - l. Suppose 4h + h + 85 = 0. Let o = l + h. Is 5 a factor of o? True Let m(k) = 232k + 32. Is m(6) a multiple of 49? False Suppose 0 = -4k + 2j + 16, -3j - 20 = -4k. Is k even? True Let r = 2 - 0. Suppose 2b = 4 + r. Suppose i - 212 = -bi. Is i a multiple of	{ "pile_set_name": "DM Mathematics" }
y - 3 Let g(a) = 1. Suppose 25 = 5s, 4v - s = 3v - 6. Let o(b) be the second derivative of -b*3/3 - 4b*2 + 7b. Let f = 47 + -55. Calculate fg(u) + vo(u). 2u Let g(r) = -6r*3 - 3r*2 + 2r - 3. Let v(o) = -15 - 5o2 + 51 - 21 + o - 13o*3 - 20 + 3o. Give 5g(z) - 3v(z). 9z3 - 2z Suppose -10d = 140 - 190. Let s(n) = 2n + 5. Let v(u) = -3u - 9. Determine ds(o) + 3v(o). o - 2 Let c(n) = -2n*2 + 9n + 42. Let k(q) = -q*2 + 4q + 21. What is 3c(m) - 7k(m)? m*2 - m - 21 Let p(m) = -2m*3 - 5m*2 - 4m + 4. Let o(b) be the second derivative of b5/10 + b4/2 + 5b3/6 - 5b*2/2 - 89b - 3. Calculate 4o(r) + 5p(r). -2r3 - r2 Let z(x) = x3 + 2x*2 + 2x. Let m(k) = 2k3 + 5k*2 + 5k. Suppose -1 - 7 = -w - d, d + 2 = w. Give wz(y) - 2m(y). y*3 Let p(d) = 17d*3 - 11d*2 - 7d. Let v(f) = 9f3 - 6f*2 - 4f. Let l be (2/8)/(((-81)/(-252))/9). Calculate lv(t) - 4p(t). -5t3 + 2t*2 Let p(x) = -15x + 3. Let r(c) = c. Calculate p(k) - 5r(k). -20k + 3 Let t(b) = -11b - 2. Let a be 5/1 - (-2 + 0). Let q(f) = 79 - 80 - af + 0f. Calculate 8q(g) - 5t(g). -g + 2 Let q(d) = -d2 + 8d - 3. Let m be q(4). Let c(b) = 15b2 + 9b + 9. Let r(a) = -7a2 - 4a - 4. Give mr(t) + 6c(t). -t*2 + 2t + 2 Let q(b) = -b*2 - b + 1. Let o(v) be the third derivative of 0 - 1/6v*4 + 8v*2 + 1/2v*3 + 0v - 1/15v5. Determine -o(c) + 5q(c). -c*2 - c + 2 Let a(x) = 16x*3 + 10x2 - x - 2. Let s(q) = q3 - q*2 + q - 2. Determine a(y) - s(y). 15y*3 + 11y*2 - 2y Let v(w) = 2w2 - 3w + 2. Suppose 8z + 15 = 3z. Suppose 70 = -6u - 8u. Let g(k) = -3k2 + 5k - 4. Give uv(l) + zg(l). -l2 + 2 Let i(f) = -1 - f - f2 + 0 + 0. Let c(k) = -9k2 - 5k - 5. Suppose 11h - 1 = 10. Calculate hc(l) - 5i(l). -4l*2 Let n(w) = -9w*2 + 19w + 2. Let o(y) = 5y2 - 10y - 1. Let a = -324 - -327. What is an(t) + 5o(t)? -2t2 + 7t + 1 Let m(b) = -38b + 8. Let u(h) = 17h - 4. Give 3m(a) + 5u(a). -29a + 4 Let b(s) = -11s - 4 + s + 22s - 11s. Let x(v) = 2v - 8. What is 11b(y) - 6x(y)? -y + 4 Let g(f) = 3204f + 108. Let q(b) = 149b + 5. Calculate -5g(s) + 108q(s). 72s Let i(b) = b + 1. Let o(y) = -2 + 6y + 0 - 9y. Let h(v) = v + 4. Let t be h(0). Give ti(p) + 2o(p). -2p Let b(g) = g2 + g - 1. Let d(k) = -4k2 + k2 + 4k2 + 4k + 6k2 - 8 + k2. Let o be (0 - 1)(0 - 1). Give od(c) - 6b(c). 2c2 - 2c - 2 Let i = 505 - 501. Suppose -5o + 4 = -11. Let v(z) = 5z*2 - 2 - 11z*o + 9z + 0z2 + 4. Let l(k) = 5k*3 - 2k*2 - 4k - 1. Give iv(a) + 9l(a). a*3 + 2a*2 - 1 Let s(g) = -5g*2 - 12g + 19. Let y(q) = -3q2 - 5q + 10. What is 2s(h) - 5y(h)? 5h2 + h - 12 Suppose -2x - 1 = -5. Suppose -3 + 1 = -xu, 4b + 37 = u. Let k(c) = -5c + 3. Let n(w) = -20 - 22 - 2w - 27 + 86 - 16. Determine bn(v) + 4k(v). -2v + 3 Let b(k) = 13k - 2k + 13627k*2 + 2 - 2 - 13630k*2. Let w(r) = -2r*2 + 6r. Let g = -15 - -9. Determine gb(t) + 11w(t). -4t2 Let s(x) = 9x*3 + 15x - 3. Let d(j) = -5j3 - 8j + 2. Let o be ((-9)/27)/(4/72). Give os(a) - 11d(a). a*3 - 2a - 4 Let u(k) be the first derivative of -2k3/3 + 7k*2 - 2k - 544. Let b(d) = 3d2 - 14d + 2. Determine 4b(q) + 5u(q). 2q2 + 14q - 2 Suppose f - 9 = 3f - 5z, -f = 5z - 33. Let p(j) = 4j*2 + 9j - 4. Suppose -47 + 12 = -7n. Let w(h) = -6h*2 - 14h + 6. Give fp(c) + nw(c). 2c2 + 2c - 2 Let z(f) = -5f2 + 9f - 11. Let m(x) = -2x2 + 4x - 5. Suppose 2v + 3i + 30 = 0, -15 + 68 = -5v - 2i. Determine vm(r) + 4z(r). -2r2 + 1 Let k(c) = -94c*2 + 181c*2 - 86c*2. Let r(y) = -6y*2 + 2y. Suppose 4u = -5h - 7 - 9, -3u = 2h + 5. Determine ur(f) + 4k(f). -2f2 + 2f Let m be (-3120)/336 - (-2)/7. Let p(d) = 4d2 + 9d - 11. Let v(z) = z*2 + 2z - 3. Calculate mv(l) + 2p(l). -l*2 + 5 Let n(v) = 0 + 2 + 0v + 4v + 2v. Let m(g) = 17g + 6. Let r(x) = -x2 - 25x - 42. Let w be r(-23). What is wm(f) - 11n(f)? 2f + 2 Let a(t) = t2 - t + 1. Let o(n) = -6n*2 + 5n - 5. Calculate 4a(x) + o(x). -2x*2 + x - 1 Let r(x) be the second derivative of -2x*2 + 0 + 3x + 0x3 + 1/4x4. Let s(m) = -m3 - m*2 + 1. Let t = -6 - -5. Calculate tr(q) - 2s(q). 2q3 - q2 + 2 Let c(a) = -2a. Let d(v) = -189v + 2. Calculate 2c(q) + d(q). -193q + 2 Let l(z) = -2z + 45. Let a be l(22). Let b(x) = -x3 - x - 1. Let o(n) = -2n*3 - 2n*2 - 3n - 3. Give ao(r) - 3b(r). r*3 - 2r*2 Let c(j) = -33j2 - j - 8. Let g(r) = -r2 - r - 2. Calculate -c(a) + 4g(a). 29a*2 - 3a Let r(f) = -16f2 + 4f - 411. Let v(h) = 9h2 - 2h + 206. Determine -4r(y) - 7v(y). y*2 - 2y + 202 Let f(q) = 2q - 4. Let a(v) be the first derivative of -v2 + 3v + 15. Determine 3a(n) + 2f(n). -2n + 1 Let x(o) = o2 - o. Let v(d) be the first derivative of d3 - 2d - 267. Calculate v(a) - 2x(a). a2 + 2a - 2 Let h(s) = -3. Let f(u) = 3u. Determine -3f(w) + h(w). -9w - 3 Let s(f) = 2f*3 + 7f*2 - 3f + 7. Let w(v) = v3 + v2 - v + 1. What is -s(y) + 4w(y)? 2y*3 - 3y*2 - y - 3 Let y(a) = 261a*3 - 5a - 5. Let j(v) = -784v3 + 16v + 16. Calculate 5j(p) + 16y(p). 256p3 Let y(x) = -81x + 108. Let f(j) = j + 2. Determine 54f(b) - y(b). 135b Let z(b) = -4b + 1. Let u(s) = s. Let w = 2661 + -2662. Determine wz(v) + 5u(v). 9v - 1 Let p(n) = -2n2 - 7n - 4. Let h(l) = 10l2 + 45l + 22. Let o(b) = -5b2 - 22b - 11. Let j(d) = -2h(d) - 5o(d). What is -4j(g) - 11p(g)? 2g2 - 3g Let t(b) = 3b + 2. Let l(d) be the third derivative of 7d*4/24 + 5d*3/6 - 42d*2. Let a(p) = 3l(p) - 5t(p). Let k(n) = 7n + 6. Give -5a(q) + 4k(q). -2q - 1 Let f(l) = 6l*3 - 4l*2. Let g(k) = 5k*3 - 3k*2. Let m be (300/8)/(9/12). Let r = 47 - m. Determine rf(o) + 4g(o). 2o*3 Suppose 0 = -5h + 31 - 1. Let n(a) = -8a + ha - 2 + 5a. Let d = 31 + -29. Let b(f) = -f. What is db(l) + n(l)? l - 2 Let h(k) = k - 1. Let v(q) = -2q + 4. Let d(c) = -3h(c) - v(c). Let y(w) = w*2 - 11w - 11. Calculate 22d(o) - 2y(o). -2o2 Let o(j) = 2j. Let t(v) = 14v + 10. Determine 6o(l) - t(l). -2l - 10 Let f(n) = -7n - 8. Suppose 0 = -16q - 51q - 737. Let s(c) = -13c - 15. Give qf(d) + 6s(d). -d - 2 Let l(t) = t3 - t2 + t. Let g(r) = -10r*3 + 7r*2 - 5r. Let w(p) = -p*2 + 11p + 307. Let y be w(24). Calculate yl(s) - g(s). 5s*3 - 2s2 Let v(w) be the third derivative of -w5/12 + w4/8 - w3/3 + w*2 + 168w. Let q(z) = -9z2 + 5z - 5. Calculate 3q(r) - 5v(r). -2r2 - 5 Let q(f) = -f3 - f2 - f. Let g be 2225/126 - (-6)/14. Let w(r) be the second derivative of -r*2 + 0 + 5r + 1/6rg + 2/3r*3. Determine -2q(l) - w(l). 2l3 - 2l + 2 Let s(a) = 5a2 + 167a - 1. Let k(i) = i*2 + 2i. Give 7k(z) - s(z). 2z*2 - 153z + 1 Let r(l) = l3 - l2 + l + 1. Let s(c) = -c*3 + 8c*2 + c. Determine r(y) - s(y). 2y*3 - 9y*2 + 1 Let p(m) = -9m*3 + 6m*2 + 6m + 2. Let s(y) = 19y3 - 14y*2 - 13y - 3. Determine -9p(u) - 4s(u). 5u3 + 2u*2 - 2u - 6 Let v be (-390)/(-42) + (-4)/14. Let o = -303 + 307. Let m(c) = -8 + 8 - 6c. Let r(u) = 3u. Determine om(z) + vr(z). 3z Let i(u) = -11u*2 + 6u + 11. Let m be 550/77 - 3/21. Let p(x) = -5x2 + 3x + 5. What is mp(t) - 3i(t)? -2t2 + 3t + 2 Let g = 19 + -14. Suppose gm = 3d + 30 + 2, -2m + 24 = -4d. Let s = 8 + -13. Let k(a) = -8a2 - 5a. Let o(c) = 7c2 + 4c. Calculate dk(f) + so(f). -3f2 Let r(f) = -4 - 16f*3 + 54f*3 - 20f*3 - f - 20f3. Let m(h) = -h3 - h - 3. Suppose 0p = -2p - 8. Give pm(s) + 3r(s). -2s3 + s Let q(g) = 5g - 72. Let k(x) = 29x - 359. Give -2k(m) + 11q(m). -3m - 74 Let u(q) = 3q3 + 4q*2 - 4q - 4. Let m(f) = 41 + 27f - 27f*2 - 11 - 7 - 21f*3 + 4. Determine 4m(p) + 27u(p). -3p3 Let w(o) = o3 + o*2 + o + 1. Let f(p) = -44p*3 - 29p*2 - 41p - 37. Let g(b) = -b*2 + 2b + 1. Let k(y) = f(y) + 4g(y). Determine -k(h) - 33w(h). 11h3 Let o(c) = -83c*3 + 3c + 6. Let n(w) = -167w3 + w2 + 5w + 10. Give -3n(p) + 5o(p). 86p3 - 3p*2 Let y be 84(1/5)/(6/15). Let i(u) = -1 + 2 - 23u + u2 + yu - 20	{ "pile_set_name": "DM Mathematics" }
-4 (c) -0.05 (d) 1/12 (e) 2 e What is the second smallest value in -1, 2, 3/5, -16? -1 What is the third biggest value in 16, 0.12, 1, 4, -3/7? 1 Which is the second biggest value? (a) 0.2 (b) 2/19 (c) -1 (d) -49 b Which is the fifth smallest value? (a) -5/4 (b) -2/5 (c) -2/7 (d) 14/11 (e) -1/2 d What is the fourth smallest value in 3/7, -6/7, -11/5, -2.3? 3/7 Which is the third smallest value? (a) -2/7 (b) 47 (c) -4 (d) -3 a Which is the smallest value? (a) -15 (b) -0.2 (c) -24 c What is the third biggest value in -2/13, 1/4, -3, 4, -41? -2/13 What is the smallest value in -43, -0.2, -0.36, -2? -43 What is the fifth biggest value in -7, 0.1, 2/9, 9/2, 4? -7 Which is the third biggest value? (a) -3/2 (b) 7 (c) 3 (d) -1.7 a Which is the third biggest value? (a) 72 (b) -17 (c) -5 b Which is the second smallest value? (a) 2 (b) 1/4 (c) 18 (d) 7 a Which is the fifth biggest value? (a) 0.5 (b) 3 (c) -3/2 (d) -3 (e) -5 e Which is the third biggest value? (a) 5 (b) -4 (c) 27/2 b Which is the fourth smallest value? (a) 0 (b) 11 (c) -1 (d) 6/5 b Which is the third biggest value? (a) 2/11 (b) -1/2 (c) -4 (d) -2/5 b Which is the second smallest value? (a) -1/8 (b) 0.2 (c) 31 b Which is the fifth smallest value? (a) -0.4 (b) 95 (c) 5 (d) 2/15 (e) -14 b What is the smallest value in -5, 23/3, -1/3? -5 What is the third biggest value in -2, -3, -1683/4? -1683/4 Which is the second smallest value? (a) 5 (b) 4 (c) 1 (d) 10 (e) 0.9 c Which is the second smallest value? (a) -0.1 (b) -1 (c) -99 (d) -4 d What is the fourth biggest value in 2/7, -1, 0.3, 1/3, -59/2? -1 Which is the second smallest value? (a) 5/11 (b) 1/52 (c) -3/8 b Which is the second smallest value? (a) -2/5 (b) -1/2 (c) 0 (d) 0.5 a What is the smallest value in 1, -1/5, 134? -1/5 What is the smallest value in 1, -0.2, 2/9, 4, 2/195? -0.2 Which is the third biggest value? (a) 1 (b) -3/2 (c) -8 c Which is the third biggest value? (a) -4/7 (b) -0.3 (c) 0.5 (d) -21 a What is the fourth smallest value in -2/21, -0.3, -2/9, 5/2, -0.068? -0.068 What is the second smallest value in 2/259, -6, -0.3, -5? -5 Which is the fourth biggest value? (a) 1/4 (b) -1 (c) 0 (d) 0.4 (e) 0.5 c Which is the second smallest value? (a) 0.1 (b) 0.5 (c) -0.13 (d) -1 c Which is the second biggest value? (a) -3 (b) -1417 (c) 2/5 a What is the smallest value in 6, -5.3, 0.5, -2? -5.3 Which is the second biggest value? (a) 3 (b) 8 (c) -0.5 a What is the third smallest value in 0.5, 0, 7/5? 7/5 Which is the third smallest value? (a) -4 (b) -1 (c) 25 (d) 0.4 d What is the third biggest value in -3/4, -2/5, -10? -10 What is the biggest value in 5.2, 0.02, 1, -3, 0? 5.2 What is the smallest value in 1, 10, -16? -16 Which is the smallest value? (a) 3 (b) 1 (c) -4 (d) 2 (e) -32 e What is the smallest value in 1/5, 1/8, -2, -0.32? -2 What is the fourth smallest value in 0.026, -3/4, 0.2, 0.1? 0.2 What is the third biggest value in 2/17, -1, 0.1, 11? 0.1 What is the fourth smallest value in -5, -3, -2/15, 19? 19 Which is the smallest value? (a) 16 (b) -14 (c) 5 (d) -1.2 b Which is the fourth biggest value? (a) 2/15 (b) 5/2 (c) -3 (d) -2 c Which is the smallest value? (a) -0.7 (b) -5 (c) 1/6 b Which is the second smallest value? (a) -1/14 (b) 3 (c) -25 a What is the smallest value in -0.5, 1/29, 2, 4/9? -0.5 Which is the fifth biggest value? (a) -6 (b) 6 (c) -4 (d) 3 (e) -5 a Which is the second biggest value? (a) 5 (b) -5 (c) -2 c Which is the second biggest value? (a) 7 (b) 2/11 (c) -3/8 (d) -2/3 b Which is the second smallest value? (a) 1/6 (b) -0.6 (c) 0.4 (d) 2 a Which is the third biggest value? (a) -2/15 (b) -0.1 (c) 0 (d) 4/9 (e) -5 b What is the smallest value in -1/4, -0.082, 0.4, -1/5? -1/4 Which is the third smallest value? (a) -2 (b) 2/7 (c) 0.3 (d) 3 c What is the smallest value in 4, -0.4, -1435? -1435 What is the third smallest value in -0.5, 233, 1/3? 233 Which is the biggest value? (a) 30/13 (b) -2 (c) -3 a Which is the fifth biggest value? (a) -2/5 (b) 1/7 (c) 0.3 (d) 2/11 (e) 0.8 a What is the biggest value in 1/4, -5, -1.8, -238? 1/4 What is the second smallest value in -5, 9, -3, -0.3, 1? -3 Which is the biggest value? (a) -14/11 (b) 3 (c) 2/3 (d) -5 b Which is the smallest value? (a) 3 (b) 16 (c) 1/6 c What is the third biggest value in 3, -42, 2? -42 What is the second biggest value in -24, 4, -2.7? -2.7 Which is the smallest value? (a) -0.3 (b) -3/4 (c) -85 c Which is the second smallest value? (a) 0 (b) -1 (c) 377 (d) -0.1 d Which is the third biggest value? (a) 3 (b) -1/2 (c) -6 (d) 12 b What is the smallest value in -57, -4/5, -1/2, 2/3? -57 What is the second smallest value in -1/2, -37.4, 0, -2, -2/7? -2 What is the third biggest value in -0.1, -17, 3, -0.4? -0.4 Which is the biggest value? (a) 0.2 (b) 289 (c) 0.5 b Which is the third smallest value? (a) 3 (b) 2/7 (c) 0.1 (d) -27 (e) -0.2 c What is the smallest value in 12, -2, -0.7? -2 What is the biggest value in 3, -5/2, -10/3? 3 Which is the second smallest value? (a) 65 (b) 3 (c) 4 (d) 1 (e) 0.06 d What is the fourth biggest value in -2, 2/11, 13, 3, -1? -1 What is the third smallest value in 0.4, 2/55, -1/3, -1/4, 4? 2/55 Which is the third smallest value? (a) 0.01 (b) -2/17 (c) 2 c What is the second smallest value in -1.1, -4, 2? -1.1 Which is the fifth biggest value? (a) 4 (b) 2/5 (c) 6 (d) 2/11 (e) -0.5 e Which is the third smallest value? (a) -3 (b) -1 (c) 1 c What is the third smallest value in 0.0928, -1, -0.3? 0.0928 Which is the third biggest value? (a) 2/3 (b) 0.4 (c) -0.01 (d) -0.1 c Which is the third smallest value? (a) 1/13 (b) -1 (c) -21/5 (d) -0.1 d Which is the fifth biggest value? (a) -1 (b) -3/5 (c) 6 (d) -6 (e) 0 d What is the second smallest value in -147, 4, -0.1? -0.1 What is the fourth biggest value in -0.3, 6, 0.17, -3/4, 5? -0.3 What is the second biggest value in 10, 6, -2/9? 6 Which is the fourth biggest value? (a) -4 (b) -17 (c) 2 (d) -2 (e) 0.5 a Which is the fourth smallest value? (a) 5 (b) 0.2 (c) 4 (d) 19 d Which is the third biggest value? (a) 0.3 (b) 1 (c) -4/283 (d) -0.1 c Which is the biggest value? (a) -0.1 (b) 4 (c) -8 b What is the biggest value in 2/5, 0.1, -0.7, 3, 4/5? 3 Which is the biggest value? (a) 0 (b) -1/3 (c) -0.01 (d) 17 d Which is the biggest value? (a) 4 (b) 5 (c) -4/9 (d) 16 d Which is the smallest value? (a) 0.3 (b) 0.4 (c) 50 (d) 5 a Which is the second biggest value? (a) -2.3 (b) -0.24 (c) -1/3 c What is the third biggest value in 3, 2, -386, -3? -3 What is the smallest value in -58, -1/5, -5? -58 What is the second smallest value in -3, 5, 0.097, -2/11, -1/6? -2/11 What is the smallest value in -4, -0.021, 2, -1/10? -4 Which is the second smallest value? (a) 17 (b) -5 (c) -64 b Which is the fourth smallest value? (a) -0.1 (b) -1.1 (c) 2/17 (d) -0.5 (e) 0.3 c What is the biggest value in 23, -8, 0.3? 23 Which is the third smallest value? (a) -30 (b) 40 (c) 2 b Which is the second smallest value? (a) -11 (b) 3 (c) 4 (d) -0.01 d What is the biggest value in -1, 111, 4, 1, -0.5? 111 What is the fifth biggest value in -0.2, 3/2, -0.09, -3, -0.1? -3 What is the fourth biggest value in -1, -2, 16, 2/9? -2 Which is the third biggest value? (a) -1/11 (b) 5 (c) 3/2 (d) 2 (e) 0.08 c What is the smallest value in -0.3, -3, 2/9, -128, 2/11? -128 Which is the smallest value? (a) 2 (b) -1280 (c) 0.3 b What is the fifth biggest value in -6, -18/11, 4, -4, -2/5? -6 Which is the third biggest value? (a) 4 (b) -0.41 (c) 5 b Which is the fourth biggest value? (a) -5 (b) 1/3 (c) -0.1 (d) 1/11 a Which is the fourth smallest value? (a) 0.5 (b) -2 (c) -54/17 (d) -3/5 a What is the third smallest value in 4/37, 0, 2/19? 4/37 Which is the fourth smallest value? (a) 3/5 (b) 2.1 (c) 0 (d) 1/10 b What is the second smallest value in 0.5, -2, -2/159, 7, -5? -2 Which is the second biggest value? (a) -4 (b) 5 (c) -6/79 c What is the third smallest value in 3, 9, -0.06? 9 What is the fourth biggest value in 1, 0.1, -1/6, 60, -0.4? -1/6 Which is the	{ "pile_set_name": "DM Mathematics" }
M and 7:48 PM? 27 What is 657 minutes before 3:05 AM? 4:08 PM What is 4 minutes after 9:47 AM? 9:51 AM How many minutes are there between 1:07 PM and 6:20 PM? 313 What is 39 minutes after 2:16 AM? 2:55 AM How many minutes are there between 2:11 AM and 2:20 AM? 9 What is 302 minutes before 12:48 PM? 7:46 AM What is 559 minutes before 10:05 AM? 12:46 AM What is 203 minutes before 2:19 AM? 10:56 PM What is 502 minutes before 9:56 PM? 1:34 PM How many minutes are there between 2:35 AM and 4:35 AM? 120 What is 588 minutes after 10:24 PM? 8:12 AM How many minutes are there between 6:03 AM and 6:45 AM? 42 What is 237 minutes after 3:32 PM? 7:29 PM How many minutes are there between 10:55 AM and 7:05 PM? 490 How many minutes are there between 5:55 AM and 12:58 PM? 423 How many minutes are there between 5:50 AM and 5:23 PM? 693 What is 52 minutes after 10:59 PM? 11:51 PM What is 252 minutes before 12:22 PM? 8:10 AM What is 59 minutes after 10:03 PM? 11:02 PM How many minutes are there between 12:52 AM and 12:14 PM? 682 What is 539 minutes after 7:48 AM? 4:47 PM What is 459 minutes before 1:52 AM? 6:13 PM What is 596 minutes before 8:53 AM? 10:57 PM How many minutes are there between 3:24 AM and 3:44 AM? 20 What is 76 minutes before 9:02 AM? 7:46 AM How many minutes are there between 3:35 PM and 1:22 AM? 587 How many minutes are there between 3:35 PM and 7:39 PM? 244 How many minutes are there between 10:36 PM and 6:24 AM? 468 How many minutes are there between 1:47 PM and 4:37 PM? 170 What is 181 minutes before 9:51 AM? 6:50 AM How many minutes are there between 10:16 PM and 11:25 PM? 69 How many minutes are there between 2:18 AM and 2:17 PM? 719 How many minutes are there between 6:30 AM and 12:02 PM? 332 How many minutes are there between 6:07 PM and 1:08 AM? 421 What is 504 minutes before 7:33 AM? 11:09 PM What is 525 minutes after 5:03 PM? 1:48 AM What is 323 minutes before 8:43 AM? 3:20 AM How many minutes are there between 6:34 PM and 1:15 AM? 401 How many minutes are there between 10:41 PM and 3:32 AM? 291 How many minutes are there between 6:23 PM and 8:57 PM? 154 How many minutes are there between 1:37 AM and 9:25 AM? 468 How many minutes are there between 1:35 AM and 11:11 AM? 576 What is 313 minutes after 5:43 PM? 10:56 PM What is 707 minutes before 3:06 PM? 3:19 AM What is 504 minutes after 1:21 AM? 9:45 AM What is 414 minutes before 4:45 AM? 9:51 PM How many minutes are there between 11:24 AM and 8:54 PM? 570 What is 6 minutes before 3:09 PM? 3:03 PM How many minutes are there between 12:55 PM and 3:59 PM? 184 What is 468 minutes before 7:32 AM? 11:44 PM What is 559 minutes after 5:44 PM? 3:03 AM How many minutes are there between 6:39 AM and 3:38 PM? 539 What is 677 minutes after 2:33 AM? 1:50 PM What is 703 minutes after 10:23 AM? 10:06 PM What is 19 minutes after 2:01 PM? 2:20 PM How many minutes are there between 12:46 AM and 8:57 AM? 491 What is 719 minutes before 10:06 PM? 10:07 AM How many minutes are there between 2:47 AM and 11:35 AM? 528 What is 482 minutes after 10:40 PM? 6:42 AM How many minutes are there between 4:22 PM and 3:27 AM? 665 How many minutes are there between 10:35 AM and 9:57 PM? 682 How many minutes are there between 5:27 AM and 2:26 PM? 539 What is 399 minutes before 12:12 PM? 5:33 AM How many minutes are there between 4:21 AM and 6:53 AM? 152 What is 472 minutes before 1:09 AM? 5:17 PM What is 170 minutes before 10:43 PM? 7:53 PM What is 699 minutes after 7:31 PM? 7:10 AM What is 675 minutes before 3:59 PM? 4:44 AM How many minutes are there between 6:27 AM and 8:17 AM? 110 What is 50 minutes before 11:00 AM? 10:10 AM What is 492 minutes after 9:31 AM? 5:43 PM How many minutes are there between 5:38 PM and 5:11 AM? 693 How many minutes are there between 3:18 AM and 12:46 PM? 568 What is 457 minutes after 2:05 AM? 9:42 AM How many minutes are there between 11:41 PM and 1:49 AM? 128 How many minutes are there between 8:07 PM and 8:18 PM? 11 What is 217 minutes after 9:03 AM? 12:40 PM What is 144 minutes before 6:56 PM? 4:32 PM How many minutes are there between 11:51 AM and 2:36 PM? 165 How many minutes are there between 3:04 AM and 2:05 PM? 661 How many minutes are there between 10:41 AM and 10:52 AM? 11 How many minutes are there between 3:48 AM and 6:00 AM? 132 What is 581 minutes before 3:03 PM? 5:22 AM How many minutes are there between 9:53 PM and 6:04 AM? 491 How many minutes are there between 3:35 AM and 6:40 AM? 185 What is 27 minutes after 5:05 PM? 5:32 PM How many minutes are there between 8:29 PM and 4:54 AM? 505 How many minutes are there between 8:15 AM and 10:31 AM? 136 How many minutes are there between 8:06 AM and 2:20 PM? 374 What is 270 minutes before 5:35 AM? 1:05 AM What is 386 minutes after 5:47 AM? 12:13 PM How many minutes are there between 9:32 AM and 8:54 PM? 682 What is 665 minutes after 9:36 AM? 8:41 PM What is 581 minutes before 2:28 AM? 4:47 PM What is 472 minutes after 6:37 AM? 2:29 PM What is 243 minutes before 10:25 AM? 6:22 AM What is 710 minutes before 2:13 PM? 2:23 AM How many minutes are there between 7:36 AM and 12:32 PM? 296 What is 607 minutes before 1:12 PM? 3:05 AM How many minutes are there between 2:33 PM and 9:42 PM? 429 How many minutes are there between 12:50 PM and 2:31 PM? 101 How many minutes are there between 1:14 AM and 3:36 AM? 142 How many minutes are there between 8:09 AM and 6:26 PM? 617 What is 132 minutes before 3:42 PM? 1:30 PM What is 211 minutes after 7:50 PM? 11:21 PM How many minutes are there between 4:06 PM and 11:16 PM? 430 What is 320 minutes before 8:09 PM? 2:49 PM What is 661 minutes after 11:02 AM? 10:03 PM How many minutes are there between 8:04 PM and 5:34 AM? 570 What is 719 minutes before 11:06 AM? 11:07 PM How many minutes are there between 7:28 PM and 8:10 PM? 42 How many minutes are there between 12:41 AM and 4:50 AM? 249 How many minutes are there between 9:32 AM and 4:42 PM? 430 What is 663 minutes after 10:51 PM? 9:54 AM How many minutes are there between 10:32 PM and 2:52 AM? 260 What is 501 minutes before 9:17 PM? 12:56 PM How many minutes are there between 8:22 PM and 3:12 AM? 410 How many minutes are there between 5:44 PM and 5:33 AM? 709 What is 325 minutes before 3:01 PM? 9:36 AM How many minutes are there between 12:58 PM and 12:25 AM? 687 How many minutes are there between 12:32 AM and 5:35 AM? 303 How many minutes are there between 8:09 AM and 8:51 AM? 42 How many minutes are there between 1:04 PM and 11:38 PM? 634 What is 503 minutes after 9:53 PM? 6:16 AM What is 327 minutes before 3:37 AM? 10:10 PM What is 130 minutes before 3:08 AM? 12:58 AM What is 405 minutes before 9:51 PM? 3:06 PM What is 283 minutes after 4:37 PM? 9:20 PM What is 56 minutes before 12:28 PM? 11:32 AM What is 159 minutes before 7:33 PM? 4:54 PM How many minutes are there between 11:25 AM and 3:34 PM? 249 How many minutes are there between 12:24 AM and 4:50 AM? 266 What is 677 minutes before 10:59 AM? 11:42 PM How many minutes are there between 6:27 AM and 3:04 PM? 517 What is 246 minutes after 5:28 PM? 9:34 PM How many minutes are there between 4:35 PM and 4:04 AM? 689 How many minutes are there between 5:05 PM and 6:35 PM? 90 What is 331 minutes before 10:17 AM? 4:46 AM How many minutes are there between 9:06 AM and 9:08 AM? 2 How many minutes are there between 5:59 PM and 1:38 AM? 459 How many minutes are there between 2:11 AM and 8:39 AM? 388 How many minutes are there between 10:48 AM and 4:08 PM? 320 How many minutes are there between 11:34 PM and 1:03 AM? 89 What is 690 minutes before 7:48 AM? 8:18 PM What is 325 minutes before 5:13 AM? 11:48 PM How many minutes are there between 9:11 AM and 6:41 PM? 570 What is 191 minutes before 5:13 AM? 2:02 AM What is 480 minutes after 7:19 PM? 3:19 AM How many minutes are there between 7:46 PM and 10:51 PM? 185 How many minutes are there between 9:01 PM and 1:11 AM? 250 How many minutes are there between 5:23 PM and 6:17 PM? 54 How many minutes are there between 10:01 AM and 7:07 PM? 546 What is 137 minutes after 11:16 PM? 1:33 AM How many minutes are there between 9:00 AM and 4:24 PM? 444 What is 467 minutes after 2:09 PM? 9:56 PM How many minutes are there between 11:42 PM and 1:45 AM? 123 How many mi	{ "pile_set_name": "DM Mathematics" }
d the third derivative of y(k) wrt k. 48k Let x(a) be the second derivative of 11a5/10 + a4/6 + 19a3/2 + 2a + 1. Find the second derivative of x(i) wrt i. 132i + 4 Let o be -1 + -1 - -2 - -8. Let x = o + -5. What is the third derivative of -4h - 4h3 + 7h*x + 4h - 3h2 wrt h? 18 Let b(k) be the first derivative of 0k - 2/3k3 - 4 - 1/5k*5 + 0k*4 + 0k*2. What is the third derivative of b(s) wrt s? -24s Let b(s) be the first derivative of 0s4 + 1/5s*5 - 1/2s*2 + 0s*3 - 3 + 0s. Find the second derivative of b(q) wrt q. 12q2 Let r = -4 - -7. Suppose 0n + 9 = rn. What is the third derivative of -q2 + 0 + 2q*n + 0 wrt q? 12 Let m(x) = -13x*4 - 4x*3 - 4x*2 - 9. Let y(p) = -26p*4 - 9p*3 - 9p*2 - 19. Let o(n) = -9m(n) + 4y(n). What is the first derivative of o(b) wrt b? 52b*3 Let u = 144 + -144. Let y(s) be the third derivative of u - 2s*2 - 1/6s*4 + 1/20s*5 + 0s*3 + 0s. Find the second derivative of y(z) wrt z. 6 Differentiate -7i4 + 7 - 3 + 1 + 5 with respect to i. -28i*3 Let g(d) be the first derivative of 5d4/4 + d2 + 1. What is the second derivative of g(m) wrt m? 30m Find the first derivative of j - 10j - 5 + 0j + 1 wrt j. -9 Let q(a) be the third derivative of 0a - 1/120a6 + 0a*5 - 1/3a*3 + 4a*2 + 0 + 0a*4. Differentiate q(h) wrt h. -3h*2 Suppose -7 = 4o + g - 25, -o + 13 = -4g. Suppose -4p + 11 = a, -op + 6 = -2a - 11. What is the second derivative of -9u3 - 6u*3 + 11u*p - 3u wrt u? -24u Let r = 3 - 9. Let o be 0/(r/(-9)-3). What is the first derivative of -5 + 2 + 2p2 + o wrt p? 4p Let i(h) be the first derivative of 0h3 - 5h + 1/5h5 + 0h*4 + 4 + 0h*2. Find the first derivative of i(l) wrt l. 4l*3 Find the third derivative of 4j4 + j4 + 5j4 - 8j*2 wrt j. 240j Let a(i) = i*2 - 2. Let k be 0/(-3) + 2 - 4. Let w be a(k). What is the third derivative of -5m*3 + 3m3 - m2 + 0mw wrt m? -12 Let r(u) be the first derivative of 18u*5/5 - 15u*2/2 + 24. Find the second derivative of r(j) wrt j. 216j*2 Let o(g) be the second derivative of 5g4/12 + g3/6 - 5g. What is the second derivative of o(i) wrt i? 10 Let f(h) be the third derivative of -11h*8/336 + 5h*4/24 + 5h*2. What is the second derivative of f(j) wrt j? -220j*3 Let f = -4/5 + 23/10. Let k(v) be the second derivative of -3v + 0v3 + 0v*4 + 0 + fv*2 + 1/20v*5. What is the first derivative of k(h) wrt h? 3h*2 Let k(i) = 2i - 3. Let b be k(4). Find the second derivative of o*b + 2o - 4o - o wrt o. 20o3 Let x(q) be the second derivative of -q4 + 6q2 + 9q. Differentiate x(v) wrt v. -24v What is the first derivative of 7 - 22v + 11v + 13v wrt v? 2 Let r(y) = -3y3 - 2y*2 - 3. Let h(j) = 5j*2 + 7 + 6j*3 + 0j6 - j6 + j*3. Let v(x) = -3h(x) - 7r(x). Find the third derivative of v(s) wrt s. 360s*3 Let j be 0/(39/18 + 1/(-6)). Let h(s) be the first derivative of 0s + 1/3s3 + 1/5s*5 + 1 + 0s*2 + js*4. What is the third derivative of h(f) wrt f? 24f Let c(t) = 40t + 7. Let l(s) = 38s + 8. Let d(b) = 4c(b) - 5l(b). Differentiate d(m) wrt m. -30 Let m(p) be the third derivative of -p9/20160 + p6/240 - p*5/15 + 3p*2. Let f(h) be the third derivative of m(h). What is the derivative of f(n) wrt n? -9n*2 Let a(l) be the second derivative of -3l5/10 - l2/2 + 6l. What is the first derivative of a(u) wrt u? -18u2 Let n(k) be the first derivative of -k5/5 + 7k3/3 - 4. What is the third derivative of n(b) wrt b? -24b Let a be 6/9 + (-4)/(-3). What is the second derivative of 5 - 5s - 6s*3 + a - 7 wrt s? -36s Let m(b) be the third derivative of b*5/60 - 5b*4/24 + 5b*3/6 - 2b2. Let x be m(4). What is the derivative of -w2 - w*2 + 3w*2 - x - 1 wrt w? 2w Let i(g) be the second derivative of 13g7/42 + 3g*3/2 - 5g. Find the second derivative of i(c) wrt c. 260c3 Let m(l) be the third derivative of -4l*7/105 + 5l*4/12 + 2l*2. What is the second derivative of m(d) wrt d? -96d2 Let c(d) = d4. Let m(a) = -10a4 + a2. Let b = 4 - -2. Let t(y) = bc(y) + m(y). Find the third derivative of t(n) wrt n. -96n Suppose 7k = 3k + 24. Find the second derivative of o + 4o - 3o - ko - 5o4 wrt o. -60o*2 What is the third derivative of -7w*6 + 8 + 0 - 8 + 3w*2 wrt w? -840w*3 Differentiate 8 + 14 - 2j*2 + 4 + 13j + 9 wrt j. -4j + 13 What is the third derivative of 3r*5 - 9r5 - r5 - 7r5 - 8r*2 wrt r? -840r2 Let r(j) be the third derivative of -j7/280 - j*5/30 + 2j3/3 - j2. Let f(y) be the first derivative of r(y). Find the second derivative of f(o) wrt o. -18o Let y(a) = -a3 + 6a*2 + 7a - 1. Let k be y(7). Let p be 0(k - -2)/(-1). Find the first derivative of -1 - 1 - j4 + p wrt j. -4j3 What is the first derivative of -v3 - 2v2 + 2v*2 + 2 wrt v? -3v2 Let c(j) be the second derivative of -j6/40 - j4/12 + j2/2 + 3j. Let y(z) be the first derivative of c(z). Find the second derivative of y(g) wrt g. -18g Let b be (-1)/(-21/8). Find the second derivative of -13 + bc + 13 + 4c2 wrt c. 8 Let z(u) = -u3 - 9u*2 - u + 3. Let c be z(-9). What is the second derivative of -8f*5 - 12f*3 + cf*3 - 3f wrt f? -160f3 Let j(q) = -q3 + 4q*2 - 2q + 2. Let b be j(2). What is the third derivative of 6w6 - w6 + wb - 4w*2 - 2w*6 wrt w? 480w*3 What is the derivative of 18 + 3o - 12 - 9 wrt o? 3 Let u(j) = j5 - j4 - 1. Let t(f) = -7f5 + 4f*4 + 3f*2 + 4. Let y(s) = -3t(s) - 12u(s). What is the third derivative of y(q) wrt q? 540q*2 Let v = 7 + -5. Suppose -vf + 6f = 0. Find the first derivative of -4p*4 + 1 + 5p*4 + fp*4 wrt p. 4p3 Let c(t) be the second derivative of t8/1680 - t6/120 + t3/2 - t. Let r(b) be the second derivative of c(b). Find the third derivative of r(o) wrt o. 24o Let h(n) = n3 - 19n2 - 5. Let i = 15 + -13. Let o(l) = -l3 + 9l2 + 2. Let v(x) = ih(x) + 5o(x). Find the third derivative of v(k) wrt k. -18 Let v = -13 - -18. Let w be ((0/(-1))/(-2))/(-1). Find the first derivative of x + 0x + wx - v + 3 wrt x. 1 Let j(x) = -x3 + 2x*2 + 4x - 1. Let t be j(3). Suppose 7i - 2i = 15. Find the third derivative of q3 - qt + 0q3 - iq*3 wrt q. -12 What is the third derivative of 6z*5 - 4z*2 - 15z*5 - 12z*5 + 4z wrt z? -1260z2 Let r(h) = h3 - 6h*2 - 8h + 10. Let w be r(7). What is the second derivative of 2m5 - 2m*3 + 2m*w - 3m*5 + m wrt m? -20m*3 Suppose 14 = 4k + 2w, 5k = -0w + 2w + 4. Suppose 3c + kc = 15. Find the third derivative of -3tc - 4t*3 + 6t*3 + 3t*2 wrt t. -6 Let o(f) be the second derivative of 0f*2 + 0f*6 + 0f*7 + 0f*3 + 0 + 0f*5 + 4f - 1/56f8 + 1/6f*4. Find the third derivative of o(l) wrt l. -120l*3 Let x(h) = 11h*2 + 9h. Let n(j) = j*2 + j. Let v(q) = -6n(q) + x(q). What is the second derivative of v(k) wrt k? 10 Let q(d) = 2. Let y(c) = -c*2 - 7c - 1. Let t be y(-7). Let a(x) = -x*3. Let h(n) = tq(n) + 3a(n). What is the derivative of h(i) wrt i? -9i*2 Suppose j = 4j - 6. Suppose u + 3 = 0, 0 = -h - jh - 2u + 3. Differentiate hz2 - 3z2 - 3 - z4 + 3z4 with respect to z. 8z3 Let m(i) be the second derivative of i9/3024 - i6/120 - i3/6 + 2i. Let s(y) be the second derivative of m(y). Find the third derivative of s(r) wrt r. 60r*2 Let o(b) be the first derivative of -4b - 4 + 1/2b4 + 0b*3 + 0b*2. What is the first derivative of o(g) wrt g? 6g*2 Find the third derivative of -71g - 2g2 + 36g + g6 - g5 + 49g wrt g. 120g*3 - 60g2 Let i(s) = -s2 + 8s - 5. Let w be i(7). Find the first derivative of 8q3 - 2 + qw - 2q2 + q2 wrt q. 24q2 Let x(r) = -r3 + r*2 + 2. Let u be x(0). Differentiate 0 + 0 - 4o*u + 0 + 1 wrt o. -8o Let s(j) be the first derivative of -17j3/3 - 7j*2 + 27. What is the second derivative of s(q) wrt q? -34 Suppose 1 = -2k + 5. Let t = 5 - k. What is the second derivative of -r*2 + 5r*2 + tr*2 + 2r - 5r2 wrt r? 4 Differentiate -2y*3 - 2y*3 + 6y*3 - 7y*3 + y + 74 wrt y. -15y*2 + 1 Suppose u = 3u - 2*z	{ "pile_set_name": "DM Mathematics" }
pose 36 = 5z - x, -2z - 8 = -z - 4x. Suppose 4p + 2s - 14 = 0, 2p + 5s - s = 10. Solve v = -pv - z for v. -2 Suppose 0 = -h + 9 - 2. Suppose -2z - 1 = n, 2n - h = -0n - z. Solve -nw - 2 + 7 = 0 for w. 1 Let f(i) = -i + 17 - 20 - i + 21. Let x be f(4). Solve d = -d - x for d. -5 Let a(p) = -p*3 + 6p*2 + 3p - 15. Let o = 38 + -32. Let i be a(o). Solve 0 = -k - i - 1 for k. -4 Let f(r) = r*3 + 5r*2 - 24r + 13. Let p be f(-8). Solve -px = 42 + 10 for x. -4 Let f = -15 - -19. Suppose -4y = 4 - 4. Solve fr + r + 5 = y for r. -1 Let w be 0/1 + (0 - 0). Let r(y) be the first derivative of y2 - 4y + 8. Let h be r(7). Solve 6j - j + h = w for j. -2 Let z(f) = f2 - 24f - 25. Let l be z(25). Let w(k) = k + 13. Let b be w(-11). Solve l = -bv - v + 9 for v. 3 Suppose 713 - 665 = 4o. Solve -9u + ou = 0 for u. 0 Let m(b) = 38b + 231. Let c be m(-6). Solve -15 = cu - 0 for u. -5 Let k(a) = -2a2 + 9a - 4. Let t be k(3). Suppose tx - 14x = -108. Solve -xq = -11q for q. 0 Suppose -71i = -61i - 80. Solve 101 = it + 69 for t. 4 Suppose 15i - 19i = -2o - 86, 5o - 5 = 0. Solve 0 = 16g - ig - 24 for g. -4 Let w(t) = t2 - 5. Let m be w(5). Suppose -7j - 132 + 153 = 0. Solve -2n + m = jn for n. 4 Let b be (5 + (-70)/21)33. Solve -18n = -bn - 12 for n. 4 Let n = -3 - -19. Suppose 6 = s - t, 3t = -t + n. Solve 2f + 0 = -s for f. -5 Let a be (16/6)/(-8) - 10/6. Let t be a(-153)/15 + (-12)/30. Solve -3u - u + t = 0 for u. 5 Let q be (2 + (-1)/2)/(6/(-8)). Let k = 0 - q. Solve 0 = kh - 0 + 8 for h. -4 Let b = 26 - 21. Let n = 209 - 201. Solve bj - n - 7 = 0 for j. 3 Let v(c) = 3c - 12. Let x = 35 + -29. Let a be v(x). Solve 4g = 2 - a for g. -1 Suppose -3u = -u - 2, 4u - 4 = -5g. Let a = 53 - 45. Solve gh - 4h = a for h. -2 Let g(b) = b2 + 2b - 7. Let m be g(-5). Suppose 12d - 10 = 14. Let h = 7 + -5. Solve m = -dw - hw for w. -2 Let s = -1 - -3. Suppose -4v + 5v = -3o + 14, -6 = v - 2o. Suppose -7 = -k + 5g, 0 = 2k + vk + 3g - 5. Solve sx + k = x for x. -2 Let r = 734 - 724. Solve 4b + 6 = rb for b. 1 Suppose -12v - 11 = -16v + a, 2v + 5a = 33. Solve 4t = -16 - v for t. -5 Let v = -3134 - -3150. Solve -3j + 28 - v = 0 for j. 4 Let n be (-1)/(-3 + 26/8). Let f be (n/12)/(1/(-189)). Let j be ((-18)/f)/((-2)/14). Solve -jg + 6g = 20 for g. 5 Suppose 0 = -102y + 93y + 153. Solve y = 3s + 2 for s. 5 Suppose 0 = -2c + 6, 2c + 0c = -2y + 12. Solve 8m - y = 13 for m. 2 Let x be (2/5)/(2/10). Suppose k + 5d = 23, 2d = xk - 3d + 29. Let c(y) = y*2 + 2y + 2. Let z be c(k). Solve -b = -2 - z for b. 4 Let d(o) = 30o + 70. Let w be d(-2). Let p = -3 + 9. Solve -w = -ph + h for h. 2 Suppose -40 = 6b - 8b. Let h = -1 - -3. Solve -3p + b = hp for p. 4 Let x(s) = -s*3 - s + 4. Let r be x(0). Suppose -3z = w - 6w + 188, -16 = -4z. Let h = w + -40. Solve h = rg - 24 + 4 for g. 5 Suppose 6b - 100 = -250. Let f = 27 + b. Suppose 0 = 3a + f - 11. Solve -4 = as + 5 for s. -3 Let q(h) = -h*3 - 11h*2 + 13h + 15. Let y be q(-12). Suppose u - 2 = -3l - l, 2u = yl + 15. Let z = u - 6. Solve -2c + z = -6 for c. 3 Suppose -16n + 7n + 54 = 0. Let h(j) = j + 1. Let w be h(1). Solve -wd = -nd for d. 0 Suppose -31l + 3i = -35l + 23, -5l - 3i + 31 = 0. Solve ly = 15 + 25 for y. 5 Suppose -41 = -4p - 3m + 2m, -m = -p + 9. Suppose 5u - 6 = -o + p, -3u - 2o = -11. Solve 2f + uf = 0 for f. 0 Suppose 102 = 4d + 2d. Let k(a) = a*3 - 17a*2 + 2a - 34. Let c be k(d). Solve 4 = 2u - c for u. 2 Suppose -2u = -0u - 8. Suppose 2c + 4m = -3c + 47, 4c - 50 = 3m. Solve us - c = -27 for s. -4 Suppose 64 = 6a + 10. Solve 2g = a - 17 for g. -4 Let v(o) = -4o + 154. Let z be v(38). Solve -d = zd for d. 0 Let s = -14 + 2. Let g be (-12)/26/s. Suppose i + 1 = 0, r + i - g = -3r. Solve -x - 4 = -r for x. -3 Let g = 65 + -64. Let z be (-14)/18 + g + (-102)/(-27). Solve -3b = -zb + 1 for b. 1 Let d(b) = b3 + 9b*2 - b - 9. Let q be d(-9). Let m(c) = 4c*2 - 2c. Let p be m(-1). Solve q = -3g + pg - 3 for g. 1 Let d be (-2)/6 - 27/(-81). Suppose -3c = -dc. Solve 2g - 5g - 15 = c for g. -5 Let d(g) = -29g - 5g*2 + 34g - 1 + 7 + 4g2. Let t be d(6). Let s = 18 + -10. Solve ty - 4y = -s for y. 2 Let c(p) = p3 - 11p*2 + 12p - 20. Let w be c(10). Solve 3u - 9 = -w for u. 3 Let w be ((8 - 4) + (0 - 5))0. Solve w = 11z - 3z - 7z for z. 0 Let v(a) = 2a + 11. Let u be v(-3). Suppose 15 = -8d + 5d. Let q = d + u. Solve p + p = q for p. 0 Let k(f) = -5f - 35. Let o be k(-7). Let q(r) = -r + 3. Let v be q(2). Let m be 3(-1 + (v - -1)). Solve -ms + o = 12 for s. -4 Let h = -32 - -33. Let v = -4 + 10. Let g be v - 1 - 1/h. Solve gr - 4 = 4 for r. 2 Let u(p) = p*2 + 2p + 2. Let x = 13 - 16. Let k be u(x). Suppose kb - 23 = 4q, 2q = 4q - 6. Solve bn = 4n for n. 0 Let x(s) = -2s - 46. Suppose 4r + 2w = -118, 4r + 3w + 0w + 121 = 0. Let j be x(r). Solve -j = 5p - 0 for p. -2 Suppose 0 = 8s - 99 - 133. Solve 6 = -7v - s for v. -5 Let v be (-1 + 2)/((2/21)/(-2)). Let y = v + 21. Solve 3d + 0d = y for d. 0 Suppose 0 = -4v + v + 45. Suppose -3g + v = 3z - 0z, -4g - 5z + 23 = 0. Solve 0p + 4 = gp for p. 2 Suppose 0 = j - 17 + 18. Let q = j + 7. Solve -5x + 2x + q = 0 for x. 2 Let c(m) = -274m - 1309. Let t be c(-5). Solve -8l + t = 69 for l. -1 Suppose 0 = -7x - 2x. Solve x = 3l - 8l - 15 for l. -3 Let n(b) = b + 5. Let v = 32 - 35. Let r be n(v). Solve rw = 2 - 4 for w. -1 Let c be ((-108)/14)/((-33)/154). Suppose 2p = -12 + c. Solve -2x - 2x - p = 0 for x. -3 Suppose 1 + 2 = z + n, 15 = 5z - n. Suppose -z = -2t - t. Solve -21 + t = 5l for l. -4 Let i = -8 + 9. Suppose 0 = u + 2f - 10, i = 3f - 8. Solve u = y + 2 for y. 2 Suppose -3h + 36 = -2g + 5g, 5h + 2g - 48 = 0. Suppose -hp + 6 = -10. Solve a - p = 3 for a. 5 Suppose 22f - 195 = -17f. Solve -22a - f + 49 = 0 for a. 2 Suppose -82f + 78f = -44. Suppose 0 = -x + 2y + 9, -4x - 3y + 0y + 47 = 0. Let n = f - x. Solve n = -p - 4p for p. 0 Suppose -2b + 15 = -b. Let n(d) = -d2 - 5d - 3. Suppose -3i - 4c - 2 = 0, -2i + 3c - 9 = i. Let o be n(i). Solve -b = 2s + os for s. -3 Let d be (-12)/((-12)/(49 + -1)). Solve 2w - 2 = -d for w. -3 Let a(z) = 2z2 + 6z + 1. Let h be a(-4). Suppose -v = 5l - h - 29, 4l - 19 = 3v. Solve -2 = k - l for k. 5 Let b be (3 - 2)/((-1)/(-13)). Suppose 0 = -5o - 20, 0o = -4n - 2o. Let l be (b + -13)(1 - n). Solve -2f + lf - 10 = 0 for f. -5 Let y(l) = -l*3 + 4l*2 + 9l + 18. Let u be y(6). Solve u = -6g + 7g + 4 for g. -4 Suppose 6 = 4w + 3u, -w - 3u + 10 = 2u. Suppose r - j - 4 = w, 4j = 6r - 3r - 16. Solve r = -y - y for y. 0 Let h = 141 - 135. Solve -hm + 8 = -4 for m. 2 Suppose 3m + 17 - 2 = 0, -5m = 5i + 25. Solve 6g + 15 + 9 = i for g. -4 Suppose -81b + 32 = -49. Suppose u - 2u + 4 = 0. Suppose 3c = -2n + 7, -4n - uc + 12 = -0n. Solve 0 = -nh + 5 + b for h. 3 Let i = 23 + -5. Suppose 3x + i = 2w, 5w + 5 = -5x - 0. Let v be (-2 - 1)/(w/(-2)). Solve 0 = j + v for j. -2 Let v = 16 + -12. Suppose -vj + 0j = -32. Solve 12 + j = 5o for o. 4 Suppose -2i + 12 = -0i - 2r, -5i = -3r - 24. Suppose 0 = q + ic + 8, q + 0 - 7 = 2c. Solve 0 = 2l - 5 - q for l. 3 Let t be 6 - (8/1 + -3). Let b be (3 + -4)-21t. Solve 5o - b = 4 for o. 5 Suppose 4i - 33 = b, 56 = 3i - 21b + 14b. Let h(o) = o*2 - 2o - 4. Let w be h(-4). Solve w = -ip + 2p for p. -4 Let l(b) = b*3 - 2b*2 + b. Let f be l(1). Suppose -8 = 3r - 2. Let n = 0 - r. Solve m - n = -fm for m. 2 Suppose -4a = -3k + 8k - 142, -3k - 4a + 82 = 0. Solve 6f + 0f - k = 0 for f. 5 Suppose 19 = -4r - t, -t - 4 + 0 = r. Let c(h) = 2h*2 + 6h - 12. Let v be c(r). Solve 0 = -4o - 0o - v for o. -2 Let n be ((-12)/15)/((-1)/(-15)). Let s be (-1)/((-21)/n - 2). Let w be (-10)/8(2 + -22). Solve -su = u + w for u. -5 Suppose -16r + 8 = -12r. Suppose 8u = ru. Suppose d = -ud. Solve -q + d = 3 for q. -3 Let o be (4 + -7 + 3)1. Suppose o = 7t - 4 + 4. Solve -2w - 4 + t = 0 for w. -2 Let z(g) = 5g - 11. Let w(b) = -5b + 10. Let q(m) = 5w(m) + 4z(m). Let s be q(5). Let c = s - -31. S	{ "pile_set_name": "DM Mathematics" }
3:57 AM How many minutes are there between 12:21 PM and 4:41 PM? 260 How many minutes are there between 9:35 AM and 10:52 AM? 77 What is 44 minutes after 11:09 PM? 11:53 PM How many minutes are there between 4:55 AM and 3:31 PM? 636 What is 136 minutes before 4:41 AM? 2:25 AM What is 102 minutes before 6:17 AM? 4:35 AM How many minutes are there between 8:29 PM and 5:28 AM? 539 How many minutes are there between 10:09 PM and 10:51 PM? 42 How many minutes are there between 6:37 PM and 1:38 AM? 421 What is 589 minutes before 3:28 AM? 5:39 PM What is 630 minutes before 11:15 AM? 12:45 AM How many minutes are there between 4:17 AM and 2:29 PM? 612 How many minutes are there between 1:12 AM and 1:47 AM? 35 What is 617 minutes after 7:20 AM? 5:37 PM What is 672 minutes before 7:33 PM? 8:21 AM How many minutes are there between 9:46 PM and 3:28 AM? 342 What is 265 minutes before 11:16 PM? 6:51 PM How many minutes are there between 7:57 AM and 5:52 PM? 595 What is 97 minutes after 3:33 PM? 5:10 PM What is 630 minutes after 5:27 PM? 3:57 AM How many minutes are there between 1:09 AM and 6:13 AM? 304 How many minutes are there between 5:47 AM and 9:30 AM? 223 What is 145 minutes before 1:05 AM? 10:40 PM How many minutes are there between 10:47 AM and 1:23 PM? 156 What is 644 minutes before 8:18 AM? 9:34 PM How many minutes are there between 6:53 AM and 12:59 PM? 366 How many minutes are there between 3:43 AM and 12:11 PM? 508 How many minutes are there between 10:00 AM and 1:24 PM? 204 How many minutes are there between 7:27 PM and 11:57 PM? 270 How many minutes are there between 5:46 PM and 9:23 PM? 217 How many minutes are there between 11:54 PM and 5:03 AM? 309 What is 493 minutes after 5:14 AM? 1:27 PM What is 457 minutes before 1:46 PM? 6:09 AM How many minutes are there between 2:43 AM and 5:18 AM? 155 How many minutes are there between 10:20 PM and 11:09 PM? 49 How many minutes are there between 5:16 PM and 10:11 PM? 295 How many minutes are there between 1:41 AM and 12:58 PM? 677 What is 462 minutes before 12:34 PM? 4:52 AM What is 277 minutes after 4:36 AM? 9:13 AM How many minutes are there between 7:57 AM and 5:16 PM? 559 What is 474 minutes before 12:01 PM? 4:07 AM How many minutes are there between 10:05 AM and 9:14 PM? 669 How many minutes are there between 12:03 AM and 12:38 AM? 35 How many minutes are there between 10:04 AM and 9:54 PM? 710 How many minutes are there between 12:04 PM and 6:46 PM? 402 How many minutes are there between 11:14 PM and 7:54 AM? 520 How many minutes are there between 3:27 AM and 5:05 AM? 98 How many minutes are there between 9:25 PM and 5:07 AM? 462 How many minutes are there between 10:17 PM and 8:56 AM? 639 What is 432 minutes after 8:38 PM? 3:50 AM How many minutes are there between 9:25 AM and 12:54 PM? 209 What is 194 minutes before 9:19 AM? 6:05 AM What is 520 minutes before 5:43 AM? 9:03 PM How many minutes are there between 7:28 PM and 9:56 PM? 148 What is 341 minutes before 7:06 PM? 1:25 PM How many minutes are there between 7:29 AM and 9:54 AM? 145 How many minutes are there between 8:08 PM and 10:36 PM? 148 What is 354 minutes after 4:48 PM? 10:42 PM How many minutes are there between 7:06 AM and 8:02 AM? 56 How many minutes are there between 3:50 PM and 12:13 AM? 503 How many minutes are there between 3:11 PM and 1:54 AM? 643 What is 607 minutes before 6:21 PM? 8:14 AM What is 10 minutes before 3:56 AM? 3:46 AM How many minutes are there between 9:18 PM and 11:05 PM? 107 How many minutes are there between 10:38 AM and 2:15 PM? 217 How many minutes are there between 5:07 AM and 2:48 PM? 581 What is 332 minutes after 11:49 AM? 5:21 PM What is 584 minutes after 12:06 AM? 9:50 AM What is 149 minutes after 11:26 AM? 1:55 PM What is 303 minutes before 9:29 PM? 4:26 PM What is 170 minutes after 5:02 PM? 7:52 PM How many minutes are there between 3:46 PM and 10:13 PM? 387 How many minutes are there between 2:40 AM and 10:50 AM? 490 How many minutes are there between 11:05 AM and 4:33 PM? 328 What is 573 minutes after 5:58 AM? 3:31 PM What is 459 minutes before 12:19 AM? 4:40 PM How many minutes are there between 1:51 PM and 11:04 PM? 553 How many minutes are there between 6:46 AM and 10:15 AM? 209 How many minutes are there between 11:23 AM and 2:27 PM? 184 What is 69 minutes after 5:42 AM? 6:51 AM What is 592 minutes before 8:05 PM? 10:13 AM How many minutes are there between 2:14 PM and 7:31 PM? 317 What is 274 minutes before 5:35 PM? 1:01 PM How many minutes are there between 8:51 PM and 11:19 PM? 148 How many minutes are there between 9:14 AM and 1:48 PM? 274 How many minutes are there between 6:59 AM and 12:02 PM? 303 What is 103 minutes after 6:41 AM? 8:24 AM How many minutes are there between 10:57 AM and 12:48 PM? 111 What is 454 minutes before 8:17 AM? 12:43 AM How many minutes are there between 1:00 AM and 9:10 AM? 490 How many minutes are there between 8:28 PM and 9:01 PM? 33 What is 470 minutes before 2:50 PM? 7:00 AM What is 692 minutes before 7:02 AM? 7:30 PM How many minutes are there between 8:55 PM and 11:17 PM? 142 How many minutes are there between 6:39 AM and 8:11 AM? 92 How many minutes are there between 9:21 AM and 12:08 PM? 167 What is 595 minutes before 2:44 AM? 4:49 PM How many minutes are there between 12:03 PM and 5:34 PM? 331 What is 576 minutes before 2:24 AM? 4:48 PM What is 128 minutes before 11:44 AM? 9:36 AM What is 429 minutes after 5:39 AM? 12:48 PM How many minutes are there between 9:39 PM and 3:21 AM? 342 What is 669 minutes after 2:38 AM? 1:47 PM How many minutes are there between 12:12 AM and 5:17 AM? 305 How many minutes are there between 11:26 PM and 9:22 AM? 596 How many minutes are there between 12:01 AM and 2:22 AM? 141 How many minutes are there between 3:31 AM and 7:35 AM? 244 How many minutes are there between 3:12 AM and 7:16 AM? 244 How many minutes are there between 3:48 AM and 11:16 AM? 448 How many minutes are there between 1:54 PM and 6:24 PM? 270 What is 191 minutes after 12:35 PM? 3:46 PM What is 9 minutes before 3:56 AM? 3:47 AM What is 532 minutes after 8:37 PM? 5:29 AM How many minutes are there between 3:05 PM and 11:07 PM? 482 How many minutes are there between 5:19 PM and 5:08 AM? 709 How many minutes are there between 12:28 PM and 2:45 PM? 137 What is 33 minutes before 7:42 AM? 7:09 AM How many minutes are there between 9:28 PM and 4:52 AM? 444 How many minutes are there between 4:13 PM and 5:57 PM? 104 How many minutes are there between 7:34 AM and 4:26 PM? 532 What is 4 minutes after 2:13 AM? 2:17 AM How many minutes are there between 10:11 PM and 1:34 AM? 203 What is 623 minutes after 11:58 AM? 10:21 PM How many minutes are there between 3:44 AM and 2:23 PM? 639 How many minutes are there between 2:00 AM and 3:07 AM? 67 What is 573 minutes before 8:54 AM? 11:21 PM How many minutes are there between 11:46 AM and 4:10 PM? 264 How many minutes are there between 3:35 AM and 11:22 AM? 467 What is 710 minutes after 6:26 AM? 6:16 PM What is 137 minutes after 5:28 AM? 7:45 AM How many minutes are there between 3:50 AM and 5:18 AM? 88 How many minutes are there between 8:25 PM and 5:09 AM? 524 What is 549 minutes before 11:33 AM? 2:24 AM What is 265 minutes after 7:35 PM? 12:00 AM How many minutes are there between 7:42 PM and 5:25 AM? 583 How many minutes are there between 1:23 AM and 1:12 PM? 709 How many minutes are there between 4:08 AM and 10:02 AM? 354 How many minutes are there between 9:10 AM and 8:12 PM? 662 What is 107 minutes after 12:51 AM? 2:38 AM What is 709 minutes before 12:07 AM? 12:18 PM How many minutes are there between 2:26 PM and 3:57 PM? 91 What is 53 minutes before 8:47 PM? 7:54 PM How many minutes are there between 12:47 AM and 6:10 AM? 323 What is 705 minutes before 9:53 PM? 10:08 AM How many minutes are there between 9:51 PM and 11:32 PM? 101 How many minutes are there between 7:51 PM and 6:58 AM? 667 What is 685 minutes after 9:37 PM? 9:02 AM What is 406 minutes after 12:49 AM? 7:35 AM How many minutes are there between 8:52 PM and 6:25 AM? 573 What is 693 minutes after 3:18 PM? 2:51 AM What is 102 minutes after 6:23 PM? 8:05 PM How many minutes are there between 7:33 PM and 5:29 AM? 596 How many minutes are there be	{ "pile_set_name": "DM Mathematics" }
Let n(o) = -3o3 + 2o*3 - 6o*2 + 3o3 + o - o3 + 2. Let h be n(6). Calculate the highest common factor of h and 12. 4 Let j(c) = -c*2 - 21c - 27. Let o be j(-18). Calculate the highest common divisor of 81 and o. 27 Suppose 5q + 489 = c, c - 296 = 3q + 3c. Let n = 2 - q. Suppose 0 = 4a + a - n. What is the greatest common divisor of a and 40? 20 Let l = 28 + -24. What is the highest common divisor of 10 and l? 2 Let v(i) = -i*2 + 7i + 3. Let o be v(4). Suppose 2l + o = 1. Let z = l + 13. What is the greatest common factor of 9 and z? 3 Let f = -11 - -12. Calculate the greatest common factor of 4 and f. 1 Let s be 3/(9/6 + 0). Suppose b = sb - 38. What is the greatest common divisor of b and 95? 19 Suppose 4l + 2h - 1204 = 0, 3h + 602 = 2l + 2h. What is the highest common divisor of l and 43? 43 Let g = 68 + -44. Calculate the greatest common divisor of g and 72. 24 Suppose 2v - 2 = -g, 2g + 1 = v + 5. Suppose v = -3i - 0i + 45. What is the highest common factor of i and 135? 15 Let y be -1(-2 + -5 + 0). Calculate the highest common factor of 7 and y. 7 Suppose -105 - 133 = -2w. Let q be (-87)/(-5) - 2/5. What is the highest common divisor of w and q? 17 Suppose 4w - 39 = 3w. Let g = -17 + w. What is the greatest common divisor of g and 11? 11 Let q(j) = j + 11. Let w be q(-9). Suppose t + 262 = 3t + 2k, wt + 4k = 268. What is the greatest common divisor of t and 16? 16 Let y be (3 + -3 + -8)/(-1). Calculate the greatest common divisor of 20 and y. 4 Let f = -109 + 181. What is the highest common factor of 8 and f? 8 Let f(l) = 5l + 3. Let a be f(3). What is the highest common divisor of a and 27? 9 Suppose 7n = 2n + 45. Suppose 5g + n - 29 = 0. Suppose 0 = -2w + 17 - 15. Calculate the highest common factor of w and g. 1 Let q(i) = i*3 + 13i*2 + 18i - 32. Let t be q(-11). Let w(b) = -11b3 + 3b*2 + 3b + 2. Let k be w(-2). What is the greatest common factor of k and t? 12 Let h(r) = 4r2 + 1. Let w be h(-4). Let b(q) = q2 + 3q + 2. Let i be b(-2). Suppose i = l + l - 52. Calculate the highest common factor of w and l. 13 Let y(n) = -31n - 12. Let z be y(-4). What is the highest common divisor of z and 28? 28 Let j be ((-84)/(-16))/(6/16). What is the highest common factor of 42 and j? 14 Let p be (-4 + (-22)/(-8))/((-3)/84). Let n(y) = 12y*2 - 3y - 5. Let l be n(4). What is the greatest common divisor of l and p? 35 Let p(j) = -j - 5. Let i be p(-7). Calculate the highest common factor of 18 and i. 2 Suppose -5q + 64 = 2c, -1 = 2c - 5. Let a(d) = d2 + 5d + 5. Let o be a(-5). Let v be ((-2)/o)/(2/(-40)). Calculate the highest common divisor of v and q. 4 Suppose 5a = 4i + 304, 3i - 117 - 151 = -4a. Suppose 3d - 2 - 20 = -y, -y + 8 = -4d. What is the greatest common factor of y and a? 16 Suppose 3n + 2 = u + 12, 5u = n + 20. What is the greatest common divisor of 25 and u? 5 Let z(i) = 2i2 + 19i - 2. Let b be z(-11). Calculate the greatest common factor of 124 and b. 31 Suppose 0 = s - 52 - 25. What is the highest common divisor of s and 7? 7 Suppose -13v = -9v - 56. Calculate the greatest common divisor of v and 63. 7 Suppose 0 = -2v - 5s - 10, -3v + 37 - 10 = -3s. Suppose -269 + 719 = vg. Calculate the greatest common divisor of g and 36. 18 Let l(r) = r - 242. Let d be l(0). Let x = d + 161. Let h = x - -158. What is the highest common divisor of h and 7? 7 Suppose -5l - 67 = -257. Suppose 6w - w = o + 48, l = 3w + 4o. Calculate the highest common divisor of 50 and w. 10 Let g be -1 - (-2 + 18)/(-2). Let q(h) = h3 + 7h*2 + 2h - 4. Let j be q(-6). Suppose -2a = -ga + j. What is the greatest common divisor of a and 10? 2 Suppose -q = 3q + 80. Let r be ((-5)/1)/(2/q). What is the highest common divisor of 10 and r? 10 Suppose 3h = 11h - 336. Calculate the highest common divisor of h and 105. 21 Suppose -2s - 2g + 4g = -62, 56 = 2s - 4g. What is the highest common factor of 51 and s? 17 Suppose -2d + d - x - 550 = 0, 2d + 1090 = 3x. Let h be (-1)/2 - d/8. Suppose -112 - h = -3w. What is the greatest common divisor of 24 and w? 12 Suppose -2t + h + 6 = 0, -4t - 4h = -0h. Let i = 1 + t. Let j be 1088/12 + 1/i. What is the highest common factor of 13 and j? 13 Suppose t + 24 = 2t. What is the greatest common factor of 60 and t? 12 Suppose 0 = 2w - 3 - 5. Let a(m) = -m*2 + 5m - 1. Let q be a(w). What is the greatest common factor of 33 and q? 3 Suppose -2l + 84 = 28. Suppose -7y + 23 = -6y. Suppose -5r = -2m + 28, -5m + r = y - 93. Calculate the highest common factor of m and l. 14 Let j be -3 - (-30)/(-2)-1. What is the highest common divisor of 108 and j? 12 Suppose -5 = -4j - 1. Let s(r) = r*3 - 5r*2 + 5r + 3. Let n be s(4). Calculate the highest common divisor of j and n. 1 Suppose -104 + 374 = 6g. Calculate the highest common divisor of g and 30. 15 Let z be (-460)/(-40) - 3/(-4)-2. Let p(y) = -2y + 2. Let x be p(-4). What is the highest common factor of x and z? 10 Let n(i) = 2i + 5. Let g be n(7). What is the highest common factor of g and 76? 19 Let s(h) = h*3 + 4h*2 - 4h - 1. Let t be s(-4). Let f = t - 0. Let a = 17 - 2. What is the highest common divisor of a and f? 15 Let t be ((-10)/4)/((-1)/4). Let d be 2/t-2-205. Suppose 3g = -0g - 5w + 190, -3w - d = -g. What is the greatest common factor of g and 28? 14 Let v = 19 + -12. Let f be (1 - 1) + 56/v. Let p = 85 - 45. What is the greatest common factor of p and f? 8 Let y(k) = 3k2 + 3k + 2. Let l be y(-2). Suppose -q - l + 25 = 0. Suppose -33 = -2r + 35. What is the greatest common divisor of q and r? 17 Let p(l) = l - 7. Let v be p(5). Let d be (v/4)/((-2)/320). Suppose 2c - 9 - 11 = 0. What is the highest common factor of d and c? 10 Let u be (-4)/18 - (-7)/(-9). Let j(m) = 19m2 + m. Let b be j(u). What is the highest common factor of 18 and b? 18 Suppose 0 = -5h - h - 84. Let b = 16 + h. Suppose 2p - 20 = -0p. What is the greatest common divisor of b and p? 2 Suppose -6j = -81 - 1047. What is the greatest common factor of 47 and j? 47 Let f = 13 + -131. Let d = f + 193. What is the greatest common factor of d and 30? 15 Let k = 200 - 120. Let l = k - -81. Let r(p) = -2p + 23. Let h be r(0). What is the greatest common factor of l and h? 23 Suppose -5w = -2f + 222, 2f = f + 5w + 101. Suppose 80h = 87h - 77. What is the greatest common divisor of h and f? 11 Let m be (-1)/2(2 + -8). Calculate the greatest common divisor of m and 12. 3 Let p = -97 - -18. Let b = p + 200. Let m be -12 + 1 + 12. What is the highest common factor of m and b? 11 Suppose -15i + 13i = -240. What is the greatest common factor of 15 and i? 15 Suppose 2f - 38 = 6. Calculate the greatest common divisor of f and 2. 2 Let l(f) be the first derivative of 3f*2 - 2 + 3f - 1/3f3. Let v be l(4). What is the highest common divisor of v and 33? 11 Let x(y) = y3 - 2y2 + 2. Let t be x(3). What is the greatest common divisor of t and 11? 11 Let l(q) be the first derivative of -q4/2 - q*3 + 2q*2 - 18. Suppose 3 = -z - 0z. Let y be l(z). What is the greatest common divisor of 120 and y? 15 Let t be -3 + ((-32)/(-6) - (-8)/12). Suppose 5d + 3y - 11 = 0, 2d - 2y - y = -4. What is the greatest common divisor of d and t? 1 Let x be -1 + 27 - (-6 - -4). Let v = x + 2. Calculate the greatest common factor of 15 and v. 15 Suppose -4r + 10 = -2r + 4i, 0 = 2r - 5i - 10. Let k(h) = -7h - r - 17h + 0h + 4. Let a be k(-5). What is the greatest common factor of a and 17? 17 Let p(a) = a3 + a + 97. Let x = 0 - 0. Let k be p(x). Let t = k - 9. Calculate the highest common factor of 11 and t. 11 Let g(s) = s2 - 18s + 50. Let m be g(15). Calculate the highest common factor of m and 15. 5 Let q be (0 - -1) + 0 + 5. Calculate the highest common divisor of q and 2. 2 Let h(z) be the first derivative of 2z*3/3 - 3z*2/2 + 1. Let t be h(2). Let a be (18/(-8))/((-2)/16). What is the highest common factor of a and t? 2 Suppose -6c + 4c + 22 = 0. Let i be (-2 - 0)/2 + 221. Suppose -4g - g = -i. What is the highest common divisor of c and g? 11 Let p(z) = -z**2 + 2 + 7 + 13 - z. Let s be p(0). Let m be (-884)/(-10) - 2/5. What is the highest common	{ "pile_set_name": "DM Mathematics" }
third smallest value in t, -0.4, 2? 2 Let b = -9 + 9.1. Let g = -608 - -1829/3. What is the biggest value in g, -1/2, b, 4? 4 Let z(s) = -2s2 + 4s + 1. Let n = 40 - 37. Let q be z(n). What is the third biggest value in 3/4, 4/5, q? q Let b = 9 - 15. Let x = 5.9 + b. Let i = 0.9 + -0.6. What is the smallest value in i, x, 0.4? x Let i = 456.8 + -457. Let n = -12 - -9. Which is the second smallest value? (a) 6/11 (b) -2/11 (c) i (d) n c Let l = 3 + -3.21. Let f = l - -5.21. Let h = f + -4. Which is the third biggest value? (a) 3 (b) -2/11 (c) h b Let r = -0.05 - 1.95. What is the second biggest value in r, -3/2, -47? r Let r = 2.055 + 0.268. Let j = 0.333 - r. Let v = -0.01 + j. Which is the third smallest value? (a) 1 (b) v (c) -1 a Suppose 4j + 44 = 15j. Which is the third smallest value? (a) -3/8 (b) 17 (c) j (d) 0.4 c Let y = -40 + 54. Let f be (-4)/14 + ((-148)/y)/(-2). Which is the third smallest value? (a) 0.1 (b) 1 (c) f c Let u be -1 - (2 - (2 + -1)). Let t(x) = x*3 + 2x*2 - 2x - 2. Let a be t(u). Let w be (456/(-126) - -4)3/4. What is the second biggest value in w, -3, a? w Let l = 47.19 - 47. Let s = 0.3213 + -0.0613. Let q = l - s. What is the biggest value in -0.3, q, 0.2? 0.2 Let o = 34.86 + -35. Let z = o - -0.14. Which is the second smallest value? (a) -13 (b) z (c) -2/7 c Let m = 18030.4 - 18030. Let v = -3 - -2. Which is the smallest value? (a) -16 (b) v (c) -0.2 (d) m a Let y = 7.16 + -0.06. Let t = y - 6.9. What is the fourth biggest value in 1.5, 2/7, -0.2, t? -0.2 Let n = -0.0112 + 0.0612. Which is the third smallest value? (a) n (b) 0.1 (c) 6 c Let o = -541 - -536. Which is the second smallest value? (a) 1 (b) 0.45 (c) o b Let d = 13 + -11. Let y = 3 - d. What is the third smallest value in y, 5, -3? 5 Let q = 20 + -20.6. Let s be 0 + 2/64. What is the third smallest value in s, -4/9, q? s Let m = 0.4005 + -0.0005. Let z be (-10)/(-44) - (-2)/(-4). Which is the second biggest value? (a) m (b) z (c) -0.2 c Let f = 11.7 + -10.7. Which is the biggest value? (a) -9 (b) -0.5 (c) f (d) 2/15 c Let d be (-544)/12 + (-1 - 2)/(-9). Let b = -41 - d. What is the second biggest value in b, -0.4, 10? b Let n = 1111/5 + -222. Let a be 8/303/(-2). What is the third smallest value in n, a, 5/3? 5/3 Let t be 38/(-665)(9 - 4). What is the third biggest value in -2/191, t, -2? -2 Let v = -21 + -5. Let b = v - -28. What is the smallest value in b, -3, 4/9? -3 Let f = -0.212 - 0.058. Let a = f + -0.03. What is the biggest value in -2/11, a, 4? 4 Let v = -17.57 - -37.57. What is the second biggest value in -1/4, 21, v? v Let n = 41 + -39. Suppose -ns + 9 = 3w + 2s, -s - 2 = 5w. What is the third smallest value in w, 2/3, 0.15? 2/3 Let c = 1198 - 1196. What is the second smallest value in c, -4, -5? -4 Let a = 253 + -258. What is the smallest value in -12, a, -3/2? -12 Let r = 179.9 - 180. Which is the fourth biggest value? (a) 1/5 (b) 20 (c) r (d) -8 d Let f = -2 + 1.8. Let v = 16.6 + -110.6. Let x = v - -96. Which is the biggest value? (a) f (b) 0.3 (c) x c Let i = -4.1 - -14. Let d = i + -4.9. What is the second biggest value in d, 0.1, 0.8, -2/9? 0.8 Let k be -4 - (2088/(-63))/8. Let c = 0.1 - 0. What is the biggest value in k, -3, c? k Let g(b) = -14b - 363. Let i be g(-25). What is the third biggest value in i, 1, 0.5? i Let d = 503 - 515. What is the second smallest value in 0.3, d, 3/4? 0.3 Let g = 614 + -617. Which is the third smallest value? (a) 4 (b) -24 (c) 5 (d) g a Suppose 0 = -24v - 619 - 101. Which is the third smallest value? (a) 7/2 (b) v (c) -2/5 a Let d = 0.1 - 0.01. Let w = d - 9.09. Let m = -4 - w. Which is the third biggest value? (a) m (b) -2 (c) -4 c Suppose 6f - 2f = 8. Which is the smallest value? (a) 1 (b) -2/7 (c) 3/2 (d) f b Suppose 0w - 3w = -90. Let m = 18 - w. Which is the third biggest value? (a) -2/13 (b) m (c) -0.2 b Let y = 14.407 + 0.593. Which is the third biggest value? (a) 3 (b) -0.4 (c) y b Suppose 5t + 0t - 25 = 0. Suppose 25 = 2c + c - to, -3o = c - 13. Let j be (-14)/60 + 4/c. What is the third biggest value in -1, j, 3? -1 Let x = -103.6 - -104. What is the biggest value in -2/15, 0, x? x Let u = 4/7 + -1/14. Which is the third biggest value? (a) u (b) 0.03 (c) 0.3 (d) -0.1 b Let q = -377 + 378. Which is the smallest value? (a) -20 (b) q (c) 3 a Let r = 682 - 681. Which is the smallest value? (a) r (b) -7 (c) -2/13 b Let o be (-46 - -43)(-8)/(-42). Which is the smallest value? (a) -1/21 (b) -3/2 (c) o b Let n(f) = f*2 - 5f + 1. Let v be n(0). Let p be ((-27)/(-432))/(v/6). Which is the fourth biggest value? (a) -5 (b) 1/5 (c) p (d) -7 d Let u = 0.06 - 3.06. Let s be -2 + (46/(-22))/(-1). Let k = 36 + -41. What is the biggest value in k, s, u? s Suppose -90 = 10i - 130. What is the third smallest value in 17, i, 1/2, -5? i Let t = 3799/4 - 948. Which is the third smallest value? (a) t (b) 4 (c) 3 b Let o = 1055 + -1058. What is the second smallest value in o, 44, 1? 1 Let k(j) = j3 + 11j*2 - j + 1. Suppose -5y - 15 = 40. Let o be k(y). Which is the third biggest value? (a) 3 (b) 2 (c) o b Suppose 2b + 5v = -14, -4b - 2v - 57 = -13. Let m be 4/336/b. What is the second biggest value in 2/11, m, 1? 2/11 Let i be 9112/72. Let f = -0.04 - -1.04. Let m = f - 5. What is the smallest value in i, m, 0.1? m Let z = 3 + -2. Let h = -1369 - -1367. Which is the second biggest value? (a) z (b) h (c) -1/3 c Let y = 10 - 6. Let h = -13.72 - -14.12. Which is the fourth smallest value? (a) h (b) 1/9 (c) y (d) -3/10 c Let r = -38 - 9. Let o = -47.4 - r. What is the third smallest value in -4, o, 2? 2 Let u(w) = -w3 - 27w*2 - 27w - 25. Let m be u(-26). Which is the fourth smallest value? (a) m (b) -3 (c) 0.4 (d) -0.5 a Let n(t) = 2t2 - t - 5. Let j be n(3). Suppose -2f = -2k - j, 3k + 0f + 15 = -f. Which is the biggest value? (a) k (b) -0.4 (c) 4/9 c Let r(n) = -37n*2 + 11n + 8. Let t be r(-1). Which is the second biggest value? (a) t (b) 2/7 (c) 3/5 (d) 2/9 b Let u = -0.05 + -0.09. Let i = -0.64 - u. What is the third smallest value in 3/7, i, -0.4? 3/7 Let f = 2882/3 - 960. Which is the third smallest value? (a) 0.03 (b) -2 (c) 0 (d) f a Let b = 0.1502 - -0.1198. What is the second smallest value in -4, b, 0.15? 0.15 Suppose -56g + 59g = 9. Let t be 0((-9)/6)/g. Let x be -1 - (2 - 5)/(-1). What is the third smallest value in 5, x, t? 5 Let j = 0.11 - 1.11. Let o = j - -1.2. Let y = -4.8 + 0.8. Which is the third biggest value? (a) -0.2 (b) y (c) o b Let h = -85 - -81. Which is the second biggest value? (a) h (b) 0.01 (c) -0.4 (d) 4/3 b Suppose 5d = 28 + 22. Let m = -50.41 - -52. Let c = 6.59 - m. What is the third smallest value in d, c, 2/7? d Let g = -15 - -14. Let z(y) = -6y2 + 4. Let v(k) = k2. Let n(c) = gz(c) - 5v(c). Let x be n(0). What is the third biggest value in -0.5, x, 0.3? x Let t = -0.154 + -13.046. Let l = t - -10. Let i = l + 3.25. Which is the third smallest value? (a) -1/3 (b) 2 (c) i b Let h(u) be the third derivative of u6/120 - 7u5/30 + u4/24 - u*3 - 19u*2. Let r be h(14). Which is the biggest value? (a) -4/5 (b) r (c) 0.4 b Let k = -210 - -202. Let i = -316 + 4738/15. What is the smallest value in -2, k, i? k Suppose 8t - 22t = 70. Which is the third biggest value? (a) t (b) 1/9 (c) -1 a Let v = -0.5 + 0.9. Let o = -0.8 - -0.6. Let y = -0.4 - o. Which is the second smallest value? (a) v (b) 2/7 (c) y b Let p be (-15)/(-3)(-4)/(-5). Let v be 2/3(27/(-39))/3. What is the smallest value in p, 7, v? v Let t = -11/15 - -37/30. Which is the smallest value? (a) 2/5 (b) -1/3 (c) t (d) -3 d Let g = -178 - -180. What is the biggest value in -113, 4, g? 4 Let k be ((-27)/(-30))/((-12)/10). Let f = -2.8 + 3. Let r = -2.2 + f. Which is the second smallest value? (a) r (b) k (c) -6/11 b Let g = -1400 + 1404. What is the second smallest value in -0.24, g, -8? -0.24 Let d be 14(147/(-70))/(-21). Let r be (3/6)/(-3 + 4). Which is the biggest value? (a) 5 (b) r (c) d a Let z = -2.6 + -0.4. Let o = -10 + 24. Let c = 9 - o. What is the third biggest value in c, -0.5, z? c Let h = 2.9 - 2.8.	{ "pile_set_name": "DM Mathematics" }
ollect the terms in -240667 - 240669 - 240672 + 722008 - 22l. -22l Collect the terms in 396 - 1174 - 93d3 + 375 + 403. -93d*3 Collect the terms in -45491979k + 45491979k - 43k*3. -43k*3 Collect the terms in -17662089042 + 31x + 17662089042. 31x Collect the terms in -228b*3 - 362b*3 - 179b*3 + 8b*2 - 18b*3 - 1. -787b*3 + 8b*2 - 1 Collect the terms in -139p - 86p + 77p. -148p Collect the terms in -28571y*2 - 851 + 28571y2 - y3. -y*3 - 851 Collect the terms in 6 + 4 - 7 - 7225z + 7212z. -13z + 3 Collect the terms in -1992q + 40 + 21 - 54. -1992q + 7 Collect the terms in 326 - 1144 - 111q + 275 + 276 + 265. -111q - 2 Collect the terms in -154s3 + 95s*3 - 477s*3. -536s*3 Collect the terms in 5425712 - 6p*2 - 5425712. -6p*2 Collect the terms in 917x - 914x - 46x*3 - 4374x*2 - 1 + 4374x*2. -46x*3 + 3x - 1 Collect the terms in -33u2 + 33u*2 - 5u*3 - 2u*3 + 323 + 5u*3 + 325. -2u*3 + 648 Collect the terms in 2095g*3 - 824g*3 - 1325g*3 + 24g. -54g3 + 24g Collect the terms in 716a - 1 + 0 + 1 + 1060a. 1776a Collect the terms in -h3 - 3h3 - h3 + 3h3 - 288h + 4. -2h3 - 288h + 4 Collect the terms in 3v3 - 1248v*2 - 1230v*2 + 2478v*2 + 6604v. 3v3 + 6604v Collect the terms in -298205i + 0i*2 - 3i*2 - 428204i + 2i2. -i2 - 726409i Collect the terms in 4 - 6 - 69t + 5t*2 - 46t + 115t. 5t*2 - 2 Collect the terms in -1 + 1 + 11l - 15l + 1248l*3 - 1. 1248l*3 - 4l - 1 Collect the terms in 1345m2 - 4500m*2 - 22m*3 + 95m*3 + 1579m*2 + 1576m*2. 73m*3 Collect the terms in -167959534852 + 167959534852 - 795d. -795d Collect the terms in 720v + 31v + 114v*3 - 130v*3. -16v*3 + 751v Collect the terms in 47 + 46 - 23p - 103p - 92. -126p + 1 Collect the terms in -7k*2 + 57k*2 - 35 + 35 + 1 - 43k*2 - 1. 7k*2 Collect the terms in -10 - 16 + 5 - 16 - 16 - 17 + 2l. 2l - 70 Collect the terms in 6685o + 3313o - 9988o. 10o Collect the terms in 3j - 2214 + 2j2 - j + 4383 - 2j - 2169. 2j2 Collect the terms in 94a*2 + a - 2a + 71a2 + 4a + 2a. 165a*2 + 5a Collect the terms in 489m2 + 488m*2 + 495m*2 - 2445m*2 + 491m*2 + 490m*2. 8m*2 Collect the terms in -32l + 218 + 45l - 9l - 26l. -22l + 218 Collect the terms in 209793v - 209793v - 122v2 + 141v*2. 19v*2 Collect the terms in -6 - 3569a + 3310a + 20. -259a + 14 Collect the terms in -4717k + 10660k + 32556k. 38499k Collect the terms in -3u2 - 138414u*3 - 3u*2 + 5u*2 - 74251u*3. -212665u3 - u2 Collect the terms in 602 - 22b2 - 200 - 67b*2 - 199 - 203. -89b*2 Collect the terms in 3y*2 - 233y - 2508 + 2504 - 987y. 3y*2 - 1220y - 4 Collect the terms in 3158r2 + 3187r*2 - 9554r*2 + 3172r*2. -37r*2 Collect the terms in -6050h*3 + 3310h*3 - 5439h3 + h2 - h*2. -8179h*3 Collect the terms in 175992y*2 - 34y*3 + 280661y*2 - 144678y*2. -34y*3 + 311975y*2 Collect the terms in 3 + 971f - 674f + 402f - 4. 699f - 1 Collect the terms in 5598t + 5214t + 5213t + 5204t - 21246t. -17t Collect the terms in -701u*2 - 90u*2 + 118u*2. -673u*2 Collect the terms in -4t + 1707t2 - 7t + 4t + 9t. 1707t2 + 2t Collect the terms in 3u3 + 20u*3 - 21u*3 + 25u*2 + 93u + 52u - 16u*2. 2u*3 + 9u*2 + 145u Collect the terms in 14623 - 14623 + 64334x. 64334x Collect the terms in 25h3 - 56 + 17h - 11h3 + 56 - 2552h*2 + 2552h*2. 14h*3 + 17h Collect the terms in 90s + 68 - 45s*3 - 68. -45s*3 + 90s Collect the terms in -a*3 - 88737a + 45156a + 43581a. -a*3 Collect the terms in 11925u - 52u2 - 75 + 75. -52u*2 + 11925u Collect the terms in 694s3 - 2819s*3 + 705s*3 + 27s + 713s3 + 12s + 708s3. s3 + 39s Collect the terms in -158 + 1190n - 1194n + 158. -4n Collect the terms in 8u - 65830371275 + 65830371275 - u2. -u2 + 8u Collect the terms in 12 + 3h*2 - 17182205h + 17182205h - 12. 3h*2 Collect the terms in -2053h - 189h2 - 5448h + 7501h. -189h*2 Collect the terms in -840j*2 + 3890 - 1305 - 1300 - 1284. -840j*2 + 1 Collect the terms in -2821w*3 - 3967w*3 - 2921w*3. -9709w*3 Collect the terms in 15580730f - 31161443f + 71f*2 + 15580713f. 71f2 Collect the terms in 2610g*2 - 12338g*2 - 3781g*2 - 8817g*2. -22326g*2 Collect the terms in 1643x + 59x2 + 2060x*3 - 59x*2 - 2062x*3. -2x*3 + 1643x Collect the terms in 46r - 67r - 145 + 22r + 791 + r2. r2 + r + 646 Collect the terms in 62b*3 + 3b*2 - 3b*2 + 59b*3 + 4 + 86b*3. 207b*3 + 4 Collect the terms in -57011 + 14248 + 14256 + 14251 + 14254 + 430d*2. 430d*2 - 2 Collect the terms in 1746q*3 + 7345q - 7282q - 3488q*3 + 1741q3. -q3 + 63q Collect the terms in 31831p*2 - 9p*3 - 53p + 53p - 63727p*2 + 31896p*2. -9p*3 Collect the terms in -19q - 47q + 28q + 160q - 40q - 50q. 32q Collect the terms in -212409x + 106156x + 106253x + 12x*2 + 5x*2. 17x*2 Collect the terms in -151x + 192x + 86x - 161x + 14x*3 + 34x. 14x3 Collect the terms in -2h - 24000 + 48006 - 24024. -2h - 18 Collect the terms in 24062r*2 - 24058r*2 - 1 + 12 - 11. 4r*2 Collect the terms in -2633r + 5272r + 12r*2 - 46r*2 - 2639r + 32r2. -2r*2 Collect the terms in 49f*3 - 20f*2 + 11f*2 - f - 3 - 25f*2. 49f*3 - 34f*2 - f - 3 Collect the terms in 16c*2 - 165c*2 + 49c*2 + 0c*2 + 5c*2 + 30c*2. -65c*2 Collect the terms in 4320778h*2 - 2 + 2 + 48h*3 - 52h*3 - 4320778h*2. -4h*3 Collect the terms in 31f*2 - 85f*2 + 473f*2 - 597f*2. -178f*2 Collect the terms in -1603p + 5476p - 690p - 1609p - 1600p. -26p Collect the terms in -495t*2 + 92t*2 + 66t*2 + 92t*2 + 75t*2 + 86t*2 + 92t*2. 8t*2 Collect the terms in -6056 - 5967 + 2m*2 - 6023 + 18046. 2m*2 Collect the terms in 8941a*2 - 469321917 + 469321917. 8941a*2 Collect the terms in 23j*3 - 161j*3 + 33j*3 + 27j*3. -78j*3 Collect the terms in -23 - 93z - 44z + 382z. 245z - 23 Collect the terms in -53i*3 + 200 + 0i*2 + 0i*2 - 60i*3 - 200 + 91i*3. -22i*3 Collect the terms in -61j + 95741916 - 95741916 - 2j2 - 153j. -2j2 - 214j Collect the terms in 151954u + 7 - 39494u + 141600u. 254060u + 7 Collect the terms in -4774643l + 4774649l + 42l2 - 33l*2. 9l*2 + 6l Collect the terms in 1538810n2 - n3 + 6n3 - n3 + 0n3. 4n*3 + 1538810n*2 Collect the terms in 10 - 10 + 1044d - 717d2 - 361d. -717d2 + 683d Collect the terms in 1 - 34x + 34x + 775x2 - 2 - 1018x*2. -243x*2 - 1 Collect the terms in 526s - 523s - 10866585 + 10866585. 3s Collect the terms in -1069 - 79m3 - 1072 + 2141 - 100m*3 + 187m*3. 8m*3 Collect the terms in 2o*2 + 6o*3 - 5o*2 + 6 + 42 - 7o + 105. 6o3 - 3o*2 - 7o + 153 Collect the terms in 28498 + 268x - 28498. 268x Collect the terms in -424l3 - 603l*3 + 311l*3 + 334l*3 + 334l*3. -48l*3 Collect the terms in -86 + 178 + 6697c - 93. 6697c - 1 Collect the terms in -26304m*3 + 24472m*3 + 4m - 4m. -1832m*3 Collect the terms in -52 - 62 - 26 + 10i - 8i + 28. 2i - 112 Collect the terms in -35 + 6168554c3 - 6168578c*3 + 134. -24c*3 + 99 Collect the terms in 5234d + 5358d + 5308d - 15889d. 11d Collect the terms in -141002l2 + 46645l*2 - 1 + 46637l*2 + 1 + 47734l*2. 14l*2 Collect the terms in 12357763998 - 41l - 12357763998. -41l Collect the terms in -5451z*3 + 2517z*2 - 2517z*2 - 1 + 5461z*3. 10z*3 - 1 Collect the terms in 99h + 138h + 130h + 314h + 134h - 811h. 4h Collect the terms in 175084f2 - 204240f*2 - 4 + 9. -29156f*2 + 5 Collect the terms in 42q - 15q - 22q + 2178 - 2178. 5q Collect the terms in -172v + 17v3 + 254v + 260v + 2 + 66v. 17v3 + 408v + 2 Collect the terms in 5395d - 340017 - 26213d + 340017. -20818d Collect the terms in o2 + 133007o + 97o3 + o2 - 66501o - 2o2 - 66509o. 97o3 - 3o Collect the terms in -197 + 129l - 194 + 755l + 266l + 391. 1150l Collect the terms in -196 - 10*y + 36 +	{ "pile_set_name": "DM Mathematics" }
Suppose -23a + 3 = -22a. Let m(x) be the first derivative of 1/5x5 + 0x4 + 3 - xa + 0x + 0x*2. Find the third derivative of m(d) wrt d. 24d Let n(h) be the first derivative of 0h2 + 8 + 11/3h*3 + 0h - 5/4h4. Find the third derivative of n(s) wrt s. -30 Suppose y + 5 = 2y. Suppose 3j - 23 = -y. Find the third derivative of 2b + b*2 + 2b*j - 5b*6 - 2b wrt b. -360b3 Let o(p) be the second derivative of 0 + 6p + 2p2 + 0p*3 + 0p*4 + 2/5p*5. Differentiate o(c) with respect to c. 24c2 Let s(f) = -f3 + f*2 - f + 2. Let t be s(-2). Let i = t + -11. What is the second derivative of -2b*2 - 2b*2 + ib2 - b wrt b? 2 Let c(w) = -w4 - w - 1 + w + 0w. Let s(z) = -2z*5 + 5z*4 + z + 5. Let l(u) = 5c(u) + s(u). Find the second derivative of l(k) wrt k. -40k3 Let o(x) be the second derivative of 0x*4 + 0 + 0x*2 + 0x*5 + 1/15x*6 + 1/2x*3 + 2x. What is the second derivative of o(j) wrt j? 24j2 Let c(i) be the first derivative of 11i*4/4 + 3i*2 + 12. Find the second derivative of c(f) wrt f. 66f What is the third derivative of -3f2 - 227 + 6f*3 + 227 wrt f? 36 What is the derivative of 0b + 44 - 3 + 0b - 39b*3 wrt b? -117b*2 Let c be (-3)/(-2) - (-1)/2. Suppose -p + l = -1, 3p + 3l - 15 = cl. Find the second derivative of k - 3kp - k4 + 5k*4 wrt k. 12k*2 Let t = 48 - 43. Let r(z) be the first derivative of 0z*t + 1/6z*6 + 2/3z*3 + 0z*2 + 0z + 0z4 - 2. What is the third derivative of r(h) wrt h? 60h*2 Suppose -5s + 2d + 8 = -3s, -3d = -4s + 16. What is the first derivative of 5c4 - 7 - cs + 10 wrt c? 16c*3 Let g(w) be the second derivative of 1/2w*3 - 2w + 0w5 - 1/42w*7 + 0w*6 + 0w*2 + 0w*4 + 0. What is the second derivative of g(o) wrt o? -20o*3 Let u = -4 + 6. What is the first derivative of 2d + d*3 - ud + 2 wrt d? 3d2 Let f(g) be the second derivative of 5g7/42 - g4/4 + 4g. What is the third derivative of f(b) wrt b? 300b*2 Let u = 11 - 6. Suppose -2 = ur - 22. Find the first derivative of 4d3 + r + 0 - 3 + 0 wrt d. 12d*2 Suppose -2o - 4 = -8. Find the third derivative of 3k2 - 3k*o + 6k*6 - 2k*2 wrt k. 720k*3 Let y(j) be the second derivative of 3j*8/56 - 5j*4/12 + 6j. What is the third derivative of y(v) wrt v? 360v3 Let y(g) be the third derivative of g4/3 + 25g3/6 - g2 + 6g. Find the first derivative of y(h) wrt h. 8 Suppose -3x - x = -8. Suppose -1 = xb - 13. What is the first derivative of -3 - 8j*3 + 4 + bj*3 wrt j? -6j*2 Let l(k) be the first derivative of -6k*5/5 - 3k*3 - 10. Find the third derivative of l(o) wrt o. -144o Let h(b) be the third derivative of -4b5/15 + 7b*4/24 - 45b*2. Find the second derivative of h(m) wrt m. -32 What is the third derivative of 4 - 2x*4 + 0 - 2x*2 - 4 wrt x? -48x Suppose 22 = c + c. Let x(w) = -4w3 - 3w*2 + 4. Let n(m) = -12m*3 - 9m*2 + 11. Let l(k) = cx(k) - 4n(k). What is the third derivative of l(t) wrt t? 24 Let h(g) = g3 - g. Let b(k) = 3k - 4k3 - 1 + 3k*2 - 3k*2 + 0. Let j(u) = b(u) + 3h(u). Differentiate j(m) with respect to m. -3m2 Let a(o) be the second derivative of 6o*6/5 - 14o*2 + 18o. Differentiate a(c) with respect to c. 144c3 Suppose -29 = -5l - 3n, 2l - 3 = 4n - 7. Differentiate -1 - l - 4 + 6 - 2z*3 wrt z. -6z*2 Let d(l) be the second derivative of 3l*7/7 + 17l*3/6 - 11l. Find the second derivative of d(s) wrt s. 360s3 Suppose -4q - 40 = -5g + g, -5q = -4g + 44. Differentiate -gz*4 + 7 + 4z*2 + 2z*2 - 6z*2 with respect to z. -24z*3 Let n(l) be the third derivative of 1/20l*5 + 0l*3 + 0l*4 + 2l*2 + 0 - 1/40l*6 + 0l. What is the third derivative of n(f) wrt f? -18 Let y(t) be the second derivative of t*7/14 + 4t*3/3 + t. Find the second derivative of y(s) wrt s. 60s*3 Find the second derivative of 178w + 17w2 - 4w*2 - 167w wrt w. 26 Let r(x) = -3x + 36. Let z be r(12). Let o(c) be the first derivative of 0c*4 + 0c + zc3 - 1 + 2/5c5 + c2. Find the second derivative of o(q) wrt q. 24q2 Find the third derivative of -589b*3 + 1 + 19b*2 + 579b*3 - 1 wrt b. -60 Let z = 8 + -19. Let m(d) = -7d + 7. Let f(c) = 13c - 13. Let h(y) = zm(y) - 6f(y). Differentiate h(q) wrt q. -1 Let n(i) be the first derivative of -i6/24 + 5i*4/24 + 3i*2 - 2. Let l(g) be the second derivative of n(g). Find the second derivative of l(b) wrt b. -30b Let j(l) be the first derivative of -1/2l2 + 0l - 1 + 1/3l3. What is the second derivative of j(u) wrt u? 2 Let q be (3/4)/(2/8). What is the third derivative of -qy3 + y - y + y2 wrt y? -18 Suppose -2x - 4l - 12 = 0, -4x = -0l - 2l - 26. Let o = x + -2. Find the second derivative of -3c*4 - 2c + oc + 2c wrt c. -36c2 Find the second derivative of z - 12z*4 + z + 4z*4 wrt z. -96z*2 Let v = 9 + -5. Differentiate 5 + 8d + d - vd wrt d. 5 Let b(g) be the second derivative of -1/4g*4 + 0g*3 - 1/30g*6 + 0g*2 + 0 + 3g + 0g5. What is the third derivative of b(k) wrt k? -24k Let r(y) be the third derivative of 2y5/15 - 11y*4/24 - 32y*2. Find the second derivative of r(i) wrt i. 16 Let z = -68 - -68. Let v(m) be the second derivative of -3m + 0 + 1/3m3 + zm*5 + 0m*4 - 1/10m*6 + 0m*2. Find the second derivative of v(a) wrt a. -36a*2 Let h(i) be the second derivative of -3i*8/7 - 2i*4/3 + 28i. Find the third derivative of h(d) wrt d. -2880d3 Let b(p) = -13p*2 - 2p + 16. Let q(s) = 40s2 + 7s - 49. Let r(o) = -7b(o) - 2q(o). What is the derivative of r(a) wrt a? 22a Let d be 110/(-30) - (1 + -5). Let g(b) be the first derivative of 0b*2 + 3 - db*3 - 2b. What is the derivative of g(f) wrt f? -2f Let u be ((-8)/4 + -1)/(-1). Let m(z) be the first derivative of 2/5z*5 + 0z*2 + 2 + 0z*3 - uz + 0z4. Differentiate m(a) wrt a. 8a*3 Let f(z) be the second derivative of 0z*4 + 0z*3 - 1/10z*5 + 3/2z*2 + 3z + 0. Differentiate f(p) wrt p. -6p2 Let n = 24 - 36. Let y be ((-18)/n)/(3/4). What is the third derivative of 0j*3 + 3j*y - 4j2 - j3 - 2j3 wrt j? -18 Let q(z) be the second derivative of z8/8 - 3z*4/4 - 17z. What is the third derivative of q(l) wrt l? 840l3 Suppose 0 = -4t + 3t + 5. Differentiate 9i - ti - 8 + 3i wrt i. 7 Let v(z) = -z3 - z2 + z - 1. Let c(b) = 16b3 + 8b*2 - 16b + 8. Let d(s) = 3c(s) + 24v(s). What is the second derivative of d(u) wrt u? 144u Let r(u) be the third derivative of 0u - 1/8u4 + 1/6u*3 + 0 + 2u*2. What is the derivative of r(i) wrt i? -3 Differentiate 5 + 8o*2 + 16o*2 - 31o*2 wrt o. -14o Let p(j) be the second derivative of j6/90 + j5/20 + 2j4/3 - 6j. Let y(t) be the third derivative of p(t). Find the first derivative of y(n) wrt n. 8 Let c(d) be the first derivative of -3d7/7 - 2d*3 + 2. What is the third derivative of c(x) wrt x? -360x3 Let p(q) be the second derivative of q6/3 + 3q2/2 - 8q. What is the derivative of p(l) wrt l? 40l3 Let q(h) = -h2 - 10. Let b be q(0). Let u = -5 - b. What is the second derivative of w3 - 4w*3 + uw - 4w wrt w? -18w Let k(s) = 28s - 1. Let q(w) = 1. Let l(d) = k(d) + 6q(d). Find the first derivative of l(m) wrt m. 28 Let l(w) = w. Let d(o) = -14o2 - 5o - 11. Let c(h) = d(h) + 5l(h). Differentiate c(q) wrt q. -28q Let h(a) be the third derivative of -17a8/336 - a5/15 - 14a*2. What is the third derivative of h(l) wrt l? -1020l2 Let k = 3 + -1. Let d(g) = g2 - 1. Let b be d(-2). Find the third derivative of -o*2 - bo*4 + 0o*2 + 5ok - o2 wrt o. -72o Let x(i) = 17i*3 - 4i*2 + 3i - 3. Let a(t) = -18t3 + 3t*2 - 2t + 2. Let u(d) = 3a(d) + 2x(d). What is the third derivative of u(y) wrt y? -120 Suppose 13s = 11s + 14. Differentiate 8 - 7 - 7u4 + s wrt u. -28u*3 Let m(i) = i - 2. Let k be m(7). What is the third derivative of -11q - q*3 + kq*2 + 7q + 4q wrt q? -6 Let n(t) = -t4 - t3 - t2 + t - 1. Let x(q) = -42q*4 + 5q*3 + 5q*2 + 54q + 5. Let f(l) = 5n(l) + x(l). What is the second derivative of f(g) wrt g? -564g**2 Let c(n) be the second derivative	{ "pile_set_name": "DM Mathematics" }
ppose k = 3g + 33, 5g - 24 + 127 = 3k. Calculate the remainder when 21 is divided by y/k(-52)/(-10). 8 What is the remainder when 206 is divided by (-336)/16(-8)/12? 10 Suppose 0 = -2i - 3c + 94, 92 = i - 4c + 45. What is the remainder when i is divided by 26? 21 Let p(t) = t*2 - t + 5. Let c be p(0). Calculate the remainder when (2/6)/(1/87) is divided by -15c/((-30)/4). 9 Let i = -38 - -41. Suppose -w = iw - 356. Let c = w + -52. Calculate the remainder when c is divided by 10. 7 Let g = 14 - 6. Suppose 3s - g = 1. Suppose -y + 29 = -i, -2i + 59 - 148 = -sy. Calculate the remainder when y is divided by 17. 14 Suppose -3t + 5h = 2h - 24, -h = 4. Let x be 5(20/t - 4). Suppose -5k - f + 6f = -260, -xf + 20 = 0. What is the remainder when k is divided by 12? 8 Suppose -b = 2, 2k - 3b - 6 = -0k. Calculate the remainder when (-9)/21 + (-365)/(-35) is divided by 12/2 - k/(-1). 4 Let i(l) = 2l - 5. Let x be i(5). Suppose -5g + 115 = xr - r, -5 = r. Calculate the remainder when 159 is divided by g. 24 Let b = 186 - -101. What is the remainder when b is divided by 16? 15 Let t(a) = a2 + 4a + 49. Suppose 3k = 7k - 164. What is the remainder when t(-8) is divided by k? 40 Let r = -58 + 41. Let u = r + 27. What is the remainder when 9 is divided by (2/(-5))/((-1)/u)? 1 Let w = 171 - -9. Calculate the remainder when w is divided by 64. 52 Let m(i) = i + 3. Let n be m(4). Suppose -2r + 3 = -n. Suppose b = 5s - 12, -rb + 3s = -s - 24. Calculate the remainder when 20 is divided by b. 4 Suppose -4 = -4l + w + 19, 0 = 3w - 15. Calculate the remainder when (0 - -96)/3l/4 is divided by (0 - 1 - 28)-1. 27 Let t(h) = h*2 - 2h - 6. Calculate the remainder when 782 is divided by t(-5). 28 Let h(i) = 3i2 - 4i - 2. Suppose -1 = 2o + 9. What is the remainder when h(o) is divided by 12? 9 Let o = -119 - -237. Suppose 0 = -3q - o - 50. Let m = -29 - q. What is the remainder when m is divided by 15? 12 Suppose 0 = -3f + 4f. Suppose 4m = -0o + o + 328, -5o + 385 = 5m. Calculate the remainder when m is divided by 20 + (-12 - (f + -3)). 18 Let t = -1886 - -2055. What is the remainder when t is divided by 69? 31 Let a(f) = 11f - 61. Calculate the remainder when 539 is divided by a(8). 26 Let m(x) = -x*2 + 2x + 5. Let v be m(4). Suppose 2t - 11 = -0q - q, -5t - 3q + 27 = 0. Let s = t + v. What is the remainder when 5 is divided by s? 2 Let p = -8 + 11. What is the remainder when -1 - p - (-46)/2 is divided by 7? 5 Let f = -30 + 44. Suppose n = -h + f, -2h = 5n + h - 66. Calculate the remainder when 35 is divided by n. 11 Let l = -440 - -777. Calculate the remainder when l is divided by 68. 65 Let r(c) = c. Suppose 2k + 2 = -k + 4u, 0 = -4u + 8. Let i be r(k). Suppose 3j - 106 = ij. What is the remainder when j is divided by 27? 25 Let q = -1051 - -1066. Let z = -5 + -78. What is the remainder when 2/(-3) - z/3 is divided by q? 12 Suppose -2o + 1 + 1 = 0. Let a(r) = 37r2. Let f = 231 + -122. What is the remainder when f is divided by a(o)? 35 Suppose -191c = -174c - 1598. Calculate the remainder when c is divided by 29. 7 Suppose -83g + 41344 = -30451. Calculate the remainder when g is divided by 7. 4 Let q(n) = -21n + 22n + 13 + 8 + 4. Let t(i) = i*3 + 3i*2 + 5i + 4. Let c be t(-3). Calculate the remainder when q(c) is divided by 9. 5 Let t = -15 - -56. What is the remainder when (17 + -16)t/1 is divided by 11? 8 Let l = 388 + -30. What is the remainder when l is divided by 10? 8 Let p = 3 - -2. Suppose pa = 3u + 130, -2a - 7 = -5u - 40. Calculate the remainder when a is divided by 12/(-16)-102. 14 Let j(d) = -2d*2 - 2d + 1. Let w be j(1). Let v be (48 + 0)/((-51)/34). Calculate the remainder when 43 is divided by 2/6 + v/w. 10 Suppose q - 64 - 46 = 0. Suppose -3j = 2j - g - 86, 5g = -5j + q. What is the remainder when 51 is divided by j? 15 Let j(f) = f*3 + 11f*2 + 10f + 6. Let o be j(-10). Suppose -99 = -os + 153. What is the remainder when s is divided by 15? 12 Suppose 12z - 7z = 175. Calculate the remainder when z is divided by (9/(-4))/(3/(-12)). 8 Suppose 0 = -4i - 28 + 336. Let r(h) = 4h - 30. What is the remainder when i is divided by r(10)? 7 Let t = 275 + -164. What is the remainder when t is divided by 42? 27 Suppose 4s - 96 = -0s. Let b(n) = 62n*2 + 9n + 7. What is the remainder when b(-1) is divided by s? 12 Let l = -22 - -50. What is the remainder when l is divided by 8? 4 Let y = -348 - -381. What is the remainder when 84 is divided by y? 18 Let t = 21 + -19. What is the remainder when 67 is divided by t/((-44)/(-422)) + (-18)/99? 10 Let h(s) = s*3 - 7s*2 + 8s + 4. Let p = -72 + 90. Suppose 308 = -14g + pg. Calculate the remainder when g is divided by h(6). 13 Suppose -11y + 15y = -4. Let q be 3(-5 - y - -3). Calculate the remainder when (2 - (q + -5))6 is divided by 21. 18 Let s(z) = -44z - 2. Let p = -25 - -24. Calculate the remainder when s(p) is divided by 15. 12 Suppose -4 = -z - 3l, -5l = -z + 4 - 32. Let u(f) = f2 - 5 - 2f*2 - 2 - 11f. Calculate the remainder when 32 is divided by u(z). 15 Suppose 4 = 4b - 0. Let j(t) = -5t + 2. Let y be j(b). Calculate the remainder when 50 is divided by 3/2(-26)/y. 11 Let q = 298 + -168. Let m = q + -78. Calculate the remainder when m is divided by 11. 8 Suppose 0 = -22g + 17g + 825. Calculate the remainder when g is divided by 87. 78 Let a be 1/(((-2)/2)/(-5)). Suppose -ab + 199 = 39. Suppose -128 = -9l + 439. Calculate the remainder when l is divided by b. 31 Calculate the remainder when 203 is divided by 106/2476/10. 13 Let f(v) = v3 - 3v*2 + v - 9. Suppose 8h = 4h - 120. Let d = h - -71. Calculate the remainder when d is divided by f(4). 8 Suppose -3v + v + 2 = 0. Suppose -2f + 0h = 4h + 14, -5h = 4f + 16. What is the remainder when 21 - (-1 - f/v) is divided by 12? 11 Let v(b) = 5b - 23. Suppose 3 = 2a - 11. Suppose -5r = -5h + 170, 6h - 5r = 2h + 135. What is the remainder when h is divided by v(a)? 11 Let b(c) = -4c2 + 3c + 10. Let x be b(6). Let i = x + 219. Calculate the remainder when i is divided by 18. 13 Suppose -2k + 0k = -46. Calculate the remainder when 160 is divided by k. 22 Suppose x = -2g - x - 2, 3g + 4x = 2. Suppose -12f + 7 = -a - 9f, -5f - 21 = 3a. Let o = g - a. Calculate the remainder when 4 is divided by o. 0 Let m = 33 + -26. Suppose -k - mk + 72 = 0. What is the remainder when 24 is divided by k? 6 Let s(p) = 7p2 + 12p - 6. What is the remainder when 163 is divided by s(-4)? 47 Let q(l) = 15l + 102. Calculate the remainder when 43 is divided by q(-6). 7 Let c(g) = -g2 - 8g - 15. Let v be c(-5). Suppose 38 - 1 = r - l, v = -r - l + 43. Calculate the remainder when r is divided by 11. 7 Let b(u) = 10u2 + 4u - 3. Let s = 14 + -9. Suppose -sf + 0c = -2c - 22, f + 3c = 18. What is the remainder when b(1) is divided by f? 5 Suppose -5d = 4m - 390, -10d + 15d + 5m - 390 = 0. What is the remainder when 152 is divided by d? 74 Let r(g) = -g2 - 9g - 4. Let k be r(-8). Suppose 6 - 50 = -kh. What is the remainder when 20 is divided by h? 9 Suppose -177 = 13y - 1204. Suppose -22 = -d - 2h, 5d - 210 = -3h - y. Calculate the remainder when 77 is divided by d. 21 Let j be (117 + -1)(-60)/(-48). Suppose j = -4w + 541. Suppose -o - x - w = -3o, 3o + x - 136 = 0. What is the remainder when o is divided by 16? 15 Let r(h) = h2 - 21h - 23. What is the remainder when 61 is divided by r(24)? 12 What is the remainder when 43 is divided by (-78)/143 + 320/22? 1 Suppose -6w = 3w - 135. Suppose 5t = 5 + w. Calculate the remainder when 27 is divided by t. 3 Calculate the remainder when 2 + (1 - -20) - 0 is divided by (2 + -4)/(-2) + (-3)/(-1). 3 Suppose 89 - 67 = q. Calculate the remainder when 1516 is divided by q. 20 Let t(s) = s3 - 16s*2 - 7s - 16. Let g be t(17). Suppose -12q = -302 - g. What is the remainder when 150 is divided by q? 36 Suppose -6l = -l + 3c - 3, 0 = -3l - 2c + 1. Suppose 3b = -5q + 112, -lq + 28 = 4b - 48. Let a = 31 - -27. What is the remainder when a is divided by q? 18 Let o be 2/(-8) - (85/(-20) - 2). Suppose -os + 175 = s. Calculate the remainder when s is divided b	{ "pile_set_name": "DM Mathematics" }
6? 5 Calculate the remainder when 288 is divided by 106. 76 What is the remainder when 16 is divided by 3? 1 What is the remainder when 414 is divided by 156? 102 Calculate the remainder when 4519 is divided by 20. 19 What is the remainder when 640 is divided by 47? 29 Calculate the remainder when 336 is divided by 193. 143 Calculate the remainder when 702 is divided by 32. 30 Calculate the remainder when 23 is divided by 23. 0 What is the remainder when 338 is divided by 49? 44 What is the remainder when 356 is divided by 15? 11 What is the remainder when 3052 is divided by 65? 62 What is the remainder when 155 is divided by 21? 8 Calculate the remainder when 2432 is divided by 14. 10 Calculate the remainder when 63 is divided by 16. 15 What is the remainder when 2569 is divided by 108? 85 What is the remainder when 75 is divided by 21? 12 Calculate the remainder when 178 is divided by 22. 2 What is the remainder when 382 is divided by 11? 8 What is the remainder when 174 is divided by 23? 13 What is the remainder when 167 is divided by 56? 55 What is the remainder when 782 is divided by 49? 47 What is the remainder when 59 is divided by 13? 7 What is the remainder when 1939 is divided by 27? 22 What is the remainder when 401 is divided by 81? 77 Calculate the remainder when 237 is divided by 8. 5 What is the remainder when 95 is divided by 6? 5 Calculate the remainder when 26 is divided by 4. 2 Calculate the remainder when 1780 is divided by 304. 260 What is the remainder when 284 is divided by 18? 14 Calculate the remainder when 258 is divided by 96. 66 What is the remainder when 5981 is divided by 136? 133 Calculate the remainder when 161 is divided by 77. 7 What is the remainder when 1085 is divided by 3? 2 Calculate the remainder when 1291 is divided by 30. 1 What is the remainder when 523 is divided by 75? 73 Calculate the remainder when 832 is divided by 49. 48 Calculate the remainder when 47 is divided by 4. 3 Calculate the remainder when 455 is divided by 95. 75 What is the remainder when 717 is divided by 36? 33 Calculate the remainder when 56 is divided by 36. 20 What is the remainder when 389 is divided by 14? 11 Calculate the remainder when 4291 is divided by 53. 51 What is the remainder when 387 is divided by 139? 109 What is the remainder when 101 is divided by 14? 3 Calculate the remainder when 373 is divided by 54. 49 Calculate the remainder when 1526 is divided by 139. 136 What is the remainder when 4597 is divided by 184? 181 What is the remainder when 646 is divided by 82? 72 What is the remainder when 1159 is divided by 10? 9 What is the remainder when 644 is divided by 272? 100 Calculate the remainder when 226 is divided by 91. 44 What is the remainder when 359 is divided by 90? 89 What is the remainder when 10259 is divided by 54? 53 What is the remainder when 89 is divided by 46? 43 What is the remainder when 1844 is divided by 71? 69 What is the remainder when 781 is divided by 152? 21 Calculate the remainder when 791 is divided by 88. 87 Calculate the remainder when 31 is divided by 21. 10 Calculate the remainder when 836 is divided by 75. 11 What is the remainder when 188 is divided by 109? 79 What is the remainder when 89 is divided by 45? 44 Calculate the remainder when 2863 is divided by 30. 13 What is the remainder when 4619 is divided by 308? 307 Calculate the remainder when 271 is divided by 8. 7 What is the remainder when 1839 is divided by 71? 64 Calculate the remainder when 59 is divided by 29. 1 Calculate the remainder when 41789 is divided by 64. 61 What is the remainder when 284 is divided by 63? 32 What is the remainder when 6377 is divided by 62? 53 What is the remainder when 1362 is divided by 91? 88 What is the remainder when 397 is divided by 20? 17 Calculate the remainder when 258 is divided by 37. 36 What is the remainder when 43 is divided by 15? 13 What is the remainder when 564 is divided by 81? 78 Calculate the remainder when 594 is divided by 183. 45 What is the remainder when 4275 is divided by 138? 135 What is the remainder when 96 is divided by 79? 17 What is the remainder when 1419 is divided by 16? 11 Calculate the remainder when 2764 is divided by 347. 335 Calculate the remainder when 94 is divided by 14. 10 What is the remainder when 31 is divided by 20? 11 What is the remainder when 2042 is divided by 336? 26 Calculate the remainder when 943 is divided by 160. 143 Calculate the remainder when 117 is divided by 106. 11 What is the remainder when 195 is divided by 12? 3 What is the remainder when 452 is divided by 65? 62 Calculate the remainder when 246 is divided by 28. 22 Calculate the remainder when 960 is divided by 193. 188 What is the remainder when 277 is divided by 89? 10 Calculate the remainder when 243 is divided by 28. 19 What is the remainder when 64 is divided by 6? 4 What is the remainder when 950 is divided by 317? 316 What is the remainder when 407 is divided by 187? 33 What is the remainder when 4 is divided by 3? 1 What is the remainder when 976 is divided by 87? 19 What is the remainder when 209 is divided by 37? 24 What is the remainder when 121 is divided by 42? 37 Calculate the remainder when 56 is divided by 16. 8 Calculate the remainder when 716 is divided by 239. 238 What is the remainder when 1145 is divided by 37? 35 What is the remainder when 257 is divided by 36? 5 What is the remainder when 619 is divided by 196? 31 Calculate the remainder when 1248 is divided by 408. 24 Calculate the remainder when 3010 is divided by 116. 110 Calculate the remainder when 145 is divided by 36. 1 What is the remainder when 8128 is divided by 15? 13 Calculate the remainder when 2082 is divided by 23. 12 Calculate the remainder when 138 is divided by 7. 5 What is the remainder when 76 is divided by 31? 14 What is the remainder when 207 is divided by 52? 51 What is the remainder when 65 is divided by 9? 2 Calculate the remainder when 279 is divided by 40. 39 Calculate the remainder when 2913 is divided by 55. 53 Calculate the remainder when 2144 is divided by 65. 64 What is the remainder when 262 is divided by 30? 22 What is the remainder when 696 is divided by 175? 171 Calculate the remainder when 207 is divided by 207. 0 What is the remainder when 376 is divided by 21? 19 What is the remainder when 397 is divided by 92? 29 What is the remainder when 124 is divided by 103? 21 What is the remainder when 1530 is divided by 73? 70 Calculate the remainder when 121 is divided by 64. 57 Calculate the remainder when 210 is divided by 43. 38 Calculate the remainder when 719 is divided by 52. 43 Calculate the remainder when 19617 is divided by 9. 6 What is the remainder when 213 is divided by 12? 9 What is the remainder when 3517 is divided by 44? 41 What is the remainder when 1617 is divided by 30? 27 What is the remainder when 94 is divided by 27? 13 What is the remainder when 41 is divided by 21? 20 What is the remainder when 183 is divided by 48? 39 Calculate the remainder when 47 is divided by 25. 22 Calculate the remainder when 4873 is divided by 46. 43 What is the remainder when 83 is divided by 24? 11 Calculate the remainder when 176 is divided by 49. 29 Calculate the remainder when 1289 is divided by 76. 73 Calculate the remainder when 94 is divided by 5. 4 Calculate the remainder when 878 is divided by 98. 94 Calculate the remainder when 107 is divided by 27. 26 Calculate the remainder when 410 is divided by 73. 45 Calculate the remainder when 1043 is divided by 134. 105 What is the remainder when 4944 is divided by 28? 16 Calculate the remainder when 1354 is divided by 7. 3 Calculate the remainder when 1847 is divided by 8. 7 Calculate the remainder when 6659 is divided by 74. 73 What is the remainder when 182 is divided by 181? 1 What is the remainder when 127 is divided by 42? 1 Calculate the remainder when 176 is divided by 18. 14 Calculate the remainder when 244 is divided by 68. 40 Calculate the remainder when 1631 is divided by 34. 33 What is the remainder when 220 is divided by 30? 10 Calculate the remainder when 3080 is divided by 1026. 2 What is the remainder when 36 is divided by 10? 6 What is the remainder when 1331 is divided by 14? 1 What is the remainder w	{ "pile_set_name": "DM Mathematics" }
be u(h). Let n be ((-3)/((-12)/200))/(r/78). Round n to the nearest one thousand. -4000 Let k = -19961 + 19961.027015. Round k to 4 dps. 0.027 Let m(t) = -1416009t - 19. Let o = -40 - -47. Let p be m(o). Let v = p - -19312082. Round v to the nearest one million. 9000000 Suppose 459p = 260p + 3613641000. Round p to the nearest 1000000. 18000000 Let o = 16.9 - -0.1. Let j = 428590.00002 + -428573. Let y = o - j. Round y to 4 decimal places. 0 Let l = 263 - 255. Suppose -10466 - 11806 = -lj. What is j rounded to the nearest 100? 2800 Let z = -5.0960038833 + 5.096. Round z to seven decimal places. -0.0000039 Let k = -5101 + 7662.7. What is k rounded to the nearest ten? 2560 Let q be 48/84 + (-1156)/14. Let t = q - -84. Suppose -5l + 2o = -64006, -tl + o = 3o - 25594. Round l to the nearest 1000. 13000 Let y = 74.638 - -0.362. Let i = -75.0000246 + y. What is i rounded to five decimal places? -0.00002 Let g = -23.93 + 25.003. Let m = g - 0.239. Round m to two decimal places. 0.83 Let c(r) = -12579r3 + 14 + 24 - 5r + 2r - 3 - r - 2r*2. Let b be c(-9). What is b rounded to the nearest 1000000? 9000000 Let w = 2.42 + 1.98. Let t = w + -4.400279. Round t to five decimal places. -0.00028 Let y = -6435.5591946 - -5893.559268. Let v = -542 - y. What is v rounded to five decimal places? -0.00007 Let h(q) = 346q + 36. Let y be (2 + 15)1/(-3)-6. Let o be h(y). Round o to the nearest 1000. 12000 Let u be ((-24)/(-40)4)/((-2)/(-526750)). Round u to the nearest 100000. 600000 Suppose 3b + 3j - 459 = 0, -5b + j + 479 = -2b. Suppose 3p - b = -4f, -f + 4p + 2 + 28 = 0. Suppose 1140 = 41i - fi. Round i to the nearest 100. 400 Let y = -3.66926 - -0.06282. Let o = 3.68 + y. What is o rounded to two decimal places? 0.07 Let a = -24206.50035 + 24204. Let p = -10.5 - -13. Let i = p + a. Round i to 5 dps. -0.00035 Let r(i) = 5398i - 24. Let b(l) = -l3 + 4l*2 + 23l - 104. Let v be b(4). Let d be r(v). Round d to the nearest 10000. -60000 Let d = -137636.999925661 + 137637. What is d rounded to 5 dps? 0.00007 Let v = -15488 + 28798. Let s be v/(-3)(30 - -2970). What is s rounded to the nearest one million? -13000000 Suppose 0 = -2p - 2i + 31 + 25, -12 = -4i. Suppose 3b + 3s - 6s - 12 = 0, 5s + p = 0. Let n be b + 1 + 6000210. Round n to the nearest 100000. 1300000 Let r(c) = 26 - 59c - 50 - 49c + 27c. Let f be r(-4). What is f rounded to the nearest one hundred? 300 Let f = -2990027 - -12084427. Round f to the nearest one hundred thousand. 9100000 Suppose -4494 = 2r + 646. Round r to the nearest one hundred. -2600 Let x = 4811140229.000002176 - 4811140483. Let h = x + 254. What is h rounded to 7 decimal places? 0.0000022 Let m be ((-248)/(-24))/(2/(-12)). Let j = -52 - m. Let v = 20 - j. What is v rounded to the nearest 10? 10 Let w = 16953.877 - 17078. Round w to the nearest ten. -120 Let t be 7/28 + 10/(-8) + 3. Suppose -38w - 359004 = 5l - 40w, 0 = -w + t. What is l rounded to the nearest ten thousand? -70000 Let s = 0.5634 - 0.0134. Let f = -0.12 + 1.51. Let h = f + s. Round h to 1 dp. 1.9 Let q = -260 + 260.306. Let f = -0.2818 + q. Round f to 2 decimal places. 0.02 Let s = -126 + 128. Suppose -so - 2r + 1156006 = -o, -2o + 3r = -2311991. Round o to the nearest one hundred thousand. 1200000 Suppose 3142361 = 7a - 2128639. Round a to the nearest ten thousand. 750000 Let z = -107.43 - -107.430037665. Round z to seven decimal places. 0.0000377 Let l = -0.1141 + -53.8479. Round l to the nearest ten. -50 Let x(d) = 5d3 + d2 - 5d + 3. Let t be x(1). Suppose 4v = -th - 30072, -5h - 7510 = -4v + 5v. What is v rounded to the nearest 100? -7500 Suppose 591f + 2285000 = 601f. What is f rounded to the nearest ten thousand? 230000 Let u = 49.3675683 - -0.0601917. Let m = u + 0.06224. What is m rounded to the nearest integer? 49 Suppose 3d = 4h + 967518 + 971410, 2d = -4h + 1292572. Round d to the nearest 100000. 600000 Suppose -10 - 2 = -4d. Suppose -z + 1948226 = -dj, 3j - 4086728 = -2z - 190231. Suppose z = -a + 148241. Round a to the nearest 1000000. -2000000 Let n = -0.6165 - -0.294. Let s = 46.67 - 47. Let h = s - n. What is h rounded to three decimal places? -0.008 Let a = -184.94945152708 + -0.05054491292. Let h = -185 - a. What is h rounded to 7 dps? -0.0000036 Let s = 364265.1391916089 + 26.2708339911. Let o = -364292 + s. Let l = o - -0.59. Round l to six decimal places. 0.000026 Let k = -277.795335 - -277.8. Round k to 3 decimal places. 0.005 Let k = 2423.994402 - 2424. What is k rounded to three dps? -0.006 Let f = -7.5 + 59.5. Let z = -50137.011 + 50085. Let i = z + f. Round i to three dps. -0.011 Let g = 10.369999157 - 10.37. Round g to seven decimal places. -0.0000008 Suppose 3s + 4h = -0s + 48, 43 = 2s - h. Let w be 442/(-22) - 3/(-33). Let y = w + s. Round y to 1 decimal place. 0 Let z = -18706.1376 - -18704. Round z to 0 decimal places. -2 Let w = -27.929462 - 354.072328. Let f = w - -382. What is f rounded to 4 dps? -0.0018 Let m = 591 + -231. Let p = m - 358.648. Let u = p - 1.04. What is u rounded to 2 decimal places? 0.31 Suppose -5q - 64b + 25 = -69b, -2q - 2b + 22 = 0. Let h(s) = 201051s2 + s. Let k be h(-3). Let r be k/(-77) + q/(-14). Round r to the nearest 1000. -24000 Let z = 11209.000005503 - 11209. Round z to seven decimal places. 0.0000055 Let r = -890 + 1104. Let q = r + -213.597. What is q rounded to two decimal places? 0.4 Let f = 47 + -45. Let j(p) = -pf + 3 - 4 + 72p - 74p + 27800p3. Let b be j(-1). What is b rounded to the nearest 1000? -28000 Let n = 0.19 - -235.81. Let s = 236.0000154 - n. Round s to 5 dps. 0.00002 Let i be (-37 + -3)(12 + -5 + -10817). What is i rounded to the nearest 100000? 400000 Let q = 0.371 + 8.299. Let j = -5.4 + 5.17. Let y = j - q. Round y to the nearest integer. -9 Let x = 0.5268 - -2.8692. Round x to one dp. 3.4 Let k = -237 - -483. Let a = -216.14 + k. Let n = a + 2.44. Round n to the nearest integer. 32 Suppose 5t + 331584 = 2n, -4n = t - n + 66310. Let a be t(-19)/(-14) - (-8)/28. What is a rounded to the nearest one hundred thousand? -100000 Let k(c) = -68c3 + 5c - 8. Suppose -51q - 114 = -32q. Let a be k(q). What is a rounded to the nearest 1000? 15000 Let f = -571 - -188.5. Let g = f + 470. What is g rounded to the nearest 10? 90 Let z = 212525 - 212501.4558. Let t = 23.29 - z. Let f = t + 0.25. Round f to 3 decimal places. -0.004 Let a be -4 + -37435506-43/18. Round a to the nearest 100000. 25000000 Suppose 16v - 17v = -104. Let m = -102 + v. Suppose -my + c - 48 = 0, -5y + 2y = -c + 73. What is y rounded to the nearest ten? -30 Let m = -24 - -30. Let k(j) = -j2 + 6j - 1. Let u be k(m). Let c be ((-6636)/(-8) - (-3)/6)u. What is c rounded to the nearest 100? -800 Let h = 42143.772 - 44742.7. Let y = -2589 - h. Let d = y + 0.172. What is d rounded to the nearest integer? 10 Let u be (-10000)/(16/24(-3)/73418). Round u to the nearest one million. 367000000 Let q = -507.5 + 3.5. Let n = q + 503.999999032. Round n to 7 dps. -0.000001 Let j = 42125 - 42125.0000026023. Round j to seven dps. -0.0000026 Suppose 2l - 4k - 1034 = 0, -6k + 2 = -5k. Let r = 11 + -7. Suppose rw - 3o + l = 0, 42 + 215 = -2w + 5o. Round w to the nearest ten. -130 Let w = -216667446825 - -216668696197.600039. Let x = 1249376 - w. Let u = 3.4 - x. What is u rounded to four dps? 0 Let u = 393.27 + 0.73. Let d = u + -394.0001068. Round d to five decimal places. -0.00011 Let z = 44125 - 11607. What is z rounded to the nearest ten thousand? 30000 Let j = 86 - 39. Let q = j + -43. Suppose ql - 68000 = 8l. What is l rounded to the nearest 10000? -20000 Let m = -148344020 - -414500665. Let o = -266156667.9999934 + m. Let b = o - -23. What is b rounded to five dps? 0.00001 Let i = 8613166066.00000318 + -8613165955. Let x = i + -111. Round x to 7 decimal places. 0.0000032 Let n = 13394.007107 + -13394. Round n to four dps. 0.0071 Let r = -426.9676 + -0.0324. Let f = -430.37 - r. Let b = 3 + f. Round b to one dp. -0.4 Suppose -4z + 364620 = -16z. Let v be (-15)/5 + 78*z/(-10). What is v rounded to the nearest 10000? 240000 Let w = 53.789 - 56.1361. What is w rounded to 1 dp? -2.3 Let a = 2.0633 + -202.6733. Let x = a	{ "pile_set_name": "DM Mathematics" }
70/12880)185/74 -46 Evaluate (8/(-1245(-20)/50))/(1(-8)/12). -2/83 What is 9/(-3)4082/(-642915)? 2/105 Evaluate ((-22)/(484/99))/(5/(40/57)). -12/19 What is the value of (2/(-14))/(22757/(-9753))? 3/49 Evaluate (-3(688/48)/(-43))/((-4)/188). -47 What is the value of (-940)/(-235)128/(-288)? -16/9 What is ((-16)/50)/(322(-132)/2310)? 2/115 What is the value of (-5)/((-560)/(-12))9183/137745? -1/140 What is ((598/1012)/13)/(-3)? -1/66 -18405/(-54)(-9)/(-15)13/(-13) -81 What is ((13272/98)/6)/((-36)/210(-20)/12)? 79 Evaluate (24/(-20)11)/(97566/23230). -22/7 Evaluate ((-18)/(1368/19))/((-2)/26). 13/4 What is (-66)/(-77)11/495-15? -2/7 What is the value of (((-44368)/423)/(-59))/((-8)/6)? -4/3 What is (-52)/((-21)/(21/4))? 13 What is (-760)/334410/(-25)? 1/11 What is (22/(-1848)-112)/(21/(-36)-4)? 6 What is the value of -5702/1300(-4)/(-72)6? -9/10 What is (21/(24/(-8)))/((-469)/536)? 8 Evaluate 44/(-3)(3/4)/(6880/2752)5. -22 What is the value of 21/15547622/2884? 1/28 Calculate 6/(-7)98/(-63)(-35)/28. -5/3 (1/20/1410)/(1-2) 0 ((-3)/1)/(20292/561412) -83 What is the value of 3672420/14197530/8? 97 What is (72/(-4992)52)/((-3)/488-2)? -61 What is the value of (-4)/(-1360)(-50235)/(-2955)? 1/20 (-117)/(-65)14640/(-549) -48 What is 4/(1/((-3)/(-5)))85/51-2? -8 Calculate ((3/88)/(2200/3520))/((-4)/22). -3/10 What is the value of (((-2)/(-2))/6)/(8(-26)/78)? -1/16 Evaluate 21(-63/(-648))/(69/2277). 11/6 Calculate (-144720/(-768))/5. 27 What is the value of 2((-2)/8)/(((-5396)/(-190))/((-64)/(-40)))? -2/71 ((-28)/(-616))/(30/(-6930)) -21/2 (-45)/(-17100)38(-2)/(-4) 1/20 ((-1053)/(-351))/(273/(-14)) -2/13 What is the value of -208(-3231/(-3968))/(-4)? 13 Calculate (-553)/((-278712)/10800)(-56)/(-20). 60 (-3)/19(-33098)/(-201) -26 Evaluate (-10)/(32/((-3072)/160)). 6 1374/2(-212)/(-1166) 34 What is ((-8680)/(-560))/(63/378)? 93 What is 1/(-81)(-1188)/(-11616)88? -1/9 What is (16/14)/((-7900)/8295)-30? 36 Evaluate 3/(-49)(720/(-27))/(-8)924/(-528). 5/14 Calculate (-546)/195(-7)/6315. 14/3 Calculate ((-13)/(-26))/((-146)/21608). -74 Evaluate ((80/(-6))/(238/102))/((-46)/(-161)). -20 What is ((-29)/(1015/(-14)))/((-10)/111004)? -111 What is the value of (-180816)/485943043/(-4)? 2/5 What is the value of (-792)/(-80)177/(5841/220)? 66 Evaluate 18/15(-4)/123/54-3. 1/15 Calculate (224/(-38192)31)/(82/(-22)). 2/41 268/69/(-27)1828/184 -67 Calculate (-106)/(3657/69)9. -18 What is (-256)/(-4)(-182)/(4550/50)? -128 What is the value of ((-22)/(-33))/(17/255)? 10 Calculate -1199(8640/704)/(-135). 109 (-77/7)/(1/(224/32)) -49 265/(-10)622/858-13 53 157/(3768/128)1/((-5)/(-40)) 128/3 (2/(-16))/(-18(-38)/19152)234/(-21) 39 Evaluate (((-4)/(-18))/(-2))/((60/702)/(110/(-33))). 13/3 What is the value of (-3)/(-51)(-45)/15((-770)/(-33))/10? -7/17 Calculate 1(-36)/1043566/(-2079). 5/13 What is the value of 720/960392/(-18)? -49/3 What is the value of (-750)/(-350)8(-112)/(-384)? 5 What is (-18)/2(-50)/(-225)-10? 20 What is the value of ((120/(-36))/((-140)/(-42)))/((-8)/1)? 1/8 -6(-196)/336(-184)/28 -23 What is (-30)/(24/4)112/(-20440)? 2/73 What is the value of 2183/4366(16/(-26))/(-2)? 2/13 Calculate 2/(-4)20/50972/((-4374)/81). 18/5 Evaluate -1627/((-108)/(-32))(-34)/68. 64 Calculate (-16)/1344-2824/(-2)-10. 40 Evaluate (((-3021)/114)/(-53))/((-4)/(-736)2). 46 Calculate ((6026/(-1703))/(-23))/(9/122). 4/39 What is ((-15)/(-80))/(692/11072)11/(-1)? -33 What is (-40)/(-25)(6045/65)/3348? 2/45 Evaluate ((513/(-130))/((-34)/(-2312)))/(-2). 17 Evaluate (-5)/259/((-6)/2). 3/5 What is the value of 1144/(-1430)6/((-1092)/(-715))? -22/7 What is ((12/(-5))/(-2))/((-82)/(-191880)156)? 18 ((1080/48)/45)/((-6)/(-124)) 31/3 Evaluate (-46)/1104-726174/54. 58 What is (280/784)/((-85)/272)(-14)/2248? 2/281 What is the value of (9/(-26))/((-405)/2862053)? 6/13 What is the value of ((-7208)/(-15708)154)/((5/(15/(-6)))/3)? -106 Calculate 1/(3/(-28)-1137/((-32058)/(-312))). 7 What is the value of ((-6)/18(-72)/(-2340))/((-8)/(-24))? -2/65 Calculate -4(-19)/(-380)(6375/18)/25. -17/6 Calculate (-6)/((-137)/((-15070)/60)). -11 Calculate (163/1304)/(713/(-34216)). -47 Evaluate ((-11)/(-46)-23)/((-22)/4). 1 ((-1276)/(-10))/22(-10)/10 -29/5 What is ((-73200)/4270)/((-10)/(-56))? -96 (9417/365)/(-43)-5 3 Calculate ((-324)/(-117))/((-8)/(-104)). 36 What is (55/(-15))/(3/(810/(-165)))? 6 Calculate (2600/3250)/((-654)/15). -2/109 What is the value of ((-2)/268)/(1-6(-20)/480)? -2/67 What is 2/(-19)(-37278)/(-48396)? -3/37 1/(-5)(-18270)/1827 2 What is the value of (2/(-63)-77)/((176/12)/(-22))? -11/3 Calculate 14/((-41)/(-37392)224). 57 Evaluate (76/48)/((1845/(-540))/(-41)). 19 What is (-1011)/674(-12)/186? 3/31 (41115/(-10))/((-7)/(-182)-117) 137 (25/(1875/(-100)))/(592/(-814)) 11/6 Calculate (7140/5950)/((-3)/(-5)6/(-171)-1). 57 What is the value of ((-5)/18)/(624400/42816)? -2/105 Evaluate ((-315)/(-126))/((-185)/9). -1/4 What is (((-5)/175)/((-93)/19065))/((-1)/(-7))? 41 What is (((-2548)/126)/(-13))/(212/(-216))? -14 Evaluate 2/66(-9)/7(-1309)/(-374)4. -6/11 Calculate (-19258/26961)/(((-2)/(-4))/((-3)/4)). 3/11 What is the value of (1/(-3))/(6370/17199)? -9/10 What is -3010(-3916)/4984012/(-22)? -129 (2/(-33)2)/((-464)/(-261)(-6)/24) 3/11 Evaluate ((-54)/(-4)67/603)/((-407)/370). -15/11 Calculate (3/(112/198))/(393/(-262)). -33 154/6545-51(55/(-2))/(9/(-6)) -22 Calculate (18/51)/(3675/(-17850)). -12/7 Calculate -14(-13)/18222/(-220)-30. 3 What is (2/(-5))/(19(-89)/194465)? 46 Evaluate ((-7)/2940)/(63/252)-2. 2/105 What is ((-4)/10)/(((-47)/(-16356))/((-125)/(-150)))? -116 (((-6)/14)/((-1452)/25410))/(1/((-56)/(-6))) 70 Calculate 1/(-18)15648/16952. -2/39 Calculate 180(-2)/3(-29)/139224. 60 What is the value of (-200)/3036/96156/(-3)? 130 Evaluate (-2155)/(-1724)(-80)/(-2). 50 180/4(-714)/(-918) 35 What is (2646/(-324))/7153/(-2618)? 3/44 Calculate (-17187)/(-458320)(-10)/3. -1/8 Calculate (-40)/30((-2)/(-3))/(50/(-2925)). 52 ((-5)/1895/((-23750)/100))/((-23)/3) -1/69 -21/(7/7) -2 What is (((-13826)/2976)/223)/((-2)/(-6))? -1/16 Calculate (-132)/7194351/351. -2/109 Calculate ((-4)/(-12)3)/((-2)/(-18))(-18316)/4338. -38 Calculate ((-1125)/(-175))/(((-80)/(-2240))/((-1)/(-8))). 45/2 Evaluate -1021((-3)/(-27)-1)/(311/(-933)). -34 Calculate ((-843)/(-1967))/((-30)/(-35)5)-14. -7/5 (((-660)/308)/15)/((-44)/(-4)) -1/77 What is (-20)/(-1200)24204/(-24)? -17/5 Calculate (-30)/4950-1321/(-4). -1/5 Calculate ((-26)/(1404/(-45)))/(1105/102). 1/13 2/(-5)(-94)/47(-5185)/(-61) 68 (6/((-1500)/(-35)))/(140/(-240)) -6/25 9/(10(-126)/4060) -29 Evaluate (1/(-5))/((7080/(-59))/(-1200)). -2 What is ((-40113)/(-89140))/((-3)/8)? -6/5 Evaluate (((-1050)/28)/(-15))/((-20)/(-336)). 42 47/(-224)-403/((-30)/(-62)) 31 Evaluate (-15)/(-9)7/(98/(-7))48. -40 Evaluate (((-21)/28)/(26/104))/(2/6). -9 What is (-47)/(2820/(-1900))((-18)/10)/(-1)? 57 5/(1/(5838/(-3150)-15)) 139 What is the value of ((-4)/(-12))/((108/18)/(-576))? -32 What is ((-10)/1050-9)/(39/(-2405))? -37/7 What is 213188/(-141)(-27)/(-18)? -52 What is the value of -658/3393(-45)/(-20)? -3/13 Evaluate (37/(-28))/((-5)/120-657). -2/73 (25(-66)/770)/((-6)/70) 25 (((-12)/(-3))/(-16))/((-129)/(-258)) -1/2 What is 1106/(-26)4589/(-1412)(-4)/(-7)? 79 Calculate ((-4)/6)/((-14)/(-10)255/1071). -2 6480/842410/8501 2/221 Evaluate ((560/275)/(-7))/(((-468)/1040)/(3/(-8))). -8/33 What is the value of (-8)/(84/616((-268)/603)/((-2)/(-12)))? 22 What is the value of ((48/(-17))/4)/(1365/(-15470))? 8 Calculate 60104/(-702)(-9)/(-2). -40 What is (40/84)/(4/(-196)7)? -10/3 What is the value of (724/1448)/(((-4)/752-4)/(-2))? -47 Calculate 9((-437)/138-4)/(-6). -19 What is the value of ((-50)/(-44))/((-965)/21230)? -25 (6/(6/(288/(-40))))/((-15)/50) 24 Evaluate (-88)/((9/36)/((-10)/(-20))(-8)/2). 44 What is the value of (546/12)/(((-282)/3243)/((-12)/69))? 91 Evaluate (-21)/((-5292)/(-35))(-9)/(-405)-6. 1/54 Calculate ((480/50)/(-6))/(187/6545). -56 What is the value of ((-90)/(-33))/((-2790)/(-46035))? 45 135/178215/(2025/(-18))-3 1/33 What is the value of (33/(-5))/(	{ "pile_set_name": "DM Mathematics" }
at is g rounded to two decimal places? -0.06 Let h = 4.500019 + -4.5. Round h to 5 dps. 0.00002 Let l = -12.66 - 0.34. Let h = l - -19. Let d = h - 6.08. Round d to one decimal place. -0.1 Let y = -12.04 + 12. Let r = y - -0.03974. Round r to four dps. -0.0003 Let w = 459.19665 - 493.196. Let g = w + 34. What is g rounded to four dps? 0.0007 Suppose -2j - 2 = -3b - 12, -15 = -3j - 3b. Suppose -4g - 3i - 46012 = 0, g - 45984 = jg - 4i. What is g rounded to the nearest 1000? -12000 Let i = -65 - -65.0001. Round i to five dps. 0.0001 Let f = -0.123 + -0.507. Let a = f - -0.630091. Round a to 5 decimal places. 0.00009 Let m = -35 - -19. Let i = -10 - m. Let b = i - 5.2. Round b to one decimal place. 0.8 Suppose 663007 = 5y - 1049888. Let z = -497339 + y. Let k = -91760 - z. What is k rounded to the nearest ten thousand? 60000 Suppose -7z - 2657 = 2873. Round z to the nearest one hundred. -800 Let m be 2 - (-923)/(-26)2/(-1). What is m rounded to the nearest 10? 70 Let g(j) = -1145j - 55. Let t be g(-19). What is t rounded to the nearest one thousand? 22000 Let v(f) = f*2 - 1. Let k be v(-2). Suppose 2l + 4300 = kl. What is l rounded to the nearest one thousand? 4000 Let u(w) = -15w + 7. Let b(p) = -7p - 1 + 2 + 0 + 2. Let r(j) = 13b(j) - 6u(j). Let d be r(-3). What is d rounded to four dps? 0 Let a = -58.9 - -7.9. Let j = a - -20.9. Let n = j + 27. What is n rounded to zero dps? -3 Let n = 785 + -792.03. What is n rounded to 0 decimal places? -7 Let b = 1.4 + -2.1. Let f = b + 0.70000009. What is f rounded to seven decimal places? 0.0000001 Let w = -4.1 - -4.09978. Round w to 5 dps. -0.00022 Suppose 2m + 0m - 16 = 0. Suppose n - p + 82 = p, 2p + m = 0. What is n rounded to the nearest 10? -90 Let l = -8 + 8. Suppose b + 7129955 = j, -j + lj - 3b = -7129955. Let f = j + -12029955. What is f rounded to the nearest 1000000? -5000000 Let s = 0.064 + -0.063895. Let p = 0.1 - 0.1. Let v = p + s. What is v rounded to 5 dps? 0.00011 Let q = 40569 + -310569. Round q to the nearest 100000. -300000 Let h = 54.126 - 0.126. Let k = h + -118. Let j = k + 64.0000027. Round j to 6 decimal places. 0.000003 Let o = 25.30131 + -25.3. Round o to three dps. 0.001 Suppose 3p + 0p - 3006 = 0. Let d be p + 3/(6/(-4)). Let v be 362d/(-12). Round v to the nearest 1000. -6000 Let l = 52 + -46.9. Let r = 6.42 - l. Round r to one decimal place. 1.3 Let n = 0 + 0. Let o be 1 + n - (1 - 1). Let j be o/(3/84) + 1. Round j to the nearest ten. 30 Suppose 3b - w + 28500002 = 0, -3b - 4w = 2b + 47499992. Round b to the nearest one million. -10000000 Let l = 213.199 - 0.199. Let c = l + -195.8. Let g = 16 - c. What is g rounded to 1 dp? -1.2 Let a(q) = -11522q3 - 11q*2 - 4q. Suppose 4k + 3y = 26, 0k + 2k - 20 = 2y. Let m be a(k). Round m to the nearest one million. -6000000 Let b = 59 - 221. Let x = b - -161.31. Let f = 0.69077 + x. Round f to four decimal places. 0.0008 Let i = -328.46313 + 351.4636. Let r = 23 - i. Round r to 4 dps. -0.0005 Let p = -15 - -14.8. Let a = -0.05 - 0. Let y = a + p. What is y rounded to one decimal place? -0.3 Let n = -1.170000077 + 1.17. What is n rounded to 7 decimal places? -0.0000001 Let a = -703566.9 + 703561.8199781. Let j = 5.08 + a. Round j to six decimal places. -0.000022 Let n = -37.11 - -0.11. Let d = 37.00000019 + n. Round d to seven dps. 0.0000002 Let i = 0.106 - 0.27. Let t = i - -0.16234. Round t to four decimal places. -0.0017 Let i(w) = -4w*2 + 0w + 6w + 6w*2 - 3. Let d be i(4). Round d to the nearest 10. 50 Let j = -69.9999951 + 70. What is j rounded to six dps? 0.000005 Let j = 4715480.270539 - 4715490. Let n = j + -0.270099. Let d = 10 + n. Round d to four decimal places. 0.0004 Let t = 13.000019 + -13. Round t to 6 decimal places. 0.000019 Let b be 2500(412/20 + -1). Round b to the nearest ten thousand. 50000 Let a = -12 + 11.86. Let n = -35.76 - -35. Let b = n + a. Round b to zero decimal places. -1 Let n = -0.16 - -7.16. Let g = 7.004 - n. Let b = 8.104 - g. What is b rounded to 0 dps? 8 Let o = 32 - 31.974. What is o rounded to 2 dps? 0.03 Suppose -1449 = -5p + m, 0p + 2m = 3p - 868. Round p to the nearest one hundred. 300 Let a = -16 + 12. Let z = a + 3.991. Round z to 2 dps. -0.01 Let r = -2337239.60069 + 2337229. Let d = -0.01 + -10.59. Let v = r - d. What is v rounded to four decimal places? -0.0007 Let z = 12461971 - 12462087.00089. Let l = -144.6 + 28.6. Let s = l - z. Round s to four dps. 0.0009 Let z = -5.3 + 5.189. What is z rounded to two dps? -0.11 Let w = 165 + -192.7. What is w rounded to the nearest 10? -30 Let c(z) = -1530001z3 - z2 - z - 1. Let w be c(-1). Round w to the nearest 100000. 1500000 Let j = 7757.5095 - 7753. Let h = -4.5 + j. What is h rounded to three dps? 0.01 Suppose -7u + 3u = -24. Let a(d) = 205d + 2. Let m be a(u). Suppose -2v + m = 152. Round v to the nearest 100. 500 Let q = 15 + -13.6. Let f = q + -1. What is f rounded to 1 dp? 0.4 Let s = 0.45 - -42.55. Let i = s - 42.931. What is i rounded to 2 dps? 0.07 Let i = -3 + -17. Round i to the nearest integer. -20 Let d = -473 + 472.99999586. Round d to seven decimal places. -0.0000041 Let x = -50 - -80. Suppose 66433 = 4r - 89567. Let k be (r/1)/((-3)/x). What is k rounded to the nearest one hundred thousand? -400000 Let j = -22 + 125. What is j rounded to the nearest ten? 100 Suppose 4f - 9597 = 5091. Suppose -5g - 10128 - f = 0. What is g rounded to the nearest one hundred? -2800 Suppose -4y - y = -h - 32301, y - 3h = 6463. Round y to the nearest 1000. 6000 Let k = -0.20675 - 0.16859. Let h = -0.4138 - k. Let x = h + 0.039. Round x to four decimal places. 0.0005 Let n = 3.051 + -2.84. Round n to two decimal places. 0.21 Let f = 6 - 4. Suppose fp - 2r + 7212 = 2r, 2p + 2r + 7194 = 0. What is p rounded to the nearest 1000? -4000 Let n = 4.96 + -5. Let b = 18 - 18.87. Let o = n - b. Round o to 1 decimal place. 0.8 Let y(f) = -335132f*3 + f + 1. Let x be y(-2). Suppose 5a - 4900003 = g, 3a - g - 258948 - x = 0. Round a to the nearest one hundred thousand. 1000000 Let i = 0.09947 + -0.099. Round i to four dps. 0.0005 Let w(a) = -1859a*2 - 12a - 4. Let i be w(6). Round i to the nearest ten thousand. -70000 Let f = -15105553 - -9505553. Round f to the nearest 1000000. -6000000 Suppose 0 = 4b, -a - 2a + 10200 = -3b. Let y = -5900 - a. What is y rounded to the nearest 1000? -9000 Suppose -532023 = 2a + 3267977. Round a to the nearest 1000000. -2000000 Let m(u) = 4160003u - 30. Let w be m(10). What is w rounded to the nearest one million? 42000000 Let k(s) = -2s + 5. Let g be k(-5). Let l = -45 + g. Let a be (0 - l/8)4. Round a to the nearest ten. 20 Suppose 29400 = -67b + 73b. Round b to the nearest ten thousand. 0 Let c = 101009573959618517.00000057 + -101009573161598321. Let u = -798020215 + c. Let p = -19 - u. What is p rounded to 7 decimal places? -0.0000006 Let p = -1024.99999481 - -1025. What is p rounded to six dps? 0.000005 Let y = -100 - -99.964. Round y to 2 decimal places. -0.04 Let s = -3978.82926 + 3973.93. Let f = 4.9 + s. Round f to four decimal places. 0.0007 Let m = -1.36 + 1.9. What is m rounded to 1 dp? 0.5 Let s = 1045 - 1045.000000441. What is s rounded to 7 decimal places? -0.0000004 Let z = 0.8 + -0.3. Let u = z - 0.515. Let v = -0.835 - u. Round v to one dp. -0.8 Let b = 0.1704 + -0.18. Let p = 3 + -3.01. Let h = b - p. Round h to three decimal places. 0 Let t = 38022786491282 - 38022653945207.000059. Let w = t - 132545993. Let o = w + -82. Round o to 5 dps. -0.00006 Let l = 0.0489816 - 0.049. Round l to 6 decimal places. -0.000018 Let w = 27.9000199 + -27.9. What is w rounded to six decimal places? 0.00002 Suppose -6a + 15 = -a. Suppose -2o = -s + as + 376, 0 = -o - 5s - 172. Let c = o - -130. What is c rounded to the nearest 10? -60 Let v be (-4)/6 - 8/(-3). Suppose -3u - v = -11. Suppose 3d = 3q + 3899994, 0q - q - ud - 1300006 = 0. Round q to the nearest one million. -1000000 Let z = 6.1 - 4.38. Let p = 1.2 - z. What is p rounded to one dp? -0.5 Let l(w) = 3w3. Let s be l(1). Let z = -1599263 + 2499858. Suppose 2i - c - 1359997 = 0, s*i - c = z + 1139402. What is i rounded to the nearest 100000? 700000 Let q = 9.8 - -0.2.	{ "pile_set_name": "DM Mathematics" }
away 0.0827? -1.0827 What is 1455 + 4.5? 1459.5 What is -1 less than -9862? -9861 What is 528 take away -0.2? 528.2 Put together 0.5 and 1204. 1204.5 What is the distance between 12.3 and -7? 19.3 Calculate -0.13 - -925. 924.87 What is -19 minus -34? 15 Work out -22 + 234. 212 5 + 2.54348 7.54348 122206.9+0.1 122207 Put together 29529 and 2.35. 29531.35 0.155955+-3 -2.844045 What is the difference between 0.091 and 0.118? 0.027 What is 2501.291 + 1? 2502.291 Subtract 8844 from -0.2. -8844.2 What is -0.025 take away -6.7? 6.675 13 - 2.09 10.91 24629 - 18 24611 Calculate -0.7 + -1416. -1416.7 Add -3.05013 and 0.4. -2.65013 Subtract 0.1497 from 0.4. 0.2503 What is the distance between -0.0925 and 646? 646.0925 What is the distance between -0.21 and -0.41? 0.2 What is -133027 minus -0.1? -133026.9 What is 135.1 + -114? 21.1 323.367+0.5 323.867 What is -0.1 - 375? -375.1 -47083+-0.1 -47083.1 Add together 0.1 and 9.137. 9.237 6+-0.095 5.905 Calculate -0.0523 + 0.03. -0.0223 What is -34 less than -82? -48 Add together 0.121 and -7. -6.879 Calculate 10306 - -1. 10307 Work out 2.4 - 0.11. 2.29 What is -1 less than -22780? -22779 What is -110 - 97.5? -207.5 Add 0 and 0.0008. 0.0008 Total of 0.8 and -32020. -32019.2 -4.453 + -11.4 -15.853 Subtract -0.2222977 from -2. -1.7777023 What is 110 + 3? 113 Total of 24245 and 0.4. 24245.4 What is the distance between 2926 and -0.13? 2926.13 Put together -28161 and 0. -28161 What is -2515 plus -0.1? -2515.1 Calculate -0.1 + -0.293323. -0.393323 Total of -1.1534 and -1.8. -2.9534 What is 5 + -4.63? 0.37 What is 0.062 minus 481.1? -481.038 Work out 0.5 - -1002. 1002.5 What is -1.1 + -174? -175.1 Calculate -658.6 - -42. -616.6 Subtract -5 from -33886.8. -33881.8 Work out 141.21 + 0.83. 142.04 What is -1.39 plus 1.2? -0.19 Calculate -0.02 + 21857. 21856.98 Add 9.105 and 4. 13.105 5+6.207 11.207 Work out -0.1 + 1647. 1646.9 Calculate -35 + -0.437. -35.437 Calculate -77306 - 1. -77307 Work out -1679 + 1. -1678 What is -85897 - -10? -85887 Subtract 2922 from 2. -2920 What is the distance between 1190 and 4? 1186 Calculate -112 + -35. -147 Add 1550 and -1035. 515 What is 0.6 take away 86? -85.4 Add 17.986 and 0.5. 18.486 What is the distance between -282280 and 3? 282283 -22.8223 - 0.3 -23.1223 What is the distance between -13 and -101? 88 -1 + -212 -213 What is 36 take away 43? -7 What is 2529 plus -0.3? 2528.7 What is -3 plus -1470? -1473 Put together -432034 and -0.3. -432034.3 Put together 49 and 6. 55 What is 0.456 less than -51.37? -51.826 What is the distance between 0.3 and 5093028? 5093027.7 What is 229 plus 33885? 34114 Add 32 and -4509. -4477 Total of 0.077835 and 26. 26.077835 What is -25 - 1.09? -26.09 Work out 2 - 27.1. -25.1 Sum -4 and 0.79901. -3.20099 What is -0.162 less than 0.09? 0.252 Calculate 0.1384 + 3. 3.1384 Work out -61385 + -0.21. -61385.21 Sum 1.66724 and 0.1. 1.76724 Add -549 and 3. -546 Calculate 12.59 - 1.6. 10.99 Total of 0.06 and -1.8. -1.74 What is -6.5048 take away 4? -10.5048 Work out 649 + -4.78. 644.22 What is 33 + 206? 239 Work out -0.5 + -725. -725.5 What is 2.75 + 150? 152.75 Put together -324.89 and -18. -342.89 -91185+0 -91185 42.54 + 10 52.54 What is the difference between 123930 and 0.2? 123929.8 Calculate -0.232 - 0.086. -0.318 Sum 0.5 and 204.332. 204.832 Work out 0.42216 - -0.4. 0.82216 Sum 10 and 0.689. 10.689 Work out -13.8134 + 0.2. -13.6134 -0.2+1938 1937.8 What is the difference between -0.2 and -59.19? 58.99 Calculate 1034 - 2068. -1034 1355570+-2 1355568 What is the difference between -52149 and -28? 52121 Add -28 and 19582. 19554 0.124+-0.32124 -0.19724 Work out 26.93 + 5. 31.93 What is 602 minus 0.07? 601.93 What is the difference between 265 and 0.3? 264.7 What is the difference between -0.018 and 1626? 1626.018 -0.03 + -78976 -78976.03 Subtract 0.68 from -479. -479.68 What is 0.08 plus -660.8? -660.72 Calculate 0 - 2.34. -2.34 Work out -3.1988 - -0.2. -2.9988 What is the difference between 0.3 and -0.03801? 0.33801 10 + 0.0183 10.0183 0.575+-889 -888.425 Put together 0 and 166426. 166426 Subtract 0.0471522 from -2. -2.0471522 Sum -3 and 0.0012. -2.9988 What is -0.1577 + -63? -63.1577 What is the distance between 396.8 and 133.5? 263.3 What is 5.6213 less than -0.5? -6.1213 Calculate -575 + 0.74. -574.26 What is -788 minus 0.06? -788.06 Sum -18297 and -0.04. -18297.04 0.3 - -1499207 1499207.3 What is 13.3013 less than -0.07? -13.3713 What is -1.12 plus -8? -9.12 Add -0.4 and -0.069364. -0.469364 -0.34+-7475 -7475.34 49+26107 26156 Calculate -2 - 66. -68 What is -2.701 plus 0.0814? -2.6196 Add 0 and -2134.6. -2134.6 Work out -2394 + -0.2. -2394.2 What is -5 minus -4448.07? 4443.07 2 - -240129 240131 Work out 30 - 0.5488. 29.4512 -3+577 574 What is 4 + -0.763? 3.237 Work out 0.003535 - -1.5. 1.503535 What is the distance between 9 and -79? 88 What is -12.5 less than 0.2? 12.7 What is the difference between 0.35 and 5? 4.65 Total of 476 and -0.271. 475.729 -0.19+1.87 1.68 Work out 278 + 1.5. 279.5 What is -0.2 plus 2.82? 2.62 What is 41679 + 6? 41685 Sum -0.017 and 1.114. 1.097 0.5+-30 -29.5 Add together -1360.269 and -4. -1364.269 Add together 9.6 and 2. 11.6 Add together -42 and -34321. -34363 43.1+19 62.1 -35 + -68 -103 Work out 203698 - 11. 203687 What is 7 less than 8273? 8266 Work out -56.64 + -0.049. -56.689 Work out 1 + -0.137001. 0.862999 -0.4 - 1407683 -1407683.4 -4.4 + -5 -9.4 Work out 68364 + 2.7. 68366.7 What is -1 minus 181.186? -182.186 -0.4+-0.0210044 -0.4210044 Total of 689 and 0.7. 689.7 Calculate 1080 + -0.001. 1079.999 Calculate -213 + -11.09. -224.09 4.6 + 24 28.6 What is the distance between 1.669 and 1566? 1564.331 Add together -4655 and 531. -4124 Sum 0.3 and 0.0141. 0.3141 What is the distance between -0.1023 and -534? 533.8977 -0.1 + 3331.7 3331.6 What is the distance between 58 and -0.063? 58.063 -517 - -17 -500 What is the distance between 0.5 and 0.06734? 0.43266 What is -4.2 minus 0.948? -5.148 What is 0.0696 less than 3? 2.9304 Work out 0.4 + 1334. 1334.4 What is the difference between 0.034 and 17098? 17097.966 What is -7 + -0.1142? -7.1142 What is 0.8 + 101? 101.8 What is the distance between -113409 and -0.1? 113408.9 147+241 388 -1.77 + 542 540.23 Work out 6.9 - -1097. 1103.9 What is -182767 plus 1.7? -182765.3 Add together -0.3 and 870136. 870135.7 Total of 36.53 and 2. 38.53 Calculate -53.697 - -0.34. -53.357 5788 + 0.2 5788.2 0.61+-0.03 0.58 Subtract -4.3 from 695. 699.3 74+26 100 Add together -195.01 and -0.3. -195.31 Total of 439 and 189.2. 628.2 Sum 0.4 and -105149. -105148.6 Subtract -1272 from 33.9. 1305.9 Work out 1593 - 0.1. 1592.9 Calculate -537 - -0.05154. -536.94846 Total of 0.55 and -0.588. -0.038 Work out -0.1 - -2.12. 2.02 What is -103 minus 32? -135 Add together -0.3 and -7890.4. -7890.7 Work out 252297 + -1. 252296 Total of -276391 and 0. -276391 What is -2 plus 2520.6? 2518.6 Calculate 25731.9 + 2. 25733.9 Put together 1374 and 0.9. 1374.9 Work out -20.43 - -10.8. -9.63 Add together -1193 and -0.28. -1193.28 Add 36.7 and 2030. 2066.7 -0.4 + -2090 -2090.4 -17.8 - 0.07 -17.87 Add 0.35 and 38.97. 39.32 Put together -6.7702 and -1. -7.7702 Calculate -587 + -1. -588 Put together -0.3 and -1588.058. -1588.358 12 + 111050 111062 Calculate -370199 + -0.2. -370199.2 What is 17 + 6195? 6212 What is 242.38 minus -0.1? 242.48 Sum -54588 and 6. -54582 What is 0.5 - -0.30263? 0.80263 What is 0.093 less than -0.09? -0.183 What is -9494732 take away -0.4? -9494731.6 Add 5.7 and -171.78. -166.08 What is 5689 - -8? 5697 Calculate -8 + 416. 408 What is the distance between -0.5 and 11815.26? 11815.76 What is 0 + -0.007603? -0.007603 Put together -7710 and 0.5. -7709.5 Calculate 14395 + -0.21. 14394.79 What is the distance between -2064 and 0.087? 2064.087 1215537 - -0.3 1215537.3 Total of -3.4 and 690. 686.6 What is 34075.3 plus 5? 34080.3 Subtract -3199 from -0.7. 3198.3 -128425 - -0.19 -128424.81 Calculate 0.94228 + 0.02. 0.96228 What is the distance between -5311 and 0? 5311 Work out -230.4 - 0.5. -230.9 152233 + 0.1 152233.1 Work out 1249.25 - -0.2. 1249.45 38.93 + 20 58.93 Work out -4038 - -0.5. -4037.5 Work out -23613 + -4.2. -23617.2 -0.00448424+3 2.99551576 What is 0.33 minus 3755? -3754.67 -0.1 + -0.27 -0.37 Put togethe	{ "pile_set_name": "DM Mathematics" }
p*3 + 3133495082p - 3133495082p. -3p*3 Collect the terms in -1647h*2 + 5141h*2 - 2 - 1653h*2 - 2 - 1832h*2 + 4. 9h*2 Collect the terms in f - 26f - 316f3 + 3f*2 + 25f + 326f3 - 3f*2. 10f*3 Collect the terms in 23a*2 + 2136a*3 - 430a*3 - 424a*3 - 429a*3 - 432a*3 - 428a*3. -7a*3 + 23a*2 Collect the terms in 273c*3 + 2c - 16c + 44c*3 + 14c. 317c3 Collect the terms in -303 + 29m*2 - 135m*2 - 75m2 - m3 + 303. -m*3 - 181m*2 Collect the terms in 2501g - 1804g + 2689g + 4176g. 7562g Collect the terms in 2 - 2 - 47941f2 + 47941f*2 + 33113f*3. 33113f*3 Collect the terms in -292l - 286l - 295l + 1736l - 289l - 285l - 283l. 6l Collect the terms in 132a - 391a - 7a*2 + 134a + 0a2 - a2 + 125a. -8a2 Collect the terms in 26131b - 7287b - 9421b - 9421b. 2b Collect the terms in 30 + 32 + 5608x + 24 + 30 - 116. 5608x Collect the terms in -5027k - 2k*2 + 5k*2 - 4529k + 9556k. 3k*2 Collect the terms in 17z + 3z2 - 17z + z3 - 3764173 + 1882094 + 1882079. z3 + 3z2 Collect the terms in 4474k + 3399k - 8081k. -208k Collect the terms in -2k - 36 + 18 + 4k - 14k*2 - 16k*2 + 8k*2. -22k*2 + 2k - 18 Collect the terms in -341f + 98f - 2365 - 138f + 2362. -381f - 3 Collect the terms in 2 - 498z2 + 1411z*2 - 499z*2 - 483z*2. -69z*2 + 2 Collect the terms in 91i*3 + i - 283 - 1437 + 490i3 + i2. 581i3 + i2 + i - 1720 Collect the terms in -3010d*3 + 12d + 2d2 + 3017d*3 - 2d*2 - 12d. 7d3 Collect the terms in -10 - 27 + 19i + 0i - 21i + 37. -2i Collect the terms in 65847o - 131690o + 65846o. 3o Collect the terms in -3776m*3 + 1814m*3 + 1874m*3. -88m*3 Collect the terms in -102l*3 + 1616l + 103l3 - 1616l - 3. l*3 - 3 Collect the terms in 10342g + 0 - 5 + 2 - 8202g + 3. 2140g Collect the terms in -728 - 798 + 116s + 1526. 116s Collect the terms in 7 - 4d - 37 + 2 + 5 + 9 + 10. -4d - 4 Collect the terms in -789w - 135w + 191w + 1. -733w + 1 Collect the terms in 7p3 - 70 - 43 - 64 + 3p - 47p2 + 125. 7p*3 - 47p*2 + 3p - 52 Collect the terms in 3262a - 652a + 4a3 + 3008a. 4a3 + 5618a Collect the terms in 1368 - 4102 + 1371 - 7034n + 1361. -7034n - 2 Collect the terms in 19s - 21s + 0 + 18 - 2 - 8. -2s + 8 Collect the terms in -856689j + 428347j + 428337j. -5j Collect the terms in -86s - 94s + 417s + 27s - 272s. -8s Collect the terms in 194979c*2 + 215984c*2 - 66639c*2. 344324c*2 Collect the terms in 48 - 243620y*2 - 60648y*2 - 48. -304268y*2 Collect the terms in 1 + 615q*3 - 286q*3 - 269q*3 - 38q*3. 22q*3 + 1 Collect the terms in 3f*3 + 861395f + 861417f - 1722801f. 3f3 + 11f Collect the terms in 4b3 - 4b*3 + 1570b + b*3 + 1366b + 1298b. b3 + 4234b Collect the terms in -88x3 + 67669958635x - 67669958635x. -88x*3 Collect the terms in 0 + 90c - 51c + 53c + 39c - 5. 131c - 5 Collect the terms in -8458x3 - 9477x*3 + 17926x*3. -9x*3 Collect the terms in 6681h - 2215h - 2253h - 2212h - 4 + 4. h Collect the terms in -265150 - 265141 + 5s - 265145 - 5s2 + 795436. -5s*2 + 5s Collect the terms in -17695 - 8m2 + 2m + 2m2 + 8853 + 9371. -6m*2 + 2m + 529 Collect the terms in 1884573j - 373894j + 353176j + 856379j. 2720234j Collect the terms in -4h - 10h - 853 - 4h + 25h - 6h. h - 853 Collect the terms in -13503338d + 6751699d + 6751635d. -4d Collect the terms in -2592y3 + 1101y*3 + 512y*3 + 489y*3 + 502y*3. 12y*3 Collect the terms in -9 - 36111s*2 + 36110s2 + s - 8 + 17. -s2 + s Collect the terms in -11f3 - 1093598 + 3280779 - 1093590 - 1093591. -11f*3 Collect the terms in -429l + 94l + 9l + 56l - 3l + 80l. -193l Collect the terms in -768377379j + 468j*3 + 768377379j. 468j3 Collect the terms in -75d*2 - 79d*2 - 75d*2 + 493d*2 - 74d*2 - 83d*2 - 108d2. -d2 Collect the terms in 4933y + 4939y + 4949y - 14816y. 5y Collect the terms in -267 + 85 - 8b*3 + 182 - 5b + b*2. -8b3 + b2 - 5b Collect the terms in -60d - 54d - 53d + 879d - 58d - 644d. 10d Collect the terms in -6 + 31 - 2 + 1404j - 1423j - 9 - 14. -19j Collect the terms in -1977 + 3820 - 1843 + 6f*2. 6f*2 Collect the terms in 769w*3 - 764w*3 - 226802w*2 + 226802w*2. 5w*3 Collect the terms in -17579710 + 17579710 - 610d*2. -610d*2 Collect the terms in -80a - 62a - 58a + 592a - 52a - 341a + 3. -a + 3 Collect the terms in 36815p*2 + 28960p*3 - 14485p*3 - 14477p*3. -2p*3 + 36815p*2 Collect the terms in 9j + 18j + 654587 - j2 - 654587 - 31j. -j*2 - 4j Collect the terms in -5z3 - 103566264 - 2z3 + 103566264 + z2 - z*2 + 13z. -7z3 + 13z Collect the terms in -1347k3 - 234 + 233 + 1271k*3. -76k*3 - 1 Collect the terms in 218755t*3 - 154028t*3 + 741423t*3. 806150t*3 Collect the terms in 110504b - 55306b - 55202b. -4b Collect the terms in 336p*2 - 111p - 28 - 169p2 + 26 - 165p*2. 2p*2 - 111p - 2 Collect the terms in -8 - 4 + 3 + 0 + 8 + 212i. 212i - 1 Collect the terms in -69011 + 19y - 69005 + 207018 - 69004. 19y - 2 Collect the terms in 24l3 + 17356l + 11l3 - 8691l - 8665l - 10l*3. 25l*3 Collect the terms in 8 - 12c*2 - 4c + 5c + 32c*2 + 33c*2 - c. 53c*2 + 8 Collect the terms in 1486x*3 - 1261x*3 + 1843x*3. 2068x*3 Collect the terms in 97d*3 + 4096 - 2042 - 94d*3 - 2054. 3d*3 Collect the terms in -6198 - 4d + 19d - 2237 + 3d. 18d - 8435 Collect the terms in -4603f + 6777f + 6271f + 7642f. 16087f Collect the terms in -1197k + 67 + 180 + 2370k - 1175k. -2k + 247 Collect the terms in -127f + 45 - 70 + 134f. 7f - 25 Collect the terms in 243n*2 + 1083n - 4371n + 1098n + 1097n + 1093n. 243n2 Collect the terms in 120 - 139y - 190y + 324y + 141. -5y + 261 Collect the terms in 691p + 140p2 - 1379p - 572p2 + 688p. -432p2 Collect the terms in -9423j*3 + 4692j*3 + 4720j*3 + 10j*2. -11j*3 + 10j*2 Collect the terms in -324 + 95 + 99 + 84 - 7u*2 + 5u*2. -2u*2 - 46 Collect the terms in -55f + 19f - 65f - 6f - 13f + 16f. -104f Collect the terms in -6206c - 36406 + 36405 + 6194c. -12c - 1 Collect the terms in -l3 - 193183l*2 + 386710l*2 - 193374l2. -l3 + 153l2 Collect the terms in 854r*3 - 933r*3 + 87r*3. 8r*3 Collect the terms in -8 - 2676333s - 9 + 2676481s - 3. 148s - 20 Collect the terms in -6 - 32825k + 164139k - 32832k - 32823k - 32830k - 32830k. -k - 6 Collect the terms in -1060847 - 15404f3 + 1060847 + 15407f*3. 3f*3 Collect the terms in 808 + 36391o - 808. 36391o Collect the terms in 1123359 - 1123359 - 915f. -915f Collect the terms in -12492k*2 - 12783k*2 + 24755k*2. -520k*2 Collect the terms in -2r*2 - 1087853281r + 543926637r + 2r*2 + 2r*3 + 543926644r. 2r3 Collect the terms in -2729 - 2j - 8581 + 1911. -2j - 9399 Collect the terms in u - 8u*2 + 9 + 20u*2 - 6u*2 - 1395u*3 - 9. -1395u*3 + 6u*2 + u Collect the terms in 75245977 - 75245977 - 73s*2. -73s*2 Collect the terms in -63d + 118d - 9d + 110d + 3673. 156d + 3673 Collect the terms in 9g2 + 9g*2 - 20g*2 + 4287g - 17 + 52. -2g2 + 4287g + 35 Collect the terms in 26 - 414 + 860y2 + 1593y*2. 2453y*2 - 388 Collect the terms in 565741 - 282863 - 282878 + 126j*3. 126j*3 Collect the terms in 4037p + 4047p - 16102p + 4056p + 3972p. 10p Collect the terms in -3655883692h*2 - 3h*3 + 3655883692h*2. -3h*3 Collect the terms in -100u*3 + 446u*3 + 31u*3 + 1162u. 377u3 + 1162u Collect the terms in -17c3 + 4c*3 + 6c2 - c3 - 2c3 - 4c*2 + 27. -16c*3 + 2c*2 + 27 Collect the terms in -3823w*2 + 15 + 2199w*2 - 15 + 2741w*2. 1117w*2 Collect the terms in -94458d - 161162d - 104232d. -359852d Collect the terms in -365v*2 + 561v + 126v2 - 557v. -239v2 + 4v Collect the terms in -10 + 2d - 4d + 27 + 1841d2. 1841d*2 - 2d + 17 Collect the terms in 4418a3 - a + 0a + 3760a3 - 6a*2. 8178a*3 - 6a**2 - a Collect the terms i	{ "pile_set_name": "DM Mathematics" }
igit of 324010871? 1 What is the ten thousands digit of 48515004? 1 What is the hundreds digit of 30163571? 5 What is the millions digit of 237548294? 7 What is the hundreds digit of 206903151? 1 What is the thousands digit of 106752628? 2 What is the ten thousands digit of 820259998? 5 What is the ten thousands digit of 457773601? 7 What is the hundreds digit of 419692? 6 What is the thousands digit of 485292010? 2 What is the ten thousands digit of 91571961? 7 What is the hundred thousands digit of 603199175? 1 What is the ten millions digit of 144735927? 4 What is the thousands digit of 125110686? 0 What is the hundred millions digit of 2275966916? 2 What is the hundred thousands digit of 1594433105? 4 What is the ten thousands digit of 16330798? 3 What is the ten millions digit of 812496775? 1 What is the units digit of 4407060724? 4 What is the ten millions digit of 337746057? 3 What is the billions digit of 2383928755? 2 What is the units digit of 8226268573? 3 What is the ten thousands digit of 56508135? 0 What is the thousands digit of 652278003? 8 What is the ten thousands digit of 1232806640? 0 What is the ten thousands digit of 171651623? 5 What is the tens digit of 1436236495? 9 What is the ten thousands digit of 6744886883? 8 What is the tens digit of 1150601842? 4 What is the hundred thousands digit of 114403438? 4 What is the ten millions digit of 2101308984? 0 What is the hundred millions digit of 3846926028? 8 What is the tens digit of 60010711? 1 What is the millions digit of 3687908094? 7 What is the ten millions digit of 67247511? 6 What is the tens digit of 154849940? 4 What is the tens digit of 113278845? 4 What is the ten thousands digit of 179724653? 2 What is the tens digit of 1997321542? 4 What is the tens digit of 1350578403? 0 What is the units digit of 2149360238? 8 What is the hundred thousands digit of 43529360? 5 What is the billions digit of 2185206013? 2 What is the hundred millions digit of 176140307? 1 What is the ten millions digit of 314613299? 1 What is the tens digit of 34337980? 8 What is the hundreds digit of 87324336? 3 What is the hundred millions digit of 119460673? 1 What is the millions digit of 362676810? 2 What is the ten thousands digit of 141588286? 8 What is the hundred thousands digit of 110186602? 1 What is the hundreds digit of 47608607? 6 What is the ten thousands digit of 1633513138? 1 What is the hundred thousands digit of 938969672? 9 What is the hundred millions digit of 150900877? 1 What is the units digit of 87367172? 2 What is the millions digit of 53376329? 3 What is the hundreds digit of 22688337? 3 What is the hundreds digit of 1416936076? 0 What is the tens digit of 107242787? 8 What is the billions digit of 3524833135? 3 What is the ten millions digit of 362476301? 6 What is the hundred millions digit of 2518979538? 5 What is the ten millions digit of 230922124? 3 What is the ten thousands digit of 7882165062? 6 What is the units digit of 66951248? 8 What is the tens digit of 18634454? 5 What is the tens digit of 50936695? 9 What is the ten millions digit of 2384051919? 8 What is the millions digit of 155206590? 5 What is the ten thousands digit of 502833722? 3 What is the millions digit of 163261220? 3 What is the hundred thousands digit of 896470931? 4 What is the ten millions digit of 132907998? 3 What is the hundred thousands digit of 235112113? 1 What is the hundreds digit of 859581473? 4 What is the units digit of 33156218? 8 What is the billions digit of 1096471473? 1 What is the thousands digit of 215348700? 8 What is the thousands digit of 27481311? 1 What is the ten thousands digit of 745385687? 8 What is the billions digit of 1826253489? 1 What is the ten millions digit of 2421383402? 2 What is the ten millions digit of 3812386501? 1 What is the hundred thousands digit of 28503727? 5 What is the thousands digit of 35282874? 2 What is the hundred millions digit of 301170457? 3 What is the tens digit of 13336015? 1 What is the hundreds digit of 54150705? 7 What is the hundred thousands digit of 229979795? 9 What is the billions digit of 5332679287? 5 What is the tens digit of 1838082841? 4 What is the billions digit of 4274450725? 4 What is the millions digit of 74794647? 4 What is the hundreds digit of 10600957? 9 What is the ten millions digit of 252350069? 5 What is the ten millions digit of 98038083? 9 What is the ten thousands digit of 733800758? 0 What is the thousands digit of 2653793893? 3 What is the ten thousands digit of 73651109? 5 What is the units digit of 68140566? 6 What is the units digit of 44974866? 6 What is the ten millions digit of 21693914? 2 What is the thousands digit of 632906567? 6 What is the ten thousands digit of 27622039? 2 What is the units digit of 3268513? 3 What is the hundred thousands digit of 1430396103? 3 What is the hundreds digit of 34253711? 7 What is the millions digit of 452023924? 2 What is the units digit of 1217561798? 8 What is the tens digit of 2838230992? 9 What is the hundreds digit of 8615408618? 6 What is the thousands digit of 314541112? 1 What is the ten millions digit of 3285494422? 8 What is the millions digit of 104866998? 4 What is the thousands digit of 90614736? 4 What is the hundred thousands digit of 816252513? 2 What is the ten thousands digit of 853326545? 2 What is the hundreds digit of 1046422179? 1 What is the ten thousands digit of 173792683? 9 What is the thousands digit of 17525372? 5 What is the hundred thousands digit of 315016699? 0 What is the millions digit of 1269612683? 9 What is the hundreds digit of 4130837368? 3 What is the thousands digit of 286048301? 8 What is the tens digit of 469198781? 8 What is the hundred millions digit of 7737690667? 7 What is the hundreds digit of 186028802? 8 What is the ten thousands digit of 62780814? 8 What is the millions digit of 986882233? 6 What is the thousands digit of 11138886? 8 What is the thousands digit of 1582628385? 8 What is the hundred thousands digit of 107330849? 3 What is the hundreds digit of 5285712921? 9 What is the thousands digit of 61654957? 4 What is the ten millions digit of 37286253? 3 What is the hundred millions digit of 1690435438? 6 What is the units digit of 750481879? 9 What is the hundred thousands digit of 41334383? 3 What is the units digit of 1750247052? 2 What is the millions digit of 18004316? 8 What is the ten millions digit of 3365351236? 6 What is the thousands digit of 78976579? 6 What is the tens digit of 181819219? 1 What is the millions digit of 207491505? 7 What is the units digit of 50860465? 5 What is the hundred thousands digit of 483724667? 7 What is the hundred millions digit of 301093248? 3 What is the hundred millions digit of 6622845262? 6 What is the hundred thousands digit of 240798141? 7 What is the tens digit of 45073314? 1 What is the millions digit of 25457662? 5 What is the ten thousands digit of 730621274? 2 What is the hundreds digit of 51249858? 8 What is the units digit of 55904352? 2 What is the ten millions digit of 1484168662? 8 What is the hundreds digit of 54985755? 7 What is the hundred millions digit of 4350889722? 3 What is the ten thousands digit of 96204587? 0 What is the ten thousands digit of 100709477? 0 What is the hundreds digit of 5832657824? 8 What is the hundreds digit of 1105500983? 9 What is the hundred millions digit of 1839655412? 8 What is the hundred thousands digit of 629790? 6 What is the hundred thousands digit of 297554306? 5 What is the hundreds digit of 18712226? 2 What is the millions digit of 87104935? 7 What is the millions digit of 128359876? 8 What is the units digit of 114935215? 5 What is the tens digit of 203595372? 7 What is the hundred millions digit of 486262350? 4 What is the ten millions digit of 152532968? 5 What is the thousands digit of 5647514707? 4 What is the units digit of 48118333? 3 What is the millions digit of 3572639569? 2 What is the ten millions digit of 1861431344? 6 What is the units digit of 1603942781? 1 What is the millions digit of 2865262? 2 What is the units digit of 394654966? 6 What is the hundred thousands digit of 111537076? 5 What is the hundreds digit of 315016343? 3 What is the millions digit of 2432560614? 2 What is	{ "pile_set_name": "DM Mathematics" }
d. Solve i + 2i = n for i. 3 Let o = -64 - -79. Let t be (2/(-4))/(o/(-30)). Let s be (-2)/(-1) - ((t - -2) + -4). Solve h = -sh - 16 for h. -4 Suppose -34a = -2252 - 500 - 1532. Solve a - 46 = -10i for i. -8 Let m = 36 + -30. Let f be -5 + -4 + m - -33. Let r = f + -30. Solve rc = c for c. 0 Suppose -4k + 5c + 5 = 12, 0 = -5k + 2c + 4. Suppose -kn + 1 = -9. Solve 2d - 1 = n for d. 3 Let c(b) = -159b + 1431. Let w be c(9). Solve -8m + 9 + 47 = w for m. 7 Suppose -3y - 14 = -5r + 15, 3y + 3r = 3. Let o be (-7)/(-6) + (-1)/(-18)y. Solve 0 = 5m - 4m - o for m. 1 Let c(a) = -a*3 + a + 2. Let u be c(-2). Let m(y) = -2y*3 + 3y*2 - 8y + 20. Let q = -544 + 546. Let d be m(q). Solve d = 3f + 1 + u for f. -3 Let g be (-20)/(-3) + -15(-8)/(-72) - -1322. Solve 1331 - g = -i for i. -4 Suppose d - 5q = -10, 3d + 247 - 239 = 4q. Solve 27o - 22o + 35 = d for o. -7 Suppose 6 = -2i - 14. Let q be ((-75)/i - 0)(-24)/5. Let k be -38/q12/2. Solve 4z + 16 = -k for z. -5 Let y = 26 + -35. Let t = y + 12. Suppose 2v - to - 38 = -7, v = o + 13. Solve 0 = -u - u - v for u. -4 Let f(q) = -2q3 - 6q*2 - 8q - 12. Let r be f(-5). Suppose rp - 28 = 121p. Solve -s = -3s + p for s. 2 Let s(q) = q2 + 67q + 1147. Let v be s(-32). Solve 217 - 82 = vj for j. 5 Let r be ((-44)/(-10))/(59/15 + -4). Let m = 70 + r. Let n(o) = 2o*3 - 7o*2 - 2o - 6. Let y be n(m). Solve yw = -0w - 2 for w. -1 Suppose -42i + 9 + 327 = 0. Solve 3b - 7 = i for b. 5 Let f(g) = -18g + 205. Let k(w) = w3 - 8w*2 - 66w + 6. Let l be k(-5). Let j be f(l). Solve 8s = js - 3 for s. -3 Let u(g) = g*3 - 24g*2 - 24g - 24. Let v be u(25). Let l be 6/180v. Solve l = -k + 3 - 1 for k. 2 Suppose 4p - 17 - 3 = 0, 4x + 16 = 4p. Let c = 82 + x. Let z = -80 + c. Solve 2n + z + 1 = 0 for n. -2 Suppose 3l - 1 = w, 0 = -5w + 5l - 2l - 41. Let y be 4/(8/w)(-3)/5. Suppose 6 = -yn + 36. Solve 0 = -0i + 5i - n for i. 2 Let b be (-1)/(1/(0 + -7)). Let o(h) be the second derivative of 5h3/6 - 33h*2/2 - 298h. Let y be o(b). Solve 13 = -3w - y for w. -5 Let z(v) be the first derivative of v4/4 - 4v*3 - 12v*2 - 53v - 49. Let x be z(14). Solve 13g = xg - 50 for g. -5 Let h(f) = -f*2 + 26f - 88. Let k be h(4). Suppose 7i - 138 - 65 = k. Solve 7o + 1 = i for o. 4 Let s be ((-9)/(-10))/(9/12)-15. Let l be 5/(105/s)56/(-12). Suppose 0 = -3y + y + l. Solve -y = z - 6 for z. 4 Let n be (-168)/336 + (1 - (-19)/2). Let l(f) = 40f*3 + 2f*2 + 4f - 6. Let b be l(1). Solve -b = -6i - n for i. 5 Let o(x) = x + 4. Let b = 43 + -44. Let q(j) = 2j3 - j2 - 2j - 1. Let g be q(b). Let h be o(g). Solve 0 + 2 = hy for y. 1 Let l(b) = b*3 + 14b*2 + 15b + 30. Let u be l(-13). Let h be (-221)/(-91) - (-12)/(-28). Solve -2 + u = hk for k. 1 Let j be (-3348)/682(-88)/12. Solve 49 = -jk - 23 for k. -2 Suppose -4583c + 0 + 0 = -4622c. Solve c = 2s - 310 + 302 for s. 4 Let n(g) be the first derivative of 2g3/3 - 30g - 217. Let m be n(4). Solve mx - 32 = -6x for x. 4 Let z be (6/(-9))/((-12)/18). Let a be (-1 + z)/2 - (3 - -31). Let k = 34 + a. Solve k = -0n - 3n + 6 for n. 2 Let s be 3((-50)/151 + 4). Suppose 4j + 8 = sx, x - 4 = -4j - 6. Solve 0 = 4m - x - 10 for m. 3 Suppose -6a + 23a = 5049. Let l = -294 + a. Solve lg + g = -20 for g. -5 Suppose -y = 2o - 13, 2 = 136y - 134y - 4o. Solve 5z + 2z = -y for z. -1 Suppose -86i + 1039 + 337 = 0. Solve -13 = ip + 51 for p. -4 Let d(f) = 7f - 496. Let r(t) = 20t - 1495. Let l(u) = 10d(u) - 3r(u). Let o be l(57). Solve 94p - op = 3 for p. -3 Let h = -3 + 3. Suppose 4v + 24 = -3i + 4i, -5i - 3v + 143 = h. Let m be i/4 - -4(-2)/4. Solve x - mx = 0 for x. 0 Let s(p) = 2p2 - 12p + 39. Let v be s(5). Suppose -j - 2n = -6, 2j + v = 3n + 55. Solve a - j = -a for a. 5 Let l = 120 + 40. Let c be l/14 - 16/(-28). Solve 5u = 2u + c for u. 4 Suppose -99z = 75z - 200z + 4186. Solve -186 = -5u - z for u. 5 Let g(x) = -x2 + 2x - 5. Let w be g(3). Let a(i) = i + 8. Let l be a(w). Suppose 4m + s + 3 = 0, 5m + s + l = -3. Solve m = 2p + 3p for p. 0 Suppose 30w + 754 = 59w. Solve -wl + 14 = -90 for l. 4 Suppose 2w + 1475 = -23w. Let d = w + 61. Solve -2u - du + 20 = 0 for u. 5 Let a(v) = -19v*2 + 18v - 48. Let u(m) = 35m2 - 37m + 96. Let b(d) = 11a(d) + 6u(d). Let k be b(22). Solve -kh = -5h for h. 0 Let h be 90/(-23) + 18/(-207). Let z be (0 + -1 + 9/36)h. Solve o = zo for o. 0 Suppose 4t + 3y = 6t - 57, 4t + 5y = 81. Solve 18 = tf - 6 for f. 1 Let c(d) = -d*2 + 4d + 18. Let g be c(6). Let y(p) = -p*3 + 3p*2 + 17p + 7. Let j be y(g). Solve 0t = -t - j for t. -1 Suppose -380 = -4a + 4l, 384 = -2a - 3l + 579. Solve -20s + 4s + a = 0 for s. 6 Let r(p) = 11p*2 + 395p + 21. Let c be r(-37). Solve 89f + c - 109 = 0 for f. -4 Suppose 16z + 144 = 1168. Suppose -69 = -i - z. Solve -ik - 5 - 5 = 0 for k. -2 Suppose -18 = k - 5c, -5k + 3c - 6 = -4. Let r be 2/(-2)k/4-30. Solve 4s + 5 = -r for s. -5 Suppose -2p - 3 = n, -3p - 15 = 13n - 15n. Let u be (5/n)/(11/132). Solve 3v = 7v - u for v. 5 Let t = -428 + 442. Suppose -43w + t = -41w. Solve 0 = -3d - 2 - w for d. -3 Let y = 24 + -70. Let b = 21 - -25. Let w = b + y. Solve -i - 1 + 6 = w for i. 5 Suppose -2l + 0l = -12. Let h be (7 + (-5 - 2))/(-5). Suppose x - j + 4 = 7, h = 4x - j - l. Solve -x + 2 = g for g. 1 Suppose -8z = -7z - 78. Let i = z + -77. Suppose -6q + 11 = -i. Solve qa - 6a = 0 for a. 0 Let s(b) = -b*2 - 9b + 108. Let w be s(-16). Let r be w/(-22) + -11 + 4335/55. Solve g + 64 - r = 0 for g. 4 Suppose 28a = 29a + 12. Let k(b) = -b*3 - 12b*2 + 3. Let l be k(a). Solve -10 = -ln - 1 for n. 3 Suppose 0d + 4d + 4h = 0, -3d + 4h + 14 = 0. Let x be 1/9d + (-10)/45. Solve x = -2c - 1 - 3 for c. -2 Let r(g) = g - 1. Let k(s) = -13s + 64. Let n(y) = -k(y) - 6r(y). Let f be n(9). Suppose 10m - fz = 5m + 35, 4z - 20 = 0. Solve 2o + 2o - m = 0 for o. 3 Let q = -244 + 240. Let p(g) = 2g*3 + 9g*2 + 7g + 15. Let r be p(q). Solve -14m + rm - 33 = 0 for m. -3 Let f(m) be the first derivative of m*3/3 - 3m*2 - 2m + 21. Let u be f(7). Suppose 0 = ux - 69 - 31. Solve -i = -5i - x for i. -5 Let l(o) = o*2 + 3o - 7. Suppose -14 = -2s - 4j, -4j + 4 + 1 = -s. Let x be l(s). Let y be 2/x + 840/220. Solve -y = 2v - v for v. -4 Suppose -11k + 1142 = 515. Solve 65l - 64 = kl for l. 8 Let c be 2/6-3-69. Solve c - 3 = -22p for p. -3 Suppose 15z - 195 = -195. Solve z = i + 15 - 16 for i. 1 Suppose -20h + 2427 = 2167. Solve -1 = -3m - h for m. -4 Let r(i) = -8i - 1. Let o be r(-3). Suppose -o = -4m - 3. Solve 0 = -ms + 12 - 7 for s. 1 Suppose -2g - n + 33 = 0, -84 + 18 = -5g + 3n. Let i(s) = -s3 - s2 + s + 1. Let t be i(-2). Suppose -8 = -tw - w. Solve 0 = -wz + 5z + g for z. -5 Suppose 4x + 2z = 4z + 122, 2x - 58 = 2z. Suppose 38l = xl + 12. Suppose 16 = -lf + 6f. Solve -fh = -8h - 16 for h. -4 Let o(u) = u3 - u2 - 6u + 2. Let h = 53 - 50. Let a be o(h). Suppose -5r - 4z = -23, -ar = -4z + z. Solve 10 = rg + 4 for g. 2 Let b(c) = -6c*3 - 12c*2 - 23c - 22. Let r(d) = -7d3 - 12d*2 - 23d - 22. Let y(z) = 6b(z) - 5r(z). Let k be y(-10). Solve -kl - 4 = -4l for l. -1 Suppose -32q + 15q + 22 = -420. Solve 15z + q = 2z for z. -2 Let r = -19271 - -19497. Solve -r = -18t - 370 for t. -8 Let p = -10 + 10. Let b(r) = 3r*2 + 6r - 7. Let t be b(3). Suppose p = -5g + t - 18. Solve k - 9 = -g for k. 5 Suppose 2t = 133 - 13. Suppose -t = -15p - 0. Solve b - 6 + p = 0 for b. 2 Let a = -38 + 66. Suppose a = 2i + 4s, -2i + 2s = 5 - 3. Suppose -5w = 2k - 52, iw - 2k - 44 = w. Solve 2z + w = -z for z. -4 Let v(h) = -h + 9. Let s be v(5). Suppose -3r - 3z = -18, 6 = -sz - 2. Suppose -d - 4 = -4d + 2y, 4y + r = 5d. Solve d - 2 = 2u for u. -1 Suppose 0 = v - i - 25 - 63, -i + 72 = v. Solve 26 = -27k + v for k. 2 Let s(n) = -n3 - 9n*2 + 9n - 13. Let t be s(-10). Let m(d) = d*2 - 7. Let x be m(t). Let w be (-6)/12(4/x - 2). Solve 0 = v - wv for v. 0 Let z = -760 - -765. Suppose -f = -s - 4f + 27, -35 = -5s + zf. Solve s = -22p + 18p for p. -	{ "pile_set_name": "DM Mathematics" }
o: 1, h: 4, i: 4, r: 2}. What is prob of sequence ii? 3/95 Calculate prob of sequence tvld when four letters picked without replacement from lltldllvdd. 1/336 Three letters picked without replacement from {i: 3, y: 3, l: 2, c: 6, t: 1}. Give prob of sequence iiy. 3/455 What is prob of sequence tl when two letters picked without replacement from {d: 1, o: 4, t: 7, l: 2}? 1/13 What is prob of sequence dj when two letters picked without replacement from djc? 1/6 Four letters picked without replacement from {j: 9, e: 5}. What is prob of sequence jeje? 60/1001 Two letters picked without replacement from {o: 1, x: 1, n: 2, c: 2}. What is prob of sequence ox? 1/30 Four letters picked without replacement from {v: 1, y: 2, p: 1}. What is prob of sequence ypvy? 1/12 Calculate prob of sequence wywh when four letters picked without replacement from {y: 6, w: 3, h: 4}. 6/715 Four letters picked without replacement from ggcbobggooggggoooc. What is prob of sequence ggbc? 7/2295 Calculate prob of sequence bc when two letters picked without replacement from ccccbcbbcbbbccbbcb. 9/34 Calculate prob of sequence zb when two letters picked without replacement from {l: 1, z: 1, h: 1, v: 1, b: 1}. 1/20 Two letters picked without replacement from {t: 2, d: 2}. What is prob of sequence dt? 1/3 Two letters picked without replacement from {k: 5, u: 11}. What is prob of sequence uk? 11/48 Two letters picked without replacement from tztygzzoofoo. Give prob of sequence ot. 2/33 Three letters picked without replacement from yyfphyypphpqyyyy. What is prob of sequence yhp? 2/105 Calculate prob of sequence vlp when three letters picked without replacement from {v: 1, p: 1, y: 1, l: 1, d: 1}. 1/60 Three letters picked without replacement from dqf. What is prob of sequence fqd? 1/6 Calculate prob of sequence po when two letters picked without replacement from {g: 1, o: 2, j: 4, p: 3, e: 2, f: 3}. 1/35 Calculate prob of sequence ah when two letters picked without replacement from {f: 2, t: 3, p: 2, h: 3, a: 3}. 3/52 Calculate prob of sequence bgm when three letters picked without replacement from {b: 4, m: 3, h: 1, r: 1, g: 4, v: 1}. 2/91 Two letters picked without replacement from {n: 3, y: 1, p: 5, c: 1, s: 1}. Give prob of sequence np. 3/22 What is prob of sequence ojoo when four letters picked without replacement from {o: 4, j: 7}? 7/330 Calculate prob of sequence ca when two letters picked without replacement from ngacw. 1/20 Calculate prob of sequence mvsk when four letters picked without replacement from sksmmemmsmve. 1/792 Three letters picked without replacement from wxwwwiwxwwxxi. What is prob of sequence ixx? 2/143 Four letters picked without replacement from {p: 2, x: 3, z: 3}. Give prob of sequence pzzp. 1/140 What is prob of sequence tx when two letters picked without replacement from {t: 1, l: 1, x: 2, c: 1, z: 1, k: 1}? 1/21 Three letters picked without replacement from afccfacyfdcdcf. What is prob of sequence ayd? 1/546 Two letters picked without replacement from {s: 1, l: 1, b: 1, n: 1, r: 1}. Give prob of sequence nr. 1/20 What is prob of sequence rrrr when four letters picked without replacement from rrrrr? 1 Four letters picked without replacement from eeeeeeeeeeieieei. What is prob of sequence ieei? 3/140 Four letters picked without replacement from iiiicicippbiail. Give prob of sequence ppba. 1/16380 Three letters picked without replacement from zzzzkrrwzzrfzf. Give prob of sequence kfr. 1/364 Four letters picked without replacement from ekyyskykehmkkeky. Give prob of sequence ksey. 3/1820 Two letters picked without replacement from {u: 4, j: 2, x: 7}. What is prob of sequence jx? 7/78 What is prob of sequence qx when two letters picked without replacement from vxvkkktvqkqk? 1/66 Calculate prob of sequence nxx when three letters picked without replacement from hxxxixhixxnixxii. 1/60 Two letters picked without replacement from prj. What is prob of sequence rj? 1/6 What is prob of sequence re when two letters picked without replacement from {h: 2, m: 2, r: 4, e: 5, z: 1, x: 1}? 2/21 Calculate prob of sequence xww when three letters picked without replacement from xwwxw. 1/5 Three letters picked without replacement from qqqdqqqd. What is prob of sequence qdd? 1/28 What is prob of sequence hddn when four letters picked without replacement from uiihdnd? 1/420 Three letters picked without replacement from {p: 5, j: 3, k: 1}. Give prob of sequence jkj. 1/84 Three letters picked without replacement from {p: 7, t: 10, f: 1}. What is prob of sequence tpp? 35/408 Three letters picked without replacement from {h: 3, j: 13}. What is prob of sequence hhj? 13/560 Two letters picked without replacement from {q: 1, k: 1, h: 2, b: 1, z: 2, l: 1}. What is prob of sequence kq? 1/56 Two letters picked without replacement from ohqhqnxhooy. What is prob of sequence hq? 3/55 Two letters picked without replacement from {o: 1, d: 1, y: 1, e: 2}. What is prob of sequence do? 1/20 Calculate prob of sequence vv when two letters picked without replacement from vvssvsv. 2/7 Calculate prob of sequence sss when three letters picked without replacement from {y: 1, v: 6, k: 2, t: 3, s: 6}. 5/204 Four letters picked without replacement from wwvgrvvvrggwwr. What is prob of sequence rgvr? 3/1001 Calculate prob of sequence cz when two letters picked without replacement from {z: 2, q: 1, c: 1, b: 2}. 1/15 Three letters picked without replacement from {w: 2, l: 3}. What is prob of sequence lwl? 1/5 Two letters picked without replacement from {h: 3, b: 1, w: 1, x: 2}. What is prob of sequence hb? 1/14 What is prob of sequence hk when two letters picked without replacement from {l: 4, h: 2, z: 1, o: 3, k: 1, m: 1}? 1/66 Three letters picked without replacement from {q: 14, b: 5}. Give prob of sequence qbb. 140/2907 Four letters picked without replacement from {f: 2, e: 1, l: 1, o: 3, d: 3}. What is prob of sequence dedo? 1/280 Calculate prob of sequence uqz when three letters picked without replacement from quzq. 1/12 Three letters picked without replacement from {r: 4, a: 3}. What is prob of sequence rrr? 4/35 Three letters picked without replacement from xezuy. What is prob of sequence yue? 1/60 Two letters picked without replacement from efkdzse. What is prob of sequence ds? 1/42 Calculate prob of sequence zfsd when four letters picked without replacement from fqqfqfzfsqfqqzdsqffq. 7/29070 Three letters picked without replacement from {x: 5, v: 14}. Give prob of sequence vvv. 364/969 Two letters picked without replacement from crcqsqzzqczpzrrrzzrs. What is prob of sequence sz? 3/95 What is prob of sequence lglg when four letters picked without replacement from {x: 1, u: 3, l: 2, g: 4}? 1/210 What is prob of sequence uuo when three letters picked without replacement from ugogkuggo? 1/126 Three letters picked without replacement from {t: 3, q: 1}. What is prob of sequence qtt? 1/4 Two letters picked without replacement from {e: 1, l: 4, u: 1, b: 4}. What is prob of sequence ub? 2/45 Two letters picked without replacement from {x: 9}. Give prob of sequence xx. 1 Four letters picked without replacement from {o: 2, i: 1, f: 1, p: 11}. What is prob of sequence foio? 1/16380 Three letters picked without replacement from {f: 2, m: 2, v: 3, e: 5}. Give prob of sequence vmf. 1/110 What is prob of sequence bmss when four letters picked without replacement from mgmssbxsgxmbxb? 9/4004 What is prob of sequence rnnw when four letters picked without replacement from wrwwnnnr? 3/140 Two letters picked without replacement from {q: 3, a: 12}. Give prob of sequence qq. 1/35 Two letters picked without replacement from sssaiitsa. What is prob of sequence aa? 1/36 Four letters picked without replacement from uequ. What is prob of sequence euuq? 1/12 What is prob of sequence yyf when three letters picked without replacement from {y: 2, f: 6}? 1/28 Four letters picked without replacement from xxxxxxotmtxvtxxtott. What is prob of sequence toxt? 15/2584 Calculate prob of sequence yqv when three letters picked without replacement from qqvyvqvqqqvqq. 8/429 What is prob of sequence mi when two letters picked without replacement from {i: 1, x: 6, g: 1, l: 3, m: 3, h: 4}? 1/102 Calculate prob of sequence ne when two letter	{ "pile_set_name": "DM Mathematics" }
, -0.2, 0.051 in descending order. 0.051, 0.04, 1/127, 0, -0.2 Put 4/7, 3/2, 4, 2/17, 5, -51 in increasing order. -51, 2/17, 4/7, 3/2, 4, 5 Put 4, -0.681, 0.4, -8, 2/11 in ascending order. -8, -0.681, 2/11, 0.4, 4 Sort 2/7, 0.22, 34, -4, -0.3, 7 in ascending order. -4, -0.3, 0.22, 2/7, 7, 34 Sort -0.2, 3707, 1/2, 5, -1/2, -2/3 in descending order. 3707, 5, 1/2, -0.2, -1/2, -2/3 Put -1/10, 2/7, 28, 44 in descending order. 44, 28, 2/7, -1/10 Put 0.5, 0.4, 5/31, -58, 2/9 in decreasing order. 0.5, 0.4, 2/9, 5/31, -58 Put 358, 11, -5, -11 in decreasing order. 358, 11, -5, -11 Sort 0, 671, -1, -4 in descending order. 671, 0, -1, -4 Sort 2/159, -2/3, -8, -2. -8, -2, -2/3, 2/159 Put -417, 41, 0, 5 in descending order. 41, 5, 0, -417 Put -5, 43, 762 in increasing order. -5, 43, 762 Put -1/2, -0.0005, -4 in descending order. -0.0005, -1/2, -4 Sort -11, -22404, -1/6, 1 in ascending order. -22404, -11, -1/6, 1 Put -3/8, 5, -4, 2/365, -1 in increasing order. -4, -1, -3/8, 2/365, 5 Put 0, -5, -1, 3, -154 in decreasing order. 3, 0, -1, -5, -154 Put 1, -1/4, 6.6, -53 in increasing order. -53, -1/4, 1, 6.6 Sort -2106, -220, -5. -2106, -220, -5 Sort -5, -1, 2, 148, 10, -3. -5, -3, -1, 2, 10, 148 Put 4/3, 2/21, 0.398, 5 in descending order. 5, 4/3, 0.398, 2/21 Put -12269, 2, -3 in increasing order. -12269, -3, 2 Sort 184, -37, -3. -37, -3, 184 Sort -3/7, -29, 14, -19.2 in ascending order. -29, -19.2, -3/7, 14 Sort 70, 11, 5, 3, 15 in descending order. 70, 15, 11, 5, 3 Sort -2997, 2/5, 0.02, 3, -2/19 in increasing order. -2997, -2/19, 0.02, 2/5, 3 Put -1, -23, 1, -11, 15 in decreasing order. 15, 1, -1, -11, -23 Sort -2/3, 24/7, 0.3, 1/2, -3, 7 in decreasing order. 7, 24/7, 1/2, 0.3, -2/3, -3 Sort 3, -2, 0, 329, -5 in increasing order. -5, -2, 0, 3, 329 Put -6, 1, -7, 9/8 in increasing order. -7, -6, 1, 9/8 Put 2, -2/7, -13474.3 in decreasing order. 2, -2/7, -13474.3 Put -2, -5/6, -195, -0.17, -1 in decreasing order. -0.17, -5/6, -1, -2, -195 Sort 0.1, 6504, -0.1, 6/11, -5 in decreasing order. 6504, 6/11, 0.1, -0.1, -5 Sort -0.1, -0.91, 0, -2, -2/9 in ascending order. -2, -0.91, -2/9, -0.1, 0 Put -5, 184, -3, 2, 0, -4 in decreasing order. 184, 2, 0, -3, -4, -5 Put 126, -2, -1, -53 in descending order. 126, -1, -2, -53 Put -10, 0.1, -2/7, 2195 in descending order. 2195, 0.1, -2/7, -10 Sort 0, -3, -163, -1.3, 0.3 in descending order. 0.3, 0, -1.3, -3, -163 Sort -9, -1, -8, 0, -2 in decreasing order. 0, -1, -2, -8, -9 Put -0.2, -7/48, 0.13, -2/9 in increasing order. -2/9, -0.2, -7/48, 0.13 Put 0, -1, -18, 1, -25 in descending order. 1, 0, -1, -18, -25 Sort 0, 70, -288, -10 in ascending order. -288, -10, 0, 70 Put -2/3, 2, 0.4, 0.01, -3, -0.13 in ascending order. -3, -2/3, -0.13, 0.01, 0.4, 2 Put 5, -149, 264 in increasing order. -149, 5, 264 Sort 3, -1, -8622 in decreasing order. 3, -1, -8622 Put -44, -5, -3, -4 in decreasing order. -3, -4, -5, -44 Put 0, -0.1, 45740, 0.3 in descending order. 45740, 0.3, 0, -0.1 Sort -9, -3, 0, -39, 1, 12. -39, -9, -3, 0, 1, 12 Put -5, -2401, 5 in decreasing order. 5, -5, -2401 Put 1, 1808, 3, 4 in decreasing order. 1808, 4, 3, 1 Put -49/6, -0.63, 2/11, -0.3 in decreasing order. 2/11, -0.3, -0.63, -49/6 Put 178, 5, 37, -1 in descending order. 178, 37, 5, -1 Put 6/11, 7723, 0.4 in ascending order. 0.4, 6/11, 7723 Sort 595, 34, 5 in decreasing order. 595, 34, 5 Put 1, -0.72, 5.17 in descending order. 5.17, 1, -0.72 Sort -4.3, -2, 10 in decreasing order. 10, -2, -4.3 Put -86, -4, -1/5, 1/6, -0.5 in ascending order. -86, -4, -0.5, -1/5, 1/6 Put 3, -272, 1, -5, -0.1, 2/9 in decreasing order. 3, 1, 2/9, -0.1, -5, -272 Put 0.08, -3, 1, 0.3, 9 in decreasing order. 9, 1, 0.3, 0.08, -3 Put 1, -6, 653 in descending order. 653, 1, -6 Put 2, 3, 140, 18, -2 in increasing order. -2, 2, 3, 18, 140 Put 3, -3, -287, 10 in descending order. 10, 3, -3, -287 Sort 3, -18, 3/2, -7/2, 2/9 in ascending order. -18, -7/2, 2/9, 3/2, 3 Sort 0.3, 91/4, 2/17, 4/27 in decreasing order. 91/4, 0.3, 4/27, 2/17 Sort 679, 2/475, 0, 2/11 in descending order. 679, 2/11, 2/475, 0 Put -124, 0, 5, -1, -108, -3 in increasing order. -124, -108, -3, -1, 0, 5 Put -2, 91, -3, -5, -9, 2 in decreasing order. 91, 2, -2, -3, -5, -9 Sort 15, 3, 0.4, -38. -38, 0.4, 3, 15 Put 7, 34778, -5 in decreasing order. 34778, 7, -5 Sort 2, -8, 3, -104, -3 in ascending order. -104, -8, -3, 2, 3 Sort 0.2, 4/11, -28509, -2. -28509, -2, 0.2, 4/11 Sort -126, 2.1, -29 in descending order. 2.1, -29, -126 Sort 3, -1, -9, 4, -206 in ascending order. -206, -9, -1, 3, 4 Sort -105217, -0.2, 1/2 in descending order. 1/2, -0.2, -105217 Put -88, -2, -39 in decreasing order. -2, -39, -88 Sort -1, -15, 17, 8 in decreasing order. 17, 8, -1, -15 Put 654/5, 2/5, 0.5, -6/11, -1 in descending order. 654/5, 0.5, 2/5, -6/11, -1 Sort 1, -1/3, 81654, 0.05 in ascending order. -1/3, 0.05, 1, 81654 Put 6, 1, -38, 5, -4 in ascending order. -38, -4, 1, 5, 6 Sort 0, 13, 1, -14, -2 in increasing order. -14, -2, 0, 1, 13 Sort 2/9, 112, -233, 0.41 in increasing order. -233, 2/9, 0.41, 112 Sort -0.5, 1/48, 4/9, -1/5 in ascending order. -0.5, -1/5, 1/48, 4/9 Sort 1, -238, -1.1, 5 in decreasing order. 5, 1, -1.1, -238 Sort 5, 199726, -2. -2, 5, 199726 Put 0.2, 174, -2/5, -4, -0.05, 69 in increasing order. -4, -2/5, -0.05, 0.2, 69, 174 Sort 12.8, 4, 2/7, -4 in decreasing order. 12.8, 4, 2/7, -4 Sort 44, 2, -142 in decreasing order. 44, 2, -142 Put -25, 4, -861 in increasing order. -861, -25, 4 Put 5, -19, 10 in increasing order. -19, 5, 10 Sort 4, 0.5, 3/7, 371, -0.5 in descending order. 371, 4, 0.5, 3/7, -0.5 Sort 7, 0.4, -0.4, 52, -17 in descending order. 52, 7, 0.4, -0.4, -17 Sort 0, -3, -356, 39, 4 in decreasing order. 39, 4, 0, -3, -356 Sort 2, -5/14, -20.02 in descending order. 2, -5/14, -20.02 Put -65, 1, 11 in decreasing order. 11, 1, -65 Put 2, -0.1, 1/3, 1/2, -18, -11/5 in ascending order. -18, -11/5, -0.1, 1/3, 1/2, 2 Put -4, 55, 4, 1169 in decreasing order. 1169, 55, 4, -4 Sort 2681/3, -1/3, -46, -2 in increasing order. -46, -2, -1/3, 2681/3 Sort -3, 3, -4, 12689, 0.2. -4, -3, 0.2, 3, 12689 Sort 5, 3, -183, -1, 0, -50 in decreasing order. 5, 3, 0, -1, -50, -183 Sort -626, -1, -4, 5/4, 3, -3/7 in decreasing order. 3, 5/4, -3/7, -1, -4, -626 Sort -11.8, 1/7, -4/3, 5, 1. -11.8, -4/3, 1/7, 1, 5 Sort -72, -5, 274. -72, -5, 274 Sort 6, 4, -516, 5, 0 in descending order. 6, 5, 4, 0, -516 Sort 2, -3, 57, -46, -2 in decreasing order. 57, 2, -2, -3, -46 Sort 28, 3, -5, 111. -5, 3, 28, 111 Sort -0.14, -0.3, 0, 1, 1/118 in descending order. 1, 1/118, 0, -0.14, -0.3 Put 3, 143, 4, 2 in decreasing order. 143, 4, 3, 2 Sort -1697, -1/3, 1, 4 in descending order. 4, 1, -1/3, -1697 Sort -0.1, 1, 3/1990. -0.1, 3/1990, 1 Put 23, -4, 174, 0.1 in decreasing order. 174, 23, 0.1, -4 Sort -4, -1, -5, -139, 18, 4 in decreasing order. 18, 4, -1, -4, -5, -139 Sort 18, -5, 120, 0, -8 in increasing order. -8, -5, 0, 18, 120 Sort 4/17, -2, 0.4, 14 in descending order. 14, 0.4, 4/17, -2 Sort 0.53, 1/7, 28, 0.32. 1/7, 0.32, 0.53, 28 Put 7, 3, -15, -335, 2 in decreasing order. 7, 3, 2, -15, -335 Sort -44, 3, -6, -4. -44, -6, -4, 3 Sort -2, -4275/46, 3. -4275/46, -2, 3 Sort 0.1306, -1/4, 4. -1/4, 0.1306, 4 Sort 0.04, 2, -2, 24.22, -1/3 in increasing order. -2, -1/3, 0.04, 2, 24.22 Sort 342, -8, -11. -11, -8, 342 Put -2/3, 32, -26, 5/4 in ascending order. -26, -2/3, 5/4, 32 Sort -10, 4, 8, -8 in decreasing order. 8, 4, -8, -10 Put 970, 2, -5 in ascending order. -5, 2, 970 Put -150, -2, -2006 in ascending order. -2006, -150, -2 Put -2/15, -9, -0.9, -7 in descending order. -2/15, -0.9, -7, -9 Put -0.16, 0.386, 1/17 in decreasing order. 0.386, 1/17, -0.16 Put -7, 4, 15, 9, -1 in descending order. 15, 9, 4, -1, -7 Sort 33.63, 1/2, -5, 3, 2, -2/19 in ascending order. -5, -2/19, 1/2, 2, 3, 33.63 Sort -4, -33, 18, -3, -1, -2/9 in increasing order. -33, -4, -3, -1, -2/9, 18 Sort 7, -5, -29, -27, -2, 5 in increasing order. -29, -27, -5, -2, 5, 7 Sort -3, 2/9, -4, 0.2, 0.045 in decreasing order. 2/9, 0.2, 0.045, -3, -4 Put -5, -289/3, -0.2, 3 in ascending order. -289/3, -5, -0.2, 3 Put -7/3, -0.3, -155, 1, 3, -0.2 in descending order. 3, 1, -0.2, -0.3, -7/3, -155 Put 2, -0.3, 1/97, 0, -4 in decreasing order. 2, 1/97, 0, -0.3, -4 Sort 0.1, 5, 0.4, 9/4, 36.6, -6. -	{ "pile_set_name": "DM Mathematics" }
70610/(-1842)). -1/23 Evaluate (-13)/(338/(-8))7/((-56)/(-6)). 3/13 Evaluate (-2104)/131590/8. -18 Evaluate -826/(-936)1/2. 1/9 Evaluate (132/456)/(-11)23. -3/19 What is -5208/(-480)-6? -13 Evaluate 374/16833/2. 1/3 What is ((-9)/(-15))/((-1106)/49770)? -27 5(-18)/(-45)4(-24)/(-320) 3/5 What is the value of ((-1)/(1/42))/(106/265)? -5 What is ((-8)/6-13)/(13/(195/20))? 13 What is 4/1025-1? -10 Evaluate 15/(-5)(-3)/(-81). -1/9 What is -4016/2800(231/(-18))/(-11)? -4/15 78/156(-34)/(-1) 17 Calculate (9/66)/(282/(-517)). -1/4 What is the value of (9/60148/(-111))/((-2)/(-2))? -1/5 (7/148/(-2))/(-3)21 14 What is ((-6)/3)/(172/(-258))? 3 Calculate 2/25665/515. 11 Calculate (-3)/1-10-1(-6)/(-36). -5 What is the value of 2/(-8)((-60)/(-30))/(78/24)? -2/13 (98/(-35))/((-18)/(-315)7) -7 What is ((-10)/(-6))/(182/273)16/(-130)? -4/13 What is the value of (2/(-6))/(2/(-30)(-1500)/(-3600))? 12 What is the value of ((-64)/1232)/((-19)/627)? 12/7 Evaluate (168/105(-5)/2)/(8/(-6)). 3 (3-112)/((-170)/15980-94) -36 What is -410/(-14)(-24)/(-216)-63? -20 What is the value of (2/42)/((-912)/(-13680))? 5/7 Evaluate -713/(-6)2. 7 What is ((29/((-14500)/(-120)))/1)/((-6)/20)? -4/5 What is the value of (-609)/(-58)5/35? 3/2 What is the value of 7/14408/(-714)? -2/7 Evaluate ((-14448)/(-3440))/((-7)/(-2)). 6/5 What is the value of ((-66)/(-968))/((-2)/8)12/6? -6/11 What is the value of ((-2)/(-5)5)/(68/(-374))-1? 11 What is the value of 303/606(-26)/(4/(-2))? 13/2 Evaluate 2/814(-4864)/4256. -4 Calculate ((3/(-2))/((-267)/445))/(25/3). 3/10 Evaluate (292/511)/((-2)/4). -8/7 Evaluate ((-4)/(-6))/(694/19779). 19 What is ((-76)/(-114))/((-9)/((-324)/(-6)))? -4 What is (((-148)/24)/37)/((-2)/(-6)-2)? 1/4 What is the value of 526/(-1625)340/48? -1/5 Calculate 963/(-642)12/8. -3/8 1(-6)/(-3)18/(630/(-5)) -2/7 What is (-12)/(-8)(20/810)/(6/9)? 1/18 What is (132/55)/((-36)/30)? -2 What is the value of 576/396(-55)/(-10)? 8 What is the value of (-3)/2((-678)/1017)/((-19)/2)? -2/19 What is the value of 1/(-2)2615/(-369)? 5/3 What is the value of (-217)/714/14? -31 (714/4284)/(1/(-180)) -30 (-84)/((-15)/(-105)-42) 14 (-56)/(-42)(351/(-60))/13 -3/5 What is the value of ((-114)/9)/(39/(351/(-6)))? 19 Evaluate 2/(5/100-5). -8 What is the value of (56/(-20))/((180/(-75))/(-6))? -7 (-4)/8(-68)/(-221) -2/13 What is ((14/21)/(1/(-1)))/(2/39)? -13 ((-24)/(-28)-1)/(-15(-6)/(-63)) 3/5 Calculate 18/1812(-12)/8. -18 ((-6)/80)/((-1497)/1996) 1/10 Calculate ((-3)/4)/(30/520). -13 Evaluate (3/18)/(-65/90). -1/2 Calculate (7(-60)/1260)/(-2(-2)/60). -5 What is (18/6120)/(-2)? 0 Evaluate ((-3)/(-12))/((-13)/((-624)/18)). 2/3 9/(-9)(-6)/(-28)-221 9 What is (95/(-114))/(-5)(-6)/(-8)? 1/8 What is 52/4(-6)/(78/13)? -13 What is the value of (-17)/(136/6)-68/(-18)? -2 What is (33/(-11))/((-45)/4)(-6)/2? -4/5 What is (-4)/(-1)1(-8)/((-800)/925)? 37 What is the value of (-21)/672/(-420)25/8? 15/8 What is the value of ((-4)/(-14))/((864/1456)/(-27))? -13 Evaluate 2464/(-48). -12 Evaluate -133(128/(-112))/8. 19 What is the value of (23/((-2070)/(-144)))/(28/(-35))? -2 What is (9(198/(-81))/11)/(-13)? 2/13 What is 1/3((-1)/1)/(13/234)? -6 What is the value of (((-2)/(-5))/(141/235))/((-16)/3)? -1/8 What is ((-4)/(-70))/((380/300)/(-19))? -6/7 What is the value of (-10)/(-420)187/21? 1/7 (-2)/6(-3)/(-28)(-8)/4 1/14 Evaluate (760/(-190))/(204/((-4)/(-2))). -2/51 What is 8/6-11(-18)/132? 2 What is 36/(-6)68/2040? -1/5 Calculate ((-432)/(-84))/(66(-2)/56). -24/11 What is (6-4(-5)/(-120))/(2/16)? -8 What is 31530/(-9459)((-9)/2)/1? 15 What is the value of -3(-14)/(-420)16/8? -1/5 Evaluate ((-152)/(-684))/((-4)/8). -4/9 Evaluate 24/4((-1160)/(-48))/(-29)-4. 20 What is the value of ((-25)/((-750)/(-80)))/(2(-5)/10)? 8/3 Calculate (-6)/22((-2)/(-2))/(3/3). -3/11 What is the value of ((-7)/49)/(-7(-10)/(-490))? 1 -115((-26)/(-65))/(-2) 23 Calculate (-9)/(-21)((-1)/4)/(10/(-140)). 3/2 Evaluate (-16)/(-36)(-6)/(-4)(-328)/82. -8/3 What is (784/(-224))/((-14)/(-36))? -9 Evaluate (-2)/((-14)/(392/(-42))4/(-6)). 2 Evaluate (66/(-231))/((-10)/(-70)). -2 What is the value of (1/6)/(((-85)/(-765))/(1/(-2)))? -3/4 Evaluate (((-2)/(-8))/(35/(-56)))/((-12)/(-600)). -20 (99/495)/(4/10)-2 -1 Calculate ((-6)/4)/((-118)/(-177))(-20)/(-3). -15 Calculate -1(-14)/((-4830)/23). -1/15 Calculate -65(-49)/(4410/(-36)). -26 1/((150/(-30))/(3/6-4)) 2/5 Calculate ((-12)/(-45))/(508/(-381))10/48. -1/24 What is ((-20)/18)/((56/(-63))/8)? 10 What is the value of 4/7721/(-618)? -2/3 Calculate 2/((-6)/9)(-12)/(-144)4. -1 Evaluate -8(-25)/(-40)(-12)/210. 2/7 Evaluate (((-84)/(-22))/21)/(-2). -1/11 What is 1/(-12)(-872)/(-981)? -2/27 Calculate ((-1800)/350)/(((-24)/84)/(2/2)). 18 84/784-884/9 -8 Evaluate (8/24-2)/((-13)/((-312)/16)). -1 Evaluate ((-20)/60)/(20/48)-152. 24 What is (-2)/(-13)(-28899)/(-494)? 9 What is 63/(-35)(-6)/(-9)? -6/5 Calculate 396/495(5/(-2))/5. -2/5 What is 15/((18/6)/((-6)/(-6)))? 5 Evaluate 5/(45/(-4))(23/(-6))/23. 2/27 What is the value of (-1)/(-1)63/63? 1 What is the value of 25/10-5240/375? -8 Evaluate ((-35)/7)/(-465/2132). 41 Calculate (-1818/(-243))/((-2)/(-15)). 10 (((-2)/(-10))/((-5)/45))/(63/(-105)) 3 What is the value of (-702)/6535/(-14)? 27 ((-1400)/8750)/((1/(-5))/(-1)) -4/5 Evaluate (-3)/943/(258/414). -23 ((-213)/2556)/(2/(-3)) 1/8 What is (4/(-18))/((22/396)/1)? -4 Evaluate 1-31/6-83. 12 Evaluate (-10)/(-6)(-312)/1170. -4/9 Evaluate (865/692)/(1/21/(-10)). -25 What is the value of ((-327)/(-218))/((-16)/24)? -9/4 What is 10/(-3)(-9)/(-105)21? -6 Calculate (2/(-4))/(((-1643)/31)/(-1060)). -10 (4/400)/((-36)/18045/24) -2/75 Calculate 459/(-357)(-35)/15. 3 Calculate 490/588(-2)/10. -1/6 Evaluate 125/100(-6)/(-5)(-15)/(-45). 1/2 Calculate (((-968)/(-4))/11)/2. 11 Evaluate 144/(-33)((-54)/(-44))/(-3). 6/11 Calculate (24/42)/(((-8)/140)/(-1)). 10 Calculate (-128)/(-1792)28/6. 1/3 Calculate (-5)/(70/(-8))(-66)/(-48)4. 22/7 What is the value of (2(-7)/(-4))/(380/760)? 7 What is the value of ((-36)/(-20))/((-2421)/(-538))? 2/5 Evaluate (145/580)/(((-20)/112)/(-1)). 7/5 Evaluate (60/(-840))/(9/(-90)). 5/7 What is the value of ((-198)/(-24))/(((-210)/(-40))/(-7))? -11 (203/203)/(2(-1)/(-4)) 2 Evaluate (276/345)/((-24)/780). -26 What is the value of (96/112)/(18/(-294))? -14 What is (392/(-483))/(2/(-49))? 14 What is (1089/(-132))/(9/482)? -22 What is ((18/(-20))/((-84)/1330))/((-75)/(-100))? 19 What is the value of 7-39102/(-3094)? 9 Evaluate (6/(216/9))/(8/(-12)). -3/8 What is the value of 60/(-3312)6(-12)/15? 2/23 What is ((-20)/6)/((16385/174)/113)? -4 Calculate 2/(-18)(-30)/(-10)2820/36190. -2/77 What is the value of 32/(-120)3(-35)/14? 2 (((-27)/324)/((-5)/510))/((-5)/(-10)) 17 Evaluate (-234)/104((-18)/(-18))/((-102)/(-4)). -3/34 What is the value of 165/(-30)16/8? -11 Evaluate (1196/(-506))/(6/(-33)). 13 What is the value of (-1)/(-3)-272/(-27)? 2/3 (-282)/705-252 20 -28/40352/(-4) 7 Evaluate (((-72)/(-27))/8)/((-2)/66). -11 What is the value of 9772/698((-4)/(-70))/(-1)? -4/5 What is (0(90/(-162))/(-5))/6? 0 Calculate (-1)/(-15)2(-9)/33. -6/5 What is the value of 16/(-10)(53400/96)/89? -10 What is (57/(-988))/((-15)/(-8))5/(-3)? 2/39 Evaluate 160/(-70)36/288. -2/7 What is the value of (((-21)/(-126)6)/(-6))/((-4)/(-30))? -5/4 ((-256)/(-7680))/(4/(-16)) -2/15 Evaluate 9/(-3)8/(1344/21). -3/8 Evaluate 70/(-10)(-8)/644. 2/23 Evaluate (153/2754)/((-4)/(-18))-12. -3 What is the value of 3/(-6)(8/2)/(16/32)? -4 What is (-5)/5145/630? -1/14 Calculate (-2)/(-12)315/(-42)384/(-720). 2/3 1/33440/(-20) -8 What is the value of ((-2329)/1644)/((-8)/(-48))? -17/2 What is the value of (-12)/(-2)2/18(-2538)/188? -9 Calculate (24/(-22))/(28/(-22)). 6/7 Evaluate (48/(-28))/(92/(-483))(-6)/(-9). 6 (2151/(-1195))/(4/80-2) 18 What is the value of (-1)/(-9)(-90)/6075? -25/2 Evaluate (-85)/(-34)(-6)/60. -1/4 What is (6/4)/(534/1782/32)? 8 What is the value of (33/(1980/40))/((-10)/105)? -7 (-3)/85216/(-2445) 4/5 (-12)/((-42)/(-7))5/1011 -11 What is (-1(-8)/(-6))/((-12240)/(-55080))? -6 -9*(588/(-21))/28 9 What is (-	{ "pile_set_name": "DM Mathematics" }
+ 1 Let k(v) = -3v - 2. Let d(q) = -181q - 9. Calculate d(i) - 4k(i). -169i - 1 Let k(n) = -3n + 5. Let d(i) = -i3 - 6i*2 + 7i - 8. Let h be d(-6). Let q = 37 + h. Let v(a) = -7a + 11. Determine qk(t) + 6v(t). -3t + 1 Let r(s) = 31s2 - 2s + 1. Let b(z) = z*2 + z + 1. Determine -3b(t) - r(t). -34t2 - t - 4 Let a(r) be the second derivative of r3/3 + 3r*2/2 + 391r. Let s(p) = 2p + 2. Determine 5a(k) - 4s(k). 2k + 7 Let v(d) = -8d3 - 2d*2 + 3d - 2. Let u = 1740 + -1736. Let q(c) = -25c3 - 7c*2 + 10c - 7. What is uq(k) - 14v(k)? 12k3 - 2k Let m(l) = -2l. Let z = -11 + 6. Let j(w) be the first derivative of w2/2 + 112. What is zj(g) - 4m(g)? 3g Let y(m) be the first derivative of -23m2/2 - 5m - 55. Let s(z) = -15z - 3. What is -8s(a) + 5y(a)? 5a - 1 Let b(q) = q - 4. Let d(v) = -134. What is 2b(k) - d(k)? 2k + 126 Let c(y) = -7y2 + 6y - 9. Let l = 5 - 1. Suppose 56 = ln + 2v, 32 = n - 0n - 4v. Let q = n + -25. Let u(a) = -3a2 + 3a - 4. Give qu(k) + 4c(k). -k*2 - 3k Let v(c) = -c*2 - 6c + 30. Let b(t) = -4t + 20. Let i(y) = -3b(y) + 2v(y). Let q(d) = d2. Let k be (-14)/4-2 - -1. Calculate kq(a) + 3i(a). 2a2 Let l(v) = -3v + 378. Let f(h) = h - 126. Calculate 17f(k) + 6l(k). -k + 126 Let o(v) = -174v - 34. Let m(s) = -119s - 23. Calculate 7m(u) - 5o(u). 37u + 9 Let l(t) = 2t - 2. Let o(y) = 11y + 350. Let n be o(-33). Suppose p + 9 = -3p + 5z, -2p = -4z. Let g(b) = -b + 1. Determine ng(v) + pl(v). v - 1 Let f(r) = 28r - 12. Let q(w) = -7w + 3. Let t(k) = 2f(k) + 9q(k). Let o(m) = 5m - 2. Give 8o(d) + 5t(d). 5d - 1 Let v(c) be the second derivative of c4/6 - c3/2 - 2c*2 - 449c. Let l(f) = -f - 1. What is -4l(i) + v(i)? 2i*2 + i Let x(h) = 2h*2 + 4h - 1. Let r(o) = 9o + 4o*2 - 8 + 37 - 30. What is -4r(w) + 9x(w)? 2w2 - 5 Let c(j) = -j2 - j + 1. Let u(d) = 6d2 + 16d - 7. Determine -14c(b) - 2u(b). 2b2 - 18b Let m(q) be the third derivative of q*3/6 + 53q*2 + 2. Let z(n) = -2n + 2. Let b(f) = -2f + 2. Let w(i) = -5b(i) + 6z(i). Calculate -5m(u) + w(u). -2u - 3 Let s(h) = 6 + 12h + 3h2 + 11h2 + 2. Let p(u) be the third derivative of u5/12 + u4/6 + u3/2 - 192u2 - 5. Calculate -8p(c) + 3s(c). 2c*2 + 4c Let d(n) = -n*3 - 3n*2 - n - 1. Let y(r) = 15r*3 + 27r*2 + 9r + 6. Determine -18d(f) - 2y(f). -12f3 + 6 Let m(j) = -5j*2 + 11j - 5. Let o(t) = 141 + 2t2 - 3t - 139 - 2t. Give -3m(k) - 7o(k). k2 + 2k + 1 Let x = -914 - -915. Suppose 0 = 5q - 4d + 13, 5d = -5q + q + 6. Let m(v) = v*3 + v + 1. Let s(c) = -2 + 2 + 1. Determine qs(w) + xm(w). w3 + w Let c(i) = i3 + i. Let o(u) = -10 - u3 + 2u + 0u - 7 + 18. What is 4c(m) - o(m)? 5m3 + 2m - 1 Let p(t) = -3t - 2. Let g(n) = 2n + 3. Suppose 101 = 4v + 85, -2v + 3 = z. Calculate zg(r) - 4p(r). 2r - 7 Let d(p) = -p + 1. Let i(o) = 10o - 7. Let s(f) = 3d(f) + i(f). Let x(r) = -15r + 9. Determine 9s(z) + 4x(z). 3z Let r(s) = -s. Let x(z) = 41z - 1. Give 6r(d) - 2x(d). -88d + 2 Let j(l) = -9l*2 - 13l - 6. Let x(d) = -8d - 6d - 4 + 5d - 6d*2. Suppose 0 = -109f - 43f - 1064. Determine fx(v) + 5j(v). -3v*2 - 2v - 2 Let c(f) = -f - 1. Let h(t) = t - 8. Let v(j) = 3c(j) - h(j). Suppose -4u - 6 = -5u. Let a(b) = 5b - 6. What is uv(s) + 5a(s)? s Let q(h) = -3h. Let g(i) be the second derivative of i3/6 - i. Let o be 50/(-175) + (-12)/7. What is og(w) - q(w)? w Let n(v) = 7v3 - 6v*2 + 6v - 3. Let p(y) = -5y3 - y2 - 2y + 1. Determine n(u) + 2p(u). -3u*3 - 8u*2 + 2u - 1 Let z(i) = 14i3 + 3i - 8i3 + 3 - 4i*3. Let q(a) = -3a*3 - 2a - 2. Calculate -3q(y) - 2z(y). 5y3 Let w(x) = -4x - 2. Suppose -106s = -67s + 117. Let c(a) = -5a - 1. Let i be (-3)/(-6)(1 + 3). What is ic(j) + sw(j)? 2j + 4 Let y(k) = 15k*3 - 156k. Let w(x) = -x*3 + 12x. Give -27w(t) - 2y(t). -3t3 - 12t Suppose -210q = -209q + 7. Let b(o) = 25o - 7. Let g(t) = -13t + 3. Give qg(x) - 3b(x). 16x Let z(t) = 20t*2 - 101t. Let x be z(5). Let b(r) = 3r3 + 8r + 2. Let i(v) = -2v3 - 4v - 1. Determine xi(w) - 3b(w). w*3 - 4w - 1 Let p(i) = 5i + 6i - i + i + 6 - 6i2. Let c(h) = h2 - 2h - 1. Let t = 16 - -21. Let m = -15 + t. What is mc(a) + 4p(a)? -2a2 + 2 Let i(p) = 2p2 - 8. Let v(k) = k2 + k - 1. Calculate i(u) + 2v(u). 4u*2 + 2u - 10 Let z(l) = -9l3 - 5l*2 + 3l - 1. Let t(c) be the first derivative of -c*4 - 2c3/3 + c2/2 - 88. Let p = 12 + -17. Calculate pt(r) + 2z(r). 2r3 + r - 2 Let l(c) = -c2 - 1. Let z(w) = 4w*2 + 3w + 5. Let n = -1825 - -1835. Determine nl(t) + 2z(t). -2t2 + 6t Let r(y) = -y3 - y2 - y + 1. Let i(g) = -g*2 - 7g + 10. Let w be i(-8). Let n(m) = 5mw + 6m + 0 - 3 + 2m - 3 + 7m*3. Give -n(q) - 6r(q). -q3 + q2 - 2q Let z(i) = -2i - 4i + 7 + 7i - 2i. Let h(r) = -7. Let x(u) = 4. Let t(d) = -3h(d) - 5x(d). What is 21t(k) - 3z(k)? 3k Let r(t) = 48t. Let o(g) = -g. Calculate -5o(f) - r(f). -43f Let k(d) = -382d*3 + 18d - 8. Let t(h) = 3h - 1. Determine -k(r) + 6t(r). 382r3 + 2 Let h(t) = -t2 + 6t - 3. Let k(q) = 17q + 888 + 893 - 1791 - 3q*2. What is -17h(g) + 6k(g)? -g2 - 9 Let v(b) = 23b - 6. Let f(l) = 8l - 2. Let g = 287 - 281. Give gv(o) - 17f(o). 2o - 2 Let n(d) be the second derivative of d4/6 + d3/3 + d*2 + 19d + 9. Let b be (-3 + 0)4/6. Let t(k) = 2k*2 + 2k + 1. Calculate bn(c) + 3t(c). 2c2 + 2c - 1 Let c(t) = -5t + 1. Let v = 139 + -146. Let r(q) = 5q + 0q - q + 8 - 9. Calculate vr(u) - 6c(u). 2u + 1 Let r(p) = -8p2 + 4p + 18. Let b(v) = -24v2 + 13v + 51. What is -6b(m) + 17r(m)? 8m2 - 10m Let d(f) = -234f2. Let v(l) = -234l*2 + 1. Give 3d(y) - 2v(y). -234y*2 - 2 Let x(j) = 2j + 1. Let f(z) = 1040z + 65. Calculate f(c) - 65x(c). 910c Let c(n) = -10n - 9. Let r(j) = -1. Let k(u) = -c(u) + 3r(u). Let f(z) = z + 1. Let q(y) = y3 + 7y*2 + y + 6. Let w be q(-7). What is wk(d) + 8f(d)? -2d + 2 Let w(d) = -9d. Let k = 342 - 339. Let r(q) = -5q. Determine kw(o) - 5r(o). -2o Let z(h) = 6h*2 - 4h + 6. Let u(g) = 10g2 - 6g + 9. What is -5u(y) + 8z(y)? -2y2 - 2y + 3 Let c(d) = -6d2 - 88d + 2. Let l(f) = f*2 + 2f - 1. What is -c(w) - 5l(w)? w2 + 78w + 3 Suppose a + 3d - 39 = -a, d + 19 = 2a. Suppose 7s - a = 9s. Let n(g) = -g. Let p(l) = 5l - 2. Give sn(t) - p(t). t + 2 Let s(l) = -5l - 6. Let t = -10 - -7. Let p be 0 + -1 + (-6)/t. Let c(y) = -y - 1. Suppose m = -2z + 2, -5m - 7 - 27 = -z. Calculate mc(d) + ps(d). d Let x(k) = 5k*3 + 3k*2 + 3k - 2. Let z(t) be the second derivative of 1/20t5 + 1/12t*4 + 1/2t*2 + 1/6t*3 - 17t + 0. Give -x(y) + 3z(y). -2y*3 + 5 Let x(v) = 20v*3 - 17v*2 - 34v - 11. Let o(z) = 7z3 - 6z*2 - 12z - 4. Determine -17o(n) + 6x(n). n*3 + 2 Let n(h) = -193h - 14. Let y(c) = -65c - 4. Give -6n(o) + 21y(o). -207o Let o(w) = w2 - 1. Let c(p) be the first derivative of p3 - 4p - 103. Give -c(b) + 2o(b). -b*2 + 2 Let n be (0 - -1)/((-1)/4). Let g(v) = -17v*2 + 3v - 11. Let m(o) = -9o2 + 2o - 6. What is ng(w) + 7m(w)? 5w2 + 2w + 2 Let z(c) be the third derivative of c5/60 - c4/24 - c3/6 - c2. Let n be 363/(-231) - 8/(-14). Let k(u) = 2u2 + u + 1. Calculate nz(l) - k(l). -3l2 Let c be 2/4 - 3/(-2). Let q(y) be the first derivative of -3y*2 - 6y - 3. Let u = -100 + 111. Let n(d) = d + 1. Calculate cq(a) + un(a). -a - 1 Let b(y) = 8y + 4. Suppose -8 = 51d + 43. Let w(x) = -x - 1. Calculate db(z) - 5w(z). -3z + 1 Let r(w) = -119w*3 - 49w*2 - 49w + 49. Let d(n) = 5n3 + 2n*2 + 2n - 2. Suppose 276 = 10o - 214. What is od(u) + 2r(u)? 7u3 Let q(c) = -c2 + c - 3. Let x(j) = -2j2 + 2j - 5. Let r(k) = k*3 + 12k*2 - 13k - 10. Let v be r(-13). Determine vq(m) + 6x(m). -2m2 + 2m Let j(l) = -5l3 - 6l*2 + 11l. Let t(d) = -4d3 - 5d*2 + 10d. Let n = 528 - 534. Give nt(i) + 5j(i). -i*3 - 5i Let a(n) = 5n3 + 2n*2 - 2. Suppose -28k = -23k - 40. Suppose -kf + 15 = 47. Let q(b) = 4b3 + 2b**2	{ "pile_set_name": "DM Mathematics" }
= 4q. Suppose ps - m = 48. What is the tens digit of s? 3 Suppose -43 = -3i - 4n, -2i - 3i - 2n + 53 = 0. What is the tens digit of 3565/45 + (-2)/i? 7 Let w be 7/((-42)/20)-3. Let r(q) = 2q - w + 0q - 7q. What is the tens digit of r(-6)? 2 Suppose 118 = i + 2r - 4r, -4i + 3r + 467 = 0. What is the units digit of 2/6 - i/(-3)? 9 Suppose -2p - 5 + 11 = 0. Suppose 6z - p = 27. Suppose -4w - 3k + 15 - 6 = 0, k + z = 0. What is the units digit of w? 6 Suppose -s + 2h = -66, h - 65 = 5s - 350. Suppose p + s = -3p. What is the tens digit of ((-240)/(-56))/((-2)/p)? 3 Suppose 2s - 3559 = -n, 2n + 3564 = 2s - 2n. What is the units digit of 1 + (-3)/12 - s/(-16)? 2 Suppose w + 11 = -z - 49, 105 = -2w + z. Let r be (211 - 1)((-6)/(-15) - 0). Let k = r + w. What is the tens digit of k? 2 Suppose v - 3b = -b + 29, -5b = -3v + 85. Suppose -193 = -3q - v. Let h = q + -31. What is the units digit of h? 5 Let r(q) = -324q3 - 5q*2 - 16q - 14. What is the tens digit of r(-2)? 9 Suppose -6 = -8w + 6w. Suppose -4k = -wi + 10, 0 = i + 4k + k + 3. Suppose g = ir - 37, -6r + 3r - 4g + 28 = 0. What is the units digit of r? 6 Let p = -2363 - -4977. What is the units digit of p? 4 Suppose 4z - 3z = 0. Suppose k + 0k = z. What is the units digit of (14 + -5)(k + 1)? 9 Let n(m) = -m3 + 6m*2 - 4m. Let d be n(4). Suppose -2k - 4k = -30. Let z = d - k. What is the tens digit of z? 1 Let r(l) = 3l - 12. Let f be r(8). Suppose -v + f = v. What is the units digit of 0 - v/(-9)3? 2 Let v = 71 + -76. What is the hundreds digit of (-35)/14438/v? 2 Let l(f) = -f - 18. Let s(j) = 2 + 12 - 1 + 5. Let p(z) = 5l(z) + 4s(z). What is the tens digit of p(-8)? 2 Suppose 907 = -12l + 12547. What is the hundreds digit of l? 9 What is the hundreds digit of 2 - -1 - -538 - -5? 5 Let i be ((-15)/(-10))/(5/730). Let n = i - -7. What is the hundreds digit of n? 2 Let y be 0 + 3 - 0 - -30. Let d be y + -2 + (-4)/(-2). Suppose 2v - d = -5. What is the units digit of v? 4 Suppose 3o + 2o = -15. Let f = 32 + -28. Let q = o + f. What is the units digit of q? 1 Let o be ((-8)/(-16))/((-2)/56). Let g(t) = -t3 - 14t*2 - 11t - 6. Let w be g(o). What is the units digit of (w/20)/(2/10)? 7 Let o be (-2)/(-10) + (-56)/(-20). Let t be -71-8 + -1. Suppose t = 5k + 2y + 2y, -4y = -ok + 65. What is the units digit of k? 5 Let d(c) = -9c + 4. Let m = -5 - -16. Let x = m - 16. What is the units digit of d(x)? 9 Suppose -2098 = -8d + 1982. What is the tens digit of d? 1 Let y(q) = 2q*2 + 5q + 2. Let u be -2(-2)/(-4)5. Let p be y(u). Let i = -11 + p. What is the tens digit of i? 1 Suppose -48y + 190601 = -41911. What is the tens digit of y? 4 Suppose -5y - 20 - 60 = 0. Let w = y + 5. Let o = w + 21. What is the tens digit of o? 1 Suppose -182 = -4o + 142. What is the units digit of o? 1 Let w = 149 - -588. What is the units digit of w? 7 Let y(p) = 25p*2 - 7p - 42. What is the units digit of y(-9)? 6 Let c(m) = 2m + 2m*2 + 2m - 104 + 107. What is the tens digit of c(4)? 5 Let h(b) = -3b3 - 2b + 16. What is the tens digit of h(-6)? 7 Let v be (-10 + 1)/(6/(-4)). Let y(i) = -7i + 10. Let t(j) = -14j + 20. Let w(l) = 2t(l) - 5y(l). What is the tens digit of w(v)? 3 Let u = 47 - 18. Suppose g + 3 - u = 5j, 0 = g + 4. What is the units digit of ((-18)/15)/(j/15)? 3 Let u be -1 + (-4 - (-7 - 2)). Let x be 2/8 + 211/u. Let c = x - -8. What is the tens digit of c? 6 Suppose -5u + 169 = -406. Suppose -109 = -4z + u. What is the tens digit of z? 5 Let r(h) = 813h*2 - 4h + 3. Let w be r(1). Let u = -561 + w. What is the tens digit of u? 5 Let j = 300 - 107. What is the hundreds digit of j? 1 Let w be (-630)/28(-8)/6. Let o = 27 + w. What is the units digit of o? 7 Suppose -2k = -3j + 8, 3j - 7 = -0k + k. Suppose 94 + 6 = -jw - 2h, w = 3h - 46. Let p = w + 71. What is the tens digit of p? 2 Let l(r) = r*2 + 9r - 20. Let w be l(-15). Let o = w + -23. Let z = 68 - o. What is the units digit of z? 1 Let t(j) be the third derivative of 25j4/12 - 7j*3/3 + 34j*2. What is the units digit of t(5)? 6 What is the hundreds digit of (-2 - 61)/(-510/600)? 7 Suppose 6x - 161 = 403. Suppose 0 = -4a - x + 286. What is the units digit of a? 8 Let w be 5((-564)/15)/(-2). Let j be w/3 - (-8)/12. Suppose -25 = -3q + 4k, 2q + 3k - j = -2k. What is the units digit of q? 1 Let x be ((-12)/(-7))/(4/14). Suppose 2b + b = x. Suppose -2u - bu = -4. What is the units digit of u? 1 Let r(q) = 6q*2 + 34q + 144. What is the units digit of r(17)? 6 Let n(g) be the second derivative of -2g3/3 - 21g*2/2 - g. Let h be 0 + 6/9 - 53/3. What is the tens digit of n(h)? 4 Let g(q) = -q + 9. Let k be g(7). Suppose 4l - 5l + k = 0. Suppose v + 8 = 3n + 3v, 2n - l = -3v. What is the units digit of n? 4 Let r(x) = -3x*2 + 2x. Let g be r(-2). Let w = g + 21. Suppose -wk + 64 = -56. What is the tens digit of k? 2 Let i(y) = y2 + 20y - 50. Let u be i(-25). Suppose 6w - u = 447. What is the units digit of w? 7 Let x = 43 + -15. Suppose -3z - x + 235 = 0. What is the tens digit of z? 6 Suppose -1 = -2c - 37. Let v(k) = 21k*2 - 18. Let z(g) = -6g*2 + 5. Let i(u) = cz(u) - 5v(u). What is the units digit of i(3)? 7 Let f(l) = -2l*2 + 36l - 5. What is the units digit of f(13)? 5 Suppose -12 = 4b, 3b - 2b = -4k + 49. Let u = k + -4. What is the units digit of u + -3 + 3 - 0? 9 Suppose -4p + 0 = -3g + 15, 2g - 10 = p. Suppose -3z + 122 + 34 = p. Suppose 5u = z + 103. What is the units digit of u? 1 Suppose 4u = 3c + 7291, 2u = -43c + 39c + 3640. What is the units digit of u? 2 Let v(l) = 12l + 14l*2 + 2l + l*3 - 17 + 2 + 3. What is the tens digit of v(-12)? 0 Let o(l) = 10l - 19. Suppose -3n + 5u + 64 = 0, -2u - 5 = -1. What is the units digit of o(n)? 1 Let q = 26 + -15. Let w(i) = i3 - 11i*2 + 3i + 12. What is the tens digit of w(q)? 4 Let m(w) be the second derivative of 7w3/6 - w2 - 37w. Let s = 8 + -3. What is the units digit of m(s)? 3 Suppose 280 = -8j + 13j. What is the tens digit of j? 5 Suppose 0 = b - 3, -10b = 3k - 11b - 7704. What is the units digit of k? 9 Suppose -6b = 14b - 7220. What is the units digit of b? 1 Let b = -18 + 15. Let a = b + 9. Suppose 3f - 5l = 7f - 18, -4l + a = -f. What is the units digit of f? 2 Let q = -52 - -57. Suppose qo - 17 = -x + 16, -x + o = -15. What is the tens digit of x? 1 Let r(g) be the third derivative of -37g4/24 - 4g*3/3 + 4g*2. Let y be r(-7). Suppose 0 = 4x - y + 59. What is the units digit of x? 8 Suppose -17 - 43 = 2c. Let j be 78 - (4 - 7 - 0). Let p = j + c. What is the tens digit of p? 5 Let y be -3 - 0 - (-22)/1. Suppose 2l - 3i = 2i - y, -4l - 2i = 2. Let r = 28 - l. What is the units digit of r? 0 What is the hundreds digit of 12(-5)/(-10) + 367? 3 What is the hundreds digit of (-6 - -4) + (601 - -3)? 6 Let x(u) be the third derivative of 0 + 8/3u*3 + 0u - 2u2 - 1/24u*4. What is the units digit of x(11)? 5 Let j(u) = 74u + 367. What is the units digit of j(0)? 7 Let k(s) = -51s - 7. Let p be k(-3). Let d = p + -35. What is the tens digit of d? 1 Let u = 38 + -86. Let s be ((-58)/(-8))/((-3)/(-12)-1). Let p = s - u. What is the tens digit of p? 1 Let c(l) = -l*2 + 43. Let r be c(0). Let i = -64 + r. Let x = 38 + i. What is the tens digit of x? 1 Suppose 0 = -2x + 5 - 1. Suppose -xd + 5d + 4r - 86 = 0, -5r + 36 = d. What is the units digit of d? 6 Let w be 20976/64 - (-1)/4. Suppose 5c - 521 = 4z + w, 4z - 503 = -3c. What is the hundreds digit of c? 1 Let h(k) = -3k - 12. Let r(p) = 3p + 13. Suppose -2 = 4q + 10. Let j(n) = qh(n) - 2r(n). What is the units digit of j(8)? 4 Let v = 26 + -46. Let a = -16 - v. Suppose b - 17 = -ab - 4g, 2b + 3g - 4 = 0. What is the units digit of b? 5 Suppose 3r = 3z + 12, -5 = 5z + 15. Let j(i) = i*2 - 1. Let b be j(r). What is the units digit of (b - -1) + 18? 8 Let m = 3766 + -1904. What is the units digit of m? 2 Suppose 0 = b + 5f - 62, 5b - 5f = -0b + 280. What is the tens digit of b/(-38)428/(-6)? 0 Let z(a) = 99a + 299. What is the hundreds digit of z(33)? 5 Let b(j) be the first derivative of j*3/3 - 11j*	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.