Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
at is the biggest value in -4/5, -4, o, -2? o Let w be 0 + (-15)/12 - (-59)/((-68204)/(-1309)). Let q = -47 - -330/7. Let s = -233/6 + 39. What is the smallest value in -1/2, q, s, w? -1/2 Let b = 36.7 - 35.6. Let i = -12.3 - -9.3. What is the biggest value in -9, i, b? b Let r = 4774 - 4774. What is the fifth smallest value in 3, 0.2, r, -5, 191? 191 Let y = 0.9 - 30.9. Let m = -29.84 - y. Suppose -3z - 12 = k, 2z + 2k - 6 = -14. Which is the second smallest value? (a) z (b) m (c) -4/3 c Let k = -5.49 - -5.45. Let f = -33 - -10. Let p = 22.7 + f. What is the smallest value in -5, k, p? -5 Let k be 66/(-825) + 236/450. Let s = -17.4 + 15. Let v = s + 0.4. Which is the second smallest value? (a) 5/3 (b) v (c) k c Let j = -0.1 + -0.2. Let k = 1041/5080 - 5/1016. Which is the biggest value? (a) -4 (b) j (c) k (d) 4 d Let z = -5 + 5.22. Let d = z - 0.42. Let l = d - 0. What is the second smallest value in 0, 4, l? 0 Let m(s) = -s2 - 2s - 2. Let v be m(0). What is the second biggest value in 1/5, v, -4/19? -4/19 Let o be (96/58 + -2)/(-23 - -24). Let v = o - -99/203. Let j = -5.4 - -5. What is the second biggest value in 12, v, j? v Let n = -35059 + 35056. Let w = -0.2 - -0.3. Which is the third smallest value? (a) 0.6 (b) 2 (c) w (d) n a Suppose 4p - 22 = -a, 5a = p + 17 - 12. What is the second smallest value in -2, -0.05, p, 2? -0.05 Let f = 0.24 - 0.04. Let v = -242.1 + 242.5. Which is the third biggest value? (a) f (b) 3/4 (c) v (d) 2 c Let k = 8886 - 8883. Which is the smallest value? (a) 1.4 (b) k (c) 13 a Let u = 56079 + -56085. Let j = -4.9 + -0.1. What is the third smallest value in 3, u, j? 3 Let l = -12751 - -12758. Which is the smallest value? (a) -2.5 (b) l (c) 2 a Let p = 1189/792 + -1/792. Which is the fourth biggest value? (a) -1.9 (b) p (c) -6 (d) -1 (e) -0.2 a Let p = 0.38 + 0.12. Let m = -110 + 190. Let n = -76 + m. What is the third biggest value in p, n, -0.1? -0.1 Let m be (-6)/15 - (-4)/10. Let j = -112.9 - -112.4. Which is the smallest value? (a) -2 (b) m (c) 4 (d) j a Let r = -178 - -161.7. Let s = -51.8 - r. Let j = s + 36. What is the third smallest value in -3, j, -1? j Let x = 137 + -55. Let t = x - 34. Let q = 51 - t. Which is the third biggest value? (a) -1 (b) 0 (c) q (d) -0.02 d Let r = -7 + 75/11. What is the third biggest value in 1/6, -1, r, -2/169? r Suppose 3b - 5j + 17 - 83 = 0, 2j = b - 21. Suppose -2f = g - b, -2f + 52 = 4g + 10. What is the smallest value in f, -2, -1/3, 1/4? -2 Let v = 3.7 - 30.7. Let o = -28 - v. Let w = 2797/13 - 215. Which is the smallest value? (a) 2/17 (b) w (c) o (d) 5/2 c Let m = -0.343 + 0.079. Let k = m + 0.064. Let d = -0.8 + 0.3. What is the second biggest value in 3, d, -0.1, k? -0.1 Let o = -14.2 - -13.2. Let b = 1583 - 1585. What is the biggest value in -3.7, o, b? o Let i = -0.1 + 2.1. Let s = -0.524 + 0.63. Let m = s + 0.894. What is the fourth biggest value in m, 13, -1, i? -1 Let g = -1.95 - 0.05. Let q be (11920/(-200) - -59)(8/3)/(-4). Which is the third smallest value? (a) g (b) q (c) 0.11 b Let d = 2/31 + -349/3968. Let g = d - 45/128. What is the biggest value in g, 0.08, 0? 0.08 Let k = 30.349 - -5.651. Which is the smallest value? (a) 2/9 (b) k (c) 0 c Let z = -3470.1 - -3470. What is the biggest value in z, -2/485, 0.1? 0.1 Let q = 88.1 + -83.1. What is the third smallest value in -0.3, 63, q, -1/7, -3? -1/7 Let r = 0.252 + 0.208. Let s = r + 2.54. Which is the second biggest value? (a) 0 (b) 0.3 (c) s b Let f = 13/55 - -113/220. What is the third smallest value in -0.286, 0.1, f? f Let j = -26617/3584 + -1/512. Which is the third biggest value? (a) 1/3 (b) j (c) -11 (d) 0.4 b Let v = 4.95 - -0.05. Let n = -176/53 - -2500/689. What is the biggest value in n, 3/2, v? v Let s = -4.5 - -0.5. Let q be 6161/(-138)(-26)/(-91). Which is the fourth biggest value? (a) s (b) -3 (c) 2 (d) q a Let q = 15694 - 15694.3. Which is the smallest value? (a) 13 (b) -85 (c) -4 (d) q (e) -0.4 b Suppose -2d + 22 = 5g, 8 = -g - 5d + 17. Suppose -gn + 7 = -1. What is the biggest value in -2/5, 15, n? 15 Let l = 477 + -476.88. Suppose 14 + 10 = 12i. What is the biggest value in i, 8, l? 8 Let t be (11/(-3) - -4)/(9/(-135)). Let h = 15 + -14.9. Which is the second biggest value? (a) h (b) t (c) 2/3 (d) -0.54 a Let n = -198 - -102. Let a = -97 - n. What is the biggest value in a, 0.5, -2/9, 4? 4 Let z = 1.9 + -2. Let n = 402.2 + -12.2. Let c = 381 - n. What is the smallest value in c, z, 2? c Let f = 110.734 + -110.334. Let o = -0.5 + 1.5. Which is the second smallest value? (a) o (b) f (c) -0.2 (d) -5 c Suppose 0 = 3a + 4u + 13, -106u - 7 = a - 102u. What is the second biggest value in 1/3, 94, 4, a? 4 Let y = 196298/5 - 39260. Let v = 71/5 + -69/5. Which is the third biggest value? (a) y (b) 0.5 (c) v a Let f = 0.21 - 0.06. Let i = -9.15 + f. Let j be (-4)/((-24)/(-21)) - -3. What is the smallest value in 3/7, 3, j, i? i Let q = 8.2888 + -0.2888. Let p = 3 + -23/8. Which is the fourth smallest value? (a) q (b) 3/4 (c) 0.5 (d) p a Let f = 46 - 46.3. Let c = 27.1 + -27. Let h = 0.1 - c. What is the second smallest value in f, h, -2/17? -2/17 Let y(w) = -15w - 379. Let o be y(-25). Let x be ((-63)/14 - o) + -12. Which is the third biggest value? (a) -3/5 (b) -1/2 (c) x c Let p(x) = x + 13. Let t be p(-9). Suppose 2n + 475 = -3n + 470. Let z = -3 - 0. What is the second smallest value in z, t, n, -5? z Let m = -69.8 + 66.26. Let s = m + 3.24. What is the third biggest value in 0, s, -1, 52? s Let p be -733 + (-1)/(-3)(-60)/4. What is the biggest value in p, -0.5, 0.5? 0.5 Let w = 0.624 + -0.324. Let f = 0.046 - -0.054. What is the third smallest value in w, f, -17? w Let y = -0.0311 + -0.0271. Let t = y + 2.8682. Let z = t + 0.19. What is the smallest value in 2/15, -1/17, z? -1/17 Let o = -7 + 9. Suppose 47i - 90 = 7i + 70. What is the smallest value in 0.4, 0.6, o, i? 0.4 Let v = 129.74 - 131. Let n = v - -1.16. Which is the smallest value? (a) -0.4 (b) -3/4 (c) -2/9 (d) n b Let o be (-1 + 139/99)3-15. Let j = -18 - o. Let y = 11 - 16. What is the smallest value in -0.4, j, y? y Let h = 17/297 + 1954/297. Let y = h + -241/33. Which is the third smallest value? (a) 0.2 (b) -0.053 (c) y a Let l be 30/(-120) - 3/4. Let m be l/(-3) - 0/(-2). Let t = -0.5 + 0. What is the second smallest value in m, 1, 0.1, t? 0.1 Let f = -448 - -457. Let o = -0.055 - 12.545. Let p = 13 + o. Which is the biggest value? (a) p (b) f (c) -2/7 b Let q = 7113/22 - 647/2. Let f = 11 - 11.05. What is the third smallest value in -3, q, f? f Let s = -1851 - -1849. Which is the third biggest value? (a) s (b) 138 (c) -5 c Suppose 4a - 2l = -6, -9a - 13 = -5a - 3l. What is the second smallest value in 0.2, -1/12, a, 4? 0.2 Let g = -46 + 48.7. Let d = 1.7 - g. Let m = 0.629 + -0.129. What is the fourth smallest value in 0, d, -3/8, m? m Let g = 0.66 - -163.34. Let x = 164.4 - g. Which is the second biggest value? (a) x (b) 28 (c) -0.5 a Let r = 42 + 39. Let s = -95 + r. Let q be (-5)/s - (-31)/62. What is the third smallest value in q, 4/7, -0.5? q Suppose -5z + 4z + 2t + 19 = 0, -5t - 64 = -4z. Let y = 463.7 + -464. What is the second smallest value in z, y, -0.1, -3? y Let u = 4754 + -9515/2. What is the third biggest value in 0.4, u, 1.1, -3/7? -3/7 Let w = 59.333 - 0.133. Let j = w - 59. Suppose t - 2i - 10 = 0, -2t - i + 3i = -10. Which is the fourth smallest value? (a) t (b) j (c) -6/5 (d) 1 d Let u be 72/(-10)19/(2280/16). Which is the second biggest value? (a) u (b) 2/5 (c) 0.3 c Let n = -54 + 109/2. Let h = -64 - -81. Let z = 20 - h. Which is the fourth smallest value? (a) 0.04 (b) -1 (c) z (d) n c Suppose -d - 4d = 70. Let k = 19 + d. Let b be 4/1466/(-132). What is the second smallest value in -0.3, k, b, 2/5? b Suppose 4x = -x + 20. Let w be (-5988)/(-7984)(-2)/(-4). What is the second biggest value in -2/7, w, -2/13, x? w Let y be ((-2)/6)/(1/1). Let k = 1310.9622 - -0.0378. Let w = k - 1308. Which is the third smallest value? (a) y (b) 9 (c) w b Let c = -20324 - -20333.7. Let r = 0.01 - 0.41. What is the biggest value in 2, c, r? c Suppose -50h	{ "pile_set_name": "DM Mathematics" }
= -13. Calculate f(i) - 13u(i). 13i Let v = -53 - -52. Let b = 6 - v. Let d(q) = 2434q + 1 - 2434q + q*2. Let u(g) = 2g*2 + 2. Give bd(j) - 4u(j). -j2 - 1 Let v = 5534 + -5526. Let q(n) = -5n3 - n2 - 3n + 29. Let g(o) = -14o*3 - 3o*2 - 8o + 86. Give vq(m) - 3g(m). 2m3 + m2 - 26 Let d(o) = 28o*2 - 19o - 24. Let s(u) = u*2 + 3u + 4. What is d(h) + 6s(h)? 34h*2 - h Let n(t) = 15t*2 - 2. Let s(f) = 25f*2 + 12f*2 + 22f*2 - 74f*2 + 16f*2 - 1. Determine n(b) - 2s(b). 13b2 Let q(s) = 815s + 17. Let i(w) = -9w - 2. Determine 18i(k) + 2q(k). 1468k - 2 Let d(k) = 2k3 - 2k*2 + 107k. Let g(w) = -2w3 + 3w*2 - 109w - 1. Calculate -3d(t) - 2g(t). -2t3 - 103t + 2 Let c(a) = 273a + 195. Let r(n) = 39n + 27. Give -2c(s) + 15r(s). 39s + 15 Let y = -77 - -528. Let v(h) = 2 - 1 + 451h - h*3 - yh. Let m(x) = -4x3 - 2x*2 - x + 5. Calculate 2m(n) - 10v(n). 2n*3 - 4n*2 - 2n Let v(s) be the second derivative of -19s5/20 - 4s3/3 + s2/2 - 65s + 70. Let i(b) = 6b*3 + 3b. What is 8i(y) + 3v(y)? -9y3 + 3 Let a = -9 - -5. Let x(j) be the third derivative of -j6/15 - 2j*3/3 - 11j*2 + j - 212. Let l(v) = 25v*3 + 11. Give al(h) - 11x(h). -12h*3 Let n(z) = 3z + 2090. Let t(o) = 3o + 2098. Determine -5n(b) + 6t(b). 3b + 2138 Let t(i) = -29i + 4. Let m(y) be the first derivative of -29y*2 + 9y - 1953. Determine -4m(a) + 9t(a). -29a Let u(w) = -2w3 + w2 - w - 1. Let c be (3/51-2)/(28994/646 - 45). Let p(q) = -5q*3 - 1 + 4q*3 - q + 0q + q*2. What is cp(z) - u(z)? z*3 Let t(y) = 9y + 1. Let a(r) = 542r + 7. What is -a(f) + 5t(f)? -497f - 2 Let j(h) = 9h*2 + 50h - 7. Let p(d) = -31d2 - 199d + 26. What is -11j(y) - 3p(y)? -6y2 + 47y - 1 Let z be (-2)/7 + (-4)/(140/(-255)). Let n be 19/(-133) - -112/z. Let y = n - 28. Let g(c) = 20c. Let s(w) = -w. Give ys(h) - g(h). 5h Let z(x) = -25x + 3. Let r(y) = -1010y + 117. Let l(b) = -b + 2. Let m(t) = -4l(t) - 2r(t). Determine 6m(j) + 484z(j). 44j Let x(s) = -3087s*3 + 42s*2 + 30. Let z(y) = -3y*2 - 2. What is x(i) + 14z(i)? -3087i3 + 2 Let m(o) = -2o + 11. Let u(g) = 5g + 1889 - 3757 + 1836. Determine -8m(z) - 3u(z). z + 8 Let k(i) = 23i*2 - 116i*2 - 1 + 31i*2 + 29i*2 - 7i. Let z(d) = -11d2 - 2d. Determine -2k(o) + 7z(o). -11o2 + 2 Let v be ((-5)/2)/((-460)/184). Let h(w) = w - 23. Let k(d) = -1. What is vh(t) - 5k(t)? t - 18 Let u(b) = b2. Let r(s) = -31 + 56 - 8s*2 + 0s*2 - 6s - 25. Calculate -2r(z) - 18u(z). -2z2 + 12z Let q(i) = 22i2 - 5i - 2. Let b(w) = 44w2 - 9w - 3. Let z be (0 - 3) + (39/(-26))/((-3)/20). Determine zq(f) - 4b(f). -22f2 + f - 2 Let z(o) = 15o + 2667. Let s(n) = 3n + 527. Calculate -21s(d) + 4z(d). -3d - 399 Let t(i) = 5i3 - i2 + 3i + 5. Let h(u) = 4u3 + 4 - 188u - 204u + 394u. Calculate 3h(f) - 2t(f). 2f3 + 2f2 + 2 Let r(k) = k2 - k + 1. Let w(p) = -16p3 + 7p*2 - 7p + 7. Let j be 2/(-2) - (1/6 - 155/(-186)). Give jw(u) + 14r(u). 32u3 Let p(a) = 3a + 10. Suppose 5 + 24 = -64q - 35. Let i(h) = h + 1. What is qp(l) + 6i(l)? 3l - 4 Let o(h) = 43h2 + 13h + 7. Let z(g) be the first derivative of 7g3 + 3g*2 + 3g - 227. Give -4o(v) + 9z(v). 17v2 + 2v - 1 Let w(k) = -6k - 5. Let b be (-41 + 39)(-3)/(-2). Let d(v) = -13v - 9. Determine bd(t) + 7w(t). -3t - 8 Let i(a) be the second derivative of -a*5/10 - 4a*4 + 5a3/6 + a2/2 - 6399a. Let z(m) = -3m*3 - 72m*2 + 8m + 2. What is -8i(j) + 5z(j)? j*3 + 24j*2 + 2 Let i be (-1 - 0)/(-4 - -3). Let s(f) = 3f + 16. Let c(w) = -w. Give is(v) + 5c(v). -2v + 16 Let t(j) = -j2 + 6j - 9. Let n be t(4). Let g(b) = b*3 + 1. Let x(s) = 0s*3 - 2 + 571379s*2 - 571379s*2 + 3s*3. What is nx(d) - 2g(d)? -5d3 Let v(i) = -i3 + 292i2 - 5i + 6. Let l(z) = -3z2 - z + 2. Give -3l(b) + v(b). -b*3 + 301b*2 - 2b Let a(w) = -10w - 24 - 23 + 47. Let u(m) = -5m - 3. Let s(i) = -10i - 5. Let o(v) = -3s(v) + 5u(v). What is 3a(p) + 5o(p)? -5p Let m(z) = -850z2 - 6z + 20. Let a(o) = -849o2 - 5o + 16. Give -5a(i) + 4m(i). 845i2 + i Let v(y) = -2y*2 + 22. Let l(b) = 38b*2 - b + 181. Calculate -l(u) + 6v(u). -50u2 + u - 49 Suppose 4d - 5x - 1 = 0, -d - 5x + 16 = 22. Let a(w) = w3 - w2 + 2w + 6. Let y(r) = r2 - 1. Give dy(u) - a(u). -u*3 - 2u - 5 Let c(r) = 33r - 5. Let x(q) = 98q - 14. Let p(s) = -27s3 + 2511s*2 + s - 98. Let h be p(93). Give hx(z) + 14c(z). -28z Suppose 0 = -5a + 4c + 6, 9c - 13c = 16. Let g(b) = 6b - 3. Let k(x) = x - 1. Determine ak(i) + g(i). 4i - 1 Let x(r) = 5r*3 - 11r*2 - 26r - 5. Let i(g) = -3g3 + 7g*2 + 17g + 3. Give 22i(n) + 14x(n). 4n3 + 10n - 4 Let l(j) = -92j2 + 28j + 6. Let v(o) = -836o2 + 253o + 55. Give -55l(a) + 6v(a). 44a2 - 22a Let d(g) = -9g3 + 33g*2 - 21g + 21. Suppose 64 = 19o - 11o. Let n(v) = ov2 + 47v*3 - 5v + 5 + 44v3 - 93v*3. Determine -5d(p) + 21n(p). 3p*3 + 3p*2 Let c(d) = 3d*2 + 4d + 3. Let t = -76 + 71. Suppose -4a + 5v - 6v - 17 = 0, 4v + 11 = 3a. Let b(x) = -2x*2 - 2x - 2. Determine ac(w) + tb(w). w*2 - 2w + 1 Let d(c) = -2c - 725. Let b(g) = 8g + 2162. Give 3b(j) + 10d(j). 4j - 764 Let q(c) = 28c*3 + 21c + 10. Let x(s) = 15s3 + 10s + 4. Calculate -2q(h) + 5x(h). 19h3 + 8h Let n(w) be the second derivative of w*3 - 5w*2/2 + 3w. Let t = 0 - 1. Let u(a) = 62a + 1236. Let c be u(-20). Let h(j) = -j + 1. Give ch(o) + tn(o). -2o + 1 Let d(z) = z + 11. Let a(w) = -25w2 - 4w - 43. Determine -a(k) - 4d(k). 25k*2 - 1 Let h(g) = -3g - 7. Let a(z) = z + 1. Let t be (-1 - 1)/(-2) - 1. Suppose t = -4m - 2i - 5 + 15, 4m + 3i = 5. Let f = -4247 - -4248. Give fh(c) + ma(c). 2c - 2 Let k(h) = 67h*3 + 2396h. Let y(f) = -20f3 - 799f. Determine 3k(u) + 10y(u). u*3 - 802u Let y(z) = -z*3 + 2z*2 + 1. Let t(u) = 2u*3 - 3u*2 - 2. Let l = -5 + 352. Suppose lg - 348g = 3. What is gt(d) - 7y(d)? d3 - 5d*2 - 1 Let c(g) = -86g*2 + 87g + 52. Let z(u) = -19u2 + 22u + 13. What is 2c(k) - 9z(k)? -k*2 - 24k - 13 Let s(d) = -4. Let l(f) = 3701f + 11. Determine l(g) + 3s(g). 3701g - 1 Let i(m) = -106m*3 + 16m*2 - 16m + 16. Let a(d) = 309d + 293. Let o be a(-1). Let n(u) = 21u*3 - 3u*2 + 3u - 3. What is on(l) - 3i(l)? -18l3 Let d(h) = 3h*2 - 5h + 4. Let k(f) = -f*3 + 3f*2 - 6f + 4. Determine 2d(s) - 3k(s). 3s3 - 3s*2 + 8s - 4 Let q(v) = 19v + 3. Let c(g) = g3 - 27g*2 - 326g + 75. Let o be c(36). Let h(m) = 18m + 2. Give oh(x) - 2q(x). 16x Let b(d) = -27d2 + 4d + 2. Let q(y) = -9y - 6049y*2 + 3040y*2 - 4 + 3064y*2. Determine 9b(i) + 4q(i). -23i*2 + 2 Let y(l) = -5l - 3. Let c(p) = -11p. Let i(m) = 32m - 1. Let b(o) = 3c(o) + i(o). Determine 2b(s) - y(s). 3s + 1 Let y(g) be the second derivative of -g5/5 - g4/4 + 4g*3/3 - 3g*2/2 - 271g - 1. Let r(p) = -p3 - p2 + p - 1. Give -6r(c) + 2y(c). -2c3 + 10c Let h(c) = 397684c2 + 784c + 784. Let p(t) = 2533t2 + 5t + 5. Determine 5h(u) - 784p(u). 2548u2 Let u(c) = -c3 + 11c + 4 + 10c - c3 + 12c + 4c3 - 38c. Let s be -1011/2. Let q(f) = f - 1. Calculate sq(m) - u(m). -2m3 + 1 Let q(t) = -t3 + t*2 - t. Let i(w) = -2w*3 + 7w*2 + 6w + 4. Let c(r) = -5r3 + 16r*2 + 13r + 8. Let a(s) = -4c(s) + 9i(s). What is -a(o) - q(o)? -o*3 - o - 4 Let s(u) be the second derivative of 5/6u*3 + 0u*2 + 0 - 30u. Let l(h) = 13h + 3. Let f(n) = n + 1. Let o(j) = 4f(j) - l(j). Determine 3o(y) + 5s(y). -2y + 3 Let j(c) = 232c + 149. Let q(w) = -231w - 119. Calculate 4j(u) + 5q(u). -227u + 1 Let d(c) be the first derivative of 2c2 + 9c - 1. Suppose 6l = 55 - 7. Let w(n) = -11 - 2 - n - l + 18. What is 2d(u) + 7w(u)? u - 3 Let k(t) = 9t + 340. Let p(q) = 12q + 341. Determine 7k(r) - 6p(r). -9r + 334 Let h(g) be the third derivative of g5/30 - g3/6 + 3g2 + 31g - 12. Let q(v) be the second derivative of v3/6 + v2/2 + v. Determine -h(d) + q(d). -2d2 + d + 2 Let t(f) = 22	{ "pile_set_name": "DM Mathematics" }
9952 What comes next: -756, -548, -340? -132 What is the next term in -7648, -30891, -69622, -123835, -193524, -278683, -379306, -495387? -626920 What is next in -221, -897, -2031, -3623, -5673, -8181? -11147 What is the next term in -1096, -853, -612, -367, -112, 159? 452 What comes next: -959, -1843, -2703, -3539? -4351 What is next in -712, -2847, -6436, -11503, -18072, -26167, -35812, -47031? -59848 What is the next term in 82, 175, 448, 991, 1894, 3247, 5140? 7663 What is the next term in 177, 527, 877, 1227, 1577? 1927 What comes next: -151, -287, -441, -625, -851, -1131, -1477? -1901 What is the next term in -239, -644, -1051, -1460, -1871, -2284, -2699? -3116 What comes next: 337, 453, 545, 619, 681, 737, 793, 855? 929 What is next in 13179, 26379, 39579, 52779? 65979 What comes next: -618402, -618400, -618398, -618396, -618394, -618392? -618390 What is next in 46, -26, -98, -170, -242, -314? -386 What comes next: -3, 109, 221, 333, 445? 557 What is next in -554644, -554639, -554634, -554629? -554624 What is the next term in 242042, 242033, 242012, 241973, 241910, 241817, 241688, 241517? 241298 What comes next: 377, 1647, 3761, 6719, 10521, 15167, 20657? 26991 What is the next term in -1144, -2345, -3556, -4777, -6008, -7249? -8500 What comes next: 2035, 1874, 1607, 1234, 755, 170, -521? -1318 What is next in -6146, -6129, -6100, -6059, -6006? -5941 What is next in 379, 472, 591, 742, 931, 1164, 1447? 1786 What is next in 145, 126, 89, 28, -63, -190, -359? -576 What is the next term in -861, -1661, -2459, -3261, -4073? -4901 What is next in 1360, 2679, 3998? 5317 What is the next term in -136, -283, -466, -691, -964? -1291 What is the next term in 69267, 69271, 69283, 69303, 69331, 69367? 69411 What is the next term in -20, -132, -328, -608, -972, -1420? -1952 What is next in -1052, -1057, -1064, -1067, -1060, -1037? -992 What is the next term in -56125, -56128, -56131, -56134, -56137? -56140 What comes next: -2444, -9496, -21250, -37706? -58864 What is next in -828, -904, -980, -1056? -1132 What comes next: -11558, -11698, -11838, -11978, -12118? -12258 What is the next term in 521, 1811, 3871, 6701? 10301 What is the next term in -79, -242, -489, -814, -1211, -1674, -2197, -2774? -3399 What is next in 224, 533, 1372, 3005, 5696, 9709, 15308? 22757 What comes next: -1602, -1674, -1744, -1812, -1878? -1942 What is next in -888, -1766, -2644, -3522, -4400, -5278? -6156 What is next in 2776, 5533, 8290? 11047 What is the next term in 135, 416, 723, 1068, 1463, 1920? 2451 What comes next: 51271, 102551, 153831? 205111 What is next in -8845, -35400, -79659, -141622, -221289, -318660? -433735 What is next in 30147, 120787, 271853, 483345, 755263? 1087607 What comes next: 796892, 1593783, 2390674, 3187565, 3984456? 4781347 What is the next term in -149728, -149730, -149736, -149746, -149760? -149778 What is the next term in 4188, 4196, 4218, 4260, 4328? 4428 What is next in -17273, -17272, -17269, -17264, -17257, -17248? -17237 What comes next: -123, -155, -213, -297, -407, -543, -705? -893 What is next in 21169, 21153, 21127, 21091? 21045 What is the next term in -1504234, -3008467, -4512700, -6016933, -7521166, -9025399? -10529632 What is the next term in -1631, -1669, -1705, -1739, -1771? -1801 What comes next: 250, 535, 820, 1105, 1390, 1675? 1960 What comes next: -7475, -14950, -22425, -29900, -37375, -44850? -52325 What is the next term in -3938095, -3938094, -3938093, -3938092, -3938091? -3938090 What comes next: -16000, -16337, -16676, -17017, -17360? -17705 What comes next: -3570251, -3570250, -3570249? -3570248 What is next in -466, -405, -344, -283, -222, -161? -100 What is the next term in 30, 60, 90, 120? 150 What is the next term in 503, 4741, 16441, 39335, 77155? 133633 What comes next: 7428, 7514, 7600? 7686 What comes next: -726187, -726185, -726183, -726181, -726179? -726177 What is next in -80, -119, -158, -197, -236, -275? -314 What comes next: 1454, 2880, 4308, 5738, 7170, 8604, 10040? 11478 What is next in -441, -1523, -2603, -3681, -4757, -5831, -6903? -7973 What is the next term in 404, 1350, 2296, 3242, 4188? 5134 What is the next term in -242, -452, -660, -866? -1070 What is next in -32, -224, -570, -1082, -1772? -2652 What is next in 17638, 17614, 17574, 17518, 17446, 17358, 17254? 17134 What is next in -39361, -78690, -118033, -157396, -196785, -236206? -275665 What is the next term in -295, -134, 135, 512, 997, 1590? 2291 What is next in -111256, -222510, -333762, -445012, -556260? -667506 What is next in -26590, -53179, -79772, -106369, -132970, -159575, -186184? -212797 What is the next term in 97741, 97736, 97729, 97720, 97709? 97696 What is next in -64629, -64636, -64655, -64692, -64753? -64844 What is the next term in -5817, -11594, -17329, -23016, -28649, -34222, -39729, -45164? -50521 What is next in 53, -26, -147, -310, -515? -762 What is the next term in -82, -199, -368, -613, -958, -1427? -2044 What is the next term in 544, 4341, 14658, 34759, 67908, 117369, 186406? 278283 What is the next term in 19451, 19485, 19519, 19553? 19587 What is next in -10416, -20080, -29744? -39408 What is next in -183, -186, -201, -234, -291, -378, -501, -666? -879 What is next in -2, 115, 272, 469? 706 What is next in -167, -398, -675, -998, -1367? -1782 What is the next term in 206, 447, 700, 965, 1242, 1531, 1832? 2145 What comes next: 42, 284, 900, 2076, 3998? 6852 What comes next: 904, 937, 980, 1039, 1120, 1229? 1372 What is the next term in -5446, -5443, -5452, -5479, -5530, -5611, -5728, -5887? -6094 What comes next: -1235, -2487, -3753, -5033? -6327 What is the next term in 1194950, 1194952, 1194954, 1194956, 1194958, 1194960? 1194962 What comes next: -202347, -202353, -202371, -202407, -202467? -202557 What is next in 161957, 161964, 161971, 161978, 161985? 161992 What is the next term in -307, -1060, -2319, -4084, -6355, -9132? -12415 What is next in 2117, 4270, 6423, 8576? 10729 What comes next: 14609, 14622, 14635, 14648, 14661, 14674? 14687 What comes next: -2050072, -2050083, -2050108, -2050153, -2050224, -2050327, -2050468, -2050653? -2050888 What is the next term in -33098, -66161, -99210, -132239, -165242? -198213 What is next in -263469, -263473, -263479, -263487? -263497 What comes next: 552, 2427, 6014, 11691, 19836, 30827, 45042, 62859? 84656 What comes next: 9451, 9362, 9273, 9184, 9095? 9006 What is next in 2234, 2226, 2202, 2162, 2106, 2034, 1946? 1842 What is next in -288, -423, -648, -963, -1368, -1863, -2448? -3123 What comes next: -110842, -221685, -332528, -443371, -554214? -665057 What is next in -170, -463, -894, -1475, -2218? -3135 What comes next: -2171, -2203, -2297, -2483, -2791? -3251 What is next in 13971, 13917, 13827, 13701, 13539, 13341, 13107? 12837 What is next in -427, -406, -371, -322, -259? -182 What comes next: -177, -406, -635, -864, -1093? -1322 What is the next term in -117, -22, 73, 168, 263, 358? 453 What is the next term in 709, 639, 539, 409, 249, 59, -161? -411 What comes next: 1338, 2723, 4106, 5487? 6866 What comes next: -63, -76, -89, -102, -115? -128 What comes next: -155, -521, -1537, -3533, -6839, -11785, -18701, -27917? -39763 What is the next term in -219849, -219855, -219873, -219909, -219969? -220059 What is the next term in 18, 75, 132, 189, 246? 303 What is the next term in -30, 22, 74? 126 What is next in -79, -616, -1511, -2764, -4375, -6344, -8671? -11356 What is next in -87, -762, -2577, -6102, -11907? -20562 What comes next: 3536, 14151, 31842, 56609, 88452, 127371, 173366? 226437 What comes next: -13037, -13028, -13017, -13004, -12989? -12972 What is the next term in 203, 312, 447, 614, 819? 1068 What is next in 2810057, 11240232, 25290523, 44960930, 70251453? 101162092 What is next in 37422, 37425, 37428, 37431, 37434? 37437 What comes next: -333, -316, -285, -234, -157? -48 What is the next term in 1249, 1389, 1527, 1663, 1797, 1929? 2059 What is the next term in 475444, 950890, 1426336, 1901782, 2377228, 2852674? 3328120 What is next in -1404, -2639, -3888, -5157, -6452? -7779 What is the next term in -1155, -2386, -3693, -5076, -6535, -8070? -9681 What is next in 66190, 132386, 198582, 264778, 330974, 397170? 463366 What is next in -608, -1526	{ "pile_set_name": "DM Mathematics" }
, -29248, -29258? -29268 What comes next: 24, 43, 86, 165, 292, 479, 738, 1081? 1520 What comes next: -989, -1108, -1227, -1346, -1465? -1584 What comes next: -17042, -34051, -51032, -67973, -84862, -101687, -118436, -135097? -151658 What is the next term in -803, 279, 2089, 4633, 7917? 11947 What is next in 3642, 3643, 3644, 3645? 3646 What is next in 359, 1614, 3705, 6632, 10395? 14994 What is the next term in -277063, -554128, -831193, -1108258? -1385323 What comes next: 142647, 285296, 427945, 570594, 713243, 855892? 998541 What comes next: 1827, 1692, 1471, 1164, 771? 292 What comes next: -682, -677, -670, -661, -650? -637 What comes next: -140, -157, -206, -305, -472? -725 What is the next term in -4063, -8141, -12233, -16345, -20483, -24653, -28861? -33113 What is the next term in -18184, -18212, -18278, -18400, -18596, -18884, -19282? -19808 What is next in -1183, -1151, -1107, -1051, -983, -903? -811 What is the next term in 15, 4, -91, -276, -557, -940, -1431? -2036 What comes next: 3148, 6319, 9490? 12661 What is next in -20911, -20880, -20797, -20638, -20379, -19996, -19465? -18762 What is the next term in -12, 57, 238, 531? 936 What is next in 3460, 3440, 3420, 3400, 3380? 3360 What is the next term in -168, -626, -1392, -2466, -3848? -5538 What is the next term in -288, -271, -248, -219, -184, -143, -96? -43 What comes next: 5658, 5625, 5588, 5547? 5502 What comes next: -1517560, -3035120, -4552680? -6070240 What is next in -3094, -2880, -2666? -2452 What is next in -538, -4231, -14280, -33871, -66190, -114423, -181756? -271375 What is next in -4464, -8815, -13166, -17517? -21868 What comes next: 343, 368, 393, 418, 443, 468? 493 What comes next: 41181, 41186, 41191, 41196, 41201, 41206? 41211 What is next in 73712, 147425, 221130, 294821, 368492? 442137 What is next in 357, 444, 583, 774, 1017? 1312 What is next in 4285, 8564, 12843, 17122? 21401 What is next in -36, -77, -130, -195, -272? -361 What comes next: 113192, 452761, 1018710, 1811039, 2829748? 4074837 What is next in 18226, 18272, 18318, 18364, 18410, 18456? 18502 What is next in -49921, -99798, -149673, -199546, -249417? -299286 What is the next term in -306971, -307030, -307137, -307298, -307519, -307806, -308165, -308602? -309123 What is next in 795, 805, 841, 915, 1039? 1225 What is the next term in 268, 247, 220, 187? 148 What is next in -1705, -1613, -1509, -1393, -1265? -1125 What comes next: 345, 305, 167, -117, -595? -1315 What is the next term in -7857, -7875, -7893, -7911, -7929, -7947? -7965 What is the next term in 58078, 464591, 1567982, 3716689, 7259150, 12543803? 19919086 What is the next term in 681, 388, -393, -1908, -4403, -8124, -13317, -20228? -29103 What comes next: 215, 424, 633, 842, 1051? 1260 What is next in -245463, -490925, -736385, -981843, -1227299, -1472753, -1718205? -1963655 What is the next term in -11446, -22893, -34336, -45775, -57210, -68641? -80068 What comes next: 36106, 36084, 36056, 36022, 35982, 35936, 35884? 35826 What is the next term in 13489, 26967, 40437, 53899, 67353, 80799, 94237? 107667 What is next in -362, -195, -28? 139 What is next in 109, 98, 49, -56, -235, -506, -887? -1396 What is the next term in -2041, -2043, -2049, -2059, -2073, -2091? -2113 What is next in -201, -173, -87, 87, 379, 819, 1437? 2263 What is next in -316, -538, -760, -982, -1204, -1426? -1648 What comes next: 557, 908, 1273, 1658, 2069, 2512, 2993, 3518? 4093 What is the next term in -287, -452, -615, -776, -935, -1092, -1247? -1400 What is the next term in 3930, 7933, 11936? 15939 What is the next term in -1169, -9488, -32059, -76004, -148445, -256504, -407303, -607964? -865609 What is next in -195, -382, -571, -774, -1003, -1270, -1587, -1966? -2419 What is the next term in -2413, -4817, -7215, -9607, -11993, -14373? -16747 What is next in -1175, -2965, -5369, -8393, -12043, -16325, -21245, -26809? -33023 What is the next term in -272, -371, -468, -563, -656, -747? -836 What is next in -58632, -58633, -58634, -58635, -58636, -58637? -58638 What comes next: -113897, -227795, -341693, -455591? -569489 What comes next: 32, 61, 102, 155, 220, 297? 386 What is next in 493, 972, 1445, 1912, 2373? 2828 What is next in -10705, -10635, -10513, -10339, -10113, -9835, -9505? -9123 What is the next term in 681941, 681942, 681943, 681944? 681945 What is next in 2317, 9568, 21755, 38878, 60937? 87932 What is next in 1131, 2277, 3419, 4551, 5667, 6761, 7827, 8859? 9851 What comes next: -152136, -304267, -456386, -608487, -760564? -912611 What is next in 133, 1290, 4425, 10528, 20589, 35598, 56545? 84420 What is next in -7396, -7390, -7382, -7372, -7360? -7346 What is next in 99890, 99889, 99886, 99881? 99874 What is next in 138, -1663, -6548, -16059, -31738, -55127? -87768 What is next in -199, -417, -631, -841, -1047, -1249, -1447? -1641 What comes next: 168, 1447, 4910, 11649, 22756? 39323 What is next in 268, 218, 168, 118, 68, 18? -32 What comes next: 180, 679, 2030, 4659, 8992, 15455? 24474 What is the next term in -113202, -226388, -339574? -452760 What is the next term in 51, 593, 1495, 2757? 4379 What is the next term in 43240, 43248, 43256, 43264? 43272 What is next in -101842, -203659, -305476, -407293, -509110, -610927? -712744 What comes next: -978, -3407, -7274, -12567, -19274, -27383, -36882? -47759 What is the next term in 3490, 3599, 3708, 3817, 3926, 4035? 4144 What comes next: -90, -195, -328, -489, -678, -895? -1140 What is next in 20232, 20193, 20154, 20115, 20076? 20037 What comes next: -45570, -45574, -45570, -45552, -45514, -45450? -45354 What is next in -42, 175, 536, 1041? 1690 What is the next term in -8918, -9024, -9130, -9236? -9342 What comes next: -206071, -206070, -206069, -206068, -206067, -206066? -206065 What is the next term in 361, 727, 1093, 1459? 1825 What is next in -41, -32, 45, 196, 427, 744, 1153? 1660 What comes next: -1058404, -1058406, -1058408, -1058410? -1058412 What is next in 23381, 23382, 23383? 23384 What comes next: 172, 215, 260, 307, 356, 407, 460? 515 What comes next: -5512456, -5512455, -5512454, -5512453? -5512452 What is the next term in -297, -342, -417, -522? -657 What is next in 2775608, 2775606, 2775604, 2775602? 2775600 What comes next: -463, -1765, -3937, -6979, -10891, -15673, -21325? -27847 What is the next term in 629, 1308, 2143, 3212, 4593, 6364, 8603? 11388 What is next in -15, -251, -899, -2169, -4271, -7415, -11811? -17669 What comes next: 93312, 186624, 279938, 373254, 466572, 559892? 653214 What comes next: 2101, 4202, 6311, 8434, 10577, 12746, 14947, 17186? 19469 What is next in -2214, -2215, -2218, -2223, -2230, -2239, -2250? -2263 What is next in 149738, 299474, 449210, 598946? 748682 What is next in -68404, -68402, -68400, -68398? -68396 What is the next term in 14, 45, 96, 173, 282, 429, 620? 861 What comes next: 99, 986, 3441, 8250, 16199, 28074? 44661 What is next in -1183, -4750, -10693, -19012, -29707? -42778 What comes next: 103, 150, 117, -26, -309, -762, -1415, -2298? -3441 What is next in 1457, 1433, 1391, 1331, 1253, 1157? 1043 What is the next term in -28073, -28079, -28097, -28133, -28193? -28283 What is the next term in -245147, -245160, -245173, -245186, -245199? -245212 What is next in -71, -204, -427, -740, -1143, -1636, -2219? -2892 What is next in -483836, -967683, -1451532, -1935383, -2419236, -2903091? -3386948 What comes next: -22574, -45145, -67716, -90287? -112858 What comes next: -585, -750, -1203, -2088, -3549, -5730? -8775 What is next in -423, -765, -1075, -1335, -1527, -1633, -1635, -1515? -1255 What comes next: -437, -1662, -3667, -6446, -9993? -14302 What is next in 711, 1419, 2121, 2817, 3507? 4191 What comes next: 482944, 482946, 482948, 482950, 482952, 482954? 482956 What is the next term in 1343, 1990, 2641, 3296, 3955, 4618? 5285 What is next in -278645, -278643, -278637, -278627, -278613, -278595? -278573 What is the next term in 458, 910, 1362, 1814? 2266 What comes next: -670, -575, -482, -391? -302 What is the next term in -552, -489, -390, -255? -84 What is the next term in -118, -235, -356, -481? -610 What is next in -522, -1874, -4124, -7266, -11294? -16202 What is next in 856192, 1712380, 2568568? 3424756 What comes next: -50, -297, -	{ "pile_set_name": "DM Mathematics" }
easing order. n, j, -0.2 Let t = 58/423 + 4/47. Sort 1/6, t, 2, -1/7. -1/7, 1/6, t, 2 Let r(i) = -i - 4. Let q be r(-6). Let j = -3299 + 3298. Put 4, q, j in descending order. 4, q, j Let g = 1642.3 + -1642. Sort g, 1, -15. -15, g, 1 Let v = 1 + 0. Let g be (-31 + 32)(-12)/(-3). Sort -1, v, 0, g. -1, 0, v, g Let j = 638.2 + -733. Let v = j + 95. Put -4, v, 3 in decreasing order. 3, v, -4 Let a = 31801/5 - 6360. Let y be (-841)/(-330) + (-2)/(-6). Let w = -27/10 + y. Put w, -2/7, a in ascending order. -2/7, w, a Let w be (-2(-2)/(-4))/3. Put -3/2, w, -2/13, -1 in decreasing order. -2/13, w, -1, -3/2 Suppose 80 = -142g + 132g. Put 1, g, 12 in increasing order. g, 1, 12 Let t(z) be the first derivative of z*4/4 + 8z*3/3 + 5z*2/2 - 9z - 3. Let w be t(-7). Let p = 7 + -8. Sort -2, p, w in descending order. w, p, -2 Let r = 6765 + -6766. Suppose 0 = -0m + 2m + 16. Let f be 0/(4/(-1 + 3)). Sort m, f, r in ascending order. m, r, f Let q be (2/25)/((-114)/30 + 4). Sort 1/8, 3, q in ascending order. 1/8, q, 3 Let n be (0 + -3)1 - -31. Suppose -17c - n = -10c. Sort 0, c, 3, -2. c, -2, 0, 3 Let t = 8944/21 + -426. Sort t, 1/4, -15, -0.1. -15, -0.1, t, 1/4 Let v be 1/(-3)2(-22 + 16). Let b(k) = k2 + 6k + 1. Let u be b(-7). Put u, v, -4 in ascending order. -4, v, u Let z = 279.8 + -247. Let i = 33 - z. Let f = -1.02 + 1. Put f, 2/3, i in decreasing order. 2/3, i, f Let y = -0.291 + 0.091. Sort 1/2, 4/5, y, 2/13 in descending order. 4/5, 1/2, 2/13, y Let o = 43 - 39. Let a(q) = -q*2 + 6q - 7. Let j be a(5). Sort o, j, -3 in descending order. o, j, -3 Let y(t) = 20 - 12 + t - 5t - 11. Let b be y(-3). Let r be b/2 + (-4)/8. Sort 2, 0.2, r in decreasing order. r, 2, 0.2 Let z(n) = n3 - n2 - n - 2. Let d be z(2). Let b(m) = m3 - 4m*2 - 3m + 10. Let u be 1 - 1/(2 - 14/6). Let h be b(u). Put d, 3, h in ascending order. h, d, 3 Let b be (-2)/13 + 1107/351. Let p = -12 + 13. Sort -6, b, -2, p in descending order. b, p, -2, -6 Suppose -4v - 3 = -y, 2 = -5v - 26y + 29y. Put v, 2, 5 in decreasing order. 5, 2, v Let r(y) = -y*2 + 6y - 5. Let v be r(4). Suppose 0 = -vm - 9 + 21. Put 2/7, m, -2 in ascending order. -2, 2/7, m Suppose -60 = 3n - n. Suppose -10 - 25 = 7t - 2m, -3t = m + 2. Sort 2, t, 1, n in ascending order. n, t, 1, 2 Let j(u) = u3 + 3u*2 + 8u + 20. Let b = 63 - 66. Let m be j(b). Suppose -v - 12 = 3x - 4, 3x - 3v = 0. Put 0, m, x in descending order. 0, x, m Let m = -26 - -23. Let x be (1 - 11 - -1) + 4. Sort 3, m, x in descending order. 3, m, x Let z = -3/7 - -2/21. Let d = 5.12 + -0.12. Sort d, 2, z. z, 2, d Let b = -30 + 25.4. Let c = b + 3.6. Put 2, c, 4/5 in decreasing order. 2, 4/5, c Let s(k) = k2 - 20k + 108. Let c be s(10). Put -1, 4, 11, c in increasing order. -1, 4, c, 11 Let o = -341 - -336. Put -7, -3/5, o, -0.3 in increasing order. -7, o, -3/5, -0.3 Let k(i) = -14i + 136. Let u be k(10). Sort 32, -0.2, u in ascending order. u, -0.2, 32 Let g = 333 - 324. Put g, 0, 4, -5 in increasing order. -5, 0, 4, g Let j be (11/((-11)/10))/2. Let p be (52/(-20) - 9/(-15))/j. Let q = -0.7 + -3.3. Sort p, -0.8, q in ascending order. q, -0.8, p Let x = 50 - 45. Sort x, -105, 1 in descending order. x, 1, -105 Suppose 145 = 2k - 5d, -5k = 3d - 273 - 12. Sort -5, -3, k. -5, -3, k Let c = -7 - 2. Let p = c + 4. Let o = 17.1 + -17. Sort p, -4, o in decreasing order. o, -4, p Suppose -10 = -5j - 5l, -3j - 3l = -2l + 4. Sort -5/4, 2, j, 5 in descending order. 5, 2, -5/4, j Suppose 49o = 7o. Sort o, -4, 2. -4, o, 2 Let k(r) = -r*2 - 22r - 113. Let p be k(-12). Sort 1/9, 5, p in increasing order. 1/9, 5, p Let c = -148 - -158. Sort 0.1, -2, c. -2, 0.1, c Let f = -505.8 - -506. Put -0.3, -3, 0, f in decreasing order. f, 0, -0.3, -3 Let t(l) = -l*3 + 17l2 - l + 15. Let y be t(17). Let h = 29 - -7. Let j be ((-54)/h)/((-3)/8). Sort 3, j, y in descending order. j, 3, y Let l(o) be the first derivative of -o4/4 - 2o3 + 4o*2 + 8o + 1. Let f be l(-7). Sort f, -7, -2 in decreasing order. f, -2, -7 Let l = -18 - -28. Let f = l + -10.1. Put 0.7, f, -2 in ascending order. -2, f, 0.7 Let p(u) = u*3 + 4u*2 - 13u - 12. Let v be p(-6). Let s be (-2)/(-1(-1 - -2)). Put 1, s, v in decreasing order. s, 1, v Let c be 2/3150/(-10). Let k = c - -40. Suppose -2z + 3z + k = 5y, -z + 5 = 2y. Put -1, y, 0 in decreasing order. y, 0, -1 Let u be (18/4)/(27/18). Let p be 1/4 - (-17)/(-4). Sort u, 0.1, p in descending order. u, 0.1, p Suppose 0 = 4x - 7x + 6. Suppose 3k = xk - 6. Let a be -1215/k. Put -4, a, 0 in ascending order. -4, 0, a Let o = 90/11 + -393/44. Let b = -6 + 10. Put o, b, -0.01 in decreasing order. b, -0.01, o Suppose 0 = -9h - 261 + 225. Sort 111, 4, h. h, 4, 111 Let g(m) = -2m - 1. Let a be g(-2). Let u = a - 7. Let r(h) = -4h + 26. Let t be r(7). Put t, u, 0.2 in descending order. 0.2, t, u Let d(c) = 2c*2 - 11c + 35. Let l(u) = -u*2 + 6u - 17. Let x(z) = -2d(z) - 5l(z). Let s be x(5). Let i = 4 - 8. Sort i, s, 2 in decreasing order. 2, s, i Let j(v) = -7v - 94. Let n be j(-14). Put -3, 0, n, -4 in descending order. n, 0, -3, -4 Let l = -1.98 + -0.02. Let a = 0 + l. Let x = 3 + -3.5. Sort x, a, 1. a, x, 1 Let d = 28 + -33. Let y be (-9)/18(-1 + -1). Sort -7, d, y, 3. -7, d, y, 3 Let z = -3.5 + 0.5. Let m = -21.38 - -0.38. Let y = 25 + m. Put z, y, -2/5 in decreasing order. y, -2/5, z Let n = -875 + 875. Let h = 5 - 10. Put h, 16, 3, n in decreasing order. 16, 3, n, h Let r(a) = 4a2 - a + 1. Let j be r(1). Let m be j/(-5)5/(-2). Let n(o) = -o*2 + 2o + 2. Let h be n(3). Put 1, h, m in decreasing order. m, 1, h Let l = 396.59 - 396. Put 0.1, -3/5, l, -3 in increasing order. -3, -3/5, 0.1, l Let n be (4/(-14))/(3/(-42)). Suppose 1 + n = 5d. Suppose 16 = 2f + 3q + 2q, 5f = q - 14. Sort 0, f, d in decreasing order. d, 0, f Let m be (10/4)/(1/2). Let c = 1 + -13. Let h be -3((-40)/c)/m. Sort -1, h, 2/9 in ascending order. h, -1, 2/9 Let q = 95/3 + -32. Let v be (-4)/(-3)(-39)/(-13). Let y = -39 + 38. Put q, v, y in decreasing order. v, q, y Let q = 3/920 + -1897/17480. Put 1, 7, q, 4/5 in ascending order. q, 4/5, 1, 7 Let b(o) = o3 - 11o*2 + 11o - 14. Let r be b(10). Suppose 0 = 4l - l + 3. Sort r, 0, 3, l in descending order. 3, 0, l, r Let u = 0.11 - -3.89. Let g = 1111050 + -21105259/19. Let b = -247 + g. Put u, b, -0.5 in increasing order. -0.5, b, u Suppose -6u + 2u - 480 = 0. Let w = u + 116. Sort w, 0, -7 in ascending order. -7, w, 0 Let m = 328 + -327. Sort m, 0.3, 19. 0.3, m, 19 Let d(i) be the second derivative of i4/12 + i3 - 15i*2/2 + 2i. Let g be d(-7). Put -1, 5, g in increasing order. g, -1, 5 Suppose 127w = 122w. Sort w, 1, 8. w, 1, 8 Let c = 5915/6 + -985. Sort -2/15, c, 4 in ascending order. -2/15, c, 4 Let m(r) = 2r3 + 37r*2 + 18r + 12. Let k be m(-18). Sort -3, k, -4 in descending order. k, -3, -4 Let m be (-3)/(-14)(-8)/3. Let s be -6(-1)/(-3) - (-11)/5. Sort -2/21, s, m in increasing order. m, -2/21, s Let b(g) = -g + 3. Let s be b(-5). Suppose w = -4h - 3, -4w + 10 = sh - 3h. Let f = -5 + 5. Sort f, -5, h in descending order. f, h, -5 Suppose 0 = 27n + 14 + 13. Put 4, n, -2, -4 in increasing order. -4, -2, n, 4 Let i be 4/(-18) - (-704)/(-72). Let b be -3 + ((-4)/i)/((-2)/(-10)). Sort 1, 3, b, 4 in increasing order. b, 1, 3, 4 Let u = 5 + -10. Let r = u + 4. Let o = 5.1 + -1.1. Sort -6, r, o in descending order. o, r, -6 Let y = -14 + 13. Let b = -6.9 + 12.9. Sort -5, b, y in ascending order. -5, y, b Let b = -129 - -135. Sort -6, b, -3 in decreasing order. b, -3, -6 Suppose 5y = -0q - 3q - 3, q - 7 = y. Suppose -5d = -1 - q. Put d, -1, 7 in decreasing order. 7, d, -1 Let u = -1 - 0. Let v = 1 + u. Let h be (-5 + 2)/(24/15 - 1). Sort v, 5, h in increasing order. h, v, 5 Let y(m) = m2 + 50m - 100. Let k be y(2). Sort -42, -2, k. -42, -2, k Let q = 73 - 70. Sort -2, 1, -1, q in descending order. q, 1, -1, -2 Suppose 51f = 29f + 2926. Put 5, 0, f in ascending order. 0, 5, f Let v be 6(-2)/6 - -8. Put 5, -3, v in increasing order. -3, 5, v Let y(n) = 2n*2 + 13n + 18. Let g be y(-7). Suppose -g = -2*p - 31. Put -1, 2, p, 3 in decreasing order. 3, 2, -1, p Let v = -168 + 169. Put 5, -16/9, v in desc	{ "pile_set_name": "DM Mathematics" }
base 11. -32a720 -12225322 (base 6) to base 3 -201221112112 Convert -1022001221221 (base 3) to base 9. -1261857 b7b2 (base 14) to base 16 7be0 Convert -52552522 (base 6) to base 5. -343221403 5824a9 (base 12) to base 3 2122211221010 What is -5a675 (base 11) in base 5? -10243243 89aa (base 14) to base 8 56472 Convert -112021101001202 (base 3) to base 14. -1016468 What is -100111000101100111 (base 2) in base 14? -424bd What is -1959b2 (base 12) in base 16? -6cc56 -21006 (base 10) to base 9 -31730 What is 2104424 (base 6) in base 11? 6a79a What is -9473b4 (base 12) in base 15? -311d31 -14320031 (base 5) to base 15 -2ec46 4102114 (base 6) to base 3 100220022201 ca00 (base 13) to base 8 66626 What is -11576 (base 12) in base 6? -255430 What is 808460 (base 9) in base 7? 4032225 10aca9 (base 13) to base 6 12250410 Convert -6a249 (base 13) to base 16. -2f4c7 1001010101101011 (base 2) to base 7 216343 -101544516 (base 8) to base 11 -97a3133 -1907d (base 15) to base 14 -217c2 What is -15010305 (base 6) in base 10? -514625 Convert -9b24 (base 15) to base 4. -20001310 What is -11540443 (base 8) in base 12? -a2596b 1020021210012 (base 3) to base 8 2377556 What is -7a10a7 (base 16) in base 2? -11110100001000010100111 Convert -33966b (base 13) to base 11. -763a2a What is -329967 (base 10) in base 8? -1204357 What is -1112100202112 (base 3) in base 16? -c6c26 -141361 (base 8) to base 14 -14289 What is -18354 (base 16) in base 8? -301524 Convert 431416 (base 10) to base 5. 102301131 1616631 (base 8) to base 2 1110001110110011001 100101110100000010101011 (base 2) to base 10 9912491 670891 (base 12) to base 2 110010000001111101101 1010001110111101110 (base 2) to base 13 b9837 Convert 47251 (base 12) to base 3. 11211211221 Convert -416219 (base 10) to base 9. -703845 Convert 54065 (base 14) to base 7. 1504155 -100321312 (base 4) to base 7 -405601 -3127112 (base 8) to base 16 -cae4a What is -320103 (base 8) in base 14? -2ab99 11614 (base 12) to base 7 125026 Convert -a575de (base 15) to base 3. -112210221010102 111220022001 (base 3) to base 9 456261 What is -2222112102 (base 3) in base 9? -88472 What is 72532 (base 10) in base 9? 120441 What is -157a97 (base 13) in base 8? -2015533 What is -224113 (base 6) in base 15? -59a3 61123 (base 10) to base 14 183bd -1d1ba (base 16) to base 6 -2315550 Convert -3b13d (base 14) to base 3. -21101211200 What is 2710667 (base 11) in base 9? 8731776 Convert 1101111100100001000010 (base 2) to base 11. 2077686 What is 3311321302 (base 5) in base 14? d3a73d What is 1162526 (base 9) in base 16? 9a3bf -1323240034 (base 5) to base 14 -62c0d8 -b830bb (base 12) to base 15 -3c6b12 What is -1222312010 (base 4) in base 15? -89a0b What is 246260 (base 8) in base 12? 41354 What is 11144 (base 9) in base 5? 214121 Convert 33bb78 (base 13) to base 2. 100101011001111010111 What is 1352223 (base 7) in base 5? 21242001 What is 2010212122101 (base 3) in base 5? 242423132 2154573 (base 10) to base 13 5a58c5 Convert -113131 (base 8) to base 15. -b60e Convert -41411210 (base 5) to base 13. -bc53b What is 2201201 (base 5) in base 14? da32 What is -204110043 (base 5) in base 14? -180c15 -480464 (base 10) to base 5 -110333324 Convert -1010100100010010000 (base 2) to base 4. -1110202100 What is -10100101100011111 (base 2) in base 9? -138245 What is -1667b (base 12) in base 5? -2011223 144080 (base 9) to base 2 10101100011011001 What is -14862 (base 16) in base 11? -58184 554424 (base 6) to base 5 2441014 What is -425464 (base 7) in base 9? -122437 Convert -751747 (base 8) to base 4. -331033213 What is -48658b (base 13) in base 6? -101011030 222201102220 (base 3) to base 12 214436 6987 (base 11) to base 16 23d2 Convert 13044265 (base 7) to base 5. 301000421 What is -564b5 (base 14) in base 9? -348323 What is 1320301332 (base 4) in base 10? 494718 -100111220210 (base 3) to base 6 -4003033 What is -2252521 (base 6) in base 9? -186064 What is -2101049 (base 11) in base 15? -4d2e22 What is -246316 (base 7) in base 13? -178b1 -454987 (base 11) to base 10 -723917 11100111001000011111 (base 2) to base 10 946719 Convert 138071 (base 9) to base 14. 22bac 400314 (base 6) to base 10 31222 What is 1001001111111010111010 (base 2) in base 6? 123544322 Convert -11001000011110001 (base 2) to base 10. -102641 Convert 86581 (base 11) to base 2. 11110101101110000 121102021111101 (base 3) to base 11 4a1a279 What is 11100001002120 (base 3) in base 12? 9311b9 What is 12111002000220 (base 3) in base 14? 55c234 What is 1a54a7 (base 16) in base 12? 6b2747 500761 (base 14) to base 11 157851a Convert 134482 (base 10) to base 7. 1100035 Convert 2182020 (base 12) to base 4. 120120012120 Convert 5522253 (base 6) to base 8. 1031531 What is -252035 (base 6) in base 15? -69e2 Convert 446465 (base 7) to base 4. 103110131 Convert -14700226 (base 9) to base 3. -111210000020220 What is -1a1499 (base 12) in base 13? -13098c -a4c496 (base 14) to base 3 -101110202202211 Convert 361700 (base 9) to base 11. 139709 What is 6601a9 (base 11) in base 14? 1d637a -245ce (base 16) to base 7 -1160143 What is 15235565 (base 7) in base 6? 51102152 Convert 22240422 (base 5) to base 4. 233330022 What is 10024012444 (base 5) in base 11? 5700183 -25603325 (base 8) to base 14 -a866c5 What is 103112013 (base 4) in base 11? 54596 1313032321 (base 4) to base 11 303a1a -13037 (base 13) to base 11 -24499 535660 (base 9) to base 2 1001101111010001001 141824 (base 9) to base 8 251244 203129 (base 10) to base 2 110001100101111001 What is 451399 (base 10) in base 6? 13401451 Convert -11645 (base 9) to base 5. -222232 What is -661736 (base 8) in base 10? -222174 What is -386b50 (base 13) in base 7? -14352435 -1305048 (base 9) to base 10 -712277 -24400245 (base 6) to base 7 -6416231 14345303 (base 6) to base 9 835663 Convert 1010002253 (base 6) to base 5. 10122430134 What is -4232022 (base 5) in base 2? -10001010011100111 What is 203235135 (base 6) in base 4? 31123110203 Convert 1402234 (base 5) to base 9. 43014 Convert -1000010000100100011 (base 2) to base 14. -708a7 22212433 (base 5) to base 9 326121 1023214312 (base 5) to base 2 1000010000001111111011 Convert 20220332022 (base 4) to base 11. 1307784 What is -e109 (base 16) in base 14? -16dcd What is -31322022 (base 4) in base 15? -11d30 What is 223023232 (base 4) in base 9? 288561 202012220012 (base 3) to base 11 251aa0 3233220011 (base 4) to base 12 3b4005 Convert -3200302 (base 6) to base 12. -76092 Convert -cc9760 (base 13) to base 12. -1744b2a What is -8a300 (base 12) in base 9? -308760 What is 1303105 (base 7) in base 4? 221103001 213540 (base 9) to base 12 617b3 -a53d49 (base 16) to base 10 -10829129 What is 8a6e8 (base 15) in base 3? 211101000002 What is -2571336 (base 9) in base 11? -87a707 Convert 124170 (base 12) to base 16. 489e4 Convert 11321322000 (base 4) to base 2. 101111001111010000000 What is -123967 (base 10) in base 13? -4456c 3b75a (base 13) to base 3 12122102010 What is 11000000110000100110 (base 2) in base 8? 3006046 What is 5a8894 (base 13) in base 12? 882798 What is 30322302310 (base 4) in base 3? 20101001110201 -6153b (base 14) to base 7 -1664004 What is -202467 (base 9) in base 2? -11101010010000101 Convert -4444200 (base 6) to base 9. -371050 Convert 13523462 (base 7) to base 3. 2101100102222 Convert 75b25a (base 16) to base 7. 122363650 Convert 133435 (base 6) to base 11. 9415 Convert -77564 (base 8) to base 3. -1122202110 -ac91e3 (base 15) to base 10 -8232063 What is -2403505 (base 13) in base 9? -22867671 17ab1 (base 12) to base 8 103145 Convert 3430424102 (base 5) to base 16. 750aff What is 10001000110111100001011 (base 2) in base 5? 2122004000 Convert -2760670 (base 10) to base 15. -397e9a -101001111011111111011110 (base 2) to base 15 -e7258a -100001000101010100001 (base 2) to base 12 -443429 -429905 (base 10) to base 6 -13114145 -870877 (base 13) to base 16 -306589 677241 (base 11) to base 12 4400a5 -134692 (base 12) to base 11 -1a8683 402bd (base 15) to base 11 129682 -2791216 (base 11) to base 4 -102110303332 Convert -110103321230 (base 4) to base 12. -19492b8 What is 1531345 (base 7) in base 13? 74416 What is dc2a (base 16) in base 5? 3300422 16216617 (base 8) to base 13 a10983 Convert -3670b (base 15) to base 16. -2a68f Convert	{ "pile_set_name": "DM Mathematics" }
value? (a) -2/9 (b) 14 (c) -5 (d) -0.5 (e) -706 (f) -0.08 (g) -6 b Which is the sixth biggest value? (a) 0 (b) 2/9 (c) 0.4 (d) -2/13 (e) -4/5 (f) 96.377 e What is the fourth biggest value in 5, 12, -28/3, 11/10? -28/3 Which is the fourth smallest value? (a) -0.37 (b) 3 (c) 2.6 (d) -3 (e) -0.1 c What is the biggest value in 1/517593, 2.66, -0.4? 2.66 What is the biggest value in 0.739, 2/49, 11, -0.1, 4, 2/5, 20? 20 What is the third smallest value in 2524, -16/5, 70? 2524 Which is the third smallest value? (a) 221 (b) 70 (c) 394 (d) 3 a What is the fourth biggest value in -7, -8, 3.1811, 0? -8 Which is the smallest value? (a) -2228595 (b) 2/5 (c) 0 (d) 1/6 a Which is the second smallest value? (a) -3169 (b) -1.105 (c) -15 (d) 0 c Which is the sixth biggest value? (a) 4 (b) 1456 (c) -2/3 (d) 0.1 (e) 0.12 (f) 2.3 c What is the sixth biggest value in 1, -14, -0.4, -1, -2/245, -0.8? -14 Which is the third smallest value? (a) 0 (b) 1/11 (c) -27831628 b Which is the smallest value? (a) -32 (b) 8 (c) 0 (d) 1 (e) -1/5 (f) 27 a What is the fourth biggest value in 4, -0.4, 1/2, -17609, -0.3? -0.4 What is the second biggest value in -12, -46, -7/6? -12 What is the biggest value in -327, -241085, 0.4? 0.4 What is the second biggest value in -18, -1/6, 46.61? -1/6 What is the biggest value in 2890/7, -8276, -2/17? 2890/7 What is the second smallest value in 3.55, 5, 85170? 5 Which is the sixth smallest value? (a) -3 (b) -6 (c) 5 (d) 0.24 (e) 0.2 (f) 0.473 (g) -0.03 f Which is the biggest value? (a) 110/9 (b) 0.021 (c) 2/3 (d) -0.1 (e) 234 (f) 5 e Which is the third biggest value? (a) -2/18177 (b) -1/54 (c) 4 b What is the fifth biggest value in 2/79, -1, 0.5, -4/5, 962, 168, 1/4? 2/79 Which is the third smallest value? (a) 24 (b) -0.125388 (c) 3 a Which is the second smallest value? (a) -1/3 (b) -3748.9961 (c) 5 (d) 2/3 a What is the second biggest value in 1, 68, 6, 4/5, 2/9, 1/3, -40/13? 6 What is the second smallest value in -3, -29746, -3/299, -5? -5 Which is the biggest value? (a) 0.2315 (b) 1 (c) -5 (d) -0.24 (e) 2 e What is the second biggest value in -4, 159346, -136? -4 What is the fourth biggest value in 1/2, 1623, -1/3, -3.0225? -3.0225 What is the smallest value in 0.2, -74, -2, -16, 2/5, -242, -4? -242 Which is the second smallest value? (a) 1 (b) 290 (c) 38823 (d) 0.4 (e) -5 d Which is the second biggest value? (a) -3/35 (b) -2 (c) -0.21 (d) 23.9 (e) -4 (f) -0.2 a What is the second biggest value in -19, 0.149, 0, -5, -7, -0.5? 0 Which is the sixth biggest value? (a) 4/9 (b) 121/12 (c) -21 (d) 1/3 (e) -2/7 (f) 6 c Which is the fifth smallest value? (a) -37 (b) 4 (c) -5 (d) 0.136634 (e) -1/4 b What is the third smallest value in 0.141, -12/7, 5, 91/4? 5 What is the second biggest value in -0.2, -2/33, 1.5, 2/5, -3, 7, -3.5? 1.5 Which is the third biggest value? (a) -1/6 (b) 15.17165 (c) 0.31 (d) 2 c What is the fourth smallest value in -1/4, 1269, -0.31, 0, 5, -0.3, 10? 0 What is the fourth smallest value in -16, 9/7, 1748/11, -3, 1/2? 9/7 Which is the second smallest value? (a) 0.3 (b) 257 (c) 4/3 (d) -1 (e) -0.5 (f) -2/7 (g) 4 e Which is the fourth biggest value? (a) -2/15 (b) 47 (c) 273 (d) -0.06 (e) -10 a Which is the smallest value? (a) 12/11 (b) -259 (c) 633 b Which is the third smallest value? (a) -3594 (b) 1 (c) -1.2 (d) 2/3 d What is the sixth biggest value in 1, 2/29, -2/13, -4, 2/9, 143265? -4 Which is the seventh smallest value? (a) -0.3 (b) 1/9 (c) -5 (d) 0.3 (e) 4 (f) -1/7 (g) -76 e Which is the fourth biggest value? (a) -1 (b) 0.2 (c) -196/13 (d) 6.9 c What is the biggest value in 1, 4, 11/3764694? 4 Which is the smallest value? (a) -92 (b) 2 (c) -274/11 (d) 11/5 (e) -1 (f) 1 a What is the second biggest value in 2/5, 8/5, -1.3, 2.1, -0.5, 0.05? 8/5 Which is the sixth biggest value? (a) 1 (b) 3/8 (c) 10 (d) 100 (e) -1 (f) -21 f Which is the fourth smallest value? (a) -0.125 (b) -8 (c) 1/8 (d) -205 (e) -1 (f) -23 e What is the third smallest value in -2/3, 60, 129980? 129980 What is the fifth biggest value in -5, 0.1, -3, -1/274, 0, -2/9? -3 What is the sixth biggest value in -2/13, -3, -1/6, 1/2, 3, 947? -3 What is the second smallest value in -4, -0.01, 0.3, 0.1, 13658/25, 0, 4? -0.01 What is the second biggest value in -40, 151.67, 133? 133 Which is the second biggest value? (a) 1/3 (b) -29 (c) 5 (d) 18/7 (e) 5/4 d What is the second biggest value in -63, 34, -149? -63 Which is the biggest value? (a) -4/3 (b) -2 (c) -160269 (d) 0.03 d What is the third smallest value in -70, 2, 1/5, -0.3, -1? -0.3 Which is the second biggest value? (a) -10 (b) 1.48 (c) 11 (d) -354 (e) 1 b What is the third biggest value in -3558, -2, 17114? -3558 Which is the second biggest value? (a) -960 (b) 5 (c) -1/13 (d) 8 (e) -2/9 (f) -73 b Which is the second smallest value? (a) 2390676 (b) -1 (c) 2/9 (d) 4 c What is the fourth smallest value in 0.2, -0.8, 1, -3/214, 1/20? 0.2 Which is the fifth smallest value? (a) 0.12 (b) 1 (c) 1/23 (d) -8 (e) 4 (f) -1 (g) -3 a What is the fourth smallest value in -0.3, -4, 481.01, 0.3? 481.01 What is the fourth biggest value in -8/29, 2/15, 2/197, 0.4? -8/29 What is the second biggest value in 0.12, 11, -2/79, -21/4? 0.12 What is the third smallest value in -0.025, -1515, -1/21? -0.025 Which is the fourth biggest value? (a) -2/9 (b) 9 (c) 5 (d) 6 (e) 0.09 (f) 3/4 f Which is the third smallest value? (a) 973 (b) -0.2775 (c) -5 (d) -1 (e) 0.5 b Which is the biggest value? (a) -11/48 (b) 3.1 (c) 5.29 c Which is the seventh smallest value? (a) -1/254 (b) -2/53 (c) -3/5 (d) 1 (e) -5 (f) -1/5 (g) 2/15 d Which is the second smallest value? (a) 11786638 (b) -2 (c) -1 c Which is the sixth smallest value? (a) 84 (b) -1.5 (c) -0.106 (d) -4/7 (e) -0.5 (f) -5 a What is the fifth smallest value in -11, -65, -0.4, -47.56, 4? 4 Which is the fourth biggest value? (a) 2/31 (b) -4 (c) 0.06 (d) -1571 (e) 4 (f) -1 (g) 0 g What is the third biggest value in 1.3, 2/11, 295804? 2/11 What is the third biggest value in 3011, -5, 0, 3/4, 0.3, -6/37? 0.3 Which is the sixth biggest value? (a) 2 (b) 1 (c) -1926 (d) 2/7 (e) 0.3 (f) 310/7 (g) 3/7 d Which is the fifth biggest value? (a) 0.3 (b) -1/3 (c) 0.1 (d) 2.551 (e) -2/9 (f) 1.7 e What is the second biggest value in 3, 0.1, -3/5, 4, 38.085, -295/6, -0.3? 4 Which is the sixth biggest value? (a) 2/25 (b) 0.3 (c) -5 (d) 30948 (e) -4 (f) 5 (g) 4 e Which is the third smallest value? (a) -1/4 (b) -6357259 (c) -2/23 c Which is the fourth smallest value? (a) 4 (b) 1/27 (c) 5 (d) -0.03214 c Which is the seventh biggest value? (a) -1/16 (b) -0.4 (c) 4/9 (d) 3215/4 (e) 4/5 (f) -1 (g) 1/2 f Which is the fifth smallest value? (a) -5 (b) 66 (c) -3/5 (d) 1/137 (e) -0.1 (f) -1/4 (g) 0.5 d What is the third biggest value in 8.7, 90037, -2, -3? -2 What is the second biggest value in -4, -3, -1196.2, 0.0082? -3 Which is the second biggest value? (a) -276272 (b) 8 (c) 8/5 c What is the fifth smallest value in -3, -0.04, -277, -0.02, 0, 1? 0 What is the second biggest value in -3/4, 0, -3, -964, -1, -22? -3/4 What is the third smallest value in -5, -3, -473684? -3 What is the biggest value in -10481, -4, 39? 39 Which is the second biggest value? (a) 1.5 (b) 2/3597 (c) 1407/4 a Which is the fourth smallest value? (a) 591790 (b) 0 (c) -0.04 (d) -7/4 a Which is the fifth biggest value? (a) -1 (b) -0.16 (c) -25/3 (d) 7 (e) 0.36 c What is the fifth biggest value in -15, -3, 34/5, 2/9, 13, 3? -3 What is the third biggest value in 265736, 0.4, 1, 1/2, -4? 1/2 Which is the fourth biggest value? (a) 0.5124 (b) 55 (c) -6 (d) -6/11 (e) 2/5 d Which is the second smallest value? (a) -0.7 (b) -5.06 (c) 9.62 a What is the biggest value in -1, 2/145, 3, -13, 4/9, -3/16? 3 What is the third smallest value in 2651/6, 0, 168/31? 2651/6 What is the fifth smallest value in 0.63, -2, -0.68, -0.6, -2/7, -1/9? -1/9 What is the biggest value in 6/7, 2791, 4, -0.06, 0.03? 2791 What is the fourth smallest value in 0, -31, -6.5, 0.094? 0.094 Which is the fourth sm	{ "pile_set_name": "DM Mathematics" }
der when (-126)/(-27)(-5 - -11) is divided by q? 3 Suppose 9 = 2m - 5. What is the remainder when 35((22 + -29)(-10)/7 + -9) is divided by m? 0 Let k = 68 + -55. Suppose 0 = -13p + 221 + k. What is the remainder when 123 is divided by p? 15 Let l = -320 + 343. Calculate the remainder when 548 is divided by l. 19 Suppose 32 = -3a + 386. Suppose 0 = -9f + 11f - a. What is the remainder when f is divided by 10? 9 Let b(c) = 2c3 - 20c*2 + 5c - 73. What is the remainder when 379 is divided by b(11)? 155 Suppose 1 = -8l + 121. Suppose -x + 3a + 6 = 0, -2a = -4x - 2 + 6. Suppose -w - 8 + l = x. What is the remainder when 13 is divided by w? 6 Suppose 0 = -228n + 75n + 126684. Calculate the remainder when n is divided by 20. 8 Let x = 79 + -379. Let j = x + 334. What is the remainder when 164 is divided by j? 28 Suppose -5u - 2h + 14031 = -7817, 13088 = 3u - 4h. Suppose 11w = 373 + u. Calculate the remainder when w is divided by 24. 23 Suppose -575 = 4v - 563, 5d - 3075 = 5v. What is the remainder when d is divided by 64? 36 Let r be 8/36 - 2411/(-9). Suppose 31p + w + 123 = 36p, w + r = p. What is the remainder when 95 is divided by p? 23 Let y be (2/(-3))/(334/2295). What is the remainder when 13/(-65) + 32/y-9 is divided by 12? 7 Suppose -4p = 24, 293d - 6 = 290d - p. What is the remainder when 2113 is divided by d? 1 Suppose -3g - j + 8799 = -8j, 2959 = g + 2j. What is the remainder when g is divided by 20? 7 Let r = -33 - -39. Calculate the remainder when (0 + 268)/23/r is divided by 17. 16 Let y = 927 - 923. Suppose g + 3x = 6x + 30, -5g + 218 = 2x. Suppose -80 = -yc + 2b, -3c + 2b + 16 = -g. Calculate the remainder when c is divided by 6. 4 Suppose -3n = 2n - 20. Suppose 0 = -0f - 3f - nq + 101, 4q = 20. Calculate the remainder when 105 is divided by f. 24 Suppose 2r - 202 = -4i, -9i + 13i = 5r + 181. Calculate the remainder when 1155 is divided by i. 28 Suppose -2a + 3a = 1, 2p = -2a - 10. Let y be ((-2)/(-3))/(p/(-2601)). Suppose -7u + 82 + y = 0. What is the remainder when u is divided by 9? 8 Suppose -73o + 8403 - 5429 = -31555. Calculate the remainder when o is divided by 110. 33 Calculate the remainder when 220 + (-18)/905 is divided by 74. 71 Let n = -2023 - -2123. What is the remainder when 1206 is divided by n? 6 Let v(j) = j*3 + 7j*2 - 23. Calculate the remainder when 41 is divided by v(-6). 2 Let w = 25032 - 24769. What is the remainder when 962 is divided by w? 173 Let t be -2 - (-2 - 1) - 104. Suppose 2r + 140 = -2b, -2b + 40 + 39 = -r. Let s = r - t. What is the remainder when 59 is divided by s? 29 Let f = -14872 + 14887. Calculate the remainder when 333 is divided by f. 3 Let d be (9/6)/(12/32). Suppose 3u + 312 = 3z, -z + dz = -u + 308. What is the remainder when z is divided by 55? 48 Suppose 20n + 2d = 24n + 118, 0 = n + 2d + 32. What is the remainder when (-588)/(-15) + (-2)/10 is divided by 4/20 - (1296/n)/4? 6 Suppose 5067 = 41m - 222. What is the remainder when 509 is divided by m? 122 Let t(u) = u*2 + 10u + 45. Let r(i) = -5i + 19. Let m be r(0). Let b = m - 19. What is the remainder when t(b) is divided by 12? 9 Let n be 29/((5 - (-132)/(-27)) + 0). Let p = n - 242. Calculate the remainder when 111 is divided by p. 16 Suppose -16h + 36 = -10h. Let i(p) = -2p*3 + 16p*2 - 9p + 9. Calculate the remainder when i(7) is divided by ((-20)/8)/(23/h + -4). 14 Let h(x) = -18x - 32. Let o(d) = -37d - 66. Let j(c) = 11h(c) - 6o(c). Suppose -27 = -u + 13. Calculate the remainder when j(3) is divided by u. 36 Suppose 92801 + 32998 = 183j - 65802. What is the remainder when j is divided by 344? 15 Suppose 9 = -o - 3a, 0o = -4o - 3a - 9. Let s = -6017 + 6032. Suppose 3h + r - s = o, 4h - r - 20 = -5r. What is the remainder when 11 is divided by h? 1 Let y = 236 - 198. Suppose 10q - 20 = 5q. Suppose -p - u = p - 29, -p = -qu - 10. What is the remainder when y is divided by p? 10 Let o be 6/3 + (-1 - -4)/3. Let f(w) = wo + 4 - 1 - 379w*2 - 15w + 384w2. What is the remainder when 48 is divided by f(-7)? 8 Let p(n) = -8n*2 + 11n + 161. Let w be p(-8). Let j = 466 + w. Calculate the remainder when 375 is divided by j. 24 Suppose 1211 + 1285 = 12a. Let l = 222 - a. Calculate the remainder when 47 is divided by l. 5 Let d be 4/(-26) + (-804)/(-156). Suppose 27 = 2w + a, 0 = 5w - da - 28 - 17. What is the remainder when 31 is divided by w? 7 Calculate the remainder when 553/(-158)958/(-7) is divided by 12. 11 Suppose 3q = 3b - 5b + 627, -3b = 3q - 939. Calculate the remainder when b is divided by 33/(-44) + (-510)/(-8). 60 Let y(b) = -3 + 5 + 2 - b*2 - 3b + 16. What is the remainder when 5 is divided by y(-6)? 1 Let g(a) = 26a2 - 4a - 1. Suppose 0z - d = -2z + 12, 3z = 4d + 28. What is the remainder when g(z) is divided by 67? 64 Calculate the remainder when (-366)/18-15 + (7 - 5)/2 is divided by 219. 87 Let n(g) = 398g - 14. Let l be n(3). Suppose 39p - l = 19p. What is the remainder when p is divided by 20? 19 Suppose 0 = 15b - 13b - 22. Let t(x) = 17 + b + 5 + 2x - x. Calculate the remainder when t(-17) is divided by 9. 7 Suppose -25330 - 17654 = -24d + 22536. What is the remainder when d is divided by 161? 154 Suppose -2i + 3o + 1320 = 936, 16 = 2o. What is the remainder when 4691 is divided by i? 203 Let f = -38 - -41. Let k be -4 - (f-2 - 4). Suppose 0 = ky - 57 - 87. Calculate the remainder when 69 is divided by y. 21 Suppose 140 = z - b + 2, 0 = 3b + 12. Let f be z/(-2 - -2 - (-8)/(-4)). Let u = f - -118. What is the remainder when u is divided by 9? 6 Let r(z) be the third derivative of z*6/120 - 7z5/60 - z4/12 - 10z3/3 - 5z*2 - 11. Calculate the remainder when 79 is divided by r(8). 23 Suppose -248 = -11m - 39. Calculate the remainder when 49 is divided by (1/9 - 420/135) + m. 1 Let w(j) = 4j - 9 - 3j*2 + 4j*2 + 0j - 14. Let m(l) = -l*2 - 3l + 22. Let v(h) = 5m(h) + 6w(h). Calculate the remainder when v(-14) is divided by 22. 20 Let r be ((-36)/15)/625. Let n = r + 53. Let t = 14 - 1. Calculate the remainder when n is divided by t. 4 Let h(r) = 2r*2 + 378r + 2208. Suppose 0 = -2k - b + 253, 5b - 226 = -4k + 289. What is the remainder when k is divided by h(-183)? 5 Let k(v) = -27v*2 + 81v - 135. Let z(s) = 5s2 - 16s + 27. Let c(h) = -2k(h) - 11z(h). Calculate the remainder when 232 is divided by c(10). 11 Calculate the remainder when -3054(-2)/12 - -14 is divided by 14. 5 Calculate the remainder when ((-30)/(-12))/(105/303870) is divided by 94. 91 Let z be 2/(-10)(-10)/(-2) + 832. Calculate the remainder when (z/(-4))/(-9 + 66/8) is divided by 20. 17 Let g = 84 + -59. Suppose 29x = gx + 92. Calculate the remainder when x is divided by 16. 7 Let g = 171 - 199. Calculate the remainder when 293 is divided by (5 + g/7)21. 20 Let a = -2460 - -2473. What is the remainder when (6/(-9)41)/((-8)/60) is divided by a? 10 Suppose 0 = 4m + 2u - 3648, -3m + 4u + 3764 = 1006. Calculate the remainder when m is divided by 45. 14 Let l(f) = 6f + 94. Let r be l(-11). Suppose -6k + 20 = -2k - 3i, 0 = 3k + i - r. What is the remainder when 87 is divided by k? 7 Let s(l) = -l3 + 11l*2 - 33l + 140. What is the remainder when s(7) is divided by 4/((-2)/(-23)1)? 13 Let t(d) = 2d*2 + 8d + 3. What is the remainder when t(-6) is divided by (30/8)/(10 - (-2175)/(-232))? 3 Let r(w) = 5w + 328. Calculate the remainder when r(-27) is divided by 92. 9 Suppose 0 = 5l + 3q - 9970, 5l - 100q - 9965 = -104q. Calculate the remainder when l is divided by 246. 29 Let h(b) = -114b - 1831. What is the remainder when h(-28) is divided by 26? 9 Let f = 119 + -70. Suppose 2i - 91 + 473 = 4n, 400 = 4n + 4i. What is the remainder when n is divided by f? 48 Let f(b) be the second derivative of b4/12 - b2/2 - 2b - 55. What is the remainder when 139 is divided by f(4)? 4 Let a = -148 - -213. Suppose 932 = -58x + 12010. Calculate the remainder when x is divided by a. 61 What is the remainder when (-87)/116 + (-1435)/(-4) is divided by 109? 31 Let r = -937 + 635. Let d = r + 351. What is the remainder when d is divided by 9? 4 Let f(c) = -6c + 16 - 6*c -	{ "pile_set_name": "DM Mathematics" }
+ 2 - 19c. What is j(-2)? -4 Suppose -7u + 99 = 211 - 91. Let l(r) be the first derivative of -4r2 + r - 1. What is l(u)? 25 Let q(g) = 2g + 2. Let f be q(-3). Let j(m) = -m*2 + 2. Let c(o) = 3o*2 - 2o*2 - 169 - 163 + 329. Let h(z) = fj(z) - 3c(z). Calculate h(-2). 5 Let z(a) = a3 - 6a*2 + a - 4. Suppose 0 = 3t - 4t + 4n - 10, -4t = -3n - 25. Suppose -q = 13 - 29. Let f = q - t. What is z(f)? 2 Suppose -4h + i + 21 = 0, -h - 2h + 3i + 18 = 0. Let j(p) be the second derivative of -2p*3/3 + 2p*2 - 20p - 2. Calculate j(h). -16 Let l = -10 + 4. Let f(c) be the first derivative of -c*3/3 - 4c*2 - 8c - 776. Give f(l). 4 Let n(d) = 4d - 1. Let a(p) = -p - 13. Let x be a(-26). Give n(x). 51 Let v(m) = m3 + 3m*2 - m + 2. Suppose -3y + 0y - 2f = -42, -3y - f = -39. Let t = -20 + y. Let h(i) = -i2 - 9i - 11. Let x be h(t). What is v(x)? 5 Let n(d) = -320d2 + 2 + 6d - d + 319d2. Determine n(5). 2 Let q(z) = z2 - 5z - 1. Let s be q(4). Let v(t) be the first derivative of -t*2/2 - 3t - 188. Give v(s). 2 Let y be 6 + 15/(-10)4/3. Let x(q) = q3 + 5q - 3 - yq2 + q2 + 2q*2 - 3q*2. Determine x(4). 17 Let s = 204 - 172. Let q be (9/6)/(12/s). Let h(g) = -2g + 4. Calculate h(q). -4 Let x(b) = -114b + 108. Let c(u) = -70u + 65. Let m(q) = 13c(q) - 8x(q). Calculate m(9). -1 Let y(c) be the first derivative of -c3/3 + c2 + 119. Suppose -2p + 14 = t + 5, -3t + 25 = 5p. Determine y(t). -15 Suppose 4y = 77f - 74f + 38, 3y - f - 21 = 0. Let t(j) = 11j*2 - 8j - 3. Let k(q) = 5q2 - 4q - 1. Let h(w) = 9k(w) - 4t(w). Give h(y). 8 Let y(p) be the third derivative of -3p2 + 1/24p*4 + 10 + 0p + 0p3. Determine y(3). 3 Suppose -3f = -4h + 8h - 6, 5h + 15 = 0. Let w(y) = -y2 + 3y + 9y - f - 3y - 4y. Determine w(4). -2 Let s be 0 + 0 + 2-2. Let c(t) = -t3 + t2 + 2t + 1. Let b(k) = -5k*3 + 9k*2 + 9k + 9. Let f(o) = -b(o) + 6c(o). Determine f(s). 1 Suppose -108j + 113j + 70 = 0. Let g(o) = -3o - 11. What is g(j)? 31 Let d(k) = k*3 + 7k*2 + 9k + 12. Let f be d(-6). Let h(u) = -u*2 - u - 5. Let m(i) = 4 - 1 - 2. Let t(q) = fm(q) - h(q). What is t(-2)? 1 Suppose 225 = 21o + 183. Let b(q) be the third derivative of 0q + 0 + 1/24q4 - 3q*o - 1/6q*3 + 1/4q*5. Give b(1). 15 Let n(f) = -5f*3 + 4f*2 - f + 9. Let l(d) = 2d3 + d2 - d + 2. Let c(k) = 2l(k) + n(k). Give c(6). -5 Let k(u) = 93 - 123 + 4u + 76 - 2u. Calculate k(-21). 4 Let n(x) = -13x - 1. Let b = -98 + 215. Let c = b + -118. Determine n(c). 12 Suppose 5h = -5, -2x = 6h - 5h + 131. Let u = x - -65. Let o(w) = -w*2 - w - 10. What is o(u)? -10 Suppose 2d - 8 = -2d, d + 8 = 5n. Let g(i) = -i*3 + 10 - 14i*2 - 25 + 0 - 2i + 4in. Determine g(-10). 5 Let n(c) = -2c*2 - 7 + 6 - 4c*3 - 334c + 335c. Determine n(-2). 21 Let o(t) = -t3 + 10t*2 - 13t + 1. Suppose -3w = -0m - 3m - 33, 0 = -5w + m + 47. Give o(w). -35 Let y(c) = -3c3 - 4c*2 - 4c + 53. Let n(d) = d3 + d2 + d - 18. Let i(z) = -7n(z) - 2y(z). What is i(0)? 20 Let l(z) = 12z - 9 - 13z + 0z. Give l(-9). 0 Suppose -4j - 2 = -3k, -4k + 4j = 2j - 16. Let x = 12 + -1. Let w(h) = -6h + 26. Let t(i) = 2i - 9. Let r(n) = xt(n) + 4w(n). Calculate r(k). -7 Let s(a) be the first derivative of -9a2/2 + 7a - 294. Calculate s(4). -29 Suppose 6x + 24 = -6. Let s(n) = -6 - 9 + 4 - 3n + 2n. Give s(x). -6 Let n(x) = 2x*2 + 10x + 5. Suppose 5a - o = -20, 3o + o = -4a - 16. What is n(a)? -3 Let l be 17/510(-2)/(-4). Let c(r) = -r2 + r + 6. Give c(l). 6 Let w(x) = -x - 19. Suppose 12 = -2k + 5n, -3n + 6 = 48k - 49k. What is w(k)? -13 Let u(k) be the third derivative of -k7/2520 - k6/240 + k5/40 + k4/12 - 8k2. Let v(m) be the second derivative of u(m). Give v(2). -7 Let z be 15/(4 + -1 + -4). Let m be 30/z - (1 + -4). Let w(h) = 2h - 6h + 0 - 4h*2 + m - 4. Calculate w(-2). -11 Let z be -5 + 7/5 - 4/10. Let s(u) = 2u*2 + 3u - 5. Determine s(z). 15 Let p(w) be the third derivative of -w6/120 + w5/30 + 40w2 + 18. Let n = 3 + -2. Calculate p(n). 1 Let y(g) = g - 11. Suppose -4b + 4 = -3b. Suppose -2p + 14 = bf - f, -2p + 8 = 2f. Give y(f). -5 Let n = 44 + -39. Let j(q) = 1 - 2q + 1 + nq2 - 6q2. Give j(-4). -6 Let r(q) = q2 - 13q - 9. Let d = -124 + 138. Calculate r(d). 5 Let o(r) = -r3 - 14r*2 + r - 4. Let h(t) = -10t*2 - 3. Let z(c) = -3h(c) + 2o(c). Suppose -1 = 3p - 2p. Give z(p). 3 Let c(j) = j + 28 + 0j - 30. What is c(15)? 13 Suppose 4f - 1 = -4v - 17, 0 = 3v + 4f + 9. Let x = 7 + v. Let h(y) be the second derivative of y*3/6 - 9y*2/2 + 8y. Determine h(x). -9 Let y be 6 + -5 + 0 + 1. Let p(i) = 1. Suppose 0 = k - 1. Let h(c) = 3c - 12. Let z(m) = kh(m) + yp(m). Calculate z(7). 11 Let w(r) = 3r + 6 - 4 + 8909r2 - 8915r2 + r3. Calculate w(5). -8 Let d(b) = b*3 - 5b*2 + 6b - 2. Suppose 6g + 5k = 2g, -k = -g. Suppose -2y + 3y - 12 = g. Suppose -5z + 8 = -y. Calculate d(z). 6 Let z(r) be the second derivative of r*3/6 - 4r*2 + r. Let s = -22 + 29. Determine z(s). -1 Let x = 26 - 30. Let d(g) be the third derivative of 2g*2 + 1/6g*3 + 1/20g*5 - 1/8g*4 + 0g + 1/120g6 + 0. Determine d(x). -3 Let f(b) = -b3 + 3b*2 - 2b + 2. Suppose 90 = -4z - z. Let p be -2 + z/(-3) - -2. Let x be (12/10)/(p/15). Determine f(x). -4 Let w(d) = 11d*2 - 17d - 7. Let z(i) = -8i2 + 11i + 5. Let r(q) = 5w(q) + 7z(q). Calculate r(-7). 7 Let o(n) = -n*2 - 2n + 7. Suppose 58 = -3w - l + 43, 2l - 5 = w. Calculate o(w). -8 Let j(y) = -2y2 - 8y + 5. Suppose -5p = 2q + 31, -24 = -5p + 8p + 3q. Calculate j(p). -5 Let a be (-14)/(4/(-22) - 48/99). Let g = a - 19. Let m(f) = f2 + f + 1. Calculate m(g). 7 Suppose a + 332 = 320. Let y(l) = -l - 3. Calculate y(a). 9 Let r(y) be the third derivative of y6/120 - y5/10 + 5y*4/24 - 2y*3/3 - 848y*2. Suppose -5s + 15 = 40. Let a = 0 - s. Determine r(a). -4 Let w(i) be the third derivative of -i6/120 + i5/12 - 7i4/24 + 7i*3/3 - 9i*2 + 11i. What is w(4)? 2 Let a(l) = -l*3 - 8l*2 - 14l - 2. Let w be a(-6). Let z(j) = -wj + 1 + 0j + 9j + j2. Calculate z(0). 1 Let n(q) = 8q*2 + q - 1. Suppose 2l = 2s - 6, -4s - 6 = 5l - 3l. Let k(u) = -2u2 - 5u + 4. Let j be k(l). What is n(j)? 8 Let d(r) = -4r3 + 10r2 + 8. Let k(j) = j3 - j*2 - j - 2. Let t(z) = d(z) + 5k(z). Calculate t(-6). -8 Let a(m) = -3m2 - m - 2. Let n be a(-1). Let i(q) be the first derivative of q2 - 4q*2 + 4q2 - 4. Determine i(n). -8 Let l(u) = u3 - 5u2 + u + 3. Let t(x) = x3 - 9x*2 - 10x + 100. Let p be t(9). Let m = 3 + -1. Let j be m + 4/p5. Calculate l(j). -9 Let t(q) = 399q + 409q + 1 - 1212q + 0 + 402q. Determine t(4). -7 Let x(m) be the first derivative of -m4/4 - 4m*3/3 + 3m*2 + 2m + 20. Calculate x(-5). -3 Suppose 38j = 39j - 13. Let p(h) = -h*3 + 14h*2 - 13h + 5. Calculate p(j). 5 Suppose 5n = -w - 4, -3n + 5w = w - 16. Let p(i) = -2i*3 + 2i*2 - i - 3. Calculate p(n). -3 Let o(b) = -6b. Let k be o(-1). Let s(t) = -20t2 + t - 4t + 6t2 + 15t*2 + 9 - 6t. What is s(k)? -9 Let y = 359 + -360. Let s(j) be the third derivative of j6/720 + j5/120 + j4/12 - j2. Let r(c) be the second derivative of s(c). Give r(y). 0 Suppose 0 = 4t + 2u + 12, 2t + 5u + 0 = -14. Let m(h) be the first derivative of 2h3/3 + h2 + 51. Determine m(t). 4 Let o(p) be the second derivative of -p5/20 - p4/3 + 3p2/2 - p. Let i(v) = -v2 - 7v + 40. Let z be i(-11). Determine o(z). 3 Let w(a) = -2a*3 + 2a*2 + a + 1. Let q be -1 - -4 - (-1 - -2). Suppose -5 = -6z + 25. Suppose 0 = 5m - 4m + zo - q, -4m + 2o + 8 = 0. Determine w(m). -5 Suppose 0z + 3z = 6. Let f(c) = 2 + 20c - 1 - 20c - 2cz. Give f(1). -1 Let g(a) = a3 + 2a2 - 5a - 4. Let h be g(-3). Let b(v) = 0 - 2065v + 2069v - 3. Give b(h). 5 Let z(k) = -k - 2. Let r(x) = 8x. Let c be ((-8)/12)/(4/(-6)). Let u be r(c). Let d be -2 + 0 + (u - 1). Calculate z(d). -7 Let d(m) = m. Let o(r) = 6r. Let p(g) = -7g + 1. Let c(f) = -6o(f) - 5p(f). Let h be c(-9). Suppose -ha = 3t - 22 + 7, 9 = 3a. Give d(t).	{ "pile_set_name": "DM Mathematics" }
t q = g + v. Is q prime? False Let n be (-685)/(-10) - (-2)/(-4). Is n/8 - 3/(-2) a composite number? True Let g = 87 - -39. Suppose 72 = 3m - g. Suppose -2y - y - 29 = -2c, 0 = 5c - y - m. Is c a prime number? True Let x = -11 - -13. Suppose xp - 276 = -2p. Is p a prime number? False Let k = 7 - 5. Suppose -5j = -kj - 171. Let c = j - 23. Is c composite? True Let j = 1 - -1. Is 74(3/j - 1) a composite number? False Let x(v) = 7v*2 - 1. Let n(o) = 15o*2 + o - 1. Let q(k) = -4n(k) + 9x(k). Let h be (-4)/14 - (-120)/(-21). Is q(h) prime? True Suppose -4h = -0h - 276. Let j = -32 + h. Is j composite? False Let w be 2/5 + (-52)/(-20). Suppose -5d = 2r - 0d - 6, 3r - 9 = -wd. Suppose 4c = 3g + 107, 4g = rc - 2c - 43. Is c a composite number? False Suppose 273 + 918 = 3s. Is s composite? False Let f = 13 - 8. Suppose -fw = 5y - 10 - 120, 5w = -4y + 105. Is y composite? True Let y(c) be the second derivative of 131c4/12 + c3/6 - c2/2 - 10c. Is y(1) prime? True Let v be 6/36219/6. Suppose -2z = z - v. Is z composite? False Suppose 3t - 7t + 2253 = 5g, -4t + 1355 = 3g. Is g a composite number? False Let t(q) = 7q - 2. Let p(m) = m*2 - m. Let o be p(1). Suppose o = -3b + 3u - 0u + 6, 3b + 4u = 13. Is t(b) prime? True Suppose -q - 1 = 5. Let t(o) = 3 + 1 + 9o + o3 - o + 8o*2 - 2. Is t(q) a prime number? False Let i be 2/(6/(-3))-3. Let m(g) = 4g2 - 2g + 1. Is m(i) composite? False Let k(y) = -y - 5. Let t be k(-5). Suppose 5a - 195 = -ta. Is a a composite number? True Suppose 0 = 3d - 14 + 2. Let i be (10/8)/(1/d). Suppose 4p + 2q - 56 = q, 0 = iq. Is p prime? False Suppose -3k = 5b - 8056 + 1242, 4b = -k + 5447. Is b a prime number? True Suppose 8m + 5 = 3m. Let t(n) = -2 - 6n*3 - 34n*3 + 1. Is t(m) a composite number? True Suppose -h = 2 - 8. Let k(f) = 4f*2 - 3f + 15. Is k(h) a prime number? False Let i be ((-224)/(-1))/2 - 0. Suppose 2r + 2u - 4u = i, -121 = -2r + 5u. Is r a prime number? True Let r = -20 + 87. Is r prime? True Let m be (40/25)/(2/5). Suppose -my - 7 + 19 = 0. Is y a prime number? True Let f(m) = -2m2 - 1. Suppose -1 = -3z - o - 0, 4z + 12 = -4o. Let r be f(z). Is (-11)/((-6)/r + -1) composite? True Let w(n) = -n + 14. Let b be w(7). Let t = b + -4. Suppose -q + tq - 26 = 0. Is q a prime number? True Suppose 108 = -3g - 3a - a, -g = -3a + 49. Let n = g - 66. Is (n/6)/((-4)/12) a prime number? True Suppose 5i - 5697 - 8238 = 0. Is i composite? True Suppose -2 = y + y. Let s(v) = 4v + 0 - 25v + 1. Is s(y) a prime number? False Let r be (-3)/12-2-2. Let y = 17 - r. Is (-4)/y - (-1426)/18 a prime number? True Suppose 2y - 5d = 158, 0y - 2d - 81 = -y. Is y a composite number? False Let a = -5 + 11. Let i be ((-74)/a)/(3/(-9)). Let p = i + -23. Is p a composite number? True Let b(p) = 21p + 11. Is b(16) a composite number? False Suppose -4m + 3q = -7, -4m + 2m + 3q - 1 = 0. Suppose 3k - mk = 0. Is (9 + 2 - k)1 a prime number? True Suppose -488 - 384 = -4c - 4d, -219 = -c - 2d. Is c a prime number? False Suppose -3x + 5905 = a, 0 = 3x + 3a - a - 5903. Is x composite? True Is -3564/(16/(-7)) composite? True Let y(r) = r3 + 10r*2 - 2r + 1. Let m be 4/18-3-3. Let v be 5/m-14. Is y(v) composite? True Suppose 3z - 15 - 3 = 0. Let j = 9 - z. Suppose -2u - 25 = -4c - ju, 13 = c - 2u. Is c prime? True Let g be 9 - 0/(-1) - -1. Is 3/5 + 224/g composite? False Is 1112/3 - (-4)/12 prime? False Suppose -3p + 11 = -o + 1, -2o + 30 = 4p. Suppose 201 = v + 2v - 5m, -v + om = -67. Is v a composite number? False Is 475/9 + 2/9 composite? False Let h be 0 - (-12)/((-3)/(-1)). Suppose 27 - 211 = -hc. Is c composite? True Suppose 28 = -0f + f. Is (-4)/(-14) - (-3548)/f composite? False Let s(g) = 10g*2 - 2g*3 - 3g + g*3 - 8 - 4g. Let a(k) = 8k3 + k2. Let c be a(1). Is s(c) a prime number? False Let c be (-1(0 + 1))/(-1). Suppose -2m = -0 + 4. Is c/m-2 + 36 composite? False Let u(o) = -o*3 - 5o*2 - 2o + 9. Let q be u(-4). Let f = 21 + -15. Let m = f + q. Is m a composite number? False Let t = -1 + -4. Let p(x) = -9x + 1. Is p(t) a prime number? False Let q = 12 - 7. Suppose 0 = 5i - 5 - q. Suppose 215 = -iz + 7z. Is z a prime number? True Is 2/8 - 918/(-8) a prime number? False Let x = 1 - 7. Let c = x + 117. Suppose c = -2q + 365. Is q a prime number? True Let z(f) = 19f + 1. Let m be 1/(-3)(-6)/1. Suppose 0 = o + m - 4. Is z(o) composite? True Let h = 1 + -2. Let k(w) = -w - 1. Let a be k(6). Is h/2 + a/(-2) a prime number? True Let v(x) = x - 3. Let w be v(3). Suppose 6p - p - 55 = w. Is p a composite number? False Suppose 12 = -3b + 4b. Suppose -b = -k - 3k. Is (k/4)/(2/248) prime? False Let f(z) = z3 + 7z2 + 3. Let n(r) = r2 - 7r - 1. Let c be n(6). Let b be f(c). Suppose 206 = 3a + 5d + 24, -5a + 360 = -bd. Is a a composite number? True Suppose -11 = -5h + 9. Let r = -3 + 23. Suppose -o + 6 = o + 2m, -ho = 2m - r. Is o a prime number? True Suppose s + 0 = -6. Let n = 2 + s. Is (-80)/(-6) + n/(-6) a composite number? True Suppose 0 = -5r - 4i + 399 + 1075, -3r - i = -890. Is r prime? False Suppose 3b - 2 = b. Let w = b + -1. Suppose 0 = 2l + 2l - 3n - 357, w = -5l + n + 460. Is l prime? False Let w be (-54)/2128/6. Is (-2279)/(-9) - w/(-54) a prime number? False Is ((-5)/(-1) - 1) + 5659 a prime number? False Suppose 361 + 67 = 2n. Is n a prime number? False Suppose 0 = -13c + 7c + 8634. Is c a prime number? True Suppose 8 = n - r, -4n + r + 3 = -17. Let j = 0 + n. Suppose 2k = -jm + 496, 0 = 6m - 3m + 5k - 379. Is m composite? True Let d(x) = -x - 1. Let w be d(-3). Suppose 0 = -m + 178 - 44. Suppose -m + 40 = -wh. Is h a composite number? False Suppose -11 = -5x + 3f + 2, -5x - 4f + 6 = 0. Suppose n + 116 = 2l, -2l = -7l - xn + 299. Is l prime? True Suppose -h = -0h - 19. Let d be (128/(-12))/(11/(-3)). Let o = d - h. Is o a prime number? True Suppose 5o - 496 = 4h, 2o + 2h = -3h + 205. Suppose 5r - o - 75 = 0. Is r prime? False Suppose -5j + 0o + 3o + 5990 = 0, -4j + 4775 = o. Is j a prime number? False Let k(d) = -11d3 - d2 + 3d - 3. Is k(-4) a composite number? False Suppose -3g = -6, z - 2z + 572 = -4g. Let q = z + -395. Is q composite? True Let p = 52 + 75. Is p prime? True Let u be (2032 - -2) + -1 + -1. Is (u/24)/((-4)/(-6)) a composite number? False Let s(w) = 2w*2 - 16w + 25. Is s(11) composite? True Suppose -6y + y = -10. Suppose 4u - 71 = -5h, -u + yu = 5h + 24. Is u prime? True Let v = -410 + 580. Suppose 0 = -5i + 925 + v. Is i composite? True Is 3 + -1 + (-398)/(-2) a prime number? False Suppose 2h = -2h - 20. Let l = h + 15. Is l composite? True Suppose 5o + 247 = 2w, 4o = 4w + w - 643. Is w a prime number? True Let j = -39 - -74. Is j composite? True Let p = -18 - -13. Let h(d) = 21d2 - d + 6. Let i(b) = 32b*2 - 2b + 9. Let u(f) = pi(f) + 8h(f). Is u(-2) a composite number? False Let v be ((-520)/(-25))/((-1)/5). Let p = -69 - v. Is p prime? False Let q be 9/((-6)/2) + -1. Let p(d) = -18d - 1. Is p(q) composite? False Suppose 3n - n = 4. Suppose q - 5q = -3c + 247, nc - 166 = 2q. Is c a composite number? True Suppose 10 = -3m + 25. Suppose -2r - 175 = -mu - 0r, 4r - 79 = -3u. Is u composite? True Suppose -4s + 6 = -s. Let p be 0 - s - 2-2. Suppose -2 = -pf + 6, 68 = 4h - 2f. Is h a composite number? False Suppose -8k + 3k + 387 = -3x, 5k - 355 = -5x. Let b = k - 53. Suppose -3g + g + b = 0. Is g prime? True Suppose -5a + 1420 = -a. Is a prime? False Let r(u) = 20u + 9. Is r(4) a composite number? False Suppose 7 = 3j - 2. Suppose -p + jp = 74. Is p a prime number? True Let l be 1-2 + -2 + 4. Suppose l = -w + 2w + 9. Is 1 - 3/(w/60) composite? True Let n(f) = -f3 - 6f*2 + 4f + 4. Let g = -3 + -2. Let t be n(g). Let d = 74 + t. Is d a prime number? False Is 2/(-4 - 90/(-21)) prime? True Suppose 4x + 0x = 8. Suppose -5z = -x - 63. Is z composite? False Let d be ((4 - 2)-1)/(-1). Suppose 86 = 2p + q, -p - 9 = -dq - 57. Suppose -x + 41 = -p. Is x a composite number? True Suppose c + 6163 = 5a + 795, -2a = -c - 2149. Is a composite? True Sup	{ "pile_set_name": "DM Mathematics" }
2z = 5z + 49, 4z = -12. List the prime factors of r(y). 5 Let v(s) = -s3 + 7s*2 - 6s + 3. Let b be v(6). Suppose 0 = 2o - bo. Suppose o = 2x - 6x + 40. List the prime factors of x. 2, 5 Suppose -2n = -3n + 3t - 3, 17 = 3n + 4t. Suppose -68 = -ni + 22. What are the prime factors of i? 2, 3, 5 Suppose -d = -10 - 2. Let r = d - 3. What are the prime factors of r? 3 Let h(j) = j2 + j - 2. Let n be h(-3). Let x be 14/(-10) - n/(-10). Let c = x + 5. What are the prime factors of c? 2 Let i(u) = -u3 - 6u2 - 7u - 2. Let v be i(-5). Let s = v + -5. List the prime factors of (-1)/3 + 34/s. 11 Suppose -3c - 5 = -8c, -4c + 22 = 2l. Let p(z) = -2z2 + 9z + 11. Let d(m) = -m*2 + m. Let f(s) = -d(s) + p(s). List the prime factors of f(l). 2 Suppose 3j = -0j - 15. What are the prime factors of j/(2(-2)/4)? 5 Let a = 0 - 1. List the prime factors of 251 - 0/a. 5 Let r(n) = -14n + 2. List the prime factors of r(-6). 2, 43 Let s(o) = -3o - 10. Let m(p) = 2p + 9. Let w(q) = -4m(q) - 3s(q). What are the prime factors of w(10)? 2 Let z = 3 - 44. Let a = z + 57. List the prime factors of a. 2 Let c(p) = 5p - 28. What are the prime factors of c(7)? 7 Suppose -3p = -0p + 48. Let n = p - -22. Suppose -ni - 27 = -5w - 2i, -4i - 21 = -3w. What are the prime factors of w? 3 Let y = -15 + 28. Let a = y - -1. List the prime factors of a. 2, 7 Let w = -2 + -2. Let u(r) be the second derivative of r4/12 + r3/2 + 5r2/2 - 2r. What are the prime factors of u(w)? 3 Let v be (-25)/(-15) + 1/3. Suppose vk = -2k + 52. List the prime factors of k. 13 Let n(f) be the third derivative of f5/30 + f4/8 - 5f3/6 - 4f*2. What are the prime factors of n(-4)? 3, 5 Suppose 144c = 142c + 480. What are the prime factors of c? 2, 3, 5 Let z(j) = j3 + 3j*2 + 2j + 239. List the prime factors of z(0). 239 Let j(l) = l*3 + 3l*2 + 2l + 3. Let u be j(-3). Let d be 21 - (-3)/u. Suppose -y = -3t + 36, -4y + d = -4t + 57. List the prime factors of t. 11 Let m be (-7)/(-3) - 3/9. Suppose 5l = mh - 22, -3h + 11 = -2l - 0. Let s = 6 + l. What are the prime factors of s? 2 Suppose 0 = 2j - r - 13, -4j = 3r - 35 + 14. What are the prime factors of j? 2, 3 Let g(y) = -y3 + 6y*2 + 10y - 7. Suppose 0 = -0k + 2k - 14. What are the prime factors of g(k)? 2, 7 Let s(j) = j + 19. Let m(d) = -d*2 + 6d + 7. Let r(l) = l + 1. Let y be r(6). Let t be m(y). List the prime factors of s(t). 19 Let l be (14 + 0)1/2. Let a = 1 + l. List the prime factors of a. 2 Let x = 12 - 8. Suppose -xl - 8 = -5l. What are the prime factors of l? 2 Let n(z) be the third derivative of z6/120 - 3z5/20 + z4/24 + 11z3/6 - 4z2. Let o be n(9). What are the prime factors of o/50 + (-58)/(-5)? 2, 3 Let o = -32 - -65. What are the prime factors of o? 3, 11 Let x(y) = y2 - 6y - 9. What are the prime factors of x(8)? 7 Let q be (0 + -4)(-5)/(-10). Let l(y) = -6y2 - 2y - 1. Let o(n) = 3n2 + n. Let v(r) = 2l(r) + 5o(r). What are the prime factors of v(q)? 2 Let o be ((-21)/(-12) - 1)28. Let y = o - 12. List the prime factors of y. 3 Let f(p) = -27p - 87. List the prime factors of f(-11). 2, 3, 5, 7 Let t(v) = v3 + 8v*2 + 6v. Let s be (-5)/(-15) + 8/(-6). Let d(c) = -7c2 + c + 1. Let i be d(s). List the prime factors of t(i). 7 Let f = -6 - -1. What are the prime factors of 2/f - 67/(-5)? 13 Let c be ((-1)/2)/(2/(-8)). List the prime factors of c/((-2)/2)-4. 2 Let z(j) = -j*3 + 11j*2 - 3j + 7. What are the prime factors of z(5)? 2, 71 Let r = 4 - -2. Let c(w) = w*2 - 2w + 4. Let p be c(r). Let s = p + -17. What are the prime factors of s? 11 Let d(m) = m*2 + 3m - 2. Let v be d(-3). Let q be 0 - v/44. Suppose -qy + 10 = -y. List the prime factors of y. 2, 5 Let k(y) = y*2 + 16y - 51. List the prime factors of k(14). 3, 41 Let u = -23 - -51. What are the prime factors of u? 2, 7 Let k(h) = 3h2 - 4h - 3. Suppose 0 = -8b + 3b - 15. What are the prime factors of k(b)? 2, 3 Let o be -4(0 - 3/6). Suppose -oi + 35 = 3i. What are the prime factors of i? 7 Let p(m) = -m3 + 6m*2 + m - 7. Let y be p(6). Let f be (-410)/(-50) - 2/10. Let c = y + f. List the prime factors of c. 7 Let o be 5/20 - 185/4. Let u = 82 + o. List the prime factors of u. 2, 3 Let z be ((-44)/(-10))/((-1)/(-5)). Suppose -3t + 4m + 19 = -z, -4t + 33 = -m. Suppose -37 = -4n + t. What are the prime factors of n? 11 Suppose 0p = 2c + p - 7, 6 = 2c + 2p. Suppose cu - 13 = 63. List the prime factors of u. 19 Suppose -5y + 6 = -2y. Suppose -yu = -7u. Suppose 2q - 8 - 20 = u. List the prime factors of q. 2, 7 Let t = -3 - -5. Suppose tu - 5p + 6 = -1, 4u - 3p = -21. Let h = 10 + u. List the prime factors of h. 2 Suppose 5t - 6t - 3 = 0. Let d be (2/t)/((-4)/18). Suppose -d = 2g - 3g. What are the prime factors of g? 3 Let o(n) = n3 + 5n*2 + 2n + 3. Let t = 14 - 10. Suppose -2f + t = -3f. List the prime factors of o(f). 11 Suppose 0 = 2q - 239 + 77. What are the prime factors of q? 3 Suppose 17y - 19y + 142 = 0. What are the prime factors of y? 71 Let n(o) = o2 - 3o - 4. Let y be n(3). Let m be (y/(-5))/(10/25). Suppose ms = 4s - 2g - 26, g = -2s + 38. What are the prime factors of s? 17 Suppose -2p - 64 = -220. What are the prime factors of p? 2, 3, 13 Let q be (-6)/(-36/639). Suppose 2 = -2d, 32 = 5a - 4d + q. Let l = 54 + a. What are the prime factors of l? 17 Suppose -k + 1 + 4 = 0, -4x - 5k = -149. Let s = -18 + x. What are the prime factors of s? 13 Let y = 14 + -2. Let q be ((-10)/(-4))/(6/y). Suppose 23 + q = 4p. What are the prime factors of p? 7 Suppose 0 = 4u + u - 65. Suppose -10 = 2m + 4n, -4m + 0n = -3n - u. List the prime factors of (-99)/(-12) - m/4. 2 Let j(i) = i*3 + 12i*2 + 10i - 1. Let a be j(-11). Suppose n - a = -4n. What are the prime factors of n? 2 Suppose -5a + 5 + 0 = 0. Let v(b) = b*2 - 1. Let y be v(a). Suppose -2o + 10 + 4 = y. List the prime factors of o. 7 Let z = -167 - -260. What are the prime factors of z? 3, 31 Suppose 10o - 6 = 8o. Let l be 4/14 - (-374)/14. Suppose -5a + 2m = -2a - l, 46 = 5a - om. What are the prime factors of a? 11 Let d = 158 + -79. What are the prime factors of d? 79 Suppose -22 = p - 6p - x, -3p + 2 = -5x. Suppose -pj - j + 34 = 4n, -70 = -5j + 5n. List the prime factors of j. 2, 5 Let d(h) = -h + 20. Let c = 7 + 2. What are the prime factors of d(c)? 11 Let c(o) = 69o - 6. List the prime factors of c(2). 2, 3, 11 Let d = 25 - 22. Let g(r) = r2 - 2r + 0r2 - 1 + 2. What are the prime factors of g(d)? 2 Let b be (-1 + -2)(-2)/2. Let x(c) = c3 - c2 - 2c + 2. What are the prime factors of x(b)? 2, 7 Suppose -g + 5 = 3i, 37 = -3g - 3i + 7i. Let c(j) = -j - 1. Let f(n) = -7n - 13. Let p(q) = -5c(q) + f(q). List the prime factors of p(g). 2, 3 Let s(t) = -t3 + 10t*2 - t + 10. Let p be s(10). Suppose p - 30 = -3l. List the prime factors of l. 2, 5 Let f(a) = a - 1. Let q be f(1). Let t = q + 8. List the prime factors of t. 2 Let n = 5 - -22. Let r = n + -11. List the prime factors of r. 2 Suppose 4 = 3j - j. Suppose 0 = -s + j, -4z - 3s = -s - 76. What are the prime factors of z? 2, 3 List the prime factors of (-45)/(-2)6/5. 3 Let w be ((-16)/(-6) - 2)6. Suppose 5r - wz - 114 = 0, -4z - 26 = -4r + 3r. Suppose 5g - 13 = r. What are the prime factors of g? 7 Let a(l) be the second derivative of 5l*3/6 + 5l*2/2 - 3l. Let d be a(4). Let w = 37 - d. List the prime factors of w. 2, 3 Let m = 235 + -104. What are the prime factors of m? 131 Suppose o = -3o + 8. Let p(w) = w2 + 3w - 6. Let n be p(-6). Suppose oa = -0a + n. What are the prime factors of a? 2, 3 Suppose -4b - h - 3 = 0, 5b + 5h + 15 = -0h. Let w(x) = x + 17. List the prime factors of w(b). 17 Let k be -1 + 1 + -5 + 24. Suppose 2q - k = -3. List the prime factors of q. 2 Let z = -15 - -53. List the prime factors of z. 2, 19 Let z(v) = v2 - 2v + 82. List the prime factors of z(0). 2, 41 Suppose 3g + 3 - 2 = 5j, 3j = -4g + 18. Suppose -jl = 2l. Suppose l = -f + 4b - 8, f - 2 = 2b - 0b. List the prime factors of f. 2, 3 Suppose -2w + 5l = 4, 0 = w + l + 2. Let i(b) = 3b**2 - b - 2. List the	{ "pile_set_name": "DM Mathematics" }
y be 4/2 + (3 - 1). Suppose 0 = -o - 3l + 13, yl = l + 9. Calculate the smallest common multiple of o and 11. 44 Let w(p) = p*3 - 13p*2 + 16p - 7. Calculate the least common multiple of 5 and w(12). 205 Let k = -3 + 7. Let s = 79 - 75. What is the least common multiple of s and k? 4 Suppose -4f - 4g - 139 = g, 5f = -3g - 177. Let a be (-3)/((-9)/(-6)) + -1. Find the common denominator of -21/8 and a/f(-89)/1. 24 Suppose -z + 0z + 4l + 36 = 0, 3z = 4l + 76. Calculate the smallest common multiple of z and 14. 140 Suppose 4r - 2 = 3r. Suppose 3c - 28 = -5m, -3c + 7m - 22 = rm. What is the smallest common multiple of 7 and c? 7 What is the common denominator of 14/15 and 3177/81 - 2/9? 15 Let h = -17 - -25. Calculate the lowest common multiple of h and 7. 56 Let g = 28852/217505 - 27/205. Let t = g + -24421/19098. Let f = -6299 + 113279/18. Calculate the common denominator of t and f. 18 Calculate the lowest common multiple of 24 and -10-126/20. 72 Let r = 4583/22 + -208. Let q be 3/3 - 4859/4853. Let u = 296165/106766 + q. Calculate the common denominator of u and r. 22 Let b = -1/320 + -1879/320. Find the common denominator of b and 36. 8 Let j(l) = -4l + 36. Calculate the least common multiple of (-2)/(2/(-1)) + 9 and j(6). 60 Let m = 16 + -12. Calculate the smallest common multiple of m and 92. 92 Calculate the common denominator of -6((-9)/(-30))/1 and 2/5 + 273/30. 10 Let b be ((-13)/2)/(5/(-10)). Let a = 19 - b. Calculate the least common multiple of 16 and a. 48 Let l(q) be the first derivative of 2q3/3 + q2/2 - 2. What is the least common multiple of 11 and l(1)? 33 Suppose 85 - 1 = 3u. Let p be 16/u(-14)/(-4). Suppose 3 = -pk + 17. What is the least common multiple of k and 3? 21 Let q = 4768442659/355 + -13432259. Let s = q - 145/71. Let r = -398/15 - s. Calculate the common denominator of -46/3 and r. 3 Suppose 5c - 10c = -50. Suppose -o - 3 - 3 = -2s, 4o = 4s - 12. What is the least common multiple of 3 + (-2)/s3 and c? 10 Let s be 6/4 + (-18)/(-4). Suppose 3z = -6 + 15, -s = 2i - 4z. Suppose -5g - 2w = -21, i = -g - 4w - 0. What is the smallest common multiple of 10 and g? 10 Suppose -y + 54 = -4y. What is the common denominator of ((-2)/6)/((-16)/(-20)) and ((-4)/y)/(16/(-498))? 12 Suppose -i - 4i = -10. Calculate the least common multiple of i and 30. 30 Let u(o) = -12o - 3 + 0o2 - 10 + o2 + 4. What is the lowest common multiple of u(13) and 24? 24 Let x(z) be the second derivative of z4/4 + z3/6 - 2z2 - 2z. What is the lowest common multiple of 22 and x(-3)? 220 What is the common denominator of (-273)/104 + -15 and 87/26? 104 Let b = -21137/6 + 3510. What is the common denominator of (25/(-30))/((-4)/3) and b? 24 Let r be 15/9 + (-1)/(-3). Suppose -rb = -3b + 5. Calculate the least common multiple of 2 and b. 10 What is the common denominator of -4 and (-158)/(-20) - 30/75? 2 Suppose -27 - 23 = -5q. Calculate the lowest common multiple of 5 and q. 10 Let z = -20 - -26. Calculate the least common multiple of z and 4. 12 Calculate the common denominator of 65/56 and 275/30 + (-4 - 1). 168 Suppose 3v = -26 + 218. Suppose -2n = o - 3, n - 6n - v = -4o. Calculate the lowest common multiple of o and 7. 77 What is the smallest common multiple of -1 + 23/1 + 0 - 4 and 14? 126 Suppose 0 = -8n + 3n + 30. Let s be (0 - 3)/(-9)n. What is the least common multiple of s/(-8) - 100/(-16) and 10? 30 Let c be ((-4)/18)/((-759)/9). Let m = c - 6329/1518. What is the common denominator of m and 4/10 + 343/30? 6 Let h be 5((-12)/20 - -1). Calculate the common denominator of 71/4 + (2 - h) and 79/12. 12 Suppose -2r = -r - 9. Calculate the lowest common multiple of r and (2(-3)/(-9))/((-18)/(-243)). 9 What is the least common multiple of 2/(-11) - 2010/(-165) and 88? 264 Find the common denominator of (266/(-120) + 0)/((-2)/5) and 101/2. 24 Let g(i) = i*2 + 4i + 4. Let q be g(-5). Let h = q + -18. Calculate the common denominator of 95/16 and 4/(-2) + h/12. 16 Suppose 4o - o = 36. Let a(q) = q2 + 2q + 2. Let l be a(-2). Suppose lu = u + 6. What is the smallest common multiple of o and u? 12 What is the common denominator of (1 - (-129)/(-48)) + -4 and -121/18? 144 Let r = 0 + 1. Calculate the lowest common multiple of 14 and r. 14 Let f be (-42374)/30(-20)/(-24). Let v = f + 3548/3. Find the common denominator of v and 119/12. 36 Let t = -40923766082/12458457 - -1/1132587. Let s = 3282 + t. Calculate the common denominator of s and 2/(-80)-134 + 7/(-28). 110 Suppose -467 = t + 4w + 226, -5t = 5w + 3435. Let m = t - -5487/8. Find the common denominator of m and 57/2. 8 Let a = 149 + -119. What is the lowest common multiple of 12 and a? 60 Let l = 3/6161 + -708569/110898. Find the common denominator of -97/14 and l. 126 Suppose 2r - r = 51. Calculate the smallest common multiple of 21 and r. 357 Let j = -26/43 - -2711/430. Find the common denominator of j and -11/14. 70 Suppose 4i = 8i. Suppose i = -y + 4 + 1, -2t - 4y + 52 = 0. What is the smallest common multiple of 18 and t? 144 Calculate the common denominator of -101/18 and 382/48 + (-24)/18. 72 Let h = 309 - 36. What is the common denominator of -1 + h/12 + -2 and -61/20? 20 Let d be 108/(-10) + (-36)/(-45). Calculate the lowest common multiple of ((-14)/d)/(3/15) and 7. 7 Let r = -163 + 171. Calculate the least common multiple of 34 and r. 136 Let d be ((-1)/8)/((-15)/626260). Let g = d + -5234. Calculate the common denominator of g and -127/12. 12 Suppose 20 = 4z, -3v + 0z + 4z = 164. Find the common denominator of -57/14 and ((-260)/v - -2) + 1. 84 Let v = 144 + -242. Calculate the common denominator of 149/18 and (-2)/(-6)2163/v. 126 Let w(u) be the second derivative of -u*5/20 - 13u4/12 + u3/6 + 9u2 - 6u. What is the least common multiple of w(-13) and 9? 45 Let c(v) = -v*3 + 7v*2 - 4v - 2. Calculate the lowest common multiple of 24 and c(6). 120 Let i(g) = 3g - 6. Let b be i(4). Let c(a) = a - 1. What is the smallest common multiple of 2 and c(b)? 10 Find the common denominator of 10/45(-453)/(-8) and (-61)/(-16) + (-3)/(-2). 48 Let c = 993/34 + 5/17. What is the common denominator of ((-205)/60 + 4)9 and c? 4 Find the common denominator of 18(1/(-4) + -1) and (0 + (-106)/(-4))/(-1 + 2). 2 Let x(y) = 2y3 - 4y*2 - 3y. Calculate the smallest common multiple of x(4) and 5. 260 Let c = 1745/208 + -118/13. Calculate the common denominator of 85/52 and c. 208 Suppose i - 4i = 9, -5f + 5i = -15. Suppose f = 2s + s - 9. Suppose p = -5j + 40, 0 = -2j + 2p + 1 + 3. What is the smallest common multiple of s and j? 21 Let j(u) = -6u - 2. Calculate the smallest common multiple of j(-3) and 8 + -10 + 4 + 4. 48 Suppose p = -0p - l + 69, -2l + 204 = 3p. Let r = -178/3 + p. Calculate the common denominator of r and 23/9. 9 Let m = 835/189 + -19/27. Let c = -4548 - -36441/8. Calculate the common denominator of c and m. 56 Let l be 907(-2)/(-36) + -1. Let k = 569/9 - l. Let z = 47/11 - 827/88. What is the common denominator of z and k? 24 Suppose -3l = -0l - 18. Suppose -6q + q = -5, 2z - 5q = 17. What is the least common multiple of z and l? 66 Let x = 666736080/7 - 95853033. Let v = 604034 + x. Let c = v + 986. What is the common denominator of -61/2 and c? 14 Let m = 150 + -134. Calculate the smallest common multiple of m and 7. 112 Let d(a) = a3 + 9a*2 + 10a - 1. Let p be d(-7). What is the common denominator of 1 + (p/21 - -3) and -51/2? 14 Let s = -2453/8 + 307. Find the common denominator of 45/4 and s. 8 Let m(c) = -29c + 13. Let k be m(-9). What is the common denominator of -151/12 and (9/18)/((-12)/k)? 12 Suppose 4r - 14 = 10. What is the least common multiple of r and 20? 60 Suppose -3r - 9 = 0, a - 2r + 9 - 37 = 0. Let x(l) = l + 7. Let n be x(-5). Calculate the lowest common multiple of (-3)/((-3)/44n) and a. 22 What is the least common multiple of -4(0/3 + -4) and 12? 48 Let n(i) = i*2 - 8i - 5. Let s be n(7). What is the lowest common multiple of (-13)/(s/64) and 38? 304 Let b(v) = 2v*2 - 3v + 4. Calculate the smallest common multiple of b(4) and -5(-4 + (0 - 0)). 120 Suppose 4a + 5i = -70, -a + i - 102 = 4a. What is the smallest com	{ "pile_set_name": "DM Mathematics" }
115, -30889, -32751, -34719? -36811 What is next in 8454, 33673, 75698, 134529, 210166? 302609 What is the next term in 247800, 247743, 247686? 247629 What is next in -17688652, -17688649, -17688646, -17688643? -17688640 What is the next term in -20928, -20465, -20002, -19539, -19076, -18613? -18150 What comes next: 1518, 13601, 46920, 112095, 219746, 380493? 604956 What is the next term in -2549, -3720, -5423, -7658, -10425, -13724? -17555 What is the next term in 12337111, 12337110, 12337109, 12337108? 12337107 What is next in 952, 7792, 27038, 65110, 128428, 223412? 356482 What comes next: 54, 19, -16, -51, -86, -121? -156 What comes next: 2405043526, 2405043523, 2405043518, 2405043511, 2405043502, 2405043491, 2405043478? 2405043463 What is next in 54547, 53506, 52465? 51424 What is the next term in -11285, -21852, -31675, -40760, -49113, -56740, -63647? -69840 What comes next: -156, -148, 182, 990, 2432? 4664 What comes next: 7722, 15447, 23170, 30879, 38562, 46207? 53802 What is next in 2372, 1475, 602, -235, -1024, -1753, -2410, -2983? -3460 What comes next: 2145, 8448, 18925, 33582, 52425? 75460 What comes next: -20146693, -20146698, -20146703, -20146708? -20146713 What is next in -70711, -565702, -1909249, -4525630, -8839123? -15274006 What comes next: 21013, 21005, 20987, 20959? 20921 What is the next term in 34131, 136566, 307297, 546324, 853647, 1229266, 1673181? 2185392 What comes next: 74825, 155019, 235213, 315407, 395601? 475795 What comes next: -1598, -5741, -12684, -22433, -34994? -50373 What is next in 966143, 1932722, 2899301, 3865880, 4832459, 5799038? 6765617 What comes next: 4756, 39535, 135018, 321901, 630880, 1092651? 1737910 What comes next: 3197, 6103, 8785, 11237, 13453, 15427, 17153? 18625 What is the next term in -100162120, -100162117, -100162114, -100162111, -100162108, -100162105? -100162102 What is the next term in 3782541, 7565108, 11347683, 15130266? 18912857 What is the next term in -175835, -176536, -177699, -179318, -181387, -183900, -186851? -190234 What is next in -229552, -457846, -686140, -914434, -1142728? -1371022 What comes next: 62949, 62843, 62737, 62631? 62525 What is the next term in 6399, 6498, 6597? 6696 What is the next term in -271242, -271486, -271716, -271926, -272110, -272262? -272376 What comes next: -43803, -44073, -44343, -44613, -44883? -45153 What is the next term in -167, 3300, 12705, 31018, 61209, 106248, 169105, 252750? 360153 What comes next: -321825, -321757, -321687, -321615, -321541, -321465? -321387 What is next in 35319, 141993, 319785, 568701, 888747, 1279929, 1742253, 2275725? 2880351 What comes next: -21867, -27765, -33663? -39561 What comes next: -117542, -117247, -116950, -116651? -116350 What is next in 38579, 80367, 122155? 163943 What comes next: 218499, 218529, 218583, 218661, 218763, 218889, 219039? 219213 What is next in 19755, 19434, 19111, 18786, 18459? 18130 What is the next term in 204810, 409621, 614430, 819237, 1024042, 1228845, 1433646? 1638445 What is next in -4887, -19524, -43917, -78066, -121971, -175632? -239049 What comes next: -1301309, -1301322, -1301335, -1301348, -1301361, -1301374? -1301387 What comes next: -538, -1198, -2274, -3766? -5674 What comes next: -38204, -38368, -38650, -39056, -39592, -40264, -41078? -42040 What is next in -6677, -12479, -17407, -21461, -24641, -26947, -28379? -28937 What comes next: 384237, 384218, 384187, 384144? 384089 What comes next: -110130, -110095, -110030, -109935, -109810? -109655 What is the next term in 35464, 71190, 106918, 142648, 178380, 214114, 249850? 285588 What is the next term in 30366891, 30366893, 30366895? 30366897 What comes next: 197, 314, 627, 1232, 2225, 3702? 5759 What is the next term in 11749, 23285, 34821, 46357? 57893 What is the next term in -2758, -11138, -25104, -44656, -69794, -100518, -136828? -178724 What comes next: 139208, 278422, 417646, 556880, 696124, 835378, 974642? 1113916 What is next in 9908, 9849, 9742, 9581, 9360? 9073 What is next in 2098440089, 2098440088, 2098440087? 2098440086 What comes next: -3374804, -13499146, -30373044, -53996492, -84369484? -121492014 What is next in -39513216, -39513217, -39513218, -39513219, -39513220? -39513221 What comes next: -3433622, -3433629, -3433636, -3433643? -3433650 What is next in -21644, -17522, -13366, -9158, -4880? -514 What is the next term in 11920, 95924, 324304, 769366, 1503416, 2598760, 4127704? 6162554 What is the next term in -8775, -17373, -25971, -34569? -43167 What is next in 91751, 183470, 275107, 366620, 457967, 549106? 639995 What comes next: -437, 1157, 5455, 13801, 27539, 48013? 76567 What is the next term in -15579755, -15579759, -15579765, -15579773, -15579783, -15579795, -15579809? -15579825 What comes next: 8602, 34394, 77366, 137500, 214778, 309182, 420694? 549296 What is next in -51489, -51493, -51509, -51543, -51601, -51689, -51813? -51979 What is the next term in -4407199, -8814402, -13221605? -17628808 What is next in 255294, 510921, 766548, 1022175? 1277802 What comes next: 5767, 46106, 155637, 368956, 720659, 1245342? 1977601 What comes next: 80117, 80075, 80035, 80021, 80057, 80167, 80375? 80705 What comes next: -144268, -158148, -172028, -185908? -199788 What is next in -1140997, -1140626, -1140253, -1139878, -1139501, -1139122? -1138741 What comes next: -280, -1026, -2430, -4624, -7740, -11910, -17266, -23940? -32064 What is next in 65072, 520461, 1756566, 4163747, 8132364, 14052777, 22315346? 33310431 What comes next: -2359, -9565, -21599, -38449, -60103, -86549, -117775? -153769 What is the next term in -19035, -76106, -171217, -304368, -475559, -684790? -932061 What comes next: 12598, 18671, 24742, 30811, 36878? 42943 What comes next: -18346, -18564, -18942, -19486, -20202, -21096? -22174 What is the next term in -3909287, -3909278, -3909269, -3909260? -3909251 What is next in 5048, 10092, 15160, 20288, 25512? 30868 What is next in 3184, 7268, 11348, 15424? 19496 What is next in 1203287, 2406747, 3610207, 4813667? 6017127 What comes next: -331, -2631, -8853, -20959, -40911, -70671, -112201? -167463 What comes next: 10367, 19192, 28015, 36836, 45655, 54472, 63287? 72100 What is next in 17770, 32620, 47470, 62320? 77170 What comes next: 90674, 90861, 91174, 91613, 92178? 92869 What is next in -880253, -1760537, -2640859, -3521225, -4401641, -5282113, -6162647? -7043249 What is next in -576150, -2304678, -5185580, -9218856, -14404506, -20742530, -28232928? -36875700 What comes next: -21936, -21095, -19700, -17757, -15272? -12251 What comes next: 11025, 21564, 32031, 42426, 52749? 63000 What comes next: -10928, -27331, -43734? -60137 What comes next: -11161, -21506, -31851, -42196, -52541? -62886 What is next in -782, -3494, -8028, -14390, -22586, -32622? -44504 What is the next term in -337959, -338016, -338073, -338130, -338187, -338244? -338301 What is the next term in -173596, -694459, -1562578, -2777959, -4340608, -6250531, -8507734, -11112223? -14064004 What comes next: -206511, -204171, -201831, -199491? -197151 What is next in 9609, 9680, 9737, 9780, 9809, 9824, 9825? 9812 What is the next term in 4616, 36935, 124624, 295361, 576824, 996691, 1582640, 2362349? 3363496 What is next in -15429, -12210, -8991? -5772 What is next in 38111, 76516, 114921, 153326? 191731 What is next in 363, 1590, 3919, 7584, 12819, 19858, 28935, 40284? 54139 What is next in 32, 98, 310, 746, 1484? 2602 What is next in -4589531, -4589471, -4589411, -4589351, -4589291, -4589231? -4589171 What is next in -67126, -67122, -67128, -67144, -67170, -67206, -67252? -67308 What is the next term in 200, 455, 766, 1133, 1556, 2035, 2570? 3161 What is the next term in 1130, 1142, 1150, 1148, 1130, 1090, 1022? 920 What comes next: -14677894, -14677896, -14677898? -14677900 What is the next term in -13921, -14161, -14865, -16267, -18601? -22101 What comes next: 143472, 143596, 143924, 144558, 145600? 147152 What is next in 13952, 54987, 123382, 219137? 342252 What is next in -248870, -249125, -249380? -249635 What is the next term in -151424, -607698, -1368154, -2432792, -3801612? -5474614 What is the next term in 976342, 1952687, 2929032, 3905377, 4881722, 5858067? 6834412 What comes next: -486909815, -486909816, -486909817?	{ "pile_set_name": "DM Mathematics" }
he hundreds digit of 77631? 6 What is the tens digit of 1789? 8 What is the units digit of 10149? 9 What is the tens digit of 976? 7 What is the thousands digit of 4526? 4 What is the ten thousands digit of 50866? 5 What is the hundreds digit of 44423? 4 What is the units digit of 8208? 8 What is the thousands digit of 36022? 6 What is the tens digit of 3721? 2 What is the hundreds digit of 799? 7 What is the tens digit of 843? 4 What is the units digit of 3856? 6 What is the ten thousands digit of 24351? 2 What is the units digit of 554? 4 What is the units digit of 34977? 7 What is the tens digit of 87461? 6 What is the units digit of 122652? 2 What is the units digit of 3928? 8 What is the hundreds digit of 1316? 3 What is the tens digit of 3169? 6 What is the units digit of 1271? 1 What is the units digit of 165258? 8 What is the hundreds digit of 3272? 2 What is the thousands digit of 1881? 1 What is the hundreds digit of 32372? 3 What is the ten thousands digit of 46144? 4 What is the tens digit of 571? 7 What is the thousands digit of 6519? 6 What is the hundreds digit of 207? 2 What is the thousands digit of 10479? 0 What is the units digit of 305? 5 What is the units digit of 619? 9 What is the thousands digit of 57738? 7 What is the units digit of 27285? 5 What is the tens digit of 1910? 1 What is the tens digit of 2501? 0 What is the units digit of 4511? 1 What is the hundreds digit of 2844? 8 What is the thousands digit of 8686? 8 What is the thousands digit of 2104? 2 What is the thousands digit of 3585? 3 What is the hundreds digit of 342? 3 What is the thousands digit of 44958? 4 What is the thousands digit of 65474? 5 What is the hundreds digit of 3222? 2 What is the thousands digit of 3909? 3 What is the ten thousands digit of 97338? 9 What is the hundreds digit of 880? 8 What is the hundreds digit of 5481? 4 What is the tens digit of 244? 4 What is the thousands digit of 1621? 1 What is the units digit of 1096? 6 What is the hundreds digit of 3219? 2 What is the tens digit of 89889? 8 What is the tens digit of 43192? 9 What is the units digit of 1591? 1 What is the units digit of 6149? 9 What is the thousands digit of 36323? 6 What is the thousands digit of 1035? 1 What is the hundreds digit of 51931? 9 What is the thousands digit of 1420? 1 What is the units digit of 2803? 3 What is the tens digit of 8620? 2 What is the units digit of 15358? 8 What is the thousands digit of 1258? 1 What is the tens digit of 804? 0 What is the ten thousands digit of 133222? 3 What is the tens digit of 9874? 7 What is the tens digit of 67467? 6 What is the hundreds digit of 495? 4 What is the hundreds digit of 8542? 5 What is the tens digit of 8774? 7 What is the units digit of 78552? 2 What is the units digit of 8370? 0 What is the hundreds digit of 35714? 7 What is the units digit of 2052? 2 What is the units digit of 1425? 5 What is the units digit of 1675? 5 What is the tens digit of 12863? 6 What is the units digit of 47? 7 What is the units digit of 2313? 3 What is the thousands digit of 3398? 3 What is the thousands digit of 76183? 6 What is the hundreds digit of 86190? 1 What is the tens digit of 1600? 0 What is the units digit of 29980? 0 What is the hundreds digit of 53758? 7 What is the thousands digit of 7754? 7 What is the hundreds digit of 27773? 7 What is the ten thousands digit of 76884? 7 What is the units digit of 20845? 5 What is the hundreds digit of 3912? 9 What is the tens digit of 1174? 7 What is the hundreds digit of 1220? 2 What is the thousands digit of 4706? 4 What is the tens digit of 1308? 0 What is the units digit of 12675? 5 What is the tens digit of 4813? 1 What is the tens digit of 256? 5 What is the tens digit of 52152? 5 What is the thousands digit of 41199? 1 What is the units digit of 54? 4 What is the units digit of 15523? 3 What is the thousands digit of 8107? 8 What is the thousands digit of 2190? 2 What is the units digit of 488? 8 What is the ten thousands digit of 53883? 5 What is the units digit of 384? 4 What is the units digit of 1960? 0 What is the hundreds digit of 1620? 6 What is the thousands digit of 51296? 1 What is the units digit of 449? 9 What is the thousands digit of 3748? 3 What is the hundreds digit of 2851? 8 What is the units digit of 26978? 8 What is the thousands digit of 1166? 1 What is the hundreds digit of 604? 6 What is the ten thousands digit of 54961? 5 What is the units digit of 8775? 5 What is the tens digit of 6147? 4 What is the hundreds digit of 6665? 6 What is the units digit of 9889? 9 What is the hundreds digit of 16818? 8 What is the ten thousands digit of 11925? 1 What is the hundreds digit of 6339? 3 What is the units digit of 8455? 5 What is the units digit of 1217? 7 What is the tens digit of 528? 2 What is the hundreds digit of 624? 6 What is the tens digit of 441? 4 What is the hundreds digit of 1052? 0 What is the tens digit of 570? 7 What is the ten thousands digit of 76935? 7 What is the tens digit of 1901? 0 What is the thousands digit of 96275? 6 What is the hundreds digit of 5018? 0 What is the ten thousands digit of 17287? 1 What is the hundreds digit of 52246? 2 What is the units digit of 12995? 5 What is the hundreds digit of 640? 6 What is the units digit of 72180? 0 What is the tens digit of 50401? 0 What is the tens digit of 33713? 1 What is the ten thousands digit of 15688? 1 What is the units digit of 4963? 3 What is the tens digit of 937? 3 What is the units digit of 114? 4 What is the tens digit of 4925? 2 What is the thousands digit of 139186? 9 What is the hundreds digit of 425? 4 What is the units digit of 470? 0 What is the units digit of 6047? 7 What is the tens digit of 90257? 5 What is the hundreds digit of 58996? 9 What is the hundreds digit of 88330? 3 What is the tens digit of 18491? 9 What is the units digit of 65001? 1 What is the tens digit of 16? 1 What is the ten thousands digit of 99387? 9 What is the tens digit of 646? 4 What is the units digit of 1183? 3 What is the thousands digit of 6706? 6 What is the hundreds digit of 28659? 6 What is the tens digit of 7487? 8 What is the units digit of 891? 1 What is the tens digit of 808? 0 What is the ten thousands digit of 56311? 5 What is the thousands digit of 10156? 0 What is the hundreds digit of 1039? 0 What is the hundreds digit of 2913? 9 What is the tens digit of 7076? 7 What is the hundreds digit of 13760? 7 What is the hundreds digit of 31300? 3 What is the units digit of 14694? 4 What is the units digit of 2583? 3 What is the tens digit of 2874? 7 What is the units digit of 1008? 8 What is the tens digit of 191? 9 What is the tens digit of 23856? 5 What is the thousands digit of 1358? 1 What is the units digit of 861? 1 What is the thousands digit of 111832? 1 What is the units digit of 1075? 5 What is the thousands digit of 112439? 2 What is the thousands digit of 3973? 3 What is the hundreds digit of 64432? 4 What is the ten thousands digit of 11979? 1 What is the hundreds digit of 6996? 9 What is the thousands digit of 100607? 0 What is the hundreds digit of 2580? 5 What is the thousands digit of 1549? 1 What is the hundreds digit of 41401? 4 What is the units digit of 2061? 1 What is the thousands digit of 9183? 9 What is the units digit of 229? 9 What is the thousands digit of 1607? 1 What is the tens digit of 620? 2 What is the thousands digit of 116798? 6 What is the tens digit of 7841? 4 What is the units digit of 17734? 4 What is the thousands digit of 17503? 7 What is the units digit of 763? 3 What is the thousands digit of 7923? 7 What is the tens digit of 1384? 8 What is the hundreds digit of 1273? 2 What is the tens digit of 1155? 5 What is the units digit of 2138? 8 What is the units digit of 4217? 7 What is the tens digit of 555? 5 What is the units digit of 11883? 3 What is the ten thousands digit of 75710? 7 What is the tens digit of 54? 5 What is the thousands digit of 21793? 1 What is the hundreds digit of 4937? 9 What is the tens digit of 2984? 8 What is the thousands digit of 3008? 3 What is the hundreds digit of 71010? 0 What is the hundreds digit of 4153? 1 What is the units digit of 1673? 3 What is the tens digit of 491? 9 What is the units digit	{ "pile_set_name": "DM Mathematics" }
e 2/4 - 15/(-10). What is the second smallest value in -1/7, -1/8, b, t? -1/8 Let j = 110 + -119. What is the third smallest value in j, 10/3, -0.2? 10/3 Let u = -0.1789 - 0.0211. Let g = -3.3 + 3. Which is the second smallest value? (a) 0.3 (b) u (c) g b Let p = 62 - 432/7. Let u = -182 - -81. Let d = -101.4 - u. What is the second smallest value in d, p, -4/3? d Let v = 31 - 94/3. Let k = 0.25 + -0.4. Let g = k - -0.35. What is the third biggest value in g, v, -5/3? -5/3 Let k be 0 + 87/18 - (-4)/6. Let q = 35/6 - k. Which is the biggest value? (a) q (b) -2/7 (c) 0.5 c Let i = 0.3 - 0.3. Suppose 3t + 4x - 7x - 33 = 0, 5x = -10. Let a be 93/t - -3 - 6/(-9). What is the third biggest value in i, -0.5, a? -0.5 Suppose 3u + 7d - 258 = 4d, 3u - 226 = 5d. Let r = 84 - u. Which is the third smallest value? (a) 1 (b) r (c) -33/4 b Let t = -5/42 - -149/546. Which is the third biggest value? (a) 0.3 (b) -3 (c) t (d) -0.5 d Suppose -5l - 68 = 7. Let o = l - -11. Let t = 0.07 - -0.33. Which is the biggest value? (a) -3/4 (b) o (c) t c Let a = -284 - -286. Let d = -0.2 + 0.2. What is the second smallest value in a, -0.12, d? d Let x = 7748 + -2595578/335. Let y = 1334/1005 + x. Which is the third biggest value? (a) 3 (b) y (c) -1 c Let q = 9.23 + -7.23. Let x(i) = -i*3 + 6i*2 - i - 7. Let o be x(6). Which is the second smallest value? (a) q (b) 0 (c) 1 (d) o b Let y be 647/1078 + 2/(-11). Let q = y + 1/98. Let i = -5 + 5.4. What is the smallest value in 1, i, q? i Let k be (2/8)/((-50)/(-24280)). Let r = k - 121. What is the fourth smallest value in r, 0.2, -4, -3? r Let g = 0.0837 + -5.0837. What is the fourth smallest value in 3/4, g, -2/5, 0.4? 3/4 Let l = 12.8 + 2.2. Let r = -4 + l. Let h = -11.1 + r. What is the smallest value in 1, -6, h? -6 Let v = 8.86 + 0.14. Let q = v - 9. Let x = q + 0.6. Which is the second biggest value? (a) -4 (b) -1/4 (c) x b Let v be (-8 - -5)/((-10)/8 - 1). Let q = -0.4 - 4.6. What is the fourth biggest value in -2, v, 0.3, q? q Let h = -37 + 16. Let s = h + 16. Let o = -0.2 + 0.1. Which is the second biggest value? (a) o (b) 2/13 (c) s a Let d = -91 - -146. Let z = d + -54.7. Let v = 3 + -7. Which is the third smallest value? (a) -8 (b) v (c) z c Let i = -17.02 + 6.1. Let p = i - -11. Let d = p - 1.08. Which is the second biggest value? (a) 0 (b) d (c) 0.1 a Let h = 15.19 + -15.39. Let f = 256/665 + 2/133. What is the third biggest value in 2/13, h, f? h Let k = 2.089 - 2.289. Which is the second smallest value? (a) k (b) -0.11 (c) -5/6 (d) -1 c Suppose -85z + 76 = -81z. What is the third biggest value in z, 3/4, 5? 3/4 Let q = -5 - -10. Let h = 89 - 3475/39. Let v = -17/39 - h. What is the third smallest value in q, v, 3? q Let v(y) = 5y - 15. Let s be v(4). Let u(k) = k*2 - 7k + 8. Let n be u(s). Let l = 8 + -3. What is the smallest value in -0.1, n, l? n Let s = -5 - 5. Let x be (14/s)/(1/(-37)). Let o = x + -52. What is the third smallest value in -3, o, -3/4? o Suppose -f - 115 + 4 = 0. Suppose 0 = -4u - 4b + 16, -5u + 4 = -4b + b. Let t be f/108 - u/9. What is the second smallest value in 0.2, t, 2? 0.2 Let t = -195 + 194.9. What is the third biggest value in 92, t, 1/4? t Let l = -16 + 37/2. Let k = -10 - -24. Let s be ((-4)/6)/(21/k). What is the third smallest value in -3, l, s? l Let n = -16.07 - -15.3. Let o = 0.27 + n. Let g = o - 0.5. Which is the third biggest value? (a) g (b) 2 (c) -3 c Let x = 5/7 + -3/14. Let d be (1 + 0)/(-2 + 3 + -2). Which is the smallest value? (a) d (b) x (c) -2 c Let w = 65/87 - -1/348. Which is the fourth smallest value? (a) -18 (b) w (c) -3/8 (d) 4/5 d Let p = 25 - 20. Suppose 0 = 3t - 2g - 5, 0 = -2g + 7g + 5. Let q = 0.1 + -2.1. What is the third biggest value in t, p, q? q Let y = -0.021 - 0.509. Let t = y + 0.35. Let k = -0.38 - t. What is the third biggest value in -0.4, 1/4, k? -0.4 Let n = -113/63 + 11/7. Let w = 7 - 8. Let x be w(-1)/264. What is the second biggest value in 2, x, n? x Let p be (2/12)/(6/(-16)). Let r = p - 2/9. What is the third biggest value in r, -0.5, -2/17? r Let h = -9.03 - -0.03. Let s = 14 + h. Let y = 3 - s. What is the smallest value in -0.1, 2/13, y? y Let r = 309.97 + -310. Which is the second smallest value? (a) r (b) 4/15 (c) 0.2 c Let x(n) = n*3 + 2n*2 + 1. Let h be x(-2). Suppose 0 = 3p - 3t - 51, -2t - 3t = p - 29. What is the smallest value in 0.5, p, -0.5, h? -0.5 Let x = -0.23 + -0.07. Let m = 6250 + -6246. What is the second smallest value in 2, -0.1, m, x? -0.1 Let m be 2/684(2 - -1782). Let r = m + -46/9. What is the second biggest value in r, 0.3, -15? r Let k = -1.588 - -1.488. Which is the third smallest value? (a) 0.03 (b) 5 (c) k b Suppose -162 = 120x - 111x. Which is the third smallest value? (a) x (b) -0.2 (c) -1 b Let j = -114 - -1139/10. Let z = 327 + -4253/13. Which is the fourth smallest value? (a) -0.2 (b) j (c) z (d) 1/6 d Let n be 3/((12 + -18)1/(-6)). What is the second smallest value in -2/41, -3, n, 1? -2/41 Let l = -2 + -1. Let f = 0.3 - 0.5. Let m(g) = -g3 - 13g*2 - 24g - 2. Let t be m(-2). What is the third biggest value in t, f, l? l Let x = -0.25 - -0.05. Let j = -7.233 + 0.033. Let m = j + 4.2. Which is the second biggest value? (a) 5 (b) x (c) m b Let t = 0.05 - -0.01. Let r = 0.04 - t. Let m = 0.08 - r. What is the third biggest value in -3, m, 2/7? -3 Let r = 6.15 - 0.15. Let g = -1 + r. What is the biggest value in g, 0, 0.1? g Let m = 8 - 14. Let z = m + 6.4. Let p = 861 + -860.7. Which is the third biggest value? (a) p (b) 1 (c) z a Let x be 1(76/36 + -2). Suppose -44 = 4m - 48. What is the second biggest value in x, m, 2/3, -2? 2/3 Let t = -779/6 - -259/2. Which is the second biggest value? (a) 28 (b) 3 (c) 4 (d) t c Let j be ((-44)/(-110))/(-1 + 14/10). Let o = 7 - 4. Let y = -8 + o. Which is the smallest value? (a) j (b) -2/13 (c) y c Let x = 19 + -17. Suppose s = -k - xk - 5, 0 = k + 3. Which is the second biggest value? (a) -2 (b) s (c) -4 a Let f = 1218 - 1218.4. Let x = 1 + -0.9. Let c be (-8)/3010/12. What is the second smallest value in x, c, f? c Let g(m) = -15m + 355. Let h be g(24). What is the smallest value in h, 1.48, -3/7? h Let k = -17 - -16. Let n = 107 - 109. Which is the third smallest value? (a) k (b) n (c) 1 c Let s = -8.3823 + 0.1923. Let k = 8.2 + s. Which is the biggest value? (a) 2 (b) k (c) 4 c Let r = 10 - 5.5. Let l = -4 + r. Let p = -92 - -91.9. Which is the third smallest value? (a) l (b) p (c) 4 c Let y(j) = -j2 + 42j - 359. Let g be y(11). Which is the second smallest value? (a) -0.09 (b) 0.3 (c) g a Let d = -13 + 9. Let z be -6 + 272/36 + 4/(-18). What is the second biggest value in z, -0.3, -3, d? -0.3 Let r be -2 - 03/(-9). Let a = -430 + 432. What is the second smallest value in -0.4, 0.3, r, a? -0.4 Let n be ((-12)/96)/(3/((-12)/2)). What is the fourth biggest value in n, 0, 3/5, 2/7? 0 Suppose 2x - 5y - 15 = 10, -2x - 3y + 1 = 0. Suppose -17z + xz = 0. Which is the second smallest value? (a) -2/9 (b) -3/11 (c) z a Let u = 463 - 462.6. What is the second smallest value in 6, -3, u? u Let l = -0.0659 + 0.0659. Which is the third biggest value? (a) 1/8 (b) 10 (c) l c Suppose f - 1 = 5x, -2f + x - 17 - 8 = 0. Let q = f + 14. Suppose q = 3r + 2r. Which is the second biggest value? (a) -0.5 (b) -3/2 (c) r a Let o = -1.55 - -1.15. What is the second smallest value in 2/23, o, -2, 0.5? o Let a = 17/3 + -227/39. Let y = 2.381 - -2.619. What is the smallest value in -5, y, a? -5 Let r = 4/701 + 685/2804. Let g = -3.1 + 2. Let f = g + 5.1. What is the biggest value in r, -2, f? f Let x = 0.64 + 90.36. Let s = 93 - x. Which is the second smallest value? (a) -1 (b) 0.1 (c) s (d) -9 a Let z = -128/3 - -2170/51. Let y = -0.81 + -0.09. Which is the third smallest value? (a) 0.3 (b) y (c) z a Suppose 0 = 2w - 7 + 3, 4a + 5w + 6 = 0. Let j be 0 - 0/a - 1/(-5). What is the smallest value in 2, 4, j, -5? -5 Let g = -277 - -274. Which is the smallest value? (a) -2/17 (b) 1.5 (c) g (d) 3 c Let i = -783 + 755. Suppose o + 9 = -15. Let z = i - o. What is the third biggest value in 1/11, -3, z? z Let p = -0.1261	{ "pile_set_name": "DM Mathematics" }
g(k) = k*2 + 1. Let t(p) = 12g(p) + s(p). Let y = -19 - -21. Let b(c) = 4c - yc - c. Determine b(t(d)). 2d2 Let x(b) = -35 + 35 - b + 0b. Let r(c) = 42c + 10. Let t(v) = -14v - 3. Let m(w) = -6r(w) - 20t(w). Calculate x(m(a)). -28a Let g(v) = -12744v + 10. Let f(m) = -4m. Calculate f(g(w)). 50976w - 40 Let f(b) = 14b - 9. Let c(s) = 3s + 426. Give c(f(y)). 42y + 399 Let a(j) = 668j. Let m(y) = -213y - 1. Determine a(m(t)). -142284t - 668 Let t(z) = 20z2. Let w(y) = 8y + 55. Let x(h) = -2h - 15. Let m(b) = -6w(b) - 22x(b). Calculate m(t(j)). -80j*2 Let i(o) = 0o + 0o - 5o*2. Let t(m) be the second derivative of 3m*3/2 - 3990m. Calculate t(i(w)). -45w2 Let c(t) be the first derivative of 13t*3/3 - 6t - 8. Let r(o) = -703o2 + 323. Let b(y) = 323c(y) + 6r(y). Let i(d) = -2d*2. Determine b(i(w)). -76w*4 Let u(f) = 180f + 1. Let y(m) = -126m + 2. Give u(y(c)). -22680c + 361 Let s(x) = -2x2. Let h(a) be the second derivative of a3/6 + 109a. What is s(h(g))? -2g2 Let o(c) = 19c - 3. Let x(r) = -56r + 10. Let p(m) = -10o(m) - 3x(m). Let v(u) = -u - 3. Let j(y) = -4y - 14. Let q(t) = 3j(t) - 14v(t). What is p(q(z))? -44z Let i(j) = -2j*2 - 251j - 90. Let u(m) = -6m. What is u(i(w))? 12w*2 + 1506w + 540 Let r(q) = -398295q2. Let j(g) = -2g. What is j(r(m))? 796590m2 Let j(o) = 2o*2 + 3. Let h(a) be the third derivative of -7a*4/24 - 38a*2. Calculate j(h(v)). 98v2 + 3 Let s(i) = i2. Let f(w) be the first derivative of 10w3/3 + 137. Calculate f(s(v)). 10v*4 Let m(k) be the first derivative of 79k*2/2 - k + 771. Let d(y) = 6y. Determine d(m(t)). 474t - 6 Let g(q) = 22092q*2. Let f(i) = -26i*2. Determine f(g(p)). -12689468064p*4 Let c(f) = -12f*2 - 1. Let v(q) = -6830q. Calculate v(c(k)). 81960k2 + 6830 Let n(i) = 2i. Let u(c) = -38943c2 - c - 19. Calculate n(u(o)). -77886o*2 - 2o - 38 Let a(f) = -2 - 2f2 + 2. Let j(u) be the second derivative of u5/60 + 4u*2 - 17u. Let c(b) be the first derivative of j(b). Calculate a(c(w)). -2w4 Suppose -9 = 3b + 2j + 3j, -2j - 2 = 2b. Let k(i) = -6i2 - 12i*b + 19i*2. Let c(p) = -25p. What is c(k(t))? -25t2 Let n(b) = -159865b. Let f(l) = 10l. Give f(n(j)). -1598650j Let f = -6 - -8. Let c(r) = -3r + rf + 3r - 3r2. Let n(p) be the second derivative of 2p*3/3 + 6p. Give c(n(w)). -32w2 Let z(t) be the first derivative of -t2/2 - 114. Let j(r) = 62r*2 + 7r. Let p(m) = 21m2 + 2m. Let x(d) = 2j(d) - 7p(d). Give z(x(o)). 23o2 Let h(m) = -m. Let p(c) = 3245c*2 - 18c. Determine p(h(a)). 3245a2 + 18a Let b(a) be the first derivative of -5 + 0a2 - 8/3a*3 + 0a. Let x(p) = 2p2. Determine x(b(y)). 128y4 Let t(g) = -1. Let w(a) = a2 - a + 3. Let m(o) = 3t(o) + w(o). Let b(s) = 25s*2 - 30s. Let p(z) = b(z) - 30m(z). Let h(n) = 6n*2. Give p(h(d)). -180d*4 Let o(u) = -2765u. Let q(r) = -270r. Give o(q(z)). 746550z Let c(b) = 12 + 12 - 36 + 12 - 20b2. Let z(a) = 7a. What is c(z(j))? -980j2 Let q(s) = 20s + 38. Let m(o) = -11o - 19. Let i = -123 - -134. Let r(x) = im(x) + 6q(x). Let l(z) = z. What is r(l(v))? -v + 19 Let w(g) = 1346g. Let o(s) = 28s + 1. Determine o(w(k)). 37688k + 1 Let t(b) = 2b2. Let r(h) = -3833762h. Give t(r(w)). 29395462145288w2 Let z(l) = -95l + 2. Let o(b) = -349b. Calculate o(z(m)). 33155m - 698 Let d(o) = 2o2. Let h = -16 - -56. Let i(k) = -52 + 28 + 24 - hk. Determine i(d(p)). -80p2 Let x(t) = -24t - 1. Let m(h) = 113h - 3. What is x(m(d))? -2712d + 71 Let r(v) = 94240 - 94240 + 2v2. Let s(q) be the second derivative of -5q*4/12 + 2q. Determine r(s(c)). 50c4 Suppose 0 = -4h - 0h + m + 8, h = 2m + 2. Let a(c) = -7c2 - 5c*2 - 10c*2 + 25c*h. Let b(k) = 18k*2. What is a(b(w))? 972w*4 Let w(o) be the first derivative of -2o*2 + 75. Let n(l) = -23l. Calculate w(n(r)). 92r Let l(o) = 19o*2. Suppose 6t = 2t - 4t. Let a(q) be the third derivative of 1/12q4 + q2 + 0 + 0q*3 + tq. What is l(a(m))? 76m2 Let s(x) = x. Let j = -21 - -21. Let b(u) = j - 5u + 25u + 0. Give s(b(g)). 20g Let d(h) = -41h. Let u(o) = 6o*2 + 11o*2 - 18o*2. What is u(d(f))? -1681f*2 Let z(p) = 238p + 6 + 5 - 214p - 5. Let d(t) = -2t*2. Calculate d(z(b)). -1152b*2 - 576b - 72 Let t(b) = -189b2 - 3b. Let a(c) be the first derivative of -c*2 + 304. Calculate t(a(u)). -756u*2 + 6u Let o(p) = -2p. Let d(l) = -449778l. Calculate d(o(f)). 899556f Let r(v) = 4v. Let s(j) be the first derivative of 8j3 - 534. Give s(r(u)). 384u*2 Let o(d) = 2d. Let x(k) = -23182k. Let l(s) = -161s. Let a(m) = 865l(m) - 6x(m). Calculate a(o(z)). -346z Let k(m) = m2 - m - 1. Let l(h) = -2h*2 + 3h + 3. Let t(u) = -3k(u) - l(u). Let n(j) = 51j*2 - j. What is t(n(b))? -2601b*4 + 102b3 - b2 Let t(x) = x. Let j(a) = 3a. Let h(v) = 2j(v) - 7t(v). Let q(m) = -44m - 1. Give h(q(r)). 44r + 1 Let k(b) = 3370b. Let f(x) = -248x. Give f(k(i)). -835760i Let r(u) = 3u2. Let b(o) = o - 478. Calculate b(r(g)). 3g*2 - 478 Let d(j) = -27j. Let i(l) be the second derivative of -22l + 1/6l*3 + 0 + 0l*2. What is i(d(y))? -27y Let h(a) = -5a. Let t(r) = 247292r. Give t(h(u)). -1236460u Let l(f) = -2f2. Let b(z) = z3 - 8z2 + 7z. Suppose 6q - 4q = 14. Let u be b(q). Let p(x) = ux - 6x + x + 4x. Determine l(p(k)). -2k2 Let k(x) be the third derivative of -x4/12 - 2x2. Let i(a) be the second derivative of 0a*2 + 2/3a*3 + 0 - a. What is i(k(s))? -8s Let m(h) be the second derivative of -h*3/2 + 64h. Let p(z) = 79z. Give p(m(r)). -237r Let q(y) be the second derivative of -5y3 + 7y. Let v(x) = 3x. Let z(d) = 2d. Let k(t) = -3v(t) + 4z(t). Give k(q(f)). 30f Let u(m) = 3138m. Let p(o) = o*2. What is u(p(f))? 3138f*2 Let z(t) = 56t*2 - 784t + 1. Let j(m) = -m. Determine z(j(r)). 56r2 + 784r + 1 Let m(q) = 3q2. Suppose 2g - 9 = y - 0y, -4g = 2y - 22. Let k(j) = 56j + 1. Let d be k(0). Let h(v) = 36v - d - 47v + y. What is h(m(t))? -33t2 Let u(s) = -20s*2 + 10s + 12. Let r(i) = 19i2 - 8i - 10. Let z(h) = -5r(h) - 4u(h). Let a(m) = 3m2. Calculate z(a(j)). -135j*4 + 2 Suppose -7w - 121 = -142. Let x(h) be the third derivative of 0h + 0h*w - 8h*2 + 1/12h*4 + 0. Let v(g) = -2g. Give x(v(y)). -4y Let p(q) = 3q. Let t(x) = -7x2 - 498x. Calculate t(p(i)). -63i2 - 1494i Let u(c) = -2c2. Let v(r) = -23r + 65r - 25r - 14r + 3r*2. Calculate v(u(s)). 12s*4 - 6s*2 Let q(k) = -18110k*2. Let b(j) = j. What is b(q(v))? -18110v*2 Let m(k) be the second derivative of -2k*3/3 + 37k. Let t(z) = -22z2. Give m(t(c)). 88c*2 Let n(z) = -11z*2 - 17z - 17. Let v(u) = -2u2 - 3u - 3. Let m(t) = -6n(t) + 34v(t). Let d(a) = 4a2. Determine d(m(f)). 16f*4 Let s(t) = -3t. Let k(o) be the third derivative of o*4/12 + 16o3/3 - o2 - 52o. Determine k(s(a)). -6a + 32 Let v(s) = -24s2 - 48s. Let o(f) = -f. Let m(k) = -48o(k) + v(k). Let c(j) be the second derivative of j3/6 + 2j. Give c(m(a)). -24a2 Let j(b) = -2b. Let r(q) = -152 + 416q2 - 175 + 327. Calculate j(r(u)). -832u*2 Let n(y) = 32y2. Let g(m) be the first derivative of m5/30 + 19m2/2 - 18. Let f(z) be the second derivative of g(z). Give f(n(t)). 2048t*4 Let p(f) = 161f2. Let d(r) = -r2 + r. Let o(b) = -8b2 + 7b. Let i(u) = -14d(u) + 2o(u). Calculate p(i(z)). 644z4 Let j(k) be the third derivative of -1/60k*5 + 0k*4 + 0k - 32k2 + 0k3 + 0. Let f(o) = -o2. What is j(f(l))? -l*4 Let p(t) = 107922t*2. Let w(j) = -5j*2. What is w(p(s))? -58235790420s*4 Suppose 3p = 3c - 6, 2c + p - 1 = -0. Let l(v) = v - 1. Let u(h) = 2h2 + 6h - 6. Let t(b) = cu(b) - 6l(b). Let i(s) = s - s + s*2. Determine i(t(z)). 4z*4 Let i(z) = -3z. Let l(h) = -265529h. Calculate l(i(f)). 796587f Let a(l) be the first derivative of -l*2 + 12 - 3 + 2l*2 + 9. Let w(m) = 5m. Determine a(w(q)). 10q Let m(r) = 147r*2. Let p(j) = -250j. Calculate p(m(s)). -36750s2 Suppose 76 = 3m - 4d, -5m = -2d - 38 - 70. Let g(z) = 2z - 19	{ "pile_set_name": "DM Mathematics" }
ulate s. -3, 0, 1 What is y in -y*2 - 7y + 30 = 0? -10, 3 Let -3a4 + 99a*3 - 279a*2 + 273a - 90 = 0. What is a? 1, 30 Solve 54r5/5 + 108r*4/5 + 72r*3/5 + 16r*2/5 = 0. -2/3, 0 Factor 2a*2 + 2a - 144. 2(a - 8)(a + 9) Factor 4o2 + 76o + 312. 4(o + 6)(o + 13) Suppose -3l3/4 - 9l*2 + 81l/4 - 21/2 = 0. Calculate l. -14, 1 Determine p, given that -p*2/5 + 23p - 114/5 = 0. 1, 114 Factor 3o5 - 21o*4 - 198o*3 - 438o*2 - 381o - 117. 3(o - 13)(o + 1)*3(o + 3) Factor -5s2 - 45s + 50. -5(s - 1)(s + 10) Find k such that -2k5 - 20k*4 - 64k*3 - 52k*2 + 66k + 72 = 0. -4, -3, -1, 1 Factor 2b5 + 134b*4 - 556b*3 + 844b*2 - 566b + 142. 2(b - 1)4(b + 71) Find k, given that -4k4 + 56k*3 + 332k*2 - 816k + 432 = 0. -6, 1, 18 Factor 5y3 - 695y*2 + 4035y - 5985. 5(y - 133)(y - 3)2 Factor r3/4 + 4r2 - 9r - 144. (r - 6)(r + 6)(r + 16)/4 Factor h*5/5 + 26h*4/5 + 232h*3/5 + 774h*2/5 + 567h/5. h(h + 1)(h + 7)(h + 9)2/5 Find u, given that -6u*2 + 490u + 496 = 0. -1, 248/3 Factor -2g4/3 - 342g*3 - 2036g*2 - 12184g/3 - 2704. -2(g + 2)3(g + 507)/3 Factor -51o2 - 312o - 36. -3(o + 6)(17o + 2) Let 2j*2 + 50j = 0. What is j? -25, 0 Factor -2k4/3 - 2k*3 + 20k*2/3. -2k*2(k - 2)(k + 5)/3 Solve -2y*2/3 - 996y - 372006 = 0 for y. -747 Suppose 7y4 + 681y*3 + 16315y*2 - 12201y - 4802 = 0. What is y? -49, -2/7, 1 Factor w*3/2 + 131w*2 + 259w/2 - 261. (w - 1)(w + 2)(w + 261)/2 Solve 4c5/17 + 10c*4/17 - 44c*3/17 - 96c*2/17 + 72c/17 + 54/17 = 0 for c. -3, -1/2, 1, 3 Factor -2u3/9 + 2u*2/9 + 4u/3. -2u(u - 3)(u + 2)/9 Factor 5n*2 + 1085n + 3210. 5(n + 3)(n + 214) Factor 4m2/5 + 68m/5 - 48. 4(m - 3)(m + 20)/5 Determine g, given that -2g4 - 48g*3 + 216g*2 - 224g = 0. -28, 0, 2 What is l in 4l4/3 - 352l*3/3 + 1280l*2 - 14848l/3 + 19456/3 = 0? 4, 76 Factor -2c2/7 - 148c/7 - 80. -2(c + 4)(c + 70)/7 Solve r*5 - 7r*4 + 3r*3 + 59r*2 - 104r + 48 = 0. -3, 1, 4 Solve 3m2/4 - m/8 = 0. 0, 1/6 Determine m so that 45m*5 + 145m*4 - 645m*3 + 615m*2 - 100m - 60 = 0. -6, -2/9, 1 What is q in -q*2/4 + 25q/4 - 6 = 0? 1, 24 Let 2m2/5 + 66m - 668/5 = 0. Calculate m. -167, 2 Solve 4v2 + 3992v + 996004 = 0 for v. -499 Solve 2v2/9 + 17180v/9 + 36894050/9 = 0. -4295 Let 6r3/11 - 276r*2/11 + 4134r/11 - 20280/11 = 0. Calculate r. 13, 20 Let 2a4/7 - 44a*3/7 - 2a*2/7 + 44a/7 = 0. What is a? -1, 0, 1, 22 Solve -5s5 - 375s*4 + 1560s*3 - 1580s2 = 0 for s. -79, 0, 2 Suppose -i3/7 - 78i2/7 + 499i/7 - 60 = 0. What is i? -84, 1, 5 Solve -574q3/9 + 764q*2/3 + 962q/3 + 20/9 = 0. -1, -2/287, 5 Let -9b5/8 + 75b*4/8 - 127b*3/8 - 3b*2/8 + 13b/2 + 3/2 = 0. Calculate b. -1/3, 1, 2, 6 Suppose -a*2/8 - 10a - 200 = 0. What is a? -40 Factor -2r2/5 - 1032r/5. -2r(r + 516)/5 Determine t, given that -t*2/2 - 1171t/2 - 1752 = 0. -1168, -3 Suppose 4m4 + 8m*3 - 4m*2 - 8m = 0. What is m? -2, -1, 0, 1 Find u such that -2u5/7 + 34u*4/7 + 1166u*3/7 + 3230u*2/7 + 300u = 0. -15, -2, -1, 0, 35 Factor -j*2/5 + 1704j/5. -j(j - 1704)/5 Solve 60r*5 - 245r*4 - 160r*3 + 1095r*2 - 90r = 0 for r. -2, 0, 1/12, 3 Find b such that 5b5 - 40b*4 + 65b*3 + 110b*2 - 160b - 160 = 0. -1, 2, 4 Factor -5s3 + 285s*2 - 2530s. -5s(s - 46)(s - 11) Factor b2/3 + 9b + 176/3. (b + 11)(b + 16)/3 Factor -q3 + 19q*2 - 87q + 117. -(q - 13)(q - 3)2 Find c, given that -2c*5 + 6c*4 - 4c*3 = 0. 0, 1, 2 Solve -18v*5/11 + 240v*4/11 - 284v*3/11 - 56v*2/11 + 94v/11 + 24/11 = 0. -1/3, 1, 12 Factor -5h3 + 20h*2 + 5h - 20. -5(h - 4)(h - 1)(h + 1) Determine x so that -3x*5/5 + 39x*4/5 + 306x*3/5 + 654x*2/5 + 561x/5 + 171/5 = 0. -3, -1, 19 Let -2t2 - 2846t/3 + 1900/3 = 0. What is t? -475, 2/3 Factor 8y3 - 44y*2 - 80y - 28. 4(y - 7)(y + 1)(2y + 1) Factor -5z2 - 135z - 460. -5(z + 4)(z + 23) Factor -2l2/15 + 10l/3 - 76/5. -2(l - 19)(l - 6)/15 Find z such that 3z2/4 + 123z/2 + 540 = 0. -72, -10 Find f such that 6f4/5 + 93f*3/5 + 39f*2/5 - 93f/5 - 9 = 0. -15, -1, -1/2, 1 Solve 4c2 - 872c + 868 = 0. 1, 217 Factor -3q3 + 216q*2 - 987q - 1206. -3(q - 67)(q - 6)(q + 1) Factor 4a*3 + 60a*2 + 264a + 320. 4(a + 2)(a + 5)(a + 8) Determine p so that -55p*4 - 90p*3 + 95p*2 + 90p - 40 = 0. -2, -1, 4/11, 1 Factor 2c3 + 31c*2 + 40c - 28. (c + 2)(c + 14)(2c - 1) What is i in -i4 + 2i*3 + 292i*2 + 574i + 285 = 0? -15, -1, 19 Factor 5w5 - 5w*4 - 25w*3 - 15w*2. 5w*2(w - 3)(w + 1)2 Solve -35l*4/4 + 545l*3 - 10805l*2/4 + 3720l - 855 = 0. 2/7, 2, 3, 57 What is w in -2w2/7 - 808w/7 - 81608/7 = 0? -202 Factor -4w3 - 80w*2 + 84w. -4w(w - 1)(w + 21) Factor 3g*2/8 + 105g/4 - 2133/8. 3(g - 9)(g + 79)/8 Suppose -5c4 + 140c*3 - 1135c*2 + 700c + 16500 = 0. What is c? -3, 10, 11 What is x in -196x5 - 252x*4 + 332x*3 + 108x*2 + 8x = 0? -2, -1/7, 0, 1 Factor f*3/5 + 6f*2/5 - 19f/5 - 24/5. (f - 3)(f + 1)(f + 8)/5 Determine z, given that -3z2 - 12z - 12 = 0. -2 Solve -2x4/3 + 12x*3 - 26x*2/3 - 48x + 136/3 = 0 for x. -2, 1, 2, 17 Determine t, given that -4t5/5 - 44t*4/5 - 156t*3/5 - 196t*2/5 - 16t = 0. -5, -4, -1, 0 Factor 3y2/2 - 3y/2 - 9. 3(y - 3)(y + 2)/2 Solve -t*3/3 + 44t*2 + 45t - 266/3 = 0 for t. -2, 1, 133 Determine y so that y*3 - 65y*2 - 66y = 0. -1, 0, 66 Factor -3c3 - 78c*2 + 12c + 312. -3(c - 2)(c + 2)(c + 26) Find i such that i3/4 - 7i*2/2 - 8i = 0. -2, 0, 16 Factor 5o3 + 35o*2 - 960o + 3420. 5(o - 6)2(o + 19) Let -20w2 + 84w - 16 = 0. Calculate w. 1/5, 4 Determine j so that -j*4 + 4j*3 - 5j*2 + 2j = 0. 0, 1, 2 Factor 4s3/5 - 4s*2 + 28s/5 - 12/5. 4(s - 3)(s - 1)2/5 Solve -c5/3 + c*4 + 38c*3/3 + 8c*2 - 64c/3 = 0 for c. -4, -2, 0, 1, 8 Suppose -2m2/7 - 6m/7 + 8 = 0. Calculate m. -7, 4 Factor 6d3/5 + 8d*2/5 - 98d/5 + 12. 2(d - 3)(d + 5)(3d - 2)/5 Factor -4n2 + 57080n - 203632900. -4(n - 7135)2 Factor 9l*3 + 7890l*2 - 2631l. 3l(l + 877)(3l - 1) Find u, given that u*2/5 + 32u/5 + 12 = 0. -30, -2 Solve -x*3 - 147x*2 + 148x = 0 for x. -148, 0, 1 Factor 3j3/4 - 1350j*2 + 810000j - 162000000. 3(j - 600)3/4 What is d in 20d*3/13 - 378d*2/13 + 322d/13 + 36/13 = 0? -1/10, 1, 18 Suppose -q*2/5 - 48q/5 - 576/5 = 0. What is q? -24 Let -7n4 + 9n*3 + 5n*2 - 9n + 2 = 0. Calculate n. -1, 2/7, 1 What is g in -2g4/7 - 2g*3/7 + 4g*2/7 = 0? -2, 0, 1 Let 5c*5/4 + 29c*4/2 + 34c*3 - 76c*2 - 156c + 72 = 0. What is c? -6, -2, 2/5, 2 Determine i, given that 3i4 + 1470i*3 + 7299i*2 + 11652i + 5820 = 0. -485, -2, -1 Factor -5h3 - 35h*2 - 35h + 75. -5(h - 1)(h + 3)(h + 5) Factor -4b*2 + 72b + 1120. -4(b - 28)(b + 10) Factor 3g2 - 870g + 867. 3(g - 289)(g - 1) Factor -6i2/13 - 70i/13 + 24/13. -2(i + 12)(3i - 1)/13 Determine k, given that k5/8 + 3k*4/4 - 9k*3/2 + 5k*2 = 0. -10, 0, 2 Let -8b*5/7 - 160b*4/7 - 554b*3/7 - 694b*2/7 - 356b/7 - 64/7 = 0. Calculate b. -16, -2, -1, -1/2 Determine w so that 28w3 + 804w*2 - 232w = 0. -29, 0, 2/7 Suppose 8b5/9 - 68b*4/9 - 16b*3/3 + 104b*2/9 + 40b/9 - 4 = 0. Calculate b. -1, 1/2, 1, 9 Factor 2l4/9 + 14l*3/9 - 20l*2/9 - 32l/9. 2l(l - 2)(l + 1)(l + 8)/9 Suppose -5r4 - 10r*3 = 0. What is r? -2, 0 Let -35c*4 - 200c*3 + 95c*2 + 200c - 60 = 0. Calculate c. -6, -1, 2/7, 1 Factor 33895575246a4 - 11241429784a*3 - 18999708a*2 - 10680a - 2. 2(3a - 1)(1781a + 1)*3 What is h in 217h*5 + 954h*4 + 1426h*3 + 852h*2 + 157h - 6 = 0? -2, -1, -3/7, 1/31 Let -3w5 + 97w*4/7 - 75w*3/7 - 15w*2 + 76w/7 - 12/7 = 0. Calculate w. -1, 2/7, 1/3, 2, 3 Factor -4i2 + 10244i + 20504. -4(i - 2563)(i + 2) Factor g*5/4 + 21g*4/2 + 41g3/4. g3(g + 1)(g + 41)/4 Factor -2500x3 - 17650x*2 - 4209x/4 - 63/4. -(x + 7)(100x + 3)*2/4 Factor -10r*3 + 615r*2 - 890r - 600. -5(r - 60)(r - 2)(2r + 1) Deter	{ "pile_set_name": "DM Mathematics" }
548 - 19r2 - 548. -19r*2 Collect the terms in -5n*2 - 31 + 62 - 31. -5n*2 Collect the terms in -13987 + 13987 + 9l*2. 9l*2 Collect the terms in 1518l*2 - 2 + 2. 1518l*2 Collect the terms in -24o*2 + 2o*3 + 17o*2 - 9o + 9o. 2o*3 - 7o*2 Collect the terms in 4l*2 - 4l*2 + 0l*2 + 50 - 3l*2. -3l*2 + 50 Collect the terms in -310a*3 - 10a*3 - 194a*3. -514a*3 Collect the terms in 10g*2 - 6g2 - g2 - 5g2. -2g*2 Collect the terms in -4v*2 - 8v*2 + 25v*2. 13v*2 Collect the terms in -12u + 3u + 5u + 4u + 27u*2. 27u*2 Collect the terms in 7b + 42 - 7b + 2b*2. 2b*2 + 42 Collect the terms in -25s*2 - s + s + 17s*2 + 9s2. s2 Collect the terms in 30 - 30 + 8u3 + 9u*3. 17u*3 Collect the terms in -2 + 25 - 13 + 20 - a. -a + 30 Collect the terms in 3u + 28 + 20 + 27 - 75. 3u Collect the terms in -7l - 5 + 2l + 3 + 0. -5l - 2 Collect the terms in 643b2 + 30b - 30b - 641b*2. 2b*2 Collect the terms in 24i*2 - 27i*2 + 6i*2. 3i*2 Collect the terms in -5n*3 + 15n*3 - 13n*3. -3n*3 Collect the terms in -19u*2 + 0u*2 + 3u*2. -16u*2 Collect the terms in 11x + 7x - 20x. -2x Collect the terms in 2q*2 - 1585 + 3169 - 1584. 2q*2 Collect the terms in 771x + x3 + x3 + 433x + 0x*3. 2x*3 + 1204x Collect the terms in 26h - 15h + 7h. 18h Collect the terms in 2p2 + 9p2 + p2 - p*2. 11p2 Collect the terms in -n2 - 5n2 - 7n*2 + 14n2. n2 Collect the terms in 13w2 + 11w*2 - 8w*2 + 6w*2. 22w*2 Collect the terms in 135 - 5a - 135. -5a Collect the terms in -2898 + 2898 + 25p. 25p Collect the terms in -s3 - 30s - 38s - 29s + 97s. -s3 Collect the terms in -k3 - 9081 + 9081 + 0k3. -k3 Collect the terms in 43a2 - 7a*2 + 8a*2 - a. 44a*2 - a Collect the terms in -113462r*2 - 9r*3 + 113462r*2. -9r*3 Collect the terms in 17z*3 + 30z*3 + 8z*3 - z - 11z*3. 44z*3 - z Collect the terms in 915u - 450u - 463u. 2u Collect the terms in -237b*3 + 478b*3 - 242b3. -b3 Collect the terms in -44j - 76 + 159 - 83. -44j Collect the terms in -11 - 4l + 26 - 4 - 11. -4l Collect the terms in 4t2 - 7t*2 - 7t*2. -10t*2 Collect the terms in 3x*2 + 2 - 6 - 2x*2 - 3x*2. -2x*2 - 4 Collect the terms in 3m*2 + 3m*3 - 3m*2 - 14m*3. -11m*3 Collect the terms in 9q*3 - 7 + 7. 9q*3 Collect the terms in 2o + 3 + 0o - 3. 2o Collect the terms in 33n + 63n - 26n. 70n Collect the terms in -28y2 + 15y*2 + 29y*2. 16y*2 Collect the terms in 20l + 20l - 5l + 14l. 49l Collect the terms in -117q + 2 - 2 + 99q. -18q Collect the terms in -3t*2 - 9t*2 + 9t*2. -3t*2 Collect the terms in 241i*3 - 489i*3 + 245i*3. -3i*3 Collect the terms in 39 + 12p*2 - 39. 12p*2 Collect the terms in 5 - 2 - 4 + 55j*3 - 19j*3. 36j3 - 1 Collect the terms in a2 - 6a2 + 15a*2 - 7a*2. 3a*2 Collect the terms in -565 - 2i - 567 + 1132. -2i Collect the terms in -1 - 57t - 40t - 35t. -132t - 1 Collect the terms in -273k*3 + 152k*3 + 133k*3. 12k*3 Collect the terms in 1409x*3 - 2819x*3 + 1416x*3. 6x*3 Collect the terms in -3o*2 - 4o*2 + 5o*2 - 3o*2. -5o*2 Collect the terms in 32l - 57l - 7l. -32l Collect the terms in 6s - 5s - 4s + s. -2s Collect the terms in -103h*2 - 108h*2 + 212h2. h2 Collect the terms in -6r3 + 0r*2 - 10r*2 + 10r*2. -6r*3 Collect the terms in -41z*2 + 33z*2 - 215z + 215z. -8z2 Collect the terms in a3 - 7551 + 7551. a*3 Collect the terms in 19n*3 + n - 10n + 19n3 - 45n*3. -7n*3 - 9n Collect the terms in 1 - 6 + 14c + 3. 14c - 2 Collect the terms in -46l2 + 933 - 933. -46l*2 Collect the terms in 5i + 96 - 96 - 2i. 3i Collect the terms in 2k - 2k - 8k + 9k + 37k3. 37k*3 + k Collect the terms in 24y*2 + 23y*2 - 49y*2 + 63y - 63y. -2y*2 Collect the terms in 2f*3 + 237f - 237f. 2f*3 Collect the terms in -10t + 6t + 0t + t*2 + 4t. t*2 Collect the terms in 93t - 140t + 79t. 32t Collect the terms in 20l*2 - 49l*2 + 24l*2. -5l*2 Collect the terms in 266 - 266 - 4m*2. -4m*2 Collect the terms in 293n + 161n - 5n. 449n Collect the terms in 20 - 1 - 1 + 21s + 6. 21s + 24 Collect the terms in -8d - 2d + 4d - 2d - 2d*2. -2d*2 - 8d Collect the terms in -142z2 + 56z*2 - 153z*2. -239z*2 Collect the terms in 0r - r - 48r2 + r. -48r*2 Collect the terms in -2 - 27n + 21n + 2. -6n Collect the terms in -1043g + 518g + 522g. -3g Collect the terms in -20 + 8 - g3 + 12. -g3 Collect the terms in 1209636 - 1209636 - 2m + 2m + 2m2. 2m*2 Collect the terms in 34k*2 - 227k*2 - 81k*2 - 344k*2. -618k*2 Collect the terms in -10b*2 - 6b*2 + 8b*2. -8b*2 Collect the terms in -42f*2 + 13f*2 + 17f*2 + 11f2. -f2 Collect the terms in 18a + 18a - 39a. -3a Collect the terms in 18541c - 6c*2 - 18541c. -6c2 Collect the terms in 1 - 9i - 17i - 1. -26i Collect the terms in -16h + 26h - 15h - 10h. -15h Collect the terms in 310 - 310 - 3r*3. -3r*3 Collect the terms in 3b + 37b2 - 3b - 33b2. 4b*2 Collect the terms in 728 + 2k*3 - 728. 2k*3 Collect the terms in -5 + 5 - 5x*2 + 4x2. -x2 Collect the terms in 9b + 979b*2 - 985b*2 - 9b. -6b2 Collect the terms in 1074w*3 - 10w + 10w. 1074w*3 Collect the terms in 19j*2 - 39j*2 + 6j*2. -14j*2 Collect the terms in -833 - 2b + 833 - b. -3b Collect the terms in 69g*3 + 72g*3 + 73g*3 + 66g*3 - 281g3. -g3 Collect the terms in 10o2 - 25o*2 + 4o*2 + 8o*2. -3o*2 Collect the terms in -8 + 9 + 4c - 1. 4c Collect the terms in -l + 0l + 2l - 29. l - 29 Collect the terms in 10 - 5 + 3y*3 - 5. 3y*3 Collect the terms in 281 - 281 + 14q*3 + 2q*3. 16q*3 Collect the terms in 6y - 4y + 0y + 6y. 8y Collect the terms in 2b2 + 7b*2 - 3b*2 - 3b*2. 3b*2 Collect the terms in -79k + 6k - 30k. -103k Collect the terms in 3c2 + c2 - 8c2. -4c*2 Collect the terms in -252r + 520r - 265r. 3r Collect the terms in 6d*3 + 18d3 - d2 + 15d3. 39d3 - d2 Collect the terms in -2260a - 2252a + 9019a - 2252a - 2253a. 2a Collect the terms in 118p3 + 11p - 10p + 13p. 118p3 + 14p Collect the terms in -4u2 + 5u*2 + 8u*2 - 7u*2. 2u*2 Collect the terms in 4h + 14h2 - h2 - 12h + 8h. 13h*2 Collect the terms in 7v*2 + 7v*2 - 15v2. -v2 Collect the terms in 73l - 29l - 46l. -2l Collect the terms in -7c2 + 2244c - 2244c. -7c*2 Collect the terms in 11r3 - r2 - 15r3 - 3r*2 + 13r*3. 9r*3 - 4r*2 Collect the terms in -16u*2 - 42u*2 + 9u*2. -49u*2 Collect the terms in 0 + 29m*2 - 27m*2 + 33. 2m*2 + 33 Collect the terms in 2d*2 + 12d*2 - 26d*2 + 3d*2 + 7d*2. -2d*2 Collect the terms in -3j + 7j + 2j*2 + 10j - 2j. 2j*2 + 12j Collect the terms in -2b3 - 161b - 20b + 8b + 0b3. -2b*3 - 173b Collect the terms in 0w + 0 - 7w + 0 - 2w2. -2w*2 - 7w Collect the terms in 90 - 22t - 90. -22t Collect the terms in -2d2 + 1819 - 1819. -2d*2 Collect the terms in 107r*3 + 147r*3 + 5r*3 - 28r*3. 231r*3 Collect the terms in 4w3 + w3 - 6w3 + 2w3. w3 Collect the terms in -5n2 + 17n*2 + 7 - 13n2. -n2 + 7 Collect the terms in -47f3 + 3f*3 + 20f*2 - 20f*2. -44f*3 Collect the terms in 36 - 3n2 + n3 + 0n3 + 3n2. n3 + 36 Collect the terms in 88w2 + 83w*2 - 186w*2. -15w*2 Collect the terms in 80l*2 - 145l*2 + 63l*2. -2l*2 Collect the terms in -250j*3 + 553j*3 + 628j*3. 931j*3 Collect the terms in 27f*3 + 9f*3 - 22 + 21 + 28f*3. 64f*3 - 1 Collect the terms in 26t*2 - 70t*2 + 26t*2 + 22t*2. 4t*2 Collect the terms in 0 + 4 - 1 - 55t. -55t + 3 Collect the terms in 43z*3 - 129z*3 + 87z3. z3 Collect the terms in 5f + 2348 - 2348 - 4f - 2f. -f Collect the terms in 321 - 633 - 6g*3 + 312. -6g*3 Collect the terms in 3u*3 - 4u3 + u3 - u3. -u3 Collect the terms in 7o - 14o - 57o3 + 7	{ "pile_set_name": "DM Mathematics" }
- 1775 = 3z, -1207 = 4x - 5z - 4762. What is the remainder when x is divided by 28? 27 Let h = 122 + -51. What is the remainder when h is divided by 24? 23 Let c = 20 - -3. Let o(s) = -s3 - 1. Let m(b) = 7b*3 - 6b*2 + b + 18. Let j(q) = -m(q) - 6o(q). What is the remainder when c is divided by j(5)? 7 Suppose -6g + 3g - 48 = -4p, -4p + 5g + 48 = 0. Calculate the remainder when 23 is divided by p + 10/(-4)12/(-30). 10 Suppose -44q + 46q - 1587 = -5d, 3d - 2q = 965. Calculate the remainder when d is divided by 81. 76 Let i = -51 - -56. Let f(s) = s3 + 2s*2 - 6s + 3. Calculate the remainder when f(i) is divided by 30. 28 Let j(x) = 16x + 2. Calculate the remainder when j(2) is divided by 24. 10 Suppose -42 = -t - 25. Calculate the remainder when 228 is divided by t. 7 Let h(g) = 2g - 3. Let k be h(4). Let i = 10 - k. Suppose if + 4r - 100 = -0f, 3f - r = 43. What is the remainder when 47 is divided by f? 15 Let v(j) = j*3 - 7j*2 + 13j - 3. Let t = 1 + 5. Let r be v(t). Let n = 108 - r. What is the remainder when n is divided by 35? 34 Let b = 121 + -114. Let x = 13 - -19. Calculate the remainder when x is divided by b. 4 Let i(m) = m*3 + 21m*2 - 2m - 22. What is the remainder when 12/(-8)-279/3 is divided by i(-21)? 19 Suppose 104a - 109a + 20 = 0. Suppose -al - 9 = -5l. What is the remainder when 24 is divided by l? 6 Calculate the remainder when 15750/147 - 32/28 is divided by 66. 40 Let x = 1481 - 1418. What is the remainder when x is divided by 37? 26 Let k = 34 - 27. Suppose -ki + 79 = -12. Calculate the remainder when 23 is divided by i. 10 Calculate the remainder when 488 is divided by 286/8 - 3/4. 33 Suppose -4r - 200 = -14r. What is the remainder when r is divided by 7? 6 Let h = 30 - 26. Let y = -8 - -15. What is the remainder when y is divided by h? 3 Suppose 0 = 2c - m - 50, 2c - 4m - 41 = 3. Suppose -4t + 16 = 4d - 2d, -5d = 2t - 64. Calculate the remainder when c is divided by d. 12 Suppose 0 = 2n + n - 96. Let r = -29 + n. What is the remainder when 161/r - (-7)/21 is divided by 19? 16 Let t be 36/(-45)(-1990)/(-4). Let u be 8/16 - t/4. Suppose 7o = 2o + u. What is the remainder when 39 is divided by o? 19 Let s(i) = 4i*2 - i. Let v be s(-1). Suppose -4r = -vr - 360. Calculate the remainder when 31 is divided by r/(-32) + (-1)/4. 9 Suppose 2c + 8 = 0, d = -3d + c + 32. Calculate the remainder when 45 is divided by d. 3 Suppose 10w = -5114 + 19594. Calculate the remainder when w is divided by 5. 3 Suppose -4h = -3h + 2j - 4, -2h + 4j = -40. Suppose -2b = -5w + 133 - 14, 0 = 5w + 3b - 109. Calculate the remainder when w is divided by h. 11 Suppose 14 + 2 = 2r. Suppose 0 = -0g - 4g + r. Suppose -4b - b = gf - 75, -5b + 45 = -4f. What is the remainder when 51 is divided by b? 12 Suppose 4v - 11100 = -v - 5g, 3v - 5g = 6660. What is the remainder when v is divided by 101? 99 Let o(n) = 93n2 - 2n - 1. What is the remainder when o(-1) is divided by (1 + (-9 - 0))(-39 + 37)? 14 Let q = 2543 + -2455. Calculate the remainder when q is divided by 23. 19 Let x = 64 - 32. Let t = x - 11. What is the remainder when 61 is divided by t? 19 Suppose 6h = h. Suppose 3 = -3q - 12, -3r + 2q + 25 = h. Suppose r + 11 = j. Calculate the remainder when j is divided by 5. 1 Let j(r) = 42r*2 + r + 1. Let w = -32 + 31. Calculate the remainder when j(w) is divided by 11. 9 Suppose 0 = 107i - 110i + 39. Calculate the remainder when 2129 is divided by i. 10 Let f(g) = -5g - 9. Suppose 16x + 54 = -10. What is the remainder when 106 is divided by f(x)? 7 Let k = -35 + 60. Let u = -23 + k. Suppose 0 = -ua + 5a - 66. What is the remainder when a is divided by 8? 6 Let j = -37 + 40. Let t(b) = 13b - 1. Let f = 14 + -1. What is the remainder when t(j) is divided by f? 12 Suppose -4x + 42 = -4b + 5b, 0 = 5b + 4x - 162. What is the remainder when 46 is divided by b? 16 Suppose -r - 5 = -4. Let x(a) = 4a*2 - 1. Calculate the remainder when 15 is divided by x(r). 0 Let k(z) be the third derivative of 17z4/12 - z3/3 + 7z2. Calculate the remainder when k(1) is divided by 11. 10 Let r(l) = l2 + 2l + 3. What is the remainder when 10 - (-30)/(-5) - (11 - 31) is divided by r(-4)? 2 Let r = 1111 + -1081. What is the remainder when r is divided by 16? 14 Suppose -5s - 18 - 12 = 0. Let m be (-1)/(19/s + 3). Suppose m = -a + 29. What is the remainder when a is divided by 8? 7 Suppose 0 = -0k + 4k - 2r - 54, -3r = -3. Let m(s) = -11s + 41. What is the remainder when m(0) is divided by k? 13 What is the remainder when 8 is divided by 20/(12 - (-76)/(-8))? 0 Suppose 5p - 4p = 0. Suppose -5q = -25, -3q = 2s - 4q + 9. What is the remainder when s - (0 - 33) - p is divided by 11? 9 Let q = -6 + 54. Calculate the remainder when 285 is divided by q. 45 Suppose k = 11k - 90. Calculate the remainder when 4/(19/17 + -1) is divided by k. 7 Suppose t + 25 = 118. What is the remainder when 284 is divided by t? 5 Let j(t) = 37t3 - t2 + 4t - 2. Let f be j(1). Suppose z = 2z + 27. Let o = z + f. What is the remainder when 32 is divided by o? 10 Let l = 0 - -66. Let u(y) = -10y - 5. Let j be u(-7). Suppose -3f - 7 = -t - 78, -3f = 2t - j. Calculate the remainder when l is divided by f. 20 What is the remainder when 260/(-78)(-38 - 1) is divided by 38? 16 Let t(k) be the first derivative of k4/4 + 2k*3 - 3k*2/2 + 5k - 1. What is the remainder when 3/(-3) - 11/((-44)/268) is divided by t(-6)? 20 Suppose -5z - 97 = -4b, 4b - 4z = -0z + 92. Let u(k) = -k2 + 7k + 8. What is the remainder when u(6) is divided by 156/b + -3 + 2/6? 2 What is the remainder when (0 - -1)/((-605)/(-151) + -4) is divided by 76? 75 Let y(d) = -d*3 + 6d*2 - 23d + 166. Calculate the remainder when 102 is divided by y(6). 18 Let u be 2/((-9)/18 - 2/(-8)). What is the remainder when u/((-4)/(-114)-3) is divided by 40? 36 Let q(n) = 17n - 5n2 - 8 + 4n*2 - 5n. Let j = -3 - -12. What is the remainder when q(j) is divided by 11? 8 Let l(q) = 2q2 + 23q + 25. Let c be (-7 + 1)64/(-6). Suppose -2k - c = -3a, -5k + 19 + 31 = 3a. What is the remainder when l(-12) is divided by a? 17 Suppose -67l + 25 = -62l. Let r = 31 - 18. Suppose 12 = -3s, r + 18 = 3o - s. What is the remainder when o is divided by l? 4 Suppose 5o - o = 32. Let r be (354/8)/((-1)/o). What is the remainder when r/(-10) - (-6)/(-15) is divided by 18? 17 Suppose 53 = 2q + 3f - 10, f = -4q + 131. Suppose 7424 = -4i + 62i. Calculate the remainder when i is divided by q. 29 What is the remainder when (1 + -185)((-10)/(-4))/(-5) is divided by 41? 10 Suppose -46n = -51n - 360. Calculate the remainder when 28 is divided by (-16)/n + (-426)/(-27). 12 Let v(p) = -p*3 - 22p*2 + 25p + 52. Let u = 6 + -2. Calculate the remainder when (-573)/(-27) - u/18 is divided by v(-23). 3 What is the remainder when (-20)/(-15) - 352/(-6) is divided by 14? 4 Suppose -13i + 10 = -55. Suppose -19 = -4b + 3b. What is the remainder when b is divided by i? 4 Let w be -3-51/3. Suppose -7b - 82 = -t - 6b, 5t = -wb + 420. What is the remainder when t is divided by 43? 40 Suppose -234 - 46 = -4x. Let w(n) = n*2 + 9n - 10. Let q(s) = -4s2 + 6s + 7. Let p be q(3). Calculate the remainder when x is divided by w(p). 10 Calculate the remainder when 46 is divided by 366/27 + 80/180. 4 Calculate the remainder when 177 is divided by 64/80 + (-648)/(-15) + -1. 5 Suppose -5v = -4n - n - 260, 0 = -n - 4. Calculate the remainder when 82 is divided by v. 34 Let j(w) = -91w - 4727. Suppose -4y - 17 = -133. What is the remainder when y is divided by j(-52)? 4 Calculate the remainder when 1410(33 - 32) is divided by 29. 24 Let w(r) = -r*3 + 10r*2 - 17r + 11. Let a be w(8). Suppose -3i + 4p = 5p - 259, 5p = -ai + 275. What is the remainder when i is divided by 33? 19 Calculate the remainder when 387 is divided by (-22)/(-12) - -3 - (-5)/30. 2 Let g(i) = 6i*2 + 35i - 29. Let j(o) = o*2 + 7o - 6. Let m(p) = -2g(p) + 11j(p). Suppose -b + 11 = -0. What is the remainder when b is divided by m(3)? 3 Let i(g) = -g + 1. Let u(j) = 10j + 72. Let s(r) = 6i(r) + u(r). Suppose 0 = d + d - 54.	{ "pile_set_name": "DM Mathematics" }
5g + 40 = -lw. Solve a + c - g = -0c, 2a - 4 = c for a. 3 Let w = -309 - -320. Solve 32r = -o + 35r - 8, -5o + w = 2r for o. 1 Suppose 0 = -2q + u + 4, -24 = -q - 3q - 2u. Solve 8c - qc - 22 = 5s, s = c - 5 for c. 3 Let p(r) = -r3 + r2 + 49r - 46. Let w be p(7). Solve -3i + 2a + 6 + w = 0, -2a - 8 = -2i for i. 1 Suppose 156 = 219v - 702 - 18. Solve -vu - 3c + 28 = 0, 4u - 15 = -c + 5 for u. 4 Let l = -76 + -86. Let o be l/(-243) + (0 - 40/(-3)). Solve -3q + 5 = -0q + 4z, 0 = 3q - 5z - o for q. 3 Suppose -2h - 2 = 2. Let u be h/((-4)/10) - 4/4. Suppose -f = uf - 35. Solve 2z = 8, -z + 2 = p - f for p. 5 Let g = 6458 + -6442. Solve 3q - 21 = -3x, 18q - gq = 3x - 11 for x. 5 Let m(i) = -i*2 - 4i. Let l be m(-4). Suppose l = -2x + 12. Suppose 0 = -d + xd - 5. Solve -24 = 4g - 2y, g + 2y - d = -y for g. -5 Suppose 4y - 25 = -y. Let n be ((-9)/3 + 11 - -1)20. Suppose 13l + 32l - n = 0. Solve -lm = -2m - 4p - 14, -yp - 13 = -m for m. 3 Let g be 9((-248)/18 + 14). Solve 0 = -3i - 0i - 3n - 12, -gn = -5i - 6 for i. -2 Let m(k) = k2 - 3k - 6. Let t be m(5). Let z(i) = 3i + 11. Suppose 13v + 46 = 85. Let f be z(v). Solve d - 3y - 23 = 3d, ty = -f for d. -4 Let k = -906 - -908. Let o = -58 + 61. Solve z - 4 = -kt - 13, -oz = t + 2 for z. 1 Let o be ((-30)/105)/((-2)/77) - -8. Solve -4s - 5a - 9 = 26, 2s = -3a - o for s. -5 Suppose -5a = 301p - 306p - 30, 5p = -15. Solve ag + 2c - 6c = 17, 4g = c + 1 for g. -1 Suppose -147 = 11j - 60j. Solve -5y + 2t = 54 - 48, 2y = -jt + 9 for y. 0 Suppose -2f - 34 = h, 0 = h - 3f + 4f + 30. Let w = 29 + h. Solve -y = -2y + 4z - 19, -wz = 4y for y. -3 Let n be (-28)/(-6)(-1 + 44/11). Let y(h) = -6h + 86. Let u be y(n). Solve 2r + u = 0, 3v = v - r - 5 for v. -2 Let f(y) = -y*3 + 19y*2 + 50y - 596. Let s be f(20). Solve -3m + 9 = -sk + 7k, 4m - k = 22 for m. 5 Suppose -i = 3h - 20, 12 = 3h - 2h - 5i. Suppose 0t + 3z = 3t + 6, 4t + 4z = 32. Let j = 4 - 1. Solve -tc = 5g + 18, c + c - jg - h = 0 for c. -1 Let o(t) = 2t - 10. Let p be o(5). Suppose 10 + p = 5x. Suppose 6 = 2v - 3f + x, v - 2 = f. Solve q - vu - 3 = 0, 4q - 4u - 2 = -6 for q. -5 Let c be (-4000)/(-750) + (-2)/6. Solve m = -d + 1, -2d + 3 = -cd for m. 2 Suppose 3 = -3c - 3, 3j - 2c = 13. Suppose ja - 62 + 107 = 0. Let y be (2 + 25/a)6. Solve -3o = -2b - yb + 6, 1 = -o + b for o. 2 Suppose 4f = 4r - 964, r + f = -3r + 969. Let y = -238 + r. Solve i = yh + 20, -2i = 5h - 0i + 12 for h. -4 Let p = -29345 + 29350. Solve -15 = 5c - ph, -4h + 124 = 5c + 103 for c. 1 Let k(q) = 3q + 2. Let j be k(-2). Let m be 38/8 - j/16. Suppose -3h - 11 = -ml, 5 = h + 2. Solve -3u - p = 5, 0 = -lp + 3 + 1 for u. -2 Let s(w) = 6w*2 + 390w - 396. Let o be s(-66). Solve 2 = m - 3j, o = 15m - 20m - j - 22 for m. -4 Let y(q) = 31q + 376. Let m be y(-12). Solve -27s + 8 = 5u - 23s, -u = -2s + m for u. 0 Suppose -194p = -12p - 182. Solve -2i = -4a + 18, -2 = -a - i + p for a. 4 Let l = 2148 + -2145. Solve -4q - 2n = -ln + 7, 4n = -q + 11 for q. -1 Let j = 387 + -308. Suppose 6l + 79 = j. Solve -22 = -4g + 2d - ld, g + 17 = -4d for g. 3 Let s = -269 - -270. Let x(t) = 12t - 8. Let h be x(s). Solve -g + h = -3f, -5g - 3f - 16 = -0g for g. -2 Let u = -1337 - -1881. Suppose 0 = -ur + 539r. Let w = 21 - 2. Solve -5l + w = 4q, rq - q - 5 = -2l for l. 3 Let f be (33/(-45) - 6/(-15))0. Suppose f = 6t - 3t - 15. Suppose -5x - 5j = 15, -3j = -tx - 5j. Solve -4d + 6 = -2g, 0 = -xg + d + d for g. 3 Let f = -178 + 183. Let q be (-4)/(4/3) + f. Solve 0 = 5p - 0z + 4z + 28, -8 = 3p - qz for p. -4 Let w = 1169 - 1153. Solve -i + 5n = -w, -2i + 0n + 2n + 16 = 0 for i. 6 Suppose -2c - 5k + 201 = 0, -15k + 102 = c - 13k. Solve 14 = -4v + cd - 110d, 4d + 3 = -3v for v. -5 Let m = -73 - -181. Suppose 107t + 4 = mt. Solve -f = f + 4u - 10, -3u + 5 = tf for f. -1 Suppose -2k + 36 = 4g, k = -4g + 9g - 10. Solve 0 = 5d + 3o - 6o - 30, -2o = k for d. 3 Let x be (-22)/8 - ((-171)/36 + 5). Let v be x/(-2) - 28/(-8). Solve -z + 4 = 4n, -vn + 2n - 2z = -8 for n. 0 Suppose -2n = -5a + 236, -2n - 2n = -5a + 482. Let o = n + 176. Let d = 54 - o. Solve -f - c = -2 + d, -19 = f - 4c for f. -3 Let h(f) = f + 59. Let p be h(-18). Suppose 79 = 4m - 5a, 4a + 35 + p = 4m. Solve -m = -3k + 5l, 7 = 4k - 5l - 6 for k. -3 Let k(b) = 14b + 303. Let t(m) = 26m + 611. Let q(a) = 7k(a) - 3t(a). Let w be q(-14). Solve 0 = -u + 4g + 12 + w, -4u - 5g = 25 for u. 0 Let i = -62 + -12. Let u = i + 85. Suppose 2 = -o, 4f - o - u = f. Solve -2k + f = y, 0 = 2k - 5k for y. 3 Let t be 5 - 9 - 29/(-1). Suppose 0 = 4v - 4f - 84, t = -4v + 3f + 106. Solve v = 5r + 4u, 2r - 4 = 5r - 5u for r. 2 Suppose 122q = -382q. Solve -4d - 4c = 15 - 7, -d - 2c = q for d. -4 Let j be 7 - (55/22)/(1/2). Suppose -3t + 5 = -2u, ju = -19t + 24t - 15. Solve 4y - 4w + 7 = 23, 0 = -uw - 5 for y. 3 Let o = 746 + -746. Solve -4c - 2d + 22 = o, -9c + 7c = -3d + 9 for c. 3 Let p be (-60)/(-105)7(-3)/(-2). Solve 4r - 16 = 4o + pr, 0 = 3o + 4r + 17 for o. -3 Suppose 3a - v - 12 = 0, 17a - 13a - v = 16. Solve ax + 0j + 12 = -2j, 2 = 4x - 5j for x. -2 Let a be (-6 - -8)(-12 - (-7 - 6)). Solve 3o = 2q + 1, 0 = ao + 38q - 41q + 1 for o. 1 Suppose 4f - v + 1 = 14, -2f = -v - 5. Solve -fr + 8 = 0, -4 = -4s - 3r - 2 for s. -1 Let x = 52 - 46. Let d = -6 - x. Let o = d + 15. Solve 2k - 8 = -4s + 4, -9 = -os + 5k for s. 3 Let w(r) = -18r + 289. Let y be w(-23). Let n = y + -700. Solve -3z = 4b + 1 - 2, b + nz + 11 = 0 for b. 4 Let s = 15150 + -15117. Solve -u = 0, s - 3 = 5d - 4u for d. 6 Suppose 15h + 328 = 358. Suppose -4w + 46 = -2b, 4b + 4w = -81 - 23. Let z = -21 - b. Solve -3n - n - 10 = -hs, zn = -16 for s. -3 Let g(p) = -46p - 168. Let d be g(-9). Let x = -236 + d. Solve -x = -4t - h, 0 = -2t + 4t - 5h + 6 for t. 2 Let t(k) be the third derivative of k5/30 - 7k*4/4 + 27k*3 - 12k*2 + 5. Let n be t(16). Solve -n = 4d - 5a, 0d - 2a - 1 = -d for d. -3 Let n = 6920 + -6916. Solve 4x - 20 = -nj, -2x = -5j - 0x + 32 for j. 6 Suppose -a = 5z + a - 1404, 5z - 5a = 1390. Let c be (-18)/(-7) - (-5)/(z/24). Solve cw - 4w = 2r - 3, 4w - 12 = -5r for r. 0 Suppose -842 = -22x - 138. Solve -b + 3k + 1 = 0, xk = 2b + 27k - 1 for b. -2 Let g(f) = 35f + 212. Let y be g(-6). Solve 6k + 10 = yk + 3a, -4k - 4a = -4 for k. -1 Suppose 0 = j + z + 1, -4j - 20 = z - 5z. Let p be -32 + 62/j. Let x = -29 - p. Solve 0 = -4a - t + x, -3a - t - 3 = -3t for a. 1 Let i(x) = -6997x*3 + 6996x*3 + 0x - 4x2 - 12 - 7x. Let h be i(-4). Solve -h = -3t + 5s, -2s + 6s + 8 = 4t for t. -3 Let y be 213/16 + 339/904. Suppose -a = 4a. Let k = a - 0. Solve k = 3o - 5w - 14, yo + 2w - 6 + 2 = 0 for o. 3 Suppose 14u + 12 = 17u. Let d = u + -2. Solve -3l - d = -2x, x + 3l = -4x - 16 for x. -2 Let a(m) = m3 + 33m*2 - 34m + 23. Let j be a(-34). Suppose -jv = -20v - 36. Solve h - 4f + v = 2, -2f = -h - 4 for h. 2 Suppose -n + 2232 = -9n. Let j = 279 + n. Solve 2c + 9 = -5z, 2z - 5c = -jc + 8 for z. -1 Suppose 26 = 1424x - 1411x. Solve -5 = -11q + 10q - 2b, -xb = -2 for q. 3 Suppose 0 = 148z - 155z + 6 + 8. Solve -17s = -4y - 19s + 4, -11 = -y + zs for y. 3 Suppose 0 = -127r + 123r + 8. Solve -19 = -3z + 5p, 2z - rp - 10 = -0z for z. 3 Let v be (22 - 18)3/4. Let z = 34 - 24. Solve -g - 8 = vg - 4x, 5x - z = -3g for g. 0 Let g(t) = -325t3 + 10 + t - 334t*3 + 660t*3 + 7t*2. Let x be g(-7). Suppose 0 = -d, -xm - 2d + 0 = -6. Solve 3k - q - 13 = 0, mq + 5 = 3 for k. 4 Let o(r) = 46r + 141. Let p be o(-3). Solve 3f = 3, -25s + 26s = -pf - 2 for s. -5 Let m be 24/456 + 74/38. Solve 0 = -y + md - 9, -18d = 4y - 21d + 26 for y. -5 Suppose 172 = 1179n - 1136n. Solve -5b + 5 + 15 = -5s, 2s - nb + 10 = 0 for s. -3 Let k = 373 + -371. Suppose 12 = -4d, 2d + 10 = 4u - ku. Solve 4f + 2j - 8 = 0, -uj + 4 = -f - 4j for f. 4 Let i(h) = -h3 + h2 + 7*h + 2. Let q be i(3)	{ "pile_set_name": "DM Mathematics" }
6 b What is -1 (base 8) in base 2? -1 Convert 13 (base 7) to base 4. 22 Convert -442 (base 7) to base 8. -342 Convert 1 (base 4) to base 14. 1 -d9 (base 14) to base 6 -515 What is -14 (base 16) in base 8? -24 What is 33 (base 4) in base 11? 14 331 (base 6) to base 2 1111111 2 (base 5) to base 8 2 Convert -3 (base 11) to base 3. -10 What is -4 (base 10) in base 14? -4 Convert 2 (base 8) to base 4. 2 0 (base 14) to base 12 0 What is 4 (base 6) in base 5? 4 What is b6 (base 15) in base 3? 20100 What is 1 (base 2) in base 7? 1 What is -15 (base 15) in base 12? -18 -333 (base 4) to base 13 -4b What is 103 (base 10) in base 5? 403 10001 (base 2) to base 14 13 What is -206 (base 10) in base 3? -21122 Convert 63 (base 8) to base 15. 36 -8 (base 9) to base 11 -8 Convert -18 (base 10) to base 4. -102 What is 10101 (base 2) in base 9? 23 What is 535 (base 6) in base 9? 245 Convert -20 (base 12) to base 8. -30 What is 16 (base 16) in base 2? 10110 -7 (base 14) to base 6 -11 Convert 2 (base 15) to base 16. 2 1145 (base 6) to base 16 119 What is 4 (base 13) in base 10? 4 59 (base 15) to base 6 220 Convert -127 (base 9) to base 2. -1101010 -8 (base 16) to base 12 -8 Convert 4 (base 16) to base 9. 4 -5 (base 11) to base 2 -101 What is 33 (base 4) in base 3? 120 Convert -6 (base 12) to base 16. -6 -11011001 (base 2) to base 6 -1001 Convert 2 (base 8) to base 7. 2 Convert -3 (base 8) to base 15. -3 What is -233 (base 5) in base 14? -4c What is 0 (base 12) in base 16? 0 Convert -10100 (base 2) to base 6. -32 -5e (base 16) to base 15 -64 What is 4 (base 16) in base 7? 4 Convert 11112 (base 3) to base 10. 122 What is 55 (base 7) in base 6? 104 What is -2 (base 13) in base 8? -2 111 (base 5) to base 6 51 Convert 2b (base 12) to base 13. 29 -12 (base 3) to base 13 -5 -32 (base 13) to base 3 -1112 What is -86 (base 10) in base 16? -56 -2222 (base 3) to base 10 -80 Convert -4 (base 14) to base 4. -10 What is 30 (base 8) in base 12? 20 Convert -16 (base 10) to base 14. -12 -32 (base 6) to base 2 -10100 Convert 22 (base 12) to base 13. 20 Convert -13 (base 4) to base 16. -7 What is -3 (base 8) in base 10? -3 What is -1100001 (base 2) in base 6? -241 0 (base 3) to base 13 0 Convert 0 (base 4) to base 16. 0 7 (base 12) to base 8 7 Convert -3 (base 7) to base 15. -3 1 (base 10) to base 4 1 Convert 0 (base 4) to base 7. 0 Convert 15 (base 16) to base 14. 17 Convert 4 (base 15) to base 14. 4 What is -212 (base 3) in base 11? -21 What is 4 (base 10) in base 3? 11 -20 (base 10) to base 5 -40 -102 (base 4) to base 11 -17 What is 12 (base 11) in base 2? 1101 7 (base 13) to base 10 7 1 (base 7) to base 11 1 What is -10111101 (base 2) in base 5? -1224 What is c (base 15) in base 8? 14 -1 (base 10) to base 5 -1 -210 (base 4) to base 12 -30 1 (base 7) to base 3 1 Convert 16 (base 14) to base 5. 40 Convert -12 (base 15) to base 11. -16 21 (base 4) to base 7 12 11010 (base 2) to base 3 222 2 (base 10) to base 8 2 -ca (base 16) to base 13 -127 What is 2 (base 4) in base 11? 2 What is -2 (base 8) in base 16? -2 Convert 11 (base 9) to base 8. 12 What is -1 (base 16) in base 10? -1 What is 6 (base 10) in base 13? 6 Convert -21 (base 4) to base 15. -9 Convert -8 (base 11) to base 9. -8 aa (base 13) to base 12 b8 40 (base 10) to base 3 1111 Convert 5 (base 14) to base 4. 11 What is 68 (base 13) in base 5? 321 11 (base 10) to base 2 1011 Convert 2 (base 4) to base 11. 2 Convert 10111 (base 2) to base 3. 212 3 (base 14) to base 15 3 8 (base 16) to base 15 8 What is -1 (base 13) in base 8? -1 What is 1 (base 11) in base 3? 1 What is -1 (base 5) in base 3? -1 What is -11 (base 14) in base 11? -14 Convert -86 (base 12) to base 8. -146 -b (base 13) to base 15 -b Convert -1 (base 9) to base 13. -1 What is 13 (base 6) in base 14? 9 What is 1 (base 7) in base 10? 1 5 (base 16) to base 12 5 What is 220 (base 3) in base 15? 19 Convert cd (base 16) to base 15. da What is 10 (base 7) in base 6? 11 What is 6 (base 9) in base 7? 6 c (base 16) to base 10 12 What is 11 (base 3) in base 9? 4 What is 13 (base 16) in base 7? 25 Convert 5 (base 15) to base 2. 101 What is -1 (base 16) in base 5? -1 Convert 4 (base 9) to base 4. 10 What is -110 (base 4) in base 14? -16 Convert -11 (base 6) to base 13. -7 Convert 2 (base 14) to base 9. 2 c (base 13) to base 6 20 What is -18 (base 10) in base 8? -22 -3 (base 5) to base 14 -3 What is -13 (base 6) in base 3? -100 -1 (base 12) to base 5 -1 What is 1000000 (base 2) in base 10? 64 Convert 2 (base 12) to base 2. 10 What is 122 (base 11) in base 12? 101 2 (base 16) to base 11 2 Convert 1 (base 6) to base 9. 1 Convert 2 (base 8) to base 5. 2 What is -202 (base 4) in base 13? -28 -7e (base 16) to base 14 -90 3 (base 14) to base 12 3 8 (base 10) to base 3 22 Convert -1 (base 5) to base 7. -1 -3 (base 8) to base 4 -3 What is -1 (base 10) in base 14? -1 Convert 24 (base 10) to base 13. 1b Convert 5 (base 12) to base 10. 5 What is 39 (base 16) in base 5? 212 What is 1b (base 16) in base 6? 43 What is 3 (base 8) in base 12? 3 What is 0 (base 8) in base 9? 0 Convert -5 (base 6) to base 11. -5 Convert 10100 (base 2) to base 15. 15 Convert 1 (base 12) to base 11. 1 What is -205 (base 7) in base 4? -1213 Convert -110001 (base 2) to base 15. -34 What is 205 (base 6) in base 8? 115 Convert -35 (base 14) to base 13. -38 Convert 10 (base 2) to base 12. 2 What is -20 (base 13) in base 6? -42 -15 (base 7) to base 8 -14 -25 (base 11) to base 13 -21 -63 (base 14) to base 12 -73 Convert 19 (base 11) to base 7. 26 Convert -2 (base 16) to base 11. -2 -128 (base 12) to base 13 -107 What is -32 (base 5) in base 15? -12 What is -49 (base 10) in base 4? -301 What is 1010 (base 3) in base 5? 110 What is -1 (base 15) in base 12? -1 Convert 94 (base 11) to base 8. 147 What is 127 (base 10) in base 4? 1333 3 (base 10) to base 3 10 Convert -22 (base 3) to base 8. -10 Convert -4 (base 12) to base 2. -100 Convert 36 (base 11) to base 10. 39 Convert -c (base 15) to base 9. -13 Convert -12 (base 4) to base 10. -6 -148 (base 12) to base 13 -125 Convert 22 (base 9) to base 11. 19 Convert 123 (base 4) to base 11. 25 -4 (base 13) to base 3 -11 What is -5 (base 9) in base 6? -5 What is -14 (base 5) in base 7? -12 -b (base 16) to base 7 -14 Convert 1 (base 7) to base 8. 1 -43 (base 6) to base 2 -11011 c (base 14) to base 16 c What is 20 (base 9) in base 14? 14 65 (base 9) to base 2 111011 What is 52 (base 10) in base 3? 1221 -232 (base 4) to base 10 -46 Convert 10101 (base 2) to base 7. 30 105 (base 6) to base 2 101001 49 (base 15) to base 2 1000101 Convert -2 (base 7) to base 5. -2 Convert -5 (base 9) to base 14. -5 -100 (base 4) to base 15 -11 43 (base 5) to base 14 19 Convert 21 (base 4) to base 8. 11 Convert -3b (base 12) to base 13. -38 a (base 12) to base 9 11 Convert -14 (base 6) to base 11. -a Convert -221 (base 7) to base 15. -78 What is -102 (base 11) in base 9? -146 Convert -5 (base 15) to base 12. -5 Convert 12 (base 14) to base 12. 14 What is -2 (base 3) in base 16? -2 Convert -21 (base 5) to base 3. -102 Convert -42 (base 15) to base 10. -62 13 (base 4) to base 11 7 -122 (base 3) to base 7 -23 What is 1012 (base 5) in base 4? 2010 Convert -13 (base 4) to base 16. -7 Convert 3 (base 11) to base 13. 3 Convert 4b (base 12) to base 14. 43 Convert -15 (base 6) to base 10. -11 What is -9 (base 14) in base 15? -9 22 (base 9) to base 10 20 Convert -11 (base 6) to base 11. -7 10 (base 4) to base 13 4 26 (base 10) to base 9 28 1001 (base 3) to base 9 31 -79 (base 14) to base 8 -153 61 (base 10) to base 3 2021 What is -11 (base 2) in base 7? -3 -82 (base 10) to base 8 -122 What is 221 (base 5) in base 2? 111101 What is 13 (base 4) in base 9? 7 Convert 0 (base 10) to base 14. 0 What is -82 (base 15) in base 14? -8a What is -5 (base 14) in base 16? -5 Convert 21 (base 6) to base 15. d What is 5 (base 11) in base 10? 5 What is 9 (base 14) in base 8? 11 Convert 160 (base 8) to base 9. 134 What is -13 (base 6) in base 9? -10 -6 (base 15) to base 2 -110 Convert 304 (base 7) to base 9. 177 What is -64 (base 13) in base 15? -57 -1 (base 14) to base 2 -1 Convert -47 (base 8) to base 5. -124 Convert -1403 (base 5) to base 15. -103 Convert 72 (base 10) to base 2. 1001000 What is -13 (base 11) in base 10? -14 Conver	{ "pile_set_name": "DM Mathematics" }
is the greatest common factor of 102 and 7914? 6 What is the greatest common divisor of 331281 and 9? 9 Calculate the highest common factor of 2761 and 1166. 11 Calculate the greatest common factor of 27460 and 60. 20 Calculate the highest common divisor of 4864 and 127072. 608 What is the greatest common factor of 495205 and 5? 5 Calculate the highest common divisor of 235290 and 6510. 930 What is the highest common divisor of 8829 and 324? 81 What is the greatest common divisor of 818 and 129653? 409 What is the highest common divisor of 219606 and 102? 102 Calculate the greatest common factor of 21078 and 522. 18 What is the greatest common factor of 5346 and 10978? 22 What is the highest common divisor of 290496 and 4806? 534 Calculate the greatest common factor of 322 and 133791. 161 What is the greatest common divisor of 60 and 632640? 60 What is the greatest common divisor of 2982 and 129504? 426 Calculate the highest common factor of 270 and 7440. 30 What is the highest common divisor of 5040 and 9352? 56 What is the highest common factor of 4407 and 2373? 339 What is the greatest common divisor of 88 and 610269? 11 What is the greatest common factor of 117 and 3440541? 39 What is the greatest common factor of 1592 and 10746? 398 What is the highest common factor of 32 and 23912? 8 Calculate the greatest common factor of 477616 and 48. 16 Calculate the greatest common divisor of 1656206 and 62. 62 What is the highest common factor of 1613736 and 54? 54 What is the highest common divisor of 13005 and 25? 5 What is the highest common factor of 154740 and 384? 12 Calculate the greatest common factor of 41412 and 19074. 102 What is the highest common factor of 366279 and 498? 249 Calculate the highest common factor of 1473489 and 909. 909 Calculate the greatest common factor of 998 and 1100794. 998 What is the greatest common divisor of 13956 and 132? 12 What is the greatest common factor of 4989 and 174? 3 Calculate the highest common factor of 291 and 16781. 97 What is the highest common factor of 733 and 1742341? 733 What is the highest common factor of 20718 and 27? 9 Calculate the highest common divisor of 232 and 194. 2 What is the highest common divisor of 10418810 and 118? 118 What is the greatest common divisor of 12 and 23524? 4 Calculate the highest common divisor of 255 and 912900. 255 Calculate the highest common divisor of 824 and 480289. 103 Calculate the highest common divisor of 1408 and 8960. 128 What is the highest common divisor of 12089056 and 464? 464 What is the highest common factor of 400 and 30440? 40 What is the highest common factor of 389324 and 52? 52 What is the greatest common factor of 5356 and 58401? 103 Calculate the greatest common factor of 9766 and 41891. 257 What is the greatest common divisor of 35 and 191205? 35 Calculate the greatest common divisor of 627 and 55005. 57 What is the greatest common factor of 368 and 40816? 16 What is the greatest common divisor of 2274488 and 8? 8 What is the greatest common divisor of 7296 and 83968? 128 What is the highest common factor of 955 and 913935? 955 What is the highest common factor of 2192 and 16988? 548 Calculate the highest common divisor of 2064 and 2785712. 688 Calculate the highest common divisor of 45186 and 3417. 51 Calculate the greatest common divisor of 43430 and 387. 43 Calculate the greatest common divisor of 36 and 217524. 12 Calculate the highest common divisor of 6736 and 248. 8 Calculate the highest common divisor of 1617 and 19371. 33 What is the greatest common divisor of 13080418 and 1534? 1534 What is the greatest common factor of 142989 and 14? 7 What is the highest common divisor of 1994 and 3418713? 997 What is the highest common factor of 9750 and 11500? 250 Calculate the highest common divisor of 52796 and 938. 134 What is the highest common divisor of 90506 and 1079? 13 Calculate the greatest common factor of 1104 and 13344. 48 Calculate the greatest common factor of 215 and 120830. 215 Calculate the greatest common factor of 33440 and 507760. 880 Calculate the highest common factor of 6183 and 171. 9 What is the highest common divisor of 450 and 822? 6 Calculate the greatest common factor of 159888 and 66. 6 What is the greatest common divisor of 54048 and 228? 12 Calculate the greatest common factor of 112 and 2107. 7 What is the greatest common divisor of 455 and 171535? 455 What is the highest common factor of 55 and 257345? 55 What is the greatest common divisor of 211792 and 992? 496 What is the greatest common factor of 104 and 19? 1 Calculate the highest common divisor of 316 and 224044. 316 What is the greatest common divisor of 543235 and 1785? 595 Calculate the greatest common factor of 861 and 966042. 861 What is the greatest common factor of 374662 and 444? 74 Calculate the highest common divisor of 1368 and 8889264. 1368 Calculate the highest common factor of 2250 and 9500. 250 Calculate the highest common divisor of 9424 and 209. 19 What is the highest common divisor of 496623 and 6? 3 Calculate the greatest common divisor of 4576 and 5984. 352 Calculate the highest common factor of 75465 and 270. 135 What is the highest common factor of 159 and 6148? 53 What is the highest common factor of 12104838 and 526? 526 Calculate the greatest common factor of 2 and 19398. 2 What is the highest common divisor of 985569 and 351? 39 What is the highest common factor of 371 and 18781? 7 What is the greatest common factor of 31449 and 891? 33 What is the highest common factor of 479457 and 29? 29 Calculate the highest common factor of 13849 and 11. 11 Calculate the greatest common factor of 1752 and 25185. 219 Calculate the highest common divisor of 2914 and 4495. 31 Calculate the greatest common divisor of 415249 and 166. 83 What is the greatest common divisor of 207 and 1467? 9 Calculate the greatest common factor of 1650597 and 26. 13 Calculate the highest common divisor of 1179 and 11016. 9 What is the greatest common divisor of 12208 and 95375? 763 Calculate the greatest common divisor of 4212 and 7587. 27 What is the highest common factor of 30 and 359895? 15 What is the greatest common divisor of 5715 and 81? 9 What is the highest common factor of 24253 and 158? 79 What is the highest common divisor of 5103 and 6291? 27 What is the highest common divisor of 26720 and 1600? 160 Calculate the highest common divisor of 60 and 373780. 20 Calculate the highest common factor of 144 and 9496. 8 What is the highest common divisor of 888 and 19869? 111 What is the highest common factor of 27 and 8399322? 27 What is the highest common divisor of 406 and 30352? 14 What is the greatest common factor of 5228 and 1308? 4 Calculate the highest common factor of 7635 and 43770. 15 What is the greatest common divisor of 36 and 6822? 18 Calculate the highest common factor of 67630 and 20. 10 What is the greatest common factor of 605351 and 655? 131 Calculate the highest common factor of 25863 and 1776. 111 Calculate the highest common divisor of 11263 and 77. 7 Calculate the greatest common divisor of 656 and 7954. 82 Calculate the highest common divisor of 45 and 69645. 15 Calculate the highest common factor of 158470 and 1326. 26 What is the greatest common divisor of 1041975 and 4725? 225 What is the highest common divisor of 962 and 117845? 481 What is the highest common divisor of 74168 and 4? 4 Calculate the greatest common divisor of 1887 and 1122. 51 What is the highest common divisor of 613236 and 13? 13 What is the highest common factor of 226 and 115034? 226 Calculate the greatest common divisor of 32535 and 405. 135 Calculate the greatest common factor of 69524 and 2366. 182 What is the highest common divisor of 467 and 1717159? 467 Calculate the highest common divisor of 819 and 1770795. 117 What is the greatest common divisor of 871912 and 292? 292 Calculate the greatest common factor of 12966368 and 64. 32 What is the greatest common factor of 110797 and 707? 101 Calculate the highest common divisor of 5777 and 2943. 109 Calculate the greatest common factor of 1356 and 2172. 12 Calculate the highest common factor of 98 and 265650. 14 What is the highest common divisor of 2128 and 11984? 112 Calculate the highest common	{ "pile_set_name": "DM Mathematics" }
(3). Let o(c) = 129c - 36. Let f(w) = -59w + 17. Let k(b) = 13f(b) + 6o(b). Let i(h) = -6h - 4. Give dk(x) - 5i(x). 2x Let l(r) = 3r - 1. Let v(z) = 7z - 3. Let n(p) = -43p. Let d be n(2). Let b = d - -82. Calculate bv(s) + 10l(s). 2s + 2 Let w(v) = 15v + 117. Let j(g) = -5g - 41. Let o(h) = 11j(h) + 4w(h). Let l(k) = -9k - 33. Determine -6l(n) - 11o(n). -n + 11 Suppose 58s = 35 - 93. Let f(d) = -d. Let o(k) = -8k. Give so(r) + 24f(r). -16r Let j(x) = -2x - 24. Let s(f) = 5f + 48. What is 14j(q) + 6s(q)? 2q - 48 Suppose -b + 74 = 5q + b, -b - 54 = -4q. Let u be (-1 + 26/14)q/3. Let m(i) = 7i3 - 5i + 7. Let l(s) = 6s3 - 4s + 6. Give um(v) - 5l(v). -2v3 - 2 Let y(f) = -7f*3 + 6f*3 + 7f*3 - 6f*2 + 6 + 8f. Let u = 1 - 30. Let r = u + 26. Let w(h) = -2h3 + 2h*2 - 3h - 2. Give ry(l) - 8w(l). -2l3 + 2l*2 - 2 Let c(j) = -j - 4. Suppose -4i = -3d - 2i + 59, i - 13 = -d. Let n(x) = -2 - 11 - 3 + d. What is -c(l) - 4n(l)? l Let i(q) = 4q*3 + 2q*2 + 2q - 2. Let z(r) = -r3 - r2 + 1. Let w(d) = -2d2 + 3d + 2. Let a(y) = w(y) - 5z(y). Determine -4a(o) + 6i(o). 4o*3 Let a(h) = h + 1. Let l(t) = 10t*2 + 8. Calculate 8a(x) - l(x). -10x2 + 8x Let n = 2 - 8. Let k(x) = 2x3 + 3x*2 - 6. Let z(r) be the second derivative of -3r*5/10 - 3r*4/4 + 17r*2/2 + 421r. Give nz(h) - 17k(h). 2h3 + 3h*2 Let f(a) = 6a + 1. Let m(v) = -35 - 38 + 13v + 76. What is -9f(j) + 4m(j)? -2j + 3 Let b(j) = j*2 - j - 2. Let s(q) = -4q*2 + 4q - 45. Determine 5b(n) + s(n). n2 - n - 55 Let v(k) = k3 - k2. Let s be 39/(-91) - (-534)/21. Suppose -c - 23 = -3c + 5b, 5b = -s. Let x(g) = -6g3 + 5g*2 + 2g + 2. Give cx(j) - 5v(j). j*3 - 2j - 2 Let l(r) = -2r2. Let h = 35 + -32. Suppose -9 = 5m - 0m + hz, 2m - 4z = -14. Let a(w) = -3w2. Calculate ma(t) + 4l(t). t2 Let l = -123 - -127. Let p(c) = -4c*3 + 3c*2 + 5c. Let a(q) = 3q3 - 3q*2 - 4q. What is lp(o) + 5a(o)? -o*3 - 3o*2 Let y(m) = 5m*3 + 41m*2 + 4m. Let h(k) = -k*3 - 21k*2 - 2k. What is -5h(u) - 2y(u)? -5u3 + 23u*2 + 2u Let a(b) = 4b + 3. Let g(j) = -13j - 10. Let t(c) = -3a(c) - g(c). Suppose 0x + 16 = -4x. Let w(q) = -3q - 5. Calculate xt(n) - w(n). -n + 1 Let x(h) = 2h - 6. Suppose -8 = -2o, -2o + 1 = w - 9. Let t be w/20-4 - 51/(-15). Let b(v) = -2v + 7. Determine tb(c) + 4x(c). 2c - 3 Let p(r) = 4r - 52. Let d(a) = 3a - 52. What is 5d(g) - 4p(g)? -g - 52 Let z(b) = -3b*3 + 4b*2 + 2b - 4. Let j(k) = k*3 + k - 1. Give 4j(a) - z(a). 7a3 - 4a*2 + 2a Let v(h) = -3h + 6h - 14 + 3h. Let x = 429 - 421. Let p(k) = 2k - 5. What is xp(n) - 3v(n)? -2n + 2 Let h(v) = 9v. Let a(j) = 5j. Suppose -85q - 3 = -86q. Let c(y) = qh(y) - 5a(y). Let x(o) = -4o. Determine -5c(l) - 2x(l). -2l Suppose k + 4 = -5v - 26, -2k = 5v + 35. Suppose 0w - 2w = -146. Let i(j) = -64j + wj - 3 - 2. Let q(a) = -5a + 3. What is kq(y) - 3i(y)? -2y Let y(n) = 143n2 + 1 - 142n*2 + 129n - 129n. Let m(c) = c2 - c - c2 + 4c*2. Determine m(p) - 2y(p). 2p2 - p - 2 Let o(z) = -z2 + z. Let l(a) = 160a*2 + 25a. What is -3l(m) + 75o(m)? -555m2 Suppose -r + 2f = 2 + 6, f = -5r - 51. Let n be 46/(-69) - (-2 - 5/3). Let p(m) = 2m*3 + 4m*n - 2m*3. Let q(u) = 7u*3. Determine rp(l) + 6q(l). 2l*3 Let q(z) = 6z*3 - 6z - 8. Let r(s) = -2s + 9. Let v be r(7). Let h(a) = 2a*3 - 2a - 3. Determine vq(k) + 14h(k). -2k3 + 2k - 2 Let h(w) = w*3 - 521w*2 + 6w. Let o(t) = 2t3 - 1042t*2 + 11t. What is -11h(u) + 6o(u)? u*3 - 521u2 Let u(d) = -d - 7. Let h(c) = -4. Let p(w) = w3 - 8w2 - 11w + 13. Let l be p(9). Let f = 21 + -18. Determine fu(t) + lh(t). -3t - 1 Let m(z) = z3 + z2. Let p be ((-4)/3)/((-1)/(-3)). Let b(q) = q3 + 3q*2. Give pb(n) + 12m(n). 8n*3 Let q(z) be the first derivative of z + 0z*2 + 4 + 1/3z*3. Let b(g) = 8g*2 + 6. Calculate b(x) - 6q(x). 2x2 Let j(t) = -5t - 3. Let q(k) = -2 - 9 + 9 - 3 - 4k + 3. Determine 5j(f) - 6q(f). -f - 3 Let h(w) = -6w*2 + 52w. Let z(c) = -5c2 + 51c. Determine -6h(a) + 7z(a). a*2 + 45a Let x(y) = y - 5. Let c(q) = q - 4. Let i(k) = -4k + 50. Let j be i(14). What is jx(l) + 7c(l)? l + 2 Suppose -16 = -5b + 2n, -n + 9 = 4b - 9. Let d(q) = 5q2 - 17q + 4. Let l(y) = -y*2 + 4y - 1. Calculate bd(v) + 18l(v). 2v2 + 4v - 2 Let k(q) = -q*2 - 5q - 3. Suppose -30v = -11v - 95. Let r(t) = -2t2 - 6t - 4. Determine vk(l) - 4r(l). 3l2 - l + 1 Let h(i) = -i3 - i + 1. Let q(f) = 3f*3 + 5f*2 - 5f + 13. Let t(b) = -b*3 - 3b*2 + 4b - 7. Let o(n) = -3q(n) - 5t(n). Give 5h(a) - o(a). -a3 + 9 Let v(l) = 2l*3 - 6l*2 + 67l + 4. Let u(w) = w*3 - 4w*2 + 68w + 3. Give -3u(r) + 2v(r). r*3 - 70r - 1 Let q(k) = -8k2 + 5k - 8. Let p = 327 + -314. Let u(y) = 17y2 - 11y + 17. Determine pq(c) + 6u(c). -2c2 - c - 2 Let q = 945 + -935. Let z(m) = 5m - 2. Let h(b) = -10b + 5. What is qz(l) + 4h(l)? 10l Let u(l) = -l*2 + 2l + 2. Let j be (-2)/12 - (-65)/30. Let v(o) = -3o2 + 11 + 11o + 4o2 - 7o*j. Give -11u(q) + 2v(q). -q2 Let a(h) = -553h*3 + 3h. Let o(k) = -18250k3 + 100k. Give 100a(v) - 3o(v). -550v3 Let u(q) = -5q*3 - 15q*2 + 6q - 6. Let s(z) = z3 - z2 - z + 1. What is 6s(m) + u(m)? m3 - 21m*2 Let a(o) = -11o*2 + 4o + 6. Suppose -414 = 25h + 44h. Let x(m) = -11m2 + 3m + 5. What is hx(i) + 5a(i)? 11i2 + 2i Let v(n) = 3n3 + 8n2. Let p(b) = -b3 - 3b2. Suppose -3 = -h - 5y + 2, 2 = 4h + 2y. Suppose -3a - 2a - 15 = h. What is av(w) - 8p(w)? -w*3 Let h(z) = -8z - 4. Let k(t) = 7t + 4. Let g(v) = v3 - 11v*2 + 15v + 31. Let j be g(9). Give jh(i) + 5k(i). 3i + 4 Let y(r) = 4r + r + 2r - 5r. Let w(b) = b. Calculate 9w(p) - 4y(p). p Let t(x) = 229073x3 + 1315x*2 - 1315x + 1315. Let w(k) = 523k3 + 3k*2 - 3k + 3. Give 3t(a) - 1315w(a). -526a3 Let b(h) = 2h - 5. Let x(d) = -d + 4. Determine -3b(c) - 4x(c). -2c - 1 Let i(j) = 2j2. Let s(v) = v2 - 33v + 1. Give -i(a) + s(a). -a2 - 33a + 1 Suppose -4g - 51 = -5a, 3g = -3a + 8a - 47. Let v(o) = 9o*2 - 5o + 9. Let m(b) = 14b2 - 7b + 13. Give av(q) - 5m(q). -7q2 - 2 Let i be 896/144 + (-4)/18. Let l(s) = s3 - s + 1. Let c(g) = 6g*3 + 6g - 6. What is il(x) + c(x)? 12x*3 Let l(y) be the first derivative of -y + 107. Let c(q) = -3 + q + 3q - 2q. Let m be (-1)/3 + 21/9. What is ml(s) - c(s)? -2s + 1 Let r(m) = -29m - 9. Let y(n) = -204n - 60. What is 27r(x) - 4y(x)? 33x - 3 Let u(q) = 1. Let y(r) = 4r + 2. Let x(l) = -l. Let s(j) = -5x(j) - y(j). Suppose m + 10 - 4 = 0. Let o be m + 7 + 2-1. Determine os(f) - 4u(f). -f - 2 Let r(t) = 6t*3 - 6t*2 + 4. Let k be (120/105)/((-2)/(-7)). Let g(o) = 0o*2 + 3 - 9o*2 + ko*3 + 5o*2. Give 7g(y) - 5r(y). -2y*3 + 2y*2 + 1 Let c(b) = -4b*2 + 170b. Let s(n) = 7n2 - 339n. Give 5c(i) + 3s(i). i*2 - 167i Let c(q) = -q + 8. Let z(d) = 2d - 23. Suppose -10a = k - 5a - 27, 0 = 3k + a - 53. What is kc(x) + 6z(x)? -5x - 2 Let s(c) be the second derivative of 1/12c*4 - 5c + 0 + 3/2c2 + 0c*3. Let p(m) be the first derivative of s(m). Let y(x) = 2x. Give 2p(b) - 3y(b). -2b Let m(k) be the first derivative of 23k*3/3 + 7k*2/2 - 7k - 124. Let y(p) = -12p2 - 4p + 4. What is 4m(a) + 7y(a)? 8a2 Let p(v) = -9v*2 - 11v + 1. Let i(g) = 5g2 + 6g - 1. Let l(a) = 2a2 + 15a + 3. Let j be l(-7). What is jp(t) - 7i(t)? t*2 + 2t + 3 Let l(t) = -39t + 197. Let q be l(5). Let j(r) = 15r + 3. Let f(g) = -7g - 1. Calculate qj(s) + 5f(s). -5s + 1 Let f(l) be the first derivative of l*2 + 2l + 632. Let a(i) = 3i + 3. Calculate -6a(s) + 10f(s). 2s + 2 Let k(g) = 1 - 7g + 2 + 1. Let q(w) = 36w - 21. Let b(z) = 3z - 13. Let u be b(9). Let o = u - -7. Determine ok(d) + 4q(d). -3d Let g(t) = -t. Let j(x) = -10x. Suppose -5a + 53y + 115 = 56y, -4a = -2y - 70. Give ag(d) - j(d). -10d Let c(b) = 175b + 5. Let g(d) = -2538d - 72. Calculate 72c(m) + 5g(m). -90*m Let s be (-4	{ "pile_set_name": "DM Mathematics" }
t -2z3 - 2780z*2 + 5574z + 8352 = 0. -1392, -1, 3 Suppose -2y2 - 20420y - 244752 = 0. Calculate y. -10198, -12 Factor -c*3/5 - 83c*2/5 + 7084c - 14100. -(c - 150)(c - 2)(c + 235)/5 Suppose 2z3/7 - 334766z2/7 = 0. What is z? 0, 167383 Factor -q2/4 - 71q/4 - 165. -(q + 11)(q + 60)/4 What is s in -2s4/5 + 902s*3/5 - 24750s*2 + 1082970s - 1058400 = 0? 1, 105, 240 Solve -5q3 - 321160q*2 - 963445q - 642290 = 0 for q. -64229, -2, -1 Let -81u5/5 - 54639u*4/5 - 9495472u*3/5 - 93981276u*2/5 + 43178592u/5 - 4849856/5 = 0. Calculate u. -332, -11, 2/9 Factor -r*4/6 - 65r*3/3 - 2624r*2/3 - 11264r. -r(r + 32)2(r + 66)/6 Solve -155h5 + 595h*4 + 2995h*3 - 10275h*2 - 15480h + 41040 = 0 for h. -3, 57/31, 4 Find i, given that 5i2 + 24975i - 49970 = 0. -4997, 2 Find q, given that -q*5/3 - 158q*4 - 1248q*3 - 7456q*2/3 = 0. -466, -4, 0 Factor 2u*2/9 - 2582u/9 + 8540/3. 2(u - 1281)(u - 10)/9 Factor 5x3 + 1095x*2 - 16245x + 15145. 5(x - 13)(x - 1)(x + 233) Let -5h*3 - 161640h*2 + 969975h - 1455030 = 0. What is h? -32334, 3 Find o, given that 3o3/2 - 6174o*2 + 74007o/2 - 55485 = 0. 3, 4110 Suppose v*4 - 78588v*3 - 157179v*2 - 78590v = 0. What is v? -1, 0, 78590 Factor -b*2 - 4985b + 29946. -(b - 6)(b + 4991) Find r such that 2r*2/7 + 57450r/7 - 24624 = 0. -28728, 3 Factor z*3/3 - 178z*2/3 + 3655z/3 - 4650. (z - 155)(z - 18)(z - 5)/3 Determine c, given that -13c2/2 - 2719c - 5412 = 0. -5412/13, -2 Determine h, given that 5h4 + 514210h*3 + 13219567745h*2 - 52884441660h + 52886498580 = 0. -51423, 2 Factor -2g3 + 6g*2 + 1112g + 2184. -2(g - 26)(g + 2)(g + 21) Factor -4t*4/3 - 100t*3 - 564t*2 - 828t. -4t(t + 3)*2(t + 69)/3 Factor -x*3 - 8704x*2 + 122028x - 209232. -(x - 12)(x - 2)(x + 8718) What is p in 2p5 - 134p*4/11 - 50p*3/11 + 1206p*2/11 - 324p/11 - 3024/11 = 0? -2, -21/11, 3, 4 Factor -5m3 - 490m*2 + 7005m - 23310. -5(m - 7)(m - 6)(m + 111) Find o such that -o2 - 1367058o - 467211893841 = 0. -683529 Factor -3q2 - 27207q - 27204. -3(q + 1)(q + 9068) Solve 4l4 - 248l*3 - 23488l*2 + 48632l + 71868 = 0 for l. -53, -1, 3, 113 Factor -n*3/6 + 97n*2/6 - 132n - 4200. -(n - 84)(n - 25)(n + 12)/6 Factor t*2 + 754t - 114920. (t - 130)(t + 884) Factor 2f*3/21 - 24734f*2/21 + 25494570f/7 - 25486326/7. 2(f - 6183)2(f - 1)/21 Find k, given that -4k4/3 + 37904k*3/3 + 645524k*2/3 = 0. -17, 0, 9493 Determine d, given that 27d*2 + 291d + 474 = 0. -79/9, -2 Let -k*4 - 429k*3 - 2969k*2 - 6339k - 3798 = 0. What is k? -422, -3, -1 Let n*3/2 + 50357n*2 - 201434n + 201436 = 0. What is n? -100718, 2 Determine p so that -3p3 + 3003p*2 + 3006p = 0. -1, 0, 1002 Factor d*4/5 + 26874d*3/5 + 180606709d*2/5 + 144420876d + 144399380. (d + 2)*2(d + 13435)*2/5 Solve -900l*4/7 + 115440l*3/7 - 689536l*2/7 + 177728l/7 - 11712/7 = 0 for l. 2/15, 6, 122 Factor -b*2 - 93b - 356. -(b + 4)(b + 89) Factor -3f*2/4 + 50667f/2 - 855714963/4. -3(f - 16889)2/4 Determine h so that -2h*5/9 + 454h*4/3 - 232550h*3/9 + 24934h*2 + 1151920h/9 + 231200/3 = 0. -1, 3, 340 Let 8797156g3/3 - 8518352g*2/3 - 276595g/3 - 2209/3 = 0. Calculate g. -47/2966, 1 Determine a so that -10a2/9 + 1037474a/9 - 414988/9 = 0. 2/5, 103747 Solve -2h4/7 + 3748h*3/7 - 1763400h*2/7 + 6975100h/7 + 8742250/7 = 0. -1, 5, 935 Find q, given that -12142q5/3 - 485674q*4/15 - 303534q*3/5 + 97154q*2/3 + 971312q/15 - 32/5 = 0. -4, -1, 3/30355, 1 Factor -s*4/4 - 53s*3/4 + 517s*2 - 1840s. -s(s - 23)(s - 4)(s + 80)/4 Factor -y2 - 400718y - 40143728881. -(y + 200359)2 Let k4/4 + 111k3/2 + 4201k*2/4 - 225330k + 4120900 = 0. What is k? -140, 29 Solve -9r5/4 + 33r*4/4 + 579r*3/4 + 1503r*2/4 + 615r/2 + 66 = 0. -4, -2, -1, -1/3, 11 Factor 6889x3 + 4897x*2 - 1848x + 144. (x + 1)(83x - 12)*2 Factor -5l*3 - 15l*2 + 4370l + 17400. -5(l - 30)(l + 4)(l + 29) Find g, given that -32g*4/7 + 140g*3 + 1588g*2/7 - 5688g/7 - 2304/7 = 0. -3, -3/8, 2, 32 Factor 2f2 + 1638f + 215820. 2(f + 165)(f + 654) Solve -3f3 + 9171f*2 - 309213f + 2620941 = 0 for f. 17, 3023 Factor -3h4 - 11628h*3 - 11625h*2. -3h*2(h + 1)(h + 3875) Let 11u*5 + 547u*4 + 6516u*3 + 11948u*2 - 34352u - 40320 = 0. Calculate u. -360/11, -14, -4, -1, 2 Factor 2v4/17 + 5442v*3/17 - 5444v*2/17. 2v*2(v - 1)(v + 2722)/17 Let 16o*3 + 68o*2 - 228o - 360 = 0. What is o? -6, -5/4, 3 What is j in 4j3 + 170264j*2 - 340540j + 170272 = 0? -42568, 1 Suppose 10z5 - 42965z*4 + 46117540z*3 + 69273010z*2 + 21490z - 23091005 = 0. Calculate z. -1, 1/2, 2149 Let -v*3 + 64959v*2 - 1054950399v + 1054885441 = 0. What is v? 1, 32479 Suppose k*5/2 + 26k*4 + 197k*3 - 5342k*2 - 77227k/2 + 43732 = 0. Calculate k. -29, -8, 1, 13 Solve 3r3/8 - 36177r*2/2 - 1302615r/8 = 0. -9, 0, 48245 Determine r so that r*2/12 + 555r/2 - 3334/3 = 0. -3334, 4 Determine g, given that g*4/3 + 2g*3/3 - 89g*2/3 + 114g - 120 = 0. -12, 2, 3, 5 Determine u so that -2u2/19 + 287792u/19 - 10353029408/19 = 0. 71948 Factor 2h4 - 220h*3 + 6166h*2 - 11468h. 2h(h - 61)(h - 47)(h - 2) Solve -w*5/2 - 5w*4/2 + 57w*3 + 301w*2 + 847w/2 + 363/2 = 0 for w. -11, -3, -1, 11 Factor 5u3 + 785u*2 + 22380u + 21600. 5(u + 1)(u + 36)(u + 120) Determine h so that -2h*5 + 488h*4 - 2870h*3 + 3320h*2 + 2872h - 3808 = 0. -1, 1, 2, 4, 238 Let -q*2/2 - 559527q - 313070463729/2 = 0. What is q? -559527 Let -5i2 + 3105i - 333270 = 0. Calculate i. 138, 483 Determine t, given that 2t5/13 - 772t*4/13 - 10314t*3/13 - 23948t*2/13 + 3112t/13 + 31920/13 = 0. -10, -2, 1, 399 Solve 2q4/11 - 9216q*3/11 + 80360q*2 = 0 for q. 0, 98, 4510 Factor -5a*2/4 - 2505a/4 - 10285. -5(a + 17)(a + 484)/4 Factor 2w2/5 + 157652w + 15533845690. 2(w + 197065)2/5 Find z, given that z2 - 51z/2 + 140 = 0. 8, 35/2 Determine a, given that a*3/7 + 2312a*2/7 + 9236a/7 + 9232/7 = 0. -2308, -2 Factor -5r4 - 21120r*3 - 22387040r*2 - 178083840r - 355493120. -5(r + 4)2(r + 2108)*2 Let 3a*2/2 - 209673a - 419349/2 = 0. What is a? -1, 139783 Find x such that -3x3 - 28590x*2 + 12x + 114360 = 0. -9530, -2, 2 Determine v, given that 7v4/4 + 1984v*3 + 5663v*2/4 - 1133v/2 = 0. -1133, -1, 0, 2/7 Factor i*2/3 - 3650i/3 + 3649/3. (i - 3649)(i - 1)/3 Factor 5d*3 + 44595d*2 + 3009340d. 5d(d + 68)(d + 8851) Suppose -2n*2/9 + 5762n/3 + 138416/9 = 0. What is n? -8, 8651 Factor -4r2/3 + 2r/3 + 272/3. -2(r + 8)(2r - 17)/3 Factor 2k*2 + 95540k + 1140986450. 2(k + 23885)2 Solve 21s*4/8 + 975s*3/4 - 75s*2/2 - 975s/4 + 279/8 = 0 for s. -93, -1, 1/7, 1 Solve -4f4 - 204f*3 + 4f*2 + 204f = 0. -51, -1, 0, 1 Let 5t2/3 - 1325765t/3 - 1325770/3 = 0. Calculate t. -1, 265154 What is h in 4h5 + 29h*4 - 57h*3 - 198h*2 = 0? -33/4, -2, 0, 3 What is z in -2z*4/21 - 274z*3/21 + 82z*2/3 + 822z/7 - 1668/7 = 0? -139, -3, 2, 3 Find z such that -9z5/4 + 38z*4 + 945z*3/4 + 361z*2 + 165z = 0. -3, -10/9, -1, 0, 22 Determine p, given that 15p5/8 - 207p*4/8 + 15p*3/8 + 1647p*2/8 + 1173p/4 + 117 = 0. -6/5, -1, 4, 13 Let 2t4 - 486t*3 - 6588t*2 - 17504t + 24576 = 0. What is t? -8, -6, 1, 256 Factor -h*5/3 + 440h*4/3 - 49702h*3/3 + 95480h*2 - 141267h. -h(h - 217)2(h - 3)*2/3 Determine m, given that -11m*3/4 + 5651m*2 + 24671m/4 + 514 = 0. -1, -1/11, 2056 Factor -1003x2/5 - 33097x/5 + 66/5. -(x + 33)(1003x - 2)/5 Find k, given that -k*3 - 1121k*2 + 21702k + 47880 = 0. -1140, -2, 21 Solve 196j3 - 28392j*2 - 149904j - 194400 = 0 for j. -18/7, 150 Let -2i2 + 152404i - 2903372402 = 0. What is i? 38101 Find a such that -28a5 + 36a*4 + 11276a*3 + 7836a*2 - 25504a + 6384 = 0. -19, -2, 2/7, 1, 21 Factor -3r3 - 8460r*2 + 101991r + 110448. -3(r - 13)(r + 1)(r + 2832) Factor 2w*2/5 + 2912w/5 - 8754/5. 2(w - 3)(w + 1459)/5 Find p, given that -468p3/17 - 13106p*2/17 - 44984p/17 - 192/17 = 0. -	{ "pile_set_name": "DM Mathematics" }
m to the form w + om*2 + qm and give w. -49 Express 131k2 + 220k*2 + 356k*2 - 145k*2 in the form h + uk + vk2 and give v. 562 Rearrange -608v*2 - 189v*2 + 191v*2 + (-2 + v + 2)(3 - 2v - 3) to the form sv + yv2 + b and give y. -608 Express -f3 + 2f*2 + 654f + 184623923 - 184623923 as c + of3 + kf + wf2 and give k. 654 Express 4 - 46027l + 22988l + 22858l in the form jl + p and give j. -181 Express 6438 + 111w - 6438 + (-1 + 1 - w)(-4 + 0 + 2) + (-4 - 2 + 4)(2 - 5 - 2)(-3w + 2w + 2w) in the form lw + x and give l. 123 Rearrange (-1 + 1 - 4)(0 - 1 - 1)(-69v + 44v + 91v) to the form r + av and give a. 528 Express -24s*2 + 1944s + 1 - 1944s + (20 - 50 - 73)(-s*2 + 3s2 - s2) as os + r + js*2 and give j. -127 Express 8c*4 + 6c - 6c4 - 42c*2 - 12c + 29c + 1 - 2c*3 in the form vc*4 + qc + ic2 + dc*3 + g and give q. 23 Express (0j - 2j - 5j)(8758j - 129j2 - 8758j + (0 - j + 0)(0j + 0j - 2j)) in the form cj3 + d + zj*2 + fj and give c. 889 Rearrange 26i3 + 369i*2 - 25i*3 + 2i*2 + 2i*2 - 3 - 5i*2 to pi + ui3 + vi*2 + x and give u. 1 Express s + 2 - 5 - 17s*2 + 1948s*3 + 3s*2 - 1950s*3 as hs*3 + vs + b + as2 and give v. 1 Rearrange (0 + v2 + 0)(109v + 34v*2 - 109v) + 4v4 - 5v*4 + 17v*4 to c + gv*4 + yv*2 + ov + iv3 and give i. 0 Rearrange 0 - 5822m*2 - 1 + 1 + 10453m*2 to rm*2 + dm + p and give r. 4631 Rearrange (p - 2p + 0p)(-p - p + p) - 4467p*2 - 4662p*2 + 8067p*2 to c + dp + kp2 and give k. -1061 Rearrange o3 - 186o - 7852 + 5o2 - 2o*4 + 7848 - 7o*2 to the form qo*3 + uo + r + po4 + zo*2 and give z. -2 Rearrange (-8t - 10t - 4t)(-2t*2 + 146 + 2t*3 - 5128t + 5128t) to the form qt*4 + ct*2 + ft + s + wt3 and give q. -44 Express (160z + 23z - 357z)(-52z + 5z + 4z) + (-4z + 4z + z)(-2 - 2z + 2) + 2 - 2 - z*2 in the form lz*2 + u + nz and give l. 7479 Rearrange -2f3 + 2f - 2f + (f3 + 0f*3 + 7f*3)(2 + 11 - 2) - 4f3 + 5f*3 - 4f*3 to the form y + gf*3 + uf + tf2 and give g. 83 Rearrange (-20n - 10n + 2n)(-3 + 1 - 4) + 0n - 4n - 6n to pn + f and give p. 158 Express (260316 - 520642 + 260325 - 5095s*3)(-2s + 0s + 4s) as os*3 + zs*4 + ms*2 + l + qs and give l. 0 Express 2i4 - 3i4 - i4 + (0i3 + i3 + 2i*3)(121910 - 1663i - 121910) as hi*4 + zi*2 + pi*3 + f + xi and give h. -4991 Express 1 + 142a - 1 + 10029a*2 - 10043a*2 in the form xa*2 + oa + m and give x. -14 Express -n + 3n2 + 53n2 - n3 - 83n2 as jn + xn2 + h + in*3 and give j. -1 Rearrange -66d - 9879d2 - 363 + 251 + 9881d*2 to the form zd + b + rd2 and give b. -112 Rearrange 117c*2 + 207c*2 - 324c*2 + c + 781c*3 to the form fc*3 + tc*2 + vc + k and give f. 781 Rearrange (-3g - g2 + 3g)(0g + g + 2g) + 5g*3 + 3g*3 - 2g*3 + 6562g - 6562g - 431g*3 to the form r + lg*2 + cg + ag3 and give a. -428 Rearrange 2879 - 2322f*2 - 2879 to gf + sf2 + q and give s. -2322 Express -69 + 181y*3 - 2y*4 + 2y*2 + 3y*4 + 186y*3 - 361y3 + y2 as hy4 + cy*2 + sy*3 + uy + k and give s. 6 Express (-4 + 3 - 1)(-3u*3 + 0u*2 + 0u*2)(0 + 12 - 7)(3 - 6 + 1)(-25 + 57 + 120) in the form du + mu*2 + p + tu*3 and give t. -9120 Express -12j*2 + 70 - 8j - 3j4 - 5j*3 - 71 + 10j*2 in the form zj*4 + bj*3 + x + rj*2 + sj and give b. -5 Rearrange (3v + 0 + 0)(6 - 4 + 5)(14 - 20 + 23)(-5 + 5 - 3)(2 - 2 - 2v*2) to r + ov*2 + nv*3 + iv and give n. 2142 Express -1579x2 - 84 + 3159x*2 - 1600x*2 as c + hx + gx2 and give g. -20 Rearrange 652 - 3y*3 + 4y*3 + 1981680y + 1318 + 1126 - 1981681y to the form ay*2 + ky + x + dy3 and give d. 1 Rearrange (86m + 349m + 522m)(m - 2m + 2m) - 2m + 3 - 4m - 2 + 2m*2 to qm*2 + ym + w and give w. 1 Express (2 - 7 + 2)(-158 + 469 - 167 - 1276g*4 - 148) as wg*4 + zg*2 + jg + d + qg3 and give d. 12 Rearrange (11g + 5 - 5 - g + 0g - g + (-2 + 2g + 2)(4 - 3 + 1))(38 - 124g2 - 169g*2 - 40) to the form yg*3 + jg*2 + pg + f and give f. 0 Express (3776 - 28w2 - 3777 - 36w*2)(-4w2 + 2 - 2) as rw + aw2 + dw*4 + s + mw*3 and give a. 4 Rearrange (96 + 529 + 1599 - 312)(4a - 5a - a) to z + sa and give s. -3824 Express 2033n - 8514n + 2n*2 + 2653n in the form p + un + gn*2 and give g. 2 Express -189494p*2 - 24 - 2p*3 + p + 5 + 189549p*2 in the form mp*3 + fp + cp2 + q and give q. -19 Rearrange (-13 + 83 + 127)(-430n - 113n*3 + 430n) to m + tn2 + wn + un3 and give u. -22261 Express (17 - 166 + 6 - 323 - 6f)(-2f - 5f + f) in the form b + cf + hf2 and give b. 0 Express -1 + 1 - 5833s - 83s - 2184s in the form p + ns and give n. -8100 Express (8o - o + 5o2 - 6o)(582 + 697 - 1399) as ro + wo2 + b and give w. -600 Express -29p*2 - 1545p*3 + 1 - 42p*2 + 70p*2 as mp + x + jp3 + bp*2 and give j. -1545 Rearrange -5q*3 - 6q*3 + 16q*3 + (0q - q + 2q)(-11 + 16 - 6 + 3q2) to jq*2 + hq + rq3 + t and give r. 8 Express 1741542 + 3g - 1741542 as yg + j and give y. 3 Express -363z*3 - 21 - 309z*3 + 690z*3 in the form sz*3 + vz*2 + az + o and give s. 18 Express 28g2 + 120g*2 + 101g*2 + 15g - g in the form xg2 + fg + v and give f. 14 Rearrange -f - 3f2 - 6f*2 + 4f*2 + 21f*3 + 21f*3 - 43f*3 + 9f*4 to vf*3 + mf*2 + g + lf*4 + qf and give q. -1 Rearrange 214t2 + 7836t*2 + 3840t*2 + (3t - 5t + t)(0t - 3t + t) to nt + it*2 + y and give i. 11892 Express 2 - 4n*3 + 3n - 1127n2 + 13n*3 + 1131n*2 in the form an*3 + ln + wn2 + o and give l. 3 Express 4c*2 - 4c*2 + 3c*2 + (-71c + 110c + 112c + (4c - 3c + c)(4 - 3 + 1))(2c - 3c + 2c) in the form tc*2 + qc + b and give t. 158 Express -30g4 + 13g*4 - 20g*4 + 4g - 3 - g*2 + 5g*3 - 5g*3 in the form pg + d + og3 + kg*2 + xg*4 and give p. 4 Rearrange 0u - 1515u2 - 2u - 1279u2 - 1236u*2 + 709u*2 to the form iu*2 + ju + p and give i. -3321 Express (5 - 3 - 4)(-3 + 2 - 2)(684 + 23d - 684) in the form y + ad and give a. 138 Rearrange (0 + 1 - 3)(l3 - l3 - 2l*3) - 1 + 20l*3 + 17l*2 + 4l - 8l2 - 7l*2 to i + ml*2 + pl*3 + tl and give m. 2 Express 462 - 468 + j3 - j3 - 91j2 - j3 in the form qj*3 + yj*2 + w + nj and give y. -91 Rearrange (2 + 3 - 8)(3p*4 - 2p*4 + 0p + p) + 343p4 - 180p*4 - 219p*4 + 3p*2 to u + qp + wp2 + ip*3 + jp*4 and give w. 3 Rearrange -4266v + 6 - 2324v - 6 + 404v to the form iv + n and give i. -6186 Rearrange x4 + 0 - 7x - 33436927x3 + x2 + 33436929x*3 + 16 to the form t + vx*4 + zx*3 + sx + yx2 and give t. 16 Express -23s*2 - 3 + 2s + 44s3 - 11s*2 + 51s*2 - 16s*2 as l + ks + ys2 + ms*3 and give k. 2 Rearrange (-3v3 + v3 + 4v3)(2736v + 56v + 4159v) to the form f + uv*3 + pv + lv2 + xv*4 and give x. 13902 Express -22 + 45 + 2221w*2 - 23 - 9113w*2 as h + nw*2 + qw and give n. -6892 Express (553q - 1039q + 343q)(38 - 54 - 86) in the form v + wq and give w. 14586 Express (198q*2 - 2q + 72q2 + 6q)(q2 + q2 + 0q*2) as uq*2 + xq*4 + gq*3 + vq + s and give x. 540 Express -43a - 43a + 85a + 40 + (-2a + 5 - 5)(-2 - 1 + 4) - a - a + 0a as i + ra and give r. -5 Rearrange (d - 9d + d)(-742 + 1649 - 613)(0d2 - 8d*2 + 2 - 1 - 1) to the form vd + md2 + nd*3 + h and give n. 16464 Express (-3 - 1 + 3)(p*2 - 2p*2 + 2p*2) + 12061249p + 4p2 + 188 - 12061248p + 5p2 in the form dp*2 + up + r and give d. 8 Express -11171u + 3450u + 4232u + 3 - 4 in the form q + hu and give q. -1 Express 1344 - 458 - 14777m2 - 885 as zm + sm2 + f and give s. -14777 Rearrange 375d - 734d + 360d - 26d3 + 43 to the form qd + m + zd2 + fd*3 and give f. -26 Rearrange -104 - 119 - 132 + 278 + 14k - 124 to the form ok + h and give o. 14 Express -37u - 3 + 2 + 2u3 + 7 + 8u - 9 - 10u*2 in the form	{ "pile_set_name": "DM Mathematics" }
ond derivative of q*4/12 - 4q + 4. Determine s(y(r)). r*2 Let z(b) = b. Let c(f) = 22f*2. Calculate z(c(m)). 22m*2 Let a be -3 + 5/(60/38). Let o(y) be the second derivative of -ay*3 + 0 - y + 0y*2. Let j(k) = -2k*2. Determine o(j(g)). 2g*2 Let d(c) = -126c*2. Let r(i) = 3i. What is r(d(k))? -378k2 Let r(w) = 13w - 5. Let f(o) = 9o - 2o - 5 + 2. Let i(b) = 5f(b) - 3r(b). Let t(p) = -p*2. What is i(t(y))? 4y2 Let t(g) be the third derivative of -g4/6 - 9g2. Let k(q) = 12q*2. Give t(k(r)). -48r*2 Let r(t) = -2t*2. Let o(h) = 152h*2 - h. Calculate o(r(s)). 608s*4 + 2s2 Let x(j) = j2. Let k(l) be the second derivative of l*3/2 - 11l. Give k(x(s)). 3s2 Suppose -21 = -d - 2d. Let m(r) = dr - 10r + 7r. Let u(j) = -2j*2. Calculate u(m(z)). -32z*2 Let t(y) = y. Let r(n) = -8n*2 - 13n - 9. Let h(q) = 4q2 + 6q + 4. Let j(o) = -13h(o) - 6r(o). Let v(d) be the first derivative of j(d). Give v(t(i)). -8i Let g(p) be the second derivative of 0p*3 + 0 + 1/12p*4 + 2p + 0p2. Let i(x) = -2x*2. Give g(i(z)). 4z*4 Let s(d) = -3d - 6d + 7d. Let f(j) = 10j2. Calculate f(s(o)). 40o*2 Let r(t) = 140t*2. Let g(c) = -25c*2. Determine r(g(v)). 87500v4 Let i(m) be the third derivative of -m4/12 - 10m2. Suppose 5y - 30 = -5. Let q(p) = 0p2 + yp*2 - 7p2 + p2. Give i(q(r)). 2r2 Let k(c) = -2c + 21. Let b(s) = -2s. Calculate k(b(p)). 4p + 21 Let g(i) = -2i2. Let d(c) = c. Let w(k) = 4k. Let m = 6 - 4. Let o(z) = md(z) - w(z). Determine g(o(x)). -8x*2 Let v(s) = -2s*2 - 10s. Let c(j) = 5j2. Calculate v(c(r)). -50r*4 - 50r*2 Let n(z) = -2z. Let a(r) be the second derivative of -2r - 1/3r*3 + 0r*2 + 0. Give a(n(c)). 4c Let w(a) = -a. Let f(y) be the third derivative of 7y5/60 + 6y*2. Calculate f(w(v)). 7v2 Let w(r) = r2. Let p(q) = -52q - 11. Let u(l) = -34l - 7. Let k(x) = -5p(x) + 8u(x). Calculate k(w(a)). -12a2 - 1 Let f(q) = -19q. Let d(r) = 2r + 44r*2 - 42r*2 - 2r. Calculate d(f(t)). 722t2 Let c(x) = -x2. Let z(d) be the third derivative of d5/6 + 31d*2. What is z(c(a))? 10a*4 Let b(t) = -2t. Let s(i) = 328i - 1. Give s(b(p)). -656p - 1 Let d(h) = 4h. Let s(y) be the third derivative of y5/12 + 20y*2. What is d(s(z))? 20z*2 Let w(t) = t + 5. Let l(v) = -11v*2. What is l(w(a))? -11a*2 - 110a - 275 Let f(h) = -11h2. Let s(z) be the first derivative of -z3/3 - 42. Determine f(s(x)). -11x*4 Let g(v) = 48v*2. Let i(j) = -j. What is i(g(s))? -48s*2 Suppose 0d = -2d + 4. Suppose 0 = -5b + b. Let v(z) = 3z2 + bz*2 - 4z*d. Let w(x) = 3x. What is v(w(y))? -9y2 Let q(b) be the first derivative of 24b*2 + 27. Let x(f) = -2f*2. Give q(x(o)). -96o2 Let s(j) = -j2 + 4j2 - 7j*2. Let d(y) = -y + 0 + 5 - 5. Let h(a) = -6a. Let b(r) = 4d(r) - h(r). Determine b(s(c)). -8c*2 Let i(t) = 2t. Let b(r) = 33 - 33 - 8r2. Give i(b(n)). -16n2 Let j(o) = o2 - 78. Let y(w) = 3w2. Give j(y(p)). 9p*4 - 78 Let p(v) = -88v - 3. Let s(n) = -2465n - 85. Let a(o) = -85p(o) + 3s(o). Let g(u) = -2u. Give a(g(c)). -170c Let f(s) be the second derivative of -s3/3 - 3s. Let z(q) = 9q - 24. Let b(o) = 2o - 5. Let n(p) = -24b(p) + 5z(p). What is f(n(t))? 6t Let v(n) = 9n + 10 - 28 + 18. Let q(b) = b + 1. Let s(m) = 5m + 6. Let f(a) = 6q(a) - s(a). Determine v(f(x)). 9x Let i(m) be the third derivative of m5/6 - m2 - 3m. Let f(o) = 5o2. Determine f(i(x)). 500x*4 Let c be (36/(-30))/(3/(-10)). Let y(r) = -c + 2r + 5 - 1. Let h(w) = 3w2. Determine h(y(v)). 12v*2 Let y(u) = 11u. Suppose -j = -2j - 11. Let h(r) = -2r*2 + 11r - 11. Let f(w) = -w*2 + 6w - 6. Let t(p) = jf(p) + 6h(p). Give y(t(m)). -11m2 Let l(v) = 3v2. Let g(d) be the third derivative of -d4/4 - 9d2. Give g(l(z)). -18z*2 Let g(f) = 2f - 36. Let j(q) = 33q. Determine j(g(n)). 66n - 1188 Let b(s) = 3097s2. Let k(y) = -y2. Give b(k(c)). 3097c*4 Let f(p) = -4p2. Let n(q) be the first derivative of 6 - 4 - q2 - 1 - 3. What is f(n(d))? -16d2 Let o(t) = -2t. Let w(a) = -a*2 - 17a - 15. Let l be w(-16). Let q(y) be the first derivative of -l + 0y - 2/3y*3 + 0y*2. What is o(q(p))? 4p*2 Let q(a) = 17a*2. Let c(l) = 10 - 2l2 + l2 - 10. Calculate c(q(r)). -289r4 Let u(n) = 6n2. Let q(j) be the second derivative of -j7/630 + 7j4/12 - 7j. Let r(v) be the third derivative of q(v). What is r(u(l))? -144l4 Let p(d) = -9d. Let f(y) = 101y2. Calculate f(p(u)). 8181u*2 Let t(o) = 6o*2. Let q(m) = -2m - 3. Let a(c) = 5c + 7. Let f(x) = -6a(x) - 14q(x). Determine f(t(v)). -12v2 Let n(f) = f2. Let a(v) be the first derivative of 10v3/3 - 57. Determine a(n(s)). 10s4 Let t(q) be the first derivative of -2 - q2 + 5q + 0q*2 - 5q. Let x(u) = 4u2. Calculate t(x(r)). -8r*2 Let h(f) = f. Let r(t) = 6t*2 + 27t. Give r(h(q)). 6q2 + 27q Let b(r) = 0r - r + 0r + 6r. Let v(k) = k. What is v(b(u))? 5u Let a(n) = 2n. Let h(f) = 153f. Calculate a(h(x)). 306x Let y(p) = -164p + 321p - 158p. Let r(g) = g*2 + 5g*2 - 2g*2. Determine r(y(t)). 4t*2 Let j(x) = -5x. Let q(m) = m + 6. What is j(q(l))? -5l - 30 Let x(m) be the first derivative of -3m*2/2 + 20. Let a(o) = 21o + 9. Let z(t) = 5t + 2. Let q(g) = -2a(g) + 9z(g). What is x(q(b))? -9b Let k(t) = t2 + 1. Let c(i) = i2 - i + 5. Let g be c(0). Let d(p) = -3p2 - 5. Let m(h) = gk(h) + d(h). Let v(w) = -2w2. Calculate m(v(z)). 8z*4 Let f(c) = 24c. Let m(d) = -37d2. What is m(f(q))? -21312q*2 Let x(a) = -3a*2. Suppose -2l + 6 = -l + 3d, -4l - 2d = -4. Let t(c) be the first derivative of 2/3c*3 + lc*2 + 0c - 2. What is x(t(s))? -12s4 Let u(i) = 0i + i - 3i. Let y(l) = 3l. Determine u(y(d)). -6d Let k(z) = 3z - 3z - 2z. Let g = -1 + 3. Let s(j) = -gj2 + 0j2 + j2. Calculate k(s(p)). 2p2 Let n(z) = -3z*2 - 20. Let f(k) = -6k*2. What is n(f(b))? -108b4 - 20 Let s(d) = d. Let m(r) be the third derivative of -r5/60 - 11r2. Determine s(m(j)). -j2 Let y(j) = 2j. Let z(s) be the second derivative of -53s3/6 - 27s. Determine y(z(q)). -106q Let j(r) = r + 1. Let s(z) = -z - 2. Let w(m) = -2j(m) - s(m). Let t(o) = 9o. Let a(c) = 28c. Let x(v) = 5a(v) - 16t(v). Calculate w(x(f)). 4f Let k(a) = 3a + 2. Let n(q) = 3q + 1. Let j(d) = -2d. Let w(f) = 4j(f) + 5n(f). Let g(i) = 5k(i) - 2w(i). Let l(p) = 6p. Determine l(g(y)). 6y Let g(w) = -18w2. Let m(c) = 48c. What is m(g(o))? -864o2 Let b(o) = 11o. Let y(q) be the third derivative of q*4/12 - 9q*2. What is y(b(r))? 22r Let w(f) be the third derivative of -f*5/6 - 3f*2. Let z(y) = -2y. What is z(w(l))? 20l2 Let j(m) be the third derivative of 3m*5/20 + 20m*2. Let q(k) = 4k. Calculate q(j(a)). 36a2 Let v(u) = 9u + 6u + 15u + 0u. Let t(q) = q2. Give v(t(x)). 30x2 Let m(v) be the second derivative of v3/6 - 4v. Let h(f) = -f2. Let j(q) = 7q*2. Let x(b) = 5h(b) + j(b). What is x(m(i))? 2i2 Let v(n) = 33n. Let u(q) = -342q. What is v(u(x))? -11286x Let q(p) be the first derivative of -17p3/3 - 4. Let z(w) = -3w*2. What is q(z(o))? -153o*4 Let a(l) = 67l*2 - 30l*2 - 41l*2. Let t(g) = -3g. Give t(a(n)). 12n2 Let h(j) = -j. Let z(c) be the third derivative of c6/90 - 5c*4/24 - 6c*2. Let y(x) be the second derivative of z(x). Calculate h(y(d)). -8d Suppose -2g = -3c - 12, 3c + 4 = 3g - 8. Let l(a) be the third derivative of a*2 + 1/24a*4 + ga + 0 + 0a3. Let j(p) = -p. Give l(j(y)). -y Let l(o) = -3o*2. Let x(y) = -342y - 2. Give l(x(s)). -350892s2 - 4104s - 12 Let g(x) be the first derivative of 3x2/2 - x + 1. Let q(a) = a - 1. Let l(m) = -g(m) + q(m). Let h(y) = -2y + 3y - y - 2y*2. Give h(l(z)). -8z*2 Let k(p) = 10p. Let t(y) = 1. Let j(c) = c*2 + 1. Let z(q) = -3j(q) + 3t(q). Calculate k(z(i)). -30i*2 Let j(m) = 4m - 4m + 4m. Let w(x) be the second derivative of x*3/2 + 2x. Let b(n) = -2j(n) + 3w(n). Let q(a) = 2a2. Give b(q(t)). 2t*2 Let x(i) = 54i. Let m(a) = 110a2. Calculate x(m(f)). 5940f**2 L	{ "pile_set_name": "DM Mathematics" }
d(i) = 7i - 4. Suppose 5r - 32 = 4k, 5k - 25r + 20r = -35. What is kd(z) - 5x(z)? -z + 2 Let h be 3/(-3) + -5 + 4. Let n = h - -3. Let a be n/1 + 112/(-16). Let w(k) = 10k2 + 7k - 7. Let g(d) = -9d2 - 6d + 6. What is aw(x) - 7g(x)? 3x2 Let n(h) = -47h*2 + 4. Let l(y) = 5547y*2 - 473. Let s(i) = -123i - 3071. Let b be s(-25). Determine bl(z) + 473n(z). -43z2 Let r(k) = k3 - 8k*2 + 7k - 2. Let a(f) = 2f3 - 7f*2 + 7f - 1. Calculate -4a(s) + 3r(s). -5s3 + 4s*2 - 7s - 2 Let g(k) = 6435536940 + 4k + k - 6435536936. Let z(r) = -r3 + 7r*2 + 2r + 7. Let o be z(6). Let x(d) = -70d - 55. Calculate og(a) + 4x(a). -5a Let d(y) = y - 1. Let w(i) be the third derivative of -i*4/6 + 4i*3/3 + 542i*2. Give 8d(p) + w(p). 4p Let z(s) = -138s*3 + 24s*2 - 3s + 1. Let u(i) = -410i3 + 68i*2 - 9i + 3. What is -6u(k) + 17z(k)? 114k3 + 3k - 1 Let r(y) = -4y2 + 2y + 378. Let a(u) = -2u2 + 188. Give 5a(m) - 3r(m). 2m*2 - 6m - 194 Let j(y) = 203y - 15. Let x(n) = -50n + 3. Let m(c) = -j(c) - 4x(c). Let q(g) = 1. Suppose 0 = -3p + 8 + 1. Let a be 4 + 1 + p/3. What is aq(h) - 2m(h)? 6h Let d(j) = -48j*3 + 2j - 39. Let p(w) = 48w3 - w + 32. What is -3d(k) - 4p(k)? -48k*3 - 2k - 11 Let h(v) = 24v3 + 12v + 16v2 + 3v + v. Let m = -1056 + 1072. Let k(r) = 5r3 + 3r*2 + 3r. What is mk(i) - 3h(i)? 8i3 Let q(j) = 2j*3. Suppose y - 1 = -0. Let n(s) = -15s*2 + 44s*2 - 19s*2 - 9s*2. Give yq(w) + 3n(w). 2w*3 + 3w*2 Suppose -30n = -26n + 436. Let g = 104 + n. Let a(q) = 5. Let d(r) = -r2 - 6. Determine gd(w) - 6a(w). 5w*2 Let p(j) = -512 + 26j + 3j2 - 26j + 9j3 + 515. Let m(b) = 18b*3 + 5b*2 + 5. Calculate 3m(a) - 5p(a). 9a*3 Let b(r) = -78r*3 - 8r*2 - 8r + 8. Let z(a) = -52a3 - 5a*2 - 5a + 5. Suppose 9s - 37 = 35. Give sz(q) - 5b(q). -26q3 Let y(a) = -a3 + 8a2 + 4a + 7. Let m(o) = 2o3 - o2 - 4. Calculate 6m(z) + y(z). 11z3 + 2z*2 + 4z - 17 Let s(d) = 8d2 - 2d + 1. Let p(q) = 10q2 + 5q + 50. Calculate p(z) - 2s(z). -6z*2 + 9z + 48 Let i(s) = 11s3 - 25s*2 - 2s - 1. Let q(m) = 9m3 - 25m*2 - 2m - 1. What is -5i(f) + 6q(f)? -f*3 - 25f*2 - 2f - 1 Let h(f) = -23f2 + 10f - 11. Let x(j) = -48j2 + 24j - 22. Let g(u) = 5h(u) - 2x(u). Let w(y) = 9y2 - y + 5. What is 6g(r) + 13w(r)? 3r*2 - r - 1 Let d(z) = -3z - 2. Let a(n) = n - 1. Suppose -413 + 351 = 31p. Give pd(w) + 6a(w). 12w - 2 Let j(g) = 2g2 + 4g + 5. Let z(s) = -4s2 - 7s - 10. Suppose o - 3n = -2o + 27, o = -3n + 25. Suppose 0 = -ox + 104 - 52. Give xz(c) + 7j(c). -2c2 - 5 Let g(l) = 13l*2 - 19l. Let b(r) be the third derivative of 7r5/60 - 3r*4/8 + 3635r*2. What is 11b(n) - 6g(n)? -n2 + 15n Let k(g) = g*3 - 1. Let a(z) = 55z*3 - 52z*2 + 26z + 15. Let q(f) = 27f3 - 24f*2 + 12f + 7. Let u(y) = -6a(y) + 13q(y). What is -k(n) - u(n)? -22n3 Let d(c) = 5c*2 - 11c + 14. Let m be -4 - ((-2)/(-7) - 660/105). Let w(g) = 11g - 3g*2 + 0g*2 - 4g - m - 7. Give -5d(b) - 8w(b). -b*2 - b + 2 Let p(w) = -5w + 4. Let d(t) = -122 + 212 + 6t - 103 - t + 9t. Let y = 7 - 11. What is yd(j) - 11p(j)? -j + 8 Let r(a) = 20a2 + 602a + 13. Let b(l) = -27l2 - 802l - 18. Give 8b(x) + 11r(x). 4x2 + 206x - 1 Let g = -2532 - -2528. Let p(c) = 4c - 7. Let v(r) = r2 - 9r + 15. Calculate gv(z) - 9p(z). -4z2 + 3 Let f(n) = n3 + n + 2. Let v(h) = h3 + 2h*2 + 2h - 36. Give 3f(i) - v(i). 2i*3 - 2i*2 + i + 42 Let k(x) = 1284x - 52. Let i(v) = 856v - 37. Calculate -7i(r) + 5k(r). 428r - 1 Let s(k) be the first derivative of -2k3/3 - 5k*2/2 - k - 3. Let g = 97 - 95. Let w(z) = 94z*g + z - 51z*2 - 42z*2. Determine s(n) + 3w(n). n*2 - 2n - 1 Let j(o) = 121o - 66o - 21 - 34 - 11o2. Let a(s) = -s + 1. Let q(z) = -177z - 1594. Let u be q(-9). Determine uj(p) - 55a(p). 11p2 Let d(v) = 890v*3 + 4v*2 - 28v + 4. Let m(b) = -891b3 - 3b*2 + 21b - 3. What is 3d(n) + 4m(n)? -894n3 Let o(f) be the second derivative of -f5/4 - 11f*4/12 + 11f*3/6 - 7f*2/2 - 1940f. Let z(q) = -3q3 - 6q*2 + 6q - 3. Give 6o(c) - 11z(c). 3c3 - 9 Let w(k) = 2k*3 - 36k*2 + 10. Let c(l) = 2l*3 - 35l*2 + 11. Determine 2c(n) - 3w(n). -2n*3 + 38n*2 - 8 Let x(o) = 5o*2 - 5o + 9. Let q be (4/(-2))/(11/33) + 2. Let d(y) = y*2 - y + 1. Determine qd(s) + x(s). s*2 - s + 5 Let s(q) = -q + 7. Let l(a) = 28a - 47. What is -l(i) - 4s(i)? -24i + 19 Let o(a) = 7a - 1. Let i(x) = -45x + 183. Calculate i(k) + 6o(k). -3k + 177 Let p(k) = -5k + 128. Let f(m) = -40m + 1023. What is -6f(q) + 46p(q)? 10q - 250 Let h(r) be the second derivative of r3/6 - r2/2 - 6r. Let j(f) be the first derivative of 15f - 14f + 5f - 3f*2 + 25. Calculate 34h(o) + 6j(o). -2o + 2 Let u(j) = -5j + 2. Let v(o) = 4o - 2. Suppose 2t + 4 - 8 = q, 3q = -5t + 21. Suppose -9g = -t + 30. Calculate gu(r) - 4v(r). -r + 2 Let i(y) = -1929 + 1929 + 3y. Let p(b) = -23b + 7. Let r(t) = 8t - 2. Let j(g) = -2p(g) - 7r(g). Determine 14i(o) + 4j(o). 2o Let k(o) = o + 4. Let l be k(-6). Let r(p) = p*2 + 2p - 7. Let w(x) be the third derivative of x5/60 + x4/24 + 64103x2. Give lw(v) + r(v). -v*2 - 7 Let v(h) = -13h*3 - 208h*2 - 70h + 7. Let w(q) = 9q3 + 147q*2 + 50q - 5. Give -12v(n) - 17w(n). 3n3 - 3n*2 - 10n + 1 Let j(b) = 6b3 + 14b*2 - 9b - 435. Let i(r) = -7r3 - 18r*2 + 11r + 434. Calculate 4i(s) + 5j(s). 2s3 - 2s2 - s - 439 Let v(w) = w3 - 3w2 - w + 1. Let b(j) = 109j*3 - 17j*2 + j + 6. Determine b(t) - 5v(t). 104t3 - 2t*2 + 6t + 1 Let a(s) = 17977s + 3. Let j(u) = -17943u - 4. Give 4a(l) + 3j(l). 18079l Let c(o) = 5o - 3. Let b(j) = 14j - 9. Let k(y) = 5y*2 - 61y - 46. Let n be k(13). Determine nb(p) - 17c(p). -p - 3 Let u(y) = 71y2 - 63y - 6. Let p(r) = -141r2 + 130r + 10. Calculate 3p(q) + 5u(q). -68q2 + 75q Let m(o) = -3o. Let v(k) = 14k*2 - 2k + 39. Calculate -2m(r) + v(r). 14r*2 + 4r + 39 Let b = 32 - 26. Let m(u) = -5u - 348u*2 + 699u*2 + 2 - 352u*2. Let v(r) = -r. Give bv(w) - m(w). w*2 - w - 2 Let f(b) = 297b*3 - 9b*2 + 9b + 9. Let j(k) be the second derivative of -37k5/10 + k4/6 - k3/3 - k2 + 151k + 28. Determine 2f(c) + 9j(c). -72c3 Let c(h) = -2h*2 - 5h - 4. Let i(v) = 511 - 263 - 255 - 9v - 117v*2 + 113v*2. Give -7c(j) + 4i(j). -2j*2 - j Let w(r) = 43r - 730r3 - 12257r*2 + 12300r*2 + 128r*3. Let g(s) = -43s*3 + 3s*2 + 3s. What is -43g(m) + 3w(m)? 43m3 Let g(f) = -8f*2 + 3f*2 - 3f + 6f2 - 2f*2. Let i be 12 + -13 - -12. Let m be (0 + (2 - 10))i. Let d(h) = 3h*2 + 8h. Determine mg(p) - 3d(p). -p*2 Let o(m) = 19m*3 - 20m*2 - 21m + 20. Let l(w) = -6w3 + 6w*2 + 7w - 6. Calculate -7l(h) - 2o(h). 4h3 - 2h*2 - 7h + 2 Let y = -8 + 3. Suppose 3h = 34h - 18662. Let q(d) = -h + 9d2 + 316 + 280 + 9d. Let t(z) = -14z2 - 14z + 9. Give yt(v) - 8q(v). -2v2 - 2v + 3 Let i(t) = -44t - 12. Let q = 31276 + -31265. Let v(g) = -15g - 4. What is qv(f) - 4i(f)? 11f + 4 Let k(z) be the third derivative of -7z*4/12 + 2z*3 + 2z*2 + 22z. Let d be -2(4 + 1) - 2. Let o(x) = x - 1. Determine do(b) - k(b). 2b Let v(o) = -3o*2 - 4o*3 - 4o*2 - 5 + 3o + 3o3. Let x(j) = 0j - 13j - 9j*3 + 4j*2 + 7j + 3 + 4j + 10j*3. Give 3v(a) + 5x(a). 2a3 - a2 - a Let q(w) = -17w - 3. Let n(p) = 33p + 125. Let b(v) = -228v - 914. Let x(s) = -6b(s) - 44n(s). Give -11q(u) + 2x(u). 19u + 1 Let u(z) = -4z - 9. Suppose 0 = -4w + 5w - 11. Let m(b) = 29b + 118. Let i(j) = -671j - 2750. Let c(n) = 2i(n) + 47m(n). What is wu(o) + 2c(o)? -2o - 7 Suppose 97r + 331 - 105 = -259. Let u(d) = d + 1. Let n(h) = -h + 3. Let z(i) = 4i - 10. Let o(y) = 7n(y) + 2z(y). Determine ro(s) + 2u(s). -3s - 3 Let m(p) = 3p*3 + 2p*2 - 1. Let q(s) = 8s*3 + 6s*2 + s - 489. Determine 6m(z) - 2q(z). 2z*3 - 2z + 972 Let a(d) = 1144d2 + 3d - 320. Let t(u) = 381u*2 + u - 113.	{ "pile_set_name": "DM Mathematics" }
7 - 47t2 + 135t*2 - 318t*2 - 17t*3 + 16t*3 - 172t*2 wrt t? -3t*2 - 804t Let l(o) be the second derivative of 0o3 + 0o*5 - 29/2o*2 + 121o - 1/4o4 + 0 - 11/10o*6. Find the third derivative of l(t) wrt t. -792t Let v(k) = -2k + 8. Let y be v(3). Suppose yu - 3f = 7, -u + 2u = 4f + 6. What is the second derivative of 14q + 16q2 - 11q*u - 5q + 3q2 wrt q? 16 Suppose -g + 33 = 2g. Let y be ((-49)/(-21))/((-21)/(-18)). What is the second derivative of yh5 - gh - 73h4 + 36h*4 + 37h*4 wrt h? 40h*3 Differentiate 993h*4 + 267h*4 + 3208 - 22h*4 + 1488h*4 + 610h*4 wrt h. 13344h3 Let p(i) = i3 + 7. Let v(t) = -42t3 - 9t*2 - 1145t - 28. Let u(z) = -4p(z) - v(z). Find the second derivative of u(d) wrt d. 228d + 18 Let q(k) be the second derivative of 1793k7/21 - 331k*4/4 - 445k + 1. Find the third derivative of q(b) wrt b. 215160b2 Let f(d) = 5493d*3 + 22d*2 - 22d + 7421. Let a(i) = -1099i3 - 4i*2 + 4i - 1484. Let h(k) = -11a(k) - 2f(k). What is the derivative of h(u) wrt u? 3309u2 Find the second derivative of 726c - 4c5 - 66c*4 - 1299c + 791c wrt c. -80c*3 - 792c*2 What is the first derivative of 3904r*4 - 59r*2 - 60r*2 + 119r*2 + 3190 wrt r? 15616r*3 Let f(m) be the third derivative of 2959m*8/336 + 857m*4/6 + 4165m*2. What is the second derivative of f(w) wrt w? 59180w*3 Let w(q) be the second derivative of 743q*6/15 - 1748q*2 - 5269q. What is the derivative of w(z) wrt z? 5944z3 Let u(j) be the first derivative of 133j*6/30 + 83j*4/12 + 19j - 151. Let r(t) be the first derivative of u(t). What is the third derivative of r(m) wrt m? 3192m What is the third derivative of 67q*5 + 4q*3 - 1844q*2 - 622q2 + q3 - 9q5 - 3042q*2 wrt q? 3480q*2 + 30 Let u(g) = -349g - 1044. Let v be u(-3). Let f(k) be the first derivative of -26 + 0k - vk*4 - 16/3k*3 + 0k2. Find the third derivative of f(a) wrt a. -72 Let n(z) = -z4 - 2z3 + 1. Let w(v) = -1704v*4 + 6v*3 - 3v*2 + 179. Let a(t) = -3n(t) - w(t). What is the third derivative of a(s) wrt s? 40968s Let x(z) be the second derivative of -922z5/5 - z4/3 - 1177z3/6 - 92z + 4. Find the third derivative of x(y) wrt y. -22128 Let f(b) = 1894b4 + 4802b - 5. Let x(g) = 5682g4 + 14403g - 14. Let z(v) = -14f(v) + 5x(v). Find the second derivative of z(m) wrt m. 22728m2 Let x(u) be the third derivative of u9/72 - u8/84 + 1249u5/60 + u3/6 + 1842u2. What is the third derivative of x(b) wrt b? 840b*3 - 240b*2 Let h be -4(-3)/62. Let f = 32 - 20. What is the third derivative of 12d - fd - 3d*2 + 0d*2 + 2d*h wrt d? 48d Let f(o) be the second derivative of 0o3 + 0 - 65/4o*4 - 147/2o*2 + 112o. Find the first derivative of f(q) wrt q. -390q Let d(y) = -y2 + 9y + 26. Let l be d(11). Find the second derivative of 18w4 - 1190w - 1 + 1239w - 6w*l wrt w. 144w*2 Let l(n) = 12266n - 5824. Let i(x) = 2453x - 1157. Let z(v) = -22i(v) + 4l(v). Differentiate z(y) with respect to y. -4902 Let g(j) = j2 + 495j + 8062. Let d(o) = o*2 + 246o + 4035. Let z(n) = -5d(n) + 2g(n). Differentiate z(b) with respect to b. -6b - 240 Let o(v) = v2 - 10v + 24. Suppose 5c - 3l - 33 = -l, -5l = 4c - 33. Let t be o(c). What is the derivative of -8 - 66ut + 39u*3 - 6 wrt u? -81u*2 Let c be 5 + (-3 - 9/(54/(-7860))). Find the first derivative of 218 + 0m4 - m4 - 1312m2 + 8m*4 + cm*2 wrt m. 28m*3 Let b(f) = -6f*4 - 520f*3 + 3f*2 + 396f + 6. Let w(g) = 3g4 - g3 - g2 - g - 2. Let r(h) = b(h) + 3w(h). Find the second derivative of r(i) wrt i. 36i2 - 3138i Let n(q) = 866q3 + 1997q*2 - 40q - 8. Let s(y) = -289y3 - 666y*2 + 15y + 3. Let g(l) = 3n(l) + 8s(l). What is the third derivative of g(w) wrt w? 1716 Let s(v) be the first derivative of v6/2 - v5 - 3v4/4 - 239v3 - v2 - 2v + 7758. What is the third derivative of s(i) wrt i? 180i*2 - 120i - 18 Let z(u) be the third derivative of -7u6/60 + 3u*5/4 + 2659u*3/6 + 8u*2 - 150u. Differentiate z(s) wrt s. -42s2 + 90s What is the first derivative of -909j3 - 912 - 810j*3 - 1337j*3 - 2885 wrt j? -9168j*2 Suppose -8c + 1443 = 107. Suppose cl - 172l + 15 = 0. Differentiate 10p3 + 39 + 11p*l + 0p*3 with respect to p. 63p*2 Let k be 4 - -12 - 1/(0 + -1). Find the third derivative of -147q*3 - 7 - kq*2 + 5 + 0q*2 - 42q*3 - 7q2 wrt q. -1134 Let o(c) be the first derivative of c6/6 - 204c4 - 31c*3/3 - 24c - 736. Find the third derivative of o(k) wrt k. 60k2 - 4896 Find the second derivative of -413t*2 - 2t - 114t2 - 372 - 109t*2 - 473t*2 + 268t*2 wrt t. -1682 Differentiate -3733r + 4781r - 1318 + 1721 + 4155 with respect to r. 1048 Let n(s) be the second derivative of 2057s*6/30 - 933s*2 + 1284s. Find the first derivative of n(g) wrt g. 8228g3 Let q(b) = 668b - 747. Let w(h) = -666h + 775. Let u(g) = 4q(g) + 6w(g). Differentiate u(l) with respect to l. -1324 Let r = -1 + -31. Let i = 71 + r. Find the third derivative of 13l*3 + 34l*2 - il*3 - 11l2 wrt l. -156 Let y(u) = -u3 - 6u2 - 10u - 6. Let j be y(-4). Differentiate -101tj + 10t - 68 + t - 11t wrt t. -202t Let o(j) = 36j3 + 2j*2 - 8j + 21. Let v be o(6). Find the third derivative of -vf + 7821f - 51f2 + 33f*3 wrt f. 198 Let c be (1 - (1 - (-102)/(-2))) + -4. What is the first derivative of -16 + c + 55x*4 - 24 - 10x*4 wrt x? 180x*3 Let x(r) be the first derivative of 316r*4 - 38r*3/3 - 2r*2 + r + 5557. Find the third derivative of x(a) wrt a. 7584 Let b be 4/(-3)3 - 16. Let z = 24 + b. What is the third derivative of 14c4 - 21c*2 - 26c*z + 9c*4 + 5c*4 wrt c? 48c Suppose 120 = 2w + 3w. Let o(h) = w - 2 - 54 + 13h. Let v(g) = -6g + 16. Let n(a) = 4o(a) + 7v(a). What is the first derivative of n(x) wrt x? 10 Let d = 628 - 428. Suppose -5t - 3a + 185 = a, -d = -5t - a. What is the first derivative of -4 - tn - 1 - 3 + 25n wrt n? -16 Suppose -9k + 49691 - 11864 = 0. What is the second derivative of 4240u + 3 + 19u*2 - 2 - ku wrt u? 38 Let o(w) = 25487w - 16170. Let y(a) = 849a - 539. Let q(g) = -4o(g) + 121y(g). Differentiate q(n) wrt n. 781 Let d(u) = -11u - 9. Let r be d(-1). Find the first derivative of -47z*4 - 238 - rz + 220 + 2z wrt z. -188z*3 Let z = -10 - -14. Let f be ((-76)/(-6))/(14/105). Find the second derivative of -fd + 120d + 5d*4 + 19d*z wrt d. 288d2 Let h(y) be the first derivative of y5/20 - 23y4/8 - 7y*2 - 72. Let d(s) be the second derivative of h(s). What is the second derivative of d(j) wrt j? 6 Let m(y) be the second derivative of -137y*4/12 - 2y*3/3 + 1851y*2/2 + 102y - 4. What is the derivative of m(t) wrt t? -274t - 4 Let c = 584/321 - 52/107. Let k(p) be the third derivative of -11/20p*5 + cp*4 + 0 + 0p + 30p2 + 0p*3. Find the second derivative of k(r) wrt r. -66 Suppose -18 + 2 = 4a, 5y = -2a + 612. Suppose -13q + 683 = y. Find the third derivative of -ql*6 - 4l*2 - 95l*3 + 95l*3 wrt l. -5160l*3 Let t be (3 + -1)/21 + 2. Suppose k - t - 6 = 0. What is the third derivative of -4u2 + u2 - 18u*5 + ku*2 wrt u? -1080u*2 Suppose 2x + 3r = 5, -4x - 5r = -0 - 7. Let c be (12/(-3) - x)17/(-2). What is the third derivative of 16v4 - 38v4 - v2 + cv4 wrt v? -120v Let k(d) be the third derivative of -281d2 + 179/24d*4 + 59/20d*5 + 0 + 0d + 0d3. What is the second derivative of k(l) wrt l? 354 Suppose 25 = -3u + 8u. Let z be -3 - (u - 9 - 2). What is the second derivative of -10f*z + 4 - 205f + 199f - 4 wrt f? -60f Let c(a) = -61a3 + 65. Let u(j) = -185j*3 + 195. Let n = -207 + 205. Let d(w) = nu(w) + 7c(w). What is the first derivative of d(k) wrt k? -171k*2 Suppose 2 = 2z + 3w + 7, -2z + w + 7 = 0. Differentiate 25j2 - 11j*2 - 2j*2 + 6j - 64 - 6jz wrt j. 12j + 6 Let k(x) be the first derivative of x*4/2 - 495x*2/2 - 3228x + 7484. Differentiate k(t) with respect to t. 6t2 - 495 Let r(l) = -2l - 22. Let m be r(-10). Let h be (m + 4)*(-44)/(	{ "pile_set_name": "DM Mathematics" }
orm ji + di*2 + fi*3 + h and give d. -2 Express (2x + 4 - 2 + 1)(-902x*2 + 2578x*2 - 1 - 898x*2) in the form g + fx*3 + ax*2 + px and give g. -3 Express (268 + 1255 + 707)(2g*3 - 4 + 4) - 2g3 - g3 + 2g3 as vg*3 + xg + q + zg2 and give v. 4459 Rearrange ((26 - 150 + 12)(-3 + 3 - 2)(4 + 1 + 0)(1 + 1 - 3) - 3 + 1 - 4)(-2s + 0s + s) to p + us and give u. 1126 Express (88891w2 - 4852w - 44445w2 - 44448w*2)(2w - 4w + w) as ow3 + zw + pw2 + f and give p. 4852 Rearrange 11t + 218t2 - 222t*2 + 293t - 2 + 0 + 1 to b + at2 + yt and give y. 304 Express 836l4 - 2 + 832l*4 + 50l*3 - 5l*2 - 2507l*4 + 838l*4 in the form pl*2 + ol*3 + ql + tl4 + v and give t. -1 Express (0a + 2a + a)(4a3 + 4 - 4) + 334a*4 - 532a*3 + 532a*3 as xa*3 + fa*2 + qa + ga4 + h and give f. 0 Express 2m - 302m2 - 12 + 92m*2 + 114m*2 + 22m*3 - 2 + 91m*2 as i + gm + um3 + tm*2 and give g. 2 Express 15104w - 552w + 4437w - 3 + 3 in the form x + iw and give i. 18989 Express -4734a - 1109a + 21856a + 6241a as j + ga and give g. 22254 Express 12403o - 8243o + 4251o in the form lo + t and give l. 8411 Rearrange -3p2 + 0p*2 + 38 - 2p*2 - 258 - 88 to the form rp*2 + g + op and give g. -308 Rearrange 3245o + 8508o + 273o + 14307 - 14307 to q + jo and give j. 12026 Rearrange 305n + 86n + 84n to t + zn and give z. 475 Express 26l - 58l - 1 + 337l3 + l4 - 2l*2 + 2 + 35l in the form jl + wl*2 + cl*4 + pl*3 + n and give w. -2 Express 3h + 83 - 3h3 - 2h + 344 - 2h2 as wh + kh3 + qh2 + t and give q. -2 Express -u2 - 32 + u + 42 - 31 - 4u3 as fu*3 + pu + au2 + y and give a. -1 Rearrange t - t3 - 435 + 23472t*2 - 23473t2 - 1612 + t4 to ft3 + mt*4 + p + lt*2 + qt and give l. -1 Rearrange 4b2 - 2b*4 + 4622867b + 0b4 - 4622866b - b*3 - 2b*2 + 37 to the form k + ub*2 + ab*4 + jb + gb3 and give u. 2 Rearrange -638z - 791z - 1197z to pz + n and give p. -2626 Rearrange (3 + 3 - 4)(1550886 - 7188i - 1550889 - 926i) to oi + t and give t. -6 Express 4886d*2 - 301d + 4897d2 - 9781d*2 - 4d*3 in the form v + gd*2 + bd*3 + rd and give g. 2 Rearrange ((0 + 1 + 0)(3a - a - 4a) + (103 - 103 + 4a)(-16 - 10 - 24))(4a - a + a) to the form ya + j + ma2 and give m. -808 Rearrange -4347t - 7871t - 646t - 2799t to ft + a and give f. -15663 Rearrange -82 - 31s2 + 29s + 57s2 + 84 to the form ls + q + hs2 and give l. 29 Rearrange -10c - 8c3 + 312 + 315 + 2c*3 - 898 + 270 to the form tc*3 + f + xc*2 + rc and give f. -1 Express -301 + 238 - 21j2 + 222j*2 + (-j + j - 2j)(2j - j + 0j) as k + oj + gj2 and give o. 0 Express (-2v - 2v + 2v)(6 + 0 - 4) - 3v + v + 7v + (21 - 6 + 16)(-3v + 8v - 2v + (3v + 0 + 0)(7 - 2 + 3)) as dv + y and give d. 838 Rearrange 32 - 21029d2 + 10509d*2 + 10512d*2 to id + kd2 + u and give u. 32 Express -2n - 36467 + 36474 + 2n - 32n*2 + 0n as un2 + in + p and give u. -32 Express (0f + 0f + 2f)(-5 + 31 - 2) + 3f + 2 - 2 + 1568 + 103f - 1568 as x + qf and give x. 0 Rearrange (3i*2 - 4i2 - i2)(-143 + 138 + 756) + 2i - i*2 - 2i + (3i + 0i - 5i)(-i - 5i + 4i) to qi + wi*2 + t and give w. -1499 Express 49d + 4d - 51d - 12 + 10d - 25 + 25 + (5 - 2 - 4)(-d + 3d + 0d) in the form ud + p and give p. -12 Express -9 + 2t*3 + 2t*3 + 41t*2 + 2t*3 - 38t*2 - 2t + 6t as ot*2 + c + pt*3 + xt and give o. 3 Rearrange -5a2 + 2212a*3 - 2210a*3 + 9a*2 - 59 + 7a*2 + 11a*2 to fa + qa2 + c + va*3 and give q. 22 Express (-4 + 2o + 0o + 2)(-2 - 3 + 4) - 37065 - 307854o + 307858o + 2720 in the form f + yo and give f. -34343 Express 14 - 6u + 2u4 - 10u - 3u3 - 12 + 21u as g + yu4 + wu*3 + bu*2 + pu and give b. 0 Rearrange (-3q + 3q - 2q)(-3 - 3q2 + 3) + 695q*3 - 1673q*3 - 970q*3 to tq*2 + g + fq*3 + oq and give f. -1942 Express -210q2 - 7636q*2 + 29q*2 in the form iq*2 + oq + g and give i. -7817 Express 0w + 627w*2 - 188576w*3 + 2w + 188574w3 in the form uw*2 + mw*3 + lw + j and give m. -2 Express 6 - i*3 + 255i*4 - 3i - 2i2 + 342i*4 - 595i*4 as ai*4 + ui*2 + v + oi + yi3 and give v. 6 Rearrange (5357s + 2102s - 773s)(-5 + 3s + 5) to ns2 + ws + u and give n. 20058 Rearrange (2 - 4 + 1)(-202 - 7073b - 280 + 482) to f + vb and give v. 7073 Rearrange -486j - 2j2 + 5j*3 + 0 - 1 + 444j to the form b + qj2 + fj*3 + ij and give b. -1 Express (-2 - 4 + 5)(-73 - 162 + 108)(-1 + 1 - 2)(-p + 1 - 1) in the form j + np and give n. 254 Express b2 + b2 - 52 - 56 + 6b3 + 2b + 157 - 52 - 2b4 as vb*4 + jb*3 + yb*2 + ib + k and give v. -2 Rearrange -68367x - 4 + 39892x + 4 to ax + y and give a. -28475 Express 4d*3 + 36002848d*2 + 263 - 36002848d*2 - d as jd + a + id3 + hd*2 and give i. 4 Express -13d + 12 - 18d - 13d - 8 - 6 as o + gd and give o. -2 Rearrange (2l - 5l + 5l)(2 - 3 + 2)(59l - 28l + 20l) + l2 + 0 + 0 + (3l + 4l - 4l)(-9l - 10l + 15l) to yl + al*2 + k and give y. 0 Express 28d*3 + 4d + 0d3 - 9d*3 - 3d*2 + 60 - 17d*3 + 2d as y + xd2 + nd + id3 and give y. 60 Rearrange 0 - 106b*2 + 985b*2 - 3 + 634b*2 + 238b*2 to lb*2 + g + jb and give g. -3 Express 98b - 385b*2 + 129b*2 - 1 + 125b*2 + 130b*2 in the form gb*2 + ab + q and give a. 98 Express (101 - 98 + 72)(2 + 2 - 2)(-66y + 65y + 102y) in the form uy + c and give u. 15150 Express -v*2 - 3v*3 + 8 + 113v*4 + 107v*4 - 2v + 115v4 - 16v - 328v4 as n + tv*4 + zv*3 + rv + dv2 and give n. 8 Rearrange -92f - f*2 + 71f - 3 + 44f + 4f*2 - 9f*2 to vf*2 + t + qf and give t. -3 Rearrange ((-2 + 2 - 2)(-22 + 22 - 9a) + (6 - 2a - 6)(0 - 3 + 1) - 4 + 4 - 2a)(1 - 1 + 2) to c + ga and give g. 40 Express 1710 - 340q*2 - 850 + 118q - 856 - 207q2 - 119q as mq2 + a + iq and give i. -1 Express 1 - 1602x4 - 61x + x*2 + 2x*2 + 1604x*4 as ax + ux3 + dx*2 + jx*4 + s and give j. 2 Express -37p*3 + 6054p + 6044p + 2p*2 - 11973p in the form j + lp3 + dp + up2 and give l. -37 Rearrange (0 - 1 + 5)(348 - 690 + 342 - 2621n) + 4n + 0n - 2n to the form rn + x and give r. -10482 Rearrange 3m*3 + 2m*3 - 3m*3 + (1 + 5 - 5)(-380m - 6240 + 6240)(-5 + 5 + 3m2) to rm*3 + om + xm2 + a and give o. 0 Express -12396 + 12396 + 595l*2 in the form ol*2 + fl + b and give o. 595 Express -3267 - 6u2 + 2258 - u3 + 4u*2 - 3122 as h + nu*3 + bu + ju2 and give j. -2 Express (2 - 3 - 2)(48 + 37x - 17x + 85x - 38 + 15x) as zx + m and give z. -360 Rearrange 2 + 1196k - 8367k + 1063k to mk + g and give g. 2 Express (-38p - 319 + 319 + p + 3p - 2p + (p - 3p + 4p)(3 - 4 - 1))(1 + 2 - 5) in the form cp + o and give c. 80 Rearrange (-3n - 92n - 17n)((4 - 4 + 3)(-13 - 2 + 1) + 2 + 0 + 0) to the form tn + a and give t. 4480 Rearrange -1962c*2 + 2154c*2 + 1291c*2 + 2378c*2 to n + qc + pc2 and give p. 3861 Express -2u*2 - 6u*2 + 3u*2 + (49 + 71 + 60)(-7u2 - 3u*2 + 2u*2) in the form wu*2 + su + b and give w. -1445 Express -35929204 + 35929204 + 10099d2 as id + r + nd2 and give n. 10099 Rearrange 2n - 2 - 2n2 - 16n*2 - 2n*2 - 6n*2 - 41 to vn + d + rn2 and give r. -26 Rearrange -34 + 21 + 10w*2 + 59 + 2w*3 - 11w + 6w to mw*3 + s + fw*2 + vw and give f. 10 Rearrange (t*2 + 0t*2 - 4t*2)(-814 + 1851 - 893 + (1 - 8 - 2)(-4 + 0 + 2)) to ft*2 + wt + k and give f. -486 Rearrange (-2c + 0c + 0c)(47c - 90c + 98 + 46c) to m + ic + jc2 and give j. -6 Express 458p*2 - 432p*2 - 2p + 3184 - 3188 as t + hp + mp*2 and give h. -2 Rearrange (3r + 3r - 4r)(-50 - 51 - 215r + 101)(7r - 12r - r) to the form wr*3 + hr + p + br2 and give w. 2580 Express -45 - 18 + 2563z*2 + 63 + 5829z*2 as gz*2 + qz + w and give g. 8392 Express (4 - 4 + 110x + 508x)(-1 - 1 + 1)(2x3 + 20x*3 + 4x*3) in the form k	{ "pile_set_name": "DM Mathematics" }
Solve 0 = -fs - 2 + 6 for s. 2 Let s(j) = -4j + 16. Let c be s(6). Let i(h) = h + 13. Let k be i(c). Solve -21 + 6 = -kr for r. 3 Suppose -37g + 40g - 35g = -1088. Solve -32l = -gl + 4 for l. 2 Let c = -4657 - -4659. Let p be (-1)/2(-4 - (9 + -5)). Solve -p = -ct + 6t for t. -1 Suppose 0 = -5d - 4u + 100, 0 = 2d + 42u - 41u - 37. Solve 23j = 32j - dj for j. 0 Suppose -316 = -s - 299. Solve -6 = 23v + s for v. -1 Suppose 11 = 12x - 25. Suppose -4p = 4o - 12, -3o = -0 + x. Solve -ps = -7s + 12 for s. 4 Let f be 868/42 - 20 - (-58)/3. Solve -16y + fy = -8 for y. -2 Suppose -3q = q + 264. Let v = q + 72. Let w(r) = r3 - 6r*2 + r - 4. Let l be w(v). Solve 10 + l = -3n for n. -4 Let x(d) = 5d2 + 7d + 13. Let f(t) = 27t2 + 35t + 68. Let k(q) = 2f(q) - 11x(q). Let a be k(-2). Solve -5p + 4p - a = 0 for p. -3 Let j(g) = -g*2 + 16g + 10. Let a(d) = -4d2 + 49d + 29. Let s(z) = -2a(z) + 7j(z). Let w be s(-14). Solve -2o + w = 2o for o. 3 Let w(i) = 3i + 18. Let l be w(-5). Suppose -1 = -d - 8. Let c(s) = s2 + 10s + 23. Let t be c(d). Solve lz = -tz for z. 0 Suppose -125x - 13951 + 93151 = 73x. Solve -xy = -396y + 4 for y. -1 Suppose 2c + 2c = -5l + 17, 5l - 35 = 5c. Suppose -3s = -ls - 10. Let z be (-8)/s - (-18)/150-5. Solve 0v = -v + z for v. 1 Suppose 0 = -2c + 20 - 2. Suppose -177m + 179m = 5r - 3, 4r - m - 9 = 0. Solve -cg = -rg for g. 0 Suppose 0 = 3d - 4d + 3. Suppose -140n + 141n + 3k = -12, -5k - 36 = -n. Solve -h = -n + d for h. 3 Let q be 76/(-8)2-1. Suppose 5c + 4 - q = 0. Suppose -4 = cz - 5z. Solve zf - 1 = 1 for f. 1 Let j(x) = 2x2 + 54x + 32. Let y be j(-26). Let z(w) = -w*2 - 21w - 12. Let o be z(y). Solve -2p - o = -4 for p. -2 Suppose 141 + 64 = 5q + 5r, 2q - 4r = 46. Solve 24f = -11f - q for f. -1 Let v be (-5 - 18/(-4))0. Suppose u + 2 - 17 = -4o, -5o - 4u + 16 = v. Solve ot = t - 6 for t. -2 Suppose -4y - 15 + 31 = 0. Let a be ((-12)/y)/(-12) + 15/4. Let x be 5/(11/(-3) + a). Solve -2o - o = -x for o. 5 Suppose -35m + 1362 = -4212 + 744. Solve -132k + mk = -12 for k. -2 Let l be (86/(-3))/((-18)/27). Suppose 4m - s - 22 = 18, -3m + l = -4s. Suppose 4p = m - 1. Solve pk + 6 = 5k for k. 2 Let j(b) = 10b*2 + 16b - 29. Suppose 392s + 26 = 405s. Let z be j(s). Solve -6 = zu - 41u for u. -3 Let j be 30/(-5)(-20)/8. Solve 0 = -jd + 17 - 2 for d. 1 Let b = -469 + 472. Suppose 2r - 52 = -4p, -3p - br = 2p - 66. Solve p = -3d + 7d for d. 3 Let p(l) = -11l - 10. Let s(d) = -5d - 5. Let y(c) = 2p(c) - 5s(c). Let a be y(7). Let g = -21 + a. Solve -gz - 9 + 29 = 0 for z. 4 Let b(z) = z*3 + 2z*2 + 4. Let p be b(0). Suppose -3l + 25 - p = 0. Solve lf - 6f = 4 for f. 4 Let u = 1283 - 1283. Solve u = -2q + q - 3 for q. -3 Suppose 144w = 145w - 12. Suppose -28n = -34n + w. Solve c = -1 + n for c. 1 Suppose -5f + 3i + 2 = -3, 5f - 45 = -5i. Let t = -86 + 86. Suppose a - 3 = -3h, -6a + 5a + 2h - 2 = t. Solve a = -fu + 6u + 4 for u. -2 Let w = -12 - -18. Let y be (3 - 1)222/12. Solve 35a - w = ya for a. -3 Let k be (-3 + 4)0/(1/(-1)). Let v be (-3 - -8) + -1 + (2 - k). Solve b + v = -b for b. -3 Let f(w) = -w3 - 15w*2 - 7w + 100. Let a be f(-14). Suppose -2t = r, 5t = ar + 3r - 15. Solve rm - 15 = -11 for m. 2 Suppose 5k - 9 = -4. Suppose 0 = 5f - f - 3s - k, -2f + 13 = s. Suppose 3r - fr + 20 = 0. Solve 5u = -0u - r for u. -4 Suppose -8x + 183 - 791 = 0. Let p = x + 86. Suppose -2b = -3b + 5. Solve p = bf - 15 for f. 5 Let s(n) = -n3 - 16n*2 - 21n - 14. Let x be s(-15). Let w = -79 + x. Let r be (0 - (-6)/(-2))/(w/2). Solve 0 = -rm + 4 + 2 for m. 3 Let a(v) = 4v + 46. Suppose -340 = 4i + b, -2i - 4b = -i + 100. Let y = -94 - i. Let r be a(y). Solve rw + 10 = w for w. -2 Let q be (528/40 + -12)/(1/(-30)). Let i be 8/q - (-14)/63. Solve -4o - 2o + 6 = i for o. 1 Let v = -224 - -228. Suppose -vb - 24 + 32 = 0. Solve 0 = 5c + b - 22 for c. 4 Let f(j) = -2j2 - 49j + 876. Let s be f(12). Solve s = 37m - 158 + 47 for m. 3 Let n(w) = -w3 - 13w*2 - 12w + 3. Let k be n(-12). Suppose -10 = -5b + 2u, -3u = -7u - 20. Let c = -5 - -5. Solve v + b + k = c for v. -3 Suppose f - 2 = 0, 2f - 39 = -4o - 23. Suppose 0 = 4v - 4k, 2v + 3 = ok - 2. Solve -vm - 6 = -2m for m. -2 Let q(g) be the first derivative of 9g4/4 + 3g*2/2 - 2g + 11. Let r be q(1). Solve j = -j + r for j. 5 Suppose 12 = -3t, 0 = 3h + 4t + 8 - 1. Suppose 0 = -3f - hg + 24, 1 = f - 2g - 7. Solve 5k + f = 3 for k. -1 Let l be 90 - 1 - (-3 - (-32)/4). Let p = l + -76. Solve d - p = 5d for d. -2 Let s(v) = -v + v*3 - 35v*2 + 4 - 38v*2 - 41v*2 + 116v*2. Let u be s(0). Suppose -i = i - 30. Solve -z = -uz - i for z. -5 Let d be (-34)/51 + (-8)/6. Let i be 32/14 - 6d/(-42). Solve -iz = -2 - 4 for z. 3 Let u be 10496/1536 - (0 + (-5)/(-6)). Solve 1 = uv + 13 for v. -2 Suppose 5t = 5m - 520, -4m - 136 + 552 = 4t. Let u = m + -104. Solve uk = -3k - 15 for k. -5 Let p(t) = -4t - 10. Let a be p(-4). Suppose 0 = -ao + 3o + 3k + 3, -5o + 45 = 3k. Let f = 10 - 8. Solve fi - 2 + o = 0 for i. -2 Let x be 2/(-7) + 2752/224. Let f be (-192)/18((-39)/x - -1). Solve z - f = 7z for z. -4 Let k be 35 - (450/(-9))/(-5). Let j = -30 + 40. Solve k = 5l - jl for l. -5 Suppose 249l - 488l = -255l + 32. Solve 0 = 22y - 24y - l for y. -1 Let v = 29 - 29. Suppose 483 = 2z - 6z + 507. Solve v = -0l - zl - 12 for l. -2 Let c(m) = -m2 - 42m - 75. Let u be c(-40). Solve uo + 204 = 184 for o. -4 Let i(k) be the second derivative of -k5/20 + 7k4/6 + k3/3 - 12k2 + 145k. Let f be i(14). Let s = -14 + 24. Solve -fb + s = -2 for b. 3 Let g = -246 + 246. Solve g = 5t - 14t for t. 0 Suppose 48k = -5 + 5. Solve -2f - 107 + 103 = k for f. -2 Suppose -5v + 2 - 111 = -4z, -3 = 3v. Solve 9s = -zs - 210 for s. -6 Let j be ((-70)/(-40) - 1)/(3/20). Suppose 0f + 5f + jh - 45 = 0, h = 4. Solve -3w = -fw + 4 for w. 2 Suppose 4b = 8b - 5z - 31, 0 = 5b - 5z - 35. Let i be (b/(-6) - 0)/(114/(-171)). Let k be (13 - 14) + i4. Solve -ky + 4 + 2 = 0 for y. 2 Let y = -20421 - -20463. Solve -19h - y - 53 = 0 for h. -5 Let l be -2 + ((-4)/(-4) - -19). Suppose 4s - 4o = l + 14, o + 32 = 5s. Solve sr = 11r - 5 for r. 1 Let v(o) = -3o3 - 163o*2 + 112o + 126. Let r be v(-55). Solve -a - ra = -85 for a. 5 Let p be ((-30)/(-20))/(1/2). Suppose 12 = 2g - po - 2o, 3g = -2o - 1. Let a be (-2)/(-4g/(-4) - 2). Solve -5 = b - a for b. -3 Suppose 5p - 88 = -n, 14p + 4n = 11p + 46. Solve -15 + 159 = px for x. 8 Let r be (-1 - (-1)/7)/(162/(-756)). Solve 0 = rp - 6p + 4p for p. 0 Suppose -6s = -13s + 14. Suppose 0a = -d - 3a + 8, -4d - sa + 22 = 0. Solve -d = -3f + 10 for f. 5 Suppose 3h - 24 = m, 5m - h + 30 + 104 = 0. Let f = 41 - m. Let v = 77 - f. Solve -3g + 0g = -v for g. 3 Let f = 8279 - 8194. Solve 68y - 51 = fy for y. -3 Suppose u - 542 = -3l, -2l - 174 = -3l + 3u. Let g = 180 - l. Solve g = -x - 4 for x. -4 Let a(s) = 2s2 + 57s + 471. Let w be a(-12). Solve -19 = 14k - w for k. 4 Let q be 2/(-5)10 + 64 + 12. Solve 6j = 36 - q for j. -6 Let g be ((-2976)/(-1632))/(2/34). Solve 0 = 22x + 57 + g for x. -4 Suppose -3g + 128 = t + 110, 0 = -2t - 2g + 56. Solve -25o = -t - 17 for o. 2 Suppose 4j = 3q + 320, 80 = -j + 2j - q. Let x = j + -82. Let n = x - -5. Solve 0 = -nz + 2 + 1 for z. 1 Let p(x) = -22x - 22. Let t be p(-1). Suppose 6c + 36 = 3c. Let l = c - -14. Solve tq - 2 = -lq for q. 1 Let w(p) = p3 + 7p*2 + 11p + 43. Let j be w(-6). Suppose q = -3s + 23, 2s - q = s + j. Solve 4 = 5i + s for i. -1 Let t(h) = -3h*2 - 2h - 5. Let u be t(-9). Let j = u - -236. Solve 3n + j = 3 for n. -1 Suppose -3r + 4r = 2s + 3, 0 = s + 2r - 6. Suppose 3c = -2u - 2u + 55, -2u + c + 35 = s. Let a = -15 + u. Solve i - 2i = a for i. -1 Suppose -3d - 22 = -5n, -8 = -n + 6d - 9d. Suppose 5 = -no + 20. Solve 3 = oc + 18 for c. -5 Let u be 106/(-12) - -47. Let o = 45 - u. Solve 8 = -ok + 2 for k. -2 Suppose 3h = r - 2102, -16h + 17h + 5r = -690. Let u = -670 - h. Solve -7*z = -z - u for	{ "pile_set_name": "DM Mathematics" }
when (-1 + -78 + 1)/h is divided by 10. 9 Let c be 76/(-5)10/(-4). Suppose 15j - c = 13j. What is the remainder when 75 is divided by j? 18 Let l = -339 + 531. Suppose 2x - r + 70 = l, 5r - 290 = -5x. Calculate the remainder when x is divided by 21. 18 Let r(q) = -q*3 - 22q*2 - q + 26. Calculate the remainder when r(-22) is divided by 17. 14 Suppose a = 2a - 2. Suppose u - 5 = 2l, al + l = -6. Calculate the remainder when 7 is divided by (-12 - 3)/(-3)u. 2 Suppose 0 = 5a + 4v - 241, v - 65 + 286 = 5a. Calculate the remainder when a is divided by 25. 20 Suppose -4n = -16, 2q - 1 - 5 = -2n. Let y(u) = u3 + 2u*2 - 3u + 3. Let p be y(-3). What is the remainder when 111 - (-1 + q + p) is divided by 28? 26 Let g = -66 + 71. Suppose 5j - 3a - 671 = 0, -803 = -gj + a - 126. Calculate the remainder when j is divided by 35. 31 Suppose 12 = -o + 4. Calculate the remainder when (-4 + 9/(-6))o is divided by 15. 14 Let q = -57 - -59. Suppose -v = qv - 153. What is the remainder when v is divided by 14? 9 Let k = -59 - -83. Suppose 3i - k - 6 = 0. What is the remainder when i is divided by 4? 2 Let v be (-42)/35(-10)/3. Suppose 3z = vz. Suppose zs = s - 26. Calculate the remainder when 49 is divided by s. 23 Suppose 4t + 40 = 6s - 4s, -t = -5. What is the remainder when s is divided by 21 + (-60)/(12/2)? 8 Suppose 233 = 3w - t, -2w - t + 98 = -59. What is the remainder when w is divided by 20? 18 What is the remainder when 588 - 12/8(-24)/(-9) is divided by 5? 4 Let n(b) = -b*3 - 4b*2 + 35b + 16. What is the remainder when n(-9) is divided by 12? 10 Suppose 2 = -5k + 12, 2t = k + 66. Calculate the remainder when 202 is divided by t. 32 Let l(r) = -r*2 + r + 16. Suppose 4x - 5a + 4 = -1, -3a + 3 = x. What is the remainder when 1729/28 + 6/(-8) is divided by l(x)? 13 Let m(r) = 14r + 608. Suppose 4a + 5o = 7, 3a - 13 + 4 = -3o. Suppose 0 = -2f - 0f + a. Calculate the remainder when m(-43) is divided by f. 2 Let c(u) = u3 + 13u*2 + 17. Calculate the remainder when c(-13) is divided by 6. 5 Suppose -63 + 129 = 11m. Calculate the remainder when 187 is divided by m. 1 Let l = -34 + 30. Let z = l + 13. What is the remainder when 17 is divided by z? 8 Suppose -2g + 0g - 3g = 0. Let y = g + 12. What is the remainder when 35 is divided by y? 11 Let t(f) = 149f - 6. Let u be t(2). Let g = 450 - u. Calculate the remainder when g is divided by 40. 38 Let o(p) = 3p3 + 1. Let t be ((-30)/(-45))/(1/27). Let j(q) = -q3 + 17q*2 + 19q - 16. Calculate the remainder when o(1) is divided by j(t). 0 Let v(i) = 2i2 - 15i + 15. Let b(f) = f + 2. Let h be b(0). Suppose 12 = -hs + 34. What is the remainder when v(s) is divided by 31? 30 Let a be (679 - 1)14/(-42). What is the remainder when a9/(-54) - (-4)/3 is divided by 14? 11 Let i = 1 + 3. Suppose 3g - 25 = 2u, 2u = ig + g - 23. Let m = 51 + u. What is the remainder when m is divided by 13? 11 Suppose 0 = -18d + 250 + 200. What is the remainder when 50 is divided by d? 0 Let k(t) = 8t - 261. Calculate the remainder when 121 is divided by k(33). 1 Let f(s) = s2 + 10s - 11. Let a be f(-10). Let g(v) = v + 11. Let l be g(a). Suppose l = -z + 2z - 34. What is the remainder when z is divided by 9? 7 Let l = 956 - 915. Suppose -11 = 3g + 4. Let n = g + 27. What is the remainder when l is divided by n? 19 Let a(l) = l*2 + 4l + 9. Let t = -1718 - -2762. Suppose -q + t = 8q. Calculate the remainder when q is divided by a(-7). 26 Suppose -4 = 4g, 17g - 12g - 234 = -l. Calculate the remainder when l is divided by 60. 59 Let n = 138 - 95. Let z(q) = q*3 + 15q*2 - 17q - 5. Calculate the remainder when n is divided by z(-16). 10 Suppose -3p + 3z - 30 = 0, -2p - 10 = -p - 5z. Let i = -3 - -7. Calculate the remainder when (-3 + p)(-5 + 4) is divided by i. 1 Let d(a) = a3 - 5a*2 + 5a - 1. Let f be d(4). Suppose 3g - 64 = -2r - fr, -3g - r = -44. Calculate the remainder when g is divided by 8. 5 Let x(r) = r - 4. Let c be x(7). Suppose -70 = -2a - ca. Let s = 33 - a. What is the remainder when 37 is divided by s? 18 Suppose 2r - 375 = 3k, 17r - 5k - 562 = 14r. What is the remainder when r is divided by 28? 21 Let g = -255 - -277. What is the remainder when g is divided by 9? 4 Let f = 437 + -409. What is the remainder when 44 is divided by f? 16 Let s(m) = -m + 2. Let f be s(2). Let q = 6 - -1. Suppose f = -y + qy - 78. Calculate the remainder when y is divided by 8. 5 Let b(q) = -130q + 102. What is the remainder when b(-2) is divided by 33? 32 Suppose 3s - 529 = -115. Let h = -97 + s. What is the remainder when h is divided by 7? 6 Let h(w) = 45w2 - 24w - 111. Calculate the remainder when h(-4) is divided by 12. 9 Let r(n) = n*2 + 4. Let p = -155 + 158. Suppose 4a - 199 = pl, -l = 5a - 0l - 244. Calculate the remainder when a is divided by r(3). 10 Let s = -79 - -83. Calculate the remainder when 50 is divided by ((-16)/(-3))/s360/16. 20 Let n be (9/(-3) - (-12)/2)/1. What is the remainder when (0 + (-45)/(-25))/(n/45) is divided by 10? 7 Let f(b) = b*2 - 4b + 2. Let g be f(5). Let i(j) = j + 7. Let z be i(0). Let p = z + g. Calculate the remainder when 55 is divided by p. 13 Suppose 3g = -13 + 226. Let o = -86 - -98. Calculate the remainder when g is divided by o. 11 Suppose -2h = 3n - 4, -4h = n - 4n + 28. Let k(i) = i3 + i2 + 37. Calculate the remainder when k(0) is divided by -16(h - -3) - (3 - 0). 11 Calculate the remainder when (-1450)/(0 + -5)(-7)/(-14) is divided by 37. 34 Let y be (2 + (0 - -3))-1. Calculate the remainder when (0 + 4/8)22 is divided by (-7 - y)(-3 + 1). 3 Let q(d) = d + 2. Let r be (1/(-3))/(1/(-9)). Let t be q(r). Suppose -h + 3h - 44 = x, -5h + tx = -110. Calculate the remainder when h is divided by 5. 2 Suppose 2b - 48 = 70. Suppose -4m = -0m + 12, -2l - 2m + 28 = 0. Suppose 4f - r = 77 - l, 2r - 30 = -2f. Calculate the remainder when b is divided by f. 14 Let k be 1/3 + 35/3. Let d be (44/36 - (-10)/(-45)) + 10. Suppose k = z - d. What is the remainder when 89 is divided by z? 20 Let i = -3 + -69. Let c = 90 + i. What is the remainder when 28 is divided by c? 10 Let c(z) = 9z*2 + 2z + 1. Suppose -4n + 136 = 5f + 19, n + 4f = 21. Calculate the remainder when (-2296)/(-77) - (60/n + -2) is divided by c(-1). 6 Let m be (-4 - (-11)/2)2. Suppose mc - 8c = -50. Calculate the remainder when 11 is divided by c. 1 Let g(n) = -5n - 30. Let w be g(-7). Suppose 3u - 73 = 4z, 3z - 89 = u - wu. What is the remainder when 44 is divided by u? 21 Let n(h) = -h2 + 13h - 12. Suppose -a + 5x + 20 = 0, 5a + 4 - 20 = -3x. What is the remainder when 82 is divided by n(a)? 26 Suppose h + 3p = 206, -5p = -39 + 14. Calculate the remainder when h is divided by 16. 15 Let c(f) = 48f - 22. What is the remainder when c(2) is divided by 38? 36 Let n = 325 + -76. Suppose -3o + 334 = 4q, -3q + 0q - 3o = -n. Calculate the remainder when q is divided by 30. 25 Let n(m) = -m3 + 36m*2 + 203m + 84. Calculate the remainder when 16 is divided by n(41). 0 Suppose 3t + 76 = -2m, -t + 3 = -3m + 21. Let a be 2/(-6) + (-128)/t. Suppose ag - 46 - 79 = 0. What is the remainder when 47 is divided by g? 22 Suppose -2s + 11 = -4m - 17, -3m - 24 = -2s. Calculate the remainder when 347 is divided by s. 5 Suppose -l - 2916 = 2967. Let w be l/(-21) - 2/14. Suppose -2j - 5y + 0y = -121, -5y + w = 5j. What is the remainder when j is divided by 14? 11 Let b = 265 - 218. Calculate the remainder when 135 is divided by b. 41 Suppose 66 = 5w - 449. What is the remainder when w is divided by 26? 25 Let q = 40 - 28. Calculate the remainder when 69 is divided by (-9)/q(-1 - 23). 15 Suppose 5r = 3q - 17, 36 = 3q + 5r - 31. Let i(l) = 5l*2 + l. Let u be i(1). Suppose uk - 20 = k. What is the remainder when q is divided by k? 2 Suppose 0 = 2f + 4n + 120, -2f + 3f + n = -55. Let l be f((-24)/(-15) - 2). Suppose -7u + l = -5u. Calculate the remainder when 29 is divided by u. 9 Let n = -9 + 14. Let l(f) = -f2 - 6f + 9. Let z be l(-7). Suppose -4i = -3g - 87, 2 = -zg - 0. What is the remainder when i is divided by n? 1 Let g = 115 - 98. Let n(f) = -22f -	{ "pile_set_name": "DM Mathematics" }
95629312r/5 - 1311598656/5 = 0. -6036, -1, 1/3, 18 What is s in s5/6 + 3s*4/2 + 25s*3/6 + 9s*2/2 + 5s/3 = 0? -5, -2, -1, 0 Suppose z*2/4 - 279z/4 + 2227/2 = 0. What is z? 17, 262 Factor -s*2 - 7287s - 7286. -(s + 1)(s + 7286) Factor -2m*2/19 + 29380m/19 - 29378/19. -2(m - 14689)(m - 1)/19 Suppose -3z2 - 357z + 11826 = 0. What is z? -146, 27 Factor -h*2/4 + 8388h - 70358544. -(h - 16776)*2/4 What is v in 50v*4/9 + 1010v*3/9 + 4558v*2/9 - 5618v/9 = 0? -53/5, 0, 1 Factor 3j3 - 52j*2/3 - 85j - 18. (j - 9)(j + 3)(9j + 2)/3 Factor 2p*2 - 3328p + 1233198. 2(p - 1107)(p - 557) Find v, given that -v*3 + 1091v*2 - 1090v = 0. 0, 1, 1090 Solve 4m2/3 - 104m/3 - 620/3 = 0. -5, 31 Determine h, given that -36h4/5 - 200h*3 - 5932h*2/5 + 1368h/5 = 0. -19, -9, 0, 2/9 Solve -2a2 - 5314a - 52940 = 0 for a. -2647, -10 Factor 6y2 + 17818y - 220668. 2(y + 2982)(3y - 37) Factor -h3 + 569h*2 + 570h. -h(h - 570)(h + 1) Find g such that -2g5/5 - 2148g*4/5 - 591478g*3/5 - 7863052g*2/5 + 118296g + 1573040 = 0. -530, -14, -1, 1 What is p in p*5/4 - 214p*4 + 48596p*3 - 1159268p*2 - 8342100p - 11654928 = 0? -4, -2, 34, 414 What is t in 4t3/7 - 8592t*2/7 + 4740084t/7 - 134577720/7 = 0? 30, 1059 Factor 2s2 + 2054s + 526752. 2(s + 496)(s + 531) Solve 227919409p2 - 181164p + 36 = 0. 6/15097 Factor -2n4/11 - 150n*3/11 + 7866n*2/11 + 599886n/11. -2n(n - 63)(n + 69)2/11 Determine o so that 5o*3 - 1340o*2 + 9195o - 15660 = 0. 3, 4, 261 Solve 5p2 + 12980p - 12985 = 0 for p. -2597, 1 Determine v so that 8591847v4 - 3124066v*3 + 283940v*2 + 8v = 0. -2/71007, 0, 2/11 Factor v*4/7 - 366v*3/7 + 4836v*2 - 9464v. v(v - 182)2(v - 2)/7 Factor 2v2/15 + 4424v/5 - 10624/3. 2(v - 4)(v + 6640)/15 Factor 310g2 + 23866g/7 - 44/7. 2(g + 11)(1085g - 2)/7 Factor 4s*3 + 670024s*2. 4s*2(s + 167506) Let 7j3 - 39755j*2 - 28402j + 11360 = 0. Calculate j. -1, 2/7, 5680 Determine k so that -3k5/5 - 1974k*4 - 10830663k*3/5 - 3971190504k*2/5 - 7866763584k/5 + 11848794624/5 = 0. -1096, -3, 1 Suppose -50z3/13 - 1504z*2/13 + 110z + 124/13 = 0. What is z? -31, -2/25, 1 Suppose 4w5 + 33292w*4/5 - 9332w*3 - 19964w*2/5 + 9328w - 13328/5 = 0. What is w? -1666, -1, 2/5, 1 Find q, given that -12q4 + 7060q*3 + 47444q*2 + 92748q + 42840 = 0. -3, -2/3, 595 Find a such that 5a2 + 650450a + 21154260125 = 0. -65045 Solve -i*4 + 766i*3 - 5317i*2 + 3024i + 9108 = 0. -1, 2, 6, 759 Suppose 2s2/3 + 902s/3 - 6280 = 0. What is s? -471, 20 Find j, given that -4j2 - 5016j - 1572516 = 0. -627 Let 2l2/3 - 107948l/3 + 35982 = 0. Calculate l. 1, 53973 Factor 2q3/17 - 624q*2/17 - 41238q/17 - 622340/17. 2(q - 370)(q + 29)2/17 What is h in h4/7 - 94h3 + 107577h*2/7 + 219780h/7 - 326700/7 = 0? -3, 1, 330 Factor -k*3 - 1895k*2 - 28226k - 48880. -(k + 2)(k + 13)(k + 1880) Factor -16s3 + 10560s*2 - 10548s + 2636. -4(s - 659)(2s - 1)2 Let 82g*3 + 9014g*2/5 - 132g/5 = 0. Calculate g. -22, 0, 3/205 Factor -m*3/2 - 613m*2/2 - 32332m - 32026. -(m + 1)(m + 134)(m + 478)/2 Factor -4y2 + 861980y. -4y(y - 215495) Find h, given that -6h5 + 171h*4 - 1470h*3 + 3825h*2 = 0. 0, 5, 17/2, 15 Suppose -3j*4/4 + 69j*3/2 - 675j*2/4 - 2199j - 1995 = 0. What is j? -5, -1, 14, 38 Suppose 5u2 + 2486285u = 0. Calculate u. -497257, 0 Suppose 12z3 + 3807732z*2 + 3807723z + 951930 = 0. What is z? -317310, -1/2 Determine x so that 5x2 - 58275x + 640420 = 0. 11, 11644 Factor -i*5 - 351i*4 + 33166i*3 - 987532i*2 + 11052600i - 30441632. -(i - 26)*3(i - 4)(i + 433) What is o in -4o*2 - 12152o - 9229444 = 0? -1519 Factor -11s2 + 2664s - 2653. -(s - 1)(11s - 2653) Factor -3125a3 + 244250a*2 - 39020a + 1560. -5(a - 78)(25a - 2)2 Factor -66z*5 - 134z*4 - 4z*3. -2z*3(z + 2)(33z + 1) Suppose -2z2/7 - 732z/7 - 58266/7 = 0. What is z? -249, -117 Let a*5/2 + 1157a*4/2 + 1153a*3/2 - 3469a*2/2 - 577a + 1156 = 0. Calculate a. -1156, -2, -1, 1 Factor -5m4 - 60910m*3 - 247375800m*2 - 335111588000m - 669234160000. -5(m + 2)(m + 4060)*3 Factor 2u*3 + 1428u*2 - 2u - 1428. 2(u - 1)(u + 1)(u + 714) Factor -5o*3 - 4700o*2 + 33115o - 28410. -5(o - 6)(o - 1)(o + 947) Solve -3k5/10 + k4/5 + 67k3/2 + 53k*2/5 - 44k = 0 for k. -10, -4/3, 0, 1, 11 Find v such that 2v2/13 - 13408v/13 + 13406/13 = 0. 1, 6703 Let -3u5/4 + 105u*4/4 + 51u*3/4 - 1677u*2/4 - 930u - 525 = 0. Calculate u. -2, -1, 5, 35 Factor -k*3/5 + 1842k*2/5 + 59968k/5. -k(k - 1874)(k + 32)/5 Determine o so that o*3 - 190o*2 - 11023o + 2553712 = 0. -112, 151 Let -z*3/7 + 2161z2/7 = 0. What is z? 0, 2161 Determine j so that j2/4 + 1497j/2 + 14945/4 = 0. -2989, -5 Factor c3/4 + 2167c*2/2 + 2166c. c(c + 2)(c + 4332)/4 Factor 4f2 + 53592f + 179506404. 4(f + 6699)2 Find p such that -4p*2/3 + 32956p/3 + 32960/3 = 0. -1, 8240 Find n such that -n*3 + 867n*2 + 9670n - 10536 = 0. -12, 1, 878 Suppose 4d5 - 64d*4 + 276d*3 - 376d*2 + 160d = 0. What is d? 0, 1, 4, 10 Find a such that 2a3 - 2342a*2 + 637670a + 28549950 = 0. -39, 605 Determine b so that -2b4 - 14b*3 + 54b*2 + 486b + 756 = 0. -7, -3, 6 Factor 2c2/5 + 66c/5 - 5992. 2(c - 107)(c + 140)/5 Determine n, given that 1527n4 + 164922n*3 + 4453380n*2 + 17496n = 0. -54, -2/509, 0 Factor -194k3 + 4072k*2 - 7330k - 76. -2(k - 19)(k - 2)(97k + 1) Factor -2b3 - 5126b*2 + 160712b - 300904. -2(b - 29)(b - 2)(b + 2594) Determine z, given that -4z*4/3 + 64z*3/3 - 12z*2 - 120z = 0. -2, 0, 3, 15 What is t in -t*3 + 6838t*2 + 82164t + 246600 = 0? -6, 6850 Solve 4q5 - 1448q*4 + 173184q*3 - 6830208q2 = 0 for q. 0, 98, 132 Determine r, given that r5 - 25r4 - 7r*3 + 169r*2 + 150r = 0. -2, -1, 0, 3, 25 Factor 5g3 + 9360g*2 + 18700g. 5g(g + 2)(g + 1870) Factor 2t*2 + 117458t - 234924. 2(t - 2)(t + 58731) Factor 2o2 + 17774o - 17776. 2(o - 1)(o + 8888) What is r in 2r3/9 - 1060r*2/9 - 10750r/9 - 3000 = 0? -5, 540 Determine p, given that 3p4/2 + 5949p*3/2 + 153273p*2/2 + 1228491p/2 + 1420782 = 0. -1957, -11, -4 Let -2j3 - 676j*2 + 678j = 0. What is j? -339, 0, 1 Determine j, given that -j*2/9 + 159293j/9 + 159296/3 = 0. -3, 159296 Find c such that 2c4/5 + 34c*3/5 - 16c*2/5 - 696c/5 + 1152/5 = 0. -16, -6, 2, 3 Factor -2d3/5 - 2316d*2/5 + 18624d/5 - 37312/5. -2(d - 4)2(d + 1166)/5 Let -4c2 + 2072c + 4160 = 0. Calculate c. -2, 520 Factor -y*4/3 + 133y*3 - 1564y*2 + 18640y/3 - 8256. -(y - 387)(y - 4)3/3 Determine f so that f2/6 + 6248f/3 = 0. -12496, 0 Solve -505y2 - 3495y + 280 = 0. -7, 8/101 Determine h, given that 4h4 - 1717h*3 + 182165h*2 + 138022h - 45864 = 0. -1, 1/4, 196, 234 What is t in 18t4/11 - 2752t*3/11 - 45696t*2/11 = 0? -136/9, 0, 168 Factor -3r*3 - 843r*2 + 12351r - 11505. -3(r - 13)(r - 1)(r + 295) Determine l so that -3l*5 - 102l*4 - 171l*3 + 660l*2 - 384l = 0. -32, -4, 0, 1 Determine g, given that 35g3/4 - 4225g*2/4 - 1370g - 305 = 0. -1, -2/7, 122 Factor x*3/2 - 21959x*2/2 + 120648175x/2 - 1084055625/2. (x - 10975)*2(x - 9)/2 Determine q, given that 3q5 - 8757q*4 - 17559q*3 + 96357q*2 + 105156q = 0. -4, -1, 0, 3, 2921 Solve 5k3 - 1550k*2 + 27945k - 87300 = 0 for k. 4, 15, 291 Factor 52i2 - 103188i - 166824. 4(i - 1986)(13i + 21) Factor 2n*2 - 17520n - 70112. 2(n - 8764)(n + 4) Let 3r2/5 + 1115508r/5 + 103696508172/5 = 0. Calculate r. -185918 Factor 3r2 - 327r - 13536. 3(r - 141)(r + 32) Suppose -4l3 + 196l*2 + 4228l - 4420 = 0. What is l? -17, 1, 65 Factor o*4 - 79634o*3 + 79628o*2 + 398162o + 238899. (o - 79633)(o - 3)(o + 1)*2 Factor 9228100332m*2 - 332772m + 3. 3(55462m - 1)*2 Factor 2h*2/7 - 704h + 19680/7. 2(h - 2460)(h - 4)/7 Suppose -72x4 - 97x*3/2 + 378x*2 + 787x/2 + 39 = 0. What is x? -2, -1, -1/9, 39/16 Find f, given that -25f4/2 + 1163f*3 - 54893f**2/2 +	{ "pile_set_name": "DM Mathematics" }
679 = -24i - 785. Let k be -5016/(-4). Let m = i + k. Let g(r) = -20r*3 - 6r*2 + 14. Calculate ml(v) - 5g(v). 2v*3 + 2v*2 Let y(t) = 13t + 7. Let u(g) = -22g - 11. What is -3u(q) - 5y(q)? q - 2 Suppose -4v - 6v - 108 = 2v. Let j(a) be the second derivative of -3a4/4 + 3a*3/2 + 4a. Let b(k) = -4k2 + 5k. Determine vb(m) + 5j(m). -9m2 Let m(a) = 16a*3 + 12a*2 + 52a + 1. Let v(d) = 35d3 + 26d*2 + 106d + 3. What is 13m(t) - 6v(t)? -2t3 + 40t - 5 Let r(m) = -38m2 - 2m - 38m2 + 84m*2 - 6m. Let v(s) = -3s2 - 40s - 18. Let h be v(-13). Let u(n) = -7n2 + 7n. Determine hu(w) - 4r(w). 3w2 - 3w Suppose 142v - 138 = -123v + 288v. Let k(m) = -38m. Let g(j) = -341j. What is vg(c) + 55k(c)? -44c Let g(i) = i3 - i2 - i. Suppose -13 = -239z + 229z + 7. Let l(q) = 2q2 + 23q + 2. Give zg(n) + l(n). 2n*3 + 21n + 2 Let j(d) = -d - 1. Let v(n) = -12n - 10. Let i(m) = -2m - 2m2 + 0m - 63m3 + m + 21m*3. Let p be i(-1). Let c = -39 + p. Calculate cv(o) - 22j(o). -2o + 2 Let y(z) = 6z + 2 - 4z + 5z - 6z. Let l = 375 - 381. Let a(j) = -7j - 13. Give la(o) - 39y(o). 3o Let g(f) = -f*3 + 5f*2 - 7f + 141. Let h be g(7). Let p(t) = -1. Let r(z) = -4z + 7. What is hp(i) - r(i)? 4i - 1 Let a be (-1)/(32/12). Let n(h) = -h*2 - 9h - 5. Let l(q) be the second derivative of q3/3 + q2/2 + 4q + 286. Calculate an(o) - 9l(o). 2o*2 + 1 Let r(w) = 4253w + 4240w + 20 - 4 + 12 - 8495w. Let o(g) = g + 1. What is 3o(u) + r(u)? u + 31 Suppose 14 = 2q + 4z, 4z - 15 = -4q + 1. Let d(g) = 11g - 3 + 6g2 - 11g. Let l(n) = 1. Calculate qd(p) + 3l(p). 6p2 Suppose -195a + 1944 = 129a. Let t(z) = -13z*3 - 8z*2 - 6z - 4. Let d(l) = -12l3 - 7l*2 - 5l - 3. Determine ad(x) - 5t(x). -7x3 - 2x2 + 2 Let a(m) be the second derivative of -m5/10 - 5m4/12 - 13m*3/6 + 7m*2/2 - 201m. Let d(c) = c*3 + 3c*2 + 7c - 4. Calculate -4a(i) - 7d(i). i3 - i2 + 3i Let p(v) = -v2 - 3v + 4. Let s(n) = n + 3. Let f be s(-6). Let i = -468 - -323. Let d = i - -137. Let o(g) = 3g2 + 8g - 12. Calculate dp(y) + fo(y). -y*2 + 4 Let u(h) = -4h*2 - 2h + 123. Let n(v) = 11v2 + 5v - 354. What is 6n(p) + 17u(p)? -2p2 - 4p - 33 Let y be (-22)/(-99) + 470/(-90). Let t(s) = -s - 1. Let b(r) = -3r2 - 5r - 5. Suppose 2q = 3 - 1. Give qb(u) + yt(u). -3u*2 Let n(f) = -5 + f - 4f + 8f - 4f. Let z(m) = -626m + 1200m - 3 - 573m. Let u = -10 + 0. Give uz(p) + 6n(p). -4p Let l(y) = 43y3 + 4y*2 + 2y - 40. Let r(u) = 2u2 + u + 1. Calculate -l(z) + 2r(z). -43z3 + 42 Suppose -5h - q - 86 = 0, -h + 30 - 46 = -q. Let r(n) = -2n - 7. Let m(o) = -3o - 2o + 0o - 20. Give hr(u) + 6m(u). 4u - 1 Let p(x) = -2x + 4. Suppose 5n + 35 = l, 19 = -5n + 2l - 21. Let v be (n/4)/(2/(-4)). Let b = -14326 + 14328. Let u(s) = 2s - 3. Calculate bp(r) + vu(r). 2r - 1 Let u(w) = -1004w*2 - 8w - 20. Let i(a) = -999a2 - 7a - 16. Give 5i(q) - 4u(q). -979q2 - 3q Let r(b) = -2b2 - 2b + 9. Let m(v) = -v*2 - 2v + 8. Let p be 1035/(-186) - 44/(-682) - (-2)/4. What is pm(k) + 4r(k)? -3k2 + 2k - 4 Let x(p) = 3 - 3p + 0p - 12p + 2. Let b(h) = 8h - 3. Calculate 5b(c) + 3x(c). -5c Let p(b) = -21b*2 - b - 7. Let f(a) = 32a*2 + a + 10. Let s be (-2 + (-308)/(-99))((-66)/(-12) - 1). Calculate sf(d) + 7p(d). 13d2 - 2d + 1 Let t(s) = -2s2 + 4. Let o(a) = -1. Let w be -106/15-1. Let v(k) = -34k*2 + 6k + 4. Let n be v(-1). Let f be 189/n + 1/w. What is fo(l) - t(l)? 2l2 + 1 Let f(y) = y2 - 1. Let o(m) = -111m2 + 20m - 4. Let w(a) = 314a2 - 57a + 11. Let t(z) = -17o(z) - 6w(z). Give 2f(g) + t(g). 5g*2 + 2g Suppose -4y - 19 = -5o, -3y + 184o = 189o - 12. Let j(t) = 5t*3 - 4t - 5. Let k(q) = -q3 - q2 + q + 1. What is yj(m) - 4k(m)? -m*3 + 4m*2 + 1 Let b(l) = -17l - 294. Let u(x) = -3x - 10. What is b(d) - 6u(d)? d - 234 Suppose -g = -9g + 352. Let u(o) = 2o*3 + 3o + 3. Let d(i) = -22 - 22i + 1472i*2 - 14i*3 - 1472i*2. Calculate gu(k) + 6d(k). 4k*3 Let t(j) = 3j*3 + 3j*2 + 26j + 9. Let v(z) = 3z3 + 4z*2 + 28z + 10. What is -4t(h) + 3v(h)? -3h3 - 20h - 6 Let t(f) = 3f3 + 904f*2 + 22f - 26. Let w(o) = -2o3 - 542o*2 - 13o + 16. Give -8t(x) - 13w(x). 2x3 - 186x*2 - 7x Let d(p) = -29p2 + 2p. Let u(a) = -4146a2 + 290a + 65. Let v(b) = 72558b2 - 5075b - 1131. Let r(q) = -87u(q) - 5v(q). Determine 145d(l) - 2r(l). -29l2 Let n(q) = -104q*3 + 10q*2 - 7q + 5. Let z(v) = 34v3 - 3v*2 + 2v - 1. Determine 2n(f) + 7z(f). 30f3 - f2 + 3 Suppose 0 = 95j - 96j + 161. Suppose 0 = -5l - 4r + j, 4r + 147 = 4l + 47. Let y(i) = 9i + 21i - li. Let p(t) = 5t - 2. Give -p(c) + 3y(c). -2c + 2 Let o(n) = 5n - 14. Let j(f) = f + 3. Let m(w) be the third derivative of -w*4/12 - 17w*3/6 + 152w*2. Let l(s) = -4j(s) - m(s). Give 8l(b) + 3o(b). -b - 2 Let z(y) = -2y + 142 + y - 146. Let t be (-376)/(-40) - ((-13)/5 - -3). Let b(n) = 5n + 17. Give tz(d) + 2b(d). d - 2 Let i(f) be the second derivative of 1/20f5 + 1/2f*4 - 69f + 0 + f*3 - 3f2. Let b(l) = -l3 - 13l2 - 13l + 13. Calculate 6b(g) + 13i(g). 7g3 Suppose -2r - 4 = -4r. Let j(c) = c - 10c + 1 + r. Let u(k) be the second derivative of k3/6 - k2/2 + 114759k. Determine -j(f) - 3u(f). 6f Let k(j) = 66j*3 - 44j + 44. Let d(a) = a*3 - a + 1. Let y = 4730 + -4731. Determine yk(w) + 44d(w). -22w*3 Let i(j) = 3j*2 - 5j + 2. Let c(u) be the second derivative of 0 - 2/3u3 + 1/2u*2 + 62u + 1/6u4. Give 5c(b) - 4i(b). -2b*2 - 3 Let y(g) be the first derivative of -3g*2/2 + 14g + 87. Let z be y(5). Let q(v) = -v3 - v + 1. Let b(i) = i3 + 3i - 1. Determine zb(d) - 3q(d). 2d*3 - 2 Let d = 7285 - 7278. Let g(y) = -15y*3 + 2. Let t(w) = -8w*3 + 1. Calculate dt(r) - 4g(r). 4r*3 - 1 Let a(k) = 2k*3 + 144k*2 + 21. Let w(f) = -2f*3 - 143f*2 - 24. Give -3a(j) - 2w(j). -2j*3 - 146j*2 - 15 Let x(p) = 4p*3 - 3p*2. Let i(o) = 6o*3 - 4o*2 - o. Determine 3i(q) - 4x(q). 2q*3 - 3q Let r(d) = 462d2 - d - 2. Let b(v) = v2. Give -4b(m) + r(m). 458m2 - m - 2 Let y(a) = -3a*2 - 51a + 1. Let j(k) = -12k2 - 200k + 4. Let x(p) = -6j(p) + 22y(p). Let d(q) = 2q2 + 26q - 1. What is 8d(z) - 3x(z)? -2z2 - 26z - 2 Let x(b) = 2b + 6. Let d(f) = -9f*2 - 26f + 210. Calculate -d(m) - 13x(m). 9m*2 - 288 Suppose 0 = -4u - v - 28, -2 = -4738u + 4741u - 4v. Let k(b) = 13b - 7. Let y(w) = -38w + 20. What is uy(o) - 17k(o)? 7o - 1 Let p(a) = 41a3 - 3a*2 + 2a + 2. Let g be p(1). Suppose -g = 9x - 60. Let v(k) = -k2 + k + 1. Let c(i) = 8i*2 - 8i - 8. Give xc(y) + 14v(y). 2y2 - 2y - 2 Let z(r) = 57r2 + 6r - 365. Let p(d) = 19d2 + 2d - 127. Give -17p(f) + 6z(f). 19f2 + 2f - 31 Let l(d) = 2321d3 - 3d. Let f(m) = -1791810m3 + 2315m. Calculate -3f(y) - 2315l(y). 2315y3 Let i(p) = -70p*2 - 20p + 7. Let d(c) = -19c2 - 5c + 2. Calculate 22d(h) - 6i(h). 2h2 + 10h + 2 Let c(l) = -145l + 3. Let r(g) = -857g + 19. Give 13c(q) - 2r(q). -171q + 1 Let l be (25 - 64/4) + (-21)/3. Let h(a) = -a + 1. Let u(m) = 10m - 9. Calculate lu(r) + 22h(r). -2r + 4 Let h(j) = 2524j - 258. Let o(q) = -2q + 26. What is -h(m) - 10o(m)? -2504m - 2 Let w(y) = -4y + 1. Let r be (-2 + 3/1 + -2)-3. Suppose 2z = rx + z - 6, -5z + 18 = x. Suppose 2u + xu = 5. Let a(t) = t. Give uw(c) + 5a(c). c + 1 Let s(m) = 4m - 11. Let v(u) = 5599 - 9u - 1867 - 1855 - 1854. Give 7s(c) + 3v(c). c - 8 Let x(p) = -10p3 - 6p - 3. Let r(i) be the first derivative of -1/2i2 + 0i - 80 - 1/4i4 + 0i*3. Determine 6r(t) - x(t). 4t3 + 3 Let h(d) = -6d*2 + 4d + 5. Let g(t) = -t - 1. Let o = -3085 + 3090. Calculate og(y) + h(y). -6y*2 - y Let r(c) = -13c*2 - 2c - 6. Suppose t + 87 = -f + 84, -f - 4t = 21. Let l(z) = -25z*2 - 4z - 11. What is fl(j) - 5r(j)? -10j2 - 2j - 3 Let n(t) = 55t2 + 101t - 66. Let k(i) = -18i2 - 34i + 24. Calculate -11k(f) - 4n(f). -22f*	{ "pile_set_name": "DM Mathematics" }
the least common multiple of 1815 and 1155? 12705 What is the least common multiple of 2436 and 126? 7308 What is the least common multiple of 25 and 2695? 13475 Calculate the lowest common multiple of 4 and 184. 184 Find the common denominator of -59/114 and -37/2. 114 Calculate the smallest common multiple of 990 and 8. 3960 What is the common denominator of -89/666 and -62/111? 666 What is the common denominator of -70/9 and 91/32? 288 Calculate the common denominator of 121/588 and 45/32. 4704 What is the common denominator of -151/6 and 7/10348? 31044 Calculate the common denominator of -109/72 and 49/24. 72 What is the least common multiple of 30 and 590? 1770 Calculate the lowest common multiple of 341 and 649. 20119 Calculate the smallest common multiple of 20 and 44. 220 What is the common denominator of -16/33 and -67/369? 4059 What is the common denominator of -32/1507 and -13/1233? 13563 Calculate the lowest common multiple of 10108 and 4332. 30324 What is the common denominator of -107/20 and 1/72? 360 Calculate the least common multiple of 135 and 10638. 53190 Calculate the least common multiple of 2487 and 75. 62175 What is the smallest common multiple of 480 and 60? 480 What is the smallest common multiple of 5380 and 269? 5380 Calculate the common denominator of 19/15610 and 30/10927. 109270 What is the lowest common multiple of 640 and 200? 3200 Find the common denominator of 31/54 and 4/207. 1242 Calculate the common denominator of -49/36 and 125/72. 72 What is the common denominator of 65/12 and -157/5934? 11868 Calculate the least common multiple of 371 and 21. 1113 What is the least common multiple of 384 and 84? 2688 What is the smallest common multiple of 147 and 24? 1176 What is the smallest common multiple of 90 and 45? 90 What is the least common multiple of 648 and 648? 648 Calculate the smallest common multiple of 33 and 19. 627 What is the common denominator of -139/36 and -79/516? 1548 What is the lowest common multiple of 25 and 640? 3200 Calculate the common denominator of 121/40 and 63/32. 160 Find the common denominator of -29/165 and 181/60. 660 What is the smallest common multiple of 1100 and 8? 2200 Calculate the smallest common multiple of 2 and 90. 90 What is the smallest common multiple of 22 and 202? 2222 Calculate the common denominator of -69/10 and -59/744. 3720 What is the common denominator of 101/286 and -42/11? 286 What is the common denominator of -127/438 and 53/657? 1314 Calculate the common denominator of 41/114 and -61/60. 1140 What is the least common multiple of 40 and 28? 280 Calculate the common denominator of -93/74 and 103/24. 888 Calculate the lowest common multiple of 10 and 1412. 7060 Calculate the least common multiple of 8 and 13924. 27848 Find the common denominator of -97/362 and 57/16. 2896 Calculate the lowest common multiple of 6 and 369. 738 What is the common denominator of -49/296 and 79/16? 592 Calculate the common denominator of -71/80 and -43/40. 80 Calculate the common denominator of -49/10 and 89/16. 80 What is the lowest common multiple of 1898 and 5? 9490 What is the lowest common multiple of 232 and 261? 2088 Find the common denominator of -5/84 and 16/33. 924 What is the common denominator of -30/7 and -1/9? 63 Find the common denominator of -17/209 and 17/114. 1254 Calculate the smallest common multiple of 179 and 7160. 7160 Find the common denominator of 77/45 and -103/270. 270 What is the smallest common multiple of 192 and 54? 1728 Calculate the smallest common multiple of 36 and 1440. 1440 What is the least common multiple of 1887 and 10? 18870 What is the smallest common multiple of 2 and 1? 2 Calculate the least common multiple of 75 and 125. 375 What is the common denominator of -3/20 and 69/80? 80 What is the least common multiple of 10 and 8035? 16070 What is the common denominator of 113/4116 and -87/2744? 8232 What is the least common multiple of 20 and 48? 240 What is the common denominator of 25/56 and 59/56? 56 Calculate the common denominator of 41/2325 and -61/93. 2325 Calculate the common denominator of 151/174 and -53/464. 1392 What is the smallest common multiple of 1596 and 49? 11172 What is the common denominator of -47/16 and -121/1206? 9648 Find the common denominator of -77/370 and 125/666. 3330 Calculate the common denominator of -157/84 and 49/12. 84 What is the smallest common multiple of 20 and 2762? 27620 Calculate the lowest common multiple of 30 and 20. 60 What is the smallest common multiple of 404 and 4? 404 What is the lowest common multiple of 40 and 275? 2200 Find the common denominator of 35/52 and 59/54. 1404 Calculate the common denominator of -19/350 and -17/140. 700 What is the lowest common multiple of 3 and 1? 3 What is the smallest common multiple of 28 and 168? 168 Calculate the lowest common multiple of 105 and 165. 1155 What is the least common multiple of 128 and 56? 896 What is the common denominator of 4/369 and -89/1230? 3690 What is the common denominator of -151/156 and -37/520? 1560 Calculate the common denominator of -139/390 and -89/12. 780 Calculate the common denominator of 137/12 and -83/2. 12 What is the lowest common multiple of 168 and 1920? 13440 Calculate the least common multiple of 14 and 1190. 1190 What is the smallest common multiple of 1309 and 35? 6545 Calculate the common denominator of 11/18 and 21/152. 1368 Calculate the common denominator of 49/48 and -5/84. 336 Calculate the lowest common multiple of 10 and 106. 530 What is the smallest common multiple of 21 and 24? 168 Calculate the smallest common multiple of 9 and 789. 2367 What is the lowest common multiple of 2628 and 10? 13140 What is the least common multiple of 40 and 75? 600 What is the common denominator of 10/13 and -83/705? 9165 What is the lowest common multiple of 598 and 39? 1794 Find the common denominator of 41/45 and -77/20. 180 What is the common denominator of -121/230 and -121/280? 6440 What is the smallest common multiple of 1840 and 690? 5520 What is the smallest common multiple of 12 and 2? 12 What is the least common multiple of 6 and 2? 6 Calculate the common denominator of 79/36 and -85/92. 828 Find the common denominator of 1/5740 and -37/35. 5740 What is the common denominator of -123/920 and -45/16? 1840 Calculate the lowest common multiple of 121 and 5. 605 Calculate the smallest common multiple of 1 and 272. 272 Find the common denominator of 5/22 and 89/828. 9108 What is the least common multiple of 17 and 34? 34 What is the least common multiple of 160 and 64? 320 Calculate the common denominator of -21/544 and 117/680. 2720 What is the lowest common multiple of 160 and 80? 160 What is the smallest common multiple of 140 and 70? 140 Calculate the smallest common multiple of 72 and 36. 72 Calculate the common denominator of -61/648 and -59/36. 648 Calculate the common denominator of 131/560 and -53/70. 560 What is the common denominator of -40/3 and 35/418? 1254 What is the least common multiple of 2223 and 936? 17784 Calculate the common denominator of 52/3 and 89/2. 6 Find the common denominator of -23/3 and 71/10184. 30552 Calculate the common denominator of 131/42 and -59/378. 378 Calculate the common denominator of -34/35 and -79/75. 525 What is the common denominator of 21/22 and -125/138? 1518 What is the lowest common multiple of 27 and 18? 54 What is the common denominator of 43/738 and -19/16? 5904 What is the common denominator of 7/50 and 53/20? 100 What is the common denominator of 41/668 and 61/36? 6012 What is the least common multiple of 1090 and 1417? 14170 What is the lowest common multiple of 90 and 210? 630 What is the lowest common multiple of 24 and 17616? 17616 What is the common denominator of -59/30 and -131/110? 330 What is the common denominator of -97/22 and -19/20? 220 What is the common denominator of 13/176 and 35/176? 176 What is the least common multiple of 975 and 145? 28275 Calculate the lowest common multiple of 44 and 48. 528 Calculate the common denominator of -1/20 and 29/156. 780 Calculate the least common multiple of 1035 and 230. 2070 Calculate the common denominator of -49/2662 and -103/726. 7986 What is the common denominator of -82/21 and 157/1380? 9660 Ca	{ "pile_set_name": "DM Mathematics" }
) = 2k2 + 4k + 1. Determine ms(i) + 4y(i). -2i2 - 1 Let p(n) = 12n + 9. Suppose -8d - 4 = -4d. Let g = d + 3. Let v(s) = -3s - 2. Give gp(j) + 9v(j). -3j Let z(u) = 8u2 + 2u - 6u - 2u*3 + 3 - 10u*2. Let i(k) = -k - k - k + 2k + 1. Calculate 4i(s) - z(s). 2s*3 + 2s*2 + 1 Let s(n) = 9n*3 + 11n*2 - 20. Let r(q) = 4q*3 + 5q*2 - 10. What is -7r(c) + 3s(c)? -c3 - 2c*2 + 10 Let p(s) = 3s2 - s - 5. Let i(w) be the third derivative of -w5/60 + w*3/6 - 25w*2. Calculate -5i(f) - p(f). 2f2 + f Let b(m) = 2 - m2 - 6m*2 + 2m - 7m3 + m2. Let r(i) = i3 + i2. Determine b(y) + 6r(y). -y*3 + 2y + 2 Let z(c) = 26c2 - 3c + 2. Let g(v) = 77v2 - 10v + 6. Determine -2g(q) + 7z(q). 28q2 - q + 2 Let c(w) = 6 + 6w - 4 + 0 - 3. Let o(k) = -7k + 1. Suppose 2s = 3s + 4. What is so(b) - 5c(b)? -2b + 1 Let s(b) = 1 + 98b + 95b - 191b. Let i(h) = -h - 2. Give 3i(a) + 4s(a). 5a - 2 Let z(m) = 2m2 + 5m + 5. Let a(s) be the first derivative of 2/3s3 + 4s + 2s2 - 4. What is -5a(p) + 4z(p)? -2p*2 Suppose 0 = s - 2j + 14, -4s + 3s + 5j = 26. Let t(z) = -z2 - 7z2 + 1 + 4. Let v(u) = 3 - u2 + 0 - 2. What is sv(p) + t(p)? -2p*2 - 1 Let p(m) = -2m*3 + 5m*2 - 3m + 2. Let w(b) = -3b3 + 9b*2 - 5b + 4. Suppose -4n - 18 = -2l, 0 = n - 5l + 18. Calculate nw(j) + 5p(j). -j3 - 2j*2 - 2 Let z(w) = -11w - 8. Let y(p) be the second derivative of 2p3/3 + 3p*2/2 - 8p. What is -8y(b) - 3z(b)? b Let a(t) = 6t - 2. Let q(l) = 5l - 2. Determine -2a(v) + 3q(v). 3v - 2 Let l be 230/50 + 3/(-5). Let v(u) = -13u - 6 - lu2 + 5 - 6. Suppose -2z - z = 6. Let a(n) = n*2 + 4n + 2. Give zv(k) - 7a(k). k*2 - 2k Let k(x) = 391x3 + 46x*2 - 46x + 46. Let c(u) = -26u3 - 3u*2 + 3u - 3. Determine 46c(j) + 3k(j). -23j3 Let p(r) = -57r*3 + 171r*2 + 171r + 171. Let q(b) = b*2 + b + 1. Calculate p(c) - 171q(c). -57c3 Let g(m) = 7m3 - m2 - 2. Let v(p) = -p3 + p2. Determine g(s) + 2v(s). 5s3 + s2 - 2 Let o(f) = 39f2 - 27f + 27. Let q(k) = 1. Let z(p) = -3p2 + 2p - 8. Let u(y) = -6q(y) - z(y). Determine -2o(i) + 27u(i). 3i*2 Let k(f) = 6f - 9. Let l(j) = -3j + 4. Determine 4k(a) + 9l(a). -3a Let o(p) = p*3 - 2p*2 - 2. Let f(l) = -2l*3 + 3l*2 + 3. Let b = 19 + -22. Calculate bo(d) - 2f(d). d3 Let k(h) = -h2 + 5h - 3. Let o be -13/(-6)0. Suppose -2g + og = -28. Suppose 4d + g = -6. Let c(n) = -2n*2 + 8n - 5. Give dc(j) + 8k(j). 2j2 + 1 Let l(s) = -53s - 2. Let w(z) = 79z + 3. Give -7l(f) - 5w(f). -24f - 1 Let b(f) = -f*2. Let n(h) = 3h*2 - 17h + 2. Determine -2b(i) - n(i). -i2 + 17i - 2 Let x(i) = -2i2 - 6i - 4. Let l(z) = -z*2 + 2z + 2 - 3z - 3. Let j(m) = -m - 2. Let g be j(-1). Calculate gx(d) + 4l(d). -2d*2 + 2d Let m = 71 - 62. Let r(f) = -3f3 + 2f*2 + 2f. Let x(a) = -11a3 + 9a*2 + 9a. What is mr(w) - 2x(w)? -5w3 Let r(z) be the second derivative of -2z*4/3 + 4z*3/3 + 13z*2/2 + z. Let j(p) = -2p*2 + 2p + 3. Give -9j(k) + 2r(k). 2k2 - 2k - 1 Let b(h) = -2h3 + h2 - 2h + 1. Let x(a) = a*3 + a + 1. Give -b(y) - 3x(y). -y3 - y2 - y - 4 Let i(b) = b. Let h(z) be the first derivative of -3z2/2 + 1. Suppose 0 = 12k - 56 - 16. Calculate kh(y) + 17i(y). -y Let b(d) = -2d2 - 4d + 3. Let k be (2/(-4))/((-2)/12). Let n(y) = 4y2 + 4y - 4. Let r(q) = q*2 + q - 1. Let c(x) = n(x) - 3r(x). Give kc(s) + b(s). s2 - s Let m(c) be the first derivative of -c4/4 + c3 - c2/2 - 3c + 7. Let s(j) = j*3 - 5j*2 + 2j + 5. Calculate 5m(w) + 3s(w). -2w3 + w Let i(u) = -4u*2 - 3u + 4. Let n be i(1). Let t(a) = -1 + 0a - 2a + 0. Let d(f) = f + 1. What is nt(r) - 4d(r)? 2r - 1 Let z(k) = -25k + 30. Let h(q) = -q + 1. Suppose 2 = 2j - 0. Give jz(o) - 30h(o). 5o Let z(c) be the first derivative of -2c3 - 1/4c*4 + 0c - 3c2 - 9. Let n(w) = 2w*3 + 13w*2 + 13w. Calculate -6n(o) - 13z(o). o*3 Let j(s) = -9s*2 - 6s - 6. Let a be (-10)/85 - (-166)/(-34). Let w(q) = 8q2 + 5q + 5. Give aj(k) - 6w(k). -3k2 Let d(j) = 2j*3 + 3j*2 + 2j + 3. Let b(n) = -n2 + n3 - 2n2 - 1 - n - 2n*3 + 2n*2. Calculate -3b(p) - d(p). p*3 + p Let h(o) = 3o*3 + 15o*2 - 15o. Let d(f) = -f*3 - 4f*2 + 4f. Give 15d(g) + 4h(g). -3g3 Suppose -9 = -4l + 11. Let v(h) = -17h + 10h + 5h + l. Let m(b) = b - 1. Give 5m(t) + v(t). 3t Let v(z) = -16z*2 - 7z - 7. Let t(i) = -5i2 - 2i - 2. Determine -14t(y) + 4v(y). 6y2 Let v(q) = q - 1. Let l(z) be the third derivative of z6/60 + 11z*4/24 - 11z*3/6 + 22z*2. Calculate -2l(i) + 22v(i). -4i*3 Let k(f) = -3f*3 + 4f*2 + 4f - 4. Let z(m) = 0m3 - 5m*2 - 8m - m*3 + 4m*3 + 3m + 5. Calculate 5k(n) + 4z(n). -3n3 Let g(d) = d3 + 2. Let x(q) = 3q*3 + 3. Give 5g(t) - 2x(t). -t3 + 4 Let y(t) = 4t - 14. Let o(x) = -3x + 13. What is 5o(m) + 4y(m)? m + 9 Let o(l) = -l2 - l + 1. Let x(q) = -3q*3 + 12q*2 + 12q - 12. Let f = 160 + -148. Give fo(p) + x(p). -3p*3 Suppose -6 = b + 2b. Let h be -3 - ((b - 8) + 2). Suppose -1 = -2s + p, hp - 10 = 6s - s. Let i(w) = w - 2. Let r(u) = 2u - 3. Calculate sr(c) - 4i(c). 2c - 1 Let f(h) = 3h*3 + 5h*2 - 9h - 5. Let q(c) = c*3 + 2c*2 - 4c - 2. Give -2f(g) + 5q(g). -g*3 - 2g Let l(k) = 2k2 - 3k - 3. Let g(q) = 2q2 - 4q - 3. What is -2g(p) + 3l(p)? 2p2 - p - 3 Let p(q) = 7q*2 - 3q + 7. Let a(o) be the first derivative of -o3 + o2/2 - 3o + 11. What is -10a(z) - 4p(z)? 2z*2 + 2z + 2 Let c(w) be the first derivative of -1 - 4w + 9/2w*2. Let y(b) = 4b - 2. Suppose -h - 3 = -0h. Give hc(f) + 7y(f). f - 2 Let y(f) = -f3 - f - 1. Let u(o) = 3o*3 + 2. Let r(k) = -u(k) - 2y(k). Let l(w) = -2w3 + 5w. Give 2l(d) - 5r(d). d*3 Let w(c) = 5c*2 - 4c - 16. Let u(d) = -d*2 + d + 3. What is 11u(a) + 2w(a)? -a2 + 3a + 1 Let h(d) = -12d. Let a(i) = -13i. What is 3a(q) - 2h(q)? -15q Let l(r) = r. Suppose 2p + 2k + 28 = -2p, -2p = 4k + 26. Let s = p - -6. Let w(h) = h - 1. Calculate sw(z) - 3l(z). -2z - 1 Let n(f) = 676f*2 - 4 - 671f*2 - 2 - 6f. Let s(g) = 11g2 - 13g - 13. Let p be (-9)/(-1)(-4)/(-6). Determine ps(v) - 13n(v). v2 Let o = -1 + 0. Let b(i) = 16i + 10. Let x(l) = -l - 1. Let u(a) = ob(a) - 6x(a). Let d(r) = -3r - 1. Let y = 54 + -52. Calculate yu(v) - 7d(v). v - 1 Let u(w) = -101w*2. Let a(f) = -405f*2. Give -2a(p) + 9u(p). -99p*2 Let h(m) = 0 - 5m + 4 - 3m2 + 0. Let y(a) = 4a*2 + 6a - 5. Determine -5h(d) - 4y(d). -d*2 + d Let z(i) = -2i2 - i - 5. Let n(t) = t2 + t - 3. Let d(j) = -2j - j2 + 3j*2 - 1 + 4j - 6. Let o(u) = -6d(u) + 13n(u). What is -5o(g) - 3z(g)? g*2 - 2g Let r(p) = p*2 - 3p + 24. Let t(a) = -2a2 + 4a - 25. Determine 4r(g) + 3t(g). -2g2 + 21 Suppose -5j = 2 + 18. Let d(g) = -7g - 1. Let q(l) = -8l - 1. What is jq(s) + 5d(s)? -3s - 1 Let j(a) = a2 - 4a + 2. Let u(r) = 4r2 - 11r + 5. Calculate 11j(m) - 4u(m). -5m2 + 2 Let n(q) = -1. Let g(l) = -5l - 6. Let u(r) = -r*2 + 4r - 1. Let c be u(5). Let i(y) = cn(y) + g(y). Let m(a) = 9a. What is 7i(t) + 4m(t)? t Let b(m) = 3m. Let u(k) = 7k. Let x(g) = -9b(g) + 4u(g). Let j(v) = -9v - 1. Calculate -j(c) - 6x(c). 3c + 1 Let u(w) = -13w3 + w2 + 13. Let f(c) = c*2 + 1. Let l(o) = -42f(o) + 6u(o). Let d(j) = 11j*3 + 5j*2 - 5. Calculate -36d(a) - 5l(a). -6a3 Let w(m) = -m2 + m + 2. Let k(n) = 2n2 - 2n - 4. Suppose -2d + 5d = 5t + 13, -2t + 4d = -6. Give tw(g) - 3k(g). -g2 + g + 2 Let z(a) = -2a*3 + 5a*2 - 3a + 2. Let p(c) = 4c3 - 11c*2 + 6c - 5. Calculate -2p(x) - 5z(x). 2x3 - 3x*2 + 3x Let k(t) = 1. Let j(v) = -v - 15. Give j(g) + 4k(g). -g - 11 Let f(s) = -3s + 6. Let l = -9 - -4. Let n(m) = -2m + 4. Give lf(g) + 7n(g). g - 2 Let a(f) = -273f*3 - 27f*2 + 27f - 27. Let k(m) = -39m3 - 4m*2 + 4m - 4. Calculate -4a(q) + 27k(q). 39q3 Suppose 0 = 2h - 2. Let f(o) be the second derivative of -o*3/6 - 2o. Let c(y) = 6 - 2 - 5 - y. Calculate h*	{ "pile_set_name": "DM Mathematics" }
1 f, and 1 t when three letters picked without replacement from mtuuntttfoouutt. 24/455 Calculate prob of picking 1 l and 1 i when two letters picked without replacement from {l: 1, i: 2, r: 2, d: 5, o: 2, k: 1}. 1/39 What is prob of picking 4 p when four letters picked without replacement from pppemppppppppppp? 11/20 Calculate prob of picking 1 v and 2 u when three letters picked without replacement from uuvv. 1/2 Four letters picked without replacement from {o: 1, d: 5, b: 5, a: 1, s: 4}. What is prob of picking 1 o, 1 d, 1 a, and 1 s? 1/91 Calculate prob of picking 2 c when two letters picked without replacement from {j: 2, c: 8}. 28/45 Three letters picked without replacement from rrrrrrr. What is prob of picking 3 r? 1 Three letters picked without replacement from {k: 5, e: 11, m: 1}. Give prob of picking 1 m and 2 e. 11/136 Calculate prob of picking 1 y and 2 k when three letters picked without replacement from {q: 1, h: 1, k: 4, y: 4}. 1/5 Four letters picked without replacement from {c: 3, m: 1, d: 4}. What is prob of picking 1 d, 1 m, and 2 c? 6/35 Four letters picked without replacement from {d: 2, c: 3, i: 2, z: 3, a: 3}. What is prob of picking 1 z, 2 d, and 1 c? 9/715 Two letters picked without replacement from {p: 1, l: 2, v: 1}. Give prob of picking 1 l and 1 p. 1/3 Three letters picked without replacement from {o: 2, q: 3, d: 5}. What is prob of picking 1 d and 2 q? 1/8 What is prob of picking 1 r and 1 p when two letters picked without replacement from {s: 1, p: 1, z: 2, u: 3, r: 4}? 4/55 Calculate prob of picking 3 q and 1 h when four letters picked without replacement from qqhyqyqyyqqqy. 7/143 Four letters picked without replacement from {q: 7, g: 5}. Give prob of picking 2 g and 2 q. 14/33 What is prob of picking 1 v, 2 e, and 1 r when four letters picked without replacement from {g: 3, e: 2, r: 1, k: 4, v: 1, l: 1}? 1/495 Two letters picked without replacement from {y: 1, b: 2, f: 1, w: 10}. Give prob of picking 1 y and 1 w. 10/91 What is prob of picking 2 r when two letters picked without replacement from {x: 9, r: 7}? 7/40 Three letters picked without replacement from {b: 6, y: 6}. What is prob of picking 3 b? 1/11 What is prob of picking 1 c and 3 y when four letters picked without replacement from yyyycyyc? 4/7 Calculate prob of picking 1 h and 1 v when two letters picked without replacement from vihiiiwiww. 1/45 Calculate prob of picking 2 i when two letters picked without replacement from hgwiihghh. 1/36 Three letters picked without replacement from oojjhaoohjh. What is prob of picking 2 o and 1 h? 6/55 Calculate prob of picking 1 t and 2 b when three letters picked without replacement from bhzdhczttttbtzddhdzh. 1/228 Calculate prob of picking 2 d and 1 f when three letters picked without replacement from {d: 6, f: 3, v: 3, w: 5}. 9/136 Four letters picked without replacement from {h: 7, z: 5}. Give prob of picking 3 z and 1 h. 14/99 Calculate prob of picking 1 x, 1 f, 1 r, and 1 u when four letters picked without replacement from ssrfxxxuursusxsrrx. 1/51 Calculate prob of picking 4 h when four letters picked without replacement from {h: 4}. 1 Calculate prob of picking 4 f when four letters picked without replacement from {r: 3, p: 4, l: 5, f: 4}. 1/1820 Two letters picked without replacement from {m: 3, c: 15}. Give prob of picking 1 c and 1 m. 5/17 What is prob of picking 1 s and 3 f when four letters picked without replacement from sfffffffffffffffffff? 1/5 What is prob of picking 3 d when three letters picked without replacement from {v: 1, h: 2, p: 9, d: 4}? 1/140 Calculate prob of picking 2 a and 1 x when three letters picked without replacement from {c: 3, a: 6, x: 1, t: 5, m: 3}. 5/272 Two letters picked without replacement from {d: 11, x: 3}. Give prob of picking 1 d and 1 x. 33/91 Two letters picked without replacement from smnsnss. Give prob of picking 1 s and 1 m. 4/21 Three letters picked without replacement from {k: 4, m: 5, r: 3, g: 1}. What is prob of picking 3 r? 1/286 What is prob of picking 1 a and 1 u when two letters picked without replacement from {a: 2, u: 1}? 2/3 Calculate prob of picking 2 f when two letters picked without replacement from {f: 2, w: 3, q: 2, p: 13}. 1/190 Calculate prob of picking 2 o when two letters picked without replacement from nonooon. 2/7 Calculate prob of picking 1 o and 1 d when two letters picked without replacement from {d: 5, o: 1, l: 1, b: 12}. 5/171 Four letters picked without replacement from {f: 1, l: 3, y: 6, j: 5}. What is prob of picking 1 f, 1 l, and 2 j? 2/91 Two letters picked without replacement from pipieoptpoikpieit. Give prob of picking 1 k and 1 o. 1/68 Two letters picked without replacement from {s: 1, e: 3, d: 2, q: 1, a: 4}. Give prob of picking 2 e. 3/55 Four letters picked without replacement from {u: 1, o: 1, i: 2, a: 2}. What is prob of picking 2 i, 1 u, and 1 o? 1/15 What is prob of picking 2 d when two letters picked without replacement from tdtttttdqtdtqwtqtwq? 1/57 Calculate prob of picking 2 i and 1 z when three letters picked without replacement from oofofoobbfwozbbiiifb. 1/380 Four letters picked without replacement from fnfnffn. Give prob of picking 4 n. 0 Calculate prob of picking 2 q when two letters picked without replacement from {q: 4, m: 3}. 2/7 Three letters picked without replacement from gaamaswwgemw. Give prob of picking 1 s and 2 m. 1/220 Calculate prob of picking 2 r when two letters picked without replacement from {r: 11, k: 5}. 11/24 Three letters picked without replacement from {j: 2, y: 2, m: 1, w: 2, z: 1}. What is prob of picking 2 y and 1 m? 1/56 Four letters picked without replacement from bbboqoqbqqoqboqbobq. Give prob of picking 4 q. 35/3876 What is prob of picking 1 l and 3 g when four letters picked without replacement from {l: 5, g: 11}? 165/364 Two letters picked without replacement from rrarrrrrrrrararrrr. What is prob of picking 2 r? 35/51 What is prob of picking 1 z and 1 p when two letters picked without replacement from {p: 1, z: 2, y: 1, f: 5, q: 1}? 2/45 Two letters picked without replacement from {p: 2, x: 1, f: 1, e: 2, c: 6}. What is prob of picking 1 c and 1 x? 1/11 Calculate prob of picking 1 y and 2 t when three letters picked without replacement from yytttttyttt. 28/55 What is prob of picking 2 f, 1 u, and 1 y when four letters picked without replacement from {y: 10, u: 2, f: 6}? 5/51 Calculate prob of picking 1 c and 1 h when two letters picked without replacement from hfwfhccwwhfcw. 3/26 Calculate prob of picking 2 o and 1 e when three letters picked without replacement from {x: 3, e: 1, s: 1, d: 3, w: 2, o: 2}. 1/220 Three letters picked without replacement from {n: 6, s: 10, a: 1}. What is prob of picking 1 n and 2 s? 27/68 Four letters picked without replacement from {r: 9, n: 3}. What is prob of picking 2 r and 2 n? 12/55 Calculate prob of picking 2 k and 1 q when three letters picked without replacement from {q: 9, k: 7}. 27/80 Calculate prob of picking 2 c and 2 v when four letters picked without replacement from {v: 2, c: 2, u: 9}. 1/715 Two letters picked without replacement from {s: 5, r: 2}. Give prob of picking 2 r. 1/21 Four letters picked without replacement from ecjeeeejee. Give prob of picking 1 j and 3 e. 1/3 Calculate prob of picking 3 q and 1 t when four letters picked without replacement from qqqqtqqqqqtq. 16/33 Two letters picked without replacement from {w: 2, h: 2, d: 6, b: 1, n: 1}. What is prob of picking 1 n and 1 w? 1/33 Three letters picked without replacement from dtvdvtdvvvgdt. What is prob of picking 2 d and 1 g? 3/143 Calculate prob of picking 2 h when two letters picked without replacement from {c: 2, h: 9}. 36/55 Calculate prob of picking 1 r and 2 d when three letters picked without replacement from {g: 4, d: 3, r: 6}. 9/143 Calculate prob of picking 2 r when two letters picked without replacement from {r: 13, s: 4, d: 3}. 39/95 Calculate prob of picking 1 t and 1 x when two letters picked without replacement from xrttrzrsttdrtxt. 4/35 Calculate prob of picking 1 o, 1 a, 1 d, and 1 e when four letters picked without replacement from edoooeoooawaaddaaoo. 20/323 Three letters picked without replacement from eaaunovuaevu. Give prob of picking 2 a and 1 e. 3/	{ "pile_set_name": "DM Mathematics" }
98 = -2x + l. Round x to the nearest one hundred thousand. -1300000 Let b = 30.767 - -3.103. Let z = -33.87002822 + b. What is z rounded to 6 dps? -0.000028 Let t = -17.4091673 + -88445.5878327. Let l = -88499 - t. Let b = l + 36. What is b rounded to 3 decimal places? -0.003 Let p = 573.2 - 642. Let t = 68.79999974 + p. Round t to 7 decimal places. -0.0000003 Let k = -2908272 - 1318728. What is k rounded to the nearest one hundred thousand? -4200000 Let c = -44923 + 227773. Let p = -281250 + c. Round p to the nearest ten thousand. -100000 Let n = -1.39110009336 + 1.3911. What is n rounded to seven decimal places? -0.0000001 Let f be (-5)/(-18 + -2) - 86/(-8). Suppose 2 = 13o - f. Suppose 7v - 4v + o = c, -4c + 31 = -3v. What is c rounded to the nearest 100? 0 Let p = 30.98030336 - 30.98. What is p rounded to six decimal places? 0.000303 Let j = 6.77 - -16.67. Let h = j + -8.151. Let z = h + -15.3. What is z rounded to 1 dp? 0 Suppose 2i + 5i = 35. Suppose -iu - 217290 = -0u + 2p, -u = 2p + 43450. Round u to the nearest ten thousand. -40000 Let o be (21/(-27))/(2/(-18)). Suppose -3l = 5t + 582, -2l + 12t - 363 = ot. What is l rounded to the nearest ten? -190 Let q = -613995210 + 613994435.998838. Let r = 774 + q. What is r rounded to four decimal places? -0.0012 Let d = -42625.000029145 + 42625. What is d rounded to seven decimal places? -0.0000291 Let d = -0.03132877 + 0.0144225. Let u = d - -0.0169. What is u rounded to seven decimal places? -0.0000063 Let m(i) be the first derivative of -2i*4 - 14i3/3 - i2 + 11i + 172. Let d be m(-4). What is d rounded to the nearest ten? 310 Let z = -2186.6 - -1574. What is z rounded to the nearest ten? -610 Let b = -161794 + 161792.08878. Round b to 1 dp. -1.9 Let a = 2.6345 - 2.6345225065. What is a rounded to seven dps? -0.0000225 Let z = 0.1174 - 0.0672. Let k = 1.7898 + z. Round k to zero dps. 2 Let m(v) be the third derivative of -125v*4/8 + 5v3/6 - v2. Suppose -85d - 18 = -27 - 76. Let l be m(d). What is l rounded to the nearest one hundred? -400 Let g = -0.178 - -0.331. Let h = 8 - 8.1696. Let b = h + g. What is b rounded to 3 dps? -0.017 Suppose -2f + 3r = -31, -4f = -5r - 21 - 44. Suppose 21a - 641000 = fa. Round a to the nearest 10000. 640000 Let y be (-2)/16 + (-3198)/16. Let c be y(8/(-8) - -31951). Round c to the nearest 1000000. -6000000 Let v = -7679 + 4229. Let n = -3450.2109 - v. Round n to one decimal place. -0.2 Let o = -0.06 + 0. Let m = -2728 - -2727.965. Let f = m + o. Round f to two dps. -0.1 Suppose 4o - 4i = 7901012, -4o + o = -5i - 5925757. Suppose o - 7728254 = -11w. What is w rounded to the nearest 10000? 520000 Let i be (-65195)/(-3) - 1 - 28/(-21) - 0. Round i to the nearest 1000. 22000 Let y = -80362984.99999488 - -80362878. Let k = -107 - y. Round k to seven dps. -0.0000051 Let d = -1678336 + 1678271.16221. Let c = d - 8.16711. Let l = 73 + c. Round l to 3 dps. -0.005 Suppose 35s + 5 = 30s. Let p be (29574/12)/(s/(-6)). Suppose -42213 = 3f + p. Round f to the nearest 10000. -20000 Let d = 260 - 260.0364. Let o = -0.03640809 - d. Round o to 6 dps. -0.000008 Let k = -15229 + 15232.8644. Round k to 1 decimal place. 3.9 Let w = 54.9913 - 55. Let c = w - -283.0087. Let a = 283.000179 - c. What is a rounded to five dps? 0.00018 Let c = 25032.3 - 29413. Round c to the nearest 1000. -4000 Let y = -6483 + 6482.75205. Round y to two dps. -0.25 Let w = 3.8795573 + -4.02865. Let z = 0.1492 + w. What is z rounded to 5 decimal places? 0.00011 Let x(u) = -2u2 - 101u + 58. Let o(m) = m*2 + 51m - 29. Let p(a) = -5o(a) - 3x(a). Let r be p(-21). What is r rounded to the nearest 10? -600 Let t = 2.8 - 4.6. Let l = 3.4463835 - 1.646389. Let p = l + t. What is p rounded to six dps? -0.000006 Let q = -73 + -86. Let n = q - -67. Let b = -91.999918 - n. Round b to five dps. 0.00008 Let f = 1545 + -1050. Let b = f + -495.0229. What is b rounded to 3 decimal places? -0.023 Let a(i) = i*2 - i - 1. Let j(v) = -9v*2 - 19v - 100. Let r(l) = -2a(l) - j(l). Let g be r(-14). Round g to the nearest one thousand. 1000 Let f = -0.27059 - 0.014182. What is f rounded to two dps? -0.28 Let l = -10592.8 - -12020. Round l to the nearest 100. 1400 Let x be 25/(-75)-1552(11 + 1). Suppose f - 5o + 589 = 4827, -4o = 8. Let l = f - x. What is l rounded to the nearest one thousand? -2000 Suppose 5f = 25, 5r = r - 3f + 15. Suppose -q = -rq. Suppose -3o = -g + 4g + 3329991, 3g - 4o + 3330012 = q. Round g to the nearest 100000. -1100000 Let u(g) = 12g - 53. Let n be u(5). Let j be 1410(n + 85/(-15)). Round j to the nearest 100. 1900 Let i = -124.67 - -0.67. Let x = i - -123.9708. What is x rounded to three dps? -0.029 Let p = 38.971 + -39. Let s = 5.111 - p. Round s to one dp. 5.1 Let j = 628.9556 + 0.0444. Let g = -618.9 + j. Round g to the nearest 10. 10 Let h(w) = -1370719w + 260. Let z be h(-16). Let v = z - 34581764. Round v to the nearest 1000000. -13000000 Let d = 191.9 - 146.435. Let p = -158.1 - -158.435. Let n = d + p. Round n to the nearest 10. 50 Suppose 2 - 14 = -2j. Suppose jo - 2163 = 3o. What is o rounded to the nearest 10? 720 Let b = 146.132 - 146.065159. Let y = b + -0.067. What is y rounded to 5 dps? -0.00016 Let q = 31.00635 - -0.31165. What is q rounded to 1 dp? 31.3 Let n = 0.69 + 178.31. Let q = -61.4 - n. Round q to the nearest 10. -240 Suppose -3m - 9y + 12y = 426960012, 0 = 4m + y + 569279996. What is m rounded to the nearest one million? -142000000 Let t = 12.44 + -12. Let s = 917138 - 917138.4399564. Let w = s + t. Round w to five dps. 0.00004 Let c = 5441.0735 + 9.6265. Let p = -5117 + c. Round p to the nearest ten. 330 Let t = -2.5 + 2.9. Let z = t + 3.6. Let s = -2.4 + z. What is s rounded to the nearest integer? 2 Let v = 0.08 + 36.92. Let o = v + -36.44. Let b = -6.94 - o. Round b to the nearest ten. -10 Suppose 33u = 38u - 65. Let z(i) = -1 + u - 129997i + 6. Let x be z(-6). What is x rounded to the nearest 100000? 800000 Let k = -10420.9990731 + 10421. Round k to 4 decimal places. 0.0009 Let a = -11.589 - -9.2824. What is a rounded to 2 dps? -2.31 Let i = -0.02343 - -52.42343. What is i rounded to the nearest one hundred? 100 Let u = -3938.999999961 - -3939. What is u rounded to 7 dps? 0 Let l be (124/10)/(7/(-35)). Let j = -102 - l. Let i be j/15(-99)/(-12). What is i rounded to the nearest ten? -20 Let v = 2768.974142 - 2769. What is v rounded to three dps? -0.026 Let h = 26.437 + -26.4. Let n = h + -0.02821. Round n to 4 dps. 0.0088 Let y = -600 - -448. Let f = -152.348 - y. What is f rounded to 1 dp? -0.3 Let d = 204 - 355. Let z = -364 - d. Let m = z + 213.00000137. Round m to 7 dps. 0.0000014 Suppose 11c + 8 = 15c. Let j be (-3205(-42)/60)/(1/c). What is j rounded to the nearest one hundred? 4500 Suppose 4b - 53b - 87b + 950177600 = 0. Round b to the nearest ten thousand. 6990000 Let z = -68.7606343 + 68.76. What is z rounded to four decimal places? -0.0006 Let r = 0.027 + -0.0783. Let c = 8.8387 - r. Round c to 0 decimal places. 9 Let s = 70008 + -70007.99999971343. What is s rounded to seven dps? 0.0000003 Let f be (-1922 + -45)(-710)/35. Let m = -5 - -8. Suppose 2y - f = md, 19625 = -4d - 2y - 33573. What is d rounded to the nearest ten thousand? -10000 Let n(l) = 959921l - 4968. Let k be n(8). What is k rounded to the nearest one hundred thousand? 7700000 Suppose 0 = -15410m + 15443m - 1262250. What is m rounded to the nearest 100000? 0 Let n(d) = -20d + 8d + 2d - 658573d2 + 7. Let z be n(-7). Round z to the nearest one million. -32000000 Let i = 25.5 - -7.5. Let y = i - -10. Let p = 42.9997 - y. What is p rounded to 3 decimal places? 0 Let w(y) = 88y - 28. Let d be -62(4 - 5). Let f be w(d). What is f rounded to the nearest one hundred? 1000 Let d = 44018 + -44019.8503. What is d rounded to two decimal places? -1.85 Let a(y) = -y*3 - 14y*2 - 23y - 20. Let o be a(-12). Let j be 2973 - 56/o4. Round j to the nearest one thousand. 3000 Let g = -91.63 + 95.9965. Let z = g - 4.4. What is z rounded to 3 dps? -0.034 Let y = 639.1 + -639.10026831. Round y to 4 decimal places. -0.0003 Let m(j) = -2108j*3 + 204j*2 - 13j + 32. Let h be m(6). Round h to the nearest 10	{ "pile_set_name": "DM Mathematics" }
+ z. List the prime factors of w. 7 Let o(l) be the first derivative of -7l2 + 667l - 70. List the prime factors of o(0). 23, 29 Let n(o) = -o*3 + 9o*2 + 11o - 8. Let g be n(10). Suppose -5w - 3s = 10, 2s + g = -3w - 5. List the prime factors of (3 - 18/8)/(w/24). 2, 3 Let x be ((-4)/3)/(2/3). Let a be (1 - 2)/(-2 + (-1 - x)). What are the prime factors of 67 - (-2 + a - -2)? 2, 3, 11 Let v(c) = c*2 + c. Let o(g) = -2g*3 - 3g*2 + 30g + 7. Let l(u) = o(u) + 4v(u). List the prime factors of l(-5). 2, 7 Let j(i) be the third derivative of -i5/15 - 5i4/12 - i3 + 42i2. Let g be j(-2). What are the prime factors of -3 + g + -10 + 133? 2, 59 Suppose 0 = 48n - 50n + 18548. What are the prime factors of n? 2, 4637 Let u be 4/63/(-2). Let q be 1 + (-1)/(-1) - u. Suppose 4z - 1179 = x, 0x = qx - 3. What are the prime factors of z? 5, 59 Let i be ((-3)/(-9))/((-1)/(-12)). Let r(d) be the first derivative of d4/2 + d3 + 3d*2/2 - 14d - 1099. List the prime factors of r(i). 2, 3, 29 Let m(v) = -v*3 + 17v*2 + 20v + 9. Let t be m(17). What are the prime factors of (0 - (-24)/6) + t? 353 Suppose 0 = 4t - h - 3955, 12 = 126h - 130h. Let b = -11 + 21. Suppose 14w - t = bw. List the prime factors of w. 13, 19 Suppose -1 - 5 = 2u, 5m + 2u = 19. Suppose -2n = 3a - 16, a = -0a + mn - 23. Suppose -2t + 220 = at. What are the prime factors of t? 5, 11 Let d(h) = -361h + 359. List the prime factors of d(-73). 2, 3, 7, 53 Let w(b) be the third derivative of b4/4 - b3/3 - 18b*2. Let o be w(5). Let p = 182 - o. What are the prime factors of p? 2, 7, 11 Suppose 3j = 83 - 50. Suppose 0 = 4t + 2f - 14, -10f + 13f - j = -t. What are the prime factors of t? 2 Let f(l) = -4l + 1134. Let z be f(0). List the prime factors of z/15 + (-10)/(-25). 2, 19 Let z = 821 - 812. Let i(m) = -51m3 + m2 + m - 2. Let t be i(-2). Suppose 3f = -zf + t. What are the prime factors of f? 2, 17 Let m = 3777 - 1996. List the prime factors of 0 + 0 + 8 + m. 1789 Let d(z) = -z*3 + 2z*2 - 5z - 5. Let c = -148 + 142. What are the prime factors of d(c)? 313 Suppose 4k - 12 = 0, 28k = 3w + 23k - 145002. List the prime factors of w. 3, 41, 131 Let q(d) = -d*3 - 11d*2 - 6d + 5. Let r be q(-8). Let v = r - -362. List the prime factors of v. 223 Let g = 43 + 37. Suppose gf - 87f + 2758 = 0. List the prime factors of f. 2, 197 Let t(x) = 19x3 + 2x*2 + 10x - 6. Let p be t(6). What are the prime factors of p/10 + -8 - (1 - 0)? 2, 3, 23 Suppose -19 + 127 = 2v. Let k = 1692 - 187. Suppose k = -47g + vg. List the prime factors of g. 5, 43 Suppose 2t = -3k + 245, 0 = 4k + 3t - 176 - 151. Let r be (54/(-7))/((-16)/224). Let a = r - k. What are the prime factors of a? 3 Let s = 25377 + -12332. List the prime factors of s. 5, 2609 Let v = 3 - 5. Let x be (-4)/36 - 33735/135. List the prime factors of x/(-20) + 1/v. 2, 3 Suppose 0 = 21y - 19y - 14. Suppose 0 = -n - 3o - y - 16, -3n = -2o + 58. List the prime factors of (n/7)/((-2)/7). 2, 5 Let h(y) = -1412y + 839. What are the prime factors of h(-4)? 13, 499 Let g be 2/(-4)(-8 + 10). Suppose -643 = 6d - 2095. Let s = d + g. List the prime factors of s. 241 Let a = 16728 - -6681. List the prime factors of a. 3, 17 Suppose 84k - 79k + 59175 = 0. What are the prime factors of (k/60)/(12/(-32))? 2, 263 Suppose 0 = 5h - b - 2245, -3h + 1354 = -2b - 0b. What are the prime factors of (-4 - (5 + -10))(3 + h)? 11, 41 Suppose 4m - 802 = -3c, 389 = 3c - 3m - 427. Suppose 4l = -3d + 758, d = -0d + 3l + c. What are the prime factors of d? 2, 3, 43 Let f(o) = o*3 - 5o*2 - 22o - 24. Let s be f(11). Suppose -t + h = -s, -1384 = 18t - 21t + 2h. List the prime factors of t. 2, 29 Suppose -63 = 7o - 14o. Suppose -o = a - 39. List the prime factors of -10(-105)/a2/2. 5, 7 Let h = -100116 + 145365. List the prime factors of h. 3, 15083 Let u(q) = 7q*2 - 8q - 48. Let r be u(-6). List the prime factors of (-72)/r + (-3084)/(-14). 2, 5, 11 Let p = 8587 - 216. List the prime factors of p. 11, 761 What are the prime factors of 1611((-1)/(24/(-218)))/((-41)/(-164))? 3, 109, 179 Let m(y) = 26y - y*3 - 58y*2 + 105y*2 + 28 - 57y*2. Let a be m(-12). Suppose 2k - 220 = k - ap, -5k + 2p + 1210 = 0. List the prime factors of k. 2, 3, 5 Suppose 446899 - 103132 = 19p. List the prime factors of p. 3, 37, 163 Suppose -5n = 3k - 41619, -2k - 3k + 69393 = -n. What are the prime factors of k? 2, 3, 257 Let j be (6/4)/(((-21)/(-8))/(-7)). What are the prime factors of (j/((-40)/(-145)))/((-1)/6)? 3, 29 Let a(l) = -20l + 74. Let t(f) = 23f*2 + 92f + 2. Let b be t(-4). List the prime factors of a(b). 2, 17 Let v = -39 + 48. Suppose 12 = -5r + vr. Suppose -62 - 337 = -rj. List the prime factors of j. 7, 19 List the prime factors of (-644)/(((-8)/12416-8)/((-8)/32)). 2, 7, 23, 97 Let x(s) = -3s + 39. Let k be x(21). Let u = 20 + k. What are the prime factors of -3 - (-261)/(7 + u)? 2, 3, 7 Let f be 4 + 12/(-6) - -1. Suppose 0 = 2b + 5a - 1073, -1113 = -2b - 0b + fa. What are the prime factors of b? 3, 61 Let x = -2307 + 1588. Let f = x + 1644. What are the prime factors of f? 5, 37 Let g(z) = 2z - 14. Let w be g(8). Suppose 4s = ws. Suppose sd + 1099 = 7d. What are the prime factors of d? 157 Suppose -12t + 659366 - 39326 = 0. What are the prime factors of t? 2, 5, 5167 Let u be 6/(-7)(-126)/27. Suppose -3s + 168 = -3b - 0s, 0 = -ub - 5s - 188. Let y = b - -109. What are the prime factors of y? 3, 19 Let l = -2122 + 23599. List the prime factors of l. 3, 7159 List the prime factors of 1499(-9 - (-3 + -7))7. 7, 1499 Let y(h) = -h*2 - 4h + 3. Let d be y(-5). Let z(w) = -4 - 65w + 21w + 18w2 + 21w + 24w. What are the prime factors of z(d)? 2, 3, 11 Suppose -4s - 64514 = -5c, 4c - 15743 = -5s + 35819. List the prime factors of c. 2, 6449 Suppose 9x - 59 = -5. Let d(c) = 2c2 + 11c - 40. What are the prime factors of d(x)? 2, 7 Suppose -16c = 59c - 1103072 - 301378. List the prime factors of c. 2, 3, 3121 Let h(i) = 39684i2 - i3 + 4i - 39701i2 - 10i + 3. Suppose -3d + 0d = -6, -2a + 2d = 38. What are the prime factors of h(a)? 3, 5, 7 Suppose 3n - 150860 = -4p, 4p - 2p + n = 75434. What are the prime factors of p? 67, 563 Let c = 301 + -62. Suppose -3i + 92 = 2q, -5q - 4i + i + c = 0. Let o = 140 + q. List the prime factors of o. 3, 7 Let b(r) be the first derivative of 11r3/3 + 4r*2 - 50r + 139. What are the prime factors of b(6)? 2, 197 Let y(z) = 11z3 - 3z*2 + 2z + 2. Let f be y(2). Suppose 6j - 160 + 112 = 0. Suppose -7l + jl = f. List the prime factors of l. 2, 41 What are the prime factors of (4004/20 - -2)(28 - -167)? 3, 13, 337 Let q(h) = -17h3 + 8h*2 + 4h - 2. Let j be q(-3). Suppose 0 = -n - g - g + j, 0 = -2n - 5g + 1031. List the prime factors of n. 523 Suppose 5m - 3p = 38232, 2p + 3p = 3m - 22936. Let v(w) = -w3 - mw + 0w2 + 21w*2 - 6 + 7674w. What are the prime factors of v(22)? 2, 13 Let d = 65 - 65. What are the prime factors of 522 + d + 54/(-9) + 9? 3, 5, 7 Suppose -4584 = -t - 4o, -3t + 14990 = 2o + 1258. What are the prime factors of t? 2, 11, 13 Let y = -9657 - -22387. What are the prime factors of y? 2, 5, 19, 67 Let w = -1903 - -2687. Let c = w - 508. List the prime factors of c. 2, 3, 23 List the prime factors of 456/(-24) + 28 - (2081-96)/3. 66601 Let a(g) be the third derivative of g*5/30 + 5g4/12 + g3/2 - 267g2. Suppose d + 24 = 4l, 0d = 4d + 2l + 24. List the prime factors of a(d). 3, 17 Let v(n) be the third derivative of -7n*4/8 - 29n3/6 - n2. Suppose 19b - 21b = 2p + 10, 4b + 2p = -22. What are the prime factors of v(b)? 97 Let d = 162 + -156. Suppose -16p + 28776 = dp. List the prime factors of p. 2, 3, 109 Suppose -r = 3r - y - 7722, 2y + 1934 = r. Suppose -2u + r = 2u - h, 4h = -8. List the prime factors of u. 2, 241 Let z = 12287 - 8574. What are the prime factors of z? 47, 79 Let m(f) = 36f + 687. What are the prime factors of m(-8)? 3, 7, 19 Let k = 569 + -122. Suppose -3g + 12 + k = 0. What are the prime factors of g? 3, 17 Suppose y + 3396 = -y. Let f = -1173 - y. List the pr	{ "pile_set_name": "DM Mathematics" }
-5l = -3d + 9 for l. -3 Let q = 4 + -2. Let m be ((2 - q)/(-2))/(-1). Let n(v) = -3v - 1. Let s be n(-2). Solve m = t - 3t - o + s, 4o = -2t + 14 for t. 1 Suppose -3r - 2v = 109, 6v + 113 = -3r + 2v. Let l be 5/(-2)84/r. Solve -3s - y + l = -6s, 2s - 4y + 4 = 0 for s. -2 Suppose -2t + t + 1 = 0. Let f be t + (-9)/(-3) + 0. Suppose fj - j - 15 = 0. Solve 4q - 3u = -9, -jq - 4u + 12 = -0u for q. 0 Let p = -16 + 28. Suppose 3t + 15 = -p. Let r be 7/9 - 2/t. Solve -3n + o - r = -2n, 5o - 25 = 0 for n. 4 Let q = -78 - -80. Let d be ((-14)/(-4))/(1/2). Solve -40 = 3j + 5h, -qh = -dh - 25 for j. -5 Let j(a) = -a3 + 10a*2 + 2a - 2. Let w be j(10). Suppose 4g = 3g + w. Solve 0 = z - 5u - g, 3u = z - 4 - 8 for z. 3 Suppose -21 = v - 5x, -3v + 2x + 7 = x. Solve 2u - 25 = -vk - k, -20 = -4k - 5u for k. 5 Let u be 3/(-3)0 - -1. Suppose 3c - u = 8. Solve 2k = cs - 9, -k + 4s = -1 + 18 for k. 3 Let j(x) = -x*2 + 14x - 11. Suppose -k - 64 = -5o, -32 = -3o + 2k + 5. Let p be j(o). Solve 4c + 2f = -4, 0 = -6f + pf - 16 for c. 1 Suppose -147 = 5a + u - 371, -5u - 95 = -2a. Solve -2y - 2 = -4b + b, -5y - 5b + a = 0 for y. 5 Suppose -6w + 8w = 12. Suppose -wo = -3o. Let h be -2 - -3 - (1 + o). Solve hf + 4n - 24 = 2f, 3n - 15 = 0 for f. -2 Let d = 3 - 1. Let b be (d/(-2) + 11)/2. Solve -5k + y = -3y + 6, -bk - 5y - 15 = 0 for k. -2 Let w be 14 + 3 + (1 - 4). Suppose -3y + 1 = -w. Solve -v = -3d - 4, 4v - 2v = 3d + y for d. -1 Let b = 12 + -20. Let p(l) = -8 + 6l2 - l2 - 4l2 + 7l. Let m be p(b). Solve 0 = 5q + 2v - 8, 3q - 2 = -4v - m for q. 2 Suppose -10 = -3s - 46. Let x = s + 17. Suppose -2m - 2l = 6, 4l + 22 = 2m - 2. Solve -2r - 2 - m = -2o, xo = 3r for r. -5 Let t be (-5)/(-10) - (-7)/2. Solve -p + 5 = -4v - 0, -tp + 7 = -3v for p. 1 Let t be (30/(-25))/((-2)/5). Suppose -c - th = 0, -c + 11 = 2c - 2h. Suppose -cq + q = -6. Solve -2 = -l - s + 5, 2l + qs - 16 = 0 for l. 5 Suppose -17 = -2g + 5. Let m(d) = -d3 + 12d*2 - 12d + 14. Let f be m(g). Solve 0 = 2s + k + 10, f + 2 = -s - 4k for s. -5 Let t be 2/((-2)/4 + (-30)/(-12)). Solve 2o + 2j + t = -j, -5j = -15 for o. -5 Suppose z + 0z = 5. Let o be ((-6)/z - 0)-5. Solve q - o = g, -2q = -3g + 5g for q. 3 Let o = -13 - -9. Let l(b) = b*2 + 4b + 4. Let z be l(o). Solve 0 = -zq - 3j - 2j + 15, 0 = 4q + 4j - 16 for q. 5 Suppose -s = s. Suppose -2w + 1 + 19 = s. Solve -u = 2q + 6, -5u + 2 = -4q - w for q. -3 Let i(d) = -15d - 1. Let s be i(-1). Solve -3q + 2j - s = 0, 3q - 4j + 1 = -21 for q. -2 Suppose -m + 6m - 5 = 0. Let a = 4 - m. Suppose 2j = -2r - j + 4, -r + 4j + 2 = 0. Solve rw = -aw + k, 0 = w + 4k for w. 0 Let g(u) = u2 + 7u + 2. Suppose -2q - 2p - 14 = 0, -5p + 34 = -5q - 1. Let z be g(q). Solve -4v + k + 17 = 6k, v = -zk + 8 for v. -2 Suppose 0 = -2s - 2p + 10, -3s - 1 = -7p + 2p. Let h(z) = 2z - 3. Let l be h(4). Solve 5j + 4c + 8 = 5c, sj + 16 = -lc for j. -2 Suppose -69 + 3 = 3z. Let o = -12 - z. Solve -2q - 3g = -q - o, 4g - 10 = -3q for q. -2 Let o = -1 - 3. Let l be (-30)/o(0 - -20). Suppose -3a - l = -8a. Solve -s - 2x = 3x + a, 5x = 5s for s. -5 Let q(z) = z*3 + 8z*2 - z - 3. Let x be 21(-1 + -3). Let a be q(x). Solve -3h - 4 = -5y - 1, 2h + 7 = ay for y. 3 Let y(d) = -d2 + 25d - 24. Let q be y(24). Solve 4l = -4m + 32, ql + l = -5m + 28 for m. 5 Let w(s) = -2s - 12. Let g be w(-7). Solve -gb + 2a - 10 = 0, -b = -0b + 2a + 5 for b. -5 Let j = -19 + 24. Solve 0 = -5a + j, -23 = -5r + a - 4a for r. 4 Suppose g - 4t + 0t = 0, -5t = 5g - 25. Let a be 04/81/2. Solve -3b = -12, ab + 3b = gs for s. 3 Suppose 0 = -5a - 4t - t + 30, -4a = 3t - 22. Let j be 2/5 + 8/5. Let v = a - j. Solve 2s = -vs - 8, -2x - 3s - 14 = 0 for x. -4 Suppose f - 3f = -10. Suppose -5r + 29 = -t, 4r - 8r - 3t = -8. Suppose 0 = u - r - 2. Solve 5y = a + 6 + u, 4a = fy - 22 for a. -3 Let b be (0 - -14)(-2)/(-4). Let o(h) = -13h - 12. Let g be o(-9). Let f be (-6)/9 + g/9. Solve f = -2w - 3x, -b = 4w + 3x - 0 for w. 2 Suppose 0 = 17g - 68 + 17. Solve -15 = 3d - gy, 0 = d + 3y - 11 for d. -1 Suppose 5g - 2g = 4s - 10, -2 = -3s + 5g. Solve 5n + 21 = -sb, -2 = -2n + b - 0 for n. -1 Let u = 3 + 0. Solve -uo = 5y + 6, 0o = -o + 4y - 2 for o. -2 Let a = -3 + 7. Let c be (a/4)/(2/16). Suppose g - c = -g. Solve 3t = 3v - 2 - 13, -t = gv - 20 for v. 5 Suppose 7 = 5r - 3. Let d = -3 + 1. Let h = d + r. Solve ha = -5a - j + 4, -j + 3 = 4a for a. 1 Suppose 2p = 117 - 107. Solve 0 = u + pq, 2q = -q + 3 for u. -5 Suppose -8 + 0 = -b. Let a = b - 5. Suppose 6 = -ax + 4q - 4, -5x - 2 = -3q. Solve xz - 5h = 3z - 9, -4z - 10 = -3h for z. -1 Suppose -8b + 60 = -4b. Solve -1 = 5u - 2r, 3u = -5r + r + b for u. 1 Suppose 1 = 2v + s, -7v + 9v - 5 = -5s. Solve 2j - 3f = -vf - 8, 4f = 0 for j. -4 Let t = -40 - -44. Solve 2y + 4z + t = -18, 0 = -5y + z for y. -1 Let z = 8 - 20. Let n = 22 + z. Solve 3l + 6 = -t, -2t - 2t + 2l = n for t. -3 Let r be 6 + (-2 + 3 - 3). Solve -2k + 30 = -ro, -k - 3 - 7 = 3o for k. 5 Suppose f - 4l + 2 - 1 = 0, -5f + 12 = -3l. Solve 4t = a - 6, 0a = fa + 6 for t. -2 Suppose 0 = q + 7 - 12. Solve 0 = 2x + 4n + 12, 3n + 16 = -qx - 0n for x. -2 Suppose 4t + q = -17, -q + 7 = 4. Let x be t(-1)/(-3)-3. Solve 0 = -2d + 3w + 14, -x + 19 = -2d - 4w for d. 1 Suppose 0 + 6 = -2g, -g + 45 = 3h. Let w be (-36)/(-15)10/3. Suppose wq = 3q + 30. Solve o + q = -o + j, -4j - h = 2o for o. -4 Suppose -5 - 4 = -3a. Let p be 0 + 0 + -1 + a. Solve 2g = r, pg = -5r + 5g + 14 for r. 4 Suppose 6 = 26o - 23o. Suppose -f - 13 = -4c, of + 4c = -0f + 22. Solve fn + 10 = 4r, 2r + r - 6 = 3n for r. 4 Let c(a) = -3a + 25. Let v be c(8). Let w be (-18)/8(-6 + 2). Solve f = v, 0n - 3n - w = -3f for n. -2 Suppose 30 = -3v + 5v. Suppose -4g - v = -9g. Solve 3w = -gc - 0w, 2c - 2w = 12 for c. 3 Let t = -192 + 195. Solve -2h + 15 = 3v, 0 = tv + 5h - 15 for v. 5 Let a be (0 - 0/2)/(8/(-4)). Let i = 0 + 4. Suppose w - i = -a. Solve 5d - 6q + 3q + 20 = 0, -wd - q = 16 for d. -4 Let j = -49 + 49. Solve j = g - 0g - 5b + 8, 0 = -5g + b + 8 for g. 2 Let z(q) = 4q2 - 3q + 5. Let h be z(2). Suppose 2u - h = -u. Solve -r - ui = -16, 0 = -r - r + i - 1 for r. 1 Suppose 2a - 6 = q, -2a + 24 = 5q + 6. Suppose -3 = h - q. Let c be 2 - (1 + -3 - h). Solve -r + 17 = 4s - 9s, -c = -3r - s for r. 2 Suppose -3y + 2 = -2y - 5u, -2y = -u - 4. Let x be (-4)/14 + y/7. Solve -4d = -3h, x = h - d - 3 + 4 for h. -4 Suppose -5a + 25 = 5m, -3m = -a - 7m + 14. Solve -al + 3g + 2g = 23, l + 3g - 16 = 0 for l. 1 Let d = 6 + -5. Solve 0 = y + 3x - 2 - d, -3x = 0 for y. 3 Let o(g) be the third derivative of 0g + 1/60g*5 + 0 + 7/6g*3 + 5/12g*4 + 4g*2. Let t be o(-10). Solve -4c = -x - 2x - t, -4c - 3x = 23 for c. -2 Suppose 3y - 2y = 5, -7 = -3t + 4y. Suppose -r + 5a = 15, -r - 3r + t = 3a. Let v = 1 - r. Solve 2 + 1 = -3c, n + c = -v for n. 0 Let a be (-1)/2 + 14/4. Let y = -5 + 7. Let h = a + y. Solve 0 = -hz - 4n - 30, 1 = 3z - z - n for z. -2 Suppose 9q - 9 = 9. Solve 7l - 4l + 3k = -12, 4 = -qk for l. -2 Suppose 4o - 37 = -o - 3f, o + f = 9. Suppose -5s - 5 = -q + 6q, os - 2q = 23. Solve -sz = -2x, 0 = -0x - 2x for z. 0 Let y = 6 + 0. Suppose 0 = -2q + 3o + y, 3q - 10 = 5o. Solve 5b + 5t + 14 + 6 = q, -4b - 19 = t for b. -5 Suppose -2w = -3h - 0w, -5w = -5h. Solve b - 5r + 0 - 1 = h, 3r = 0 for b. 1 Let r = 56 - 56. Solve -4z - 2q = -16, rq - 2q = 3z - 12 for z. 4 Suppose -26 = o - 28. Solve 0 = 4s + 3n + 5, 7 - o = -s + 3n for s. -2 Suppose -5 = 2p + c, -c = -p - 2c - 5. Let x be 7/(p + 1) + -2. Solve 0o - 5d = -3o - 15, 2d - x = o for o. -5 Let x be 2/(-10) - 3/(-15). Let z be x((-1)/(-2))/(-1). Solve -l - 9 = -3d, -5d + zd = -10 for l. -3 Let c be (-86)/10 - 9/(-15). Let p = 20 + c. Solve 0 = -5k - 3b - 4 - 2, 0 = -4b + p for k. -3 Suppose -6q + 1 = -q + f, -4q + 3 = 3f. Solve -n - 4 = q, 2y + n - 5*n - 22 = 0 for y.	{ "pile_set_name": "DM Mathematics" }
+ ik + n + tk*2 + uk*3 and give s. -67 Express -5y*2 - 2y*2 + 3y*2 - 20 + 3y2 - y3 in the form ny2 + vy + dy3 + m and give n. -1 Rearrange -2p + 12p - 25p*2 - 8p + 18 to the form up2 + sp + a and give a. 18 Express (3x - 1 + 1)((-2x - 3x + 4x)(-55x - 60x + 105x) + 0 + 0 - x2 + 3x*2 - 3x*2 + 2x*2) in the form zx + s + rx3 + hx*2 and give z. 0 Express -4160 + 4160 + 112f + 3f - 3f - 3f + 0f - 4f + 5f + (0f - f - f)(-2 + 5 - 1) in the form yf + k and give y. 106 Express -4 + 4 + 2r + (-5 + 3 + 1)(-4r + r + r) + (-1 + 0 - 7)(3r + 3r - 4r) + 0r + 0r + r - 13 + 18r + 13 as a + tr and give t. 7 Express -1 - 8 - 172z2 + 19 + 2z*4 + 167z*2 as c + pz*2 + vz*3 + fz*4 + mz and give p. -5 Express -178t - 7t - 11t as j + lt and give l. -196 Rearrange -385s4 + 779s4 - s2 + 2s3 + 13s*2 - 391s*4 to xs*3 + is + ns2 + ms*4 + b and give m. 3 Rearrange (-3 - 3 - 2k + 2)(-23 - 2k*2 + 4 + 0k*2)(-1 + 4 - 2) to dk + j + uk*2 + nk*3 and give u. 8 Express -19 + 19 - 155b + 383b in the form c + jb and give j. 228 Express -1614o4 + 5o*2 + o + 1612o*4 + 8o*3 + 2o as ro4 + lo + w + do3 + go*2 and give l. 3 Express (2 - 1 - 2)(997q2 + 2q*3 - 997q*2 + 43) as nq*2 + yq*3 + v + mq and give v. -43 Express -k - 2k2 + k + (61k - 50k - 34k)(3k - 7k + k) + k2 + k2 + 0k*2 as yk*2 + s + hk and give h. 0 Rearrange -1 + 10g2 - 209g*2 + 24g*2 - 104g*2 + 2g - g to the form i + hg + zg*2 and give z. -279 Rearrange (0 + y + 0)(-26 - 20 + 9 - 53 - 52 + 103 + (-3 + 2 + 2)(2 - 5 + 1)) to l + ay and give a. -41 Rearrange -1 - 90c2 + 4c + 184c2 - 11c*3 - 92c*2 + 2c*4 to the form f + ac*2 + wc + pc3 + qc*4 and give q. 2 Express 167 + 46r - 47r + 79 + 22 - 51 in the form lr + x and give l. -1 Express -1 + t*3 + 1 + 61t*3 + 58t*3 - 117t*3 - 2t*2 + (-2t*3 - 3t*3 + 3t*3)(2 + 4 - 1) as lt3 + n + at + ot2 and give o. -2 Rearrange -90d - d*2 - 115d - 6d3 - 21d + 9d3 - 4d*3 to f + ud*2 + hd + rd3 and give h. -226 Rearrange -2c*3 - 278c*2 - 285c*2 + 3c - 4 + 561c2 + 3c*4 to m + wc*2 + ac*3 + qc*4 + rc and give m. -4 Express 5d + 2 - 1418d*2 + 24d + 1397d2 - 2 in the form p + fd*2 + ld and give f. -21 Express (-5r3 + 0r*3 - 5r*3)(5r + 0r - 3r)(14 + 28 + 12) as cr4 + i + jr*2 + fr*3 + yr and give c. -1080 Rearrange -135s2 - 9s*2 + 2 - 3s*2 - 127s*2 + 35s*2 to the form q + ks*2 + ds and give k. -239 Express (0 - 2 + 1)(2t - t + t) + 76t - 30t - 21t + t - 2t + 4t in the form jt + b and give j. 26 Express (-4 - 5 + 8)((3 + 1 - 3)(-2 + n + 2) - 1 + 1 - 2n + 4n - 3n + 2n)(-5 + 1 + 2)(-2n - 4 + 4) in the form xn + vn2 + y and give v. -8 Express (-273 + 273 - 36n*2)(-2 + 2 + 2n2) - 15n4 + n4 + 0n4 in the form rn*2 + jn*4 + vn + cn3 + z and give j. -86 Express (-4 + 4 + 151b)(3b - 3b - b)(0b - 2b + 0b) in the form sb*2 + tb*3 + hb + j and give t. 302 Express 22r + 115r*2 - 211r*2 + 104r*2 in the form jr*2 + zr + b and give j. 8 Rearrange (-7t + 3t - 10t)(-1 - 1 + 3)(5t3 - t3 + 2t3) to the form at*2 + vt*3 + g + nt*4 + dt and give n. -84 Rearrange 2p + 151p*2 + 85p*2 - 2p to the form qp + hp*2 + z and give h. 236 Express -2 - 8i + 2i + 0i - i - 74 in the form oi + r and give o. -7 Rearrange 3 - 18q + 5q - 36q*4 + 6q + 5q + q2 - q3 + 3q*3 to pq*3 + xq + dq2 + nq*4 + l and give l. 3 Express 94x*2 - 25x*2 - 6x + 6x in the form mx*2 + kx + j and give m. 69 Express -20y4 + 2y + 88y2 + 91y*2 - 181y*2 + 0y in the form ny3 + iy*4 + l + zy + fy2 and give f. -2 Rearrange (-2o + 4o + 3o + (2o - 5o + 2o)(2 - 1 + 1))(80 - o - 87 - 4o) to uo + no*2 + p and give n. -15 Rearrange 8u - 8u + 102u*2 - 1276u*2 to the form yu*2 + ju + x and give j. 0 Express (-14q2 + 4275q - 4275q)(9 - 4 + 2) as n + yq2 + xq and give n. 0 Express 25m - 79m + 29m + 25m - 670m2 as om*2 + gm + b and give o. -670 Rearrange -5i3 - 13i*2 + 11 + 2i + 6i - 7i - 9 to xi + ti*3 + ri*2 + z and give r. -13 Express (2q - 3 + 3)(-69 + 207 + 63)(3q + 0q - q) in the form zq + iq*2 + r and give i. 804 Express (-3 + 3 - 5 + (-3 + 2 - 1)(3 - 2 + 2) + 2 + 0 - 3)(13o + 13o - o) in the form x + lo and give l. -300 Express 59580w - 4 - 59580w - 21w2 as s + uw*2 + lw and give s. -4 Rearrange 104 + 28 + 27 + 31 - z*2 to the form gz + a + nz2 and give n. -1 Rearrange -7 + 6 - 17o + 1 to the form zo + m and give z. -17 Rearrange -8a + 65 + 3a + a + 5a + 1133 to da + k and give d. 1 Rearrange (0r - 4r + 6r)((-1 - 2 + 0)(-2 + 3 + 0) - 59 + 88 + 134) to the form u + sr and give s. 320 Rearrange -147472u*3 - 2u + 9u4 + 3u*4 - 3 + 147470u*3 to x + pu*2 + iu + qu4 + au*3 and give a. -2 Rearrange 0x + 39x2 - 48x*2 + 0x - 27x2 + 4x*3 to tx + z + wx3 + jx*2 and give j. -36 Rearrange (5o*2 - 4o*2 + 2o*2)(-13o2 + 3o - 25o2 + 2 + 36o*2) to the form p + ho*2 + uo*4 + io + mo3 and give h. 6 Express -2z + z + 3z + (0 + 0 + z)(0 + 2 - 1) + 6z - 2z - 2z + 7z + 5z + 48z in the form d + mz and give m. 65 Express 2o*2 - 17453 + 2o*3 + o + 17412 - 4o*3 as vo*3 + uo + w + go2 and give g. 2 Express (-3k + 1 - 1)(-2 + 4 - 3) - 5k + 6k + 13k in the form n + yk and give y. 17 Rearrange (-2a + 2a - 3a)(4a*2 + 5a*2 + 0a*2) - 46 + 46 - 5a*3 to the form za*3 + r + na + la2 and give z. -32 Rearrange 0u*3 - 11123u*2 + 0u3 + u4 + 4u + 11124u*2 to the form wu*2 + vu*3 + ku + y + hu4 and give h. 1 Express -5p + 395 - 397 + 4p as hp + t and give h. -1 Express 10d2 - d - 40d*2 + 5 - 6 + 3 + 0d as pd2 + t + wd and give w. -1 Rearrange -164h + 75h + 158h3 - 3h*2 + 90h to qh2 + rh*3 + y + wh and give w. 1 Rearrange (96f + 108f - 302f)(1 - 6 + 4)(3 + 4 + 2) to gf + b and give g. 882 Rearrange 1808a - 30 + 30 - 2617a to oa + r and give r. 0 Rearrange -235 - 5x + 297 - 5x2 + 2x*2 to the form fx*2 + dx + g and give f. -3 Rearrange 102z3 - 60z*3 + 4z - 3 - 2z2 - 70z*3 to the form b + hz*2 + az + mz3 and give a. 4 Rearrange -52y + 38 + 6y + 51y to l + ay and give a. 5 Rearrange -12g - 14g - g3 + 12g to the form n + jg3 + qg + tg2 and give j. -1 Rearrange 2984y + 1822y2 - 2984y to the form cy2 + n + sy and give c. 1822 Express (-5 + 2 + 4)(-1 - 3 + 6)(5 - 1 + 22)((4u*2 + 0u*2 - 5u*2)(4 - 5 + 0) + 3u + 2u*2 - 3u) in the form wu + q + fu*2 and give f. 156 Rearrange 12w - 12w + 2w - 3w + 2636 + (-2w - 3w + 3w)(0 - 2 + 0) + w - 1 + 1 - 2w + 2w - 2w to h + jw and give j. 2 Rearrange -7j*2 + 8j*2 - 9j + 25j - 41j*3 - 14j + 126j3 to fj + bj3 + s + kj*2 and give b. 85 Express -2h*2 - 3h - 29h2 + 2h - 21h2 in the form jh*2 + qh + k and give j. -52 Rearrange (4 + 0 - 7)(-3l - 8l - 7 + 14l) to the form d + pl and give d. 21 Rearrange 40147 - 40147 + 688w to the form h + cw and give c. 688 Express 743 - 743 + 214u + u + 0u + u + (1 - 2 + 2)(-3u + 0u + 4u) as w + tu and give t. 217 Express 245d2 - 537d*2 + 238d*2 as id + m + td2 and give t. -54 Express (-4x*2 - 2x2 - x2)(-5x + 2x + x) + 8x*3 - 4x*3 - 11x*3 as dx*3 + n + yx*2 + ix and give d. 7 Express (-1 + 1 + a*2)(0a + 0a + 2a) + 3756a*3 + 3763a*3 - 7515a*3 + 55a in the form ha2 + d + ia + ua3 and give u. 6 Rearrange 18o + 102o + 252o to vo + x and give v. 372 Express 5894 - 5893 - 237v - 89v as o + jv and give o. 1 Express (12f - 18f + 9f)(-5 + 0 + 2) + (2f + f - f)(5 - 6 + 4) as m + uf and give u. -3 Express 2f - 2f + 2062 - 2063 - 7f*2 - 9f*3 in the form jf*3 + af + bf2 + g and give b. -7 Rearrange (-18 + 0 + 3991l - 3998l)(3 - 2 - 3) to the form a + hl and give h. 14 Rearrange -25i + 3 + 75i - 97i - 3 to the form ni + y and give y. 0 Express -2x*2 - 4x*	{ "pile_set_name": "DM Mathematics" }
e -4 - (0/(-3) + 81). Let i = 85 + m. Solve i = -2h + 4h for h. 0 Let d be (-55)/110(0 - 25). Suppose 2m = -3s + 17 + 24, 5m = 4s + 68. Let g be m/d - (-8)/(-40). Solve -12 - 3 = gq for q. -5 Let g = -6 - -16. Let k = -20 + 10. Let x = g + k. Solve x = -0t + t + 1 for t. -1 Let d(q) = -q*2 + 34q - 115. Let p be d(30). Solve 16n = pn - 11 for n. -1 Let u = -170 - -172. Solve 0 = ul + 5 - 15 for l. 5 Suppose 2z + 5i - 9 = 0, -2z + 5z - 10 = -4i. Let r = -108 - -110. Solve -3k + rk = z for k. -2 Suppose 0 = 2t - 5g, -5t + 18 = g - 9. Let n = 5393 - 5390. Solve n = -tq + 2q for q. -1 Let n(m) = m2 - 9m + 20. Let q be n(4). Solve q = -3l + 18 - 6 for l. 4 Let f = -14 + 33. Let z = f - 12. Suppose 5m = z + 8. Solve 0 = 4a - ma - 5 for a. 5 Let b be (-11 + 868/77)(12 - 1)/1. Suppose 0 = 4w - 3w - 6. Solve -3 = bm + w for m. -3 Let k(x) = 3x2 + 29x + 22. Let a be k(-10). Solve a = -10p + 2 for p. -3 Suppose 0 = -0p + 6p - 438. Suppose 0 = 78h - ph. Solve h = 3q - 4q for q. 0 Suppose -o - 12 = -13o. Solve 0 = 2y + o + 3 for y. -2 Let q(k) = 2k*3 + 9k*2 - 6k - 5. Let l(d) = d*3 + 6d*2 - 7d - 5. Let w be l(-7). Let t be q(w). Solve t = -b - 2 - 2 for b. -4 Let m(x) = -2x2 + 10x + 3. Let k be m(5). Suppose -1 = -kv + 8. Solve -3l - 6 = -v for l. -1 Suppose 4z - 39 = 2z - 5u, 4u = -z + 24. Suppose -i - 4n = -9 - z, 5n = 2i - 68. Let c = 33 - i. Solve -a + c = -0a for a. 4 Let s(v) = -v*3 - 6v*2 - 3v + 14. Let b be s(-5). Suppose 2y = -y + 3x - 6, 18 = y + 4x. Solve b = -n + yn for n. 4 Let t = 9 + -8. Suppose -2u = -5 + t. Suppose uo - 3 - 3 = 0. Solve -6y = -oy for y. 0 Let n be -1(-5)/((-10)/(-6)). Suppose 3 - 13 = -5v, 109 = no + 5v. Solve 0 = -5h + o - 8 for h. 5 Let o be (-9)/21 - 140/(-98). Solve 5 = -u + o for u. -4 Let r = -4 + 4. Suppose r = -4k - 5q - 0 - 1, q - 3 = -4k. Solve 3 = 4a - k for a. 1 Let u = -164 - -177. Solve up + 24 = 5p for p. -3 Let t = -18 + 50. Let k be (-8)/t + 42/8. Let s be (0/(2 + -4))/(-2). Solve s = -0d + kd for d. 0 Suppose -6 + 12 = 2d. Let w be 18/d2/6. Solve -w - 1 = 3f for f. -1 Suppose w + 2w - 9 = -3l, -w + 3 = -l. Suppose 0v = -wv + 4s + 27, 0 = -3v + s + 18. Let x(p) = p + 5. Let h be x(-3). Solve 7 - h = vm for m. 1 Let i be 5/(((-30)/48)/(12/(-16))). Solve 0 = iu + 15 - 3 for u. -2 Suppose d - 5 = -0d. Suppose 3w + 25 = 4c, 11w - 14 = -5c + 9w. Solve -d + c = b for b. -1 Let j(i) = i*2 - 4i + 4. Suppose -4o = -z - 3z - 32, 4 = 3o + 2z. Let k be j(o). Suppose 0 = -u + 2t + 9, -t - 7 - 8 = -ku. Solve 7d - ud = -12 for d. -3 Let i be ((-21)/6 + 2)(-12)/9. Suppose 4z - 19 = -3b, -ib = -2z - 3b + 9. Solve 0 = zm - 6m for m. 0 Let d(a) = -a - a*2 + 11a - 2a - 9. Let k be d(6). Let t = k - 3. Solve p - 2p = t for p. 0 Let w(f) = -4f3 - 2f*2 - 3f - 3. Let r(t) = -t3 + t2 + t. Let x(c) = 5r(c) - w(c). Let o be x(8). Solve o = 6k - 3k for k. 1 Suppose -2g = 4i - 2, -2i + 20 + 11 = -5g. Let a be (-7 - -3) + 1 + i. Solve a = 2l + 4 + 2 for l. -3 Let v = -108 - -133. Solve 22n = vn for n. 0 Let r(l) = 2l - 8. Let o be r(5). Suppose -5j - 5a + 30 = 0, oa + 11 - 3 = 3j. Suppose 9n - jn - 50 = 0. Solve -3i = -n - 5 for i. 5 Let o = 2611 + -2611. Let j(b) = b*2 - b - 5. Let x be j(-4). Solve -3i - x = -oi for i. -5 Let r be (-1 + 114/20)-25. Let g = 46 + r. Solve -2n + g = -6n for n. -4 Suppose 165 = 3p - 3k, -5p + k + 221 = -50. Solve 3h = -p + 39 for h. -5 Suppose -4o + 4u = -20, 7o = 5o - 3u + 15. Solve 2x + ox - 16 = 0 for x. 2 Suppose -i = -3w + 12, -3w + w = 5i - 8. Suppose -y - 102 = -wy. Suppose -4p + y = -2b, -p - 4p = -b - 38. Solve -2l = -pl - 5 for l. -1 Let c(j) be the first derivative of j2 + 6j - 3. Let p be c(0). Solve p = -a - a for a. -3 Let w(x) = 5x3 - 3x*2 + 7x - 1. Let i(k) = 6k3 - 3k*2 + 8k - 2. Let o(a) = -6i(a) + 7w(a). Let v be o(-3). Solve -6z + 10 = -v for z. 2 Suppose 3o = 2m - 1, -o - o - 6 = 0. Let h(k) = k2 - k - 5. Let p be h(m). Suppose -2n + p = 7. Solve v - 1 = -n for v. -3 Let y(f) = -3f - 20. Let u be y(-8). Let c(t) = 7t + u + 2t2 + 8t - 6t. Let a be c(-4). Solve a = d - 3 for d. 3 Let q(u) = -u2 + 7u. Suppose k - 21 = -3y, 5k = -2y - 0y + 14. Let d be q(y). Suppose 0c - 2c + 8 = d. Solve 0 = 5a + 9 - c for a. -1 Suppose 30l - 12 = 24l. Solve 0 = ln - 134 + 130 for n. 2 Let r(v) = -3v3 + 80v*2 + 28v - 23. Let n be r(27). Solve -2 + n = -2l for l. -1 Suppose -2y - 3t + 9 = 2, 5y - 52 = 4t. Solve -5l - 3 = -yl for l. 1 Let c(z) be the third derivative of -z5/60 - 10z*2. Let t be c(0). Solve -5y - 25 = -ty for y. -5 Let r = -534 + 538. Solve -10k + 42 = rk for k. 3 Suppose -3o - 2o = 40. Let u(s) = -s3 + s2 + 5s + 2. Let r be u(-2). Let v be 6/ro/(-6). Solve 0 = i - v + 5 for i. -3 Let k be 3/(((-3)/(-1))/3). Suppose 3m = -y - ky - 11, 0 = -4m + y + 17. Solve 3u + m = -3 for u. -2 Suppose -515b = -485b - 330. Solve -6m = -17m + b for m. 1 Suppose 3z - 2u - 90 = 0, 4z - 3u - 118 - 2 = 0. Solve zy - 22y = -24 for y. -3 Suppose 7t + 7 = 8t. Suppose 0 = -7m + t. Suppose -w - m = -5. Solve -h + 15 = wh for h. 3 Let p be -1(7 + -6)-11. Solve -pr - 18 = 7r for r. -1 Let q(t) = t3 + t2 + t + 10. Let p be q(0). Suppose u - 6 = 4. Suppose -5o + u = -p. Solve y + 20 = -oy for y. -4 Suppose 5w + 83 = w - 3j, -72 = 3w - j. Let f = -23 - w. Solve 0 = -4d - fd for d. 0 Suppose 23n = 2w + 24n - 8, 0 = w + 4n - 4. Solve -wu = -8 - 4 for u. 3 Let w(c) = 4c + 43. Let n be w(-11). Let d be (0 + 1)/((-3)/9n). Let a(h) = 8h - 1. Let k be a(1). Solve -dx - 2 = k for x. -3 Suppose -o + 14 = -u, -4o + 28 - 7 = 3u. Solve -66 = ov + 13v for v. -3 Let r(u) = 16 - 4u - 2 + 5u. Let x be r(-8). Let q be 3/x - 36/(-8). Solve -4 = -j + qj for j. -1 Suppose 2q = k, 3q = q - 2k + 12. Suppose -5 = 3o - 17. Solve -qu = -ou + 6 for u. 3 Let i = 20 - 17. Suppose iw + 72 = -0w. Let n be (-4)/w - (-23)/6. Solve -15 - 5 = -nb for b. 5 Let p(f) be the second derivative of f4/4 - 5f3/6 - f2 + 11f. Let r be p(-2). Solve 0g + r = 5g for g. 4 Let d(l) = 2l*3 - 27l*2 - 8l - 84. Let z be d(14). Suppose 2 = -5u + k - 0, 3k = u + 6. Solve z = 3h - uh - 12 for h. 4 Let r be ((-338)/65)/((-4)/10). Suppose -17 - 4 = 2c - 5q, -4c - q + r = 0. Solve 5d + 3 = -c for d. -1 Let i(s) be the third derivative of -s5/60 + s4/24 + 3s3/2 - 70s*2. Suppose f - 2 = 3o - 5o, 8 = -5o + 4f. Let q be i(o). Solve -q + 1 = 4h for h. -2 Suppose 98 = 4o - 2p, 0 = -5o + 4p - 94 + 224. Solve -o = 6m + 2 for m. -4 Let q be 8 - -102/(-4). Solve -qc = 4c - 35 for c. 5 Let q be ((-105)/(-6))/(2(-2)/(-16)). Suppose h - 1 = -4f + 18, -q = -5h + 5f. Solve h = -n + 4n for n. 5 Suppose u = -2h - 6, u - 5u + 3h = 13. Let i be (-3)/(u + 148/40). Suppose 0q + 12 = 3q. Solve -a + i = qa for a. 2 Suppose -5q + 15 = -75. Let g be 264/q + 2/(-3). Let c = g + -13. Solve 0f = -f - c for f. -1 Suppose 2v = v - 2m + 6, 0 = 2v + m. Let r(g) = -6g - 5. Let a be r(v). Solve -ap = -6p for p. 0 Let i = -96 + 96. Suppose id + 13 = 2j + 3d, 12 = 3j + 2d. Solve 0q = jq for q. 0 Suppose -9i - 226 = -307. Solve 19z - i = 16z for z. 3 Suppose 2b = 2w + 2, 0 = -35w + 36w - 4b + 16. Suppose 3i - 70 = i + 4s, -2i + 30 = 4s. Solve n = -wn + i for n. 5 Let n(z) = z3 - 3z*2 - 8z - 10. Let x(q) = -q*3 + 6q*2 - 2q - 10. Let k be x(5). Let y be n(k). Solve y = -2m + 13 - 5 for m. 4 Suppose 6j = 29 - 5. Suppose -2v + 48 = 4b, 0 = -3b + 5v - 0v + 10. Solve f + jf = -b for f. -2 Suppose 200 = 77i - 69i. Solve -iv = -21v + 16 for v. -4 Let h = -39 + 31. Let m = h - -11. Solve -15 = -4i - m for i. 3 Suppose 62 = 6r - 5k + 31, 0 = r + 5k - 11. Let b be (-2 + 2)/(0 + -2). Let z = 30 + -16. Solve -5p - r - z = b for p. -4 Let t = 224 + -221. Solve tl = -5 + 17 for l. 4 Let t(s) be the second derivative of s*4/12 + 2s3/3 + s2 - 6s. Let x be t(-4). Solve -xk - 4 = -3k for k. 4 Suppose -3m + 4 = -2t, -m + 3t = 3 - 2. Suppose -ml - 2l = 3r - 5, 5r = l - 7. Let k be l/(6*(-1	{ "pile_set_name": "DM Mathematics" }
w many minutes are there between 10:46 AM and 8:30 PM? 584 What is 660 minutes before 2:50 PM? 3:50 AM How many minutes are there between 1:33 PM and 8:59 PM? 446 What is 597 minutes after 9:00 PM? 6:57 AM What is 341 minutes before 11:59 AM? 6:18 AM What is 130 minutes before 12:36 AM? 10:26 PM What is 456 minutes after 8:24 AM? 4:00 PM What is 54 minutes after 4:11 AM? 5:05 AM How many minutes are there between 2:03 PM and 3:35 PM? 92 How many minutes are there between 4:48 AM and 12:12 PM? 444 What is 254 minutes after 5:00 PM? 9:14 PM What is 553 minutes before 4:53 AM? 7:40 PM What is 617 minutes after 1:57 PM? 12:14 AM How many minutes are there between 4:35 PM and 2:42 AM? 607 What is 572 minutes after 10:20 PM? 7:52 AM How many minutes are there between 3:49 AM and 5:50 AM? 121 What is 253 minutes before 7:21 PM? 3:08 PM What is 355 minutes before 4:06 AM? 10:11 PM How many minutes are there between 2:50 AM and 2:33 PM? 703 What is 404 minutes after 6:06 PM? 12:50 AM What is 410 minutes before 12:48 PM? 5:58 AM How many minutes are there between 10:35 PM and 4:16 AM? 341 How many minutes are there between 2:21 PM and 9:24 PM? 423 What is 246 minutes after 7:34 AM? 11:40 AM How many minutes are there between 12:27 PM and 12:26 AM? 719 How many minutes are there between 5:23 PM and 3:08 AM? 585 What is 274 minutes before 11:32 AM? 6:58 AM How many minutes are there between 10:04 AM and 3:06 PM? 302 How many minutes are there between 10:18 PM and 8:29 AM? 611 What is 49 minutes before 8:05 AM? 7:16 AM How many minutes are there between 7:22 PM and 6:53 AM? 691 What is 657 minutes after 8:52 AM? 7:49 PM What is 405 minutes after 6:26 PM? 1:11 AM What is 237 minutes after 6:22 PM? 10:19 PM How many minutes are there between 6:49 AM and 1:34 PM? 405 What is 710 minutes before 1:22 PM? 1:32 AM What is 657 minutes before 2:33 PM? 3:36 AM What is 665 minutes before 3:55 AM? 4:50 PM How many minutes are there between 5:36 AM and 7:07 AM? 91 How many minutes are there between 6:28 PM and 1:18 AM? 410 How many minutes are there between 1:55 PM and 5:53 PM? 238 What is 391 minutes before 2:05 PM? 7:34 AM How many minutes are there between 11:33 AM and 9:42 PM? 609 How many minutes are there between 6:42 PM and 4:02 AM? 560 What is 591 minutes before 9:43 PM? 11:52 AM What is 195 minutes before 12:10 AM? 8:55 PM How many minutes are there between 6:32 PM and 4:16 AM? 584 How many minutes are there between 7:17 PM and 4:23 AM? 546 What is 67 minutes before 9:23 AM? 8:16 AM How many minutes are there between 8:21 PM and 9:03 PM? 42 What is 320 minutes before 4:24 AM? 11:04 PM How many minutes are there between 6:47 PM and 1:51 AM? 424 How many minutes are there between 12:47 AM and 10:59 AM? 612 How many minutes are there between 5:39 AM and 11:02 AM? 323 What is 428 minutes before 6:47 PM? 11:39 AM What is 558 minutes before 5:13 PM? 7:55 AM How many minutes are there between 4:15 PM and 5:09 PM? 54 How many minutes are there between 11:04 PM and 5:30 AM? 386 How many minutes are there between 5:37 AM and 3:53 PM? 616 What is 652 minutes before 7:16 PM? 8:24 AM How many minutes are there between 9:05 AM and 6:37 PM? 572 What is 274 minutes after 8:28 AM? 1:02 PM How many minutes are there between 4:05 PM and 2:36 AM? 631 What is 10 minutes before 9:15 PM? 9:05 PM What is 504 minutes after 3:25 AM? 11:49 AM What is 293 minutes after 7:49 PM? 12:42 AM How many minutes are there between 9:34 AM and 6:52 PM? 558 How many minutes are there between 9:10 AM and 1:06 PM? 236 What is 155 minutes before 9:19 AM? 6:44 AM What is 254 minutes after 6:37 AM? 10:51 AM How many minutes are there between 11:57 AM and 4:55 PM? 298 How many minutes are there between 11:50 PM and 7:51 AM? 481 What is 539 minutes after 3:25 AM? 12:24 PM How many minutes are there between 5:16 PM and 6:05 PM? 49 How many minutes are there between 9:50 PM and 8:47 AM? 657 What is 612 minutes before 7:03 PM? 8:51 AM How many minutes are there between 2:08 AM and 10:48 AM? 520 What is 69 minutes after 1:26 PM? 2:35 PM How many minutes are there between 1:24 AM and 11:21 AM? 597 What is 689 minutes after 1:34 PM? 1:03 AM What is 141 minutes after 5:28 AM? 7:49 AM How many minutes are there between 3:37 AM and 8:57 AM? 320 How many minutes are there between 9:04 AM and 1:50 PM? 286 How many minutes are there between 4:10 PM and 6:32 PM? 142 How many minutes are there between 4:47 AM and 5:07 AM? 20 What is 39 minutes before 11:40 PM? 11:01 PM What is 101 minutes before 1:34 AM? 11:53 PM How many minutes are there between 4:59 PM and 2:27 AM? 568 How many minutes are there between 3:12 PM and 4:12 PM? 60 What is 202 minutes before 11:21 PM? 7:59 PM How many minutes are there between 4:59 PM and 10:43 PM? 344 What is 144 minutes after 5:16 PM? 7:40 PM How many minutes are there between 4:58 AM and 2:07 PM? 549 How many minutes are there between 8:42 AM and 1:25 PM? 283 How many minutes are there between 8:24 AM and 9:24 AM? 60 What is 665 minutes after 12:18 AM? 11:23 AM How many minutes are there between 12:45 PM and 8:39 PM? 474 What is 165 minutes before 4:30 AM? 1:45 AM What is 25 minutes before 11:51 PM? 11:26 PM What is 419 minutes after 5:33 PM? 12:32 AM How many minutes are there between 7:52 PM and 10:57 PM? 185 What is 546 minutes after 3:35 PM? 12:41 AM What is 305 minutes before 9:09 PM? 4:04 PM How many minutes are there between 11:33 PM and 12:06 AM? 33 What is 331 minutes after 7:14 PM? 12:45 AM How many minutes are there between 3:11 AM and 4:04 AM? 53 How many minutes are there between 1:57 AM and 6:36 AM? 279 How many minutes are there between 4:33 AM and 5:00 AM? 27 What is 360 minutes after 8:01 AM? 2:01 PM How many minutes are there between 7:26 PM and 12:47 AM? 321 What is 589 minutes before 10:06 PM? 12:17 PM What is 373 minutes before 5:23 PM? 11:10 AM How many minutes are there between 8:40 PM and 9:40 PM? 60 How many minutes are there between 12:51 PM and 7:55 PM? 424 What is 331 minutes before 7:41 PM? 2:10 PM What is 492 minutes after 10:22 AM? 6:34 PM How many minutes are there between 12:21 AM and 10:12 AM? 591 What is 682 minutes after 2:09 PM? 1:31 AM How many minutes are there between 11:57 AM and 8:13 PM? 496 What is 185 minutes before 8:13 AM? 5:08 AM What is 167 minutes before 8:38 PM? 5:51 PM What is 492 minutes before 8:31 PM? 12:19 PM How many minutes are there between 12:09 AM and 10:01 AM? 592 What is 652 minutes before 1:36 PM? 2:44 AM What is 153 minutes after 8:04 AM? 10:37 AM How many minutes are there between 1:37 PM and 2:17 PM? 40 What is 52 minutes after 10:18 AM? 11:10 AM How many minutes are there between 11:08 PM and 4:23 AM? 315 How many minutes are there between 1:15 PM and 10:43 PM? 568 What is 586 minutes after 11:30 PM? 9:16 AM What is 453 minutes after 3:12 PM? 10:45 PM How many minutes are there between 9:06 AM and 2:11 PM? 305 How many minutes are there between 5:15 AM and 1:38 PM? 503 What is 504 minutes after 10:36 AM? 7:00 PM What is 59 minutes after 2:08 AM? 3:07 AM How many minutes are there between 9:13 PM and 8:13 AM? 660 What is 53 minutes after 11:11 PM? 12:04 AM What is 354 minutes before 7:42 AM? 1:48 AM What is 647 minutes after 1:09 AM? 11:56 AM What is 77 minutes before 8:24 PM? 7:07 PM How many minutes are there between 4:43 AM and 4:27 PM? 704 How many minutes are there between 12:10 PM and 12:29 PM? 19 How many minutes are there between 1:23 AM and 4:24 AM? 181 What is 507 minutes after 12:47 AM? 9:14 AM What is 552 minutes before 10:29 PM? 1:17 PM How many minutes are there between 4:03 PM and 6:58 PM? 175 How many minutes are there between 12:23 AM and 9:22 AM? 539 How many minutes are there between 8:03 AM and 5:58 PM? 595 What is 254 minutes before 3:34 PM? 11:20 AM How many minutes are there between 10:47 AM and 8:19 PM? 572 How many minutes are there between 11:22 AM and 2:46 PM? 204 How many minutes are there between 7:27 AM and 8:23 AM? 56 How many minutes are there between 12:01 PM and 8:09 PM? 488 What is 454 minutes before 12:41 PM? 5:07 AM How many minutes are there between 11:46 AM and 7:28 PM? 462 What is 155 minutes after 11:18 AM? 1:53 PM How many minutes are there between 5:55 PM and 9:12 PM? 197 H	{ "pile_set_name": "DM Mathematics" }
ve -2h + 3g = 5, fh = 3g + 3 + 2 for h. 5 Suppose 0 = z - 11 + 8. Let f = -19 + 35. Let n be f/7 - (-2)/(-7). Solve p - 1 = za, 3p + 10 = -2a - na for p. -2 Let t = -14 - -8. Let n(o) = o*2 + 5o + 3. Let f be n(t). Solve -2p - p = 3z + f, 5z + 7 = -3p for p. -4 Suppose -3q = 5w - 7q - 70, -2w - 2q + 10 = 0. Suppose -w = -l + 4. Solve -4f + 3c - 1 = -6, 5c + l = f for f. -1 Let j be 2/(-10) - (-126)/30. Let b be 4/6 - (-21)/9. Solve -2n = -ja - 22, -2n - 1 = -b for a. -5 Let d = 1 - -12. Solve 4w + 5l = 30, -2w - 4l = -w - d for w. 5 Suppose 2h - 1 = -0d + 3d, -2d - 6 = 0. Let m be h/(-8) + 1/2. Let f be (-6 + 4)/(m-1). Solve fp + 2o - 9 = o, 3p + 6 = 5o for p. 3 Suppose -5k + 2k = -4a - 3, 0 = 4k + 2a - 26. Solve 0 = kg + 5n - 5, -4 = 3g - 6n + 2n for g. 0 Let w(f) = f - 1. Let h be w(2). Let r = -48 + 33. Let i be 2/3(-3 - r). Solve -h = -m + v, 2m - 3v + 5 = i for m. 0 Let o(w) = 5w*3 - 2w + 2. Let d be o(1). Solve 14 - 5 = 4g + dn, -5 = -5n for g. 1 Suppose -2m - 4m + 24 = 0. Solve t = -t - 3v - 12, 4v + 16 = mt for t. 0 Let d(b) = -b*3 + 4b*2 - 3b + 1. Let f be d(3). Suppose -f + 2 = -i. Let o = i + 2. Solve -5u + o = -3w - 6, 0 = 2w + 8 for u. -1 Suppose 0 - 10 = -2d. Suppose dl = 3l. Solve 3t - 9 = -4i, 4i = -t - lt + 11 for i. 3 Suppose -18m + m + 85 = 0. Solve -20 = 2t + 3j - 7, -j = m for t. 1 Let n = -18 + 21. Suppose -1 = -3v + 2. Let b be (3 + -1)/v + 0. Solve 0 = bq - 2d, -4q - nd - 4 = 10 for q. -2 Let b(f) = -f*3 - 3f*2 - f - 1. Let o be b(-3). Solve 2u + 18 = 2d + od, 0 = d - 2u - 9 for d. 3 Let v be 4(-3)/(-9)9. Suppose 34 = 2m - 5y + 3, 3y + v = -m. Solve 0 = -2k - r + 2, 3r = -mk - 0k for k. 2 Let l = 30 + -23. Let w(f) = f - 3. Let x be w(l). Solve 4s - y = 1, -xy - 4 = s - 0s for s. 0 Let a be (-32)/56(-14)/4. Solve -3d + 3b - 6b + 24 = 0, -d - ab + 11 = 0 for d. 5 Let r = 54 + -38. Suppose u + 2i - 10 = 0, 37 = 2u + 2u + 5i. Suppose -u = 2b - 4b. Solve 5y - 2s - s = 37, -r = bs for y. 5 Let s be (87/(-9) + 3)3. Let t = -17 - s. Solve -4h - t = -u, -4u = -6u + 5h + 3 for u. -1 Let c be -1((-12)/2 - 2). Let m = c + -5. Solve o - 19 = -mo - 5g, -2o - g + 5 = 0 for o. 1 Suppose 0 = -4s - 2a - 52, 2a + 3a + 75 = -5s. Let p be (-2)/6(s - -5). Solve 5r - 9 = -pz, -2r + 5z = -0z + 8 for r. 1 Suppose 0d - 2d = -6. Solve -4y = 5a + 41, -3y + y - 23 = da for y. -4 Let q(b) = -b2 + 6b - 10. Let u be q(4). Let s(k) = 0 + k - 1 + 2 + k*2. Let x be s(u). Solve -xp - 5j - 37 = 0, -5p = 3j + 37 - 2 for p. -4 Let o(n) = n3 + 6n*2 - 9n - 4. Let u = 17 + -24. Let q be o(u). Let t = q - 0. Solve 4x - 2m = t - 0, 3m + 7 = 2x for x. 2 Let c = -128 + 128. Solve -2x + 4n = -13 + 1, -5x + 2n + 14 = c for x. 2 Let k be (-16)/40(0 + -40). Solve m - 12 = 6m - 3a, -5m - a = k for m. -3 Let d(x) = x + 4. Let j be d(-4). Suppose 2b = 6b - 28. Solve 0 = -5s + 3o + 18, j = -3s + 3o - bo + 5 for s. 3 Let m(b) = 3b + 26b2 + 20b*2 - 3 - 45b*2 + 1. Let p be m(-4). Solve -pa + 4v - 8 = 2a, 8 = -4a + v for a. -2 Suppose 5v + 2m - 17 = 6, 5v = 4m - 1. Let z be (v - (-21)/6)2. Solve 2t - z = 7t - 2x, -4t + x - 8 = 0 for t. -1 Suppose 0m - m + 4 = 0. Let r(z) = -z3 + 3z*2 + 5z. Let f be r(m). Solve -2c - 4 = 2c + y, -fy = 3c + 16 for c. 0 Let f be 2/8 - 1/4. Suppose 5c - 3y - 42 = 0, -4y + 40 = 5c - c. Let n be c/68/6. Solve -2s + 3o - n = 4, -5s + 5o - 15 = f for s. -3 Suppose 12 = -4d - 4k, -3d + 3k - 7 = 4k. Let n(q) = 2q2 + 3q + 1. Let t be n(d). Solve -2x + 5 = -2i - 7, tx - 9 = 0 for i. -3 Let i be (2 - 4)/((-4)/(-22)). Let x = -7 - i. Let p be 18/10 + (-2)/(-10). Solve -6q + 2q - 5l - 10 = 0, pl + x = -4q for q. 0 Let o = 99 + -99. Solve -2x - 8 = -k, ok + 7 = 5k + x for k. 2 Let y = -6 - -7. Let n be -2 - (-2 + (3 - y)). Let p be (-8)/(-6)(1 - n). Solve 0 = c - u, -p + 1 = c - 4u for c. 1 Suppose 3c - 24 = -4f, -3c - 2c - 5f = -35. Solve -l = -3w + 17, -10 = -cw - 5l - 0l for w. 5 Let n be 2/(-7) - (-80)/35. Solve -5u - 15 = -ni, -3i + 0 + 6 = -2u for u. -3 Let h = -28 - -31. Solve 4a - 3o - 20 = 0, a - o = -ho + 5 for a. 5 Suppose 5k + s = -17 - 9, 4s = 2k + 6. Let u be (-2)/k(5 - 0). Suppose -3n + 100 = n. Solve -4q - u = 3m - 1, -5m - n = -5q for m. -3 Suppose 4n + n = 10. Suppose -3x - nx + 20 = 0. Suppose a = -5, -2k + 7k = xa + 45. Solve -11 = h - 3m, km + 5 = -3h - 0m for h. -5 Let x = 77 - 60. Solve -7 - x = 4i + 4h, 3i + 2h = -16 for i. -4 Let a = 13 + -10. Solve ab - 2m - 2 = -b, 3b + 6 = -m for b. -1 Let x be 3/(1/(3/(-3))). Let s be (-2)/6 + (-61)/x. Solve -n + 3n + 8 = 2j, 0 = 5j - s for n. 0 Let t be 3(-96)/(1 - 5). Let k be (t/(-2 - 2))/(-1). Solve o - 2h = 2h + k, 5h + 25 = 0 for o. -2 Let z = -7 - -17. Suppose o = 4m + 24 - 9, -o = 3m - 1. Let p(i) = i*3 - 8i*2 + 8i - 2. Let g be p(o). Solve d = u - 2 + z, -3d - gu = 16 for d. 3 Let x(h) = h2 - 2. Let i be x(2). Let v(z) = z3 - 8z2 - 9z + 3. Let t be v(9). Solve -tj + io + 1 = 0, -2o - 32 = 5j - 7 for j. -3 Let g be ((-4)/3)/((-2)/3). Let r = -171 + 177. Solve -b - r = gd - d, d = -2b - 8 for d. -4 Let k(j) = j2 + j + 5. Let n be k(0). Let z(f) = f2 + 7f - 4. Suppose 19 = 5p + 59. Let w be z(p). Solve -i + ws + 7 = 2, ni - 5s = -5 for i. -3 Let s be (40/35)/(-4) + 142/7. Solve -20 = 5y - 3w + s, -3y = 3w for y. -5 Suppose -5a - 17 = -0o + 2o, 4a = 3o - 32. Solve -g - 10 = 4g + 5x, 3g - 29 = ox for g. 3 Let d(o) be the first derivative of o*2/2 + 7o + 3. Let h be d(7). Solve -5s = a + a + 20, h = -4a + 3s for a. -5 Let n(i) = i2 + 4i - 9. Let y be n(-7). Solve 7 - 1 = -4c - 2f, 3c + 3f = -y for c. 1 Suppose -2t = 4n + 30, -t - 2t = 5n + 40. Let u = -3 - n. Solve 4k = -s + 5, 4s - uk = -k - 14 for s. -3 Suppose -4y - 3u = 15, 3y - u + 2 - 7 = 0. Solve y = 5i + 5, -i = -8t + 3t + 6 for t. 1 Let y = -21 - -18. Let f be (12 + -10)y/(-2). Solve 4o = fq + 12, -2q - 15 = q - 5o for q. 0 Suppose 20 = m + 4m. Suppose -12 = -3t - 2s, 0 = 2t - mt - s + 8. Let x be 14/t + (-6)/12. Solve 12 = xy + 5h, -y = 4y - 2h - 20 for y. 4 Let r be (-2)/(-7) - 1476/(-126). Solve 2n - q = 6n + 6, 0 = -2n + 4q - r for n. -2 Let u(s) = 14s*2. Let g be u(2). Let q = -37 + g. Let j(z) = -z + 23. Let b be j(21). Solve -h = bh + 2i - q, -2i = -5h + 5 for h. 3 Let y be 18/5 - (-14)/35. Solve -i - yl = -3 - 5, 2l = -2i + 4 for i. 0 Let q = 3 - 3. Solve q = 4y - 4a + 28, 0 = 5y - 0a - 3a + 27 for y. -3 Let n = -20 - -24. Solve -nd = 3v - 2 - 1, -4v = -5d + 27 for v. -3 Let j(z) = -5z. Let f be j(-5). Suppose -3v = -3q + 18, 0v + 15 = 4q - v. Solve -qa + f = 5s + 2a, s = -4a + 17 for s. 1 Let l(z) = 24z + 1. Let f be 3/9(2 - 5). Let w be l(f). Let q = 32 + w. Solve 5m - 10 = t + 2m, 3t + 4m = q for t. -1 Let j(k) = -k + 16. Let l be j(12). Solve -q - 2 = -4s, -lq - 2s + 7 = -3 for q. 2 Suppose 4f + 10 = 6f. Let c(p) = -p2 + 7p - 6. Let i be c(4). Let r(n) = -n + 6. Let s be r(3). Solve -sd + d = -3m + i, -5d + fm = 10 for d. 0 Suppose -q - 5u + 24 = 0, 0 = 4q + 2u + 4 - 28. Solve 2s + 29 = -5o, 3s + qo + 11 = 3o for s. -2 Let j = 6 + -9. Let i be (2 + (-8 - j))-1. Solve b = -x - i, 5b - 1 = -3x - 8 for x. -4 Let i(f) = -f2 - 4f - 3. Suppose -2t + 4 = -h, 6 - 5 = t. Let d be i(h). Solve -3p = -2r - 0 + 3, -p + r - d = 0 for p. -1 Suppose 6y = 3y + 12. Suppose -3p = -yp + 2. Solve 3r = 8r + 3t + 5, pt = -10 for r. 2 Let y(d) be the first derivative of d2/2 + d - 5. Let u be y(-1). Solve -11 = 3s - ur + 2r, -r - 7 = 2s for s. -3 Suppose -3l = 1 - 4. Suppose -2d + 13 = 3a, 0 = d - 2a - l - 2. Solve w - 3p + 7 = p, 5w = dp + 10 for w. 5 Let k = 3 + -3. Let l be (-25)/(1/(-1)) + k. Suppose -j = 4q - l, 5q - j = 2 + 18. Solve -11 = 2v + w, -1 = qv + 3w + 29 for v. -3 Let f = 28 - 23. Solve 0p + p - 1 = o, 0 = -5o - f for p. 0 Suppose z + 1 = -3q, -z - q = -2z + 3. Solve -t = zx + 1, 0 = -2x + x + 2 for t. -5 Suppose -10 = -5n - 0n. Let s be (5/3 - n)-24. Suppose -s =	{ "pile_set_name": "DM Mathematics" }
of 1072s3z*2 - 522669s*3 + 34s*2z*3 wrt z. 2144s*3z + 102s2z*2 Find the third derivative of -4o*6 - 2989o5 - o3 + 8o2 - 6421 wrt o. -480o*3 - 179340o*2 - 6 Differentiate -55481jl3 - 4jx + 618930l*3x with respect to j. -55481l3 - 4x Find the first derivative of -3194m3 - 3m*2 + 53365 wrt m. -9582m*2 - 6m What is the derivative of -8227w2y*3 - 63w*2y*2 - 472367w*2 wrt y? -24681w*2y*2 - 126w*2y What is the second derivative of 13c2w2 + c2w + 107163cw2 + 2cw - 188c + 22w - 3 wrt w? 26c*2 + 214326c What is the derivative of 59733d2 - 1020760? 119466d What is the second derivative of -1015094p2 + 25p - 12685? -2030188 What is the second derivative of -65621du*4 - 935du - 44d wrt u? -787452du*2 Find the second derivative of -1237o*3s*3 + 4o*3s*2 + 2o*3 + 5762o*2s - 3s3 wrt s. -7422o*3s + 8o3 - 18s Find the first derivative of 7u3 - 6u*2 + 24042u - 152505. 21u2 - 12u + 24042 What is the second derivative of -5b2f*3p2 - b2f + 302bf3p + 8bf*3 - bp + 2619fp*2 wrt p? -10b*2f*3 + 5238f Differentiate -2nw*3 - 14nw2 - 389n - 174471w3 + w wrt n. -2w*3 - 14w2 - 389 What is the second derivative of r2s2 - 64r*2s + 2r2 + 16rs3 - 3r - 75s5 + 4s - 4 wrt s? 2r2 + 96rs - 1500s*3 Find the second derivative of 856928m*2 - 4m + 458. 1713856 Find the third derivative of -25b5 + 5b*4 + 79b*3 - 346791b*2 wrt b. -1500b*2 + 120b + 474 Find the third derivative of 173045b3i - 2b2i + 9bi + 20335i - 1 wrt b. 1038270i What is the third derivative of -813637l3 + 26598l*2? -4881822 Find the third derivative of -31793fz3 - 200633fz2 wrt z. -190758f Differentiate 19672qz*3 + qz - 3q + 145816z*3 wrt q. 19672z*3 + z - 3 Find the second derivative of 68g*3 + 487g*2 - 16773g + 6. 408g + 974 Find the second derivative of -495iks*3 - 12iks - 6is - i - 2ks*3 + 4ks2 + 11ks - 2s wrt s. -2970iks - 12ks + 8k What is the third derivative of 7u4 - 4371u*3 + 5567u*2 - 2 wrt u? 168u - 26226 Find the second derivative of 32cr*3 - 4cr - 32c + 1979r3 - 9r - 9 wrt r. 192cr + 11874r What is the second derivative of -367809z*2 + 96z + 598 wrt z? -735618 What is the first derivative of z*4 - 4z*2 - 408z - 12530 wrt z? 4z3 - 8z - 408 Find the second derivative of 1922406j2s*3t*2 + 2j*2st2 - 10js3t + 9921js*3 + 4js2t*2 wrt j. 3844812s*3t*2 + 4st2 Find the second derivative of 4i*3n*2w - 103i3nw - 7i*3n + 63i3w + 36346in*2w wrt n. 8i3w + 72692iw Find the third derivative of 272857h3 - 1356450h2 wrt h. 1637142 Find the second derivative of -z5 - 7865z4 - 3z*2 - 613z - 244. -20z3 - 94380z*2 - 6 Find the second derivative of -54u*5 - 42u*3 - 92963u. -1080u3 - 252u Find the third derivative of -191d5 - 182d*4 - 2d*3 - 6d*2 + 29199 wrt d. -11460d*2 - 4368d - 12 What is the second derivative of -20b4 + 3b*3 - 13b*2 - 806b + 219? -240b2 + 18b - 26 What is the third derivative of -v*3z*3 - 2v*3 + 12v*2 + 18vz2 + 251132z*4 + z - 2 wrt z? -6v*3 + 6027168z Find the first derivative of -5252882gn*2 - 4n*2 + 4482n - 4 wrt g. -5252882n2 Differentiate 2bch*2 + 140bc + 23560b - ch2 + 33c - 4h2 wrt c. 2bh2 + 140b - h*2 + 33 What is the derivative of -1216p*3 + 1020p + 3703060? -3648p2 + 1020 What is the first derivative of 5gim*2 - 1101608gm3 - 49170im3 wrt i? 5gm2 - 49170m*3 Find the third derivative of -174q*6 - 4q*3u2 - q2u2 + 2q*2 - 6004q wrt q. -20880q3 - 24u*2 Find the second derivative of -26024k*2 + 25937k wrt k. -52048 What is the second derivative of 7r4 - 1823r*3 + 383948r wrt r? 84r2 - 10938r What is the second derivative of 137040g3 - 264241g wrt g? 822240g Find the first derivative of -1207r*3 + 46r - 208558. -3621r2 + 46 Find the second derivative of -6i*3 + 1859i*2 - 104i - 2297. -36i + 3718 What is the second derivative of h2lx3 - 4h*2l - 53hlx - 7lx - 162x*3 - 10x*2 - 2x wrt x? 6h2lx - 972x - 20 What is the third derivative of -57313g3y3 - g3y + g2y*2 - 19g*2y - gy wrt y? -343878g*3 Find the third derivative of 12932z4 + z3 + 662z2 - 79 wrt z. 310368z + 6 What is the third derivative of 4p5 - 11487p4 - p3 + 8p2 - 339p - 1? 240p2 - 275688p - 6 What is the derivative of 115004s3 + 2739 wrt s? 345012s*2 What is the third derivative of 17b*4kq - 14b*4k + 89b3q + 418b2 + 2bk + 20bq wrt b? 408bkq - 336bk + 534q What is the second derivative of -100a*4 - 398a*3 - 922201a? -1200a2 - 2388a What is the derivative of 52278i2 - 9i - 173239 wrt i? 104556i - 9 Differentiate 2s*4 - 1261s*3 + 8s + 8766. 8s3 - 3783s*2 + 8 What is the second derivative of 2f*4 - 48f*3 + 43f*2 - f - 141795? 24f*2 - 288f + 86 Find the third derivative of -13487z6 + 27553z*2 wrt z. -1618440z*3 What is the third derivative of 7c*3fj2m + 46c3fj + 398c*3f - 1134c2fj + 11cfj*2m + 47cfjm wrt c? 42fj*2m + 276fj + 2388f What is the second derivative of -42245f*5j*3 - 24f*5j - 1803fj*3 - 498fj2 wrt f? -844900f*3j*3 - 480f*3j What is the second derivative of -93787i3 - 41i + 284 wrt i? -562722i What is the second derivative of -d2r*2 - 2d*2r - 133379d2 + 14367dr2 - 5dr wrt d? -2r*2 - 4r - 266758 What is the first derivative of -213962iz*3 - 155943i - 2z4 wrt z? -641886iz2 - 8z*3 Find the second derivative of -23jz3 - 26jz - 12j + 2z3 + 454z*2 + z - 1 wrt z. -138jz + 12z + 908 Find the second derivative of 76565mn*4 + 14mn - 3m + 21n wrt n. 918780mn2 Differentiate -2o*2p + 2o2 - 979op + 10o - 59754p wrt o. -4op + 4o - 979p + 10 Differentiate -4n*2o*2w*2 - 370628n*2w*2 - 64838o*2 + 23w*2 wrt n. -8no2w*2 - 741256nw2 What is the derivative of 200t*3 + 160t*2 + 48910 wrt t? 600t*2 + 320t What is the second derivative of b*2o*3 - 2b*2o2 - b2 - 20o4 - 1035o wrt o? 6b2o - 4b2 - 240o*2 What is the third derivative of 17c*4x2 + c4 - 175c3 - 30c*2x + 122cx*2 wrt c? 408cx2 + 24c - 1050 What is the derivative of -163586o2 - 134248? -327172o What is the second derivative of 65269t3 - 48376t wrt t? 391614t What is the second derivative of 49119w*2 + 3w - 9558? 98238 Find the third derivative of 10g5x*2 + 7083g*3x - 15g2 - 81gx2 - 267x wrt g. 600g2x*2 + 42498x Find the second derivative of 23007bw*2 - 2b - 6749w + 2 wrt w. 46014b Differentiate 158j4 - 4809j*3p*2 + 4p*2 - 17229p - 11 wrt j. 632j3 - 14427j*2p*2 What is the first derivative of -2123015j*2 - 463860? -4246030j What is the second derivative of -510266a2 - 678023a? -1020532 What is the second derivative of -2503802i2 - 2456617i? -5007604 What is the second derivative of 246t2 - 82t - 56? 492 Find the second derivative of 187c5 + 2c*4 - 67c*2 - 63953c wrt c. 3740c3 + 24c*2 - 134 Find the first derivative of 160a*4 + 65a*3 - 357883. 640a*3 + 195a*2 Differentiate 193758di2 + i2 - 21i - 1709 wrt d. 193758i2 What is the first derivative of 4x*2 + 16835x - 26941 wrt x? 8x + 16835 What is the derivative of 2r*3 + 5725r*2 + 9413 wrt r? 6r*2 + 11450r Differentiate -819609o3w*2 + 3o*3 + 149535o wrt w. -1639218o3w What is the first derivative of -a*4 - 6a3 - a2 - 6219a + 4074880? -4a*3 - 18a*2 - 2a - 6219 Find the second derivative of 4d2r*2 + 2d*2 + 27717dr2 - 398dr + 156d wrt r. 8d2 + 55434d Find the third derivative of 5995o3u + o*3 + 113o*2u - 5o2 + 4ou - 31o wrt o. 35970u + 6 What is the first derivative of 41b*2 - 12b - 15084 wrt b? 82b - 12 What is the derivative of -4p*2 + 978py - 5y - 48 wrt p? -8p + 978y Find the second derivative of -1	{ "pile_set_name": "DM Mathematics" }
etween 9:54 AM and 7:35 PM? 581 How many minutes are there between 3:53 AM and 6:59 AM? 186 What is 6 minutes after 5:31 AM? 5:37 AM What is 104 minutes after 9:27 AM? 11:11 AM What is 595 minutes after 12:49 AM? 10:44 AM What is 176 minutes after 9:13 AM? 12:09 PM What is 325 minutes before 10:15 AM? 4:50 AM How many minutes are there between 2:16 PM and 3:38 PM? 82 How many minutes are there between 8:53 AM and 8:55 AM? 2 What is 69 minutes before 1:09 PM? 12:00 PM What is 491 minutes after 11:13 AM? 7:24 PM What is 445 minutes before 5:49 AM? 10:24 PM What is 253 minutes after 5:30 PM? 9:43 PM How many minutes are there between 12:33 PM and 10:38 PM? 605 How many minutes are there between 8:03 AM and 5:23 PM? 560 How many minutes are there between 3:23 AM and 8:02 AM? 279 How many minutes are there between 8:28 PM and 9:28 PM? 60 How many minutes are there between 9:00 PM and 1:20 AM? 260 What is 77 minutes before 10:50 PM? 9:33 PM What is 505 minutes after 5:50 AM? 2:15 PM How many minutes are there between 9:44 PM and 9:02 AM? 678 How many minutes are there between 10:44 PM and 11:09 PM? 25 What is 211 minutes before 11:08 AM? 7:37 AM What is 52 minutes after 5:15 PM? 6:07 PM What is 543 minutes after 12:55 PM? 9:58 PM What is 14 minutes after 4:10 PM? 4:24 PM What is 341 minutes before 5:30 PM? 11:49 AM What is 559 minutes after 8:42 AM? 6:01 PM What is 328 minutes before 3:36 PM? 10:08 AM What is 166 minutes after 8:28 PM? 11:14 PM How many minutes are there between 10:47 PM and 7:42 AM? 535 What is 313 minutes before 9:13 AM? 4:00 AM How many minutes are there between 11:12 PM and 3:37 AM? 265 How many minutes are there between 11:21 AM and 9:46 PM? 625 How many minutes are there between 3:03 PM and 4:10 PM? 67 What is 719 minutes after 8:25 AM? 8:24 PM What is 54 minutes after 3:26 AM? 4:20 AM How many minutes are there between 10:55 AM and 11:01 AM? 6 What is 110 minutes after 3:13 AM? 5:03 AM What is 387 minutes before 11:24 PM? 4:57 PM How many minutes are there between 10:05 AM and 8:10 PM? 605 What is 98 minutes after 9:55 AM? 11:33 AM How many minutes are there between 8:32 PM and 7:13 AM? 641 How many minutes are there between 12:01 AM and 8:45 AM? 524 How many minutes are there between 4:48 AM and 1:09 PM? 501 How many minutes are there between 11:48 AM and 2:24 PM? 156 What is 492 minutes before 7:56 AM? 11:44 PM How many minutes are there between 7:17 PM and 5:47 AM? 630 What is 48 minutes before 5:49 PM? 5:01 PM How many minutes are there between 12:33 AM and 5:07 AM? 274 How many minutes are there between 12:25 PM and 1:17 PM? 52 How many minutes are there between 4:12 PM and 5:29 PM? 77 How many minutes are there between 3:59 AM and 5:06 AM? 67 How many minutes are there between 12:09 AM and 7:57 AM? 468 How many minutes are there between 3:50 PM and 2:45 AM? 655 What is 560 minutes before 7:09 AM? 9:49 PM What is 420 minutes after 11:45 PM? 6:45 AM How many minutes are there between 1:34 AM and 3:02 AM? 88 What is 532 minutes before 8:13 AM? 11:21 PM What is 60 minutes after 11:59 AM? 12:59 PM How many minutes are there between 4:50 PM and 12:43 AM? 473 How many minutes are there between 12:21 PM and 12:57 PM? 36 How many minutes are there between 1:55 AM and 4:42 AM? 167 What is 313 minutes after 2:17 PM? 7:30 PM What is 172 minutes after 9:37 AM? 12:29 PM What is 166 minutes after 12:26 AM? 3:12 AM How many minutes are there between 9:39 AM and 6:42 PM? 543 What is 246 minutes after 8:23 AM? 12:29 PM What is 195 minutes before 4:07 PM? 12:52 PM What is 588 minutes before 10:58 PM? 1:10 PM What is 399 minutes after 8:10 AM? 2:49 PM How many minutes are there between 12:18 AM and 2:08 AM? 110 How many minutes are there between 4:45 AM and 2:28 PM? 583 How many minutes are there between 6:27 AM and 10:51 AM? 264 How many minutes are there between 4:55 PM and 10:20 PM? 325 What is 419 minutes after 12:50 AM? 7:49 AM How many minutes are there between 9:58 PM and 12:10 AM? 132 What is 110 minutes after 7:36 PM? 9:26 PM How many minutes are there between 9:41 AM and 5:23 PM? 462 How many minutes are there between 6:51 AM and 6:46 PM? 715 What is 644 minutes before 3:47 AM? 5:03 PM What is 203 minutes after 7:40 PM? 11:03 PM How many minutes are there between 8:42 AM and 9:41 AM? 59 How many minutes are there between 7:19 AM and 9:38 AM? 139 What is 401 minutes before 11:09 AM? 4:28 AM What is 473 minutes before 7:58 AM? 12:05 AM What is 456 minutes before 3:24 PM? 7:48 AM What is 589 minutes after 6:42 PM? 4:31 AM What is 33 minutes before 4:40 AM? 4:07 AM What is 98 minutes after 5:00 AM? 6:38 AM What is 501 minutes before 11:57 PM? 3:36 PM What is 576 minutes before 12:15 PM? 2:39 AM What is 420 minutes before 9:50 AM? 2:50 AM What is 680 minutes before 1:18 AM? 1:58 PM How many minutes are there between 1:25 PM and 8:26 PM? 421 How many minutes are there between 8:06 PM and 10:13 PM? 127 How many minutes are there between 8:12 AM and 2:51 PM? 399 What is 559 minutes before 4:33 PM? 7:14 AM What is 277 minutes after 7:24 PM? 12:01 AM What is 660 minutes after 12:18 PM? 11:18 PM How many minutes are there between 4:54 PM and 2:50 AM? 596 How many minutes are there between 5:16 PM and 5:56 PM? 40 How many minutes are there between 3:55 PM and 2:12 AM? 617 How many minutes are there between 3:10 AM and 1:35 PM? 625 What is 587 minutes after 9:51 PM? 7:38 AM What is 250 minutes before 2:04 PM? 9:54 AM How many minutes are there between 9:23 PM and 9:13 AM? 710 What is 685 minutes before 8:20 PM? 8:55 AM What is 145 minutes after 9:49 AM? 12:14 PM How many minutes are there between 6:58 PM and 4:43 AM? 585 What is 159 minutes before 7:49 PM? 5:10 PM What is 166 minutes after 8:35 AM? 11:21 AM How many minutes are there between 7:33 PM and 12:38 AM? 305 How many minutes are there between 7:12 AM and 12:25 PM? 313 How many minutes are there between 4:38 PM and 9:02 PM? 264 What is 266 minutes before 4:54 PM? 12:28 PM How many minutes are there between 9:33 AM and 8:40 PM? 667 What is 709 minutes after 9:46 PM? 9:35 AM What is 342 minutes after 10:38 AM? 4:20 PM How many minutes are there between 10:24 PM and 5:36 AM? 432 How many minutes are there between 9:24 PM and 8:16 AM? 652 What is 623 minutes before 1:42 PM? 3:19 AM What is 564 minutes after 3:36 AM? 1:00 PM How many minutes are there between 1:06 AM and 8:02 AM? 416 How many minutes are there between 1:42 PM and 9:24 PM? 462 What is 371 minutes after 12:38 PM? 6:49 PM How many minutes are there between 11:24 PM and 9:05 AM? 581 What is 705 minutes after 9:54 PM? 9:39 AM What is 170 minutes before 12:28 PM? 9:38 AM How many minutes are there between 12:49 PM and 8:15 PM? 446 How many minutes are there between 8:05 AM and 6:33 PM? 628 How many minutes are there between 6:43 AM and 10:10 AM? 207 How many minutes are there between 4:42 PM and 3:28 AM? 646 What is 328 minutes after 7:23 PM? 12:51 AM What is 321 minutes after 9:35 PM? 2:56 AM What is 416 minutes after 6:14 AM? 1:10 PM What is 388 minutes after 9:51 PM? 4:19 AM How many minutes are there between 10:15 AM and 7:27 PM? 552 What is 374 minutes before 5:01 PM? 10:47 AM What is 317 minutes before 2:05 AM? 8:48 PM What is 123 minutes before 5:37 PM? 3:34 PM How many minutes are there between 1:24 PM and 5:07 PM? 223 How many minutes are there between 9:12 AM and 2:14 PM? 302 What is 605 minutes before 5:40 AM? 7:35 PM What is 309 minutes after 11:06 AM? 4:15 PM What is 703 minutes before 12:24 PM? 12:41 AM What is 485 minutes before 7:35 AM? 11:30 PM How many minutes are there between 1:53 AM and 2:31 AM? 38 What is 315 minutes before 8:16 AM? 3:01 AM How many minutes are there between 10:48 AM and 3:22 PM? 274 What is 576 minutes before 4:56 AM? 7:20 PM How many minutes are there between 3:08 AM and 6:19 AM? 191 How many minutes are there between 10:14 PM and 5:48 AM? 454 What is 528 minutes after 8:20 PM? 5:08 AM How many minutes are there between 1:01 AM and 12:30 PM? 689 What is 145 minutes after 6:45 PM? 9:10 PM What is 466 minutes before 6:50 PM? 11:04 AM How many minutes are there between 10:10 AM and 8:27 PM? 617 How many minutes are there between 12:10 PM and 9:42 PM? 572 What is 439 minutes before 2:00	{ "pile_set_name": "DM Mathematics" }
95g Collect the terms in -k3 - 772482k - k2 - 2 + k2 + 775911k. -k3 + 3429k - 2 Collect the terms in -2596r2 - 2622r*2 + 7763r*2 - 2534r*2. 11r*2 Collect the terms in -26v*2 + 72v*2 - 46v*2 + 2229v - 823v + 3v*3. 3v*3 + 1406v Collect the terms in -28f3 - 10f*3 + 69f*3 - 10f*3 - 34f*3 - 8f. -13f3 - 8f Collect the terms in 26174 + 10h2 - 23h*2 + 7h*2 + 4h + 9h2. 3h*2 + 4h + 26174 Collect the terms in -3126 + 0f - 14f*3 + 6398 + 0f - 3272 - 23f3. -37f*3 Collect the terms in -107391m*3 + 21855m*3 - 86063m*3 + 26023m*3. -145576m*3 Collect the terms in -148l*2 - 238l*2 + 852l*2 - 234l*2 - 230l*2. 2l*2 Collect the terms in 5g - 2668g2 - 4 - 5g + 1 + 5526g2 - 2677g*2. 181g*2 - 3 Collect the terms in 1379k - 461k - 455k - 18k2 - 40k*2 - 463k. -58k2 Collect the terms in -152614w*2 - 152610w*2 - 17w*3 - 152609w*2 + 457833w*2 - 24w*3. -41w*3 Collect the terms in -227g - 67072022 + 67072022. -227g Collect the terms in -53h*3 - 1390 - 246h*3 + 1390 - 1196h*3. -1495h*3 Collect the terms in -930 - 3179t*2 - 938 + 2806 - 938 + 185t*2. -2994t*2 Collect the terms in 214w*2 - 898w*2 + 693w*2. 9w*2 Collect the terms in -8d - 369 - 180d + 190d. 2d - 369 Collect the terms in 39v + 6v - 17v - 37v + 20. -9v + 20 Collect the terms in 181 + 410 - 124s - 2s*2 + 19 - 67s. -2s2 - 191s + 610 Collect the terms in -45r - 10r*3 + 37r - 47r + 134r - 79r. -10r*3 Collect the terms in -70q + 145q + 258q + 181q - 7q*3 + 2q*3. -5q*3 + 514q Collect the terms in -63n3 - 42 + 178n*2 + 197n*2 + 42 - 375n*2. -63n*3 Collect the terms in 2k*3 + 0k*3 + 1175530100k*2 - 1175530042k*2. 2k*3 + 58k*2 Collect the terms in 42775 - 85575 + 42805 - 678h*3. -678h*3 + 5 Collect the terms in 178c*2 - 2948c - 2939c - 2945c + 8832c. 178c*2 Collect the terms in -1990c - 1388c - 139c - 429c - 385c. -4331c Collect the terms in -106i*3 + 3939472497i - 3939472497i. -106i*3 Collect the terms in 4 + 0 - 2156f*2 + 4306f*2 - 2106f*2 - 5 + 6. 44f*2 + 5 Collect the terms in -a - 1236 + 402 + 485 + 349. -a Collect the terms in 223i + 1 + 2i2 + 2i*3 - 2i*2 + 141i - 422i. 2i*3 - 58i + 1 Collect the terms in 195618k2 - 3 + 5 + 2785k*2. 198403k*2 + 2 Collect the terms in 45759o + 6560o + 11129o. 63448o Collect the terms in 1662410p + 1317520p + 418322p - 940760p. 2457492p Collect the terms in -3 + 1290m - 2358m + 3 + 1333m. 265m Collect the terms in 9 - 3201388p2 + 7 + 3201433p*2 - 16. 45p*2 Collect the terms in 3051d*3 + 4082d*3 - 6370d*3. 763d*3 Collect the terms in 58 - 113 + 57 - 337949j. -337949j + 2 Collect the terms in 16j*2 + 113j*2 - 49j*2 + 41j*2. 121j2 Collect the terms in 49 + 34 + 49 + d2 - 192 + 35 + 60. d*2 + 35 Collect the terms in 2183597s - 2183597s + 12679s*2. 12679s*2 Collect the terms in 20o*2 + 86o*3 - 19o*2 + 20o - 5o2. 86o*3 - 4o*2 + 20o Collect the terms in 10868v2 - 5187 - 113v + 116v + 5187. 10868v*2 + 3v Collect the terms in -7y3 + 30995y - 15738y - 15258y. -7y3 - y Collect the terms in -5k + 0k + 41k*3 + 1566k*3 - 4k - 1605k3 + 14k - 5k. 2k*3 Collect the terms in 2j*3 - 67822873 + 67822873. 2j*3 Collect the terms in 798z*2 + 1080z*2 + 869z*2 + 0 + 0. 2747z*2 Collect the terms in 59617l*3 - 14892l*3 - 14889l*3 - 14939l*3 - 14895l*3. 2l*3 Collect the terms in 24 - 21 + 62530j - 62681j - 2. -151j + 1 Collect the terms in 33 + 194064010s2 - 16 - 194064028s*2 - 17. -18s*2 Collect the terms in 0l*2 + 1878l - 5714l + 3836l + l2. l2 Collect the terms in -54k + 334 + 735 - 163 + 370. -54k + 1276 Collect the terms in 2644m + 904m + 1916m - 1217m. 4247m Collect the terms in -9r - 884572106724 + 884572106724. -9r Collect the terms in -15293331t3 + t2 + 15293354t3 - t2. 23t*3 Collect the terms in 16780j*2 + 39639j*2 + 48420j*2 + 22157j*2. 126996j*2 Collect the terms in -32577o - 1325o - 510o - 116864o. -151276o Collect the terms in 13 - 36 + 11w3 + 3w*3 + 102w - 169w + 67w. 14w3 - 23 Collect the terms in -200978n + 110093n - 32408n - 143994n. -267287n Collect the terms in -1987 - 12h + 1937 + 72h + 72h. 132h - 50 Collect the terms in 3507q2 + q3 - 7070q*2 - 3q*3 + 3563q2 + q3. -q*3 Collect the terms in 104b*2 - 135b*2 + 6b*2. -25b*2 Collect the terms in -30447t*2 + 5417t*2 - 6416t*2. -31446t*2 Collect the terms in 138674q*2 - 56941q*2 + 118925q*2. 200658q*2 Collect the terms in -341t + 7251t2 + 18517t*2 + 345t. 25768t2 + 4t Collect the terms in 3685f - 917f - 7f2 - 918f - 925f - 925f. -7f2 Collect the terms in 3 - 1039u*2 + 2u + 1415u2 + 1661u*2 + 979u*2. 3016u*2 + 2u + 3 Collect the terms in 115 + 108 + 110 - 299 - 13r2 + 19r*2 + 10r*2. 16r*2 + 34 Collect the terms in -62538z - 62524z + 187688z - 62564z. 62z Collect the terms in -35v2 - 34v - 28v2 - 31v*2 - 63v + 82v2. -12v*2 - 97v Collect the terms in 1845v3 + 1800v*3 + 1452v*3 - 4576v*3. 521v*3 Collect the terms in 40c + 393 - 493 + 3550 + 2048 - 38c. 2c + 5498 Collect the terms in -8b - 9b + 37b - 2 - 8b - 2 + 3b. 15b - 4 Collect the terms in -264s - 122s - 4s2 + 426s - 30s. -4s*2 + 10s Collect the terms in 2344o3 - 206213425o*2 + 206213425o*2. 2344o*3 Collect the terms in -197t - 184t + 805t - 433t. -9t Collect the terms in -222 + 135 + 87 + 570u. 570u Collect the terms in -8273f + 2074f + 2030f + 2073f + 2022f. -74f Collect the terms in 182k3 - 19k*3 + 6k - 4k + 96k*3 - 2k. 259k3 Collect the terms in 7772s*2 - 11477s*2 + 6322s*2. 2617s*2 Collect the terms in 80 - 1623 + 75 - 176d + 181d - 244. 5d - 1712 Collect the terms in 12 - 247675182g2 - 9g*3 + 247675182g*2. -9g*3 + 12 Collect the terms in 1451z - 4321z - 4 + 1471z + 1434z - 4. 35z - 8 Collect the terms in 30t3 - 36t*2 - 3t + 29t3 - 7t*3 + t. 52t*3 - 36t*2 - 2t Collect the terms in 1 + 38241924u2 + 31u*3 - 38241924u*2. 31u*3 + 1 Collect the terms in -441490y*3 - 421043y*3 + 156304y*3 - 723719y*3. -1429948y*3 Collect the terms in -980434b*2 + 1960901b*2 - 980437b*2. 30b*2 Collect the terms in -53594 + 870s*2 + 26756 + 26838. 870s*2 Collect the terms in -3k*2 - 3636k + 1371k + 1671k + 2k2. -k2 - 594k Collect the terms in 230134f + 145 - 145. 230134f Collect the terms in 9969m - 1916m - 2011m - 2015m - 2010m - 2012m. 5m Collect the terms in 12130 + 12124 + 4v*2 - 15v*2 - 24254. -11v*2 Collect the terms in -39439 - 38012 + 77456 + 96i. 96i + 5 Collect the terms in 2 + 2 - 5 - 1874x - 2879x. -4753x - 1 Collect the terms in 121p3 + 1672639049p*2 - 1672639049p*2. 121p*3 Collect the terms in -142w + 0w2 + 44w + 99w + w2. w2 + w Collect the terms in -p + 25p*2 - 19p*2 + 5p*2 + 16p*2 + 21p*2. 48p*2 - p Collect the terms in 3328b - 2859b + 4b*3 - 469b. 4b3 Collect the terms in -13945k + 2337k - 11766k - 2848k. -26222k Collect the terms in 91 + 90h + 92h + 184h - 91 - 26h. 340h Collect the terms in -12g*2 - 10g*2 - 1322g + 35g2 - 15g*2 + 2635g - 1313g. -2g*2 Collect the terms in 2j*2 - 3j2 - 101781 + 79536. -j2 - 22245 Collect the terms in -390a2 - 565a*2 - 116a*2 + 350a*2. -721a*2 Collect the terms in -18d + 47d - 131573d*2 + 4 + 131458d*2. -115d*2 + 29d + 4 Collect the terms in 10h2 + 10h*3 - 10h*2 - 3h + 449h3 - 12h*2 + 4h. 459h3 - 12h*2 + h Collect the terms in 5606z - 16929z - 1 + 2 + 5589z + 5661z. -73z + 1 Collect the terms in -46 + 17981h - 17985h + 122. -4h + 76 Collect the terms in -6816y*2 - 6818y*2 - 6817y*2 - 6815y*2 - 77y*3 + 27264y*2. -77y*3 - 2y*2 Collect the terms in -63 + 25 + 20 + 5369c + 17 + 3186c. 8555c - 1 Collect the terms in -34 - 18 - 19686l + 19. -19686l - 33 Collect the terms in -1323x2 + 703x*2 - 32x**3 - 9	{ "pile_set_name": "DM Mathematics" }
Suppose 4g = 5c - 22751, -g = 4c + 4g - s. Is c a composite number? False Let u = -12329 + 23402. Is u((-33)/9)/(-11) a composite number? False Let f(u) = -u2 - 4u + 2. Let g be f(-3). Let r be (17/(-5))/((-1)/g). Let d(n) = 3n2 - 37n + 13. Is d(r) a prime number? True Let m be 2/(-3) - (-80)/(-6). Let o(j) = 5 - 4j2 + 19j*2 + 5j + 4j3 + 3j - 3j3. Is o(m) composite? False Suppose 0 = -5s - 5, -4 = 2u - 2s - 32. Let l = 2841 - 2329. Let n = l - u. Is n composite? False Suppose r + 102 = c, 0 = 3c + 4r - 87 - 233. Suppose 4p + y = -c, 0y = 2y. Is 2/4 + (-19201)/p a prime number? True Let r(h) = -11524h - 1335. Is r(-7) prime? True Let z(h) = h*3 + 2h*2 + 2h - 2. Let f = -361 + 370. Is z(f) a prime number? True Let p(h) = -h*3 + 42h*2 - 17h + 100. Let u be p(31). Let o = u - 2903. Is o composite? True Suppose -3x = 3x - 84. Suppose 5s = 4y - 104744, 16s - xs = 8. Is y composite? True Let f = 2637 - 1280. Let i = f + -620. Is i a composite number? True Let f(a) = 550a2 - 6a - 1. Let y be f(2). Let x be 2/(-11) - y/11. Let p = 240 - x. Is p composite? False Suppose -109s + 114s = 4h + 767113, 5h + 920536 = 6s. Is s a prime number? True Let x(b) = 47537b - 1898. Is x(3) a prime number? False Let y(f) = -f - 21. Let b be y(1). Is (-17 - b)(-8138)/(-10) a prime number? False Let q = -92 - -125. Suppose 5y = -q + 43. Is 11964/8-5y/(-15) prime? True Let s = -949109 - -1350144. Is s a prime number? False Let c(r) = 162284r2 - 27r + 2. Is c(1) a prime number? False Suppose 2l - 3810 = -2t, 3l + 2t - 5709 = -3t. Suppose -d - 15072 = -l. Is (d/18)/(2/(-3)) composite? False Let k be (-2)/(-4)(5 - -9)1. Let g(f) = f + kf2 - 5 - 5 + 6 + f3. Is g(-6) a prime number? False Let o(c) be the second derivative of 211c3/6 + 91c*2/2 + 31c. Is o(6) a prime number? False Suppose 0 = -4c + 9 + 3. Let z be ((-5)/(-10))/((-7)/(-70)). Suppose -1057 = -zh - 5f + 598, f = -ch + 1001. Is h a prime number? False Suppose 3r = 2y - 39, -8y + 5y - 5r + 30 = 0. Let o be (17 - y) + 2617. Let h = o + -347. Is h composite? True Let z = 10 - -336. Suppose -135 = 4a - 2b + 147, -5a = 4b + z. Is (-2)/7 + (-25360)/a a prime number? False Suppose -2s = -2b + 6053 + 2459, 2b = -2s + 8524. Let j = 1651 - b. Let c = -1599 - j. Is c a composite number? False Suppose -20 = -4o, 3z + 11851 = 5o + 29757. Let f = -1886 + z. Is f a composite number? False Let v = -71 + 76. Suppose -3r = vg - 29414, 3g = -g - 4r + 23528. Suppose 12d = 8d + g. Is d a prime number? True Let b be 1870/33 + 2/(-3). Suppose -2t = -0t + b. Let a = 78 - t. Is a composite? True Is 5/15 - (-12)/18 - -48954 a prime number? False Let f = 56 - 155. Let j = 1082 + f. Is j a composite number? False Suppose 594 = 71w - 65w. Let j = w - 25. Suppose -3h - 2f - j = -601, -3h + 522 = 3f. Is h composite? False Let j(n) = n2 - 8n - 2. Let o be j(8). Let r be 227587 + (-1 - o) + 4. Is 1/(-5) - r/(-60) prime? True Suppose 23i = 20i - 6. Let n(l) = -927l3 + 2l*2 + 4l + 5. Let o be n(i). Suppose -7a + 7286 = -o. Is a prime? False Let c be 3(-36)/(-27)(-1)/2. Let a(u) = 638u*2 + 9u - 3. Is a(c) composite? False Is (6 - 1) + 31/(403/2263716) a composite number? False Let c(l) = l*3 + 26l*2 + 50l + 48. Let g be c(-24). Is (g + 1)/(15/45735) a composite number? False Suppose 21j = -40j + 44433268 - 18233951. Is j prime? True Let l(w) = -w*2 + 19w + 4. Let d be l(19). Suppose 0 = -g + 4h + 252 + 34, 512 = 2g + dh. Is g/((-1 - -2 - 0)2) a composite number? True Let y(x) = x*3 - 6x*2 - 6x - 2. Let s be -4 - -4 - 1(1 - 8). Let p be y(s). Suppose -2225 = -5m - 2k, 2m + m = pk + 1335. Is m composite? True Let v(p) = 15p*2 - 7p + 7. Suppose 5y - 3g = 238, -4y - y - 4g + 231 = 0. Suppose -y = -5q - 4i + 19, 3i = -2q + 32. Is v(q) a prime number? False Suppose 50a - 18483770 = -140a. Is a a prime number? True Suppose 0 = -5y + 6y - 1. Let m be (-1 - 1/1)(-7)/y. Let w(f) = f3 - 4f*2 - 8f - 13. Is w(m) prime? False Let z = -74885 + 111924. Is z composite? False Let z = -156527 - -273316. Is z a composite number? False Let s(o) = -614o + 35. Suppose -4v - 33 = 2t - 5t, 5t - 11 = 3v. Is s(v) prime? False Let a be (-4179)/(-9)(9 + (-2 - 1)). Suppose 2567 = m + i - a, 0 = 4m - 2i - 21436. Is m a composite number? True Let d(y) = -8y*3 + 6y*2 + 8y - 12. Let o(l) = 8l3 - 6l*2 - 8l + 13. Let z(v) = 6d(v) + 5o(v). Is z(-8) prime? True Let p(q) = -9713q + 39. Is p(-4) prime? True Let w(d) = d2 + 6d + 1. Let h be w(-6). Let c(l) = 10l3 - l2. Let i be c(h). Is 3220/i - 28/(-126) a composite number? True Let z = -18886 + 27404. Suppose 4n + 3396 = 2y, z = -y + 6y - 3n. Suppose -y = -3o + 4753. Is o a composite number? False Is (-4244134)/(-32) + (-507)/2704 prime? False Suppose g - 418175 = -3m, -5m - g + 4g + 696949 = 0. Is m prime? False Suppose 3j - 389 = -h, j - 102h = -103h + 131. Is j composite? True Let v(u) = -10u2 + 5u - 4. Let r be v(1). Let p be ((-21)/r)/(-7)-61782. Suppose p = 6f - 15808. Is f prime? True Suppose x = -4s + 785869, -5s - 2700575 = -3x - 343019. Is x prime? True Suppose 5w = 5x - 30, -3x - 2x + 36 = -2w. Let i(a) = -20a + x + 23 - 107a. Is i(-16) prime? True Let u(h) be the first derivative of h*4/4 - 8h3/3 + h2 - 7h + 10. Let s be u(7). Let m = 95 + s. Is m a composite number? False Suppose -21y - 3 = -20y, -3067024 = -5z + 3y. Is z a composite number? True Let w be 36/(-162) - 184088/(-9). Let t = -5393 + w. Is t prime? True Let k be (-3)/(-6 + (-105)/(-20)). Suppose 5r = kr + 4349. Is r a prime number? True Let z(p) = 672p*2 - 15p + 18. Let q be z(5). Is (-2 - -5)/(9/q) a composite number? False Let q(d) = -d*3 - 104d*2 - 50d + 5262. Is q(-115) a composite number? False Let w = -65 + 67. Let o(f) be the third derivative of 26f4/3 - f3/2 - f2 + 2f. Is o(w) prime? False Suppose 4j = -2j + 12. Suppose -2w = 4x - 1808, jw - 4x - 1799 = x. Is w/114/28 a prime number? False Suppose -8716172 + 4730250 = -51s + 7295635. Is s a prime number? False Suppose -28k + 22k = -23k + 7138657. Is k composite? False Suppose -5u - w + 424025 = 0, 4w + 1017692 = -u + 13u. Is u composite? True Suppose -j + 462295 = -2r, 5r - 9264 = -j + 453031. Is j prime? False Is (6 - 124)/((-78)/260247) prime? False Let u be ((-1488)/18)/(2 - 15/9). Let f be (2 - u)/((-8)/64). Let z = f + 3391. Is z a prime number? False Suppose 30 = n - 4n - 3d, 2n + 8 = 4d. Let j be 478334/7 + 6/(-84)n. Is 1 + (-18)/14 - j/(-98) a prime number? False Let h be 18/(-4)(-15364)/207. Let n(j) = j*3 - 12j*2 - 17j - 8. Let g be n(13). Let k = g + h. Is k prime? False Let x(v) = -22v - 23v*2 + 20v2 + v3 - 40 - 11v2 + 10. Let f be x(19). Let u = -964 + f. Is u a composite number? True Let f(o) be the first derivative of -47o*2/2 + 6o + 55. Is f(-19) composite? True Let k(l) = -14l - 54. Let r be k(-4). Is ((-3)/r)/((-6)/78956) a composite number? False Let u = 113 + -112. Let h be 2 + 1 + u + 1. Suppose 1759 = -hi - 5q + 5439, 3q - 6 = 0. Is i prime? False Let u be ((-10)/(-6))/(3/(-9)) - -25. Suppose ux = 37626 + 8794. Is x prime? False Let u(d) = 9576d + 27. Let n be u(10). Suppose 5v - n = w, 2v + 4w = -3214 + 41520. Is v a composite number? False Suppose 19315859 = 100s - 34747653 + 5777812. Is s composite? True Let u = 208 - 218. Is (-1657)/(18/45 - (-14)/u) prime? True Let m(n) be the third derivative of 1/6n3 - 20n*2 + 1/30n*5 + 0n + 0n4 + 1/3n*6 + 0. Is m(2) a composite number? True Suppose -13r + 26r - 609393 = 709184. Is r composite? False Is 7 + (32253 - (-5 - -8)) prime? True Let f be 3 + (-1)/((6/(-2))/(-3)). Is (-6 - 2147)(-10)/f a prime number? False Let z(x) = x*3 + 7x*2 - 5x - 12. Let l be z(-8). Let g = l + 39. Suppose gr = -0r - 3y + 1245, -830 = -2r + y. Is r a prime number? False Let r(a) = 20a2 - 3a + 9. Let i(p) = p*2 + 4p + 3. Let l be i(-4). Suppose ld - 3w = 5 - 2, 0 = 2w - 6. Is r(d) composite? False Let x = 165 + -174. Let h be (-4 - (-4 + 3)) + 1. Is 36/x - (h + -261) prime? False Suppose l = 5t - 76, 0 = -3*t - l + 12	{ "pile_set_name": "DM Mathematics" }
s of (1062 - -39) + 0 + -5. 2, 137 Suppose 0 = -3d + 8 + 4. Suppose 0 = 4k + 3w - 5w - 154, -89 = -2k - 3w. Suppose dq - 124 + k = 0. List the prime factors of q. 3, 7 Let m = -68 - -68. Suppose -13t + 637 = -mt. List the prime factors of t. 7 Let h = 247 + 254. What are the prime factors of h? 3, 167 Suppose 4d = 6m - 2918 - 2052, 2495 = 3m - 4d. What are the prime factors of m? 3, 5, 11 Let s(n) = 732n - 31. List the prime factors of s(1). 701 List the prime factors of 115 - 110 - (1 + -1861). 5, 373 Suppose 2h = 0, -3i + 0i - 4h + 6 = 0. Suppose d + 65 = -a, -3d - id - 85 = a. List the prime factors of (2 - 1)/((-2)/a). 2, 3, 5 Let c(g) be the second derivative of -g*5/20 + 5g4/12 + g3/6 + 3g2/2 + 7g. List the prime factors of c(5). 2 Suppose -5z + 38 = -3w - 4z, -4z = -2w - 32. What are the prime factors of 10/(-15) - 260/w? 3, 7 Let l be 16 - 15 - ((0 - -2) + -14). Suppose -783 = -lr + 2831. What are the prime factors of r? 2, 139 Suppose 4i + 499 = 11447. What are the prime factors of i? 7, 17, 23 What are the prime factors of (8/10)/(24/96420 + 0)? 2, 1607 What are the prime factors of (48150/35)/97? 2, 5, 107 Let n(j) = -3j2 - 9j - 14. Let u(g) = g - 1. Let y(p) = -n(p) - 6u(p). List the prime factors of y(-6). 2, 5, 11 Let a(o) = -4 - o2 + 3o - 10o + 5o + 7o. Let v be a(3). List the prime factors of ((-28)/5)/(v/(-10)). 2, 7 Suppose 0 = 4b - 3b - 2. Suppose r + br = 75. List the prime factors of r. 5 Let c = 578 - -1753. List the prime factors of c. 3, 7, 37 Let g be (-170)/(-30) + (-4)/6. Suppose -2b + 108 = 4t, 2b - 4t = gb - 156. Suppose 0 = 2y + y - b. List the prime factors of y. 2 Suppose 3f + 169 = 3097. What are the prime factors of f? 2, 61 Let v be (-30)/4(0 + 2/1). List the prime factors of -1220(1 - (-25)/v). 2, 5 What are the prime factors of (-48)/(-744) - 110730/(-31)? 2, 19, 47 Let q(t) = t*3 + 2t*2 - 38. Let c be q(0). Let f = -17 - c. List the prime factors of f. 3, 7 Suppose -12 = -2o - g, 2o - 6g + 2g = -8. Suppose 0 = -oy + i + 59, 7i - 2i = -y + 20. List the prime factors of y. 3, 5 List the prime factors of (4 - 6)(-2)/(-4) - -599. 2, 13, 23 Suppose 3v - 2z = 86 + 3035, -3z = -4v + 4162. What are the prime factors of v? 1039 Suppose r = -4m + 689, -4m = -r - 4r - 683. What are the prime factors of m? 2, 43 Suppose 47 = 5l - 4v, 5l - 5v - 12 = 38. Suppose ln = 945 + 623. List the prime factors of n. 2, 7 Let n(q) = q3 + 5q*2 - 4q + 7. Let u(f) = -2f - 2. Let w be u(2). Let j be n(w). What are the prime factors of ((-4)/j)/(12/390)? 2, 13 Let v(x) = x2 - 31x - 662. List the prime factors of v(49). 2, 5, 11 Suppose -490 = -5v + 5k, -4v - k + 398 = -3k. List the prime factors of v. 101 Let m(j) = -j*2 + 21j - 61. What are the prime factors of m(13)? 43 Let m = 158 + -224. What are the prime factors of -21 - m/3? 2, 5 Suppose -1429 - 1151 = -6h. What are the prime factors of h? 2, 5, 43 Let x be (-8)/(-32) - (-142)/8. Suppose 0h - 3h - 4s = -5, -s - x = -2h. What are the prime factors of h? 7 Suppose 12533 = 29i - 2953. What are the prime factors of i? 2, 3, 89 Suppose k + 1 - 6 = 0. Suppose -kl + 15 = -0l. Suppose -x + 93 = li + 37, 48 = x - i. What are the prime factors of x? 2, 5 Let q(i) = -11i. Let m(h) = -351h. Let y(b) = -2m(b) + 65q(b). What are the prime factors of y(-4)? 2, 13 Suppose -3m = m + 3v, 0 = -m + v. Let s(g) = -g3 - g2 + 61. List the prime factors of s(m). 61 Let z = -2 - 4. What are the prime factors of (-48)/(-32)(-64)/z? 2 Suppose -669 - 611 = -5j. Suppose 8c = -0c + j. What are the prime factors of c? 2 Let g(z) = -z*3 - 22z*2 - 5z - 64. What are the prime factors of g(-23)? 2, 5, 29 Let l(f) = -f*3 - 5f*2 - 13f + 8. Let k = -140 + 134. List the prime factors of l(k). 2, 61 Let l = 31 + -29. Suppose -lw = -4y + 160, 4y = -y - 3w + 189. What are the prime factors of y? 3, 13 Let d be 58-1(-7)/14. Suppose 2a - 5w - d = a, -4w - 12 = 2a. Suppose 4j + 2m = 3 + 25, am - 6 = 2j. What are the prime factors of j? 5 Let y be 9/15 + 0 + 3/(-5). Suppose 0 = -4p - 0s - s + 391, 3s - 9 = y. List the prime factors of p. 97 Let k(d) = -4 - d + 6d*2 + 0d*3 + 5d*3 - 4d*3 + 5. List the prime factors of k(-6). 7 Let k(f) = -5f + f2 + f2 + 5f - 5f + 4. List the prime factors of k(6). 2, 23 Suppose -1137 = -4o + 6507. List the prime factors of o. 3, 7, 13 Let m(n) = n2 + 6n - 8. Let a be m(-7). Let i be (-9)/(2 - a)-1. Suppose -iw + w = -10. List the prime factors of w. 5 Suppose x - 9496 = -7x. List the prime factors of x. 1187 Suppose -10b = -14b. Suppose l = -bv - 5v + 26, 3l = -4v + 89. What are the prime factors of l? 31 Let a = -62 - -49. List the prime factors of 0 + a/((-39)/558). 2, 3, 31 What are the prime factors of (-8)/(-3)(2946/12 - -5)? 2, 167 Suppose -5m - 2u - 161 - 163 = 0, 2m + 130 = -u. Let s = 16 + -47. Let n = s - m. List the prime factors of n. 3, 11 Suppose 0 = -24t - 8165 + 132245. List the prime factors of t. 2, 5, 11, 47 Let o be (1/3)/(7/7329). Let u be o/3 + 16/24. Suppose -4p = -p - u. List the prime factors of p. 3, 13 Suppose 3r = -23z + 28z - 3335, -5r - 2001 = -3z. What are the prime factors of z? 23, 29 Let g(n) = n*3 - 7n*2 + n - 3. Let a be g(7). Suppose -220 = -0j + aj. What are the prime factors of (-1227)/(-33) + 10/j? 37 What are the prime factors of 1148 + 0/3 + -3? 5, 229 Let c = -40 - -41. Let u(l) = 78l + 5. What are the prime factors of u(c)? 83 Suppose 15q - 586 = 1304. List the prime factors of q. 2, 3, 7 Suppose -4q - 5p = -7q + 159, -159 = -3q + 3p. Suppose -2s - 3b + 38 = -q, 2b = -2s + 92. What are the prime factors of s? 47 Let y be 108(3 - (-6)/(-3) - 2). Let v = y + 217. List the prime factors of v. 109 What are the prime factors of 5161 - (-6 + (-12 - -20))? 7, 11, 67 Suppose 9v - 1566 - 3663 = 0. What are the prime factors of v? 7, 83 Suppose -6g = -6485 - 3319. List the prime factors of g. 2, 19, 43 Suppose 0 = b + b + 4. Let p be 2b/45. What are the prime factors of (-14)/(-35) - 183/p? 37 Let s be 0(5/3)/(-5). Suppose s = x + h - 53 - 47, -2h + 398 = 4x. What are the prime factors of x/18 - (-2)/4? 2, 3 What are the prime factors of 30/(-40)12-122? 2, 3, 61 Let p(l) = 185l - 6. List the prime factors of p(3). 3, 61 Let y = 8 - 5. Suppose 3k - 108 = 2h, -h - yh - 216 = 3k. What are the prime factors of 6/(-15) + h/(-10)? 5 Let k(y) = -y2 - 7y - 4. Let s be k(-6). Suppose sq - 13 = 11. Suppose qb = 7b + 300. List the prime factors of b. 2, 3, 5 Suppose 4g - 11056 = 2i + 2i, 11096 = 4g + 4i. What are the prime factors of g? 3, 13, 71 Let a(j) = 138j2 - 57j*2 - 12j*2. What are the prime factors of a(-1)? 3, 23 List the prime factors of (40/(-5))/(2/(-118)). 2, 59 Let w(g) = -4 + 13 - 25 - 28 - 5g. List the prime factors of w(-10). 2, 3 Let y(b) = 14b2 - 5b - 126. What are the prime factors of y(-8)? 2, 3, 5 Suppose 1607 + 405 = 2s. What are the prime factors of s? 2, 503 Suppose -5w - 28 + 6 = -3j, 0 = -j - 2w. Suppose j = p + 1. Suppose 2l = ps - 40, -2l + l - 5 = 0. What are the prime factors of s? 2, 5 Let f(y) = -96y3 - y2 - 3y - 6. What are the prime factors of f(-2)? 2, 191 Suppose 3 = -2n + 7. Let s(o) = o*2 - 3o + 2. Let a be s(n). Let i(y) = -y*3 - y + 14. What are the prime factors of i(a)? 2, 7 List the prime factors of (-10)/63 - (2 + -384). 13, 29 List the prime factors of 417/(-2)5/((-25)/20). 2, 3, 139 Suppose 0 = -13n + 915 - 148. List the prime factors of n. 59 Let k(l) be the third derivative of l6/120 + l5/12 - l*4/8 - 2l*3 + 3l*2. Suppose 22s - 20s + 10 = 0. List the prime factors of k(s). 3 Let b(p) = -4p*3 + 2p*2 + 2p - 4. Let q be b(2). List the prime factors of 9/6(-1456)/q. 7, 13 Let f(b) = 6b*3 + 2b*2 - 7b - 3. What are the prime factors of f(4)? 5, 7, 11 Let z(y) be the third derivative of y4/24 - y3 + 4y2. Let n be z(7). Suppose t - 12 = p + n, -4p = 5t - 20. What are the prime factors of t? 2 Let i = -1170 + 2730. What are the prime factors of i? 2, 3, 5, 13 Let l be 2 - 3 - (-24)/6. Suppose -3g = -0g - d + 170, -lg - 174 = -3*d. Let	{ "pile_set_name": "DM Mathematics" }
q rounded to the nearest integer? -22 Let n = 5397.98641 + -5398. Round n to 3 decimal places. -0.014 Let j = 4073836.982 + -4069140. Let a = j + -4560.5. Let i = a + -137. Round i to 2 dps. -0.52 Let s = 32.87352 - 35.7495. Let p = s - -2.937. What is p rounded to two dps? 0.06 Suppose -28240564 + 404584 = -138n. What is n rounded to the nearest one hundred thousand? 200000 Let r(t) = -t - 921. Let x = 1 - 1. Let o be r(x). Let q be o/(-8) - (-5)/(-40). Round q to the nearest 10. 120 Let y = 2388 + 2816. Suppose -7w + 42746 + y = 0. Suppose 6r - r - w = 0. Round r to the nearest 100. 1400 Let n = -0.0173293 + 251.3603293. Let l = n + -251. Round l to two dps. 0.34 Let c = -5060 - -5059.9997325. What is c rounded to four decimal places? -0.0003 Let r = 10375 - 3967. Suppose 96 + r = 24k. What is k rounded to the nearest 100? 300 Let q = -697 + 384. Let s = 315.99 + q. Round s to one decimal place. 3 Let v = 2439.395 + -2407. What is v rounded to the nearest integer? 32 Suppose -r = b + 11, 0 = 2r + 4b + 3 + 25. Let j = r - -10. Let u be -1j(-415)/10. Round u to the nearest 10. 80 Let a = 117 + -117.0434. Let s = 0.0164 + a. What is s rounded to two dps? -0.03 Suppose 12m + 6m + 486379367 = -104866633. What is m rounded to the nearest one hundred thousand? -32800000 Suppose -n + 10n = 729. Let y = 78 - n. Let h be (-3551 - -11)(-2000)/y. Round h to the nearest one hundred thousand. -2400000 Let i = 165393811.8 - -532221120.2. Let c = 697615227.000311 - i. Let u = c - 295. Round u to five decimal places. 0.00031 Let v = 476.0145 - 0.0145. Let l = 475.9774 - v. Round l to one decimal place. 0 Let b = -3.8943 + -0.621. Round b to 2 dps. -4.52 Suppose 0 = 5o - p - 172600005, 2p = 5o - 3o - 69040010. Suppose -249q - o = -253q. Round q to the nearest 1000000. 9000000 Let g = -8.26 - 0.94. Let v = 0.132 - -9.0532. Let u = v + g. Round u to three dps. -0.015 Suppose -2s - 6m + 2m = -108, 3m + 270 = 5s. Let q(u) = -57u*2 - 14u - 12. Let w be q(-1). Let b = w + s. Round b to 1 decimal place. -1 Let l = 76 + 45. Let y = l - 119.844. What is y rounded to one decimal place? 1.2 Let g = 1.52915 - -0.07275. What is g rounded to 1 decimal place? 1.6 Let p = 9016.99999815 + -9017. Round p to six dps. -0.000002 Let u = 165 + -29. Let k = u + 1096. Let v = 2412 - k. What is v rounded to the nearest one hundred? 1200 Let a = -58423.9 + 56097. Round a to the nearest one hundred. -2300 Let z be 8 + -8 + -1 + -50999. Let l be z/(-9 - 23448/(-2608)). What is l rounded to the nearest 100000? 5500000 Let y = -42995978 - -201285978. What is y rounded to the nearest one million? 158000000 Let r = 17308.79928761 + -17308.8. Round r to 5 dps. -0.00071 Let n = -42 + 56. Let d = 8.8 - n. Let c = d - -5.3. Round c to 0 dps. 0 Let l = 17.44 - 17.439504. Round l to five dps. 0.0005 Let o = -2086.00003339 - -2086. What is o rounded to six dps? -0.000033 Let q(c) = -197015c - 380. Let b be q(-12). Round b to the nearest 1000000. 2000000 Let m = -6060 + 8801. Let d = 2741.01273 - m. Round d to 2 dps. 0.01 Let p = 2623.9999517 + -2624. Round p to 6 decimal places. -0.000048 Let n(p) = 167188p*2 - p - 4. Let q be n(4). Suppose -46y = -45y + q. What is y rounded to the nearest one hundred thousand? -2700000 Let s = -647.22 + 9.22. Let x = 637.9999286 + s. Round x to six dps. -0.000071 Let n = -29327 + 29321.0401. Round n to two dps. -5.96 Let n = 3940 + -3940.000008796. What is n rounded to seven dps? -0.0000088 Let i = -1.35 - 0.25. Let l = -1.16 + i. Let w = -0.56 - l. Round w to one dp. 2.2 Let s = 5.912 + -5.9091736. What is s rounded to 4 decimal places? 0.0028 Let g be -3 + (-12)/(-3) + -1 + 8125. Let k be (0 + g)/((-14396)/2880 - -5). What is k rounded to the nearest one million? 6000000 Suppose 82a + 38a - 125506224 - 756637776 = 0. Round a to the nearest one million. 7000000 Let j = 155902 + -155902.470315. Let u = -116 - -116.47. Let h = u + j. What is h rounded to 5 dps? -0.00032 Let i = -2634 + 2653.57. Let z = 251.4 - 272. Let g = z + i. Round g to one decimal place. -1 Let g = 2046.6 - -117.6. Round g to the nearest ten. 2160 Let p = -1137959 - -2008959. Let i be p(3/7 - 4/(-7)). What is i rounded to the nearest ten thousand? 870000 Let l = -1045 + 1045.00010348. Round l to five dps. 0.0001 Let l = 10.131 - 16.071. Round l to the nearest 10. -10 Let a = 285677471 - 285677416.99999952. Let t = 51 + 3. Let r = a - t. Round r to 7 dps. 0.0000005 Let b be 2/(-16) + (-804887222)/(-4016). Round b to the nearest 10000. 200000 Let c = -0.07 + 17.97. Let a = 4.4 - -9.3. Let j = a - c. What is j rounded to 0 decimal places? -4 Let n = 12131523 - 2625723. Round n to the nearest 1000000. 10000000 Suppose -4f - 4b - 18 = -3f, -74 = 5f + 4b. Let a be (2640/56)/((-16)/f + -1). What is a rounded to the nearest 100? 300 Let g = 1.57 + -1.6084. Let s = 0.040472 + g. Round s to four decimal places. 0.0021 Suppose 189625976 = 39y + 1485985976. Round y to the nearest 1000000. -33000000 Suppose -3j = 5q - 52674, -4q = 4j - 54475 - 15757. Round j to the nearest one thousand. 18000 Let a = 7 - 6.718. Let g = -0.17 - a. Round g to 2 decimal places. -0.45 Let q be ((-32)/(-5))/((-12)/11910). What is q rounded to the nearest 100? -6400 Let m(h) = -23h2 + 4h + 5. Let y(d) = -11d + 27. Let k be y(2). Let c be m(k). What is c rounded to the nearest one hundred? -600 Let d(c) = c3 - c2 + 4. Let p be d(0). Suppose pr + 720000 = r. What is r rounded to the nearest one hundred thousand? -200000 Let q = -25.506 - -25.432889. What is q rounded to 3 dps? -0.073 Let n(j) = 448j2 + 40j - 748. Let f be n(-41). What is f rounded to the nearest one hundred thousand? 800000 Let r = 271 + -125. Let p = r - 146.0000157. What is p rounded to five dps? -0.00002 Let i be (-8)/(-12)-6 - (-5364)/4. Suppose t - 3k - 1344 = 4t, 3t + i = 4k. Let x = t - -277. Round x to the nearest 100. -200 Let g = 16.9540081653 + -16.954. Round g to 7 dps. 0.0000082 Let v = -2555 + 2554.201. Round v to zero decimal places. -1 Let p = 5897.997615661 + -5421.99761543. Let o = p - 476. What is o rounded to seven dps? 0.0000002 Suppose 4b - 22b + 126 = 0. Suppose 9d - 2480 = bd. Round d to the nearest one thousand. 1000 Let l be 2338052/(-5) - (-2)/5. Let n = l + 731488. Suppose -5s = n - 83878. What is s rounded to the nearest ten thousand? -40000 Suppose 6h - 11h + 15 = 0. Suppose 0 = hw - 327 + 1083. Let i = w - -444. Round i to the nearest 10. 190 Let y = -10.942054 + 10.963. Round y to 4 dps. 0.0209 Let w(b) = 101b*3 + 33b*2 - 114b - 40. Let u be w(-35). Round u to the nearest 100000. -4300000 Suppose -g - 3g + 12 = 0. Let p(r) = 48 - 39 - 1366668r + 0 - 5. Let k be p(g). What is k rounded to the nearest 1000000? -4000000 Let t = 95 + -95.09. Let s = -446.9 - -446.80995. Let c = t - s. Round c to four decimal places. 0.0001 Suppose -3g - 36 + 33 = 0, 0 = 3z - 5g - 88676. Let k = z + -142757. What is k rounded to the nearest 10000? -110000 Let g = -3.13 + 3.1298351. Round g to six decimal places. -0.000165 Let n = -3186.33 + 3114. Let p = -72 - n. Let q = -0.59 + p. What is q rounded to one decimal place? -0.3 Let a = -0.03735646 + 65.03661646. Let x = 65.67 - 0.67. Let g = x - a. Round g to four decimal places. 0.0007 Let t = -30.45 + -3.25. Let z = t + 33.6859. Round z to three decimal places. -0.014 Let q = 907 + -451. Let y = 457.039 - q. What is y rounded to 2 dps? 1.04 Let c = -959 + 426. Let l = 533.000569 + c. What is l rounded to five dps? 0.00057 Let b = -50 + 34. Let w = -12 - b. Suppose 0 = -4q - i + 4080003, -1101379 = wq - i - 5181376. Round q to the nearest 100000. 1000000 Let p = -9954 - -10434.02. What is p rounded to the nearest 10? 480 Let h = 16328 + -17032.9. What is h rounded to the nearest ten? -700 Let x = -20990 + 20990.0995. Round x to 3 decimal places. 0.1 Suppose -n + 12 = 3n, 3 = -3l - 4n. Let b be l + -1 - (7 + -707). What is b rounded to the nearest one hundred? 700 Suppose 3t - 2t = -761397. Let k = t - -350397. What is k rounded to the nearest ten thousand? -410000 Let q = -0.073936 - 37.435064. Let c = q + -0.091. What is c rounded to 0 dps? -38 Let y be 2/5 - 894/(-4)*(-609624)/(-90). Round y to the nearest ten	{ "pile_set_name": "DM Mathematics" }
mon denominator of w and 10/(-24)(19 + 25). 12 Suppose -2f - 3d = 5403, 0 = -4f - 5d - 6573 - 4238. Find the common denominator of (f/70)/9 + 1 and 29/23. 230 Let h be -4(9/(-3))/3 - 13. What is the common denominator of -93/28 and ((-55)/h)/(180/135)? 84 Suppose -11d + 0 = -0. Suppose -4y = 3i + 213, 0 = -y - 2i - di - 52. Calculate the common denominator of -7/12 and ((-206)/y)/(10/15). 36 Let l = -219823/24 - -9158. Calculate the common denominator of (-1 - 182/132) + (810/(-36) - -24) and l. 264 Let p = -1254 + 2604. Calculate the least common multiple of 24 and p. 5400 Let u = 2307325/256 - 9013. Find the common denominator of u and -11/36. 2304 Let c = -126322 - -237193. Let k be (-6)/(-2) - c/(-61290). Let u = 172/227 + k. Calculate the common denominator of u and -47/4. 60 Suppose -70 = -5v + 5a - 20, 2a - 12 = -2v. Let o be (-2 + (2 - 2))/(-1). Suppose 0 = 5x - 82 + o. What is the smallest common multiple of x and v? 16 What is the common denominator of -61/145 and ((-97)/29 - -3)144/(-315)? 1015 Calculate the smallest common multiple of 16 and (187)/((-225)/(-300)). 336 Let f be 3 - ((-1)/(-1) + 2 + 0). Suppose -5r = -25, 0 = -fo + 5o + 2r - 5. What is the common denominator of 70/33 and 37/(-3) + o - (-9 + 6)? 33 Let y(c) = 5c + 43. Let n be y(-9). Find the common denominator of (-4)/(-8) + 0 - -2 and n + ((-4)/(-6))/((-21)/(-9)). 14 Let v be -3 + (-30)/121-2. Suppose -vo + 14 = 24. What is the common denominator of -39/10 and (-1)/(-16)(25/o - 18)? 80 Calculate the least common multiple of 168 and ((-1862)/56 - -7)-24. 2520 Suppose -37l + 4l = -52998. What is the least common multiple of 6 and l? 4818 Calculate the lowest common multiple of 30/3 + 6824(-1)/(-4) and 780. 8580 Let v = 17193462479/1132751718 + -4900/372861. Let p = 2/1519 + v. Calculate the common denominator of -131/6 and p. 6 Let f = 9137/4 + -1124005/492. What is the common denominator of f and 137/66? 2706 Let q = 55889 - 838403/15. Let h = -406039/36 + 11283. Calculate the common denominator of q and h. 180 Let t(g) = 3g - 4. Let d be ((-3)/(9/8))/((-19)/57). Suppose 0 = -dw + 36 + 44. Calculate the lowest common multiple of w and t(3). 10 Let z(h) = -31h + 679. Calculate the lowest common multiple of z(21) and 58. 812 Let a(v) = -v*2 - 1. Let t(j) = -12j*2 + j. Let y(o) = 6a(o) - t(o). What is the lowest common multiple of y(3) and 30? 90 Let y(r) = 273 - 194 + 16r - 15r. Calculate the least common multiple of 60 and y(11). 180 Suppose -12 = -3o, q - 26 + 3 = -2o. Let r = 92 - 56. What is the smallest common multiple of r and q? 180 Let v be (20/(-12) - 4)-9. Let h = v + -49. Suppose -35 = -hq + 35. Calculate the least common multiple of 5 and q. 35 Let l = -38 + 90. Let h = l + -38. What is the smallest common multiple of 158 and h? 1106 Let u(y) = 84 - y*2 + 20y + 98 + 2y - 273. Calculate the lowest common multiple of 264 and u(8). 1848 Let z = 4565 + -3690. What is the smallest common multiple of 4 and z? 3500 Suppose -d - 4u = -25, -4d + 3u = -67 - 109. Suppose 3c = 2p - d, 5p + 0p = -3c + 113. What is the lowest common multiple of p and 10? 110 Calculate the common denominator of ((-9)/((-144)/(-142)))/((-3)/(-2)) and (-116)/(-754) + 1382/312. 12 Suppose d + 1582 = 130y - 129y, -1588 = -y + 2d. What is the least common multiple of y and 2364? 4728 Let w be (6 + (-2 - (-18214)/480))-398. Let i = w + 16694. What is the common denominator of 49/12 and i? 120 Let j(c) = -5c - 35. Let g be j(-14). Suppose 0 = 3n - 13 - g. Calculate the least common multiple of 3 - -4(-1)/(-2) and n. 80 Let f be (2 - 1) + 0 + (-4128)/3. What is the common denominator of f/(-308) - 15/3 and -75/56? 56 What is the common denominator of 5 + ((-46562)/48 - -9)(-1)/(-190) and 7/54? 8208 Let d be ((-44)/6)/(0 - (-56)/(-3924)). Let q = 57013/112 - d. Let r = 20040 + -761417/38. Find the common denominator of r and q. 304 Suppose 0 = 5c + 2u - 7u - 60, c - 32 = -3u. Suppose 0f - 5f = -z - c, -f = 2z + 1. Find the common denominator of (-70)/16(-1)/(-30)f and 67/22. 176 Let n = 15345 - 14834. What is the lowest common multiple of n and 56? 4088 Let r(f) = 10 - 4f2 + 2f + 14 - 33 + 27f3. Let t be r(7). Let c = t - 290283/32. Find the common denominator of -85/14 and c. 224 Let g(n) = 17n3 - n2. Suppose -15p - 20 = 5p. What is the lowest common multiple of -5 - 2/p - (-15)/1 and g(1)? 48 Suppose -18c + 14c = -8. What is the common denominator of 67/10 and ((-141)/(-35) - 2) + c/(-1)? 70 Let t = -552 - -872. Suppose 0 = -f, -4c + 6f = 7f - t. What is the lowest common multiple of 16 and c? 80 Let y(k) = -k3 - 2k*2 + 50k - 11. Let c be y(6). Let w(i) = 18i3 + i2 - i + 2. Calculate the least common multiple of 92 and w(c). 460 Let g be (-10605)/18(-6)/38980. Let z = g - 1144400693/70164. Let a = z + 16315. What is the common denominator of a and 15/7? 126 Let i = -3 - -24. Let s(q) = 23q + 68. Let f be s(-4). What is the smallest common multiple of (f/(-30))/((-4)/(-30)) and i? 42 Let x be (1 - 3)4/8. What is the common denominator of ((-18)/80)/(-6(-6)/984) and 46/(-100)(-3 + x)? 100 Let b(s) = 20s - 2. Let n be b(-8). Let m be n((-5)/2)/(-5). Let i = m + 121. What is the smallest common multiple of 68 and i? 680 Let o = 962 - 940. Calculate the lowest common multiple of 1528 and o. 16808 Let u be (-24)/56 + 405/(-35). What is the least common multiple of (-13)/(455/(-270)) - u/42 and 381? 3048 Let m(c) = 24c3 + 15c*2 + 15c - 30. What is the lowest common multiple of m(2) and 108? 756 Let y(t) = 391t + 1219. Calculate the smallest common multiple of y(11) and 840. 38640 Suppose 42c - 115c + 3420 = -54c. What is the least common multiple of 100 and c? 900 Let r(q) = 10q - 8. Suppose -f = -2g + 22, -4 = -3f + 2. What is the least common multiple of r(g) and 32? 224 Let x be (-86)/(-301) - (-1 - (-5190)/(-112)). Let z = x + -10039/216. Find the common denominator of z and 80/21. 189 Suppose -u - 4s + 257 = 0, -2 + 1 = s. What is the common denominator of 753/u - (-36)/(-27) and 45/7? 203 Let a = 6690/7 - 60700/63. Calculate the common denominator of a and 7048/648 - 70/7. 81 Suppose -8d + 3d + 1325 = 5o, -4o = -3d + 788. Calculate the common denominator of -101/2 and ((-172)/d)/((-10)/30). 22 Suppose -22w - 3053 = -24w - h, -4w = -3h - 6101. Let n = 6103/4 - w. Let v = -1646 - -59213/36. Calculate the common denominator of v and n. 36 Suppose 0 = 170p - 190p + 4560. Calculate the smallest common multiple of p and 19. 228 Suppose 6n + 3837 = 7722 - 3837. Let c(d) = -d*2 - 9d + 1. Let i = -1 + -7. Calculate the least common multiple of c(i) and n. 72 Let r = -90 - -95. Suppose 5u + 433 = 4i, i - 6u = -8u + 118. What is the lowest common multiple of i and r? 560 Let k be 2 + (-6 - -4) + (-64)/(-4). Let h(i) = -i*3 + 15i*2 + 16i + 8. Calculate the lowest common multiple of 2 and h(k). 8 Let m(c) be the second derivative of c*3/3 - 7c*2 + 17c. Let w be m(9). Suppose 0 = 3d + w - 10. What is the least common multiple of 18 and d? 18 Let i be 0 + 14 + 3/(3 - 6). What is the lowest common multiple of 24 and 3i - (3 + -3)1? 312 Let q = 104 - 70. Let t = 76 - q. What is the common denominator of (1 + 669/t)(-1)/(-3) and 19/2? 14 What is the lowest common multiple of ((-39)/(-12))/((-3)/(-204)) and 2? 442 Let x(d) = d*3 - 6d*2 - 4d + 22. Let i be -4 - (6/2 - 1). Calculate the least common multiple of (-130)/i + 2/6 and x(8). 1298 Let j = 65 - 45. Suppose -69g = -67g - 150. Let k = g - 68. What is the lowest common multiple of k and j? 140 Let q = -1998/13 - -19057/130. Find the common denominator of q and (-28)/49 + 16857/15498. 1230 Let p = -4/873 - 2518/873. Find the common denominator of p and -47/792. 792 Calculate the common denominator of 139/140 and ((-4)/(-16)-6 - 8)/(-18 - -4). 140 Find the common denominator of 138/(-46) - 26/(-24) and -27/452. 1356 Suppose 2s - 41 + 1 = 0. Let k = -304 + 314. What is the smallest common multiple of ((-1456)/(-130))/(4/k) and s? 140 What is the common denominator of (-2 + -2)/24-61 and 4/(-6) - ((-477)/90 - 1)? 30 Let y = -241 + 244. Suppose -246 = -yb + 450. Calculate the smallest common multiple o	{ "pile_set_name": "DM Mathematics" }
ommon multiple of 432 and 9. 432 Calculate the least common multiple of 48 and 20. 240 Calculate the smallest common multiple of 25 and 4975. 4975 Calculate the common denominator of -47/57 and -93/190. 570 Find the common denominator of 24/25 and -57/55. 275 Calculate the common denominator of 53/738 and -11/16. 5904 What is the least common multiple of 56 and 77? 616 What is the lowest common multiple of 308 and 616? 616 Find the common denominator of -81/6830 and 43/115. 157090 What is the smallest common multiple of 5 and 10? 10 Find the common denominator of 83/70 and 77/6. 210 What is the lowest common multiple of 10 and 148? 740 Calculate the lowest common multiple of 2706 and 410. 13530 Find the common denominator of 57/602 and -21/86. 602 Calculate the smallest common multiple of 91 and 78. 546 Calculate the lowest common multiple of 642 and 20. 6420 Calculate the least common multiple of 24 and 132. 264 Calculate the least common multiple of 66 and 352. 1056 Calculate the lowest common multiple of 3648 and 608. 3648 What is the lowest common multiple of 9 and 144? 144 What is the common denominator of 27/20 and -5/108? 540 Calculate the least common multiple of 522 and 72. 2088 What is the least common multiple of 6 and 1229? 7374 What is the smallest common multiple of 2356 and 76? 2356 What is the common denominator of 29/2 and 43/224? 224 Calculate the smallest common multiple of 930 and 186. 930 Calculate the lowest common multiple of 60 and 84. 420 What is the lowest common multiple of 954 and 12? 1908 Calculate the lowest common multiple of 1610 and 12. 9660 Calculate the smallest common multiple of 232 and 8. 232 What is the smallest common multiple of 548 and 137? 548 What is the common denominator of -59/1300 and -19/35? 9100 What is the least common multiple of 1472 and 6? 4416 What is the common denominator of 13/24 and 109/180? 360 Calculate the common denominator of 42/379 and -101/4. 1516 What is the least common multiple of 1473 and 10? 14730 Calculate the lowest common multiple of 10 and 4. 20 Calculate the least common multiple of 416 and 728. 2912 Calculate the common denominator of -123/308 and 83/92. 7084 Find the common denominator of -25/2768 and 43/8. 2768 What is the smallest common multiple of 63 and 30? 630 What is the common denominator of -57/2570 and 53/2056? 10280 What is the least common multiple of 800 and 1100? 8800 Calculate the lowest common multiple of 66 and 22. 66 What is the common denominator of -57/134 and -31/38? 2546 Find the common denominator of 51/83 and -3/2905. 2905 What is the common denominator of -21/19 and -39/38? 38 What is the smallest common multiple of 72 and 120? 360 What is the common denominator of 61/9 and 38/39? 117 Calculate the common denominator of 21/22 and -95/1424. 15664 What is the common denominator of -5/696 and -49/116? 696 Find the common denominator of -31/20 and 57/5. 20 What is the common denominator of -67/78 and 59/104? 312 What is the lowest common multiple of 30 and 45? 90 Find the common denominator of 17/32 and 41/476. 3808 Calculate the least common multiple of 160 and 220. 1760 What is the common denominator of -149/36 and -47/20? 180 Calculate the smallest common multiple of 5491 and 2312. 43928 Calculate the smallest common multiple of 476 and 51. 1428 Find the common denominator of -121/90 and -5/24. 360 Calculate the common denominator of -17/520 and 12/65. 520 Find the common denominator of 37/120 and 32/35. 840 Calculate the common denominator of -26/847 and 137/462. 5082 Calculate the smallest common multiple of 13295 and 5. 13295 What is the smallest common multiple of 169 and 2? 338 What is the least common multiple of 450 and 198? 4950 What is the least common multiple of 27 and 21? 189 What is the least common multiple of 108 and 1200? 10800 Calculate the common denominator of 65/16 and 77/1084. 4336 Calculate the common denominator of -5/768 and 103/320. 3840 What is the common denominator of 13/298 and 41/22? 3278 What is the common denominator of -68/15 and 45/2? 30 Calculate the lowest common multiple of 16 and 60. 240 What is the common denominator of 5/19424 and -149/12? 58272 Find the common denominator of 55/21 and -67/273. 273 What is the lowest common multiple of 2 and 146? 146 What is the common denominator of -41/100 and 23/24? 600 What is the lowest common multiple of 8 and 326? 1304 What is the least common multiple of 22 and 4276? 47036 What is the lowest common multiple of 93 and 7? 651 Calculate the common denominator of 97/126 and 103/210. 630 Calculate the least common multiple of 52 and 40. 520 Find the common denominator of 43/3969 and -50/39. 51597 Calculate the common denominator of -73/196 and -91/32. 1568 What is the common denominator of -131/132 and -43/3300? 3300 Calculate the common denominator of 107/24 and 71/296. 888 What is the lowest common multiple of 3402 and 18? 3402 What is the lowest common multiple of 30 and 615? 1230 What is the least common multiple of 5468 and 5? 27340 Calculate the smallest common multiple of 21 and 3774. 26418 Calculate the least common multiple of 6 and 6. 6 Calculate the smallest common multiple of 225 and 3. 225 Calculate the least common multiple of 226 and 80. 9040 Find the common denominator of 113/264 and 25/132. 264 Find the common denominator of 137/18 and 95/16. 144 What is the common denominator of 37/786 and -71/66? 8646 Calculate the common denominator of -79/6 and -3/16. 48 What is the least common multiple of 957 and 3190? 9570 What is the lowest common multiple of 60 and 96? 480 What is the common denominator of -157/264 and -89/66? 264 What is the least common multiple of 4104 and 4? 4104 Calculate the smallest common multiple of 6 and 2412. 2412 What is the smallest common multiple of 20822 and 1? 20822 What is the smallest common multiple of 659 and 5? 3295 Find the common denominator of -95/4 and -63/142. 284 What is the common denominator of -31/90 and 45/8? 360 What is the least common multiple of 5346 and 378? 37422 Calculate the common denominator of -85/6 and 61/102. 102 Find the common denominator of 119/36 and 81/26. 468 Calculate the common denominator of 121/40 and 23/668. 6680 Find the common denominator of 91/7704 and -145/42. 53928 What is the common denominator of 101/3090 and 26/3? 3090 What is the least common multiple of 15 and 1489? 22335 Calculate the smallest common multiple of 11 and 193. 2123 What is the least common multiple of 42 and 516? 3612 What is the smallest common multiple of 111 and 111? 111 Calculate the common denominator of -89/154 and -21/506. 3542 Calculate the lowest common multiple of 114 and 48. 912 Find the common denominator of 7/15 and 19/18. 90 What is the common denominator of 14/249 and 131/156? 12948 Calculate the lowest common multiple of 1203 and 20. 24060 What is the least common multiple of 996 and 4? 996 Find the common denominator of 51/872 and 33/28. 6104 Calculate the common denominator of -89/12 and 81/22. 132 Calculate the lowest common multiple of 88 and 976. 10736 Calculate the common denominator of 137/30 and -3/734. 11010 Calculate the common denominator of -73/2178 and -40/99. 2178 Find the common denominator of 115/1734 and -157/204. 3468 What is the common denominator of 52/11 and 37/151? 1661 Calculate the smallest common multiple of 400 and 70. 2800 Calculate the smallest common multiple of 99 and 33. 99 What is the common denominator of -109/5456 and -53/24? 16368 What is the least common multiple of 56 and 88? 616 Calculate the smallest common multiple of 80 and 128. 640 Calculate the common denominator of -93/8 and -5/31. 248 What is the least common multiple of 35 and 140? 140 What is the common denominator of -29/9 and -121/312? 936 Calculate the common denominator of -23/112 and 53/968. 13552 What is the common denominator of 35/16 and -1/6238? 49904 Calculate the lowest common multiple of 106 and 22. 1166 Calculate the common denominator of -79/714 and 151/84. 1428 Find the common denominator of 17/75 and -32/35. 525 Find the common denominator of -17/44 and 45/292. 3212 Calculate the common denominator of -191/3420 and 53/1368. 6840 Find the common denominator of -5/4209 and -67/549.	{ "pile_set_name": "DM Mathematics" }
) = -r*2. Calculate s(h(b)). -3b*2 Let g(s) = 2s - 36. Let m(l) = 2l2. Give m(g(h)). 8h*2 - 288h + 2592 Let o(w) = 3w. Let h(y) be the second derivative of -5y*4/12 - 6y. Give h(o(g)). -45g2 Let v(h) be the second derivative of h + 0 + 0h*2 + 0h*3 + 5/12h*4. Let o(g) = -2g. What is v(o(i))? 20i2 Let t(a) = -2a. Let h(s) = 5s2 + 3s - 3. Let b(n) = -4n2 - 2n + 2. Let w(c) = -6b(c) - 4h(c). Calculate w(t(o)). 16o2 Let x = -6 - -16. Let k(q) = -2q - 34. Let z be k(-18). Let d(l) = 22lz - xl*2 - 8l*2. Let b(n) = -3n*2. Calculate d(b(t)). 36t*4 Let h(d) = 2d*2. Let r(o) = 66o*2. Give r(h(l)). 264l*4 Let s(m) = 2m - 6. Let b(f) = 4f - 11. Let h(c) = -6b(c) + 11s(c). Let u(q) = -3q. Determine h(u(i)). 6i Let t(w) = -w - 3. Let o(h) = -2. Let x(m) = 3o(m) - 2t(m). Let c(k) be the first derivative of k2 - 3 + 1 - 1. What is x(c(s))? 4s Let m(k) = -90k2. Let l(o) = o - 21. Give m(l(s)). -90s*2 + 3780s - 39690 Let v(n) = n*2 - 2n*2 + 4n*2. Suppose 4p - 9 = 2l + 7, 2l + 12 = 2p. Let y(m) = 1 - 1 + pm. Give v(y(d)). 12d2 Let a(x) = 77x*2. Let g(i) = -9i*2. Determine g(a(w)). -53361w*4 Let j(b) = -168b - 1. Let k(a) = 6a. Determine k(j(o)). -1008o - 6 Let s(a) = 8a2. Let v(o) = -o2 - o. Let j(g) = -10g*2 - 3g. Let m(n) = j(n) - 3v(n). Let i(h) = 7m(h) + 6s(h). Let c(z) = -z. Calculate i(c(l)). -l2 Let d(w) = -11w. Let t(s) = -44s. Let u(i) = 9d(i) - 2t(i). Let o(x) = -4x. Calculate u(o(l)). 44l Let m(q) = -3q + 5q + 8q. Let t(r) = -3r2. What is m(t(b))? -30b*2 Let z(k) = -77k*2. Let b(m) = -m. Give z(b(u)). -77u2 Let t(h) be the third derivative of -h5/60 - 2h2 - 3h. Let l(z) = -44z. Determine l(t(g)). 44g*2 Let a(m) = -m - 605. Let x(o) = -2o*2. Calculate a(x(c)). 2c*2 - 605 Let l(n) = 10n*2 + 15. Let y(f) = 2f*2. Give y(l(z)). 200z*4 + 600z*2 + 450 Let g be 4/(-2)3/(-2). Suppose 0 = -2t + 7 - 3. Let h(y) = gy*2 - 3y2 - yt. Let a(s) = -s. Calculate h(a(u)). -u*2 Let j be 4/(-1) + 0 + 4. Let v(o) be the third derivative of j + 0o + 1/12o4 + 0o3 + o2. Let m(l) = 2l. What is v(m(b))? 4b Let s(d) = -d + 10. Let a(l) = 25l2 + 2l. What is s(a(t))? -25t2 - 2t + 10 Let y be -2 + ((-12)/(-4) - -1). Let q(m) = -3m2 + 0m*2 + 7m*2 - 2m*y. Let h(j) = 4j*2. Calculate q(h(r)). 32r*4 Let r(s) = -2s*2. Suppose -c = c - 4. Let m(d) = 0d*2 + 0d*2 - 3d*2 - 2d*c. What is r(m(a))? -50a4 Let f(x) = x2 + 0x2 - 2x2. Let r(c) be the first derivative of c2 - 5. Give r(f(h)). -2h2 Let y(u) = -29u*2 - 3u. Let l(d) = 57d2 + 5d. Let h(t) = -3l(t) - 5y(t). Let b(i) = -i. Give b(h(c)). 26c2 Let g(s) = -10s - 14. Let r(u) = 2u + 3. Let c(x) = 3g(x) + 14r(x). Let l(z) = -6 - 6 + 12 - 3z. What is l(c(f))? 6f Let t(s) = 2s. Let i = -3 + 4. Let y(u) = u*2 + 2u - 1. Let w be y(i). Let k(h) = h*2 - 6h*2 + wh*2. What is k(t(p))? -12p2 Let y(z) = z2. Let t(n) = 18n2. Let s(a) = -t(a) + 15y(a). Let c(k) be the first derivative of -k*3/3 + 3. Determine s(c(h)). -3h*4 Let w(u) = 56u. Let x(b) = 8b2. What is x(w(f))? 25088f*2 Let m(b) = -5b + 3. Let l(k) = 6k - 4. Let q(w) = 3l(w) + 4m(w). Let z(n) = -1 - 2n*2 + 1. Determine q(z(x)). 4x*2 Let j(q) = 9q. Let r(d) = -6d. Calculate j(r(u)). -54u Let i(g) = 2g2. Suppose 20 = a + 3a. Suppose -19 = -ao + 6. Let w(r) = -or - r + r + 2r. Determine i(w(s)). 18s*2 Suppose -79 = -5t - 5d + 91, -9 = -t + 4d. Let y(p) = -29p + 2p*2 + tp. Let o(h) = 4h2. Calculate o(y(k)). 16k*4 Let u be (-66)/(-14) + 2/7. Let f(r) = 4r*2 - 5. Let l(h) = -2h*2 + 2. Let y(p) = ul(p) + 2f(p). Let t(q) = -q2. Determine t(y(x)). -4x*4 Let u(b) = -b + 1861. Let k(o) = 3o*2. Give u(k(t)). -3t*2 + 1861 Let c(f) = -2f - 3. Let z(a) = -3a - 5. Let b(l) = 5c(l) - 3z(l). Let n(i) be the third derivative of -i4/12 - i2. What is b(n(y))? 2y Let h(y) = -32y. Let a(i) = 4i + 6. What is h(a(o))? -128o - 192 Let t(g) be the second derivative of g6/360 + g4/12 + 3g. Let x(b) be the third derivative of t(b). Let r(i) = -i. What is r(x(u))? -2u Let t(a) = a2. Let n(j) = -7j*2 + 8j*2 - 4j*2. Let h(r) = -n(r) - 6t(r). Let k(v) = 3v. Calculate h(k(l)). -27l*2 Let g(f) = -7f. Let s(h) = -6h. Let m(i) = 4g(i) - 5s(i). Let w(j) be the first derivative of -2j*3/3 - 4. What is m(w(p))? -4p*2 Let b(r) = -r. Let v(a) be the third derivative of 5a*4/24 + 16a*2. Determine b(v(k)). -5k Suppose -f + 14 = -3l, 10 + 2 = -3l. Let p(o) be the first derivative of 0o - 3 - 1/3o*3 + 0o*f. Let q(v) = 2v. Give p(q(y)). -4y2 Let h(q) = -2q*2. Let w(y) = 1249y. Give w(h(t)). -2498t2 Let n(f) = 261f. Let p(b) = -4b. Determine p(n(c)). -1044c Let y(m) = 2m2 - 3m - 3. Let s(a) = -2a2 + 4a + 4. Let l(j) = -3s(j) - 4y(j). Let p(k) = -10k. Calculate p(l(c)). 20c2 Let f(h) = h2. Let x(w) = 2102w. Give f(x(c)). 4418404c*2 Let p(t) = 6t*2 - 10t + 5. Let r(l) = -2l2. Give p(r(d)). 24d*4 + 20d*2 + 5 Let j be 2/15/2. Let y(k) = 0k2 - 2k*2 - 4k + jk2. Let o(r) = 15r*2 - 21r. Let t(g) = 4o(g) - 21y(g). Let a(u) = -2u2. Give a(t(x)). -18x*4 Let a(v) = 11v*2. Let u(m) = 13m*2 - 7m*2 - 8m*2. Calculate u(a(y)). -242y4 Let t(x) = x2. Let o(z) = -9360z2. Calculate o(t(y)). -9360y*4 Let j = -3 - -5. Let n(p) be the first derivative of 0p + j + 1/2p2. Let t(a) = -4a. What is t(n(q))? -4q Let b(r) = -320r. Let o(q) = 3q. Calculate o(b(u)). -960u Let y(w) = 178w2. Let t(r) = -20r. Calculate y(t(b)). 71200b2 Let i(v) = -v2. Let o(u) = -u + 3u - 6u. Let a(n) = 4n. Let f(w) = -4a(w) - 3o(w). What is i(f(p))? -16p2 Let h = -18 - -18. Let v(s) be the third derivative of 1/12s*4 + 0s3 + 0 + s2 + hs. Let q(l) = -l. Calculate v(q(d)). -2d Suppose -5o + 32 = 27. Let f(l) = -o - l2 + 1 + 4l*2. Let w(c) = -3c*2. Calculate w(f(s)). -27s*4 Let j(y) = -2y. Let m(n) = 58n - 1. Calculate j(m(i)). -116i + 2 Let j = 0 + 4. Let n(d) = -3d2 + 5. Let a(p) = -2p*2 + 4. Let o(c) = jn(c) - 5a(c). Let f(r) = 2r. Give o(f(w)). -8w2 Let b(t) = t2. Let k(w) be the second derivative of 3w*3 + w. What is b(k(h))? 324h*2 Let h(m) be the second derivative of 0m*3 + 1/12m*4 + 0 + 0m*2 - 4m. Let j(t) be the third derivative of -t4/8 + t2. Give h(j(w)). 9w2 Let b(c) = c. Let y(l) be the third derivative of -l4/4 - 8l*2. Determine y(b(f)). -6f Let w(n) = 29n2. Let p(a) = 19a*2. Calculate w(p(b)). 10469b*4 Let s(q) be the second derivative of 0 - 1/12q*4 + 2q + 0q2 + 0q*3. Let k(x) = -1. Let p(g) = g - 1. Let c(u) = -3k(u) + 3p(u). What is c(s(j))? -3j*2 Let g(k) = k. Let h(v) = -9v. Let o(b) = b. Let p(i) = -h(i) - 4o(i). Determine p(g(t)). 5t Let f(u) = 783u2. Let z(b) = 3b*2. Calculate f(z(k)). 7047k*4 Let q(j) = 20j*2 + 28j*2 - 4j*2. Let x(v) = 2v. Give x(q(z)). 88z2 Let z(b) = -11b*2. Let j(v) = -v - 20. Determine z(j(y)). -11y*2 - 440y - 4400 Let s(m) = 8 + 7 - 13 - 6m + 4m. Let t(g) = g*2 - 5g + 5. Let d(h) = 5s(h) - 2t(h). Let w(b) be the first derivative of -b*2/2 + 1. Calculate w(d(u)). 2u*2 Let g(l) = 508 + l - 508. Let y(f) = 5f*2. Give y(g(x)). 5x*2 Let q(r) = 13r*2 - 42r*2 + 16r*2 + 11r*2. Let b(h) = 8h. Let c(o) = -7o. Let m(t) = t + 1. Let l be m(5). Let i(n) = lb(n) + 7c(n). Give q(i(a)). -2a*2 Let u(x) = -2x*2. Let y(h) = 3h + 0 - 2h - 1. Let c(k) = k2 + k - 1. Let v(g) = -c(g) + y(g). Determine u(v(l)). -2l*4 Let u(v) = -21v*2. Let q(z) = 5z*2 - 8z*2 + 5z*2. Calculate q(u(a)). 882a4 Let h(o) = o2 + 584. Let q(c) = c. Calculate q(h(d)). d*2 + 584 Let y(a) = 2a*2. Let g(c) = 3c - 5. What is y(g(o))? 18o2 - 60o + 50 Let p(z) = 4z2. Let y(h) = 7h - 13h + 4h. Calculate p(y(x)). 16x2 Let v(x) = -2x. Let k(n) = -8n2 + 5n. Let f(p) = 9p2 - 6p. Let o(h) = 5f(h) + 6k(h). Calculate v(o(m)). 6m2 Let v(h) be the second derivative of -h3/3 + 2h. Let g(x) be the third derivative of 0x + 0x3 - x2 - 1/30x5 + 0 + 0x**4. What is g(v(i))	{ "pile_set_name": "DM Mathematics" }
months? 51000 How many kilometers are there in 457.3206 millimeters? 0.0004573206 Convert 80493.86ml to litres. 80.49386 How many milliseconds are there in three eighths of a second? 375 How many milliseconds are there in 59742.65 minutes? 3584559000 How many months are there in 11/4 of a millennium? 33000 How many centimeters are there in one sixteenth of a kilometer? 6250 How many centimeters are there in one quarter of a meter? 25 What is 792.0096 days in hours? 19008.2304 Convert 47.266 hours to microseconds. 170157600000 Convert 47721.75 years to centuries. 477.2175 How many decades are there in 0.8102483 centuries? 8.102483 How many millilitres are there in seven halves of a litre? 3500 How many hours are there in 36.235476 microseconds? 0.00000001006541 How many millimeters are there in 246471.9m? 246471900 What is 212091.9 months in years? 17674.325 What is 74/5 of a hour in seconds? 53280 Convert 983.9037 litres to millilitres. 983903.7 What is 6/25 of a millimeter in micrometers? 240 What is 3/16 of a day in seconds? 16200 How many millilitres are there in 53.00915l? 53009.15 How many millilitres are there in 32/5 of a litre? 6400 How many kilograms are there in 1492.157t? 1492157 How many months are there in 32/5 of a millennium? 76800 What is 13/5 of a centimeter in micrometers? 26000 How many seconds are there in ten ninths of a hour? 4000 What is 133.930206 microseconds in days? 0.000000001550118125 Convert 931.5826 kilometers to centimeters. 93158260 Convert 4834.1988 microseconds to days. 0.000000055951375 How many kilometers are there in 835.9947nm? 0.0000000008359947 What is 39209.04 litres in millilitres? 39209040 How many milliseconds are there in 1/20 of a minute? 3000 What is 594.0917 micrograms in kilograms? 0.0000005940917 Convert 826549.2m to nanometers. 826549200000000 Convert 0.6388022 centuries to decades. 6.388022 How many millilitres are there in fifty-three quarters of a litre? 13250 How many millilitres are there in eighty-one quarters of a litre? 20250 What is 0.6922242ml in litres? 0.0006922242 Convert 8135.338 nanometers to millimeters. 0.008135338 What is 143341.74 months in millennia? 11.945145 How many nanometers are there in 1.493812km? 1493812000000 How many kilograms are there in 8/25 of a tonne? 320 What is 3/7 of a week in days? 3 What is 61.828445 days in weeks? 8.832635 How many micrometers are there in 3/25 of a millimeter? 120 What is 3/25 of a meter in centimeters? 12 How many nanometers are there in one fifth of a micrometer? 200 How many months are there in 11.2127 decades? 1345.524 How many tonnes are there in 6053.717g? 0.006053717 How many seconds are there in fifty-one halves of a minute? 1530 What is 19/4 of a minute in seconds? 285 Convert 901.7829 millilitres to litres. 0.9017829 What is 67/4 of a day in minutes? 24120 How many millilitres are there in 368.8362 litres? 368836.2 What is 9/10 of a hour in minutes? 54 What is 2/15 of a millennium in months? 1600 How many grams are there in 64/5 of a kilogram? 12800 What is 11/2 of a decade in years? 55 What is 48/5 of a litre in millilitres? 9600 How many kilograms are there in 3/8 of a tonne? 375 What is twenty-one halves of a decade in months? 1260 What is eighteen fifths of a litre in millilitres? 3600 How many centimeters are there in 0.8014721 micrometers? 0.00008014721 What is ninety-five halves of a kilogram in grams? 47500 How many millilitres are there in 3/25 of a litre? 120 What is 70.62449 meters in millimeters? 70624.49 How many tonnes are there in 37502.48kg? 37.50248 How many decades are there in 54/5 of a millennium? 1080 What is 34/5 of a millennium in years? 6800 Convert 0.9024964 millennia to years. 902.4964 How many seconds are there in 45.14214 minutes? 2708.5284 What is 21/2 of a century in years? 1050 How many kilograms are there in five quarters of a tonne? 1250 What is 30.13188 grams in milligrams? 30131.88 What is 3/40 of a milligram in nanograms? 75000 How many micrograms are there in seven halves of a milligram? 3500 What is 707.0643 centimeters in micrometers? 7070643 How many microseconds are there in 69453.01 weeks? 42005180448000000 What is 0.5771624ns in milliseconds? 0.0000005771624 What is 1/10 of a micrometer in nanometers? 100 How many millilitres are there in 21/5 of a litre? 4200 What is one fifth of a week in minutes? 2016 What is eight fifteenths of a decade in months? 64 How many millilitres are there in 0.8063658 litres? 806.3658 How many grams are there in seventy-one fifths of a kilogram? 14200 How many nanograms are there in twenty-one halves of a microgram? 10500 What is 16/15 of a minute in milliseconds? 64000 Convert 43597.89 weeks to seconds. 26368003872 What is seventy-six fifths of a meter in centimeters? 1520 What is 93154.22 kilograms in milligrams? 93154220000 What is 7.994568 months in years? 0.666214 How many micrograms are there in 6/25 of a milligram? 240 What is 32.8646052 nanoseconds in weeks? 0.000000000000054339625 How many milligrams are there in eleven quarters of a gram? 2750 What is 102.3809 centimeters in nanometers? 1023809000 How many micrometers are there in eighteen fifths of a centimeter? 36000 How many micrograms are there in 3/50 of a milligram? 60 Convert 1.059641m to nanometers. 1059641000 What is eighty-one halves of a century in months? 48600 How many months are there in twenty-seven quarters of a decade? 810 How many years are there in 2.6375856 months? 0.2197988 What is five eighths of a day in seconds? 54000 How many decades are there in 6.583711 centuries? 65.83711 Convert 963899.4kg to milligrams. 963899400000 What is 9534.371ml in litres? 9.534371 How many microseconds are there in seven quarters of a millisecond? 1750 What is 3/10 of a kilogram in grams? 300 What is 622317.9 minutes in hours? 10371.965 How many nanometers are there in 835929.9um? 835929900 How many microseconds are there in 6/25 of a millisecond? 240 How many decades are there in sixty-nine halves of a millennium? 3450 How many millimeters are there in one twentieth of a kilometer? 50000 What is 67/4 of a litre in millilitres? 16750 Convert 31497.45ml to litres. 31.49745 How many grams are there in fifteen quarters of a kilogram? 3750 Convert 71.30946 litres to millilitres. 71309.46 What is twenty-six fifths of a tonne in kilograms? 5200 Convert 730.592 milliseconds to seconds. 0.730592 How many millimeters are there in 9111.05 meters? 9111050 How many nanograms are there in 3/10 of a microgram? 300 Convert 76869.414 minutes to days. 53.3815375 What is 17/2 of a kilogram in grams? 8500 What is 5.204131 centuries in millennia? 0.5204131 What is 431043.5 litres in millilitres? 431043500 What is 2135.272 minutes in seconds? 128116.32 How many litres are there in 737.3863 millilitres? 0.7373863 How many micrograms are there in 56.15236t? 56152360000000 What is twenty-seven halves of a kilogram in grams? 13500 What is 0.678066kg in grams? 678.066 What is 1/5 of a milligram in micrograms? 200 How many meters are there in one fifth of a kilometer? 200 How many micrograms are there in 44/5 of a milligram? 8800 What is 3/40 of a litre in millilitres? 75 What is thirty-seven halves of a meter in centimeters? 1850 What is four thirds of a millennium in months? 16000 How many kilometers are there in 0.1630813mm? 0.0000001630813 How many millilitres are there in 5.505411 litres? 5505.411 Convert 30.9725ml to litres. 0.0309725 How many months are there in 29/2 of a year? 174 What is 2448.569l in millilitres? 2448569 What is seventy-seven fifths of a millennium in years? 15400 What is three eighths of a milligram in micrograms? 375 What is 46/5 of a millennium in centuries? 92 What is one tenth of a milligram in nanograms? 100000 How many millilitres are there in twenty-one quarters of a litre? 5250 What is 6/25 of a millennium in years? 240 What is 3/50 of a milligram in nanograms? 60000 What is one quarter of a gram in milligrams? 250 What is 11/8 of a tonne in kilograms? 1375 What is 3352.1229 milliseconds in days? 0.00003879771875 What is 507.0971 hours in nanoseconds? 1825549560000000 How many millilitres are there in three eighths of a litre? 375 Convert 122.3556 micrometers to centimeters. 0.	{ "pile_set_name": "DM Mathematics" }
-3v, -v - 2v = 3n - d for n. 1 Let n(u) = -53u - 308. Let h(s) = 54s + 308. Let p(q) = -2h(q) - 3n(q). Let i be p(-6). Solve -g - 8 = -4a, -4a = -ia + 5g - 26 for a. 3 Suppose 381j = -22j + 2015. Solve 20 = 5u + jg, -3g = -2 - 1 for u. 3 Suppose 4h = -5o, h - 3h - 3o = 2. Let r be (-12)/(-54) - 852/(-54). Suppose i + 4 = 2i. Solve hu - r = -j, -2u - j + i = -0 for u. 4 Suppose -13 = -4q - 4r + r, -5q = 2r - 18. Solve 3i + qh = i - 10, -i + 3h = -15 for i. 3 Let h(r) = -7r - 228. Suppose -w - 3g + 4 - 22 = 0, -2w - 3g = 51. Let j be h(w). Solve js = -0s + 5o - 1, 5o = -3s + 19 for s. 3 Let h be -2 + ((-20)/35)/(14/(-98)). Solve 2x = -3c - 10, hc = -41x + 37x - 4 for x. 1 Let k(w) = -w*3 - 11w*2 + 10w - 22. Let p be k(-12). Suppose 46 - 166 = -24v. Solve -g - vh = -24, g + 8 = -pg + 5h for g. 4 Suppose d - 12 = -11, 4d = -4h - 164. Let c = h + 47. Solve 2u = -g, 3 = -5u + 4g - cg for u. -1 Let y = -20 - -24. Suppose 0 = -73o + 71o + 4. Solve 2k = 3m - 15, -om = -k + yk + 3 for m. 3 Let w(y) = -y*2 + 12y - 34. Let v be (-5)/(175/(-217)) - (-1)/(-5). Let t be w(v). Let l = 0 - -3. Solve -lx - x = 5b - 10, 0 = -tx for b. 2 Suppose 5d - 546 = -576. Let k be (-10(-1)/d)/(10/(-18)). Solve -3w = -8w, kw + 12 = 3g for g. 4 Let b be ((-8)/12 - 4602/(-18)) + -7 - 5. Solve 5x - 4d - 5 = 0, -x - 238d - 20 = -bd for x. 5 Let a(u) = -9u3 + u2 - 3u + 2. Let k(d) = d3 - d + 1. Let h(i) = -a(i) - 5k(i). Let n be h(1). Solve -9 = -5j - 3b, 3j - n = -j - 4b for j. 3 Let s = -407 - -1394. Suppose -5l = 972 - s. Solve 5k = lg + 32, g - k + 5 + 3 = 0 for g. -4 Let w be 19893/3839 + (-1)/((-33)/(-6)). Suppose -5o + 0o + 20 = 0, 0 = 4g - 4o. Solve 2d + j + 12 = -j, -3 = -gd + wj for d. -3 Suppose 329r = 327r - 4x + 4, -3r + 14 = -2x. Solve 2y - n = 3y + 2, 5y - rn = -19 for y. -3 Suppose 5n = -5r + 10, 0 = -2n + 248r - 247r + 10. Solve ng + 36 - 48 = 4v, 5v = 0 for g. 3 Let b(t) = 2t*2 + t + 2. Let y be b(-2). Suppose 27 = yc + c. Solve -d - 2x + 7x - 20 = 0, x + 10 = cd for d. 5 Let n(v) = -v3 - 15v*2 - v. Let u = 56 + -71. Let m be n(u). Solve -3d + m = 0, 2d + d = -2p + 5 for p. -5 Suppose 22k - 21k = 140. Suppose -8y - k = -156. Solve y + 5 = -5m + 3b, -2m - 2b - 6 = 0 for m. -2 Let v(p) = p2 + p - 25. Let l be v(0). Suppose 4x = 5u + 113, -4x + 2 - 39 = u. Let g = l - u. Solve 2o - 4j + 6 = g, -2j = o + 2o + 1 for o. -1 Suppose 31q - 2016 = -q. Suppose -72 = -45m + q. Solve -3w = -mr + 4r - 3, 15 = 2w + 5r for w. 0 Let a be -2((-9)/2 - -1). Suppose -28 = -52h + 804. Suppose au - h = 3u. Solve -2r + 4c - 4 = -ur, 5r = -3c + 17 for r. 4 Suppose 112 - 52 + 185 = 35l. Solve -4p + 4m - 11 = -lp, 2m + 22 = 4p for p. 5 Let o be (-3 - 1)/((-4)/(-6)). Let k(j) = 7j - 56. Let y be k(9). Let b = y - o. Solve -4 = -5m + 3n + b, 3n = -12 for m. 1 Let d(n) be the first derivative of n4/2 + n3/3 - 2n2 - 6n + 68. Let v be d(2). Solve 0 = -5a + vj - 2j + 37, 5a - 3j = 34 for a. 5 Let c be (4 + (-54)/12)(-11 + 1). Solve 2x - cx + l = -11, 0 = 2x - 4l + 6 for x. 5 Suppose 3y + 13 = 3v + 2y, 0 = v - y - 3. Solve 2s - 50q + 48q - 8 = 0, s = vq for s. 5 Let a be 37 + (602/(-98) - (-2)/14). Let c(u) = -u3 - 3u*2 + 2u. Let q be c(-4). Suppose -3i = -7 - q. Solve -iv - a = 4f, -4v = -3f - 2v - 6 for f. -4 Let w = 2729 + -2714. Solve 3m = 4l - 0l + 9, 4l - w = -5m for m. 3 Suppose 5n + 16a = 14a + 252, -2n - 5a + 84 = 0. Solve 2f + 27 = 5t, -4t - 50f + nf = -22 for t. 5 Let j(a) = a2 - 3a + 10. Let v be j(0). Let x be 21 + 2/(v/5). Solve -b = -3, -b - x = 4o - 3b for o. -4 Let r = 5285 + -5285. Solve -2y + 4 = -rg + 2g, 0 = -4y + g + 13 for y. 3 Let w = -5366 + 5370. Suppose 4 = -4a, 5a - 1 = -4p + p. Let f be (32)/(0 + p). Solve -f = o - 5, -wo = -3g + 1 for g. 3 Suppose -2 = w - 4. Suppose 0 = -12m - 2m. Suppose md = 11d - 44. Solve -3s = -2x + 7, -dx - 4 = -2s + w for s. -5 Let s be -156-1(-8)/(-16). Let t = s - 78. Solve t = 5g - a + 11 - 4, -3g = -3a - 3 for g. -2 Let w = -74 + 201. Let v = w + -127. Let s(l) = l3 + 9l*2 + 6l + 4. Let y be s(-3). Solve -4b + y = 4k - vb, 3k = 4b - 5 for k. 5 Let p(x) = -2x*3 - 2x*2 - x + 1. Let d be p(-1). Suppose 2t = -4y - 6, -dt - 2 - 1 = 3y. Solve -tg = -4n + 17, -4g + n + 3 = 4 for g. 1 Let a be 6/1821 - (-14 + -7 + 15). Solve u = -4q + 6, 1 = 4q + 5u - a for q. 1 Let q(h) = 103h + 209. Let c be q(-2). Solve 5k + 0g = g + 19, 9 = -k - cg for k. 3 Suppose -216 = 2l + 3a - 46, 4l + 3a = -334. Let x = 80 + l. Let p be (-44)/(-8) - x/(-4). Solve -2w + pn - 27 = -0n, n = 3w + 8 for w. -1 Let t be 13/2 + 28/(-56) + -1 + 5. Suppose o + 15 = 6o. Solve oc - 2c = 3j + t, -c + 2j = -8 for c. 4 Suppose -2q = -2h + 29 - 25, q + 2h = 10. Solve -qo = 5w, 0 = 3w - 8o + 6o - 16 for w. 2 Suppose k = -4z + 48, 0k + 252 = 4k + 4z. Let n be (-8)/k + 1200/85. Solve -5f - n = -2l, -4 = -3l - f - 0 for l. 2 Suppose -90 = 14p - 15p - b, -3b = p - 98. Suppose 14 = -36f + p. Solve -s + 3t + f = -0s, 0 = s - 5t - 6 for s. -4 Let q(k) = 17k + 310. Let i be q(-18). Solve 4d + 4u - i = 0, -5u + 0u - 2 = -2d for d. 1 Suppose -f - 3i - 11 + 64 = 0, -3i + 230 = 4f. Suppose 3o - f = -2g, -5g + 24 = 2o - 19. Let j = -17 + o. Solve jq - 8 = -s, 5q - 5 = 4q for s. -2 Let j = -600 + 607. Solve 0 = -o - p - j + 4, 0 = 2o - p for o. -1 Suppose -133b + 976 = -221. Solve -5x = u - 18, 0 = 3x + bu - 11u - 3 for x. 3 Let u = 35 - 82. Let i = u + 52. Let t(m) = -m2 + 7m - 7. Let n be t(i). Solve 0 = -4h - 3w + 2w - 3, 4h - nw = -23 for h. -2 Suppose 0 = -7b - 5b - 2556. Let h = -202 - b. Solve -4k + 27 - 6 = -w, 0 = -4k - w + h for k. 4 Let b(u) = u3 + 25u*2 + 25u + 24. Let n be b(-24). Let r be (n/(-2))/((-3)/((-21)/28)). Solve -5d - g - 8 = r, -3g + 2g = 3 for d. -1 Let a = 11831 - 11829. Solve -3f = au - 11, 4u + 7 = -2f + 1 for f. 7 Let w = 11 + 157. Let a = w + -163. Solve -s - ao - 23 + 7 = 0, 5o = -3s - 8 for s. 4 Suppose 0 = -6k + 5 + 7. Suppose -14d + 13d - 4 = -3v, 4v - kd - 8 = 0. Solve v = -0p - 5p + 2c - 21, -4 = 2p - 3c for p. -5 Suppose 0 = -15k - 4k + 855. Suppose 8y = -y + k. Let f = 37 + -6. Solve 0 = 3n + yp + f, 4p + p = 5n - 15 for n. -2 Suppose -m = 5v - 6m - 25, 0 = -3m - 9. Let f = 92 - 88. Let z be (f/4)/(4/8). Solve zy + 2 = -vs - 6, -4y = s + 7 for y. -1 Suppose 2q + 2i + 487 = -q, -5q + 4i = 819. Let f = -161 - q. Solve 2j - 2 = 2o, -2o + o + 1 = -fj for o. -3 Suppose -339 - 81 = -102f - 38f. Solve 5 = 2g + 5i, 4i = -fg - 5 + 2 for g. -5 Let g = -1682 + 1685. Solve -6 + 1 = gx + s, 2x - 3s = -7 for x. -2 Suppose 3g - 4y - 11 = 0, 0y - 8 = -g - 3y. Suppose -gt + 0 = -30. Let x be 6/9 + 20/t. Solve -17 = -3h + 6h + 4a, 0 = xh + 3a + 11 for h. 1 Suppose 0 = -69q + 46q + 690. Suppose 7c = 22c - q. Suppose -3s = 2z + 1 + 11, -2z + 20 = -5s. Solve 3r + 2o = 0, zr - 16 = cr - 4o for r. -2 Suppose -71 + 517 = 104n + 30. Solve w + 10 = 5d - 7, -nd = -3w - 18 for d. 3 Suppose 0m = -3m + 114. Let o = m + -37. Let j be (-1)/(39/(-36) + o). Solve 5l = f - 14, 0 = -0f + 3f - 5l - j for f. -1 Let x = -10661 + 10665. Solve x = -5g - 4i, 5g - 8g - 2i - 2 = 0 for g. 0 Let g be (52 + 2)(5 + 27/(-6)). Suppose gv - 5 = 22v. Let l be 0 + 6 - (v + -2). Solve -4h - 19 = -d, h - l = -3d + 3h for d. -1 Suppose 4a - 3 = -5t, -2a - 17 = -5t + 4. Let y = t + 2. Let m(w) = -27w - 200. Let f be m(-8). Solve -4k + f = 0, -15 = -d - yk + 2 for d. -3 Suppose 30 = -2i + 5w - 32, -59 = 3i + w. Let t be (-8)/(-13 - i)-11. Solve 3d = -t - 2, 1 = -4h + 3d for h. -1 Let z(s) = -s*2 + 22s - 37. Let y be z(2). Solve 0 = -3f + yv - 18, 5f + 38v = 33v - 30 for f. -6 Let g = -2 + 4. Suppose 223 = -5f - 4c + 671, -2f + 4c + 168 = 0. Let r = 93 - f. Solve gh = 4u - 8, -15 = 5h + ru + 5 for h. -4 Let y = 256 + -262. Let n be (y + 20/3)6. Solve -3w + 12 = 3b, -3b = -nw + 2 + 7 for w. 3 Let g be (140/(-90))/(63/(-486)). Solve 3*d +	{ "pile_set_name": "DM Mathematics" }
45 How many minutes are there between 2:05 PM and 6:30 PM? 265 What is 675 minutes before 1:12 PM? 1:57 AM What is 609 minutes after 2:30 PM? 12:39 AM What is 665 minutes before 12:45 AM? 1:40 PM What is 538 minutes before 2:55 PM? 5:57 AM What is 646 minutes after 5:57 PM? 4:43 AM What is 344 minutes before 9:59 AM? 4:15 AM What is 102 minutes after 9:36 AM? 11:18 AM How many minutes are there between 5:15 PM and 10:43 PM? 328 How many minutes are there between 9:46 PM and 12:26 AM? 160 What is 298 minutes after 11:32 PM? 4:30 AM How many minutes are there between 3:27 PM and 2:06 AM? 639 What is 639 minutes after 1:38 AM? 12:17 PM What is 60 minutes before 3:11 AM? 2:11 AM How many minutes are there between 5:02 PM and 1:26 AM? 504 What is 2 minutes after 11:18 PM? 11:20 PM How many minutes are there between 4:35 PM and 4:44 PM? 9 How many minutes are there between 11:09 AM and 9:48 PM? 639 What is 90 minutes before 3:10 AM? 1:40 AM How many minutes are there between 12:22 PM and 9:20 PM? 538 What is 20 minutes after 5:39 PM? 5:59 PM How many minutes are there between 10:17 AM and 6:03 PM? 466 What is 416 minutes after 6:33 AM? 1:29 PM How many minutes are there between 1:10 AM and 3:34 AM? 144 What is 708 minutes after 10:19 AM? 10:07 PM What is 328 minutes after 12:22 PM? 5:50 PM How many minutes are there between 5:40 PM and 2:35 AM? 535 How many minutes are there between 4:23 AM and 11:19 AM? 416 What is 564 minutes after 8:45 AM? 6:09 PM What is 708 minutes after 7:39 AM? 7:27 PM How many minutes are there between 10:52 AM and 2:16 PM? 204 What is 699 minutes before 7:16 PM? 7:37 AM What is 111 minutes before 2:38 AM? 12:47 AM How many minutes are there between 10:30 PM and 2:30 AM? 240 What is 675 minutes before 12:42 AM? 1:27 PM What is 327 minutes after 3:02 AM? 8:29 AM What is 341 minutes after 8:29 AM? 2:10 PM How many minutes are there between 9:32 PM and 2:56 AM? 324 How many minutes are there between 12:11 AM and 11:41 AM? 690 How many minutes are there between 10:41 AM and 1:28 PM? 167 How many minutes are there between 3:13 PM and 11:24 PM? 491 What is 508 minutes before 6:17 AM? 9:49 PM How many minutes are there between 3:57 AM and 2:33 PM? 636 What is 546 minutes after 1:06 PM? 10:12 PM What is 4 minutes after 4:36 AM? 4:40 AM What is 631 minutes before 9:25 PM? 10:54 AM How many minutes are there between 12:51 AM and 4:14 AM? 203 What is 310 minutes before 10:36 PM? 5:26 PM What is 90 minutes after 6:58 AM? 8:28 AM How many minutes are there between 4:39 AM and 7:45 AM? 186 How many minutes are there between 3:21 PM and 1:45 AM? 624 What is 421 minutes after 1:32 PM? 8:33 PM How many minutes are there between 7:14 PM and 4:04 AM? 530 How many minutes are there between 3:30 PM and 10:55 PM? 445 How many minutes are there between 4:09 AM and 10:04 AM? 355 How many minutes are there between 11:19 PM and 4:34 AM? 315 How many minutes are there between 4:01 PM and 2:37 AM? 636 What is 4 minutes after 6:23 AM? 6:27 AM What is 459 minutes after 8:09 PM? 3:48 AM What is 207 minutes after 9:23 AM? 12:50 PM How many minutes are there between 7:54 AM and 11:21 AM? 207 How many minutes are there between 11:33 AM and 11:53 AM? 20 How many minutes are there between 9:31 PM and 2:20 AM? 289 What is 292 minutes before 1:35 AM? 8:43 PM How many minutes are there between 5:36 AM and 10:54 AM? 318 How many minutes are there between 10:24 AM and 2:54 PM? 270 How many minutes are there between 5:32 AM and 4:51 PM? 679 What is 692 minutes before 4:59 AM? 5:27 PM How many minutes are there between 4:16 PM and 12:50 AM? 514 How many minutes are there between 3:15 PM and 1:12 AM? 597 What is 581 minutes after 4:30 AM? 2:11 PM What is 251 minutes before 2:01 AM? 9:50 PM How many minutes are there between 2:44 AM and 7:21 AM? 277 What is 325 minutes before 11:04 AM? 5:39 AM How many minutes are there between 1:33 PM and 7:59 PM? 386 What is 170 minutes after 11:57 AM? 2:47 PM How many minutes are there between 8:20 PM and 7:37 AM? 677 What is 394 minutes after 8:51 AM? 3:25 PM How many minutes are there between 11:25 AM and 7:52 PM? 507 What is 153 minutes before 4:26 PM? 1:53 PM What is 96 minutes after 1:16 AM? 2:52 AM How many minutes are there between 3:54 PM and 3:44 AM? 710 How many minutes are there between 12:34 AM and 8:24 AM? 470 What is 236 minutes after 7:46 AM? 11:42 AM How many minutes are there between 2:35 PM and 4:22 PM? 107 What is 680 minutes before 12:22 PM? 1:02 AM How many minutes are there between 3:00 AM and 6:22 AM? 202 What is 631 minutes before 11:06 PM? 12:35 PM What is 53 minutes before 7:42 AM? 6:49 AM How many minutes are there between 5:27 AM and 7:04 AM? 97 What is 48 minutes before 9:55 AM? 9:07 AM How many minutes are there between 1:54 PM and 4:01 PM? 127 What is 391 minutes before 6:50 AM? 12:19 AM What is 583 minutes before 12:33 PM? 2:50 AM What is 406 minutes before 6:58 AM? 12:12 AM How many minutes are there between 3:55 PM and 5:58 PM? 123 What is 655 minutes before 4:28 PM? 5:33 AM How many minutes are there between 8:27 PM and 9:02 PM? 35 What is 344 minutes after 12:58 PM? 6:42 PM How many minutes are there between 7:55 PM and 5:02 AM? 547 How many minutes are there between 3:48 AM and 5:48 AM? 120 How many minutes are there between 7:46 AM and 5:35 PM? 589 What is 332 minutes after 7:19 PM? 12:51 AM How many minutes are there between 7:29 PM and 10:08 PM? 159 How many minutes are there between 9:16 PM and 7:32 AM? 616 What is 611 minutes before 10:59 AM? 12:48 AM How many minutes are there between 6:46 AM and 7:37 AM? 51 What is 681 minutes before 1:12 AM? 1:51 PM What is 12 minutes before 1:19 AM? 1:07 AM What is 646 minutes after 8:15 AM? 7:01 PM What is 244 minutes before 3:35 AM? 11:31 PM What is 557 minutes before 8:48 AM? 11:31 PM How many minutes are there between 6:56 AM and 5:12 PM? 616 What is 235 minutes before 4:57 PM? 1:02 PM How many minutes are there between 7:54 AM and 7:11 PM? 677 How many minutes are there between 7:29 AM and 6:26 PM? 657 How many minutes are there between 8:32 PM and 5:44 AM? 552 How many minutes are there between 1:47 PM and 7:40 PM? 353 How many minutes are there between 1:29 PM and 6:15 PM? 286 How many minutes are there between 12:37 AM and 10:34 AM? 597 How many minutes are there between 9:47 PM and 7:57 AM? 610 What is 128 minutes after 7:36 PM? 9:44 PM What is 320 minutes before 5:26 AM? 12:06 AM How many minutes are there between 8:24 AM and 10:52 AM? 148 How many minutes are there between 5:05 PM and 12:52 AM? 467 How many minutes are there between 10:22 PM and 1:53 AM? 211 What is 332 minutes after 4:04 AM? 9:36 AM How many minutes are there between 3:40 PM and 2:08 AM? 628 What is 670 minutes after 10:38 AM? 9:48 PM What is 456 minutes before 11:06 PM? 3:30 PM What is 616 minutes before 11:32 PM? 1:16 PM How many minutes are there between 2:13 AM and 4:03 AM? 110 How many minutes are there between 8:40 PM and 1:36 AM? 296 How many minutes are there between 4:40 PM and 4:05 AM? 685 How many minutes are there between 12:19 PM and 2:02 PM? 103 How many minutes are there between 11:50 PM and 9:20 AM? 570 What is 702 minutes after 11:55 AM? 11:37 PM What is 50 minutes after 5:32 AM? 6:22 AM How many minutes are there between 4:47 PM and 2:07 AM? 560 How many minutes are there between 3:25 PM and 8:16 PM? 291 What is 526 minutes before 6:16 PM? 9:30 AM How many minutes are there between 5:38 PM and 9:33 PM? 235 How many minutes are there between 4:35 AM and 10:07 AM? 332 How many minutes are there between 1:51 AM and 4:13 AM? 142 What is 657 minutes before 6:49 AM? 7:52 PM How many minutes are there between 8:41 PM and 11:16 PM? 155 How many minutes are there between 4:45 AM and 9:15 AM? 270 What is 704 minutes before 2:57 PM? 3:13 AM How many minutes are there between 2:06 PM and 8:33 PM? 387 How many minutes are there between 12:27 PM and 3:19 PM? 172 How many minutes are there between 1:54 AM and 10:17 AM? 503 How many minutes are there between 8:32 AM and 10:47 AM? 135 How many minutes are there between 7:07 AM and 8:58 AM? 111 How many minutes are there between 5:17 PM and 9:43 PM? 266 How many minutes are there between 8:52 AM and 4:35 PM? 463 What is	{ "pile_set_name": "DM Mathematics" }
tiple of 17 and a? 34 Let v(t) = -t*2 - 6t + 7. Let l be v(-7). Let s = 7 + l. Suppose 0y + 4 = y. Calculate the smallest common multiple of y and s. 28 Let w = -93 - -142. Calculate the common denominator of -45/4 and w. 4 Suppose 0 = -5d - 3 - 22. Let m be 2/(-10) + 29/d. Let u = m - -9. What is the least common multiple of u and 3? 3 Let w(u) = -11u. Let t = -14 + 6. Let q be w(t). Suppose 2n + q = 6n. What is the lowest common multiple of n and 2? 22 Let b = 95/56 - 401/616. Suppose 103 = -4t + m, 5t + 3m + 150 = -0m. What is the common denominator of (45/t)/((-4)/78) and b? 22 Let q = 597711/8 + -74812. Let i = q + 88. Find the common denominator of i and 85/22. 88 Suppose -5j + 4165 = -y, -2j + 20825 = -8y + 3y. Let i = y + 33415/8. Calculate the common denominator of -49/12 and i. 24 Let r = 2 - 4. Let o = 8 - r. Find the common denominator of (-2)/(-4)(-174)/o and 101/12. 60 Suppose v - 3 - 1 = 0. Suppose vz = 3y - 0z + 10, z + 2 = 3y. Calculate the least common multiple of y and 14. 14 Suppose -3n - 31498 - 32459 = 0. Let l = -255683/12 - n. Let d = 1231 - 7435/6. Calculate the common denominator of d and l. 12 Let i be 1/(-2)(3 - 9). Let c(d) = 4d - 3d - 2 + id - 3d. Calculate the smallest common multiple of c(4) and 11. 22 Suppose -3p - 323 = -4l - 2p, 3p + 321 = 4l. Let m = -20369/10 - -2042. Find the common denominator of m and -3 - (0 + l/(-2)). 10 What is the common denominator of 19/20 and 0 + (2 - 226/28)? 140 Suppose 0 = 2m - 4m + 18. Calculate the smallest common multiple of m and 10. 90 Let t be 2/227. Let m be (-24)/t(-168)/4. Calculate the common denominator of (-3)/m226 and -31/5. 30 Let h = -18979/4972 - 21/452. Let i be (-2)/(-1) - 76/(-2). Find the common denominator of (-66)/i(-10)/(-8) and h. 176 Suppose 0 = -3n - n + 112. Suppose -2g + n = -0z - 2z, 3g = -z - 6. Find the common denominator of 67/14 and -2(2 + 169/z). 42 Let i be ((-6)/(-8))/((-1)/(-4)). Suppose i = -5k + 8. Calculate the lowest common multiple of 8 and k. 8 Suppose 8 - 52 = -z. Suppose 0 = 3o + 5a - 33, -z = -4o + a - 6a. Calculate the smallest common multiple of o and 5. 55 Suppose -b + 3 - 5 = 3r, -5r + 10 = -5b. Let m(d) = 1 - 3 + 4 + 5d2 + r + d3. Calculate the lowest common multiple of 4 and m(-4). 36 Calculate the smallest common multiple of 28 and 3/1 + -4 + 7. 84 Calculate the lowest common multiple of 3 and (-16)/(-2)(1 + 2). 24 Suppose 0 = 3j - j + 276. What is the common denominator of -2 - (j/(-15) - 3) and -5/7? 35 Suppose -i - 15 = -4i. What is the smallest common multiple of 11 and i? 55 Suppose 5w - 5l = 4w - 15, -12 = -4l. Suppose 0 = -4z + 20, 4z + wz - 12 = -y. Find the common denominator of 0 + 5/(50/y) and 32/9. 45 Suppose 3 = -4y - 1. Let g be -19 + 4 + y. Find the common denominator of (g/(-44))/((-1)/26) and 97/4. 44 Suppose -5g = -0g - 2930. Let j = g + -1709/3. Calculate the common denominator of j and 0. 3 Let r(c) = -92c2 + 3c + 1. Let z be r(4). Let l be (((-10)/z)/(-2))/(-1). Let s = l + -112403/17508. Calculate the common denominator of -89/18 and s. 36 Suppose 0 = -4v + 2l - 170, 0l + 3l = 15. Let q be (142/118646)/(4/9420). Let c = q - 2/5393. What is the common denominator of v and c? 11 Let f be 621/(-2). Let w(c) = c*2 + 6c + 13. Calculate the smallest common multiple of w(f) and 6. 78 Let u = -288005665465312255/44884853230929348 + 2/684512493609. Let j = u - 2/16393. What is the common denominator of (-1)/4 + (-241)/36 and j? 36 Let a be (-2)/36/(-4). Let f be a/(-1)(75 + -2). Find the common denominator of (-1)/2f/5 and 149/6. 30 Let l be (-4)/6 - (-2289106)/132. Let s = 17337 - l. Calculate the common denominator of 43/10 and s. 110 Let c = -720/13 + 6298/117. Calculate the common denominator of -18/5 and c. 45 Let d(f) = f2 - 14f - 1. Let b be d(7). Let a = 143 + b. Let u = 63 - a. Find the common denominator of u and 23/8. 8 Find the common denominator of (-203)/(-24) + 24/36 and -89/14. 56 Let t(z) = -9z2 - 2z - 20. Let n be t(9). Let l = n + 4619/6. Find the common denominator of -85/8 and l. 24 Let p be (-1)/(-5) - 177526/40. Let r = p + 4435. What is the common denominator of r and (-57)/(-28)109/27? 140 Suppose 5u - 3w + 29 = 10u, u - 3w + 5 = 0. Calculate the smallest common multiple of u and 6. 12 Let q(n) = 2n2 - 3n - 1. Let c = -1 - -5. Let u be q(c). Let r = -10 + u. What is the lowest common multiple of 8 and r? 72 Let k be 2322 - -1(-4 - -3). Let d be (4 - 866)22/(-8). Let u = k - d. What is the common denominator of -56/5 and u? 10 Let c = -39 - -55. Let n(l) = -l*3 - 2l + 4. What is the least common multiple of c and n(0)? 16 Let r be 6 - 4 - 150303/14. Let z = 10729 + r. What is the common denominator of z and -77/4? 28 Suppose -2 - 2 = -3v - 4n, v + 4n + 4 = 0. What is the lowest common multiple of v and 8? 8 Suppose -4g = -360 - 1696. Find the common denominator of -29/20 and 1/(-5) - g/(-120). 60 Let j(b) = -b*3 + 7b*2 - 10b + 6. Let k be j(6). Let a = -1/166 - -3446/249. Find the common denominator of a and 128/k - 3/6. 18 Let r(v) be the second derivative of v*3/6 + 13v*2/2 + 3v. What is the lowest common multiple of 5 and r(-6)? 35 Suppose 3r = 4r. Suppose -2w - 5u - 18 = r, 6u - 2u + 11 = -5w. What is the least common multiple of 11 and w? 11 Suppose -k + 2 = 3. Let f be ((-3)/2)/(3/(-824)). What is the common denominator of f/1122/k and -87/8? 56 Let u(z) = z*3 + 24z*2 - 50z + 54. What is the least common multiple of u(-26) and 50? 50 Suppose 7x + 22 = 92. What is the lowest common multiple of x and 80? 80 Calculate the common denominator of (-1770)/525(-10)/16 and -5/24. 168 Suppose 0 = 4n + 2 + 2. Let y be (-2 + -2)/1n. Suppose 0 = 4a - y, 3m + 0 - 20 = -2a. Calculate the lowest common multiple of 10 and m. 30 Let u be 23(-8)/6. Let d = -7 - u. Suppose -3n + 13 = d. Calculate the least common multiple of 11 and n. 44 Let t = 104 + -70. What is the smallest common multiple of t and 6? 102 Suppose l = 6 - 4. Calculate the least common multiple of l and 12. 12 Suppose 4d - 3c + 602 = 187, 2c = -2d - 218. Let a be ((-16)/3)/(2/(-12)). Calculate the common denominator of 137/18 and (-1)/(a/d) - -1. 144 Let a be ((-2)/(-490))/((-2)/(-5)). Let s = a + 122/49. What is the common denominator of s and 14/3? 6 Let x = -1 + 6. Let m be 1/4 + 15/4. Suppose -j - mj + 55 = 0. What is the lowest common multiple of j and x? 55 Let h(p) be the third derivative of -p4/24 - 5p*3/6 - 3p2. Find the common denominator of h(-3) and -31/3. 3 Let u(o) = -o3 + 2o2 + 4o + 1. Let v be u(3). Suppose 0 = -vq - q + 20. Calculate the least common multiple of q and (24/9)/23. 4 Let w(i) = 2i - 5. Let p = 78 + -68. What is the lowest common multiple of w(6) and p? 70 Suppose b = 4h - 84, -56 = -2h + 6b - 2b. Let o = h - 10. What is the lowest common multiple of o and 6? 30 Let r = -1/1307 - -99341/11763. Let y = -284 - -1697/6. Calculate the common denominator of r and y. 18 Let k = -8 + 11. Let c = 0 + k. Suppose -13 = -3b - 1. Calculate the lowest common multiple of c and b. 12 Suppose -5j + 3g + 0g + 3 = 0, 0 = 2j + 4g - 22. Let n = -1 + j. Suppose 0 = -3w + 2w + n. Calculate the smallest common multiple of 10 and w. 10 Suppose 2s = -4p + 12, 4p + s - 8 = -2s. Let g = 37 - 18. Suppose 2c + 9 = -3x - c, -3x - g = 5c. What is the smallest common multiple of p and x? 10 Suppose 0 = 3t + 11 - 35. Suppose 5a + 4o + t - 4 = 0, 4a + 24 = 2o. Find the common denominator of (a/10)/((-12)/75) and -45/4. 4 Let o = -39 - -11. Let f = 39 + o. Let j = -5 + f. What is the lowest common multiple of j and 11? 66 Suppose -i = -3i + 42. Calculate the least common multiple of 66 and i. 462 Let x = 17 - 19. Find the common denominator of (-2)/6 - 111/18 and (-234)/40 - (1 + x). 20 What is the lowest common multiple of 10 - (-2 + -2)/(-2) and 3? 24 Let c = -424/91 + 8/91. What is the common denominator of 74/3 and c? 21 Suppose 37 = 4u + 5. Suppose -t = -5c + 38, 3t + 0t - 2c = -127. Let q = 65 + t. Calculate the lowest common multiple of u and q. 88 Suppose 4v - 6500 = 2n, 5v - 2n - 499 - 7627 = 0. Let i = v + -12937/8. Find the common	{ "pile_set_name": "DM Mathematics" }
63? 1.9737 What is 0.13 + -34.5? -34.37 What is 6628 minus -0.419? 6628.419 Add -6656 and -114. -6770 What is -0.692 minus 1? -1.692 Calculate -4 - -51060.3. 51056.3 0.1464 - 0.205 -0.0586 Work out -0.13 - 431.02. -431.15 Total of 398389 and -1.8. 398387.2 Work out -0.3 - 142270. -142270.3 What is the distance between 419 and -41? 460 Add 269 and 20. 289 What is -0.3 + -0.08781? -0.38781 What is -0.0828 - -0.03? -0.0528 Work out -46260 - -1. -46259 -3 + 517 514 Work out 0.2 - -351486. 351486.2 What is 2.2 + -302? -299.8 What is 0.14 less than -20913.9? -20914.04 Calculate -3 + -12507. -12510 What is 198 + -39.541? 158.459 Add -1573 and -0.96. -1573.96 Work out 1849 + -5. 1844 What is 1716.8 minus -3? 1719.8 Put together 243 and 19.6. 262.6 What is -18 - -1725? 1707 Total of 3645 and -50.4. 3594.6 What is -1.2 + -144? -145.2 Work out -2 - -0.0658. -1.9342 Add together 459 and -0.4. 458.6 Total of 11 and -127814. -127803 Add together -1895 and -84. -1979 -0.1398 - -1.33 1.1902 Add together 0.362 and 13. 13.362 Add together 0.15 and -1114. -1113.85 Calculate -91151 - 0.2. -91151.2 0.073 + -3 -2.927 What is -1.91 + -3? -4.91 What is 3 - -1162? 1165 Work out 0 + -637885. -637885 Calculate -1.61 - 0.58. -2.19 What is -0.1 + -0.080075? -0.180075 What is the difference between 1926 and -1.39? 1927.39 -27.45 + -10 -37.45 Work out 3.8319 + -0.7. 3.1319 What is 0.4 + -73.034? -72.634 180 + 70 250 What is the distance between -2.6 and -0.073? 2.527 Calculate -289331 - -0.9. -289330.1 What is 0.1 minus 13842? -13841.9 Work out 0.5 - 3103. -3102.5 Work out 719 + -91. 628 What is -5 plus -1.368338? -6.368338 Subtract -23 from 114.039. 137.039 Sum -167 and -51. -218 What is 0.0515 minus 0.02? 0.0315 Subtract -19.023 from -83. -63.977 Total of -0.422 and -0.059. -0.481 1240+-1190 50 1.821 + 5 6.821 What is -187193 minus 0.037? -187193.037 Total of -19913 and -0.3. -19913.3 Add -5.181235 and -0.1. -5.281235 Subtract -6.2824 from 0.022. 6.3044 -236 + 3341 3105 Subtract 85.6 from -0.02263. -85.62263 715872 + 0.4 715872.4 What is the difference between -5 and -322622? 322617 What is -0.391 minus 0.028? -0.419 Total of 0.7 and -0.2538. 0.4462 What is the difference between -1609 and 0.5? 1609.5 Total of 0.08 and 7348. 7348.08 9.944 + 155 164.944 Calculate 0.6635 - 1.9. -1.2365 What is 6.756 less than 0.1? -6.656 What is 144 plus -0.3? 143.7 Subtract -0.051 from -602. -601.949 Subtract 710 from -40. -750 What is 5.5 plus 0.2? 5.7 Work out -23215 + -1. -23216 What is -0.7 - -2.081? 1.381 What is -10822 plus -5? -10827 Work out 0 + -110614. -110614 Work out 2167 + -0.0417. 2166.9583 What is the distance between 2 and -2127.03? 2129.03 What is the distance between -5 and 153? 158 Calculate 3 + -77484. -77481 Sum 0.14 and 4. 4.14 Calculate -7 - 0.0581. -7.0581 What is -0.09 + -108258? -108258.09 What is -0.12539 take away -0.3? 0.17461 Work out 1.1176 - 154. -152.8824 Add 0.1 and 26. 26.1 Work out 0.37 - -26.6. 26.97 What is -3398 take away 2.57? -3400.57 -3612+4 -3608 What is the distance between -10.5908 and -1? 9.5908 Put together 1 and 156908. 156909 Calculate 0 - 469. -469 Sum -9.9 and -6337. -6346.9 What is the distance between 3 and 258580? 258577 Work out -769 - -945. 176 Put together 19 and 9410. 9429 Put together -20.1862 and 11. -9.1862 What is 0.2 less than 3.464661? 3.264661 What is 0.5 minus 1.1592? -0.6592 What is 0.3 plus -0.1033? 0.1967 What is 5 less than -300117? -300122 What is -2.47 less than -178.16? -175.69 What is -0.339 take away 0? -0.339 What is -4969 + -38.3? -5007.3 Add 39.57 and 79.1. 118.67 Sum 576991 and 0. 576991 Work out -2.4 - 0.1436. -2.5436 What is 0 take away 2368.2? -2368.2 What is 0.14 plus 7.4? 7.54 What is -54 minus 185? -239 89 + -14 75 Work out 159599 + 0.25. 159599.25 Add together 0.11 and -93413. -93412.89 Calculate 3097.39 + -0.4. 3096.99 Work out 4 - -0.2714. 4.2714 What is -0.2 plus 41.88? 41.68 Calculate -1 + 214809. 214808 Add together 623515 and -0.4. 623514.6 Calculate -3099 - -4. -3095 Add -0.7 and -410896. -410896.7 Subtract 14.57 from 4. -10.57 What is the difference between -4186 and -0.018? 4185.982 What is -2959 + 4? -2955 What is -0.725 less than 0.5? 1.225 What is the distance between 0.5 and -0.5835? 1.0835 What is 3687 - -0.0636? 3687.0636 Work out 85.5849 - -0.1. 85.6849 Work out -105 - -6. -99 Calculate -0.126 - 0.394. -0.52 Add -16 and 4. -12 What is -30.772 take away 0.02? -30.792 Work out 17307 + -0.1. 17306.9 Put together 17413 and 0.4. 17413.4 Add together -0.4 and -3887. -3887.4 Calculate -138048 - 4. -138052 Work out 1 + -8.647. -7.647 What is -558.44 + 9.2? -549.24 Add -0.0887 and 1124. 1123.9113 What is the difference between -0.3745 and 0.191? 0.5655 What is 2.2 less than -7.273? -9.473 What is -224 - 0.093? -224.093 Add 0.5 and 366.1. 366.6 Add 0.27 and -53236. -53235.73 What is 768.3 less than 0.3? -768 What is -18 + 90365? 90347 Sum -1887.104 and -0.3. -1887.404 Add together -18 and -1.081. -19.081 Add together -80 and -89. -169 What is -13 take away 71? -84 -0.2 + 1.0287 0.8287 What is -0.5 minus -0.02737? -0.47263 Calculate 1595 - 0.2. 1594.8 What is the distance between 0.09 and -9698? 9698.09 -0.4 + -6836 -6836.4 -67 + 51 -16 Subtract -2 from 0.2528. 2.2528 Add together 2240 and -192. 2048 Calculate 0.4 + 0.0802609. 0.4802609 Calculate -185 - 611. -796 2.1+0.0663 2.1663 What is -462 - -520? 58 What is the difference between 0.2 and 13282137? 13282136.8 Calculate -4 - 0.519. -4.519 Calculate 0 - -35380. 35380 What is the difference between -1.3311 and -0.18? 1.1511 -158375 - 0 -158375 What is 0.091 take away 4558? -4557.909 Subtract 9.97 from 2. -7.97 Add together 588 and -2. 586 Sum -0.5 and 1861012. 1861011.5 Work out 151 - 1405. -1254 Subtract 913 from 3. -910 What is 0.08 - 20435? -20434.92 Sum 11962 and 2. 11964 Work out -336 - 0.003. -336.003 9.7 + 19 28.7 Sum -1926 and -1.5. -1927.5 What is the distance between -17 and -74? 57 Work out -0.0961 + 0.3. 0.2039 Add together 845 and -12.86. 832.14 Calculate -8 - 135. -143 Work out 43900 + -0.12. 43899.88 Work out 0.08 - -0.33. 0.41 What is -313 minus -0.2? -312.8 Sum -7 and -3195. -3202 What is 2304.3 less than 54? -2250.3 What is -0.0256 plus -2? -2.0256 What is the difference between -42 and -93? 51 Put together 0.58 and 51888. 51888.58 Subtract -843 from 0.2. 843.2 What is 1277.9 - -3? 1280.9 Calculate 27 + 366.63. 393.63 What is the distance between -0.202 and 0.3? 0.502 Add together -6251929 and 0. -6251929 Add 1 and -1298.685. -1297.685 Subtract 21278.13 from -3. -21281.13 What is the distance between 0.8432 and 0.21? 0.6332 What is -2234 plus 23? -2211 Sum -0.05 and -75.5. -75.55 Calculate -113 - -22. -91 What is -5 plus 4.8? -0.2 Add -1.0107 and -3. -4.0107 -1.2087 + 0.5 -0.7087 What is -8.31 less than 0.15? 8.46 Work out -90.3 - 11. -101.3 Total of -44870 and -0.1. -44870.1 What is -5.33 less than 29? 34.33 What is 6818 minus -464? 7282 Work out -9634 - -0.04. -9633.96 -14101.47 - 1 -14102.47 Subtract 0.45 from 0.11. -0.34 Work out -22778 + -1. -22779 What is 4 take away 100979? -100975 Sum -1.2 and 695.5. 694.3 What is -9 + 19974? 19965 -0.167 - -15.35 15.183 What is -2 + -9287? -9289 What is 3 minus 40.8? -37.8 What is -0.6247 less than 2.3? 2.9247 What is 1 - 155344? -155343 Work out -2.4 - -60.4. 58 What is the difference between -2303 and 0.4? 2303.4 -150 - -0.0089 -149.9911 Put together -0.049717 and 1.2. 1.150283 What is -3 take away -224863? 224860 Work out -4 + -82.82. -86.82 What is the distance between -0.39802 and 0.2? 0.59802 What is -30 + -52? -82 1074 + -62 1012 Sum 175413 and -0.09. 175412.91 7.2+32 39.2 Work out -217012 - -0.4. -217011.6 Put together 407 and -3.73. 403.27 -15581 + 12.6 -15568.4 Calculate -14.782 - 3.4. -18.182 Work out -89050 + 4. -89046 -31.97 - 0 -31.97 Work out 11316 + 0.017. 11316.017 What is the distance between -1153.9 and 0.4? 1154.3 Subtract -2.361 from -0.1. 2.261 What is the difference between 0.3569 and 0? 0.3569 Total of 0.257 and -5. -4.743 What is 111174 less than 1.6? -111172.4 What is -0.49 less than -3.3? -2.81 Subtract -0.2 from -26.6925. -26.4925 What is the distance between -3 and 2342? 2345 Total of -0.05254 and 0.5. 0.44746 What is 4.4143 + 0.12? 4.5343 What is the diff	{ "pile_set_name": "DM Mathematics" }
- 4cb + 7c*4 - 15c*3 + 6c2 - c4 = 0. -1, 1, 2 Factor 1/2l3 - 1 + l2 - 1/2l. (l - 1)(l + 1)(l + 2)/2 Let t(g) = 3g3 - 4g*2 - 5g - 4. Let m(x) = x3 - x2 - x - 1. Let a(j) = 4m(j) - t(j). Let b(p) = -p2. Let w(z) = -a(z) + 2b(z). Factor w(y). -y(y + 1)2 Factor -18p*2 + 540p*3 + 16 - 282p*3 - 272p*3 + 14p + 2p4. 2(p - 8)(p - 1)(p + 1)2 Let k(s) be the second derivative of -s7/6300 - s6/450 - s5/75 + s*4/6 + 2s. Let a(p) be the third derivative of k(p). Let a(m) = 0. Calculate m. -2 Let f(w) be the second derivative of -1/6w2 + 0 - 1/20w*5 - 7/36w*4 - 3w - 5/18w3. Factor f(o). -(o + 1)2(3o + 1)/3 Let u(o) be the first derivative of -2o*5/5 + 2o*4 - 4o*3 + 4o*2 - 2o + 15. Determine p so that u(p) = 0. 1 Let o = -110 + 113. Factor 0 - 3/2x2 - 1/2x - 3/2xo - 1/2x*4. -x(x + 1)*3/2 Factor 22 - 9q2 - 10 - q4 + 6q3 - 12. -q2(q - 3)*2 Let -11/2a*4 - 2a*5 + 5/4a + 1/4a2 - 17/4a*3 + 1/4 = 0. What is a? -1, -1/4, 1/2 Let c = 253 + -251. Solve 0 + 4/11g*3 + 2/11g*c + 0g + 2/11g4 = 0 for g. -1, 0 Let a(d) be the first derivative of -5d*5 - 55d*4/2 - 115d*3/3 - 15d2 - 1. Find m such that a(m) = 0. -3, -1, -2/5, 0 Let -c4 + 5/3c - 5/3c*3 - 2/3 + 5/3c*2 = 0. Calculate c. -2, -1, 1/3, 1 Factor -28/3j - 26/3j2 + 3j4 + j3 - 8/3. (j - 2)(j + 1)(3j + 2)2/3 Let h(c) be the third derivative of -c8/840 - 2c7/525 + c5/75 + c*4/60 - 3c*2. Determine r, given that h(r) = 0. -1, 0, 1 Suppose -6 - 6 = -3r. Suppose -18 - 6 = -rv. Factor -8g*2 + v - 3 - 5 + 8g. -2(2g - 1)*2 Suppose 7 - 1 = v - o, -15 = 3o. Factor 0x2 + v - 1 - 1 + x2. (x - 1)(x + 1) Let l(x) be the third derivative of -x7/1260 + x6/180 + x*4/6 + 6x*2. Let d(w) be the second derivative of l(w). Factor d(m). -2m(m - 2) Let a(z) be the first derivative of z4/2 + 2z3/3 - z2 - 2z + 10. Determine b so that a(b) = 0. -1, 1 Let l(q) be the first derivative of -2q*3/3 + 2q + 22. Factor l(m). -2(m - 1)(m + 1) Let a(u) be the first derivative of u + 2. Let j(h) = h*2 + 3h + 3. Let x(w) = -3a(w) + 3j(w). Factor x(s). 3(s + 1)(s + 2) Let a = 2 + -2. Let v(u) be the third derivative of 1/90u6 + 0 - 1/90u*5 + au - 2u2 + 0u*3 + 0u*4 - 1/315u*7. What is r in v(r) = 0? 0, 1 Let k(q) = -9q*3 - 7q*2 + 11. Let t(f) = -4f*3 - 4f*2 + 6. Let l(w) = 2k(w) - 5t(w). Determine u so that l(u) = 0. -2, 1 Let n = 561 + -3921/7. Let -2/7q*2 + 0 + nq = 0. What is q? 0, 3 Suppose -5v - 9 - 3 = -p, -4p + 2 = 3v. Factor 0w*2 - pw3 + w + w3 + 0w2. -w(w - 1)(w + 1) Let h(z) be the first derivative of 3z*5/10 - 3z4/8 - z3/2 + 3z2/4 + 1. Solve h(a) = 0 for a. -1, 0, 1 Find b, given that 12b + 3b3 - b2 - 10b2 - b2 + 0b3 = 0. 0, 2 Let c(v) be the second derivative of -v6/90 + v5/15 - v4/6 + 2v3/9 - v2/6 + 19v. Factor c(d). -(d - 1)4/3 Let y(v) be the first derivative of 0v*2 + 2 - 1/12v*4 + 0v + 1/9v3. Factor y(m). -m2(m - 1)/3 Let o(a) be the third derivative of 0a + 0a*3 - 1/120a6 + a2 - 1/72a4 + 0 + 1/630a*7 + 1/60a*5. Factor o(i). i(i - 1)*3/3 Let j be (-15)/(-6)8/10. Factor 4uj + 8u*2 + 4u*2 + 4u*3 + 16u. 4u(u + 2)*2 Let m be 2 + (1/(-6)47)/4. Let h(c) be the second derivative of 1/16c4 - 3c + 1/16c5 - mc*3 + 0 - 1/8c*2 + 1/60c6. Factor h(q). (q + 1)3(2q - 1)/4 Let n = 1/12 - -2/3. Solve 1/4d5 + 0d + 0 + 3/4d3 + nd*4 + 1/4d*2 = 0. -1, 0 Let o be -3 - (2 - (6 + 0)). Determine w, given that 14w*2 + 1 + 2w*3 - o + 8w*3 + 4w = 0. -1, -2/5, 0 Suppose 3n = 5n - 16. Suppose nz - 10 = 3z. Find x such that -2 + 0x4 + 7x3 + x3 + 8x - 2x4 + xz - 13x2 = 0. 1 Solve 3m*3 + 7m*5 + 40m*2 + 0m*5 + 12m*4 - 42m*2 = 0. -1, 0, 2/7 Let m = 5 - -13. Suppose -u - 2l + m = u, -4l = -u - 16. Factor 4 - n3 - u - n4. -n3(n + 1) Let t be 8/(-90)(-6)/64. Let i(p) be the third derivative of 1/480p6 + p2 + 0 + 1/96p4 + 0p + 0p3 + tp*5. Determine y so that i(y) = 0. -1, 0 Let h = 119 + -115. Let y(z) be the third derivative of -1/840z*8 - 2/525z*7 + 0 + 1/75z*5 + 0z + 1/60zh + 2z*2 + 0z*3 + 0z*6. Factor y(d). -2d(d - 1)(d + 1)*3/5 Suppose 3w + 38 = -22. Let z be (-8)/w + (-6)/(-15). Suppose -4/5b3 - 16/5b*2 + 4/5b*4 - 14/5b - z + 2/5b5 = 0. Calculate b. -1, 2 Let f(u) be the first derivative of u6/240 + u5/30 + u4/12 - u2/2 + 3. Let s(m) be the second derivative of f(m). Solve s(o) = 0. -2, 0 Suppose -2 = g, 2d = 4g - 7g. Let t be (6/(-4))/(3/(-8)). Let 0 - 1 - 2ld + 2l4 - lt + 2l = 0. What is l? -1, 1 Let w = -1/62 + 16/31. Let x(o) be the first derivative of -1 - 1/4o*4 + wo*2 + 0o + 0o3. Factor x(v). -v(v - 1)(v + 1) Let p be (-2)/4 - (-14)/12. Let x(r) be the first derivative of 2r*2 - 2 - pr*3 - 2r. Factor x(d). -2(d - 1)2 Suppose -16z + 12 = -10z. Factor 0 - 1/2a*z + 1/2a. -a(a - 1)/2 Let r be -7 + 0 - (-3 - -2). Let s(z) = -8z2 + 2. Let w(u) = u2. Let o(f) = rw(f) - s(f). Factor o(c). 2(c - 1)(c + 1) Let u = -1 - -1. Suppose up + 2p = 8. Find z, given that z3 + 2 - p - 3z + 4 = 0. -2, 1 Let c(v) be the third derivative of 1/90v5 + 1/12v*4 + 0v + 2/9v3 + 0 + 6v2. Suppose c(f) = 0. Calculate f. -2, -1 Let i(c) = -c2 + 9c - 5. Let l be i(8). Factor -ld4 + d4 + 7d2 - 4d2 - d4. -3d2(d - 1)(d + 1) Let k(c) = -6c + 28c - 9c*3 - 12 - 18c*2 - 7c. Let w(d) = d3 + d2 - d + 1. Let v(x) = -k(x) - 12w(x). Factor v(f). -3f(f - 1)2 What is a in 2/7a*3 + 4/7a*4 + 0 + 0a - 2/7a2 = 0? -1, 0, 1/2 Let c(b) be the first derivative of -4/9b*3 + 4/3b + 7/6b4 + 4 - 7/3b*2. Solve c(l) = 0. -1, 2/7, 1 Factor 4/7f*2 + 2/7f*3 + 2/7f + 0. 2f(f + 1)*2/7 Let a = 18 - 18. Let z(o) be the second derivative of -1/126o*7 + 2o + 0o3 + 0o*2 + 0o*5 + a + 0o*4 - 1/90o6. Factor z(u). -u4(u + 1)/3 Let l(g) be the second derivative of -g6/6 - g5/4 + 5g*4/12 + 5g*3/6 + 11g. Let l(h) = 0. Calculate h. -1, 0, 1 Let k = -59/8 + 8. Let h(m) be the first derivative of -1/4m - 5/6m*3 - 1 + km*2 + 1/24m*6 - 1/4m*5 + 5/8m4. Factor h(p). (p - 1)5/4 Let x be (-8)/10 - 990/(-675). Find i, given that -4/9 + 2/3i3 - xi + 2/9i2 + 2/9i*4 = 0. -2, -1, 1 Solve 0 + 2/15b*2 - 8/15b = 0. 0, 4 Let t(u) be the first derivative of 7u4/18 - 2u*3/3 + 2u*2/9 - 8. What is h in t(h) = 0? 0, 2/7, 1 Let z be (-1 + 0)/((-3)/(-69)). Let h = -23 - z. Factor 1/3m*5 + 0 - 1/3m - 2/3m4 + hm*3 + 2/3m*2. m(m - 1)*3(m + 1)/3 Factor 6b4 + 70b*3 + 211b + 2b4 + 209b - 3b4 + 305b*2 + 180. 5(b + 1)*2(b + 6)*2 Let j(t) = -12t*2 - 45t + 57. Let l(q) = -3q2 - 11q + 14. Let p(m) = -5j(m) + 21l(m). Factor p(h). -3(h - 1)(h + 3) Let y be (4/10)/(56/280). Suppose 0b + 0 + 1/4b*y - 1/4b*4 + 0b*3 = 0. What is b? -1, 0, 1 Let k(b) = 3b*2 + 9b2 + b2 - 4b2. Let r(z) = -13z*2. Suppose 0 = -3s - 11 - 4. Let v(j) = sr(j) - 7k(j). Factor v(c). 2c2 Let n = -7 - -10. Let a(t) be the first derivative of -1 + 1/6t*2 + 0t + 1/4t4 - 1/3t*n - 1/15t*5. Factor a(k). -k(k - 1)*3/3 Let 1/9s*4 + 0s*2 + 1/3s*3 + 0 - 4/9s = 0. What is s? -2, 0, 1 Let t(a) = 36a3 - 63a*2 + 18a + 1. Let b(x) = 12x3 - 21x*2 + 6x. Let n(g) = 8b(g) - 3t(g). Find w such that n(w) = 0. -1/4, 1 Let -4n + 2n - 3n2 + 5n + 6 + 0 = 0. What is n? -1, 2 Let v(z) be the first derivative of z*4/6 + 2z*3 + 9z*2 + 18z - 4. Factor v(h). 2(h + 3)3/3 Let u be (-42)/(-5) - 4/10. Suppose uq = 2q. Determine w, given that -1/3w*2 + 0 + qw - 1/3w3 = 0. -1, 0 Let w be 3/(-2)12/(-10). Let o = 264 + -1311/5. Suppose 3/5q4 - 3/5q + 0 - oq3 + wq*2 = 0. What is q? 0, 1 Let n = -703/4 - -176. Factor 3/4l*3 + 5/4l*2 + 1/4l - n. (l + 1)*2(3l - 1)/4 Let s = -2 - -3. Find m, given that -2m - m + 11m3 - 12m*3 + s + 3m*2 = 0. 1 Let y = -3 - -4. Let q be 6y - 2 - 2. What is t in 2 + 2t - 2t*q - 2t = 0? -1, 1 Let s be ((-1)/2)/((-8)/64). Factor -q**5 +	{ "pile_set_name": "DM Mathematics" }
c - 3q - 144 = p. What is the units digit of c? 3 Let y(u) = -u*3 + 18u*2 - 23u + 15. Let z be y(11). Suppose 7i - 203 = z. What is the hundreds digit of i? 1 Let w(v) = -7v*2 - 6v*2 + 8v*2 - 11v*2 - 34v + 17 + 14v2. What is the units digit of w(-14)? 1 Suppose 15c - 140107 = 422033. What is the hundreds digit of c? 4 Let j = -187 + 180. Let r(n) = 4n2 + 5n - 9. What is the hundreds digit of r(j)? 1 Let g = 8997 - -736. What is the units digit of g? 3 Let n be (-4)/((-63)/81 + (-4)/18). Suppose 2q - 7 + 1 = 0. Suppose nu - 903 = g, u - 5g = qu - 479. What is the hundreds digit of u? 2 Let n = 33362 - 16235. What is the thousands digit of n? 7 Let n(r) be the third derivative of -r*5/60 + 19r*4/24 + 5r*3/6 - 22r*2. What is the units digit of n(9)? 5 Let i(z) = -337z*3 + 2z*2 + 3z + 1. Let f be i(-1). Suppose -4t - 9 = -f. Let w = t - 47. What is the tens digit of w? 3 What is the thousands digit of (1 + 6)((-2)/(-13) - 1098252/(-2457))? 3 Suppose 2h = -5f + 703, -2h + 260 + 431 = f. Suppose 0 = i - 3d - 65 - h, 5d - 25 = 0. What is the units digit of i? 4 What is the thousands digit of 4268 + -8 + -1 + (-5)/1? 4 Let h(g) be the second derivative of g4/12 + 13g*3/6 + 4g*2 + g. Let t be h(-8). Let j = t + 86. What is the tens digit of j? 5 Let x(p) = -p + 33. Let g be x(24). Suppose 0 = gt - 47 - 70. Suppose ts - 5s = 2064. What is the units digit of s? 8 Let c(w) = 35w2 + w - 2. Let a be (9 - 3)8/12. Let i be 4a/(-8) - (-2 + -2). What is the tens digit of c(i)? 4 Let w = 4331 - 3086. What is the thousands digit of (103)/((-17400)/w - -14)? 1 Let n be 2/((-5)/(5/(-2)))-12. Let h = 15 + n. Suppose 2g + hg - 240 = 0. What is the units digit of g? 8 Suppose 72n - 684 = 69n. Let g = n + 54. What is the tens digit of g? 8 Suppose d + 4l = 6197, l + 12418 = 2d + 3l. Suppose t + 546 + 1005 = k, 4k + 5t - d = 0. What is the thousands digit of k? 1 Let g(k) = 3k3 - k2 + 2k - 1. Let p be g(1). Suppose 5m + 55 + p = -a, m + 23 = -4a. Let l(x) = -x*2 - 13x + 4. What is the units digit of l(m)? 6 What is the ten thousands digit of (-704718)/170(-10 + 2 + 3)? 2 What is the hundreds digit of 3/18 - 1852445/(-294)? 3 Let q be 6((-23144)/(-60) - (-4)/(-10)). Let c = q - 1516. What is the units digit of c? 6 Let j(h) = -h*2 + 19h - 37. Suppose 4b - 9b - 47 = -2p, -p + b = -19. Let x be j(p). Let u = 37 + x. What is the tens digit of u? 4 Suppose 0 = -z + 3v + 5, 5v - 4 = z - 9. What is the tens digit of (-1)/((-2988)/597 + z)? 9 What is the hundreds digit of ((-100)/80)/((-10)/182488)? 8 Let g(r) = r2 + 3r - 38. Let b be g(5). Suppose 4v - 1168 = -v - 4k, 0 = bv - k - 462. What is the hundreds digit of v? 2 Let f be (-30)/9(-42)/10. Let h = f + 43. Let j = 150 - h. What is the tens digit of j? 9 Suppose 3z + 4 - 1 = -3j, -5j + 3 = 3z. Suppose -5b = -4k + 1921, -2k - jb = -4b - 953. What is the hundreds digit of k? 4 Let h be (-2)/(-15) + 1504/(-30). Let z = h - -131. What is the units digit of z + -4 + 3 - -3? 3 Let n(m) be the second derivative of m5/12 - 11m*4/6 + 7m*3 + 6m. Let k(x) be the second derivative of n(x). What is the hundreds digit of k(26)? 2 Let n(q) = -144q2 - 3q + 135q2 + q + 7. Let c be n(4). Let w = -42 - c. What is the hundreds digit of w? 1 Let q(n) = n - 33. Let i be q(19). Let f be 7/i + (-1917)/(-6). Suppose -x - 5g = -46, -68 = 5x + 4g - f. What is the units digit of x? 1 Let f(a) = -a*3 - 16a*2 - 15a + 3. Let w be f(-15). Suppose -wh + h = d - 8, 0 = -d + 4. Suppose 156 = 6s - hs. What is the tens digit of s? 3 Let v(p) = 549p*2 + 349p + 15. What is the tens digit of v(-6)? 8 Suppose -3d + 35 = 4i, -21i = -22i + 5. What is the hundreds digit of (d - 13) + 6 + 447? 4 Let w be 154/21 - (-30)/18. Let r(y) = 3y3 - 22y*2 + 9y - 3. What is the tens digit of r(w)? 8 Let y(g) = -3g + 22. Let s be y(7). Let l be 5/s - (6 + -6). Suppose -6 = 2u, -lm + m + 253 = 5u. What is the tens digit of m? 6 Let p = 518 - 515. Let b(q) = 32q2 + 6q - 12. What is the hundreds digit of b(p)? 2 Let w = 4363 - 3515. What is the hundreds digit of w? 8 Let v be ((-6)/27)/((-5)/90). Suppose -vm = c - 48, -2c + 6c - 244 = -3m. What is the tens digit of c? 6 Suppose 2v = v + 3. Let o = -4376 - -4461. Suppose -vc = -o - 119. What is the tens digit of c? 6 Suppose -673b = -659b - 343770. What is the ten thousands digit of b? 2 Let c = 11934 + -6273. What is the thousands digit of c? 5 Suppose -769 + 193 = -4t + 2g, 0 = 3t + g - 437. Suppose -4f - t = 4059. What is the tens digit of (-4)/(-16) - (f/4 - 2)? 6 Let p(b) = 65b3 - 2b*2 + b + 1. Let d be p(1). Let g = 89 - d. Suppose -19i - 270 = -gi. What is the units digit of i? 4 Suppose 0 = 3s - 12, -k - 3270 + 9309 = -3s. What is the units digit of k? 1 Let k be (-548)/(-2) + (-2 - 1). Suppose -3a = 4g + 116 + k, -a - 195 = 2g. Let c = g - -175. What is the units digit of c? 6 Suppose -5470 = -66t + 1466660. What is the tens digit of t? 0 Let z(d) = -2d*3 - 18d*2 - 13d + 13. Let p = -118 + 106. What is the tens digit of z(p)? 3 Let l = 10385 + -6542. What is the hundreds digit of l? 8 Let j = 2946 - 290. What is the units digit of j? 6 Suppose 3v = 4j + 475, 27j - 5v = 29j + 205. Let f = 224 - j. What is the hundreds digit of f? 3 Suppose 554405 = 177z - 433078. What is the tens digit of z? 7 Suppose -14p + 5845 = -31129. What is the tens digit of p? 4 Let h = -109 - -80. Let k(b) = -15b + 76. What is the hundreds digit of k(h)? 5 Let x be 5/((-20)/(-16336)) + (4 - 0). Suppose 0 = 305h - 309h + x. What is the tens digit of h? 2 Let q be 7/(-1) - -4 - -12. Suppose qb - 2090 = -5g + 6b, -4g - 2b + 1672 = 0. What is the tens digit of g? 1 Let q(m) = 2m*2 - 23m + 15. Let s be q(7). What is the hundreds digit of (-8)/6 - 11776/s? 2 What is the ten thousands digit of (6/(-4))/((-2)/(-33) - 48244600/795709200)? 6 Let q be (-433)/5 + (-30)/(-50). Let w = -81 - q. Suppose 0 = -4s - 4r + 360, 2s = -0s + wr + 208. What is the tens digit of s? 9 Suppose -5q + 3 = -17. Suppose 3j - 7 + q = -2g, -2g + 4j + 38 = 0. Suppose -gy + 658 = -2y. What is the units digit of y? 4 Suppose 137070 = -355q + 364q. What is the thousands digit of q? 5 Let y(g) = g*2 - 38g + 285. Let o be y(28). Suppose -2k - 2s + 3122 = 0, 0 = os - 6s - 1. What is the units digit of k? 2 Suppose -5u + 12m - 10m + 40 = 0, -2m = -3u + 24. Let j(x) = 2x*3 + 3x*2 + 2x + 4. Let h be j(3). Suppose -h = -uy + y. What is the units digit of y? 3 Let l = -413 + 1534. What is the thousands digit of l? 1 What is the units digit of 255/(-153)(-7164)/20? 7 Let k(a) = 3a + 15 - 13 - 1 + a2 - 17. Let x be k(-6). Suppose 92 = xn - 3h, -3n + 131 + 7 = 5h. What is the units digit of n? 6 Let h be (42313/48)/((-6)/(-32)). Suppose -21p - h = -22p. What is the tens digit of p? 2 Suppose -4p + 184x - 179x = -180947, -135780 = -3p - 4x. What is the thousands digit of p? 5 Let q(y) = 110y - 106. Suppose -15s - 15s = -150. What is the hundreds digit of q(s)? 4 Suppose -2q + 3q - 47 = -c, -235 = -5c + 5q. Suppose -b = -5a + c, -b + 22 = 2a - 3b. Suppose 0 = 6h - ah + 441. What is the units digit of h? 7 Let m(p) = 2p*3 - 52p*2 + 9p - 25. What is the tens digit of m(27)? 7 Let v(r) = 4r2 + 2r. Let c(b) be the second derivative of b*3/6 + 3b*2/2 + 20b. Let o be c(-8). What is the tens digit of v(o)? 9 Let i = 306 + -138. What is the units digit of 1 + i + 3/3? 0 Let k(q) = 442q - 65. Let l be k(-3). Let z = 2096 + l. What is the tens digit of z? 0 Let k(t) = 45t*3 + 2t*2 - 2t + 15. Let s = -378 + 381. What is the thousands digit of k(s)? 1 Suppose -4z = -6l + 83606, 0 = -4l - 5z + 58892 - 3124. What is the units digit of l? 7 Let f(y) be the third derivative of -29y4 - 11y*3/3 - 145y*2. What is the tens digit of f(-2)? 7 Suppose -156i + 159i = 23508. What is the hundreds digit of i? 8 Suppose 4j = o - 4603, 3j + 520 - 499 = 0. What is the hundreds digit of o? 5 Let l(k) = k - 209. Let d(o) = 70. Let a(z) = 7d(z) + 2l(z). Let y be a(-25). Suppose 26i - 676 = y*i. What is the tens digit of i? 6 Suppose 33	{ "pile_set_name": "DM Mathematics" }
out 3.34 * 34721. 115968.14 Product of -14.826 and -65. 963.69 Multiply -34840.4441 and -0.4. 13936.17764 Product of 0.88 and 1029620. 906065.6 20500722 4510154 What is the product of 3063.78 and 214? 655648.92 Multiply -1962 and 2741. -5377842 Product of 210421.9 and -1.23. -258818.937 Calculate -19.302823-0.1. 1.9302823 Multiply -23 and -514584. 11835432 -5 times 1006085 -5030425 Work out -0.005 * -358116. 1790.58 -0.07924962 -1971.998 Multiply -264074.742 and -0.3. 79222.4226 What is 0.2334 times -48758? -11380.1172 Calculate -10704-9106. 97470624 Work out -0.23415 * 2.51. -0.5877165 -856.9 times -3514 3011146.6 What is the product of -0.3 and -5732.255? 1719.6765 Product of -2.5138 and 0.027. -0.0678726 Work out 0.1 * -17443.7. -1744.37 -1.725 * -0.4033 0.6956925 Product of -9.094 and 9. -81.846 Work out -351 * 0.116283. -40.815333 Work out 72851935 * -4. -291407740 What is -14534 times -87? 1264458 71.24476 times -140 -9974.2664 What is the product of 0.18 and -658332? -118499.76 Work out 17089818 * 0.05. 854490.9 19.569 times -0.23 -4.50087 18 * -683.77 -12307.86 -0.07 * 117764.8 -8243.536 Work out 0.111 * 0.047276. 0.005247636 What is 2.5 times 7182.667? 17956.6675 769025.85 times 0.3 230707.755 -0.8 times -72584791 58067832.8 -0.021 * 90392 -1898.232 Product of -2.4925 and -8218. 20483.365 Multiply 254 and 27.9631. 7102.6274 Calculate -0.954706605. -4471274.75 Calculate 2-193696251. -387392502 318.264 times 10.98 3494.53872 0.7 times -472211 -330547.7 Calculate 0.112851078. 1285107.8 1634177 -0.5 -817088.5 Product of 540761 and 0.13. 70298.93 Multiply -5 and 0.27305917. -1.36529585 180.99-708 -128140.92 What is the product of 0.5 and 815.37407? 407.687035 Calculate 61-31.88181. -1944.79041 -0.031 * 6599925 -204597.675 Product of 2.8 and -6606.48. -18498.144 30.264835 times -5 -151.324175 Multiply -7 and 12680666. -88764662 10 times -5702.508 -57025.08 0.007 times 408888 2862.216 -4 * -47939831 191759324 Work out -126.84 * -0.9062. 114.942408 What is -1.12 times -0.27656? 0.3097472 What is -104.56622 times -5? 522.8311 What is 2.5 times -2.314231? -5.7855775 Calculate -76963862. -15392772 -56.04987 times -0.109 6.10943583 -0.04 -135331 5413.24 3.190028 times -1.9 -6.0610532 What is -0.2 times 63.5974? -12.71948 What is 20.56446 times 0.03? 0.6169338 Work out -2 * 6.153405. -12.30681 What is the product of 3.53483 and 0.5? 1.767415 19-1215196 -23088724 -93811177-3 281433531 3 times 845212.1 2535636.3 Calculate -137188729-0.1. 13718872.9 0.08 times -1798092 -143847.36 -0.4797.2841 -318.91364 0.03 times -49.6678 -1.490034 Work out 0 * 25287963. 0 -8 times 203093 -1624744 What is -0.084 times -362903? 30483.852 What is the product of 0.6 and -13.68284? -8.209704 -57.2401 times -77 4407.4877 0.1 times -10010639 -1001063.9 What is 3 times 0.088808? 0.266424 Calculate 0.151357.6. 1.15026 Work out -230078949 -0.2. 46015789.8 Multiply 55717 and 24. 1337208 Product of -141213.304 and 2. -282426.608 1 * 11662621 11662621 -0.0316 times 1161.9 -36.71604 Multiply -0.099 and 413.73. -40.95927 What is 0.2 times 333.6342? 66.72684 Work out 934 * -203309. -189890606 Multiply 2014938 and 0.16. 322390.08 -1668100.0354 -5905.074 -2702 times 7319 -19775938 What is 0.652 times 1420? 925.84 Work out -370.49976 -0.2. 74.099952 Multiply -0.3 and 3472984. -1041895.2 1 * 15476171.8 15476171.8 What is 0.3 times -27936201? -8380860.3 What is -0.5 times -21825377? 10912688.5 72 * 407011 29304792 Work out -202 * 235.94. -47659.88 What is 0.11217 times -115.04? -12.9040368 -7.31 * 5012 -36637.72 Multiply -0.3 and 50651.1. -15195.33 1705.5850.01 17.05585 Product of -39 and -414570. 16168230 Work out 0.75 -1139956. -854967 Calculate -396465822-0.3. 118939746.6 What is -6577662 times 5? -32888310 Product of -101 and 22270. -2249270 Multiply -2.80243 and 195. -546.47385 What is -0.066 times -818571? 54025.686 Product of 0.127 and -49082. -6233.414 -604.72753 0 0 Multiply -0.073009221 and 0.5. -0.0365046105 0.07 * 1539.961 107.79727 Calculate -692112-0.5. 346056 Multiply -908654472 and 0.1. -90865447.2 Work out -0.8 369864. -295891.2 Work out 4 * 21609.318. 86437.272 What is the product of 2.937 and -3338? -9803.706 Multiply 26475757 and -5. -132378785 0.1042023.831 0.399197862 What is the product of -553406 and -7.1? 3929182.6 What is -50 times -0.121503? 6.07515 0.05 times 0.0534089 0.002670445 What is 60559204 times 0.1? 6055920.4 Multiply 242 and -517.982. -125351.644 Product of -4.97 and -11256. 55942.32 Multiply -1672 and 822. -1374384 -29541245.8 -17133919.2 What is -12309082 times 0.04? -492363.28 -0.1 times 19789061 -1978906.1 -902.955 * 0.6 -541.773 Product of -14 and 12975867. -181662138 Calculate 638.75430.078. 49.8228354 1 times 5564.079 5564.079 Work out -27.04838 -303. 8195.65914 Product of -5.16244 and 0. 0 Multiply -94431 and -0.54. 50992.74 Product of -1 and 4303215. -4303215 -28838946 times 1.7 -49026208.2 Work out 18032605 * -0.4. -7213042 -11 times 9.1376 -100.5136 -2.0553 times 5034 -10346.3802 Work out -17806.598 * 0. 0 Multiply 20948.3 and 893. 18706831.9 Multiply 21.0685 and 0.035. 0.7373975 Product of -43692 and -81.8. 3574005.6 What is the product of 0.73829393 and 0.03? 0.0221488179 Work out -4.611725 * 2. -9.22345 17850381 times -6 -107102286 Product of -8558.8 and -0.43. 3680.284 Multiply 0.4 and -2229389. -891755.6 434773.81 205273.83 Calculate 209102697. 56394270 Calculate 119.62-73.4. -8780.108 Multiply 0.12 and 2430216. 291625.92 Multiply 883 and 920.3. 812624.9 Work out -90.8118 -48. 4358.9664 What is the product of 39 and -426350? -16627650 Multiply 3.5 and 1194640. 4181240 Work out 0.6 * 19316925. 11590155 -668554.39 times -0.3 200566.317 -0.6 * -780152 468091.2 Product of 5 and 23257.7354. 116288.677 Multiply 48987 and 1450. 71031150 -353486045 -176743020 Product of 12.79 and 11.63. 148.7477 476100128-3 -1428300384 Multiply -174.2 and 0.01533. -2.670486 Product of -3168 and 163. -516384 1425076 * -0.03 -42752.28 Work out -320474 * -4. 1281896 What is the product of -4 and -30.7184? 122.8736 Calculate 12933500.4. 517340 Product of -933950991 and -5. 4669754955 Calculate -0.0063312.77. -0.0808341 What is the product of -90096 and 143? -12883728 Multiply 10879.72 and 3. 32639.16 What is -985 times 11547? -11373795 0.33805901 1141770.3 0.5920886 460443 What is the product of 0.2 and 317.565? 63.513 What is 2.0408 times 781? 1593.8648 Multiply 93139 and -0.9381. -87373.6959 Multiply -25.87 and 781.4. -20214.818 Work out -0.155 * 70.612. -10.94486 6639.5 times -148 -982646 What is -357960.6 times 13? -4653487.8 -2171446 times 0.12 -260573.52 Product of 1096310 and -21. -23022510 Multiply -4 and -198499.925. 793999.7 What is 3.711537 times 0.1? 0.3711537 -6705265 times -0.13 871684.45 Product of -0.2 and -2090183. 418036.6 Product of 2 and 66441552. 132883104 Work out 56387253 * -0.1. -5638725.3 5.357-7089 -37975.773 What is 85586697 times 5? 427933485 What is -16 times 2.73938? -43.83008 635 times -659.5 -418782.5 What is the product of 3853.173 and -1? -3853.173 Calculate 11689-3115. -36411235 -15.456 * 63002 -973758.912 Calculate 1.2830292. 38773.76 8 times -3427451 -27419608 37238532 times 0 0 Calculate 505902.96. 149746.4 -609 * 1470.21 -895357.89 What is 0.6 times -8844660? -5306796 Multiply -191 and 79.96. -15272.36 Work out -4 * -11300808. 45203232 -4 times -116871410 467485640 0.82513669 2010935.2 Calculate 297355-1187. -352960385 Calculate -3-34872754. 104618262 2 times 218146960 436293920 Multiply -544196 and 29. -15781684 Product of -43812636 and 0.04. -1752505.44 -0.426 12296.2 -5238.1812 -203698 * 1.73 -352397.54 Work out 33223 * -672. -22325856 -0.033 * -306856 10126.248 -0.241 times 18.5972 -4.4819252 What is the product of -0.97512 and 11? -10.72632 -18 * 73533 -1323594 What is the product of 161.1 and 909? 146439.9 What is -12144 times -0.1687? 2048.6928 What is the product of 22338.9 and 1.7? 37976.13 What is 10999 times 6517? 71680483 Calculate -0.0771832.54. -0.19604482 663530.0604 4007.7212 -916 times 23133 -21189828 Work out 252 * 44.9288. 11322.0576 226.3-158202 -35801112.6 Work out 1968.59 -1.71. -3366.2889 -254 * -0.153672 39.032688 Calculate 297.9*90	{ "pile_set_name": "DM Mathematics" }
Round q to the nearest 1000. 76000 Let f be (-1170032)/(-6) - 50/(-75). Suppose -f = -u + 2m, 3u + 2m = 5m + 585009. What is u rounded to the nearest ten thousand? 200000 Let j = 44 - 42. Suppose 0 = -3o - 2x + 72 + 103, 2x + j = 0. Suppose t - 60 = 4f, o = 3t - 5f - 93. What is t rounded to the nearest ten? 40 Let u = -207 - -205. Let f be (u - -3)(-75493 - 7). What is f rounded to the nearest 1000? -76000 Let d(j) = -j. Let g(z) = -4174996z - 8. Let m(s) = 6d(s) + g(s). Suppose 58i + 24 = 52i. Let h be m(i). What is h rounded to the nearest 1000000? 17000000 Let i = 1109948.7 - 141497.7. Let n = -968465.00017 + i. Let c = -14 - n. Round c to 4 dps. 0.0002 Let d = 10699.351 - 5.351. Let l = 10694.10926 - d. Let o = 0.115 - l. What is o rounded to 3 decimal places? 0.006 Let f = 94 + -103. Let p(g) = -223650g*3 + 2g*2 + 18g - 9. Let j be p(f). Suppose -5m = 25, -4b - 3m = j + 25359174. Round b to the nearest one million. -47000000 Let c = 827.700013747 - 827.7. What is c rounded to 7 decimal places? 0.0000137 Let r(q) = 14q + 9. Let s(j) = 6j3 + j2. Let m be -2 - -1 - -41/2. Let c be s(m). Let h be r(c). What is h rounded to the nearest 10? 110 Let t = -9.4241 + 12.89. Round t to 1 decimal place. 3.5 Let a = 442 + -440.99. Let w = -0.9226 + a. What is w rounded to three decimal places? 0.087 Let r = -48903812323.63753683 + 48903812016. Let b = 0.36600317 - r. Let t = b - 308. Round t to four dps. 0.0035 Let a = 113726336.000246 + -113726221. Let d = -248 - -133. Let h = a + d. What is h rounded to 5 decimal places? 0.00025 Let k = -0.10859094 - -0.10867. Round k to 5 decimal places. 0.00008 Let x = -248 + 592. Let p = x + -342.952. What is p rounded to two dps? 1.05 Let d be (-4)/1(52/(-8) - -6). Suppose -dn = -5m + 3n - 675, -540 = 4m + 2n. What is m rounded to the nearest 10? -140 Let s = 3480.0000461 + -3480. What is s rounded to 4 dps? 0 Suppose -1687 - 24 = j + 3b, 4j = -3b - 6817. Let k = j - 2371. Round k to the nearest one hundred. -4100 Let z be (0 - 6)/(7 + (-153)/18). Let f be z - (102/8 + 8/32). Let p be -6(-3000000)/f1. Round p to the nearest 1000000. -2000000 Let k(z) = -10108z*2 + 10z - 8. Suppose -c - 3 = 5. Let d be k(c). What is d rounded to the nearest 10000? -650000 Let m = -97292857 + 97292898.9999976. Let p = 181 + -139. Let s = m - p. Round s to 6 decimal places. -0.000002 Let h = -9.711 + 6.59. Round h to zero decimal places. -3 Let f = -76031 - -76049.9788. Let o = 26.038 + f. Let p = 45 - o. Round p to 3 decimal places. -0.017 Let h = 0.546 + -0.5237. Let g = h - 0.01395. What is g rounded to 4 decimal places? 0.0084 Let u = -7893641108.0000621 - -7893640558. Let o = u + 550. Round o to five decimal places. -0.00006 Suppose 5x = 6i - 2i + 7, -13 = -5i - x. Let c be (-20714972)/(-44) - (i - (-24)/(-11)). Suppose -2t = c + 155205. Round t to the nearest 10000. -310000 Let v be (-8(-5)/200)/((-1)/(-109616495)). Let o = 42223299 - v. Round o to the nearest 1000000. 20000000 Let y = 16658 + -36678. What is y rounded to the nearest one thousand? -20000 Let o(h) = -h*3 + 19h*2 - 32h + 5. Let j be o(17). Suppose 9s + j + 51 = 0. Let w be (5/s - -1) + (-40001)/2. Round w to the nearest 10000. -20000 Let d = -11.33107 + 10.949. What is d rounded to one decimal place? -0.4 Let h = 2168.8775 + -2169. Round h to two decimal places. -0.12 Let t = -7.646 + 7.40364. Let a = -0.243 - t. Round a to 4 decimal places. -0.0006 Let s(x) = -54x - 8. Let o be (-27)/(-12) - (20/(-16))/(-5). Let l be s(o). What is l rounded to the nearest 10? -120 Let x = 7300 - 7091.05. Let b = x - 209. Round b to 1 dp. -0.1 Let a = -8970 + 4502. Let w = 4734.9 + a. Let h = w - 254. Round h to the nearest integer. 13 Let j = 689.823 + -734.01. Let b = j + 0.387. What is b rounded to 0 dps? -44 Let i = 96 - 160. Let n = -2472.338737 + 2536.33873647. Let o = n + i. Round o to seven dps. -0.0000005 Let u = -0.4528 + -74.0072. Round u to the nearest ten. -70 Let p = 26070 + -26069.90017. Round p to 3 decimal places. 0.1 Let g = 64.413 - -21.728. Let t = g + -94.13462. Let j = 8 + t. Round j to three decimal places. 0.006 Let z = -281.0281 - -0.0281. Let l = 280.68440068236 - -0.31559588764. Let s = z + l. Round s to seven dps. -0.0000034 Let m = -358 + 184. Let v = 174.00000113 + m. Round v to 7 decimal places. 0.0000011 Let l be 32/112 + (91963180/(-28) - 1). What is l rounded to the nearest ten thousand? -3280000 Let k = -495.98336871 - -0.03196871. Let c = k + 496. Round c to 1 decimal place. 0 Let o be ((-148)/(-18))/2 - 47/423. Let t be 252/(-3)(892/8 - o). Round t to the nearest 1000. -9000 Let m = -8145006.5332 + 8147472. Let q = 2466 - m. What is q rounded to two dps? 0.53 Let h = -10007 + 10007.0000007049. What is h rounded to 7 dps? 0.0000007 Let y = -24571 + 26284.954. Let w = y - 1717.9540208. Let r = -4 - w. Round r to 6 decimal places. 0.000021 Let b = 347144264 + 798675736. What is b rounded to the nearest one million? 1146000000 Let g = 653 + -464. Let q = -1.9 - -88.3. Let c = q - g. Round c to the nearest ten. -100 Let t = 933.9 + -0.9. Let x = t + -933.01262. What is x rounded to 3 decimal places? -0.013 Let v = -0.5289 + 0.58. Let m = 0.1393 + -0.0404. Let u = v - m. Round u to three decimal places. -0.048 Let x be (0 + -1)/(4/(-16)). Suppose -2l = -351020 - 236980. Suppose -3i = -2g - 3g - 441000, 2i - l = xg. What is i rounded to the nearest 10000? 150000 Let f = 36285462.99999776 + -36285534. Let r = 86 + -157. Let v = r - f. Round v to 7 decimal places. 0.0000022 Let z = -5369313176.9809776 - -5369285192. Let c = 27985 + z. Let n = 0.019 - c. What is n rounded to six decimal places? -0.000022 Let d = -2590.083933 - -2590.1. What is d rounded to four dps? 0.0161 Let n = 1.3480611 - -5722856.6519389. Let t = n + -5722885.80231. Let u = t + 27.8. Round u to four decimal places. -0.0023 Let w = -94338516.55 - -94337512.5502594. Let r = -1004 - w. Round r to 5 dps. -0.00026 Let o = 9191484.2500069 + -9191485. Let m = -0.75 - o. What is m rounded to 6 dps? -0.000007 Let k = -5695.93494 + 6000.934951. Let s = -305 + k. Round s to six decimal places. 0.000011 Let l(m) = m2 - m + 1. Let v be l(2). Let j be (7/14)/(1/8). Suppose -4p - 263985 = vu, -p - jp - 4u - 329980 = 0. Round p to the nearest ten thousand. -70000 Let x(t) = -9 + 12 + 19 + 410t - 73t. Let c(r) = 5r*3 - 3r + 2. Let f be c(1). Let g be x(f). Round g to the nearest 100. 1400 Suppose 26k + 9 = 25k. Let g(j) = -1. Let d(l) = 57777l - 3. Let p(x) = d(x) + 4g(x). Let n be p(k). What is n rounded to the nearest 100000? -500000 Let q = -2145.46 + 2151. Round q to the nearest integer. 6 Let z = 12895905 + -12896685.9601. Let l = z - -781. What is l rounded to two dps? 0.04 Let y = -243 - -41. Let i = y + 201.9999904. Round i to five dps. -0.00001 Let k = 559841 - 559413.819. Let v = k - 399.75. Let g = 0.069 + v. What is g rounded to the nearest integer? 28 Let a = -4383.953 + 4390. What is a rounded to one decimal place? 6 Let o = -23499.7 + 23454.70032. Let r = -28 - -73. Let j = o + r. Round j to four dps. 0.0003 Let q = -805696683 + 805696898.9999396. Let w = q - 216. What is w rounded to six dps? -0.00006 Let i = 107751.098 + -109230.9. Let b = -1481 - i. What is b rounded to 1 decimal place? -1.2 Let x = 25280 - 26151.7. What is x rounded to the nearest one thousand? -1000 Suppose 13f - 17f + 16 = 0, -5q + 1061004 = f. Let p be (10q)/(24/40). Round p to the nearest 1000000. 11000000 Let y = 40 - 40.02. Let w = y - -71.02. Let i = w + -71.0003. What is i rounded to 3 dps? 0 Let r = -23.292 + 11.283. What is r rounded to zero decimal places? -12 Let l = -0.0803 - 74.9197. Let j = -74.6054902 + -0.3940698. Let s = l - j. Round s to four dps. -0.0004 Let o(l) = -8841l*3 - 740l*2 + 6l - 19. Let u be o(7). Round u to the nearest 10000. -3070000 Let n(j) = 7388887j2 + 20j - 27. Let z be n(9). Suppose -232m - z = -227m. What is m rounded to the nearest one million? -120000000 Let g(f) = 809706*f - 578. Let p be g(13). What is p rounded to the nearest 1000000? 11000000 Let n = 257.113329 - 257.15. What is n rounded to two decimal places? -0.04 Let s = 1.5 - 2.02. Let v = -1452044.96 - -1452044.4	{ "pile_set_name": "DM Mathematics" }
Is 157 at most as big as 965? True Are -1/3 and -619/163 equal? False Which is smaller: -74/5633 or 0? -74/5633 Which is smaller: -2153 or 58? -2153 Are -995301 and 2/3 equal? False Is -4040300 at most -4040302? False Is -29240 <= -29240? True Which is greater: -1/1346021 or 1? 1 Which is bigger: -1626 or 1/27? 1/27 Which is smaller: 66697 or 66705? 66697 Which is smaller: 1 or 66/1501? 66/1501 Is -8805 at least as big as -8794? False Is -3339 >= -3339? True Is 1561 != -612? True Which is smaller: -1 or 15668? -1 Is -8/7631 at most 1? True Which is smaller: 19037 or 5? 5 Which is bigger: 99613 or 39? 99613 Which is smaller: 1 or 1/1754571? 1/1754571 Are -72/97327 and -1 nonequal? True Is -85/3086 greater than 1? False Which is smaller: 0 or 2/3235543? 0 Which is smaller: 1 or 255/25054? 255/25054 Which is bigger: -1215 or -356? -356 Is -2722397 > 0.1? False Which is greater: 7771 or 7773? 7773 Is 4691 greater than or equal to 258044/55? False Which is bigger: -617291/7 or -88183? -88183 Is -9761794 less than or equal to -9761794? True Are -114174 and -114175 non-equal? True Which is smaller: -2/59 or 2/303? -2/59 Do 3364 and 2/403 have different values? True Is 5 less than 238908? True Is -558/25 at most as big as 129? True Is -11/4 >= 7.4495? False Are 121 and 1459/12 equal? False Which is greater: 11568 or 11567? 11568 Which is smaller: 3 or 1675/1052? 1675/1052 Is 0 at least as big as 2/119455? False Which is bigger: -6201139 or -6201140? -6201139 Is 18206 > 18207? False Which is bigger: -34272.3 or 4? 4 Which is smaller: -76162 or -76159? -76162 Is -839 smaller than 1.1? True Does -54164 = -54165? False Which is smaller: -2459 or -63913/26? -2459 Is 6/954263 smaller than 1? True Does -109/1594 = 1? False Do -269 and -20 have the same value? False Are -26836/109 and -246 non-equal? True Which is bigger: 2306 or 2313? 2313 Which is bigger: 132498 or 0.1? 132498 Which is smaller: 1 or -3/127813? -3/127813 Is 211 < 3994/19? False Which is smaller: -0.1 or 176586? -0.1 Which is bigger: -158088 or -158095? -158088 Are -0.04 and 130/3 unequal? True Which is smaller: 1/76809 or 0? 0 Which is greater: 0 or -12/25423? 0 Is 21293 <= 21295? True Is -4216 less than -71687/17? False Which is greater: -565178 or -5? -5 Is -198 at least as big as -1604? True Which is smaller: 191873 or 767489/4? 767489/4 Which is smaller: 2286 or 2183? 2183 Which is bigger: -947 or -908? -908 Is -18 bigger than -3129.6? True Is -47887 less than or equal to -47885? True Is 13/4 > -82784? True Which is greater: -159598 or -159595? -159595 Which is greater: 210564 or -4? 210564 Which is smaller: 81/2 or -0.0602? -0.0602 Is 113 at least as big as 9.94? True Which is greater: -2174555 or -2174554? -2174554 Which is smaller: -75549 or -75552? -75552 Which is smaller: 1.385 or 118? 1.385 Which is greater: 18084 or 18087? 18087 Which is smaller: 1954/87 or 21? 21 Is -1/143684 less than 1? True Which is bigger: 8 or 2898/335? 2898/335 Is 13282/3 < 4427? False Which is smaller: -1240 or -284? -1240 Which is smaller: 12935 or 64671/5? 64671/5 Which is smaller: 21402 or 21404? 21402 Is -8196 greater than -8196? False Which is smaller: 1/3416009 or 1? 1/3416009 Are 2454648 and 2454652 nonequal? True Is 1419.4 greater than 5? True Which is smaller: 273 or 671/4? 671/4 Which is bigger: -21060 or -21057? -21057 Which is smaller: -6/47 or -14/3? -14/3 Is 28553 at least as big as 28553? True Which is smaller: -3977/8 or -498? -498 Which is smaller: 1 or -7/42439? -7/42439 Which is smaller: -994 or -446? -994 Are -5583/328 and -18 nonequal? True Is -20 at most as big as -27039? False Is 6412 != 6491? True Which is greater: 586 or -53? 586 Which is bigger: -2036/7 or -290? -290 Which is greater: 10 or 24486/2383? 24486/2383 Which is smaller: 5587 or 117338/21? 5587 Which is bigger: 7/6 or 10/4509? 7/6 Is -22 greater than 90/7? False Which is bigger: 17.1529 or 1/2? 17.1529 Do -259/163 and 2 have the same value? False Is -75377 < -75375? True Which is greater: 1812942/5 or 362589? 362589 Is -31 at most 142? True Which is smaller: -1 or 13/2954? -1 Do -389675 and -2/7 have different values? True Which is smaller: -1636 or -34/7? -1636 Which is smaller: -4133 or -4147? -4147 Is -94204 < -94204? False Which is bigger: 0.03 or 71360/11? 71360/11 Is 206917 > 206917? False Are 21100 and 63302/3 equal? False Is 4693 < 84467/18? False Is 32439 greater than 32438? True Which is greater: 2 or 161/187? 2 Is 4.497 at least as big as -39? True Which is bigger: 0 or 4608/3617? 4608/3617 Is 48577 > 48577? False Does 18/7 = -4/1777? False Is 1 >= -23931? True Which is greater: -670432/13 or -51573? -670432/13 Is 1017 bigger than 31531/31? False Which is bigger: -1/4 or -74181? -1/4 Is -17/41966 not equal to 0? True Is -16.24 greater than or equal to -103? True Is -807/7741 not equal to -1? True Is -1/935288 > 0? False Which is smaller: 76/11 or -0.134? -0.134 Is -1763 at least as big as -1772? True Which is greater: 2106015 or 2106016? 2106016 Which is greater: 331 or 786? 786 Is -77081 less than -77077? True Which is bigger: 39243/25 or 1569? 39243/25 Are 0.1 and 7/20159 equal? False Is 10164 at least as big as 10172? False Do -1 and -2/2687 have the same value? False Which is greater: -1162/4461 or 0? 0 Is -1.9 greater than or equal to 1948/9? False Which is greater: -727 or -52996/73? -52996/73 Is 822/391 >= 1? True Is -22525 less than -22491? True Which is smaller: -14900/237 or -63? -63 Which is smaller: 57/12463 or -1? -1 Which is greater: -3834 or -2? -2 Which is smaller: 9543 or 9530? 9530 Which is bigger: -1902 or -1913? -1902 Is -521 at least as big as -2725? True Which is greater: 3/4030 or 1? 1 Is 6865 at least as big as 6865? True Which is smaller: 14584 or 0.1? 0.1 Is -5729 less than or equal to 18? True Which is smaller: -6962 or -7252? -7252 Is 3 smaller than 2714.43? True Which is bigger: 77 or 477? 477 Which is bigger: 87938 or 87939? 87939 Is -73 greater than -369? True Is -6173 greater than -6194? True Which is greater: 27/65 or -21? 27/65 Are -1 and 513150 equal? False Which is smaller: 5098 or 11? 11 Is -0.2 bigger than -36.7325? True Is 0 > 204/11? False Is 1206 < 1177? False Is -38 equal to -1825/47? False Is 202848 greater than 202850? False Does 120324/43 = -2? False Which is greater: -4.03 or -79? -4.03 Are 1 and -58/3047 nonequal? True Are -272110 and -272110 non-equal? False Is 0 at least as big as 443/991? False Are 28150/117 and 240 equal? False Which is greater: 88245 or 88242? 88245 Which is bigger: 3323433 or 3323432? 3323433 Is -16 at least as big as -122898? True Is 1/3 < -321814? False Which is bigger: 5/2 or -1418? 5/2 Which is greater: -0.1 or 80234? 80234 Which is bigger: -2566510 or -2566512? -2566510 Which is smaller: 191051/4 or 47764? 191051/4 Are 0 and 36/43205 equal? False Which is smaller: 410 or -1504? -1504 Is -111003 != -222007/2? True Is -466191 >= 2? False Is 0 less than or equal to 0.0358464? True Does 5401199 = 5401198? False Is -916/39 bigger than -23? False Which is bigger: -1 or -312/5185? -312/5185 Are 0 and 25/27787 non-equal? True Which is bigger: -58041/70 or -830? -58041/70 Is 372019 equal to -3? False Are -7 and 7/10060 unequal? True Which is bigger: 1966/1137 or 1? 1966/1137 Is 328695 < 328695? False Do 11093/3 and 3697 have different values? True Is 49/524 <= 1? True Is 3975 greater than 31809/8? False Which is smaller: 2/7810899 or 1? 2/7810899 Is 120 equal to 13704/113? False Which is greater: 67147/6 or 11190? 67147/6 Is 1 equal to -2/17725191? False Which is bigger: 0 or -128/4333? 0 Do -1 and 21/827422 have the same value? False Which is greater: -7912 or -102874/13? -7912 Is 88 greater than 4041/5? False Which is smaller: 0 or -287/1605? -287/1605 Which is bigger: -4466188 or -4466189? -4466188 Which is greater: -2.26465 or -0.1? -0.1 Is -25030 > 52? False Is -6253 less than -6256? False Is 1 greater than -3/190241? True Is -827694/17 less than or equal to -48689? False Is -6541 <= -379449/58? False Is 58325 smaller than 58324? False Is 494 at most -1/2284? False Which is bigger: 0 or -49/9739? 0 Which is smaller: 263/13 or -4? -4 Which is smaller: 0 or 8/35? 0 Which is bigger: 549/62 or 9? 9 Which is smaller: 446321 or 0? 0 Which is	{ "pile_set_name": "DM Mathematics" }
- 2. Let m be t(5). Let f = m - 74. Solve -fr + 17 = 5 for r. 3 Suppose -3h - h + 20 = 0. Let p be (h/(-15))/(2/(-108)). Let s = p + -14. Solve -2i - s = 2 for i. -3 Let a be (-8)/36 - (-685)/45. Solve -4d + 3 - a = 0 for d. -3 Let o(k) = 6k + 3. Let d be o(3). Let f = d + -19. Solve 4 = -2s - f for s. -3 Let s = 245 + -243. Solve 0 = -sh + 6h - 12 for h. 3 Suppose 229 - 271 = -14h. Solve 12 = -3f + h for f. -3 Let h(w) = -2w - 8w + 9w - 2w*3 - 7 + 4w*2 - 24w*2. Let g be h(-10). Solve -4 + g = -n for n. 1 Let f be -6 + (3 + -11)/(-4). Let l = 3 - f. Suppose -p = -u + 1 + l, 2p = -8. Solve 2i + 2i = -u for i. -1 Let k(j) = 2j2 + 3j + 3. Let l(w) = 2w2 + 4w + 4. Let o(n) = 4k(n) - 3l(n). Let v be o(2). Let s be v/(-24)(-8 + -1). Solve -sy + 4 = 10 for y. -2 Suppose -3z = -7z. Suppose -k + 7 + 0 = z. Let l = k - 7. Solve l = -2b + b + 2 for b. 2 Let w(z) = -z3 + 18z*2 - 34z + 37. Let o be w(16). Solve -ov + 0v + 5 = 0 for v. 1 Suppose -169t + 152t = -34. Let s = 8 - 6. Suppose 2j - 18 = 4i, -j - j + s = 4i. Solve -tm = -jm + 15 for m. 5 Suppose 4w + 145l - 143l - 80 = 0, 26 = w + 2l. Solve -28 + w = 5x for x. -2 Suppose 2v + 3k = 11, 4k + 8 = -4. Solve 0 = -va + 14a for a. 0 Let i(f) = f3 - 5f2 + f + 8. Let m be i(5). Let l(t) = t3 + 4t2 - 5t + 5. Let x be l(-5). Suppose 0 = -4c + 6 + 6. Solve c = xs + m for s. -2 Let r be (-1)/(-5) + 833/85. Solve -r = 3z + 2z for z. -2 Let t(n) = n*2 - 1. Let p(i) = -3i*2 + 11i + 16. Let q(u) = p(u) + 2t(u). Let f be q(12). Solve 0k = fk - 10 for k. 5 Suppose 2f = -5n + 3f + 72, -36 = -2n + 4f. Let v be (-3 - (-2 + -3)) + 2. Suppose vg - n = 2. Solve -g = 3l + 2 for l. -2 Let f = 69 + -67. Let b be (8/10)/(7/(-35)). Let d = 8 + b. Solve 0 = -da + fa - 10 for a. -5 Let u be -124 + (-224)/486/(-7). Let w be (-1 + 3/(-15))/(18/u). Solve q = -q + w for q. 4 Let o(u) = 6u - 59. Let z be o(13). Solve -v - z = -15 for v. -4 Let r be ((-32)/208 - 0) + (-7945)/(-13). Solve 3o - r + 608 = 0 for o. 1 Let l = -3 - 3. Let x(g) = -g2 - 6g - 2. Let q be x(l). Let r be 1/((q - 1)/(-3)). Solve 0 = w - 0 - r for w. 1 Let j = -3 + 8. Let p be (2 + (-15)/3)-1. Suppose 7 = jb - p. Solve -bh = -5h - 3 for h. -1 Suppose 0 = -3g - h + 9, 5h - 18 = -3g + 3. Let a be 2g/((-6)/(-3)). Solve -5 = an - n for n. -5 Let q = 199 + -197. Solve qu - 4u - 6 = 0 for u. -3 Let x be ((-48)/(-1 - -3))/(-1). Let y be (-1)/(0 + (-4)/x). Suppose -t = -yt. Solve t + 2 = d for d. 2 Let f(s) = 2s2 - 15s + 17. Let i(a) = a*2 - 8a + 9. Let m(d) = 3f(d) - 5i(d). Let b be m(4). Suppose 1 = -t + b. Solve -3 = -p + t for p. 4 Let f = 113 + -98. Solve 5g = 8g + f for g. -5 Let o be -6((-2)/4)/(12/16). Solve o = 6g - 14 for g. 3 Suppose 100u + 170 = 5d + 95u, -176 = -5d - u. Solve d = 14s - 21s for s. -5 Let w(t) = -7t3 + 13t*2 + 4t + 11. Let i(m) = -m3 + m2 + m. Let g(p) = 6i(p) - w(p). Let a be g(7). Solve 0h = -3h + a for h. 1 Let q = 1 - -1. Let h = 3 - -1. Suppose 3a - 8 = h. Solve -z + qz = -a for z. -4 Let o be (-4)/8 - 1/(-2). Solve -r - 3r + 4 = o for r. 1 Let z = 36 - 77. Let i = z - -48. Solve -io = -2o - 25 for o. 5 Let j = -66 + 67. Let g(t) = -t*3 - 2t*2 + 2t + 1. Let x be g(j). Solve l + 3l + 12 = x for l. -3 Let y = 0 + 5. Let d(z) = -z + 7. Let a be d(y). Solve -ah - 6 = h for h. -2 Suppose -k + 20 = h - 3k, -k = 2h - 40. Let i = h + -17. Solve o = -io - 20 for o. -5 Let o(y) = y2 + 15y + 38. Let u be o(-8). Let v be 2/6 + (-174)/u. Solve 6 + v = 4q for q. 4 Let i be 10(114/15 - 7) - -7. Solve 10c = ic - 9 for c. 3 Suppose -6s - 20s + 52 = 0. Solve st + 0 = 4 for t. 2 Let w(x) = x3 - 5x*2 + 6x + 2. Let f be w(4). Suppose -2r = 2 - f. Let v be 2/6 + 22/6. Solve -vk + 0 = r for k. -1 Suppose -91d + 11 = -87d - 5i, d = 4i. Let f = -1 - -4. Solve -dm - 1 - f = 0 for m. -1 Let g be 2 - -3 - -22/(-4). Solve -15 = b - gb for b. 5 Let p = -1743 + 1760. Solve -17o + p = -0o for o. 1 Suppose g - 3k + 8 + 6 = 0, 2k = 8. Let s be (g/3)/((-1)/15). Let t be (-135)/60(-16)/18. Solve -2l = -s + t for l. 4 Suppose 2p + 0 - 7 = r, 0 = r + 1. Let k(v) = 14v - 14. Let h(w) = 16w - 15. Let u(s) = -6h(s) + 7k(s). Let z be u(8). Solve -px - x = -z for x. 2 Let i(g) = -g3 + 3g*2 + 10g + 12. Let y be i(0). Solve -11x + y = x for x. 1 Suppose -t = 2t + 3x - 792, 2t - 5x = 556. Solve 0 = tu - 266u - 8 for u. 4 Let z(q) = 2q*3 + 2q*2 - 6q + 4. Let a be z(3). Let h = a - 51. Solve 0 = -g - 2 + h for g. 5 Suppose 0 = 6t - 27 - 9. Suppose -4k = q - 12, -2q - t = q - 2k. Solve -2i + 7 + 3 = q for i. 5 Suppose g - 144 = 5i + 86, 3i + 155 = 4g. Let w be (-9)/(i/(-10)) + 6. Solve wd + 1 = 9 for d. 2 Let h(g) = g - 4. Let p be h(3). Let t be p/(-5) - 76/(-20). Let x(r) = r3 - r2 - r - 2. Let v be x(2). Solve -to - 16 = -v for o. -4 Let w(t) = -t*3 + 3t*2 - 2t. Let f be w(2). Suppose -4 = -fk - k. Suppose -kr + 0r - 12 = 0, -2j - 5r - 11 = 0. Solve -jn + 10 = -0 for n. 5 Let z = -615 - -625. Solve -l = l - z for l. 5 Let c be ((-4)/2)/(4/8) + 12. Let k(b) = b*3 - 9b*2 + 9b - 6. Let q be k(c). Solve -qt + 6 = -0 for t. 3 Let j = -14 - -15. Let z(g) = g3 + 12g*2 - 13g. Let t = 1 - 14. Let a be z(t). Solve -i + 3 - j = a for i. 2 Suppose 2m - 3m = 3. Let h = m - -9. Solve -z + h = 1 for z. 5 Suppose -g + 0 = -2. Let x be (1 - 2)(3 - (9 + -4)). Let d be 13 - (x + -1 + g). Solve 0j - d = 5j for j. -2 Let p(z) = -1. Let d(m) = m2 + 4m. Let b(y) = d(y) - 3p(y). Let u be b(-3). Solve uv + 10 = 2v for v. 5 Suppose 2c + 4 = -2b + 14, -5c - 4b = -30. Let w(m) = 4m*2 + 5m*2 - cm*2 + 1. Let a be w(-1). Solve 4p - p + 15 = a for p. -5 Suppose -2r = 2c - 28, -183c + 182c - 3r = -14. Solve 0 = 21a - ca for a. 0 Let t = 2066 - 2062. Let w be (-6)/(-4)20/6. Solve -t = -wy - 14 for y. -2 Let l = 52 - 47. Suppose -21 = -3w - 3o, lw + 2o + 0 = 20. Solve -ws = -s + 3 for s. -3 Let v = 6 - -2. Suppose 2 + 7 = 3d. Suppose -5t + d = -b, 3b = 5t - 2t - 9. Solve -4l + t = v for l. -2 Let b(v) = 3v + 3. Let u be b(8). Let r = u + -23. Solve -15 = -7g + rg for g. 5 Let t = -1447 - -1467. Solve -5c - t + 35 = 0 for c. 3 Suppose 0 = -2a + 3d - 11, -5d = 2a - 0a - 29. Let g be (-3)/(12/(-16)) - (-3 + a). Solve -gj + 2j = 9 for j. -3 Suppose 88 - 81 = v. Solve -3i + 10 - v = 0 for i. 1 Suppose 31 - 61 = -10f. Solve fi - 1 + 4 = 0 for i. -1 Suppose -21n + 60n = 507. Solve 4h = nh - 9 for h. 1 Let s be 7 + (-2)/((-3)/(-3)). Let x = s + -3. Let u = 145 - 133. Solve 0 = -xd - 2 + u for d. 5 Let q be (-8)/4(-138)/(-12). Let v = -20 - q. Solve vl - l = 0 for l. 0 Let i be (-4)/(-8)((168 - -5) + -7). Solve 1 = -82z + iz for z. 1 Let b = -107 - -115. Let j be 2(0 + b/4). Solve 3c - j = -c for c. 1 Suppose 5a + 43 = 3. Let s be (17/4)/((-2)/a). Let c = s - 11. Solve 4z = -26 + c for z. -5 Suppose -5n - 2l - 58 = 0, 2n = 4l - 4 - 24. Suppose -23m - 25 = -18m. Let f be (-1)/m - n/15. Solve 3s = f + 2 for s. 1 Let j(d) = 6d - 11. Let q be j(4). Suppose qy - 32 = 241. Solve 5h + 6 = y for h. 3 Suppose 3w = 20 - 5. Let h be 32/(-40) - (-129)/w. Solve -2a = 3a - h for a. 5 Let b = -52 + 84. Let v be 6(-4)/b-4. Solve -3 = -3g + v for g. 2 Suppose 2a - 26 = -c, -3a = 6c - 2c - 49. Solve 0 = -4v - a + 15 for v. 1 Suppose -5r + 10 = 0, -17p + 13p = 2r - 52. Solve 16 = -4k + p for k. -1 Suppose 2d = -m + 80, 34m - 39m + 154 = 4d. Solve -9z - d = -50 for z. 1 Suppose h - u + 1 = -2u, 4u + 24 = h. Suppose -2r - 71 = -5w, 5w + 3r = 63 - 7. Suppose -z = s - 9, s = -hz + 2z + w. Solve -3k = -zk for k. 0 Let i(w) = w2 - 8w - 7. Let s be i(9). Suppose -19 = sg - 4g + 5y, 0 = -5g - 2y + 4. Suppose -9d + 23 + 58 = 0. Solve gx - d = -x for x. 3 Suppose g + 4g = 15. Suppose 5 - 1 = gv + 4w, 0 = 2v - 2w - 12. Let c(k) = k*3 - 2k*2 + 2. Let u be c(2). Solve -14 = -vd - u for d. 3 Suppose 8 = -7h - 104. Suppose -3j = -j + 30. Let u = j - h. Solve 0 = -3m + 10 - u for m. 3 Suppose -7 + 17 = 2d. Suppose -3a + 4s + 20 = -0a, -da + 15 = -3s. Solve ak = -k + 3 for k. 3 Suppo	{ "pile_set_name": "DM Mathematics" }
311. What is the highest common divisor of l and m? 1 Let v(w) be the first derivative of -w*3/3 + 33w*2/2 - 63w - 191. Let i be v(26). Calculate the highest common divisor of i and 21. 7 Let v(m) = 54m - 1730. Let w be v(33). What is the greatest common factor of 6 and w? 2 Suppose -3b = 22 - 127. Suppose -k + 159 = -5w, 4k - 2w - 3w - 651 = 0. Let v = 178 - k. Calculate the highest common factor of b and v. 7 Let r(i) = 9i - 181. Let d be r(23). Suppose -3k + 2u = -20, -6k + 2u + d = -2k. Suppose -7 = -w + 5. What is the greatest common divisor of k and w? 6 Suppose -5c = -k - 5, -c = 4c + 5k + 25. Let m be 48(c - 15/(-20)). Let r be ((-12)/(-7))/(m/378). Calculate the highest common divisor of r and 63. 9 Suppose 0 = 5x - 2o - 808, 5o - 15 - 314 = -2x. What is the highest common factor of x and 846? 18 Let k(h) = 2h2 - 11h - 100. Let j be k(14). What is the greatest common factor of j and 8487? 69 Let n = 139154 + -139148. Let c(g) = 19g2 + 3. Let a be c(-3). Calculate the greatest common divisor of a and n. 6 Suppose 10r = 19r - 36. Suppose 423 = 4l - 4k + 55, -l + 95 = -rk. Calculate the highest common divisor of 7 and l. 7 Let t be (-3)/(-6)8-1. Let z be (-882)/10(4 - (t + 13)). Calculate the highest common divisor of 126 and z. 63 Suppose -104 - 112 = -9j. Suppose 23k - 6 = jk. Let g(u) = -2u2 - 12u + 12. Let c be g(k). What is the greatest common divisor of c and 24? 12 Let m(w) = 4w2 + 4w - 16. Let u(b) = b*3 + 11b*2 - 9b + 39. Let p be u(-12). Let t be m(p). What is the highest common divisor of t and 144? 16 Suppose -2i = -2y - 184, -5i + 8y + 460 = 7y. Suppose -iq + 112q - 7440 = 0. What is the greatest common factor of q and 24? 12 Let x be (-1 + (-1 - 232))27/(-54). Calculate the greatest common factor of 4329 and x. 117 Suppose d + 5j - 88 = 0, -5d + 644 = 2j + 135. Calculate the highest common factor of 103 and d. 103 Let m be 12 - 68/12-147. Calculate the greatest common divisor of 2405 and m. 65 Let j = -255 - -687. Suppose -619c + 534c + 1374 = -666. Calculate the highest common divisor of c and j. 24 Let x(d) = d*2 - 2d - 33. Let v be x(-6). Suppose -4i = 5r - 1253, -10r - 1271 = -vr + 2i. What is the highest common factor of 11 and r? 11 Let w = -923 + 508. Let o = w + 705. What is the greatest common factor of o and 20? 10 Suppose -51 = p - u, 0 = 3p + 4u - 2u + 143. Let s be (-9)/(-21) - 7/(p/242). What is the greatest common factor of 7 and s? 7 Let w be (115/20 + -5)/(4/4944). Calculate the highest common divisor of w and 18. 9 Suppose 5j = 9 + 11. Suppose -4q + 3z - 4z = j, -3q = 4z + 16. Suppose -4p + y + 8 = -p, q = 4y - 4. What is the greatest common divisor of 1 and p? 1 Let y = 118977 - 118964. Let l(j) = j*2 - 4j + 5. Let f be l(4). Suppose -4i = -fi + 169. Calculate the greatest common factor of y and i. 13 Suppose 0 = 2v - 5v + 42. Let q = -111 + 208. Let y = 125 - q. What is the greatest common divisor of v and y? 14 Suppose -1112532 = 411w - 5038404. What is the highest common factor of 72 and w? 24 Suppose 7p - 198 = 8p - m, 0 = -2p + 3m - 393. Let n = p + 205. Calculate the greatest common factor of n and 26. 2 Suppose 19m + 17m = 216. Suppose 2q - 3o - 101 = 0, -mq + 5q = -4o - 48. What is the highest common factor of 65 and q? 13 Let m = 1033 + 397. Suppose 8a + m = 10a. Calculate the highest common divisor of 55 and a. 55 Suppose -555u = -518u - 148. Let h = 116 + 368. What is the greatest common factor of u and h? 4 Suppose 20z = -17116 - 4284. Let m = -494 - z. Calculate the greatest common divisor of m and 9. 9 Let t = -336 + 348. Let j be (20/6)/((-8)/(-72)). Let u = j + -6. What is the greatest common factor of u and t? 12 Let w be -2 + 5 + 0 - (-4 - -169). Let h = w + 207. Calculate the highest common factor of h and 495. 45 Let f = -310 + 312. Suppose 3149 = fp - 5c, -542 = -5p - 4c + 7248. Calculate the highest common divisor of 22 and p. 22 Let h = -10318 - -15066. Suppose -3796 = 4m + 3n, -5m + n - h = 4n. Let l be m/(-63) - 2/18. What is the highest common factor of 3 and l? 3 Let k be -10(-6 + 10)(708/(-30) + 5). What is the greatest common factor of k and 3069? 93 Let o(r) = -24r + 4r - 18r*2 - 17r*2 + 44 + 33r*2. Let g be o(-10). What is the greatest common divisor of g and 11? 11 Let r be (394 - 0) + 1/((-7 - 1)/32). Calculate the highest common divisor of 75 and r. 15 Suppose -12g + 12 = -8g, 2g - 1796 = -2k. Let h = 915 - k. What is the greatest common factor of h and 1220? 20 Let w = 1280 - 371. Suppose -2s - 936 = -q - 3q, 2s + w = -5q. Let o be ((-6)/(-4))/((-33)/s). What is the greatest common factor of 63 and o? 21 Suppose -3q = j + 28, -j = -2j + 4q. Let g = -3 - j. Suppose -21p + 33p - 1248 = 0. What is the greatest common factor of g and p? 13 Let q be (49/14 + -4)12 - -42. Suppose 0 = -0y - qy + 144. Let f = 39 + -23. Calculate the highest common factor of y and f. 4 Let b be (-212)/(-53) - (468/(-3) + 0). Suppose 0k = -2q - k + 20, -q + 10 = -3k. What is the highest common factor of b and q? 10 Let z be (-1905)/(-45) - (-4)/(-3). Suppose -37v = -zv + 100. What is the greatest common factor of 30 and v? 5 Let t be (-6)/(-9) - (3 - (3 - 34))/(-3). Calculate the greatest common divisor of t and 31764. 12 Let o be (2 - 1)/(9/(-2133)). Let s = -97 - o. Calculate the highest common factor of 7 and s. 7 Let i = 107 + 71. Let z = 181 - i. Suppose -4h + 6r - r + 73 = 0, 0 = 4h + r - 43. Calculate the highest common divisor of h and z. 3 Let r(m) = -411m - 123. Let q be r(-1). What is the greatest common divisor of q and 234? 18 Let y(h) = h + 6. Let t be y(-4). Let s be (4053/(-49) - 4/14) + t. Let p be (-2 - -4)/((-9)/s). Calculate the greatest common factor of p and 45. 9 Suppose 3l - 95 + 29 = 0. Suppose 17j + 2106 = 23j. Suppose x - 178 = -2z, -z = -15x + 13x + j. What is the highest common factor of l and x? 22 Let c(b) = b + 48. Let h = -599 - -570. Let k be c(h). Calculate the highest common divisor of 304 and k. 19 Let g = -3 - -7. Let b be (18 - 3)2320/348. What is the greatest common factor of g and b? 4 Let u be (-2 - -1)(-5400)/272. What is the greatest common divisor of u and 304? 16 Let i be (-21988)/23 + 0 + 4. Let l be (-419720)/i - (-3)/((-102)/(-4)). What is the greatest common divisor of 18 and l? 9 Suppose 3w + 3i - 5169 = 0, 7i = 2w + 12i - 3458. Calculate the highest common factor of 9 and w. 9 Suppose 0 = -18u + 15u - 63. Let p = u + 25. Suppose -5q = -4b + 87, -pb - 53 = -5b - 5q. Calculate the highest common divisor of b and 112. 28 Let b(l) = l3 - 24l*2 + 214l + 18. Let m be b(12). Calculate the greatest common divisor of 363 and m. 33 Let a = 4412 + -4409. Calculate the highest common factor of 753 and a. 3 Let h(k) be the second derivative of k*5/20 + 25k*4/12 - 29k*3/3 - 22k*2 - 109k. Let l be h(-27). Calculate the greatest common factor of 80 and l. 16 Let r be -4 + 0 - -8 - 4/2 - -764. What is the greatest common factor of r and 1? 1 Let a be (-3)/(-6)(10 - 2). Suppose d - 3d + 5p = 660, 333 = -d + ap. Let s be 15/6 + d/(-2). What is the greatest common divisor of 33 and s? 33 Suppose 2u = -21 + 81. Let l be ((-126)/28)/(4/(-440)). What is the greatest common factor of u and l? 15 Suppose 7s = 3s - 5m - 16, m = -5s - 20. Let r be 8(-10)/s1/(-1). Let c be 10/r - 81/(-2). Calculate the greatest common factor of c and 80. 40 Let p = -11207 + 11267. Calculate the highest common divisor of p and 2630. 10 Let i be (-29 + -1)(-54)/81. What is the greatest common factor of 570 and i? 10 Let q = 2754 + -2054. Calculate the greatest common divisor of q and 425. 25 Suppose 0 = -2j + 4x + 12052, 0 = -5j + 3x + 17459 + 12685. Suppose -6o + 73o - j = 0. Let c = 31 + -21. Calculate the highest common divisor of o and c. 10 Let o be (-1 - 0/(-1)) + -51. Let k = -29 - o. Let y = 197 - -10. Calculate the highest common divisor of k and y. 23 Let f = 515 - 489. Let m be (-7)/(-28) + (-726)/(-8). What is the highest common factor of f and m? 13 Let t be (-525)/6(-48)/84. What is the greatest common factor of t and 330? 10 Suppose 5h = -4o + 93, -38h - 83 = -43*h + o	{ "pile_set_name": "DM Mathematics" }
between 7:48 AM and 1:55 PM? 367 How many minutes are there between 2:24 AM and 11:54 AM? 570 What is 618 minutes before 12:56 PM? 2:38 AM What is 291 minutes before 8:38 PM? 3:47 PM What is 191 minutes before 5:18 PM? 2:07 PM How many minutes are there between 7:52 PM and 2:36 AM? 404 How many minutes are there between 12:26 PM and 4:24 PM? 238 What is 328 minutes after 1:20 PM? 6:48 PM What is 92 minutes after 11:13 AM? 12:45 PM How many minutes are there between 6:13 PM and 5:40 AM? 687 How many minutes are there between 7:32 AM and 10:54 AM? 202 What is 388 minutes after 4:36 PM? 11:04 PM How many minutes are there between 8:46 PM and 10:23 PM? 97 What is 707 minutes before 3:31 PM? 3:44 AM How many minutes are there between 1:29 AM and 4:22 AM? 173 How many minutes are there between 1:18 PM and 12:15 AM? 657 What is 11 minutes before 7:10 AM? 6:59 AM What is 172 minutes before 2:36 AM? 11:44 PM What is 111 minutes before 8:16 AM? 6:25 AM What is 399 minutes before 7:40 PM? 1:01 PM What is 391 minutes before 7:38 AM? 1:07 AM How many minutes are there between 9:45 AM and 2:38 PM? 293 What is 172 minutes after 4:26 AM? 7:18 AM What is 376 minutes before 7:25 AM? 1:09 AM What is 692 minutes before 6:16 AM? 6:44 PM How many minutes are there between 4:31 PM and 5:12 PM? 41 How many minutes are there between 6:45 AM and 3:06 PM? 501 What is 128 minutes before 11:57 AM? 9:49 AM How many minutes are there between 9:29 PM and 1:39 AM? 250 What is 372 minutes after 11:29 AM? 5:41 PM How many minutes are there between 9:55 PM and 8:18 AM? 623 What is 320 minutes after 5:39 PM? 10:59 PM What is 62 minutes before 3:32 PM? 2:30 PM What is 372 minutes after 10:39 PM? 4:51 AM How many minutes are there between 7:05 AM and 7:24 AM? 19 What is 44 minutes before 3:02 AM? 2:18 AM How many minutes are there between 4:47 PM and 12:30 AM? 463 How many minutes are there between 5:47 AM and 10:36 AM? 289 How many minutes are there between 12:38 PM and 11:42 PM? 664 What is 646 minutes before 4:08 PM? 5:22 AM How many minutes are there between 7:16 PM and 2:59 AM? 463 What is 592 minutes after 1:38 AM? 11:30 AM What is 115 minutes before 1:10 PM? 11:15 AM What is 367 minutes after 3:13 PM? 9:20 PM How many minutes are there between 10:47 AM and 6:06 PM? 439 How many minutes are there between 10:24 PM and 1:28 AM? 184 How many minutes are there between 1:51 AM and 7:51 AM? 360 What is 217 minutes before 1:51 PM? 10:14 AM How many minutes are there between 7:37 AM and 12:14 PM? 277 What is 418 minutes before 3:04 PM? 8:06 AM What is 270 minutes after 1:19 AM? 5:49 AM What is 385 minutes after 12:14 PM? 6:39 PM How many minutes are there between 8:54 AM and 9:08 AM? 14 What is 624 minutes after 10:58 AM? 9:22 PM How many minutes are there between 10:26 PM and 8:38 AM? 612 What is 283 minutes before 1:58 AM? 9:15 PM What is 404 minutes before 7:26 PM? 12:42 PM How many minutes are there between 4:59 AM and 9:48 AM? 289 What is 342 minutes before 3:45 AM? 10:03 PM What is 398 minutes before 2:02 AM? 7:24 PM How many minutes are there between 10:47 AM and 3:49 PM? 302 What is 317 minutes before 6:29 AM? 1:12 AM What is 136 minutes after 10:42 AM? 12:58 PM How many minutes are there between 2:47 PM and 1:50 AM? 663 How many minutes are there between 4:41 AM and 3:53 PM? 672 What is 507 minutes after 2:42 AM? 11:09 AM How many minutes are there between 8:02 PM and 1:04 AM? 302 What is 644 minutes after 7:07 PM? 5:51 AM How many minutes are there between 6:04 AM and 6:56 AM? 52 What is 675 minutes before 4:37 PM? 5:22 AM How many minutes are there between 5:47 PM and 7:16 PM? 89 How many minutes are there between 6:30 AM and 11:28 AM? 298 How many minutes are there between 3:21 AM and 5:54 AM? 153 What is 676 minutes after 2:29 PM? 1:45 AM How many minutes are there between 7:27 AM and 2:51 PM? 444 What is 305 minutes after 8:58 AM? 2:03 PM What is 19 minutes before 2:57 PM? 2:38 PM What is 543 minutes before 6:57 AM? 9:54 PM What is 121 minutes after 8:12 AM? 10:13 AM How many minutes are there between 3:26 AM and 10:16 AM? 410 What is 690 minutes before 1:20 PM? 1:50 AM What is 385 minutes after 6:30 PM? 12:55 AM What is 372 minutes before 2:01 PM? 7:49 AM How many minutes are there between 6:17 AM and 2:22 PM? 485 How many minutes are there between 10:44 AM and 11:09 AM? 25 What is 399 minutes after 4:58 PM? 11:37 PM What is 120 minutes before 6:31 AM? 4:31 AM What is 19 minutes before 9:38 PM? 9:19 PM How many minutes are there between 6:31 PM and 6:40 PM? 9 What is 341 minutes after 7:48 PM? 1:29 AM What is 270 minutes after 1:37 AM? 6:07 AM What is 76 minutes after 12:56 AM? 2:12 AM How many minutes are there between 3:47 AM and 2:11 PM? 624 How many minutes are there between 3:23 AM and 9:07 AM? 344 What is 19 minutes before 8:36 AM? 8:17 AM What is 385 minutes after 8:15 AM? 2:40 PM How many minutes are there between 9:48 AM and 3:32 PM? 344 What is 709 minutes before 7:29 AM? 7:40 PM What is 448 minutes after 2:55 AM? 10:23 AM How many minutes are there between 3:28 AM and 1:45 PM? 617 How many minutes are there between 4:21 AM and 11:03 AM? 402 How many minutes are there between 12:48 AM and 9:43 AM? 535 How many minutes are there between 3:10 PM and 1:44 AM? 634 How many minutes are there between 5:43 AM and 7:25 AM? 102 What is 173 minutes after 11:18 AM? 2:11 PM What is 517 minutes before 4:41 PM? 8:04 AM How many minutes are there between 10:24 AM and 6:26 PM? 482 What is 535 minutes before 3:51 PM? 6:56 AM How many minutes are there between 8:43 AM and 1:13 PM? 270 What is 505 minutes after 8:39 PM? 5:04 AM What is 704 minutes before 10:47 AM? 11:03 PM What is 35 minutes before 10:17 PM? 9:42 PM What is 482 minutes before 10:51 AM? 2:49 AM How many minutes are there between 6:06 AM and 1:04 PM? 418 What is 120 minutes before 3:38 AM? 1:38 AM How many minutes are there between 2:31 PM and 2:25 AM? 714 How many minutes are there between 9:17 AM and 10:47 AM? 90 How many minutes are there between 9:53 AM and 11:00 AM? 67 How many minutes are there between 10:09 PM and 9:41 AM? 692 How many minutes are there between 7:58 AM and 4:48 PM? 530 How many minutes are there between 9:59 PM and 6:43 AM? 524 What is 538 minutes before 10:11 AM? 1:13 AM What is 115 minutes after 6:25 AM? 8:20 AM What is 104 minutes after 9:21 PM? 11:05 PM How many minutes are there between 9:17 AM and 3:12 PM? 355 What is 501 minutes after 12:04 AM? 8:25 AM What is 399 minutes before 10:59 PM? 4:20 PM What is 610 minutes before 3:14 AM? 5:04 PM What is 240 minutes after 9:59 PM? 1:59 AM What is 153 minutes before 6:03 AM? 3:30 AM How many minutes are there between 9:39 AM and 9:10 PM? 691 How many minutes are there between 2:08 AM and 1:39 PM? 691 What is 678 minutes before 2:58 PM? 3:40 AM How many minutes are there between 6:46 PM and 7:05 PM? 19 How many minutes are there between 11:32 AM and 5:45 PM? 373 How many minutes are there between 9:49 AM and 1:55 PM? 246 What is 51 minutes before 11:49 PM? 10:58 PM What is 620 minutes before 12:25 AM? 2:05 PM How many minutes are there between 11:18 AM and 10:34 PM? 676 What is 175 minutes before 3:13 AM? 12:18 AM What is 69 minutes before 6:30 PM? 5:21 PM How many minutes are there between 9:28 AM and 11:19 AM? 111 What is 385 minutes after 3:48 AM? 10:13 AM How many minutes are there between 11:07 PM and 7:23 AM? 496 How many minutes are there between 10:41 PM and 8:50 AM? 609 What is 394 minutes before 11:09 PM? 4:35 PM What is 166 minutes after 7:23 AM? 10:09 AM How many minutes are there between 10:56 PM and 5:40 AM? 404 What is 173 minutes before 11:41 PM? 8:48 PM What is 662 minutes before 12:01 AM? 12:59 PM What is 360 minutes before 2:55 PM? 8:55 AM How many minutes are there between 7:40 PM and 4:59 AM? 559 What is 107 minutes before 11:41 PM? 9:54 PM What is 524 minutes before 9:42 PM? 12:58 PM What is 466 minutes after 6:12 PM? 1:58 AM How many minutes are there between 2:39 AM and 3:30 AM? 51 What is 560 minutes after 4:31 PM? 1:51 AM How many minutes are there between 7:11 PM and 5:10 AM? 599 What is 360 minutes before 3:35 PM? 9:35 AM How many minutes are there between 1:37 PM and 8:25 PM? 408 What is 525 minutes before 1	{ "pile_set_name": "DM Mathematics" }
5x = gx. What is x rounded to six decimal places? 0 Suppose -1222829 = 18o + 292771. What is o rounded to the nearest 10000? -80000 Let c = -0.39 - -3.89. Let j = c - 3.4999915. What is j rounded to 6 decimal places? 0.000009 Let c = -56031 + 84197. Let q = 28164.4591 - c. Let w = 1.55 + q. Round w to 3 dps. 0.009 Let m = -15 + 18. Let v be (1550/15)/(m/9). What is v rounded to the nearest one hundred? 300 Let p = -260 - -261.79. What is p rounded to one decimal place? 1.8 Suppose 2k = -2k + 24. Suppose -ki + 15 = -i. Let d(t) = 4445t2 - 3t + 4. Let b be d(i). What is b rounded to the nearest 10000? 40000 Let w(p) = p*2 + 44p - 82. Let y be w(-34). Round y to the nearest 100. -400 Let t(v) = -2v3 - 12v*2 - 49v - 9. Let z be t(-11). What is z rounded to the nearest one thousand? 2000 Let g = 502.02 - 514. What is g rounded to zero decimal places? -12 Let t = -0.5711 - -0.0981. Let r = t + 0.043. What is r rounded to 1 decimal place? -0.4 Let q(b) = -79b2 + 23b + 232. Let v be q(-7). Round v to the nearest one hundred. -3800 Suppose 16 = 2g + 3g + 3d, -32 = -4g + 4d. Let u be (4/g)/((-27594)/6900 + 4). What is u rounded to the nearest one hundred? 900 Let t = 7790.83 - 7902. Let y = t + 2.17. Let u = -111.78 - y. Round u to one decimal place. -2.8 Let z = 12 - 67. Let b = z - -55.0016. Round b to 4 dps. 0.0016 Let q = 1008846.0182 - 1008985. Let o = 137.45 - -1.55. Let c = q + o. What is c rounded to 3 decimal places? 0.018 Let m(h) = -236h*2 - 13h - 2. Let v be m(-9). Let o be (1 - 3) + 3 + v. Round o to the nearest ten thousand. -20000 Suppose -3f - 467 - 101 = -u, -4u - 736 = 4f. Let p = f - -100. What is p rounded to the nearest ten? -90 Let m = 25.06 + -25. Let c = -5.56 + m. Let x = c - -4.44. What is x rounded to one dp? -1.1 Let f(w) = -7w*3 + 21w*2 + 11w - 3. Let t(c) = 3c3 - 10c*2 - 5c + 2. Let r(z) = -2f(z) - 5t(z). Let p be r(6). Round p to the nearest 10. 90 Let p = 398.08177 - 398. Round p to 3 decimal places. 0.082 Let t be 984/(20/1405). Suppose t = 5g - 12962. What is g rounded to the nearest one thousand? 8000 Let l = 15 - 13. Let f be 3/((-6)/l) + 15998. Suppose -5k + o - 2o = f, 12806 = -4k + 2o. Round k to the nearest 1000. -3000 Let a = -2004 + 2004.2183. What is a rounded to 1 dp? 0.2 Let g = -427523.08788 + 427545. Let v = g - -0.0882. Let t = v + -22. Round t to four decimal places. 0.0003 Let y = 39.428 - 48.7915. Let m = y + 1.6205. Let c = m - -7.7. Round c to two dps. -0.04 Let y = 2.008 + -2. Let a = -31.73 - -13.238. Let m = a - y. What is m rounded to zero decimal places? -19 Let s = 1.83 - 1.7992. Let k = s - -0.023. What is k rounded to 3 dps? 0.054 Let v = -26.362 + 11.544. Let a = 15.038005 + v. Let g = a - 0.22. What is g rounded to 6 decimal places? 0.000005 Let h = 25114428 + -8873936. Let f = h + -11100492. What is f rounded to the nearest 1000000? 5000000 Let w = 121.159 + -240.801. Let i = -119 - w. What is i rounded to one dp? 0.6 Let g = -3.1216 + 3.527. What is g rounded to 1 decimal place? 0.4 Let x = 180412.39944 + -180405. Let s = -7.4 + x. What is s rounded to four dps? -0.0006 Suppose 2w - 7w - 65509 = 3l, -52406 = 4w + 2l. What is w rounded to the nearest one thousand? -13000 Let z = -12.5602471 + 12.56. Round z to 5 dps. -0.00025 Let d be 2500/(-3)1307790/275. Round d to the nearest 100000. -4000000 Let o(h) = 10 - h*3 - 17h - 192h2 + 10 + 200h*2. Let x be o(11). What is x rounded to the nearest one hundred? -500 Let z = -0.117 - -0.18. Let y = 0.0319 - z. Round y to three dps. -0.031 Let f = -6723 + 6722.99996593. What is f rounded to 6 decimal places? -0.000034 Let d = 0.09 + 0.006. Let s = -0.05 - -0.15. Let t = s - d. What is t rounded to two decimal places? 0 Let u = 0.803 - 7.955. Let r = -0.148 + u. Round r to the nearest integer. -7 Let z = 76 - 64. Let c = -1017 - -1029.14. Let j = z - c. What is j rounded to 1 decimal place? -0.1 Let l = 17064616 + -17052492.0088. Let u = l + -12118. Let r = 6 - u. Round r to three decimal places. 0.009 Suppose 2j = 2y - 82, 0 = -j - 3y - 0y - 53. Let l be (-4)/22 - 1196/j. Let n = l - 5. Round n to the nearest ten. 20 Let r = -9 + 11. Suppose 54915 = ru + 6515. Round u to the nearest ten thousand. 20000 Suppose 10313961 = -26i - 10356039. Round i to the nearest one hundred thousand. -800000 Let h = 2966742.934 - 2970190. Let m = h - -3444. Let g = 3 + m. What is g rounded to two decimal places? -0.07 Let g = -82.502969 + 82.5. What is g rounded to 4 decimal places? -0.003 Suppose r = -l + 3r - 3612, r = 2l + 7221. What is l rounded to the nearest 1000? -4000 Let y = -42.9999639 - -43. Round y to five dps. 0.00004 Let q = 403.2866 - 403. What is q rounded to 2 dps? 0.29 Suppose 10187 = 28g + 65683. Round g to the nearest one hundred. -2000 Let x(w) be the third derivative of 125w5/6 - 9w*2. Let g be x(-2). Let v be (-660)/((-10001)/g - -2). Round v to the nearest 1000000. 3000000 Let o = 749.674 + -2.474. Let w = -681 + o. Round w to the nearest ten. 70 Let o = -40.773 + 150.884. Let j = o + -110. Round j to 2 decimal places. 0.11 Let k = 0.04 + -0.0399473. Round k to 5 dps. 0.00005 Let r = 6 + -5.96. Let a = -65.46 + 66. Let j = a - r. What is j rounded to the nearest integer? 1 Let p = -409 + 290. Let x = p - -118.943. Round x to 2 dps. -0.06 Suppose 5j - 15185893 + 5402363 = 0. Suppose -23n = -26n + 10670118. Let z = j - n. Round z to the nearest one million. -2000000 Let l(u) = 7199u + 2. Let n be l(2). Let t = -214 + 219. Suppose -tc - n = -9c. Round c to the nearest 1000. 4000 Let s = -0.172 - 29.128. Let l = s + 29.29999869. Round l to six dps. -0.000001 Let w be ((-396)/54)/((-1)/(-39303)). Let j = w - -568222. Round j to the nearest one hundred thousand. 300000 Let l be (39/(-78))/(-1 + 41621/41620). Round l to the nearest 100. -20800 Let o be (901/(-2))/((-4)/(-8)). Let q = o - -1594. Suppose 827 = -2r - q. Round r to the nearest one hundred. -800 Let n = -4373.124 + -13127.586. Let c = n - -17762. Let p = c + -260. Round p to 1 decimal place. 1.3 Let j = -21.8 - 1.2. Let c = 23.1598 - 0.1858. Let q = j + c. What is q rounded to 2 decimal places? -0.03 Let q = -117.18 - -2.18. Let u = q + 115.081. Round u to 2 decimal places. 0.08 Suppose -i + 18 = -3o, 10i - 5i - 72 = -3o. What is i rounded to the nearest 100? 0 Suppose 34l - 152880 = 55l. Round l to the nearest one thousand. -7000 Let a = -0.0676 - 11.6024. Let s = -12.298 + -0.102. Let h = a - s. Round h to 1 dp. 0.7 Let o = -0.403618 - -121.248118. Let y = -121 + o. Let l = 0.16 + y. Round l to 3 decimal places. 0.005 Let x = -107914013 - -52862297. Let c = x + 55051674.399741. Let b = c + 41.6. Round b to five decimal places. -0.00026 Let t = -10 + 16. Let j = -24.9 + 18.66. Let l = t + j. What is l rounded to 1 dp? -0.2 Let t = 197 + -197.00189. Round t to 3 dps. -0.002 Suppose -l - 5n - 3583054 = 0, 0 = 3l - 6l + 3n - 10749162. Let y = 14483054 + l. What is y rounded to the nearest 1000000? 11000000 Let a(u) = -1450000u2 + 2u - 2. Suppose 5d = 4d + 1. Let r be a(d). Round r to the nearest 1000000. -1000000 Let q = -1.39999674 - -1.4. What is q rounded to 7 decimal places? 0.0000033 Let i = -81 - -80.01. What is i rounded to zero dps? -1 Let k = -0.8 + 46.8. Let m = 26 - k. Let v = m - -20.003. What is v rounded to two dps? 0 Let u = 451 + -3923. Let b = 3472.1943 + u. Let p = -0.2 + b. Round p to 3 decimal places. -0.006 Let m = 203.7 - 24.7. Let p = 179.113 - m. Round p to 2 decimal places. 0.11 Let o = 0.2 - 0.29. Let k = o + -5.91. Let r = 13.6 + k. Round r to the nearest integer. 8 Let a = -0.049 + 0.04933. Let m = -89 - -89. Let w = a + m. Round w to four decimal places. 0.0003 Suppose -5v + 0v = -105. Let j be (-3 - 0)/(v/(-16688)). Let z = j - 1454. What is z rounded to the nearest one hundred? 900 Let m = 2.09000078 - 2.09. Round m to 7 dps. 0.0000008 Let w = -2950.0000007836 + 2950. Round w to 7 dps. -0.0000008 Let k = -3 + 5. Let u be 8 - (k + 0/(-4)). Suppose us + 1119 = s - 4c, -s - c - 224 = 0. What is s rounded to the nearest 10? -220 Let y = 1715.669887 + -2163.66962. Let t = y - -448. What is t rounded to five decimal places? 0.00027 Let o = -20.3 + 1.3. Let	{ "pile_set_name": "DM Mathematics" }
y5 + 6y*2 - 5/6y*3 - 5/24y*4 + 0y. Give l(5). -5 Let p(y) = y*2 - y. Suppose 3o + 0 = 3j + 12, 0 = -3o + 12. Let d = -2 - j. Let i be 5/d - 1/(-2). Determine p(i). 6 Let h(d) = -d*2 - 4d. Let k be h(-5). Let a(r) = -r*2 - 9r - 5. Give a(k). 15 Suppose 0 + 16 = 4t. Suppose -x = 3, -tx - 20 = l - 3l. Suppose 0 = -5n + 3n - l. Let u(d) = -d - 1. What is u(n)? 1 Let n(u) = u2 + 5u + 2. Let h be n(-6). Let p(b) = -6 + h + 4 + b. What is p(-3)? 3 Let v(n) = 2n + 0n*3 - 2n*2 + 8n2 + n3 + 3 + 3n. Let p be v(-5). Let d(g) = -g3 + 4g*2 - 5g + 2. Calculate d(p). -4 Suppose 35 = 5c - 5q, 3 = 3c + 5q - 2. Let d(k) = -1 + c + k - 2. Give d(-2). 0 Let t(q) = q*2 - 3q - 1. Suppose 0 = -5b + 1 + 14, 2n - 5b - 35 = 0. Suppose n = p + 4p. What is t(p)? 9 Suppose -2q + 0 = 4. Let x(y) be the second derivative of y4/12 + y3/3 - y2/2 - 7y. Determine x(q). -1 Let n be (24/(-7))/((-6)/63). Suppose 0 = 2x + 2x - 5o + n, -4 = -4x - 5o. Let t(h) = -h3 - 5h*2 - h + 1. Give t(x). -11 Let c(d) be the first derivative of -4d*3/3 + 7d*2 + 3d + 1. Let v(f) = f*2 - 5f - 1. Let b(n) = -6c(n) - 17v(n). What is b(1)? 7 Suppose -4 = -3t + 5y, 5y + 0y = 5. Let x(u) = 41ut + 0u - 7 + 12u2 - 42u*3 - 5u2 + u. Determine x(7). 0 Let v(r) be the third derivative of r5/60 - 7r4/24 - 5r*3/6 + 9r2. Determine v(7). -5 Let s(g) = g3 - 5g2 - 4g - 5. Let f be -1 - 144/(-8). Give s(f). 7 Suppose -5u + 4 - 24 = 0. Let o = 5 + u. Let m(y) be the second derivative of y5/20 + y4/12 + y3/6 - y2/2 + y. Give m(o). 2 Suppose -4t + 0 - 32 = -5h, t + 8 = 5h. Let f(p) be the third derivative of p4/24 + 3p3/2 - p2 - 13. Give f(t). 1 Suppose 0 = -5a + 17 + 3. Suppose 9i + 25 = ai, 2x = i + 9. Let n(p) = xp + 4 + 7 - 5 - 3p. Calculate n(5). 1 Let u(r) = 42r - 1 - 19r - 26r. Calculate u(3). -10 Let k be (-11 - 2)/(-1). Suppose 0 = -3h + 13 - 4. Let q(s) = -3s + hs2 + s3 - 6s2 + 4 + s2. What is q(k)? 4 Suppose 5o = -3v - 5, -2 = -5o + 5v + 33. Let z(p) = -7p + 0p + 4p + 3. Give z(o). -3 Let j(w) be the first derivative of -w5/40 + w4/6 + 5w3/3 - 4. Let y(h) be the third derivative of j(h). What is y(3)? -5 Let d = -3 + 5. Let b = 5 + -2. Let z be 0 + 10/d - b. Let p(x) = x3 - 2x2 - 2x + 3. Calculate p(z). -1 Let x(l) = l*3 - 5l*2 + l - 3. Suppose 0 = -0m - 5m + 125. Suppose m = d + 4d. What is x(d)? 2 Let i(r) = r*2 + r + 1. Let p(u) = 7u*2 + 6u + 4. Let b(c) = -6i(c) + p(c). Let s(a) = -a2 + 14a - 21. Let t be s(12). Determine b(t). 7 Suppose -7 = -4n + 89. Let q(w) = -2w - 2. Let d be q(-3). Suppose 0 = -di - n. Let t(r) = -r2 - 6r + 6. Give t(i). 6 Suppose -2s + 5h - 31 = 0, -4s - s - 3h - 31 = 0. Let k = s + 10. Let f(x) = -2x + 3. Determine f(k). -1 Suppose 0 = 2p + p. Let j = 11 + -10. Let u(x) = -7 + 0x + j + x. Determine u(p). -6 Let p(h) be the second derivative of h6/120 - h5/12 - h3/3 + 5h*2/2 - 3h. Let n(d) be the first derivative of p(d). Calculate n(5). -2 Let f(u) = -u*3 - 6u*2 - 2u - 6. Suppose -12 = 2q - 4m, 2m - m + 24 = -4q. Calculate f(q). 6 Let n(p) = 7p2 - 1. Let s be (-2)/(-4) - 175/(-10). Let d = s + -19. Determine n(d). 6 Let p = 4 - -6. Let d = p + -5. Let o(s) = -s3 + 6s*2 - 4s. Calculate o(d). 5 Suppose 7 = -3c - 2t, -t = 5c - 6 + 13. Let o be (-1 + (-1)/c)-1. Let y(z) = o + z - 3 - 1. What is y(4)? 0 Let n(y) = 4y3 + 5y*2 - 4y + 23. Let j(s) = s3 + s2 - s + 6. Suppose 2k + 0k + 18 = 0. Let g(v) = kj(v) + 2n(v). What is g(0)? -8 Let i(f) = -f3 + f2 + f + 3. Let o = 8 + -8. Calculate i(o). 3 Let i(g) = 4g3 - 2g*2 - g. Suppose 2n + 12 = -5p, -2n - 11 + 3 = 3p. Determine i(n). -5 Let g(w) be the first derivative of -3w*2/2 + 2w - 1. Let o be 50/14 - (-8 - 477/(-63)). Give g(o). -10 Let f(o) = 3o3 - 2o*2 + 1. Suppose 26r - 11r = -15. Calculate f(r). -4 Let q be 24/2(-2)/(-4). Let s(x) = x*3 - 7x*2 + 6x - 2. Determine s(q). -2 Let i be 0 + 6/(-2) + 6. Let d(x) = -x*2 + 0x*2 + 2x*2 - 2x. What is d(i)? 3 Let k be (-76)/(-13) + 38/247. Let g(t) = -t*2 + 6t + 3. Calculate g(k). 3 Let i(v) be the third derivative of v*2 - 1/3v*3 + 0v + 1/120v6 + 0 - 1/15v*5 + 1/12v4. Let z = -1 + 4. Calculate i(z). -5 Let n(s) be the first derivative of s2/2 - 5s + 8. Suppose 4q - 4 = o - 0o, -14 = -3o - q. Give n(o). -1 Suppose -2n + r + r = 4, 8 = -2n + 3r. Suppose 3q = -nq. Suppose q = -2h - h. Let b(j) = j3 - j2 + j - 7. Give b(h). -7 Let l(t) = -t*2 + 4t + 4. Let c be l(5). Let y(u) = -u - 4. Let q(f) = -f*2 - 2f - 7. Suppose 6 = -4k - 6. Let n(p) = kq(p) + 5y(p). Give n(c). 3 Suppose 5j + 32 = 3a - 8, -2a + 25 = -3j. Let r(b) be the third derivative of 0b + 0 - 1/24b4 - 2b*2 + 7/6b*3. Calculate r(a). 2 Let t(m) = -3m*3 + 8m*2 + 7m + 8. Let l(z) = -2z3 + 7z*2 + 6z + 7. Let b(w) = -4l(w) + 3t(w). Determine b(-3). -4 Suppose 3n = -3t + 2t - 5, -5t = -3n - 11. Let l(v) = -v2 + v. Determine l(n). -6 Let w(g) = -g3 + 6g*2 - 5g + 2. Let o be (-10)/8(-32)/8. What is w(o)? 2 Let l(f) be the first derivative of f4/4 + 8f*3/3 + 6f + 60. Give l(-8). 6 Suppose -4o = -2o - 4. Let n(u) be the first derivative of 1/2uo + u - 1. Determine n(-5). -4 Let o(h) = -h - 8. Let t = -104 - -98. What is o(t)? -2 Let v be (0 + -1)5/(-1). Let n(y) = y2 - y - 4. What is n(v)? 16 Let a(y) = y3 + 3y2 + y - 1. Let b(f) = f3 + 5f*2 + 5f + 2. Let g be b(-4). Let k be (g - 2)(-3)/(-6). Calculate a(k). 1 Let c = 2 - -8. Let u = 15 - c. Suppose -a - 11 = n + 2n, 2a = un. Let p(v) = -v*2 - 7v - 5. What is p(a)? 5 Suppose 3o + 2j = 6, o - 2j = -5j + 9. Let m(y) = -6y2 + oy + 3y3 + 2y + 9 - 4y3. Give m(-6). -3 Let u = -8 + 13. Suppose -uk - 3 - 2 = 0. Let r(g) be the first derivative of 3g2 + g - 1. Determine r(k). -5 Let w be -7 + 4 + 3 - -15. Suppose -3d + w = 2d. Let t(k) = -2k*2 + 4k. Determine t(d). -6 Let c(d) = d - 5. Let v(o) = o - 6. Let q be v(-6). Let p be 3/q + 2/8. What is c(p)? -5 Let g = 2 + 1. Let x(i) = 3i + g - 6i - i. Determine x(4). -13 Let u(k) be the first derivative of k*2/2 - 5k + 11. Let t = -2 - -6. Let m be (2/t)/((-2)/20). Calculate u(m). -10 Let g(t) = -3t - 13. Let q be g(-6). Suppose -4h = h - q. Let b(y) = -y*2 + 3y - 1. Determine b(h). 1 Suppose -2z = -0z + 8, -2 = 5t + 3z. Suppose -tl - 10 = -4l. Let s(h) = h*3 - 6h*2 + 5h - 7. Give s(l). -7 Let m(j) = j - 3. Suppose 2g - g = 31. Suppose -2l + u - 13 = l, 0 = -5l - 3u - g. Calculate m(l). -8 Let l(y) = y*2 - 14y - 14. Suppose -2m - 66 = -4n, 0 = n + 2m + 3m. Determine l(n). 1 Let a = 25 - 29. Suppose -4y = -9y. Let w(s) = 2s + y - s - 1. What is w(a)? -5 Let a(w) be the third derivative of -w6/120 + w5/12 + w4/12 - w3/3 + 2w2. Let x(h) = h3 + 3h2 - 5h + 1. Let n be x(-4). Calculate a(n). 8 Let l(g) be the second derivative of -g*5/20 + 2g*4/3 - 5g*3/6 - 4g*2 - 32g. Determine l(7). 6 Suppose -10 = -0h - 2h. Let a(k) = 0k - hk + 1 + 4k. Give a(6). -5 Let i(b) = 1 + 0 + 4 + 4b - 3. What is i(3)? 14 Let d(k) be the first derivative of 2k3/3 - 3k*2/2 - 3k + 10. Determine d(3). 6 Let r(b) be the third derivative of -b*5/60 + 7b*4/24 - 4b*3/3 - 4b2. Give r(6). -2 Let w(q) = -q2 + 6q + 9. Let j be w(7). Suppose 1 = -jl + l. Let k(n) = -8n3 - n2 - 2n - 1. Calculate k(l). 8 Suppose -5l - 25 = 0, b + 3b - 36 = 4l. Let f = 2 + 0. Let c(y) = 3 - f + y + 1. What is c(b)? 6 Let h(g) be the second derivative of g4/6 - g2 + g. Let v(n) = n + 3. Let u be v(0). Suppose -2c = -uj + 19, c = -3c - j - 3. Calculate h(c). 6 Let p(t) = -t*2 + 1. Let a(l) = 5l*2 - 5l - 5. Let b(i) = a(i) + 6p(i). Let h be b(-4). Let d(m) = m2 - 3m - 5. What is d(h)? 5 Let n(b) = b*3 + 6b*2 - 6b - 6. Let x(i) be the first derivative of i3/3 - i2/2 - i - 5. Let s(y) = n(y) - 6x(y). Determine s(1). 1 Let l(z) be the first derivative of -1/6z*3 + 0z - 1/24z4 + z2 + 1. Let y(b) be the second derivative of l(b). What is y(2)? -3 Let m(d) = -d. Let q(s) = 7s - 3. Let l(a) = -6*m(a) - q(a)	{ "pile_set_name": "DM Mathematics" }
multiple of 504 and 560? 5040 Calculate the lowest common multiple of 100 and 40. 200 Calculate the common denominator of 40/3 and -4/2247. 2247 What is the common denominator of 31/156 and 77/48? 624 What is the lowest common multiple of 748 and 272? 2992 What is the least common multiple of 453 and 102? 15402 What is the smallest common multiple of 11 and 165? 165 What is the lowest common multiple of 16 and 232? 464 Calculate the common denominator of -32/13 and 115/78. 78 Find the common denominator of 7/9 and 13/10850. 97650 What is the least common multiple of 114 and 18? 342 Find the common denominator of 5/441 and 59/21. 441 Calculate the common denominator of 77/10 and 67/1598. 7990 Find the common denominator of 119/48 and -103/342. 2736 Calculate the common denominator of -23/12 and -37/282. 564 Calculate the smallest common multiple of 70 and 76. 2660 What is the common denominator of -14/149 and -50/5811? 5811 Find the common denominator of 99/28 and -5/8. 56 What is the lowest common multiple of 488 and 976? 976 Calculate the lowest common multiple of 77 and 121. 847 What is the common denominator of 45/1016 and 91/32? 4064 Find the common denominator of 69/16 and 71/66. 528 Calculate the smallest common multiple of 36 and 171. 684 What is the common denominator of 57/32 and 137/144? 288 What is the common denominator of 32/75 and 82/315? 1575 Calculate the lowest common multiple of 511 and 49. 3577 Calculate the lowest common multiple of 32 and 320. 320 Calculate the smallest common multiple of 1098 and 288. 17568 Calculate the common denominator of 29/624 and 31/1365. 21840 What is the common denominator of 137/10290 and -119/50? 51450 Calculate the smallest common multiple of 516 and 8. 1032 What is the least common multiple of 560 and 96? 3360 What is the common denominator of -121/20 and 1/6? 60 Find the common denominator of 1/130 and 15/364. 1820 Calculate the smallest common multiple of 22 and 1130. 12430 What is the common denominator of -101/1430 and 59/182? 10010 Calculate the common denominator of 81/4 and 49/558. 1116 What is the least common multiple of 2 and 645? 1290 Find the common denominator of -59/54 and -10/681. 12258 Find the common denominator of -23/30 and 139/90. 90 What is the common denominator of -127/1650 and -7/4? 3300 Calculate the smallest common multiple of 70 and 35. 70 What is the least common multiple of 9 and 33? 99 Calculate the smallest common multiple of 12 and 20. 60 Find the common denominator of 5/21 and -59/56. 168 Find the common denominator of -89/700 and -68/35. 700 Find the common denominator of 161/90 and -103/20. 180 Find the common denominator of -97/7036 and -49/6. 21108 Calculate the smallest common multiple of 793 and 65. 3965 Calculate the lowest common multiple of 21 and 63. 63 Calculate the least common multiple of 425 and 2975. 2975 Calculate the common denominator of -13/36 and 3/1448. 13032 Calculate the smallest common multiple of 243 and 6264. 56376 Calculate the common denominator of -25/318 and -55/48. 2544 Calculate the common denominator of 59/588 and -41/28. 588 Find the common denominator of -87/50 and 64/115. 1150 What is the smallest common multiple of 525 and 133? 9975 Calculate the common denominator of 8/3389 and 22. 3389 Find the common denominator of 161/5808 and 145/4752. 52272 Calculate the least common multiple of 2996 and 56. 5992 What is the common denominator of -127/6 and -53/136? 408 Find the common denominator of 41/75 and -74/7425. 7425 Calculate the common denominator of -13/1470 and 8/3675. 7350 Calculate the smallest common multiple of 132 and 220. 660 What is the smallest common multiple of 12984 and 18? 38952 What is the lowest common multiple of 14 and 462? 462 Calculate the least common multiple of 228 and 5700. 5700 What is the common denominator of 11/478 and -14/3? 1434 What is the smallest common multiple of 90 and 25? 450 Calculate the smallest common multiple of 91 and 78. 546 Calculate the common denominator of 81/11716 and -67/16. 46864 What is the common denominator of -46/111 and 60/259? 777 What is the common denominator of -23/504 and 71/420? 2520 What is the common denominator of 9 and -61/9? 9 What is the smallest common multiple of 3212 and 6? 9636 Find the common denominator of 61/5472 and -15/8. 5472 What is the least common multiple of 8 and 18? 72 Find the common denominator of -81/20 and -85/792. 3960 What is the common denominator of 36 and 7/397? 397 Find the common denominator of 149/660 and -49/594. 5940 What is the least common multiple of 143 and 77? 1001 Calculate the common denominator of 99/16 and 49/76. 304 What is the common denominator of 109/180 and 161/30? 180 What is the common denominator of 46/57 and 43/345? 6555 Calculate the lowest common multiple of 4 and 1051. 4204 What is the least common multiple of 44 and 55? 220 Calculate the lowest common multiple of 25 and 11. 275 Calculate the smallest common multiple of 186 and 4247. 25482 What is the smallest common multiple of 867 and 136? 6936 Calculate the smallest common multiple of 656 and 40. 3280 Calculate the lowest common multiple of 44 and 5800. 63800 What is the least common multiple of 1988 and 12? 5964 Calculate the lowest common multiple of 2160 and 60. 2160 What is the least common multiple of 20 and 515? 2060 Calculate the lowest common multiple of 4 and 116. 116 Calculate the least common multiple of 2975 and 350. 5950 Find the common denominator of -127/1810 and 37/724. 3620 Calculate the least common multiple of 544 and 1598. 25568 What is the common denominator of 8/7 and 45/4498? 31486 What is the common denominator of -3/11 and -43/7? 77 Calculate the smallest common multiple of 56 and 32. 224 Calculate the smallest common multiple of 16 and 2928. 2928 Calculate the least common multiple of 8 and 108. 216 What is the smallest common multiple of 32 and 8004? 64032 Calculate the common denominator of -91/176 and 51/848. 9328 What is the common denominator of 103/588 and 34/63? 1764 Find the common denominator of -15/416 and 11/52. 416 Calculate the lowest common multiple of 144 and 567. 9072 Find the common denominator of 59/6 and -49/230. 690 Find the common denominator of -83/80 and 43/48. 240 What is the common denominator of -151/714 and 41/21? 714 Calculate the lowest common multiple of 88 and 66. 264 Calculate the least common multiple of 68 and 8. 136 What is the common denominator of 109/4170 and -23/40? 16680 Calculate the lowest common multiple of 800 and 8. 800 What is the least common multiple of 60 and 160? 480 Find the common denominator of -107/1210 and 48/25. 6050 Calculate the least common multiple of 600 and 33. 6600 Find the common denominator of -67/219 and -19/27. 1971 Calculate the least common multiple of 156 and 12. 156 What is the smallest common multiple of 6 and 3594? 3594 What is the lowest common multiple of 1200 and 27? 10800 Calculate the least common multiple of 2374 and 10. 11870 Find the common denominator of 50/11 and -5/1023. 1023 Calculate the lowest common multiple of 180 and 75. 900 Calculate the common denominator of -109/12 and -65/4. 12 What is the least common multiple of 495 and 135? 1485 What is the common denominator of -5/324 and 53/324? 324 Calculate the lowest common multiple of 594 and 2376. 2376 What is the lowest common multiple of 115 and 115? 115 What is the common denominator of 31/78 and 31/10? 390 Calculate the lowest common multiple of 88 and 44. 88 What is the common denominator of 47/180 and 71/75? 900 What is the least common multiple of 680 and 96? 8160 Calculate the common denominator of 3/1936 and -117/224. 27104 Find the common denominator of 29/7490 and 57/14. 7490 Calculate the smallest common multiple of 3480 and 180. 10440 What is the smallest common multiple of 20 and 992? 4960 Calculate the least common multiple of 120 and 20. 120 Calculate the smallest common multiple of 23 and 111. 2553 Find the common denominator of -59/8 and -79/224. 224 What is the common denominator of 105/22 and -161/570? 6270 What is the common denominator of -89/75 and 16/1665? 8325 What is the least common multiple of 76 and 188? 3572 Calculate the least common multiple of 102 and 3. 1	{ "pile_set_name": "DM Mathematics" }
Collect the terms in 97y2 + 88y*2 + 102y*2 - 248y*2. 39y*2 Collect the terms in -334 - 333 + 667 - 5h. -5h Collect the terms in -56v*2 - 39v*2 + 16v*2. -79v*2 Collect the terms in 18b + 18b - 50b + 18b. 4b Collect the terms in -73i3 + 24i*3 + 23i*3 + 27i3. i3 Collect the terms in -24a + 363a + 2 + 7a. 346a + 2 Collect the terms in -1075221 - 2m + 1075221. -2m Collect the terms in 42p + 39p - 76p. 5p Collect the terms in -b + 2b - b + 3b*2. 3b*2 Collect the terms in 503 - 503 - 3d2 + d2. -2d2 Collect the terms in -10u*3 - 3u*3 - 5u*3 - 21u*3. -39u*3 Collect the terms in 180n + 180n - 360n - 5n3. -5n*3 Collect the terms in 0v - 7v - 5v. -12v Collect the terms in 54n*2 + 51n*2 - 108n*2. -3n*2 Collect the terms in 124j*3 + 175j*3 + 347j*3 + 172j*3. 818j3 Collect the terms in -102 + 102 - z2 + z*2 - 3z*3. -3z*3 Collect the terms in -73i - 17i2 + 73i. -17i2 Collect the terms in -5 - 3 + h + 8. h Collect the terms in -20y*3 + 12y*3 + 17y*3. 9y*3 Collect the terms in 18 - 18 - 53s*2. -53s*2 Collect the terms in -10r*2 + 10r*2 + 5r*2 - 17r*2. -12r*2 Collect the terms in -286k*3 - 290k*3 + 567k*3. -9k*3 Collect the terms in -177i*3 - 13i*3 + 2i - 2i. -190i*3 Collect the terms in -6m*3 - 25m*2 + 25m*2. -6m*3 Collect the terms in -8p*3 + 45 - 45. -8p*3 Collect the terms in 36r*2 + 23r*2 + 4r*2 + 71r*2. 134r*2 Collect the terms in -3l - 176 + l + 176. -2l Collect the terms in -807t - 54t2 + 807t. -54t2 Collect the terms in 39l*3 - 77l*3 + 30l*3. -8l*3 Collect the terms in -6 + 6 - 6s*2 - 7s*2. -13s*2 Collect the terms in -3 - 1973h + 1986h - 2 + 5. 13h Collect the terms in 56z2 - 8 + 52z*2 - 103z*2. 5z*2 - 8 Collect the terms in -96p + 28p + 47p. -21p Collect the terms in 2 - h3 + 2 - 2h*3. -3h*3 + 4 Collect the terms in 8s + 0s + s - 3s. 6s Collect the terms in 11d + 5d - 14d. 2d Collect the terms in 157o - 466o + 155o + 149o. -5o Collect the terms in -19f3 - f + 105f*3 + 3f. 86f3 + 2f Collect the terms in 8317 - 8317 + 0f + f2 + 0f. f*2 Collect the terms in -8k*2 + 2k + 2k - 4k. -8k2 Collect the terms in -26k*2 + 7k*2 + 11k*2 + 10k*2. 2k*2 Collect the terms in 4j + 33j2 - 35j*2 - 4j. -2j2 Collect the terms in 1939 - 1939 - d2 + 5d*2. 4d*2 Collect the terms in -9s - 16s + 340 - 340 + 27s. 2s Collect the terms in 2z*2 - 26z + 6z2 - 9z2. -z2 - 26z Collect the terms in 86m*2 + 88m*2 - 11m*2. 163m*2 Collect the terms in -3 + 0c - 4c - 5c. -9c - 3 Collect the terms in -32c + 34c - 42 + 83 - 41. 2c Collect the terms in -2c3 + 872c*2 - 872c*2. -2c*3 Collect the terms in -836q*3 + 2501q*3 - 828q*3 - 829q*3. 8q*3 Collect the terms in 2q - 10q - 2q. -10q Collect the terms in -q2 + 12q2 - q2. 10q2 Collect the terms in 1 - 273p*3 - 1 + 268p*3. -5p*3 Collect the terms in -1 - y + 2 + 2y. y + 1 Collect the terms in -9 + 14 - 3c3 - 5. -3c*3 Collect the terms in -2u*3 - 4u*3 - 2u*3. -8u*3 Collect the terms in -7w + 15w - 8w + 11w2. 11w*2 Collect the terms in -502c*2 + 735c*2 - 231c*2. 2c*2 Collect the terms in -3z*2 + 26z*2 + 3z*2. 26z*2 Collect the terms in -277276o + 2o2 + 277276o. 2o2 Collect the terms in 20d*2 + 9d*2 - 7d*2 - 11d. 22d2 - 11d Collect the terms in -27h3 + 17h*3 - 65h*3. -75h*3 Collect the terms in -28 + 8 + 20 - 37s*3. -37s*3 Collect the terms in -24y + 18y + 38y + 40y. 72y Collect the terms in 11p3 + 47p - 4 + 4 - 54p. 11p*3 - 7p Collect the terms in 2u2 + 2442 + 2u*2 - 2442. 4u*2 Collect the terms in 550 + 6f - 550. 6f Collect the terms in -118h*2 + 118h*2 - 6h*3 - 5h*3. -11h*3 Collect the terms in -2f*2 + 15f*2 + 0f*2. 13f*2 Collect the terms in 3 + 79p - 3 - 75p. 4p Collect the terms in -3v2 + 2v*2 + 2v2. v2 Collect the terms in -132k - 30k - 103k. -265k Collect the terms in -53g3 + 7g3 - g3 - 26g3. -73g*3 Collect the terms in 60d*2 + 684 - 684. 60d*2 Collect the terms in -34c - 20c + 175c + 185c. 306c Collect the terms in 11 - 32 - 8 + 2l - 92. 2l - 121 Collect the terms in 1 - 2 + 21x2 + 1. 21x*2 Collect the terms in -41o*2 - 42o*2 + 121o*2 + 2o*3 - 38o*2. 2o*3 Collect the terms in -70j*2 + 65j*2 - 2 + 5. -5j*2 + 3 Collect the terms in 0t*2 + 19t*2 - 23t + 23t. 19t*2 Collect the terms in 604t - 2t3 - 300t - 304t. -2t*3 Collect the terms in -23 + 14 + 11 + 19i. 19i + 2 Collect the terms in 119w*2 - 119w*2 - 53w*3. -53w3 Collect the terms in -p - 5 - 11 - 12 + 28. -p Collect the terms in -i3 - i*3 + 7i*3. 5i*3 Collect the terms in 0q + 0q + 3 - 4q*3. -4q*3 + 3 Collect the terms in 4 - 6 + 2 + 6g*2. 6g*2 Collect the terms in 0b - 15 + b + 7b + 0b. 8b - 15 Collect the terms in -39m + 0m2 + m2 + 25m + 14m. m2 Collect the terms in 167454 + 5w - 167454 - 2w. 3w Collect the terms in 4k - 2k - 2k - 3k*2. -3k2 Collect the terms in -315 - 319 + 634 - w. -w Collect the terms in -x3 - 103x2 + 188x*2 - 100x*2 + 15x2. -x3 Collect the terms in 50t - 27t + 7t2 - 23t. 7t2 Collect the terms in 0j*3 - 3j3 + j3 + 7j3 - j3. 4j*3 Collect the terms in 20a + 20a - 11a. 29a Collect the terms in 9g*2 - 13g*2 + 6g*2. 2g*2 Collect the terms in 95152t - 2t2 - 95152t. -2t2 Collect the terms in -5k - 2k - 3k - 2k. -12k Collect the terms in -2h2 - 4h*2 - 4h*2 + 8h*2. -2h*2 Collect the terms in 3t2 + t2 + 2t2 - 7t2. -t2 Collect the terms in -5j3 - 7j*3 - 34j*3. -46j*3 Collect the terms in -26 + 26 - 10s*3. -10s*3 Collect the terms in 92h + 105h - 196h - 2 + 2. h Collect the terms in 196 - 19f - 392 + 196. -19f Collect the terms in -6z2 + 1155z*3 - 1153z*3 + 6z*2. 2z*3 Collect the terms in -109 - 170 + 24 - 3a*3. -3a*3 - 255 Collect the terms in -6z*3 + 69z*3 + 140z*3. 203z*3 Collect the terms in 91h*3 - 183h*3 + 93h3. h3 Collect the terms in 71u3 - 126u + 126u - 40u*3 - 32u3. -u3 Collect the terms in 5w - 5w + 161w2 - 328w*2 + 165w*2. -2w*2 Collect the terms in 3h - 63 + 32 + 7h + 31. 10h Collect the terms in -11 + 2h3 + 4 + 4. 2h*3 - 3 Collect the terms in 21d + 13180 - 13180. 21d Collect the terms in 3n + n - 5n3 - n3 + 0n. -6n3 + 4n Collect the terms in -32s - 14s + s*3 + 46s. s*3 Collect the terms in 43n + 73n - 117n. -n Collect the terms in -x + x + 127x2 - 65x*2 - 64x*2. -2x*2 Collect the terms in -2 + 28h*2 - 47h*2 + 2. -19h2 Collect the terms in f3 - 851572 + 851572. f*3 Collect the terms in 13h*2 + 11h*2 - 21h*2. 3h*2 Collect the terms in -9c*3 + 79 - 79 + 14c*3. 5c*3 Collect the terms in -15 - u - 8 + 32 - 9. -u Collect the terms in -18p*3 - 34p + 10p + 24p. -18p3 Collect the terms in 14 + 2186h*2 - 14. 2186h*2 Collect the terms in 7n*3 + 73n*3 + 11n*3. 91n*3 Collect the terms in 279n - 128n - 150n. n Collect the terms in 23t - 18t*2 + 19t - 46t. -18t*2 - 4t Collect the terms in -34x - 4x + 11x - 9x. -36x Collect the terms in 375y*2 - 265y*2 + 1720y*2. 1830y2 Collect the terms in q2 - 3q2 - 5q*2 - 7q*2. -14q*2 Collect the terms in 4v*2 - 18v*2 + 16v*2. 2v*2 Collect the terms in 456 - 456 + 8i*2. 8i*2 Collect the terms in 32h*2 + 59 - 28 - 30. 32h*2 + 1 Collect the terms in -12n*2 + 14n*2 - 12n*2. -10n*2 Collect the terms in -6 + 8 - 10t*3 - 2. -10t*3 Collect the terms in -20o + 0o + 22o. 2o Collect the terms in -145 - 19j + 76 + 69. -19j Collect the terms in -4j + 5j3 + 2j*3 - 5j*3 + 6j*3. 8j*3 - 4j Collect the terms in 264y - 523y + 261y. 2y Collect the terms in -30p + 17p + 14p. p Collect the terms in -l - 4l + 0l + 8l - 2l. l Collect the terms in 11 + 3m*2 - 37m*2 - 11. -34m*2 Collect the terms in -3 + 3 - 107v*3. -107v**3 Collect the ter	{ "pile_set_name": "DM Mathematics" }
3 + 2f2 + f - 26. Calculate w(4). 1 Suppose 0 = 5x + 5f + 5, -x + 2x - 5f = -1. Suppose 0 = -2p + 5p - 6. Let i(o) = -1 + 3o + 0o + po + 0o. Calculate i(x). -6 Let y(x) = -11x*2 - 13x - 29. Let v(i) = -5i2 - 6i - 14. Let h(m) = -13v(m) + 6y(m). Calculate h(0). 8 Let l(d) = d*3 + 6d*2 + 6d + 4. Let w(o) = -o - 18. Let f be w(-13). Determine l(f). -1 Let n(j) = j*2 + 2j + 6. Suppose 2v + 7 = -3q + v, 2q + 4v = 12. Determine n(q). 14 Let b = -6 + 4. Let h = b - 1. Let f(k) = -k - 3k - 4 + 2k + 3k. Determine f(h). -7 Let y(z) be the second derivative of -z5/20 - z3/6 - 5z*2/2 - 6z. Calculate y(0). -5 Suppose -10 = 5a - 5c, -2a + a = c - 6. Let d(r) = ar*2 + 2 + 3r3 + r2 - 2r3. Determine d(-3). 2 Suppose -4g = -2g - 4. Let o(r) = r2 - gr*2 + 8 - 13 + 0r*2 - 6r. Give o(-4). 3 Let l(n) = -14n2 - 4n - 1. Let x(c) = -5c2 - c. Let z(t) = 6l(t) - 17x(t). Give z(8). 2 Let a(v) = v3 - 6v*2 - 7v + 2. Let m be a(7). Let f(x) = -5x - 1. Let o(u) = 5u. Let c(g) = mf(g) + 3o(g). Calculate c(2). 8 Let m = -6 + 7. Let i(p) = p - 1. What is i(m)? 0 Let i be (5(-3)/9)/((-6)/18). Let z(q) = 1 + 0q2 - q2 + 8q - 2q. Give z(i). 6 Let q(a) = 29a + 0a*3 - 2a2 + 1 - a3 + 2 - 26a. Calculate q(-3). 3 Let i(n) be the first derivative of -13n*2/2 - n + 11. Give i(-1). 12 Let w(l) = -2l + 5. Let n(q) = 3q - 8. Let y(a) = -5n(a) - 8w(a). Determine y(6). 6 Let q(m) = m + 1. Suppose 0 = s + 2g + 4 - 2, -4s + 5g = -18. Suppose -t + st + 4 = 0. Determine q(t). -3 Let s(p) = 13p - 5. Let y(z) = -20z + 8. Let m(u) = 8s(u) + 5y(u). Suppose -3f + 4t = -51, 0 = -t - 4t - 15. Let c = 11 - f. Determine m(c). -8 Let p = 85 + -81. Let m(x) = -x*2 + 7x - 7. Determine m(p). 5 Let o(d) = d*3 - 3d*2 - 2d - 2. Let n be (-3)/12 - (-63)/12. Suppose t + 1 - n = 0. Determine o(t). 6 Let m(v) = -v - 11. Suppose 0 = -l - 5 - 1. Calculate m(l). -5 Let x be 3(4/(-6) - 0). Let c(l) be the third derivative of l6/120 + l5/20 + l4/24 + l2 + 3l. Calculate c(x). 2 Let j(v) = 5v2 - 11 + 1 - 2v + 7 + 4 - v*3. Give j(4). 9 Suppose -4z - 17 = -5t, 2z - t = -z - 10. Let o(v) = -2v + v + 5 - 4. Calculate o(z). 4 Let g(v) = -2v*2 + 9v - 7. Let q(f) = f*2 - f - 1. Let d(w) = -g(w) - q(w). Calculate d(7). 1 Let x(q) = -2q + 8. Let t = -13 - -3. Let w = -4 - t. Give x(w). -4 Let z be (-1 + -2)/12-4. Let y(k) = -k3 - 1. Let o be y(z). Let d(l) = l3 + l2 - 3l - 1. What is d(o)? 1 Suppose -v = -0v - 3y - 7, 0 = -4v - 4y + 12. Suppose va = a + 21. Let d(k) = 2k - 5. Give d(a). 9 Let c(w) be the second derivative of w5/60 + w4/24 - w*3/2 + 5w*2/2 + 5w. Let h(v) be the first derivative of c(v). What is h(0)? -3 Let x(v) = 3v2 + v + 1. Let j(w) = -w2 - 5w - 1. Let a be j(-5). Calculate x(a). 3 Suppose -25 = -5d, d = 2h + 3d - 24. Let x(g) = g3 - 8g*2 + 5g + 10. Calculate x(h). -4 Let z(h) = 4h + 6. Let v(k) be the second derivative of -k4/12 - k3/2 - 2k*2 + 4k. Let b be v(-3). Determine z(b). -10 Let y(i) = -i3 + 3. Let n(j) = -j2 + 8j - 4. Let f be (-2)/((-2)/162). Let t be n(f). Let p be 10/25 + t/10. What is y(p)? 3 Let x(w) = -7w2 - 3w - w3 + 10 - w - 3. Let y be x(-6). Let n(k) = k3 + 6k2 + 6k - 3. Determine n(y). -8 Let h be (18/21)/(3/21). Let o = 4 - h. Let b(i) = -i*2 - 2i + 1. What is b(o)? 1 Suppose a + 2a = 21. Let s(w) = 4w*2 - 6w - 6. Let u(f) = -3f2 + 6f + 7. Let i(k) = -2s(k) - 3u(k). What is i(a)? -2 Let o(x) = x*3 + 5x*2 - x. Let t be o(-4). Suppose 5n = q - t, 2n = -5q + 3q + 4. Let j(k) = -3k - 4. Give j(n). 5 Let b = -10 - -10. Let w = 3 + -5. Let f(l) = l + 1. Let n(j) = -5j - 6. Let m(s) = wn(s) - 11f(s). What is m(b)? 1 Let t(p) = p + 6. Let k be t(-5). Let s be ((0 - k)/1)/1. Let w(q) = -1 - q2 - 5q3 + 0 + q3 + 3q2. Give w(s). 5 Let i(j) be the third derivative of j6/120 + j5/10 + 7j4/24 + j3/3 + 20j2. Let l = -4 - 1. Calculate i(l). -8 Let t(o) = -3o*2. Let b(q) = 4q*2 + q + 1. Let h(p) = 2b(p) + 3t(p). What is h(-4)? -22 Let d(t) = -7t - 10. Let m(b) = -3b - 5. Let s(x) = -2d(x) + 5m(x). Give s(-7). 2 Suppose 6l = 2l. Suppose l = 6j - j - 20. Let x(z) = j - 1 + 3z - 1. Give x(-2). -4 Let x(u) be the third derivative of u6/120 - u4/12 + u3/6 + 2u*2. Let g be (-28)/(-12) - 1/3. Calculate x(g). 5 Suppose 2y + 9 = -3o - 3, 2y + 4 = o. Let z(w) be the second derivative of w5/10 + w4/3 + 2w3/3 + 3w2/2 + w. Give z(o). -5 Let r(k) = -k3 - 2k2 + 4k + 1. Let f be r(-3). Let h(v) = -6v2 + 7v*2 - 3v - 2 - 4v2. Calculate h(f). -8 Let x(m) = -5m*3 + 8m + 2. Let l(i) = -i3 + i2 + i + 1. Let f(w) = 6l(w) - x(w). Calculate f(6). -8 Let s(u) = 0u + 0u + 8 - 9 - u2. Determine s(2). -5 Let a = 7 - 1. Let m(b) = -b - 7b*3 + 2b*3 + 0 + 3 + 4b*3 + 6b2. Give m(a). -3 Let l(b) = -b2 + b - 5. Let s be 3 + (2 - -1)-1. Calculate l(s). -5 Let o(n) = 2n. Let l be o(1). Let g(p) = -3p2 + 3p*2 - 6p - p*l - 7. Determine g(-5). -2 Let h(y) = y - 6. Let l be 0-4(-4)/32. What is h(l)? -6 Suppose -2n + 6n - 16 = 0. Let m(t) = -5t2 + t - 1. Let p(q) = -q2 - q. Let d(v) = -m(v) + 4p(v). Give d(n). -3 Let g be (-34)/(-5) + (-1)/(-5). Let z(w) = 2w - 7. Give z(g). 7 Let q = -36 + 42. Let f(l) = 3l - 9. Calculate f(q). 9 Let h be (-1)/(-1 + 2/4). Suppose -2y + hl + 1 + 7 = 0, -y + 2l = -6. Let p(o) = -2o + 2o + 3o - 1 - yo. Determine p(1). 0 Let a(d) = -d + 3. Let k be (-4)/(-6)(13 - 1). Suppose k = -3p - 4. Let v be p/22 + (-10)/(-55). Give a(v). 3 Let l(o) be the second derivative of o*3/6 - 11o*2/2 + 2o + 10. Calculate l(11). 0 Let k(a) be the first derivative of -a7/84 - a6/360 + a5/120 + a4/24 - 4a3/3 - 4. Let w(s) be the third derivative of k(s). Calculate w(-1). 9 Let x(c) = c2 + c + 2. Let l be 5(-1 + 14/10). Give x(l). 8 Let q = 10 + -15. Let s(l) = -4l2 - l + 3. Let i(d) = d2 - d + 1. Let h(c) = 3i(c) + s(c). Calculate h(q). 1 Let x(o) be the first derivative of o*3/3 + 2o*2 + 3o - 1. Suppose -2k = 3n - 6 - 12, -4k + 30 = 3n. Let u = -11 + k. What is x(u)? 8 Let x(w) = -10w2 - 6w + 9. Let j(a) = -7a2 - 4a + 6. Let m(c) = -7j(c) + 5x(c). Let s(k) = k*3 - 4k*2 + 3k - 1. Let z be s(2). What is m(z)? 0 Let z be (-1 + 5)/(-2) - 3. Let q(c) = c*3 + 5c*2 + 2c + 6. Let b be q(z). Let r = -8 - b. Let y(l) = l*2 + 2l + 2. Determine y(r). 10 Let s(y) be the first derivative of -1/2y2 + 2 + 7y. Calculate s(6). 1 Let v be -2 + 18/2 - (-9)/(-3). Let w(g) = -g*3 + 5g*2 - 3g - 1. Give w(v). 3 Let y(s) = s*3 - 7s*2 + 8s - 8. Suppose 20 = 4z + z. Suppose -5h + zd = -50, 2h + 0h - 17 = d. Give y(h). 4 Suppose 19 = 3d + 1. Let v(t) = -t + 8. Calculate v(d). 2 Let k(c) = c + 3. Let q(t) = t*2 + 7t + 6. Let f be q(-4). Give k(f). -3 Suppose 0 = 26k - 29k + 3. Let g(y) = 2y3 + 2y*2 - 2y + 1. What is g(k)? 3 Let w(d) = -d*3 - 6d*2 - 3d + 4. Suppose -y + 2j + 1 = 0, -3j = -3y - 0y - 6. Calculate w(y). -6 Let c(y) = -y*3 - 5y*2 + 4y - 2. Suppose 5m = 4i + 29, m - 6m = -i - 11. Calculate c(i). 10 Let w = -1 - 3. Let u be (-28)/(-10) + (-2)/(-10). Let n = u + w. Let y(x) = -10x - 1. Calculate y(n). 9 Suppose 0 = 3d + 26d - 145. Let u(v) = v - 6. Let g = 12 + -1. Let l(n) = 5n - 30. Let m(b) = gu(b) - 2l(b). Calculate m(d). -1 Let w(n) = 2n*2 - 5n + 6. Let p be w(2). Let t(a) = -a*2 + 5. Calculate t(p). -11 Suppose 2h + 2h - 3q + 25 = 0, 2h - 2q + 14 = 0. Let y(a) = 1 + 3a + 12a*2 - 13a*2 - 5a. Determine y(h). -7 Let k(g) = 2g3 + 12g*2 - 3g - 11. Let r be k(-6). Let u(s) = -3s + 3. Give u(r). -18 Let w(y) = y + 2. Suppose 0 = 5q + 1 + 19. Give w(q). -2 Let w(a) be the third derivative of a*2 + 0a + 0 + 11/6a3 + 1/20a*5 - 5/12a*4. Let p(x) = 2x*2 - 5x + 6. Let u(i) = 5p(i) - 3w(i). Give u(-4). -7 Let c(s) = -257s - s2 + 4 - 15 + 257s. Give c(0). -11 Let y be 2/1(-1 - -2). Let j(g) = -g2 + 2g - 1. Determine j(y). -1 Let t(l) = 2l3 - 3l2 - 2. Let j(n) be the first derivative of -n4/4 + n*3/3 + n - 2. Let y(d) = 5j(d) + 2*t(d). Determine y(1). -1 Let b = -	{ "pile_set_name": "DM Mathematics" }
= -733/3 + 240. Let j = h + c. What is the second biggest value in 4, j, 2? 2 Let s = 186 - 180. Let i be (0/(-2) - -1) + -46. Let u be (-9)/s12/i. What is the second biggest value in -4, u, -0.2? -0.2 Suppose -18 = -5m + 12. Suppose -7r - m = -r. Let l = -3 - -4. Which is the second smallest value? (a) r (b) l (c) -2/5 c Let g be (-25984)/(-2560) - 20/2. What is the second smallest value in 0.2, -54, g? g Let t = -62 + 57. Let d be 0 + 1 - 1-4. Which is the second biggest value? (a) t (b) d (c) -0.03 c Let q = 42.1 + -41.8. Let b = 0.14 + -0.07. What is the biggest value in b, -2, q, -4? q Let f = -14.61 - -10.61. Which is the smallest value? (a) f (b) 16/11 (c) -1 (d) 0 a Suppose -14 = -57p + 64p. What is the fourth biggest value in -2/9, 2/5, -1, p? p Let t(i) = -11i + 30. Let k be t(3). Let f be 5/(-3 + 2 + 2). Which is the second smallest value? (a) -1 (b) f (c) k a Let u(n) = -n3 - 8n*2 + 15n - 46. Let q be u(-10). Which is the biggest value? (a) -0.4 (b) q (c) 799 c Let w = 33 + -15. Let l = -18 + w. Which is the smallest value? (a) l (b) -2/7 (c) -5 c Suppose -3 = 8q + 37. Let l be -21(q/(-1))/(-10). What is the third smallest value in l, -2, -0.08? l Let n = 148.4 - 148. What is the biggest value in 2/3, 5, n? 5 Let s = -3146 - -47188/15. Let q be (-5 + 4)(1 - 4). Which is the second biggest value? (a) q (b) 8 (c) s (d) 0 a Let q = -2322 - -183435/79. What is the biggest value in 1/3, -5, q? 1/3 Let p be 45/232 + 146/(-1168). Let t = 2 + -6. Which is the second biggest value? (a) p (b) -0.4 (c) t (d) 3 a Let h be 1(0 - 36/9). Let w be (6/10)/((-8)/(-5)). Which is the second biggest value? (a) h (b) 1/4 (c) w (d) -5/8 b Let l = 0.212 - 0.412. Which is the fourth smallest value? (a) l (b) 0.3 (c) -3 (d) -2.2 b Let h = -739/5 - -148. Which is the second smallest value? (a) -5 (b) -2 (c) 2 (d) h b Let o = 0.01 + 0.29. Let v be 108/120 + (-6)/15. What is the biggest value in 0.2, v, o? v Suppose -115z + 44 = -126z. What is the third biggest value in 7, z, 1? z Suppose -3g + 2j = -8, 3j = 3g + g - 11. What is the fourth smallest value in 22, 0.3, -1, g? 22 Let x = -0.2 + 0.6. Let y = 0.00569 + -0.20569. Which is the third biggest value? (a) -0.5 (b) x (c) y (d) 1 c Let f be (1 - 1) + 3-1. Let s = 1027 - 1027.5. What is the third smallest value in s, f, -0.2, 4? -0.2 Let p be 0(-4 - 1)/10. Which is the third biggest value? (a) -0.83 (b) p (c) 1/4 a Let x = 0.156 + 3.844. Which is the second smallest value? (a) x (b) -1/3 (c) -92 b Suppose 0o + 2o = -3p - 1, -5p = o + 11. Let t be (-6 + o)6/60. Which is the smallest value? (a) 2 (b) t (c) 0.06 b Let x = 18.3 + -18.306. What is the third smallest value in 5, x, 0.3? 5 Let z be 50/(-126) + (-2)/(-7). Let y = -80 + 99. Let l = y + -19.1. Which is the biggest value? (a) z (b) 1 (c) l b Suppose -129 + 149 = -20w. What is the third smallest value in -2/7, w, 560? 560 Let b = 0.11 - -3.89. Let t = -844.4 - -844. What is the second biggest value in -5, b, t? t Let w = 1597 - 1602. What is the second smallest value in w, -14/3, 0.2? -14/3 Let i = 0.701 - 0.67. Let n = i + 0.269. Which is the second biggest value? (a) 4 (b) n (c) -0.1 b Let z = -30.5 + 30.5. What is the biggest value in -2, -3/4, 0.03, z? 0.03 Let v = 965.6 + -966. What is the smallest value in 1, 24, v? v Let t be 0 + -3 - 152/(-56). Suppose -5l = 4h - 44 + 11, -16 = -2l - 3h. What is the second smallest value in t, l, -8? t Let q = -1.07 + -0.33. Let t = q - -1.8. Which is the third smallest value? (a) t (b) 2 (c) 1/2 b Let s be -2(45/6 - 0). Let y be (-8)/10 - 6/s. Suppose -2j + 10 = 3j. What is the second smallest value in j, y, 1? 1 Let o be (-1)/(-4) + 0/(-2). Let p = -16148/23 + 702. Which is the third smallest value? (a) p (b) o (c) -1 b Let m = -20.59 + 20.35. What is the third smallest value in -5, m, -2? m Let u = -1691 - -11815/7. What is the biggest value in 2, u, 4? 4 Let o = 9.4 + -9. Let f = 415 - 414. What is the second biggest value in f, 3, o? f Let u be (5/1)/(2 - 1). Let c be (-4 + 6)u/105. Let o be (2/(-12))/(3/12). What is the third biggest value in o, -8, c? -8 Let m = -0.5 + -1.5. Let s = 1457 - 1460. What is the biggest value in s, m, -1/3? -1/3 Let a = 11.2 - 11.253. Let q = 0.017 - a. What is the fourth biggest value in -3/7, 0.4, q, 1/2? -3/7 Let z(q) = -2q*2 - 12q - 20. Let g be z(-4). Which is the biggest value? (a) 1/9 (b) 4 (c) -1 (d) g b Let j = -33 - -32.5. Let w = 5.5 + j. Which is the third biggest value? (a) -5/6 (b) w (c) 2/5 a Let k = 17.64 - 18. Let z = 0.4 + k. Let o be -2 + 2 + 8/(-52). What is the second smallest value in o, z, 4? z Let q = -0.1 + 0.1. Let y be (1/4)/(15/(-5) + 4). Which is the second smallest value? (a) q (b) -3/14 (c) y a Let h be (-6)/15 + 2/30. Let w be (0/1)/(7 + (-48)/6). Which is the biggest value? (a) -2/9 (b) h (c) w c Let m = 0.00831 - -0.39169. Let t be 0 + 2(-1)/(-22). What is the second smallest value in 3, t, -3, m? t Let z = -0.7 + -0.3. Let u = z - -0.5. Let q = -29509/9 - -3279. Which is the second smallest value? (a) u (b) q (c) -1/6 c Suppose 21 = n + 4r, 21 = 28n - 27n + 2r. What is the third smallest value in -0.5, 0, n? n Let c be (104/12 - 4)4/(-14). Let d(y) = -y*3 + 2y*2 + 4y + 18. Let h be d(4). Let g = -0.2 - -0.1. What is the second biggest value in h, g, c? g Let y = -129.6 - -130. Suppose 4z - 4 - 8 = 0. What is the third biggest value in -5/3, z, y? -5/3 Let y = -1 - -1. Let t = 108 + -112. Let w = t - y. Which is the second biggest value? (a) -5 (b) w (c) 3 b Let s = 2.7 - 4. Let k = -1.1 - s. What is the second smallest value in -2/3, k, -4? -2/3 Let w = -592.1 - -618. Let u = 26 - w. Let z be 0 - (-1 - (-2)/4). Which is the second biggest value? (a) z (b) u (c) -4 b Let i = 1 + 2. Suppose 3m - i = 9. Suppose -t = l - 4 - 2, 2l - 5t = -9. What is the third smallest value in -0.5, l, m? m Let m = 1077 - 1075. Which is the third smallest value? (a) -19/2 (b) 1/4 (c) m c Suppose 13o + 527 + 526 = 0. Let x = -86 - o. What is the third smallest value in 3/2, 5, x? 5 Let r = 59 + -55.94. Let x = 3 - r. Let l = x + 0.56. What is the second biggest value in l, -1, 1/6? 1/6 Let l = 0.5 + -0.1. Let g = 0.41416 - 0.11416. What is the biggest value in g, 2/13, l? l Let q = 0.33 - -16.67. Let f = 17.02 - q. Let p = -2.6 - -2.3. What is the second smallest value in f, 0, p? 0 Let p = -1259.6 - -1260. Which is the fourth smallest value? (a) -5 (b) 5 (c) -10 (d) p b Let t = 6 + -5.9. Let l = 6.32 + -1.02. Let z = l + -5. Which is the third smallest value? (a) z (b) -2 (c) t a Let i be -4(57/12 - 4) - 0. Let s be (i/(-6))/((-3)/(12/(-70))). Which is the third smallest value? (a) 5 (b) s (c) 2 a Suppose 0 = 4n - 2j + 28, -4n + 5j = j + 32. Let z = -1476/7 - -211. Let h = 0.5 - 0.7. Which is the biggest value? (a) n (b) h (c) z c Let c be (-26)/91 + (-3424)/70. Let d = 49 + c. Let l be 20/70 - (-2)/(-7). What is the second smallest value in d, 1/7, l? l Let j = 0.507 - 0.207. Which is the third smallest value? (a) -3.2 (b) j (c) 2 c Let m = 404.8 + -405. Which is the third biggest value? (a) -3 (b) -4/7 (c) m a Let s = -11 + 10.92. Let t = 31/26 + -9/13. Which is the smallest value? (a) s (b) -4 (c) t b Let p = -0.07 - 11.93. Let x = 8 + p. What is the smallest value in x, 0.6, 2? x Let n be (-3)/28/(-6). Let k be (-3)/1264/80. Which is the fourth biggest value? (a) k (b) n (c) -4 (d) 1/2 c Let w = -89.4 + 88.4. What is the smallest value in 2, w, 1/8? w Let g = 2 + -2.02. Let p = 74 - 73.5. Suppose -31z + 33z = 6. Which is the third biggest value? (a) p (b) z (c) g c Let u = 106 - 107. Which is the smallest value? (a) u (b) 0.069 (c) -0.4 a Let v = 925 - 923. What is the third smallest value in v, 1/13, -5? v Let k = 1595/24 - 199/3. Let s be 12/24. Let d = 22 - 89/4. Which is the biggest value? (a) s (b) k (c) d a Let y = -9 + 44. Let f be ((-20)/y)/((-15)/21). What is the third smallest value in f, 0.5, -2, 2/15? 0.5 Let a = -9 + 10. Let w = -365 + 370. What is the second smallest value in 2/11, a, w, -3/4? 2/11 Let q be 1-1(-2 - 1). Let o = -2.48 + 0.08. Let v =	{ "pile_set_name": "DM Mathematics" }
years are there in twenty-nine halves of a century? 1450 What is nine tenths of a millimeter in micrometers? 900 What is 402.7257 litres in millilitres? 402725.7 What is 0.2582914 kilometers in meters? 258.2914 What is 12/25 of a kilometer in meters? 480 What is thirteen fifths of a century in decades? 26 What is 742610.3 meters in micrometers? 742610300000 What is 2457524.79 minutes in weeks? 243.8020625 What is 44/5 of a gram in milligrams? 8800 How many seconds are there in 0.3718093 weeks? 224870.26464 Convert 92.70327 meters to kilometers. 0.09270327 What is 3/8 of a millimeter in micrometers? 375 How many seconds are there in 30352.24 nanoseconds? 0.00003035224 What is 37948.59 millennia in years? 37948590 How many grams are there in 6/25 of a kilogram? 240 What is 4190.235 months in years? 349.18625 What is 2.828679 millilitres in litres? 0.002828679 What is 1/10 of a centimeter in micrometers? 1000 What is 1.103673 hours in days? 0.045986375 What is 17/4 of a decade in months? 510 How many millilitres are there in 93/4 of a litre? 23250 How many millennia are there in 284255.34 months? 23.687945 How many tonnes are there in 68.43617g? 0.00006843617 How many meters are there in 3/40 of a kilometer? 75 What is 5.639946 minutes in microseconds? 338396760 What is twenty-one halves of a kilometer in meters? 10500 How many centimeters are there in 1/5 of a kilometer? 20000 How many milligrams are there in 6/25 of a gram? 240 What is 4.750393 years in months? 57.004716 How many months are there in 47.3385 decades? 5680.62 How many nanoseconds are there in 28753.3us? 28753300 What is nine tenths of a hour in minutes? 54 What is 44/5 of a decade in months? 1056 How many grams are there in 0.8394283kg? 839.4283 What is four fifteenths of a decade in months? 32 What is 53.6824 grams in tonnes? 0.0000536824 What is 699677.5nm in micrometers? 699.6775 Convert 2.646336 millilitres to litres. 0.002646336 What is 92.76171 hours in milliseconds? 333942156 How many litres are there in 27511.5 millilitres? 27.5115 What is 505406.8 decades in centuries? 50540.68 How many weeks are there in 32335140.6ms? 0.0534641875 How many milliseconds are there in twenty-five quarters of a second? 6250 What is 759829.2 days in milliseconds? 65649242880000 Convert 3797.999 micrometers to nanometers. 3797999 Convert 8.608444 years to centuries. 0.08608444 What is one twentieth of a millimeter in nanometers? 50000 What is five quarters of a kilogram in grams? 1250 Convert 98.91497l to millilitres. 98914.97 Convert 79142.77 millennia to centuries. 791427.7 What is 151931.22 months in millennia? 12.660935 What is 3/8 of a milligram in micrograms? 375 How many tonnes are there in 538058.8mg? 0.0005380588 How many months are there in nineteen quarters of a millennium? 57000 What is 0.786154 centimeters in kilometers? 0.00000786154 What is 58/3 of a hour in seconds? 69600 How many kilograms are there in seven eighths of a tonne? 875 What is six fifths of a milligram in micrograms? 1200 What is six fifths of a litre in millilitres? 1200 Convert 4.748818 millimeters to nanometers. 4748818 How many years are there in 3/25 of a century? 12 What is 1/20 of a kilometer in meters? 50 How many months are there in 823444.7 millennia? 9881336400 What is eleven halves of a litre in millilitres? 5500 How many days are there in 828.59481 minutes? 0.5754130625 Convert 7964.553nm to meters. 0.000007964553 What is 13/8 of a millimeter in micrometers? 1625 What is twenty-nine fifths of a milligram in micrograms? 5800 How many millilitres are there in 0.357064 litres? 357.064 What is 25/4 of a kilometer in meters? 6250 How many milligrams are there in 11/8 of a gram? 1375 How many grams are there in eleven quarters of a kilogram? 2750 What is fifty-seven fifths of a gram in milligrams? 11400 How many meters are there in nine tenths of a kilometer? 900 How many micrometers are there in one quarter of a millimeter? 250 How many millimeters are there in 0.9661998 centimeters? 9.661998 What is 37/2 of a century in years? 1850 How many milligrams are there in 6/5 of a gram? 1200 What is 3/50 of a millennium in decades? 6 How many decades are there in 6.51914 years? 0.651914 What is 5.537165ug in tonnes? 0.000000000005537165 What is 30075.9g in nanograms? 30075900000000 How many years are there in 5/4 of a century? 125 What is one fifth of a milligram in micrograms? 200 How many litres are there in 38225.44 millilitres? 38.22544 What is nineteen quarters of a micrometer in nanometers? 4750 What is 11/8 of a millennium in years? 1375 What is 0.4481067 millilitres in litres? 0.0004481067 How many milliseconds are there in 1/6 of a minute? 10000 Convert 882711.9 millilitres to litres. 882.7119 Convert 16.280259 months to millennia. 0.00135668825 How many milliseconds are there in 1/5 of a minute? 12000 What is 3/50 of a second in microseconds? 60000 How many years are there in thirty-seven fifths of a decade? 74 Convert 5248.278ms to seconds. 5.248278 How many tonnes are there in 4.609437 kilograms? 0.004609437 What is thirteen quarters of a kilometer in meters? 3250 What is eight sevenths of a week in hours? 192 How many centimeters are there in 5.47601m? 547.601 How many weeks are there in 4997309.31ns? 0.000000008262746875 What is 6/5 of a meter in centimeters? 120 How many minutes are there in 3/10 of a hour? 18 Convert 2.828717nm to centimeters. 0.0000002828717 How many years are there in 85.92064 millennia? 85920.64 How many days are there in 0.9117756 weeks? 6.3824292 What is 0.7237788 tonnes in milligrams? 723778800 Convert 3.138514 nanoseconds to milliseconds. 0.000003138514 How many months are there in twenty-one halves of a decade? 1260 What is three eighths of a litre in millilitres? 375 How many centuries are there in 22710.099 months? 18.9250825 How many grams are there in 11/2 of a kilogram? 5500 How many micrograms are there in three fifths of a milligram? 600 Convert 47.12069 micrometers to nanometers. 47120.69 Convert 0.7289838 litres to millilitres. 728.9838 What is 3/8 of a kilometer in meters? 375 What is 6/5 of a litre in millilitres? 1200 Convert 9696.15 millennia to decades. 969615 How many centimeters are there in 902431.4m? 90243140 Convert 1551656.4 months to decades. 12930.47 What is 705185.6 centimeters in micrometers? 7051856000 What is 15.98023 millennia in months? 191762.76 Convert 33905.02 nanograms to tonnes. 0.00000000003390502 What is seventy-two fifths of a meter in centimeters? 1440 Convert 4.679371g to nanograms. 4679371000 What is 2565.92 milligrams in grams? 2.56592 How many micrograms are there in 408.325 nanograms? 0.408325 What is 31/5 of a litre in millilitres? 6200 Convert 27.4846 millennia to years. 27484.6 How many millimeters are there in 32/5 of a centimeter? 64 What is 410069.79 nanoseconds in hours? 0.000000113908275 What is 0.0689495 litres in millilitres? 68.9495 How many nanograms are there in 15.33556mg? 15335560 What is thirteen eighths of a microgram in nanograms? 1625 How many micrograms are there in one tenth of a gram? 100000 What is 51/5 of a decade in years? 102 How many decades are there in eleven halves of a millennium? 550 What is four sevenths of a week in minutes? 5760 Convert 46.2537 months to decades. 0.3854475 Convert 0.673008m to millimeters. 673.008 What is nineteen quarters of a meter in millimeters? 4750 What is 6/5 of a centimeter in micrometers? 12000 How many months are there in 7/6 of a millennium? 14000 What is 0.6496385mm in meters? 0.0006496385 What is 1/15 of a day in seconds? 5760 How many minutes are there in 1/28 of a week? 360 How many nanometers are there in five eighths of a micrometer? 625 How many millilitres are there in 1/5 of a litre? 200 What is fifteen sixteenths of a minute in milliseconds? 56250 How many kilometers are there in 5647.572nm? 0.000000005647572 How many millennia are there in 0.2272604 centuries? 0.02272604 Convert 1.38857ml to litres. 0.00138857 How many milliseconds are there in 0.4546057ns? 0.0000004546057 How many millimeters are there in 974108.3 kilometers? 974108300000 What is 6/5 of a litre in millilitres? 1200 What is 1/4 of a meter in centimeters? 25 How many grams are there in 2	{ "pile_set_name": "DM Mathematics" }
is the closest to 0.155 in -0.1, -3/8, -3/4, 3, -4? -0.1 What is the nearest to 2/13 in 1/8, 0.03, 0.06, -0.3, -7/4? 1/8 What is the closest to -2 in 0.1, -2/15, 0, 29.8, 7/19? -2/15 What is the nearest to -2 in 0.04, 21/10, 0.1? 0.04 What is the closest to 8 in -1/2, -0.3, 1/3, 10, -0.6? 10 Which is the closest to -18? (a) 0.4 (b) -1 (c) 112/5 b What is the nearest to 0.1 in -0.2, -5, -774, 3? -0.2 Which is the nearest to -12? (a) -3/4 (b) 3 (c) -4/3 (d) -0.3 (e) -17/98 c Which is the nearest to 21? (a) 0.4 (b) -111 (c) -2 (d) -1/2 a Which is the nearest to 1.5? (a) 38 (b) 0.7 (c) 12 b What is the closest to -25 in -5, 794, 4/3, 5, 3? -5 Which is the closest to 0? (a) -6 (b) -2 (c) -253 (d) 3 (e) -0.1 e Which is the nearest to -2? (a) -4 (b) -1/4 (c) -0.06 (d) -3/47 (e) 22 b Which is the closest to 0? (a) 1 (b) -3 (c) 4 (d) 1/9 (e) 1311 d Which is the nearest to -2/5? (a) 243 (b) -2 (c) -12 (d) 0.03 d Which is the closest to -1? (a) -67 (b) 0.2 (c) 0 (d) 4/3 (e) -1/4 e What is the closest to 2/5 in -0.34, 4, 8391, -0.4? -0.34 What is the nearest to -3 in -0.0198, 4, 0.4, -0.4? -0.4 Which is the closest to -1? (a) 108/71 (b) 1/3 (c) 0.4 (d) -4 b Which is the closest to 0.4? (a) -2/3 (b) -47372 (c) -1/8 c What is the closest to -5 in 0.1, -0.26, -32, -2/71? -0.26 What is the closest to -14 in -21, -0.54, -5? -21 Which is the closest to 1.1? (a) -0.1 (b) 0 (c) -1/9 (d) -2 b What is the nearest to -2 in -1, -26, 0.6? -1 What is the nearest to 0.2 in -2/15, -1/3, -1/2, 3/47? 3/47 What is the closest to -4 in -3, 5, 3, -5810? -3 What is the nearest to 0.1 in -0.046, -1.6, -0.4, 2? -0.046 What is the nearest to -0.12 in -0.7, -0.5, 4/13? -0.5 What is the nearest to 21 in 1/6, -4/3, -6, 4? 4 Which is the nearest to -5? (a) 0.2 (b) 43 (c) 26 (d) -3/7 (e) -0.2 d What is the closest to 0.1 in -0.2, 0.2, 33, 35, 2/7? 0.2 Which is the closest to 0? (a) -0.28 (b) -386 (c) 6 a What is the closest to 32/7 in -2, 25/7, 5, 3, 0.2? 5 What is the closest to 281 in 1, 0.3, -10/7? 1 What is the nearest to 2 in 1, 2/15, 0.11, -2/3, -9? 1 Which is the closest to -198? (a) 0 (b) -14 (c) -2 (d) -1 (e) -5 b Which is the nearest to 1? (a) -18831 (b) -0.1 (c) -0.4 b Which is the closest to -1.8? (a) 3/2 (b) -2249 (c) 3 (d) 4/7 (e) 5 d What is the nearest to -10.69 in 0.1, -4/5, 1/3, 0.4? -4/5 What is the closest to 0 in -0.1, -1, -34477? -0.1 What is the closest to 16 in -0.1, 205, 4, -2/9, -2? 4 What is the nearest to 8 in 0.4, 0.176, -1/2, -2/19? 0.4 What is the closest to 1/3 in 1/2, -23, -0.5, -32/7? 1/2 Which is the nearest to 15? (a) -1 (b) 0 (c) -3 (d) -3/73 b What is the nearest to 1 in -4, -0.72, 5, -0.4, 0.2? 0.2 What is the nearest to -1/2 in -7, -15, -2, 201? -2 What is the nearest to -2 in 0.3, 1, -67, 9? 0.3 Which is the closest to 0.1? (a) -3 (b) 4/7 (c) 354 (d) 4 b What is the closest to 1 in -19, 2, 68, -2? 2 What is the closest to 0.1 in -4/9, 0.9, 0.12, 0.4? 0.12 What is the nearest to 1 in -1, 0.13, 5, 6, 0.3? 0.3 Which is the nearest to -1/2? (a) 1 (b) -1.9943 (c) 0.1 c Which is the nearest to -2? (a) 13/3 (b) -1.7 (c) 0.1 (d) -4 b Which is the nearest to -0.1? (a) -4.9 (b) 2/5 (c) -1/2 (d) -2/7 (e) -2/11 e What is the nearest to 2 in -2/47, 5, -4.9? -2/47 What is the closest to 1.5 in -0.5, -66, 4? -0.5 Which is the closest to -1/4? (a) 4 (b) 1 (c) 47.781 b Which is the nearest to -17? (a) -6/11 (b) 2 (c) 56 a What is the nearest to 8 in -1/3, 1/8, -0.4, 8/75? 1/8 Which is the nearest to 9/19? (a) -4 (b) -12 (c) 0.7 c What is the closest to 992/5 in -3/5, 3, 1, -0.3? 3 What is the closest to 6187 in 1/5, 4, 5? 5 What is the closest to -3 in -2/5, -12, 10, 20? -2/5 What is the closest to 0.03 in 13, 82, -0.18? -0.18 What is the closest to -10 in 1, -27, 4, 0.2, -3? -3 What is the nearest to 41 in 60, -2/9, -5? 60 Which is the nearest to 0.2? (a) 582 (b) 0.2 (c) -2 b What is the closest to 4 in -59, -3/5, -0.3, 5? 5 Which is the nearest to -727? (a) 0 (b) 1/4 (c) 0.4 (d) 4 (e) 3/8 a What is the nearest to -257 in 1, -1/3, 0.3, -1, -2/61? -1 What is the nearest to 4 in 0.2, 2, -2, -29.2, -0.01? 2 What is the closest to 1.3 in 0.7, 29, -7, -3/4, 2/7? 0.7 Which is the closest to 0.13? (a) 0 (b) -0.4 (c) 2/43 c What is the closest to 7/10 in 2/9, -1/6, -5/3, -1/4? 2/9 What is the nearest to -0.2 in 2/11, 2/7, -20/137, -4, -1? -20/137 What is the nearest to 3/5 in 53, 3/7, -0.06? 3/7 Which is the closest to -724? (a) 2 (b) -3 (c) 4 (d) 0.1 b What is the nearest to 3 in 2/13, -7, -0.1, 34? 2/13 What is the closest to 1.2 in 2, -1/3, 54, -5? 2 What is the nearest to 1/3 in 5, 3/7, 1/8, 31/3, 3? 3/7 What is the nearest to -1378 in -1/3, -1/4, -0.02, -0.3? -1/3 Which is the closest to -751? (a) -0.1 (b) -3 (c) 1/3 (d) -0.3 b What is the nearest to 2/3 in 2/27, -10/177, 22, -1/9, 4? 2/27 Which is the closest to 0.1? (a) -626/7 (b) 17 (c) -3/2 c What is the closest to 2/7 in -4, 2.35, 2/13? 2/13 Which is the nearest to 1? (a) -1 (b) 0.3 (c) 5 (d) 2/107 (e) -2/1663 b What is the nearest to -1.69 in 3, 0.1, 76/5? 0.1 Which is the closest to 1? (a) 0.67 (b) -0.28 (c) 2 a Which is the nearest to -2? (a) -192 (b) 51/2 (c) 6 c What is the nearest to 0.06 in 127, -135/2, -4? -4 What is the closest to 1 in 9, 2/13, 91/5? 2/13 Which is the nearest to -1/3? (a) -1 (b) 1 (c) 12/47 c What is the closest to 0.4 in 0, -1/13, 4, 0.2, -0.2? 0.2 What is the nearest to -56/3 in -23, 0.4, -0.4, -0.5? -23 What is the nearest to 1 in 1/6, 1076, 2/21? 1/6 What is the closest to 0 in -8.64, 0.3, -3? 0.3 What is the closest to -1 in -2/19, 0.1, -2, 0.24, -8.8? -2/19 What is the closest to -0.1 in -480, -2, 21? -2 What is the nearest to -9 in 1/275, 0, -2, -6/7? -2 What is the closest to -4 in 4, 159, 0.08? 0.08 Which is the nearest to 0.1? (a) -7 (b) 1/3 (c) 6 (d) 1/10 d Which is the closest to -99949? (a) 1/2 (b) 0 (c) -1/6 (d) 5 (e) 0.2 c Which is the nearest to -1.3? (a) 3 (b) -1/12 (c) -0.4 (d) 1/6 c What is the nearest to 0 in 0.9, 5, 3, -4.9? 0.9 What is the nearest to 2.7 in -103, 0, 1/4? 1/4 What is the closest to -0.1 in 121, -3, -2/25? -2/25 What is the nearest to -0.8 in 1, -2, -6, -228, 5? -2 What is the nearest to 2 in -417, 5, -5, -3? 5 What is the nearest to -1.2 in 22.4, 4, 22/5? 4 Which is the closest to -0.7? (a) -0.2 (b) 17/3 (c) -3 (d) 0.5 a What is the closest to -2/9 in 434, -0.06, 0.2? -0.06 What is the closest to 46 in -6, -2/19, 0.2, -11? 0.2 Which is the nearest to -10/7? (a) 66 (b) 2/3 (c) -1/4 (d) 0.5 c Which is the nearest to 0.5? (a) 2 (b) 7/2 (c) 37 (d) -3 a What is the closest to 0 in 0.11, 0.25, -6/11, 3/23, -0.3? 0.11 What is the closest to -0.14 in 296, -0.1, -1/6, 4, -2/9? -1/6 What is the closest to -1 in 1/19, -0.3, 1, 2/179? -0.3 Which is the closest to 0.33? (a) -2 (b) 13010/11 (c) -4/3 c What is the closest to 0.1 in 57, 5, 166? 5 Which is the closest to 1? (a) 12 (b) 1/6 (c) 0.38 (d) 2/7 c What is the closest to -2/11 in 21.1, -4/11, 2, -2/79? -2/79 Which is the nearest to -2/7? (a) -1 (b) -2/5 (c) -81149 b What is the closest to -101 in 37, -3, 0.1, 1? -3 Which is the closest to -0.2? (a) 0.5 (b) 4/3 (c) 140 (d) -0.1 (e) -1/5 e Which is the nearest to 1? (a) 3 (b) -4 (c) 0.26 (d) -3/23 (e) -0.05 c Which is the closest to -0.288? (a) -8 (b) 2.6 (c) 0.5 c Which is the nearest to -2? (a) -9/8 (b) -4 (c) -2 (d) 1/2 c Which is the closest to -2/47? (a) -0.9 (b) 3 (c) -13 a What is the nearest to 0.1 in -245, 0.02, -11? 0.02 Which is the nearest to -123? (a) -0.2 (b) -12 (c) 1/6 (d) -4 b Which is the closest to -0.2? (a) 10 (b) -2/81 (c) 24 b Which is the nearest to -2? (a) -5 (b) 0.2 (c) -0.24 (d) -2/19 (e) 34 c Which is the closest to 15/8? (a) -0.3 (b) 1/18 (c) -0.72 b Which is the nearest to 7? (a) 166 (b) -0.4 (c) -9/10 (d) -2/9 d What is the nearest to 0.0318 in -0.4, -0.3, -2/7, 0, -16? 0 Which is the nearest to 25? (a) -2/45 (b) -6 (c) 0.5 (d) 1/9 c Which is the nearest to -1? (a) 7214 (b) 10 (c) -5 (d) -0.2 d Which is the closest to -1? (a) -0.7 (b) -120/11 (c) 2 a What is the nearest to -534 in 0.11, 1, 5/2? 0.11 Wha	{ "pile_set_name": "DM Mathematics" }
-546sqrt(19) + 4599 Simplify ((3sqrt(77)-1)/sqrt(11) + sqrt(567)-2 + (sqrt(70) - (-1sqrt(70) - sqrt(70)))/sqrt(10))2. 2268 Simplify -2sqrt(17) + -5 + 5(sqrt(17) + 1). 3sqrt(17) Simplify (0 + sqrt(252))-1. -6sqrt(7) Simplify -2 + sqrt(272)-3 + -2. -12sqrt(17) - 4 Simplify sqrt(5) + sqrt(45) + 0 + 5. 5 + 4sqrt(5) Simplify (-33(-3 + sqrt(1700)))2. -4860sqrt(17) + 138429 Simplify (4sqrt(170))/sqrt(10)-4. -16sqrt(17) Simplify (-5 + sqrt(28)/(2sqrt(4)2))2. -5sqrt(7)/2 + 407/16 Simplify -5(0 + sqrt(500))3. -150sqrt(5) Simplify ((sqrt(612) + 1 + sqrt(612) - sqrt(612) - -1sqrt(272))2)2. 80sqrt(17) + 6804 Simplify (((sqrt(343)-2)/sqrt(7) - sqrt(49))/(sqrt(7) - 3sqrt(252)))*2. 63/289 Simplify -4 + (-2sqrt(4050))*2. 16196 Simplify 2 + sqrt(76)/((sqrt(28)/sqrt(7) + sqrt(4))-2 + sqrt(4)). -sqrt(19)/3 + 2 Simplify (-4 + sqrt(80)/(sqrt(10)1 + sqrt(10) + sqrt(10)))1. -4 + 2sqrt(2)/3 Simplify sqrt(704)1 + sqrt(11) + 6sqrt(176). 33sqrt(11) Simplify (5 + sqrt(156)/sqrt(12))4-4. -80 - 16sqrt(13) Simplify (2 + (sqrt(153) + -5)4)*2. -432sqrt(17) + 2772 Simplify (sqrt(44) + -4 + -1 + sqrt(44) + sqrt(44))*2. -60sqrt(11) + 421 Simplify -6(sqrt(2) + sqrt(10)/sqrt(5))3. -36sqrt(2) Simplify (0 + (2 + sqrt(242) - sqrt(242)) + -5)2. 9 Simplify (sqrt(8) + sqrt(96)/sqrt(108) + sqrt(8))/(sqrt(48)/(sqrt(24)/sqrt(2))). 7sqrt(2)/3 Simplify -5(sqrt(5) + 0) - 2sqrt(5)1. -7sqrt(5) Simplify (-4 + -4 + sqrt(5) + 4)1. -4 + sqrt(5) Simplify sqrt(85)/(sqrt(5)-2-2). sqrt(17)/4 Simplify (sqrt(5000)-2)/(sqrt(10) - -1sqrt(1000))-2. 40sqrt(5)/11 Simplify -2 + (sqrt(96)-6)/(2sqrt(1728)). -2 - sqrt(2)/2 Simplify 3 + (2 + sqrt(243))2. 36sqrt(3) + 250 Simplify 2(-1 + sqrt(153)) + -2. -4 + 6sqrt(17) Simplify 6(-1 + sqrt(13))2 + 2. -12sqrt(13) + 86 Simplify (sqrt(117)/sqrt(3)-6)/sqrt(3). -6sqrt(13) Simplify ((sqrt(180)1 - sqrt(180)) + 5 + 1)-3. -18 Simplify (sqrt(1872) - (sqrt(1872) - ((sqrt(1872) + 0 + -4 - sqrt(1872)) + sqrt(1872)))*2) + -4. -20 + 12sqrt(13) Simplify ((sqrt(588)-1 + sqrt(588) - sqrt(588)) + sqrt(12) - sqrt(12))/((sqrt(28) - sqrt(252))/sqrt(7)). 7sqrt(3)/2 Simplify ((2sqrt(66) + sqrt(66))/sqrt(6))2 + (sqrt(110)-2)/sqrt(10). -2sqrt(11) + 99 Simplify sqrt(119)/(sqrt(7) - sqrt(343))1. -sqrt(17)/6 Simplify (sqrt(2904)2)/(-6sqrt(72)). -11sqrt(3)/9 Simplify ((2 + sqrt(192)1 + sqrt(192))6)2. 2304sqrt(3) + 27792 Simplify 4sqrt(18)/(sqrt(9) + sqrt(225)). 2sqrt(2)/3 Simplify 3(1sqrt(72) + (sqrt(150)/sqrt(3))*2). 18sqrt(2) + 150 Simplify sqrt(704)3 - -3sqrt(704). 48sqrt(11) Simplify (sqrt(80) - (sqrt(80) - (1 + (sqrt(80) + 0 - sqrt(80) - sqrt(80))))) + -3. -4sqrt(5) - 2 Simplify (4sqrt(264)/sqrt(6))/sqrt(4). 4sqrt(11) Simplify ((sqrt(567) - (sqrt(567) + 1 + sqrt(567))*2) + 2 + sqrt(567) - (-2(-1 + sqrt(567))*2 - sqrt(567)))-6. 270sqrt(7) + 6786 Simplify (3(sqrt(475)-1 - (sqrt(19)2 + -4)))*2. -504sqrt(19) + 8523 Simplify (3(-1sqrt(726))/sqrt(3))*2. 2178 Simplify (-4 + (-1 + sqrt(1008) + sqrt(1008) - sqrt(1008)) - -1(-1 + sqrt(1008)))*2. -288sqrt(7) + 4068 Simplify sqrt(1331) - 5(sqrt(1331) + -4). -44sqrt(11) + 20 Simplify ((5sqrt(34)/sqrt(2))2 + -1sqrt(17)3)2. -6sqrt(17) + 850 Simplify (0 + sqrt(3) + 1 + sqrt(3))2-5. -65 - 20sqrt(3) Simplify 2(3 + (2sqrt(187) + sqrt(187))/sqrt(11)). 6 + 6sqrt(17) Simplify (2 + sqrt(5))*2 + -1 - (-3sqrt(30))/sqrt(6). 8 + 7sqrt(5) Simplify (-2sqrt(275)/sqrt(5))/((sqrt(90)/sqrt(2))/sqrt(9) - sqrt(5) - sqrt(5)). 2sqrt(11) Simplify ((sqrt(612) + 1)-1 + 2 + (sqrt(612) - 1sqrt(612)))2 + -3. -12sqrt(17) + 610 Simplify ((sqrt(228)/sqrt(4))/sqrt(3) - sqrt(19))4. 0 Simplify (sqrt(1573) - 3(sqrt(1573) + (sqrt(1573)3)2)) + sqrt(1573). -42471 - 11sqrt(13) Simplify ((2-2sqrt(6))/(-3(sqrt(2) + sqrt(8)/sqrt(4))) + 4)2. 16sqrt(3)/3 + 52/3 Simplify (-2sqrt(171)-4 - (sqrt(171) - (-1 + sqrt(171))3))2. -180sqrt(19) + 17109 Simplify -5 + (sqrt(13) + sqrt(52)/sqrt(4))-1 - -6(sqrt(13) - (sqrt(130) + sqrt(130)-1)/sqrt(10)). -5 + 4sqrt(13) Simplify (2 + (sqrt(11) - sqrt(33)/sqrt(3))-4)2. 4 Simplify (sqrt(500) - (sqrt(500) - (sqrt(500) + 3 + -2) - sqrt(500)))2. 40sqrt(5) + 2001 Simplify -4sqrt(80) + sqrt(20)/sqrt(4) + -1 + sqrt(5). -14sqrt(5) - 1 Simplify (sqrt(1152)-1)2 + sqrt(18). 3sqrt(2) + 1152 Simplify (-3(sqrt(18) - sqrt(72)))/sqrt(6). 3sqrt(3) Simplify (sqrt(80))*2-2. -160 Simplify ((sqrt(45) + sqrt(3645)-1)/(sqrt(36)/sqrt(4)-3))*2. 320/9 Simplify -1(3(sqrt(2) + 1) - sqrt(2)). -3 - 2sqrt(2) Simplify sqrt(77)/(2sqrt(11)) + 5sqrt(21)/sqrt(3) + -4. -4 + 11sqrt(7)/2 Simplify 4(sqrt(170)/(sqrt(10) + 6sqrt(640) + sqrt(640) + sqrt(640)))2. 68/4225 Simplify sqrt(12)/(sqrt(216) + (sqrt(216) - (sqrt(216)-2 + sqrt(216)) - sqrt(216)) - sqrt(216)). sqrt(2)/6 Simplify -5 + (-1 + sqrt(405))-2 + 1. -18sqrt(5) - 2 Simplify (6sqrt(17)2-2)2. 9792 Simplify ((2sqrt(352))/sqrt(2) - (sqrt(11) - (2sqrt(11) + -1) - (-1 + sqrt(891) + sqrt(891) - sqrt(11))))2. -104sqrt(11) + 7440 Simplify sqrt(136)/(3sqrt(128)). sqrt(17)/12 Simplify -3(sqrt(5) - sqrt(45)) - (3 + 2sqrt(5))2. -29 - 6sqrt(5) Simplify (sqrt(459)/sqrt(3) - sqrt(17)) + -4 + sqrt(204)/(sqrt(48)/sqrt(4)) + (sqrt(17)-1)2 + -3. 10 + 3sqrt(17) Simplify -2(-1 + sqrt(1331) + 1sqrt(1331) + sqrt(1331))*2. -23960 + 132sqrt(11) Simplify 5-2sqrt(2736). -120sqrt(19) Simplify sqrt(171)/sqrt(2916). sqrt(19)/18 Simplify (sqrt(130) + (sqrt(130) - 2sqrt(130))1)/(3sqrt(10)-1). 0 Simplify (sqrt(160)/(sqrt(10) - sqrt(90)))/sqrt(8). -sqrt(2)/2 Simplify (-1sqrt(133)6)/sqrt(7). -6sqrt(19) Simplify (((sqrt(77) - (-1sqrt(77) + sqrt(77)) - sqrt(77))6)/(1sqrt(847)))2. 0 Simplify 1(sqrt(39) + (sqrt(273)2)/sqrt(7))/sqrt(3). 3sqrt(13) Simplify -6-25(sqrt(1088) + -1)2. -960sqrt(17) + 65340 Simplify 3(-4 + (sqrt(11) + 1 + sqrt(11) + -1 - (sqrt(132)-2 - sqrt(132))/sqrt(12))). -12 + 15sqrt(11) Simplify (sqrt(6)/(sqrt(6)/(sqrt(27) + sqrt(3))))2. 48 Simplify 4(sqrt(2) + (sqrt(2) - ((sqrt(162) - 2sqrt(162)) + sqrt(162) - sqrt(162)) - sqrt(2))2) + (sqrt(18)/(sqrt(18)/(1sqrt(2))))*2. 4sqrt(2) + 650 Simplify -1 + (sqrt(27)-3 - (sqrt(3) - sqrt(9)/(sqrt(12)/sqrt(4) + sqrt(3)))2). -9sqrt(3) - 7/4 Simplify (sqrt(98) - ((sqrt(98) + sqrt(98) + -1)-6)2) + 4. -14144 + 1015sqrt(2) Simplify (sqrt(98) + 1)-6. -42sqrt(2) - 6 Simplify (sqrt(2016)1)/sqrt(8) + -2 + (sqrt(7) + sqrt(112) + sqrt(7))-1. -2 Simplify ((sqrt(104) - -3(sqrt(104) - sqrt(104)-2)) + sqrt(104))/sqrt(8). 11sqrt(13) Simplify sqrt(11) - sqrt(88)/sqrt(2) - (0 + sqrt(11) + sqrt(11) + 5) - (((0 + sqrt(11))-5)*2 + sqrt(11) + 1 + -4). -277 - 4sqrt(11) Simplify 5sqrt(22)/sqrt(2)5 + ((1sqrt(11) + sqrt(11))21 - (sqrt(11) + 1)2). 42 + 23sqrt(11) Simplify ((sqrt(99) + (sqrt(99)-1 - sqrt(99) - sqrt(99) - sqrt(99)))3)/(sqrt(441)1). -9sqrt(11)/7 Simplify sqrt(567) - (sqrt(567) + 1) - (sqrt(7) + 4 + sqrt(7)2). -3sqrt(7) - 5 Simplify (1 + (6sqrt(51)/sqrt(3) - (sqrt(17) + 0 + 1 + sqrt(17))))2. 272 Simplify -4sqrt(44)/((sqrt(80)/sqrt(2))/sqrt(10) + sqrt(4))-4. 8sqrt(11) Simplify (-1sqrt(220))/sqrt(11) - sqrt(120)/sqrt(96). -5sqrt(5)/2 Simplify -4((sqrt(63)-3)*2 + 6(sqrt(7)-1)2). -2436 Simplify (sqrt(70) - ((sqrt(70) - (sqrt(70) + ((sqrt(70) + -1sqrt(70))-6 - sqrt(70)) - sqrt(70))) + sqrt(70)))/(-3sqrt(30)/sqrt(3)). 2sqrt(7)/3 Simplify sqrt(132)/((sqrt(108)1 - sqrt(108) - sqrt(108))/sqrt(9)). -sqrt(11) Simplify (sqrt(1008) + (sqrt(1008) + sqrt(1008) + 4)*2 - sqrt(7)) + -1. 203sqrt(7) + 4047 Simplify (-5 + -3sqrt(10)/sqrt(2))2. 30sqrt(5) + 70 Simplify 5 + -5sqrt(200) - sqrt(200). -60sqrt(2) + 5 Simplify sqrt(77)/(-1sqrt(1008)). -sqrt(11)/12 Simplify sqrt(14)/sqrt(32) + -6(-2 + sqrt(7))*2. -66 + 97sqrt(7)/4 Simplify -3 + sqrt(90)/sqrt(5) + 1 + 5. 3 + 3sqrt(2) Simplify (sqrt(168)/(-4sqrt(8) + sqrt(8)) + sqrt(21))/sqrt(7). 2sqrt(3)/3 Simplify (sqrt(33) - (sqrt(2112) + sqrt(2112) + (-2sqrt(2112) - sqrt(2112))))/(sqrt(176) + 1sqrt(176) - sqrt(176)). 9sqrt(3)/4 Simplify 3(-1 + sqrt(76)). -3 + 6sqrt(19) Simplify (4(sqrt(102) + sqrt(102)-1 + sqrt(102)))/sqrt(6). 4sqrt(17) Simplify (sqrt(3888)-1 + sqrt(3888))/(	{ "pile_set_name": "DM Mathematics" }
12 - 2 = j, -3j - l + 23 = 0. Suppose 0w - w = -j. Is 11 a factor of d(w)? True Let p = -13 + 8. Let i be (-2)/p + 92/20. Suppose 0 = 3u - 2u - i. Does 3 divide u? False Suppose c = -3c - 280. Let h = -50 - c. Suppose -2p - h = -7p. Is p even? True Let f(l) = 12l - 1 + 20l - 3l - 2l. Let o be f(-1). Let z = o - -58. Is 15 a factor of z? True Suppose -p = 1, -5l + 314 = 2p - p. Does 2 divide ((-1)/3)/((-3)/l)? False Suppose 3x - 100 - 65 = 0. Let u = -30 + x. Is 21 a factor of u? False Is 17 a factor of (-1)/((-2)/3063)? True Let o be (6/(-9))/((-4)/102). Let m = o + -11. Is m a multiple of 5? False Suppose 3 - 15 = 4m, 0 = -2c + 3m - 135. Let k = c + 153. Does 27 divide k? True Let m be (-2)/6 - 56/3. Let q = 20 + -54. Let b = m - q. Is 15 a factor of b? True Suppose -2q + p + 2p + 22 = 0, -5p = q - 24. Does 3 divide q? False Let p be (-7)/(-3) + (-2)/(-3). Suppose 0k = -2k - 8, 5k = pl - 104. Is 14 a factor of l? True Let n = 12 + 3. Is 5 a factor of n? True Let o = -129 - -188. Does 7 divide o? False Let y be ((-3)/(-4))/((-6)/(-1848)). Does 6 divide 8/(-6)y/(-14)? False Suppose -3b - 63 = 27. Let c be b/3(-2)/4. Suppose -80 = -4o - 3k, -4k + ck = 0. Is 17 a factor of o? False Suppose 2i - 30 = i - r, 4r = 2i - 30. Suppose 0n - n + i = 0. Is 8 a factor of n? False Suppose 0 = -3a - 2a - 10. Does 23 divide 0/(1 + a) - -23? True Let h = -4 + 4. Suppose 0 = -hj - j. Suppose -2m - m + 9 = j. Is m a multiple of 3? True Let d(q) = q*2 - q + 7. Let j be d(0). Let v(m) = m - 5. Let y be v(j). Suppose -yc = 5k - 75, -4c + 0c - 6 = -2k. Does 13 divide k? True Let t be (-3)/((5 + -4)/(-4)). Let a = -5 + t. Does 3 divide a? False Suppose 2u - 4 + 0 = 0. Suppose -s + u + 4 = -5t, -4t - 42 = -2s. Let g = s + -14. Is 6 a factor of g? False Is 7 a factor of -4 + 1 + -2 + 3 - -16? True Let d = -10 - -18. Let i(a) = 3a2 - 2a*2 - 5a - d + a. Is 19 a factor of i(-6)? False Let g = -25 + 216. Suppose g = 5j + y, -j + 5y - 58 = -3j. Is 13 a factor of j? True Suppose 2t - 4l - 80 = -5l, -92 = -2t + 2l. Is 14 a factor of t? True Suppose 4z - 3z = -2. Let b(r) = 6r2 - 3r - 3. Let i be b(3). Is (i/(-15))/(z/20) a multiple of 14? True Let z(m) = -8m2 + 2m - 3. Let u be z(2). Let r = u - -65. Suppose 3j - l = 128, 234 - r = 5j + l. Is j a multiple of 17? False Let f(m) = -m*2 - 7m - 1. Does 6 divide f(-5)? False Let u = 168 + -58. Does 10 divide u? True Suppose 4 = 3c - 17. Let u = -3 + c. Suppose -uh + 48 = -28. Is 9 a factor of h? False Suppose -8 = -4p, -4u + 3p + 8 + 18 = 0. Suppose 3r - 3h + u = 5r, 16 = 2r - h. Suppose -3b = -2b - r. Does 3 divide b? False Let s be (14/4 - -1)6. Let f = 73 - s. Is 13 a factor of f? False Let g(x) = 28x - 1. Does 20 divide g(2)? False Is (-15)/((-3)/6 - 1) a multiple of 2? True Suppose -3i + 3b - 12 - 18 = 0, i + 14 = 3b. Let l(p) = -10p - 10. Is l(i) a multiple of 35? True Let v(l) = 2l*2 + 10l*2 - 5l + 6l. Suppose -2y = -6y - 4. Is v(y) a multiple of 11? True Suppose 2p + 101 - 13 = 5b, 0 = 2b - p - 35. Suppose -2o = o - b. Is 3/o22/1 a multiple of 11? True Let s(x) be the second derivative of 13x3/6 - x. Suppose -5t = 10 - 15. Is s(t) a multiple of 6? False Let o(s) = s*3 - 5s*2 + s + 1. Let f be o(5). Suppose -2q - f = -5q. Is q a multiple of 2? True Let h(l) be the second derivative of 2l*3/3 + l. Let w be h(-1). Is 9 a factor of 195/21 - w/(-14)? True Suppose -5h - 2v - 9 = 0, v = -h + 4h + 1. Does 13 divide ((-330)/5)/(h2)? False Let m(u) = -3u*2 + 4u*2 + 0u*2 - 7 - 5u. Let x be m(7). Suppose 49 + x = 4r. Does 14 divide r? True Suppose 0 = -0b - 2b - 2. Is 8 a factor of -18(-1 - b/(-3))? True Suppose -11 = -3r + 7. Does 16 divide r/(-9)177/(-2)? False Suppose 2v - 40 = -2t, 14 = 5t - 1. Suppose v = -3w + 2w. Is 6 a factor of w(-2 + (3 - 2))? False Let t = 105 - 209. Is t/(-10)30/12 a multiple of 12? False Suppose -5a - 5x + 501 = -3x, 3a = 4x + 285. Is a a multiple of 33? True Let s(g) = 10g2 + 13 + 2 + g3 + 3g - 5. Let z be s(-10). Let t = z + 32. Is 6 a factor of t? True Let m(b) = -b - 9. Suppose 3w + 40 - 13 = 0. Let n be m(w). Suppose n = -2d + 6d - 112. Does 14 divide d? True Suppose -2x + 2c = 3c - 86, 0 = -3x - c + 129. Let k = x - 24. Does 19 divide k? True Suppose v = -0v + 32. Let o = -1 + v. Is o a multiple of 13? False Let l(s) = 15s + 7. Let v(b) = 7b + 3. Let q(j) = 2l(j) - 5v(j). Let w(r) = 21r + 3. Let z(m) = -9q(m) - 2w(m). Is z(5) a multiple of 5? False Let o = 66 - 141. Let u = o + 105. Is 15 a factor of u? True Let u(x) = x + 16. Let j(n) = -4n - 65. Let q(s) = 2j(s) + 9u(s). Is q(10) a multiple of 9? False Suppose 8 = 9o - 8o. Does 4 divide o? True Let p = 140 + -4. Suppose -p = -2y - 2y. Is 16 a factor of y? False Let j = 1 - -1. Let a = 0 + j. Suppose -x - 11 = -ax. Does 11 divide x? True Let i = 11 + -7. Is 8 a factor of i3 - (3 - 0)? False Let t(x) = 8x - 1. Let h(v) = v2 + 4v. Let r be h(-3). Let m = r + 7. Is t(m) a multiple of 13? False Suppose k - m = 1 + 5, -5m - 27 = -4k. Suppose 9 - 81 = -kq. Is q a multiple of 8? True Let h(t) = -t3 - 14t*2 - 5t - 10. Is h(-14) a multiple of 15? True Let s = 6 - 13. Let g = 4 - -12. Let u = g + s. Does 6 divide u? False Let a(r) = -28r3 - 4r*2 - 3. Is 41 a factor of a(-2)? True Suppose 4 = 5b - b. Suppose u - b = -2. Let x(n) = -14n3 - n2 + 1. Is x(u) a multiple of 14? True Suppose -q + 84 = 6q. Is 2 a factor of q? True Let j(i) = 3i2 - 7i + 6. Suppose 2k + 20 = 7k. Is 9 a factor of j(k)? False Suppose 2t - f - 156 = -5f, 0 = 2f + 10. Is t a multiple of 11? True Suppose -z + 168 = 6z. Is z a multiple of 18? False Let x be (155 - -1)/4 + 0. Let b = x + 23. Is b a multiple of 13? False Let y be 2 - (2 + -3 + -10). Let k = 11 - 17. Let u = y + k. Is 6 a factor of u? False Let o be -321 + 1. Let g(w) = -w3 - w2 + 8w - 4. Does 10 divide g(o)? False Let f = -6 + 48. Is 13 a factor of 2052/f + (-1)/(-7)? False Let s = -23 - -45. Is 22 a factor of s? True Let f(z) = -z3 + 11z*2 + z - 11. Let u be f(11). Suppose d + 2d - 54 = u. Does 11 divide d? False Suppose t + 9 = -0t. Suppose -2n + 938 = -5s, 4s - 2n + 247 = -503. Is 5 a factor of s/(-36) + 2/t? True Let z(m) = 2m + 12. Let o be z(9). Let v = o + 64. Suppose 3w - 235 + v = -4k, 3w + 147 = 4k. Is 11 a factor of k? False Suppose -9o + 4o = -165. Does 7 divide o? False Let s = 107 - 37. Is s a multiple of 14? True Suppose -2a + 63 = a. Let b = -1 - -3. Suppose 2k - 3h = -6h + a, -bh + 58 = 5k. Is 12 a factor of k? True Let r be 1/((6/75)/2). Let q = r - 9. Is 8 a factor of q? True Let i be (-14)/(-6) + (-4)/12. Suppose -f + 438 = if. Let x = -96 + f. Does 16 divide x? False Let d(h) be the third derivative of -h6/20 + h5/20 + h4/24 + h3/6 - 4h*2. Is d(-2) a multiple of 24? False Let c = -9 - -12. Suppose t - c - 6 = 0. Does 9 divide t? True Let g be ((-4)/6)/((-6)/90). Suppose -3b + g = -275. Does 24 divide b? False Let r = 1 - -4. Suppose ri = -0i - 2s + 4, -i - 2s = -4. Suppose 4 = n + 2w, iw = -4n - 3w + 36. Does 10 divide n? False Let o = 45 - 33. Is o even? True Let c(f) = 3f3 + 5f*2 - 5f + 1. Let y(p) = -13p3 - 21p*2 + 19p - 5. Let k(t) = -9c(t) - 2y(t). Is 8 a factor of k(-5)? True Suppose 0 = -15o + 531 + 369. Is 10 a factor of o? True Let z(r) be the third derivative of r8/5040 + r7/5040 - r6/360 + r5/60 + 3r*2. Let a(u) be the third derivative of z(u). Is a(-2) a multiple of 5? False Let c(a) = a. Let g(p) = -2p*2 + 26p + 12. Let x(w) = -w*2 + 13w + 6. Let d(z) = -6g(z) + 11x(z). Let k(v) = 6c(v) + d(v). Is k(9) a multiple of 4? True Does 21 divide (1 + 1)(-210)/(-20)? True Is (-13)/((-130)/804) + (-8)/20 a multiple of 14? False Let f be (-1 + 3)/((-8)/20). Does 4 divide (f - (-2 + 1))/(-1)? True Is (20/(-60))/(1/(-54)) a multiple of 9? True Let i(x) = 2x3 + 2x2 + x + 1. Let a(w) = -w3 + 1. Let o(q) = -a(q) - i(q). Let r be o(-3). Let j = r - -45. Does 20 divide j? False Suppose m - 5w - 42 = 0, w + 3 = -5m + 109. Does 3 divide m? False Let i be 6 + (3 + -3 - 2). Suppose 0 = i*t - 2 + 6. Let o = 14	{ "pile_set_name": "DM Mathematics" }
458/65) Simplify ((q*(1/20)qq18)/((q/((qq*(-7/8))/q))/(qq/(qq(-1/2)))))8 assuming q is positive. q(747/5) Simplify ppp(-21/2)pp/((pp(p(-1/83)p)/p)/p)p(pp(2/29))/(ppp/(pp*(-25/4))p) assuming p is positive. p*(-141233/9628) Simplify ((h/(hh/h*(-1)))/hhh/(h/((((h(4/3)h)/hh)/h)/h)))/(h/h(-2/7)h*0)(h/(h/(h*(-12)/h))(h/(h*(1/6)h))/h)(8/11) assuming h is positive. h(-3062/231) Simplify (m7/(m(-2/19)m))(-10/7)(mm0)(1/22)/(m(2/7)/m(-3/7)) assuming m is positive. m(-27477/2926) Simplify ((aa(a(-1/4)aa)/a)(13/7))(-43)(aa(-2/23)/aa)/a*1(a/(aa(-1/3)/aa)a)18 assuming a is positive. a(-126027/644) Simplify ((x/(xx/(x/x*(-1)))x)(2/27)/((x/((x(-1)/xxx)/x)x)/(x/x1)))/(x(4/5)x/(xx(-3)/x)(xx/x(1/2))/(x/x6)) assuming x is positive. x(-3821/270) Simplify (z1z(-7))(-7/5)(z/(zz*(-2)/zz))*45/((zz*(1/4)zz)/z7) assuming z is positive. z(2043/20) Simplify (((t(-1/4)t)/t)(-5/4))(-39)(t3/t(1/4))(17/3) assuming t is positive. t(163/48) Simplify ((((t/(t/t(-2/11)))/(tt/(t/t(-3/2))))(1/4))(-4/15))(-1/11) assuming t is positive. t*(7/3630) Simplify ((uu(-7)/u)(-11)(u10)36)44 assuming u is positive. u19228 Simplify (((u(-2/7))(2/25)/(u6/(u/(u/u(2/15)u))))14)33 assuming u is positive. u(-79574/25) Simplify (p1)*(3/13)(p(-1))(-4/7)(pp*(-2/7)(p(p(-3)/p)/ppp)/p)/((p(-2/3)p)/p)(-48) assuming p is positive. p(-3047/91) Simplify ((aa9/a)(-3/22)/(a21(a/(aa(-11)a))/a))(-6/11) assuming a is positive. a(2061/121) Simplify (((x/(x*(2/13)xxx)x)/(x(6/5)x))/((xxx(-2/7))/x(-2/15)))/((x/(x(1/10)/x))/(x/x(-1/4))x(-3)x/x3) assuming x is positive. x(-4649/5460) Simplify ((f2)(-27))(-4/3)/(((f0/f)/((f/f(2/27))/f))/(f(-2/5))(-3/5)) assuming f is positive. f(49387/675) Simplify (c*(4/5)/c(cc/(c(2/39)/c))/c)/(c/(c(-11)c)c/(c(cc/(c/(cc(23/4)/c)))/c)) assuming c is positive. c(-2731/780) Simplify (s*(-2)s)49/(s1ss*(-3/8))((s/s*(-5))/(s(ss/(s/(ss*6s)s))/s))(-38) assuming s is positive. s(203/8) Simplify ((j/(jj(2/3)))23/(j/(j/(j*(-2)jj))j(-9)))(-24) assuming j is positive. j152 Simplify (b(2/11)/(bb(-1/3)bbb))*(-2/121)(b*3/(bbb/(((b(-6)/b)/bbb)/b)bbb))/(bb(-3)bb(b/((b(-4)/b)/b))/b) assuming b is positive. b(-63658/3993) Simplify ((i(i(-2)/i)/ii)(17/2))(-1/5)((i/i(-1))(2/45))(-1/35) assuming i is positive. i(5351/1575) Simplify ((t(4/5)t(3/5))/(t5/(tt2)))/((t/t(1/4))(-39))4 assuming t is positive. t(582/5) Simplify c(2/7)c*2cc(-2/9)c*(-3)/c(c/c*(-4)c/((c*(-1/2)/c)/c)c)(2/43) assuming c is positive. c(-1340/2709) Simplify ((((((p*(3/4)/pp)/p)/p)/p)/p(-2/15))/((p/((p(1/2)pp)/p))/p)*(14/11))/((ppp(-13))/pp9)(-20) assuming p is positive. p(-39737/660) Simplify y(-1/6)(y(-1/5)y)/y(y/(y9/y))/yy*(-9/2)((y/(y/((y/(y*(8/3)yy))/y)yy))/(yy(4/5)))/(y(-2/19)/y8) assuming y is positive. y(-754/57) Simplify (b(-1/3))(1/3)b(1/11)/(b(-6)/b)(b*0b/b13)(1/12) assuming b is positive. b(592/99) Simplify ((s(-2/3)s(-2/7))/(ss(1/4))(9/5))/((s*4/s(ss/s(-3/7)s)/s)/((s/s*(-5)s)/s(-2/7))) assuming s is positive. s(-113/84) Simplify ((r/(r/((rr/r(-1/6)r)/r)))(-2/77))(7/4)/((r*(-1/3)r)*(-1/86)r(-2/13)/r(-5/2)) assuming r is positive. r(-179813/73788) Simplify (((g(-10)/(g/g*(2/19)))/((g/(g/(g/(((gg(g/(gg*(-11)ggg))/g)/g)/g))))/(g/g*(1/2)g)))44)(11/7) assuming g is positive. g*(-31218/133) Simplify (((((u/(u(uu(-2/11)/u)/u))/u)/u)/u)/(u/(u/u(2/11)u)u))/(u(2/7)u*(1/2))(u/u(2/11))/u(2/21)u6u*1/uu assuming u is positive. u(2281/462) Simplify ((i/(i/((i/i(-3))/ii))ii)/(ii*(-15)iii)(i1i)/i(i/i(2/17))/i)33 assuming i is positive. i(10032/17) Simplify s17sss((s/s41)/ss)/s((ss*(-33)s)/s)/(ss(1/3)) assuming s is positive. s(-163/3) Simplify (c6/c(2/13))(-42)cc5c*6((c*(-1)c)/ccc)/((cc/c(3/4))/c) assuming c is positive. c(-12105/52) Simplify ((l(-9)/((ll*(-30)/ll)/ll))(2/41))(-39) assuming l is positive. l(-1560/41) Simplify ((f/(f(-21)f))/(f*24/f)(f(6/11))(10/11))2 assuming f is positive. f(-364/121) Simplify ((g*(-11)/gg)/(g(-10)/g))(4/33)/((g(2/13))(4/3))22 assuming g is positive. g(-176/39) Simplify (q*(-1/8)q4)27/((q(1/3))(17/5))(2/89) assuming q is positive. q(1117123/10680) Simplify ((h*(-1)h)*(-6)(h/h*(-1/3)h)/(h*3hh))/((hh/h*(5/6)h6)/((h/((h(-5)/h)/h))/hh(2/3))) assuming h is positive. h(-13/6) Simplify (((((i/(i/(i/((ii*3i)/ii)i)i))/i)/i)/(i/(ii8)))/(i(-2)/i)*(2/19))/(((ii/i(2/29))/(i/i(4/5)))/(i2)37) assuming i is positive. i*(205481/2755) Simplify ((((yyy(-6))/y)/(y(-4)y))/((yyy(-2/7)/y)/(y6/y)))/((y(-1))(-15)(y(-1/3))(16/5)) assuming y is positive. y(-1223/105) Simplify ((y(-2/5)/yy(-1/5))/(y(-2/9)((((y/y(-3))/y)/y)/y)/y))/((yy*(-1/4)/yy(1/7)/y)/(y(-2/7)/y(4/7))) assuming y is positive. y(-203/180) Simplify (f(-2/47)/(f(1/3)f)(f*(-5/6)f)26)(2/9) assuming f is positive. f*(278/423) Simplify v(((v/v*(-1/7))/v)/v)/vvv(-5/12)(vvv43)(-7/3) assuming v is positive. v*(-8843/84) Simplify ((vv*5)/((v/(vv*10))/v)vv/v(2/57)v(-2/5))(-5/6) assuming v is positive. v*(-5291/342) Simplify ((((cc/((c/(c/(c/(c*3c))c))/c))/c)/c)(9/8)/((c(10/3)/c)/c)(6/23))(-9) assuming c is positive. c(-8739/184) Simplify (s(1/2)ss)(2/67)(s*1s)*(4/5)s*(2/19)s*(-8)s*(2/7)s/((s/(s/(s*(-9)s)))/s) assuming s is positive. s(181143/44555) Simplify (q(-21)q/(q(-4/5)q))/(q*(2/45)qq/(q(1/20)/q)) assuming q is positive. q(-835/36) Simplify ((u/(u/(u/u0)))16)(-6/31)/((u/u(-4/3)u/(u*(2/13)u))/(u/(u/u*(-2))u(1/5)/u)) assuming u is positive. u(-48821/6045) Simplify ((m/(m/m*(-2/17)))/((mm*(4/5)m)/mm))(-1/50)/((m(3/2)mm/m(7/4))/(m(-1/4))39) assuming m is positive. m(-48627/4250) Simplify (g4/ggg/(gg*(2/27))g*(1/9)/(gg/(gggg/(((gg*(-1/20)g)/g)/g)gg)g))(1/8) assuming g is positive. g(3827/4320) Simplify (b/b8b(-6/11))(-47)/((b(-2/3))(-2/45)(bb(bb*(2/9))/b)/(bb/b(5/2))) assuming b is positive. b(1045097/2970) Simplify ((h((hh(4/9))/h)/h)(-2/3)(h/((h/(h/(h/(h(9/5)/h)h)))/h))/h(1/6))(-24) assuming h is positive. h*(-364/45) Simplify ((tt*(1/28)(t((t/(tt(t(-33)/t)/tt))/tt)/tt)/t)(-26))(-15/2) assuming t is positive. t(185835/28) Simplify (v/((v9/v)/v)v(-3/2)vvvv(1/5)vv(1/10)/v)(-17/2) assuming v is positive. v(357/10) Simplify (f/f0f)*(-1)f*(-3/4)ff(4/7)/f((ff/((f/(((f(-1)f)/f)/f))/f)f)(2/17))(-2/13) assuming f is positive. f(-13593/6188) Simplify ((q0)(-49))(-2/47)/(((q/((q(-4/9)/q)/q)q)/(q/q*(2/3)))/(qq(2/5))(-11/5)) assuming q is positive. q*(-1618/225) Simplify ((i/(ii/i(-1)))(-5/2)i(-6)/((i(-1/4)/i)/i))/((ii(-1/3))(-36/11)i(-2)((i/(i(i(-2/11)i)/iiii)i)/i)/i) assuming i is positive. i*(37/4) Simplify ((pp/p*(1/3)p*(-4/9))/((pp(-2/3))/(p/p(2/7))))/(p(1/4)/(p(-1/9)/p)p(-2/23)p(p(-3)/p)/pp) assuming p is positive. p(19295/5796) Simplify (p1p)(-3/44)p/(p((p/p(-5))/p)/p)pp(-8)/p((p(2/7))(-4))(2/33) assuming p is positive. p(-5639/462) Simplify (o3/o0)*(23/4)((o/(o*(-1/6)oooo)o)/(ooo(-13)))(-2/93) assuming o is positive. o(19031/1116) Simplify ((m(-25/4)/m(-4))/(m(-6/23)m(6/23)))(2/69) assuming m is positive. m(-3/46) Simplify (((gg*(-38)g)/gg/g(-3/14))/((g/((((ggg11gg)/g)/g)/ggg))/g)(-34))(-19) assuming g is positive. g(136135/14) Simplify (t(-2/7)/(t/((tt(-3/7))/t)))(-9/2)/(t(-3)/t(-1/2)(t/((t/(t/t(-1/4)))/t))/t(3/7)) assuming t is positive. t(235/28) Simplify ((y/(y/y2))30)31(y(-1))12y(-7)yy/(y(2/7)/y)y assuming y	{ "pile_set_name": "DM Mathematics" }
275305)*2 Factor 3m*2 + 1167846m. 3m(m + 389282) What is f in f*5/3 + 233f*4/3 + 4781f*3 + 259075f*2/3 - 273652f/3 = 0? -148, -43, 0, 1 Let 2n4/11 + 56n*3/11 + 514n*2/11 + 1756n/11 + 1872/11 = 0. What is n? -13, -9, -4, -2 Factor 4g2 - 384924g - 2694664. 4(g - 96238)(g + 7) Determine x, given that -4x4/3 - 60x*3 + 2060x*2/3 + 6300x - 20776/3 = 0. -53, -7, 1, 14 Factor 4x4 + 7464x*3 + 3474468x*2 - 7001264x - 10468272. 4(x - 3)(x + 1)(x + 934)2 Let 1571z*2/3 + 3136z/3 - 4 = 0. What is z? -2, 6/1571 Suppose g*5/8 - 11g*4 + 285g*3/4 - 53g*2/2 - 2491g/8 - 405/2 = 0. Calculate g. -1, 4, 5, 81 Factor i*4/5 + 1348i*3/5 + 451572i*2/5 - 1822496i/5 + 1827904/5. (i - 2)*2(i + 676)*2/5 Factor -2k*4 + 80k*3 + 1014k*2 - 308k - 19600. -2(k - 50)(k - 4)(k + 7)2 Factor -4k*3 - 19260k*2 + 38548k + 57804. -4(k - 3)(k + 1)(k + 4817) Solve -5b*2 - 5112820b - 1307046417620 = 0 for b. -511282 Factor -h*3/4 - 132h*2 - 13824h + 995328. -(h - 48)(h + 288)2/4 Find d such that -2d*3 - 394d*2 - 4462d - 4070 = 0. -185, -11, -1 Find j such that -3j4 + 174j*3 - 2313j*2 + 9366j - 10824 = 0. 2, 4, 11, 41 Factor 3m2 - 40401m + 282660. 3(m - 13460)(m - 7) Suppose 5d5 - 3955d*4 + 833735d*3 - 20445485d*2 + 142921480d - 123305780 = 0. Calculate d. 1, 13, 382 What is q in 5q5 + 2240q*4 + 265930q*3 + 3341620q*2 + 4866225q - 8476020 = 0? -217, -12, -3, 1 Let -2r5 + 190r*4 + 8602r*3 + 66754r*2 - 263264r + 187720 = 0. Calculate r. -19, 1, 2, 130 Determine o so that -o*4/8 + 25o*3/4 + 1287o*2/8 - 1071o/2 = 0. -21, 0, 3, 68 Let -196o4 - 3976o*3 + 10272o*2 + 56960o - 140800 = 0. What is o? -22, -4, 20/7 Solve -r*2/8 + 8r - 735/8 = 0. 15, 49 Factor 2v4/9 - 6560v*3/9 - 6572v*2 - 19728v - 19734. 2(v - 3289)(v + 3)3/9 Factor -w4/6 - w*3/3 + 6w*2 + 12w. -w(w - 6)(w + 2)(w + 6)/6 Solve -4k*3/7 - 7778k*2/7 - 19424k/7 - 7768/7 = 0. -1942, -2, -1/2 Factor -t*5 + 4t4 + t3 - 4t2. -t2(t - 4)(t - 1)(t + 1) Find c such that 3c4/5 - 30996c*3/5 - 93006c*2/5 - 93012c/5 - 6201 = 0. -1, 10335 Find r such that 2r4/3 - 2506r*3/15 + 18974r*2/3 + 13286r/5 - 19176/5 = 0. -1, 3/5, 47, 204 Factor -4m2 - 264m + 6880. -4(m - 20)(m + 86) Factor -3m2 + 116352m - 1128148992. -3(m - 19392)2 Suppose -2j*2/11 - 28174j/11 - 28172/11 = 0. Calculate j. -14086, -1 What is d in -5d3 - 114615d*2 + 458520d - 458540 = 0? -22927, 2 Find h, given that 4h2/3 - 406016h/3 + 10303062016/3 = 0. 50752 Factor -3i5/4 + 1044i*4 - 1449063i*3/4 - 1457427i*2/2. -3i*2(i - 697)*2(i + 2)/4 Determine h, given that 3h5 - 2256h*4 - 69909h*3 - 371382h*2 + 2396388h - 2711976 = 0. -17, 2, 782 Let 6832d5/3 + 73537d*4 + 275386d*3/3 + 20639d*2 + 310d/3 = 0. What is d? -31, -1, -2/7, -5/976, 0 Solve -3x2/4 - 2025x - 56553/4 = 0 for x. -2693, -7 Determine l so that -2l2/3 + 296l/3 + 298/3 = 0. -1, 149 Find w such that 92w4 + 16860w*3 + 70264w*2 + 17184w = 0. -179, -4, -6/23, 0 Factor 35s3 + 790s*2 - 365s - 460. 5(s - 1)(s + 23)(7s + 4) Determine x so that x*3/5 + 44x*2/5 - 12x - 2880 = 0. -30, 16 Factor -2c3 - 218c*2 - 710c + 332706. -2(c - 33)(c + 71)*2 What is s in -725s*2 - 860s + 460 = 0? -46/29, 2/5 Factor 2a2 + 46a. 2a(a + 23) Factor 2120t2 - 5092t - 2376. 4(5t + 2)(106t - 297) Factor -2b2/13 + 7664b/13 + 69138/13. -2(b - 3841)(b + 9)/13 Factor 4w2 - 2532w + 110168. 4(w - 586)(w - 47) Find i, given that i*3 - 4063i*2 + 24347i - 20285 = 0. 1, 5, 4057 Suppose -q*2 - 1417q - 26562 = 0. Calculate q. -1398, -19 Find r, given that -4r5/3 + 160r*4 + 7316r*3/3 + 8416r*2 - 7312r/3 - 8576 = 0. -8, -6, -1, 1, 134 Let -10w5 - 15610w*4 - 585145w*3/2 + 628105w*2 - 801735w/2 + 80955 = 0. What is w? -1542, -21, 1/2, 1 Find p, given that -2p4/9 - 166p*3/9 + 1184p*2 - 12672p - 49152 = 0. -128, -3, 24 Factor -3w3 - 531w*2 + 4395w - 8325. -3(w - 5)(w - 3)(w + 185) Factor 22p*3/7 + 34404p*2/7 - 6256p/7. 2p(p + 1564)(11p - 2)/7 Factor -2u3 - 338u*2 - 12988u - 24640. -2(u + 2)(u + 55)(u + 112) Let 7s*3/2 + 13849s*2/6 - 12887s/3 + 1984 = 0. What is s? -1984/3, 6/7, 1 Factor -5n2 - 385n - 380. -5(n + 1)(n + 76) Determine z, given that -2z5/3 + 364z*4/3 - 1226z*3 - 14356z*2/3 - 1480z/3 + 6384 = 0. -2, 1, 14, 171 Suppose -3r5/7 + 12r*4/7 + 111r*3/7 - 120r2/7 = 0. Calculate r. -5, 0, 1, 8 Determine k so that k5/5 + 58k4/5 + 723k*3/5 + 3514k*2/5 + 6976k/5 + 4128/5 = 0. -43, -6, -4, -1 Solve 10g4 - 135g*3 - 1825g*2 + 5250g = 0 for g. -10, 0, 5/2, 21 Suppose y*5/2 - 3y*4/2 - 37y*3/2 - 33y*2/2 + 36y = 0. Calculate y. -3, 0, 1, 8 Factor 2h2/13 + 744h/13 + 67942/13. 2(h + 161)(h + 211)/13 Suppose 4h5/9 - 227h*4/3 - 765h*3 - 2679h*2 - 3771h - 1620 = 0. What is h? -3, -3/4, 180 Suppose -3u5/4 - 1347u*4/4 + 5469u*3/4 + 14967u*2/4 + 4077u/2 = 0. Calculate u. -453, -1, 0, 6 Suppose 2z5/7 - 1242z*4/7 + 192194z*3/7 + 27990z*2 - 386884z/7 = 0. What is z? -2, 0, 1, 311 Factor -26738m2/19 + 213900m/19 + 32/19. -2(m - 8)(13369m + 2)/19 Find x such that -x4/2 - 787x*3 + 3156x*2 = 0. -1578, 0, 4 Solve 2l*2/5 - 76l/5 - 318 = 0. -15, 53 Factor -m*2/2 + 206m + 6405/2. -(m - 427)(m + 15)/2 Determine b so that 4b*2 - 18484b - 18488 = 0. -1, 4622 Find f such that f*3 - 334882f*2 + 669761f - 334880 = 0. 1, 334880 Factor 2n2/3 - 366838n/3. 2n(n - 183419)/3 Suppose 20h5 - 9045h*4 + 175040h*3 - 34155h*2 - 175060h + 43200 = 0. Calculate h. -1, 1/4, 1, 20, 432 Factor v*3 + 35070v*2 - 140292v + 140296. (v - 2)*2(v + 35074) Find i, given that 50i5 + 660i*4 + 1726i*3 + 1268i*2 + 72i - 80 = 0. -10, -2, -1, -2/5, 1/5 Factor -b*2/2 - 16992b + 33985/2. -(b - 1)(b + 33985)/2 Solve -3b*2 + 466686b - 18149651883 = 0. 77781 Determine w, given that 25w4 + 42845w*3 + 34105w*2 - 265485w + 51390 = 0. -1713, -3, 1/5, 2 Let -39f2/2 + 20745f/2 - 40392 = 0. What is f? 51/13, 528 Factor -4r2 - 7310864r - 3340545776656. -4(r + 913858)2 Let 4z*5 - 84z*4 - 196z*3 + 2052z*2 + 6912z + 4752 = 0. Calculate z. -3, -1, 6, 22 Let 2v5/5 - 56v*4/5 - 8546v*3/5 - 25216v*2/5 - 16728v/5 = 0. Calculate v. -51, -2, -1, 0, 82 Solve -v*3 + 122069v*2 - 244135v + 122067 = 0 for v. 1, 122067 Solve -2q2/7 - 1286q/7 + 184 = 0. -644, 1 Find v, given that -16v5/3 - 616v*4 + 31951v*3/3 - 70124v*2/3 + 9729v - 3406/3 = 0. -131, 1/4, 2, 13 Suppose 4a5/7 - 132a*4/7 - 1244a*3/7 - 2796a*2/7 + 232a/7 + 3936/7 = 0. Calculate a. -4, -3, -2, 1, 41 Let 2h2/5 + 16646h/5 - 66616/5 = 0. Calculate h. -8327, 4 Find a such that -2a2/5 + 128a/5 + 26 = 0. -1, 65 Find i such that -2i4/3 - 146i*3/15 - 82i*2/3 - 142i/15 + 44/5 = 0. -11, -3, -1, 2/5 Determine i, given that 8i4 - 3914i*3 + 978i2 = 0. 0, 1/4, 489 Factor u5/7 + 330u4/7 + 2270u*3/7 + 2880u*2/7 - 8775u/7 - 17442/7. (u - 2)(u + 3)3(u + 323)/7 Factor v*4/9 - 25v*3/9 + 127v*2/9 + 17v. v(v - 17)(v - 9)(v + 1)/9 Factor 5t*3 - 760t*2 + 3555t + 17640. 5(t - 147)(t - 8)(t + 3) Solve 2b*2 - 21598b + 21596 = 0 for b. 1, 10798 Solve -t*2/5 + 380t + 15264/5 = 0 for t. -8, 1908 Factor 2f3 + 188f*2 + 4418f. 2f(f + 47)*2 Find l such that -3l*5/7 + 669l*4/7 - 6864l*3 + 1091904l*2/7 = 0. 0, 47, 88 Factor 117g*2/5 + 678g/5 - 144/5. 3(g + 6)(39g - 8)/5 Factor -4r*2 + 52632r - 173132964. -4(r - 6579)2 Factor 11w*2 + 170w + 600. (w + 10)(11w + 60) Determine w, given that -w*5/4 + 163w*4/2 + 493w*3/2 + 83w*2 - 985w/4 - 329/2 = 0. -2, -1, 1, 329 What is w in 39w5/4 - 587w*4/4 + 2487w*3/4 - 2037w*2/4 + 49w/2 = 0? 0, 2/39, 1, 7 Solve -2m4 - 4346m*3 - 2367474m*2 - 7072030m - 4708900 = 0 for m. -1085, -2, -1 Suppose -2g2/7 + 1312g/7 + 55680/7 = 0. What is g? -40, 696 Let 2d2 + 769324d + 73982427122 = 0. Calculate d. -192331 What is m in m*4/4 - 32555m*3/2 + 1059762913m*2/4 + 529930290m + 2	{ "pile_set_name": "DM Mathematics" }
a microgram? 5800 How many micrometers are there in 22.66756 meters? 22667560 What is 3/40 of a milligram in micrograms? 75 What is 15/4 of a gram in milligrams? 3750 Convert 1.0562 nanograms to kilograms. 0.0000000000010562 How many millilitres are there in 0.9586547 litres? 958.6547 How many microseconds are there in 49/5 of a millisecond? 9800 What is 11/8 of a millimeter in micrometers? 1375 What is 6510.529 decades in months? 781263.48 What is 354597.4l in millilitres? 354597400 What is 11/8 of a litre in millilitres? 1375 What is sixty-four fifths of a micrometer in nanometers? 12800 What is 1/5 of a kilogram in grams? 200 What is 67.7682 nanometers in millimeters? 0.0000677682 How many milliseconds are there in 3521.605us? 3.521605 How many millilitres are there in 5/8 of a litre? 625 How many millimeters are there in 2.248234km? 2248234 Convert 7392.908 weeks to days. 51750.356 Convert 9.642773 years to millennia. 0.009642773 Convert 5.187977 millilitres to litres. 0.005187977 What is 0.9960592ng in micrograms? 0.0009960592 Convert 80.72572 kilograms to grams. 80725.72 Convert 3.158742 millennia to months. 37904.904 What is 0.2260695 days in nanoseconds? 19532404800000 What is 317.54952 minutes in days? 0.2205205 What is 1/20 of a millisecond in microseconds? 50 What is 24334.61 millennia in centuries? 243346.1 How many nanograms are there in 3/40 of a milligram? 75000 How many kilometers are there in 0.5688625 micrometers? 0.0000000005688625 What is fifty-three fifths of a kilometer in meters? 10600 How many months are there in 10/3 of a year? 40 What is 0.5978114mm in centimeters? 0.05978114 How many centimeters are there in 6587.549 meters? 658754.9 Convert 26226.14 meters to millimeters. 26226140 How many decades are there in 18744.066 months? 156.20055 Convert 70.46427l to millilitres. 70464.27 What is twenty-three eighths of a day in minutes? 4140 What is 18/5 of a microgram in nanograms? 3600 How many millilitres are there in 445972.6l? 445972600 How many minutes are there in seven sixths of a day? 1680 How many minutes are there in 1/4 of a week? 2520 What is thirty-three fifths of a second in milliseconds? 6600 Convert 0.9246182ml to litres. 0.0009246182 Convert 56.52822s to microseconds. 56528220 What is thirteen eighths of a meter in millimeters? 1625 How many centuries are there in 11/2 of a millennium? 55 What is 3/5 of a minute in seconds? 36 Convert 389028.5mm to nanometers. 389028500000 Convert 0.2325983us to milliseconds. 0.0002325983 What is 1/24 of a millennium in months? 500 What is 1/5 of a litre in millilitres? 200 Convert 86.10436 kilograms to milligrams. 86104360 What is 0.1453139mg in kilograms? 0.0000001453139 What is 158106.21 nanoseconds in minutes? 0.0000026351035 How many nanograms are there in 27/2 of a microgram? 13500 Convert 111694.14 months to years. 9307.845 What is fourty-five quarters of a microgram in nanograms? 11250 How many millilitres are there in 34/5 of a litre? 6800 What is 12115.71 litres in millilitres? 12115710 How many nanometers are there in 47217.93mm? 47217930000 What is 3/8 of a centimeter in micrometers? 3750 What is 3/16 of a day in seconds? 16200 What is 2/125 of a microgram in nanograms? 16 What is 675541.8 millilitres in litres? 675.5418 Convert 585.5661mg to tonnes. 0.0000005855661 What is fifty-nine fifths of a microgram in nanograms? 11800 What is fifty-one quarters of a litre in millilitres? 12750 How many litres are there in 85285.88ml? 85.28588 What is fifty-five thirds of a century in months? 22000 How many nanoseconds are there in 6/5 of a microsecond? 1200 What is 7/4 of a millennium in decades? 175 What is 2.365558 litres in millilitres? 2365.558 How many weeks are there in 169606426.5 nanoseconds? 0.00000028043390625 How many litres are there in 0.6196742 millilitres? 0.0006196742 How many years are there in 39.85371 months? 3.3211425 How many meters are there in 3.661872cm? 0.03661872 How many micrometers are there in 52900.19 nanometers? 52.90019 What is 79902.2 meters in centimeters? 7990220 How many millilitres are there in 5609.689 litres? 5609689 How many millilitres are there in 51/4 of a litre? 12750 What is 51.15321 months in years? 4.2627675 How many minutes are there in ten ninths of a day? 1600 How many years are there in seventy-one quarters of a century? 1775 Convert 1.8479466 months to millennia. 0.00015399555 How many micrometers are there in three fifths of a millimeter? 600 Convert 3070.918km to millimeters. 3070918000 What is 7/4 of a day in hours? 42 What is eighty-one quarters of a week in hours? 3402 How many millilitres are there in seven quarters of a litre? 1750 Convert 64278.4 grams to milligrams. 64278400 How many seconds are there in four thirds of a hour? 4800 How many nanograms are there in one sixteenth of a milligram? 62500 What is thirteen fifths of a microgram in nanograms? 2600 Convert 82385.23l to millilitres. 82385230 Convert 97.53599 milligrams to tonnes. 0.00000009753599 What is 57521.71ml in litres? 57.52171 What is one tenth of a litre in millilitres? 100 Convert 605.3709ug to milligrams. 0.6053709 How many litres are there in 5234.721 millilitres? 5.234721 What is fourty-one halves of a millisecond in microseconds? 20500 Convert 7017.506 years to months. 84210.072 How many litres are there in 11268.18 millilitres? 11.26818 Convert 9494.174 litres to millilitres. 9494174 Convert 871257.1 kilograms to grams. 871257100 What is 71.1052l in millilitres? 71105.2 How many kilometers are there in 84.91583um? 0.00000008491583 How many years are there in twenty-nine halves of a millennium? 14500 How many days are there in ten sevenths of a week? 10 How many millimeters are there in 7/25 of a meter? 280 Convert 24.924009s to minutes. 0.41540015 What is 18/5 of a decade in years? 36 How many millilitres are there in 3/25 of a litre? 120 How many weeks are there in 1315937.07ns? 0.000000002175821875 What is seventeen quarters of a kilometer in meters? 4250 What is 42508.05 centuries in decades? 425080.5 How many tonnes are there in 544.1411 kilograms? 0.5441411 How many millilitres are there in twenty-one halves of a litre? 10500 What is 15/4 of a litre in millilitres? 3750 How many years are there in 24.52454 centuries? 2452.454 Convert 726.6738um to nanometers. 726673.8 What is one quarter of a kilometer in centimeters? 25000 What is 41/2 of a millennium in decades? 2050 How many micrograms are there in 1/16 of a gram? 62500 What is two fifteenths of a week in seconds? 80640 How many millilitres are there in thirty-one halves of a litre? 15500 How many micrograms are there in 7/2 of a milligram? 3500 How many days are there in 83.613195 milliseconds? 0.0000009677453125 Convert 48923.03ug to tonnes. 0.00000004892303 What is 6789.215ns in seconds? 0.000006789215 How many litres are there in 588525.7 millilitres? 588.5257 Convert 74008.73 kilometers to nanometers. 74008730000000000 How many years are there in 0.572157 millennia? 572.157 Convert 59801.36 nanometers to millimeters. 0.05980136 How many millilitres are there in 29/2 of a litre? 14500 Convert 13516677.9 nanoseconds to days. 0.00000015644303125 How many hours are there in 63.990081us? 0.0000000177750225 How many grams are there in 29/2 of a kilogram? 14500 What is 15.28587m in nanometers? 15285870000 What is 18/5 of a second in milliseconds? 3600 What is 5.780913 millennia in years? 5780.913 How many hours are there in three eighths of a week? 63 What is 1/36 of a week in seconds? 16800 How many millilitres are there in 8.11705l? 8117.05 How many grams are there in thirteen eighths of a kilogram? 1625 How many months are there in 0.165978 millennia? 1991.736 How many years are there in 18/5 of a century? 360 How many millilitres are there in one quarter of a litre? 250 What is 73.13181 centuries in months? 87758.172 What is seven eighths of a gram in milligrams? 875 How many days are there in 3/7 of a week? 3 How many millilitres are there in eleven eighths of a litre? 1375 What is 69/2 of a litre in millilitres? 34500 What is 0.8995092 decades in months? 107.941104 What is 270000.24 months in decades? 2250.002 Convert 46.00211 centuries to decades. 460.0211 What is twenty-	{ "pile_set_name": "DM Mathematics" }
Simplify (sqrt(288) + (-3 + sqrt(288))*2)-3. -891 + 180sqrt(2) Simplify 6(3 + sqrt(19)) + ((sqrt(171)3)2 - sqrt(171)). 3sqrt(19) + 1557 Simplify 1(-1 + 3sqrt(176))*2. -24sqrt(11) + 1585 Simplify sqrt(26)/sqrt(50)2. 2sqrt(13)/5 Simplify (-2(0 + sqrt(252)))2. 1008 Simplify (sqrt(304) + 5 - sqrt(190)/sqrt(250)) + 2. 7 + 19sqrt(19)/5 Simplify (sqrt(12)2 + 0)-2. -8sqrt(3) Simplify (1(sqrt(27) + 2sqrt(27)))/(-4sqrt(36)/sqrt(4)). -3sqrt(3)/4 Simplify ((sqrt(3) - (sqrt(3) + -3 + 4)) + 0 + -5)2. 36 Simplify -1sqrt(38)/sqrt(2)-5. 5sqrt(19) Simplify (sqrt(3024)-2)/(sqrt(30)/(sqrt(40)/sqrt(4))). -24sqrt(7) Simplify 4 + ((sqrt(38) - (-2sqrt(190) + sqrt(190) - sqrt(190))/sqrt(5) - sqrt(38))/sqrt(2))2. 80 Simplify (sqrt(180)/(-2sqrt(6)))/sqrt(6). -sqrt(5)/2 Simplify ((sqrt(77) + (sqrt(77) - (sqrt(77) + 1sqrt(77) + sqrt(77)))-6)/((sqrt(84)/sqrt(3))/sqrt(4)))*2. 1859 Simplify 2((sqrt(26)/(sqrt(8)/sqrt(4)))*2 + sqrt(13)). 2sqrt(13) + 26 Simplify -3sqrt(3328). -48sqrt(13) Simplify ((sqrt(143) - 3sqrt(143))/sqrt(11) - sqrt(13))2 - sqrt(416)/sqrt(8). -2sqrt(13) + 117 Simplify -5 + (4(sqrt(2) + 0) - sqrt(2)) + sqrt(2) + 1. -4 + 4sqrt(2) Simplify (sqrt(68) + 2 - sqrt(17)) + 3. sqrt(17) + 5 Simplify (1sqrt(3)3 + (sqrt(12) - (sqrt(12) - sqrt(48)/sqrt(4))) + -1)*2. -10sqrt(3) + 76 Simplify 2(sqrt(52) + -3). -6 + 4sqrt(13) Simplify sqrt(117)/(3sqrt(108)/sqrt(12))5. 5sqrt(13)/3 Simplify -6((sqrt(700)-2 + sqrt(700))2 + (sqrt(28) - sqrt(28)-1) + sqrt(7)). -4200 - 30sqrt(7) Simplify sqrt(133)/((sqrt(35) + sqrt(140)/sqrt(4))/sqrt(5)). sqrt(19)/2 Simplify (1sqrt(2) + -2)*2 + 4. -4sqrt(2) + 10 Simplify ((sqrt(33)3 - sqrt(33))-1)/sqrt(3). -2sqrt(11) Simplify -1 + (sqrt(130) + -3-3sqrt(130))/sqrt(10). -1 + 10sqrt(13) Simplify ((-2sqrt(351))/sqrt(9))/(sqrt(3) - sqrt(36)/sqrt(48)). -4sqrt(13) Simplify 3 + -2sqrt(19) - (sqrt(1900) + 2 + sqrt(1900) - sqrt(19)). -21sqrt(19) + 1 Simplify sqrt(325)-5 - (sqrt(637) + 2)2. -641 - 53sqrt(13) Simplify (2(sqrt(39) + sqrt(156)/sqrt(4)) - sqrt(39))/((sqrt(66)/sqrt(2))/sqrt(11)). 3sqrt(13) Simplify sqrt(11) + 2 + 3 + sqrt(11) + (-4sqrt(176) + sqrt(11))2 + sqrt(11). 3sqrt(11) + 2480 Simplify (sqrt(72)-1 - sqrt(18))/sqrt(6). -3sqrt(3) Simplify 3 + sqrt(20)-5. -10sqrt(5) + 3 Simplify sqrt(20)/sqrt(40) + -5. -5 + sqrt(2)/2 Simplify -3 + (sqrt(27) + -3sqrt(27))2. 105 Simplify -3 + sqrt(70)/sqrt(490). -3 + sqrt(7)/7 Simplify (2sqrt(17) + 3)6. 18 + 12sqrt(17) Simplify (sqrt(351)/sqrt(3) + -4 + 4)*2. 117 Simplify (sqrt(7) + 3 + 4)-2 + 0. -14 - 2sqrt(7) Simplify (3sqrt(637) - sqrt(637) - sqrt(637)) + 4sqrt(1872). 55sqrt(13) Simplify (sqrt(1700) - (sqrt(1700) + 1)-5)2. 600sqrt(17) + 61225 Simplify ((sqrt(88) - 2sqrt(88))-6)/sqrt(8). 6sqrt(11) Simplify ((sqrt(425) + -1)-5)*2 + -3. -250sqrt(17) + 10647 Simplify -5 + ((sqrt(10)3)/sqrt(2))2. 40 Simplify ((sqrt(448) + sqrt(7))-6-1)2. 20412 Simplify ((sqrt(30)/sqrt(6))2 + 1)-2. -12 Simplify -1 + (sqrt(637) + (1 + sqrt(637) - sqrt(637)) - 5(sqrt(52) - sqrt(13))2). -65 + 7sqrt(13) Simplify sqrt(7) + sqrt(7) + sqrt(7) + (sqrt(7) + -2 + 4 - sqrt(7))*2 + -5. -1 + 3sqrt(7) Simplify (-5 + 1(-4 + (sqrt(44) - sqrt(11)) - sqrt(11)))2. 81 Simplify (sqrt(168)/(sqrt(32)/sqrt(4)))/(sqrt(7) + sqrt(63)-5). -sqrt(3)/14 Simplify -4(sqrt(28)/sqrt(4))2-1. 28 Simplify (sqrt(243)2)2 - -62sqrt(3). 12sqrt(3) + 972 Simplify sqrt(15)/sqrt(80). sqrt(3)/4 Simplify (sqrt(26)-2)/sqrt(2) + -3 + 0. -2sqrt(13) - 3 Simplify 2 + 2 + (sqrt(3) - sqrt(24)/sqrt(512))*2. 403/64 Simplify (-2(-5 + sqrt(1900)-26 + sqrt(1900)))*2. 4400sqrt(19) + 919700 Simplify (-3 + sqrt(192)2)2-4. -3108 + 384sqrt(3) Simplify sqrt(85)/(sqrt(5) + (sqrt(560) - sqrt(35))/sqrt(7)). sqrt(17)/4 Simplify (sqrt(102) + 44sqrt(102))/(sqrt(6) + sqrt(36)/sqrt(24)). 34sqrt(17)/3 Simplify (sqrt(5) - (1 + sqrt(5))) + 4 + sqrt(35)/(sqrt(14)/sqrt(2)). sqrt(5) + 3 Simplify (2sqrt(56)-1)/(sqrt(8) + sqrt(16)/sqrt(8)). -4sqrt(7)/3 Simplify ((3sqrt(1100) - sqrt(1100))2)2 + sqrt(1100) + -1(sqrt(1100) - (sqrt(1100)2)2). 22000 Simplify sqrt(26)/(sqrt(242) + 2sqrt(242) + sqrt(242) + sqrt(2)). sqrt(13)/45 Simplify ((sqrt(77) + -3sqrt(77))-6 + sqrt(77) + sqrt(77))/sqrt(7). 14sqrt(11) Simplify -3((sqrt(152) - sqrt(152)22)/(sqrt(8) + (sqrt(96)2)/sqrt(12)))2. -57 Simplify ((-3 + sqrt(108))2 + sqrt(3))-2. -234 + 70sqrt(3) Simplify ((sqrt(125) - sqrt(125)-4)-5 - sqrt(125))2 + 5. 84505 Simplify -4 + sqrt(432) + 5 + (1 + sqrt(432) - sqrt(432))2. 2 + 12sqrt(3) Simplify 5sqrt(36)/(sqrt(12)-2). -5sqrt(3)/2 Simplify (2sqrt(1100))*2 + -1 + -4. 4395 Simplify -5 + 4sqrt(176)-5. -80sqrt(11) - 5 Simplify (sqrt(11) - (-1 + sqrt(275) - sqrt(11)) - ((sqrt(11) + -1)2 + -2)) + (sqrt(1584) + 1 + sqrt(1584) + -1)2. -sqrt(11) + 6327 Simplify (sqrt(133) - (2sqrt(133) + sqrt(133)))/sqrt(7) - sqrt(19) - (sqrt(152)-3)/sqrt(8). 0 Simplify (4 + 1(sqrt(5)-3 + -5))*2. 6sqrt(5) + 46 Simplify (sqrt(117))*2 + -1 + (sqrt(91)1 - sqrt(91) - sqrt(91))/sqrt(7) - (sqrt(1872) - (1 + sqrt(1872) + -3))*2. -sqrt(13) + 112 Simplify (-2-1sqrt(44))/(sqrt(36)5). 2sqrt(11)/15 Simplify (sqrt(396) + 2)5. 10 + 30sqrt(11) Simplify sqrt(704) + (sqrt(704) - (sqrt(704) + (sqrt(704)-3-2)2 + sqrt(704)) - sqrt(704)). -25344 - 8sqrt(11) Simplify -1sqrt(28) + sqrt(7) + -4. -4 - sqrt(7) Simplify sqrt(15)/(sqrt(5)-23). -sqrt(3)/6 Simplify 3sqrt(288) - (sqrt(16)-2)/sqrt(8). 38sqrt(2) Simplify (-2 + sqrt(2057) + -4)*2. -132sqrt(17) + 2093 Simplify -3(0 + sqrt(2) + 0). -3sqrt(2) Simplify ((sqrt(88) - sqrt(88)1)4)/(sqrt(8) + (sqrt(8) - (sqrt(8) + -2(sqrt(24)/sqrt(3) + sqrt(8))))). 0 Simplify ((2sqrt(520))/sqrt(10))/(sqrt(36)/(sqrt(36)/sqrt(4) + sqrt(9))). 4sqrt(13) Simplify 3(sqrt(1872) - (2sqrt(1872) - sqrt(1872)))6-4. 0 Simplify (sqrt(85) - (sqrt(85) + (sqrt(85) + (sqrt(85) - -5(sqrt(85)1 - sqrt(85))) - sqrt(85))))/(1sqrt(500)). -sqrt(17)/10 Simplify (-2 + sqrt(275) - sqrt(11)) + (sqrt(33)/sqrt(27) + sqrt(11))*2. 4sqrt(11) + 158/9 Simplify (sqrt(78)1-4 - sqrt(78))/((sqrt(150)/sqrt(5))/sqrt(5)). -5sqrt(13) Simplify 2(6(sqrt(320) + 0)6)*2. 829440 Simplify ((sqrt(136) + sqrt(136) + sqrt(136) + 1sqrt(136) + sqrt(136) + sqrt(136))-4)/(sqrt(48)/sqrt(96)). -96sqrt(17) Simplify (5(sqrt(147) - (sqrt(147) + (2sqrt(147) - sqrt(147))))1)2. 3675 Simplify (5(sqrt(132) + (sqrt(132) - ((-5sqrt(132) - sqrt(132) - sqrt(132)) + sqrt(132)))))/sqrt(12) + 1. 1 + 40sqrt(11) Simplify (sqrt(66)/(sqrt(6)4))2 + -2. -21/16 Simplify (-1 + sqrt(11) + -5)2 + -4. -12sqrt(11) + 43 Simplify sqrt(55)/(sqrt(11) + 2sqrt(539)) + -2. -2 + sqrt(5)/15 Simplify (((sqrt(700) + -1)2 - sqrt(700)) + 4)-1. -705 + 30sqrt(7) Simplify 1(sqrt(396)/sqrt(4) - sqrt(11)). 2sqrt(11) Simplify ((sqrt(99)3 - sqrt(44)5)1)*2. 11 Simplify -3 + 2 + sqrt(76)/sqrt(4) + -4. -5 + sqrt(19) Simplify sqrt(170)/((2sqrt(60))/sqrt(6)). sqrt(17)/2 Simplify (-3 + sqrt(32) + sqrt(4)/sqrt(2) + 5 + 1)*2. 30sqrt(2) + 59 Simplify ((sqrt(1872) - (sqrt(1872) - ((sqrt(1872)1 - sqrt(1872)) + sqrt(1872)))) + sqrt(1872))/sqrt(4). 12sqrt(13) Simplify 1 + (sqrt(42)-15)/sqrt(6). -5sqrt(7) + 1 Simplify (2(sqrt(70) - -2sqrt(70)))/(sqrt(10) - sqrt(80)/sqrt(32)). 12sqrt(7) Simplify (-2 + -2 + sqrt(19)-2)2 + sqrt(152)/(sqrt(8) - (sqrt(8) - -4-1sqrt(8)) - sqrt(8)). 49sqrt(19)/3 + 92 Simplify ((0 + sqrt(320) + -1)*2 + -4)6. -96sqrt(5) + 1902 Simplify (sqrt(45)-21)/(sqrt(9) + sqrt(81)3 + sqrt(9) + sqrt(9)). -sqrt(5)/6 Simplify 1-1sqrt(5)2 + -4. -2sqrt(5) - 4 Simplify sqrt(76)1 + 0. 2sqrt(19) Simplify (6(-6(sqrt(12)/sqrt(4) + sqrt(3)) - sqrt(3)))*2. 18252 Simplify ((sqrt(2) - -4sqrt(8)/sqrt(4)) + sqrt(2))*2 + sqrt(36)/sqrt(2). 3sqrt(2) + 72 Simplify (sqrt(77)/(-2sqrt(11)))2 - (-2sqrt(84))/sqrt(12). 7/4 + 2sqrt(7) Simplify (sqrt(121) - (sqrt(121) - (2(sqrt(121) - 1sqrt(121)) + sqrt(121))))/(sqrt(539)-1). -sqrt(11)/7 Simplify sqrt(60)/(sqrt(12) - sqrt(768)) + 0. -sqrt(5)/7 Simplify (-4 + sqrt(200))*2 + (sqrt(2) - (sqrt(2) - (3sqrt(2) + -2)*2)). -92sqrt(2) + 238 Simplify (sqrt(11) - (sqrt(11) + (sqrt(110) + 1*sqrt(110))/sqrt(10)))	{ "pile_set_name": "DM Mathematics" }
rt(2) + ((sqrt(162) - (sqrt(162) - (sqrt(162) - (sqrt(162) - ((sqrt(162)1 - sqrt(162)) + sqrt(162))))))/sqrt(9) + sqrt(18))2. sqrt(2) + 73 Simplify ((sqrt(4900)-1 + sqrt(4900))/sqrt(7))*2. 0 Simplify 1 + sqrt(15)/sqrt(5) - (sqrt(3) + (sqrt(363) - (sqrt(363) + sqrt(363) + sqrt(363) + 1 - sqrt(363))) - sqrt(3)). 2 + 12sqrt(3) Simplify sqrt(132)/sqrt(48) + -1 + 3. sqrt(11)/2 + 2 Simplify (0 + (sqrt(931)1 - (sqrt(1539) + sqrt(1539) + 1sqrt(1539))))*2. 7600 Simplify sqrt(3564) - -2(2sqrt(3564))2. 18sqrt(11) + 28512 Simplify -5sqrt(684)-3 + 3. 3 + 90sqrt(19) Simplify ((sqrt(65)-1 + sqrt(65) + sqrt(65))4)/(sqrt(60)/(sqrt(12)2)). 8sqrt(13) Simplify -2 + 2sqrt(3) + -5 + sqrt(21)/(sqrt(14)/sqrt(2))4. -7 + 6sqrt(3) Simplify (-6(-1 + sqrt(13)) + -3 + -1sqrt(13))*2. -42sqrt(13) + 646 Simplify (5 + (sqrt(19) + 0 - sqrt(19)))5. 25 Simplify (sqrt(20)/(sqrt(24)/sqrt(6)))2 - (sqrt(320) - (sqrt(320) + 0)). 5 Simplify (3sqrt(68))*2-1. -612 Simplify ((sqrt(19) - 2sqrt(19))26 - (-5 + sqrt(19) + 2sqrt(19))) + 5. -3sqrt(19) + 124 Simplify -4((2sqrt(114))/sqrt(6) - (sqrt(76) - (sqrt(76) + 0))*2). -8sqrt(19) Simplify -2 + sqrt(117) + (-2 + sqrt(117) + (sqrt(117) - (-2 + sqrt(117) - sqrt(117))) - sqrt(117))*2. 3sqrt(13) + 115 Simplify 0 + (sqrt(2057) - (-1 + sqrt(2057)) - sqrt(2057)) + (sqrt(2057) - (3 + sqrt(2057) + 1)). -11sqrt(17) - 3 Simplify -1 + sqrt(7) + 1 + -2 + (sqrt(63) + 1)2. 7sqrt(7) + 62 Simplify (sqrt(475) - (-3sqrt(475))2) + (sqrt(171) + sqrt(171)2)/sqrt(9). -4275 + 8sqrt(19) Simplify ((-2sqrt(56)-1)/(sqrt(800) - sqrt(800)-2))*2. 7/225 Simplify ((sqrt(65) + sqrt(65) + -4(-2sqrt(65) + sqrt(65)) + sqrt(65))/(sqrt(180) + 2sqrt(180)))*2. 637/324 Simplify (sqrt(18)16)/(sqrt(6)-1-2 - sqrt(6)). 6sqrt(3) Simplify (sqrt(45)3 + sqrt(45))/sqrt(9) + (sqrt(120)/sqrt(4))/sqrt(6) + sqrt(5). 6sqrt(5) Simplify (sqrt(171) - -6(sqrt(171) + -2sqrt(171)))/sqrt(9) + -5. -5sqrt(19) - 5 Simplify ((3 + 4sqrt(1900) - sqrt(1900) - sqrt(1900)) + sqrt(1900))*2. 180sqrt(19) + 17109 Simplify (3 + (sqrt(50)1 - sqrt(50)))2. 9 Simplify -6(1 + sqrt(3)) + -2 + (sqrt(12)/sqrt(4))*2 - (-3(sqrt(9)/sqrt(3) - sqrt(3))-2)2. -6sqrt(3) - 5 Simplify sqrt(1300) + sqrt(1300) + (-1sqrt(1300))2 + sqrt(52)-2. 16sqrt(13) + 1300 Simplify (sqrt(304) + -3(sqrt(304) + 2) - (5 + -2sqrt(304)))2. 121 Simplify (2 + (sqrt(1573) + sqrt(1573) + -1)2)2 + 3. -88sqrt(13) + 12593 Simplify ((2 + sqrt(288))6 - sqrt(288))*2-6. -44064 - 8640sqrt(2) Simplify ((sqrt(1872) - (-5 + (sqrt(1872) - (sqrt(1872) - (sqrt(1872) + 0) - sqrt(1872))))) + -1)2. -96sqrt(13) + 1888 Simplify (-1-3sqrt(363))*2-2. -6534 Simplify sqrt(20)/(sqrt(32)/(sqrt(48)/sqrt(6))). sqrt(5) Simplify ((2sqrt(315))/sqrt(5) - sqrt(126)/(sqrt(50) + sqrt(2)))2. 847/4 Simplify ((1sqrt(170) - sqrt(170))/sqrt(10) - (sqrt(17) + 1sqrt(17)-1))*2-6. 0 Simplify 1 + (sqrt(192) + (0 + sqrt(192))*2 - (sqrt(3) - sqrt(21)/sqrt(7))-3). 8sqrt(3) + 193 Simplify ((sqrt(76) - (sqrt(76) + -1sqrt(76)))*2 - ((3sqrt(19))*2 + 1)) + -4. -100 Simplify -3 + (2sqrt(2299) - sqrt(2299)). -3 + 11sqrt(19) Simplify 1((sqrt(931)-1 - sqrt(931)) + -5)2. 140sqrt(19) + 3749 Simplify -3sqrt(847)-4 + ((sqrt(847) - (sqrt(847) + 3sqrt(847)) - sqrt(847)) + 4 - sqrt(847))2. -308sqrt(7) + 21191 Simplify -4sqrt(57)/sqrt(3) - sqrt(19)-1-3. -7sqrt(19) Simplify -2 + 1 + 1sqrt(1008). -1 + 12sqrt(7) Simplify sqrt(117)/sqrt(36) - sqrt(65)/(sqrt(5) - (sqrt(5) + sqrt(20))). sqrt(13) Simplify (-2 + sqrt(200))*2. -40sqrt(2) + 204 Simplify 1((sqrt(11) + 1sqrt(99))*2 - sqrt(176)-1). 4sqrt(11) + 176 Simplify 5(sqrt(21)/sqrt(3) + -1). -5 + 5sqrt(7) Simplify 3 + 0 + sqrt(1088). 3 + 8sqrt(17) Simplify (-5sqrt(104)2)/((sqrt(800)2 - sqrt(800)) + sqrt(800) + sqrt(800)). -sqrt(13)/3 Simplify 1 + 2sqrt(208) + -1 + -2. -2 + 8sqrt(13) Simplify ((sqrt(275) + (sqrt(275) - ((sqrt(275) + sqrt(275) + sqrt(275)1 - sqrt(275) - sqrt(275)) + -3)))-4)2. 480sqrt(11) + 4544 Simplify sqrt(33)/(sqrt(18)/sqrt(6)) - (-2sqrt(176) - sqrt(176))2. -1584 + sqrt(11) Simplify (-4sqrt(220))/sqrt(11). -8sqrt(5) Simplify (5 + sqrt(500) + 2 + sqrt(500))3. 21 + 60sqrt(5) Simplify (sqrt(75) + -1)2 - sqrt(3)-1-6. -16sqrt(3) + 76 Simplify -5(sqrt(3) - (sqrt(3) + sqrt(18)/sqrt(6))2)-5. -300 + 25sqrt(3) Simplify (sqrt(931) + -1 + sqrt(931))2-4. -14900 + 112sqrt(19) Simplify (sqrt(60)/sqrt(4)-1)/(sqrt(3) + (sqrt(3) - (sqrt(6)/sqrt(2) + sqrt(3)))4). sqrt(5)/3 Simplify (sqrt(27) - sqrt(3)) + -3 + sqrt(30)/(sqrt(50)/sqrt(5)). -3 + 3sqrt(3) Simplify -1(sqrt(176) + -2). -4sqrt(11) + 2 Simplify (0 + sqrt(162) + -2 + -3)*2. -90sqrt(2) + 187 Simplify sqrt(4)/(-3sqrt(6)/sqrt(3)). -sqrt(2)/3 Simplify sqrt(56)/(sqrt(800)1). sqrt(7)/10 Simplify (-4 + -6(sqrt(300) + 1) + sqrt(300))2. 1000sqrt(3) + 7600 Simplify (-2(sqrt(85) + -1sqrt(85) - sqrt(85)))/(sqrt(10)/(1sqrt(2))). 2sqrt(17) Simplify (3sqrt(625) + sqrt(25))/(sqrt(5) + 3sqrt(605) + sqrt(605)). 16sqrt(5)/45 Simplify sqrt(10)/(sqrt(5) + sqrt(40)/(sqrt(16)/sqrt(2)))5. 5sqrt(2)/2 Simplify (-1(sqrt(3) - sqrt(192)2))2. 675 Simplify 1 + (sqrt(110)/(sqrt(30)/sqrt(3)))2-2. -21 Simplify (sqrt(38) + -3sqrt(342))/sqrt(2). -8sqrt(19) Simplify ((sqrt(162) + 1sqrt(162) + sqrt(162) - sqrt(162) - sqrt(162))/sqrt(9))/(-2sqrt(225))2. -sqrt(2)/5 Simplify (sqrt(19) + sqrt(57)/sqrt(3)4 - (sqrt(133)2)/sqrt(7))-1. -3sqrt(19) Simplify (sqrt(28) + sqrt(140)/sqrt(5))6. 24sqrt(7) Simplify -5-4(sqrt(99) + 1). 20 + 60sqrt(11) Simplify 4(sqrt(11) - (sqrt(396) + 1 + sqrt(396))). -44sqrt(11) - 4 Simplify (2sqrt(68) + (-2 + -2sqrt(17) - sqrt(17)))*2. -4sqrt(17) + 21 Simplify (-2sqrt(52)/(sqrt(100)-6))*2. 13/225 Simplify (-2 + (sqrt(425) - (sqrt(425) - (sqrt(425) + -1) - sqrt(425))) + -4(sqrt(425)1 + sqrt(425)))2. 180sqrt(17) + 15309 Simplify sqrt(2448) + -1 + 3. 2 + 12sqrt(17) Simplify 5(sqrt(8) + -4). -20 + 10sqrt(2) Simplify sqrt(65)/((sqrt(5) - sqrt(80))6)-5. 5sqrt(13)/18 Simplify -3 + -5 + -5 + sqrt(21)/sqrt(3). -13 + sqrt(7) Simplify (sqrt(5)41-6 + -4)2. 192sqrt(5) + 2896 Simplify (2sqrt(7)-1 - sqrt(7))*2-2 + 5 + 4. -117 Simplify 61sqrt(567)5. 270sqrt(7) Simplify sqrt(1216) + 0 - sqrt(304)3. -4sqrt(19) Simplify -3 + 5 + (sqrt(704) - sqrt(704)-1). 2 + 16sqrt(11) Simplify ((-5-1sqrt(99))/(sqrt(144)-2 + sqrt(144)))2. 275/16 Simplify (2 + 4sqrt(275))*2. 80sqrt(11) + 4404 Simplify 2(3(-1 + sqrt(80)))*2. -144sqrt(5) + 1458 Simplify (sqrt(6)/sqrt(3)4)2 + (sqrt(50)2 - sqrt(2)). 9sqrt(2) + 32 Simplify (sqrt(405)/(sqrt(9)2))/((sqrt(108) + sqrt(108) + 2sqrt(108))/sqrt(12)). sqrt(5)/8 Simplify (-5 + sqrt(38)/((sqrt(32)/sqrt(4))/sqrt(4)))2. -10sqrt(19) + 44 Simplify (-5sqrt(320)1 + (sqrt(320) - (-2 + sqrt(320)-1)) + sqrt(320))2. -64sqrt(5) + 1284 Simplify -6(sqrt(1331) + 2 - sqrt(1331)). -12 Simplify (sqrt(143)/(sqrt(275) - (sqrt(275)2 + sqrt(275) + sqrt(275)))6)2. 52/25 Simplify (-2sqrt(165)/sqrt(5))/sqrt(11). -2sqrt(3) Simplify 0 + ((sqrt(17) - ((sqrt(204) - (sqrt(204) + sqrt(204)1 + sqrt(204))) + sqrt(204))/sqrt(12)) + -4 + sqrt(17) + 0)*2. -24sqrt(17) + 169 Simplify ((-3sqrt(180) - sqrt(180))/sqrt(10))/(sqrt(42)/(sqrt(7)1)). -4sqrt(3) Simplify 5sqrt(1700) - (sqrt(17) - (sqrt(187) + sqrt(187)-4 + sqrt(187))/sqrt(11))2. -153 + 50sqrt(17) Simplify ((sqrt(120)3)/sqrt(5))/((sqrt(120)/sqrt(2))/sqrt(5)). 3sqrt(2) Simplify -2((-1 + sqrt(567) - sqrt(567)) + (sqrt(21)/sqrt(3))2 + -3). -6 Simplify ((2 + sqrt(720) + -4 - sqrt(720)) + -2)2. 16 Simplify (sqrt(42)/(sqrt(6)/sqrt(3)))/(-2sqrt(12)/sqrt(4)). -sqrt(7)/2 Simplify ((sqrt(484)-3)/sqrt(11))/sqrt(4) + -2. -3sqrt(11) - 2 Simplify (sqrt(20) - (3sqrt(200))/sqrt(10))/(-4sqrt(12)/sqrt(3)). sqrt(5)/2 Simplify ((sqrt(304) + 0 + sqrt(304))*2 + -2 + 2 + sqrt(19) + sqrt(19))2. 4sqrt(19) + 2432 Simplify 5(5 + sqrt(2) + 0)*2 + 4. 50sqrt(2) + 139 Simplify (-2sqrt(13) + 3)22. -24sqrt(13) + 122 Simplify 3 + sqrt(99)/(sqrt(9) + sqrt(36)/sqrt(4)). sqrt(11)/2 + 3 Simplify (sqrt(600) - (sqrt(600) - sqrt(600)-2))/((-2sqrt(132))/sqrt(11)). 5sqrt(2) Simplify -6(sqrt(102)/sqrt(6))*2 + -3. -105 Simpl	{ "pile_set_name": "DM Mathematics" }
y = 5.8 + -30.8. Let h = 25.1 + y. Which is the nearest to 6? (a) -3 (b) -0.3 (c) h c Let n = 0.28 + 0.02. Let u = -82/5 - -169/10. What is the nearest to u in 2/13, 2/3, n? 2/3 Suppose -8h = -111 - 33. What is the closest to h in -3, -5, 0.4? 0.4 Suppose -5w = -3q - 2, 4w = -q - 51 + 39. What is the nearest to w in 0.2, -0.1, 85? -0.1 Let t = -4.68 + -0.32. Let d = -100 - -97. What is the nearest to 0 in t, 2, d? 2 Let r be 88/1100(-1 - -2)5. Which is the closest to 0.1? (a) 1 (b) 3 (c) r (d) 9 c Let n be (-23)/463/3. Let t = -15 + 14. Which is the closest to n? (a) t (b) 0.5 (c) -0.1 c Let z = 102 + -117. Let v = -0.064 - 14.536. Let j = v - z. Which is the closest to 0.2? (a) -5/4 (b) j (c) -0.1 b Let g = 11 + -10.9. Let m = 0.2 - 0.01. Let t = m - -0.11. What is the closest to g in -1/4, t, 5? t Let v(u) = 5u*2 - 55u - 3. Let h be v(11). Which is the closest to -2/3? (a) -2 (b) h (c) 4 (d) 5 a Let p be 3/(-8) + (-3)/(-8). Which is the closest to 4? (a) -3 (b) p (c) 0.09 c Let u = 5.0435 - 0.0435. Which is the closest to u? (a) -0.5 (b) -5/4 (c) -2/7 c Let s = 4.545 + 0.455. Which is the closest to -0.1? (a) s (b) -4 (c) -2/3 c Let w = 0.7 + 3.3. Which is the closest to 0.1? (a) 1/4 (b) w (c) -1 a Let u be 24/7 + (22/14 - 2). Suppose 5g + 5k = 4k + 9, 0 = -ug - 5k + 1. Which is the closest to 0.3? (a) 2/11 (b) g (c) 0.1 a Let h be (-3)/(6/(-12) + 2). What is the nearest to -5 in -0.4, h, 2? h Let y = -250.9 - -251. What is the nearest to y in 0, -0.1, 1.1? 0 Let r = 0.5 + 4.5. Let m = 17.7 - 18. Let o = m + -0.1. Which is the closest to 1? (a) r (b) o (c) -0.3 c Let j be (-4 + (-1820)/(-355))(-2)/(-9). Let q = j - 2/71. Let d = 3/34 - -24/17. Which is the closest to 2? (a) d (b) q (c) -4 a Let l be (-2)/(-4)2 - 1. Let w be (873/48)/((-72)/(-32)). Let h = w - 25/3. What is the closest to l in 1/3, h, -0.2? -0.2 Let t be 43 - (1 + -2 + -2 + 3). Let n = 42 - t. Which is the closest to n? (a) 0.5 (b) -5 (c) 0.3 c Let i = 2088 - 2088.05. Which is the closest to -2/9? (a) i (b) 2 (c) 4/3 (d) -2/9 d Suppose -59s + 150 = -145. What is the nearest to 2 in s, 4, -0.13, 1? 1 Let k = -79728 - -638759/8. Let p(j) = -2j3 + 6j*2 - j - 12. Let g be p(5). Let y = g + k. Which is the nearest to 0? (a) y (b) 3 (c) 0.4 a Let x = -26 - -28. Suppose 2o + 3m = -3, o - xo + 5m = 8. Which is the nearest to 0.1? (a) o (b) -1/6 (c) -0.2 b Let o = 0.1 + 0. Let x = 3/4 + -7/20. Let u = -1.52 + 4.52. Which is the nearest to o? (a) x (b) u (c) 2 a Let z(l) = l + 1. Let u be z(0). Let y = -1.539 - -1.339. Which is the nearest to u? (a) y (b) 0.03 (c) 3/7 c Let l be (108/(-42) - -2)(-14)/12. Which is the nearest to l? (a) -18 (b) -2/5 (c) -5 b Let v = -611.3 - -670. Let s = -59 + v. Which is the nearest to -4? (a) -2/17 (b) s (c) -1 c Let l = -4.58 - -6.58. What is the closest to 0.2 in -0.36, l, -1/8, 5? -1/8 Let d = -1.12 + 1.17. What is the nearest to 1 in d, 0, 0.3? 0.3 Let u = -28.51 + 0.51. Let y = u + 28.5. Which is the closest to 1? (a) 5 (b) 2/9 (c) y c Let g = -23 + 24. Let o = -106 - -114. Which is the closest to -1/4? (a) o (b) 3 (c) g c Let h = -1.14 - -1.24. Which is the nearest to h? (a) 2 (b) -2/5 (c) 0.2 c Suppose -1184n = -1187n. Which is the closest to 1? (a) -4 (b) n (c) 168 b Let n = -11.9 - -12. Let a = 56 - 55.7. What is the closest to n in -1, a, 0.36? a Let j = 4.94 - -0.06. Let t = j + -7. Let s = -6 + 3. Which is the closest to t? (a) 2/3 (b) s (c) -2/7 b Let w = -1.5 + 1.49. Let j = w + 38.01. Let t = 32 - j. What is the nearest to t in -0.1, 5, 1/2? -0.1 Let k = 3.3 + -11.8. Let y = 9 + k. Let g = 0.9 - 1. Which is the closest to g? (a) y (b) -5 (c) 0.3 c Let g = -165.57 + 167. Let k = g + -0.43. Suppose -3a = -2a + 3. What is the closest to -0.1 in k, a, 4? k Let r = 1.44 + -4.14. Let h = r - -3.1. Let a be (1 + -1)/(-1 - 1). What is the nearest to a in h, -4, 0? 0 Suppose 4j = 20, -6 = -2q - j - 3. Let i be q/(-8) - (-9)/(-72). Which is the nearest to -11? (a) 1/6 (b) i (c) -2 c Let g be 14/(-3)108/(-21). Let n be ((-9)/g)/((-1)/(-4)). Which is the nearest to -1/3? (a) 1 (b) n (c) -5 b Let f = -68 + 67.5. Let g = -396 - -819/2. Let v = g + -129/10. What is the nearest to -1 in 3/2, f, v? f Let l = 224 + -182. Which is the nearest to 0? (a) 0.2 (b) l (c) -3 a Suppose n + 3n = 284. Let g = 70 - n. Let i = 0.2 - 0.2. What is the closest to 1 in g, -0.2, i? i Let m = 1.2 + -1.4. Let v = -44.39 + 44.4. What is the nearest to 0 in -2, m, v? v Let k = 23/10 - 9/5. Let n = -1.3 - -1. Let x = n + -0.2. Which is the closest to k? (a) 3 (b) x (c) 0.4 c Let h = 5/6 - 1/6. Let j = -128 - -128. Which is the nearest to j? (a) -4/7 (b) h (c) 3 a Let k = -787 + 788. Which is the closest to -2/9? (a) -5 (b) -36 (c) k (d) -1 d Let i = -0.043 + -2.957. What is the nearest to 2 in -8, 0.4, i? 0.4 Let k = 245 + -234. Which is the closest to -1/4? (a) 1/5 (b) k (c) -4 (d) -0.4 d Let c be ((3 - 1) + -3)59. Let m = -4/76447 + -58481903/993811. Let r = m - c. What is the nearest to 0.1 in r, 0.3, 3? r Let j = -8 - -9. Suppose 3y + 4h + 28 = 0, 3y - 8y - 32 = 3h. Which is the closest to -0.1? (a) 0.4 (b) j (c) y a Suppose g - 2g = 0. Suppose 28 = 5i - 4c, -5i - 3c + 14 = -gi. What is the nearest to 3/5 in i, 0.5, 5? 0.5 Let y = 13 + -3. Let x = -2 + y. Let k be 12/x + 3/2. Which is the nearest to -3? (a) 0 (b) -0.3 (c) k b Let r = -519 + 522. Which is the closest to 0.3? (a) 4 (b) 0.3 (c) r b Let n = 0.3309 - 0.0309. Which is the nearest to n? (a) -1 (b) 2/3 (c) 1 b Suppose 2t - f - 5 = 0, 10 - 20 = 4t + 2f. Let v = -0.8 + 1. What is the closest to v in 0.5, t, -0.2? t Let c = 87.3 - 87.2. What is the nearest to c in -0.5, -6, 0.1? 0.1 Let t = 733 + -728. Which is the nearest to -0.1? (a) 3/7 (b) 0.1 (c) -12 (d) t b Let t = -433 - -1731/4. What is the nearest to t in 1, 0, -0.1? -0.1 Let g = -1 + 0.7. Let n be 4/3 + 6 + (-15)/2. Let x be -2 - (2 + 34/(-9)). Which is the closest to x? (a) -5 (b) n (c) g b Let r be ((-1)/2 - 0)0. What is the closest to -0.2 in r, -26, -2/13? -2/13 Let f = -186 + 186.5. What is the nearest to 0 in -2/19, f, -4? -2/19 Let j be (-16)/(-10) - (-6)/15. Let w = -28 - -26. Let z = 55 - 54. Which is the nearest to z? (a) -0.1 (b) j (c) w b Let h be 1 + 2/(-2) - 0. Let s = 82/3 - 27. Let t = 45/266 + -1/38. What is the nearest to h in s, 2/3, t? t Let g = 461/1092 + 1/156. Let w be (10/3 - -1) + -4. Let j = 0.04 - 4.04. What is the nearest to w in j, g, 0.1? g Let h = -98.1 - -98. Let v be (-2)/(-6) + 8/(-12). What is the nearest to 0 in h, v, 36? h Let l = 0.8 + -0.3. Suppose -97x = -174 + 465. Which is the closest to x? (a) -3 (b) l (c) 0 a Let w(n) = -39n + 44. Let z be w(1). Which is the closest to -2/5? (a) -0.1 (b) z (c) 0 (d) 25 a Let h = -1605 - -1627.97. Let q = -23 + h. Let f = q + 0.23. What is the closest to f in 0.2, 4, -5? 0.2 Let o be (-357)/153 - 82/(-30). Which is the closest to 16/5? (a) o (b) 0.3 (c) 0.2 a Let o = 132.1 + -132.3. Which is the nearest to 2/63? (a) o (b) -2 (c) -2/13 c Suppose -a = s + 3a - 112, 2s + 3a = 204. Let g be 3 + s/(-52) - (-3)/(-3). What is the closest to g in 2, 5, 4? 2 Let d = 3 + -2. Let j = 700 - 700.1. Which is the nearest to j? (a) 4 (b) -1/21 (c) d b Let f = -7.36 - -2.36. What is the nearest to 0 in f, 0.3, 4? 0.3 Suppose 22k + 44 + 0 = 0. Which is the closest to 0? (a) -5 (b) k (c) 0 c Let x = -0.323 - -0.373. Which is the nearest to x? (a) 3 (b) -0.5 (c) -2/15 c Let i = -0.8 - -0.4. Let l = 0.2 + i. Let u = -13792 + 41378/3. What is the closest to u in l, -1/7, -0.3? -1/7 Let x(i) = -i + 4. Let q be x(5). Let f be (-1 - q)(2 + -3). Which is the closest to 3? (a) -1 (b) f (c) -2/5 b Let l be (-6)/(18/4(-2)/(-6)). Let o be ((-6)/l)/(4/(-2)). Let d be 16/(-9) + (-4)/18. Which is the nearest to 0? (a) d (b) 3 (c) o c Let m = -734/77 - -108/11. Let k = 0 - 1. Let g = 11 + -10. What is the closest to g in -5, k, m? m Let q(p) = 7p - 2. Let n be q(-6). Let f be n/(-36) - 3/3. Let z = -134/3 - -45. What is the closest to 0.1 in 0.1, f, z? 0.1 Suppose -2g + 2 = q - 4, -5*q = -20. Supp	{ "pile_set_name": "DM Mathematics" }
3/136 Two letters picked without replacement from cpcfpkcppphcfppppp. What is prob of picking 1 f and 1 p? 20/153 Two letters picked without replacement from nqnffdo. Give prob of picking 1 n and 1 d. 2/21 Three letters picked without replacement from uppuwppuuuuwwppuup. Give prob of picking 1 p and 2 u. 49/204 What is prob of picking 2 h and 2 i when four letters picked without replacement from ihihihi? 18/35 Four letters picked without replacement from ksbgtgbbgtbb. Give prob of picking 2 t and 2 g. 1/165 Three letters picked without replacement from {t: 1, x: 2, g: 4, l: 1, w: 3}. Give prob of picking 2 g and 1 t. 2/55 What is prob of picking 4 x when four letters picked without replacement from {x: 8, z: 2}? 1/3 Four letters picked without replacement from ffeeeeqehqweqe. What is prob of picking 1 h, 1 e, and 2 f? 1/143 Calculate prob of picking 1 j, 1 i, and 2 b when four letters picked without replacement from jrpqirbb. 1/70 Two letters picked without replacement from {c: 2, w: 4, b: 3, l: 2, q: 2, r: 1}. Give prob of picking 1 c and 1 w. 8/91 Three letters picked without replacement from {j: 2, d: 6, t: 1, s: 1, y: 1, r: 5}. What is prob of picking 2 j and 1 d? 3/280 Calculate prob of picking 4 r when four letters picked without replacement from {r: 5, q: 5, x: 1}. 1/66 Three letters picked without replacement from tunubupnupuup. What is prob of picking 1 b and 2 p? 3/286 Two letters picked without replacement from {q: 7, r: 2, i: 6}. What is prob of picking 2 q? 1/5 Calculate prob of picking 1 t, 1 r, and 1 h when three letters picked without replacement from {a: 2, i: 1, t: 5, r: 2, h: 2, b: 1}. 10/143 Calculate prob of picking 2 r when two letters picked without replacement from {z: 1, d: 1, e: 9, n: 1, r: 2, a: 1}. 1/105 Four letters picked without replacement from vxvnnxxnmx. Give prob of picking 1 v, 2 n, and 1 x. 4/35 What is prob of picking 4 z when four letters picked without replacement from {z: 11, o: 1}? 2/3 Calculate prob of picking 2 c and 1 y when three letters picked without replacement from {y: 4, c: 7}. 28/55 Calculate prob of picking 2 t when two letters picked without replacement from {t: 3, x: 7}. 1/15 Four letters picked without replacement from {x: 3, u: 2}. Give prob of picking 2 u and 2 x. 3/5 Three letters picked without replacement from vvvvnvnvnnvnvvnnvvv. What is prob of picking 1 v and 2 n? 84/323 What is prob of picking 2 y when two letters picked without replacement from {y: 6, l: 7}? 5/26 What is prob of picking 2 f when two letters picked without replacement from ffrf? 1/2 What is prob of picking 1 d and 1 i when two letters picked without replacement from {d: 8, y: 7, i: 5}? 4/19 What is prob of picking 3 f when three letters picked without replacement from {f: 4, b: 2, r: 2, k: 5}? 2/143 Calculate prob of picking 1 y and 3 e when four letters picked without replacement from yyeeyyyyyyyyeyyyey. 14/765 What is prob of picking 1 h, 1 t, and 1 k when three letters picked without replacement from {t: 1, x: 1, h: 2, q: 2, k: 4}? 1/15 Three letters picked without replacement from {w: 4, t: 3, r: 2, j: 2, q: 2}. What is prob of picking 1 r and 2 w? 6/143 Three letters picked without replacement from {o: 2, n: 6}. What is prob of picking 2 o and 1 n? 3/28 Two letters picked without replacement from {n: 3, a: 1, x: 5, b: 1, k: 2}. Give prob of picking 2 x. 5/33 Two letters picked without replacement from {p: 3, s: 2, h: 4, c: 6}. Give prob of picking 2 s. 1/105 Calculate prob of picking 2 j and 1 r when three letters picked without replacement from vjrninnjnnnini. 1/364 Three letters picked without replacement from {d: 1, k: 1, n: 1, c: 5, g: 6, y: 2}. What is prob of picking 1 n, 1 c, and 1 d? 1/112 Two letters picked without replacement from rqnrzod. What is prob of picking 1 d and 1 o? 1/21 Two letters picked without replacement from {c: 4, e: 2, q: 2, x: 2, z: 3, n: 2}. What is prob of picking 1 x and 1 q? 4/105 Calculate prob of picking 1 d and 2 v when three letters picked without replacement from dcvv. 1/4 Calculate prob of picking 1 d and 1 o when two letters picked without replacement from tdttdttqttzqdoqtdzd. 5/171 Calculate prob of picking 2 z when two letters picked without replacement from {z: 5, d: 4, l: 8}. 5/68 Two letters picked without replacement from {z: 1, d: 2, v: 6, n: 3, g: 2}. Give prob of picking 1 n and 1 d. 6/91 Two letters picked without replacement from {l: 6, u: 3, o: 1, q: 2, m: 1}. What is prob of picking 1 l and 1 u? 3/13 Calculate prob of picking 2 y, 1 v, and 1 x when four letters picked without replacement from {v: 2, x: 1, h: 1, y: 2}. 2/15 Two letters picked without replacement from {c: 2, d: 3, v: 1, u: 1, h: 4}. Give prob of picking 1 u and 1 c. 2/55 Calculate prob of picking 2 z when two letters picked without replacement from zzuzuuuuuuu. 3/55 Calculate prob of picking 1 u and 1 f when two letters picked without replacement from fuff. 1/2 Three letters picked without replacement from mzxzmmwmkwmzkwmmaazz. What is prob of picking 1 m and 2 z? 7/114 Two letters picked without replacement from {w: 8, y: 1, u: 1, s: 2, k: 2, z: 1}. What is prob of picking 1 s and 1 y? 2/105 Four letters picked without replacement from wrbwrbbwb. What is prob of picking 2 b and 2 r? 1/21 What is prob of picking 1 b and 1 r when two letters picked without replacement from {u: 1, g: 2, r: 1, o: 2, b: 1}? 1/21 Four letters picked without replacement from yydqqyqyyidy. Give prob of picking 1 d and 3 q. 2/495 Two letters picked without replacement from {i: 1, g: 5, t: 3, v: 5, a: 2, l: 4}. What is prob of picking 1 i and 1 l? 2/95 What is prob of picking 1 y and 1 f when two letters picked without replacement from yycycycmmcymyfc? 2/35 Three letters picked without replacement from assgslaglgwaasagw. Give prob of picking 1 g, 1 a, and 1 s. 2/17 Three letters picked without replacement from ywikwifiuyfi. What is prob of picking 1 w, 1 k, and 1 f? 1/55 Calculate prob of picking 1 s and 2 q when three letters picked without replacement from sssqqsqfssqsss. 27/182 Three letters picked without replacement from {x: 4, w: 2, q: 5, f: 2, n: 4}. What is prob of picking 3 n? 1/170 Four letters picked without replacement from {j: 5, b: 8}. Give prob of picking 2 b and 2 j. 56/143 Two letters picked without replacement from jjqgjgij. What is prob of picking 2 g? 1/28 Four letters picked without replacement from {u: 2, s: 2, a: 2}. What is prob of picking 2 u, 1 s, and 1 a? 4/15 Two letters picked without replacement from {b: 3, k: 1, g: 1, u: 1, x: 1}. What is prob of picking 1 u and 1 x? 1/21 Four letters picked without replacement from ffasfffaas. Give prob of picking 1 s and 3 a. 1/105 Two letters picked without replacement from {y: 2, x: 2, z: 1, j: 2, l: 1}. Give prob of picking 1 l and 1 x. 1/14 Four letters picked without replacement from {v: 7, o: 1}. Give prob of picking 4 v. 1/2 Two letters picked without replacement from gqmmbbqbqqbqqqq. Give prob of picking 1 m and 1 q. 16/105 What is prob of picking 2 f when two letters picked without replacement from ffhfhfffffhffffhfhff? 21/38 Four letters picked without replacement from {l: 6, e: 2, r: 2, a: 3}. What is prob of picking 1 e, 2 l, and 1 r? 12/143 Calculate prob of picking 1 x and 3 r when four letters picked without replacement from rrxxrrvvrv. 2/21 What is prob of picking 1 d, 1 o, and 1 y when three letters picked without replacement from {o: 1, y: 3, p: 7, g: 2, d: 5}? 5/272 Four letters picked without replacement from {x: 4, y: 3, o: 5}. What is prob of picking 2 o and 2 y? 2/33 Three letters picked without replacement from sqpsqqqsqpsqsqq. What is prob of picking 1 p and 2 q? 8/65 Calculate prob of picking 2 g, 1 j, and 1 s when four letters picked without replacement from jsgsga. 2/15 Calculate prob of picking 4 a when four letters picked without replacement from {t: 3, a: 2}. 0 Two letters picked without replacement from twwwlwtwwwwdw. Give prob of picking 1 l and 1 t. 1/39 Two letters picked without replacement from {t: 10, c: 3, m: 2, j: 1}. What is prob of picking 1 m and 1 j? 1/60 Two letters picked without replacement from jjc. What is prob of picking 2 j? 1/3 Two letters picked without replacement from {w: 1, b: 4, a: 2, g: 1	{ "pile_set_name": "DM Mathematics" }
in decreasing order. 16, -1/6, q, -3 Suppose -4 = -2h + 2y - 3y, 0 = 5h - 3y - 32. Suppose -t - 15 = -5c, t - hc = -12 + 1. Let v = 0 + -4. Put t, v, 2 in ascending order. v, 2, t Let y = 2 - 1. Let z be y/(-12 + -3). Let c = -0.5 + 3.5. Put -0.3, z, c in increasing order. -0.3, z, c Suppose -3p = -2h + 23, -2h - 4p = -0p + 12. Put -3, 6, 0, h in decreasing order. 6, h, 0, -3 Suppose -d = -4t + 6t + 7, 5t + 20 = -5d. Sort t, -5, 1 in increasing order. -5, t, 1 Let h = -119762/45 - -2661. Let d = 2/45 + h. Sort 0, 0.5, d. d, 0, 0.5 Let i(c) = -5c*2 + 2c - 1. Let w be i(1). Suppose -4 - 1 = d. Sort d, w, -0.3. d, w, -0.3 Let c = -65 - -70. Sort 1, 4, c in decreasing order. c, 4, 1 Suppose 0 = 3w + 2 - 14. Suppose -15 - 9 = -3s. Let t = s - 5. Sort t, -3, w. -3, t, w Let a = -3 - -5. Let s be (6/(-12))/((-1)/10). Sort -1, a, s. -1, a, s Let q be 0(1 + -2) + (-18)/9. Sort -14, q, 5 in descending order. 5, q, -14 Suppose 0 = 5h - 7u + 9u + 1, 2u + 6 = 0. Put h, -4, -21, 0 in descending order. h, 0, -4, -21 Suppose 4r - 6r = -10. Suppose 3i + r + 1 = 0. Let j(m) = 4m + 3. Let b be j(-2). Sort -4, b, i in increasing order. b, -4, i Let a be 2/7 - 16/(-42). Let f(w) = -w3 + 7w*2 + 8w - 3. Let b be f(9). Let y be 3 - 1b/(-27). Put a, 5, y in decreasing order. 5, a, y Suppose 4f + 4x = -16, 0 = f + 5x - 9x - 6. Suppose 5k + 15 = 4z, 4k + 8 = -z + 17. Suppose -30 = -5o + 3p, p - 3 = -o - z. Sort f, o, 2/5. f, 2/5, o Let p(j) = -j*2 - 6j - 5. Let g be p(-4). Let r = 9 - 8.95. Let k = r - -0.55. Put k, -2/11, g in descending order. g, k, -2/11 Let i = -17 + 12. Sort 0, i, -0.3 in descending order. 0, -0.3, i Let u = 1.1 + -0.8. Put 1, 0, u in decreasing order. 1, u, 0 Suppose -23h - 4m - 4 = -25h, m + 1 = -3h. Suppose -b + 2w + 3w + 9 = 0, -5w - 15 = 5b. Suppose 3p + 10 = 1. Put h, b, p in ascending order. p, b, h Let d = -4 + 8. Sort d, -1, 1 in decreasing order. d, 1, -1 Let j = 0.1 + 0. Put j, -5, 0 in increasing order. -5, 0, j Let u = 10.24 + 0.76. Sort 0, -1, -1/3, u in decreasing order. u, 0, -1/3, -1 Let q be (1 - 0)2/(-2). Let v(i) = -5i + 1. Let y be v(1). Let z be (-3)/(-9) + (-42)/(-9). Sort q, y, z. y, q, z Let y(o) = -2o + 4. Let d be y(4). Let v be 1/(0 - (-2)/4). Put -1, v, d in increasing order. d, -1, v Let d = 10 + -9. Let m(s) = -s*2 + 8s - 8. Let a be m(7). Let c(l) = -l*3 + 4l*2 + 5l + 3. Let v be c(5). Put d, a, v in descending order. v, d, a Suppose -13 - 6 = 2g + 5q, -4g = 2q - 2. Sort g, -2, -5 in ascending order. -5, -2, g Let p be -3 + (-10)/(-2) - -4. Sort 4, 3, p. 3, 4, p Let w = 7 + -11. Put -1/6, w, -2 in ascending order. w, -2, -1/6 Let r be 7/((-42)/(-48)) + -3. Sort 0.1, r, -1 in descending order. r, 0.1, -1 Suppose 2s + s = -6. Let b(y) = 2y*2 + 3y. Let p be b(s). Sort 0.04, p, -2 in decreasing order. p, 0.04, -2 Let c = 7.513 - -0.087. Let j = -8 + c. Put j, 0.3, 0.1 in increasing order. j, 0.1, 0.3 Let t = -4 + 4.05. Let x = -2.95 - t. Sort 4/5, x, -2/5. x, -2/5, 4/5 Let s(n) = -n - 2. Let x be s(-3). Suppose -5u - 3a = -u - 26, 5u - 3a - 19 = 0. Suppose -80k = -78k + 10. Sort u, x, k in ascending order. k, x, u Let w = 0.4 + -0.9. Sort 0.5, 8, w in decreasing order. 8, 0.5, w Let s = -3 + 2. Let b = -0.7 - s. Let n = 2.4 + -0.4. Sort b, n, 1 in decreasing order. n, 1, b Let m = 1.62 - 1.42. Let i = 3 + -2.4. Let p = i - m. Put p, -5, -2/9 in descending order. p, -2/9, -5 Let v = -8 - -5. Suppose 0m - m + 18 = 5h, -6 = 3m. Let z(p) = -p2 + 2p. Let c be z(2). Put c, v, h in ascending order. v, c, h Let k = -72 - -76. Sort k, -0.4, -0.1, -4 in ascending order. -4, -0.4, -0.1, k Let l be -2 - 8/39/(-6). Sort l, -1, 5, -3 in decreasing order. 5, l, -1, -3 Suppose 3t - 2 = t. Let k be 5 - (4 + -1 + -7). Put k, t, 4 in decreasing order. k, 4, t Let i = -10 + 9.5. Sort 0.5, i, -0.1 in increasing order. i, -0.1, 0.5 Suppose 0 = -4b + b + 21. Suppose -bt + 6t = 5. Let j = 2.8 + -3. Sort j, -2, t. t, -2, j Let q = 130 - 128. Sort q, 5, 0, 8 in descending order. 8, 5, q, 0 Suppose 4p + d = -2d + 11, -2d + 14 = -4p. Let t be p + -12/(-1). Put 4, t, -4 in ascending order. -4, t, 4 Let v be (-2)/2 - -2 - 0. Suppose -a = 2l - 4a - v, 4l = -a + 23. Sort l, 2, 0 in decreasing order. l, 2, 0 Let n(w) = -2w*3 + 3w*2 - 3w + 4. Let a be n(3). Let h be (3/(-6))/((-1)/a). Let l be (h/(-10))/(2/5). Sort 2, l, 3 in descending order. l, 3, 2 Suppose -28 = 3i + i. Let a be i/5 - (-10)/25. Sort a, 4, 5 in increasing order. a, 4, 5 Let q = 100/21 + -16/3. Let n = -161/4 + 40. Let m = -26 - -26. Sort n, q, m in descending order. m, n, q Suppose -5t + 32 = 2m - t, 25 = 5t. Let c be m/(-52)(-8)/6. Let j = 2.6 + -3. Sort c, 0.4, j in descending order. 0.4, c, j Suppose -4h + 31 - 11 = 0. Sort h, 4, 2 in descending order. h, 4, 2 Suppose 4d + 2g = 8 + 42, d + 5 = -4g. Suppose -2u - d = 3u. Put u, 1, -5 in descending order. 1, u, -5 Let t = -4 + 23. Let l = t + -17.4. Let v = l + 0.4. Put v, 1/2, 0.2 in increasing order. 0.2, 1/2, v Suppose 3j + 2m - 164 = -j, 5m + 52 = j. Let h be j/36 - 4/6. Put h, -3/8, -4/5 in increasing order. -4/5, -3/8, h Let f = 0.953 - -0.047. Sort -0.1, f, 4. -0.1, f, 4 Let k = 39 - 118/3. Put -1/8, k, 0.2 in increasing order. k, -1/8, 0.2 Suppose 0 = -0i + 2i + 4. Let q be 2 - (-2 - -1)i. Suppose -6k - 5n = -k + 10, k - 4n + 7 = 0. Sort -1, k, q in descending order. q, -1, k Let n = 18 - 16. Let y be -2(n + -1)/(-7). Sort 0.1, y, 3 in descending order. 3, y, 0.1 Let x(o) = -5o - 2. Let j(f) = -6f - 2. Let h(c) = -6j(c) + 7x(c). Let m be h(2). Let q = 29/10 - 299/110. Sort q, 1/8, m in ascending order. m, 1/8, q Let l(b) = -b3 - 3b*2 - b + 2. Let t be l(-3). Suppose 5a + 20 = a. Put -4, a, t in decreasing order. t, -4, a Let z be (-2)/(-8)7/(-7). Let h = 0.25 + 0.05. Let x = -5 + 5. Sort z, x, h in descending order. h, x, z Let p(f) = -3f + 5. Let i be p(3). Suppose a - 5a = -20. Sort -1, a, i. i, -1, a Let c(w) be the first derivative of w4/4 + 2w*3 + 7w*2/2 + 3w - 1. Let g be c(-6). Let u be 2/(-6) + g/(-36). Sort -2, u, 0 in increasing order. -2, 0, u Let j be 1/(-4 + 4 + -1). Put 1, j, 2 in descending order. 2, 1, j Suppose -x - 3f = -1, -3 + 1 = -2x - 4f. Sort x, -4, -1, -2 in descending order. x, -1, -2, -4 Let q = 0 + 5. Let n = 1 + 1. Suppose -ny + 5y = -15. Sort -1, y, q in increasing order. y, -1, q Let j = -4/5 + -17/10. Let y = -64 - -66. Put y, j, 0.1 in increasing order. j, 0.1, y Let p = -43 + 45. Put 1, p, 1/10, 9 in ascending order. 1/10, 1, p, 9 Let h = -3/46 + 101/138. Let x = 1 + -1.2. Sort -2, h, x. -2, x, h Suppose -5i = 2u - i, 3u = 4i - 10. Let s be ((-3)/(-1))/((-3)/u). Let w = 2 - 7. Sort w, 0, s in decreasing order. s, 0, w Let p = 100.2 + -100. Let c = -7 + 4. Sort c, p, -0.2. c, -0.2, p Let w(g) = g3 + 17g2 + g + 15. Let n be w(-17). Let z(m) = m3 + 2m2 - m + 3. Let o be z(-3). Sort -5, o, n in increasing order. -5, o, n Let y = 123 + -122.6. Sort -3, -0.19, y in ascending order. -3, -0.19, y Let o be (6/1)/(6/4). Suppose -5z = -4z. Suppose 5f + zf - 25 = 0. Put -4, f, o in ascending order. -4, o, f Let d = 3 + -2. Let t(q) = 5q*3 - 2q - 1. Let l be t(-1). Suppose -a - 3a = 0. Put a, l, d in decreasing order. d, a, l Let v = 115 + -29. Let c be v/(-30) + (-8)/60. Sort -1, 1, c in increasing order. c, -1, 1 Let t = -56 - -44. Put t, 5, 1, -1 in descending order. 5, 1, -1, t Let i = 2 + -6. Let w = 0.7 + -1.02. Let t = -0.08 + w. Sort t, 0.1, i in decreasing order. 0.1, t, i Let w = 165.3 + -165. Sort w, -4/3, -2/7 in descending order. w, -2/7, -4/3 Suppose 25 - 20 = -w. Put w, 3, -2, -3 in descending order. 3, -2, -3, w Let i be (-66)/36 + 1/3. Let h = 23 + -22.6. Sort i, 0, h in increasing order. i, 0, h Let g = 1/73 - -139/511. Sort 4/9, g, 0 in ascending order. 0, g, 4/9 Let c = 13/20 + -2/5. Let p(x) = x2 + 6x - 10. Let t be p(-7). Let a be t + (-3 - (-236)/40). Sort a, c, -3. -3, a, c Let z(a) be the third derivative of a*6/120 - 2a5/15 + a4/4 + 4a3/3 - 2a*2. Let u be z(7). Put u, 4/9, -0.5 in ascending order. -0.5, 4/9, u Suppose 0 = -4d - 3h - 5, -4d = 4*h + 1 + 3. Let q be d + (-3)/(-1) + -1. Suppose q	{ "pile_set_name": "DM Mathematics" }
actor of (-21)/((-21)/u - -2)? True Suppose -717 = -3l + 84. Suppose -3f - 36 = -l. Is f a multiple of 23? False Let r = 42 + 94. Suppose -4w + 281 = -p, -p + 66 + r = 3w. Does 21 divide w? False Let u(x) be the first derivative of x*4/4 - 2x*3 - 4x*2 + 9x + 1. Suppose 0b - 2b = -14. Does 2 divide u(b)? True Let i = 0 - -2. Suppose -is = 4y - 24, 3s - 4y + 4 = -2y. Suppose -3t + 130 = st. Is t a multiple of 13? True Let u = 11 + 49. Is 3 a factor of u? True Let d(u) = -u3 - 6u*2 - 2u + 3. Is d(-6) a multiple of 5? True Let t(q) = -q + 270. Does 48 divide t(0)? False Let o = 9 + -4. Let w be (-14)/(o/((-5)/2)). Let u = w + -4. Is u a multiple of 3? True Suppose 0 = -x + 8x - 140. Is 13 a factor of x? False Suppose 10 = 6a - 14. Is a even? True Let y(r) = -r*3 - 5r*2 - 3. Let d be y(-5). Let x(p) = -p + 2. Let c be x(0). Is 28 - (c + 6/d) a multiple of 11? False Let t = 6 - 5. Suppose 46 = -5n + 2b - 6b, -b = -t. Does 4 divide 2 + 0 + n/(-2)? False Let y(h) = h*2 + h - 4. Let l(q) = 4q*2 + 2q - 12. Let o(v) = 2l(v) - 7y(v). Is 2 a factor of o(3)? True Let y be ((-8)/(-4))/((-2)/7). Is y/48/(-2) a multiple of 5? False Let f(a) = -a2 - a + 38. Let m be f(0). Suppose 7 - m = -3z + 2c, 2c + 22 = 2z. Does 9 divide z? True Let z be (1 - -1) + 64/(-8). Let b = 38 - z. Does 22 divide b? True Let i = -274 - -560. Is i a multiple of 15? False Suppose -4h = -0h - 64. Does 8 divide h? True Let f(m) be the second derivative of m5/20 + 5m*4/6 + 5m3/3 + m2/2 - 4m. Is 20 a factor of f(-8)? False Let u(j) = 5j*2 + 4. Let k be u(-4). Suppose -6t - k = -2t. Let r = 65 + t. Is 22 a factor of r? True Suppose 18 = 6v - 4v. Let b be (-3 - 0) + 0/(-2). Let i = b + v. Is i a multiple of 3? True Is 12 a factor of 1204/20 + 4/(-20)? True Suppose -324 = -4l - 2o, 4l - o = -0o + 330. Is 28 a factor of l? False Let c = 18 - 10. Suppose -5z - 68 = -4x - 3z, -4z = c. Is x a multiple of 8? True Is 9 a factor of 18((0 - 2) + 4)? True Suppose -26 = -5j + 3s, 0j + 5j = -s + 18. Suppose -2i = 4d - 102, ji = 5d - 0d + 165. Is i a multiple of 27? False Suppose v + 16 = -4w, 3w - 5w - 30 = -5v. Suppose -5i - vj + 100 = j, 2i + 3j = 42. Does 9 divide i? True Let d(v) = 2v - 12. Is d(16) a multiple of 4? True Let d = 101 + -65. Let c = -7 + 99. Suppose 2z - d = -2m, -5z - 2m + c = m. Is 10 a factor of z? False Suppose 1220 = -5q - 115. Let u = -181 - q. Does 25 divide u? False Let i = -54 - -85. Let f be ((-60)/(-16))/(2/(-8)). Let u = f + i. Is 16 a factor of u? True Let g(j) = -j3 + 9j*2 + 4j - 4. Let c be 9 + 0(-4)/(-8). Is g(c) a multiple of 8? True Suppose 2d + 0d = 52. Is 12 a factor of d? False Let l = -222 - -407. Suppose -3n = -5f + l, -f - 5n - 2 = -11. Does 17 divide f? True Let t be (3 - -9)(0 - -11). Let c = t + -85. Does 25 divide c? False Suppose 2r = -2t + 76, -2t + 90 - 12 = 4r. Is 4 a factor of t? False Let p = 32 + 344. Suppose 3r - p = -r. Does 27 divide r? False Let t(k) = -3k3 + 3k*2 - 2k + 1. Let j be t(2). Let g = j + 25. Suppose 0 = -4i - 4a + 32, -2i + g = -0i - 4a. Does 2 divide i? False Let o(x) = 61x*2 - 2x + 1. Let q be o(1). Suppose 0 = 3p + p + 2z - q, 0 = 3p - 5z - 45. Does 4 divide p? False Suppose 0 = 5n + 30 - 10. Is 13 a factor of n/(-10) + (-128)/(-5)? True Let g(u) = 8u + 4. Let n(o) = 9o + 5. Let m(d) = 5g(d) - 4n(d). Let a be m(-1). Is a/(-6) + 8/6 even? True Let p(d) = 5d + 2. Let k be p(-2). Let s be (k/2)/((-4)/22). Let t = s + -8. Is 14 a factor of t? True Suppose 0c + 10 = -c. Let b = 22 + c. Does 6 divide b? True Does 10 divide (14/21)/(-1 + 284/282)? False Let v(y) = -y + 1. Let u be v(4). Let g = u + 11. Suppose -3l - g = -26. Does 6 divide l? True Suppose 5s - 3s = 658. Does 47 divide s? True Suppose 4t - 14 - 10 = 0. Suppose -3d + t = 0, -2b + 3d = -b - 46. Is 11 a factor of b? False Let k(t) be the first derivative of -5t3/3 + 7t*2/2 + 6t + 2. Let r(y) = -6y2 + 6y + 7. Let w(s) = 5k(s) - 4r(s). Is w(8) a multiple of 9? False Suppose -6a = -2a + 40. Let w be 127/2 - 0. Let s = w + a. Is 12 a factor of s? False Let k(y) = 4 - 3 - 10 + y. Let v be k(8). Is 2(6/2 - v) a multiple of 4? True Suppose 2h = -2d + 2, 3h - 18 = -0h + 2d. Suppose 0 = 7z - 4z - 135. Suppose -z = o - ho. Does 5 divide o? True Let u(r) = -2r + 1. Let t be u(0). Suppose 0 = p - t - 5. Is p a multiple of 6? True Let m(i) = 8i + 8. Let l be m(6). Suppose -g - l = -5g. Does 7 divide g? True Let p(j) = -j2 + 11. Does 8 divide p(0)? False Suppose 7b = 6b + 238. Is 14 a factor of b? True Let c = 1 + 4. Suppose -4q + 3q - 4 = 0, -4g - q + 12 = 0. Suppose 0 = gk - 2w + w - 10, k - cw = -7. Is 3 a factor of k? True Suppose 3m + 85 = c, 0m + 5m - 5 = 0. Does 11 divide c? True Suppose -p - 5 = -13. Suppose -3v = v - p. Suppose -vz + 26 = 4i - 6i, 3z - 2i = 36. Is 10 a factor of z? True Suppose 30 - 10 = 5i, -4i = 3f - 136. Does 20 divide f? True Suppose -4b - 5 = -21. Suppose -q + 1 = -b. Suppose -2k + ql - 73 = -5k, 5l = -k + 41. Does 8 divide k? True Does 23 divide (-9)/(-12) + 178/8? True Let m be 2 - (1 + -1)/(-1). Is 4 + m - (-2 - 0) a multiple of 4? True Let d(j) = 1. Let o(i) = 12i - 4. Let p(y) = 10d(y) + 2o(y). Is 13 a factor of p(1)? True Suppose -24 = -7a + 3a. Let f = a + -1. Is f a multiple of 4? False Let y(w) = -w2 + 8w + 5. Does 4 divide y(7)? True Let l = 18 + -13. Let j(r) = -r*2 + 5r + 4. Let i be j(l). Suppose -ih - 4n = -76, 4h - 48 = 4n - 4. Does 12 divide h? False Suppose 9 = -4i + 29. Suppose 5t + n - 103 = -0n, 5n = -it + 115. Is t a multiple of 6? False Suppose -8a - 135 = -9a. Is 45 a factor of a? True Let c be -11 - (-3 + -1 + 2). Let m be (3/c)/((-2)/30). Let y(s) = 4s - 5. Is y(m) a multiple of 4? False Does 20 divide 0 + (3 + 0)22? False Let h(o) = o2 + 2. Let b be h(0). Suppose 111 - 27 = bp. Does 19 divide p? False Let g be (-6)/(-8) + 18/8. Suppose 26 = 4m - 9m - 3a, 0 = 2m - ga + 2. Let y = m - -9. Is y a multiple of 3? False Suppose 0g - g = -77. Is 7 a factor of g? True Suppose -w = 3l - 2, -5 = -2l + w + 3. Suppose lh + 0h - q - 19 = 0, -2q = h - 12. Is h a multiple of 5? True Suppose 0 = -4o + 5 + 3. Suppose 5d + 31 = -ou, 3d + 0d + 23 = u. Let y = d + 42. Is y a multiple of 13? False Suppose z - 15 = -2z. Let t(o) = -o3 - 7o*2 + 6o + 11. Let a be t(-8). Suppose -3 - a = -zd. Is d a multiple of 6? True Suppose -3n + 21 = 3f, -3n + 7 = n - 3f. Is (54/n)/(2/4) a multiple of 9? True Suppose y + 549 = 5f, 4f - 8f = 2y - 428. Is f a multiple of 15? False Let r be 5 - (-1)/1-1. Suppose 0 = c + r, -2h - 4c = 3h - 74. Is h a multiple of 9? True Suppose -i = -l - 3l + 281, 0 = 4l + i - 279. Is l a multiple of 14? True Suppose 0 = 5u + x + 3x - 141, u - 5 = 5x. Let h = 41 - u. Does 5 divide h? False Let y(g) = -g*2 - 6g - 4. Let n be y(-5). Let s be n + (10/(-2) - -1). Does 14 divide (0 + s)/((-18)/84)? True Let o(a) = a*2. Let g(p) = 2p - 4. Let m be g(3). Let c be o(m). Suppose -2k + ck = 6, l + k = 35. Does 16 divide l? True Let a be (-8)/(-3) + (-3)/(-9). Let j(c) = 5c2 + 4c - 4. Let h(x) = -4x2 - 4x + 3. Let l(f) = aj(f) + 4h(f). Does 3 divide l(-3)? True Suppose -3r = -0r + t + 55, 69 = -4r + 3t. Let c = -10 - r. Is 15 a factor of (1 - 86/c)-4? False Let t be 2(2 + -13 + 2). Let y = -10 - t. Suppose 3h - 2g = 13, -5h = 3g + y - 36. Is 3 a factor of h? False Suppose 185 = u + 5i, u + 4i = 3u - 356. Is u a multiple of 45? True Suppose -60 = -7d + 2d. Let c be d/42 + 19/7. Suppose co + 123 = 4k - 0k, o = -k + 36. Does 13 divide k? False Let a(w) = 3w2 + 10w - 14. Is 35 a factor of a(5)? False Let v(m) = -m*3 - 5m*2 - 2m - 6. Suppose -7z - 25 = -2z. Let s be v(z). Does 3 divide (3 - (0 + s))-3? True Let l(n) be the third derivative of 2/3n3 + n2 - 1/8n4 + 0 + 0n + 1/120n6 + 3/20n*5. Does 12 divide l(-9)? False Suppose 0f + 68 = 4f. Is f a multiple of 7? False Suppose n - 6 = v, 2n + 2v = 6n - 16. Suppose 190 = 3o + 2q, 0 = -4o - 3q + nq + 260. Suppose -o - 4 = -5d. Is d a multiple of 7? True Let l(a) = -235a*2. Le	{ "pile_set_name": "DM Mathematics" }
+ 2p = -0q - 42 for q. 10 Solve -3c + 0z - 12 = -3z, 0 = 2c - 5z + 14 for c. -2 Solve 2s - 2m - 9 + 1 = 0, -5m + 52 = 3s for s. 9 Solve 22 = -5d - 3y, -2y - 20 = 3y for d. -2 Solve 30 = 5d - 2v, 0 = 4v - 1 + 21 for d. 4 Solve 5m - 4n = 15, 0 = -m + 4n + 14 + 5 for m. -1 Solve 6 = -3s, 22b + 4s + 5 = 23b for b. -3 Solve 0 = k + 3x + 11 - 2, 0 = -k - 5x - 15 for k. 0 Solve t - i = 8, 2i + 9 = 3 for t. 5 Solve 0p + 5u + 30 = -5p, -4u = -6p + 4 for p. -2 Solve 5h - 5 = -5o, 5h + 15 = 5o - 0o for h. -1 Solve 3a + 7 + 5 = 3p, 0 = 3a + p + 4 for a. -2 Solve -5c = 4k - 11, -10 + 1 = -4c - 3k for c. 3 Solve 4s - m - 3m - 4 = 0, 0 = -2s + 3m + 2 for s. 1 Solve -3k + 10f - 20 = 6f, -3k - 4f = -20 for k. 0 Solve -19b = -16b - 4l + 6, 3b - 5l + 9 = 0 for b. 2 Solve -2z - 4 = -2s, 13z - 23 = -4s + 12z for s. 5 Solve -l + 3 = k, 2k + 17l - 14l - 5 = 0 for k. 4 Solve -5s + 26 = -g, -7g - 2 = -4g + 4s for g. -6 Solve 4u + u - f = -14, 3u - 6 = -3f for u. -2 Solve 0 = n + c - 2, -4n + 3c = -3n - 10 for n. 4 Solve 10 = z + 2z - y, 2z + 8 = -3y for z. 2 Solve 0 = 5z - 2s - 15, 40s = -5z + 35s - 20 for z. 1 Solve 0 = 217v - 216v, -5g - 4v - 5 = 0 for g. -1 Solve 3m + 5f - 10 = 0, -6m = -54f + 58f - 26 for m. 5 Solve 2n - 3 = -5x, n - 3x = -0x + 7 for n. 4 Solve -7a - 3h + 0h = -13, -h = 5 for a. 4 Solve h - 4 = -v, 3h + 4v = 2v + 9 for h. 1 Solve -3p + 5 = 2p, -2b - 4 = 4p for b. -4 Solve 57h - 60h + 6 = 0, 0 = 4x + 4h - 12 for x. 1 Solve 5m + 28s = 32s - 46, s = -2m - 8 for m. -6 Solve 3h + 3z = -6, 4h - 2z - 2z = -16 for h. -3 Solve 0 = 3y + l - 0l, -2y - 5l = 0 for y. 0 Solve 16 = -4c + 2x + 2, x = -3c + 2 for c. -1 Solve k + 4k + 10 = 0, -4r - 30 = 5k for r. -5 Solve -d = 0, 1 = g - 0g + 2d for g. 1 Solve 0 = -8f + 10f, 4g = 2f + 8 for g. 2 Solve 0 = -2g + 10, -6c + 7c + 3g = 16 for c. 1 Solve -n - 5o + 2 - 1 = 0, 0 = n + 3o + 1 for n. -4 Solve -5v + 2u + 35 = 0, 5v + 3u + 7 = 17 for v. 5 Solve 0 = -j + 8c - 7c - 2, 0 = -3j - 2c + 19 for j. 3 Solve -3p - s + 2 = 0, -5p + 4s + 4 = 29 for p. -1 Solve i - 3 = s, 2s + 0i = -4i - 12 for s. -4 Solve 5g - 11 = 2n - 3n, 4 = 4n for g. 2 Solve -9 = -3j - 4q + q, 2j - 2q + 6 = 0 for j. 0 Solve 2w = -3b + 27 - 33, -2w + 4b + 22 = 0 for w. 3 Solve 4j - 7 + 17 = -5l, 2l = 2j - 4 for j. 0 Solve -7p + 8p = -3x + 1, -4p - 4x = -4 for p. 1 Solve -4 = -4o - 2c, 0 = -38c + 35c for o. 1 Solve -2d + 5y + 8 = 2, -4y = 8 for d. -2 Solve 4s + 4 = 0, -65s - 13 = 3m - 67s for m. -5 Solve 3r = -5x - r - 26, -12 = -4x + 5r for x. -2 Solve 0 = 4j + 4i, -4j - 30 = 10i - 12i for j. -5 Solve 6l = 2l + 4, 0 = -v - 2l + 2 for v. 0 Solve -8s - 2i - 16 = -3s, -3s + 5i = 22 for s. -4 Solve -9j + 7j - 16 = -2n, -3j = -4n + 32 for n. 8 Solve 2p - 4o + 8 = 0, -3p + 7o - 4 = 3o for p. 4 Solve -4j + 4b = -52, -b + 8 - 11 = 0 for j. 10 Solve 5a - 22 = u, 4u + 2a = -0a for u. -2 Solve 2z = -3t - 5, 5t + 4z = -z for t. -5 Solve 4b + 24p + 2 = 21p, 5p + 7 = -3b for b. 1 Solve 0v + 5v + 4 = -z, -3z - v - 12 = 0 for z. -4 Solve -2p + 8 = 0, 3p - 7 - 3 = -t for t. -2 Solve -5l - 10 = 0, 4s + 9l - 6 = 4l for s. 4 Solve 2d = -4t, 4d + 2 = -14 for t. 2 Solve a - 10 = 6a, 2g = -5a - 14 for g. -2 Solve -7 = -4y - 0n - n, -2n - 13 = -y for y. 3 Solve 5n - h - 22 = 8, -3n = 3h for n. 5 Solve 5v + 10 = h - 6h, v - 5h = 16 for v. 1 Solve 3k - 10 = -4u - 3, -u + 2k - 12 = 0 for u. -2 Solve 4n = p + 8n + 3, -3n = -2p - 6 for p. -3 Solve 3r = 2c - 2, -r + 3 = -2c + 5 for c. 1 Solve -3k = -12, 5w - 10w - 5k = 15 for w. -7 Solve 0 = -3l + 2o + 10, 63l - 15 = 58l + 5o for l. 4 Solve 3 = -y - 2t, 4y - 2t - 15 = -t for y. 3 Solve 0 = o, -2l - o = -5l - 9 for l. -3 Solve 0 = m + 4, 161r - 159r - 18 = 4m for r. 1 Solve -5b - 5 = 5a, 0b - 3a = -3b + 15 for b. 2 Solve 0 = -3q + 15, 4w + 5q - 5 = -0w for w. -5 Solve 4f - 20 = 7f - 4v, -3v + 15 = -4f for f. 0 Solve -2m - 16 = 5c, -5m + 3c = 11 - 2 for m. -3 Solve -18w = 2d - 20w + 14, 4d - 12 = -4w for d. -2 Solve j = -3t - 5, 3j - 4t - 20 = j for j. 4 Solve 2g - 2d - 6 = 0, 0g + 4g + 5d - 21 = 0 for g. 4 Solve 0 = 3g + q - 11, 0 = -2g - 3q - 0q + 5 for g. 4 Solve -3d = k + 11, d + 6k = 2k for d. -4 Solve -4 = 5g + 4x, g = 2x - 5 - 7 for g. -4 Solve 0 = x + 4f - 5f + 1, 0 = -2x - 2f + 10 for x. 2 Solve 2j - 16q - 7 = -15q, -5q - 13 = j for j. 2 Solve -4s - 8 = 2m - 2s, -2s = 5m + 5 for m. 1 Solve 5h + 10 = -5s, 4h + 13 = -5s + 4 for s. -1 Solve 4f = -20, 16 = -3s + 5s - 4f for s. -2 Solve -s - d = -6d + 4, -3s - 5d = -8 for s. 1 Solve 0 = -3x + 6, x - 9 - 18 = -5u for u. 5 Solve -2x + 3 = -3x, -u + 2x + 8 = 0 for u. 2 Solve -18 + 5 = p + 5m, 4m + 2 = 2p for p. -3 Solve -x + 3 = -l, 3x + 47 - 41 = 0 for l. -5 Solve n - 12 = -5b, -b = -2b + 3 for n. -3 Solve -587 = -5d - v - 598, -d + 4v + 23 = 0 for d. -1 Solve -2m + 3 = -p, 46m = 5p + 48m + 27 for p. -5 Solve 5r - 15 = 0, -3t + 0t - 18 = -3r for t. -3 Solve -21t - 20 = -26t, 3t + 18 = -5q for q. -6 Solve -62k + 11 = -60k + 5i, -3k - 2i = 0 for k. -2 Solve -3q - 19 = 2l, 2q - l - 8 = 3q for q. -3 Solve -67m - 3q + 5 = -66m, 4q - 16 = m for m. -4 Solve 2w = -4z - 2, -2w = -z - 0 + 12 for w. -5 Solve -5l + 6l - 4v - 7 = 0, -l - 3v = 7 for l. -1 Solve 4m + 4v - 36 = 0, 6m - 7m - 3v = -19 for m. 4 Solve 0 = 3c - 5r - 28, -c + 3r + 16 + 0 = 0 for c. 1 Solve s - 74 = c - 70, 25 = -5c for s. -1 Solve 8s - 20 = 3s, r - s + 4 = 0 for r. 0 Solve -9g + 2y = -16, 7g = 4g - y + 7 for g. 2 Solve 0 = -g + 2c, 3g - 4c = 5g + 16 for g. -4 Solve 5r - 4h = -9, 4h = -r - r + 2 for r. -1 Solve 2w + 70 = 2m + 74, 5m - 2w = 8 for m. 4 Solve -3o = -m - 8, o - 8 = -4m + 3m for o. 4 Solve v + 4t = -0v - 4, 4v - 24 = 4t for v. 4 Solve 0 = 4y + n + 14, y + n = -0n - 5 for y. -3 Solve -n + 8 = -3n + 3q, 4n + 4q - 4 = 0 for n. -1 Solve -18 = 5o + 4d, 5d = -6o + 7o - 8 for o. -2 Solve -5d + 3c + 17 = 0, -37c = -4d - 40c - 8 for d. 1 Solve -4w = 2k - 26, -5k + 2k + 19 = 2w for k. 3 Solve 5c + 3i + 20 = 1, -5i = -5c - 35 for c. -5 Solve x - 6 = f - x, 0 = -4f + 4x - 20 for f. -4 Solve -4x - 16 = -y, -y - 4x = 16 - 0 for y. 0 Solve -6x - 8 = -2o - 7x, -1 = 3o - 5x for o. 3 Solve 3h - 5b = 13, h + 3b + 19 = -0b for h. -4 Solve 9 = -3p, -221w - 54 = -216w + 3p for w. -9 Solve 0 = -4d - 5p + 15, 5d + 4p = -0 + 21 for d. 5 Solve -3j = -4d + 17, 5d + 0d = 5j + 20 for j. 1 Solve 2j - 5z - 23 = 0, 0 = 2j - 5j + z + 2 for j. -1 Solve -a - 5 = 3j, 2a + 4j = 5j + 4 for a. 1 Solve -28 = 4u - 5s + 2s, 16 = 4s for u. -4 Solve -3i + 17 = 4x, -16 = -5x + 5i - 7i for x. 2 Solve k - 5 = -2q, -3k - 7q + 8q + 1 = 0 for k. 1 Solve 0 = -4a - 0a + 5b + 26, -5b + 2 = 3a for a. 4 Solve -6h - 8 = -2l - 7h, 0 = -5l - 3h + 22 for l. 2 Solve 10d - 5d + 4f = 5, 5f + 5 = -4d for d. 5 Solve f + 12 = -3n, 16f = 20f + 2n + 18 for f. -3 Solve 0k + 5k + 15 = 0, -k = -5g - 2 for g. -1 Solve -2i + 0 - 2 = b, i - 5b = -23 for i. -3 Solve a + 20 = 4m, 4a = -3m + 3a + 8 for m. 4 Solve 4t - c = -9, 3c - 2c = t for t. -3 Solve 0 = 3p - 2p + 5h - 5, p - 2h = -9 for p. -5 Solve 25 = -5g + 5k, g + 11k + 3 = 10k for g. -4 Solve 4d - 3a - 51 = -22, -3d + 12 = a for d. 5 Solve 0 = 10s - 5s + 5i + 25, -2s + 6 = -2i for s. -1 Solve 7z - 2z - 17 = -n, 5n - 4z = -31 for n. -3 Solve 0 = 5m - 5k - 29 - 11, -5m + 22 = k for m. 5 Solve 5s + 31 = 308r - 305r, 0 = 5s - 4r + 33 for s. -5 Solve 3a - 6 = 3z, -2z - 8 = -74a + 71a for z. 2 Solve 2 = 2k + 4z, 12z - 15z = -5k - 21 for k. -3 Solve 5b + 10 = 2z, 0z - 5z = 25 for b. -4 Solve -4l + 3j + 5 = 8j, -4j - 22 = -2l for l. 5 Solve -5h + 4n + 40 = 0, h - 13 - 11 = 4n for h. 4 Solve r + 3q = -4r + 22, q - 4 = 0 for r. 2 Solve -d + 2w - 2 = 0, 4w = -4d + 7w - 3 for d. 0 Solve -2w + b - 5 = 0, -4w - 368 = 2*b - 378 for w. 0 Solve -t + 6 - 9 = -h, -	{ "pile_set_name": "DM Mathematics" }
t is the first derivative of p(d) wrt d? -580d3 Let w(p) = -206p - 201. Let u(s) = -208s - 201. Let i(j) = -3u(j) + 4w(j). Find the first derivative of i(k) wrt k. -200 Let w(t) be the first derivative of 51t*5/5 - 320t*3/3 + 387. Find the third derivative of w(d) wrt d. 1224d Suppose 15 + 15 = 6z. Find the second derivative of -6t*2 - 6t*5 + 6t*2 + 52t + 13tz wrt t. 140t3 Let r(v) be the first derivative of -v6/60 - v*3 + 7v*2 + 39. Let a(s) be the second derivative of r(s). Find the first derivative of a(g) wrt g. -6g*2 Let l = -753 + 2249. Find the second derivative of 16j*5 - 1496 - 23j + l wrt j. 320j3 Let s(l) be the third derivative of -73l*7/105 - 151l*3/6 - 4l*2 + 25. Differentiate s(o) wrt o. -584o*3 Let a(h) = 61h4 + h3 + 10h2 - 2. Let d(z) = z3 + z2 - 1. Let k(c) = -a(c) + 2d(c). What is the third derivative of k(j) wrt j? -1464j + 6 Differentiate -241 + 0a*2 - 173a*2 + 3a*2 + 2a*3 + 63 wrt a. 6a*2 - 340a Suppose -1 = 40y - 121. Let p(u) be the first derivative of 0u*2 - 11/3u*y - u - 10. Differentiate p(z) with respect to z. -22z Let o = -972 - -972. Let r(b) be the first derivative of 1/3b3 + ob*2 + 4 - 7b. What is the derivative of r(k) wrt k? 2k Let p(a) = a3 - a2 - 2a. Let w be p(3). Suppose -3h + 5h + 4 = 2o, 4o = 2h + w. Find the third derivative of r4 - 9r*h + 21r*2 + 4r*4 wrt r. 120r Let g(l) = -564l - 238. Let b(n) = 282n + 117. Let o(m) = -5b(m) - 2g(m). What is the derivative of o(k) wrt k? -282 Let u(k) be the third derivative of -35k4/24 + 8k*3/3 + 21k*2. Differentiate u(l) wrt l. -35 Let q = 5095/6 - 849. Let j(h) be the second derivative of -qh*3 + 0h*2 + 0h*4 + 0 + 1/30h*6 + 0h*5 - 9h. Find the second derivative of j(d) wrt d. 12d2 What is the third derivative of 6b - 5693b3 - 5771b*3 - 41b*2 + 11650b*3 wrt b? 1116 Let f = 708 - 301. Suppose s = 2u - 5u + f, u - 125 = -3s. What is the first derivative of -137y - 3y*3 + uy - 2 wrt y? -9y2 Let z(y) = -2y*2 + 2y + 1. Let p(n) = -2n2 + 75n - 27. Let c(h) = -p(h) + 2z(h). Differentiate c(w) wrt w. -4w - 71 Let z = -55 + 60. Let w(v) be the third derivative of 1/24v6 + 0v*4 + 0 - 7v*2 + 0v + 0vz - 1/2v*3. Differentiate w(c) with respect to c. 15c2 Let u(x) be the first derivative of x6/24 - x*5/5 - 19x*2/2 + 20. Let q(d) be the second derivative of u(d). What is the third derivative of q(n) wrt n? 30 Let a be (3/(-2))/((-18)/96). Let i(n) = n - 5. Let c be i(a). Differentiate -3b*2 + 0 - 2 + cb*2 - 12b*4 wrt b. -48b*3 Let y(q) be the second derivative of 11q*5/20 + 10q*4/3 + 33q. Find the third derivative of y(x) wrt x. 66 Let h(i) = -31i + 31. Suppose 3o - 3 = 2b, 5o - o - 2 = 3b. Let m(g) = 8g - 8. Let p(w) = bh(w) + 22m(w). Find the first derivative of p(j) wrt j. -10 Let g(h) = h*4 + 2h3 + h2 + h + 1. Let a(p) = 35p4 - 12p*3 - 6p*2 - 6p + 386. Let z(s) = a(s) + 6g(s). What is the derivative of z(n) wrt n? 164n*3 Let i = 85/12 + -55/12. Let g(f) be the second derivative of 0 + 4/3f*3 + 7f + if2. Differentiate g(z) with respect to z. 8 Let d(a) be the third derivative of 443a*5/30 + 53a*4/8 + 11a*2 + 2. What is the second derivative of d(b) wrt b? 1772 Let d(y) = 3y - 4. Let a be d(2). Suppose -z + 5z = 4n + 8, -5z + 16 = -2n. What is the third derivative of 2t3 + 17t*a - 14t*2 + nt3 wrt t? 24 Let t(f) = f2 + 3f - 1. Let x be -3 + 4/(0 + -4). Let j be t(x). Find the first derivative of 5h*3 - 3h*3 + jh*3 + 1 wrt h. 15h*2 Let q(r) be the second derivative of 5r*8/84 - 2r*4/3 - 3r*2 - 16r. Let k(m) be the first derivative of q(m). Find the second derivative of k(p) wrt p. 400p3 Let h(m) be the third derivative of 0m*4 + 11/60m*5 + 10m*2 + 2/15m*6 + 0m*3 + 0 + 0m. What is the third derivative of h(p) wrt p? 96 Let o = 2162 - 4315/2. Let n(r) be the first derivative of 11 + 0r3 + 3/4r*4 + 0r - or2. What is the second derivative of n(g) wrt g? 18g Let p(f) = -117f + 157. Let n(s) = -59s + 77. Let k(h) = 13n(h) - 6p(h). What is the first derivative of k(g) wrt g? -65 Let v(w) = 3w3 - 6w*2 + 87w + 4. Let x(p) = -2p3 + 5p*2 - 88p - 3. Let c(b) = 3v(b) + 4x(b). Find the second derivative of c(l) wrt l. 6l + 4 Find the first derivative of 2u*2 - 7u*4 - 26 - 47u*4 + 93 + 250 wrt u. -216u*3 + 4u Let j(p) be the second derivative of -1/6p7 + 0 + 0p*5 + 14p + 7/6p3 + 0p*4 + 0p*6 + 0p*2. Find the second derivative of j(f) wrt f. -140f*3 Let p be 1 + -3 - (1 + -4). Let b(w) = -p - 2 + 1 + 1. Let y(g) = -2g + 6. Let u(r) = -2b(r) - y(r). Find the first derivative of u(x) wrt x. 2 Find the second derivative of -225z*4 + 170z - 17z3 + 17z*3 + 59z*4 wrt z. -1992z*2 Let u be (8/(-2))/(-4)3. Find the second derivative of y - 6y + 11y + 9yu wrt y. 54y Let d(n) be the second derivative of 11n8/28 + n4/4 + 8n*2 - 28n. What is the third derivative of d(v) wrt v? 2640v3 Let f(k) be the third derivative of 0 - 2/15k*6 - 1/6k*4 + 0k*3 - 9k*2 + 0k*5 + 0k. What is the second derivative of f(g) wrt g? -96g Suppose -4u = 21 - 53. What is the derivative of 10n - 13 - 10n - un + 2 wrt n? -8 Find the first derivative of -39t + 3 - 16 - 2 - t wrt t. -40 Suppose 2v - 4t + 10 = 0, -3 = 2v - t - 2. What is the first derivative of v + 5 - 5 - 5q*2 wrt q? -10q Find the second derivative of -317 + 83o2 - 319 + 47o + 636 wrt o. 166 Let b(u) = u*3 + 2u*2 - u + 9. Let r be b(-3). Find the third derivative of -3 + r - 32q*2 + 20q*2 + 20q*4 wrt q. 480q Find the third derivative of -3u3 + 47u*2 + 41u*2 - 39u*4 + 19u*2 + 42u*2 - 22u*2 wrt u. -936u - 18 Let v(n) be the first derivative of -n*4/2 + 3n3 + n2 + 34n + 143. What is the second derivative of v(d) wrt d? -12d + 18 Find the second derivative of 112k + 22k*2 + 37k*2 + 91k*2 - 25k*2 + 19k2 wrt k. 288 Let v be 8 + (-2 - -1)/(2/4). Find the second derivative of g5 + 38g + vg*4 - 14g - 6g4 wrt g. 20g*3 Let n(z) be the first derivative of -213z*4/4 - 138z*3 - 216. Find the third derivative of n(f) wrt f. -1278 Let a(m) = 2m*2 + 9m + 6. Let h be a(-4). Suppose 4c + c - 20 = hx, -4c - x = -3. What is the third derivative of 4n*5 - 3n*2 - 3nc - n5 wrt n? 180n2 Suppose 0 = -4w - 253 + 29. Let m be 18/7 + 32/w. Find the third derivative of 5u6 - u6 + 0u*6 + 2u*2 + 0u*m wrt u. 480u*3 What is the second derivative of j + 4 - 1900j*2 + 472 - 7 + 1412j*2 wrt j? -976 Let f(j) be the second derivative of 13j8/28 + j7/21 + j*4/12 - 10j*2 - j + 13. What is the third derivative of f(w) wrt w? 3120w*3 + 120w2 Let a(p) = p3 + 2p2 - p. Let g be a(-2). Suppose q + 0 = g. Differentiate -qx*2 - 6x*2 + 19 - 16 with respect to x. -16x Let a(c) = 1. Let o(g) = 124g5 - 26g - 13. Let l(t) = 5a(t) + o(t). What is the second derivative of l(p) wrt p? 2480p*3 Let o = 3170/1461 + -3/974. Let v(h) be the second derivative of 0 + 5h + 0h2 - 1/6h*4 + oh*3. What is the second derivative of v(l) wrt l? -4 Let y(x) be the first derivative of -25x*4 - 2x*3/3 - 4x*2 + 46x + 546. Find the second derivative of y(i) wrt i. -600i - 4 Differentiate -18s + 4 - 7s - 6 - 39 wrt s. -25 Let l = -16 - -23. Find the second derivative of -9k*3 - 2k + 11k + lk - 3k wrt k. -54k Let a(o) be the first derivative of -o*6/30 - 5o*4/8 + 5o*2 - 9. Let f(n) be the second derivative of a(n). Find the second derivative of f(z) wrt z. -24z What is the second derivative of 528m4 + 38m*3 - 296m - 38m3 + 3m*2 - 519m*4 wrt m? 108m*2 + 6 Let z(g) be the third derivative of 229g*4/8 - 129g*3 + 3g*2 + 20. Differentiate z(u) wrt u. 687 Let m(u) = 264u*3 + 4u*2 - u. Let f(p) = 264p*3 + 5p*2 - 2p. Let s(b) = 5f(b) - 6m(b). What is the third derivative of s(k) wrt k? -1584 Let j = 13 + -13. Let x(l) = -2l - 2l + 1 + j + 0. Let s(y) = 3y. Let g(a) = 3s(a) + 2*x(a). Differentiate g(p) with respect to p. 1 Let c be ((-5)/(-10))/(2/(-72)). Let z = 19 + c. Find the	{ "pile_set_name": "DM Mathematics" }
= m + 3u, 2m + u = 0. Suppose -b - v + 15 = 4v, -b + 2v = -1. Suppose 7 = bo - 18. Solve oz + 10 = -2l + l, 0 = -ml - 5z - 10 for l. 0 Suppose 2k = 6k - 32. Let w be 36/k + (-9)/6. Solve -3m + 3n + 2n - 11 = 0, -13 = -wm - n for m. 3 Let m be (-3 + 0 + 3)/3. Suppose -4r - 12 + m = 0. Let q(h) = -9h. Let c be q(r). Solve 5b + 2p - c = 0, -4b - 5p + 8 = -17 for b. 5 Suppose 15 = 2l - 5. Suppose -4t + 6 + l = 0. Solve -w = -3y - 2w - 3, 4y - 5w = -t for y. -1 Suppose 0m = 4m + 24. Let z = m + 9. Suppose 0 = 2o + zo - 85. Solve 2d + 2b = 18, 5d - 2d + b = o for d. 4 Let p(c) = -c2 - 5c - 4. Let d be p(-3). Let a be d/2(0 - 0). Solve 4 = x, -3i + 3x - 6x + 9 = a for i. -1 Let h(u) = -4u. Let w(j) = j + 6. Let n be w(-7). Let d be h(n). Solve -y = 4v + 22, -3y - d = -3v - 13 for v. -5 Let t be (-64)/(-3) - (-28)/(-21). Solve y + 3a = 5, 4y + 5a = -0y + t for y. 5 Let c = 0 + 8. Suppose -5k + 0 = z - 10, 4k = -2z + c. Solve 0 = 3o - 2n + k, o + n - 2 = -6 for o. -2 Suppose -6j = -j + o - 24, 5j - 4 = 4o. Suppose 0a - a + 12 = 0. Solve -5l + 8 + 3 = jy, 4y = -4l + a for l. -1 Let s(g) be the second derivative of g3/6 + 8g*2 + 6g. Let w be s(-14). Solve -3p - 9 = 3z, 2z + 0p - wp - 2 = 0 for z. -1 Suppose 21 + 3 = 3z. Suppose -3r + 1 = -z. Solve 5v = rs + 2s, -s + 2v = 3 for s. 3 Let p(k) = 3k + 38. Let s be p(-11). Solve x = -5, 9 + 16 = f - sx for f. 0 Let q be (-222)/(-42) + (-4)/14. Solve -t = -5m + 4, qm - 3m = 2 for t. 1 Suppose -14n + 6n = -16. Let b = -14 - -34. Solve -nt + b = -4m, 0 = -4m - 3t - 9 - 1 for m. -4 Let d be (-2)/2 - (-2 - 2). Suppose -4o - 8 = -2y, -30 = 3y - 4o - 38. Let g be (-2)/4 - 78/(-4). Solve 0a - dl = -2a + g, y = -a + l + 8 for a. 5 Let k be (2/(-8))/(2/(-24)). Suppose 2n + 2i = 6, -kn = -n - 3i - 11. Solve -na - 16 = -5y, -3a - 12 = 2y - 0y for a. -4 Let q(j) = -j*2 - 21j - 17. Let f be q(-20). Solve -3m = 2c + 2m + f, -4c - 4m = 12 for c. -4 Let p be (-8)/(-2)(-3)/(-2). Solve -4a + 4q + 26 = -p, q = -a - 2 for a. 3 Suppose 2j - 7 = -1. Suppose -4n - 18 + 53 = -3h, -4n = -h - 25. Solve ju + 4 = v - 9, -2v = nu + 29 for v. -2 Suppose -5d - 24 = g - 2g, 5g + 5d + 30 = 0. Let a be (0/(-1))/(2 + g). Solve -17 = -aj - j + 4y, 5j + 11 = -4y for j. 1 Let z be ((-5)/(-2))/((-3)/(-6)). Let n(y) = y2 + 6y + 7. Let c be n(-5). Let p be (0 - 1)/((-1)/c). Solve d - zs - 8 = 0, -3d - d + ps = 4 for d. -2 Suppose 5o - 10 = -2b, -o + 5b = 4o - 45. Solve 4t + 12 = oc, 2t = -3c - 0c - 11 for c. -1 Let n(v) = -v*2 - v + 4. Suppose 4g = -4 + 20, 2f - 2g = -8. Let y be n(f). Suppose -2a + a + y = 0. Solve -h + 1 = -ac, c - 2h = -h - 4 for c. 1 Let d = -7 - -9. Solve -dz - 2z = 4, k + 3z - 2 = 0 for k. 5 Suppose -4q - 2z = 206, 3z = -4q - 2z - 203. Let c = q + 74. Solve 0 = m + 5w - c, w - 4 = 3m + 2w for m. -3 Suppose 8 - 6 = m. Solve 5y + 3i = 34, -2y + mi + 3i = 5 for y. 5 Suppose -24 = -4f + 32. Let w be 3/2(f - 0). Solve 2q = s - 3s - 2, 3s - w = 3q for s. 3 Let q be 22 + (-6)/(34/6). Solve -5b + q = 3k, 4b - 3b - 3 = -k for k. -2 Let h = 12 - 19. Let p = 12 + h. Solve 0 = 3w - pb - 31, 3w + b - 3b = 16 for w. 2 Suppose 0 = 9x - 6x + 4q + 5, 3x - 5q - 40 = 0. Solve 0r = 5j + 2r + 10, 8 = -4j + xr for j. -2 Suppose -4 = 2c - 2, -5c = 2i - 19. Suppose -10 = -5o - 3z, 3o + 3z - 4 - 2 = 0. Solve -oh + 3a + i = -5h, -4a = 8 for h. -2 Suppose -w + 0w + 24 = 0. Solve 5y + t - 1 = -w, -t + 2 = 0 for y. -5 Let x(h) = -2h - 2. Suppose -2j = -5v + 2v - 4, 2j + 28 = -5v. Let s be x(v). Suppose sq - 88 = 2q. Solve -3p - 2g + q = -0p, -5p + 5 = -3g for p. 4 Let g be (-96)/(-30) + (-2)/10. Suppose -15 = -4d + 13. Let z = d - g. Solve -5l + a + 0 = -3, 0 = -5l - za - 12 for l. 0 Suppose -9 = -4k + 7. Let g = -34 + 57. Let u be 13 + 1 - 4/(-2). Solve -b + g = 4v + 7, kv = 4b + u for b. 0 Suppose 2 = y - 3. Suppose 2z = r + 2 + 2, yz + 5r = 40. Suppose 2l + 12 = 5l. Solve 0m + 5k + l = m, m + 5k - z = 0 for m. 4 Let d = -55 - -96. Solve -z - 3z + 5l - d = 0, -l = -5z - 25 for z. -4 Let b = 29 + -29. Solve b = 5g - 3r - 14, -r = -g + r + 7 for g. 1 Let p be 1 + (-1 - 2 - -2). Suppose 5q + 1 - 16 = p. Solve -4g - 5v = -23, v = qg - v for g. 2 Let u(r) = -r2 + r + 13. Let m = -2 - -2. Let k be u(m). Suppose 0 = -5t - 3 + k. Solve -4j + 8j = -2c, -5j - t = 2c for c. 4 Suppose -4 + 0 = -2u. Solve -5y - 5 = 5q, -5y - uq = -3q - 19 for y. 3 Let c = -4 - -2. Let t be (c/6)/((-2)/18). Let n be 8/t - 4/(-12). Solve 4d = -nx - 1, -2 = -2x - 3d - 4 for x. 5 Let h = 32 - 7. Solve 2m + 20 = -4w, 2m - 5w = -2m + h for m. 0 Let q(t) = 6t - 16. Let g be q(3). Solve 4n - u = -15, n + gu - 9 = -2u for n. -3 Suppose 0 = 2v - 0 - 2. Solve 2m = 2u + v - 7, 0 = -m - 5u - 15 for m. -5 Suppose 2m = 37 + 3. Let s(k) = -k3 + 20k*2 - 18k - 17. Let u be s(19). Solve 5p = -m, up + 3 + 6 = l for l. 1 Let g be 38/12 + 1. Suppose -gu - 8 = -5u. Solve s + 5d - 12 = 11, 0 = -5s - ud + 31 for s. 3 Let w(j) be the second derivative of 1/6j4 + 0 + j - 2/3j3 + j2. Let p be w(3). Solve -5t + 35 = -5c - 0t, 0 = -2t + p for c. -3 Let h = -84 + 87. Solve 4z - 5r = 8z - 12, -hz = 5r - 9 for z. 3 Let a = 13 - 11. Solve -6q + 3q + 2 = -u, au = 2q + 4 for q. 2 Suppose -3c + 7 + 17 = -4l, -4c + l = -32. Solve -c = 3x + 5q, 2x + 0q - 3q = 1 for x. -1 Let l be (-2)/5 - 129/15. Let z = l - -13. Solve 0r + r = -u, -z = -r for u. -4 Let n be (-2 - (1 - 1)) + 4. Suppose 0 = t - 3o - 2, nt - 5 - 7 = -2o. Solve -ty + y + 1 = -i, 5y - 5i - 5 = 0 for y. 0 Let z = 182 - 176. Solve z = -3u - 5t - 9, t = u + 5 for u. -5 Let u = -4 + 8. Suppose 11 = uq - 5. Suppose 5g = h - 12, 2g - 3g = -qh + 10. Solve -25 = -5x - v, 0x = hx - 3v - 10 for x. 5 Let o(f) = f - 1. Let x be o(4). Suppose xz + 4 = -4a, -z + 24 = -3a + 8. Solve 5b + 2 = -4p - 3, -2p + 2 = zb for p. -5 Suppose 3z + 26 = 2. Let k be (-1 + -3)/z6. Solve -4h = 2v - 8, 4 = kh - h + 3v for h. 2 Let w(r) = -r*2 - 8r. Let i be w(-7). Suppose 0a + i = a. Solve 3 = d - as + 4s, 9 = 3d - 3s for d. 3 Let s = 269 + -157. Suppose -s = u - 5u. Let x = u - 16. Solve -3h + 7 + 2 = -4w, -4h + x = -3w for h. 3 Let y be (34/3)/((-36)/(-54)). Let v(g) = -3g + 1. Let l be v(-1). Solve 0 = -lp + 5d - y, 2d = -2p - d - 3 for p. -3 Let d(y) = -y2 - y + 4. Let s be d(3). Let o = s + 18. Let r be 6/o - 68/(-20). Solve ri - 4q = i - 13, 2i + 2 = q for i. 1 Let c(a) = -a*2 - 4a + 1. Let l be c(-3). Let b = 8 - l. Solve 2y + 2r - 9 = -3, -4y + 12 = -br for y. 3 Let p be 0/1 + 32. Let a be (0 - 3)/(p/(-4)). Let d = -198 - -210. Solve -4t = -q - aq - d, 12 = -3q + 5t for q. -4 Let o(c) = c - 11. Let x be o(8). Let a(g) = -g2 - 2g + 5. Let i be a(x). Solve 0 = -ir + 6, 2m - r - 1 = -2m for m. 1 Let z be ((-96)/(-15))/(((-4)/(-10))/1). Let g(v) = -v + 1. Let s be g(-2). Solve 2l + 5n = 14, -2l = sl + 3n - z for l. 2 Let c(b) = -b*2 - 6b + 7. Let u be c(-6). Let o = 12 - u. Solve 0 = 4i, o = 5v - 5i + 25 for v. -4 Let p be (-27)/12 - (-1)/4. Let u be 24 - 0p/(-2). Solve -3f = 2f - i - 21, -5f + u = -4i for f. 4 Suppose -h - h = 2j - 14, 3j = -h + 15. Solve -3f + 5p + 24 = 5, -6 = hp for f. 3 Let y = -48 + 53. Solve 5d + 15 = u + 3u, -yu + d = -3 for u. 0 Let t(w) = -5w - 5. Let z be t(9). Let p be (z/15)/((-1)/3). Suppose 2v = 8 + p. Solve vd + 5 = 4d, 5o + d - 4 = 0 for o. 1 Let t be -14 - -12 - (-10)/1. Solve 7 = d + 4y - ty, 14 = 5d + y for d. 3 Suppose 6r = 3r + 45. Solve -5t + 2k - r = 0, 2t - 5t - 5 = -2k for t. -5 Let o(y) = y + 3. Let b be o(0). Solve -5h = -2j - 6, 0h - j - b = 3h for h. 0 Let l(f) = f - 4. Let h be l(5). Let r be (-1)/1 + h - 0. Solve 2d = 4g, rg = 3d - 5g + 1 for d. -2 Suppose -5o + 15 = -0o. Suppose -5d = -0d - 30. Suppose -12 = 2b + 4u, -b - 9 = du - ou. Solve -4i - q - 23 = 4q, b = -4q - 12 for i. -2 Suppose a - 1 = -0. Let z(j) = 4j - 1. Let i be z(a). Let v(s) = -5s3 - 2s*2 + 1. Let t be v(-1). Solve -im	{ "pile_set_name": "DM Mathematics" }
second smallest value? (a) 2 (b) 5 (c) u a Let v = 414.7 + -415. What is the second smallest value in -2/15, v, -0.37? v Let g(s) = -41s - 77. Let y be g(-2). Which is the smallest value? (a) y (b) -11 (c) 0 b Let p = 82 - 1556/19. Which is the biggest value? (a) 0.5 (b) p (c) 1.9 c Let k = 7718/27 + -286. Let x = 5/27 - k. What is the smallest value in x, -0.4, 0? -0.4 Let f = 345 + -1036/3. Let n = 1.03 + -1. Which is the biggest value? (a) f (b) -4 (c) n c Let u(j) = -j3 + 8j*2 + 12j - 30. Let d be u(9). Let c be 3/6(d - -1 - -10). What is the second biggest value in -1/2, c, -5/12? -5/12 Let c = -48/95 - -2/5. What is the third biggest value in c, 3/10, 2? c Suppose 3 = -2a - 7. Let o(f) = 4f3 - 2f*2 - 3f + 1. Let s be o(-1). Let v be s + (-5)/20 + 3. What is the second biggest value in v, a, -4? -4 Let g = -1.52 + 1.52. What is the fourth biggest value in g, 5, -0.2, 1? -0.2 Let y = 1083 - 1082. Let g = -2.5 + 2. Which is the fourth biggest value? (a) -4/5 (b) y (c) -11 (d) g c Let k be (-10)/(-4) - 2/4. Suppose 0 = -2q + 3g + 147, q - 109 = g - 36. Let d be q/(-28) - 8/(-4). Which is the second biggest value? (a) 3 (b) k (c) d b Let x = 1.3 + 2.7. Let w = -37 + 37. What is the second smallest value in -5, w, x? w Let n be 0 + 1 - 25/5. Let p = 16 - 15.93. Let m = -0.13 - p. Which is the second biggest value? (a) n (b) m (c) 2 b Let g = 1061 + -901.2. Let l = g + -160. What is the second smallest value in 0.5, l, 0.63? 0.5 Let u = -1752 + 1709. What is the fourth smallest value in -0.1, -1, u, -1/8? -0.1 Let x = 6.43 - 5.2. Let j = x - 1.23. Let h be 1/(-5) - 2/(-5). Which is the smallest value? (a) h (b) j (c) 4 b Let k = 0.22 - 0.02. Let h = 7/2 - 55/14. Which is the third smallest value? (a) h (b) k (c) -1/9 b Let k be (-455)/52 + (2 - -7). What is the smallest value in k, -1, -2? -2 Let j = 4 - 17. Let c = -12.9 - j. Let u = -2 - -2.05. What is the third biggest value in -4, c, u? -4 Let j = -5.026 - -0.026. Let f = -1 + 1.5. Let h = -58 - -58.08. What is the biggest value in f, j, h? f Let j = -65 - -32. Let s = j - -35. Which is the third smallest value? (a) -1/3 (b) 0.1 (c) 4/9 (d) s c Let h be (-6)/(-4) - 39/(-52) - 1. What is the third biggest value in -1/4, h, -1? -1 Let g = -0.1 + 0.14. Let h = -0.2458 + 0.0458. What is the biggest value in g, -5, h, -0.1? g Suppose 0 = -4j + 4x - 12, -5j = 6x - x - 15. Let s = 425/4 - 107. What is the second biggest value in s, j, 1? j Let v = -66 - -61. What is the third smallest value in v, -636, -3? -3 Let d be 3/(-2)(-8)/6. Let z = 364 - 361. Which is the second biggest value? (a) z (b) 2/7 (c) d c Let l = 3 - 2. Let o = 0 - l. Let b = 1.9877 + 0.0123. What is the biggest value in -0.5, o, b? b Let r = 29 - 25. Suppose -2v - p + 34 = r, 2p + 60 = 4v. Let z be (-6)/85/v. Which is the second smallest value? (a) -0.01 (b) z (c) 1/3 a Let f = -116.5 + 116. What is the biggest value in 0.1, f, 0? 0.1 Let d = 0.2 - -2.8. Let t = -8 - -5.7. Let p = 2.2 + t. Which is the third smallest value? (a) p (b) 0 (c) d c Suppose o - 4o = 9. Let u be ((-6)/(-36))/((-1)/o). Let p = 0.35 - 0.45. Which is the second smallest value? (a) p (b) -0.4 (c) u a Let g = -8 - 37. Let n = g - -44.5. Which is the third biggest value? (a) 1/4 (b) n (c) 0.4 b Let s = 30.3 - 30. Let p = 0.7 + s. Which is the second biggest value? (a) p (b) -1 (c) 5/2 a Let q = -0.281 - -6.281. What is the second biggest value in q, -0.1, 2/9, 1? 1 Let s be 3003/(-805) - -4 - (-2)/(-5). Which is the biggest value? (a) s (b) -5 (c) 0 c Let j be (2 + 12/(-8))12/(-15). Which is the second biggest value? (a) -2/17 (b) j (c) 3.2 a Let t be -5 + 72/15 + 2/6. What is the smallest value in -1, -2, -20, t? -20 Let c = -249.02 - -249. What is the third smallest value in 0.2, c, -2? 0.2 Let g = 8 - 30. Let i = -41 - g. Let t = -23 - i. Which is the third biggest value? (a) t (b) -5 (c) 1/5 b Let m = 2 + -3. Let x = 3 - m. Let j(z) = -z2 - 32z - 5. Let r be j(-32). Which is the second biggest value? (a) -6 (b) x (c) r c Let a = -164.2 - -163.7. Let y = -21/37 - 1/259. What is the third smallest value in a, 0.5, y? 0.5 Let o = -0.34 + -21.66. Let y = -32 - -12. Let t = y - o. What is the third smallest value in -0.5, t, -2? t Let c = -889/4 - -222. What is the second biggest value in 3/5, 2, -4, c? 3/5 Let z be (-4)/(-5) - 1379/(-70). What is the third smallest value in 2/11, 0.4, z? z Let t(w) = 8w + 43. Let f be t(-6). Let h be 46/10 + (f - 3/(-3)). Which is the third biggest value? (a) h (b) 0.4 (c) -2 c Let y = -32.8 + 45.8. What is the second smallest value in -8, y, -0.1? -0.1 Let p be ((-955)/14)/5 + 2. Let k = p + 23/2. Let r = -0.1051 - 0.2949. Which is the biggest value? (a) 0.1 (b) k (c) r a Suppose -5p - p = 12. Let q(h) = -3h2 - 1. Let g be q(1). What is the smallest value in p, g, 2/21? g Let q be ((15/2)/5)/4. Let w = 18 + -17.97. What is the third biggest value in q, -1, w? -1 Let h = 52 + -52. Let d be -1 + 0 + (-4674)/(-21). Let x = -222 + d. What is the biggest value in h, -0.4, x? h Let z = 5 + -21/4. Let p = -6.4 - -6. Let l = -99/92 - -15/46. Which is the second biggest value? (a) p (b) z (c) l a Let d be (7972/(-44))/(-1) - -2. Let h = 183 - d. Let k = 1.6 + 1.4. Which is the smallest value? (a) k (b) 3/2 (c) h c Let l = -0.57 - 0.43. Let f = -15.2 + 15.4. Which is the biggest value? (a) 0.06 (b) -2 (c) f (d) l c Let d = -28.7 + 32.7. What is the second smallest value in -3, -2, -10, d? -3 Let n = -2.2 + 4. Let d = 2 - n. Let o be ((-4)/(-6))/(100/(-750)) - -4. What is the third biggest value in -2, d, o? -2 Let b = -0.51 + 0.46. Let v = b - -3.05. What is the third smallest value in v, -3, 4? 4 Let d = 0.6 + -0.1. Let r = 0.0589 - -0.1411. What is the second biggest value in -0.07, d, r? r Let b = 0.2 - 0.5. Let l be (30/35)/(33/7). What is the second biggest value in -10, l, 0.3, b? l Let u = -12 - -17. Suppose 2t - t = 5g - 40, g + ut = 8. Let o be (-4)/g - (-13)/22. What is the second smallest value in o, 0, 1/6? o Let w be (2/4)/((-2)/20). Let l = 0.45 - 0.64. Let h = -0.29 - l. What is the smallest value in h, w, 2? w Let l = 237.86 - 238. Which is the second biggest value? (a) -2 (b) 5 (c) l c Let w = 637 - 636.85. What is the second smallest value in 1, w, 4, -3? w Let j = -238 - -248.7. Let p = -11 + j. Let k = -21 - -16. What is the second smallest value in k, 2/11, p? p Let x = 28 - -19. Let w = x - 46.7. Suppose 0 = -2n + 4n + 4. Which is the third smallest value? (a) -1/3 (b) w (c) n b Let u = 3 - 4. Let p = 1947.7 - 1947.5. Which is the smallest value? (a) u (b) p (c) 2/9 a Let o = 24.2 + -5.1. Let f = o - 19. What is the fourth smallest value in f, 1, -2/9, 1/4? 1 Let h(z) = z*3 - 3z*2 - 4z + 2. Let w(x) = -3x - 11. Let q be w(-5). Let o be h(q). Which is the smallest value? (a) -3 (b) o (c) 1 (d) -1 a Suppose -4v = 672 - 40. Let x = -469/3 - v. Suppose q + q + 12 = 3o, o - 8 = 2q. Which is the second biggest value? (a) 0 (b) x (c) q a Let w = 3 + 2. Let c be ((-8 - -15) + -10)1/6. What is the biggest value in w, c, -2/5? w Suppose 0r - 3h = -3r - 3, 0 = 4h. Let v = -105 + 109. Which is the second biggest value? (a) r (b) v (c) -0.4 c Let x be 0 - -1 - (-2)/(-8). Let h = 142393/85434 + -1/28478. Which is the third biggest value? (a) h (b) 0.07 (c) x b Let q = -17.31 + -0.29. Let o = q - -33. Let p = o - 15. Which is the smallest value? (a) -3 (b) p (c) -2 a Suppose -s - j = -2s + 2, 3j = 0. Let p = -1.57 + 1.5. Let y = p + -0.03. Which is the second smallest value? (a) y (b) 0.2 (c) s b Let s = -1169 + 1059. Which is the smallest value? (a) 1 (b) s (c) 2 (d) -1 b Let y = 4 - 0. Let l = -7 - -3. Let g be (l/10)/(1/(-5)). Which is the smallest value? (a) -0.5 (b) y (c) g a Let g = -186 + 181. What is the fourth smallest value in -3, -1, g, 1? 1 Suppose 0 = -20v + 14v - 18. Which is the biggest value? (a) v (b) -2/5 (c) 7 (d) -0.3 c Let y = -0.0045 + -0.2955. Which is the second biggest value? (a) -2/9 (b) y (c) 33 a Let n = 445 + -441. Which is the third biggest value? (a) 64 (b) -4 (c) n b Let u be 1(-2 + 4 - -3). Let r = -0.5 + -2. L	{ "pile_set_name": "DM Mathematics" }
f 1694 to the nearest integer? 41 What is the square root of 1273 to the nearest integer? 36 What is the cube root of 21074 to the nearest integer? 28 What is the cube root of 3302 to the nearest integer? 15 What is 265 to the power of 1/3, to the nearest integer? 6 What is the third root of 6196 to the nearest integer? 18 What is the eighth root of 41707 to the nearest integer? 4 What is 1066 to the power of 1/3, to the nearest integer? 10 What is 16718 to the power of 1/4, to the nearest integer? 11 What is the fourth root of 29908 to the nearest integer? 13 What is 12214 to the power of 1/2, to the nearest integer? 111 What is 2022 to the power of 1/8, to the nearest integer? 3 What is the cube root of 4473 to the nearest integer? 16 What is the square root of 3646 to the nearest integer? 60 What is the fifth root of 1468 to the nearest integer? 4 What is 6211 to the power of 1/4, to the nearest integer? 9 What is the square root of 1807 to the nearest integer? 43 What is 358 to the power of 1/2, to the nearest integer? 19 What is 81766 to the power of 1/9, to the nearest integer? 4 What is the third root of 8868 to the nearest integer? 21 What is 11590 to the power of 1/2, to the nearest integer? 108 What is the cube root of 4228 to the nearest integer? 16 What is 3772 to the power of 1/2, to the nearest integer? 61 What is 1003 to the power of 1/8, to the nearest integer? 2 What is 23127 to the power of 1/10, to the nearest integer? 3 What is the cube root of 3678 to the nearest integer? 15 What is the cube root of 1188 to the nearest integer? 11 What is 1731 to the power of 1/6, to the nearest integer? 3 What is the square root of 3089 to the nearest integer? 56 What is 94484 to the power of 1/4, to the nearest integer? 18 What is the sixth root of 31064 to the nearest integer? 6 What is the square root of 88510 to the nearest integer? 298 What is the fourth root of 10604 to the nearest integer? 10 What is 6790 to the power of 1/3, to the nearest integer? 19 What is 293 to the power of 1/2, to the nearest integer? 17 What is 3941 to the power of 1/9, to the nearest integer? 3 What is the seventh root of 8288 to the nearest integer? 4 What is 235 to the power of 1/2, to the nearest integer? 15 What is 28597 to the power of 1/4, to the nearest integer? 13 What is the cube root of 9958 to the nearest integer? 22 What is 2409 to the power of 1/3, to the nearest integer? 13 What is the cube root of 8236 to the nearest integer? 20 What is the seventh root of 7913 to the nearest integer? 4 What is the tenth root of 465 to the nearest integer? 2 What is 22586 to the power of 1/3, to the nearest integer? 28 What is the square root of 8399 to the nearest integer? 92 What is the third root of 11795 to the nearest integer? 23 What is the square root of 1170 to the nearest integer? 34 What is the cube root of 15207 to the nearest integer? 25 What is the third root of 384 to the nearest integer? 7 What is 20670 to the power of 1/10, to the nearest integer? 3 What is the square root of 1607 to the nearest integer? 40 What is 4036 to the power of 1/4, to the nearest integer? 8 What is the cube root of 1932 to the nearest integer? 12 What is the square root of 772 to the nearest integer? 28 What is 3380 to the power of 1/3, to the nearest integer? 15 What is the fifth root of 9601 to the nearest integer? 6 What is the square root of 2526 to the nearest integer? 50 What is the fifth root of 5665 to the nearest integer? 6 What is 4489 to the power of 1/4, to the nearest integer? 8 What is the square root of 11524 to the nearest integer? 107 What is the third root of 4423 to the nearest integer? 16 What is 644 to the power of 1/7, to the nearest integer? 3 What is the square root of 7573 to the nearest integer? 87 What is the sixth root of 673 to the nearest integer? 3 What is 10026 to the power of 1/5, to the nearest integer? 6 What is 83875 to the power of 1/2, to the nearest integer? 290 What is the square root of 19971 to the nearest integer? 141 What is 6467 to the power of 1/3, to the nearest integer? 19 What is 854 to the power of 1/6, to the nearest integer? 3 What is 2462 to the power of 1/8, to the nearest integer? 3 What is 3827 to the power of 1/10, to the nearest integer? 2 What is the sixth root of 23736 to the nearest integer? 5 What is the cube root of 18152 to the nearest integer? 26 What is 4779 to the power of 1/6, to the nearest integer? 4 What is the square root of 5938 to the nearest integer? 77 What is 23 to the power of 1/9, to the nearest integer? 1 What is the cube root of 10586 to the nearest integer? 22 What is 3083 to the power of 1/9, to the nearest integer? 2 What is 90879 to the power of 1/2, to the nearest integer? 301 What is the third root of 3154 to the nearest integer? 15 What is the eighth root of 20187 to the nearest integer? 3 What is the third root of 6290 to the nearest integer? 18 What is the square root of 62115 to the nearest integer? 249 What is the sixth root of 17583 to the nearest integer? 5 What is the square root of 417 to the nearest integer? 20 What is 1118 to the power of 1/3, to the nearest integer? 10 What is the cube root of 2658 to the nearest integer? 14 What is the third root of 19257 to the nearest integer? 27 What is 75425 to the power of 1/9, to the nearest integer? 3 What is 7301 to the power of 1/3, to the nearest integer? 19 What is the square root of 338 to the nearest integer? 18 What is the square root of 16722 to the nearest integer? 129 What is 1260 to the power of 1/9, to the nearest integer? 2 What is the sixth root of 4294 to the nearest integer? 4 What is the square root of 16345 to the nearest integer? 128 What is the third root of 54319 to the nearest integer? 38 What is the third root of 12721 to the nearest integer? 23 What is 2224 to the power of 1/3, to the nearest integer? 13 What is the square root of 1509 to the nearest integer? 39 What is 5086 to the power of 1/3, to the nearest integer? 17 What is 17650 to the power of 1/2, to the nearest integer? 133 What is 22834 to the power of 1/2, to the nearest integer? 151 What is 649 to the power of 1/10, to the nearest integer? 2 What is 1923 to the power of 1/2, to the nearest integer? 44 What is 10080 to the power of 1/2, to the nearest integer? 100 What is the square root of 1779 to the nearest integer? 42 What is the third root of 2073 to the nearest integer? 13 What is 42896 to the power of 1/2, to the nearest integer? 207 What is the cube root of 21889 to the nearest integer? 28 What is the sixth root of 1204 to the nearest integer? 3 What is the fourth root of 136 to the nearest integer? 3 What is the cube root of 48274 to the nearest integer? 36 What is 822 to the power of 1/2, to the nearest integer? 29 What is the square root of 108305 to the nearest integer? 329 What is the cube root of 4808 to the nearest integer? 17 What is 6595 to the power of 1/7, to the nearest integer? 4 What is 12255 to the power of 1/3, to the nearest integer? 23 What is the square root of 7577 to the nearest integer? 87 What is the seventh root of 2143 to the nearest integer? 3 What is 1090 to the power of 1/5, to the nearest integer? 4 What is the fourth root of 2214 to the nearest integer? 7 What is the square root of 786 to the nearest integer? 28 What is the cube root of 3376 to the nearest integer? 15 What is 126 to the power of 1/2, to the nearest integer? 11 What is the tenth root of 3251 to the nearest integer? 2 What is 1593 to the power of 1/2, to the nearest integer? 40 What is 1355 to the power of 1/7, to the nearest integer? 3 What is 156 to the power of 1/2, to the nearest integer? 12 What is the seventh root of 1643 to the nearest integer? 3 What is 18359 to the power of 1/10, to the nearest integer? 3 What is the ninth root of 34063 to the nearest integer? 3 What is 3216 to the power of 1/3, to the nearest integer? 15 What is the third root of 14517 to the nearest integer? 24 What is the cube root of 4609 to the nearest integer? 17 What is 22621 to the power of 1/5, to the nearest integer? 7 What is the square root of 7125 to the nearest integer? 84 What is the square root of 4412 to the nearest integer? 66 What is the four	{ "pile_set_name": "DM Mathematics" }
= -21/43 + b. Suppose 0t + 4t - 196 = 3u, 0 = 2u. What is the common denominator of t and a? 4 Calculate the common denominator of 53/22 and 37/6 - (9 + -7). 66 What is the common denominator of 9425/(-234) - (-4)/(-18) and -89/2? 2 Let i = 10 + -8. Let z = 4221/1648 - -13/103. Find the common denominator of (-69)/66 + i - 1 and z. 176 Let p(s) = -9s3 - 4s*2 - 4s - 2. Let z be p(-2). Suppose -2 = 5x - z. What is the smallest common multiple of 100/16 + 1/(-4) and x? 12 Suppose -2n = -5n + 54. Suppose 0 = -l + 2l - 5h + 2, -4l - 3h + 38 = 0. What is the least common multiple of l and n? 72 What is the least common multiple of 162 and (-21)/35 + 66/10? 162 Let w be 0 + (-6)/3-2. Calculate the common denominator of 63/8 and 291/12w/6. 24 Suppose 4o + 5l - 13 = -0l, -4o = -5l - 3. Find the common denominator of -65/12 and 1/4 - (-36)/o. 12 Let n be (-7 + 9)/(526/(-18)). Let u = n + -20143/1578. What is the common denominator of u and -55/8? 24 Let y be 2/618/3. What is the smallest common multiple of 3 and ((-3)/y)/((-6)/20)? 15 Calculate the smallest common multiple of 104/10 - (-4)/(-10) and 22. 110 Calculate the common denominator of 77/8 and (-2)/(-3) - 14/588. 56 What is the smallest common multiple of 4 and (-268)/(-22) + (-6)/33? 12 Let o = -635 + 4416/7. Find the common denominator of o and 17/9. 63 Find the common denominator of (9/63)/((-2)/79) and (-4)/18 - (-2984)/(-1152). 112 Suppose 0 = -2v + 5 + 1. Calculate the least common multiple of 11 and v. 33 Let i(h) = h*3 + 6h*2 + 2. Let w be i(-6). Suppose -25 + 5 = -wt. Calculate the least common multiple of 18 and t. 90 Suppose -508 = 4l + 664. Let c = l + 551. Let s = c + -4165/16. Calculate the common denominator of s and 79/4. 16 Let l(n) = -n3 + 8n*2 - 5n + 1. Let j be l(7). Calculate the smallest common multiple of j - (-6 - (-3 + 0)) and 12. 36 Let h = 7397/36 + -2036/9. Calculate the common denominator of (-2 + 25/11)/(8/(-104)) and h. 44 Let f = 4649 - 40256/9. Let j = f + -173. Find the common denominator of 7/3 and j. 9 Let u(y) = 7y + 13. Let q(b) = 6b + 12. Let t(k) = 6q(k) - 5u(k). What is the smallest common multiple of 22 and t(5)? 132 Suppose -f + 212 = f. Suppose -f - 4 = 5j. Find the common denominator of 62/9 and j. 9 Let k be (3 - 1) + -6 + 6. Suppose -3m = -kc + 18, -3c = -0c - m - 27. What is the smallest common multiple of 1 and c? 9 Suppose 5w + 12 + 8 = 0. What is the smallest common multiple of (-12)/1550/w and 8? 40 Let p(s) = s2 - 2s + 2. Let x be p(4). Suppose 0 = 2o + x, 9 = 2j - 5o - 36. What is the least common multiple of j and 8? 40 Let p(t) = 15t*3 - 2t + 1. Let z(w) = -w*2 + 4w + 6. Let m be z(5). Calculate the lowest common multiple of p(m) and 16. 112 Let w = 67961 + -206996/3. Let a = -25195/24 - w. Find the common denominator of a and -21/16. 16 Let a = -19 + 31. Suppose 1 = -4x + 73. Calculate the smallest common multiple of x and a. 36 Suppose 8b - 4b - 16 = 0. Let k(q) = -q2 + 2q + 5. Let c be k(0). Suppose -cw + 0 = 2i - b, 4w = -16. What is the least common multiple of i and 12? 12 Suppose -a = -0a + 5, 0 = 5f - 4a + 10. Let w be f/9 + 16/6. Suppose -3c + 7c = wu - 44, u - 26 = 4c. What is the least common multiple of 4 and u? 36 Let y = 3 - 5. Let d(f) = 2 + 0f + 3f - 4f - 5f. Calculate the lowest common multiple of 12 and d(y). 84 What is the common denominator of -73/9 and 2 + -5 - (0 - 7/(-30))? 90 Let v = 2 - 2. Suppose p + 42 + 8 = v. Find the common denominator of -131/6 and (10/6)/(12/p). 18 Suppose 0 = -2y - 2y + v + 36, 0 = 4y - 5v - 52. Let u be (-164)/y1-2. What is the common denominator of -7/16 and (-3)/(-8)u/(-3)? 16 Let u = 87 + -47. Calculate the least common multiple of u and 30. 120 Let r = 4499/1060 + 3/530. Find the common denominator of 1660/(-80)(-2)/(-8) and r. 16 Suppose 2d + 92 = -124. Calculate the common denominator of (-3)/2d/15 and 4/9. 45 Suppose 0 = 3s - 53 - 55. Suppose -r = 2r - s. Calculate the least common multiple of 34 and r. 204 Let i = -83 - -101. What is the least common multiple of 34 and i? 306 Let w(u) = -u3 - u2 + 2u. Let c be w(2). Let p = -2 - c. Suppose -15 - 21 = -4f. Calculate the lowest common multiple of p and f. 18 Let t = -4 + 12. Calculate the common denominator of -17/2 and (-189)/7(-3)/t. 8 Let w = 62/9 - 67/9. Find the common denominator of 67/10 and w. 90 Let o = 149112 - 599649/4. Let f = o + 794. Find the common denominator of 77/12 and f. 12 Let j = -1831 + 3735/2. Calculate the common denominator of j and 32/61. 122 Let n(i) be the second derivative of -7/6i*3 + i + 0 + 1/12i4 + i2. Calculate the least common multiple of n(7) and 4. 4 Find the common denominator of 1/(-7 + -4)40 and 1/(-2)267/6. 44 Let c be 96/(-10) + 10/(-25). What is the lowest common multiple of 5 and (-12)/c + 1/(-5)? 5 Suppose 3 = -3n - 0, 2n - 93 = 5r. What is the common denominator of -54/7 and r? 7 Suppose j + 4t - 11 = 0, -4j - 7 = -0j - t. Find the common denominator of (-1 - j) + (-85)/6 and -133/12. 12 Let j = -20/77 + -2204/1001. What is the common denominator of -36/7 and j? 91 Suppose -4k = 4q - 3k - 63, 0 = 2q - k - 33. Let o = 1 + 13. Calculate the lowest common multiple of q and o. 112 Let y = -10877/7 + 1548. Find the common denominator of 47/12 and y. 84 Let z = -918/19 - -45349/950. Calculate the common denominator of z and -49/18. 450 Let f(c) = 4c3 - c + 2. What is the lowest common multiple of f(1) and 9? 45 Let z = -14 + 33. Suppose 31 = -3p - l, -33 = 5p + 5l + 12. Let v = z + p. What is the least common multiple of 5 and v? 40 Let u = -61453/9936 + 167/27. Let h = -17383/16560 - u. Find the common denominator of -39/22 and h. 220 Let c = 2/1035 + 5794/1035. Calculate the common denominator of -39/17 and c. 85 Calculate the common denominator of -33(224/(-720) + 1/6) and 89/66. 330 What is the common denominator of -43/3 and (-5034)/(-540) - (-4)/(-18)? 30 Let a be (-2)/7 + 16/7. Find the common denominator of 33/16a/6 and 53/2. 16 Calculate the common denominator of -101/14 and ((-67)/12)/((-1)/3). 28 Let c = 4349 - 17485/4. Let p = 614623/171516 + -2/14293. Calculate the common denominator of p and c. 12 Let d(h) = h*2 - 6h + 14. Let w be d(6). Let p = -3 + w. Suppose 4u + u = -m + 12, 3m - 2 = 2u. Calculate the lowest common multiple of m and p. 22 Let b(f) = f. Let m be b(0). Let r be (-20)/7 + 5/(-35). What is the least common multiple of 5 and m + -3 + (r - -13)? 35 Suppose t - 17 = 2v - 3, -4t + 5v + 44 = 0. Calculate the lowest common multiple of t and (2 - 1)/((-2)/(-36)). 18 Find the common denominator of (-4)/(-10) - (-1422)/120 and -3/62. 124 Let s = 21 - 33. What is the common denominator of (4/s)/((-2)/(-64)) and 37? 3 Let o = -4/5 - -23/10. Find the common denominator of o and 137/18 + (-2)/2. 18 What is the common denominator of -101/8 and 100/32 - 4 - -4? 8 Let d be (2 + 1)/(6/(-4)). Let i = d + 8. What is the lowest common multiple of 22 and i? 66 Find the common denominator of 703/57((-15)/2)/5 and -99/14. 14 Suppose -2u + 6 = u. Calculate the lowest common multiple of 5 and (u/(-6))/(5/(-15)). 5 Suppose 0 = 5x - 2q + 6, 0 = -5q + 20 - 5. Suppose xs - s = -2c - 42, -3c = -2s + 81. Calculate the common denominator of s and -77/6. 6 Let m(u) = -u - 5. Let i = 6 + 4. Let p = i - 19. What is the least common multiple of m(p) and 14? 28 Let o = 5 - -1. Calculate the common denominator of 46/11 and 3/o + 129/30. 55 Suppose 2f - 8 = f. Let h be (-2)/f - 9862/(-88). Let r = h + -15211/132. What is the common denominator of r and 119/10? 60 What is the common denominator of -101/4 and (47/18)/(5/(-10))? 36 What is the common denominator of 558/168 - (-6)/14 and 30/7? 28 Suppose 5x + 5n - 17 - 18 = 0, -4x - 2n = -26. Let h = -155 + 159. What is the smallest common multiple of x and h? 12 Suppose 3o = 4o - 20. Suppose -w = w - 60. Let f = w - o. What is the smallest common multiple of f and 9? 90 Let g = 9 + 31. Calculate the smallest common multiple of 44 and g. 440 Let l = -36 - -58. Suppose -u + 10 + 0 = 0. What is the smallest common multiple of l and u? 110 Let x = 7343 + -73353/10. Calculate the common denominator of x and (	{ "pile_set_name": "DM Mathematics" }
lculate 132/1155715/(-12)62. -62 (1552/291)/((-7)/((-1155)/176)) 5 What is the value of (-668)/(-32064)(-24)/6? -1/12 (-52)/3(25)/(2640/(-990)) 65 (((-1)/2)/(12/3))/98-4 1/196 What is the value of 17(3618/(-162))/67? -17/3 (92/(-161))/((-1224)/51) 1/42 2/((3312/(-1265))/(-72)) 55 4-10830/(-1440) 9 Calculate 4240/(-4770)(-5)/1018. 8 Calculate (-323)/(-19)((-45)/(-102))/((-15)/(-12)). 6 Calculate 35/(-6)21051/46780. -21/8 Evaluate 160/(-30)(57/76)/(40/960). -96 (579/(-3281))/((-420)/170) 1/14 Evaluate ((6175/50)/(-19))/((27/9)/(-6)). 13 Evaluate (5298/(-3532))/((3/(-360))/((-1)/2)). -90 (42/(-140))/(((-504)/(-63))/16) -3/5 What is ((-4)/31)/(123388/17546)? -2/109 What is the value of (245/(-2058))/((-190)/304)? 4/21 Evaluate ((-110)/(-7810))/(2/(-4)). -2/71 What is the value of -111/1(-2036)/2036? 11 Calculate ((-56133)/126)/(-27)(-2)/(-11). 3 Calculate ((-5621)/(-1925)-25)/(2/2). -73 What is the value of 9160/30((-108)/(-56))/((-12)/14)? -108 What is -1((-816)/2856)/(20/21)(-105)/(-18)? 7/4 What is the value of 1230/2400112/12? 7/5 What is the value of 477/(-1696)(-2604)/279? 21/8 815/(-90)65/1860 -2/93 What is the value of ((-16)/((-16848)/81))/(21/(-6))? -2/91 Evaluate ((-59460)/(-26757))/((-1)/41). -80/9 Evaluate 45/(-9)1625/(-1400). 10/7 What is (34/435248)/(2/8)? 3/2 What is ((-708)/94/16)/((1050/90)/35)? -59 Calculate ((253/1012)/((-19)/76))/((-1)/125). 125 Calculate ((-16)/4)/(-1)-46(-45)/24840. 1/3 What is 38(84/(-16))/(-3)(560/(-49))/20? -38 Calculate 486/324-3(-8)/(-1). -36 What is the value of (-2090)/(-209)1(-4)/((-32)/68)? 85 (-388)/(171/((-16587)/(-388))) -97 Calculate ((-5)/6010)/(913/(-32868)). 30 Evaluate (-120)/((-160)/8)658/(-47). -84 Evaluate ((-1280)/((-210)/42))/(-10)1(-5)/(-2). -64 Evaluate (8/(-20)5)/(((-3)/18)/(98/14)). 84 Calculate (((-2)/13)/(2696/9984))/(-2). 4/13 Calculate ((-90)/126(-20)/50)/((-14)/(-2940)). 60 What is the value of 51748/(-3044)-12/(-6)-3? 17 (32/(-2))/((3708/(-76632))/(2/2)) 62 What is the value of (86208/14368)/(15/(-8))? -16/5 Calculate (138/391)/((13671/(-31))/21). -2/119 (24/(-36))/((-4000)/(1200/(-30))) -1/150 What is (((-1675)/670)/((-1)/(-2)))/((15/25)/(-3))? 25 What is ((-990)/180)/(273416/(-416))? 2/239 What is the value of (-20)/(-90)567/(-126)(-12)/108? 1/9 Calculate 15/(-210)42/4. -3/4 What is ((-77760)/(-10108800))/((1-2)/8)? -2/65 Calculate (120/45)/(44/1089-6). -11 Calculate 1/(-5)-4624(-80)/(-384). 46 What is the value of (51/2601595)/(5/6)? 14 Calculate ((1700/(-16))/(-5))/((-130)/(-4576)22). 34 Evaluate (-10)/(-6)(4(-111)/(-322640))/((-1)/(-8)). 2/109 What is (108/16)/(36/(-192))(90/9)/(-100)? 18/5 Calculate ((-60)/(-8))/(70/(-245)70). -3/8 Calculate (((-60390)/(-88))/45)/((-24)/(-96)). 61 Evaluate (77097/829)/(9/(-3)). -31 What is the value of ((-165)/(-198))/(6(-2)/(-72))-8? -40 What is the value of (92(-26)/143(-11)/(-4))/2? -23 Evaluate ((-3990)/(-2280))/((-14)/80). -10 Calculate -1119496/(-26114). 4 Calculate ((-54)/(-63))/((-248)/434)32/(-54). 8/9 Calculate 23/((-5428)/(-295))(-132)/(-15). 11 Evaluate ((-1304)/(-242544))/((-1)/12). -2/31 Calculate 106/44(-2684)/(-122). 53 Evaluate (-13(-24)/234)/(2/(-148)8/(-3)). 37 0/(12/963/(-84))(-2)/6 0 What is (-358)/358(-16)/218/16? 9 Calculate (-14)/(5782/37583). -26 Calculate (50/(-2500)45)/((-156)/(-20)). -3/26 Evaluate ((-11)/(-42))/(187022/(-153018)). -3/14 Calculate (29/(-58))/(-1)2/226. 13 What is ((-12)/(-1))/((12/168)/((-12)/(-21))464)? 6/29 What is ((-2)/88)/(19/5712/8)? -1/22 Calculate (3776/4248)/((-228)/(-54)). 4/19 ((-246160)/41630)/((-6)/69) 68 Calculate (-44)/(-154)2(-12)/(-468)211. 4/13 What is (242450/(-10080))/((-7)/1)? 5/6 Evaluate 21/35(-375)/(-15)(-10)/(-30). 5 What is the value of (203/116)/((-63)/216)? -6 1620/14042/(-1)5/25 -6/13 Calculate (1450/25)/(-29)8/(-360). 2/45 What is 3((-8)/(-252)-7)/(-2)? 1/3 Evaluate ((-2)/(-9))/(327/(-8829))(-26)/3198. 2/41 What is the value of 4(-3)/(-300)((-5280)/(-7128))/(4/3)? 1/45 Calculate 175/(-75)-78((-8)/(-1))/16. 91 What is (-20)/(-500)300/(-50)(-40)/6? 8/5 What is the value of (4/(-12)(-480)/(-80))/(4/2)? -1 What is the value of ((-10)/38703)/(36/54)? -1/43 Evaluate -102(2/(-4))/(10(-114)/(-760)). 34 Calculate (24747/(-452))/(6/2045/(-108)6). 73 Evaluate 122(-144)/(-65880)61/(-8). -1/5 What is (2/21)/(-1)2023/(-867)? 2/9 Evaluate -7(32/(-140))/((-120)/(-12150)-3). -54 (20/(1280/688))/((-280)/320) -86/7 Evaluate (-49872)/2078(-4)/912. 2/19 What is the value of (363/1452)/((26/(-24)3)/1)? -1/13 What is (4/(-60))/((-19)/(-95))(-29)/87? 1/9 Calculate ((-38801)/(-1446)(-48)/(-42))/(-4). -23/3 What is (13570/115)/(-118)249/2? -49 Calculate (-9000)/(-7000)(-48)/9. -48/7 What is the value of ((-20)/(-884))/((-323)/(-10982))? 10/13 Evaluate ((-13572)/42978)/(((-2)/(-19))/(-2)). 6 Evaluate ((25/(-10))/(-5))/((2673/(-7062))/81). -107 (126/(-18))/((-2)/2-6(-1)/3) 7/2 What is the value of (-8)/5(-5780)/(-2312)? -4 What is the value of 4071138/(-4598)? -37 Calculate 39/(202410/(-1384))18/(-8). 3/5 What is the value of (-5406)/34(-65)/(-78)(18/(-15))/(-6)? -53/2 Calculate 72/(-54)(-117)/4162. 3/4 What is the value of 1/((74/(-1628))/(5/(10/(-7))))? 77 Calculate 299/(11960/120)2/57. 2/19 What is the value of 35288/1604-224/44? -24 What is the value of (-232)/2010819/608? -29 What is (-408)/(-340)(-15)/(-24)40/(-33)? -10/11 What is (1242/(-7245))/((-10101)/(-455))? -2/259 Calculate ((-264)/9)/(50/(-15)27/(-135)). -44 What is (-6)/320432/7662? -16/3 (-10)/18052/39 -2/27 Evaluate (-18)/9((-425)/(-1125))/17. -2/45 What is the value of (4/(-16))/(14/392)((-72)/(-2121))/(-12)? 2/101 Calculate ((64/176)/((-128)/(-2112)))/(4/6). 9 Evaluate 1306960/326742/6(-3)/4. -10 Calculate ((-148)/1480)/((3/4)/(15/4)). -1/2 What is the value of ((-8)/(-68))/((-7745)/(-3098)(-3)/(510/(-4)))? 2 What is the value of ((-17016)/(-7090))/(84/5)? 1/7 Calculate (72/4554)/((-1221)/(-9361)). 4/33 (1855/70)/(45/90) 53 What is (93/45)/((246/(-205))/(56/8))? -7/2 What is 2915/(-221540)(-8)/(-2)? -1/19 Calculate ((-1004)/753)/(13/(-3))(225/(-10))/(-9). 10/13 Calculate (-10)/79(-924)/1485. 8 What is the value of (1521/(-936)30/(-39))/(2/136)? 85 Evaluate 1781000/311675(42/8)/1. 30 What is the value of 53(-5244)/(-54378)(-6)/(-23)? 4/3 Evaluate (3(-49)/(-18))/(1916/(-1824)). -49 What is (33/132-15)/((6/20)/(72/60))? -15 Evaluate -4027/1440(-80)/(-66). -10/11 Evaluate (-1682)/(-2523)36/2. 12 What is (((-40)/(-9))/2)/(21/((-7560)/(-150)))? 16/3 Evaluate ((-174)/(38280/(-110)))/(3/474). 79 What is the value of ((-830)/(-1162))/(10/(-1050))? -75 Evaluate ((-85)/(-17850)105)/(1/(-10)). -5 What is (1350/(-20))/(-15)(10304/(-98946))/56? -2/239 Evaluate ((2800/(-910))/20)/(15/(-26)). 4/15 Calculate ((-42)/20(-345)/(-1242))/((-15)/(-80)). -28/9 What is 9/((2(-6)/8)/(4704/2352))? -12 Calculate (((-210)/84)/((-30)/3))/(6/246-1). -41/4 What is the value of (-294378)/(-652)4/42? 43 Calculate (152/(-190))/(((-34)/(-10))/((-95)/(-3610))). -2/323 What is the value of 2/((-1160)/6)14/(-9)(-32)/112? -2/435 What is the value of (327/(-218))/((-15)/(-410))? -41 ((-2)/(-73))/(9204/6382974) 19 (-3)/(-15)235148/31302 2/9 ((-17)/((-4386)/4))/2(-33)/224 -2/43 Calculate 1008/(-27)6900/4025. -64 Evaluate (2(-54)/33)/(5372/29546). -18 Evaluate ((324/21)/(-6))/(3/((-756)/48)). 27/2 What is the value of (-2)/(-30)(3/6)/((-16)/(-1248))? 13/5 Evaluate ((-8)/(-2))/((-86)/(-11696)-34). -16 Calculate (18/11583-9)/(9/(-117)). 2/11 What is 1446/482(-6)/27(-1809)/(-54)? -67/3 Evaluate (-6)/(-18)8235/732-12. -45 Evaluate 3/(-195)3235/647. -1/13 Evaluate ((-9)/(-828))/((-3)/4)180/(-30). 2/23 60882/4234290/(-30) -139 (-1292)/(-16)1720/4085 34 What is (3/9)/(32(-20)/109440)? -57 (((-36)/738)/(264/(-83886)))/((-1)/(-6)) 93 (-16)/6((-119)/(-34))/(-7)-45 -60 What is the value of 1566279/535488/3? 78 ((6/(-8))/((4554/8052)/23))/(2/4) -61 What is (-2(30/12)/(-1(-3)/15))/2? -25/2 Calculate (-142)/((-2)/2(-6)/3(-283)/(-283)). -71 Evaluate ((-12100)/660)/(15/9). -11 What is (3/(-3))/1(-12610)/5044? 5/2 What is (20/(-5)*(-1)/10)/((-27)/(135/(-1)))? 2 What is the value	{ "pile_set_name": "DM Mathematics" }
29) Simplify (((k/(k/k*(-3/5)))/kk)/k)/kk9 assuming k is positive. k(32/5) Simplify a/(aa*18)a(4/15) assuming a is positive. a(-266/15) Simplify m*(-3)/(m/(mm/m*(-11)mm)) assuming m is positive. m11 Simplify (sss(s/s*(2/15)s)/ss)/s(4/3)(s*8/s)/ssss(1/3) assuming s is positive. s(178/15) Simplify ((a/a*(1/4)a)/a(-2/5))/(a(3/2))(2/67) assuming a is positive. a(2821/1340) Simplify ((s4)(-4/9))37 assuming s is positive. s(-592/9) Simplify (n1)27/(n/(nn(-4)n)n/((nn/n*0n)/nn)) assuming n is positive. n26 Simplify o(-4/3)/(o/(o/(ooo(-3/2)ooo))oo)o(-1/8)o7 assuming o is positive. o(1/24) Simplify a/((a/(a/a*15a))/a)a/(a/(a/a(-10/9))a) assuming a is positive. a(-98/9) Simplify (l(-2/7)/l)*49/(llll/(l/l*(1/4))l(l/(ll(-2/7)))/l) assuming l is positive. l(-1863/28) Simplify a3/a(-6)(((aa*(-2))/aa)/a)/(a/a(-4)) assuming a is positive. a2 Simplify ((vvv*8)/(vv/(v/(vv/v(-1/18)))v))(-2/57) assuming v is positive. v(-107/513) Simplify (x/(xx(-2/17)x))/(x/x*(3/4))(x(-1))(-39) assuming x is positive. x(2575/68) Simplify q21/qqqq(-4) assuming q is positive. q18 Simplify (zz(zz*(-2/9))/zzz)/z32 assuming z is positive. z(-254/9) Simplify (mmm/(m/(mm*(1/3))m))*(-31)(mm10/m)/m(-2/29) assuming m is positive. m(-5417/87) Simplify tt/(t((tt*(-1/3))/t)/t)(ttt*(-1/4)t)/tt(6/7)/(t(-5/4)t) assuming t is positive. t*(109/21) Simplify (xx/(xxx((x(1/4)x)/xx)/x)xx(-1/5))(2/75) assuming x is positive. x(-3/250) Simplify ((c/(cc/(c/((cc/(cc*(-3/11))c)/c)c)c)ccc)/c)(23/4) assuming c is positive. c(46/11) Simplify f15/ff(-13) assuming f is positive. f Simplify (m(-7))(-7) assuming m is positive. m49 Simplify d*(-2/5)/(dd*(-3/8))(dd(-4))/(d/(dd/(d*0d)d)) assuming d is positive. d(-121/40) Simplify y9y*(-6/11)/yy assuming y is positive. y(93/11) Simplify ((o/o3)/o)(-16) assuming o is positive. o48 Simplify b/b*(-7)b3 assuming b is positive. b11 Simplify ((x(-1/8)/x)/x)/x(1/5)x(-4/5)x2 assuming x is positive. x(-9/8) Simplify (k/(kk(1/7))k*(-1/3))/(kk0/k)19 assuming k is positive. k*(-10/21) Simplify (ss*(2/5)s(s/(s/(s(-2/7)/s)))/s)/(((((ss(ss*0)/s)/ss)/s)/s)/(ss(-2/7))) assuming s is positive. s(29/35) Simplify (r0r)(5/8) assuming r is positive. r(5/8) Simplify (g*(3/7)(g/(g(4/5)/g))/g)/((g(2/5)g)/(g/(ggg(-6)gg))) assuming g is positive. g(78/35) Simplify ((m(3/5)/m)/mm)/m(m(1/33)m)/m assuming m is positive. m*(-226/165) Simplify ((ll*(8/5))/(l/(((ll*(-4)l)/l)/ll)))(10/7) assuming l is positive. l(-2) Simplify d/(d(9/8)/d)d*(-13)d assuming d is positive. d*(-89/8) Simplify (c/((((cc(-2/3))/c)/c)/c))/(((c/c(-2/9))/c)/c)(c1)(22/5) assuming c is positive. c(398/45) Simplify (www(w/(w*(-1/4)w)w)/ww)/(w/((w*(-8)/ww)/w))(w2)(-46) assuming w is positive. w(-391/4) Simplify z(-14)/zz(-1/9) assuming z is positive. z(-136/9) Simplify c(-22)/(c(-17)c) assuming c is positive. c(-6) Simplify (v/v(-10)v((((v(-15)v)/v)/vv)/v)/v)(-10) assuming v is positive. v50 Simplify (ww(-1/2))35 assuming w is positive. w*(35/2) Simplify (hh*(-13)/hhh)/(h/(h(hhh((hhhh*(10/11))/hh)/hhhh)/h)) assuming h is positive. h(-34/11) Simplify (i/(i(-2/15)/i)i)/(i/(i/(ii28/i))) assuming i is positive. i(-373/15) Simplify ((v(2/9))(1/16))(-9/7) assuming v is positive. v(-1/56) Simplify ((gg(-6))/g0)/(g(2/3))(-1) assuming g is positive. g(-13/3) Simplify (c/(c/(c(-10)c)))/(c/c(2/75)) assuming c is positive. c(-748/75) Simplify (t(t/((t/(t/t*(-2/9)))/t))/tt(-8))/(t4t(tt/(t1/t)t)/t) assuming t is positive. t*(-115/9) Simplify (l/(l/(l/(ll/(l/(l*(-15)/ll))))))/(l/l17) assuming l is positive. l31 Simplify t*(2/9)t*(1/4)t((tt*(-2/7)ttt)/t)(-42) assuming t is positive. t(-4051/36) Simplify (x*0/xx(xxx(-5/2)/x)/x)(3/16) assuming x is positive. x(-15/32) Simplify (((ss/(ss2)s)/s)(-1/14))(1/26) assuming s is positive. s(1/364) Simplify (r8r)/r(1/14) assuming r is positive. r(125/14) Simplify jj*(2/117)jjjj/(j(9/2)/jj) assuming j is positive. j(121/234) Simplify ((f/(f0/f))/f)(-1/8)/(f(2/7)/(f*(-1)/ff)) assuming f is positive. f(-79/56) Simplify (l(1/5)/(l/(ll2)))/(l(-1/3))(-17/5) assuming l is positive. l(16/15) Simplify (u/(uu*1u))/(((u/(uu/u(-3)))/u)/u)(u(-1/3))(-2/23) assuming u is positive. u(278/69) Simplify q2q(-13)qq assuming q is positive. q(-9) Simplify (r0r*(1/5))/(r/(rr*(-6/5)r)r(-1/4)) assuming r is positive. r(1/4) Simplify s(-6)(s*7s)/s(s/(s1/s))(2/55) assuming s is positive. s(57/55) Simplify i(3/7)/((ii*(-1/2)/i)/i)(ii(-2/7))(-5) assuming i is positive. i(-23/14) Simplify v(2/7)/(vv32) assuming v is positive. v(-229/7) Simplify ((z(z(-1/5)zz)/z)(-7/4))(19/3) assuming z is positive. z(-399/20) Simplify (u/(uu*(3/2)u))/uuuu(-4)(u(-4/3)/u)/((u/(u6/u))/u) assuming u is positive. u*(-17/6) Simplify ll*2l/l(-13) assuming l is positive. l17 Simplify (r(-1))19 assuming r is positive. r(-19) Simplify (g(1/4)gg)23 assuming g is positive. g(207/4) Simplify (zz(-2/5))(2/29)/((zzz(2/13)zz)/((z(3/10)z)/zz)) assuming z is positive. z(-10603/3770) Simplify r(-19/4)(r(r/(r/((r/((rr*(-8/7))/rr))/r))r)/r)/r assuming r is positive. r(-129/28) Simplify f/((ff/f*(-9/7)f)/f)f(-12) assuming f is positive. f(-100/7) Simplify (u(-12)u)45 assuming u is positive. u(-495) Simplify (mm(-5/6)mmm(-2/9)/m)27 assuming m is positive. m(51/2) Simplify (u/u(-19)(u(uu20)/u)/uu)36 assuming u is positive. u1476 Simplify l*16ll/l(-2/3) assuming l is positive. l(56/3) Simplify ((vv2/v)30)(-20) assuming v is positive. v(-1200) Simplify m*(2/3)m*(-1/11)/mmmm*(1/4)m/m(-1/4) assuming m is positive. m(203/66) Simplify ((ll9l)/l)/(l*(-2/5)/lll)(l*(-7)l)/(l/l(-6/11)) assuming l is positive. l(102/55) Simplify ((x2)24)(-35) assuming x is positive. x(-1680) Simplify (((a*1a)/a)/(aa(-4/11)))(11/3) assuming a is positive. a(4/3) Simplify (ii/(i/(i*(1/8)/i)i)ii)/i(-13) assuming i is positive. i(113/8) Simplify (j*(-5/12)j)/jj/(j20/j) assuming j is positive. j(-221/12) Simplify (w(-3/7))(-37) assuming w is positive. w(111/7) Simplify (l/(l/(l(1/3)ll))l)39/(l5ll0) assuming l is positive. l124 Simplify (h/(hh(-1/5))hh(-5))/((h0h)/h(-2/15)) assuming h is positive. h(-74/15) Simplify (i/(i/i*10i))(-19) assuming i is positive. i(-171) Simplify ((l/((l/l(2/15))/l))/(l1l))/(((l(2/9)/l)/l)/(ll/(l/l(1/5)))) assuming l is positive. l(19/9) Simplify (g/g0)(-4/21)/(((g*1g)/gg)/(g(-1)/g)) assuming g is positive. g(-88/21) Simplify (p(-3/5))(3/37) assuming p is positive. p(-9/185) Simplify (u(2/9)u)*(11/7)(u/(uu/u(-3/5)u))24 assuming u is positive. u(-19051/315) Simplify l*(-6)/lll1/lll(2/3)((ll(-5))/l)/l assuming l is positive. l(-31/3) Simplify z(-1/10)z*(-3)(z/z(-1))(1/19) assuming z is positive. z(-569/190) Simplify (o/o(2/15))/o(-14/5) assuming o is positive. o(11/3) Simplify (w*(-7)/((w(w/(ww5))/w)/w))(-2/13) assuming w is positive. w(2/13) Simplify ((t(1/7)/t)/((t(ttt*(-4/7))/tt)/t))(-3/38) assuming t is positive. t(24/133) Simplify (y*(-2/11)(yy/((y/y(4/3)y)/y)y)/yyy)/(y/y(2/3))(-3/10) assuming y is positive. y(1403/330) Simplify (g/g(-2))/g(9/5) assuming g is positive. g(6/5) Simplify ((q(-5/4)/qqq)/q)/qqq(-8)(qq0)/q(-4) assuming q is positive. q(-17/4) Simplify ((yy(-1/9))(1/37))(9/4) assuming y is positive. y(2/37) Simplify (i/(ii(2/23))ii(i/((ii(-4/3))/ii))/iii)48 assuming i is positive. i(4688/23) Simplify n/n*(-1/2)n*(-4/3)n/(nn/(nn*3))n**(-1/3) assuming n is positiv	{ "pile_set_name": "DM Mathematics" }
- 684. What is the tens digit of x? 6 Let n(d) = d*3 - 2d*2 - 2. Let l be n(3). Let s = 12 - l. Let f = s + -3. What is the units digit of f? 2 Let h = 4 + -6. Suppose 2r - 17 = w, -2w - 4r = 2 - 0. Let a = h - w. What is the units digit of a? 7 Let y(d) = d*3 + 14d*2 + 13d + 7. Let r be y(-13). Let i(o) = 2o - 3. What is the tens digit of i(r)? 1 Let k be (-16)/3 - (-4)/(-6). Let z(n) = -5n - 8. What is the tens digit of z(k)? 2 Let f be (1/3)/(3/342). Suppose f = 3z - n, z + 36 = 2z - 5n. What is the units digit of z? 1 Let a be -2 + 5 - (-2 + 0). Let o = a - 4. What is the units digit of o? 1 Let z = 42 - 13. What is the tens digit of z? 2 Suppose 0 = -x - 2v + 13, 4v - 6 = -x + 13. Let w = x - 2. What is the units digit of w? 5 Let s(u) = u. What is the units digit of s(6)? 6 Let z(p) = 5p*2 - 4p - 1. Let a(k) = -9k2 + 8k + 1. Let r(w) = -4a(w) - 7z(w). Let g be r(2). Let u = 0 - g. What is the units digit of u? 1 Let u(x) be the second derivative of -1/2x2 + 0 + 1/6x3 - x. What is the units digit of u(3)? 2 Let n(z) = -z3 + 7z2 + 7z + 1. Let o be n(7). Let q = o - 24. What is the tens digit of q? 2 Suppose -5d = z - 3z + 26, 6 = -2z - 3d. Suppose -b + 100 = zb. What is the units digit of b? 5 Suppose -3v - 5l + 10l + 109 = 0, -v + 4l = -41. What is the units digit of v? 3 Let z(b) = 2b*3 - 2b*2 - 10b + 2. What is the units digit of z(6)? 2 Let j = 11 - 4. Let q(o) = -4o2 - 6o - 15. Let s(m) = m*2 + 1. Let l(z) = -q(z) - 5s(z). What is the units digit of l(j)? 3 Let s(d) = -d*3 + 2d*2 - 4d + 6. Let q(t) = -t3 + t2 - 3t + 6. Let r(k) = -6q(k) + 5s(k). What is the units digit of r(-4)? 2 Let k = -22 + 46. What is the tens digit of k? 2 Let n be 106/(-9) + (-4)/18. Let s be -1 - (-1 - -2) - -21. Let o = n + s. What is the units digit of o? 7 Let j = 123 - 84. Suppose -y + j = 2y. What is the units digit of y? 3 Let b(a) = -a*3 + 3a*2. Let z be b(2). Suppose 0 = -0d + d - z. Suppose -5l - 2m = -39, -2l + dm - 3m = -12. What is the units digit of l? 7 Let z = 15 - 12. Suppose 111 = zs + 18. What is the units digit of s? 1 Suppose -o - 5p + 0 = -5, -5 = -o - p. Suppose 0k - 52 = -ob + 2k, -2k - 42 = -4b. What is the units digit of b? 0 Suppose -5s + 3v + 371 = 2v, 227 = 3s - 5v. What is the units digit of s? 4 Let x be 4/(-2) - -12 - 2. Let g(y) = 6y - 9. What is the tens digit of g(x)? 3 Let d = -134 + 244. What is the hundreds digit of d? 1 Let u(c) = 2c2 + 4. Let f be u(3). Let i = f - 8. What is the tens digit of i? 1 Suppose -f = -5m - 211, -3m + 6m - 844 = -4f. What is the tens digit of f? 1 Let c(b) = 2b*3 - 43b*2 + 26b + 23. What is the tens digit of c(21)? 2 Let l be 2/(-5) + 72/(-20). Let n = 6 + l. Suppose 0 = -4w + 62 - n. What is the tens digit of w? 1 Suppose -2g + 5g + 5j + 1 = 0, 3g + 3j = 9. Let u = g + -5. What is the units digit of u? 3 Let h(i) = -i3 - i2 - 2. Let j be h(-2). What is the tens digit of (4/j)/(6/63)? 2 Let z(b) = -b - 7. Let c be z(-5). What is the units digit of 1/c - 19/(-2)? 9 Let y = -9 + 51. What is the tens digit of y? 4 Suppose 3x + 14 = 5x + 3o, -4x + 16 = 3o. What is the tens digit of 24/x1 - -3? 2 Let g be -13(0 + -1). Suppose 0 = gv + v - 60. What is the units digit of v? 5 Suppose -1279 - 81 = -5q. What is the tens digit of q? 7 Suppose -3o - 5 - 1 = 0. Let a = o - -6. Suppose -5f = 5l - 35, -l + af = 9 + 4. What is the units digit of l? 3 Let p be -2(-3 - 28/(-8)). What is the units digit of -13(0 + -1 + p)? 6 Let c(j) = -j*3 + 10j*2 + j + 9. What is the tens digit of c(10)? 1 Suppose 3o = 4j + 1, 3o - 20 = -o - 4j. Suppose b = ob - 26. What is the tens digit of b? 1 Let z(i) = -i*2 - 14i - 1. What is the units digit of z(-9)? 4 Let u(j) = 28j3 + j2 - j + 1. Let t be 6 + -3 - 2 - 0. What is the tens digit of u(t)? 2 Let c = -10 - -15. Suppose -cv - 7 = -2. What is the units digit of (v/3)/((-3)/27)? 3 Let u(x) = -15x - 13. What is the tens digit of u(-3)? 3 Let l be 20/6 - 3/9. Suppose -lb - 1 = -4. What is the units digit of b? 1 Let h(z) = -26z + 25. What is the hundreds digit of h(-4)? 1 Suppose 2a + 0a - 171 = 5n, 0 = -2n + 2a - 72. Suppose -2b - 21 = q + 24, -4b = 3q + 139. Let r = n - q. What is the units digit of r? 6 Let d(r) = 2r*2 - 7r + 2. What is the hundreds digit of d(-6)? 1 Suppose 0 = -5x - 16 - 4. Let q(h) be the second derivative of -h4/12 - 7h*3/6 - 5h*2/2 + h. What is the units digit of q(x)? 7 Suppose 2o + 33 = 3o. What is the units digit of o? 3 Let g = 213 + -119. What is the tens digit of g? 9 Let p(y) = -y2 - 7y - 6. Let d be (-1)/(-5) + 78/(-15). Let c = d - -1. What is the units digit of p(c)? 6 Let v = -10 - -4. What is the units digit of ((-4)/v + -4)-9? 0 Let a = 3 - -11. What is the tens digit of a? 1 Let k = 98 - 0. What is the units digit of k? 8 Let v(a) be the first derivative of a4/4 - a3 + 2a*2 + 7. What is the units digit of v(3)? 2 Let r(h) = -2h - 10. Suppose -19 + 5 = 2d. What is the units digit of r(d)? 4 Suppose d = -d + 30. Let v = d - 4. What is the tens digit of v? 1 Let o be (4/2)/(1 - 2). Suppose -3j = -3 - 0. What is the units digit of ((-4)/(-2) - o) + j? 5 Let l = 2 + 4. Suppose t + 2t = l. What is the units digit of t? 2 Suppose -4l - 3 + 15 = 0. Suppose -h + 4 - 1 = p, 0 = -lp + 6. What is the units digit of h? 1 Suppose 4q - 6 = 10. Suppose -qf = -44 - 20. Suppose 0 = -2c, 2m = 3c + 2c + f. What is the units digit of m? 8 Suppose 0 = 4z + 2y - 210, -3z + 7z + 3y = 215. Suppose 3t - t - z = 0. What is the tens digit of t? 2 Let p(h) = 13h*2 - h - 5. What is the hundreds digit of p(3)? 1 Suppose 0p = 3p - 39. What is the units digit of p? 3 Let k = -4 - 8. Let c = k - -7. What is the units digit of c/2(-4)/5? 2 Suppose 0 = -3j - 4f + 211 + 66, 5 = 5f. What is the units digit of j? 1 Let u = -9 - -7. Let d(c) = 7c*3 + 8c*2 + 8c + 7. Let q(m) = -13m3 - 15m*2 - 15m - 13. Let h(w) = 11d(w) + 6q(w). What is the units digit of h(u)? 3 Let m be ((-1)/(-1))/((-4)/(-20)). Suppose -l + ml - 48 = 0. What is the units digit of l? 2 Let z(p) = -p - 8. What is the units digit of z(-11)? 3 Suppose 0i = -3i + 924. What is the units digit of (-3)/(-2)i/33? 4 Let d(y) = -y + 7. Let w be d(6). Let p be (-1 - w)/((-14)/7). Suppose 0 = 5n + 3o - 10, -n + 3o + 1 = -p. What is the units digit of n? 2 What is the units digit of 5(-28)/(-35)18/8? 9 Suppose -7b + 2b = -3d + 6, -5d - 4b = 27. Let y = d - -11. What is the units digit of y? 8 Suppose -4z + 165 = 5g, -4z + 2z + 27 = g. Suppose 27 = 5n + u + 3u, -5n + g = -u. Let b(i) = -i3 + 8i*2 - 6i - 5. What is the units digit of b(n)? 2 Suppose 3w - 30 = -0w. What is the units digit of ((-12)/w)/((-3)/15)? 6 Suppose -4d + 4r = 4, -2d + 13 + 5 = 2r. Suppose 10 = a - 4x, 3a - 44 - d = 3x. Let p = 27 - a. What is the units digit of p? 9 Let l(k) = k3 + 7k*2 - 3k + 11. What is the units digit of l(-7)? 2 Suppose -3u = 4a + 14 - 69, 0 = 5a - 3u - 35. What is the tens digit of a? 1 Suppose j = 4j. Suppose -5w = -jw - 60. Suppose -3f + 12 = -w. What is the units digit of f? 8 Let y be (3 - 2)0 - -1. Let d = y + 24. What is the units digit of d? 5 Let v = 58 - 4. What is the units digit of v? 4 Let h(t) = -40t + 2. Let y be h(2). What is the units digit of 2/(3(-4)/y)? 3 Suppose 6r + 576 = 9r. What is the units digit of r? 2 Suppose 2u - 4 = -0u. Suppose -us - 105 = -5s. What is the tens digit of s? 3 Suppose m + 9h - 26 = 4h, h = -2m + 7. Suppose r - m = 38. What is the units digit of r? 9 What is the units digit of 5/((-15)/(-36))5? 0 Let x be (0/(2/(-1)))/2. Suppose -3 = -q - x. Suppose 30 = 3p - q. What is the units digit of p? 1 Let u(b) = -2b + 6 + 2 + b + 0b. Let t be u(0). Suppose 0 = -tr + 3r + 65. What is the tens digit of r? 1 Suppose u + 2z = -z + 116, -2u + 232 = 5z. What is the units digit of u? 6 Suppose -2f - 63 + 175 = 0. What is the tens digit of f? 5 What is the units digit of 4 + 2(-86)/(-4)? 7 Suppose 0n = 7n - 189. What is the tens digit of n? 2 Let f(u) = -5u*2 + u. Let a be f(-1). Let s(y) = -5y - 12. What is the	{ "pile_set_name": "DM Mathematics" }
*2 - 2v. Let d be t(-2). What are the prime factors of d/(-5)(1000/15)/2? 2, 5 Let t = 8 + -11. Let b = -1 - t. What are the prime factors of (-806)/(-18) - b/(-9)? 3, 5 Let l be (70/(-8))/(3/12). Let u = l + 88. What are the prime factors of u? 53 Let q(l) be the third derivative of l6/60 - l5/12 - 5l*4/24 - 2l*3/3 + 7l*2. Let g be q(5). What are the prime factors of (6/4)/(8/g)? 2, 3 Let w = 273 + -228. What are the prime factors of w? 3, 5 Let x(m) = 2m*3 + 6m*2 + 3m - 1. Let r be x(-3). What are the prime factors of (-38)/((8/20)/(26/r))? 13, 19 What are the prime factors of (2 - (-436)/8)/(1/26)? 13, 113 Suppose 0 = 3h + 12, -h = v - 23 - 80. Suppose v - 1547 = -8q. What are the prime factors of q? 2, 3, 5 Let m be (-6)/(4/(-4 + 2)). Let i = m + -19. List the prime factors of 36 - (-7)/((-28)/i). 2, 5 Let p(k) be the second derivative of k5/20 - k4/12 + k*3/6 + 105k*2/2 - 4k. List the prime factors of p(0). 3, 5, 7 What are the prime factors of (-426)/4432/(-24)? 3, 71 Suppose -10q + 7q = 3j - 4086, -2q = 3j - 2727. What are the prime factors of q? 3, 151 Suppose 0 = 1058x - 1053x - 5120. What are the prime factors of x? 2 Suppose -47d + 24642 = -4216. What are the prime factors of d? 2, 307 Let a be (-78)/(-65)(-10)/(-4). Suppose -3z + 41 = -19. Suppose 0 = -2q - aq + z. List the prime factors of q. 2 Let z(j) = j3 + 23j*2 - 38j + 10. List the prime factors of z(-24). 2, 173 What are the prime factors of (9200/6)/2 + (-29)/(-87)? 13, 59 Let x(n) = -7n - 20. Let z be x(-8). Suppose m - h - z = 0, -m + 4h + 40 = h. List the prime factors of m. 2, 17 List the prime factors of (2 + 2)/(15/((-12225)/(-10))). 2, 163 Let w be (-1)/(-1) + 0 + 4 + -4. Let h(t) = 159t - 2. What are the prime factors of h(w)? 157 Suppose -68f = -58f - 18260. List the prime factors of f. 2, 11, 83 Suppose -31j - 4878 = -40j. List the prime factors of j. 2, 271 Let w(o) = 232o*2 - 3o - 2. Let i be w(-1). Let x = -117 + i. List the prime factors of x. 2, 29 Let p(x) = -5x + 24. Let l = -3 - 8. List the prime factors of p(l). 79 Suppose a - 6a = -50. Let c = 0 + 5. Suppose 3p = p - a, cf + p = 50. What are the prime factors of f? 11 Let y(j) = j + 7. Let x be y(-14). Let s be 6/21 + 156/x. Let m = 46 + s. What are the prime factors of m? 2, 3 What are the prime factors of 5(8/10)/(66/12045)? 2, 5, 73 Let t(o) = 2o*2 - 2o + 4. Let q be t(2). Let g be (-1)/10/q. Suppose g = 2u - 81 + 29. List the prime factors of u. 2, 13 Suppose t - 5477 = -4i, 3t - 549 = -2i + 2192. What are the prime factors of i? 37 Let h = -19 - -16. Let x be (-4 - h)/(2/(-8)). List the prime factors of (-850)/20x/(-5). 2, 17 Let i be (9/(-6))/(3/(-12)). Let v(z) = z*2 + 2z - 9. What are the prime factors of v(i)? 3, 13 Suppose -c + 2u + 2 = 4u, 5c + 4u = 28. Let h(n) = 4n + cn + 4 - 2 - 3n. What are the prime factors of h(3)? 29 Suppose -49h + 40h + 17856 = 0. List the prime factors of h. 2, 31 Let m be (6 + -3)/(9/(-6)). Let c be m/(-12) + 11/6. Suppose 4n - 131 = -3j, 0n + 34 = n + cj. List the prime factors of n. 2 Let k(v) = 14v + 6. Suppose 4y - 3 - 5 = 0. Let r(w) = 3w + 1. Let f(z) = yk(z) - 11r(z). What are the prime factors of f(-3)? 2 Let l(g) = g*3 - 5g*2 + 7g - 4. Let y be l(4). Let d be 7/(28/40) - -1. Let p = y + d. List the prime factors of p. 19 Let n(j) = 19j3 - 8j*2 + 10j + 23. What are the prime factors of n(4)? 1151 Let p(z) = 37z + 735. What are the prime factors of p(0)? 3, 5, 7 Let v(a) = 2a + 2. Let p be v(2). Let f = p + 8. Suppose 11 = b - f. What are the prime factors of b? 5 Let j(r) = -27r + 27. Let v be j(-3). Suppose -v + 276 = 2t. What are the prime factors of t? 2, 3, 7 Let i = 181 + -127. Let d = -32 + i. List the prime factors of d. 2, 11 Let p = 579 - 392. What are the prime factors of p? 11, 17 Suppose -4h + 13 = -7. Suppose -j + hi - 3 = 0, i = -3i + 4. Suppose -2a = -jw - 2w + 56, -w + 4 = 2a. List the prime factors of w. 2, 3 Let d be (-12 - 48)/(-2 + 0). Suppose 29b = db - 216. List the prime factors of b. 2, 3 Let l(z) = -4z*2 + 10z - 6. Let j(y) = -y*2 + 1. Let h(f) = -3j(f) + l(f). Let x be h(8). Suppose -x = -t + 9. List the prime factors of t. 2 Suppose 8o = 36 - 12. Suppose -oi + 168 = -0i. List the prime factors of i. 2, 7 Suppose -t + 328 = 2m, -2m + 7m = -4t + 1309. What are the prime factors of t? 2, 163 Suppose 0 = -2i - 0i + 4. Suppose ir - 7r - 20 = 0. List the prime factors of (-8 - r) + 2 + 11. 3 List the prime factors of (62/16)/(2/1632). 2, 3, 17 Let o be -6342/10 + (-7)/35. Let m = o + 320. List the prime factors of m. 193 List the prime factors of 2168/(3(-8 + 98/12)). 2, 271 Suppose -2f + 12 = 4l, 5l = -5f - 1 + 6. What are the prime factors of 9/(-3)-63 - 0/f? 3, 7 Suppose 0m + 4m - 5b = 73, -2m = -2b - 34. Let a = m - -33. What are the prime factors of a? 3, 5 What are the prime factors of (-80880)/160(-28)/3? 2, 7, 337 Let j(l) = 2 + 11 - 6l - 7l + 0. List the prime factors of j(-3). 2, 13 Let z = -290 - -335. What are the prime factors of z? 3, 5 Let s(p) = -342p - 5. List the prime factors of s(-2). 7, 97 Let y(x) = x*3 - 2x*2 - 4x + 5. Let p = 5 + -2. Suppose pw + 8 = 5w. What are the prime factors of y(w)? 3, 7 Suppose 272h - 96836 = 229h. List the prime factors of h. 2, 563 Let a = 14 + -5. Suppose 383 = am - 112. List the prime factors of m. 5, 11 Suppose 10l - 5q - 815 = 9l, 3236 = 4l + 4q. List the prime factors of l. 2, 3, 5 Let t(z) = z*2 - 7z - 2. Let y be t(6). Let c = -1 + y. Let v(u) = u*2 + 7u + 2. What are the prime factors of v(c)? 2, 5 Let x(t) = -t*3 + 13t*2 - 13t + 17. Let i be x(12). Suppose -is + 410 = -0s. List the prime factors of s. 2, 41 Let d = -13 + -17. Let v = d + 2. What are the prime factors of (3 + -1)/((-4)/v)? 2, 7 Let u be (-5)/(-3) - 1/(-3). Suppose uv + 8 = -n + 22, -v + n + 1 = 0. Suppose 2o + 72 = vo. What are the prime factors of o? 2, 3 Suppose 0 = 5s - s - 16. Suppose l - 79 = -2n, 280 = -0l + 4l - 4n. Suppose -4g + b + l = -3, 4b - 96 = -sg. What are the prime factors of g? 2, 5 Let q(u) = 13u*2 + 24u + 6. What are the prime factors of q(-8)? 2, 17, 19 What are the prime factors of (2-150)/(5 - 963/189)? 2, 3, 5, 7 Suppose 4v - 87 = -5k, -2k + 5v - 75 = -6k. Let b = -8 - 1. Let u = k - b. List the prime factors of u. 2, 3 Let t(n) = 31n3 - 3n*2 + 16n - 120. What are the prime factors of t(5)? 2, 5, 47 Let u be ((-1)/(-2))/(2/4). Suppose 3c = 2l - 14, 3c - 7 + u = -3l. List the prime factors of (0 + 172/16)l. 43 Let h(u) = 19u - 51. Let t(g) = -9g + 25. Let c(i) = -4h(i) - 9t(i). Let w be c(6). Let p(z) = -z3 + 10z*2 - 3z - 11. List the prime factors of p(w). 43 Let t be 5257/49 + (-6)/21. Suppose -2p + 51 = -t. List the prime factors of p. 79 Suppose 40 = 4x + 5w, -x - 3w - 2w + 25 = 0. Let r(g) = 42g + 2. Let b be r(4). Suppose xq = -0q + b. What are the prime factors of q? 2, 17 Let g(h) = -h + 5. Let q(y) = -1. Let l(x) = -g(x) - 3q(x). Let d be l(9). Suppose 2m - 3 - d = 0. List the prime factors of m. 5 List the prime factors of (-3 - -1007)/(0 - -2). 2, 251 Suppose 61 = -2l - 119. Let t = -57 - l. List the prime factors of t. 3, 11 Let u(t) = -325t*2 + 12 + 10 + 326t*2 + 14t. List the prime factors of u(-15). 37 Suppose 11 = j + y, 7 - 16 = -j - 3y. Let z be 12/(-72) - (-62)/j. Suppose -zu + u = -172. What are the prime factors of u? 43 Let x be (-5)/(45/(-24))6/4. Suppose 0 = -xk - 257 + 913. List the prime factors of k. 2, 41 Suppose 0j = -3j + 12. Suppose -a = -l + 2l + 38, j = -2a. What are the prime factors of -683/l3? 17 Let t be 15/5 + 0 + 12. Let w = t + -19. Let d = 6 + w. List the prime factors of d. 2 Suppose 182f = 196f - 29050. List the prime factors of f. 5, 83 Let g be -243/((-36)/51). Let c = g - 40. List the prime factors of c. 2, 31 Suppose 3o - 2o = 1. Suppose 3j = 2j - 4f + 17, f = -2j - o. Let c(w) = 5w*2 - 4w - 3. List the prime factors of c(j). 2, 3 Let o = 84 - 50. Suppose 5v - 3p = 92 + o, 5p = -5v + 110. Suppose 0 = -vu + 27u - 96. What are the prime factors of u? 2 Suppose -4i + 8h - 3h + 23 = 0, -4i -	{ "pile_set_name": "DM Mathematics" }
Let w = t - 20237144. Let g = w + -14. Round g to five dps. -0.00006 Let h = 0.0795 + -0.062. What is h rounded to 3 dps? 0.018 Suppose 8d = 6d + 25200000. Round d to the nearest 1000000. 13000000 Suppose z + 125 = -4z. Let g be (-15)/z + (-794)/(-10). What is g rounded to the nearest 100? 100 Let m = 104 - 153. Let q = -42.9 - m. What is q rounded to zero decimal places? 6 Let j be 5045 + 4/((-12)/15). What is j rounded to the nearest 1000? 5000 Let m = 12 - -22. Let b = m - 34.82. Round b to one dp. -0.8 Let p = 46.1 - 41. Round p to 0 dps. 5 Let r = -43 - -81.3. Let h = r - 25. Let d = h + -3. What is d rounded to the nearest integer? 10 Let z(t) = -t2 + 7t + 11. Let k be z(8). Suppose -ki + i + 4 = 0. Suppose -3d + r - 43 = -4d, 4r = id - 110. What is d rounded to the nearest 10? 50 Let n = 52 - 129. Let s = 50 + n. Let o = s - -26.99999885. What is o rounded to 7 dps? -0.0000012 Let m(y) = -617y*3 - 6y*2 - 4y + 5. Let g be m(-5). Round g to the nearest 10000. 80000 Let g = -4842 + 4833.996. Let s = g - -8. Let h = -0.00400059 - s. What is h rounded to seven dps? -0.0000006 Let z = 51.077 - 0.077. Let v = 50.9878 - z. What is v rounded to 3 dps? -0.012 Let w = -1 + 0.625. Let m = 5.31 - 5. Let g = w + m. Round g to 2 decimal places. -0.07 Let l = 52.999999 - 53. Round l to five decimal places. 0 Suppose -5930 = -3k + 2080. What is k rounded to the nearest 100? 2700 Let z = -30 - -27.6. Let r = z - 0.1. What is r rounded to zero decimal places? -3 Let p = 53 - 184. Let b = p - -88. Let u = b + 43.000037. What is u rounded to 5 decimal places? 0.00004 Let n = -3.22161 - -3.22. Round n to 3 dps. -0.002 Suppose 5x - 1785 = 2s, -2s - x - 1534 = 221. What is s rounded to the nearest one hundred? -900 Let y = -211.98936 - -212. Let b = -0.27 + 0.28. Let u = b - y. Round u to 4 dps. -0.0006 Let x = 0.112 - 0.1. Let m = 0.01200108 - x. What is m rounded to 7 dps? 0.0000011 Let j = 8.79 + -1.09. What is j rounded to the nearest integer? 8 Suppose -3v + 4 - 16 = 0, -u - 32008 = 2v. Round u to the nearest one thousand. -32000 Let s(y) be the second derivative of -29y5/20 + y4/6 - y3/6 - 2y*2 + 3y. Let w be s(-3). What is w rounded to the nearest 1000? 1000 Suppose 2p - 2t + 14 = 0, 4p - 9 + 38 = 5t. Let k be 3/((-45)/p)-5. Let o be (-4 + 3)/(k/(-166)). What is o rounded to the nearest 10? -80 Let g = -1945965 + 4105746. Suppose 2x + 2x + z + 8639109 = 0, x = -z - g. Let r = x + 1199776. Round r to the nearest one hundred thousand. -1000000 Let b = 1 + -3. Let x be (0 - 1)/(b/246). Let g = x + -73. Round g to the nearest 10. 50 Let y = 9.694 - 0.214. Let c = 8 - y. Round c to one dp. -1.5 Suppose 7p = p. Suppose 4j + 0j + 764020 = 5a, p = j - 4a + 191016. Round j to the nearest 10000. -190000 Suppose 4r - 5l = -13090, -2l = -11r + 6r - 16354. Round r to the nearest one thousand. -3000 Let i = -165 + 103. Let d = 137171354.999939 - 137171293. Let m = i + d. Round m to five dps. -0.00006 Let b = -1643209 - -623209. What is b rounded to the nearest one hundred thousand? -1000000 Let d = 2.43 - 0.89. Let r = 0.06 + d. What is r rounded to 0 decimal places? 2 Let o = -0.068 + -1.252. Let r = 0.22 + o. Let c = -1.0999877 - r. What is c rounded to six decimal places? 0.000012 Let a = 37.2 + -5.2. Let d = a - 31.9999971. What is d rounded to six dps? 0.000003 Let t = 682.999999453 + -683. What is t rounded to seven decimal places? -0.0000005 Suppose -5d = -4q + 2474, q - 3d = -0q + 615. Let t = -51 + q. What is t rounded to the nearest one hundred? 600 Suppose -3z = -5z - 5000. What is z rounded to the nearest one hundred? -2500 Let b be (-16)/6127500/10. Round b to the nearest ten thousand. -30000 Let x = -26.1 - -4.8. Let g = x + 20. Let w = g - -1.299991. What is w rounded to 6 dps? -0.000009 Let g = 713.996 - 712. Let r = 5 + -3. Let p = g - r. What is p rounded to three dps? -0.004 Let h = 7.8 + -7.834. What is h rounded to 1 decimal place? 0 Let p = 0.0590092 - 0.059. What is p rounded to 6 decimal places? 0.000009 Let c = -1355 + 245. Let v be (898 - -2)/(9/c). Round v to the nearest ten thousand. -110000 Suppose -2a = -4j + 62253042, -27690713 = 4j - 3a - 89943758. Suppose j = 2t - 13815359. Let z = t - 20789309. What is z rounded to the nearest 1000000? -6000000 Suppose 13 - 3 = 5h. Let b(v) = 154443vh + 1 + 1 + 2 - 3v. Let t be b(-3). Round t to the nearest one hundred thousand. 1400000 Suppose 2m - 448 - 40 = p, 0 = 2p + 2m + 1006. What is p rounded to the nearest one hundred? -500 Let j = 8825425 - 8825432.0000008. Let o = -7 - j. What is o rounded to 6 decimal places? 0.000001 Let i = -1 - -1.4. Let d = 48484 + -48484.4000064. Let v = i + d. Round v to six dps. -0.000006 Let h = -8 - -7.2. Let z = h - -1.5. Let u = z - 0.70002. What is u rounded to 5 dps? -0.00002 Let s = -20.99999958 - -21. What is s rounded to 7 decimal places? 0.0000004 Let r = 3.529 - -0.331. Let y = -4.053 + r. Round y to 2 decimal places. -0.19 Let s = -30.968 - 0.032. Let w = s - -31.000105. Round w to 5 dps. 0.00011 Let f(l) = -62l - 7. Let g be f(-2). What is g rounded to the nearest ten? 120 Let l = -16 - -3. Let r = -12.84 - l. What is r rounded to one dp? 0.2 Suppose -3z = 316000 + 1784000. What is z rounded to the nearest one million? -1000000 Let p = -6 + 6.224. Let d = -1.434 + p. Let m = d + 0.33. What is m rounded to 1 dp? -0.9 Suppose 3k = -3t + 213, -k + 5t + 34 = -25. What is k rounded to the nearest 10? 70 Let r(d) = -8616d3 + 6d*2 - 8d - 9. Let x be r(7). Let s = 10455059 + x. What is s rounded to the nearest 1000000? 8000000 Let q = 16 - 15.89. Let a = -0.1098 + q. Round a to three decimal places. 0 Suppose 2f = 3z + 47, 3f + 3z = -0z + 93. What is f rounded to the nearest ten? 30 Let w = -5.3 + 3.7. What is w rounded to one decimal place? -1.6 Suppose -4s - 4o + 51384 = 0, 3o + 0o - 51384 = -4s. Let d = -3146 + s. What is d rounded to the nearest 1000? 10000 Let y be 0 + 0 + 40997 + 3. What is y rounded to the nearest ten thousand? 40000 Let f be 1/2 - 18/12 - -44001. Round f to the nearest 10000. 40000 Let c = 8.34 - 8. Let t = c - 0.425. What is t rounded to 2 dps? -0.09 Let f = 9 - 12. Let s = 3524.478949 + -3521.479. Let g = f + s. What is g rounded to five dps? -0.00005 Let n be (-3 + -1 + -58)-200. Suppose 0k + 4k - n = 0. What is k rounded to the nearest one thousand? 3000 Suppose 840 = -0q + 3q. Suppose q + 40 = 2i. What is i rounded to the nearest 100? 200 Let i = 3.7 + -3.7095. Round i to 3 decimal places. -0.01 Let w(m) = -22562m2 - 527437m*2 - 4m + 0m. Let a = 2 - -2. Let s be w(a). Round s to the nearest one million. -9000000 Let i = 674 + -114. Suppose 2x - 2804 = 4p, 2x - 3851 = -3p - 1054. Suppose 0 = 5r + 2j + 3j + x, -i = 2r + 3j. Round r to the nearest 100. -300 Let o = 5.00017 + -5. What is o rounded to 4 decimal places? 0.0002 Let s = 25888244 - 13422362. Let x = 12465882.06200029 - s. Let i = x + -0.062. What is i rounded to seven dps? 0.0000003 Suppose -3 = -2d + 1. Let v(i) = 6i + 8i - 4 - 42594i*3 - 7i*d - 6i. Let x be v(-6). What is x rounded to the nearest 1000000? 9000000 Let v = 22 + -21.932. Let w = v + 29.932. Let c = 30.0000021 - w. Round c to 6 decimal places. 0.000002 Suppose r - 4t = 6r - 1223, -r = -3t - 237. What is r rounded to the nearest 10? 240 Let k = -110.00000177 - -110. Round k to 7 decimal places. -0.0000018 Let w = 4.5 + -4.499982. Round w to five decimal places. 0.00002 Let b = 3 - 0. Suppose -bv - v = -220000. Suppose 0o - v = o. What is o rounded to the nearest ten thousand? -60000 Let v = -12.6 + -0.2. Let l = v - -12.7999943. What is l rounded to six dps? -0.000006 Let v = 10.1187 + -8.228. Let q = 1.9 - v. What is q rounded to three dps? 0.009 Suppose -20 + 1 = m - 3w, -m - 3w = -11. Let r = m - -7. Suppose 3p + rn = n - 22492, 2p = n - 15004. Round p to the nearest one thousand. -8000 Let l = -5 - -5. Suppose b = 3 - l. Suppose -3q + 866172 = bw + 61766181, 4w - 3q = -81199991. What is w rounded to the nearest 1000000? -20000000 Let d = -0.058 - -0.05756. What is d rounded to four decimal places? -0.0004 Let q = 9.6946 - 0.0346. Let y = 0.86 - q. Let z = -10 - y. Roun	{ "pile_set_name": "DM Mathematics" }
0). Let j(p) be the first derivative of 41 + xp2 + 0p. Let b(y) = -35y. Determine b(j(c)). -35c Let p(a) = -1696276a2. Let u(v) = 5v*2. Calculate u(p(k)). 14386761340880k*4 Let h(c) = -2070762c + 12830. Let o(n) = -1291n + 8. Let v(t) = -4h(t) + 6415o(t). Let w(f) = -10f. What is w(v(y))? -12830y Let l(q) be the first derivative of -q2 + 4. Let a(f) be the third derivative of -95f*4/3 + 111f*2 - 3f. Determine a(l(n)). 1520n Let n(w) be the second derivative of w6/180 - 31w*3/6 + 31w. Let s(p) be the second derivative of n(p). Let g(l) = 11l - 6. Determine s(g(t)). 242t*2 - 264t + 72 Let p(i) = 42i2. Let t(d) = -d2 - 4d - 32. Let b(l) = -5l - 40. Let n(o) = 4b(o) - 5t(o). Give n(p(w)). 8820w*4 Let g(i) = 73i*2. Let r(m) = -17m*2 - 9m - 221. Let k(d) = -8d2 - 5d - 102. Let x(u) = 13k(u) - 6r(u). Calculate x(g(o)). -10658o4 - 803o*2 Let a(b) = -260b*2. Let q(o) = 7o + 6. Let k(u) = 64u + 56. Let c(j) = -3k(j) + 28q(j). Calculate a(c(f)). -4160f*2 Let k(r) be the first derivative of -3r*2/2 + 279r - 338. Let m(l) = -3l. Calculate k(m(h)). 9h + 279 Let y(z) = 2z2 + 20z. Let r(f) = -39f + 6. Determine y(r(l)). 3042l*2 - 1716l + 192 Let p(h) = -10263132h. Let w(f) = f. Determine p(w(s)). -10263132s Let i(s) = -1773s + 3543s - 1792s. Let y(m) = 13m. What is y(i(r))? -286r Let p(a) = -2a*2 + 4a. Let g(n) be the third derivative of 7n5/30 - 433n*2 - 3n - 2. Give g(p(j)). 56j4 - 224j*3 + 224j*2 Let k(n) = -430n2. Let t(v) be the third derivative of -v4/6 - 1279v2. Determine k(t(o)). -6880o2 Let q(u) = -u2 + 23305551. Let z(g) = -g. Give z(q(j)). j*2 - 23305551 Let d(r) = 41r - 137. Let y be d(8). Let s(m) = ym + 12m*2 - 191m. Let j(w) = 2w2. Calculate j(s(v)). 288v*4 Let r(k) = -3k. Let b(t) be the second derivative of t*4/6 - 232t*2 - 8t - 69. Determine b(r(u)). 18u2 - 464 Let j(v) = -v2 + v2 + v2. Let c be 29/((-232)/(-9600)) - (-5)/1. Let x(m) = -1205 + c + 30m*2. Give j(x(u)). 900u*4 Suppose -2v - 26r - 15 = -21r, -3 = v + r. Let x(j) be the third derivative of 0j + 0 + 26j*2 + vj*3 - 1/4j*4. Let z(q) = 6q*2. Give x(z(d)). -36d2 Let y(h) be the third derivative of -h5/30 - 307h3/6 - 29h*2 - 5h. Let o(k) = 4k. Calculate o(y(t)). -8t2 - 1228 Let j(h) be the second derivative of -h3/6 + 22h - 35. Let r(a) = 634a*2 - 3a - 2. Calculate r(j(n)). 634n2 + 3n - 2 Let g(h) = -147 + 147 - 617h + 1206h - 613h. Let m(k) = 14k*2. Determine m(g(j)). 8064j*2 Let q(v) = -49v. Let p(w) be the second derivative of w*4/12 - 698w. Give q(p(r)). -49r2 Let t(b) = 237b + 34. Let v(r) = -3r. Let p(q) = t(q) + 3v(q). Let n(k) = -91k - 14. Let h(w) = 12n(w) + 5p(w). Let s(c) = 2c*2. Determine h(s(i)). 96i*2 + 2 Let r(i) = 3i. Let l = -525 + 3425. Suppose 2a + 15 = -3a, -4a = 4o - 11588. Let z(g) = -o + l - 16g. Determine r(z(q)). -48q Let u(o) = 76o - 3265. Let t be u(43). Let n(w) be the first derivative of 0w + 5/3wt + 0w*2 + 22. Let v(d) = -2d. Calculate v(n(s)). -10s2 Let b(a) = 102a*2. Let o(y) = 11y + 180. Let u(l) = 5l + 80. Let c(n) = 16o(n) - 36u(n). Determine b(c(k)). 1632k*2 Let w(v) = 5v. Let g(r) = 49732719r2. What is w(g(f))? 248663595f*2 Let m(q) = 33q*2 + 5q + 5. Let u(c) = 49c2 + 8c + 8. Let o(b) = -8m(b) + 5u(b). Let t(l) = -82l - 316l + 397l. Calculate t(o(p)). 19p*2 Let p(j) be the second derivative of -8j + 0 + 0j2 - 1/6j*3. Let z(t) = -9t - 6. Let u(i) = 26i + 17. Let w(d) = 6u(d) + 17z(d). Determine p(w(k)). -3k Let n(h) = -117436h. Let d(y) = 11y - 7. Determine d(n(u)). -1291796u - 7 Let j(k) = -379603k + 8. Let m(s) = 2s2. What is j(m(q))? -759206q*2 + 8 Let l(v) = -3v. Let t(d) = -51d + 19. Let r(u) = -18u + 6. Let x(q) = 21r(q) - 6t(q). Let a(s) = -s + 2. Let f(j) = 6a(j) - x(j). Determine l(f(k)). -198k Let x(r) = -5r - 2. Let z(h) = -6h - 3. Let y(k) = 3x(k) - 2z(k). Let v(p) be the first derivative of 0p - 15/2p*2 - 4. What is y(v(c))? 45c Let f(d) = 485 + 61879d2 - 485 - 61898d*2. Let g(c) = 448c. Give g(f(y)). -8512y2 Let f(s) = -2382s*2 + 7s. Let w(k) = 1035k. Determine w(f(a)). -2465370a*2 + 7245a Let b be -5 + 16/(112/441). Let m(c) = -129c + bc + 72c. Let a(u) = 584u*2. Calculate a(m(q)). 584q*2 Let v(p) = -297p. Let b(z) = 3z - 100. Let k(t) = -5t + 175. Let u(o) = -7b(o) - 4k(o). Determine v(u(a)). 297a Let r(q) = -q2 - 995. Let k(a) = 143331a. Give k(r(i)). -143331i2 - 142614345 Let s(b) be the first derivative of -2b*3/3 + 7894. Let x(g) = -622g + 1. Determine x(s(n)). 1244n2 + 1 Suppose 0 = -4v - 0v. Let z = 266 + -262. Let x(h) = vh + 2h - zh - h. Let l(b) = 8b. Determine x(l(c)). -24c Let t(i) be the second derivative of 135i4/4 - 333i - 3. Let y(k) = 4k. Determine y(t(n)). 1620n*2 Let t(k) = 8k. Let b(n) = 396n + 4. Let j be b(1). Let z(q) = 407 - 807 + 19q + j. What is t(z(g))? 152g Let g(b) be the first derivative of 38b*3 + 150. Let c(v) = 39v - 11v - 14v - 13v. What is c(g(q))? 114q*2 Let q be ((-60)/(-24))/((-1)/2). Let o = q - -17. Let w(f) = -19 + o + 7 + f. Let s(c) = -4c. Determine w(s(v)). -4v Let r(a) = -37a + 31. Let z(q) = 370q - 201q - 171q. What is z(r(n))? 74n - 62 Suppose 10c - 1 = 9c. Let b = 4 + c. Let x(i) = -3 + 3 - 2i - b. Let v(n) = -2n*2. Give x(v(p)). 4p*2 - 5 Let h be (-144)/108 - (-10)/3. Let y(n) = -hn + 414 - 414. Let j(i) = -34i + 1. Determine j(y(f)). 68f + 1 Let q(u) = u + 1. Let w be 1 + -6 - (-11 + 3). Let i = -1 + w. Let j(l) = -12li - 5l*2 + 22l*2 - 7l*2. Give j(q(h)). -2h*2 - 4h - 2 Let f = -788 + 848. Let z(o) = -36 - 3o - f + 96. Let u(l) = -l2 - 1. Let s(n) = -20n*2 + 1. Let m(p) = -s(p) - u(p). What is z(m(x))? -63x*2 Let l(p) = -26p + 3 + 73p + 34p - 4 - 5. Let t(j) = -3j. Give t(l(x)). -243x + 18 Let j(y) = -53y + 12. Let l(o) = 52o - 10. Let b(d) = 5j(d) + 6l(d). Let f(q) = 2q2. Let c(s) = -s2. Let n(m) = 9c(m) + 4f(m). Give b(n(r)). -47r*2 Suppose -38v = -35v + 30. Let r be (4/5)/(v/(-25)). Let q(n) = -10n*2 + 4n*2 + 2n*r. Let a(c) = -2c*2. Give q(a(x)). -16x*4 Let f(z) = -374z - 374z + 749z. Let u(w) = 243w. Give u(f(r)). 243r Let k(j) = -43j. Let v(p) = -7p - 553585. Determine v(k(r)). 301r - 553585 Let w(i) = -2i*2 + 62. Let t(k) be the third derivative of 17k*4/24 - 882k*2. Give t(w(c)). -34c*2 + 1054 Let x(r) = -1856r. Let t(s) = 17s - 12s - 4s + 6s. What is t(x(d))? -12992d Suppose 4q + 4t - 33 = 163, -2t + 142 = 3q. Let u(b) = 99b + 44 - q. Let n(x) = x. Give n(u(s)). 99s Let q(y) be the second derivative of y3 + 80y. Let i(p) = 426 - 213 + 3p - 213. Determine q(i(n)). 18n Let u(i) = 2i2 - 60. Suppose d - 108 = -z, 3d + 110 = -z + 444. Let a(g) = -113g + 227g - dg. What is a(u(o))? 2o2 - 60 Let p(d) = -d2. Suppose -392 = -108n - 97n + 18. Let x(k) be the second derivative of -33k + 0k*n + 0 - 5/6k*3. Determine p(x(v)). -25v*2 Let f(l) = 2l. Let b(x) = 56x2 - 3x - 9. Let d be b(-3). Let n(z) = -254z2 - 98 + dz*2 - 248z*2. What is n(f(t))? 8t*2 - 98 Let r be (-21409)/(-1897) - (-4)/(-14). Let q(g) be the second derivative of 7/6g*3 + 0 + 0g*2 - rg. Let a(j) = 4j2. Give q(a(x)). 28x*2 Let h(d) = d - 38. Let z(j) = 4j - 136. Let c(u) = -5h(u) + z(u). Let b(n) = 10n*2. What is b(c(r))? 10r*2 - 1080r + 29160 Let k(f) be the second derivative of f*3/3 + 157f. Let d(b) = 36b2 + 10 + 8 - 16. Determine d(k(n)). 144n*2 + 2 Let z(f) = -17f. Let s(y) = 421y. Let t(o) = -10572o. Let k(n) = -153s(n) - 6t(n). What is z(k(q))? 16677q Let x(q) be the first derivative of 24q*2 + 1057. Let p(v) = 7v. Calculate p(x(s)). 336s Let w(x) = 55x - 9x - 13x - 17x - 12x. Let m(i) = -26i2 + 15. Calculate m(w(g)). -416g*2 + 15 Let d(j) = 2484379j. Let b(m) = -6m + 26. What is b(d(c))? -14906274c + 26 Let d(l) be the third derivative of 0l3 + 0 - 170l*2 + 0l + 0l4 - 11/60l*5. Let f(m) = -3m. What is f(d(s))? 33s2 Let n be ((-52)/(-20))/((-2)/(-10)). Let i(o) = 29o**	{ "pile_set_name": "DM Mathematics" }
s + 7s + 6s. Let c(p) = -p + 1602. Determine n(c(b)). -b + 1602 Let d(q) be the second derivative of 2q3/3 - 5q*2 + 121q. Let i(o) = -o + 3. Let v(t) = 6d(t) + 20i(t). Let m(h) = -4h2. Calculate v(m(n)). -16n*2 Let t(f) = -9f - 38. Let r = 43 + -49. Let n be t(r). Let s(a) = na2 - 5a*2 - 4a*2 - 5a*2. Let m(v) = v - 37. Give m(s(z)). 2z*2 - 37 Let a(o) = -3o*2. Let f(b) = -156b - 98b + 112b + 114b - 286b. Calculate a(f(n)). -295788n2 Let c(x) = 7 + 3944x*2 - 7912x*2 + 3986x*2. Let u(r) = 12r. Give c(u(g)). 2592g2 + 7 Let k(r) = 653346r + 8. Let a(c) = 9c. What is a(k(s))? 5880114s + 72 Let l(v) = 4v. Let r(h) be the first derivative of 190h*3/3 - 390. Give r(l(t)). 3040t*2 Let t(s) = -95s*2 + 1. Let f(k) = 19k*2 + 4. Let y(z) = 77z*2 + 16. Let w(g) = -4f(g) + y(g). Give t(w(j)). -95j4 + 1 Let i(n) = -n2. Let b(t) = 59t - 4812345. Determine b(i(p)). -59p2 - 4812345 Let o(r) = r2 + 855r - 8297. Let k(q) = -3q. What is k(o(t))? -3t*2 - 2565t + 24891 Let d(u) = 18 - 73u + 160u + 124u - 18. Let y(b) = -b. Calculate d(y(m)). -211m Let g(y) = 29y2. Let s(h) = 2165471h*2. What is s(g(l))? 1821161111l*4 Let c(t) = 1767t. Let y(n) = 8157n2. Determine y(c(a)). 25468511373a*2 Let w(t) = -90t*2. Suppose 11j - 4i + 2 = 10j, -2i + 8 = 3j. Let h(m) = -2m + 28m*2 + jm + 33m2 - 60m*2. Determine w(h(b)). -90b*4 Let r(f) = -16988817f. Let a(h) = -2h2. Calculate a(r(d)). -577239806118978d*2 Let v(y) = -28y + 42. Let t(n) = 2977n + 2. What is t(v(q))? -83356q + 125036 Let t(u) = -2u2 + 20u. Let v(l) = -7191l. Give t(v(f)). -103420962f*2 - 143820f Suppose 31 + 131 = 18u. Let g(q) = -13q + 9. Let w(z) = 6z - 4. Let f(s) = uw(s) + 4g(s). Let a(k) = -8k - 1. Calculate a(f(h)). -16h - 1 Let t = 386 - 329. Let j(k) = 325 + tk - 325. Let q(r) = -2r2. Calculate q(j(z)). -6498z*2 Let v(a) = 3 - 6 + 3 + 855358a*2 - 855280a*2. Let t(q) = 21q - 3. Calculate t(v(g)). 1638g2 - 3 Let v(q) = 15q. Let o(h) = -40h2 - 34428h. Give o(v(y)). -9000y2 - 516420y Let p(d) = 2d2 + 21. Let g(f) be the third derivative of 19f*4/8 + 6757f*2. Calculate p(g(o)). 6498o*2 + 21 Let a(m) = 2m - 1. Let n(z) = -7 - 4 - 3z + 7 + 6. Let k(f) = 2a(f) + n(f). Let s(c) = 8c. Determine k(s(y)). 8y Let k(s) = 11s - 60. Let c(a) = 175a - 945. Let y(z) = -4c(z) + 63k(z). Let g(n) = 91n2. Determine g(y(p)). 4459p*2 Let y(x) = 754x*2. Let z(j) = -14761j*2. Calculate y(z(v)). 164286889234v*4 Suppose -10g = 7g - 34. Let j(u) = -2u - 5u2 - u2 + gu. Let s(m) = 4m2. Determine j(s(l)). -96l*4 Let o(v) = -61998v. Let k(n) = -2n2 - 122. Determine o(k(y)). 123996y*2 + 7563756 Let k(c) = -56c*2 + 25c*2 + 4 + 25c*2 - 4. Let a(o) = 243o. What is k(a(w))? -354294w2 Let s(h) = -31466110h + 31466110h - 6h*2. Let z(l) be the first derivative of 0l + 1 - 7/2l2. Give z(s(t)). 42t*2 Let s(l) = 20l*2. Let u(y) be the first derivative of 6043 - 2y*3 - 6099 + 3y*3. Determine s(u(j)). 180j4 Let j(z) = z2. Suppose 0 = -36l - 1282 + 1822. Let n(f) be the first derivative of 0f + 0f2 - 10/3f*3 + l. Give j(n(t)). 100t*4 Let o(n) = -14n*2. Let z(u) = 219069u - 31. Determine z(o(r)). -3066966r2 - 31 Let w(d) = -54d. Let z(o) be the third derivative of o*7/840 - 23o*4/12 - 180o*2. Let b(h) be the second derivative of z(h). Give b(w(y)). 8748y*2 Let m(a) = -173676898a. Let z(u) = u. Calculate m(z(v)). -173676898v Let c(r) = 4r + 11. Let x(u) = 34u + 37u - 94u. Give c(x(d)). -92d + 11 Let w(k) = -302k + 666. Let c(o) = -33o + 72. Let g(i) = 37c(i) - 4w(i). Let u(p) = 3 - 3 + 6p. Calculate u(g(s)). -78s Let x(a) = 8982a2. Let l(z) = -2z - 445. What is l(x(r))? -17964r2 - 445 Let a(l) = l + 1. Let r(h) = -h + h - 189h*2 + 92h*2 + 100h*2. What is r(a(m))? 3m*2 + 6m + 3 Let g(n) = -15n. Let b(l) = 3l + 1. Let d(y) = -2y - 4. Let p(c) = -4b(c) - d(c). Determine p(g(j)). 150j Let t(b) = b2. Let s be (-9 + 9 - 4) + 4. Let c(d) be the third derivative of s + 11d*2 + 0d*3 + 5/24d*4 + 0d. Calculate t(c(y)). 25y2 Let f be ((-8)/(-20))/(4/(-20)) - -35. Let j be f/(-2)(-4 + 40/12). Let g(m) = jm - 12m - 5 + 5. Let t(z) = 10z2. Give g(t(q)). -10q2 Let o(m) be the third derivative of m4/3 + 2m2 + 1338m. Let d(k) = 20k2. Calculate d(o(q)). 1280q*2 Let n(a) = -3a - 2182. Let o(f) = -20173f2. Give n(o(h)). 60519h*2 - 2182 Let f(m) = 2m*2. Suppose 4v - 552 = 60. Let g(j) = 36j + vj + 145j. Give g(f(n)). 668n*2 Let h(f) = 10f*2. Let d(w) = -17w*2 + 21w. Let y(o) = 14o2 - 18o. Let m(x) = -5d(x) - 6y(x). Give h(m(l)). 10l4 + 60l*3 + 90l*2 Let w(z) = 3942 + 2z*2 - 3942. Let j(o) = 3075o*2. Calculate j(w(u)). 12300u*4 Let f(y) = -20y + 20. Let l(p) = 9p - 8. Let r(s) = -2f(s) - 5l(s). Let t(o) = 8o + 5o - 10o. Give t(r(v)). -15v Suppose -4j = -m + 24 - 80, 52 = 4j - 2m. Let n(v) = 15v - jv - 32v. Let c(u) = -5u - 6. Let r(f) = -f - 1. Let h(i) = c(i) - 6r(i). What is h(n(p))? -32p Let a(p) = -p. Let t(w) = 60393408 - 60393408 + 2836w. Determine t(a(f)). -2836f Let x(g) = -4923g. Let j(m) = 34268m. What is x(j(u))? -168701364u Let h(i) = -1204i - 292i2 + 2 + 603i + 601i. Let k(c) = 2c*2. What is k(h(t))? 170528t*4 - 2336t*2 + 8 Let q(n) = -6n - 3389. Let l(d) = 8d + 3388. Let f(r) = 4l(r) + 5q(r). Let u(j) = -j. Give u(f(a)). -2a + 3393 Let d(g) = -6g2 + 2. Let m(o) = 63956327 - 63956327 - 3o*2. Give m(d(t)). -108t*4 + 72t*2 - 12 Let r(s) be the third derivative of -13s*4/12 - 2s*2. Let l(f) be the third derivative of -1/30f5 + f2 + 0 + 0f3 + 0f*4 - 6f. Calculate r(l(p)). 52p2 Let l(g) be the third derivative of -g5/60 + 9g*2. Let o(m) = -18m*2. Let k be (2/2)/(6/90). Let n(p) = kl(p) - o(p). Let c(h) = h*2. What is n(c(z))? 3z4 Let x(o) = o2 - 3o2 - 6o*2 + 0o*2. Let k(a) be the third derivative of 0 + 4a*2 + 0a - 1/8a4 + 0a*3. What is x(k(v))? -72v*2 Let g(c) = -7c. Let s(x) be the third derivative of -7x5/60 - 19x*3/6 - 19x*2 + 1. Let z(r) be the first derivative of s(r). Give z(g(t)). 98t Let j(m) = 745219m2. Let x(f) = -7f*2. Calculate j(x(b)). 36515731b*4 Let t(x) = 14x - 7. Let z(k) = 17k + 1. Let i(v) = 14v. Let y(a) = -4i(a) + 3z(a). Let s(f) = -3t(f) - 8y(f). Let c(r) = 2r. Determine s(c(o)). -4o - 3 Let v(w) = -w. Let n(r) be the second derivative of 44r - 85/3r*4 + 1 + 0r*2 + 0r*3. Give v(n(u)). 340u*2 Let r(p) = -14026p. Let k(z) = -2163z2. Give r(k(l)). 30338238l*2 Let x(i) = 2i - 26. Let b = 18 + -16. Let s(l) be the first derivative of 2l + 265l*2 + 29 - bl - 266l2. Determine s(x(j)). -4j + 52 Let x(s) = -5s2 - 6s. Let g(w) = 8w2 + 9w. Let i(p) = -2g(p) - 3x(p). Let u(h) = 29h2. Calculate u(i(n)). 29n*4 Let y(u) = -5u + 75. Suppose 0 = 4d - 16, 13d - 14d = -2p - 2. Let o(a) = a - 3. Let i(h) = py(h) + 4o(h). Let w(l) = -4l. Give i(w(k)). 4k + 63 Let z(r) = r*2. Let q(j) = -5248j*2 + 1176j + 1. Calculate q(z(c)). -5248c4 + 1176c*2 + 1 Let n(l) = 183l. Let r(j) = 747899j. Determine n(r(c)). 136865517c Let z(o) = 36o. Let i(y) be the second derivative of 7y*3 + 352y. Give i(z(d)). 1512d Let h(x) = -4x. Let m(g) = -12g + 7. Let n(y) = 5y - 3. Let z(i) = -2i - 57. Let o be z(-27). Let r(u) = om(u) - 7n(u). Give r(h(l)). -4l Let n = -90 + 42. Let k(u) = 56u2 + 48u - 48. Let w(m) = -m*2 - m + 1. Let a(j) = nw(j) - k(j). Let o(r) = 5r - 3r + 0r. Calculate a(o(f)). -32f*2 Let o(l) = 26l - 57l + 16l + 22l + 57. Let g(i) = i. Give o(g(c)). 7c + 57 Let i(s) = -7057 + s + 7057 - s + s2. Let a(t) be the third derivative of t4/6 - t*3/6 + 3t*2. What is i(a(u))? 16u*2 - 8u + 1 Let o(t) be the first derivative of -3t2 - 896. Let r(n) = -159n. What is o(r(m))? 954m Let i(k) be the first derivative of -k5/8 - 4k*3/3 - 12k + 70. Let v(m) be the third derivative of i(m). Let n(l) = -6l2. Give v(n(j)). 90j*2 Let w(u) = -2u2 + 449. Let h(a) be the second derivative of a4/6 + 23	{ "pile_set_name": "DM Mathematics" }
1) Let n = -11/3965 + 63561/43615. Factor 0 + 2/11i2 - ni. 2i(i - 8)/11 Let c(t) be the second derivative of t*4/3 - 16t*3 + 280t*2 + 119t - 3. Factor c(y). 4(y - 14)(y - 10) Factor -245/2q + 1830 - 5/2q*2. -5(q - 12)(q + 61)/2 Let a(u) be the third derivative of 1/66u*4 + 1/33u*3 + 0u + 1/330u5 - 46u*2 + 0. Suppose a(t) = 0. What is t? -1 Suppose -20t - 252 = -11t. Let c be (-2 - (-22)/3) + (t - -23). Factor cz*3 + 0 + 1/3z*2 - 2/3z. z(z - 1)(z + 2)/3 Let t = -1/2031572 - -4063151/14221004. Factor 0 + tr3 - 6/7r*2 - 20/7r. 2r(r - 5)(r + 2)/7 Solve -35/3x - 1/6x3 + 71/6x*2 + 0 = 0. 0, 1, 70 Suppose 3678 = -4c - 2z, 2z + 1105 = -3c - 1653. Let b be 6/21 - c/210. Factor 10/3u*2 - 4/3 - 8/3u*3 + bu. -2(u - 2)(u + 1)(4u - 1)/3 Let v = 55 + 16. Factor 67g3 - vg*3 - 223 + 59g*2 - 320g + 17g2 - 177. -4(g - 10)*2(g + 1) Let n be (-45)/40 - (-2412)/2144. Factor n + 1/7s2 - 2/7s. s(s - 2)/7 Let q(d) = -d4 - 93d*3 - 580d*2 - 1002d - 517. Let h(c) = -5c4 - 187c*3 - 1158c*2 - 2002c - 1033. Let z(b) = -6h(b) + 14q(b). Solve z(l) = 0. -2, -1, 65/4 Let s(d) = -526d3 - 6d*2 - 3d + 2. Let z be s(-1). Factor 135f + 56f*3 - 109f*3 - 9f*2 + z + 50f*3. -3(f - 7)(f + 5)2 Let z(x) be the second derivative of 0x*2 + 70x + 0x3 + 0x*5 + 0 + 1/20x*6 + 0x*4. Factor z(r). 3r*4/2 Let -9 - 856f + 729f2 - 23 + 1734f + 2586f + 139f*2 = 0. Calculate f. -4, 2/217 Suppose -943j = 96j - 2078. Factor -162n*j + 3n*3 - 657/4n - 165/4. 3(n - 55)(2n + 1)2/4 Let z be (24 - (-30400)/(-1254))-9. Solve zi2 + 2/11i*5 + 0 + 38/11i*3 + 0i + 16/11i4 = 0. -4, -3, -1, 0 Let a(j) = -j2 - 3j*2 + 24j - 128 - j*2 + 5j. Suppose -2b + 6b + 12 = 0. Let v(k) = k*2 + k. Let d(w) = bv(w) - a(w). Suppose d(y) = 0. What is y? 8 Factor 96z + 234/5z*2 + 9z*3 + 3/5z*4 + 288/5. 3(z + 1)(z + 4)2(z + 6)/5 Let w = -253 - -244. Let k be (1305/260)/w-8. Factor -ky + 14/13 + 8/13y2. 2(y - 7)(4y - 1)/13 Let l(b) be the third derivative of b*8/1680 + 13b*7/1050 + 41b*6/600 + 47b*5/300 + 3b*4/20 - 283b*2. Solve l(j) = 0 for j. -9, -2, -1, 0 Solve 7260f + 513f4 - 2845f*3 - 4180f*2 - 287f*4 - 5f*5 - 456f4 = 0 for f. -22, -3, 0, 1 Let l(o) = -o2 + 2o. Suppose -14x + 9x = -5. Let m(i) = -6i + 5. Let r(u) = xl(u) + m(u). Solve r(f) = 0 for f. -5, 1 Suppose 5i = 4b + 15, 3i - 6i + 3b = -9. Determine s, given that -3s2 + 0si - s3 - 28 + s + 21 + 10 = 0. -3, -1, 1 Let n = -2419199/120 + 20160. Let b(j) be the second derivative of 1/80j5 + 13j + nj6 + 0 + 0j*2 - 1/24j*3 - 1/48j*4. Factor b(x). x(x - 1)(x + 1)2/4 Let l(v) be the first derivative of -3v*4/4 + 1818v*3 - 1652562v*2 + 667635048v - 1774. Determine o, given that l(o) = 0. 606 Let n(l) be the first derivative of -l7/4200 - l6/360 + 4l3/3 - 189. Let r(d) be the third derivative of n(d). Factor r(a). -a2(a + 5)/5 Suppose 291z - 3w = 296z - 36, 4z - 4w = -16. Let -8/3t*2 - 8/3t*z + 2/3t*5 + 2/3t*4 + 0t + 0 = 0. What is t? -2, -1, 0, 2 Let o(u) = 12u2 - 4u - 10. Let q(m) = m*2 + m - 1. Let l = 25 + -77. Let a = -50 - l. Let s(r) = ao(r) - 44q(r). Solve s(g) = 0 for g. -3, 2/5 Suppose 5/2a*3 + 65a - 40 - 55/2a2 = 0. What is a? 1, 2, 8 Let h = 8828/15 + -8732/15. Factor 28/5t - 4/5t2 + h. -4(t - 8)(t + 1)/5 Suppose -20/7q*3 + 0 - 184/7q*2 - 36/7q = 0. What is q? -9, -1/5, 0 Let o be (73/146)/((-6)/(-9))64/78. Let -2/13w*5 - 6/13w*3 + 0w*2 + 0w + ow4 + 0 = 0. What is w? 0, 1, 3 Let g(k) be the third derivative of -k5/60 - 213k*4/8 - 2188k*2. Find x, given that g(x) = 0. -639, 0 Suppose -3i + 2f = -31, -1665 + 1621 = 4f. Determine m, given that 3/4 + 3/4m4 + 15/4m + 15/4m5 - 15/2m*i - 3/2m*2 = 0. -1, -1/5, 1 Let h(i) = 5i*3 + 26i*2 - 33i + 14. Let k(c) = 7c3 + 26c*2 - 32c + 14. Let a(t) = 5h(t) - 4k(t). Solve a(r) = 0 for r. 2/3, 1, 7 Find j, given that 46353j3 + 5j*5 + 53980j*2 - 196000j - 995j4 + 2627j*3 + 10253 - 210253 = 0. -2, -1, 2, 100 Let u(x) be the first derivative of 2x*5/25 + 89x*4/20 - 182x*3/3 - 477x*2/10 + 476. Determine f, given that u(f) = 0. -53, -1/2, 0, 9 Suppose -u + y = -2u - 1, 2y + 6 = 0. Let 23t*2 - 8t*3 - 35t*2 - 4t*4 + 24tu = 0. What is t? -3, 0, 1 Let l(o) be the second derivative of o5/10 - 8o4/3 - 55o*3/3 - 38o*2 + 683o. Solve l(v) = 0. -2, -1, 19 Factor -87 - 263/2j - 45j*2 - 1/2j*3. -(j + 1)(j + 2)(j + 87)/2 Let v(r) = r3 + 200r*2 + 847r - 1068. Let p(j) = -2j3 - 391j*2 - 1692j + 2135. Let b(h) = 4p(h) + 10v(h). Factor b(t). 2(t - 1)(t + 5)(t + 214) Let v = 53/5359 - 369150045/69667. Let q = -5296 - v. What is p in -2p*2 - 2/13p*4 + 14/13p*3 + q - 6/13p = 0? -1, 2, 3 Suppose 2h + 16b - 11b = 30, -3h = 4b - 38. Let c be 5 + -15 - -1h. Factor -1/3p - 1/3p*2 + c. -p(p + 1)/3 Let f(y) = -5y3 - y2. Let q be f(-1). Suppose 0 = qi - 5v - 96, -4v = 2i - 5i + 71. Factor 24z2 + 6z - iz2 + 3z + z. -5z(z - 2) Let c(r) be the third derivative of r*5/300 - 11r*4/40 - 74r*3/15 + 423r2. Let c(w) = 0. Calculate w. -4, 37 Let x(u) be the third derivative of u7/840 + u*6/90 + 119u*3/6 - 55u*2 - 3u. Let l(j) be the first derivative of x(j). Factor l(t). t*2(t + 4) Let f(v) be the first derivative of 34v5/5 - 86v*4 + 890v*3/3 - 50v*2 - 1070. Factor f(i). 2i(i - 5)2(17i - 2) Let j(q) be the third derivative of -4075/84q*4 + 6883/42q*5 + 3872/735q*7 + 109q*2 - 19681/420q*6 + 0 + 125/21q*3 - 32/147q*8 + 2q. Factor j(w). -2(w - 5)3(16w - 1)2/7 Suppose 3f + 15 = -5p, -f - 593 = 2p - 588. Let h(c) be the first derivative of pc + 3/16c*2 - 1/2c*3 - 3 + 3/8c*4. Factor h(k). 3k(2k - 1)*2/8 Suppose -3n - 2o + 12 + 12 = 0, 4n + 3o = 34. Let p be 1(-5 - 1)/(-2). Factor 1/2q2 + n - pq. (q - 4)(q - 2)/2 Let c(y) = -4y + 8. Let b be c(3). Let o = b - -6. Factor 8v2 + 3v*3 - ov*3 - 10v2. v2(v - 2) Let 75x*2 + 170x + 26x2 - 18x2 - x3 = 0. What is x? -2, 0, 85 Let x(g) be the first derivative of -g*6/1080 - 7g*5/360 + 25g*3/3 - 60. Let a(r) be the third derivative of x(r). Factor a(m). -m(m + 7)/3 Let z(q) be the first derivative of 4q2 - 18/7q + 129 - 2/7q3. Let z(y) = 0. What is y? 1/3, 9 Factor -5/4r*3 - 935/4r*2 - 43245/4 - 44175/4r. -5(r + 1)(r + 93)2/4 Let u(l) be the second derivative of -l7/945 + l*6/36 - 7l*5/135 - 73l*2/2 - 39l. Let h(f) be the first derivative of u(f). Let h(b) = 0. What is b? 0, 1, 14 Let o(h) be the second derivative of 2h7/63 + 8h*6/45 - 2h*5/5 - 4h*4 - 6h*3 - 827h. Determine z so that o(z) = 0. -3, -1, 0, 3 Let c = -4/6655 - -267/1331. Let j(f) be the third derivative of 0f - 1/40f*4 + 0 + cf*3 - 1/100f*5 + 13f*2. Solve j(s) = 0 for s. -2, 1 Let a(m) be the third derivative of 20/3m*3 - 95/6m*4 + 33/2m*5 + 55m*2 + 0m - 27/8m6 + 0. Solve a(o) = 0 for o. 2/9, 2 Suppose -5k + 4 = -x - 13, x + 1 = k. Find v such that 4v4 + 3v*5 + 75v - 2v3 + 24v*3 + 120v*2 - 28v*4 - kv3 = 0. -1, 0, 5 Let s(y) be the first derivative of -y6/6 + 8y5/15 + 7y*4/3 + 2y*3/3 - 25y*2/6 - 14y/3 + 4957. Solve s(h) = 0 for h. -1, 1, 14/3 Let d be (25956/(-135))/14 + 14. Let v(j) be the third derivative of 0j + 0 + 1/150j*5 - 2j*2 + 1/20j*4 - dj*3. Solve v(q) = 0. -4, 1 Factor -22q*3 + 11q*3 + 34q*2 - 209q + 10q3 + 58q + 174. -(q - 29)(q - 3)(q - 2) Let p be ((-16)/(-52))/(10/65). Let j be (5/(-10))/(6/(-8)). Factor -jsp + 32/3s - 128/3. -2(s - 8)2/3 Find c such that 237/2c*5 + 94/3c + 417/2c2 + 2665/6c*3 + 2/3 + 2309/6c*4 = 0. -1, -2/9, -2/79 Let n(w) = 14w + 6. Let j be n(11). Suppose 5v - j = -4o, -100 = -4v + 2o + 28. Factor 14k2 + k5 + 28 - 7k*2 - v - 3k4 - k3. (k - 2)*2(k - 1)(k + 1)2 Let s be 16494/832 + 210/(-28). Find r, given that 250/9r - 4 - 8/9r*5 - 526/9r*s - 118/9r*4 + 146/3r**3 = 0. -18, 1/4, 1 Let f be ((-75)/(-42))/((-72)/(-126)) - (-23)/(-184)	{ "pile_set_name": "DM Mathematics" }
/7a4 + 0a + 2/7a5 + 0 + ka*3. 2a*2(a + 1)*3/7 Let y = 103222/3 + -34406. Solve y - 1/3j*2 - j = 0. -4, 1 Factor 2/13d*2 - 222/13d - 2420/13. 2(d - 121)(d + 10)/13 Let d(t) = 610t + 7320. Let m be d(-12). Factor 3/5c*4 + 48/5c*2 - 24/5c*3 + mc + 0. 3c2(c - 4)*2/5 Let g(v) be the second derivative of 13 + 3v*2 - 3/2v*3 + 1/4v*4 - 2v. What is f in g(f) = 0? 1, 2 Let g(r) be the first derivative of -25r4/22 - 16r3/11 + r2/11 - 4. Solve g(b) = 0 for b. -1, 0, 1/25 Suppose 139 - 119 = 5g. Factor 196i*5 + 26i3 + i4 + 18i2 - 27i - 195i5 - 27 + 8i*g. (i - 1)(i + 1)(i + 3)3 Suppose -5t = 75s - 71s - 74, -4s + 64 = 0. Factor 2/5v*t + 18/5 - 4v. 2(v - 9)(v - 1)/5 Let o(v) be the third derivative of -v*6/540 - 46v*5/135 + 31v*4/36 + 123v*2 + 3v. Find g, given that o(g) = 0. -93, 0, 1 Let j = 5875538/5 - 1175090. Factor -ja + 64/5 + 4/5a*3 + 4a*2. 4(a - 2)(a - 1)(a + 8)/5 Let s(b) = -b*2 - 7b + 4. Suppose -90 = 11q - 13. Let m be s(q). Factor 11t - 13t3 - 3t - m + 11t3 - 2t. -2(t - 1)2(t + 2) Let m(k) = -4k4 + 8k*3 + 24k*2 - 6k - 12. Let x(s) = -17s4 + 32s*3 + 102s*2 - 23s - 49. Let u(l) = 9m(l) - 2x(l). What is n in u(n) = 0? -1, 1, 5 Let i = 1273/140240 + 6/1753. Let t(z) be the second derivative of -3/80z5 + 0z*3 + iz*6 + 0 - 3/32z*4 + 3z + 0z2. Factor t(x). 3x*2(x - 3)(x + 1)/8 Let j(a) be the second derivative of -a6/15 - 81a*5/10 - 184a*4 - 1024a*3/3 + 7199a. Factor j(o). -2o(o + 1)(o + 16)(o + 64) Let d(r) = -2r4 - r3 + r2 + r + 1. Let m(l) = -39l*4 - 96l*3 - 414l*2 - 624l - 267. Let q(u) = 18d(u) - m(u). Factor q(b). 3(b + 1)*2(b + 5)(b + 19) Let x(p) = -p4 - 247p*3 + 6p + 2. Let m(h) = 9h4 + 1977h*3 - 51h - 17. Let k(g) = -6m(g) - 51x(g). Solve k(i) = 0. 0, 245 Factor -6h2 + 10515/2h - 1314. -3(h - 876)(4h - 1)/2 Let s be (62 - 40500/525) + (-1 - -18). Let j = 6798/7 - 969. Factor -p + 4/7p*4 - sp*3 + jp2 + 1/7. (p - 1)3(4p - 1)/7 Let p(v) be the second derivative of v*4/78 + 94v*3/39 + 1941v. Factor p(x). 2x(x + 94)/13 Let n = -3649 + 3652. Let j(t) be the first derivative of 0t - 6t2 - 21 - t3 + 3/5t5 + nt*4. Let j(s) = 0. What is s? -4, -1, 0, 1 Let o be ((-242)/220-221)/(6 - 5). Let k(j) be the first derivative of 34 + 1/15j*3 - 11/5j*2 + oj. Factor k(d). (d - 11)*2/5 Let t be (-178)/1513 - (-29)/102. Let h(n) be the second derivative of 0 - tn*4 + 0n*2 + 11n - n*3. Factor h(y). -2y(y + 3) Suppose 2x - 13 - 35 = 4u, -5x + 105 = -5u. Let g be 8/6(-5)/((-20)/x). Factor 7m + gm - 18m + 2m*3 + 3m. 2m(m - 1)(m + 1) Determine j so that -634 - 607 - 3j*2 + 282j + 1241 = 0. 0, 94 Let u be 2(13 - 12) - (3 + (-51)/6). Let -ub - 25b2 - 35/2b*3 + 0 = 0. Calculate b. -1, -3/7, 0 Let x(i) = 5i*2 - 460i - 1554. Let a(g) = -4g2 + 449g + 1555. Let d(u) = -6a(u) - 5x(u). Let d(r) = 0. Calculate r. -390, -4 Let o be (-6)/2 + 102/(-1). Let b be (1 + 6/(-9))o/(-10). Factor -br + r*2 + 1/2r3 + 2. (r - 1)2(r + 4)/2 Let v(b) = b2 + 15b - 98. Let x be v(-20). Factor -7a3 - 1 + 25 - 92a + 2a4 + 94a*x - 30a*3 + 3a*4. (a - 3)(a - 2)*2(5a - 2) Let m(i) be the third derivative of 0i - 1/525i7 + 0i*3 - 116i*2 - 1/100i*6 + 0 + 2/75i*5 + 0i*4. Factor m(p). -2p*2(p - 1)(p + 4)/5 Let w(c) = c + 1. Let f(j) = -j3 - 2j*2 - 4j - 3. Let b = 216 - 219. Let d(y) = bw(y) - f(y). Factor d(l). l(l + 1)*2 Factor -36 - 16a*3 - 13a*3 + 12a + 20a2 + 29a*3 + 4a*3. 4(a - 1)(a + 3)2 Determine l so that -39967500/7l*2 - 14600/7l*3 - 48627125000/7l - 22186125781250/7 - 2/7l4 = 0. -1825 Factor 5476038/11f*3 - 169362/11f*2 + 1746/11f - 6/11. 6(97f - 1)*3/11 Let c = 23755/2 + -11876. Find w, given that cw + 1/2w3 - 3/2w*2 - 1/2 = 0. 1 Let g = 18887 - 18884. Factor 3/5y*g - 12/5y*2 - 42/5 - 57/5y. 3(y - 7)(y + 1)(y + 2)/5 Factor -9b*3 - 6b*4 - 9b*4 + 6b*2 - 7b*4 + 25b*4. 3b*2(b - 2)(b - 1) Let j(u) = -8u*2 - 120u + 1723. Let f(h) = 12h2 + 180h - 2585. Let y(p) = 5f(p) + 7j(p). Factor y(i). 4(i - 9)(i + 24) Let w = 39 + -28. Let u be 1/(-3)(8 - w). Solve 26m*3 - 3m + u - 25m3 - 2m*2 - 1 = 0. -1, 0, 3 Let v be 44/(-14) + 6/42 - 756/(-196). Determine k, given that 9/7k + 3/7k5 + 0 + vk*4 - 12/7k*3 - 6/7k2 = 0. -3, -1, 0, 1 Let d(o) be the second derivative of -o4/9 + 44o3/3 + 5o - 143. Factor d(r). -4r(r - 66)/3 Let g(x) = -x*2 + 3x + 4. Let a be g(4). Let r = -6837 - -6840. Solve -2/15v2 + a - 2/15v*r + 2/15v*4 + 2/15v = 0. -1, 0, 1 Let u(l) be the first derivative of -109l4/9 - 428l*3/27 + 1312l*2/9 - 16l/3 - 742. Find d, given that u(d) = 0. -3, 2/109, 2 Let a(g) = g + 63. Let w be a(8). Factor 187o2 - 40o - 8o3 + 23o*3 - wo*2 - 66o*2 - 60o*2. 5o(o - 2)(3o + 4) Let n(y) be the first derivative of 0y - 64 - 4/5y5 - 4/3y*3 + 0y*2 + 2y*4. Solve n(l) = 0 for l. 0, 1 Let z = 346 - 344. Factor 4v*3 - 3v*z - 4v*3 - 13v*2 + 4v*4. 4v*2(v - 2)(v + 2) Suppose 10c - 35 + 5 = 0. Factor 33i - 5813i*3 - 18 + 3i*5 + 10i*4 + 5777i*c + 2i*4 + 6i*2. 3(i - 1)*3(i + 1)(i + 6) Suppose -4d + 5y = 25, -3d + 20 = -0d + 4y. Let h(o) = -o*3 + 48o*2 + 31o + 885. Let f be h(49). Factor 4u2 + 0 + du + 1/2uf. u2(u + 8)/2 Let q(t) be the second derivative of -2 + 0t2 + t3 - 82t - 1/18t4. Find y such that q(y) = 0. 0, 9 Let o be (0 - 1)/(-9)0/25477/43816. Factor -3/4u*2 + o + 63/4u. -3u(u - 21)/4 Let z(x) be the third derivative of -x*5/150 + 1951x*4/60 - 130x*3 + 7x*2 + 466x. Solve z(c) = 0. 1, 1950 Determine c, given that 0c3 - 54/7c - 33/7c2 + 3/7c*4 - 24/7 = 0. -2, -1, 4 Find o, given that 0 + 46o + 1/2o3 - 24o*2 = 0. 0, 2, 46 Suppose 4p - 85l + 12 = -87l, p - 13l - 132 = 0. Solve 4/7u*p - 16/7 - 12/7u = 0. -1, 4 Let f(a) be the second derivative of a*4/78 + 16a*3/13 + 92a*2/13 - 5551a. Factor f(w). 2(w + 2)(w + 46)/13 Let a(d) = d*3 + 9d*2 - 99d - 222. Let v be a(-2). Let -4/3f5 + 35/3f*3 + 50/3 + 8/3f*2 - 85/3f - 4/3fv = 0. What is f? -5/2, 1, 2 Let s = 647 + -452. Let l = 1381/7 - s. Factor -2/7j*2 - 32/7 - lj. -2(j + 4)2/7 Factor -772/7g + 16/7 - 194/7g2. -2(g + 4)(97g - 2)/7 Let 25/4h3 + 13/2h*2 - 1/4h*4 + 0 + 0h = 0. What is h? -1, 0, 26 Suppose 28 = -6i + 208. Let p be (-8)/2(-3 - (-86)/i). Find x such that px2 - 2/5x - 2/15x3 + 0 = 0. 0, 1, 3 Let l = 56343/43 + -507001/387. Determine v, given that -lv*2 - 2/9 + 4/9v = 0. 1 Find j, given that 1/2j2 + 89401/2 - 299j = 0. 299 Let l(d) be the first derivative of 32d + 4/5d*5 + 7d*4 + 24d*3 + 40d*2 + 131. Find u such that l(u) = 0. -2, -1 Let j(d) be the third derivative of 5d*8/336 - 11d*7/42 - 15d*6/8 + 35d*5/12 + 65d*4/3 - 70d*3 + 236d*2 + 1. What is g in j(g) = 0? -3, -2, 1, 14 Suppose 0 = b - 202 + 197. Let j be ((-8)/(-32))/(b/80). Suppose 9/7q*2 + 3/7q*3 - 3/7q*j - 3/7q - 6/7 = 0. Calculate q. -1, 1, 2 Let y be (-2 + (-176)/(-33))57/2. Find w, given that 11 + 6w - 31 + y - 15 + w*2 + 26w = 0. -30, -2 Let k = -160333 + 801853/5. Factor -196/5 - 4/5g3 + 388/5g - kg2. -4(g - 1)*2(g + 49)/5 Suppose 0 = -35d + 42d - 28. Suppose 15m2 - 19m*2 - 96m*d + 100m4 = 0. What is m? -1, 0, 1 Let i(v) be the third derivative of -v6/30 + 73v5/5 - 145v*4/2 + 434v*3/3 - 1028v2. Find q, given that i(q) = 0. 1, 217 Let s(o) be the third derivative of o5/60 - 23o4/12 + 15o*3/2 + 11o*2 - 62o. Factor s(y). (y - 45)(y - 1) Let h(z) be the first derivative of -86 + 2/27z*3 + 8/9z + 5/9z2. Factor h(x). 2(x + 1)(x + 4)/9 Let o be 0 - 11/(11/(-2)). Suppose 16 = 5z - 2k, 3z - 5k - o = -0. Suppose -15u3 + u5 + 7u3 + 4u*4 + 5u*3 - 2u*z = 0. What is u? -3, 0, 1 Let a(q) = -3q + 249. Let u be a(12). Let b = u - 423/2. Determine p, given that bp - 3/4p*2 - 3/4 = 0. 1 Let r = -95349 - -381671/4. Let -5 - 25g + rg4 - 75/4g*2 + 175/4g*3 + 105/4g**5 = 0. Calculate g	{ "pile_set_name": "DM Mathematics" }
2 + v2 - 2) + 1 - 1 + v2)(-9 - 27 - 7) as f + iv + av2 and give a. -172 Rearrange 9o - 4o + 11o to ro + x and give r. 16 Express g4 - g4 + 4g4 + (3 - g2 - 3)(0g - g*2 + 0g) + (-2 + 4 - 3)(-2g*4 + 2g*4 - 2g*4) as wg + d + bg4 + hg*2 + ag*3 and give b. 7 Rearrange 8r*3 + 8r*3 - 21r*3 + 10r*3 + 4r - 2 to v + pr3 + zr*2 + ir and give p. 5 Express -10i2 + 9 - 9 as ki*2 + z + ni and give k. -10 Express 20 - 51 + 27 - u + (2u - 6u + 2u)(5 - 4 - 2) as qu + t and give t. -4 Rearrange (0t*2 + 0t*2 + 2t*2)(2 - 1 + 1) + (-28t + 117 - 117)(-3t - 3t + 3t) to p + st*2 + ut and give u. 0 Rearrange (-2 - 7 + 75)(b + 2b - 6b) to d + jb and give j. -198 Rearrange -6j2 - 7j3 + 1 + j3 + 4j2 + 5j*3 to the form d + fj + kj3 + bj*2 and give b. -2 Rearrange 10q + 8q - 6q + 0q2 + 2q*2 to xq + c + yq2 and give y. 2 Express 2 + 18x - 18x - 5 - 5x*2 as tx + i + mx2 and give m. -5 Express 4a*2 + 15a*2 + 4 - 21a*2 as g + na + ua2 and give g. 4 Express 2z2 + 796 - z4 + 5z3 + 3z*4 - 795 + z in the form lz*3 + cz*2 + r + pz*4 + vz and give c. 2 Express (0x - 2x - 4x)(-x*2 - 2x*2 - 3x*2) - 2x3 + x3 + 3x3 as sx + wx3 + qx*2 + r and give w. 38 Rearrange 12f*4 + 0f - 14f4 - 4f*2 - 2f to the form z + cf4 + sf*3 + rf*2 + kf and give c. -2 Express (8l2 - 4l*3 - 4l*2 - 5l*2)(1 - 1 + 2l) as hl + c + gl2 + ul*3 + ql*4 and give u. -2 Express (110b + 7 + 19 - 26)(12 - 2b*2 - 12) as xb*3 + tb + z + lb2 and give x. -220 Express 7d3 - d2 + 27 - 27 as w + zd2 + ad*3 + ld and give a. 7 Rearrange -4a + 3a - a to the form f + ha and give h. -2 Rearrange -16i + 16i + 3i*2 - 19i to the form ui + yi*2 + g and give y. 3 Express -8m*2 + 13m*2 - 3m2 + m - m + m2 + (0m + 0m - m)(5m - 4m - 2m) + 2m2 - m2 - 2m*2 in the form cm + lm2 + y and give l. 3 Express -g2 - g2 + 3g*2 + (4g - 8g - 4g)(4 - 2 - 1)(0g - g + 2g) as lg + x + wg*2 and give w. -7 Rearrange (-3p*2 + 2p*2 + 2p*2)(-6p - 9 + 9) + 4p3 - p3 + 2p - 3p to the form x + ip2 + wp*3 + ap and give x. 0 Rearrange -6 - 4w2 + 6 - 6 to the form vw*2 + sw + b and give v. -4 Express 9b + 4b + 15b + 5b in the form ib + k and give i. 33 Express 0q - 22 + 0q - q + 7q*2 + 20 as dq + u + hq2 and give u. -2 Express -25c - c*2 + 7c + 0c2 in the form gc + v + hc2 and give v. 0 Rearrange -191i - 14i3 + 0i*2 + 193i - 4i2 to a + pi + hi3 + ti2 and give h. -14 Express (2 - 2 + t2)(-5t + 3t + 6t*2 - 5t*2) as m + ct + it2 + rt*3 + ht*4 and give c. 0 Express 0 + 1 + 8n - 3 + 18n4 - 15n*4 as wn*3 + p + cn*4 + dn + mn2 and give p. -2 Rearrange -259n + 1 + 259n + 15n*3 to bn*2 + xn + m + qn3 and give q. 15 Rearrange 2 - 135b*4 - 136b4 + b2 + 272b4 + 7b to xb2 + g + mb + rb4 + pb*3 and give m. 7 Rearrange -4t - t + 2t to the form p + qt and give q. -3 Express (o - o + o)(14 + 8 + 3) in the form io + g and give i. 25 Rearrange 0 + 8 - 2 - 7 - 49t3 to the form v + pt + nt2 + ht*3 and give v. -1 Rearrange 2u*3 + 106 - 106 - 26u + 2u2 to cu*2 + ku + p + iu3 and give i. 2 Rearrange (2y + y - y)(-32 - 29 + 64 + y2) to fy + ky3 + d + ny*2 and give f. 6 Express -10k + 6k + 28k as ck + v and give c. 24 Rearrange 7 + 2f*2 - 10 - 8f*2 to the form p + af*2 + tf and give p. -3 Rearrange i*4 - 2i*3 - 177i + 177i + 1 - i2 to oi + m + ui4 + pi*2 + yi*3 and give y. -2 Express 3h + 0h + 4h - 4h in the form q + wh and give w. 3 Rearrange (-6f2 - 2f*3 + 6f*2)(5f + 4f + 5f) - 3f*3 + 2f*4 + 3f*3 to kf*4 + uf*2 + p + gf*3 + rf and give k. -26 Express 278 - 141 - 139 + 10b3 as pb*3 + ub + n + vb2 and give n. -2 Express ((-4c + 2c + c)(3 + 3 - 5) + 1 - 2c - 1)(1 + 2 - 4 + (3 - 3 + 1)(-1 - 1 + 4) + 2 - 5 + 5 + 1 - 1 - 2) as d + lc and give l. -3 Rearrange 2y2 + 2 - 95y + 80y - 2 - y3 to oy*2 + q + hy + by3 and give o. 2 Express (-3 + 2 + 0 - 2d + 8d2)(0d + 4d - 3d)(7d - 2d - d) as ld + c + xd*3 + jd*4 + id*2 and give i. -4 Express (0 - 1 + 3)(0h - 1 + 2h - 1) + (h - h - h)(-2 + 6 - 1) in the form b + fh and give b. -4 Express (8n2 - 2 - n2 - n2)(2 + 2 + 1) in the form z + hn + on*2 and give o. 30 Express (-3f*2 - 15f*4 + 3f*2)(-4 - 1 + 4) in the form df2 + lf*4 + uf + of3 + p and give p. 0 Rearrange 13b*2 - 2b*3 + 3b - 15b2 + b + 2b*4 - 1 + 4b*3 to ub*3 + xb + m + sb4 + hb2 and give u. 2 Express -g2 - 9g - 25 + 16 + 9 in the form ug + n + lg2 and give u. -9 Express 7 - 2 - 5 - 41o in the form ko + j and give k. -41 Rearrange -2s + 261s2 - 4s*3 + 1 - 523s*2 + 264s*2 + 2s*4 to the form ts*4 + ns*2 + q + bs + is3 and give t. 2 Express 1 + 24q*2 + 21q*2 - 18q*2 as zq + dq2 + t and give d. 27 Rearrange (4 - 1 - 1)(x - x - 2x) + 4x + 0x + 4x + 3x - 3x - 2x + 0x + x + 0x to the form bx + d and give b. 3 Express 264h3 + 0h*2 + 13h*2 + 3h*2 - 262h*3 in the form nh*2 + fh + r + wh3 and give n. 16 Rearrange 1309 - 1309 - 43k to the form a + fk and give f. -43 Rearrange -29q*2 + 3q*3 + 62q*2 - 33q*2 - 9 to the form xq*3 + jq + rq2 + u and give u. -9 Express 10 - 4h2 + h3 + 6h + 3h*2 - 3h - 8 in the form zh + sh*3 + ih*2 + n and give i. -1 Rearrange (15 - 6c + 2c + 2c)(3c*3 - 2c*3 - 2c3) - c4 + c4 + c4 to the form sc + mc*3 + h + wc*4 + gc*2 and give w. 3 Express (b + 3b - 6b)(-5 + 5 - 2)(b - 2b + 3b) in the form o + vb + hb2 and give h. 8 Rearrange (0 - 3c + 0)(0 + 0 + 2c*2)(6c - 110 + 110) to the form f + dc*2 + kc*3 + sc*4 + pc and give s. -36 Rearrange (-2 - 8k + 2)(-2 + 9 + 2) to the form vk + w and give v. -72 Rearrange 2s*4 + 4s + 0s4 + s3 - 3s + s3 - s2 to ns2 + ds*3 + is*4 + v + xs and give n. -1 Rearrange -2y4 - y3 + 6y + 6y4 + 3y - 6y + 1 to ly + wy3 + r + uy*2 + ay*4 and give l. 3 Rearrange (0 + 622d - 642d - 2)(-d*2 - 2d*2 + 5d*2) to ld*2 + sd*3 + hd + x and give s. -40 Rearrange 24q - 90q - 30q + (-3q + 2q - q)(4 - 4 + 1) + 0q - 2q + 0q to the form bq + z and give b. -100 Express -15 - 60d + 37d + 22d as xd + i and give i. -15 Express l*2 - 38l*2 + 6l*2 as d + cl*2 + bl and give c. -31 Rearrange -1 - 2y4 - 3y*4 + 4y*4 - 5y to dy3 + sy*4 + ty*2 + z + qy and give q. -5 Express 41f2 + 46f*2 - 59f*2 as mf*2 + gf + p and give m. 28 Rearrange -2v3 - 6v*3 + 4v*3 - 3v*2 + (-1 + 2v + 1)(0v*2 + 2v2 - v2) to qv + hv*2 + jv*3 + c and give j. -2 Express (2v - 2 + 2)(3 + 2 - 4)(-5v + v + v + v - 2v - v + v - 4 + 4 + (-3v + 2v + 3v)(4 + 0 - 3)) in the form g + yv2 + lv and give y. -4 Express 4x - 3x + 6x + (-2x + 3x - 2x)(0 + 5 + 0) as k + hx and give k. 0 Rearrange -18 + 72 - 28 + 0h - h to the form n + uh and give u. -1 Express 0r3 + 5r*3 + 3r*3 + (0r*2 - 5r2 + r2)(2r - 3r + 0r) in the form jr + kr*2 + h + sr*3 and give s. 12 Rearrange -5m - 4m3 + 4m + 5m3 to the form xm + y + im3 + um*2 and give x. -1 Express (-3j + 7j - 3j)(1 - 1 - j) - j2 - j2 - j2 + 2j*2 - 3j + j - j*2 as x + sj*2 + aj and give s. -3 Express -2l2 - 6 - 1229l + 1229l as vl + w + ul2 and give w. -6 Rearrange 17 + 102g*2 + 13 - 30 to the form d + ag*2 + ug and give a. 102 Express (0n2 + 2n2 - n2)(-3n + 1 - 10n + 5n) in the form kn + an*2 + pn3 + c and give p. -8 Express y2 - 2y + 3y*2 - 3y + y in the form l + xy2 + ry and give r. -4 Express (4 - 4 - x*2)(2 - 1 - 4)(-4x*2 - 12x + 12x) in the form ax + dx4 + v + yx*2 + gx*3 and give g. 0 Rearrange (26n - 265 + 265)(0n*3 + 3n*3 - 4n*3) + (2n3 + n3 - n*3)(-n - n + n) to the form yn3 + in*2 + un + fn4 + q and give f. -28 Rearrange -113n + 113n + 1 - 11n*2 to c + xn*2 + dn and	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.