Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
2760707 What is -aecdd (base 15) in base 12? -229bb4 -530524 (base 6) to base 12 -20a44 What is 6151022 (base 8) in base 12? 665416 934872 (base 16) to base 12 3295a16 What is 175cb4 (base 14) in base 8? 3107266 4476b0 (base 14) to base 16 237bfa Convert 11e9e (base 16) to base 11. 50144 What is 1023400 (base 6) in base 13? 19a13 What is 2b2cf (base 16) in base 8? 531317 Convert -1140120 (base 6) to base 16. -e910 31234534 (base 6) to base 11 56a469 20112110120121 (base 3) to base 15 489237 -13025165 (base 7) to base 15 -185838 -102120011102021 (base 3) to base 5 -3033104231 -1011431213 (base 5) to base 11 -1188870 What is 2035e (base 16) in base 4? 200031132 Convert 1010011000110100011110 (base 2) to base 15. 38bca2 Convert -870214 (base 11) to base 4. -11103220300 What is -276967 (base 10) in base 6? -5534131 Convert -961098 (base 13) to base 15. -4968a0 What is -60415 (base 12) in base 4? -132201101 Convert 5579893 (base 10) to base 7. 65266624 What is -4001512 (base 7) in base 5? -110034233 Convert -100110001110111101111110 (base 2) to base 8. -46167576 Convert 36623420 (base 7) to base 13. 8ac659 What is 12210 (base 10) in base 7? 50412 Convert -2810464 (base 11) to base 10. -4846725 What is -22092bb (base 12) in base 2? -11000101111011001101111 Convert -4482320 (base 9) to base 4. -21031320213 -3040331 (base 6) to base 7 -1143361 -10c83 (base 13) to base 5 -1440241 -142661 (base 8) to base 6 -1030145 Convert 10712 (base 15) to base 13. 1a9c9 Convert 2333000 (base 7) to base 15. 5c16b 10101000110001001000011 (base 2) to base 15 743889 Convert 77874a (base 13) to base 12. b3a807 -202040125 (base 6) to base 4 -31030023311 3973d (base 14) to base 5 14010441 What is 248055 (base 10) in base 3? 110121021020 -825387 (base 9) to base 4 -1313200021 Convert 1771218 (base 12) to base 3. 100011200020102 What is 13a5b (base 12) in base 3? 1101121222 Convert 22688620 (base 9) to base 10. 11041938 What is -83446 (base 10) in base 11? -57770 What is -11011101001001011101 (base 2) in base 5? -212441241 What is 430522 (base 7) in base 10? 74692 -122201233 (base 5) to base 11 -36a216 What is -35393 (base 11) in base 9? -77014 -235155 (base 8) to base 13 -2a83a Convert 11221002211 (base 3) to base 16. 17b09 What is -11412343 (base 6) in base 11? -226162 What is -1d83a (base 15) in base 7? -550630 What is -1137077 (base 9) in base 12? -25812a Convert 95a51 (base 13) to base 5. 32113130 422011 (base 8) to base 10 140297 101111001001111000 (base 2) to base 10 193144 Convert -611000 (base 7) to base 5. -11303321 What is -700718 (base 10) in base 5? -134410333 -4b5c1 (base 16) to base 13 -aa661 -11603a1 (base 14) to base 8 -37520131 10577402 (base 9) to base 12 1874602 -48313 (base 12) to base 9 -157316 5278a (base 15) to base 11 169590 33468 (base 11) to base 15 e569 Convert 15457756 (base 8) to base 2. 1101100101111111101110 -1cbe67 (base 15) to base 6 -50055011 -33303344 (base 6) to base 16 -f5170 Convert 1101100000111110 (base 2) to base 5. 3232413 Convert 15304435 (base 6) to base 14. ddca3 -6bc081 (base 13) to base 3 -11211111011212 Convert 43373 (base 10) to base 5. 2341443 Convert 10201312 (base 5) to base 6. 1451330 8711 (base 10) to base 4 2020013 Convert 3a0cb4 (base 13) to base 2. 101010110001101000000 Convert -1065a22 (base 12) to base 2. -1011111001110101111010 -5233543 (base 6) to base 4 -331322013 What is c78f5 (base 16) in base 11? 509139 What is 89749 (base 11) in base 14? 35543 What is 255205a (base 12) in base 11? 4152147 Convert 86127 (base 15) to base 8. 1477050 What is 13303332220 (base 4) in base 11? 1179699 Convert -14594 (base 16) to base 14. -22536 Convert -4c074 (base 13) to base 8. -422637 Convert a38082 (base 12) to base 6. 130544242 What is -240631332 (base 7) in base 8? -70754554 -692c (base 13) to base 10 -14741 Convert -589149 (base 10) to base 3. -1002221011100 -13330302200 (base 4) to base 3 -10220212201012 100141301 (base 5) to base 14 a469d Convert 2744a (base 13) to base 8. 217027 12002110200112 (base 3) to base 15 386ace 343852 (base 13) to base 12 4b7431 2122121110 (base 3) to base 2 1100101111101011 131172 (base 11) to base 10 206505 What is -341054501 (base 6) in base 3? -102200122022201 What is aa01 (base 14) in base 9? 44287 Convert 10b09a8 (base 15) to base 3. 211111002212212 What is 1210121200 (base 3) in base 16? 8a72 Convert 1000100001110001101 (base 2) to base 10. 279437 Convert 1050727 (base 10) to base 14. 1d4cbd What is 21101021 (base 4) in base 2? 1001010001001001 45a53 (base 14) to base 10 169417 -404245054 (base 6) to base 11 -3a01347 What is -258611 (base 11) in base 7? -3312460 Convert 30206553 (base 7) to base 9. 4640343 Convert -28214 (base 13) to base 12. -37525 What is -a3a7 (base 13) in base 3? -1011000120 What is -49a028 (base 12) in base 16? -124ca0 What is -90ad3 (base 14) in base 9? -580183 What is 94881 (base 10) in base 7? 543423 Convert 444321030 (base 5) to base 14. 38a01b -707a2a (base 14) to base 9 -7110337 What is -11536004 (base 8) in base 16? -26bc04 Convert 102447 (base 14) to base 10. 544159 Convert 20333312130 (base 4) to base 3. 11102211111200 What is 1002a49 (base 11) in base 9? 3305452 What is 11011010111000010001 (base 2) in base 11? 562637 Convert -6355538 (base 12) to base 6. -1510231312 Convert 63178c (base 16) to base 3. 110012221012221 Convert -716427 (base 9) to base 5. -102042002 3173ac (base 16) to base 13 8961a2 What is -8157657 (base 9) in base 12? -1558967 -2434116 (base 9) to base 7 -14143365 b3c54 (base 13) to base 5 40312414 Convert 10100110111111001110 (base 2) to base 10. 683982 Convert -110010110011000001 (base 2) to base 11. -132360 -1cfd0 (base 16) to base 10 -118736 Convert -265cdc (base 14) to base 10. -1322410 Convert 6333 (base 7) to base 10. 2229 Convert 1001100001001111010 (base 2) to base 9. 524788 Convert 3a8026 (base 13) to base 8. 5317611 Convert 735934 (base 12) to base 10. 1814008 Convert -274770 (base 12) to base 10. -650820 Convert 2050152 (base 7) to base 10. 247389 Convert 5101601 (base 10) to base 12. 1860395 10517763 (base 10) to base 14 157b00b -101064451 (base 7) to base 10 -5898460 -1102022102 (base 3) to base 16 -6d19 Convert -466a6 (base 15) to base 9. -371553 -3aaa17 (base 12) to base 6 -32502431 What is -a6abd (base 16) in base 9? -1250418 What is -138048 (base 10) in base 4? -201231000 What is 116235 (base 8) in base 3? 2000222221 What is -32508 (base 13) in base 16? -16332 131551 (base 8) to base 15 d91e -690cb (base 16) to base 8 -1510313 What is -37232 (base 9) in base 4? -12012101 52340512 (base 6) to base 5 342143232 Convert 1001377 (base 8) to base 14. 6bb55 4124325 (base 7) to base 4 1320202233 8e494 (base 16) to base 10 582804 What is 1122212211100 (base 3) in base 2? 11010111101011011110 Convert 360216 (base 7) to base 15. 14393 What is 5bbe94 (base 15) in base 11? 2531445 What is 3661074 (base 8) in base 16? f623c Convert -3ae33 (base 16) to base 13. -85a31 Convert -224014123 (base 5) to base 7. -11336562 What is de6a0 (base 16) in base 9? 1637601 Convert -682843 (base 9) to base 6. -12433103 459319 (base 10) to base 11 294103 What is 101111100111011 (base 2) in base 10? 24379 413114231 (base 5) to base 7 20244260 What is -526035 (base 16) in base 13? -1170336 Convert -31013323002 (base 4) to base 15. -47e54c What is 1d8b9 (base 16) in base 12? 5a049 What is 7758 (base 12) in base 6? 140552 Convert 4803682 (base 9) to base 10. 2600903 What is -10111000110101011110 (base 2) in base 16? -b8d5e 101010101001010011 (base 2) to base 4 222221103 What is -596533 (base 13) in base 5? -1021040313 -12111010222 (base 4) to base 2 -110010101000100101010 -2321692 (base 10) to base 12 -93b6a4 What is 24023 (base 8) in base 12? 5b2b 119a94a (base 11) to base 2 111111011100001110010 What is 3350542 (base 7) in base 2? 1100101011110100000 11110110210 (base 3) to base 13 30c8a What is 1208171 (base 10) in base 15? 18ce9b Convert -220011200 (base 3) to base 5. -1030442 What is -55375 (base 11) in base 15? -18bda 210110101122 (base 3) to base 5 102004003 What is 2337056 (base 8) in base 6? 21404022 Convert -3b65b4 (base 15) to base 9. -5333387 42450a (base 15) to base 12 1080a61 1457161 (base 8) to base 3 210012120000 Convert 3aa181 (base 11)	{ "pile_set_name": "DM Mathematics" }
. -0.299331 1 * 96.343 96.343 What is 1 times -284863? -284863 Work out 5712611 * 1. 5712611 Calculate 19470.5. 8939.5 What is the product of -15166 and 197? -2987702 Product of -340 and -388. 131920 1 -90601 -90601 Multiply 0.0443079 and -0.2. -0.00886158 Multiply -1697.36 and -19. 32249.84 0 times 148837 0 Product of 144.9 and 42.75. 6194.475 Multiply -1.6 and -90.68. 145.088 15061 * 0.01 150.61 Calculate -2-4383. 8766 Product of 3579.81 and 0.3. 1073.943 Product of -1.2 and -1.7846. 2.14152 Work out -0.4 -1.4074. 0.56296 Work out -129 * 5326. -687054 -0.0693694 -48.0942 0.02070.0059 0.00012213 Product of 2470670 and -0.2. -494134 Calculate -8-1262. 10096 -297477 -0.02 5949.54 -0.07799004 * 4 -0.31196016 -52 times 0.4096 -21.2992 Work out 1.2 * -1.4259. -1.71108 What is 0.4 times -6092? -2436.8 Multiply 4 and -616.1. -2464.4 Product of 0.02404 and 1.4. 0.033656 106.82 times 42 4486.44 Multiply -6 and -8.1839. 49.1034 What is 189.33 times 11? 2082.63 Multiply 8348 and -2. -16696 -3 times 0.658989 -1.976967 -3763 times -1.9 7149.7 38 * 0.05691 2.16258 Product of -21251 and 3.9. -82878.9 Calculate 9-6295. -56655 -3751.58 -592.5 Multiply -18 and -0.124. 2.232 -2 * -7363 14726 -20.0168069 -0.0336138 Product of 1 and 39227. 39227 Work out -6323 0.32. -2023.36 Multiply -120 and -4247. 509640 0.50.11737 0.058685 Product of 2 and 187386. 374772 Product of 73 and 0.0306. 2.2338 -565-942 532230 Work out -59454 * -4. 237816 0.3 * -1110833 -333249.9 What is the product of 24063 and -115? -2767245 2163 * 14.4 31147.2 Calculate -3.9496-0.06. 0.236976 What is the product of 22351 and -0.048? -1072.848 Work out -11394 9. -102546 0.062423 * -7 -0.436961 -31770.7 -2223.9 Work out 0.4 4466. 1786.4 What is 0.02 times -3063.9? -61.278 Multiply -2 and 36716. -73432 266083-0.5 -133041.5 Calculate -10669-37. 394753 What is the product of 0.99459 and -23? -22.87557 What is the product of -1.4 and -33.03? 46.242 What is the product of 2 and 24.953? 49.906 -5 times -5650.2 28251 Work out 0.14101 * 7. 0.98707 4 * 0.59889 2.39556 Calculate -408513-0.2. 81702.6 -0.027 -0.8488 0.0229176 Work out 237955 * -24. -5710920 What is 15 times 3103? 46545 -0.05203 -10.15 -8194.25-5 40971.25 -0.11 times 24842 -2732.62 -1577.6 times -0.5 788.8 What is the product of -0.037 and -0.0887? 0.0032819 Work out 26.827 * 7. 187.789 Calculate -0.076-12451. 946.276 Product of -0.187 and 0.302. -0.056474 What is -0.57 times 0.01643? -0.0093651 Work out 0.06 -68.46. -4.1076 What is the product of -67059 and -0.2? 13411.8 10830 times -0.13 -1407.9 Multiply 1866 and 14. 26124 Product of -23 and 1515. -34845 -0.2 * -0.00666 0.001332 -5316 times 2.84 -15097.44 -1.35-17673 23858.55 What is the product of 12811 and 4? 51244 What is -1161 times 22.4? -26006.4 What is the product of 0.4 and -5290.3? -2116.12 Calculate -0.4218-0.078. 0.0329004 Calculate 123.999. 12266.1 What is the product of -0.03 and -375598? 11267.94 -9 times 688.19 -6193.71 What is the product of -0.2 and -44402? 8880.4 Work out 1.5169 -9. -13.6521 Product of 185 and 760.8. 140748 What is the product of 1018 and -0.28? -285.04 Work out -1773 * 0.11. -195.03 -95 times 11 -1045 Multiply 422849 and -0.3. -126854.7 54-2527 -136458 0.59 times 1657 977.63 Work out 0.4 3.491. 1.3964 8344-0.02 -166.88 70.089 0.623 What is the product of -0.01969 and -0.43? 0.0084667 30561 * -12 -366732 What is the product of 1401411 and -0.2? -280282.2 What is the product of 130 and -341? -44330 Work out 0.3 * -17877. -5363.1 0.05993 times 0.4 0.023972 Calculate 0.04142326. 5693.04 54803 -0.04 -2192.12 What is the product of 25.829 and -4? -103.316 Work out -5 * -1634.2. 8171 Product of 0.04 and -77605. -3104.2 Product of 0.1996 and -0.1. -0.01996 5 times 0.02196 0.1098 What is 0.062367 times 2.7? 0.1683909 Multiply 7 and -52465. -367255 Work out 1.3 * 1442. 1874.6 Calculate -0.2136311. -27262.2 Work out -176 -0.76. 133.76 Multiply -51 and 157. -8007 Work out 696.961 * 0.4. 278.7844 -0.59 * -0.0154 0.009086 49.4219-2 -98.8438 1 times 21155 21155 0.025322 -21 -0.531762 Calculate -10544115. -4337210 Work out 906.3 -9. -8156.7 Calculate 171.21.05. 179.76 What is -0.04603 times 5? -0.23015 Product of 2.2 and -129. -283.8 What is -0.6001 times -215? 129.0215 What is the product of -128.4 and 66? -8474.4 Multiply -1 and 199.18. -199.18 -59-651 38409 -0.2 times 77686 -15537.2 1 * 0.089767 0.089767 What is the product of 4 and 1687.04? 6748.16 Multiply -1 and 7693. -7693 15.908-0.16 -2.54528 Work out 0.15633 8. 1.25064 -564404 * -3 1693212 -32187 times -1 32187 Product of -0.1609 and -2916. 469.1844 Multiply 3 and 15965. 47895 18257 times 0.5 9128.5 Product of -17283 and 0.1. -1728.3 What is the product of -0.01939 and -1.3? 0.025207 Multiply 2.12094 and 1. 2.12094 Work out 205.9 * -123. -25325.7 What is 3311.5 times -20? -66230 Multiply 9 and -0.08089. -0.72801 What is -5 times -27559? 137795 9.318 times -3.8 -35.4084 Work out 79375 * 0.1. 7937.5 What is 29.7 times -3.063? -90.9711 Calculate -2583892. -516778 Product of -60 and -0.6565. 39.39 Product of 0.001 and 2827. 2.827 What is the product of 220 and -6631? -1458820 What is 266.94 times 37? 9876.78 Multiply 0.1 and -1.16539. -0.116539 Calculate -942-16.7. 15731.4 Work out -28991 * 0.006. -173.946 Calculate 6451593. 1027485 5.77235 28.8615 What is the product of 12.165 and -37? -450.105 Multiply 13 and 89531. 1163903 -0.4-484184 193673.6 6087 9 54783 What is -0.04 times -34.417? 1.37668 -2125504 times 0.3 -637651.2 What is 8713 times 8.9? 77545.7 Multiply 1 and -9271. -9271 What is the product of 12.3 and 1.42? 17.466 Work out -0.129974 * 1. -0.129974 -74273 * 3 -222819 Work out -0.036 * 2889. -104.004 What is the product of 0.054 and -3082? -166.428 Multiply 33499 and -4.7. -157445.3 Multiply -2 and -1.3729. 2.7458 5 * -7878 -39390 What is 0.61203 times -0.5? -0.306015 Work out 58486 * -0.4. -23394.4 Product of 2078 and 53. 110134 What is the product of -4 and -285529? 1142116 Work out 0.1 * -110022. -11002.2 Multiply 30.42 and -42. -1277.64 Work out 0 * 14750. 0 143705 times -0.3 -43111.5 What is -1 times -0.558? 0.558 Multiply -45.19 and 6. -271.14 Calculate -0.0528165. -8.712 Calculate 0.032261810.3. 0.009678543 -0.0261818 -0.47124 0.4 -404231 -161692.4 274.8-181 -49738.8 516384 1 516384 What is -4 times 7140? -28560 What is the product of 12 and 0.133? 1.596 -64.33-0.5 32.165 Calculate -0.40.265443. -0.1061772 Multiply 707 and 412. 291284 -2.1 * -0.0133 0.02793 -753.3 times 31 -23352.3 Calculate 580460-0.2. -116092 0.98-7.6 -7.448 -1.2081 times 5 -6.0405 Work out 0.4 * 2909. 1163.6 -5.213013 -15.63903 1-23463 -23463 0 * -12.68387 0 Work out 41 * 0.3. 12.3 2155.4 * -0.53 -1142.362 Multiply -2.4356 and -0.3. 0.73068 What is the product of 0.8 and 2470? 1976 0.143 * 1001 143.143 Calculate 23.480.4. 9.392 Multiply -1990 and -5.8. 11542 Product of -0.201 and -2.31. 0.46431 Calculate 0.6-2799.39. -1679.634 What is the product of 3 and 26716? 80148 Product of -101 and -852. 86052 Multiply -22 and -209.7. 4613.4 Calculate -1180.00035. -0.0413 0.1 -1049655 -104965.5 Product of 593 and -107. -63451 What is -352 times 0.036? -12.672 34.66214 13.98642 Product of -0.2 and -113.779. 22.7558 Work out 0.03 18783. 563.49 Multiply -3 and -261446. 784338 Calculate -27244.2. -11440.8 -3471-17 59007 Calculate -52034818. -9366264 Multiply -30 and -15.1486. 454.458 What is the product of 54.2 and 0.086? 4.6612 15.62 times 111 1733.82 Calculate 232-2766. -641712 Multiply 0.01794 and -0.57. -0.0102258 What is the product of 25.53 and 433? 11054.49 -11.0990.09 -0.99891 -1945 times -3 5835 Product of 0.4 and 431. 172.4 Work out 3 2484. 7452 Calculate -1557.37-0.1. 155.737 3.2572 56 182.4032 Calculate 339660.02. 679.32 0.06-0.001416 -0.00008496 -0.009 times -25830 232.47 What is the product of 10 and -1791? -17910 -0.2583.305 -116.661 What is the product of 16 and -0.4256? -6.8096 0.15349-0.4 -0.061396 Product of 22 and 18899. 415778 Product of 236.64 and -53. -12541.92 Work out 0.4 * 1647.18. 658.872 Calculate -0.04*5243. -209.72 What is the product of -12000 and -2? 24000 What is -19 times -1532? 29108 Multiply -3337 and 111	{ "pile_set_name": "DM Mathematics" }
3. Let l = -0.12 + 5.12. Which is the second biggest value? (a) k (b) x (c) l a Let i = -0.04 - -0.44. Let p = 97225 + -1261726/13. Let z = -169 + p. Which is the third smallest value? (a) i (b) z (c) 0.2 a Let y = 2.2 + -1.9. What is the second smallest value in y, 2/3, 0.2? y Let v = 8523374/28357 - 10/4051. Let u = v + -300. Let k(r) = r3 + r2 + r + 2. Let m be k(-2). Which is the third smallest value? (a) m (b) u (c) -3/4 b Suppose -3s + 29 = -76. Suppose -11 = -3v - 62. Let t be (-3)/(-15) + v/s. Which is the second biggest value? (a) t (b) 0.5 (c) -5 a Let w = 0.05 + -0.13. Let o = -32 - -31.62. Let g = o - w. Which is the third biggest value? (a) -1/2 (b) 1/3 (c) g a Let s = 1 + -2. Let w = 1 - 5. What is the smallest value in w, -2/21, s? w Let l = 0.2 + -0.2. Let d be (1/16)/(1/(-6)). Let g = -0.21 + 5.21. Which is the second smallest value? (a) l (b) d (c) g a Suppose -d = -p + d + 19, -4p = 4d - 16. Let r be (-2)/4(-6)/p. Which is the second smallest value? (a) r (b) -2/3 (c) 5 a Let d = -0.1 + 0.3. What is the second smallest value in -2/3, d, -2/9, 5/3? -2/9 Suppose -3o - o + 24 = 0. Let p = 8 - o. Let b = 460.1 + -460. What is the third smallest value in p, b, -4? p Suppose -p - 3p - 16 = 0. What is the third biggest value in 0.4, p, 1/4? p Let b = 5.92 - 6. Let k = -0.22 + b. Let g = 0.6 + k. What is the third biggest value in -5/2, g, -1/3? -5/2 Let f = 0.5 - 0.8. Suppose -4x + x + 3 = n, 2n + 14 = 4x. Which is the biggest value? (a) f (b) 2/5 (c) x c Let v = -0.41 + 0.01. Let m = -0.2 - v. What is the smallest value in m, -3/8, 4? -3/8 Let y be -2 - ((-153)/8)/9. Which is the third smallest value? (a) y (b) -1 (c) -3/2 a Suppose c - 3 = -5. Let b be (60/33 + c)-1. What is the biggest value in b, 1/2, -3/2? 1/2 Let n = 2 - 1.5. Let i = 2.5 - n. Which is the smallest value? (a) 5 (b) 4 (c) i c Let p = -7 + 7.7. Let i = 5.7 - p. Which is the biggest value? (a) 1/3 (b) 4 (c) i c Let o = 81 + -51. Let f be 0 + 3/o2. Let v = -3 + 2. Which is the smallest value? (a) f (b) v (c) 2/3 b Let y = -19/12 + 7/3. Let j(x) = -2x + 6x - 3x. Let w be j(3). Which is the second smallest value? (a) y (b) 0 (c) w a Let t be (2 - 1/1)127. Let h = 1399/11 - t. Let l = -700/9 - -78. What is the smallest value in l, h, 0.4? h Let b = 0.07 - 5.07. Let i = b - -4.8. What is the third smallest value in -3, i, 2/19? 2/19 Suppose -2h + 4u = u + 6, -4h - u - 12 = 0. Which is the smallest value? (a) h (b) 3/8 (c) -1.2 a Let v = 0.57 - -0.02. Let j = -0.19 + v. Which is the biggest value? (a) -4 (b) j (c) -3/4 b Let r = 471/38 + -25/2. Which is the second smallest value? (a) r (b) -4 (c) 2 a Let h = -8 - -7.8. Suppose -4u = u - 5. What is the second biggest value in -0.4, u, h? h Let j = 2234/9 + -248. What is the third smallest value in j, -3, -5, 2/5? j Let s = 3.12 + -0.12. Let c = -4 + 5. What is the third biggest value in s, -5, c? -5 Suppose 6z - 12 = -0z. What is the smallest value in -3/2, z, -5? -5 Let j = 8/21 + 20/21. Let v = 0.5 + -1. Let m = 1.5 - v. Which is the second biggest value? (a) j (b) m (c) -2 a Let r = -4 - -11. Let w be (-22)/(-6) + (4 - r). Which is the third smallest value? (a) 5 (b) -1/8 (c) w a Let y(n) = -n*3 + 7n*2 + 7n + 7. Let r be y(8). Which is the third biggest value? (a) 1 (b) 2/11 (c) r c Let o = -3.95 + -0.05. Let n = -6.94 - -7. Let c = n - -0.34. What is the second smallest value in 0.2, o, c? 0.2 Let h be (2/3)/(100/(-30)). Suppose 0 = 4o - o - 12. What is the second smallest value in -2/5, h, o? h Let k = 1755747737/585 - 3001279. Let w = -2/117 - k. What is the second smallest value in 0.1, w, -5? 0.1 Let h = 7.14 - 0.14. Let q = h - 2. What is the third smallest value in q, -5, -2/9? q Let v = 23.4 + -23. Which is the second smallest value? (a) v (b) -1 (c) 0 c Let l = 0.4 + -2.4. Let m be ((-278)/2)/(-4 + 1). Let n = 46 - m. Which is the third smallest value? (a) n (b) l (c) -0.2 c Let o = 1 + 4. Let x(q) = -q. Let j be x(o). What is the third smallest value in -1/4, 4, j? 4 Let f be 1((0 - -1) + -1). Let t = -1.2 - -6.2. Let k = 6 - t. Which is the smallest value? (a) 2/11 (b) f (c) k b Let w = 284/435 + 2/145. Which is the biggest value? (a) -6 (b) -2 (c) w c Let v be 0 - (-2)/(-5) - 704/(-1360). What is the smallest value in 0, -1/2, v, 1? -1/2 Let i = -22 - -22.5. Let o = -4 + 3. Let h = o + i. Which is the second biggest value? (a) -3 (b) -1 (c) h b Let t be -8((-5)/2 + 2). Suppose -ti + 36 = -4v, v + 5i - 5 = 16. Let g = 0.3 - 1.3. Which is the second biggest value? (a) v (b) 0 (c) g c Let q = 0.6 + -1. Let g = q - -0.2. Let i = -6 - -5. Which is the biggest value? (a) 0.1 (b) i (c) g a Let z = -15/2 + 29/4. What is the third smallest value in -2/3, 2, z? 2 Let d = -7.4 - -10.4. What is the third biggest value in d, -1, 0.4? -1 Let y be (29/16 - 2)-4. Let l = -0.25 + -0.05. What is the biggest value in -0.7, y, l? y Let o be 226/(-1284)(5 - 3). Let w = -2/107 - o. Let z be ((-2)/(-2))/((-7)/2). Which is the third smallest value? (a) w (b) 0.5 (c) z b Let j = -0.36 + 0.06. Let z be (25/(-4) - -5)-4. What is the third smallest value in j, z, 0? z Let o = -91.3 + 91. Let u = -0.08 - -3.08. Which is the biggest value? (a) o (b) u (c) -1/8 b Let m = -9 + 4. What is the second smallest value in 3, m, 5? 3 Let r(d) = d3 + 9d*2 - d - 8. Let w be r(-9). What is the third biggest value in -0.3, 2, -1, w? -0.3 Let a be (-6)/4(-8)/90. What is the third smallest value in a, 3/2, 4, 9? 4 Let k = 6.7 + -9.7. What is the biggest value in -2/7, 6/13, k? 6/13 Let h be (-3)/24/(-15). Let s = 3.4 - 3. Let m = s + 0.1. Which is the second biggest value? (a) 4/9 (b) m (c) h a Let p = 0.03 + 0.17. Which is the biggest value? (a) -2/17 (b) 0 (c) -0.5 (d) p d Let h = 28 + -26. Let g(l) = -l3 - 3l2 + 4. Let y be g(-3). Which is the third biggest value? (a) h (b) 0.1 (c) y b Let r = -4 - -1. Let o = -8 - -2. Let g = 4 + o. What is the third smallest value in g, r, -0.1? -0.1 Let t = -3.4 - -3. Let i = 13 - 25. Let x = i + 12.03. Which is the third smallest value? (a) t (b) 0 (c) x c Let h = -2.13 - -0.13. Which is the second biggest value? (a) -1/3 (b) -1 (c) h b Let m = 33 + -29. Which is the second biggest value? (a) 0 (b) 9 (c) m (d) -1 c Let w = 69.1 + -65.91. Let r = -0.19 + w. Which is the second smallest value? (a) -3/4 (b) r (c) 1/8 c Let p = -3.99 - -4. Let n = p - -1.99. Let d = -0.2 - 0. Which is the third biggest value? (a) d (b) n (c) -1/4 c Let k = 2 + 2. Let s = -50.3 - -50. What is the biggest value in s, -1, k? k Let f = -152 - -146.6. Which is the smallest value? (a) f (b) 2 (c) -2 (d) -5 a Let c be ((-22)/(-495))/((-1)/(-3)). What is the third biggest value in -1/3, c, -1? -1 Suppose -p - p = 0. Let r(h) = h3 - 18h2 - h + 16. Let w be r(18). What is the third smallest value in p, -0.5, w? p Let y = -1.6 - -1.47. Let x = y - -0.03. What is the second smallest value in -5, -3/8, x? -3/8 Let u be 40/(-350)(-10)/4. Which is the biggest value? (a) -2/5 (b) 1 (c) u b Let m = -85/62 + -4/31. Let q(j) = j*2 - 22j + 76. Let t be q(4). What is the second smallest value in t, 1, m? 1 Let w = -9.3 - -9. Let o = -7 + 4. Suppose j + 1 - 6 = 0. Which is the second biggest value? (a) j (b) o (c) w c Let z = -0.1 + 13.1. Let f = z - 12.6. Which is the third smallest value? (a) f (b) -4 (c) -4/7 a Let h = 0.8 + -0.3. Let k = -15 + 12. Which is the biggest value? (a) h (b) k (c) -4 a Let r = 3 - 6. Let l be (8/6)/(3/129). Let j = l - 58. What is the third smallest value in j, 0.5, r? 0.5 Let y be -4 + 6 + (-15532)/(-2). Let o be 1/3 + y/42. Let c = o + -185. What is the second biggest value in 1, c, 2/11? c Let q = 23 + -23.1. Let v = -0.5 + 2.5. Let c = -2.3 + v. What is the second smallest value in q, c, -5? c Let b(o) = o*3 + 6o**2 - 2. Let q be b(-6). Let j = -7 - -6.6. What is the second biggest value in 2, q, j? j Let f = -2 - -3. Let o = 28.2 - 29. Let l = f + o. Which is the second smallest value? (a) l (b) -0.4 (c) -1 b Let h = -5.9 + 6. Let j be -3 - -3 - 1 - 4. Which is the third smallest value? (a) j (b) h (c) -0.5 b Let q = 71/2	{ "pile_set_name": "DM Mathematics" }
1377) - (sqrt(1377) + -2)) + -3 + sqrt(1377) - (0 + sqrt(1377) + -3sqrt(1377) + 0)) + 5))2. 559872sqrt(17) + 16144272 Simplify (((-6(-1 + -1sqrt(684) + sqrt(684)) - (4(sqrt(684)-1 - sqrt(684)) + -5)) + 5)63 + 0)*2. 497664sqrt(19) + 14266368 Simplify 6(-3(sqrt(153) + sqrt(153) + -3 + sqrt(153) + -1 + sqrt(153) + 1sqrt(153)3))*2. -9072sqrt(17) + 405702 Simplify -5 + ((sqrt(1225)-3 - sqrt(1225)) + sqrt(25) + (sqrt(1600)3 - sqrt(1600)))/((sqrt(1470)2)/(2sqrt(864) - sqrt(864))). -66sqrt(5)/7 - 5 Simplify ((sqrt(192) + (sqrt(192) - -2sqrt(192)))*23 - (sqrt(192) + 0 + 3)) + 0 + 5 + 4 + ((sqrt(192)-1 - sqrt(192)) + 1)2. -40sqrt(3) + 9991 Simplify (5 + -35(sqrt(76)/(sqrt(4) + sqrt(4) + sqrt(144)) + -2 + sqrt(475)))*2. -21525sqrt(19)/4 + 7264675/64 Simplify (2((sqrt(187)2 - sqrt(187)) + sqrt(187)) + -3(sqrt(187)1 + sqrt(187)))/(53sqrt(891)-4). sqrt(17)/270 Simplify ((sqrt(250) - (sqrt(250) + (2sqrt(250) + sqrt(250))2))-5-2)/((-1sqrt(50)/sqrt(2))/(sqrt(5) + -3(sqrt(5) - sqrt(80)))). 3000sqrt(2) Simplify (4(-1sqrt(76) - 5sqrt(304))3)*2 + (3sqrt(5700) + sqrt(57))/((sqrt(6)-2 - sqrt(6))/sqrt(2)). -31sqrt(19)/3 + 1324224 Simplify sqrt(208)2-2 + -3 - (-1(sqrt(91)/sqrt(7) - sqrt(13)) - sqrt(1053)-3)*2. -9480 - 16sqrt(13) Simplify -4 + (2sqrt(882))/((-1sqrt(24))/sqrt(4)) + (sqrt(36)/sqrt(3) + 5 + sqrt(3)-2 + (sqrt(3) + -4 + sqrt(9)/sqrt(3))-1)*2. -50sqrt(3) + 89 Simplify (0 + -4 + (sqrt(2736) + 0 - sqrt(2736)) + -2 + -2sqrt(2736)-2 + -4 + 1sqrt(2736) + sqrt(2736) + 0 + -2)2. -1728sqrt(19) + 98640 Simplify (-5-4-1sqrt(200))/(sqrt(90) + (-3sqrt(90) - sqrt(90))-1). -8sqrt(5)/3 Simplify (sqrt(84)/(1sqrt(1728) - sqrt(12)) + 1 + 1(sqrt(7) + 1 + sqrt(7) + -1 + sqrt(7) + sqrt(7) + sqrt(7)) + -4)*2 + 2. -336sqrt(7)/11 + 23283/121 Simplify ((sqrt(1575)-3 - sqrt(1575)) + sqrt(63) + (sqrt(441)-2)/sqrt(7))/(6(sqrt(81)4 + sqrt(81))). -7sqrt(7)/30 Simplify (sqrt(56)/sqrt(4))/sqrt(7) + 4 + (2sqrt(18) - (1 + (0 + sqrt(2))*2)) - (2sqrt(864))/(sqrt(108)/(2sqrt(9))). -17sqrt(2) + 1 Simplify -4(3(sqrt(72) - (-5(0 + sqrt(72)) + sqrt(72))2) + (-4(-4 + sqrt(242) + 2sqrt(242)))2). -126592 + 16824sqrt(2) Simplify ((2(sqrt(133)2 + sqrt(133)))/(sqrt(21)/sqrt(3)5))2 + ((-1sqrt(228))/sqrt(12) - ((((sqrt(114)-3)/sqrt(6))2 - sqrt(19)) + sqrt(19))). -3591/25 - sqrt(19) Simplify (-1sqrt(3328)-5)/((sqrt(24) + (sqrt(24) - 6sqrt(24)4) + sqrt(24))/sqrt(6)) + -4. -40sqrt(13)/21 - 4 Simplify ((-5(sqrt(77) + sqrt(77)-1)-64)/(-6sqrt(11)2 - (sqrt(99) - -3sqrt(99))))2. 0 Simplify (sqrt(80) + -1 - sqrt(80))3 - (sqrt(80)1 + 2)2 - ((-4sqrt(80)-2 - (sqrt(80)-1 + 2 - sqrt(80))) + 0)*2. -8091 + 144sqrt(5) Simplify ((sqrt(2200) - (sqrt(2200) + (sqrt(2200)2 - sqrt(2200)) + sqrt(2200)))/sqrt(2) - (-3sqrt(44)3)2) + -4 + -2-2sqrt(2156). -3568 + 36sqrt(11) Simplify (-5((-4-1sqrt(171) - sqrt(171)) + 2sqrt(171)-2))/((sqrt(900) - 1sqrt(900))5 + (sqrt(900) - (sqrt(900) + 21sqrt(900)))). -sqrt(19)/4 Simplify -1(-3 + -4(((sqrt(304) + 1)-2)2 + sqrt(304) + 0 + (sqrt(304) + -1)2)1). 112sqrt(19) + 6103 Simplify (((sqrt(800) + 1sqrt(800)-2)-3)/((-2sqrt(70)2)/(-5(sqrt(7) - ((sqrt(7) - sqrt(7)2) + sqrt(7))))))2. 1125 Simplify (sqrt(19) + sqrt(133)/sqrt(7))3 + (sqrt(190) + (sqrt(190)3 - sqrt(190)) + sqrt(190))/sqrt(10) - ((-3sqrt(475))*2 - sqrt(57)/(sqrt(9)/sqrt(3))). -4275 + 11sqrt(19) Simplify 4 + (2 + sqrt(441)/sqrt(7) + -2 - (-3 + ((-3sqrt(77)5 - sqrt(77)) + sqrt(77))/sqrt(11))). 7 + 18sqrt(7) Simplify ((sqrt(4719) + 1sqrt(4719)-3 + sqrt(4719))1)/((-1sqrt(18)6 + sqrt(18))/((sqrt(168)/sqrt(4))/sqrt(7))). 11sqrt(13)/5 Simplify -1 + (-2 + sqrt(425) + 3)2 + -2 + (sqrt(425) + 1 + -4 + sqrt(425) - ((sqrt(425) + -1 - sqrt(425)) + -1))2. -10sqrt(17) + 2124 Simplify (3((-3 + 5 + -4-4(sqrt(343) + 2))-3 + -5))*2. 647136sqrt(7) + 7215489 Simplify (2sqrt(384))/(sqrt(88)/(2sqrt(11)) + sqrt(8) - sqrt(8)) + (2 + -2sqrt(243))2 + 0 + sqrt(192) + 1 + sqrt(192). -40sqrt(3) + 977 Simplify -2 + 0 + (sqrt(304))*2 + 0 + 5 + -2(sqrt(1216) + -3 + 1). -16sqrt(19) + 311 Simplify -4 + (6(-2sqrt(637) - sqrt(637)) + -1 - (1 + sqrt(637) + -1 - ((-2sqrt(637) - sqrt(637)) + -3)))*2. 1232sqrt(13) + 308320 Simplify 1 + ((-1 + sqrt(325) + sqrt(325)1 + sqrt(325) + ((sqrt(325) + 1)-3 - sqrt(325)))-2)2 + -3sqrt(325) + 2 + (sqrt(325) - (sqrt(325)-3 + -2))2. 225sqrt(13) + 6571 Simplify 1 + (sqrt(56)/(-2sqrt(288) + sqrt(288)))2 + 0 + -4 + 2 + 4. 115/36 Simplify (-3 + -5 + (-1(sqrt(500) + -2) + -4sqrt(500)-2 - 4(5(-1 + sqrt(500)) - sqrt(500))))*2. -2520sqrt(5) + 40696 Simplify (3(sqrt(85) + 3sqrt(85)-2 + (sqrt(85) - (sqrt(85) + 1(1sqrt(85) - sqrt(85))))))/((5sqrt(5) - sqrt(5))1 - sqrt(720)1). 15sqrt(17)/8 Simplify (sqrt(63) - ((sqrt(567) - sqrt(567)-3)/sqrt(9) - sqrt(63)) - (3sqrt(9072) + sqrt(9072)))/(-4-5sqrt(1296)). -5sqrt(7)/24 Simplify (-22(sqrt(4356) + sqrt(4356)-1))/(-2(sqrt(12) + sqrt(120)/sqrt(90))6). 0 Simplify ((2 + 0 + -4 + sqrt(117) + 1 + -4)-3)*2-6 + -4. -7672 + 1620sqrt(13) Simplify ((sqrt(11) - (sqrt(11) - (sqrt(11) + 0 + sqrt(11))2 - sqrt(11))*2)-4 + 0 - (4sqrt(88))/(sqrt(8)/(-1sqrt(4) - sqrt(4)))) + 5. 12sqrt(11) + 709 Simplify (((sqrt(96)-1 - sqrt(96)) + sqrt(96))6-4)/(6-2sqrt(1152)) + 1. -sqrt(3)/3 + 1 Simplify (1 + -5 + (sqrt(637)-12 - (1 + (-1sqrt(637) - sqrt(637)) + sqrt(637))) + 5)2. 637 Simplify ((sqrt(77)2 - sqrt(77))-1-53)/(-1(sqrt(1331) - sqrt(1331)2) + sqrt(1331) + -2sqrt(1331)-1). 15sqrt(7)/44 Simplify -5 + (-2sqrt(1728)2)/(4(sqrt(81)/sqrt(3))/sqrt(3)) + -4. -8sqrt(3) - 9 Simplify (sqrt(275)/(sqrt(375)/sqrt(3) - sqrt(5))-2)/(-6-3(sqrt(405) + (-1sqrt(405) - sqrt(405)))). sqrt(11)/324 Simplify 4(6(-5 + (-4sqrt(832)1 + (-1sqrt(832) - sqrt(832) - sqrt(832))4)*2) + 3). 5111700 Simplify (sqrt(648) + 1 + (sqrt(198)2 - sqrt(198))/sqrt(11) - (0 + sqrt(648))66)*2-42. -6290072 + 10032sqrt(2) Simplify -1 + ((1(-4(1 + sqrt(475)) - sqrt(475)) - ((sqrt(475) - (-2 + sqrt(475) + -1 - sqrt(475))) + (sqrt(475)-1-3 - sqrt(475)))) + -5)*2. 960sqrt(19) + 30543 Simplify 2((4((sqrt(475) - sqrt(475)1) + sqrt(475)))25 - (-4 + 2 + sqrt(684) + (sqrt(684) + 1)4)2). -240sqrt(19) + 41792 Simplify 3 + (sqrt(50)/(sqrt(1000) - sqrt(1000)-4))2 - (0 + 4sqrt(5)-4 + 2). 501/500 + 16sqrt(5) Simplify (sqrt(143)12)/(-3(sqrt(275) + sqrt(11))) - (4 + (6(sqrt(1300)-4 + sqrt(1300)))2). -421204 - sqrt(13)/9 Simplify 0 + 2(1sqrt(3584)-5 + sqrt(3584))/(2(sqrt(288)-3 - sqrt(288))). 4sqrt(7)/3 Simplify -2 + (((sqrt(539) + -2)-5 + sqrt(539) + (sqrt(539) + 2)-5)2 - (-3-1(sqrt(539) - 3sqrt(539))3)2). -130979 Simplify 3 + sqrt(275) + 3 + -5 + (-4-4sqrt(891)3)*2. 5sqrt(11) + 2052865 Simplify -4 + ((sqrt(275) + (sqrt(275) + 0)3)26 - ((sqrt(275) + -2 - sqrt(275))*2 + 1 - sqrt(275))2). 10sqrt(11) + 26386 Simplify ((1 + sqrt(720) + 5 - sqrt(720) - (sqrt(720) + (-4(sqrt(720) + 1) - sqrt(720)))) + 0 + (sqrt(45)-6)/sqrt(9)-3)*2. 1320sqrt(5) + 21880 Simplify ((sqrt(132)/(sqrt(12)-1))2 - ((1 + sqrt(11) - sqrt(11)) + -5))-5 - (sqrt(132)22)/(sqrt(132)/(sqrt(22)/sqrt(2))). -75 - 4sqrt(11) Simplify (-2 + ((sqrt(684) - (0 + -2sqrt(684)))-6 + 1 + sqrt(684) + 1 + 3 + 2)2)-4. -790892 + 5712sqrt(19) Simplify (sqrt(637)1-2 + 4 + (1 + 2sqrt(637) - (-4 + -1sqrt(637))))2 + 1 + 3. 126sqrt(13) + 722 Simplify -4(4 + (1 + sqrt(468) + -5 - sqrt(468)) + sqrt(468) - (-4 + (-1 + sqrt(468) + sqrt(468))-3))*2. -91732 - 336sqrt(13) Simplify ((sqrt(195) + (sqrt(195) + (sqrt(195) - (sqrt(195) + 2sqrt(195))))-2)/((sqrt(60)/sqrt(3))/sqrt(4)))/(34sqrt(3)-2-4). sqrt(13)/32 Simplify (sqrt(26)/((sqrt(32) - sqrt(8))/sqrt(4)))*2 - ((2sqrt(325))*2 + 2) - (4 + -6(1sqrt(130)/(sqrt(10)-2))*2). -2547/2 Simplify (1 + -3(-2 + sqrt(243)) + (-2(0 + sqrt(3))2 + sqrt(3) - (sqrt(27) + -1)))1. -29sqrt(3) + 2 Simplify ((-1(sqrt(1100) + sqrt(1100)-2 + sqrt(1100) + 0) - (3 + 2 + sqrt(1100)-1)) + 5 + -2)*2. -40sqrt(11) + 1104 Simplify 0 + ((2sqrt(120)/sqrt(4))/((sqrt(5) + sqrt(80))-3))/(sqrt(768)2 + sqrt(12) - (sqrt(1200) - 2sqrt(1200))). -s	{ "pile_set_name": "DM Mathematics" }
q*2 + 3q - 8. Let j be l(-5). Is j at least as big as 8/13? True Let v = 126 - 120. Which is greater: 1/5 or v? v Let i = -29 + 18. Is -9 not equal to i? True Let d be 294/(-45) - 3/(-9). Suppose 3a + 2a - 15 = -5c, -5a = 3c - 3. Let w = d + c. Is w equal to 1? False Suppose 3v - 4 = -v. Let k = 0 + 5. Let i be (v/3)/(k/(-15)). Which is smaller: -2 or i? -2 Let t be (3/(-4))/(270/(-9)). Is t less than or equal to 0? False Let k(p) = -p*3 - 7p*2 + 10p + 17. Let n be k(-8). Is -2/89 < n? True Suppose 2l = -2l + 4. Suppose -l + 11 = 5q. Suppose -r = qr. Is 4/9 <= r? False Let x = 38 + -113/3. Which is greater: x or 1? 1 Let b be 54/(-10) + (-2)/(-5). Which is smaller: b or -6? -6 Suppose 3x + 16 + 8 = 3s, 4x = s - 23. Suppose 0 = -i - 4l - 4, -si - 3l + 15 + 0 = 0. Are i and 8 nonequal? False Let c be (-4)/3150/(-20). Is c < 1? False Suppose t + 0t = -7. Which is greater: t or -6? -6 Suppose 0c - 4 = -2c. Suppose -3z + 5 = c. Let w be (-4)/36/(-4). Which is smaller: w or z? z Suppose -2 = -2b + 6. Let h be (-2)/4 + 6/b. Which is greater: h or -1? h Suppose 72 = -p + 5p. Let v be (-8)/36 - (-1)/p. Which is bigger: 0 or v? 0 Suppose -z + 4d - 5 + 0 = 0, 4z - 2d + 6 = 0. Which is bigger: -5/8 or z? -5/8 Let b(c) be the second derivative of c4/12 - c3/6 - c. Let p be b(0). Let k = 105/202 + -2/101. Which is bigger: p or k? k Let i = -9 + -12. Is -21 <= i? True Let r = 2 + -2. Let i = -11 + 8. Which is bigger: i or r? r Let n = -0.3 + 0.4. Let c = 2 - 5. Let a = c - -1. Which is bigger: a or n? n Suppose -7y - b - 9 = -3y, 5b = -25. Let p = -3 + 5. Let k be (-6)/4 + p/4. Is y < k? False Suppose -3l = 9, 0w + 2l + 144 = 3w. Suppose -4r + w = -2r. Let m be -2 - (r/(-7) + 1). Which is smaller: -1/4 or m? -1/4 Suppose 0 = -2x + 19 + 49. Let a = x - 18. Is 15 greater than a? False Let x(p) = p - 4. Let f be x(-10). Let l be (-4)/f - 8/28. Suppose -2q + 2u - 10 + 2 = 0, l = 3q + u. Is -2 >= q? False Suppose -50 = 5v + 2x, 5v - 3x = -30 - 20. Is -3 != v? True Let c be ((-16)/30)/(42/(-175)). Which is bigger: c or 2? c Suppose 5j + 13 = 8. Is -3/5 <= j? False Suppose -4a - 54 = 42. Let k be ((-18)/a)/((-126)/(-16)). Which is smaller: k or 1? k Suppose -4t + 4m = 24, -2t - 12 = 4m - 2m. Let u be (7 + -1)(-3)/t. Which is bigger: u or 4? 4 Suppose 4a - 3 = -27. Let u be 10/15 - (-16)/a. Suppose -2z - 3o = -12, 4o - 18 = -4z - 2. Which is smaller: u or z? u Let d(f) = -f2 + 7f - 9. Let o be d(6). Let t = o - 6. Is t >= -7? False Let l = -239/11 + 22. Which is bigger: l or 0? l Let c be 1 - (-1)/((-4)/5). Let p = -12 - -11. Which is greater: c or p? c Let f = -14 - -18. Suppose 3 = 5s - fs. Which is greater: 9/5 or s? s Let y = 39.8 - 40. Let q = -25 - -38. Let b = -18 + q. Is b smaller than y? True Let s = 39 + -7. Are s and 33 unequal? True Let d = 0.13 + -3.13. Let r = 0 - -0.1. Is r at least as big as d? True Suppose -g - 2 = 2. Let f be g/(-54)(-18)/(-12). Is 1 not equal to f? True Let w be 1 - (35/(-4))/(-5). Is 0.09 less than w? False Let u = -3203/308 - -114/11. Let i = u + 59/84. Is i less than -8? False Let h = 197/6 + -33. Is -1 less than h? True Let f(c) = c - 9. Let z be f(-6). Let y = 3 + -1. Let p be (3/z-4)/y. Which is greater: p or 7/5? 7/5 Let c = -18 + 17. Let x = 1/28 - -45/308. Is c != x? True Let p = -805/6987 + -1/411. Which is smaller: p or 1? p Let u = 8 + -4. Suppose 4c + 13 = -j + u, 4c + 14 = -2j. Let t be 1/(-4) + (-1)/(-36). Is c > t? False Let r = -16 - -13. Let p = -11 - r. Is 2 at least p? True Let d = -0.7 + 0.7. Let s = 2 + -2. Let n = d - s. Is 2/3 at most n? False Let o = 175 + -1580/9. Is o greater than or equal to -0.2? False Let t = -19 - -20. Does t = -2/15? False Let f be (2/(-15))/(15/25). Let n = 17.9 + -18. Which is smaller: f or n? f Suppose 5c = -4h + 2h + 54, -3c + 5h + 20 = 0. Is c at least 9? True Let y be 0 + (-31749)/429 + 1. Let o = -798/11 - y. Let t = o - 11/52. Is t bigger than -1/2? True Let q(o) = -o*3 + 2o*2 + 3o - 4. Let d be q(3). Let l(c) = -2c + 5. Let i be l(4). Let u be -1 + ((-6)/(-2))/i. Which is greater: u or d? u Let a = 11 + -7. Suppose 0 = f + f - 10, 3f - 3 = aw. Is 2 not equal to w? True Let v = -10.4 + 9.47. Is 0.1 greater than v? True Suppose 7k - 5k - 10 = 0. Suppose 3i - 2m = -3, -2i + 2m - km - 2 = 0. Which is smaller: i or -2/39? i Let p = 11 - 9. Let y = p + 1. Is 4 less than y? False Let l = -8/29461 + 144447395/412454. Let a = l - 350. Is -1 less than or equal to a? True Suppose -2x - 3x + u = -33, -4 = -2u. Suppose l = -0c + 5c - 32, -3c - l = -16. Are x and c equal? False Let c = -22 - -22. Are -1 and c unequal? True Suppose 0 = -4d + 8d - 140. Let y = 56 - d. Which is bigger: y or 20? y Suppose 2t + 3z = 6t + 81, 3z = t + 18. Which is greater: t or -22? t Suppose -6 = -2l + 2h, -4h = 4l - 16 - 12. Which is smaller: l or 3? 3 Let y = 4/31 + -14/589. Do y and 0 have the same value? False Let x(r) = r + 13. Suppose 26 - 9 = -q - 5s, -q - 13 = 3s. Let f be x(q). Suppose b = -5v + 5, -fb + 25 = -b. Which is smaller: 2/11 or v? v Suppose 6q = -2q + 40. Is q less than 4? False Let g be ((-32)/(-5))/((-6)/(-15)). Let y be g/(-24)(-6)/(-14). Which is bigger: y or 0.2? 0.2 Let b = -13 - -13. Suppose 2o - 5z - 17 = o, 0 = o + 2z - 3. Does b = o? False Let r be 21(-12)/24. Do r and -2/3 have the same value? False Let i = -6 + 17.1. Let x = i - 11. Which is bigger: -8 or x? x Suppose -2r - 1 = -h, 4r = 3r - 4h - 23. Let t be (-2)/(8/123). Is t != r? True Suppose 0 = -0c - 5c. Suppose -4a - a = c. Is a bigger than 1/3? False Let z = -12 + 13. Suppose 6p = 3p + 6. Which is bigger: p or z? p Let b = -2/19 + 31/114. Is 0 at least b? False Let j(r) = 14r + 1. Let n be j(1). Suppose -4y + n = -41. Let x be 6/15 - y/10. Does x = -1? True Let d be (45/30)/(21/(-68)). Is -4 at least d? True Suppose 4r - 31 = 4v - v, -3v = -2r + 23. Suppose 0 = z + r - 6. Let m = 0.9 + -0.7. Is z greater than or equal to m? True Suppose 2z = 6z. Which is greater: z or 6/13? 6/13 Let o(u) = -5u + 18. Let n be o(4). Let j be (12/(-5))/(1/(-5)). Let b be j/30(-2)/n. Is b at least -1? True Let q be (-136)/(-61) - (-2)/(-1). Let y = q + -520/671. Suppose 0 = -10z - 3z - 26. Do z and y have the same value? False Let i(x) = x + 11. Let w be i(-10). Let q be 1 + (-4 + w)/3. Is -2 at least q? False Let q = -6 - -10. Let g = q - 3.9. Which is smaller: g or -8? -8 Suppose -3s - 3n = -s - 24, -5s = -n - 26. Suppose -z + sz - 5 = 0. Which is smaller: z or 2/17? 2/17 Let v = -17 + 17.1. Which is smaller: v or -12? -12 Let d be (6/(-8))/((-4)/(-32)). Let s = -8 - d. Let a = s + 2. Is a less than -3/8? False Let a(u) = u*3 + 8u*2 + 6u + 9. Let w be a(-7). Let o = w + -17. Which is smaller: -4/5 or o? o Let m = 0.7 + 1.3. Is 0 at least as big as m? False Let z = 93 + -184. Let l be (-112)/(-390) - (-14)/z. Is -1 smaller than l? True Suppose 3y - l = 4, 4y + 5l - 14 = 2l. Let w = 1 + 3. Suppose yj + w = 4j. Is 1 at most as big as j? True Let n = -43/2 + 21. Let t(p) = -p*2 + 6p - 7. Let d be t(5). Which is greater: n or d? n Suppose -14d - 3 = -13d. Which is smaller: -4 or d? -4 Let t = 45 + -73. Let c be t/(-98) - (-1)/21. Do -4 and c have different values? True Let j be (-490)/880 + 9/24. Is j at most 2/9? True Let b(k) = -5k + 6. Let w be b(4). Let u(z) = -z2 - 8z - 27. Let h be u(-6). Which is bigger: w or h? w Let g = -14 - -10. Let a = g + 0. Is -0.1 smaller than a? False Let q be 1 + 2/(4/(-6)). Let k be 37/(-7) + 2/7. Let b = q - k. Which is smaller: b or 2? 2 Let a be (1 + 0)(-9)/(-9). Let r = -595/3 + 189. Let m = 109/12 + r. Which is smaller: m or a? m Let d be (-4)/61-2(-1)/12. Is d != 1? True Let y = -3.683 + -0.297. Let i = 4 + y. Which is bigger: -2/5 or i? i Suppose 4r + 5z - z = -8, -3r = 2z + 6. Which is bigger: r or -2/3? -2/3 Let c(d) = -7d + 2. Let o(l) = -20l + 6. Let f(j) = 17c(j) - 6o(j). Let g be f(5). Suppose 0 = -5n + g + 2. Is 2 smaller than n? False Suppose 9s + 13 = f + 4s, -6 = 2f - 2s. Let k = 11 + f. Suppose -t - 3 = -k*t. Is 3/7 bigger than t? False Let c = 12 + -9. Let l be 26/(-10) - c/(-1). Which is bigger: 4 or l?	{ "pile_set_name": "DM Mathematics" }
83 = 4s, 44 = 4s - 4x. What is the lowest common multiple of 482 and s? 5302 Let m = 910 + -322. What is the common denominator of (-15)/(90/m)1/(-4) and 62/5? 10 Suppose -5i - 924 = -8i. Calculate the common denominator of ((-96)/(-512))/(32/i) and -1/5. 40 Let h = 783/14 + -412/7. Calculate the common denominator of h and -81/514. 3598 Let q be ((-90207)/90)/((-18)/(-15)). Let v be 1 - (-33)/(-36)922. Let n = v - q. Find the common denominator of n and -23/22. 132 Let g = 14/491 - -33655/7856. Let k(d) = -37d2 + 6d - 1. Let l be k(9). Let x = 64751/22 + l. What is the common denominator of g and x? 176 Let p be 0(1 - (-1)/(-2)). Suppose -8a + 3a + 270 = p. Calculate the common denominator of -53/8 and 121/a21. 24 Find the common denominator of 121/114 and 5453/(-2952) - (-1)/(-9). 456 Calculate the smallest common multiple of ((-14)/(-2))/((-2)/(-2)) and (-238)/(-18) - 2(-9)/(-81). 91 Suppose -6g = -183 + 135. Calculate the lowest common multiple of 30 and g. 120 Let m be (-4 + 3)1 - -5. Suppose 2t + 2t = m. Suppose 3p - 7 = -t. Calculate the smallest common multiple of 14 and p. 14 Suppose 468 = -757p + 766p. Calculate the lowest common multiple of p and 20. 260 Let d be (0 + 15)2/6. Let b = 6 - d. Suppose 28x - 2x - 494 = 0. What is the smallest common multiple of x and b? 19 Let r(t) be the first derivative of -24t2 - 2t + 14. Calculate the lowest common multiple of 6 and r(-1). 138 Suppose -4i + 12 = -28. What is the smallest common multiple of i and 11? 110 Let k = 110 - 114. Calculate the lowest common multiple of (8 + k)/((-12)/(-45)) and 9. 45 Let b = -1343/3 + 464. What is the common denominator of b and 53/3? 3 Let i = 16423985/14 - 1176106. Let g = -2961 - i. What is the common denominator of g and -21/22? 154 Calculate the common denominator of 5/(-9) + (-6)/(-24) - 1 and 47/16. 144 Let u = -22 - -22. Suppose 5b + 83 - 33 = u. What is the common denominator of -91/4 and (-194)/15 - (-4)/b? 12 Let o = 23 + -26. Let p be (-4)/(-18)-6o. Suppose 0c - 2c + 16 = 4q, 4c + 40 = pq. Calculate the lowest common multiple of 5 and q. 30 Let l = -3164 + 18917/6. What is the common denominator of -67/4 and l? 12 Let r = -33 + 43. What is the lowest common multiple of ((-16)/r + (-3 - -4))-5 and 27? 27 Let j(y) = y*2 - 8y + 4. Calculate the lowest common multiple of 1 and j(0). 4 Let w = 14/13763 - 230368/253528223. Let m = w + -2081585/110526. Let p = -28557/8503 + -4/773. What is the common denominator of p and m? 66 Suppose 3u + 3a + 337 = -2a, -a = 2u + 213. Let q = -37243/110 + 3666/11. Find the common denominator of -23/9(-654)/u and q. 130 Let f be (-6762)/(-285)15/24. Let r = -111/38 - f. Calculate the common denominator of r and 17/5. 20 Suppose -5r - 2429 = 4z, -3z - 6r = -r + 1818. Let s = 3613/6 + z. Let v = 116/33 - -901/66. Find the common denominator of s and v. 6 Let h = -1524 - -1604. What is the lowest common multiple of h and 56? 560 Calculate the least common multiple of -4390/(-24) and 30. 90 Let n be (3 - 10197/3405)/((-12)/40). Let u = n + 2963/681. Calculate the common denominator of u and 32/21. 21 Find the common denominator of (-35)/231118/10 and -53/9. 99 Let o = 15 - 13. Suppose -2k = -oa + 50, k + 134 = 5a + 5. Let m = 34 - 14. Calculate the least common multiple of a and m. 260 Suppose -67 + 59 = -t. Calculate the smallest common multiple of t and 280. 280 Let s(y) = -8y + 12y - 9y*2 - 2 + 4y*3 - 3y*3. Calculate the common denominator of 87/10 and s(9). 10 Suppose -2n + 3n = -184. Let h be 82-64/n. Let t = h + -3845/138. Calculate the common denominator of t and 47/2. 6 Let a(q) = 2q - 32. Suppose 2t = 4w - 152, 4 = -3t + 2t. What is the least common multiple of a(17) and w? 36 Suppose 0 = -5w + f + 3, -w + 2f - 3 = 0. Calculate the smallest common multiple of -7 + 30 + w + -2 and 76. 836 Suppose -525 = l - 6l + s, -3s = 2l - 227. Suppose 0t + 118 = 4t - 2v, -2v = 3t - l. Find the common denominator of 149/30 and t. 30 Suppose 0 = 12k - 11k - 12. What is the least common multiple of k and (-2)/8 + (-73)/(-4)? 36 Let k(m) = m*3 - 5m*2 + m - 3. Let u be k(5). Suppose -i - g = -7, -g + u = -0g. Calculate the lowest common multiple of 2 and i. 10 Let p = 31 + -22. What is the least common multiple of p and 6/(-12) + (-58)/(-4) + -6? 72 Suppose -2n = -2v + 16, 0 = -5v + 4n + 25 + 11. Calculate the least common multiple of v and 18. 36 Let q = -9560473/146 - -65483. What is the common denominator of 9/22 and q? 1606 Let k be (24/9)/(-2)6/(-1). Calculate the smallest common multiple of 14 and (-11 + k)/((-6)/8). 28 Let i(q) = 2q*2 - q + 1. Suppose 5w - 4b = 50, 12b = -w + 8b + 34. What is the smallest common multiple of i(-3) and w? 154 Let m be 6/(-9)-5-3. Let d = m - -30. Calculate the lowest common multiple of d and 4. 20 Let p = -673/63 - -160/63. Let v = 2251 - 29295/13. Calculate the common denominator of p and v. 91 Find the common denominator of 49/16 and 3146/8320 + 8/(-10). 64 Let j = -32 + 31. Calculate the common denominator of -59/14 and j34(-11)/(-308). 14 Let x be ((-2154)/8)/(2/(-72)). Let c = 193811/20 - x. Calculate the common denominator of c and 193/12 - 7/((-154)/(-88)). 60 Let a = 517 + -196. What is the least common multiple of a and 18? 1926 Suppose m = 2z, 0 = 5m - 3m + 4z - 8. Suppose -2h + 3b = 4b - 15, -3b = -9. Calculate the lowest common multiple of h and m + -1 - (-15 - -12). 12 What is the common denominator of -9/70 and ((-41)/7 + -9)/(-2)? 70 Let c be (441/14)/((30/(-27))/(-2)). Let h = c + -65. Calculate the common denominator of 38/11 and h. 110 Let n(w) be the second derivative of w3/2 + 5w*2 - 8w. Calculate the least common multiple of n(4) and 18. 198 Suppose 5s + 0k = 2k + 404, 0 = 5s - 3k - 406. Calculate the least common multiple of s and 20. 80 Let b(f) = 3 + 3f + 145f2 + 12 - 146f*2. Calculate the lowest common multiple of 6 and b(4). 66 Suppose 410 = -2x - 5o, 1056 = -5x + 6o - 3o. Calculate the smallest common multiple of 36 and 5(-18)/x + (-106)/(-14). 72 Let p = 1135/14 + -108063/1330. What is the common denominator of 173/60 and p? 1140 Let d = 704 + -683. What is the lowest common multiple of d and 9? 63 Let o(v) be the second derivative of 7v3/6 - v2/2 + v. Let r be o(-1). Let q = 3 - r. What is the least common multiple of 11 and q? 11 Let b = 24/355 + 19309/3195. Let s be -208721/(-24). Let v = -1183/6 + s. What is the common denominator of v and b? 36 Suppose 0 = 3s - 12, -u + s - 28 = -3u. Calculate the least common multiple of 108 and u. 108 Let s = 2932/11 + -263. What is the common denominator of s and 669/522 + 3(-5)/(-90)? 319 Find the common denominator of ((-42)/40 - 95/(-76))-41 and 104/(-18)3/12. 45 Let u(v) = -v3 - 6v*2 - 5v + 6. Suppose -2b - 3 = -19. What is the least common multiple of b and u(-5)? 24 Let o(m) = 5m - 10. Suppose -4l + 42 = -4p - 2, -4l = -2p - 36. Find the common denominator of (-47)/7 + 2/l and o(5). 7 Suppose -6h + 4 = -4h. Let g(d) = d3 - d - 1. Let l(i) = i2 + i + 10. Calculate the smallest common multiple of g(h) and l(0). 10 Suppose -3t = -8t + x - 130, -4x = t + 26. Let s = -1995 - -27957/14. What is the common denominator of 2 + 56/t - (-6725)/1040 and s? 112 Let l(m) = m3 - 9m*2 + 6m - 9. Let p be l(9). Let b = p - 42. What is the smallest common multiple of b and 8? 24 Let n(c) = -3c3 + 18c*2 + 8c + 21. Let f be n(-15). Suppose -5s - f = -4236. Let m = s + 15723/8. Find the common denominator of m and 51/20. 40 Suppose -w + 126 = 2q, -4q + 3w + 154 + 118 = 0. Let m = -56 + q. What is the least common multiple of m and 33? 99 Let u(r) = 11r3 + 3r + 3. Suppose 5 - 11 = 3s. Let d be u(s). Calculate the common denominator of -19/10 and (-52)/d + (-778)/(-84). 30 Suppose -21y = -16y + 375. Let r = 102 + y. Find the common denominator of 49/3 and r. 3 Find the common denominator of (-15)/(-10)(-43)/(-150) and -92/45. 900 Find the common denominator of (3/(-2))/((-108)/1680) and -139/12. 12 Let o be (6/(-7))/((-5)/35). Let c = -4 + o. Let r = -38 + 58. Calculate the least common multiple of r and c. 20 Suppose v = 2v - 10. Suppose 2x - 3	{ "pile_set_name": "DM Mathematics" }
h is greater: 46 or 93508? 93508 Is 242275707 < 242275707? False Which is greater: 0.05 or 0.637766? 0.637766 Do -2244214 and -15709496/7 have the same value? False Is 0 greater than or equal to -407/343202? True Is 3767270 >= 6? True Which is greater: -59 or -2/3228639? -2/3228639 Are -2220/779191 and 0 equal? False Which is smaller: 2.2 or -4/194047? -4/194047 Which is bigger: 5/2 or 19123507? 19123507 Which is bigger: 9.98 or -1/4096? 9.98 Which is greater: 1 or 343/87481? 1 Is -1.733 less than -219861? False Which is greater: 14773243/5 or 2954648? 14773243/5 Which is smaller: 2616 or 34456? 2616 Is 0 > 385/186017? False Which is smaller: 303 or 183684/607? 183684/607 Is -65224520 bigger than -65224542? True Is 0 smaller than -2661/13286? False Is -0.3 >= 303/11755? False Which is smaller: 131513/539 or 245? 131513/539 Is 7291394 not equal to 7291273? True Is 6886899 < 6886898? False Which is smaller: -3541 or -43862? -43862 Is -0.1 > 7211.541? False Is -6755797 != -0.005? True Which is bigger: 3/89 or 59818? 59818 Is -1 less than -74/66331? True Which is bigger: -91/2 or -392963? -91/2 Do 6869 and -2510 have the same value? False Is 14058454 less than or equal to 14058454? True Is 610167 bigger than 14/5? True Do 11609/2978 and 5 have different values? True Which is smaller: -42021 or -41270? -42021 Is 3279328 > 0.5? True Is -4413364 equal to -30893554/7? False Is -65897234 >= -65897233? False Do 1776274.55 and -0.2 have the same value? False Which is bigger: 0 or 1766/61779? 1766/61779 Which is smaller: 0 or -5/1472412? -5/1472412 Which is smaller: 13478 or 48783? 13478 Which is bigger: 2/9 or 4348486? 4348486 Which is smaller: 0.3 or 427856? 0.3 Which is bigger: 0 or 4/2108559? 4/2108559 Is -19848055 greater than -19848054? False Which is smaller: -4478233 or 0.1? -4478233 Is 50 at least 6/644735? True Is 1 bigger than 2/39378433? True Which is bigger: 674567 or 674572? 674572 Is 22675 > 23244? False Which is bigger: 287711638 or 287711639? 287711639 Which is bigger: -183/4385737 or 1? 1 Is -188106/16819 < -11? True Is -1 less than 32/574949? True Do 2142445 and 2142451 have the same value? False Is -456749 less than -456841? False Are 76704164 and 76704165 equal? False Is -3/61159 greater than 490/9? False Is 6737 at most 1907? False Which is greater: 2058 or -15677? 2058 Which is bigger: 1 or 208/3933637? 1 Is 1464664 less than 220? False Is 1 != -133/261432? True Which is smaller: 11/4168896 or 1? 11/4168896 Is -28555 at most -2.796? True Is -66780019/6 equal to -11130002? False Is -1169 less than 62433? True Which is bigger: -2.1 or -6038/69? -2.1 Which is smaller: 3/311 or -420? -420 Does 2 = -7211.293? False Do 1 and -176/163665 have the same value? False Is 432 <= 2198? True Does -72545016 = -72545015? False Which is greater: -36546/54869 or -1? -36546/54869 Which is smaller: -1 or -5377/14541? -1 Which is bigger: -138152 or -138993? -138152 Is 123445931 at most as big as 123445939? True Is -205893 greater than -206304? True Does 503505 = -91? False Is -1 > 3/6996530? False Which is bigger: 1 or 5301/2167? 5301/2167 Is -61 less than or equal to -22302/373? True Which is smaller: 138329 or 138345? 138329 Which is smaller: 44688 or 42675? 42675 Is 1 greater than 6092/9169? True Which is greater: 1/395952 or 0? 1/395952 Are 1341364836 and 1341364837 equal? False Which is smaller: 237446577 or 237446575? 237446575 Does -157811 = -158008? False Does -371672 = -370292? False Which is smaller: 309253 or 309250? 309250 Which is greater: -417027 or -417390? -417027 Which is greater: 8252862 or 8252856? 8252862 Is -80691 at least -80947? True Is -15746794 equal to -15746793? False Which is smaller: 402 or 1540577? 402 Which is greater: 101718201 or 101718193? 101718201 Which is bigger: -36/75539923 or -1? -36/75539923 Which is smaller: -1627540 or -1627569? -1627569 Which is smaller: 16121/7269 or 3? 16121/7269 Is -4360149 not equal to -4360220? True Is 10240 greater than 8092? True Is -143/1112 at most as big as -1/33? True Are 17277/22031 and 2 non-equal? True Is -9407252 bigger than -9407256? True Which is greater: 7051012 or 7051039? 7051039 Is -987102 <= -42445359/43? True Which is bigger: -116124600 or -4? -4 Which is smaller: 63 or 70497? 63 Which is smaller: 43415 or 2214128/51? 2214128/51 Is -1 bigger than -67/868000? False Which is greater: 38865 or 224? 38865 Which is greater: 7660909 or 9? 7660909 Is 195229414 less than or equal to 390458829/2? True Which is smaller: -1653086352 or -1? -1653086352 Which is smaller: 3/4 or -150.86? -150.86 Do 1 and -2352/1216921 have different values? True Which is bigger: 208 or 439/893? 208 Which is smaller: -58/5152377 or 1? -58/5152377 Is -62059052 >= -62059048? False Which is bigger: -621544/5639 or -111? -621544/5639 Are 1524 and 17/48 equal? False Which is smaller: 3715 or -22760? -22760 Which is bigger: -52592 or -52546? -52546 Which is smaller: 662821491 or 662821492? 662821491 Do -4/83 and -4501/198 have different values? True Is 51956 != 204? True Which is smaller: -40165624/37 or -1085556? -40165624/37 Which is greater: -523 or 107415? 107415 Which is smaller: -4 or -1155301? -1155301 Which is smaller: 2560987316 or 2560987315? 2560987315 Is 2697082/25 greater than 107882? True Is -1 less than 176/16009? True Which is smaller: 3986 or 3554? 3554 Are 0 and -15/36231659 unequal? True Which is greater: 1/4 or 519.872? 519.872 Is 50228 greater than or equal to 51059? False Do -2433087 and -2433074 have different values? True Is -25507547 bigger than -0.38? False Is 868175721 greater than 868175721? False Which is bigger: -24593135 or -24593136? -24593135 Is 4/6127053 > -1? True Is 56691733 at most as big as 56691733? True Is 760003 greater than or equal to 759998? True Do 772379/8 and 96547 have the same value? False Which is smaller: -803143 or -803241? -803241 Do -21620/9709 and -2 have different values? True Which is smaller: 193.8 or 3.91? 3.91 Which is greater: 538 or -0.01537? 538 Is 11828 > 10703? True Does 4257820 = 4257819? False Which is bigger: 35023/9684 or 4? 4 Are 1/5 and 57092/711 equal? False Is 0 less than or equal to 1320/600383? True Is 513384473 < 513384473? False Are 1 and 1383/49933 unequal? True Is -2559811 < -2559771? True Is -45303023 >= -45303016? False Which is bigger: -75932395 or -75932399? -75932395 Which is greater: 0 or 14109058? 14109058 Which is smaller: 46 or 73149/1613? 73149/1613 Is -182/4820423 at most 1? True Which is smaller: 1266452749 or 1266452748? 1266452748 Is -10659 bigger than -8053? False Is -8319 at least as big as 0.062061? False Is 203/4000 less than or equal to 20? True Which is greater: -182481 or -184656? -182481 Which is greater: 4025/1102 or 5? 5 Is -144170 at most as big as -143157? True Which is smaller: -729/118127 or -1? -1 Is 5 equal to -2/2123559? False Is -462279 at least 21? False Which is bigger: 1 or -126/13436455? 1 Is -136636 smaller than -136624? True Which is smaller: -20501/3175 or -5? -20501/3175 Is -19748621 equal to -19748565? False Is 393016 bigger than 2.4? True Is -46 < -83849/1867? True Is -66.906 >= 8/7? False Which is smaller: -7765/68 or 0.15? -7765/68 Is 9/1325405 > -0.12? True Which is greater: 532239 or 532237? 532239 Is 28498 > 28407? True Is -912692 at most -912692? True Are -2521073 and -2521074 non-equal? True Is 105.9745 at least as big as 403? False Are -12 and -1594.154 equal? False Which is smaller: 98 or 65356/673? 65356/673 Is 36490 at most as big as 36646? True Which is bigger: 27 or 186.394? 186.394 Is 859326/107 less than 8030? False Which is greater: -691598 or -24? -24 Is 6437 smaller than 701559/109? False Is -16120613 != -16120618? True Is 4/1099080267 less than or equal to -1? False Is 22124 > 22200? False Is 69151 at most as big as 1383041/20? True Which is smaller: -1 or 3/136378751? -1 Which is smaller: 43682190 or 43682153? 43682153 Which is greater: -245716477 or 0.2? 0.2 Which is bigger: 966205 or 966236? 966236 Which is bigger: 1.002401 or 126? 126 Is -41974380 at least -41974380? True Which is smaller: -75193627 or -75193629? -75193629 Which is bigger: 2/3 or 411245052? 411245052 Which is greater: -59870318/5 or -11974064? -59870318/5 Is -143950/399 bigger than -360? False I	{ "pile_set_name": "DM Mathematics" }
e Does 23 divide 64? False Does 17 divide 1027? False Is 25 a factor of 875? True Is 24 a factor of 1128? True Is 486 a multiple of 9? True Is 7060 a multiple of 20? True Is 21870 a multiple of 135? True Does 11 divide 3003? True Is 988 a multiple of 76? True Is 57 a factor of 2950? False Is 136 a factor of 77092? False Is 24 a factor of 1464? True Is 16480 a multiple of 40? True Is 6 a factor of 10583? False Is 15947 a multiple of 37? True Does 13 divide 222? False Is 285 even? False Is 105 a multiple of 2? False Is 299 a multiple of 158? False Is 14267 a multiple of 9? False Is 18 a factor of 34416? True Is 34 a factor of 952? True Is 37047 a multiple of 14? False Is 30 a factor of 2760? True Is 20725 a multiple of 25? True Is 35209 a multiple of 14? False Is 468 a multiple of 9? True Is 11 a factor of 2739? True Does 31 divide 8334? False Is 18 a factor of 25092? True Is 6 a factor of 1720? False Does 91 divide 273? True Is 24 a factor of 192? True Is 9504 a multiple of 18? True Does 19 divide 8149? False Does 37 divide 2664? True Is 16 a factor of 197? False Is 50 a factor of 11100? True Is 651 a multiple of 16? False Does 9 divide 1098? True Is 42 a factor of 1279? False Is 96 a multiple of 3? True Is 67 a factor of 6532? False Is 5551 a multiple of 13? True Does 7 divide 1274? True Is 6 a factor of 580? False Is 9 a factor of 1609? False Is 64 a factor of 10590? False Is 14375 a multiple of 191? False Is 150 a factor of 10018? False Does 29 divide 2175? True Is 39 a factor of 780? True Does 77 divide 2079? True Is 1700 a multiple of 10? True Is 120 a multiple of 6? True Does 209 divide 3553? True Is 447 a multiple of 49? False Does 66 divide 1138? False Does 24 divide 734? False Is 32 a factor of 21585? False Is 1440 a multiple of 15? True Does 54 divide 195? False Is 5103 a multiple of 29? False Does 43 divide 17544? True Is 36 a factor of 7596? True Does 188 divide 6768? True Does 13 divide 7111? True Is 241 a multiple of 4? False Does 5 divide 3749? False Does 16 divide 3701? False Is 161 a factor of 5474? True Does 4 divide 5224? True Does 20 divide 2640? True Is 47 a factor of 5248? False Is 112 a factor of 9520? True Is 1378 a multiple of 46? False Is 108 a factor of 1235? False Does 5 divide 11988? False Does 15 divide 2340? True Is 133 a factor of 8379? True Does 69 divide 24499? False Is 7 a factor of 532? True Is 621 a multiple of 69? True Does 9 divide 4599? True Does 7 divide 3301? False Does 97 divide 3796? False Is 71 a factor of 20012? False Is 105 a factor of 1057? False Does 7 divide 6972? True Does 22 divide 13662? True Is 12670 a multiple of 35? True Does 31 divide 615? False Is 4416 a multiple of 24? True Is 3 a factor of 4681? False Is 164 a factor of 1731? False Does 17 divide 1938? True Is 92631 a multiple of 18? False Is 119 a multiple of 14? False Is 245 a multiple of 7? True Does 40 divide 1531? False Is 2 a factor of 5991? False Is 15 a factor of 330? True Is 667 a multiple of 29? True Is 73366 a multiple of 181? False Does 23 divide 888? False Is 9 a factor of 54? True Is 25 a factor of 948? False Is 1335 a multiple of 15? True Is 29 a factor of 74993? False Is 80503 a multiple of 19? True Does 65 divide 2405? True Is 60 a factor of 3780? True Does 3 divide 129? True Is 23 a factor of 5478? False Is 12453 a multiple of 18? False Does 25 divide 148? False Is 184 a multiple of 4? True Does 6 divide 251? False Is 21462 a multiple of 294? True Is 897 a multiple of 39? True Does 6 divide 72? True Does 58 divide 522? True Is 1620 a multiple of 180? True Is 441 a multiple of 9? True Does 3 divide 1548? True Is 20 a factor of 579? False Does 70 divide 28197? False Is 5 a factor of 25? True Is 4329 a multiple of 9? True Is 20 a factor of 580? True Does 22 divide 298? False Does 9 divide 22626? True Is 49 a factor of 1519? True Is 13 a factor of 234? True Is 17 a factor of 14625? False Is 11746 a multiple of 14? True Is 27 a factor of 8532? True Does 67 divide 1089? False Does 35 divide 2485? True Is 7284 a multiple of 28? False Is 114 a multiple of 6? True Is 6033 a multiple of 12? False Is 13 a factor of 3192? False Is 76 a factor of 456? True Is 16299 a multiple of 9? True Is 474 even? True Does 31 divide 775? True Is 15 a factor of 58882? False Does 81 divide 14297? False Does 2 divide 164? True Does 111 divide 4329? True Does 96 divide 2296? False Is 255 a multiple of 17? True Does 9 divide 278? False Is 598 a multiple of 23? True Does 10 divide 350? True Is 7 a factor of 1128? False Does 27 divide 5508? True Is 416 a multiple of 13? True Is 8668 a multiple of 44? True Is 9 a factor of 2394? True Is 609 a multiple of 29? True Does 21 divide 3171? True Is 352 a multiple of 44? True Is 133 a factor of 3680? False Is 20339 a multiple of 43? True Does 173 divide 21300? False Does 53 divide 5674? False Is 10592 a multiple of 16? True Is 22 a factor of 830? False Is 30 a factor of 660? True Does 20 divide 11025? False Is 502 a multiple of 61? False Does 16 divide 6544? True Does 19 divide 703? True Is 39100 a multiple of 170? True Is 17 a factor of 5117? True Is 66 a factor of 22900? False Is 22 a factor of 251? False Is 30 a factor of 2281? False Does 38 divide 2710? False Does 34 divide 14008? True Is 8448 a multiple of 44? True Is 87 a factor of 1479? True Does 54 divide 4305? False Is 38057 a multiple of 19? True Is 481 even? False Does 43 divide 8541? False Is 505 a multiple of 30? False Is 1046 a multiple of 43? False Does 33 divide 301? False Is 141 a factor of 47517? True Is 39 a factor of 6591? True Is 468 a multiple of 16? False Is 700 a multiple of 20? True Is 90 a factor of 922? False Is 282 a multiple of 3? True Is 23 a factor of 968? False Does 3 divide 1517? False Is 1689 a multiple of 10? False Does 184 divide 78494? False Does 73 divide 11899? True Does 175 divide 4468? False Is 47 a factor of 930? False Does 53 divide 424? True Does 98 divide 454? False Does 209 divide 48130? False Is 40 a factor of 8621? False Does 4 divide 3514? False Does 316 divide 115024? True Does 9 divide 99? True Is 6 a factor of 390? True Is 8478 a multiple of 27? True Does 5 divide 353? False Is 2856 a multiple of 42? True Is 4630 a multiple of 10? True Is 16 a factor of 13176? False Is 28520 a multiple of 10? True Is 15 a factor of 390? True Is 288 a multiple of 4? True Does 4 divide 2546? False Does 13 divide 15257? False Does 11 divide 1694? True Is 13 a factor of 1733? False Is 3850 a multiple of 11? True Is 54 a factor of 594? True Is 17 a factor of 24497? True Is 26 a factor of 1846? True Does 22 divide 58080? True Is 6 a factor of 100? False Is 8 a factor of 306? False Is 48048 a multiple of 24? True Is 9 a factor of 769? False Is 2 a factor of 6338? True Is 23 a factor of 15502? True Does 18 divide 1386? True Does 154 divide 946? False Is 16938 a multiple of 39? False Is 16 a factor of 368? True Is 1639 a multiple of 11? True Does 16 divide 5674? False Is 119 a factor of 1142? False Does 12 divide 28071? False Is 18646 a multiple of 11? False Does 82 divide 2136? False Does 53 divide 27348? True Is 43 a factor of 42918? False Is 18 a factor of 4676? False Does 60 divide 2724? False Does 50 divide 723? False Is 25 a factor of 3375? True Does 16 divide 2023? False Is 22 a factor of 7422? False Is 2611 a multiple of 15? False Does 8 divide 688? True Is 23 a factor of 8763? True Is 2350 a multiple of 24? False Does 58 divide 46922? True Is 54 a factor of 5346? True Is 8670 a multiple of 10? True Does 19 divide 17050? False Does 47 divide 1222? True Is 26672 a multiple of 19? False Is 38 a factor of 1722? False Is 11 a factor of 1045? True Does 14 divide 4985? False Is 608 a multiple of 19? True Is 25 a factor of 15700? True Does 9 divide 9550? False Is 81594 a multiple of 38? False Does 31 divide 305? False Is 11 a factor of 32725? True Is 24 a factor of 86900? False Is 4966 a multiple of 26? True Is 315 a multiple of 7? True Does 10 divide 5230? True Does 17 divide 20275? False Is 561 a multiple of 11? True Is 23 a factor of 679? False Is 509 a multiple of 7? False Is 28 a factor of 10322? False Is 2520 a multiple of 12? True Does 51 divide 25676? False Does 15 divide 390? True Is 3 a factor of 3241? False Is 19 a fa	{ "pile_set_name": "DM Mathematics" }
Three letters picked without replacement from {w: 2, v: 5, f: 6, q: 2, g: 3, l: 1}. Give prob of sequence fwg. 2/323 Four letters picked without replacement from pphpdqqqqqhhppppq. What is prob of sequence qpdh? 3/1360 Calculate prob of sequence wo when two letters picked without replacement from chwooctctoocwchooo. 7/153 Calculate prob of sequence xl when two letters picked without replacement from {l: 1, x: 2, i: 4, o: 1}. 1/28 Two letters picked without replacement from exe. What is prob of sequence ex? 1/3 What is prob of sequence ggg when three letters picked without replacement from {g: 5}? 1 Calculate prob of sequence vc when two letters picked without replacement from lqvecleceeeleeeel. 1/136 Calculate prob of sequence ls when two letters picked without replacement from sslsssssssssssssss. 1/18 Two letters picked without replacement from {f: 5, x: 3, s: 1, v: 1, m: 3, n: 4}. What is prob of sequence fm? 15/272 Three letters picked without replacement from {v: 2, b: 1, z: 3, f: 1}. Give prob of sequence zbz. 1/35 Two letters picked without replacement from {y: 2, i: 7, l: 3, g: 5, t: 1}. Give prob of sequence ll. 1/51 Calculate prob of sequence hjj when three letters picked without replacement from {l: 7, j: 4, h: 8, a: 1}. 4/285 Three letters picked without replacement from ijnrrrquurruqqjiurur. Give prob of sequence jun. 1/684 What is prob of sequence fqq when three letters picked without replacement from yyqyyyfqqqqyqyy? 1/91 Four letters picked without replacement from {a: 2, o: 2, p: 1, y: 6}. What is prob of sequence apoa? 1/1980 Three letters picked without replacement from qqddqqedeed. Give prob of sequence edq. 8/165 Three letters picked without replacement from dqqqqdqqqqqqqaqqq. Give prob of sequence qqq. 91/170 What is prob of sequence oq when two letters picked without replacement from {q: 1, m: 4, o: 2, j: 3}? 1/45 Calculate prob of sequence yr when two letters picked without replacement from {g: 1, r: 1, y: 1, t: 4, c: 1}. 1/56 Two letters picked without replacement from {g: 2, t: 3, h: 1, w: 3, x: 2, z: 4}. Give prob of sequence wg. 1/35 Two letters picked without replacement from cfffffqfqf. What is prob of sequence cf? 7/90 Three letters picked without replacement from {u: 1, l: 2, b: 1, x: 1}. What is prob of sequence ubl? 1/30 What is prob of sequence uuzn when four letters picked without replacement from {n: 2, g: 1, z: 1, u: 2}? 1/90 Calculate prob of sequence ssh when three letters picked without replacement from {h: 8, s: 2}. 1/45 Calculate prob of sequence tuku when four letters picked without replacement from zuttukuhtuu. 1/132 Four letters picked without replacement from {e: 4, k: 3, p: 4}. Give prob of sequence pkkk. 1/330 What is prob of sequence kkko when four letters picked without replacement from {k: 18, o: 2}? 8/95 What is prob of sequence lol when three letters picked without replacement from {j: 1, w: 3, l: 2, o: 10}? 1/168 Calculate prob of sequence rq when two letters picked without replacement from {o: 1, y: 2, q: 2, a: 1, r: 2}. 1/14 Four letters picked without replacement from uhhuhhuhuhuhu. What is prob of sequence hhuh? 21/286 What is prob of sequence yy when two letters picked without replacement from {i: 2, y: 5}? 10/21 Calculate prob of sequence aa when two letters picked without replacement from yaayayaaayayaaaa. 11/24 Two letters picked without replacement from rrrraarrrarr. Give prob of sequence aa. 1/22 Two letters picked without replacement from knnkkn. What is prob of sequence nn? 1/5 Calculate prob of sequence xb when two letters picked without replacement from qbqx. 1/12 Calculate prob of sequence tqqq when four letters picked without replacement from ttttttqtqtqqtt. 10/1001 Two letters picked without replacement from mmmmkjmmmjmmmm. Give prob of sequence jk. 1/91 Calculate prob of sequence tb when two letters picked without replacement from {u: 2, b: 1, t: 7, r: 7}. 7/272 Three letters picked without replacement from {q: 1, p: 5, t: 5, y: 1, u: 4}. What is prob of sequence yqu? 1/840 What is prob of sequence zzoa when four letters picked without replacement from ayzaaozoeyyzzggzzzg? 7/2584 Calculate prob of sequence ttt when three letters picked without replacement from ttttttttt. 1 Four letters picked without replacement from kkkkkkkkzkkkkzkz. Give prob of sequence kzkk. 33/280 What is prob of sequence yyyp when four letters picked without replacement from {n: 7, p: 1, s: 1, y: 3, z: 1}? 1/2860 Calculate prob of sequence xr when two letters picked without replacement from {r: 3, x: 8, p: 5}. 1/10 Four letters picked without replacement from {r: 2, l: 3, a: 13}. What is prob of sequence arrl? 13/12240 Four letters picked without replacement from {s: 2, o: 4, h: 7}. Give prob of sequence ooho. 7/715 What is prob of sequence zz when two letters picked without replacement from {z: 3, q: 8}? 3/55 Four letters picked without replacement from pppppppppp. What is prob of sequence pppp? 1 Calculate prob of sequence bj when two letters picked without replacement from bjyyyjyjjbb. 6/55 Calculate prob of sequence jty when three letters picked without replacement from {e: 1, y: 2, m: 1, r: 2, t: 1, j: 2}. 1/126 What is prob of sequence adab when four letters picked without replacement from {b: 3, a: 2, d: 5}? 1/168 Two letters picked without replacement from feeteeeftteeff. Give prob of sequence ft. 6/91 What is prob of sequence rh when two letters picked without replacement from oehhhrhhohohhhhomhr? 11/171 Three letters picked without replacement from {f: 7, v: 3, o: 6, e: 3}. Give prob of sequence fov. 7/323 Two letters picked without replacement from tutyttttttt. Give prob of sequence uy. 1/110 Three letters picked without replacement from {i: 11, a: 2, x: 1, n: 1}. What is prob of sequence nia? 11/1365 What is prob of sequence ddd when three letters picked without replacement from {o: 3, d: 4, e: 2, z: 1}? 1/30 What is prob of sequence gkd when three letters picked without replacement from qkdahghakhda? 1/330 Two letters picked without replacement from mqqmmqqmqmmq. Give prob of sequence mm. 5/22 Two letters picked without replacement from {h: 4, q: 3, l: 6}. Give prob of sequence qh. 1/13 Calculate prob of sequence xen when three letters picked without replacement from oxoexxxnxxxlxnxen. 9/680 Calculate prob of sequence xx when two letters picked without replacement from xxxxxxxxxx. 1 Two letters picked without replacement from irrrrirrri. What is prob of sequence ii? 1/15 What is prob of sequence yl when two letters picked without replacement from {l: 7, y: 3}? 7/30 Three letters picked without replacement from nhffrfchfhffjrff. What is prob of sequence frf? 1/30 What is prob of sequence cvc when three letters picked without replacement from wzrwczzrvwcvmwv? 1/455 Calculate prob of sequence kko when three letters picked without replacement from {b: 5, k: 2, o: 1, i: 1}. 1/252 Two letters picked without replacement from {a: 8, x: 5, q: 3}. Give prob of sequence ax. 1/6 Calculate prob of sequence zzz when three letters picked without replacement from zzcczc. 1/20 Two letters picked without replacement from ababbbbbab. What is prob of sequence aa? 1/15 What is prob of sequence ns when two letters picked without replacement from {m: 2, d: 10, s: 5, h: 2, n: 1}? 1/76 Two letters picked without replacement from txzxtxfzfbxb. What is prob of sequence tt? 1/66 Calculate prob of sequence qdd when three letters picked without replacement from {d: 3, q: 3}. 3/20 Two letters picked without replacement from {i: 3, m: 4, o: 1, l: 3}. What is prob of sequence li? 9/110 Two letters picked without replacement from pupuupuupupu. Give prob of sequence uu. 7/22 Calculate prob of sequence bkbk when four letters picked without replacement from {b: 9, k: 10}. 45/646 Four letters picked without replacement from {t: 6, j: 1, w: 5, z: 1, a: 2, d: 5}. Give prob of sequence zttt. 1/969 Three letters picked without replacement from {s: 3, e: 4, w: 5}. Give prob of sequence wew. 2/33 Three letters picked without replacement from gsxwsdd. Give prob of sequence gdw. 1/105 What is prob of sequence rqr when three letters picked without replacement from qfrrqrqrqqqqr? 35/429 Three letters picked without replacement f	{ "pile_set_name": "DM Mathematics" }
2 + 112 + -3 + -5 + -4? 87 Calculate -42 - (20 + 34 + -99). 3 What is the value of -100 + (109 - -7) - 20? -4 What is the value of 29 + (-70 - (-2 + -13))? -26 Calculate -88 - (0 + -3) - (-32 - (-44 + 19)). -78 What is the value of 53 + 11 - 75 - ((1 - 2) + -15)? 5 Evaluate 9 - (15 - 9) - (19 - -37) - -6. -47 2 + -29 - (-4922 - -5023) -128 What is the value of -34 + 148 - (-38 + (68 - 8))? 92 -1 + -5 + (28 + -31 - 11) -20 What is the value of (10 - 114) + (8 - -75 - 103)? -124 What is 32 + (-3 - 17) + 3 + (-1 + -1 - 70)? -57 Evaluate -15 + (-2 - -12 - ((0 - 46) + (-373 - -358))). 56 Evaluate (4 + (6 - -1) - (24 - 32)) + -55. -36 What is the value of (-5 - -30 - 13) + (-4 + 2 - 25)? -15 -10 + 7 + -10 + -1 + 42 + 1 29 Evaluate 60 - 29 - 33 - (-4 - 18). 20 What is the value of 3 - 3 - -53 - (-7 + -1 - (-40 + 16))? 37 What is -125 + (124 - -53) + -112? -60 Evaluate 19 + -40 - (-23 + 0) - -13. 15 Evaluate 3 + (-13 + 3 - (24 - (-75 + 24))) + -1. -83 Evaluate -6 - (24 - (-2 - -15) - 8) - 10. -19 Evaluate 2 - (-821 - -824 - (-6 - (-1 + 1))). -7 What is 48 - (-88 - -92 - 2)? 46 What is the value of (-75 - 22) + 3 + (-35 - (10 + -21)) + 8? -110 What is (-20 - -1) + 7 + (0 + 8 - -2) + 11? 9 Evaluate -20 + (25 - -8) + -13 + 0 + -73. -73 Calculate -99 + 106 + -61 - -122. 68 What is -27 + (7 - 56 - -43)? -33 What is 11 + (-146 - -93) + -46? -88 What is -55 + -1 - (26014 + -25976)? -94 What is -154 + 113 - -54 - -79? 92 47 + -62 + -48 - -52 -11 What is the value of -158 + 204 + -59 + 64? 51 4118 + -4125 - ((-2 - -3) + 16 + 2) -26 Evaluate 1 + -42 + -2278 + 2317. -2 What is 4 + 14 + -23 + -6 - (-1 + -13)? 3 Evaluate 16 + -3 + -3 + (-18 - -2) - (3 - -1). -10 What is the value of -31 + -23 + -37 + 49? -42 What is the value of (-16 - -21) + -82 + 77 + (-1 - 39)? -40 What is the value of -3 + (21 - -38) + -83? -27 28 - (7 + -8 - (-1 - -12)) 40 What is the value of -40 - (-14 - -14) - -12 - (-7 + (4 - 4))? -21 What is -93 - ((54 - 63) + -143)? 59 Calculate -16 + (3 - 1) - (83 - (-32 - -3 - -69)). -57 Evaluate (45 - 0) + (6 - 7) + 10 + (31 - 27). 58 Evaluate 44 + -26 + -1 + -48 + (4 - -1). -26 What is (-113 - -109) + (5 - -11)? 12 What is (-39 - 5) + (47 - -7)? 10 What is 93 + 76 + 30 + -130? 69 Calculate -6 - (3 + -11) - 92 - (-92 + 92). -90 What is the value of (13 - -13 - 13) + 39 + -17? 35 Calculate (39 - (-32 + 117)) + 35. -11 Evaluate -6 - 10 - (16 + -31) - (-1 + -93). 93 5 + -15 + (-5 - (7 - -14)) + 8 -28 10 + (-2 - (-12 - -20) - 5) - 14 -19 Evaluate 24 + -3 + -34 + 63. 50 (14 - 10) + (0 - 77) + (-46 - -53) -66 Evaluate 15 - 6 - (-3 + -1) - 7. 6 Calculate 16 - 12 - (15 + 1) - (5314 - 5404). 78 What is the value of (6 + 9 + -18 + 15 - 6) + 19? 25 (-2 + 7 + 4 - 95) + (-30 - -24) + 0 -92 What is -140 + 155 - (6 - (17 + 12))? 38 What is -48 + (123 - -1) + (11 - (10 - 6))? 83 Evaluate (44 + 76 - 88) + (-90 - 1). -59 10 + -44 + (-35 - -35) + (0 - -1) -33 What is the value of (3 + -13 - 17) + -3 + 18 + 14? 2 Calculate (-26 - 1) + 27144 + -27183. -66 Calculate (34 - 86) + 108 + -79. -23 39 - (23 + (81 - 24)) -41 What is the value of 47 + -13 + -79 - -96? 51 Evaluate (-365 - -355) + (-6 - -26 - 11). -1 Calculate -72 - 31 - -82 - (-1 - 38) - -6. 24 What is the value of (-1 - (4 + 72 - -2 - 0)) + -1 - 2? -82 What is 30 - (3 - -3) - (12 - (-3 - -8)) - -7? 24 Calculate 5 + -12 + -5 - (169 - 218). 37 Calculate 107 + 6 - (804 - 779). 88 -4282 - -4244 - (0 + -40) 2 2 - ((145 - 113) + -111) 81 What is the value of -95 - (-25 + 74 + -122)? -22 -1179 - -1122 - (-39 + 1) -19 What is 29 + -20 + -14 - (-17 + 3)? 9 What is the value of (-39 - (-25 - 10)) + -32? -36 -10601 - -10557 - ((2 - 2) + 16) -60 Calculate 99 + -1 - ((69 - 31 - 12) + -21). 93 Evaluate 29 + -25 + 1 + -17. -12 Calculate (-6278 - -6290) + -3 + 0 + -83. -74 What is (-2 - -41 - (159 + (-140 - -9))) + 1 + 83? 95 What is 15 + 13 + -108 - -18 - (0 + 1)? -63 Evaluate 39 - (85 + (-74 - -41)). -13 Calculate (1 - (-4 - -3)) + 1768 + -1777 - -130. 123 What is 22 + 2 + -6 + (-348 - -337)? 7 What is (4 - 4 - (12 + -8)) + (-5 - -32 - 79)? -56 Calculate (2 - (-24 - -1)) + -2057 + 2145. 113 What is -78 - -6 - (-19 + (53 - 46))? -60 Calculate 33 + 0 + -29 - -58 - -8. 70 What is (-25 - (-21 + -7)) + (10 - 2) + -20? -9 Calculate -9 + 16 - 74 - -35. -32 What is 2 + 3 - ((4 - (7 - 10)) + (0 - -57))? -59 What is -6 - (-5 + -62 + 5)? 56 Calculate 1 + (-6 - -15 - -28) + (13 - 1). 50 Evaluate 0 - 93 - (-30 + 145 + -101) - -7. -100 Evaluate -34 - (-6 - 10 - (-9 + 14)). -13 Evaluate (18 - -27) + (-1 - 41). 3 What is 45 + (-31 - 8 - -43) + (0 - 11)? 38 What is 27 - (13 + (-8 - -17) + -16)? 21 What is the value of 11 - (6 - -5 - (8 - (8 - 9)) - -5)? 4 Calculate (49 - 16) + 9 + 0 + (-94 - -92). 40 Calculate (0 - 3) + 3 + (6 - 9) + -310 + 345. 32 Calculate 4380 + -4408 + (6 - (-1 - -3)). -24 Calculate -31 - (-1 + (12 + 13 - 24)). -31 Calculate (-35 - 9) + 27 - 3. -20 (-77 - (49 - 184)) + (-21 - 1) 36 14 + (11 - 1 - (36 + -21) - -59) 68 Calculate 30 + -1 + (204 - 69) + -159. 5 Evaluate 9 + 6 + -9 + -2 + -4 - (-45 - 14). 59 What is the value of -200 + (-120 - -201) - ((-9 - -2) + -2)? -110 What is (-14 - -23 - -8 - (0 - (1 - 6))) + -8? 4 Calculate 122 + -80 - (61 + -32 + -42). 55 Calculate (29 - 0 - 34 - 31) + 74. 38 -71 + (-13 + 47 + -16 + -15 - -10) -58 What is the value of (-48 - (2 + -13 + -6)) + -12? -43 37 - -7 - (-3 - (-4 + 6) - 2) 51 What is the value of 31 + (13 - 62 - -21)? 3 Calculate 33 - (-21 + -32 + (15 - -108)). -37 Calculate 41 + (-1 + 2 - (-13 + 17) - (-3 - 0)). 41 Calculate -16 + (10 + -3 - -61) + (-1 - -11). 62 What is the value of -3 - (4 - ((5 - 12) + -1 + 12 + 4))? 1 What is (87 + -13 + 1 - 1) + 5 + 0 + -2? 77 What is -69 + 213 + -66 + -2? 76 Evaluate -6 - -12 - 89 - (-435 + 395). -43 Calculate 15 - (-6 - -33) - -18. 6 -4 + (-9 - (-33 + 23 + (4 - -2))) -9 Evaluate 0 - 1 - (-38 + (-22 - -36) - -19) - 43. -39 What is the value of 11 - (-1 + 12 + -19 - 1) - 1? 19 What is the value of ((5 - 59) + 9 - -12) + 14 - -6? -13 Calculate (93 - 54) + -165 + 182. 56 What is 1 - -5 - (31 + -9 - 8)? -8 11 + 2 + -4 + -1 + -24 + -1 + 12 -5 Calculate 91 - (9 + (0 - 19) + 38). 63 Calculate 114 + -59 - (37 + 22). -4 What is -95 - (-13 + (17 - 1 - 12 - -6))? -92 Evaluate 6 + 6 + -32 + (-6 - (-2 - 9)). -15 -17 + -2 - -50 - 49 -18 Calculate 3 + -12 + 41 + (8 - (-3 + (-1 - -4))). 40 What is the value of (-17 - 0) + -23 + 71 + -41 - (42 + 1)? -53 What is 0 + 17 + (-62 + 19 - -22)? -4 What is -15 + (64 + -4 - 19)? 26 (-39 - -14 - 13) + 4 + -8 -42 Evaluate 4 - (-4 + 1 - 5) - (-5123 - -5109). 26 What is 1642 + -1691 - (-88 - -1)? 38 What is -34 - (19 - 48) - -24? 19 What is (-1520 + 1557 - (44 + 2)) + (-18 - 1)? -28 What is the value of -128 + (-373 - -364 - (-1 - (-3 + 24 + -2)))? -117 What is the value of 12 + ((-5 - 14) + 30 - 68)? -45 Calculate (1 - 2) + 9 - (20 - (32 + -38) - 46). 28 -25 - (-1 + -1) - (221 - 193) -51 Calculate (17 - 7) + -35 - -1. -24 What is the value of -19 - (19 - (-1 + 4)) - -10? -25 Calculate -13 + 77 - (-51 + 156). -41 What is 41 + -86 - (25 - 67)? -3 Calculate 50 - (53 - 114 - -140). -29 1 + (33 - (48 - -51)) -65 Calculate 2 + -2 - (-31 + 2 - (141 - 152)). 18 (823 - 763) + -23 + 1 + 3 41 72 - 35 - 19 - (10 + 0) 8 Evaluate 26 + 5 + -20 + (-15 - (-5 - 5)). 6 Evaluate (-59 - 1) + (-982 - -955). -87 What is -1895 + 1865 - (122 + 2)? -154 Calculate 18 + 1 + -8 - (-1 - -25 - (0 + -2)). -15 What is 16 + (31 - 52) + 2 + 4 + -15? -14 Calculate 12 + 6 + (-580 - -593). 31 -58 - (1 - (12 + -10 + 8 + -14)) -63 What is (-3 - (93 - -1)) + 75 + -35 + 0 + -39? -96 Calculate (-12 - 3) + (44 - (55 - 16 - 9)). -1 What is (19 - -3) + -253 + 261 - -27? 57 Evaluate -11 + 15 + -11 + -12 - -12. -7 Evaluate -16 + (-2 - 1) + 1 + (-9 - (-43 + 33)). -17 (114 - 115) + (0 - (-5 + -20)) 24 Calculate (-6 - (4 - (-4 + 4))) + 29 + 1 + 23. 43 -77 - 27 - -191 - 21 66 What is 39 + -267 + 50 + 63? -115 What is 140 - 96 - (36 - -6)? 2 -10 + -16 - (10 - 1 - -15) -50 What is -1 - -53 - (-36997 - -37082)? -33 Evaluate 16 + (74 + -56 - (18 + 0)). 16 -18 + (-15 + (23 - 22) - (-2 + -27)) -3 Calculate (-8 + 35 - 30) + -7 + 116. 106 -17 + 27 + 6 + (79 - 1) + -8 86 What is the value of -16 - -3 - (-2 - -7) - 1 - (47 + -55)? -11 0 + -107 - ((-160 - 329) + 525) -143	{ "pile_set_name": "DM Mathematics" }
implify y(-2/7)/(y7y)((y/y(1/4))/y)/(y/((y/(y(-3)/y))/y))(y(-6)((y(-6)/y)/y)/y)28 assuming y is positive. y(-11915/28) Simplify u(-6)u2(u1)11(uu*(-6)u5)/(((u/(u3u))/u)/(uu(-2))) assuming u is positive. u10 Simplify (v(1/4)/v(-3)vv/(v*(-2/9)/v)vv/(v/(vv*6/vv)))/((v/(vvv*0))/(vv/v(-1/6)))12 assuming v is positive. v*(1889/36) Simplify ((((i/((ii*(-39)i)/i))/i)/(i/(i/i(8/7))))/(i/(i(-14)/i))(-6/37))(-7/11) assuming i is positive. i(-10218/407) Simplify (((q(-1))*(-1/5)(q/(q/(q/q*(-2/5)))qq)(-1/9))(-5/7))(-32) assuming q is positive. q(-256/63) Simplify qq/(q*(-1/11)/q)qq/(q/(qq*(-10)/q))(q(-7)/q)(31/4) assuming q is positive. q*(-747/11) Simplify (a/(aa/(((a/(a/a*8)a)/a)/a)a)a4)20((a(-1/3))23)18 assuming a is positive. a42 Simplify r/((r(13/8)/r)/r)rr(2/33)rr(r*(-1)/r)/r(r/(r35/r))/r assuming r is positive. r(-8597/264) Simplify (((pp((p*(5/3)/p)/p)/p)/p)/ppp/(p(-3)pp))10(p/(p*(-2/5)p)pp/(pp/p(1/8)))(-6) assuming p is positive. p(811/60) Simplify ((q(-1/2))(-24)q*11/qq/q12)(-2) assuming q is positive. q*(-22) Simplify (((bbb(-4))/b)/b(-2/23)b/(b/(b*5b))bbb(1/4)/b)/(b/(b(1/6)/b)b/b*(1/4)((b/(bb/b(1/2)))/b)/(b(5/4)bb)) assuming b is positive. b(1795/276) Simplify d(-2/101)/d(-34)(d/(dd/(dd(-16))))26 assuming d is positive. d(-38584/101) Simplify ((a(-1/17)aaaa*(-4/5)(aa(-3)a)/(a*2aa))(2/3))(16/11) assuming a is positive. a(-2592/935) Simplify (((mm/(m/(m*(-2/101)m)))/m)(-38)/(((((m(-48)/m)/m)/m)/m)/((mm/m40)/m)))48 assuming m is positive. m(-117552/101) Simplify ((b/((b/b(-5)b)/b))/(b/(b/b*(-2)))(b/(bb(-1/2)))(-25))/(b(-3)(bb(-1/9))/bb)23 assuming b is positive. b(595/18) Simplify ((b*(-1/17)b)/((b/b(-2/7))/b))/(b12bb(-10)) assuming b is positive. b(-279/119) Simplify ((w*(-12)w)/(w/((w/(w/(ww/(w/(ww*(-3/8))))))/w)w))/(w(-13/3))(-7) assuming w is positive. w(-1025/24) Simplify (((q1)*(-5)(qq/q(-1)q)(5/12))(5/11))(2/67) assuming q is positive. q(-100/2211) Simplify (i/i*(-7)i*(-2))/(iii/(i/((i/i2)/i))i/i*(2/11))i*(-3/4)/(ii*(-1)/i)i/(i*3/i)i/(iii5) assuming i is positive. i(-69/44) Simplify (c(-1/3))(-1/13)(ccc/c1ccc)*(-5/12)((cc(-3/5)/c)/(c/(ccc3)c))/((c*(1/7)/c)/cc/c*(-2/7)c) assuming c is positive. c(-157/1820) Simplify ((l(-1/4))*34l*(1/2)l/((l*2/ll)/l))/(((l/(ll(-5)))/l8)/(l(-1/4)/(ll1))) assuming l is positive. l(-29/4) Simplify (p/(p/p*(4/3))p(4/3))(-5/3)(p0/p(-2))/(p/p(-5)p/(pp(-2)p)) assuming p is positive. p*(-85/9) Simplify ((ss*(-6)s((ss/(s/s*0)s)/s)/s)/(s*(-1/2)s*5/s))/(((sss/(s/s(3/2)))/ss(2/19))/(s(5/6)s((s/s(-1/4))/s)/s)) assuming s is positive. s(-2057/228) Simplify (n((n/((n(nn(-10/7)/n)/n)/n))/nnn)/nnn)29((n*(-39)n)/n)/nnn(-30) assuming n is positive. n(822/7) Simplify (q*(3/16)/((qqq/(((q(-1/13)/q)/q)/q)q)/qq)(q(-3/4))(-6/37))32 assuming q is positive. q(-104170/481) Simplify (((g/(g/(ggg*(-19)g)gg))/g(-1/3))/(g24g(-19)))(3/32) assuming g is positive. g(-17/8) Simplify (uu*(-1)uu(5/2)/uu)*(-35)/((u(u*(-1)/uu)/uuu*1/u)/(uu*(-7)uu(-6)u)) assuming u is positive. u*(-265/2) Simplify (((jj(j(-3/7)j)/j)/j)(-17/5))(-9/4)/(j(-2/35)/(j(1/11)/j))(-40) assuming j is positive. j(14803/385) Simplify (((((q/(q/q*(-1/3)))/q)/q)/qq)/(q/q*(-18))(qq8)/(qqq(-10)))(-31) assuming q is positive. q(403/3) Simplify ((q(5/2)/(q/(q/(qq((q/q(-1/15)q)/qqq)/qqq))q))/(qqq(-3/2)q(-2/7)))/((q1)4)37 assuming q is positive. q(-16042/105) Simplify ((o2)23)(11/6)(o1o)*(-1/18)/(o/(o/(o(oo/(o/(ooo(-2))oo)o)/o)o)oo(3/4)) assuming o is positive. o(3005/36) Simplify ((k(-7/2)(k/k*(-14))/kk)/(k(1/8))(-40))(-1/17) assuming k is positive. k(-33/34) Simplify (ff(-2/5)fff/(f((f/(f/(ff*(-3/2))))/f)/ff)f(f/f(-6))/(f/f(2/11)))/((f(-1/3))(16/5))(-29) assuming f is positive. f(-1297/66) Simplify (d/(d*(-6)dd))/((dd/(d(d(-2)ddd)/dd))/d)(d6/d)/d1(dd*7/ddd(-7)/d)/(dd*(-5/4)/dd/(d*5/d)d) assuming d is positive. d*(53/4) Simplify (ppp(-2/7))3p*(-7)p/(pp/((p(-1/4)p)/p)pp)(p(-7/4)(p/p*(2/21))/p)/(pp*(2/5)p)(-48) assuming p is positive. p(11366/105) Simplify z*(2/7)/(zz*(-2/7)/z)(zz(3/4))/zz*7z*(-4/11)/(z/(zz(z/z(2/13)z)/zzz))(z/(z/(zz/z*(-1/2)z)))(-21/4) assuming z is positive. z(-52621/8008) Simplify ((s(-4/9)/s(-2))/(ss0s*4))/((s(ss4s)/s)8)2 assuming s is positive. s*(-895/9) Simplify (((s/(ss*(5/7)))/(s/(ss(-8/7)/s)))35)(-34) assuming s is positive. s3400 Simplify (((k*(-10)/(kk/(k(kk*12)/kk)))/((k/(kkkk(-1/5)))/(k(-1/2)/k)))(-1/60))(2/35) assuming k is positive. k(-23/10500) Simplify (xxx/(xx/x*(5/8)))/(xx/(xx/x(-37))x)x/x(6/29)xx(10/17) assuming x is positive. x(157785/3944) Simplify ((rrr/r(-1/3))(-8/17))(2/55)(r/(r(r/(rr*(-2/5))r)/r)r)36/((r/r(2/9))/(r(1/2)/r)) assuming r is positive. r(341063/16830) Simplify a(-7/2)a*26a*17aa29a assuming a is positive. a(141/2) Simplify ((p9p(-5/4)/p)/(p(-1/7)/pp(pp0)/p))15 assuming p is positive. p*(2895/28) Simplify ((ff*(-6)/f(((f/((f/f8)/f))/f)/f)/f)/(f2)20)(10/7) assuming f is positive. f(-400/7) Simplify f(3/4)/f*(1/3)(f0)(-41)(f/(ff*0)ff)/f((f/f*(-1))/f)/ff*(-3/5)f(-5) assuming f is positive. f(-251/60) Simplify (d(-8/9)/d(-5/7)(d/(d/((d(-2/7)/d)/d)d))/d13)(-13) assuming d is positive. d*(13481/63) Simplify uu*(-1)u*3((uuu/u(-2/7))/u)17(u(2/7))(13/6)/(uu0)(15/8) assuming u is positive. u*(6821/168) Simplify (ddd/((d(2/15)/d)/dd)d(-2))(2/129)(((d/(d*(-2/5)/d))/dd)/d)*32dd(1/4)d(-1/3) assuming d is positive. d(354071/7740) Simplify (t*(3/5)t/(t0/t))(-1/2)/(t/(t*(3/5)tt)t*2/t(t/(t/t*9t))/t(t(1/7)tt)/t) assuming t is positive. t(-619/70) Simplify (g6/g12(g0)(-26))(-2) assuming g is positive. g12 Simplify (a12/a(1/3))*(-45)a*(-1)(a*(2/13)/aa)/aa(-5/2)/((a(2/17)/a)/a) assuming a is positive. a(-233139/442) Simplify ((ss(1/2))6/(((s/((ss(2/11))/s))/s)/(s/(s/s(2/5)))))/((s(-6)/((((ss*(-3/8))/s)/s)/s))/(ss(-1))(-2)) assuming s is positive. s*(5811/440) Simplify ((u/(uu*(1/2))uu/(u/u(-12)))/(u/(uu*15/uu)u(-6)))19 assuming u is positive. u(361/2) Simplify (r(-5)/(r(-3/2)r))/(rrr/r*1rr((r/r*(1/12))/r)/r)(rr(-1/5)/rrr(-1/10)r)/(r(r(2/5)rr)/r)(-2/81) assuming r is positive. r(-611/108) Simplify ((h(13/5))(1/4)/(h/(((h/h(-5/9))/h)/h)h(1/2)/h))20 assuming h is positive. h(-53/9) Simplify ((n(1/4)n)(17/2)n*5n*(3/5)n)/(n*(1/2)n/n*(-1/6)n*(-2/7)nn(-2/7)) assuming n is positive. n(12709/840) Simplify (ww/w*(-1/46)w)*26w*(1/12)w20 assuming w is positive. w(27227/276) Simplify (hhh*(3/5)h/h(-1))(-46/3)hh*(-5)h*(1/9)hhh/(h/(h*(1/2)h))(((hh/h2)/h)/h)/h assuming h is positive. h(-6653/90) Simplify ((m/(m*(2/15)/m))/mmm((m*(1/2)/m)/m)/mmm3/mmmm/(m*(5/6)/m)m)/((m*5/(mm7))/(m1/(mm/m(-2)))) assuming m is positive. m(113/15) Simplify (cc24)/c41(c(-11/3)c)/(c/(cc(-15/4))) assuming c is positive. c(-269/12) Simplify (h(-1))(-14/9)(h/(h/((h/(hh/(h/(h(-2)h))h))/h)))/(h/(h(4/3)h))(h/h(-5))/(hh*4)(h/h(-2/7))/h5 assuming h is positive. h(-52/63) Simplify ((g/g(2/3))37)(-17/6)(g(gg(-1))/g)(-26)(g/g0)30 assuming g is positive. g*(-89/18) Simplify (f/(f/(ff*(-1/3)))fff)*(-7/12)((((f/(ff(-1)))/ff)/f)/f)/(ff/f(-1)f)((f(2/7))6)(-3/13) assuming f is positive. f(-24683/3276) Simplify (i(-2/29)/(i5i))(-12)/(i(-1/2)i/i(-2)(i(-2/3))(2/27)) assuming i is positive. i**(330631/4698)	{ "pile_set_name": "DM Mathematics" }
b*2 + n and give y. 2716 Express -3t + 2t - 18870t*3 + 2 + 18880t3 - t2 + 5t4 - 3 in the form zt + kt2 + rt*4 + pt*3 + y and give z. -1 Rearrange (-g + 2 + 1 - 1)(17589g - 36730g + 14589g) to z + qg*2 + ug and give q. 4552 Rearrange -15w2 - 2w*3 + 40422w*4 - 20212w*4 - 20180w*4 - w + 1 to the form b + vw*2 + iw*3 + cw + rw4 and give b. 1 Express -4 + 2o*4 - 36o - 3o2 - 37o + 11o3 + 117o + 5o3 - 41o as io3 + do*4 + wo*2 + to + f and give i. 16 Express -362 - 4t + 78t*4 + 12t + t + 2t + 363 in the form mt*4 + pt + c + zt3 + xt*2 and give p. 11 Express -121 + 9p*2 - 80 + 3p*2 + 30p*2 + 173 in the form ap + op2 + m and give o. 42 Rearrange 2m - 28m3 - 2m*4 + 6m*3 + 34m*3 + 5m + 2m2 to the form wm*4 + km*2 + ym + um3 + v and give k. 2 Express 246 - 1519k - 174 - 73 in the form ak + w and give w. -1 Express -220y*2 + 663y*2 - 219y*2 + 91 + 4y - 225y2 in the form zy*2 + p + jy and give p. 91 Express (-12s3 - 10s*2 + 10s*2)((-5 + 0 + 3)(3s - 5s + 4s) + 123s - 121s - 179s) in the form is*3 + c + vs + xs4 + ys2 and give x. 2172 Rearrange -r2 + 2124 - 3405 + 1704 to the form yr2 + k + sr and give y. -1 Express 24w + 80w - 29w + (3w - 3w - w)(3 + 3 - 4) - 3 - w + 3 + (1 - 2 - 1)(-4w + 5w + w) + 8w + 5w - 4w as s + dw and give s. 0 Rearrange 3a*4 - 188a + 13 - 56 + 12 + 16 + 9 to sa + da*3 + la*4 + xa*2 + j and give j. -6 Rearrange 436a + a*2 + 793a + 589a - 243a + 2 - 104a to z + ta*2 + ua and give u. 1471 Express 8761i - 18021i + 8825i - 2 in the form gi + h and give g. -435 Rearrange 591b3 + 1 + 591b*3 + 14b - 1185b3 - 3 + 3b*2 to qb*3 + u + mb*2 + nb and give u. -2 Rearrange -1397b + 475b + 2b3 + 3b*2 + 13b*2 - 16b*2 to fb*3 + jb + y + ob2 and give j. -922 Rearrange ((-4 + 6 + 8)(4b - 4b + b) - 2b + 4 - 4 + 5 + 2b - 5)(0 - 4 + 15) to u + jb and give j. 110 Rearrange -113 - 53u - 66u - 49u + 161u to the form p + au and give a. -7 Express 7484m - 582m + 6607m in the form p + nm and give n. 13509 Express (-2 + 0 + 5)(-20 + 55 - 20 - a)(0 - 1 + 2)(-a + a + a) in the form s + qa2 + ka and give q. -3 Express 2363j + j2 - 6j*2 - 2124j in the form yj2 + x + fj and give f. 239 Rearrange 1103y + 3734y + 75y to the form my + j and give m. 4912 Express 48445u2 + 151 + 144 - 453 + 71749u*2 + 158 + (u - u - u)(u + 0u + 0u) in the form lu2 + k + qu and give l. 120193 Express 10524s + 866s + 1072s + 4428s + 3427s as cs + b and give c. 20317 Express -3g + 5g - 3g + (3 + 0 - 1)(1 + g - 1) + (2 + 3 - 7 + (1 + 7 - 2)(1 - 1 + 2))(4189 - 532g - 4189) as s + jg and give j. -5319 Express 3943 - 4128 + 3k - 8k in the form vk + b and give v. -5 Rearrange 2t + 26571t2 - 25 + 26569t*2 - 53153t*2 to the form bt + vt2 + n and give b. 2 Express -2c*2 + 4c - 4c - 3c - c + 0c + 157 in the form nc*2 + w + fc and give w. 157 Express ((-2 - 3 + 2)(56 - 6 + 48) + (-4 + 3 + 3)(-6 + 2 + 1))(-2t2 - t2 + 4t2) as g + lt + st2 and give s. -300 Express 2s*2 - 18s*3 - 120 + 122 + 13s*3 + 10s*4 - 43s*3 - 6s*3 as gs*4 + as + vs3 + ws*2 + f and give f. 2 Rearrange 3p + p + p + (13 - 51 - 68)(464 - 20p - 464) to the form c + wp and give w. 2125 Rearrange 33j*4 - 2 + 45j*4 - 44j + j*2 - 64j + 112j to the form cj*4 + l + sj*2 + kj + tj3 and give k. 4 Rearrange (n - n - n)(1 - 2 + 0)(5 - 4 + 1)(-447 + 26 - 1903) + n + 0n + 0n - 3n + 3n - n + (-1 - 1 + 1)(n - n - n) + n - 4 + 4 to vn + a and give v. -4646 Express (1 - 1 - n + (5n + n - 4n)(-1 + 4 - 2) + 4n - n - 2n + 79n + 5n + 23n)(-3 + 2 - 1) - 2n - 2n - 7 - 3n in the form h + rn and give r. -225 Express 130v*2 - 7v - 251v2 - 322v*2 - 2v + 2v in the form h + rv + gv2 and give g. -443 Express -28x + 25x - 6x*2 + 2x + 86x3 in the form g + ax + bx2 + fx*3 and give a. -1 Rearrange -4 + 3 + 4 + 124h - 190h4 + 200h*4 to the form z + nh*3 + ph*4 + th + lh2 and give p. 10 Express (37s*2 - 19s*2 - 16s*2)(-117s - 93s - 78s) as fs + hs2 + r + as*3 and give a. -576 Express (3401b*2 - 5808 + 5808)(0b + 0b - 2b) in the form wb*2 + s + ob + pb3 and give p. -6802 Express -2243 + 6714 - 163p - 2234 - 2235 in the form o + ip and give i. -163 Express -6 + 4 + 2j - 1 + 6 - 13j2 + 7 + j3 in the form aj*2 + p + qj + rj3 and give r. 1 Express -31u + 270u2 + 59u - 18u - 277u*2 + 9u*3 - 34u in the form nu3 + lu + au2 + g and give a. -7 Express 43b + 4 + 4 - 5 - 21b - 20b + b*4 - 271b*2 as s + db*2 + nb*3 + ab + ib4 and give i. 1 Rearrange (18 + 0 + 18)(88d - 158d + 111d) to the form wd + g and give w. 1476 Express 83w - 5w*4 + 12w*4 - 126w*2 - 82w in the form gw4 + hw + dw2 + f + xw*3 and give h. 1 Express (-32w - 3w + 4w)(2w + 4w + 11w)(-4 - 4w*2 + w - 12 + 19) in the form x + cw*4 + ow + iw3 + nw*2 and give c. 2108 Rearrange (s - s + 7s)(-2 + 2 + 3s) - 3s2 + 6s*2 + 0s*2 + (1 + 2s - 1)(6s - s - 2s) to the form v + ws + qs2 and give q. 30 Rearrange (216 - 1891 + 151 - 6139 + 464)(5f - 4f + 5f) to the form yf + t and give y. -43194 Rearrange 30q2 + 201q*4 + 211q*4 - 52q*2 - 4q - 2 - 626q4 + 202q*4 to the form f + yq*4 + xq*3 + oq + iq2 and give f. -2 Rearrange -12 - 63 + 15751i - 57 + 132 to the form di + g and give d. 15751 Rearrange (y + 0y + 0y)(-11y + 5 - 5) + (6y - 3y - 5y)(-4 - 3y + 4) + (-y + 1 - 1)(2y + 5 - 5) to f + qy + dy*2 and give d. -7 Express (-1 - 24906n + 50572n - 20260n)(5 + 1 - 4)(-2 + 1 + 3)(-4 + 2 + 3) as wn + u and give w. 21624 Rearrange (2t3 - 4t*3 + 4t*3)(3911 - 13065 - 13777 - 5269 + 3046)(-2t + 3 - 3) to f + st4 + dt*3 + kt*2 + bt and give s. 100616 Rearrange -31i2 + 29i*2 - i + 663i*3 - 642i*3 + 3 to l + yi + mi2 + xi*3 and give x. 21 Rearrange -20 - 8k + 55k + 4 + 61k + 12k to m + uk and give m. -16 Rearrange 618 + 0r3 - 7r*3 - 3r + 14r2 + 84r*2 - 620 + 9r*3 to c + lr*2 + qr + br3 and give l. 98 Express 6517 - 37p*2 - 6517 + (4p - 3p - 5p)(0p + 6p - 3p) as yp + o + fp*2 and give f. -49 Express 7 + a - 7 + (-a - 4a + 3a + (4 - 2 - 3)(-3a + 3a + 2a) - 146 - 22a + 146)(0 - 3 + 0) - 48 + 58 + a + 0a in the form o + ca and give o. 10 Rearrange 19950w - 39896w + 402w*2 + 19953w to t + fw + jw*2 and give j. 402 Rearrange 42a*4 - 129a*4 + 1 + 21 + 44a*4 - 2a + 41a4 to wa + y + na2 + va*4 + xa*3 and give w. -2 Express (-2l + 3 + 0l - 2l + (5 - 5 + l)(6 + 12 - 31) - 2l + l + 0l)(14l2 + 3l*2 - 2l*2) in the form x + zl + gl3 + pl*2 and give p. 45 Express (11646i + 3263i + 2498i + 14384i)(-3i2 - 4i*2 + 5i*2) as wi*3 + gi*2 + b + ai and give w. -63582 Express (-4k + k + 4k)(-1 + 4 - 5)(-211 - 38 + 35)(2 + 2k - 2) as h + wk2 + lk and give w. 856 Express -147 + 291 - 144 - 5099a - 9307a as fa + m and give f. -14406 Express 4p + 1582p2 - 58p*3 - 5p - 3150p2 + 1573p*2 in the form fp*3 + np + h + ap2 and give a. 5 Express (-9 + 3 - 2)((1 - q - 1)(10 - 2 + 1 + (5 - 1 - 2)(0 - 1 - 1) - 7 + 1 - 9) + (q + 0q - 3q)(2 + 2 - 2)) as p + lq and give l. -48 Express -501f - 10f + 87f - 7 - 7 + 1 as tf + k and give t. -424 Rearrange (2g2 - 2g*2 - 2g*3)(81g + 54g + 5 - 148g) to mg*3 + yg + zg4 + kg*2 + o and give m. -10 Express (-50z*3 + 53z*3 + 3z2 - z2)(-10683 - 4270 - 2509 + 454) in the form c + qz*3 + rz*2 + pz and give r. -34016 Rearrange 3366h - 106478h*2 + 53242h*2 + 53239h*2 to sh*2 + b + xh and give x. 3366 Express 601z + 117z + 6700z in the form pz + r and give p. 7418 Rearrange -131t2 - 132t*2 - 5407 + 0t + 264t2 + 0t to ct + nt*2 + v and give n. 1 Rearrange -202l*4 + 3l + 60 + 2l2 - 61 + 105l*4 to the form gl*4 + ul*2 + al*3 + pl + c and give g. -97 Rearrange (-107y + 1099 + 538y - 1099)(-2805y**2 +	{ "pile_set_name": "DM Mathematics" }
ement from iiiwpiiiipiwi. 3/26 What is prob of sequence top when three letters picked without replacement from {b: 3, o: 1, p: 3, t: 3, d: 3, h: 1}? 3/728 What is prob of sequence yo when two letters picked without replacement from meoyoom? 1/14 What is prob of sequence hh when two letters picked without replacement from vhgghm? 1/15 Two letters picked without replacement from {m: 1, r: 4, q: 6, s: 3, v: 4, l: 1}. What is prob of sequence sl? 1/114 Calculate prob of sequence zzzk when four letters picked without replacement from {z: 3, k: 9}. 1/220 Two letters picked without replacement from {t: 1, s: 1, f: 1, p: 4, c: 4, a: 7}. What is prob of sequence fc? 2/153 Three letters picked without replacement from {p: 9, g: 10}. What is prob of sequence ppg? 40/323 What is prob of sequence ik when two letters picked without replacement from {e: 3, k: 3, i: 9, g: 2, q: 1}? 3/34 What is prob of sequence wj when two letters picked without replacement from {w: 11, j: 2, z: 2}? 11/105 What is prob of sequence ooo when three letters picked without replacement from oooooooooo? 1 Calculate prob of sequence bdd when three letters picked without replacement from dpdppjbbobopdkppp. 3/680 Four letters picked without replacement from {q: 2, h: 3, f: 5, p: 1, t: 1, j: 3}. What is prob of sequence hfth? 1/1092 Two letters picked without replacement from ikbtk. Give prob of sequence bk. 1/10 Calculate prob of sequence llc when three letters picked without replacement from cclllclllcclcc. 7/52 Three letters picked without replacement from {b: 1, i: 1, r: 1}. What is prob of sequence iri? 0 Calculate prob of sequence tti when three letters picked without replacement from sixtsitnnientie. 4/455 Three letters picked without replacement from lxxlyxxlxxyxyylxldy. Give prob of sequence dyy. 10/2907 Three letters picked without replacement from {m: 2, r: 18}. Give prob of sequence mmr. 1/190 Two letters picked without replacement from wwffswkkkwwxzwwkz. What is prob of sequence sw? 7/272 What is prob of sequence pdd when three letters picked without replacement from {p: 3, d: 9}? 9/55 Four letters picked without replacement from {f: 5, p: 7}. What is prob of sequence fpfp? 7/99 What is prob of sequence rp when two letters picked without replacement from grgggrzrpzgdgp? 3/91 Calculate prob of sequence go when two letters picked without replacement from dzgagggorgadagggdg. 1/34 Three letters picked without replacement from iccci. What is prob of sequence cii? 1/10 What is prob of sequence bibb when four letters picked without replacement from bbbibbibbbbibb? 45/364 Four letters picked without replacement from wwwwbbywywwbwwbbb. Give prob of sequence bywy. 9/4760 What is prob of sequence gg when two letters picked without replacement from ygggyg? 2/5 Four letters picked without replacement from {u: 7, b: 3, i: 3}. What is prob of sequence bbbi? 3/2860 Three letters picked without replacement from {l: 4, s: 6}. What is prob of sequence ssl? 1/6 Calculate prob of sequence dss when three letters picked without replacement from {s: 3, d: 2}. 1/5 Four letters picked without replacement from grffpfd. What is prob of sequence gfdp? 1/280 Two letters picked without replacement from xjjvxxxmxmxx. What is prob of sequence mx? 7/66 What is prob of sequence fmff when four letters picked without replacement from mfffmffmmmmmmm? 45/2002 Four letters picked without replacement from nnnnsnsnnnnnsnnnsnnn. Give prob of sequence nnnn. 364/969 Four letters picked without replacement from ivvbcc. What is prob of sequence vvci? 1/90 Three letters picked without replacement from ttmtttmmtmtmtttmtt. Give prob of sequence ttm. 11/68 Three letters picked without replacement from ffwffw. Give prob of sequence fww. 1/15 Calculate prob of sequence as when two letters picked without replacement from {c: 2, j: 1, s: 1, a: 3}. 1/14 Three letters picked without replacement from eqtywtyc. Give prob of sequence ycq. 1/168 Two letters picked without replacement from zzzaza. Give prob of sequence aa. 1/15 Three letters picked without replacement from vvyvpvpyv. What is prob of sequence ypy? 1/126 Two letters picked without replacement from {h: 2, d: 1, x: 2, k: 1, p: 2}. Give prob of sequence kx. 1/28 Two letters picked without replacement from pqxqnynd. Give prob of sequence xp. 1/56 Calculate prob of sequence do when two letters picked without replacement from {d: 11, o: 3}. 33/182 Calculate prob of sequence wcx when three letters picked without replacement from {i: 1, w: 3, x: 6, c: 4, q: 2}. 3/140 Two letters picked without replacement from {c: 1, r: 3}. What is prob of sequence rc? 1/4 Calculate prob of sequence ej when two letters picked without replacement from ljmedbd. 1/42 Two letters picked without replacement from {h: 2, w: 1}. Give prob of sequence hw. 1/3 Three letters picked without replacement from wwwzzux. Give prob of sequence wwu. 1/35 Three letters picked without replacement from uweeweeewefwefswww. Give prob of sequence ffw. 7/2448 What is prob of sequence bb when two letters picked without replacement from {b: 3, n: 1}? 1/2 Calculate prob of sequence ez when two letters picked without replacement from {t: 3, z: 4, d: 3, e: 2, j: 4}. 1/30 Two letters picked without replacement from xisfz. What is prob of sequence xz? 1/20 Two letters picked without replacement from {y: 11, m: 1}. What is prob of sequence my? 1/12 Three letters picked without replacement from ssssssssss. What is prob of sequence sss? 1 Calculate prob of sequence zmv when three letters picked without replacement from {h: 3, m: 1, d: 7, v: 1, z: 1}. 1/1716 Two letters picked without replacement from dttt. Give prob of sequence td. 1/4 Calculate prob of sequence euo when three letters picked without replacement from oeaooaaaxaauuu. 3/728 Three letters picked without replacement from {x: 5, z: 2}. Give prob of sequence xxx. 2/7 Three letters picked without replacement from vddqdvqdd. What is prob of sequence dvd? 5/63 Two letters picked without replacement from {b: 4, r: 2, h: 1, w: 1, p: 1}. What is prob of sequence hb? 1/18 What is prob of sequence rqr when three letters picked without replacement from arllaaaqqrala? 1/429 Four letters picked without replacement from {x: 1, q: 1, o: 3, n: 1, w: 1}. What is prob of sequence oqox? 1/140 Four letters picked without replacement from {d: 1, y: 1, q: 1, t: 1, a: 1}. Give prob of sequence dttd. 0 Calculate prob of sequence qww when three letters picked without replacement from {w: 2, o: 5, q: 2}. 1/126 Calculate prob of sequence cn when two letters picked without replacement from {c: 6, n: 2}. 3/14 What is prob of sequence ibjh when four letters picked without replacement from {j: 8, v: 6, b: 1, i: 3, h: 1}? 1/3876 Calculate prob of sequence qb when two letters picked without replacement from {d: 1, f: 6, k: 7, z: 2, b: 2, q: 1}. 1/171 Calculate prob of sequence ej when two letters picked without replacement from uwjcjte. 1/21 What is prob of sequence zs when two letters picked without replacement from {s: 3, z: 4, m: 1}? 3/14 Three letters picked without replacement from dttpmpt. Give prob of sequence mtp. 1/35 Calculate prob of sequence wgs when three letters picked without replacement from sogowgwrgoor. 1/220 What is prob of sequence xxyu when four letters picked without replacement from {s: 1, u: 1, c: 3, n: 6, y: 2, x: 2}? 1/8190 Calculate prob of sequence zad when three letters picked without replacement from {z: 4, a: 2, r: 1, d: 3}. 1/30 Four letters picked without replacement from {b: 2, a: 1, z: 8, h: 1, n: 1, i: 2}. What is prob of sequence aihh? 0 Calculate prob of sequence avvv when four letters picked without replacement from bmbbalvvvbbmmvb. 1/1365 Three letters picked without replacement from pxjngnnpggijxgpx. What is prob of sequence nxj? 3/560 Calculate prob of sequence beb when three letters picked without replacement from {e: 5, n: 2, b: 2}. 5/252 Calculate prob of sequence pppq when four letters picked without replacement from psppqdrdpdggspd. 1/546 Three letters picked without replacement from {g: 6, a: 4}. What is prob of sequence aag? 1/10 Calculate prob of sequence boy when three letters picked without replacement from {x: 4, o: 1, e: 2, b: 7, y: 4, n: 2}.	{ "pile_set_name": "DM Mathematics" }
common multiple of y and 12? 12 Let t(u) = -u + 1. Suppose -4b - 2 = -30. What is the smallest common multiple of b and t(-5)? 42 Suppose t - o - 19 = 2o, 8 = 4t + 5o. Let s = 31 + -22. Suppose m = -0m + s. Calculate the least common multiple of t and m. 63 Let y be (-4)/(-20) + (-502)/1960. Let s = 591/196 - y. Find the common denominator of 5/14 and s. 14 Let j = -5/2592 + -154199/12960. What is the common denominator of j and 1/2? 10 Let a = -39 + 59. What is the smallest common multiple of (-1 - 0)4-4 and a? 80 Find the common denominator of 31/14 and (6/(-192))/((-1)/6). 112 Let f = 8219/3 + -11001/4. Find the common denominator of 59/18 and f. 36 Suppose 3h + 551 - 56 = 0. Let y = -36515/6 + 6111. Find the common denominator of 1/3h/50 and y. 30 Suppose -2o + 0o + 2 = 0. Calculate the least common multiple of o and 9. 9 Suppose -2q - 1 = 2l - 7, -2q = l - 11. Calculate the lowest common multiple of q and 18. 72 Suppose -4k + 3c = -20, -3k + 2k - 18 = 5c. Calculate the lowest common multiple of 12 and 89/4 + k/(-8). 132 Let l(f) = 548f - 6. Let j be l(7). Let t = -30543/8 + j. Find the common denominator of t and (-639)/(-60) + (-3)/(-12). 40 Let n be (2/(6/(-9)))/(-1). Suppose 4p = i, ni + 9 = 7p - 4p. Find the common denominator of 22/7 and 789/72 + p/3. 56 Let y = -591283/73404 + -3/8156. What is the common denominator of 3 + (-5)/(-50) - 3 and y? 90 Let p = -23 - -43. What is the common denominator of (-3 - (-107)/(-3))/(-6) and (79/(-3))/(p/(-6))? 90 Let c(b) = 9b. Let y be c(-2). Let l be (y/6)/(6/(-4)). Suppose -4h = 3g - 87, -5h + 4g - lg = -80. What is the lowest common multiple of 16 and h? 144 Let u = 27 + -5. Calculate the least common multiple of u and 54. 594 Suppose 3q + 4o - 2o + 58 = 0, 4q - 3o + 49 = 0. Calculate the common denominator of 85/16 and (-4)/314/q. 48 What is the lowest common multiple of 20/(-6)(-54)/5 and 12? 36 Suppose p = 45 - 14. Suppose 13 = -3o + p. Suppose -5u = -3k + 2, -5u - 10 = k - ok. Calculate the lowest common multiple of k and 22. 44 Suppose 0 = 5h - d - 55, 0h + d - 45 = -5h. Let g be (-84)/h + (-4)/(-10). What is the common denominator of 4/g - (-86)/28 and 42/11? 77 Let o = 21 - 9. Let w be (-11 - -7)/(-11). Suppose 2b - o = -2y - 0y, -4 = wy. Calculate the smallest common multiple of 1 and b. 7 Let h = -210431/14 + 15070. Let m = h + -54/7. What is the common denominator of m and 93/20? 20 Let n be (-2)/4(-4)/(-1746). Let d = n + 12515/1746. Find the common denominator of d and -30/11. 66 Let m be (1 - -11)10/6. Let t = -13 + m. What is the least common multiple of t and 5? 35 Let o = 2869224 + -28718983/10. Let l = -2672 - o. Find the common denominator of l and 3/(-18) + 21 + -2. 30 Let a = 7 + -9. Let m = 16 - a. What is the common denominator of (m/(-7))/(5/(-7)) and 43/8? 40 Let r be (-1)/(-3) + 60/9. Suppose 5a - 8 = -2v, 3v - ra + 3a = 12. What is the lowest common multiple of 10 and v? 20 What is the common denominator of (-9)/(-3 + 0) + -5 and -39/10? 10 Suppose n - 3 + 4 = 0. Calculate the least common multiple of 41/4 - (-4)/(-16) and (4 - n) + 1 + 0. 30 Let n be (-4)/(-14) - (-230)/(-70). What is the common denominator of -65/8 and n - ((-189)/(-16))/7? 16 Suppose 6s - 4s = -4. Calculate the common denominator of ((-2)/(-6))/((-8)/6) and s316/84. 28 Let u be (4 + -1)8/6. Suppose 5i - 8 = 3f - 3, -ui = -3f - 1. Suppose -t - 14 = 4h - 54, -t + 4 = 0. What is the least common multiple of h and f? 45 Let c = -161 + 162. Calculate the lowest common multiple of c and 38. 38 Suppose 39z + 4r - 36 = 37z, r + 68 = 5z. What is the lowest common multiple of (-114)/(-7) - 2/7 and z? 112 Let z = 47 - 7. Calculate the smallest common multiple of z and 12. 120 What is the smallest common multiple of 4 and 2/(-4) - (-60)/8? 28 Let x = 38 + 30. What is the least common multiple of 16 and x? 272 Let t(c) be the third derivative of c6/120 - c5/15 - c4/3 + c3/2 - 3c*2. Let x be t(5). Find the common denominator of 54/x26/15 and 8/11. 55 Let o(l) = l*2 - 4l - 4. Suppose s + 13 = 4h - 8, 0 = 4s + 4. Let a be o(h). Calculate the common denominator of a/3 - (-33)/27 and 44/5. 45 Let r = 12835147 - 128245279/10. Let x = r + -10631. Find the common denominator of 50/7 and x. 70 Suppose -5p + 3 - 38 = -5i, 3 = i + 3p. What is the common denominator of -56/5 and ((-6)/(-35))/(i/15)? 35 Suppose 0u - 2 = -2u. Calculate the common denominator of u/3142/(-12) and ((-89)/(-10) - 9) + 5. 90 Let u = -10105 + 202039/20. Let v = -1249 + 1782. Let l = v - 1097/2. Calculate the common denominator of u and l. 20 Find the common denominator of (-6)/3 - (-32)/(-7) and 3/(-9) - 435/(-63). 7 Let j = -10 - -8. What is the smallest common multiple of ((-2)/j + -2)-11 and 5? 55 Calculate the common denominator of (438/(-16))/((-75)/10) and 9/16. 80 What is the common denominator of (-12)/3120 - 4/(-26) and (-7)/410/(-13)? 260 Let f = -28 - -44. Calculate the least common multiple of f and 18. 144 Let l = -1297 + 1907. Let u = l - -6. Find the common denominator of 596/u - (-2)/(-7) and -43/16. 176 Calculate the lowest common multiple of 40(12/60)/((-1)/(-2)) and 8. 16 What is the common denominator of -87/14 and (-4942)/(-1960) + 6/14? 140 Let p = 25 - 17. Let f be -3(2/(-6) + -1). Suppose -3w + f = -w. Calculate the lowest common multiple of w and p. 8 Calculate the common denominator of -1 - -1 - ((-68)/6)/1 and -4/39. 39 Let s(d) = -5d + 6. Let v = -6 - -3. Find the common denominator of s(4) and (-1)/v + (-76)/(-36). 9 Let k(z) = -20z. Let s be k(-1). Suppose 4p + 3w = -p + 28, 0 = 5w + s. What is the least common multiple of p and 4? 8 Let v(r) = 4r. Calculate the least common multiple of 6 and v(5). 60 Let j be -6 + 4 - (-6 - 0). Suppose jx - 19 = -7. What is the smallest common multiple of x and 3? 3 Let q(c) = c*2 - c. Let t(g) = -2g - 1. Let x be t(-2). What is the least common multiple of q(x) and 20? 60 Suppose -2l - 4 = 10. Let m = -24 + l. Let f = 4018/11 - 364. Calculate the common denominator of f and m. 11 Let a(q) = -q3 - 9q*2 - 10q - 12. Let k = 3 + 13. Let j be (-3 + 0)k/6. Calculate the smallest common multiple of 5 and a(j). 20 Let g = 6 + -7. Let v(o) = -20o. What is the lowest common multiple of v(g) and 22? 220 Let z = -43679/110 + 2002/5. Find the common denominator of z and (-81 - 2)/(0 - -20). 220 Let l(g) = -g*2 + 11g + 16. Calculate the smallest common multiple of 12 and l(12). 12 Let b(a) = a*2 + 3a - 1. Calculate the lowest common multiple of 18 and b(-4). 18 Let s = 26793/154 - 1187/7. Calculate the common denominator of s and -2 - ((-835)/90 - 0). 198 Let p(c) be the second derivative of 3c + 1/6c*3 + 0 + 7/2c*2. Calculate the least common multiple of 8 and p(13). 40 Find the common denominator of -27/11 and 6/(-9) + (746/84 - 4). 154 Let j be (-1 - 1)(-1 + 0). What is the common denominator of 3 + ((-121)/(-10))/(-1) and (-58)/12 + (-2)/j? 30 Suppose 3 + 1 = k. Suppose -r + 3a + 65 = r, -ka + 27 = r. What is the least common multiple of r/5 + (-3)/15 and 10? 30 Suppose 4u - 2 = 18. Let d(w) = w3 - 7w*2 - 8w + 10. What is the smallest common multiple of d(8) and u? 10 Suppose 2x - 6x + 125 = -b, -2x = b - 55. What is the smallest common multiple of x and 25? 150 Let u = -864313/30 - -28807. Calculate the common denominator of u and -139/6. 30 Let c(g) = g2 - 5g + 7. Let t be c(5). Suppose 0 = 2i - 5 - t. What is the common denominator of 3/10 and 46/i18/(-15)? 10 Let f be ((-285)/(-3))/(-1) - -2. What is the common denominator of -55/2 and f/54 - (1 - 0)? 18 Let g(c) = 7c - 10. Calculate the smallest common multiple of g(7) and 30. 390 Suppose -13 = -2a + 1. What is the smallest common multiple of 5 and a? 35 Let b be ((-791330)/30)/((-10)/3). Let g = 7907 - b. Find the common denominator of 41/12 and g. 60 Let q = -51/70 + -3/140. Let h = 242/7 - 199/7. What is the common denominator of h and q? 28 Let a = 12 + -3. Suppose -20k + 141 = -39. What is the lowest common multiple of a and k? 9 Suppose -3y - 135 = -3b, -5b = y - 2*y - 229. Let g = -2 + 3. What is the common denominator of -17/2 and ((-2)/(-14))/(g/b)? 14 Calculate the lowest common	{ "pile_set_name": "DM Mathematics" }
et j = 0.258 + 0.142. Let t = -6 + 1. Which is the nearest to 0.1? (a) 0 (b) j (c) t a Let m = -131.9 - -129.9. Which is the closest to 2? (a) m (b) 5 (c) -21 b Let x be (-2 + 2)/((-41)/(-2)). Let h = 29/2 + -14. Which is the nearest to h? (a) 2 (b) x (c) -0.1 b Let u = 128 - 900/7. Let t = 3.993 + 0.007. Which is the nearest to 0.06? (a) u (b) t (c) 0.2 c Let w = 1.464 + -95.464. Which is the nearest to 0.4? (a) 2 (b) 0.3 (c) w b Let o = 91 - -35. Let j = 30 + -36. Let k be (o/(-196))/(j/(-7)). Which is the nearest to k? (a) 0.3 (b) 0 (c) 0.05 b Let z = 1594/13 - 122. Which is the closest to -0.2? (a) 1/5 (b) z (c) 0.5 a Let t = -4/39 + -50/273. Let s be (-2512/21)/(15/140). Let q = 135 + s. Which is the nearest to -1? (a) t (b) 0.5 (c) q a Let v = 1791/2 - 895. Which is the nearest to v? (a) 7 (b) 2 (c) 3/7 (d) -3 c Let w = 0.093 - -0.307. What is the closest to -1 in -8/5, w, 2/15, -5? -8/5 Suppose 0 = -2k - 3o - 87, -k = -7o + 2o + 11. Let f be (2/5)/(k/20). Which is the nearest to f? (a) 0.07 (b) 0.5 (c) 0.1 a Let x = 0.81 - 5.81. What is the nearest to 0 in -2/9, x, 2/5? -2/9 Let z be (-123/(-14))/(12/(-24)). What is the closest to z in 0.5, 1/9, 1/3? 1/9 Let d = -50 - -70. Let l = -15 + d. Suppose -3g - 9 = 2q, lq = g - 3g - 17. Which is the nearest to 2/5? (a) 1 (b) g (c) -2 a Let w = -5.5 - -5.7. Let i = -49 - -48. What is the nearest to i in 4, w, -4? w Let n = -7601 - -7598. Let z(t) = -t - 2. Let l be z(-2). Suppose 5i = -20 - l. Which is the closest to -1? (a) i (b) n (c) -3/2 c Let q(b) = 2b2 - 16b + 28. Let y be q(2). What is the closest to -6 in -0.1, -2/5, y? -2/5 Let f be -1 + 2 + 95464670/1290. Let k = f - 74004. Let d = k - -2/43. Which is the nearest to -3? (a) 5 (b) 1/3 (c) d b Let h = 0.5 - 0.8. Suppose 0 = 2o - 7o - 15. Let n = -28.9 + 29. Which is the closest to n? (a) o (b) 0.3 (c) h b Let f = -361 + 365. Which is the nearest to 0? (a) 2 (b) f (c) 0.06 c Let y = 62 - 72. Let j = y - -9.8. What is the nearest to j in -2, -4, -5? -2 Let l = 0.02 - 0.42. Which is the closest to 3? (a) l (b) -2/49 (c) -1 b Let s = 9 + -8. Let j = -145 - -148. What is the closest to s in 1, j, 5? 1 Let k = 1315 + -1325. Which is the nearest to -0.1? (a) 0.01 (b) 4 (c) k a Let h = -13.4 + 13. Let k = -0.05 - 0.95. Which is the nearest to k? (a) 2/11 (b) h (c) 2 b Let l = -299 - -295. Let i = -2 + 1.7. Let g(u) = u + 4. Let r be g(-4). Which is the closest to r? (a) 5 (b) l (c) i c Let z = 112 - 112.17. Let p = 0.03 - z. Let j = 2.94 + 0.06. What is the closest to 1/3 in p, j, 4? p Let y = 23/108 - 7/540. Let j = 0.04 + -2.04. Let v = -2 + j. What is the closest to 2 in v, y, 3? 3 Let p = 93 + -89.26. Let q = p - -0.26. What is the closest to 1 in 0.4, -0.3, q? 0.4 Let z = 0.066 + -32.066. Let l = z + 34. What is the closest to l in 3, -2/11, -5? 3 Let d = -2.95 + -0.05. Let y = -950 + 949. Which is the closest to d? (a) 9 (b) y (c) 0.2 b Suppose 9n - 32 = n. Suppose k = -3k - n. Which is the nearest to 0? (a) -5 (b) -0.5 (c) k b Let f = 511 + -513. Which is the closest to f? (a) -2/15 (b) -1/2 (c) 21 (d) -0.1 b Suppose k - 4 = 0, 0 = -3g + 4k - 9 - 7. Let r = -181 - -186. Which is the closest to g? (a) 1 (b) 2 (c) r a Let g = 18.3 + -18.67. Let z = -0.02 + 0.05. Let m = g - z. Which is the nearest to -1? (a) 0.3 (b) m (c) 0 b Let l(j) = -2j + 3. Let o be l(2). Suppose 22 = -52s - 30. Which is the nearest to o? (a) 5 (b) 2 (c) s c Let j = 78 - 17. Let d = -60.6 + j. What is the closest to -1/2 in 2, d, 1? d Suppose 2i = -256 + 258. Let u = 2.3 - 2.2. Which is the closest to 1? (a) -7 (b) i (c) u b Let s = -643 - -646.99. Let z = -0.01 - s. Let r = -208 + 1459/7. What is the closest to 1 in r, z, -3? r Let v = -1085 - -1080. Which is the nearest to 0.2? (a) -84/11 (b) 0.3 (c) 3 (d) v b Let h(z) = z + 10. Let m be h(-7). Suppose 4t + 6 = -3u, 8u - 3u = -mt - 10. Which is the nearest to t? (a) -0.5 (b) 1 (c) 2/3 a Let k = -164 - -164. What is the nearest to k in 0, 4/9, 4? 0 Let g = 237 - 237.2. Let x = -1 - -1.4. Let f = x - 0.4. Which is the closest to g? (a) 1/3 (b) f (c) -2 b Let o = 145 + -111. Let d = 34 - o. What is the closest to -0.1 in 1, d, -2/3? d Let m = 1.1 - -9.9. Let a = 35 - 46.1. Let b = m + a. What is the closest to b in -5, 4, 5? 4 Let f be 1(0 + 1/3). Let y = -7.9 - -4.9. Let n be -3 + 0 + (1 - -1). Which is the nearest to 0.1? (a) f (b) y (c) n a Let x = 2.2 - 1.7. Suppose 3i - 5 = -2i. Let r = -2 + 5. Which is the nearest to i? (a) r (b) 0 (c) x c Let y = 9 + -7. Let n = 0.2 - y. Let j = 0.8 + n. Which is the nearest to -0.2? (a) -1/2 (b) -4 (c) j a Let z = 5.92 - 5.52. Which is the closest to -19? (a) z (b) -4 (c) -0.5 b Let a = 19/2 + -53/6. Let m = 87.3 - 87. Let k be 3(0 + -1 - 0). What is the closest to 0.2 in k, a, m? m Let m(k) = -119k - 835. Let o be m(-7). What is the nearest to 0 in o, 73, -0.3? -0.3 Let j = -0.212 - -0.112. Let y = -0.02 + 0.12. Which is the closest to j? (a) 2 (b) 8 (c) y c Let q be (-3 - -1 - -1)/((-74)/(-4)). Let o = -0.6 + 0.7. What is the nearest to o in q, -5, -0.5? q Let y be 5 - (-126)/(-24) - 81/(-4). Let p be (-55)/75 - (-1 + 12/y). Let m = 0.1 - 0.2. What is the nearest to m in 0.1, -4, p? 0.1 Let o be ((-6)/42 + 0)/((-2)/4). Let w = 147 - 1321/9. Which is the nearest to o? (a) 0.4 (b) w (c) -0.1 b Let c = -54.302 + 54. Let y = c + 0.002. What is the closest to 0.1 in y, 7, -5? y Suppose -2s = 13s + 60. Which is the nearest to 2/19? (a) 7 (b) s (c) -0.5 c Let o = 725.9 - 730.9. Let w = -3.1 + 3. What is the nearest to w in -1/2, o, 0? 0 Let n = -0.26 - 0.03. Let k = -1.29 - n. What is the closest to -1 in k, -0.2, 2/9? k Let p = -854 + 852. What is the nearest to p in -77, 0, 3/4? 0 Let v = 1803 - 1799. Let r = 2169/11 - 197. Which is the nearest to -0.1? (a) -3/4 (b) r (c) v b Let u be 3 - (12/10)/((-2)/(-5)). What is the nearest to -0.8 in u, 1/8, -0.5? -0.5 Let z = 2 + -3. Let g be (-8)/(1 - -3) + 0. Let w be (-24)/18 + (-3)/g. Which is the closest to z? (a) 3 (b) w (c) -3 b Let l(w) = -w + 12. Let j be l(10). Let m be (-270)/(-75) - j2. Which is the nearest to m? (a) -1/4 (b) -5 (c) -4 a Let f be -5(-2 - (-28 - -3)). Let x be f/(-69)(-1)/(-15). Let u be 2/(2 + -2 + 6). Which is the closest to -0.6? (a) -1/6 (b) u (c) x a Let d be 35/(-42)316/(-100). What is the nearest to -2/9 in d, 3/4, 5/2? d Let a = 1443/4 + -5427/20. Let y = a + -89. Let p = 0.3 + -0.4. What is the nearest to y in 1/3, 3/4, p? 1/3 Let o(p) = p*2 + 11p + 18. Let y be o(-8). Let z be y/(-42) + ((-62)/42 - -1). Which is the closest to -2? (a) z (b) -5 (c) -4 a Suppose g + 2s - 2 = -0, 0 = 3g + s + 4. Let o = 63.55 - 63.57. Which is the closest to 0? (a) o (b) 1 (c) g a Let k = 0.969 + -1.269. What is the closest to 0 in 5, k, -0.075? -0.075 Let r = 0.11 + 0. Let x = 0.028 - 0.638. Let n = x + r. Which is the nearest to 0? (a) n (b) 2 (c) 0.4 c Suppose -8 = 5d + 2, -3c - 3d = 12. Let x be c(-2)/(-1 - 1). Let z = 1.5 + -1.4. What is the nearest to z in -2/7, x, 4? -2/7 Let f = -812.7 + 813. What is the nearest to f in 0.1, 9, 0? 0.1 Let j(v) = v + 1. Let m(k) = -k*2 + 20k + 41. Let d be m(22). Let p be j(d). Let t = 163/15 + -32/3. Which is the nearest to p? (a) -2 (b) 2/9 (c) t a Let g = 22 - 22.21. Let f = g - 0.09. Let d = -2.6 - -1.6. Which is the closest to d? (a) 1 (b) f (c) -4/9 c Let o = -2/23 + -15/92. Let y(f) = -f*3 - 69f*2 + 144f + 140. Let q be y(-71). Which is the nearest to 1? (a) q (b) -0.4 (c) o c Let r be 10/15 + 2 + -2. Let i be ((-2)/4)/(2/(-4)). Let f be 2/(-8) - i/4. Which is the closest to 1? (a) 4 (b) f (c) r c Let h = 17.13 + -17. Let c = 0.23 - h. What is the nearest to c in -1, 2, -0.3? -0.3 Let c = -212 - -847/4. What is the closest to 2 in 0, 3/2, c? 3/2 Let a = -394 + 280. Let r = 110 + a. What is the closest to -0.1 in r, 0.4, -0.3? -0.3 Let q(l) = -35l + 69. Let r be q(2). What is the closest to -0.3 in -0.029, r, -3? -0.029 Let k = 94 + -150. Let x = -53 - k. What is the closest to -2/3 in -1, -2/5, x? -2/5 Suppose -5i = 5k + 3 + 7, 3k - i = 14. Which is the closest to 3/13?	{ "pile_set_name": "DM Mathematics" }
respect to v. 432091ps*2 - 3pt3 What is the second derivative of 414v*3 - 42359v*2 + 1014571v - 23 wrt v? 2484v - 84718 What is the second derivative of -10c*4 - 1800c*3 + 5c*2 + 56630929c wrt c? -120c2 - 10800c + 10 Find the third derivative of 162557135b3 - 15b*2 + 1642b - 44 wrt b. 975342810 Differentiate -gl4 + 17051635g - 2504410l4 with respect to l. -4gl3 - 10017640l*3 Find the second derivative of 58375380n*3w + n + 9266842w - 1 wrt n. 350252280nw Find the third derivative of 7643b*3h*3u*3 - 5b*3h*2q + 3b3u - 321bh*3q + 363bh*2qu - 46bu3 + q wrt h. 45858b*3u*3 - 1926bq Find the first derivative of 402565x*4 + 173x + 525000676. 1610260x3 + 173 Find the second derivative of 839366878s*2 - 514669792s. 1678733756 What is the second derivative of -21345bi*2 + 3bi + 966b - 22i2v - iv - 2i + v + 3 wrt i? -42690b - 44v Find the third derivative of -14368a5 + 274a*3k2 - a3 - 438a2k*2 - 539ak2 + ak + k*2 - 2k wrt a. -862080a2 + 1644k*2 - 6 What is the derivative of -2a*4 - 3767574a - 15152881 wrt a? -8a3 - 3767574 What is the derivative of -4012f*3 - 115f + 31911648 wrt f? -12036f2 - 115 Find the third derivative of -8724646j*4z3 - j3z - 2j*3 + 60j*2 + 5jz3 - 2jz2 - 299z*3 - 23 wrt j. -209391504jz3 - 6z - 12 What is the derivative of -551287p2 - 256p + 294947561 wrt p? -1102574p - 256 Find the second derivative of -8684800d*2 + 21765229d. -17369600 What is the third derivative of -18h3k*3 + 18h*3k - 60534h3 + 21h*2k*2 + 148341k*3 wrt h? -108k*3 + 108k - 363204 What is the third derivative of 4ln*5 + 1125ln2 - 425ln - 6l + 2800996n5 - 2n*2 - n wrt n? 240ln2 + 168059760n*2 What is the second derivative of -38158g*4 + 305g*2 - 114110371g wrt g? -457896g2 + 610 What is the second derivative of -5510b*3j + 783b3 + 2b*2 + 20bj - 1056404j wrt b? -33060bj + 4698b + 4 Differentiate 2g4 - g3 + 4636g2 - 268g - 1610303 with respect to g. 8g3 - 3g*2 + 9272g - 268 What is the second derivative of 11p5 - 38721p*4 + 1089p - 279? 220p3 - 464652p*2 Find the second derivative of 5536317w*3z*2 + 31w*3z - 562858w3 wrt z. 11072634w*3 Find the second derivative of 5d*3x*2z2 - d3x2 - 98207d*2x - 2dxz - dx - 112075x3z2 - x3 wrt z. 10d3x*2 - 224150x*3 What is the third derivative of 634y*6 + 8787y*4 - 95y*2 + 3008091y? 76080y3 + 210888y Find the first derivative of 52b2k*2 + 960429691b*2 + 2433571bk2 wrt k. 104b*2k + 4867142bk What is the derivative of -21282668x3 + 25313718 wrt x? -63848004x*2 Differentiate -223465455k*2 - 1471185724 wrt k. -446930910k What is the third derivative of 6b4 - 3044270b*3 + 1126333b*2 - 4 wrt b? 144b - 18265620 Differentiate 49605u3 + 38u*2 - 14403739 wrt u. 148815u*2 + 76u Find the first derivative of 372557650s - 202647992 wrt s. 372557650 Differentiate -11324992kq + 30733583k with respect to q. -11324992k Find the third derivative of 49595254k*3 + 74328747k*2. 297571524 Differentiate -25632f3 - f2 - 114f - 12755980 wrt f. -76896f*2 - 2f - 114 Find the first derivative of 37400ay*2 - 1010ay - a - 456013y*2 - 171y wrt a. 37400y2 - 1010y - 1 Find the first derivative of 151348855m - 265082690 wrt m. 151348855 Differentiate 4390p4 + p2 - 30p - 52695378 wrt p. 17560p*3 + 2p - 30 Find the first derivative of 194351938v + 135835997 wrt v. 194351938 Find the second derivative of -156554358q*3 + 132571834q + 4. -939326148q Find the second derivative of 4854q*2s + 3q2 + 6631qs - 69s wrt q. 9708s + 6 Find the third derivative of 11170273f*3 + 57f*2 + 4f + 3498 wrt f. 67021638 Find the second derivative of 20286563v2 - v + 28387953. 40573126 Find the second derivative of 5348803u*5 + 1275582u wrt u. 106976060u3 Find the first derivative of 8851724d - 30810657. 8851724 Differentiate -147175h2 + 3hu - 415722u with respect to h. -294350h + 3u Find the second derivative of -49316241m2 + 33661337m. -98632482 Differentiate -175v3x - 14v3 + 18257v*2x - 5v2 - 270v + 4 wrt x. -175v3 + 18257v*2 Differentiate -10u*2 - 10999u - 5767611 with respect to u. -20u - 10999 Find the first derivative of -442494031j - 169464275. -442494031 What is the second derivative of -126291d4n + 48d3n*2 - 510294dn2 + 138d wrt d? -1515492d2n + 288dn*2 What is the second derivative of 1665262t*4 + 3t*3 + 239643938t wrt t? 19983144t2 + 18t Find the third derivative of 223844805l3 - 393399l*2 - 23l. 1343068830 Differentiate 3402l2y - 609054l2 + 280y - 6 wrt y. 3402l2 + 280 Find the second derivative of -6153903q*3 + 7841600q wrt q. -36923418q What is the derivative of 1386014g*2 + 38g + 6149555? 2772028g + 38 What is the second derivative of 26l*4 - 1313853l*3 + 74031472l? 312l2 - 7883118l What is the derivative of -k*3 + 45k*2 + 54666k + 17092032? -3k2 + 90k + 54666 Find the third derivative of -308366961i2q*3 - 1114i*2 + 2iq4 - 6734iq2 - 8 wrt q. -1850201766i*2 + 48iq Find the first derivative of -2a*3j2 + a3 - 2a2 + 10aj4 - 76789a + 15943j - 5 wrt j. -4a*3j + 40aj*3 + 15943 Find the third derivative of -278347h*3y*3z + 3h3y + 20h2y*2z - hy3 + 57yz - 869z wrt h. -1670082y3z + 18y Find the first derivative of -3b*3g - 2265480b3 - 3123877bg + 2g wrt g. -3b3 - 3123877b + 2 What is the first derivative of -16h3z - 1763855hz - 1543530z - 28 wrt h? -48h*2z - 1763855z What is the derivative of 17316863r*3 + 58382763? 51950589r*2 What is the second derivative of -834545l5 - l3r + 2lr - 107l + 9r + 108 wrt l? -16690900l*3 - 6lr What is the first derivative of 2592ox3 + 1150434o + 1685x3 wrt x? 7776ox2 + 5055x*2 Find the third derivative of -656f*2k*5 - 6185f*2k*3 + 3f*2k*2 - 528336f*2k - f*2 wrt k. -39360f*2k*2 - 37110f*2 What is the first derivative of -6529485d4 - d2 + d - 16550756? -26117940d3 - 2d + 1 What is the second derivative of 6996591c5 - 7c*4 + 113128674c? 139931820c3 - 84c*2 What is the third derivative of 2a*4s + 10a3s + 430438a3 + 2a*2s + as - 76967s wrt a? 48as + 60s + 2582628 Find the second derivative of -59829088s*2 + 6812108s wrt s. -119658176 What is the second derivative of -4w4z*3 - 5608351w*4 + 388828606wz3 wrt w? -48w*2z*3 - 67300212w*2 What is the second derivative of -2j*4 + 49875j*3 + 18j*2 - 540j + 2863 wrt j? -24j2 + 299250j + 36 Find the first derivative of -57957841r3 - 84406467. -173873523r*2 What is the derivative of -47880356d - 13359655? -47880356 Find the first derivative of 24414578n3 + 9657332 wrt n. 73243734n*2 What is the second derivative of 4f*2z*2 - 2f*2z + 1091798f2 - 15fz2 + 15f - 200z wrt f? 8z*2 - 4z + 2183596 What is the third derivative of 1069r4 - 737r*3 + 11235340r*2? 25656r - 4422 Find the third derivative of -15170871z5 + 36208z*2 + 128 wrt z. -910252260z*2 What is the second derivative of 4r*4 - 9908919r*3 + 688713733r? 48r2 - 59453514r What is the first derivative of 2746082p - 12853041? 2746082 Find the second derivative of -3135240l*5 + 9916l + 17. -62704800l3 Differentiate -5553il3o - 569ilo2 + 2l*3o - 60735978l2o*2 wrt i. -5553l*3o - 569lo*2 What is the second derivative of 232am2 - 550559am + 114m*5 + 28m*2 - 7m wrt m? 464a + 2280m*3 + 56 What is the third derivative of 296744v*4 - 32v*3 + 60394686v*2? 7121856v - 192 Differentiate 2301339q - 2770238 wrt q. 2301339 What is the derivative of -45318875u*2 + 47695290 wrt u? -90637750u Find the second derivative of -34796848w2 + 33533106w. -69593696 What is the derivative of k*3 - 6k*2 + 178090k + 22341072 wrt k? 3k2 - 12k + 178090 What is the second derivative of -18w4 - 311128w*2 - 4156742w? -216w*2 - 622256 Fi	{ "pile_set_name": "DM Mathematics" }
ve 130t - 28 = 2b + 125t, 376 = -96b - 2t for b. -4 Solve -57f + 55f - 63 = -5t, -3t = 5f - 13 for f. -4 Solve 0 = 2i + r + 10, 5i - 3r - 961 = -997 for i. -6 Solve -62m - 340 + 87 = -x, 3 = -x - 2m for x. 5 Solve 4 = -2r + 3r - 2z, -2z = 5r + 16 for r. -2 Solve 0 = 3s - 3, -5v - 92 = s - 113 for v. 4 Solve 3p + 104 = 2j + 99, 2j = 2p + 6 for j. 4 Solve -2t - 2z = 16 + 6, 27t = 4z - 80 for t. -4 Solve 0 = o - h + 10, 0 = 5o + 626h - 622h - 31 for o. -1 Solve 0 = -2l + 3p - 6, -185p = -4l - 187p - 28 for l. -6 Solve -34 + 43 = 3a - s, -4 = -4a + 4s for a. 4 Solve 5k + 12 = -4i - 29, 9 = -5k + 4k - i for k. -5 Solve 4i + 157 = -2w + 141, 5w - 5i - 20 = 0 for w. 0 Solve -2s = 4v - 6, -3v + 344s - 345s = -2 for v. -1 Solve 2k + 3f = 36, 894k - 891k + 60 = 5f for k. 0 Solve -s - 4 = -2y, 4s - 10 = -3y + 7 for y. 3 Solve 38y + 4t - 16 = 43y, 4t = 9y + 16 for y. 0 Solve -z = -5y + 19, -901y = -897y - 5z - 11 for y. 4 Solve 3f + 76 = 70, -4k + 4f + 17 = -7k for k. -3 Solve 142f - 147f - 30 = 0, -4b - 4f = 24 for b. 0 Solve -35 = 4a - 138l + 133l, -3a + 2l - 21 = 0 for a. -5 Solve 66h - 67h = -3, 0 = 2n + 3h + 3 for n. -6 Solve 4q - 21 = 3l, 3l - 36q = -3q - 282 for l. 5 Solve 50o + 17 = 3y + 45o, y = -3o + 1 for y. 4 Solve -3k = -3v, 61 = -4k + 5v + 57 for k. 4 Solve 80k - 82k - c + 59 = 0, -k = 2c - 31 for k. 29 Solve -4f + 2f = -2, 8m + 9m + 4f = 21m for m. 1 Solve -4n = -4a + 4, 2n - 2a = 3a - 14 for n. 3 Solve o + 169 - 139 = 5r, -108 = -16o - 4r for o. 5 Solve -15a - 19a = -s - 105, 4s + 18 = 2a for a. 3 Solve 5v + 6h = 10h, v - 9h + 41 = 0 for v. 4 Solve 2d - 9t - 95581 + 95611 = 0, t + 28 = -5d for d. -6 Solve -t - 5 = -3a - 4, 38 = -4t - 5a for t. -7 Solve -7 = -3y - 2o, 35431 = -2y + 4o + 35409 for y. -1 Solve 3y = 3j, -898j = -894j - 16 for y. 4 Solve -9j - 34 = -3z - 4j, 25z - 2z - 4j - 89 = 0 for z. 3 Solve -239j + d = -241j - 27, 5j + 2d = -66 for j. -12 Solve -5 = n + 3f, 3n + f - 145 = -136 for n. 4 Solve -18 = 2b + 2n, -5b - 9 = 37188n - 37192n for b. -5 Solve -q + r - 3 = 0, -232q + 237q + 3r - 17 = 0 for q. 1 Solve 0 = -2h - s + 28, 5s - 4 - 15 - 81 = 0 for h. 4 Solve 3l + 910 = -3w + 931, -5l + 20 = 2w for l. 2 Solve -3h = -24x + 25x - 17, 9x = 2h - 50 for h. 7 Solve -r - 2096 = 2c - 2100, -5r + 5c - 25 = 0 for r. -2 Solve -16 = 4s + 4v, 5v - 117 + 130 = 2s for s. -1 Solve 3102z + 6 = 3100z - 2l, 3z - 39 = 3l for z. 5 Solve 98f + s + 68 = 74f, 4f + 28 = 4s for f. -3 Solve -8n + 4n + 20 = 0, -440x - 89 = -441x - 18n for x. -1 Solve v + 299 - 320 = 5z, 5v = 3z + 17 for z. -4 Solve -6r = -2r + 12, -24 = -4j + 4r for j. 3 Solve 3x - 6h - 12 = 0, -663x + 667x + 2h = -34 for x. -6 Solve -34 = -2b + 3l, -9l + 4l = -4b + 64 for b. 11 Solve 1226u - 5 = 1225u - 3r, -2 = -4u + 6r for u. 2 Solve 2a = 4i + 30, 117i - 21 = -3a + 119i for a. 3 Solve -4a = 3c - 5, 2a - 384c = -390c - 2 for a. 2 Solve 1108 = 3a + 2y + 1110, 2a + 5y + 5 = 0 for a. 0 Solve -2i = -5a + 1, -5a - 96i = -94i + 11 for a. -1 Solve -97a + 91a = b - 7, -5b = -a + 27 for b. -5 Solve 3y - o = -5, 3y - 273o = -2y - 263o for y. -2 Solve -51x + 47x + 4q + 33 = 1, 25 = -5q for x. 3 Solve -y + 15 = 3u + 44, -34 = 4u - y for u. -9 Solve 30 - 20 = -5b - j, b + 2 = 4j for b. -2 Solve a - 4t + 29 - 46 = 0, -a + 22 = -5t for a. -3 Solve -12c + 17c = -28x + 30x - 88, -x - 1 = 0 for c. -18 Solve 0 = 4u - 2o + 16, -4u - 3o - 97 = -101 for u. -2 Solve 0 = 3n + 5x + 15, 15 = 46n - 49n + x for n. -5 Solve n = -r - 7, -n - 4r = 743 - 721 for n. -2 Solve -2024y + 2c - 14 = -2022y, 5c - 25 = 0 for y. -2 Solve 4r = 12, -15r + 12 = -6k + 10r + 13r - 36r for k. -1 Solve 8j + 77 = -r, 3j = -4r - 122 + 104 for j. -10 Solve i - 2n = 9, 4i + 15n - 12 = 11n for i. 5 Solve -j = 1830z - 1828z + 7, 2j - 9z - 51 = 0 for j. 3 Solve -68w - 6 = 2i - 71w, -3i = 23w - 101 for i. 3 Solve u - 21 = 5o, -3u + 903 - 890 = -5o for o. -5 Solve 5n = -l - 14, -5n - 703 + 713 = 5l for l. 6 Solve -2n + 3u - 5 = 0, 26n - 22n - 5u = -9 for n. -1 Solve p + 8 = 4a, p = 140a + p - 4p - 652 for a. 5 Solve 0 = -6n + 7j - 9, 36j - 17 = n + 40j for n. -5 Solve -38 = -140a + 133a + j, -3j - 9 = 0 for a. 5 Solve g + 11 = -2m, 183g + 16 = -2m + 181g for m. -3 Solve 6x - 138 = m, 4m + 114x - 111x = 69 for m. 0 Solve -13z + 0b = -9z - b + 5b, -z = -3b for z. 0 Solve -x - 3v + 13 = 0, 34v - 38v = -16x - 52 for x. -2 Solve -15t - 5y = -19t - 29, 0 = -t - 4y + 40 for t. 4 Solve -3m + 86 - 94 = -5h, 4m - 25 - 11 = -5h for m. 4 Solve -49c + 52c - 6r - 21 = 0, 4c + 5r = 93 for c. 17 Solve -4z + 3y - 24 + 33 = 0, -y = 3 for z. 0 Solve 6c + 3g = 31559 - 31604, 0 = 3c - 4g + 39 for c. -9 Solve -21w = -25w - 5d + 11, -5d = -5w - 20 for w. -1 Solve 95 - 107 = -c + h, 2c - 5h - 33 = 0 for c. 9 Solve 3d = -2m - 62 + 72, 5d - 20 = -4m for d. 0 Solve -2f + 9 = -5m, -5f + 29m - 33m = -39 for f. 7 Solve -3m + 0m + 7 = -g, -4g = 3m - 17 for m. 3 Solve -5z - 3g - 4 = 0, 218z - 214z = -5g + 15 for z. -5 Solve -321d - 3b - 20 = -326d, 0 = 2d - 2b - 12 for d. 1 Solve 0 = 2t + 8110d - 8107d - 12, -4t = -4d + 16 for t. 0 Solve -2q - 4 = 2y, -5q + 36y - 10 = 38y for q. -2 Solve -128p + 131p = -2o + 33, -22o + 447 = 5p for o. 21 Solve -14 = -2s + 2q, -4s - 4q = -7q - 25 for s. 4 Solve -3s + 0s + 3v = 12, 2v + 24 = 15s + 136 for s. -8 Solve 2c - 16 = -14f, -3c = f + 144 - 68 for c. -27 Solve -15l - 57 = -19l - g, -3g - 25 = -2l for l. 14 Solve 5p - 4 = -1340a + 1338a, 0 = 205a - 3p - 410 for a. 2 Solve 5k = m - 2670 + 2632, 0 = -5k + 4m - 47 for k. -7 Solve 5a - 4y + y = 0, 12a - 11a = 13y for a. 0 Solve 0 = -2r - g + 38, -25g - 26 = -4r - 4 for r. 18 Solve 4s + p + 10 = 2, -4s - 4p = 20 for s. -1 Solve -3g + 16 = y, 4g - 38y = -35y + 43 for g. 7 Solve 2j + 6 = -6m, -5m - 5j - 129 + 64 = 0 for m. 5 Solve 12x + 3q = 53 + 43, -3x + 17 = -q for x. 7 Solve 126 = -l - j + 120, -3j + 6 = -5l for l. -3 Solve -60 = 12h - 4h - 5h, 0 = -2x - 4h - 70 for x. 5 Solve 12h + r + 27 - 3 = 0, 2h - 5r + 314 = 310 for h. -2 Solve 7o - 102a + 5 = -105a, 5a = -4o - 16 for o. 1 Solve -40 = 7a - 54, 2c + 4 = a for c. -1 Solve -x + 2g = 0, -g + 5737 = -x + 5739 for x. 4 Solve 16 = 3a + n, 16 = 2a - 2765n + 2767n for a. 4 Solve 3c + 5 = l + 13, 0 = -5c + 15 for l. 1 Solve 2 = 54576t - 54578t + 2x, -2t + x = 0 for t. 1 Solve 5x + 57k - 1 = 56k, 9k = 2x - 38 for x. 1 Solve 2u = -3t + 5368 - 5408, -t - 15 = -u for u. 1 Solve -4m - k = -39, 5k + 30 = -99m + 104m for m. 9 Solve 71t + 33 = 68t - 3y, -3t - 19 = 2y for t. 3 Solve 3w + 105i = 102i, -w + 2i + 9 = 0 for w. 3 Solve -2144o = -2152o + 4y - 236, 3o + 92 = 5y for o. -29 Solve 0 = -5r - y + 37, 3r - 3730 = -y - 3703 for r. 5 Solve -4m + p + 2p + 23 = -11m, 3p = -9 for m. -2 Solve 5d = -4f + 27, -31d - 12 = -31d + 6f for d. 7 Solve 0 = 3f + 3x - 6, -8f + 2f - 2x = -16 for f. 3 Solve 61 = r + 13f, -4r = -r + f - 5f + 32 for r. -4 Solve 0 = 2a + 10, -136z + 141z + 65a - 45 = -355 for z. 3 Solve o + 24 = 94v - 90v, 5o + 30 = 2v for v. 5 Solve 2o - 382 = 10s - 330, 0s = -s - 5o + 52 for s. -3 Solve -2y + 50 = -2d, 3609y - 5d = 3612y - 35 for y. 20 Solve -2t - 5h + 53 = 112, -3t + 4h = -61 for t. 3 Solve -1267h + 1246h - n - 101 = 0, 3h + 31 = 4n for h. -5 Solve 0 = -m - 2a + 28, -88m = -83m + 2a - 20 for m. -2 Solve 13c - 54 = 22c, -a - 2c - 12 = 0 for a. 0 Solve g - 6 = -5u, -1703g + 1702g = 2u for u. 2 Solve -36 = -5q - 2r, 30q + 4r = 32q + 24 for q. 4 Solve 3s = n + 6, 5n - 6 - 4 = -5s for n. 0 Solve d + 46 - 11 = -5j, -j - 7 = -3d for j. -7 Solve -12d + 11d - 2p = 1, 9d + 5p = 17 for d. 3 Solve n = -320u + 318u + 1, -2n - 4 = -2u for n. -1 Solve 914g + 3w + 45 = 909g, 0 = -3w - 45 for g. 0 Solve 4q = -3p - 3, -425q = p - 423q + 3 for p. 3 Solve 2m + 2l = -6, -2*m - l -	{ "pile_set_name": "DM Mathematics" }
the tens digit of a? 1 Let n(j) = -164j + 53. What is the hundreds digit of n(-23)? 8 Let t(y) = y2 + 4y + 3. Let i be t(-6). Let v(o) = o*3 - 15o2 + 6. Let c be v(i). Let w(j) = -j2 + 6j + 10. What is the units digit of w(c)? 0 Let u = -28 + 6. Let n = 12 + u. Let r(a) = -5a - 11. What is the units digit of r(n)? 9 Suppose -3u - 2u - 100 = 0. Let j be 4(1 + -2 - 5/4). What is the tens digit of (j + -1)/(4/u)? 5 What is the units digit of ((2569/14)/(-1))/(1/(-2))? 7 Suppose 20o - 3600 = 18920. What is the thousands digit of o? 1 Let g = -22 - -27. Suppose 0 = -gd - 3p + 210 + 99, 132 = 2d - 3p. What is the tens digit of d? 6 What is the hundreds digit of (424/(-16))/((-3)/54)? 4 Suppose -2r + 0r + 42 = 0. Suppose 4c - r = 15. What is the units digit of c? 9 Suppose v = j + 38, -v + 5j + 43 = -3. Let n be (44/6)/(12/v). What is the tens digit of 1-31n/(-11)? 6 Suppose 5l = -2q + 1017, q = -7l + 10l + 525. What is the hundreds digit of q? 5 Let l(o) = 18o2 + o - 23. What is the hundreds digit of l(-11)? 1 Let v = -23 - -44. Let z = v + -11. What is the units digit of z? 0 Suppose -15v + 3l = -16v + 688, -2056 = -3v - 5l. What is the tens digit of v? 8 Suppose 5p = w + 4594 + 828, p - 2w = 1079. What is the units digit of p? 5 Let w(r) = -r*3 - 17r*2 - 21r + 19. Let y be (-100)/6 + 32/48. What is the tens digit of w(y)? 9 Let n(g) = g*3 + 26g*2 + 8g + 58. What is the hundreds digit of n(-25)? 4 Let b be 36/(-10) - (-18)/(-45). Let v be (3 + b)/(3/(-27)). Suppose -2r + v = r. What is the units digit of r? 3 Let i(h) = 94h. Let n be i(2). Suppose 5t + n = 63. What is the units digit of 6/10 + (-660)/t? 7 Let w be 4 + -3 + 1 + 1. Suppose 4l - 220 = 3l + 2h, -5h = -wl + 658. What is the units digit of l? 6 Suppose -5s = -2s - 12. Let x be (4 + -12)2/s. What is the units digit of -3 - x - (-4 - 25)? 0 Let w(o) = o - 23. Let a be w(11). Let v(u) = -3u + 10. What is the units digit of v(a)? 6 Let w be 3032/4 - (0 - -2). Suppose 8l = 2l + w. What is the hundreds digit of l? 1 Let x = -101 - -144. Suppose 0 = 2r - 79 - x. What is the tens digit of r? 6 Let s(f) be the first derivative of 45f*2/2 + 10. What is the units digit of s(1)? 5 Let v(x) = x + 4. Let w be (-2 - 0)/(3/(-6)). Suppose 18 = -h + wh. What is the units digit of v(h)? 0 Suppose m + 138 = 3m. Let c = m + -20. Suppose -2b - 9 = -c. What is the tens digit of b? 2 Let f be -2 - (3 + -3)/(-1). What is the tens digit of f/11 + (-1722)/(-33)? 5 Suppose -198 + 62 = -4t. Suppose -t = -3w + 5p, 0w + 3p = -4w + 55. Let g = 27 - w. What is the tens digit of g? 1 Let p be (-6)/((4/6)/(-1)). Suppose 11o = po + 222. What is the units digit of o? 1 Let w(b) = 2186b2 + 8b + 8. What is the units digit of w(-1)? 6 Let d be 58/(-4)7/7-30. Suppose -4q = -0q + 2f - 348, 0 = 5q - f - d. What is the tens digit of q? 8 What is the hundreds digit of -1(-5 + -341 + -5)? 3 Suppose -5p - 2v = -6p + 2092, 5p - 10404 = -4v. What is the thousands digit of p? 2 Let c(h) = 13 - 3 + 3h + 10 - 5. What is the units digit of c(13)? 4 Let c be -1(0 + (9 - 1)). What is the tens digit of 12/c1-22? 3 Let s(t) = 37t + 25. Let i be s(-11). What is the hundreds digit of (i/6)/((-7)/21)? 1 Let p be -6(0 + (-6)/9). Suppose py = 3 + 1, -392 = -4c - 4y. What is the tens digit of c? 9 Suppose 3 = m + 2v, -2m + 2 = 2v + 6. Let q(c) = 2c2 + 2c + 44. What is the hundreds digit of q(m)? 1 Let b(r) = 18r2 - 140r - 16. What is the thousands digit of b(14)? 1 Let r = 53 + 3. Suppose -100 = 5b + 2d, 3b + d + d + r = 0. Let o = -9 - b. What is the units digit of o? 3 Let s = 530 - 794. What is the tens digit of ((-3)/(-2))/((-9)/s)? 4 Suppose -161s + 171s = 17350. What is the hundreds digit of s? 7 Let b = 154 + 352. What is the units digit of b? 6 Suppose -60175 = 57y - 239725. What is the tens digit of y? 5 Suppose 0 = -2l + 7l. Let q(a) be the second derivative of -a*4/12 + 10a*2 - 7a. What is the units digit of q(l)? 0 Let i(c) = c*3 + 5c*2 - 8c - 8. Let m be i(-6). Let q = m + -4. Let y(p) = -p + 63. What is the units digit of y(q)? 3 Let n(j) = 8j2 + 2j - 1. Let b be (9/(-12))/(2/(-8)). Let z be n(b). Let x = 109 - z. What is the units digit of x? 2 Let q(r) = r*3 - 19r*2 - 26r + 28. Let y be q(21). Suppose 0 = 7f - 14f + y. What is the units digit of f? 2 Let y be (-4 - -2) + -2 + 36. Let q = 14 - 5. Suppose 7u + y = qu. What is the units digit of u? 6 Let f(n) = -n*2 + n + 4. Let y be f(0). Let g be 8/((-21)/6 + y). Let u = 45 - g. What is the tens digit of u? 2 Let a be 545(12/(-5) + 3). Let x be 2/(-10) - a/15. Let c = 37 + x. What is the tens digit of c? 1 Let m(t) = 102t2 + 3t - 18. What is the thousands digit of m(-4)? 1 Let x(y) = 34y2 + 2y - 1. Let p be (-1 + 17)1/(-2). Let m = 9 + p. What is the tens digit of x(m)? 3 What is the hundreds digit of (-8)/(-80) + (-10738)/(-20)? 5 Let l be ((-12)/(-16))/((-2)/(-32)). Suppose 8 = 2o - 2g, 0 = 4o - 3o + 4g + 1. Suppose -l = -x - ox. What is the units digit of x? 3 Let h = -70 + 292. What is the tens digit of h? 2 Suppose -2u - 8 = d, -7d = 4u - 3d + 16. What is the hundreds digit of 153 + 44/336/u? 1 Suppose 3p + h - 5281 = 0, -3p + h + 4473 = -800. What is the thousands digit of p? 1 Suppose l - 1 = 2l. What is the units digit of 88/(-5)l - 16/(-40)? 8 Let r = -129 + 57. Let s = 1 - r. What is the units digit of s? 3 Suppose -c = -2j - 6c + 31, 4c - 20 = 0. Suppose 4n = jy - 520, -3y - 268 = -3n - 790. What is the hundreds digit of y? 1 What is the tens digit of 4-1934(-8)/64? 6 Suppose -n - 5 = 12. Let t = n + 6. Let o = 37 + t. What is the tens digit of o? 2 Let c be (3 + 0 + -1)(0 + 3). What is the units digit of (-3)/c - (-990)/12? 2 Let j(x) = x*3 - 2x*2 - x + 118. Let v be j(0). Let h = 203 - v. What is the units digit of h? 5 Suppose 14q = -1441 + 8665. What is the hundreds digit of q? 5 Let n be (3/(-2))/((-3)/1818). Suppose 3m - n = -6m. What is the units digit of m? 1 Let y = -20 + 25. Suppose 0 = ym + m - 24. What is the units digit of (-9)/(-6) + 294/m? 5 Suppose -4b = -5x + 253 + 568, -2x + 4b + 326 = 0. What is the tens digit of x? 6 Suppose 182 = 5w + 2c, -4w + c + 31 + 125 = 0. Suppose a - 6 = w. What is the tens digit of a? 4 What is the units digit of 24/(-16) + 125/2? 1 Let t = -7 + 10. Suppose -144 = -2b - 2d - 2d, tb + 3d = 207. Suppose 2v - 40 - b = -5r, 0 = r - 5v - 5. What is the units digit of r? 0 Suppose 13 + 59 = 4s. Let l be -2 + s/(-1)1. Let n = l + 38. What is the units digit of n? 8 Let v = -890 + 1467. What is the hundreds digit of v? 5 Suppose -5h + 8 = 2f - 4f, -3h - 3f = -9. Let y(l) = 11l - 2. Let n be y(h). Suppose 5i - 60 = n. What is the tens digit of i? 1 What is the units digit of 900 + 4(-21)/28? 7 Suppose -4y - 3f = 1, 0 = 4y + 3f + 2f + 7. Suppose 9 = -yn - 13. Let z = n + 28. What is the tens digit of z? 1 Suppose 5t + 3n = 10t - 718, -t = -n - 144. What is the tens digit of t? 4 Let k(b) = 13b*2 + 9b - 104. What is the hundreds digit of k(-13)? 9 Let g be 6/12(30 + 0). What is the units digit of (430/(-25))/((-6)/g)? 3 Suppose 2d - 3d + 1 = 0. What is the units digit of 3/(-3) + d + -2 + 130? 8 Suppose 0 = -10w - 5w. Suppose -4c = -2r - wr + 68, 0 = r + 5c - 13. What is the units digit of r? 8 Suppose -4b + 3142 = 5w - 3w, 3148 = 4b - 4w. What is the tens digit of b? 8 Let l = -623 - -845. What is the units digit of l? 2 Let k(c) = -c*3 + 4c*2 + c - 5. Let m be k(2). Suppose r + ms - 321 = -r, 5r + 2s = 855. What is the hundreds digit of r? 1 Suppose -6 = -4h - 2. Let g(z) be the first derivative of z4 + 3. What is the units digit of g(h)? 4 What is the hundreds digit of (52/5)/((-4990)/625 - -8)? 6 Suppose -o + 3 = 1. Suppose 5m + 51 = ot, 6t - 2t + m = 91. What is the units digit of t? 3 Let z(h) = h - 7. Let j be z(9). Suppose -2 = ji - i. Let p = 8 - i. What is the tens digit of p? 1 Let z(h) = -2h3 + 4h*2 - 9h + 6. Let b(i) = i3 - i2 + i - 1. Let k(n) = -b(n) - z(n). What is the tens digit of k(4)? 4 Suppose -2s + 3 + 5 = 0. Suppose b - 40 = -3w, 4b = sw - 102 + 38. What	{ "pile_set_name": "DM Mathematics" }
: 1, k: 1, r: 2}. What is prob of sequence yuk? 1/210 Three letters picked without replacement from aknggngnaaa. Give prob of sequence ang. 2/55 Calculate prob of sequence hvvh when four letters picked without replacement from hvvhhhvvhhhvvhhhhh. 11/204 Two letters picked without replacement from uugguuuuggu. What is prob of sequence gu? 14/55 Calculate prob of sequence up when two letters picked without replacement from {p: 1, u: 1, d: 1}. 1/6 Four letters picked without replacement from csjjuiijsi. Give prob of sequence ucss. 1/2520 Four letters picked without replacement from eees. Give prob of sequence seee. 1/4 Four letters picked without replacement from zzzzszsz. What is prob of sequence sszz? 1/28 Calculate prob of sequence gl when two letters picked without replacement from lllggg. 3/10 Three letters picked without replacement from uovsvll. What is prob of sequence llo? 1/105 What is prob of sequence oc when two letters picked without replacement from {z: 2, o: 11, c: 1}? 11/182 Three letters picked without replacement from cjcjjcttcttccjc. What is prob of sequence ttc? 2/65 Two letters picked without replacement from qnnqnqqnnneeqqnqcq. Give prob of sequence nn. 7/51 Calculate prob of sequence od when two letters picked without replacement from odddodou. 3/14 Three letters picked without replacement from llxyyxyxxxeyliy. What is prob of sequence iye? 1/546 Calculate prob of sequence zzuz when four letters picked without replacement from {z: 3, u: 4}. 1/35 Two letters picked without replacement from qxqqqqqqxqq. What is prob of sequence xx? 1/55 Three letters picked without replacement from rrrprttrtrtttttrrrtt. What is prob of sequence ttr? 9/76 What is prob of sequence rg when two letters picked without replacement from rmgrrmrgrrpprrm? 8/105 Three letters picked without replacement from {m: 7, a: 3, p: 3, v: 1}. What is prob of sequence mpa? 3/104 Two letters picked without replacement from wewuwirwuuwwwi. What is prob of sequence wu? 3/26 Four letters picked without replacement from ejivsijejsepeje. What is prob of sequence esji? 2/819 Two letters picked without replacement from {e: 5, f: 8}. What is prob of sequence ef? 10/39 Four letters picked without replacement from ooooooooo. Give prob of sequence oooo. 1 Three letters picked without replacement from kkyvwyvn. What is prob of sequence wyk? 1/84 Two letters picked without replacement from {y: 1, z: 1, f: 1, d: 1, o: 2, h: 1}. Give prob of sequence yo. 1/21 Three letters picked without replacement from eeeeeeddeeeeeeed. Give prob of sequence ddd. 1/560 Four letters picked without replacement from argyagaanyrygiryriyy. Give prob of sequence gyrg. 2/1615 What is prob of sequence xxhx when four letters picked without replacement from {h: 12, x: 6}? 1/51 What is prob of sequence bq when two letters picked without replacement from itqqibqqiqiibqqqt? 1/17 Four letters picked without replacement from ogooghoghoggh. Give prob of sequence ggoo. 10/429 What is prob of sequence hww when three letters picked without replacement from {h: 1, d: 3, w: 4, z: 2}? 1/60 Calculate prob of sequence bt when two letters picked without replacement from {j: 5, d: 1, t: 6, a: 2, b: 1}. 1/35 Four letters picked without replacement from wwixxivxiwxxpiiwwv. Give prob of sequence xxip. 5/3672 Two letters picked without replacement from puuubrr. What is prob of sequence uu? 1/7 What is prob of sequence cycc when four letters picked without replacement from yycyyccyysycss? 1/143 Four letters picked without replacement from cczzcz. What is prob of sequence zzcc? 1/10 What is prob of sequence ee when two letters picked without replacement from {c: 2, e: 2, p: 1, q: 9}? 1/91 Two letters picked without replacement from {l: 2, m: 2, f: 1, d: 2, r: 1}. What is prob of sequence lf? 1/28 Calculate prob of sequence xxx when three letters picked without replacement from {x: 9}. 1 Three letters picked without replacement from bdkekaeaebamk. Give prob of sequence eab. 3/286 Three letters picked without replacement from qnnqnq. Give prob of sequence nnn. 1/20 Two letters picked without replacement from gzogg. Give prob of sequence oo. 0 Four letters picked without replacement from qxqxxqxxlxnlnnly. What is prob of sequence xlqn? 27/7280 Three letters picked without replacement from {z: 2, m: 2, q: 1, p: 1}. Give prob of sequence pmm. 1/60 What is prob of sequence hmc when three letters picked without replacement from hcfmccccchm? 4/165 What is prob of sequence fpf when three letters picked without replacement from {f: 4, p: 3}? 6/35 Three letters picked without replacement from {k: 1, o: 1, v: 1, m: 2}. Give prob of sequence vkm. 1/30 What is prob of sequence obbb when four letters picked without replacement from bbbbbblbbbibbeboieqb? 143/9690 Three letters picked without replacement from fffxffxffs. Give prob of sequence ffs. 7/120 Three letters picked without replacement from {q: 3, n: 1, j: 1, o: 6, t: 3, s: 1}. Give prob of sequence nto. 3/455 Two letters picked without replacement from {x: 9}. Give prob of sequence xx. 1 What is prob of sequence bkk when three letters picked without replacement from bbbbknkknkbbnbbn? 1/35 Two letters picked without replacement from {v: 5, r: 7}. Give prob of sequence rv. 35/132 What is prob of sequence acm when three letters picked without replacement from cjrmrac? 1/105 Three letters picked without replacement from yyj. Give prob of sequence yyj. 1/3 Three letters picked without replacement from {o: 3, v: 1, l: 1, t: 2}. What is prob of sequence oto? 2/35 What is prob of sequence bgb when three letters picked without replacement from {b: 2, g: 2}? 1/6 What is prob of sequence yhjf when four letters picked without replacement from {f: 11, y: 1, h: 1, j: 4}? 11/14280 Three letters picked without replacement from {y: 3, r: 2, k: 4}. Give prob of sequence yyy. 1/84 Calculate prob of sequence ses when three letters picked without replacement from {s: 7, e: 1, j: 12}. 7/1140 Four letters picked without replacement from rpfflfllflvlprplfvlp. Give prob of sequence fppf. 2/969 Two letters picked without replacement from {w: 14, x: 1}. What is prob of sequence wx? 1/15 Two letters picked without replacement from zctzczztcz. Give prob of sequence ct. 1/15 Two letters picked without replacement from pupuupuupupppuuu. Give prob of sequence up. 21/80 Four letters picked without replacement from {l: 2, v: 2, m: 1, h: 2, t: 2, q: 5}. What is prob of sequence qmvq? 5/3003 Calculate prob of sequence nrrr when four letters picked without replacement from {f: 1, r: 4, n: 2, m: 4}. 1/165 What is prob of sequence rv when two letters picked without replacement from {t: 1, p: 3, v: 3, w: 3, r: 1}? 3/110 Three letters picked without replacement from {d: 5, u: 1, b: 1, r: 3}. What is prob of sequence dbr? 1/48 Calculate prob of sequence cyyy when four letters picked without replacement from gggcgcyyyyyyycyc. 2/65 What is prob of sequence ch when two letters picked without replacement from hrucz? 1/20 Calculate prob of sequence cxcp when four letters picked without replacement from {b: 6, c: 2, z: 4, p: 2, x: 1}. 1/8190 Two letters picked without replacement from {h: 4, o: 1, e: 1, v: 2}. What is prob of sequence eo? 1/56 Two letters picked without replacement from qhhhhhqhqhhqqyqhqhqq. Give prob of sequence hq. 9/38 Calculate prob of sequence oomb when four letters picked without replacement from {o: 3, b: 2, m: 4}. 1/63 What is prob of sequence pi when two letters picked without replacement from plpiihpipphhp? 3/26 Two letters picked without replacement from {k: 3, y: 8}. What is prob of sequence ky? 12/55 What is prob of sequence bf when two letters picked without replacement from {b: 3, f: 2, h: 3}? 3/28 Three letters picked without replacement from agggaggggg. Give prob of sequence aag. 1/45 Four letters picked without replacement from yxyxxoymyxy. What is prob of sequence xooy? 0 What is prob of sequence spap when four letters picked without replacement from apppspsspjsjp? 1/143 What is prob of sequence cbz when three letters picked without replacement from {z: 1, c: 2, v: 1, b: 1}? 1/30 Two letters picked without replacement from hhlele. Give prob of sequence el. 2/15 Two letters picked without r	{ "pile_set_name": "DM Mathematics" }
831p3 + 3530p*2 + 31 wrt p. 700986 Differentiate 7hp - 827hz2 + 2hz - 13h + 56323pz*2 - 5z*2 wrt h. 7p - 827z2 + 2z - 13 Differentiate i*3n - 100i3 + i2n - 135005n with respect to i. 3i*2n - 300i2 + 2in What is the second derivative of 40887y*2 + 77242y wrt y? 81774 Find the third derivative of 255969o4 + 4o*2 - 1704o - 3. 6143256o Find the second derivative of 9421s*2 - 20466s wrt s. 18842 Differentiate -1897975w - 6711366. -1897975 Differentiate 438576i*3 + 523397 wrt i. 1315728i*2 What is the second derivative of il*2r*2 + 3il + 2ir2 - 3ir + 603l*2r + l2 - r2 + 10r wrt l? 2ir2 + 1206r + 2 What is the second derivative of 1099f4m*2 - 9f*3m*3 + 2fm2 + 1656m*3 wrt f? 13188f*2m*2 - 54fm3 Find the third derivative of -x4 + 1715x*3 + 2129x*2 + 24x. -24x + 10290 Find the third derivative of -273i*3r*3 - 714i*3r + 53i2r*3 - 14i*2r*2 - i - 23 wrt i. -1638r*3 - 4284r Differentiate 157890d2 - 371590. 315780d What is the first derivative of 836587t4 - 483547 wrt t? 3346348t*3 Find the second derivative of -1004384i*2t - 1304it - 2i - 5 wrt i. -2008768t Differentiate -9401x3 + 6x*2 - 235147. -28203x*2 + 12x Find the third derivative of -1381083d5k3 - d2k3 - 295d*2k + 1192k wrt d. -82864980d*2k*3 Find the third derivative of -6v*4 - 25440v3 + v2 - 73849v + 1 wrt v. -144v - 152640 Find the first derivative of -32u3 - 177u*2 + 94756 wrt u. -96u*2 - 354u Find the third derivative of 2d2wy2 - 1651d*2y*3 + 69d*2y - 2wy*4 + wy*3 + wy*2 + 2wy wrt y. -9906d*2 - 48wy + 6w What is the derivative of 2s2v - 5782s2 - sv + 26s + 1747232v wrt v? 2s2 - s + 1747232 What is the second derivative of -261l*3 - 5l*2 - 254l - 99? -1566l - 10 What is the second derivative of 15968o*2u3 + o2u2 - 536ou2 + 27ou + 2u*3 + 2u*2 wrt o? 31936u*3 + 2u*2 What is the second derivative of -377312f*2 - 651490f wrt f? -754624 What is the second derivative of 104762w4 + 30w - 217? 1257144w2 Differentiate -gj*2k - 2106gj*2 + 6gk - 4j*2k + j*2 + 21jk + 22 with respect to g. -j2k - 2106j2 + 6k Find the second derivative of -226652i2 - 4478i. -453304 What is the third derivative of 101q4 + 22q*3 - 187043q*2 wrt q? 2424q + 132 Find the first derivative of 88p2 - 349pt - 31548t wrt p. 176p - 349t Find the second derivative of 3c2ix - 2c*2i - 200246c2x*3 + 1280880cix*3 wrt c. 6ix - 4i - 400492x3 Find the second derivative of -259fk2 + 59188fk - 4f - 724k4 wrt k. -518f - 8688k2 Differentiate 37c*4l*2 + 29699c*2l*2 + 2415978l*2 wrt c. 148c*3l*2 + 59398cl2 Find the third derivative of 363107b*3 + 356698b*2 + b wrt b. 2178642 Find the first derivative of 15329i*4 + 9i*2 + 304609 wrt i. 61316i*3 + 18i What is the second derivative of -484442v4 - v - 40483? -5813304v*2 Find the second derivative of 512m*2u + 110m2 - 61m + 9u - 2 wrt m. 1024u + 220 Find the second derivative of aj3 + 148aj - a + 11691j*3 + 18j + 5 wrt j. 6aj + 70146j Differentiate 5155ku3 - 4ku + 2277279k + 3u with respect to u. 15465ku2 - 4k + 3 Find the third derivative of -228379f5 + 13f*2 - 13f - 72. -13702740f2 Differentiate 6d*2z - 203245d2 + dz*2 + 16171dz with respect to z. 6d*2 + 2dz + 16171d Differentiate 976231j2l - 2j2 - 100473j wrt l. 976231j2 Find the third derivative of -3835t*4 + 6t*3 + 160258t*2 wrt t. -92040t + 36 Find the second derivative of -157ab*5 + 8ab3 - 2ab - 45575b wrt b. -3140ab*3 + 48ab What is the third derivative of -3254786h*5 - 930895h*2 + 2 wrt h? -195287160h*2 Find the second derivative of -131579z*2 - 129z - 8333. -263158 What is the second derivative of u*3 - 367487u*2 + 4341u + 13 wrt u? 6u - 734974 Find the third derivative of -1050o*6 - 38o*3 - 260162o*2 + 2o wrt o. -126000o3 - 228 Find the third derivative of 34533h*3 - 18643h*2 + h wrt h. 207198 Differentiate -148879g - 53464. -148879 Find the third derivative of 46690t4 - 2t*3 - 34t*2 - 1165t. 1120560t - 12 What is the third derivative of -2j*2x*3 - 2j*2 - 17463jx2 + jx - 389899x3 + 2x wrt x? -12j2 - 2339394 What is the derivative of 2s*3w - 15104s3 - 8494w*2 wrt w? 2s*3 - 16988w Find the third derivative of -39835y3 + 2y*2 + 286142. -239010 Find the third derivative of -22378df3 - 500df2 - 4df - 5f wrt f. -134268d What is the third derivative of -248203d*6 - 10032d*2 - 3d + 1? -29784360d3 Differentiate -107500ciw - 11cw + 4c - 95w - 1 with respect to i. -107500cw What is the second derivative of -4028p5 + 4p*4 + 3p + 23183? -80560p3 + 48p*2 What is the first derivative of -131962s - 546668 wrt s? -131962 Differentiate -3011k2w - 6kw*2 - 1779w*2 + 15 wrt k. -6022kw - 6w*2 What is the third derivative of 22768gk3 + 17349g + k*2 wrt k? 136608g Differentiate -1338135j + 3155954 with respect to j. -1338135 Find the third derivative of 101950i*6y + 2i3y - 6i2y + 56i2 + iy - y wrt i. 12234000i3y + 12y Differentiate 3g*3o - 23g3 - 7go + 6g - 8295o3 - 42 wrt o. 3g*3 - 7g - 24885o2 What is the third derivative of -39787b*4o - 2b2o + 410b2 + 4b - 3o wrt b? -954888bo What is the second derivative of -3r*4 - 188r*3 + 27r*2 - 3r - 10462? -36r2 - 1128r + 54 Find the first derivative of -28088t4 - 42707. -112352t3 What is the second derivative of -q5 - 124q3 + 826q*2 - 3507394q wrt q? -20q3 - 744q + 1652 What is the second derivative of -f*3j2 + f3jt*3 - 34f*2jt - 258f*2t - 261fj*2t - 2fjt3 + 4j*2t*3 wrt j? -2f*3 - 522ft + 8t3 Find the third derivative of h6 - 730379h3l*2 + 17h*2l*2 + 103h*2 - 158 wrt h. 120h*3 - 4382274l*2 Differentiate 56jtv - 42jv + 57j - 1221tv wrt t. 56jv - 1221v Differentiate -149908o2 - 538987 with respect to o. -299816o Differentiate 7833t4v3 + t4 + 15473v3 with respect to t. 31332t*3v*3 + 4t3 What is the second derivative of l3q2 - 74l*3q + 182l2q*2 - lq*2 - 168lq - 113q*2 wrt l? 6lq2 - 444lq + 364q*2 Find the second derivative of -39fy3 + 103fy2 - 5fy + 199f + 5y2 - 5y - 1 wrt y. -234fy + 206f + 10 What is the second derivative of 27331ox4 - 4ox3 - 7ox + 20o - 2011x wrt x? 327972ox2 - 24ox Find the first derivative of -305258q*2 - 25005 wrt q. -610516q What is the second derivative of 10s2y*2 - 2s*2y - 198s2 - 227sy2 - 3sy - 6 wrt s? 20y*2 - 4y - 396 What is the second derivative of -n*3w + 13n3 - 1893n*2w + n*2 - 3nw - 152n - 19w wrt n? -6nw + 78n - 3786w + 2 Find the third derivative of 32166dt5 - 503973dt2 - 2t*5 wrt t. 1929960dt2 - 120t*2 Find the third derivative of -44318v*5 - 264422v*2 wrt v. -2659080v*2 What is the third derivative of -2g*2n*5 + 3367982g*2n*3 - 4g*2n*2 + 22g*2n + 5gn*2 - 96g wrt n? -120g2n*2 + 20207892g*2 What is the second derivative of 301314p*3 + 98p - 197? 1807884p Find the third derivative of -882a*6 + 3a*4 - 6a*3 + 49497a*2. -105840a*3 + 72a - 36 Differentiate -61a3 - 3a*2 + 3a - 24911 wrt a. -183a2 - 6a + 3 What is the first derivative of -5k4 + 14110k*3 + 209020 wrt k? -20k*3 + 42330k*2 What is the third derivative of -14u*3w*3 + 6635u*3w*2 - 23u*3 + 2u*2w*2 + 11745uw3 wrt w? -84u*3 + 70470u Find the third derivative of 2v6 + 4v*5 + 413v*4 - 19544v*2 wrt v. 240v*3 + 240v*2 + 9912v What is the third derivative of -227360o3 - 92455o2 wrt o? -1364160 What is the first derivative of x3 + 6693x2 + 2x - 19672? 3x2 + 13386x + 2 What is the second derivative of 9c2di3 - 6c*2i - 2371cdi - 541ci3 + 2di wrt i? 54c*2di - 3246ci Find the third derivative of -556610v*3 - 1346956v**2. -3339	{ "pile_set_name": "DM Mathematics" }
se 10 = -2f, 4f = -2l - 2 - 10. Suppose q + 11v - 10v = 4, 0 = -4q + 5v + 16. Solve -qm = l + 16 for m. -5 Suppose 4a - 3 = -k, 5k = -7a + 2a - 15. Let w(j) = -j - 5. Let r be w(k). Suppose 3b - 8 - 52 = r. Solve 3z - b = -z for z. 5 Let c(k) = k - 5k + 2k + k - 4. Let b be 9/((-189)/77) + (-1)/3. Let x be c(b). Solve x = i + i for i. 0 Let n(h) = -h*3 + 11h*2 + 17h - 27. Let m be n(12). Let t = 36 - m. Let w(y) = y*2 + y - 38. Let r be w(6). Solve -tj + r = -5j for j. -2 Let g(p) = -5p + 7. Let v be g(3). Let f = v - -14. Solve -y + f - 3 = 0 for y. 3 Let t(a) = -a*3 + 21a*2 + 47a - 18. Let g be t(23). Suppose -gp + 4i = -0p - 43, p - 15 = 4i. Solve 7c - 14 - p = 0 for c. 3 Let l = 2780 - 2767. Solve 4y + l = 33 for y. 5 Suppose 0 = 48w + 678 - 1446. Solve 9x - 25 = -wx for x. 1 Let o(f) = f3 - 55f*2 + 518f - 78. Let l be o(43). Solve 17 - 25 = -lr for r. 1 Let r(c) = -c2 + 5c - 4. Suppose 4t - 3 - 9 = 0. Suppose y + 8 = ty. Let d be r(y). Solve d = -2n - n - 9 for n. -3 Let h be (-3 + 13)/((-21)/(-6) - 3). Solve hw - 132 = -32 for w. 5 Let t = -96 - -87. Let b be (-3 + -2 - t)(-5)/(-4). Solve 0 = -by + y - 20 for y. -5 Let u be 102/96/(-2). Let a be 10/(-40) + u/(-8). Suppose 3 = -2q - z - 2z, -5z - 13 = 2q. Solve -q = af - 22 for f. 4 Suppose -m + 37 = -5g - 32, -3g = 4m - 345. Suppose -9 = c + 2c, -3s + m = c. Solve -s + 29 = -q for q. 0 Let b(l) be the second derivative of l4/12 + 7l*3/3 - 16l*2 + 10l. Let p be b(-16). Let z be (p(-3)/15)/(1/(-1)). Solve -k - k = z for k. 0 Let l be (23/(-6))/((-1)/(-3)). Let s be (-97 - -2)/(-5) + l. Suppose 0 = sj - 8j - 32. Solve n = -jn - 5 for n. -1 Let b(x) = -x + 1. Let a(l) = 7l - 17. Let q(t) = -a(t) - 6b(t). Let s be q(9). Let k be (2 + -1)/((-3)/(-12)). Solve sv = kv + 10 for v. -5 Let a = -201 + 206. Let b be (-20)/a - (-8)/((-1)/(-1)). Solve -bi - 24 = -8 for i. -4 Suppose 2o - 724 = -11o - 399. Solve -17g = -o + 8 for g. 1 Let a(h) = -h2 + 8h - 6. Let k be a(6). Let o(f) = f*3 + 4f*2 + 3. Let u be o(-3). Let s be u/18(-3 + k). Solve -sg - 15 = g for g. -5 Let b(i) be the second derivative of 25i*3/6 + 177i*2/2 - 26i - 4. Let s be b(-7). Solve -j + 3 = -s for j. 5 Let y(k) = 2k2 + 6k + 20. Let m be y(-2). Suppose mf - 3f - 260 = 0. Solve -3n - f + 5 = 0 for n. -5 Let a(s) = -6s*2 - 82s - 242. Let w be a(-9). Solve -24i = -wi - 84 for i. 6 Let t(i) = -i*2 - 3i + 15. Let y be t(-5). Suppose -yh - 15 = -6h - b, 4b = -h. Solve 5 = -5n - h for n. -5 Let v be 1/(3/72)119/(-21). Let m = v + 139. Solve -2t - m - 3 = 0 for t. -3 Suppose -98 - 1873 = -27v - 324. Solve -vp + 175 = -86p for p. -7 Let t be (-10 + 18)(-1 - -4)/12. Suppose tp = 99 - 81. Solve po - 13o = 16 for o. -4 Let z be (8/(-24) + 66/18)/(2/3). Solve 5x - z = 6x for x. -5 Let n(u) = 21u*2 + 756u + 88. Let o be n(-36). Solve -42d = -64d - o for d. -4 Let n = -19 - -23. Suppose -42 = -nd + 86. Let r = d + -16. Solve -4b + 0 = r for b. -4 Let l be 155/(-93)3-1. Suppose 5 = x, -4r - 7x + 110 = -lx. Solve 27w + 4 = rw for w. -2 Let f(r) = r3 - 21r*2 + 24r - 12. Let t be f(20). Suppose 0 = 9l - 43l + t. Solve -5h + l = 2 for h. 0 Let t be (-1 - -4 - 2)/1. Suppose 2a = 2n + 14, -a = 4n - t + 4. Let x = 12 + n. Solve -5p - x = -7p for p. 5 Suppose -4v + 7h - 122 = -181, -2h - 28 = -3v. Suppose 6s - 2 = 5s. Solve 4b - s = v for b. 2 Let q be 18/6(-3 - -3 - -11). Suppose 5b - 314 = -2u, -28u = b - qu - 79. Solve b - 64 = -n for n. 0 Let g = -9686 - -9714. Solve -65 = gx - 37 for x. -1 Suppose -207v - 3l = -202v - 56, -4v + 2l + 36 = 0. Solve -5 = -t - v for t. -5 Let k be 117/27 - 8/6. Suppose -3a = -kc + 303, 19 = 2c + 2a - 199. Suppose f - 6f + 5g = -c, -5g - 29 = -f. Solve -4n + 3 - f = 0 for n. -4 Let s be 63/2(-4)/(-6). Let h = 3959 + -3953. Solve 5w - h = -s for w. -3 Let o(n) = -2n3 + 11n*2 - 2n - 11. Suppose 0s - 5s = 0. Suppose p + 8 - 13 = s. Let r be o(p). Solve rz - 24 = -4 for z. 5 Suppose 280 = 1245b - 1225b. Solve -11c - b = -18c for c. 2 Suppose -2965w = -2971w + 14040. Solve -12 = 2336q - wq for q. 3 Let p(m) = m3 - 5m*2 + 53. Let s be p(6). Let q = 132 - s. Solve -47 = -4y - q for y. 1 Suppose 22n - 65 - 353 = 0. Suppose -309 - 14 = -nw. Solve 2t + 21 - w = 0 for t. -2 Suppose 0 = -0q + 5q - 140. Let p = -94 + 10. Let g = -81 - p. Solve -q = 5v - g for v. -5 Let f = -43 + 52. Suppose 4h = 57 - f. Suppose -3i + 6 + 6 = 0. Solve -il = 8 + h for l. -5 Let h be 499 - -1 - (0 - (-1 + 5)). Suppose 0 = 9t - t - h. Let o = 64 - t. Solve -2 - o = -k for k. 3 Let i = -29 + 34. Suppose ia = -5o, -o + 6o = -3a + 6. Suppose -1 = -ot - 2n, t - 4 = 2n - 1. Solve 2v - t = v for v. 1 Suppose 0 = 5v - 0v - 235. Suppose -4g - 99 + 315 = 4h, 4h = 12. Suppose -16 = -gq + vq. Solve -2t - q - 2 = 0 for t. -3 Let s(m) = -3m3 + m2 + m - 1. Let a be s(1). Let n be 7 - (-12)/((-8)/a). Let r be (180/3755)/(6/20). Solve nq = rq + 4 for q. 2 Let q = 3413 + -3412. Solve q = 12c - 47 for c. 4 Let n be ((-80)/(-50))/((-4)/(-50)). Suppose 0 = -c - n + 23. Let o be c + -3 + 4 - 4. Solve -2v + 4v = o for v. 0 Let m(i) = i3 - 13i*2 + 3i - 12. Let d be m(6). Let q = 266 + d. Solve -4l = l + q for l. -4 Let v = -36 - -68. Suppose 0 = 1484b - 1492b + 96. Suppose 0 = -vj + 38j - b. Solve jp + p + 12 = 0 for p. -4 Let t = 132 - 124. Suppose -i - t = -8. Suppose i = 2j - 12j + 80. Solve 2m + j + 2 = 0 for m. -5 Suppose 3c + 16056 = 16086. Solve -v = 2v + cv for v. 0 Let m = 6 + -1. Suppose 2t + 83 - 93 = 0. Suppose z + 10d = 13d + 2, tz - 4d = 10. Solve -4l = -ml + z for l. 2 Let a be -11 - 1014/(-91) - 2820/(-7). Let s = a + -393. Solve -15x - s = -20x for x. 2 Suppose 2q = 30q + 6496. Let z = 235 + q. Let w = 10 + -5. Solve z = -wy + 28 for y. 5 Let o = 522 - 200. Solve -o = -10m - 342 for m. -2 Suppose 2p + s - 6 = 0, 0 = 5p + 1273s - 1275s - 6. Suppose -3v + 10 = 43. Let l = 15 + v. Solve -4i + l = -pi for i. 2 Suppose -9s - 25 = -4w - 4s, -4w = 4s + 20. Suppose -72h + 73h = w. Solve 39i - 34i + 5 = h for i. -1 Let v(u) = -652u + 1956. Let j be v(3). Solve -18t = -18 - j for t. 1 Let a be 25 - (15 + (-120)/8). Solve 2j = 7j - a for j. 5 Suppose 2963 - 2391 = 22r. Solve 20h - rh = 12 for h. -2 Let w(j) = -j*3 - 2j*2 + j - 1. Let i(p) = 5p*2 + 2p - 3. Let u(a) = -i(a) - 2w(a). Let l be u(2). Solve -2r + 13 = l for r. 2 Let g be ((-4)/18)/((-1)/18). Suppose o + 5 = j, 4j - go - 14 = -2o. Solve -6 + j = 4p for p. -1 Suppose -14k - 1095 = -1697. Solve -52c - 27 = -kc for c. -3 Suppose -6g + 75 = -3g. Let t = g + -28. Let x(u) = u + 9. Let b be x(t). Solve b - 1 = 5f for f. 1 Suppose -5x - 5u = -65, 43x - 41x - 29 = -u. Solve 2b - x = -30 for b. -7 Let c(k) = -k2 + 49k + 1852. Let r be c(-25). Solve rz = 15z - 65 for z. 5 Suppose -15 = -2l - 5p, 0 = 4l + l - 4p - 21. Suppose -2i = 5z - 7, -li + 2 = 3z - 6z. Solve 11 = 3w - i for w. 4 Suppose -18 = -130n + 127n. Let a be (n/(-7 + 1))/(1/(-5)). Solve a = -8c - 3 for c. -1 Let y be (01/2)/(-1). Let a = 61420 + -61418. Solve ai + 5i = y for i. 0 Suppose -5u = 2v + 3v, 2u = v - 12. Let y = u - -3. Let s(g) = -g + 1. Let z be s(y). Solve -3 = zj + j for j. -1 Let t(u) = -17u - 110. Let n be t(-10). Suppose nl - 61l = 0. Solve 5h - 35 + 10 = l for h. 5 Suppose 3 = -z, 0z = 5d + 5z + 100. Suppose -2h + 5a + 38 = 0, 95 = 5h + 3a - 6a. Let k = h + d. Solve -kt + 4 = -0 for t. 2 Let f be 8/(26/(-22) - -1). Let n(u) = -55u - 975. Let x be n(-17). Let b = x - f. Solve 0 = bq - 5q - 5 for q. -5 Let m(n) = 3n*3 + 30n*2 + 26n - 9. Let i be m(-9). Solve -44s + 38s = i for s. 0 Suppose 4x + 7 = -5q + 56, -55 = -4x - 3q. Let k be -3 + 104/x + (-1)/2. Solve 4f + 5 = kf for f. -5 Let u be ((-20)/45)/((-9)/(-135))-30. Solve -4n + 29n - u = 0 for n. 8 Let i be (2256/658)/((-3)/((-63)/6)). Solve 751j = 749j - i for j. -6 Let t(u) = -2u*3 - 29u*2 + 15u + 24. Let h be t(-15). Suppose -17b + hb = 14. Solve -2z + 3z = b for z. 2 Suppose 6a - 7a = -7. Let g(t) = -5*t	{ "pile_set_name": "DM Mathematics" }
-4278, -7936, -12606, -18288, -24982? -32688 What is next in 2662, 5404, 8146, 10888? 13630 What is the next term in -176080, -352164, -528248, -704332, -880416? -1056500 What is next in 321, 2498, 8381, 19818, 38657? 66746 What is next in 7934, 31643, 71132, 126407, 197474? 284339 What is next in -102, -135, -190, -267, -366, -487? -630 What is the next term in -42669, -42676, -42683? -42690 What is next in -13962, -13966, -13972, -13980, -13990, -14002, -14016? -14032 What is next in -3278, -26465, -89396, -211943, -413978, -715373, -1136000? -1695731 What is next in 358246, 716506, 1074766, 1433026? 1791286 What is the next term in -21004, -42011, -63016, -84019, -105020? -126019 What is the next term in 1620, 1606, 1592, 1578? 1564 What is next in 15, -121, -267, -429, -613? -825 What is the next term in -16906, -33816, -50726, -67636, -84546? -101456 What is the next term in 1982, 2048, 2114, 2180? 2246 What comes next: 950, 774, 484, 80, -438, -1070, -1816? -2676 What is next in 10418, 10416, 10412, 10406, 10398, 10388? 10376 What is next in -42, -207, -498, -927, -1506, -2247, -3162? -4263 What is the next term in -7200, -14400, -21602, -28806, -36012, -43220, -50430? -57642 What comes next: -702, -1351, -2000, -2649, -3298, -3947? -4596 What is the next term in 5238, 5241, 5246, 5253, 5262, 5273? 5286 What comes next: 1791, 2799, 3781, 4725, 5619, 6451, 7209, 7881? 8455 What is next in 60360, 120731, 181102, 241473, 301844? 362215 What is next in 49, 65, 31, -83, -307, -671? -1205 What is next in -10267, -20532, -30797, -41062? -51327 What comes next: -3045, -12198, -27455, -48816, -76281, -109850? -149523 What comes next: -102, -187, -382, -741, -1318? -2167 What is next in 7221, 7237, 7251, 7263, 7273, 7281, 7287? 7291 What is next in 1972, 3939, 5880, 7783, 9636, 11427, 13144, 14775? 16308 What is the next term in 2037, 2051, 2069, 2091, 2117, 2147? 2181 What is next in 1396, 1398, 1402, 1408, 1416, 1426? 1438 What is the next term in 13008, 26040, 39084, 52140, 65208? 78288 What is the next term in -147, -286, -451, -654, -907? -1222 What is the next term in 3086, 3117, 3148, 3179, 3210, 3241? 3272 What is the next term in 419, 1121, 2111, 3395, 4979, 6869, 9071, 11591? 14435 What is the next term in -119, -178, -351, -698, -1279, -2154, -3383? -5026 What comes next: -26, -191, -510, -989, -1634, -2451? -3446 What is the next term in 428, 2097, 3766, 5435, 7104, 8773? 10442 What is next in 38530, 38533, 38536, 38539, 38542? 38545 What comes next: -48862, -48866, -48872, -48880, -48890, -48902? -48916 What is next in -98805, -98764, -98723, -98682, -98641, -98600? -98559 What is next in 415, 447, 519, 649, 855? 1155 What is the next term in -8634, -17682, -26730, -35778, -44826? -53874 What is the next term in 10681, 21361, 32039, 42715? 53389 What is the next term in -1580, -1510, -1462, -1448, -1480, -1570? -1730 What comes next: 1793, 1777, 1727, 1631, 1477, 1253, 947, 547? 41 What is the next term in 239, 283, 391, 593, 919, 1399, 2063, 2941? 4063 What is next in -3350, -3273, -3144, -2963? -2730 What is next in 6869, 6875, 6881? 6887 What is next in 19631, 78515, 176655, 314051, 490703, 706611, 961775? 1256195 What comes next: -26, -240, -724, -1580, -2910? -4816 What is next in -3306, -3290, -3274, -3258? -3242 What is the next term in 6970, 6882, 6794? 6706 What is next in 686, 780, 872, 962, 1050? 1136 What is the next term in 1420, 2836, 4252, 5668, 7084? 8500 What is next in 6796835, 13593671, 20390507, 27187343, 33984179? 40781015 What is next in 402, 797, 1182, 1557, 1922, 2277, 2622? 2957 What is the next term in 2291, 4590, 6895, 9206, 11523, 13846? 16175 What comes next: -202, -293, -416, -571, -758, -977? -1228 What is the next term in -992, -929, -880, -851, -848? -877 What is the next term in 11, 298, 583, 866, 1147, 1426, 1703? 1978 What comes next: -630373, -630379, -630389, -630403, -630421, -630443, -630469? -630499 What comes next: -72155, -72183, -72211, -72239? -72267 What comes next: -19, 36, 339, 1064, 2385, 4476, 7511? 11664 What is the next term in -511, -512, -503, -484, -455, -416, -367? -308 What is the next term in -27266, -54536, -81810, -109088, -136370? -163656 What is next in 53644, 53649, 53654? 53659 What is the next term in -14777, -29546, -44315, -59084, -73853? -88622 What is next in 185459, 370917, 556375? 741833 What comes next: 16082, 32209, 48338, 64469? 80602 What is the next term in 284, 738, 1516, 2780, 4692, 7414? 11108 What comes next: 37, -546, -2159, -5318, -10539, -18338, -29231, -43734? -62363 What is the next term in -64, -195, -494, -1045, -1932, -3239, -5050, -7449? -10520 What is next in -23, -41, -35, 13, 121, 307, 589? 985 What comes next: -9585, -76643, -258639, -613041, -1197317? -2068935 What is next in -45, -83, -117, -147, -173, -195, -213? -227 What is next in -129384, -258765, -388146, -517527? -646908 What comes next: 861, 1733, 2623, 3537, 4481, 5461? 6483 What comes next: 148020, 296088, 444168, 592266, 740388, 888540, 1036728, 1184958? 1333236 What is the next term in -89, -235, -515, -959, -1597? -2459 What is next in -205, -346, -705, -1384, -2485, -4110, -6361? -9340 What comes next: 190192, 190183, 190164, 190129, 190072, 189987, 189868, 189709? 189504 What comes next: 1498, 1143, 788, 433, 78, -277? -632 What is the next term in -1053, -3568, -7761, -13632, -21181? -30408 What comes next: -294, -180, 14, 294, 666, 1136, 1710? 2394 What is next in -147, -1056, -3533, -8364, -16335, -28232? -44841 What is next in -3389, -6803, -10217, -13631? -17045 What is the next term in 668, 1539, 2610, 3881? 5352 What is next in -65, -369, -1143, -2621, -5037, -8625, -13619? -20253 What is the next term in 75818, 75820, 75822, 75824? 75826 What is next in -551957, -551959, -551961, -551963? -551965 What comes next: -667, -1375, -2083, -2791, -3499, -4207? -4915 What comes next: 1403, 2985, 4567, 6149, 7731, 9313? 10895 What is the next term in 1422, 2852, 4282, 5712? 7142 What comes next: 25588, 102243, 229994, 408835, 638760, 919763, 1251838, 1634979? 2069180 What is next in 19, -12, -75, -170, -297, -456? -647 What is the next term in -2037, -8103, -18211, -32361? -50553 What is the next term in -1405, -1355, -1293, -1213, -1109, -975? -805 What comes next: -2880, -5729, -8506, -11175, -13700? -16045 What comes next: 5661, 11320, 16979, 22638, 28297, 33956? 39615 What is next in -354, -389, -426, -459, -482, -489, -474? -431 What comes next: 6272, 12456, 18650, 24860, 31092, 37352? 43646 What comes next: 7435, 30076, 67811, 120640, 188563, 271580? 369691 What is next in 1408, 1425, 1466, 1543, 1668, 1853, 2110? 2451 What is next in -1494, -12121, -41026, -97347, -190222, -328789, -522186? -779551 What is the next term in -407, 847, 2103, 3361, 4621, 5883, 7147? 8413 What comes next: -24979, -49960, -74939, -99916, -124891, -149864, -174835? -199804 What comes next: 676, 1212, 2098, 3328, 4896? 6796 What is next in 369, 751, 1125, 1485, 1825? 2139 What is the next term in -4828, -4823, -4818, -4813, -4808? -4803 What is next in 202393, 404790, 607187, 809584? 1011981 What is next in -4232, -8460, -12688? -16916 What comes next: -23660, -94639, -212938, -378557, -591496, -851755, -1159334? -1514233 What comes next: -103888, -207770, -311646, -415516, -519380? -623238 What is next in -19050, -76206, -171466, -304830? -476298 What is the next term in -533969, -533972, -533975? -533978 What comes next: -3527878, -3527880, -3527882, -3527884, -3527886, -3527888? -3527890 What is the next term in -1378, -1356, -1334? -1312 What is next in -91554, -183103, -274654, -366207? -457762 What is the next term in -126369, -252740, -379111, -505482, -631853, -758224? -884595 What is next in 194, 759, 1694, 2999, 4674, 6719, 9134? 11919 What is the next term in 97838, 97812, 97786, 97760? 97734 What is next in -173873, -173869, -173863, -173855, -173845, -173833? -173819 What is the next term in -62, -251, -562, -995? -1550 What comes next: 138, 543, 1222, 2175, 3402, 4903? 6678 What is the next term in -270, -1072, -2410, -4284, -6694, -9640? -13122 What comes next: -5027, -5090, -5183, -5300, -5435, -5582, -5735? -5888 What comes next: 225, 651, 1359, 2349, 3621, 5175? 7011 Wha	{ "pile_set_name": "DM Mathematics" }
55832 - -0.3. -28855831.7 What is 46010717 less than -0.08? -46010717.08 Put together 1453.81 and 8.8. 1462.61 Subtract 1604894604 from -2. -1604894606 What is the distance between -2544133.54 and -5.8? 2544127.74 -13.085579 + -24 -37.085579 Put together 4755941 and 0.02. 4755941.02 Work out -0.781137 - 140. -140.781137 -157400 + 276 -157124 What is 40897294.1 less than 0.082? -40897294.018 Add 25090 and 66361. 91451 What is 38412 less than 1731? -36681 What is -507921 + -19? -507940 What is the difference between 0.1 and 0.1585534023? 0.0585534023 24 + 51.45284 75.45284 What is 0.5 take away -29.35232616? 29.85232616 What is -1.3524 plus 1868425? 1868423.6476 Total of -42543.656 and 0.5. -42543.156 Work out 68306 + -1.483. 68304.517 What is the difference between -169554063 and 0.55? 169554063.55 Calculate -0.1 + -2981762035. -2981762035.1 -6916 + -180 -7096 Work out -2 + 0.03356524. -1.96643476 Add together -0.3 and -0.029141327. -0.329141327 What is -49048 minus 196572? -245620 Work out 1730.5 - -0.80862. 1731.30862 What is -243478831 + 26? -243478805 Calculate 989128 + 2.7. 989130.7 Add -0.6973 and 0.07101. -0.62629 Sum 2 and -442247052. -442247050 Calculate -2413225631 - -2. -2413225629 What is -358552 minus -0.0991? -358551.9009 Put together 103844069 and -50. 103844019 -7490.352 - -22.46 -7467.892 452.0049 - -8705 9157.0049 What is -158 take away 12374.814? -12532.814 What is -3809658748 plus 0.04? -3809658747.96 41276549 + 5 41276554 What is 1.6040524 + -0.85? 0.7540524 Subtract -0.5 from -51044916. -51044915.5 What is 41634 + 0.68367? 41634.68367 What is 0.15391 + -65.3? -65.14609 -414 - -176.56 -237.44 What is 0.045 plus -110927? -110926.955 What is 3401334 - 0.4? 3401333.6 Sum 200818 and 0.418. 200818.418 What is the distance between -87 and -22900.4? 22813.4 Add 13362 and -474999. -461637 Subtract 136.7 from -32297. -32433.7 Add 0.0691 and 3.109. 3.1781 What is 0.2318 - -2694.2? 2694.4318 Total of 3 and -0.02238938. 2.97761062 Work out 7.006 - -1.196. 8.202 What is the distance between 1095732 and 438? 1095294 Subtract 224917 from -18.8339. -224935.8339 Work out -0.5 - -13331998. 13331997.5 What is -879302 minus -111? -879191 Work out 1094833 - -0.16. 1094833.16 Subtract 0.024 from -237180082. -237180082.024 Work out 2 - 836703862. -836703860 What is 109 take away 1.326631? 107.673369 Add together -4.43 and 328301. 328296.57 What is the difference between 0.140638 and 48425? 48424.859362 12206.3+0.203 12206.503 Calculate -293347 - -0.48. -293346.52 What is 2376.016 + -0.149? 2375.867 Add 304.521 and -0.7061. 303.8149 What is -1644264 take away 21? -1644285 -12+5007990961 5007990949 Add together -314286.2 and 8.058. -314278.142 What is 1 take away -1210991487? 1210991488 What is the difference between 9117478 and 24? 9117454 What is 0.02031 - 110.51? -110.48969 Calculate -5.3 + -26.36405. -31.66405 Work out 411.9404 - -0.096. 412.0364 Work out -4 - 214.06828012. -218.06828012 What is the distance between 0.059 and -26655? 26655.059 What is 0.3 plus 8.561776? 8.861776 What is -5176.2 take away -0.1309? -5176.0691 What is the distance between -2969.7 and 26902.9? 29872.6 Work out -1484 - 1851543. -1853027 -15 - 39892634 -39892649 What is the distance between 3403 and -0.17779926? 3403.17779926 Work out -13.4695011278 - -3. -10.4695011278 Calculate -202382.8379 - -10. -202372.8379 What is the distance between -16991720 and 14? 16991734 What is -20 - -198012807? 198012787 Subtract -0.007034175 from 0.5. 0.507034175 Put together -0.3 and 565678. 565677.7 What is the distance between -1490.356415 and -3? 1487.356415 Calculate -145 - -0.00857. -144.99143 Add -14658.5 and -44.9. -14703.4 Subtract 0.2 from -12445282. -12445282.2 Calculate 1349.33 - -0.8737. 1350.2037 Total of -0.1 and -7780694. -7780694.1 -420498.3 - -8.2 -420490.1 What is -5 take away 854643.0698? -854648.0698 Work out 1296 + -0.5285. 1295.4715 Add 0.046 and 87393. 87393.046 744361266+-0.4 744361265.6 What is -7542622 - 216? -7542838 Calculate 452.16492 + 0.9. 453.06492 Sum -30 and -38269.5301. -38299.5301 Add 8716 and 9448. 18164 Put together 311 and -1068.8. -757.8 Add together -292171.707 and -36. -292207.707 Calculate -0.1375 + 8484. 8483.8625 What is -0.0682206 take away -4205? 4204.9317794 What is -1198.59 plus 38.4818? -1160.1082 Total of 0.01 and -8263432060. -8263432059.99 Calculate -7004 - 1428. -8432 Total of -7.82521 and 0.3935. -7.43171 2.1 + -0.122535117 1.977464883 2210.16 + -1.03 2209.13 Calculate -0.42 + -3.0621. -3.4821 7 - -108466046 108466053 What is 2927 take away 113867? -110940 Sum -2.5651 and 9503. 9500.4349 -14042715 + -1 -14042716 Calculate 0.3 - -258529656. 258529656.3 Subtract -259795 from 0.332. 259795.332 What is 174074 minus 1.8? 174072.2 Work out 197554 + -19700. 177854 Calculate 65301899 - -0.2. 65301899.2 -134775.45+-185 -134960.45 What is 7228395 less than 1? -7228394 Add 960 and -0.1477544. 959.8522456 Calculate -0.4 - 16277.24293. -16277.64293 What is 1512653.6 minus -29? 1512682.6 Subtract -203 from -459.3971. -256.3971 Subtract 104571 from -347.8. -104918.8 -1397 + 94.24081 -1302.75919 What is -0.054 - -418528? 418527.946 What is -22.6212 plus 259? 236.3788 Calculate 13574829 + 0.4. 13574829.4 What is 75158.8 - -68277? 143435.8 What is 19064.093 less than 906? -18158.093 What is 0.23662 - -0.07664? 0.31326 What is the distance between -127138.84 and 0.01? 127138.85 Subtract 11 from -37942726.78. -37942737.78 Total of 997 and 0.0407698. 997.0407698 What is 4.97 take away 0.0605901? 4.9094099 Calculate 129.5603 - 344. -214.4397 Total of -30676270.9 and 4. -30676266.9 Total of -68017 and -1085. -69102 What is -1821.2745 plus 0.115? -1821.1595 What is 259 - 1723192? -1722933 Total of 1.8 and 55106.77274. 55108.57274 What is -0.041 minus 513.1461? -513.1871 What is the distance between 272075 and 0.12167? 272074.87833 What is the distance between -0.0257 and -25313? 25312.9743 Add -4749879141 and 4. -4749879137 Put together -955 and 1035.39. 80.39 What is the distance between 41106845 and -2? 41106847 Add -233313217 and 3. -233313214 What is the distance between 45736901 and -5? 45736906 Total of 956.491 and -312. 644.491 What is the difference between 0.2 and 63928190? 63928189.8 Add together 306.3 and -23484. -23177.7 Work out -5 + 25733253266. 25733253261 What is -229731441 minus 25? -229731466 Put together -4 and -197848. -197852 Sum -8962 and -3607.59. -12569.59 Work out -2 - -5771486807. 5771486805 What is -12.42394 minus 8.6? -21.02394 What is the distance between 0.21 and -925923.335? 925923.545 What is 4574 + -16883? -12309 What is -160688671 plus 89? -160688582 Calculate -2.56 + 613.999. 611.439 17.2 - -1323510 1323527.2 What is 0.03 plus 6612859? 6612859.03 What is the distance between 17626 and 10370? 7256 Calculate -0.5028704 + -720. -720.5028704 Calculate -62109 - -0.003328. -62108.996672 What is -0.016704 minus 40925.5? -40925.516704 What is 0.0432 less than 2454.18? 2454.1368 -15 - 16086070 -16086085 Calculate -0.5 + -19755.63. -19756.13 What is the distance between 13 and 630995164? 630995151 -5 + -21665830532 -21665830537 0.390228 + -0.271 0.119228 Put together 5014178825 and 17. 5014178842 What is 25974 plus 7144? 33118 Subtract 31405553 from -0.44. -31405553.44 Calculate -1961 - -9918009. 9916048 What is the difference between 4.44321825 and 4? 0.44321825 What is the distance between -31.7 and 31492? 31523.7 What is -72599188 - 1.031? -72599189.031 What is 2344.74 minus 4910? -2565.26 Total of -14.25 and -2062386. -2062400.25 -602218.5 - -1 -602217.5 Work out -0.2 + 0.033710424. -0.166289576 -0.4676 + 9.5 9.0324 What is -17 plus 32554? 32537 Sum 244 and 749.36. 993.36 What is -0.4 + -3649.0073? -3649.4073 Sum 0.0430417998 and 182. 182.0430417998 Sum 5448831 and -36.7. 5448794.3 0.11+-0.049981097 0.060018903 Put together -955.3 and 894. -61.3 Add -0.059177 and -487.2. -487.259177 What is -122319.2 minus -5? -122314.2 What is -61313.2045 minus 0.04? -61313.2445 What is 0.3 take away 76895949? -76895948.7 Work out 98444 + -138.67. 98305.33 Sum 91410671620 and 0. 91410671620 What is -0.23 + 306318079? 306318078.77 Total of -837 and -112544. -113381 Sum -7880 and -3432. -11312 What is the distance between 1.3710836 and 0	{ "pile_set_name": "DM Mathematics" }
is the nearest to 5/3 in -1/7, -0.9, 1? 1 Which is the nearest to -1? (a) -0.35 (b) -2/5 (c) -2/15 b Which is the nearest to -119/5? (a) 1/6 (b) -24/11 (c) -2/17 b Which is the closest to 2/15? (a) 2 (b) -4/13 (c) -1/5 (d) 4 c Which is the closest to 1? (a) -15 (b) 5 (c) -0.1 c What is the closest to 1 in 9, 412, -5? -5 What is the nearest to -6 in -5, 3, -63, 2? -5 What is the nearest to 0.1 in -2/3, -27, -0.2, 0.3? 0.3 What is the nearest to -2 in 0.3, 2/9, -3.52? -3.52 Which is the closest to -1? (a) 0.5 (b) 3/4 (c) 4/9 (d) -13 c What is the nearest to -0.3 in 3/8, -26, -0.3? -0.3 Which is the closest to 2? (a) -2/151 (b) -0.5 (c) 0.2 (d) -3/4 c Which is the nearest to -0.01? (a) -2/9 (b) 0.7 (c) -2/3 a What is the closest to 0 in 2, -1/3, 1, 4/3? -1/3 What is the closest to 13 in -5, 2, 0.2, 3? 3 Which is the nearest to -1/2? (a) 4 (b) -0.09 (c) -10 b What is the closest to 2 in 1, -1/23, 0.3, 0? 1 What is the closest to -9.6 in 0, 2, 3/13? 0 What is the nearest to -3 in -0.4, -32, 5, 0? -0.4 What is the closest to 0.07 in -0.263, 0.2, -4? 0.2 Which is the closest to 56? (a) -1 (b) -3/4 (c) 2 c Which is the nearest to -1? (a) -13/5 (b) 2/9 (c) 3 (d) -2/9 d Which is the closest to -1? (a) 2/7 (b) 29 (c) -4 (d) 0.09 d What is the closest to -2.1 in -3, -0.5, 4, -3/5? -3 What is the closest to -1 in -2/7, 20, 2/17, 2? -2/7 Which is the closest to -2? (a) -2 (b) 6/11 (c) -5 a What is the nearest to 3/7 in -2, -16, 0.2? 0.2 Which is the closest to -0.1? (a) -0.02 (b) 1/3 (c) 18 a Which is the nearest to 0.1? (a) -4/7 (b) 4 (c) 0.1 (d) 3 c What is the closest to 2/5 in -0.3, 8/5, 0.5? 0.5 Which is the closest to -0.2? (a) 3 (b) -3 (c) 0.13 c Which is the nearest to -2/5? (a) -8 (b) -1 (c) 0 c Which is the closest to 1/4? (a) -6 (b) -0.11 (c) 0 c Which is the closest to -2/23? (a) 0.2 (b) -1 (c) 0 (d) 3/5 c What is the closest to 2/5 in -3/4, 1.1, -2/3, -4/3? 1.1 Which is the nearest to -0.3? (a) 0.5 (b) -1/15 (c) 3/31 (d) 4 b What is the nearest to 6/7 in -6, -0.11, 3, 1? 1 What is the nearest to 1/3 in -5, 0.1, 5, -2/5? 0.1 Which is the closest to 0.1? (a) -0.041 (b) 4/5 (c) -1/4 a What is the closest to 2/7 in 4, -2, 3, 1/10? 1/10 What is the closest to 3 in -2, 17, 4/5? 4/5 Which is the closest to 2? (a) -3 (b) -5 (c) 2/9 c Which is the nearest to 1.1? (a) 3 (b) 2/9 (c) -5 (d) -2 b What is the closest to -1/3 in -7, -4/3, -21? -4/3 Which is the nearest to 1/5? (a) 0 (b) 0.1 (c) -4 (d) -1/6 b What is the closest to 0 in 3, 30, 1/89? 1/89 Which is the closest to 1? (a) 3 (b) -0.3 (c) 5 (d) 2/4453 d Which is the closest to 0? (a) -0.3 (b) 0.4 (c) 99 (d) -20 a What is the nearest to 8 in 4/9, 4, 3/14? 4 Which is the closest to 2/5? (a) 5 (b) -5 (c) -1/3 c Which is the closest to -2/9? (a) 0.1 (b) -1 (c) -5 (d) 1 a Which is the nearest to -0.0511? (a) -5 (b) 0.11 (c) 3/4 b What is the closest to -3 in 1/4, 0, -1/5, -8? -1/5 What is the closest to 0.1 in -0.2, 0, 1/16, -2/17? 1/16 What is the closest to 4/31 in 1, -10, 0? 0 What is the nearest to 980 in 1, 4, -0.5? 4 Which is the closest to -4? (a) 3 (b) 0.5 (c) -1/4 c What is the closest to -1/3 in -2, 0.8, -0.2, -4? -0.2 Which is the nearest to -24? (a) -13 (b) -5 (c) -0.4 (d) -2/11 a What is the closest to -1/5 in -7, 1/3, 0.6? 1/3 Which is the closest to -0.1? (a) -21 (b) 0.02 (c) 0.1 b Which is the closest to 0? (a) 2/11 (b) 3/2 (c) 3 (d) 0.3 a Which is the nearest to -7? (a) 4 (b) -1 (c) -5 (d) 0.2 c Which is the nearest to -4? (a) 30 (b) 1 (c) -4/3 (d) 1/3 c Which is the nearest to -0.1? (a) -5 (b) 1/52 (c) -4/3 (d) 0.2 b What is the closest to 13 in -2, 4, 6, -0.4? 6 What is the closest to 1 in -0.2, 4, 39? -0.2 What is the nearest to -2 in -33, -0.2, -0.4? -0.4 Which is the closest to -1/4? (a) -2 (b) 2/9 (c) -5/227 (d) 4 c Which is the closest to -17? (a) -1/3 (b) -5 (c) 2/7 b Which is the closest to 1? (a) -1/11 (b) 2/3 (c) -3 b Which is the closest to -2? (a) 2/7 (b) 1/10 (c) -1.4 c What is the closest to 0 in 0, -2/11, 9? 0 Which is the closest to 3? (a) -3/2 (b) -0.5 (c) -5 b What is the closest to -1 in -2, 0.287, -5? -2 What is the closest to -4 in 4, -4, 1/30? -4 What is the nearest to -9/7 in 2/17, -0.3, 3, 4? -0.3 Which is the nearest to -2/5? (a) 88 (b) -1 (c) -4 b What is the closest to -1/15 in -3, -15, -4, 3? -3 What is the closest to -4 in 4, 3, -5, 6? -5 What is the nearest to -5 in 0.1, -3/7, 2/3, -5? -5 Which is the nearest to -1? (a) 6 (b) -0.3 (c) -3/5 (d) -1/4 c What is the closest to 10.4 in -5, -0.6, -4? -0.6 What is the closest to 2/21 in -0.034, 4, -1/3? -0.034 Which is the nearest to -4/5? (a) 0.5 (b) -1/2 (c) -2/5 (d) 5 b Which is the closest to 2/19? (a) 5 (b) -3/7 (c) -0.2 (d) -1 c What is the closest to -1/4 in -1, 3, -1.3, 0.4? 0.4 What is the nearest to -0.4 in 4, -5, 80? 4 Which is the closest to 3? (a) -1/8 (b) -1/4 (c) 0.4 c Which is the nearest to 0? (a) 3 (b) -1 (c) 4 (d) 2 b What is the closest to 1 in -2/7, 4, -2040/7, 5? -2/7 Which is the nearest to 0.1? (a) 4 (b) -1.1 (c) -0.2 c Which is the closest to 1/5? (a) 1/4 (b) 16 (c) -1/5 (d) 4 a Which is the closest to 2/25? (a) 1 (b) 2/5 (c) -5 b Which is the nearest to 26? (a) -3 (b) 2/7 (c) -0.3 b What is the closest to -1 in 1.3, 2/15, -3, -3/2? -3/2 Which is the nearest to -6? (a) 3 (b) -0.174 (c) -1 c Which is the closest to -6? (a) -68 (b) 0 (c) 2/11 b What is the nearest to -6 in -2/3, -6/11, -4/3, -1/5? -4/3 Which is the nearest to 0? (a) 1/10 (b) 5 (c) -9/89 a Which is the closest to -57? (a) -1/5 (b) -2 (c) 5 b Which is the closest to -6? (a) -5/3 (b) -28 (c) -0.2 (d) -0.3 a What is the closest to -2/5 in -4, -0.1, -2/61, -0.5? -0.5 Which is the nearest to 5/2? (a) -0.5 (b) -2/3 (c) -11 (d) -2 a What is the closest to 0 in 0, -1/4, -0.4, -1.7? 0 What is the closest to 0.1 in 2/9, -3/8, -2/41, 4? 2/9 Which is the closest to 1? (a) 3 (b) 51 (c) -2/3 (d) 0.1 d What is the nearest to 285 in 12, 0.2, 0.1? 12 Which is the closest to 0? (a) 3 (b) -13/2 (c) -0.3 c What is the nearest to -1/2 in 1, -0.004, -0.4, 4/25? -0.4 Which is the nearest to 3? (a) 1.1 (b) 2 (c) 0.3 b Which is the closest to -0.02? (a) -3 (b) 3/7 (c) -5 (d) 8 b Which is the closest to -3? (a) -5 (b) 3 (c) 2 (d) 2/83 a What is the closest to -1 in 2/9, 5, -0.1, 0.07? -0.1 Which is the nearest to -0.2? (a) -5 (b) 0.2 (c) -17 b What is the nearest to -2 in 4, -3/5, 12, 1? -3/5 Which is the nearest to -57? (a) 0.3 (b) -1 (c) -3/5 (d) 0.5 b What is the closest to -1/5 in -4, -31, 0.2, -1/4? -1/4 What is the closest to 3/7 in -56, 0.5, -5, 2? 0.5 Which is the nearest to -2/5? (a) -2 (b) 1/5 (c) -8 (d) -5 b What is the nearest to -0.021 in -2/3, -4, -0.1? -0.1 What is the closest to 5 in 14, 1/2, 0.1? 1/2 What is the nearest to -1 in 24, -1/5, -68? -1/5 What is the closest to -1 in 0.3, -2, -2/11, 5? -2/11 What is the closest to 4 in -3, -4, -25/11? -25/11 Which is the nearest to 3? (a) 0 (b) -5 (c) -0.1 a What is the closest to -6 in -2/17, -2, -11.39? -2 What is the nearest to 10 in -1, 0, -7? 0 What is the nearest to -0.2 in 1, 4, 11, 5? 1 What is the nearest to 1/2 in -0.3, 0.5, 3, 0? 0.5 Which is the nearest to 2/5? (a) -2/3 (b) 5 (c) 1 c What is the closest to -1 in 0.1, -62/9, 3/11? 0.1 What is the nearest to 2 in -35.5, 5, 2/5, -0.5? 2/5 What is the nearest to 1 in -1, -2/7, -4/53, -0.1? -4/53 Which is the closest to -1/4? (a) -0.5 (b) 1/16 (c) 1/11 a What is the nearest to 0.3 in -2, -3, 0.5, -24? 0.5 Which is the closest to 1? (a) -0.81 (b) -1 (c) -3/4 c What is the nearest to 2 in -0.2, -0.02, -4/3, 0.8? 0.8 Which is the nearest to -1? (a) -4/5 (b) 20 (c) -1/3 (d) 1 a Which is the nearest to -3? (a) 1/41 (b) -4 (c) -4/5 b Which is the nearest to 2/5? (a) -0.4 (b) -1 (c) -3 (d) -2/21 d Which is the closest to -26? (a) 0.2 (b) -2/15 (c) 1 (d) 0 b What is the nearest to -0.1 in 1.4, -4, -2/5? -2/5 Which is the closest to -0.1? (a) -56 (b) 1 (c) -5 (d) -3 b What is the closest to 0.2 in -1309, -4, 2/9? 2/9 What is the closest to 0.2 in 0.1, 50, -5, 0? 0.1 Which is the nearest t	{ "pile_set_name": "DM Mathematics" }
ainder when 964 is divided by 108? 100 Calculate the remainder when 865 is divided by 191. 101 Calculate the remainder when 27 is divided by 3. 0 What is the remainder when 3279 is divided by 81? 39 Calculate the remainder when 122 is divided by 41. 40 What is the remainder when 244 is divided by 81? 1 Calculate the remainder when 128 is divided by 12. 8 Calculate the remainder when 94 is divided by 33. 28 What is the remainder when 932 is divided by 107? 76 What is the remainder when 991 is divided by 71? 68 What is the remainder when 675 is divided by 26? 25 Calculate the remainder when 3649 is divided by 44. 41 Calculate the remainder when 570 is divided by 34. 26 Calculate the remainder when 583 is divided by 13. 11 Calculate the remainder when 1262 is divided by 16. 14 What is the remainder when 89 is divided by 45? 44 Calculate the remainder when 6292 is divided by 203. 202 Calculate the remainder when 255 is divided by 24. 15 Calculate the remainder when 214 is divided by 54. 52 Calculate the remainder when 5461 is divided by 13. 1 What is the remainder when 999 is divided by 50? 49 Calculate the remainder when 65 is divided by 31. 3 What is the remainder when 71 is divided by 3? 2 Calculate the remainder when 1373 is divided by 4. 1 Calculate the remainder when 223 is divided by 69. 16 Calculate the remainder when 625 is divided by 320. 305 Calculate the remainder when 990 is divided by 7. 3 What is the remainder when 279 is divided by 110? 59 Calculate the remainder when 7014 is divided by 23. 22 What is the remainder when 503 is divided by 23? 20 What is the remainder when 72 is divided by 19? 15 What is the remainder when 122 is divided by 16? 10 Calculate the remainder when 1058 is divided by 5. 3 What is the remainder when 1660 is divided by 207? 4 What is the remainder when 2476 is divided by 118? 116 What is the remainder when 34 is divided by 19? 15 What is the remainder when 173 is divided by 50? 23 Calculate the remainder when 76699 is divided by 130. 129 What is the remainder when 17 is divided by 5? 2 What is the remainder when 4481 is divided by 4468? 13 What is the remainder when 719 is divided by 20? 19 Calculate the remainder when 1794 is divided by 58. 54 Calculate the remainder when 312 is divided by 36. 24 Calculate the remainder when 83 is divided by 18. 11 Calculate the remainder when 7749 is divided by 228. 225 What is the remainder when 193 is divided by 65? 63 Calculate the remainder when 81 is divided by 17. 13 What is the remainder when 596 is divided by 10? 6 Calculate the remainder when 917 is divided by 27. 26 What is the remainder when 2272 is divided by 53? 46 What is the remainder when 25 is divided by 15? 10 What is the remainder when 1228 is divided by 16? 12 Calculate the remainder when 1281 is divided by 226. 151 Calculate the remainder when 15933 is divided by 249. 246 What is the remainder when 361 is divided by 13? 10 What is the remainder when 258 is divided by 29? 26 What is the remainder when 213 is divided by 67? 12 What is the remainder when 677 is divided by 22? 17 Calculate the remainder when 34 is divided by 12. 10 Calculate the remainder when 3594 is divided by 29. 27 Calculate the remainder when 133 is divided by 41. 10 What is the remainder when 12179 is divided by 116? 115 Calculate the remainder when 554 is divided by 40. 34 Calculate the remainder when 74 is divided by 4. 2 Calculate the remainder when 3827 is divided by 5. 2 What is the remainder when 142 is divided by 36? 34 What is the remainder when 145 is divided by 4? 1 Calculate the remainder when 10475 is divided by 62. 59 What is the remainder when 261 is divided by 85? 6 What is the remainder when 233 is divided by 125? 108 What is the remainder when 6438 is divided by 57? 54 What is the remainder when 146 is divided by 141? 5 What is the remainder when 197 is divided by 18? 17 Calculate the remainder when 104 is divided by 32. 8 Calculate the remainder when 95 is divided by 32. 31 What is the remainder when 100 is divided by 29? 13 What is the remainder when 1996 is divided by 18? 16 What is the remainder when 97 is divided by 10? 7 Calculate the remainder when 88 is divided by 64. 24 Calculate the remainder when 53 is divided by 4. 1 What is the remainder when 25 is divided by 17? 8 Calculate the remainder when 539 is divided by 134. 3 What is the remainder when 737 is divided by 102? 23 Calculate the remainder when 180 is divided by 13. 11 Calculate the remainder when 81 is divided by 28. 25 What is the remainder when 634 is divided by 163? 145 Calculate the remainder when 5692 is divided by 8. 4 Calculate the remainder when 10976 is divided by 90. 86 What is the remainder when 98 is divided by 19? 3 What is the remainder when 963 is divided by 46? 43 What is the remainder when 373 is divided by 86? 29 Calculate the remainder when 404 is divided by 29. 27 Calculate the remainder when 727 is divided by 56. 55 What is the remainder when 581 is divided by 221? 139 What is the remainder when 107 is divided by 105? 2 What is the remainder when 78 is divided by 21? 15 Calculate the remainder when 252 is divided by 53. 40 Calculate the remainder when 73 is divided by 21. 10 What is the remainder when 222 is divided by 2? 0 What is the remainder when 989 is divided by 306? 71 What is the remainder when 483 is divided by 174? 135 Calculate the remainder when 962 is divided by 88. 82 Calculate the remainder when 308 is divided by 52. 48 What is the remainder when 1766 is divided by 64? 38 Calculate the remainder when 536 is divided by 30. 26 What is the remainder when 1482 is divided by 364? 26 Calculate the remainder when 385 is divided by 97. 94 Calculate the remainder when 1171 is divided by 249. 175 Calculate the remainder when 15 is divided by 9. 6 Calculate the remainder when 143 is divided by 21. 17 Calculate the remainder when 313 is divided by 19. 9 What is the remainder when 1050 is divided by 1044? 6 Calculate the remainder when 137 is divided by 12. 5 What is the remainder when 39367 is divided by 10? 7 Calculate the remainder when 3964 is divided by 1320. 4 Calculate the remainder when 2483 is divided by 27. 26 Calculate the remainder when 1312 is divided by 13. 12 What is the remainder when 384 is divided by 16? 0 What is the remainder when 1275 is divided by 112? 43 Calculate the remainder when 9899 is divided by 36. 35 What is the remainder when 166 is divided by 15? 1 Calculate the remainder when 237 is divided by 17. 16 What is the remainder when 63 is divided by 35? 28 What is the remainder when 167 is divided by 28? 27 Calculate the remainder when 91 is divided by 18. 1 Calculate the remainder when 1720 is divided by 860. 0 What is the remainder when 404 is divided by 15? 14 What is the remainder when 715 is divided by 18? 13 What is the remainder when 431 is divided by 18? 17 Calculate the remainder when 6319 is divided by 49. 47 Calculate the remainder when 115 is divided by 13. 11 Calculate the remainder when 639 is divided by 37. 10 What is the remainder when 3363 is divided by 17? 14 Calculate the remainder when 93 is divided by 26. 15 What is the remainder when 139 is divided by 50? 39 Calculate the remainder when 228 is divided by 23. 21 Calculate the remainder when 1691 is divided by 113. 109 Calculate the remainder when 61 is divided by 32. 29 Calculate the remainder when 76 is divided by 17. 8 Calculate the remainder when 53 is divided by 33. 20 Calculate the remainder when 9 is divided by 3. 0 Calculate the remainder when 61 is divided by 34. 27 Calculate the remainder when 85 is divided by 32. 21 Calculate the remainder when 1538 is divided by 44. 42 What is the remainder when 100 is divided by 51? 49 What is the remainder when 409 is divided by 83? 77 What is the remainder when 335 is divided by 30? 5 Calculate the remainder when 6025 is divided by 31. 11 Calculate the remainder when 1958 is divided by 20. 18 Calculate the remainder when 1195 is divided by 559. 77 Calculate the remainder when 187 is divided by 88. 11 Calculate the remainder when 1135 is divided by 10. 5 What is the remainder when 203 is divided by 35? 28 Calculate the remainder when 226 is divided by 57. 55 Calculate the remai	{ "pile_set_name": "DM Mathematics" }
by 256? 218 What is the remainder when 390683 is divided by 188? 19 Calculate the remainder when 280886 is divided by 697. 692 What is the remainder when 10787 is divided by 3590? 17 Calculate the remainder when 567 is divided by 169. 60 Calculate the remainder when 129311 is divided by 1724. 11 Calculate the remainder when 57565 is divided by 389. 382 Calculate the remainder when 166723 is divided by 56. 11 Calculate the remainder when 22802 is divided by 76. 2 What is the remainder when 130469 is divided by 32617? 1 What is the remainder when 3612 is divided by 452? 448 Calculate the remainder when 1094944 is divided by 547472. 0 What is the remainder when 89458 is divided by 145? 138 What is the remainder when 1747 is divided by 293? 282 What is the remainder when 11420 is divided by 876? 32 Calculate the remainder when 40341 is divided by 74. 11 What is the remainder when 4714 is divided by 14? 10 What is the remainder when 6033 is divided by 15? 3 What is the remainder when 18158 is divided by 2267? 22 Calculate the remainder when 12787 is divided by 277. 45 What is the remainder when 26177 is divided by 8685? 122 What is the remainder when 4870 is divided by 196? 166 Calculate the remainder when 17640 is divided by 151. 124 What is the remainder when 21948 is divided by 1222? 1174 What is the remainder when 375343 is divided by 104? 7 What is the remainder when 977 is divided by 226? 73 What is the remainder when 646310 is divided by 64631? 0 What is the remainder when 1361484 is divided by 340370? 4 Calculate the remainder when 81 is divided by 51. 30 Calculate the remainder when 8189 is divided by 130. 129 Calculate the remainder when 30067 is divided by 33. 4 Calculate the remainder when 29062 is divided by 53. 18 Calculate the remainder when 31575 is divided by 789. 15 What is the remainder when 20056 is divided by 69? 46 Calculate the remainder when 559 is divided by 222. 115 What is the remainder when 4833 is divided by 93? 90 Calculate the remainder when 26111 is divided by 4350. 11 What is the remainder when 23057 is divided by 26? 21 What is the remainder when 9139 is divided by 21? 4 What is the remainder when 750 is divided by 651? 99 Calculate the remainder when 1176 is divided by 860. 316 What is the remainder when 210592 is divided by 5014? 4 What is the remainder when 548324 is divided by 101? 96 What is the remainder when 4255802 is divided by 217? 215 What is the remainder when 664 is divided by 205? 49 What is the remainder when 1753 is divided by 203? 129 Calculate the remainder when 16099 is divided by 70. 69 Calculate the remainder when 84236 is divided by 149. 51 What is the remainder when 602 is divided by 200? 2 Calculate the remainder when 40930 is divided by 1665. 970 What is the remainder when 8195 is divided by 50? 45 What is the remainder when 675 is divided by 22? 15 What is the remainder when 20172 is divided by 39? 9 What is the remainder when 350318 is divided by 20606? 16 What is the remainder when 39306 is divided by 2801? 92 Calculate the remainder when 47534 is divided by 3. 2 Calculate the remainder when 3649 is divided by 34. 11 Calculate the remainder when 17650 is divided by 1855. 955 Calculate the remainder when 2318 is divided by 3. 2 What is the remainder when 26770 is divided by 315? 310 Calculate the remainder when 1337894 is divided by 14. 12 Calculate the remainder when 135637 is divided by 63. 61 What is the remainder when 551 is divided by 61? 2 Calculate the remainder when 11649 is divided by 776. 9 Calculate the remainder when 67046 is divided by 18. 14 Calculate the remainder when 14399 is divided by 899. 15 What is the remainder when 585151 is divided by 8? 7 Calculate the remainder when 8186 is divided by 170. 26 Calculate the remainder when 128233 is divided by 309. 307 What is the remainder when 150894 is divided by 1677? 1641 Calculate the remainder when 5906 is divided by 1409. 270 What is the remainder when 44113 is divided by 2593? 32 Calculate the remainder when 362701 is divided by 302. 301 Calculate the remainder when 186313 is divided by 11. 6 What is the remainder when 30455 is divided by 216? 215 Calculate the remainder when 6872 is divided by 6758. 114 What is the remainder when 466304 is divided by 214? 212 Calculate the remainder when 298641 is divided by 162. 75 Calculate the remainder when 16570 is divided by 367. 55 What is the remainder when 1234 is divided by 430? 374 What is the remainder when 44608 is divided by 1652? 4 Calculate the remainder when 172592 is divided by 341. 46 Calculate the remainder when 74674 is divided by 9321. 106 Calculate the remainder when 1460 is divided by 294. 284 Calculate the remainder when 749931 is divided by 1181. 1177 Calculate the remainder when 265034 is divided by 6464. 10 Calculate the remainder when 73071 is divided by 24353. 12 What is the remainder when 9457 is divided by 4724? 9 What is the remainder when 2153 is divided by 7? 4 Calculate the remainder when 1451 is divided by 1347. 104 Calculate the remainder when 701560 is divided by 609. 601 Calculate the remainder when 55027 is divided by 27453. 121 Calculate the remainder when 45610 is divided by 126. 124 Calculate the remainder when 16485 is divided by 47. 35 What is the remainder when 8714 is divided by 80? 74 Calculate the remainder when 2189 is divided by 275. 264 Calculate the remainder when 3313 is divided by 26. 11 What is the remainder when 219673 is divided by 442? 441 What is the remainder when 1033 is divided by 107? 70 What is the remainder when 66157 is divided by 607? 601 What is the remainder when 20653 is divided by 73? 67 What is the remainder when 8160 is divided by 106? 104 Calculate the remainder when 15710 is divided by 212. 22 What is the remainder when 8453 is divided by 5? 3 What is the remainder when 30369 is divided by 99? 75 Calculate the remainder when 21165 is divided by 58. 53 What is the remainder when 12870 is divided by 65? 0 Calculate the remainder when 47236 is divided by 844. 816 Calculate the remainder when 3069 is divided by 32. 29 Calculate the remainder when 1017739 is divided by 168. 163 Calculate the remainder when 18445 is divided by 419. 9 Calculate the remainder when 731606 is divided by 8922. 2 What is the remainder when 230673 is divided by 1891? 1862 Calculate the remainder when 18123 is divided by 9. 6 What is the remainder when 12993 is divided by 811? 17 What is the remainder when 946 is divided by 183? 31 Calculate the remainder when 1910 is divided by 560. 230 What is the remainder when 2120 is divided by 96? 8 What is the remainder when 731 is divided by 119? 17 What is the remainder when 355 is divided by 115? 10 What is the remainder when 1032 is divided by 750? 282 What is the remainder when 10130 is divided by 13? 3 What is the remainder when 10313 is divided by 167? 126 Calculate the remainder when 251440 is divided by 45. 25 Calculate the remainder when 813 is divided by 411. 402 Calculate the remainder when 363835 is divided by 9. 1 Calculate the remainder when 29230 is divided by 406. 404 Calculate the remainder when 655 is divided by 12. 7 What is the remainder when 1153 is divided by 145? 138 What is the remainder when 17063 is divided by 5519? 506 Calculate the remainder when 531 is divided by 111. 87 Calculate the remainder when 16277 is divided by 16212. 65 Calculate the remainder when 7367 is divided by 205. 192 What is the remainder when 81110 is divided by 161? 127 What is the remainder when 2119 is divided by 141? 4 What is the remainder when 58945 is divided by 634? 617 Calculate the remainder when 68593 is divided by 11421. 67 Calculate the remainder when 26799 is divided by 400. 399 What is the remainder when 4669 is divided by 57? 52 What is the remainder when 57396 is divided by 205? 201 Calculate the remainder when 20840 is divided by 219. 35 What is the remainder when 1806 is divided by 130? 116 What is the remainder when 1432 is divided by 593? 246 What is the remainder when 9122 is divided by 27? 23 What is the remainder when 1890 is divided by 238? 224 What is the remainder when 109035 is divided by 31? 8 What is the remainder when 42220 is divided by 2? 0 Calculate the remainder whe	{ "pile_set_name": "DM Mathematics" }
4a2. Calculate gk(b) + so(b). 4b*3 Let h(f) = 40f - 114f + 1 + 36f + 39f. Let n(x) = -x. Calculate -2h(r) - 4n(r). 2r - 2 Let l(h) = -2559h2 - 5h + 6 + 2592h2 - 6. Let t(n) = 280n*2 - 42n. What is 42l(j) - 5t(j)? -14j2 Suppose r - 42 = -13r. Let b(p) = 3p2 - 3 - p3 - 1 + 2p + 2. Let z be b(r). Let t(n) = 6n2 - 9n. Let l(d) = -3d2 + 4d. What is zt(k) + 9l(k)? -3k2 Let x(h) = 20h*2 + 3h + 12. Let q(y) = -21y2 - 3y - 10. Calculate -6q(w) - 5x(w). 26w2 + 3w Let u be (0 + -4)/(6/(-6)). Let n(w) = 3w2 + 4w + 5. Let q(v) = 4v2 + 3v + 4. Give uq(t) - 3n(t). 7t2 + 1 Let i(o) = -309o*2 + 3o + 2. Let k(b) = 310b2 - 5b - 3. Determine 6i(h) + 4k(h). -614h2 - 2h Let o(g) = 5g2 + 3g. Suppose 7 = -5k + 92. Let l(y) = 3y*2 + 5y + ky + 17y*2 + 16y*2. What is 6l(m) - 44o(m)? -4m*2 Let h(a) = 24a*2 + 30. Let z(q) = -12q*2 - 16. Determine -4h(s) - 7z(s). -12s*2 - 8 Let y(f) = 4f*2 - 23f - 35. Let r(s) = -s*2 + 5s - 1. Determine 5r(i) + y(i). -i2 + 2i - 40 Let l(p) be the first derivative of 7p2/2 + 4p - 50. Let t(w) = -8w - 5. Let d(g) = -g2 - 4g + 1. Let r be d(-3). Give rt(b) + 5l(b). 3b Let i(m) = 347 - 156 - 24m*2 - 188. Let u(q) = 49q*2 - 7. Calculate -7i(s) - 3u(s). 21s*2 Let u(a) be the first derivative of 8a*3/3 - 7a*2/2 + 7a + 198. Let j(c) = c*2 - c + 1. Calculate -42j(b) + 6u(b). 6b*2 Let l(q) be the first derivative of 7q*3/3 + 2q + 169. Let r(c) = 6c2 + 2. What is 3l(n) - 2r(n)? 9n*2 + 2 Let a(x) = -9x3 + x2 + 6. Let l(n) = 5 - n*2 - 8n3 - n2 + 4n2 - n2. Let u = -18 + 12. Give ul(t) + 5a(t). 3t3 - t2 Let h(f) = -11f3 + 6f*2 - 6f + 6. Let i(o) = 37o3 - 25o*2 + 25o - 25. Let l(u) = -2u3. Let t(n) = i(n) - 4l(n). Calculate -25h(m) - 6t(m). 5m3 Let y(j) = 120j*2 + 45j - 45. Let x(u) = -26u + 11u + 4 - 11u2 + 11u. What is -45x(n) - 4y(n)? 15n2 Let w(g) = -8g*2 + 3. Let x(a) = 6a*2 + 909 + 11a*2 - 916. What is -7w(y) - 3x(y)? 5y*2 Let r(z) = 5z3 - z2 + 7z + 3. Let g(q) = 3q*2 - q. Let k(s) = 3g(s) + r(s). Let d(f) = 9f3 + 15f*2 + 7f + 5. Calculate 3d(u) - 5k(u). 2u3 + 5u*2 + u Suppose 0n + 3n = c + 7, 2n + 4c = 14. Let a(u) = -4u + 5 - 53un - u + 56u*3. Let b(v) = -12v*3 + 21v - 21. Calculate -21a(z) - 5b(z). -3z3 Let l(j) = -2j + 1. Suppose -152 - 69 = -13y. Let o(f) = -6f + 2. Calculate yl(w) - 6o(w). 2w + 5 Let i(m) = -47m*2 - 18m + 51. Let d(o) = 12o2 + 4o - 13. What is 9d(q) + 2i(q)? 14q2 - 15 Let j(q) = -q - 4. Suppose -3n - 15 = 3t, -t + 0 = -4n - 5. Let v = t + 6. Let c(m) = -m - 7. Give vc(x) - 5j(x). 2x - 1 Let n(d) be the second derivative of d3/2 - 2d*2 + 250d. Let m(p) = 5p - 6. Calculate 5m(u) - 7n(u). 4u - 2 Let b(z) = -10z3 - 13z*2 + 13z + 13. Let t(u) = -4u2 + 103u*3 + 4u*2 - 98u*3 + 6u*2 - 6 - 6u. What is -6b(l) - 13t(l)? -5l3 Let k(q) = -4q*2 + 6q - 1. Let y(o) = -2o2 + 3o. Let m(l) = 3k(l) - 5y(l). Let s(i) = 1. Calculate m(n) + 3s(n). -2n*2 + 3n Let n(i) = -3i3 + 7i - 7. Let u(v) = -v*3 + 3v - 3. Let a(s) = -s + 2. Let l be a(-2). Let k be (-4 + l + -7)1. Determine ku(o) + 3n(o). -2o*3 Let r(m) = -7m + 35. Let p be r(4). Suppose -i - pi = 40. Let t(n) = -n3 - n + 1. Let y(k) = -3k*3 - 5k + 6. What is it(d) + y(d)? 2d*3 + 1 Let d(n) = -13n*3 + 11n*2 - 15n - 3. Let f(l) = -l*2 - 36l + 48. Let x be f(-37). Let h(t) = 7t3 - 6t*2 + 8t + 1. Calculate xh(m) + 6d(m). -m*3 - 2m - 7 Let n(o) = -o3 + o2. Let a(w) = 30w2 - 202w - 35w3 + 202w. Calculate -a(i) + 30n(i). 5i*3 Let l(z) = 1 + 97z - 287z + 94z + 95z. Let y(g) = -7g + 9. Let i = -29 - -11. What is il(j) + 2y(j)? 4j Let t(v) = -6v*2 + 526v + 10. Let w(g) = -g*2 + 106g + 2. Give 3t(p) - 16w(p). -2p2 - 118p - 2 Let k(a) = -874a3 - 2a*2 + 6. Let t(d) = -478077d*3 - 1095d*2 + 3285. Give 1095k(l) - 2t(l). -876l*3 Let s(v) = -8v*2 - 2v - 27. Let b(t) = -t*2 + 1. What is 5b(l) - s(l)? 3l2 + 2l + 32 Let b(d) = d*2. Let s = -78 - -87. Suppose 0 = sz - 1 - 35. Let c(n) = -2n2 - n - 2. Determine zb(l) + c(l). 2l2 - l - 2 Suppose 0 = -5k + 14 - 44. Let u(s) = 1. Let n(w) be the second derivative of w3/6 - w2 + 999w. Let x = -1 + -2. What is ku(h) + xn(h)? -3h Let h = 4 + -7. Let s(x) be the third derivative of -x*4/24 + 2x*2 + 514. Let m(n) = -2n + 1. Give hm(c) + 4s(c). 2c - 3 Let g(b) = -b2 + 5b - 7. Let r(f) = f*2 - 6f + 6. Calculate -4g(c) - 5r(c). -c*2 + 10c - 2 Let t(o) = 11o3 + 7o*2 - 7o - 2. Let a(f) = -9f3 - 7f*2 + 6f + 2. Calculate -5a(y) - 4t(y). y*3 + 7y*2 - 2y - 2 Let d(f) be the third derivative of 12f5/5 - 7f*4/6 - 1021f*2. Let j(l) = 16l*2 - 3l. Calculate 3d(n) - 28j(n). -16n2 Let y(s) = s2 - 5s + 6. Let f(a) = a*2 - a + 1. Suppose -5d + 4x - 47 = 0, -d + 2 = 2x + x. Let w be (0 - -1)(-2 - 21/d). Determine wy(h) - 3f(h). -2h*2 - 2h + 3 Let d(f) = 9f3 + 7f*2 - f - 10. Let a(w) = -3w - 13 - 12 + 6w3 + 2w + 5w2 + 18. Give 7a(i) - 5d(i). -3i*3 - 2i + 1 Let s(b) = 56b2. Let q(f) = 555f*2 + 74f. Let k(a) = 8a2 + a. Let l(w) = -74k(w) + q(w). Give 8l(r) + 5s(r). -16r2 Suppose 0 = k - 3k. Let n = 782 + -780. Suppose ka - 4 = na. Let d(v) = -13v - 7. Let p(i) = -4i - 2. Determine ad(w) + 7p(w). -2w Let j(p) = -2p - 3p - 815 + 813. Let n(s) = 5s + 2. What is -3j(k) - 4n(k)? -5k - 2 Let j(r) = 27r*3 - 6r*2 + 3r + 14. Let g(s) = 28s3 - 5s*2 + 3s + 12. What is -6g(a) + 5j(a)? -33a3 - 3a - 2 Let g(c) = 8c2 + 5. Let f(s) = s2 + s - 1. Let r(z) = 6z*2 + 5z - 4. Let h(n) = -5f(n) + r(n). Determine g(o) - 6h(o). 2o2 - 1 Let n(x) = -6x*2 + 24x + 5. Let r(t) = 3t2 - 13t - 3. What is 4n(i) + 7r(i)? -3i2 + 5i - 1 Let j(o) = 116o3 + 4o*2 + 5o + 6. Let b(i) = -116i3 - 4i*2 - 6i - 7. What is -5b(w) - 6j(w)? -116w3 - 4w*2 - 1 Let g(i) = 5i*3 - 7i*2 + 11i + 26. Let v(r) = -2r3 + 3r*2 - 5r - 13. What is 3g(a) + 7v(a)? a*3 - 2a - 13 Let z(y) be the second derivative of -2y3/3 - 3y*2 + 7y. Let v(g) = -g - 1. Determine -14v(x) + 3z(x). 2x - 4 Suppose 0 = -2o + 14 + 32. Let r = o - 19. Suppose v - 2 = -3. Let h(k) = -1. Let q(a) = -2a3 + 2a - 1. Determine rh(x) + vq(x). 2x3 - 2x - 3 Let i(d) be the first derivative of -11d4/4 - 4d*3/3 - 5d*2 - 7d + 375. Let z(a) = 6a3 + 2a*2 + 5a + 4. Give -4i(u) - 7z(u). 2u3 + 2u*2 + 5u Let w(d) be the second derivative of -2d2 + 2/3d*3 - 11d - 1/4d4 + 0. Let l(o) = -7o*2 + 9o - 9. What is 4l(a) - 9w(a)? -a2 Let g(v) = -v2 - v - 2. Let i(t) = -9t2 - 5t + 5. What is 5g(b) - i(b)? 4b*2 - 15 Let p(q) = 26q + 124. Let g(n) = 2n - 1. What is 12g(j) - p(j)? -2j - 136 Let r(v) = v2 + 11v + 5. Let t(g) = -16g2 + 4g - 4. Let k(m) = -7m2 + m - 2. Let n(u) = 7k(u) - 3t(u). Calculate 7n(z) + 3r(z). -4z*2 - 2z + 1 Let h(g) = 7g3 - 3g*2 - 5g. Let v(b) = -4b2 - 246b + 260b - 20b*3 + 9b*2 + 3b*2. Calculate -8h(l) - 3v(l). 4l*3 - 2l Let s(f) = 9f2 - 16f - 7. Let t(o) = -5o2 + 20o + 16. Let m(l) = 2l + 2. Let i(h) = -6m(h) + t(h). What is -5i(d) - 3s(d)? -2d2 + 8d + 1 Let u(b) = 7b3 - 2b. Suppose 0 = -3d - d - 8. Let y = -25127 + 25128. Let r(t) = t3 - t + 1. Give dr(k) + yu(k). 5k*3 - 2 Let d(i) = 8i + 1. Let o(c) = 2c. Let h(b) = -2b*3 - 11b*2 + 5b - 4. Let g be h(-6). What is gd(q) - 9o(q)? -2q + 2 Suppose -112 + 88 = -12h. Let m(z) = -65z2 - 13. Let o(i) = -11i*2 - 2. Determine hm(f) - 13o(f). 13f*2 Suppose -4k = 28 - 0. Let o = 51 - 55. Let d(p) = 5p2 + p + 1. Let x(c) = -9c*2 - 2c - 2. What is kd(b) + ox(b)? b*2 + b + 1 Let x(k) = 5k*2 - 14k + 17. Let a(v) = -20v2 + 64v - 67. Give 2a(n) + 9x(n). 5n2 + 2n + 19 Let m(i) = -4i. Let x(h) = h3 + 2h*2 - 2h - 1. Let q be x(2). Let f(r) = 16 - 2r + q - 27. What is -3f(p) + 2m(p)? -2p Let w(z) = 110z3 - 10z*2 + 4z + 5. Let l(t) = 5	{ "pile_set_name": "DM Mathematics" }
8 + 2561.6492. Let k = f + -10549688.000017. Let o = k + -41. Round o to 5 decimal places. -0.00002 Suppose 3m - 2m - 7 = 0. Let v = -3 + m. Suppose 3u - 41806 = 6f - vf, 10 = 5u. What is f rounded to the nearest 1000? -21000 Let h = 168.9 + -128. Round h to the nearest ten. 40 Suppose -6w = 2n - w - 9, -n + 2w = 0. Let a be n - (-165)/(6/2). Let s be a(3/9 + 0). What is s rounded to the nearest 10? 20 Let x = 5 - 3. Let n(y) = 7y2 - x - 6y - 7 + 4. Let u be n(5). What is u rounded to the nearest 100? 100 Let w = 3.681 + -3.89099. Let r = w - -0.21. What is r rounded to 5 dps? 0.00001 Let s = -5 - -5.01. Let j = -0.01006 + s. Let m = j - 0. Round m to five dps. -0.00006 Let p = 0.129 - 0.12. Let v = -51.991 - p. Let u = 52.0074 + v. What is u rounded to three decimal places? 0.007 Let i = 79.5 + -79.50001354. What is i rounded to six dps? -0.000014 Let r = 6230 - -13546. Let s = r - 10476. Round s to the nearest one thousand. 9000 Let j = 3.75 - 239.75. Let m = -232.62 - j. What is m rounded to one dp? 3.4 Let h = 396 - 396.00000597. What is h rounded to 7 dps? -0.000006 Let m = 74.0313 + -74. What is m rounded to two dps? 0.03 Let q = 28.19949 - 28.2. What is q rounded to 4 dps? -0.0005 Suppose 0 = o - 1, 4s - 3o + 5 - 34 = 0. Suppose -1980000 = -5m + sm. What is m rounded to the nearest one hundred thousand? -700000 Suppose 2f = -5d + 24114595 - 64974585, 0 = -f + 3d - 20430006. Round f to the nearest 1000000. -20000000 Let k = -0.24 - 17.76. Let p = -17.28 - k. What is p rounded to one dp? 0.7 Let o = 259.9999955 - 260. What is o rounded to 7 dps? -0.0000045 Let u be (10/9)/(-5) + (-102060222)/(-27). Suppose 4y - 3y - 22 = -2q, -34 = -3y + 2q. Let p be u/14 + (-8)/y. What is p rounded to the nearest 10000? 270000 Let k = -16.07 - -22.03. What is k rounded to the nearest integer? 6 Suppose -167269 - 4828477 = -h. Let n = -7895746 + h. Round n to the nearest 1000000. -3000000 Let r(s) = -4687s3 + 12s*2 + 66s + 32. Let t be r(-16). Round t to the nearest 1000000. 19000000 Let z = -14642.80558 - 0.19442. Let s = -14623.0005 - z. Let x = s - 20. Round x to three dps. -0.001 Let n = 366 - 347.3. Let f = -0.3 - n. Let d = f + 19.116. What is d rounded to two decimal places? 0.12 Suppose 0 = 9h + 56796310 - 205116310. What is h rounded to the nearest one hundred thousand? 16500000 Let j = 1104.000000597 + -1104. Round j to 7 dps. 0.0000006 Let k = -3031 + 6263. Let s be (1 + 1)/1 - k/1. What is s rounded to the nearest 1000? -3000 Let i(v) be the first derivative of 0v + 0v2 - 7 - 2/3v*3 + 32031/2v*4. Let a be i(-4). What is a rounded to the nearest 1000000? -4000000 Let b = 2566992 + -2566991.8770207. Let f = -0.123 + b. Round f to 6 decimal places. -0.000021 Let x = -868 - -867.266. What is x rounded to 2 decimal places? -0.73 Let g = -25.044 - -0.044. Let v = -25.00000016 - g. Round v to 7 decimal places. -0.0000002 Let p = -5.051 - -0.031. Let o = p + 5.01999779. Round o to 7 dps. -0.0000022 Let v(k) = 15k*3 + 11k*2 + 6. Let d(c) = 22c*3 + 16c*2 + 9. Let s(o) = -5d(o) + 7v(o). Let h be s(3). What is h rounded to the nearest 10? -170 Suppose 5t - 37 - 173 = 0. Suppose -t = q - 12. Let m be (1125/q)/(3/1040). Round m to the nearest 10000. -10000 Let v = 0.068 + 40.332. Let i = -33 + v. What is i rounded to the nearest integer? 7 Let k(q) = -3519q + 148. Let c be k(-8). What is c rounded to the nearest 10000? 30000 Let i(t) = 7t - 6. Let r(n) = -n. Let z(y) = -i(y) - 6r(y). Let v be z(6). Suppose v = 6x - 10x - 128000. Round x to the nearest ten thousand. -30000 Let o = -22 - -28.76. Round o to the nearest integer. 7 Let a = -39.1 + 2.1. Let f = a - -37.00004. What is f rounded to five decimal places? 0.00004 Let s = 40.044 - -14.888. Let l = -0.068 - s. Let m = l - -55.000082. Round m to five dps. 0.00008 Suppose 5s + 31 = -69. Let y = s - -28. Let n(c) = 1758c3 - 2c*2 + 4c. Let b be n(y). What is b rounded to the nearest 100000? 900000 Let u be 2/(-8) - (-18)/8. Suppose -457x = -455x - 1380000. Suppose uw + w = -x. What is w rounded to the nearest one hundred thousand? -200000 Suppose 0 = -2d - h + 21, -8d + 4h = -3d - 59. Let u(k) = 260k + 10. Let p be u(d). Round p to the nearest 100. 2900 Let n = -454 + 97. Let m = n - -357.000239. What is m rounded to five dps? 0.00024 Let o = 652 + -651.997778. What is o rounded to 4 dps? 0.0022 Let v(c) = 2c2 - 9c - 33. Suppose -5g = -2w - 46, 30 = -4g + 8g - 5w. Let l be v(g). What is l rounded to the nearest ten? 80 Let a be (-5)/1(-31632)/24. Round a to the nearest 100. 6600 Let y(t) = -264076t2 + 1. Let b be y(-1). Let u = -24309 + 59384. Let c = u + b. Round c to the nearest ten thousand. -230000 Let k(g) = -5247g*3 + 3g*2 - 8g + 10. Let z be k(-5). What is z rounded to the nearest one hundred thousand? 700000 Suppose -2u = -4t - 20002, 4t + 15002 = t + 2u. Let p = -93 - -92. Let c be (p + -219)/((-10)/t). Round c to the nearest 10000. -110000 Let z = 1.9099987 + -1.91. Round z to 7 decimal places. -0.0000013 Let f(c) = -52c3 + 3c*2 + 7c + 2. Let u be f(-6). What is u rounded to the nearest one thousand? 11000 Let g = 8.5 - 15. Let f = 7.619128 + -1.119182. Let k = f + g. Round k to five decimal places. -0.00005 Suppose 0 = 2o + 125184 - 24984. Round o to the nearest ten thousand. -50000 Let d = -69.944 + 70. Let j = d - -17.544. Round j to the nearest ten. 20 Let x = -204 + 87. Let g = -117.00000047 - x. Round g to 7 decimal places. -0.0000005 Let g = -0.031 + 0.031981. Round g to four decimal places. 0.001 Let k(c) = -7 - 192c*3 + 4c*2 + 2c*2 - 11c + 8 + 7. Let d = 9 + -1. Let y be k(d). Round y to the nearest 10000. -100000 Let g = 172.8 - 272. Round g to the nearest integer. -99 Let l = -5094002.81499937 + 5094031.815. Let t = 29 - l. Round t to 7 dps. -0.0000006 Let y(k) = 4k - 2. Let h be y(2). Suppose -2m = -hm. Suppose m = 4q - 5l - 7199985, -4q + 4l = -0l - 7199988. Round q to the nearest one million. 2000000 Let r = -34.479 - -34.7. Let i = 147.29898 - 147.08. Let m = i - r. Round m to 4 dps. -0.002 Let j(p) = -72p2 + 3p + 1. Let x = -7 + 5. Let f be j(x). Let t = f - -193. What is t rounded to the nearest 1000? 0 Let d = 0.157392 - 0.1573. Round d to four decimal places. 0.0001 Let m = -33 - -38. Suppose 258000 = 11l - ml. Round l to the nearest 10000. 40000 Suppose -60g + 58g = 1162000. What is g rounded to the nearest 10000? -580000 Let u = -11 + 10.9. Let z = u + 0.099. Round z to 2 decimal places. 0 Let j(b) = -34331b - 289. Let h be j(-19). Round h to the nearest 100000. 700000 Let z = 529 - 528.99999412. What is z rounded to 6 decimal places? 0.000006 Let n = 1 - -9. Let g(r) = 10102r - 20. Let q be g(n). What is q rounded to the nearest ten thousand? 100000 Let x be (-4)/18 + 7207/(-9)-26. What is x rounded to the nearest 1000? 21000 Let y(r) = 4887r - 17. Let b be y(21). Suppose -d = k + 2d - 34215, -3k - 2d + b = 0. Round k to the nearest 1000. 34000 Let o = 1.14 + -0.04. Let l = 1.1000025 - o. Round l to six dps. 0.000003 Let c be 398915988/28 - (-33)/77. Round c to the nearest one hundred thousand. 14200000 Let m = -0.83 - -1.6. Let d = -0.77438 + m. Round d to three decimal places. -0.004 Let l = -234186 - -234186.1099985. Let a = -0.32 + 0.21. Let g = a + l. Round g to six decimal places. -0.000002 Let o = -2690872.8200001 - -2690911.82. Let d = 39 - o. What is d rounded to 7 dps? 0.0000001 Let x = -86.9 + 86.8998321. Round x to five dps. -0.00017 Let k = 97 + -109.18. What is k rounded to 1 decimal place? -12.2 Let n be (-289)/(-3) + 4/(-12). Suppose -g = g + n. What is g rounded to the nearest ten? -50 Let s(w) = 36944w*2 - 2w - 7. Let r(p) = p + 1. Let b(d) = -5r(d) - s(d). Let z be b(6). Round z to the nearest one hundred thousand. -1300000 Let g = 3.697 - 3.54. Let l = g - 1.247. Round l to one decimal place. -1.1 Let w(f) = 2f + 41. Let x be w(-15). Suppose xr = 16r + 122000. Round r to the nearest one thousand. -24000 Let a = 708073 - -603927. What is a rounded to the nearest ten thousand? 1310000 Suppose 5f = -20, -3h = -5f - 1 - 1. Let t = 1 - h. Let k = -1 - t. What is k rounded to the nearest ten? -10 Suppose -5f = 2*r + 5	{ "pile_set_name": "DM Mathematics" }
in -449, 5, -4? -4 Which is the closest to -25? (a) -3/5 (b) 501 (c) 2/17 a Which is the nearest to 1? (a) 0.4 (b) 0.16 (c) -3 (d) -2/15 (e) -2/63 a What is the closest to -0.1 in 0.2, -34/7, -0.0674, 4? -0.0674 What is the closest to 40 in -4/23, 6, -4? 6 Which is the nearest to 3? (a) 4 (b) 267/4 (c) -2/9 (d) 15 a Which is the closest to -0.2? (a) -5/176 (b) 0.5 (c) -1 (d) 10 (e) 3 a What is the nearest to 61 in 1, 118, -2? 118 Which is the nearest to 8/7? (a) -0.4 (b) 128.8 (c) -2 a Which is the nearest to -2314? (a) 1/2 (b) -1 (c) 5 (d) -0.4 b Which is the closest to 0.2? (a) 2/5 (b) 0.3 (c) 16 (d) -0.027 b What is the nearest to -1 in -1/2, 2/15, 5, -3/8, -0.011? -1/2 What is the closest to 25 in 0.5, -7, -0.1, -0.3? 0.5 What is the closest to -16/5 in -0.3, -13/152, 3? -0.3 What is the closest to -105 in -5, 1/9, -0.82, -8? -8 Which is the nearest to 0.1? (a) 0.01 (b) -2/15 (c) -1444 (d) -8 a Which is the nearest to 2/31? (a) 0 (b) 3/7 (c) -5 (d) 3/233 d Which is the closest to 1? (a) -4/3 (b) 765/157 (c) 10 (d) -2 a What is the closest to 1/5 in 1/8, 10/9, -1/7? 1/8 Which is the nearest to -2? (a) -12 (b) -1.2 (c) -1 (d) 42 b Which is the closest to 3? (a) -100 (b) -3 (c) 10 (d) 0.5 d Which is the nearest to 239? (a) 5 (b) 5.01 (c) 2/13 b Which is the closest to 1? (a) -28 (b) 7 (c) -2/9 c What is the nearest to -4 in -0.2, 0, -39, -1/6? -0.2 What is the nearest to 3/44 in -0.2, 3.6, 2, -2? -0.2 What is the nearest to 0 in -1, -68, -22, 6? -1 Which is the closest to 0? (a) 0.4 (b) -5 (c) 4/3 (d) 22 (e) 1 a What is the nearest to -1 in 1/2, -4, 18, -2/7? -2/7 What is the closest to -15/8 in -0.9, 1/3, -17, 2? -0.9 Which is the nearest to 32213? (a) -0.4 (b) -4 (c) 3 (d) -0.2 c Which is the nearest to -8/11? (a) -4 (b) -1 (c) 38 (d) 2 (e) -0.1 b Which is the nearest to 0.2? (a) -2/10667 (b) 1/6 (c) 1/2 b Which is the nearest to 2? (a) -0.5 (b) -2 (c) -2/49 (d) -5/3 c Which is the nearest to -2.2? (a) 5 (b) 5/4 (c) 2/7 (d) 42 (e) -3 e Which is the nearest to 2/5? (a) -725 (b) -1/4 (c) -5 (d) 198 b What is the nearest to 30/5441 in 1/4, -0.03, 5? -0.03 What is the nearest to 2/33 in 0.4, -5/3, -8? 0.4 Which is the nearest to 226? (a) 0.2 (b) -4/5 (c) -1 (d) 2/7 (e) -2/29 d Which is the nearest to 1/131? (a) 156 (b) 5 (c) -1/7 c Which is the nearest to 2157? (a) 0.036 (b) 2 (c) -4 b What is the nearest to -323 in 6, -2/13, 0? -2/13 Which is the nearest to 1? (a) 0.2 (b) -25/3 (c) -3/64 a Which is the nearest to 2/3? (a) 0.5 (b) 0.2798 (c) -0.4 a Which is the closest to -1? (a) 36/7 (b) -1 (c) -4 (d) -2/7 b What is the closest to -2/5 in 0.5, 173, 0, 3/5? 0 What is the nearest to -0.18 in 0.5, -8/7, 171, -1/8? -1/8 What is the nearest to 0.3 in 0.4, 1, -4, -1032, -4/7? 0.4 What is the closest to 1/2 in 3, 0.1, 4/9, 761, 4/7? 4/9 Which is the nearest to -0.22? (a) -2 (b) -2/46359 (c) -3/2 b What is the nearest to 0.1 in -291, -1, 2/9, 1? 2/9 What is the nearest to 10 in -37, 0.7, 8, 0.1? 8 Which is the nearest to -2/5377? (a) 1/4 (b) -0.1 (c) -3/8 b Which is the nearest to 0? (a) -0.4 (b) -4/13 (c) -3 (d) -19/2 b What is the nearest to -0.17 in -5, 0.5, -2, -373, -0.4? -0.4 Which is the closest to -1/2? (a) 3 (b) 40 (c) 1/2 (d) 3/4 (e) 19 c Which is the closest to 0.3? (a) 13 (b) -2 (c) -3 (d) 67 b What is the nearest to 2/3 in -137, 18, -0.2? -0.2 Which is the nearest to -441/10? (a) 3.7 (b) -0.3 (c) 1 b Which is the closest to 1? (a) -0.14 (b) 0.5 (c) -92 (d) 5 b Which is the closest to -2? (a) 5 (b) 4 (c) 807.3 (d) 0 d Which is the nearest to 0.22? (a) -84/5 (b) -4/7 (c) 5/4 b Which is the nearest to 1? (a) -2/7 (b) 0 (c) -415/8 (d) 2/9 d Which is the nearest to 0.14? (a) 7/3 (b) 4 (c) -43 (d) -5 (e) 1 e Which is the closest to -1? (a) -6/11 (b) 0.2788 (c) 1/2 (d) -0.1 a Which is the closest to -310/49? (a) -5 (b) -1 (c) -0.1 a Which is the nearest to -3975? (a) -4 (b) 0.4 (c) -0.4 a Which is the nearest to 2? (a) 0.053 (b) 0.4 (c) 0.5 (d) -0.6 (e) 1.6 e What is the nearest to -1 in 0.2, 0.832, 1/4, -2/5, -5/4? -5/4 Which is the closest to 1/4? (a) -8/13 (b) 1/3 (c) 4 b Which is the nearest to 1? (a) -6 (b) 115 (c) -0.33 c Which is the nearest to 4? (a) 74 (b) 4 (c) 2 b Which is the closest to 1/36? (a) -0.8 (b) 3 (c) 2.3 (d) -0.3 d What is the nearest to -12/7 in 80, -4, 2, -0.07? -0.07 Which is the nearest to -10? (a) 4/7 (b) -1 (c) 0.2 (d) 318/5 b What is the nearest to -1 in -0.8, 319/5, 0.8? -0.8 What is the closest to 0.3 in -15, -0.3, -162? -0.3 What is the nearest to -2/3 in 3, -5, 2/3, 1, -0.07? -0.07 What is the nearest to -32 in -0.3, -2/17, 3/31, 1/6, 1/9? -0.3 What is the closest to 1.2 in 0.5, 5, -2/9, -3/4, -2/3? 0.5 Which is the closest to -68? (a) -2/23 (b) -24 (c) -1/3 b What is the nearest to 0 in -2/7, 7453, -1? -2/7 What is the nearest to 1 in -0.261, 5, 0, 1? 1 What is the nearest to -1 in -0.6, 0, -3, -7, 0.04? -0.6 What is the nearest to 2/17 in 5/7, -3, 7, 3, -5? 5/7 What is the closest to 1 in -5, 0.015, -22, -2, 3? 0.015 What is the closest to 1/4 in -90, -1, -6/5, 5, -0.3? -0.3 Which is the nearest to 0.3? (a) -0.5 (b) -40 (c) -25 (d) -6 (e) 1 e What is the nearest to 1 in -1, 0.1, 4/2993, -0.1, -5? 0.1 What is the closest to 1 in -311, -0.4, -32, 0.5, -8? 0.5 Which is the nearest to -2/11? (a) 1/3 (b) 5 (c) -3/2 (d) -3 (e) 2/9 e Which is the closest to 3/4? (a) -7 (b) 0.02819 (c) 7 b What is the closest to -2 in 3, 0.088, -15? 0.088 What is the closest to -0.1 in -2/3, -3, -0.03, 0.13, -1/7? -1/7 Which is the nearest to -0.1? (a) 4/5 (b) 29/8 (c) -4 (d) 7 a Which is the nearest to 1? (a) -177 (b) -3 (c) 876 (d) -0.4 d What is the nearest to 21 in -0.11, 1/5, 5/2, 2/3? 5/2 What is the nearest to -79 in 4, 1/2, 0.2, 2, 0.09? 0.09 Which is the nearest to -39? (a) -4 (b) -6 (c) 23 b What is the closest to -2.013 in 7, 5/3, 1/6, -2/5? -2/5 What is the closest to -2 in 18242, 4/7, -0.4, 1? -0.4 Which is the closest to -9? (a) 0.3 (b) 24 (c) 4 (d) -1/21 d Which is the nearest to 1? (a) 14 (b) -0.04 (c) 2/117 c Which is the nearest to -1/4? (a) -3975.4 (b) 0.1 (c) -3 b What is the nearest to 0.1 in -3/4, -0.001, -1/8, 11, 0.5? -0.001 What is the nearest to -0.01 in -2, -9, -6, -7/6, -2/7? -2/7 Which is the closest to -1? (a) 508.9 (b) 3 (c) -2 (d) 1 c Which is the nearest to 1/10? (a) -4 (b) -0.4 (c) -4/9 (d) -0.3 d What is the closest to 0.04 in 24, 94, -0.5, -0.2? -0.2 Which is the closest to 0.5? (a) 2 (b) 0.2 (c) -5 (d) 1/4 (e) 5 d What is the closest to -1985 in -6, 2/9, 5? -6 Which is the closest to -6? (a) -37/3 (b) 2 (c) -188 (d) 1 a Which is the closest to 2/149? (a) -19 (b) -3 (c) 0.9 (d) -5 c Which is the closest to -0.04? (a) -1/3 (b) -0.5 (c) 4821 a Which is the closest to 1? (a) 3 (b) 13963 (c) 2 (d) 0.9 d Which is the closest to 0.3? (a) 3 (b) 4/3 (c) -3 (d) -632 b What is the nearest to 9611 in 0.3, -0.3, 11/2? 11/2 Which is the nearest to 11.9038? (a) 1/7 (b) 0.1 (c) -1 a What is the closest to 0.4 in 28/5, 11, -0.3? -0.3 What is the nearest to 0 in 2, -2/21, -376, 1/2? -2/21 Which is the closest to -4/25? (a) -4 (b) 4 (c) -1.7 (d) 2/13 d Which is the closest to 9? (a) -4/7 (b) 0.5 (c) -13 (d) 0 b Which is the closest to 0.1? (a) -1 (b) -2 (c) 2 (d) 0.0289 (e) 3/5 d Which is the closest to 1.5? (a) -5 (b) 327 (c) -3 c What is the closest to -3/7 in -99, 1.2, -2/15? -2/15 What is the closest to -32 in -0.05, 19, 1/3, -0.4? -0.4 Which is the closest to -1.8? (a) -5 (b) -48 (c) 0 (d) 60 c Which is the nearest to -72? (a) 0.2 (b) -0.1 (c) 33/65 b Which is the nearest to 2? (a) -0.2 (b) -2/369 (c) -8 (d) -5 b Which is the closest to -0.1? (a) 3 (b) -0.2 (c) -1160 (d) -3/2 b Which is the closest to 0.041266? (a) -2 (b) -0.5 (c) -2/7 c Which is the nearest to 2? (a) -0.31 (b) 2 (c) 1 b Which is the closest to -1357? (a) 8 (b) 0 (c) 4 (d) -0.2 d What is the closest to -1/4 in 43.4, 4, -5/2, -4? -5/2 Which is the closest to 14/15? (a) 4/5 (b) -7/6 (c) 51/11 a What is the nearest to 2 in -4, -2, 1410? -2 Which is the n	{ "pile_set_name": "DM Mathematics" }
= x + 1. Let t = 6 + -2. Let b be z(t). Give a(b). 6 Let v(u) be the second derivative of -u*3/3 - 2u2 - u. Let t = 155 + -152. Calculate v(t). -10 Let v = 31 + -37. Let h(d) = -d3 - 6d2 - 6. Calculate h(v). -6 Let r(q) = -9q*3 - q - 1. Let b be (6/9)/((-6)/(-27)). Suppose 4h - b = -11. Let t = -3 - h. What is r(t)? 9 Let w(y) = -y*2 - 4y - 2. Let v(a) = -a - 5 + 3a2 + 0 + 4. Let p be v(-1). Suppose pt + 17 = -5r, -2r - 2 = 2t + 4. Calculate w(r). -2 Let v(h) = h - 6. Let q(i) = -i3 - 5i*2 + 7i + 9. Let j = -14 + 8. Let m be q(j). What is v(m)? -3 Let d(b) = -7b2 - 5b + 5. Let m(f) = 15f2 + 10f - 11. Let p(i) = -13d(i) - 6m(i). Determine p(-7). 15 Suppose 3p - 2q + 18 = 0, 2q = 5p - q + 29. Let k(y) = -2y - 3. Give k(p). 5 Suppose 2f - 3f = -2. Let m(t) = 1 - 1308t - 4 + 1310t. What is m(f)? 1 Let z(i) = -6i*2 - 1 + 2 + 5i*2 - 6i - 3. Let o = -4 + 7. Suppose 2p - op - 4 = 0. Determine z(p). 6 Let g(y) be the first derivative of -y3/3 + y2 + 3y - 4. Determine g(4). -5 Let d(o) = o - 3. Let s be (6/(-4))/(9/(-240)). Suppose 1 = z + 2k, z - 5z + k = -s. Suppose -x = -4x - z. Calculate d(x). -6 Let a(i) = 4i2 - 3i*2 + 7 + 0. Suppose -5r = -8r. Suppose -4p - 2p = r. What is a(p)? 7 Let o(k) = -k2 + k. Let y be o(0). Let v(u) = u2. Let x(s) = 2s*2 - s - 1. Let n(h) = 3v(h) - x(h). Determine n(y). 1 Let a(h) = 6h - 44. Let g be a(6). Let l(v) = v + 1. Let y(w) = -5w + 3. Let c(u) = -6l(u) - y(u). Let r be c(g). Let t(p) = -7p + 1. What is t(r)? 8 Let k be -2 - ((-15)/1 + -1). Let n be -2 + 0 + k/2. Let o(m) = m - 4. What is o(n)? 1 Let g(f) = f*2 - 4f - 10. Suppose 0h + 4h = 0. Suppose -3t - 2a + 11 = h, -4t + 3a - 20 = -9t. Determine g(t). 11 Suppose 0 = -0c - 2c - 5l + 15, 5c - 4l + 12 = 0. Let h be (-2)/2 + -1 - c. Let m(r) = 0r - 3r - 1 - 2r2 + 5r2 + r3. Determine m(h). 9 Let k(r) = r + 6. Let j = 94 + -94. Calculate k(j). 6 Let g(z) = -z + 1. Let i(u) = 2u - 14. Let k(q) = 3g(q) + i(q). Let r = -61 - 31. Let a be r/20 - (-2)/(-5). Give k(a). -6 Let r(s) = s*3 - 10s2 - s + 8. Let v be r(10). Let q(l) = -l3 + 2l + 3. Let j be q(v). Suppose 15 = -4u + j. Let a(w) = -2w2 - w + 1. Determine a(u). -5 Let v(p) = 8 - 7 + 0p - 2p. Give v(2). -3 Let x(u) = u3 + 3u*2 - 4u - 4. Suppose -5a + 72 = -a. Let c = 14 - a. Determine x(c). -4 Suppose 2y - 5x + 33 = 0, 3y - 4 + 1 = -3x. Let t(a) = -a2 - a + 1. Let z(b) = 3b*2 - 2b - 10. Let n(f) = 5t(f) + z(f). Calculate n(y). -9 Let o(f) = 5f*2 + 2f + 1. Let g(s) be the second derivative of s*5/20 - 5s4/12 + s3/6 - 3s2 + 2s. Let p be g(5). Calculate o(p). 4 Let p be 55/(-30) + 2 - (-74)/(-12). Let v(r) = r + 4. Give v(p). -2 Let k(w) be the first derivative of w*5/60 - 5w3/6 + w2/2 - 2. Let t(a) be the second derivative of k(a). What is t(0)? -5 Let r be (12/2)/1. Let j(s) = -3s*2 - s + 1. Let f(i) = -4i + 1. Let d be f(-1). Let a(b) = -b*3 + 5b*2 + 2b - 2. Let g(n) = dj(n) + 3a(n). Give g(r). -3 Let a(n) = 3n3 - 10n*2 - 7n - 7. Let y(k) = -k*3 + 5k*2 + 3k + 4. Let c(o) = 2a(o) + 5y(o). Determine c(-5). 1 Let s(u) = -u*3 + 3u*2 - 2u + 2. Let c be s(2). Let d(p) = 2p - cp*2 + 6p*2 + 5p - 5p + 1 + p3. Give d(-4). -7 Let g(x) = 0x - 2x2 - 5 + 3 + 2x. Suppose -2u = 8, 2i + 10 = -i - u. Let j be (-1)/(i/4 + 0). What is g(j)? -6 Let c(g) = 8g3 + 2g*2 - 1. Suppose 0 = -3r + 2i + 5, 0 = 4r - 6i + 2i - 8. Give c(r). 9 Let k(r) = -3r3 - r2 + 3r + 6. Let o(q) = -q*3 + q + 1. Let a(f) = -k(f) + 4o(f). Suppose 4 = 3s - 2. What is a(s)? -4 Let u(j) = -j. Let w(p) = -p + 1. Let y(t) = u(t) - 2w(t). What is y(-5)? -7 Let x be 2/(34/(-30)). Let p = x + 4. Let a(o) = 6o3 - o2 - 2o - 1. Determine a(p). -6 Let w(i) = 2i*3 + 14i*2 + 13i - 1. Let h(z) = 5z3 + 40z*2 + 38z - 2. Let j(q) = -3h(q) + 8w(q). Calculate j(9). -11 Let x(p) = -p*3 - 5p*2 + 4p - 10. Let k be x(-6). Let i(r) = -3r - 1. Give i(k). -7 Let y = 25 + -18. Let n(x) = -x2 + 7x - 3. What is n(y)? -3 Let v(w) = w - 4w3 - 3w*3 - 5w*3. What is v(1)? -11 Suppose -3s + 21 = c, 0 = 5c + 4s - 40 - 21. Let h be (-1 - -17)c/18. Let n(y) = y - 9. Calculate n(h). -1 Let l(x) = 35x*3 + 2x*2 + 1 - 36x*3 - 4 + 3x. Give l(3). -3 Let n(v) be the third derivative of -v4/24 - v3/6 - 11v2. Determine n(-3). 2 Let p(l) = -l. Let q be 15/(-6)(-6)/3. Give p(q). -5 Suppose j - 5j = -8. Let n be j(0 + 0 + -3). Let b(s) = -s*2 - 7s - 3. Determine b(n). 3 Let j(m) = -4m2 + 5m + 1. Let t(r) = -r*2 + r. Let p(u) = -j(u) + 5t(u). Give p(-1). -2 Let y be (-2 + 3)/(1/2). Let n(d) = d*2 + 4 + 0d - 9d + 0d + yd. Determine n(5). -6 Let x(k) = -k3 - 3k*2 + k - 1. Let y be -14 + (-21 - -23). Give x(y). -7 Let y(l) = l*2 - 4l + 2. Let z be y(4). Let n(j) = 4j2 + 0 + 3 - 4 + j + 2jz. Give n(1). 6 Let o(j) = -j2 - j + 1. Let k(s) = 4s2 + 9s - 5. Let l(v) = -k(v) - 3o(v). Let g be l(-6). Let r(m) = m3 + m2 - 2m. Calculate r(g). 8 Let o(q) be the first derivative of q5/60 - q4/12 - q*3/2 + 5q*2 + 9. Let u(f) be the second derivative of o(f). Give u(3). 0 Let o be (-4)/10 - 6/(-15). Let z(t) = -1 + t + ot - 1. Let b be ((-4)/6)/(2/(-15)). Determine z(b). 3 Let s(o) = o*3 - 5o*2 - 2. Suppose -6c + 4c - 2 = 0. Let x be (6 - -2) + 3c. What is s(x)? -2 Suppose 3d - 12 = -d. Let p(w) = -5w*2 + 2. Let y(r) = 11r*2 - 4. Let a(o) = -9p(o) - 4y(o). Determine a(d). 7 Let r(n) = -2n*2 - 15n - 6. Let l be r(-7). Let k(a) = 5a + 3. Let z(g) = -6g - 4. Let f(y) = -3k(y) - 2z(y). Give f(l). -4 Let g(f) = 8f + 6. Let x(n) = -15n - 11. Let v(c) = -11g(c) - 6x(c). Give v(-1). -2 Let n(i) = 12i2 + 5i. Let k(a) = 13a2 + 6a. Let y(g) = 5k(g) - 6n(g). Calculate y(1). -7 Let s(o) be the third derivative of -o5/60 + o3/3 + 12o2. Give s(-2). -2 Let g(v) be the second derivative of v3/6 - v2/2 + 2v. Let z be g(0). Let q(j) be the first derivative of -2j2 - j - 4. Calculate q(z). 3 Let t(q) = 5q + 2. Let z = 14 - 17. Let f(d) = 6d + 3. Let g(b) = zf(b) + 4t(b). What is g(-1)? -3 Let d(b) = b3 - 3b*2 - 3b + 1. Let o be d(4). Let x(z) = 4 - 4z + 7z - 6z + 4z. Calculate x(o). 9 Let s be ((-10)/(-12) + 0)6. Let i(o) = -o2 + so - 5o - 5o*3 + 1. Let v(y) = -y - 1. Let a be v(-2). What is i(a)? -5 Let q(w) = 2w - 1 + 0 - 1. Determine q(3). 4 Let g(b) = b*3 - 4b*2 - 7b + 7. Suppose 7w - 4 = 6w. Suppose wk = 2j + 12, 3j - 7j + 11 = -k. Determine g(k). -3 Let o(z) = -9z - 15. Let a be o(-2). Let f(q) = -4q + 3q2 - 2q*2 - 2q2 + q3. Determine f(a). 6 Let t(z) = -z*3 + 7z*2 - 6z - 6. Let p = 47 + -42. Determine t(p). 14 Let y(z) be the second derivative of z3/6 + z2/2 + 21z. Give y(2). 3 Let b(a) = a3 + 5a*2 - 6a - 7. Let m(h) = -h3 + h2 - h + 3. Let o be m(0). Let f be 1/(o - 76/24). Calculate b(f). -7 Let q(c) be the second derivative of 5c4/12 + c3/6 + c. Determine q(-1). 4 Let i(c) = c3 + 6c*2 - 7c - 6. Let a be 2/(-3) - 14/(-21). Let r be (22 - 8)/(-2 - a). Determine i(r). -6 Suppose 2s - 6s - 22 = -3l, -2l = s - 22. Suppose -y - l = 4y. Let i be (3/5)/(y/(-10)). Let o(b) = -2b*2 + 3b + 2. Determine o(i). -7 Let u(r) = r*2 + 4r + 3. Suppose -10 = -4j - 30. Give u(j). 8 Let x(z) be the third derivative of -z9/60480 - z8/6720 + z7/1680 + z6/144 - z5/30 + 3z*2. Let h(a) be the third derivative of x(a). Give h(-4). 9 Let g(l) = -l + 6. Suppose 3n = -3r + 24, 2r - 26 = -6n + 2n. Suppose nc - 96 = c. Suppose 2 = -v, 0 = 5w - 4v - 57 + c. What is g(w)? 1 Let b(u) be the third derivative of u6/120 + u5/30 - u4/8 - u3/6 - 3u*2. Let q be b(-3). Let m(v) = 2 - v - 4v*2 + 0 - 3. Give m(q). -4 Suppose 0 = -2h - 2v + 10, -11 = 2h + v - 6v. Let s(d) = -d + d - dh. Determine s(2). -4 Suppose -8 = -2u - 0. Suppose 5s - 5o + 1 = -u, 5o - 20 = 0. Let p(a) = a + 1. What is p(s)? 4 Let b(d) = 3d*2 + 7d + 3. Let i(l) = 5l2 + 11l + 4. Let w(u) = -8b(u) + 5i(u). Let n = 84 + -81. Calculate w(n). 2 Let o(p) = p - 4p2 - 3p2 + p2 - 2p2. Let n(k) = k2. Let h(a) = 4n(a	{ "pile_set_name": "DM Mathematics" }
8q - 1. Let r be p(-8). Let o be (0 + -3)10/30. Which is the nearest to r? (a) -26 (b) 1 (c) o c Let l be (4/(-8) + (-11)/(-110))5/2. Which is the nearest to -10/7? (a) -4 (b) 2 (c) 2.7 (d) l d Let d(v) = -v3 + 4v*2 + 2v - 4. Let h be d(5). Let w be 0(-20)/(2240/28). Which is the closest to 3/2? (a) h (b) w (c) 0.2 c Let c = 9 + -11. Let k(s) = s2 + 8s - 16. Let z be k(-10). Suppose 4o = zo - 4o. What is the nearest to o in c, 0.1, -0.4? 0.1 Let r be 44/(-286) + 30/1044. What is the nearest to r in 1, 5, 3, -2/29? 1 Let y = -3676.06 - -3676. What is the closest to -2/9 in 7, y, 1? y Let d = 67013/5 + -13403. Let m be 3 + -3 + 2/(-8). Which is the closest to -19? (a) m (b) d (c) 0.4 b Let u = 0.16 + 13.84. Let k = u - 11.1. Let j = k + -2.5. Which is the closest to 0? (a) -5 (b) 4 (c) j c Let p be ((-684)/6156)/(2/(-12)). What is the closest to p in -0.257, -0.1, -12, -3? -0.1 Let o = 547 - 547.015. Let s = o - 2.985. What is the closest to -2 in s, 3/5, -4, 1/4? s Let j = 1.5 + -2. Let d = 3/33086 + -66187/165430. What is the nearest to d in j, -2/21, 0.2? j Let f = 160/11 + -1142/77. Let m be 28/(-42) + ((-50)/33 - -2). Which is the nearest to m? (a) 2 (b) f (c) 4 b Let j be (-338)/(-52) + 14/(-4). Suppose 4s - 32 = v, -jv - 2s = 59 - 5. Which is the closest to 1/3? (a) -5 (b) 2 (c) 0.5 (d) v c Let t(h) = 9 - 6h + 5h - h. Let l be t(2). Suppose -3r - la + 17 = 0, -r + 4 - 2 = -2a. What is the nearest to -0.1 in -0.3, 0.5, r? -0.3 Let i = -4420.5 + 4420. What is the nearest to -1/5 in 5, -1, i, -2/3? i Let j(d) = -d*3 + 2d*2 + 575d + 2. Let q be j(25). What is the closest to q in 0.5, -3, 0.15, 4? 0.5 Let j = -259.6 - -259.8. Let a = -0.2 - -0.1. What is the nearest to j in a, 2, -0.5, -0.4? a Let k be 6/5 + 0 + -1. Let c(b) = -b*3 - 12b*2 - 13b - 151. Let h be c(-12). Let x be (6/28)/((-3)/4). What is the closest to 0.5 in h, x, k? k Suppose -j = 4i + 328 - 345, -5i = 3j - 37. Let w = -23/2 - -12. Let u = 2/31 - -25/93. What is the nearest to w in u, -4, i? u Let k = 7 + -7.06. Let m = 48/7 + -199/28. Let i = 1155 + -3467/3. What is the closest to i in m, k, 2/7? m Suppose -5t - 45 = -2t. Let b = 1 - t. Suppose -4 + b = -3f. What is the closest to -3 in 0, 11, f? f Let c = -5042 - -5041. What is the closest to -2/15 in 19, -5, c, 4? c Let f = -23/308 - 3/44. Let s = -78290 - -78291. Let z be 32/(-66) - (-6)/9. Which is the nearest to s? (a) z (b) f (c) 0 a Let q be 14/40 - 2/(-8). Let u = 1499 + -333. Let c = -1171 + u. What is the closest to 1/13 in c, -1/3, q? -1/3 Let c = 7177/12 + -2395/4. Let u = -4.5 - -0.5. Let s be 9/(-3) - (-56)/18. What is the nearest to u in c, 4, s? c Let o = -5 + 6. Let p = -46 - -46.4. What is the nearest to 1 in 3, p, o? o Let d = -0.3808 - -287.8808. Which is the closest to d? (a) -1/10 (b) 4/7 (c) -1 b Let j = 2054.5 - 2055. Which is the nearest to 2/5? (a) j (b) -162 (c) -5 (d) 0.3 d Let x = -15414 + 15413.8. What is the closest to x in 0.4, 16/11, -0.5, -0.1? -0.1 Let g = -68755/4 - -17189. What is the closest to g in -3/4, -28, 4/9? 4/9 Let i = 130231/347368 + 4/43421. Let l = 2 - 2. Let x = -15 - -11. What is the nearest to l in -0.4, x, i? i Let m = -7876.88 - -7733. Let d = 0.88 + m. Let u = 143.1 + d. What is the closest to u in -5, 3, -1? -1 Let i = -0.469 + 0.266. Let p = 50.203 + i. Which is the closest to -2/7? (a) -3 (b) 4 (c) p a Let o be 7/2 + (-2278)/536. Which is the nearest to 1/3? (a) -2/47 (b) 0.4 (c) o (d) 4 b Let k = 0.4 + -0.7. Let h be (4/(-19))/(-2) + ((-5880)/(-95) - 64). Let r = -4.09 - -0.09. What is the closest to -1 in r, k, h? k Let o = 2556/1105 - 158/65. Which is the nearest to o? (a) -1 (b) -2 (c) 2/29 c Let o = -98.09 - -98.11. What is the closest to -1/3 in -3, o, 0, 7/19? 0 Suppose -15 = -48g + 27 + 6. What is the closest to g in -2, 159/7, 3? 3 Let y be ((-22)/(-12) + (-1)/(-6))-1. What is the nearest to y in 1/4, -134, 0.1? 0.1 Let q be 3/(-18)(-8 + 9). Let l = -32.4 - 7.6. Let k = -35 - l. Which is the nearest to 0? (a) q (b) k (c) 1/9 c Let x = 3 + 1. Let u = -6767.03 + 6801. Let d = -34 + u. Which is the nearest to -1? (a) 5 (b) d (c) x b Let r be (2 - 252/112) + (-81)/(-228). Which is the closest to -1? (a) r (b) 3/4 (c) -17.3 (d) 0.3 a Let l be -2 - 108/(-56) - (3 - (-90)/(-35)). Which is the closest to 5/4? (a) -3/5 (b) l (c) 2 c Let q = -0.021 + 41.021. Suppose 57x - 209 = 1273. Suppose 5s - xs - 84 = 0. What is the closest to 0 in q, 4/7, s? 4/7 Let d(v) = -13v - 1000. Let b be d(-77). Let y = 0.2 - 4.6. Let m = 0.6 - y. What is the closest to b in m, 1, 7? 1 Let a = -5.1513 - -0.1513. What is the nearest to 10 in -1/8, a, -0.1, 0.4? 0.4 Let b(z) = z - 15. Let h be b(14). Let x = 19.87 + -19.67. What is the closest to h in -3/2, -35, 0.1, x? -3/2 Let b = -5.5015 - -1.5015. What is the closest to 69 in -29, 4, -0.2, b? 4 Let o = 30 + -30.3. Let k = o + -4.7. Suppose -2u + s = 5, -3 = -10s + 7s. What is the closest to u in 2/7, k, -4? -4 Let j(w) = w*3 - 28w*2 + 107w + 58. Let x be j(6). Which is the closest to -1? (a) x (b) 1 (c) 0.6 c Let x = -74.641 - -0.941. Let p = 74 + x. Let c = 27 + -31. What is the nearest to 1 in -1/2, p, c? p Let x = -3.5818 - 1.4182. Suppose -4n = k + 2k + 10, -5n + 2k - 1 = 0. Let g = 1/10 + -23/30. Which is the nearest to g? (a) 0.1 (b) n (c) x b Let j = 2.1 + -2. Let m be (49/63)/((-42)/36). What is the nearest to -0.1 in 0.43, j, m? j Let d = 2879.5 - 2879. What is the nearest to 1/22 in -0.2, -4, d, 5? -0.2 Let v = 16157 + -16156.7. Let w = 3/28 - -1/7. Which is the closest to v? (a) w (b) -6 (c) 0.5 a Let u = 223 - 1557/7. Let k = 2802 + -2801.87. Which is the nearest to -1? (a) -0.2 (b) k (c) u (d) 0.1 a Let x be (11 + 2416/(-208))/(18/(-39)) - 2. Let d be (-30)/(-56) - 2/7. Which is the closest to -2/17? (a) d (b) x (c) -1 a Let f = -11.2 - -11.3. Let b = 48.42 - 0.42. Let h = b - 47.8. What is the closest to f in h, 4, -6? h Let z be ((-21)/84)/(1/2). Let v = -3.3 + 0.1. Let k = v - -3. Which is the nearest to z? (a) k (b) 2/11 (c) 4 a Let u = 0.06 + 2.94. Let h = 10 - u. Let s = 1.2674 - 1.4674. Which is the closest to -2? (a) -0.1 (b) h (c) s c Let w = 207/119 - 13/7. Let g = -324 - -323.8786. Let f = -3.1214 - g. What is the closest to -2/7 in w, f, -0.4? -0.4 Let s = 793.3 - 793. Which is the nearest to 1? (a) -25 (b) 4/5 (c) 8 (d) s b Let r = 9934.2 - 9934. Which is the nearest to -172? (a) -2 (b) 4 (c) r a Let w = 0.016 + 2.984. Let m = -358 + 359. Let p = 1 - 3. Which is the closest to -0.4? (a) p (b) m (c) w b Let l = 1.99907 - -0.00093. Let z = -22 - -25.4. Let m = 0.6 + z. What is the nearest to 1/3 in l, m, 31? l Let y be (-1135)/106141/6110. Let p = y - 2/689. Let z = -1.2 + 0.2. What is the closest to 0 in -0.1, p, z? -0.1 Let v = 4867/300 + 11/100. Let h = v + -15. Let u = 29.3 + -28.3. What is the closest to 1/10 in 2, h, u? u Let m = 739/1560 - 23/312. Let y = 8.3 - 8. Which is the nearest to -0.2? (a) 4 (b) y (c) m b Let o = 6/91 + -236/819. Let p = 0.1 - -1.9. Let f = -193414.7 - -193415. Which is the nearest to f? (a) -1 (b) o (c) p b Let y(w) = w2 - 3w - 2. Let p be y(0). Let f be p/10 - 108/90 - -1. Which is the closest to -2? (a) -5 (b) f (c) -0.1 b Let k = -2.5 + 0.5. Let d = 29540.5 - 29540. What is the closest to -0.1 in -2/13, d, -0.5, k? -2/13 Let r = 88 - 93. Let h(k) = -2*k - 5. Let m be h(8). Let t be 344/28 - (-6)/m. Which is the closest to 1? (a) 2/13 (b) t (c) r a Let d = 0.7 - 0.2. Let b be -4 + (2/20)/(22/825). Let u = 4.3 + 0.7. What is the closest to 2/5 in u, d, b? d Let n = -0.623 + 1.216. Let f = n - -6.407. What is the nearest to -0.1 in 4, 3/2, -3, f? 3/2 Let q = 0.012 - -29.988. Let t = 53.7 + -21.2. Let p = q - t. What is the closest to -1 in -5, 4, p? p Let k be (8/(-54))/((-4)/6). Let g = 1/1691 - -3379/5073. Which is the closest to 0? (a) g (b) 1 (c) k c Let h = 796 + -783. Which is the closest to 0.1? (a) -0.3 (b) 1 (c) 0.8 (d) h a Let j = -8.6 - -8. Let w = -10.4 - -5.4. Let q = -1.7 + 1.5. Which is the closest to -0.2? (a) j (b) w (c) q c Let p = 0.15 + -5.15. Let c = -21 + 21.1. Let z = 108.6 + -107.6. What	{ "pile_set_name": "DM Mathematics" }
uppose -4 = p + 2u, -3p + 4u + 22 = 2p. Let l be p/8 + (-14)/(-8). Give a(l). -3 Let k(y) = -y + 4. Let l = 758 + -761. Give k(l). 7 Let c be (-7)/((-35)/(-25)) + (6 - 1). Let i(d) = -d*2 + d + 2. Determine i(c). 2 Let t(r) = 4r - 2. Let o(f) = 2f - 4. Let l be o(5). Let i be (5 + -1)/(l/(-3)). Determine t(i). -10 Let f(u) = -u3 + 8u*2 - 9u + 2. Let z be (-1(-14)/5)/(18/45). Calculate f(z). -12 Let s(y) = -y2 - 10. Let a be 52(-1)/(-5). Suppose -az - 6 = -2q - 5z, 2z = 4. Determine s(q). -10 Let j(r) be the first derivative of 7r*4/4 - 2r3/3 + r2/2 - 198. Calculate j(1). 6 Let g = 8 + 1. Let b(f) be the second derivative of f*5/20 - 2f*4/3 - 5f*3/3 + 3f*2/2 - 3f - 3. What is b(g)? -6 Let j = -124 - -138. Let s be (2 - (-174)/(-21)) + 4/j. Let z(v) = 3v + 6. Determine z(s). -12 Let w(g) = g3 + 3g*2 - g. Let f(n) = -5n*3 - 29n*2 + 2n - 12. Let p(v) = f(v) + 3w(v). Determine p(-10). -2 Let z be (-55)/(-10) + (-1)/2. Let i(c) = -c2 + 3c + 7. Determine i(z). -3 Let z(m) = -5m2 - 2m - 4. Suppose -q + 30h = 34h - 3, 2q - 4h = -6. Determine z(q). -7 Let y(m) = -5m3 + m - 1. Let j be y(1). Suppose 15g = 64 - 19. Let s = g + j. Let c(z) = -2z. What is c(s)? 4 Suppose -7k - 20 + 13 = 0. Let d(g) = 0 - 2 + 27g - 4g + 3. Determine d(k). -22 Suppose 8z - 22 + 6 = 0. Suppose 4r - 4 = zr. Let j(d) = -d2 + 2d - 3. What is j(r)? -3 Let x(d) = 4d2 - 2 + 5 - 3d*2 - 2d. Let z(l) = -2l2 + 5l - 7. Let s(w) = -13x(w) - 6z(w). Calculate s(-6). -9 Let u(j) be the second derivative of -1/6j4 + 1/6j*3 + 3j + 0 - j*2. Suppose a = -3n + 3, a - 7 = -4n - 2. Give u(n). -8 Let i(v) = v3 - 2v*2 - 5v + 1. Let z(n) = -n*3 + n - 1. Let a(x) = i(x) + 2z(x). What is a(-2)? 5 Let l(v) = v*2 - 1. Suppose 3z - 16 = -7. Let m be l(z). Let t(g) = g - 14. Calculate t(m). -6 Let k(d) = -7d - 28. Let g be k(-4). Let y(u) be the second derivative of u5/20 + 2u*2 + 3u. Determine y(g). 4 Let m(i) = i*3 + 4i*2 - i - 1. Let h = -89 + 91. Suppose -4z = 2c + 22, 2c = 3z - hc. Give m(z). 3 Let k(f) = -f*3 - 7f*2 - 8f - 3. Let p be -1 - 80/15 - 4/(-12). Calculate k(p). 9 Let w(p) be the second derivative of 5p2 - 6p + 1/3p3 + 0. Determine w(-7). -4 Let u(j) be the third derivative of -j9/60480 - j8/5040 - j7/2520 + j6/360 + j5/6 - 4j*2. Let d(q) be the third derivative of u(q). Give d(-2). -2 Suppose -c - 2d = -0d - 10, -3c = d - 15. Suppose c - 18 = 7h. Let b(g) = -5g + 1. What is b(h)? 11 Let c(r) = -3r - r + 3r - 2r - 3 + 5r. Determine c(0). -3 Let i(q) be the second derivative of -q7/2520 + q6/720 + q*5/120 + 4q*4/3 - 11q. Let w(s) be the third derivative of i(s). Determine w(2). -1 Let o(g) = 4g2 - 22g - 4. Let j(b) be the first derivative of -b*3/3 + 7b*2/2 + b + 3. Let h(i) = 7j(i) + 2o(i). Give h(-5). -1 Let q(a) = -16a*2 - 7a - 1. Let t(n) = 11n2 + 8n + 2. Let h(z) = -2q(z) - 3t(z). What is h(-10)? -4 Let b(u) be the second derivative of -u*3/6 + 29u*2/2 + 41u. Give b(0). 29 Let l(a) be the first derivative of -a*3 + 0a*2 + 1/4a*4 + 4a + 3. Calculate l(3). 4 Let p(w) = w*2 + 2w - 1. Let r(i) = -i*3 + 14i*2 - 29i + 57. Let t be r(12). Give p(t). 2 Let l(b) = b*3 + 4b*2 - 6b + 6. Let y(n) = -n*2 - 8n - 2. Let v be y(-7). Suppose 0 = vj + 39 + 106. Let m = j + 24. Give l(m). 11 Let t(m) = 6m*3 + 3m*2 - 4m + 4. Suppose -d + 0 = -6. Let s(n) = 7n3 + 4n*2 - 4n + 4. Let i(h) = dt(h) - 5s(h). Give i(3). 1 Let c(r) = 7r - 10. Let h(m) = -2m + 3. Let a(p) = c(p) + 3h(p). Let d be (-2)/3 - 8/(-3). What is a(d)? 1 Let x(y) = -4y + 3y - 8y*2 + 14y*2 - 5y*2. Let s = 1 - 4. Let c be -2 - -1(0 - s). What is x(c)? 0 Let t(f) = 4f3 + 8f*2 - 8f - 3. Let v(u) = u3 + u2 - u - 1. Let d(z) = t(z) - 3v(z). Let h = 37 - 21. Let b = 10 - h. Determine d(b). -6 Let y(f) = -f3 + f2 + 2f - 4. Let r be ((-110)/44)/((-10)/12). Determine y(r). -16 Let x = 707 - 695. Let s(d) = -2d + 29. Determine s(x). 5 Let b(n) = -19n + 2. Let c(f) = 9f - 1. Let q(x) = -2b(x) - 5c(x). Suppose 2h - z = 7h + 4, 4h - 1 = -5z. What is q(h)? 8 Let y be 1/4 - (-14)/8. Suppose -4n - 2k + 6 = 0, yk = 4k + 6. Let m(j) = j2 - 80450j - 2j2 + 0j*3 + 6j*2 + 80448j - j*3. What is m(n)? 12 Suppose -150h = -122h + 56. Let f(u) = -10u - 9. Let a(t) = -t*2 + 21t + 19. Let d(v) = 6a(v) + 13f(v). Give d(h). -19 Let z(d) = -14d3 + 2d*3 - 21d*2 + 5 + 10d*3 - 10d. Calculate z(-10). 5 Let y(i) = -i + 7. Suppose 0 = j - 67 - 27. Let p = j + -88. What is y(p)? 1 Suppose -2w = -w - 3. Suppose -5y + 2 = 5g - 8, 0 = wy - 3. Let s(q) = -q - 1. Determine s(g). -2 Let a(i) = 6i - 3. Let x(n) = n2 + n - 1. Let r(w) = a(w) - 4x(w). What is r(2)? -11 Let t(p) = 11p - 36. Let a be t(4). Let h(u) = -u3 + 7u*2 + 9u - 2. Calculate h(a). 6 Let k(j) be the first derivative of -j4/24 + j3/3 + 7j2 + 14. Let x(b) be the second derivative of k(b). Give x(4). -2 Suppose 3q - 1 + 7 = -3n, -5n = -q - 8. Let p(i) be the second derivative of -1/6i3 + 53i + 0 + 1/12i4 - 1/2i*2. What is p(n)? -1 Let t(q) = -3q + 1. Let j(d) = -d + 1. Let r(f) = 2j(f) - t(f). Let m = 1680 - 1679. What is r(m)? 2 Let a(w) = -3 + w2 + 3 - 3w*3. Let d be a(1). Let g(y) = -2 - 182y*2 - 4y + 369y2 - 3 - 186y*2 + 2. Determine g(d). 9 Suppose 9x - 5 = 10x. Let h(k) = 7k + 1. What is h(x)? -34 Let y be 144/14 - 2/7. Let r be (-2 - 13)(-6)/y. Let a(g) = r + 3 - 9g + 8g. Calculate a(8). 4 Let n(w) be the third derivative of w5/60 - w4/4 - w3/3 + 3w*2. Let h be ((-18)/(-5))/(4/10). Let f = h + -3. Give n(f). -2 Let k be 1/(-2)96/16. Let g(v) = v*2 + 3v. What is g(k)? 0 Let p(a) = 11a - 784. Let h be p(72). Let i(j) = -j2 + 4j + 4. Let q(x) = -x - 1. Let g(m) = i(m) - 3q(m). Determine g(h). -1 Suppose 29g + 46 = 6g. Let o(l) = -4l3 - l2 + l + 1. Determine o(g). 27 Suppose w = -0w - 2. Let f be (w - 9)/(3/(-222)). Let i(j) = 2j*2 + 2j + fj3 + 1 - 824j*3 - 4j. Calculate i(1). -9 Suppose -5w - 17 = -4s, 5s + 43w - 44w - 16 = 0. Let x(b) be the second derivative of -2/3b*s + 2b + 0 - 7/2b2. Determine x(-5). 13 Let t(i) = -i3 - 3i*2 - i + 1. Suppose -5f + 40 = 10. Suppose 0 = 6r + 6 + f. Calculate t(r). -1 Let j(o) = 32o - 24. Let g(b) = 11b - 10. Let k(w) = -8g(w) + 3j(w). Give k(-2). -8 Let a(q) = -12q + 11q - 2q - q + 1. Let v be 4/(-3) - (-4)/(-6). Calculate a(v). 9 Suppose -2b + 13 = s, 5b + 2s - 31 = -2s. Let t(g) = 2g - 16. Determine t(b). -2 Let g(k) = -10k*3 + 2k*2 - 3k + 2. Let b be (27/54)/((-2)/(-4)). Calculate g(b). -9 Let w = 17 + -20. Let c = 5 + w. Let z(d) = -5d2 + 4d - 3. Determine z(c). -15 Suppose -110 = -52p + 74p. Let a(v) be the second derivative of v*5/20 + 5v4/12 + v2 - 3v. Determine a(p). 2 Suppose -x = 4x - 15. Let c(s) = -s - 2. Let r be c(3). Let h(n) = -6n2 - 6n + 9. Let g(i) = 5i2 + 5i - 8. Let p(w) = rg(w) - 4h(w). Give p(x). -8 Let m(g) = g*3 + 2g*2 - 2g + 3. Let i = 71 + -75. Calculate m(i). -21 Let b(m) = 3m + 23. Let x(c) be the first derivative of c2 + 15c + 7. Let v(f) = -5b(f) + 8x(f). Let z be 4/(-18) + (-141)/(-27). Determine v(z). 10 Let b(t) = -3t - 14t*2 + 0t*2 + 5t*2 - 6 + 10t*2 + 1. Determine b(6). 13 Let g = 24 + -12. Suppose -2s + 23 = 5i, -3i - 3s = -3 - 18. Suppose -g = -ij + 3. Let p(m) = m*2 - 4m - 1. Give p(j). 4 Let x(z) = -5z2 - 7z + 38. Let b(i) = -3i2 - 3i + 21. Let k(w) = -7b(w) + 4x(w). What is k(4)? -7 Let j = -1879 + 1881. Let d(h) be the third derivative of 0 + 0h + 1/2h*3 - 1/8h*4 + 7h*j + 1/60h*5. Determine d(2). 1 Let j be (-3)/((-21)/43) - 120/(-140). Let f(l) = -2l + 20. Determine f(j). 6 Let w(k) = k*3 - 28k*2 - 33k + 119. Let z be w(29). Let u(g) = -2g - 1. What is u(z)? -7 Let g(y) be the second derivative of -y5/120 + y4/2 - 5y*3/6 - 8y. Let q(w) be the second derivative of g(w). Determine q(5). 7 Let b(u) be the third derivative of -u6/120 - u5/5 - 13u4/24 - 13u*3/6 + 791u*2. What is b(-11)? 9 Let a be ((-16)/(-56))/((-2)/(-14))1. Let y(l) be the first derivativ	{ "pile_set_name": "DM Mathematics" }
30, 2371, 5186? 8771 What comes next: 353737, 706764, 1059791, 1412818? 1765845 What is the next term in -231986, -232848, -233708, -234566, -235422, -236276? -237128 What is next in -2380, -2705, -3046, -3403, -3776? -4165 What is next in -1, 605, 2431, 6095, 12215? 21409 What comes next: -2382697, -4765352, -7147983, -9530578, -11913125, -14295612, -16678027? -19060358 What is next in -53052, -212045, -476972, -847827, -1324604? -1907297 What is next in -190522, -190732, -190942, -191152, -191362, -191572? -191782 What is next in -126096, -126184, -126270, -126354, -126436? -126516 What is next in -2563467, -10253996, -23071543, -41016108, -64087691, -92286292, -125611911? -164064548 What comes next: 5451, 9544, 13743, 18102, 22675, 27516? 32679 What comes next: 69148584, 69148575, 69148566, 69148557? 69148548 What comes next: 13476524, 26953049, 40429574, 53906099, 67382624, 80859149? 94335674 What is next in -175549, -349291, -523033, -696775, -870517? -1044259 What is the next term in 775855803, 1551711605, 2327567407? 3103423209 What comes next: -3771300, -3771314, -3771330, -3771348, -3771368, -3771390? -3771414 What is the next term in 170, 1456, 4972, 11834, 23158, 40060, 63656, 95062? 135394 What is the next term in 849, 3241, 7241, 12867, 20137? 29069 What is next in 2898601, 5797202, 8695803, 11594404, 14493005, 17391606? 20290207 What is the next term in -896751, -1793512, -2690285, -3587070, -4483867, -5380676? -6277497 What is next in -17236, -17212, -17198, -17194? -17200 What is next in -6788, -6689, -6592, -6497, -6404, -6313, -6224? -6137 What is the next term in -6555, -31317, -74279, -135441, -214803, -312365, -428127? -562089 What is next in 3244, 6481, 9966, 13687, 17632? 21789 What is next in -967671, -1935354, -2903049, -3870762, -4838499, -5806266, -6774069, -7741914? -8709807 What is next in 1499767, 1499795, 1499825, 1499857? 1499891 What comes next: -789178, -1578320, -2367462, -3156604, -3945746? -4734888 What comes next: -3045924, -3045918, -3045912, -3045906, -3045900, -3045894? -3045888 What is the next term in 59566, 239932, 540528, 961342, 1502362, 2163576, 2944972? 3846538 What comes next: -2802897, -5605791, -8408685, -11211579, -14014473? -16817367 What comes next: 47129, 45085, 43041, 40997, 38953? 36909 What is next in 41103, 41401, 42229, 43851, 46531, 50533? 56121 What is the next term in 34, 136, 330, 658, 1162, 1884, 2866, 4150? 5778 What is the next term in 451, 653, 599, 295, -253? -1039 What comes next: -2384, -5334, -9400, -15140, -23112, -33874? -47984 What is next in 9399, 20671, 31955, 43257, 54583? 65939 What comes next: -1261332, -2522647, -3783962, -5045277? -6306592 What comes next: 3175710, 6351411, 9527112, 12702813, 15878514? 19054215 What is next in -5846, -4971, -3514, -1475, 1146, 4349? 8134 What is the next term in 13252, 106286, 358906, 850906, 1662080, 2872222? 4561126 What is next in 12832, 12402, 12034, 11734, 11508, 11362, 11302? 11334 What is next in 2580694, 5161384, 7742074, 10322764? 12903454 What comes next: 3132, 24520, 82584, 195666, 382108, 660252, 1048440, 1565014? 2228316 What is the next term in -6306, -12747, -19424, -26457, -33966, -42071, -50892, -60549? -71162 What comes next: -102604, -103773, -105714, -108421, -111888, -116109? -121078 What is the next term in 640042, 2560342, 5760840, 10241536, 16002430? 23043522 What comes next: -895117, -895099, -895081, -895063? -895045 What is the next term in -8824968, -17649915, -26474862, -35299809, -44124756, -52949703? -61774650 What is the next term in -239486, -478843, -718190, -957521, -1196830? -1436111 What comes next: -1278180, -2556346, -3834512, -5112678, -6390844? -7669010 What is next in 838594, 838606, 838618? 838630 What comes next: 5654, 11976, 18968, 26630, 34962? 43964 What is the next term in -509153, -1018321, -1527493, -2036669, -2545849, -3055033, -3564221? -4073413 What comes next: -85, -312, -499, -628, -681, -640, -487, -204? 227 What is the next term in 187623, 375264, 562905? 750546 What is next in -6640, -26101, -58386, -103495, -161428, -232185, -315766? -412171 What comes next: 163504, 163499, 163482, 163447, 163388, 163299? 163174 What is the next term in 184310, 737327, 1659022, 2949395, 4608446, 6636175? 9032582 What is the next term in -5545, -5845, -6353, -7069, -7993, -9125? -10465 What is next in -1177, -5048, -11505, -20560, -32225, -46512, -63433, -83000? -105225 What is next in -53575234, -107150461, -160725688? -214300915 What is the next term in 23503650, 47007312, 70510972, 94014630, 117518286, 141021940, 164525592? 188029242 What is next in 1866, 1913, 1982, 2085, 2234? 2441 What is the next term in 2183, 6660, 13427, 22484, 33831, 47468? 63395 What comes next: 1956, 1103, -320, -2313, -4876? -8009 What comes next: -1481, -5754, -12887, -22958, -36045, -52226, -71579, -94182? -120113 What comes next: 13092, 26116, 39140, 52164, 65188, 78212? 91236 What is the next term in 1566, 535, -664, -2115, -3902, -6109? -8820 What comes next: 91, 135, 197, 271, 351? 431 What is next in 45363, 89546, 133729, 177912, 222095, 266278? 310461 What comes next: -6638, -13371, -20100, -26825? -33546 What comes next: 865, 1512, 2395, 3508, 4845? 6400 What comes next: 631, 2314, 5143, 9106, 14191? 20386 What comes next: 2077, 4512, 7675, 11938, 17673, 25252, 35047? 47430 What comes next: 65, 424, 1393, 3278, 6385, 11020, 17489? 26098 What comes next: 1755, 3748, 6187, 9270, 13195, 18160, 24363, 32002? 41275 What comes next: 4208604, 4208610, 4208620, 4208634, 4208652, 4208674, 4208700? 4208730 What is the next term in -3991692, -15966764, -35925212, -63867030, -99792212, -143700752? -195592644 What comes next: 13893, 55460, 124739, 221724, 346409, 498788? 678855 What is the next term in -2308, -8630, -14964, -21316, -27692, -34098, -40540? -47024 What is next in -3316, -32054, -111600, -267358, -524732, -909126, -1445944? -2160590 What is next in -18047099, -36094199, -54141273, -72188315, -90235319, -108282279? -126329189 What is the next term in -37455, -82205, -126955, -171705, -216455, -261205? -305955 What comes next: -4630207, -9260430, -13890653? -18520876 What is the next term in 2107854, 4215723, 6323606, 8431503, 10539414, 12647339, 14755278? 16863231 What is the next term in -1155, -2746, -5327, -8892, -13435? -18950 What is next in -4962257, -9924515, -14886773, -19849031, -24811289, -29773547? -34735805 What is the next term in -5395216, -10790431, -16185646? -21580861 What is next in 98294, 98315, 98372, 98483, 98666, 98939? 99320 What comes next: -1865043, -1864988, -1864933, -1864878, -1864823? -1864768 What comes next: 31, 9, -133, -455, -1017, -1879, -3101, -4743? -6865 What is next in 14000, 28027, 42006, 55937, 69820, 83655, 97442? 111181 What comes next: 80628, 161247, 241860, 322467, 403068? 483663 What comes next: -209994, -419908, -629820, -839730, -1049638? -1259544 What is the next term in -13319510, -26639031, -39958554, -53278079, -66597606, -79917135, -93236666? -106556199 What is the next term in -118430, -118352, -118222, -118040, -117806, -117520? -117182 What is next in 109, 287, 595, 1069, 1745, 2659? 3847 What comes next: 12037373, 12037360, 12037347, 12037334, 12037321, 12037308? 12037295 What comes next: 4768199, 4768215, 4768231, 4768247, 4768263, 4768279? 4768295 What is next in -140245, -560465, -1260835, -2241355? -3502025 What is next in -9923, -8834, -7021, -4490, -1247, 2702, 7351, 12694? 18725 What comes next: 117555865, 235111722, 352667579, 470223436, 587779293, 705335150? 822891007 What is the next term in 54860, 113679, 172498, 231317, 290136? 348955 What is next in -283899, -1135593, -2555093, -4542399, -7097511? -10220429 What comes next: 2030601, 8122379, 18275349, 32489517, 50764889? 73101471 What is next in -15527, -28852, -42177? -55502 What is next in -692478, -1384975, -2077472, -2769969? -3462466 What comes next: -14394, -28415, -42434, -56451, -70466? -84479 What is the next term in 29200, 28896, 28592, 28288? 27984 What is next in -13061850, -13061854, -13061858, -13061862? -13061866 What comes next: -562136, -1125264, -1688392, -2251520, -2814648? -3377776 What is the next term in 6851767, 6851749, 6851703, 6851617, 6851479, 6851277,	{ "pile_set_name": "DM Mathematics" }
h: 3, m: 1}. What is prob of sequence pmz? 1/80 What is prob of sequence ow when two letters picked without replacement from {o: 4, u: 3, w: 10, r: 1, y: 1}? 20/171 What is prob of sequence aah when three letters picked without replacement from {a: 2, h: 9}? 1/55 Three letters picked without replacement from qwjejqqeqjqjw. Give prob of sequence weq. 5/429 Calculate prob of sequence kb when two letters picked without replacement from {l: 3, b: 7, k: 4}. 2/13 What is prob of sequence hlgg when four letters picked without replacement from {g: 2, l: 1, a: 1, z: 2, h: 8}? 2/3003 Four letters picked without replacement from ssjjs. What is prob of sequence sssj? 1/10 What is prob of sequence tkat when four letters picked without replacement from {a: 1, t: 6, k: 1, v: 3, q: 1}? 1/396 Two letters picked without replacement from {s: 2, f: 2, x: 4}. Give prob of sequence sf. 1/14 Two letters picked without replacement from {t: 2, w: 6, p: 1, q: 1, x: 2}. What is prob of sequence xq? 1/66 Two letters picked without replacement from iczssggnn. What is prob of sequence gn? 1/18 Two letters picked without replacement from eelvrgir. Give prob of sequence vl. 1/56 Calculate prob of sequence jsp when three letters picked without replacement from {p: 1, j: 2, g: 1, s: 4, h: 1}. 1/63 Two letters picked without replacement from {w: 1, d: 3, k: 2, b: 6, r: 5}. Give prob of sequence wb. 3/136 Two letters picked without replacement from {e: 5, g: 3, k: 1, v: 1, f: 5}. What is prob of sequence kg? 1/70 Three letters picked without replacement from kkkkkkkskksssksssss. Give prob of sequence ssk. 40/323 Calculate prob of sequence jbjj when four letters picked without replacement from ssjjvjvjjsvjsjbjjy. 7/1020 Two letters picked without replacement from {d: 1, y: 1, v: 2, q: 1, c: 7, z: 2}. Give prob of sequence zq. 1/91 Calculate prob of sequence dq when two letters picked without replacement from zzaaazadqqananqqnza. 2/171 Two letters picked without replacement from {x: 1, v: 6, f: 3, a: 9}. Give prob of sequence xf. 1/114 Three letters picked without replacement from titgtititih. Give prob of sequence iti. 2/33 Three letters picked without replacement from vvqgvyppv. What is prob of sequence qvp? 1/63 What is prob of sequence ve when two letters picked without replacement from evbe? 1/6 Calculate prob of sequence lla when three letters picked without replacement from paaallllllllaaalpl. 15/136 Two letters picked without replacement from kuskkunukukukukuk. Give prob of sequence sn. 1/272 Calculate prob of sequence lwl when three letters picked without replacement from llwmbliwlwlllwbbb. 7/170 What is prob of sequence cq when two letters picked without replacement from crqqryr? 1/21 Three letters picked without replacement from {v: 1, p: 6, w: 2, t: 3}. What is prob of sequence pvp? 1/44 Three letters picked without replacement from uzdzuuznzuzzz. What is prob of sequence uzu? 7/143 Calculate prob of sequence lox when three letters picked without replacement from {o: 3, l: 1, j: 2, x: 7, e: 4}. 7/1360 What is prob of sequence sgg when three letters picked without replacement from {g: 2, s: 1}? 1/3 Calculate prob of sequence mymi when four letters picked without replacement from {i: 5, m: 2, y: 3}. 1/168 What is prob of sequence jdej when four letters picked without replacement from jedjb? 1/60 Four letters picked without replacement from {r: 5, s: 7}. Give prob of sequence rrrr. 1/99 Two letters picked without replacement from zbzzzabzzz. Give prob of sequence zb. 7/45 What is prob of sequence qsuq when four letters picked without replacement from qqvyqyysus? 1/420 Calculate prob of sequence kbkb when four letters picked without replacement from {b: 7, v: 1, k: 2}. 1/60 Four letters picked without replacement from yyyyyyyyy. What is prob of sequence yyyy? 1 Calculate prob of sequence bn when two letters picked without replacement from nbrtnfnn. 1/14 Two letters picked without replacement from {k: 1, m: 1, a: 1}. What is prob of sequence ma? 1/6 Two letters picked without replacement from {j: 3, r: 5, c: 2}. Give prob of sequence cj. 1/15 What is prob of sequence xw when two letters picked without replacement from {w: 4, o: 4, x: 6}? 12/91 What is prob of sequence srsd when four letters picked without replacement from {s: 9, l: 2, r: 2, d: 3}? 9/910 Four letters picked without replacement from {x: 2, m: 1, i: 1, r: 1, e: 1, n: 1}. Give prob of sequence mrin. 1/840 What is prob of sequence uy when two letters picked without replacement from {g: 2, r: 4, u: 3, x: 3, y: 3, q: 1}? 3/80 What is prob of sequence kkp when three letters picked without replacement from {k: 12, p: 3}? 66/455 Three letters picked without replacement from {b: 3, q: 2, y: 9, e: 5}. What is prob of sequence yeq? 5/323 What is prob of sequence zz when two letters picked without replacement from {z: 4, t: 4, a: 3, k: 3}? 6/91 Calculate prob of sequence rz when two letters picked without replacement from {z: 1, s: 1, g: 1, r: 1, n: 1}. 1/20 Three letters picked without replacement from {t: 10}. Give prob of sequence ttt. 1 Four letters picked without replacement from hkhuhhuuukkkuvuuvuk. What is prob of sequence vhuv? 2/2907 Three letters picked without replacement from wwwwwxwwwxw. What is prob of sequence xww? 8/55 Four letters picked without replacement from {p: 3, b: 1}. What is prob of sequence ppbp? 1/4 Two letters picked without replacement from zuzhzuuhzu. Give prob of sequence uz. 8/45 Three letters picked without replacement from xcxschsu. Give prob of sequence scs. 1/84 Four letters picked without replacement from rcaccacwh. What is prob of sequence hara? 1/1512 Three letters picked without replacement from {v: 1, j: 3}. What is prob of sequence jjv? 1/4 Four letters picked without replacement from goggoopggttotgog. What is prob of sequence optt? 1/1456 Three letters picked without replacement from {c: 7, f: 1, p: 1}. What is prob of sequence cfp? 1/72 Three letters picked without replacement from {p: 3, x: 2, n: 2, z: 4}. Give prob of sequence npp. 2/165 Calculate prob of sequence bbsb when four letters picked without replacement from bssbsbsbbssbb. 21/286 Three letters picked without replacement from rhktthd. What is prob of sequence dtt? 1/105 Calculate prob of sequence aww when three letters picked without replacement from {a: 3, m: 2, w: 4}. 1/14 Four letters picked without replacement from shhsgnghhhhhhhhsshs. Give prob of sequence hhgs. 275/23256 Two letters picked without replacement from wqqwewwwfwfffwffiwf. Give prob of sequence wq. 8/171 Two letters picked without replacement from {y: 2, i: 2, d: 1, m: 1}. What is prob of sequence yi? 2/15 Calculate prob of sequence qq when two letters picked without replacement from eqegqqedee. 1/15 Calculate prob of sequence pfo when three letters picked without replacement from ozofozoyoozpzpfo. 1/120 Three letters picked without replacement from xiinxiiiiggixixninxi. What is prob of sequence nxg? 1/228 What is prob of sequence ccj when three letters picked without replacement from {j: 12, c: 3}? 12/455 What is prob of sequence mcm when three letters picked without replacement from {m: 2, c: 7}? 1/36 Three letters picked without replacement from ccscccsscccccccc. Give prob of sequence scs. 13/560 Four letters picked without replacement from sssasaazlassasusasss. Give prob of sequence luaa. 1/3876 Three letters picked without replacement from {a: 4, x: 1, s: 1, j: 9}. What is prob of sequence xsa? 2/1365 Calculate prob of sequence bcb when three letters picked without replacement from {b: 12, c: 6}. 11/68 Calculate prob of sequence vuu when three letters picked without replacement from iuihvui. 1/105 Calculate prob of sequence aq when two letters picked without replacement from qqa. 1/3 Calculate prob of sequence ip when two letters picked without replacement from {p: 1, i: 4, h: 1, y: 1, w: 4}. 2/55 Three letters picked without replacement from {y: 6, p: 4, r: 2, b: 7, a: 1}. What is prob of sequence bbr? 7/570 What is prob of sequence zwh when three letters picked without replacement from {w: 1, z: 1, t: 1, k: 1, h: 1}? 1/60 Calculate prob of sequence lh when two letters picked without replacement from lkwiwwwidwwih. 1/156 Four letters pi	{ "pile_set_name": "DM Mathematics" }
n. -51 Express -7380 + 7380 - 65s + 2s + 0s + 0s + (-3 + 0 + 4)(-2 + s + 2) in the form xs + y and give x. -62 Rearrange -1768t + 1768t - 114t2 to the form dt*2 + bt + l and give d. -114 Express 3 - p*2 + 4 + 2 + (1 + 2p - 1)(-4 + p + 4) in the form g + xp + yp2 and give g. 9 Express d3 - 3d*4 + 1 + 3d2 - d4 - 6d3 + 3d*3 in the form md*4 + ud*2 + r + gd*3 + ld and give r. 1 Express (5q3 - 4q3 + q3)(-3q + q + 0q)(-3 - 2 + 4) in the form uq + kq*4 + b + vq*2 + yq3 and give k. 4 Express 0 + f2 + 27 - 7 - 2f2 in the form q + bf + zf2 and give q. 20 Express 34u*4 - 39u*4 + 2u*3 + 1 + 0 + 2u*3 in the form t + wu*3 + ju*4 + xu*2 + vu and give j. -5 Express 2i - 3i*3 + 6i*3 + 7i*3 + 2i*3 as v + wi*2 + pi*3 + li and give l. 2 Express (-1 + 1 - 2)(11 - 604f + 7 + 600f) as p + rf and give p. -36 Rearrange 5 - m*2 + 91m - 91m to ym + wm2 + g and give w. -1 Express 253i + 37i2 - 253i in the form l + qi + ci*2 and give c. 37 Rearrange (-6u + 4u + 4u)(-2 + 0 + 6)(-1 + 4 - 2)(0u - 2u - u) to hu + gu2 + k and give g. -24 Express -2124 + 2124 - 210b*3 + (-4 + 4 + b)(0b2 + b2 - 3b*2) as jb*3 + xb + lb2 + d and give j. -212 Express 2 + 9v*2 - 2 + (15v - 7v + 3v)(-2 - 2v + 2) as cv2 + gv + w and give c. -13 Rearrange 4094 + r*2 - 4094 to h + yr*2 + or and give o. 0 Rearrange (4k - 2k - k)(-3k + 4k - 2k)(-9k + 15k + 10k) to the form wk3 + ak + i + gk2 and give w. -16 Express (-7 + 0 - 1)(-4n3 - n3 + 3n*3) as o + yn + dn2 + un*3 and give u. 16 Rearrange (10 + 7 - 7)(3c - c - 3c + 0c + 3c - c + (4c - 2c - 4c)(1 - 1 - 2) + 1 - 1 - c) + (2c - c + 0c)(3 - 1 + 0) to the form qc + d and give q. 42 Express k - 2 - 1 + 2k2 + 4 + (2 + 1 - 4)(-4k2 + 17k*2 - 27k*2) as jk + p + ok2 and give p. 1 Rearrange (-152y + 8620 - 8620)(2 - 2 - 1) to gy + f and give g. 152 Express (-2i3 - i3 + 2i*3)(0i - 17i - 21i) as zi*2 + q + wi + oi3 + ti*4 and give t. 38 Express (6 - 6 + 14f)(0 + 0 - 7f*2)(2f + 0f - 3f) as uf*2 + rf*3 + pf + df4 + k and give d. 98 Rearrange 50g + 2g4 + 3 - g3 - 52g + 2g3 to tg + og4 + z + wg*3 + ag2 and give z. 3 Express -n4 - 4n + 1 - 6n*2 + 3n*4 + 4n in the form vn4 + sn + on2 + an*3 + u and give o. -6 Rearrange (-x - 2 - 3 + 4)(1 + 2 + 0)(-1 - 3 + 3) + 17x - 11x - 17x to the form c + ax and give a. -8 Express (3 - 1 - 3)(8q - 28q - 5q) as bq + o and give b. 25 Express 2y3 + y3 - 7y*3 + (-2y*2 + 2y*2 - 2y*2)(-y + y - y) in the form ny + oy*2 + z + gy*3 and give g. -2 Express -8 + 542j*2 - 1077j2 - j3 + 537j2 - 2j as mj + fj*2 + aj*3 + l and give l. -8 Rearrange 47 + 24 + 2h*2 + 11 to the form ih*2 + vh + s and give i. 2 Express (-2v + v - 6v)(0v + 1 - 2 - v) in the form zv + lv*2 + r and give l. 7 Express 18 - 18 + 27a - 10a as da + p and give d. 17 Rearrange (1 - 1 - 2r)(-344r - 341r + 674r) to the form p + hr*2 + sr and give h. 22 Rearrange -3n - 37n + 1 + 7n to q + on and give o. -33 Express (-f + 1 - 1)(-1 + 2 - 3) + 3f - 3f + f + 12 - 12f - 12 - f + 3f - f + (f - 3f + 0f)(1 + 0 + 1) + 0f - 4f + 3f in the form k + hf and give h. -13 Rearrange 20 - 20 + i*2 + 8i to the form pi2 + t + ni and give p. 1 Rearrange -38i3 - 2i + 1 - 10i3 + 1 - 1 to yi*3 + ui + ki2 + t and give u. -2 Express (o - o - 2o)(0o*2 + 2o*2 - 5o*2) - 30o*3 + 2o + 6o3 + 17o*3 as bo*2 + d + go*3 + ko and give g. -1 Express 200 - 74y - 200 as py + j and give p. -74 Rearrange -2q + 2q + 2q2 + 0q*2 to the form mq + c + xq2 and give x. 2 Rearrange 7w + 3w - 4w + 5w2 to the form hw + tw2 + u and give t. 5 Express -5q - 4 + 11q - 3 as oq + w and give o. 6 Express -5c2 + 3c*2 + 5 + 2c*3 - 1 as u + sc*2 + bc*3 + kc and give s. -2 Rearrange (0a3 + 2a*4 + 0a*3)(-1 + 6 - 3) + (-8a4 + 3a*4 - 2a*4)(6 - 5 + 3) to the form h + pa4 + ja*2 + ta + oa3 and give p. -24 Express (0 - r + 0)(4 + 3 - 5)(-214 - 34r + 214) as k + dr + wr*2 and give w. 68 Rearrange 9 - 49u - 2u3 - 9u - 9 to the form w + ku + gu*2 + xu*3 and give k. -58 Rearrange (5a - 12a - 12a)(10 - 10 - 2a) + 0 - 2a2 + 0 to qa + c + ra2 and give r. 36 Express 5 + i - 6 - 8i - 7i in the form y + bi and give b. -14 Rearrange (-2a - a4 + 2a + (0a4 + a4 + a4)(4 - 4 - 2))(-6 + 1 - 1) to la*3 + ha + na4 + qa*2 + t and give n. 30 Rearrange 0b + 17b + 9b to the form xb + k and give x. 26 Express -3w*2 - 4w*2 + 6w*2 - 2w - 3w3 as tw*3 + hw*2 + rw + f and give t. -3 Rearrange (5s + 25s - 13s)(-s - 2 + 2) + 3s2 + 4s*2 - 5s*2 to zs*2 + ws + m and give w. 0 Rearrange (-1 - 9 + 1)(-4 + 4 - 8x + (-2x - 3 + 3)(-2 + 2 + 2) + 6x - x - 3x - x - 3 + 3) to the form ox + u and give o. 99 Rearrange -5h - 2h + 7h - 10h2 to the form t + yh + qh2 and give q. -10 Express (5 - 5 + 6d*2)(-5 + 5 - 2d) - 2d*3 + 0d*2 + 0d*2 as od*2 + ld + zd3 + c and give z. -14 Express (6 + 0 - 3)(-2j2 + 3j*2 - 2j*2) + (0 + 2 + 0)(-3j2 - 5j*2 + 3j*2) in the form r + yj + cj2 and give c. -13 Express -2v - 4v + 2v + (2 - 5 + 5)(0v + 0v + v) + 4v - 3v + 0v in the form sv + i and give s. -1 Express (0u*2 + 0u2 - u2)(-10 + 51 + u + 25) as g + nu + fu2 + pu*3 and give p. -1 Express 9z - 7z - 3z + 6 in the form j + sz and give j. 6 Rearrange -2 - 6j*2 - 18j*3 + 0 + 19j3 + (2 - j2 - 2)(2j + 2 - 2) to the form q + xj2 + tj + lj3 and give t. 0 Express (-d2 - 6d*2 - 3d*2)(-3 - 3 - 2d + 7 - 8d*2) as wd*2 + o + kd*3 + bd*4 + zd and give w. -10 Rearrange (-1 + 6x + 1)(-4 - 3 + 2)(5x - 2x - 2x) to the form rx2 + jx + u and give r. -30 Rearrange -1 - 11x4 + 30x4 + x2 - 15x4 to the form zx + lx4 + ax*3 + cx*2 + u and give u. -1 Rearrange 2l + 3l - 3l*3 - 13l to z + pl3 + ql + ul2 and give q. -8 Rearrange -11s*2 + 14s*2 - 13 + 19 to os + cs2 + b and give b. 6 Express (5a*3 - 9a3 + a3)(5a - 6a - 1 + 3) as z + va + ba2 + ga*4 + oa*3 and give z. 0 Express -4k + 0k - 8k as s + zk and give z. -12 Express -6 + 2w + 10w - 11w - w*2 in the form d + kw + ow2 and give d. -6 Express -2q + 330 - 330 + 2q2 + 8q*3 - 3q*3 as d + iq + mq3 + kq*2 and give i. -2 Rearrange -4 - 13w + 5 - 2w3 + 12w + 2w3 + 2w*3 - 3w*3 + (1 - 1 - 2w)(-w2 - 5w*2 + 5w*2) to the form ow + r + lw3 + bw*2 and give o. -1 Rearrange -5i*4 - 113i*3 + 6i*4 + 1 + i + 111i*3 to the form mi + d + ni2 + ri*4 + ci*3 and give r. 1 Rearrange (4u - 75u - 1 + 38u)(u2 + 3 - 3) to ru*2 + y + gu*3 + zu and give y. 0 Express 3d - 78 + 89 + 0d - 2d as ad + m and give m. 11 Express -19b2 + b - 1 - 13b*2 + 31b*2 as qb*2 + lb + i and give q. -1 Express 2b3 + 2b*3 - 3b - 6b3 + (2b*2 - 2b*2 - 2b*2)(0b + 2b + b) as h + wb3 + nb + vb2 and give n. -3 Rearrange -661h*2 + h + 661h*2 - 6h*3 to bh*2 + fh*3 + v + jh and give f. -6 Express -3j - 2j*3 + 3 + 69j2 + j4 - 69j2 as zj*2 + mj*3 + y + qj*4 + nj and give q. 1 Rearrange -b - 3b + 0b + 6b to the form h + qb and give q. 2 Express 2h2 - 3 + 0h*2 + 0 - 4h*2 as dh + g + nh2 and give g. -3 Rearrange -13 + 9f - 15 - 10 + 35 to b + xf and give x. 9 Express 36u + 3u3 - 3u*2 - 2u*4 - 67u + 33u - u4 as yu*4 + su*2 + k + nu + au3 and give a. 3 Rearrange 6d*3 - 3d*2 - 3d*2 + 3d2 + d2 + 2 to the form q + fd3 + sd*2 + kd and give s. -2 Express (-2 + 0 + 105k - 88k)(5 - 4 + 0) + 0k + k + k as j + mk and give j. -2 Express -15q*2 + 24q*2 + 9q*2 + 50q*2 as m + nq*2 + bq and give m. 0 Express -13j + 18j - 7j as r + yj and give y. -2 Rearrange -7y2 - 5 - 2 + 7y*2 - 12y*3 to d + ty*2 + qy + ly3 and give l. -12 Express (-7 + 43 + 5)(2 - 2h - 2) as gh + s and give g. -82 Rearrange y*	{ "pile_set_name": "DM Mathematics" }
ssuming f is positive. f(-8/959) Simplify q/q(1/2)q(4/9) assuming q is positive. q(17/18) Simplify (u(-6/7))4 assuming u is positive. u(-24/7) Simplify ((q(2/5))(-8/3))(-42) assuming q is positive. q(224/5) Simplify (l/l(4/11)l)/(((l/l*20)/lll)/l) assuming l is positive. l(227/11) Simplify x37x((x/((x(-28)x)/x))/xx)/x assuming x is positive. x66 Simplify (v/((v(1/4)/v)/v))15/(v10/vv/(v/(v*4v))) assuming v is positive. v*(109/4) Simplify z/(zz*(-2))z(-4/13) assuming z is positive. z(22/13) Simplify ((kk(4/7))/kk/k*5)/(kk*(2/25)k(-1/6)) assuming k is positive. k(-4559/1050) Simplify ddd*(4/17)d(-6) assuming d is positive. d(-64/17) Simplify o*(18/5)o17 assuming o is positive. o(103/5) Simplify ((kkkk2)/k)(-22)(k/(kk(-2))k)(-7/3) assuming k is positive. k(-95) Simplify (j(-1))(-50)/(j/(jjj*0)j)34 assuming j is positive. j50 Simplify (j/(jj/(jj(34/5)/j)))/j(-3) assuming j is positive. j*(44/5) Simplify (j(j*(-1/3)/j)/jj)/jjj*(3/5)(jj(-2/7))(-2/5) assuming j is positive. j(-2/105) Simplify (hh/((h/((h/(h*5h))/h))/h)hhhh/h*(-1/2))/(hh(1/4)/h)9 assuming h is positive. h(-7/4) Simplify (s1/((ss(-10)s)/ss))2 assuming s is positive. s18 Simplify (m/(m/(m(-8)/m))mm(-3/4)/m)13 assuming m is positive. m(-507/4) Simplify (a(2/7)/a)(-16) assuming a is positive. a(80/7) Simplify (i/(i(2/7)ii)((ii/(((ii*4)/i)/i))/i)/iiiiii)/(i*(-2/9)i(ii/(iii*3i))/i) assuming i is positive. i(311/63) Simplify (g6)(-29) assuming g is positive. g(-174) Simplify (zz/((z/(zz*(-2/9)zz)z)/z))/zz(5/3)z(z(1/3)/z)(-24) assuming z is positive. z(193/9) Simplify (k(-10))(2/73) assuming k is positive. k(-20/73) Simplify d(-1)d(1/7) assuming d is positive. d(-6/7) Simplify oo(-17)o(-42) assuming o is positive. o(-58) Simplify (q/(qq/q11))(-7/10) assuming q is positive. q(-7) Simplify (x2x)(-20/11) assuming x is positive. x(-60/11) Simplify w*(18/11)wwwwwww0 assuming w is positive. w(84/11) Simplify x*(2/3)xx1 assuming x is positive. x(8/3) Simplify o(-11)/(ooo/(ooo/(o(-17/4)o))) assuming o is positive. o*(-31/4) Simplify ((ddd/d(-1/2)d)/dd/((ddd4)/dd))/((d/d(-5))/d(1/2)) assuming d is positive. d(-7) Simplify (n(-6)/n(n/(nn/n*(-3))n)/n)8 assuming n is positive. n(-88) Simplify (((yy1y)/yy)/(y/(yy*7y)))/((y*(1/4)y)/(yyy*(2/3)y)) assuming y is positive. y*(161/12) Simplify (d/(ddd(-1/3)))/(ddd(-7)/d)(d(d/(d/(d3d)))/d)/((dd5)/dd) assuming d is positive. d*(10/3) Simplify (bb(-2/9)/b)/b(1/12) assuming b is positive. b(-11/36) Simplify p/p(-4)ppp/(pp/(pp/(p10/p))) assuming p is positive. 1/p Simplify (u1)(-2)/((u/(uu(-2/5)))/u)(12/13) assuming u is positive. u*(-94/65) Simplify iii(-3/16)ii/i(2/5) assuming i is positive. i(273/80) Simplify (ww1)31/(w/w(-3/4))(2/73) assuming w is positive. w(9045/146) Simplify ((v/v(-1))/v)(-1/3)/(v(-5)/(v*3v)) assuming v is positive. v(26/3) Simplify (b/b(-1))/b*4b*(1/3)bb(-1/2) assuming b is positive. b(-7/6) Simplify (y/y(-3/2))/((y(y*8/y)/y)/y)(y/y1)/y(-8) assuming y is positive. y*(9/2) Simplify ((qq*(2/7)qq)/q(-7))/(q(2/3)/q4) assuming q is positive. q(286/21) Simplify (y/y(2/5))9 assuming y is positive. y(27/5) Simplify ((z(-13)z)/z)/z(z/z26)/z assuming z is positive. z(-40) Simplify (r/(rr*(2/13)r))(4/3) assuming r is positive. r(-20/13) Simplify ((g(-2/9)/g)(-18/7))(1/14) assuming g is positive. g(11/49) Simplify (w*8wwww(-1/4)w)/(w(-4)/(w1/w)) assuming w is positive. w*(63/4) Simplify (ggg8)/g(4/5) assuming g is positive. g(46/5) Simplify (bb(b/(b(-3/5)/b))/b)(4/7) assuming b is positive. b(72/35) Simplify (w/(w(-2/15)w))(-39) assuming w is positive. w(-26/5) Simplify (x(1/10)/x(-2))/(x/(xxx*(-1)xx))42 assuming x is positive. x(861/10) Simplify (tt/t*5t)/t*2t*(3/4)tt/(t(tt(-3))/t) assuming t is positive. t(3/4) Simplify (yy(3/5))/y(7/4) assuming y is positive. y(-3/20) Simplify (v/(((v(1/3)v)/v)/v)v)26/((v/(v/v(-7)))/(vv(-2)v)) assuming v is positive. v(229/3) Simplify (v(4/7))(-33) assuming v is positive. v(-132/7) Simplify ((vv/(vvvv/((v*(-1/9)/v)/v)))/vvv(-7))(-2/11) assuming v is positive. v(200/99) Simplify (y22/yy)/(yy21yy) assuming y is positive. y(-2) Simplify ((((d1d)/dd)/d)/d)(-46)/(d/((d/(d1d))/d))(-1/67) assuming d is positive. d(3/67) Simplify ((((s/(s((s/s0)/s)/s)s)/s)/ssss)(4/5))33 assuming s is positive. s(396/5) Simplify ((o/(o/(o(2/3)/o)))12)0 assuming o is positive. 1 Simplify (y3)(-48) assuming y is positive. y(-144) Simplify (mmm/(mm(-1/3)))(-2/21)/((m/((mm6)/m)mm)/(mm(-3))) assuming m is positive. m(7/9) Simplify ((ff(4/3))(-1/64))17 assuming f is positive. f(-119/192) Simplify aa*(-5)aa/((a/(aaa/(aaaa*(-2/5)/a)))/a)((aa(1/6)aa)/a)/a0 assuming a is positive. a(47/30) Simplify l/(l/l6)l*(-1/10)l*(-1/4)ll(-5) assuming l is positive. l(33/20) Simplify c(3/10)c/(c/((cc(-3/13))/c))c assuming c is positive. c(139/130) Simplify (l(-1)/(ll(2/13)))13 assuming l is positive. l(-28) Simplify (s/s0)26/((s/s(-3/8))/(s/(ss/(s/(s/(s(-3/4)/s)))))) assuming s is positive. s(175/8) Simplify (kkk*(1/7)kk/((k/(kk(-2/11)))/k))(-5) assuming k is positive. k(-1910/77) Simplify q(-14)/((q*(-34)/q)/qq) assuming q is positive. q21 Simplify t/(t/t(-6))t(-4/13) assuming t is positive. t(-82/13) Simplify (w0)(-4/7)(((www/(w/(w/w*(-10/3)w)))/w)/w)/w2 assuming w is positive. w(10/3) Simplify w*(9/4)ww(-2/17) assuming w is positive. w(213/68) Simplify m(-2/15)mmm/m*3mm(m/m(-1))(4/5) assuming m is positive. m*(52/15) Simplify ((w(ww(-3)/w)/www)/wwww/w*(-11))/(w(ww(1/10)w)/www(4/5)) assuming w is positive. w(81/10) Simplify (u(-2))(-1/2)u(3/4)u/u4 assuming u is positive. u(-5/4) Simplify v(-3/10)/v(-21) assuming v is positive. v(207/10) Simplify ((i(-1/2)i)/(i3/i))10 assuming i is positive. i(-15) Simplify (t(-4)t)/(tt/(tt*5/tt)t)(t(2/11))(1/8) assuming t is positive. t(1/44) Simplify (z/(z(2/3)/z))(4/5)/(z3/((z(2/5)/z)/z)) assuming z is positive. z(-53/15) Simplify z*(2/11)/((z/(zz*(-15/2)z)z)/zzz) assuming z is positive. z(-183/22) Simplify z(1/2)/z0(z/(zz4))/z(-1) assuming z is positive. z(-5/2) Simplify i(2/11)/(i/(ii/(ii(-1/2))))i*(-2/9)i(-4) assuming i is positive. i(-701/198) Simplify ((l/l(-2/5))/(l(-1/3)l))18 assuming l is positive. l(66/5) Simplify m(17/2)/m(-1/17) assuming m is positive. m(291/34) Simplify (mm/(m/m*(-15))m)/(m*8mm) assuming m is positive. m(-23) Simplify ((q(-4)/q)(-1/9))(-14/11) assuming q is positive. q(-70/99) Simplify ((w(1/2))(4/5))(-1/11) assuming w is positive. w(-2/55) Simplify (x(xx/x(-4))/xx)(2/7) assuming x is positive. x2 Simplify s*10ss/(s15/s) assuming s is positive. s(-2) Simplify (j5/j(1/11))(-15) assuming j is positive. j(-810/11) Simplify (((r(2/7)r)/rr)(-2/93))25 assuming r is positive. r(-150/217) Simplify (cc/(c/c*(-2/5))cc)(13/2)(c*(2/11)c)/(cc/((c/((c6/c)/c))/c)) assuming c is positive. c(1329/110) Simplify (ll/l*(-2/17)ll/(l/(ll(l(-3)l)/lll)))/((l/(l*(-3/4)l))/(l/l(-1/2))) assuming l is positive. l(331/68) Simplify vv6v*0v((v/(vv(-2/13)))/v)/v(-3/7) assuming v is positive. v*(690/91) Simplify (m(m(3/8)/m)/m)(-34) assuming m is positive. m(85/4) Simplify (x/(((x13x)/x)/x))/((x10x)/x) assuming x is positive. x(-21) Simplify (n(-2)/n)/(nn7n) assuming n is positive. n(-12) Simplify c6/(c/c3) assuming c is positive. c8 Simplify ((u/(uu(-2/5)u))/u)(-1/15)/((u/((u/(u2u))/u))/uu*(-9)) assuming u is positive. u	{ "pile_set_name": "DM Mathematics" }
True Which is smaller: -1/180 or -35? -35 Which is smaller: 331 or 334? 331 Which is bigger: -14.5 or -1/2? -1/2 Is 2/2173 > 1? False Which is smaller: -60/37 or -1? -60/37 Which is smaller: -0.1 or -2.6265? -2.6265 Which is smaller: 35/13 or 2? 2 Are -49 and 4/5 equal? False Which is bigger: -377 or -379? -377 Which is smaller: -1 or -0.03221? -1 Is 45 < 13? False Is -672 >= -1343/2? False Which is bigger: 22 or 108? 108 Which is bigger: -51 or -523/10? -51 Is -79 > -238/3? True Is 0 bigger than -72/385? True Is -5/623 less than -1? False Is -132/17 > -9? True Is -14434 greater than or equal to -14434? True Which is greater: -74/5 or -0.1? -0.1 Which is smaller: 22 or -7/17? -7/17 Are 0 and -3/7264 nonequal? True Which is smaller: 2/5 or 70? 2/5 Which is greater: -1/2 or 418? 418 Which is smaller: -27.21 or -5? -27.21 Is -163 less than or equal to -173? False Which is greater: -1 or 2/177? 2/177 Which is bigger: -17 or -28? -17 Which is smaller: 78 or 55? 55 Which is greater: -5/1767 or 0? 0 Which is smaller: 44 or 60? 44 Is 635 greater than 4? True Which is smaller: 560/101 or 5? 5 Which is bigger: -1578 or -1574? -1574 Are 0 and 22/1049 nonequal? True Which is smaller: -226 or -31? -226 Which is bigger: -24 or -40? -24 Is 201 greater than 186? True Which is smaller: -0.0846 or -3? -3 Is 7/3 equal to -19? False Are 1/274 and 1 non-equal? True Are -3/8 and -1 non-equal? True Is -6372 smaller than -6372? False Which is greater: -1 or -2/30607? -2/30607 Which is bigger: -8/9 or -1? -8/9 Are -859 and -859 equal? True Which is greater: 2730/31 or 87? 2730/31 Is 3 bigger than 125/78? True Which is bigger: 1 or -26/333? 1 Is 0 at most 1/21? True Which is greater: 4/3291 or 0? 4/3291 Which is smaller: 188 or 566/3? 188 Which is greater: -218 or -213? -213 Is -1/2296 bigger than -1? True Which is greater: 2/735 or -1? 2/735 Is 54 less than -8? False Is 29/3 at most 1/2? False Which is smaller: 1/147 or 1? 1/147 Do 758 and 758 have different values? False Which is greater: 0.009 or 4? 4 Which is smaller: -1 or -5/576? -1 Are -1786 and -1788 non-equal? True Which is bigger: 1/2433 or -1? 1/2433 Which is bigger: 41 or 962/23? 962/23 Is 60 at most 1/3? False Which is greater: 0.7 or 1/1265? 0.7 Which is bigger: -349 or -350? -349 Is 302 less than 302? False Is -13 at most -603/49? True Which is smaller: 5/6478 or -1? -1 Which is greater: 0 or -2/6301? 0 Which is smaller: 0 or 12? 0 Is 0 < 9/359? True Is -520 < -520? False Is -3255 less than -3255? False Is 982 at most -5? False Which is bigger: -1 or -126/281? -126/281 Which is bigger: 1 or 2/245? 1 Which is greater: -0.115 or 0.4? 0.4 Which is greater: -123 or 1/4? 1/4 Which is greater: 6680 or 33406/5? 33406/5 Which is bigger: -982 or -983? -982 Is 0 equal to 3/202? False Which is smaller: -1 or 17/1549? -1 Is -12436/7 greater than -1778? True Are 1 and -10695 non-equal? True Which is greater: 0.1 or 33? 33 Is -23 greater than or equal to -0.07? False Which is bigger: -16 or -14? -14 Which is smaller: -10 or 0.066? -10 Is 243/2 != 122? True Are -137 and -6 nonequal? True Is 0 less than or equal to 1? True Which is greater: -2123 or -2121? -2121 Is 0 at most as big as -43/38? False Is 3081 greater than 3081? False Is 1 less than 2/2837? False Is -20 >= -26? True Are 0.088 and -0.3 nonequal? True Which is bigger: 585 or 586? 586 Is 1 less than or equal to -5/4446? False Is 13 at least 186/13? False Which is smaller: 3/506 or 1? 3/506 Is -218 at least as big as -1309/6? True Is 103 > 1558/15? False Which is greater: 168 or 154? 168 Is 1 at least -26? True Which is greater: 22 or 28/9? 22 Which is smaller: -6891 or -6895? -6895 Which is smaller: 106/21 or 5? 5 Which is bigger: -6 or 99? 99 Is 290 at least as big as 289? True Which is smaller: -36 or -2? -36 Which is smaller: -1970 or -1966? -1970 Which is smaller: 1 or -3/11461? -3/11461 Is -29.3 bigger than 2? False Is 243 greater than or equal to 243? True Which is smaller: -293 or -21? -293 Is 259 smaller than 262? True Which is bigger: 48/37 or 0? 48/37 Which is bigger: 6037 or 6040? 6040 Is 55 at most as big as 53? False Which is bigger: -704/23 or -30? -30 Which is bigger: 881 or 880? 881 Is 3/16619 equal to -1? False Which is bigger: -74 or -15? -15 Which is smaller: 551 or 549? 549 Which is greater: -1 or -1/47? -1/47 Is 16 < -0.86? False Are -1 and 1/3012 nonequal? True Is -57 greater than 14/3? False Does 108 = 110? False Which is smaller: 128 or 134? 128 Are -0.1 and 1/23 nonequal? True Is -344 at most 13/3? True Is 5454 <= 5455? True Is 67 at most as big as 67? True Which is greater: 108/17 or 5? 108/17 Is 651 < 651? False Which is bigger: 0 or -1/123? 0 Which is smaller: 2/5 or 0.03? 0.03 Which is smaller: 18/1657 or -1? -1 Is -25154 greater than -25153? False Which is smaller: -4 or -110? -110 Is 4 greater than -3? True Is -30 bigger than -604/21? False Which is bigger: -4809 or -4816? -4809 Is -216 less than or equal to -223? False Which is smaller: 12 or 175/16? 175/16 Are 0 and -65/1067 unequal? True Does -14 = -83/6? False Which is greater: -975 or -1/2? -1/2 Which is smaller: 1/9213 or 1? 1/9213 Which is smaller: 0.98 or 3/8? 3/8 Which is smaller: -6.7 or 49? -6.7 Is 557 greater than or equal to 556? True Is 1141 at most as big as 1140? False Does -5 = -14? False Which is bigger: 770 or 768? 770 Which is greater: 19 or 264? 264 Do -6491 and -6490 have different values? True Is 494 equal to 494? True Which is smaller: 10 or 0.7? 0.7 Which is smaller: 2621 or 23594/9? 2621 Does 1/3 = -140? False Which is smaller: -122.3 or 0.09? -122.3 Is 1 at least as big as 3/7148? True Is -0.1 not equal to 1/800? True Which is smaller: -5/32 or 36? -5/32 Is 13.973 less than 1? False Which is bigger: 5041 or 5042? 5042 Do -1 and 483 have different values? True Which is smaller: 172 or 173? 172 Which is greater: -14 or -6? -6 Which is greater: -15/53 or 1? 1 Which is greater: 1/2 or -761.3? 1/2 Are -2587 and -2587 non-equal? False Is -261 at least as big as -9? False Which is smaller: 0 or -2/71? -2/71 Which is bigger: -72/13 or -5? -5 Is 3777 at most 3777? True Which is bigger: -61 or -23? -23 Are -2 and -2 nonequal? False Is 45 at most as big as 75? True Is -3 less than or equal to 78/5? True Which is greater: -45/106 or 1? 1 Which is smaller: -3013 or -3012? -3013 Which is smaller: 9 or -4/49? -4/49 Is -1 at most -7/156? True Which is smaller: -1 or 90/559? -1 Is 1/3 at most -154? False Do 3326 and 3330 have different values? True Is -15 equal to -11? False Is 0.2 != 13351? True Which is smaller: 17/26 or 2? 17/26 Is 1 less than -1/2656? False Which is bigger: -425/4 or -106? -106 Which is greater: 1 or -5203? 1 Is 149 greater than 443/3? True Is 118 <= 154? True Which is smaller: 143 or -1/2? -1/2 Is 1/69 greater than or equal to 0? True Which is smaller: 0 or -870? -870 Are -30620 and -30620 nonequal? False Do -4893 and -2 have different values? True Which is smaller: 2839 or 2842? 2839 Is 98 != 41? True Is 5/16644 greater than 1? False Which is bigger: 67 or 4? 67 Is -203 less than -214? False Which is smaller: 181 or 182? 181 Is 5/5061 != -1? True Which is greater: 3/1888 or 1? 1 Is -0.0066 > 0.3? False Is 295 at least 252? True Is -4/5583 at least -1? True Is 0 <= -4/33? False Does 0 = 1558? False Which is smaller: 307 or -1? -1 Is -6/5 at most as big as -40.3? False Which is bigger: 835 or 0? 835 Is -18 at least -9? False Is 0 < -6/217? False Which is smaller: 2353 or -2/3? -2/3 Is -41 < -37? True Which is greater: 148 or 139? 148 Which is bigger: 1/2 or 17391? 17391 Which is bigger: 221 or 664/3? 664/3 Is 23 less than or equal to 0? False Which is bigger: 416 or 365? 416 Are 138 and 137 nonequal? True Which is bigger: 105/13 or 0? 105/13 Which is smaller: -1326 or -1324? -1326 Are 559 and 558 nonequal? True Is 3 bigger than 104/47? True Which is bigger: 5 or -192? 5 Which is bigger: -16 or -129/8? -16 Is 3 > -588? True Which is greater: -19 or -1/27? -1/27 Which is greater: 24.7 or -2? 24.7 Which is smaller: -3998 or 0.3? -3998 Is -4473 >= -4473? True Is 83 at least 748/9? False Is 22/97 >= 1? False Is -1697/4 <= -423? True Is -803 greater than -802? False Is -80 less than or equal to -79? True Which is smaller: 174 or 185? 174 Is -0.0458 >	{ "pile_set_name": "DM Mathematics" }
22? 6 What is the remainder when 1288061 is divided by 2618? 5 What is the remainder when 2963483 is divided by 246945? 143 Calculate the remainder when 76694 is divided by 14043. 6479 Calculate the remainder when 11931 is divided by 594. 51 Calculate the remainder when 107080 is divided by 595. 575 What is the remainder when 2484462 is divided by 148? 134 What is the remainder when 196063 is divided by 4108? 2987 What is the remainder when 26581322 is divided by 188520? 2 Calculate the remainder when 41405 is divided by 904. 725 What is the remainder when 17495995 is divided by 135? 130 Calculate the remainder when 340112 is divided by 213. 164 Calculate the remainder when 18314109 is divided by 166. 159 Calculate the remainder when 422120 is divided by 105526. 16 What is the remainder when 708330 is divided by 9703? 11 Calculate the remainder when 25533210 is divided by 20. 10 Calculate the remainder when 317091 is divided by 1331. 313 What is the remainder when 737266685 is divided by 1559? 1554 Calculate the remainder when 28368467 is divided by 335. 332 Calculate the remainder when 135769093 is divided by 38. 33 Calculate the remainder when 715287 is divided by 7860. 27 Calculate the remainder when 36441696 is divided by 852. 804 Calculate the remainder when 837380 is divided by 153. 11 Calculate the remainder when 72626668 is divided by 772. 768 What is the remainder when 100192 is divided by 3024? 400 What is the remainder when 156578 is divided by 15641? 168 What is the remainder when 22677 is divided by 11151? 375 Calculate the remainder when 269125 is divided by 237. 130 What is the remainder when 7935131 is divided by 24875? 6 What is the remainder when 439487263 is divided by 105? 103 Calculate the remainder when 832252 is divided by 208039. 96 Calculate the remainder when 694628 is divided by 651. 11 What is the remainder when 79296 is divided by 26420? 36 Calculate the remainder when 20991 is divided by 775. 66 What is the remainder when 1775375 is divided by 2? 1 What is the remainder when 2839414 is divided by 45796? 62 Calculate the remainder when 10291232 is divided by 781. 776 Calculate the remainder when 935630135 is divided by 358. 357 Calculate the remainder when 38829448 is divided by 137. 86 Calculate the remainder when 183659769 is divided by 976. 969 Calculate the remainder when 1654026257 is divided by 3577. 3572 What is the remainder when 1843127 is divided by 360? 287 What is the remainder when 446022 is divided by 21237? 45 What is the remainder when 2898061 is divided by 2898058? 3 Calculate the remainder when 1254419 is divided by 418133. 20 Calculate the remainder when 393500 is divided by 469. 9 What is the remainder when 3902792 is divided by 21? 5 What is the remainder when 1461233 is divided by 902? 895 Calculate the remainder when 127772 is divided by 60. 32 What is the remainder when 89870451 is divided by 9? 6 What is the remainder when 235339 is divided by 77555? 2674 Calculate the remainder when 53379 is divided by 12768. 2307 What is the remainder when 75876551 is divided by 4343? 4341 Calculate the remainder when 12360521 is divided by 29. 25 What is the remainder when 369626 is divided by 238? 12 Calculate the remainder when 61941942 is divided by 195. 192 What is the remainder when 14048480 is divided by 7? 5 What is the remainder when 497811 is divided by 380? 11 What is the remainder when 40141 is divided by 5011? 53 Calculate the remainder when 162261 is divided by 415. 411 What is the remainder when 4292006 is divided by 58000? 6 Calculate the remainder when 9824 is divided by 4905. 14 Calculate the remainder when 1593184 is divided by 989. 894 Calculate the remainder when 47385314 is divided by 423. 8 Calculate the remainder when 164003 is divided by 163041. 962 What is the remainder when 928324 is divided by 28129? 67 Calculate the remainder when 73952 is divided by 24387. 791 Calculate the remainder when 396559 is divided by 132158. 85 Calculate the remainder when 874470 is divided by 145710. 210 Calculate the remainder when 90683 is divided by 182. 47 Calculate the remainder when 52579594 is divided by 53. 43 Calculate the remainder when 447867 is divided by 447003. 864 Calculate the remainder when 1881656 is divided by 12136. 576 Calculate the remainder when 1790957 is divided by 62. 25 What is the remainder when 172745 is divided by 122? 115 Calculate the remainder when 22205 is divided by 22070. 135 What is the remainder when 1393644 is divided by 174201? 36 Calculate the remainder when 330355 is divided by 15731. 4 Calculate the remainder when 1547735 is divided by 38. 33 What is the remainder when 136916937 is divided by 15628? 29 What is the remainder when 7946130 is divided by 107380? 10 What is the remainder when 66140368 is divided by 2363? 2361 What is the remainder when 1927403 is divided by 3016? 179 What is the remainder when 1242487 is divided by 451? 433 Calculate the remainder when 2743393 is divided by 446. 47 What is the remainder when 819573 is divided by 52? 1 What is the remainder when 634892 is divided by 13794? 368 What is the remainder when 2086837 is divided by 521708? 5 What is the remainder when 148218 is divided by 2355? 2208 Calculate the remainder when 82734 is divided by 4584. 222 What is the remainder when 5275826 is divided by 97? 93 What is the remainder when 138349 is divided by 23051? 43 Calculate the remainder when 385333 is divided by 1059. 916 What is the remainder when 29403198 is divided by 3540? 3498 Calculate the remainder when 1327390 is divided by 15612. 370 What is the remainder when 189774 is divided by 62320? 2814 Calculate the remainder when 3090574 is divided by 7024. 14 Calculate the remainder when 23927964 is divided by 516. 12 Calculate the remainder when 287838 is divided by 28780. 38 Calculate the remainder when 4238379 is divided by 1059590. 19 Calculate the remainder when 1721592 is divided by 54. 18 Calculate the remainder when 83970 is divided by 1185. 1020 What is the remainder when 739821 is divided by 5918? 71 What is the remainder when 14499847 is divided by 3567? 3559 What is the remainder when 987481 is divided by 493737? 7 Calculate the remainder when 127825937 is divided by 110. 107 What is the remainder when 16098267 is divided by 2742? 2727 Calculate the remainder when 73011509 is divided by 253. 10 What is the remainder when 66993 is divided by 1065? 963 What is the remainder when 2329774 is divided by 29? 1 Calculate the remainder when 1325901 is divided by 78. 57 What is the remainder when 91629840 is divided by 105? 15 What is the remainder when 55935122 is divided by 14? 12 What is the remainder when 999251 is divided by 35? 1 What is the remainder when 68632357 is divided by 75? 7 Calculate the remainder when 2321081 is divided by 2717. 763 What is the remainder when 219590 is divided by 4354? 1890 Calculate the remainder when 2793059 is divided by 994. 913 What is the remainder when 42911 is divided by 2624? 927 Calculate the remainder when 101706 is divided by 1418. 1028 Calculate the remainder when 237016 is divided by 377. 260 What is the remainder when 3971925 is divided by 1271? 50 What is the remainder when 6665002 is divided by 1038? 4 Calculate the remainder when 127047 is divided by 1286. 1019 What is the remainder when 688750 is divided by 48? 46 What is the remainder when 1529190 is divided by 1562? 1554 Calculate the remainder when 882632 is divided by 4880. 4232 What is the remainder when 81921 is divided by 386? 89 What is the remainder when 959373 is divided by 7560? 6813 What is the remainder when 6526145 is divided by 37? 11 What is the remainder when 56582 is divided by 27639? 1304 Calculate the remainder when 28593 is divided by 1990. 733 What is the remainder when 918372 is divided by 23548? 0 Calculate the remainder when 7260631 is divided by 1881. 1852 Calculate the remainder when 201700 is divided by 67167. 199 What is the remainder when 17939397 is divided by 4484844? 21 Calculate the remainder when 1849646 is divided by 5622. 8 What is the remainder when 12787039 is divided by 53279? 79 What is the remainder when 20726892 is divided by 3815? 3812 What is the remainder when 2513173 is di	{ "pile_set_name": "DM Mathematics" }
in 536.5474 micrograms? 536547.4 What is 47925.08 hours in seconds? 172530288 Convert 4327.494ug to grams. 0.004327494 Convert 5526.683 micrograms to kilograms. 0.000005526683 Convert 868.93155 minutes to days. 0.6034246875 Convert 0.7144583 grams to nanograms. 714458300 What is 5/8 of a kilogram in grams? 625 Convert 13.501566 months to years. 1.1251305 How many micrometers are there in 6/5 of a millimeter? 1200 How many microseconds are there in 5/8 of a millisecond? 625 How many minutes are there in 4/3 of a day? 1920 Convert 0.305865 years to decades. 0.0305865 What is 295109.6mm in micrometers? 295109600 How many milligrams are there in 6/25 of a gram? 240 What is 3/32 of a millennium in months? 1125 What is 7/2 of a decade in months? 420 What is 6327.737 centuries in months? 7593284.4 How many seconds are there in twenty-three thirds of a minute? 460 What is 204900.72ns in minutes? 0.000003415012 How many millilitres are there in five eighths of a litre? 625 What is 3/40 of a millennium in months? 900 What is 59.51867m in nanometers? 59518670000 How many years are there in one twentieth of a century? 5 What is 412654.7 millimeters in micrometers? 412654700 What is 17802.1 centimeters in meters? 178.021 Convert 67711.01 milliseconds to seconds. 67.71101 How many micrograms are there in 3/10 of a milligram? 300 How many millilitres are there in 7/4 of a litre? 1750 How many litres are there in 79.56589 millilitres? 0.07956589 How many years are there in thirteen quarters of a millennium? 3250 What is 0.5079234t in micrograms? 507923400000 How many millilitres are there in one tenth of a litre? 100 What is 5/28 of a week in minutes? 1800 What is 7/4 of a week in hours? 294 Convert 33.30144 litres to millilitres. 33301.44 What is three tenths of a millimeter in micrometers? 300 What is 8360.37ml in litres? 8.36037 How many tonnes are there in 797.371ng? 0.000000000000797371 How many hours are there in twenty-five halves of a day? 300 What is 0.1855539t in grams? 185553.9 How many millilitres are there in 3/40 of a litre? 75 What is 1/20 of a gram in milligrams? 50 How many centimeters are there in 44.71605mm? 4.471605 How many years are there in 29/2 of a millennium? 14500 What is 3.169007 hours in seconds? 11408.4252 How many seconds are there in 404589.1 weeks? 244695487680 How many milligrams are there in 0.6987564 micrograms? 0.0006987564 What is 3/10 of a gram in milligrams? 300 How many years are there in twenty-nine halves of a century? 1450 Convert 150954.6969ns to weeks. 0.00000000024959440625 How many centimeters are there in seventeen halves of a meter? 850 How many micrometers are there in 7891.567 kilometers? 7891567000000 How many nanometers are there in 7.88496cm? 78849600 What is 97133.3 litres in millilitres? 97133300 How many meters are there in 805.6296 kilometers? 805629.6 How many millimeters are there in 13/4 of a meter? 3250 What is 21856.61 years in months? 262279.32 How many decades are there in three fifths of a millennium? 60 What is 1/5 of a milligram in micrograms? 200 How many centimeters are there in 31/5 of a meter? 620 How many millilitres are there in 3/8 of a litre? 375 How many decades are there in 5.202064 years? 0.5202064 What is 3/32 of a millimeter in nanometers? 93750 What is twenty-two ninths of a day in minutes? 3520 What is 29.8001 years in months? 357.6012 How many kilograms are there in 19/4 of a tonne? 4750 How many months are there in twenty-one eighths of a century? 3150 What is 1/20 of a kilometer in meters? 50 How many micrometers are there in 99720.12m? 99720120000 How many meters are there in fourty-four fifths of a kilometer? 8800 What is 7/4 of a century in years? 175 What is 47/4 of a meter in millimeters? 11750 How many micrometers are there in 21/4 of a centimeter? 52500 What is 8.097806 centuries in months? 9717.3672 How many months are there in one twentieth of a millennium? 600 What is seventy-five quarters of a second in milliseconds? 18750 What is one sixteenth of a milligram in nanograms? 62500 What is 0.2731558ml in litres? 0.0002731558 What is 0.1930997 microseconds in nanoseconds? 193.0997 What is twenty-seven quarters of a centimeter in micrometers? 67500 What is 3/32 of a tonne in grams? 93750 What is 2496.11 days in seconds? 215663904 What is 3/10 of a millennium in centuries? 3 How many months are there in 6/5 of a millennium? 14400 What is twenty-seven fifths of a century in decades? 54 How many months are there in thirty-two fifths of a millennium? 76800 How many litres are there in 0.488951ml? 0.000488951 Convert 0.6027706mm to centimeters. 0.06027706 What is 21/4 of a millennium in months? 63000 What is 6/5 of a hour in seconds? 4320 What is 27.69987 micrometers in nanometers? 27699.87 How many seconds are there in 336.272 weeks? 203377305.6 What is 1/5 of a litre in millilitres? 200 What is 77/3 of a minute in seconds? 1540 What is 3334.041 millimeters in kilometers? 0.003334041 How many years are there in 5/8 of a millennium? 625 Convert 79977.68 decades to millennia. 799.7768 What is 8/25 of a microsecond in nanoseconds? 320 How many minutes are there in 874.0219 days? 1258591.536 How many years are there in 1/10 of a decade? 1 What is 172731.9 years in millennia? 172.7319 What is 4188.14 weeks in milliseconds? 2532987072000 Convert 68360109.3s to weeks. 113.02928125 How many centuries are there in 27463.96 years? 274.6396 How many tonnes are there in 569364.8 kilograms? 569.3648 How many millimeters are there in 61266.07 centimeters? 612660.7 Convert 0.3061621l to millilitres. 306.1621 How many grams are there in 419252.3ug? 0.4192523 What is 0.090633nm in micrometers? 0.000090633 What is 24315.8 litres in millilitres? 24315800 How many millilitres are there in three tenths of a litre? 300 How many tonnes are there in 983.4655 micrograms? 0.0000000009834655 What is 1/4 of a minute in milliseconds? 15000 Convert 77.61109 years to millennia. 0.07761109 Convert 75504.68kg to nanograms. 75504680000000000 How many millimeters are there in 865822.7 micrometers? 865.8227 Convert 8004.63 micrometers to meters. 0.00800463 How many millilitres are there in 33/5 of a litre? 6600 How many millilitres are there in thirty-one halves of a litre? 15500 How many millilitres are there in 15/4 of a litre? 3750 What is fifty-two fifths of a microgram in nanograms? 10400 What is 43/4 of a microsecond in nanoseconds? 10750 Convert 76347.58l to millilitres. 76347580 Convert 2073.555ml to litres. 2.073555 What is twenty-three thirds of a century in months? 9200 What is five eighths of a kilogram in grams? 625 How many meters are there in 3/50 of a kilometer? 60 How many litres are there in 0.4097395 millilitres? 0.0004097395 How many nanometers are there in 8493.295mm? 8493295000 What is 51/2 of a litre in millilitres? 25500 How many months are there in 6/25 of a century? 288 How many meters are there in 11/10 of a kilometer? 1100 Convert 241714.6t to micrograms. 241714600000000000 What is 0.8671344 litres in millilitres? 867.1344 How many seconds are there in 7.020125 milliseconds? 0.007020125 What is 0.2776432um in centimeters? 0.00002776432 How many months are there in twenty-three thirds of a millennium? 92000 What is eighteen fifths of a millimeter in micrometers? 3600 What is 49/5 of a microgram in nanograms? 9800 What is fifteen quarters of a tonne in kilograms? 3750 What is 293.7131l in millilitres? 293713.1 What is 77/2 of a microsecond in nanoseconds? 38500 How many nanometers are there in 52760.12 millimeters? 52760120000 How many months are there in one fifth of a millennium? 2400 How many micrometers are there in 27/5 of a millimeter? 5400 What is 8/25 of a kilogram in grams? 320 What is 228041.1us in minutes? 0.003800685 What is 332169.9 months in years? 27680.825 How many nanograms are there in thirty-seven halves of a microgram? 18500 What is 6/25 of a meter in centimeters? 24 How many centimeters are there in 97/2 of a meter? 4850 How many millimeters are there in 3/32 of a kilometer? 93750 Convert 140.0467 centuries to months. 168056.04 How many micrograms are there in 8/25 of a milligram? 320 What is 69548.42ml in litres? 69.54842 How many millilitres are there in	{ "pile_set_name": "DM Mathematics" }
sh - 3h for h. -1 Suppose 48 = 3b + 4k, 6 = k + 3. Let u(r) = r*2. Let p be u(2). Suppose -t = -pt + 6. Solve -tm - b + 2 = 0 for m. -5 Suppose 4j = 4g + 32, g + 4 = 4j - 22. Solve 2c = -4 - j for c. -5 Suppose -s - 2s + 2 = -2n, -4s + 3n = -2. Solve 6 = 4a - s for a. 2 Let j = 5 + -3. Let w = -26 - -28. Let i = w - j. Solve ig - 5 = g for g. -5 Let j be (-208)/39(-5 - (-1 - 1)). Solve -2s - 2s = j for s. -4 Suppose 5h + 15 = -0. Let q = 1 - h. Suppose qb + 0b = 2w - 26, 3b = 5w - 37. Solve wg + 19 = 4 for g. -3 Let j be (-1)/1 + -1 + 2. Suppose -4v - 4 + 20 = j. Solve 2 + v = -2g for g. -3 Suppose -4s - 20 = -4n, -n = -4s + 5s - 1. Let d = 12 + -5. Solve -dx = -nx for x. 0 Suppose 48 = 4k - 12. Suppose 7j + k = 12j. Solve 2 = -5m - j for m. -1 Suppose -3g + 2f = -10, 6g - 2g - 5f - 18 = 0. Suppose v + 4 = 0, o - 44 = -2o + 5v. Let y = o + -5. Solve 0 = yc + gc - 5 for c. 1 Let l = 4 - 12. Let y = -5 - l. Solve -yk = -k - 2 for k. 1 Let p(v) = -v3 - 9v*2 - v - 6. Let l be p(-9). Suppose -lt = -3 - 3. Solve -5o + 6 = -to for o. 2 Suppose 43 = 5a - 17. Let s = -11 + a. Solve -f - s = -6 for f. 5 Let p be 6/412. Let a(d) = -d2 - 15d - 14. Let y be a(-14). Suppose y = 10z - 4z - 150. Solve -8r + z = -pr for r. 5 Let i be (3/(-2) - 1)-2. Solve i = -5t - 5 for t. -2 Let r be -24 - (0 + -1 + 2). Let u be 4/(-10)r/5. Solve ug - g = -1 for g. -1 Let y(i) = i + 7. Let l(m) = 2m + 7. Let o(r) = -2l(r) + 3y(r). Let p be o(-5). Solve p - 4 = -4f for f. -2 Suppose -3m - 3 = -4m. Solve mo - 10 = -2o for o. 2 Suppose 0 - 2 = -2z. Let p = 2 + -2. Suppose p = k + k - 8. Solve -h = -z + k for h. -3 Suppose 0 = -4l - 40 + 72. Solve -6y + 2y = l for y. -2 Let p(v) = -v3 - v2 + 2v - 7. Let d be p(-3). Solve -4b = b + d for b. -1 Suppose -3j - 7 = -19. Suppose i = -jb + 8, -b = b - 2i - 4. Let r = b + 0. Solve rq + 5 = 3 for q. -1 Let t(l) = l*2 - 12l + 2. Let x be t(12). Suppose -r - 2 = -6. Suppose -4z + 4 = -r. Solve m - zm = x for m. -2 Suppose b = 9b - 16. Solve 3y + b + 7 = 0 for y. -3 Suppose 0 = -2j + j + 2. Solve 2 = jb + 8 for b. -3 Let o be (-50)/(-3) - 2/3. Let n = o - 7. Suppose -3a - 2a + 4p = -45, a - 3p - n = 0. Solve -5k = a + 16 for k. -5 Let i = 165 + -160. Solve 0 = -6q + iq + 3 for q. 3 Let f be (-2 + 4 - 3) + 6. Suppose 5j = fx - 15, 7j + 12 = 5x + 3j. Suppose x = z - 3. Solve zs + s = 20 for s. 5 Suppose -t + 0 = 4. Let a(l) = 13 - 13 + l - 2l. Let k be a(t). Solve -r - r - k = 0 for r. -2 Suppose 4w + 5n + 0 = 4, -5w + 50 = -5n. Solve -c - c - w = 0 for c. -3 Let k(j) = 3j - 19. Let r be k(7). Solve 2s + 8 + r = 0 for s. -5 Let f(x) = 2x2 - 5 + 4 - 11x*2 + 18x. Let k(v) = -4v2 + 9v - 1. Let r(i) = 3f(i) - 7k(i). Let j be r(9). Solve 7g - 9 = jg for g. 3 Let c be (-17 + -1)/((-1)/(-1)). Let u = -3 - c. Solve 6 = 3d + u for d. -3 Let i be 1 - (1 + -4 + 2). Let m be (1/(-2))/(i/(-8)). Solve mp = -p + 6 for p. 2 Suppose 0u + u - 3 = 0. Suppose 0 = -p + u. Solve pb - 17 = -5 for b. 4 Let x = 1 + 0. Let o be (x - 5)/(1 + -2). Solve 2 = -2r + or for r. 1 Let i = -5 - -7. Solve -6m - i = -7m for m. 2 Let a(v) = -2v - 2 + 3v - 1. Let k be a(11). Solve 2w = 4w - k for w. 4 Suppose -4v + 3v = -5. Solve 3k + v + 7 = 0 for k. -4 Suppose -j + 26 - 1 = 5x, 4j - 5x = 0. Solve 0g + jg = -10 for g. -2 Let b = 11 - 7. Suppose 2i + b = 2f, 0 = -i - f - 4 + 10. Suppose -4o + 12 = -2o. Solve -2a - i = o for a. -4 Let r(x) = -x + 9. Let p be r(5). Solve -4 = -pw - 0 for w. 1 Let c = -22 - -34. Suppose f - 4f = 0. Suppose -o + 4o + 3k = 12, o - 4k + 1 = f. Solve -c - 3 = on for n. -5 Suppose 0 = 5s - 7s. Suppose -2g + 32 - 12 = s. Suppose -5x + 0 = -g. Solve 3b - x = -8 for b. -2 Let n = 28 + -24. Solve n = 2v - 2 for v. 3 Let j(c) = c. Let f be j(-12). Let r be (-2)/(-2(-3)/f). Solve l + rl = 0 for l. 0 Let j = -1 - 7. Let q be ((-30)/j)/(1/4). Suppose 2g + 3g + q = -4l, 3 = -g. Solve l = -3v + v for v. 0 Let y be (3/2)/((-9)/(-30)). Solve 0 = yb + 25 - 10 for b. -3 Let h(c) = -2c - 1. Let m be h(-3). Suppose mu = 6 + 39. Solve 3k + 6 = -u for k. -5 Suppose -5z + 31 = 11. Suppose -5q = 9 - 4, 0 = 2t + zq + 4. Solve -3j = -3 - t for j. 1 Suppose 2c + c - 21 = 0. Let g be 3/(-9) + 2/6. Suppose g = 2d - 0d - 4. Solve 1 = -dn + c for n. 3 Let b = 0 - -1. Suppose 2 = -3i - b. Let f = 3 + i. Solve -3v + v = -f for v. 1 Let j = -4 - -9. Suppose 0 = 5p - j - 0. Let a be -14(p/2 - 1). Solve -2i = -ai + 15 for i. 3 Let s(w) = -2w2 - 8w. Let t be s(-4). Let u = -6 - -8. Solve 3h - uh - 4 = t for h. 4 Let g = -2 + 5. Suppose 0 = 2y + gj - 15, -5y - j = -2j + 5. Solve 3m - 6 = -ym for m. 2 Suppose -4r = -3r + 2. Let i = 0 - r. Solve ik = 5k - 12 for k. 4 Suppose 0b + 2b - 4 = 0. Let r be -1(1 + 3/(-3)). Solve v - 2v - b = r for v. -2 Let c be (-4)/(-10)(-4 + -1). Let x be (5/(10/(-8)))/c. Solve 2m + xm + 4 = 0 for m. -1 Suppose 2q - 10 = -0q. Suppose -q = -2d + 1. Suppose -di + f = -5, 0 = i - 5i + f + 7. Solve o = -o - i for o. -1 Suppose -3i - 7 = 2j, 0 = -j - 0j + 4i + 24. Suppose -jy = -18 - 18. Solve -4m + ym = 0 for m. 0 Let q be (24/10)/((-2)/(-10)). Suppose -4v + q = -0v. Solve -3x = -0 - v for x. 1 Let h(c) = -7c2 - 4c - 6. Let v be (-20)/3 - 4/(-6). Let y(f) = -13f2 - 7f - 11. Let r(t) = vy(t) + 11h(t). Let b be r(3). Solve -l + 16 = bl for l. 4 Let o be 3/(-4) + 756/48. Suppose -3p + 5n - 17 = 0, 0p - 13 = 3p - 4n. Solve 4f = -p - o for f. -4 Suppose 0o + 2o - 5d - 1 = 0, 0 = -2o - 2d + 8. Solve -ox = -4 + 1 for x. 1 Let g be 0(3/2 + -1). Solve gj - 16 = 4j for j. -4 Let q(d) = -6d - 1. Suppose -4 = 4g - 0g. Let k be q(g). Suppose kr = 3 + 17. Solve ro + 10 = -o for o. -2 Suppose 10u + 27 = 13u. Solve -2j + u = j for j. 3 Let h be (10/(-6))/((-5)/(-15)). Let v = 9 + h. Let c = -1 + 1. Solve c = -8r + vr for r. 0 Let g(l) = l*2 - 6l + 8. Let o be g(5). Solve -ov = -v + 10 for v. -5 Let y be -2 - (0 + 88/(-4)). Solve -3i = i + y for i. -5 Suppose -5h + 22 - 2 = 0. Solve 5c = hc + 1 for c. 1 Suppose -3u = -16 - 23. Suppose -2l - 2l = -28. Solve l = 4s - u for s. 5 Let c(v) = -v2 + 4v + 10. Let d be c(5). Solve 12 = di + 27 for i. -3 Let v = 6 - -6. Let y(i) = i - 9. Let c be y(7). Let r = 2 + c. Solve r = -4o + v + 8 for o. 5 Let l be (2 - -1)(-28)/(-21). Suppose 5u + 4s - 12 = 0, -lu - 2s + 6 = -0u. Suppose un + n - 3 = 0. Solve 0 = -nh - 15 + 3 for h. -4 Suppose -3x = -z - 9, 2z - z - 9 = -3x. Solve 0 = -xy + 14 + 1 for y. 5 Suppose 0g + 2 = -2g. Let f be (-1)/g - -133. Let q be (f/(-32))/(1/(-16)). Solve -q = -8b + 3b for b. 4 Suppose 0 = q - 3. Suppose 9 = 42i - 39i. Solve qg = i - 0 for g. 1 Suppose -48 + 44 = -j. Solve 5z - 1 = j for z. 1 Let q(p) = 2p*2 - 4p - 1. Let m be q(3). Suppose -3k = 2r - 16, -2r = 2r - mk - 32. Solve 8x - 4x = -r for x. -2 Suppose t - 2j + 21 = 1, 3t = -5j - 16. Let o = t - -16. Solve -3n + 2 = -o for n. 2 Let z(d) = -d - 4. Let x(t) = 3t - 1. Let b be x(-1). Let i be z(b). Solve i = -4n + 4 for n. 1 Suppose 4d - 2 = 6d. Let m be (0 - d) + -2 + 1. Solve m = 3h - h + 2 for h. -1 Let m be 2/(((-3)/(-4))/((-9)/(-8))). Solve 3i = 4i + m for i. -3 Suppose 0 = -3m - p - 3, 0m - m + p + 3 = 0. Suppose 4f + 9 = 4q - 11, -4q - 3f + 20 = m. Solve 0 = qo - 6 - 14 for o. 4 Suppose 28 = 6o + o. Solve oh + 2 - 6 = 0 for h. 1 Let r(f) = f - 3. Let w be r(12). Solve w = -3k - 3 for k. -4 Let z(n) = 5n2 - 3n + 1. Let k be z(2). Solve 3p = 6p - k for p. 5 Let p = 34 + -20. Let g = -12 + p. Solve 4 = 3s - g for s. 2 Let o(j) = j2 - 5j - 7. Let s be o(6). Let r be (0 - s)(-2)/(-2). Solve 0 = -w + 2 - r for w. 1 Let k(q) be the second derivative of q3/6 + 2q*2 - q. Let x = 1 + -3. Let r be k(x). Solve s - rs - 2 = 0 for s. -2 Suppose -4a + 21 = t - 0, 5a - 4t = 0. Solve 15 = p - ap for p. -5 Suppose 5f - 7 = 13. Let i = f - 0. Let h(l) = l3 - 3l*2 - 2l + 4. Let b be h(4). Solve -a + ia = b for a. 4 Let d be (3/2)/((-2)/(-12)). Suppose -4s + s - d = 0. Let b be 22 + (1 - 0) + s. Solve 4*x = -x +	{ "pile_set_name": "DM Mathematics" }
to -8? (a) -12/13 (b) -2/9 (c) 0.1 (d) 2/3 a What is the nearest to 2/9 in -9, 4, 0.004? 0.004 What is the closest to 2 in -3, 0, -5? 0 What is the nearest to 3/2 in 0.1, -1/3, 0.4, 0.06? 0.4 What is the nearest to -1.14 in 2, -8, -3? -3 Which is the nearest to -0.1? (a) 5 (b) -2 (c) 0.022 c Which is the nearest to -0.6? (a) 0.1 (b) 3/7 (c) 20 a Which is the nearest to 3/10? (a) 16 (b) 5 (c) -5/3 c Which is the nearest to 266? (a) -3/5 (b) 3 (c) -5 (d) 1/2 b What is the closest to 50 in 5, -1, -2? 5 What is the closest to -0.2 in 9, -0.01, -0.2? -0.2 Which is the nearest to -0.2? (a) 1 (b) -0.03 (c) -1/5 c What is the closest to -9 in 30, -0.01, 2/13? -0.01 What is the nearest to -0.1 in -0.04, -4/7, 4/7, 8/3? -0.04 Which is the nearest to 4? (a) -5 (b) 9 (c) 0.11 c Which is the nearest to 0? (a) -0.5 (b) 2/13 (c) -5 b Which is the closest to 0.1? (a) 0.4 (b) 2 (c) -10 a Which is the nearest to 0.1? (a) -1 (b) 0.1 (c) 0.05 (d) 4 b What is the closest to -2 in 4, -5, 2? -5 What is the nearest to -1 in -1/4, -3, -6/5, 4? -6/5 What is the nearest to 4 in 1, 2/7, -4/7? 1 Which is the nearest to -5/2? (a) -27 (b) 1/2 (c) -3 c Which is the nearest to -1/4? (a) -5 (b) 2/15 (c) -40 b Which is the nearest to 4/5? (a) -3 (b) 1/5 (c) 3/4 (d) -2/11 c Which is the nearest to 6? (a) -4.6 (b) 5 (c) 3/7 (d) 1 b Which is the closest to 2/3? (a) -0.6 (b) 1/8 (c) 2 (d) 0.7 d What is the closest to -2/7 in -3/7, -5, -0.5, -103? -3/7 What is the closest to 2 in 2, -0.4, 2/3, 3? 2 What is the closest to 12 in 1/9, -2/3, -4/5? 1/9 Which is the nearest to 2? (a) -0.2 (b) 0.3 (c) 1/96 (d) 1/2 d What is the nearest to 0.2 in -2, 61, -1? -1 What is the nearest to 1 in -4, -0.05, 5? -0.05 What is the nearest to -10 in 0.3, 0.05, 2/7? 0.05 What is the nearest to 0 in 0.5, 0.2, -4? 0.2 Which is the nearest to 1? (a) -0.06 (b) 42 (c) 0 c Which is the nearest to -1? (a) 11 (b) 0.1 (c) -0.3 c Which is the closest to 0? (a) 2/17 (b) -0.2 (c) -137/3 (d) -1/8 a What is the nearest to -1 in 5, 287, 1? 1 What is the closest to 3 in -2, -0.1, 0.1, 6? 0.1 Which is the closest to -2? (a) -3/16 (b) -5/6 (c) -1/4 b What is the closest to 0 in -87, -1/10, 0.4? -1/10 Which is the closest to -0.1? (a) -4 (b) 4/7 (c) -12 (d) 3/56 d Which is the nearest to 0.83? (a) 5 (b) 2/9 (c) -0.1 b Which is the closest to 0? (a) -1 (b) 0.4 (c) 65 (d) 2/3 b What is the closest to 3 in -7, -5, -1? -1 What is the closest to 2 in -4/3, -3, -3/44? -3/44 Which is the closest to -2/7? (a) 0.4 (b) -2/15 (c) -35/2 b What is the closest to -69 in -4, 0.07, 1/4? -4 Which is the closest to 1.6? (a) 2/3 (b) -6 (c) 3 a What is the nearest to 1/6 in -1/5, -3, 0.3, -3/7? 0.3 Which is the nearest to 12? (a) 1/3 (b) -1/3 (c) 3 c What is the closest to 26 in -3, 0.3, 0.2? 0.3 Which is the nearest to 0? (a) 1/116 (b) 3 (c) -0.6 a What is the nearest to -1 in 6, 5, -3? -3 What is the closest to 1 in -9/4, -2/15, 5? -2/15 Which is the closest to -41? (a) -0.2 (b) -2/9 (c) -1 (d) -3 d What is the nearest to -2243 in 0.4, -0.5, 5? -0.5 What is the closest to -0.1 in 2, 5, 0.4, -5? 0.4 What is the nearest to 2/5 in -5, 0.208, 5, -4? 0.208 What is the closest to 0.1 in -0.5, -2, 40, 0.2? 0.2 Which is the closest to 0.1? (a) 1/9 (b) 0.2 (c) -46 a Which is the closest to -8/5? (a) 1/4 (b) 0.4 (c) 1 (d) 3 a Which is the closest to 13? (a) -2/7 (b) 0 (c) 4/9 c Which is the nearest to -1? (a) 24 (b) 5 (c) -10 b What is the closest to -286 in -3, -1/8, -0.1? -3 What is the nearest to -0.5 in 2, 23, -0.3, 5? -0.3 Which is the nearest to -3/58? (a) 2/19 (b) -3 (c) 2/7 a Which is the nearest to 7/2? (a) 3 (b) 1/5 (c) 1 a What is the closest to 1/2 in 1, 9, -4? 1 What is the nearest to 0.134 in -5, 0, -3? 0 Which is the nearest to 2? (a) 19 (b) 5 (c) -4 (d) -3 b What is the closest to -12 in 0, -356, 0.1? 0 Which is the nearest to -1? (a) 4/15 (b) 2 (c) 0.5 (d) 0.3 a Which is the closest to -0.1? (a) -8/7 (b) 1 (c) -3/8 c What is the nearest to -1 in -2/3, 16, 0.5, -0.08? -2/3 Which is the nearest to -0.05? (a) -1.7 (b) 0.3 (c) -4/5 b Which is the closest to -3? (a) -2/7 (b) -2/3 (c) -1/5 (d) 3 b Which is the closest to -1/4? (a) 0.042 (b) 1 (c) 0.1 a What is the closest to 1 in -0.1, -0.3, -3/2? -0.1 Which is the closest to -1/4? (a) -2 (b) -3 (c) 5 (d) -2/5 d What is the closest to 0 in -3, 0.3, 1/21, -4? 1/21 What is the closest to -14 in -4, -1/5, 19? -4 Which is the closest to 0.4? (a) 95 (b) -4 (c) 0.2 c Which is the nearest to -0.2? (a) 0 (b) 10 (c) -1/3 (d) 5 c What is the closest to 3 in -0.3, -1/4, -2/35, 2? 2 Which is the closest to 0.1? (a) 0.5 (b) -1/7 (c) -1 (d) -179 b Which is the closest to 2/13? (a) -2 (b) -0.3 (c) 2.9 b Which is the closest to -1? (a) 0 (b) 21 (c) -1/4 (d) 1 c Which is the closest to 0.066? (a) -3 (b) -2/11 (c) 2 (d) 1/7 d Which is the closest to -0.4? (a) -12 (b) -7 (c) -4 (d) -0.1 d What is the nearest to 1 in 0.4, 1, -486? 1 Which is the closest to 23? (a) 0.2 (b) -1/9 (c) -0.11 a Which is the closest to -1/5? (a) -1 (b) -1.04 (c) 2/11 c Which is the closest to -0.12? (a) -35.9 (b) -4 (c) -3 c What is the nearest to 0.4 in 4/7, -0.38, -2, -0.4? 4/7 Which is the closest to -0.1? (a) -5 (b) -0.03 (c) -1 (d) 0.1 b What is the nearest to 1 in 5, -1/6, -0.34, -0.2? -1/6 Which is the closest to 3/5? (a) 3/5 (b) 1/3 (c) -1 (d) -0.4 a What is the nearest to 2/11 in -1/5, -5, 5? -1/5 What is the closest to 1 in -5, 77, -0.1, 2? 2 What is the nearest to 2/5 in -1, 2/41, 2/21? 2/21 What is the nearest to -3 in 2/13, -0.2, 2, -12/11? -12/11 Which is the closest to 0? (a) -0.08 (b) 0.2 (c) 56 a Which is the nearest to -1? (a) -0.3 (b) -21 (c) -16 a Which is the nearest to 1/4? (a) -0.06 (b) 2 (c) 0.064 (d) 0.2 d Which is the closest to -4/5? (a) -8 (b) -6 (c) -4 c Which is the nearest to 1? (a) -5 (b) -2/7 (c) -2 (d) 0.047 d Which is the closest to -2/5? (a) 3/7 (b) 7 (c) 2/35 c Which is the closest to 2? (a) -0.22 (b) 0.5 (c) 10 (d) 0.3 b Which is the nearest to 0? (a) -3/7 (b) -81 (c) -0.3 (d) 3/2 c What is the nearest to -1 in -24, -0.2, 0? -0.2 What is the nearest to 71/3 in 2, 5, -0.5, 0? 5 Which is the nearest to 1/2? (a) -0.1 (b) -3/5 (c) 0 c What is the closest to -2/45 in 2/15, 4, 0.1, 1/2? 0.1 What is the nearest to 1 in -3, -3/2, 4/15? 4/15 What is the nearest to 2 in 0.1, 18, 1/11? 0.1 What is the closest to 1/11 in -4, -2/7, -1/5? -1/5 What is the closest to -0.1 in -3, 2, 95, -0.02? -0.02 What is the nearest to 1 in 0.1, -11, -4/7, 2/15? 2/15 What is the closest to 321 in -1, 0.2, -3, 0.1? 0.2 What is the nearest to -0.2 in -5/3, 2/9, -0.02? -0.02 Which is the nearest to 0? (a) -1 (b) 3/5 (c) -0.066 c What is the closest to 2/27 in 4, 0.5, 2/15? 2/15 Which is the closest to 7/2? (a) 3 (b) 0.4 (c) 5 (d) 3/7 a Which is the closest to 254? (a) 4 (b) 0.1 (c) 5 c Which is the closest to 0.1? (a) -4 (b) 0 (c) -241 (d) 7 b Which is the closest to -2/3? (a) -1/2 (b) -2/9 (c) -1/3 (d) -3 a Which is the closest to 0.1? (a) -0.2 (b) -5 (c) 1.1 (d) 0.05 d What is the closest to 2 in -2/37, -7, 2? 2 What is the nearest to -2 in 3/4, -46, -5, 0.1? 0.1 What is the nearest to -3 in 4, 1/6, -13, 2/3? 1/6 What is the nearest to 0 in -0.1, -1, 7/2, -2/5? -0.1 What is the closest to 1/4 in -2, -5.1, -3, 5? -2 Which is the closest to 2/3? (a) -20 (b) 1/7 (c) -2/17 b What is the closest to -2/11 in 0.4, -1, -3/5? -3/5 Which is the closest to 0.1? (a) -0.3 (b) 2 (c) 15/7 a What is the nearest to 6 in 5, 0, 1/4, 3? 5 What is the closest to -0.5 in -5, 0, 1/3, -43? 0 What is the nearest to -2 in 72, -1, 1/10? -1 What is the closest to -0.2 in 0.43, 24, -3, -1/3? -1/3 Which is the closest to -3/8? (a) -1 (b) -1/3 (c) -4/5 (d) 0.5 b What is the closest to -32 in -1/3, 0, -0.2? -1/3 Which is the nearest to 0? (a) -0.5 (b) -5 (c) -154 a What is the closest to -1 in -233, -4/3, 4/9? -4/3 Which is the nearest to -2458? (a) -1 (b) 3 (c) -0.6 a Which is the closest to -1? (a) 34 (b) 1/4 (c) -2/3 c What is the closest to 3 in -0.3, 2/9, 9, -20? 2/9 What is the closest to -2/3 in	{ "pile_set_name": "DM Mathematics" }
Let -r*4/2 - 1310r*3 - 2570r*2 + 125520r - 376992 = 0. What is r? -2618, -12, 4, 6 Solve r*3/5 - 1357r*2/5 + 236451r/5 + 167370993/5 = 0. -257, 807 Solve -4i3 - 32268i*2 - 3133452i - 76534276 = 0. -7969, -49 Determine x so that -10x3 - 4164x*2 + 2906376x - 334756016 = 0. -4102/5, 202 Let 2v2 - 15621820v - 31243648 = 0. Calculate v. -2, 7810912 Factor -4c3 + 3275924c*2 + 65519680c + 327600400. -4(c - 819001)(c + 10)*2 Factor -2z*3/5 - 9006z*2/5 - 5021406z/5 - 750748402/5. -2(z + 311)2(z + 3881)/5 Factor 2n2/9 + 44746n/3 + 536920/9. 2(n + 4)(n + 67115)/9 Factor -3l2/8 - 42315l/8 + 121854. -3(l - 23)(l + 14128)/8 Factor -l*2 + 11711252l - 34288355851876. -(l - 5855626)*2 Find g such that 2g*2/7 + 3687374g/7 - 62685936/7 = 0. -1843704, 17 Suppose 220405v2 + 10v = 0. What is v? -2/44081, 0 Find j, given that -2j4 + 1598910j*3 - 426088729122j*2 + 37850171917415578j - 227085692655607044 = 0. 6, 266483 Factor -2q4/3 + 37970q*3/3 + 113964q*2. -2q*2(q - 18994)(q + 9)/3 Factor -m3 + 917m*2 - 9059m - 9977. -(m - 907)(m - 11)(m + 1) Find z, given that z*4/5 - 23012z*3/5 - 2636139z*2/5 - 5203238z/5 - 2590112/5 = 0. -112, -1, 23126 Solve i*3/2 - 26111539i*2/2 + 170453130292899i/2 - 170453104181361/2 = 0 for i. 1, 13055769 Factor 2a2/7 + 1041806a/7. 2a(a + 520903)/7 Factor w*2/4 - 5765895w/4 + 2882947/2. (w - 5765894)(w - 1)/4 Suppose -p4 - 3635p*3 - 136431p*2 + 916839p - 1424412 = 0. Calculate p. -3597, -44, 3 Factor r*4/3 + 541r*3/3 - 53954r*2/3 - 155248r. r(r - 93)(r + 8)(r + 626)/3 Factor 12v*2/5 - 480537v/5 + 6332634. 3(v - 66)(4v - 159915)/5 Find u such that -u5 + 9717u*4 - 6668948u*3 + 1198024400u*2 - 3547536288u + 2356171120 = 0. 1, 2, 362, 8990 Let p*2/9 + 42191p + 8981642 = 0. Calculate p. -379506, -213 Solve b*5/6 + 145b*4/3 - 60959b*3/6 + 207304b*2/3 - 233176b/3 - 471104/3 = 0 for b. -433, -1, 4, 136 What is y in -y*3/4 + 45704y*2 - 2089495325y + 58470042652 = 0? 28, 91394 Factor -216l3 + 2546620l*2 - 7505985600l - 695020500. -4(l - 5895)2(54l + 5) Find x, given that -2x*5 + 3314x*4 + 3340392x*3 + 19962656x*2 + 39872128x + 26563680 = 0. -702, -2, 2365 Let 20x4 + 5873x*3/2 - 2175913x*2/2 - 2872219x - 1369440 = 0. What is x? -317, -2, -5/8, 864/5 Find z such that -17z5/8 + 523z*4 - 12057z*3/2 + 702z*2 = 0. 0, 2/17, 12, 234 Factor -2m*2/9 - 1899956m/9 - 451229100242/9. -2(m + 474989)2/9 Determine h, given that -363h*4/7 + 941226h*3/7 + 85857h*2/7 - 106668h - 280044/7 = 0. -6/11, 1, 2593 Factor -3p3 + 44862p*2 - 12671424p. -3p(p - 14666)(p - 288) Determine w, given that 125w*3 + 415178050w*2 - 2325000020w + 3255001400 = 0. -3321430, 14/5 Find y such that -277196879726010y3 + 166317917237646y*2 + 126358736y + 24 = 0. -2/5264949, 3/5 What is v in 3v4 + 77838v*3 - 233757v*2 - 5605512v - 13701072 = 0? -25949, -4, 11 Find a, given that -3a2 - 339083778a - 339083775 = 0. -113027925, -1 Find s, given that -s*2/7 + 247s - 78540 = 0. 420, 1309 Find t, given that t*4/3 + 3376t*3/3 - 6772t*2 - 81104t/3 + 216448/3 = 0. -3382, -4, 2, 8 Determine a, given that -2a3/23 + 132870a*2/23 - 132868a/23 = 0. 0, 1, 66434 Determine v so that v*3/5 - 3509v*2/5 - 323649v/5 - 939339/5 = 0. -87, -3, 3599 Factor 2p2 - 215272164p + 5792763074155362. 2(p - 53818041)2 Solve -2p*5 - 7140p*4 - 6407998p*3 - 63360860p*2 + 6408000p + 63368000 = 0. -1780, -10, -1, 1 Factor k*3 - 2984416k*2 - 5968835k - 2984418. (k - 2984418)(k + 1)2 Let 5f*4 + 81455f*3 - 14864885f*2 + 696234985f - 1957120680 = 0. What is f? -16472, 3, 89 Let -f*2 - 160194428f - 6415563690561796 = 0. What is f? -80097214 Determine y so that -11921y2 - 1023y + 1370 = 0. -5/13, 274/917 Factor -3y2/7 - 52852536y/7 - 232782546802608/7. -3(y + 8808756)2/7 Let -2127k*4/4 + 2278015k*3/4 - 813249927k*2/4 + 96776231517k/4 + 45499293/2 = 0. Calculate k. -2/2127, 357 Let -4s3 - 4188100s*2 - 1096451884332s - 99742442832396 = 0. What is s? -523467, -91 Factor -3n3/5 + 55136562n*2/5. -3n*2(n - 18378854)/5 Solve -5s3 - 288s*2 + 5555s + 56658 = 0 for s. -71, -38/5, 21 Factor 4t3 + 440184t*2 + 12022495236t - 4830184404144. 4(t - 396)(t + 55221)*2 Suppose -5d*2/2 - 726415d - 105535750445/2 = 0. Calculate d. -145283 Find s such that -18s3/11 - 221536s*2/11 - 681370810s/11 + 151536100 = 0. -6155, 22/9 Factor k*3 + 4965k*2 - 311674k. k(k - 62)(k + 5027) Determine d, given that d*3 - 80058d*2 - 4645887d - 67377556 = 0. -29, 80116 Determine n so that -128n3 + 132896n*2 + 633422n + 753046 = 0. -19/8, 1043 Suppose 45l5 - 1540l*4 + 14020l*3 - 24640l*2 + 4800l = 0. Calculate l. 0, 2/9, 2, 12, 20 What is o in -o*4/4 + 263o*3/4 + 31805o*2/4 - 633483o/4 + 734994 = 0? -104, 9, 349 Determine x so that -3x3/8 - 9640173x*2/8 + 57841131x/8 - 48200955/8 = 0. -3213397, 1, 5 Find h such that -21981h3 + 791314h*2/3 - 791308h - 24 = 0. -2/65943, 6 Solve f*2 - 28936907f - 57873818 = 0. -2, 28936909 Let 3q3/5 + 957q*2 - 8954856q/5 - 14327759628/5 = 0. What is q? -1662, 1729 Solve 28575k2 + 55209k - 3882 = 0. -2, 647/9525 Factor -37238450o2/9 - 5057180o/9 - 171698/9. -2(4315o + 293)*2/9 Factor -2h*3/3 + 5063392h*2/3 - 1068244063800h - 4273003260000. -2(h - 1265850)2(h + 4)/3 Determine l so that -32l3/15 + 292366l*2/5 + 20794454l/15 - 438928 = 0. -24, 5/16, 27433 Find k, given that -k*5/2 - 63k*4/2 + 353k*3/2 + 5427k*2/2 - 8888k + 6030 = 0. -67, -9, 1, 2, 10 Factor -5v2 - 17178495v + 17178500. -5(v - 1)(v + 3435700) Solve 3d3 - 205656d*2 + 6166887d + 6372546 = 0 for d. -1, 31, 68522 Solve -k*4/11 + 3447k*3/11 - 1536497k*2/11 + 185776161k/11 - 365433894/11 = 0 for k. 2, 249, 2947 Factor 2a2/7 + 49314a/7 - 1332936/7. 2(a - 27)(a + 24684)/7 Find j such that -24026312j2 + 6557672j - 447458 = 0. 473/3466 Factor 5d3 + 29320d*2 + 49890660d + 19358001360. 5(d + 548)(d + 2658)*2 Factor -2o*2/13 + 13922952o/13. -2o(o - 6961476)/13 Factor -5h3 + 419415h*2 - 8764539075h - 1297466265375. -5(h - 42015)2(h + 147) Find r, given that 2r2/7 - 326743748r/7 + 13345184607135938/7 = 0. 81685937 Determine a so that 2a2/9 - 6824344a/3 + 5821458878792 = 0. 5118258 Factor -p*3 + 1356652p*2 - 2713300p. -p(p - 1356650)(p - 2) Factor -3j2 - 42459j + 8568144. -3(j - 199)(j + 14352) Suppose 2z3/17 + 5714z*2/17 - 7214000z/17 + 1928500000/17 = 0. What is z? -3857, 500 Find q, given that 4q5 + 10532q*4 - 42126812q*3 - 84285204q*2 - 42147864q = 0. -4818, -1, 0, 2187 Let -3q4/4 - 5721q*3 - 11415q*2/2 + 97233q - 343215/4 = 0. Calculate q. -7627, -5, 1, 3 Solve -3w2 - 9780w - 338625 = 0. -3225, -35 Determine q so that 5q3/3 - 6165q*2 + 494530q/3 + 1456560 = 0. -7, 34, 3672 Solve -d*4/2 - 3901d*3 + 27584139d*2/2 + 83485183970d - 229000758470450 = 0. -6971, 3070 Solve -r*2 + 2122r - 509496 = 0 for r. 276, 1846 Factor 3p2 - 169041p + 845130. 3(p - 56342)(p - 5) Factor -2t2 + 582766t + 582768. -2(t - 291384)(t + 1) Factor a*3 + 98129a*2 + 2398518584a - 432484713164. (a - 179)(a + 49154)2 Factor -5x*2/4 + 57325x/4 - 1880835/2. -5(x - 11399)(x - 66)/4 Factor 5c2 + 24641880c - 517481685. 5(c - 21)(c + 4928397) Solve 232r4/7 - 1534688r*3/7 - 4552686r*2/7 - 470826r + 119124/7 = 0 for r. -3/2, 1/29, 6618 Solve -5d4/3 - 92978d*3/3 + 316169d*2/3 - 260386d/3 = 0. -18599, 0, 7/5, 2 Solve -2t5/3 + 290t*4/3 - 1106t*3/3 - 1054t*2 + 2820t = 0 for t. -3, 0, 2, 5, 141 Solve 2067y3/2 - 1248465y*2/2 - 10253226y - 14880 = 0 for y. -16, -1/689, 620 Factor -2m2/11 - 1583422m/11 - 19000776/11. -2(m + 12)(m + 791699)/11 Determine x so that 5x3 + 191231890x*2 - 382463800x = 0. -38246380, 0, 2 Determine h so that h*3/10 - 1063h*2/5 + 240599h/10 + 121363/5 = 0. -1, 121, 2006 Let -3j5 + 67755j*4 + 474477j*3 - 1016115j*2 - 11860050j - 16944000 = 0. What is j? -5, -2, 5, 22592 Determine a, given that 4a*3/5 -	{ "pile_set_name": "DM Mathematics" }
0. Give f(-3). -2 Let q(r) = -12r - 3. Determine q(-2). 21 Let k(v) = -15v*2 + 2v - 1. Calculate k(1). -14 Let s(o) = -o*2 + 4o + 13. Determine s(7). -8 Let r(y) = 40y2 + 3y + 2. Give r(-1). 39 Let w(x) = x - 3. What is w(-2)? -5 Let s(x) = -x*3 + 15x*2 - 6x - 29. Calculate s(15). -119 Let q(i) = -3i - 39. Give q(-11). -6 Let n(b) = b3 + 6b*2 + b + 4. Give n(-5). 24 Let z(q) = -5q - 21. Give z(-6). 9 Let j(m) = -m*3 - 49m*2 - 94m + 8. Give j(-47). 8 Let m(x) = -x*2 - 4x + 9. What is m(-7)? -12 Let m(v) = -7v2 + 138v + 32. Calculate m(20). -8 Let l(a) = -45a + 2. What is l(-1)? 47 Let a(f) = -3f*2 - 8f + 69. What is a(4)? -11 Let z(i) = -i*3 - 16i2 + 8. What is z(-16)? 8 Let i(j) = j3 - 18j2 - 49j + 174. What is i(20)? -6 Let h(l) = 36l + 433. Give h(-12). 1 Let k(t) = -t2 - 6t + 39. Give k(-10). -1 Let n(s) = 2s2 + 15s + 16. Calculate n(-6). -2 Let t(w) = w - 7. What is t(14)? 7 Let p(w) = -21w + 4. Determine p(2). -38 Let d(l) = 2l*2 - 2l + 3. Give d(3). 15 Let d(r) = r*2 + 12r + 8. Give d(-4). -24 Let f(y) = y*3 - 8y*2 + 3y + 16. Determine f(7). -12 Let n(b) = b*2 - 8b + 10. What is n(7)? 3 Let b(g) = g*3 - 21g*2 - 23g + 32. Calculate b(22). 10 Let d(f) = -f*2 - 14f - 1. What is d(-14)? -1 Let a(s) = -s*3 - 11s*2 - 19s + 3. Give a(-9). 12 Let l(f) = f + 22. Calculate l(17). 39 Let b(y) = -y + 2. Calculate b(6). -4 Let s(y) = y*3 - 30y*2 + 52y + 102. Calculate s(28). -10 Let l(m) = 61m - 666. Calculate l(11). 5 Let o(z) = -z3 - 7z*2 - 7z - 2. What is o(-6)? 4 Let m(v) = v*2 + 22v + 85. What is m(-18)? 13 Let v(p) = p*2 - 2p - 6. Determine v(5). 9 Let x(w) = w*3 + 8w*2 + 3w - 5. Give x(-6). 49 Let t(w) = -w. Calculate t(0). 0 Let r(x) = -x*2 + 45x + 312. What is r(-6)? 6 Let r(h) = -h*2 + 18h - 37. What is r(13)? 28 Let m(g) = -g*3 + 5g*2 + 7g - 34. Determine m(7). -83 Let i(m) = m*3 - 4m*2 + 3m - 4. Give i(3). -4 Let d(o) = o*3 + 4o*2 - 6o - 14. What is d(-5)? -9 Let j(x) = x*3 + 17x*2 - 2x - 32. Give j(-17). 2 Let z(b) = b*3 - 10b*2 + 12b + 8. Give z(8). -24 Let d(v) = v*3 + 7v*2 + 8v + 6. What is d(-5)? 16 Let r(z) = -z*3 - 4z*2 + z + 3. Calculate r(-3). -9 Let i(h) = -8h - 3. Give i(-1). 5 Let n(t) = t*3 - 27t*2 + 23t + 79. Determine n(26). 1 Let p(x) = -2x3 - 48x*2 + 47x - 107. What is p(-25)? -32 Let q(u) = u*2 - 7u - 17. Give q(-6). 61 Let b(k) = k*3 - 9k2 + k - 7. What is b(9)? 2 Let c(u) = u3 - 6u2 + 4u + 8. Give c(4). -8 Let u(j) = -3j3 - 2j*2 - j - 4. Calculate u(-2). 14 Let r(n) = 58n + 177. Give r(-3). 3 Let m(t) = -t - 9. What is m(-7)? -2 Let x(s) = -s*2 - 22s + 108. Give x(-26). 4 Let g(o) = 6o - 19. Give g(4). 5 Let s(j) = j3 + 11j*2 + 16j - 2. Give s(-7). 82 Let p(h) = -2h2 - 17h + 10. Determine p(-9). 1 Let l(o) = -o*3 - 7o*2 - 6o - 5. Determine l(-6). -5 Let o(d) = -d*2 - 18d - 19. What is o(-17)? -2 Let v(a) = 2a2 - 9. Give v(-3). 9 Let i(m) = m3 + 10m*2 - 13m + 6. What is i(-11)? 28 Let x(a) = a*2 + 19a + 70. Determine x(-9). -20 Let g(a) = -a*3 + 4a*2 + 3a - 6. Calculate g(2). 8 Let s(g) = 3g2 - 15g + 6. What is s(5)? 6 Let h(p) = -p*2 - 9p + 2. Determine h(-4). 22 Let x(v) = v*3 - 9v*2 - 10v + 5. Calculate x(10). 5 Let v(j) = j*2. What is v(0)? 0 Let o(v) = -2v*2 + 21v - 52. What is o(6)? 2 Let t(i) = -i*3 - 5i*2 - 2i - 5. Give t(-5). 5 Let z(r) = -r*3 - 19r*2 - 17r + 25. Calculate z(-18). 7 Let z(y) = 3y - 32. Determine z(13). 7 Let m(b) = b3 - b2 + 3b + 3. What is m(4)? 63 Let z(j) = -j*3 - 6j*2 + 4j + 2. Calculate z(-7). 23 Let j(a) = -3a3 + 1. Give j(-1). 4 Let o(i) = i3 + 3i*2 - 3i + 4. Calculate o(2). 18 Let a(r) = -4r + 9. Determine a(-3). 21 Let d(i) = -i2 - 5i - 9. Give d(-6). -15 Let g(s) = -s*2 + 9s - 16. Give g(9). -16 Let f(q) = 13q + 11. Give f(2). 37 Let u(v) = -v3 - 12v*2 + 27v - 17. Calculate u(-14). -3 Let i(k) = k*3 + 12k*2 - 12k + 48. What is i(-13)? 35 Let r(n) = -n*3 - 9n*2 - 12n - 10. What is r(-8)? 22 Let z(d) = -7d + 3. Calculate z(6). -39 Let q(s) = -s2 + 8s - 6. Give q(6). 6 Let m(d) = 4d3 - 3d*2 - 4d + 4. Give m(2). 16 Let c(n) = -2n2 + 60n - 9. Give c(30). -9 Let h(n) = 12n + 2. Calculate h(2). 26 Let s(u) = u3 - 17u*2 + 29u + 11. Give s(15). -4 Let k(b) = b*3 - 4b*2 - 3b - 4. Determine k(4). -16 Let j(v) = -4v3 + 3v*2 - 9v - 10. Give j(-1). 6 Let p(n) = 2n2 - 5n - 8. Calculate p(5). 17 Let c(r) = r*2 - 8r + 3. Calculate c(5). -12 Let h(y) = y*2 + 13y - 20. What is h(-13)? -20 Let a(g) = g - 3. Calculate a(10). 7 Let p(k) = -k*3 - 4k*2 + 2. Give p(-4). 2 Let v(k) = -k - 7. Calculate v(-1). -6 Let o(k) = -10k*3 + 3k2 - 3. Give o(-1). 10 Let o(l) = -l3 + 8l2 + 18l + 13. Give o(10). -7 Let s(b) = -b - 6. What is s(-3)? -3 Let w(j) = j*3 - 7j*2 + 4j - 1. Give w(5). -31 Let j(i) = i*3 - 20i*2 + 18i + 7. What is j(19)? -12 Let l(c) = -c*2 + 14c - 23. Give l(6). 25 Let p(m) = m*2 + 17m - 58. Give p(-19). -20 Let q(m) = -m*2 + 22m - 13. Determine q(21). 8 Let p(y) = 51y - 1. What is p(-1)? -52 Let k(u) = -9u*3 + 4u + 4. Give k(-1). 9 Let u(y) = y*2 + 5y - 5. Determine u(-8). 19 Let x(w) = -w*2 - 19w - 42. What is x(-17)? -8 Let d(w) = w*3 - 4w*2 - 16w - 37. Give d(7). -2 Let r(b) = -6b + 20. What is r(13)? -58 Let d(f) = f2 - 4f + 4. Calculate d(-3). 25 Let m(g) = g2 + g - 10. Give m(3). 2 Let p(m) = -m - 6. Determine p(-9). 3 Let w(y) = y2 + 6y - 4. Give w(11). 183 Let l(y) = y2 + 40y - 87. What is l(-42)? -3 Let n(z) = -25z2 - z - 1. What is n(-1)? -25 Let t(o) = -2o - 12. Determine t(-26). 40 Let r(b) = -16b2 - 5b - 4. Determine r(-1). -15 Let u(h) = h*3 + 2h2 + h - 15. Calculate u(0). -15 Let m(a) = a3 - 5a2 + 3a - 73. Determine m(6). -19 Let l(q) = q*3 + 6q*2 - 4q - 13. Determine l(-5). 32 Let w(n) = n*2 - 3n - 4. Determine w(6). 14 Let n(g) = 41g + 41. Determine n(-1). 0 Let s(z) = -3z - 1. Give s(3). -10 Let c(j) = j*2 + 8j - 21. What is c(-9)? -12 Let u(f) = -f*3 - 17f*2 - 75f - 19. Give u(-8). 5 Let b(z) = -3z - 32. Determine b(-13). 7 Let d(b) = 76b + 534. Give d(-7). 2 Let o(k) = 2k - 8. What is o(-6)? -20 Let u(k) = -5k - 2. Give u(10). -52 Let y(w) = -65w2 - 2w + 1. Determine y(1). -66 Let w(n) = -n*3 + 7n*2 - 8n + 5. What is w(6)? -7 Let l(h) = -3h - 3. Give l(-2). 3 Let x(b) = b3 - 10b*2 - 4b + 16. Give x(10). -24 Let d(c) = -17c + 46. What is d(3)? -5 Let m(v) = -v2 - 19v + 114. What is m(5)? -6 Let t(k) = -k*3 - 4k*2 - 4k - 2. Give t(-3). 1 Let x(s) = -s*2 + 12s + 98. Give x(-8). -62 Let h(r) = 16r + 19. What is h(-8)? -109 Let j(a) = a2 + 74a + 392. What is j(-6)? -16 Let w(z) = z - 4. Calculate w(-14). -18 Let p(l) = -l*3 + 17l*2 + 37l + 20. Calculate p(19). 1 Let w(h) = -8h + 55. Calculate w(6). 7 Let m(j) = -42j - 305. Give m(-7). -11 Let d(a) = 29a + 13. Determine d(-1). -16 Let a(n) = -n2 + 13n + 1. Give a(13). 1 Let h(o) = -2o2 - 22o + 1. Calculate h(-11). 1 Let n(x) = 7x + 1. Determine n(0). 1 Let b(f) = f3 + 13f*2 - f - 6. Calculate b(-13). 7 Let h(q) = 3q + 12. Give h(-4). 0 Let n(w) = -w3 + w + 68. Calculate n(0). 68 Let s(d) = -d2 - 7d + 4. What is s(-6)? 10 Let p(s) = -s3 + 3s*2 - 11s - 3. What is p(5)? -108 Let i(v) = v*2 + 17v - 9. Give i(-21). 75 Let b(t) = -3t3 - 2t - 1. What is b(-2)? 27 Let z(a) = -2a2 + 12a + 9. Calculate z(7). -5 Let u(z) = 5z + 25. What is u(-3)? 10 Let h(r) = -18r - 89. What is h(-5)? 1 Let w(b) = 36b3 - 3b + 1. Calculate w(1). 34 Let l(t) = -2t + 8. Calculate l(6). -4 Let c(w) = -w2 - 6w + 24. Calculate c(-10). -16 Let s(c) = c*2 + 6c. Determine s(-5). -5 Let n(y) = -y*2 + 9y - 22. Give n(9). -22 Let p(g) = -g*3 + 2g - 4. What is p(2)? -8 Let t(x) = -x - 15. Determine t(-6). -9 Let u(z) = -z*3 - 4z*2 - 3z - 29. Determine u(-4). -17 Let y(r) = -17r + 1. What is y(-2)? 35 Let v(g) = g2 - 7g + 4. Determine v(5). -6 Let a(v) = -v + 14. Determine a(0). 14 Let n(v) = v*3 - 7v*2 - 9v + 7. Determine n(8). -1 Let p(s) = -s*3 - 94s*2 - 90s + 279. Give p(-93). 0 Let w(n) = n - 8. Determi	{ "pile_set_name": "DM Mathematics" }
= r for x. -4 Let v be (-4)/(8/(-5))2. Let m = -12 - -17. Solve -r - 4r = v, 9 = -2y - mr for y. -2 Suppose 83 = -3z + c, -c - 41 = -2z - 97. Let y = z - -47. Suppose 5l - 7 = -d, 3l - 2 = d - 1. Solve 5j - y = 5o, 2o + j - d = -2j for o. -2 Suppose -5w = 4g - 38, 0w - 4w - 5g = -34. Let d be w/(-39) - (-67)/13. Solve 4i = -3v - d, 2v = 3i - i + 6 for v. 1 Let d(q) = 2q + 7. Let p be d(6). Let b be 3/(-9) + (-20)/(-6). Let w = 6 - b. Solve -x - 4x = 2h - p, -wx = -5h + 1 for x. 3 Let h(z) = z - 12. Let w be h(14). Let s be 4/4 + w + -3. Solve 3c + 2l - 3 = 5, s = -4c - 2l + 12 for c. 4 Suppose 3z = -2s - 0z - 4, -2s + 16 = -2z. Solve 0 = 4j + n - 5n - s, 2j + 5 = -5n for j. 0 Let p = 45 + -40. Solve c - 14 = 2z - 4, -pz = -c + 25 for z. -5 Suppose 3b + 48 = 54. Solve -l + 1 = -by - 0y, -y = 0 for l. 1 Suppose 6x = x + 20. Solve -4o = -5f + 11, -o = -xf - 2 + 13 for o. 1 Suppose 0 = o - 6 - 6. Let g be -3 - (4/6 - 44/(-33)). Let h = o + g. Solve -3u + 4x - h = 1, -17 = -3u - x for u. 4 Let p(x) = -x2 - 4x + 4. Let w be p(-5). Let t(r) = 4r2 - 1. Let y be t(w). Suppose 0 = -yv - v + 72. Solve 13 = a + 4d, a = -a - 4d + v for a. 5 Let y be 61/(-2)-1. Let u = 3 - y. Solve -a - 1 = 2c, uc = 2a + 3c for a. 3 Let o(m) = -2m + 28. Let u(p) = -p + 11. Let k(z) = -5o(z) + 12u(z). Let t be k(-12). Solve -2c = -3x - 0c - 5, 0 = -4c + t for x. 1 Let f = 1 - -1. Suppose 1 = 3a + fp - 9, -3p = -a - 4. Let l be (2 + 2)a - -2. Solve r = 2b - l, b + 0 = -r - 1 for b. 3 Let x = -11 + 15. Solve i - 2i = -4g + 7, 2i = xg - 2 for g. 3 Suppose -1 = -4x + 35. Suppose 3 = -t - x. Let z be (t/(-1))/((-9)/(-6)). Solve -5q - 5u + z = 43, 4q - 3u = 7 for q. -2 Let u(b) = 5b - 20. Let x be u(-6). Let o be (-4)/12 + x/(-15). Solve 0 = on - 2z + 7, 5n + z + 1 = -28 for n. -5 Let o = 6 - 0. Suppose -l = 2l - o. Let i be (-22)/(-8) - 1/(-4). Solve -k + ik - 3y = 15, 0 = -lk - y + 3 for k. 3 Let s = 10 - 6. Suppose -2g + 6g - 15 = -n, 0 = sg + 2n - 14. Solve 5p - gp + 2c = -3, 5p = 4c + 41 for p. 5 Let o be (1 - 0 - 1)4/12. Solve or - 3r - w + 2 = 0, 5w = -4r - 1 for r. 1 Let g be (0 + 2/5)/(1/10). Let v = -15 - -44. Let d be 2/(36/45). Solve -3a + db = -35, b + v = a + ga for a. 5 Suppose n - 1 = -3h + 12, -3 = -h - n. Solve -2f = 3q + 13, -f + 6f = hq - 20 for f. -5 Suppose 9q = 4q + 4b, -9 = 4q - 5b. Suppose 19 = 5h + q. Solve g + 5j - hj - 8 = 0, -22 = -5g - 4j for g. 2 Let k be 6/(3/(-1)) + 9. Solve -3j + k = -w + 16, 12 = -3j for w. -3 Let y = -5 - -7. Suppose ya - c = 59, 2a - 10 = 5c + 45. Solve 4l - 2f = a, -5l + 3f + 26 = -14 for l. 5 Let d be 3/22/(-1). Let p = 3 + d. Suppose -5 = -0b - b. Solve p = -bz - s + 21, 7s - 2s = 5 for z. 4 Let o(g) = -4g - 5. Let f be o(-2). Suppose -fl + 16 = 4. Solve 0 = -b + s, 4s = -lb - 0 + 8 for b. 1 Suppose -4 = -i - 1. Suppose -2x - 1 = b - 7, 0 = 3x + 4b - 4. Solve -2w = 3q + 2, 0 = 3q - 2w + iw + x for q. -2 Suppose -4r + 9r = 0. Solve -3z - 2z - 20 = 5i, r = 2i - 2z for i. -2 Suppose h + 3 - 5 = -3y, 0 = -y + h + 6. Solve 2n + 10 = -l, -yl = -7l - 3n - 29 for l. -4 Let m = 110 - 96. Solve 2u - 2v + 14 = 0, 5u + m + 19 = 4v for u. -5 Suppose -10 = -3o + 5. Let a be 1(-1 + o)1. Suppose 4f + 12 = 0, -2q = f - 0 - 1. Solve 4y + 2 + 6 = qh, 0 = -4h + ay + 16 for h. 4 Let i be ((-3)/(-1))/3 - -30. Suppose 4a - i = 3y, 10 = 2a - 3y + 7y. Let j(k) = -k*2 + 9k. Let g be j(a). Solve 1 + 4 = -p, -4n - g = 2p for n. -1 Let z = -10 + 8. Let a(b) = -2b - 2. Let p be a(z). Suppose -c - i = -pi - 17, -3c + 48 = -2i. Solve 0 = 5r + 2n, -2r - c = 4n - 6n for r. -2 Let q be -1(-1 - 0)0. Suppose q = 3h + h - 20. Suppose 0 = a - 0a - f - h, 14 = 3a - 4f. Solve 2u - o = -a, -u = 2o - 0o - 2 for u. -2 Let n be (-10)/(-20)(13 - -1). Suppose -nu + 3u + 20 = 0. Solve uy - 14 = 3j, 4j - 4y + 11 = 3 for j. 2 Let m(p) = p2. Let d be m(2). Solve -b - 23 = -5r, 13 = -0r + r + db for r. 5 Let z be 3 + (-2 - 3) + 1. Let s be (-5)/2-2 + z. Solve 3j + 8 + 3 = t, -3j = -st + 17 for t. 2 Let l(d) = d*2 + d - 2. Let h be l(5). Let c be 48/14 - 12/h. Solve t - c = 3q + q, -3q + t = 3 for q. 0 Let z(d) = d3 + 5d*2 - 2d - 5. Let x be z(-5). Solve r = -xw - 0w + 2, 4w + 10 = 5r for r. 2 Let q be ((-6)/(-4))/((-24)/(-80)). Suppose 0 = qw - 40 + 10. Let b be 4/(w/(-3)) + 7. Solve -ba + 2j = 5, 0j + 4j - 17 = 3a for a. 1 Suppose 8 = 2k + 4. Solve -m + 5l = -6m - 50, km = 2l for m. -5 Suppose 0v - 30 = -3v. Suppose -6i = -i - v. Solve 0 = p + 2q - 15, p - 3q = -iq for p. 5 Let j(z) = -z3 - 7z*2 + 8z + 2. Suppose 4p = -5g - 7 - 45, -4g + 5p - 17 = 0. Let t be j(g). Solve -d + t = 0, -3i + 2 = -2i + 3d for i. -4 Suppose 4a = 5r, 4 = a - 3r - 3. Let k(w) = -w*2 - 6w - 2. Let q be k(a). Solve -5j + 25 = qh, -3j + 4 + 22 = 4h for j. 2 Let x be 0/(-2(5 + -4)). Solve -2v + v - 2 = x, -3v = 4g - 6 for g. 3 Let v = -12 + 7. Let c = 9 + v. Solve 3l - 5o = 14, co + 11 = 2l - o for l. 3 Suppose b - 3 = -14. Let r = -6 - b. Solve d + 2f = -r, 5d - 4f - 16 = 1 for d. 1 Let n = 5 - 5. Let r be 3 + 1 + n + -1. Solve 0y + 4y = -2k, -4y + rk - 20 = 0 for y. -2 Let i(h) = -h + 1. Let d(j) = -3j + 1. Let v(l) = -d(l) + 4i(l). Let r be v(0). Let y = -5 + 8. Solve -yf + w = f - 3, 0 = w + r for f. 0 Let o be -6 + 4 - 1-4. Let j(l) = 2l + 3. Let g be j(-5). Let w = g - -17. Solve ox - 10 = 2t + 3t, 0 = -5t + 3x - w for t. -2 Let k(s) = -s - 13. Let w be k(-13). Suppose w = 3o + 4 - 10. Solve -18 = -4y - z - 0, -5z = oy for y. 5 Let y(u) = 4u3 - u + 1. Let a be y(1). Solve af + 20 + 2 = 2n, 2n = 2f + 16 for f. -3 Suppose -4c = 5b - 12, 28 = 4c - 0c + b. Solve 5w = -2r + 13, -r = w + 2w - c for w. 3 Suppose 3f = -4p + 13 + 15, 3f - 2p - 4 = 0. Solve fj + 2o = 22, 5o + 3 = 3j - 7 for j. 5 Let f be (-1 - -51)6/15. Solve 0c + 3q - 35 = -4c, -q = 3c - f for c. 5 Suppose 5w - 4 = 6. Let c be (-1)/w(2 + -2). Suppose -3v - 2v = c. Solve 0l + 5l - 4q = -30, 3q - 15 = v for l. -2 Let p = 7 + -4. Suppose -3u - 3b = -21, b + 46 = 4u - b. Suppose -2f - u = -0o - 2o, 0 = 5o - 2f - 10. Solve 5i + oj = -pj, -i = -j - 8 for i. 3 Suppose -4f - p + 15 = -3, f = -2p + 8. Suppose -3b - 15 = -fb. Solve -3s - 3x = b, s + s - 2x + 10 = 0 for s. -5 Let s(k) = 9k*2 + 1. Let f = 2 - 1. Let t be s(f). Solve -h + 3d + 13 = h, 5h + d = -t for h. -1 Suppose -5x + c = -23, -x + 31 = 3x - 5c. Solve -20 = xp - i, p = 4i - 5i for p. -4 Suppose -3b = -5r - 0 + 5, 0 = 2b + 2r - 18. Solve -2d + 6 = 2p, 3p = 3d + 4 + b for p. 3 Let w = 7 + -2. Suppose 0 = 3f - wo - 13, -o - 29 = f + 4o. Let n = 23 + f. Solve 8b - 5b - 2v = -n, 3v = -2b + 9 for b. -3 Suppose 3w - 12 = 3. Solve -14 = -2c - 4a, -a = -6a + w for c. 5 Suppose 4z + 8 = -j, 4j - z + 3 = 5. Solve -3f + 2f - x + 6 = j, 4f = -x + 21 for f. 5 Let j(v) = -v*2 - 10v + 7. Let h be j(-8). Solve 8 = c - 4p, 0 = -2c - 4p - p - h for c. -4 Suppose -5t = -25, -v - 11 = -3t + t. Let b = v + 7. Let s(c) = c3 - c2 + c. Let p be s(0). Solve -r + f - b = -pf, -2f = -10 for r. -1 Suppose -2u - 5p - 55 = 2u, 105 = -5u + p. Let f = 60 + u. Let r = 72 - f. Solve 1 = 2s - c - 2c, -4c - r = 5s for s. -4 Suppose -y = -5y. Solve yi + 26 = -5i - 2l, -2 = 2i - 2l for i. -4 Suppose -13 = 5c + 2w, -4w - 16 = -0w. Let o = c + 5. Solve -oi - 5 = i + 4b, 4b + 20 = 0 for i. 3 Let a be (-17)/6 + 8/(-48). Let o be 0 + (-72)/(a + -1). Solve -7 = 5w + o, 5w + 16 = -3b for b. 3 Let o = -59 - -62. Solve 0i + 13 = -5s + i, os + 3i = 3 for s. -2 Let m(q) = 7q - 9. Let c be m(2). Solve -2s = -4f - 24, 8 = -2s - s - cf for s. 4 Let d(t) = -t - 3. Let v be d(-5). Suppose -3h = 3l + vl - 102, 20 = 2l - 4h. Solve -5k - p = l, -4p + 3 = -5 for k. -4 Suppose -8m + 3m = 0. Let y be m/(-1)(-15)/(-45). Let q(b) = -4b - 1. Let g be q(-1). Solve -4n = 3a, 3a + yn + gn = 3 for a. 4 Let z = 0 + 2. Suppose 5 + 5 = zk. Solve -4b + k = -g, -6b - 20 = -5b + 4*g for b. 0 Let g = -10	{ "pile_set_name": "DM Mathematics" }
he power of 1/4, to the nearest integer? 20 What is the cube root of 10434 to the nearest integer? 22 What is the third root of 28224 to the nearest integer? 30 What is 23344 to the power of 1/2, to the nearest integer? 153 What is 579 to the power of 1/7, to the nearest integer? 2 What is 12954 to the power of 1/2, to the nearest integer? 114 What is the tenth root of 1823 to the nearest integer? 2 What is 3526 to the power of 1/6, to the nearest integer? 4 What is 447 to the power of 1/8, to the nearest integer? 2 What is the square root of 35602 to the nearest integer? 189 What is 3006 to the power of 1/3, to the nearest integer? 14 What is 10560 to the power of 1/2, to the nearest integer? 103 What is 27967 to the power of 1/6, to the nearest integer? 6 What is the ninth root of 31732 to the nearest integer? 3 What is 135 to the power of 1/8, to the nearest integer? 2 What is the ninth root of 13219 to the nearest integer? 3 What is 2684 to the power of 1/3, to the nearest integer? 14 What is the cube root of 19533 to the nearest integer? 27 What is the cube root of 497 to the nearest integer? 8 What is 2624 to the power of 1/10, to the nearest integer? 2 What is the third root of 16203 to the nearest integer? 25 What is 5226 to the power of 1/3, to the nearest integer? 17 What is 87023 to the power of 1/3, to the nearest integer? 44 What is the square root of 43278 to the nearest integer? 208 What is 1098 to the power of 1/2, to the nearest integer? 33 What is the cube root of 1909 to the nearest integer? 12 What is 211 to the power of 1/2, to the nearest integer? 15 What is the cube root of 97494 to the nearest integer? 46 What is the sixth root of 2034 to the nearest integer? 4 What is the cube root of 1726 to the nearest integer? 12 What is the square root of 11266 to the nearest integer? 106 What is the cube root of 1656 to the nearest integer? 12 What is the square root of 3293 to the nearest integer? 57 What is the ninth root of 32569 to the nearest integer? 3 What is 130207 to the power of 1/3, to the nearest integer? 51 What is the fifth root of 14777 to the nearest integer? 7 What is the tenth root of 11014 to the nearest integer? 3 What is the seventh root of 16310 to the nearest integer? 4 What is 18830 to the power of 1/3, to the nearest integer? 27 What is the square root of 1030 to the nearest integer? 32 What is 530 to the power of 1/2, to the nearest integer? 23 What is the square root of 59794 to the nearest integer? 245 What is the sixth root of 2219 to the nearest integer? 4 What is the square root of 260 to the nearest integer? 16 What is the cube root of 1695 to the nearest integer? 12 What is 785 to the power of 1/4, to the nearest integer? 5 What is the seventh root of 109931 to the nearest integer? 5 What is 9055 to the power of 1/3, to the nearest integer? 21 What is 33280 to the power of 1/2, to the nearest integer? 182 What is the square root of 1297 to the nearest integer? 36 What is the cube root of 5051 to the nearest integer? 17 What is the fifth root of 6203 to the nearest integer? 6 What is the square root of 16151 to the nearest integer? 127 What is the cube root of 102653 to the nearest integer? 47 What is the square root of 137 to the nearest integer? 12 What is the third root of 129914 to the nearest integer? 51 What is 1678 to the power of 1/3, to the nearest integer? 12 What is the third root of 124 to the nearest integer? 5 What is the third root of 110 to the nearest integer? 5 What is 7916 to the power of 1/2, to the nearest integer? 89 What is the square root of 15181 to the nearest integer? 123 What is 9005 to the power of 1/2, to the nearest integer? 95 What is 2006 to the power of 1/9, to the nearest integer? 2 What is the cube root of 806 to the nearest integer? 9 What is 138654 to the power of 1/8, to the nearest integer? 4 What is 122 to the power of 1/3, to the nearest integer? 5 What is the third root of 106 to the nearest integer? 5 What is 10288 to the power of 1/9, to the nearest integer? 3 What is 93099 to the power of 1/9, to the nearest integer? 4 What is 1515 to the power of 1/3, to the nearest integer? 11 What is the tenth root of 140473 to the nearest integer? 3 What is the square root of 322 to the nearest integer? 18 What is the square root of 100422 to the nearest integer? 317 What is the eighth root of 2483 to the nearest integer? 3 What is 3816 to the power of 1/2, to the nearest integer? 62 What is the cube root of 98951 to the nearest integer? 46 What is the fourth root of 76837 to the nearest integer? 17 What is 13169 to the power of 1/3, to the nearest integer? 24 What is 37966 to the power of 1/3, to the nearest integer? 34 What is 31567 to the power of 1/3, to the nearest integer? 32 What is the square root of 170167 to the nearest integer? 413 What is 11911 to the power of 1/5, to the nearest integer? 7 What is 2496 to the power of 1/3, to the nearest integer? 14 What is 1217 to the power of 1/3, to the nearest integer? 11 What is 2285 to the power of 1/7, to the nearest integer? 3 What is the cube root of 2309 to the nearest integer? 13 What is 107236 to the power of 1/8, to the nearest integer? 4 What is 56443 to the power of 1/6, to the nearest integer? 6 What is the square root of 127117 to the nearest integer? 357 What is the fourth root of 6026 to the nearest integer? 9 What is the cube root of 16364 to the nearest integer? 25 What is 912 to the power of 1/5, to the nearest integer? 4 What is the third root of 20764 to the nearest integer? 27 What is the fourth root of 1405 to the nearest integer? 6 What is 9534 to the power of 1/2, to the nearest integer? 98 What is 1069 to the power of 1/4, to the nearest integer? 6 What is the seventh root of 16845 to the nearest integer? 4 What is the cube root of 7 to the nearest integer? 2 What is the square root of 21084 to the nearest integer? 145 What is the third root of 578 to the nearest integer? 8 What is 49424 to the power of 1/3, to the nearest integer? 37 What is 1480 to the power of 1/4, to the nearest integer? 6 What is 26382 to the power of 1/2, to the nearest integer? 162 What is 47342 to the power of 1/2, to the nearest integer? 218 What is the square root of 758 to the nearest integer? 28 What is 1349 to the power of 1/3, to the nearest integer? 11 What is 45132 to the power of 1/2, to the nearest integer? 212 What is the square root of 24487 to the nearest integer? 156 What is the cube root of 8291 to the nearest integer? 20 What is the third root of 626 to the nearest integer? 9 What is the square root of 570 to the nearest integer? 24 What is 31490 to the power of 1/10, to the nearest integer? 3 What is 3135 to the power of 1/5, to the nearest integer? 5 What is the third root of 18478 to the nearest integer? 26 What is the fifth root of 3816 to the nearest integer? 5 What is the square root of 10984 to the nearest integer? 105 What is the third root of 1732 to the nearest integer? 12 What is the seventh root of 8579 to the nearest integer? 4 What is the square root of 36587 to the nearest integer? 191 What is 1775 to the power of 1/3, to the nearest integer? 12 What is 35740 to the power of 1/10, to the nearest integer? 3 What is 368 to the power of 1/3, to the nearest integer? 7 What is the ninth root of 1226 to the nearest integer? 2 What is 7849 to the power of 1/3, to the nearest integer? 20 What is the fourth root of 292 to the nearest integer? 4 What is the square root of 1229 to the nearest integer? 35 What is 11674 to the power of 1/9, to the nearest integer? 3 What is the square root of 6226 to the nearest integer? 79 What is 1861 to the power of 1/10, to the nearest integer? 2 What is 5454 to the power of 1/9, to the nearest integer? 3 What is the third root of 29399 to the nearest integer? 31 What is the tenth root of 1910 to the nearest integer? 2 What is the fifth root of 21628 to the nearest integer? 7 What is the square root of 621 to the nearest integer? 25 What is 2623 to the power of 1/6, to the nearest integer? 4 What is 79323 to the power of 1/8, to the nearest integer? 4 What is the third root of 186 to the nearest integer? 6 What is the fifth root of 574 to the nearest integer	{ "pile_set_name": "DM Mathematics" }
are there in 0.8550084 months? 0.0000712507 Convert 508357.3 weeks to seconds. 307454495040 How many millilitres are there in 438.146l? 438146 What is eleven quarters of a millennium in years? 2750 Convert 84948.98t to micrograms. 84948980000000000 What is 57968.69ml in litres? 57.96869 Convert 15.81573 millennia to decades. 1581.573 How many micrograms are there in one twentieth of a gram? 50000 How many minutes are there in 0.5855442 microseconds? 0.00000000975907 Convert 83384.14 milligrams to kilograms. 0.08338414 What is 6.773965 microseconds in milliseconds? 0.006773965 How many meters are there in seven halves of a kilometer? 3500 How many grams are there in 25/4 of a kilogram? 6250 How many millimeters are there in one fifth of a meter? 200 What is 78489.11 minutes in nanoseconds? 4709346600000000 What is 4/3 of a hour in seconds? 4800 Convert 4.690012 nanograms to milligrams. 0.000004690012 What is 549.587 centuries in months? 659504.4 How many micrograms are there in 698073.9 grams? 698073900000 How many millilitres are there in 7/4 of a litre? 1750 What is 27.6234km in nanometers? 27623400000000 What is seven eighths of a micrometer in nanometers? 875 How many millilitres are there in 26920.14 litres? 26920140 Convert 0.85758 kilograms to tonnes. 0.00085758 How many minutes are there in thirteen ninths of a week? 14560 How many nanoseconds are there in 6951.46 milliseconds? 6951460000 Convert 4.581157m to micrometers. 4581157 How many hours are there in 1277675.7 minutes? 21294.595 How many microseconds are there in one quarter of a millisecond? 250 How many millennia are there in 26.667798 months? 0.0022223165 What is 27.63094 meters in micrometers? 27630940 What is 7/8 of a milligram in micrograms? 875 How many tonnes are there in 74.37196 nanograms? 0.00000000000007437196 What is 3796903.8ns in hours? 0.0000010546955 How many decades are there in 52/5 of a millennium? 1040 Convert 51818.5 decades to months. 6218220 What is 1/4 of a millennium in decades? 25 What is 3/32 of a tonne in grams? 93750 What is twenty-seven halves of a microgram in nanograms? 13500 What is 7610.049ms in microseconds? 7610049 How many millilitres are there in 3/8 of a litre? 375 What is seventy-four fifths of a kilogram in grams? 14800 What is 125014.3 days in nanoseconds? 10801235520000000000 Convert 547271.3 millimeters to meters. 547.2713 What is 6/25 of a millennium in years? 240 What is fourty-four fifths of a millimeter in micrometers? 8800 What is 42.03314l in millilitres? 42033.14 What is 1488.024km in centimeters? 148802400 What is 53/4 of a meter in centimeters? 1325 Convert 881.1646um to kilometers. 0.0000008811646 Convert 9.4744 minutes to seconds. 568.464 What is 477.7529 millilitres in litres? 0.4777529 How many meters are there in 8.961757 nanometers? 0.000000008961757 Convert 5123.125mm to centimeters. 512.3125 What is 712942.4m in nanometers? 712942400000000 What is 66033.91 decades in years? 660339.1 What is 1/4 of a tonne in kilograms? 250 What is fifty-seven halves of a gram in milligrams? 28500 How many nanoseconds are there in eighty-one quarters of a microsecond? 20250 How many kilograms are there in 29/5 of a tonne? 5800 What is 9017.392 milligrams in nanograms? 9017392000 Convert 57885.66ng to micrograms. 57.88566 What is twenty-nine halves of a centimeter in millimeters? 145 What is 51.0868701 minutes in weeks? 0.005068141875 How many minutes are there in four fifteenths of a day? 384 What is 39.39656g in micrograms? 39396560 How many seconds are there in 4/15 of a minute? 16 What is 6912.367 weeks in milliseconds? 4180599561600 How many millilitres are there in 11/8 of a litre? 1375 Convert 50952.13 kilograms to tonnes. 50.95213 What is 9.665141 centuries in months? 11598.1692 Convert 2.759951l to millilitres. 2759.951 Convert 5.28767 decades to millennia. 0.0528767 How many micrograms are there in 5/4 of a milligram? 1250 Convert 561.6629um to kilometers. 0.0000005616629 What is 946.0704 kilometers in nanometers? 946070400000000 How many months are there in seven halves of a decade? 420 Convert 9937.365 days to nanoseconds. 858588336000000000 How many months are there in seven halves of a millennium? 42000 How many nanograms are there in 40100.48 micrograms? 40100480 What is 53/4 of a litre in millilitres? 13250 Convert 0.5101344 milliseconds to nanoseconds. 510134.4 What is 0.9486947 hours in minutes? 56.921682 What is 7/4 of a day in hours? 42 What is eight fifteenths of a hour in minutes? 32 Convert 1248.187 hours to milliseconds. 4493473200 How many millilitres are there in seven eighths of a litre? 875 What is fifty-three quarters of a microsecond in nanoseconds? 13250 What is fourty-seven quarters of a litre in millilitres? 11750 Convert 3603.463l to millilitres. 3603463 Convert 0.1360914 millimeters to nanometers. 136091.4 How many nanograms are there in 4.50735 milligrams? 4507350 How many weeks are there in 80855258.4us? 0.00013368925 What is 67736.65 tonnes in milligrams? 67736650000000 What is 1739.2701us in minutes? 0.000028987835 What is thirty-two fifths of a century in decades? 64 How many nanoseconds are there in 3/5 of a microsecond? 600 How many millilitres are there in 79/2 of a litre? 39500 What is 872562.7 nanograms in tonnes? 0.0000000008725627 What is eleven tenths of a hour in minutes? 66 What is 25386.19 millilitres in litres? 25.38619 What is 811.8712 hours in milliseconds? 2922736320 What is one fifth of a millennium in decades? 20 What is 72.77978 years in decades? 7.277978 What is 7/3 of a day in hours? 56 What is 0.0534044ng in tonnes? 0.0000000000000000534044 What is seventeen quarters of a millennium in months? 51000 How many nanometers are there in 1/20 of a micrometer? 50 How many milligrams are there in 41/2 of a gram? 20500 What is 81.92679 tonnes in nanograms? 81926790000000000 What is 600.926 millimeters in meters? 0.600926 How many centimeters are there in 0.5869249km? 58692.49 Convert 9.40013 micrograms to nanograms. 9400.13 What is 882.3054 kilograms in tonnes? 0.8823054 How many years are there in 29/2 of a century? 1450 How many millilitres are there in 170562.5 litres? 170562500 Convert 0.495925t to milligrams. 495925000 What is 2/15 of a minute in seconds? 8 How many years are there in 13/5 of a millennium? 2600 How many millilitres are there in 1/10 of a litre? 100 What is 5/8 of a kilometer in centimeters? 62500 What is one tenth of a tonne in grams? 100000 How many kilograms are there in 50477.52 milligrams? 0.05047752 How many nanometers are there in fifty-one fifths of a micrometer? 10200 How many micrometers are there in 9356.801m? 9356801000 How many days are there in twenty-three sevenths of a week? 23 How many seconds are there in two fifteenths of a week? 80640 What is 1/5 of a meter in millimeters? 200 Convert 608348.4 kilometers to micrometers. 608348400000000 Convert 684.355m to nanometers. 684355000000 How many hours are there in 4.7710278 nanoseconds? 0.0000000000013252855 What is seven halves of a litre in millilitres? 3500 How many minutes are there in fifteen quarters of a week? 37800 Convert 4939.196 micrograms to nanograms. 4939196 How many millilitres are there in one fifth of a litre? 200 Convert 0.07582 meters to millimeters. 75.82 Convert 0.6349488nm to kilometers. 0.0000000000006349488 How many hours are there in 31.52475 days? 756.594 How many nanometers are there in one fifth of a micrometer? 200 What is 32/5 of a litre in millilitres? 6400 How many millilitres are there in twenty-six fifths of a litre? 5200 How many months are there in 9/10 of a decade? 108 What is 67/5 of a meter in centimeters? 1340 What is 1/4 of a decade in months? 30 How many micrometers are there in one tenth of a millimeter? 100 What is 9.073799t in milligrams? 9073799000 How many nanograms are there in 4063.654 milligrams? 4063654000 How many micrometers are there in 3/25 of a millimeter? 120 Convert 160559.4 millennia to months. 1926712800 What is seven quarters of a century in years? 175 Convert 66.9917 meters to nanometers. 66991700000 What is 92120.51l in millilitres? 92120510 What is 756547.6km in centimeters? 75654760000 Convert 60396.732ns to hours. 0.00000001677687 W	{ "pile_set_name": "DM Mathematics" }
+ 81)/13 Determine n, given that 68n3 - 138n*2 - 200n + 6 = 0. -1, 1/34, 3 Find x, given that 2x2/11 + 358x/11 - 724/11 = 0. -181, 2 Factor d*2/3 + 176d/3 + 7744/3. (d + 88)*2/3 Factor 5h*3 - 25h*2 - 10h + 120. 5(h - 4)(h - 3)(h + 2) Find l, given that 8l*5 + 120l*4 - 142l*3 - 204l*2 + 314l - 96 = 0. -16, -3/2, 1/2, 1 Solve -22d4 + 136d*3 - 134d*2 + 20d = 0 for d. 0, 2/11, 1, 5 Factor 8j3 - 164j*2 + 220j + 152. 4(j - 19)(j - 2)(2j + 1) Factor 4q2 - 360q - 736. 4(q - 92)(q + 2) Suppose -v*2/4 - 31v/2 - 61/4 = 0. Calculate v. -61, -1 Factor 2y4 - 58y*3 + 544y*2 - 1664y. 2y(y - 13)(y - 8)2 Determine j so that 2j*4/5 - 2j*3 = 0. 0, 5 Factor -13j*2/5 - 28j/5 - 4/5. -(j + 2)(13j + 2)/5 Determine p so that 20p5/9 + 82p*4/9 + 28p*3/9 - 118p*2/9 - 4p/3 = 0. -3, -2, -1/10, 0, 1 Factor 738v2 - 2210v - 12. 2(v - 3)(369v + 2) Find b, given that b4 + 32b*3 + 286b*2 + 480b + 225 = 0. -15, -1 Suppose -3l5 + 21l*4 + 12l*3 - 156l*2 - 144l = 0. What is l? -2, -1, 0, 4, 6 Determine c, given that 2c5/11 - 92c*4/11 + 768c*3/11 - 1664c*2/11 - 2560c/11 + 9216/11 = 0. -2, 4, 36 What is g in -g*2/7 - 47g/7 - 172/7 = 0? -43, -4 Factor 2u4/9 - 20u*3/9 + 58u*2/9 - 16u/9 - 32/3. 2(u - 4)2(u - 3)(u + 1)/9 Determine j, given that -2j*5/9 - 8j*4/9 + 32j*2/9 + 32j/9 = 0. -2, 0, 2 What is q in q*4 - 801q*3 - 1605q*2 - 803q = 0? -1, 0, 803 Solve -22f2 - 1310f - 708 = 0 for f. -59, -6/11 What is c in 4c3 - 126c*2 + 960c + 512 = 0? -1/2, 16 Factor 3p2 - 288p + 285. 3(p - 95)(p - 1) Factor 3r3 - 9r - 6. 3(r - 2)(r + 1)*2 Factor 5v*4 + 30v*3 + 65v*2 + 60v + 20. 5(v + 1)2(v + 2)*2 Let -5x*3 + 31515x*2 - 66213015x + 46371181505 = 0. Calculate x. 2101 Suppose w*2/2 - 23w/2 + 21 = 0. Calculate w. 2, 21 Factor o*5/6 + 65o*4/6 + 955o*3/6 - 3265o*2/6 + 1700o/3 - 578/3. (o - 1)*3(o + 34)2/6 Factor y2 - 138y + 4761. (y - 69)2 Factor -t2/5 - 5124t/5 - 6563844/5. -(t + 2562)2/5 Determine r, given that -r2/4 - 27r/2 + 28 = 0. -56, 2 Let -2i*3/5 - 12i*2/5 - 18i/5 = 0. Calculate i. -3, 0 Suppose 2d5 - 128d*4/15 - 136d*3/15 + 36d*2/5 + 106d/15 + 4/3 = 0. Calculate d. -1, -2/5, -1/3, 1, 5 Suppose 2t3/7 - 10t*2/7 - 8t + 64/7 = 0. Calculate t. -4, 1, 8 Factor 2x4 - 6x*2 - 4x. 2x(x - 2)(x + 1)2 Suppose -14r*3/5 + 3988r*2 - 5696r/5 = 0. What is r? 0, 2/7, 1424 Factor 3g4 - 27g*3 - 3g*2 + 27g. 3g(g - 9)(g - 1)(g + 1) Let -5n4 + 750n*3 + 5n*2 - 750n = 0. What is n? -1, 0, 1, 150 What is h in 5h2 - 275h - 280 = 0? -1, 56 Find m such that -m*4/4 - 3m*3 - 39m*2/4 - 7m = 0. -7, -4, -1, 0 Let 2t4/3 + 4t*3/3 - 14t*2/3 - 40t/3 - 8 = 0. What is t? -2, -1, 3 Suppose -u*5/2 + 13u*4/2 + 63u*3/2 + 83u*2/2 + 17u = 0. Calculate u. -2, -1, 0, 17 Factor -o*4 - 21o*3 - 118o*2 - 60o + 200. -(o - 1)(o + 2)(o + 10)2 Determine i so that i2 + 28i - 29 = 0. -29, 1 Factor -25392n*3 - 24840n*2 + 549n - 3. -3(n + 1)(92n - 1)2 Solve -2m*3/7 + 92m*2/7 - 90m/7 = 0 for m. 0, 1, 45 Factor 5m2 - 6440m + 2073680. 5(m - 644)2 Find l, given that 16l*3 - 676l*2 + 1448l - 320 = 0. 1/4, 2, 40 Determine d so that 2d5/7 - 22d*4/21 - 2d*3/3 + 94d*2/21 - 40d/21 - 8/7 = 0. -2, -1/3, 1, 2, 3 Find d such that d*5 - 28d*4 + 237d*3 - 486d*2 - 864d + 2592 = 0. -2, 3, 12 Factor 6w3/5 + 256w*2/5 + 168w/5. 2w(w + 42)(3w + 2)/5 Solve 22z3 + 40z*2 + 14z - 4 = 0 for z. -1, 2/11 Suppose w*3 - 77w*2 + 1360w + 4800 = 0. Calculate w. -3, 40 Factor -u*4 - 23u*3 - 51u*2 + 175u - 100. -(u - 1)*2(u + 5)(u + 20) What is k in -k2/4 + 3k/4 - 1/2 = 0? 1, 2 Determine v so that v*5 + 5v*4 + 2v*3 - 14v*2 - 3v + 9 = 0. -3, -1, 1 Suppose -2q5 + 30q*3 - 20q*2 - 120q + 144 = 0. Calculate q. -3, 2 Determine a so that a*2/7 - 16a - 113/7 = 0. -1, 113 Determine u, given that -8u4/3 + 22u*3 - 8u*2/3 - 22u + 16/3 = 0. -1, 1/4, 1, 8 What is s in -5s5/4 + 35s*4/2 - 40s*3 - 160s*2 = 0? -2, 0, 8 Factor -2m*2/11 + 3232m/11 - 3230/11. -2(m - 1615)(m - 1)/11 Let x*3/5 + 4x2/5 + x/5 - 6/5 = 0. What is x? -3, -2, 1 Determine t so that t4/8 + t*3/8 = 0. -1, 0 Factor -2x*4/3 - 4x*3 + 8x*2/3 + 16x. -2x(x - 2)(x + 2)(x + 6)/3 Determine q so that q5 + q4 - 2q3 - 2q2 + q + 1 = 0. -1, 1 Factor -l4 - 2l3 + 7l*2 - 4l. -l(l - 1)2(l + 4) Solve 4f2 - 72f - 76 = 0 for f. -1, 19 Let 4l5 + 60l*4 + 288l*3 + 432l2 = 0. Calculate l. -6, -3, 0 Factor -v2/7 + 7568v/7 - 14318656/7. -(v - 3784)2/7 Factor 3a*2/4 + 1035a/2. 3a(a + 690)/4 What is c in 3c2/4 - 9c/2 - 21/4 = 0? -1, 7 Factor n*2 - 16n + 15. (n - 15)(n - 1) Let 2w*3/3 - 34w*2/3 + 28w/3 + 784/3 = 0. What is w? -4, 7, 14 Factor -7v3/2 + 39v*2/2 - 19v - 12. -(v - 4)(v - 2)(7v + 3)/2 Factor 4z*4/7 - 12z*3/7 - 4z*2/7 + 12z/7. 4z(z - 3)(z - 1)(z + 1)/7 Find b, given that -2b2 - 3580b - 1602050 = 0. -895 Suppose -2c4 - 34c*3 - 80c*2 + 600c = 0. What is c? -10, 0, 3 What is m in -5m2 - 810m - 2385 = 0? -159, -3 Determine d, given that d*5/11 + 251d*4/11 + 15370d*3/11 - 47626d*2/11 + 48133d/11 - 16129/11 = 0. -127, 1 Suppose 2k3/21 - 50k*2/21 + 82k/7 - 114/7 = 0. Calculate k. 3, 19 Determine b, given that -15b3 - 445b*2 + 615b - 155 = 0. -31, 1/3, 1 Factor -2w2 + 8w + 42. -2(w - 7)(w + 3) Let t*4 - 11t*3 - 13t*2 + 11t + 12 = 0. Calculate t. -1, 1, 12 Determine i, given that 6i5/11 - 2100i*4/11 + 4176i*3/11 + 12i*2/11 - 4182i/11 + 2088/11 = 0. -1, 1, 348 Solve 2v5/17 + 6v*4/17 - 92v*3/17 + 144v*2/17 = 0 for v. -9, 0, 2, 4 Solve 3y*2/2 + 127y/2 + 21 = 0. -42, -1/3 Let 3p3 - 315p*2 + 1482p + 1800 = 0. Calculate p. -1, 6, 100 Determine j so that -2j2/3 - 82j/3 + 28 = 0. -42, 1 Solve -t*5 - 4905t*4 - 6017208t*3 - 6012304t2 = 0 for t. -2452, -1, 0 Let -w3/2 - 13w2 + 149w/2 - 93 = 0. What is w? -31, 2, 3 Find m such that 30m3/23 - 82m*2/23 - 140m/23 - 48/23 = 0. -2/3, -3/5, 4 Suppose -162x5/13 + 36x*4 + 490x*3/13 - 1628x*2/13 + 1024x/13 - 192/13 = 0. Calculate x. -2, 4/9, 1, 3 Factor -4m5/7 - 8m*4/7 + 12m*3/7 + 16m*2/7 - 16m/7. -4m(m - 1)*2(m + 2)*2/7 Find x such that 70x*3 - 37x*2 - 31x - 2 = 0. -2/5, -1/14, 1 Factor -j4/7 - j3/7 + 3j2/7 + 5j/7 + 2/7. -(j - 2)(j + 1)3/7 Suppose 4u*3 - 5964u*2 + 2220096u + 2226064 = 0. What is u? -1, 746 Factor i*4/3 + 80i*3 + 316i*2 + 944i/3. i(i + 2)2(i + 236)/3 Factor g*4/3 + 13g*3/3 + 17g*2 + 21g. g(g + 3)2(g + 7)/3 Let -2z4 - 90z*3 - 1302z*2 - 5542z + 6936 = 0. Calculate z. -17, -12, 1 Let -20h2/9 + 44h/3 - 8 = 0. What is h? 3/5, 6 Factor a*4/6 - 13a*2/6 + 2a. a(a - 3)(a - 1)(a + 4)/6 Factor 2v*2/9 - 52v/3 + 338. 2(v - 39)2/9 Solve -5h*5 - 40h*4 - 90h*3 - 20h*2 + 95h + 60 = 0. -4, -3, -1, 1 Let 12z3 + 3488z*2 + 16048z + 9152 = 0. Calculate z. -286, -4, -2/3 Factor 2k4/7 - 128k*3/7 - 130k*2/7. 2k*2(k - 65)(k + 1)/7 Let 14v*5 - 38v*4 - 236v*3 - 232v*2 - 48v = 0. What is v? -2, -1, -2/7, 0, 6 Suppose -5t3 - 90t*2 + 5t + 90 = 0. What is t? -18, -1, 1 Find m, given that m*3 - 119m*2 + 116m + 236 = 0. -1, 2, 118 Factor 3a2 - 7797a - 7800. 3(a - 2600)(a + 1) Factor 3m4 - 12m*3 + 9m*2. 3m*2(m - 3)(m - 1) Determine k so that 2k*2/3 + 224k/3 = 0. -112, 0 Determine g so that -g5/8 + g4/4 + 6g3 + 61g*2/4 + 113g/8 + 9/2 = 0. -4, -1, 9 Factor -3s2/4 + 915s/2 - 279075/4. -3(s - 305)2/4 Factor -f2/3 + 56f/3 - 784/3. -(f - 28)*2/3 Find j, given that -3j*4 + 228j*3 + 3j*2 - 228j = 0. -1, 0, 1, 76 Suppose 12i2 - 376i - 256 = 0. Calculate i. -2/3, 32 Factor -338j2/7 + 104j - 56. -2(13j - 14)*2/7 Factor 2m*4/17 + 16m*3/17 + 42m*2/17 + 36m/17. 2m(m + 2)(m + 3)2/17 Find j, given that j2/3 - 65j/3 - 68 = 0. -3, 68 Factor -33j2/7 - 12j/7. -3j(11j + 4)/7 Solve -3v*3 - 12v*2 + 12v + 48 = 0. -4, -2, 2 Solve -9q*5/5 +	{ "pile_set_name": "DM Mathematics" }
q wrt q. 20q*3 Differentiate -5 - 1 - 4d*4 + 2 wrt d. -16d3 Let p(k) be the first derivative of -k8/84 - 5k4/12 + 5k*2 - 11. Let f(h) be the second derivative of p(h). Find the second derivative of f(j) wrt j. -80j*3 Let x(t) = 27t*3 - 7t*2 - 4t. Let f(w) = -w3 - w2 + w. Let h(c) = 4f(c) + x(c). What is the third derivative of h(y) wrt y? 138 Let r(u) be the second derivative of 5u7/42 - u4/2 + 4u. Find the third derivative of r(l) wrt l. 300l*2 What is the first derivative of 18x*4 - 27x*4 - 8 + 12x*4 wrt x? 12x3 Let m(c) be the second derivative of c7/14 + c*4/2 + 4c. What is the third derivative of m(n) wrt n? 180n2 Let u(f) be the third derivative of 3f5/10 + f4/8 + 11f2. Find the second derivative of u(m) wrt m. 36 Suppose -2m - 3m + p = -19, -2m + p = -10. What is the third derivative of -5w2 - w2 - 2w2 + wm - 6w3 wrt w? -30 Let y(p) be the first derivative of 12p*5/5 + 2p*3 - 23. Find the third derivative of y(j) wrt j. 288j Suppose 28 = 4g - 0g. Suppose -2c - 10 = -gc. Find the second derivative of -s*5 + cs - s + 3s5 wrt s. 40s*3 Let v = -5 + 2. Let w(l) = 5l*3 - 3l*2 - 4. Let u(t) = -11t*3 + 7t*2 + 9. Let r(x) = vu(x) - 7w(x). What is the first derivative of r(d) wrt d? -6d*2 Let b(f) = -1. Let w(h) = 24h + 6. Let v(i) = -6b(i) + w(i). What is the first derivative of v(g) wrt g? 24 Let s(c) = -33c*4 + 72c*2 + 7. Let f(r) = -22r*4 + 48r*2 + 5. Let w(t) = 7f(t) - 5s(t). Find the third derivative of w(i) wrt i. 264i Differentiate 51z3 + 1 + 0 - 60z*3 with respect to z. -27z*2 What is the second derivative of -101y*3 + 14y + 105y3 + 9y wrt y? 24y Let x = -3 + 5. Let f(y) = y2 - y + 2. Let m be f(x). What is the third derivative of 0h*4 - mh2 + h4 + 2h2 wrt h? 24h Suppose 3s = 2s + 2. Let f(m) = 6m4 - 2m*3 + 2m*2 + 2m - 1. Let j(d) = -d4 + d3 - d*2 - d. Let z(b) = sf(b) + 4j(b). Differentiate z(x) wrt x. 32x*3 Let v(i) be the second derivative of -5i*8/56 + 2i*4/3 - 2i. What is the third derivative of v(g) wrt g? -600g3 Let k = 153 - 9179/60. Let r(t) be the third derivative of t2 + 1/60t*5 + 0t*4 + kt*6 + 0t*3 + 0t + 0. Find the third derivative of r(n) wrt n. 12 Let v(q) = -3q - 1. Let x be v(-1). Find the third derivative of -xu2 + u2 - u*4 + 2u*2 wrt u. -24u What is the derivative of 5 - j*4 + 6j*2 - 6j*2 wrt j? -4j*3 Let f(p) be the first derivative of 2p*6/3 + 5p*2/2 - 1. What is the second derivative of f(h) wrt h? 80h3 Let a = 4 + -2. Let p be 3/(1 - (-1)/a). Differentiate g3 - p - g3 + g4 wrt g. 4g3 Let v(z) be the first derivative of -z6/10 - z3/3 + 4z + 4. Let p(o) be the first derivative of v(o). What is the second derivative of p(t) wrt t? -36t2 Let t(c) = -c4 + 34c3 + 41. Let v(f) = -f4 + 33f3 + 41. Let o(z) = 4t(z) - 5v(z). Find the first derivative of o(r) wrt r. 4r*3 - 87r*2 Let x(k) = -30k - 21. Let j(w) = -w + 1. Let b(p) = -2j(p) - x(p). What is the first derivative of b(g) wrt g? 32 Let f(b) be the first derivative of -b4/2 - b3/3 + 2. Find the third derivative of f(o) wrt o. -12 Suppose -13 - 17 = -5w. Let y(q) be the first derivative of -3 + 1/2qw - q3 + 0q*4 + 0q*2 + 0q + 0q5. What is the third derivative of y(g) wrt g? 180g2 Let h(m) be the third derivative of m5/60 - m*4/4 + 2m*3/3 + 2m*2. Let r be h(6). What is the second derivative of 2y*4 - 2y + 0y - yr wrt y? 12y*2 Let i(z) be the second derivative of -7z*5/20 - 13z*4/12 - 48z. What is the third derivative of i(d) wrt d? -42 Let x be (-56)/(-35) - (-2)/5. Let g(u) be the third derivative of -1/3u3 + 0u + 0 + 0u4 - 2u*x - 1/60u*5. What is the derivative of g(n) wrt n? -2n Let v(o) = o4 + o3 + o*2 - o. Let n(h) = -42h*4 - 30h*3 - 30h*2 + 24h. Let l(s) = -n(s) - 30v(s). Find the second derivative of l(j) wrt j. 144j*2 Let j(u) = -2u*2 + 3u + 6. Let a(i) = i*2 - 2i - 5. Suppose 5f + 3p + 23 = -p, -f = 5p + 13. Let g(d) = fa(d) - 2j(d). Differentiate g(y) wrt y. 2y Let w(c) be the first derivative of 0c2 + 0c + 3/4c4 + 1/3c3 + 1. Find the third derivative of w(a) wrt a. 18 Let d(y) = -y2 + y - 1. Let u(v) = v - 11. Let z be u(10). Let w(p) = p*2 - 3p - 1. Let n(i) = zw(i) - 3d(i). Find the first derivative of n(m) wrt m. 4m Let c(i) be the first derivative of 6i*5/5 + 16i*3/3 + 5. What is the third derivative of c(f) wrt f? 144f Let u(c) be the second derivative of 0 + c*2 + 0c*3 + 0c*4 - 1/10c*6 + 4c + 0c5. Differentiate u(z) with respect to z. -12z*3 What is the third derivative of -16k*2 - 52k + 52k - 13k*6 wrt k? -1560k*3 Let s = -6 + 9. What is the third derivative of -4h*3 + 3h*s + 3h2 + h2 - h2 wrt h? -6 Find the third derivative of l2 - 5l2 + 2l*4 - 4l*4 wrt l. -48l Let n(h) = 51h2 + h - 59. Let z(o) = -50o*2 - o + 57. Let j(s) = 5n(s) + 6z(s). Differentiate j(r) with respect to r. -90r - 1 Suppose -2n = 5f - 144, 0 = -3f - n - n + 88. Suppose 4j - f = -4. What is the third derivative of u*2 + 2u*2 - 5u*6 + 4u*j wrt u? -120u*3 Find the second derivative of 6g + 22g + g3 - 1385g*5 + 1381g*5 wrt g. -80g*3 + 6g Suppose -3w = -3m - 6, -11 + 3 = -4w + 3m. Suppose wf + 4k = -10, 4k = 2f + 2f - 28. What is the first derivative of f + 2a*2 - 3 - 2 wrt a? 4a Differentiate 10z3 - 3z + 2 + 3z + 5 wrt z. 30z2 Let b(u) = u2 - 17u - 18. Let p be b(18). Let w(l) be the second derivative of 1/2l*3 - l - 3/2l2 + p. Find the first derivative of w(s) wrt s. 3 Let d(i) = i3 - 2i2 - 2i - 1. Let c(s) = 2s - 9. Let p be c(6). Let x be d(p). Find the second derivative of -z3 - xz*4 - 3z - z*3 + 2z*3 wrt z. -24z*2 Suppose -2 = 3y - 2m, -y = -m - 0 + 1. Find the third derivative of 4v*5 - 6v5 - v2 + yv2 - 4v*2 wrt v. -120v*2 Let f be 75/(-45) - -12. Let g(a) be the first derivative of 0a2 + 0a + 2 - fa3 - 1/2a*4. Find the third derivative of g(o) wrt o. -12 Let z(r) be the first derivative of 7r*5/120 - 7r*4/24 + 2r*3/3 + 6. Let n(a) be the third derivative of z(a). What is the derivative of n(d) wrt d? 7 What is the second derivative of 0s*4 - 5s*4 - 4s*5 - 3s*5 + 2 - 153s + 184s wrt s? -140s*3 - 60s*2 Let y(m) = 21m*3 + 5m*2. Let x(t) = -7t*3 - 2t*2. Let g(z) = -7x(z) - 2y(z). What is the third derivative of g(c) wrt c? 42 Find the third derivative of 119m*5 + 22m*2 - 72m*5 - 65m*5 wrt m. -1080m2 Let d(o) be the first derivative of o5/5 + 2o3 - 11. Find the third derivative of d(b) wrt b. 24b Differentiate 30 - 48x3 - 28x*3 + 89x*3 wrt x. 39x2 Let z(i) = i2 - 3i - 6. Suppose -26 = -4c + 5x + 4, -2c + 3x = -16. Let a be z(c). Differentiate 4 - 1 + r - a - 5r with respect to r. -4 Let z = 13 + -12. Let x(y) = y*2 - y - 1. Let i(m) = -5m*2 - m + 4. Let t(h) = zi(h) + 4x(h). What is the second derivative of t(l) wrt l? -2 Suppose -4v + 32 = -0v - 2r, -2r + 13 = v. What is the derivative of -19y*2 + vy*2 + 6y*2 + 1 wrt y? -8y What is the derivative of 7w - 2w + 10 + 6 + 1 wrt w? 5 Let s(w) be the third derivative of -17w4/24 - 25w*3/3 + 2w*2 + 21. What is the first derivative of s(m) wrt m? -17 Let h(l) be the first derivative of 3 - 2/5l*5 - 3l + 0l3 + 0l*2 + 0l*4. Find the first derivative of h(f) wrt f. -8f*3 Let k(a) = 3a*3 - 12a - 9. Let r(v) = 2 - 3 + 0v + 0v - v. Let q(o) = k(o) - 9r(o). What is the second derivative of q(w) wrt w? 18w Let s(l) be the second derivative of l7/840 - l6/45 + 5l3/3 + 2l. Let p(u) be the second derivative of s(u). Find the third derivative of p(g) wrt g. 6 Let r(s) be the second derivative of 1/2s3 + 0s*5 - s + 0 - 1/30s*6 + 0s*4 + 0s*2. What is the second derivative of r(a) wrt a? -12a*2 Let h be (2 + -2)(0 + 1). Let b(l) be the second derivative of 0l3 + hl*4 + 0 + 1/20l*5 - l + 1/2l*2. What is the derivative of b(z) wrt z? 3z*2 Suppose 10s = 4s + 12. Let d(i) = -i + 8. Let w be d(6). Find the third derivative of 2b**2 - b	{ "pile_set_name": "DM Mathematics" }
to p? (a) 2 (b) 0.1 (c) -2/3 c Let q = 348 + -353. What is the nearest to -2 in -4, 2/23, q? -4 Let a = 0.5 - 0. Let u = 5.9086 + 0.0914. What is the closest to 1 in 0.3, u, a? a Let g = 28 - 27.8. What is the closest to -2 in -2/19, g, 0.4? -2/19 Let i = 2 + -6. Let x = 0 - -1. Let u = 0.201 - 0.001. Which is the nearest to u? (a) 3 (b) i (c) x c Suppose -s + 0z + 2z + 22 = 0, -3z = 9. Suppose 2c - 6c + 24 = 0. Let m be (-2)/6 - s/c. What is the nearest to -0.1 in m, -1/4, 0? 0 Let b = 1.647 - 1.747. What is the nearest to 1/6 in 1/3, b, -32? 1/3 Let m = -226.4 + 226. What is the closest to 3 in 0.4, m, 4, 1? 4 Let b be -4 + 40/48 + 3. What is the nearest to 6 in -2, b, 4? 4 Let g = 1 + 0. Let x = 197.924 - 198. Let t = x + 0.176. Which is the closest to g? (a) t (b) -1/3 (c) 2/11 c Let f be 3/(-2)(-3)/(-18). Suppose d - 552 = -0a + 4a, -5d + 536 = -4a. Let l = 140 + a. What is the nearest to -2/3 in f, 1.1, l? f Let k = -137 - -205. Let g = k - 68. Which is the nearest to -2/13? (a) 0.2 (b) 5 (c) g c Let q = 1 + -0.9. Let p = -0.3214 - 0.0786. What is the closest to q in -4/3, p, -3? p Let u = 353 - 353.3. Which is the closest to -57? (a) u (b) 1 (c) 1/5 a Suppose p + 94 = 6p - 4y, 13 = p + 5y. Let o = -7 - 3. Let q be 22/o + p/6. What is the closest to -3 in 3, 4, q? q Let l = 27 - 54. Let z = l - -25. Which is the nearest to -5? (a) -4 (b) z (c) 2 a Let g = -8.7 - 40.3. Let i = g + 49.5. Which is the nearest to 2/7? (a) i (b) 0.4 (c) 0 b Let q = -0.071 - -0.271. What is the nearest to -63 in 4/7, q, 0.4? q Let z = -738 - -740. What is the closest to z in -5, 0.5, 6, 0.3? 0.5 Let o = 1804 - 1808. Which is the closest to -2/5? (a) -48 (b) 4 (c) o (d) -1 d Let o be (-2)/16(12 + -5 - 15). Let v = -1.3 - -2. Let w = v + -1. Which is the nearest to -3? (a) w (b) 4 (c) o a Let u = -1999 - -2001. What is the nearest to u in -4, 21, -0.17, 0? 0 Let x = 0.04 - 0.44. Let f = -0.1 + 0.21. Let p = f - 0.01. Which is the closest to p? (a) 2 (b) x (c) 1/4 c Let k = 140.4 + -140.1. Let f = 0.7 + 0.3. Which is the closest to f? (a) 0.4 (b) 0.1 (c) k a Let b = -38 - -38.3. What is the nearest to -0.2 in b, 3, 5? b Let z be 0/237/74. What is the closest to 1/4 in -2, 3/4, z, 0.2? 0.2 Let d = -11.97 - -12. Let p = d - 3.03. Let o be (-3 - 1 - -3)0. Which is the closest to p? (a) -1/3 (b) -4 (c) o b Let k be (175/(-5))/5 + 0 + 1. Which is the nearest to k? (a) 1 (b) 0.4 (c) -4 c Let h = 185.6 - 186. What is the nearest to -0.2 in -12, -2, h? h Let m = -2 - -7. Let j = m - 1. Let s = 3.9 - j. Which is the closest to s? (a) 0.4 (b) 1 (c) -3 a Let j = 0.09 + 0.01. Suppose -l - 4u - 17 = 0, 2l - 5l = 5u + 23. Which is the closest to 0.1? (a) -5 (b) j (c) l b Let o = -0.033 + 36.033. Let l = o - 35.6. What is the nearest to -1/4 in -3, l, 1/6? 1/6 Let q = 74/9 + -397/45. Let m = -16.5 - -18.5. What is the nearest to -2/13 in -0.4, q, m? -0.4 Let i = 1470 - 1475. Let k = 0.2 + -1.4. Let f = k - -1. Which is the nearest to f? (a) 0.3 (b) -3 (c) i a Let s = -893/90 - -97/10. Suppose l + 4y + 4 = -3l, -4y + 12 = -4l. Let d be (l/(-10))/(6/15). What is the closest to s in -4, d, -1? d Let h = 4975 - 4975. Let m = 3/8 - 5/8. Which is the nearest to 3/4? (a) m (b) -5 (c) h c Let o = 14 + -14. Let m = -0.58 - -0.28. What is the closest to 3 in o, -3/5, m? o Let r = 35 + -25. Let f = r + 1. Let v = -11 + f. Which is the nearest to v? (a) -5/3 (b) 2/11 (c) -4 b Suppose -3a - 3 = 3c, -2c + 6a + 23 = 3a. Let f = -97 - -102. What is the closest to -0.1 in f, 0.3, c? 0.3 Let r = 43 + -94. Let s = r + 50.7. Which is the nearest to s? (a) 3 (b) -2 (c) 1/9 c Let r = -0.914 + -0.086. Let g be 2((-3)/(-18))/(-1). What is the nearest to g in -4, -1/2, r? -1/2 Let z = -6109 + 6106. Let k = 0.2 - 0.4. Which is the closest to k? (a) -13 (b) z (c) 1 c Let j = 1113/20 + -223/4. Which is the closest to -0.06? (a) -1/2 (b) j (c) -1/3 b Let v = 183 + -1285/7. Let g = -56 - -54. Which is the closest to -2? (a) 0 (b) v (c) g c Let m be 68/(-16) + 2/8. Let j be (-2 - 9/(-4))-1. Let z = -3403/3 - -1133. What is the nearest to j in m, z, 3? z Let w = -0.1286 + 0.4286. Which is the closest to 0.3? (a) 4 (b) -2 (c) w (d) -2/3 c Let u = -659 + 663. Which is the closest to 2/5? (a) 0.08 (b) u (c) -5 a Suppose -31 = 4y - 27. What is the nearest to y in 3, -5/4, -16? -5/4 Let y be -51 + (1204/63)/4. What is the closest to y in -0.3, 2, -1/4, 1? -1/4 Suppose -y = -9 + 5. Let j be (y/(-58))/(-3 - -2). Let m = -64/87 + j. Which is the closest to m? (a) 4 (b) 4/7 (c) 1/5 c Let t be 1/((-4)/4) - -4. Suppose 3q - td = -15, -9q - 10 = -7q - 4d. What is the nearest to 1 in q, -0.1, 5? -0.1 Suppose -5q - 5k - 20 = 0, -q = -4k + 11 - 2. Let r = -0.36 - 0.04. What is the nearest to -1 in -0.1, q, r? r Let f = -94/9 - -91/9. Which is the nearest to -2/3? (a) -6 (b) -33 (c) f c Let j be 15/((-60)/(-8))-1. Which is the closest to j? (a) -1 (b) -4 (c) -13 a Let z = 29 + -22. Let v = z - 6. What is the nearest to -2 in 0.3, -3, v? -3 Let r(t) = -54t - 101. Let l be r(-2). What is the closest to 1 in -0.01, 0.3, l? 0.3 Suppose 4n = 4s - 12, 5s - 2 = 3n + 7. Let m = -105 - -527/5. Which is the nearest to m? (a) -0.1 (b) -0.5 (c) n a Let d = 6 - 3. Let g = 10310 - 10314. Which is the closest to -0.2? (a) g (b) -1/5 (c) d b Let q = 1355 + -71813/53. Let o = q + -61/212. Let t = -8.1 - -8. Which is the nearest to t? (a) o (b) 3 (c) 0.3 a Let g(l) = -l2 + 7l - 8. Let n be g(6). Let x = -0.02502 + 4.02502. Let k = 0.8 - 1. Which is the closest to n? (a) k (b) x (c) -0.1 a Let x = 525 + -524.5. Let c = 0.7 - 1. Let p = -0.1 - c. What is the closest to -1 in -1, x, p? -1 Let o = -0.11 + 0.31. Let x = 15/2 - 7. Let i = -32 - -34. Which is the nearest to x? (a) i (b) o (c) -4 b Suppose 60 = 2i + 8. Suppose -ih = -31h - 25. Let x = -1.5 + 1.5. Which is the nearest to x? (a) h (b) -5/4 (c) 2/7 c Let b = 0.0734 - -0.1266. Let h = -11 + 11.5. What is the closest to -2 in b, 0.3, h? b Let g = -0.107 - 0.093. What is the closest to 11 in g, -1/2, 0.5? 0.5 Let d be (1(2 + -3))/3. Suppose -4u - 6 = 5l - 2u, -5u = -10. Which is the closest to -0.1? (a) -4 (b) d (c) l b Let u = 2523.1 + -2523. Let p = 0.4 - 0.2. Which is the closest to 0? (a) -8 (b) p (c) u c Let v(j) = j*2 + 7j - 4. Let u = 6 + -13. Let g be v(u). Which is the closest to -0.1? (a) g (b) 2/9 (c) 0.1 c Let i(l) = 5l + 163. Let s be i(-33). What is the nearest to s in -3, -0.1, -7, 0.5? -3 Suppose -2g + 4p - 17 = 5, 2p = -5g + 5. Let x = 0 - -0.3. Let c = -11 + 8. What is the nearest to g in x, c, -3/4? -3/4 Let y = 749/66 + -67/6. Suppose -n - 3s = 16, -5s = -1 + 26. Let k = -1.4 - -0.4. Which is the closest to k? (a) y (b) 0.5 (c) n c Let y = 5 + -5.3. Suppose -35 = 5j - 30. Let t = 1 + 0. What is the closest to t in y, j, -4? y Let u = -38.0682 - 0.0318. Let c = u + 38. Let x = -0.5 + -2.5. What is the closest to -1 in x, 2/9, c? c Let o = -0.016 - -83.016. Let d = o + -84. What is the nearest to -1/2 in -5, -2/9, d? -2/9 Let x = -314 - -313.2. What is the nearest to x in -2/3, 2/11, 0.5, -0.01? -2/3 Let w = -41 + 165/4. Let l = -8 - -7. Let i = 0.9 + 0.1. What is the nearest to i in 3/8, l, w? 3/8 Let r be (0 - 6)38/76. Suppose 0 = -2n + 8 + 2. What is the closest to -1 in n, -0.4, r? -0.4 Let x = -1 + 3. Suppose -xh - 10 = 3h. Let q be 0 - (90/24 - 4). What is the nearest to q in h, 0.5, 0.1? 0.1 Let s be (-12)/15 + (-244)/(-305). Let b be 3-1 + 1 - -22. Let a be (1/5)/((-16)/b). What is the nearest to 0.4 in a, s, 3/2? s Let l = -104.5 + 104.5. Which is the nearest to l? (a) -1/6 (b) 0.5 (c) 5 (d) 2/17 d Let u = -83 - -58. Let g = -122/5 - u. What is the closest to 1 in -1/2, -3, g? g Let l = -1 - 2. Let k be 1-8 - (-5 - (-80)/(-16)). Let u = 1 + 0. What is the closest to 4 in u, k, l? k Let c = -336 + 336. Let z = 0.3 - 0. Let v = 0.2 - z. What is the nearest to 1 in 4, v, c? c Suppose s = -3, 4t + 4s - 132 = t. Let r = 50 - t. Which is the closest to -2? (a) -3/5 (b) -1/5 (c) r a Let v = 3 + 3. Suppose -2j - 4x = -82, -j + vx = 2x - 11. Let g = j + -61/2. Which is t	{ "pile_set_name": "DM Mathematics" }
ound s to 1 decimal place. -1.1 Let r = 3155879517492.999868 + -3155889535451. Let m = r + 10017990. Let s = m + -32. Round s to five decimal places. -0.00013 Suppose 4w = -2q - 0q + 58, w + 2q = 22. Let b be 1/(w/(-15) + 1). Let i be (-1)/5 + (-31999999)/b. What is i rounded to the nearest one million? -6000000 Let b = -18.66 - 0.34. Let k = b + 19.00013. Round k to four decimal places. 0.0001 Let c = 11.099564 + -11.1. What is c rounded to 4 decimal places? -0.0004 Suppose 3b + 4l + 3 = 0, 4l = -2b - 8 + 2. Suppose v + bv - 2i = -3202, -2i + 2 = 0. What is v rounded to the nearest one hundred? -800 Let p = 4 - 3. Let x = p - 1. Let o = x - 0.22. What is o rounded to one decimal place? -0.2 Let h = 0.069 - 1.079. Round h to 1 dp. -1 Let s be 44954937/45 + 4/10. Let j = 9701001 + s. What is j rounded to the nearest one million? 11000000 Let p = -6065.088 + 6045. Let d = p + 20. Let s = 0.06 + d. What is s rounded to two dps? -0.03 Let n be (2 - 4/2) + 4. Suppose -d = -nd. Suppose q = -dq + 2200. What is q rounded to the nearest 1000? 2000 Let f be ((-610077)/(-2))/((-3)/12). Let z = 6620154 + f. What is z rounded to the nearest one million? 5000000 Let r(i) = i. Let a be r(-3). Let f be (a + 333)200/3. Let q be (-7)/((-7)/(-250))f. Round q to the nearest one million. -6000000 Let d = 17 - 16.9997. Round d to four decimal places. 0.0003 Let h = 19.82562894 - 19.78963. Let l = h + -0.036. Round l to seven decimal places. -0.0000011 Let f = 4759014 - 4759206.0181. Let m = f + 192. What is m rounded to 3 dps? -0.018 Let b = 229752.9963 + -229833. Let f = b - -80. What is f rounded to three dps? -0.004 Let a = 1765.58855026 + -1768.68855. Let u = a - -3.1. What is u rounded to 7 dps? 0.0000003 Suppose 3b - 49985 = 2i + 8b, 124988 = -5i - 4b. Round i to the nearest 10000. -30000 Let m = 8.6 + -14. What is m rounded to zero dps? -5 Let g = 42.46 + -43. Let h = 0.04 + g. Round h to zero dps. -1 Let a = -1.605 + 1.6. Let o = -0.0050053 - a. Round o to six decimal places. -0.000005 Let q be (-4)/14 - 11080908/(-21). Suppose -s = q - 2827662. What is s rounded to the nearest 1000000? 2000000 Let d = -17404 + 12104. What is d rounded to the nearest one thousand? -5000 Let p be (-96)/(1 + (-4508)/4500). Round p to the nearest 10000. 50000 Let l = -0.053 - -0.078. Round l to two dps. 0.03 Let t = -226 - -120. Let g = -106.0043 - t. What is g rounded to 3 decimal places? -0.004 Let z = -1.9 - 7.1. Let x = z - -9.00000019. Round x to seven decimal places. 0.0000002 Let p = 4370.7 + -4068. Let v = 290 - p. What is v rounded to the nearest integer? -13 Let d be -4 + 7 - -12. Suppose dx - 3x = -16. Round x to 0 decimal places. -8 Let z = -1403.99999293 + 1404. What is z rounded to 7 dps? 0.0000071 Suppose -i - 5h = 140846, 0h = 2i + 3h + 281685. Let c = 323841 + i. Round c to the nearest ten thousand. 180000 Let g = 29.26 - 29. Let k = g - 1.88. Round k to 1 dp. -1.6 Let h = -2047440.30600051 - -2047485.306. Let t = 1.7 - -43.3. Let k = t - h. Round k to seven dps. 0.0000005 Let v = 62.23 - 63. What is v rounded to one dp? -0.8 Let s = -482.9348 - 0.0652. Let b = s - -483.08015. Let y = b + -0.08. Round y to four dps. 0.0002 Let c = 5664.035 + -5646. Let n = c + -18. Round n to 2 decimal places. 0.04 Suppose 2x - 6 = -0. Suppose c + 10 = -q + xc, -c = -3q - 10. Let g be (-432)/((-1504)/750 - q). What is g rounded to the nearest ten thousand? 80000 Let k = 22.165926035 + -0.165921835. Let y = 22 - k. What is y rounded to six decimal places? -0.000004 Let r be 2/(-4 - (-11279997)/2820000). What is r rounded to the nearest one hundred thousand? -1900000 Suppose 0 = -z + 3 - 1. Suppose zi - i - 208 = 0. Suppose -t = -5t + i. Round t to the nearest ten. 50 Let r = -82 + 82.000296. What is r rounded to 5 decimal places? 0.0003 Let y(x) = -9999x2 - 13x + 22. Let l be y(11). What is l rounded to the nearest 100000? -1200000 Let h = 0.04 - 0.105. Round h to 2 decimal places. -0.07 Let s = 0.066336 + 55.573064. Let l = s - 0.0394. Let n = l - 63. What is n rounded to the nearest integer? -7 Let c = -0.1 + -0.08. Let x = c - 0.43. Round x to 1 dp. -0.6 Let r = -28.92 + 26. Round r to 1 decimal place. -2.9 Let o be 157509/((-27)/(-80)). Suppose -6u - o = -u. Round u to the nearest 10000. -80000 Let o = 16 - 15.78. Let b = o + 32.78. Let x = b - 32.9924. What is x rounded to three decimal places? 0.008 Let h = 2 + -2. Suppose -4i + 0g - 238 = g, h = -g + 2. Round i to the nearest one hundred. -100 Let b = 1.8 - 1.46. Let o = 11.76 + b. Let n = 12.100049 - o. Round n to 5 dps. 0.00005 Suppose -a + 3v = 2628 + 5378, -5a - 4v = 39992. Let p be a/(-3)3250. What is p rounded to the nearest 1000000? 2000000 Let j = -0.0806 - 4.0294. Let t = j + 4. Round t to one dp. -0.1 Let q = 7 - 8. Let o = q + 0.999993. Round o to six dps. -0.000007 Let f be 4/8(-8)/2. Let a be f/2-1 - 4. Let b(m) = -22000m. Let r be b(a). Round r to the nearest 10000. 70000 Suppose -13w + 18w + 900 = 0. Round w to the nearest 100. -200 Let i be (140/(-6))/(8/612). Suppose 0 = f - 4f - 3k - 24, 0 = 3f - k + 4. Let j be i/(-7)220/f. What is j rounded to the nearest one thousand? -19000 Let n = -530925.1 - -530920.100002. Let s = n - -5. What is s rounded to 6 decimal places? 0.000002 Let l be (17556892/8)/((-1)/(-6)). Let q = l + -4367672. Suppose -r - q = 2x, -r = 3x - 2r + 13200003. Round x to the nearest 1000000. -4000000 Let g be 0 + 1/((-1)/(-2720000)). Suppose 0 = 6f - 2f + g. Round f to the nearest one hundred thousand. -700000 Let z = -58824.2311 + 58910.2310898. Let l = 86.099 - 0.099. Let t = l - z. What is t rounded to 6 dps? 0.00001 Let r = 1.27 - 1.2753. What is r rounded to three dps? -0.005 Let f = -0.3 + 0.29966. Round f to 4 dps. -0.0003 Let v = 4308.372 - 4297.371993. Let h = v + -11. What is h rounded to 6 dps? 0.000007 Suppose -21323658 = 4j + 200796986. Let g = 77752932 + j. Suppose -4y = -v - 13099980, 3v - y = -17077224 - g. What is v rounded to the nearest 1000000? -13000000 Let t = 4802682.96499971 - 4802683. Let g = t - -0.035. Round g to seven dps. -0.0000003 Let r be (225/1)/(2/(-23200)). What is r rounded to the nearest 1000000? -3000000 Suppose -5w + 83975 = -2h, -5h = -4w + 255751 - 45771. Round h to the nearest ten thousand. -40000 Suppose -14i + 4i = -1300000. What is i rounded to the nearest 100000? 100000 Let q = -3.26 - 0.34. Let n = -3.43008 + -0.17752. Let k = n - q. Round k to three dps. -0.008 Let h = 3.500024 + -3.5. What is h rounded to 5 decimal places? 0.00002 Let w = 5 - 4.99957. Round w to four dps. 0.0004 Let g = 6497562 - 6497561.5600097. Let v = g - 0.44. What is v rounded to 6 decimal places? -0.00001 Let x = 190.701 - -38.069. Let z = x + -230. Round z to 1 decimal place. -1.2 Let u = 0.294 + -0.31. Round u to 2 dps. -0.02 Let o = -442960.2000056 + 442961.9. Let q = o - 1.7. What is q rounded to 6 dps? -0.000006 Let y(j) = j*2 - j - 4. Let u be y(3). Suppose -1786 + 32786 = uw. What is w rounded to the nearest one thousand? 16000 Let h = -66 + 128. Round h to the nearest 10. 60 Let d = -0.0425 + 0.024. What is d rounded to 3 decimal places? -0.019 Let z be 283664800/28 + 2/7. Let v = z - 2530886. Round v to the nearest 1000000. 8000000 Let s(h) = 6h3 + 3h*2 - 5h - 4. Let k be s(-4). Round k to the nearest 1000. 0 Let b = -8787 - -8734.39. Let p = b + 53. What is p rounded to one decimal place? 0.4 Suppose 0 = -2v - 0v + 4. Suppose u - 14 + v = 0. What is u rounded to the nearest ten? 10 Let t = -189 + 147. Let d = -5417477974 - -5417477931.99999967. Let a = t - d. Round a to seven dps. 0.0000003 Let k be (4 + 130)/((-2)/100). What is k rounded to the nearest one thousand? -7000 Let l = 131.99884 - 132. Round l to 3 dps. -0.001 Let l = -0.338 - -0.25. What is l rounded to two dps? -0.09 Let l(m) = m*3. Let x be l(1). Let g be 75(x + (-16791)/(-9)). Round g to the nearest one hundred thousand. 100000 Suppose -2t - 18000006 = -2l, -4l + 2l + 9000006 = -t. Round t to the nearest one million. -9000000 Suppose 3i + 77110 = 5g, 2g = 3i + 7*g + 77090. Round i to the nearest 1000. -26000 Let d = 16.4 + -11. Round d to the nearest integer. 5 Let x = -18 + -5. Let k = 22.5 + x. Ro	{ "pile_set_name": "DM Mathematics" }
o the nearest 1000000? 459000000 What is -0.000006491 rounded to 6 decimal places? -0.000006 What is -67380 rounded to the nearest ten thousand? -70000 What is 67907 rounded to the nearest one thousand? 68000 What is 0.00107818 rounded to 4 dps? 0.0011 Round 9125 to the nearest 100. 9100 Round -0.00030408 to 5 decimal places. -0.0003 What is 990300 rounded to the nearest ten thousand? 990000 What is 0.00041478 rounded to four dps? 0.0004 Round -286050000 to the nearest one million. -286000000 What is 34360 rounded to the nearest 10000? 30000 What is -0.0000084388 rounded to seven dps? -0.0000084 What is 0.00182 rounded to 3 decimal places? 0.002 Round 5.2653 to 1 decimal place. 5.3 What is 64670000 rounded to the nearest 1000000? 65000000 Round 110100 to the nearest ten thousand. 110000 Round 0.0846 to three dps. 0.085 Round -0.000080985 to six dps. -0.000081 What is 2465.9 rounded to the nearest one thousand? 2000 Round -0.00046428 to 4 decimal places. -0.0005 What is -0.000017996 rounded to six dps? -0.000018 What is -0.0004789 rounded to four decimal places? -0.0005 Round 0.66517 to one dp. 0.7 Round -0.01943 to two decimal places. -0.02 Round -17694.2 to the nearest one thousand. -18000 Round 10767.5 to the nearest 10. 10770 Round -10.335 to the nearest integer. -10 What is 17524.9 rounded to the nearest one hundred? 17500 What is -265000 rounded to the nearest 10000? -270000 What is -275030 rounded to the nearest ten thousand? -280000 What is 2.0031 rounded to two decimal places? 2 Round 0.00001072 to six dps. 0.000011 What is -2260 rounded to the nearest 10000? 0 What is -3152400 rounded to the nearest 1000000? -3000000 Round 1463800 to the nearest 10000. 1460000 Round -0.006251 to three decimal places. -0.006 What is -30270 rounded to the nearest 1000? -30000 What is 195.399 rounded to the nearest ten? 200 What is 0.0016747 rounded to four dps? 0.0017 Round 473.46 to the nearest one hundred. 500 What is 0.00506 rounded to four dps? 0.0051 Round -0.0000113655 to 6 decimal places. -0.000011 Round 299500 to the nearest ten thousand. 300000 Round 0.000026147 to 7 decimal places. 0.0000261 What is 458.76 rounded to the nearest integer? 459 Round -0.0374 to three dps. -0.037 Round -3799.8 to the nearest one hundred. -3800 What is -1339000 rounded to the nearest one hundred thousand? -1300000 Round 0.0012928 to five decimal places. 0.00129 Round -0.00001084 to six dps. -0.000011 Round 0.000016169 to 7 dps. 0.0000162 What is -0.2603 rounded to three dps? -0.26 What is -746.3 rounded to the nearest one hundred? -700 Round -2.2377 to one decimal place. -2.2 What is -0.052157 rounded to 3 dps? -0.052 Round -254.3 to the nearest ten. -250 Round 13153 to the nearest 100. 13200 Round -1606300 to the nearest 1000000. -2000000 Round -2780000 to the nearest 100000. -2800000 Round -42.05 to the nearest 10. -40 What is -11230.7 rounded to the nearest 10? -11230 Round 1776170 to the nearest 10000. 1780000 What is -0.017274 rounded to three decimal places? -0.017 What is 800200 rounded to the nearest one hundred thousand? 800000 What is 105742 rounded to the nearest 100000? 100000 What is 0.0301033 rounded to three dps? 0.03 What is 1626 rounded to the nearest one hundred? 1600 Round 0.00044364 to 4 dps. 0.0004 Round -650.09 to the nearest 100. -700 Round -0.00035272 to five decimal places. -0.00035 What is 0.0048656 rounded to 3 decimal places? 0.005 Round -14.44 to 0 decimal places. -14 What is 0.026305 rounded to 4 decimal places? 0.0263 What is 1.66239 rounded to 2 dps? 1.66 What is -0.007084 rounded to 3 dps? -0.007 What is -0.00062684 rounded to 4 dps? -0.0006 Round -28070 to the nearest ten thousand. -30000 What is 16.98 rounded to one dp? 17 What is 311.63 rounded to the nearest one hundred? 300 Round 0.000732 to 5 dps. 0.00073 What is 2880300 rounded to the nearest one hundred thousand? 2900000 Round -40.626 to the nearest ten. -40 What is -12690 rounded to the nearest 1000? -13000 What is 531000 rounded to the nearest ten thousand? 530000 Round 0.000003689 to 6 dps. 0.000004 What is -9.2666 rounded to 1 decimal place? -9.3 Round 0.091816 to 2 decimal places. 0.09 Round 0.05767 to 3 decimal places. 0.058 Round -9096200 to the nearest one million. -9000000 Round -2.1442 to 2 dps. -2.14 Round -187200 to the nearest 10000. -190000 What is 0.959 rounded to 0 decimal places? 1 What is 492.19 rounded to 0 dps? 492 Round 0.12271 to 2 dps. 0.12 What is 1.18928 rounded to 2 dps? 1.19 Round 2205500 to the nearest one hundred thousand. 2200000 Round -466700 to the nearest 10000. -470000 Round -0.000156972 to six decimal places. -0.000157 Round 0.000445 to 4 dps. 0.0004 Round 1.261 to the nearest integer. 1 What is 19940000 rounded to the nearest one million? 20000000 Round -5184900 to the nearest one hundred thousand. -5200000 What is 0.0012517 rounded to 5 dps? 0.00125 Round 106.136 to the nearest integer. 106 What is 0.062603 rounded to two dps? 0.06 Round 310.19 to zero decimal places. 310 Round 548.87 to zero dps. 549 Round -66770000 to the nearest one million. -67000000 What is -0.00000784 rounded to 6 dps? -0.000008 Round -19.7 to the nearest 10. -20 Round 0.0000048599 to 6 dps. 0.000005 Round 1.675 to zero decimal places. 2 Round 0.012308 to three decimal places. 0.012 Round -0.000005378 to seven dps. -0.0000054 What is -4237 rounded to the nearest 100? -4200 Round 182.69 to the nearest 100. 200 Round -1.2123 to one dp. -1.2 Round 56.05 to 0 decimal places. 56 What is -0.00775 rounded to four decimal places? -0.0078 Round 1.15148 to two decimal places. 1.15 Round 664.7 to the nearest 10. 660 What is 0.000002328 rounded to six decimal places? 0.000002 Round 6.968 to 0 dps. 7 What is 0.00000037297 rounded to seven dps? 0.0000004 Round 6844 to the nearest 100. 6800 What is 708.7 rounded to the nearest one hundred? 700 Round 32000 to the nearest one thousand. 32000 What is -0.011664 rounded to 4 decimal places? -0.0117 What is -11270 rounded to the nearest 1000? -11000 What is 0.0000006094 rounded to seven dps? 0.0000006 Round 2.06 to the nearest ten. 0 Round -0.0000009274 to 7 decimal places. -0.0000009 What is -0.001035 rounded to five decimal places? -0.00104 Round -546870000 to the nearest one million. -547000000 What is -11783.9 rounded to the nearest 1000? -12000 What is 0.74077 rounded to two dps? 0.74 What is 0.006978 rounded to two dps? 0.01 Round -0.00022788 to four dps. -0.0002 Round -0.11083 to 2 dps. -0.11 What is 39.98 rounded to zero dps? 40 What is -0.2089 rounded to one dp? -0.2 What is -123.1 rounded to the nearest ten? -120 What is 37190000 rounded to the nearest 1000000? 37000000 Round -6033 to the nearest 1000. -6000 Round 57.8 to zero decimal places. 58 Round -2631.1 to the nearest 100. -2600 Round -5.49 to 1 dp. -5.5 What is -132850000 rounded to the nearest 1000000? -133000000 Round 148.41 to the nearest 10. 150 What is 1798.9 rounded to the nearest 10? 1800 What is -156.9 rounded to the nearest integer? -157 Round -0.0038643 to 3 decimal places. -0.004 Round -31528000 to the nearest one million. -32000000 Round -0.000028535 to seven dps. -0.0000285 Round -6.4494 to 1 decimal place. -6.4 Round 0.018631 to 3 dps. 0.019 Round -0.005888 to four dps. -0.0059 What is -174.36 rounded to the nearest 10? -170 Round -0.0044373 to 5 decimal places. -0.00444 What is 0.00000137 rounded to six decimal places? 0.000001 What is 35.43 rounded to the nearest integer? 35 Round 17711000 to the nearest one million. 18000000 Round 99155000 to the nearest one million. 99000000 What is 8.322 rounded to 0 decimal places? 8 What is -0.35428 rounded to 2 dps? -0.35 Round -0.0000080335 to six decimal places. -0.000008 What is -116600 rounded to the nearest 10000? -120000 What is 0.471576 rounded to 1 dp? 0.5 What is 2.087 rounded to one decimal place? 2.1 Round 0.0072387 to three decimal places. 0.007 What is 17760000 rounded to the nearest one million? 18000000 What is 0.00002795 rounded to 6 decimal places? 0.000028 What is -24949300 rounded to the nearest one hundred thousand? -24900000 Round 0.01688 to 3 decimal places. 0.017 Round -28656.3 to the nearest 100. -28700 What is 6440000 rounded to the nearest 100000? 6400000 What is 0.0004662 rounded to	{ "pile_set_name": "DM Mathematics" }
rivative of p5/60 - p4/12 + p3/3 + p2/2 - p. Let l(c) be the first derivative of t(c). Is l(7) composite? False Suppose 7961 - 1034 = 3x. Is x prime? True Let d(p) = 2p + 1171. Is d(0) prime? True Let y(t) = -6t + 13. Let n be y(11). Is 5 - (3 - 0) - n composite? True Let r(t) = 418t*2 - 2t - 1. Suppose 4w = -2u - 0 + 2, -5u + 2w = 7. Is r(u) a prime number? True Let r = -1176 - -1867. Is r prime? True Let s = -1 + 3. Is s(1492/8 - 0) composite? False Suppose 0 = -2y - 0y. Let o = -4 + 6. Suppose -18 = -oc - 5w, 3w + 6 = -yw. Is c a composite number? True Is (259/21)/((-2)/(-6)) a prime number? True Let b be ((-15)/9)/(1/3). Let c be (-16)/6 - b/(-15). Is 23/(c/45-3) a prime number? False Is 39/(-2)(-218)/3 prime? False Let s(a) = 95a*2 + 10a - 27. Is s(6) composite? True Let j(z) = z*3 - z + 115. Let h = -1 - -3. Suppose -hl + l = 0. Is j(l) composite? True Let h(a) = -3a3 - 4a*2 + a + 1. Let t be h(-3). Let o = t + -30. Is o composite? False Let u = -4 + 6. Suppose ut + 2f = f, 3t = -4f. Is 22(-1 - (t + -2)) a prime number? False Suppose 4y - 364 = -2s, -s + 4y = s - 396. Let h = s - 51. Is h composite? False Suppose 0 = 4z - 32 + 8. Suppose 0 = -za + a + w + 16, 0 = a + 3w. Is a composite? False Is (4 - 8)/(6/(-39)) a composite number? True Let y(p) = -35p - 19. Is y(-14) a composite number? True Suppose -935 = -2c - 3i, -5c - 2i + 2351 = i. Let q = -329 + c. Is q prime? False Suppose 4c - 135 = 5x, 0 = x - 1. Is c + (-6)/9-3 prime? True Let z = 1966 + -1335. Is z composite? False Is (226/(-4) - 3)-2 a prime number? False Let p(j) = j2 + 3j + 1. Let z be p(-4). Suppose -h - 4h = -5s + 730, 0 = zs - 4h - 729. Is s a prime number? False Let r = 59 - -150. Is r composite? True Suppose -834 = 7f - 13f. Is f prime? True Let k(c) = -c*2 + 22c - 9. Let f be k(10). Let g = 140 + f. Is g a composite number? False Suppose 441 + 1327 = 8g. Is g prime? False Suppose -5p = 58 + 112. Suppose 0y = -2y + 110. Let j = y + p. Is j composite? True Suppose 2l + u = -378, 2u - 772 = 4l - 0u. Let y = l - -395. Suppose y = 2z + 34. Is z prime? False Suppose -w - 4w + 4825 = 0. Is w a prime number? False Let f(y) = 7y2 + 2y - 4. Is f(-3) a prime number? True Suppose l = 6m - 3m - 210, -4m = -l - 279. Suppose 0 = 3i - m + 27. Is i a prime number? False Let p = 53 - -9. Is p composite? True Suppose 19n - 5826 = 13n. Is n composite? False Let h(p) be the first derivative of -3p4/4 + p3/3 + 7p*2/2 + 6p + 3. Is h(-5) prime? False Let x be (-6 - -6) + -52. Let t = 13 + x. Suppose -tc + 105 = -0c. Is c a composite number? True Suppose -10 - 1 = -p. Let t(i) = i3 - 8i*2 - 16i + 16. Is t(p) a prime number? False Is ((-3586)/(-88))/(1/4) a composite number? False Let y(o) = -o*3 - 3o*2 - 3o - 3. Let c be 6/4(-2)/3. Let k be (1/c - 3)/1. Is y(k) composite? True Suppose -2l = 4a + 732, -l - a - 3a - 362 = 0. Suppose -5o + 0o = 795. Let j = o - l. Is j a composite number? False Let l = -3 - -5. Suppose 0 = 2t + lv - 43 + 5, -t + 7 = 4v. Is t prime? True Let c(z) = z3 + 11z*2 - 7z - 13. Let j be c(-11). Let s = j + -26. Is s prime? False Let g = 368 + -81. Is g a composite number? True Is ((-1323)/(-4) - 0) + 24/96 prime? True Let b(x) = 121x3 - x + 1. Is b(1) a composite number? True Let o = 3 + -3. Suppose 3x - 15 = -o. Suppose -2i = -xi + 27. Is i a prime number? False Let g(k) be the first derivative of 9k2/2 + 5k + 2. Let z be g(-6). Let a = z + 70. Is a composite? True Suppose 2j - 3j - 11 = 0. Let n(s) = s*3 + 12s*2 + 6s - 2. Is n(j) a prime number? True Suppose 30 = 2g + 5o, 4o - 10 = 2g - 4. Suppose -9 = -3j + 3n, -7 - g = -4j + 2n. Suppose -f + 99 = -4z, -jz = 4f - 2z - 379. Is f composite? True Let o be 1 - -3 - (0 + 1). Suppose -45 - 120 = -oy. Is y a composite number? True Suppose 33 = 3p - 390. Is p prime? False Let m(o) = o*2 + 10o + 8. Let s be m(-6). Let c be (2 + -2)-1 + -10. Let u = c - s. Is u a prime number? False Suppose -2k = 2m + 3m - 875, k - 524 = -3m. Let g = m - 114. Suppose 2c = 3f - 117, 3c - 80 = -4f + g. Is f composite? False Let q = 8 - 12. Is (-1124)/(-12) - q/(-6) composite? True Let o(n) = -n3 - 8n*2 - 9n - 5. Let t be o(-7). Is (7/2)/(t/126) a composite number? True Suppose 597 + 544 = k. Suppose 4u - k = -249. Is u prime? True Is -4(-2 - (-3267)/(-12)) prime? True Let c(w) = -5w3 + 6w + 3. Let r be c(-4). Suppose -5t - u = -388, -2t - 2t + 3u = -r. Is t composite? True Is 487(-3)/12-4 prime? True Let p(t) = 4t2 - 9t + 13. Is p(6) a prime number? True Let k(r) = 57r3 + 3r*2 - 6r + 7. Is k(3) composite? True Let s = -195 + 481. Suppose 3w + 2p = 5w - 196, 0 = -3w - 5p + s. Is w composite? False Suppose 3d + 85 = 25. Let o be (16/10)/(4/d). Let z = 18 + o. Is z composite? True Let d(f) be the second derivative of -f*5/20 + 3f*4/4 + 7f*3/6 - 17f*2/2 - f. Is d(8) composite? False Let n(c) = 5c*3 + 2c2 - 1. Let w(x) = x2 - 4x - 3. Let v be w(5). Let o be n(v). Let g = 116 - o. Is g prime? False Let v(a) = a + 50. Let w(o) = o3 - 4o2. Let f be w(4). Let i be v(f). Let y = 3 + i. Is y a composite number? False Let y(x) = -x2 + 31x + 11. Is y(16) a prime number? True Let o = 4 + -2. Let f(h) = 6h*o + 0h - 5h - 2h + 0h. Is f(-5) composite? True Suppose 0 = u + 38 - 151. Suppose 3a = 109 + u. Suppose -5m + 430 = 5h, h = -m + 4h + a. Is m a prime number? True Is 0 + 15702/4 prime? False Suppose j + 0j = -1517. Let l = -882 - j. Is l prime? False Suppose -5g + 1912 = 447. Is g a prime number? True Suppose 0 = h + 2m - 280 - 57, 1 = m. Suppose h = j + 4j. Is j prime? True Suppose 8s - 1457 - 4631 = 0. Is s a prime number? True Suppose -z + 2159 = u, u + 2z + 1261 = 3418. Is u a prime number? True Is (-7819)/(-35) + (-4)/10 prime? True Suppose 0 = k + 3 - 61. Is k a composite number? True Let l(z) = 6z - 5. Let g(w) = -w + 1. Suppose 3x - 2c = -8 + 1, c - 21 = 5x. Let j be g(x). Is l(j) a prime number? True Let j(y) be the second derivative of 3y4/4 + y3/6 + y2/2 + y. Let l be (4/(-2) + 1)1. Is j(l) composite? True Let a = 186 - 318. Let c = a - -185. Is c prime? True Let g(k) = -13k + 2 + 3k*2 + 3k*2 + 9k - k2. Is g(3) a prime number? False Let p(r) = r3 - 2r2 + 2. Let t be p(2). Suppose tq - 463 - 67 = 0. Is q prime? False Let h = 43 + 12. Let v = 24 + h. Let n = v + -46. Is n prime? False Suppose 4x - s = s + 352, 0 = 5x + s - 426. Suppose w = 3w - x. Is w a prime number? True Let d = -888 + 1997. Is d prime? True Let y = -34 + 72. Let b = y - 3. Is b composite? True Let t(h) = h2 - 9h - 9. Is t(13) prime? True Let o(t) = -2t3 - 3t*2 + 2. Let m be o(-2). Let y be -2 + 2 - m/(-3). Is y/7 + (-795)/(-35) a prime number? True Let n(b) = -b + 10. Let p be n(8). Let a(t) = 3t*2 + 5t - pt + 5 - 2t*2. Is a(-6) a prime number? True Is 2/5 + (-4734)/(-90) prime? True Let b be (1-1)/1 + -369. Let i = 2 - -8. Is (i/(-25))/(2/b) composite? True Let z be (-7)/(14/20)-1. Let c = z + 37. Is c composite? False Let k = -129 + 292. Is k composite? False Let g(b) = b3 + 14b*2 + 20b - 4. Is g(-11) a prime number? True Suppose -l - 12 = -3l + 2c, 0 = 5l + 5c - 50. Let u(p) = -p*3 + 9p*2 - 8p - 5. Let o be u(l). Let w = 1 - o. Is w a composite number? True Let o(v) = v*3 + 6v*2 - 3v - 2. Let n be o(-6). Suppose 0 = -3t - 9, 5a = 2t - 27 + 338. Let z = a + n. Is z composite? True Let v(y) = 21y*2 - 4y + 4. Is v(5) a composite number? False Suppose -4n = -l - 13640, -5n + 10207 = -2n + 5l. Is n a composite number? True Suppose -46 = 5d - 2a, a + 31 - 2 = -4d. Let l be 3/(-12) + (-178)/d. Suppose -22 = -2o + 4q, 0 = 2o - 0q + 3q - l. Is o prime? True Suppose 0q = -2q + 564. Let b = q + -104. Suppose -2l - b = -4l. Is l composite? False Let s be (-1)/(11/(-11)). Let r be (38/5)/(2/10). Let o = r + s. Is o a composite number? True Let b(g) = g3 + 0g*3 - 5 + 0g + 4g2 - 5g - 2g3. Let s be b(6). Let v = s - -292. Is v a prime number? False Suppose -5h = -h - 536. Let t = -64 + h. Suppose 0 = -3l + 7l + 2v - 80, 4l - 3*v = t. Is l composite? False	{ "pile_set_name": "DM Mathematics" }
s = 0.2 + -1.2. Let m = s - -4. Let t = -1 + 1. Which is the closest to 1? (a) -5 (b) t (c) m b Let n = 18.89 - 19. Let w = 3.89 - n. Let p be 2 - 1 - 4/(-1). Which is the closest to -2/3? (a) w (b) p (c) -3/5 c Let j = -36 - -36. What is the closest to -0.17 in -1/6, j, 5? -1/6 Let b = 90 + -47. Let x = b - 29. Let p = x - 9. What is the nearest to 4 in p, -1/2, -2? p Let p = 3 + -2.9. What is the nearest to 2 in 5, p, 0.5? 0.5 Let g = 33 + -30. Which is the closest to 1? (a) -3 (b) g (c) 0.5 c Suppose 0i = -2i. Let g = -0.27 - 0.03. Let z = 2 + 2. Which is the closest to i? (a) g (b) -1/6 (c) z b Let s be 2/10 + 273/(-15). Let h be (6/28)/(s/(-24)). Which is the nearest to h? (a) 4 (b) 2 (c) -1/7 c Let g = 13 - 13.5. What is the nearest to -0.3 in g, 2/9, 5? g Let s = 4.15 - 0.15. Let k be (0 - 1)(-2)/18. What is the nearest to 1/2 in 2, s, k? k Let x = -4 - -3. Let g = -0.09 + -0.01. Which is the nearest to x? (a) 0.3 (b) 1/5 (c) g c Suppose 4j - 4h = 16, 6j - 5 = j + 2h. Let u = 1.4 - 0.4. Which is the closest to j? (a) 1/3 (b) -7 (c) u a Let p be (3/(-12) + 0)/((-21)/12). What is the closest to -1 in -8, 5/4, p? p Let r = -34 - -18. Let j = r - -16. Let l = -2 + 2.5. Which is the nearest to j? (a) 1/5 (b) 0 (c) l b Let q = 4.2 - 0.2. Let p = 100 - 107.3. Let d = 7 + p. Which is the closest to -1? (a) 2/3 (b) d (c) q b Let r = 0.278 + 4.612. Let m = 0.11 + r. Let f = 524/9 - 58. Which is the nearest to 0.1? (a) f (b) -1 (c) m a Let u = -25 - -28. Let w = 21 - 101/5. Which is the closest to 0? (a) w (b) 4 (c) u a Let n = 19 + -16. Which is the closest to 0.3? (a) -1/8 (b) -3 (c) n a Let p = -2 - -1. Let q = -3 + p. Let f = -3 - -4. What is the nearest to 0 in f, -6/7, q? -6/7 Let s = -33 - -30. Which is the closest to 1? (a) -3/5 (b) -5 (c) s a Suppose 0 = -q + 8 + 2. Suppose -3d + 5d = -q. Suppose 3k - 2k - 17 = 5u, 2u + 3k = 0. Which is the closest to 2/5? (a) d (b) -2 (c) u b Let u = -101/3 + 34. Let y be (-138)/(-33) - 2/11. Let p be 24/20(-2)/4. What is the closest to u in -4, p, y? p Let q = 27/7 + -29/7. Let a = -0.1 - 0.2. What is the closest to q in a, 0.1, -5? a Let g = 118 - 113.3. Let a = g - 5. Suppose 3p + 6 = -m + 22, 5m = -3p + 32. What is the nearest to 0.1 in -2/5, p, a? a Let g(h) = h - 2. Let r be g(7). Let u be ((-80)/(-30))/(2/(-3)). Which is the closest to -6? (a) u (b) 2/3 (c) r a Let k = 9.7 + -10. Which is the nearest to -1/4? (a) 3 (b) -4 (c) k c Let m = -0.6 + 0.1. Let v = 22 + -17. What is the nearest to -1 in v, m, 2? m Let y = 74 - 79. What is the nearest to 0 in 2, 0.1, y? 0.1 Let r be (40/(-15))/((-8)/12). Which is the nearest to -1/2? (a) -2/11 (b) -2 (c) r a Let n = 7.1 + -7. Let o = n + -0.6. Which is the closest to 0.1? (a) 0 (b) o (c) -0.1 a Let s = -13 - -141/11. What is the nearest to -1/2 in -1/7, s, -0.5? -0.5 Let m(v) = 2v + 8. Let s be m(-6). Let l be (-25)/(-30)s/(-5). What is the nearest to l in -0.2, -0.4, 5? -0.2 Let n = -5.8 + 6. Which is the nearest to n? (a) 0 (b) 2 (c) 3 a Let f(d) = 4 + 5d2 - 2d*2 - 4d*2 - 5d. Let c be f(-6). Suppose -3i - 3 = -3x - 6i, 1 = 5x + 4i. What is the closest to -2/5 in x, c, -5? c Let w = 15 + -29/2. Let o = 6 - 5.97. Let k = o + -0.03. What is the closest to w in k, 4, 1/3? 1/3 Let j = -4 + 3. Let i = 13/8 + -179/120. Which is the closest to -0.1? (a) 3 (b) j (c) i c Let t = -1 - 0.3. Let n = 2.2 + t. Which is the nearest to -0.1? (a) n (b) -2 (c) -0.5 c Let g(z) = 16z*2 - z. Let j be g(1). Let k be -2j/12 + 2. Let w = -9 - -5. Which is the nearest to 1? (a) k (b) -2 (c) w a Let g = 7.14 + -0.14. Let s = 11 - g. Let r = s - 4.3. What is the nearest to 0.1 in -4, r, -2/3? r Let k = -3/37 - -101/333. Which is the closest to 2/7? (a) -1/4 (b) k (c) 0.3 c Let s = 3.3 - 4. Let j = s - -1. Let h = 14 - 14.1. Which is the closest to h? (a) 2/13 (b) -0.3 (c) j b Let v = -5 - -16/3. Let i = -6/11 + 41/55. Which is the closest to v? (a) 2 (b) i (c) 0.4 c Let z = 0.31 - 0.01. Let o = -0.2 - -0.1. Which is the nearest to o? (a) -3/5 (b) z (c) 4 b Suppose 2c = 8c + 6. Let x = 0 + 2. What is the nearest to -1 in x, -5, c? c Let x = 4 + 7. Let o be 4 + -1 - x/3. What is the closest to 2/7 in o, 2/7, -1? 2/7 Let l = 0 + -1. Let w = -5.08 - -0.08. Let q = w + 4.9. Which is the nearest to q? (a) 5 (b) l (c) 3 b Let h = -30.7 - -31. What is the nearest to -0.1 in 0.4, 0.5, h? h Let n be (1/2)/((-7)/42). Which is the closest to 0.1? (a) n (b) 0.3 (c) -1/3 b Let z = -43 - -39.2. Let m = 1.2 - z. Let j = -6 + m. Which is the nearest to j? (a) -4 (b) 3 (c) 0.2 c Let v = -15.91 + 0.91. What is the closest to 0 in 0.5, v, 2? 0.5 Suppose -4w + 31 = -3y, 0w + 2w - 5y - 33 = 0. What is the closest to 2 in w, 1/3, -5? 1/3 Let k(s) = 4s + 3. Let h be k(-2). Let p = -4 - h. What is the nearest to 1/3 in p, -2/5, 2? p Let f = -24 + 23.9. Which is the closest to -1/3? (a) f (b) -5 (c) 2/17 a Let d = -9.6 - -8. Let v = 1.7 + d. What is the closest to v in -0.1, 5, -4? -0.1 Let u = -4 - -7. Let n = 2125/7 - 303. What is the nearest to 1/3 in n, 3/5, u? n Let u = 1.5 - 1.4. Let k = 0.3 + -0.1. Let s = -0.8 - k. Which is the closest to 0? (a) s (b) 0.5 (c) u c Let n = 64/3 + -21. Let t = 50 + -51. What is the closest to t in 0.5, n, 0.2? 0.2 Suppose 0 = z + 4z. Suppose z = d - 4q + 24, 4d + q + 1 = -10. Let s = -5 + 4. Which is the closest to s? (a) -1 (b) 1 (c) d a Let h = 17 - 17. What is the closest to h in -0.5, -0.05, -5/4? -0.05 Let s be 10/2 - 34/6. Which is the closest to s? (a) 1/4 (b) 11 (c) 1 a Let y be 3/208655/198. Let i = y - 51/8. What is the nearest to -2/3 in i, -0.2, 2/5? -0.2 Let r = 1.1 - 0.8. Let p be 1/(-2) - (-3)/2. Suppose -3 + p = s. What is the closest to -2 in 0.2, s, r? s Suppose u + 7 = -3g + 29, 4g = 2u + 36. Let h(n) = n2 + n - 7. Let j be h(0). Let m be 14/g(-3)/j. Which is the closest to 1? (a) -5 (b) m (c) 3 b Let d = -1/84 - 5/21. What is the closest to -2 in 0, d, -2? -2 Let f = 0.002 + -3.002. What is the closest to 1 in 2, f, -3/13? 2 Let f = -51 + 355/7. Let c = 17 - 12.5. Let j = c + -0.5. What is the nearest to -0.1 in f, j, 2/13? f Let t = 0.3 + 0.7. Let o(k) = -k + 8. Suppose -m = -4h - 8, 3h = m + 8h + 1. Let f be o(m). Which is the nearest to t? (a) 2 (b) f (c) 5 a Let i(s) = s2 + 4s - 9. Let z be i(-5). Which is the closest to -4? (a) 1 (b) z (c) 0 b Let s = 6/59 + -107/472. Which is the nearest to 1.8? (a) -0.5 (b) s (c) -2 b Suppose -p - 4 = -3p. Let h = -1 + p. Let f = 17.8 + -18. Which is the closest to f? (a) h (b) -5 (c) 2 a Let m be -32 + 2 + 1. Let c be 4(-1 + 0/(-2)). Let a = 102 + -920/9. What is the nearest to 0.1 in a, c, m? a Let b be (12/42)/((-3)/(-42)-6). What is the closest to b in -1/2, 2/55, 1/3? -1/2 Let p be (-2)/(1 - 17)-6. Let j = 4.92 + -4.72. What is the closest to 0.2 in j, -5, p? j Let y = -2/23 + -32/161. Let t = 0.7 - 0.3. Which is the closest to y? (a) -5 (b) t (c) 0.3 c Suppose -2m + n = 2, -5n + 16 = -3m - m. Which is the closest to 0.1? (a) -4 (b) 0 (c) m b Let g = 72 + -72.4. Which is the closest to -4/7? (a) 5 (b) 4 (c) g c Let c = -7.9 - 0.1. Let k = c - -12. What is the closest to 1 in -0.3, -0.4, k? -0.3 Let t = 2.2 - 2. Let v = -0.3 + t. Let o = 0 - v. Which is the nearest to -0.1? (a) o (b) -2 (c) 3 a Let m = 10 + -12. Let w = -13 - -15. Which is the nearest to w? (a) -0.3 (b) 1/4 (c) m b Let r be ((-6)/(-25))/((-14)/(-35)). Which is the closest to 2/5? (a) 1/3 (b) r (c) -3 a Let v = 17.9 - 16.9. Let s = 0.9 - 1. Which is the closest to s? (a) v (b) 0.4 (c) -0.1 c Let y = -0.1 - 0.1. Let x = 1.2 + y. Let o = 0 - x. Which is the closest to o? (a) 1/12 (b) -3/4 (c) 0 b Let b = 22 + -19.9. Let i = -2 + b. What is the closest to i in -2, 1/6, -4? 1/6 Let q = 45/7 + -43/7. Let s = 11937 + -5502955/461. Let f = s - 932/2305. What is the closest to q in -5, f, 3/4? 3/4 Let w = -26/3 - -9. Suppose -3m + 28 = 2g - 7g, -2m = 5*g + 23. Let n = m - 5. Which is the nearest to 1? (a) w (b) n (c) 1/7 a Let k = 0.05 - 0.55. Let s = 10 - 10. Which is the closest to s? (a) k (b) -0.3 (c) -1/3 b Let x = 0.038 - 1.	{ "pile_set_name": "DM Mathematics" }
s divided by (-18)/h - 3/(-15). 0 Let m(a) = -9 + a - 3a2 + 2a*2 + 5a + 2. Let t be m(6). Let z = t - -8. Calculate the remainder when z is divided by 1. 0 Suppose 2a - 8 = -2, -5g + 2a + 119 = 0. Suppose -6c + g = -c. What is the remainder when c is divided by (2/(-3))/((-4)/18)? 2 Let r(z) be the second derivative of -z*3/6 - 3z. Calculate the remainder when 2 is divided by r(-1). 0 What is the remainder when 128 is divided by 5/(-15) + (-79)/(-3)? 24 Let f = 43 + -26. Suppose 4y + 56 = 8. Let m = -3 - y. What is the remainder when f is divided by m? 8 Suppose -a = -11 - 20. What is the remainder when a is divided by 11? 9 Suppose 0 = -4u + u + 12. What is the remainder when 11 is divided by (-225)/(-36) - 1/u? 5 Let h(b) = -b + 18. Let n be -73/3 - 2. Let w = 0 - n. Calculate the remainder when 26 is divided by h(w). 8 Suppose 2y - 39 = -4n + 31, 0 = 5n + 3y - 90. Calculate the remainder when 58 is divided by n. 13 Let h = 238 + -228. Let p(l) = l2 - 3l - 2. Calculate the remainder when p(-4) is divided by h. 6 Suppose -8q + 4q + 72 = 0. Calculate the remainder when 70 is divided by q. 16 Suppose 9u - 5z - 36 = 7u, 2u - z - 20 = 0. What is the remainder when (-6)/21 - (-424)/14 is divided by u? 6 Let x be (-40)/30(-3)/(-2). Let t = x + 6. What is the remainder when t is divided by 3? 1 Suppose 9l - 14l + 75 = 0. What is the remainder when 29 is divided by l? 14 Let k(s) = -s2 + 13s + 2. Let z be k(7). Suppose 12 = -4i + z. Calculate the remainder when 30 is divided by i. 6 Suppose -58 = -3s - 2c, -5c = -s - 3s + 108. Let a(d) = 3d*2 - 10d + 9. What is the remainder when a(7) is divided by s? 20 Let v = -124 + 170. Calculate the remainder when v is divided by 13. 7 Suppose 4u = 3c - 14, -u = -2c + 3c - 14. Let j(p) = p*3 - 11p*2 + 10p + 6. What is the remainder when j(c) is divided by 3? 0 Suppose -2i + 6q - 18 = 2q, 25 = -3i + 4q. Let x(g) = -2g + 9. Calculate the remainder when x(i) is divided by 6. 5 Suppose -2p + 72 = p. Calculate the remainder when (3/2)/(2/p) is divided by 5. 3 Let d = -13 - -33. What is the remainder when 76 is divided by d? 16 Suppose 5s = z - 0s - 16, 4z + 3s + 5 = 0. Suppose 57 - z = 4g. Calculate the remainder when (50/(-15))/((-1)/12) is divided by g. 12 Suppose -38 = -y + 31. Calculate the remainder when y is divided by (-33)/55 - (-93)/5. 15 Let l = 246 - 172. What is the remainder when l is divided by 11? 8 Suppose 5f = 5h + 480, -5f = -h - h - 483. What is the remainder when f is divided by 10? 7 Let w be (-18)/424/(-18). Let n be 4/w - 13/(-3). Suppose nb - 21 = 69. Calculate the remainder when 35 is divided by b. 17 Suppose 0 = -3p - 5z + 90, -4 - 58 = -2p - 4z. Let j(x) = 5x - 8. Calculate the remainder when p is divided by j(3). 4 Suppose -5a + 260 = g + 111, -20 = -4a. Calculate the remainder when g/16 + (-3)/4 is divided by 3. 1 Suppose 4b + 206 = 2g, 3b - 4g + 142 = -0b. Let m = 84 + b. Suppose -3c = -r + m, 0r - 3c + 12 = r. Calculate the remainder when 61 is divided by r. 19 Suppose 2d + 54 = -5l, -2l - 5d - 18 = -3d. Let o = l + 20. Calculate the remainder when 21 is divided by o. 5 Let f = 3 + 0. Suppose -fp = -5y - 7 + 126, -4y - 3p = -106. What is the remainder when y is divided by 6/15 - (-43)/5? 7 What is the remainder when 15 is divided by 5/(-3)90/(-75)? 1 Let z(n) = -n - 11. Let d be z(-8). Let l = d - -18. Calculate the remainder when 28 is divided by l. 13 Let r(p) = 11p2 - 2p + 1. Calculate the remainder when 39 is divided by r(1). 9 Let g(b) = 16b - 4. Suppose -6i + 15 = -i. Calculate the remainder when g(i) is divided by 15. 14 Let p(o) = -o*3 - 3o*2 + 1. Suppose 0 = -5l, -268 = -2v - 2v - 5l. What is the remainder when v is divided by p(-4)? 16 Let q(f) = 4f + 4 - 5 - 1 - 4. Calculate the remainder when 63 is divided by q(7). 19 Let k = 30 - 17. Let s = k + -6. Calculate the remainder when 13 is divided by s. 6 Suppose -446 + 26 = -3o. Let k = o - 96. What is the remainder when k is divided by 23? 21 Suppose r + 89 = -2r - 2s, 0 = 4r - 4s + 132. Let w = 56 + r. Calculate the remainder when w is divided by (-11)/((-2)/26). 12 Suppose c - 4c - 4x + 26 = 0, 3c = -5x + 31. Suppose 0 = cm - 8, 4n = 7n + 4m - 61. What is the remainder when n is divided by 8? 7 Suppose 0 = -3j + q + 251, -3j - 5q + 341 = j. Calculate the remainder when j is divided by 29. 26 Let m = 7 - -8. Calculate the remainder when m is divided by (-12)/(26/(-8)). 7 Suppose -4r - 5 + 21 = 0. Suppose -5i + 26 = -r. Calculate the remainder when 17 is divided by i. 5 Let k(u) = u + 3. Let t be k(3). Let b be 66/(-14) - t/21. Let n = 14 + b. What is the remainder when 26 is divided by n? 8 Let v = -122 - -200. Calculate the remainder when v is divided by 27. 24 Let o(u) = -u*3 + 6u*2 + 8u + 5. Let k be o(7). Suppose -3q = -6q + k. What is the remainder when 13 is divided by q? 1 Suppose 0 = l + 41 - 118. Calculate the remainder when l is divided by 40. 37 Let m(p) = -p*3 + 8p*2 - 5p - 9. Let i = -9 - -16. Let r be m(i). Suppose -14 = 5w + 11, c + rw + 22 = 0. What is the remainder when c is divided by 2? 1 Let y be ((-3)/(-9))/((-3)/(-18)). Let o = 7 + -4. Suppose oa - 3t - 26 = yt, -t = 5a - 6. Calculate the remainder when 5 is divided by a. 1 Suppose -4y - 117 + 14 = 5g, 0 = 3y + 2g + 72. Let l = 45 + y. What is the remainder when l is divided by 8? 7 Let x(v) = 12v - 101. Calculate the remainder when 150 is divided by x(10). 17 Suppose 0 = -37v + 41v - 76. What is the remainder when 75 is divided by v? 18 Suppose 0 = -0n - n. Let o = 5 + n. What is the remainder when 14 is divided by o? 4 Let h be 0 + 2 + (-1 - 4). Suppose 3n - 20 - 13 = 0. Let d = h + n. What is the remainder when 15 is divided by d? 7 Let m(b) = 2b - 5. Let a be m(4). Let o = -22 - -22. Suppose o = 4r - ar - 21. What is the remainder when r is divided by 11? 10 What is the remainder when (-2)/((-4)/22) + 2 + -4 is divided by 5? 4 Let n = -232 - -342. What is the remainder when n is divided by 7? 5 Suppose 4 + 2 = g + 5b, 4b = 4g - 48. Let y = g - 6. Let h = 22 - 19. Calculate the remainder when y is divided by h. 2 What is the remainder when 4 is divided by (-3)/(-9)(4 - 1)? 0 Let j(y) = -y + 10. Calculate the remainder when -11 - (3 - (12 + -3)) is divided by j(7). 2 Suppose -5 = -2h + 2f - 5f, 0 = h - 5f + 4. What is the remainder when (-4)/(-3)(h - -8) is divided by 7? 5 Let b be ((-9)/(-4))/((-2)/(-56)). Suppose i + b = d + 2i, -3d = -i - 185. What is the remainder when d is divided by 21? 20 Let l be (-1)/(2(-2)/12). Suppose -v = -s + 35, -s - lv + 35 = -2v. Suppose s = -0t + t. What is the remainder when t is divided by 18? 17 Suppose 2w - 6w + 80 = 0. What is the remainder when 37 is divided by w? 17 Let v(a) = 16a3 + a2 + a. Let n be v(-1). Suppose -w - 2w + 33 = 0. What is the remainder when ((-21)/4)/(4/n) is divided by w? 10 Let l(k) = k*2 - 5k - 2. Let u be l(-4). Let y = u + -20. What is the remainder when 53 is divided by y? 11 Let m(r) = r*2 + 3r. Let k be m(3). Let j be ((-4)/3)/((-1)/6). Let b = j + k. Calculate the remainder when b is divided by 9. 8 What is the remainder when (-6)/((-72)/(-140))-3 is divided by 13? 9 Let y(u) = u3 - 9u*2 + 10u - 6. Let q be y(8). Calculate the remainder when (-2 + 5)/(3/q) is divided by 20/3 - 6/9. 4 Suppose -8 = -19o + 15o. Let j(c) = 2c - 6. Calculate the remainder when j(4) is divided by o. 0 Suppose -4x - x = -25. Suppose -4w - 22 = -m, -x = 3w - 2w. Suppose 0 = -3n + mn + 14. Calculate the remainder when n is divided by 5. 4 Suppose 0 = 4q - 31 - 45. Let g be 7/4 + (-8)/(-32). What is the remainder when q is divided by 0 - -6 - (-3 + g)? 5 Let z(k) = -26k - 1. Calculate the remainder when 99 is divided by z(-1). 24 Suppose 3 = 2k - 5. Suppose -ka + 4y + 200 = 0, -a - 2a + 140 = -5y. What is the remainder when a is divided by 19? 17 Let i = -9 - -11. Calculate the remainder when 38 is divided by (10/(-8))/(i/(-32)). 18 Suppose -5p = -j + 1 - 12, -3p - 15 = -3j. Suppose m - 2m + 3b - 69 = 0, 3b + 159 = -3m. Let h = 81 + m. Calculate the remainder when h is divided by j. 6 Suppose -5c -	{ "pile_set_name": "DM Mathematics" }
))/vv)(-14)(v/((vv11)/v)v)33 assuming v is positive. v151 Simplify (((((hh(1/5))/h)/h)(-3/25)h(2/7)/h8)(-28))(5/3) assuming h is positive. h*(8888/25) Simplify ((r(rr(-4)/rr)/rr)10(rr(2/29))/(rr*(-2/9)r))(-8) assuming r is positive. r(43240/261) Simplify ((((u/u(-2/21))/(u/(u/u(-2/29))))/((u*(-7)/u)/(uu/u*5u)))(2/49))(31/4) assuming u is positive. u*(135253/59682) Simplify (((n/(nnn/n(-9)))/(n/n36))(-6/19))(-19) assuming n is positive. n144 Simplify ((ff/(ff/f(-42)f)f)(-12)(f/(f/(fff*12))ff)/f(-1/41))(20/3) assuming f is positive. f(142140/41) Simplify ((o34/o)33o*(-16)o/o*(3/11)o)(20/9) assuming o is positive. o(236440/99) Simplify (w*20w*(3/19)ww(-25)ww(-16/3))11 assuming w is positive. w(-5126/57) Simplify (i0/i)(-44)/((i(-3)/i)/(i(ii4i)/i))(i(4/3)/(ii(-11)))(1/4) assuming i is positive. i(341/6) Simplify (t(-1/8)/t(1/2))33(tt*(-1)t(t(-3)t)/t)8 assuming t is positive. t(-293/8) Simplify (((l/((ll(-3/13))/l))(1/40))(2/35))(-27) assuming l is positive. l(-108/2275) Simplify (((p(-1/5)pp(-2/27))(-25))(-1/14))(-25/4) assuming p is positive. p(-875/108) Simplify ((p0)(-10)/(((p/(p(p/(p*(-3)p))/pppp))/p)/p(-1/4)))/(((p(-2)/p)/p)(-2/79)/(((pp(-2))/p)/p)(-28)) assuming p is positive. p(28329/316) Simplify ((q(-2)/(q/(((q*(1/2)q)/qq)/q)))/(qqq0/qq(-1)))(-3/2) assuming q is positive. q(15/4) Simplify ((n(-1/3))(-38))(-39)(n0n)(-2/83)/(n(3/2)nn(-7)) assuming n is positive. n(-81261/166) Simplify ((ff(2/3))(-3/49))(-7)(ff(-2/3))(-1)((f/(f*(-2/5)f))/ffff)(2/21) assuming f is positive. f(64/105) Simplify v11v*(-36)(vvv*(-8/5))/vv/(v*(-13)v)v assuming v is positive. v(-58/5) Simplify ((j/(j(-13)j)j)/(jjj(-2/5)))4/((j(2/7))(-9)(j/j8)/j5) assuming j is positive. j(2246/35) Simplify (u(2/13)(u5u)/uu(u*(2/27)u)/u(-2/25))(1/39) assuming u is positive. u(64127/342225) Simplify ((j(-2/3))(-12))16(j2)(-28)(jj/(j/(jjj(-1/4)))j)/j(2/5) assuming j is positive. j(1507/20) Simplify (s*(-4/5)(ssss(-6))/s)(-37)(ss2/s)/(s/(s/(((s(-2)/ss)/s)/s)s))(s/s0)27 assuming s is positive. s(1058/5) Simplify (((m8/m)(-4/13))33)(-19) assuming m is positive. m(17556/13) Simplify (n/n*(-20)n/n(-40))/((n/(n(13/5)n))/nn/((nn37/n)/n)) assuming n is positive. n(503/5) Simplify (((b11/(bb(1/10)))/(b3)30)(9/2))(-22) assuming b is positive. b(79299/10) Simplify (i/i*26i*(5/3)i(iii/(i/(i/(ii(-3/5)))))/i(1/9))(-6/7) assuming i is positive. i(1786/105) Simplify (((t0)(-19)(t(-2/7)/t)(-10/7))(1/93))(-23/3) assuming t is positive. t(-230/1519) Simplify (q1)(-44)(q(-1))(34/3)(q(-2/7)/q)(2/43)(qq(1/3))/(qq3) assuming q is positive. q(-17476/301) Simplify (j(-1))(-2/17)/(j/j*(1/5)j*3)(((jj(-2)jjj)/j)/(j*(-2)j))/(j/(j/(j/j(-1))))(1/15) assuming j is positive. j(-463/255) Simplify ((s(2/7)/s)*(-39)s(-1)/(s(-2/13)/s))/((s(2/3))22)17 assuming s is positive. s(-60421/273) Simplify ((b(-2/5)/b)8)*(-6/7)((b(-1))(-6))(2/7) assuming b is positive. b(396/35) Simplify hh1h*(1/10)/hh*(-1)h(h/((hh(((hh*0)/hhh)/h)/h)/h))/hh((hh/(h*(-2/5)h))/(h3/h))33 assuming h is positive. h(-187/10) Simplify ((x/x7)38/((x/(x5/x))/x)4)(-3/2) assuming x is positive. x318 Simplify ((t(-1/41)ttt/(t(-19)t))/(t/(((t/(tt13t)t)/t)/t)t/t(8/5)))(1/10) assuming t is positive. t(1143/2050) Simplify (j(-6/7)j/(j/((jjj(1/3))/j)))/(j(-1))(-3/11)j/j*(5/4)j(jj*(1/2)j)/j(j(-1))(5/11) assuming j is positive. j(1847/924) Simplify ((j0)(-30/11)j*(-2/5)j(-5))(-1/36) assuming j is positive. j*(3/20) Simplify ((vv/v*(-4)v)*(-4/7)(v*(3/10)v)/(v(-1/6)/v))(-15) assuming v is positive. v23 Simplify ((l(-1/7)/ll(-2/5))/(l2/ll/(l/(lll*(-2/15)l)l)))/(((l(2/21)/l)/(l/l2))/(l/(l(-1/5)/ll)l/l5)) assuming l is positive. l(-767/105) Simplify ((x/(xx/(x39/x)))15/(x(-3/8)/x47))39 assuming x is positive. x(187941/8) Simplify ((z*(2/5)zz(-2)/zz)/(z*(1/4)/(zz*(-1/7))))/(zzz(-2/7)zzz5)(-2/17) assuming z is positive. z*(351/340) Simplify ((t(t*(-6)/t)/tt*(1/2))/(tt(2/5))(-11))/((tt(4/5)/ttt(-3/8)t)/(t2/t(-3))) assuming t is positive. t(459/40) Simplify ((j(-3)jj/((jj0)/j))/((jj*(1/6)j)/(jj/j(-1/4))))/((j0)(3/29)/((jj*1j)/j(-8))) assuming j is positive. j(121/12) Simplify (((v/v*(-3/2))/v)/(v(vv/(vvv(5/4)/v))/vv))/(v(v/(v(2/5)v))/v)*31(v/v*(1/7)v1/v)(-4/15) assuming v is positive. v(1809/140) Simplify (a(-46)/a38)/(a(-27))(-43) assuming a is positive. a(-1245) Simplify (y*21y*(25/2)y)/(y*(27/5)/yyy/(yy(-2/65))) assuming y is positive. y(3779/130) Simplify i*(3/2)ii(1/10)(i/(i/(ii(-4)iiiii)))/i*3(i/(i*6i)i4/i)/(ii*3i(-1)) assuming i is positive. i(-22/5) Simplify ((v(-7)/(v(-1/6)/v))/(v/v*(-4/3)v/v*(-2/5)))/((vv*(2/5)v)(18/11)/(v(-3/11)/(((vv(-2/9))/v)/v))) assuming v is positive. v(-1129/90) Simplify ((m(-2/9)/mmm(-4/7)m*7mm(-1/6))(5/2))20 assuming m is positive. m(22175/63) Simplify s/(s/(ssss*(-2/3)))s(ss*(-9)s)/s(s(15/4))19 assuming s is positive. s(799/12) Simplify ((z/((z/(zz(2/3)))/z))(-28)/(z(2/9)/z(-1/4)))/(z(-1/4)/z(-1/3)z(2/3)z*(-6)zz) assuming z is positive. z(-647/9) Simplify (l(5/4)/(l/(ll*(-6)ll)l))/((l*(-2/7)/l)/((lll/l(-6)l)/l))((l1/l)39)(-21) assuming l is positive. l(183/28) Simplify (((ff*(-24))/(f/(f/((f(ff/(fff(-19/2)ff))/f)/f))ff))/(f/(ff*(4/3)fff)f/(f(4/13)f)))(39/4) assuming f is positive. f(-2095/8) Simplify ((t(-4))21(t0/t)(-4))(-21) assuming t is positive. t1680 Simplify (((c/(c/(c(4/7)/c)))/c(2/23))/(((c/(c/(c(ccc/(c/(c*(-2)c)))/c)))/c)/cc)(-3))(-2/61) assuming c is positive. c(166/9821) Simplify ((s(-2)/s)(-8/9))(-7)/((s/((ss(1/3))/s))/s(1/4)((s(-1)/s)/s)(-48)) assuming s is positive. s(-1957/12) Simplify ((q(-1/3))(-2/7)q*7q(-4))/((q/q1)(2/75))17 assuming q is positive. q*(65/21) Simplify ((((b(b/(bb(-2/11)))/bb)/b)/b(1/18))/(b(4/3)(b(-2/5)/b)/b))(-24) assuming b is positive. b(-4724/165) Simplify (tt/(t*4tt)(t/(tt5tt))/t(t(1/4))(-18))/((t/(t*4tt))/(t(-1/5)/t)(tt(2/5)/t)(-9/2)) assuming t is positive. t(-109/10) Simplify (v(-2/11)v3)/(v(1/4)/v*(-2/35))((vv(5/2)v)/v)/v*5v(v/(v(1/6)/v)v)/vv2 assuming v is positive. v(27001/4620) Simplify (aaa1)26/((a/a1a)/a)*(-1/15)a(a/(a(-5)/a))/aa/(a/(a/a*6a))(a(-1)/a)(-3/2) assuming a is positive. a84 Simplify ((k/k(1/12))/k(3/7)(k*(1/2)k)*30)/((kk*(2/7)k)*(-21)/(((kk(-1))/k)/(k/((k/k(-5))/k)))) assuming k is positive. k(8105/84) Simplify h(-18)h/(hhh/(h(-2/69)/hh))(h/h(-34))(-1/3) assuming h is positive. h(-729/23) Simplify ((c(1/3)cc/c4)/((cc*(2/7)c)/c*3))/((cc*(3/7)c)/c(-2/23))(15/2) assuming c is positive. c*(-2735/138) Simplify (l/(l(l/(l*(2/3)/l)l)/l))(-28)/(l(-1))*(-20)(l(-1/2))33(l(-2)l)/l(-4) assuming l is positive. l(23/6) Simplify (l/l(-2))(2/109)/(l/(l/(ll/l(-1)l)))*(1/4)((ll(2/9)/lll)/lll)2/((l/((l/(ll(-2/5)))/l))/l)(3/16) assuming l is positive. l*(422771/78480) Simplify ((ff/f9)(1/3)(f(4/13)/f)/f(3/7))(-2/25) assuming f is positive. f(1886/6825) Simplify (((j(3/2)/((j/(j(-3)j))/j))/(((jj8)/j)/j(-5)))36)(-1) assuming j is positive. j486 Simplify z(-2/7)/zz*(-1/5)(((z/(zz((zz/(zzz(5/3)/zz))/zz)/zz))/zz)/z)/(z(-2)z)((((z(-5)/z)/z)/z)/(z(3/4)/z))10 assuming z is positive. z(-16447/210) Simplify (d/(d(-1/13)/d)d)/(dd/(d/d3)dddd)(dd/((d/d(2/5))/dd)d)(2/5)(d(2/3)/d)(-19)*	{ "pile_set_name": "DM Mathematics" }
)/((tt/(tt*1t))(-36/7))(-26) assuming t is positive. t*(2840/21) Simplify (www(-2/3)(w*4/w)/w(w/w*(-4/7))/w(w/w4)/w)/((w(-2/7))*(-20)w(-7)/w(-7)) assuming w is positive. w*(-122/21) Simplify (((mm*0/mm)*(-22)m(-9)/m(-1/9))44)46 assuming m is positive. m*(-562672/9) Simplify (gg*(-3/7)/gggg*14(gg/g(-2/23))/g4)(32/7) assuming g is positive. g(70368/1127) Simplify (((f/f(-1/11))/f)/(ff*(-2)/f)(ff1)(-23/5))/(f(1/4)/(f/(f/(f2f)ff))(f(-2/7))(-32)) assuming f is positive. f(-23873/1540) Simplify ((y2/y)(-7/13))(-3/7)/((yy(-1))(-32)(yy*8y)/(yy4y)) assuming y is positive. y*(-49/13) Simplify (f(f*(-3)f)/f)/(ff(-2/11))f*(2/3)f*(1/4)(f*(7/2)ff(-3))/((f/(f/f(-5/7)fff))/f(1/12)) assuming f is positive. f(523/154) Simplify (m(-28/9)/(m(2/133)/m)(m(-13))5)49 assuming m is positive. m(-562450/171) Simplify (m38m(-44))/(m20)(29/4) assuming m is positive. m(-151) Simplify q*12q/(q(q/(q/(q(2/25)q)q))/qqq)(q(-24))(-46) assuming q is positive. q(27873/25) Simplify (y/y(-35)yy*(-3/2)yy)/((yyy/y(-1/16))/y(-8/7)) assuming y is positive. y(3729/112) Simplify ((x(-2)/(x/(xx*12xx))x*(1/2)/(xxx/(xxx(4/5))))(-3))(-2/129) assuming x is positive. x(123/215) Simplify r/(r/(r(-3)/r)r)rr*(-3)rrr*6r/(r/r*(-2))((r/(r*(5/6)/r))/(rr(3/5)))/(r0/rrr)(-3/22) assuming r is positive. r(-214/165) Simplify n*33/(nn/n*(-38))(n/(n/n(-12)))/((n25n)/n) assuming n is positive. n(-44) Simplify (((vvvv*(-2/3)vvv)48/(v/((v/(v/v1))/v)v(-6)))(-5/2))(1/11) assuming v is positive. v(-1305/22) Simplify (((ww*20/ww)/(w*(-4/3)w))/(ww/((w/(ww*20w))/w)w8))(-3/37) assuming w is positive. w(32/37) Simplify ((nn*(-6))/(nn(-2/3)))33(n/((n6n)/nn))/((nn/(n/(n(n(n*(-1/3)/n)/n)/n)n))/n)(n4/n)/((n(-1/6)/n)/n) assuming n is positive. n(-349/2) Simplify (c(-7)c*(12/5)(c(-2/15))(1/27))(-1/4) assuming c is positive. c(373/324) Simplify ((o*8oo(-1/3))/(o(-1/3)oo)(-46))/((o(-1/3))(-19/3)/(o0)(-14)) assuming o is positive. o(749/9) Simplify (g(-2/27)g8)(-18)(g(-3/10)/(g((g(g/g(-5))/g)/g)/g))(-4/15) assuming g is positive. g(-10594/75) Simplify (((d/(dd/((d/d*(-6))/dd)d))/d17)/(d3/d(-19)))(8/7) assuming d is positive. d(-272/7) Simplify ((((m/m(2/7))(-2))(-2/39))(-2/21))(-5) assuming m is positive. m(200/5733) Simplify (((i/i(-1/3))/i)(-5/4))(-2/7)/(((ii/(ii6i))/i)/i*(-1/7)i*(1/4)i2) assuming i is positive. i(397/84) Simplify (((f/(fff/(f/f10)))/f)/f(1/2)f(-1/31)/(f(2/17)/f))23 assuming f is positive. f(-282417/1054) Simplify ((m(4/7)/m)/(m/m(-5/3)m))*(-2/3)(m(-1))(5/13)/((m*(2/7)/m)/mm(-1)) assuming m is positive. m(592/117) Simplify (z*(-1)zz(-3/4))/(zz((zzz(1/4))/z)/zz)*(-3/16)((z/z(-8))/z)/(z(-1/3)z)(z*5z)/zz3 assuming z is positive. z(2917/192) Simplify (p(-15)/(p/(pp*(-2/7)p)))*(-1/7)/((pppp/(pp7)p)/(p*(-1/6)/p)(pp/p(-2))/p(-9)) assuming p is positive. p(-2683/294) Simplify (x35x*30(xx9/x)1)(-11) assuming x is positive. x(-814) Simplify ((g(-34)(g(g/(g/(gggg*(-13)gg)))/g)/g)(-13))(9/13) assuming g is positive. g387 Simplify ((v(-1/5))(-7)/(vv*(-2/9)/vv)(2/31))40 assuming v is positive. v*(15064/279) Simplify ((ooo(-4/7)(o/(oo(-24)/o))/o)/(o(-5/6)/o)(-8/9))(4/29) assuming o is positive. o(17992/5481) Simplify (pp*6pp6/p)0pp(-3/7)p/p*(-2/5)(pp(-2/7)p)(-1) assuming p is positive. p(9/35) Simplify (ggg*(-14))/(g/((g/(gg*(6/13)))/g))(ggg*4)/(gg/(gg(-1/5))) assuming g is positive. g(-628/65) Simplify ((z(2/11))(1/3)/(z(-4)/((zz*(-1/10)z)/z)))19 assuming z is positive. z(31103/330) Simplify ((w*28ww(-1/11))/(w(1/33))24)(1/21) assuming w is positive. w(310/231) Simplify (m(3/10)/m(1/8)(m*(7/4)/m)/mm/(mmm(-18/11)))49 assuming m is positive. m*(12103/440) Simplify ((ddd(-2/19))/((d(1/3)/d)/d))(5/4)(d*(1/5)d*(1/3))/((d(d/d*(-1/2)dd)/d)/d)(6/13) assuming d is positive. d(56779/14820) Simplify (n((n/(nn/(nn*(2/7)n)))/n)/n)*(-7/8)n(10/17)/(n(-23/3)n) assuming n is positive. n(1429/204) Simplify uu*(-4)uu(1/7)u(-1/6)/(u(-3/7)u)(u*(1/9)uu(-3/5))(-14) assuming u is positive. u(-6143/630) Simplify ((f2)45f*(1/16)/((fff(-1/6))/fff))(-20) assuming f is positive. f(-20935/12) Simplify ((n(n(n(-15)/n)/n)/nn)*(-42)/(nn*(-30)nn(-1)))(-2/127) assuming n is positive. n(-1318/127) Simplify (l(-9/2)/l(-4/7)(l12)(-2/11))(-6/23) assuming l is positive. l(2823/1771) Simplify ((f*(-13)f(-1/3))/(f(15/4)ff(-12)))(5/8) assuming f is positive. f(-365/96) Simplify (u14u(-2/13))(1/24)(u*0u6)/(u/u(-2/9)uu/(uu(-4/3))u) assuming u is positive. u*(473/234) Simplify (((zzz(-3/5)zz)/(z(2/11)/z))/(zzz/z(4/3)zzzz/(z/((zz*(-4))/zz))))/(z/z*(-2/7)z(zz(-6))/z)(2/125) assuming z is positive. z(75391/28875) Simplify (q/q20qq)*(-16)q*(-22)/(qqq22) assuming q is positive. q226 Simplify (((y/(y/(y(-2/3)y)))*(-45/7)/((yy*(-3/2)y)/yyyy(4/5)/y))(-19))31 assuming y is positive. y(141949/70) Simplify ((oo(1/7))(4/9)/(o/(oo30o)ooo/o(5/11)))(23/5) assuming o is positive. o(461633/3465) Simplify ((ii/i(1/3))(-20))(-1/13)/(((i(-5)/i)/i)/ii3/i(i(2/7))12) assuming i is positive. i*(1402/273) Simplify (uuu(-1)uu/(u/(u/((u(1/4)/u)/u)u)u))50(u/((u/(u*(-1/2)u))/u)u)(-35)/(u(-1/12)/(u(2/9)u)) assuming u is positive. u(5447/36) Simplify (d7d3d)*(-18)/((dd5/d)/d(-1/6)(d/(d/(d/(dd/d*(-1/2)))d))(-46)) assuming d is positive. d(-1909/6) Simplify (((qq/((q0/q)/qq))*32/((qq/(q/q*(-1/3))q)/((qq9/qq)/q)))(-1))32 assuming q is positive. q(-9920/3) Simplify ((((p/p1p)/pp)*9(p(-1/8)/p)/p(2/3))49)(-38) assuming p is positive. p(-161063/12) Simplify (((d(-1/3)/d)16)(-17))(-11/5) assuming d is positive. d(-11968/15) Simplify (i*2/((i/(i((i*4ii)/i)/i))/ii))*(-2/7)/((i/(i/(ii(-1))))(1/25)/(((i/(i/i0))/i)/i6)) assuming i is positive. i(-61/7) Simplify (((m/(m/m(-1/3)m)m)/mm)/mm)*(-2/15)/(mm(-2/5))33(m(-4/9)/m(-1/3))/((m/m(-2))/mm)(-9) assuming m is positive. m(107/15) Simplify (c*(-2/7)/cc/(((c/(cc/((c(-6)/c)/c)))/c)/c))/(((c(1/3)c)/c)/(c*(-2)/c))c(-6/5)/c(-7)(c(-2/3))(-8) assuming c is positive. c(648/35) Simplify ((bb/(b(-3)/b))/(b/(b(2/7)b))(b*(2/9)b)/bb6)/((b/((b(-3)b)/b))/bbbb(1/4)(b0)5) assuming b is positive. b(1829/252) Simplify s(-3)/s*(5/3)s4/(s(-3)/s)((s5/s)/s9)(-9/8) assuming s is positive. s(215/24) Simplify (((t(-2/3)/(tttt/t*(-1/4)t))/(t(2/5)/(t(-7)t)))(-1/21))(4/17) assuming t is positive. t(739/5355) Simplify ((((u(-4/9)/u)/u)/(((uu(-7))/u)/u))/(u(-8)/uu(-5)))31 assuming u is positive. u(5456/9) Simplify ((((r/(r/r(-1/20)))/r)/r24)/(r6/(r(-1/28)r)))(-1/36) assuming r is positive. r(117/140) Simplify ((s(3/4)/s2)/((ss(3/2))/(s(1/2)s)))(-7/3) assuming s is positive. s(21/4) Simplify (s*(-4)s*29ss(9/8)sss/((sss*(-25))/s)s)(-1/11) assuming s is positive. s(-441/88) Simplify (((hh18h)/(hh/h12hh))/(h8h(2/21)))(-1/5) assuming h is positive. h(-418/105) Simplify (((f0)(-2/77)/(f(-1/6)/f(-2/9)))(4/9))(3/43) assuming f is positive. f(-2/1161) Simplify (((q*(-2/5)qq(-6))40)(-24))5 assuming q is positive. q25920 Simplify ((k/k(8/9))/(k/k(2/5))((kk(4/3)kk)/k)(3/2))38 assuming k is positive. k(7714/45) Simplify (d(-12)dd/(d(-1/3)/d))(4/13)/((d(-1/5))(-30))(1/4) assuming d is positive. d(-25/6) Simplify ((kk*(7/4)kkkk)/kk(-1/7))(2/5)(k(2/7)k)*(2/13)(kk(-1/4)k)(-21/8) assuming k is positive. k(-3134	{ "pile_set_name": "DM Mathematics" }
2 + o + 2. Let r be w(6). Suppose 2d + 5h = 6d - 28, r = -2h. Sort -1, z, d in descending order. d, z, -1 Let h be 0 + (-2 - 0) + 7. Let w = -6 + 4. Put w, h, -5 in descending order. h, w, -5 Let h = -7 - -3. Let d = -244/357 + 2/119. Let n = 0 + 3. Put n, d, h in decreasing order. n, d, h Suppose -4k + 14 = -2c, -3c - 2k - 4 = -23. Sort c, -4, 2. -4, 2, c Suppose 4q = 7q. Sort -9, q, 5. -9, q, 5 Let l = 2.6 - -1.4. Let d = -1.89 - -1.8. Let b = d + -3.91. Sort b, -2/5, l. b, -2/5, l Let k(z) = z*2 + 19z - 5. Let p be k(-19). Let b(w) = w*2 - 8w + 4. Let l be b(6). Sort p, 5, l in increasing order. l, p, 5 Suppose 2q = -5 + 17. Suppose -o - 2o = -q. Suppose 0 = 5m - 2z - 28, -o = -2m - 3z - 6. Put m, -1, 1 in increasing order. -1, 1, m Let k be 72/(-84) - (-2 + 5 - 4). Let b = 9 - 6. Put -3, k, b in increasing order. -3, k, b Let w = -1.5 + 1.9. Sort 1/3, w, -4. -4, 1/3, w Let g = 650/21 - 92/3. Put -2/7, g, -2, -4 in increasing order. -4, -2, -2/7, g Suppose 5i - 13 + 8 = 0. Suppose -3z - 9 = -0z. Put -2, i, z in descending order. i, -2, z Let g(s) be the second derivative of s3/3 + 4s*2 - 6s. Let h be g(-7). Put -5, 4, h in decreasing order. 4, -5, h Let s = -57.7 - -58. Put 4, -6/5, s in ascending order. -6/5, s, 4 Suppose 4g = -4q - 20, g + 2q + 9 = 3. Let l be (-11)/(-14) - g/(-14). Put 4, l, -0.04 in decreasing order. 4, l, -0.04 Let b(t) = t3 + 9t*2 - 11t - 12. Let h be b(-10). Sort h, -0.1, 15. h, -0.1, 15 Suppose 3g = -4y + 7, -5g = 5y - g - 9. Put -2, y, -1 in descending order. y, -1, -2 Let t = 81 + -1055/13. Let s(k) = -k*3 + 14k*2 + 14k + 17. Let r be s(15). Let m = -1.2 + 1. Put r, m, t in descending order. r, t, m Let s = -3 - 0. Let f = -3 - s. Let z = -0.3 + f. Sort -1, z, 2/19 in descending order. 2/19, z, -1 Let v be (-4 - ((-4 - 0) + 0))/(-2). Sort -3, -1, 1, v in descending order. 1, v, -1, -3 Let l = -1 + 2. Let i = 2/115 - 48/115. Put l, i, 0.4 in descending order. l, 0.4, i Let i be (6/(-7))/((-1)/(-7)). Let g be ((-6)/42)/(-3). Sort i, -2, g in descending order. g, -2, i Let v be -1 - (-2 - (-1594606)/11). Let c = -145264 - v. Let u = c - -301. Put u, 0, -2 in descending order. u, 0, -2 Let t = 15 + -14. Sort t, -1/5, 0.4, 2/3 in descending order. t, 2/3, 0.4, -1/5 Suppose 5 = -f + 2r + 8, f = r. Let i = 5.66 + -0.56. Let z = 0.1 - i. Sort z, 5, f in ascending order. z, f, 5 Let a = -8.8 - -9.3. Sort a, 8, 3, -0.4 in ascending order. -0.4, a, 3, 8 Let c(j) = -1 + j*2 - 2j - 8j2 + 5j*2 - 6j*3. Let o be 2/6 - 8/6. Let s be c(o). Sort s, -0.4, -1/4. -0.4, -1/4, s Let m = 57 - 55. Put -5, m, -1, 6 in descending order. 6, m, -1, -5 Let q = -13 - -14. Put -4, q, 4 in decreasing order. 4, q, -4 Let a = -51/2 - -26. Let p be 264/(-12) + (-1 - 2). Let v = p - -21. Put v, 0.4, a in descending order. a, 0.4, v Suppose 5x = -5r - 30, 3x + 7 = -r - 7. Let q be (2 + 1)(-5)/(-3). Suppose 2a - 5 = q, 5h = -a + 30. Sort -5, x, h. -5, x, h Let p = -3 + 5. Let s(n) = 3n - 2. Let v be s(2). Put 1, p, v in decreasing order. v, p, 1 Let p(l) = l*3 - 6l*2 + 4l + 4. Let g be p(5). Let t = -12.5 + 12. Sort g, -4, t in decreasing order. t, g, -4 Let p = 5.3 + -6. Let j = p - -1. Let u = 5 - 2. Put j, u, 2 in decreasing order. u, 2, j Let u = -11 + 16. Suppose 5c + u = -5p, -c + p = -3c. Put 3, c, -1 in descending order. 3, c, -1 Let m be (-1 - (-12)/8)/1. Let q be (-2)/12(-27)/(-18). Sort -0.5, m, q. -0.5, q, m Let z be (-4 + 5)(5 - 0). Suppose -s + 0s - zu = -21, 0 = s - 4u + 15. Suppose -l - 5f - 6 = 2l, 3f + 6 = -3l. Put s, l, -5 in descending order. s, l, -5 Let q be ((-3)/(-2))/(9/12). Let j be q/11 + (-57)/11. Let h = 11 - 10. Sort 0, j, h in decreasing order. h, 0, j Let u be 21/27 + 4/18. Let w(a) = -a*3 - 4a*2 + 4a - 2. Let s be w(-5). Put u, 4, s in decreasing order. 4, s, u Let k = 13 - 15. Let d(h) = h3 - h - 3. Let o be d(0). Sort k, o, 2 in increasing order. o, k, 2 Let j be 7 - 2 - (11 - 10). Put -2, j, -1, -3 in descending order. j, -1, -2, -3 Let b(i) be the third derivative of i5/60 + 5i4/24 + i2. Let u be b(-6). Suppose -t - 25 = -ut. Put t, -1, 0 in descending order. t, 0, -1 Let b = -12 - -11.99. Let c = b + -0.09. Put c, 0, -4 in increasing order. -4, c, 0 Let y be 2/(-7) + 90/21. Suppose 0 = -9t - 2t + 22. Put t, -0.4, y in increasing order. -0.4, t, y Let l = 0.21 + 0.29. Sort 3, 5, l in decreasing order. 5, 3, l Let h = 0.2 - 2.2. Sort h, 0.2, -2/5 in ascending order. h, -2/5, 0.2 Suppose 5a + 25 = -5d + a, -5 = -a. Let v be 3(-6)/d - 4. Sort v, 1, 2 in increasing order. v, 1, 2 Let a = 8 - 4. Suppose 2r - g = 3, 7 - 3 = ar - 4g. Let q be (-2)/2(-5 + 2). Put r, 4, q in increasing order. r, q, 4 Let o = 1 + -6. Suppose 4y + 0y + 8 = 0. Put 4, o, y in decreasing order. 4, y, o Let a be -3 + 0 - (3 + 19/(-3)). Sort 3, 0.3, -2, a in increasing order. -2, 0.3, a, 3 Let j = -2 + 2.01. Let s = j - 4.01. Let z = -2.83 + -0.17. Put s, 1, z in decreasing order. 1, z, s Let a = -20 - -26. Let m(t) = t - 5. Let x be m(a). Sort x, -2, -4 in descending order. x, -2, -4 Let l be 10/35 - 74/14. Let k = 7 + -3. Let s(h) = h3 + 6h*2 + h + 4. Let y be s(-6). Put y, k, l in increasing order. l, y, k Let v = -0.6 + 0.9. Let k = -218 - -2183/10. Let z = k + 31/30. Put 4, z, v in descending order. 4, z, v Let t = 23 + -162/7. Let c(o) = 99o + 1. Let g be c(1). Let i be (-4)/2 + g/30. Sort 2, i, t. t, i, 2 Suppose -1 = 3q - 7. Suppose -qs - 8 + 2 = 0. Sort s, 4, 3. s, 3, 4 Suppose 5j + 4p = -0j + 10, 6 = 3j + 3p. Put j, 0, 1 in ascending order. 0, 1, j Let j = -14.966 + -0.034. Sort 1/2, -0.3, j in decreasing order. 1/2, -0.3, j Suppose 0 = -2p + 3g - 6, -3p + 2g - 2 = 2. Suppose q = 5q - 8. Sort -5, q, p. -5, p, q Suppose -5t = -2r - 24, 5t - 7 - 3 = -5r. Put 5, t, -5, 1 in descending order. 5, t, 1, -5 Let a be (-5)/2016/(-18). Sort a, 3/7, -0.5 in descending order. 3/7, a, -0.5 Let h = -2 + -2. Let t be (-4)/22 - 150/22. Let p = 10 + t. Sort p, -3, h in decreasing order. p, -3, h Suppose 2t = -3y + 2, 2y - t = -2y - 12. Let o = 2 - 6. Sort o, 0.5, y in descending order. 0.5, y, o Let g be 3 - 2/416. Let f = 5.1 + -5. Sort 0, f, g in ascending order. g, 0, f Let k = -0.4 + 0.6. Let v = k - -0.2. Sort 4, 3, v in ascending order. v, 3, 4 Let y = -2 - -4. Let i = -5 + y. Let l = 17 + -16.7. Sort l, i, 4 in descending order. 4, l, i Suppose d + 2 = 2d. Put d, -3, -2 in descending order. d, -2, -3 Let l = -3/289 + 2625/2312. Put -2/5, -3, -2/19, l in decreasing order. l, -2/19, -2/5, -3 Suppose 5b = 3a + 6, -a - 4a = -b + 10. Sort a, -17, 4. -17, a, 4 Let o = -25/17 - -259/153. Let p = -11 - -10. Sort 0.5, o, p. p, o, 0.5 Let q = 312 + -310. Let c = 0.1 - -0.1. Put 1, q, c in ascending order. c, 1, q Let n = 16 + -11. Sort -2/15, 1, n in descending order. n, 1, -2/15 Let h = 311 + -310. Let c be 4/6 + 3/(-9). Put h, 0.06, c in decreasing order. h, c, 0.06 Suppose -2q + 48 = -0q. Let t be (-4)/(-6) - q/(-18). Put t, -2, 4 in decreasing order. 4, t, -2 Let z be 1/(-1(-3)/(-9)). Let r(v) = -v + 1. Let q(a) = a2 + 8. Let d(w) = -q(w) + 5r(w). Let y be d(z). Sort y, 4, 2 in ascending order. 2, y, 4 Let w = -13 + 2. Let p = -13 - w. Let g = 0.35 + 0.05. Put g, -1/2, p in decreasing order. g, -1/2, p Suppose -5m = g + 6, m - 3m = 3g + 5. Suppose -26k - 6 = -24k. Sort k, 4, m in decreasing order. 4, m, k Let i be (-1084)/6(-2)/(-8). Let r = -45 - i. Sort 0, r, 3 in decreasing order. 3, r, 0 Let f = 0.01 + -4.01. Put -1, 0.06, f in decreasing order. 0.06, -1, f Let p(w) = 0 - w + 8 - 2w + 4w. Let y be p(-8). Put y, 3, 1 in descending order. 3, 1, y Let t = -125 + 122. Let z(o) = o*2 - 3o + 4. Let f be z(3). Put t, f, -2 in decreasing order. f, -2, t Suppose -i = -0i - 5. Put i, -4, -1 in descending order. i, -1, -4 Let g = -8 + 10. Sort 0.3, g, -1/3 in ascending order. -1/3, 0.3, g Let l(o) = o2 - 9o + 8. Let k be l(8). Suppose k = 3t + 4n - 20, 5t + 10n = 5n + 30. Suppose y = 6y + 20. Put 2, y, t in descending order. t, 2, y Let o be ((-7)/(-28))/((-1)/10). Let f = -14 + 18. Sort 3/5, o, f in ascending order. o, 3/5, f Let f = 0.2 - -0.3. Let o = f + -0.5. Sort o, -3/5, 2/19 in decreasing ord	{ "pile_set_name": "DM Mathematics" }
2c = -10 for a. 2 Suppose 4z - 8 = 12, 4a + 2z + 62 = 0. Let q = a - -15. Let s be ((-3)/4)/(q/(-2))-16. Solve -h - s = -4f, -3f + 6f = 5h + 6 for f. 2 Let t(f) = f3 - 6f*2 - 52f + 286. Let g be t(5). Solve -4r - 3x = -g, 6r + 5 = 7r - 4x for r. 1 Let y be -5 + 9 - (3 + 0). Let r be (-4)/y + (-1 - (-2 + -3)). Solve -2n + 8 = -5p, -n + 3p + 0p + 5 = r for n. -1 Let q(f) = f2 - 10f + 9. Let n be q(9). Solve n = -u + 3h - 4h - 6, 0 = 5u - 4h - 6 for u. -2 Let o = -3622 - -3628. Solve -4b = -5p - 36 + 1, -33 = -3b + op for b. 5 Let b(p) = -p3 + p2 - p + 6. Let h be b(0). Let j be (-3 - 0) + 9 - 1h. Solve 2l - 3 = s, -2s - 7 = -5l - jl for l. 1 Let m be (-6)/9(-54)/4 - 2. Let s = -3 + 7. Suppose 0 = mo - so. Solve a = o, -5a = -2v + 7 + 1 for v. 4 Let f = 4062 - 4051. Solve 0m - 4t = -5m + f, 3m + 19 = -4t for m. -1 Suppose -12 = -5q - 3f, 1 - 9 = 5q - 2f. Suppose 4d = i - 0d - 25, q = -5i - 5d. Solve -k - 5 + 0 = -ia, 4a = 5k + 25 for k. -5 Let z(p) = 3p2 - 43p - 4. Let y be z(8). Let n = -151 - y. Solve 0 = -4d - 2f + 4, 5 = nd - 5f - 0 for d. 1 Let j(s) = 41s + 126. Let f be j(-3). Suppose 3c + 2 = -2l, 4l - 21 = -fc - 31. Solve -4t = -0t + r + 12, 10 = -t - cr for t. -2 Suppose -2g + 81 = f, 134 = -4g + 7g - f. Let y = g - 42. Let h be 32 - 6 - 5 - (1 - y). Solve -4p - 5 = -h, 5 = k + p for k. 1 Suppose 266i - 274i = -16. Solve -13h + 15 = -8h - 3r, ih - 6 = -4r for h. 3 Suppose -41 = -16q + 17 + 70. Solve 4x + 89f = 90f + 5, -x - 2f = -q for x. 2 Let j(b) = -b*3 + 47b*2 - 496b + 30. Let w be j(16). Solve -7p = 4k + 15, k - 5p - w = -0 for k. 5 Suppose 0 = -65m + 75m - 40. Solve -s = 3s + mb, 0 = -2s + 5b - 35 for s. -5 Let n = 19 - 27. Let y(i) = i2 + 4i - 4. Let x be y(n). Suppose 0 = -4h + 5a + 1, -3a + x = 4h + a. Solve -s - 1 = -2c + hc, -c + 5s = 6 for c. -1 Suppose -4t = 5d - 41, -4t - 5 = -5t + 4d. Let g be (-10)/(-3) + 3/t2. Let o be 3/g - (-3)/12. Solve -3r - 2c + 6c = -3, 2r - o = 3c for r. 5 Let a(k) be the first derivative of 7k3/3 + 25k*2/2 + 46k + 107. Let t be a(-2). Solve -4u + 3z - t = 0, -3z = 5u + 6 - 3 for u. -3 Let f = 9654 - 9634. Solve 2z - 5m = -28, 203m = 208m - f for z. -4 Let z(r) = 12r2 + 180r + 6. Let y be z(-15). Solve 4x - 14 = 5n, 0 = -4x + yn - 5n + 22 for x. 6 Suppose -4d + 13i - 11i + 162 = 0, -4d - 2i + 174 = 0. Let f be (d/(-56))/((-3)/16). Solve -fm + 4k = 4, -5k - 16 = m + m for m. -3 Let m(t) = -2t*3 - 17t*2 - 8t + 1. Suppose 4j - 14j = 0. Let b be j + (-228)/28 + 1/7. Let n be m(b). Solve -2c - 1 = -3y - 12, -5c - n = 2y for y. -3 Suppose 18 = 10b + 8. Suppose 3v - 3o + 8o + 23 = 0, -5v + o - b = 0. Let z be 0 + v + 2 + 2. Solve 5q + 0q + 5p - 20 = 0, -q = -zp + 4 for q. 2 Let v(t) = 7t - 130. Let m be v(20). Solve -4p = 5j - m, -9j - 8 = -5j for p. 5 Let x(f) = 2f3 - f2 - 2f - 609. Let h be x(0). Let m = h - -611. Solve 7d - 3d = -mi + 6, -13 = 3d - 2i for d. -1 Suppose -3x + 3m + 1671 = 0, 0x - 2m + 2246 = 4x. Let j = x - 538. Solve 0 = 5b + 2d + j, 0b + 2b + 3 = 5d for b. -4 Let g(c) = c - 1. Let z be g(3). Let o(p) = -10p - 10 - zp3 + 3 - 5 + p3 - 8p*2. Let t be o(-7). Solve f = -3x - t, -2x + 0f + 4f = 6 for x. -3 Let p = 72 + -68. Let a(b) = -2b*2 + 8b. Let c be a(p). Solve -3y + 4y = -5f - 1, c = -2f + y - 6 for f. -1 Suppose -2j - 30 = 2w, 0 = -w + 2w - 2j + 30. Let z be (-10)/w - 5/(-2). Let u be (-1 + 1)/(-2 + z) - 0. Solve -2 - 5 = -s + 2v, 4v + 4 = u for s. 5 Let l be 0 - 3(-1)/1. Let r(j) = -j2 + 7j - 2. Let x be r(6). Let h be 0/(-1)x/(-8). Solve h = s - 4m - 15, -lm = s + 6 for s. 3 Suppose 2u + 2l = -230, -u - 5l - 61 = 62. Let r = u + 113. Suppose 4a - 3 - 5 = r. Solve y = 2 + 3, -at = y - 9 for t. 2 Let q be (-33)/11 - (-5 + 0 + -2). Solve -qt + 6 = 5v, 4v + 6t - 5t = 7 for v. 2 Suppose -40a - 24a + 729 = 179a. Let s = 2 + 2. Suppose 2n - 4 = 4k, -sn + 5k + 11 = -0k. Solve 0 = 3r - ad + 2 + n, 0 = 5r - 2d + 19 for r. -5 Let r(b) = b3 + 42b*2 - 42b + 68. Suppose -602 = -48m + 62m. Let n be r(m). Solve -s + 6s - 4a = n, -3a = 5s - 25 for s. 5 Let v(r) = -r + 6. Suppose -2x - 3x = -50. Suppose -w = xw - 66. Let q be v(w). Solve o - 2o - 2k - 2 = q, -4o - 8 = k for o. -2 Let j(a) = a*3 - 4a*2 + 6a - 30. Let k be j(4). Let h be (2 + 8/k)6. Solve g - hi - 4 + 5 = 0, 2i + 17 = -3g for g. -5 Let c = -472 - -519. Let p = c + -22. Solve -3s + 23 = -4z, 0z + 5z - 3s + p = 0 for z. -2 Let y(r) = 2r*2 - 44r + 50. Let z be y(22). Let g = z + -47. Solve -3o - 5w + 13 = 30, -5o - 2w = g for o. 1 Suppose 15k + 1 = 61. Suppose n - 28 + 11 = -ks, -5n = -2s + 3. Let w be 1/((-10)/(-8) - n). Solve -2y = 3z - wy + 4, 5 = y for z. 2 Let m = 6958 - 6992. Suppose -f + 31 = 2z, 4z = 4f - 0z - 160. Let w = m + f. Solve -wn - 4p - 5 = 0, 0 = -5p + 4 - 14 for n. 1 Suppose -b = -89 + 87. Let x be (-3)/b(-13 + 175/15). Solve 0 = 4i - xq - 4, -2q - 2q = 2i - 2 for i. 1 Let v(u) = 20u + 45. Suppose -4b + 0b + 4 = 0, 4b = -n + 2. Let h be v(n). Let y be 4/(0 + (-2)/(-2)). Solve 5z + 15 = 5g, -yz + hg = -5z + 15 for z. 0 Let v(a) = -a2 - 129a - 496. Let n be v(-4). Solve s + 7 = u, ns = -u - 4 - 9 for s. -4 Let i = 3532 - 3527. Solve -4 = -2m + 4r, im + 8 = -22r + 23r for m. -2 Suppose 3o - 2y - 8 = 33, -2o + 23 = 3y. Suppose 2 - 12 = -2u. Suppose uv - o = 12. Solve 5t + 4p = -4, -vt + 2t - 2p = 4 for t. -4 Let g = 910 + -900. Solve 5t - 16 = 2p, -5p + 5 = 5t + g for t. 2 Suppose 0 = 4w + v - 14, -3v + 2v = -2. Let i be 10/(-195)1 - 5122/(-1014). Solve il = wn - 6n + 1, -5n = 15 for l. 2 Let g = 403 - 377. Suppose 11u - g = -4. Solve 5m + uh + 3h = 25, h + 1 = 5m for m. 1 Let g be (2 - 133/35)/(48/(-160)). Solve gr - r - 10 = -i, -5i = r + 22 for i. -5 Let q = 0 - 0. Let r(a) = -510a - 72926. Let w be r(-143). Solve -p + 1 - 10 = -z, -wz + 5p + 41 = q for z. 4 Let n = -192 + 213. Let u be 3/(-9) + 154/n. Solve -3 = c, 2f = -2f + c + u for f. 1 Let u be (-6)/27 - 56/(-9). Let y(q) be the third derivative of 5q*4/24 - 8q*3/3 - 347q*2. Let i be y(u). Solve -i = h + 4b + 1, -2b - 5 = h for h. 5 Suppose -16r + 144 - 112 = 0. Suppose rd - 5 + 1 = 0. Solve 0 = 3m - dw - w + 27, -4w = -2m - 28 for m. -4 Suppose 2c - 4g = -5g + 16, 2c - 14 = -2g. Let n = -11 - -28. Suppose -2m = -5j + 25, -4j + 2m = m - n. Solve -a = 5h - jh + 2, -5h + c = -a for h. 1 Let h be 3/(-2)(-7 - 5(-13)/(-15)). Solve -5m - 4f = -15, -5m = 16f - hf + 10 for m. -1 Let d(i) = i*3 + 24i*2 - 6i - 60. Let r be d(-24). Suppose 2m - 92 + r = -2x, -14 = -4m - 2x. Solve 0 = mw - 0t - 3t + 9, w = 4t for w. -4 Let i be (-2)/(-4) - 6/12. Suppose -173v + 174v = -27. Let c = -11 - v. Solve -k - o = -5k - c, i = 4k - 5o for k. -5 Suppose 2225 = 8l - 3l - 5d, 457 = l - 5d. Let j = 462 - l. Solve -j = 5o, 0o - 4 = -4z + 3o for z. -2 Let q(a) = -a2 - 6a + 15. Let f be q(-6). Suppose 0 = 2o - fo + 130. Solve -5n - 2x + o = -4n, 3n + x = 15 for n. 4 Let v(g) = 3g3 - 3. Let z be v(2). Suppose 0 = 4l - 21 + z. Solve l = -2s - d + 14, 2s - 22 = -2d - 4 for s. 5 Let c be 25 + 2/(-1). Let z be 1/50 + (18 - 18). Suppose z = 2m - 16 + c. Solve 5h - mt - 20 = 0, 4t - 4 = -4h + 12 for h. 4 Let b(k) = -31k + 191. Let f be b(6). Solve 0 = 4u - 4w, 3w = -0u - fu - 40 for u. -5 Suppose 0 = -4f + 5d - 7, -d - 3 = -5f + 4. Suppose 53935v - 53904v = 62. Solve fg + 3 = -vm + 3g, -4g = -20 for m. 1 Suppose -10 = 3s + 2s. Let p be 44/(-99) + 62/18. Let y be p + 1(4 + -1 + s). Solve -2g - 12 = 2x, 0 = -3x + 5x + yg + 22 for x. -1 Suppose 0 = 4z + 5f - 80, 4z = -4f + 79 - 3. Let o be (3 + -2)/(z/30). Solve -8 - 7 = 2q + 5r, 0 = -2q - or for q. 5 Let c(l) = l3 + 5l*2 - 2l + 28. Let t be c(-6). Suppose 2n - 8 = ti, -3n = -0i + 4i - 12. Solve i = -2b - 8, 3j - 7j = 5b + 12 for j. 2 Let y = -1 + 4. Suppose 5d = 3p + 17, -4d - yp + 6 = -13. Suppose 5s + z - 27 = 0, 5z + 4 = 7z. Solve -4a = -4o - 24	{ "pile_set_name": "DM Mathematics" }
3. 2p*2(2p + 1)/3 Let k(t) be the second derivative of 0 - 1/10t*5 + 1/3t*4 + 1/3t*3 - 6t - 2t2. Suppose k(d) = 0. Calculate d. -1, 1, 2 Let r(m) = m3 + 6m - 4m2 - 2m*3 - 5 - 2m. Let t be r(-5). Factor -2/7l4 + 2/7l*3 + 0l + t + 0l2. -2l*3(l - 1)/7 Let h = -121 + 487/4. Factor -3/4c2 + 3/4c - hc3 + 3/4c*4 + 0. 3c(c - 1)2(c + 1)/4 Let i be (-36)/(-10) + (-9)/15. Suppose -4r = -5r + i. Solve -18/5z - 2/5z*5 - 12/5z*4 - 32/5z*2 - 4/5 - 28/5z*r = 0. -2, -1 Let m(x) be the second derivative of 9x5/40 + x4 + 3x3/4 - 3x*2/2 - x. Suppose m(c) = 0. Calculate c. -2, -1, 1/3 Let q(c) be the first derivative of 0c*3 - 1/3c*2 + 1/6c*4 - 1/15c*5 + 1/3c - 5. What is y in q(y) = 0? -1, 1 Let k(p) be the second derivative of -p*4/60 - 2p*3/15 - 3p*2/10 + 11p. Let k(s) = 0. What is s? -3, -1 Let s(d) be the first derivative of d5/20 - d4/16 - d3/12 + d2/8 - 9. Suppose s(x) = 0. Calculate x. -1, 0, 1 Let x = 1 + 1. Let -2h3 + hx + 3h*3 - 6h + 6h = 0. Calculate h. -1, 0 Let t be (2 + (-36)/15)-5. Suppose -s - 2 = 2m, m - 9 = -s - ts. Factor 2/7h3 - 4/7h*s + 0 + 2/7h*5 + 0h*2 + 0h. 2h3(h - 1)2/7 Let m(f) be the third derivative of f5/80 - 5f4/16 + 25f*3/8 - 6f*2. Let m(q) = 0. What is q? 5 Suppose -1/3v*4 + 1/3v - 2/3v3 - 1/3 + 2/3v*2 + 1/3v5 = 0. What is v? -1, 1 Let r(t) = t2 - 4t + 5. Let j(z) = -1. Let u(s) = 10j(s) + 2r(s). Factor u(c). 2c(c - 4) Let k(u) = 3u*4 - 9u*3 - 25u*2 + 4u + 17. Let w(t) = -t4 - t3 - t*2 + 1. Let g(p) = -k(p) + 5w(p). Determine x so that g(x) = 0. -1, 1, 3/2 Let d(c) be the second derivative of -8c - 19/3c*4 + 0 + 8c*2 - 8/3c*3 - 14/5c*5 - 2/5c6. What is n in d(n) = 0? -2, -1, 1/3 Let m(w) be the third derivative of w9/2268 + w8/5040 - w3/6 + 3w2. Let u(v) be the first derivative of m(v). Solve u(r) = 0 for r. -1/4, 0 Let d(m) be the first derivative of -1/2m*2 + 1/9m*3 - 3 + 1/4m*4 - 1/3m. Suppose d(s) = 0. What is s? -1, -1/3, 1 Let t = -5 + 7. Suppose -tz2 + 132z + 147z5 - 84z*4 - 7z*3 - 40z*2 - 422z*3 - 24 = 0. What is z? -1, 2/7, 2 Let t(u) be the first derivative of 2/3u*2 - 4/9u*4 - u - 2 - 1/9u*3 - 1/6u5. Let c(g) be the first derivative of t(g). Find v, given that c(v) = 0. -1, 2/5 Let m(s) = s4 - s3 - s2 - s - 1. Let h(t) = -73t4 - 392t*3 - 29t*2 + 226t - 62. Let l(p) = -h(p) + 2m(p). Solve l(f) = 0. -5, -1, 2/5 Let j be (0 - 0)1/(-1). Find b, given that -2 + jb3 + 2b*3 - 3b4 + 2 + b2 = 0. -1/3, 0, 1 Let s(n) = n*2 - 2n - 5. Let x be ((-24)/9)/(4/(-6)). Let f be s(x). Factor 5z3 + 5z - z*f - 1 - 6z2 - z - z4. -(z - 1)*4 Let q(l) = 2l - 6. Let y be q(10). Let x be 1 + (-6)/y1. Solve 0o*2 - 4/7o*3 - 2/7 + xo + 2/7o4 = 0. -1, 1 Let g = 4 + -7/2. Let r(f) be the first derivative of 6/5f*5 + 0f + 1 + f*2 - gf*4 - 2f*3. Factor r(s). 2s(s - 1)(s + 1)(3s - 1) Suppose h = -3h - 5t + 15, 4h = 2t + 22. Suppose hc - 12 = c. Solve -4/9z*2 - 2/9z*c + 4/9 + 2/9z = 0. -2, -1, 1 Let r be (2 - (-35)/(-18))/(2/4). Let f(p) be the second derivative of -4p + 0 - rp*3 + 0p*2 + 1/36p*4. Factor f(k). k(k - 2)/3 Let y be (-46)/(-9) + (-3)/27. Let o(c) be the third derivative of 0cy + 3/8c*4 - 1/40c*6 - 5c*2 + 0 + 0c + c*3. Factor o(i). -3(i - 2)(i + 1)2 What is q in -20q*3 + 0q*2 - 16q - 32q2 - 5q*4 + 4q*4 - 3q4 = 0? -2, -1, 0 Let n(t) be the second derivative of t8/2520 - t7/420 + t6/270 + t*3/3 - 5t. Let a(f) be the second derivative of n(f). Factor a(u). 2u2(u - 2)(u - 1)/3 Let g be 31/3 + 2/3. Suppose 0 = -2c + g + 1. Solve a*3 + 0 - 2a*3 - 6a + ca2 - a3 + 2 = 0 for a. 1 Let g(b) be the first derivative of -21b*5/25 - 69b*4/20 - 27b*3/5 - 39b*2/10 - 6b/5 - 12. Find k, given that g(k) = 0. -1, -2/7 Let w be 119/70 + (-1)/(-2). Let i = w - 17/10. Let -3/2g3 - 1/2g*5 + 0g + 0 + ig2 + 3/2g4 = 0. What is g? 0, 1 Let z(t) be the first derivative of -t6/12 - t5/5 - t4/8 - 3. Factor z(u). -u*3(u + 1)*2/2 Suppose 2v - d + 19 - 24 = 0, 0 = -3v + d + 8. Factor -1/6j - 4/3jv - 7/6j*2 + 8/3j*4 + 0. j(j - 1)(4j + 1)2/6 Let l(j) be the first derivative of j7/210 + j6/50 + j5/50 - j4/30 - j3/10 - j*2/10 + 4j - 2. Let g(d) be the first derivative of l(d). Factor g(f). (f - 1)(f + 1)4/5 Let a(k) = -k2 - k. Suppose m = -4v + 2, -3m - v + 0 = -6. Let r(u) = u2. Let g(n) = mr(n) + a(n). Factor g(d). d(d - 1) Determine p so that -3p*2 - 1/2p*3 - 7/2p - 5/4 + 1/4p4 = 0. -1, 5 Suppose -8/9f - 2/3 - 2/9f2 = 0. What is f? -3, -1 Suppose -5p + 17 = -x, x - 3x + 14 = 2p. Solve -wx + w4 + 0w4 + 2w*3 = 0. -1, 0 Suppose -5f = -12f + 14. Determine d, given that -2/3d*4 + 0 - 2/3d*3 + 2/3d + 2/3df = 0. -1, 0, 1 Let j(k) be the third derivative of k6/160 + k5/80 - k4/32 - k3/8 + 7k*2. Solve j(q) = 0 for q. -1, 1 Let u(n) = -25n*4 - 5n*3 + 35n*2 + 10n + 5. Let x(c) = -13c4 - 3c*3 + 17c*2 + 5c + 2. Let m(r) = 2u(r) - 5x(r). Factor m(t). 5t(t - 1)(t + 1)(3t + 1) Suppose -3i + 4h = -6i + 14, 2h - 12 = -4i. Let b(q) = 2q + 1. Let s be b(1). Factor -4/3c*4 - 2/3c*2 + 0 + 0c - ics. -2c*2(c + 1)(2c + 1)/3 Let j be (64 + 2)/(-3 + 5). Suppose 3k + 21 = 5k + 3m, -5k - m = -j. Factor 0y2 - 3y*2 - k + 0 + 9y. -3(y - 2)(y - 1) Let l(k) = -k3 + k2 - k + 4. Let w be l(0). Let f be 2/8 + 7/w. Determine a so that -2a2 + 2a*f - 2a*4 + 0a*3 + 4a3 = 0. 0, 2 Let m be 6/((10/(-8))/5). Let h be 6/m + (-37)/(-4). Determine p so that p5 + 0p5 + hp*3 - 10p*3 = 0. -1, 0, 1 Let d(k) = 6k*4 - 8k*3 + 2k. Let n(y) = 7y4 - 9y3 - y2 + 3y. Let a(u) = -3d(u) + 2n(u). Factor a(z). -2z*2(z - 1)(2z - 1) Let x(k) = 3k4 - 11k*3 + 14k*2 - 4k + 4. Let t(p) = 21p4 - 78p*3 + 99p*2 - 27p + 27. Let a(y) = 4t(y) - 27x(y). Factor a(j). 3j2(j - 3)(j - 2) Let p(i) be the first derivative of -2 + 0i*3 - 1/8i*4 + 0i + 0i2 + 1/10i*5. Let p(z) = 0. What is z? 0, 1 Suppose 4d + 2c - 18 = 0, 2c + 8 + 37 = 5d. Let h = d + -5. Find f such that -hf + f2 - f2 + 2f2 = 0. 0, 1 Factor -27i*2 - 486i*3 - 3 - 8 - 1 + 84i. -3(2i + 1)(9i - 2)*2 Let d(f) be the first derivative of 0f*2 + 1 + 0f - 1/15f3. What is t in d(t) = 0? 0 Let r = 1 + -3. Let t be 5/((-20)/(-9)) + r. Factor 0i*2 + 0 - 1/4i*5 + 0i + ti4 + 0i3. -i4(i - 1)/4 Let z(h) = h + 2. Let p be z(-5). Let t be 0(1 - p/(-6)). Factor -2/5k2 + 0 + 2/5k*3 + tk. 2k2(k - 1)/5 Factor 0 - 4/5h4 + 8/5h*3 + 4/5h*2 - 8/5h. -4h(h - 2)(h - 1)(h + 1)/5 Let s(m) be the first derivative of 6 + 2m2 + 0m*3 + 8/3m - 1/3m4. Factor s(z). -4(z - 2)(z + 1)2/3 Let k(q) be the first derivative of -1/10q*4 + 4 - 4/9q*3 + 16/15q - 4/15q2. Find y, given that k(y) = 0. -2, 2/3 Suppose 10 = 4q - 2c, -1 = -q - 3c - 2. Let 6k3 - 4k*4 + qk - 4k2 + 0k*2 + 2k*4 - 2k*2 = 0. Calculate k. 0, 1 Suppose 0 = 4m + 2w - 5 - 1, -4m = w - 9. Let -1/2i + 0i2 + 0 + im + 0i4 - 1/2i*5 = 0. Calculate i. -1, 0, 1 Let d(z) be the first derivative of 3z*5/5 + 3z4/2 + z3 + 3. Factor d(f). 3f2(f + 1)*2 Let z be 6(1 + 6/(-18)). Determine b so that 10/3b - 4/3b*2 - 2/3b*5 + 8/3b*z - 8/3b*3 - 4/3 = 0. -1, 1, 2 Find i such that 6/5 - 9/5i + 0i2 + 3/5i3 = 0. -2, 1 Let x(q) be the second derivative of -q7/70 - 3q6/25 - 9q*5/50 + 4q*4/5 + 3q*3/2 - 27q2/5 + q + 1. Find y such that x(y) = 0. -3, -2, 1 Let k(t) be the first derivative of -t4/20 + 2t3/15 - t2/10 - 4. Suppose k(z) = 0. What is z? 0, 1 Let j(m) = -7m + 10. Let u be j(4). Let w be ((-9)/u)/((-10)/(-8)). Factor -4/5p2 + wp + 2/5p4 - 4/5p*3 + 2/5 + 2/5p*5. 2(p - 1)*2(p + 1)*3/5 Let a(r) be the first derivative of 1/3r*6 + 9r*4 + 0r*3 - 27r*2 + 0r - 16/5r5 - 1. Factor a(q). 2q(q - 3)3(q + 1) Let t(b) be the second derivative of -b*4/4 + 5b*3/2 - 6b*2 - 14b. Determine v, given that t(v) = 0. 1, 4 Let d(c	{ "pile_set_name": "DM Mathematics" }
104 for z. -4 Solve 165301g - 5i = 165304g - 6, 0 = -2g + 4i + 4 for g. 2 Solve 3v - 8i = -431i + 861, 0 = -3v - i + 17 for v. 5 Solve 85049 = 5f - 4b + 85035, 70 = 13f - 2b for f. 6 Solve -9h - 5h - 79 = -18h + 5a, -372 = -2h + 20a for h. -4 Solve -t - 21c + 45 = 3t, 40c - 36c + 8 = 64t - 62t - 0 for t. 6 Solve -3a - 2d - 170 = -198, -d + 8 = 0 for a. 4 Solve -4u = -3t - 65, -37 = -11u + 13t - 10t + 126 for u. 14 Solve -5r = -z + 26, -2r = -7462z + 7457z + 107 for z. 21 Solve 81g - 104g - 5m - 187 = 0, 11 - 54 = 3g - 4m for g. -9 Solve 0 = p, 16498r + 3p + 290 = 16556r for r. 5 Solve -15c + 122 = 63t - 11c, -3c = 5t - 7 for t. 2 Solve 3o + 2h + 2 = 0, -516h + 518h + 10 = -5o for o. -4 Solve w + 2412s = 1206s + 1208s - 5, 9w = 2s - 29 for w. -3 Solve 0 = 5n + 23b - 131, -2n - 7 + 30 = -5b - 1 for n. 17 Solve -7v + 12280n - 12276n = -51, 3v + 80n + 877 = 0 for v. 1 Solve -4z = -24p - 32, p - 2z - z + 2424 = -0z + 2417 for p. -1 Solve 334 = 4a - 13b, -13a = -29a + 14a - 2b - 54 for a. -1 Solve 2w = -2w - 8, -108w - 12 + 9 = -5f - 103w - 143 for f. -30 Solve 2w + 3i = 34, -5w + 167i - 41 = 164i for w. -1 Solve 0 = -6o + 3p - 8014 + 8233, -39 = -o + p for o. 34 Solve 5p - 3m = -0m - 7, -m = -4p - 14120 + 14113 for p. -2 Solve 465g = -5w - 469g + 931g + 31, 0 = 27w - 2g - 222 for w. 8 Solve 12z - 10z = -3v - 3 - 1, 3z + 13v = -0z + 11 for z. -5 Solve -5w - 8 = -2n, -5w = 9n + 14051 - 14142 for n. 9 Solve 2m + 20 = 5r, -r - 3407 = -2m - 6807 + 3404 for m. 5 Solve p + v + 4 = 4p, 2v + 5 + 9 = -3p + 6 for p. 0 Solve -14p = -4i + 7 + 10 + 5, 56p - 61p + 15 = 0 for i. 16 Solve 0 = 3u + 5n - 188, 3n - 104 = -3u - 25 + 35 for u. 1 Solve -30030r - 30 = -2z - 30029r, -4r - 67 = -34z + 105 for z. 2 Solve 15r - 22 = -z, 45r - 5r - 39r + 0z + 3z = 22 for r. 1 Solve -z + 2258h - 154 = 2233h, -5z + h = 26 for z. -4 Solve 4p - 363 + 257 = -10r + 8r, -5p = -5r - 170 for p. 29 Solve 6n - 9n - k - k = -0n - 90, -11n = 6k - 270 for n. 0 Solve -2u = 2i - 2189 + 2179, 3i - 8u + 5u + 105 = 9u for i. -3 Solve -5r = -2t - 78, 3r + 6t - 2t = -3 + 29 for r. 14 Solve -4u + 101 - 21 = 565020c - 565024c, 4c = u - 32 for u. 16 Solve -2f + 3j = -5, 89j + 8 = 9f + 88j - 27 for f. 4 Solve 563t = -23v + 564t + 364, 5t - 46 - 6 = -2v for v. 16 Solve -l - 6 = 5d + 18 - 1, -24l - 201 = -7d - 15d + 25d for l. -8 Solve -5c + 148l - 8845 = -1721, -4l + 200 = -2c for c. -4 Solve -4k + 25 = 5q - 54, -15k = -3q - 4k - 234 for q. -1 Solve y + 703d - 702d = 18, 0 = -5y + 5d + 50 for y. 14 Solve 2k = 35036a - 35041a + 76, 0k - 2k + 2a = 36 for k. -2 Solve 4290 = -5t + 4385, 3u + 5t = 89 for u. -2 Solve -2z + 14 = -4j + 4, 359z - 360z + 162j - 185j - 95 = 0 for z. -3 Solve -6t = 2i, -8458080t + 60 = 5i - 8458085t for i. 9 Solve -4u - 139w = -81w - 59w - 15, 3w = 4u - 37 for u. 1 Solve -2m + 5a + 13 + 13 = a - 6a, -3m + 5m + 3a = 13 for m. 8 Solve u + 34 = -4u + w - 29, -3u - w - 33 = 0 for u. -12 Solve -3o - 8q = 6313 - 6333, 5o = -3q + 54 for o. 12 Solve -3o - 90w = -86w - 3, -4o - 5w + 2 = -2 for o. 1 Solve 0 = 5r - 5k + 25, -r - 8 - 27 = 5k for r. -10 Solve 7u - 389z + 384z + 107 = 0, -u = -5z + 11 for u. -16 Solve 2n = -449k + 445k + 14n - 512, 3n - 118 = -k for k. -5 Solve 4l - 9 = b, -23l + 596b - 595b = 29 for l. -2 Solve -60l + 55l - 38m - 10 = 0, -7l + 4m - 19 = -5 for l. -2 Solve 491b - 9 - 3 = 245b + 244b, 0 = g - 5b + 32 for g. -2 Solve 3m - a = -15, 149m - 76m + 150 = 74m - 52a for m. -6 Solve g + g = -4b - 50, -g - 5g + 2b + 51406 = 51346 for g. 5 Solve -9w - t = -7w + 2, -6w + 7w - t + 7 = 0 for w. -3 Solve 1846s - 1843s = -6g + 111, -5s - 2g + 49 = 0 for s. 3 Solve 4o = 3f + 380, -7448 = 2f + o - 7532 for f. -4 Solve -2k - 70 = -4m, -4147k = -4154k - 5m + 40 for k. -5 Solve -t + 5c = -10, -3t - 3c - 10 = 14 for t. -5 Solve 1 = 2c - 7c - 12r + 10r - 13, 0 = 2c + 5r + 14 for c. -2 Solve -14967k + 9t - 23 = -14968k, 4k - 30 = -5t for k. 5 Solve 4g = -3x - 126, -2x + 3g = -71 - 32 for x. 2 Solve 369d + 12t + 2 - 17 = 374d + 2t, -2d = 2t - 18 for d. 5 Solve -w = 3d + 79, -5d + 2w + 368 = -3d + 226 for d. -2 Solve n - 5q = 0, 189n + 9q - q = -12n + 6q - 1007 for n. -5 Solve o - 4n + 66 = 0, 2o - 3536630n + 3536635n - 76 = 0 for o. -2 Solve 6p - 6t - 78 = 0, 15p = -13p + 31p - 2t - 42 for p. 16 Solve 2y - 33b + 170b = 279b - 720, 10 = -3y - b for y. -5 Solve -4k + d + 4d = 40, -123k + 181k + 274 = -4d for k. -5 Solve -v = 6m + 37, -v - 99 = 6m - 3m - 74 for m. -4 Solve -4j + 40f = 39f - 14, 3f - 888 = -918 for j. 1 Solve -u - 311f + 517f + 143 = 243f, -5u + 2f - 33 = 0 for u. -5 Solve 25 = -4y - 3g, -9g + 12 - 36 + 1 = -2y - 4 for y. -4 Solve -50i + 576 - 326 = 0, 0 = -3u - i + 65 for u. 20 Solve k - 4x - 106 + 208 - 99 = 0, -2k - 3x + 16 = 0 for k. 5 Solve -14d + 5l - 103 = -18d, -l - 217 = -8d for d. 27 Solve 3z - 5n + 21 = 0, -4z - 3162998n = -3163002n + 20 for z. -2 Solve 0 = 11d + 5c + 34, 256c - 260c = 2d for d. -4 Solve -50 = -3g - 2l, -168l - 54 = -57g + 52g - 170l for g. 2 Solve -4r + 96a - 64 = r + 99a, -a = 41r + 454 for r. -11 Solve 5h + 305 = -10o, -181h + 178h + 1 - 44 = o for h. -5 Solve 4n + 286 = 5y, 4060282y - n = 4060283y - 50 for y. 54 Solve -681f + 339f + 346f - 34 = -10s, 0 = s + 3s + 12 for f. 16 Solve 3027i = 3031i + 12, 31 = -4l - 0l - 5i for l. -4 Solve -2z + 24 = f, 158z - 160z + 100f = 1390 for z. 5 Solve 0 = 29o - 9u - 14, 95o - 3u - 1 = 189o - 90o + 31 for o. -2 Solve -216m = -110m - 103m + 4v + 289, -m + 385 = -5v for m. 5 Solve -2c - 43 = 22k + 9 - 0, -3c = k - 0k + 14 for c. -4 Solve z - 10 = -2s, -52z = 3s + 27 + 86 - 27 for s. 6 Solve -4v + z + z - 108 = 0, 5v + 176 = 5z + 36 for v. -26 Solve 8n - 4n + 5l - 13612 + 13417 = 0, -172 = -4l for n. -5 Solve -22c + 18c + 20 = 32d - 36d, 0 - 3 = -3d - 3c for d. -2 Solve 3p + 128 = -8d, -2d - 7 = d + 2526p - 2529p + 41 for d. -16 Solve -15o - 58 + 13 = 0, -o - 6 = f + 3o + 3 for f. 3 Solve 0 = -2g - 2439 + 2441, -5r + 2g = 162 for r. -32 Solve 4q = p + 32, 1796p - 7 - 16 = 1800p + 5q for p. -12 Solve 8p - 4p + 3 = g, 48p - 25 = -3g + 52p for g. 11 Solve 46w - 41w + 85 = 3o, 0 = 4w - 5o + 120 for w. -5 Solve -324180 = -n + 8a - 324211, -3n - 3a + 14 = -n for n. 1 Solve -10 + 35 = -5i + 10i, 22t + 65 - 92 = -i for t. 1 Solve -66m + 6 = -66m - 5v + 3v, 44 = -5m - 13v for m. -1 Solve f + 16 = -3h - 0f - 10, -13f + 14f = -14 for h. -4 Solve 0 = 22165s - 22166s - 4x - 8, -4x = 3s + 24 for s. -8 Solve -2o = 324j - 168j - 159j - 11, -4j - 8 = -o for j. -1 Solve 0 = 2u + 2o + 2, -131o + 6 = 20u - 85o for u. -2 Solve 4t = -2l + 5l + 54, t + 744 - 1104 = 20l for l. -18 Solve -6i = -12z + i + 119, 318z - 319z + 5i + 32 = 0 for z. 7 Solve -7l + 8l + a + 10 = 0, 6l - 9l - 37 = 4a for l. -3 Solve -2s = -5k + 26, -14s + 11k = 8k + 7k + 195 - 13 for s. -13 Solve 0c - c + 5 + 0 = -88g + 89g, -c = -2g - 17 for g. -4 Solve m + 131540 = -4g + 131558, -14 = 3m - 5g for m. 2 Solve -92f + 2198u = 2202u + 460, -2f - 6u - 10 = -2u for f. -5 Solve -2w - 4m = -185 + 75, 9m - 145 = -w + 106 for w. -1 Solve -5q + 4723 = 4t + 4725, -5q = -8t - 34 for q. 2 Solve 2a - 2n = -2873 + 2883, 0 = -3n - 21 for a. -2 Solve 39 = -4w + 8s - 9s, 5s + 236 = -5w - 4 for w. 3 Solve 3o = 0, -a + 927o - 11 = 929o for a. -11 Solve -3630q + 3629q - 113 = 10g, -213 = 18g + 5q for g. -11 Solve 7u = -21, 3g + 2u - 141 + 165 = -u for g. -5 Solve 0 = -m + 4m - g - 14, 14g = -209m + 109m + 102m - 36 for m. 4 Solve -6 = -2s + c, 20s - 16s - 14c = 7s + 53 for s. 1 Solve 2 = 4v - 2d + 6, 67d - 84 = -3v + 83d for v. -4 Solve 37z - 33z - 13 - 15 = -2b, -4 = b + 8z for b. 20 Solve -2i - 6 = -15 - 29, 61 = 2b - 6b + 3i for b. -1 Solve -9k = -419m + 414m - 18, 0 = 2m for k. 2 Solve 0 = 2*l - a - 30, -52	{ "pile_set_name": "DM Mathematics" }
-1ac (base 15) to base 6. -1443 Convert 2375 (base 8) to base 15. 5a2 12763 (base 8) to base 16 15f3 What is 7e65 (base 15) in base 8? 64366 -110220 (base 3) to base 7 -1005 Convert 414320 (base 5) to base 2. 11010110001110 1656 (base 10) to base 11 1276 What is -1770 (base 12) in base 13? -138c What is 306 (base 12) in base 14? 234 What is -412 (base 15) in base 11? -764 What is -288 (base 9) in base 6? -1042 What is -340 (base 15) in base 2? -1011011111 28a5 (base 16) to base 4 2202211 1260 (base 7) to base 12 343 -9644 (base 13) to base 16 -516b What is -22110010 (base 3) in base 2? -1100000001111 What is -1007 (base 9) in base 6? -3224 Convert -3212 (base 4) to base 11. -19a Convert -1103330 (base 5) to base 15. -5a60 What is -758 (base 13) in base 5? -20011 -2940 (base 16) to base 13 -4a64 -20012202 (base 3) to base 2 -1000110110001 Convert 60372 (base 8) to base 10. 24826 -1211012 (base 3) to base 10 -1328 Convert -50253 (base 9) to base 10. -33015 -131b7 (base 14) to base 6 -1001341 What is -101 (base 2) in base 7? -5 -13461 (base 7) to base 6 -24553 Convert c9 (base 15) to base 3. 21000 -343 (base 16) to base 8 -1503 Convert -7490 (base 10) to base 14. -2a30 What is 2121220 (base 3) in base 12? 1136 9597 (base 12) to base 7 65530 What is 1011000001101111 (base 2) in base 10? 45167 Convert 23881 (base 10) to base 7. 126424 What is -21a (base 11) in base 5? -2023 Convert -1145441 (base 6) to base 13. -2191c Convert 12032 (base 5) to base 12. 624 5585 (base 14) to base 6 152333 Convert 4a96 (base 13) to base 10. 10601 Convert -14394 (base 12) to base 11. -1a1aa Convert 2423201 (base 5) to base 8. 130562 21650 (base 12) to base 8 126134 What is 452 (base 7) in base 2? 11101001 Convert -10010 (base 3) to base 12. -70 -306 (base 12) to base 13 -279 Convert 3131 (base 12) to base 8. 12365 Convert 4a98 (base 13) to base 9. 15481 What is c9 (base 14) in base 2? 10110001 What is -791 (base 10) in base 3? -1002022 What is -8693 (base 11) in base 7? -45313 What is -22102 (base 6) in base 2? -101111110110 -34b8 (base 12) to base 6 -43152 -1000011 (base 3) to base 12 -511 Convert 1a28 (base 16) to base 5. 203241 Convert -1242 (base 7) to base 6. -2103 224 (base 15) to base 2 111100100 1164 (base 16) to base 5 120302 What is -2901 (base 11) in base 13? -1928 What is -2653 (base 7) in base 8? -1772 Convert 220 (base 12) to base 5. 2222 -21032 (base 8) to base 2 -10001000011010 3656 (base 10) to base 14 1492 Convert -1353 (base 7) to base 11. -440 What is -1ba0 (base 12) in base 9? -4633 Convert 28924 (base 13) to base 4. 102213121 -2220210002 (base 3) to base 7 -326303 What is c9 (base 16) in base 3? 21110 What is 10132 (base 6) in base 11? 101a -6a79 (base 12) to base 3 -121022210 What is -127472 (base 9) in base 4? -102331133 -34230 (base 8) to base 5 -430423 What is 1b9 (base 13) in base 7? 636 Convert 2f2 (base 16) to base 2. 1011110010 Convert 1101100100 (base 2) to base 6. 4004 -4447 (base 15) to base 13 -677b 44222 (base 5) to base 9 4172 Convert 20951 (base 10) to base 3. 1001201222 110b (base 16) to base 7 15502 -125251 (base 6) to base 4 -2310133 Convert aa7 (base 13) to base 10. 1827 -4534 (base 6) to base 11 -88a 5514 (base 8) to base 9 3863 Convert 12301 (base 5) to base 12. 673 What is -349c (base 14) in base 12? -536a Convert 151152 (base 6) to base 4. 3203030 Convert -65420 (base 7) to base 2. -11111111001011 Convert 2847 (base 9) to base 7. 6160 What is 3bc (base 16) in base 5? 12311 -33414 (base 6) to base 2 -1001001010010 What is 962 (base 10) in base 12? 682 -101101111111100 (base 2) to base 11 -16768 Convert 700 (base 11) to base 10. 847 Convert 1000011 (base 3) to base 4. 23131 43233 (base 5) to base 12 1853 11131213 (base 4) to base 6 251331 What is -3327 (base 13) in base 2? -1101111011011 Convert -23010 (base 8) to base 6. -113024 Convert 4017 (base 11) to base 4. 1103132 166 (base 11) to base 7 364 Convert -31110 (base 5) to base 14. -a50 Convert -465 (base 7) to base 4. -3303 Convert -647 (base 14) to base 3. -1200220 Convert 18c4 (base 13) to base 12. 2191 Convert -d9 (base 16) to base 7. -430 Convert -455 (base 11) to base 9. -664 What is -351 (base 8) in base 3? -22122 15a3 (base 15) to base 4 1020231 What is 11010010100 (base 2) in base 8? 3224 31203 (base 6) to base 2 1000001010011 -31 (base 11) to base 7 -46 What is 8e8 (base 16) in base 2? 100011101000 -15b9 (base 14) to base 4 -330233 Convert -4300422 (base 5) to base 13. -269c6 Convert 173 (base 16) to base 13. 227 Convert 151 (base 7) to base 5. 320 What is -12004 (base 5) in base 11? -72a 1a6 (base 13) to base 3 102022 Convert -1010111000101100 (base 2) to base 15. -d328 Convert 141c (base 14) to base 12. 2082 a61 (base 13) to base 15 7ce Convert 10411 (base 5) to base 15. 33b -110001000110011 (base 2) to base 16 -6233 33012 (base 5) to base 14 b73 -57aa (base 15) to base 3 -221112021 -1d (base 16) to base 5 -104 What is -2501 (base 11) in base 8? -6304 Convert -24166 (base 9) to base 8. -37463 -133212 (base 4) to base 2 -11111100110 Convert -37d8 (base 15) to base 8. -27177 Convert 4551 (base 9) to base 14. 1327 Convert -c12 (base 15) to base 3. -10201122 Convert 1427 (base 14) to base 16. deb 287a (base 11) to base 12 2199 What is 143 (base 16) in base 8? 503 51332 (base 6) to base 7 25616 -612 (base 16) to base 7 -4350 What is -130 (base 5) in base 6? -104 -1011102 (base 3) to base 8 -1520 Convert -3ab2 (base 14) to base 13. -4930 1010010000100001 (base 2) to base 15 c6b2 What is -10011111111011 (base 2) in base 12? -5b0b -625 (base 15) to base 13 -827 1001110000 (base 2) to base 13 390 What is 129b (base 12) in base 2? 100001010111 -113013 (base 6) to base 5 -302404 Convert 998 (base 16) to base 3. 10100222 Convert 181 (base 16) to base 5. 3020 10010010110011 (base 2) to base 5 300040 22620 (base 8) to base 6 112304 What is -111011011100111 (base 2) in base 13? -10b16 10201 (base 4) to base 8 441 What is -66 (base 14) in base 5? -330 What is -100001001000 (base 2) in base 6? -13452 What is 374 (base 11) in base 13? 282 -3548 (base 13) to base 5 -214441 What is 1f4 (base 16) in base 12? 358 -331123 (base 5) to base 13 -526c -376 (base 9) to base 16 -138 What is 15d85 (base 15) in base 8? 211626 What is 193 (base 14) in base 3? 110001 Convert 40440 (base 10) to base 16. 9df8 Convert -3211 (base 4) to base 6. -1021 Convert -10241442 (base 5) to base 12. -42502 -661 (base 8) to base 4 -12301 What is -424 (base 12) in base 11? -4aa What is 1036 (base 7) in base 5? 2440 1012221 (base 3) to base 9 1187 Convert -101111 (base 4) to base 13. -674 -10100110010101 (base 2) to base 4 -2212111 What is -21b (base 15) in base 3? -122122 Convert -143b8 (base 13) to base 8. -112167 What is -11111101000 (base 2) in base 11? -1580 What is 20b1 (base 13) in base 12? 2762 Convert -21241 (base 6) to base 13. -1426 1511 (base 6) to base 12 297 -11506 (base 10) to base 9 -16704 What is 6483 (base 13) in base 11? a546 What is 6035 (base 7) in base 16? 824 What is 80 (base 12) in base 11? 88 Convert -72cb (base 15) to base 6. -304202 Convert 24161 (base 9) to base 13. 7492 2e26 (base 15) to base 3 111122000 What is 15b7 (base 15) in base 8? 11100 Convert 1a80a (base 12) to base 7. 222136 Convert -3b2 (base 16) to base 7. -2521 What is 2211 (base 4) in base 14? bb Convert 253 (base 7) to base 9. 161 -220200 (base 4) to base 9 -3500 What is 522 (base 7) in base 3? 100200 Convert -4074 (base 8) to base 13. -c62 Convert 1d7 (base 15) to base 7. 1150 Convert 1348 (base 9) to base 4. 33320 220 (base 11) to base 8 410 Convert -543103 (base 6) to base 11. -30693 What is 573 (base 9) in base 8? 727 12b3 (base 16) to base 7 16646 What is 1500 (base 16) in base 11? 4048 775 (base 9) to base 2 1001111011 Convert 61603 (base 9) to base 3. 2001200010 What is 2c2 (base 16) in base 10? 706 Convert -33825 (base 9) to base 12. -11065 What is b315 (base 16) in base 3? 2022212222 Convert 33562 (base 7) to base 8. 20511 -26431 (base 10) to base 12 -13367 What is -110100110010 (base 2) in base 7? -12564 11c6b (base 15) to base 3 2212220202 1128 (base 14) to base 9 4066 What is -dd1 (base 16) in base 8? -6721 6555 (base 8) to base 13 1745 Convert 100010101110 (base 2) to base 6. 14142 100210121 (base 3)	{ "pile_set_name": "DM Mathematics" }
lylyyy. Give prob of sequence lyle. 7/520 Calculate prob of sequence uyy when three letters picked without replacement from yyyuyuyuyuuuu. 35/286 Calculate prob of sequence nn when two letters picked without replacement from rsssrsnnsssn. 1/22 Four letters picked without replacement from {s: 3, e: 3, w: 5}. Give prob of sequence wwes. 1/44 Two letters picked without replacement from {y: 1, h: 2, o: 4}. Give prob of sequence oy. 2/21 Calculate prob of sequence hz when two letters picked without replacement from hzhhhhhhzhhhh. 11/78 Two letters picked without replacement from {x: 5, g: 15}. Give prob of sequence xx. 1/19 Calculate prob of sequence km when two letters picked without replacement from {m: 2, d: 1, e: 1, n: 1, k: 2}. 2/21 Three letters picked without replacement from {r: 12, f: 3, x: 1}. Give prob of sequence rff. 3/140 What is prob of sequence bmb when three letters picked without replacement from bbmyy? 1/30 Three letters picked without replacement from vjvvjvvjjvvivv. What is prob of sequence jiv? 3/182 Three letters picked without replacement from crcrccrccxrrrxx. Give prob of sequence crc. 6/91 Two letters picked without replacement from {c: 5, u: 5}. Give prob of sequence uu. 2/9 What is prob of sequence fr when two letters picked without replacement from {e: 1, r: 1, k: 1, u: 1, f: 1, j: 2}? 1/42 What is prob of sequence fjrj when four letters picked without replacement from {r: 1, f: 1, j: 2}? 1/12 Three letters picked without replacement from {l: 9, h: 3}. Give prob of sequence lhl. 9/55 What is prob of sequence tt when two letters picked without replacement from tltlllll? 1/28 Calculate prob of sequence rmrr when four letters picked without replacement from {r: 19, m: 1}. 1/20 What is prob of sequence hf when two letters picked without replacement from {e: 3, p: 2, f: 1, h: 1}? 1/42 What is prob of sequence hhx when three letters picked without replacement from mmmxhxhhmmh? 4/165 Three letters picked without replacement from wwwqqwwqqww. What is prob of sequence wqq? 14/165 Calculate prob of sequence bp when two letters picked without replacement from {m: 2, p: 1, g: 3, q: 2, f: 5, b: 6}. 1/57 Calculate prob of sequence lsp when three letters picked without replacement from {x: 1, p: 5, l: 1, s: 12}. 10/969 Four letters picked without replacement from nhtoyzonoztoyyy. What is prob of sequence ntzo? 4/4095 Calculate prob of sequence woo when three letters picked without replacement from nwocononnno. 2/165 What is prob of sequence ssl when three letters picked without replacement from sssslssls? 1/6 Two letters picked without replacement from {i: 3, k: 11, w: 3, j: 1, c: 1}. Give prob of sequence ij. 1/114 Three letters picked without replacement from ydddygydsugsu. What is prob of sequence uyg? 1/143 Calculate prob of sequence jaz when three letters picked without replacement from {j: 5, h: 3, a: 1, y: 1, p: 4, z: 1}. 1/546 Three letters picked without replacement from {o: 3, u: 4}. Give prob of sequence uoo. 4/35 Four letters picked without replacement from {n: 2, f: 1, c: 2, w: 1, r: 2, m: 5}. What is prob of sequence mmcr? 2/429 Three letters picked without replacement from {k: 1, m: 2}. Give prob of sequence mkm. 1/3 Two letters picked without replacement from {n: 1, q: 3, t: 1, y: 1, j: 1}. What is prob of sequence jy? 1/42 Two letters picked without replacement from {e: 10, v: 2}. What is prob of sequence ve? 5/33 Three letters picked without replacement from kbbvbbbbbbvkdbbsbbkb. What is prob of sequence bvb? 13/285 Four letters picked without replacement from {m: 7}. Give prob of sequence mmmm. 1 Four letters picked without replacement from {j: 1, t: 11, m: 2, k: 1, q: 1, l: 4}. Give prob of sequence kjlm. 1/14535 Calculate prob of sequence vuuj when four letters picked without replacement from jcckuevku. 1/1512 What is prob of sequence tce when three letters picked without replacement from {c: 2, t: 1, e: 1, f: 1}? 1/30 What is prob of sequence ywt when three letters picked without replacement from wytwwttynwwnytwnwy? 7/306 Three letters picked without replacement from {y: 4, e: 15}. Give prob of sequence yey. 10/323 Two letters picked without replacement from {x: 4, s: 3, d: 5, y: 5, t: 1}. What is prob of sequence xd? 10/153 What is prob of sequence ooc when three letters picked without replacement from {o: 4, l: 2, g: 1, c: 3}? 1/20 Two letters picked without replacement from {j: 6, o: 2, n: 4, i: 3, c: 1, w: 3}. What is prob of sequence co? 1/171 Two letters picked without replacement from jrxjxoooorrxjx. Give prob of sequence xo. 8/91 Two letters picked without replacement from xtoxoxotoxxxtmtmxmxx. Give prob of sequence xx. 18/95 Four letters picked without replacement from skteaettekakkttsks. Give prob of sequence ttae. 1/612 Calculate prob of sequence nns when three letters picked without replacement from {s: 4, n: 9, q: 2, o: 1}. 3/35 Four letters picked without replacement from uuubuuuuuuuubububbuu. What is prob of sequence bbuu? 35/969 Three letters picked without replacement from {o: 2, m: 9}. Give prob of sequence mom. 8/55 Two letters picked without replacement from miikss. Give prob of sequence im. 1/15 Calculate prob of sequence scss when four letters picked without replacement from {s: 3, c: 4}. 1/35 Four letters picked without replacement from znzzmomhnzhnnb. Give prob of sequence zzzm. 2/1001 Four letters picked without replacement from {x: 5, b: 1, v: 1, f: 2, h: 1}. What is prob of sequence xfxb? 1/126 Four letters picked without replacement from nniuiuiiuuuu. What is prob of sequence iuuu? 4/99 Three letters picked without replacement from {m: 3, p: 1, k: 2, f: 1, t: 3}. What is prob of sequence ttk? 1/60 What is prob of sequence vd when two letters picked without replacement from lldmdjdmmvmmvmldmvl? 2/57 Calculate prob of sequence hhch when four letters picked without replacement from cqnuncchhh. 1/280 What is prob of sequence xgex when four letters picked without replacement from eexeexlxxlellgegeel? 2/969 Four letters picked without replacement from zeezzeezeseqqese. Give prob of sequence qzqs. 1/2730 Two letters picked without replacement from {o: 2, k: 1}. What is prob of sequence ko? 1/3 Calculate prob of sequence vvxk when four letters picked without replacement from kxvvivkvnx. 1/105 Two letters picked without replacement from kjjjk. Give prob of sequence kk. 1/10 Three letters picked without replacement from {z: 1, x: 3}. Give prob of sequence zxx. 1/4 Calculate prob of sequence qu when two letters picked without replacement from {q: 4, i: 3, u: 11}. 22/153 Calculate prob of sequence cwww when four letters picked without replacement from cwwcaaaaawcaa. 3/2860 Three letters picked without replacement from xxqeeexonqdeqxqneexe. Give prob of sequence qqx. 1/114 Calculate prob of sequence vlvl when four letters picked without replacement from {v: 6, l: 4}. 1/14 What is prob of sequence tgqi when four letters picked without replacement from {q: 1, i: 1, t: 3, g: 2}? 1/140 What is prob of sequence xgex when four letters picked without replacement from egeegegxgggxeg? 5/1716 Calculate prob of sequence ggg when three letters picked without replacement from {g: 12, l: 1}. 10/13 Calculate prob of sequence zzzz when four letters picked without replacement from {g: 5, z: 11}. 33/182 Three letters picked without replacement from {o: 5, m: 7}. What is prob of sequence mmo? 7/44 Two letters picked without replacement from {g: 8, o: 2, m: 2, e: 1, f: 6, w: 1}. Give prob of sequence oe. 1/190 What is prob of sequence ay when two letters picked without replacement from mzzamqymampzyzmya? 9/272 Calculate prob of sequence ku when two letters picked without replacement from {u: 1, k: 2}. 1/3 What is prob of sequence qko when three letters picked without replacement from kkoooqqooqkqq? 25/572 Calculate prob of sequence nsk when three letters picked without replacement from mnksklm. 1/105 Four letters picked without replacement from {e: 5, h: 5}. What is prob of sequence ehhh? 5/84 Two letters picked without replacement from {w: 1, r: 2, s: 1, m: 1, z: 2, k: 1}. What is prob of sequence zr? 1/14 Two letters picked without replacement from {v: 4, r: 15}. What is prob of sequence rv? 10/57 What is prob	{ "pile_set_name": "DM Mathematics" }
y + 20y - 86y + 24y. -8y Collect the terms in -228 + 457 - 18y - 229. -18y Collect the terms in -168z + 260z - 190z. -98z Collect the terms in 3 + 21k + 21k - 4 + 5. 42k + 4 Collect the terms in 2351p3 + 1157p*3 + 4320p*3. 7828p*3 Collect the terms in 464 - 1403 + 466 + 473 + 4r. 4r Collect the terms in q3 - 51 - 203 + 67. q3 - 187 Collect the terms in -1 - 23k + 21k - 15k - 25k + 17k. -25k - 1 Collect the terms in -1 - 30q + 66q - 73q + 3 - 151q. -188q + 2 Collect the terms in -4u2 - u2 + 2u*2 + 15u - 39u. -3u*2 - 24u Collect the terms in 9x - 14x - 3 + 27x + 9x. 31x - 3 Collect the terms in -b - 51 + 53 - 27b - 5b. -33b + 2 Collect the terms in -3299 + 167c3 + 1652 + 1648. 167c*3 + 1 Collect the terms in -206t + 356t - 153t. -3t Collect the terms in -1804u*2 + 9u*3 - 6u*3 - 7u*3. -4u*3 - 1804u*2 Collect the terms in -9w - 40w - 23w + 133 - 67 - 68. -72w - 2 Collect the terms in -p + 9 - 326p*3 + 4p - 3p. -326p*3 + 9 Collect the terms in -9w + 21w + 0w + 19 + 26w. 38w + 19 Collect the terms in -22202 + 11107 + 11028 + 4i. 4i - 67 Collect the terms in 83y2 + 77y*2 + 159y*2 - 326y*2. -7y*2 Collect the terms in -2i*2 + 7i*3 + 13i*3 - 19i3 - 28. i3 - 2i2 - 28 Collect the terms in -1655q - 1651q - 1 + 4 + 3308q. 2q + 3 Collect the terms in 57p + 153p2 - 29p - 28p. 153p*2 Collect the terms in 22j - 5j - 14j - 10j - 2j. -9j Collect the terms in -30 + 14651f + 91 - 14656f. -5f + 61 Collect the terms in 194n2 - 38n + 22n + 16n. 194n2 Collect the terms in -6 + 22 - 7 + 755c - 9. 755c Collect the terms in 36h - 223977 + 223977. 36h Collect the terms in 12v + 15 + 2 + 3. 12v + 20 Collect the terms in 538379 + 6a - a - 538379. 5a Collect the terms in 61043k*3 - 30447k*3 - 30595k3. k3 Collect the terms in -342c - c2 - 193c + 535c. -c2 Collect the terms in 21 - 21 - 77u*2. -77u*2 Collect the terms in 587j*3 - 553j*2 + 553j*2. 587j*3 Collect the terms in -555 + 17s + 1107 - 552. 17s Collect the terms in 2403l + 2377l + 2379l - 9529l + 2372l. 2l Collect the terms in 5 + 19c*2 - 3c*2 + 5 + 6c*2. 22c*2 + 10 Collect the terms in -885553t*3 + 443060t*3 + 442488t*3. -5t*3 Collect the terms in 112w*3 + 16w - 45w - 34w*3 + 29w. 78w3 Collect the terms in -4f - 2f + 101f*3 + 6f. 101f3 Collect the terms in 55m*2 - 93m*2 + 25m*2 + 71m*2. 58m*2 Collect the terms in 11 - 4 - 6 - 5 - 2 + 3c*3. 3c*3 - 6 Collect the terms in -25341 + 3c + 12660 + 12681. 3c Collect the terms in 3 + 3a*2 + 3 - 27 + 27 - 6. 3a*2 Collect the terms in 379 - 10x - 379. -10x Collect the terms in -5 - 826n - 864n + 2506n - 2 - 866n. -50n - 7 Collect the terms in 2839n + 817n + 458n. 4114n Collect the terms in -18q2 + 7q*2 - 18q*2 + 18q*2 - 26q*2. -37q*2 Collect the terms in 155h*3 - 211h*3 + 178h*3. 122h*3 Collect the terms in 13 - 13 + 9098v*2. 9098v*2 Collect the terms in -1611s*2 - 1638s*2 + 3254s*2. 5s*2 Collect the terms in -153j + 47j - 166j. -272j Collect the terms in -39u*3 + 160u*3 - 43u*3 - 36u*3 - 26u*3. 16u*3 Collect the terms in -3s*2 + 159 + 2s2 - 210 - 417. -s2 - 468 Collect the terms in -920g2 + 329g*2 - 1528g*2 - 3. -2119g*2 - 3 Collect the terms in -3y*2 + 5y*2 - 35 + 18 + 9 + 5 - 2y*3. -2y*3 + 2y*2 - 3 Collect the terms in 97 + 4m - 4m + 281 - m2. -m2 + 378 Collect the terms in 13s*3 + 15434s - 15434s - 11s*3. 2s*3 Collect the terms in -2120 + 333p*3 + 2120. 333p*3 Collect the terms in -1 - 1 + 3 - 6c*2 - 23c*2. -29c*2 + 1 Collect the terms in 493g + 241g + 236g - 48g. 922g Collect the terms in -460d2 + 604d*2 - 143d2. d2 Collect the terms in 250v2 - 2v + 374v2 + 3v. 624v2 + v Collect the terms in 6691766050p2 - p3 + p*3 - 6691766050p*2 + 2p*3. 2p*3 Collect the terms in 5g3 - g3 - 3g3 - 3627g + 3627g - 3. g3 - 3 Collect the terms in -3h - 38 - 65 - 2. -3h - 105 Collect the terms in 224h*2 + 132h*2 - 80h*2. 276h*2 Collect the terms in 287j*2 - 396j + 396j. 287j*2 Collect the terms in 313j - 693j + 332j. -48j Collect the terms in -100d*2 - 169 - 11d*2 + 332 - 163. -111d*2 Collect the terms in -472924b + 2b2 - 472923b + 945847b. 2b*2 Collect the terms in 3194u*3 - 12777u*3 + 3199u*3 + 3186u*3 + 3193u*3. -5u*3 Collect the terms in -19h*3 - 19h*3 + 64h*3 - 23h*3. 3h*3 Collect the terms in 13r*2 - 1527 - 1530 + 3064. 13r*2 + 7 Collect the terms in 32k - 8k + 19k + 7k + 26k. 76k Collect the terms in -29556q*3 + 59087q*3 - 29912q*3. -381q*3 Collect the terms in 43693d*2 - 21797d*2 - 21844d*2. 52d2 Collect the terms in t2 - 7t2 - 3t*2 - 841t + 121t. -9t*2 - 720t Collect the terms in -71901711r + 3r*2 - 2 + 2 + 71901711r. 3r2 Collect the terms in 1923283k - 1923283k + 4k*2 - 5k2. -k2 Collect the terms in 0j3 - 2j*3 + 3975 - 8j*3 - 3975. -10j*3 Collect the terms in -443q*3 + 56q*2 + 454q*3 - 56q*2. 11q*3 Collect the terms in 63 + 163 + 142 - 63 + 0n2 + n2. n*2 + 305 Collect the terms in 103 + 118 - 221 + 3j*3 + j. 3j*3 + j Collect the terms in -2q*3 - 163421q + 163421q - 19q*3. -21q*3 Collect the terms in 60l - 292l + 458l. 226l Collect the terms in 166n - 8595n2 + 8609n*2 - 166n. 14n2 Collect the terms in 6085c*2 + 6092c*2 - 12195c*2. -18c*2 Collect the terms in 2b*2 + 12562 - 3b2 - 12353. -b2 + 209 Collect the terms in -t - 354 + 384 - 11t - t2. -t2 - 12t + 30 Collect the terms in 137278y2 + 3 - 6 + 4. 137278y*2 + 1 Collect the terms in -32z + 1456939 - 1456939. -32z Collect the terms in 369m + 816m + 156m. 1341m Collect the terms in 4s*2 - 6447s - 5649s + 529s + 6s2. 10s*2 - 11567s Collect the terms in 18420o2 - 14396o*2 + 24352o*2 + 5960o*2. 34336o*2 Collect the terms in 2167 + 30a*2 - 2167. 30a*2 Collect the terms in -13461s*2 + 6735s*2 + 6728s*2. 2s*2 Collect the terms in -1733q*2 + 0q - 5q + 1738q*2. 5q*2 - 5q Collect the terms in -15v + v2 - 16v - v + 7v + 2v. v*2 - 23v Collect the terms in 34w3 + 41w*3 + 37w*3 - 110w*3 + 93. 2w*3 + 93 Collect the terms in -7q + 1264 + 1260 - 5q - 2524. -12q Collect the terms in -985 + 985 + 247l3 - 31l*3. 216l*3 Collect the terms in -25y - 10y - 9y - 65y. -109y Collect the terms in 8z3 - 15z*3 - 17z*3 + 6z*3. -18z*3 Collect the terms in -9m*3 - 2m*3 - 2m + 8m3 + 29m - 27m. -3m*3 Collect the terms in -2x*2 - 15 + 39 - 20 - 20. -2x*2 - 16 Collect the terms in 12176s*3 - 24359s*3 + 12182s3. -s3 Collect the terms in -5k - 194k*2 + 4k - 223k. -194k*2 - 224k Collect the terms in 6q - 137q - 19q + 26q - 67q. -191q Collect the terms in -5c2 + 7c*2 - 18c*2 + 0c*2 + c. -16c*2 + c Collect the terms in -788m*2 + 2369m*2 - 770m*2 - 806m*2. 5m*2 Collect the terms in -4851u - u*2 + 3701u + 10371u. -u2 + 9221u Collect the terms in -256w2 + 194w*2 + 553w*2. 491w*2 Collect the terms in 1 - 394d*2 - 1 - 178d2 + d2. -571d2 Collect the terms in -74494i*3 - 4i*2 + 4i*2. -74494i*3 Collect the terms in -36k - 330k3 + 19k + 331k3 + 17k. k*3 Collect the terms in 4304r - 4304r - 110r*2 - 2 + 8r*3. 8r*3 - 110r*2 - 2 Collect the terms in -159090v*2 - 159121v*2 + 318233v*2. 22v*2 Collect the terms in -11n + 46n + 5n - 183. 40n - 183 Collect the terms in -271 + 815 - 271 + 8u - 273. 8u Collect the terms in 3975 - 1980 - 1995 + 5v*3. 5v*3 Collect the terms in -6940s*2 - 6951s*2 + 13913s*2. 22s*2 Collect the terms in 3z*2 - 6z*2 + 3z*2 + 2106z*3. 2106z*3 Collect the terms in 229h*2 + 169h + 159h - 328h. 229h2 Collect the terms in 105u*3 - 332u*3 + 109u*3 + 115u*3 + 36u. -3u3 + 36u Collect the terms in 19o - 692o*2 - 19o + 693o2. o2 Collect the terms in -74u*2 + 213u*2 - 72u*2 - 73u*2 - 26u - 7u. -6u*2 - 33u	{ "pile_set_name": "DM Mathematics" }
biggest value in 2, -2, -1112, 3/11, 2/7, -92? -2 What is the smallest value in 281, -2, -3, 2/3, 26, -0.3? -3 What is the fourth biggest value in 0.07, -58272, -13, 3? -58272 Which is the smallest value? (a) -1/3 (b) 21/839 (c) -14 (d) -21 (e) -4 d What is the smallest value in 0.1, -1/8, -12/29, -1/3, -4/9? -4/9 Which is the second biggest value? (a) -5 (b) -61 (c) 414968/11 a Which is the fifth biggest value? (a) 0.2 (b) -693/16 (c) 3/4 (d) 0 (e) -0.2 (f) 1.77 (g) -4 e Which is the third biggest value? (a) 181 (b) -51 (c) -24 b Which is the third biggest value? (a) -0.054 (b) -181 (c) 0.5 (d) 4 (e) -0.3 a Which is the second biggest value? (a) -0.4 (b) -3/10 (c) -1010 (d) 20 b What is the fourth smallest value in -6, 7, 491, 14/23? 491 Which is the third biggest value? (a) -4 (b) 55/12 (c) 328 (d) -4/9 (e) 4 (f) 1 e What is the third biggest value in -1/2, -0.035, -2.95134, -0.1? -1/2 Which is the third biggest value? (a) 2/79173 (b) -99/8 (c) 0 b What is the fifth biggest value in -9/50, 0.1, -0.5, 482/15, 0.2? -0.5 Which is the third biggest value? (a) 1/8 (b) -3/2 (c) -0.5 (d) 1 (e) -0.4 (f) 0.69114 (g) 3 f What is the fifth smallest value in 254.7, -0.5, 5, 2, 1/330? 254.7 Which is the second smallest value? (a) -0.5 (b) 1.6 (c) 7 (d) 20 (e) -0.013 e Which is the fourth biggest value? (a) -2/5 (b) -67 (c) 0.3287 (d) 43 b What is the third smallest value in -2/3, 0.5, -0.09, -0.03, 9, -1/3, -0.079? -0.09 Which is the biggest value? (a) -633 (b) -2.2 (c) 5 (d) -82 (e) -5 c What is the second biggest value in 1067735, -3, 3? 3 Which is the third biggest value? (a) -1603 (b) -38 (c) -14 (d) -2 b Which is the second biggest value? (a) -23313954 (b) 3/7 (c) 0.05 c Which is the second smallest value? (a) -5 (b) -1070 (c) -1.862 (d) 0 a Which is the biggest value? (a) 6 (b) 1 (c) -78 (d) 140 (e) 29/3 (f) 0.3 d What is the third smallest value in 456.6, 0, 0.1, 3/13, -4/15, -0.1? 0 What is the second biggest value in 50, 957.3, 4/3, 3? 50 Which is the third biggest value? (a) -4 (b) -956/85 (c) -5 (d) 4 c What is the fourth smallest value in 3, -1049, 0, -5, -0.3, 0.13? 0 Which is the fifth smallest value? (a) -1010555 (b) 0 (c) -0.5 (d) 0.1 (e) 6 (f) 5 f Which is the fifth biggest value? (a) -22 (b) -5 (c) 0.043 (d) 3 (e) 6 (f) 16 b What is the fourth smallest value in -33898, -1, 10/7, -4? 10/7 What is the sixth smallest value in -2, 0, 3, -1/8, 1/6, -295.39? 3 What is the second biggest value in -6121, 2/43, -2, 6/73? 2/43 Which is the seventh smallest value? (a) 233 (b) -1/3 (c) 3 (d) -5 (e) -25.8 (f) 1 (g) -242 a Which is the biggest value? (a) -2 (b) -9 (c) -0.4 (d) 0.09 (e) -4 (f) 2 (g) 0.23 f What is the sixth smallest value in 0.2, 5, 207, -4/9, 13.3, 2/135, 0.5? 13.3 What is the second smallest value in 95/21, 0.3, 1/739? 0.3 Which is the third smallest value? (a) 4 (b) -6 (c) -10 (d) 30 (e) 2.8 (f) -0.07 (g) -2 g What is the second biggest value in -38, 2125, -3552? -38 Which is the fourth biggest value? (a) 820/23 (b) 1 (c) -2/7 (d) 3 (e) -1/4 e Which is the third biggest value? (a) -0.1 (b) -5 (c) -0.04 (d) 10 (e) -34 (f) 8 (g) -7 c What is the fourth smallest value in 10, 8.9, -2/17, -455, -0.5? 8.9 What is the sixth smallest value in -121, 4/7, 1, -6/5, -1/127, -5? 1 What is the sixth biggest value in -0.5, -52.53, -0.2, -22, -10, -1, -0.3? -22 Which is the fourth biggest value? (a) 3/10 (b) -2 (c) -1 (d) 20508 b What is the third smallest value in 2/345, 13.476, 6? 13.476 What is the fourth smallest value in -127, 2.23, 3, 3/5, -2/5, 6/7? 6/7 Which is the third smallest value? (a) -2/11 (b) 3 (c) -0.3087 (d) 14 (e) 2/3 e Which is the third smallest value? (a) 0.09 (b) 0.4 (c) 2179 (d) 0 (e) 2.5 (f) -0.3 a What is the fifth smallest value in 26, -1, 1/12, 570, 0.5? 570 What is the fifth smallest value in 36, 3, -0.3, 0.2, 0.08, 6/11, 10? 3 What is the fourth smallest value in -0.0961, 5, -11, -17? 5 What is the biggest value in -1/2, 7999, 995/9? 7999 Which is the second smallest value? (a) -3/7 (b) 82/7 (c) 3/10 (d) 0.1139 (e) -1 (f) 0.2 a What is the fourth biggest value in 3, -2/3, -0.5, -1/4, -4/9, -175? -0.5 What is the second smallest value in 3, -4, 0.4, -16011421? -4 Which is the biggest value? (a) 141824 (b) -8.3 (c) 27 a What is the fourth biggest value in 2/5, -3/4, 1, 0.0808, -15, 2/21? 0.0808 What is the biggest value in -63/11, 44245/6, 2/11? 44245/6 What is the seventh biggest value in 0, 19, -1, -20/87, 4, -0.34, -3/2? -3/2 What is the second smallest value in 5, 17769812, 0.1, -3/5? 0.1 What is the third biggest value in 750, 17, 2361? 17 What is the third smallest value in -5, 4, -279644, 1/335? 1/335 Which is the third biggest value? (a) 1/7 (b) -921/10 (c) -24 b Which is the third biggest value? (a) 4 (b) -0.31 (c) 0.25 (d) -12856 b Which is the fourth smallest value? (a) 0.1 (b) 14.918 (c) 3 (d) 2 (e) -2 (f) -0.1 d What is the fourth smallest value in 1/3, 5, 3707, -5, -0.1? 5 Which is the second smallest value? (a) -2/9 (b) 95316 (c) -4 (d) -1/3 d Which is the fifth biggest value? (a) 14 (b) 8/5 (c) 2 (d) -3/19 (e) 25 (f) 2.2 b What is the second biggest value in -315/13, -1/10, 2238? -1/10 Which is the third biggest value? (a) -0.2 (b) -3/2 (c) 5 (d) -2320273 (e) -4 b What is the fifth biggest value in 5/16, 6, -2/11, -17, -1/2, 0.12, 0.06? -2/11 Which is the smallest value? (a) 2 (b) -0.0483 (c) 2/9 (d) 24 b What is the smallest value in -2/7, 561, -5, 27, -3, 1/4? -5 Which is the third smallest value? (a) 36907 (b) 2/8907 (c) 0.2 a Which is the sixth biggest value? (a) -15 (b) -2/3 (c) 0.2 (d) 2/45 (e) 3 (f) -2 (g) -17 a What is the fourth smallest value in 18, 1, 31, -2, 77? 31 What is the third biggest value in 131, -33, 23/15? -33 What is the smallest value in -4, 1.1, 5, 6327, 2, 0.14? -4 What is the biggest value in 0.01, 2/3, -95, 5, 0.2, -7, -0.19? 5 What is the fourth biggest value in 8, 28/3, -2, -2/213, 37? -2/213 Which is the seventh biggest value? (a) -0.4 (b) -0.2 (c) 0.4 (d) -1/3 (e) -4 (f) 921 (g) -8 g What is the smallest value in 4, -10566, -15.7? -10566 Which is the third smallest value? (a) 15 (b) -0.34 (c) -0.5 (d) 4 (e) 2411 d Which is the fourth biggest value? (a) 0.01 (b) 3 (c) -3.5 (d) -3/34 (e) 1 (f) -2.5 d Which is the third biggest value? (a) -2/3 (b) -4 (c) -23 (d) 1201 (e) 4 (f) -6/7 (g) 1 g Which is the third smallest value? (a) 0.4 (b) -15.95 (c) 0.2 (d) -4 (e) -0.5 (f) -2/31 (g) 157 e Which is the smallest value? (a) 7/2150 (b) -109 (c) -11 b Which is the second smallest value? (a) -2 (b) -40 (c) -77879 b What is the smallest value in -106, 4/7, 0.1, -264/17? -106 What is the second smallest value in 0.08, -3, -45.3, 5, -605? -45.3 What is the fourth biggest value in 6, -0.4, 5, -1/18, 23, 2/3? 2/3 What is the third smallest value in 126301, 1, 4/265? 126301 What is the second smallest value in 0.5, -5, 4, -2, -0.08, 2/5, 91.18? -2 What is the second smallest value in 1/3, 2/3, 1509940? 2/3 What is the second smallest value in 28.7, -0.1054, -5, 29? -0.1054 Which is the second biggest value? (a) 97/134 (b) -4 (c) 294 a Which is the third smallest value? (a) 0.1 (b) -3 (c) -14 (d) 59 (e) 3/2 (f) -0.4 (g) -2 g What is the third smallest value in 63750057, 1, -1, 5, -0.1? 1 What is the fifth smallest value in 2, 24, 1371/11, 4, 3/8? 1371/11 Which is the biggest value? (a) 0 (b) 0.153 (c) 4.65 (d) -599 (e) -4/5 c Which is the fifth biggest value? (a) -80 (b) 15 (c) -19 (d) -1/2 (e) 37 (f) 10 (g) -3 g Which is the third biggest value? (a) 97/3 (b) 13/19 (c) 2/7 (d) 2 (e) 5 (f) 0.3 d What is the third smallest value in -4/723, -29.43, -0.2, -2? -0.2 What is the fourth smallest value in -3/7, 3, -3/4, 0.37, 15/7? 15/7 What is the biggest value in 4, -0.05, 170, -2095/2? 170 Which is the fourth smallest value? (a) -0.38 (b) 0.047 (c) 0 (d) 1/4 (e) -296 b What is the smallest value in -11362, 0.054, -0.3? -11362 What is the second smallest value in -0.5, -98, 5, -5, 30, -2/41? -5 Which is the fifth biggest value? (a) 29 (	{ "pile_set_name": "DM Mathematics" }
(b) -0.5 (c) w (d) 3 a Let n = 0.7081 - 0.9081. Let v = -1.25 + 0.15. Let l = 0.8 + v. What is the nearest to n in -1/4, 3, l? -1/4 Let f(p) = -p. Let s be f(-2). Let q be 05/(150/(-5)). Let n be (q/s)/(-3 + 4). Which is the nearest to 2/9? (a) -5 (b) -2/3 (c) n c Let v = -1 + 0.6. Let x = 0.01 + -5.01. Let r be (72/27 + (-3)/(-9))(-3)/45. Which is the nearest to 0.2? (a) r (b) v (c) x a Let w = 9442 + -9442.2. Which is the nearest to 0.1? (a) 4 (b) 0.75 (c) w c Let t = -5957 - -5957.2. What is the nearest to -3/4 in 5, -3, -1, t? -1 Let u = -142.005 - -142. Let l = u + -0.095. Which is the closest to l? (a) -5/3 (b) 0.1 (c) 0 (d) -2 c Let w = 2.1 + -0.1. Let k = 16214 + -16217. Which is the closest to 2/5? (a) k (b) w (c) -5 b Let g = -193.5 + 191. Let x be ((-729)/(-12) + -3)-4. Let m be 7/(-3)(-22)/x. What is the nearest to 0.1 in -0.1, m, g? -0.1 Let m = 78.4 + -76.4. Let u = 208 - 6442/31. Which is the closest to u? (a) -1/3 (b) -3 (c) m a Let r = 103 - 104.64. Let j = 1.44 + r. What is the closest to j in 4, -3, -1/7? -1/7 Let d be ((-18)/36)/((-2)/216). Suppose -10v - d = -28v. What is the nearest to -2 in v, 1, -1/9? -1/9 Let m(i) = 19i + 14. Let o be m(-1). Let v = 0.822 + -0.322. Which is the closest to 49? (a) v (b) o (c) 2 c Suppose 2d - x = 5, -4x - 10 = d + 10. Let p be 16/6 + d + -2. Let g = 2.7 - 0.7. Which is the nearest to -2? (a) g (b) 3 (c) p c Let v be (-4)/(-30) + 602/210. Suppose -5i - 26 = 4y, -vy + 5i = i + 4. Which is the nearest to 0.02? (a) 0.3 (b) y (c) 2/7 c Let m = -125.63 - -125.53. Let t = 11 + -8. Which is the nearest to -0.1? (a) m (b) t (c) 88 a Let u = 0.64398 + -0.44398. What is the closest to u in 0, 1/7, 22, 1/2? 1/7 Let k = 43.696 - 0.796. Let o = k - 43. Let d = 0.3 - 0.2. Which is the closest to o? (a) d (b) -13 (c) 4 a Let i be (-549)/54 - 5 - -3. Which is the closest to 2? (a) 1/4 (b) -0.4 (c) i a Suppose 3g - 13 = -1. Let x = -22 + 21.984. Let b = x - 2.984. What is the closest to -2 in g, 1, b? b Let u = -2.93 + 3.43. Let q = 0.5 + 1.5. Let j = 5 - q. Which is the nearest to -1? (a) -1 (b) j (c) u a Let k = -1 + -3. Let n = 0.57417 - -0.42583. Which is the nearest to n? (a) 0.3 (b) k (c) 2/15 a Let i be 91/(-38) + (-58)/551. What is the nearest to 0.01 in -2/15, i, -1/3? -2/15 Let x = 0.8 - -1.2. Let h(c) = 3c3 - 21c - 20. Let z be h(-1). What is the nearest to 28 in z, x, 5? 5 Let r = -2062 - -8245/4. What is the nearest to -9 in -1/2, r, 5? r Suppose 5v = -5n - 20, -4v = -n - 0 + 1. Let a be ((-165)/39 + 4)3848/(-6216). What is the nearest to 0 in 1/4, 0.4, v, a? a Let i = -0.9 + 0.5. Let k = 2436.1 + -2436. What is the nearest to -12 in 5, k, i? i Let l = 281 + 379. Let o = l - 660.1. Which is the closest to -0.1? (a) -2 (b) o (c) 0.8 (d) 0.3 b Let i = -6993 + 6989. What is the closest to 1 in -3.84, 2/21, i? 2/21 Let v = -46.2 - -46.4. Let u = 0.0606 + -0.4606. What is the nearest to -1 in -1, v, 0.1, u? -1 Let b = 4 - 3.6. Let x = 376 - 29. Let a = x + -352. What is the nearest to -0.3 in b, -7, a? b Let q = -5.2 + 5. Let d = -104.1 + 111. Let z = d + -7.5. What is the closest to z in q, 4, -2/5? -2/5 Suppose 32 + 68 = -22x + 210. Which is the closest to 0.4? (a) -4/3 (b) x (c) 2/3 c Let m be ((-2)/8)/((122/(-1281))/(5/(-7))). Which is the nearest to -0.1? (a) -0.1 (b) -4 (c) m (d) 1/5 a Let w = 1740 + -1739. Let v be 6/(-2) + 5 + 1. What is the nearest to 27 in w, -0.5, v? v Let o = 1.67 - 0.47. Let z = o - 0.2. Let g = -0.3 - -1.3. Which is the closest to g? (a) z (b) 4 (c) 5 a Let x(z) = -z - 18. Let o be x(-18). Let f = 225.21 - 220.21. Which is the closest to o? (a) 4 (b) -0.2 (c) 0 (d) f c Let d be -4(-21 - 648/(-32)). What is the nearest to 0.4 in -2/13, -0.4, 3/2, d? -2/13 Let o be (45/10 + -5)/(5/(-2) + 2). Which is the closest to -3? (a) o (b) -3/5 (c) -1/52 (d) -2 d Let p = -0.06253 - 0.03747. Let w = -5.5 + 0.5. Let g = 4.7 + w. Which is the nearest to p? (a) 3 (b) g (c) -0.05 c Let s = -23203 + 46405/2. Let x be ((-16)/(-6))/((-7)/3). Let v = x - -13/42. What is the closest to 0 in 4, v, s? s Let c = 130.3 - 187. Let w = 13.2 + -70.2. Let v = w - c. What is the nearest to -0.1 in -4, -5, v? v Let t = 674.7 + -675.7. Let l = -45/308 + -1/28. What is the nearest to 3/5 in l, t, -5? l Let r = 32298.8 + -32300. What is the closest to 0.1 in -5/3, -5, r? r Let t = 14.7 + 20. Let k = t + -34.4. What is the closest to -0.1 in -1, k, 45? k Suppose 3f + 12 = 0, 20 - 37 = -5g + 3f. Suppose -2 = -3l - 2s + 13, 5s = 15. Let t be g/(-4)l/(-3). Which is the closest to 0? (a) -5 (b) t (c) 0 c Let y = -717108 - -717126. Let h = -12/11 + 58/33. Which is the nearest to -1? (a) y (b) 0.1 (c) -2/13 (d) h c Let d = 1.6 + 24. Let x = -20.6 + d. Let n = -2.9 - -3. Which is the nearest to -0.1? (a) n (b) x (c) 0.2 a Let d = 8.79 - 7.79. What is the closest to -3/2 in 19, d, -1/5? -1/5 Let k = -140 + 107. Let t be (-1 + 0/(-1))k/726. What is the nearest to t in -0.4, -6/11, -2/3? -0.4 Let m = 152064/17 + -61584373/6885. Let n = m + -2/81. What is the closest to -0.1 in n, 6/5, 5? n Let p = 108611.7 + -108612. Let m = -7 - -7.06. Which is the nearest to p? (a) m (b) -4 (c) -0.5 c Let o = 349 + -591. Let h = 248 + o. What is the closest to h in 2, -2/3, 0.2? 2 Let a be (1 - (-6)/2) + (3 - 2). Let w be (-7)/6 - (-2)/3. Let p = 1.07 + -4.07. What is the closest to w in p, a, 0.3? 0.3 Let v = -7924 + 7923.83. What is the nearest to -2/9 in -5, 2, v? v Let g = 7 - 7. Let d = -519 + 510.6. Let b = 7.9 + d. What is the closest to -0.2 in 2, b, g? g Let b be 24 - (-22 - (-2540)/55). What is the nearest to -11 in b, -5, 4, -3? -5 Suppose 4c - 13 = -2j + 1, 3c = 5j + 4. Let n be ((-4)/((-48)/(-4)))/(c/(-9)). What is the nearest to n in 0.05, -12, 3/8? 3/8 Let l = -471.2 - -471.5. What is the closest to 1/2 in -1, l, 0.26, -9? l Let h = 7693 - 7694. Which is the nearest to h? (a) -1/4 (b) -0.5 (c) 0.1 (d) 24/19 b Suppose -34c = 99c + 30c. Let g = -13 + 18. What is the closest to c in g, -2/5, -1/6? -1/6 Suppose 0 = -2y - 3y. Let q = -1112 + 1165. Suppose -2s + 58i = qi - 17, 5s = -3i - 4. Which is the nearest to y? (a) 0.5 (b) 10 (c) s a Suppose -n - 3 + 0 = 0. Let t = -1.8714 + 1.4714. Which is the closest to 18? (a) n (b) 2 (c) t b Let t = -2720 - -2723. What is the nearest to -4 in -1/8, t, -6.8? -6.8 Let b = -605 + 606.3. Let h = 12 + -12. What is the closest to h in 5, -4, b? b Let q = -0.3479 + -2.6521. What is the nearest to -6 in -4/17, -1, 4, q? q Suppose -3c + 3f = -0c - 84, -5c + 140 = -4f. Let m = -250/9 + c. What is the closest to 7 in 3, m, -5? 3 Let u be 140/308/84. What is the nearest to -1 in 2, -1/14, u, -5? -1/14 Let m = 11843.5 + -11844. Which is the nearest to -2? (a) 1/2 (b) m (c) 7 b Let w = -1280 + 2555/2. Which is the nearest to 0.06? (a) 3/8 (b) 0.2 (c) w b Let t be 1/4 + 9/60. Let m = -13472 + 13475. Let a = -32 + 95/3. What is the nearest to a in t, m, -0.2? -0.2 Let u = 0.75089 - -0.24911. What is the nearest to -0.1 in 2/17, -0.6, -3/7, u? 2/17 Suppose -30h + 150 = -33h. Let b be ((-4)/h)/(3/(-15)). Suppose -9 = k - 2j, 4k + 13 - 2 = 3j. What is the nearest to -0.4 in b, -0.2, k? b Let a = -12862 + 13038. What is the closest to 1 in -1/2, 2, a, -0.2? 2 Let t = 7262 - 7274. Which is the closest to t? (a) -0.5 (b) 1 (c) 226 a Let l = 34 + -36. Let b be ((-4)/5)/(35(-28)/350). Suppose 0 = -c - 5g - 4, 4g + 6 = 2. What is the closest to b in -3, l, c? c Let t = -0.168 + -123.832. Let n = t - -127. What is the nearest to 0 in n, 2, 40? 2 Let d = -1501/11 + 410/3. Let o = 4/33 + d. Which is the nearest to o? (a) -1/5 (b) -1 (c) -2 a Let d = -575 - -977. Let r = -399 + d. Which is the nearest to -9/2? (a) 2/3 (b) r (c) 2 a Let w(z) = z*2 + 20z + 84. Let h be w(-6). Which is the nearest to 0? (a) 3 (b) h (c) 12/43 b Let q = -421.4 - -421. Let h be (18/(-15))/((-174)/(-20)). Which is the nearest to q? (a) h (b) -2 (c) -0.2 c Let p = -55.52 + 56.02. Which is the closest to -51/5? (a) p (b) -3 (c) 0.2 (d) 0.3 b Let v = 1.95 - -0.05. Let k be 3 + 2 + 228/(-48) + 0/(-1). What is the closest to 2/3 in 4, 0.4, v, k? 0.4	{ "pile_set_name": "DM Mathematics" }
r, 7r = 4t + 5r - 298. Calculate the highest common divisor of 16 and t. 8 Let j(p) = p*2 + 251p - 4553. Let a be j(17). Suppose -2t = -7t + 75. Calculate the greatest common factor of t and a. 3 Let x be (-10)/(4/(-42)1). Suppose 4v + 2a - 83 - 5 = 0, 29 = v + 4a. What is the highest common factor of x and v? 21 Let x be 16 + -3 + -8 - (-1385 + 4). What is the greatest common factor of 28 and x? 14 Let w = -576 + 696. Calculate the highest common factor of 45 and w. 15 Suppose -9k = -0k. Let u(o) = 2o3 - o2 + 40. Let y be u(k). Calculate the greatest common divisor of 140 and y. 20 Let l be (-26)/(1/(-2)52/195). Calculate the greatest common factor of 39 and l. 39 Suppose 97 = 5q - 8. Suppose -630 = 396p - 402p. Calculate the greatest common factor of q and p. 21 Suppose 3w - i = 83 + 147, -2w + 2i + 148 = 0. Calculate the greatest common divisor of 130 and w. 26 Let r(l) = -195l + 1360. Let x be r(6). Calculate the highest common factor of 2375 and x. 95 Suppose 5t - 625 = -5d, -d - 299 - 176 = -4t. Let p = 98 - 83. What is the greatest common factor of t and p? 15 Suppose -45 = -6c - 15. Suppose -2d - 17 = -4b + 3, cb = -5d + 55. Calculate the greatest common divisor of 28 and b. 7 Suppose 5p + 2n - 1021 = 1396, 5n + 961 = 2p. Calculate the highest common divisor of 345 and p. 69 Let a be 6/(-2 - -5) + 54. Let r = a + -31. What is the highest common factor of 175 and r? 25 Let d = 22 + -11. Let v = 18 - 16. Suppose -t - 2 = 0, -3y - vt + 371 = -6t. What is the highest common divisor of d and y? 11 Let m(r) = r*3 - 2r*2 + r + 42. Let u be m(0). Calculate the highest common factor of 6 and u. 6 Suppose d + 0d = g - 31, d + 5 = 0. Let m = -72 + 102. Suppose gp - m = 21p. Calculate the greatest common divisor of 42 and p. 6 Let u be (-2)/13 + 6/39. Suppose 2d - 622 = -ud. Suppose 0 = -3f + 9, -3f = -4c + d. Calculate the greatest common factor of 16 and c. 16 Suppose 0 = 4y + 3k - 361, -7y - 5k + 450 = -2y. Calculate the highest common factor of 7 and y. 7 Let g be (-382)/(-8) - (-4)/16. Suppose -q - q = -g. Let t(f) = f*2 - 4f + 4. Let j be t(6). Calculate the highest common divisor of q and j. 8 Suppose -5k - 44 = -2o, -3k - 5 + 53 = 5o. Let v(i) = i + 14. Let z be v(o). Let u be ((-10)/4)/((-13)/z). Calculate the highest common factor of 55 and u. 5 Let t(r) = 2r + 16. Let f be t(-7). Suppose -4y + 348 = 2i, i + 0 = -f. Let o be (-5)/(-22/y). Calculate the highest common factor of 10 and o. 10 Let m be (4 - 6) + (178)/(-1). Let c = m + 272. What is the greatest common divisor of 24 and c? 24 Let t(z) = 9z - 1. Let u be t(3). Let x(s) = -s + 15. Let a be x(12). Suppose -2574 = -8r - ar. What is the greatest common factor of u and r? 26 Suppose 2v - 3 = v. Suppose 4w - 25 = -y, -3y + 77 = vw + 20. What is the highest common factor of 187 and y? 17 Let y = 621 - 373. What is the highest common factor of y and 8? 8 Suppose 5i - 5r + 8 - 3 = 0, 2i + 4r + 8 = 0. Let n be -122/i + -3. Let l be ((-10)/15)/((-1)/30). What is the highest common divisor of l and n? 4 Let w be ((170/4)/(-5))/((-2)/84). Calculate the highest common divisor of w and 408. 51 Suppose 145 + 244 = 19d + 180. Suppose 2h = -3h - 2y + 613, 2h = -2y + 250. Calculate the greatest common divisor of h and d. 11 Let c = -235 - -256. Calculate the greatest common factor of 987 and c. 21 Let s = 25 + -50. Let m be (-49)/(-2) + (-4)/(-8). Let f = m - s. What is the greatest common factor of 10 and f? 10 Let w = -367 + 94. Let l = w + 436. Let r be l/3 - 8/(-12). What is the greatest common divisor of 22 and r? 11 Let d(p) = 12p - 166. Let o be d(14). What is the greatest common divisor of o and 30? 2 Let d(x) = 5x2 - x - 6. Suppose -4l - 3k + 15 = -1, 9 = -l - 4k. Let j = -9 + l. Let c be d(j). Calculate the greatest common factor of 80 and c. 16 Let p be 6/(-8)6/9-10. Calculate the highest common divisor of 25 and p. 5 Let k = 9 - 9. Suppose 2v - g - 9 = k, -g = -v - 0g + 4. Let h be 13 + v/((-10)/6). Calculate the highest common factor of h and 30. 10 Suppose -483 = -27v + 20v. What is the highest common factor of 3 and v? 3 Let w(a) = -a*2 - 18a + 10. Let t be w(-13). Suppose -2x = 2h - 3h + 36, -3x - t = -2h. What is the greatest common divisor of h and 6? 6 Suppose -4z + 3h = -0h + 98, 4h = -3z - 86. Let v = -11 - z. Let i = -746 - -821. Calculate the highest common factor of i and v. 15 Suppose 10p - 3605 = -85. Calculate the highest common factor of p and 11. 11 Let h = 1133 + -1049. Calculate the highest common factor of h and 308. 28 Let i be 9 + (1/4)/(7/(-28)). Suppose -2j + i = 0, -l + j = 4l - 426. What is the greatest common divisor of 43 and l? 43 Let x be (-2)/(-8) - (-162)/24. Suppose 2z = -5m + 282, 3m - 2z - 38 = 128. What is the greatest common divisor of x and m? 7 Let d = 1241 + -1231. What is the greatest common divisor of 545 and d? 5 Let h = 96 + -91. Suppose hx - 3x - 4i = 40, 4x = -5i + 28. What is the greatest common factor of x and 6? 6 Let d(u) = u*2 - 9u + 10. Let t be d(8). Suppose 2600 = 7x - tx. Suppose -7l = -12l + x. Calculate the highest common factor of l and 13. 13 Suppose -5a + 109 = t - 291, 5a - 2t - 385 = 0. Suppose a = 4l + 23. What is the highest common divisor of l and 140? 14 Let s(h) = -h*3 + 7h*2 + 6h - 33. Let n be s(7). Calculate the greatest common divisor of n and 333. 9 Suppose 185 = 8y - 55. What is the highest common factor of 1350 and y? 30 Suppose 2v + 51 = -3k + 274, -k + 3v = -78. What is the greatest common factor of 125 and k? 25 Let z be 26/6 - 78/234. Let s(o) = o*2 + 2o - 5. Let v be ((-10)/(-2))/(-3 - -2). Let j be s(v). What is the highest common divisor of z and j? 2 Let x be (-9)/(-72) - (78/(-16) + 1). Let m(s) = -2s - 2. Let t be m(-15). Calculate the highest common divisor of x and t. 4 Suppose 0 = 5z - 3h + 4h - 725, 2h = 0. Let l = z - 33. Calculate the highest common divisor of l and 14. 14 Let v(w) = 2w*3 - 2w*2 - 6w + 5. Let p be v(3). Suppose 4b + p = 87. Calculate the highest common factor of 24 and b. 8 Let l be (-1069)/((-3)/(-6) + -1). Suppose -1421 = -2t + r, -2t - t + l = 5r. Suppose -5d = -t - 9. What is the highest common factor of d and 16? 16 Suppose -2u - d = -35, -4u = 3d - 76 + 9. What is the greatest common factor of 133 and u? 19 Let h(r) = -8r2 + r + 3. Let t(j) = 9j*2 - 3. Let z(s) = -6h(s) - 4t(s). Let n be z(-1). Calculate the highest common divisor of 132 and n. 12 Let t = 14 + 0. Let k = t - 9. Suppose 0 = 3w - 5r + 22, -2w - 13 = -2r - k. What is the greatest common divisor of 2 and w? 1 Let x be ((-6192)/301)/((-3)/70). What is the highest common factor of 15 and x? 15 Let t be 4/(-5) + -164941/(-30). What is the highest common divisor of 9 and t? 9 Let c(g) = 2g3 + 19g*2 - 18g - 4. Let n be c(-10). Calculate the greatest common divisor of n and 36. 4 Suppose -5z = -79 - 1651. Let k = z + -186. What is the highest common divisor of k and 64? 32 Suppose 8 + 27 = -5q. Let l = -3 - q. Let p = 16 + 4. Calculate the highest common divisor of l and p. 4 Let j(o) = 33o2 - 1. Let v be j(1). Suppose 28 = -4m, -60y = -62y - m + 41. What is the greatest common factor of v and y? 8 Suppose -4m + 12 = 2m. Let g be (-1)/2 - (-15)/2. Suppose 0t - 5f + g = -t, -f = -m. Calculate the highest common divisor of 6 and t. 3 Suppose -3v - 4 = q - 24, 0 = -4v + 3q + 44. Let h = 0 - -2. Suppose -hj + 120 = j. Calculate the highest common factor of j and v. 8 Suppose -i + 72 = 2g, -2g - 5i + 3i + 72 = 0. Let f be (-119)/(-9) - 8/g. What is the highest common factor of f and 91? 13 Let x = -2016 + 3385. What is the highest common divisor of 37 and x? 37 Let o = 60 - 101. Let w = -25 - o. Let a be 5/(-15) + (-13)/(-3). Calculate the greatest common divisor of a and w. 4 Suppose 9p = -0p + 576. Let v(j) = 2j + 8. Let z be v(4). What is the greatest common factor of z and p? 16 Suppose -70 = -5k - 5b, -17k + 28 = -15k - b. Calculate the highest common factor of 1162 and k. 14 Suppose -152 = -4w + 100. Let p = w - 25. What is the highest common factor of 95 and p? 19 Suppose d + 14 = -4h - 26, -59 = 2d + h	{ "pile_set_name": "DM Mathematics" }
Rearrange 7a3 + 3a - 1 - a4 + a3 + 3a4 + 2a*3 to the form da*3 + za + ua4 + h + ta*2 and give h. -1 Rearrange (w - 6w + 2w)(-6 - 13 - 3) + (-w + 2 - 2)(1 + 0 + 0) to x + ow and give o. 65 Rearrange 8t3 - 8 - 6 + 3t4 - t4 - 3t3 to z + at*3 + ct*4 + st + pt2 and give z. -14 Rearrange (-3d - d + 2d)(d2 + d2 - d2) + (-2 + d3 + 2)(-3 + 4 + 0)(-5 - 1 + 0) - 2 + 2 + 4d3 to the form yd*3 + ld*2 + ud + n and give u. 0 Express (3n + 3 - 3)(-365n2 + 729n*2 + 41 - 362n*2) in the form i + ln*2 + jn + dn3 and give j. 123 Express 635 + 634 + 638 - 2319r*2 - 1907 as ir*2 + p + wr and give i. -2319 Rearrange -7d3 + 25d*3 + 37d3 + (-d2 + d*2 - 2d*2)(1 - 1 + d) + d3 + d3 + 0d3 + 2d*2 + 22d to q + rd3 + cd + wd2 and give w. 2 Rearrange 57 + 23 + 305 + 99 - f to nf + u and give u. 484 Rearrange 2q - q - 2q + (-5 + 7 + 1)(2q - 2q + 2q) - 2q + 3q + 6q to the form b + xq and give x. 12 Rearrange 3j - 7j + 2j - 76j*2 - 87j*2 + 2 + 34j*2 to sj + wj2 + b and give w. -129 Rearrange (1 - 1 + 3)(1 - 2 + 2)(0 - 3 + 5)(0 - 5 + 0)(-21s*2 + 24s*2 - 2s + 7s) to the form qs*2 + vs + j and give v. -150 Rearrange ((9 + 2 + 0)(-2 + 2 - 2) + 12 + 5 + 28 - 2)(3w - w - 4w) to qw + z and give q. -42 Rearrange 842h4 + h3 + 3h2 + 4h*3 - 844h*4 + 1 - 6h to the form mh4 + ah*2 + th*3 + w + ch and give t. 5 Express (-2 + 0 + 2194s - 2581s)(-1 - 1 + 5) as ns + v and give n. -1161 Rearrange (34 + 24 - 16)(-4k + 7 - 7) to lk + o and give l. -168 Express 2g + 31 - 31 + 165 as dg + r and give d. 2 Express (-r - 3r + 5r)(-4r + 3r - 2r) + ((0 + 2 + 0)(r - 3r - 3r) + 2 - 2 + r)(5r + r - 4r) in the form u + mr + pr2 and give p. -21 Express (1 - 4v*4 - 1)(-1 + 10 - 1 + 2 + 0 - 3 - 2 + 4 - 1 + (-3 - 1 + 3)(5 + 1 - 5) + 3 - 6 + 1) in the form j + av*3 + hv*2 + iv + ov4 and give o. -20 Express (5548 + 5985 - 401 + 6736 - 4498)(-3d3 + 6d*3 - 4d*3) as cd + md2 + pd3 + y and give p. -13370 Rearrange 62 + w3 + 10w + 66 - 126 to xw + tw3 + i + zw*2 and give i. 2 Express (-w + 0w + 0w)(0w3 - 4w*3 + 3w*3) - 26w + 58w - 30w - 30w4 as n + zw*3 + pw*4 + sw + hw2 and give s. 2 Rearrange (3 - 3 - 2s)(-4s + s + s + 9s - 4s + 4s + (-2 + 5 - 2)(5 - 5 - s) - 2s + 7s - 3s) to the form b + rs + ns2 and give n. -16 Express 2 + 10r*3 - 7r*3 + 4r2 - r2 - 3r4 - r3 + 0r*3 as br*2 + hr*4 + j + tr + gr3 and give g. 2 Express -11z*2 - 36z*2 + 15z*2 + (4z - 5 + 5)(0z + 2z + z) as nz*2 + hz + i and give n. -20 Express -6 + 0 + 21n + 1 + 3 as hn + i and give h. 21 Rearrange 4w + 9w - 318 + 312 to r + hw and give h. 13 Express -479 - 1383q + 2758q - 1373q as o + jq and give j. 2 Rearrange (-2l*2 + 3l*2 - 4l*2 - l)(-45 - 81 + 13 + (-1 + 3 - 3)(6 - 4 - 1)) to the form bl + a + vl2 and give v. 342 Rearrange -134d + 6d3 + 130d - 2 + 2 + d*2 to the form qd + vd3 + jd*2 + z and give q. -4 Rearrange 4g*2 - 2g*3 - 4g*2 + (-83g + 235g - 95g)(-3g*2 - 4g2 - g2) to the form hg + b + fg*2 + dg*3 and give f. 0 Express -113w + 229 - 229 + (-7 + 27 + 18)(0 + 0 - w) - 2 + 0 + 2w - w as s + tw and give t. -150 Rearrange (3s - 1 - 14 - 2s)(-119 + 36 + 54) to z + ks and give k. -29 Rearrange w3 + 0w*2 + 3w*3 - 17474w + 0w2 + 17476w to the form h + tw + sw*2 + dw*3 and give s. 0 Rearrange -163 + 341 + 1455r - 178 + 731r to l + jr and give j. 2186 Express 2g - 10g*3 + 4 + 6g*3 + 3g*3 - 6g*3 as wg*3 + kg + sg2 + j and give k. 2 Rearrange d3 - d3 - 4d*3 - 34d + 2d3 - 4d*3 - 1 to g + zd + vd2 + hd*3 and give z. -34 Rearrange -42w*3 + 101w*2 - 49w*3 - 99w*2 to aw*2 + rw + lw3 + z and give l. -91 Rearrange -23i*3 + 2i + 1 - 532i4 + 530i*4 - 13i*3 to mi*2 + xi + bi4 + oi*3 + u and give o. -36 Rearrange -32d - 199d2 + 32d + 6d2 to jd + m + yd2 and give y. -193 Rearrange -246n4 + n3 + 121n4 - 21n - 2 + 124n4 + 8n + 4n to wn*2 + x + an*3 + vn + pn4 and give p. -1 Rearrange (-15q*2 - 19q*2 + 32q*2 - 3q*3)(-27 - 20 - 17) to the form l + tq3 + rq + cq2 and give t. 192 Rearrange 3 - 13q4 - 6 - q3 + 10q4 + 4q + 3q4 - 2q*4 to kq + zq4 + a + oq*3 + dq*2 and give a. -3 Rearrange 2 - 17g*3 - 25g*2 - 18g*3 + 9g*2 + 30g*3 - 17g*2 to mg*2 + y + jg + pg3 and give p. -5 Express (-2 - 2 + 5)(0 - 3 - 2)(12d + 57 - 57) in the form k + cd and give c. -60 Express -6264 + 6273 + 4q*3 - 8q*3 in the form d + aq*3 + jq*2 + sq and give a. -4 Rearrange (-24 - 29 + 4)(-3v + 3v - 3v + (-4 + 6 + 0)(1 - 3v - 1) + 3v - 3v - 2v + 0v + 4v - 5v) to uv + b and give u. 588 Rearrange -1 + 107k + 119k + 10k*3 - 242k to x + ck3 + jk + lk2 and give c. 10 Rearrange (-2 + 6 + 0)(29g + 40g + 10g) to the form n + fg and give f. 316 Express 4a2 + 3a*4 + 3a*3 - 2a*2 + 7 + 2a - 3a - a4 as oa*2 + la*4 + ia*3 + y + ra and give l. 2 Rearrange -25k + 27k + 228k to y + hk and give y. 0 Express 8c3 + 40c*2 + c - 42c*2 - 18c*4 + 7c*4 in the form zc + nc2 + bc*3 + jc*4 + k and give k. 0 Express (75v - 75v - 54v*2)((4v + v - 4v)(5v - v - 3v) + v2 + 3 - 3 + 0v*2 + 0v*2 - 12v*2) as nv + m + fv2 + zv*3 + tv*4 and give n. 0 Rearrange (3r + 4r - 6r)(-3 + 2r + 3) - 2r2 + 3r*2 + 0r*2 - 268r*2 - 2098r*2 + 237r*2 to zr + sr2 + q and give s. -2126 Express 156 + 0m + 0m + 3m + 126 as d + ym and give y. 3 Rearrange 0 - 4 - 8r - r to the form ur + x and give u. -9 Rearrange -2 + 6 - 196u - 4 - 204u to the form t + hu and give h. -400 Express 0x - 1614x*3 - x + 1612x*3 as px*2 + zx + m + vx3 and give z. -1 Rearrange -4i*3 - 718i*4 + 7i + 719i4 + 0i*3 - 1 to the form gi + b + hi3 + ui*2 + mi*4 and give g. 7 Express 4 + 1273h - 668h - 4 + 4h*2 - 673h in the form nh + y + xh*2 and give y. 0 Express (1 + 4 - 7)(2 + 1 - 5)(-9 + 10 + 4o - 3) as ko + h and give h. -8 Express -2 + 41b*3 - 76b*3 - 23b + 32b3 as cb*2 + mb*3 + jb + z and give j. -23 Express -42j + 0j - j - 43j + 3j*2 as hj + qj2 + v and give h. -86 Rearrange -33l*3 + 13 + 3l2 + l - l2 + 34l3 to rl + zl3 + xl*2 + o and give r. 1 Rearrange (-3r + 0r + 0r)(-r + 4r - 6r) + (r + 0r + 2r)(3r - r + 0r) to the form fr2 + kr + z and give f. 15 Rearrange (0 + 3 - 2)((n - 2 + 2)(-3 - 1 + 5) + 43415 + 242n - 43415)(-n*2 + n - n) to the form kn*2 + mn + jn3 + s and give j. -243 Rearrange 2l*3 + 71 + 11l*2 - 4l*3 - 4l*4 - 70 - 10l*2 to the form yl*3 + al*4 + gl*2 + r + fl and give a. -4 Express 4u3 + 26u*4 - 2304u*2 - 5u*3 + 2290u*2 + u as ku + au2 + qu*3 + n + yu*4 and give y. 26 Express 3f*2 + 3f*2 + 6f*4 - 5f*2 + (2f*2 - 2f2 + f3)(-8f + 3f + 19f - 4) in the form of4 + x + nf*2 + mf*3 + cf and give c. 0 Express 0 - 39972j4 + 0 - 17j + 4j + j2 + 39969j*4 as dj*3 + fj + m + uj4 + vj*2 and give v. 1 Express -1 - 3p*4 - 1115p*3 + 1115p*3 - 3p*2 in the form up + y + rp3 + bp*2 + op*4 and give o. -3 Express 5s*3 - 3s*3 + 4s*3 + 488 - 465 as fs*2 + ts + ls3 + r and give r. 23 Express -19c*3 + 2 + c - 3 + 17c*3 - 20c*4 + 26c*4 - 2c*2 in the form wc*4 + nc*2 + uc + jc3 + b and give n. -2 Express (0o*2 - 2o*3 + 0o*2)(-1 + 2 + 0) - o*2 - 15o*3 + 3o*2 + 6o2 + o2 as fo + so*2 + ao*3 + d and give a. -17 Express -264m2 - 112 + m3 + 129m2 + 136m*2 in the form jm + im2 + t + sm*3 and give i. 1 Express (-473 - 1804 + 435 - 395)(h - h - h*2 + 1) as r + mh*2 + jh and give r. -2237 Rearrange 1448y4 - 1454y*4 - 3y*2 + 4y*2 + 2y*3 - 5y + 1 + 0y2 to the form oy*3 + py*4 + zy + cy2 + f and give c. 1 Express -l - 2l*2 + 0 - 2l - 20 + 50 + 40 as dl + ul*2 + c and give c. 70 Express 0 - 2 + 7 - 36o - 3 - 4 as j + x*o and give x.	{ "pile_set_name": "DM Mathematics" }
3 - y2. 181y3 - y2 Collect the terms in 113538 + 114039 - 227577 + d. d Collect the terms in -712 + 1396b*3 + 133b*3 + 712 - 359b*3. 1170b*3 Collect the terms in -350t - 204 + 75 + 71 + 57. -350t - 1 Collect the terms in 2132g - 20190g - 2743g. -20801g Collect the terms in 206z*3 + 181z*3 + 185z*3 + 192z*3 - 787z*3. -23z*3 Collect the terms in 9 + 37n*2 - 34n*2 + 122292697n - 122292697n - 9. 3n*2 Collect the terms in 228c*3 + 408c*3 + 319c*3 + 352c*3 + 84c*3. 1391c*3 Collect the terms in 83 + 137 + 185 + 29v - 27v. 2v + 405 Collect the terms in 330s2 + 320s*2 + 318s*2 - 1321s*2 + 333s*2. -20s*2 Collect the terms in 4927z*3 - 1714z*3 + 2z - 1708z3 - z - 1618z*3. -113z*3 + z Collect the terms in 29065c - 7923c + 48130c. 69272c Collect the terms in -1101a*2 - 5a + 111a2 - 24a + 38a - 9a. -990a2 Collect the terms in 9643 + 315y + 9650 - 19293. 315y Collect the terms in -199 + 86 + 2876c*3 + 113. 2876c*3 Collect the terms in -12 - 142g*3 + 47g*3 + 91g*3. -4g*3 - 12 Collect the terms in 37723g*3 - 6155g*3 - 3109g*3 + 32844g*3 + 19694g*3. 80997g*3 Collect the terms in 270b*2 - 177b*2 - 720b*2 - 1278b*2. -1905b*2 Collect the terms in 12r*2 + 100221r + 100223r - 200437r. 12r2 + 7r Collect the terms in 72m - 93m - 12m2 + 108m - 93m. -12m*2 - 6m Collect the terms in -734 + 13d + 2168 - 713 - 716. 13d + 5 Collect the terms in -262i + i2 + 523i + 113 - 251i. i2 + 10i + 113 Collect the terms in 3 - 3046w2 - 7w + 4w - 5 + w. -3046w*2 - 2w - 2 Collect the terms in -16x2 - 24297 - 24315 + 97243 - 24312 - 24319. -16x*2 Collect the terms in -40 - 412a*3 - 95a*2 + 40 + 95a*2. -412a*3 Collect the terms in -322533 + 95c*2 - 63c*2 + 322533. 32c*2 Collect the terms in 13 - 156f + 16f2 + 320f - 33 - 164f + 20. 16f*2 Collect the terms in 5232 - 15680 - 104o + 5225 + 5223. -104o Collect the terms in 2424t*2 + 415t*2 - 914 + 899. 2839t*2 - 15 Collect the terms in 128u - 24u3 - 45u - 14u3 + 6u*3 - 82u. -32u3 + u Collect the terms in -94537h*2 + 189103h*2 - 94567h*2 + 112h*3. 112h3 - h2 Collect the terms in -46908g - 33361g - 681026g. -761295g Collect the terms in 423 - 466w - 135 - 150 - 135. -466w + 3 Collect the terms in 3f + 876f*2 - 8f - f + 11. 876f2 - 6f + 11 Collect the terms in -517 + 87l - 32l + 16l + 44l + 176. 115l - 341 Collect the terms in 6 + 57r*2 - 24r*3 + 28 + 9r*3 - 57r*2 + 6 + 14r3. -r3 + 40 Collect the terms in 348845s2 + 3 - 1 + 348924s*2 - 2 - 697768s2. s2 Collect the terms in -96c3 - 69648c + 198c3 - 105c*3 + 69332c. -3c3 - 316c Collect the terms in 0w2 + 3125w - 780w - 783w - 778w - 7w*2 - 784w. -7w2 Collect the terms in 18974986k - 9487510k - 9487491k. -15k Collect the terms in 0 - 24n + 0 - 34n + 58n + n3 + n3. 2n3 Collect the terms in -19107s*3 + 16025s*3 + 1 - 61s*2 + 61s*2. -3082s*3 + 1 Collect the terms in 35p*3 + 5 - 69p*3 - 39 + 29p*3. -5p*3 - 34 Collect the terms in -25p*3 - 26p*3 - 1378978p*2 + 4p*3 + 1378978p*2. -47p*3 Collect the terms in 13z + 14352z2 - 8z - 14354z2 + 8z. -2z2 + 13z Collect the terms in 348n2 + 80652n*3 - 348n*2. 80652n*3 Collect the terms in -3191u*2 - 8u + 6421u2 - 3213u*2 + 8u. 17u2 Collect the terms in -91c - 64 - 47 + 132 - 19. -91c + 2 Collect the terms in -267 + 208r*3 - 67r*3 - 72r*3 + 267 + r - 73r*3. -4r*3 + r Collect the terms in 219p*2 + 292p*2 - 3251p*3 - 511p*2. -3251p*3 Collect the terms in -2524282o*3 - 432443o*3 + 737557o*3. -2219168o*3 Collect the terms in 386874c*2 + 351001c*2 + 23735c*2 + 34825c*2. 796435c*2 Collect the terms in -2h - 212764 - 45327 - h + 2h2 + 3h. 2h2 - 258091 Collect the terms in 2609d - 5252d + 2593d. -50d Collect the terms in -265525 + 13417s*2 + 4638s*2 + 265524. 18055s*2 - 1 Collect the terms in -14a - 14a + 500a + 202a + 108a. 782a Collect the terms in -3391 - 1282g*3 + 3391 + 1342g*3. 60g*3 Collect the terms in -59z*3 + 17z*3 + 228z*3 - 103z*3 + 68z*3. 151z*3 Collect the terms in 15517g*2 - 15516g*2 - 98571g + 98573g. g2 + 2g Collect the terms in 14738744a - 14738743a - 3 + 3. a Collect the terms in -10801o + 44637o + 56727o. 90563o Collect the terms in 40m - 20m + 0m - 25m + 4m. -m Collect the terms in -3258g*3 + 1096g*3 - 14 + 998g*3 + 1079g*3 + 14. -85g*3 Collect the terms in -609t*2 - 21t*3 - 8t*3 + 5t - 606t2 - 7t + 1819t2 - 604t*2. -29t*3 - 2t Collect the terms in -124374u + 248712u - 124320u - 3. 18u - 3 Collect the terms in 1661 + 1900 + 38t - 3561. 38t Collect the terms in 63379y2 - 126391y*2 + 62914y*2. -98y*2 Collect the terms in 12853 - 12853 - 42l. -42l Collect the terms in 2581 + 2574 + 65a - 62a + 2571 - 7726. 3a Collect the terms in 142641d - 284902d + 142257d. -4d Collect the terms in -21u2 + 19u*2 + u - 844 - 2u. -2u2 - u - 844 Collect the terms in 137g + 49g + 113g + 115g. 414g Collect the terms in 13967i - 26874i + 12871i. -36i Collect the terms in -595582 - 12z2 + 297843 + 297813. -12z2 + 74 Collect the terms in d2 - 2546d + 173d + 2221d + 152d. d*2 Collect the terms in 139v - 39v + 3 - 35v - 307v2 + 282v*2 - 65v. -25v2 + 3 Collect the terms in -8140o + 4069o + 542 + 4074o + 2o2. 2o*2 + 3o + 542 Collect the terms in -2n2 + n2 - n2 - n + 2n*2 + 24228n*3. 24228n*3 - n Collect the terms in 105 - 22d*3 - 5d*3 + 25 + 4d*2 + 25d*3. -2d*3 + 4d*2 + 130 Collect the terms in -831162 + 416094 + 415068 - 9g*3. -9g*3 Collect the terms in -4033k + 7554k - 4053k. -532k Collect the terms in 31023i - 14273i + 18737i. 35487i Collect the terms in -10 - 14 - 7 - 31v - 8 + 105v. 74v - 39 Collect the terms in -6 + 3206u3 - 1555u*3 - 1647u*3 + 10. 4u*3 + 4 Collect the terms in -87624 + 87624 - 2y*3. -2y*3 Collect the terms in 34o*3 - 8o*3 - 13o*3 - 14o*3 + 2 + 4963o2. -o3 + 4963o2 + 2 Collect the terms in -1967f*2 - 10f - 1943f2 + 3977f*2. 67f*2 - 10f Collect the terms in -90203 - 3r2 - r + 0r - 11r2 + 90203. -14r*2 - r Collect the terms in -2 - 70o - 92o + 547o*2 - 1 - 224o. 547o2 - 386o - 3 Collect the terms in -21z3 - 1765 - 1689 - 1767 + 5221 + 26z*3. 5z*3 Collect the terms in 6 - 38932k*2 + 2k - 417743k2 - 7 + 1. -456675k*2 + 2k Collect the terms in -15075469b2 + 15075469b*2 + 25741b*3. 25741b*3 Collect the terms in -41d*2 - 3 - 7 + 42d*2 + 10 + 1 - 84d*2. -83d*2 + 1 Collect the terms in 715j*3 - 2726j*3 + 1115j*3. -896j*3 Collect the terms in 26740 - 80219 + 26734 + 26745 + 14j*3. 14j*3 Collect the terms in 890 - 3578 + 890 + 888 + 910 - 5w*2. -5w*2 Collect the terms in 14x*2 + 16x - 25 + 6x + x + 1. 14x*2 + 23x - 24 Collect the terms in 551t + 2 + 328t - 1487t + 561t - 2. -47t Collect the terms in 189903481119v - 3v2 - 189903481119v + 18v2. 15v*2 Collect the terms in -14 + 14a - 108a2 + 99a*2 - 24. -9a*2 + 14a - 38 Collect the terms in 45f - 1792 - 145f + 46f - 2204 + 52f. -2f - 3996 Collect the terms in 564252s - 281961s - 282283s. 8s Collect the terms in 1978910 - 36c*2 + 93c*2 - 3c - 1978909. 57c2 - 3c + 1 Collect the terms in 41n2 + 7205n + 224 - 224. 41n2 + 7205n Collect the terms in -290i3 - 1 - 31i*3 - 4i + 354i3 + 4i - 41i3. -8i*3 - 1 Collect the terms in -5 + 11 + 78o*3 + 47o*3 + 1. 125o*3 + 7 Collect the terms in 4635v + 9173v + 3745v. 17553v Collect the terms in -25y - 14y3 + 53y + 11680104y2 - 28y - 11680104y2. -14y*3 Collect the terms in 967f*3 - 205882f + 102936f + 102946f. 967f3 Collect the terms in -1223z*2 - 199z - 44z - 88z*2 + 122z + 121z. -1311z*2 Collect the terms in 510312693 + 83z - 510312693 - 78z. 5z Collect the terms in -279y3 + 281466869y - 281466869y. -279y*3 Collect the terms in -83 + 3929d -	{ "pile_set_name": "DM Mathematics" }
u - 63u - 828. What is the remainder when u is divided by 9? 3 Let n = -115 + 153. Let y be (1 - -45)/((-4)/(-2)). Let u = n - y. What is the remainder when 43 is divided by u? 13 Suppose -42 = -30t + 23t. Suppose 0 = 2v - 5i + ti - 19, 0 = 5v + 5i - 35. Let a = 235 + -165. Calculate the remainder when a is divided by v. 10 Let v = 721 + -382. Calculate the remainder when v is divided by 374/17 - (1 + 1). 19 Suppose 0 = -9i + 48 + 60. Suppose ip - 135 = 11p. Calculate the remainder when p is divided by 36. 27 Suppose -8g + 51 = 11. Suppose gs - k = 2s + 20, -5k + 19 = 2s. Suppose 0 = -5u - 0u + 240. What is the remainder when u is divided by s? 6 Let c = -312 - -270. Calculate the remainder when 19 + 11/(77/c) is divided by 3. 1 Suppose 0 = 4d + 4k - 952, 243 = -30d + 31d + 2k. Calculate the remainder when 483 is divided by d. 17 Let g be (-12)/(-6) + 6/2. Suppose gx = 40 - 170. Let c = 39 + x. What is the remainder when 24 is divided by c? 11 Let y = 3429 + -3305. Calculate the remainder when 641 is divided by y. 21 Suppose j - 12v = -8v + 754, 0 = 2j + 3v - 1574. What is the remainder when j is divided by 13? 11 Suppose f - 103 = 3d, 4f + 2d + 3d - 480 = 0. Calculate the remainder when f is divided by 2 + (-9)/6 - (((-3395)/70 - -29) + 11). 7 Suppose o = 5o - 4w - 188, -92 = -2o + w. Suppose 0 = -7i + 2i + o. Suppose 0s + 4s = -k + 4, 3s = -i. Calculate the remainder when k is divided by 4. 0 Suppose -3c + 4w + 15451 = 0, -2c - 5162 = -3c - w. Calculate the remainder when c is divided by 29. 24 Suppose -3h = 2p - 269, 0 = 3p - 2p - 4. Let o = -113286 - -113459. Calculate the remainder when o is divided by h. 86 Suppose 157w = -113w + 4320. What is the remainder when 3183 is divided by w? 15 Let z(j) = 397j - 765. Let v = -106 + 170. Let u = v - 46. What is the remainder when z(2) is divided by u? 11 Let m = 14845 + -14843. Suppose 0 = h - 6h + 45. Let s = h + -8. Calculate the remainder when m is divided by s. 0 Let c be (105/28)/(6/40). Suppose 30g - cg = 245. Calculate the remainder when g is divided by 37. 12 Let l = 25 - 24. Suppose p + l - 2 = 0, -5i = -5p - 10. Suppose ib + 16 = 103. Calculate the remainder when b is divided by 16. 13 Let u(q) = 5q - 8q + 20q*2 + 4q - 9 + q. Let j be u(3). Suppose 5y - 32 = -3l + j, 337 = 4l - 5y. Calculate the remainder when l is divided by 41. 37 What is the remainder when 322 is divided by 3/(-5) - (-3 - 1344/15)? 46 Suppose -3a + 109 - 16 = 0. What is the remainder when 388/(-28)(-46 + (-4 - -43)) is divided by a? 4 Calculate the remainder when 564 is divided by 6(2/10)/((-16)/(-2120)). 87 Calculate the remainder when 6204 is divided by (99/55)/(1090/(-100) + 11). 12 Suppose p - 227 = 101. Suppose -p = -8n + 288. Calculate the remainder when 145 is divided by n. 68 Let c = 161 - 167. Calculate the remainder when (c/(-4))/(-3 + 321/106) is divided by 8. 5 Let j = -4741 + 4975. Calculate the remainder when j is divided by 102. 30 Let r(m) be the second derivative of 2m3/3 - 23m*2/2 + 9m. Let h be r(7). Calculate the remainder when 86 is divided by (23 - (-1 - 1)) + h. 26 Suppose 0 = -5o + 4c + c + 3400, -2o + 1368 = 2c. What is the remainder when o is divided by 223? 13 Suppose -4c + 12 = 32, 3t = 2c - 8. Let b(a) = 4a*2 + 12a + 4. Calculate the remainder when b(t) is divided by 13. 11 Suppose -183o + 59o = -80o - 2332. Calculate the remainder when 1003 is divided by o. 49 Let z(o) = o3 + 24o*2 + 2o + 83. Suppose 4j + 65 + 31 = 0. Calculate the remainder when 135 is divided by z(j). 30 Let w = 1 + 1. Suppose 0g + b + 625 = 4g, -2b = -g + 151. Let t = 160 - g. What is the remainder when t is divided by w? 1 Suppose 10i - 2279 = -9i - 1937. What is the remainder when 27753 is divided by i? 15 Let x = -59 + 51. Let b be (2/(x/(-20)))/((-4)/40). What is the remainder when 14 is divided by (b/4 + 5)4/(-5)? 2 Suppose -13x - 362 = -15x + 4k, -k - 182 = -x. Calculate the remainder when x is divided by 31. 28 Suppose 1130q - 5100 = 1110q. What is the remainder when q is divided by 32? 31 Suppose -9b - 59d + 1366 = -57d, -3b - 5d = -451. Calculate the remainder when 928 is divided by b. 16 Suppose -160 + 529 = r. Suppose -c = 4x + 2c - r, 5x - c = 447. What is the remainder when x is divided by 33? 24 Suppose -32 = -2d - 5w, 4d - w - 44 = 2d. Suppose d = -5j + 8j. What is the remainder when 28 is divided by (j - 4/1) + 13? 12 Let i(u) = 4u + 19. Let d be i(-7). Let a = -63 + 85. What is the remainder when 2/d + 14616/81 is divided by a? 20 Let i = 116 + -114. Let u be (2 - 1)(-2 + i)/3. Suppose -5f + 3m + 111 = u, -2f + f - 4m = -13. Calculate the remainder when 40 is divided by f. 19 Suppose -4x + 3c = 363, -5x + 4c - 216 - 237 = 0. Let a = x - -118. What is the remainder when (14/5)/((-6)/(-105)) is divided by a? 24 Calculate the remainder when -1518/1897(-120 + -1) is divided by 241. 5 What is the remainder when 272 is divided by (2 - 144/(-15))/(17/85)? 40 Let d(z) = z*3 - 11z*2 - 8z + 203. Calculate the remainder when d(11) is divided by 90. 25 Suppose 15 = -3v, -25v = 10r - 24v - 64945. What is the remainder when r is divided by 38? 35 Suppose -2y = -q + 34, 4q - y + 0y - 136 = 0. Calculate the remainder when q is divided by 23 + 4 + -6 - (-2 - -3). 14 Suppose 5785 + 20 = 45k. Suppose n = -5t + 39, -n + 6n = 5t + 75. What is the remainder when k is divided by n? 15 Suppose 12v - 1348 = -736. Calculate the remainder when v is divided by (4 - 15)/(1 - (-2 - -4)). 7 Suppose 2k - 108 = 6k. Let m = 43 + k. Calculate the remainder when m is divided by (-5)/((-10)/(-8)) + 38 + (-43 - -12). 1 Suppose 3w = 5d + 4867, 5w + 11d - 8149 = 14d. What is the remainder when w is divided by 39? 35 Suppose 0 = -4u + 5z + 70, 220u - 4z + 22 = 222u. What is the remainder when 1107 is divided by u? 12 Suppose 0 = -23z - 67z + 24390. What is the remainder when z is divided by 267? 4 Calculate the remainder when 18645 is divided by ((-11529)/(-305))/((-6)/(-20)). 123 Suppose 66 = 13k - 0k + 1. Calculate the remainder when 457 is divided by k. 2 Let d = 238 + -233. Calculate the remainder when 471 is divided by ((-215)/d(-2 - -1))/1. 41 Suppose -6x = -25x + 14763. Suppose -m - 20m = -x. What is the remainder when 702 is divided by m? 36 Suppose 0 = 7k + 9k - 32. What is the remainder when 347 is divided by (k + (-423)/(-6))4/5? 57 Let q be 9/1 - 60/12. Suppose 0 = -4a - 8, -3n = -qn + a + 39. What is the remainder when 108 is divided by n? 34 Let z be (-11 - -1)3/(-6). Let s be 9z/302. What is the remainder when 73 is divided by (10(5 - s))/(3 + -2)? 13 Suppose 0v + 2v = 544. Let i = -114 + 166. Suppose 0 = 4a - v + i. What is the remainder when a is divided by 15? 10 Suppose 5d - 18h = -14h + 99, 0 = -d - h + 18. What is the remainder when 24(-5)/((-15)/33) is divided by d? 17 Suppose 45y - 26341 - 50 = 14784. Calculate the remainder when y is divided by 297. 24 Let z = 561 - -3617. What is the remainder when z is divided by 22? 20 Suppose -2h = 3b + 16, 3b + 18 = 6. Let u(s) = -13s - 23. Let x be u(h). What is the remainder when 23 is divided by (x/(-9))/(6/(-144))? 7 What is the remainder when ((-15)/(-15))/((-5)/80)(-517 + 3) is divided by 121? 117 Let f(w) = -792w - 2021. What is the remainder when f(-5) is divided by 108? 103 Suppose j + 18 - 933 = 0. Let s = 26 - -15. Calculate the remainder when s is divided by 4/6 + j/45. 20 Suppose -5n = -3n - k - 42, -n - 2k + 31 = 0. Suppose 2m - 2w = 13 + n, 4w = -m + 23. What is the remainder when 64 is divided by m? 7 Suppose 4z - 162 = -3w, z + 4w + 109 = 4z. Suppose -6n + 105 + z = 0. Calculate the remainder when 334 is divided by n. 22 Suppose -y + 187 = 2s + 2y, y - 359 = -4s. Calculate the remainder when s is divided by (-1)/(55/99)(-80)/6. 17 Suppose 0 = -2w - 17 + 27. Suppose -6b - 2d = -wb - 213, d = 3b - 618. What is the remainder when b is divided by 70? 67 Suppose 5x - 11340 = 2s + 6249, 3s = -3x + 10566. Calculate the remainder when x is divided by 88. 87 Suppose -23 = -427i + 426i - 3k, -3i - k + 117 = 0. What is the remainder when i is divided	{ "pile_set_name": "DM Mathematics" }
= -0.1576 - 747.8424. Let x = l + 747.99997415. What is x rounded to 6 dps? -0.000026 Let o = -0.622357497 + 0.29565993. Let m = o - -0.3267. Round m to 6 dps. 0.000002 Let q = -0.2214 - -77.1294. Let x = q - 77. Let m = x - -0.1315. What is m rounded to three decimal places? 0.04 Let c = 16 - 44. Let x = 3 - c. Let s = x - 32.8. Round s to the nearest integer. -2 Let u = 14748 - 14748.000019639. What is u rounded to seven dps? -0.0000196 Let u = -11088 + 11088.06711. Round u to 2 dps. 0.07 Let k = 19.75671813 + -19.757. Round k to four dps. -0.0003 Let l = -0.032 + 0.508. Let v = -0.034 - l. Let g = 0.50999972 + v. Round g to 7 decimal places. -0.0000003 Let x = 0.3948 + -0.536. What is x rounded to two dps? -0.14 Let m(i) = -69i3 + 4i2 - 6. Let y be m(-2). Suppose 129 - y = -k. Let c = -633 + k. What is c rounded to the nearest 100? -200 Let o = -68899073.8713743203659 - 891650969617.1286251126341. Let a = -891719867995 - o. Let i = 696 - a. What is i rounded to 7 decimal places? 0.0000006 Let f(d) = d2 - 6d - 23. Let s be f(9). Suppose 4a = -3l + 4994, -2l + 7732 = sa + 2736. What is a rounded to the nearest 100? 1300 Let s = 2173.9999987575 - 2174. What is s rounded to 7 decimal places? -0.0000012 Let c = 0.33 - -8.67. Let m = -119 - c. Let h = 127.999941 + m. What is h rounded to five decimal places? -0.00006 Let d(c) = -4c*2 - 3c*2 + 8c*2 - 20 + 16. Let u be d(0). Let t be 758/10 - -1u/(-20). What is t rounded to the nearest 10? 80 Let f = 103.53 + -91.1. Let k = -12.6 + f. What is k rounded to two decimal places? -0.17 Let o be -909941 - (-567)/271. Round o to the nearest 10000. -910000 Let h be 3(-6)/(-3)(-40)/(-15). Suppose -hc + 13c = 588. Let g = c - 1154. What is g rounded to the nearest 100? -1400 Let k = -0.2083 + 0.37687. What is k rounded to three dps? 0.169 Let u = -3025.2 + 3022. Let q = -1131812.17999713 + 1131815.38. Let c = u + q. Round c to six decimal places. 0.000003 Let z = -792.061411 - -792.1. What is z rounded to four dps? 0.0386 Let z = 0.21767 - 0.2211095. What is z rounded to four decimal places? -0.0034 Suppose 187c - 75c + 5529596 = -100c. Round c to the nearest one hundred. -26100 Let z = -91903363885 - -91903425281.899941. Let t = -61395.6 + z. Let k = 1.3 - t. What is k rounded to five decimal places? 0.00006 Let y = -0.024972 + 0.0177559. Round y to three dps. -0.007 Let q = 702.61 + -1743. What is q rounded to the nearest one hundred? -1000 Let m(d) = -79d2 + 21d - 26. Suppose 0y + 6y - 132 = 0. Let k be m(y). Round k to the nearest 1000. -38000 Let m = -6766 - -6766.00014923. Round m to 6 dps. 0.000149 Let g = -8728.1382 + 8727. Round g to one dp. -1.1 Let g = -13.599 - -13.5975455. Round g to five decimal places. -0.00145 Let m = 268465288 - 268465288.225000938. Let p = m - -0.225. What is p rounded to 7 decimal places? -0.0000009 Let k = 2.6 + -0.3. Let c = 20.85 - k. Let l = -2.05 - c. What is l rounded to the nearest integer? -21 Suppose 13 = y + 8. Suppose -yn = -n - 15599968. Suppose 5 = a + 1, -2a = t + n. What is t rounded to the nearest one million? -4000000 Let w = 2137.5 + -2288.652. Let h = w - -151. What is h rounded to 2 decimal places? -0.15 Let j(i) be the second derivative of i*3/6 - 4i*2 + 16i. Let s be j(-10). Let b be ((s/(-4))/(-9) + 1)358. What is b rounded to the nearest 10? 180 Let t = -33.4 - -6.4. Let b = 26.5 + t. Let s = b - 52. What is s rounded to the nearest ten? -50 Let k = 235.508 - 0.508. Let r = k - 228.35. What is r rounded to 1 dp? 6.7 Let o = 0.7 + -0.3. Let s = 0.411 - o. Let z = 0.016 + s. What is z rounded to two dps? 0.03 Let k = 4886.78 - 4932. Let o = 45 + k. Let g = o + -0.2. What is g rounded to 1 decimal place? -0.4 Suppose 3m = 4b - 240 + 3, 4b - 5m - 235 = 0. Let k = 61 - b. Let f(y) = 6101y3 + y2 - 2y. Let v be f(k). Round v to the nearest one thousand. 6000 Let u = -7307.6 + 6057. What is u rounded to the nearest 10? -1250 Let x = -8421.99999566 + 8422. Round x to 6 decimal places. 0.000004 Let v = 0.004 + -1228.004. Let d = -1227.9999449 - v. Round d to five dps. 0.00006 Let l = -914 + 1280. Let b = 1033724350.9999829 - 1033723985. Let m = l - b. Round m to 6 decimal places. 0.000017 Let i = -2.6736 + 2.7. Let w = i - -4.3136. Round w to 1 dp. 4.3 Let m = 704.95945 + -1.14945. What is m rounded to the nearest integer? 704 Let v(m) = -58911m + 157. Let u be v(-13). Round u to the nearest 100000. 800000 Suppose -5s = g + 4366, 0s = -5g + 2s - 21911. Let b = -1211 - g. Round b to the nearest 10000. 0 Let k(n) = -919n2 + 4n - 1. Let b be k(3). Let a = 19464 + b. Suppose -l + 5r - a = 7r, 5l + 2r = -56004. Round l to the nearest 1000. -11000 Let y = 780.52525 + 0.07475. What is y rounded to the nearest 10? 780 Let v = -5946534.69125 - 16.30875. Let p = v + 5946597.000005. Let u = p - 46. Round u to five decimal places. 0.00001 Let f(n) = -5n + 142. Let c be f(29). Let j be ((-20)/(-3))/(3c/5332500). Round j to the nearest one million. -4000000 Let k = 0.528 + -169.728. Let j = k - -169.200000691. Round j to 7 dps. 0.0000007 Let z = -154103 + 80027. Round z to the nearest ten thousand. -70000 Let f = -1647069.99792 + 1646917. Let p = f - -153. Round p to four decimal places. 0.0021 Let x = -244.6 - 48.4. Let a = -292.23 - x. What is a rounded to the nearest integer? 1 Let d = -18775.00000044623 - -18775. What is d rounded to 7 dps? -0.0000004 Let y = 4139345 - 1884045. What is y rounded to the nearest 100000? 2300000 Let o = -0.0386 - 1.538. Round o to 2 decimal places. -1.58 Let f = -9330 - -9330.7663. Round f to 1 decimal place. 0.8 Let v = 58 - 57.69. Let g = v + -3.01. Let d = -2.69999985 - g. What is d rounded to 7 dps? 0.0000002 Let s = 21852 + -21944.917. Let o = 1.617 + s. Round o to the nearest ten. -90 Suppose 0f = -139f - 14481020000. What is f rounded to the nearest 1000000? -104000000 Let y = 3035.000001559 + -3035. What is y rounded to 6 dps? 0.000002 Suppose 0 = 4b - 10 + 2. Let m be 148/b(-1287)/(-18). Let c = 309 + m. Round c to the nearest 1000. 6000 Let w = -986 + 288. Let c = w - -808.1. Let p = c + -106. Round p to zero dps. 4 Let j = -2385 + 2384.95113. What is j rounded to 4 dps? -0.0489 Let n = -45028 - 2817972. Round n to the nearest 100000. -2900000 Let h = 213 - 123. Let d = -89.89 + h. Let c = 0.109495 - d. What is c rounded to 4 decimal places? -0.0005 Let x = -78886.957 + 78850. Let k = 37 + x. Let c = k + 9.857. What is c rounded to zero dps? 10 Let k = 1568.9874 - -0.5126. Round k to the nearest 100. 1600 Let w(a) = -a*3 - 9a*2 + 12a + 24. Let g be w(-10). Suppose -gn = -6n + 28. Suppose 0 = 9m - nm + 2975. What is m rounded to the nearest one hundred? 600 Let a = 346.9 - 346.90002476. What is a rounded to six decimal places? -0.000025 Suppose 9q - 7q = 18. Suppose -qd = -5d + 351856. Let i = -10964 - d. Round i to the nearest ten thousand. 80000 Let b = 6.336 - -468.564. Let g = 474.89998101 - b. What is g rounded to 6 dps? -0.000019 Let k = 599.29871 - -25916704.70129. Let o = k - 25917269.000082. Let y = o - 35. What is y rounded to 5 dps? -0.00008 Let h = -6674.257 + 6684. Let t = 184 - 174.3. Let w = h - t. What is w rounded to 2 dps? 0.04 Let k = 7918.9 - 7614. Let r = -309.462 + k. Let q = 0.302 + r. Round q to 1 decimal place. -4.3 Let t = 13.818 + -15.1946. What is t rounded to one decimal place? -1.4 Let w = 199.126705712 - 0.126123712. Let a = 199 - w. What is a rounded to four decimal places? -0.0006 Let r = 636.3 + -621.11. What is r rounded to the nearest integer? 15 Let o = -46501.9980169 - -46502. What is o rounded to 5 decimal places? 0.00198 Let f = -934 - -884. Let b = -5 - -2. Let i = b - f. What is i rounded to the nearest ten? 50 Let h = 2.03 - 1.809. Let k = h + -0.220981. What is k rounded to six dps? 0.000019 Let w(k) = 21k2 + 28k + 14. Let v be 1(-44)/(4 + 0). Let t be w(v). Let f be (t - -3)/((-4)/304). Round f to the nearest ten thousand. -170000 Let b = 323 + -1531. Let q = -1207.99999321 - b. Round q to seven dps. 0.0000068 Suppose 14k - 28904400 = -17*k. Round k to the nearest one hundred thousand. 900000 Let h = -2.51 - 231.49. Let j = h - -235.67. Let k = j + -1.6700073. What is k rounded to 6 dps? -0.000	{ "pile_set_name": "DM Mathematics" }
cx - 12600. Round x to the nearest one thousand. 1000 Let z = 84924 + -84754.692. Let x = z - 170. Let h = x + 0.122. What is h rounded to one decimal place? -0.6 Let b = 4827.08 + -4918. Let t = 90.3 + b. Round t to two decimal places. -0.62 Let o = 838 + -837.98926. What is o rounded to two decimal places? 0.01 Let q = 8354008 + -4993008. Round q to the nearest one hundred thousand. 3400000 Let r = 88777973 - 88785171.31065. Let x = r + 7198. Let k = 0.31 + x. What is k rounded to 4 dps? -0.0007 Let n = -0.147 + 13.347. Let h = 4.8 + n. Let w = 15.72 - h. What is w rounded to one dp? -2.3 Let o = -8046 + 8046.005451. What is o rounded to 4 dps? 0.0055 Let y = 0.035 + -0.313. Let h = 26.422 - y. What is h rounded to the nearest 10? 30 Suppose 0 = -3b + 5m + 355146, -2b - 4m = -4b + 236766. Suppose 22623 = 5l - b. What is l rounded to the nearest 10000? 30000 Let a = 66 - -9985. Let w = a - 34651. What is w rounded to the nearest ten thousand? -20000 Let x = 28869 - 28855.00025. Let p = -1792 + 1778. Let m = p + x. Round m to four dps. -0.0003 Let h = 43.9 + -4.9. Let i = -4129.11 + 4168. Let b = i - h. What is b rounded to one dp? -0.1 Suppose -60475212 = -29a + 42207988. What is a rounded to the nearest ten thousand? 3540000 Let p = -228 - -62. Let c = 165.9965 + p. What is c rounded to three decimal places? -0.004 Let b = 3100 - 3099.99996106. What is b rounded to five decimal places? 0.00004 Let d = -16895.994779 - -16896. What is d rounded to 4 decimal places? 0.0052 Let y = 215 - 259. Let j = 44.00034 + y. What is j rounded to 4 dps? 0.0003 Let d = -1912.571 + 1921.5. Let l = d + -10.04. Round l to 1 dp. -1.1 Let p = -345376 + 345375.999805381. What is p rounded to 6 decimal places? -0.000195 Let n = -309204346.29998885 + 309204400. Let w = n - 53.7. What is w rounded to six decimal places? 0.000011 Let u = 6.468994964 - 6.469. Round u to 7 dps. -0.000005 Let g = 0.89 + -0.964. Let t = g + 60.074. Let k = -59.476 + t. What is k rounded to 1 decimal place? 0.5 Let t = 1.985 + -1.985024642. What is t rounded to 5 decimal places? -0.00002 Let l = 7286.83 - 7287.660194. Let f = -0.83 - l. What is f rounded to 5 dps? 0.00019 Let k = -2 - -1.984. Let t = 14.3090208 - 14.293. Let y = k + t. Round y to six decimal places. 0.000021 Let n = -0.0223517 - -0.019758. Round n to 3 dps. -0.003 Let o = 4934076903 - 12401155690. Let s = -7467078740.99999939 - o. Let u = 46 - s. What is u rounded to 7 decimal places? -0.0000006 Let g = 23226.97 + -23014. Let l = g - 213. What is l rounded to zero decimal places? 0 Let s = 3.02 - 3.735. Let x = 0.9 + s. Let c = -0.326 + x. What is c rounded to one dp? -0.1 Let y = -2848330 + 6707176. Suppose -i = -7i - y. Let r = i + 943141. Round r to the nearest one million. 0 Let y = 6.867384352 - -7.3326161. Let q = -14.2 + y. What is q rounded to seven dps? 0.0000005 Suppose 6d - 972000 = 2d. Suppose 9q - 24 = -3q. Suppose -y - d = qy. Round y to the nearest 10000. -80000 Let w = -228.4 + 6.4. Let q = -221.999999364 - w. Round q to seven decimal places. 0.0000006 Let b = 0.447 + -190.447. Let p = -607 - b. Let s = -417.000507 - p. What is s rounded to four dps? -0.0005 Let w = 5 + -110. Let o = -104.819 - w. What is o rounded to 2 decimal places? 0.18 Let w(f) = 2289999f - 7. Let k(x) be the second derivative of x2/2 + 32x. Let i(a) = 5k(a) + w(a). Let t be i(-2). Round t to the nearest one million. -5000000 Let w = 68347 + -20222. Round w to the nearest ten thousand. 50000 Let g = -0.00263 + 0.00857. Round g to three decimal places. 0.006 Suppose 0 = 5b - 3b. Suppose b = -o - 2c - 99649048, c - 398596165 = 4o - 0c. Let s = o - -146149042. What is s rounded to the nearest 1000000? 47000000 Let r = -12117 - -12023.3. Round r to the nearest one hundred. -100 Let t(f) = -20f3 - 6f*2 - 4f + 20. Let d be t(5). What is d rounded to the nearest ten? -2650 Let q be (-649 - 3) + 913/83. Round q to the nearest 10. -640 Let i = -2235.10905 + 2235. Let o = 426.89 + -427. Let m = o - i. What is m rounded to 4 decimal places? -0.001 Let d be (316/(-36))/(1/30). Let a be (-520)/(-6)(-535380)/d. Suppose 3t - 4t = 3b + 3479998, 5t + a = -b. Round b to the nearest one hundred thousand. -1200000 Let i = 5428 - 5428.02964. Round i to one decimal place. 0 Suppose -4y = -8 - 4. Let c be -1(-1026 - 2)6. Suppose -yh + c - 678 = 0. What is h rounded to the nearest one hundred? 1800 Let c(t) be the third derivative of 11t6/120 + t5/15 + 5t*4/12 - 4t*3/3 + 160t*2. Let v be c(6). Round v to the nearest 100. 2600 Suppose -3g + 95216308 = -3267452. Suppose 14y + 33392080 = -g. What is y rounded to the nearest 100000? -4700000 Let z = -4.947 - 786.353. Round z to the nearest 100. -800 Suppose -j = -2433 - 2397. Let v be (-7995 + -5)j/8. What is v rounded to the nearest one hundred thousand? -4800000 Let y(d) = 36421d - 197. Let z be y(21). Let l = 1424644 - z. Round l to the nearest 1000000. 1000000 Let t = 14.97978 + -14.973. What is t rounded to 3 dps? 0.007 Let u = -1002843423 - -2164806481. Let z = -1161963053.30000003 + u. Let p = z - 4.7. What is p rounded to 7 decimal places? 0 Let v = 53986.028599 - 53986. What is v rounded to 2 dps? 0.03 Let y = -25649.000053054 - -25649. Round y to six dps. -0.000053 Let n = 946337408 - 644013255. Let b = n + -302324512.999538. Let h = -360 - b. Round h to four dps. -0.0005 Let l = 0.1 + 1.43. Let q = -3694310 - -3694311.529917. Let v = l - q. What is v rounded to 5 decimal places? 0.00008 Let q = -45.907899495 - -45.908. Round q to five dps. 0.0001 Let r = -3683 - -3683.1487. Let b = r + -0.0204. What is b rounded to three dps? 0.128 Suppose -6u + u - 4f = 12, 4u = f + 3. Suppose j + 1 = u, -5j = -o + 2o - 5289995. Round o to the nearest 100000. 5300000 Let v = 67.65 + 0.35. Let a = -1174.7911 - -1242.782. Let w = a - v. Round w to 3 decimal places. -0.009 Let y = -2522.0686 - -2522. What is y rounded to two dps? -0.07 Let z = 3582 - 3581.9999906077. Round z to 7 decimal places. 0.0000094 Let u = -2973.77240092 + 2988.7724. Let d = 0.04 - -14.96. Let m = u - d. Round m to 7 decimal places. -0.0000009 Let d be 4932956/(-16)-1 - (6 - (-100)/(-16)). Round d to the nearest 1000. 308000 Let q = -15.09293644 + 15.093. Round q to 6 dps. 0.000064 Let w = 119 - 115. Let g = w - 4.66. Let y = g + 0.66000528. What is y rounded to 7 dps? 0.0000053 Let i = -39795.8107 - -39719.8. Let k = 76 + i. What is k rounded to two dps? -0.01 Let q = 4.99 + 25.278. Round q to 1 dp. 30.3 Let k = 249 - 273.2. Let s = k - -154.2. Let v = 129.9804 - s. Round v to three decimal places. -0.02 Let t = -14.68 + 14.680000075. Round t to 6 decimal places. 0 Let i = 6 - 2. Suppose f - if = 0. Suppose fy - 25 = y. Round y to the nearest 10. -30 Let y = 44 - 17. Let q be (-1405)/(9/y(-6)/(-4000)). What is q rounded to the nearest 100000? -2800000 Let y = -37926.38424 - -37927. Round y to 2 decimal places. 0.62 Let k = -9646.334 + 9662. Let i = 2.4 - 2.634. Let c = i - k. What is c rounded to the nearest integer? -16 Let x = -25499.6 - -28654. What is x rounded to the nearest one hundred? 3200 Let f = 4214 - 3923. Round f to the nearest 10. 290 Let p = 0.0856 + -0.4629. Round p to one decimal place. -0.4 Let a = 651 + -650.93372. Round a to 3 decimal places. 0.066 Let c = 0.218 + 65.782. Let g = c + -66.0271. What is g rounded to 2 dps? -0.03 Let j = 14 - -12. Let m = 24 - j. Let y be -1560000 - (-24/m + -4). What is y rounded to the nearest one hundred thousand? -1600000 Let c be (-57)/(-11) + (-20)/110. Let v be 6/(-45) + (-64)/(-30). Suppose -n - d - 82798 = -cn, -2n - vd = -41404. What is n rounded to the nearest 1000? 21000 Let r = -0.2308 + 0.21004. Round r to two dps. -0.02 Suppose -4h = -7g - 6840, -g + 199 = h + 1173. What is g rounded to the nearest one hundred? -1000 Let l = -928390398355 + 928390397299.000001274. Let t = -1056 - l. What is t rounded to seven dps? -0.0000013 Let b = 4539 + -4539.9308. Round b to 2 decimal places. -0.93 Suppose -4d = -3o + 152, -3d - 190 = 2d - 4o. Let m be (-8 + -32)d/(-8)2. What is m rounded to the nearest one hundred? -400 Let p(u) = 1036561u*3 - 22u - 15. Let s be p(5). Round s to the nearest 1000000. 130000000	{ "pile_set_name": "DM Mathematics" }
x2 + c3x - 3c*2x*2 + 52cix*2 + 2ci + 443x wrt x? -2c3i - 6c2 + 104ci What is the third derivative of 494j*2n*3r + 2j2n - jnr + n*2 wrt n? 2964j*2r Find the second derivative of -c*5 + 2222c*4 + 2c - 200 wrt c. -20c3 + 26664c2 Find the third derivative of d2u3 + 273d*2u*2 + 3u*6 + 116u*4 wrt u. 6d*2 + 360u*3 + 2784u Find the second derivative of 3a5bh - 16a*3bh - 25abh - 22ah + bh wrt a. 60a*3bh - 96abh Find the third derivative of -200m2q*3 + 3m*2q*2 - 94m*2q - 3mq*5 wrt q. -1200m*2 - 180mq2 Differentiate i2x - 1660i2 + 946x with respect to i. 2ix - 3320i Find the second derivative of 40co2 - 11co - 2 wrt o. 80c Find the third derivative of -67b4 + 2b*3 + 339b*2. -1608b + 12 Find the third derivative of 271m3t*2 - 2m*3 - 5m*2t*2 - 15m*2t + 3m wrt m. 1626t*2 - 12 Differentiate 6m3 - m2 + 309m + 8887. 18m*2 - 2m + 309 Find the second derivative of 3iu*2w*2 + 8iu2w - iu2 + 2iuw*2 + 18iuw - 98iw*2 wrt w. 6iu2 + 4iu - 196i Find the first derivative of 150fv - 3fx*3 - 149f - vx3 - x + 1 wrt v. 150f - x*3 Find the first derivative of 8u*2w*2 - 691u*2 - 87w*3 wrt w. 16u*2w - 261w2 What is the second derivative of 19411c*2 - 928c? 38822 Find the second derivative of 565rw*3 + 3r + 15w3 + 2w + 188 wrt w. 3390rw + 90w What is the first derivative of -254c - 102? -254 Find the first derivative of 296nsx + 104nx - 3n wrt s. 296nx Find the third derivative of 10320x5 - 7x*2 + 83. 619200x*2 Find the second derivative of -28p*4 - 9p*3 + 438p. -336p2 - 54p Find the second derivative of 5g2s*4 + 2g*2s - 59g2 - 16gs2 wrt s. 60g*2s*2 - 32g What is the derivative of -124c4n*3 - 15cn3 - 2n*3 + 52n*2 - n wrt c? -496c*3n*3 - 15n*3 What is the derivative of 1352y + 294 wrt y? 1352 What is the second derivative of 20y5 - 44y*4 - 3y - 18? 400y3 - 528y*2 Find the second derivative of 265gk2 + 443gk - 9k*2 - 1 wrt k. 530g - 18 What is the first derivative of 1342f2i*2 - 4f*2 - 12i*2 - 4i - 16 wrt f? 2684fi*2 - 8f Differentiate -34056t3 - 10163. -102168t*2 Find the first derivative of 4j*2q*2 - 20j*2q + 127j2 + 2jq2 wrt q. 8j*2q - 20j2 + 4jq Find the first derivative of 3969n + 2797 wrt n. 3969 Find the second derivative of -2ds*3 + 16ds + 4d - 2274s3 + 74 wrt s. -12ds - 13644s What is the first derivative of 21n2o - 3n2 + 4no - 2276o + 2 wrt n? 42no - 6n + 4o What is the second derivative of 10l4z - 2l2z*2 + 4l*2 + l + 51z*2 wrt l? 120l*2z - 4z2 + 8 What is the first derivative of -8b*3io + 4b*3i + 3b3o*2 - 65b*2i + 28io wrt o? -8b3i + 6b3o + 28i Find the third derivative of -3m*2s*3u3 + m2s3u + m*2su3 - 3m*2s - 4ms*2u*2 - 2u*3 wrt u. -18m*2s*3 + 6m*2s - 12 Differentiate 20dpu3 + 2du3 + 11d + 7pu*3 - 8u*2 with respect to p. 20du3 + 7u3 What is the derivative of d4 - 160d2 - 469? 4d*3 - 320d What is the derivative of -2oxy3 - 2oxy + 29oy - 21x3y - 2y3 wrt x? -2oy3 - 2oy - 63x*2y What is the second derivative of -17prt2 + 3pr - pt*2 - 9rt2 + 2rt + 2r + 2t wrt t? -34pr - 2p - 18r Differentiate -14i*2s - 3is + s + 209 with respect to i. -28is - 3s Find the third derivative of 5265o*5 - 5294o*2. 315900o*2 Differentiate -2f*3mu - 2f*3m + 6f3u - 81f3 + 2f*2u + 2mu with respect to m. -2f3u - 2f3 + 2u Find the second derivative of -3559y4 + 3973y. -42708y2 What is the third derivative of -2lz3 - 225lz - 189z3 - z2 wrt z? -12l - 1134 Find the third derivative of i6 + 45i*5 - 54i*2 + 4i wrt i. 120i3 + 2700i*2 Find the third derivative of 33c*6o - 3c4o + 2c2 - 3o wrt c. 3960c3o - 72co What is the third derivative of 144k6 + 2k*5 + 7k*3 - 211k*2 + 8k wrt k? 17280k3 + 120k*2 + 42 Differentiate 3i*2o + 1343i2 + 68io wrt o. 3i*2 + 68i What is the second derivative of 385xz*3 + 6xz + 2z*3 + 45z + 2 wrt z? 2310xz + 12z Find the third derivative of 31l*6 - 418l*2 wrt l. 3720l*3 What is the third derivative of -2a*3o*3s + 9a3o*3 - 7a*3os + 2a*2o*3s - 2a2o*2s + 23a2os + ao*3s wrt a? -12o3s + 54o3 - 42os Find the third derivative of 7851w*3x - w*2x + 69w2 - 6w - 2x wrt w. 47106x What is the second derivative of 2kr*2s - 51ks*3 - 2r*2s3 - r2s2 + 8r*2s + 83r2 wrt s? -306ks - 12r*2s - 2r2 Find the second derivative of -2fs2 + fsw3 + 8fsw2 - s2w3 - 3s*2w + 9sw*3 - 2sw2 wrt s. -4f - 2w3 - 6w Find the second derivative of 6097b2 - 103b - 25 wrt b. 12194 What is the third derivative of -3kpq3 + 33kpq*2 + 4kq4 + 69kq3 + 42kq2 wrt q? -18kp + 96kq + 414k Find the second derivative of 9dq*3 + 4dq - 384d - q*3 wrt q. 54dq - 6q What is the third derivative of -1613s5 - s2 + 42s? -96780s2 Differentiate -53y*2 + 37 with respect to y. -106y Find the third derivative of -16cjl3 - cjl - 2cj + 3cl3 - 8cl2 wrt l. -96cj + 18c Find the third derivative of 786r6 + 3r*3 - 2r*2 - 1570r. 94320r3 + 18 What is the first derivative of 5434am2 - 32m*2 - 23 wrt a? 5434m*2 Find the third derivative of 2k*5y*2 + 6977k*3ty3 + 2263k*2ty2 - k2ty - 2k*2y*3 wrt k. 120k*2y*2 + 41862ty3 Find the third derivative of -t2w*3 + 4t*2 + 3w3 + w2 + 5 wrt w. -6t2 + 18 Find the second derivative of -3b*3r - b*2rx + 10b*2r + 8b2x - 2brx + 7bx - b - rx - r wrt b. -18br - 2rx + 20r + 16x Find the third derivative of -3l6 - 44l*3 - 14l*2 - 3l - 4 wrt l. -360l3 - 264 Find the second derivative of 7339y*2 + 3557y wrt y. 14678 What is the first derivative of 76nq - 3n + q3 - 3 wrt q? 76n + 3q2 What is the third derivative of 10842a*3c*2p + 2a3cp2 + 3a*2c*2 - 7a*2cp2 + a2c - ac + 6c*2p wrt a? 65052c2p + 12cp*2 Find the second derivative of 8p*5 - 6p*4 + 287p. 160p3 - 72p*2 Find the third derivative of 3f*4 - 1897f*3 + 671f*2 - 7. 72f - 11382 Find the second derivative of 484r3 - 260r. 2904r What is the third derivative of -h3m*2 - 21h*3m + 69h2m + m*2 wrt h? -6m*2 - 126m What is the third derivative of g*5l*3 + 1083g*5l + 71g2l*3 - gl*3 wrt g? 60g*2l*3 + 64980g*2l What is the third derivative of 198i6 + 65i*2? 23760i*3 What is the first derivative of -2074hj3k*2 - 2hk2 + 362hk - 2k wrt j? -6222hj*2k*2 Find the second derivative of 43h*2u*2y*2 - 6h*2uy2 + 2hu2 + 237hy + uy*2 wrt h. 86u*2y*2 - 12uy2 What is the second derivative of -5v*3 - 42v*2 + 3030v wrt v? -30v - 84 What is the second derivative of -4017u3 + u2 + 62u + 4 wrt u? -24102u + 2 What is the third derivative of s*5 - 71s*3 - 147s*2 wrt s? 60s*2 - 426 What is the second derivative of 1063g*2l*4 - 3g*2l - 2g2 wrt l? 12756g*2l*2 Find the second derivative of -375w*4 - 108w. -4500w2 What is the third derivative of 768g*5 - 2g*3 + 2792g*2 wrt g? 46080g*2 - 12 Find the third derivative of -342j*3p*3 + 3j*3p*2 - 156j*3p + 3j3 + j2 + 3p*3 wrt p. -2052j*3 + 18 Differentiate 7166x*4 + x + 6629 wrt x. 28664x*3 + 1 What is the third derivative of 10a*4 - 3a*3 - 262a*2 - 2a wrt a? 240a - 18 What is the third derivative of -280a*3t*3 - 13a*3t*2 - 23a*3 wrt t? -1680a*3 Find the second derivative of 2136s*5 + 7s + 176. 42720s3 Find the second derivative of 3n*2v2 - n2v + 2nv + 65v*2 + 2 wrt v. 6n*2 + 130 What is the second derivative of 11d*3s2 - d3s + 51d*2s + 6s3 wrt s? 22d*3 + 36s Find the third derivative of 98v5 - v4 + 50v*2 - 2 wrt v. 5880v*2 - 24v What is	{ "pile_set_name": "DM Mathematics" }
*2 + 838353z2 + (z2 - 1 + 1)(-3z + 4 - 4) to j + fz2 + lz*3 + uz and give l. -393 Rearrange -6k2 + 5k*2 - 5k*2 - 132k - 47k + 4k*2 to the form m + fk + yk2 and give f. -179 Express -s2 + 27s*4 - s - 2 + 5882s*3 - 5883s*3 - 28s*4 as ps*4 + bs + gs3 + js*2 + n and give g. -1 Express -2c*2 + 2 - 2 + 360c - 184c - 145c as kc + i + xc*2 and give k. 31 Rearrange -696v + 6v4 - 721v + 1428v - v2 - 3v*3 to c + ov*3 + wv*2 + tv + bv4 and give b. 6 Rearrange (18s + 31s - 63s)(-1 + 1 + 1)(-4 + 1 + 0) to the form w + bs and give b. 42 Express -504 + 1420y + 1420y - 5703y + 1427y + 1429y in the form r + zy and give r. -504 Express 43y*3 + 9y*3 + 22y*3 + (y - 4y*2 - y)(1 - 2y - 1) - y3 + 4y3 - y3 as i + by2 + py + ay3 and give a. 84 Express 15411b - 15411b - 3 - 695b*4 - 2b*3 in the form ab + tb2 + s + zb*3 + vb*4 and give v. -695 Express -1313 + 3812u - 279u + 1313 as p + qu and give p. 0 Express 269d3 + 246 - 252d*3 - 11d*3 as hd*3 + md + gd2 + q and give m. 0 Express (-2j*4 + 2j4 - j4)(-26 + 9 - 3)(-110 - 363 + 118) in the form l + bj3 + gj*2 + tj*4 + yj and give t. -7100 Rearrange -32l4 - 1 + 3 + 1833l - 1834l + 2 + 12l*2 + 2l*3 - 3 to the form kl*2 + h + ol + al3 + dl*4 and give a. 2 Express (4f*3 + 10 - 10)(-f - f + 0f) + 43f*4 - 118f*4 + 60f*4 - 3f*4 - 2f*2 - 10 + 10 in the form yf*4 + pf*3 + zf*2 + mf + g and give z. -2 Rearrange (-o*2 + 2o2 + o2)(239o + 241o - 477o - 22o2)(5 - 3 - 1)(-8 + 48 + 57) to io*3 + lo*4 + uo + fo2 + g and give l. -4268 Rearrange (-4 - y + 4)(3129 + 2644 - 7659) - 1 + 0 + 2y - 3y to s + py and give p. 1885 Express -55z*2 - z + 181z*2 - 63z*2 + 1553 - 64z*2 in the form wz + s + rz2 and give s. 1553 Rearrange 2387i*2 + 1744 - 1744 - 390i*2 to the form d + vi*2 + yi and give v. 1997 Express (2a + 0a + 2a)(3958 - 7917 + 3959 - 4526a) in the form p + ta*2 + ia and give t. -18104 Express -88 - 3b - 4 + 2b - 38 in the form x + ub and give u. -1 Express -1336x*2 - x - 2319 + 4641 - 2322 in the form gx*2 + u + cx and give g. -1336 Express (2d - 1 + 1 + d2)(28176 + 30877 - 9571 - 5477) as ad + sd*2 + n and give a. 88010 Express 44x - 31x2 + 9x*2 - 38 + 30x*2 - 6x*2 as ux + o + ix2 and give o. -38 Express -3z - 1 - 6z2 + 0z + 4z + z4 - 2z + 0 + 3z3 as n + fz*3 + jz + bz2 + mz*4 and give f. 3 Rearrange -9855a + 22246a - 9358a to o + ja and give j. 3033 Express 740f*2 - 25f*2 + 2 + f - 70f*2 + 566f*2 as of + y + af2 and give o. 1 Rearrange -198g*2 + 3 - 4 - 2g*2 - 170g*2 + 53g*2 to w + mg*2 + sg and give w. -1 Express -7816z2 - 4841z*2 + 14986z*2 in the form wz*2 + mz + c and give w. 2329 Express 5b - 4b*2 + 6 - 16b + 2b + 2b*2 - 21b in the form rb2 + ib + w and give i. -30 Rearrange -38428d2 + 5d*3 - 736 + 38427d*2 + 2d - 6d3 to ld*2 + x + wd + td3 and give l. -1 Express -46 + 46 + 3002p*2 - 28p*2 in the form jp + op2 + l and give o. 2974 Express (d - 3d + d)(4 - d - 4) + 0d + 0d + d2 - 2395d*2 + 3969d*2 + 2d + 26240d2 - 2d as nd2 + r + id and give n. 27816 Rearrange 3w + w3 - 5w*2 - 11 + 1 - 17 + 76 to yw*3 + lw + rw2 + k and give k. 49 Rearrange 6730i*2 + 6694i*2 - 6i4 + 18 + i3 - 13407i2 + i - 3i*4 to xi + ui2 + ri*4 + ai*3 + j and give r. -9 Rearrange (3 + 1 - 2)(-3 - 2 + 3)(-2s + 3s + s) + (0 - 1 + 2)(4s + 3 - 3) + 5s + 3 - 3 - 10s + s - 2s to js + q and give j. -10 Express 1975 + 4h*3 - 986 - 990 - 58h*2 + 13h*2 + 4h in the form xh2 + bh*3 + fh + g and give b. 4 Rearrange 15 + 580z + 40z*3 + 8 - 579z + 4 to nz + uz*2 + oz*3 + p and give p. 27 Express 29t + 1 - 112t2 + 334t*2 - 119t*2 - 106t*2 as g + rt*2 + ft and give r. -3 Rearrange (150p + 1 - 56p + 6p)(3 - 2 - 2 - 3 - 2 + 3 + (-2 + 3 - 3)(-2 + 2 + 2) - 3 + 3 + 1) to the form sp + g and give s. -600 Rearrange (-28 + 546u2 + 29 - 310u*2 + (-2u - 2 + 2)(2u + u - u) - u - u*2 + u)(-6u - 13u + 3u) to the form ru*2 + pu + gu3 + f and give p. -16 Express (1207 - 1207 + 2t*2 + 31t)(-87t + 194t + 130t) in the form gt + jt*2 + lt*3 + q and give g. 0 Rearrange (12k - 34 + 34)(2 + 1 - 4)(3 + 0 + 1) + (-2 + 4 - 1)(-4k + 6k - k) to the form b + jk and give j. -47 Express -x*3 + 49x*2 - 2 + 5x - 33x2 + 6x*3 - 2x - 4x as i + qx + fx2 + ux*3 and give q. -1 Rearrange (65c + 18 - 125c + 70c)(1 - 1 + 10c) to the form lc2 + u + fc and give l. 100 Rearrange c2 - c4 - c*2 + (3c*3 + 2c*3 - 4c*3)(5c + 34c + 24c) - 45c*4 + 13c*4 + 16c*4 to wc*4 + tc + zc3 + qc*2 + p and give p. 0 Express (-1 + 124o - 15o2 - 124o)((-2 + 6 - 3)(-7 + 1 - 12) + 1 - 5 + 2) as ko2 + bo + a and give a. 20 Express 2 - 1425p - 3 + 457p - 2146p + 302p as q + dp and give q. -1 Express -5v2 - v4 - 32v3 - 3v*2 + 4639v - 4636v - 2v*4 + 5v*4 as dv*2 + iv*3 + y + mv*4 + cv and give m. 2 Express (2 - 6 + 2)(0 + u + 0) - 6 + 3u + 2 - 7 - 751 + 751 - 112u in the form tu + a and give a. -11 Rearrange (24 - 2p2 + 7p*2 - 3p*2)(0p + 173 - 225 - 29p) to the form fp + i + up*2 + gp*3 and give g. -58 Express 509w - 7 - 1197w - 1005w - 7 + 9 in the form tw + d and give t. -1693 Rearrange (-242v - 116v + 20v)(35v - 95v + 39v) to the form zv2 + lv + q and give z. 7098 Rearrange (-6o + 9 - 9)(8 - 6 - 3 + 12o) + (-12o + 7o - 2o)(-4o + 4o - o) to the form fo*2 + s + go and give g. 6 Express 8833h - 65756 + 65756 as r + th and give r. 0 Express 1 + 31836k2 + 31834k*2 + 18k*3 - 63671k*2 + k as o + qk*2 + fk*3 + dk and give f. 18 Rearrange -272b - b3 + b2 - 12 + 139b + 136b + 9 - 40b*4 to the form rb + db2 + jb*3 + v + gb4 and give g. -40 Rearrange -c2 - 224c3 + 2c*4 + 210c*3 + 455c - 451c to sc*3 + p + yc*4 + kc + jc2 and give k. 4 Rearrange 6298x - 13769x - 15046x to rx + k and give r. -22517 Express -941g + 95 + 126 + 64 + 939g + 5 as u + xg and give u. 290 Rearrange 11 + 0g + 9 - 4g*3 - 4g - 39g2 + 18g*2 - 21 to rg*2 + ig*3 + z + vg and give z. -1 Rearrange (13 - 7 + 3o - 4)(-543 + 145 + 222) to v + ho and give h. -528 Express -960d + 1737d + 157d*2 + 2 - 771d in the form wd2 + r + cd and give r. 2 Rearrange -10m2 - 2 - 5m*3 + 16m*3 + 17m3 + m3 + 3m2 - 2m to the form tm + fm*2 + a + xm*3 and give t. -2 Rearrange (79 + 2s - 56 - 36)(12 + 6 + 33) to x + ps and give x. -663 Rearrange -2582 + 11120c2 - 11118c*2 - 1883 to sc*2 + ic + v and give s. 2 Rearrange -3n + n + 1229 + 53n*2 - 157n*2 - 1231 - 107n*2 to the form x + mn*2 + bn and give m. -211 Express (5 - 1 - 2)(x + 4x - x) + 11 - 11 + 16x + 0x + 0x - 5x - 4x + 6x - 3x in the form a + jx and give a. 0 Express -1529h2 + 4744h*2 + 2220h*2 + 1678h*2 in the form xh*2 + t + vh and give x. 7113 Rearrange 3 + 12r2 + 14r*2 - 48r*2 + 45r - 5r2 to the form p + wr + ir2 and give i. -27 Rearrange (-2t + 3t - 2t)(100 + 398t + 269 - 713t - 370 - 779t) to rt + ut*2 + q and give u. 1094 Express -5016c - 32 - 11c3 + 2507c + 2516c as yc*2 + zc + tc3 + q and give q. -32 Express h2 + 1738h - 1656h + h2 in the form a + dh + yh2 and give d. 82 Rearrange -15g - 155 - 239 + 373 to v + xg and give v. -21 Express 9c*4 + 9199c*3 - c - 172c*2 + c - 9203c*3 - 11c*4 as lc + zc4 + pc*3 + bc*2 + i and give p. -4 Rearrange 15 - 11 + 6 + 7 + 192m to r + qm and give q. 192 Rearrange -22a*4 + 2a*3 + 80a*4 - 47 + 2a - 33a4 - 51 - 19a*4 to the form c + ma*4 + ja*3 + ua + ba2 and give m. 6 Express -3944v*3 + 10 + 3939v*3 - v + v as h + qv*2 + jv*3 + cv and give h. 10 Express 70204m2 + 70200m*2 - 140405m*2 - 6m + 271 in the form jm2 + f + gm and give f. 271 Rearrange 5w2 - 2w2 - w2 + (-2w + 2w - w)(8 - 8 - 9w) + w - w - w**2 +	{ "pile_set_name": "DM Mathematics" }
is the o'th term of -48545, -48514, -48485, -48458, -48433, -48410? -o*2 + 34o - 48578 What is the h'th term of 1793, 14302, 48255, 114374, 223381, 385998? 1787h3 + 6 What is the l'th term of -110111, -110120, -110129, -110138, -110147, -110156? -9l - 110102 What is the x'th term of -3411, -6807, -10203? -3396x - 15 What is the k'th term of -4380, -4379, -4376, -4371, -4364, -4355? k2 - 2k - 4379 What is the c'th term of -159, -333, -503, -663, -807, -929? c*3 - 4c*2 - 169c + 13 What is the q'th term of -113, -547, -1273, -2291? -146q2 + 4q + 29 What is the s'th term of 1236555, 1236559, 1236565, 1236573, 1236583, 1236595, 1236609? s*2 + s + 1236553 What is the o'th term of 988754, 988757, 988760? 3o + 988751 What is the b'th term of 524, 1455, 2388, 3323, 4260, 5199? b*2 + 928b - 405 What is the c'th term of -470, -737, -1004, -1271, -1538, -1805? -267c - 203 What is the y'th term of 5191, 5212, 5241, 5272, 5299, 5316? -y3 + 10y*2 - 2y + 5184 What is the n'th term of 393287, 393295, 393305, 393317? n*2 + 5n + 393281 What is the u'th term of 13447, 13522, 13605, 13696, 13795, 13902? 4u2 + 63u + 13380 What is the a'th term of -603620, -603621, -603622, -603623? -a - 603619 What is the h'th term of 2415, 2401, 2375, 2337, 2287, 2225? -6h2 + 4h + 2417 What is the o'th term of 601, 603, 623, 667, 741, 851, 1003, 1203? o*3 + 3o*2 - 14o + 611 What is the l'th term of 0, -66, -272, -690, -1392, -2450? -12l3 + 2l*2 + 12l - 2 What is the c'th term of -783124, -783125, -783126, -783127? -c - 783123 What is the t'th term of -2066, -3644, -5222? -1578t - 488 What is the x'th term of -1781596, -1781597, -1781598, -1781599, -1781600? -x - 1781595 What is the r'th term of -110, -108, -106, -104? 2r - 112 What is the d'th term of 292, 395, 498? 103d + 189 What is the p'th term of -222, -647, -1072, -1497, -1922? -425p + 203 What is the x'th term of -41, -49, -35, -5, 35, 79, 121? -x*3 + 17x*2 - 52x - 5 What is the x'th term of 92, 550, 1314, 2384? 153x2 - x - 60 What is the h'th term of -20, 14, 114, 304, 608, 1050? 4h*3 + 9h*2 - 21h - 12 What is the h'th term of 720, 11067, 39150, 93837, 183996? 1478h3 + h - 759 What is the w'th term of 953, 966, 1001, 1070, 1185, 1358? 2w3 - w2 + 2w + 950 What is the q'th term of 56665, 113312, 169959, 226606? 56647q + 18 What is the z'th term of -61, -47, 1, 101, 271, 529, 893? 3z3 - z2 - 4z - 59 What is the c'th term of -60, -149, -264, -405, -572? -13c2 - 50c + 3 What is the b'th term of 2992, 5102, 7212, 9322, 11432, 13542? 2110b + 882 What is the g'th term of -80698, -80695, -80692, -80689? 3g - 80701 What is the b'th term of -47, -183, -411, -731, -1143, -1647, -2243? -46b2 + 2b - 3 What is the d'th term of -261, -364, -463, -558, -649, -736? 2d2 - 109d - 154 What is the j'th term of 2025, 1791, 1557, 1323, 1089? -234j + 2259 What is the b'th term of -7104, -14202, -21284, -28344, -35376, -42374, -49332, -56244? b3 + 2b*2 - 7111b + 4 What is the d'th term of -130, -340, -552, -766, -982, -1200? -d*2 - 207d + 78 What is the t'th term of -1949, -2348, -2751, -3158, -3569, -3984, -4403? -2t2 - 393t - 1554 What is the b'th term of -126, -223, -316, -405, -490, -571? 2b2 - 103b - 25 What is the s'th term of 247, 225, 165, 49, -141, -423? -3s3 - s2 + 2s + 249 What is the l'th term of 4314, 8617, 12920, 17223, 21526? 4303l + 11 What is the c'th term of 13965, 13932, 13889, 13830, 13749, 13640? -c3 + c2 - 29c + 13994 What is the p'th term of -1855, -1797, -1741, -1687, -1635, -1585? -p*2 + 61p - 1915 What is the o'th term of -11445, -11325, -11205, -11085, -10965? 120o - 11565 What is the k'th term of -4726, -4759, -4790, -4819, -4846, -4871, -4894? k2 - 36k - 4691 What is the z'th term of 366225, 1464893, 3296007, 5859567, 9155573, 13184025, 17944923? 366223z2 - z + 3 What is the p'th term of -67156, -134316, -201476, -268636, -335796, -402956? -67160p + 4 What is the g'th term of 1903, 3249, 4595, 5941, 7287, 8633? 1346g + 557 What is the l'th term of -3458, -3479, -3488, -3479, -3446? l3 - 28l - 3431 What is the m'th term of 314278, 628550, 942822, 1257094? 314272m + 6 What is the h'th term of -3188, -5967, -8746? -2779h - 409 What is the x'th term of -879, -3490, -7839, -13926? -869x2 - 4x - 6 What is the w'th term of -22163, -22165, -22167, -22169? -2w - 22161 What is the v'th term of -110, -114, -146, -224, -366, -590? -3v*3 + 4v*2 + 5v - 116 What is the o'th term of -15418, -15372, -15250, -15016, -14634? 6o3 + 2o*2 - 2o - 15424 What is the k'th term of 40, 143, 294, 487, 716, 975? -k*3 + 30k*2 + 20k - 9 What is the m'th term of 52871, 105746, 158621? 52875m - 4 What is the o'th term of -2396, -2070, -1526, -764, 216, 1414? 109o*2 - o - 2504 What is the m'th term of 35443, 70902, 106361, 141820, 177279, 212738? 35459m - 16 What is the c'th term of 1916, 7666, 17250, 30668? 1917c2 - c What is the b'th term of -132, -346, -694, -1242, -2056? -11b3 - b2 - 134b + 14 What is the c'th term of 624, 2408, 5380, 9540, 14888? 594c*2 + 2c + 28 What is the l'th term of 245517, 491061, 736619, 982197, 1227801, 1473437, 1719111? l3 + l2 + 245534l - 19 What is the a'th term of 1807, 1665, 1419, 1063, 591, -3, -725, -1581? -a3 - 46a*2 + 3a + 1851 What is the w'th term of 193, 1490, 5017, 11890, 23225, 40138? 186w3 - w2 - 2w + 10 What is the d'th term of -29, -470, -1675, -4028, -7913? -64d3 + 2d*2 + d + 32 What is the n'th term of 1230, 2477, 3716, 4947, 6170? -4n*2 + 1259n - 25 What is the a'th term of 264, -24, -314, -606, -900? -a*2 - 285a + 550 What is the a'th term of 11214, 11237, 11266, 11301, 11342? 3a2 + 14a + 11197 What is the b'th term of -130, -61, 54, 215, 422, 675, 974? 23b2 - 153 What is the h'th term of -300, -578, -876, -1200, -1556, -1950, -2388? -h3 - 4h*2 - 259h - 36 What is the d'th term of 390, 609, 838, 1083, 1350, 1645, 1974, 2343? d3 - d2 + 215d + 175 What is the t'th term of 4800, 4917, 5034, 5151? 117t + 4683 What is the x'th term of 843, 1688, 2521, 3342, 4151, 4948, 5733? -6x2 + 863x - 14 What is the f'th term of 7770, 7753, 7730, 7701? -3f2 - 8f + 7781 What is the w'th term of 13529, 27057, 40585? 13528w + 1 What is the d'th term of 309, 2850, 9797, 23352, 45717, 79094, 125685, 187692? 367d3 + d2 - 31d - 28 What is the o'th term of 5075, 10140, 15205, 20270? 5065o + 10 What is the o'th term of 86, 100, 124, 158, 202, 256, 320? 5o2 - o + 82 What is the j'th term of 266720, 266720, 266718, 266714, 266708? -j2 + 3j + 266718 What is the s'th term of -455, -419, -383, -347? 36s - 491 What is the b'th term of 50918, 50912, 50902, 50888, 50870, 50848? -2b*2 + 50920 What is the p'th term of 298925, 298927, 298929, 298931, 298933, 298935? 2p + 298923 What is the o'th term of -3920, -7064, -10208, -13352, -16496, -19640? -3144o - 776 What is the w'th term of -196, -333, -414, -439, -408? 28w*2 - 221w - 3 What is the k'th term of -7973, -31941, -71903, -127859, -199809? -7997k2 + 23k + 1 What is the m'th term of -7720, -15451, -23182, -30913, -38644? -7731m + 11 What is the i'th term of 15108, 120757, 407520, 965955, 1886620? 15093i3 - i2 + i + 15 What is the m'th term of -440, -438, -440, -446, -456, -470, -488? -2m2 + 8m - 446 What is the i'th term of 17, -22, -175, -508, -1087, -1978, -3247? -11i3 + 9i*2 + 11i + 8 What is the j'th term of -2533, -10216, -23049, -41032, -64165, -92448, -125881? -2575j2 + 42j What is the s'th term of 39, 294, 969, 2274, 4419, 7614, 12069? 35s3 + 10s - 6 What is the n'th term of -95247, -95236, -95225, -95214, -95203? 11n - 95258 What is the b'th term of -1952, -1932, -1902, -1862, -1812, -1752? 5b*2 + 5b - 1962 What is the o'th term of 1614, 12895, 43520, 103161, 201490, 348179, 552900, 825325? 1612o3 - 3o + 5 What is the a'th term of -646, -594, -506, -382? 18a2 - 2a - 662 What is the i'th term of 1407, 1397, 1387, 1377, 1367? -10i + 1417 What is the p'th term of -3410, -6448, -9486, -12524? -3038p - 372 What is the b'th term of 8209, 8204, 8191, 8164, 8117, 8044, 7939? -b*3 + 2b*2 - 4b	{ "pile_set_name": "DM Mathematics" }
108))? -6 Evaluate -2 + 2004/1320 - 8/(-44). -3/10 Evaluate 3/(-4) - (-8541)/876. 9 What is 99/(-88)(2 + 12/(-9))? -3/4 (6/5)/((-25)/(-125)) - 2 4 What is the value of -5 + 9/(-3) - (1 + -4)? -5 What is the value of (-6)/(-3 + ((-45)/(-2))/5)? -4 Calculate ((-450)/(-525))/(4/(-14)). -3 What is the value of (-7176)/(-8320) + 8/(-10)? 1/16 Calculate (-1)/(-21)(-108)/36. -1/7 What is -4 + (23 - 12) + -6 + 1? 2 What is (282/658)/((-102)/(-28))? 2/17 What is 64/(-192)1/(2/15)? -5/2 Calculate 3/(-6)3 - 629/(-374). 2/11 What is the value of (-3 + 12/4)/(-2)? 0 What is the value of (-15)/12 - (-7)/8439? 2 ((-3)/(-9))/((-1)/3) -1 What is the value of 6/(210/145) + 4-1? 1/7 Calculate -1 + 1 + 16/(-56). -2/7 (7/(-5) - -1)/(2/30) -6 Calculate ((-4 - -6) + -3)-1. 1 What is the value of 2640/420 + 6/(-1 - 0)? 2/7 Evaluate 8/36 + 1 + 112/(-18). -5 What is ((-81)/21 + 3)/(50/(-35))? 3/5 (-5 + 96/18)/((-2)/6) -1 What is the value of (-1)/((154/98)/11)? -7 What is the value of -2(1 + 5/(-10))? -1 Calculate ((-162)/(-30) - 5)/(4/(-5)). -1/2 What is the value of (-12)/1456/(-12) + -4? 0 Evaluate 6/(-240) + 4/10. 3/8 What is (66/21 - 3)/(-1)? -1/7 What is 192/(-528)22/4? -2 Evaluate 9/6(13 + -11). 3 Calculate (3 - (1 + 2))/(-5). 0 (3 + 48/(-20))/3 1/5 Evaluate (-52)/12 + 4 - 247/(-390). 3/10 What is the value of 2/(63/6-2)? -2/21 Evaluate (-12)/14((-150)/18 - -8). 2/7 (3(-5)/90)/(4/(-6)) 1/4 What is (-299)/((-91)/7) + -13? 10 What is ((-1)/3)/(2 + 49/(-21))? 1 1 - (-21)/616/(-7) -7 3 + (-11)/4 - 0 1/4 What is (41)/(-30 - (-20)/(-5))? -2/17 Evaluate (-76)/16 - (-9)/12. -4 Calculate -5 + 10 + (-2)/24. 1 What is the value of ((-2)/10)/(-3 - (-90)/25)? -1/3 What is ((-1)/3)/(5/(-30))? 2 What is 4 + 291/(-57) + 1? -2/19 Evaluate 87/588/(-90). -2/15 Evaluate 4/14((-42)/(-12) - 3). 1/7 Evaluate -6((3894/(-90))/11 - -4). -2/5 What is the value of 7 - (4 + -1 + 3)? 1 Calculate 4/12 - (-4)/80. 1/3 What is the value of (-5)/15 + (8 - (-3210)/(-414))? -2/23 Evaluate ((65/20)/(-13))/(-2). 1/8 What is (-4)/82 - (-2)/(-4)? -3/2 Evaluate 20/(-4) + -3 + 2. -6 Calculate ((-3)/(-4))/(129/516). 3 What is the value of (12/(-28))/(444/56 + -8)? 6 Calculate (12/12)/(4/20). 5 What is 3 + -2(-3 - -6)? -3 (-54)/45(-5)/(-2) -3 What is 1/1 + (46/(-14) - -2)? -2/7 Evaluate 6/18(-4 + 25). 7 Evaluate (2-1 - -1)/(1 + -10). 1/9 What is 15((-192)/396 + (-4)/22)? -10 Calculate 760/(-200) - ((-12)/(-10) - 1). -4 60/150(-10)/16 -1/4 What is (-24)/(-28)196/42? 4 Evaluate 46/(-14) - (-10)/35. -3 What is 3/(238/102(-9)/2)? -2/7 Calculate ((28/(-3))/(-7))/((-4)/(-6)). 2 What is the value of ((-8)/8)/((-1)/(-5))? -5 What is ((4 - -2) + 1 - 14)/(-1)? 7 Calculate ((-39)/(-12) - 3)-28. -7 Evaluate (7/21)/(12/(-48)). -4/3 What is the value of (-58)/1455/2? -1 110/45 - 4/9 2 Calculate (4 - -2)7(-3)/63. -2 Calculate 4/2082-4. -2/13 What is 04/48 - -11? 11 Evaluate 126/(-135) + 1/3. -3/5 What is the value of (-75)/450 - ((-1)/(-2) + -1)? 1/3 Evaluate 5/((-100)/12)140/(-294). 2/7 Calculate (-198)/273 + 1 + (-50)/(-325). 3/7 Calculate (6/2 - -2) + -10. -5 What is (-3 + 21/6)/(22/308)? 7 What is the value of ((-8)/(-24)0)/9? 0 What is the value of (-8)/12(-27)/(-45)? -2/5 What is ((-2)/(-8))/((-51)/(-204))? 1 (51/(-17))/(6/(-14)) 7 What is the value of (-56)/(-462)(-6)/(-4)? 2/11 What is (1/9)/(1/(-2))? -2/9 What is the value of -53 + 39 - (-512)/36? 2/9 Evaluate (-13 - -8) + 12/2. 1 What is the value of ((-72)/135)/(4/(-10))? 4/3 Evaluate (-20 + 18)(16/(-6) - -2). 4/3 (-8)/(-24) - (-13)/(-3) -4 What is (-33)/297 + (399/216)/(-7)? -3/8 What is the value of (30/(-36))/((-270)/(-72))? -2/9 Calculate (-2)/6 - ((-4 - -4) + 0). -1/3 What is the value of 13/(-4)4? -3 76/(-14) + 0 + (-30)/(-70) -5 Evaluate (-13)/260 - 3/(-12). 1/5 Evaluate (4/5)/((6 - 11)/25). -4 Evaluate ((-7)/56)/((-3)/(-18)). -3/4 What is 1 + (4/6 - 6/9)? 1 What is the value of ((-1)/4-2)/((-29)/58)? -1 (-14)/(-30) - 5/(-25) 2/3 What is 170/(-40) - (0 + -4)? -1/4 What is the value of 6/7(-63)/(-18)? 3 What is (-42)/668/(-28)? 2/11 Calculate 5/15 + 170/30. 6 What is (60 - 62)(-3)/2? 3 What is 31/(-248) - 45/24? -2 Calculate (-34)/(-12) - (4 + -1). -1/6 Calculate (-1813)/1078 + (-3)/(-2)1. -2/11 0/(2 + -4 + 1) 0 What is the value of 4 - 183/27 - 2/9? -3 What is the value of (150/90)/((-15)/(-27) - 0)? 3 Calculate (-16)/(-2520)14(-5)/2. -2/9 Calculate 80/(-38) + 24/(96/8). -2/19 Evaluate 10/135 + 97/(-216). -3/8 1/(6/(-12) + 1) 2 Evaluate 8/2 + 17 + (16 - 30). 7 Calculate ((-10)/(-15))/(1/(-3)). -2 What is (-3)/(-3)(6 + -3)? 3 Evaluate (-13)/11 + 1 - 9576/(-1848). 5 Evaluate -758/609(-11 + 2). 6 Evaluate (-1552)/112 + 5 - -9. 1/7 What is the value of -14 + 10 - (0 - -1)? -5 (3/48-2)/(75/(-100)) 1/6 Evaluate 39/65(-5)/(-6). 1/2 What is (-4)/((-8)/(-3))4/3? -2 What is -2 + (-18)/(-8) + 15/30? 3/4 What is 9/4792/(-297)? -6 What is ((-3)/(-18))/((-6)/(-8))? 2/9 (135/(-405))/((-1)/(-9)) -3 0/(-3) - (0 + 3) -3 Evaluate 2/(12/(-20) - (-2)/(-30)). -3 Evaluate (-2)/((-2)/1) - 5/5. 0 152/(-56) - (10/(-14) - -1) -3 Calculate (12/8)/(2(-3)/(-12)). 3 Calculate 70/(-245) + (-4)/14. -4/7 What is 10/(-3)-11(-252)/1155? -8 What is 2/16124/(-3)? -2 Calculate (912/380)/((-17)/(-10) + -2). -8 What is the value of (-4 + 2)1/5? -2/5 Calculate (-2 - 2)4/81. -2 Calculate 62/(-16)(-2)/(-3). -1/2 What is the value of -7((-3)/((-21)/10) - 2)? 4 What is (-155)/(-55) - (3 - 35/11)? 3 Calculate -1 + 0 - (-14)/4. 5/2 What is the value of ((-6)/28)/3 - 6/14? -1/2 Evaluate (-2)/4 + 11/10. 3/5 Calculate (-376)/(-360) + 24/(-40). 4/9 Evaluate 357/(-147) + 12/28. -2 What is the value of (-5)/8(10 - 6 - 2)? -5/4 What is the value of 2 - (2 + -6 + 3)? 3 What is the value of 30/(-35)7/(-21)? 2/7 What is 34/(-10) - (-6)/2? -2/5 What is the value of (-135)/((-210)/(-14)) + (-4)/(-1)? -5 Evaluate -2(-8 + (-330)/(-42)). 2/7 What is the value of 33/368 + -8? -2/3 Calculate (-20)/(-6)36/(-15). -4 What is the value of (-45)/(-5) - 780/84? -2/7 What is 6/14 + (-135)/756? 1/4 Calculate ((1479/(-34))/29)/((-6)/(-8)). -2 What is (-5 + 3)3/21? -2/7 Evaluate ((-451)/5412)/((-8)/(-6) - 1). -1/4 Calculate 0/((21 + -19)/(0 + -1)). 0 2-34/24 -1 Calculate (2 - (-30)/(-9))/(164/(-861)). 7 What is the value of (-1)/(-7) - 1701/(-441)? 4 (21/63)/(2(-2)/48) -4 Calculate -5 + ((-4)/12 - -5). -1/3 What is the value of 4/9 - (-259)/(-333)? -1/3 What is 72/34 - ((-438)/34 - -13)? 2 What is -3 - 3/((-12)/4)? -2 Evaluate (-9)/22736/1539. -8 What is the value of -81 - 6225/(-750)? 3/10 4/(-46) + (-14688)/2484 -6 Calculate (-2 + 6 - 3) + (-12)/(-6). 3 (0/(-4))/4 + 2/(-10) -1/5 What is the value of -6 - -7 - (-213)/(-36) - -5? 1/12 What is (-34)/34((-21)/8 - -3)? -3/8 Calculate (18/(-8))/(57/(-152)). 6 34/68(2 - 6) -2 5 + (-14)/2 - -6 4 What is ((-588)/33)/4 + 60/(-110)? -5 What is the value of -2 + 9 - (-6)/(-60)76? -3/5 What is (1 - 2/3) + (-70)/126? -2/9 What is (-6 - -1) + -1 + 0 + 2? -4 What is the value of 9/15250/300? 1/2 Calculate (5 - 0/(-2)) + -5. 0 Evaluate -2 - 7/((-140)/52). 3/5 Evaluate (63/(-21))/(9/6). -2 (-32)/(-44)11/44 2/11 Calculate 2 + (-28)/4 + 7 + 0. 2 Calculate (-3)/(-15)7/(7/(-4)). -4/5 What is (1 + (-17)/5)/((-38)/95)? 6 Calculate (10/12)/((-110)/(-66)). 1/2 What is the value of (-4 - 0) + (-124)/(-30)? 2/15 18/(-12)12/(-9) 2 What is the value of 4/(-24) - 25/(-6)? 4 Calculate 2/(1/(-12/6)). -2/3 What is 16/136(2 + 15)? 2 Calculate (1/(6/9))/(3/(-16)). -8 ((-4)/14)/((-2)/14) 2 Evaluate (-21)/54(-4)/7. 2/9 Evaluate ((-1)/((-3)/(-2)))/(20/(-30)). 1 Calculate (-18)/12(-4)/(-14). -3/7 3/2 - 126/(-36) 5 What is (-5 - 55/(-10))-12 - -1? -5 ((-4)/(-5))/(-8 + 39/5) -4 What is the value of 18/3(-8)/6? -8 What is (5/4-1)/((-1)/4)? 5 Evaluate 966/644 + 1 + -1. 3/2 1/8(7 + -4)8 3 Calculate (-78)/(-13)(-4)/6. -4 15 - (2783/165 + -2) 2/15 What is the value of 2/2(-48)/240? -1/5 What is 69/168 + 0 + (-34)/119? 1/8 What is the value of 1/9(6 - 3)? 1/3 Evaluate 3/(-18)-857/38. 2 What is ((-5)/2)/((-2)/4)? 5 What is 6 + (6 - (-162)/(-12))? -3/2 Evaluate 3*(-8)/12 + 0. -2 Evaluate (-5)/(-1) - 126/18. -2 What is the value of (-8)/21 - (-6)/9? 2/7 Calculate ((-6)/(-12))/(-4 - (1 + -7)). 1/4 Calculate (-4)/(-26) -	{ "pile_set_name": "DM Mathematics" }
- a, -2m + 2a = -16. Let h = z + m. Does 2 divide h? True Let f(w) = 2w2 - 8w. Let z be f(6). Does 12 divide (-9)/2(-128)/z? True Let y(l) = l3 + l2 - 17. Let i be y(0). Let v = 8 - i. Does 13 divide v? False Let u(w) = 25w - 19. Is 37 a factor of u(9)? False Let l(i) = -2 - 2 - 3i + 5. Is l(-3) a multiple of 5? True Let q(o) = 11o*2 + o + 2. Let y(f) = -12f*2 - f - 1. Let l(h) = -3q(h) - 4y(h). Let r be l(2). Suppose 0 = 4b + b - r. Is b a multiple of 6? True Let m = -247 - -475. Is m a multiple of 12? True Suppose 2t = 5p - 20 + 6, -3t = 2p - 17. Suppose 4d + q - 17 = 0, 3q - 3 = pd - 0. Suppose 2i + 32 = v, i = -dv - 27 + 102. Does 9 divide v? False Suppose -2k = 2k - 5m - 10, -k + 3m + 6 = 0. Let r = k + 4. Does 3 divide r? False Suppose 0 = 5t - 2t - 3z + 42, 4t + 11 = -5z. Let i = 24 + -2. Let k = t + i. Is 11 a factor of k? False Let x be ((-2)/(-4) + -1)0. Let s be (1 - 2)0 + 2. Suppose xc = sc - 4n - 8, -52 = -4c - n. Is 6 a factor of c? True Suppose -4v - 174 = -6v. Is v a multiple of 14? False Suppose 0 = -3b + 138 + 6. Is 16 a factor of b? True Let o(m) = -m - 9. Let x be o(-6). Let v(d) = 5d*2 + 6d + 6. Does 33 divide v(x)? True Suppose -41d = -38d - 906. Does 9 divide d? False Let x = 5 - 1. Let f be (3/x)/((-1)/(-4)). Suppose 48 = fa - a - o, 88 = 4a - 4o. Is 14 a factor of a? False Let b(r) = r3 - 4r*2 - 9r + 13. Let u be b(6). Let z = u + -19. Is z a multiple of 9? False Suppose -j - 4 + 0 = 0, 2o + 4j = 458. Does 18 divide o? False Let x be 108/(-3)(3 - 4). Suppose p + p = x. Does 6 divide p? True Suppose 4s + 4v = -0s + 4, 3v = 3s + 3. Does 13 divide (s + 52/(-16))-12? True Let r(x) = x3 + x2 - 2. Let u be r(0). Let b(g) = -g3 + 2g*2 + 2g - 1. Is 11 a factor of b(u)? True Let g(x) = -3x2 - x - 5. Let b be g(-4). Let h be 1(0 + -3 - 84). Let o = b - h. Is 15 a factor of o? False Suppose 0 = a - 4u - 11, -139 = -5a - 0u - u. Is 14 a factor of a? False Suppose 4t = -t + 155. Is t a multiple of 6? False Suppose -12 = q - 4q. Suppose -80 = -2s + qv, -3v + 2v = -4. Is s a multiple of 13? False Let h(r) = 4 + 0 + r3 + 8r*2 + 1 + 3. Is h(-8) a multiple of 5? False Suppose -15 = -14d + 9d. Suppose ds - 240 = -s. Is 16 a factor of s? False Let k = -33 - -81. Does 16 divide k? True Let c = 2 - -24. Is 11 a factor of c? False Suppose 0 = 3j - 289 + 64. Is 24 a factor of j? False Suppose 0 = -3l, -j + 33 = l - 3l. Is 15 a factor of j? False Let b be (3 - 2) + 1/1. Suppose -2u = 5h - 5, -3u - 2u + 2h - b = 0. Let w = 9 + u. Does 6 divide w? False Let f(c) be the second derivative of -c*3/6 + 17c*2/2 - 3c. Is 17 a factor of f(0)? True Let i be ((-2)/(-2))/(-1) - -12. Let g(r) = r*3 - 2 + 4r*2 - ir + 6r2 - 3r*2. Is g(-8) a multiple of 11? True Suppose -2x = 5f - 9, 3f - 3x = -x + 15. Suppose -3t = -2t - f. Suppose 3q = 3k - k + 41, -5q + 81 = tk. Does 10 divide q? False Suppose 3b - 2b = 1. Let a(t) = 16t*2. Does 16 divide a(b)? True Let d = 4 - -110. Does 6 divide d? True Let q(b) = -2b - 4. Let g be q(-5). Let h(u) = 2 - u + u*3 - u + 9u - 7u2. Is h(g) a multiple of 4? True Suppose -8p + 3p = -2r - 75, 5r + 156 = 2p. Let k be 516/10 + 4/10. Let d = k + r. Is 11 a factor of d? True Let z(x) = -8x + 4. Let m(v) = 16v - 8. Let h(y) = -y. Let u be h(-3). Let k(r) = um(r) + 5z(r). Is k(3) a multiple of 8? False Suppose x - 12 = 2k, 7x + 3k = 3x + 15. Let q be (-1 - (-2 - 0)) + x. Let f = q + -5. Is f a multiple of 2? True Let p be (3/2)/(1/2). Suppose 2n = -pn + 240. Is n a multiple of 16? True Let u(a) = -21a2 + 1. Let z be u(1). Let i = -35 - z. Is 3 a factor of (8/(-10))/(3/i)? False Suppose -5 = -2t - s, -4t + 2s + 38 = 8. Suppose -tq + 4q - 2 = 0. Let m = 16 - q. Is m a multiple of 18? True Let q be ((-3)/2)/(3/4). Let c = q - -8. Suppose -o - 25 = -co. Is 3 a factor of o? False Let w(d) = -4d*3 - 4d*2 + 6d - 7. Let m(b) = 3b3 + 4b*2 - 5b + 6. Let i(j) = -3m(j) - 2w(j). Let v be 10/(-3 - (-1 + 0)). Does 3 divide i(v)? True Let v(g) = -15g - 9. Let r(c) = -1. Let q(m) = -3r(m) + v(m). Let k be q(-7). Suppose -2y - k = -5y. Does 17 divide y? False Let a(h) = h. Let n be ((-3)/2)/(5/(-10)). Let r be a(n). Suppose -59 = -5f + z + 45, rz - 68 = -4f. Is 10 a factor of f? True Let g = 6 + -5. Let x be g/(-5) + (-4)/(-20). Suppose -2k - k + 30 = x. Is k a multiple of 4? False Let l(p) = -2p3 - 5p*2 - 3p + 4. Suppose 0 = 3a - a + 6. Let v be l(a). Let i = v - 15. Is 4 a factor of i? False Suppose 0q - 33 = -3q. Suppose b - 1 = -p, -q = 3b - 2. Is 4 a factor of p? True Suppose 0 = -b + 5c - 6, 3b + 4c = 20. Suppose -2j + 28 = -bp, 4j = -2p + 7 + 49. Suppose 16 = x + h, 0 = 5h + 4 - j. Does 11 divide x? False Let u(i) = i - 3. Let f be u(6). Suppose -2n - fn = 20. Does 5 divide (-2 - -17)n/(-10)? False Suppose -4t - 5h = -56 - 75, -4t - 4h = -136. Is 13 a factor of t? True Suppose 4w - 15 - 1 = 0. Suppose -2g - w = -4g. Suppose 2o = gz - 13 + 1, 26 = 3z - o. Is 9 a factor of z? False Let c be -1(1 - (-2)/(-2)). Let q(i) = i3 + i2 - i + 4. Does 3 divide q(c)? False Suppose -164 = -5t - 44. Suppose 94 = -5n + t. Is 1/(2/n)-3 a multiple of 8? False Suppose -4q - 112 = -8q. Let y = 12 + q. Is y a multiple of 20? True Let a(g) = g3 + 11g*2 - 13g + 4. Is 8 a factor of a(-12)? True Let r be 0 + -2 + -2 + 1. Let y be (r/(-4))/(2/96). Suppose g - y = -2g. Is g a multiple of 12? True Suppose 4w = 7w + 3i - 213, 3i = -2w + 147. Is w a multiple of 11? True Is 32 a factor of 321(-27 - -28)? True Let s(a) be the third derivative of -a*4/24 + 7a*3/6 + 3a*2. Is 12 a factor of s(-5)? True Suppose -7 = 4k - 3. Is (-129)/(-6) + k/(-2) a multiple of 11? True Let p = 69 + -39. Suppose 0 = -4g - p + 174. Suppose 5i - g = -11. Is i a multiple of 2? False Let r = 5 + -5. Suppose u + u - 5 = 5y, r = 3u + y + 18. Let i = u - -10. Does 3 divide i? False Suppose 18d = 14d + 192. Does 24 divide d? True Let a(u) = u*3 - 2u*2 + 1. Let f = 16 + -13. Is a(f) a multiple of 6? False Let m = 36 - -24. Suppose -6v + 3v = -m. Is 15 a factor of v? False Let t = -3 + 7. Suppose 0 = to + 59 + 13. Let i = -10 - o. Is i a multiple of 3? False Let r(p) = -5p2 + p3 + 2p*2 + 12p*2 - 7. Let o be r(-5). Suppose -2z - o = -6z - 5n, 5z + 3n = 126. Is 9 a factor of z? True Let m = 0 + 29. Does 3 divide m? False Let u(c) = c*3 + 4c*2 + 4c + 2. Let d be u(-2). Does 16 divide 37/((d + 1)/6)? False Suppose 3x - 2x - 3b = 2, 2 = 2x - 5b. Let u = 4 - x. Let d = -5 + u. Does 3 divide d? True Let n(i) = -7i + 28. Is n(-12) a multiple of 28? True Suppose 155 = 4l - 225. Let g = -44 + l. Does 17 divide g? True Let v be (-35)/(-14) - (-1)/2. Suppose vw + c = 119, 7 - 20 = -w + 5c. Is w a multiple of 6? False Let q = 21 - -21. Is q a multiple of 6? True Let f = 70 + -6. Suppose -4a - 4c + 56 = -f, 0 = c + 4. Is a a multiple of 10? False Suppose -4p + 357 + 267 = 0. Does 30 divide p? False Suppose 5l - 8l + 45 = 0. Is 9 a factor of l? False Let v(r) = -r*2 + 11r - 4. Let c be v(10). Suppose l - c = -i + 15, 0 = -2l + 6. Is 9 a factor of i? True Suppose 0 = -2u - 3 - 1. Is u/2 - (-12)/3 even? False Suppose 3h = 4j + 69 - 16, -2 = -2j. Is h a multiple of 10? False Suppose -6f + 2f = 0. Suppose 3t - 5 - 10 = f. Suppose 0 = tr + 4 - 39. Does 7 divide r? True Let z(h) = h2 + 3h + 1. Let i be z(-5). Let v(b) = -b*3 + 11b*2 + 5b - 11. Is v(i) a multiple of 11? True Suppose -2y + 15 = -15. Let x = y - 12. Is 2 a factor of x? False Let s = -54 + 117. Does 12 divide s? False Let c(d) = 15d. Suppose 3k = -2 + 8. Does 15 divide c(k)? True Let k(m) = m2 + 2m - 4. Let f be k(6). Suppose 0 = -3c - 12, -16 = -3v - 3c + f. Is 24 a factor of v? True Let j = -312 + 554. Does 18 divide j? False Let d be (-71)/(-6) + (-3)/(-18). Suppose -5l + 213 = -j, -d = 4j - 0j. Is l a multiple of 21? True Let w = 2 - -8. Let h(g) = -g*2 + 14g - 10. Does 15 divide h(w)? True Let l = -19 + 35. Does 16 divide l? True Let f(p) = p*2 + p. Suppose -3y - 12 = 0, 6i = 2i - 2y - 36. Let d be f(i). Suppose -2g + d + 34 = 0. Does	{ "pile_set_name": "DM Mathematics" }
2 + o + tk and give w. 8 Rearrange 12v*4 + 2659v*3 - 18v*4 + 7 - 2660v*3 + 3v*2 - 4 to zv*2 + fv*4 + wv*3 + x + dv and give x. 3 Rearrange (3 + 0 + 0)(2j*3 - 2j*3 + 2j*3) + (1 - 1 - 1)(-3j + j3 + 3j) - 111j + 111j + 19j3 to the form rj*3 + lj + aj2 + x and give r. 24 Rearrange (1 - 3b - 1)(-3 + 3 - b) + (2b + 0b - b)(25b - 26b + 24b) to o + lb + ub2 and give u. 26 Rearrange 607l + 886l + 77l - 442l to d + kl and give k. 1128 Express ((-3 + 7 - 8)(k - 3k + k) - 56k + 96 - 96)(-1 + 5 - 6) in the form uk + w and give u. 104 Rearrange 24b*2 - 26b*2 - 9b - 2b3 + 4b*2 + 1 to tb*2 + gb + rb3 + l and give r. -2 Express q - 31q*2 - 2q*4 + 28q*2 + 6q*4 as cq*3 + xq + a + hq4 + pq*2 and give a. 0 Express -222n*2 + 201n*2 + 657n2 - n2 + 2n2 - 2n*2 + (n - 6n + 3n)(3n - 3n + 2n) as kn + cn2 + h and give c. 631 Rearrange (2719 - 2719 + 62l*2)(l - 3l + 4l)(-1 - l + 1) to the form f + il*2 + rl + tl4 + ol*3 and give t. -124 Express (-3 + 1 + 4)(-o2 + o2 - 2o2) - o + o + o2 - 16o*2 - 15o - 22o2 + 12o as zo2 + p + fo and give f. -3 Rearrange 1971i + 1881i - 3971i to the form ri + f and give r. -119 Express (-7022 - 3388z + 3513 + 3507)(2z2 + 2 - 3 - z2) as s + yz*3 + oz*2 + qz and give y. -3388 Rearrange (-2s - s - 6s)(1120s + 305 - 561s - 557s) to the form js2 + h + zs and give z. -2745 Express 0 - 7856t + 51t*2 - 1 + 7851t - 1 in the form o + vt2 + xt and give x. -5 Rearrange 26b3 + 7b*3 - 4b + 0b - 21b*3 to ob + ub3 + rb*2 + p and give u. 12 Rearrange 53a*2 + 50a*2 + 16a*2 + (-3a2 + a2 + 3a2)(-2 - 2 + 2) to the form d + oa2 + za and give d. 0 Express (-3q + 3q + 2q)(2q - 2q - 2q2) + 624q*3 + 623q*3 + 5 - 11q*2 - 1246q*3 as t + zq*3 + vq*2 + nq and give v. -11 Express (-1 - 1 + 3)(a + 0a + 2a)(49 + 57 - 18) + 3 - 3 - a in the form z + qa and give q. 263 Rearrange -2t*4 - 644t*2 + 57t*2 - 337t*2 + (-3 + 2 + 0)(3t4 - t4 + 0t*4) to xt*2 + b + kt*4 + rt*3 + ut and give x. -924 Rearrange (-7g + 4g + g)(-1 - 3 + 1)(-2g2 + 5g2 - g2) to the form ug2 + l + sg + jg3 and give j. 12 Express (p + 0 + 0)(9 + 97257p - 97259p - 5p2 + 2p*2) in the form up*2 + op + rp3 + d and give o. 9 Rearrange 44d*3 - 1 + 14d*2 + 10d*2 - 45d*3 to the form k + rd*3 + qd + ud2 and give k. -1 Express (-2p + p - 2p)(29p - 257p - 20p) as w + kp*2 + mp and give k. 744 Rearrange -79y3 + 813 + 231y*3 - 819 to the form hy*2 + my + z + ty3 and give t. 152 Express -39k - 107k4 + k2 - 115k*4 + 242k*4 in the form rk*3 + uk*2 + ck + w + zk4 and give c. -39 Express -3 + 2x - 17x2 - x4 + 2x*3 - 10x + 27x - 17x as zx4 + j + qx + yx3 + dx*2 and give d. -17 Express -14m2 - 8 - m4 + 11m2 + 3m*2 - 4m in the form s + rm3 + hm*4 + am + cm2 and give r. 0 Rearrange 62 - 21 + 688f - 19 - 21 to vf + a and give a. 1 Express 361z - 1084z + 360z - 117 + 362z as pz + j and give p. -1 Rearrange 6n4 + 46n*2 + 12n + 51n2 + 8 + 50n*2 - 149n*2 - 5 to the form gn*3 + f + dn*4 + an + bn2 and give a. 12 Express 16 - 59 + 10 + 16 + 18n*3 + 21 as l + un + cn2 + dn*3 and give d. 18 Rearrange -1023f - 23 + 1056f + 6 to the form vf + t and give v. 33 Rearrange 141 - 278 + 137 - 178b to the form t + hb and give h. -178 Express (0a + 4a - 6a)(-2 - 1 + 0) - 229a + 475a + 39a in the form i + ma and give i. 0 Rearrange -3u - 30u + 47u - u2 + 61u to the form bu2 + p + iu and give i. 75 Express 129r2 + 144r*2 + 151r*2 - 17r*2 - 28r*2 in the form br*2 + hr + s and give b. 379 Express (2 - 2 + q - 2q - q + 4q + (-3 + 3 - q)(2 + 3 - 7) + q - 3 + 3)(396 - 40q - 32q + 70q) as aq + fq2 + k and give a. 1980 Express (3u + 4u - 6u)(-3u + u + 4u)(-7 + 2 + 0)(3 + 1 + 2) - 40u + 40u - 8u*2 in the form gu*2 + qu + w and give g. -68 Express 3a3 - a - 2a*2 + 5 + 2 - 9 - 4 in the form i + sa*3 + ya + ga2 and give g. -2 Express (53y2 - y2 - 552y2 - 403y*2)(-2 + 2 - 2y) in the form ry*2 + gy + ky3 + t and give k. 1806 Rearrange 340a*2 + 1 - 31 - 342a*2 to the form d + xa + za2 and give d. -30 Rearrange (-5 + 5 + 8)(-7u + 2u - 16u) to hu + a and give h. -168 Rearrange -26d - 8d*4 + 2d3 + d4 + 0d3 + 108d + 2d4 to id*2 + qd*3 + sd + kd4 + h and give q. 2 Express 21g*2 - 50g*2 + 230g*2 + 41g*2 in the form ig*2 + cg + q and give i. 242 Express 11t2 + 4t*2 - 7t + 2t2 - 33t*2 in the form yt + q + ut2 and give y. -7 Express (2 - 1 - 3)(-233401q + 1 + 233405q + 5) as cq + z and give z. -12 Express (-1328 - 27 - 1146)(5 + p - 5) as kp + c and give k. -2501 Express (-35 - 21 - 12)(4p4 - 3p*4 + 8p*4) in the form op*3 + ip*2 + d + rp + tp4 and give t. -612 Express -19 + n + n2 - 28n*2 - 8 + 27 in the form rn + yn2 + l and give y. -27 Express (0q + 3q - 2q + (-5 + 3 + 3)(q + q - 5q))(0q - 5q + q)(q + 9q - 6q) as cq3 + wq*2 + hq + g and give c. 32 Rearrange -13m - 22m + m + (-2m - 3m + 6m)(7 - 1 - 3) to the form gm + y and give g. -31 Rearrange -2y*3 - 3y*3 + 6y3 - y2 - 4y + 0 + 34y + 3 to sy3 + r + xy*2 + fy and give x. -1 Express -642w - 44w - 443w + 126w + 106w in the form yw + o and give y. -897 Rearrange (1 + 0 + 0)(86c + 227 - 227 + (3c - 5c + 4c)(1 - 1 - 1))(0 + 2 - 1) to z + gc and give g. 84 Rearrange -3144t3 + 4t*4 - 8t - 2t4 - t2 + 3145t*3 + 25t2 + t2 to the form j + st2 + ft*4 + lt + at3 and give f. 2 Express (2 - 2 + 5d)(54d + 82d - 17d) as ld2 + vd + z and give l. 595 Express (-2 + 1 + 2)(96d*2 - 35d*2 + 151d*2) + 0d2 - d2 + 4d2 as kd + r + zd2 and give k. 0 Express -o3 - 3o*2 - 9o - o*2 + 1 - 13o + 20o in the form ko*2 + to*3 + wo + m and give w. -2 Rearrange (8 + 0 + 18)(4r*2 - 4r2 + r2) - 4 + 4 + 3r2 to the form nr*2 + y + kr and give n. 29 Rearrange 20c2 - 66c*2 + 28c*2 + 2c + 2c3 + 24c*2 to n + gc + ac3 + jc*2 and give j. 6 Express ((1 - 3 + 1)(x*2 + 4x*2 - 3x*2) + 4116x*2 + 1828x*2 - 1391x*2 + 89x*2)(4x - 3x + 2x) in the form sx*2 + qx + tx3 + c and give s. 0 Rearrange (-11 - 8 - 4)(-5l - 20l - 33l) to tl + u and give t. 1334 Express ((-2 + 0 + 1)(-1 + 4 - 2) + 4 + 1 - 3)(2k2 + 2k2 - k2)((-5 + 1 + 5)(3k + 2k - 3k) - 3 + 3 - 8k) as o + hk + ck*3 + tk*2 and give c. -18 Express (4y + 19 - 19)(3 + 1 + 1)(-22 - 2y2 + 22) as gy*3 + ty*2 + dy + w and give w. 0 Rearrange 0t + 0t - 19416 + 19416 - 848t2 to d + gt + jt2 and give j. -848 Rearrange -4 - 5b*2 - 5b2 + b2 - 3b2 to n + cb + rb2 and give r. -12 Rearrange (-10 + 10982g*2 - 10277g*2 + 11)(3g - 2g - 2g) to h + zg + ig2 + xg*3 and give x. -705 Express (86p*2 - 38p*2 - 46p*2 - 115p)(-2 + 2 + 3p) as wp + ap*3 + ip*2 + m and give a. 6 Rearrange 7l*2 - 11l*2 + 32l - 34l + 55l*3 + 2l*2 to the form ul*3 + cl*2 + k + ol and give u. 55 Express (3 + 3 - 308538p + 308538p - 82p2)(2p - 5p + 2p) as z + hp + ap2 + rp*3 and give h. -6 Rearrange 5h*3 - 2 + 0h*3 - 4h*2 + 8h*2 + 11h - h*2 - 4h*3 to ch + ah2 + dh*3 + j and give a. 3 Rearrange (3 - 4 + 2)(8 + 2 - 3)(-6z - 10z - 13z) to rz + x and give r. -203 Express -208m - 42 - 95m + 42 + 50m as s + vm and give v. -253 Rearrange 122o*2 - 2o - 62o2 + 2 + 3o - 61o2 + 584o*4 to no*4 + xo*2 + do*3 + ko + q and give n. 584 Express (f3 + f3 - f*3)(-2f + 4f - f) - 37495f + 37495f + 27f4 + 20 in the form rf*3 + sf*2 + kf*4 + tf + w and give k. 28 Express -63h + 36h + 26h + 2h*2 + 2 in the form t + qh + rh2 and give r. 2 Rearrange -9 - 6 + 1004k - 14 + 29 to the form o + vk and give v. 1004 Rearrange 35n*2 + 99n*2 + 3n - 3n to the form f + cn*2 + bn and give c. 134 Express (18 - 18 - 4n)(-2 - 1	{ "pile_set_name": "DM Mathematics" }
) = 35r2 + 1. Let z be i(q). What is the highest common factor of x and z? 18 Let p be (-2)/(-7) - 96/(-7). Suppose 27 = c - 1. Calculate the highest common divisor of p and c. 14 Let w(u) = 12u - 10. Let h be w(10). Let f = 0 + 10. What is the greatest common factor of h and f? 10 Suppose -21x = -17x - 12. Let w(z) = -z*2 + 7z - 3. Let o be w(4). Let h = o - x. Calculate the highest common factor of h and 36. 6 Let r(a) be the second derivative of a*5/20 + 3a4/4 - a3/6 + 13a2/2 + 3a. Let x be r(-9). Calculate the highest common divisor of x and 11. 11 Suppose -3q + 81 = 9. Suppose -k + 4b + 16 = 0, -2k - 4b = -k + 8. Suppose -ki + q = -0i. What is the highest common divisor of 15 and i? 3 Let f be 2 - 0 - 0/11. What is the greatest common factor of f and 4? 2 Let r(y) = y*2 - 3y - 4. Let f be r(-6). Let p be ((-4)/(-2))/((-2)/(-26)). Suppose p = 2t - 14. Calculate the highest common divisor of f and t. 10 Let t be (-6)/15 + 132/5. Let g = 114 - 49. What is the greatest common divisor of g and t? 13 Let t(j) = j2 + 2j - 3. Let c be t(5). Calculate the highest common factor of c and 8. 8 Suppose -2q = -6, 2q - 21 = -5h - 0. Suppose 4r - 2 = 2l - l, 4l - hr - 57 = 0. What is the highest common divisor of l and 3? 3 Suppose 7a - 5a = -50. Suppose -d + 18 = -17. Let u = a + d. What is the greatest common factor of 110 and u? 10 Let f = 22 + -18. What is the highest common factor of 4 and f? 4 Let m = 13 - -1. Let s = m - 6. Suppose -41t + 40t = -40. What is the highest common divisor of s and t? 8 Suppose -3a + 4j + 234 = 34, -a + 84 = 3j. Suppose 5p = 10p + 55. Let w = p - -19. What is the highest common factor of w and a? 8 Let a be (-1 - (-3 + 2)) + 6. Let k be -2(-1)/(1/1). Let n be k/9 - 16/(-9). Calculate the greatest common divisor of n and a. 2 Let b(g) be the third derivative of -g4/24 - 4g*3/3 + 3g*2. Let r be b(-10). Calculate the highest common divisor of r and 16. 2 Let f = 9 + 71. What is the greatest common divisor of f and 16? 16 Suppose 0 = -4v - 4c + 64, -3c = 4v - 2c - 76. Let x = v + -14. What is the highest common factor of x and 54? 6 Suppose -2 + 14 = 4b. Suppose -bz = -4z + 14. Calculate the greatest common factor of 21 and z. 7 Let d(s) = -s3 + 6s*2 - 4s + 3. Let q(r) = -r*2 + 3r - 3. Let n be q(3). Let k = 2 - n. Let h be d(k). Calculate the highest common factor of 20 and h. 4 Let b(s) = -s + 8. Let x be b(6). Suppose -27 = -2j + 5i + 18, 0 = -xj + 3i + 35. Let k be 4 + 5 + 49/(-7). Calculate the highest common factor of k and j. 2 Let l be (-1 + (-1)/(-2))-4. Suppose lc - 4 = c. Suppose -4w + z + 38 = 0, -cw + 42 = z - 0. Calculate the greatest common factor of w and 20. 10 Let i be -6 + 17 + 3/1. What is the greatest common divisor of 182 and i? 14 Let o = -21 + 25. Let n be 1o - (-1 + 1). Calculate the greatest common factor of 4 and n. 4 Suppose -10r = -0r - 120. Let h = 227 + -95. Calculate the greatest common divisor of h and r. 12 Let s(z) = 3z - 2. Let l be s(2). Suppose 0 = -4v - 4u - 24, 0 = -v - 5u + u - 6. Let m = l - v. What is the highest common factor of 4 and m? 2 Let a(y) = -5y + y + 4 + 5 - 3y - y2. Let w be a(-7). Calculate the highest common factor of 9 and w. 9 Let y = 26 + -5. Let f = -11 + y. Let r be f + -5 + (2 - 0). Calculate the highest common factor of r and 7. 7 Let j be (4 - 11)(-24)/14. Let n be 6 - -4 - (2 + 0). Calculate the highest common divisor of j and n. 4 Let c be ((-6)/(-4))/((-18)/(-264)). Let y = -12 + c. What is the greatest common factor of 50 and y? 10 Let s be -13/6-2. Let b be (s - (-2 - -2)) + 3. Suppose -3z - 4q + 100 = 0, -2z + q = -q - 76. Calculate the highest common factor of b and z. 4 Let k(g) = g - 4. Let s be k(7). Suppose 23 = 2f - s. Calculate the highest common divisor of f and 143. 13 Let w(y) = -13y + 2. Let l be w(-2). Let b(z) = 7 - 6 + lz*2 + 43z*2. Let p be b(-1). What is the greatest common factor of p and 9? 9 Let d be ((-6)/2)/35. Let q(r) = -3r - 7. Let j be q(d). Let k be (-99)/(-12) - (-6)/j. What is the greatest common divisor of k and 9? 9 Let g(t) = -t3 - 2t*2 + 3t - 1. Let k be g(-4). Let n = -1 + 0. Let s be 172 + 4/(-2) - n. Calculate the greatest common divisor of s and k. 19 Suppose s + s = w + 13, -4s - 49 = 3w. Let c be ((-16)/(-12))/((-1)/w). Let m = -48 - -78. Calculate the highest common divisor of m and c. 10 Let z = -37 + 151. Calculate the highest common factor of z and 38. 38 Suppose -2n + 5d - 23 = 0, 4d - 25 = -7n + 2n. Calculate the greatest common divisor of 1 and n. 1 Suppose 2z + 160 = 10z. Calculate the highest common divisor of 30 and z. 10 Suppose -3 = -4k + 17. Suppose -71 = -3t + ku, 5t - 2u = 187 - 56. Let v = t + -19. Calculate the greatest common divisor of 24 and v. 8 Let k = -10 - 5. Let g = 23 + k. Calculate the greatest common factor of g and 56. 8 Let f(j) = j*2 - 7j - 4. Let g be f(8). Suppose 72 - 8 = gk. Let i = 8 - 4. What is the highest common divisor of i and k? 4 Suppose -q - 11 = u - 0u, 2q = -4u - 34. Let f be 3u/(-9)50. What is the greatest common factor of f and 40? 20 Let h be -14 + 2 + 0 + -1. Let s = 24 + h. Calculate the greatest common divisor of s and 44. 11 Let w(s) = -10s + 2. Let g be w(3). Let f = -18 - g. Suppose -90 = 2r - 5r. What is the highest common divisor of f and r? 10 Let f = -2 - -3. Let r(c) = 3c*2 + f + 2c*3 - 5 - c + 2. Let d be r(2). Calculate the greatest common factor of d and 36. 12 Let b be -2 + -2 + (-3 - -11). Let y be (1 + -2)/1 + 29. Calculate the highest common divisor of b and y. 4 Let d = -24 - -132. What is the greatest common factor of 27 and d? 27 Let i be (2/(-4))/(3/54). Let c be (-6)/(-27) - 7/i. Let o be c/(-1 - 0) - -2. What is the highest common divisor of 9 and o? 1 Let d = -226 + 316. Let u be d/(-25) - (-4)/(-10). Let m = 6 + u. Calculate the highest common factor of m and 18. 2 Let f(c) = 3c*3 + 4 - 7c*3 + 2c*3 + 6c + 3c3 + 7c*2. Let w be f(-6). Suppose -x = -12 - 20. Calculate the highest common divisor of w and x. 4 Suppose 0 = -2v + 8, 5p + v - 2v = 1996. Suppose 0u + p = 5u. Calculate the highest common divisor of u and 32. 16 Let x = 0 - 0. Let b be x/1 + 31. Let c(a) = 2a + 47. Let i be c(-23). Calculate the highest common factor of b and i. 1 Let f be 2 - (-6)/(-1 - 2). Suppose -d - 4k + 5 = f, -k - 11 = -2d + 8. Let z be 26 - ((-2)/2 + 0). Calculate the greatest common factor of z and d. 9 Suppose -2l = -8, -4j + 5l + 35 + 9 = 0. Let h = 28 - j. What is the highest common factor of 108 and h? 12 Let m(a) = 10a*2 + a - 5. Let y be m(-5). Suppose 3h - 2u = 180, -5u = -4h - 4u + y. What is the greatest common factor of h and 24? 12 Let k be -33 - (0 + (-4)/(-2)). Let p = k - -65. Suppose 2j - 24 = j + 2z, 2j - 44 = 2z. Calculate the highest common divisor of j and p. 10 Let n be -1 + (-1 - -3) + -2. Let g be n/(-4) + 8/(-32). Suppose -5c + y - 5y + 141 = 0, -5c + y + 121 = g. What is the greatest common factor of 175 and c? 25 Let p = -26 + -15. Let h = -16 - p. Let c = h - -1. Calculate the highest common factor of c and 39. 13 Suppose 4j + 21 = -s + 2s, -s = -1. Let x(l) = l2 + 3l - 7. Let y be x(j). Calculate the highest common divisor of 21 and y. 3 Let k be (-4 + 1)/(6/4). Let z be (2 - 2)/((-4)/k). Suppose f = -zf + 3. What is the highest common divisor of 12 and f? 3 Suppose -3q - 88 = -7q. What is the greatest common factor of q and 77? 11 Let u(l) be the first derivative of 7l4/4 + l3/3 - l*2/2 - 2l - 1. Let y be u(2). Let a = y - 14. Calculate the greatest common divisor of 6 and a. 6 Let r be 21 + -29 + 54. What is the greatest common divisor of r and 6? 3 Let z = 11 + -8. Suppose n + s - 31 = -4n, 5n - 28 = 2s. Calculate the highest common divisor of n and z. 3 Suppose 3g + 5u - 190 = 0, 0 = 4g + 3u - 114 - 143. Calculate the greatest common divisor of 26 and g. 13 Let n(z) = -z*2 - 1. Let r(k) = -3k*2 + 11k + 1. Let w(q) = 4n(q) - r(q). Let s be w(-7). What is the greatest common factor of 161 and s? 23 Let z(i) = -21i + 2. Let k be z(-2). Calculate the greatest common factor of k and 110. 22 Let n = -13 - -29. What is the highest comm	{ "pile_set_name": "DM Mathematics" }
0z. Give t(j(y)). -9y*2 - 3y Let r(k) be the third derivative of 10k4/3 + 9k*2 - 44. Let h(m) = 6m*2. Give h(r(n)). 38400n*2 Let t(y) = -2445466943y. Let z(q) = -q*2. Calculate z(t(f)). -5980308569305765249f*2 Let t(i) = -23 + 13 + 3 + 2i + 4 + 5. Suppose 4d + 4 - 16 = 0. Let l(u) = 0 + 0 - 2u + du. What is t(l(y))? 2y + 2 Let c(p) = -2p - 3p + 4p. Let i be (-7 - 161/(-14))/((-3)/4). Let s(o) = -2o. Let y(d) = d. Let f(t) = is(t) - 13y(t). Give c(f(w)). w Let c(b) = b - 61805. Let h(k) = -5k2. Determine c(h(t)). -5t*2 - 61805 Let j(z) = 12z*2. Let f = 46 - 46. Suppose f = -3x + 3c + 21, -4c - c = 4x - 19. Let t(o) = 1 - 5o - 1 + xo. Determine j(t(n)). 12n*2 Let q(f) = 352507f*2. Let x(l) = -403l*2. Give x(q(c)). -50077257574747c*4 Let u(o) = 8o. Let m(l) be the second derivative of 1/12l4 + 0 - 64l + 0l3 + 0l*2. Give m(u(d)). 64d2 Let r(s) = s2 + 2s - 120. Let z(j) = 192j. Determine z(r(o)). 192o2 + 384o - 23040 Suppose -34 = -15z + 13z. Let r(f) = 18f - 31f + zf. Let i(d) be the second derivative of -d4/12 + 16d. Give r(i(b)). -4b2 Let p be (-88)/(-308) - (1 + (-1559)/7). Let l(s) = -p + 5s*2 + 222. Let n(r) = 2r*2. What is n(l(m))? 50m*4 Let j(s) = -2s*2 - 54s. Let m(x) = 480032x. Give m(j(r)). -960064r*2 - 25921728r Let o(l) = -44l2. Let c be 1 + -4 + 100/4. Let p(v) = -cv - 18v + 39v. Calculate o(p(b)). -44b2 Let l(d) = -18d*2. Let c(i) = 84 + 8i - 11i - 79 + 5i. Calculate c(l(u)). -36u2 + 5 Let g(j) = j2. Let u(q) be the first derivative of 30 + 77/2q*2 + 0q. Give u(g(z)). 77z2 Let c(h) = -h + 3. Let m(s) = -2. Let r(f) = -2c(f) - 3m(f). Let x(n) be the first derivative of -13n*2 + 84. Give x(r(u)). -52u Suppose 0 = 1083l - 1081l + 6. Suppose -17 = 2z + 63. Let o(d) = -22d - 3. Let f(m) = 285m + 40. Let u(n) = lf(n) + zo(n). Let y(v) = -2v. Give y(u(g)). -50g Let r(o) = o + 15763914. Let t(w) = -4w. Calculate t(r(f)). -4f - 63055656 Let d(n) = -120n - 682. Let i(v) = 24v + 146. Let j(c) = 6d(c) + 28i(c). Let t(x) = 2x + 4. Give t(j(s)). -96s - 4 Let q(b) = -327134b. Let t(c) = 36c2. What is q(t(o))? -11776824o2 Let a(q) = -q2. Let w(f) be the second derivative of -f*6/360 - 119f*5/120 + 13f*4/3 - 24f. Let o(d) be the third derivative of w(d). Calculate a(o(j)). -4j2 - 476j - 14161 Let z(l) be the second derivative of -l*4/6 - 368l3 + l2/2 + 2l - 4164. Let g(c) = -c. What is g(z(u))? 2u*2 + 2208u - 1 Let y(s) = -6s. Suppose -x - 17 = -4o - 5, -36 = -5o - 4x. Let k(r) be the first derivative of or2 - 21 - 5r*2 + 5 - 2. Determine y(k(w)). 12w Let t(c) = 7c. Let l(h) be the first derivative of h6/360 + h3/3 + 53h*2/2 - 146. Let z(d) be the third derivative of l(d). Determine z(t(q)). 49q*2 Let p(l) = 1963l. Let c(h) = -4113h2. Calculate p(c(g)). -8073819g*2 Let c(j) = 19j*2 - 2j. Let n(w) = 16w2 - 25. Let p(k) = 10k*2 - 15. Let h(g) = -3n(g) + 5p(g). Give h(c(b)). 722b*4 - 152b*3 + 8b*2 Let j(x) = 5x + 12 - 3x - 5x + 5x - 40. Let p(z) be the third derivative of z5/30 + z2. Calculate j(p(w)). 4w*2 - 28 Suppose 57j = 200j - 429. Let s(x) be the third derivative of 1/24x*4 + 0 - 32x*2 + 0x*j + 0x. Let m(o) = 3o2. Give m(s(u)). 3u*2 Let u(d) = -101d. Let m(w) = 277w2 - 94w*2 - 144w*2 - 118w*2. Give u(m(z)). 7979z*2 Let c(x) = 4x*2 + 3x - 3. Suppose -k - 6 = -9. Let u(d) = 6d2 + 5d - 5. Let o(g) = ku(g) - 5c(g). Let w(n) = 12n. Determine w(o(b)). -24b*2 Let d(b) = 2b + 4. Let q(o) = 53o + 56. Determine q(d(p)). 106p + 268 Let n(t) = -48t. Let m(o) be the third derivative of o5/10 + 2557o*2. Calculate n(m(l)). -288l*2 Let s(w) = 241w. Let q(r) = -118r2 + 27r*2 + 66r*2 + 26r*2. Give s(q(k)). 241k*2 Let y(u) = 950u*2 + u + 67905. Let r(n) = 2n. Give r(y(b)). 1900b2 + 2b + 135810 Let s(f) = 102f + 124f - 328f. Let q(r) = -154r*2 - 151r*2 + 303r*2. What is q(s(k))? -20808k*2 Let y(b) = 47b + 50. Let w(f) = 494f + 520. Let r(o) = -5w(o) + 52y(o). Suppose 3z = -0z + 6. Let u(p) = -1 - zp*2 + 3 - 2. Give u(r(t)). -1352t*2 Let n(k) = -2k + 3. Let b(m) = 3m - 4. Let d(v) = -3b(v) - 4n(v). Let q(p) be the second derivative of 0 + 5/12p*4 + 0p*2 + 41p + 0p3. Give d(q(j)). -5j*2 Let f(w) = 5w. Let m(l) = -258285790l. Give f(m(c)). -1291428950c Let u(t) = -143t2 - 33t + 132. Let b(g) = 22g2 + 5g - 20. Let o(v) = 33b(v) + 5u(v). Let a(x) = -4 + 16x - 2 + 6. Give o(a(n)). 2816n*2 Let q(k) = -6k*2. Let z(a) be the second derivative of 257a*3/6 + 30a - 2. What is q(z(f))? -396294f2 Let h(d) = 7d. Let w(j) = -138j + 10 - 11 + 31j. What is w(h(o))? -749o - 1 Let a(w) = 3453w. Let t(o) = 1162o2 - 5o. Give a(t(b)). 4012386b2 - 17265b Let g(h) = 15357h. Let s(d) = 60d*2. Give g(s(k)). 921420k*2 Let f(l) = -14596l + 267. Let x(s) = -273s + 5. Let n(y) = -5f(y) + 267x(y). Let u(w) = -15w + 1. Determine n(u(v)). -1335v + 89 Let q(s) = 811s*2 - 2s + 119. Let h(b) = -172b2. Calculate q(h(v)). 23992624v*4 + 344v*2 + 119 Let v(k) = 3k - k*2 - 2k - 1 - 2k. Let o(t) = 4t*2 - 10t*2 + 813t - 818t - 5. Let n(b) = 2o(b) - 10v(b). Let q(h) = 17h*2. Determine n(q(g)). -578g*4 Let b(a) = -4a*2 - 79a + 22. Let v be b(-20). Let s(k) = -147k2 - 153k*v + 304k*2. Let m(t) = -11t*2. What is m(s(j))? -176j*4 Let w(h) = -233758778h. Let n(j) = 2j2. What is n(w(o))? 109286332584106568o*2 Let v(c) = 3300166c. Let w(h) = -70h2. Determine w(v(m)). -762376693928920m*2 Let o(m) = 2m*2 + 10m - 15. Let j(h) = -h*2 - 4h + 6. Let q(b) = -10j(b) - 4o(b). Let n(c) = -455c2. Calculate n(q(r)). -1820r*4 Let s(k) = 56k*2. Suppose -5o + 125 = l, -4l + 134 = -3l - 4o. Let i(f) = -136f - lf + 269f. Determine i(s(z)). 168z2 Let g = 134 + -132. Let x(p) be the first derivative of -g + 1/2p*2 + 0p. Let d(n) = 4n. Give d(x(q)). 4q Let n(w) = -w*2. Let c(m) = -730m + 55. Let f = 136 - 140. Let x(d) = -27d + 2. Let i(l) = fc(l) + 110x(l). Determine n(i(v)). -2500v*2 Let s(u) = -385u*2 - 12u + 12. Let n(w) = 26176w2 + 818w - 818. Let z(g) = 6n(g) + 409s(g). Let q(j) = 3j. Calculate z(q(r)). -3681r*2 Let g(a) = 175a + 6. Let d(c) = -168c - 5. Let q(z) = 6d(z) + 5g(z). Let u(j) be the third derivative of j4/24 + 273j*2. Give u(q(s)). -133s Let s(i) = 13026i. Let j(w) = 255w*2. Determine j(s(z)). 43267552380z*2 Let b(l) = 28l. Let t(p) = 2255p2 + 105p - 140. Let r(m) = 188m2 + 9m - 12. Let s(c) = -35r(c) + 3t(c). Give s(b(h)). 145040h2 Let i(h) = -h2. Let k = -407 - -416. Let a(p) = kp*2 + 30p - 6p - 4p*2. Determine i(a(y)). -25y*4 - 240y*3 - 576y2 Let r(p) be the second derivative of p3/3 + 17p2/2 - 5p + 5. Let l(u) = -2u2. Give r(l(o)). -4o*2 + 17 Let f(r) = 2r. Let i(l) be the third derivative of -19l7/1260 - l5/12 + l3/6 - 51l*2. Let a(n) be the third derivative of i(n). Calculate a(f(y)). -152y Let l(i) = -26i - 16. Let q(w) = 5w + 3. Let o(h) = 3l(h) + 16q(h). Let k(r) be the third derivative of 0 + 4r2 + 0r*3 - 1/8r*4 + 0r. Give o(k(z)). -6z Let y(k) be the second derivative of 0 - 1/6k*3 + 0k*2 - 57k. Let f(h) = -65h. Determine y(f(j)). 65j Let r(t) = t + 304. Let v(z) = 63z2 + 19z. Determine r(v(d)). 63d2 + 19d + 304 Let j(b) = 5404683b2. Let a(z) = -z2. What is a(j(c))? -29210598330489c*4 Let f(h) be the third derivative of 0h - 44h2 + 1 + 0h*4 + 0h*3 + 31/60h*5. Let c(p) = -p. Determine f(c(y)). 31y2 Let j(i) be the third derivative of i7/630 - i*4/12 + 8i*3 - 8i*2 - 6. Let c(b) be the second derivative of j(b). Let o(u) = 28u. Calculate o(c(q)). 112q2 Let a(y) be the third derivative of y5/60 - 11676y2. Let j(k) be the third derivative of k4/3 - k*3/2 - 2k*2. Calculate j(a(d)). 8d*2 - 3 Let c(a) = -1914a*2. Let i(w) = -39w - 9695 + 9695 + 2w2 + 39w. Calculate c(i(q)). -7656q4 Let d be 44/(-132) - (-308)/6. Let a(h) = 22h - dh + 22h. Let p(g) = 7g2. What is a(p(n))? -49n*2 Let h(a) = 8345748	{ "pile_set_name": "DM Mathematics" }
is x rounded to the nearest one hundred? -600 Let q = 32677 + -149790. Let l = 117114.000024 + q. Let f = l - 1. What is f rounded to 5 dps? 0.00002 Let d = -56165246 - -28065246. What is d rounded to the nearest 1000000? -28000000 Let d = 23000671 - 23027532.9892. Let l = -26902 - d. Let w = 40 + l. Round w to three decimal places. -0.011 Let s be 400 - (-3)/(-9)3. Suppose -n + 2 = -2. Suppose -o + nu = 171 + s, 5o + 3u = -2735. What is o rounded to the nearest 100? -600 Let w be (-8)/(-10)5/2. Let h = w + -2. Let j = h + 0. Round j to the nearest 100. 0 Let u = 9.27 - 6.536. Let j = 16 - 18.7. Let l = u + j. Round l to 2 dps. 0.03 Let p = 190.0000087 - 190. Round p to six decimal places. 0.000009 Let c = -188 - -283. Let o = 95.121 - c. What is o rounded to 2 decimal places? 0.12 Suppose 4z - 569 = 751. What is z rounded to the nearest 100? 300 Let o(t) = -2t2 + t. Let i be o(-1). Let q(c) = c2 - 4c + 1. Let x be q(i). Suppose 3w - x = 20. What is w rounded to the nearest ten? 10 Let g(h) = -55h*3 - 7h*2 - 8h + 4. Let l be g(-6). Suppose -3m - l = 4q, 3m - m = -3q - 7785. What is m rounded to the nearest 1000? -4000 Let f = 63.7078 + -0.0078. What is f rounded to the nearest integer? 64 Let o = 1.26 - -0.04. Let x = 4352806 + -4352804.69999888. Let q = x - o. What is q rounded to seven decimal places? 0.0000011 Let d = 21.91 - 22. Let s = -0.089998 - d. Round s to 5 dps. 0 Let a = 778.52363 + -258.52154. Let z = 520 - a. What is z rounded to four decimal places? -0.0021 Let v = -47111.0240102 + 47111. Let a = -0.024 - v. What is a rounded to 6 decimal places? 0.00001 Let p = 12 - 11.7. Let z = 0.29969 - p. What is z rounded to four dps? -0.0003 Let j be (-33)/(-12) - 2/(-8). Suppose 0 = -jh + 2 + 10. Suppose -5y = 4s + 12, 3y + 0y + hs + 12 = 0. Round y to 2 dps. 0 Suppose -5j + 35 = 3w, 2w + 40 = 5j + 6w. Suppose -3l = -4o + 9o + 12315, -l - jo - 4112 = 0. Round l to the nearest one thousand. -4000 Let a = 0.13 + -2.63. Let j = 2.469 + a. Round j to 2 decimal places. -0.03 Let r = -37.899741 + 37.9. Round r to five dps. 0.00026 Let k = -31.09918 - -29.499. Let q = k - -1.6. What is q rounded to 4 dps? -0.0002 Suppose -4v + v = 16200. What is v rounded to the nearest one thousand? -5000 Suppose 6k = 11k + 2700000. Round k to the nearest one hundred thousand. -500000 Let k = -14 + 9. Let q = -5.00000003 - k. Round q to seven dps. 0 Let t = 788.34 - 796. Round t to one dp. -7.7 Let b = 13 + -12.99996. What is b rounded to 5 decimal places? 0.00004 Let o be 2/(-4) + (-43400007)/(-14). What is o rounded to the nearest one million? 3000000 Let l(n) = 7 + 166n2 + 3 - 81n*2 + 71n*2 - 9n. Let d be l(-10). Round d to the nearest 1000. 16000 Let u = -2458 - -2458.001079. What is u rounded to four decimal places? 0.0011 Let f = 0.05 + -0.039. Let l = f - 0.010892. Round l to 5 decimal places. 0.00011 Let w = 56 - 108. Let o be (-13)/(w/(-6000000)) + 0. What is o rounded to the nearest 100000? -1500000 Let z = 48 + -48.000055. Round z to four decimal places. -0.0001 Suppose 0 = 5i - 3i - 4. Let u be 3/(i/12803). Round u to the nearest one hundred. 600 Let q = -260.3 + 33.3. Let z = -227.1055 - q. Let o = z + 0.11. What is o rounded to three decimal places? 0.005 Let d = -4 + -3. Let b = d - -7.0026. What is b rounded to 3 dps? 0.003 Let b = 54.042 - 0.042. Let u = b + -178. Let h = -123.99999943 - u. What is h rounded to 7 decimal places? 0.0000006 Let i = -393977.3882 - -7.3882. Let s = i + 393941.000065. Let r = s - -29. Round r to 5 decimal places. 0.00007 Let b = -8.1 - -17.82. Let q = b - 9. Let s = -0.24 + q. What is s rounded to 1 decimal place? 0.5 Let j = -3 - -6. Suppose 1400 = -jh + h. What is h rounded to the nearest 100? -700 Let g = -139.91 + 138. Round g to 1 decimal place. -1.9 Let l = 0.28 - -2.92. What is l rounded to 0 dps? 3 Let x = 1.38166 - 1.38. What is x rounded to 4 decimal places? 0.0017 Let t = 30 - 32.52. What is t rounded to 1 dp? -2.5 Let i = -7469 - -7505.144. Let x = -36 + i. What is x rounded to two dps? 0.14 Let m = 0.34 - 3.54. Let l = m - -2.3. Let q = l - -0.89913. What is q rounded to four decimal places? -0.0009 Let p = 4458.09999 + -4458. Let g = 0.1 - p. What is g rounded to 6 dps? 0.00001 Let m(y) = -18741y. Let g be m(-4). Let w(t) = -t2 + 11t + 12. Let j be w(12). Suppose 2s - 4474964 + g = j. Round s to the nearest 1000000. 2000000 Let m = -21315 - -21315.140088. Let y = m - 0.14. Round y to five dps. 0.00009 Let v = -142.9999395 + 143. What is v rounded to 6 dps? 0.000061 Suppose -20 = -5x, -5p + 3x = x - 92. Suppose 3y = l + p, 3y + 2l = 4l + 16. Suppose 3s - ys = -6500. What is s rounded to the nearest one thousand? 1000 Suppose m + 3m = 12. Suppose 14 = -mn + 4b, 4n + 2b = 5b - 7. Suppose -403 = -ny - 1603. What is y rounded to the nearest 100? -600 Let h(j) = 2064j*2 - 6j + 3. Let w be h(-6). Let n = 44343 - w. Round n to the nearest 100000. 0 Let b = 5 - 4.9972. What is b rounded to 3 decimal places? 0.003 Let g = -0.16 - -0.3. Let m = g + -0.12. Round m to 2 dps. 0.02 Let y = -1837448.680097 - -1837450. Let q = 1.32 - y. What is q rounded to 5 decimal places? 0.0001 Let i = 0.15 - 0.098. Round i to 2 dps. 0.05 Let l = -1.78283 + -0.28231. Let c = l + -2.9348. Let d = -5 - c. Round d to five dps. -0.00006 Let x = 0.14 - 0.143. What is x rounded to three decimal places? -0.003 Let v = 22.3 + -1.5. Let r = v + 1.2. Let z = r + -21.99999964. What is z rounded to 7 decimal places? 0.0000004 Let g = 26902 - 99902. Round g to the nearest 10000. -70000 Suppose -2n = -3f, -3f = 3n + 1 - 16. Suppose -nm + 4l + 1439975 = -l, 0 = 5m + 4l - 2400020. What is m rounded to the nearest 100000? 500000 Let l be 2/(-5) - (-10890908)/20. Let x = l + -2444545. What is x rounded to the nearest 1000000? -2000000 Let i be 0 + 7 + (-12)/6. Suppose 10w = iw + 1120. Suppose d = -3d - w. Round d to the nearest 10. -60 Let v = -14 - -13.86. Let m = 0.38 + v. What is m rounded to one decimal place? 0.2 Let j = 379 - 242. Let r be 158/(-2) + (-21)/(-7). Let c = j + r. Round c to the nearest 10. 60 Let p = 4.297 - 1.2965. Let t = -3 + p. Round t to three dps. 0.001 Let s = 0.07 - 0.0705. Round s to three dps. -0.001 Let c = 20 - 19.99999976. What is c rounded to seven decimal places? 0.0000002 Suppose -3d - i - 391 = -14701, 0 = -2d + 2i + 9540. Round d to the nearest one thousand. 5000 Suppose 0 = 5l - 4l. Let x = 0 - l. Suppose -3325 = 4i - n, -3n + 2 + 13 = x. What is i rounded to the nearest one hundred? -800 Let c = 48 + -47.02. What is c rounded to one decimal place? 1 Let f = -0.881 - -0.93. Let y = f + -1.169. Let n = y + 1.12000047. Round n to seven dps. 0.0000005 Let u = 4363 + -2539. Let c be 4/(-14) + u/14. Round c to the nearest one hundred. 100 Let p = -641663364 + 641663336.0601961. Let m = p + 27.9278. Let c = m - -0.012. Round c to 6 dps. -0.000004 Let g = 287730 - 202935. Suppose -5n = -4o + 173991, 3n + 2n + 173979 = o. Let r = n + g. Round r to the nearest ten thousand. 50000 Let q(p) = -3 + 5p + 0 + p. Let i be q(4). Suppose i = t - 13. Round t to the nearest ten. 30 Let m = -12.85 + -0.15. Let k = -13.7 - m. Let p = k + 0.664. Round p to 2 decimal places. -0.04 Let i(o) = 8o - 4. Let n be i(7). Suppose 0p = -2p + n. Let a be 57204/p - 6/39. Round a to the nearest 1000. 2000 Let n be (-116026409)/4 - 3/(-12). Let x = n - -47606602. Suppose -i + x = -4i. Round i to the nearest one million. -6000000 Let n = -0.4230017 - -0.27300313. Let i = n + 0.15. Round i to 7 decimal places. 0.0000014 Let m = -101411183072873498 + 101411181625734210.00000027. Let a = m - -1447139272. Let p = 16 + a. Round p to seven decimal places. 0.0000003 Let j = 0.1768 - 0.18. Round j to three dps. -0.003 Let w = 0.0354 + -0.016. What is w rounded to 3 decimal places? 0.019 Let l(y) = -50248y + 8. Let t be 54/(-12) + (-2)/(-4). Let x be l(t). What is x rounded to the nearest ten thousand? 200000 Let k be (-96)/36*213/(-4). What is k rounded to the nearest 10? 140 Let d = 0.05 + -0.049. Let f = -0.00100116 + d. Round f to seven decimal places. -0.0000012 Let y = -1167 - -1166.5148. Let g = y + 0.5. What is g rounded to three decimal p	{ "pile_set_name": "DM Mathematics" }
g + 3500? 1967304 Find the second derivative of -2t4 + 3t*3 + 5448t*2 + 48499t. -24t2 + 18t + 10896 Find the second derivative of 540y4 + 12y*3 - 18y + 265 wrt y. 6480y2 + 72y What is the derivative of 2059641k + 282094? 2059641 What is the second derivative of -1466c*5 - 6c*4 - 18c*2 + 2834348c wrt c? -29320c3 - 72c2 - 36 What is the third derivative of k3n3 - 20k*3w + 7kn*4w - 47kn*4 + 20kn2w + knw wrt n? 6k3 + 168knw - 1128kn What is the first derivative of 2b2 + 1169b + 38469 wrt b? 4b + 1169 What is the third derivative of -w6 + 886w*5 - 2w*4 - 3w*2 + 965w + 3 wrt w? -120w3 + 53160w*2 - 48w What is the second derivative of -103548f5 + 304204f wrt f? -2070960f3 What is the third derivative of 30877z*3 + 133820z*2 wrt z? 185262 What is the third derivative of 782862z*3 - 3z*2 - 155106z wrt z? 4697172 Find the second derivative of 57n4 + 3538n*3 - 1791899n. 684n2 + 21228n Differentiate 341m3o + 1738450m3 + 215m*2o + 2mo + o with respect to o. 341m3 + 215m*2 + 2m + 1 Find the third derivative of -10f3j*3 + 4235f*3j*2 + 2812f*2j*3 - 56j*3 wrt f. -60j*3 + 25410j*2 What is the second derivative of 7a*3 - 9585a*2 - 292539a wrt a? 42a - 19170 What is the third derivative of 415682w*4 + 9293w*2 - 3w - 2? 9976368w Find the second derivative of 142m*3 - 6442m*2 - 605953m wrt m. 852m - 12884 What is the first derivative of -39ap3w + ap2w + 6ap*2 - aw - 2365p3 + 10pw wrt w? -39ap3 + ap*2 - a + 10p What is the second derivative of -2i3 + 47789i*2 - 10135i - 36? -12i + 95578 Find the second derivative of 33808d*2 - 85755d. 67616 What is the third derivative of -l*4s*2 + 28142l*4 + 14l*2 - ls*2 - 21s + 60 wrt l? -24ls*2 + 675408l What is the third derivative of 4i6 + i5 + 1078i*4 - 54880i*2 wrt i? 480i*3 + 60i*2 + 25872i Find the third derivative of -743449t3 - 11t*2 - 11860t wrt t. -4460694 What is the third derivative of 37i3k + 352i3 + 21299i*2 - 2k wrt i? 222k + 2112 Find the first derivative of 191771v*2 - 2123412. 383542v Find the second derivative of 366g4 + 188g*3 - 5174863g wrt g. 4392g2 + 1128g What is the second derivative of -53j5z + 5023j2z*3 + 24jz3 - j + 76z*3 - 35z*2 wrt j? -1060j*3z + 10046z3 What is the third derivative of 4h*5 + 14245h*3 + 106722h*2? 240h*2 + 85470 Find the second derivative of 18f*2l*4 + 19f*2 + 72fl3 + 72fl - 57l*2 - 108l wrt l. 216f2l*2 + 432fl - 114 What is the derivative of -1260403x*2 - 1109592? -2520806x What is the second derivative of -2047985f2 + 2424265f wrt f? -4095970 What is the third derivative of -3191u3 + 30777u*2 + 2? -19146 What is the second derivative of 2677236y*2 + 1330181y wrt y? 5354472 Find the first derivative of -7193j2 + 3jv2 + 46318v*2 wrt j. -14386j + 3v2 What is the third derivative of 193d*5y*2 - 9d*5 - 57142d*2y*2 wrt d? 11580d*2y*2 - 540d*2 What is the second derivative of 1472tu2 - 2tu + 3u*2 - 16785u wrt u? 2944t + 6 What is the first derivative of 157371h - 220219 wrt h? 157371 Find the first derivative of -4047949s + 31061 wrt s. -4047949 Differentiate 244636n*4u + 5n2u*3 - 3u*3 - 482805u*2 with respect to n. 978544n*3u + 10nu*3 What is the derivative of -106454ru + 132540r - 1 wrt u? -106454r Find the second derivative of -3i*5u + 322i5 - 3i*2u - 4iu - 45i - 2u - 54 wrt i. -60i3u + 6440i3 - 6u Find the third derivative of 43lr*3 + 3lr2 - 9lr + 156r*5 - 31r*2 wrt r. 258l + 9360r2 Find the second derivative of 1632413a*4 - 988a + 114. 19588956a2 Find the third derivative of 92546v*3 - 178416v*2 wrt v. 555276 What is the first derivative of -27782r + 10232? -27782 What is the second derivative of -2474k4 + 2k*3 - 7k*2 - 3k - 5107? -29688k2 + 12k - 14 What is the third derivative of -360195x3 + 3x*2 - 172023? -2161170 What is the derivative of 140753p*3r*3 + 2r*3 - 3r*2 + 9485 wrt p? 422259p*2r*3 Find the third derivative of 181531fi6 - 3fi4 + 1341fi2 - fi - 5f + i2 + 2i wrt i. 21783720fi*3 - 72fi What is the first derivative of -2a*4 - 504a*3 + 26a*2 - 55748? -8a*3 - 1512a*2 + 52a What is the third derivative of 232f2r*3 + 10f*2r*2 + 3930f*2 - 5fr3 - 31r*3 + 1 wrt r? 1392f*2 - 30f - 186 Find the third derivative of 1891315z4 + 2819529z*2. 45391560z Differentiate -10177c2j*3 + 169c*2 + 2c - j*4 - j - 105 wrt j. -30531c*2j*2 - 4j*3 - 1 Find the third derivative of 72tx3 - 4tx2 - t + 291x*4 + 4242x*2 wrt x. 432t + 6984x Find the second derivative of 3123681h*3 + 2h*2 + 1235417h wrt h. 18742086h + 4 Differentiate -21223c*4 - 22113. -84892c*3 Find the second derivative of 2331267h*2 + 25h + 16537 wrt h. 4662534 What is the first derivative of 9op*3 + 9op2 - 2op - 295o + 11p3 + p2 + p - 7070 wrt o? 9p*3 + 9p*2 - 2p - 295 Differentiate 40r3y - 42865r2y + 513630y - 2 wrt r. 120r*2y - 85730ry Find the third derivative of -1443u4 - 169u*3 + 3u*2 - 42193u - 2 wrt u. -34632u - 1014 What is the third derivative of 88r*3z*3 + 440785r*3z + 74r2z*3 + 2r*2z2 + z3 wrt z? 528r3 + 444r*2 + 6 Differentiate -1505s*4 - 2s*3 + 2s*2 - 36312 wrt s. -6020s*3 - 6s*2 + 4s Find the first derivative of -j*3t - 165j + 3071t - 5 wrt j. -3j2t - 165 What is the second derivative of 50437b4d + b*3d + 4bd - 3b - 183d + 2 wrt b? 605244b2d + 6bd What is the derivative of 13l3 + 6l*2 - 6l - 19592 wrt l? 39l2 + 12l - 6 Differentiate -1070j2y*3 + 58878j*2 + 2jy4 wrt y. -3210j*2y*2 + 8jy3 Find the second derivative of -7rv3 - rv*2 - 51rv - 30r + 72v3 - v2 + 2v wrt v. -42rv - 2r + 432v - 2 What is the second derivative of -1534171t3 - 125488t - 3? -9205026t Differentiate 49083s - 45943. 49083 What is the second derivative of -86067k3v2 - k3v - 5k*2 + 76kv wrt v? -172134k*3 What is the second derivative of 2lw2 - 1272lw - l - 2683w*5 wrt w? 4l - 53660w3 Differentiate -2l*2x*2 - 2l*2x - 31053l2 + 7231x*2 with respect to x. -4l*2x - 2l2 + 14462x What is the third derivative of 232312t3 + 426757t2? 1393872 Find the third derivative of -k3q3 - 7k*3qv - 190k*3 - 58k*2q*3 + 6kq3v + 9kq*3 wrt k. -6q*3 - 42qv - 1140 What is the first derivative of -38028n + 10989? -38028 What is the first derivative of 12619q - 44718 wrt q? 12619 Find the first derivative of -9g*2 + 12929g + 889172 wrt g. -18g + 12929 Find the third derivative of 1441626t*4 + 1443503t*2. 34599024t Find the third derivative of 3b3ikt*3 + 5b*3ikt2 - b2ikt + 149b*2it2 - 19189bkt*3 - 51ikt - it3 wrt t. 18b*3ik - 115134bk - 6i What is the first derivative of 563879m2w*2 + 2m*2w + 31m2 - 1336m - 5 wrt w? 1127758m2w + 2m2 What is the second derivative of -10429j*4 - 45j*3 - 639139j wrt j? -125148j2 - 270j Find the second derivative of -39894n3 + 61n + 303 wrt n. -239364n Find the third derivative of 604gu4 + 20368gu2 - 2gu - 9u*4 wrt u. 14496gu - 216u What is the third derivative of m*6 - 1582m5 - m3 - 5046m2 - 6? 120m*3 - 94920m*2 - 6 Find the second derivative of 652g*2i*3 + 1519g*2 - 163gi + 180i*3 wrt g. 1304i*3 + 3038 What is the second derivative of -218573t*4 + 7335t + 7? -2622876t2 What is the third derivative of 127354s*3 - 22s*2 - 162 wrt s? 764124 Find the second derivative of -17go2 - 2go + 7450g + 279o2 - o wrt o. -34g + 558 Find the third derivative of 15722v3 - 23v*2 + 144v - 2 wrt v. 94332 Find the second derivative of -1221797b5 - 146b - 131 wrt b. -24435940b3 What is the third derivative of 2753737v*6 - 1113954v*2? 330448440v*3 Find the first derivative of 5mr4 - 2mr + 14315m - 355r*4 wrt r.	{ "pile_set_name": "DM Mathematics" }
prime? True Let f = 556 - 67. Is f a composite number? True Let q(z) = 332z - 5. Is q(2) a composite number? False Suppose 12c - 6734 - 48718 = 0. Is c a composite number? False Let u(s) = s + 10. Let n be u(-7). Is 1/n + (-1424)/(-12) a prime number? False Suppose 3x + 5j - 3550 = -1303, 2j = 0. Is x composite? True Let z = -706 + 1569. Is z a prime number? True Suppose -45h = -38h - 133. Is h a composite number? False Suppose 3o + 22 - 4 = 0. Is (4/o)/((-8)/4452) a composite number? True Let u be (1/2)/((-2)/(-8)). Suppose -3p + 34 = -up. Is p a prime number? False Let d be (-45)/(-3) + (0 - 3). Suppose 0 = 5y + 3f, -y - 3f + 0f = -d. Is (-3 - y) + (19 - -2) composite? True Let q(g) = 63g + 2. Let t be q(2). Suppose -4y + 5m + t = -0y, 3y - 127 = -4m. Is y prime? True Suppose 3r - 8r - 5v + 5940 = 0, 3v - 1192 = -r. Is r composite? True Let a = -5 - -7. Let x(c) = c*2 + 6 - 4c + 12c + 0c*a + 4. Is x(-8) composite? True Is -478(-4 + ((-14)/4 - -2)) composite? True Let i(p) = -p + 6. Let f be i(4). Is 63 + f - 4/(-2) a composite number? False Let n(y) = y*3 - 14y*2 + 6y - 8. Let v(b) = 3b3 - 41b*2 + 19b - 24. Let h be (69/(-12) + 3)-4. Let g(c) = hn(c) - 4v(c). Is g(7) prime? False Suppose -2p = 3p - 2475. Suppose -5d = -2d - p. Suppose 3j = 6j - d. Is j composite? True Let b = 111 + 16. Is b composite? False Suppose 2a - 207 = -f - 2a, -3f - 5a = -593. Is f a composite number? False Is (4/(8/(-251)))/(1/(-2)) composite? False Let b(d) = -d2 + 3d + 7. Let m be b(5). Let g = -6 - -17. Let i = g - m. Is i composite? True Suppose -3 = -5w + 4w. Let k be -2 - w/((-6)/8). Suppose -9 = -3r + 2q, r + 3q - 9 = -kr. Is r prime? True Is (-101)/(33/78 - (-2)/(-4)) a composite number? True Suppose 2w - 446 = -w + 5z, -z = -2w + 309. Is w composite? False Let g(f) be the first derivative of 179f4/4 - f2/2 - 1. Let m be g(1). Suppose -u + m = u. Is u prime? True Suppose 9p - 4p - n - 1689 = 0, 3p = -n + 1007. Is p a prime number? True Suppose -w + 137 = p + 2w, 3p + 2w - 376 = 0. Let j = p + -87. Is j a prime number? False Suppose 3h + 2h = 0. Suppose hi - 3i + 669 = 0. Is i prime? True Is 0/2 - (-10 + -457) composite? False Is 80 - (1 - 5 - -1) prime? True Let n(d) = -4d + 6 + 2d*2 + 4d - 2d. Is n(-4) composite? True Let v = -52 + 29. Let d = 56 + v. Is d a composite number? True Suppose 4l - 1 = 4u + 3, 5u - 3 = 3l. Suppose -up = 4p - 1645. Is p prime? False Is (-189)/(-4) - (-1)/(-4) a prime number? True Let d = 285 + -198. Is d a prime number? False Suppose 5f = -5b - 66 + 6, 5f = 0. Let i = -5 + 7. Is (-928)/b - i/6 a prime number? False Suppose -v - 5y = -3264, 7785 = 4v + y - 5290. Is v a composite number? True Let a(l) = -2l2 - 4l - 3 + 0 - 2. Let x(d) = d3 - d2 - 3d - 4. Let v(s) = -3a(s) + 4x(s). Is v(2) a prime number? False Let r = 136 - 309. Let o = r - -384. Is o a prime number? True Let l(a) = -a2. Let v(c) = c2 - 34. Let r(o) = -2l(o) - v(o). Is r(0) a prime number? False Let g(w) = -7w3 - 6w - 13. Is g(-6) a composite number? True Suppose -7 + 1 = -2h. Is -1 + -1 + h9 a prime number? False Let h = 0 - -6. Is (92/h)/((-2)/(-21)) prime? False Let c = -4 - -4. Let b = 33 - c. Suppose b = f + 5d, 3f + 0d = 2d + 31. Is f a prime number? True Let b be (18/(-4))/(9/(-132)). Suppose 2k + b = 4k. Is k a composite number? True Suppose 3o + 291 = 5b, 2b + 0b - 117 = o. Let r = 83 + b. Is r a composite number? True Suppose 4p = -p + 13835. Is p a composite number? False Suppose 631 + 3278 = 5f + b, 20 = 5b. Is f a prime number? False Suppose 2t = t. Suppose -c + 6c - 305 = t. Suppose -3v - c = -256. Is v a prime number? False Let g = 1507 - 788. Is g a prime number? True Suppose 2n = 7n - 10. Let x be 5 + -3 + n - -2. Is (-3)/6 - (-897)/x a composite number? False Suppose o + 3 = 4. Let p(u) = 10u2 - u + 1. Let l be p(1). Is 128/l - o/(-5) composite? False Let i(r) = -4r + 11. Is i(-25) a prime number? False Let p(o) = o*3 + 9o*2 - 4. Let s be p(-8). Suppose 0h - 4h - s = 0. Let j = 26 + h. Is j composite? False Suppose 4 = 3k + 5w, k - 4 = -0w + w. Let a(l) = 12l + 1. Is a(k) prime? True Suppose -5y = -4z + 694, -y = y + z + 275. Let h = y + 227. Is h a composite number? False Let u be 11/3 + 2/(-3). Let c(g) = 5g*2 - 2g + 4. Is c(u) prime? True Suppose 4 = -4h, 3d - h = 625 + 1974. Is d composite? True Let p = -200 - -873. Is p a composite number? False Let z = -5 + 7. Is (-131)/((z - 3)1) prime? True Let o(t) = -t2 - 3t + 2. Let n be o(-3). Let r be 48/18(-3)/n. Is 135 + r/(-2) a composite number? False Let b(y) = -2y - 9. Let x be b(-7). Suppose -w - 2w = xp - 37, 0 = -2p + 5w + 21. Is 522/p + (-1)/4 a composite number? True Suppose 15 = -4u - y, 3y = -2u + y. Let g(c) = -4c - 1. Is g(u) prime? True Let p(u) = -3u - 1. Let t(g) = g + 1. Let n(b) = -p(b) + 2t(b). Is n(4) a composite number? False Let h = 94 + -29. Is h prime? False Is 1157/((-6 + 0)/(-6)) composite? True Let z be (-2 + 19 - -1)3. Is (-2)/4 - z/(-4) prime? True Suppose 7729 = 8k - 7k - 3h, -2k + 15502 = 5h. Is k prime? True Let q = 4 - 2. Suppose -t - q = -2t. Suppose 2u + tu = 24. Is u prime? False Let n(y) = -y*3 - 5y*2 + 4y + 1. Let o be n(-6). Suppose -v - 2 + o = 0. Is v a composite number? False Suppose 32 + 1 = 3i. Is i prime? True Suppose -l + 0l = -553. Is l a prime number? False Is 4 + (-3 - (1 - 103)) prime? True Let j(s) be the second derivative of -s*5/20 - 4s*4/3 - 5s*3/2 - 7s*2/2 + 6s. Is j(-16) prime? True Let j(l) = 41l2 - 4l + 2. Is j(2) prime? False Suppose 22s - 23s = -89. Let k = s - -330. Is k prime? True Let l(v) = 135v2 + 2v - 3. Is l(1) a composite number? True Let f be (-44)/14 + 1/7. Is (f - (-8)/2) + 88 a composite number? False Is (-2)/((-4)/(-6)) + 214 a composite number? False Let o(i) = -i. Let q be o(-13). Let g(t) = 4t2 + t + 3. Let b be g(3). Let h = b + q. Is h prime? False Suppose -n + 8 = -4z, 35 - 15 = 4n - 4z. Suppose c = -3p + 10, np = 3c + 17 + 5. Is (14 - (-2)/c) + 0 prime? True Suppose -4a = -7a + 138. Is a prime? False Suppose -1842 = v - 7v. Is v a prime number? True Suppose -r = 2r. Suppose c + 4c = 1070. Suppose r = 3t - 17 - c. Is t a composite number? True Let h(u) = u + 6. Let b be h(5). Let s = 142 - 85. Suppose 2t + b - s = 0. Is t a composite number? False Let q be (-4)/12 + 2/(-3). Is (-1)/(2/(-180)) + q prime? True Suppose -5o + 1445 = -2i, 5o - 569 = 3o - i. Is o composite? True Suppose 68 = 31r - 29r. Is r prime? False Let k be (-2)/9 + 47/9. Suppose 3t + 602 = km, 2m + 0t - 5t = 237. Is m a prime number? False Let m = 1100 + -189. Is m prime? True Let u(a) be the first derivative of -2 + 3a + 3/2a2 + 0a*3 - 11/4a*4. Is u(-2) a composite number? True Is (3/2)/(3 - 273/92) composite? True Let g(x) = -43x - 7. Is g(-2) a composite number? False Let f = 60 + -24. Suppose -31 = -u + f. Is u prime? True Let m(k) = k*2 + 3k - 1. Let g be m(-3). Let q = g + 5. Let f = q - -63. Is f a composite number? False Is -4(-4)/16 - -580 prime? False Let b be 2/5 + 293/5. Is (b - 4)3/5 a composite number? True Suppose 876 = 4u - 596. Suppose 110 = 2n - u. Is n composite? False Is 14720/30 - (-1)/3 composite? False Let m(h) = -12h + 2. Let n(s) = 3s - 1. Let t be n(1). Let x be m(t). Is (-1)/(-2 + (-42)/x) composite? False Suppose z - 316 = -3d + 7d, 3d + 4z = -237. Let v = d + 132. Is v a prime number? True Let a = 16 + 221. Is a prime? False Let v = 23 - -15. Let f = v + -9. Let p = 50 - f. Is p prime? False Let a = -138 + 547. Is a prime? True Let w(m) = -13m + 4. Let v(i) = -26i + 7. Let s be (-1 - -4)/(-1 - 0). Let g(k) = sv(k) + 5w(k). Is g(4) a composite number? True Let g be (1 - 1)/(-2)-1. Suppose g = -t - 3c + 8, -t = 2t - c - 14. Suppose ts - s = f - 57, 4f - 217 = 5s. Is f a prime number? True Let r = -313 - -210. Let j = r + 177. Is j prime? False Suppose -4c = -1460 - 3368. Is c a composite number? True Let w(l) = 111l - 1. Let a be w(2). Let f = a - -1. Suppose -2x - 3x + 555 = -3j, 2x - f = 3j. Is x a composite number? True Suppose -2k - 44 = 2*k. Let y be	{ "pile_set_name": "DM Mathematics" }
hat is the smallest value in -8/9, -4/3, 0.4, 32? -4/3 What is the third biggest value in 4, 0.1, -1.9, 1? 0.1 What is the third smallest value in -0.2, 0.04, 17? 17 Which is the biggest value? (a) 0.7 (b) 14 (c) -0.2 b What is the second biggest value in -40, -0.5, 0? -0.5 What is the fourth smallest value in -38, -1, 2/3, -1/14? 2/3 Which is the third smallest value? (a) 5 (b) -25 (c) 2/11 (d) -0.1 (e) -2 d Which is the biggest value? (a) 4.23 (b) -3/5 (c) -0.3 a Which is the third biggest value? (a) -4 (b) 60 (c) -0.2 a What is the third biggest value in -0.3, -0.008, -1/11? -0.3 What is the biggest value in 1.8, -2, 1, 2/23, -4? 1.8 Which is the third biggest value? (a) -2/13 (b) 3 (c) -3 (d) 146 a What is the fourth smallest value in -0.2, 1, -7, -5? 1 Which is the fourth smallest value? (a) 2/5 (b) 3 (c) 0 (d) -5/4 b What is the second smallest value in -3, 0.5, -1/5? -1/5 Which is the second smallest value? (a) -6/13 (b) -3 (c) -26 b What is the biggest value in 0.3, 28, -1? 28 Which is the biggest value? (a) 4 (b) 1/3 (c) -17 a Which is the smallest value? (a) -1 (b) 0.1 (c) 0.068 (d) -2 (e) -1/4 d What is the smallest value in 0.5, -1/4, 78? -1/4 Which is the biggest value? (a) -3 (b) -46 (c) -0.4 (d) -0.5 (e) 12/11 e What is the third biggest value in 9, 4/11, -1/8? -1/8 Which is the smallest value? (a) -69 (b) 1 (c) 1/4 (d) -4 (e) -0.4 a Which is the fourth smallest value? (a) 0.2 (b) -4/5 (c) -5 (d) 22.4 d Which is the third smallest value? (a) -3 (b) 38 (c) 0 (d) 1/3 d Which is the fourth biggest value? (a) 1/2 (b) 0.7 (c) -0.07 (d) -2/11 d What is the second smallest value in 0.2, -1, -0.2, -99? -1 What is the second smallest value in -1470, 2/7, 0? 0 Which is the second smallest value? (a) 3 (b) 1/395 (c) 2/17 c Which is the third smallest value? (a) -2 (b) -0.341 (c) 0 c What is the biggest value in -3, 16, 0.1, -1? 16 What is the fourth biggest value in 8810, 0.4, -5, 2? -5 Which is the third smallest value? (a) 1/2 (b) 0 (c) -0.01 (d) -0.08 (e) -0.4 c What is the smallest value in 2, -12, -0.06? -12 Which is the third biggest value? (a) -2 (b) -1/7 (c) -71/8 (d) 0.3 a What is the third smallest value in -1/2, -8/5, -4, 1/9, 3? -1/2 Which is the third smallest value? (a) 0 (b) -0.7 (c) -1580/3 a Which is the smallest value? (a) 5 (b) -2/3 (c) -1 (d) 2 c Which is the second biggest value? (a) -2/3 (b) 2.67 (c) -0.1 c Which is the fourth smallest value? (a) -3 (b) -0.2 (c) 0 (d) -0.15 c Which is the fourth biggest value? (a) -1/3 (b) 2 (c) -2/5 (d) -4 d Which is the smallest value? (a) 0.1 (b) -7 (c) -3/2 (d) 2/37 b What is the fourth biggest value in -2/15, 4, 4/15, 1/6? -2/15 What is the fourth biggest value in 2/11, -2/17, 12, 1? -2/17 Which is the third biggest value? (a) -9 (b) -3/5 (c) 0.05 a Which is the third smallest value? (a) 7 (b) -3 (c) -4/19 (d) 0.4 d Which is the second smallest value? (a) -0.03 (b) 7 (c) 3/7 (d) 11 c Which is the third biggest value? (a) -4/3 (b) 2 (c) -3 c What is the second smallest value in -2/45, -3/5, -3, -5? -3 What is the fourth biggest value in 64, 2, 0.5, 0.1? 0.1 Which is the second smallest value? (a) -1/5 (b) 3.6 (c) 0.1 c What is the biggest value in 22, -74, -3? 22 Which is the second biggest value? (a) -0.04 (b) -3/2 (c) -1/3 c Which is the third biggest value? (a) 1/2 (b) -5 (c) -23 c Which is the smallest value? (a) 4 (b) 5 (c) -0.2 (d) 49 c What is the third smallest value in -5, 0, 15? 15 What is the second smallest value in 0.1, -5, -0.05, 0? -0.05 What is the smallest value in 2, 0.7, 2/3, -0.1? -0.1 Which is the third biggest value? (a) 2 (b) -106 (c) 1/2 (d) 0.4 d What is the second smallest value in 5, -0.3, -0.5, -4? -0.5 Which is the second biggest value? (a) 1.3 (b) 5 (c) 0 (d) -0.4 a What is the second smallest value in 2, -0.1, 50? 2 Which is the second smallest value? (a) 0.8 (b) 2/3 (c) -11 (d) 2 b Which is the second smallest value? (a) -7 (b) 1 (c) 1/4 (d) 114 (e) -1/3 e What is the fourth biggest value in -0.2, 2/9, 1, 0.02, -3? -0.2 What is the third smallest value in 3/2, 0.3, -2/7, -12? 0.3 Which is the biggest value? (a) 1/7 (b) 0.5 (c) -1 (d) 2/11 b Which is the third biggest value? (a) -0.4 (b) -1 (c) 29/4 (d) 0.4 a What is the third biggest value in -1, 3, -7, 0.4, -66? -1 Which is the third smallest value? (a) 1/6 (b) -4 (c) -1/363 a What is the third biggest value in -5, 2/7, -2/21, 0.015? -2/21 What is the fourth smallest value in -7, 1, -4, -1/2? 1 What is the third smallest value in -4/9, 3/2, 0, -0.2? 0 Which is the second biggest value? (a) 309 (b) 1/7 (c) -2/11 b What is the biggest value in 4, 0.04, -2, -3? 4 What is the third biggest value in 33, -4, 0, 4? 0 What is the smallest value in -5, 6, 0.53? -5 What is the second smallest value in 1/2, 4/15, 6? 1/2 What is the second smallest value in 6/23, -8, 3/4, 0, 1? 0 Which is the second biggest value? (a) -0.5 (b) 0.4 (c) 28/5 b Which is the third biggest value? (a) -2 (b) 4457 (c) -1 a What is the second smallest value in 236, -3, 0, -1/2? -1/2 What is the second smallest value in 3/202, -4/5, 4? 3/202 What is the second biggest value in -7, -0.3, -12? -7 What is the third smallest value in -2, 4, -2/283? 4 Which is the third smallest value? (a) 0.2 (b) -5 (c) -5/13 (d) -6 c Which is the fourth smallest value? (a) 2/7 (b) 15/2 (c) 5 (d) 2/5 b What is the fourth smallest value in 18, 3, -2, 2? 18 What is the third smallest value in 0.5, 17, 0, 2/15? 0.5 What is the second biggest value in 812, 0, -2/7? 0 What is the fourth biggest value in -0.15, 25, -2, -4, 1/3? -2 What is the third smallest value in -0.07, 0.5, 2? 2 What is the biggest value in 482, 0.2, 1/4? 482 What is the fourth biggest value in 1.5, 5/6, 0.9, 0.3? 0.3 What is the smallest value in -4, -15, 3/8, -3? -15 What is the second smallest value in 3/34, -1/2, -0.1? -0.1 What is the smallest value in 2/5, 20, -9/7? -9/7 What is the fourth biggest value in 0, -0.5, -92, 0.4? -92 Which is the third biggest value? (a) -1 (b) 0.07 (c) 0.12 (d) 1/9 (e) 1 d Which is the third smallest value? (a) -1 (b) 0 (c) -5.4 (d) -3 a What is the third biggest value in 0.2, 114, 0, 1/4, -2? 0.2 What is the third smallest value in 68, -0.17, 0.5? 68 What is the second biggest value in -0.3, -15, -4, 6? -0.3 Which is the second smallest value? (a) 4 (b) -4.7 (c) 0.4 c What is the fifth biggest value in -3/7, -3, -166, -0.5, 0.2? -166 Which is the second biggest value? (a) 10/9 (b) 58 (c) 2 c Which is the third smallest value? (a) -15 (b) -1 (c) 0 (d) 0.01 c Which is the second smallest value? (a) 4 (b) -2 (c) -0.3 (d) -4/13 d Which is the fourth biggest value? (a) 2/7 (b) 22 (c) -4 (d) -2/7 (e) -3 e What is the third biggest value in -2/7, 2/11, -1, -2/11, 108? -2/11 What is the smallest value in 3/2, 0.5, -2014? -2014 Which is the fourth biggest value? (a) 4.277 (b) 1/3 (c) 4 (d) -0.4 d Which is the second smallest value? (a) -16.1 (b) -2/13 (c) -8 c What is the smallest value in 4/5, -8, 5/7? -8 Which is the second biggest value? (a) -7 (b) -4 (c) -0.1 (d) -0.4 (e) 5 c What is the biggest value in -2.1, 2/5, 10? 10 What is the second smallest value in 2/13, 4, -3/34, -2? -3/34 What is the second smallest value in -6, 3, -1/67, 5? -1/67 What is the second smallest value in 10, 0.3, -5, -19? -5 Which is the biggest value? (a) 1/7 (b) -3 (c) -138 (d) -1 a What is the fourth biggest value in -20/3, 0.2, -0.1, 0.08, -1? -1 Which is the second biggest value? (a) 318 (b) -0.1 (c) 0.4 c Which is the second smallest value? (a) -80 (b) 1 (c) -2 (d) 1.3 c What is the second biggest value in 3/7, -18, -3, -9, 2? 3/7 What is the biggest value in -14, -0.1, -9? -0.1 What is the biggest value in -0.04, -2, 3? 3 What is the biggest value in -5, -3/10, -3/7, 1.5, 0.4? 1.5 What is the second smallest value in 4, 119, -0.4? 4 What is the fourth smallest value in -4, 4, 3, 1/11? 4 Which is the third smallest value? (a) -1/10 (b) 4 (c) -0.065 b Which is the smallest value? (a) 0 (b) 3 (c) -1/4 c What is the second smallest value in -4.3, -1/7, -4/5, 2/	{ "pile_set_name": "DM Mathematics" }
4). -1 What is the value of 39/15 + (-3)/5? 2 Calculate 12/15(3 + -13 + 15). 4 (-1 - 3) + 55/15 -1/3 Calculate 14/84(-4)/2. -1/3 (8/(-2))/(-17 - -3) 2/7 What is 3 - ((-258)/(-18) - 42/18)? -9 What is the value of (-2)/16(3 + -13 - -4)? 3/4 Calculate 2/(-14)11/(33/(-6)). 2/7 -4 + (7 - (-250)/(-90)) 2/9 What is 2/(-2) - 24/(-20)? 1/5 Evaluate (-48)/10 - (-8)/(-40). -5 (-16)/3(-4 - (-44)/8) -8 What is the value of 1/3 - (-20)/(-240)? 1/4 ((-21)/28)/(3/12) -3 Calculate (-16)/(-6)(-18)/12 + -2. -6 Calculate (-225)/(-30) - 9/6. 6 Calculate (9 + (-16 - -8))/((-2)/8). -4 Evaluate ((-171)/(-38))/((36/3)/(-2)). -3/4 What is the value of 9(-63)/162 + 8/2? 1/2 What is (9/(-132)2)/(24/32)? -2/11 What is (-130)/39 - (1 + (-1)/3)? -4 Evaluate -18 - -26 - (4 + 8). -4 Evaluate (-3 + -1 - -1)2. -6 What is 4 + 3 - (-2070)/(-315)? 3/7 What is (2/3)/((-1)/(-2)-6)? -2/9 What is the value of 16 + 1008/(-70) + -1 + -1? -2/5 (-12)/(-3) + (-105)/281 1/4 Calculate (-2)/(-7) - (0 + (-8)/(-14)). -2/7 What is the value of 2057/231 + -9 + 298/42? 7 Calculate -1 + (-80)/(-126) - (-8)/56. -2/9 Calculate 2(8 + 209/(-22)). -3 Calculate (((-140)/63)/(-2))/(4/18). 5 What is the value of ((-13)/((-130)/(-8)))/(4/30)? -6 2/(-2) + (-14)/91-13 1 What is the value of ((-4)/(-4) - -8) + -7? 2 What is the value of (-6)/4(-5 - (-7)/(-21))? 8 Evaluate (20/24)/(5/4). 2/3 Evaluate 22/165 - ((-128)/(-60) - -5). -7 What is 3/(-2)50/(-15) + -1? 4 What is (1 - -4 - (-7144)/(-722)) + 5? 2/19 Calculate (34/(-120))/(2/8). -2/5 Evaluate (-12)/4 + (-75)/(-24). 1/8 Calculate (45/20 + -3)32/36. -2/3 What is 5/(30/8)12/8? 2 (-160)/(-256) - 2/16 1/2 Evaluate 154/(-12)3. -5 Evaluate 1/(-1)(-2 + 50/30). 1/3 What is (-3 + 11 + 4)/(9/(-6))? -8 Calculate 4/10 + 17/(-30). -1/6 (-54)/8 + (-180)/(-240) -6 Evaluate -6 + (4/10)/((-12)/(-30)). -5 (-1 + 20/24)2 -1/3 What is 680/476((-42)/4)/(-3)? 5 121/(5 + 2) 3 24/(-54) - (-12)/27 0 Evaluate (-6)/4(-16)/8. 3 Evaluate (-15)/((-8100)/444) + 2/(-9). 3/5 ((-1)/(-3))/((5/(-15))/(-1)) 1 What is the value of 2 + -5 + 11/((-2508)/(-708))? 2/19 Evaluate (7/(-105))/(-224/160). 2/9 Calculate (-75 + 72)(-3)/(-3). -3 Calculate (-48)/(-18)((-57)/(-24) + -2). 1 What is (10/(-4) + 3)/(5 - 6)? -1/2 What is the value of (25/(-10))/(45/(-36))? 2 ((-390)/(-910))/(1/(-14)) -6 Calculate ((-24)/20)/((-1)/(-5)). -6 0 + 13/3 - 4 1/3 (-1)/(-15)13 - (-2 + 3) -2/15 What is the value of 1/(-2 - (-4)/4) - -2? 1 Calculate 343/36. 1 What is ((-3)/(-14))/((45/12)/(-5))? -2/7 What is (2 - (1 + (-8)/4))/1? 3 What is the value of (0/(-1 + -3))/(-2)? 0 Calculate 2/10 + 3614/(-1170) - -3. 1/9 (-117)/(-630) - (-6)/(-21) -1/10 Evaluate (1280/(-72))/103/4. -4/3 Calculate 214/(-2)4/(-14). 4 Calculate -1(-2 + -3 - (-10 - -6)). 1 Calculate 3/6 - (-4 - 61/(-14)). 1/7 Evaluate (-1 + -13)(-9)/(-54). -2/3 -3(-1)/(-4)150/675 -1/6 Evaluate (-8)/(-3)(-51)/(-34) - 3. 1 Evaluate (59/(-177))/(-11-2). -1/6 Evaluate (-1)/(-5) + (-264)/(-30) + -6. 3 (-9)/(-3) - -536/(-30) -3 What is the value of (-7 - (-6)/3)/(5/(-5))? 5 Calculate (-2)/(-6)114/(-7). -2/3 Calculate (13/(-52))/(27/(-24)). 2/9 -7 - 47/(-94)(-1 - -1) -7 (-128)/(-384)3/(-1) -1 What is the value of (-3 + (-26)/(-14))/((-12)/14)? 4/3 Calculate (-2 - (-2 + 4))/(0 - 2). 2 510/(-25)4/2 -4 Evaluate 22/(-440)24/(-9). 2/15 What is the value of (3 - (-38)/4)32/(-160)? -5/2 ((-11)/33)/(5/9) -3/5 ((-1)/((-10)/(-6)))/((-115)/1150) 6 What is 3(-108/16)/(-3)? 5 Calculate (-8)/(-20) + 56/10. 6 Evaluate -2 - (135/15)/((-45)/(-10)). -4 Evaluate 8/(-20) - (-64)/110. 2/11 Evaluate 44/(-16) + 3 - (-15)/12. 3/2 What is (3/2)/((-7)/(-14))? 3 What is the value of 4(-3 + (-22)/(-8))? -1 Calculate 9/6(-3)/(-18). 1/4 Calculate (-3)/(-4) + -6323/3672. 2/9 Evaluate 23/161 + -2 + (-237)/(-105). 2/5 Evaluate ((-42)/(-56))/(2(-1)/16). -6 What is the value of (-2)/((-22)/(-4) - 3)? -4/5 What is 390/(-609) - 24/(-42)? -2/29 Evaluate (-10)/4(-51)/(-30) + 4. -1/4 Calculate (-46)/(-70) + (-79)/(-553). 4/5 What is 12(-1)/2(17 - 16)? -6 Calculate (6/(-36))/((-1)/6). 1 What is (-18)/4048/(-36)? 3/5 What is the value of (128/(-24))/1615? -5 What is (-1(4 - 6))/(5 - 3)? 1 4 - (-18)/(-12)2 1 What is the value of (-23)/((-690)/100) + 1/(-3)? 3 (-5)/(550/132) + (-134)/(-120) -1/12 Evaluate 3/(-18)4(6 - 0). -4 Calculate 7 + (-2)/7 + 5786/(-770). -4/5 Evaluate (15 - 17)(30/4)/3. -5 What is the value of (-2)/((-6)/(-9)) - 6/(-3)? -1 Calculate (-46)/161(10 + 4). -4 What is the value of 1420/426 + 1-3? 1/3 What is the value of ((-28)/(-35))/(-4 - (-234)/60)? -8 Evaluate (3/2)/((-54)/(-180)). 5 Evaluate (-24)/15 - (28/35)/2. -2 What is 4 - (252/(-4))/(-7)? -5 Calculate 23 + -24 + (0 - 2). -3 What is ((-2)/(-4))/((-36)/(-360))? 5 What is the value of ((-12)/16)/(90/(-20) + 6)? -1/2 Evaluate (84/(-16))/((-27)/(-24)) - -6. 4/3 Evaluate 6/(-21) - 488/56. -9 ((-12)/20)/(-3(-1)/(-15)) 3 Evaluate 9/(-2)25/(-150). 3/4 Calculate ((-4)/10)/(4 + 340/(-50)). 1/7 Evaluate (-18)/4(-21)/63. 3/2 Evaluate (70/(-6))/(-7) + (-11)/(-33). 2 What is the value of 832/(-160) - 1/(-5)? -5 Calculate (-24)/(-360) - 2/(-6). 2/5 What is the value of 2/614/(-35)? -2/15 Evaluate 7 - (303/101 - -14). 0 15/4 - (-3 - (-15)/4) 3 What is the value of 6(18/4)/9? 3 Calculate ((-48)/30)/((-8)/(-20)). -4 What is the value of ((-7)/(-2) - 2)48/18? 4 Calculate 24/7 - (5 - 2) - 1. -4/7 Calculate 132/55 + -11 + 9. 2/5 What is -21/36/(-8)? 1/2 What is the value of (-50)/(-125) + ((-12)/5 - 2)? -4 What is -14 - (-27 + 7 - -8)? -2 Evaluate (-1 - 5/(-3))(-60 - -66). 4 Evaluate -3112/(-450). 2/25 Evaluate (0 + -2)/((-12)/18). 3 5/7032 3/7 What is the value of (2 + -5)/(-6)13/26? 1/4 Calculate 5 + ((-152)/26 - -1). 2/13 What is the value of (-2)/(-4) + 2(-5)/(-4)? 3 What is (-2 + 24/9)(-3)/(-13)? 2/13 What is the value of (30/90)/((-1)/3)? -1 Evaluate -9(-3)/9 - (-4 - -14). -7 -14 + 7 - (0 + -11) 4 Calculate ((-34)/(-6) - 4)(-9)/(-5). 3 What is (-4)/(4/3) - (5 + 1)? -9 (-1)/(40/(-36)) + (-12)/8 -3/5 What is the value of ((144/(-8))/3 - -5) + 2? 1 (-5)/(-20) - 34/8 -4 What is the value of (-9(-2)/27)/(14/(-6))? -2/7 Calculate (6/((-168)/(-7)))/(1/2). 1/2 What is the value of ((-2)/(-6) - 0)747/(-166)? -3/2 1-6230/(-345) 4 What is 2 + -1 - 5/4? -1/4 Calculate 7 - 8/1 - -2. 1 Calculate 0 + 4/18 + 456/(-108). -4 Calculate 288/(-405) + 7/63. -3/5 ((5 - 2) + 1)29/(-174) -2/3 3/(-90)16/(-12)3 2/15 Evaluate (-13)/10 + (-2)/(-20). -6/5 Evaluate 13/30 - (4 - 125/30). 3/5 What is ((-2)/36)/(-2 + (-45)/(-20))? -2/9 Evaluate 4 - 0 - 0/(-4). 4 Calculate (-19 - -9)4/(-10). 4 1 - (-10)/(100/(-15)) -1/2 Calculate -1 + 42/(-7) + 8. 1 Evaluate (-3)/(216/344) - (-4 - 1). 2/9 What is (-5)/3 - 1320/(-630)? 3/7 Calculate (-34)/6 + 148/(-111) + 0. -7 Evaluate (-4)/927/6. -2 Evaluate (-5(-4)/60)/(2/(-6)). -1 Calculate 2420/308 + 3/21. 8 -254/804 -5 Calculate -1(-6)/(-72)8/2. -1/3 What is ((-42)/(-18) - 2)(-2 - -8)? 2 -44((-203)/42 + 5) - -6 -4/3 What is the value of 62/(-14) - 45/(-105)? -4 What is (16/120)/(((-4)/(-3))/2)? 1/5 6/(-22)12/(-18) 2/11 What is (5 - 13 - -5)/(18/4)? -2/3 What is the value of (-2)/8 - (-65)/100? 2/5 (-6(0 + 1))/(-17 - -22) -6/5 Calculate (-13)/(-130) + 123/(-30). -4 What is ((-30)/300)/(3/(-5))? 1/6 Evaluate (-1)/(-6) + 620/(-120). -5 Evaluate (8/12)/((-9)/((-378)/(-4))). -7 Calculate -6 + 2 + 39/9. 1/3 7 + (-6 - -5)7 0 What is 6 - 244/56 - 3/2? 1/7 Evaluate (85/(-9) + 9)/(2/(-6)). 4/3 59/525 - (-2)/10 2/7 Evaluate 7 - (-3)/4-4. 4 Evaluate (25/10 - 3)0/(-2). 0 Evaluate (-4 + 5)(0 - 1)5. -5 What is (-24)/(-35) + (-14)/49? 2/5 Evaluate 3/(-152/(-4)). 2/5 (5 - (-1243)/(-231))3/(-2) 4/7 What is (-1(-4)/(-30))/(40/(-180))? 3/5 What is 4/6171/38? 3 Calculate -2 + 40/6 + -3 + -1. 2/3 (-2)/(14/7 - 3) 2 Calculate 4 + 1/((-10)/40). 0 What is the value of -1(-23)/((-2277)/22)? -2/9 What is the value of (1 - 2/6)/((-160)/(-180))? 3/4 What is the value of (8/320*30)/(2/8)? 3 Calculate 2/(-7) - (-69)/21. 3 What is (-98)/49 - (4 + 4/2)? -8 8/5 + -2 - (-238)/70 3 Evaluate 3/18 - 2 - (-2)/(-3). -5/2 Calculate ((-141)/658)/(2/(4/(-3))). 1/7 What is the value of (19/(-57))/((-1)/(-3))? -1 What is the value of ((-24)/18)/(3 + -2)? -4/3 What is the valu	{ "pile_set_name": "DM Mathematics" }
6/160 - i5/40 + 3i*2. Factor b(c). -3c*2(c + 1)(c + 2)/4 Let i be 139/(-4) + 4 + -2. Let z = i - -33. Let -1/4 - 1/2a - za2 = 0. What is a? -1 Solve -3/2q - 3/4q2 - 1 - 1/8q3 = 0. -2 Let p(v) be the second derivative of -v8/448 + v7/280 + v6/160 - v5/80 - v2 - 2v. Let k(l) be the first derivative of p(l). Factor k(g). -3g*2(g - 1)*2(g + 1)/4 Let v be (-522)/(-135) + 12/90. Determine m so that -5/2m3 + 1/2m*v + 9/2m*2 - 7/2m + 1 = 0. 1, 2 Let y(f) = 6f2 - 4f - 2. Let s(h) = -7h2 + 4h + 3. Let w(i) = 4s(i) + 5y(i). Let j be w(2). Factor 0k + 3/4k*3 + 0 + 1/4kj. k2(3k + 1)/4 Let l(m) = -m*2 - 6m + 3. Let g(j) be the first derivative of j3/3 + j2/2 - 2. Let s(v) = 2g(v) + l(v). Factor s(b). (b - 3)(b - 1) Determine i so that 1/2i - i5 + 0 - 3/2i*3 - 5/2i*4 + 1/2i*2 = 0. -1, 0, 1/2 Let i be (-2)/(-5)((-192)/(-18) + -9). Let 0 - 2/3k2 + 2/3k*3 - 2/3k + ik4 = 0. Calculate k. -1, 0, 1 Let b(v) be the second derivative of -1/8v*4 + 1/4v*3 + 2v + 0v2 + 0. Solve b(z) = 0 for z. 0, 1 Let k(a) be the second derivative of 1/24a*4 + 1/4a*3 - 3/40a*5 + 1/60a*6 + 4a + 0 - 1/2a2. Let k(f) = 0. Calculate f. -1, 1, 2 Let f(s) be the first derivative of -5s*3/18 - 5s*2/6 + 5s/2 + 14. Factor f(k). -5(k - 1)(k + 3)/6 Let v(k) = 4k4 + 13k*3 + 19k*2. Let h(j) = -36j*4 - 116j*3 - 172j*2. Let c(n) = -3h(n) - 28v(n). Find u, given that c(u) = 0. -2, 0 Let s(r) = -18r*3 + 49r*2 - 9r - 9. Let d(q) = 9q3 - 24q*2 + 5q + 4. Suppose 13 = -o - 0o. Let h(g) = od(g) - 6s(g). Solve h(m) = 0 for m. 1/3, 2/3, 1 Let z(i) be the third derivative of 0i + 1/36i4 + 1/60i5 - i2 + 0i3 - 1/72i*6 + 0. Let z(l) = 0. What is l? -2/5, 0, 1 Let b be (-25)/30 - 0 - -1. Let u(a) be the second derivative of -1/9a*3 - 1/36a*4 - ba2 + a + 0. Factor u(i). -(i + 1)2/3 Find f such that 20/11f2 + 20/11f*3 + 2/11f*5 + 10/11f*4 + 10/11f + 2/11 = 0. -1 Suppose 8/3w2 + 0w + 0 + 0w3 - 2/3w4 = 0. Calculate w. -2, 0, 2 Let z(g) be the first derivative of g5/12 - 2g4/9 + g3/18 + g2/3 + 3g + 1. Let d(q) be the first derivative of z(q). Let d(y) = 0. What is y? -2/5, 1 Let o(h) be the third derivative of -h9/211680 - h8/70560 - h*5/30 - 4h*2. Let j(d) be the third derivative of o(d). Factor j(s). -2s*2(s + 1)/7 Let w = 0 + 3. Solve 3fw - 4 - f2 + 2 + f + 3 - 4f3 = 0. -1, 1 Let g(d) be the second derivative of -d4/16 - d*3/4 - 3d*2/8 - 5d. Let g(r) = 0. Calculate r. -1 Suppose 4 = p, -3z + 4p - 24 = -7z. What is r in -4r*2 - 3r*z + 2r4 + r2 + 4r4 + 3r*3 - 3r = 0? -1, -1/2, 0, 1 Let j(s) be the first derivative of 1/4s4 - s + 1/3s*3 - 1/2s*2 + 3. Factor j(f). (f - 1)(f + 1)*2 Let n = 93/19 - 6875/1653. Let j = n - 2/29. Let 0 - 1/3h*3 - 1/3h + jh2 = 0. Calculate h. 0, 1 Let g = -333 - -1673/5. Factor 16/5k + g - 2k2. -2(k - 2)(5k + 2)/5 Suppose -711 = 3c + 654. Let g = 3193/7 + c. Find i, given that -8/7i*4 + 0 - 6/7i*5 + 4/7i*3 + 2/7i + gi2 = 0. -1, -1/3, 0, 1 Let r(q) be the third derivative of 1/2q*5 + 4/3q*3 - 7/6q*4 + 0 + 0q - 3/40q6 + 2q*2. Factor r(l). -(l - 2)(3l - 2)2 Let h(s) be the second derivative of 3s5/80 + s4/4 - 3s3/8 - 27s*2/4 - 48s. Factor h(v). 3(v - 2)(v + 3)2/4 Let y(l) = -l3 - 8l2. Let g be y(-8). Determine t, given that 8/7t*5 + 0 - 2/7t*4 + 0t*3 + gt + 0t2 = 0. 0, 1/4 Suppose 10d - 10 = 8d. Suppose dm*3 + 2 - 3 + 3m*2 - m - 4m*4 + 3m*4 + 3m4 = 0. Calculate m. -1, 1/2 Let c(k) be the third derivative of k9/80640 - k8/8960 + k7/2240 - k6/960 + k5/60 + 4k2. Let y(f) be the third derivative of c(f). Factor y(u). 3(u - 1)*3/4 Let m be (-1 - 1)(-8)/(72/21). Let -ms3 + 0 + 4/3s + 10/3s2 = 0. What is s? -2/7, 0, 1 Let f(a) be the first derivative of a6/30 - a4/10 + a2/10 + 10. Let f(q) = 0. What is q? -1, 0, 1 Let s be ((0 + -2)/(-2))/1. Let u = s + -1. Factor -8/7m + 0 + 2/7m4 + um*2 + 6/7m*3. 2m(m - 1)(m + 2)*2/7 Solve 3/2b*2 + 0b + 0 + 3/4b3 = 0. -2, 0 Suppose 0 = 3a + 4j + 20, 0j = 2a + 4j + 20. Let u be (-4)/12 - 20/(-12). Factor ux - 4/3x*3 + 2/3x*2 + a - 2/3x*4. -2x(x - 1)(x + 1)(x + 2)/3 Let a be 19/(-4 - -1). Let q be (-4)/(-3) - 2/a. Let -16/9bq + 4/3b*3 - 4/3b - 2/9 + 2b4 = 0. Calculate b. -1, -1/3, 1 Let m(y) be the first derivative of y5/120 + y4/8 + 3y3/4 - y2 - 3. Let q(n) be the second derivative of m(n). Factor q(v). (v + 3)*2/2 Let r = -97781 - -2737465/28. Let k = r + 61/4. Factor -2/7x*2 + kx - 4/7. -2(x - 2)(x - 1)/7 Let g(t) = -t2 - t + 1. Let a(h) = h4 + h*3 - 2h2 + 1. Let b(n) = a(n) + g(n). Factor b(f). (f - 1)2(f + 1)(f + 2) Let c(y) be the first derivative of -y*3/3 + 7y*2/2 + 8y - 40. Suppose c(r) = 0. What is r? -1, 8 Let z(n) be the first derivative of 1/11n4 + 0n*3 + 0n + 0n2 + 4 + 1/33n*6 + 6/55n*5. Factor z(s). 2s*3(s + 1)(s + 2)/11 Suppose -5w - 2l - 2l = 12, -4w + l = -3. Let u be (-3)/(-9)(w + 9). Factor -6gu + 5g*3 - 2g3 + g3 + 2g. -2g(g - 1)(g + 1) Let b be ((-12)/(-18))/(2/9). Find q such that 0q5 - 2q*2 - 6q*5 + 12q*4 - bq3 - q5 = 0. -2/7, 0, 1 Let g(t) = -3t - 12. Let x be g(-5). Let c(o) be the first derivative of 0o + 1/24o6 - 1/10o*5 - 1/8o*2 + 0o*4 + 1 + 1/6o*x. Solve c(y) = 0 for y. -1, 0, 1 Determine h so that -246h*2 + 31h*3 + 26h*3 - 3h*4 - 424h + 6h2 + 124h = 0. -1, 0, 10 Suppose -2/3o + 5/3o*2 - 5/3o*4 + 2/3o*3 + 0 = 0. Calculate o. -1, 0, 2/5, 1 Let z be 0 - 2/(8/(-4)). Suppose 3b - 5 = z. Factor -2/5 + 3/5w - 1/5w*b. -(w - 2)(w - 1)/5 Suppose -5b = -12 - 3. Let g(v) be the third derivative of 0v + 1/210v5 - 2v*2 + 1/420v*6 + 0 - 1/84v*4 - 1/21vb. Let g(j) = 0. What is j? -1, 1 Let u(v) = v3 - v. Let p(t) = -3t3 + 15t*2 + 3t - 15. Let b(d) = p(d) - 2u(d). Solve b(x) = 0 for x. -1, 1, 3 Let u(b) = -b2 - 20b + 22. Let h be u(-21). Let -8f5 + 2f*2 - 49/2f*3 + 11/2f - h - 28f4 = 0. Calculate f. -2, -1, 1/4 Let s(g) = -g3 - 4g2 + 3. Let a(b) = -b3 + b*2 - 1. Let l(t) = -3a(t) - s(t). Solve l(o) = 0. -1/4, 0 Let g(a) be the second derivative of a*4/24 - 9a*2/4 + a - 8. Factor g(d). (d - 3)(d + 3)/2 Let -6/11c + 2/11c*3 - 4/11 + 0c*2 = 0. What is c? -1, 2 Factor -202 - 84t*3 + 202 + 15t - 25t2 - 15t*4 + 29t*3. -5t(t + 1)(t + 3)(3t - 1) Let g(x) be the third derivative of -x*6/280 - 3x*5/70 - 9x*4/56 + 6x*2. Suppose g(r) = 0. Calculate r. -3, 0 Factor 5u*2 + 10u*2 + 3u*3 - 24u*2. 3u*2(u - 3) Let g(v) be the third derivative of 2v2 - 1/735v*7 + 0v*6 + 0v + 0v4 + 0 + 1/105v*5 - 1/21v*3. Suppose g(k) = 0. Calculate k. -1, 1 Let b = 0 - -3. Suppose -4u + bu - 4c - 16 = 0, 3c + 12 = 3u. Let -2/9j5 + 4/9j*4 - 2/9j*3 + 0j*2 + 0j + u = 0. Calculate j. 0, 1 Solve -2/5p2 - 6/5 - 8/5p = 0 for p. -3, -1 Let m = -1113/5 + 223. Suppose -2/5t3 - 2/5t*2 + mt + 2/5 = 0. Calculate t. -1, 1 Let o(j) be the second derivative of j*5/5 + 4j*4/3 + 10j*3/3 + 4j*2 - 6j. Find b such that o(b) = 0. -2, -1 Suppose x - 3x - 8 = 0. Let r = -2 - x. Determine b, given that 4b*2 + 0 + r + 7b - 2b + b = 0. -1, -1/2 Find h, given that -10h*2 + 11h*2 - 9h*2 - 36h - 4h2 + 4h*3 - 20 = 0. -1, 5 What is i in -38/9i*2 + 14/9i*3 + 8/9 + 16/9i = 0? -2/7, 1, 2 Let n(f) be the first derivative of f7/1470 + f6/2520 - f5/210 - f4/168 + 2f3 - 3. Let d(i) be the third derivative of n(i). Factor d(o). (o - 1)(o + 1)(4o + 1)/7 Let b(o) be the second derivative of o*4/6 + 5o3/12 + o2/4 - 5o. Factor b(u). (u + 1)(4u + 1)/2 Let m be (-4)/14 + 34/21. Let k be 19 - (0 - -3). What is b in -8b2 + kb - m + 10/3b3 = 0? 2/5, 1 Let h be (2/5)/((-52)/(-20) - 1). Factor 1/2w + 0 + hw2. w(w + 2)/4 Let f be 81/(6/3). Let l(v) be the second derivative of 1/7v*2 + 1/42v*f + 0 - 2/21v*3 - v. Factor l(c). 2(c - 1)*2/7 Let 427a*2 - 24a + 34a3 - 10a*5 + 6a*4 - 8 + 0a*3 - 425a**2 = 0. What is a?	{ "pile_set_name": "DM Mathematics" }
- 16sqrt(7) Simplify (4(-6(sqrt(1584) + 3 + sqrt(1584))4 + (4 + sqrt(1584))-3 + 2 + -1))2. 1625472sqrt(11) + 66029968 Simplify (63sqrt(175)-1)2 + (-4(sqrt(112) - (sqrt(112) + 1sqrt(112))) + sqrt(112) + 2)2. 80sqrt(7) + 59504 Simplify -6(((sqrt(363) + 2sqrt(363) + -4)-1)2 + (0 + 0 + sqrt(363) + -3)2 + 2). -21942 + 1980sqrt(3) Simplify -316-2sqrt(11) - (-4 + (sqrt(11)5 + sqrt(11))2 + -3 + sqrt(1100)). -389 + 26sqrt(11) Simplify ((3 + 0 + -6(sqrt(1539) + -2)5)5)2-5. -173633625 + 4252500sqrt(19) Simplify (sqrt(288) + 1((sqrt(288)-3 - sqrt(288)) + sqrt(288)))/((sqrt(6) - sqrt(96))-2-1). 4sqrt(3)/3 Simplify 1(sqrt(99) + (sqrt(99) - 4(sqrt(99) + 1)) - (sqrt(99) + 0)-4)2 + (3sqrt(99))*2-5 + 5(sqrt(99) + 0) + 0. -4043 - 33sqrt(11) Simplify (-1 + (sqrt(300) - sqrt(300)2) + 0 + sqrt(300)-16)2 + 3(0 + 1sqrt(27) + sqrt(27) + -2)2. 68sqrt(3) + 15037 Simplify (sqrt(8640)/sqrt(4))/(sqrt(60)/sqrt(3))2 + 2. 2 + 12sqrt(3) Simplify 5 + 6((sqrt(50)/(sqrt(20)/sqrt(4)2))/(sqrt(200) + sqrt(200) + sqrt(200)-22))*2. 803/160 Simplify -2(((((sqrt(99) - (sqrt(99)-2 + sqrt(99)) - sqrt(99)) + sqrt(99))-6)/(3sqrt(3)-2))/((sqrt(42)/(1sqrt(7)))/(sqrt(288)-2)))*2. -50688 Simplify (((sqrt(4752) + sqrt(4752)-2 - sqrt(4752))-1-6)/(3(sqrt(147) - ((-5(sqrt(147)-1 + sqrt(147)) - sqrt(147)) + sqrt(147)))))2. 25344/49 Simplify (4(-4sqrt(1134) + sqrt(1134) + sqrt(1134)))/(sqrt(28)/(sqrt(256)4 + sqrt(256)))-2. 5760sqrt(2) Simplify 1 + (2 + sqrt(700))*2 + (sqrt(700) - (sqrt(700) + sqrt(700)3)*21) - (-3(0 + sqrt(448)) - sqrt(84)/(sqrt(768) - sqrt(768)-2)). -10495 + 1777sqrt(7)/24 Simplify (((sqrt(50)-1)/sqrt(5))/(sqrt(405) + 2sqrt(405)) - (-1 + (sqrt(4) - sqrt(100))/sqrt(2) + -4))2. 1070sqrt(2)/27 + 41123/729 Simplify 1 + (((-1sqrt(384))/sqrt(8) + sqrt(48))/(-5(sqrt(24) + sqrt(216))))*2. 1 Simplify -5((-4(sqrt(50) - (-1 + sqrt(150)/sqrt(3))))2 + (1 + sqrt(50) + 0 + sqrt(200)/sqrt(4))2). -1085 - 100sqrt(2) Simplify ((2sqrt(300)15)/(-4sqrt(18)/sqrt(3) + sqrt(6) + -6sqrt(18)/sqrt(3)) + -3 + -1)2. 400sqrt(2)/9 + 6296/81 Simplify (5 + (sqrt(612) - ((sqrt(612) - sqrt(612)-2)6 - sqrt(612))) + -5 + (sqrt(17)4-2 - (sqrt(17) + sqrt(1700)-2)))2. 122825 Simplify (-2 + (sqrt(128) - (sqrt(128) - ((sqrt(128) + 1)5 - sqrt(128))))5 + -3sqrt(128)-3 + 3)2. 12064sqrt(2) + 108324 Simplify ((-1sqrt(800) + ((sqrt(400)-2)/sqrt(8) - sqrt(50)))3)/(6(sqrt(810) - (sqrt(810) + sqrt(810) + -2sqrt(810)))-1). 7sqrt(5)/18 Simplify ((3 + sqrt(1300))-6 + 3 - (3 + (sqrt(1300) + 3 - sqrt(1300)) + 5))*2. 3120sqrt(13) + 47476 Simplify ((-3(sqrt(243) - (sqrt(243) - sqrt(243)-1)) + 0 + 1(sqrt(243) + 2)-5)1 + 5)2. 180sqrt(3) + 997 Simplify ((-1sqrt(3159) + sqrt(3159) + sqrt(3159))/(-1sqrt(9)/sqrt(3)) + -3 - (-6-1sqrt(130))/(sqrt(50)/(sqrt(5)-2))2)*2. -90sqrt(13) + 2934 Simplify 4(((6(sqrt(90) + sqrt(90)-1))/sqrt(2))/(sqrt(144) - (sqrt(144) - sqrt(144)13 - sqrt(144))))2. 0 Simplify (0 + sqrt(128) + -1 + 3 + sqrt(128) + (-3 + sqrt(2)-2 - (sqrt(2) - sqrt(14)/(sqrt(77)/sqrt(11)))))*2. -28sqrt(2) + 393 Simplify -2 + (((3 + sqrt(325) + sqrt(325))2 - sqrt(325) - sqrt(325))-5 + sqrt(325) + 1 + -5 + (sqrt(325) + sqrt(325) + -1 + sqrt(325))6)2. -3600sqrt(13) + 27923 Simplify (sqrt(175) - (sqrt(175) - sqrt(175)1)2)115 + (sqrt(1029)3)/(sqrt(300)-3). 243sqrt(7)/10 Simplify ((sqrt(240)/(sqrt(8)2))/((sqrt(275)/sqrt(5))/sqrt(11)))/(sqrt(3) + sqrt(108)4 - 2sqrt(24)/sqrt(8)). sqrt(2)/46 Simplify (sqrt(20)/(sqrt(60)/sqrt(6))-2 + -4 + (-4(sqrt(2) + sqrt(2)5) - sqrt(128)2))*2. 336sqrt(2) + 3544 Simplify -3((-1(sqrt(425)1 - sqrt(425)) + sqrt(425) - ((sqrt(425) + 0)2-3 - sqrt(425))) + -3)6. -22896 - 180sqrt(17) Simplify (-2(4 + -1((-3sqrt(847)4 - sqrt(847)) + sqrt(847) + -2 + sqrt(847) + 0 + sqrt(847))))*2. 5280sqrt(7) + 338944 Simplify (1 + -5 + -1 + sqrt(147) + -2)*2 + (sqrt(75) - 12sqrt(75) - (3 + sqrt(75) + -3))2. -98sqrt(3) + 496 Simplify -1((sqrt(17) - (sqrt(1088) + sqrt(17)))-2 + ((sqrt(17) + 0)-2)2) - (sqrt(136)3 + sqrt(136))/(sqrt(16)/sqrt(8)-3). -68 - 40sqrt(17)/3 Simplify (-4 + 1((3(sqrt(304) - (5 + sqrt(304))))*2 + (4 + sqrt(304))-4 + sqrt(304))-1)-4. -48sqrt(19) + 852 Simplify -5(4(1 + (-3sqrt(66))/sqrt(6)) - (2 + sqrt(66)/sqrt(6) - (sqrt(11) - (sqrt(11) - -5sqrt(55)/sqrt(5)) - sqrt(11))2)). -1990 + 65sqrt(11) Simplify (sqrt(102) + -4(sqrt(102)-3 - sqrt(102)) + 1-4sqrt(102))/(sqrt(2304)/sqrt(6) + (sqrt(6) - sqrt(6)2-6)). 13sqrt(17)/21 Simplify (((sqrt(2736) + -1sqrt(2736) + 5)4 + -4)4-6)2 + 5. 147461 Simplify -2 + (sqrt(114) + (sqrt(114) - -2-2sqrt(114)) + (sqrt(114) - (2sqrt(114)-1 + sqrt(114))) + sqrt(114) + sqrt(114))/(sqrt(486)-2-4) + 3. sqrt(19)/36 + 1 Simplify (-3 + (-5(sqrt(80) + 0 - sqrt(80))3-3 + 2)-6)2. 225 Simplify (-1(((sqrt(76) + sqrt(76)-32)1 - (sqrt(76) - (-2 + sqrt(76) + 1) - 3(sqrt(76) - (sqrt(76) + (1 + sqrt(76) - sqrt(76)))))) + -4))*2. 160sqrt(19) + 1964 Simplify (-2sqrt(5500)6 + (-4sqrt(5500)-2 - sqrt(5500)))/((2sqrt(360))/(5sqrt(8))). -125sqrt(11)/3 Simplify 3 + sqrt(162) + 4 + sqrt(162) + -4 - ((sqrt(20) + 2sqrt(80)/sqrt(4))/(sqrt(10)-13))*2. 1 + 18sqrt(2) Simplify (5(1 + ((sqrt(72) - (sqrt(72)1 + sqrt(72)))/sqrt(2))/(sqrt(12) + 2sqrt(48)/sqrt(4))))2-3. -100 + 50sqrt(3) Simplify (6-1-62sqrt(170))/(((2sqrt(270))/sqrt(9))/(-6sqrt(27))). -648sqrt(17) Simplify -55(2 + (1 + sqrt(76) + -1)-1)2. -2000 + 200sqrt(19) Simplify (3(-4 + sqrt(153)/sqrt(81) + (5 + sqrt(153))-5 + -1))*2. 7920sqrt(17) + 41012 Simplify -4 + (1(sqrt(76)3 + sqrt(76)) + sqrt(76) + -3(1sqrt(76) + sqrt(76) - sqrt(76)) + sqrt(76) + sqrt(76))/(46(-1sqrt(484) + sqrt(484) - sqrt(484))). -4 - sqrt(19)/66 Simplify sqrt(363) + -5 + (sqrt(363)-1)*2 + 2sqrt(363) + 4 + 0 + (sqrt(45)/sqrt(5) - sqrt(9))/sqrt(3)5. 33sqrt(3) + 362 Simplify (sqrt(26)/(sqrt(2) + sqrt(4)/sqrt(2)) + ((sqrt(195)/sqrt(5))/sqrt(3) - sqrt(13)) - (sqrt(91) + -5-2sqrt(91))/sqrt(7))-4 + -2. -2 + 42sqrt(13) Simplify (-4sqrt(102)4 - (sqrt(102) - -5(sqrt(102)1 + sqrt(102) - sqrt(102))))/(((sqrt(324) + sqrt(36))3)/((sqrt(54)/sqrt(3))/sqrt(3) + sqrt(6))). -11sqrt(17)/3 Simplify (((sqrt(1088) + -2sqrt(1088))1 - sqrt(1088) - 6(sqrt(1088) + sqrt(1088) + 0))-3)*2 + 3 + (4sqrt(1088)-3 + 1)2. -192sqrt(17) + 2075908 Simplify 5(1 + (sqrt(2156)/sqrt(4) + (sqrt(11) - (sqrt(1331) + 2)2) - (-3 + sqrt(1331) - (-5 + sqrt(44))))). -6680 - 225sqrt(11) Simplify 6(5 + ((sqrt(200) - (sqrt(200) - (sqrt(200) + sqrt(200)-2 + sqrt(200) + sqrt(200)) - sqrt(200)))-6)/(-1sqrt(160) - sqrt(160)) + 5) + -2. 18sqrt(5) + 58 Simplify ((sqrt(1331) + -4)-2 - (sqrt(1331) - (2 + sqrt(1331) + 4 + sqrt(1331))))*2 - (-1 + (3(sqrt(1331) + -5))*2 + 4). -10680 + 682sqrt(11) Simplify (1((sqrt(396) - (5-2sqrt(396) - sqrt(396) - sqrt(396))) + 3 + 3) + 1)2. 1092sqrt(11) + 66973 Simplify (5sqrt(308)/(5sqrt(14)/sqrt(2)))/((-1sqrt(36)-3)/sqrt(9)-6). -sqrt(11)/18 Simplify ((-5(0 + sqrt(500)) - sqrt(500))2 - (-1 + (sqrt(5) + sqrt(20) + 5)2)) + sqrt(180)22 + 0 + sqrt(125)-1. -11sqrt(5) + 17931 Simplify (5 + (sqrt(300) + 0 + -3 + sqrt(300))*26)33 + 1. -6480sqrt(3) + 65332 Simplify ((-1 + sqrt(242) + 0)2 - (sqrt(242) + ((-2 + sqrt(242))4)*2) - ((-3 + sqrt(2450))1 - sqrt(2450))*2)-1. -671sqrt(2) + 3702 Simplify (((sqrt(1452) + (sqrt(1452) - (-2sqrt(1452) + sqrt(1452)))2)-4)/((3sqrt(180)/sqrt(5))/((sqrt(72)/sqrt(4))/sqrt(2))))2. 48400/3 Simplify (((2sqrt(76) - sqrt(76))5)/((sqrt(160)/sqrt(4))/sqrt(10)) + (sqrt(2736) - (2 + -1 + sqrt(2736)))-42)2. 80sqrt(19) + 539 Simplify 5 + (-4(5 + (sqrt(125)1)*2) - (sqrt(5)3 + 4 + (-5 + -3 + sqrt(5))*2)). -588 + 13sqrt(5) Simplify -1(sqrt(5) - (-3 + (sqrt(20)/sqrt(4) - sqrt(5)) + sqrt(5))2 - 6sqrt(320) - sqrt(5)162-2). 14 + 17sqrt(5) Simplify (4(-5sqrt(153)3 + sqrt(153) + sqrt(153)))/((sqrt(63) - 3(sqrt(504)/sqrt(8) + sqrt(63)))/sqrt(7))33. 468sqrt(17)/5 Simplify ((sqrt(153) - (sqrt(153) + (-2sqrt(153)-2 - sqrt(153)))) + sqrt(153)-11)/(sqrt(99)/(sqrt(11) - (sqrt(539) + sqrt(11) - sqrt(11)))*5). 24	{ "pile_set_name": "DM Mathematics" }
1/3, to the nearest integer? 96 What is 497987 to the power of 1/9, to the nearest integer? 4 What is the square root of 59726 to the nearest integer? 244 What is 352730 to the power of 1/2, to the nearest integer? 594 What is the cube root of 499752 to the nearest integer? 79 What is the third root of 8315156 to the nearest integer? 203 What is 23672387 to the power of 1/2, to the nearest integer? 4865 What is the cube root of 66912 to the nearest integer? 41 What is the third root of 2130346 to the nearest integer? 129 What is the cube root of 1519087 to the nearest integer? 115 What is 3030547 to the power of 1/4, to the nearest integer? 42 What is the square root of 136160 to the nearest integer? 369 What is the cube root of 649717 to the nearest integer? 87 What is the cube root of 109322 to the nearest integer? 48 What is the square root of 11084250 to the nearest integer? 3329 What is 193137 to the power of 1/10, to the nearest integer? 3 What is the square root of 277165 to the nearest integer? 526 What is the cube root of 911148 to the nearest integer? 97 What is 212959 to the power of 1/5, to the nearest integer? 12 What is the square root of 3473100 to the nearest integer? 1864 What is the square root of 998667 to the nearest integer? 999 What is the third root of 381172 to the nearest integer? 73 What is the third root of 210227 to the nearest integer? 59 What is 1467499 to the power of 1/2, to the nearest integer? 1211 What is 359398 to the power of 1/7, to the nearest integer? 6 What is 135100 to the power of 1/3, to the nearest integer? 51 What is 4902737 to the power of 1/4, to the nearest integer? 47 What is 5147812 to the power of 1/8, to the nearest integer? 7 What is 830445 to the power of 1/7, to the nearest integer? 7 What is the cube root of 940666 to the nearest integer? 98 What is 2115227 to the power of 1/2, to the nearest integer? 1454 What is the third root of 96025 to the nearest integer? 46 What is the cube root of 98233 to the nearest integer? 46 What is the third root of 28970 to the nearest integer? 31 What is the sixth root of 837163 to the nearest integer? 10 What is the third root of 7247821 to the nearest integer? 194 What is the third root of 541782 to the nearest integer? 82 What is 4571031 to the power of 1/10, to the nearest integer? 5 What is 146521 to the power of 1/2, to the nearest integer? 383 What is 10087823 to the power of 1/2, to the nearest integer? 3176 What is 1056708 to the power of 1/5, to the nearest integer? 16 What is the sixth root of 3091662 to the nearest integer? 12 What is 1192854 to the power of 1/3, to the nearest integer? 106 What is the fourth root of 5616683 to the nearest integer? 49 What is 2224032 to the power of 1/2, to the nearest integer? 1491 What is the square root of 3407712 to the nearest integer? 1846 What is the square root of 152627 to the nearest integer? 391 What is 1912231 to the power of 1/3, to the nearest integer? 124 What is 104131 to the power of 1/3, to the nearest integer? 47 What is 127720 to the power of 1/9, to the nearest integer? 4 What is 7768869 to the power of 1/6, to the nearest integer? 14 What is 54542 to the power of 1/3, to the nearest integer? 38 What is the square root of 293140 to the nearest integer? 541 What is the cube root of 693594 to the nearest integer? 89 What is 5045463 to the power of 1/2, to the nearest integer? 2246 What is the third root of 5198285 to the nearest integer? 173 What is the square root of 1265837 to the nearest integer? 1125 What is the cube root of 6221490 to the nearest integer? 184 What is the third root of 14594620 to the nearest integer? 244 What is 54496 to the power of 1/2, to the nearest integer? 233 What is 554994 to the power of 1/3, to the nearest integer? 82 What is 721010 to the power of 1/3, to the nearest integer? 90 What is 8514971 to the power of 1/7, to the nearest integer? 10 What is the cube root of 2772644 to the nearest integer? 140 What is 38937065 to the power of 1/3, to the nearest integer? 339 What is 142834 to the power of 1/10, to the nearest integer? 3 What is 106655 to the power of 1/2, to the nearest integer? 327 What is 11418939 to the power of 1/3, to the nearest integer? 225 What is 8376267 to the power of 1/2, to the nearest integer? 2894 What is the seventh root of 130739 to the nearest integer? 5 What is 1134769 to the power of 1/2, to the nearest integer? 1065 What is the square root of 139498 to the nearest integer? 373 What is 2101385 to the power of 1/2, to the nearest integer? 1450 What is 152443 to the power of 1/2, to the nearest integer? 390 What is 12685873 to the power of 1/2, to the nearest integer? 3562 What is the square root of 90946 to the nearest integer? 302 What is 214118 to the power of 1/2, to the nearest integer? 463 What is the cube root of 22057752 to the nearest integer? 280 What is the third root of 2848644 to the nearest integer? 142 What is 214443 to the power of 1/2, to the nearest integer? 463 What is 607278 to the power of 1/2, to the nearest integer? 779 What is the square root of 726259 to the nearest integer? 852 What is 344818 to the power of 1/4, to the nearest integer? 24 What is the seventh root of 386626 to the nearest integer? 6 What is the ninth root of 6952155 to the nearest integer? 6 What is the square root of 3436843 to the nearest integer? 1854 What is 515038 to the power of 1/3, to the nearest integer? 80 What is the square root of 18056015 to the nearest integer? 4249 What is the eighth root of 180350 to the nearest integer? 5 What is the cube root of 20431165 to the nearest integer? 273 What is 212321 to the power of 1/2, to the nearest integer? 461 What is the seventh root of 3247922 to the nearest integer? 9 What is 896781 to the power of 1/8, to the nearest integer? 6 What is 4737307 to the power of 1/3, to the nearest integer? 168 What is the square root of 14332571 to the nearest integer? 3786 What is the tenth root of 2160398 to the nearest integer? 4 What is the fourth root of 5301449 to the nearest integer? 48 What is the cube root of 206515 to the nearest integer? 59 What is the cube root of 4068854 to the nearest integer? 160 What is the third root of 7345746 to the nearest integer? 194 What is 61142 to the power of 1/3, to the nearest integer? 39 What is 364937 to the power of 1/9, to the nearest integer? 4 What is the sixth root of 559405 to the nearest integer? 9 What is 9480615 to the power of 1/5, to the nearest integer? 25 What is 2907710 to the power of 1/2, to the nearest integer? 1705 What is the cube root of 432818 to the nearest integer? 76 What is 2405562 to the power of 1/8, to the nearest integer? 6 What is 8259582 to the power of 1/10, to the nearest integer? 5 What is the cube root of 1376630 to the nearest integer? 111 What is 16654673 to the power of 1/3, to the nearest integer? 255 What is the eighth root of 423477 to the nearest integer? 5 What is the cube root of 1956869 to the nearest integer? 125 What is the third root of 5598039 to the nearest integer? 178 What is the fourth root of 11260622 to the nearest integer? 58 What is the square root of 82183 to the nearest integer? 287 What is 982 to the power of 1/8, to the nearest integer? 2 What is the cube root of 1738755 to the nearest integer? 120 What is 3627286 to the power of 1/3, to the nearest integer? 154 What is the tenth root of 14918858 to the nearest integer? 5 What is the sixth root of 997972 to the nearest integer? 10 What is 92036 to the power of 1/7, to the nearest integer? 5 What is the square root of 5265183 to the nearest integer? 2295 What is the cube root of 175780 to the nearest integer? 56 What is the third root of 2440366 to the nearest integer? 135 What is 1523907 to the power of 1/3, to the nearest integer? 115 What is 9696861 to the power of 1/2, to the nearest integer? 3114 What is the cube root of 21851 to the nearest integer? 28 What is the ninth root of 87952 to the nearest integer? 4 What is the square root of 241700 to the nearest integer? 492 What is the square root of 5481983 to the nearest integer? 2341 What is the square root of 12227165 to the nearest integer? 3497 What is the third root of 12618357 to the	{ "pile_set_name": "DM Mathematics" }
-2)/6609) a composite number? False Suppose -3x = 110 - 116. Is 26631/15 + x + 2/(-5) composite? False Let m = -11 + 8. Let t = -1 - m. Suppose 2k = 5j + 5, 3k - tk = 5j - 5. Is k prime? False Let k(u) = u*2 - 9u + 49. Let i(a) = 15a2 - 2a - 2. Let w be i(-1). Is k(w) a prime number? True Suppose -5c + 1149 = 4b, 0 = b - 4 + 3. Let h = c - -325. Is h a prime number? False Let v(i) = 23i2 - 9i - 4. Let s(u) = 47u2 - 17u - 9. Let q(o) = 6s(o) - 11v(o). Is q(-4) composite? True Suppose 0 = 3a + u - 13119 - 6443, 5u + 13047 = 2a. Is a prime? True Suppose 18i = 7i + 71291. Is i prime? True Suppose 24 = 8y + 8. Suppose 4c - 1924 = yq, c - 1908 = -3c - 2q. Is c composite? False Let n(q) = 53q. Let v be n(1). Suppose 25x + 90 = 10x. Let c = v - x. Is c a composite number? False Let p = -134 - -196. Suppose 0h = -h + p. Is h composite? True Suppose -2t + 2082 = -2r - 1982, -3t = r + 2044. Let u = r - -3308. Is u a composite number? True Suppose 0 = -5j + 3767 - 902. Is j a composite number? True Suppose 60n = 58n + 794. Suppose n - 4855 = -6y. Is y prime? True Suppose 0 = -4d - 2d - 90. Is 2/(-10) + (-4668)/d prime? True Let v(a) = 5a. Let f be v(-3). Let c be ((-5)/f)/((-2)/102). Let k(p) = -6p - 5. Is k(c) a prime number? True Let a(x) = x3 - 3x*2 + 3x - 1. Let t be a(3). Let j = -3 + t. Suppose jp - 30 = 45. Is p a prime number? False Let u(r) be the third derivative of -149r*4/24 - 4r*3/3 + 29r*2. Is u(-3) prime? True Let h be (68/(-12) - -1) + 231. Let i be (-11140)/(-25) + 4/10. Suppose -f = -d - h, f - 4d - i = -f. Is f prime? True Let o = 172 - 104. Suppose 0 = -29t + 23t - 6. Let a = t + o. Is a prime? True Let b = -36 + 21. Let m be (-2)/(-3) + 32/(-3). Is 115/3 + m/b a composite number? True Let t(j) be the third derivative of 0 - 1/6j*3 + 0j*5 + 0j*4 + 0j + 5j2 + 7/30j*6. Is t(2) a prime number? True Suppose -n = 26 + 9. Let k = n + 55. Let x = 45 - k. Is x prime? False Let x = 70 - 82. Let i = x - -67. Is i a composite number? True Suppose 3497 + 15147 = 4h. Is h composite? True Let z = -67 + 38. Let p = z + 30. Is 1p/((-4)/(-628)) prime? True Suppose s + 5 = 5q - 7, 4 = 2q. Is (-3 - s)3 - -130 a composite number? False Let j = -15 + 18. Let k be (-9 + (6 - j))/(-1). Is (-242)/(-4) - k/4 a prime number? True Let i(j) = j3 - j2. Let l be i(3). Suppose lp = 13p + 360. Let q = 221 - p. Is q composite? False Suppose 17c - b = 22c - 50421, -40328 = -4c - 3b. Is c composite? True Suppose -14y + 4y = -150. Let f(u) be the first derivative of -u*4/4 + 17u*3/3 - 21u*2/2 + 14u - 1. Is f(y) prime? True Is 24211 + 10/2 a prime number? False Let q(m) = 1247m - 127. Is q(4) a composite number? False Suppose 3o - 4j = -0o - 811, -3o + 3j = 816. Let u = o + 438. Is u a composite number? True Suppose 6569 = 24y - 13375. Is y composite? True Let w = -338 + 873. Let o = 792 + w. Is o a composite number? False Let j(v) be the first derivative of 29v3/3 - v2 - 2v - 3. Suppose -2d - 12 = -5d + t, 3d = 4t + 21. Is j(d) prime? False Let c(d) = -68d - 1. Let h = 0 - 2. Let x = h + 1. Is c(x) prime? True Is (18/14 - 1) + 143875/35 prime? True Let k(p) = 5p*2 + p + 5. Let r = 11 + 1. Let s be 1/(-4 - (-51)/r). Is k(s) a prime number? True Let o = 336 - -1867. Is o prime? True Is 1/((-1)/2)446629/(-58) a prime number? True Suppose 9n = -104 - 6826. Let k = n + 1635. Is k prime? False Suppose a = -r + 1270 + 4956, a + 3r - 6220 = 0. Is a a composite number? False Suppose 20w = 9740 - 760. Is w composite? False Let q be 4 + 4/4 + -3. Is (10 - 9)/(q/398) a prime number? True Let g(t) = t2 - 3t - 3. Let u be (-25)/(-3) + 10/(-30). Is g(u) composite? False Let p(u) = u*2 - 7u + 6. Let w be p(7). Suppose -3q - 15 = -wq. Let a = 126 - q. Is a prime? False Is 4/(-6) + 0 + (-1652275)/(-87) a prime number? False Let n(t) = 373t2 + 386t - 7. Is n(-8) prime? False Let h(l) = -9793l3 + l + 1. Let p be h(-1). Is (-22)/11 - -1p a composite number? False Suppose -3q + 2x = -11337, -3q = 4x - 10054 - 1283. Is q prime? True Let x(z) = -z*2 + 13z + 6. Let g be x(13). Suppose -3l - 2620 = -5w, -l = -w - gl + 496. Is w composite? False Let s(c) = 4c*2 - 4c - 35. Let p(v) = -v*2 - v + 1. Let j be p(-4). Is s(j) a prime number? False Let z(d) = -2d*3 + 4d*2 + 45d - 15. Is z(-6) a prime number? False Let j(d) = -2d - 30. Let z be j(-12). Is z/(120/(-8972)) + 4/10 a composite number? False Let w = -35 - -38. Is ((-15)/6 + w)3106 prime? True Suppose -2x + 2 = 4u - 10, -10 = 2u - 3x. Let d(c) = 292c3 + 2c*2 - 3c + 2. Is d(u) a composite number? False Suppose 331432 = 73x - 5x. Is x composite? True Let d be -3 + 8 + -3 - 10. Let v be (-2250)/d - (-1)/(-4). Suppose 2p - v = -5o - 2, 2p = -o + 59. Is o a prime number? False Suppose 0 = -3m + 3d + 192 + 132, 4d = m - 117. Let p = -16 - 36. Let k = m + p. Is k prime? True Suppose -5h - 3s + 2s = -523, s + 101 = h. Let y(j) = j + 7. Let q be y(-4). Suppose qo - 1091 = -h. Is o prime? False Suppose -3s = s - 8. Suppose 0 = -7l + sl + 15. Suppose lx = -103 + 496. Is x composite? False Is (3790(0 + 6/12))/1 a prime number? False Suppose 5q - 14 = -9. Let t be q/(-4 - 4214/(-1054)). Let n = -326 - t. Is n a composite number? True Suppose -4w + 24808 = 4n - 0n, -2n - 5w + 12419 = 0. Is n a composite number? False Let x(s) = -264s + 59. Is x(-13) a composite number? False Suppose -23 = -4g - 0g + 3u, 0 = g + 3u - 2. Suppose 10835 = gi - 2400. Is i prime? True Let a = -32 + 35. Suppose 0 = -ab - 2m + 756 + 911, -2b + 1124 = -5m. Is b prime? True Let b(c) = -21c3 - c2 + 1. Let n be b(1). Let k = -28 + n. Let z = -27 - k. Is z a prime number? False Is 1428828/60 + (-16)/(-20)-1 a composite number? False Suppose -7z + 65276 + 489 = 0. Is z a composite number? True Suppose 4r - 3r = 4. Suppose -rp - 4y = -756, y = 5p - 2y - 961. Is (6 + -4)/(2/p) composite? False Let g = 7171 + -10299. Let p = 4489 + g. Is p prime? True Let q = -4 + 5. Suppose -4o + 4a - 3 - q = 0, 2a - 20 = -4o. Suppose oz + 598 = 2g + z, 4g = -5z + 1160. Is g a prime number? False Is (-82)/4(-3)/(6/44) a composite number? True Suppose 168v - 173v = -14705. Is v composite? True Let d(h) = -3h*3 + 2h*2 + 4h + 2. Let r(c) = -3c3 + c + 5c*3 - 3c*3. Let x(z) = d(z) + r(z). Is x(-3) a prime number? True Is 1/((25/(-23095))/(-5)) composite? True Is (1 - 2)/((-14)/121254) a composite number? True Let z = -8716 + 12315. Is z a prime number? False Let q be (-3)/(1 - 144/145). Suppose 5x - 4040 = -0x. Let s = x + q. Is s composite? False Let l(g) = g2 - 6g + 6. Let x be l(-5). Let p = x + 238. Suppose -4z = -17 - p. Is z a composite number? False Suppose -9 = 3n, 0 = 2f - 4n - 938 - 1376. Is f composite? False Let c(s) = 90s - 43. Let m(o) = -o2 + 9o - 1. Let v be m(8). Is c(v) composite? False Let x = -17 - -17. Let v be -1 - 0 - (0 + x). Let p(k) = -161k3 + k2 + 2k + 1. Is p(v) composite? True Let f = -282 - -406. Let l = f - -154. Suppose -20 - l = -z. Is z composite? True Let b(u) = 5u2 + 0u*2 + 11u + 3 - 3u + 0u*2. Let a(x) = -6x*2 - 8x - 3. Let t(c) = 4a(c) + 5b(c). Is t(6) a prime number? False Suppose 5k = g + 2k + 213, -1150 = 5g + 2k. Suppose -6z = -2062 - 272. Let p = g + z. Is p a composite number? True Suppose n - 3b = 5984, 10n = 13n + 2b - 17941. Is n prime? True Let q(z) = -3z - 5. Let f be q(-3). Suppose -fh + 4 = -0h. Suppose 4v - 856 = 3o, o + h + 3 = 0. Is v prime? True Suppose 3x = -4m - 38, -x + 5x - 3m = -59. Let y(f) = f + 18. Let v be y(x). Is (10/15)/(v/678) composite? False Let n = -45438 + 97189. Is n a composite number? True Let q(t) = -1922t3 - 4t*2 - 3t. Is q(-1) a prime number? False Is ((-16)/((-96)/(-772182)))/(-3) a composite number? False Let f be 1102/5. Let r be (-10)/f(-12)/5. Is ((-159)/r)/(2/(-4)) a composite number? False Let z(v) be the second derivative of -v7/840 - v6/90 + v5/40 + v4/6 + v3/6 - 2v. Let u(a) be the second derivative of z(a). Is u(-5) composite? True Suppose 0 = 5i + 4s - 2, -5i - 2s = -4i - 4. Is (-669 + -2)i/2 composite? True	{ "pile_set_name": "DM Mathematics" }
divided by o? 11 Suppose -q + 0q + 67 = 4a, -3q + 5a + 235 = 0. Calculate the remainder when q is divided by 19. 18 Suppose -4t + 3v - 4v + 380 = 0, 0 = -5t + 5v + 450. Calculate the remainder when t is divided by 14. 10 Suppose l - 2z = -4, -3l - 6z = -8z - 4. Let b(n) = 20n*2 - 2n + 1. What is the remainder when b(1) is divided by l? 3 Let r = 88 - 63. Suppose 1 + 0 = -y, 5y = m - 15. Calculate the remainder when r is divided by 135/m + (-1)/(-2). 11 Suppose 5v - 9 - 26 = 0. Let a = v + -6. What is the remainder when a is divided by 1? 0 Let j = 2 + -8. Let n be (j/(-10))/((-1)/(-5)). Let z = 0 + n. What is the remainder when 9 is divided by z? 0 Let a = -85 - -179. What is the remainder when a is divided by 19? 18 Suppose -4t - 10t + 826 = 0. What is the remainder when t is divided by (6/(-4))/((-1)/10)? 14 Let j = 131 - 64. Suppose 0 = -2g - o + 3o + 26, -3o = 4g - 80. Calculate the remainder when j is divided by g. 16 Let w be 2/(-4)-6 - 0. Let i be ((-6)/w)/((-2)/3). Suppose -44 = b - 5b + 2o, 2b - 18 = io. Calculate the remainder when b is divided by 7. 5 Suppose -2j = -5p - 0 - 7, 0 = -5j + 2p + 28. Let o = 4 - 2. Suppose -oq = -q - j. Calculate the remainder when 11 is divided by q. 5 Suppose -4b + 2z + 40 = -6, 15 = b + 3z. What is the remainder when 34 is divided by b? 10 Let a(b) be the second derivative of -b4/12 + 5b3/6 - b2 - 2b. What is the remainder when 6 is divided by a(2)? 2 Let g = -52 + 82. What is the remainder when g is divided by 11? 8 Suppose 4h - l = 109, 3l - 6l = 4h - 105. What is the remainder when h is divided by 7? 6 Let l be ((-4)/10)/(2/10). Let o = 0 - l. Let i = -1 + 6. Calculate the remainder when i is divided by o. 1 Suppose 3n + 0t = -3t, -3n + 5t + 24 = 0. Let x = -72 - -76. What is the remainder when x is divided by n? 1 Suppose -2o + 9 + 27 = 4t, -t = -2o + 26. Suppose -u + 4c - 3 = 0, u + 0c = 2c + 3. What is the remainder when o is divided by u? 5 Let s(z) = 4z - 52. Calculate the remainder when s(21) is divided by 7. 4 Suppose m + 0m - 7 = 0. Let r(i) = 2i2 - 8i + 2. Let v be r(m). Let w = v - 22. What is the remainder when w is divided by 8? 6 Let a = -69 - -133. Suppose -5u = -3j - a, -u + 4j + 3 = -20. Calculate the remainder when 21 is divided by u. 10 Let m(j) = -3j - 20. What is the remainder when 47 is divided by m(-11)? 8 Let k = -9 + 29. What is the remainder when k is divided by 7? 6 Suppose -2 + 7 = l. Suppose -4t + 4m = -80, 2m - 44 = lt - 129. Calculate the remainder when 44 is divided by t. 14 Let g(s) = -s + 4. Suppose -5a - 15 = 10. Calculate the remainder when g(a) is divided by 4. 1 What is the remainder when (-8)/(-32) + (-438)/(-8) is divided by 14? 13 Let h = 2 + 0. Suppose 3b - 40 = -hb. What is the remainder when 21 is divided by b? 5 Suppose 0 = g - 3f - 50, 0g + 4f + 250 = 5g. What is the remainder when g is divided by 26? 24 Calculate the remainder when (-1448)/(-10) + 3/15 is divided by 37. 34 Suppose -4g + 9 = -11. Suppose -2p - g - 6 = u, 4u = -2p - 50. What is the remainder when 24 is divided by (-1)/(14/u + 1)? 11 Suppose -r = -4o + 24, 0o - 24 = -4o - 4r. Calculate the remainder when (-340)/(-12) + 4/o is divided by 8. 5 Let a(m) = 4m - 1. Calculate the remainder when 105 is divided by a(7). 24 Let p = 129 + -95. What is the remainder when p is divided by ((-2)/4)/((-1)/24)? 10 Let s = -49 + 50. What is the remainder when 3 is divided by s? 0 Let q(l) = -5l - 6. Calculate the remainder when q(-15) is divided by 24. 21 Let g = 9 - -23. What is the remainder when g is divided by 7? 4 Let d = -1 + 89. What is the remainder when d is divided by 15? 13 Suppose -3x + 7x - 20 = 0. Let h be 1/((6/(-34))/(-3)). Suppose h - 5 = 4b. Calculate the remainder when x is divided by b. 2 Suppose -5f + 3o = -f + 200, 4f + 3o = -224. Let r = f - -102. What is the remainder when r is divided by 13? 10 Let c = -15 - 12. Let f = -2 - c. What is the remainder when f is divided by 14? 11 Let d(y) = y + 7. Suppose 0 = 5w, 3f = -w - 5 - 7. Let l be d(f). Suppose 3m + h = 6h + 12, 0 = m - lh. What is the remainder when m is divided by 4? 1 Suppose -7f = 6f - 234. Calculate the remainder when f is divided by 5. 3 Let g(i) = -5i3 - i2 + 1. Let o be g(-1). Suppose -h = 4h - o. Calculate the remainder when h is divided by 1. 0 Let v = -5 - -9. Suppose 0s - s = 4g - 9, -2s + vg = -30. Calculate the remainder when (0 - 1)(-49 + 0) is divided by s. 10 Suppose -17 = -a + 4w, 3a - 152 = -a - 5w. What is the remainder when 17 is divided by 2/11 - (-192)/a? 5 Let o(l) = -2l - 11. Let x = 9 - 17. Let v = 6 - 3. What is the remainder when o(x) is divided by v? 2 Suppose h - 4z + 2 = 0, -3h + 6h - 33 = -z. What is the remainder when 27 is divided by h? 7 Suppose 19 = 6u - 29. Calculate the remainder when 21 is divided by u. 5 Let y be (2/(-5))/((-3)/615). Calculate the remainder when y/8(5 + -1) is divided by 14. 13 Suppose 39 = 2g - 3. What is the remainder when g is divided by 4? 1 Suppose 0 = -z - o + 29, 2z - 4o - 24 = 28. Let f(h) = -h*3 + 6h*2 - 6h + 2. Calculate the remainder when z is divided by f(4). 8 Let i(k) = -4k3 + k - 1. Let a be i(1). Let b be (-40)/6 - a/(-12). Let z(v) = v3 + 7v*2 - 2v - 3. Calculate the remainder when 21 is divided by z(b). 10 Let j = -14 - -19. What is the remainder when 19 is divided by j? 4 Let p(i) = i*3 - 7i*2 + i - 6. Let s be p(7). Let y(f) = 28f*2 - f. Suppose 44b - 312 = 38b. What is the remainder when b is divided by y(s)? 25 Let s = 15 - -7. Let b be 4/(2(-2)/(-16)). Let w = b - 4. What is the remainder when s is divided by w? 10 Suppose -5a + 3t = -t - 123, a - 39 = -4t. Calculate the remainder when a is divided by 14. 13 Suppose -x = -3x + 4. Suppose -8l + 37 = -3l - 4j, -3l + 21 = -xj. Suppose ly = 106 + 9. Calculate the remainder when y is divided by 6. 5 Suppose 85 + 0 = 5i. Suppose -5r + 5 = -3l - 25, 5r = 5l + 20. What is the remainder when i is divided by r? 8 Suppose 0 = -3h - 151 - 2. Let a = h + 73. Calculate the remainder when (a/(-33))/((-4)/114) is divided by 7. 5 Suppose 5 + 27 = 2w. Calculate the remainder when 29 is divided by w. 13 Let r(l) = 5l*2 + 1. Suppose 7g - 2g + 4 = -x, 2x - 2g - 40 = 0. Let c = 0 + x. Calculate the remainder when r(3) is divided by c. 14 Let v = 1 - -29. What is the remainder when 87 is divided by v? 27 Suppose 3i = -4 + 88. What is the remainder when 27 is divided by (0 - i/(-1))/2? 13 Let f(y) = -y*2 + 6y. Let x be f(5). Let a(u) = -u*3 + 5u2 + 3. Let b be a(x). Let r = b + 1. What is the remainder when 6 is divided by r? 2 Let y(t) = -t2 + 20t + 18. Calculate the remainder when y(16) is divided by 21. 19 Let r(l) = 3l - 36. Calculate the remainder when 52 is divided by r(18). 16 Let d = 161 - 127. Calculate the remainder when d is divided by 10. 4 Suppose 0 = 2r + 5w - 18, -r + 4w - 14 = -3r. Let s = 2 - r. Calculate the remainder when 17 is divided by 2(0 + s + 0). 5 Suppose 0 = 4w - w - 24. Suppose -55 = 3s - ws + 4i, -s = -4i + 5. What is the remainder when s is divided by 8? 7 Let v = 56 + -46. Calculate the remainder when v is divided by 4. 2 Let h = -28 - 44. Let v = 109 + h. What is the remainder when v is divided by 13? 11 Suppose u + 15 = 26. Calculate the remainder when u is divided by 7. 4 Suppose -3 + 12 = l. What is the remainder when l is divided by 3? 0 Calculate the remainder when 6/(-16)2 - (-175)/4 is divided by 23. 20 Suppose 4w - 281 = -29. What is the remainder when w is divided by 22? 19 Let r = 34 - 9. Suppose 4x = -x + 295. Suppose 0 = 4i + 16, -3f + x = -3i - 2i. What is the remainder when r is divided by f? 12 Let l be ((-2)/(-3))/((-4)/(-6)). Calculate the remainder when 50 is divided by (1 - 2) + (15 - l). 11 Let w = -1 + 12. Suppose 2u - 9 - w = 0. Suppose 0 = -q + 5l + 3, 0q - 3q - 5l = -69. Calculate the remainder when q is divided by u. 8 Let s be (-18)/(-12)(-8)/(-6). What is the remainder when (1/2)/(s/120) is divided by (-16)/((-1 - -3) + -3)? 14 Suppose 5b - 6b = -1. What is the remainder when 29 is divided by (3(7 + -2))/b? 14 Suppose 49 = 5*c - 181. Let k = c - 30. Cal	{ "pile_set_name": "DM Mathematics" }
n divisor of 98 and 4655? 49 What is the highest common factor of 135 and 81? 27 What is the greatest common divisor of 220 and 40? 20 Calculate the highest common divisor of 132 and 11748. 132 Calculate the greatest common divisor of 336 and 714. 42 Calculate the highest common divisor of 594 and 3402. 54 What is the highest common factor of 38 and 3743? 19 Calculate the greatest common factor of 50 and 3950. 50 What is the greatest common divisor of 153 and 17? 17 Calculate the highest common factor of 890 and 170. 10 What is the greatest common factor of 20 and 95? 5 Calculate the highest common divisor of 3 and 291. 3 What is the greatest common factor of 1495 and 130? 65 What is the greatest common factor of 1862 and 14? 14 What is the highest common factor of 4171 and 86? 43 Calculate the greatest common divisor of 670 and 70. 10 What is the greatest common divisor of 390 and 22685? 65 Calculate the greatest common factor of 8080 and 16. 16 Calculate the highest common factor of 78 and 819. 39 What is the greatest common divisor of 500 and 20? 20 What is the greatest common divisor of 5 and 2615? 5 What is the highest common factor of 18 and 456? 6 Calculate the highest common factor of 1183 and 91. 91 Calculate the greatest common divisor of 113 and 3051. 113 Calculate the greatest common divisor of 188 and 10199. 47 What is the greatest common factor of 1419 and 2112? 33 Calculate the highest common divisor of 468 and 72. 36 Calculate the highest common divisor of 59 and 531. 59 What is the highest common divisor of 228 and 408? 12 What is the highest common factor of 624 and 78? 78 Calculate the highest common factor of 8901 and 621. 207 What is the greatest common factor of 45 and 7515? 45 What is the highest common divisor of 8528 and 41? 41 Calculate the greatest common divisor of 24 and 48. 24 Calculate the highest common factor of 62 and 7750. 62 What is the greatest common divisor of 93 and 1581? 93 What is the highest common divisor of 176 and 77? 11 What is the greatest common divisor of 8267 and 63? 7 Calculate the greatest common factor of 63 and 549. 9 What is the highest common divisor of 47603 and 526? 263 What is the highest common divisor of 304 and 19? 19 Calculate the greatest common divisor of 2990 and 130. 130 Calculate the greatest common factor of 1785 and 4590. 255 Calculate the highest common divisor of 105 and 70. 35 Calculate the highest common divisor of 3237 and 39. 39 Calculate the highest common factor of 272 and 480. 16 Calculate the greatest common factor of 60 and 1590. 30 What is the greatest common divisor of 10 and 1730? 10 Calculate the highest common divisor of 84 and 483. 21 What is the greatest common divisor of 47 and 1927? 47 What is the highest common divisor of 515 and 5? 5 Calculate the highest common divisor of 5085 and 226. 113 What is the highest common divisor of 26 and 234? 26 What is the highest common factor of 725 and 100? 25 Calculate the highest common factor of 90 and 2880. 90 What is the highest common factor of 11 and 1243? 11 Calculate the highest common divisor of 140 and 189. 7 What is the highest common divisor of 39 and 1157? 13 What is the greatest common factor of 5376 and 16? 16 Calculate the greatest common factor of 1295 and 77. 7 What is the highest common factor of 2249 and 39? 13 What is the greatest common factor of 2260 and 120? 20 What is the greatest common factor of 219 and 6? 3 What is the highest common divisor of 2981 and 55? 11 What is the highest common divisor of 46164 and 12? 12 Calculate the highest common divisor of 80 and 12. 4 What is the highest common divisor of 88 and 4048? 88 Calculate the highest common factor of 2327 and 26. 13 Calculate the greatest common divisor of 2167 and 11. 11 What is the greatest common divisor of 78 and 3159? 39 Calculate the greatest common factor of 513 and 19. 19 What is the highest common factor of 50 and 8? 2 Calculate the greatest common factor of 295 and 177. 59 What is the highest common divisor of 127 and 5969? 127 What is the greatest common divisor of 2073 and 3? 3 What is the highest common factor of 13044 and 60? 12 Calculate the highest common divisor of 8 and 776. 8 What is the highest common divisor of 60 and 1880? 20 What is the greatest common factor of 4 and 6? 2 Calculate the greatest common divisor of 115 and 7705. 115 What is the highest common factor of 156 and 221? 13 Calculate the highest common divisor of 4410 and 90. 90 What is the highest common factor of 112 and 80? 16 Calculate the highest common divisor of 1678 and 12. 2 What is the highest common divisor of 33 and 1089? 33 What is the greatest common factor of 1332 and 180? 36 Calculate the highest common divisor of 136 and 17. 17 Calculate the highest common factor of 72 and 36264. 24 Calculate the greatest common factor of 121 and 209. 11 Calculate the highest common divisor of 102 and 6. 6 What is the greatest common factor of 697 and 1271? 41 What is the highest common factor of 1420 and 5396? 284 Calculate the greatest common divisor of 42672 and 21. 21 Calculate the greatest common divisor of 364 and 156. 52 Calculate the highest common factor of 780 and 1310. 10 Calculate the greatest common factor of 2758 and 378. 14 What is the highest common factor of 70 and 1890? 70 What is the highest common divisor of 2592 and 6264? 216 Calculate the greatest common divisor of 16 and 688. 16 Calculate the greatest common divisor of 20 and 172. 4 What is the greatest common divisor of 6714 and 72? 18 Calculate the greatest common factor of 69 and 1035. 69 Calculate the greatest common divisor of 696 and 28304. 232 Calculate the greatest common divisor of 120 and 3880. 40 Calculate the greatest common factor of 53 and 848. 53 Calculate the highest common factor of 1071 and 441. 63 Calculate the greatest common factor of 16 and 112. 16 Calculate the greatest common factor of 315 and 10. 5 What is the highest common divisor of 810 and 990? 90 Calculate the highest common divisor of 40 and 10280. 40 Calculate the greatest common factor of 575 and 175. 25 What is the greatest common factor of 12072 and 8? 8 Calculate the highest common factor of 621 and 5727. 69 Calculate the highest common factor of 400 and 32. 16 What is the highest common divisor of 962 and 74? 74 What is the greatest common factor of 102 and 306? 102 What is the highest common divisor of 26 and 806? 26 Calculate the greatest common divisor of 256 and 28. 4 Calculate the greatest common divisor of 2756 and 52. 52 Calculate the highest common factor of 143 and 275. 11 Calculate the greatest common divisor of 1267 and 8145. 181 What is the highest common factor of 154 and 110? 22 What is the highest common divisor of 839 and 1? 1 Calculate the highest common factor of 111 and 444. 111 What is the greatest common factor of 462 and 1722? 42 What is the greatest common divisor of 104 and 572? 52 Calculate the highest common divisor of 9261 and 189. 189 Calculate the greatest common divisor of 13464 and 153. 153 Calculate the greatest common divisor of 2147 and 113. 113 Calculate the highest common divisor of 12 and 266. 2 What is the highest common divisor of 30 and 855? 15 Calculate the greatest common factor of 850 and 34. 34 What is the greatest common divisor of 74 and 4107? 37 Calculate the greatest common factor of 53718 and 42. 42 What is the highest common factor of 186 and 1209? 93 Calculate the greatest common divisor of 672 and 42. 42 Calculate the highest common divisor of 1955 and 85. 85 What is the highest common divisor of 47 and 752? 47 Calculate the highest common factor of 9648 and 12. 12 Calculate the greatest common factor of 8 and 100. 4 Calculate the highest common factor of 24 and 1656. 24 Calculate the highest common divisor of 40 and 1160. 40 What is the highest common factor of 7 and 161? 7 Calculate the greatest common factor of 219 and 237. 3 Calculate the highest common factor of 168 and 12. 12 What is the highest common divisor of 338 and 78? 26 Calculate the greatest common divisor of 135 and 774. 9 What is the highest common factor of 1854 and 18? 18 What is the highest common factor of 14931 and 54? 27 Calculate the highest common divisor of 217	{ "pile_set_name": "DM Mathematics" }
/10 Let q = -27693 - -27876. Which is smaller: q or 2746/15? q Suppose 4a - 48n = -53n + 30, 3a = -5n + 30. Which is bigger: 13/49 or a? 13/49 Suppose 0 = 5k + 125x - 128x + 4110, -5x = 5k + 4070. Is k at most -822? False Suppose 0 = 4b + 3x - 4x, -3b + x = 1. Let q be (10/5 + 0)/b. Suppose i = -2r - 21, i = -i - q. Which is bigger: -13 or r? r Let p be 141 - -3733 - (3 - 2 - -14). Is 3869 greater than or equal to p? True Let g be (570/(-75) - -71) + (-3660)/25. Is g greater than or equal to -146? False Let k = 5.646 - 1223.646. Is k >= 0.2? False Let g = -821 + 1081. Let b = g - 260. Which is greater: b or -99? b Suppose 316722 = 24q + 274q + 83090. Is 8610/11 smaller than q? True Let o = 1859.9 - 1860. Is o greater than -4172? True Let x = 30641 - 30613. Let q be 6/(-4)8/30. Which is smaller: x or q? q Let b be ((-3445)/(-78))/(2/(-3)). Let t = -155/4 - b. Are t and 28 equal? False Let p(w) = -7w2 + w - 1. Let s = -118 + 119. Let x be p(s). Let z be (-4)/6 - 19/3. Is z smaller than x? False Let g be (2 + -47)((-138)/(-30) - 5). Suppose -20i - g = -38. Let s = -5735/24 - -239. Is i > s? True Let m(u) = -10u - 205. Let f be m(-26). Let h = 63 - f. Which is greater: h or 102/11? 102/11 Let x be 13/(-195)-165 - 621. Do -361/7 and x have different values? True Suppose 0 = -5l + 3u, 1 + 13 = -2l + 4u. Let o be 264/(-42) - -6 - (-2)/7. Suppose -2x - x + 9x = o. Which is bigger: l or x? l Suppose 134 = -5u + 4t, -4u - 11 = -3t + 96. Which is greater: u or -49? u Let d = -2404 - -2404. Which is smaller: 1/2580 or d? d Suppose 0 = k + 4r + 10, -r - 3 = -0r. Suppose -s = -f - k + 4, -3f = -5s - 14. Which is greater: -6/11 or f? -6/11 Suppose -17k = -3h - 22k - 1164, 2h = k - 776. Let y = 388 + h. Is y not equal to 1/232? True Let f = -164 + 468. Let v = 306 - f. Which is bigger: v or 2.1? 2.1 Suppose 0 = -67k + 425 - 1162. Which is greater: -109/9 or k? k Suppose -1558i + 1559i + 4o + 3517 = 0, -4i - 3o = 13964. Which is bigger: i or -3486? i Let t = 449 + -897. Which is smaller: -451 or t? -451 Suppose 0 = -4x + 4t - 3328, 76t - 74t = -3x - 2496. Is x less than or equal to -832? True Let w be (2/2)/((-44)/8). Let s = 164 - 273. Let d = 108.92 + s. Is d less than w? False Let m be (23/(-2) + -2)2/(-3). Suppose 0 = -x + 4j + 27, -4j + 25 = -mj. Is 7 < x? False Let o = 4364 + -4365. Let b(j) = -j2 - 7j + 2. Let u be b(-4). Which is bigger: o or u? u Let a = 234594/59 - 3976. Which is greater: 5 or a? 5 Let l be (-636)/(-1166) + 27615/11. Is 2510 at most l? True Let f = 19479 + -17873. Which is smaller: 1608 or f? f Let u = -2687.34 - -2671. Let b = 15 - 15.34. Let n = u - b. Is -3/4 < n? False Suppose 28 = 4j, -76f = -75f - 4j + 27. Are -30/221 and f equal? False Let v = -400.625 + 429. Let p = 0.525 + v. Let k = p - 29. Which is smaller: k or 55? k Suppose -8t - 7t = -30. Suppose -4z - f = -25, z + f + tf - 9 = 0. Suppose -2y + 18 + z = 0. Which is greater: y or 6? y Let w = 3115 + -43605/14. Is w smaller than -0.6? False Let x(m) = 54m*2 + 213m - 27. Let w be x(-4). Which is smaller: -716/47 or w? -716/47 Let p(n) = -n*3 + 4n*2 + 14n - 9. Let k be p(6). Let i be (-5(-176)/(-55))/((-9)/1). Is i smaller than k? True Let a = -0.1 + 1.1. Suppose -i - 17 = -5t, 10i + 5t - 32 = 6i. Suppose 3c - 4q - 6 = -q, iq + 18 = -3c. Which is smaller: c or a? c Let j(l) = -14l*2 + 10l. Let t be j(2). Let r be (-1767)/t - 12/(-18). Let k = r - 50. Do k and 2/3 have different values? True Let l(t) = 5t2 + 162t + 60. Let v be l(-32). Is 322 at least v? True Let t be (-5160)/387-31/(-2). Which is greater: 128 or t? 128 Let s(b) = 647b - 163. Let d be s(-1). Is d smaller than -4047/5? True Let n be 2/6 + 93/(-9). Suppose -15x + 21x = -36. Let y be ((-19)/(-10) + (-2)/5)x. Which is smaller: y or n? n Let v be 5/102(-1 + -1). Let r be (8/(-20))/v4. Is 1/5 equal to r? False Let m be 8/63/310. Let o(x) = -795x + 44521. Let w be o(56). Which is smaller: m or w? m Suppose 90 + 220 = -m. Suppose 190g + 15017 + 38886 + 5187 = 0. Which is smaller: m or g? g Let i be 362/(-5) - (-2 - (-56)/35). Let b = 65 + i. Let s be (92/30 + -3)/(b/(-777)). Which is smaller: s or 7? 7 Let n = -11721 - -11674. Suppose -2b - 50 = -b. Which is smaller: b or n? b Let l be (4 + -1 - 10) + 5768/(-4). Is l < -1448? True Let y = -19290 + 19293. Let n be 2/(-11)(14 - 7). Which is smaller: y or n? n Suppose 2 - 14 = -4n, -5x - 2n = -61. Suppose 6 = -10h + xh. Suppose -o - 1 = 2u - 2, -o - h = -5u. Is 3/29 bigger than o? True Let c = -66 + 40. Let x = 29 + -28. Which is smaller: c or x? c Let d(i) = -71i - 2. Let n be d(2). Let s be ((-22)/1 - -2)(44 - (-1470)/(-40)). Which is smaller: s or n? s Let u(b) = 16b*3 - 8b + 8. Let v be u(2). Let z = v - 122. Suppose -2f - 8 = 4s, -10 = 4f - 3s + 5s. Is z bigger than f? False Let a = -4106 + 4106.13. Which is smaller: a or -99? -99 Let a(v) = v3 + 232v - 277v + 1 - 3v*2 - 9v*2. Let j be a(15). Let w be (-4)/(-7)30/8. Is j <= w? True Let z = 90357646303/80051 + -1128751. Which is smaller: -1 or z? -1 Let l = -378 + 524. Let w = 114 - l. Are w and -32 equal? True Let w(y) = y*3 + 66y*2 - 214y - 354. Let v be w(-69). Is 1421/11 > v? True Suppose 151w - 73w = 73w - 5. Which is smaller: -55/179 or w? w Let m(z) = 3z*2 - 13z*2 - 12z*2 + 2 - 8z*2 + 56z + z*3. Let y be m(28). Which is bigger: y or -14? y Suppose -q + 3 = 150. Let n be -2 + -1q/(-15). Let x(b) = b*3 - 37b*2 + 335b + 113. Let a be x(18). Which is bigger: a or n? n Let z = -29104 - -29045. Is -72 less than or equal to z? True Let z be 5 + ((-68)/408)/(2/(-12))-5. Which is bigger: z or -3/1082? z Suppose 0 = -4i + 2p + 260, -33i + p = -36i + 185. Let u = -67 + i. Are u and -27/10 equal? False Let t = -4296 - -4410. Is -0.5 less than t? True Let k = -11785 + 11786. Let z = 0 - -3. Let q = -3.8 + z. Which is smaller: k or q? q Let r = 1 + 9. Let c = -489 + 1601. Let l = 1123 - c. Are l and r nonequal? True Suppose h + 5f + 19 + 31 = 0, 3h + 4f + 106 = 0. Let n be (-856)/(-2354) + 356/(-11). Which is smaller: n or h? n Suppose -31t = -30t - 5. Suppose 0 = 5l - v - 1, tl = -v + 2 + 7. Suppose 9 = 5o - l. Is -1 smaller than o? True Let c be -2((-382)/(-68) + (-2)/17). Which is greater: c or -15? c Let r(a) = -20a - 9. Let v be r(0). Let d be -61/8 - v/12. Which is greater: 9/38 or d? 9/38 Suppose -3d + 2 = 53. Let o be (1131/406)/((-4)/24). Let w = d - o. Is -73 > w? False Let b = -0.4019 - -0.2019. Is 1284 greater than b? True Let i = -72 - -70. Let t be (-28)/175i/(-12). Let o be (1 + -1)/(15 - 13). Is o less than or equal to t? False Let w = 14768 - 15271. Which is smaller: -2 or w? w Let g = -63 + 65. Suppose d + gd = 12. Suppose 0u - 3u - 3 = dl, 2l + 12 = 2u. Is 3 at least as big as u? True Let q = 8935499/1050 + -8510. Is 0 bigger than q? True Let q = 23474.9 + -23491.8. Let o = 0.2 - 0.2. Is o != q? True Let j = -0.1277 + -512.8723. Let d = j - -512.9. Do d and 2.7 have the same value? False Suppose 2d + 4v - 261 = 319, -5d - 4v + 1474 = 0. Suppose -44772 = -218s + 19974. Is d <= s? False Let d(y) = 179y + 2147. Let n be d(-12). Which is smaller: n or -5/98? n Let j = -325 + 121. Let n = j - -204. Which is greater: 33 or n? 33 Let p be 5/(258/120) + 2. Are 74/19 and p nonequal? True Let s = -8 + 14. Let l be (150/(-100))/(2/42). Let b = -27 - l. Is s >= b? True Let a = -2.329 + 1490.329. Which is greater: a or -1/4? a Suppose 5g = -11g + 6g. Suppose g = -11u + 4u. Which is smaller: 2/3 or u? u Suppose 5s - 2r = -9s - 164, -4s - 19 = 5r. Is s < -186/19? True Let f be 12 - (3375/(-10))/(-25). Is f smaller than -459? False Let d = -43 - -91. Let q = 220532 - 220484. Is q >= d? True Let s be ((-1)/(-639))/((21/1372)/3). Let y = s - 6/71. Which is bigger: 0.34 or y? 0.34 Suppose 0 = 3s - 2s. Let i = 72 + -73. Let r be ((-3)/(-8)-1)/i + 0. Is r <= s? False Suppose 4a = 20, 0 = 42n - 37n - 2a - 315. Which is greater: n or 86? 86 Let m be 5/(-3)(-384)/80(-1562)/(-4). Is m equal to 3122? False Let n be 76/52*537 - (-30)/195. Is n bigger than 781? True Let r = -2361 + 26047/11. Is -2/15 less than r? True Sup	{ "pile_set_name": "DM Mathematics" }
Let m = 25.11 - x. Let i = m + -0.33. What is i rounded to the nearest integer? 21 Let a = 2272764 + -1065889. Let v = a - 1206869.40689. Let g = v - 5.6. Round g to 3 decimal places. -0.007 Let p = 34296.000036394 - 34296. What is p rounded to 7 dps? 0.0000364 Let q = -1352 + 755.3. Let b = q - -565. Let s = -31.700253 - b. What is s rounded to 5 decimal places? -0.00025 Let t = 39 + -34. Suppose -3q + 549702 = -k, -tk + 366451 = q + q. Suppose 3416767 + q = 2m. Round m to the nearest 1000000. 2000000 Let a = 719362 + 156110. Let r = 49035 - 12507. Suppose -8g + a = -r. Round g to the nearest 10000. 110000 Let n = 579324 - 950439. Let c = 371114.829899 + n. Let u = -0.17 - c. Round u to 5 dps. 0.0001 Let g be 5/1152/(-10). Suppose 2q - r - 22 = q, -10r = 3q - 27. Let m be q/g - ((-1535986)/8 + -2). Round m to the nearest 10000. 190000 Let l = -7.7 - -11. Let r = l + 54.7. Let x = r - 57.999992. What is x rounded to 6 decimal places? 0.000008 Let z = 578.1 + -499. Let d = z - 85. Let b = d + 5.89999967. What is b rounded to 7 decimal places? -0.0000003 Suppose -2o = 4z + 806, 0o = -5z + o - 1004. Let h = z + 105. Let v be h/(-6)9225000. Round v to the nearest one million. 37000000 Let b(p) = -882p2 + 71p + 721. Let a be b(-12). Round a to the nearest one thousand. -127000 Let l = 41.976 + 0.024. Let g = l + -85. Let m = g + 43.195. Round m to two decimal places. 0.2 Let n(q) = 45476q3 - 12q*2 - 6q + 16. Let d be n(-6). Let r = d + 6413196. What is r rounded to the nearest 100000? -3400000 Let j = -430.72 - -1.72. Let a = j - -358.8. Round a to the nearest integer. -70 Let u = -8.74 - -2940.74. Let h = u + -2932.00004506. What is h rounded to six decimal places? -0.000045 Suppose 3d = -i + 116341, -37005 = -2d + 3i + 40563. What is d rounded to the nearest one thousand? 39000 Let j(w) = 2w + 50000008. Let f(m) = -5m - 150000022. Let z(b) = -4f(b) - 11j(b). Let y be z(0). Round y to the nearest one million. 50000000 Suppose -5i - 20 = 0, -4x = -5i - 1891 - 5481. Suppose -4t - 1838 - 619 = -z, 0 = -3t - 4z - x. Round t to the nearest 100. -600 Let d = 257006183140.6200464 + -257006685510. Let y = -502369 - d. Let v = -0.38 + y. Round v to 6 decimal places. -0.000046 Let c = 14427.06877 - 14427. Round c to three dps. 0.069 Let w = -5 + -8. Let p(n) = -n2 - 16n - 29. Let z be p(w). Suppose z = 6k - k, 90010 = 5d + 5k. Round d to the nearest 10000. 20000 Let p = -783 - -728. Let c = 58.63 + p. What is c rounded to one dp? 3.6 Let o = 119.258 - -68.236. Let u = 188 - o. Round u to one decimal place. 0.5 Let y = 21.071 + -21.117996. What is y rounded to 3 dps? -0.047 Suppose -4w + 3b - 79790 = -2b, -w - 4b = 19958. Let j = 29660 + w. What is j rounded to the nearest one thousand? 10000 Let n = 11.41198 - 0.05898. What is n rounded to the nearest integer? 11 Let j = 32.971 + -33. Let s = -7215 + 7215.028504. Let l = s + j. Round l to five dps. -0.0005 Let n = 59.36455709 - -27972.06201291. Let g = 28030.2 - n. Let d = 1.23 + g. What is d rounded to 3 decimal places? 0.003 Let w = -0.022394 - 2.529506. What is w rounded to one dp? -2.6 Let p = -194.7 + 194.80446. Round p to 2 dps. 0.1 Let c(q) = -572q*3 - 8q*2 + 24q + 940. Let x be c(29). Round x to the nearest one million. -14000000 Let o = -24 + 28. Suppose -6z = -oz - 59946. Let l = z - 19173. What is l rounded to the nearest 1000? 11000 Let j = 29799739.96000514 - 29799934.96. Let b = -1048 + 853. Let o = j - b. Round o to 6 decimal places. 0.000005 Let z = 214878 + -89078. Round z to the nearest one hundred thousand. 100000 Let t = -131 + -217. Let c = -13759123275.99999821 - -13759122928. Let h = t - c. What is h rounded to seven decimal places? -0.0000018 Let u = 86.4 + -66. Let q = -128.4 + u. Let x = q + 108.000000173. Round x to 7 decimal places. 0.0000002 Let p be (63/105)/((-3)/(-15)). Let o be (4 - p)1 - 194697/(-3). What is o rounded to the nearest 10000? 60000 Let o = 143.486 + -143. Let b = 0.5606 - o. What is b rounded to 2 dps? 0.07 Let g = -0.876 + 0.276. Let r = 10.7 + g. What is r rounded to 0 decimal places? 10 Let n = -411390 + 1470800. Suppose 5y + 4029405 = n. Let s be 4/(-24) - y/(-6). Round s to the nearest 10000. -100000 Let s = -85 + 73. Let d = s + 37. Let v = -236 + d. What is v rounded to the nearest 10? -210 Let d = -34557.81563 - -34558. Let o = 0.186 - d. What is o rounded to 4 dps? 0.0016 Suppose -4l + 5x + 4462063 = -7191512, -11653620 = -4l - 4x. Round l to the nearest one hundred thousand. 2900000 Let m = 0.32 - 9.32. Let p = 118 + m. Let f = -109.98 + p. What is f rounded to one decimal place? -1 Let h = -4433.90000037694 + 4433.9. What is h rounded to 7 dps? -0.0000004 Let j = -3 + 1.91. Let d = -212623 - -212621.90909. Let g = j - d. Round g to 4 dps. 0.0009 Let q = -7844 - -4558. Let o = 3287.441 + q. Let d = 1.4 - o. What is d rounded to 3 dps? -0.041 Let h = -91 + 135.7. Let d = h + -31. Let w = 13.700247 - d. Round w to 4 decimal places. 0.0002 Suppose 29h - 418940 = 23952573. Let j = h + -1371397. What is j rounded to the nearest 10000? -530000 Suppose 26431 = a + l - 4l, 5l = 0. Let w = -419 - a. What is w rounded to the nearest 1000? -27000 Let y be (2/16)/(2/32). Suppose m + 3089669 = 4r - 38620351, ym + 83419990 = -2r. What is m rounded to the nearest one million? -42000000 Let a = 3594.5 - 1184. Round a to the nearest ten. 2410 Let y = 3409869 + -1063138. Let k = y + -1271731. Round k to the nearest 100000. 1100000 Let w = -4.3266 + 4.32582612. Round w to four dps. -0.0008 Suppose -4i - 3j + 113 = 0, 0i = -4i - 2j + 114. Let c(q) = q - 19. Let x be c(i). Suppose k - xk + 566100 = 0. Round k to the nearest ten thousand. 60000 Let d(a) = a*3 - 2a*2 + 5a - 1. Let p be d(4). Suppose -2h - p = -63. Let k be (-20)/8(h + -33606). What is k rounded to the nearest 10000? 80000 Let j(y) = -33 + 298y + 46y - 50 - 30 - 167. Let d be j(20). What is d rounded to the nearest one thousand? 7000 Suppose 52336 = -5p - 56729. Let k = p + 31793. What is k rounded to the nearest one thousand? 10000 Let m = 1898225 + 906775. Round m to the nearest one hundred thousand. 2800000 Let f = -830 + 829.44. Let l = f - -0.54675. What is l rounded to 3 decimal places? -0.013 Let m = -106666026.0120229 + 106666014. Let p = m - 33.9879857. Let j = -46 - p. Round j to 6 dps. 0.000009 Suppose -5b + 69020 = 5o + 834875, -2 = -2o. Let f = 265372 + b. What is f rounded to the nearest ten thousand? 110000 Let g = -0.02802 + -0.0249. Let y = -6.28692 - g. Let q = 0.826 - y. Round q to 1 dp. 7.1 Let y = -3463 - -1782. Let c = -1681.00001149 - y. Round c to six dps. -0.000011 Let a = -13894030.42 + 13894020.11999857. Let z = -60 - -70.3. Let d = a + z. Round d to 7 decimal places. -0.0000014 Let z(b) = 8989b3 - 21b*2 - 36b - 96. Let y be z(-7). Round y to the nearest one hundred thousand. -3100000 Let m(s) = -2161s3 + 5s*2 + 8s - 10. Let v be m(-5). What is v rounded to the nearest one thousand? 270000 Let a = -114 - -156. Suppose 4r - a = u, 4r - 126 = 3u + 3r. What is u rounded to the nearest ten? -40 Suppose -254001 = 5j + 6z, -3j = -5z + 100850 + 51585. Round j to the nearest 1000. -51000 Let l = -483 - -330. Let t = -12777.88 + 12935. Let n = l + t. Round n to the nearest integer. 4 Let g = 0.0093 - 195.0093. Let k = g + 195.0155. Round k to 3 decimal places. 0.016 Let s = 0.39788 + 3688.00212. What is s rounded to the nearest 100? 3700 Let i = -819 + 818.99515. Let x = i - -0.56025. Round x to one dp. 0.6 Let o = -506.6 + 556. Let p = o - 51. Let y = p + 1.600295. What is y rounded to four dps? 0.0003 Let v = 7.7145 - 11.1342. Let n = 0.296 - 3.696. Let z = n - v. What is z rounded to 2 dps? 0.02 Let t = 16 + 39. Let w = t - 55. Suppose -5b + 6b + 23100000 = w. What is b rounded to the nearest one million? -23000000 Let g = -2 - -101. Let f = g + -77.99955. Let t = -21 + f. Round t to 4 decimal places. 0.0005 Let a = 20.2 - 28.9. Let h = a + 0.1. Let k = -52.1 + h. What is k rounded to the nearest 10? -60 Let y = 0.07971 + 376.02029. Let q = 395 - y. What is q rounded to the nearest integer? 19 Let l = 1486.134 - -8.266. What is l rounded to the nearest ten? 1490 Let m = -7517	{ "pile_set_name": "DM Mathematics" }
Which is the closest to -1/3? (a) -0.3 (b) -3/8 (c) -5 (d) 13/10 a Which is the nearest to 0.1? (a) -19/10 (b) 0.3 (c) 0.4 (d) 3/8 b What is the closest to 2 in 0.1, 5, -8.9? 0.1 What is the nearest to -6 in 7, -1/4, 3/2, 2? -1/4 Which is the closest to 2/5? (a) -10 (b) 0.5 (c) 15 b What is the nearest to 0 in -0.4, -5, -41? -0.4 Which is the closest to -210? (a) 1/20 (b) 2/13 (c) 1 a Which is the nearest to -0.1? (a) -956 (b) -0.8 (c) -2/15 c Which is the nearest to 36? (a) -2 (b) -5/2 (c) -122 a Which is the nearest to 0.5? (a) 1/4 (b) 4 (c) -4 a Which is the nearest to -3? (a) 0.4 (b) -0.2 (c) 0 b Which is the nearest to 5? (a) -5 (b) 5 (c) 1/5 (d) -263 b What is the closest to 0 in -1, 95, 4? -1 Which is the nearest to -1? (a) -0.24 (b) 1/11 (c) 0 (d) -5/4 d What is the nearest to -2 in 1/8, -2/13, 1.4? -2/13 What is the closest to 0.15 in -2/7, 0.2, 4, 1/2? 0.2 What is the nearest to -13 in 0.3, -0.11, -5? -5 What is the nearest to 1 in 7.9, -5, 1/8? 1/8 Which is the nearest to 2? (a) -10/9 (b) 3 (c) 4 b Which is the nearest to 1? (a) 0.1 (b) 5.7 (c) 0.5 (d) -1 c What is the nearest to -2 in -13, 11.4, 1? 1 Which is the nearest to -13.5? (a) 3 (b) 2 (c) -3 c Which is the closest to -2/5? (a) 0.3 (b) -4 (c) -0.2 (d) 1 c Which is the nearest to -0.4? (a) -25 (b) 2/21 (c) -0.5 c Which is the nearest to 2/3? (a) -1.2 (b) -3 (c) -2 (d) -0.5 d What is the closest to 2/7 in 0.2, -1/11, -3? 0.2 What is the closest to 1 in 9/19, 4, -2/5, -3? 9/19 Which is the nearest to -2/17? (a) 4 (b) 2/7 (c) -5 (d) 1/6 d Which is the closest to 1/13? (a) 2 (b) 1 (c) 5/8 c What is the closest to -2 in 0.2, -3, 2/5, -10? -3 What is the nearest to 4 in -1/4, 1/4, 5, -4? 5 What is the closest to 0 in 0, -1/3, -139? 0 Which is the nearest to 1? (a) -0.32 (b) 0.2 (c) 0 (d) 1/2 d Which is the closest to -1? (a) 0.5 (b) -0.22 (c) 15 (d) -1/2 d Which is the nearest to 0? (a) -2/11 (b) 1/7 (c) 1/18 c Which is the nearest to 6? (a) 2 (b) -0.4 (c) 1 (d) 3/40 a Which is the closest to -28? (a) 0.2 (b) 10 (c) 1 a Which is the nearest to 5? (a) -0.31 (b) -2 (c) 4 (d) 3 c What is the nearest to -48.1 in 3, 4, 2/9? 2/9 What is the closest to -0.05 in -26, 0.8, 2? 0.8 What is the nearest to -1/3 in 0.3, -0.5, 83? -0.5 Which is the nearest to -1? (a) -5 (b) -3 (c) 18 b What is the nearest to -1/3 in -0.5, 2, -626, -5? -0.5 What is the closest to 0.1 in 15, 0.2, 1/4? 0.2 What is the closest to -2 in -0.3, 3, -3/4, -4/7? -3/4 Which is the closest to -5/7? (a) 3 (b) -21 (c) -3 (d) 1 d What is the closest to 2/29 in 1, -4, -28, -2/3? -2/3 What is the closest to -2 in 0.09, 3/19, -5? 0.09 What is the nearest to 0.5 in 1/4, -2, -4, -0.21? 1/4 What is the closest to 0 in 1.39, 4/9, 0? 0 What is the nearest to -0.1 in 122, -3, -4, 0.5? 0.5 Which is the nearest to 1/6? (a) -37 (b) 2 (c) 1/5 c Which is the closest to 11/3? (a) -1/3 (b) 0.1 (c) -0.4 (d) -0.2 b Which is the nearest to -0.1? (a) 51 (b) -2 (c) 1/22 c Which is the closest to -1? (a) -0.2 (b) 65 (c) 3 a Which is the closest to 1/3? (a) 3.4 (b) -2 (c) -5 (d) -1 d What is the nearest to 5 in -4, -2, 2/7, 3/4? 3/4 Which is the closest to 6? (a) 2 (b) 0.5 (c) 4 (d) -0.3 c What is the closest to 2/3 in 6/13, 0.2, 0.05? 6/13 What is the closest to 5/6 in 2, -1, -2/11? -2/11 Which is the closest to 0.1? (a) 3 (b) 1/5 (c) 32 (d) -0.3 b What is the nearest to -2/7 in 0.2, -1, -2/23, 0.3? -2/23 Which is the closest to -5? (a) -596 (b) -3 (c) 0.4 b What is the nearest to 466/21 in -0.4, -3, 0.1? 0.1 What is the closest to 2/39 in 0.1, -1, 4/7, -8? 0.1 Which is the nearest to -2/9? (a) 2/9 (b) 13 (c) -6 a What is the closest to 8 in 5, 21, -0.5, -2? 5 What is the nearest to 0 in -1/3, 41, -0.4, 1/6? 1/6 Which is the nearest to 0? (a) 0 (b) 4 (c) 0.5 (d) 1 a Which is the nearest to -1? (a) -7 (b) -1/2 (c) 0.2 (d) 2/5 b What is the closest to 1 in 2/9, 4, 6/7? 6/7 Which is the closest to 1? (a) 2/17 (b) 2/315 (c) 8 a What is the closest to 0 in -2, 2/9, 218? 2/9 What is the nearest to 0.1 in 1, 22/3, -5, 4? 1 What is the closest to 0 in -881, 0.4, 5, -4/3? 0.4 What is the nearest to -1 in -0.2, -0.5, 154, 2/7? -0.5 What is the closest to 4 in 0.3, 2, -3/5, 11? 2 What is the nearest to 1/4 in 1/27, -0.4, 1/7, 9? 1/7 Which is the nearest to 2/9? (a) 2/9 (b) 2 (c) -130 a What is the nearest to 0 in -52, -1/5, 0.06? 0.06 Which is the closest to -1? (a) -4/7 (b) 2 (c) 3 (d) -0.74 d What is the closest to -1/3 in -2/9, 1/2, 18? -2/9 What is the closest to -1 in -0.061, -8, -5/6? -5/6 What is the nearest to 2 in -0.3, -0.02, -21? -0.02 What is the nearest to 1/5 in 0.1, -0.5, 16, 3? 0.1 Which is the nearest to 1? (a) -5 (b) 3 (c) 42 b Which is the closest to -2/9? (a) -3/4 (b) -0.26 (c) 4 (d) -0.25 d What is the nearest to -2 in -0.1, -1, -12, 3/5? -1 Which is the closest to -1/32? (a) -2/21 (b) -0.4 (c) -0.5 (d) -4 a Which is the closest to 1/4? (a) -1/5 (b) 1 (c) 0.5 (d) -10 c Which is the closest to -1/3? (a) 1/13 (b) -0.1 (c) 4 (d) -3/5 b What is the closest to 4/7 in -1/4, 4/9, 0.1? 4/9 What is the nearest to -2/5 in 2/5, 2, 2/9, -1? -1 Which is the closest to 1? (a) 0.04 (b) 5 (c) -1/9 a Which is the closest to 1? (a) -2/7 (b) 1 (c) 9 (d) -3 b What is the nearest to -3 in 4/9, 5, -3, -3/7? -3 Which is the closest to -0.1? (a) 1 (b) -0.1 (c) 0 (d) 6/11 b Which is the nearest to -1? (a) 0 (b) -10 (c) -12/7 (d) 0.2 c Which is the nearest to -2/5? (a) -3/4 (b) -9 (c) -2 (d) 4 a What is the closest to -4 in -2, -4, -1/2, 1/2? -4 What is the nearest to -1 in -0.02, 3, 1/3, -3? -0.02 What is the nearest to -1 in 1, -4/5, 2, 5? -4/5 Which is the nearest to 24/5? (a) -5/2 (b) -5 (c) 5 c Which is the nearest to -2/3? (a) -1/109 (b) 0.3 (c) -1/3 (d) 0.4 c Which is the nearest to 1? (a) 2/9 (b) -2/21 (c) 169/8 a Which is the nearest to 98.3? (a) -0.5 (b) -1/4 (c) 0 c What is the nearest to 0.2 in -0.3, 5, -12/17? -0.3 Which is the nearest to -1.8? (a) 2/3 (b) 5 (c) 0.6 c What is the closest to 3 in -1/6, 7, 2? 2 What is the nearest to -1/5 in 25/3, 0.4, 1/3, 0.04? 0.04 What is the nearest to -548 in -0.4, 0.06, -1/6? -0.4 Which is the closest to -6230? (a) -0.3 (b) 3 (c) -3 c What is the closest to 1 in 44, 4, -1/6, -1/3? -1/6 Which is the nearest to -1/2? (a) -2 (b) 2/7 (c) 1/21 (d) -4/5 d Which is the closest to 0? (a) -0.5 (b) -12 (c) -1 (d) -0.1 d Which is the nearest to 5? (a) 0.4 (b) 5 (c) 5.9 (d) -0.3 b What is the nearest to -2 in -4, 2.3, 0.5? -4 Which is the nearest to 8.1? (a) 0.4 (b) -5 (c) 2 (d) -1/4 c What is the nearest to 0.1 in 86, -0.4, -2? -0.4 Which is the closest to -1? (a) -1 (b) -4/5 (c) 0.5 a Which is the closest to 0? (a) 1 (b) 4/61 (c) -1/6 b What is the closest to -0.1 in -0.01, 0.5, -0.5? -0.01 Which is the nearest to -0.1? (a) 2/11 (b) 2/23 (c) 2/5 (d) -2/3 b What is the closest to -0.1 in 8, 4, -38? 4 Which is the nearest to 3? (a) -14 (b) -2/3 (c) 4 c What is the closest to 0 in 0.4, 4/5, -0.5, 4? 0.4 What is the nearest to -0.3 in -3/7, 2, 1.7? -3/7 Which is the closest to 6? (a) -3/4 (b) 0.3 (c) 13 (d) -4 b Which is the closest to 1? (a) -1 (b) -3 (c) 217 a What is the nearest to -2/3 in -0.06, -2, 2/5, -5? -0.06 Which is the closest to 2/21? (a) -0.3 (b) 0.1 (c) -1 (d) 2/19 b Which is the closest to -0.1? (a) 0.57 (b) -1/3 (c) 0.2 (d) 1/4 b Which is the closest to 1/3? (a) 2/5 (b) -2 (c) -3/5 (d) -1/5 a What is the closest to 2/7 in 48, 5/3, 5, 1/8? 1/8 Which is the nearest to -1/3? (a) 44 (b) 0 (c) 3 (d) -5 b Which is the nearest to 4? (a) -28/5 (b) -1/6 (c) -1/23 c Which is the nearest to -9? (a) -5 (b) -45 (c) -1 (d) -0.2 a What is the closest to -1 in 13, -1.3, 0.2, 0? -1.3 What is the nearest to 0.1 in -11, -3/8, 0.1, 1? 0.1 Which is the closest to 8? (a) -5 (b) -1/7 (c) -2/17 (d) 10 d What is the nearest to 0 in -0.1, -8, -0.4, -3? -0.1 What is the closest to 0.1 in -24, -5, -4? -4 What is the nearest to 2/5 in 1/4, 0.3, 0, -1/7? 0.3 Which is the closest to 2? (a) -2.8 (b) 4 (c) 0.1 c Which is the closest to 1? (a) -9 (b) -5 (c) -2 (d) 2/11 d Which	{ "pile_set_name": "DM Mathematics" }
the common denominator of -37/32 and 15/8. 32 What is the least common multiple of 1624 and 1015? 8120 Calculate the lowest common multiple of 21 and 939. 6573 What is the lowest common multiple of 203 and 1044? 7308 Calculate the common denominator of 73/32 and 45/16. 32 Calculate the lowest common multiple of 140 and 112. 560 Calculate the lowest common multiple of 11774 and 4. 23548 What is the common denominator of 87/68 and -63/20? 340 What is the common denominator of 197/660 and -31/780? 8580 Calculate the common denominator of -73/402 and 43/6. 402 Find the common denominator of -82/585 and -13/15. 585 What is the least common multiple of 726 and 20? 7260 Calculate the common denominator of -8/1111 and 2/99. 9999 Find the common denominator of -101/10 and 119/36354. 181770 What is the common denominator of -32/333 and -29/2664? 2664 What is the common denominator of 14/1375 and 27/875? 9625 What is the common denominator of 53/210 and -53/252? 1260 Calculate the least common multiple of 11 and 25. 275 Calculate the lowest common multiple of 1368 and 494. 17784 Calculate the lowest common multiple of 609 and 319. 6699 What is the lowest common multiple of 552 and 18? 1656 What is the common denominator of 35/256 and 39/256? 256 Calculate the lowest common multiple of 90 and 70. 630 Calculate the common denominator of -69/2698 and -1/8. 10792 Find the common denominator of 3/32 and 61/10. 160 Calculate the common denominator of -37/5408 and -17/7436. 59488 What is the lowest common multiple of 63 and 105? 315 Calculate the lowest common multiple of 496 and 88. 5456 What is the least common multiple of 83 and 5? 415 What is the common denominator of -14/75 and 71/315? 1575 Find the common denominator of 143/18 and -81/160. 1440 Calculate the common denominator of 10/387 and -85/6. 774 What is the least common multiple of 52 and 50? 1300 What is the smallest common multiple of 132 and 3? 132 What is the lowest common multiple of 3 and 3? 3 Calculate the smallest common multiple of 896 and 280. 4480 Calculate the least common multiple of 63 and 3753. 26271 Find the common denominator of 23/1350 and -71/175. 9450 What is the common denominator of -5/9 and 91/4? 36 Calculate the least common multiple of 4495 and 5. 4495 What is the least common multiple of 7 and 1300? 9100 Calculate the lowest common multiple of 15 and 375. 375 What is the least common multiple of 678 and 11? 7458 What is the common denominator of -75/122 and -11/76? 4636 What is the common denominator of -21/121 and -85/88? 968 Calculate the common denominator of -93/14 and 87/1388. 9716 Find the common denominator of 17/36 and -29/2186. 39348 What is the smallest common multiple of 28 and 4921? 19684 Calculate the lowest common multiple of 297 and 6. 594 Calculate the lowest common multiple of 963 and 963. 963 What is the common denominator of 61/5 and -71/338? 1690 Calculate the common denominator of -53/175 and -55/4. 700 What is the common denominator of 151/30 and 2/13655? 81930 What is the common denominator of 75/38 and -89/1116? 21204 Calculate the smallest common multiple of 21 and 14. 42 Calculate the smallest common multiple of 6 and 84. 84 Calculate the common denominator of -59/12 and -107/490. 2940 Find the common denominator of -46/9 and -29/349. 3141 What is the least common multiple of 6237 and 495? 31185 What is the common denominator of 67/75 and -17/810? 4050 Calculate the smallest common multiple of 48 and 14. 336 Calculate the common denominator of 151/66 and 27/22. 66 Calculate the lowest common multiple of 60 and 3642. 36420 What is the common denominator of 33/371 and -51/56? 2968 Calculate the common denominator of 43/22 and 29/8. 88 What is the lowest common multiple of 7336 and 11528? 80696 Calculate the common denominator of -113/100 and -19/40. 200 What is the lowest common multiple of 112 and 56? 112 Calculate the common denominator of -67/6 and 151/54. 54 Calculate the common denominator of -181/990 and 67/22. 990 Calculate the common denominator of 9/8 and 99/1198. 4792 What is the lowest common multiple of 7203 and 10290? 72030 What is the lowest common multiple of 799 and 9? 7191 Find the common denominator of -8/147 and -107/234. 11466 What is the smallest common multiple of 15 and 84? 420 What is the common denominator of 37/18 and -41/124? 1116 What is the least common multiple of 414 and 1458? 33534 Calculate the smallest common multiple of 60 and 48. 240 What is the least common multiple of 30 and 8130? 8130 Find the common denominator of -25 and -53/87. 87 What is the smallest common multiple of 578 and 867? 1734 What is the lowest common multiple of 280 and 472? 16520 Calculate the lowest common multiple of 1702 and 253. 18722 What is the least common multiple of 3429 and 648? 82296 What is the common denominator of 43/632 and 51/10? 3160 Find the common denominator of 7/27 and -113/18. 54 Find the common denominator of 5/18 and 29/378. 378 Calculate the common denominator of 67/360 and -55/84. 2520 Find the common denominator of 11/5226 and 133/5226. 5226 Calculate the smallest common multiple of 2 and 30. 30 Calculate the lowest common multiple of 63582 and 9. 190746 What is the lowest common multiple of 21 and 87? 609 What is the lowest common multiple of 246 and 205? 1230 Calculate the common denominator of -11/20 and 47/5022. 50220 What is the least common multiple of 63 and 63? 63 Find the common denominator of -125/108 and -113/360. 1080 Calculate the smallest common multiple of 60 and 84. 420 Find the common denominator of -46/2205 and 187/60. 8820 What is the smallest common multiple of 144 and 1888? 16992 What is the smallest common multiple of 2738 and 18? 24642 What is the least common multiple of 54 and 8685? 52110 What is the smallest common multiple of 1 and 20871? 20871 Find the common denominator of -63/265 and -29/530. 530 What is the smallest common multiple of 6 and 25? 150 Calculate the least common multiple of 6530 and 5877. 58770 What is the least common multiple of 319 and 6? 1914 Calculate the smallest common multiple of 4 and 19694. 39388 Calculate the lowest common multiple of 21 and 9. 63 Calculate the least common multiple of 218 and 108. 11772 What is the least common multiple of 18 and 436? 3924 What is the common denominator of 1/160 and 169/120? 480 Calculate the common denominator of 115/14 and 51/22. 154 What is the lowest common multiple of 52 and 338? 676 Find the common denominator of 36/733 and -63/10. 7330 Calculate the common denominator of -127/7250 and 33/80. 58000 What is the common denominator of -81/6178 and 119/10? 30890 What is the common denominator of 17/135 and 85/12? 540 What is the common denominator of 33/20 and 43/35? 140 Find the common denominator of 89/6105 and -43/3885. 42735 Calculate the smallest common multiple of 3170 and 1585. 3170 Calculate the common denominator of -97/12 and 81/196. 588 Find the common denominator of 37/10 and -15/646. 3230 What is the common denominator of -59/16 and 7/3800? 7600 Find the common denominator of -1/36 and 113/132. 396 Calculate the least common multiple of 252 and 56. 504 Calculate the smallest common multiple of 549 and 61. 549 Calculate the least common multiple of 80 and 210. 1680 Calculate the lowest common multiple of 121 and 44. 484 Find the common denominator of 36/5 and 30/551. 2755 Calculate the lowest common multiple of 270 and 1566. 7830 Calculate the least common multiple of 16 and 1104. 1104 What is the common denominator of 173/14364 and -11/3? 14364 Calculate the common denominator of 45/7 and -39/385. 385 What is the least common multiple of 40 and 180? 360 What is the least common multiple of 24 and 264? 264 Calculate the common denominator of 26 and 44/227. 227 What is the common denominator of -31/51 and 3/23? 1173 Calculate the lowest common multiple of 30 and 695. 4170 Calculate the smallest common multiple of 44 and 744. 8184 Calculate the smallest common multiple of 22 and 198. 198 What is the lowest common multiple of 980 and 1666? 16660 Calculate the smallest common multiple of 10 and 5. 10 Find the common denominator of -49/246 and -31/12. 492 Find the common denominator of 131/12 and 44/113. 1356 What is	{ "pile_set_name": "DM Mathematics" }
. 1/30 What is prob of picking 2 e, 1 j, and 1 n when four letters picked without replacement from {n: 2, j: 1, y: 1, u: 4, e: 2, c: 2}? 2/495 Two letters picked without replacement from {h: 2, k: 2, p: 3, a: 6, w: 4}. What is prob of picking 1 p and 1 k? 3/68 Four letters picked without replacement from fffcjjcccf. Give prob of picking 1 j, 1 c, and 2 f. 8/35 Two letters picked without replacement from {y: 1, n: 5, s: 5}. What is prob of picking 1 y and 1 s? 1/11 Calculate prob of picking 1 u, 1 o, 1 m, and 1 p when four letters picked without replacement from {m: 1, u: 4, o: 4, p: 2}. 16/165 What is prob of picking 1 w and 1 t when two letters picked without replacement from poofttfofcwwwfoffpw? 8/171 Two letters picked without replacement from {i: 14, p: 1}. What is prob of picking 1 i and 1 p? 2/15 Calculate prob of picking 3 a when three letters picked without replacement from aakabaabbabbaaaaaia. 220/969 Four letters picked without replacement from {w: 3, s: 2, h: 4, v: 1, j: 1}. What is prob of picking 3 h and 1 v? 2/165 Four letters picked without replacement from eejvvveeeeevj. What is prob of picking 1 j, 2 v, and 1 e? 84/715 What is prob of picking 1 g and 1 o when two letters picked without replacement from {g: 2, o: 4}? 8/15 Three letters picked without replacement from {i: 2, x: 2, c: 1, e: 2, v: 7, z: 2}. What is prob of picking 1 e, 1 z, and 1 i? 1/70 What is prob of picking 1 m, 2 q, and 1 p when four letters picked without replacement from {v: 1, p: 1, m: 2, q: 2, w: 1}? 2/35 Two letters picked without replacement from vooovooooovoovoooo. What is prob of picking 1 v and 1 o? 56/153 Four letters picked without replacement from azzcccaaacczcz. What is prob of picking 3 a and 1 z? 16/1001 Three letters picked without replacement from {i: 7, n: 3, c: 1, r: 2, a: 3, h: 1}. Give prob of picking 1 c, 1 h, and 1 a. 3/680 Two letters picked without replacement from {n: 3, t: 17}. Give prob of picking 2 n. 3/190 Two letters picked without replacement from mmqqqmmmmmqihi. Give prob of picking 1 h and 1 m. 1/13 Two letters picked without replacement from {b: 3, m: 2, k: 3, l: 3, g: 2, a: 1}. What is prob of picking 1 b and 1 l? 9/91 Calculate prob of picking 3 g and 1 d when four letters picked without replacement from ggggdddgggggdg. 480/1001 Two letters picked without replacement from ymtvatym. What is prob of picking 1 t and 1 m? 1/7 Three letters picked without replacement from {y: 1, h: 1, v: 1, l: 2, r: 11}. Give prob of picking 1 v, 1 l, and 1 h. 1/280 Calculate prob of picking 2 y and 1 h when three letters picked without replacement from vgyhygo. 1/35 Three letters picked without replacement from {c: 1, p: 2, a: 3, o: 2, n: 3, d: 1}. What is prob of picking 1 c, 1 p, and 1 o? 1/55 What is prob of picking 1 h and 1 d when two letters picked without replacement from dlhji? 1/10 Three letters picked without replacement from {g: 2, l: 1, j: 4, d: 1, i: 3}. What is prob of picking 1 g and 2 i? 2/55 Calculate prob of picking 1 j and 1 k when two letters picked without replacement from jkfrkvroj. 1/9 Calculate prob of picking 2 e when two letters picked without replacement from {w: 4, x: 1, e: 5}. 2/9 Calculate prob of picking 3 o and 1 f when four letters picked without replacement from fomomfmmmmfomfomm. 4/595 Calculate prob of picking 1 p, 2 g, and 1 w when four letters picked without replacement from {w: 8, h: 5, g: 2, c: 2, p: 2}. 4/969 Four letters picked without replacement from vvdtaqdvdqvvvdvds. Give prob of picking 1 q, 2 d, and 1 a. 1/119 Four letters picked without replacement from hhhhphhphhhhhhhhph. What is prob of picking 3 h and 1 p? 91/204 What is prob of picking 3 i when three letters picked without replacement from iirinriiririirnir? 21/170 Two letters picked without replacement from kzzzzzzkzzzz. What is prob of picking 2 z? 15/22 Calculate prob of picking 1 e and 2 q when three letters picked without replacement from euqseeeqqqqqqqguq. 18/85 Four letters picked without replacement from {o: 16, l: 4}. What is prob of picking 4 o? 364/969 What is prob of picking 1 o and 1 z when two letters picked without replacement from uohkhzz? 2/21 Three letters picked without replacement from {j: 8, h: 3, i: 2, d: 2}. What is prob of picking 2 h and 1 j? 24/455 Four letters picked without replacement from eqeqyyqymyyeeeyqeeq. Give prob of picking 2 q and 2 y. 25/646 Calculate prob of picking 3 m and 1 x when four letters picked without replacement from mmgxxmmmx. 5/21 Two letters picked without replacement from uaaaaxaaaaxaaabxaab. Give prob of picking 1 b and 1 a. 26/171 Two letters picked without replacement from {o: 4, n: 1, p: 4, e: 6}. What is prob of picking 1 o and 1 n? 4/105 What is prob of picking 3 e when three letters picked without replacement from {l: 4, e: 3}? 1/35 Two letters picked without replacement from lwehew. Give prob of picking 2 w. 1/15 Three letters picked without replacement from qqqqvqqv. What is prob of picking 3 q? 5/14 What is prob of picking 2 u and 1 q when three letters picked without replacement from uqhgsquw? 1/28 Calculate prob of picking 2 p when two letters picked without replacement from pheehpep. 3/28 Three letters picked without replacement from {d: 2, a: 4, q: 5}. Give prob of picking 1 q, 1 d, and 1 a. 8/33 Four letters picked without replacement from {l: 3, o: 1, s: 1, f: 2}. What is prob of picking 2 f, 1 l, and 1 s? 3/35 What is prob of picking 1 z and 1 b when two letters picked without replacement from lllffllbflfllllzllf? 1/171 What is prob of picking 1 t and 2 m when three letters picked without replacement from {m: 2, t: 7, r: 5, o: 1, z: 1}? 1/80 Three letters picked without replacement from kubuurc. Give prob of picking 1 r and 2 u. 3/35 Two letters picked without replacement from ruoeduo. Give prob of picking 2 r. 0 Two letters picked without replacement from {s: 11, w: 9}. What is prob of picking 1 s and 1 w? 99/190 Two letters picked without replacement from {j: 1, p: 3}. Give prob of picking 2 p. 1/2 Calculate prob of picking 3 x and 1 p when four letters picked without replacement from {l: 1, x: 3, p: 1}. 1/5 Calculate prob of picking 1 v and 1 r when two letters picked without replacement from {v: 1, n: 2, r: 1}. 1/6 What is prob of picking 1 l and 1 d when two letters picked without replacement from dtlld? 2/5 Two letters picked without replacement from {q: 2, a: 11}. What is prob of picking 2 a? 55/78 Two letters picked without replacement from nkrvrqrsqvnr. Give prob of picking 1 r and 1 v. 4/33 Calculate prob of picking 1 l and 1 g when two letters picked without replacement from {g: 4, z: 1, o: 5, l: 1}. 4/55 Four letters picked without replacement from kvvvvhkdkddvhdd. Give prob of picking 1 d, 2 v, and 1 h. 20/273 Calculate prob of picking 1 a, 1 h, and 1 w when three letters picked without replacement from {h: 1, f: 1, s: 4, a: 2, w: 1}. 1/42 Calculate prob of picking 2 i when two letters picked without replacement from {x: 2, i: 2}. 1/6 Four letters picked without replacement from {o: 5}. What is prob of picking 4 o? 1 Two letters picked without replacement from qxhxqqxxgqqer. What is prob of picking 1 q and 1 e? 5/78 Calculate prob of picking 2 l when two letters picked without replacement from lfffftffflyffbtlf. 3/136 Calculate prob of picking 1 j, 1 r, and 1 y when three letters picked without replacement from {j: 1, t: 1, x: 1, f: 2, r: 1, y: 1}. 1/35 Two letters picked without replacement from ncnxxxfcrxxn. What is prob of picking 1 x and 1 c? 5/33 What is prob of picking 3 e when three letters picked without replacement from eeyeyyyy? 1/56 Two letters picked without replacement from pvmvxvvvvvivivipvi. What is prob of picking 1 i and 1 x? 4/153 Four letters picked without replacement from rvttrvtvttrtvrtrt. Give prob of picking 1 t, 1 v, and 2 r. 16/119 What is prob of picking 1 h and 1 q when two letters picked without replacement from {h: 11, q: 2}? 11/39 Three letters picked without replacement from ygyvkggggy. Give prob of picking 2 g and 1 y. 1/4 What is prob of picking 1 f and 2 t when three letters picked without replacement from {f: 4, t: 3}? 12/35 Three letters picked without replacement from {u: 9, j: 4, z: 3, i: 2}. What is prob of picking	{ "pile_set_name": "DM Mathematics" }
hat are the prime factors of (j/(-2))/(2/(-4))? 13 Suppose -3z - 4o + 63 = -o, -2z + 5o = -70. What are the prime factors of z? 5 Let a = -6 - -3. Let u be 1/(((-3)/a)/(-7)). List the prime factors of (u/(-21))/(1/39). 13 Suppose -61 = -5k - 2c, 4k = -4c - 12 + 68. Suppose 3b - 16 = m + k, -b + 4m + 20 = 0. Suppose b - 20 = -w. What are the prime factors of w? 2, 3 Let l(o) = -8o - 5. Let x be l(-4). Suppose -3 + x = -3p. Let r(j) = -j*2 - 8j + 11. What are the prime factors of r(p)? 11 Let q(r) = -r*3 + 4r*2 + r. Let w be q(4). Let x be (-3)/(-6)w + 2. Let l = x + -1. List the prime factors of l. 3 Let f be (-30)/(-8) - 1/(-4). Let k(c) = -c*3 + 6c*2 - 5c + 3. What are the prime factors of k(f)? 3, 5 Let l = -7 + 7. Suppose 0 = -4j, 3v + 5j - 36 = -lj. List the prime factors of v. 2, 3 Suppose 0 = -4o + 7 - 43. List the prime factors of (-19)/(-2) + o/(-6). 11 Let j(f) = f + 15. Let a be (-12)/54 + 32/(-18). Let k(y) = y + 16. Let s(o) = aj(o) + 3k(o). List the prime factors of s(-9). 3 Let u be 2/5 - 240/(-25). Suppose 0 = j - 5, -7j = -4x - 2j - 25. Suppose xr - 2r + u = 0. What are the prime factors of r? 5 Let n = 5 - -3. List the prime factors of n. 2 Suppose -10s + 5s = 280. Let p = s + 93. What are the prime factors of p? 37 List the prime factors of 3/(1 - 10/15). 3 Let n be (1/3)/(-1)3. Let s(l) = -4l3 + l2 + 2l + 1. What are the prime factors of s(n)? 2 Let p(t) = -t2 + 9t + 12. Let u be p(10). What are the prime factors of (u/(-2))/((-2)/24)? 2, 3 Suppose 43 = 4k - v, -2k + 6k - 5v - 39 = 0. List the prime factors of k. 11 Let c be (-2)/6 + (-20)/(-6). Suppose 0 = -2p - cp + 30. List the prime factors of p. 2, 3 Let d be 2/336/(-4). Let q(a) = a2 + 3a. List the prime factors of q(d). 2, 3 Suppose -3o = -5s + 19 + 6, -35 = -5s + o. What are the prime factors of s? 2 Let f = 42 - 11. What are the prime factors of f? 31 Let z(b) = -b3 + 12b*2 + 2. Let x be z(12). Let u(s) = -6 + s - 5s*2 - 2s2 - s3 + 3sx. List the prime factors of u(-5). 2, 7 Suppose -2 = -v - 3. List the prime factors of (-301)/(-14) - v/2. 2, 11 Let n = -54 + 28. Suppose 22m + 60 = 18m. Let s = m - n. List the prime factors of s. 11 Suppose 2r = -r + 9. Suppose -rc - 2i = -3i - 71, -12 = -c - 2i. List the prime factors of c. 2, 11 List the prime factors of ((-414)/12)/(1/(-4)). 2, 3, 23 List the prime factors of 105 + -2 + (5 - 2). 2, 53 Let o be (3 + -6)(-4)/(-3). Let m(r) = r + 7. What are the prime factors of m(o)? 3 Let y = -48 + 71. What are the prime factors of y? 23 What are the prime factors of 12/864/3? 2 What are the prime factors of 54 + -7 + (0 - 3)? 2, 11 Suppose -4i = -b + 61, 2b - 122 = -0i - 5i. List the prime factors of b. 61 Suppose -i = 5d - 12 - 2, -4i = 5d - 11. Let f = d - 5. Let h = f + 7. What are the prime factors of h? 5 Let u be ((-5)/10)/(2/152). Let m be (u/1)/(5 + -7). Let d = 31 - m. What are the prime factors of d? 2, 3 Let r be ((-2)/(-4))/((-2)/(-24)). Suppose 3s - r = 12. What are the prime factors of s? 2, 3 Suppose 2t = -4y - 38, -y - 20 = -4t + 12. What are the prime factors of 18/y(-76)/6? 19 Suppose -2x = -3x + 130. List the prime factors of x. 2, 5, 13 Let j = 3 + -2. Let i(h) = 2h3 + 5h*3 + 4h*3. What are the prime factors of i(j)? 11 Let c be (6 - 8)/(2/(-3)). Suppose 0w - 2w = 4q - 80, -cq = -2w - 67. List the prime factors of q. 3, 7 Suppose -i - i + 16 = 5b, -b + 2i - 4 = 0. Let m be 0 - 4/(b-1). Let x = 13 - m. What are the prime factors of x? 11 Let x(p) = 10p*3 + 2p + 1. Let z be x(-1). List the prime factors of (-152)/z - 8/(-44). 2, 7 Suppose -3p + 94 = a - 6p, 4a + 4p = 376. Suppose 33 = 2g + 5s, -a = -g - 4g - s. What are the prime factors of g? 19 Let d be 2/((-12)/9 - -2). Let o(b) = -2b*d - 1 - 3b - b*3 + b. List the prime factors of o(-1). 2 Suppose -4z + t + 45 = 0, -4z - 25 = -5z + 3t. List the prime factors of z. 2, 5 Suppose -c + 4m = -37, 4c - m - 122 = 2m. List the prime factors of c. 29 Let m(v) = -5 + 3v - v + v2 - 8v - 2. List the prime factors of m(9). 2, 5 List the prime factors of (3/3)/((-1)/(-33)) - 3. 2, 3, 5 Suppose -b = s - 12, 2s + 4b + 0b = 24. What are the prime factors of s? 2, 3 Let b(y) = 2y - 1. Let u be b(2). Suppose ul = 2p, -6l + l = 5p + 25. List the prime factors of (5/15)/(l/(-42)). 7 Suppose 23 + 17 = 4t. Suppose -6v + t = -v. What are the prime factors of v? 2 What are the prime factors of -1 - -40 - (7 - 5)? 37 Let h = -3 + 13. List the prime factors of h. 2, 5 Suppose 4w - 2j - 135 = -9, 5w - 3j - 156 = 0. List the prime factors of w. 3, 11 Suppose 5v + 19 = -i, -v - 2i + 1 = 12. Let w(h) = -h*3 - 5h*2 - 2h - 1. Let a be w(-5). Let o = a - v. What are the prime factors of o? 2, 3 Let k(a) = 2a2 + 2a - 13. What are the prime factors of k(-6)? 47 Let h be 10/(-2)(-5 + 4). Suppose 0 = -v - v + 2d + 74, hv + 5d = 235. List the prime factors of v. 2, 3, 7 Suppose -3i + 12 = -i. Suppose -10l = -7l - i. What are the prime factors of l? 2 Suppose 0 = 2w - 44 + 6. What are the prime factors of w? 19 Let c = 33 - -56. List the prime factors of c. 89 Let y(m) = m - m + 2m + 6. List the prime factors of y(5). 2 Let o = -77 - -123. List the prime factors of o. 2, 23 Let o(s) = 2s*2 + s + 1. Let n be o(-1). Suppose nz = 18 + 10. List the prime factors of z. 2, 7 Suppose g = -4g + 5. Let f be 1/2 + g/(-2). Suppose f = 5v + 19 - 49. What are the prime factors of v? 2, 3 Suppose -4n = f - 685, 5n = -3f + 917 - 52. What are the prime factors of n? 2, 5, 17 What are the prime factors of -36(-3(-2)/(-8) + -3)? 3, 5 Suppose -2f = -6f + 284. Suppose 4r + 43 = 3q, -4q + 5r + f = 13. Suppose 3t = -2n + q - 5, 4n - 24 = -4t. List the prime factors of n. 2, 3 Let j(z) = 3z - 4z - z - 1 + 2 + 2z*2. Let r be j(1). List the prime factors of ((-1)/3)/(r/(-6)). 2 Suppose -o - 1 = -10. What are the prime factors of 2/(1 - o/11)? 11 Suppose -4a = -5a + 43. List the prime factors of a. 43 Let k(m) = -m + 3m + 3m2 - 2 + m + 0m. What are the prime factors of k(-3)? 2 Let a(d) = 5d2 + 1 - 70d*2 - 6d*2 - 24d*2. Let g be a(-1). List the prime factors of g/(-8) - (-3)/12. 2, 3 Suppose -587 + 119 = -3l. List the prime factors of l. 2, 3, 13 Suppose 3l - 2x = 25, 5l + x + 9 = 55. List the prime factors of l. 3 Suppose -3u = -2u + 5. Let q be 1 + u/((-15)/(-12)). What are the prime factors of (39/(-9) + -1)q? 2 Suppose z - 1068 = -5z. List the prime factors of z. 2, 89 Suppose p - 2 - 6 = 0. List the prime factors of p. 2 Let b(y) = 4y + 10. What are the prime factors of b(7)? 2, 19 Let j(i) = -i*2 - 9i - 5. Let c be j(-9). Let p be (-43)/c - (-2)/5. What are the prime factors of (-46)/(-6) - 6/p? 7 Let u(x) = -x - 2 + x*2 - 1 + 2x. Let f be u(4). Let z = f - 11. List the prime factors of z. 2, 3 Let s = -10 + 10. Suppose s = -0u - 5u + 75. What are the prime factors of u? 3, 5 Let t(i) = -6i - 2. Let o(n) = -5n - 1. Let m(w) = -3o(w) + 2t(w). What are the prime factors of m(3)? 2 Let o(w) = 4w - 4w + 3w. Suppose l + 2r = 2l + 6, 2r = 5l - 2. List the prime factors of o(l). 2, 3 Let w(z) = -16z*3 + 4z*2 + 4z + 3. List the prime factors of w(-2). 139 Suppose -2a = 3b, 5b - a = -2a. Suppose b = 4w + w - 175. Suppose 0 = 4r - 13 - w. What are the prime factors of r? 2, 3 Let a(d) = -6d2 - 10d + 13. Let y(t) = t*2 - 1. Let i(r) = a(r) + 5y(r). What are the prime factors of i(-10)? 2 Suppose -2s + g + 4 = -6, -2s + 2g + 12 = 0. Let m(h) = -h2 + 6h - 1. What are the prime factors of m(s)? 7 Let p(i) = -i*3 + 2i*2 + 4i - 3. Let a be p(3). Suppose a = 3t - 5m - 124, 3t = -3m - 0m + 156. List the prime factors of t. 2, 3 Let t(i) = -i2 - 7i - 7. Let z be t(-5). Let f(l) = l*2 - 2l - 4. Let o be f(6). Suppose -2b = -d + 2b - 8, -zb + o = d. List the prime factors of d. 2 Let t = 9 - 5. Let s = t - -5. List the prime factors of s. 3 Let g(r) = -63r - 27. What are the prime factors of g(-3)? 2, 3 Let y = 9 + -6. Suppose 5x - 29 = 2n, -2x - x + 21 = -yn. List the prime factors of 3/(-2) + (-41)/n. 19 Suppose -5q + 5f = -0*q - 280, f = 4. What are the	{ "pile_set_name": "DM Mathematics" }
*2 wrt t. 2j*2 - 316 Differentiate 120r*2 - 2r - 30. 240r - 2 Find the third derivative of -8a*2i*6 + 91a*2i2 + a2 - 25ai*6 wrt i. -960a*2i*3 - 3000ai3 Find the third derivative of 351q*3u - q*2u - 6q2 - 6 wrt q. 2106u What is the third derivative of 3g3mv3 + 5g*3mv2 - 9g*3 + 2g*2m + 34g2 - gmv3 wrt g? 18mv3 + 30mv2 - 54 Differentiate 8053u*3 + 887 wrt u. 24159u*2 Find the second derivative of -1197n*2 + 2n - 258. -2394 What is the first derivative of ak2m*2 + 5ak2m - 302k2m2 wrt a? k2m2 + 5k*2m Find the second derivative of 2a2bg2 - 2a*2bg - 2a*2b + 184a2g + 492abg2 + bg*2 + 2bg + 7g wrt g. 4a2b + 984ab + 2b Find the first derivative of -x3 + 5x*2 + 186x - 5257 wrt x. -3x2 + 10x + 186 Differentiate -2pz*2 - 3pz - 85p + 2053z2 with respect to p. -2z*2 - 3z - 85 What is the second derivative of 857oy*2 + 2oy - 731o wrt y? 1714o Differentiate bm*2 + 359b - 3m4 - 2m*2 wrt m. 2bm - 12m*3 - 4m Find the third derivative of 3q4z*3 + 100q*4z*2 + 2q*2z + 392qz*3 wrt q. 72qz3 + 2400qz2 Differentiate -127k*4 + 2k + 530. -508k3 + 2 What is the third derivative of -5g*4j - 199g3j - 1876g2j wrt g? -120gj - 1194j Find the third derivative of 2c*2i*3 - 22c*2i*2 - 22c*2 - 1473i4 + i2 wrt i. 12c2 - 35352i Find the second derivative of 1224n2 - 2529n wrt n. 2448 Find the third derivative of -2261m6 + 2083m*2. -271320m*3 Differentiate 10224c*3d*2 + 15d*2 - 51 with respect to c. 30672c*2d*2 Differentiate 897g*2m*3 - 2g*2m + 1436m3 - m2 with respect to g. 1794gm3 - 4gm Find the third derivative of 47c*3 + 136c*2. 282 Differentiate -201t*2 - 137 with respect to t. -402t Find the second derivative of 13d2t*3 - 49d*2t*2 + 2d*2t - 2d + 3t3 - t2 - t wrt d. 26t3 - 98t*2 + 4t What is the derivative of -195d4 + 263 wrt d? -780d*3 What is the derivative of -5qs3w*2 - qw*3x - 4qw*3 + 21s*3w*3x + 4s3w*2x - s*2wx wrt q? -5s*3w2 - w3x - 4w*3 What is the third derivative of -567cn4 - 2cn3p + 2cnp - 32n*2 - 2np - 4n wrt n? -13608cn - 12cp What is the first derivative of 1484l - 865? 1484 Find the third derivative of 22l*4 - 9l*3 + 741l*2. 528l - 54 Differentiate -b*3i + 5b3 + 7b*2 + 357i4 with respect to i. -b3 + 1428i3 What is the first derivative of 1520j*3 + 1604? 4560j*2 Find the third derivative of -35f*6 - 5f*2 - 1 wrt f. -4200f*3 What is the second derivative of 9132i*2p*3 - ip*3 - 2ip2 - 3657ip wrt i? 18264p*3 Find the first derivative of -10bfq - bf + 4fq - q + 8 wrt b. -10fq - f What is the first derivative of -11g*2w + 5g2 + 156w - 2249 wrt w? -11g2 + 156 What is the third derivative of 339k*3q - 2k2q - 3k2 wrt k? 2034q Find the first derivative of -7g2 - 13g + 325 wrt g. -14g - 13 Find the second derivative of -2q*2x*2 + 157q*2x - 33qx*2 + 2qx - 3x wrt q. -4x2 + 314x Differentiate 2i4m - i*3m + 311i2m + 7527m wrt i. 8i*3m - 3i2m + 622im Find the second derivative of -14cj*2n + cr3 + j2nr2 - j2r*3 + 3jn - 2nr3 + 2nr2 - 2n wrt j. -28cn + 2nr*2 - 2r*3 Differentiate 5b*3pqz + 29b3pz - b3q - 15bqz - pq - qz with respect to p. 5b*3qz + 29b*3z - q Differentiate 5988b3 + b2s - 9181s with respect to b. 17964b*2 + 2bs Find the second derivative of -12q*3 + 6q*2 - 18q + 3 wrt q. -72q + 12 Find the third derivative of -458m*3y*2 - 2m*2y*2 - 11my2 + y wrt m. -2748y*2 Find the second derivative of -2a*2f*2h - a*2fh - 2af + 3a + 304f2h*3 + 2h*3 wrt f. -4a*2h + 608h3 Find the third derivative of -54a*5 + 3a*4 - 6a*2 + 17. -3240a*2 + 72a What is the second derivative of -9f4 + 19f*3 - 2f*2 - 15612f? -108f2 + 114f - 4 What is the third derivative of -14652d3 - 20d*2 + 144d + 1? -87912 What is the third derivative of 71d3 - 112d2? 426 What is the second derivative of u3 + 45u2 + 171u wrt u? 6u + 90 Differentiate -a4t*3 + 1138a*4t + a - t*3 + 1691 wrt a. -4a*3t*3 + 4552a*3t + 1 What is the second derivative of 29i2ps2 + 19i*2s*2 - 4is - 264ps2 + s2 wrt i? 58ps2 + 38s*2 What is the first derivative of 1126y + 1168 wrt y? 1126 What is the derivative of -156z3 + 1713? -468z*2 What is the third derivative of -2127d*5 + 83d*2 + 2d wrt d? -127620d2 Differentiate 8q*3 - 21q*2 + 2281. 24q*2 - 42q Find the second derivative of -2876v2 - 273v. -5752 What is the second derivative of -61k2n*2 - 51k*2n + 2kn*3 - 5kn + 4n*3 + 2n wrt n? -122k2 + 12kn + 24n Find the second derivative of -6n5 - 45n. -120n3 What is the third derivative of -8l*4 + 3l*3 + 38l*2 wrt l? -192l + 18 Find the first derivative of -4i3s + 15i2s - 102s wrt i. -12i*2s + 30is Find the second derivative of -59j3 - 6j*2 + 3j - 5 wrt j. -354j - 12 What is the second derivative of -259u*2 - u - 182 wrt u? -518 What is the derivative of -51x4 - x2 + 97? -204x3 - 2x What is the second derivative of 3j5 + 92j*2 + 17j - 4? 60j3 + 184 Find the third derivative of -1072k*3 + 73k*2 wrt k. -6432 Find the third derivative of -2cp3 - 42c + 770p3 + 11p*2 - 2p wrt p. -12c + 4620 What is the third derivative of -2my3z*2 + 4my3 - 19my2z*2 - 16my2z + 17y3 wrt y? -12mz2 + 24m + 102 Find the third derivative of x*5 + 2x*4 + 454x3 + x2 - 2191x - 1 wrt x. 60x*2 + 48x + 2724 Find the second derivative of -28g4 + 1116g. -336g2 What is the third derivative of -3hn3w*2 - 16hn3w + 2hn*2w*2 + 98hw2 + 5n*3z - 2n2w*2z + nw2z - 2z wrt n? -18hw2 - 96hw + 30z Find the third derivative of -p*6 - 25p*4 - 238p*2. -120p*3 - 600p Find the first derivative of 127f - 143 wrt f. 127 What is the second derivative of 14146y*3 + 14284y wrt y? 84876y What is the second derivative of 3l*2z3 + l2z2 - 225l*2z - 6z3 - 2z wrt z? 18l2z + 2l2 - 36z What is the third derivative of -8016o4 + 598o*2 - o + 3? -192384o Find the third derivative of 220g3 + 205g*2. 1320 Find the third derivative of 3cq3 + 2cq2r + 8cq*2 + 2c - 4q4r - 2q4 - 2q*3 wrt q. 18c - 96qr - 48q - 12 Find the second derivative of -193o*4 - 264o wrt o. -2316o2 Differentiate 93q*2s*3 + 2q*2 - 1022q - s*3 wrt s. 279q*2s*2 - 3s*2 What is the second derivative of -234z*3 - 23z? -1404z Find the third derivative of 55v*6 + 107v*2. 6600v*3 Find the third derivative of nv*2w + 2nw*4 - 22nw - 2v*2w*3 + 41w*4 + 5w*2 + 2 wrt w. 48nw - 12v*2 + 984w What is the derivative of -48abj3 - 3abj + 140ahj2 + 15ah + 2aj3 - 2bhj*2 wrt b? -48aj3 - 3aj - 2hj2 Differentiate m4u - 9m4 - u + 37 wrt m. 4m*3u - 36m3 What is the derivative of -1294u*4 - 7u - 7421? -5176u3 - 7 What is the derivative of 10f*2 - 16f + 1145? 20f - 16 What is the second derivative of -3770pr2 - 2pr + 12p + 11r + 2 wrt r? -7540p What is the third derivative of 4d3ko3 + 61d*3ko2 + d3o - 155dko3 - 5dk wrt o? 24d*3k - 930dk Find the second derivative of -3b4v + 206b3v + 5bv + 60v wrt b. -36b*2v + 1236bv What is the second derivative of 1784w2x - 2wx + x - 165 wrt w? 3568x What is the second derivative of 201d*3w*2 - 6d*3 + 2dw - 4d wrt w? 402d3 Find the second derivative of 46t*3 - 2t*2 + 1653t wrt t. 276t - 4 Differentiate -glx2 - 3glx + 3gl + 14gs - 2lsx2 + lx*2 - 74sx + 2x*2 with respect to g. -lx*2 - 3lx + 3l + 14s What is the first derivative of 145g*2x*2 - 2g*2x + 3g2 + gx*3 + 103g wrt x? 290g2x - 2g2 + 3gx2 Differentiate -1960a*2q + 5546a2 wrt q. -1960a**2 What is the second der	{ "pile_set_name": "DM Mathematics" }
f sequence teex? 1/252 What is prob of sequence ffo when three letters picked without replacement from {o: 1, f: 5, a: 1, y: 2}? 5/126 Calculate prob of sequence hooh when four letters picked without replacement from hohhhhohhhhhhhoh. 3/140 Two letters picked without replacement from {p: 2, b: 7, u: 3, j: 4, n: 3}. Give prob of sequence bj. 14/171 Three letters picked without replacement from wwwwwwnwwn. Give prob of sequence wnn. 1/45 Two letters picked without replacement from pwdpwpppppwpdwpp. Give prob of sequence dp. 1/12 Calculate prob of sequence dp when two letters picked without replacement from {d: 2, g: 2, p: 1, q: 1}. 1/15 Four letters picked without replacement from fnyyyffnyyvynn. What is prob of sequence yvff? 3/2002 Four letters picked without replacement from plpflfpfffildf. What is prob of sequence ppll? 3/2002 Two letters picked without replacement from jennnnenehjejqjq. Give prob of sequence hq. 1/120 Two letters picked without replacement from woowww. What is prob of sequence oo? 1/15 Four letters picked without replacement from {g: 1, f: 3, d: 1, l: 2, u: 4}. Give prob of sequence uull. 1/330 Three letters picked without replacement from {a: 2, i: 2, s: 1, t: 1, e: 4}. What is prob of sequence eis? 1/90 What is prob of sequence zta when three letters picked without replacement from jtazj? 1/60 Four letters picked without replacement from {n: 1, x: 9, k: 1, o: 3}. What is prob of sequence xxno? 9/1001 Three letters picked without replacement from ysfsyspkspskkjsppf. Give prob of sequence pys. 1/102 Two letters picked without replacement from qbmemmqmbmbboox. What is prob of sequence qo? 2/105 Two letters picked without replacement from ririrrrrrrrrrrri. What is prob of sequence ri? 13/80 Calculate prob of sequence njnj when four letters picked without replacement from jjjjnnn. 3/35 Calculate prob of sequence dzkj when four letters picked without replacement from kvzjdqj. 1/420 Three letters picked without replacement from ttugtggbqgwuuww. Give prob of sequence qtw. 3/910 Calculate prob of sequence aov when three letters picked without replacement from xiooiwxaoxaaaov. 8/1365 Calculate prob of sequence gw when two letters picked without replacement from waooddgdgaoadxo. 1/105 What is prob of sequence uuzp when four letters picked without replacement from pzzysyssppappsuyupz? 1/2584 What is prob of sequence qq when two letters picked without replacement from qjqmqqqzqqqqqj? 45/91 Two letters picked without replacement from {y: 2, k: 2, h: 1}. What is prob of sequence ky? 1/5 Four letters picked without replacement from {h: 5, e: 2}. Give prob of sequence hhhh. 1/7 Three letters picked without replacement from {r: 1, o: 8, t: 2, h: 5, e: 1}. What is prob of sequence hho? 2/51 Four letters picked without replacement from vbwwvvwbwbwvvwvwbbvw. What is prob of sequence wbvw? 49/2907 Two letters picked without replacement from {c: 1, j: 4, l: 4, q: 1, w: 5}. Give prob of sequence wq. 1/42 Two letters picked without replacement from ojofeggofoozojzjzo. Give prob of sequence ge. 1/153 What is prob of sequence becv when four letters picked without replacement from {b: 4, v: 7, c: 1, l: 1, z: 2, e: 3}? 7/6120 What is prob of sequence hxbb when four letters picked without replacement from {w: 1, r: 2, x: 2, b: 2, h: 1}? 1/420 What is prob of sequence en when two letters picked without replacement from {t: 4, u: 2, b: 3, e: 1, m: 7, n: 1}? 1/306 What is prob of sequence jcco when four letters picked without replacement from {a: 3, j: 1, w: 1, v: 1, o: 4, c: 4}? 2/1001 Two letters picked without replacement from yxtyyyyyty. Give prob of sequence ty. 7/45 What is prob of sequence kvn when three letters picked without replacement from {w: 3, n: 2, c: 6, d: 1, k: 2, v: 1}? 2/1365 Calculate prob of sequence mmk when three letters picked without replacement from {i: 10, b: 4, k: 4, m: 2}. 1/855 What is prob of sequence fl when two letters picked without replacement from {g: 8, k: 1, f: 1, v: 3, t: 2, l: 3}? 1/102 What is prob of sequence ku when two letters picked without replacement from ouukiowg? 1/28 Calculate prob of sequence olbo when four letters picked without replacement from llblloo. 1/105 Calculate prob of sequence fn when two letters picked without replacement from {f: 6, n: 1, j: 7}. 3/91 Calculate prob of sequence tt when two letters picked without replacement from {o: 6, n: 2, t: 7}. 1/5 Two letters picked without replacement from lpcczrrzi. Give prob of sequence zc. 1/18 Calculate prob of sequence ew when two letters picked without replacement from lsesaiwe. 1/28 Two letters picked without replacement from {l: 4, c: 1, k: 4, m: 2}. Give prob of sequence lk. 8/55 Two letters picked without replacement from {h: 1, m: 1, c: 3}. What is prob of sequence hm? 1/20 What is prob of sequence bu when two letters picked without replacement from {u: 3, j: 5, d: 1, b: 1}? 1/30 Three letters picked without replacement from {c: 2, g: 2, e: 2, u: 1, k: 1}. What is prob of sequence cug? 1/84 What is prob of sequence db when two letters picked without replacement from usbiguiiduddii? 3/182 What is prob of sequence yyoy when four letters picked without replacement from {o: 2, b: 4, y: 5}? 1/66 Four letters picked without replacement from ighhhhii. What is prob of sequence gihi? 1/70 Two letters picked without replacement from {q: 1, z: 3, p: 1, u: 1, s: 3, k: 2}. What is prob of sequence us? 3/110 What is prob of sequence zf when two letters picked without replacement from zggzzzzgzfzzfggzzzzz? 13/190 Four letters picked without replacement from tjrsjlrrrlrrrrslr. Give prob of sequence ltjj. 1/9520 Three letters picked without replacement from {j: 1, n: 1, z: 1}. Give prob of sequence jnz. 1/6 Calculate prob of sequence ng when two letters picked without replacement from {g: 3, n: 1, p: 1}. 3/20 Three letters picked without replacement from {w: 1, r: 1, h: 1, m: 1, z: 1}. What is prob of sequence wrm? 1/60 Four letters picked without replacement from {p: 4, z: 1, t: 2, i: 3, g: 3, y: 2}. What is prob of sequence ipyg? 1/455 Two letters picked without replacement from uccccccccccccccucccc. What is prob of sequence cu? 9/95 Two letters picked without replacement from zdzzzzzdzzzdddzzdz. What is prob of sequence zd? 4/17 Two letters picked without replacement from nppsphnashpnseh. What is prob of sequence nh? 3/70 Four letters picked without replacement from otkumvm. What is prob of sequence vovv? 0 Two letters picked without replacement from whhavpav. Give prob of sequence ph. 1/28 Three letters picked without replacement from {q: 2, e: 5, c: 3, g: 2}. What is prob of sequence ece? 1/22 Calculate prob of sequence plua when four letters picked without replacement from {u: 2, a: 1, p: 1, l: 2}. 1/90 What is prob of sequence tes when three letters picked without replacement from eqsstsq? 1/70 What is prob of sequence sreh when four letters picked without replacement from rsrerfeyhhef? 1/660 Two letters picked without replacement from qxmqqqqbmmxxb. Give prob of sequence xx. 1/26 What is prob of sequence jbj when three letters picked without replacement from beijhhjbbj? 1/40 What is prob of sequence ygg when three letters picked without replacement from {y: 3, g: 6, x: 8}? 3/136 Calculate prob of sequence kbb when three letters picked without replacement from {b: 7, k: 9}. 9/80 Calculate prob of sequence apo when three letters picked without replacement from ppapaaaoapapapaaapp. 40/2907 Four letters picked without replacement from dppppppdpdpdpd. Give prob of sequence pddp. 60/1001 Two letters picked without replacement from {f: 7, y: 4}. Give prob of sequence ff. 21/55 Calculate prob of sequence nqnq when four letters picked without replacement from qqqqnqqqnnqqqqqq. 3/140 Calculate prob of sequence wyhy when four letters picked without replacement from {i: 2, y: 11, h: 1, w: 4, l: 1}. 55/11628 Calculate prob of sequence dg when two letters picked without replacement from uewqgdwu. 1/56 Calculate prob of sequence jyq when three letters picked without replacement from {y: 2, q: 1, j: 1}. 1/12 Three letters picked without replacement from zdzzaddda. What is prob of sequence zza? 1/42 What is prob of sequence rur when three letters picked without r	{ "pile_set_name": "DM Mathematics" }
-6j - 50 = 25j + 105. Is -166 at least j? False Suppose 0 = -3m + 2g + 1, m - 7 = -g - 0g. Let v be -1 + ((-1048)/16)/((-2)/(-4)). Let s = 138 + v. Which is smaller: s or m? m Let z be (-2 + 2533/2)(-84)/(-18). Let w = 2944597/499 - z. Does 1 = w? False Let y(o) = -12o2 + 9o - 9. Let i be y(1). Let a be (-322)/(126/i - -12). Suppose f = -4f - 220. Is a at most as big as f? True Suppose -2z + 5 = 2k + 3, 3k = -z + 3. Let p = -11678433 + 385420400/33. Let v = 973 - p. Is k at least v? True Suppose -354x + 360x = 1698. Let t = x + -284. Which is greater: 2/29 or t? 2/29 Let t(a) = -2a*2 - 16a + 10. Let v(b) = b - 5. Let z be v(-2). Let f be t(z). Suppose f = -3l + 9l. Are l and -3 unequal? True Suppose 8a - 47 = -15. Suppose 0 = -3z + ak + 3, -4z + 3k = 2k - 4. Which is greater: -3/41 or z? z Suppose 24 = 5m + 4s, 37m + 12s = 39m - 64. Is m smaller than 191? True Let g be ((789/4)/(-3))/(171/1064). Which is smaller: -408 or g? g Let q = -375953/4677497 - -106/1333. Do q and 1 have the same value? False Let f = 2271 - 2375.9. Is f greater than -1/3? False Suppose -5q - 4h - 154 = 0, -2h = 34 - 32. Let b = -23 - -24. Let x = -3 + b. Do x and q have the same value? False Let g(z) = -14z2 + 11z + 10. Let j be g(-1). Let m be 120/1610/j. Let x = 5 + -5.3. Is x smaller than m? False Let a be (2/(-4))/(2/(-44)). Let f = a - 48. Suppose 0 = 2u + 2h + 82, -3h + 21 = 4u - 5u. Is f equal to u? False Suppose 4g = -5u + 515, -3g + 312 = -3u + 6u. Suppose -3h + 6 = w, 5w - 3h = u - 15. Let i be ((16/60)/1)/(w/200). Is i less than 3? False Let r(w) = 82w - 984. Let x be r(3). Do x and -736 have different values? True Suppose 0b + 28 = -4b - 4m, 0 = -m + 4. Let g = 439 - 436. Suppose -5w = 4x + 11 + 56, -gw = x + 36. Is w less than or equal to b? True Suppose 6c - 3c - 6 = 0. Suppose -3y - 87r + 91r + 33 = 0, 4r + 30 = 2y. Let q be y/(-210) + -2 + c + 0. Is -1 at most as big as q? True Suppose 0 = -18u + 71u + 106. Let b be (44/(-6))/(2/(-6)). Let z be b/(-21) - (-2)/6. Is u smaller than z? True Let j = -0.017 - 0.026. Let c = j + 3.043. Let n = c - 2.8. Which is greater: 17 or n? 17 Suppose k + 0k = -18. Let d be 23 + (-77)/7 - -54. Let p = d + k. Is p at least -2/3? True Let q = -1341 - -1340.83. Let r = 417.17 - 420. Let u = r + q. Is u != 3/8? True Let z be ((-3)/68)/((-20)/(-36)28/(-160)). Which is bigger: z or -1? z Suppose 259b + 8696 + 15331 + 12751 = 0. Which is smaller: b or -8/5? b Suppose 0 = 2f - 4f. Let a be 7 - (-945)/(-132) - (-2)/(-8). Is a greater than or equal to f? False Suppose 2q + 0q - 6 = 0. Suppose 297 = -4d - 3s, -d - 8s - 53 = -qs. Let k = -547/7 - d. Is 0 greater than k? True Suppose 3 = i - s, -4s = i - 1964 + 1986. Is 8/631 greater than i? True Let n(d) = -d*2 - 2d + 17. Let p be n(-5). Suppose 2 = -pi + 8. Is 4 less than i? False Let a(o) = o2 - 1. Let i(u) = -5u*2 - u + 22. Let k(d) = -6a(d) - i(d). Let v be k(0). Does v = -25? False Let j = 0.247 - 0.247. Let m = 6.6 - 172.6. Do m and j have the same value? False Let h = -0.17 - 0.03. Let m = 67 - 68.808. Let s = -0.192 + m. Which is greater: s or h? h Let l be 8(123/3854)/(3/18). Which is greater: 2 or l? 2 Suppose -13i + 16 = -17i, q - 5i - 449 = 0. Let l = 458 - q. Is l less than or equal to 143/5? False Let g be (2/3)/((-4)/321). Suppose 10d + q = -565, -2d + 3q = q + 80. Which is bigger: d or g? g Let d = -15834 + 15757. Does -80 = d? False Suppose -8r + 20 = -3r. Let g(b) = 2b*3 - 9b*2 + b - 15. Let j be g(r). Is j less than -27? False Let r = 5832 - 5831. Which is greater: r or -157? r Let j be -50 + 57 + 42/14. Suppose 2 = 2t - 2. Suppose 0 = -tg + g + 9. Which is greater: g or j? j Let n = 165 + -163.67. Let l = -5.5357 - -4.5357. Are l and n equal? False Let a = 12467 - 12443. Suppose 5w + 10 = 3t, -2w - 4 = 6t - 2t. Which is bigger: t or a? a Let i = -14601 - -8962. Is i not equal to -5638? True Let k = 991/240 + 13/48. Let o be 2/((-14)/665) + 6. Let l = o - -92. Do l and k have the same value? False Suppose -21z = -95z - 136517 - 480199. Is z equal to -1/2? False Let y = -1.40461 - -0.00461. Is y < 0.086? True Let l = -49 + 48. Suppose 15h = 5s + 20h - 750, s - 158 = -5h. Do l and s have the same value? False Let f(w) = 11 + 7 + 4w - 3 - w. Let u be f(-6). Let l be 928/(-188) - (u - 2). Do 0 and l have the same value? False Let y(k) = -k3 - 4k*2 - 10k. Let i be y(0). Is i < 1/2746? True Let n be (-3)/60/(-2). Let g = 10/19 - -65/57. Let d = g + -28/15. Which is greater: d or n? n Let w(b) = 11b + 10. Let d(z) = -5z - 5. Let r(a) = 9d(a) + 4w(a). Let h be r(-4). Let y(j) = -3j. Let n be y(h). Which is smaller: 4 or n? n Let q be 2/((-123)/129 + 1). Let l = q + -41. Suppose -3b + 202 = 5y, 0 = b + l - 6. Is y less than or equal to 39? True Suppose -6s = 4a + 404, 0s + 271 = -4s - a. Which is greater: -60 or s? -60 Suppose 6 = 35g - 224 + 90. Which is smaller: g or 322/103? 322/103 Suppose 6v = v + 5g + 55, 0 = 3g - 15. Suppose -2n + 44 = 4l + v, n - 4l - 14 = 0. Let z be (-2 + (-16)/(-1))(-14)/n. Is -27/2 greater than z? True Let d = 36 + -23. Suppose -2c = j + d, 2c = 4j - 0c + 42. Suppose 92 = -14w - 6. Does w = j? False Let z = 20014 + -20006. Is z smaller than 390? True Let v = 1496440/141 - 10613. Let l = 64/1551 + v. Let n(u) = -u + 2. Let a be n(2). Which is greater: a or l? l Let q = 2/2153 - 27993/4306. Let n = 17915/2982 + 44/213. Let f = n + q. Is -4/9 less than or equal to f? True Let c(d) = -52d - 832. Let y be c(-16). Let p = 28/3 - 5743/615. Is y at most p? False Suppose -66p - 322 = 338. Which is smaller: -440/41 or p? -440/41 Suppose -41q - 2q + 1125095 = 0. Let i = q - 235805/9. Which is smaller: i or -37? -37 Suppose 2o = -4w + 2, -7w = -6w + 3o - 13. Let k be ((-114)/(-12))/((w/(-164))/1). Which is greater: k or 778? k Suppose -12 = 4i, -4o = o + 3i - 11. Suppose -w + ol - 81 = 15, 318 = -3w + 2l. Let t = w - -108. Do t and -1/9 have the same value? False Let k be (-574)/4(-285 + 287). Which is smaller: k or -2578/9? k Let s be -7 + (-1495)/(-175) + -56/(-50). Which is smaller: s or -25? -25 Let f be ((-1824)/(-6))/(3/3). Suppose 0 = 3m - 2q - 924, m - 212 - 116 = 4q. Do f and m have different values? False Let p be (-7)/(-1 - 6)14. Let u be -1(-1)/(0 + 2/16). Is u < p? True Let v = 0.0331 - -0.3299. Let a = -0.337 - v. Is -10 bigger than a? False Let n = 18/829 + -107/43108. Which is greater: 1 or n? 1 Let s be (-10)/(-55) + 1549/11. Let x = s - 219. Is x < -157/2? False Let m be 14/105 - (11712/(-11250))/(-8). Let k(g) = g2 - 3g - 11. Let y be k(5). Which is bigger: m or y? m Let h = 3660 - 3659. Which is smaller: h or 16.33? h Let g = 1 + -1. Let y = 1/320311 - -647348514/5445287. Let n = y - 119. Is n >= g? False Suppose -12 - 32 = -2f. Let x = 21 - f. Let w be (2/x + 30/(-5))1. Which is bigger: w or -9? w Let u = 7.5 + -7.4. Is u less than 7287? True Let i = 2166 + -2315. Which is smaller: 6/7 or i? i Suppose 0 = -43s + 28s + 15. Let x be ((-8)/(-10))/((-8)/(-20)). Is s less than or equal to x? True Let l = -255 - -267. Suppose 22 = 2a - l. Let x = 9718/597 - -11/199. Which is bigger: a or x? a Let m = 2157.02 + -2157. Which is greater: 195/7 or m? 195/7 Let w be (-36 - -31) + (-1)/(1/(-4)). Let a be -64 - -61 - 95/w. Which is smaller: 90 or a? 90 Let n = 801 - 802.5. Are n and -0.054 nonequal? True Suppose -29x - 102037 = 582x. Which is bigger: -5 or x? -5 Let o(m) = 3m*3 + 15m*2 - 5m - 24. Let y be o(-5). Is y at most -54/223? False Let y be (288/(-27))/(5/(-60)). Is 134 greater than or equal to y? True Suppose 5v + h - 162 = 0, 2v - 34 = v - h. Let s = -1050 - -1409. Let q = s + -329. Is q <= v? True Let p = 810 + -659. Let n be 19 + p + 7/(-1). Is 165 greater than n? True Let m = -14782 - -14770. Which is smaller: -383 or m? -383 Let r(t) = t*2 - 4t - 22. Suppose 2k + 2b = 18, -3k + 14 = b - 7. Let d be r(k). Which is smaller: -11 or d? -11 Let b = -5756/9 + 2054/9. Let f = b - -3728/9. Let o(q) = -q2 - 3q + 1. Let k be o(-2). Are k and f non-equal? True Let j = 110 - 110. Suppose j + 12 = 3i. Suppose 3 - 7 = ip, 4*o - p + 55 = 0. Is -13 bigge	{ "pile_set_name": "DM Mathematics" }
1860 = -45m. Suppose 19w - 8 = m. Determine l so that 0 + 4/9l + 2/9l*w = 0. -2, 0 Let j = -198 + 347. Suppose -18v + 13 = -j. Factor 3 + va - 21/4a*3 - 27/4a*2. -3(a - 1)(a + 2)(7a + 2)/4 Let u(v) = 2v3 + v2 - 2v - 3. Let d(m) = -9m*3 - 76m*2 - 1357m - 2438. Let f(t) = -d(t) - 4u(t). Solve f(r) = 0 for r. -35, -2 Suppose y + x - 68 = -x, 5y + x - 349 = 0. Let p = -68 + y. Suppose -9 + 42z2 - 41z*p + 8 = 0. Calculate z. -1, 1 Let y = -18459 - -18462. Factor -189/4 - 45/2v*2 - 4v*y - 54v - 1/4v4. -(v + 3)3(v + 7)/4 Suppose -v + 5a - 12 = -0v, 0 = 5v + 3a - 24. Suppose vr - 3g - 27 = 0, 3r - 21 - 11 = 4g. Factor -8w2 + w2 - rw - 4w3 + 8w + 4 + 3w2. -4(w - 1)(w + 1)2 Suppose 4c = 9c - 80. Let g = c - 13. Factor 0d2 - 5 - d2 - gd2 - d2 + 10d. -5(d - 1)2 Let r(q) = 3q*4 + 12q*3 - 22q*2 - 129q - 115. Let x(l) = -2l4 - 8l*3 + 15l*2 + 87l + 77. Let c(h) = -5r(h) - 7x(h). Factor c(i). -(i - 3)(i + 2)2(i + 3) Suppose 0 = 3g + 2 - 8. Suppose 2 = gz - 2. Find j, given that -2j4 + 2j + 0j - 94j*3 + 2j*z + 92j*3 = 0. -1, 0, 1 Suppose t - 8 = 4b, -7b + 4b - 6 = 3t. Let d(i) be the third derivative of 7/60i*5 + 23/24i4 + i3 + ti - 10i*2 + 0. Factor d(g). (g + 3)(7g + 2) Let t = 237/3502 - -1277/7004. Suppose 0 + 0m*3 - 5/4m*4 + tm*5 + 0m + 0m2 = 0. What is m? 0, 5 Let o(m) be the second derivative of 1/48m*4 + 0m*2 - 4m + 4 - 1/24m3. Factor o(t). t(t - 1)/4 Let p be -5-8(-5)/(-50)2. Suppose 8i - 198 = 74. What is s in -is4 + p - 61s*2 - 17s - 23s + 8s*5 + 87s*2 + 32s*3 = 0? -1, 1/4, 1, 2 Let t = 4901 + -4898. Let a(u) be the second derivative of 0 - 5/6u*t - u + 5/24u*4 + 0u*2. Factor a(k). 5k(k - 2)/2 Let p(a) be the second derivative of 2a*6/105 + 2a*5/35 - 5a*4/7 + 8a*3/21 + 40a*2/7 + 13142a. Suppose p(q) = 0. What is q? -5, -1, 2 Factor -794/5n - 2/5n*2 - 792/5. -2(n + 1)(n + 396)/5 Let t(k) be the third derivative of -k5/60 - 491k*4/24 - 244k3 + k2 - k - 234. Factor t(j). -(j + 3)(j + 488) Factor 27m + 0 + 141m2 + 91/3m*3 + 5/3m*4. m(m + 9)*2(5m + 1)/3 Let c = -30665 + 214675/7. Suppose 4/7z*5 - 20/7z*2 + cz*4 - 16/7z + 0 + 12/7z3 = 0. What is z? -4, -1, 0, 1 Suppose 4j + 13j = -1275. Let f be ((-18)/j - 0)/(4/20). Factor 0w*3 + 12/5w*2 + f + 16/5w - 2/5w4. -2(w - 3)(w + 1)3/5 Let m be (12/50)/((351/(-43875))/(6/(-25))). Let 6/5q*5 + mq*2 + 26/5q*3 - 16/5 - 8q - 28/5q4 = 0. What is q? -1, -1/3, 2 Suppose 15m - 55 = 20. Factor 120d2 - 255d + md3 - 231 + 617 - 256. 5(d - 1)*2(d + 26) Let g = 355 + 50. Let 93i2 + 15 + 537i*2 + 11 - 340i + gi3 + 14 = 0. What is i? -2, 2/9 Let n(t) be the second derivative of t5/10 + 250t*4/3 - 2012t*3/3 + 2016t*2 - 13t - 16. Solve n(o) = 0. -504, 2 Let y(s) = 26s3 - 2368s*2 - 175249s. Let m(l) = 3l3 - 296l*2 - 21906l. Let f(z) = -17m(z) + 2y(z). Find n, given that f(n) = 0. -148, 0 Let x(m) be the third derivative of 3/2m3 + 11/4m*4 + 5/24m*7 + 61/48m*6 + 0m + 0 + 643/240m5 + 98m*2. Let x(f) = 0. Calculate f. -2, -3/5, -2/7 Suppose 2/7z*4 + 10/7z - 12/7 - 10/7z3 + 10/7z*2 = 0. What is z? -1, 1, 2, 3 Suppose 790 = 203a + 192a. Let y(f) be the third derivative of -1/735f*7 - 1/84f*4 + 1/420f*6 + 1/210f*5 + 3f*a + 0 + 0f + 0f3. Factor y(j). -2j(j - 1)2(j + 1)/7 Suppose 2b - 24 = -4b. Suppose -2o - o = c - 26, -136 = -4c - bo. Factor -10a + 19 - 2a2 - 3a*2 - c + 14. -5(a + 1)*2 Suppose 180g - 180g3 - 2/5g*4 - 902/5 + 904/5g*2 = 0. What is g? -451, -1, 1 Let k = 3191947/1241310 - 1/177330. Determine u so that ku - 24/7u2 - 18/7u*3 + 3 + 3/7u*4 = 0. -1, 1, 7 Let v(o) be the third derivative of -13o*5/5 - 157o*4/8 - 3o*3/2 + 34o*2 - 34. Suppose v(g) = 0. What is g? -3, -1/52 Let j(l) = 2912l - 55326. Let q be j(19). Factor 1/8s3 - 3/2 - 7/8s*2 + qs. (s - 3)(s - 2)2/8 Let i = -88961 + 88961. Factor -2/3n*2 - 6n + i. -2n(n + 9)/3 Suppose 2035j - 2040j + 15 = 0. Determine s, given that 15s + 0 + 40s*2 + 5/3s*5 + 110/3s*j + 40/3s4 = 0. -3, -1, 0 Let i(c) be the second derivative of -c6/240 - 47c5/80 - 185c*4/96 - 23c*3/12 - 1418c + 4. Let i(x) = 0. Calculate x. -92, -1, 0 Let b(f) be the second derivative of -f7/3780 + f6/216 + f5/30 - f4/4 - 2f3/3 + 33f. Let v(z) be the third derivative of b(z). Solve v(l) = 0 for l. -1, 6 Suppose -55p4 - 77p*4 - 147p - 97p + 84p - 48 + 60p2 + 280p*3 = 0. What is p? -6/11, -1/3, 1, 2 Suppose 2/7s*4 - 138/7s*2 + 1080/7 - 306/7s + 34/7s3 = 0. Calculate s. -20, -3, 3 Suppose m + 3m - 116 = -2x, 308 = 5x + m. Factor -xl - 15 - 6 - 34l*2 + 1 - 26l*3 - 32l*2 - 2l*4. -2(l + 1)*3(l + 10) Let v(h) = 5h2 + 858h - 36127. Let d(t) = 140t2 + 23170t - 975430. Let b(n) = 2d(n) - 55v(n). Factor b(o). 5(o - 85)2 Let p = -434 - -436. Suppose -3q + 8q - 18 = pn, -q - 5n = 18. Factor 0y*q - 4/3y + 0 + 1/3y3. y(y - 2)(y + 2)/3 Let g(w) = -3w + 3. Let s(y) = 13y - 13. Let z(m) = -9g(m) - 2s(m). Let x(n) = 2n*2 + 102n + 1146. Let k(j) = x(j) - 6z(j). Factor k(v). 2(v + 24)*2 Let n be (2 + -1)(12 - (3 - -9)). Suppose -18g + 23 + 31 = n. Factor 0p*g + 2/15p*5 + 0p + 0 + 0p2 - 2/15p*4. 2p*4(p - 1)/15 Let o(b) be the first derivative of -4b3/3 + 62b*2 + 264b + 1143. Find c such that o(c) = 0. -2, 33 Suppose 9z + 2 - 47 = 0. Factor -147h*z + 152h*5 + 2h*4 + 3h*4. 5h*4(h + 1) Let x(h) be the second derivative of -1/48h4 - 1/80h*5 + 0h*2 + h + 1/120h*6 + 157 + 1/168h*7 + 0h3. Factor x(d). d2(d - 1)(d + 1)*2/4 Let r(f) be the second derivative of -11/18f*4 - 8/15f*5 + 1/2f*2 + 13/18f*3 + 4 - 15f. Suppose r(o) = 0. Calculate o. -1, -3/16, 1/2 Suppose -v + 11v = 30. Find l such that -4 + 2047l + 5lv - 2047l + 11l2 + 2l*4 - 14l3 = 0. -1/2, 1, 2 Let j(n) be the second derivative of n6/90 - n5/30 + n4/36 - 175n - 5. Suppose j(k) = 0. Calculate k. 0, 1 Solve -15/4i*2 - 21/8i*3 + 0 + 3/8i*4 + 6i = 0 for i. -2, 0, 1, 8 Let k(f) be the second derivative of 3f5/40 + 5f*4/8 - 2f*3 - 9f*2 - 26f + 15. Find g, given that k(g) = 0. -6, -1, 2 Suppose -3b = 398 + 886. Let h be (-3 + b/(-140))/((-7)/(-70)). Suppose 32/7c*3 - hc*4 - 88/7c*2 - 36/7 + 96/7c = 0. Calculate c. 1, 3 Suppose 32 = 3g - k, 5k - 34 = -3g + 4k. Let a be -4 + 2 - g/((-484)/92). Factor 0 + 0t + at*4 - 2/11t*3 + 0t2. t3(t - 2)/11 Let m = 993913/3469213 - -240/2791. Let b = m - 1/113. Determine i, given that 2/11i*3 + b - 2/11i - 4/11i2 = 0. -1, 1, 2 Let x(s) be the third derivative of s6/24 + 11s*5/12 - 1505s*4/24 + 6125s*3/6 - 211s*2. Factor x(r). 5(r - 7)*2(r + 25) Let n(y) = y3 + y2 + 40. Let g be n(0). Let h = -10086 - -10088. Factor 5z3 - 15z + 90 - gz2 - 14z*2 + 34z*h. 5(z - 3)*2(z + 2) Let h(i) = -3i2 - 2i - 4. Let g(r) = 12r2 + 9r + 15. Let z be (32/4 - 10)2/(-1). Let m(f) = zg(f) + 15h(f). Factor m(y). 3y(y + 2) Suppose -83 = 49f - 328. Let q(v) be the second derivative of -2v - 1/24v*4 + 0 - 1/180v*6 + 0v*2 - 1/40v*f - 1/36v*3. Factor q(j). -j(j + 1)*3/6 Factor -1026 + 622 - 1162f - 1912 - 2f2. -2(f + 2)(f + 579) Let p(s) be the third derivative of -s8/112 - 3s*7/70 + 21s*6/40 + 83s*5/20 + 15s*4/2 - 24s*2 + 1. Let p(x) = 0. Calculate x. -4, -3, -1, 0, 5 Let m(b) be the first derivative of -28/3b*3 + 0b + b*4 + 12b*2 + 60. Let m(d) = 0. Calculate d. 0, 1, 6 Let x(d) = 4d. Let u(p) = 2p2 - 26p - 20. Suppose -2m - 12 = -14. Let b(g) = mu(g) + 5x(g). Determine s, given that b(s) = 0. -2, 5 Let j(a) = 2a*2 + 3a - 44. Let n be j(-6). Let x(z) be the second derivative of -nz + 1/28z*4 + 0 - 9/14z*2 - 1/7z*3. Find o, given that x(o) = 0. -1, 3 Find k, given that 147/4k*3 + 234k - 1701/4k2 - 33 = 0. 2/7, 11 Let i(y) be the third derivative of -y6/360 + 13y*5/60 + 23y*4/36 - 40y*3/3 - 49y*2 + 6. Factor i(k). -(k - 40)(k - 2)*(k + 3)/3 What is n in 9	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.