Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
ters picked without replacement from swssswwwwssww. Give prob of sequence ww. 7/26 Two letters picked without replacement from {r: 1, y: 7, t: 2, b: 4}. Give prob of sequence br. 2/91 Four letters picked without replacement from soaooods. What is prob of sequence ossd? 1/210 Three letters picked without replacement from dqdomdmomqdrdmydor. Give prob of sequence omy. 1/408 Four letters picked without replacement from {m: 4, x: 15}. Give prob of sequence mmmm. 1/3876 Four letters picked without replacement from nnnnynyynynnnn. Give prob of sequence nnny. 120/1001 Two letters picked without replacement from {i: 2, l: 1, s: 2}. Give prob of sequence si. 1/5 What is prob of sequence qssq when four letters picked without replacement from {w: 1, s: 1, t: 1, q: 1, p: 1}? 0 Calculate prob of sequence qe when two letters picked without replacement from {q: 5, u: 1, e: 5, l: 1}. 25/132 Two letters picked without replacement from epegg. What is prob of sequence gg? 1/10 Two letters picked without replacement from fkdfdfkf. Give prob of sequence fk. 1/7 What is prob of sequence otti when four letters picked without replacement from {t: 9, y: 2, o: 3, i: 4}? 1/85 What is prob of sequence tttt when four letters picked without replacement from {t: 6}? 1 Four letters picked without replacement from {l: 4, a: 1, e: 3}. Give prob of sequence eeel. 1/70 What is prob of sequence rfiv when four letters picked without replacement from {f: 2, r: 4, v: 6, d: 1, k: 2, i: 4}? 2/969 Calculate prob of sequence dqq when three letters picked without replacement from {q: 7, d: 5, w: 8}. 7/228 Two letters picked without replacement from nvsn. Give prob of sequence sn. 1/6 Two letters picked without replacement from vvzwvzx. What is prob of sequence zw? 1/21 What is prob of sequence yg when two letters picked without replacement from yagad? 1/20 Two letters picked without replacement from {s: 1, m: 2, j: 1, h: 2, a: 1, q: 1}. Give prob of sequence sq. 1/56 What is prob of sequence mnoa when four letters picked without replacement from anaommc? 1/210 What is prob of sequence hizz when four letters picked without replacement from {z: 9, h: 4, i: 3}? 9/455 Two letters picked without replacement from fffiifi. Give prob of sequence if. 2/7 Three letters picked without replacement from {l: 8, o: 1, q: 1, c: 2, w: 2}. What is prob of sequence wwo? 1/1092 What is prob of sequence tzg when three letters picked without replacement from {z: 4, t: 4, g: 2, p: 2}? 4/165 Four letters picked without replacement from araaraeaeaaaa. What is prob of sequence reer? 1/4290 What is prob of sequence tlcm when four letters picked without replacement from {l: 2, c: 1, t: 9, m: 1}? 3/2860 Calculate prob of sequence ocv when three letters picked without replacement from {c: 11, o: 7, v: 2}. 77/3420 Calculate prob of sequence qq when two letters picked without replacement from {r: 1, k: 1, q: 2}. 1/6 Calculate prob of sequence kkv when three letters picked without replacement from khhkvokhhkh. 2/165 What is prob of sequence wbbq when four letters picked without replacement from {w: 4, b: 2, f: 6, q: 2, s: 3}? 1/3570 Two letters picked without replacement from {t: 2, h: 2, i: 1, x: 1}. What is prob of sequence ti? 1/15 Two letters picked without replacement from {j: 2, n: 1}. What is prob of sequence nj? 1/3 What is prob of sequence coo when three letters picked without replacement from {o: 5, c: 3}? 5/28 Two letters picked without replacement from xxoxoxddxxdd. Give prob of sequence do. 2/33 What is prob of sequence ry when two letters picked without replacement from {r: 11, y: 5}? 11/48 Two letters picked without replacement from {q: 1, f: 2, d: 2, w: 1, v: 1}. Give prob of sequence wq. 1/42 What is prob of sequence aoao when four letters picked without replacement from ommaoaaa? 1/70 Four letters picked without replacement from qqqq. Give prob of sequence qqqq. 1 Two letters picked without replacement from pjmmnkmnm. Give prob of sequence np. 1/36 Calculate prob of sequence pp when two letters picked without replacement from {p: 3, d: 1}. 1/2 Two letters picked without replacement from vjx. Give prob of sequence jx. 1/6 Calculate prob of sequence hgh when three letters picked without replacement from {h: 2, g: 5, r: 4, m: 2}. 5/858 Two letters picked without replacement from lhlllllhhlllyjlyh. What is prob of sequence yy? 1/136 Four letters picked without replacement from yxywxwyxywy. Give prob of sequence wxxx. 1/440 Two letters picked without replacement from kbbbbbbkbb. What is prob of sequence bk? 8/45 Two letters picked without replacement from {u: 4, d: 1, x: 1, h: 6, f: 1}. Give prob of sequence xf. 1/156 Two letters picked without replacement from kqqqkqq. Give prob of sequence kk. 1/21 Calculate prob of sequence oo when two letters picked without replacement from olleo. 1/10 Three letters picked without replacement from xxxxrxrx. Give prob of sequence xxr. 5/28 Four letters picked without replacement from qssrbbjbb. What is prob of sequence qjbs? 1/378 What is prob of sequence ekq when three letters picked without replacement from {o: 1, k: 1, q: 1, r: 2, m: 1, e: 2}? 1/168 Four letters picked without replacement from tjjfjjjfjojfftjjjffo. Give prob of sequence fjtf. 5/969 Three letters picked without replacement from {d: 2, g: 4, f: 1, q: 4, o: 3, z: 3}. Give prob of sequence gdg. 1/170 Calculate prob of sequence sm when two letters picked without replacement from pcqspmpssppmsmspmqm. 25/342 Four letters picked without replacement from {i: 1, g: 4, x: 2, z: 1, w: 2}. Give prob of sequence xxzw. 1/1260 Three letters picked without replacement from dzzdzzzzz. What is prob of sequence dzd? 1/36 Two letters picked without replacement from {h: 1, z: 1, y: 4, e: 1, o: 4}. Give prob of sequence ze. 1/110 Two letters picked without replacement from {p: 8, j: 7, e: 3}. What is prob of sequence ee? 1/51 Three letters picked without replacement from oooopppjojpppp. Give prob of sequence joj. 5/1092 What is prob of sequence gg when two letters picked without replacement from {j: 7, g: 12}? 22/57 What is prob of sequence vlx when three letters picked without replacement from {v: 2, x: 5, l: 13}? 13/684 Three letters picked without replacement from {o: 1, m: 1, r: 8, g: 7, v: 2, k: 1}. Give prob of sequence grm. 7/855 Calculate prob of sequence yp when two letters picked without replacement from spsppsssguyxssus. 1/80 Three letters picked without replacement from rrrrrrr. What is prob of sequence rrr? 1 Three letters picked without replacement from bgagaabaggaag. What is prob of sequence bgg? 10/429 Three letters picked without replacement from {f: 1, c: 3, j: 1, q: 2}. Give prob of sequence qfq. 1/105 Three letters picked without replacement from nnn. Give prob of sequence nnn. 1 What is prob of sequence kfff when four letters picked without replacement from {k: 4, f: 14}? 91/765 What is prob of sequence ow when two letters picked without replacement from {l: 2, o: 5, w: 3, s: 3}? 5/52 Calculate prob of sequence bk when two letters picked without replacement from kbbdl. 1/10 Two letters picked without replacement from {b: 7, m: 6}. Give prob of sequence mm. 5/26 Calculate prob of sequence hhcc when four letters picked without replacement from {h: 11, c: 5}. 55/1092 Two letters picked without replacement from nnmndnfm. What is prob of sequence md? 1/28 What is prob of sequence rr when two letters picked without replacement from krrkkrrrrrrrrrr? 22/35 Calculate prob of sequence xiii when four letters picked without replacement from yxozxiixiyzxiioiyozi. 7/969 Three letters picked without replacement from {z: 5, j: 5, b: 8}. Give prob of sequence jbb. 35/612 Four letters picked without replacement from {j: 2, f: 1, a: 3, x: 1, o: 3}. Give prob of sequence jxja. 1/840 Three letters picked without replacement from crrjccrcjcuju. Give prob of sequence ujj. 1/143 Calculate prob of sequence sk when two letters picked without replacement from {k: 1, i: 1, j: 1, h: 11, s: 1}. 1/210 Calculate prob of sequence wb when two letters picked without replacement from {w: 3, b: 2}. 3/10 Two letters picked without replacement from qkpcykucucupp. Give prob of sequence yc. 1/52 What is prob of sequence kq when two letter	{ "pile_set_name": "DM Mathematics" }
2u. Suppose -2 + 0q*2 + 0q*2 - q + uq2 - q2 = 0. Calculate q. -1, 2 Let a(x) be the third derivative of -x5/150 + x4/20 + 4x3/15 - x2 - 3x. Solve a(t) = 0. -1, 4 Let y be 1((-7)/6 - 15/(-10)). Factor 0 + ym*3 + 0m + 0m2 - 1/3m4. -m3(m - 1)/3 Suppose 0 = 5n - i - 25, 3n - 4i - 15 = -3i. Let f(x) be the third derivative of 0x + 0 + 1/270xn + 2/27x*3 - 1/36x*4 - 4x*2. Factor f(d). 2(d - 2)(d - 1)/9 Let x(t) = t2 + 139t + 4469. Let y(o) = -o + 4. Let i(d) = -x(d) - 5y(d). Determine f, given that i(f) = 0. -67 Let u be 6/69 + 136/23 + -6. Factor 2/3s*3 + 2/3s + 4/3s2 + u. 2s(s + 1)2/3 Let q = 22 - 9. Let n = 8 + q. Factor -ni*4 + 3i - 18i2 + 8i*4 + 9i*5 - 17i*4 + 36i*3. 3i(i - 1)3(3i - 1) What is b in 8b*4 - 110b*5 - 114b*5 + 184b*2 + 32b*3 - 14b - 12 + 106b3 - 280b*4 = 0? -1, -1/4, 2/7, 3/4 Suppose -2q*4 + 20983q*3 + 20q*2 + 32q - 20947q3 - 86q*2 = 0. Calculate q. 0, 1, 16 Factor -2/5t*2 - 72/5 + 6t. -2(t - 12)(t - 3)/5 Let g(u) be the first derivative of -u*5/3 - 25u*4/12 - 10u*3/3 + 10u*2/3 - 28u + 31. Let h(i) be the first derivative of g(i). Let h(d) = 0. What is d? -2, 1/4 Let u = -920 + 11041/12. Let c(d) be the third derivative of ud4 + 1/60d*5 + 0 + 0d - 1/2d3 + 2d*2. Factor c(v). (v - 1)(v + 3) Let x(y) be the first derivative of 5 + 0y2 - 1/9y*3 + 0y. Factor x(h). -h2/3 Let w(v) be the third derivative of -v6/120 - v*5/12 - 7v4/24 - v3/2 - 3v2 + v. Factor w(s). -(s + 1)2(s + 3) Let m(j) be the third derivative of j*6/40 + 3j*5/20 - 9j*4/8 + 5j*3/2 - 28j*2. Factor m(y). 3(y - 1)*2(y + 5) Let -264/5u - 3/5u2 - 5808/5 = 0. Calculate u. -44 Let m(x) = -x2 + 33x + 70. Let n be m(35). Let p(i) be the third derivative of 0 + ni - 1/195i5 + 1/780i*6 + 0i*3 - 7i*2 + 1/156i*4. Factor p(g). 2g(g - 1)2/13 Let p(g) = -g2 - 3g + 4. Let n be p(-3). Find l such that 34ln - 37l*4 + 6l + 2l2 + 7l*2 = 0. -1, 0, 2 Suppose 5s*3 + 30s + 15 + 16s + 25s*2 - 11s = 0. Calculate s. -3, -1 Suppose 4489o - 4344o = 0. Factor 10/7g + 2/7g*2 + o. 2g(g + 5)/7 Suppose 103m*4 - 120m + 95m4 - 8 + 105m*3 - 164m*2 - 3m*3 - 8 = 0. What is m? -2/3, -2/11, 1 Let m be (0/(-9))/(9 - 6). Factor 4/19 + 6/19i + mi2 - 2/19i*3. -2(i - 2)(i + 1)2/19 Suppose -w3 - 65w + 147w2 - 6w*3 - 180 - 103w - 2w3 = 0. Calculate w. -2/3, 2, 15 Determine t so that 28/19t*2 - 34/19t*3 + 320/19t - 6/19t4 + 192/19 = 0. -4, -2/3, 3 Let l(j) = -j2 - 10j + 11. Let q be l(-11). Factor qp3 - 4p*3 + 3p*3 + 4p*5 + 4p - 7p3. 4p(p - 1)2(p + 1)2 Let i(q) be the second derivative of -q5/160 - 3q4/16 - 11q3/16 - q2 - 4q + 31. Factor i(y). -(y + 1)2(y + 16)/8 Let z(h) be the third derivative of -1/3h4 + 19h*2 + 2/15h*5 + 0 + 0h - 1/60h6 + 0h*3. Factor z(q). -2q(q - 2)2 Let j(h) = 6h*3 - 12h*2 + h. Let w(m) = -2m3 - m3 + 17m2 - 11m*2. Let b = 3 - 0. Let n(l) = bj(l) + 5w(l). Suppose n(r) = 0. Calculate r. 0, 1 Let u = -41 + 42. Let j(f) = -f2 - f - 1. Let w(s) = 6s*2 + 3s. Let p(x) = uw(x) + 3j(x). Factor p(r). 3(r - 1)(r + 1) Let d(k) be the first derivative of -k*4/22 - 8k*3/33 - 71. Factor d(h). -2h*2(h + 4)/11 Let f(z) be the second derivative of -z*6/30 - 3z5/20 + z4/3 + 17z. Suppose f(q) = 0. Calculate q. -4, 0, 1 Let t = -2259 + 11307/5. Factor 2/5q - 8/5q4 + 0 - 8/5q*2 + tq*3 + 2/5q*5. 2q(q - 1)4/5 Let a be (4 - 3)-1 + 3. Suppose 3t + t + t2 + 3t*a = 0. What is t? -1, 0 Let r = -520 - -520. Let v(p) be the first derivative of rp - 4/3p3 + 1 + 6p*2. Factor v(h). -4h(h - 3) Let b(m) be the first derivative of -9m*5/10 + 7m*4 - 19m*3/2 + 5m*2/2 - 93. Factor b(t). -t(t - 5)(t - 1)(9t - 2)/2 Let o(x) be the first derivative of -x6/6 - 4x*5/5 + 16x*3/3 + 8x*2 + 112. Factor o(w). -w(w - 2)(w + 2)3 Let h(x) be the first derivative of x6/3 - 12x*5/5 + 7x*4 - 32x*3/3 + 9x*2 - 4x - 107. Find k, given that h(k) = 0. 1, 2 Let a be 3/4 + (-27)/4-3. Factor 33d - 68 + a - 12d2 + 29. -3(d - 2)(4d - 3) Let u = -246 + 244. Let d be ((-8)/(-10))/(0 - 1/u). Let 0 - 42/5p4 + dp - 48/5p2 + 74/5p*3 + 8/5p*5 = 0. What is p? 0, 1/4, 1, 2 Let j = -3220/3 + 1084. Let f = -23 + 25. Suppose -jl*f - 2/3 + 16/3l = 0. Calculate l. 1/4 Let f(x) be the second derivative of -x7/126 - x6/6 + 17x5/60 + 5x*4/12 - 8x*3/9 - 361x. Solve f(z) = 0 for z. -16, -1, 0, 1 Suppose 5v - 6 = 2v. Determine z so that z*5 + 16z*2 + 13z - 16 - z*4 - 8z*3 + 3z - 10z2 + 2z*v = 0. -2, 1, 2 Let i = -1 - -16. Let u be (i/6 - 1) + 8/(-48). Factor -5/3j*3 + uj*4 + 0j + 1/3j2 + 0. j2(j - 1)(4j - 1)/3 Let j(s) be the first derivative of 2s3/21 - 20s*2/7 + 200s/7 - 115. Suppose j(m) = 0. What is m? 10 Let k(f) be the third derivative of -f*8/448 - 3f*7/280 + 3f6/80 + f5/8 - 21f4/32 + 9f*3/8 - 271f*2. Factor k(m). -3(m - 1)*3(m + 3)2/4 Let t(d) = d3 + 15d2 - d - 10. Let o = 31 - 46. Let s be t(o). Determine q so that 2 + qs - 2q*2 - 3q*3 + 9q - q*3 - 6q + 0q2 = 0. -1, 1, 2 Let n(a) be the first derivative of 0a + 15/2a2 + 19 - a3. Factor n(o). -3o(o - 5) Let h(r) = -r + 12. Let u be h(-12). Factor ud*3 + 2d*2 - 9d*3 + 3d*2 + 5d*4 + 5d*2. 5d*2(d + 1)(d + 2) Let x(s) be the second derivative of 2s*6/135 - 2s*5/45 + 95s. Factor x(l). 4l3(l - 2)/9 Let b(k) be the second derivative of k*4/9 - 2k*3/9 + 32k. Factor b(h). 4h(h - 1)/3 Factor 1216/5n2 - 1792/5n - 80n3 + 64/5n*4 - 4/5n*5 + 1024/5. -4(n - 4)*3(n - 2)2/5 Let q(g) be the first derivative of g4/11 - 2g3/3 + 13g*2/11 - 8g/11 + 1. Find i such that q(i) = 0. 1/2, 1, 4 Let 2/5u2 + 22/5u - 84/5 = 0. Calculate u. -14, 3 Let k be (6 + (6/39 - 6))/(-1)-2. Find f, given that 6/13f + 2/13f5 + 0f*4 + 4/13f*2 - 8/13f*3 - k = 0. -2, -1, 1 Determine h, given that 14/9h*5 + 8/3h*2 + 0 - 16/9h + 92/9h3 + 22/3h*4 = 0. -2, -1, 0, 2/7 Let d be (-16)/(-6) + 14/(-21). Determine x so that -4 - 3x*2 + 2x + dx2 + 3x = 0. 1, 4 Suppose -253 - 33 = -22q. Suppose -qz = -3 - 36. Find l, given that 0l - 10/9l*4 - 8/9l*2 + 16/9l*z + 0 + 2/9l5 = 0. 0, 1, 2 Let k(b) = b3 - b*2 + 2b. Let c(m) = 6m3 + 4m*2 - 16m. Let q(x) = c(x) - 4k(x). Factor q(w). 2w(w - 2)(w + 6) Find g such that -4/3 - 44g - 65/3g2 = 0. -2, -2/65 Let u(b) = -b2 - 1. Let t(w) = -w - 11. Let i be t(-9). Let m(j) = 3j2 + 2j + 3. Let h(z) = iu(z) - m(z). Factor h(l). -(l + 1)2 Let r(b) = b + 12. Let f be r(-9). Solve -7n*5 + 4n3 - nf + 8n5 - 4n*4 = 0. 0, 1, 3 Factor -23w*3 + 9w*3 + 10w*3 + 12w*2. -4w*2(w - 3) Suppose 0 = 3v - 3t + 176 + 64, 3v = -2t - 225. Let f = 315/4 + v. Factor 3c3 + fc*4 - 1/2c + 3/4c2 + 0. c(c + 1)*2(7c - 2)/4 Factor 0d - 4/7d2 + 2/7d*4 + 0 - 2/7d*3. 2d*2(d - 2)(d + 1)/7 Let h be 21(-288)/(-28)3/6. Let v be (h/15 + -5)2. Factor -8/5k3 - vk*2 - 24/5k - 1/5k4 - 9/5. -(k + 1)2(k + 3)2/5 Let a = -187 + 189. Let d be (1 + 2 - -2) + -2. Determine k, given that ka - 35 + k*d + 35 = 0. -1, 0 Let f(n) = -n + 3. Let l be f(3). Suppose -5x + 3x + 6 = l. Factor 3k*4 - 5k + k*4 + 4kx + k3 - 1 - 3k2. (k - 1)(k + 1)*2(4k + 1) Let r(u) be the first derivative of -u7/3780 + 7u6/1620 - u5/36 + u*4/12 - 3u*3 + 8. Let i(t) be the third derivative of r(t). Factor i(j). -2(j - 3)*2(j - 1)/9 Let z(l) be the first derivative of -3l5/20 - 3l4/4 - l3 - 212. Factor z(n). -3n2(n + 2)*2/4 Let p(c) be the first derivative of 2c*5 - 3c*4 - 16c*3/3 - 153. Factor p(j). 2j*2(j - 2)(5j + 4) Factor 2/7m3 + 32/7m*2 + 40/7m + 0 - 2/7m4. -2m(m - 5)(m + 2)2/7 Let k(r) be the third derivative of -r5/270 - 7r4/108 + 2r*2 - 52. Factor k(d). -2d(d + 7)/9 Let f(t) be the second derivative of -t7/105 - 7t*6/75 - 13t5/50 - t4/30 + 14t3/15 + 8t*2/5 - 74t. Let f(b) = 0. What is b? -4, -2, -1, 1 Let j(s)	{ "pile_set_name": "DM Mathematics" }
15, what is 5 + -129? -124 In base 9, what is -45 + -161? -216 In base 6, what is -51 - -5? -42 In base 15, what is -13 - -3d? 2a In base 12, what is 5 - 47? -42 In base 11, what is 4 + -132? -129 In base 16, what is -126 + -5? -12b In base 11, what is 3 + 122a? 1232 In base 13, what is 79 - 5? 74 In base 7, what is -1136 + 11? -1125 In base 7, what is -10 + 4410? 4400 In base 11, what is 2 + -15? -13 In base 6, what is 151345 + 2? 151351 In base 7, what is 1 + -13310? -13306 In base 2, what is -10 - 10101100? -10101110 In base 14, what is -3 - -6? 3 In base 3, what is 11 + -20? -2 In base 7, what is -540 + -24? -564 In base 10, what is -63 - 1? -64 In base 2, what is -110101101 - 110? -110110011 In base 3, what is -11 - 0? -11 In base 7, what is -6413 - -1? -6412 In base 10, what is 1472 + 8? 1480 In base 8, what is 70 + -10? 60 In base 4, what is 130 + 212? 1002 In base 6, what is -2 + 111? 105 In base 14, what is -14 + -231? -245 In base 13, what is 2 - -21? 23 In base 6, what is -22 + -2? -24 In base 15, what is -aca2 + -3? -aca5 In base 12, what is 3b - -3? 42 In base 7, what is 302 - 25? 244 In base 2, what is -1 - -1101100? 1101011 In base 10, what is 1114 - 1? 1113 In base 2, what is 1 + -101001011? -101001010 In base 13, what is 4382 - 4? 437b In base 13, what is -22 + 29? 7 In base 7, what is -4556 + -1? -4560 In base 12, what is -b - -11? 2 In base 10, what is -7 + -40? -47 In base 12, what is a + 19? 27 In base 2, what is -11000 + -110010? -1001010 In base 3, what is 21101 - 10001? 11100 In base 14, what is -1c6 + 0? -1c6 In base 6, what is -2501 - 11? -2512 In base 16, what is 95 + -2a? 6b In base 3, what is -102 + -11010? -11112 In base 10, what is 6 - 23? -17 In base 6, what is 120 - 12? 104 In base 11, what is 4 - 201? -1a8 In base 4, what is 0 + -32311? -32311 In base 4, what is -201 - 1000? -1201 In base 4, what is -3 + 0? -3 In base 5, what is -44 - 11? -110 In base 14, what is 26c8 + -2? 26c6 In base 11, what is 127 - 2? 125 In base 14, what is 4 + 5? 9 In base 7, what is 200 + -3? 164 In base 7, what is 2 + -4146? -4144 In base 2, what is -11110 - -101? -11001 In base 15, what is 1 - 9dd? -9dc In base 14, what is -18 - 23? -3b In base 11, what is -181 + -8? -189 In base 8, what is -1 - 452? -453 In base 8, what is -4564 - -1? -4563 In base 5, what is 1 - -41? 42 In base 8, what is -75 - 173? -270 In base 2, what is 11110000101100 + -10? 11110000101010 In base 9, what is -73 - -2? -71 In base 2, what is 1010101 - 1010010? 11 In base 10, what is -363 - 16? -379 In base 10, what is -574 + -9? -583 In base 14, what is 5d - -5c? bb In base 12, what is -3 - 696? -699 In base 8, what is 1 - -144? 145 In base 14, what is 3 + -226? -223 In base 16, what is -37 + 5? -32 In base 5, what is -11244 - -1? -11243 In base 15, what is -2 + 5e? 5c In base 3, what is 12 - 110? -21 In base 7, what is 34 - 3? 31 In base 14, what is 3 - 23? -20 In base 5, what is -2341 + -10? -2401 In base 13, what is -18 - -8? -10 In base 13, what is 5 + -1a2? -19a In base 8, what is 2 - 627? -625 In base 3, what is -10 + 1112? 1102 In base 15, what is 0 - -3? 3 In base 9, what is -2248 - -1? -2247 In base 6, what is -3511 + -31? -3542 In base 13, what is -3 - -6? 3 In base 4, what is -332 + 323? -3 In base 4, what is 11 + -100003? -33332 In base 8, what is 2462 + 3? 2465 In base 11, what is 28 - 338? -310 In base 5, what is 0 - -31034? 31034 In base 10, what is 5 - -280? 285 In base 11, what is -4 + -77? -80 In base 7, what is 2 - 4205? -4203 In base 16, what is 0 - c1? -c1 In base 16, what is 9 - -717? 720 In base 16, what is -ec + a? -e2 In base 10, what is -1343 - 1? -1344 In base 7, what is 1122 + -11? 1111 In base 8, what is 2 - -250? 252 In base 4, what is 12 - 3? 3 In base 10, what is -8 - 5? -13 In base 5, what is -3 + -1003? -1011 In base 9, what is -5 + -12? -17 In base 6, what is 13 + 125? 142 In base 3, what is 0 - 10122? -10122 In base 11, what is -4 + 151? 148 In base 10, what is -1980 + -1? -1981 In base 3, what is 1 + -111100? -111022 In base 10, what is -31 - 13? -44 In base 6, what is -3004 - -1? -3003 In base 2, what is 100111111 - 11? 100111100 In base 11, what is 18 + -6? 12 In base 11, what is 5 - 18? -13 In base 13, what is -a + -4? -11 In base 5, what is 3 + 44? 102 In base 15, what is -391 + -8? -399 In base 10, what is -319 + 30? -289 In base 14, what is 2 + -6a? -68 In base 10, what is -6 + -14? -20 In base 4, what is 11 + -10031? -10020 In base 4, what is 102 + 1012? 1120 In base 16, what is 7af + -5? 7aa In base 15, what is 0 - 4c1? -4c1 In base 7, what is -324 - 11? -335 In base 3, what is -21202 + 110? -21022 In base 15, what is 14 - 61? -4c In base 8, what is 2176 - 10? 2166 In base 8, what is -645 - -7? -636 In base 14, what is -4c + -3? -51 In base 3, what is 212022 + 12? 212111 In base 6, what is 2 - -1005? 1011 In base 10, what is -3 + 571? 568 In base 15, what is -4eab - 3? -4eae In base 6, what is -1145 - 4? -1153 In base 13, what is -192 - -3? -18c In base 15, what is 5 + 190? 195 In base 9, what is -26 - 84? -121 In base 13, what is -127 - 11? -138 In base 15, what is -160c + 1? -160b In base 16, what is -3d15 + 0? -3d15 In base 12, what is 28 - 19? b In base 7, what is 601 - -4? 605 In base 11, what is -4 - -492? 489 In base 11, what is 76 - -8? 83 In base 6, what is 5 + -3? 2 In base 13, what is -563 + -4? -567 In base 3, what is 0 - -1011? 1011 In base 12, what is -467 - -3? -464 In base 15, what is -5 + -b5a? -b60 In base 7, what is 5 - 41? -33 In base 5, what is 110 + -1014? -404 In base 4, what is -10 - 111? -121 In base 3, what is 122 - -102? 1001 In base 7, what is -40455 + -5? -40463 In base 11, what is 0 + -5aa? -5aa In base 13, what is 19 - -c? 28 In base 6, what is 1 + -320? -315 In base 9, what is -5 + 2? -3 In base 15, what is -3 + -1014? -1017 In base 7, what is 6 - -13333? 13342 In base 14, what is -9 - 6? -11 In base 6, what is -3 + 3543? 3540 In base 7, what is 0 - -460? 460 In base 15, what is dad - 5? da8 In base 4, what is 12 - 12? 0 In base 7, what is 5 - -2262? 2300 In base 12, what is -46 - 0? -46 In base 2, what is -100110 + -1001? -101111 In base 10, what is 4 + 24? 28 In base 3, what is 2 - 122? -120 In base 4, what is -22 - -313? 231 In base 13, what is 1a - 1a? 0 In base 16, what is 9 + 1? a In base 11, what is 11 - 47? -36 In base 13, what is -4b3 + -4? -4b7 In base 16, what is -5287 - 5? -528c In base 12, what is -2 - -817? 815 In base 4, what is 12103 + -3? 12100 In base 2, what is -1111111 + -101? -10000100 In base 10, what is -2162 - 4? -2166 In base 14, what is a10b - 4? a107 In base 7, what is 40 - 2? 35 In base 12, what is -526 + -5? -52b In base 14, what is 56 + -16? 40 In base 10, what is 8 - -13? 21 In base 12, what is -4b + -b? -5a In base 3, what is 110112 - -211? 111100 In base 14, what is -9d2 + 2? -9d0 In base 10, what is -924 - -12? -912 In base 15, what is -1 - 264? -265 In base 13, what is 3b + -6? 35 In base 15, what is 66 - -5? 6b In base 2, what is 101 + -111000? -110011 In base 7, what is 13 - -1633? 1646 In base 13, what is -51 + -a? -5b In base 5, what is 1232 - 3? 1224 In base 6, what is 5 - 202? -153 In base 15, what is e + 4? 13 In base 5, what is -4 - -112031? 112022 In base 8, what is 1 - 53? -52 In base 5, what is 0 + 424? 424 In base 13, what is 0 - -319? 319 In base 5, what is 23241 + 4? 23300 In base 13, what is 7 - -b? 15 In base 15, what is -88 + -3? -8b In base 4, what is -310 - -211? -33 In base 6, what is 1 - 21? -20 In base 5, what is 4 + -344? -340 In base 10, what is 51 - -14? 65 In base 11, what is -20 - -86? 66 In base 6, what is 52 - -50? 142 In base 8, what is 2 + -5446? -5444 In base 10, what is 2 - 45? -43 In base 13, what is 2 + -4? -2 In base 16, what is -1 - -196? 195 In base 15, what is 2 - 6b? -69 In base 15, what is 1 - 7b? -7a In base 7, what is 1 + 65? 66 In base 3, what is -12 + 2102120? 2102101 In base 7, what is 30 + -35? -5 In base 12, what is -1 - -22? 21 In base 2, what is -10101011 - 1111? -10111010 In base 3, what is 11 - -11101221? 11102002 In base 4, what is 2 - 2? 0 In base 5, what is -10 - -241? 231 In base 14, what is 4 - b? -7 In base 12, what is -9 - -30? 23 In base 15, what is -1 - 75? -76 In base 2, what is 101 + -	{ "pile_set_name": "DM Mathematics" }
prob of sequence fs when two letters picked without replacement from {i: 2, s: 5, f: 3, r: 3}. 5/52 Three letters picked without replacement from xxwgxgxgxxxggggxwgx. What is prob of sequence xxx? 28/323 Two letters picked without replacement from {u: 3, q: 6, o: 2, e: 1, d: 1}. Give prob of sequence uu. 1/26 Calculate prob of sequence wjjk when four letters picked without replacement from nwwwwkjkjnnnnewjwn. 1/1020 Calculate prob of sequence zzw when three letters picked without replacement from wwwwwzwzww. 1/45 What is prob of sequence bf when two letters picked without replacement from {f: 1, b: 7}? 1/8 What is prob of sequence kf when two letters picked without replacement from {y: 8, m: 4, o: 1, k: 4, f: 2}? 4/171 What is prob of sequence gn when two letters picked without replacement from {g: 1, x: 1, n: 1, q: 1, a: 1}? 1/20 What is prob of sequence nww when three letters picked without replacement from {n: 4, s: 2, w: 7}? 14/143 Two letters picked without replacement from {z: 2, g: 11, m: 2}. Give prob of sequence mg. 11/105 Two letters picked without replacement from {f: 3, o: 1, a: 1, c: 2}. What is prob of sequence oa? 1/42 Two letters picked without replacement from xxttxtptpxtxxtxt. Give prob of sequence pp. 1/120 Calculate prob of sequence dpe when three letters picked without replacement from {l: 2, d: 2, r: 1, p: 2, e: 5, w: 2}. 5/546 Three letters picked without replacement from {w: 13, t: 6}. Give prob of sequence www. 286/969 Calculate prob of sequence kq when two letters picked without replacement from {q: 18, k: 2}. 9/95 Four letters picked without replacement from {p: 11, w: 9}. Give prob of sequence ppwp. 99/1292 Two letters picked without replacement from wbbvbbvbvbbbbwb. Give prob of sequence vw. 1/35 What is prob of sequence bt when two letters picked without replacement from twbsjtbj? 1/14 What is prob of sequence mmm when three letters picked without replacement from {m: 17, u: 3}? 34/57 Three letters picked without replacement from ilblhbiilbiihsilb. What is prob of sequence bls? 1/255 What is prob of sequence uuw when three letters picked without replacement from uwwuww? 1/15 Three letters picked without replacement from nnnnnnnfnnnannxnanf. Give prob of sequence fax. 2/2907 Calculate prob of sequence aaaa when four letters picked without replacement from {a: 6}. 1 Calculate prob of sequence fjjj when four letters picked without replacement from dfddjjjjjiwi. 1/198 What is prob of sequence qa when two letters picked without replacement from {s: 3, p: 5, q: 5, d: 1, a: 2}? 1/24 Two letters picked without replacement from {e: 2, x: 4, z: 1, m: 2, n: 1}. Give prob of sequence zn. 1/90 Three letters picked without replacement from {t: 2, s: 7, h: 3}. What is prob of sequence thh? 1/110 Three letters picked without replacement from geegbts. What is prob of sequence ste? 1/105 What is prob of sequence pvu when three letters picked without replacement from {p: 1, b: 2, v: 4, u: 2}? 1/63 Four letters picked without replacement from fepaepaeefpapf. Give prob of sequence ffaf. 3/4004 Three letters picked without replacement from {v: 1, n: 1, x: 9, z: 7}. What is prob of sequence vxz? 7/544 What is prob of sequence exae when four letters picked without replacement from eaeaeeexeaeaaa? 3/286 Three letters picked without replacement from gccnnngcggnnggnngc. What is prob of sequence cnn? 7/204 Three letters picked without replacement from ffjj. Give prob of sequence jff. 1/6 Calculate prob of sequence ss when two letters picked without replacement from {a: 4, t: 2, s: 7}. 7/26 Calculate prob of sequence zzz when three letters picked without replacement from {z: 7}. 1 Three letters picked without replacement from hlbljblbblhdjbb. What is prob of sequence hbb? 2/91 Four letters picked without replacement from {c: 18, r: 2}. Give prob of sequence rccc. 8/95 Calculate prob of sequence iib when three letters picked without replacement from riibbbbrrriibb. 3/91 What is prob of sequence hh when two letters picked without replacement from {t: 5, s: 4, k: 2, h: 7}? 7/51 Four letters picked without replacement from {h: 1, l: 7, w: 6, s: 1}. What is prob of sequence lwsl? 1/130 What is prob of sequence iiii when four letters picked without replacement from iiiiikiiiiii? 2/3 What is prob of sequence szt when three letters picked without replacement from qeetgeegqeseettzezt? 4/2907 Four letters picked without replacement from {a: 8, g: 3, i: 7}. What is prob of sequence iagg? 7/1530 What is prob of sequence awoi when four letters picked without replacement from {a: 1, w: 3, m: 9, j: 2, o: 1, i: 3}? 1/10336 Calculate prob of sequence jjj when three letters picked without replacement from hhujuujhujjsjj. 5/91 What is prob of sequence gw when two letters picked without replacement from gbcwwb? 1/15 Two letters picked without replacement from vckjvjccjjjkccjjj. What is prob of sequence vj? 1/17 Calculate prob of sequence vfco when four letters picked without replacement from {v: 1, f: 9, o: 8, c: 2}. 2/1615 Calculate prob of sequence qiqi when four letters picked without replacement from {p: 9, q: 3, i: 4}. 3/1820 Two letters picked without replacement from {e: 5, q: 15}. What is prob of sequence ee? 1/19 Calculate prob of sequence qx when two letters picked without replacement from {w: 3, q: 13, x: 2}. 13/153 Four letters picked without replacement from {z: 1, d: 3, g: 4}. Give prob of sequence zggd. 3/140 What is prob of sequence qqvk when four letters picked without replacement from qzfsskfqkvqfkfs? 1/1820 What is prob of sequence rcsr when four letters picked without replacement from {h: 1, s: 6, r: 3, c: 5}? 1/182 What is prob of sequence nby when three letters picked without replacement from {s: 4, b: 6, u: 2, n: 4, y: 1}? 1/170 Three letters picked without replacement from whvxc. Give prob of sequence hcw. 1/60 Two letters picked without replacement from ivvv. Give prob of sequence vv. 1/2 Calculate prob of sequence vltp when four letters picked without replacement from vvktlpy. 1/420 Calculate prob of sequence jjd when three letters picked without replacement from jjhdj. 1/10 What is prob of sequence yz when two letters picked without replacement from vzyyvyvzvzyvvyyvzy? 14/153 What is prob of sequence cvoc when four letters picked without replacement from vvovccvo? 1/105 Two letters picked without replacement from {t: 3, y: 11, i: 1}. What is prob of sequence yi? 11/210 Calculate prob of sequence ttv when three letters picked without replacement from ndnvdtentedd. 1/660 Four letters picked without replacement from {g: 1, d: 6, m: 7, i: 5}. Give prob of sequence imid. 35/3876 What is prob of sequence aoh when three letters picked without replacement from gdaddgodh? 1/504 What is prob of sequence jpjp when four letters picked without replacement from jjpjpjjpjjjjjp? 45/1001 Calculate prob of sequence chi when three letters picked without replacement from {h: 1, z: 2, p: 1, c: 1, i: 4}. 1/126 Three letters picked without replacement from {v: 10, a: 1, u: 3, m: 2, o: 1}. What is prob of sequence aum? 1/680 What is prob of sequence qpqu when four letters picked without replacement from qbqqpeufqpuqu? 1/143 What is prob of sequence vnv when three letters picked without replacement from vnnvvvvko? 5/63 Three letters picked without replacement from mcqccmoccnmq. Give prob of sequence qoq. 1/660 What is prob of sequence oo when two letters picked without replacement from {h: 1, l: 1, i: 2, a: 2, o: 2, v: 7}? 1/105 Four letters picked without replacement from {v: 1, l: 1, p: 2}. Give prob of sequence pvlp. 1/12 What is prob of sequence sag when three letters picked without replacement from {a: 10, g: 2, s: 2}? 5/273 What is prob of sequence ppp when three letters picked without replacement from lldpdpddp? 1/84 Two letters picked without replacement from rrruruuuur. What is prob of sequence ru? 5/18 Three letters picked without replacement from {z: 3, h: 6, y: 1, b: 1, s: 3, f: 5}. What is prob of sequence zyz? 1/969 What is prob of sequence fk when two letters picked without replacement from {k: 12, f: 3}? 6/35 What is prob of sequence ffk when three letters picked without replacement from fffkffkffk? 7/40 What is prob of sequence zgfa when	{ "pile_set_name": "DM Mathematics" }
60, -0.3, -1? -60 What is the third biggest value in -3/4, 0.3, 50? -3/4 Which is the second smallest value? (a) 33 (b) 6/7 (c) -3 (d) -1 d Which is the second biggest value? (a) 80 (b) -3/5 (c) 1/2 c What is the smallest value in 0.4, 0.27, 0.2? 0.2 Which is the third smallest value? (a) 4 (b) 3 (c) -1.41 a What is the fourth biggest value in -0.07, -232, 0.3, 4? -232 Which is the third biggest value? (a) 0 (b) 0.8 (c) -120 (d) 2 a What is the third smallest value in -1/3, -5, 0.3, -26? -1/3 What is the second smallest value in -0.2, 5, -40? -0.2 What is the second biggest value in 272, -4, -2/7? -2/7 Which is the third biggest value? (a) 6 (b) 8 (c) 0.036 c What is the smallest value in 2/15, 1/6, 2.8, -0.4? -0.4 What is the smallest value in -1/7, -0.28, -0.4, 0.4? -0.4 What is the third smallest value in -0.1, -1, -14.7, 0? -0.1 Which is the second smallest value? (a) -25 (b) 66 (c) 0.2 c Which is the second biggest value? (a) 1 (b) 0.078 (c) -0.4 b Which is the third biggest value? (a) 1 (b) 6358 (c) -5 c Which is the third biggest value? (a) 0 (b) 2/9 (c) 1/272 (d) -4 (e) 2 c What is the third smallest value in 3, 5, 122? 122 Which is the third biggest value? (a) 0.5 (b) -6 (c) -85 c What is the biggest value in 2, 6, -0.06, -5? 6 Which is the third smallest value? (a) 79 (b) 0.1 (c) 2/199 a What is the second biggest value in 2/25, -1/2, 6, -5, -2/13? 2/25 Which is the second smallest value? (a) -0.4 (b) 1 (c) -3 a Which is the smallest value? (a) -15/4 (b) 0.5 (c) -3 a Which is the smallest value? (a) 24 (b) 1 (c) 22/9 b Which is the third smallest value? (a) -9.3 (b) 1/3 (c) 5 (d) 6 c What is the second smallest value in 2/7, 2, 6, 0.1, 3? 2/7 What is the second biggest value in -4/7, 6/23, -5? -4/7 What is the biggest value in 0.2, 12, 7? 12 What is the fourth smallest value in -18, -0.1, 0.3, -0.5? 0.3 What is the third biggest value in -33/4, -5, 1/4? -33/4 What is the fourth smallest value in 5, 3, 0.022, 0.5, 2? 3 What is the second smallest value in -1/8, 1/7, 1788/29? 1/7 Which is the fourth smallest value? (a) 1/4 (b) -0.1 (c) -807 (d) 0.4 (e) 1/2 d What is the third smallest value in -4, 2.2, 0.1, 5, -0.3? 0.1 What is the third biggest value in -0.5, 0.7, -9, -5, -4/7? -4/7 What is the smallest value in -1/6, 4, 0.5, 1.5, -0.3? -0.3 What is the second smallest value in 3, 0.103, -1? 0.103 Which is the biggest value? (a) 5/4 (b) 0.16 (c) -2 (d) 4 d Which is the second biggest value? (a) 2/23 (b) -1/5 (c) -19 b Which is the fifth smallest value? (a) -0.4 (b) 10 (c) -5 (d) 1.2 (e) -2 b What is the second smallest value in -1/5, 4, -0.585, 1? -1/5 Which is the third smallest value? (a) 0.3 (b) -4 (c) 13 (d) -13 a What is the third biggest value in -5/6, 0.17, -1/5? -5/6 What is the third smallest value in 1, -3, 1/2, -4, 8.4? 1/2 What is the second smallest value in 0.0452, 7, 1/5? 1/5 Which is the second smallest value? (a) -0.02 (b) -2 (c) -7/5 c Which is the biggest value? (a) -1/2 (b) -1 (c) 0.5 c Which is the smallest value? (a) 3 (b) 2/9 (c) 1/4 b What is the second smallest value in -4, 14/13, -0.1? -0.1 What is the second biggest value in -2, -8, 4? -2 What is the smallest value in -0.2, 0.2, 2, -7? -7 What is the third biggest value in 2/3, 4, -2.1, -1/3, -11/3? -1/3 What is the third biggest value in 4, -0.0682, -1? -1 Which is the third biggest value? (a) 0.7 (b) 2 (c) 0.3 c Which is the fourth biggest value? (a) 5/4 (b) -1/6 (c) 3 (d) 2/11 b What is the biggest value in -2/7, 2, 0, 3.5? 3.5 Which is the third biggest value? (a) 81 (b) -4/5 (c) -1/4 b What is the third biggest value in 3, 2/233, 0.2? 2/233 What is the smallest value in -39, 2/7, 4/7? -39 What is the second biggest value in 3/11, 1/3, -3, -5? 3/11 What is the fourth smallest value in 1/12, 0.04, -3, -1/6? 1/12 What is the second smallest value in -4, 4/15, -0.084? -0.084 Which is the second smallest value? (a) 3/5 (b) -2/3 (c) -0.1 (d) -344 b Which is the smallest value? (a) 27 (b) 53 (c) -2 c Which is the second smallest value? (a) -3 (b) 0.02 (c) 2 b What is the biggest value in 132/5, 4, -5, -0.1? 132/5 What is the biggest value in 4, 0, 9? 9 What is the second smallest value in -77, -2/7, 2? -2/7 Which is the fourth biggest value? (a) 1/5 (b) -1/21 (c) -0.1 (d) 1/10 c Which is the smallest value? (a) -19/3 (b) 4/5 (c) -3/7 (d) 1/5 a Which is the biggest value? (a) 2/13 (b) 5 (c) 16 c What is the second smallest value in 0.08, -269, 0.4? 0.08 Which is the third smallest value? (a) -3/7 (b) 17 (c) -759 (d) -0.3 d What is the fourth biggest value in -1/10, 12, -0.04, -1? -1 What is the smallest value in -0.3, -9, 2/13? -9 Which is the second biggest value? (a) -30 (b) 0.1 (c) 1.7 (d) 4 c What is the fourth smallest value in -0.3, 1, -0.6, 835, -5? 1 Which is the second biggest value? (a) 139/3 (b) 0.4 (c) 4 (d) -1 c Which is the biggest value? (a) -20 (b) 0 (c) 0.1 (d) -6 c What is the second biggest value in 0.06, -5, 23? 0.06 Which is the fifth smallest value? (a) -2/11 (b) -1 (c) 38 (d) 3 (e) -5 c What is the second biggest value in 2, -957, 0? 0 Which is the second biggest value? (a) 96 (b) -0.3 (c) 0.5 c Which is the second biggest value? (a) -0.27 (b) -30 (c) -5 c What is the biggest value in -3, -5, 0.5, -0.004? 0.5 Which is the third smallest value? (a) -2/3 (b) 2.7 (c) 5/6 b Which is the fifth biggest value? (a) 5 (b) -4 (c) 39 (d) -1/2 (e) 1/15 b What is the smallest value in 0, -8, 96, -5/3? -8 Which is the second biggest value? (a) 3 (b) -1/52 (c) 0.02 c What is the smallest value in -3, -4, 4, -1? -4 What is the smallest value in -1/4, 2/7, 0.5, 0.2? -1/4 What is the second smallest value in -18, 2, -0.3? -0.3 Which is the biggest value? (a) -0.088 (b) 0.1 (c) 4 (d) 5 d What is the second smallest value in -0.3, -4, 1/17, 4? -0.3 Which is the second biggest value? (a) 0.2 (b) -33 (c) 3/5 (d) 2 c Which is the fourth smallest value? (a) -5 (b) 0.26 (c) -0.06 (d) 4 (e) 3 e Which is the fourth biggest value? (a) 3/2 (b) 0 (c) 0.1 (d) -6/5 d Which is the second biggest value? (a) 34 (b) -1/4 (c) 3/5 c Which is the third biggest value? (a) -0.1 (b) 0.3 (c) 4 (d) 11 (e) 9 c What is the second biggest value in -1/4, 544, -6/7? -1/4 Which is the third smallest value? (a) -2 (b) 0.2809 (c) -5 b Which is the second biggest value? (a) 3 (b) -3/2 (c) -1/6 (d) -3 c Which is the third biggest value? (a) 2/5 (b) 3/2 (c) -384 c What is the second smallest value in 4, -23, -1/4, -7? -7 What is the fourth smallest value in -1/7, -1, 0.3, -95? 0.3 Which is the second biggest value? (a) 0.1 (b) 4 (c) 2/17 (d) -4 c Which is the fourth biggest value? (a) 0.1 (b) -2/9 (c) 21 (d) -9.1 d What is the biggest value in -3, 2/5, 5, -23? 5 Which is the third smallest value? (a) 2/11 (b) 3 (c) 2/9 (d) 1 d Which is the second biggest value? (a) -4 (b) 4 (c) -1.2 (d) -2/7 (e) -5 d What is the biggest value in 0.1, 20, 11? 20 What is the fourth smallest value in -0.6, -4, -1, -2/5? -2/5 Which is the third smallest value? (a) 24/7 (b) 1 (c) -71 a Which is the second smallest value? (a) -1/2 (b) 3 (c) 2765 b Which is the second smallest value? (a) -6 (b) -3 (c) 17 (d) 0 (e) -2/21 b What is the second biggest value in -4.2, -1, 0.4? -1 Which is the third smallest value? (a) -8/3 (b) -2 (c) -3 (d) -2/5 b What is the fifth biggest value in 2/5, 5, -8, -2, 12? -8 What is the biggest value in 34/11, -2/7, -3/2? 34/11 Which is the fourth biggest value? (a) 0.2 (b) -1/3 (c) 4/3 (d) 0.1 b What is the biggest value in 3, -0.16, -0.4? 3 Which is the second biggest value? (a) -1 (b) 2/9 (c) 0 (d) 2/3 b What is the second biggest value in -0.4, -3.2, -0.3? -0.4 Which is the second biggest value? (a) -3 (b) -134 (c) -4 c Which is the fourth smallest value? (a) 1/3 (b) 0.4 (c) 2/9 (d) -0.2 b Which is the fifth biggest value? (a) -8 (b) 0.3 (c) 4/7 (d) -1 (e) -0.1 a Which is the third smallest value? (a) -0.5 (b) -0.1 (c) -5 (d) 1/4 b Which is the smallest value? (a) 25 (b) -0.12 (c) -1 c What is the second biggest value in -1/4, -55, 0.1, 0, -1/5	{ "pile_set_name": "DM Mathematics" }
1? 1 Let u = 247/9 - 997/36. Which is the closest to 0.1? (a) -5 (b) -33/8 (c) u (d) -0.08 d Let l = 0.03 + 0.47. Let x = 43 - 41.8. Let r = x + -1.4. Which is the closest to -0.4? (a) 1 (b) l (c) r c Let q(o) = 28 - 88o + 189o - 87o. Let y be q(-5). Let h be 1(72/y + 2). What is the closest to 0.1 in h, 0.06, 3? 0.06 Let o = 17072 - 17132. Which is the closest to o? (a) -24 (b) -3/7 (c) 0 a Let f = 8 + -7.6. Let l = -16580 - -132637/8. What is the nearest to -9 in 5, l, f? l Let s be 86/11 - 2 - 6. Let p be (-6)/(-10) + (-410)/(-50). Let o = -269/30 + p. What is the closest to -0.5 in -1/2, o, s? -1/2 Let w = 0.11 + 3.89. Which is the nearest to -2? (a) -0.24 (b) w (c) -3/2 (d) -0.1 c Let i(w) = 29w2 - 8. Let j be i(-4). Let x = j + -3651/8. Let f = -4.7 - 0.3. Which is the nearest to f? (a) x (b) -3/2 (c) 1/4 b Let c = 2137 - 2136. Let f be ((-12)/10)/((-9)/30). Let g = -0.4 - -0.7. What is the closest to c in f, g, 2? g Let y = -29.967 + -0.033. Let h = 42 + -11. Let j = y + h. What is the nearest to 2/3 in j, -2/9, -2? j Let x = -0.0091 - -0.0415. Let y = -0.0324 + x. Which is the nearest to 2/5? (a) y (b) 5 (c) -1/5 a Suppose 28k = 27k + 2. Let v be ((-3)/54)/(18/12 - k). Which is the closest to v? (a) 0.4 (b) 0.3 (c) 4/5 b Let f = 1.4865 - 2.4865. Which is the nearest to f? (a) 3/2 (b) 67 (c) 9 a Let q = -0.0422 + -251.9578. Which is the nearest to q? (a) 4/9 (b) -3 (c) 5 b Let y = 1768 - 1768.729. What is the nearest to 0 in 0.4, y, 2? 0.4 Let d = 211 + -233.8. Let n = -25 - d. Let r = 2.2 + n. What is the closest to 2 in r, -5/2, -2/17? r Let m = -2 - 3. Let x = 0.6085 - 62.6085. Which is the closest to -1/4? (a) m (b) -2 (c) x b Let q = -825 - -828.51. What is the nearest to 0.1 in q, -3/2, -0.4, 2? -0.4 Let l = -2 - -2.4. Let d = 125 - 1251/10. Let m = 1477 + -1476. Which is the closest to d? (a) -0.1 (b) m (c) l a Let z = 2551 - 7652/3. What is the closest to 0.3 in z, -3/8, 0.01, -11? z Let l be (104/117)/4(-1 - (-4 + 2)). Which is the nearest to l? (a) 0.41 (b) 0.5 (c) -2 (d) 4 a Let q = -4.72 - -4.82. Let a = 1/15 - -3/5. What is the closest to a in -1/4, -16, q? q Let l be 3 + -1 - 5 - 1. Let n = 94 + -145. Let d = 50.97 + n. Which is the closest to -0.3? (a) d (b) l (c) -0.4 c Let v = 42 + -42.2. Let m be (32/2)/((-24)/180). Let w = m - -124. Which is the nearest to v? (a) w (b) 1 (c) -13 b Let o(q) = q*2 - 6q + 2. Let x be o(5). Let a = -38 + 38.1. What is the nearest to a in x, 5, 0.5? 0.5 Let q = -535.9 + 535.6. Which is the nearest to 7? (a) -1.5 (b) 4 (c) q (d) -4 b Let z be (-204)/(-176) - 9/36. Which is the closest to z? (a) 0 (b) 0.06 (c) -4 b Let o = -14684 + 14682. What is the closest to 0.1 in o, -5, 22, 1? 1 Let d = -4.45 + -0.55. What is the closest to -0.2 in -4, -2/15, d? -2/15 Let g = -306 - -307. Let y(w) = -w + 4. Let o be y(8). Which is the nearest to -0.1? (a) -5 (b) o (c) g c Let f = -6323 + 6328. Which is the nearest to 0? (a) -1/2 (b) f (c) -0.09 (d) 2.06 c Let u = -0.03 - -0.33. Let p be (5 + -1 + (-21)/6)/(-2 + (-20)/8). What is the closest to u in -4, p, 4? p Let l be (-8)/(-14) + 4/(-56). Let z = 64 - 63.4. Which is the nearest to 1/2? (a) l (b) z (c) -2 a Suppose -4n = -n - 3. Let j = 0.153 - 0.453. What is the nearest to -1 in j, -0.17, n? j Let m = -401/1197 + 15/133. Suppose 1 = -2w + w. What is the closest to w in -1/2, -0.6, m? -0.6 Suppose 3f + 13 = z + 4, -4f - 12 = 0. Suppose 8 = -2i - z. What is the nearest to 0.1 in 2, i, -2/35? -2/35 Let j be (-4)/12623940/(-5320). Suppose f + 0f = 1. What is the closest to f in 3/13, j, -2/7? 3/13 Let f be 80/16 - (6 - 1). Let m = -0.058 - 67.942. Let u = 71 + m. What is the nearest to u in -2/5, 1/6, f? 1/6 Let y = 0.15 - 0.18. Let s = 41373 - 41369. What is the closest to -2/3 in y, -1/4, -3, s? -1/4 Let u = -146.3 + -14.9. Let b = 161 + u. What is the closest to 2/7 in -1/10, -0.4, b? -1/10 Let m(h) = -102h - 419. Let u be m(-14). Which is the closest to u? (a) 4/5 (b) 1/5 (c) -3/5 a Let o = 749 - 23217/31. Let p = 23/124 + o. Which is the nearest to p? (a) 3 (b) -1 (c) -2/17 c Let l = -18.354 - -81.354. Which is the closest to -1.1? (a) -2/11 (b) -2/5 (c) l (d) 5 b Let h be (2/(-3))/((-136)/51). Let i = 44 + -44. Which is the nearest to -0.1? (a) -1 (b) i (c) h b Let i = -0.113751 - 0.016249. Let q = -0.2 + 0.2. What is the closest to -1 in i, 2, q? i Let y be (9/(-1))/((-144)/(-96)). Let r = -0.84 + 1.34. Which is the nearest to r? (a) 0 (b) y (c) -5 a Let c be (-4 - (3 + 2))4/(-6). Let b be (c/(31 + 5))/(1/(-3)). What is the closest to 0.1 in b, 4, 2/7? 2/7 Suppose -a + 2i + 0i = -9, i + 18 = 5a. Suppose m + 4 = 0, ap = -p - 3m - 32. What is the closest to -0.2 in -0.5, p, -1, -2? -0.5 Let d = 30286 + -30287. What is the nearest to d in 0.8, 1.6, 19? 0.8 Suppose -7b - 14b = 2205. Let t be ((-5)/18)/(b/84). What is the closest to -0.1 in 1/6, 2, t? 1/6 Let d be 1 + (-25 + 3 - -17). What is the closest to 2 in -1/3, d, -3/7, -10? -1/3 Let m be (-6)/(-8)(-16344)/(-27). Suppose m = 4p + 434. Which is the closest to 7? (a) 4 (b) 2 (c) p c Let l = 132.26 + -132.29. What is the nearest to 2 in -3/2, -17, 3/5, l? 3/5 Let v = 2958.5 + -2958. What is the closest to 95 in 0.2, 0, v, 5? 5 Let r = -0.4585 - 6.5415. Which is the closest to 7/3? (a) r (b) 1/3 (c) 4/9 c Let p = 480.6 - 485.6. What is the closest to 0.031 in p, -2/7, 5? -2/7 Let m(p) = -95p + 1756. Let u be m(18). Which is the nearest to 0.2? (a) -0.4 (b) u (c) 0.4 c Let j be (128/(-11) + 12)22/36. Which is the nearest to 0? (a) 30 (b) -5 (c) 2 (d) j d Suppose -3v = 5i - 8, 0 = 4v + 2i - 6i - 32. Let m be (-22)/33 - v/(-36). Which is the nearest to 0? (a) m (b) -2/37 (c) -3 b Let d = 55530.151 - 55457. Let z = -0.151 + d. Let y = -72 + z. Which is the nearest to y? (a) 7 (b) -2/5 (c) -1/4 c Let y = -281 - -285. What is the nearest to -0.03 in 1/5, -1.8, y? 1/5 Let p = 42.72 - 0.72. Let g = 43.047 - 0.047. Let x = g - p. Which is the nearest to -1/4? (a) 0.06 (b) x (c) 3/2 a Let m = 2287/2 - 1142. Let b = 1 - 0.9. Let s = b - 5.1. What is the nearest to 2/3 in s, 4, m? m Let n = 221.62 - 228.62. Which is the closest to -1/8? (a) 1/8 (b) -6 (c) n (d) -1/4 d Let l = -4823.1 - -4818.1. Which is the nearest to -3/4? (a) -3 (b) l (c) 1 (d) 0.3 d Let o be (-2 + 120/63 + (-14)/(-21))1. What is the nearest to 0.1 in 3/199, 1/3, o? 3/199 Let m(h) = 3h2 + 0h*2 + 18h + 31 - 4h2. Let s be m(19). Let q be (1/2)/(s/24). Which is the closest to q? (a) -0.2 (b) -1/4 (c) -1/14 c Let z be -1(-28)/(-16) + (-2 - -4). Which is the closest to z? (a) 1 (b) 18.9 (c) -7 a Let t = -2531.1 - -2531. Let k = 1 - 0. Which is the nearest to t? (a) -0.13 (b) k (c) -4 a Let u be 6/(-18)(20/15)/(12/18). Which is the closest to -0.2? (a) -0.4 (b) 1052 (c) -3 (d) u a Suppose 57n - 49n = 32. Let r = 68.9 - 69. Which is the closest to 0? (a) r (b) n (c) -7 a Let v = 502 - 613.6. Let p = -113 - v. Which is the closest to 0.3? (a) p (b) 0.1 (c) 1 b Suppose -i + 4y - 123 = 0, -2i = -7i + 4y - 631. Let h = 637/5 + i. Which is the nearest to h? (a) 3 (b) 5 (c) 5/3 (d) 11 c Let n = 22/45 + -4/45. Suppose -1 = -a + 4. Suppose -3d - 4i + 22 = 0, d + 2i + a = 15. What is the closest to n in -0.1, d, -0.5? -0.1 Let y = 197.3 - 193.3. What is the nearest to 2 in y, 0.1, 0.2? 0.2 Let s = -774.2 + 773.7. Which is the closest to -1? (a) 0.2 (b) s (c) -1204 b Let g = -3.9 + 3.5. Let u = 35 + -33. Suppose -o = 5f + 12 + 4, -o = -uf - 12. Which is the nearest to -2? (a) g (b) o (c) -4/7 c Let d = 17799 + -17799.09. Which is the closest to -3? (a) -2/3 (b) d (c) -10 a Let n be 607/45 - 10/(-30). Let o = n + -68/5. Let r = -1113 - -1111. Which is the closest to r? (a) o (b) 1/4 (c) -4 c Let g = 0.3775 - 0.3775. Which is the nearest to 0? (a) -3/8 (b) 1 (c) 13 (d) g d Let t = -0.086 - 0.014. Let g be 22/(-16) + 1 + 22/44. What is the closest to 0.1 in t, g, -1, 1/3? g Let z(x) = -26*x + 94. Let j be z(11). Let f = -2498/13 - j. Which is the closest to -1? (a) -0.3 (b) 53 (c) 2 (d) f a Let i = 0 - -1. Let p = 15/8 + -3/8. Let j = -1740/31 - -344	{ "pile_set_name": "DM Mathematics" }
4)/((-28)/m). What is the greatest common factor of 81 and v? 81 Suppose g - 2q = -81, 2q = 3g - 3q + 240. Let t = -74 - g. Let i be t/(4/243). Calculate the highest common factor of 5 and i. 1 Suppose -5u = -3w + 281, -10u + 3 = -13u. Calculate the greatest common factor of w and 4. 4 Let v be (-2 - (6 + -4)) + -35. Let c = 12 + v. Let j = -19 - c. What is the highest common factor of 4 and j? 4 Suppose -53s - 2547 = -5s + 1341. Suppose -102 = v - 15. Let m = s - v. Calculate the greatest common divisor of m and 14. 2 Let p(n) = -n2 + 32n - 79. Let g be p(26). Let r be 6/(-21) + (-1161)/(-21). What is the greatest common factor of g and r? 11 Suppose 66w = -5g + 69w + 16332, 4w = 2g - 6516. Calculate the highest common factor of 10 and g. 10 Suppose q = 4v - 81, -3v + 4q = -4v + 33. Let o(z) = 3z*2 - 83z + 455. Let p be o(7). Calculate the greatest common divisor of v and p. 21 Suppose 3a + 96 = 432. Let d = 63 + -53. Suppose -2l + v = -28, 8l + 28 = dl + v. Calculate the greatest common divisor of l and a. 14 Suppose 81d - 80d - 39 = -5u, -4u = d - 33. Suppose c + 0c - 15 = 0. Calculate the greatest common factor of d and c. 3 Let z(o) = 24o*2 + 6o + 10. Let w be z(6). Suppose -2i = 11i - w. Calculate the greatest common divisor of i and 30. 10 Suppose -11k - 518 = -25k. Suppose -29n = -kn. Let x be (n - (-4 + 1)) + 1 + 24. What is the highest common factor of 252 and x? 28 Let v be (-10)/(-6)6/2. Let m(l) = 15l + 5. Let a be m(v). Let y(o) = -11o2 + 125o - 130. Let j be y(10). What is the greatest common divisor of a and j? 20 Let l(k) = k*3 + 12k*2 - 93k - 42. Let u be l(-17). What is the highest common divisor of u and 1222? 94 Let w = 500 + -699. Let y = w + 607. Calculate the greatest common divisor of y and 17. 17 Let u be (1536/(-120))/((-4)/70). Let d = -221 + u. Suppose z = -x + 3 + 12, -5z + 54 = -2x. What is the highest common divisor of z and d? 3 Let v(l) = l + 4. Let i be v(8). Suppose ig = 379 + 29. Suppose 3 = -gj + 35j. Calculate the highest common factor of 21 and j. 3 Let x = 532 - 338. Suppose 0 = 4w - n - x, -46 = -w - 4n + 3n. What is the highest common divisor of 18 and w? 6 Suppose -4433 = -1767j + 1736j. Calculate the greatest common factor of 39 and j. 13 Suppose 283r - 3420 = 265r. Let d be 4/30 - 298/(-15). What is the greatest common divisor of r and d? 10 Suppose y - b + 1 = 3, -3y = -b - 4. Let w = 27 + y. Suppose 3l - 3v = 321, 0 = 7l - 12l - 5v + 585. Calculate the greatest common divisor of w and l. 28 Let i = 79 - 38. Let g be 2/(-7)-7(0 - -1). Suppose 4510 = -gq + 12q. Calculate the greatest common divisor of i and q. 41 Let a be -12(-1559903)/816 + 3/(-4). Calculate the highest common divisor of 203 and a. 203 Let o be 4/(-18) - (4740/(-810))/(2/240). What is the highest common divisor of 6 and o? 6 Suppose 19y + 0y - 8810 = 8366. What is the highest common divisor of y and 24? 8 Suppose -34s + 7344 = -5168. What is the highest common divisor of 92 and s? 92 Suppose -u - 3p + 3032 = 0, -4u - p = -6744 - 5384. What is the greatest common factor of u and 64? 8 Let b = 203 - 201. Suppose 6m + k - 85 = 3m, 2m = bk + 70. Calculate the greatest common divisor of 50 and m. 10 Let f(z) = -24z3 - 8z*2 + 2z - 9. Let k be f(-5). Calculate the highest common factor of 9 and k. 9 Let r be (162/(-42) - -3)-7. Suppose 15 = rl - 45. What is the highest common factor of 60 and l? 10 Let k be (9/(-36)10)/(-1 - (-243)/244). Calculate the highest common divisor of k and 854. 122 Let q = 117 - -16. Let i = q + -127. Calculate the greatest common divisor of i and 192. 6 Let c = -18396 - -18638. Calculate the highest common factor of 1892 and c. 22 Suppose 0 = -7k + 14 - 0. Suppose -ki + 96 = 2i. Suppose 41g - 35 = 36g + 5d, -3d + 43 = 5g. What is the highest common divisor of i and g? 8 Let c(p) = p3 - 8p*2 + 8p. Let z be c(7). Let q = 105 - 8. Suppose q - z = 2g. What is the highest common divisor of g and 15? 15 Suppose 5o = -4p + 36, 3o - 2o = 2p - 18. Suppose -106h = -103h - 675. Suppose 11m = -14m + h. What is the greatest common factor of p and m? 9 Let d(v) = -v*3 - 4v*2 + 91v + 304. Let r be d(-14). What is the greatest common factor of r and 3795? 165 Suppose 2a = -d + 860, -5a + 7d = 3d - 2137. Suppose 2w = 15w - a. What is the greatest common factor of 429 and w? 33 Let o(w) = -7w + 39. Suppose 0 = t - 68 + 73. Let p be o(t). What is the greatest common divisor of 74 and p? 74 Let r be 7 - 3071/(4 - 3/915). What is the highest common divisor of 6 and r? 6 Let u = 103 - 98. Suppose 13 = uz - 17. What is the greatest common divisor of 96 and z? 6 Suppose 849 = 92f - 1083. Let s = -1 - -3. Let x be 126/(1/(3/s)). What is the highest common factor of x and f? 21 Suppose 5x = -5d + 5836 - 686, -x + 2d = -1036. Calculate the greatest common divisor of 645 and x. 129 Let u = 24631 - 6601. What is the highest common factor of u and 90? 30 Suppose 13a - 12a = 3r + 24, 4a - 5r = 124. Calculate the highest common factor of 1524 and a. 12 Let p = 72 - 72. Let r be 20 - (6 + p + -4). What is the highest common factor of r and 18? 18 Suppose 0 = -u + 5, 2f + u - 34 = 3u. Suppose 0 = b - 21 - f. Suppose r - 170 = -4r + 5n, -r = -4n - b. What is the highest common factor of 62 and r? 31 Let b(o) = -11o - 401. Let f be b(-37). Suppose 5k = 986 - 56. What is the highest common divisor of k and f? 6 Let h(f) = -f3 + 10f*2 + 20f + 21. Suppose -213 = i - 224. Let s be h(i). Let x be (4 - 2) + -1 + 14. Calculate the greatest common factor of x and s. 15 Let o(n) = 8n + 9n - 40n + 12n + 2n2. Let i be o(8). Suppose -8y + 106 + 854 = 0. What is the highest common factor of y and i? 40 Let h(c) = 27c - 3723. Let m be h(142). What is the highest common divisor of 24 and m? 3 Let t be ((-11)/2 + (14 - 10))186. Let v = t + 339. Suppose 2f - 21 = 19. Calculate the highest common factor of f and v. 20 Suppose -1201z = -10286 - 84593. Let r be ((-316)/(-8))/((-2)/(-52)). What is the greatest common divisor of z and r? 79 Let h = -99 + 109. Suppose -4f + h = -2. Let o be f/(-9)-2(27 + 0). What is the highest common divisor of o and 126? 18 Let s = -126 - -94. Let k be 0 + ((-2856)/(-46) - s/(-368)). Suppose -457 = -5r - 4l, -4r - 101 = 2l - 469. Calculate the highest common factor of r and k. 31 Let o = 70 - 65. Suppose -7 = of + 18. Let b be (-1)/f - (-885)/75. Calculate the highest common divisor of b and 4. 4 Let j = -119 + 50. Let g be j/(-9)3 - -1. Let n be (-1)/(-11/32). What is the greatest common divisor of n and g? 8 Suppose 2h - 70 = 2d, 0d - d = -5. Suppose 20t + h = 24t. Suppose -4i + 217 + 11 = 3s, 4i - 3s = 252. What is the greatest common factor of t and i? 10 Let w(t) = t - 1. Let r be w(4). Suppose -2526 - 5965 = -7a. Let x = a + -1211. Calculate the highest common divisor of x and r. 1 Let q be (15-2)/(-5)(-1209)/(-62). What is the greatest common factor of 1872 and q? 117 Suppose 828 = 9j - 27. Suppose -157f - j = -162f. What is the greatest common factor of 1349 and f? 19 Let d be ((-624)/(-102) - (-4)/(-34))29. Let t = 238 - d. What is the highest common factor of 1 and t? 1 Suppose -6m - 2m - 182 = -318. Calculate the highest common factor of 2176 and m. 17 Let g(d) = 7d - 4. Let o be -5 - -9 - (0 - 0). Let s be g(o). Suppose 897 = -13c + 1001. What is the highest common divisor of c and s? 8 Suppose -a = 9 + 84. Let h(p) = p*2 + p - 2. Let x be h(2). Let z be (x + a/12)-36. Calculate the greatest common factor of 27 and z. 27 Let t be -22/34 + 10494/187. Let b be 39040/28 + (-16)/t. What is the highest common divisor of b and 34? 34 Let w(i) = -2i*2 + 50i - 47. Let a be w(20). What is the greatest common factor of 867 and a? 51 Suppose -75o = -78o - 153. Let m be (-6)/(-51) - (3921/o - -3). What is the highest common factor of m and 74? 74 Let b(l) = -l*3 + 28l*2 + 35l - 44. Suppose -4n + 116 = -4u, -12n + 3u = -14*n + 58. Let d be b(n). Calculate the highest common factor of 13 and d. 13 Let x = 2994 - 2892. Calculate the greatest common factor of x and 2346. 102 Let w be 5 + -4 + (-33 - -2). Let b be ((-68)/24)/(	{ "pile_set_name": "DM Mathematics" }
2. Solve -3v - 11 = -mq - 5, 0 = -3v - q - 6 for v. -2 Let p(f) = -f - 5. Let n be p(-8). Suppose -n = -z + 2. Solve 0 = 4d - zo + 13, -3d - o = -3o + 8 for d. -2 Suppose 4t - 40 = -4o, -4o = -20 - 0. Let s = 6 + -2. Solve 0b = -sb - 3r - 2, 2r + t = b for b. 1 Let v = -17 - -19. Solve 9b - vy = 4b - 20, -8 = 2b + 5y for b. -4 Let j = -319 + 322. Suppose -44 + 9 = -5l. Solve 7 = -y + 3m - lm, -5m = jy for y. 5 Let p(m) = -m*3 + 8m*2 - 7m + 5. Let u be p(7). Let g = u - 1. Solve 3n = 4v - 8 + 21, gv + 1 = -n for n. 3 Let s be 1 - (-2)/(0 - -2). Let a(n) = n2 - n - 2. Let z be a(3). Solve -zr = -5g + 11, r = sg - 3r - 2 for g. 3 Suppose -4 = -4x, -q + 5q - 87 = x. Solve 5y + 4 + 1 = -2c, 5c + 3y = -q for c. -5 Suppose 5g - 61 = -5m - 26, m = 2g + 4. Let w(y) = y*2 + 8y - 4. Let v be w(-8). Let j = m + v. Solve z - 4x + 19 = 0, -6z + jz + 4 = 4x for z. -3 Suppose -4p = -75 + 31. Let h = p - 9. Let v be -52(-1)/h. Solve 3i + 3c - 9 = 0, -5i = 4c - 6 - v for i. -1 Let r(u) = -u2 + 7u - 2. Let h be r(6). Solve hc + 3 = -v, -14 - 9 = -c - 5v for c. -2 Suppose -2q - 3q + 5 = 0. Let u = q - -1. Let i be (14/(-7))/((-1)/u). Solve 2d - 4c - 22 = 0, id + d + 4c = -15 for d. 1 Let j = -7 - -7. Suppose -4k - 16 = j, 0 = -2z + 3z - 5k - 24. Solve 7r + 19 = 3r - 3b, 0 = -zr + 2b + 6 for r. -1 Let t be (21/6 - 3)4. Solve 0 = -tz - 4a - 16, -4a = -4z - 2a + 18 for z. 2 Suppose -2y = -8y + 192. Solve 4x + 0q + 5q = -1, -5x + 4q = y for x. -4 Suppose 4r = -o + 4, r + 2r - 3 = 5o. Solve 0 = -5x + x - 8, -2b - 2x - 8 = o for b. -2 Suppose -3b + 17 - 5 = 0. Solve -s = -q - 6, 0s = 2s + bq for s. 4 Suppose -77 = -4a - 21. Suppose c = -3h - 2h + a, -2h - 5c = -24. Solve -4m - hx - 4 = 0, 2m + 0x = -4x + 10 for m. -3 Let b = -42 - -45. Solve -5n - k + 24 = 0, bn - k - 7 = 1 for n. 4 Suppose -5u + 10 = -0u. Solve -uo + 7 = -y + 16, y + 12 = -5o for o. -3 Suppose 5i + 40 = 3d, 0i + 5i + 50 = 5d. Let t(g) = -g2 + 5g + 4. Let h be t(d). Solve 2j + 0j = 2v + 4, 0 = 3j - hv - 11 for j. -3 Let x(a) = -3a + 2a2 + 0 + 2 + 1. Let l be x(2). Let m be (-10)/(-30)(-9)/(-1). Solve 0f - f = -lc - 7, mf - 10 = 4c for c. -1 Let k = 0 - -2. Let l(j) = j + 5. Let p be l(-3). Solve -ko - 3o - 7 = -pf, -o + 13 = -4f for f. -4 Let t = 21 + -16. Solve 4g = -3j + 5g - 4, tg = 5j + 20 for j. 0 Let y(d) = -3d + 32. Let k be y(9). Solve -4x = f - 1, 10f = 4x + kf + 29 for x. -1 Let t(h) = h*2 + 4h - 1. Let d be t(-5). Solve b - 15 = -dl, 0l + 5b = -5l for l. 5 Let o(f) = f. Let q(k) = -k*2 - 3k - 2. Let h(x) = o(x) - q(x). Let s be h(-4). Solve -sg + 2 = 0, -3c + 14 = 2c + 4g for c. 2 Let w(z) = 3z2 + 8z + 2. Let k be w(-3). Let o be (-12)/(-3)(-6)/(-8). Solve 5h - k = 0, oh + 0h = 4n + 15 for n. -3 Suppose -3u = -57 + 21. Let f = u + -8. Solve -4l - 8 = -4h, -fl - 24 = h + 3h for h. -2 Let k(z) = -3z3 - 3z*2 - 3z - 2. Let n(d) = d*2 + d + 1. Let j(f) = k(f) + 3n(f). Let q be j(-1). Solve -4b + u = -5, 0b = -b + 2u - q for b. 2 Suppose -26 = -2l - 8. Let f(z) = -z*3 + 10z*2 - 7z - 13. Let o be f(l). Solve x = -ov - 28, -v + 5x = v - 5 for v. -5 Let i = 4 - 0. Suppose -im + 3w + 2w = -2, 2 = 2m - 2w. Let c(g) = -g2 + 7g - 7. Let s be c(5). Solve -5t - 13 = 2a, t = 3t + ma + s for t. -3 Let w(f) = f*3 - 5f*2 + f + 2. Let t = -2 + 7. Let y be w(t). Solve -3g = -2d - y, 0d + 2 = -d for g. 1 Suppose -3j - 35 + 71 = 0. Let g = -3 + 5. Solve 6 = 4z + 5b, -gz - 2b + 7b - j = 0 for z. -1 Let n(g) = g2 - g. Let w be n(-1). Let v(t) = t + tw - t - 3t + 3. Let u be v(3). Solve -3q + 2 = -f + u, 4q = 4f + 12 for f. -5 Suppose 4b + 100 = 4a, -3b + b = 2. Suppose -2 + 6 = -4i, 0 = -4r + 4i + a. Solve -rt = 5h + 5, -3t - 4h = h + 11 for t. 3 Let n(j) = j*2 - 7j + 5. Let z be n(4). Suppose 5q - 35 = -0q. Let y = q + z. Solve -3b + 14 = 5r - yb, b - 2 = -r for r. 4 Let z be (0 - 0)/(8 + -7). Solve 4o + 20 = 2n, 4n = 3o - zo + 15 for o. -5 Let y be 6 + -2 - (4 - 2). Suppose -8z = -6z - 4. Solve zk - 4o + 4 = -2k, -yk + 10 = 4o for k. 1 Let o(g) = -2g + 1. Let p be o(-2). Let x be 110/25 - 2/5. Let c be (-1)/((-76)/(-20) - x). Solve -pk = -5i + c, -i - k = 2i - 11 for i. 3 Suppose -4g = 5k + 16, -5g + k = -2k - 17. Let n be (-14)/(-3)(-30)/(-35). Let c be 36/8(n + -2). Solve -3z + m + c = 0, -3m = -4z + 2m + g for z. 4 Let z(x) = x2 - 6x + 15. Let r be z(6). Let l be r/6 + (-1)/2. Solve -6 = -2j, -3c + lj - 16 = -c for c. -5 Suppose -3r - 2 = 2d, -2r + r + 1 = -d. Solve 0i = -5i - 5l, -3l - 3 = r for i. 1 Suppose -5a - 3s + 21 = 0, 3a + 2s - 19 = -2a. Suppose 0 = -3h + au + 9, u = -h - 0u + 5. Solve 3m + 11 = hv, 2v + 4m + 21 = v for v. -1 Suppose 0 = 2z + 11 - 29. Let r = z - 6. Solve b - 3 = -p, 10 = rb - 0b + 4p for b. 2 Let n(v) = v*3 + 5v*2 + 4v - 1. Let m be n(-3). Suppose mw - 14 - 1 = 0. Solve -i - 4y + 0 = 2, wi - y + 6 = 0 for i. -2 Suppose 0k - 6 = -3m + k, -4k + 12 = 0. Solve mq = 5u - 28, 0u - 2q + 18 = 4u for u. 5 Let z(x) = -x2 + 6x. Let l be z(6). Solve 4u + 16 = h + 1, l = u - 5h - 20 for u. -5 Let r = -18 + 11. Let j = r + 11. Suppose -jm + 8 + 0 = 0. Solve -z = mz + 2p + 4, -2z + 3p = -19 for z. 2 Suppose -3g = -4w - 10, 3 = w - 2. Solve 4o + 3v = g, -3o - 3v + 0 = -9 for o. 1 Let o be (80/24)/(1/3). Let g be (140/(-21))/(1/(-3)). Solve -2t = o, -d - 5t = -t + g for d. 0 Suppose 0k - 3k + o = -3, -4k = 4o - 20. Solve -t = kp - 5, -2t - p = -4t + 5 for t. 3 Let c(y) = y*2 - y - 1. Let o be c(-1). Let i be o - (1 - 0)0. Suppose -i = j - 3. Solve 0 = -3w + jt + 7, 3t - 8 = 3w + 4t for w. -1 Suppose 0 = -6q + 3q. Let a(k) = 3k + 16. Let v be a(-7). Let z be q(v/(-2))/5. Solve -4 = 3m - 2y, 2m + zy = 2y for m. -4 Suppose 4p = 10 + 2. Suppose -j + 2q = -pq + 22, -15 = -3q. Let a be (2j)/(-2 + 4). Solve 3u + 5f = -6, u + af - 4f + 2 = 0 for u. -2 Suppose 0 = -5k + 3r + 68, k + 3r = -0k + 28. Solve 0 = -4p - 4v - k, -4v = -2p - 6 - 2 for p. -4 Let m = 7 + -8. Let d be (4/5)/(m/(-5)). Solve -dg - 2b - 24 = 0, 0b - 4 = -2g + 3b for g. -4 Let j(v) = v*2 - 11v + 5. Let t be j(7). Let n = t + 43. Suppose 4c - 5 = 3k - 21, -9 = -k + 5c. Solve 2r - n = 2p - k, -2r - p + 7 = 0 for r. 5 Let h(u) = u*3 - 6u*2 + 2. Let l be h(6). Let z = -98 + 148. Suppose a + z = 3a. Solve 14 = 2g - 2x, -l = -g + 5x + a for g. 2 Let z be (3/(-9))/((-3)/45). Let k be ((-2)/z)/(3/(-150)). Let f be 16/(-6)3/(-2). Solve 2m = 4, -fm + 3 = -5w - k for w. -3 Let s = 0 + -4. Let w be 1/2-1s. Suppose 0 = 5m + 5k - 45, -4m + 2k = 3k - 21. Solve -wz + 6 = p - 6p, -mp + 15 = 5z for z. 3 Let h = 45 + -42. Solve -2r - hr - 4 = -a, -3r + 2a = 1 for r. -1 Suppose -10 + 25 = 5p. Suppose 2t - 3t = -4. Solve 3a - 4o - 3 = -0, ta = po + 4 for a. 1 Suppose 3o = -z - 3z - 2, 4z + 10 = o. Solve 8 = om - 2q, -4 = 2m + 3q - 2 for m. 2 Let n(x) = -x + 10. Let a be n(7). Solve -5m + 0q + 35 = -2q, 4q + 35 = am for m. 5 Suppose -5d - 2x + 54 = 0, 2x + 0x + 26 = 3d. Solve 2c - b - 4 = d, -6 = -2c - b for c. 5 Suppose -r + 0r + 22 = 0. Solve -5w = 5q - 30, -w - 2w + 5q = r for w. 1 Let w(f) = f2 - 3f - 5. Let x be w(5). Solve -1 = a - 0, -5d = -xa - 30 for d. 5 Let a = 14 - 10. Suppose q - a = -q. Solve qg + 31 = -0g - 5r, 2r + 10 = 0 for g. -3 Let i be 5 - (4 - (4 + -2)). Suppose 5 = iy - 16. Let b(k) = k2 - 4k - 7. Let g be b(6). Solve -u - 5a = 6, 0 = gu + 2a - ya - 30 for u. 4 Let t be ((-6)/2)/(3/(-4)). Suppose -tp + 5n = -12 + 2, 2n = p - 1. Solve 0 = pb + 15, 3z = -3b + 7b + 27 for z. 5 Let n(w) = w3 + 8w*2 + 8w + 10. Let k(x) = x*2 + 10x + 14. Let c be k(-7). Let l be n(c). Solve 2i = -d - l, 4d = 5d - 2i - 5 for d. 1 Let n(c) = c*3 + 2c*2 - 6c - 5. Let o be n(-3). Solve 0u - 4u = 4v + 20, 0 = -2v + ou + 14 for v. -1 Let c = -32 + 51. Solve t - 3n - 17 = -t, 4t - n - c = 0 for t. 4 Let g = 333 + -330. Let k be (-1 + (0 - -1))-1. Let r be (2 - (1 + k)) + 3. Solve g*	{ "pile_set_name": "DM Mathematics" }
r + 8732m*2 + mr*2 - 31mr - r + 2 wrt m? 6r*2 + 145529268r Find the second derivative of 17939z3 + 56z*2 - 35393z - 138 wrt z. 107634z + 112 Find the third derivative of -20499709v*5 - 2v*3 - 11334274v*2. -1229982540v*2 - 12 Differentiate -4j*3mo + 57580j*3o - 341130j2m - jmo - 358o wrt m. -4j*3o - 341130j2 - jo Find the third derivative of -1787377j4 - 2j*3 + 3391j*2 - 36j. -42897048j - 12 Differentiate 64710891y*2 - 3684239. 129421782y Find the second derivative of -44788330a3 + 73711829a. -268729980a What is the third derivative of 56bq4 + 2bq3 - 96454bq2 - q4 - 6q3 + q2 + 2q wrt q? 1344bq + 12b - 24q - 36 What is the first derivative of -16b*2x + 18b2 + 17bx + 9b + 192362x + 1194 wrt b? -32bx + 36b + 17x + 9 Differentiate -648261720c*3 - 582986136. -1944785160c*2 What is the first derivative of -9988307u + 2671556? -9988307 Find the first derivative of -2bg*3 + 42bg - 12906897b - 1520g wrt g. -6bg2 + 42b - 1520 What is the second derivative of -466524549d2 + 365230938d? -933049098 What is the third derivative of 4661586s3 + 1529427s*2 wrt s? 27969516 What is the third derivative of -387p*4q + 50717p4 + 3p*3q + 330p2 - 5pq + 3p + 102q - 3 wrt p? -9288pq + 1217208p + 18q Differentiate 1171898v*4 - 2v*3 + 2v*2 + 27612102 with respect to v. 4687592v*3 - 6v*2 + 4v What is the third derivative of 7k3r3 - k3r2 - 80k*3 + 4k*2r*3 + 18k*2 + 20459kr3 - 3k + 10 wrt r? 42k3 + 24k*2 + 122754k What is the first derivative of -5n3 - 397508n*2 + 11473751 wrt n? -15n*2 - 795016n Differentiate -350238bs*2 - 20940327b + 232s3 - 2 with respect to s. -700476bs + 696s*2 Differentiate -4v*3 - 172522v - 818854 wrt v. -12v2 - 172522 What is the second derivative of 257d*4 + 236818d*3 - 94700d + 66? 3084d2 + 1420908d What is the derivative of -12427463d3 + 373587 wrt d? -37282389d*2 What is the second derivative of -15951199p*2 + 10139204p + 1 wrt p? -31902398 Differentiate 13hi*2 + 67hir*2 - 22hr2 + 2h - 61ir*2 + 194r*2 + 6r - 3 wrt i. 26hi + 67hr*2 - 61r*2 Find the first derivative of -2dp3 - 129dp + 908d + 15719p3 + 757 wrt d. -2p*3 - 129p + 908 What is the first derivative of 8359p3v*3 - 364821400p*3 + 19588pv4 wrt v? 25077p*3v*2 + 78352pv3 What is the derivative of -131201fj - 869174f + 558j - 59 wrt j? -131201f + 558 What is the first derivative of -26343339q2 + 106759294 wrt q? -52686678q Find the second derivative of 365184d3 + 14d*2o - 272do - 28d + 4o - 233 wrt d. 2191104d + 28o What is the derivative of 5ci + 4700cr + 17381c - 857ir + 97 wrt r? 4700c - 857i What is the third derivative of -20r*3u*4 + 7273r*3u - 272740u3 - 168u*2 wrt u? -480r*3u - 1636440 What is the third derivative of 27590157h6 - 90h*2 - 133710h wrt h? 3310818840h3 Find the second derivative of -t4 + 1066t*3 - 1675t*2 + 9607956t. -12t2 + 6396t - 3350 Find the third derivative of 77447538m5 + 20307693m*2 wrt m. 4646852280m*2 What is the second derivative of 28171a*4 + 14a*3 + 16a*2 + 2a + 128024838 wrt a? 338052a2 + 84a + 32 What is the first derivative of 27093787q2r*3 - 5q*2r2 + q2 - 2655q - 173 wrt r? 81281361q*2r*2 - 10q*2r Differentiate -4is*3 - 164531306i - 8177669s4 wrt s. -12is2 - 32710676s*3 Find the second derivative of -10dm3 - 2dm2 - 2dm - 3493d + 385m3 + 867m*2 - 29m + 3 wrt m. -60dm - 4d + 2310m + 1734 Find the first derivative of 16170820f2 + 28287902. 32341640f Find the first derivative of -10r3u - 125r3 - 1893r*2u*2 - 2r*2 + 966r + 301u2 wrt u. -10r*3 - 3786r*2u + 602u Find the third derivative of -714kst*4 + 1602kst*3 - 6kst*2 - 2kst - kt2 + kt - 2st*2 + 3t*4 - 8299t + 19 wrt t. -17136kst + 9612ks + 72t Find the second derivative of 30052193p2s*2 + 200p - 72976s2 wrt p. 60104386s*2 What is the second derivative of -180525m*4 - 5m*2 - 5674m + 427 wrt m? -2166300m2 - 10 What is the third derivative of 20c*5 - 18408c*3 + 9416571c*2 wrt c? 1200c*2 - 110448 What is the derivative of 91351966lu - 1001l + 86468 wrt u? 91351966l What is the derivative of 4iq3 - 3iq + 27946190i + 4q2 - 19432q wrt q? 12iq*2 - 3i + 8q - 19432 What is the third derivative of -218452j*4k*3 + 6j*4k - 401j2k*2 + 2jk3 + 712k*3 wrt j? -5242848jk3 + 144jk What is the first derivative of 780952k*3v*3 + 2903k*3 - 2k*2 - 11k + 5v3 - 10 wrt v? 2342856k*3v*2 + 15v2 What is the third derivative of -g3j2 + 1709g*3j - 87g3 + 4g*2j + 661gj*2 + 2734j wrt g? -6j2 + 10254j - 522 Find the second derivative of 2u5 + 10377u*3 + 1213u*2 + 198373338u wrt u. 40u3 + 62262u + 2426 Find the third derivative of 10p4 + 6367812p*3 - 29p*2 + 58805p wrt p. 240p + 38206872 Differentiate -542u*4 - 2384u - 152839841 with respect to u. -2168u3 - 2384 What is the second derivative of 86f*4 - 47138f*2 + 480f - 7709 wrt f? 1032f2 - 94276 Differentiate 156g*2o - 55g2 - 973g - 93660679o with respect to g. 312go - 110g - 973 What is the third derivative of -1485j2l*3 - 15j*2l + 575jl*3 - 1400jl - 60l*2 wrt l? -8910j*2 + 3450j What is the first derivative of -6671161w3 + 19187622? -20013483w*2 Differentiate -19dg2x - dg - 4drx + 6051g3rx + g3x - g*2x + 1537g2 + gx - rx wrt r. -4dx + 6051g*3x - x Differentiate -5793w3 + 1497w + 318681133 wrt w. -17379w2 + 1497 What is the second derivative of 22i*3o*3 - 2i*3 + 323i*2o*3 + io*3 + 34io + 1849o*3 + 5o wrt i? 132io*3 - 12i + 646o3 What is the first derivative of yz*2 + 2460949y + 27103086z3 + 30 wrt z? 2yz + 81309258z*2 Find the third derivative of -36925305b*3 + 2b*2 - 376786. -221551830 Find the second derivative of 420679344h*2 - 488688844h wrt h. 841358688 Find the first derivative of -2klz3 + 4414329kl - 12lz2 + 5lz + 2z*3 - 28235 wrt k. -2lz3 + 4414329l Find the third derivative of 4045616c3 + 30057418c*2 wrt c. 24273696 Differentiate -114279782g*2 - 2g + 301967272. -228559564g - 2 Find the second derivative of 819763w*4 - 4797w + 465. 9837156w2 Differentiate 38r*2x + 461146379r2 + 47rx - 16856x with respect to x. 38r2 + 47r - 16856 What is the first derivative of 9871946r - 13396116? 9871946 What is the second derivative of -472476913g*5 + 1244279g - 200 wrt g? -9449538260g3 What is the third derivative of -138208863t*5 + 9t*2 - 4035106? -8292531780t*2 Find the first derivative of -4b*2y - 755244b2 - 56407y - 162 wrt b. -8by - 1510488b Find the first derivative of 65943256p + 59806198. 65943256 Differentiate -63ps + 3822412p + 9997s*2 wrt s. -63p + 19994s Find the first derivative of 640259889p*2 + 167443833 wrt p. 1280519778p Find the second derivative of 4rw*3 + 2673rw + 1200w*3 + 464w*2 + 242w + 17 wrt w. 24rw + 7200w + 928 Find the first derivative of -dil + 122di + 142dl - 1902d + 3il - 846i + 3 wrt i. -dl + 122d + 3l - 846 What is the second derivative of 288684567f2 + 103152106f? 577369134 Find the third derivative of -1051y5 + 193y*4 - 2y*3 + 3647805y*2 wrt y. -63060y*2 + 4632y - 12 What is the second derivative of 184786538g2 + 571416390g? 369573076 Find the first derivative of -2dj*2 - dj - 102d - 16022j*2 + j + 160182 wrt j. -4dj - d - 32044j + 1 What is the second derivative of 19127611t5 - 1147t - 508 wrt t? 382552220t3 Find the second derivative of -17b*2ly - 556b*2l - 140b2y*3 - 2bly + 8bl - 2by*3 + 15991ly3 + 2y*3 wrt b. -34ly - 1112l - 280y3 What is the third derivative of -17652329p*4 - 445326p*2 - 25? -423655896p Find the second derivative of 21683109s5 - 44537129s. 433662180s3 What is the second derivative of 12k*2z*3 - 986k*2z - 267k2 - 60k*	{ "pile_set_name": "DM Mathematics" }
7 is divided by 23? 19 Calculate the remainder when 1744 is divided by 134. 2 What is the remainder when 316 is divided by 24? 4 What is the remainder when 76 is divided by 16? 12 What is the remainder when 2010 is divided by 1005? 0 Calculate the remainder when 6 is divided by 2. 0 What is the remainder when 2172 is divided by 60? 12 Calculate the remainder when 300 is divided by 143. 14 What is the remainder when 860 is divided by 47? 14 Calculate the remainder when 36 is divided by 9. 0 Calculate the remainder when 1002 is divided by 59. 58 What is the remainder when 456 is divided by 155? 146 What is the remainder when 9 is divided by 6? 3 Calculate the remainder when 93 is divided by 29. 6 Calculate the remainder when 3274 is divided by 52. 50 Calculate the remainder when 667 is divided by 22. 7 Calculate the remainder when 1678 is divided by 23. 22 Calculate the remainder when 8948 is divided by 24. 20 Calculate the remainder when 892 is divided by 149. 147 What is the remainder when 368 is divided by 7? 4 What is the remainder when 195 is divided by 20? 15 What is the remainder when 427 is divided by 134? 25 What is the remainder when 341 is divided by 80? 21 What is the remainder when 2268 is divided by 134? 124 Calculate the remainder when 390 is divided by 194. 2 What is the remainder when 67 is divided by 23? 21 Calculate the remainder when 547 is divided by 504. 43 Calculate the remainder when 717 is divided by 103. 99 What is the remainder when 220 is divided by 181? 39 What is the remainder when 80 is divided by 44? 36 Calculate the remainder when 34 is divided by 19. 15 What is the remainder when 97 is divided by 53? 44 What is the remainder when 5103 is divided by 176? 175 Calculate the remainder when 419 is divided by 47. 43 Calculate the remainder when 185 is divided by 11. 9 Calculate the remainder when 118 is divided by 87. 31 What is the remainder when 1685 is divided by 421? 1 What is the remainder when 934 is divided by 306? 16 What is the remainder when 232 is divided by 47? 44 Calculate the remainder when 681 is divided by 217. 30 Calculate the remainder when 1234 is divided by 603. 28 Calculate the remainder when 414 is divided by 166. 82 Calculate the remainder when 663 is divided by 12. 3 Calculate the remainder when 627 is divided by 101. 21 Calculate the remainder when 547 is divided by 50. 47 What is the remainder when 178 is divided by 68? 42 Calculate the remainder when 130 is divided by 58. 14 What is the remainder when 192 is divided by 35? 17 Calculate the remainder when 1536 is divided by 253. 18 Calculate the remainder when 560 is divided by 279. 2 What is the remainder when 2657 is divided by 141? 119 Calculate the remainder when 1534 is divided by 746. 42 Calculate the remainder when 177 is divided by 36. 33 What is the remainder when 141 is divided by 25? 16 Calculate the remainder when 77 is divided by 40. 37 What is the remainder when 692 is divided by 7? 6 Calculate the remainder when 906 is divided by 440. 26 Calculate the remainder when 6711 is divided by 18. 15 What is the remainder when 61 is divided by 48? 13 What is the remainder when 128 is divided by 10? 8 Calculate the remainder when 1440 is divided by 238. 12 Calculate the remainder when 39 is divided by 7. 4 What is the remainder when 765 is divided by 64? 61 Calculate the remainder when 1180 is divided by 386. 22 What is the remainder when 452 is divided by 12? 8 Calculate the remainder when 450 is divided by 46. 36 Calculate the remainder when 419 is divided by 53. 48 Calculate the remainder when 56 is divided by 25. 6 Calculate the remainder when 307 is divided by 49. 13 What is the remainder when 356 is divided by 348? 8 Calculate the remainder when 957 is divided by 60. 57 What is the remainder when 374 is divided by 101? 71 Calculate the remainder when 537 is divided by 41. 4 What is the remainder when 926 is divided by 31? 27 Calculate the remainder when 2442 is divided by 15. 12 What is the remainder when 303 is divided by 45? 33 What is the remainder when 2043 is divided by 137? 125 Calculate the remainder when 12 is divided by 9. 3 What is the remainder when 56 is divided by 35? 21 What is the remainder when 255 is divided by 13? 8 Calculate the remainder when 130 is divided by 97. 33 What is the remainder when 368 is divided by 11? 5 Calculate the remainder when 73169 is divided by 18. 17 Calculate the remainder when 281 is divided by 72. 65 What is the remainder when 211 is divided by 87? 37 Calculate the remainder when 710 is divided by 710. 0 What is the remainder when 24 is divided by 7? 3 What is the remainder when 634 is divided by 11? 7 What is the remainder when 272 is divided by 59? 36 Calculate the remainder when 1582 is divided by 9. 7 Calculate the remainder when 857 is divided by 72. 65 What is the remainder when 203 is divided by 5? 3 What is the remainder when 105 is divided by 17? 3 Calculate the remainder when 2063 is divided by 43. 42 What is the remainder when 37 is divided by 8? 5 What is the remainder when 1935 is divided by 22? 21 Calculate the remainder when 160 is divided by 10. 0 Calculate the remainder when 199 is divided by 32. 7 Calculate the remainder when 341 is divided by 48. 5 What is the remainder when 27 is divided by 15? 12 Calculate the remainder when 623 is divided by 18. 11 Calculate the remainder when 257 is divided by 29. 25 Calculate the remainder when 856 is divided by 39. 37 What is the remainder when 371 is divided by 12? 11 What is the remainder when 376 is divided by 95? 91 Calculate the remainder when 373 is divided by 116. 25 Calculate the remainder when 436 is divided by 345. 91 What is the remainder when 256 is divided by 65? 61 What is the remainder when 2497 is divided by 139? 134 Calculate the remainder when 638 is divided by 107. 103 What is the remainder when 5712 is divided by 1902? 6 What is the remainder when 461 is divided by 14? 13 What is the remainder when 55 is divided by 14? 13 Calculate the remainder when 84 is divided by 11. 7 What is the remainder when 1652 is divided by 326? 22 Calculate the remainder when 4418 is divided by 67. 63 What is the remainder when 634 is divided by 23? 13 What is the remainder when 868 is divided by 97? 92 What is the remainder when 271 is divided by 69? 64 Calculate the remainder when 1406 is divided by 229. 32 What is the remainder when 439 is divided by 106? 15 Calculate the remainder when 4744 is divided by 2357. 30 What is the remainder when 8433 is divided by 111? 108 Calculate the remainder when 228 is divided by 146. 82 Calculate the remainder when 125 is divided by 35. 20 What is the remainder when 2626 is divided by 53? 29 Calculate the remainder when 195 is divided by 65. 0 Calculate the remainder when 5650 is divided by 22. 18 What is the remainder when 960 is divided by 14? 8 Calculate the remainder when 450 is divided by 113. 111 Calculate the remainder when 717 is divided by 32. 13 Calculate the remainder when 1278 is divided by 146. 110 Calculate the remainder when 123 is divided by 54. 15 Calculate the remainder when 1968 is divided by 152. 144 Calculate the remainder when 1343 is divided by 269. 267 What is the remainder when 346 is divided by 172? 2 Calculate the remainder when 129 is divided by 66. 63 What is the remainder when 923 is divided by 28? 27 What is the remainder when 347 is divided by 12? 11 Calculate the remainder when 179 is divided by 15. 14 What is the remainder when 126 is divided by 76? 50 What is the remainder when 46967 is divided by 14? 11 What is the remainder when 114 is divided by 50? 14 Calculate the remainder when 55 is divided by 19. 17 What is the remainder when 2537 is divided by 94? 93 What is the remainder when 321 is divided by 63? 6 What is the remainder when 136 is divided by 89? 47 What is the remainder when 584 is divided by 576? 8 Calculate the remainder when 104 is divided by 9. 5 What is the remainder when 2256 is divided by 61? 60 Calculate the remainder when 2191 is divided by 309. 28 Calculate the remainder when 5448 is divided by 116. 112 Calculate the remainder when 18 is divided by 6. 0 Calculate the remainder when 7325 is divided by 1828. 13 Calculate the remainder	{ "pile_set_name": "DM Mathematics" }
er when 26377 is divided by 1448. 313 Calculate the remainder when 846038 is divided by 3540. 3518 What is the remainder when 3347190 is divided by 290? 10 What is the remainder when 146717 is divided by 171? 170 What is the remainder when 233624157 is divided by 3360? 3357 What is the remainder when 208959 is divided by 10995? 54 Calculate the remainder when 1500292 is divided by 4464. 388 Calculate the remainder when 3537858 is divided by 13. 12 What is the remainder when 4902411 is divided by 132488? 355 Calculate the remainder when 14812332 is divided by 8. 4 What is the remainder when 2260795 is divided by 141263? 587 What is the remainder when 7724465 is divided by 27? 8 What is the remainder when 26233315 is divided by 728701? 79 What is the remainder when 266712 is divided by 100? 12 Calculate the remainder when 100830 is divided by 1975. 105 Calculate the remainder when 15671 is divided by 3165. 3011 What is the remainder when 18812 is divided by 72? 20 Calculate the remainder when 361857 is divided by 4065. 72 What is the remainder when 101843 is divided by 1061? 1048 Calculate the remainder when 29618088 is divided by 9493. 9421 What is the remainder when 807930 is divided by 134655? 0 Calculate the remainder when 868383 is divided by 289454. 21 What is the remainder when 272589 is divided by 3585? 129 Calculate the remainder when 22005 is divided by 300. 105 Calculate the remainder when 3622064 is divided by 36. 32 Calculate the remainder when 58520 is divided by 5851. 10 What is the remainder when 364677 is divided by 52094? 19 What is the remainder when 11445597 is divided by 456? 453 What is the remainder when 173821 is divided by 249? 19 What is the remainder when 113310 is divided by 891? 153 Calculate the remainder when 172238 is divided by 508. 26 Calculate the remainder when 3333696 is divided by 21. 9 What is the remainder when 18890968 is divided by 1479? 1180 Calculate the remainder when 719564 is divided by 1831. 1812 Calculate the remainder when 29516474 is divided by 1209. 1157 Calculate the remainder when 720482 is divided by 101. 49 Calculate the remainder when 11920344 is divided by 655. 654 What is the remainder when 339626787 is divided by 36? 15 Calculate the remainder when 14409253 is divided by 1747. 1744 Calculate the remainder when 8855923 is divided by 2617. 2612 Calculate the remainder when 12068843 is divided by 204. 203 What is the remainder when 339544 is divided by 1698? 1642 Calculate the remainder when 599658 is divided by 149888. 106 Calculate the remainder when 12584798 is divided by 800. 798 What is the remainder when 39891067 is divided by 4432338? 25 Calculate the remainder when 1642367 is divided by 160. 127 Calculate the remainder when 15197 is divided by 14205. 992 Calculate the remainder when 75951845 is divided by 1253. 1250 What is the remainder when 988333 is divided by 494157? 19 Calculate the remainder when 24899 is divided by 1025. 299 What is the remainder when 113277493 is divided by 1529? 1528 What is the remainder when 10865266 is divided by 5592? 10 Calculate the remainder when 74594779 is divided by 136. 3 Calculate the remainder when 5269038 is divided by 2634459. 120 Calculate the remainder when 4372688 is divided by 101. 95 Calculate the remainder when 724492 is divided by 119. 20 Calculate the remainder when 278384 is divided by 226. 178 What is the remainder when 160658546 is divided by 5682? 5678 Calculate the remainder when 1055579 is divided by 522. 95 What is the remainder when 119210104 is divided by 3506179? 18 Calculate the remainder when 172645 is divided by 19165. 160 Calculate the remainder when 1186022 is divided by 169417. 103 What is the remainder when 217690091 is divided by 424? 11 Calculate the remainder when 935435 is divided by 233434. 1699 What is the remainder when 43930884 is divided by 39? 36 What is the remainder when 161995 is divided by 1906? 1891 Calculate the remainder when 2509948 is divided by 18455. 68 What is the remainder when 3832156 is divided by 479018? 12 Calculate the remainder when 53635330 is divided by 15320. 10 Calculate the remainder when 7692800 is divided by 1603. 3 What is the remainder when 76089 is divided by 14? 13 Calculate the remainder when 1523507 is divided by 270. 167 What is the remainder when 188519227 is divided by 32? 27 What is the remainder when 513634 is divided by 511026? 2608 What is the remainder when 39514264 is divided by 90? 34 What is the remainder when 1459467 is divided by 40540? 27 Calculate the remainder when 1770865 is divided by 1769925. 940 Calculate the remainder when 6252 is divided by 5655. 597 What is the remainder when 38740 is divided by 3864? 100 Calculate the remainder when 11228615 is divided by 15815. 15780 Calculate the remainder when 908728 is divided by 3720. 1048 Calculate the remainder when 32474 is divided by 8086. 130 What is the remainder when 1789093 is divided by 77782? 107 What is the remainder when 59671 is divided by 4232? 423 Calculate the remainder when 16367653 is divided by 2947. 15 Calculate the remainder when 532336 is divided by 8586. 4 What is the remainder when 1193792 is divided by 1010? 982 Calculate the remainder when 10001064 is divided by 63701. 7 What is the remainder when 120955 is divided by 2420? 2375 Calculate the remainder when 2103766 is divided by 11953. 38 What is the remainder when 4739309 is divided by 1579767? 8 What is the remainder when 2089260 is divided by 1721? 1687 What is the remainder when 11229215 is divided by 636? 635 Calculate the remainder when 3547056 is divided by 2673. 2658 What is the remainder when 8154785 is divided by 17? 4 What is the remainder when 1299667 is divided by 2221? 382 Calculate the remainder when 84723 is divided by 2573. 2387 Calculate the remainder when 199983 is divided by 1840. 1263 Calculate the remainder when 31318 is divided by 4446. 196 Calculate the remainder when 41527184 is divided by 574. 6 What is the remainder when 4907558 is divided by 1536? 38 What is the remainder when 7498974 is divided by 605? 604 Calculate the remainder when 69127 is divided by 5914. 4073 What is the remainder when 1647584 is divided by 119? 29 What is the remainder when 148823069 is divided by 290? 289 What is the remainder when 9393966 is divided by 71? 27 Calculate the remainder when 1135340 is divided by 6839. 66 Calculate the remainder when 50655785 is divided by 200. 185 What is the remainder when 941808 is divided by 232? 120 What is the remainder when 529715 is divided by 34? 29 What is the remainder when 3540830 is divided by 1637? 1636 What is the remainder when 699905 is divided by 8334? 8183 What is the remainder when 175944 is divided by 58635? 39 What is the remainder when 360807 is divided by 757? 475 Calculate the remainder when 12779691 is divided by 655. 641 Calculate the remainder when 500132 is divided by 169. 61 Calculate the remainder when 2092772 is divided by 21. 17 Calculate the remainder when 8231882 is divided by 1371924. 338 What is the remainder when 110454 is divided by 1939? 1870 Calculate the remainder when 1722426 is divided by 17. 3 What is the remainder when 8165737 is divided by 50? 37 Calculate the remainder when 13774342 is divided by 687. 679 What is the remainder when 779632 is divided by 11812? 40 What is the remainder when 35032 is divided by 473? 30 What is the remainder when 5809593 is divided by 1033? 1 Calculate the remainder when 49603 is divided by 190. 13 What is the remainder when 10943823 is divided by 5815? 5808 What is the remainder when 38695 is divided by 6411? 229 What is the remainder when 1182557 is divided by 80? 77 Calculate the remainder when 370682 is divided by 1005. 842 What is the remainder when 83521 is divided by 212? 205 What is the remainder when 27189873 is divided by 27189864? 9 Calculate the remainder when 1875524 is divided by 293. 31 What is the remainder when 1828967302 is divided by 1018? 1016 What is the remainder when 404660230 is divided by 35? 30 Calculate the remainder when 15446749 is divided by 7. 3 What is the remainder when 332951 is divided by 41599? 159 What is the remainder when 32531228 is divided by 3044? 0 Calculate the remainder when 2091	{ "pile_set_name": "DM Mathematics" }
2)(p(-5)/p)/p0 assuming p is positive. p(-7/2) Simplify q23/(q/(qqq(-10))qq) assuming q is positive. q12 Simplify (f(-1/2)/f)11((ff(-1))/ff)(7/5) assuming f is positive. f(-33/2) Simplify o/((oo/o(-2/31))/oo)(((o(3/5)o)/o)/o)/o assuming o is positive. o(-382/155) Simplify p(-14)p(-1/60) assuming p is positive. p(-841/60) Simplify mm*(3/5)mmm/((mm/m(-2/61))/m)m assuming m is positive. m*(1393/305) Simplify tt*(-1)t(tt*(-2/7)t)/t((t/(t/((t(1/2)tt)/t)))/t)/t(-1/6) assuming t is positive. t(50/21) Simplify (s2(ss(-6)s)/s)(7/5) assuming s is positive. s(-21/5) Simplify ((ww/(w/(www(-9/4)ww)))/w)/w(2/23) assuming w is positive. w(153/92) Simplify (b1)(-1/8)/(((b/(bb/(b/b*(-1/2))))/b)/bb5) assuming b is positive. b(-29/8) Simplify (n(-1)/n(-1))/((nn(1/9)nn)/nn/n(-3/7)) assuming n is positive. n(-223/63) Simplify t*(-2/35)(t*(-36)tt)/t assuming t is positive. t(-1227/35) Simplify (vv/v*17v)/vvv/((v(v(v*(-10/13)v)/v)/v)/v) assuming v is positive. v(-159/13) Simplify (k(9/7)k)/kk(-2/13) assuming k is positive. k(103/91) Simplify (tt/(t(-1)t))*(10/13)((t/t(-2/7))/t)/((t/t(-8))/t) assuming t is positive. t*(-562/91) Simplify (ii/i(-7))/(i(-22)ii) assuming i is positive. i29 Simplify ((y(-2)/y)/y)(-1/13)/(y(-1)/yyy0) assuming y is positive. y(17/13) Simplify (z*(-1/2)zz)(3/5)((zz(2/3)z)/z)(14/11) assuming z is positive. z(997/330) Simplify s*8/((ssss/s*(-2))/s)s*(-6)((ss/(s/((s/(ss*(-1)/s))/s)s))/ss)/s assuming s is positive. s(-3) Simplify (d(2/3)d)*(-7/5)(d(-1))(-2/69) assuming d is positive. d(-53/23) Simplify (b(-2/9))40/(b(5/4)/bb(-2/25)) assuming b is positive. b(-8153/900) Simplify ((yy/y*(1/2)y)/y)41/((y(-2)/yy)/(y/(y/(y(-3/10)y)))) assuming y is positive. y(321/5) Simplify ((c/(c/c16))/c(-1/15))(-4) assuming c is positive. c(-964/15) Simplify ((z7/z)/(z/((z/(z*6/z)z)/z)))/(zzz(1/2))(-25) assuming z is positive. z(127/2) Simplify (s(2/11)s/s0s)/(s*5/(s/(s/((s(ss/s(-1))/s)/s)))) assuming s is positive. s(-9/11) Simplify (f(-4))50 assuming f is positive. f(-200) Simplify (j(-1/9)/(j/(j/j8)))19 assuming j is positive. j(-1387/9) Simplify ((x(1/3)/x)/xxx)(-26)(x(-1))(1/21) assuming x is positive. x*(-61/7) Simplify fff(1/3)/fff/f(4/3) assuming f is positive. f2 Simplify (s(-1/5)s)/(s/(((ss4)/ss)/s)s) assuming s is positive. s(14/5) Simplify (b(-2/7)bbb)(-13)/(b1)(-2/55) assuming b is positive. b(-13571/385) Simplify ((p*(-1/2)pp)/(p/(pp*(7/5)p)))/((p/(p(1/4)/p))/p(-7/4)) assuming p is positive. p*(2/5) Simplify (ii(-31))/(i/i(-2/13)) assuming i is positive. i(-405/13) Simplify b24/bb(-15) assuming b is positive. b8 Simplify (g(-4/5)g)(1/5) assuming g is positive. g(1/25) Simplify c*9c(13/6) assuming c is positive. c(67/6) Simplify j/(j*6j)j6(j/(j/(jj/j(2/3))))(-19/3) assuming j is positive. j(-76/9) Simplify (c(2/5)cc5/cc)/(cc(-2)ccc(-2)) assuming c is positive. c(37/5) Simplify f/f*(-12)fffff/((f/(f*31/f))/f)ff assuming f is positive. f50 Simplify (g/g(-12))/g(-14/5) assuming g is positive. g(79/5) Simplify vv*7vvv((vv*13)/v)/vvvv assuming v is positive. v26 Simplify (h(-2/25)h)/(h/(h/h(2/41))) assuming h is positive. h(893/1025) Simplify (n(-2)/n)(-2/11) assuming n is positive. n(6/11) Simplify o8oo12o assuming o is positive. o*22 Simplify ll*(7/4)l*6l(-2/19)/l(2/7) assuming l is positive. l(4447/532) Simplify (w(2/15)w(-9))/(w(-3))(2/45) assuming w is positive. w(-131/15) Simplify ((x0)(4/19))24 assuming x is positive. 1 Simplify y(-19)yy(6/19) assuming y is positive. y(-336/19) Simplify f(1/3)/(f/(f10/f))f/(f*3/f)ff2f assuming f is positive. f(34/3) Simplify j(-2/25)/j(-1/17) assuming j is positive. j(-9/425) Simplify (qq(-14))/((q/(((q/q2q)/q)/q))/q) assuming q is positive. q(-15) Simplify v(-22)/(v35/v) assuming v is positive. v(-56) Simplify r*(-5/6)rr/(rrr(-10)) assuming r is positive. r(55/6) Simplify (rr*(6/7)r)/r(2/7) assuming r is positive. r(18/7) Simplify a*(-5)/aa*7(a*2a)(-1/5) assuming a is positive. a(2/5) Simplify ((v1/v)(6/17))(-6/13) assuming v is positive. 1 Simplify (m/(m(2/7)m))/m(-5)(m*1m)(1/12) assuming m is positive. m(205/42) Simplify (u/((u(11/3)/u)/u))(7/5) assuming u is positive. u(-14/15) Simplify n/n(-16)n(-28)n assuming n is positive. n*(-10) Simplify (kk(-7))(-16) assuming k is positive. k*96 Simplify ii*(-8)iii*0(ii(4/3)i)/((i/(i/i*(-3/8)i))/i) assuming i is positive. i(17/24) Simplify s7s(-1/9)((ss(4/9))/s)/(ss*(1/4)s) assuming s is positive. s(61/12) Simplify (g(-4/3)/g(-2/5))(-7/6) assuming g is positive. g(49/45) Simplify s(-8)/((s(1/12)/s)/s) assuming s is positive. s(-73/12) Simplify ((xx(-3/4))/((((xx*(8/7)x)/xx)/x)/x))(2/65) assuming x is positive. x(-5/182) Simplify r22rrr(1/2) assuming r is positive. r(49/2) Simplify (b(-1/2)/b)(-10)/(b/((b*(1/2)b)/b))(-17/3) assuming b is positive. b(107/6) Simplify (x*(1/10)/(x/((xx*(-4)x)/xx)))/((x/(x/(xx/x*0)x)xx)/x)(4/23) assuming x is positive. x(-747/230) Simplify (l(1/11)/l)(7/5) assuming l is positive. l(-14/11) Simplify (t(2/5))*(2/7)t*9t/(t(ttt8)/t)t assuming t is positive. t(39/35) Simplify r(2/3)r(6/11)/rrr(r/(rr(1/3)/r))12 assuming r is positive. r(337/33) Simplify xxx4x*(-8)/x(xx1)(1/10) assuming x is positive. x(-14/5) Simplify (iii6i)/iii(iii(-2/11))/i(ii/i(-6)i)/ii(-3) assuming i is positive. i(174/11) Simplify (((fffff/(f(f/(((((ff/(f/(ff*(-1/4))))/f)/f)/f)/f))/f)f)/f)/f)*(-18)f/f*(5/3)f/((f*1f)/f) assuming f is positive. f*(-85/6) Simplify ((mm((mmm1/m)/mm)/mm)(-2/5))(-15) assuming m is positive. m24 Simplify (a0a)/(a(-7/9)/a) assuming a is positive. a(25/9) Simplify (p/(p/p*(-3/8)))/(((p/(ppp(3/14)/p)p)/p)/p) assuming p is positive. p*(47/56) Simplify (rr/(r/(rrr*(-5))))/(rr/r*12rr) assuming r is positive. r6 Simplify (z/((z/(z/(z/z(-6))))/zzzz)(zz/(z/((zz(-7))/zzz)))/z)/(z(-2)((z/z(-8))/z)/z) assuming z is positive. z(-18) Simplify (j*(4/3)j/((j/(jj(2/27)jj))/j))46 assuming j is positive. j(6716/27) Simplify ((n/(n/(n(-2/3)/nn)))(-4/5))(-1/32) assuming n is positive. n(-1/60) Simplify t2(t(1/4)t)/tt assuming t is positive. t(13/4) Simplify ((v/((v(2/39)/v)/v)v)/v)/(v*(-1/6)vv) assuming v is positive. v(29/26) Simplify ((p(-1/10)p)/ppp(pp/(pp(-10)/p)p)/p)8 assuming p is positive. p(556/5) Simplify v(-1/16)/(v/v(-27)) assuming v is positive. v*(-449/16) Simplify oo*3oo/o(-14) assuming o is positive. o20 Simplify jjj/(jj/(jj(-1/3)/j))j*(-1)(jj/(jj*7)j)/jjjjjj5j assuming j is positive. j*(11/3) Simplify (zzz/(z/(z/z(-1/12)))zzzz(-8))(-4/9) assuming z is positive. z(23/27) Simplify (c(-5)c)(-30) assuming c is positive. c120 Simplify v(3/4)/(v(-5)v)(v*(3/7)/v)/(v/((v/(v/(v/((vv*(-2/21)vv)/v))v))/v)) assuming v is positive. v(23/84) Simplify s(-4)/((ss(2/13)/s)/s)s/(ss(-4))s(-2/9) assuming s is positive. s(73/117) Simplify (z(-2))(-13)/(((zz/(zz*(-2/11)))/zz)/z)5 assuming z is positive. z(276/11) Simplify j*(-27)/(jj(-5/7)) assuming j is positive. j(-191/7) Simplify (p*(-30)p)/p(-21) assuming p is positive. p(-8) Simplify z*(2/11)/(zzzz*(-2/33))((z/z(2/9))/z)/z1 assuming z is positive. z(-394/99) Simplify (o/o(-2/35)o)/(oo/((o/(o*(-14/13)/o))/oo)) assuming o is positive. o*(1426/455) Simplify o/(ooo(-1/6))o(-9) assuming o is positive. o(-59/6) Simplify n(-1/7)/n(4/9)(n/(n(-1)/n)n)(-2) assuming n is positive. n(-541/63) Simplify (n*(-4)/nnn(-4))*(2/107)	{ "pile_set_name": "DM Mathematics" }
)/4. 2/21 Evaluate 18/(-48)(-8)/6. 1/2 What is (-12)/20(0 - (-20)/(-72))? 1/6 Evaluate ((-80)/(-200))/(22/(-30)). -6/11 Evaluate -8 + (3 + 3/1)/3. -6 (18/36)/(1/8-2) -2 Evaluate 66/18 + -3 - 88/114. -2/19 What is (-4)/(1(0 + 1)-4)? 1 What is the value of (60/(-32) - -2)/(41/164)? 1/2 Evaluate 259/28 - (-7)/(-28). 9 Evaluate (-7)/(-3)(6 - 3 - 6). -7 Evaluate (16/(-24) - -1)/3. 1/9 What is the value of 26(-24)/84 + 7? -3/7 Calculate 24/(-15) + 4292/370. 10 What is (-39)/(-42) + (4 - 124/28)? 1/2 What is the value of 1 + 15/(-18)1 - 0? 1/6 What is (-8)/14 - 220/(-630)? -2/9 Calculate (-2 + 0)/(((-12)/9)/(-2)). -3 Calculate 1/362-4. -2/9 ((-1)/(-2))/((-35)/30) -3/7 Calculate ((-8)/10)/(1596/(-210)). 2/19 What is the value of -7 + -4(-4)/4? -3 What is (-5)/(-1) + 306/(-72)? 3/4 What is 125/15 + -5 - 3? 1/3 0 - (4/6 + 0) -2/3 What is the value of 9 - (-5)/(-1) - 186/48? 1/8 Calculate (49/14 - 5)(-4)/(-30). -1/5 (4/10)/((-11)/(495/27)) -2/3 What is the value of (-294)/(-210) - (-14)/(-10)? 0 (-128)/(-120)-6 - -6 -2/5 What is the value of 3(21/(-7))/(-3)? 3 What is 55/22(112/(-35))/(-4)? 2 Evaluate 9/(-30)10/(-5). 3/5 Evaluate 0/(5 - 4 - 5). 0 (-587)/1761(18/1)/(-1) 6 What is 3/(-2)(-36)/(-27) + 1? -1 Evaluate (2/(-5))/(20/(-25)). 1/2 What is the value of 8/(-44) - ((-588)/(-385))/7? -2/5 Evaluate (-1)/(-5) + 420/(-1350). -1/9 (6/(-2))/(-1 + (-3)/(-12)) 4 What is the value of 20/90(4 + -13)? -2 -47/70 + 8/20 0 Calculate -13 + 12 + 0 + -5 - -2. -4 Evaluate ((-5)/(-10))/(-3 + 44/8). 1/5 What is (-5)/9 - (-136)/(-306)? -1 Calculate ((-12)/18)/(8/12) + -4. -5 Calculate 74/(-14) - (-20)/70. -5 Evaluate 40/(-16)4/35. -2/7 What is ((-6)/(-26))/((-78)/52)? -2/13 -2 - ((-114)/36 + (-2)/(-12)) 1 What is the value of ((-4)/(-8))/((-28)/8 - -4)? 1 What is the value of 2(-5)/(-20) + 1? 3/2 Evaluate 13/(-104)-24. 1 Calculate -314/10520. -8 What is 51/36 + (-33)/44? 2/3 What is (-21)/(-6)152/(-76)? -7 What is the value of 4/13(-6)/24? -1/13 27/54 + (-3)/(-9) + -1 -1/6 What is (-3)/5 + (7 - 12)/(-5)? 2/5 Calculate (-33)/(-6)21/77. 3/2 Evaluate (-228)/48 - (-15)/(-12). -6 Evaluate 4/50 + 462/(-150). -3 Evaluate 6/(-4)-61/3. 3 (-99)/(-36) - 7/(-28) 3 (0 - 35/56)(-12)/15 1/2 Evaluate ((-8)/(-32))/((-3)/(48/5)). -4/5 What is 2/(-4)2 - 14/(-10)? 2/5 What is (0 + (-3)/2)(-4)/(-18)? -1/3 Evaluate 1184/1113/8. 4 Evaluate 15/(-45)-115-1. -5 Evaluate (-9)/6-66/(-27). -2 -35 + 31 - (0 - -2)/2 -5 What is (4/7)/((-286)/(-91))? 2/11 Calculate 330/297(-48)/(-20). 8/3 Evaluate (-133)/19 - 74/(-10). 2/5 3/4 - (5 - 5/4) -3 What is 45/(-72)2/33? -5/4 What is the value of 14/(-70) + 1/5? 0 Evaluate 495/75 + (-7)/1. -2/5 (34/(-2) - -5) + 10 + -3 -5 Calculate 136/1309 + (0 - 6/(-33)). 2/7 What is the value of 8/5 - (-70)/175? 2 ((-17 - -10) + 5)-2 4 What is (2 + 2/(-4))/((-507)/52)? -2/13 What is the value of (9/15 - 0)5? 3 Calculate (-42 - -28) + 1-1 - -7. -8 -5(2/6 + 195/(-675)) -2/9 Evaluate (-1(0 + 1))/((-19)/(-38)). -2 What is 88/(-24) - 24/18? -5 What is the value of 0/(3/220/(-15))? 0 What is the value of (-14 - -5) + 3(1 + 1)? -3 What is (-45)/30 + 2/(-20) + 1? -3/5 Calculate (-12)/(-45)5-3. -4 (-2 - 78/(-36)) + (-10)/12 -2/3 What is the value of 16/(-12)(-6 + 636/104)? -2/13 Calculate -5 + 872/96 + -4. 1/12 What is (3/(-2))/(13/26) + 2? -1 4(-3)/162 -3/2 What is the value of (-10)/(-14)((-8)/(-20))/2? 1/7 Calculate (216/(-180))/(4/10). -3 8/(-14)(-3)/12 1/7 What is the value of (28/70)/(4/(-5))? -1/2 Calculate ((-87)/(-27) - 3) + 100/36. 3 What is (-1)/3(-6 + (-3)/(-1))? 1 Calculate -1 + 9/8 + 70/80. 1 Calculate 12/86(-4)/(-18). 2 Evaluate ((-1)/((-35)/28))/((-8)/20). -2 What is -6((-95)/(-15) - (6 + -1))? -8 6 + 6 + 498/(-42) 1/7 1653/(-232) - (5/(-1) - 2) -1/8 (-2)/8(279/18 - 17) 3/8 Calculate (16/(-32))/((-15)/36). 6/5 Calculate 2/32 + 484/704. 3/4 What is the value of (-21)/6(0 - (-28)/49)? -2 ((-6)/(-12) - (-1)/(-3))-4 -2/3 What is -4 - ((-340)/140 - (-6)/14)? -2 What is the value of (9/2)/(-3) + 1768/272? 5 16/3(4 + -3) 2 What is the value of 104/(-48) + 3/18? -2 Calculate ((-77)/(-22))/(7/4). 2 What is the value of -8(85/(-136) + 6/(-16))? 8 What is (1/2)/(385/(-110))? -1/7 What is 16/(-6)15/180? -2/9 Evaluate 64/8 + 65/(-20). -1/4 What is (1/3)/(16 - 1912/120)? 5 What is the value of (40/114)/(6/36) - 2? 2/19 46/(-36) - 48/(-32) 2/9 Calculate (6/(-8) - -1) + 17/(-4). -4 What is 20/15 + (-6)/27? 10/9 What is the value of (-6)/(-238) - ((-2)/(-14) + 0)? -2/17 Calculate 11/(-15)-3. 1/5 Calculate 1 - (9/(-21) + (-520)/(-315)). -2/9 Evaluate (1 + -4)(2 + -4). 6 Calculate (-14)/3156 - 1/3. -3/5 Calculate (16 - 2)/((-322)/(-92)). 4 What is the value of (-15)/((-300)/(-280))2/4? -7 What is ((-128)/192)/(1/6)? -4 What is 16/6 + 40/(-60)? 2 Evaluate (-273)/(-42) + (-1 - 5). 1/2 Evaluate (-2)/(-6)(14/7)/1. 2/3 What is the value of (-3)/18 - 44/33? -3/2 Calculate 25(-3)/45 + (-2)/6. -2 What is the value of (-1 - 1)2 + 9? 5 Evaluate (8/(-80))/(10/10). -1/10 50/144 + (-10)/45 1/8 What is the value of 21-212/(-24)? 2 What is (1 - 22/18)(-23 - -14)? 2 What is the value of ((-1771)/(-1265))/(2(-2)/10)? -7/2 Calculate 0(-11)/(-9 + 31). 0 Evaluate 24/300 + (-792)/3025. -2/11 Calculate (-1 + -13 + 6)(-2)/4. 4 What is 44/66(-9)/(-42)? 1/7 (-3 - 1)/(8/(-6)) 3 What is -1((-35)/(-15) + -2)? -1/3 Calculate (-1)/((12/10)/6). -5 What is the value of -49/(-12) + 126/(-35)? -3/5 What is ((-180)/(-55) - 3)6/9? 2/11 Evaluate ((-30)/20 + 1)/(1/(-8)). 4 60/(-63) + 24/84 -2/3 Evaluate 2/(6 - 2)6/15. 1/5 (-1 - (-39)/54)/((-10)/(-6)) -1/6 What is (-420)/(-63)3/4? 5 What is the value of -316/108-1? 4/9 What is -6(-7)/421? 1 29/(-174) + (-7)/30 -2/5 What is (63/(-18))/(6/(-12))? 7 Evaluate 2(-4 - (-52)/8). 5 Calculate 4/7 - (-731)/301. 3 (1320/25)/(-6) - -9 1/5 Evaluate 1/(-5) + 18/(-10). -2 Evaluate ((-6)/(-2))/((5 - 1)/(-4)). -3 -14/76(-4 - -2) 2/19 (-84)/(-1176) - (-2)/21 1/6 Calculate 8 - (-2 + 7 + -2). 5 What is the value of (15/(-70))/((-36)/42)? 1/4 What is the value of (-4)/3 + -3(-8)/(-36)? -2 Evaluate (8/10)/(84/35). 1/3 Calculate (-100)/70 + 1 + 0. -3/7 What is the value of (-4)/84-35-3? -5 Evaluate 17/(-9) + -1 - 101/909. -3 Calculate ((-6)/(-8))/3(23 + -20). 3/4 Evaluate ((-1863)/(-63))/(-9) + 3. -2/7 ((-8)/(-20))/(4 - 5) -2/5 What is 1/24 + 22/(-132)? -1/8 (-11)/22 + (-7)/((-70)/15) 1 What is the value of -2((-300)/(-24) + -10)? -5 What is the value of 4/10 - ((-408)/40)/(-3)? -3 Calculate (-20)/(-15) - (-943)/(-552). -3/8 What is the value of 1353/330 - (-2)/(-20)? 4 42/6(-2)/14-1 1 Evaluate 2/(-15) - (2695/(-75))/7. 5 -8 + (-6 - (-1610)/112) 3/8 (20 - 19)4/24 1/6 3 - (2 - 1) - 2 0 Calculate 74/629 - (-53)/(-17). -3 Calculate (2/10)/((-8)/20)2. -1 Calculate 3/(-15)(0 - (-5 + 3)). -2/5 Calculate (-80)/32(6 - 4). -5 Calculate 1357/230 - ((-1)/10)/1. 6 Evaluate -9 + 684/52 + (-4)/26. 4 15/10(60/9 - 0) 10 What is the value of 0 - (20/(-2 + -3) - -5)? -1 What is the value of ((2 - -1)/3)/(27/(-6))? -2/9 What is (267/(-178))/((-6)/(-16))? -4 Calculate ((-153)/90 + 2)8/6. 2/5 4 + 150/(-35) - (-5)/7 3/7 Calculate -4(-39)/(-182)(-14)/4. 3 Evaluate (-65)/(-180) + 8/(-18). -1/12 Evaluate 0 - -6 - (-20)/((-260)/39). 3 -1 + (-12)/(-10) - (-23)/(-40) -3/8 What is ((-3)/12)/((-35)/(-20))? -1/7 Calculate (2/(-5))/(72/(-20)). 1/9 What is the value of (22 + -25)/(-32/(-10))? -5 Calculate ((-490)/(-168) + -3)/(1/2). -1/6 What is the value of -1(-1)/(-9) - 0? -1/9 1 + 0 + -2 + 1 0 What is the value of 8 + (414/(-36))/((-34)/(-24))? -2/17 Evaluate (-20)/(-6) + 33/(-11). 1/3 What is (38/(-95))/(-3 - -6 - 2)? -2/5 Evaluate (((-68)/(-32))/(-17))/(1/(-8)). 1 What is the value of 6/(-8) + (-529)/(-460)? 2/5 What is the value of (8/4)/(-6)9? -3 What is (-1)/7 + 110/35? 3 What is (-284)/(-36) + 368/(-414)? 7 (608/20)/8 - 4/5 3 What is 140/28 - (1 - (-76)/18)? -2/9 Evaluate -2 + 20/660/40. 3 What is the value of (-1476)/(-24)(-3)/27 + 7? 1/6 What is the value of 11/(-9) - -2 - (-2)/9? 1 What is 30/(-8)45/(-225)? 3/4 Calculate 34/4(-34)/(-68) - 4. 1/4 -611/(-22)4/21 4/7 What is the value of 15/6 + -1 + (-374)/44? -7 What is 2 + 0 - 52/8? 3/4 Calculate 5/6 + (-10)/(-4) + -3. 1/3 Evaluate (16/(-40))/(	{ "pile_set_name": "DM Mathematics" }
2q, -4f - 5q + 4 = -0q. Let v = 1 + f. Find the third derivative of 0i2 + 0i*2 - 2i*4 + vi*2 wrt i. -48i Let o = -7 + 7. Let s(a) be the second derivative of oa2 + 0 + 2a + 1/12a4 + 1/20a*5 + 0a3. What is the third derivative of s(u) wrt u? 6 Let x(b) be the second derivative of b6/15 + 2b2 + 7b. Differentiate x(j) with respect to j. 8j3 Let s = -14 + 18. Differentiate -9 - 5f4 + fs + 1 with respect to f. -16f3 Let j(k) be the third derivative of 4k7/105 + k3/6 + 7k2. Differentiate j(b) with respect to b. 32b*3 Let s = -6 - -13. Let v(x) = -x + 9. Let n be v(s). Find the first derivative of 2 - n - 2 + 4 - 2t*4 wrt t. -8t*3 Let b(c) = 6c - 2. Let a(g) = 5g - 3. Let p(u) = -5a(u) + 4b(u). Differentiate p(q) with respect to q. -1 Let c(m) be the second derivative of -11m*6/30 - 7m*3/6 + 3m. What is the second derivative of c(i) wrt i? -132i2 Let i(f) be the third derivative of 7f*6/60 + 5f*3/3 - 11f*2. What is the derivative of i(l) wrt l? 42l*2 Let q(z) be the third derivative of -4z7/105 + z4/12 + 15z2. What is the second derivative of q(l) wrt l? -96l2 Let g(h) be the first derivative of -h7/21 - 7h4/12 + 3h + 2. Let z(a) be the first derivative of g(a). What is the third derivative of z(o) wrt o? -120o2 Differentiate 7 - 5o*2 - 5o*2 + 2o*2 + 3o*2 with respect to o. -10o Let j(n) be the third derivative of 11n9/504 - 11n*5/60 + 9n*2. Find the third derivative of j(o) wrt o. 1320o*3 Let z(i) = i - 6. Let v be z(10). Find the third derivative of 2o*3 - 2o*3 + vo2 + o4 + o*4 wrt o. 48o Let u(n) = n4 - n3 + n2 - 1. Let f(s) = -2 + s3 + s2 + s2 - 2s4 - 3s*3 - 1. Let m(q) = -f(q) + 2u(q). What is the derivative of m(d) wrt d? 16d3 Let y(a) be the second derivative of a5/4 - 29a*3/6 + 30a. Find the second derivative of y(b) wrt b. 30b Find the third derivative of 26 - 16 - 10 + 5d*2 - 26d*4 wrt d. -624d Let q = 9 + -6. What is the derivative of 26a + qa*2 + 3 - 26a wrt a? 6a Suppose 3z + q = 11, 0 = z - q - 1 - 0. What is the third derivative of 3v6 - zv*2 - 2v*3 - 2v*6 + 2v*3 wrt v? 120v*3 Let u(z) be the second derivative of 3z*5/20 + 11z*4/12 - 12z. What is the third derivative of u(l) wrt l? 18 Let x(s) = 14s - 5. Suppose 6d = 3d + 9. Let m(w) = -5w + 2. Let b = 25 - 17. Let o(l) = bm(l) + dx(l). Find the first derivative of o(r) wrt r. 2 Let x(u) = -u*3 - 10u*2 - u - 8. Let c be x(-10). Suppose 9 + 1 = 5n. Find the second derivative of -4r + nr + r*2 + 2r*c wrt r. 6 Let g(k) = -4k*3 + 9k2 - k + 10. Let y(x) = -x3 + 1. Let c(w) = -g(w) + 2y(w). What is the second derivative of c(l) wrt l? 12l - 18 Let r(o) be the second derivative of 2/3o3 + 0 + o2 + 2o. What is the derivative of r(s) wrt s? 4 Let h be ((-2)/3)/(4/(-24)). Suppose -3x - 2 - 13 = -5a, -4a + 12 = hx. What is the derivative of -2 + 2t + 0t - t - at wrt t? -2 Suppose -5n + c + 52 = 0, -5 = -4c - 13. Suppose x = -x + n. What is the second derivative of 2ux + u5 - 2u5 + 4u + 2u5 wrt u? 60u*3 Let v(a) = 8a*3 + 20a*2 + 11. Let c = -9 + 20. Let h(t) = -3t*3 - 7t*2 - 4. Let s(b) = ch(b) + 4v(b). What is the third derivative of s(f) wrt f? -6 What is the second derivative of -7r*4 + 2r - 3r + 4r - 2r wrt r? -84r*2 Let s be (9/(-6))/(-3)6. Suppose s = 2z + z. What is the first derivative of -3o*4 - z + 2o4 - o4 wrt o? -8o3 Let n = 3 - 1. Let o(p) = p3 - 5p*2 + 5p - 2. Let t be o(4). Find the second derivative of 4 - 4 - nh4 + 3h - th4 wrt h. -48h*2 Let u = -16 + 18. Let l(r) be the third derivative of 1/6r3 + ru + 0r + 1/24r*4 + 0. What is the first derivative of l(m) wrt m? 1 Let n(b) be the first derivative of -11b*2 + 22b + 23. What is the first derivative of n(f) wrt f? -22 Let q(v) be the third derivative of v7/210 - v5/10 + 3v2. Find the third derivative of q(f) wrt f. 24f Let a(o) = -o3 + o2 + 1. Let q(r) = 3r3 - r2 - 5. Let d(x) = a(x) + q(x). What is the derivative of d(f) wrt f? 6f*2 Let k be 6/(-5((-16)/(-10) - 2)). Let q(j) be the first derivative of 0j + 3/2j*2 - 2 + 1/3j*k. Find the second derivative of q(p) wrt p. 2 Let t(d) be the second derivative of 4d - 2/3d3 + 4d*2 + 0. Differentiate t(a) wrt a. -4 Find the third derivative of -3s*5 + 6s2 + s2 + 2s2 - 8s*5 wrt s. -660s*2 Suppose -12 = -5q - 3z, -3q + 11 - 3 = z. What is the first derivative of 2 - 2b3 - 1 + bq wrt b? -3b*2 Suppose -d = -4y - 14, 2d + 5y + 15 = 3d. Let s = -6 + d. What is the third derivative of -l3 - l2 - l4 + 2ls + l3 wrt l? 24l Let n(j) = j2 - 4j - 6. Let y be -18((-30)/9 - -3). Let u(i) = -i - 1. Let h(b) = yu(b) - n(b). What is the second derivative of h(t) wrt t? -2 What is the first derivative of 7o3 - 11 + 23 + 5 wrt o? 21o*2 Let c(l) be the second derivative of 0l*2 + 0l*6 - 9l + 2/21l7 + 0 - 7/12l*4 + 0l*3 + 0l*5. What is the third derivative of c(h) wrt h? 240h*2 Find the first derivative of -3x*2 + 12x*2 - 5 - 7x*2 + 0 wrt x. 4x Suppose 4a + 4l = 8, -l + 5l = 0. Differentiate -af - 3f4 + 2f + 7f4 - 6 with respect to f. 16f*3 Let k(x) be the third derivative of 0 + 3x*2 - 1/3x*3 + 0x + 5/24x4. What is the derivative of k(l) wrt l? 5 Let p = -9 + 18. What is the first derivative of -p + 10f*2 + 0 + 14 - 4f*2 wrt f? 12f Suppose 0 = -4x - r + 14, x = -2x + 3r + 3. What is the third derivative of -4f*2 + xf*2 + 6f5 + f2 - 2f2 wrt f? 360f2 Let r(x) be the third derivative of x7/105 - x5/24 - x3/2 + 4x2. Let j(k) be the first derivative of r(k). What is the second derivative of j(c) wrt c? 48c Let l(g) = -g + 1. Let c be l(1). What is the third derivative of 2t2 - 2t*3 - 5t*2 + 2t*2 + ct2 wrt t? -12 Let h(n) = n3 + 5n2 - 6n + 8. Let u be h(-6). Let g = -4 + u. Find the second derivative of -3m - 4m*g + 5m*4 + 5m wrt m. 12m2 Let f = 6 - 6. Suppose 0 = -j - 2h + 11, j + 4h - h - 15 = f. What is the second derivative of 5s*j - s - 7s3 - s3 wrt s? -18s Let v = -5 + 0. Let w(s) = -4s*3 + 3s + 2. Let z(h) = -8h3 + 7h + 5. Let y(p) = vw(p) + 2z(p). Find the second derivative of y(q) wrt q. 24q Let u(p) be the third derivative of p5/30 + p4/6 - 2p*2. What is the second derivative of u(n) wrt n? 4 Let p(n) be the second derivative of -2n - n*2 + 0n*3 - 1/4n*4 + 0. Differentiate p(o) wrt o. -6o Suppose 0b = -5b + 15. Find the first derivative of h*b + 3h + 2 - 3h wrt h. 3h*2 Let h(b) be the second derivative of -2b*7/7 - 11b*4/12 - 10b. What is the third derivative of h(d) wrt d? -720d2 Let f be 5/2 - (-4)/8. Find the second derivative of -4w*2 + fw*2 + 0w + 0w - 2w wrt w. -2 Let g(i) be the third derivative of 31i7/105 + 65i*3/6 + 65i*2. Find the first derivative of g(q) wrt q. 248q*3 Let w(v) be the first derivative of 12v*7/7 - 9v*3 + 9. What is the third derivative of w(g) wrt g? 1440g*3 Let f(p) = 4p - 4. Let a(c) = -c + 2 - 2c + c. Suppose 0 = y - z - 1 + 5, 10 = 5z. Let v(h) = yf(h) - 5a(h). What is the first derivative of v(x) wrt x? 2 Let w(l) be the third derivative of -l5/12 - l4/24 + 3l2. Find the second derivative of w(y) wrt y. -10 Let d be (-5)/(-2) + 3/6. Let x(t) be the first derivative of -t - t - 2 + 2t*2 - dt*2. Differentiate x(y) wrt y. -2 Let n(g) = -2g + 13. Let c be 8/(-12)(1 + -10). Let i be n(c). Differentiate -2 - i - k2 + 5 + 1 wrt k. -2k Let s be (8/(-10) - -2)/((-30)/(-100)). Let a(i) be the second derivative of 0 + 1/4is + 0i*3 + 4i + 1/2i2. Differentiate a(u) wrt u. 6u Let n(x) = -x5 + x4 + x*3 + x. Let z(h) = 2h*5 - 5h*4 - 5h*3 + 5h*2 - 5h. Let i(r) = 5n(r) + z(r). What is the third derivative of i(k) wrt k? -180k*2 Suppose 28 = 4p + 4j, 3p = -2p + 2j. Let k(i) be the first derivative of -2i + p + 1/2i*2. What is the derivative of k(n) wrt n? 1 Suppose -2x = -0x + 10. Let b = -4 - x. What is the first derivative of b + 2 - 4 + d wrt d? 1 Let l(i) = 11i. Let o(b) = -b + 1. Let r(n)	{ "pile_set_name": "DM Mathematics" }
- 7160. Calculate the common denominator of -31/452 and m. 452 Let b(w) = -w*3 + 9w*2 - w + 9. Let v be b(9). Suppose v = -2y - 2y + 12. Let h(c) = -c2 + 13c + 1. Calculate the least common multiple of h(13) and y. 3 Let b(a) = -25a + 6 + 9a + 3. Let n be b(-5). What is the common denominator of -5/2 and 6 + n/2 - 0/1? 2 Let n = 7 + -2. Suppose ny + 20 = 40. What is the lowest common multiple of 8 and (32/(-24))/(y/(-42))? 56 Suppose 3b + 0b + 5c - 81 = 0, -2c + 154 = 5b. Suppose 5719 = -32d - 14d + 7007. What is the lowest common multiple of b and d? 224 Let g = -6832 - -6838. What is the smallest common multiple of 73 and g? 438 Let j(o) be the second derivative of o*3/6 + 15o*2/2 - 474o. Let d = 3 + -3. Calculate the lowest common multiple of 33 and j(d). 165 Let o be ((-2)/(-21))/141088/(-16). Let j = -243 - o. Find the common denominator of j and -115/56. 56 Let f = -1799 - -3359. Find the common denominator of -22/45 and 2/(-5) - 5746/f. 180 Suppose 0 = -2p + 2v - v, -p - 4v = 0. Suppose 3y = -4n + 6y + 646, 3n + 2y - 476 = p. Calculate the least common multiple of 44 and n. 1760 Suppose 4x - 2t = -5t + 71, x = 3t + 14. Suppose -41 + 245 = xy. What is the common denominator of y and 59/3? 3 Suppose 2k + 9734 = 4n, 0 = -n - 18k + 17k + 2426. Calculate the least common multiple of 6 and n. 14586 Suppose -3w + 2y = -0y - 281, 0 = -5w + 2y + 475. Suppose -wt = -96t - 12. Calculate the lowest common multiple of 58 and t. 348 Suppose 2q + 8r - 10 = 13r, 0 = 4q - 2r - 20. Suppose -3x = -qa + 312, 3a - 2a - 52 = -2x. Calculate the smallest common multiple of 50 and a. 300 Let k = 886/5 - 34133/190. What is the common denominator of 80907/2172 - (1 - (-3)/4) and k? 38 Let p be 1 + -3 - (-2 - -1). Calculate the lowest common multiple of ((9 - -71)/8)/1 and (p - 3)14/(-8). 70 Let c(x) = 2x2 + 49x - 26. Let t be c(-25). Calculate the common denominator of -19/6 and t/(-9)1235/38. 18 Suppose 2u = -5w + 492, 15u + 120 = w + 10u. What is the smallest common multiple of w and 48/60 + 1188/15? 400 Find the common denominator of (74 - 76) + 422/294 and 55/21. 147 Let f = 1 - -31. Let l(r) = -452r - 1786. Calculate the smallest common multiple of l(-4) and f. 352 Suppose 0 = 2m + 6, -6c + 3c = -2m - 18. What is the common denominator of c - (2 - (-139)/(-6)1) and -13/12? 12 Calculate the common denominator of 18/((-159768)/(-17956)) - 2 and 3/49. 15533 Suppose -5s + 1 = -a, -21a - 2s + 6 = -20a. Calculate the smallest common multiple of a and 1196. 1196 Suppose 10m + 3m - 312 = 0. Find the common denominator of m/(-9) + 7 + (-8 - -3) and -91/398. 1194 Let h = 699821 - 314919271/450. Calculate the common denominator of h and -47/450. 450 Suppose -260 = -2w + 36v - 32v, w - 141 = v. Calculate the smallest common multiple of w and 41/2 - 1/2. 760 Suppose -49b + 54b + z = 2206, -4b - 4z + 1784 = 0. Calculate the smallest common multiple of 440 and b. 440 Suppose -2n - 2n = 8. Suppose -14q + 12q + 19 = g, 3q + 2g - 30 = 0. What is the common denominator of (-28)/5 - n/8 and q? 20 Let g = -563 + 701. Calculate the lowest common multiple of g and 322. 966 Suppose 4l + 12 = 24. Let t = 4/37 + -45/74. What is the common denominator of t and 0 + 1 + 153/12 + l? 4 Let y = 2909 - 14288/5. Suppose 43 + 59 = -2f. Let b = f + y. Find the common denominator of 29/8 and b. 40 Let z = -2971/126 + -16/63. Let h be (11 - 1)(-52)/8. What is the common denominator of ((-2)/(-6))/((-78)/h) and z? 18 Let w(p) = 3p*2 - p - 1. Let u be w(-1). Let h = 19669/18 - 1089. What is the common denominator of 22/(-4)u/12 and h? 72 Suppose -174o + 60288 + 28626 = 0. What is the smallest common multiple of o and 292? 2044 Let s = -41548/10521 - 5/1503. What is the common denominator of 1(-80)/36(-624)/(-455) and s? 21 Calculate the common denominator of ((-22)/(-4)1)/(87216/4108) and 39/38. 10488 Suppose 25k - 29k - 5x + 16 = 0, 2k = 4x + 8. Suppose 4b + kw = 48, -b - 8 = -5w - 50. What is the smallest common multiple of b and 2? 34 Let n be 6393(0 + (-25)/(-120)). Let g = -1334 + n. What is the common denominator of -71/4 and g? 8 Suppose 0 = -8b + 42 - 242. What is the smallest common multiple of 11 and 15(240/b)/(-4)? 396 Suppose 317 = 3k - 47k + 1417. Calculate the lowest common multiple of 2995 and k. 14975 Let j = 9173/4248 + 26/531. Calculate the common denominator of -43/4047 and j. 32376 Let i = -384560107/417018 - -4/208509. Let c = 936 + i. Let y = -72934/21 + 3472. Find the common denominator of c and y. 42 Suppose 10j - 5j + 15 = 0. Let o be 172985/150 - 6/j. Let f = -1156 + o. Find the common denominator of f and -115/12. 60 Calculate the common denominator of (-126)/(-90) + (-13528)/5520 and 121/60. 1380 Calculate the common denominator of -7/473 and (-723)/(-2079) - 4/18. 9933 Let c be (-490652)/12(-1 - 38/(-32)). Let z = 7670 + c. What is the common denominator of z and (-1 - 3) + ((-973)/(-30))/7? 240 Let v(o) = 40o + 3503. Calculate the smallest common multiple of v(-84) and 858. 858 Let y = -178007/30 - -5945. Let i = 417/20 - y. What is the common denominator of i and (1/3)/((-4)/(-255))? 12 Suppose -3q - 4k = -34, 3q - 4q = -2k - 18. Suppose -qx + 515 = -9x. Let y = x - 57. What is the lowest common multiple of y and 10? 230 Let u = 7 - 2. Let h = 694 + 118. Let c = h - 802. What is the smallest common multiple of c and u? 10 Let g be ((-68474)/6839 - -10)(-1)/(-1). Let m = -46387/38103 - g. Calculate the common denominator of 67/130 and m. 390 Suppose -5d - 3g = 5, -4d + 85g - 89g - 12 = 0. Let a(k) = -3k3 - 6k*2 - k + 2. Calculate the smallest common multiple of d and a(-7). 744 Let u be (-2)/9 - 2/36-7078. Let k = u - 278. Calculate the common denominator of ((9/(-60))/(-1))/((-6)/k) and 75/28. 56 Suppose 0f = 8f - 16. Let g = 125 - f. Suppose -g = 3l - 141. Calculate the smallest common multiple of l and 9. 18 Let a = 38121/7 + -25655356/4711. Let s = 8398/795021 + 54064709449/4280393064. Let k = a - s. What is the common denominator of k and -25/12? 24 Let s = 617897/2 + -308967. Calculate the common denominator of (-2)/(-5) - 303/(-180) and s. 12 Calculate the common denominator of 97/1320 and (-1 - (-302)/(-1540)) + 2360/2065. 9240 Let v(b) = 2b*3 + 14b*2 - 5b + 25. Let j be v(-7). Suppose -j = -2i + 4m, 2i - 3i = 2m - 10. What is the smallest common multiple of 7 and i? 140 Let n = 5314 + -5298. Calculate the lowest common multiple of n and 326. 2608 Let m be (-17)/408(-14956)/27. Let j = m + 7/81. Calculate the common denominator of j and -101/66. 66 Suppose 981b - 988b = -306530. Let z = b - 1313881/30. Find the common denominator of -34/75 and z. 150 Let v(z) = -4 - 3z3 - z2 - z2 + z - 3z*2. Let j be v(4). Calculate the least common multiple of j/(-24) - 4/(-6) and 4. 12 Let r(g) = 6g*2 + 15g + 1. Let c be r(-3). Find the common denominator of 2/c - 552/(-80) and (-4)/(-3)(-36)/11. 110 Let t = -46965 + 3522428/75. Calculate the common denominator of t and 91/160. 2400 Suppose 1755 = 37q - 2500. Calculate the smallest common multiple of 375 and q. 8625 Let k = -338381/2408 - -1125/8. Find the common denominator of k and -41/6622. 6622 Suppose 203c - 79488 = -4c. Calculate the smallest common multiple of 192 and c. 384 Let h = -9628558489/30 + 320996632. Let x = 44687 - h. Calculate the common denominator of 1/33 and x. 330 Let i = -63079/3 - -5971499/284. Calculate the common denominator of i and -99/104. 22152 Suppose -z = 2u + 3u - 1393, -2z + 2u + 2834 = 0. Calculate the lowest common multiple of z and 1570. 14130 Suppose -7p + 3039 = -391. Suppose 3m - d - 319 = 166, 0 = 3m + 4d - p. What is the lowest common multiple of 36 and m? 324 Let j be (-17 - -12) + (-30)/(-2). Suppose -3o - j - 23 = -h, 5o = -h + 41. Calculate the smallest common multiple of 30 and h. 180 Let l be 244776995342/(-11654065360) + 8/4 - 2. Let f = l - -2/20810831. Let n = 207/10 + f. Calculate the common denominator of -93/8 and n. 56 Let u = 413 - 191. Let d(g) = -4g2 - 5g - 3. Let n be d(-4). Let p = 59 + n. Calculate the least common multiple of u and p. 444 Let l = -114313 + 49726178/435. Find t	{ "pile_set_name": "DM Mathematics" }
? False Is 1615033 prime? False Is 262202 composite? True Is 1415651 a prime number? True Is 46333 prime? False Is 5429321 a composite number? False Is 193243 a composite number? False Is 103549 a prime number? True Is 7349 composite? False Is 174821 a prime number? True Is 16645 prime? False Is 37399 prime? False Is 131981 composite? True Is 2099 composite? False Is 3455857 a prime number? True Is 567335 a composite number? True Is 2029 prime? True Is 77389 prime? False Is 4645 prime? False Is 1009 a prime number? True Is 3961 a composite number? True Is 967114 prime? False Is 30265 prime? False Is 555817 prime? False Is 78661 composite? True Is 2495 a prime number? False Is 98509 a composite number? True Is 2296907 a composite number? False Is 21531 a composite number? True Is 4817 a prime number? True Is 3754087 composite? False Is 278191 a composite number? False Is 3593 prime? True Is 1693 composite? False Is 269398 prime? False Is 111721 a composite number? False Is 15727 a prime number? True Is 10001 prime? False Is 4321 a prime number? False Is 602695 composite? True Is 125921 prime? True Is 1259 prime? True Is 292373 a composite number? True Is 1023337 a prime number? False Is 37923 composite? True Is 48407 composite? False Is 239831 a prime number? True Is 163199 a composite number? False Is 1361 a composite number? False Is 181767 a composite number? True Is 301703 a prime number? True Is 633151 composite? False Is 1757 composite? True Is 16271 a composite number? True Is 10299 composite? True Is 55469 composite? False Is 28411 prime? True Is 17453 prime? False Is 828767 composite? True Is 451159 prime? True Is 75507 prime? False Is 17083 prime? False Is 60217 prime? True Is 576185 composite? True Is 64373 composite? False Is 1559867 a prime number? False Is 785 a composite number? True Is 9101 a composite number? True Is 8915 composite? True Is 87331 prime? False Is 330547 prime? False Is 532339 prime? False Is 462394 a composite number? True Is 17698 a composite number? True Is 243301 composite? False Is 664907 a prime number? False Is 1504159 a prime number? False Is 553603 prime? False Is 35179 a composite number? True Is 7327 composite? True Is 106801 a composite number? False Is 11957 prime? False Is 227299 prime? True Is 435373 a composite number? True Is 554029 composite? True Is 205319 prime? True Is 27581 a prime number? True Is 19529 prime? False Is 91855 prime? False Is 28387 a composite number? False Is 699 composite? True Is 53503 prime? True Is 12071 prime? True Is 5671 a composite number? True Is 66841 prime? True Is 176723 prime? False Is 6007 a prime number? True Is 942899 composite? False Is 201961 prime? True Is 361163 composite? True Is 565 a composite number? True Is 12949 composite? True Is 3091 a prime number? False Is 1507393 a prime number? False Is 150721 a prime number? True Is 10979 prime? True Is 9973 prime? True Is 521 composite? False Is 29221 composite? False Is 1067 a composite number? True Is 5347 composite? False Is 7817 a prime number? True Is 10427 prime? True Is 42631 prime? False Is 21055 prime? False Is 55073 composite? False Is 138821 a composite number? False Is 7639 composite? False Is 13798 composite? True Is 168313 a prime number? False Is 25111 a composite number? False Is 4111 a composite number? False Is 90583 composite? False Is 2389 prime? True Is 20477 prime? True Is 404249 a prime number? True Is 185429 a composite number? False Is 75817 composite? True Is 390553 a prime number? True Is 466019 composite? False Is 6191 prime? False Is 34807 prime? True Is 139115 composite? True Is 535273 a composite number? False Is 651113 a composite number? True Is 77339 a composite number? False Is 44221 composite? False Is 826231 a composite number? True Is 583391 a prime number? True Is 38767 prime? True Is 4271 prime? True Is 641891 composite? False Is 3433 composite? False Is 1973 composite? False Is 24839 a composite number? True Is 61546 composite? True Is 24159 a prime number? False Is 331 a prime number? True Is 8083 a prime number? False Is 108561 prime? False Is 9619 prime? True Is 213247 prime? True Is 265313 a prime number? True Is 279479 prime? True Is 14078 a prime number? False Is 437461 a prime number? False Is 113327 a prime number? True Is 7283 a composite number? False Is 9242 prime? False Is 108835 composite? True Is 51211 composite? True Is 29905 a prime number? False Is 12941 a prime number? True Is 195717 composite? True Is 231107 a composite number? False Is 614569 a prime number? True Is 7297 prime? True Is 2183 a composite number? True Is 38 a prime number? False Is 10637 prime? False Is 16741 a composite number? False Is 180883 a prime number? True Is 52807 a composite number? False Is 1542179 a prime number? True Is 22229 a prime number? True Is 216089 composite? True Is 254494 a prime number? False Is 579 a composite number? True Is 1511 a prime number? True Is 17417 prime? True Is 7187 a prime number? True Is 194203 a composite number? False Is 54797 composite? True Is 9851 a composite number? False Is 299033 a composite number? True Is 265865 a prime number? False Is 284061 a prime number? False Is 13781 prime? True Is 1847411 a prime number? False Is 659 prime? True Is 2491661 prime? True Is 4897 a prime number? False Is 522113 a prime number? True Is 1726 a prime number? False Is 292777 composite? False Is 271207 prime? False Is 9413 prime? True Is 4439 a prime number? False Is 3781 composite? True Is 281363 a composite number? False Is 2179 composite? False Is 4661 a prime number? False Is 41455 a composite number? True Is 541217 prime? True Is 2283 a prime number? False Is 1657253 prime? False Is 3749 composite? True Is 24611 a prime number? True Is 179969 a prime number? True Is 99929 a prime number? True Is 5368307 a composite number? True Is 147491 a composite number? True Is 515507 a composite number? False Is 5147 prime? True Is 2411 prime? True Is 20863 a composite number? True Is 14813 prime? True Is 10481 prime? False Is 3989 prime? True Is 105218 a composite number? True Is 11383 composite? False Is 89 a prime number? True Is 1361 prime? True Is 1361 a composite number? False Is 2130133 composite? False Is 82699 a prime number? True Is 184993 composite? False Is 3898 a prime number? False Is 2129 a prime number? True Is 90371 a prime number? True Is 21467 prime? True Is 107441 a prime number? True Is 12655 a prime number? False Is 127349 prime? False Is 38771 composite? True Is 313687 a composite number? True Is 8159 composite? True Is 381 a composite number? True Is 1333261 a prime number? True Is 213553 a composite number? False Is 440117 prime? False Is 126359 a prime number? True Is 3248331 a prime number? False Is 998 prime? False Is 61459 a composite number? True Is 1526039 a prime number? False Is 29383 composite? False Is 506983 prime? True Is 441713 prime? True Is 49349 prime? False Is 2479 a composite number? True Is 50527 a composite number? False Is 168061 a composite number? True Is 301 prime? False Is 100289 prime? False Is 628271 prime? False Is 1721 prime? True Is 30551 a prime number? False Is 12949 a prime number? False Is 357967 composite? False Is 858085 a prime number? False Is 2477 prime? True Is 3821 prime? True Is 5389 prime? False Is 31379 a composite number? False Is 10037 a composite number? False Is 57747 a prime number? False Is 718897 composite? False Is 64907 a composite number? True Is 10687 a prime number? True Is 14983 prime? True Is 5051 composite? False Is 222247 composite? False Is 2779 a prime number? False Is 60251 composite? False Is 3453 prime? False Is 2053 composite? False Is 3472883 a composite number? False Is 1084669 composite? False Is 87071 composite? False Is 55559 composite? True Is 260387 composite? False Is 142949 a composite number? False Is 191339 a prime number? True Is 781 prime? False Is 17247 prime? False Is 1871 prime? True Is 18399 composite? True Is 2298059 prime? True Is 60757 composite? False Is 2509 prime? False Is 73433 prime? True Is 4339 prime? True Is 347411 prime? True Is 55553 a composite number? True Is 720677 a composite number? False Is 252482 a composite number? True Is 2837	{ "pile_set_name": "DM Mathematics" }
)/(9/42). Let w = -15 - -13. Is s at least as big as w? True Let u be 3(-4)/(-48) - 92/(-16). Suppose 11 = -0h + h - m, -3m + 16 = 4h. Are u and h equal? False Let u = -21 + 31. Which is greater: 11 or u? 11 Let o = -177 - -185.1. Let n = 8 - o. Let c = -0.1 + -0.9. Do n and c have different values? True Let c be 1 + (-20)/(-8)-4. Let f be 4/(9 + 3)c. Is f >= -1? False Let z(h) = -h*3 + 7h*2 + 2h - 10. Let y be z(7). Suppose 3v - y = -1. Suppose 0 = -q - 3q + 4. Is v equal to q? True Let z be 6/(-20)(-36)/(-27). Which is smaller: 1 or z? z Suppose 2z = 4 + 2. Suppose 0 = -b + zb + 2. Suppose 0 = a + 3a. Is b greater than or equal to a? False Let k(t) be the second derivative of -t4/12 - t3/2 - 2t2 - 5t. Let o be k(-2). Are o and -6/5 nonequal? True Let u = -0.6 + 1.3. Let i = u + -0.73. Let r = 2.03 + i. Which is bigger: r or -1/3? r Suppose -1 + 25 = -4o. Suppose -2f - m = 10, 2f + 5m - m + 16 = 0. Which is smaller: o or f? o Let w = 0.1 + -0.8. Let v = -188/3 + 62. Which is smaller: v or w? w Let r = 0.022 - 23.022. Let g = 23 + r. Is g bigger than -2/11? True Let g be (-30)/(-16) + (-37)/74. Which is bigger: -2 or g? g Let m = 2 + -3. Suppose -3u = -3d - 99, -4u + 138 - 3 = -5d. Let o be -213/u. Which is bigger: m or o? o Let c be -3 + (-1)/((-3)/6). Let p = c + 0. Let l be (p - -3)/(-2)-1. Is -1/3 at least l? False Let d(x) = 8x - 4x - 7 + x2 + 5x. Let t be d(-9). Which is greater: t or -8? t Let m be (-232)/(-20) - 4/(-10). Which is greater: 11 or m? m Let d(m) = 9m - 3. Let x be d(1). Let v(i) = -i3 + 6i*2 + 3. Let t be v(6). Suppose -f - 2w + t = -1, -3f + 5w + 23 = 0. Is x at least f? True Let q be (2 - 2)/(1/(-1)). Suppose -3n + 0n = -9. Let x = q + n. Is 2 greater than or equal to x? False Let t(q) = q*3 + 3q*2 + 3q. Let g be t(-3). Let a be ((3/2)/(-1))/g. Which is smaller: -1/3 or a? -1/3 Let x be (-1)/52 + (-24)/(-96). Which is bigger: -0.1 or x? x Let r be 7 + 12/(-3) + 31/4. Which is greater: r or 11? 11 Suppose 2j = -2d - 2, -2j = 5d - 0 - 1. Let f(c) = c*2 + 3c + 2. Let h be f(j). Is 4/9 > h? True Suppose -3d + 6 = -0. Suppose 0w + d = -w. Is w not equal to -4/7? True Let b(u) = u*3 - 12u*2 - 15u + 19. Let y be ((-6)/9)/((-4)/78). Let t be b(y). Is t < -7? False Let a be (2 - (-11)/(-5))2. Suppose 3u = 5z - 0u - 10, -5z = 4u + 25. Is z at most a? True Let a be (-39)/85 + 4/10. Let d = a + -63/85. Let y = -3 + 2. Which is bigger: y or d? d Suppose 4a + 0a = -12, 2w - 6 = 4a. Is -3 less than w? False Let r be (-14)/7 + 1 + 10. Suppose r = 2l - 3l. Let u be (l/4)/(3/8). Are -7 and u equal? False Let l = 2 - 2.3. Let h = -1.2 - -0.2. Is l bigger than h? True Let g = -11 + 9. Do g and -0.08 have the same value? False Suppose 0 = -8x - 95 + 279. Is x smaller than 22? False Let z be (-159)/((-22)/(-8) - 2). Let d be 30/(-195) + z/(-26). Is d at most 7? False Suppose -5z = g - 0g - 3, z = 4g + 9. Which is smaller: -3/11 or z? -3/11 Let n be ((-4)/(-6))/((-60)/18). Are n and 1 unequal? True Suppose -5h - 2v = 2, 2 = 5h - 5v - 3. Let n = 1.5 + -2.7. Let c = n - -0.2. Is h greater than c? True Suppose -23 = -7s + 8s. Which is smaller: s or -22? s Let s(l) = l*2 - 16l - 89. Let y be s(20). Which is smaller: -11 or y? -11 Let d = -619/6 + 103. Is d smaller than -1? False Let m = 7 - 0. Let i = m - 6. Let z = i + 1. Is 1 equal to z? False Suppose -v + 5z - 1 - 9 = 0, 4z = -3v + 8. Is v <= -2/25? False Let u be (4/6)/(1/(-6)). Suppose 1 = -2y + 3b, -5y + 3b - 13 = -b. Are u and y non-equal? True Let j = -231532/137 + 1690. Which is smaller: j or 1? j Let n = 2.46 + -0.46. Which is smaller: 1/10 or n? 1/10 Let c = -0.4 + 2.4. Let x = 0.18 + 0.02. Do x and c have the same value? False Let j = -954/7 + 136. Is 16 less than j? False Let m(z) be the second derivative of z5/10 + z3/3 - z2/2 - z. Let g be m(1). Suppose 4 = 2b - gb. Is -2 not equal to b? True Let g(s) = -4s - 15. Let c be g(-4). Is c bigger than -3/16? True Let g(v) = -v*2 - 8v - 10. Suppose -4a - 35 = a. Let s be g(a). Which is smaller: -5/3 or s? s Let m(b) = b2 - 4b + 2. Let k be m(5). Let w be (2/(-3))/((-34)/153). Let g be (-14)/(-4)w/k. Which is smaller: 1 or g? 1 Suppose 3b + 45 = -5x, 0 = 5x + 4b + 17 + 33. Let y be (9/x)/(3/4). Is -2 <= y? True Let g = 0.5 + -0.4. Let k = 3 - 3. Let n = g - k. Which is smaller: 0.4 or n? n Let x = 0 - 0.1. Let l = -15 - -12. Is l at most x? True Let d be 14/(-8)(-80)/56. Is 4 less than d? False Let s be (-1 - 1)4/(-4). Suppose sc - 4 = 6c. Let i be 11/(-3) - 3/c. Is -0.1 bigger than i? True Let c(h) = -h3 - h2 + 6h + 2. Let u be c(-4). Let d = u - 23. Are 6 and d nonequal? True Let o = 3 + -4. Let j = 0.6 + -0.6. Do j and o have the same value? False Let v(o) = o3 - o2 + 2o + 2. Let j be v(0). Is 3 bigger than j? True Suppose 3q = 3x + 18, 2q - 13 = 3x - 0q. Is x smaller than -1? False Let h = 3 + -3. Suppose 6p + 4v = 2p + 44, h = -5p - 4v + 54. Suppose 3 = -j, 4s + 4j + p = 3s. Is 3/4 at most as big as s? True Let c = 37 + -35. Which is bigger: c or -18? c Let z = -1 + 3. Suppose -2 = -3m + 1. Is m smaller than z? True Let m(s) = s2 - 3s - 1. Let q(l) = -l - 6. Let p be q(-9). Let c be m(p). Is -1 smaller than c? False Let d = -0.9 - 0.9. Let q = d + 2.8. Is q greater than -5? True Let w(a) = a*3 - 2. Let x be w(2). Suppose d = -2c + 14, d + 15 = xd - c. Suppose -2s = -du - 8, -u + 7 = 3s + 2. Which is smaller: u or -3/2? -3/2 Suppose -11 = -2l - 1, 2l + 17 = 3p. Let c be p(3 + (-20)/6). Is -11/4 at most c? False Let l be 1 + (0 - -1) + -2. Let h = -5 + 6. Which is bigger: l or h? h Suppose -2 = -t + 3t. Is -2/13 less than t? False Let j = -46 - -54. Which is bigger: j or 7? j Let n = 2366 + -272088/115. Is n < -1? False Let r(m) = 5m*2 - 5m - 1. Let s be r(3). Is 3/5 bigger than s? False Let l be (-4 - -2)/(10/25). Is -1 equal to l? False Let k = 8/165 - -2/15. Which is smaller: 0.2 or k? k Let f = 11/185 - 1987/27195. Which is greater: -1 or f? f Let q = 0.25 - 5.25. Which is smaller: q or 2/13? q Let b = -14 - -16. Suppose g + bg = 27. Do g and 10 have different values? True Suppose 4b - 4 - 4 = 0. Suppose 7c = bc. Let h be (-114)/(-63) - (-4)/(-30)5. Which is smaller: h or c? c Suppose f = 2y + 4, 1 = 5y + 11. Suppose -l = f, l + 29 = -4j + 1. Let r be 26/(-42) - 2/j. Is r greater than or equal to 0.2? False Let f = 17 + -17.1. Is f bigger than 1.8? False Let h = -2/165 - -76/825. Is h not equal to -1? True Let n be -4 - (-356)/44 - 4. Is n at most as big as 1? True Let a = -6 - -6. Let n be a + (2 - 5) - 0. Is 2 less than n? False Let i = 610 + -1808/3. Is 7 equal to i? False Let s = -0.12 + -0.18. Is s bigger than -0.3? False Suppose -3v - 276 = 4b, 3b - b + 156 = 3v. Which is greater: -71 or b? -71 Suppose 3x + 2f = f + 48, -2x + 4f = -46. Let m = x + -12. Which is smaller: 4 or m? 4 Suppose 7a = 8a. Suppose 3j + 1 + 2 = a. Which is smaller: j or 6? j Let c = -86191/195 + 442. Are c and 1 equal? False Suppose -5b + 9b = 12. Is -1 bigger than b? False Suppose -4r = -3y - 14, 0y - 2y = 4r - 4. Let a be (y + (-3)/(-6))/1. Which is smaller: a or -2? -2 Let p = 0.4 + -0.33. Let i = 1.07 - p. Let h = -2 + i. Are h and -5 equal? False Let z(q) = q + 3. Let g be z(-3). Let w be 6/(9/61). Let b be -2 - -1 - w/(-3). Which is greater: g or b? b Let s = 0 - 3. Let m(t) = 5t*3 + 4t*2 + 2t - 5. Let y(j) = 6j3 + 4j*2 + 2j - 6. Let u(q) = -5m(q) + 4y(q). Let r be u(s). Is r equal to -1? False Suppose -2w = -w - 5z - 29, -2 = 2w + 2z. Which is bigger: 5 or w? 5 Suppose 0 = -2p + 2h + 44, 11 = -2p - 5h + 62. Is 20 smaller than p? True Suppose 4w = -5d + 21, 3d - 9 = 4w + 2d. Is w at least as big as -1? True Suppose o = 3o + 24. Which is greater: o or -13? o Let d = 0.4 + -3.4. Which is smaller: 1 or d? d Suppose -2i + 4r = 18, -i - 3i + 2r = 12. Let p(g) = 2g - 7. Let z be p(7). Suppose 0 = -4x - z - 5. Is x bigger than i? False Let q be (-8)/6 + (-1)/(-3). Let h be (-2)/(-8)(-5)/((-45)/(-8)). Is q >= h? False Let b = -7 - -18. Suppose -5i - 31 = -b. Which is smaller: -3 or i? i Let g = -15/7 + 83/42. Suppose -3*i + d + 3 =	{ "pile_set_name": "DM Mathematics" }
733/5. Let z be (-2)/(160/(-52) + 3). Let k be z/(-117) + 10/18. Are k and t nonequal? True Let r(c) = c + 8. Let d be r(-5). Suppose 0 = -2k + d + 27. Which is smaller: 16 or k? k Let n(p) = p3 + 5p*2 - 6p + 2. Let f be n(-6). Suppose fx = -x - 63. Let s be (3/(-9))/(x/(-18)). Which is greater: 1 or s? 1 Suppose -185 = -5j + 5q - 0q, 0 = -3j - 2q + 91. Let x be (11/j)/((-8)/(-66)). Which is smaller: x or 3? x Suppose 6r - 4r = 2100. Let z be (-880)/r + 2/3. Which is smaller: z or -1? -1 Let i = 537 + -542. Which is greater: i or 32? 32 Let d = -94 - -97. Let g be d - (-134)/(-130) - 2/1. Which is bigger: -1 or g? g Let f(i) = 3i - 12. Let b be f(5). Suppose c = -bc + 56. Suppose -2r - c = -12. Is r greater than or equal to -1? True Let o = 89.7 - 89.86. Which is smaller: 0.18 or o? o Let d = -2 + 10. Let v = 16 + -23.8. Let x = v + d. Which is bigger: x or -3? x Let v = -136.9 - -144. Let x = -7 + v. Suppose -6a = -2a - 24. Is x >= a? False Let k = -1614 + 1594. Which is smaller: -4 or k? k Let x = -160 - 4. Which is smaller: x or -165? -165 Let j be 2838/(-6) + 0 + 0/6. Which is bigger: -471 or j? -471 Let d be 20/(-6)12/(-10). Suppose db + 35 = -b. Let w be 24/(-8) + -1. Which is bigger: w or b? w Suppose 0 = -3y, -3j - 9 = y - 0y. Let g = j + 4. Let p be (-8)/52 + 15/13. Is p at least as big as g? True Let i(f) = 4f. Let v be i(1). Suppose -2s - 4d - 104 = -4s, 4d = vs - 212. Suppose 5q = -3z + 40, 4 - s = -5q - 5z. Is q at most -1? False Suppose -2o - 22 = 4u, o + 5 = -4o. Let x(s) = -4s3 + 2s*3 + 5 - 5s*2 + 8s + s3. Let c be x(-6). Which is bigger: u or c? u Let p be ((-18)/5)/((-3)/(-15)). Let j(y) = -y3 - 19y2 - 18y + 3. Let r be j(p). Which is bigger: 0 or r? r Suppose -6m = 40 + 158. Let b be 6/m - (-70)/22. Let t = -5 + 8. Is t less than or equal to b? True Let l be (-160)/(-100)(-2)/810. Are -27/5 and l unequal? True Let n be ((-10)/6)/(17/(-51)). Suppose 5b = 20, ng + 2b + 2 - 5 = 0. Let r be (-7)/4 + g/4. Which is smaller: r or 0.03? r Let s be (-2)/(-4) - 9/(-2). Suppose 0g - 5g = 0. Suppose ga + s = 5a. Is a > 1? False Let q be (9/(-2))/((-15)/40). Which is greater: 5 or q? q Let t(f) = f*3 - 4f*2 + 3f + 4. Let r be t(3). Which is smaller: 1.4 or r? 1.4 Let o = 456 + -592. Is o greater than or equal to -136? True Let p be (530/8 + -10)4. Which is smaller: p or 226? p Suppose -z = -2q + 55, -5z + 5q = -94 + 344. Let n be (-16)/(-10)z/27. Let b(t) = -2t*2 - 2t + 1. Let p be b(-2). Which is smaller: p or n? p Suppose -5m = -9m - 16. Suppose 6f = 3f - 6. Let t(u) = -u*3 - 4u*2 + 2. Let k be t(f). Which is smaller: k or m? k Suppose -5n - w = -6w - 50, -2n + 24 = -3w. Suppose 0u = -nu - 354. Is -60 smaller than u? True Suppose 2r + r - 3 = 0. Let h be r + 0 + (-9)/3. Which is bigger: h or -0.6? -0.6 Let q = -3 - -3. Let i = 57 + -22. Let d = -104/3 + i. Is d less than q? False Let z(f) = 9f2 + 199f - 28. Let j be z(-22). Which is smaller: -11 or j? j Let j = 5 - 3. Let l be (j/5)/(2/110). Suppose s - l = -s. Is 11 bigger than s? False Let j be 3/((-183)/36 - (-55)/11). Which is bigger: -32 or j? -32 Let k be (-56)/26 + 2 - 372/(-52). Suppose 8o = o + k. Which is greater: 2 or o? 2 Let k(n) be the second derivative of n5/20 - n4 + 13n*3/3 + 9n*2/2 - 2n. Let f be k(9). Which is smaller: f or -7/6? -7/6 Suppose 5o + 33 + 17 = 0. Let v be 110/(-6) - 2/(-6). Let f = v - o. Which is smaller: -9 or f? -9 Let x = 11 - 36. Let j = -25 - x. Suppose 2c - 2 + j = 0. Which is greater: 2 or c? 2 Let p(w) = -w*3 - 3w*2 + 3w - 1. Let i be -6(7/(-3) + 3). Let o be p(i). Which is smaller: 1 or o? 1 Let r(o) = -o3 - 4o*2 + 6o - 2. Let f be r(-5). Let t = 5 + f. Let s be (t/(-5))/((-2)/4). Which is smaller: s or -2? -2 Let o = -41 + 28. Let v be 4 + -58 + -1 + -1. Let k be (v/20)/((-1)/(-5)). Is o at most k? False Suppose q - 5z - 31 = -3q, -3z - 9 = 0. Suppose -qt = 3a + t + 34, -5a + 10 = -5t. Let m = 17 + a. Is 14 >= m? True Let d = -42/3865 - -21018416/50245. Let n = 418 - d. Suppose -2j - 2h = h - 6, 3j - 6 = -3h. Which is smaller: n or j? n Let v = 2/79 + 152/237. Let j be 10/1 + -12 + 11. Let q(r) = 2r*2 - 19r + 5. Let z be q(j). Does v = z? False Let q(m) = -11m2 + 4m + 2. Suppose 19v - 24v - 10 = 0. Let x be q(v). Is -49 less than x? False Suppose j + 3 + 0 = 0. Let i = 4 + j. Let r(s) = -2s3 - 81s*2 + 42s + 42. Let w be r(-41). Is i >= w? True Suppose 2n = -2, b + 4b + 3n - 12 = 0. Suppose -2j + o = -bo + 16, -12 = -5j - 3o. Suppose jq = q. Is q at least as big as 0? True Let n be -2 - 0 - (-3)/((-6)/(-20)). Let g be n/9053/18. Which is smaller: g or 1? g Suppose -6t + 112 = 1336. Which is greater: t or -203? -203 Let b(x) = 5x*2 + 56x - 13. Let v be b(-13). Which is greater: 100 or v? v Let y = -1993 - -3003. Which is smaller: y or -1? -1 Let s be (27/(-6))/(3/(-6)). Let g = 6 - s. Are 0 and g equal? False Let w = 3.09 + -0.09. Let j = -6 + 5.6. Let m = -0.3 - j. Which is bigger: w or m? w Let f be (-133)/(-9) + (-6)/(-27). Let w = -14 + f. Let l be ((-4)/25)/(54/(-15)). Which is smaller: l or w? l Let a = 0.172 - 0.242. Let v = 0.14 + -0.74. Does a = v? False Let u = -9100 + 9125.162. Let o = u - -0.038. Let v = o - 25. Is 1 != v? True Let t be 2/(-8) - 7/(-12). Let a(n) = -4n2 - 16n + 28. Let w(v) = 3v2 + 16v - 28. Let z(b) = -4a(b) - 5w(b). Let d be z(14). Is t < d? False Let f = -59 - -20. Let j = f + 119/3. Which is smaller: 2 or j? j Let v = 22.973 + 0.027. Let g = v + -7. Let o = g + -16.2. Is o <= -2? False Suppose 2g - r = g - 1102, g + 1114 = 5r. Which is bigger: g or -1098? -1098 Let v be (-2)/1 - -91. Let t = -3 + v. Let o = t - 5. Is o less than 1/3? True Let f(a) = -14a + 281. Let t be f(28). Is t bigger than 2? False Let o be -8 + (9 - 5) + 1. Is o greater than -2? False Let s = -78.911 + -0.089. Let c = 91 + s. Are 1 and c equal? False Let y = 3 + -19/7. Let j(v) = 25v + 1. Let n be j(3). Suppose -4a - 4w - n = 0, 2a + a + 49 = 5w. Is y less than a? False Let p(m) = -m2 - 13m - 12. Let x be p(-12). Suppose -6 - 6 = -2a. Suppose -2f - 2 - a = x. Are -3 and f equal? False Let d(k) = 75k - 11. Let f be d(-4). Is 1/4 >= f? True Let d(r) = r + 8. Let q be d(-8). Let s be (1 + q)0/(-8). Let v be (s - -4) + 1 + -4. Does 2/13 = v? False Let z = 24.9 + 8.1. Let f = 22 - z. Which is smaller: -1 or f? f Let p = -4 + 12. Suppose 5 = 3y - py - 4v, -v - 1 = y. Which is bigger: 1/134 or y? 1/134 Let v(q) = -2q*2 + 60q - 60. Let x be v(29). Which is bigger: x or -2/3? -2/3 Let x = 14 - 23. Let f be 3 + x(-1)/(-4). Suppose -q - 3q + 8 = 0. Which is greater: q or f? q Let b = 8 + -7.8. Let c = 0.5 - b. Let f = -0.5 + c. Is 0 less than f? False Let c be -427/180 - (-94)/165. Are -1 and c equal? False Let r = -31/106 - -28289/318. Do r and 89 have the same value? False Let t be 40/(5/1) + -7. Which is smaller: -9/41 or t? -9/41 Let t be (-203)/(-7 + (-20)/(-3)). Is 610 bigger than t? True Suppose -3u + 0u - q - 13 = 0, -4u - 39 = -3q. Let k(d) = -d2 - 5d - 5. Let g be k(-5). Is g != u? True Let o = 382 - 383. Is -5/23 greater than o? True Let n = -25 - -19. Let x = 18 - n. Suppose 2l + x = -3o + 4o, -4l = 5o + 34. Is l at least -10? False Let d = -477 - -472. Let r = 0.3 - -0.7. Does r = d? False Let u = 634 - 641. Which is greater: u or -23? u Suppose 84 + 3 = -29q. Let r(i) = -i*3 - 4i*2 - 2i - 2. Let k be r(-3). Which is smaller: k or q? k Let l be 3 - (100/(-3))/(-10). Which is smaller: l or -1.8? -1.8 Let u be 33/(-9) + 22. Let m(n) = -un - 2 + 20n - 8 - 5. Let r be m(-15). Which is smaller: -20 or r? -20 Suppose 4a - 2802 = -3h, 35a - 697 = 34a + h. Which is smaller: 700 or a? a Let k = 668 + -647. Is k <= 18? False Let j = -124/35 - -37/14. Which is greater: 2/21 or j? 2/21 Let z = 37 + -62. Let l = -25.4 - z. Is l > -1/4? False Let v = -99971 + -418231. Let t = v - -16590399/32. Let y = 248 - t. Are 0 and y equal? False Let i(c) be the first derivative of c4/4 - 11c*3/3 + 4c + 12. Let u be i(11). Let y be (u/3)/(5/(-15)). Do 1 and y have different values? True Let u = -133/1020 - 1/340. Let d(z) = -z*3 - 6z**2 - 5	{ "pile_set_name": "DM Mathematics" }
n be a(5). Let i(k) be the first derivative of k3/3 + k2/2 + 6707. Let l(b) = -4b2 - 7b - 2. Give nl(w) + 5i(w). w*2 - 2w - 2 Let s(j) = 2j3 - 2j*2 + 2j - 29. Let u(f) = 2f3 - 3f*2 + 3f - 30. Suppose -51c - 14 = -54c - 5y, -5c - 5y + 10 = 0. Give cu(q) + 3s(q). 2q*3 - 27 Let p(d) = -6d - 8. Let v(l) = 7l - 7. Let i(y) = -8y + 14. Let c(b) = 2i(b) + 3v(b). Give -7c(x) - 6p(x). x - 1 Let m(o) = -2o2 - 2o - 5. Let z(l) = -55l + 5 + l2 + 56l + 0 - 2. Let f be (-1)/2(49 - 9). Let s be (-9)/(-15) + (-88)/f. Determine sz(y) + 3m(y). -y2 - y Let k(b) = 73b + 4. Let x(m) = 145m + 7. Give -5k(f) + 2x(f). -75f - 6 Let k(t) = -1081t - 161. Let d(x) be the third derivative of -5x4/6 - x3/2 + 2x2 + 421x - 2. Determine 161d(l) - 3k(l). 23l Let s(n) be the second derivative of -3n5/20 - n4/6 + n*3/3 + 7n*2/2 + 2n + 1234. Let c(y) = -5y3 - 4y*2 + 3y + 13. Give -4c(i) + 7s(i). -i*3 + 2i*2 + 2i - 3 Let f(n) = -39n. Let i(s) be the first derivative of -10s*2 + 597. Determine -6f(h) + 13i(h). -26h Let f(b) = 767b + 2. Let u(c) = -6c. What is f(h) + 2u(h)? 755h + 2 Let p(l) = -5l2 - 4l + 4. Let u(w) = -w*2 - w + 1. Suppose k - 2 = -3g, 2g + k = g - 2. Let s be 1/(-2) + (-3)/g. Let j = 3 + s. What is jp(v) - 4u(v)? -v2 Let g(x) = -4921x + 130. Let v(q) = 984q - 24. Calculate -2g(w) - 11v(w). -982w + 4 Let s(h) = h*3 + 2h + 1. Let u(i) = 4i3 - 2i*2 - 100i + 5. What is -5s(f) + u(f)? -f3 - 2f*2 - 110f Let j(l) = -60l3 - 17l*2 + 53l + 34. Let z(h) = -21h3 - 6h*2 + 17h + 12. What is -6j(m) + 17z(m)? 3m3 - 29m Let h(m) be the first derivative of -m2/2 + m + 943. Let t(f) = -f3 + 4f - 4. Determine -4h(c) - t(c). c*3 Let n(i) be the second derivative of 2i3/3 - i2/2 - 1483i. Let a(w) = 4w - 1. Determine 4a(u) - 6n(u). -8u + 2 Let l(t) = -4t*2 - 5t - 3. Let f = -2622 - -2624. Let u(q) = q*2 + q + 1. Calculate fl(r) + 9u(r). r2 - r + 3 Let l(h) = 7h - 1. Let w(m) be the second derivative of 10m3/3 - 3m*2/2 - 3m - 58. Calculate -17l(u) + 6w(u). u - 1 Suppose 3w - z - 1 = 3z, 4 = -2w - 2z. Let n(r) = r. Suppose 3v = -2v + 25. Let y(k) = 0 - 4 - 3 + v. Determine wy(f) + 3n(f). 3f + 2 Let w(v) = 10v*3 + 67v*2 - 9v - 117. Let l(m) = -5m3 - 33m*2 + 4m + 52. Calculate -9l(h) - 4w(h). 5h3 + 29h*2 Let v(x) = 8x*2 - 6x - 18. Let j(i) = -10i2 + 8i + 18. Calculate -2j(c) - 3v(c). -4c2 + 2c + 18 Let m(s) = -27s3 + 4s*2 + 17s + 8. Let n(f) = -5f3 + f2 - f + 1. What is -m(v) + 4n(v)? 7v3 - 21v - 4 Let s(h) = 3h2 - 2h + 1. Let f(g) = 8g2 - 6g + 3. Let k(o) = -22o2 + 216o + 44. Let b be k(10). Calculate bf(i) - 11s(i). -i*2 - 2i + 1 Let g = -128 + 132. Suppose -15b + 11 = -gb. Let x(o) = 2o - 1. Let p(w) = 3. Let f(y) = -1. Let d(a) = 8f(a) + 3p(a). Give bx(c) + d(c). 2c Let s(z) = -3z*2 + 2z + 5z2 + z - z3 - z. Let r(p) = -2p*3 + 4p*2 + 4p. Let i = 5764 - 5777. Let f = -7 + 13. Give fr(g) + is(g). g*3 - 2g*2 - 2g Let l = -31 - -36. Let k be 6/l(-45)/27. Let a(q) = -q3 - 3q2 - 3. Let i(b) = b2 + 1. Determine ka(u) - 6i(u). 2u3 Let k(i) be the third derivative of -i6/24 + i5/10 - 7i*4/24 - 11i*3/6 - 3i*2 + 284i. Let t(v) = v3 - v2 + v + 1. Determine -k(u) - 6t(u). -u3 + u + 5 Let r(b) = -5b*3 - 6b*2 - 6b. Let s(g) = 11g3 + 11g*2 + 11g. Suppose -37t + 234 = 2t. Give ts(h) + 11r(h). 11h3 Let r(m) = -2. Let d(v) = 3427v + 11. Determine -d(j) - 5r(j). -3427j - 1 Let b(q) = 4q3 - 30q + 14. Let z(r) = -2r2 - 12r + 57. Let i be z(-9). Let o(g) = -g*3 + 6g - 3. Calculate ib(c) + 14o(c). -2c3 - 6c Let p(d) = -d*2 + 2d. Let r(b) = 21b2 - 6b + 29. Give -3p(u) - r(u). -18u*2 - 29 Suppose -6j - 270 = -16j. Let k be (-1 - (-818)/(-6))j/(-18). Let r(g) = 206g - g2 + 0 + 1 - kg. Let b(u) = 6u2 + u - 3. Give -b(s) - 3r(s). -3s2 - s Let j(o) = 5o + 43. Let d be j(3). Let p(y) = -62 - 3y - d + 115. Let b(w) = 2w + 4. Give -5b(l) - 4p(l). 2l Let k = 163 - 135. Let m be 1/2k/(-14). Let h(i) = -1. Let y(d) = -4d2 - 6. Calculate my(g) + 6h(g). 4g*2 Let g(x) = x + 8. Suppose 13p - 4p = -900. Let v = -96 - p. Let i(d) = 1. Give vi(c) - g(c). -c - 4 Let c(x) = 543x3 - x2 - 9. Let n(z) = -1086z*3 + 2z*2 + 21. Determine -14c(k) - 6n(k). -1086k*3 + 2k2 Let y(m) = -m - 1. Let i(g) be the second derivative of g3/2 + 3g2 + 2g + 6. Suppose 49c - 9 = 40. Give ci(r) + 4y(r). -r + 2 Let o(y) = -y2 + 10y - 7. Let i be o(9). Let l(a) = a*2 - 1. Let s(p) = 6p*2 - 3. Suppose -24c = 8147 + 3109. Let u = -475 - c. What is is(m) + ul(m)? 6m2 Let n(x) = -6x + 46. Let y(f) = 16f - 47. What is -4n(w) - 5y(w)? -56w + 51 Let x(l) = -l*2 - 3l + 2. Let t(g) = 3g2 + 10g - 7. Let z(u) = -u - 2 - 20u3 + 18u*3 - 38u*2 + 34u*2 + 2u. Let b be z(0). Give bt(i) - 7x(i). i*2 + i Let u(q) = -3q*3 + 2q - 120. Let r(v) = 6v3 - 5v + 239. What is 2r(a) + 5u(a)? -3a3 - 122 Let c(f) = -3f + 9. Suppose 0 = 4x + 34 - 94. Let m(u) = 5 - 22u + 35u - xu. Determine 3c(o) - 5m(o). o + 2 Let u(w) = -464w + 1. Let y(t) = 482t - 1. Give -5u(i) - 4y(i). 392i - 1 Let q(d) = d3 - d2 - 4. Let n(a) = -a3 + 4a*2 - 382a + 18. Determine -n(w) - 4q(w). -3w*3 + 382w - 2 Let u(s) = -s - 2. Let j(f) = f - 1. Let p(w) = -j(w) - 5u(w). Let o(y) = -2y - 5. Calculate 5o(h) + 2p(h). -2h - 3 Let m(r) be the second derivative of -5r*3/6 - 3r*2/2 + 6r. Suppose 53 = 15f - 2 - 20. Let q(d) = 9d + 6. Calculate fm(j) + 3q(j). 2j + 3 Let z(f) = -f3 - 14f. Let p(y) be the third derivative of -y*6/24 - 23y*4/8 + 1526y*2. What is -2p(n) + 11z(n)? -n3 - 16n Let l(k) = -91k3 - 3k*2 - 19k - 13. Let a(o) = -181o3 - 5o*2 - 33o - 23. Calculate -4a(s) + 7l(s). 87s3 - s2 - s + 1 Let x(b) = 2b - 38. Let d(f) = -15f - 1657. Give -d(w) - 4x(w). 7w + 1809 Let g(q) = -2q - 4. Let r(b) be the second derivative of -b*3/3 - 5b*2/2 - 205b + 1. What is -6g(c) + 4r(c)? 4c + 4 Let n = -23 + 28. Let q(y) = 4y + 2. Let i(a) be the first derivative of 3a2/2 + a - 439. Determine ni(d) - 4q(d). -d - 3 Let i(u) = -4. Let m(l) = -729l + 14580. Give 7290i(j) + 2m(j). -1458j Let g(s) = -9s*2 + 5s. Let o(a) = -5a2 + 11a - 181. Let t(l) = l*2 - 2l + 33. Let c(w) = -2o(w) - 11t(w). Determine -2c(u) + g(u). -7u*2 + 5u + 2 Let z(o) = 9o2 - 8o + 5. Let c(j) = j*2 + 12j + 15. Let m(s) = 8s + 9. Let n(t) = -5c(t) + 8m(t). Give 11n(l) + 6z(l). -l2 - 4l - 3 Let j(i) = 38i + 55. Let v(f) = 38f + 27. Determine 2j(p) - 3v(p). -38p + 29 Let u(s) = 488s - 3. Let w(g) = -1459g + 8. What is -11u(x) - 4w(x)? 468x + 1 Let f(x) = -10x3 - 12x - 6610. Let g(j) = 8j3 + 10j + 6609. Calculate -5f(a) - 6g(a). 2a3 - 6604 Let l = -11 + 6. Let u(p) = 4 + 245p*2 - 28p3 - p3 - 7 - 7 + 15 - 250p2. Let i(q) = 14q*3 + 2q*2 - 2. Determine li(s) - 2u(s). -12s*3 Let j(g) = -252g + 724. Let z(l) = -164l + 483. Calculate 5j(y) - 8z(y). 52y - 244 Let w(t) = -5t - 101. Let v(f) = -10f - 216. Calculate -4v(j) + 9w(j). -5j - 45 Let g(n) = -28n - 12. Let v(i) = 269i - 9 + 1 - 288i. Let o(k) = 5g(k) - 7v(k). Let u(r) = 6r + 4. Calculate 4o(b) + 5u(b). 2b + 4 Let l(q) be the first derivative of -27q2/2 + 3q + 4008. Let n(y) = -352y + 40. What is -40l(k) + 3n(k)? 24k Let v(u) = -15. Let k(c) = c + 11. Let p(d) = 3k(d) + 2v(d). Let n(o) = 16o + 14. Determine 4n(t) - 22p(t). -2t - 10 Let w = -7 + 4. Let o(g) = -g*2 + 3g - 3. Let b(z) be the first derivative of -2z3/3 + 2z*2 - 4z - 47005. Give wo(l) + 2b(l). -l*2 - l + 1 Let c(j) be the second derivative of -5j4/6 - j3/6 - j*2 + 86j - 4. Let d(g) = -g*2 - 1. Determine c(u) - 4d(u). -6u2 - u + 2 Let g(i) = -10i - 7. Let l(h) = -h + 7. Let r(q) = -2q + 1. Let p be r(-2). Let m be l(p). Let d be m - 86/(-4). Let k(a) = 3a + 2. What is dk(o) + 4g(o)? 2o Let r(y) = 35y3 - 3y2. Let w(l) be the third derivative of -l5/60 - l*3/6 + 13262l	{ "pile_set_name": "DM Mathematics" }
sing order. -40, -5, -2, 4 Sort 10, -16, 16 in ascending order. -16, 10, 16 Sort -0.3, 163, 14/3, -5. -5, -0.3, 14/3, 163 Sort -43, 5, 43, -0.3. -43, -0.3, 5, 43 Put 0.2, 12, -1.8 in descending order. 12, 0.2, -1.8 Put -26, 0, -2 in decreasing order. 0, -2, -26 Sort -1, 3, 5, 0. -1, 0, 3, 5 Put 5, 201, -6 in descending order. 201, 5, -6 Put -3, 5, 0, 1, 148 in ascending order. -3, 0, 1, 5, 148 Put -28, -1, -5, 5 in increasing order. -28, -5, -1, 5 Sort -9, 3, -4, -2 in descending order. 3, -2, -4, -9 Put -8, 6, 3, 27 in decreasing order. 27, 6, 3, -8 Put 7, -10, -3 in descending order. 7, -3, -10 Sort -36, 2/5, -5, 5 in increasing order. -36, -5, 2/5, 5 Sort -12, -1, 6, 0 in decreasing order. 6, 0, -1, -12 Sort 2, 1, 1/2, -3. -3, 1/2, 1, 2 Put 2, 1, 0, 4, 1042 in ascending order. 0, 1, 2, 4, 1042 Put -8, -4, -5 in descending order. -4, -5, -8 Put -15, 1, -5, 4 in decreasing order. 4, 1, -5, -15 Sort 5, -10, 71, 3, 1 in decreasing order. 71, 5, 3, 1, -10 Sort 5, 4, 0.2, -3 in ascending order. -3, 0.2, 4, 5 Sort 0.5, -1, -1/70, -0.4, -29 in increasing order. -29, -1, -0.4, -1/70, 0.5 Sort -5, -3, 0.62, 3. -5, -3, 0.62, 3 Sort 2, -0.9, 3, -4/7, -0.15 in ascending order. -0.9, -4/7, -0.15, 2, 3 Sort 0.03479, -2/7, -0.2 in decreasing order. 0.03479, -0.2, -2/7 Put -9, 8, -5, 0 in ascending order. -9, -5, 0, 8 Sort 4, -5, -4, -40. -40, -5, -4, 4 Put 4, 5, -162, -11 in descending order. 5, 4, -11, -162 Put -26, -3/7, -0.08, -0.4 in increasing order. -26, -3/7, -0.4, -0.08 Sort -4, 2, 3, -78 in descending order. 3, 2, -4, -78 Sort -5, -710, 4 in descending order. 4, -5, -710 Sort 10, 7, 4, -3 in decreasing order. 10, 7, 4, -3 Sort -2, 4, -66. -66, -2, 4 Sort 6, 0.5, 122/5 in decreasing order. 122/5, 6, 0.5 Sort -4, 20, -3/5, 1/6, 2 in descending order. 20, 2, 1/6, -3/5, -4 Sort -2, -228, 4, -3 in increasing order. -228, -3, -2, 4 Sort 0.66, -3, -0.5 in decreasing order. 0.66, -0.5, -3 Sort 2, -7, -5, 0, 3 in descending order. 3, 2, 0, -5, -7 Put 2, -9.6, -1, 1/4 in increasing order. -9.6, -1, 1/4, 2 Put -0.4, 51/5, 0.2 in decreasing order. 51/5, 0.2, -0.4 Sort -2, 3, 5, 14 in decreasing order. 14, 5, 3, -2 Put 3, -18, -2/3, 0.3 in ascending order. -18, -2/3, 0.3, 3 Sort 5, 1, 53, 0.1 in decreasing order. 53, 5, 1, 0.1 Sort 3, 0, -3, 230 in increasing order. -3, 0, 3, 230 Put -0.3, 20/209, -5 in increasing order. -5, -0.3, 20/209 Sort 5, -5, 14. -5, 5, 14 Put 4, 73, -4, 0 in descending order. 73, 4, 0, -4 Sort -2.207, 1/3, 2/3. -2.207, 1/3, 2/3 Put 0.4, -1/17, 5/6, 3/2, -4 in increasing order. -4, -1/17, 0.4, 5/6, 3/2 Sort 2/3, -0.2, 2, 4.3, -1 in ascending order. -1, -0.2, 2/3, 2, 4.3 Put 13/5, 1/7, -2, -2/5, 2/5 in descending order. 13/5, 2/5, 1/7, -2/5, -2 Sort -4, 2/3, -2/5, -1, -7 in increasing order. -7, -4, -1, -2/5, 2/3 Sort -3, 3, -5, -108 in ascending order. -108, -5, -3, 3 Put 6, -15, 5 in decreasing order. 6, 5, -15 Put 2, -4, -1, 67 in decreasing order. 67, 2, -1, -4 Sort 0.3, 0.004, 2/3, -1/5, -5. -5, -1/5, 0.004, 0.3, 2/3 Sort 1/7, -2, -15. -15, -2, 1/7 Put 5, 8, -5, -4 in ascending order. -5, -4, 5, 8 Sort -2, -12, -4, -1 in descending order. -1, -2, -4, -12 Sort 3, 73, -35 in increasing order. -35, 3, 73 Sort -12, -5, -6, 4 in ascending order. -12, -6, -5, 4 Sort -2/3, -0.1, 41, -1 in descending order. 41, -0.1, -2/3, -1 Put 5, -5, 34 in descending order. 34, 5, -5 Sort 1, -92, -9. -92, -9, 1 Sort 1, -233, -2/29 in increasing order. -233, -2/29, 1 Sort -0.1423, -0.3, 0.2, -7 in ascending order. -7, -0.3, -0.1423, 0.2 Put -2, 11.4, -5, 3 in decreasing order. 11.4, 3, -2, -5 Put -2, 3, 25, 5 in increasing order. -2, 3, 5, 25 Put -25, -3, 2 in descending order. 2, -3, -25 Sort -16, 2, -3, -1 in ascending order. -16, -3, -1, 2 Sort 0, 3, -14, 5, -2 in decreasing order. 5, 3, 0, -2, -14 Put 4, -1279, -1 in increasing order. -1279, -1, 4 Sort 70, 1, -4 in increasing order. -4, 1, 70 Sort -0.5, -4, 3/16, -0.2, 5 in decreasing order. 5, 3/16, -0.2, -0.5, -4 Sort -2, -64, 4, 29, 5. -64, -2, 4, 5, 29 Sort 4, 20, 2, -4 in increasing order. -4, 2, 4, 20 Sort 15, 30, 4 in decreasing order. 30, 15, 4 Put 1, 109, -4, -2 in descending order. 109, 1, -2, -4 Sort 3, -3, 0.69, -1. -3, -1, 0.69, 3 Put -6, -2/3, 116 in descending order. 116, -2/3, -6 Put -2, -24, -1/5, 5 in decreasing order. 5, -1/5, -2, -24 Sort 0, -5, 12 in decreasing order. 12, 0, -5 Sort 3, 0, 12, 2, -2 in ascending order. -2, 0, 2, 3, 12 Sort -2, 9, 5 in decreasing order. 9, 5, -2 Put -2, -8, 2, 4, -6 in ascending order. -8, -6, -2, 2, 4 Sort 0, -7, 2, 312, 5. -7, 0, 2, 5, 312 Sort -23, 2, -9 in decreasing order. 2, -9, -23 Sort 5, -5, -44 in decreasing order. 5, -5, -44 Sort 329, -1, 3 in descending order. 329, 3, -1 Sort 4, -35, -5, 5 in decreasing order. 5, 4, -5, -35 Sort -34, -6, 0 in descending order. 0, -6, -34 Sort 2/23, 95, 2/7. 2/23, 2/7, 95 Put 1, 9, 3, -5, 5 in descending order. 9, 5, 3, 1, -5 Sort 2, 7, 12, 4 in descending order. 12, 7, 4, 2 Put -3, -0.4, 0.4, -54 in decreasing order. 0.4, -0.4, -3, -54 Sort -3, -5, 416 in decreasing order. 416, -3, -5 Sort -3, 105, 2. -3, 2, 105 Put 51, -18, -1/9 in descending order. 51, -1/9, -18 Sort -5, -2, -1/15 in decreasing order. -1/15, -2, -5 Sort 1, -4, 68 in increasing order. -4, 1, 68 Put 1, -179, -4 in descending order. 1, -4, -179 Sort 0, 2, 17, -8. -8, 0, 2, 17 Put -1/6, 24, 0.31, -0.1 in ascending order. -1/6, -0.1, 0.31, 24 Sort -2, -3, 0 in increasing order. -3, -2, 0 Sort -4, -5, 5, 103. -5, -4, 5, 103 Sort 2, -2/7, -6/7, -6/5 in ascending order. -6/5, -6/7, -2/7, 2 Put -3, 6, 1, -18 in ascending order. -18, -3, 1, 6 Put 0.2, 6, -2, -1 in increasing order. -2, -1, 0.2, 6 Sort 210, -2, 2 in descending order. 210, 2, -2 Put -4, 26, -35 in descending order. 26, -4, -35 Sort -2, 5, 36, -4. -4, -2, 5, 36 Put 17, 0, -0.1, 70 in descending order. 70, 17, 0, -0.1 Put -5, -14, -1/3, 1 in increasing order. -14, -5, -1/3, 1 Sort 7, 2, -112 in decreasing order. 7, 2, -112 Sort 2/69, 4, 0.2 in ascending order. 2/69, 0.2, 4 Put 11, 15, -5, -3 in ascending order. -5, -3, 11, 15 Sort -2/7, -0.1, -1 in decreasing order. -0.1, -2/7, -1 Sort 3, -6, -4, 13. -6, -4, 3, 13 Sort 4, -5, -4, 25, -3 in descending order. 25, 4, -3, -4, -5 Sort -5/8, -2, 0. -2, -5/8, 0 Sort -1, 227, 12, -2 in descending order. 227, 12, -1, -2 Put 2/17, -3, 0, 1/4 in descending order. 1/4, 2/17, 0, -3 Sort -0.3, -279, 2/21. -279, -0.3, 2/21 Put -17, 5, 1 in ascending order. -17, 1, 5 Put 15, 3/8, -4, -2 in descending order. 15, 3/8, -2, -4 Sort 8, 3, 31, 4. 3, 4, 8, 31 Put -0.021, 1/6, 1/4 in increasing order. -0.021, 1/6, 1/4 Sort -0.1, -7/20, 1, -0.12 in decreasing order. 1, -0.1, -0.12, -7/20 Put 95, 1/5, -1 in ascending order. -1, 1/5, 95 Put 0.5, -2, -0.23, -1/4 in descending order. 0.5, -0.23, -1/4, -2 Put -1/5, -1023, -1 in descending order. -1/5, -1, -1023 Put 0, -1, 16 in decreasing order. 16, 0, -1 Sort -0.12, -3, -42 in increasing order. -42, -3, -0.12 Put -0.4, -0.2, 0.05, 1, 4 in increasing order. -0.4, -0.2, 0.05, 1, 4 Sort 0, -1.5, -2/145 in increasing order. -1.5, -2/145, 0 Sort -2/5, 0.4, 22/3, -3 in increasing order. -3, -2/5, 0.4, 22/3 Put 0, 1, 5, 4 in ascending order. 0, 1, 4, 5 Sort -5, 5, -2700 in decreasing order. 5, -5, -2700 Sort -3, 1601, -2, -1. -3, -2, -1, 1601 Sort -2, 3, 90. -2, 3, 90 Put -10, -4, 63 in decreasing order. 63, -4, -10 Put 0, 1, -3, -361 in decreasing order. 1, 0, -3, -361 Sort -0.2, 2, -558.7 in ascending order. -558.7, -0.2, 2 Put -4513, 2, -3 in descending order. 2, -3, -4513 Put 0, -5, -0.37, -0.5 in increasing order. -5, -0.5, -0.37, 0 Sort -5971, 0, 4. -5971, 0, 4 Put 633, 4, -5, 0 in decreasing order. 633, 4, 0, -5 Sort -0.3, -2/33, -1/6. -0.3, -1/6, -2/33 Put -24, -2, 4, -3 in decreasing order. 4, -2, -3, -24 Sort 2/7, 0.4, 1/23, 0 in ascending order. 0, 1/23, 2/7, 0.4 Sort -3, 774, 2, -2 in descending order. 774, 2, -2, -3 Put -2/307, -0.5, 9 in increasing order. -0.5, -2/307, 9 Sort 5, 3, -4, -3, -7 in increasing order. -7, -4, -3, 3, 5 Sort 53, -3, 4 in ascending order. -3, 4, 53 Sort 19, 3, -97 in increasing order. -97, 3, 19 Put 1, -2, -2/5, -4/9 in ascending order. -2, -4/9, -2/5, 1 Sort -5, 3, 0, -4. -5, -4, 0, 3 Sort 3, -12.7, 10, -2, 4/5. -12.7, -2, 4/5, 3, 10 Sort 1, -1, -21 in decreasing order. 1,	{ "pile_set_name": "DM Mathematics" }
o). Let d be u(-3). Solve 0r = -r + d for r. 2 Let r be (-1 - -2)/(10/4 - 2). Let s(c) = rc - 5 + 12 + 9 + 6. Let l be s(-11). Solve lv - 5 = -v for v. 5 Suppose 193 = 15p - 617. Let q = p - 35. Solve 15 = -4i + q for i. 1 Let o(a) = -24a*3 + a. Let q be o(-1). Solve 0 = -qc + 97 + 64 for c. 7 Let w = 46 - 40. Let p(k) = -k*3 + 5k*2 + 8k - 8. Let l be p(w). Let j = 10 - 4. Solve 2 + j = lv for v. 2 Suppose -33z + 35z - 68 = 2k, 5k - 172 = -4z. Solve 48c - 60 = zc for c. 6 Let c be ((-36)/27)/(12/(-18)). Suppose -4r + cv = -82, 0 = -4v + v - 9. Solve 0 = -rj + 21j + 8 for j. -4 Let q be (0 - 1000)/((-4)/8). Suppose 0 = 18g + 2g + q. Let t = g - -102. Solve -3 = s - ts for s. 3 Let h(o) = -o*2 + 11o + 50. Let j be h(-5). Let x = -9 - j. Solve 19g + 10 = xg for g. 5 Let v be (86/4 - 18)(4 - 0). Suppose 0 = 5l - 3a - 70, 3a + v = -l + 2l. Solve 6r = lr - 16 for r. 2 Let y be (-8484)/(-2142) - 6/(-153). Solve -7o + 38 = -y for o. 6 Let a be (380/(-114))/((-1)/(-87)). Let k = a - -300. Solve -3 = 7o - ko for o. 1 Let h = 758 - 607. Solve 167j = hj + 64 for j. 4 Suppose -4z + 110 = 2a, -z + 14 + 18 = -4a. Suppose p = -5x + 68, 3p + 4x - 6x - 136 = 0. Solve z = -5s + p for s. 4 Suppose 0 = 103s - 13121 - 3668. Solve 8r + s - 179 = 0 for r. 2 Let i(b) = 4b - 54. Let f be i(26). Let n = -39 + f. Let o be 1 + n + (0 - (-2 - -4)). Solve 0 = -q + 3q - o for q. 5 Let o(p) = p*2 + 4p - 75. Let d be o(7). Suppose -3w = 2i + 4, -di - 2w - 2w = 8. Solve -i = 2u - 0u for u. -2 Suppose -5l = -3r + 15, -3r + 4 - 13 = 3l. Suppose -4j = -p - 78, -2 = -11p + 10p. Suppose -14 = -h + 2a, 3a + 5 + 6 = -h. Solve -ht + j = -rt for t. 5 Suppose -g = -s - 4s - 20, 0 = 2s + 8. Let d be 9 + ((-8)/10)/(1/5). Suppose 0 = -dl - 45 + 50. Solve 3h - l - 2 = g for h. 1 Suppose 121 = 5p + 46. Let d(s) = s2 - 13s - 24. Let z be d(p). Suppose t - 21 = -4c, zc - 2c = -5t + 25. Solve -f - c = -1 for f. -4 Suppose -3f + 9 = 2j - 1, 0 = 4j - 4f. Suppose -2v + 4y = -26, -jv - 6 = -7y + 11y. Let x be ((-1)/(-2))/(3/18). Solve vi - 10 = xi for i. 5 Let p(i) be the third derivative of -i4/6 + 8i*3/3 + 16i*2. Let s be p(0). Solve 0q - s = 4q for q. -4 Let q be (-1113)/(-212)344/6. Suppose -39s = -11 - q. Solve 6w + s = 38 for w. 5 Suppose 14015 = -156d + 25527 + 15164. Solve 0 = -5t - 151 + d for t. 4 Suppose -11j - 2 = -13. Let y be (-40)/(-8) - (j + -1)/2. Solve -yr + 8r - 3 = 0 for r. 1 Suppose 4g - 2g + 2 = 0. Let x be 14(0 - g). Suppose 115d + 73d = 3d - 3d. Solve 0 = xl - d + 20 for l. -5 Let s(u) = u*2 + 11u + 21. Let o be s(-14). Let x = o - 59. Let c be 4(-4)/14(-7)/x. Solve i + 0i = -c for i. -2 Suppose 0 = -4j - 5t + 12, 5j - 15 = 9t - 4t. Suppose -11 = -jq - 2r + 41, 0 = 3q - 4r - 76. Solve q = 4l - 0 for l. 5 Suppose -18w + 432 = 6w - 0w. Solve 12k + wk + 90 = 0 for k. -3 Let f = 12 + -9. Let i = -2 + 6. Suppose -16 = 4h, -12 = 3u + 5h - i. Solve ud = fd + 1 for d. 1 Let w(u) = u2 - 30u + 81. Let f be w(3). Solve -24o + 20o = f for o. 0 Let a(h) = h*2 - 7h + 25. Let l be a(4). Suppose -4b + b + l = -i, b = 2i + 1. Solve bn = 4n + 4 for n. 4 Let m be ((-74)/296)/((-2)/408) - -21. Solve mg = 21g - 192 for g. -6 Let u be -1 - (-10 - (-73)/(-1)). Solve -152 = -14d - u for d. 5 Suppose s = -2s + 12, 0 = -2y + 2s. Let i be 11 + (5 - 10 - -1). Suppose -iu = u - 176. Solve 6 = yb + u for b. -4 Let v(s) = s - 5. Let u be v(5). Let n = -567 + 287. Let z = -276 - n. Solve u = -zf - 0f + 4 for f. 1 Let l = 200 - -41. Let q = 245 - l. Solve -qw + 3 = -13 for w. 4 Let h = 43 - 39. Let b(y) = y*2 - 3y. Let t be b(h). Let k be 6/((-2)/t - -1). Solve -5j + 2 = k for j. -2 Let d = 6 + -149. Let g = -140 - d. Solve 5l - gl + 10 = 0 for l. -5 Let v be ((-5)/(-50))/((-49)/(-14210)). Solve vh + 24 = 37h for h. 3 Let t(y) = -2y2 + y + 12. Let r(h) = -h2 + 5. Let i(o) = -7r(o) + 3t(o). Let w be i(1). Solve -wk = -11k + 6 for k. 1 Suppose z = 2t - 25, -5t - 3z + 44 = -13. Solve 0 = -5i + t - 7 for i. 1 Suppose -4o + 13y - 17y = -16, -5o + y + 20 = 0. Suppose -12 = -20h + 19h. Solve -h - 4 = -oi for i. 4 Let b(k) = -9k - 2. Let q be b(-2). Suppose 6322 = 6x + 6262. Solve 6f + q = xf for f. 4 Let v(b) be the first derivative of b3/3 + 11b*2/2 - 10b - 2. Suppose 48 = -5a + 13j - 9j, -5j = 5a + 75. Let y be v(a). Solve -y = -2p + 3p for p. -2 Suppose 121q - 1040 = -87q. Solve -qt + 1521 = 1526 for t. -1 Let n(x) = -59x - 276. Let t be n(-5). Solve -t = 7d + 9 for d. -4 Suppose -5o - 286n + 4 = -285n, -5o - 12 = -3n. Solve o = -16z - 341 + 197 for z. -9 Suppose 0 = 8w + 16 - 16. Suppose w = c, -i = 5c - 4c + 1. Let k(h) = -5h - 5. Let j be k(i). Solve ja = a - 5 for a. 5 Let o = 27 - 7. Let a(p) = -6p - 15. Let m be a(-4). Suppose -16j = -17j + m. Solve jy = 5y + o for y. 5 Let h(q) = 6q - 266. Let z be h(30). Let l be (0(-2)/4)/(z + 90). Solve 2w + w + 3 = l for w. -1 Let m be (-3621)/(-22862) + 1/(-14) - (-711)/23. Solve -99o + 68 = -mo for o. 1 Let j(m) = -3m*2 + 36m. Let s be j(12). Suppose s = -10v + 21v. Solve -2c - 7 + 3 = v for c. -2 Let g = 196 - 105. Let o = 117 - g. Suppose -6w + o = 2. Solve w - 5 = -b for b. 1 Let c = -7 + 12. Suppose 2d - 5d + 25 = ch, 0 = d - 4h + 20. Suppose 5z + q + dq - 32 = 0, 0 = -3z - 4q + 26. Solve 3o + 3 = z for o. 1 Let d be (-12 - 2)125/(-7) - -1. Solve -8p + d - 161 = 0 for p. -5 Suppose -23x - 5f = -24x + 507, -x - 3f + 547 = 0. Solve -547p + xp - 60 = 0 for p. -4 Suppose -4h = -3a - 124 + 820, -5a + 1155 = -5h. Let b = a + -223. Solve 4j = 7 + b for j. 3 Let u = -85 + 86. Let c be -15u/10-2. Suppose 3g = h - 34, -g + 35 = 2h + 4g. Solve 2x = -cx + h for x. 5 Suppose -19i - 72 = -37i. Solve -6w = -iw + 2 for w. -1 Suppose -y + 127 = 3s, -7y - 107 = -3s - 3y. Let r = s - 25. Suppose 11q = rq - 45. Solve -5i - 4 = -q for i. 1 Let b(q) = q2 - 4q - 33. Let h be b(-8). Let s be h/14 + 12/(-8). Solve 5t - s = 7 for t. 2 Suppose -r + 18 = -3z, r - 3 = -255z + 253z. Solve 4s - 17 = -r for s. 2 Let d be (-75)/50(-1 + -1). Suppose x - 3x + 4y + 24 = 0, 5x - 25 = dy. Suppose 0 = -xc + 3c - 4. Solve cu - 21 = -5 for u. 4 Let p(a) be the first derivative of -2a*3/3 - 9a*2/2 + 38a - 234. Let s be p(-7). Solve 4i - 15 + s = 0 for i. 3 Let p(i) = i2 + 2i - 3. Let o be p(4). Let u be (-1o/(-12) + -1)4. Solve 15 = uj + 2j for j. 3 Let r(g) be the third derivative of -g6/120 - g5/6 + 13g4/24 + 5g*3 + 3g*2 + 6. Let z be r(-11). Solve 0 = -i - z + 12 for i. 4 Let g = 135 - 98. Let h = -32 + g. Suppose hw + 24 = 2y, -y - 3w + 1 = -11. Solve -3b + y = -6b for b. -4 Suppose 4z - 84 = -2w, 0 = -3w + 4z - 102 + 148. Solve -wv = -146 - 62 for v. 8 Let g be (6(-2)/(-16))/(77211/(-1980) - -39). Solve -33v = -g - 132 for v. 9 Let r(p) = p3 - 10p*2 + 7p - 69. Let n be r(10). Let y = n - -14. Solve 2k - y = -13 for k. 1 Suppose 3o = -r + 23, 6r - 2r - 5o - 7 = 0. Suppose -6 + 3 = -d. Solve -db + 20 = -rb for b. -4 Let f = 2 - -6. Let k(d) = -135d - 1482. Let q be k(-11). Solve b - qb = f for b. -4 Suppose -48 = -3w - 2b, 0 = 4w - 3b - 53 - 11. Solve 42x + w = -26 for x. -1 Let s be (68/102)/((-2)/9) - 2-22. Solve -45u - s = -131 for u. 2 Let b = -59 + 57. Let x be b/315/(-2). Suppose 5z = -2t - 7, z + 14 + x = 4t. Solve tn + 9 = -7 for n. -4 Suppose 3y + 4v = 94, -36 - 82 = -4y + 2v. Let k be 9/1 - (y - 26). Solve -4z - k = -5 for z. 0 Let u = 138 + 18. Let y = 156 - u. Solve y = -4b - 3b + 28 for b. 4 Suppose 0 = -0y - 11y - 2233. Let o = y - -205. Solve 9r = -16 - o for r. -2 Let k = -24 - -44. Suppose 5a = -5 + k. Solve y = -a + 1 for y. -2 Let x(o) = o*3 + 7o*2 + 6o + 9. Let w be x(-6). Let y = -8323 - -8327. Solve -a + w = -ya for a. -3 Suppose 0 = 3p + v - 18, 12v - 30 = -5p + 7v. Solve 168w - 169w = p for w. -6 Let o be 741792/7200 - 2/75. Solve 90 = -88g + og for g. 6 Suppose -12j - 85 = -1057. Suppose 0 = 2u + 45 - j. Solve 11i - u = 37 for i. 5 Suppose -88 = -4d - 4y, -5y + 78 = 53d - 50*d. So	{ "pile_set_name": "DM Mathematics" }
ms in -j + 5j + 4j - 4j. 4j Collect the terms in -4283c + 2139c - c*2 + 2144c. -c*2 Collect the terms in 2n + 0 + 4 - 1 + 0. 2n + 3 Collect the terms in o2 - 8o*2 + 7o*2 + 6o*3 - 8o*3. -2o*3 Collect the terms in -2r*3 + 3519r*2 + 6r*3 - 3519r*2 - 3r3. r3 Collect the terms in 11v3 - 12v*3 + 11v*3. 10v*3 Collect the terms in 52n + 11n2 - 52n. 11n2 Collect the terms in -44o + 21o + 11o + 12o - 2o*3. -2o*3 Collect the terms in -8 + 19x - 9x + 8 - 11x. -x Collect the terms in 2s + 0s - 4s. -2s Collect the terms in 5b2 + 0b*3 - 3b3 - b2 + 10b3. 7b*3 + 4b*2 Collect the terms in 0b*3 + 400 - 400 - 6b*3. -6b*3 Collect the terms in 8792 + 10i*2 - 4396 - 4396. 10i*2 Collect the terms in -3a*2 - 377a + 377a + 6a*2. 3a*2 Collect the terms in -338t + 629t + 443t. 734t Collect the terms in 6f - 6f + 29f*3. 29f*3 Collect the terms in -1438u*3 + 721u*3 + 714u*3. -3u*3 Collect the terms in 44w*2 - 2w*2 - 38w*2. 4w2 Collect the terms in 1162 - q3 - 1162 + 3q3. 2q*3 Collect the terms in 24f - 8 - 16f + 17f. 25f - 8 Collect the terms in -y3 + 3628 - 1814 - 1814. -y3 Collect the terms in -19a*3 - 17a*3 + 10a*3 - 8a*3. -34a*3 Collect the terms in -2k - 33925k2 + 2k + 33929k2. 4k*2 Collect the terms in 2v3 - v3 + 21v2 + 4v*3. 5v*3 + 21v*2 Collect the terms in -854n*3 + 1682n*3 - 844n*3. -16n*3 Collect the terms in 9 + 2s + 7s - 9 - 8s. s Collect the terms in -4f2 + 8f*2 - 10f*2 - 3f*2. -9f*2 Collect the terms in 361k + 2 - 2. 361k Collect the terms in -126 + s2 + 126. s2 Collect the terms in 21y*2 - 224y*2 + 38y*2. -165y*2 Collect the terms in -21 + 40 + j - 19. j Collect the terms in -47l*2 + 2 + 2 - 4. -47l*2 Collect the terms in 20f*3 + 5f*3 + 0f*3. 25f*3 Collect the terms in -127w + 251w - w2 - 124w. -w*2 Collect the terms in -7j*3 - 6j*3 + 4j*3. -9j*3 Collect the terms in -a - 32a + 31a. -2a Collect the terms in 11 - 11d - 11 + 19d - 5d. 3d Collect the terms in 44h + 1 + 3 + 435h - 3. 479h + 1 Collect the terms in 2h + h + 4h + 7h. 14h Collect the terms in 2m*3 - 45605 - 3m3 + 45605. -m3 Collect the terms in 116413z - 3z*2 - 116413z + 6z2. 3z*2 Collect the terms in -8a - 16a - 15a + 39a + a2. a2 Collect the terms in -138y*3 - 5970 + 5970. -138y*3 Collect the terms in -330j + 2j3 + 330j. 2j3 Collect the terms in 8p*2 + 273 - 273. 8p*2 Collect the terms in 179y*2 - 268y*2 - 223y*2. -312y2 Collect the terms in 16 - k3 - 16 - 6k2 - k3. -2k*3 - 6k*2 Collect the terms in 27z*3 - 64z*3 + 32z*3. -5z*3 Collect the terms in 0a*2 - 4a*2 - 7a*2 - 2a*2. -13a*2 Collect the terms in 14w*3 - 54w*2 + 23w*3 + 54w*2. 37w*3 Collect the terms in 0 + 0 + 221t. 221t Collect the terms in 6m*2 + 4m - m - 3m. 6m*2 Collect the terms in -1064v + 533v + 531v + 0v3 + 31 + v3. v3 + 31 Collect the terms in -433a*2 + 872a*2 - 439a*2 - 5a*3. -5a*3 Collect the terms in -6x*3 + 6x*3 - 5x*3 - 10x*3. -15x3 Collect the terms in -q3 - 8q3 + 15q*3. 6q*3 Collect the terms in 13z*2 + 3z*2 - 2z*2. 14z*2 Collect the terms in -87v - 25 + 25. -87v Collect the terms in 17h*3 - 55h*3 + 12h*3 + 29h*3. 3h*3 Collect the terms in -3b*2 + 4b*2 + 7b*2 - 9b2. -b2 Collect the terms in -16u2 - 5u + 5u. -16u*2 Collect the terms in 2485p*3 - 1240p*3 - 1240p*3. 5p*3 Collect the terms in 4y*2 + 4y - 3y - y + y2. 5y*2 Collect the terms in -31q + 76q - 41q. 4q Collect the terms in 6k + 1 + 8 - 9. 6k Collect the terms in 3 - a - 7a + 6a + 3a. a + 3 Collect the terms in 15y - 11y + 14y - 2y. 16y Collect the terms in -12l*2 - 9l*2 + 20l2. -l2 Collect the terms in 4 + 7 - 1 - 178y. -178y + 10 Collect the terms in 1138o2 - 573o*2 - 567o*2. -2o*2 Collect the terms in -117f*3 + 30f*3 + 63f*3. -24f*3 Collect the terms in -393 + 393 + 3r*2. 3r*2 Collect the terms in -10h*2 + 5h*2 + 6h2. h2 Collect the terms in -z2 - z2 - 12z2 + 2z*2. -12z*2 Collect the terms in -2t + 10449355 - 10449355. -2t Collect the terms in -g2 - 4g*3 + 3g*2 + 2g*3. -2g*3 + 2g*2 Collect the terms in -76i - 40i - 5i. -121i Collect the terms in -21b*3 + 11b*3 - 8b*3 - 6b*3. -24b*3 Collect the terms in 5k*3 - 2 - 5 + 5k*3. 10k*3 - 7 Collect the terms in 4i - 3i + 2i - 528i2 - 4i. -528i2 - i Collect the terms in 28m - 45m + 20m. 3m Collect the terms in -1892 + 633 + 630 - 2h*2 + 629. -2h*2 Collect the terms in 2b*2 + 10 - 22 + 9. 2b*2 - 3 Collect the terms in -2w + 40 - 88 + 48. -2w Collect the terms in -6z + 332 - 332 - 3z. -9z Collect the terms in 0c3 + 15c*2 - 13c*2 + 2c*3 - 2c*2. 2c*3 Collect the terms in 7p*2 + 3p2 - p2 - 11p2. -2p*2 Collect the terms in 7u*2 - 20u*2 + 9u*2 + 5u2. u2 Collect the terms in -12m2 + 442m - 442m. -12m2 Collect the terms in -c2 + 0c3 + c2 - c3. -c3 Collect the terms in -12v*3 + 3 + 52v*3 - 3. 40v*3 Collect the terms in 61 - 9x*2 - 61. -9x*2 Collect the terms in 4 - 2z*3 + 0z*3 + 20z*2 - 20z*2. -2z*3 + 4 Collect the terms in 4 - 9 - 6t*2 + 5. -6t*2 Collect the terms in -23w + 22w - 6w. -7w Collect the terms in 2c*2 + 157268c - 157268c. 2c*2 Collect the terms in 681i*2 - 2 - 680i2 + 1. i2 - 1 Collect the terms in -41l3 - 17l*3 - 58l*3. -116l*3 Collect the terms in -8z*3 + 212 - 634 + 215 + 207. -8z*3 Collect the terms in -135s - 17 + 17. -135s Collect the terms in -9l*3 + 8l*3 - 17l*3. -18l*3 Collect the terms in -25i - 1408 - 14i + 11i + 1410. -28i + 2 Collect the terms in 29d - 29d - 5d*3. -5d*3 Collect the terms in -152m + 75m + 77m + 2m2. 2m*2 Collect the terms in 32q + 74q - 27q. 79q Collect the terms in -5237995 + 5237995 + 5x*2. 5x*2 Collect the terms in 4534 + 2p - 4534. 2p Collect the terms in 198 - 398 - 2b*2 + 200. -2b*2 Collect the terms in 15x*2 - 57x*2 + 43x2. x2 Collect the terms in 4t - 3 + 8 - 6. 4t - 1 Collect the terms in -19v2 + 19v*2 + 14v*3. 14v*3 Collect the terms in 67 + 183g - 183g + 2 - g2. -g2 + 69 Collect the terms in 65r*2 - 20r*3 + 71r*3 - 64r*2. 51r3 + r2 Collect the terms in 2o2 - 21o - 3o2 + 5 - 5. -o2 - 21o Collect the terms in 0w + 483w*3 + 122w*3 - 2w. 605w3 - 2w Collect the terms in -97n - 105n + 180n. -22n Collect the terms in 1 - 51b - 1 + 42b - b. -10b Collect the terms in 7 + 0i + 0i - 6i. -6i + 7 Collect the terms in 3q*3 - 527 + 527. 3q*3 Collect the terms in -80255x + 80255x + 2x*2. 2x*2 Collect the terms in 0w2 - w2 + 15w2. 14w*2 Collect the terms in -3v - 13 + 4 + 0 + 1 + 9. -3v + 1 Collect the terms in v3 - 3v*3 - 15v*3. -17v*3 Collect the terms in -21g*3 + 1672g - 1672g. -21g*3 Collect the terms in 2t + 71t3 - 61t*3 - 2t. 10t3 Collect the terms in -18 + 129w*3 + 5 + 13. 129w*3 Collect the terms in 64r*3 - 201r*3 + 67r*3 + 69r3. -r3 Collect the terms in 431w - 146w - 142w - 142w. w Collect the terms in 174j2 - 346j*2 + 178j*2. 6j*2 Collect the terms in -2k + 9k - 24k + 12k. -5k Collect the terms in -21p2 + 6p*2 + 3p*2 + 12p*2 - 3p*3. -3p*3 Collect the terms in -4c - 8c - 15c - 8c. -35c Collect the terms in -14k2 - 41k*3 + 22k*3 + 31k*2 - 17k*2. -19k*3 Collect the terms in y - y + 6y - y. 5y Collect the terms in 29t + 100t - 130t. -t Collect the terms in -23x + 17x + 12x. 6x Collect the terms in -7b3 - 5b*3 - 21b*3 - 4b*3. -37b*3 Collect the terms in 461 - 3m*2 + 4m - 461. -3m2 + 4m Collect the terms in -8736r - r3 - 8733r + 17469r. -r3 Collect the terms in 4 + 0y*3 - 4 - 33y*3. -33y*3 Collect the terms in -15660 + 15660 - 3o*3. -3o*3 Collect the terms in 14u - 50 + 26 + 24 + u2. u2 + 14u Collect the terms in 4t*2 + 4t*2 - 5t*2 - 2060t + 2060*t	{ "pile_set_name": "DM Mathematics" }
-5 + (sqrt(104)/(sqrt(8)-41) - ((sqrt(130) + 5sqrt(130))6)/sqrt(10)). -145sqrt(13)/4 - 5 Simplify (-2(5 + 1 + sqrt(1053) + -2) + 2-2sqrt(13) + sqrt(91)/sqrt(28) + (sqrt(13) + 1)-42)*2. 944sqrt(13) + 46277/4 Simplify ((5 + (sqrt(19) - sqrt(114)/sqrt(54))-1)2)*2 + (41sqrt(76))/(3sqrt(100) - sqrt(100)). -394sqrt(19)/15 + 1204/9 Simplify (5 + 2sqrt(17)3 - (sqrt(170)/(sqrt(100)/sqrt(10)) + 4))2 + -3. 10sqrt(17) + 423 Simplify (2sqrt(77)1 + -4sqrt(77)-2)/(-3sqrt(11)3-2)4. 20sqrt(7)/9 Simplify ((sqrt(10) + -6sqrt(40))/((-2sqrt(6))/sqrt(3)) - ((-4 + sqrt(20)/sqrt(4))2 - (sqrt(720) + ((sqrt(720) - sqrt(720)3)*2 - sqrt(720))))) + -4. 27sqrt(5)/2 + 2855 Simplify (-5-1sqrt(756)1)/(sqrt(567)-6-6-6). -5sqrt(3)/324 Simplify ((5((sqrt(528) - (3sqrt(528) + sqrt(528))) + sqrt(528)))/(1sqrt(147) + sqrt(147) - sqrt(48)-1))2-4. -17600/81 Simplify 2((-62sqrt(187))/sqrt(11) - (-1 + ((sqrt(136)/(sqrt(8) + -1sqrt(8) - sqrt(8)))*2 - sqrt(17))))-46. 768 + 528sqrt(17) Simplify 2((-2sqrt(1620)-55)/((2sqrt(100)3 - sqrt(100))/(sqrt(160)-2)))2. 2073600 Simplify ((sqrt(540)/(1sqrt(10)))/((sqrt(27) + 2sqrt(27) + sqrt(27))/sqrt(3)))/(-5(sqrt(3) - 2sqrt(12)/sqrt(4))3). sqrt(2)/60 Simplify (4 + 6(1 + sqrt(52) + -4(sqrt(13) + -2sqrt(13))) + sqrt(26)/(sqrt(6)/sqrt(3)) + 3sqrt(13)4)2. 980sqrt(13) + 31313 Simplify (-5 + 6(sqrt(612)1 + 1 + 3 - (5 + (sqrt(612) - (-5 + 1 + sqrt(612) - sqrt(612))))) + -2)*2. 1369 Simplify -6(0 + sqrt(68)/(sqrt(576) + 1sqrt(576) - sqrt(576)) - ((5 + -1 + sqrt(17))2 - ((sqrt(255)/sqrt(5))/sqrt(3) - sqrt(17)))). 95sqrt(17)/2 + 198 Simplify (5-2sqrt(5) + (sqrt(220)/sqrt(4) + sqrt(55))/sqrt(11) - ((sqrt(5) + 4)1 + -2))2 + 0 + 4. 36sqrt(5) + 413 Simplify 0 + (-3(-5 + (sqrt(308) + sqrt(308)3-1)/(sqrt(7) + (sqrt(7) - sqrt(42)/sqrt(216)))))2. 2160sqrt(11)/11 + 7659/11 Simplify (5 + 5((0 + sqrt(700))2 - (sqrt(700) + -2 + sqrt(700) + 1 - sqrt(700))) + -4)*264. 14400sqrt(7) + 420864 Simplify 3(1 + -2 + (sqrt(48) + 3 + sqrt(12)1 + 3 + 2)*2 + 2). 288sqrt(3) + 519 Simplify (-1(sqrt(117) + (sqrt(117) - (sqrt(117) - -3sqrt(117)2))))/(sqrt(9)22 + 5sqrt(45)/sqrt(5))-5. -25sqrt(13)/9 Simplify 5(6(3 + ((sqrt(3200) - (sqrt(3200) + -3 + sqrt(3200))) + 0 - sqrt(3200))4))22. -3456000sqrt(2) + 73809000 Simplify (sqrt(40)/sqrt(8) - sqrt(5)) + -4 + sqrt(25)/(sqrt(35)/sqrt(7)) + (-4 + sqrt(20)-1)2. -12 - 3sqrt(5) Simplify -1 + (-22sqrt(11))*2 + -3 + -2 - (5 + ((sqrt(44) + -1sqrt(44))2 - (2 + (-1 + sqrt(11) + sqrt(11))2))2). -8sqrt(11) + 259 Simplify ((sqrt(1331) - (-5 + sqrt(1331)-2))2 - 6(-1sqrt(1331))2) + (5(sqrt(1331) - (2 + sqrt(1331))) - (1 + (-2sqrt(1331) - sqrt(1331))))2 + -2. -396sqrt(11) + 16116 Simplify ((-52-34sqrt(75)-2 + -5)3)*2. 108000sqrt(3) + 38880225 Simplify (-21((sqrt(80) - (sqrt(80) + 3 + sqrt(80) + sqrt(80)))1 - (5 + (-1sqrt(80) - sqrt(80))))-5)2. 6400 Simplify (-2 + 1-3(sqrt(200) + 1) - (4(sqrt(200) + sqrt(200)-2) - (sqrt(200)1 - sqrt(200))-6))2. -100sqrt(2) + 225 Simplify -2 + (-3(sqrt(2187) - sqrt(2187)-1))/(sqrt(576) + 2sqrt(576) + (sqrt(63)2)/sqrt(7)). -27sqrt(3)/13 - 2 Simplify -2 + (sqrt(968) - ((sqrt(968)2 - sqrt(968))-6 - sqrt(968)))/(sqrt(144) + sqrt(144) + sqrt(144) + 3sqrt(144) + sqrt(144)). -2 + 44sqrt(2)/21 Simplify (-2(sqrt(588) + (sqrt(588) - -1sqrt(588))) + sqrt(588) + 2sqrt(588)-6 + sqrt(588) + sqrt(588))/(6(sqrt(100) - -1sqrt(100))3). -7sqrt(3)/12 Simplify (sqrt(204) + 22sqrt(204))/(1sqrt(12)1) + (sqrt(17) + sqrt(17) + 2 + 2 - ((sqrt(204)1)/sqrt(12))*2). -13 + 7sqrt(17) Simplify -1(-4(sqrt(605) + sqrt(605) + -3)2 + 5 - (-4 + (-1 + sqrt(605) - sqrt(605)))26) + 3. -528sqrt(5) + 9864 Simplify (-2 + sqrt(68) + 1 - sqrt(68) - (sqrt(68) + -1 + 1 + sqrt(68)))*2 + (-3sqrt(68)-1 + sqrt(68) + -1 + 0)2. -8sqrt(17) + 1362 Simplify (-3sqrt(612)2 + 2 + sqrt(204)/(sqrt(96)/sqrt(8)) + (sqrt(17) - (2 + (sqrt(17) - (sqrt(17) - (sqrt(17) - sqrt(85)/sqrt(5)))))))*2. 19652 Simplify (1 + (sqrt(567)14 - (4 + sqrt(567) + -4))2 + 4)*2. 540sqrt(7) + 20437 Simplify (sqrt(98) + -4sqrt(98) + -5)2 + -5 + (-3 + (sqrt(98) + 0 - sqrt(98)) - (2 + (sqrt(98)-1 - sqrt(98)) - sqrt(98)))*2. 1809 Simplify (-55-6((sqrt(245) + -2)6 + -1 + -2sqrt(245))-2)2. -65520000sqrt(5) + 368010000 Simplify (4 + ((sqrt(77) + 1sqrt(77))/sqrt(7) - (5 + (sqrt(11) - sqrt(33)/sqrt(3)))))2 - (2 + -3 + 1 + sqrt(1331)2)*2. -5279 - 4sqrt(11) Simplify ((-3sqrt(66)3)/(sqrt(72)/sqrt(3)))*2 - ((sqrt(88) + -4sqrt(88)1)/sqrt(8) - (-4 + (sqrt(44))24)). 3sqrt(11) + 1579/4 Simplify (sqrt(143)22 + sqrt(143) - sqrt(143))/(sqrt(11) - sqrt(66)/(sqrt(6)2)) - 5(1sqrt(39)1)/sqrt(3). 3sqrt(13) Simplify (-2sqrt(605)2 + -1sqrt(605) + sqrt(605) + -1 + -1 + 45sqrt(605)2-5)2. 8976sqrt(5) + 25177684 Simplify (sqrt(243)-1 - (-1(-1 + sqrt(3)) + sqrt(3) + -51sqrt(3))) + 4 + 5(-4 + sqrt(75) + 1)2. -154sqrt(3) + 423 Simplify ((-1(sqrt(200) - (5 + sqrt(200) + sqrt(200) + sqrt(200)-2)))*2 - (1 + (sqrt(200) - (1 + sqrt(200) - sqrt(200))) + -2)) + -3 + -4. -110sqrt(2) + 220 Simplify (((sqrt(208) - (sqrt(208) + 1 + sqrt(208)))3 - (-3 + sqrt(208)1))*2 - ((sqrt(208) + 3)-1 + -1)*2)2. -64sqrt(13) + 6208 Simplify (3-4(sqrt(204) + -2sqrt(204))/sqrt(12)-6 + sqrt(136)/(sqrt(8)2) + (sqrt(17) - (sqrt(17) + 0))-3 + 2 + sqrt(425) + -1)2. -133sqrt(17) + 300717/4 Simplify (2(-4 + -1sqrt(12) + -4))*2 - -5(2(4 + (sqrt(3) + sqrt(3)2)-2))2. -832sqrt(3) + 2784 Simplify ((-1sqrt(95)-2 + sqrt(95))2-1)/(-4(sqrt(5) - sqrt(540)/sqrt(12) - -4(sqrt(5)-2 - sqrt(5)))). -3sqrt(19)/28 Simplify 4 + sqrt(405) + 0 + sqrt(245) + 0 + 3 + -1(0 + (1sqrt(500))*2). -493 + 16sqrt(5) Simplify (5sqrt(450)1 - -62sqrt(450))/(sqrt(100)/(sqrt(10)3) + (-3sqrt(250) - sqrt(250) - sqrt(250) - sqrt(250))). -153sqrt(5)/89 Simplify (sqrt(231)/(sqrt(14)/sqrt(2)))/(sqrt(9)/(sqrt(9)/sqrt(3))) + (-2sqrt(88)3)/(sqrt(8) + sqrt(8) + sqrt(800)-2) + 2. 2 + 4sqrt(11)/3 Simplify -5 + -1 + -5 + 3 + 5 + ((sqrt(1216) + 3)-4 + -4)*2. 1024sqrt(19) + 19709 Simplify 1 + ((sqrt(96)1)/((sqrt(48)/sqrt(4) + sqrt(12))-3))*2 + (-6sqrt(32) - sqrt(8)-5)2 + -5. 3494/9 Simplify (-5(2sqrt(121) + sqrt(121)) + sqrt(121) - sqrt(121))/(sqrt(11)33)42. -40sqrt(11)/3 Simplify 1(-6(5 + -3 + sqrt(891)2) - -6(sqrt(891)-2 + sqrt(891))35)2. 22032sqrt(11) + 9270108 Simplify (-4 + 5 + (0 + sqrt(243) + 6(0 + sqrt(243) - sqrt(243)) - ((1 + sqrt(243))-1 + sqrt(243)-1 + 4)))2. -108sqrt(3) + 2191 Simplify 3(-3 + 5-2-1((3 + sqrt(425)-2 + sqrt(425))2 - sqrt(425)-23)). 13011 Simplify 2(4(-2 + (sqrt(200) - (-2sqrt(200))*2)) + (-4sqrt(2) + 2 - (-1 + sqrt(2))1)). -6410 + 70sqrt(2) Simplify 0 + (-2 + sqrt(325)24)*2 + (-5(sqrt(1053) - (sqrt(1053) + sqrt(1053)-1 + 3) - (-1 + sqrt(1053))1))*2. -160sqrt(13) + 20904 Simplify 3((sqrt(648)-6)/sqrt(6))*24 - 2(-4 + ((sqrt(3) + sqrt(12)/sqrt(4) + 4)2 + sqrt(3) - sqrt(576)/sqrt(12))). -26sqrt(3) + 46608 Simplify ((sqrt(960) + -1sqrt(960) + sqrt(960) - -3(sqrt(135) + sqrt(15)))/(3sqrt(1280)-1))*2. 25/48 Simplify ((sqrt(95)-1)/sqrt(5) - (sqrt(209)/(sqrt(44)/sqrt(4)) - sqrt(19)))*2 + (5 + sqrt(171) + 0 + sqrt(171) + sqrt(171) + sqrt(171) + 6sqrt(171)-1)2. -60sqrt(19) + 728 Simplify -6(sqrt(1200) - (sqrt(180)/sqrt(5))/sqrt(3))/(sqrt(24)-1 - (-2sqrt(6)-5 + sqrt(6))). 54sqrt(2)/13 Simplify ((-1(sqrt(3087) + -1 + sqrt(3087)) + (sqrt(3087) + -3 + sqrt(3087) - sqrt(3087)) + -4)-1)24. 1008sqrt(7) + 12492 Simplify -5 + (sqrt(209)/(sqrt(44) - sqrt(11)))2 + 4 - (-1 + sqrt(114)/(sqrt(60)/(sqrt(80)/sqrt(8)))). -sqrt(19) + 19 Simplify (5(sqrt(3456) + sqrt(3456) + (2sqrt(3456) + sqrt(3456))2 + sqrt(3456)))/((2(sqrt(588) + sqrt(588)-1) - sqrt(588))-6). 90sqrt(2)/7 Simplify ((sqrt(99) - (sqrt(99) - ((-2sqrt(99) + sqrt(99))5 - sqrt(99)))) + sqrt(99) + (sqrt(99) + 3(sqrt(99) + -1sqrt(99)) - sqrt(99)))/(3sqrt(729)5)6. -2sqrt(11)/9 Simplify -4(sqrt(720)3-3 + -5)2 - (((sqrt(720) + sqrt(720) + sqrt(720)2 + -4)1)2 + 3). -244919 - 3936sqrt(5) Simplify ((-3*sqrt(486))/sqrt(3))/((sqrt(9) +	{ "pile_set_name": "DM Mathematics" }
ghest common factor of t and o. 9 Let d be 96 + ((-7)/(-21))/((-1)/(-6)). Suppose k + d = 8k. Suppose -f - 3x + 69 = x, 0 = -3x + 15. What is the greatest common divisor of f and k? 7 Suppose w + 5f - 205 = 0, -4w + 9f + 925 = 8f. What is the greatest common divisor of 70 and w? 10 Let a(n) = -17n + 256. Let u be a(15). Let w = 107 - 102. Calculate the highest common factor of u and w. 1 Suppose 8h + 59 - 331 = 0. Let l = h - 48. Let n be ((-6)/21)/(-1) - 780/l. Calculate the highest common factor of 84 and n. 28 Suppose 0 = -4s + 132x - 135x + 60576, -5s = -x - 75739. What is the highest common divisor of s and 17? 17 Suppose 31r - 10p = -14p + 1131884, -5r - p + 182563 = 0. What is the highest common divisor of r and 224? 224 Let k(f) = -7f*3 + 11f - 17. Let q be k(-4). Let y = 255 - 169. What is the greatest common divisor of y and q? 43 Suppose -15q + 10q = -3m - 13, -4q - 5m = -3. Suppose 148 - 6 = l. What is the highest common factor of l and q? 2 Let s(g) = 2g*3 + 9g*2 + 205g + 1086. Let t be s(-5). Calculate the greatest common factor of t and 30. 6 Let u(f) = 2f + 5f - 5f + 2f + 14. Let o be u(4). Suppose 3k + z - 417 = 0, -5z + o + 515 = 4k. What is the highest common factor of k and 20? 20 Suppose 32 = 2j + 4r, -r = -414j + 419j - 134. What is the highest common factor of j and 6608? 28 Let j(c) = c3 - 3c*2 - 338c - 31. Let y be j(20). Suppose 4o = 4n - 2788, 0 = -0n - 5n - 3o + 3525. Calculate the highest common divisor of n and y. 9 Suppose 12t = 10t + 10. Suppose tc + 19 = 3v, 1 = -v - 2c - 0. Suppose vp - 41 = 100. What is the highest common divisor of p and 376? 47 Let g = 235 + -239. Let w be -8(3 + (-2 - g))/(-1). Calculate the highest common factor of w and 640. 40 Let u = 611 - 256. What is the greatest common factor of 923 and u? 71 Suppose -61a + 19872 = -29a. What is the greatest common divisor of 27 and a? 27 Suppose -312 = -5p + 238. Suppose -5f - m + 10 = 0, m = -0m - 5. Suppose -13 = fv - 145. What is the greatest common factor of p and v? 22 Let o(c) = -2c - 11. Let z be o(-9). Let h be (-20)/(-70) + (-23)/7 - -29. Suppose -4a + 222 - h = 0. Calculate the highest common factor of a and z. 7 Let s = -3657 + 9825. What is the highest common divisor of s and 24? 24 Let d be 116/5 + (-80)/(-100). Calculate the greatest common factor of d and 3552. 24 Let w(q) = -q*3 + 22q*2 - 7q + 15. Let r be w(21). Let s = r + -305. What is the greatest common divisor of 32 and s? 4 Let d = 569 + -561. Suppose -4m - d = 0, 36m - 33m = -y + 26. What is the highest common factor of y and 56? 8 Let m be (-7252)/(-98) + 18/3. Calculate the highest common factor of m and 15880. 40 Let o = 504 + -507. Let f be -1 + 9 + (-12)/(o/1). What is the greatest common divisor of 60 and f? 12 Suppose -36 = -5h + 2h. Suppose 52r = 24r + 3696. What is the greatest common factor of h and r? 12 Let d(z) = 2z*2 - 8z - 185. Let n be d(-8). Suppose 3y + 56 = 5y. Calculate the highest common factor of y and n. 7 Suppose -5n - 8 = 7. Let u be ((-16)/(-12))/(0 + (-2)/n). Let m(h) = 6h + 2. Let o be m(u). What is the highest common divisor of o and 42? 14 Let f(m) = 11m - 6. Let k be f(-20). Let c = -73 - k. Calculate the greatest common factor of 34 and c. 17 Suppose 0 = 113k - 14386 - 3242. Calculate the highest common divisor of k and 228. 12 Let j = -4449 + 4482. Calculate the greatest common divisor of j and 649. 11 Suppose -4p - p = -140. Let x be 2/(-16) + (-3880)/(-128)20/50. Calculate the highest common factor of x and p. 4 Suppose 4v - 7 = 5, 0 = -3q - v + 24. Suppose -263 + 53 = qy. Let a = y - -105. What is the highest common factor of 15 and a? 15 Suppose -5o + 200 - 75 = 0. Suppose 12b = ob - 3172. Let w = b - 174. Calculate the greatest common divisor of w and 14. 14 Suppose -a = -d - 0 - 1, d - 2a = 1. Let b be 15(-5)/d - 1. Calculate the highest common factor of 84 and b. 12 Let k = -3045 + 3055. What is the highest common factor of k and 894? 2 Let x be (-4)/1 + (24 - -13). Suppose -6g + x = -39. What is the highest common factor of g and 108? 12 Suppose -12 + 26 = c - 2x, 4c - 30 = -5x. Let h(l) = 24l - 141. Let m be h(c). What is the highest common divisor of m and 22? 11 Suppose 54569 = 254n + 4277. Suppose 2l = -2d + 108, -216 = -4l + 4d + d. Calculate the highest common divisor of l and n. 18 Let a = 2405 + -2402. What is the highest common factor of a and 1527? 3 Suppose -5r + 4z = -2797, -4r - 2z - 2z = -2252. Let w(y) = y2 + 23y - 3495. Let t be w(49). Calculate the highest common factor of r and t. 33 Suppose 3l + 300 = 4p, -81p + 4l = -79p - 160. Calculate the greatest common factor of p and 486. 18 Let u(p) = -40p*3 + 3p*2 + 2p + 1. Let j be u(-1). Calculate the greatest common divisor of j and 98. 14 Let y be (2240/(-50) - 4)/((-1)/5). Calculate the greatest common divisor of 1769 and y. 61 Let h = 234 - 223. Suppose -z + hz = 400. What is the greatest common factor of z and 150? 10 Suppose -9t = 5531 - 6125. What is the greatest common factor of 2024 and t? 22 Suppose -3n + 6a = 4a - 51, -3n = -a - 57. Suppose 3 - 24 = -3v. Calculate the greatest common factor of n and v. 7 Suppose 5k + 738 = 2v - 78, 3v = -k + 1224. What is the greatest common factor of v and 153? 51 Let d(f) = -12f - 4. Let m be d(-3). Suppose 14j - 3j = 847. Let l = 81 - j. Calculate the highest common factor of l and m. 4 Suppose 8h - 359 = -15. Suppose 0z - h = -4m - z, 2m - 5z = 5. Calculate the greatest common divisor of m and 190. 10 Suppose 0 = -59t + 71t - 3120. Suppose -61w - t = -65w. What is the highest common factor of w and 5? 5 Let g(h) = 3h - 15h - 20 - 116h + 3. Let b be g(-9). Suppose b = 4v - 3p - 349, 4v = -p + 1500. Calculate the greatest common factor of v and 34. 34 Suppose 369 = 2y + 321. Suppose 5h = 16 - 1. Suppose 20 = r + 4j, -2r + hj = -0r - 51. Calculate the highest common divisor of r and y. 24 Let k be ((-6)/(1 + -7))/((-11)/(-198)). Let w = 29 + -11. What is the greatest common factor of w and k? 18 Let q(f) = f*3 + 7f*2 - 16f - 27. Let n be q(-7). Let c(h) = h*3 - 9h*2 + 15. Let z be c(9). What is the highest common factor of n and z? 5 Suppose 71x - 932 = 68x + 2n, -2n = 7x - 2228. Calculate the greatest common factor of 2449 and x. 79 Let j = 5382 + -5370. Calculate the greatest common factor of 4536 and j. 12 Let y(a) = 2. Let j(q) = -5q + 2. Let c(o) = -j(o) - 2y(o). Let d be c(3). What is the greatest common factor of 621 and d? 9 Suppose 14 = c + c - 5h, 0 = -5c + 3h + 16. Suppose s + 10g - 7g - 66 = 0, cg = s - 66. Calculate the highest common factor of s and 22. 22 Let r(m) = 67m + 615. Let x be r(-7). Calculate the greatest common divisor of x and 1387. 73 Let b(d) = 38d - 416. Let w be b(14). Calculate the greatest common factor of w and 87. 29 Let h be 6/((-16)/(-24)(-9)/(-4)). Suppose 5l + 5m - 555 = 0, -6l - hm + 108 = -5l. What is the greatest common divisor of l and 48? 16 Suppose -w - 2692 = -f - 2705, 3f + 9 = 0. Calculate the greatest common divisor of 3430 and w. 10 Suppose 0 = -2y - 52 + 132. Suppose 53 = 3m - 2z - 16, -24 = -8z. Calculate the greatest common divisor of y and m. 5 Let l(c) = -3c*2 + 7c - 8. Let k(t) = -2t2 + 6t - 10. Let s(f) = 4k(f) - 3l(f). Let o be s(5). Calculate the greatest common divisor of 40 and o. 8 Suppose -8 + 4 = -2r. Suppose ra - 572 = -2a. Let g(y) = -18157y + 36325. Let k be g(2). What is the greatest common factor of a and k? 11 Let h(c) = -11c - 51. Let l be h(-13). Suppose -5s = -2n + 66, -2s - l = -3n + 2s. Calculate the highest common factor of 36 and n. 4 Let p(o) = 7o2 + 2o - 118. Let s be p(17). Suppose -33 = st - 1942t. Let l be 2/(0 - (-2)/11). What is the highest common divisor of t and l? 11 Suppose -5g + 8149 = -2x + 1210, 1350 = g + 5x. Calculate the greatest common factor of g and 1108. 277 Suppose -4358 = -85n + 5587. Calculate the highest common factor of n and 143. 13 Let i = -17865 + 18074. What is the highest common divisor of i and 11? 11 Suppose -1041o = -g - 1046o + 1189, -3o - 6057 = -5g. What is the highest common divisor of g a	{ "pile_set_name": "DM Mathematics" }
ect the terms in 5j2 - 76 - j2 - 2j*2 + 81 + 68. 2j*2 + 73 Collect the terms in 120d*2 + 186d*2 + 20d*2. 326d*2 Collect the terms in -126359765 + 126359765 - 4r. -4r Collect the terms in 35b*3 + 16b*3 - 21b*3 + 13b*3. 43b*3 Collect the terms in 20g*3 - 7g*3 + 2g*3 + 14g*3 - 5g*3. 24g*3 Collect the terms in -3 - 8756g*2 + 8762g*2 + 2. 6g*2 - 1 Collect the terms in 78s*2 - 8s - 12s2 - 13s*2 - 40s*2 - 15s*2. -2s*2 - 8s Collect the terms in 965n2 + 1498n*2 + 5223n*2. 7686n*2 Collect the terms in 16 + 13u*2 - 6 - 3u*2 - 8. 10u*2 + 2 Collect the terms in 3w - 3w + 316w*3 + 358w*3 - 648w*3. 26w*3 Collect the terms in 28772w*2 - 14389w*2 - 14375w*2. 8w*2 Collect the terms in 706c - 1380c + 693c. 19c Collect the terms in -3q - 5093q3 - 4q + 5091q3 + 2q. -2q3 - 5q Collect the terms in -416a + 132261 - 132261. -416a Collect the terms in -2530244f3 + 28f*2 + f - 28f*2 + 2530245f3 - f. f3 Collect the terms in -129h2 - 30h*2 + 1 - 3 + 40h + 24h. -159h*2 + 64h - 2 Collect the terms in -4409 - 718q2 + 4409. -718q*2 Collect the terms in -261c*2 + 611c*2 - 352c*2. -2c*2 Collect the terms in -9 + 3 - 6x*2 + 4x*2 + x + 3x*2 + 2x. x*2 + 3x - 6 Collect the terms in -17i2 + 2i*2 - 23i*2 + 15i*2 - 22i*2 - 2i*2. -47i*2 Collect the terms in 125 - 11q*3 + 274q*2 - 125 - q - 4q. -11q3 + 274q*2 - 5q Collect the terms in -308w + 96w + 108w - 52 - 4w*3 + 104w. -4w3 - 52 Collect the terms in 3095d + 1101d - 19516d. -15320d Collect the terms in 1 - 173i - 1 + 317i - 358i. -214i Collect the terms in 136642a + 6a2 - 136642a. 6a2 Collect the terms in -17715 - 17709 + 9h*3 - 12h*3 + 35424. -3h*3 Collect the terms in -481z + 5z2 + 962z - 492z. 5z*2 - 11z Collect the terms in 4841m3 + 6582m*3 + 0 + 0. 11423m*3 Collect the terms in -52z + 158 + 23 + 88 + 263. -52z + 532 Collect the terms in -55399n + 156682n + 1 - 1. 101283n Collect the terms in -239d2 + 88d*2 + 64d*2 + 88d2. d2 Collect the terms in -f - f + f*2 + 160f*3 + 3f. 160f3 + f2 + f Collect the terms in -874951v + 874951v + 30v*2. 30v*2 Collect the terms in 170p*2 - 68p*2 - 972p*2. -870p*2 Collect the terms in -10663v + 21450v - 10482v. 305v Collect the terms in 2 + 48 + 18h - 52. 18h - 2 Collect the terms in 25550107 - 2v*3 - 25550107. -2v*3 Collect the terms in -2x - 41 - 31 + 159 - 52 - 35. -2x Collect the terms in 677866j*3 - 1355742j*3 + 677883j*3. 7j*3 Collect the terms in -6d*3 - 7d - 15d2 + 14d*2 + 7d. -6d3 - d2 Collect the terms in 15y*3 + 36y*3 - 12y*3 - 3y*3. 36y*3 Collect the terms in -4x*2 - 2x*2 + 3890x + 5x2 - 3890x. -x*2 Collect the terms in -1287u*3 - 424 + 424. -1287u*3 Collect the terms in 12m*2 + 7m*3 + 9m*3 + 8m*3 - 26m*3. -2m*3 + 12m*2 Collect the terms in -377 + 228n + 377. 228n Collect the terms in 481 + 3s + 60 + 1124. 3s + 1665 Collect the terms in -3699d + 1801d + 1892d. -6d Collect the terms in 5j*2 + 17j*2 - 17j*2 - 37j2 - j2. -33j2 Collect the terms in 841w*3 - 2w*2 - 6w*2 - 1991w*3 + 8w*2. -1150w*3 Collect the terms in 10226v*3 + 0v - 10225v3 + 0v - 941 + 941. v*3 Collect the terms in -925c - 2385c + 398c + 716c - 2369c. -4565c Collect the terms in -1056m - 1075m + 2141m. 10m Collect the terms in m3 + 21675989m - 21675989m. m3 Collect the terms in 2s*2 - 3s*2 - 425s + 501s. -s2 + 76s Collect the terms in 19d3 + 4823143d*2 - 4823143d*2. 19d*3 Collect the terms in -5q + 8q + 21q - 14q. 10q Collect the terms in 4137t + 9 - 8269t + 4137t. 5t + 9 Collect the terms in -20f - 15f + 35f - 2f*2 - 52f*2 + 17f*3. 17f*3 - 54f*2 Collect the terms in 45p - 702p + 559p. -98p Collect the terms in 5232b + 5223b - 15678b + 5222b. -b Collect the terms in -2678m*2 - 2658m*2 + 5339m*2. 3m2 Collect the terms in i3 - 566841i + 566841i - 5. i*3 - 5 Collect the terms in -50y + 83y - 49y. -16y Collect the terms in 6o + o*2 + 20682 - 10335 - 10347 - 6o. o*2 Collect the terms in 14z*3 - 94z*3 + 0z*3 + 41z*3. -39z*3 Collect the terms in 323 - 164 + 2u*3 + u - 159 + 2u*3. 4u*3 + u Collect the terms in -31 - 27 - 35 + 95 - 7g*2 + 0g*2. -7g*2 + 2 Collect the terms in 289373 - 289373 + 2b. 2b Collect the terms in -1594g*2 + 1686g*2 - 96g*2. -4g*2 Collect the terms in m + 323m*3 + 220m*3 + 253m*3. 796m*3 + m Collect the terms in 131b*3 + 91b*3 - 235b*3. -13b*3 Collect the terms in 15v - 19v - 20v + 5v - 53v. -72v Collect the terms in 10g - 92g + 3g*2 - 6g*2. -3g*2 - 82g Collect the terms in 5781g - 11586g + 5790g. -15g Collect the terms in -61 - 2981y + 61. -2981y Collect the terms in -94695217s2 + 5s*3 + 94695217s*2. 5s*3 Collect the terms in -1437 - 1434 + 2871 - 16l*3. -16l*3 Collect the terms in -1263t - 346t + 1614t. 5t Collect the terms in 335v*2 - 164v*2 + 154v*2. 325v*2 Collect the terms in -746f - 20 + 9f2 + 746f. 9f2 - 20 Collect the terms in -25520 - 3t*2 + 0t*2 + 25520. -3t*2 Collect the terms in 20i*3 - 15i*3 - 44 - 4i3. i3 - 44 Collect the terms in -46p2 - 102p*2 + p + 15p*2. -133p*2 + p Collect the terms in 516g*2 - 17g - 1017g2 + 505g*2 + 17g. 4g2 Collect the terms in -23261q*2 + 23261q*2 + 345q*3. 345q*3 Collect the terms in 6u*2 - 21383 + 42770 - 21382. 6u*2 + 5 Collect the terms in -1867284k + 3734574k - 1867292k. -2k Collect the terms in 50u - 108u + 25u + 26u. -7u Collect the terms in 320x2 - 225x*2 + 585x*2 + 89x*2. 769x*2 Collect the terms in -85t - 133564 + 133564. -85t Collect the terms in 68964g - 68964g + 17g*3. 17g*3 Collect the terms in -17i - 7i + 31i - 4i - 8i. -5i Collect the terms in -233y + 1188y + 2373y + 91y. 3419y Collect the terms in 3n3 + 40 + 57 - 140 + 45. 3n*3 + 2 Collect the terms in 2 + 1 - 61x*3 + 51x*3 - 3. -10x*3 Collect the terms in -3t*3 - 161t*2 + 166 - 84 + 61t*2 - 82. -3t*3 - 100t*2 Collect the terms in -4k*2 + 2k - 7k2 + 12k*2 + 0k*2 - 2k2. -k2 + 2k Collect the terms in 31343r*2 - 23r + 11r - 31345r*2 + 12r. -2r2 Collect the terms in -4d*3 + 8d*2 + 0d*2 - 2d*2 + 0d*3 + 2d*2. -4d*3 + 8d*2 Collect the terms in 24v*3 + v - 46v*3 - v + 0v. -22v3 Collect the terms in -1484f - 4365f + 292f - 1685f. -7242f Collect the terms in -30i3 - 4i*3 + 13i*3 - 66i*3 + 2. -87i*3 + 2 Collect the terms in 10p + 16p3 - 10p - 12p3. 4p*3 Collect the terms in -731k + 244k + 245k + 244k. 2k Collect the terms in 20c - 10c + 4320c2 - 10c. 4320c2 Collect the terms in -416348298 + 52j*3 + 416348298. 52j*3 Collect the terms in -26r + 587 + 606 - 1193. -26r Collect the terms in -657o + 16o2 + 34 - 6o*2 - 11o2. -o2 - 657o + 34 Collect the terms in 140s + 33s - 61s + 19s. 131s Collect the terms in 1451l - 729l - 8873l - 1434l. -9585l Collect the terms in -2 + 35 + 25f*3 - 33 - 28f*3. -3f*3 Collect the terms in -27 - 28 + 4281n + 55 - 4286n. -5n Collect the terms in 70q3 - 24705843q*2 + 24705843q*2. 70q*3 Collect the terms in -516t*2 - 87448 - 2t + 87448. -516t2 - 2t Collect the terms in -419m + 174m + 291m. 46m Collect the terms in -2 + 108h - 250h + 2 + 143h. h Collect the terms in -33q*2 - 56q*2 + 88q2. -q2 Collect the terms in -971m2 + 504m*2 + 463m*2 + 6. -4m*2 + 6 Collect the terms in -10v*2 - 1606 - 29v*3 + 10v*2. -29v3 - 1606 Collect the terms in -394912317 + 394912317 + j3. j*3 Collect the terms in -20537 + 20537 + 5y. 5y Collect the terms in -r2 - 393r + 841r - 448r. -r*2 Collect the terms in 650d + 663d + 647d - 1962d. -2d Collect the terms in -529t2 + 2 + 528t2 - 2. -t2 Collect the terms in -165x + 32x + 33x + 35x + 39x + 30x. 4x Collect the terms in -74q - 87q + 246q - 49q - 77q. -41q Collect the terms in -31a**2	{ "pile_set_name": "DM Mathematics" }
p? 4 Suppose p = 2 - 0. Suppose -10 - p = 3t. What is the units digit of -2(-7)/t-2? 7 Let w(g) = g3 - 9g*2 + 20g - 20. What is the hundreds digit of w(11)? 4 Let c = -3 - 6. Let g = c - -59. What is the units digit of g? 0 Suppose -5v + 3c + 10 = 0, 0v = -5v - 3c + 10. Suppose vg - 31 = 115. What is the units digit of g? 3 Suppose 4v - 3v = -5d - 11, -3d = 4v - 7. What is the tens digit of -3 + (-1436)/(-16) + 1/v? 8 Let r(m) = -6m - 39. Let o be r(-7). Suppose -4w = -i - 692, oi = -w - i + 156. What is the tens digit of w? 7 What is the hundreds digit of (448/40020)/((-4)/(-70))? 3 Let g(n) = -2n*3 + 18n*2 + 15n - 15. What is the hundreds digit of g(-7)? 4 Let k = 66 + -31. Suppose 0 = 10x - 3x - k. Suppose -xl + 4u + 74 = -8, 3l - 5u - 44 = 0. What is the units digit of l? 8 Let v(x) = 1470x2 - 3x - 1. What is the units digit of v(-1)? 2 Let u be (-3 + 1 + 3)2. Let p be (1 - -3 - -119) + -1. Suppose 5h = ut - 110, 0 = -2t - h - 0h + p. What is the units digit of t? 0 Suppose i + 3d - 1623 = 1271, 2d - 8696 = -3i. What is the thousands digit of i? 2 Suppose -67f + 183818 = -38354. What is the tens digit of f? 1 Suppose 5o - 5t - 4388 = 7107, -4610 = -2o - 4t. What is the tens digit of o? 0 Suppose -111d = -146d + 119805. What is the tens digit of d? 2 Let l(j) = j2 - 2j - 7. Let u be l(3). What is the units digit of (u/(-20))/((-1)/(-205))? 1 Suppose -19o = -10o - 981. What is the tens digit of o? 0 Let w(d) = -d*3 - 15d*2 + 3d + 19. Let q be w(-15). Let v = q + 33. Suppose v + 22 = f. What is the units digit of f? 9 Let z(w) = w*2 - 23w + 65. Let m be z(-28). Suppose 7s - 530 = m. What is the tens digit of s? 8 Let h be (-24)/(-36)(1 + 2). Suppose 2p - 2w = 3w + 25, hp - 20 = 4w. Suppose p = 4v - 5b - 190, 5b + 96 = 2v + 2b. What is the units digit of v? 5 Suppose 7s - 1 = 8s, -v = 3s - 2195. What is the thousands digit of v? 2 Let i(k) be the second derivative of -k4/12 - 3k*3/2 + 2k*2 + 7k. Let u = -10 - -1. What is the units digit of i(u)? 4 Let y = 3988 - 2276. What is the thousands digit of y? 1 Suppose 3n = -5d - 0n - 313, -d = -n + 69. Let v = -22 - d. What is the tens digit of v? 4 Let h be (-35)/7 + 6/1. What is the tens digit of 0 - ((-1)/h)/((-5)/(-250))? 5 Suppose -12l + 108 = -6l. Let q be ((-81)/l)/(6/8). What is the units digit of 30 + q + (-12)/3? 0 Let w(b) = b - 105. Let t(o) = -o2 + o + 1. Let v(d) = -t(d) - w(d). What is the units digit of v(0)? 4 Suppose -8 = 2d - 18. Suppose -dm + 6 = -34. Let z(n) = -n2 + 9n + 6. What is the units digit of z(m)? 4 Let n(w) = w*2 + 5w + 43. Let k be n(0). Suppose -3u = -5s - 7u + k, 2u = -3s + 25. What is the units digit of s? 7 Suppose 30f - 20110 + 880 = 0. What is the tens digit of f? 4 Suppose 11v - 5703 = 952. What is the tens digit of v? 0 What is the units digit of 3/(-10) + (39543/10)/1? 4 Let f(n) be the third derivative of n6/120 - n5/5 + 13n*4/24 + 7n3/6 - n2. What is the units digit of f(11)? 9 Let x = -1 - 3. Let c(z) = z*2 + 5z + 9. What is the units digit of c(x)? 5 Let w(l) = l*3 - 6l*2 - 6l - 3. Let y be w(7). Suppose yf + 1 = 13. Suppose 42 = -j + fj. What is the tens digit of j? 2 Let v = -249 - -366. What is the hundreds digit of v? 1 Let s = 878 - 179. What is the hundreds digit of s? 6 What is the hundreds digit of -15 + (-54)/(-4) + 2170/4? 5 Suppose -2u - 428 = 712. Let r = -404 - u. What is the hundreds digit of r? 1 Let b be 4-1 - (-8 + 6). Let h(n) = 2n3 + 3n*2 - n - 2. Let j be h(b). What is the units digit of (j - -2)(-123)/6? 1 Suppose -3b - 3332 = -5b - 2m, 3b - 5m = 5030. What is the thousands digit of b? 1 What is the tens digit of (-60)/(-105) - 71304/(-21)? 9 Let q(n) = 10n + 2. Let z be q(3). Let u = z + 247. What is the hundreds digit of u? 2 Let d be 71/(-3)36/(-12). Suppose -11 + 5 = -2n. Suppose -174 = -ns - 2k + 37, -k + d = s. What is the units digit of s? 9 What is the tens digit of (1-1)/(20/(-1500))? 7 Let k be 294/8 - (-4)/16. Suppose -c - 5 = -k. What is the tens digit of c? 3 Let h = -587 + 2243. What is the units digit of h? 6 Suppose -b = -16 + 12. Suppose 0s - bs = 20, -5c = 2s - 280. What is the units digit of c? 8 Let m(u) = 36u*2 - 5u - 8. Let f(v) = -v*3 + 7v*2 + 9v - 11. Let x be f(8). What is the hundreds digit of m(x)? 3 Let h(a) = 4a + 45. Let w be h(-10). Suppose -wn + 3c + 1233 = 0, 0c = -n - c + 245. What is the tens digit of n? 4 Let n = -10 - -5. Let b(f) = -9f + 4. What is the units digit of b(n)? 9 Let c = 333 - 193. What is the tens digit of c? 4 Suppose 4v - 86 = 2r, -5v + 5r = -62 - 33. Suppose 0 = 16m + v - 712. What is the units digit of m? 3 Let u be -190 + (1 - 2) - (-9 - -10). Let n = -98 - u. What is the units digit of n? 4 Let v(y) = y*2 - 5. Let r be v(-6). Suppose -102 = 28d - rd. What is the tens digit of d? 3 Let d = -22 - -18. Let a be d/(-10)1-5. Let y = 10 + a. What is the units digit of y? 8 Let k(w) = w + 20. Let c be k(-4). Suppose -3g + cg = 65. What is the units digit of g? 5 Let n(q) = -q3 + 5q*2 + 6q + 5. Let s be n(6). Suppose 3d - 36 = -o, d + d = -so + 37. Suppose -10v + dv - 12 = 0. What is the units digit of v? 2 Let f = -80 + 523. What is the tens digit of f? 4 Let k(a) = 5a2 + 40a + 10. Let t be k(-8). What is the units digit of ((-15)/t)/(4/(-536))? 1 Let b = 785 - 101. What is the units digit of b? 4 Let g = -42 + 785. Suppose 3w - g = -2r, 0 = -4w + 6r - r + 1006. What is the units digit of w? 9 Suppose 0 = 3k - d - 7739, 8k - 10k = 3d - 5174. What is the thousands digit of k? 2 Let v(r) = 8r - 9. Suppose 0 = 2x - 180 + 140. What is the units digit of v(x)? 1 What is the tens digit of (2/8 - 483/(-36))6? 8 Let u be (-1 - -2)/(1/(-948)-2). What is the hundreds digit of ((-3)/(-6))/(1/u)? 2 Let v(h) = 3h + 28. Let m be v(-7). Let s = -16 + 5. Let n = m - s. What is the units digit of n? 8 Suppose 0 = -i - 3, -3j - 3i = -0i - 174. What is the units digit of j + 3/2(6 - 8)? 8 Let m(f) = -f3 - 17f*2 + 22f - 21. Let q be m(-18). Let s = 236 + q. Suppose 176 = 4t + 4c, -27 = -4t - 2c + s. What is the tens digit of t? 4 Let w be (-180)/(-99) - 2/(-11). Suppose wp - 1 = 1. What is the units digit of (0/(-1) + p)30? 0 Suppose -31 = -6d + 53. Let b(f) be the second derivative of -f5/20 + 13f*4/12 + 5f*3/2 + 4f*2 - f. What is the units digit of b(d)? 2 Suppose 3468 = b - m, -6b = -4b - 3m - 6940. What is the tens digit of b? 6 Suppose t - 16 = -3t. Suppose 4q = t + 20. Let k(j) = j*2 - 3. What is the tens digit of k(q)? 3 Let r = -16 - -23. Suppose 3c = rc - 332. What is the tens digit of c? 8 Suppose 80t = 89t - 9153. What is the thousands digit of t? 1 Suppose 6 = 3l - 3h - 201, 139 = 2l - h. What is the units digit of l/4 - (-2)/(-4)? 7 Suppose 46 + 44 = 2q. Let d = q - 24. What is the tens digit of d? 2 Suppose -198 = -4b + 2u + 3u, -b + 2u = -48. Suppose 22i = 19i + 12. Suppose iw - 64 = b. What is the tens digit of w? 2 Suppose 530 + 3230 = -5k. Let y be 26/39 + k/(-6). Suppose -y = -9a + 6a. What is the units digit of a? 2 Let i be -512(0 + 8/10). Let u = i + 84. What is the tens digit of u? 3 Suppose 3v + 2473 = -2v + 4d, -5d + 10 = 0. Let a = -237 - v. What is the units digit of a? 6 Let c = 2155 - 983. What is the hundreds digit of c? 1 Suppose t + 353 = 4054. What is the tens digit of t? 0 Suppose 2i - 2x = -5x + 3507, 5i - 8770 = -5x. What is the hundreds digit of i? 7 Let v(y) = -y*3 + 16y*2 - 14y - 7. Let t be (-4)/(-2)15/2. Let q be v(t). Suppose -5c = -3b + q, b + 2b = 4c + 7. What is the units digit of b? 1 Suppose -3 = -j - 0, -3d + 4j + 21 = 0. Let z(u) = u + 26. What is the tens digit of z(d)? 3 Suppose 4u = -3z + 10926, 2z - 5 = -1. What is the thousands digit of u? 2 Let g(c) = 2c3 - c3 + 9c*2 + 7c + 3 + 0c3. Let l(w) = 7w + 51. Let d be l(-8). What is the tens digit of g(d)? 6 What is the hundreds digit of (5 + 0)/(-10)(3 - 617)? 3 Let m = 160 + 1931. What is the units digit of m? 1 What is the tens digit of 437 + -8 + 14 + 0? 4 Let j(y) = -y3 - y2 - 13y - 90. What is the tens digit of j	{ "pile_set_name": "DM Mathematics" }
is 7/2 of a litre in millilitres? 3500 What is 13/8 of a milligram in micrograms? 1625 Convert 17.56586 micrometers to centimeters. 0.001756586 What is 0.997032 years in months? 11.964384 How many litres are there in 39.05038ml? 0.03905038 Convert 191.4088 millilitres to litres. 0.1914088 What is 716311.35 minutes in days? 497.4384375 How many nanograms are there in 10.69712 kilograms? 10697120000000 What is thirty-two fifths of a kilometer in meters? 6400 What is 6/5 of a kilogram in grams? 1200 How many millilitres are there in 7.994393 litres? 7994.393 What is sixty-four fifths of a decade in years? 128 How many microseconds are there in 333060.1ms? 333060100 What is 9247.608 months in millennia? 0.770634 What is 1071.702 months in centuries? 0.893085 How many decades are there in 26.9416 millennia? 2694.16 How many nanograms are there in 2/125 of a microgram? 16 Convert 36173.6 weeks to microseconds. 21877793280000000 How many microseconds are there in 21/4 of a millisecond? 5250 What is 75.20114 seconds in nanoseconds? 75201140000 What is 57.26334 decades in years? 572.6334 What is 7362.481l in millilitres? 7362481 How many microseconds are there in 6/5 of a millisecond? 1200 Convert 1697.109um to meters. 0.001697109 What is 2/45 of a week in seconds? 26880 How many millimeters are there in 1/10 of a kilometer? 100000 Convert 8898.308 millilitres to litres. 8.898308 Convert 52297415.1ns to weeks. 0.00000008647059375 How many millilitres are there in fourty-one halves of a litre? 20500 How many millilitres are there in nine tenths of a litre? 900 How many years are there in 17/4 of a millennium? 4250 How many grams are there in 44.0468 milligrams? 0.0440468 What is 3/10 of a century in years? 30 What is 56201.12 millilitres in litres? 56.20112 Convert 317413.3 minutes to seconds. 19044798 What is 0.8759888 centuries in years? 87.59888 How many tonnes are there in 47.25768 kilograms? 0.04725768 How many micrometers are there in 0.8169456km? 816945600 Convert 79.53409l to millilitres. 79534.09 What is 2377.596 months in years? 198.133 How many millimeters are there in 1/4 of a meter? 250 What is 0.206262ng in kilograms? 0.000000000000206262 Convert 54999.29 tonnes to kilograms. 54999290 What is 19470.624 months in decades? 162.2552 What is 8/3 of a year in months? 32 How many months are there in 3.221403 millennia? 38656.836 What is twenty-seven halves of a century in decades? 135 What is five quarters of a litre in millilitres? 1250 What is seventeen halves of a centimeter in millimeters? 85 What is three fifths of a milligram in micrograms? 600 What is 3483.162mg in nanograms? 3483162000 How many kilograms are there in one tenth of a tonne? 100 How many minutes are there in seven thirds of a day? 3360 What is 83.60558 millilitres in litres? 0.08360558 How many tonnes are there in 0.2105969 micrograms? 0.0000000000002105969 What is 7565.389l in millilitres? 7565389 Convert 2.874603kg to micrograms. 2874603000 What is 24.56756ml in litres? 0.02456756 Convert 78237.23 millilitres to litres. 78.23723 How many hours are there in 5/6 of a week? 140 Convert 483.942 millimeters to centimeters. 48.3942 How many millimeters are there in 37/2 of a centimeter? 185 What is 31/5 of a millennium in decades? 620 How many decades are there in fourty-one halves of a century? 205 How many micrograms are there in 6/25 of a milligram? 240 Convert 49138.66 meters to centimeters. 4913866 How many meters are there in 72/5 of a kilometer? 14400 What is 6228.721 kilograms in micrograms? 6228721000000 How many minutes are there in twenty-one eighths of a day? 3780 What is 11/2 of a hour in seconds? 19800 How many kilometers are there in 746.7734 micrometers? 0.0000007467734 What is 0.743576g in nanograms? 743576000 What is 0.8665441 litres in millilitres? 866.5441 What is 0.556611ug in nanograms? 556.611 What is 1/5 of a tonne in kilograms? 200 What is 6/5 of a milligram in micrograms? 1200 How many seconds are there in 28/3 of a minute? 560 What is 6/5 of a meter in millimeters? 1200 How many milliseconds are there in 5/6 of a minute? 50000 Convert 0.8446031 hours to seconds. 3040.57116 What is 0.1682401t in grams? 168240.1 How many nanometers are there in 1/10 of a millimeter? 100000 How many seconds are there in 1/9 of a hour? 400 How many micrograms are there in six fifths of a milligram? 1200 Convert 69.12601l to millilitres. 69126.01 How many millilitres are there in 0.4359659l? 435.9659 What is 1/20 of a meter in micrometers? 50000 What is 6499.955 years in centuries? 64.99955 Convert 41952.86cm to nanometers. 419528600000 What is three eighths of a minute in milliseconds? 22500 How many milligrams are there in 3/50 of a kilogram? 60000 What is twenty-seven quarters of a millennium in months? 81000 Convert 3.863481 years to months. 46.361772 How many months are there in fifty-two thirds of a century? 20800 How many minutes are there in 72/5 of a day? 20736 How many years are there in one fifth of a millennium? 200 Convert 0.0464149 centuries to decades. 0.464149 What is three fifths of a microgram in nanograms? 600 How many nanoseconds are there in 9825.237 hours? 35370853200000000 How many kilometers are there in 86.75691um? 0.00000008675691 Convert 40.90209nm to kilometers. 0.00000000004090209 How many meters are there in fifteen quarters of a kilometer? 3750 What is 21/8 of a meter in millimeters? 2625 How many millennia are there in 951599.5 decades? 9515.995 How many months are there in 13/4 of a millennium? 39000 How many months are there in twenty-one eighths of a decade? 315 How many months are there in 7/3 of a year? 28 What is one fifteenth of a day in seconds? 5760 How many seconds are there in 61088.16 days? 5278017024 What is 11/10 of a day in minutes? 1584 Convert 0.6608072 millennia to decades. 66.08072 How many micrometers are there in 17/2 of a centimeter? 85000 Convert 124.23186 microseconds to days. 0.00000000143786875 How many seconds are there in 2/27 of a day? 6400 How many centimeters are there in three fifths of a kilometer? 60000 How many nanograms are there in 0.5125191g? 512519100 What is thirty-two fifths of a kilogram in grams? 6400 What is fifty-three fifths of a gram in milligrams? 10600 What is twenty-seven halves of a gram in milligrams? 13500 How many kilograms are there in 82.9459mg? 0.0000829459 What is 21130.93 litres in millilitres? 21130930 How many centuries are there in 42.44222 years? 0.4244222 What is 1.562425 millennia in decades? 156.2425 How many millilitres are there in 53/4 of a litre? 13250 How many millilitres are there in fourty-nine fifths of a litre? 9800 What is 21/5 of a litre in millilitres? 4200 What is 9913.299 micrometers in centimeters? 0.9913299 What is 142.005ng in tonnes? 0.000000000000142005 Convert 914.4143ng to grams. 0.0000009144143 How many months are there in 5/4 of a millennium? 15000 Convert 5361.361ug to milligrams. 5.361361 How many millimeters are there in 1/64 of a kilometer? 15625 What is 3/10 of a kilometer in meters? 300 How many seconds are there in 53029.69 hours? 190906884 How many grams are there in 7768.837 nanograms? 0.000007768837 How many tonnes are there in 2.029149ug? 0.000000000002029149 What is 5/4 of a century in months? 1500 How many millennia are there in 7.299538 centuries? 0.7299538 How many millilitres are there in 962407.6 litres? 962407600 How many micrometers are there in 1/20 of a meter? 50000 How many grams are there in one twentieth of a tonne? 50000 What is 3.16148 millennia in years? 3161.48 How many months are there in 1/60 of a century? 20 What is 6702.277mg in nanograms? 6702277000 How many millilitres are there in 3/50 of a litre? 60 What is 9.884762ns in microseconds? 0.009884762 How many litres are there in 707.4754ml? 0.7074754 How many kilograms are there in 9/10 of a tonne? 900 How many millilitres are there in 19/4 of a litre? 4750 How many millimeters are there in fifty-four fifths of a centimeter? 108 How many nanograms are there in 710359.4g? 710359400000000 Convert 7.770986 years to centuries. 0.07770986 What is 1596500.01ms in weeks? 0.002639715625 What is one tenth of a millimeter in nanometers? 100000 How many minutes are there in 87/	{ "pile_set_name": "DM Mathematics" }
Let a = 0.13 - 0.191. Round a to two decimal places. -0.06 Let v = -1.7088 - -1.7. Round v to three dps. -0.009 Let t = -8 - -7.7. Let f = t + -3.7. Let v = 4.00000028 + f. What is v rounded to 7 dps? 0.0000003 Let x = 32 + -31.58. Let n = 0.3 - x. Round n to one dp. -0.1 Let u = -249749.93 - -249745.93000025. Let a = u + 4. Round a to seven dps. 0.0000003 Let r = -6 - -2. Let b(y) be the third derivative of 11y6/120 - y5/10 - y4/6 + 2y*3/3 - 8y*2. Let u be b(r). Round u to the nearest 100. -800 Let g = -3.6 - -3.62. What is g rounded to one decimal place? 0 Let b = -0.31 + 0.31358. What is b rounded to 4 decimal places? 0.0036 Let d = -0.79 + 53.79. Let z = -0.1105609 - 52.8927391. Let s = z + d. Round s to 3 decimal places. -0.003 Suppose 2c - 45 = 2x - x, -4c - x + 81 = 0. Let d = c - 101. Round d to the nearest 10. -80 Suppose 9i + 29440 = -7i. Round i to the nearest 1000. -2000 Let q = -3.80157 + 3.8. Round q to 4 decimal places. -0.0016 Let b(k) = 1743k - 1. Let u be b(7). What is u rounded to the nearest 1000? 12000 Let c = 23.0620583 - 25.36205776. Let l = 0.01 + -2.31. Let k = c - l. Round k to seven decimal places. 0.0000005 Let h be 2792/(-2)5/10. Let d = 458 + h. What is d rounded to the nearest 10? -240 Suppose -5j + 53 = 43. Suppose -4m = -0m - 20. Suppose ji + 1415 = -5d, 0d = -mi + 4d - 3620. What is i rounded to the nearest 100? -700 Let f = 10.53 - 2.52. Let h = 8 - f. Let v = -0.01092 - h. Round v to 4 dps. -0.0009 Let l = 26.4 + -26.1168. Let s = l - 0.27. What is s rounded to 3 decimal places? 0.013 Let d = 4580.945 + -4565. Let r = d + -16. Let b = r + 0.006. Round b to 2 dps. -0.05 Let v = 66817 - 66817.1700085. Let d = v + 0.17. Round d to 6 dps. -0.000009 Let q = -0.2149 - -0.206. What is q rounded to 3 decimal places? -0.009 Let n(f) = 57777f - 7. Let q be n(-9). Round q to the nearest 100000. -500000 Let d = -40519320690108215.00000001 - -40519320487271541. Let m = d + 202836676. Let c = m - 2. Round c to 7 decimal places. 0 Let a(v) = -18245v*2 + 19v - 4. Let g be a(-4). What is g rounded to the nearest one hundred thousand? -300000 Let p be ((-72)/1)/((-4)/15154). Suppose 3a = 3j - 314994, 4j = 3a + p + 147222. Round j to the nearest ten thousand. 110000 Let i = -0.007005332239845 + -214511.046995077760155. Let b = -214466.054 - i. Let z = 45 - b. What is z rounded to seven decimal places? -0.0000004 Let x = 24.07 - 93.51. Let c = x - -71. What is c rounded to 1 decimal place? 1.6 Let m = 19 + 15. Let r = m + -77. Let b = 43.00041 + r. What is b rounded to four decimal places? 0.0004 Let g = -39.3 - -24.2. Let i = 13 + g. Round i to the nearest integer. -2 Let b be 2 + (3/1 - -1). Let o = b - 11. Let a(g) = -18401g3 - 6g*2 - 6g - 5. Let d be a(o). What is d rounded to the nearest 1000000? 2000000 Let c = -626555 + 1989633. Suppose c + 956922 = b. Round b to the nearest one hundred thousand. 2300000 Suppose 2f = -8, -3f - 10 = -2q + 3q. Suppose -qs + 350000 = -4s. What is s rounded to the nearest 10000? -180000 Let l = -0.05 + -0.082. Let a = 0.658 - l. What is a rounded to one decimal place? 0.8 Let r(u) = -u*3 + 9u*2 + 13u - 6. Let m be r(10). Let i(b) = 180b - mb + 29b. Let g be i(-2). Round g to the nearest one hundred. -400 Let a(z) = 9z*2 + 4z + 2. Let l be a(-4). What is l rounded to the nearest one hundred? 100 Let f(d) = 4889d2 + d + 2. Let u be f(-3). Round u to the nearest ten thousand. 40000 Suppose -4 = -4a + 4. Let p = a - -3. What is p rounded to the nearest 10? 10 Let b = 8247.56742963 + -8239.36743. Let x = -8.2 + b. Round x to 7 dps. -0.0000004 Let b = -43.000037 - -43. What is b rounded to 5 dps? -0.00004 Let v be (-17)/(-119) + (-559999)/(-7). Round v to the nearest 100000. 100000 Let v = 28.999548 - 29. Round v to four dps. -0.0005 Let w = -309514 - -508514. Round w to the nearest ten thousand. 200000 Let k = 2011.9 - 1481. Let z = -564 + k. Round z to zero decimal places. -33 Let u = 241.0000238 - 241. Round u to 6 decimal places. 0.000024 Let x = -4 + 3.5. Let h = 0.3 + x. Let i = h + 0.199996. What is i rounded to five dps? 0 Let m = -0.059 - 23.941. Let h = -24.000014 - m. What is h rounded to 6 decimal places? -0.000014 Let p = -250 + 362. Suppose 5o - o = -p. Round o to the nearest 10. -30 Let v(w) = -3w*3 - 2w*2 - 4w - 2. Let d be (-3)/923. Let f be v(d). What is f rounded to the nearest 10? 20 Let t be 72001/(-3) + 16/48. Round t to the nearest 10000. -20000 Let p = 87 - 80.7. Round p to zero dps. 6 Let m = -1 - 0. Let w(h) = h*3 + 6h*2 - 8h - 5. Let p be w(-7). Let k be 29199998/p + 2 + m. Round k to the nearest one million. 15000000 Let j = 0.1 - -1. Let r = j + -1.10000065. Round r to seven dps. -0.0000007 Let b = 3.22 + -1.2. Let l = 0.004 + b. Let p = 2 - l. Round p to two decimal places. -0.02 Suppose 2o = -2o + 2w - 1966, 0 = 4o - 3w + 1969. Round o to the nearest 100. -500 Let n(w) = 24999w - 1. Let u be n(-1). What is u rounded to the nearest ten thousand? -30000 Let r = 7.9 + -7. Let s = r + -0.90000014. What is s rounded to 7 decimal places? -0.0000001 Let o = 34.99999993 + -35. Round o to 7 dps. -0.0000001 Let s = -481 + 481.229. Let n = 0.152 - s. Let f = -0.0769911 - n. Round f to six decimal places. 0.000009 Suppose -6 = -4n + 2. Suppose no + 2o - 3l = 20, -o + 5l = 12. Let c be 881/2 + (-4)/o. What is c rounded to the nearest 100? 400 Suppose 7444 = 3n + 634. What is n rounded to the nearest 100? 2300 Let r = 35 - 35.000077. Round r to five decimal places. -0.00008 Let n = 0.088 + -0.0880061. What is n rounded to six decimal places? -0.000006 Let p = -4 - -6. Suppose -pz + 6z - 25199990 = 2t, z + t = 6300005. What is z rounded to the nearest one million? 6000000 Let n = -4.399992 - -4.4. What is n rounded to five decimal places? 0.00001 Let z = 3295 + -1583. Let t = z + -1112. Round t to the nearest 100. 600 Let u = 34 - 39. Let h(q) = q3 + 5q*2 + 3q + 4. Let x be h(-4). Let v be x/(-20) - (-498)/u. What is v rounded to the nearest 100? -100 Let z = -540.1878 - -454.2. Let j = z + 86. What is j rounded to 3 decimal places? 0.012 Suppose -3c - 1 = -4. Let p be 330 - (-3)/3c. Let m = p + 409. What is m rounded to the nearest one hundred? 700 Let u be 3/((-4)/((-10094232)/9)). Suppose -3r = -x - 198770 - u, 2x + 1733260 = 5r. Suppose r + 93348 = -5p. Round p to the nearest 10000. -90000 Let s = -2064.994 - -2064.3339949. Let m = s - -0.66. Round m to 6 dps. -0.000005 Let j = 13.88 + -11. Let z = j - 4.11. Round z to one dp. -1.2 Let c(s) = -s*2 - s + 2. Let p be c(-4). Let l = -19 - p. Let n = 79 + l. Round n to the nearest one hundred. 100 Let x = 15.67 - 16. Let y = 0.3394 + x. Round y to 3 decimal places. 0.009 Let p = 12422071 + -12422083.078387. Let g = -6.07839 - p. Let l = g - 6. What is l rounded to five decimal places? 0 Let n(y) = -3y*2 + 122y*3 - 7y - y*2 - 1 + 6. Let k be n(7). Let a = k + -62606. What is a rounded to the nearest 10000? -20000 Let n = -21.3 - 1.7. Let q = n - -29.7. Round q to the nearest integer. 7 Let r = 1.5 - 1.514. Round r to three decimal places. -0.014 Suppose -5l - 2a + 265012 = a, -5l + 4a + 264984 = 0. Round l to the nearest 10000. 50000 Let c = 13 - 4.6. What is c rounded to 0 decimal places? 8 Let i = 0.300006 - 0.3. Round i to five decimal places. 0.00001 Let o be ((-7)/(-14))/((-1)/4). Let q be (-55)/1 + 1 + o. Round q to the nearest 10. -60 Let w = -164.1 - -404. Let j = w - 228. Round j to the nearest integer. 12 Let r = 0.22 - 3.03. Let c = -3 - r. Let w = c - -0.2. What is w rounded to one decimal place? 0 Let r = -11811495005549 - -11811498023040.7200031. Let m = r + -3017492. Let o = -0.28 - m. What is o rounded to six decimal places? -0.000003 Let z = 0.08 + -1.38. Let a = -5.9 + z. Round a to the nearest integer. -7 Let x = 6491.93 + -6491.8760097. Let n = -0.054 + x. Round n to 6 decimal places. -0.00001 Suppose -4p - 9 = -3p. Let n(z) = -z2 - 5z - 7. Let f be n(p). What is f rounded to the nearest 10? -40 Let m = 35.9917 - 36. Round m to 3 dps. -0.008 Let h = -2.94 - 0.06. Let w = h + 3.0015. Round w to three decimal places. 0.002 Let n = 3.34 - 2.9. Let d = -0.04 + n. Let g = -0.3998 + d. What is g round	{ "pile_set_name": "DM Mathematics" }
299/28) Simplify ((cc/((c/(cc*(-4/7)))/cc)c)/((c(-3/11)c)/c)cc*(3/2)c(1/18))(-3/22) assuming c is positive. c(-3643/5082) Simplify j(-1)/j(j/j(1/3))/j(jj1/j)(-3/10) assuming j is positive. j(-79/30) Simplify ((c(cc4c)/cc/(c/(c(2/11)/c)))/(((c/c4)/cc)/((c(-6)/c)/c)))(2/9) assuming c is positive. c(4/99) Simplify (g(-4))*(2/37)/((g/((ggg8g)/g))/ggg*(1/21)gg) assuming g is positive. g(5234/777) Simplify ((vvvv*(9/4)v(v(-17)/v)/v)(-1/8))(-6/13) assuming v is positive. v(-153/208) Simplify (((i/i(-3))/i)/ii(9/5))/(i(1/7)i8) assuming i is positive. i(-152/35) Simplify ((rr(-13/5))(-47))(2/99) assuming r is positive. r(752/495) Simplify ((((m*(2/11)/m)/mmm)/((m/(mmm/m(3/2)m))/mm))(-1/21))(-9/2) assuming m is positive. m(111/308) Simplify ((((i/(i(-7)/i))/i)/ii)/(ii13ii))/((((i/(i/(i(-15)ii)))/i)/i)/(i/i(-19))) assuming i is positive. i27 Simplify (k(k*(-21)/k)/kkk22)(-46) assuming k is positive. k(-46) Simplify (g(-13)g*(-1)/g)/((g(g*2/g)/gggg)/(g/(gg(gg/g(2/5))/g))) assuming g is positive. g(-103/5) Simplify (h(-2/25)h(2/15)/h)/(h(3/10)/(h/(h/h*(-1/13)hh))) assuming h is positive. h(-6481/1950) Simplify (q(2/7))(7/5)q/q*7q(((q(-10/3)q)/q)/q)/qq assuming q is positive. q(-134/15) Simplify q(-3/5)qq(-1/3)q(q/(q/q0))(-29) assuming q is positive. q(16/15) Simplify (z/(z(-15/2)z)zz/(z(z(-2/3)/z)/zz)z)/(z/z(-7))(-12/5) assuming z is positive. z(911/30) Simplify (x1)(-2/135)((x/x*(1/2))/x)/(xxx/((xx*(6/7)/xxx)/x)) assuming x is positive. x(-3133/1890) Simplify ((j/j(-17))(-50))(-31) assuming j is positive. j27900 Simplify (w(2/23))(1/8)/((ww*(-24)ww)/w(-20)) assuming w is positive. w(93/92) Simplify (f(-1/7)f*(-2/3)(f*(1/3)f)13)(-2) assuming f is positive. f(-694/21) Simplify (c(-1/35)/(cc/(cc/(c/(c/c*(8/7))c)c)))/((c(-5/2)/cc)/ccc/c*(-10)cc) assuming c is positive. c(-817/70) Simplify ((a3a/(aa/a(-5)))/((a/(a/a(2/5)))/(a/(aa(-1/8)))))(-1/26) assuming a is positive. a(131/1040) Simplify (v(1/5))28/(v(-3))(-14) assuming v is positive. v(-182/5) Simplify (f*(7/2)(f(f/f(2/3))/f)/ff/(f*2f)f(-1))(2/95) assuming f is positive. f(-1/285) Simplify ((s(1/3))6(ss/(sss/(s/(s((s*0/ss)/s)/sss))s))(-3/10))(2/15) assuming s is positive. s(26/75) Simplify (((t/t(-1))/(tt/(t/(ttt*3t))))(2/17))(-8/3) assuming t is positive. t(80/51) Simplify (((j/j(-5))/j(-4))36)(-6/13) assuming j is positive. j(-2160/13) Simplify (yy(-2/11))14/(y2)(-20/3) assuming y is positive. y(818/33) Simplify ((u(2/3)u)*(-12)(u/(u*(-3)uuu))(-18/13))(13/2) assuming u is positive. u(-139) Simplify ((t/t(15/7)t(-2/5)t)(-5/3))33 assuming t is positive. t*(209/7) Simplify ((c/(((ccc/(cc*9c)c)/c)/c))/((c(c/(c*(-30)c))/c)/c))/(c*(-14)/ccc(c*(1/17)c)/c) assuming c is positive. c(-103/17) Simplify (y(-7))*(1/5)/(yy(1/3))(-3/2) assuming y is positive. y(3/5) Simplify ((j/j(2/11))/(j*(19/5)j))/(j*(2/5)j)(-2/23) assuming j is positive. j(-4883/1265) Simplify ((j/j(-26))(-35/6))(5/12) assuming j is positive. j(-525/8) Simplify (x*0x)*49(x*(2/9)x)35 assuming x is positive. x(826/9) Simplify (l*(-27)l/(l*(-18)l))/((ll/l(9/4))/(l/l(-1/14))) assuming l is positive. l(-215/28) Simplify (b(-4/11))3/(b(-5))(9/7) assuming b is positive. b(411/77) Simplify (u(3/10))(-5/3)/((uuu(-2/5)uu)/uuu(-21)) assuming u is positive. u(169/10) Simplify g(5/4)/g(-12/11)(g*(-13)/g)/(ggg(-8)/g) assuming g is positive. g(-205/44) Simplify ((x/(x(-22)/xx))/x)*1(xx(3/4))/x(2/19) assuming x is positive. x(1797/76) Simplify pp/p*(-2/13)pp(-3)(pp/p(-1/3))9 assuming p is positive. p(275/13) Simplify ((g(2/5)/(g/(gg(3/11))))/(g(-6)g(-2/3)))(2/53) assuming g is positive. g(2422/8745) Simplify ((o(2/17)/o)14)0 assuming o is positive. 1 Simplify ((uuu(2/7))/((u0/u)/uu)(u2)22)48 assuming u is positive. u(15888/7) Simplify ((p/(p/(p/(ppp(-2/31)p))pp))/(pp/p(-3)p))/(p/(p/(p*8p))pp*15/ppp) assuming p is positive. p(-1114/31) Simplify (a(-12)/a(5/11))27 assuming a is positive. a(-3699/11) Simplify (((uu*1uu)/u)37(u*(-1)u)(-2/39))(-4/7) assuming u is positive. u(-444/7) Simplify (((s/(s/s(1/4))s)(-41))(-2/27))(-2/79) assuming s is positive. s(-205/2133) Simplify (i(-1)i)*(-5/3)((i/i(1/4))/i)/((i/i(-1/4))/i) assuming i is positive. 1/sqrt(i) Simplify ((g(26/7)/g)/g)/g(-1)(g(-2/7)/g)/g(-10) assuming g is positive. g(80/7) Simplify (d(-2/5)dd10)/(d4)(-45) assuming d is positive. d(953/5) Simplify (((c(2/9)/c)/c)/(c/c(-30)))/(c8)(-5/3) assuming c is positive. c(-175/9) Simplify ii*(-9)ii/i(-23)i(-15)/(i(-1/6)/ii) assuming i is positive. i(13/6) Simplify t(-1/9)/tt*(-2/5)t5/t(-4) assuming t is positive. t(337/45) Simplify (k(7/4)k29k)/(k*(-31)k/(k(2/3)/k)) assuming k is positive. k(737/12) Simplify (o4)37/(o0)35 assuming o is positive. o148 Simplify (((l/(l/l(1/3))l)/(((l(2/7)l)/l)/l))(-1/27))15 assuming l is positive. l(-215/189) Simplify ((l(-9)/(l/(l/((ll/(l/((l(-3/2)l)/l)))/l))))(-40))(1/18) assuming l is positive. l(50/3) Simplify u(-5)u(-7)(u*(-2/7)uuu)(-46) assuming u is positive. u(-958/7) Simplify ((ff/f(-2/3))45/(f7/(f/((f/((f6f)/ff))/f))))(30/13) assuming f is positive. f(3630/13) Simplify ((u/((u/u(-2/5)uu)/u))24/(u(u/((u/u*(-2/5))/u)u)/uu)(-2/3))(1/23) assuming u is positive. u(-478/345) Simplify (ff(-5/2))(-2/27)(f/(f(-13)/f))(-5/16) assuming f is positive. f(-659/144) Simplify ((s(sss*(1/6))/s)/ss(s(-1/3)/s)/s)/((s/(ss/(sss1)))/(s7/s)) assuming s is positive. s(23/6) Simplify (s7s)(-2/73)(s/s(-4))(18/11) assuming s is positive. s(6394/803) Simplify (p0/((p/p*7)/p))/((pp*(-3/11))/((p/(pp/(pp(-8))p))/ppp)) assuming p is positive. p(-19/11) Simplify (q(2/5)/q(-18))/((q(-7/5)q)/q(1/8)) assuming q is positive. q(757/40) Simplify (((bb*(2/27)/bb)/b(bb(-7))/b)/(b7/(b*(2/15)b)))4 assuming b is positive. b(-6908/135) Simplify g/((g*(-2/13)g)/g)g/g(-11)g/(g/g*11)gg(-10) assuming g is positive. g(197/13) Simplify (((c(1/3))(-3/8))39)25 assuming c is positive. c(-975/8) Simplify (f/(ff/(ff(4/5)ff))f/f(-17))/(((f/((f(1/2)f)/f))/f)/f(-22)) assuming f is positive. f(-7/10) Simplify (q(qq(2/11)/q)/q)(-20/9)/(q(4/5))(-35) assuming q is positive. q(2732/99) Simplify jj/j*(1/16)jj(-16)j/(j/(j/((j*(-1/3)/j)/jj)))j8/j assuming j is positive. j(-179/48) Simplify (y(-2)y*(2/3)y)/(y*(-10)y(5/7)/y) assuming y is positive. y(209/21) Simplify (((w/(w/((w/(w/(ww5))w)/w)))/w)/(w/(((w*24/w)/w)/ww)))/(((ww/(www9)ww)/w)/w16) assuming w is positive. w50 Simplify ((j(jj(6/11))/j)/j(8/7))/(j5)(-7/5) assuming j is positive. j(570/77) Simplify (((s(-44)/s)/ss)/s(1/11))(5/6) assuming s is positive. s(-1240/33) Simplify ((h30/h)/h(-32))(-31) assuming h is positive. h*(-1891) Simplify (((cc/((cc(-23))/c))/c)/(cc(-26)))(-29) assuming c is positive. c(-1421) Simplify ((u(2/3))(-41)/((u(1/7)/u)/u(uu*(3/5))/uu))(-2/145) assuming u is positive. u(5686/15225) Simplify (k*(-2/7)k)/k*(-2/15)((kk(-1)k)/k)(-10/3) assuming k is positive. k(89/105) Simplify (((vv1)/v)34(v*(-4)vv)/v(-1/10))(-5/4) assuming v is positive. v(-321/8) Simplify ((i/(ii/(i(ii*(-6/11))/i)ii)i)/(i(ii(-1/20)/i)/i))(-9) assuming i is positive. i(2961/220) Simplify (j(2/17))(13/5)/(((j/j(-8))/j)/(j/(j/(j*(4/17)j))j)) assuming j is positive. j(-464/85) Simplify ((l1)(-17/3)l*(-3)ll/l(-1))(-2) assuming l is positive. l(34/3) Simplify (zz/(zz(-11))zzz/(z/(zz(1/3)z))*z	{ "pile_set_name": "DM Mathematics" }
40s2 - 20s Let s(h) = 5h + h + 7 - 4. Let o(l) = -11l - 5. Let y = -10 + 15. Let x(g) = ys(g) + 3o(g). Let t(c) = -c. What is t(x(z))? 3z Let o(k) = -2k*2. Let v(x) = -73x. Give o(v(z)). -10658z2 Let t(d) = -12d*2. Let s(l) = 21l. Determine t(s(x)). -5292x2 Let k(z) = 5z*2 - 4z - 6z2 + 4z. Let g(j) = 12j. What is g(k(a))? -12a*2 Let p(j) = 2j. Let u(b) = -12b - 15b*2 + 30b - 18b. What is p(u(z))? -30z*2 Let c(z) = 16z. Let d(o) = -28o + 25o - 14 + 14. What is c(d(p))? -48p Let t(p) = -p2. Let k(c) = -50c - 4. Calculate k(t(s)). 50s2 - 4 Let j(q) = 4q + 5. Let b(x) = -3x - 4. Let o(n) = 5b(n) + 4j(n). Let i(r) = 3r. Determine o(i(v)). 3v Suppose -5a + 5l + 17 = 3l, 3a = -5l + 4. Suppose 3y = 3 + 3. Let c(z) = -zy - 2 + 5 - a. Let s(v) = 3v. Give s(c(k)). -3k2 Let p(c) = -c + 3. Let f(y) = -y + 2. Let v be f(2). Let i(d) = 2 - 6 - 10 + 4d + vd. Let u(n) = 6i(n) + 28p(n). Let r(s) = -2s. Calculate r(u(w)). 8w Let r(h) = -4h2. Let w(n) = n2 + 3n + 3. Let p(z) = 3z*2 + 8z + 8. Let f(a) = 3p(a) - 8w(a). Calculate f(r(k)). 16k4 Let y = 1 + 3. Let a(z) = yz + 0z - z. Let x(n) = -n. Determine a(x(q)). -3q Let u(w) = -571w2. Let c(q) = q. What is c(u(k))? -571k*2 Let t(g) = 2g. Let m(n) = 28n + 27n - 12n. Give m(t(u)). 86u Let v be (55/3)/(14/(-42)). Let z(j) = j + 4. Let o(y) = 15y + 55. Let p(m) = vz(m) + 4o(m). Let a(g) = -3g. Determine a(p(f)). -15f Let g(q) = 2q*2 - 3q. Suppose 0 = 4x + 16, -5j + 5 = -5x - 0. Let k(l) = l2 - l. Let w(c) = jk(c) + g(c). Let n(b) = -5b. Give n(w(h)). 5h2 Let c(i) = i2. Let o(w) = 218w. Determine o(c(g)). 218g*2 Let r(b) = 7b. Let u(w) be the first derivative of 6 + 0w - 1/2w*2. What is r(u(h))? -7h Let y(x) = -2x. Let j(h) = 6h. Let p(m) = 6m + 0m - 2m - 2m. Let v(c) = -3j(c) + 8p(c). Determine v(y(f)). 4f Let v(c) = -5c*2. Let t(j) = -14j - 8. Calculate t(v(d)). 70d2 - 8 Let n(q) = -7q + 3. Let x(u) = 2u - 6787 + 6787. Determine n(x(c)). -14c + 3 Let t(i) = -3i2. Let z(b) = -5b. Let s(u) = -66u. Let p(d) = -4s(d) + 54z(d). What is t(p(q))? -108q*2 Let t(f) = -2f. Let w(a) be the first derivative of 3a2/2 - a + 4. Let p(b) = b - 1. Let r(c) = 3p(c) - 3w(c). Determine t(r(k)). 12k Let a(h) be the second derivative of 13h3/6 + 3h. Let n(i) = -6i. Let j(y) = -2a(y) - 5n(y). Let p(b) = 3 + 2b*2 - 3. Calculate j(p(o)). 8o*2 Let o(m) = 6m - 9 - 3 - 8m. Let x be o(-9). Let c(t) = x - 3 - 3 - t. Let b(a) = 4a. Calculate b(c(n)). -4n Let v be (8/(-6))/((-2)/3). Suppose v = f - 0. Let k(b) = 2b*2 + 2b*2 - 6b*f. Let q(z) = 2z*2. Give k(q(s)). -8s*4 Let t(n) = 2n. Let i(j) = 4683j. Determine i(t(x)). 9366x Let w(q) be the second derivative of -2/3q3 + 0q*2 - 2q + 0. Let l(p) = 2p. What is l(w(b))? -8b Let n(w) = w*2. Let z(f) = -f - 1. Let u(d) = 10d*2 + 40d + 40. Let a(x) = -u(x) - 40z(x). What is a(n(i))? -10i*4 Suppose 0 = 2g + 2g + 8, 17 = -r - 5g. Let w = r + 10. Let l(j) = 2j - 3 + w. Let s(b) = -b. Give s(l(o)). -2o Let s(q) = 23q2 + 1. Let y(g) = -g. Determine y(s(o)). -23o*2 - 1 Let d(k) = 5k*2. Let u(i) = -3i. Give u(d(w)). -15w2 Let b(y) = 7y*2 + 4y + 4. Let k(t) = -8t2 - 3t - 3. Let r(z) = -3b(z) - 4k(z). Let q(i) = -5i2. Calculate q(r(d)). -605d*4 Let m(u) = -u. Let f(v) be the first derivative of 11v*3/3 - 2v + 3. Calculate m(f(k)). -11k2 + 2 Let d = 3 + -1. Let s(w) = 2 + dw - 2. Let l(x) = 0 - 2 - 2x + 2. Give l(s(u)). -4u Let d(k) = -5320k2. Let x(y) = 2y*2. Give x(d(w)). 56604800w*4 Let k(l) = -8l - 9l2 - l + 9l. Let r(q) = 3q. Determine r(k(b)). -27b*2 Let h(g) = 50g + 35. Let m(u) = 3u + 2. Let x(o) = 2h(o) - 35m(o). Let d(l) = 3 - 3 - l. Determine x(d(p)). 5p Let p be -3 + (-1 - (-9 - -1)). Let x(d) = -d*2 - d + 5d - pd. Let m(h) = -h. Calculate x(m(z)). -z2 Let x(h) = 2h + 2 - 2 - h. Let r(p) = -3p. What is r(x(w))? -3w Let h(s) = -4s. Let b(i) = -i - 1. Let l(j) = 8j + 10. Let o(v) = 10b(v) + l(v). Determine h(o(q)). 8q Suppose 6x - 2x = 48. Let r(b) = -2b - 4 - 8 + x. Let a(u) = 3u. Give r(a(g)). -6g Let w(d) = 30d. Let f(u) = 1283 + 2u2 - 1283. Calculate f(w(r)). 1800r*2 Let r(c) = -6966c. Let k(m) = m. Calculate r(k(s)). -6966s Let z(x) = 4x*2. Let p(w) be the second derivative of 4w*3/3 - 24w. What is z(p(h))? 256h2 Let z be (16 + (-6 - -3))2. Let t(u) = 26 + 9u2 - z. Let f(p) = -2p. Give f(t(r)). -18r2 Let u(q) = -q. Let s(a) = -10a*2 - a. Give u(s(o)). 10o*2 + o Let r(s) = -8s*2. Let d(t) = 255t - 2. Calculate d(r(x)). -2040x2 - 2 Let o(n) = n2. Let a(r) be the third derivative of 0r + 3r2 + 1/8r*4 + 0 + 0r*3. Determine o(a(z)). 9z*2 Let v(i) = 2i. Let m(b) = -2b2. Let k(x) = 3x*2. Let j(a) = 3k(a) + 5m(a). Calculate v(j(s)). -2s*2 Let j(w) be the first derivative of 2w3/3 + 1. Let c = -2 + 4. Let f(t) = -t2 - 2t2 + tc + 0t*2. Give j(f(a)). 8a*4 Let o(d) = -13d*2 + 28d*2 - 11d*2. Let u(p) = -7p - 5. Let j(r) = 3r + 2. Let t(s) = 5j(s) + 2u(s). What is o(t(q))? 4q*2 Let s(y) = 10y*2. Let b(x) = 3x*2 - 5x*2 + 9x - 9x. Determine s(b(j)). 40j*4 Let p(u) = -9u*2 + 7u - 7. Let b(d) = -5d2 + 4d - 4. Let o(h) = 7b(h) - 4p(h). Let k(f) = 0f2 - 2f*2 + 0f*2. Calculate k(o(g)). -2g*4 Let a(f) = -2f*2. Suppose 6 = 4u + 2. Suppose -m + 1 + u = 0. Let c(b) = 13b + 3b*m - 13b. Calculate a(c(q)). -18q4 Let b(x) = -x3 - x2 + 2. Let q be b(0). Let f(j) = jq + j - j. Let r(d) be the first derivative of d2/2 + 5. Give f(r(h)). h2 Let m(n) = 7n. Let t(r) = 41r2. Calculate m(t(w)). 287w2 Let v(b) be the third derivative of -b5/60 - 6b2. Let t(g) = -16g. Give v(t(p)). -256p2 Let i(j) = -2238j*2. Let z(c) = 3c*2. Give i(z(q)). -20142q*4 Let m = 7 + -5. Let g(l) = ml - 1 + 2 - 1. Let o(y) = 5y. Let c(u) = 10u. Let k(f) = -3c(f) + 7o(f). What is g(k(s))? 10s Let h(n) = -4n*2 + 2. Let c(d) = 270d*2. What is c(h(t))? 4320t*4 - 4320t*2 + 1080 Let q(g) = g. Let i(p) = -7p*2 + 1. What is q(i(u))? -7u2 + 1 Let k(x) = x. Let y(j) be the first derivative of j3/3 + 7. Calculate y(k(u)). u*2 Let y(a) = -2a*2. Let k(g) = 24g - 7. What is k(y(l))? -48l2 - 7 Let i(q) be the third derivative of -17q*5/60 - 2q*2. Let c(k) = -k. What is i(c(y))? -17y*2 Let a(r) = -r. Let n(z) = -4947z*2. Give a(n(o)). 4947o2 Let v(g) = g2 + 2. Let q(b) = 4b2. Calculate v(q(u)). 16u*4 + 2 Suppose -5r - 3m = -1, 0 = 4r - m - 4 - 7. Let y(t) = -rt + 0t + t. Let q(x) = 7x + 5. Let f(d) = -6d - 4. Let g(o) = 5f(o) + 4q(o). What is g(y(n))? 2n Let s(f) = 3f - 2. Let z(d) = 7d - 5. Let w(c) = 5s(c) - 2z(c). Let g(h) = -12 - 2 + 14 + h. Calculate w(g(r)). r Let j(z) = z. Let q(p) = -14p*2 - 3p + 3. Let t(y) = 168y2 + 35y - 35. Let k(a) = -35q(a) - 3t(a). Determine k(j(d)). -14d2 Let d(v) = 120v*2. Let g(b) = -4b. Give g(d(l)). -480l2 Let j(h) = -2h. Let s(b) = -b3 - b2 - 2b + 7b*2 - 2 - 2b*2. Let q be s(2). Let l(k) = -k + 2k*q + k. Determine l(j(w)). 8w*2 Let k(y) = -29y*2. Let m(u) = -5u. Determine m(k(w)). 145w2 Let r(o) = -2o. Let g(k) = 6k. Let q(i) = -2g(i) - 7r(i). Let f(y) = 2 - 2y - 2. Give q(f(t)). -4t Let p(k) = 5k. Let l(r) = -9r + 13. Let d(g) = 8g - 12. Let n(q) = -4d(q) - 3l(q). Let z(o) = -o + 2. Let b(j) = 2n(j) - 9z(j). What is b(p(x))? -5x Let c(y) be the first derivative of 5y*2/2 + 1. Let b(m) = 2m*2. Calculate c(b(o)). 10o*2 Let i(w) = 4w + 0w + 2w - 4w. Let s(q) = q + 1. Let g(x) = -7x - 6. Let n(a) = g(a) + 6s(a). Give n(i(u)). -2u Let w(z) = 13z - 7. Let r(o) = 7o - 3. Let i(x) = -14r(x) + 6w(x). Let p(b) = 2b. Calculate i(p(y)). -40y Let a(m) = -179m. Let r(h) = 9h*2. Give a(r(f)). -1611f*2 Let q(w) = -w + 9. Let x be q(7). Let v(f) = 7f*2 + xf*2 - 11f*2. Let h(a) = 6a*2. Determine v(h(o)). -72o*4 Let a(w) = -269w*2. Let r(m) = 3m. Give r(a(g)). -807g2 Let w(j) = -j - 9. Let r(o) = -1. Suppose -16v - 8 = -12v. Let l(s) = vw(s) + 18r(s). Let z(a) = a*2. Give	{ "pile_set_name": "DM Mathematics" }
+ -6 + -7? -4 What is the value of ((-288)/(-135))/32(14 - 8)? 2/5 (-35)/49 + (-297)/(-378) 1/14 What is ((-168)/(-1092))/(3/(-9))? -6/13 What is the value of (2105 - 2104)((-8)/58)/2? -2/29 Evaluate (1359/72 - 72/9) + -11. -1/8 (1(3 - -1))/((-6)/12) -8 Evaluate -6 - (-2)/(-12 + 8)-24. 6 What is the value of -4 - (1 - (5 + (-55)/15))0? -4 Calculate 2(63/(-28) - -2)24. -12 Calculate 4 - (138/20 - (-1)/10). -3 (4888/282)/((-28)/18(-24)/28) 13 What is (-452)/(-65) - 76/(-380) - 2/13? 7 What is 25 + -3 - (-4221)/(-189)? -1/3 Calculate ((-28)/35)/(140/(-1225)). 7 (-9284)/(-396) - 23 - 242/18 -13 What is the value of (2280/(-36))/(-5) + -15? -7/3 What is 20/825(-132)/(-24)? 2/15 What is the value of (-2 - (-24)/11) + (-8664)/1672? -5 What is the value of ((-9)/(-2) + -3)/(11 + 88/(-32))? 2/11 What is 2/(-12)(4 + (-11)/(594/192))? -2/27 What is (((-64)/128)/((-4)/(-272)))/1? -34 Evaluate ((-24)/(-30))/((-3468)/510). -2/17 Calculate (255920/(-4570))/((-8)/(-2)1/2). -28 Calculate ((-84)/2310)/(3/15). -2/11 What is (-7)/((-315)/54)(-100)/12? -10 What is 15 + (-15 - 2) - -24? 22 Evaluate (-2)/(-9) - (-1)/(-3)8320/(-156). 18 Calculate 451/(-22) + 6/2 + 93/(-62). -19 ((-95)/20 + 5)/((-7)/40 - 0) -10/7 Calculate ((-1121)/(-1239) - 2/(-21))(8 + -4). 4 336/(-2205) - (4 - 270/63) 2/15 What is 0 + (-2)/3(-8)/(-112)? -1/21 What is (4 - 9) + (3 - 10 - -4)? -8 Evaluate (1/(-8))/(231/9240). -5 (-4)/(-8 + 684/81) -9 What is 208/(-1848)3 + (-260)/(-44) + -6? -3/7 -7 - (-276)/48 - ((-292)/(-48) + -7) -1/3 Evaluate (279/54)/(((-1155)/126)/55). -31 Calculate 273/(-1155) - -4(-3)/33. -3/5 (25 + 6314/(-238))51/(-3) 26 What is -1 - (-16)/(-864)-30? -4/9 What is (30/160)/(-3)-2? 1/8 (5/108)/((-5210)/(-6252)) 1/18 What is the value of (-10542)/390 + (-223 - -250)? -2/65 8 + 1698/(-210) - 8/40 -2/7 (0 - (-26)/12)/(1/(2 - 1)) 13/6 What is the value of (65/(-39))/((-350)/1470)? 7 Calculate (45/(-6))/((15/(-1) - -5)/8). 6 6/6(-328)/(-24) - (-3)/9 14 Calculate (-1)/(21/(-49)14/(-24)). -4 Evaluate (-34)/(-11) + (-408)/374. 2 What is (9/135)/((-6)/198)? -11/5 8/3(-3)/((-9 - 0) + 7) 4 What is the value of (-7 + 56/8811)2/(-4)? 0 Calculate (33/77014)/((-2)/60). -18 -12 + 15 + -9 - 03/(-18) -6 (8/14)/(12/7)-2 -2/3 2/40 - ((-3)/(-30))/(65/(-65)) 3/20 Evaluate 30/190391/102 + 2/(-19). 1/2 Calculate 0 - (3/104)/(90/600). -8 Evaluate 0 + (2 - 1 - (4 - (-3 - -10))). 4 Calculate (3268/(-516) - 21/(-3))1-9. -6 What is the value of (69/63 + -1)/(19/(1710/(-20)))? -3/7 (175/(-42) - -11) + -7 + 47/(-6) -8 What is (22 - 30 - (-66)/10)/(1/(-10))? 14 Calculate 14/(-49) - ((-663)/170)/(2 - -19). -1/10 What is the value of (-104)/(-22) - 2/(-4)-8? 8/11 ((-164)/(-54) - 3)/(4/(-12) + 0) -1/9 (-636)/(-1378)130/(-4) -15 Evaluate (-14)/12(-4080)/10710. 4/9 Evaluate (-3)/((-54)/(-44)) + 110/45 + -2. -2 What is (-108)/(-15)560/224? 18 Calculate 1 - (9 - 18) - (6/(-3) - 22). 34 Calculate 3-4 + 2 + 206 + -207. -11 Calculate 7 + -6 - (16 + -25 + 6). 4 508/(-616)-2 - 1 - 188/517 2/7 Evaluate -7 - ((8 - 2) + 3). -16 6528/720 - 72/8 1/15 What is -27 + 23 - 2-4 - 1040/264? 2/33 Calculate 4 - 76/(-7581)(-10283)/26. 2/57 What is ((-18)/4)/((10/(-4))/(-5))? -9 What is the value of 6/12-335/(-63)? 5/6 Evaluate (-60)/(-114)(-7)/(-35) + (-39)/190. -1/10 Calculate 12/(-2) - (-13)/((-4160)/(-1900)). -1/16 What is the value of 970/(-1575) + 315/(-49) + (-14)/(-2)? -2/45 701/276 - 80/920 1/6 What is the value of ((-11)/22-1)/((-3)/(-6))? 1 (2124/616)/9 + (-276)/644 -1/22 Evaluate (-61)/(-58 - -60). -3 ((-335)/201)/((-4)/(-6)) - 49/(-2) 22 What is (-11)/132 + (-40)/(-48)? 3/4 Calculate ((-105)/(-30) + 425/(-102))(1 + -6). 10/3 What is -71 - (-35 - -23) - -42? -17 (-6)/(-10)(-2)/(52/(-65))-1 -3/2 What is (-2280)/2970 - ((-12)/(-189) - (-8)/(-28))? -6/11 What is the value of (-322)/(-190) - (2592/(-76) + 34)? 9/5 Evaluate (21/21)/(35 + -56). -1/21 (795/(-212))/(-3 - (-201)/72) 18 ((-58)/(-377))/(5/39) 6/5 (-534)/54 - (-72)/((-48)/(-6)) -8/9 (-9 + 0 + 9)/3 + -15 + 21 6 What is 3614/84(-1)/(-21)? 2/7 What is 60/(-3) - (340/(-34) - -1)? -11 What is the value of ((-1792)/1176 + (-2)/(-3))-21? 18 Evaluate (-13)/(1430/(-255)) + (-30)/12. -2/11 (-10)/(-35)(-441)/(-18) 7 What is (-1036)/(-364) - (9 + -1)/2 - -1? -2/13 What is (335/20)/(-67) + (-291)/(-12)? 24 Evaluate 4/(-9) + 13/(3627/155). 1/9 Evaluate 12/76 + 25872/(-2128). -12 Evaluate -23 + 16 + (-272)/(-40). -1/5 -5 - (2/(-8)-10 - 69/138) -7 Calculate (3 - 66/27)1112/695. 8/9 What is ((-11)/10 - (-6)/(-15))/(480/(-192))? 3/5 Calculate (-42)/1785-17 + 6/(-10). -1/5 What is (22/121)/((-204)/(-21318))? 19 What is ((-1)/12-10)/(-311/33)? -5/6 What is the value of 60/18018/8? 3/4 Calculate (580/522)/((-30)/(-12)). 4/9 What is the value of ((-1122)/714)/(2/14)? -11 ((-442)/260)/(-4(-9)/72) -17/5 Evaluate (1/21)/((-431)/2586) - -5. 2 (-1)/162 + (-3348)/96 + 30 -5 What is (34/(-4))/(674/(-1348))? 17 What is the value of 1175/(-141)(-12)/(-10)? -10 Evaluate 21 + (-12 - 19) + 21/1. 11 What is (450/(-120) - -31)/(2/(-2))? 3/4 Calculate 2(6 + 417/(-69)) - 3762/(-8349). 4/11 What is (13/(715/33))/((-12)/380)? -19 What is 1744/(-320) + (-34)/(-136)? -26/5 Calculate (-273)/(-13) + (-15)/(-5) + (-9 - 0). 15 What is (1572/156 + -10)2? 2/13 Evaluate 1/(-6)((-143)/22 - -8). -1/4 What is ((-2)/(-6))/(-28 + (-448)/(-14))? 1/12 What is the value of (136/(-340))/((-2)/(-10))? -2 Evaluate (-57 - (-22065)/385) + (-12)/14. -6/11 Calculate 17766/690928/(-6). -12 (268/536)/(4/(-6)) -3/4 What is the value of (622 + -628)2/(-20)? 3/5 Evaluate (-1446)/90 + 8/120. -16 111/(-180) + (-1133)/(-44) + -25 2/15 Evaluate ((-14)/(-35))/(2/(-20)) - (41 - 32). -13 Evaluate (-75 + -12)/29 - 74/(-22). 4/11 What is (-3432)/1287(9/30)/(-1)? 4/5 What is (-225)/36 - (-7 - 3/(-6)2)? -1/4 Calculate 63/42 + (-4 - 462/(-8)). 9 Calculate ((-6321)/245)/(-43)(-5 - 0/2). -3 Calculate 0/((-47)/(-799) - (-18)/(-17)). 0 What is the value of (-64)/80(-3 + 2) - (-2)/(-40)? 3/4 (1/((-28)/(-21)))/(30/(-16)) -2/5 Calculate (15/(-2)2 - 3)(-341)/(-2046). -3 192/168(-6)/(-4)70/(-30) -4 What is ((-960)/4080)/(30/(-85))? 2/3 What is the value of (16/10)/((-40)/100)-1? 4 (-988)/10374((-4)/4 - (-3)/6) 1/21 What is the value of (120/105)/((-36)/42)3/2? -2 Calculate -8 - (-7 - 572/60)/2. 4/15 Evaluate 12 - ((-2610)/2320)/((-3)/(-16)). 18 Calculate (2 - (3 + -5))(-134)/(-268). 2 What is (84/210)/(48/(-5))? -1/24 What is the value of -22 + 23 + (-588)/(-21)? 29 Calculate (1/2)/((-12)/(-8)) - (-36)/54. 1 What is the value of (-25)/25(-228)/6? 38 Evaluate -6(-6)/(-18) - (-3 - -5). -4 Calculate ((-9)/(-12))/((-15 - 16)/(-992)). 24 What is the value of (10 - (-94)/(-4))/3 + 2/4? -4 Calculate (6 - 90/21)(11 - (-4 + 8)). 12 What is -1 + 3 + 34/(-4) - 5/10? -7 What is 2/18 + (-40)/210(-287)/(-6)? -9 Evaluate 0/(-3) + (-15)/225. -1/15 What is (2-2 + 1)(17 + (-129)/9)? -8 What is the value of (-2 + (-52)/(-36))(10 - (-477)/(-45))? 1/3 -21 - (5/40 - (-6063)/(-376)) -5 Evaluate -1 - (43/(-418)12 - 14/(-77)). 1/19 Calculate (11 - (-13 + 50)) + (-56)/8. -33 Evaluate (-18)/(-405)(-39)/(-143)5. 2/33 Evaluate (-1197)/(-132) - 130/13 - 6/(-33). -3/4 (-2 - (-84)/360) + 3/2 -4/15 What is the value of (744/1860)/(313/(-105) - -3)? 21 Calculate 7 - (5/((-20)/(-12)))/(12/32). -1 (3/9 + (1 - 1))/((-25)/375) -5 Calculate (-3570)/(-612) + (-94)/84 + (-4)/(-14). 5 What is the value of ((-12)/17)/(796/(-6766))? 6 What is -3(-6 - 525/(-90))? 1/2 What is (2/(-4))/((-13)/(468/(-63)))? -2/7 Evaluate (-5 + 289/68)/(((-1)/12)/(-1)). -9 Calculate 0/(-24) - (-6)/(-14). -3/7 What is 3222/2148 - (0/3)/2? 3/2 ((-2)/(-6))/(29/(-450) + (-216)/2700) -30/13 What is (6 - 5)/((-17)/68 - 10/(-8))? 1 What is (-1 + 0)(11 + 35/(-5) + -6)? 2 What is the value of (-27)/185 + (7 - 116(-108)/(-1776))? -1/5 Evaluate (13 - 3)/(-57 - -59). 5 Calculate (-7 - -2)(4 + -3) + 376/76. -1/19 What is the value of 14/(-24)((12 - -2) + -18)? 7/3 1048/(-262)(-2)/(-3) -8/3 (8 - 175/7) + 33 16 What is the value of (-1*44/(-1430))/(6/180)? 12/13 What is the value of 4455/(-171) + 23/437? -26 What is the value of 38/(-5) + (13 - 134/10)? -8 What is 2356/133 - 357/21? 5/7 What is 5 - ((-681)/(-126) - (-124)/(-217))? 1/6	{ "pile_set_name": "DM Mathematics" }
? 104 Calculate -6 + (-44 - (-23 - (-12 - -1) - -3)). -41 What is the value of -48 + 46 - ((1 - -6) + -5 + -5 + 0)? 1 82 + (15 - (-7 + 13)) + -27 64 What is the value of 51 - 0 - (-86 + 95 - 21)? 63 Evaluate (3 - (17 + (11 - 28))) + (-21 - (1 - 2)). -17 What is -22 - (-68 - -73 - -43)? -70 Calculate (2 - 115) + -1663 + 1722. -54 What is the value of -98 + (-3 - -8) + -2 - (139 + 34 + -169)? -99 -39 + -44 + 20 + 35 -28 21 - (-17 - ((-22 - -14) + 1 + 42)) 73 Evaluate (68 - (-11 + 0 - (-14 + 13) - 0)) + -10. 68 What is the value of (-12 - 0) + (-57 - -93) - 6? 18 (-1 - (-8 - 91)) + 13 + -22 + 3 92 What is (5 + 47 - (-8 - -6 - -4)) + -9? 41 (25 - 7 - (57 + (54 - 103))) + 1 + 111 122 What is 38 - (-10 - -14 - (5 - -7))? 46 What is the value of -26 - (83 + -31 + 19 + -9)? -88 Evaluate -6 + (12 - 35 - -1) - (-11 - (0 - 15)). -32 Evaluate 33 + (84 - 92) + (0 - 76) + 5 + 2. -44 What is 186 + 68 + -37 + -104? 113 What is the value of 48 - (107 + -56 - -54)? -57 71 + (8 + -37 + 23 - (-26 - 0)) 91 Calculate (24 - -4) + -12 + 0 + 28. 44 What is the value of 41 + (6 - -14) + -34 + -20? 7 What is the value of (-16 - (-32 + (13 - -3)) - (5 - 4)) + 82? 81 What is the value of (-151 - -109) + (10 + 1 - (-4 - 2))? -25 Calculate 17 + 7 + (-7 + (-5 - -6) - 5). 13 -11 + (-5 - 0 - 0) + 36 + -1 + -35 -16 Evaluate (-9 - (-52 - (-54 - -24))) + 27. 40 Evaluate -46 + 5 + -7 + 0 - (-45 + 55). -58 Calculate -91 + 32 - (-14 + 0 + -7). -38 Evaluate -111 + (18 - (-42 + 30)) - -9. -72 What is the value of 12 - -1 - (1 - -60 - 17) - 12? -43 What is (-20 - -12 - -2) + (8 - 6) + 16? 12 Calculate (-26 - 20) + (-6 - (-2 - (-6 + 10))). -46 Calculate 0 - ((-7 + 13 + -14 - 5) + -36). 49 (-2 - 76) + (-99 - -79) + (2 - 3 - -11) -88 -1 + -66 + -1 + 12 + (307 - 318) + -2 -69 (-65 - -66 - (0 + (26 - 2))) + -45 -68 Evaluate 25 - (66 + (15 - -8) + 29). -93 What is 22 + 57 + -54 + (5 - 79)? -49 -13 + 13 + (-6 + -1 - (58 - 78)) 13 Calculate (-14 + 4 - -40 - -1) + (-92 - -109). 48 What is 10 - (-3 + 4 + (-10 - (-23 + 9)))? 5 -69 - 5 - (2489 + -2638) 75 Calculate 69 + (-10 + 20 + -14 - 26). 39 What is the value of -14 + (21 - 11) + (4 - (8 - 6 - 3))? 1 Calculate 4309 + -4309 - (-43 - 0). 43 Evaluate 56 + -13 + 28 + (-40 - 1). 30 What is the value of (169 - (38 + 17)) + (-5 + -3 - 3) + 2? 105 What is the value of 41 - 0 - (7 + 5 + 11 - 19)? 37 Calculate 2 - (4 + -2 + -4 + 26 + 22 + -17). -27 Calculate -20 + 1 - (2970 + -2973). -16 What is the value of (-22 - -9 - 10 - -52) + -18? 11 Evaluate -389 + 372 - (-34 - -1) - 66. -50 Calculate 2 - -29 - (-18 + 24 + 76). -51 Evaluate -6 - 51 - (35 - 42). -50 What is the value of 13 - (-37 - (103 - 174))? -21 Calculate -80 + (-57 - -70) + 42. -25 Evaluate 35 + (-4 + (-4 - (-5 - 6)) - -5) + -1. 42 What is the value of -15 + 2 - (558 + -518)? -53 Evaluate (1 + -2 - 1) + (6 + -2 - 7). -5 Calculate 74 + (1 - 0 - 8 - (-20 - (-70 - -50))). 67 What is the value of (15 - -3) + -3 + -1059 + 1087? 43 Calculate -20 + -90 + 21 - -208. 119 What is (1 - -49) + (-5 - 13) + (3 + 8 - 5)? 38 Evaluate -4 - (66 - -2 - (-20 + (1 - (-13 + 10)))). -88 Calculate 130 + -38 + (-34 + 46 - 11). 93 Calculate -54 - (-19 + 35) - (8 + 0 + 0 + 4). -82 1 - (11 + (-4 - 0)) - (95 + -72) -29 What is the value of 4 + 1 + -1 + (0 - 20 - (-1179 - -1128))? 35 Evaluate -9 + 4 + -4 + (38 - (3 + -13)). 39 What is the value of -79 - (-27 + 53 - 79)? -26 What is the value of (-32 - ((-19 - -71) + -55 - (-6 + 1))) + -9? -43 80 + (17 + 44 - 34) + -31 76 Evaluate -2 - 17 - (-467 - -386). 62 What is the value of -38 + (-5 + 23 - (19 - -13))? -52 What is the value of -80 + 1 - (6 - 25 - -9)? -69 What is the value of (5 + -1 - 9) + 2 + (-8 + 4 - -2)? -5 What is the value of 1 + -1 + (2 - 5 - (-17 - (-41 - 3)))? -30 What is the value of (200 - 295) + (-1 - -34)? -62 What is -133 + (-5 - 5 - 2) + (260 - 246)? -131 Evaluate (-10 - -12) + (-50 - -54 - (36 - (6 - 4))). -28 -117 + 158 + (-3 - 0) + 7 45 What is 1637 + -1622 + 0 + -25? -10 Calculate 66 - (-214 + 50 - -194). 36 Evaluate 24 + 141 + -174 - (0 - (-3 - -53)). 41 What is the value of -53 + -15 + 57 - -28? 17 Evaluate -42 - (23 + -89 + -50). 74 5 - (1 + 3 + (-61 - (-13 + 7)) - 0) 56 Evaluate 4 + -9 + 4 + (-1337 - -1280). -58 What is 0 + 7 + -22 + 18 + 8 + -96? -85 What is 81 - 135 - (166 + -261)? 41 Calculate -14 - (40 - (-21 - -36)). -39 -313 + -200 + 505 - (0 - (1 - 24)) -31 Calculate (-97 - -217) + -110 + -99. -89 Evaluate -326 - (-46 - 113) - -112. -55 (-119 - -125) + 33 + -2 - -12 49 Evaluate (-84 - -112) + 11 + -63 + -84. -108 What is -50 - (-6 + 0 + (158 - 160))? -42 What is 4 + -84 + 15 + (5 - 5)? -65 Evaluate (1642 - 1657) + (-1 - (-3 + 3)) + 79. 63 Evaluate 17 - (34 + -74 - -7) - (11 + 2). 37 Evaluate -22 + -1 + 14 + 6 + -40. -43 What is 226 + -292 - (8 - (8 + -3))? -69 Evaluate (-119 - -77 - -18) + 1 + 31. 8 17 - (-18 + (-23 - -30 - -6)) 22 Evaluate -5 - (86 - (-43 - -104)). -30 -6 + 42 - (-5 - -19 - 14) 36 What is the value of 14 - 13 - (-182 + 137)? 46 What is the value of 24 - ((-13 - 21) + 43) - 27? -12 Evaluate 86 - 129 - -52 - (-2 + 2 - 31). 40 What is 23 + 1 - (-35 - 0 - (204 - 230))? 33 -1823 + 1879 + -34 + -2 20 What is the value of (1 - (20 - -14)) + 8? -25 Evaluate 27 + -7 - (11 - (114 - -3 - 12)). 114 What is the value of 23 + -1 + (-175 - -76) + 113? 36 Calculate (0 - -50) + -3570 + 3519. -1 What is the value of 0 + 9 + -23 + 30 - -30? 46 Evaluate (21 + 15 - 18) + 1 + (-7 - -11). 23 -10218 + 10248 + (-78 - 0) -48 What is the value of (-5 - (2 - 3)) + 13 + 18 + -15? 12 Calculate (12 - (80 - 22 - 21)) + 11. -14 Evaluate 199 - (14 - -74) - 176. -65 What is the value of 9 + (3 - (-11 + 48) - (-1 - 8))? -16 Calculate 100 + 53 + -80 + 10. 83 Evaluate (3 - -10) + (-3 + (13 - 9) - 37). -23 Evaluate 5 - (-13 - (9 - (34 + 2 + -14)) - -6). -1 (-6 - 0) + 7 + (1 + (2 - -20) - 117) -93 Evaluate (467 - 454) + (-1 - (2 + -4)) - (5 + -98). 107 Calculate -3 + 9 - (4 - (9 - (13 - 15)) - -79). -66 What is the value of 12 + 1 + -6 + 3 + -1 + (1626 - 1571)? 64 What is (-29 - -2 - -1) + 78? 52 What is 27 + 11 + -380 + 329? -13 What is the value of (10 + 10 + -14 + 1 - -4) + 64? 75 (33 - 44 - (-8 + 0) - -2) + -41 -42 Evaluate -1 - 3 - 3 - 34 - (1 + -9 + 13). -46 Calculate ((148 - 140) + (1 - -2) - 15) + (-2 - -91). 85 (56 + -4 + -2 - (-45 + 43)) + -10 42 What is 53 - (203 - 210 - (0 - -8))? 68 28 + -2 + (-57 - (60 - 137)) + -11 35 Calculate 23 + (-12 - (-10 + (14 - 10 - 3))). 20 (-287 - -236) + (3 - -5 - -8) -35 -7 + -84 + (18 - (-69 - -57)) -61 Calculate 48 + (1 - 7) + 0 + 6 + -2. 46 What is 37 - -34 - 47 - 8? 16 What is -86 + (22 - (27 + -68))? -23 Evaluate -2 - (2 - -47) - (-3336 - -3352). -67 What is -5 + 13 + -58 + (53 - 20) + -34? -51 Evaluate -36 - (82 - (-24 + 97)). -45 What is the value of 19 + -7 + -76 + 1 + 5? -58 Evaluate 15 - 162 - -107 - (14 + -1). -53 What is the value of 90 + -84 + (-4 + -2 - ((8 - -62) + -13))? -57 Calculate -2 + (1 + -2 - (-445 - -432)). 10 Evaluate -4522 - -4498 - (49 + 3). -76 Calculate (-27 - -47) + 22 + -39. 3 Calculate (1 - 18 - 1) + (-2225 - -2232) + -6. -17 Evaluate (-11 - -7) + 2 - ((-1 - 3) + (3 - -3)). -4 (17 - (32 - -23)) + 6 + (3 - 14) -43 What is the value of (45 - (27 + 6)) + -31 - 1? -20 What is 13 + -25 + (29 - 25) + (-1 - 48)? -57 Calculate 85 + -119 + 17 + 2 + -5 + 127. 107 What is the value of -21 - (-26 - (-26 + 2)) - -13? -6 What is the value of 3 - (21 - 24 - 2)? 8 -53 + (-4 - (-10 + (7 - -3) + -11)) + -3 -49 Calculate (-4 - 4) + (0 - (-4 + -9)) - 30. -25 What is (7 + -18 - 4) + 10 - (6 + 1 + -63)? 51 77 + (782 + -795 - (2 - -31)) 31 (5 + -9 + 25 - 33) + (-1 - -82) 69 What is (739 - 690) + (-6 - 0)? 43 What is 10 - 2 - (0 + 2) - ((-246 - -194) + 90)? -32 Evaluate (8 - 24) + -2 + (80 - -2) - -1. 65 (891 - 872) + -69 + 1 -49 What is -32 + -52 + -22 - -59? -47 6 + 15 + -16 + 23 + -29 - -25 24 What is 20 + 32 + -75 - -27? 4 Calculate 42 + (-43 - -21) + -24. -4 Evaluate (26 - (-9 + -19 + 43)) + 14. 25 What is 57 - 4 - 1 - 85? -33 Calculate 8804 + -8791 + (-9 - (2 - 1 - 2)). 5 -135 + 25 - (-240 + 159) -29 What is (11 - -2) + -30 + 17 + -10 + 2? -8 Calculate 513 + -596 + 23 + -2. -62 What is -6 + (89 - 15) - (1 - -17)? 50 -118 - (-203 + 225 + (-7 - (7 + -1))) -127 Evaluate -12 + (1 - (-1 + -3)) + (-23	{ "pile_set_name": "DM Mathematics" }
179 What is the next term in -371178, -371176, -371174, -371172, -371170? -371168 What comes next: 20432632, 40865269, 61297906? 81730543 What is next in -413703, -827811, -1241907, -1655985, -2070039? -2484063 What is the next term in 442840, 885685, 1328530, 1771375, 2214220? 2657065 What comes next: -42972, -172346, -388122, -690300, -1078880, -1553862, -2115246? -2763032 What comes next: 41505585, 41505584, 41505583, 41505582, 41505581? 41505580 What is the next term in -384011, -384002, -383993, -383984? -383975 What is next in -159351, -159389, -159437, -159495, -159563, -159641, -159729? -159827 What comes next: 5804, 23024, 51664, 91724, 143204, 206104, 280424? 366164 What comes next: 28899, 28877, 28861, 28851? 28847 What comes next: -8646675, -8646638, -8646539, -8646348, -8646035, -8645570, -8644923? -8644064 What is next in -4407811, -4407810, -4407809, -4407808, -4407807, -4407806? -4407805 What comes next: -20309, -20146, -19873, -19490, -18997? -18394 What is the next term in 1857502, 1857499, 1857492, 1857481, 1857466? 1857447 What is the next term in 171152, 171242, 171392, 171602, 171872? 172202 What is the next term in 444186330, 444186329, 444186328, 444186327? 444186326 What is the next term in -15564, -14159, -12754, -11349, -9944? -8539 What is next in -4193, -4137, -4029, -3863, -3633, -3333, -2957, -2499? -1953 What comes next: 407, 2244, 7015, 16220, 31359, 53932, 85439? 127380 What is next in 5957806, 11915620, 17873434, 23831248, 29789062? 35746876 What is the next term in 13127, 27670, 42213, 56756, 71299, 85842? 100385 What is the next term in 3251310, 13005218, 29261726, 52020834, 81282542, 117046850? 159313758 What is next in -172891, -345279, -517667? -690055 What is the next term in 13752, 55285, 124506, 221415? 346012 What comes next: -220, -548, -992, -1558, -2252, -3080, -4048, -5162? -6428 What is next in -356677, -356609, -356495, -356335, -356129, -355877? -355579 What comes next: -3280820, -3280815, -3280810? -3280805 What is next in -5879165, -11758349, -17637529, -23516705? -29395877 What is the next term in -3124374, -6248769, -9373178, -12497607, -15622062? -18746549 What is the next term in -27543, -27421, -27213, -26919? -26539 What is the next term in -48335, -96600, -144735, -192674, -240351? -287700 What is the next term in 389, 1442, 2933, 4844, 7157, 9854? 12917 What comes next: -258729, -517478, -776227, -1034976? -1293725 What is the next term in -360, -473, -808, -1473, -2576, -4225? -6528 What is next in -764183, -6113866, -20634545, -48911720, -95530891, -165077558, -262137221? -391295380 What is the next term in -1674878, -1674734, -1674494, -1674158, -1673726? -1673198 What is next in 69522, 139428, 209336, 279246, 349158, 419072, 488988? 558906 What comes next: 4864459479, 4864459480, 4864459481, 4864459482? 4864459483 What is next in -33597, -67162, -100725, -134286? -167845 What comes next: 45440, 181821, 409158, 727463, 1136748, 1637025, 2228306? 2910603 What comes next: -80605, -162869, -245131, -327391, -409649, -491905, -574159? -656411 What comes next: -11368, -11361, -11374, -11401, -11436? -11473 What is next in -1843, 11110, 32699, 62924, 101785, 149282, 205415? 270184 What is next in -3330, -1899, 2004, 9615, 22170? 40905 What is the next term in -2630243, -10520989, -23672231, -42083969, -65756203, -94688933? -128882159 What comes next: -6158872, -6158871, -6158870, -6158869, -6158868, -6158867? -6158866 What is the next term in -261298, -261281, -261260, -261235, -261206, -261173? -261136 What comes next: 7021, 56067, 189081, 448045, 874941, 1511751, 2400457? 3583041 What is the next term in -3990741, -3990759, -3990777, -3990795, -3990813, -3990831? -3990849 What is next in 103063417, 103063419, 103063421? 103063423 What comes next: 82870, 166548, 250226, 333904, 417582, 501260? 584938 What is next in -16094, -32067, -48040, -64013, -79986? -95959 What is next in 100330, 401479, 903402, 1606099, 2509570? 3613815 What comes next: -4963, -20471, -46523, -83119, -130259, -187943, -256171? -334943 What is the next term in -21348, -42729, -63988, -85065, -105900, -126433, -146604, -166353? -185620 What comes next: 22, 742, 1480, 2236, 3010, 3802? 4612 What is the next term in 37850, 37889, 37944, 38021, 38126, 38265, 38444, 38669? 38946 What is the next term in 60877, 121003, 181133, 241267, 301405? 361547 What comes next: 10075, 10000, 9893, 9748, 9559, 9320? 9025 What comes next: 6707, 7172, 7949, 9038, 10439, 12152? 14177 What comes next: -2736811, -2736826, -2736841? -2736856 What comes next: 12099096, 12099092, 12099086, 12099078, 12099068, 12099056? 12099042 What is the next term in -2329, -9647, -21943, -39205, -61421, -88579? -120667 What is the next term in -315, -357, -401, -447, -495? -545 What is the next term in -4910, -4381, -3852, -3323, -2794? -2265 What is the next term in 3392, 8205, 13014, 17819, 22620, 27417, 32210? 36999 What is next in 917, 1884, 2855, 3830, 4809, 5792, 6779? 7770 What comes next: -20269369, -40538740, -60808111? -81077482 What comes next: -13314, -26555, -39640, -52491, -65030, -77179? -88860 What is the next term in -329, -989, -2021, -3611, -5945? -9209 What is next in 382191, 1532193, 3448873, 6132237, 9582291, 13799041, 18782493, 24532653? 31049527 What is next in 2286, 4480, 6484, 8202, 9538, 10396? 10680 What is the next term in -21537, -43630, -66331, -89640, -113557? -138082 What comes next: -246034, -492058, -738078, -984094, -1230106? -1476114 What is the next term in 86359779, 86359782, 86359785, 86359788? 86359791 What is next in 9283180, 9283184, 9283190, 9283198, 9283208? 9283220 What is the next term in -63493, -63451, -63409, -63367, -63325, -63283? -63241 What comes next: -991, -1855, -2731, -3625, -4543, -5491? -6475 What is next in -15635, -32368, -49109, -65864, -82639, -99440, -116273, -133144? -150059 What is the next term in -5388, -5540, -5802, -6174? -6656 What is next in 132930, 266583, 400236? 533889 What comes next: 9970466, 9970479, 9970492, 9970505, 9970518? 9970531 What is next in 520, 2548, 5988, 10816, 17008, 24540? 33388 What is next in -757, 107, 2445, 6995, 14495, 25683, 41297? 62075 What comes next: -72109, -140756, -209401, -278044, -346685, -415324? -483961 What is the next term in -3407, -3559, -3671, -3743? -3775 What comes next: 1343, 1328, 1287, 1220, 1127, 1008, 863? 692 What is the next term in 385859915, 771719834, 1157579753, 1543439672, 1929299591, 2315159510? 2701019429 What is the next term in -21479, -21458, -21405, -21320, -21203? -21054 What is the next term in 47682, 95474, 143468, 191766, 240470, 289682, 339504, 390038? 441386 What is the next term in -201953, -404020, -606077, -808118, -1010137, -1212128, -1414085? -1616002 What is next in -566, -1679, -3504, -6041, -9290, -13251, -17924? -23309 What is the next term in -144589177, -144589173, -144589169, -144589165, -144589161, -144589157? -144589153 What is next in 6094, 24354, 54780, 97372? 152130 What is the next term in -748877, -1497999, -2247121, -2996243, -3745365? -4494487 What is the next term in -96544, -109236, -121928, -134620? -147312 What is the next term in 1762987, 3526002, 5289017, 7052032, 8815047? 10578062 What is the next term in 78430, 156942, 235454? 313966 What is the next term in 19715, 19726, 19737, 19724, 19663, 19530? 19301 What comes next: -122, -995, -2396, -4601, -7886, -12527, -18800, -26981? -37346 What is the next term in -585801, -1171590, -1757359, -2343108? -2928837 What is the next term in 1428, 1474, 1548, 1656, 1804, 1998, 2244, 2548? 2916 What comes next: 1487, 5028, 10709, 18614, 28827, 41432? 56513 What is the next term in -140815220, -140815221, -140815222? -140815223 What is next in 165, 1020, 3323, 7788, 15129? 26060 What is the next term in -2790181, -2790179, -2790177, -2790175, -2790173? -2790171 What comes next: 5115, 10113, 14837, 19149, 22911, 25985, 28233? 29517 What comes next: -104408, -103306, -102204, -101102? -100000 What is the next term in -7079, -7293, -7507? -7721 What is next in -2149, -15946, -53455, -126532, -247033, -426814? -677731 What comes next: 891299, 1782507, 2673625, 3564653, 4455591, 5346439, 6237197? 7127865 What is next in 24305, 97679, 219985, 391223	{ "pile_set_name": "DM Mathematics" }
In base 8, what is -1 + 20400732? 20400731 In base 5, what is 2 - 3123340104? -3123340102 In base 15, what is 2b7b9 + 63? 2b82c In base 7, what is -42511 + -3656? -46500 In base 10, what is -33 + 1149713? 1149680 In base 10, what is 26735551 + -11? 26735540 In base 14, what is 1b8390 + 4b? 1b83db In base 15, what is 1e77beb2 - -1? 1e77beb3 In base 13, what is -19 - -366422? 366406 In base 4, what is -311013000131133 - -1? -311013000131132 In base 8, what is -2151623351 - -3? -2151623346 In base 10, what is 8424 + 121640? 130064 In base 14, what is 380a1 + -bd? 37dc2 In base 15, what is 9 + -e4ad589? -e4ad580 In base 9, what is 457 + 641076? 641544 In base 10, what is -11 - 1865024? -1865035 In base 16, what is 10d804 + 6? 10d80a In base 15, what is -1153 + -130? -1283 In base 8, what is -5 - 43640005? -43640012 In base 7, what is -220514 - -41213? -146301 In base 12, what is -10322 + -15a? -10480 In base 6, what is -25204244 + 321? -25203523 In base 5, what is 24210 - 20324022? -20244312 In base 11, what is 16749264 + 6? 1674926a In base 12, what is -6 - 1463b73? -1463b79 In base 8, what is 5310 - 54252? -46742 In base 6, what is 1044 + -3430453? -3425405 In base 13, what is -15 - 817ca5? -817cba In base 16, what is -103bd + -1707? -11ac4 In base 3, what is 12 - -12022200122101220? 12022200122102002 In base 7, what is -3 + -36421424? -36421430 In base 15, what is 7db7325 - -4? 7db7329 In base 9, what is 5 - 1584170? -1584164 In base 6, what is -1445141 - -1225? -1443512 In base 3, what is -1001 - -11001022100010? 11001022022002 In base 14, what is 1 - -1ad03702? 1ad03703 In base 15, what is -62 - 409? -46b In base 15, what is -e2 + c34e? c25c In base 2, what is -10110111011110010001101100010 + 100? -10110111011110010001101011110 In base 10, what is -788054 - -2? -788052 In base 12, what is -531b98 + 1? -531b97 In base 8, what is 1035734327 + -4? 1035734323 In base 11, what is 304586a1 + -8? 30458694 In base 5, what is -3 - 4103312400? -4103312403 In base 13, what is 9 + -30756a? -307561 In base 11, what is -10874 - -727? -10148 In base 3, what is -12100011011 - -2112? -12100001122 In base 13, what is -113572a + -3? -1135730 In base 4, what is -1100122302 - -1001? -1100121301 In base 2, what is -10 + 1000110001010100100011? 1000110001010100100001 In base 13, what is 7ac3 + -68? 7a58 In base 6, what is 2 - -20133445455? 20133445501 In base 13, what is 1597507 + -13? 15974c4 In base 9, what is -4 - 13150366? -13150371 In base 7, what is -1 + -23243343? -23243344 In base 2, what is -1110 - 111101010110101110111011? -111101010110101111001001 In base 4, what is -12000213 + 22211301? 10211022 In base 2, what is 1100111001010 - -10101011000? 1111100100010 In base 8, what is -12463 - -37544? 25061 In base 12, what is a84693 - -3? a84696 In base 12, what is -7340 - 5a4? -7924 In base 7, what is 1 - -3511020? 3511021 In base 3, what is -22111 + 12221020202? 12220221021 In base 16, what is -268bb72 - 2? -268bb74 In base 4, what is 11 - -211300330223? 211300330300 In base 9, what is -187 + -246544? -246742 In base 11, what is 117160a + -48? 1171572 In base 15, what is 17 - -1eb9d? 1ebb5 In base 2, what is 1 - -10001010111111110111110110010? 10001010111111110111110110011 In base 2, what is -1000000001111110100010 - -111010011? -1000000001110111001111 In base 14, what is -1097c + -47a? -11018 In base 15, what is -569 - -4644? 40ca In base 12, what is -5 + 19b19a0b? 19b19a06 In base 12, what is 218ba0 + -2? 218b9a In base 6, what is 3 - 3333054415? -3333054412 In base 13, what is b4 - -181b4c? 181c33 In base 13, what is -4 - -98c6c6a? 98c6c66 In base 13, what is 1 + 82b2543? 82b2544 In base 4, what is 1123130200 + 221213? 1130012013 In base 6, what is 2 - -10140422? 10140424 In base 3, what is -12212 - 122120220? -122210202 In base 2, what is 101001000001110001101 - 1001111? 101001000001100111110 In base 10, what is 19 - 1624781? -1624762 In base 3, what is -100211002110 - -122? -100211001211 In base 15, what is 485e1 - 19? 485c7 In base 14, what is -24bc + -26c? -274a In base 4, what is -202 + -1322221210? -1322222012 In base 13, what is -2 - -8530878? 8530876 In base 13, what is -1573926 - 3? -1573929 In base 7, what is 4 + -146261354? -146261350 In base 3, what is -220002 - -10011200002? 10010210000 In base 14, what is -4 - -97ac2a? 97ac26 In base 14, what is -4 + 33c303? 33c2dd In base 7, what is 0 - -1146123? 1146123 In base 9, what is -46533375 + -8? -46533384 In base 5, what is -10430 - 241403? -302333 In base 12, what is 1 - -b05212? b05213 In base 11, what is -10 + 4469019a? 4469018a In base 15, what is -938 - -3235? 27ec In base 3, what is -1002201222 + 200000? -1002001222 In base 7, what is 1461313132 + 1? 1461313133 In base 14, what is 69d419 + -1? 69d418 In base 9, what is -3420826 + 2? -3420824 In base 15, what is -44 + -a2ae? -a303 In base 2, what is -100 - -100100010111101000000? 100100010111100111100 In base 12, what is 119634 - -19b7? 11b42b In base 4, what is 23100202 + -300102? 22200100 In base 8, what is -4 - -31366360? 31366354 In base 10, what is 103 - -1154862? 1154965 In base 11, what is -4 + 156790? 156787 In base 2, what is 101101010000111001111 + 11? 101101010000111010010 In base 14, what is -91d8 + 18b9? -771d In base 7, what is -21 - -5001403? 5001352 In base 13, what is -3 + -631594? -631597 In base 14, what is 1885d - -8d? 1890c In base 8, what is 12 - 473345102? -473345070 In base 12, what is 917a - -6227? 133a5 In base 15, what is 3c + 20b6? 2103 In base 2, what is -1101111 + -11111011110000000? -11111011111101111 In base 2, what is -100010001111010110 + -1011100100? -100010011010111010 In base 10, what is -49427 - -38? -49389 In base 8, what is 31050 + 2552? 33622 In base 6, what is -25554 - 1435? -31433 In base 9, what is -24 - 4210365? -4210400 In base 7, what is 2144060 - -124? 2144214 In base 6, what is -43341105242 - 5? -43341105251 In base 11, what is 10 + a4a871? a4a881 In base 6, what is 211221310 + -125? 211221141 In base 16, what is -66e9 + -6ab? -6d94 In base 16, what is 201 - 24a74? -24873 In base 7, what is -3645013 + -1? -3645014 In base 6, what is -1 + 1234122? 1234121 In base 12, what is 3 + 218baa2? 218baa5 In base 11, what is -2 - -115587? 115585 In base 10, what is 104014510 - 1? 104014509 In base 12, what is -3 - -a22849b? a228498 In base 9, what is 1320770 + 4? 1320774 In base 12, what is -a0 + 7714? 7634 In base 4, what is 2 + 3110202223? 3110202231 In base 10, what is -3030 + -3713? -6743 In base 4, what is -13222221000 + -111? -13222221111 In base 4, what is -11112322121 + 1321? -11112320200 In base 13, what is -b + -6cc6a14? -6cc6a22 In base 11, what is -5 - -14498192? 14498188 In base 10, what is 16727067 + 0? 16727067 In base 4, what is 1 - 1232010113? -1232010112 In base 11, what is -3 - 1351613a? -13516142 In base 15, what is -5 - 863d02? -863d07 In base 4, what is 112231202220 - 10? 112231202210 In base 2, what is -10011111100111010001111100001 + 1? -10011111100111010001111100000 In base 13, what is -a7273 - -c? -a7264 In base 14, what is cb329cb + 0? cb329cb In base 13, what is 4c5 + -68a? -195 In base 4, what is 12 + -103123233233? -103123233221 In base 2, what is -110010101001111001010010010 - -10? -110010101001111001010010000 In base 13, what is -10 + 62c4989? 62c4979 In base 13, what is 9c62c + a8? 9c707 In base 13, what is 3 - -44b960? 44b963 In base 15, what is -12 + -66d6b7? -66d6c9 In base 13, what is -109 + -462cb6? -4630c2 In base 13, what is -46 + -3a2169? -3a21b2 In base 6, what is -1000 - 13032205? -13033205 In base 13, what is -82538c2 + 3? -82538bc In base 2, what is -100111010010 + 10010? -100111000000 In base 11, what is 3 - -2a3282? 2a3285 In base 14, what is -48a7c8 - -4? -48a7c4 In base 9, what is -1143 + -143648? -144802 In base 6, what is 105342425 - -25? 105342454 In base 11, what is 1694a615 - 1? 1694a614 In base 10, what is 15 + 66061? 66076 In base 13, what is 42157a0b - -2? 42157a10 In base 11, what is 13 - -2496a00? 2496a13 In base 11, what is 4 + -872305? -872301 In base 6, what is 134250051 - 3? 134250044 In base 12, what is -105b - -11894? 10835 In base 2, what is 11101011000000111001 + 1011? 11101011000001000100 In base 11, what is 519a93 - 5? 519a89 In bas	{ "pile_set_name": "DM Mathematics" }
*2 + sqrt(8)/(-2sqrt(16)). -433sqrt(2)/4 + 1462 Simplify -1 + (sqrt(6)3 + sqrt(6))/sqrt(2). -1 + 4sqrt(3) Simplify 2 + 1sqrt(500). 2 + 10sqrt(5) Simplify (sqrt(18) - sqrt(2))45 + sqrt(20)/(sqrt(60)/(sqrt(24)/sqrt(4))). 41sqrt(2) Simplify sqrt(5) + (sqrt(5) - (sqrt(5) - (1 + sqrt(45))*2)) + sqrt(720) + sqrt(720) + 1. 47 + 31sqrt(5) Simplify sqrt(152)/(-1sqrt(8)-5). sqrt(19)/5 Simplify (-1 + sqrt(252) + 5)*2. 48sqrt(7) + 268 Simplify sqrt(3) + 0 + sqrt(12) + sqrt(3) + sqrt(33)/(-2sqrt(11)). 7sqrt(3)/2 Simplify -3((sqrt(450))2 - (sqrt(2) + (1 + sqrt(2))4))-4. -60sqrt(2) + 5352 Simplify sqrt(17) + 0 + -2 + 5. 3 + sqrt(17) Simplify (sqrt(52)-5 + 0)2 - (-3 + -4(sqrt(52)/sqrt(4))*2). 1355 Simplify (42sqrt(68))/(sqrt(36) + sqrt(144)/sqrt(4) + sqrt(4)). 8sqrt(17)/7 Simplify 2sqrt(270)/(sqrt(6)1). 6sqrt(5) Simplify (sqrt(48) - sqrt(3)) + 5 - ((sqrt(3) + -2 + sqrt(3))-5 + sqrt(3)). -5 + 12sqrt(3) Simplify sqrt(104)/(4sqrt(800) - sqrt(8)). sqrt(13)/39 Simplify ((sqrt(300)2 + sqrt(300))2 - (sqrt(192) + 2)2)-6. -15024 + 192sqrt(3) Simplify 2(-3 + sqrt(6)/sqrt(2) + (-3 + sqrt(15)/sqrt(5))*2). -10sqrt(3) + 18 Simplify sqrt(176) + 0 - (sqrt(55)/sqrt(5) + 1). -1 + 3sqrt(11) Simplify ((4sqrt(252))/sqrt(9))2. 448 Simplify sqrt(66)/sqrt(6) + 0 - (sqrt(33)/sqrt(27))2. -11/9 + sqrt(11) Simplify (sqrt(72)/(1sqrt(3) + sqrt(3)))/sqrt(8). sqrt(3)/2 Simplify (-5 + sqrt(432) + -1 + -5(sqrt(432) + -1 + sqrt(432)))*2. 216sqrt(3) + 34993 Simplify 5(-1(sqrt(17) + -5) + sqrt(17) - sqrt(17)). -5sqrt(17) + 25 Simplify sqrt(95)/(sqrt(15)/sqrt(3)) + (sqrt(1216) - (sqrt(1216) - 3sqrt(1216))). 25sqrt(19) Simplify ((sqrt(108)-3 + sqrt(108) + sqrt(12))/(sqrt(216)3))2. 25/162 Simplify (sqrt(72)2)*2 - (sqrt(2) + 0 + sqrt(6)/sqrt(3) + sqrt(2)). -3sqrt(2) + 288 Simplify (1sqrt(14)/sqrt(18) + -2)5. -10 + 5sqrt(7)/3 Simplify 5 + (sqrt(200) + -3 + -1)2. -80sqrt(2) + 221 Simplify sqrt(22)/(sqrt(4)/sqrt(2)4). sqrt(11)/4 Simplify 3(sqrt(121)3)/sqrt(11). 9sqrt(11) Simplify -4 + (6(5 + 0 + sqrt(363)))2. 3960sqrt(3) + 13964 Simplify 4 + 3(0 + sqrt(1300))-5. -150sqrt(13) + 4 Simplify 5 + (4sqrt(612)1 + sqrt(612) - sqrt(612)). 5 + 24sqrt(17) Simplify (((sqrt(252) - (sqrt(252) + 2)) + -1)2)2. 36 Simplify (-1 + sqrt(425))2-5 - sqrt(425). -2130 + 45sqrt(17) Simplify sqrt(208)-2 + -5. -8sqrt(13) - 5 Simplify (6(1 + sqrt(1900)) + -1 + (3sqrt(1900) - sqrt(1900)))2. 800sqrt(19) + 121625 Simplify 3(sqrt(80) - sqrt(5))144. 144sqrt(5) Simplify sqrt(325) + (sqrt(325) - (0 + sqrt(325) + 4)). -4 + 5sqrt(13) Simplify 3 + -4 + sqrt(77)/sqrt(7). -1 + sqrt(11) Simplify (sqrt(399)/(sqrt(7)2) + sqrt(57))/(1sqrt(300)). 3sqrt(19)/20 Simplify sqrt(125)-24. -40sqrt(5) Simplify -3 + -1 + 3 + sqrt(567) + 1 + sqrt(567). 18sqrt(7) Simplify 4 + (sqrt(3) - (sqrt(12) + (sqrt(432))2)) + -2. -430 - sqrt(3) Simplify 2 + sqrt(4)/sqrt(2) + 2. sqrt(2) + 4 Simplify (sqrt(1377) + -6sqrt(1377)-5)-1. -279sqrt(17) Simplify sqrt(75)-2 - (sqrt(9) - sqrt(81)/sqrt(9))/sqrt(3). -10sqrt(3) Simplify sqrt(99)/sqrt(9)1 + 2. 2 + sqrt(11) Simplify 3 + (-2(sqrt(15) + sqrt(60) - sqrt(15)))/sqrt(3). -4sqrt(5) + 3 Simplify (-3sqrt(320) + sqrt(20))/(sqrt(1764)/sqrt(9) + sqrt(4) - sqrt(4)). -11sqrt(5)/7 Simplify (-6(sqrt(637) - -2sqrt(637)) + 5)*2. -1260sqrt(13) + 206413 Simplify 2((sqrt(35)/sqrt(5))22 - sqrt(7) - (1 + sqrt(28))*2). -30 - 10sqrt(7) Simplify (sqrt(76) - -6(sqrt(76) - (-1 + sqrt(76))))-3. -6sqrt(19) - 18 Simplify sqrt(55)/sqrt(5)-5 + sqrt(396) + (sqrt(396) + -2)*2. -23sqrt(11) + 400 Simplify -2 + ((1 + sqrt(720))*2 - sqrt(720)) - (sqrt(720) + (sqrt(720)-2)*2)-4. 60sqrt(5) + 12239 Simplify (sqrt(272)-1 - sqrt(272))*2 + 4. 1092 Simplify 4(sqrt(27)/(-1sqrt(9)) - ((sqrt(18)/(1sqrt(6)))*2 + sqrt(3) - sqrt(3))). -12 - 4sqrt(3) Simplify (sqrt(2200) - sqrt(2200)-3 - sqrt(2200))/(sqrt(4)/sqrt(2)4 - sqrt(2)). 10sqrt(11) Simplify 2(sqrt(75) - (sqrt(75) + (1 + sqrt(75))*2)). -152 - 20sqrt(3) Simplify ((6(sqrt(99) + -2sqrt(99) - sqrt(99)))/sqrt(9))*2. 1584 Simplify (sqrt(2673) + sqrt(2673) + (sqrt(2673) - (sqrt(2673)1 - sqrt(2673))))/(sqrt(192)-2). -27sqrt(11)/16 Simplify -2 + sqrt(33)/sqrt(3) + sqrt(88)/sqrt(2) + 0 + -2. -4 + 3sqrt(11) Simplify (-6sqrt(324) + sqrt(36))/(sqrt(12) + sqrt(192)-1 + sqrt(12)). 17sqrt(3)/2 Simplify (4(sqrt(5) - ((sqrt(15)/sqrt(3) - sqrt(5)) + -4)))2. 128sqrt(5) + 336 Simplify (sqrt(22)/(sqrt(704) + sqrt(704) + sqrt(704)-1))2. 1/32 Simplify (sqrt(56) + (sqrt(672)/(sqrt(96)/sqrt(8)) - sqrt(56)))/sqrt(8). sqrt(7) Simplify (sqrt(2268)-1)2. 2268 Simplify (0 + sqrt(2448))24 - (sqrt(2448) - (sqrt(2448) - (2 + (1sqrt(2448) - sqrt(2448))) - sqrt(2448))). -12sqrt(17) + 9790 Simplify sqrt(14)/sqrt(2)-1 - (sqrt(567)1)2. -567 - sqrt(7) Simplify (sqrt(13)-11 + -3)2 + 4. 6sqrt(13) + 26 Simplify (4 + (sqrt(2) + -1)2)2. 8sqrt(2) + 12 Simplify ((2sqrt(156) + sqrt(156))-3)/(4sqrt(12)1). -9sqrt(13)/4 Simplify (sqrt(114)/sqrt(50))/sqrt(3) + 4. sqrt(19)/5 + 4 Simplify 5sqrt(228)/sqrt(108). 5sqrt(19)/3 Simplify (4 + (4sqrt(84))/sqrt(12) + sqrt(7))*2. 40sqrt(7) + 191 Simplify (sqrt(396) + -2)*2 + -2. -24sqrt(11) + 398 Simplify 3 + -5 + (sqrt(10)/sqrt(5) + 2)*2. 4 + 4sqrt(2) Simplify (sqrt(77)/(sqrt(44)/sqrt(4)) - (sqrt(7) + -2 + -1))*21. 9 Simplify (sqrt(7)-2-31)2 + -5 + 0. 247 Simplify 15sqrt(80). 20sqrt(5) Simplify (sqrt(13) + 2sqrt(39)/sqrt(3) + sqrt(13) + -5)2. -40sqrt(13) + 233 Simplify 6(sqrt(70)/sqrt(2))/sqrt(7). 6sqrt(5) Simplify sqrt(26)/(sqrt(2) - (sqrt(6)/sqrt(3) - sqrt(2)))1-4. -4sqrt(13) Simplify ((-3sqrt(968))/(sqrt(176)/sqrt(11) - sqrt(4)))2. 2178 Simplify (sqrt(48))2-5 + 2. -238 Simplify (sqrt(77)/(sqrt(11)1))*2 + -2. 5 Simplify (sqrt(847)-2-1 + sqrt(847))2 - ((sqrt(847) + -2sqrt(847) - sqrt(847)) + 3). 22sqrt(7) + 7620 Simplify sqrt(108)5 - ((sqrt(6)/sqrt(2))*26 + (sqrt(192))*2). -210 + 30sqrt(3) Simplify -2(sqrt(1900)2 + -1)*2. -15202 + 80sqrt(19) Simplify 4 + -6sqrt(19) + 0. -6sqrt(19) + 4 Simplify (-4 + (sqrt(3) - sqrt(75)1) + (sqrt(288)/sqrt(6) - 2sqrt(108)))*2. 96sqrt(3) + 448 Simplify 2sqrt(65)/(sqrt(245)1) + 0. 2sqrt(13)/7 Simplify 1sqrt(1100)-3-3. 90sqrt(11) Simplify (sqrt(117) + 0 + (sqrt(117)-2 - sqrt(117)))*2. 468 Simplify -4 + (sqrt(2736) - -2sqrt(2736)) + sqrt(684) + 1. -3 + 42sqrt(19) Simplify ((sqrt(468) + -1 + (sqrt(468) - (sqrt(468) + 1)))-3)*26. -1296sqrt(13) + 25488 Simplify ((0 + -1 + sqrt(192) - 6(0 + sqrt(192)))-1)2. 80sqrt(3) + 4801 Simplify -3(sqrt(209)/sqrt(99))2 - (sqrt(209) - (sqrt(209) - 6sqrt(209)-2))/sqrt(11). -19/3 + 12sqrt(19) Simplify -2 + sqrt(76)/sqrt(4)-3. -3sqrt(19) - 2 Simplify ((sqrt(117) + sqrt(117) + 1 + sqrt(117) + 5)2)2. 432sqrt(13) + 4356 Simplify (sqrt(96)/(sqrt(20)/sqrt(5)) + sqrt(24))/(sqrt(12) + -5(sqrt(12) + sqrt(108))). -2sqrt(2)/19 Simplify ((2sqrt(396) - sqrt(396))2 - sqrt(396)) + (sqrt(176) + -1 - sqrt(176) - sqrt(176))2. 2sqrt(11) + 573 Simplify sqrt(192) + (4 + (sqrt(192) + sqrt(192)-3 - sqrt(192)))2. -184sqrt(3) + 1744 Simplify 5 + sqrt(204)/sqrt(432). sqrt(17)/6 + 5 Simplify -14(sqrt(38)/((sqrt(2) - sqrt(8))-1))2. -76 Simplify sqrt(143)/((sqrt(11) - 1sqrt(11)) + sqrt(11)) + sqrt(1300) + 1 + sqrt(1300). 1 + 21sqrt(13) Simplify (4sqrt(132)/sqrt(4))/(sqrt(396) + (sqrt(396) - (sqrt(396)-2 - sqrt(396)))). 2sqrt(3)/15 Simplify (sqrt(128))*2 - sqrt(24)/sqrt(3). -2sqrt(2) + 128 Simplify (4 + sqrt(13) + -2 - (sqrt(13) - (-3sqrt(117) - sqrt(117))/sqrt(9) - sqrt(13)))2. -12sqrt(13) + 121 Simplify (-1(sqrt(88) - 2sqrt(88)))/((sqrt(288)/sqrt(6))/sqrt(6)). sqrt(11) Simplify 4(sqrt(187)/(1sqrt(11)) + sqrt(17))*2. 272 Simplify (sqrt(9) + sqrt(54)/(-1sqrt(6)))/(sqrt(243) + sqrt(243)-2 - sqrt(243) - sqrt(3)). 0 Simplify (2 + sqrt(1900))2. 4 + 20sqrt(19) Simplify (sqrt(78) + -3-3sqrt(78))/(-1sqrt(150)). -2sqrt(13) Simplify (-2 + sqrt(1728))26. -576sqrt(3) + 10392 Simplify (1 + sqrt(1700))24 + sqrt(2448) + 1 + sqrt(2448) + 5. 104sqrt(17) + 6810 Simplify -1(sqrt(1573) + sqrt(1573)-2 - sqrt(1573)) - (sqrt(1573) + (sqrt(1573) + (-5(sqrt(1573)*-2 - sqrt(	{ "pile_set_name": "DM Mathematics" }
- 1) - 4n3 + 5n*3 - 3n*3 + 97 - 5n*3 - 97)(0 - 1 + 2). 2n3 - 1 Expand (-11a - 38a + 3a)(-4a + 0a + 0a). 184a2 Expand (5l - 3l - 3l)(4l2 + l2 - l*2 + 130l - 130l - 21l2 + l2 + l - l + (0l - l + 3l)(-3l + l + 3l)). 14l*3 Expand (0 + 0 + 2)(1 + 0 + 0)(-109d*5 - 12251d*4 + 12251d*4). -218d*5 Expand (-4 + 0 - 2)(0j3 - 4j*3 + 3j3) + (-j2 - 2j2 + 2j*2)(0 + 0 - 2j) + 9j*3 + 6 - 6 + 0j3 - j3 + 3j3. 19j*3 Expand (84a - 10a + 75a)(2 + a + 4a*4 - 3a*4 - 2a). 149a5 - 149a*2 + 298a Expand -153j - 32j - 197j - 366j + (4j + 4j - 6j)(-5 + 1 + 5). -746j Expand (-6 + 6 - 25u*2)(-2u - 5 + u + 3u). -50u3 + 125u*2 Expand (43 + 34 + 55 + 5 + 0 - 3 + (-3 + 0 + 4)(0 + 0 + 2) - 2 + 3 + 1 - 1 + 1 - 1)(-7 + 3 + 2)(-1 + x + 1). -274x Expand 6r*2 + 3r*2 + 52r*2 + (2r*2 + 3r*2 - 7r*2)(-2 - 1 + 1) - 2r2 + r2 + 0r*2. 64r*2 Expand 2l - 2l - l2 + (6l - 2l - 2l)(l - l - l) - 9283l*2 + 7l - 4l - 3l + 4968l2. -4318l*2 Expand (17 - 51 - 8)(3 - 2w + 0 - 2) - 3w + 4w - 2w. 83w - 42 Expand (-1 + 1 + 2y)(-211 - 105 - 76)(-2y2 + y2 + 0y*2). 784y*3 Expand (-4y*2 + 15y*2 + 2y*2)(1 + 2 - 5)(-y + 7y - 3y). -78y*3 Expand (198 - 419g - 199 - 24g - 285g)(-g2 + 0 + 0). 728g3 + g2 Expand (0 - 1 + 2)(-17v*2 - 433v + 433v - 20v*2). -37v*2 Expand (-1 - 2 + 2)(3 + 1 - 2)(-15 - 5d*4 - 10 - 19). 10d*4 + 88 Expand 2m*5 - 2m*5 + 5m5 + (m2 + 3m - 3m)(0m*3 + 4m3 - m3) + 2m5 + 2m*5 - 3m*5. 9m*5 Expand 6c*2 - 6c*2 - 7c4 + (c3 + 0c3 - 2c*3)(-9c + 3c - 3c). 2c*4 Expand (23q - 23q - 6q*3)(12q2 + 0q*2 - 4q*2). -48q*5 Expand (1 - 1 - u - 4u - 2u + 4u + 4u + u - 4u + (-2 + 0 + 4)(-2u - u + 2u) + 5 + u - 5)(-4 + 2 + 0)(-4 + 26u + 4). 156u2 Expand (517 - 3 + 221 - 101 + 299)(3d + 6d - 4d). 4665d Expand (3c + 0c - 5c)(-2 + 4 - 1)(104c*4 - 203c*4 - 7c*3 + 100c*4). -2c*5 + 14c*4 Expand (0v - 2v + v)(2v3 - 2v3 - v3) + (-4 - v*4 + 4)(-1 + 0 + 2 - 6 + 4 - 1 + 0 + 2 - 1 + (-1 + 1 + 1)(0 - 1 + 2) + 17 + 50 + 19). -85v4 Expand -2 + 2 - c3 + (c - 5c + 2c)(c2 - c2 + c2) + 5c*3 - 2c*3 - 4c*3 + (5c - c - 2c)(-11c2 - 29c + 29c). -26c*3 Expand 35w*5 - 102w + 52w5 - 114w - 86w5 + (-3 + 3 + 2)(0w5 - 3w5 + w5) - 3w3 + 3w3 - w5. -4w5 - 216w Expand (-52f + 700 + 80f - 30f)(-3 - 2 + 3). 4f - 1400 Expand (2s + s - s)(4s*3 - 3s*3 - 2s*3) + 7773s*4 + 0 - 15771s*4 + 2 - 2. -8000s*4 Expand (4o - 6o + o)(2o4 - 3o*4 + 3o*4) + (-24 + 10 + 2)(4o5 - 2o*5 + 0o*5) + 11o*2 + 2o*5 - 11o*2. -24o*5 Expand (-10 + 3 + 10)(3 + f - 3)(0f*3 + 3f3 - f3 - 4f2 + 4f*2 + 2f*3 + (-3f2 - f2 + 3f2)(2 + 2f - 2) + 5f - 5f + 3f*3). 15f*4 Expand (76 + 52 - 40 + 8)(z*3 + 3z*3 - 2z*3). 192z*3 Expand (0a + 0a - a3)(59 + 135 + 145)(1 + 2 - 5). 678a*3 Expand (0z + 2z - 5z)(24z + 3z - 16z + 2). -33z2 - 6z Expand (-16 - 12 - 10)(1 - 5 + 3)(-6f2 - 4f*4 + 5f*2 + 2f*4). -76f*4 - 38f*2 Expand (-2p + 1 - 1)(0p3 - p3 - p3) - p4 + 0p4 + 3p4 - p - p4 + p + 0p3 + 2p*4 + 0p*3 + 1344p + p*4 - 1344p + 47. 8p4 + 47 Expand (-2p*2 - 4p*2 + 4p*2 + 2p)(-2021p + 714p - 1022p - 774p). 6206p*3 - 6206p*2 Expand ((0 + 0 + f)(4f + 0f - f) - f*2 - 3f*2 + 2f*2)(0 - 4 + 6) + (-3 + 7 - 2)(3 - 1 - 3)(272f2 - 39f*2 + 57f*2). -578f*2 Expand (-6m + 12 - 6 - 4)((3 - m2 - 3)(-2m + 3m + 0m) + 3m - m*3 - 3m + 12 - 12 + 5m3). -18m*4 + 6m*3 Expand (-3u*2 - 1 + 1 + (0u + 0u - u)(-u + 2u - 2u) + (3 - 6 + 1)(5u*2 - 4u2 + u2) + 4 - 3u2 - 4)(5u + 5u - 2u). -72u*3 Expand 3v*5 + 6v5 - v5 + (4v2 - 4v2 - v3)(-v + 2v*2 + v) + (-3v*2 - 3v*2 + 15v*2)(-3v + v3 + 3v). 15v5 Expand (-f + 0f + 0f)(-2f4 - 185f - 730f3 + 730f*3). 2f*5 + 185f*2 Expand (4656 + 3364 + 843 + 1304 - 2299)(3z - 3z + 2z). 15736z Expand (1 - 6 + 3)(-20 + 41 + 50 + 2o). -4o - 142 Expand (-5a + 2a + a)(-26 + 26 + 85a) + (0a + 2a - a)(-5a + 3a + 3a) + 3a*2 - 2a*2 + 0a*2. -168a*2 Expand (264 - 181s*3 - 264)(-1 + 6s + 1). -1086s*4 Expand (-157v + 318v - 153v)(-8 + 9v + 13v - 25v). -24v2 - 64v Expand (-2k2 + 3k*2 - 3k*2)(-4k + 6k + k) + 0k3 + k3 - 3k*3 + (-4 + 2k*3 + 4)(3 + 1 + 0) + k*3 - 2k + 2k. k3 Expand ((-2 - 2 + 1)(-n + n - 5n) + n - 2n + 2n)(-n - 2 + 2). -16n2 Expand -5r*5 - 2r*5 + 0r*5 + (-1 + 4r - 1 - 2)((0r + r + r)(-r3 + 4r*3 - 2r*3) + 3r4 - r4 - r*4). 5r*5 - 12r*4 Expand 2y*3 - 3y*3 + 3y*3 + (2 - 2 + y)(-118y2 + 99y*2 - 149y*2). -166y*3 Expand (3 - 1 - 3)(22j - 12j - 3j + 120j). -127j Expand (-71y*3 - 279y*3 - 256y*3)(-2 - 2 + 3). 606y3 Expand (3 - 3 + 4r)(-4r + 2r + 7r) - 19r + 6r*2 + 19r. 26r2 Expand ((-2 - 2 + 6)(1 + 4 - 4) - 3 + 5 + 0)(2c + 28c + 40c). 280c Expand (r2 + 0r*2 - 2r*2)(-3 - 4 + 4 - 3 - 1 - 3 + (0 + 1 - 2)(2 - 3 - 1) + 2 + 1 - 6). 11r*2 Expand (-2 + k + 2)(33k2 + 32k*2 - 46k*2)(0k2 + 4k*2 - 3k*2) + 3k - 3k5 - 3k. 16k5 Expand (-7 + 7 - 17)(-1901 + 1901 + 109i). -1853i Expand 3w - 5w - w + (1 - 2 + 0)(-w + 0w - 3w)(-2 + 2 + 2). 5w Expand (1 + 2 + 0)(-87 + 28 + 39 + d). 3d - 60 Expand (-2 - 1 + 5)(0z + 0z - 2z) - 3z + z + z + (-3 + 16 - 2)(7z + 10z - 7z - 2z + 2z - 2z + (2z - 2z + z)(1 + 1 + 0) - 3 + 3 - z). 94z Expand (-13 - 17 + 8)(-3o - o2 + 4o + 1 + 4). 22o2 - 22o - 110 Expand -834w - 71w*2 + 834w + (-6w - 6w + 5w)(-w - 2w + 4w). -78w2 Expand (-240a*2 + 87a*2 + 96a*2)(3a + 0a + 3a). -342a*3 Expand (-54u + 54u + 21u*2)(5 - 5 - 5u). -105u*3 Expand (2 - 4z + 4z - 5z)(-1 - 20z + 3z - 37z). 270z2 - 103z - 2 Expand (-2 + 2 + w - 4w + 5w - 3w + 2w - w + w + (-w - 2w + 2w)(-1 - 4 + 2))(0 - 1 - 2). -12w Expand (4 - 4 + 2t)(2t + 0t + 0t)(2 + 0 + 0)(13 - 20 + 11). 32t2 Expand k - 6k + 2k + (-3 - 1 + 2)(-2k - k + k) + 3 - 3k - 3 + (-2 - 1 + 2)(-1 + 1 + 2k) + 196k + 4k + 94k. 290k Expand (-145w2 + 145w*2 + 44w*3)((-2w2 + 3w*2 + 0w*2)(4 + 0 - 3) + 0w + 0w + 6w2 + (-3w - 3w + 4w)(-2w + 0w + 3w)). 220w5 Expand (-2g - 2 + 2)(-3 - g + 3) - 2g2 + g2 + 0g2 + g2 - 7 + 7 + (6g + 3g2 - 2g - 3g)(-3 + 3 + 2 - 2 - 4 + 4 + (-1 + 0 + 2)(5 - 2 - 5)). -4g*2 - 2g Expand ((z + z + 0z)(2z2 - 3z + 3z) + 3z*3 - 5z*3 + 0z*3)(12 + 2 - 5). 18z3 Expand (-4 + 4 + o3 + (-o3 + 0o*3 + 0o*3)(3 - 3 - 2))(-54o - 7o + 3o). -174o4 Expand (4 - 4 - 1)(-2g + g - g)(24 + 30 - 39). 30g Expand (304 - 12t - 304)(-3t - 2t - t) + 3 - 3 + 2t*2 - 2t*2 - 3t*2 + 3t*2 + (4t - 2t - t)(2t + 3t - 4t). 73t*2 Expand -161 + 3m - 161 + 317 + (m - m + m)(0 - 5 + 3). m - 5 Expand (0a + 2a2 + 0a)(181 + 210 + 112). 1006a*2 Expand (-3 + 1 + 5)(-g*4 - 2 + 2) - 82 - 76 - 2g*4 + 173 + 3g. -5g4 + 3g + 15 Expand (-9 + 0 + 1)(2i + 0 + 0)(13i + 17i2 + 11i*2 - 27i*2). -16i*3 - 208i*2 Expand (3 + 1 - 6)(0m + 3m - m) - 2m + 2 - 2 + 410m + 101 - 840m + 431m. -5m + 101 Expand (3h*2 + 3h*4 - 3h*2)(4 - 3 - 2 + (-2 + 0 - 4)(2 + 0 + 0)). -39h*4 Expand (-h + 0h + 0h)(39h + 5h*3 - 3h*3 - 39h). -2h4 Expand (-4 + 0 + 1)(-6 - 7t + 6)(t*4 + 0t*2 + 0t*2). 21t*5 Expand (63z*5 + 87z*5 - 130z*5)(-3 - 1 + 3 - 2). -60z5 Expand (0 - 1 - 1)(4y + 5y - 2y)(-4y2 + y - y). 56y*3 Expand 2a*5 - 5a*5 + 2a*5 + (0a*2 + 0a*2 + 2a*3)(0a2 - a2 + 0a*2) + 0a*3 + 0a*3 - 2a*5 - 673a*5 + 915a*5 - 580a*5. -343a*5 Expand (f + 5f - f)(-62 + 16f*3 + 62) - 3f*2 + 3f2 + f4. 81f4 Expand (4 + 0 + 13)(-3 - 1 + 2)(7q + 6q + 2q). -510q Expand a4 + a4 - a4 + (4a - 2a + 0a)(-a3 + 2a3 + a3) - a4 + a4 + a*4 + (5a*3 - 3a*3 + 0a**	{ "pile_set_name": "DM Mathematics" }
3 (c) o c Let w(f) = 19f. Let v be w(6). Suppose t = -t - v. Let r = t + 175/3. Which is the smallest value? (a) -0.05 (b) 4 (c) r a Let b = -2672/11 + 243. What is the fourth biggest value in -25, 1/2, b, 2? -25 Let n = 507 + -507.4. What is the fourth biggest value in n, 1, -1/7, 5? n Let z be (0/(-7 - -3))/(-1). Suppose -3h + 3 + z = 0. Let f be h/(-3) + 35/60. Which is the third biggest value? (a) -2/5 (b) f (c) 1 a Let y = 313 + -316. Which is the third smallest value? (a) y (b) -0.1 (c) -62 b Let v = -143 + 154.7. Let f = -12 + v. Which is the third biggest value? (a) 2/9 (b) f (c) -1/3 (d) 2 b Suppose 5 = 3n - 7. Let m be n/5(8 + -13). Which is the biggest value? (a) m (b) -2 (c) -0.4 c Let r be 11/((-1045)/3240) - 2/(-4). Let m = r - -67/2. What is the third smallest value in m, 1, -2/5, 2? 1 Let s = 0.48 + -0.28. Let y be (-4)/39/6. What is the second biggest value in y, s, -4? y Let a = 0.5 + -1. Let t = 2.9497 - -0.0503. What is the third smallest value in a, -0.2, t? t Let z = 0.25 - -0.16. Let p = 0.69 - 0.8. Let o = z + p. Which is the second smallest value? (a) 3 (b) o (c) 1 c Let n = -2 - 6. Let o = -6 - n. Let v = -5 - -9. Which is the third smallest value? (a) v (b) 1/3 (c) o a Let b be -3 - -6 - (-15)/(-4). What is the fourth smallest value in -0.4, 5, 0, b? 5 Let w = 37/2 + -19. Let z = -47.12 - -47.32. Which is the fourth biggest value? (a) 5 (b) z (c) 2 (d) w d Let y(f) = -f3 - 5f*2 + 5f. Let n be y(-5). Let k = 15 + n. Let q = 9 + k. Which is the third smallest value? (a) -5 (b) q (c) -0.06 c Let m = -94 - -109. Let t = m - 19. Which is the smallest value? (a) -5 (b) 21 (c) t a Let l = 5.036 + -0.036. Let d(s) = 2s2. Let t be d(1). Which is the third biggest value? (a) l (b) t (c) -1 c Let k be 84/(-40)26-1. Let g(a) = -2a*2 + 2a + 6. Let y be g(6). Let o = y + k. What is the third smallest value in -0.11, 0, o? o Let b = -83.8 - -84. What is the third smallest value in b, 5, 2/11, -4? b Let m = 1.02 + -1.22. Suppose -2l = l - 3x - 30, 0 = -4l - x + 25. Let t = l - 5. Which is the third smallest value? (a) m (b) t (c) -3 b Let g be (3 + -13)(-15)/175. Which is the fourth smallest value? (a) g (b) -1 (c) 4 (d) -0.3 c Let j = 1.8 - 1.1. Let r = j - 0.8. Which is the second smallest value? (a) 1 (b) 2 (c) r a Suppose -2r = -3m - 13, -5m + 10 = -10m + r. What is the second biggest value in 1, m, 10? 1 Let f = 156 + -94. Let v be ((-16)/(-12))/(f/6 + -3). Which is the second smallest value? (a) -5 (b) -1 (c) v (d) -2/13 b Let q = 15 + -16. Let h be ((-16)/56)/(q10/14). What is the fourth smallest value in 2, 3, h, -0.2? 3 Let k = 923.1 + -923. Let c = -1.9 - 0.1. What is the smallest value in -0.4, c, k? c Let f = -5 + 9. Suppose -fb + 42 = 10b. What is the biggest value in -2/45, b, 2? b Let a = -1.21 - -0.01. Let l = a + 0.2. Let u = 7.3 + -7.1. What is the third biggest value in u, l, -6? -6 Suppose -2w = 3o + 19, -3w - 22 = -5o - 3. Let f = w - -11. Suppose 6j = 27 - 33. Which is the third smallest value? (a) f (b) j (c) -3 a Let i be 10/(-6 + 2 + 2). Let q = -0.7 - -3.7. Which is the third smallest value? (a) -0.09 (b) q (c) 0.3 (d) i c Let n = 4 - -1. Let h = 4 - -8. Let g be ((-8)/h)/(2/6). What is the smallest value in n, g, -2/17? g Let v = 10.31 + -7.31. What is the third biggest value in 0.4, v, -1.8, 2? 0.4 Let c = 50 + -53. What is the fourth smallest value in -0.4, 3/5, c, 1/23? 3/5 Let x = -65 - -66.5. Let z = x - 1.5. Let a = -684/5 - -136. What is the second smallest value in a, 5, z? z Suppose -43p + 41p = -2. Let f be p/555/44. What is the third biggest value in 1/3, f, -0.3? -0.3 Let o = -49 - -24. Let x = -30 - o. What is the third biggest value in -3, x, -2/9? x Let g be (385/(-50))/11 - (-1)/5. Let i = 0.2 + -0.15. Let t = i + 2.95. What is the third biggest value in 0.5, g, t? g Let a be (2 - 2) + 2/5. Let c = 10117/50560 + -1/10112. What is the second biggest value in c, 6, -3, a? a Let z(i) = -12i - 31. Let l be z(-3). Which is the smallest value? (a) -4 (b) -2 (c) -10 (d) l c Let d be 0 - ((-19)/(-10) + 2). Let u = d + 93/20. Let l = 921 + -920.5. Which is the second biggest value? (a) l (b) 3 (c) u c Let j = -1.6 - 7.5. Let f = 8.844 - -0.156. Let q = f + j. Which is the biggest value? (a) -2/17 (b) 4 (c) q b Let r = 1019 + -11211/11. Let i be (-2 - -4)(-2)/10. Which is the third smallest value? (a) 5 (b) -1/4 (c) r (d) i c Let g = 126.66 - 128. Let w = g + 0.34. Let f = -9.95 - -10. Which is the third biggest value? (a) f (b) w (c) 0.5 b Let w = 1/714 - -1397/22134. Which is the third biggest value? (a) 6 (b) w (c) 1/2 b Let w be (15/(-4))/(-3) - 4/2. Suppose 4y = d + 41 + 7, 5y = 5d + 45. Let g be ((-3)/y)/((-9)/(-6)). What is the smallest value in g, w, -2? -2 Let k = 0.2 + -0.38. Let j = 18.02 - 18. Let h = k - j. Which is the second smallest value? (a) h (b) -14 (c) 4 a Let d = 4 + 0. Suppose -5h - 68 - 44 = 2i, -2i = h + 112. Let j be (4/i)/(1/(-4)). Which is the smallest value? (a) j (b) d (c) 3 a Let x = -31267/6 + 5211. Suppose 2o - 3o = 2. Which is the fourth biggest value? (a) 0.4 (b) x (c) o (d) -3 d Let l = -884 + 1789/2. What is the second smallest value in 0, l, 0.2? 0.2 Let z = 2.065 - -1.935. Which is the second smallest value? (a) z (b) -0.2 (c) 0.4 (d) 0.08 d Let f = -1 + 1. Suppose 13 = 3m + 7, -2t - 2 = -4m. Which is the fourth smallest value? (a) 1/4 (b) 2 (c) t (d) f c Let m = 113.8 + -113.6. Let f = -4.9 - 0.1. What is the third smallest value in 2, f, m? 2 Let u = -4.971 - 0.029. Let z = 5 + -3. Let w be (-3)/z + 1 - 0. What is the second biggest value in w, -2, u? -2 Suppose 5j = -5d + 45, d = 4j - 3d - 12. Suppose 38 - j = -8y. Which is the third smallest value? (a) 3/2 (b) y (c) -13 a Let g(y) = -26y - 186. Let j be g(-7). What is the third biggest value in 17, -0.3, j? j Let p be 1(-410)/(-2) - 3. Let o = p + -1816/9. Which is the third smallest value? (a) 2 (b) o (c) 2/15 a Let g = -291/994 + 1/142. Let x = 0.3 + -0.5. Let p = -0.3 - x. Which is the second biggest value? (a) p (b) 2/9 (c) g a Let v = 3 - 7. Let n = 4.1 - 4.03. Let s = n - 0.27. What is the smallest value in v, s, -3? v Let y = 10.2 - 10.5. Which is the second biggest value? (a) y (b) 49 (c) -1/6 c Let g be ((-6)/(-75))/((-9)/(-15)). Let w be 5(-2 + 3) - (-49)/(-10). Which is the biggest value? (a) 0.5 (b) 4 (c) w (d) g b Let y be -13/21 - 0. Let v = 11.21 - 0.21. Let n = -10.6 + v. Which is the third smallest value? (a) n (b) y (c) 2/3 c Let o = 0.314 + -0.114. Which is the second smallest value? (a) -3 (b) 26 (c) o c Let o be (-26)/(3 - (1 - 0)). Suppose 5g + 9v - 10 = 4v, -3v = g - 4. Which is the second smallest value? (a) g (b) o (c) -0.5 (d) 4/3 c Let a = -138 + 137.6. Let l = 0.6 - 0.4. What is the third biggest value in l, a, 0.5? a Let i = 0.01 + 0.11. Let x = -0.11 + i. Let d = -0.49 - x. Which is the third biggest value? (a) 0 (b) 0.4 (c) d c Let u be -21/(-4)-3. Let c = 114.48 - 109.48. What is the third biggest value in u, -2, c, 1/3? u Let g(s) = 4s + 14. Let h be g(20). Let q = -94 + h. What is the smallest value in q, -0.02, 5, -3/2? -3/2 Suppose 10i + 42 = 7i. Let l be (-6)/(-10) + i/(-35). What is the third smallest value in l, -1/4, -1? l Let w(j) = j2 - 7j + 13. Let v be w(4). Let n be (6v/20)/((-42)/35). Let r be 10/(-24) + 4/6. What is the second smallest value in r, n, 0? 0 Let l = -1/3 + 23/15. Let f = 0.57 - -0.03. Let a = 1.1 - f. What is the second smallest value in a, 0.2, l? a Let r = -10.77 + 11.8. Let u = 28.23 + -28.2. Let a = u - r. What is the second biggest value in 2/3, 0.2, a? 0.2 Let w = 233.2 + -233. What is the biggest value in -0.3, 2, w, 12/13? 2 Let i = 71 + -70.5. What is the second biggest value in 0, i, 2/21? 2/21 Let v be (-864)/360 + 12. What is the third smallest value in v, -0.2, 0.4? 0.4 Let v = -90 + 89.99. Which is the fourth smallest value? (a) -3 (b) 5 (c) v (d) -5 b Let y = -2 + -4. Let r = -28 - -28. Suppose 2f - 5h - 13 = r, -2*f + 9 = h + 2. What is the biggest value in y, 0, f? f Let x = -0.167 - -0.567. Let l = -1.8 - 0.2. What is the big	{ "pile_set_name": "DM Mathematics" }
hat is the remainder when v is divided by -42((-1)/(-2))/(-1)? 19 Let m = 6 + -4. Let f be 2m - (-5)/(5/(-4)). Suppose 0 = -fi + i - 84. Calculate the remainder when i is divided by 22. 18 Suppose 38a + 480 = 22a. What is the remainder when 67 is divided by 58/5 - (11 + 342/a)? 7 Let j = -7427 - -9594. Calculate the remainder when j is divided by 55. 22 Suppose -159a + 1344 = -127a. Calculate the remainder when 1/3 - (-1500)/9 is divided by a. 41 Let o = 3462 + -3435. What is the remainder when 1039 is divided by o? 13 Suppose 2v - 6t = 936, 0 - 7 = t. Calculate the remainder when v is divided by 60. 27 Suppose 446f - 434f = 1248. Calculate the remainder when 1235 is divided by f. 91 Let l(h) = 9h*2 + 271h - 113. Calculate the remainder when l(-33) is divided by 4. 1 Suppose 47y = 42y + 400. Let q = y + -64. Suppose 0 = -4o + q + 244. What is the remainder when o is divided by 6? 5 Let u(z) = -z3 - 18z*2 - 2z - 53. Calculate the remainder when u(-19) is divided by 84. 10 Let o(x) = -30x - 611. Calculate the remainder when o(-31) is divided by 17. 13 Let i = 13054 - 11619. Calculate the remainder when i is divided by 43. 16 Let w be 20/270 + (-374)/(-54). Let a(g) = -2g*2 + 10g + 35. What is the remainder when 118 is divided by a(w)? 6 Suppose 4w = -12, 0 = -3m + 6m - 5w - 23679. Suppose -326 + m = 19c. What is the remainder when c is divided by 57? 56 Let z = -23 - -44. Suppose -a = -15a + 280. Suppose -v + a = -19. Calculate the remainder when v is divided by z. 18 Suppose -92h - 19h + 50797 - 12280 = 0. What is the remainder when h is divided by 176? 171 Let c(r) = -144r + 1339. Calculate the remainder when 338 is divided by c(9). 37 Suppose -7s + 3778 = -1199. Calculate the remainder when s is divided by 6. 3 Let y(l) = 2l2 - 61l - 306. Calculate the remainder when y(43) is divided by 155. 149 Suppose -623c + 621c + 621 + 431 = 0. Calculate the remainder when 3690 is divided by c. 8 Suppose 0 = -43c - 1261 + 4572. Calculate the remainder when 627 is divided by c. 11 Suppose -131b = -4227 - 1232 - 960. Calculate the remainder when 200 is divided by b. 4 Let f(s) = -33s + 237. Let k be f(6). Let i = k - 22. Calculate the remainder when 68 is divided by i. 0 Suppose 0 = -4c - c. Let m be (10/12)/(26/156). Suppose 3x = o - 170 + 558, c = mo + 20. Calculate the remainder when x is divided by 33. 29 Let a(h) = 24h + 634. What is the remainder when 2737 is divided by a(-26)? 7 Suppose 7o = 10 + 95. Suppose -5n = 6g - 2g - o, 3g - 3 = -n. Calculate the remainder when 20 is divided by (-6)/n + 14 + -4. 4 Suppose -9 = 3m, 2y + 3y = m - 362. Let g = 76 + y. What is the remainder when (69g/(-12))/((-3)/12) is divided by 12? 9 Calculate the remainder when (((-16)/24)/((-10)/(-18)))/((-30)/113775) is divided by 46. 43 Suppose -3128 = -314p + 5927 + 19519. Let w(n) = n3 + n2 - n + 24. Calculate the remainder when p is divided by w(0). 19 Let q(t) = 91t - 2. Let p be q(-2). Let j = 219 + p. What is the remainder when j is divided by 12? 11 Suppose -7y + 22 = -286. Suppose -14 + y = 3j. Let g = j - -23. What is the remainder when 130 is divided by g? 31 Suppose 0v = -5v, 198 = 2s - 3v. Let p = -62 + s. What is the remainder when 104 is divided by p? 30 Let h(z) = 638z2 + 14z - 14. What is the remainder when h(-2) is divided by 157? 155 Let v = 136 + -134. Let d(y) = 8y2 - 8y + 4. Suppose 3c + 148 = 4x - 81, 0 = 5x - 2c - 288. Calculate the remainder when x is divided by d(v). 18 Suppose 2r - 230 = 2t + 144, -4r + 727 = -t. Calculate the remainder when 4679 is divided by r. 179 Suppose 32b + 7080 = 10984. Calculate the remainder when b is divided by 52. 18 Let y be 6 + (-3 - 0) - 314. Let m = -221 - y. Let s = m + -55. Calculate the remainder when 68 is divided by s. 33 Suppose -f = 2 - 14. Let h be (1 - -1) + 16/(-1 - -2). Let x(s) = s*3 - 20s*2 + 37s - 13. What is the remainder when f is divided by x(h)? 2 Let h be 7/568 - 3. Calculate the remainder when 238 is divided by -3 - (-2 + h + -11). 10 Let c = -11 - -12. Let r be -7c/(-2) - (-2)/4. Calculate the remainder when 28 is divided by (20/4 - r)16. 12 Suppose 12 - 2 = 2p. Suppose 78 = -pv + 403. Let x = v - 35. Calculate the remainder when x is divided by 16. 14 Let y be 1 - (-1755)/24 - 2/16. Let h = y - -90. What is the remainder when h is divided by 15? 14 Let l(i) = 110i - 834. Calculate the remainder when l(10) is divided by 16. 10 Let y be ((-44)/10)/((14/(-5))/7). Suppose -yq + 3b = -10q - 76, 202 = 3q + 4b. What is the remainder when 208 is divided by q? 68 Let j(q) = -47q + 3484. What is the remainder when j(52) is divided by 208? 0 Suppose 3y = -g + 198, 0 = -g + 3g + 6. Suppose -2k = -5k + 3. Let m(j) = 19j - 1. What is the remainder when y is divided by m(k)? 13 Suppose 0 = 26n - 56n. Suppose 0s + v + 114 = 2s, 4s - 4v - 232 = n. What is the remainder when 216 is divided by s? 48 Let f = -7 - -25. Suppose 5t - 4t - f = 0. Suppose -10h + h + 189 = 0. What is the remainder when h is divided by t? 3 What is the remainder when 2839 is divided by (12/(-18) - (-11)/3)/(1/45)? 4 Let v = -38 + 41. Let g(s) = s + 33. What is the remainder when 211 is divided by g(v)? 31 Let x = 16 - 5. Let n = 5286 - 5257. What is the remainder when n is divided by x? 7 Let r(a) = a*3 - 25a*2 - 33a - 1420. Suppose -3g - 24 = -7g. What is the remainder when r(28) is divided by g? 2 Suppose 4f = -5t + 150 + 409, -t = 2f - 281. Let m = 210 + -174. Calculate the remainder when f is divided by m. 33 Suppose -c + 4 = 3m, 2c - 17 = m - 2. Suppose -cp + 21p = 1876. Calculate the remainder when p is divided by 67. 0 Let x = -33 - -24. Let f be 3 + (-115)/x + 6/27. Suppose 0 = 2v + f - 360. Calculate the remainder when v is divided by 35. 32 Calculate the remainder when 5567 is divided by (261261/(-130))/(-21) - 9/(-30). 95 Let w(o) = -o*3 - 15o*2 + 16o + 3. Let f be w(-16). Suppose fy - 192 = -3y. Calculate the remainder when y is divided by -63/(-1) - 0. 14 What is the remainder when 1919 is divided by (-90)/14735/(-315)? 14 Let g(c) = 2c + 11. Let j be (-63)/4240/6. Let d be g(j). Calculate the remainder when (-182)/(-21)d/(-2) is divided by 11. 6 Let w(u) = 17u - 118. Let y(g) = 8g - 58. Let f(b) = 6w(b) - 13y(b). What is the remainder when 403 is divided by f(-6)? 55 Let h(s) = 1485s - 2679. What is the remainder when 1165 is divided by h(2)? 1 Let z(v) = -5v + 18. Let b be z(0). Suppose 4s - 18 - b = 0. Let l = s - -20. Calculate the remainder when 171 is divided by l. 26 Let l(j) = -3j2 - 13j + 16. Suppose 2h - 1 - 19 = 2u, 0 = -3u - h - 10. Calculate the remainder when 15 is divided by l(u). 3 Suppose -3q + 4y = 13, 2q - y + 3 - 1 = 0. Let t be ((-3)/(-9)(q - 1))/3. What is the remainder when t/3 + 1 + 18 is divided by 4? 3 Let q(s) = s2 - 15s + 101. Let b = -20 + 47. What is the remainder when q(9) is divided by b? 20 What is the remainder when -303(-10 + 40/5) is divided by 333? 273 Suppose -21i + 534 = 30. Suppose -s - 8 = -4c, 9 = 3c - 0. Suppose -4k - 15 = -3j, -5k = -2j + s - 1. What is the remainder when i is divided by j? 6 Let b be 1221 - (-14 - -9 - -10). Suppose -t + 61 = 3q, 0 = -t - 3t - 5q + b. What is the remainder when t is divided by 10? 9 Let t be 4941/54 + (-1)/2. Let m = -32 + t. Calculate the remainder when 171 is divided by m. 53 Let g = 4519 - 4516. Let r be (0 - 46/(-4))2. Let f = r - g. What is the remainder when 32 is divided by f? 12 Suppose 4t - 4322 = 2b, -700 = -t + 4b + 391. Calculate the remainder when t is divided by 289. 212 Let a be (10 + -2)/1(0 + 4). Let d = -28 + a. What is the remainder when (39 + -1)(-4)/(-8) is divided by d? 3 Let h = 11 + -7. Suppose -hz - 5x = -15, 4z + 2x = 37 - 7. Suppose -zc + 12c - 6 = 0. What is the remainder when 15 is divided by c? 0 Suppose 3p = 92 - 47. Suppose -2s = p - 55. Let r(k) = -73k3 - k2 - k - 1. What is the remainder when r(-1) is divided by s? 12 Let h(x) = x3 - 18x*2 - 38x - 36. Let c be h(20). Suppose -cd + 164 - 29 = 5y, 2y - 54 = -d. Calculate the remainder when 77 is divided by y. 23 Let l(g) = -99 - 499g + 84 + 481*g. Let j = 4 - 9.	{ "pile_set_name": "DM Mathematics" }
he units digit of s? 9 Let h = -4 - -9. What is the units digit of h? 5 Suppose 2a - 17 = -j, 39 - 2 = 2j + 5a. Suppose j = -3h + 4h. What is the units digit of h? 1 Let s be (-3)/(-2)20/(-6). Let a = 43 + s. What is the units digit of a? 8 Let n be 12/(-8)4/6. Let a(q) = -6q - 1. What is the units digit of a(n)? 5 Suppose -508 + 2560 = 12d. What is the units digit of d? 1 Let z(u) = 2u*2 + 2u - 1. Let d be z(1). Suppose di + 0i = 24. What is the units digit of i? 8 Let r(g) = -2g - 4. Let m be r(-3). Suppose -4j - 106 = -my + 18, 124 = -4j + 5y. Let l = -18 - j. What is the tens digit of l? 1 Let j(q) = 20q. What is the units digit of j(4)? 0 Suppose -1 = -h + c, 2c = h - 3c - 9. What is the tens digit of 19/((-4)/(-5 - h))? 1 Suppose 5q + 4b - 102 = 0, 30 = 2q + 4b - 18. Let p(f) = f*2 - 9f + 12. Let s be p(8). Suppose q = sj + 2. What is the units digit of j? 4 Let z(p) = -2p - 5. Let j be z(-4). Let o(i) = i*3 - 3i*2 + 4i - 2. What is the units digit of o(j)? 0 Let p(z) = z*3 - 14z*2 + 9z + 5. Let g be p(14). Let c = -85 + g. What is the tens digit of c? 4 Suppose 5n - n - 2q = 6, 2n = -5q - 3. Let d(b) = 12b3 + 1 - 3b*3 + 3b*3 - 2b + 2b2. What is the units digit of d(n)? 3 Let w(s) = 2s + 4s - 3 + 4s - s. What is the units digit of w(3)? 4 Let u(l) = -4l2 - 2 + 3 - 5 + 3l*2 + 7l. What is the units digit of u(5)? 6 Let c(m) = 44m + 1. Let d be c(1). Let q = d - 32. What is the tens digit of q? 1 What is the units digit of (-6 + 2)/((-1)/4)? 6 Suppose 0 = -2g + 8 - 2. Let n(f) be the third derivative of f*4/24 + 2f*3/3 - 2f*2. What is the units digit of n(g)? 7 Let b = -3 - -9. Suppose -4z + 9 = -z - 5a, 2z = -5a + b. What is the units digit of z? 3 Let t = 15 + -15. Let s(k) = k3 + k2 + 2k + 40. What is the tens digit of s(t)? 4 Suppose -3i + 2u + 149 = 2i, -3i - 4u + 105 = 0. What is the tens digit of i? 3 Suppose -5u - 30 = -j, -5j = -j + 3u - 28. Suppose c = 4, -c = -2w - 2c + j. What is the units digit of w? 3 Let d be (-8)/(-1)(2 - -9). Let j = -52 + d. What is the units digit of j? 6 Let w = 1 - -1. Let t(x) = x2 + 6x + 3. Let h be t(-6). Suppose 0 = wb + hb + 20, i + 5b = -17. What is the units digit of i? 3 Suppose q - 2q - 3n = -17, 3 = 4q - n. Suppose qs = -2s + 36. Suppose -k = -5k + 16, 5z - s = 4k. What is the units digit of z? 5 Let b(z) = z2 + 5z + 5. Let s be b(-4). Let v(w) = w*2 - 4w - 1. Let p be v(5). Suppose s = -px - h, h + h + 15 = 5x. What is the units digit of x? 1 Suppose -3x - 4c - 4 = -0x, 0 = -5c - 20. Suppose -i = 4v - 77, -xv - v + 4i = -70. What is the tens digit of v? 1 Suppose 6w = 38 + 130. Let o(p) = p*3 + 4p*2 - 1. Let v be o(-2). Suppose -w = 3z - vz. What is the units digit of z? 7 Suppose -3p - 2b + 247 = 0, 2p - 3b - 169 = -0p. What is the tens digit of p? 8 Let i = -4 - -7. Suppose 62 = 2c - iv - v, c = v + 28. Suppose -2j + 5 = z, 5z - c = 4j + j. What is the units digit of z? 5 Suppose -4o - o = -100. Suppose -3m - o = -8m. What is the units digit of m + -1 - (1 + -4)? 6 Let p be (2/(-1)-1)/1. Let n(j) = -j2 + 5j - 1. What is the units digit of n(p)? 5 Let k = -15 - -14. Let n(p) be the second derivative of 2p4/3 + p3/6 - p. What is the units digit of n(k)? 7 Let d = 17 - 16. What is the units digit of (-2 - d)76/(-6)? 8 What is the units digit of 68/(1 - 3)-1? 4 Suppose 5b = 3b + 14. Suppose 22 - b = 5h. Suppose 4 - 9 = 2u + hp, -25 = -u + 4p. What is the units digit of u? 5 Let k(d) = -d3 - 4d*2 + 19d + 6. What is the tens digit of k(-7)? 2 Let s(d) = 3d2 + 2d + 1. Let v be s(2). Suppose 17 = y + 7. Let f = v - y. What is the units digit of f? 7 Let r(z) = -z*3 - 6z*2 - 2z + 5. What is the tens digit of r(-6)? 1 Suppose 4l + 0l + c = 8, c = -3l + 5. Let t be ((-20)/2)/2l. Let p = t - -24. What is the units digit of p? 9 What is the hundreds digit of (2296/(-42))/((-10)/(-6) - 2)? 1 Let n = 80 - 46. What is the tens digit of n? 3 Let r = -34 - -49. What is the units digit of r? 5 Suppose -25f - 4 = -27f. What is the units digit of f? 2 Suppose 5h - 35 = -10. What is the units digit of 28/h(-50)/(-20)? 4 Let x(i) = -3i - 6. What is the tens digit of x(-9)? 2 Let w = -36 - -47. What is the tens digit of w? 1 Let k(b) = -b2 + 5b + 5. Let n be k(5). Suppose 4v + n = 17. What is the units digit of v? 3 Let n = 4 + -3. Let l be -1 - (-1 + 0)n. Let b = l + 4. What is the units digit of b? 4 Let l be -30 + 0/2 + 1. Let t = l + 57. What is the units digit of t? 8 Suppose 3v = 5k + 22, -2v + 23 = k - 6k. Let y = v + 2. Suppose -4q = -y - 3. What is the units digit of q? 1 Let w = 200 + -83. What is the units digit of w? 7 What is the tens digit of (1 - -54)(1 + 0)? 5 Suppose 4c = 4 + 8. Suppose -2t = -t - 4s - 6, -4t = -cs - 76. Suppose -38 = -4a + t. What is the tens digit of a? 1 Suppose 32 = 5s - 3. Let k(d) = d2 - 6d + 1. What is the units digit of k(s)? 8 Suppose 0 = 5u, 3q - 2u + 16 = 154. What is the units digit of q? 6 Suppose 5k = 5, 1 = 3c + 4k - 12. Suppose 3o + 7 = t, -t + co = -5t + 13. What is the units digit of t? 4 Suppose 5l - 2 = -5q + 8, -5q = 3l - 8. Let n = q - 4. Let j = n - -11. What is the units digit of j? 8 Let l(v) be the first derivative of 22v*3/3 + v - 7. What is the tens digit of l(1)? 2 Suppose -z + 6z - 10 = w, 4 = z. Let y be (1 - -1) + 0 - w. Let t = y + 14. What is the units digit of t? 6 Suppose -2v + 5y = -0v - 28, -3v - 5y - 8 = 0. Suppose 7 = vm - 45. What is the tens digit of m? 1 Let b(x) = x + 6. Let n be b(-6). Let j(z) be the third derivative of z6/120 + z5/60 - z*4/24 + 3z*3/2 - 15z*2. What is the units digit of j(n)? 9 Suppose -2a = -12 - 12. What is the tens digit of (-18)/a(-52)/6? 1 Let z = 12 - 4. Suppose -29 = -v - z. What is the units digit of v? 1 Let b be (-45)/12 - 1/4. Let h be (-2)/b + (-5)/(-2). What is the units digit of (-1 - -12)/(h - 2)? 1 Let o be (9/3)/((-3)/(-5)). Let u be 1 - -1 - 0/o. Suppose t = -ut + 9. What is the units digit of t? 3 Let w be (-6)/9 + (-41)/(-3). Let c = w + -8. What is the units digit of ((-1)/2)/(c/(-80))? 8 Let t be 2/8(1 + 3). Let c be t((2 - 3) + 4). Suppose 0 = cb - 4v + 6, -4v + 4 = -8. What is the units digit of b? 2 Let c = -3 + 6. Suppose cz - 9 + 92 = 4r, 3r = 2z + 61. What is the units digit of r? 7 Let j be (-24)/((-2)/41). Let o(g) = 4g + 1. Let c be o(3). Suppose -j = -5x - c. What is the units digit of x? 7 Suppose 7g = 6g - 8. What is the tens digit of (-6)/g + 1302/56? 2 Let u(i) = i + 5. Let j = -7 + 12. Let d be u(j). What is the units digit of 3/2d/3? 5 Suppose 2f + f = -4l + 44, 3f - 4 = l. What is the units digit of l? 8 Let s = 55 - -39. Suppose k = 4h - 137, 2h - s = -h - k. What is the tens digit of h? 3 Let i(s) = -2s - 1. Let n be i(-3). Suppose -39 = -nl - 4w, 4l - 16 = 2l - 2w. What is the units digit of l? 7 Let s(g) be the second derivative of -g*3/6 + 11g*2/2 - 3g. Let t be s(11). Suppose -6x + 3x + 15 = 2k, t = k - 4x + 9. What is the units digit of k? 3 Let q(n) be the first derivative of n5/60 + n4/4 - n*3 - 3n*2/2 - 1. Let g(x) be the second derivative of q(x). What is the units digit of g(-7)? 1 Let n be (15/20)/((-3)/(-408)). Suppose 3q - 3 = n. What is the tens digit of q? 3 Suppose 2a = -2j + 322, 4a = -5j + 552 + 249. What is the tens digit of j? 5 Let q be 6((-12)/9)/1. What is the tens digit of (-1 + q/(-6))39? 1 Suppose -21v + 1056 = -18v. What is the tens digit of v? 5 Suppose 0v = -2v - 2y - 62, y + 163 = -5v. Let z = -6 - v. What is the tens digit of z? 2 Let l be (-6)/5(-5)/2. Suppose -ln + 28 = 4a, 0 = a + 2a + 3n - 21. What is the units digit of a? 7 Suppose 7 = -3i + 757. What is the units digit of i? 0 Suppose 5o - 15 = 0, 4o + 111 = 3w + 3o. What is the units digit of w? 8 Let w(m) = 3m3 + 9m*2 - 6m - 5. Let v(y) = 4y3 + 10y*2 - 7y - 6. Let t(p) = -4v(p) + 5w(p). Let k = 4 - 2. What is the units digit of t(k)? 7 Let r(q) = q*3 + 7q*2 + q + 3. Let m be r(-7). Let f be m + 1 - 63/(-9). Suppose -fz + 80 = 4d, -2d + 85 = 4z - 3d. What is the tens digit of	{ "pile_set_name": "DM Mathematics" }
of n(u)? 4 Let n = -3 + 5. Let f(s) = 2s + s - n - 4. What is the units digit of f(4)? 6 Let c(n) = n3 + 6n*2 - 8n + 2. Suppose 5v = v - 28. What is the units digit of c(v)? 9 Let d(a) = a3 - 4a*2 - 6a - 1. Let p be d(6). What is the units digit of 1145/p - (-4)/14? 3 Let l = 0 + 74. What is the units digit of l? 4 Suppose 318 = 414b - 413b. What is the hundreds digit of b? 3 Suppose 0 = 4o + 3p + 21, 5o + 6 = p + 2p. Let b be 2/o(-18)/4. Suppose 8r + 2l = br + 10, -5r + 10 = 4l. What is the units digit of r? 2 Suppose 5c + 235 = 970. Let w = -102 + c. What is the units digit of w? 5 Suppose -5d - 4t = -354, -220 - 84 = -4d + 2t. Suppose d = 5k + 279. Let a = 58 + k. What is the tens digit of a? 1 Suppose 0 = 4h - 22 - 74. What is the units digit of (8/h)/((-1)/(-129))? 3 Let r(c) = 3c*3 + 3c*2 + 3c + 3. Let o be r(-2). Let q(p) = 4p - 10. Let b be q(9). Let y = b + o. What is the units digit of y? 1 Let l(m) = m2. Let h be l(0). Suppose 5q - 6f - 70 = -f, -q - 2f - 1 = h. What is the units digit of q? 9 Suppose 3l - 19 = 32. What is the units digit of l? 7 Let j(c) = -3c - 2. Suppose 0 = 4l - 0 - 4. Let p = -4 + l. What is the units digit of j(p)? 7 Suppose -6x + 39 = -4x + k, 73 = 4x - 3k. What is the units digit of x? 9 Suppose 4p = 5n - 35 + 1, 2n - p - 13 = 0. Suppose t - i = nt - 41, 0 = 3t - 2i - 35. What is the units digit of t? 9 Suppose -3d + 43 = 10. Suppose 0 = 3o - l - 68, l = -3o + d + 47. What is the tens digit of o? 2 What is the hundreds digit of (-2)/((-2440)/7176 + 2/6)? 2 Let u(n) = -n*2 - 12n - 9. Suppose 3h + 18 = -0h. What is the units digit of u(h)? 7 Let k be (-48)/9(-9)/6. Let p = k - -1. What is the units digit of p? 9 Let x = 53 + -23. What is the tens digit of x? 3 Suppose 0 = -4j - 2o + 48, 41 = 3j - 2o + 12. What is the tens digit of j? 1 Let d(r) be the second derivative of 3r3/2 - r2 + r. What is the units digit of d(2)? 6 Suppose 19m - 20m = -58. What is the units digit of m? 8 Suppose 0x - 9 = -x + 2l, 15 = 3x - 3l. Let z = x - -1. Suppose -3 = -zo + 21. What is the units digit of o? 2 Suppose 3j = 31 + 8. What is the tens digit of j? 1 Suppose 5x - 135 = l, 3l + l = 4x - 124. What is the units digit of (1/(-1))/((-2)/x)? 3 Let o(d) be the third derivative of 17d4/24 - d3/6 + 4d2. What is the tens digit of o(1)? 1 Suppose -3k = -15k + 1728. What is the hundreds digit of k? 1 Let b(y) = -y2 - 3y + 4. Let f be b(-4). Suppose -3v + v + 10 = f. What is the units digit of v? 5 Let b(u) = -9u*3 + 2u*2 - 1. Suppose 3w - 2n + 7 = -0n, 0 = -4w + 5n - 21. Let k be b(w). What is the units digit of k/(-3)(-9)/(-6)? 4 Let n be 1/((-3)/2)-204. Suppose n = 3d + d. Suppose 0 = -4i + d - 6. What is the units digit of i? 7 Let l = -85 - -25. Suppose a + 4m = 8m - 35, -a = 5m + 53. Let i = a - l. What is the units digit of i? 7 Let u(p) = -p3 + 4p*2 - 3p + 3. Let w(r) = 2r - 2. Suppose 0 = -y + 1 + 1. Let i be w(y). What is the units digit of u(i)? 5 Suppose 0 = -3j + 6 + 57. What is the tens digit of 4 - (-4 + 1 - j)? 2 Let c = -40 - -291. What is the tens digit of c? 5 Let s(b) be the second derivative of b*4/12 + 7b*3/6 - 6b*2 - 3b. What is the units digit of s(-9)? 6 Suppose -8x = -6x - 56. What is the units digit of x? 8 Let t be (-2)/(-4) - (-21)/2. What is the tens digit of t + (-3)/(-6)0? 1 Let r(v) = 5v*2 + 3v - 1. Let b be r(3). Let q = 81 - b. Suppose -q = -4j - 0j. What is the units digit of j? 7 Let b(t) = -t*3 + 5t*2 + t + 2. Suppose -2q - 5h = -4q - 10, -4q = 3h - 32. What is the units digit of b(q)? 7 Suppose -98 = -7z + 189. What is the tens digit of z? 4 Suppose 144 = 19x - 15x. What is the units digit of x? 6 Let u be 24/2010/4. Let b = 6 - u. Suppose -c + bc = -10, 0 = -2i - c + 23. What is the units digit of i? 4 Suppose 0f = -f + 16. What is the tens digit of f? 1 Let x = -4 - -13. What is the tens digit of 4(x/12 + 3)? 1 Suppose -33 = -4o + m + 4m, 27 = 3o - 3m. What is the units digit of o? 2 Suppose -3v = -4v + 20. What is the tens digit of v? 2 Suppose -3 = -2l + 1. Suppose -3u + 32 = 5i - 2, -5i + 42 = 4u. Suppose -ln + u = 2n. What is the units digit of n? 2 Suppose -4z = -5i - 2z + 86, i - z - 16 = 0. What is the units digit of i? 8 Let i = 5 - 3. What is the units digit of 9/6i1? 3 Let k(x) = 20x + 15. Let h(v) = 13v + 10. Let j(a) = 8h(a) - 5k(a). What is the units digit of j(5)? 5 Suppose -4b = -b - 606. What is the units digit of b/18 + 4/(-18)? 1 Suppose 3s + 0h - 84 = -4h, 0 = 5s + h - 157. What is the tens digit of s? 3 Let c be (-1 - -3 - -1) + -2. Suppose 2k - 5k = 9. What is the units digit of (6 + k/(-3))c? 7 Suppose 10 = d - 6. Suppose 0 = -3c - d + 43. What is the units digit of c? 9 Let y be (-1 - 1)1/(-2). Suppose -y - 7 = -l. What is the units digit of l? 8 Suppose 4i - m - 14 = 0, -8 = -i - 4m + 2m. Suppose 4u - 38 = 2h, 0 = -u + 3h + i + 3. What is the tens digit of u? 1 Let f = 158 + 2. Suppose 2q - f = -3q. What is the units digit of q? 2 What is the tens digit of (-236)/(-5) - (-2)/(-10)? 4 Let t(f) = -f. Let o = 29 - 20. Let u be t(o). Let w = 20 + u. What is the units digit of w? 1 Let b be -4((-3)/(-2))/(-3). Suppose 0 = -ba + 7 + 11. What is the units digit of a? 9 Suppose w + 120 = 2w. What is the tens digit of w? 2 Let y be (-16)/(-6) - 5/(-15). What is the tens digit of y/((-5)/((-140)/6))? 1 Let b be 17(1 + 1)/2. Let g = b + -4. Suppose 40 = 3p + g. What is the units digit of p? 9 What is the tens digit of (3/2)/((-12)/(-368))? 4 Suppose -2m - 362 = -5g, -4g + 291 = 3m - 6m. What is the tens digit of g? 7 Let r be 4(-5 + 2)/(-6). Suppose rs + 0s + f + 5 = 0, f + 5 = s. Suppose q = -sq + 2. What is the units digit of q? 2 Suppose i + 5t + 23 = 0, i + 4t + 19 = -0i. Let h(g) = g3 + 4g*2 + g + 1. What is the units digit of h(i)? 7 Suppose 8k = 5k. Let u be (1 + k)(-2)/(-2). Let p = 1 + u. What is the units digit of p? 2 Let g = 7 + -2. Let b = g - 7. What is the units digit of ((-4)/6)/(b/27)? 9 Let w be 3 - (-3)/(3/2). Let f(u) = u*2 - 3u + 1. Let j be f(4). Suppose 3h + 1 = wr, -5h + 8 + j = -r. What is the units digit of h? 3 Let d = -7 - -12. Suppose 0 = di - 0 - 40. What is the units digit of i? 8 Let a = 6 - 3. Suppose -j - 10 = -5r, -3 - a = -3r + 5j. What is the units digit of r? 2 Let i(u) = -2u. Let a be i(1). Let k = 13 - a. What is the units digit of k? 5 Let i(n) = n*2 - 6n - 4. What is the tens digit of i(-6)? 6 Suppose 5p - o = 1 + 4, -2p + 2 = -5o. What is the units digit of p/(-2 + 3) - -6? 7 Let j(n) = 12n - 3. Let z be j(2). Suppose 2r - z = r. Let p = r + -12. What is the units digit of p? 9 Suppose -15 = -7z + 2z. Suppose -5x - 4c = 6, 0 = x + c + 2c + 10. Suppose -n = -zn + x. What is the units digit of n? 1 Suppose 0x + x - 35 = 3y, 4y + 40 = x. What is the tens digit of x? 2 Let t = -21 + 29. Suppose 5p = 3q + 7, 3p + t = -5q + 19. What is the units digit of p? 2 Let t = -1 + 4. Let f be (-1)/t + 8/(-12). What is the units digit of ((-12)/(-3) - f)/1? 5 Let s = 20 - -8. Let a = s - 12. What is the units digit of a? 6 Let p(j) = j*3 + 13j*2 - 15j - 8. What is the units digit of p(-14)? 6 Suppose r = -4b + 11, 3b + 0 - 37 = 5r. Suppose -b = -s - 2. Suppose 0 = -3q - sm + 3m + 23, 0 = 4q - 5m - 27. What is the units digit of q? 8 What is the tens digit of -10 + 6 + 1 + 63? 6 Suppose 3d = -6, u + 20 = -4u - 5d. Let v = 11 - u. What is the units digit of v? 3 What is the units digit of (-23 - -21) + (2 - -1183)? 3 Let o(i) = -3i - 6. Let r be o(-7). Let v be (-3)/(3 + (-48)/r). Suppose v = 4z + z. What is the units digit of z? 3 Let b(x) be the first derivative of x*2/2 - 3x - 1. Let p be 0 + 4/1 + 0. What is the units digit of b(p)? 1 What is the units digit of 84 - (-8 - -3 - -4)? 5 Let h be 13/(-3)(0 + -3). Let m = h + -5. What is the units digit of m? 8 Suppose -3s + 5l + 538 = 0, 6s - 493 = 3s - 4l. What is the units digit of s? 1 Let k(f) = -f*3 - 9f*2 + f + 12. Let m be k(-9). Suppose 45 = mb + 6. What is the units digit of b? 3 What is the units digit of (-3144)/(-36) + 2/	{ "pile_set_name": "DM Mathematics" }
ve. g*(54/19) Simplify (pp(-2/15))(1/15) assuming p is positive. p(13/225) Simplify (l/(l(-3)/l))/(l*(3/5)/l)l/(l/(l/l*(1/5))l)l(2/19) assuming l is positive. l(504/95) Simplify ((ccc(-2))28)(-2/5) assuming c is positive. 1 Simplify m/(m/m39)mm(-5/11)/m assuming m is positive. m(424/11) Simplify ((d/((dd/d(2/27))/d))/d)/(d(-3/16)dd) assuming d is positive. d(-1183/432) Simplify (d26/d)/((ddd22)/d) assuming d is positive. d2 Simplify (j*(32/7)/j)/(jj*(-24)j) assuming j is positive. j(179/7) Simplify (o(-2/7))(-20) assuming o is positive. o(40/7) Simplify a/(a/((((a*(-18)/a)/a)/a)/a))a9/a assuming a is positive. a(-14) Simplify (l*(-4)l(2/13))/(l(-3)/ll/(l(-6)l)) assuming l is positive. l(-76/13) Simplify (n(-6)/nn(-20))(6/7) assuming n is positive. n(-162/7) Simplify (m(-8)/(m/(m/(m(-14)/m))m))(-40) assuming m is positive. m(-240) Simplify (t/(t*(-15)/t)t)(-35) assuming t is positive. t(-630) Simplify (a*(2/7)a*9)/((aaaa*(3/2)/aa)/(aa/((aa(2/7))/a))) assuming a is positive. a(13/2) Simplify (b/((b(b(bb(8/15)/bb)/b)/bb)/b))/(b/b(-24/5)) assuming b is positive. b(-19/3) Simplify l(-19)l17 assuming l is positive. l(-2) Simplify x(-3/7)/(x/((x/(x(-15)/x)x)/xx)) assuming x is positive. x(116/7) Simplify ((t/(t/((t6t)/tt)))/t(-3/7))/(t(-1/2))40 assuming t is positive. t(192/7) Simplify (d(2/87)/d)(-5) assuming d is positive. d(425/87) Simplify (a11aaa(-3))(-43) assuming a is positive. a(-430) Simplify ((m/(m(-1)/m))/m)0/(m(-2)/(m/m(-3/5))) assuming m is positive. m(18/5) Simplify (q/(qq1))(-1/12) assuming q is positive. q(1/12) Simplify (n(1/8)n(-2/15))/(((nn*7)/n)/(n(nnn*1/n)/nnn)) assuming n is positive. n(-361/120) Simplify (d/(d/d(-11)))/dd/(dd4d) assuming d is positive. d(-17) Simplify g0gg*9((g*(-1/6)g)/g)(4/11) assuming g is positive. g(328/33) Simplify q*11q*(3/13)qq assuming q is positive. q(172/13) Simplify x(3/7)x*(1/5)(x(xx/x*(1/2)x)/xx)(-10/7) assuming x is positive. x(-153/35) Simplify m(-9/10)/m(-15) assuming m is positive. m(141/10) Simplify h(-7)(hh/h(3/4)h)/h(hh(2/3))(-13) assuming h is positive. h(-329/12) Simplify ((u(-4)/u)10)(-10/7) assuming u is positive. u*(500/7) Simplify (((pp*(5/3)/p)/p)/p)/(pp/p8) assuming p is positive. p(17/3) Simplify (c/(c(3/8)/c))40 assuming c is positive. c*65 Simplify (((k/(k/(kkk4k)))/k)/kk(-2/7))/(k4k(k/(k(-9)/kk))/k) assuming k is positive. k*(-65/7) Simplify (aa(-12)/a)15 assuming a is positive. a(-180) Simplify (p(1/3)/p)/((p/p*0)/p)(p(1/4))8 assuming p is positive. p(4/3) Simplify ((b/b(-5))/bb(7/4)/bb)/(b*(2/3)b)29 assuming b is positive. b(-499/12) Simplify (mm(-2/3)/mm)(-1/21)/(m(-9)mmm/(mm(2/3))) assuming m is positive. m(482/63) Simplify o/(((o/(o/(oo(oo(-4/11))/oo)))/o)/o)oo31 assuming o is positive. o(356/11) Simplify (k/(kk(-4)))/(k/(kkkk*(2/13)))(k/(((k*(-8)k)/k)/kk))/(kk*(-2/5)kk) assuming k is positive. k(816/65) Simplify ss*(-1/11)s/(s/(s(s/(ss*(-2/17))s)/s))s assuming s is positive. s(566/187) Simplify (z1)(-4/9) assuming z is positive. z(-4/9) Simplify ((w(2/13))41)(-19) assuming w is positive. w(-1558/13) Simplify ((tt/(t/t*(9/2))tt)/t(-2/37))/(t(-1))(-7/6) assuming t is positive. t(709/111) Simplify (h(1/2)h*(1/4))/(h/((hh/h(-2/7))/h))(-1/3) assuming h is positive. h*(55/84) Simplify ((h/(hhhh/(h*18h)hhhhh))/h)/((((h/(h(-4/9)h)h)/h)/hh)/h) assuming h is positive. h*(95/9) Simplify ((k(k/((k/(k*(-17)k)kk)/k))/k)/k(-2/7))17 assuming k is positive. k*(-1989/7) Simplify (s/(s/(ss*(-2/3)))s/(ss(1/11)/ss)s)/((s(-1)ss)/s5) assuming s is positive. s(173/33) Simplify (j1j)*(4/21)/(jj(-2/3))(-2/7) assuming j is positive. j(10/21) Simplify (s(-13)(s/(sss(4/9)))/ss)(-36) assuming s is positive. s520 Simplify g*(14/5)g/(g/(g*(1/26)gg)g) assuming g is positive. g*(499/130) Simplify (((d/(d(d/((dd(2/3))/d))/d))/d)/d)(1/7)/(dddd*5((dd(-4)d)/d)/d) assuming d is positive. d(-88/21) Simplify o(-8/7)/(ooo(-23)) assuming o is positive. o(139/7) Simplify (h/h(13/4))(14/5) assuming h is positive. h*(-63/10) Simplify (ll/(l((l/(ll/l*(-9)))/l)/ll)l)/l(-38) assuming l is positive. l51 Simplify p(-2/3)pp21 assuming p is positive. p(64/3) Simplify (g1)(-13)(g(-2/5))(-38) assuming g is positive. g(11/5) Simplify (o/o(-4))/(o/o*(2/7))o(-2/3)/o3 assuming o is positive. o(13/21) Simplify ((g(-1)/g)31)(26/3) assuming g is positive. g(-1612/3) Simplify (j/((j(-1/5)j)/j))/j(-2)j*(4/7)/jjj(-6/13)j assuming j is positive. j*(1961/455) Simplify (rr(5/6))(-2/9) assuming r is positive. r*(-11/27) Simplify (n/(n(((n/(n/n(-7/3)))/n)/n)/n))(1/19) assuming n is positive. n(16/57) Simplify (h1/(h*(-2/9)h))(-11) assuming h is positive. h(-22/9) Simplify ((uu/(uu(2/7)))/u(-10))(16/5) assuming u is positive. u(240/7) Simplify ((v/(v/((v/(v/(v(v(-20)v)/vv)v))/v)))/v)/(vv16) assuming v is positive. v(-38) Simplify (s(-1/2)/((s/(s/(sss(-2/9)))s)/s))/(s*4s(1/10)) assuming s is positive. s(-287/45) Simplify (ss/s20)/s(1/17) assuming s is positive. s(-307/17) Simplify bb(((b((b/(((bb(-1)/b)/b)/bb))/b)/b)/b)/b)/bbbb/b(-11)b assuming b is positive. b*16 Simplify (nn(-3/5))(3/32) assuming n is positive. n(3/80) Simplify ((l/(l/l6l))/l)(-48) assuming l is positive. l(-192) Simplify (f/(f/(f(-1/2)/f)))9/((f/f(-3/4)ff)/fff/(ff*(-7)f)) assuming f is positive. f(-93/4) Simplify (s1)43 assuming s is positive. s43 Simplify (r/(rr(3/10))rr)/(rrr(1/4)rr) assuming r is positive. r(-51/20) Simplify (tt(-9/10))/(t(-44)/t) assuming t is positive. t(451/10) Simplify n(2/9)n(-2/71)/n assuming n is positive. n(-515/639) Simplify ((i/(((i/(i20i)i)/i)/i))/i)/i(22/5) assuming i is positive. i(83/5) Simplify h(4/5)h(h(-1/4)/hh)/hhhh/(hh/(h/(h/(h/h*0)))h)hh/(hhh(3/2)) assuming h is positive. h(1/20) Simplify (ff(2/51))(-37) assuming f is positive. f(-1961/51) Simplify (o(-2/9)/o3)(-11/5) assuming o is positive. o(319/45) Simplify (u/u(-28)u)(-7) assuming u is positive. u(-210) Simplify (a*21a)/aa(1/20) assuming a is positive. a(421/20) Simplify (jj(-1/2))/j1j(-5)j(-5) assuming j is positive. j(-21/2) Simplify (o/(o*(-1/62)o))(-2/105) assuming o is positive. o(-1/3255) Simplify (jj(-1/14)/j)/(jj/((jj/(j/j7))/j))(j/j9)/(j(2/13)jj) assuming j is positive. j(-951/182) Simplify y(-23/3)/((yy28/y)/y) assuming y is positive. y(-104/3) Simplify (j(-5))(-50) assuming j is positive. j250 Simplify (m(2/9)m(2/9))/(m(-1/2)mm(-6)) assuming m is positive. m(107/18) Simplify (s/(ss6)s*(2/3)s)(-44) assuming s is positive. s(572/3) Simplify s*(-17)s/(s*(-10)s) assuming s is positive. s(-7) Simplify (s5)(2/11) assuming s is positive. s(10/11) Simplify ((y/y3)/y(-2))(-3/4) assuming y is positive. 1 Simplify (r(2/11)/(r/r*(-12)r))19 assuming r is positive. r(-2888/11) Simplify (yyy*1y)*(-2/67)(y/(y/y*7y))/yyyy/(y(2/17)y)y assuming y is positive. y(8842/1139) Simplify (v/v31)/(vv/((v(v/(v21v))/v)/v)v) assuming v is positive. v(-55) Simplify ((b(5/3)b)/(bb(-2)))/(b(2/5)b(b/((b(-1/4)/bb)/b))/b) assuming b is positive. b(61/60) Simplify (m/(m(2/3)/m)m)(-8/7)mm(-10)(m/m(3/2))/m assuming m is positive. m(-79/6) Simplify (b6)(-24) assuming b is positive. b*(-144) Simplify (gg*(-8)g*3)/(gg*(-1/2)g)(1/22) assuming g is positive. g(-179/44) Simplify (aa(-2/25)(a/(aaa(-1/9)/a))/a)(-1/20) assuming a is positive. a*(-7/4500) Simplify (zz(11/3))/(z(-8)z) assuming z is positive. z(35/3) Simplify ((ww/(www(-1/2)/w))(-13))**(-1	{ "pile_set_name": "DM Mathematics" }
Solve 0 = -ud + 3 - 0 for d. 1 Let o be 1 - -1(3 + -1). Suppose 0 + 3 = ol, 2l = -k + 49. Suppose 0 = 2w + 4q - 7q - k, -5w + 95 = -3q. Solve -3h - h = w for h. -4 Let t = -110 - -44. Let h = -58 - t. Solve 4n + h = -0n for n. -2 Let z = 3 - 2. Let x(v) = v + 11. Let w be x(-6). Let q(j) = 5j3 + 111j*2 - 91j + 29. Let f be q(-23). Solve f = wl + z for l. 1 Let i(h) = 3h + 4. Let t be i(-2). Let q = t - -6. Suppose d = -2y + 7, -y + 15 = -6y + qd. Solve -y = 4x + 3 for x. -1 Suppose -5b + 18 - 8 = 5a, -4b + 14 = 5a. Suppose -aw = 11w + w. Solve wh = 5h - 20 for h. 4 Suppose 24 = 4w + 16. Solve 11 = wx + 19 for x. -4 Let r be (-1)/4502. Let x = r + 45. Solve x = 5d - d for d. 5 Let c be (-2 - (2 + -4))/(-3). Let t = -4 + 6. Suppose 2q + to - 20 = -cq, -2o = -3q + 5. Solve 0b - 10 = -qb for b. 2 Suppose 2h + 3h + 5d = 55, -4d + 18 = 2h. Suppose -hf = 17 - 82. Solve 8u = fu - 15 for u. -5 Suppose 0 = -5m + 8 + 17. Let z = 12 + -9. Suppose -2 = 6v - 14. Solve -m + v = -zn for n. 1 Suppose 4j = -4v, -3j = -j + 4v. Solve 8n - 4n - 8 = j for n. 2 Let u(j) = 5j - 18. Let m be u(4). Suppose -q = -mk + 6, -17 = -k + 5q - 5. Suppose 2w - 14 = t, -2w + 2t - 17 = -7w. Solve -ka = w + 3 for a. -4 Let o = 1337 - 1334. Solve 2k + o - 7 = 0 for k. 2 Let z(m) = m*2 + 34m - 336. Let a be z(-42). Solve af - 8f = 32 for f. -4 Let l be (7 - 19)282/(-18). Solve 0 = 7p + 160 - l for p. 4 Suppose -2a - 10 = 5u, -4a - 6u - 10 = -u. Suppose 2m + 5p - 53 = a, 0 = 5m - 5p - 0p - 115. Solve 5w + m = 4 for w. -4 Let v(d) = d*3 + 5d*2 - 7d - 4. Let u be v(-6). Suppose -2o - 2z + 14 = -12, -uo + 31 = z. Let t be o/(-12)(-2)/3. Solve -t - 5 = -2m for m. 3 Let v be ((-2)/(-5))/((-2)/(-10)). Suppose vs + 20 = 3s + 3w, -w + 15 = 2s. Suppose k = sk. Solve k + 1 = g for g. 1 Let w = 61 - 52. Suppose i - w = -2z + 4z, 5 = -i - 5z. Solve 2 - 7 = ig for g. -1 Let c(u) = u*3 - 17u*2 + 5u - 21. Let z be c(17). Let a = 66 - z. Solve h + 1 + a = 0 for h. -3 Suppose -13 = -3b - 5t, 15b - t = 11b + 25. Solve 2q = -12 + b for q. -3 Let z be (-39)/(-1 + 4) - 2. Let c(u) = 17u + 1. Let k be c(2). Let d = z + k. Solve 0w = -5w - d for w. -4 Let n be (-14)/(-21) + 14/6. Let a(t) = -2t3 + t + 3. Let w be a(0). Solve wc + n = -6 for c. -3 Let h be (-3)/(-12) - 11/44. Solve 11w - 20w - 27 = h for w. -3 Suppose -2c - 5j = 15, j + 0j + 3 = c. Solve -9f - 2 + 20 = c for f. 2 Let g(f) = -f*3 - 9f*2 + 22f + 14. Let m be g(-11). Solve -8 + m = -6w for w. -1 Let q(n) = -n3 - 4n*2 + 3n - 1. Let r(a) = 2a3 + 9a*2 - 7a + 3. Let p(x) = 7q(x) + 3r(x). Let y be p(0). Solve yk = -2 - 4 for k. -3 Let m(d) = -4d + 63. Let a be m(15). Solve -af = -63 + 60 for f. 1 Let b(o) = o2 + 5. Let n(x) = x + 19. Let h be n(-19). Let y be b(h). Solve -k = y - 0 for k. -5 Let h(q) = -5q - 31. Let b be h(-7). Suppose bj = 2r - 0r, 4j = 5r. Solve j = -3m + 2m + 2 for m. 2 Let n = 6 - 4. Suppose -6s + 2s + n = -3w, 3s = -3w + 12. Suppose 0f = -m - wf - 7, 3m - 5f - 23 = 0. Solve 3 = -2t + m for t. -1 Let q be (4 - 0) + 5/(-10)2. Solve 2u = -qu + 10 for u. 2 Suppose 5m = -4u - 867, 5m + 5u + 61 = -804. Let p be 1/(-2) - m/(-14). Let s = p - -15. Solve -s = g - 0g for g. -2 Let m be ((-365)/(-146))/((-2)/(-16)1). Solve x + m = -4x for x. -4 Let u(c) = -c2 - 10c + 11. Let n be u(-8). Let h = -18 + n. Solve -4r = -r + h for r. -3 Let m(h) = 66h + 34. Let q be m(0). Solve -ql + 35l - 3 = 0 for l. 3 Let a be 51/(-5)-2. Let q be -5 + 3 - 4/(-2). Let d be q(28/(-8) - -4). Solve -ak = -2 - d for k. 1 Suppose 2q = 6q - 68. Let c = 10 - q. Let v be 5 + c + 3 + 2. Solve 0 = -2n + vn for n. 0 Suppose 0 = 91y - 95y + 52. Solve -4 = yr - 15r for r. 2 Let f be 4-1(-80)/64. Solve -fd = -9d - 20 for d. -5 Let v be -12(4 - (-136)/(-32)). Solve v = 4x - 1 for x. 1 Let y = -2133 - -2143. Suppose -12 = -2d - 2d. Let h = 4 - 2. Solve ho - y = -do for o. 2 Suppose 15 = -2b + 15x - 10x, 4x - 12 = 0. Solve b = -0r - 5r + 10 for r. 2 Let a(v) = -12v - 2. Let d be a(-1). Let j be d - ((-16)/28)/(2/(-7)). Solve -4f + j = -0f for f. 2 Suppose 0 = -5n + 21 + 14. Let y be ((-3)/(-3) - -3) + -1. Suppose -4z + 2p + 4 = yp, 20 = -5p. Solve 5 = -zk + nk for k. 1 Let r(q) = q*3 - 6q*2 + 2q + 8. Let o be r(6). Let k = 38 - o. Solve 5d + k = -7 for d. -5 Suppose 0 = 2n + n - 3r - 57, 3r + 27 = n. Solve 0 = 5x - 10 + n for x. -1 Suppose 4l = -3f + 13, 6f - 5f - 4 = -l. Suppose -3m = -3s + 14 - 41, -4s + 18 = 5m. Let k(a) = a - 1. Let c be k(6). Solve -cj = -m + l for j. 1 Suppose 0 = j - 2h + 43, h + h = 0. Let v = -41 - j. Solve -vy + y = -5 for y. 5 Suppose 12v - 27 = 11v - 2s, -3s = 4v - 113. Solve v - 21 = 8t for t. 1 Suppose w - 5 = -0w. Suppose 0 = 3p - wo - 25, 5p - 4o + 13 = 59. Let k be 4/6 - 8/12. Solve k = 5i - 3i + p for i. -5 Let w be (-18)/42 - (-1860)/(-21). Let i = 91 + w. Let y be -51/(-1) - 1. Solve is = -y + 2 for s. -1 Suppose 0 = k - 2k + 2a - 4, 2k + 5a + 44 = 0. Let r be 2/2 - -1 - -18. Let s = k + r. Solve -s - 8 = 4f for f. -4 Let a be ((-3)/(-4))/(13/104). Solve -ai + 11 + 1 = 0 for i. 2 Suppose 2 = -3p + 29. Suppose -7w = -w - 36. Solve 3v + w = -p for v. -5 Let g = 157 - 151. Suppose 4 = 5h - 2x, 0 = -3h + x - 0x + 2. Suppose h = 2k - 8 + 2. Solve ky = -0y + g for y. 2 Let r(m) = 29m*2 + 8m + 6. Let o be r(-1). Solve -4 = -26l + ol for l. -4 Let z = 1257 - 1248. Solve 25 = -zc + 34c for c. 1 Suppose 4 = -2r, -3r = 3u - 0 - 12. Solve uy - 55 = -31 for y. 4 Let q be (-30)/(-5)(-4)/(-8). Suppose -v - qr + 2r = -8, -4r = -v + 13. Solve 7t + v = 4t for t. -3 Suppose -5p - 4 = -4o + 1, -o - 2p - 2 = 0. Suppose o = -3h + 6. Solve -m = hm for m. 0 Suppose g + 3 = 5. Let k = 67 + -73. Let m be (-7)/42 + (-13)/k. Solve 8 = -mj + g for j. -3 Let v(f) = 4f3 - 2f*2 - 3f + 8. Let y be v(4). Let q be ((-1)/4)/((-11)/y). Solve 4z = -q + 13 for z. 2 Suppose -294 = -28r + 210. Solve r = 5j + j for j. 3 Let v be 0(2 - 5/2). Suppose -4 + v = -2w. Let n(f) = -f3 + 14f*2 + 2. Let u be n(14). Solve -us = -s + w for s. -2 Let f be (30/4)/(60/(-24) + 3). Solve -f - 17 = -8l for l. 4 Let f be 1/(((-3)/(1-27))/1). Let i be (-2)/f + 4/(-18)-10. Solve 2w - 3w = -i for w. 2 Let k(h) = -4h*2 - 20h + 5. Suppose -24x = -7x + 85. Let y be k(x). Solve -2o + yo = 12 for o. 4 Let s be 4/(-10) + (-162)/(-5). Suppose -71o - 90 = -74o. Let k = s - o. Solve 18 = -4r - k for r. -5 Suppose -1 - 2 = -z. Suppose -zv + 4 = -0n - 2n, 0 = -2n + 2v. Suppose 6x + 13 - 13 = 0. Solve n = -xm - m for m. -4 Let z = -1826 - -1829. Solve 36 = -11m + z for m. -3 Let g(p) = -2p*3 - 9p*2 + 5p + 2. Let f be g(-5). Suppose 1 = -fw + 9. Solve 0 = -4a - 4 - w for a. -2 Suppose 635t - 627t = 696. Solve 0 = -7o - 22o + t for o. 3 Suppose -2k - 3k = -5t + 25, -2t - 3k = -5. Let n(q) = q2 + 9q - 14. Let c be n(-4). Let f = 59 + c. Solve -f = -ts - s for s. 5 Let a(d) = 4d + 9. Let r be a(-5). Let b(t) = t*2 + 11t + 3. Let g be b(r). Suppose 4x = gx + 2. Solve 3h - 4h = x for h. -2 Suppose -3h + 3 = -2h, 5t + 318 = h. Let b = t - -66. Suppose 0 = 2l - w - 2w - 9, -5l - 2w - 6 = 0. Solve l = 4k + 19 - b for k. -4 Suppose 4r - 12 = 0, 26m - 27m + r + 5 = 0. Solve -mw + 2w - 2w = 0 for w. 0 Let c be (-6)/(-21) - 6/21. Solve c = 6a - 4a - 8 for a. 4 Suppose -905i = -890i - 375. Solve -22g = -17g - i for g. 5 Suppose 2c = w + 118, 4w + 4c + 409 = -3. Let d be 5/(260/(-8)) + w/(-26). Solve -ds = -0s for s. 0 Suppose 4l = -2b + 26, -10l = -5b - 6l + 107. Solve bs + 45 = 34s for s. 3 Suppose 0y = 3a - 2y - 12, 4y = -5a + 20. Suppose 5c = -0c + 15. Let v be 6(1 + c/(-9)). Solve -ai + v = -0 for i. 1 Suppose -8j + 146 = -14. Solve j = 3x + x for x. 5 Let p = 11 + -6. Let m be ((-6)/p)/(20/(-50)). Let o be (-10 - -10)1/m. Solve -d - 2d - 6 = o for d. -2 Let y be 8/(-32) + 26/8. Suppose -yw - 6 = -5w. Suppose -76 = -wl + 4x + 3, -2x - 2 = 0. Solve 2a = 7a - l for a. 5 Let v be (-16)/72 - 120/(-54). Solve 0 = -	{ "pile_set_name": "DM Mathematics" }
(c) -5 (d) 1/1019 (e) 1 (f) 1/3 d Which is the closest to 0.1? (a) -4 (b) -18104 (c) -3 (d) -2/13 d Which is the closest to -0.2? (a) -5.51 (b) -484 (c) -164 a What is the closest to -1 in 0, 3, -4, -21, -14.06? 0 Which is the closest to -63? (a) 37 (b) -0.5 (c) 24 (d) -0.7 d What is the nearest to -122 in 12, -9592, 2? 2 What is the nearest to 48 in 0.1, -3, -9, 23, 12/11? 23 Which is the closest to 0.382? (a) -0.5849 (b) -2/15 (c) -4/3 (d) 5 (e) 1 b What is the nearest to 4/3 in -10, -0.01, 1/7, -338? 1/7 Which is the nearest to 0? (a) -8/7 (b) 3/2 (c) 10.3 (d) 0.06 (e) -1 (f) 2 d What is the closest to 0.1 in 0.5, -3, -14125? 0.5 Which is the nearest to -0.04? (a) 0.2 (b) 22 (c) -0.9 (d) -1 (e) 1/89 e Which is the nearest to -0.1? (a) 1 (b) 1119 (c) 1/5 (d) 0.6 c What is the nearest to 1 in -3, -2/9, -1/7, 1.4, -31354? 1.4 Which is the closest to -1/14? (a) -10 (b) -0.069 (c) -1/7 (d) 2/5 (e) 4/9 b Which is the closest to -3/2? (a) 1 (b) 2537/201 (c) -0.1 c What is the closest to 3/17 in -0.5, -4, 76, 1, -153? -0.5 What is the nearest to 0 in -1, 5/4, 269, -3, -2.4? -1 Which is the nearest to 0.4? (a) 17 (b) 0.109 (c) 254 (d) 2/19 b What is the nearest to -1/29 in -0.3, 0.057, -3, 5.12, 17? 0.057 Which is the closest to 1/4? (a) -2 (b) -2/385 (c) 5 (d) -366.54 (e) 0 e Which is the nearest to 0? (a) -734 (b) 4/3 (c) 10/11119 c What is the closest to 12.22 in 4/5, -6, 18, 4? 18 What is the closest to -1/4 in 0.26, 24.2, 17? 0.26 What is the closest to 4 in -0.1, 1/4, 4, -32966? 4 Which is the nearest to 2/3? (a) 156/5 (b) -1/8 (c) 0 (d) -1/43 c What is the closest to 0 in -37, 1/5, 0.0689? 0.0689 What is the closest to -1/2 in -2/11, 8/3, -0.32, 1, 61, 0.1? -0.32 Which is the closest to 1? (a) 4/7 (b) -3 (c) -0.08 (d) 4 (e) 416 (f) 5.9 a Which is the nearest to 0? (a) 136 (b) 4/63 (c) 0.2 (d) -3 b Which is the nearest to -0.14? (a) -4 (b) 8095 (c) 11 a What is the closest to 137 in 1, 192.68, 0? 192.68 What is the nearest to -0.3 in 1/17, 17/5, 4, -2/45? -2/45 What is the closest to 5 in 155, -16/79, 1/3? 1/3 Which is the nearest to -7? (a) -3/11 (b) -0.3 (c) 11/13 (d) -4/15 b What is the nearest to -5/126 in -3, -1/3, -49/2, 0.13, -1, -4? 0.13 What is the nearest to 0.1 in 8630.84, -6/11, 0.2, 1/4? 0.2 Which is the nearest to -3? (a) 7 (b) -10 (c) -3/2 (d) 5 (e) -0.1 c What is the nearest to -0.5 in -63, -0.08, -10, -1, -4, 27? -0.08 What is the closest to -0.6 in -8987, -2/13, 1, 0.4? -2/13 Which is the nearest to 1? (a) 4/7 (b) 12 (c) -5/6 (d) 65 (e) 31 a What is the closest to -2/329 in 1.1, 2, -4? 1.1 Which is the closest to -2? (a) 1321 (b) 34 (c) -1/2 (d) 0.3 (e) -3 e What is the nearest to 75 in -2, 1899, 1/6, -23/2? 1/6 What is the closest to 1 in -173, 19, -0.7, -13? -0.7 What is the closest to 0 in 0.1, -5/4, -1359? 0.1 What is the closest to 5 in -1/5, -1543/3, 15? -1/5 Which is the closest to 1076? (a) 1 (b) -2/3 (c) 22525 a Which is the nearest to -3/17? (a) -8188 (b) -5 (c) 4 c Which is the closest to -2/17? (a) 5 (b) 0.4 (c) 2 (d) 1/18 (e) 1/5 (f) -1346 d Which is the closest to -0.15? (a) 759 (b) -2 (c) 0.8 (d) 3 c What is the nearest to -2/287 in -3, 0.635, 0.1, -2/11, -5? 0.1 What is the closest to 0.2 in 7, 1, 268036, 5? 1 Which is the closest to 20? (a) 8 (b) 0.3 (c) -74 (d) -6 a Which is the closest to 7? (a) 6 (b) -0.5 (c) -73 (d) -2/5 (e) -1 (f) 29 a What is the nearest to 89.87 in -2, 181, -0.3? -0.3 Which is the closest to 1/3? (a) 3 (b) 0.5 (c) 5 (d) -1/27 (e) -1/739 b Which is the closest to -20? (a) -2.8393 (b) -5 (c) -34/7 b Which is the closest to 4/61? (a) 0.3 (b) -0.0266 (c) 0.6 (d) -0.14 b Which is the closest to -6? (a) -59/4 (b) 5 (c) -1/9 (d) -2/11 (e) 2/49 d What is the nearest to -2/31 in 0, -2/9, 6/71, 17, -2? 0 What is the nearest to -3 in -0.3, -6716, -111.8? -0.3 Which is the closest to 2/67? (a) 89 (b) 0 (c) 10.3 (d) -1/3 b What is the nearest to 2 in 531881/6, -0.1, 5? -0.1 What is the closest to 7 in -1, -0.3, -8.6, -73, -0.5, 0.4? 0.4 What is the closest to 0.2 in -3.77, -1/7, -568, -1, 0.2, -1/2? 0.2 What is the nearest to 9 in 10, 21.03, -3? 10 What is the closest to -0.2 in 0.5, 1.538, -19, -0.4? -0.4 What is the nearest to -1002 in 0.9, -2/11, -2, 5? -2 Which is the nearest to 0? (a) 11/2 (b) 2 (c) 2/5 (d) 7.7 (e) 852 c Which is the nearest to 3? (a) -2.1 (b) 0.0645 (c) 292 b What is the nearest to 0.23 in -40, 0.4, -1/2, -22/79, 4/3? 0.4 What is the nearest to 0.1 in -2/33, -25, -74/45, -0.2? -2/33 What is the closest to 4 in 1258/19, 30, -0.4, -0.08? -0.08 Which is the closest to 0.1? (a) 22 (b) -0.06 (c) -5 (d) 162 (e) -58 b What is the closest to -3 in 2/7, -3104, -29, -21? 2/7 Which is the closest to -554/5? (a) -7/2 (b) -2.1 (c) -5 c What is the closest to -0.019 in -2, -4/7, -6/23, -445, -4/9, -1/2? -6/23 Which is the nearest to 2/7? (a) 22 (b) 4 (c) 6 (d) -0.1 (e) -4 (f) -1356 d Which is the closest to 2/5? (a) 0.5 (b) -1/3 (c) 9.169 (d) 0.08 (e) 267 a Which is the closest to 130? (a) -5/4 (b) 3 (c) -4 (d) 5/2 (e) -0.5 (f) 4 f What is the closest to -11 in -2/3, -2.5038, -4? -4 What is the nearest to 121 in -0.02, 0.15, 25? 25 Which is the closest to 1? (a) 1456.4 (b) -1/4 (c) -25 (d) -5 b What is the closest to 3 in -0.4, 1/7, -4/18015, 5, -2? 5 Which is the closest to -2? (a) 49 (b) 527268 (c) 0.4 c What is the closest to -15020 in -4, -4/7, -111, 5? -111 Which is the closest to 103? (a) 1/4 (b) -4 (c) -0.5 (d) -13 a What is the closest to 1851 in 2, -2/7, 3, 42, 4, -0.7? 42 What is the nearest to 509 in 63/8, 5, 35/8? 63/8 What is the closest to -81 in 1/3, -4, 75, 0.23, -3? -4 Which is the nearest to 0.1? (a) 7 (b) 11/10 (c) -2/33 (d) 5 (e) -1.4 c Which is the nearest to 2913? (a) -1/6 (b) -29 (c) 1 c What is the nearest to -10238 in -5, -1/6, 13? -5 Which is the nearest to -129? (a) 24.87 (b) -3/14 (c) 4 (d) 0 b Which is the closest to 2/13? (a) 3 (b) 1499752 (c) -1/5 c What is the closest to 1/4 in 2, 0.1, -4, 1040, -2/7? 0.1 What is the closest to -4 in 0, 0.1, 2/3, -1407? 0 What is the nearest to -4 in 2, 1, 31430? 1 Which is the closest to 1/4? (a) -0.5 (b) -18374 (c) 176 a What is the nearest to -10 in 266, -3/10, 101? -3/10 What is the nearest to 0 in 0.3, 1/5, -1/2, 2/31541, 14? 2/31541 What is the closest to 0.1 in 4, -465, -0.98, 9, -3/2? -0.98 What is the closest to 2/3 in -1/7, -33430, 2/185? 2/185 What is the nearest to -109 in 43.7, 1/74, -31? -31 Which is the nearest to 1/3? (a) 5 (b) 1/5 (c) 2 (d) -0.2 (e) 69 b What is the closest to -2 in -1462/93, 0.3, 0.1? 0.1 What is the closest to -12 in -5, 131, 21225? -5 Which is the closest to -0.1? (a) -153428 (b) 0.1 (c) 3/4 b Which is the closest to -18/55? (a) -168 (b) 4 (c) 0.2 (d) -1/1104 d What is the nearest to -139 in -3, 366/7, 4, -99? -99 Which is the closest to 1? (a) -1/168098 (b) 1/2 (c) 1 (d) 2/5 c What is the nearest to -6/11 in -1, -2, -110, -37/4, 0.5? -1 What is the closest to 1/2 in -1764, -5/2, -202/11, 3, 1? 1 What is the closest to 0 in 1/7, 337/394, -14, 0.2, 3/8? 1/7 Which is the closest to -5? (a) -1/15 (b) -0.463 (c) 0.5 (d) 2/3 (e) 5 b What is the nearest to 247 in -0.07, 0.05, 3, -0.06, -24? 3 What is the closest to 0.01 in 7, 3, 3/7, -83, 2? 3/7 Which is the closest to 2/5? (a) 1 (b) -380 (c) -2/13097 (d) -1 c What is the closest to -975 in 5, 4, -4/3, 13? -4/3 What is the closest to -0.1 in 2/15, -12, 1/3, 5, -0.414, -0.1? -0.1 What is the nearest to 0 in -2, -33/5, -0.12? -0.12 What is the nearest to 1/2 in -2/689, 0.17, -4? 0.17 What is the nearest to -1/3 in -2, -1, -4012, 673? -1 Which is the closest to 22? (a) 0.3 (b) -1 (c) 1 (d) -0.1 (e) 0.1 (f) 7700/19 c What is the closest to -19 in -0.04, 3, -2/5, -0.03, 2/7? -2/5 What is the nearest to 0.03 in -0.1963, -0.02, -0.5, 12/5, -2/11? -0.02 Which is the closest to 3? (a) -1/5 (b) -18 (c) -3 (d) -7/118 (e) -1/11 d What is the nearest to -0.06 in 3, 0.25, 0.3, 2/9, 0.35, -10? 2/9 Which is the nearest to -3? (a) -0.1 (b) 0.3 (c) -0.01 (d) -13 (e) -39 (f) -113 a What is the nearest to 8367199 in 6, 3,	{ "pile_set_name": "DM Mathematics" }
0 (b) -1/2 (c) -4 (d) u c Let d = -74783/9 - -8309. What is the closest to -2 in -5, d, -3/7? -3/7 Let o = -16 + 36. Let i be 10/o3/12. Let t = -22.2 + 19.2. What is the closest to t in i, 2/3, 3/4? i Let y be (30/45)/(-6 - (-130)/15). Let v = 1.1 + 0.3. Let p = v + -0.4. Which is the nearest to p? (a) 0.4 (b) -2 (c) y a Let u = -1.5 + 1. Let l = 0.1323 + 8.2577. Let m = l - 8.09. Which is the closest to -1? (a) u (b) m (c) -0.1 a Let w = -5158 + 5161. Which is the closest to 0.8? (a) w (b) -0.2 (c) 4 b Let w be 2/((-16)/12(3 - 6)). Let n(l) = -l*3 - 5l*2 - 3l - 3. Let q be n(-5). Suppose -qp + 7p = 0. Which is the closest to p? (a) -1 (b) 2 (c) w c Let n = 5276 - 5276.1. Which is the nearest to n? (a) -57 (b) 0.8 (c) -4 b Let h = 0.04619 - 0.04619. Which is the nearest to h? (a) -4 (b) -3 (c) 47.2 b Let g be 0 + (-102)/140 - 189/(-441). Which is the closest to -1/5? (a) g (b) -2 (c) -3 a Let p be ((-49)/21)/(-2(-4)/8). Which is the nearest to p? (a) 33 (b) -4 (c) 0.4 b Let s be (-9)/1 + (-25 - -31) + (1 - -5). What is the nearest to 13 in -10, s, 0.1? s Let n = -7/76 + -3/19. Let m = -0.6547 - 0.1453. Let s = -0.8 + -0.2. Which is the closest to n? (a) s (b) m (c) 5 b Let j be 4616/(-22) - (-8)/(-44). Let g = j + 208. Which is the nearest to -1? (a) g (b) 1/3 (c) -2/3 c Let d be ((-3)/(-2))/(3/2). Let p be d + (18/(-10))/3. Let x = -0.02 + 0.12. What is the nearest to 2 in 5, x, p? p Let p = 5.654 + -5.7. Let u = p + -56.954. Let y = -61 - u. What is the nearest to y in 1, -5, 0.1? -5 Let o = -30610667/573155 + -744/6743. Let k = o + 267/5. What is the closest to 2/9 in 9, 3, k? k Let o(u) = -u3 + 7u*2 - 4u - 16. Let j be o(6). Let s be (3j/72)/(12/(-8)). Which is the nearest to s? (a) -0.1 (b) 5 (c) 6 a Let d be (109/12)/(-1 + 0). Let i = 35/4 + d. Let k = -0.9879 - -7.9879. Which is the closest to i? (a) k (b) -0.3 (c) -2 b Let a = -4445 - -4448. What is the closest to a in 0.2, 9.5, 4? 4 Let p be ((-8)/(-14))/(-18 + (-3000)/(-168)). Which is the closest to 0.049? (a) 1 (b) 3 (c) p a Let t(c) = -c3 - 12c*2 + 33c + 66. Let n be t(-14). What is the closest to n in 1, 0.04, -102? 0.04 Let u = 2942 + -2943. What is the closest to u in 0, 0.1, 2/19, 1.1? 0 Let u = -19/31368 - -8918981/17283768. Let s = u + -18/29. Which is the closest to 0.1? (a) -4 (b) s (c) -0.4 b Let j(t) = 3t3 - 3t3 + 1 + t3. Let n be j(0). Let i = -39341 + 39340. What is the closest to i in n, -0.2, 3? -0.2 Let q = 0 - 0.2. Let d be 115(-3)/(-9). Suppose -dr = -6r + 4g + 1, -4r + g = -4. Which is the closest to -1? (a) q (b) -4 (c) r a Let i = 29/6 + -16/3. Let g = -4304 + 4301. Which is the closest to g? (a) i (b) 1/5 (c) 2/5 a Let f = -11.933 + 12.433. Which is the closest to -1/4? (a) -4 (b) f (c) 1335 b Let g = 5.3 - 5.8. What is the closest to -0.5 in g, -3, 3/5, 4? g Let n = 7204 + -7203. What is the nearest to 1/4 in 1.7, n, -5, -2/19? -2/19 Let g = 13.4 + -13.97. Let p = -0.57 - g. Let d = 0 + 0.1. Which is the nearest to -1? (a) d (b) p (c) 3 b Suppose -92f + 23f + 345 = 0. Which is the closest to -2? (a) f (b) -0.1 (c) 1 (d) -3 d Let l = -495.6 + 488.6. Let v = -1.6 + 2.1. Which is the closest to 1? (a) v (b) l (c) -0.4 a Let o = -129.96 + 130.96. Let t be 8/(-6)(-6)/(-24). What is the closest to o in -30, t, 0, -3? 0 Suppose -128h + 36h - 368 = 0. What is the nearest to -0.49 in -3/8, h, -1/2? -1/2 Suppose -3r = 3o + 6, 5r - 16 - 9 = 2o. What is the nearest to -0.05 in -5/6, o, -2? -5/6 Let o = -4.33 - -0.33. Let v = -494 + 494.1. What is the closest to v in 0.02, o, 2/5? 0.02 Let o = -16260 + 16258. What is the closest to -0.1 in -1, -0.3, -1/34, o? -1/34 Let s = -168 + 23. Let p = s - -62. Let k = p - -93. Which is the nearest to k? (a) 1/4 (b) 5 (c) -3/4 b Let l be -11 - (-14)/14(-4 - -8). Which is the nearest to l? (a) -0.5 (b) -3 (c) 26 (d) -0.8 b Let n(t) = 12t2 - 2t - 1. Let a be n(-1). Let h = 5310 - 5288. Suppose -h = -7c + a. What is the nearest to 1 in -5, c, 0.2? 0.2 Let h = -601.9 + 596.9. Which is the closest to 1/5? (a) -2 (b) -2/5 (c) h (d) 1 b Let s = 2421 - 31467/13. Let d(k) = k + 2. Let h be d(2). What is the closest to s in 2/5, h, 0.5? 0.5 Let n be (-10 - -4)(-12)/9. Let t be (11/(-66))/(n/(-12)). What is the nearest to -0.4 in t, 1, 0.3? t Let h(x) = -x*3 + 2x*2 - 2x - 1. Let d be h(2). Let w be 69/(-21) - (-30)/10. Which is the closest to -2/11? (a) d (b) -1/8 (c) w b Let p = -312406/9 - -34712. Let r be -2 - (1 - 66/21). Let f be 3/(-12) - (-10)/24. Which is the nearest to -2/9? (a) f (b) p (c) r c Let y = 739/107 - 4444/535. Let n(b) = b - 7. Let t be n(4). What is the nearest to 1 in t, y, -2/21? -2/21 Let v = -125067/4 + 31267. What is the nearest to 2/365 in -1, -2, v, 0.3? v Let t = -17.7 - -18. Let d(j) = -j*3 + 7j*2 + 9j + 4. Let o be d(8). Let w be 2/((o/8)/(2/(-4))). Which is the closest to w? (a) t (b) 5 (c) -0.2 c Let g = 0.445 - 4.535. Let s = g + 3.95. Which is the nearest to -1? (a) s (b) 3 (c) 10 a Let o = 33.069 - 33.069. What is the closest to -8 in -1/7, o, 36, 1? -1/7 Let s = 95 - 22. Let t = s - 46. Let z = t - 24. Which is the nearest to -0.2? (a) z (b) -0.03 (c) -0.1 c Let l = -233 + 237. Let r = 0 - -0.2. Let n = -5.5 + 5. What is the closest to -3 in n, r, l? n Let t = -10.039 - 4.961. What is the closest to 3 in -5, 0.08, 0.1, t? 0.1 Let k = -2 + 7. Let h = -12918 + 12880. Which is the closest to -0.1? (a) -3 (b) k (c) h a Let z = 65 - -1. Let v = 66.3 - z. What is the closest to 0 in -2/15, -2/11, v? -2/15 Let o be 996/41510/6 - (-180)/(-35). What is the nearest to -0.1 in o, -2, 2? o Let z = 50 + -46. Let w = -18191/21 + 866. Let q = w - 3/7. What is the nearest to 3 in q, -0.03, z? z Let r = -13/333 + 24853/653679. Let t = r - 3920/5889. Let l = -0.02 + 0.32. What is the nearest to l in -1/3, -1/7, t? -1/7 Let x = 11.89 - -0.11. Let c = -1987/40 - -249/5. What is the closest to -0.1 in c, x, 2/11, -1? c Let p = -307 - -311. Let w be 29/(-261) - p/18. What is the closest to 0 in 0, -11/4, w? 0 Let q = 1893 + -1894. What is the closest to -4 in 2, 5.5, q? q Suppose 2y = 4t - 6, 5y + 0t - 27 = -4t. Let u = -269603/5 - -54127. Let q = -206 + u. Which is the nearest to q? (a) 0.2 (b) -2 (c) y a Let h be 15(8/(-6) - -1) + -61. Let i be 10/122 + 44/h. Let j be (-1)/2 + (-9)/(-10). Which is the nearest to i? (a) -1 (b) -5 (c) j c Let k = -0.2283 - 0.0717. Let x = -0.05 + -1.95. What is the nearest to -2/5 in k, -1, x, 6/11? k Let q = -90.307 + -1.593. Let m = q - -92. Which is the closest to 0? (a) 2/5 (b) -57 (c) m (d) 5 c Let n = -2016.8 + 2017. Let q = 2 + -1.98. Which is the nearest to 2/7? (a) -2/7 (b) q (c) -1/6 (d) n d Let q be 325/9750((-2)/6 + (-26)/(-6)). Which is the closest to -1? (a) q (b) 1/2 (c) 2 (d) 1/111 d Let y(l) = 38l + 804. Let o be y(-21). Which is the closest to 1? (a) -1/3 (b) 455 (c) o (d) -3 a Let u = 8 - 11. Let v = -465 + 310. Let x = v + 157. What is the nearest to -1/5 in 2/3, u, x? 2/3 Let n = -2.3 - 0.7. Suppose 2 = -2a + 4. Let p = 9670.98 - 9671.18. What is the nearest to a in p, -0.5, n? p Suppose -z + 3s - 1008 = -5z, -8 = 2s. Let r = z + -251. Let g = 0.1 - -0.3. What is the nearest to -0.4 in g, r, -3/11? -3/11 Let j = -4.706 + 8.106. Which is the closest to j? (a) -2 (b) -11/2 (c) 0.6 c Let k(f) = -f*3 - 27f*2 + 124f - 5. Let s be k(-31). Let t = -3.3 + 9.5. Let j = t - 6. What is the nearest to 0 in -6, s, j? j Let t be (-236)/(-6726) + (-1820)/(-114). What is the nearest to t in -1, 2/5, 0.76? 0.76 Let i = -0.117 + 0.317. Let z = -0.3 - 1.7. Let p = 41.2 + -41. What is the closest to p in i, z, 3? i Let h = 2 + -1.4. Let d = -0.3 + h. Let f = -0.47874 - -0.57874. What is the nearest to 7 in -2/11, f, d? d Let z = 480 + -2885/6. Which is the closest to -2/3? (a) z (b) 5 (c) -1 (d) -1/8 a Suppose -3f + 2u = 2144, -4f - 2828 = 5u - 0*u. Let j = -8551/12 - f. Let k = 1/4 + j. Which is the closest to 0? (a) 1 (b) 2/3 (c) k c Let r = 3753 - 3752.9. Let l = 21/20 - 4/5. What is the nearest to 0.1 in 4, -0.1, r, l? r Let h = 0.134 - 0.334. Let r = -15.6 - 54.4. Let s = r + 70. W	{ "pile_set_name": "DM Mathematics" }
scending order. -84, -5, 63, 73 Put 49, 0.5, -30, -0.1, -6, 41 in decreasing order. 49, 41, 0.5, -0.1, -6, -30 Put 144, 1, 2/11, 47062 in increasing order. 2/11, 1, 144, 47062 Put 0, -5, 16, 5, 8, 79, -3 in increasing order. -5, -3, 0, 5, 8, 16, 79 Sort -6136, 862, -5. -6136, -5, 862 Sort 171, 8, -462 in decreasing order. 171, 8, -462 Put -619074/5, -8/7, 0 in decreasing order. 0, -8/7, -619074/5 Sort -18/5, 12, 4, -1/3, -2 in descending order. 12, 4, -1/3, -2, -18/5 Sort 2, -226, -3, -16068, -2. -16068, -226, -3, -2, 2 Sort 3/8, -1.5, 0.016, 46.642, -5. -5, -1.5, 0.016, 3/8, 46.642 Sort 4, -3, -13, -14954, -1, 1, 11. -14954, -13, -3, -1, 1, 4, 11 Sort 1, 18, 119, 69 in descending order. 119, 69, 18, 1 Put 31, -2, 1, 7, -301, -4 in decreasing order. 31, 7, 1, -2, -4, -301 Put -2861, 76392, -4 in increasing order. -2861, -4, 76392 Sort 3, -1295, 3192, -4 in descending order. 3192, 3, -4, -1295 Sort -73, 0.06, 0.01034, -1 in ascending order. -73, -1, 0.01034, 0.06 Put 56, -5, 144543 in descending order. 144543, 56, -5 Put -29753, -0.015, 0.5 in ascending order. -29753, -0.015, 0.5 Sort 4, -279, -6418 in decreasing order. 4, -279, -6418 Sort -1378153, -4, -34 in descending order. -4, -34, -1378153 Sort 53, 4, -260704 in decreasing order. 53, 4, -260704 Sort -48, 8873, -1, 14 in increasing order. -48, -1, 14, 8873 Put -4714, 1, -2, -25 in descending order. 1, -2, -25, -4714 Put 3, 34, 18, -2228, -13 in increasing order. -2228, -13, 3, 18, 34 Sort 4, -4, -5, -1563124 in increasing order. -1563124, -5, -4, 4 Sort -10, -35, -9, 2, -4, 4 in ascending order. -35, -10, -9, -4, 2, 4 Put -260, 30, -12, -4, 3, -1, -3 in increasing order. -260, -12, -4, -3, -1, 3, 30 Put 1, -145, 0, -1, -128, 5 in decreasing order. 5, 1, 0, -1, -128, -145 Put -4, 1/4, 16.98, -105, -0.3 in ascending order. -105, -4, -0.3, 1/4, 16.98 Sort 0, -42, 4, 2, 8, -5, 63 in increasing order. -42, -5, 0, 2, 4, 8, 63 Sort 5, -1/6, -9, -33, -294 in increasing order. -294, -33, -9, -1/6, 5 Sort 2404, 0.2, -18/119 in descending order. 2404, 0.2, -18/119 Sort -3, 70, 25, -24, -2, 1 in increasing order. -24, -3, -2, 1, 25, 70 Put -24, 6, 39037 in increasing order. -24, 6, 39037 Sort -3, 2, -47, 1, 0.3, 292/31 in increasing order. -47, -3, 0.3, 1, 2, 292/31 Sort 14, 1, -28, -3, 24, 55 in decreasing order. 55, 24, 14, 1, -3, -28 Sort 3, -29, 6, 5, -5, 4/43. -29, -5, 4/43, 3, 5, 6 Put 139/3, 0.09, 7.12, 1, -0.5, -4 in descending order. 139/3, 7.12, 1, 0.09, -0.5, -4 Sort 188, -2, -13, -4, -14, -5 in increasing order. -14, -13, -5, -4, -2, 188 Sort -1016632, -2, 1 in descending order. 1, -2, -1016632 Put 3, -7, 4, -3, 0, 2 in descending order. 4, 3, 2, 0, -3, -7 Sort 1.04, -1.204713, -2 in ascending order. -2, -1.204713, 1.04 Sort -4, 12, 0.5, 2002, 63 in ascending order. -4, 0.5, 12, 63, 2002 Sort 21425, -21.2, -0.2 in ascending order. -21.2, -0.2, 21425 Put 4010, -3, -2, 24 in descending order. 4010, 24, -2, -3 Put 1064, 64, -0.046 in decreasing order. 1064, 64, -0.046 Sort 3, -14360, 8, -3 in descending order. 8, 3, -3, -14360 Sort -2, -135/137, 1.74 in descending order. 1.74, -135/137, -2 Sort -3, -360, -1, -514, -14, 5, -4 in descending order. 5, -1, -3, -4, -14, -360, -514 Sort -46505, -4, -21, -5, 1 in decreasing order. 1, -4, -5, -21, -46505 Sort 1/10, 0.05, 5/2, -3631/8 in decreasing order. 5/2, 1/10, 0.05, -3631/8 Sort -887, 7016, 1. -887, 1, 7016 Put -9/7, 1/48, 1/3, 2/5, -24.2 in increasing order. -24.2, -9/7, 1/48, 1/3, 2/5 Sort -3, -90/3421, 47/5, 3/23 in descending order. 47/5, 3/23, -90/3421, -3 Sort -1051, 1/2594, 1/4 in increasing order. -1051, 1/2594, 1/4 Put 65, 5, 0, -1367 in increasing order. -1367, 0, 5, 65 Put -4, -485, -693 in ascending order. -693, -485, -4 Sort 0.1, -958, 8/5, -2/19, 7. -958, -2/19, 0.1, 8/5, 7 Sort 2.8, -1.1205, -5/41 in decreasing order. 2.8, -5/41, -1.1205 Sort -187, 2, 0, -29, 5, -6 in ascending order. -187, -29, -6, 0, 2, 5 Sort -12, 11664, 107, 0.2 in decreasing order. 11664, 107, 0.2, -12 Sort -302, 0, 6949, 17 in descending order. 6949, 17, 0, -302 Sort -3.2, -77, 0.4, 0.19 in descending order. 0.4, 0.19, -3.2, -77 Sort 9179, -469, -2 in decreasing order. 9179, -2, -469 Put -238, 0.09, -48, 8, 5, 1/4, 2 in decreasing order. 8, 5, 2, 1/4, 0.09, -48, -238 Sort 50/17, 72/5, 326 in decreasing order. 326, 72/5, 50/17 Put 242376, -3, -18, -5, 5 in ascending order. -18, -5, -3, 5, 242376 Sort -2/17, 18, 0.21, -4, 1447, 0 in decreasing order. 1447, 18, 0.21, 0, -2/17, -4 Put 17, 7589, 0, -1, 5 in decreasing order. 7589, 17, 5, 0, -1 Sort -20, 4, 24, 3, -1, -4, -7. -20, -7, -4, -1, 3, 4, 24 Sort -3, -2554, -4, 9, 3 in decreasing order. 9, 3, -3, -4, -2554 Sort 6, 86, -10666 in ascending order. -10666, 6, 86 Put 1, -15426, -1206 in increasing order. -15426, -1206, 1 Put -0.4, 2/7, -39993, -2, 18, 2 in ascending order. -39993, -2, -0.4, 2/7, 2, 18 Sort 28, 88, 12187 in descending order. 12187, 88, 28 Put 11, 4, -18, 2, 3, 5/2309 in ascending order. -18, 5/2309, 2, 3, 4, 11 Sort 2, -8, 11.39, 312, 4/3 in decreasing order. 312, 11.39, 2, 4/3, -8 Sort 14, 4, -11, 6, -25 in increasing order. -25, -11, 4, 6, 14 Put -302/25, 1, -16 in increasing order. -16, -302/25, 1 Sort 5, 11480, -5, -0.086, -49. -49, -5, -0.086, 5, 11480 Put 7, 1168, 1, 2 in decreasing order. 1168, 7, 2, 1 Put 3253, 8/5, 2/9, -0.01 in descending order. 3253, 8/5, 2/9, -0.01 Sort 1, 2, 0, -3422, -5. -3422, -5, 0, 1, 2 Sort -1, -2, 1082556 in decreasing order. 1082556, -1, -2 Put 3, 99, 5, -425045 in ascending order. -425045, 3, 5, 99 Put 0.0488, 2/241, 0, -18 in descending order. 0.0488, 2/241, 0, -18 Put -307915, -6, -2/9, 3 in decreasing order. 3, -2/9, -6, -307915 Sort -4, 5, -5807889, 3 in ascending order. -5807889, -4, 3, 5 Sort 5610, -931, 3 in descending order. 5610, 3, -931 Sort 274015, 1284, -2/3 in decreasing order. 274015, 1284, -2/3 Sort 26932, 4, 624. 4, 624, 26932 Sort 18, 1/295, 1/5, 0.31 in decreasing order. 18, 0.31, 1/5, 1/295 Sort 2/5, -2/3, 60, 0, -5 in decreasing order. 60, 2/5, 0, -2/3, -5 Sort -5, 1340062, 0.2. -5, 0.2, 1340062 Put 11/5, -76/571, 1/22 in decreasing order. 11/5, 1/22, -76/571 Put -71, -14, 2908 in increasing order. -71, -14, 2908 Put -1/5, 67, 3/8, -1/4, 3, -7 in decreasing order. 67, 3, 3/8, -1/5, -1/4, -7 Put 0, -7, -3825, -5, -12 in ascending order. -3825, -12, -7, -5, 0 Sort -262.78, 0.3, -5, 0.0116 in decreasing order. 0.3, 0.0116, -5, -262.78 Put 30, 26, 4, 3, -1, -3 in descending order. 30, 26, 4, 3, -1, -3 Sort 3/8, -1/46, 10, -0.2, -4, 4/45 in increasing order. -4, -0.2, -1/46, 4/45, 3/8, 10 Sort 18, -3, -4, 888, 21 in ascending order. -4, -3, 18, 21, 888 Sort 110, -4, -5, -52, -3, 289 in increasing order. -52, -5, -4, -3, 110, 289 Put -0.1, -3, 0.1, -18/319, 67 in descending order. 67, 0.1, -18/319, -0.1, -3 Sort -3, 5, -4, -2752647. -2752647, -4, -3, 5 Sort 14/277, -2/11, -4.57 in descending order. 14/277, -2/11, -4.57 Put -6927, -10, -1650 in ascending order. -6927, -1650, -10 Sort -1, 5, 429998, 323 in increasing order. -1, 5, 323, 429998 Put 3, -32, 82, -2, -4, -7, 1 in decreasing order. 82, 3, 1, -2, -4, -7, -32 Sort 9, 17, -2, 2477 in descending order. 2477, 17, 9, -2 Put 5, -23, -1, -0.2, 817, -0.33 in ascending order. -23, -1, -0.33, -0.2, 5, 817 Sort 11.5, 0.4694, -57 in decreasing order. 11.5, 0.4694, -57 Sort -13, -2, -4, -1/3, -14, -23/49 in increasing order. -14, -13, -4, -2, -23/49, -1/3 Sort 74, 127, 2, -2, 4, -1 in ascending order. -2, -1, 2, 4, 74, 127 Sort -186/37, -1/12, -1/58, 1/4. -186/37, -1/12, -1/58, 1/4 Put -9361, -0.01, -0.034, -2/3 in descending order. -0.01, -0.034, -2/3, -9361 Put -2, 10, -6, 0.2, 6, 168 in increasing order. -6, -2, 0.2, 6, 10, 168 Sort -11, 71, 1, -5, 32100. -11, -5, 1, 71, 32100 Put 1, -27, -1, 5, 1274, 10 in increasing order. -27, -1, 1, 5, 10, 1274 Sort 140277, -26, 3, 5, -2 in ascending order. -26, -2, 3, 5, 140277 Sort -558, 0, 1, 3, 32. -558, 0, 1, 3, 32 Put 22769, 0.4, 3, -0.1346 in increasing order. -0.1346, 0.4, 3, 22769 Sort -333, -1, 19, -30. -333, -30, -1, 19 Sort -5, -13, 5, 9, 391, -2, 0. -13, -5, -2, 0, 5, 9, 391 Sort 52, -1, 70, 4, -3, 6 in decreasing order. 70, 52, 6, 4, -1, -3 Sort 37, -3, -86542. -86542, -3, 37 Sort 3, -2, -1341204, -19. -1341204, -19, -2, 3 Put 15/26, 0.11	{ "pile_set_name": "DM Mathematics" }
1185 - 4? 1181 What is 25.842 less than 0.01? -25.832 Sum -6 and 45.56. 39.56 Put together -4 and 52700. 52696 -8.9 - 0.0585 -8.9585 Put together 0.2 and 254734. 254734.2 What is 0.4 less than -4893631? -4893631.4 What is 325 + -550? -225 -1 + 2208 2207 Add 807897 and 5. 807902 What is 0.2 plus -130.477? -130.277 -1.1 + 0.027 -1.073 What is -0.5 - -341? 340.5 What is the difference between -13.184 and 0.029? 13.213 What is 0.66 - 0? 0.66 -0.05465 - 769 -769.05465 Work out -25178.8 + 0.2. -25178.6 Subtract -187 from 5. 192 What is the distance between -35 and -0.0534? 34.9466 Sum -19969 and -98. -20067 What is 3 take away 961? -958 What is -0.5 minus 3.611? -4.111 Add together 96 and 15.972. 111.972 What is -0.1 minus 18987.2? -18987.3 Total of -0.12 and 0.1816. 0.0616 What is -10297 take away 3.2? -10300.2 Add 0.00301 and 48. 48.00301 Add together -0.5 and -50.3. -50.8 -0.2 + -3326983 -3326983.2 What is the difference between 16 and -0.00352? 16.00352 What is the difference between -3.33 and -3? 0.33 What is -0.2397 plus 3? 2.7603 -508 - 870 -1378 Add together 108 and -0.4. 107.6 Subtract 5 from 50972. 50967 Total of -67 and 43.667. -23.333 Subtract 0 from 2039. 2039 What is -13 - -0.72? -12.28 Total of 4 and 761.9. 765.9 Sum -0.019 and 319. 318.981 Subtract -3 from 18771. 18774 What is 55 + 6.3? 61.3 -4 - 80.017 -84.017 Subtract 0.7 from -12.9878. -13.6878 What is -0.2 minus 2.451488? -2.651488 -115.03+197 81.97 3124 + -6 3118 What is the difference between 2865 and 0.5? 2864.5 Add 85.8488 and 3. 88.8488 What is 3 plus -139? -136 Work out 18 - 18.916. -0.916 Subtract 0.0635 from 0.5. 0.4365 14 - -485912 485926 Total of 0.01 and -0.0185. -0.0085 Calculate 1043777 - 0. 1043777 -3.2+63 59.8 3.3+-2078 -2074.7 -57499 + 0.089 -57498.911 What is 0.6 minus -243? 243.6 Put together 0.2 and 0.28828. 0.48828 Add -42.68 and -0.3. -42.98 Total of 0.5 and 0.698. 1.198 Work out -0.08 - 814. -814.08 Add together -23 and -0.1201. -23.1201 Add together 0.1 and -0.0149. 0.0851 Work out 19.81 + -44. -24.19 4.84 - 82 -77.16 What is -26843 less than 70? 26913 Calculate 0.1 + 0.8. 0.9 Subtract 250 from 0.047. -249.953 What is 89170 - 0.4? 89169.6 -132.946+0.01 -132.936 Add -0.3 and 0.2001. -0.0999 -0.16+-39521 -39521.16 Total of -0.4 and -46445.8. -46446.2 What is 5 - -0.332? 5.332 Work out 7.6 - 47. -39.4 What is the distance between -0.22944 and -0.8? 0.57056 Work out -0.4 + -2106. -2106.4 Work out -507.6 - 0.5. -508.1 Calculate 149 + -40. 109 What is 0.3 minus 292? -291.7 What is 6 plus 2834? 2840 Put together 64 and -11. 53 What is 466 - 825? -359 Add together -4 and -8307. -8311 What is 39 + 333? 372 Work out -35394 + -0.1. -35394.1 What is 792717 + -0.1? 792716.9 What is 0.43 plus 0.163? 0.593 What is 0.3 less than 0.0329799? -0.2670201 0.008 - -0.02 0.028 Calculate -386565 - -3. -386562 Subtract -0.4 from -21294.2. -21293.8 What is the difference between 145 and 124? 21 What is the distance between -555 and 0.01? 555.01 Calculate 37885.7 - 0.4. 37885.3 -0.072+133 132.928 Sum 0.1044 and -0.069. 0.0354 Calculate -14.94 - -0.3. -14.64 What is -134106.9 minus -0.1? -134106.8 0.2 - 4514 -4513.8 Subtract 237 from 0.3. -236.7 Work out -202.9 + 0.4. -202.5 4 + -0.2082106 3.7917894 What is 0.11 less than -355? -355.11 Sum -262954 and 3. -262951 Sum -52 and -170.4. -222.4 Calculate -246 - -0.415. -245.585 Work out -38 - -0.1096. -37.8904 Work out -342 - -5.104. -336.896 What is 27.976 take away -5.23? 33.206 What is -0.09 minus 30498? -30498.09 What is -27836 - 154? -27990 What is the difference between -0.6745 and -34? 33.3255 What is 897 + -0.05? 896.95 What is -9517 less than 6? 9523 What is -1 plus -0.076004? -1.076004 81314 + 5 81319 Put together 70.5 and 1. 71.5 Work out -1 + 21.39. 20.39 Sum -286.34 and 0.7. -285.64 Put together -0.1 and -0.2225. -0.3225 Calculate -287.57 + -10.9. -298.47 Calculate 0.764 + 2. 2.764 What is -5278 - 0.5? -5278.5 Total of -59656 and 0.08. -59655.92 What is -0.4 plus -138537? -138537.4 What is -3.16 plus -4? -7.16 What is 1.964 less than -0.3? -2.264 -344+-0.6 -344.6 -0.02 - 0.0149362 -0.0349362 Sum -0.07 and -57.88. -57.95 What is 46 plus 12.11? 58.11 Calculate 18 + -0.5789. 17.4211 -2135 + 1.1 -2133.9 What is 0.01837 + 13? 13.01837 Work out -2.1 + -0.029. -2.129 Put together 781 and -269. 512 Calculate -21.79 - 27. -48.79 What is -10397 - 0.018? -10397.018 What is 153178 take away -1.9? 153179.9 What is the distance between -220115 and 0.3? 220115.3 Add 643.927 and -0.3. 643.627 Calculate 1 + -1441018. -1441017 Sum 0.3 and 1.9. 2.2 Calculate 0.5 + -0.1403. 0.3597 What is the distance between -1094 and 55? 1149 What is 44050 + -6? 44044 0.108 - -2.2 2.308 -66 - -77 11 What is the distance between 1.9 and -185.4? 187.3 Subtract 24 from 1.2. -22.8 2201+0.5 2201.5 What is -1.3134 - 0.17? -1.4834 What is 0.2 take away 0.0967? 0.1033 Calculate 4 + -8.504. -4.504 Sum -13.5 and -2.7. -16.2 Sum -312 and -33. -345 What is 0.413323 - -0.2? 0.613323 Work out -27550.2 - -40. -27510.2 Calculate 42878 + 3. 42881 Calculate -44 - -0.171. -43.829 Calculate -203 - -7. -196 Calculate 486.639 + 4. 490.639 What is 0.2 minus 680? -679.8 Add -0.9014 and 0.13. -0.7714 What is -6611 minus 8? -6619 Work out 0.2 + -106154. -106153.8 Work out 241.6712 + 0.2. 241.8712 1 + -61.4099 -60.4099 Calculate 0.2 - 640.409. -640.209 Calculate 396 - 1.14. 394.86 What is -0.1 minus 17.73? -17.83 What is -0.4 take away 220.1? -220.5 What is the distance between -11 and -978905? 978894 Work out 11941 + -2. 11939 What is 13 take away 22095? -22082 Work out -40804 + -3. -40807 What is 288 - 0.5? 287.5 Total of -4545 and 92. -4453 2568.7+9.2 2577.9 What is -14 minus -21.6? 7.6 What is 1 + 334456? 334457 What is the distance between 0.4 and 1990? 1989.6 -634+125 -509 What is the distance between 0.16916 and -0.21? 0.37916 Calculate -283 - 0.9. -283.9 Sum 0.2 and 1907. 1907.2 What is -657 take away 0.21? -657.21 Calculate -0.1119 - 0.2. -0.3119 What is -0.058872 + -0.4? -0.458872 What is -4 minus -606? 602 -0.78 - 0.25 -1.03 0.00011 - -33 33.00011 Total of 263.4 and -77. 186.4 Add 2 and 3614.8. 3616.8 Subtract 0.7396 from -0.0915. -0.8311 Total of 0.07 and 369. 369.07 Subtract 1 from -0.00639. -1.00639 What is -26 minus 468? -494 Total of -456 and 1.3. -454.7 Subtract 2 from -84.549. -86.549 What is -5657 + 17? -5640 0 + 564 564 Calculate -0.13 + -496. -496.13 Calculate 0.03388 + 0.129. 0.16288 What is the difference between 0.4 and 41188? 41187.6 Put together 204 and -1.24. 202.76 Add together -14 and -356. -370 What is 1663 less than 0.5? -1662.5 0.102 - 0.7 -0.598 Add -19439 and -4. -19443 Add together 0.2 and -15.8. -15.6 Calculate -0.246 + -0.44335. -0.68935 Total of -1.45 and -13357. -13358.45 What is the distance between 50089 and -0.4? 50089.4 Subtract -2075.1 from 2. 2077.1 What is the difference between -2358 and 0.091? 2358.091 11.171 - 0.05 11.121 27.4 - 0.06 27.34 Calculate -53417 + 0.5. -53416.5 Calculate -0.1 + -127. -127.1 Work out -4025.54 - -36. -3989.54 What is 60545 + -40? 60505 What is the distance between -3.8 and -2.03? 1.77 Put together 237 and -0.3. 236.7 What is -52 take away -0.1706? -51.8294 -0.2 - -158690 158689.8 Total of 182 and 641. 823 What is -8 take away -327? 319 -0.25+5.808 5.558 Add together 117 and 2. 119 Subtract -0.4 from -200. -199.6 What is the difference between -162 and 0.0716? 162.0716 Calculate -0.2 - -652453. 652452.8 What is 0.143 plus -0.7? -0.557 What is -161 minus 186.8? -347.8 What is -0.1 less than -65.39? -65.29 Add together -1.8977 and 0.3. -1.5977 What is the distance between -0.2 and -2088? 2087.8 What is -8305 take away 4? -8309 What is -9.64 minus 0.5? -10.14 What is 0.1148 + -3328? -3327.8852 -13993 + 0.22 -13992.78 What is -3.55 + 1.435? -2.115 What is -0.1 + 2.20869? 2.10869 What is 33 plus -142? -109 Add 172.2 and 0.2. 172.4 What is 0.02125 - -4? 4.02125 What is -0.2053 take away 1.9? -2.1053 Add together -11 and 294.87. 283.87 Add -5 and -2.45. -7.45 -0.4 + -0.04723 -0.44723 Put together 7252 and 0.1. 7252.1 What is 61 take away -0.36? 61.36 Total of -1.0443 and 146. 144.9557 -0.0308423+0 -0.0308423 What is -176 + 6? -170 Add together -0.57 and 0.1084. -0.4616 What is the difference between -2.7 and -279076?	{ "pile_set_name": "DM Mathematics" }
127 4324026407 - 0.9 4324026406.1 Put together -260.95 and -1162905116. -1162905376.95 What is 209904 - -331566370? 331776274 Total of -85.834 and -390466936. -390467021.834 Work out 1629.97 + 0.55703572. 1630.52703572 Add 21204084 and -111.593. 21203972.407 Put together -172070 and 10093038. 9920968 What is 719 take away 81762561.16? -81761842.16 Work out 0.0012977032 - 2433.11. -2433.1087022968 1376669638212 + 0.043 1376669638212.043 Put together -128009.691958 and 24.63. -127985.061958 -22288.3 + -0.075446 -22288.375446 Put together 0 and -2112059992.77847. -2112059992.77847 Work out -18845616 + 90143. -18755473 What is -105 take away -4273252308? 4273252203 What is 289.94811287497 - -0.22? 290.16811287497 Work out -1602573054 - -305198. -1602267856 What is -598 take away 23.94104207? -621.94104207 -129514.587 + 232.94 -129281.647 Put together 0.178 and 5039402369. 5039402369.178 Work out 0.1274 + -169333003. -169333002.8726 What is -3 minus 0.154348390904? -3.154348390904 What is the distance between -508.212242 and -0.0057? 508.206542 Total of 0.1079188123 and -7. -6.8920811877 What is the difference between -0.316431 and -116459518? 116459517.683569 What is -0.36015526114 + 2? 1.63984473886 Work out 355 + -4754212080. -4754211725 What is 0.2387907472 less than 7? 6.7612092528 348.3 - 1688271 -1687922.7 What is the difference between -760752505381 and 12? 760752505393 Total of 694641 and 0.0105476231. 694641.0105476231 Work out -9483.657 - -441.7. -9041.957 Calculate -871 - -5134053.1. 5133182.1 0.0069226066 - -548 548.0069226066 Work out -0.332395 - 33.3381829. -33.6705779 Add -49.1 and -0.002393479664. -49.102393479664 Add together 18710.672915 and 3.987. 18714.659915 What is -361482392047 + -6? -361482392053 Calculate -679 + 7148383.979. 7147704.979 Calculate -71699514776 - -11. -71699514765 What is -1.7 minus -2583924877050? 2583924877048.3 What is -1.233325 + 12561660? 12561658.766675 35217.72814+-0.016 35217.71214 670.1 - 3975.0961 -3304.9961 Sum -2.63 and 41.561026. 38.931026 Sum 47988.2753349 and 0.182. 47988.4573349 What is -45834 less than 4710928085? 4710973919 Work out 161.45 - 24013318. -24013156.55 What is 222 plus -14.09392783? 207.90607217 Total of 72455.9079 and 13. 72468.9079 Work out 0.4 - 60624015675. -60624015674.6 What is 13.946943320943 minus 1? 12.946943320943 What is the distance between 423950485454 and -0.1? 423950485454.1 Work out -2033848509329 + 1.2. -2033848509327.8 -5507 + 332926346 332920839 Calculate 0.083 - -39574.58293. 39574.66593 Subtract -54.01 from -9278410726. -9278410671.99 0.1841+-297695310 -297695309.8159 What is 2875 - -3.5473589? 2878.5473589 0.04588190047 - -200 200.04588190047 What is -143.7 less than -743376338? -743376194.3 What is 1333.7 take away 43028302730? -43028301396.3 Calculate -15880.7906 - -455. -15425.7906 Sum -17 and 2969509836. 2969509819 What is 5338162.7874 less than -18? -5338180.7874 Total of -11934513 and 4969427. -6965086 What is -110703496102 + -1491? -110703497593 -1552865280 - -0.45476 -1552865279.54524 Work out 59696.61 + -68.69581. 59627.91419 What is -99563 less than -89418949? -89319386 Work out 5305583947234 + -0.07. 5305583947233.93 Total of 224694971569 and -40. 224694971529 0.14299130808+-106 -105.85700869192 24889414375+-0.474 24889414374.526 Put together 291957 and -7421649. -7129692 What is -33732 less than -130934368? -130900636 Sum -9355681 and 38.566397. -9355642.433603 What is 183 plus 646428.16325? 646611.16325 What is the difference between 4638833521 and 122? 4638833399 -43.278519537+25 -18.278519537 Add -137809309.177 and -5. -137809314.177 Subtract 100748664821274 from -0.02. -100748664821274.02 Subtract -21315.86 from -0.105088184. 21315.754911816 Calculate -1631 + -50386035.1. -50387666.1 What is -5255887 + -0.06282339? -5255887.06282339 Sum -10388.5156 and 49243.72. 38855.2044 Calculate 33915145 + -4473. 33910672 Add -13318804091 and -83. -13318804174 What is the difference between 0.728068 and -1.49841? 2.226478 Put together 5502.8 and 28799.69826. 34302.49826 2064329576183+-0.2 2064329576182.8 What is 171732096 - -0.67831? 171732096.67831 Add together 9529 and 1397377.2. 1406906.2 Total of -11.5408155795 and 1. -10.5408155795 What is -169046.9843 take away 5964? -175010.9843 What is 0.31 take away 949601936649? -949601936648.69 Work out 96.41921 - -1650.4. 1746.81921 What is -3751771878 minus 0.578? -3751771878.578 -9206358 + 112120 -9094238 What is 24253020990574 take away 4? 24253020990570 -676436.134488 + -0.01 -676436.144488 5+10497.92551029 10502.92551029 Put together 14 and 13033754855.33. 13033754869.33 8632964281356 - 0.69 8632964281355.31 Add together -318210407 and -18653. -318229060 Subtract 0.325 from -179.5422928. -179.8672928 What is -11074 + -298.5883105? -11372.5883105 Calculate -28272349317087.2 + 0.5. -28272349317086.7 What is -1.3992268 minus -0.032853? -1.3663738 -4925 - 6.597962 -4931.597962 Calculate 16 - -223654021218. 223654021234 Put together -268.2429881 and 0.6202. -267.6227881 What is -0.087 less than -650214172411? -650214172410.913 Add together 1049045876683 and -91. 1049045876592 What is -92412.7 minus 40654599? -40747011.7 What is -724.914521455 + -1? -725.914521455 What is 367 take away 189243128.16? -189242761.16 What is -4 less than -13734700321995? -13734700321991 347 - -10.8034461 357.8034461 Calculate 1452 + 21919933.8. 21921385.8 Put together -6 and 12553.7084532. 12547.7084532 What is -576926755 + 0.189014? -576926754.810986 -17.509070615 + -0.1 -17.609070615 Sum -16982.756 and 17541. 558.244 What is -14403818897125 less than -5? 14403818897120 What is -0.059 - 14648433982? -14648433982.059 Work out -3712500526 - 7. -3712500533 What is the distance between -2 and -3398262790? 3398262788 -2897447751951 + -1.4 -2897447751952.4 What is -346397 - 187376? -533773 -398+0.466485931 -397.533514069 Calculate 1045004941620 + 461. 1045004942081 What is -13972444 less than 52.839? 13972496.839 Work out 505 + 2472042.7763. 2472547.7763 Total of 0.5040499 and 7.018939. 7.5229889 Subtract 44163.7240742 from -0.31. -44164.0340742 What is 112917837684.2 plus -0.3? 112917837683.9 7511164751 + 13100 7511177851 What is 3126990 minus 0.0466249? 3126989.9533751 Add -18810 and 1.248174997. -18808.751825003 Put together 47935 and 35911413. 35959348 What is -9979 less than -1268259907? -1268249928 What is the distance between -0.0309024 and -345438? 345437.9690976 Sum -332277755 and -21.088. -332277776.088 Put together -33256.41323 and 0.1832. -33256.23003 Work out -0.619 + 25056460. 25056459.381 What is 909784961.339 less than 0.2? -909784961.139 8325302+-1217.4 8324084.6 What is -99 - 77.0030057? -176.0030057 Subtract -166 from -55988795.4794. -55988629.4794 What is -0.2 take away 25457591364424? -25457591364424.2 2 + -9318396.24873 -9318394.24873 What is 6967 minus 6727351181? -6727344214 Put together 5752 and 128590.485. 134342.485 What is the distance between -16.36811354062 and 0.044? 16.41211354062 -7021604.2 - 430.2 -7022034.4 Calculate 7106178359 + 30. 7106178389 Add together -305305 and -1770547305. -1770852610 What is 1581 minus -11301367682? 11301369263 -0.1 + -5237071.26359 -5237071.36359 What is -4 - -32509.353769594? 32505.353769594 Work out 245 + -1789.0624973. -1544.0624973 Add together -171288.345661 and -1.3. -171289.645661 Calculate -106.044 + -0.335103701. -106.379103701 What is the distance between -57.68 and 177905238? 177905295.68 What is 0.0615611 take away 6542727? -6542726.9384389 Add together -19321462 and -1.4324. -19321463.4324 278.436 + 1271705 1271983.436 What is the difference between 0.1722170107343 and 0.5? 0.3277829892657 Add -959537011 and -428880. -959965891 Sum 75989 and 267.1004434. 76256.1004434 What is -23817556522560 minus -0.4? -23817556522559.6 What is 912651062154 take away 3? 912651062151 What is the difference between -0.30104 and -2668119.2? 2668118.89896 Sum -23 and 12.40539110871. -10.59460889129 2832.61 + 816128 818960.61 Subtract -90 from -153663060171. -153663060081 What is 12461865640 - -175? 12461865815 What is 4.208161844 plus 1089.9? 1094.108161844 What is 1266386893 minus -0.1395? 1266386893.1395 What is -0.5 less than -848319.6409881? -848319.1409881 Work out 90931	{ "pile_set_name": "DM Mathematics" }
prob of picking 1 u and 3 y when four letters picked without replacement from uyyyunuuyuunyu? 10/143 Three letters picked without replacement from {g: 3, r: 1, z: 1}. Give prob of picking 1 z, 1 g, and 1 r. 3/10 What is prob of picking 1 s and 1 y when two letters picked without replacement from yaayayaosyyaasaaya? 4/51 Two letters picked without replacement from wqnqsuqunsquqqnnqu. Give prob of picking 1 w and 1 s. 2/153 Calculate prob of picking 2 s when two letters picked without replacement from {s: 3, m: 6, w: 8, z: 2}. 1/57 Two letters picked without replacement from {i: 2, t: 3}. What is prob of picking 1 i and 1 t? 3/5 Calculate prob of picking 2 q when two letters picked without replacement from tjyqatsqa. 1/36 Calculate prob of picking 1 t, 1 b, and 2 f when four letters picked without replacement from fqftbb. 2/15 Three letters picked without replacement from {g: 1, s: 1, v: 7}. Give prob of picking 1 v, 1 s, and 1 g. 1/12 Calculate prob of picking 1 s and 3 l when four letters picked without replacement from {l: 12, s: 1}. 4/13 Three letters picked without replacement from {w: 1, s: 2, y: 2, t: 1, z: 1, a: 1}. What is prob of picking 2 w and 1 t? 0 What is prob of picking 1 u and 1 r when two letters picked without replacement from duddudur? 3/28 What is prob of picking 1 q and 1 w when two letters picked without replacement from {w: 3, q: 15}? 5/17 Four letters picked without replacement from nnbbn. What is prob of picking 2 b and 2 n? 3/5 Two letters picked without replacement from {m: 3, h: 4, j: 1}. Give prob of picking 2 m. 3/28 Two letters picked without replacement from {k: 1, d: 2, w: 1, y: 1, m: 1, z: 1}. Give prob of picking 1 z and 1 y. 1/21 What is prob of picking 2 m, 1 l, and 1 s when four letters picked without replacement from mslsllsslllms? 6/143 Calculate prob of picking 1 i and 1 h when two letters picked without replacement from {j: 1, i: 1, l: 2, b: 7, h: 2, p: 4}. 1/68 Four letters picked without replacement from {h: 1, w: 1, y: 1, z: 1, i: 1}. What is prob of picking 1 h, 1 y, 1 w, and 1 i? 1/5 Two letters picked without replacement from ttttttttttttttttyttt. Give prob of picking 1 t and 1 y. 1/10 Two letters picked without replacement from gjjjgkkjk. What is prob of picking 1 j and 1 g? 2/9 What is prob of picking 3 u when three letters picked without replacement from {u: 17, h: 1}? 5/6 Three letters picked without replacement from {n: 3, q: 4}. Give prob of picking 1 q and 2 n. 12/35 Two letters picked without replacement from {n: 2, a: 2, j: 2}. What is prob of picking 2 a? 1/15 Three letters picked without replacement from zylymmyyztln. Give prob of picking 1 t, 1 z, and 1 n. 1/110 Two letters picked without replacement from {h: 5}. What is prob of picking 2 h? 1 What is prob of picking 1 k and 1 o when two letters picked without replacement from {o: 3, f: 2, v: 4, k: 1}? 1/15 What is prob of picking 2 i and 1 q when three letters picked without replacement from uquuiiqii? 1/7 Two letters picked without replacement from {i: 2, q: 1}. Give prob of picking 1 i and 1 q. 2/3 What is prob of picking 1 j and 2 s when three letters picked without replacement from {y: 5, s: 3, j: 3}? 3/55 Two letters picked without replacement from {s: 1, v: 4, j: 2, x: 3, h: 7, u: 1}. What is prob of picking 1 v and 1 u? 4/153 Four letters picked without replacement from {s: 2, t: 4, k: 2}. Give prob of picking 1 k, 2 s, and 1 t. 4/35 Calculate prob of picking 4 i when four letters picked without replacement from {s: 4, o: 3, i: 4}. 1/330 Four letters picked without replacement from {k: 1, c: 1, z: 1, i: 1, n: 5, b: 3}. Give prob of picking 1 z, 1 n, and 2 b. 1/33 Calculate prob of picking 2 v and 2 j when four letters picked without replacement from jvjvjjvjjjjjjvvjvjv. 231/646 Four letters picked without replacement from yyyiyyiiiyiyyyiiiiyi. What is prob of picking 2 y and 2 i? 135/323 What is prob of picking 1 j and 1 q when two letters picked without replacement from gjqtqg? 2/15 Four letters picked without replacement from {z: 2, i: 6}. What is prob of picking 4 i? 3/14 Two letters picked without replacement from {u: 1, m: 2, n: 2, s: 1, k: 4}. What is prob of picking 1 s and 1 u? 1/45 Three letters picked without replacement from bjwjbbwbbbbw. What is prob of picking 2 j and 1 w? 3/220 Two letters picked without replacement from {o: 1, c: 1, q: 2}. Give prob of picking 1 c and 1 q. 1/3 Four letters picked without replacement from sssssddssssssd. What is prob of picking 1 d and 3 s? 45/91 Four letters picked without replacement from dpddxxfbbxffffbfbfxd. Give prob of picking 2 f, 1 d, and 1 b. 112/1615 Two letters picked without replacement from {g: 2, c: 6, b: 4, u: 3}. Give prob of picking 2 u. 1/35 Three letters picked without replacement from jjjjjjjjjdjjjjj. Give prob of picking 3 j. 4/5 Three letters picked without replacement from {y: 1, b: 5, e: 1, f: 1, p: 1}. Give prob of picking 1 e and 2 b. 5/42 Two letters picked without replacement from {b: 13, m: 5}. Give prob of picking 1 m and 1 b. 65/153 Two letters picked without replacement from rxrxwrrrirrxrxxrrrrr. Give prob of picking 1 i and 1 w. 1/190 What is prob of picking 3 q and 1 g when four letters picked without replacement from gqgqggggggq? 4/165 Calculate prob of picking 1 e and 1 j when two letters picked without replacement from {j: 5, s: 10, e: 4}. 20/171 Calculate prob of picking 1 h and 3 r when four letters picked without replacement from ssrhhssrpgrsspsrsrh. 5/646 Calculate prob of picking 1 x and 2 n when three letters picked without replacement from nnnxnnxnnnnnxn. 165/364 Two letters picked without replacement from {w: 1, v: 1, l: 2, f: 3}. Give prob of picking 2 l. 1/21 What is prob of picking 2 n when two letters picked without replacement from hhhhhhhnhhhnnn? 6/91 Three letters picked without replacement from {z: 3}. Give prob of picking 3 z. 1 Two letters picked without replacement from {o: 4, i: 3, q: 2}. Give prob of picking 1 o and 1 i. 1/3 What is prob of picking 1 v and 1 o when two letters picked without replacement from vvvovovvvvvv? 10/33 Two letters picked without replacement from wrwtwrrrwwrtxwwrrrx. What is prob of picking 1 r and 1 w? 56/171 Two letters picked without replacement from hhhhhaa. Give prob of picking 2 a. 1/21 Two letters picked without replacement from {d: 1, m: 2, y: 1, e: 3}. Give prob of picking 1 d and 1 e. 1/7 Calculate prob of picking 1 v, 1 n, 1 f, and 1 g when four letters picked without replacement from gvdnf. 1/5 Two letters picked without replacement from ryrriraf. What is prob of picking 1 i and 1 r? 1/7 Three letters picked without replacement from {g: 1, o: 2, m: 2}. Give prob of picking 1 g and 2 m. 1/10 Calculate prob of picking 1 y, 1 k, and 2 t when four letters picked without replacement from tyqttyhkyqq. 3/110 Two letters picked without replacement from {n: 11, h: 9}. What is prob of picking 1 n and 1 h? 99/190 Three letters picked without replacement from {e: 1, t: 3, k: 1, f: 3, l: 6, o: 3}. What is prob of picking 3 o? 1/680 What is prob of picking 1 l and 1 j when two letters picked without replacement from {j: 3, l: 12}? 12/35 What is prob of picking 1 a and 1 e when two letters picked without replacement from {a: 3, e: 2, x: 5}? 2/15 Three letters picked without replacement from oexooxoxexo. What is prob of picking 1 o and 2 e? 1/33 Calculate prob of picking 1 a and 1 p when two letters picked without replacement from pfatffp. 2/21 Calculate prob of picking 2 h and 1 o when three letters picked without replacement from hohq. 1/4 Calculate prob of picking 1 b and 1 f when two letters picked without replacement from {v: 14, h: 1, l: 1, f: 2, b: 1}. 2/171 Two letters picked without replacement from ddtddddndttdddddn. What is prob of picking 2 d? 33/68 Calculate prob of picking 4 v when four letters picked without replacement from ndnnnveen. 0 Calculate prob of picking 1 t and 1 y when two letters picked without replacement from {h: 11, y: 4, t: 4}. 16/171 Calculate prob of picking 1 w and 1 e when two letters picked without replacement from uwwwtfe. 1/7 What is prob of picking 1 k, 1 n, 1 y, and 1 a when four letters picked without replacement from yanpeak? 2/35 What is prob of picking 1	{ "pile_set_name": "DM Mathematics" }
-18 Let l(d) be the first derivative of -d6/15 + d4/3 + 2d + 3. Let y(k) be the first derivative of l(k). Find the third derivative of y(s) wrt s. -48s Differentiate 38g + 0 - 2 - 5g + 8 with respect to g. 33 Let v be (0 - 2) + 7 - 2. Differentiate -vf - f - 1 + 4f - f*2 wrt f. -2f Let a = 19 - 9. Let p be (-15)/a2-1. Find the second derivative of 22z2 + 2z + z*p - 22z*2 wrt z. 6z Let b(p) = -17p4 - 5p*2 + 5p - 26. Let u(j) = -8j4 - 2j*2 + 2j - 13. Let n(o) = 2b(o) - 5u(o). Differentiate n(l) with respect to l. 24l3 Let t(v) = v. Let m be t(3). What is the second derivative of -o3 + om + 16o - 17o - 4o*4 wrt o? -48o*2 Let s = -2 + 0. Let d = s - -4. Find the third derivative of 0p2 + p5 + p*d - 3p*5 wrt p. -120p2 Let x(i) = -i6 - i*3. Let g(a) = 30a*6 + 12a*3 + 14a*2. Let m(p) = g(p) + 12x(p). Find the third derivative of m(b) wrt b. 2160b3 Let u(c) = 3c*3 + 2c*2 + c + 2. Let v(n) = 10n*3 + 7n*2 + 3n + 7. Let x(h) = -14u(h) + 4v(h). What is the second derivative of x(r) wrt r? -12r Let s(h) = 20h*2 + 9. Let f(m) = -9m - 1 + 4 + 7m2 + 9m. Let y(t) = -17f(t) + 6s(t). Find the first derivative of y(x) wrt x. 2x Let y(c) = 2c*2 - 3. Let u(z) = 3z*2 + z - 7. Let v(x) = 3u(x) - 7y(x). What is the second derivative of v(a) wrt a? -10 Let t(v) = 38v*3 + 11v*2 - 2. Let n(o) = -114o*3 - 32o*2 + 7. Let l(i) = 2n(i) + 7t(i). Find the third derivative of l(d) wrt d. 228 Let d be 1 + (2 - (-1)/1). Suppose 2l - l - dv - 9 = 0, -v - 26 = -5l. What is the third derivative of r*2 - 4r*5 + 2r*6 + 4r*l wrt r? 240r*3 Suppose -16 = -3x + 50. Suppose 0 = 5z - x - 3. Find the second derivative of -5n*4 + zn + 2n4 - 3n wrt n. -36n2 Suppose -6c - 5i = -2c - 25, c + 25 = 5i. Let f be (c - (-3)/9)15. Find the second derivative of 2xf - 3x + 2x2 - 2x*2 wrt x. 40x*3 Let c(r) = -2r*3 - 8r. Let t(i) = -6i3 - 23i. Suppose -2x + 5 = 21. Let a(j) = xc(j) + 3t(j). Find the second derivative of a(h) wrt h. -12h What is the second derivative of -405g - 2 - 11 - 2g*3 + 407g + 38g2 wrt g? -12g + 76 Let a(c) be the second derivative of c*6/6 + 47c*3/6 + 37c. Find the second derivative of a(p) wrt p. 60p2 Let y(a) be the second derivative of 0a*2 + 0a*6 + 1/14a*7 + a + 0a*5 - 1/4a*4 + 0 + 0a*3. Find the third derivative of y(b) wrt b. 180b*2 Find the second derivative of -2d*3 - 7d + 3d + 12d*3 wrt d. 60d What is the first derivative of 4 - 1 - 5 - 6o wrt o? -6 Let y(u) = 3u - u + 5u + 7. Let s(l) = -8l - 8. Let m(t) = -5s(t) - 6y(t). What is the first derivative of m(f) wrt f? -2 Suppose 2q + 4 = 4q. Let a(o) be the first derivative of 0o3 + 0o + 3 + 3/4o4 - 3/2o*q. What is the second derivative of a(p) wrt p? 18p Let t(n) be the second derivative of n*8/56 - 5n*7/21 - 7n4/6 + n3/6 + 3n + 1. What is the third derivative of t(g) wrt g? 120g*3 - 600g*2 Let s(q) be the second derivative of 0q*3 + 0 + 3/20q*5 - 1/12q*4 + 4q + 0q2. Find the third derivative of s(z) wrt z. 18 Let v(n) be the second derivative of -2n*5/15 - 2n*3/3 + 7n*2/2 - 4n. Let r(k) be the first derivative of v(k). Differentiate r(q) with respect to q. -16q Let f = -4 + 28. Find the third derivative of fn*2 - 11n*2 - 9n*2 - 5n*5 wrt n. -300n*2 Let b(w) be the second derivative of 5w*4/12 + 5w*3/3 + 2w. What is the second derivative of b(n) wrt n? 10 Let t(o) be the second derivative of 13o3/6 + 31o*2/2 - 15o. Differentiate t(x) wrt x. 13 Suppose 3t - 4t + 2 = 0. Let b(q) = q. Let r be b(t). Find the second derivative of -m*3 + rm - 2m3 + 2m*3 wrt m. -6m Let s(m) be the first derivative of 0m4 + 1/7m*7 + 1 - 2/3m*3 + 0m + 0m2 + 0m*5 + 0m*6. What is the third derivative of s(n) wrt n? 120n3 Let n(h) be the third derivative of -h9/72 - 11h5/60 - 17h*2. Find the third derivative of n(d) wrt d. -840d*3 Let r(y) = -6y*2 + 5y + 2. Let v(n) = -6n2 + 6n + 3. Let d(x) = -6r(x) + 5v(x). Differentiate d(i) with respect to i. 12i What is the second derivative of 9x*4 - 19x*4 - 10x*4 + 13x + 9x wrt x? -240x2 Let h(w) be the first derivative of -w3/3 + 4w2 - 9w - 2. Let l be h(6). Differentiate -3p + l - 1 + 0 with respect to p. -3 Let z be (-8)/20(1 + -16). What is the third derivative of -c6 + c2 + 5c2 - 12c*6 + 5c*z wrt c? -960c*3 Let v(w) be the third derivative of -2w7/105 - w4/6 - 5w2. Find the second derivative of v(f) wrt f. -48f2 What is the third derivative of w2 - 8w2 + 19w*3 - 17w*2 wrt w? 114 Let n(z) be the second derivative of -4z*6/15 + 11z*3/6 - 31z. Find the second derivative of n(t) wrt t. -96t2 Let q = 10 - 6. Suppose 2 = -2r - 4n, -3r + 0n + 3n + 24 = 0. Find the third derivative of -3a2 + 2a*4 - ra*q + 0a*4 + 2a*4 wrt a. -24a Let y = -3 - -6. Let p(x) = x + 6. Let t be p(-4). What is the third derivative of tv2 - y - v5 + 3 wrt v? -60v*2 Find the first derivative of 4w*4 + 29 - 20w*4 - 19w*4 + 3w*4 wrt w. -128w*3 Let y be (-9)/(-12) - 75/(-12). Find the second derivative of 4t*2 - yt + 10t + 7t*2 wrt t. 22 Let t(q) be the second derivative of 3q*8/28 + 4q*4/3 + 17q. What is the third derivative of t(j) wrt j? 720j3 Let o(y) = 6y2 + y - 3. Let i(x) be the first derivative of -x3/3 - x*2/2 + x - 2. Let j(t) = 3i(t) + o(t). What is the second derivative of j(w) wrt w? 6 Let y = -4 + 7. Suppose 2 + 4 = yf. What is the third derivative of 3p*f + 3p*3 - 2p + p + p wrt p? 18 Let g(h) = -14h3 - 7h*2 + 7h - 6. Let k(m) = -5m3 - 2m*2 + 2m - 2. Let t(u) = -2g(u) + 7k(u). Differentiate t(d) wrt d. -21d2 Let y(x) = -3x*5 + 3x*3 - 8x - 3. Let g(l) = 4l5 - 2l*3 + 8l + 2. Let t(i) = 3g(i) + 2y(i). Find the second derivative of t(u) wrt u. 120u3 What is the first derivative of -74f - 26f4 - 31 - 76f + 150f wrt f? -104f*3 Let c = 2 + -1. Let g = 2 + c. Find the second derivative of -2z + z*g - z + 4z wrt z. 6z Let c(f) be the third derivative of f7/30 + f3/6 + 7f*2. Differentiate c(d) wrt d. 28d*3 Let m be (1/2)/((-2)/(-24)). Find the third derivative of -4n*m + 4n*6 - 2n2 - n2 + 5n6 wrt n. 600n*3 Let q = -13 + 16. Let i(m) be the first derivative of 2m + 0m2 - 2/3m*q + 2. What is the derivative of i(v) wrt v? -4v Let y(w) = 4w3 - 9w*2 - 2. Let d(n) = 8n*3 - 19n*2 - 5. Let k(s) = 2d(s) - 5y(s). Find the third derivative of k(z) wrt z. -24 Let w(l) = -l - 1. Let r be w(-1). Let b be (r/(1/1))/(-1). What is the second derivative of -2s + 2s2 + bs*2 + 0s2 + s2 wrt s? 6 Let q(v) be the second derivative of 5v3/3 - 3v*2/2 + 4v. What is the first derivative of q(n) wrt n? 10 Let i = 11 + -8. Suppose -4d + 3d + 7 = t, it = 4d + 7. Find the third derivative of tx2 + 5x*6 - 2x*6 - 2x2 - x2 wrt x. 360x3 Let j(k) = k2 + k - 1. Let c(z) = 22z*2 + 2z - 1. Let s(x) = c(x) - 2j(x). What is the derivative of s(h) wrt h? 40h Find the second derivative of 18o2 - 54o + 2704 - 2704 wrt o. 36 Let k(d) be the third derivative of -d*5/2 - 7d*3/3 + 4d*2. Differentiate k(v) with respect to v. -60v Let t(c) = -c*2 + 9c - 9. Let a be t(7). Find the third derivative of 5j2 - 49j + 49j - ja wrt j. -60j*2 What is the second derivative of 12l*5 + 23l*5 - 22l - 18l5 wrt l? 340l*3 Let p(k) be the second derivative of 3k5/5 + k3 - 16k. What is the second derivative of p(t) wrt t? 72t Let w(a) = 7a2. Let b(l) = 8l*2 + l + 1. Let z(j) = 5b(j) - 6w(j). Let p(i) be the first derivative of z(i). Differentiate p(g) with respect to g. -4 Let z(u) = u3 - 5u*2 - 4u - 8. Let w be z(6). What is the second derivative of -2m + 5m*4 - 5m*4 + 4m*w + 7m wrt m? 48m2 What is the derivative of -15w*2 - 10w*2 - 19 - 13w*2 + 14w*2 wrt w? -48w Let r(a) be the third derivative of a*6/60 + 2a*3/3 + 4a*2. Differentiate r(o) with respect to o. 6o2 Let x(i) = i5 + i3 - i2 - i - 1. Let a(c) = 4c5 - 3c*3 - 7c*2 + 3c + 3. Let s(m) = a(m) + 3*x	{ "pile_set_name": "DM Mathematics" }
= c, -p - 4c = 2p - 31. Let i(g) = -16g - 15g - 15g + 71g - 4g - 6 - 19g. Determine i(p). 4 Let u(o) = o + 1. Let k(z) = -6. Let a(x) = -k(x) - 4u(x). Let q(p) = -4p*2 + 3p + 4. Let b be q(3). Let c = -20 - b. Calculate a(c). -10 Let h be 51/68(-4)/(-1). Suppose -2w - hg + 4 - 11 = 0, -3w - 16 = -g. Let j(l) = l*3 + 6l*2 + 6l + 4. Give j(w). -1 Let z(q) = q + 1. Let p(b) = -6b + 17. Let i be p(0). Suppose 3u + w = -14, 13u + 5w = iu + 6. Calculate z(u). -3 Let w(f) = -2f*3 + 2f - 3f + 1070f*2 - 1064f*2 + 2 - 2. Give w(3). -3 Let k be ((-54)/45)/((4/(-20))/1). Let x(d) = -3d*2 + 10d + 20. Calculate x(k). -28 Let s = 679 + -839. Let a = s - -165. Let x(k) = k*2 - 7k + 3. What is x(a)? -7 Let o(l) = 208 - 13l + 0l + 143 - 312 - 7l. What is o(2)? -1 Let k = 130 + -138. Let c be k/(-48)8734/(-6). Let h = -94 - c. Let w(r) = -r3 + 4r - 3. Give w(h). -18 Let z be 2/12 + (-335)/30. Let f(n) = -2n - 25. Let g(i) = -i - 13. Let x(h) = zg(h) + 6f(h). Suppose 0 = -8a + 5a + 12, -4v - 3a = 12. Determine x(v). -1 Suppose -33p + 72 = 6. Let s(o) = -8o2 + 591o + 15o3 + 9o*p - 590o. Calculate s(-1). -15 Let o(u) = 3u2 + 16u - 11. Let t(y) be the second derivative of -y*4/12 - 4y*3/3 + 3y*2 + 30y. Let k(d) = 2o(d) + 5t(d). Determine k(5). -7 Suppose 2l - 7 = -1. Let x(w) = -15 + 501w - 1000w + 498w. Let s(a) = 3a + 43. Let c(k) = -6s(k) - 17x(k). Determine c(l). -6 Let h(r) = r2 - 121r - 2204. Let m be h(-16). Let f(g) = -11g - 122. What is f(m)? 10 Let i(r) be the third derivative of -r4/6 + 31r*3/6 - 4r*2 + 355. Determine i(0). 31 Let a(m) = 26m - 178. Let d be a(7). Let o(s) = -4s + 2s + 7 - 6s + s. Let r(v) = 48v - 48. Let g(t) = 27o(t) + 4r(t). Give g(d). 9 Suppose -t + 6 = t. Let p(g) = g - 1. Let z be ((-184)/276)/(14/(-6)). Let c(s) = -2s*2 + 7s - 2. Let y(k) = zc(k) - 4p(k). Calculate y(t). -7 Suppose 5r - 22 + 7 = 0. Let s(v) = 2957v*2 - 5v - 9. Let d(t) = 5421t2 - 9t - 17. Let m(i) = 6d(i) - 11s(i). Determine m(r). -9 Let a(r) be the third derivative of r*5/60 - 11r*4/24 + 4r*3 - 4r*2 + 13. Suppose -g + 11o + 17 = 6o, -2o - 4 = 0. Determine a(g). -4 Let g(v) = v*2 - v - 4. Let w(x) = -7x*2 + 9x + 14. Let a(u) = -4g(u) - w(u). Give a(4). 30 Let s(m) be the first derivative of 4/3m*3 + 21 - 5/2m*2 - 1/4m*4 + 2m. Calculate s(4). -18 Let v(d) = -4697461d + 2d*2 - 6 + 6d*2 + 4697493d. Calculate v(-4). -6 Let z(w) be the second derivative of w*4/12 + 13w3/6 - w2/2 + 7w - 20. Give z(-16). 47 Suppose -v + 3m = -11, v - 20 = 4m - 6. Let k(a) = 15 + av - 14 + 0 + a + 3a*3. Give k(-1). -2 Let k(a) = 7a + 3. Let m = -844 - -827. Let y = 30 - 45. Let j = m - y. Determine k(j). -11 Let g(t) be the first derivative of -10t3/3 + t2 + 3t + 1730. What is g(3)? -81 Let h(g) = g - 3. Let z = -17 - -28. Let j = z + -23. Let q be (0 - 0)(j/4)/6. Determine h(q). -3 Let x(c) = -371c - 4821. Let h be x(-13). Let n(g) = -9g3 - 3g*2 + 4. Determine n(h). -80 Let p(m) = -6m*2 - 40m + 10. Suppose t = 2k + 20, -3k - 342t = -346t + 45. Determine p(k). -4 Let t(k) = k + 12. Let v be t(-6). Suppose -vz - 14 = -50. Let l(a) = -186 + 182 - 4a + za. Calculate l(-4). -12 Let f(b) = -b2 + 26b + 104. Let q be f(27). Suppose q - 83 = k. Let w(c) = 4c + 13. What is w(k)? -11 Let c(p) be the second derivative of -2 + 2/3p*3 - 6p - 4p2. Calculate c(6). 16 Let w be 11 + -3 + (30 - 31). Let p(o) = 5o*2 - 5o + 15. Let l(b) = -b*2 - b. Let z(u) = 4l(u) + p(u). Calculate z(w). 1 Let q(z) be the third derivative of z5/60 - z4/8 - 11z3/6 - 2z*2 - 4z - 1045. What is q(6)? 7 Suppose -n = 4n + q - 42, 32 = 5n - 4q. Let t(m) be the second derivative of -4m + 14m2 - 21m*2 - 2m3 + m3 + nm2. Determine t(-2). 14 Let q = 7386 - 7358. Let a(n) = -13n + 360. Determine a(q). -4 Suppose 0 = 2o - 4o - 3x + 8, 0 = 2o + x - 4. Let q be 15/(-10)48/(-9). Let u(t) = -8 + 18 - q + 5t - 1. Determine u(o). 6 Let a(p) = 19p2 - 23p + 54. Let i(w) = -25w2 + 26w - 53. Let t(q) = 4a(q) + 3i(q). What is t(9)? 12 Suppose 0 = 5d - 5w - 44 - 51, 5d - 75 = w. Suppose -4u + d = -u - y, 24 = 4u + 4y. Let o(h) = -h*2 + 3h + 1. Give o(u). -9 Let n(p) = -4088p + 3 + 8144p - 4057p + p2. Give n(0). 3 Let n(q) be the first derivative of -10q*2 + 1/12q*5 - 36 + 0q*4 + 0q + 7/6q3 - 1/120q6. Let r(j) be the second derivative of n(j). What is r(6)? -29 Let z(a) = -a2 + 9a - 6. Let f(u) be the third derivative of -u6/120 - u5/20 + 19u*4/24 + 7u*3/3 - 3u*2. Let d be f(-6). Calculate z(d). 2 Let w(h) = -3h*3 + 23h*2 + 19h + 38. Let z(o) = -2o3 + o2 + 21o. Let p(b) = -w(b) + z(b). Calculate p(22). 6 Let m(k) = -6 - k*2 + 493k + 689k - 1869k + 686k. Let x(d) = d - 2. Let p be x(2). Calculate m(p). -6 Let b(x) = x2 + 2x - 1. Let v(d) = -d + 48. Let k be v(-21). Let p = -64 + k. Suppose -5c + p - 25 = 0. Calculate b(c). 7 Suppose -2a - 13 = -f, 1 = 3f - 6f - 4a. Let l(y) = -6 - f + 9 - y + 4. Give l(8). -6 Let u(h) be the third derivative of h4/24 + 16h*3/3 - 3532h*2 + 2h. What is u(4)? 36 Let y(v) = 36v3 - 14v*2 - 4v - 17. Let t(k) = -43k3 + 15k*2 + 4k + 18. Let o(s) = -5t(s) - 6y(s). What is o(9)? 48 Let w(a) = 4a + 251a2 + a3 - 147a2 - 113a2 + 5. Determine w(7). -65 Let z(h) be the third derivative of h5/30 - 5h4/8 + 9h*3/2 + 149h*2. Let a be z(2). Let t(s) = -5s + 29. Determine t(a). 4 Let b(n) = n*2 - 2n + 2. Suppose 4j = 139 - 11. Suppose -j = -3c - c. Suppose 0 = -2i - 4 + c. What is b(i)? 2 Let s(c) = -2c*2 - 4c + 6. Let d = -54 - -55. Let o(n) = n - 1. Let h(l) = ds(l) + 4o(l). Suppose 2a + 3t - t - 10 = 0, -4t = -a - 10. Calculate h(a). -6 Let x(h) = -383h - 8797. Let k be x(-23). Let a(g) = -g*3 + 12g*2 + 2g - 20. Give a(k). 4 Let b(y) = -384y - 5751. Let q be b(-15). Let v(l) = -2l*3 + 19l*2 - 10l + 15. What is v(q)? 6 Let y(m) be the first derivative of 286 + 1/3m3 - 2m - 5m2. What is y(8)? -18 Let i(y) = y + 4. Let d(p) = -3p + 22. Let k be d(6). Suppose u + 10 = 4g + 4u, 22 = kg - 3u. Let f be 3 - (-10)/g8/10. Give i(f). 9 Let i(l) = -147l - 1480. Let y be i(-10). Let g(b) = -2b + 16. Calculate g(y). 36 Let f(q) = 53q - 298. Let a(t) = 29t - 141. Let y(j) = -5a(j) + 3f(j). What is y(14)? 7 Let a(w) = w3 - 3w*2 - 6w + 18. Let x be a(3). Let l(s) = -2s + 2s*2 + 406 - 405 + xs*2. Calculate l(2). 5 Let i(u) = -14u - 36. Let c = -12443 - -12440. Give i(c). 6 Suppose 1 + 5 = -2q, 4s + 22 = -2q. Let p(o) be the second derivative of -o4/12 - o3/3 + 5o*2/2 + 1121o. Determine p(s). -3 Let m(u) = -u*2 - 10. Let t(p) = -20p - 15. Let c be t(-1). Suppose -3j - 4y - 1 + 13 = 0, cy = 5j + 15. Give m(j). -10 Let w(k) = k*2 - k - 1. Let x(q) = 2q*2 + 7q - 12. Let b(d) = -3w(d) + x(d). Suppose 4a - 16 = 3c, 0 = -a + 2020c - 2021c + 11. What is b(a)? 12 Let i(q) be the second derivative of q6/360 - 13q*5/120 + 7q*4/24 - 49q*3/3 - 4q - 10. Let t(m) be the second derivative of i(m). What is t(12)? -5 Let d = 61 + -24. Suppose dk = 22k - 195. Let f(b) = -b - 7. Calculate f(k). 6 Let p(z) be the second derivative of 31 + 1/5z5 + z + 1/2z*2 + 1/12z*4 + 1/6z3. Determine p(-1). -3 Let t(k) = k3 + 9k2 + 12k + 2. Suppose -5b - 35 = -5z, 33b - 30b + 21 = -4z. Calculate t(b). 16 Let v(k) = -152 + 122 - 11 + k2. Calculate v(0). -41 Let d(c) = 32c*3 - 78c*2 + 14c + 11. Let s(q) = 7q3 - 19q*2 + 3q + 3. Let u(p) = 2d(p) - 9s(p). Give u(-15). -20 Let c(g) = -g*2 - 8g - 25. Let w = 785 - 794. Determine c(w). -34 Suppose -n + 10 = 11. Let s be 614/(-56) - n/(-2). Let i(h) = -h3 - h2 + 3h. Give i(s). -2 Suppose -2j - 15j + 198 = -6j. Let y(x) = x - 26. What is y(j)? -8 Let a = 12785 + -12793. Let r(b) = -b3 - 8b*2 + 3b + 27. Determine r(a). 3 Let k(p) = -18p - 87. Let g be ((-24)/(-22))/((-1060)/(-1166)) + (-31)/5. Give k(g). 3 Suppose -n = p, -16n + 2 = -18n - 3p. Let v = -1 + 3. Let d(a) = -9a + 7 - 18a*3 - 5a*2 + 19a*3 - 4a*v + 2a*n. Calculate d(8). -1 Let f be -1(-3)/(	{ "pile_set_name": "DM Mathematics" }
o + hd and give h. 12 Express (3 + 7 - 7)(-4 + 4 + 3a + 0 - 2a + 0 - 1 + 1 + 2a + 1 - a - 1 + (-2 + 2 - 2)(-2a - 1 + 1) + 2a + 2a - 5a) in the form xa + i and give x. 15 Rearrange 14 + 11y*2 - 16 + 2y*2 to cy*2 + l + xy and give c. 13 Express p - 5p3 - 14 + 25 - 13 in the form a + sp*2 + zp + qp3 and give z. 1 Rearrange (2v*2 - 2v*2 - 2v*2)(4 + 8 - 4) to the form av2 + qv + h and give q. 0 Rearrange -34o2 - 3o3 - o4 + o*3 + 3o*4 - 4o*4 to ro*3 + qo + so2 + c + ho*4 and give r. -2 Express (-1 + 1 + 3i)(1 + 1 + 18i*3 - 20i3 + i2) as hi2 + si*4 + ni*3 + mi + b and give h. 0 Rearrange -5 + 11 - o*3 - 20 to the form po*3 + bo + n + vo2 and give n. -14 Rearrange -5h*2 - 3h - h - 4h3 + 3h*2 to the form mh + y + oh2 + lh*3 and give l. -4 Rearrange (-1 + 1 - 4s)(2 + 4 - 4 + (3 + 2 - 3)(-3 - 2 + 3) - 1 + 11 - 2) to zs + t and give z. -24 Rearrange 25185w - 203w2 - 25185w to the form mw + rw*2 + s and give r. -203 Rearrange 153 - 153 + 31t*2 to g + xt*2 + wt and give x. 31 Express 150k3 - k2 + 3k*2 - 3k*4 - 148k*3 in the form f + rk*3 + dk*2 + hk*4 + qk and give d. 2 Express (r - 4r + r)(2r - 2r - 3r) + r2 - r2 - 3r*2 as hr*2 + b + zr and give h. 3 Express 3z2 + 3 - 3 + 0z + z in the form mz + yz*2 + c and give y. 3 Express 12n + n - 8n + 39n as qn + k and give q. 44 Rearrange -m + m + 2m - 4m - m + 2m - m + m + m + (1 - 4 + 1)(0m + 0m - m) - 3m + 9m - 2m to qm + h and give q. 6 Express (-22t*2 + 119t*2 - 6t*2)(-3 + 6 + t - 2) as nt3 + vt*2 + at + c and give n. 91 Rearrange n*2 - 14n*3 + 31n*3 - 15n*3 + 9n - 3 to the form jn2 + dn + wn3 + t and give d. 9 Rearrange h - 1067h*2 + 4 + 1065h*2 - 3h*4 - 5 to jh*4 + u + qh*3 + ah*2 + ch and give j. -3 Rearrange 5b - 13b - 1 + 7b + (2b + 0 + 0)(-4 + 0 + 3) + 3b + 0b - 2b to j + ub and give u. -2 Rearrange -28d*2 + 53d*2 + 58d*2 to the form jd*2 + a + td and give j. 83 Rearrange (1 + 5 - 3)(-138 + 138 + 32b*2) to n + sb*2 + ib and give s. 96 Rearrange 4q + 7 - 11 + 3q to vq + k and give v. 7 Rearrange 12q - 43q3 - 9q*4 + 2 + 41q*3 - 12q to pq + bq*2 + g + hq*4 + kq*3 and give g. 2 Rearrange -3 - 44q + 35q + 3 to the form b + hq and give h. -9 Rearrange (f - 3f + f)(-2f3 + 0f*3 + 0f*3) + 5f*4 + 6f*4 - 5f*4 to kf*2 + pf*4 + mf*3 + hf + x and give p. 8 Express -7s4 + 23s*4 - 1 - 2s + 9s4 - s3 in the form js*3 + x + os*2 + cs*4 + ts and give j. -1 Rearrange -1 - 11u + 2u*3 + 6u*2 - u - 6u*2 to du*3 + zu + vu2 + h and give h. -1 Express (9 - 11 - 12)(-2 + g*2 + 2) in the form wg + jg2 + d and give w. 0 Express (-2h - h + 4h)(4 + 2h - 4) + (0h2 + h2 - 12h2)(-3 - 4 + 5) in the form f + vh + ah2 and give a. 24 Express j4 + 6j2 - 330j*3 + 6j - 8j2 + 332j*3 in the form xj*2 + vj*3 + r + mj*4 + sj and give m. 1 Rearrange 0a4 + 0a*3 + 11a3 + a2 - 9a3 + 5a*4 to the form ra*2 + l + ha*4 + da + xa3 and give x. 2 Rearrange ((-1 + 0 + 3)(8 + 3 - 12) + (-5 + 2 + 4)(-2 + 2 - 2) + 4 - 3 - 2 + 2 - 5 + 4 + 0 + 0 - 2)(-5 + 5 - 4h) to yh + u and give y. 24 Express -2f2 + 0f3 + 1 + f3 + 0 - f*4 - 2f*4 as zf*2 + af + rf4 + y + of*3 and give r. -3 Rearrange 9o + 0o + 3o - 5 to v + ro and give v. -5 Rearrange y4 + 2 - 5y*2 - 4 + 2y2 + y2 - y to t + uy2 + hy + zy3 + xy*4 and give u. -2 Express 5f3 + f3 - 4f3 + 1 + 2f - 3f in the form n + bf*2 + pf*3 + lf and give n. 1 Rearrange -y*3 - 4y*2 + 3y*2 + 2y*2 - 2y*4 - 7y*2 - y to wy + uy3 + i + gy*4 + by*2 and give g. -2 Express (0 + 9 + 2)(-4t + 5t + 1 + 0t) as c + ot and give o. 11 Rearrange 21 - 21 + 10a to u + fa and give f. 10 Express (-5 + 5 + o)(-4o + 0 + 0) - 3o2 - o2 + 3o*2 + 3 - 2o*2 - 3 in the form vo*2 + go + d and give v. -7 Rearrange (-3x + 4x - 2x)(-38 - 1 + 4) to the form q + bx and give b. 35 Express 118o*2 - 5o - 16 - 119o2 + 5o as p + bo + so*2 and give p. -16 Rearrange -7 + 14q + 9 + 0q + q3 + 0 to the form lq + fq3 + m + cq*2 and give m. 2 Rearrange -1 + 2 - 3 - 17a*2 + 0 to oa + ga2 + y and give g. -17 Rearrange -5009 + 5009 - 32x*3 - 2x*2 to dx + m + jx2 + lx*3 and give j. -2 Express (-11b + 3 - 3)(-b2 - b + b) + b3 + 0b3 + b3 as l + ab2 + jb + fb3 and give f. 13 Express 0b*3 + 25b - b*2 - 24b - b*3 in the form o + sb*2 + ub*3 + kb and give u. -1 Express 2b2 - 2b*2 - 2b*3 + (6b + b - 4b)(7b2 - 10b*2 - 8b*2) in the form hb + db2 + c + wb*3 and give h. 0 Rearrange 5 - 2x*2 - 13 + 2x + 0x2 + 5 to zx + k + mx2 and give k. -3 Rearrange 3w - w - w + (5 - 4 + 1)(0w + 0w + w) to the form uw + r and give u. 3 Express (4b + 2b - b)(-2 + 3 - 2)(1 + 4 - 4)(0 - 1 + 3) in the form kb + i and give k. -10 Express (5c2 + 21c - 21c)(4c - 4c - 2c + (-c - 1 + 1)(-1 + 0 + 3)) in the form z + nc3 + sc + yc2 and give z. 0 Rearrange 2j3 - 9 + 11 - j3 + j3 + j2 - 2j to the form xj*3 + z + fj + rj2 and give x. 2 Express (3 - 2 - 2)(-4 - 3m + 4) - m + m + 2m + (-m + m + m)(1 + 3 - 2) in the form x + nm and give n. 7 Rearrange -9 - 17 + 5u2 + 11 - 7u*2 to the form bu + ru2 + s and give b. 0 Express 44z - 91z - 135z + 30z as sz + v and give s. -152 Express 8r + r + 3r in the form b + ur and give u. 12 Rearrange -3p - 29 + 29 to h + qp and give q. -3 Express (-1 - n + 1 - 2 - n + 2 + (3 - 4 + 3)(2n + n - 2n) - 2n + 8n - 3n)(2 - 2 - 2) in the form yn + k and give y. -6 Rearrange (-g - g - 2g)(-3g2 + g2 - g*2) - 3g*3 + 0g3 + g3 to ag3 + w + ug + og2 and give a. 10 Rearrange 2r*2 - 8r*2 - r - 7r*2 + 3r to the form q + vr + or*2 and give o. -13 Rearrange -78a - 2a4 + 10a*2 + 79a - 2a2 to x + ka + ba3 + ha*4 + na*2 and give n. 8 Rearrange 3y - 17y + 13y - 18 to zy + a and give z. -1 Express -4x*3 - 38x + 2 - 2x2 + 38x in the form px3 + lx*2 + ix + c and give c. 2 Express -2y3 + 9 + 4 + 30y - 32y as py*3 + ry*2 + ky + v and give v. 13 Rearrange (2 + 2u - 2)(-3u + 0u + 5u + (u + 1 - 1)(-3 + 1 + 0) - 2u + 0u + u)(2 - 3 + 4) to the form mu + x + fu2 and give m. 0 Rearrange 12r*2 + r - r - 35r*2 to x + zr + yr2 and give y. -23 Rearrange -23 + 5s - 3s - s3 + 2s*2 - 3s*2 to the form xs*2 + qs + i + fs3 and give q. 2 Rearrange -13v + 49v + 43v - 4v to the form tv + n and give t. 75 Rearrange 144 + 3y3 - 3y2 - y3 - y*4 - 141 + 2y*4 to the form ny*3 + xy*4 + uy + a + py2 and give a. 3 Rearrange 0q + 6q + 26 + 4q - 11q to pq + m and give m. 26 Express 7l + 4 - 4 + (1 - 1 + 2l)(4 - 2 - 3) + 0l + 2l - 3l - l - l + l + 5l + 9l - l - 2l as dl + v and give d. 14 Rearrange (-1 - 2n2 + 1 - 2n)(-2 + 1 - 1 + 2 + 0 + 0 + (2 - 4 + 0)(0 - 4 + 2) - 2 - 1 + 5) to the form yn + gn*2 + d and give y. -12 Express 82z + 3 + 4 - 85z in the form u + hz and give h. -3 Express (2k2 + 4 - 4)(-2 + 0 + 4) - k*2 + 4k2 - k2 + 0k2 - 4k*2 + 2k*2 - 11k*2 + 9k*2 + 11 + 11k - 12 as xk + r + ck*2 and give c. 2 Express (-11 - 3s + 11)(s + 3 - 3)(0s - 6s + 2s) in the form rs + k + ns2 + us*3 and give u. 12 Express -2k - 4k2 + 0k*2 + 2k*3 - 2 + 5k*2 + 5k*4 in the form gk + ck4 + xk*2 + sk*3 + o and give x. 1 Express (36z*2 - 36z*2 - 26z*4)(1 + 2 - 1) in the form cz3 + kz*4 + qz + a + oz2 and give k. -52 Express 35 + 5q - 35 as o + jq and give j. 5 Express 15k - 10k + 3k in the form t + ik and give i. 8 Express (0u*2 - 2u*2 + 0u*2)((-u + 0u + 3u)(2 + 0 - 3) + 2u - 2u - 2u) in the form tu3 + zu*2 + r + su and give t. 8 Rearrange (-l*3 + 33l + 2 - 33l)(-2 + 6 - 10 - 1 + 4 - 2 + (5 - 1 - 2)(-1 + 1 + 2)) to the form sl*3 + z + rl + kl2 and give s. 1 Express -g2 - 1 - 7g*2 + 6g + 6g2 + 7g as bg + n + fg*2 and give n. -1 Express b - 2b**	{ "pile_set_name": "DM Mathematics" }
, -820479, -820516? -820561 What is next in -54303, -54079, -53855? -53631 What is the next term in 18973298, 18973358, 18973528, 18973862, 18974414, 18975238? 18976388 What is the next term in 178254, 356487, 534710, 712917, 891102, 1069259, 1247382, 1425465? 1603502 What is the next term in -788, -6181, -20792, -49223, -96076, -165953, -263456? -393187 What is the next term in 2856677, 2856683, 2856687, 2856689, 2856689, 2856687, 2856683? 2856677 What comes next: 163166, 326283, 489400, 652517? 815634 What comes next: -179, -6, 275, 670, 1185, 1826? 2599 What is next in -680534, -680466, -680346, -680168, -679926, -679614, -679226, -678756? -678198 What is next in -17992, -141883, -478154, -1132993, -2212588, -3823127, -6070798? -9061789 What is the next term in 73957, 147906, 221859, 295816? 369777 What is the next term in 43058, 86265, 129472, 172679, 215886, 259093? 302300 What comes next: 15273, 15184, 15041, 14844, 14593? 14288 What is next in -4753, -4974, -5191, -5404, -5613, -5818, -6019? -6216 What is the next term in 770, 1501, 2228, 2951, 3670, 4385? 5096 What comes next: 189187, 188717, 187951, 186901, 185579? 183997 What is the next term in 25835662, 25835692, 25835740, 25835806, 25835890? 25835992 What is next in -942, -434, 506, 1956, 3994? 6698 What is next in -124913422, -124913401, -124913378, -124913353, -124913326, -124913297, -124913266? -124913233 What is the next term in 2989235, 2989183, 2989131, 2989079, 2989027? 2988975 What is next in 5689, 20840, 46091, 81442, 126893? 182444 What is next in -467040, -1868195, -4203464, -7472847, -11676344? -16813955 What comes next: 97324567, 194649138, 291973709, 389298280? 486622851 What is the next term in 139, 480, 737, 910, 999, 1004, 925? 762 What is the next term in 9044, 16575, 22606, 27143, 30192, 31759, 31850? 30471 What is next in -79799, -158869, -237939, -317009, -396079, -475149? -554219 What comes next: -846207, -1692418, -2538663, -3384960, -4231327, -5077782? -5924343 What comes next: 12395814, 24791620, 37187420, 49583214? 61979002 What comes next: 4441489, 4441486, 4441483, 4441480? 4441477 What is next in -3991, 16844, 51569, 100184, 162689? 239084 What is next in 25679, 205400, 693197, 1643108, 3209171, 5545424? 8805905 What is the next term in -810792, -810767, -810706, -810591, -810404, -810127, -809742? -809231 What is next in -49045, -98082, -147111, -196138, -245169, -294210? -343267 What is the next term in -43353816, -43353821, -43353826, -43353831, -43353836? -43353841 What is next in 3779, 23480, 59103, 110642, 178091, 261444, 360695, 475838? 606867 What is the next term in 3974, 3869, 3774, 3695, 3638, 3609, 3614? 3659 What is the next term in -3773, -13382, -29395, -51818, -80657, -115918, -157607? -205730 What is next in -43840, -43775, -43592, -43231, -42632? -41735 What is the next term in 1929543, 3859058, 5788563, 7718052, 9647519, 11576958? 13506363 What is next in 18038, 18112, 18230, 18386, 18574, 18788, 19022, 19270? 19526 What comes next: -11422562, -11422623, -11422684, -11422745, -11422806, -11422867? -11422928 What comes next: 1210, 4303, 9490, 16795, 26242, 37855, 51658? 67675 What is the next term in -23, 3665, 13199, 31351, 60893, 104597, 165235, 245579? 348401 What is next in -1079, 1390, 7943, 20620, 41461, 72506, 115795, 173368? 247265 What comes next: -27628, -27669, -27734, -27835, -27984, -28193? -28474 What is next in -36087814, -72175621, -108263428? -144351235 What is next in -16278, -32765, -49252, -65739? -82226 What comes next: -7603, -30047, -67469, -119875, -187271, -269663, -367057, -479459? -606875 What is next in -1309414, -1309417, -1309420, -1309423, -1309426, -1309429? -1309432 What comes next: 7180960, 7180957, 7180954? 7180951 What is next in -3601622, -7203235, -10804846, -14406455, -18008062, -21609667? -25211270 What is next in 5528685, 44229385, 149274139, 353834973, 691083913? 1194192985 What is the next term in 798446, 798492, 798568, 798674, 798810, 798976, 799172? 799398 What is the next term in 38758, 37466, 36172, 34876, 33578, 32278? 30976 What comes next: -4154, -8251, -12280, -16235, -20110, -23899, -27596? -31195 What is the next term in -93933, -188914, -283885, -378840, -473773? -568678 What is the next term in -2400, -424, 1554, 3534, 5516, 7500? 9486 What is the next term in -27695, -100303, -221317, -390743, -608587, -874855? -1189553 What is next in 289746, 289763, 289782, 289803, 289826? 289851 What is next in -6080, -5266, -4452, -3638, -2824, -2010? -1196 What is next in -5746433, -11492881, -17239329? -22985777 What is next in -40517150, -40517146, -40517142? -40517138 What is next in 355075, 1420041, 3194989, 5679919, 8874831, 12779725, 17394601? 22719459 What comes next: -395756, -395730, -395704, -395678, -395652? -395626 What is next in -8485126, -8485139, -8485166, -8485213, -8485286, -8485391, -8485534? -8485721 What is next in 1121194, 1121281, 1121368? 1121455 What comes next: -1381, -2128, -3357, -5068, -7261? -9936 What comes next: 52341, 104674, 157003, 209328? 261649 What comes next: 1384, 3082, 5612, 9388, 14824, 22334, 32332? 45232 What comes next: -51, 1755, 4817, 9135, 14709? 21539 What is the next term in 11051, 11058, 11065, 11072, 11079? 11086 What comes next: -2205, -5379, -10665, -18063, -27573? -39195 What is next in -2629, -3763, -4915, -6091, -7297? -8539 What is the next term in -25054, -52159, -79264, -106369, -133474, -160579? -187684 What is the next term in -2708807, -10835262, -24379353, -43341080, -67720443, -97517442, -132732077? -173364348 What is the next term in -1326, -34, 2054, 4938? 8618 What is the next term in 3840, 3770, 3678, 3552, 3380, 3150, 2850, 2468? 1992 What is next in -34472, -69745, -105018, -140291? -175564 What is next in -842, -1963, -3832, -6449, -9814? -13927 What is next in -14093, -15347, -16601? -17855 What is next in 7293, 33651, 105177, 244449, 474045? 816543 What comes next: 7862785, 7862777, 7862763, 7862743, 7862717, 7862685? 7862647 What is next in -27526, -30110, -32694, -35278, -37862, -40446? -43030 What is next in -7819, -10416, -13011, -15604, -18195, -20784, -23371? -25956 What comes next: -1579, -12763, -43123, -102247, -199723, -345139? -548083 What comes next: -13620635, -13620630, -13620623, -13620614, -13620603, -13620590, -13620575? -13620558 What comes next: 196587500, 393175001, 589762502, 786350003? 982937504 What is next in 6038106, 6038056, 6038006, 6037956, 6037906, 6037856? 6037806 What is next in 111, 660, 1925, 4188, 7731, 12836, 19785, 28860? 40343 What comes next: -460910, -460930, -460964, -461018, -461098, -461210, -461360? -461554 What is the next term in -324, -985, -2496, -5283, -9772, -16389, -25560, -37711? -53268 What is next in 10439, 22972, 37591, 54290, 73063, 93904, 116807, 141766? 168775 What is next in 157110, 157055, 157000, 156945, 156890? 156835 What is next in 1122, 2387, 4330, 6945, 10226? 14167 What is next in -41296256, -165185004, -371666250, -660739994, -1032406236, -1486664976? -2023516214 What is the next term in -203256749, -203256742, -203256731, -203256716, -203256697, -203256674, -203256647? -203256616 What is the next term in 61, 299, 635, 1075, 1625, 2291? 3079 What is next in 13271, 14488, 15705? 16922 What is next in -2601, -2660, -2739, -2832, -2933, -3036, -3135? -3224 What is the next term in 137036, 137031, 137024, 137015, 137004, 136991, 136976? 136959 What comes next: 56770, 99963, 143156, 186349, 229542, 272735? 315928 What is next in 15588, 15816, 16196, 16728, 17412? 18248 What comes next: -984783, -984740, -984675, -984594, -984503, -984408, -984315? -984230 What is the next term in -13237, -12605, -11915, -11137, -10241, -9197, -7975, -6545? -4877 What is next in -55, 621, 1757, 3353? 5409 What is next in 1761825, 3523655, 5285485, 7047315, 8809145, 10570975? 12332805 What is the next term in 508343, 1016669, 1524995, 2033321, 2541647, 3049973? 3558299 What comes next: -38, -356, -1250, -3014, -5942? -10328 What is the next term in -1243, -1110, -863, -442, 213, 1162, 2465? 4182 What is the next term in 2083944, 4167899, 6251854, 8335809, 10419764? 12503719 What is the next term in 502, 584, 636, 622, 506, 252? -176 What is next in -11724545, -11724535,	{ "pile_set_name": "DM Mathematics" }
b of sequence fxaf when four letters picked without replacement from ffarxx? 1/90 What is prob of sequence aago when four letters picked without replacement from {g: 6, v: 3, o: 1, u: 1, j: 2, a: 2}? 1/2730 Calculate prob of sequence zz when two letters picked without replacement from hzhhhhzhhhhhhhhhhh. 1/153 Calculate prob of sequence txu when three letters picked without replacement from xtsqu. 1/60 What is prob of sequence lw when two letters picked without replacement from {w: 4, l: 4, h: 3}? 8/55 Calculate prob of sequence jj when two letters picked without replacement from ijjiiccjii. 1/15 Two letters picked without replacement from {p: 2, q: 1, y: 1, z: 7, e: 1, j: 2}. Give prob of sequence pq. 1/91 What is prob of sequence ssy when three letters picked without replacement from ygygyssy? 1/42 Three letters picked without replacement from xxxxeek. What is prob of sequence xee? 4/105 Three letters picked without replacement from {v: 1, l: 1, z: 1}. What is prob of sequence vzl? 1/6 What is prob of sequence az when two letters picked without replacement from zfqqfaqeqzqqzzqfe? 1/68 Three letters picked without replacement from {y: 1, h: 7, b: 1, d: 2, r: 8}. Give prob of sequence dhh. 14/969 What is prob of sequence dsps when four letters picked without replacement from {s: 2, d: 3, p: 6, l: 4}? 1/910 Two letters picked without replacement from oyaaowoaooooawlo. What is prob of sequence aa? 1/20 Three letters picked without replacement from ppptffhfftfptpwpw. What is prob of sequence wpp? 1/68 What is prob of sequence cby when three letters picked without replacement from {v: 2, a: 1, y: 2, c: 1, m: 1, b: 1}? 1/168 What is prob of sequence whv when three letters picked without replacement from {v: 1, h: 3, w: 3}? 3/70 Three letters picked without replacement from dfdtymdfffffl. Give prob of sequence mtf. 1/286 What is prob of sequence iisi when four letters picked without replacement from {i: 4, s: 10}? 10/1001 Two letters picked without replacement from {o: 5, w: 3, u: 7, r: 3, s: 1}. Give prob of sequence sr. 1/114 Calculate prob of sequence vv when two letters picked without replacement from vvsvvvsssv. 1/3 Three letters picked without replacement from {l: 5}. Give prob of sequence lll. 1 Two letters picked without replacement from {q: 17, b: 2}. What is prob of sequence qq? 136/171 Calculate prob of sequence pskp when four letters picked without replacement from {k: 2, s: 3, p: 4}. 1/42 What is prob of sequence jkjj when four letters picked without replacement from jjjjjjjjjjjk? 1/12 Two letters picked without replacement from {t: 1, p: 2, g: 2, s: 1, o: 1, a: 2}. What is prob of sequence pg? 1/18 Two letters picked without replacement from ababaaabaaaa. Give prob of sequence bb. 1/22 Three letters picked without replacement from {b: 2, e: 3, v: 3}. What is prob of sequence vvv? 1/56 Calculate prob of sequence uvy when three letters picked without replacement from kvhfvuyyhvyvv. 5/572 Two letters picked without replacement from {z: 3, c: 8}. Give prob of sequence zc. 12/55 Three letters picked without replacement from {z: 2, v: 10}. Give prob of sequence vvv. 6/11 Three letters picked without replacement from knsggnansgmkkamg. Give prob of sequence sna. 1/280 What is prob of sequence bbbb when four letters picked without replacement from {k: 12, b: 6}? 1/204 Calculate prob of sequence ttt when three letters picked without replacement from {k: 1, v: 1, m: 5, t: 10}. 3/17 Two letters picked without replacement from rrqrrrqrrrq. Give prob of sequence rr. 28/55 Two letters picked without replacement from {u: 1, p: 7, n: 5}. What is prob of sequence up? 7/156 What is prob of sequence nnns when four letters picked without replacement from nnsnnnnsnnnsnn? 45/364 Four letters picked without replacement from {y: 5, v: 1, p: 1, d: 2}. What is prob of sequence ddpv? 1/1512 Four letters picked without replacement from kfgffwfggwgwf. What is prob of sequence wkgg? 3/1430 Calculate prob of sequence ez when two letters picked without replacement from zezezzzzeeezeeee. 21/80 What is prob of sequence ney when three letters picked without replacement from {r: 1, e: 1, t: 1, n: 1, g: 2, y: 1}? 1/210 Three letters picked without replacement from rbdqpdbqbb. Give prob of sequence bbp. 1/60 Two letters picked without replacement from {e: 2, c: 5, d: 10, r: 3}. What is prob of sequence dd? 9/38 Calculate prob of sequence iuu when three letters picked without replacement from {g: 10, z: 1, i: 1, n: 1, u: 7}. 7/1140 Calculate prob of sequence of when two letters picked without replacement from {c: 2, o: 1, f: 3, h: 1, a: 2, y: 10}. 1/114 Four letters picked without replacement from zzulljllulzuj. What is prob of sequence ljul? 1/143 Calculate prob of sequence iii when three letters picked without replacement from {r: 9, i: 10}. 40/323 Two letters picked without replacement from {s: 7, b: 9}. Give prob of sequence sb. 21/80 Calculate prob of sequence nwif when four letters picked without replacement from wninnwiwnwiiwffiii. 7/1836 What is prob of sequence rc when two letters picked without replacement from {c: 2, q: 1, p: 1, r: 4}? 1/7 What is prob of sequence bl when two letters picked without replacement from {i: 1, o: 1, z: 1, l: 1, k: 2, b: 1}? 1/42 Three letters picked without replacement from fllflglllffllfffll. What is prob of sequence llf? 35/272 What is prob of sequence www when three letters picked without replacement from {m: 3, w: 4, h: 11, v: 1}? 4/969 Two letters picked without replacement from dyiyyoibdyyyybydyb. What is prob of sequence bd? 1/34 What is prob of sequence vcc when three letters picked without replacement from vcc? 1/3 Two letters picked without replacement from hshghhghgehhggshghg. Give prob of sequence gs. 7/171 What is prob of sequence ff when two letters picked without replacement from {u: 7, f: 2}? 1/36 What is prob of sequence nzn when three letters picked without replacement from zppzpnnpz? 1/84 What is prob of sequence gt when two letters picked without replacement from zdldzltzdgztdtydzttt? 3/190 Two letters picked without replacement from iimmmmmiiimimmmiii. Give prob of sequence ii. 4/17 What is prob of sequence vuvv when four letters picked without replacement from {v: 3, u: 3}? 1/20 Four letters picked without replacement from {n: 1, x: 6, e: 1, i: 3, m: 1}. What is prob of sequence nmxi? 1/660 What is prob of sequence om when two letters picked without replacement from {m: 8, f: 5, t: 2, o: 1}? 1/30 What is prob of sequence njk when three letters picked without replacement from {s: 2, i: 1, j: 1, n: 1, a: 1, k: 1}? 1/210 Two letters picked without replacement from {d: 1, b: 2, w: 1, l: 1, z: 1, g: 1}. Give prob of sequence gd. 1/42 What is prob of sequence rbmb when four letters picked without replacement from rbbrbrrrbrbrmbbrmr? 7/680 What is prob of sequence vrn when three letters picked without replacement from jzjrnvnrjmnjrr? 1/182 Two letters picked without replacement from {x: 1, q: 2, e: 3, o: 1, c: 1, y: 4}. What is prob of sequence cx? 1/132 Three letters picked without replacement from {s: 4, x: 2, g: 7}. What is prob of sequence xsx? 2/429 Four letters picked without replacement from jitttjtff. What is prob of sequence ftjt? 1/63 What is prob of sequence dy when two letters picked without replacement from {o: 1, p: 1, d: 11, y: 1, r: 1}? 11/210 Two letters picked without replacement from weeeeweeewe. What is prob of sequence ee? 28/55 Two letters picked without replacement from {a: 4, j: 1, w: 1, c: 4}. Give prob of sequence aw. 2/45 Four letters picked without replacement from {c: 1, a: 11, j: 3}. What is prob of sequence jjcj? 1/5460 Three letters picked without replacement from jcnsmnnncsnccusmm. What is prob of sequence mmn? 1/136 What is prob of sequence yy when two letters picked without replacement from {y: 5, d: 2}? 10/21 Calculate prob of sequence wa when two letters picked without replacement from awwaawawacwacawwwwa. 4/19 What is prob of sequence svvs when four letters picked without replacement from {v: 6, s: 2}? 1/28 Two letters picked without replacement from {c: 1, t: 12}. What is prob of sequence tt? 11/13 Three letters picked without replacement from ebnfngfbbnlnnen. What is prob of s	{ "pile_set_name": "DM Mathematics" }
84 divided by -4? 46 Divide 4 by -161. -4/161 -5 divided by -24 5/24 Calculate -674 divided by 6. -337/3 7 divided by 1270 7/1270 What is -84 divided by 28? -3 -7 divided by 1 -7 Calculate -142 divided by 16. -71/8 Calculate -2124 divided by 4. -531 -77 divided by 143 -7/13 1716 divided by 4 429 -1281 divided by 61 -21 Calculate 1845 divided by -123. -15 Divide -2 by 206. -1/103 -28 divided by -2 14 -4725 divided by -5 945 Divide 1440 by 3. 480 Divide 2 by -55. -2/55 657 divided by 3 219 Divide 5151 by 5151. 1 Divide -5 by 148. -5/148 86 divided by -6 -43/3 Divide -1080 by 5. -216 2786 divided by -1393 -2 -64 divided by -16 4 Divide 133 by 7. 19 What is 358 divided by 3? 358/3 Divide 2576 by -28. -92 Calculate 5 divided by -203. -5/203 Calculate -1017 divided by 113. -9 2 divided by 12 1/6 0 divided by -6 0 Divide 1363 by 5. 1363/5 Calculate -12 divided by 74. -6/37 What is 1 divided by 832? 1/832 What is 0 divided by 1017? 0 What is 140 divided by 140? 1 3420 divided by 9 380 What is -17400 divided by 6? -2900 Calculate 3 divided by -132. -1/44 Calculate 5950 divided by -425. -14 What is 22518 divided by -6? -3753 49 divided by 7 7 53180 divided by -5 -10636 What is 37182 divided by -6? -6197 What is -3265 divided by 653? -5 What is -81 divided by -11? 81/11 What is 3415 divided by 5? 683 1 divided by 290 1/290 Divide -6218 by -2. 3109 What is 5 divided by -32? -5/32 Calculate 0 divided by -10. 0 What is 62 divided by 3? 62/3 Divide 1892 by 172. 11 What is 890 divided by 12? 445/6 Calculate 19680 divided by -6. -3280 Calculate -242 divided by -11. 22 Divide -28 by -15. 28/15 What is 317 divided by 6? 317/6 Calculate 0 divided by 3040. 0 What is 836 divided by -418? -2 555 divided by 15 37 What is -1 divided by 117? -1/117 9836 divided by -4918 -2 What is 2 divided by 21? 2/21 Calculate -2795 divided by -1. 2795 Calculate -788 divided by -197. 4 Calculate 256 divided by 23. 256/23 -3975 divided by 1325 -3 Calculate 10 divided by 12. 5/6 198 divided by -22 -9 -58 divided by 2 -29 Divide 49932 by -3. -16644 1206 divided by -603 -2 -8 divided by 33 -8/33 Calculate -27 divided by 4. -27/4 What is 227 divided by -227? -1 Calculate 74 divided by 74. 1 -25900 divided by 175 -148 4 divided by -167 -4/167 Divide 8 by -75. -8/75 Divide 459 by -9. -51 Divide -111 by 3. -37 34 divided by 25 34/25 105 divided by -1 -105 What is -1471 divided by -3? 1471/3 -3080 divided by -40 77 Divide 11 by -28. -11/28 What is 21474 divided by 9? 2386 What is -62 divided by 2? -31 5919 divided by 5919 1 What is 0 divided by 272? 0 -1185 divided by 3 -395 Divide 3 by 2839. 3/2839 Calculate -228 divided by 228. -1 -1173 divided by 3 -391 Divide 11704 by -1672. -7 What is -8860 divided by 3? -8860/3 Calculate -19121 divided by -4. 19121/4 Divide 592 by 37. 16 Divide -7085 by 1417. -5 Calculate 2165 divided by 17. 2165/17 What is 144 divided by -48? -3 What is 2 divided by -13? -2/13 -121 divided by -5 121/5 What is 144 divided by -48? -3 What is -1 divided by 10? -1/10 Divide -18 by -100. 9/50 What is 2490 divided by -2? -1245 What is -470 divided by -94? 5 What is 804 divided by -804? -1 What is -474 divided by 3? -158 Calculate 0 divided by -96. 0 Divide 4420 by -5. -884 -60 divided by 39 -20/13 -1053 divided by -13 81 Calculate 0 divided by 58. 0 Calculate -258 divided by -1. 258 Divide 994 by 2. 497 -60 divided by 30 -2 Divide -222 by -2. 111 Divide 8290 by 1658. 5 What is -2582 divided by 2? -1291 Calculate -123 divided by -1. 123 What is 304 divided by -304? -1 Calculate -41 divided by 11. -41/11 What is -416 divided by -13? 32 What is 11954 divided by -2? -5977 What is -7965 divided by 9? -885 -8436 divided by -2109 4 -18 divided by -874 9/437 -3 divided by 146 -3/146 3590 divided by 718 5 Calculate 1255 divided by 251. 5 Calculate -5 divided by -14. 5/14 Divide -290 by 2. -145 Divide 3 by 24. 1/8 Divide -60 by -12. 5 Divide -6 by 63. -2/21 7521 divided by -2 -7521/2 Divide 88002 by -6. -14667 Calculate -392 divided by -6. 196/3 Divide -435 by -3. 145 What is 282 divided by 1? 282 Divide -4476 by -6. 746 What is -1032 divided by 1? -1032 Divide -49 by 11. -49/11 90 divided by 6 15 -66 divided by -3 22 -2604 divided by 4 -651 Calculate -1540 divided by 77. -20 Calculate 85556 divided by -4. -21389 Calculate 753 divided by 6. 251/2 Divide 15 by 322. 15/322 -2115 divided by 4 -2115/4 5 divided by 73 5/73 -55 divided by 2 -55/2 Divide 2158 by -83. -26 What is -148 divided by 74? -2 Divide -41 by 1. -41 Calculate 4 divided by -394. -2/197 Divide -914 by 1. -914 Calculate -1 divided by 2143. -1/2143 Divide 2 by -89. -2/89 14808 divided by -6 -2468 Calculate 35 divided by 7. 5 Calculate 9710 divided by 4855. 2 What is 1005 divided by -2? -1005/2 Divide -520 by 5. -104 Calculate 102 divided by -18. -17/3 What is -2080 divided by 160? -13 Calculate -6 divided by -50. 3/25 What is 74 divided by 1? 74 5857 divided by 4 5857/4 Calculate -404 divided by -101. 4 Calculate 363 divided by -121. -3 Divide -6 by -1242. 1/207 Calculate 729 divided by 3. 243 Calculate -18894 divided by -6. 3149 -124 divided by -62 2 Calculate -6 divided by 20. -3/10 Divide -29 by -133. 29/133 -4953 divided by 1651 -3 Calculate 14640 divided by 3660. 4 Calculate 1 divided by -1634. -1/1634 Divide 9 by -582. -3/194 Divide 11 by -15. -11/15 Divide -1164 by -582. 2 Divide 762 by 3. 254 Divide -1 by 131. -1/131 Calculate 27700 divided by -554. -50 -801 divided by 3 -267 -3912 divided by -24 163 -478 divided by -14 239/7 -6450 divided by -5 1290 135 divided by -27 -5 -4 divided by -868 1/217 Calculate 4 divided by 54. 2/27 -267 divided by -89 3 -10450 divided by -10 1045 Calculate 214 divided by 2. 107 Calculate 1208 divided by -2. -604 140 divided by -20 -7 1210 divided by 242 5 0 divided by -7681 0 Calculate 2 divided by -69. -2/69 What is -244 divided by -18? 122/9 What is -15 divided by 3? -5 Divide -419 by -1. 419 Divide -3 by -7. 3/7 Divide -408 by 5. -408/5 Divide 2800 by -100. -28 7 divided by -21 -1/3 What is 2 divided by -24? -1/12 Calculate 14580 divided by 1. 14580 What is 1430 divided by -22? -65 Calculate 556 divided by 4. 139 What is -26188 divided by -4? 6547 56 divided by -4 -14 -29330 divided by 1 -29330 What is -3693 divided by 6? -1231/2 What is -1356 divided by -452? 3 Calculate -43 divided by 63. -43/63 Divide 3327 by -3327. -1 -108 divided by 2 -54 Divide -234 by -78. 3 What is 980 divided by 4? 245 What is -50 divided by 5? -10 Calculate -1080 divided by 12. -90 What is -37230 divided by -5? 7446 What is -199 divided by 7? -199/7 Calculate -2 divided by 142. -1/71 -5 divided by -274 5/274 What is -4037 divided by 11? -367 Divide -2 by 85. -2/85 -12645 divided by 5 -2529 Divide 0 by -31. 0 Calculate 4 divided by -55. -4/55 2 divided by 1 2 What is 246 divided by -6? -41 What is 180 divided by -36? -5 Divide 72 by -12. -6 Calculate 1 divided by -51. -1/51 Calculate 37 divided by -23. -37/23 Divide 158 by 79. 2 5 divided by -63 -5/63 What is -2280 divided by -4? 570 2548 divided by -11 -2548/11 1520 divided by -5 -304 Divide 1974 by 21. 94 What is 5 divided by -35? -1/7 Divide -1220 by -5. 244 Divide 1456 by 28. 52 What is -280 divided by 8? -35 Divide 6600 by -55. -120 1364 divided by -31 -44 Calculate 2095 divided by -1. -2095 Calculate -55 divided by 12. -55/12 Calculate -42 divided by -42. 1 What is 2 divided by 1431? 2/1431 What is 168 divided by -3? -56 1 divided by -124 -1/124 1060 divided by -212 -5 -5 divided by 23 -5/23 What is 250 divided by 20? 25/2 -171 divided by -1 171 Divide 91 by 7. 13 Divide 1 by 4244. 1/4244 Calculate -8160 divided by -4080. 2 Divide 20 by 645. 4/129 72 divided by 5 72/5 Divide -1852 by -4. 463 Divide -57 by 6. -19/2 517 divided by 1 517 What is -460 divided by -5? 92 Divide 650 by 13. 50 332 divided by -166 -2 Divide 33 by -33. -1 181 divided by -5 -181/5 What is 3 divided by 511? 3/511 -4480 divided by 280 -16 -230 divided by -5 46 Calculate -94 divided by -2. 47 Calculate 16896 divided by 704. 24 Calculate 11 divided by 675. 11/675 Divide -1123 by -2. 1123/2 What is 924 divided by -42? -22 Divide 1 by 425. 1/425 -2 divided by -3 2/3 What is -760 divided by 8? -95 What is -2340 divided by 585? -4 Divide 9111 by -3. -3037 What is -4670 divided by 5	{ "pile_set_name": "DM Mathematics" }
earest to -2 in 0.3, 2, 1711? 0.3 Which is the closest to 2/7? (a) -3/7 (b) 137 (c) -4/3 (d) 3 (e) 2/5 e Which is the nearest to 0? (a) -4 (b) -4396 (c) 5 (d) -2 d Which is the closest to -0.2? (a) 1/3 (b) -2 (c) -0.1902 (d) -33 c Which is the nearest to 1/8? (a) -2/17 (b) 3 (c) -8 (d) -1/72 d Which is the closest to 1? (a) -21 (b) -0.024 (c) -0.038 (d) -5 b Which is the closest to -3/4? (a) -2/81 (b) 1.9 (c) 10 a What is the closest to 0.06 in 1.21, -20, -3? 1.21 Which is the closest to -1? (a) -5 (b) -3/8 (c) -0.1 (d) 3/1409 (e) 1/3 b What is the closest to -3/17 in 0, -3, -61? 0 What is the nearest to 4/35 in 5/4, -1, -2? -1 Which is the nearest to -1/3? (a) 0 (b) -19048 (c) -0.5 c Which is the closest to 1? (a) 86 (b) -19 (c) 4 (d) -2/21 d Which is the nearest to -1? (a) -5 (b) -10.7 (c) -0.01 (d) 2 c What is the closest to -14 in 10.8, -3, 2/9? -3 Which is the nearest to 41? (a) 15 (b) 1/2 (c) -2/5 a What is the nearest to 5/172 in 0.109, 1/2, 0? 0 Which is the nearest to -590? (a) -0.1 (b) -1/5 (c) 0.4 (d) 0 b Which is the closest to -3? (a) -12 (b) 22 (c) 44 a Which is the nearest to -0.1? (a) 0 (b) -1 (c) 161 (d) -1/4 a What is the nearest to 2 in -3, 108, 0.2, -0.1, -41? 0.2 Which is the nearest to 2? (a) 2/5579 (b) 0.05 (c) -9 b What is the nearest to 0.095 in -1, -2/11, 10/7, 3/8? -2/11 Which is the nearest to 0.5? (a) 5 (b) 6/11 (c) -168 b What is the closest to 31 in -1.2, 0.04, 2/3, 4? 4 What is the nearest to -4 in 3, 1, 0, -0.08, -1/3? -1/3 What is the nearest to 3 in -1/4, -63, 1/6, -11/6? 1/6 What is the nearest to -1 in -0.5, -5, -2.14, -9? -0.5 What is the nearest to -1 in -354, -3, -26, 4, 0.3? 0.3 What is the nearest to -4 in -2, -10, 30, 3? -2 What is the nearest to 0.5 in 7, 11, -4? -4 What is the nearest to 0 in 0.1, -1/3, 4/5, -29, 314? 0.1 Which is the closest to 0? (a) -6 (b) 0.5 (c) -0.2 (d) 2 (e) -2/865 e Which is the nearest to 2/69? (a) 1/4 (b) 28/5 (c) -0.4 (d) 1 a Which is the nearest to 2? (a) 5/6 (b) -2/19 (c) -0.042 (d) 1/6 (e) -26 a What is the closest to 3/85 in 11, 2, -23? 2 Which is the nearest to -2? (a) 5 (b) 0.0811 (c) -2 (d) 1 (e) 4 c Which is the nearest to -2/7? (a) 0.31 (b) 0.3 (c) 0 (d) 5/8 c What is the closest to -9.1 in 4, -0.1, 1, -6? -6 Which is the closest to 9? (a) -0.5 (b) 0.4 (c) 5 (d) 640 c What is the nearest to 18 in -2/17, -2/5, -164, 0.2? 0.2 Which is the closest to 1/4? (a) -0.5 (b) 0.4 (c) -4 (d) -10/17 b What is the nearest to -2/3 in -1/4, -0.5, 220/7, 1, 3? -0.5 Which is the closest to -2/57? (a) -2 (b) 1/3 (c) 8 (d) -2/15 (e) 0.4 d What is the nearest to 0 in 10, 1.79, -2/19, -2/11? -2/19 What is the nearest to 0.2 in 1, 98, 3/14, 0.4, -1/5? 3/14 What is the nearest to -2 in -0.2, 3/5, 1.05, 5? -0.2 What is the closest to 0 in -2/13, -2, 152, 1/10? 1/10 Which is the closest to 0.1? (a) 0.87 (b) 5/2 (c) -1/2 (d) 12 c What is the nearest to 16.6 in 2/15, 2/9, 0.6, 2? 2 Which is the nearest to 9? (a) 0.07865 (b) 0.4 (c) 2/9 (d) 2/11 (e) 2/15 b Which is the nearest to -1/4? (a) -2/7153 (b) -0.036 (c) 0.2 b Which is the closest to -5/4? (a) -2 (b) 2 (c) -3 (d) -273 a What is the nearest to -0.2 in -257, 1/8, -7/4? 1/8 Which is the nearest to 1079? (a) 3 (b) 5 (c) -4 b Which is the nearest to 0.3? (a) 0.3 (b) -1 (c) -15 (d) -0.2 (e) 0.041 a What is the nearest to 63 in -0.5, 2/23, -1/9, 0.05, -0.6? 2/23 Which is the nearest to -712? (a) -1 (b) 9/5 (c) 0 a Which is the nearest to -3? (a) 32/37 (b) -7 (c) 0.2 c Which is the closest to 0? (a) 35 (b) 509 (c) -4 c Which is the nearest to -3/85? (a) 1 (b) -0.1 (c) 10 b Which is the nearest to 0.1? (a) 0.22 (b) -1/59 (c) 1/6 c Which is the nearest to -1/5? (a) -3 (b) 46 (c) 1.667 (d) 3 (e) -1/6 e What is the closest to -255/76 in 1, -0.4, 1/4, 5? -0.4 Which is the closest to -5/17826? (a) 4 (b) 2 (c) -2/15 (d) 3/4 (e) -2/7 c What is the nearest to -11 in -0.15, 13, -5, 0.4? -5 Which is the nearest to 0? (a) -4 (b) -1 (c) 11/3 (d) -0.2 d What is the closest to 0.03 in -0.2, 0, 5, 615, -1/8? 0 What is the closest to -8 in 2/11, 65, 2/141? 2/141 Which is the closest to -1/3? (a) 1/3 (b) 0 (c) 2/9745 (d) -1/7 d Which is the closest to 4? (a) 0 (b) 0.3 (c) 5 (d) -0.6245 (e) -2 c Which is the closest to -1/63? (a) -3 (b) 2.9 (c) -3.4 b Which is the closest to -10? (a) 159/8 (b) 2 (c) 0.4 c What is the closest to 0.1 in 2/13, -0.03, 9.9? 2/13 What is the closest to 0.3 in -1, -0.15, -1/7, -0.01, -2/9? -0.01 What is the nearest to -6 in 0.1, -39.15, 5? 0.1 Which is the closest to -1/3? (a) -4/5 (b) 0.5 (c) -5/16 (d) 0.05 c Which is the closest to 0? (a) 3/22 (b) 3 (c) -5 (d) 2/7 a Which is the closest to 2? (a) -1 (b) -2 (c) 81833 a Which is the nearest to -1? (a) -10.5 (b) 0 (c) -20 b What is the closest to -0.06 in 3/14, 1, -14? 3/14 What is the closest to 342 in -2/3, -5, 0.6? 0.6 What is the closest to -1 in -2.5, -3.4, 0.3, 0.28? 0.28 What is the closest to -2 in -59, -74, 2, -2? -2 Which is the nearest to 1/2? (a) -3.1 (b) -0.105 (c) 115/6 b What is the nearest to 0.1 in -43, -5, 2/3, -3? 2/3 What is the nearest to -2/39 in 0.3, -2, 2/5, 101/2? 0.3 What is the closest to -2/5 in 88, -4, -2/9? -2/9 Which is the nearest to 0? (a) 0.2 (b) 2/13 (c) 2 (d) 1/126 (e) 21 d Which is the nearest to 0.1? (a) -0.1 (b) 3 (c) 2 (d) -2/13 (e) 0.045 e Which is the nearest to -2? (a) 4 (b) -121/2 (c) 2/3 c What is the nearest to 2 in -1780, -3, -5, 4/3, 0.3? 4/3 Which is the closest to 0.08? (a) 1/2 (b) 0.01 (c) 20.1 (d) 3 (e) -0.3 b What is the closest to -1111 in -22, 5, 0.4? -22 Which is the nearest to -1? (a) 23/10 (b) 151 (c) -0.3 (d) -1/6 c Which is the closest to 514.1? (a) -0.3 (b) 3/8 (c) -4/9 b Which is the closest to 121? (a) -1/6 (b) -2 (c) 10 c Which is the nearest to -2.61? (a) -0.5 (b) 0.03 (c) -3/10 (d) 1/2 (e) 0.3 a Which is the nearest to -0.3? (a) -0.31 (b) 1.5 (c) 2/3 (d) -17 a What is the nearest to 0.5 in 0.5, -11, 0.4, 2? 0.5 Which is the closest to 0.06? (a) 5 (b) -0.28 (c) -3.7 b Which is the closest to 1? (a) 1.5 (b) 0 (c) 7/8 c Which is the nearest to 1? (a) -1/8 (b) -0.3 (c) 1 (d) 2/25 (e) 3/11 c What is the nearest to -12 in 0.1, -1/5, 0, 5? -1/5 Which is the closest to -0.1? (a) 2/15 (b) -2 (c) 7 (d) -4 (e) -4/225 e What is the closest to 1 in -8377, 3, -2? 3 Which is the nearest to 3? (a) 4 (b) 0.067 (c) -30 a Which is the nearest to 0.2? (a) 61 (b) -3 (c) 0.0537 c Which is the nearest to 4? (a) -0.048 (b) 1 (c) -1.8 (d) 3 d Which is the closest to 10? (a) -3 (b) -1/3 (c) -5.2 b Which is the nearest to -28? (a) -4 (b) 0 (c) 1 (d) -9/4 (e) 103/2 a What is the nearest to 0 in -3/7, 2, 0, -2/15, -1/6? 0 Which is the nearest to 2014? (a) -0.4 (b) 1/3 (c) 2 (d) -4 (e) 0.5 c Which is the closest to -192? (a) -0.3 (b) -0.2 (c) 27 (d) 4 a What is the closest to -2/3 in -0.0476, -0.4, 1? -0.4 Which is the closest to -9? (a) 0.9 (b) 16 (c) -3 c Which is the closest to -3/2? (a) 1/10 (b) -1/68 (c) -14 b What is the closest to 11 in 263, -0.1, -0.025? -0.025 What is the nearest to 56 in -2, 0.1, -0.4, 6? 6 Which is the closest to 3630? (a) 1/4 (b) 10 (c) -0.1 b Which is the closest to 1? (a) -3 (b) 8 (c) 6/7 (d) -17 c What is the nearest to 1 in -47, 1, 1/3, 4, -13? 1 What is the closest to -9/7 in -1, -79, 2? -1 Which is the closest to -3/7? (a) -5/6 (b) -4 (c) 1/2 (d) 5 (e) -0.04 e What is the nearest to 2 in -2/3, -0.4, 0.1, 0.111, 2/35? 0.111 Which is the nearest to 46? (a) -4 (b) 17/2 (c) -1 (d) -1/3 b Which is the closest to 4563? (a) 1/2 (b) -6 (c) -3 (d) 1/4 a Which is the nearest to -6? (a) -5 (b) -9 (c) 0.0477 (d) 0.1 a Which is the closest to -1/4? (a) 47 (b) -5 (c) -0.3 (d) -0.4 c What is the closest to -603 in 0.07, -1, 3, -0.3? -1 What is the nearest to 2/3 in -7/3, 5, 54, -10, 0.07? 0.07 What is the closest to 11.02 in -0.4, 0.4, 1/5? 0.4 Which is the closest to 27? (a) -3 (b) -10 (c) 2 (d) 3/4 c Which is the nearest to 5/23? (a) 0.26 (b) 0.05 (c) -1 a Which is the nearest to -0.15? (a) 16 (b) -3 (c) -0.04 (d) -1 c Wha	{ "pile_set_name": "DM Mathematics" }
aq? 1/6 Four letters picked without replacement from yterpbt. What is prob of sequence tyeb? 1/420 What is prob of sequence ii when two letters picked without replacement from milii? 3/10 Four letters picked without replacement from ussuuuusuuuuuuss. What is prob of sequence uusu? 165/1456 Two letters picked without replacement from {i: 2, y: 10, h: 2}. Give prob of sequence hh. 1/91 Four letters picked without replacement from {e: 6, h: 4}. What is prob of sequence hhee? 1/14 Three letters picked without replacement from {h: 3, m: 4}. Give prob of sequence mhh. 4/35 Two letters picked without replacement from lqgqqgqlq. Give prob of sequence gq. 5/36 Four letters picked without replacement from {l: 4, d: 2, i: 2, s: 11}. What is prob of sequence ddsl? 11/11628 Two letters picked without replacement from {l: 1, i: 3, p: 2, b: 1, m: 5}. What is prob of sequence lm? 5/132 Calculate prob of sequence ypl when three letters picked without replacement from ybbiilbpyib. 1/495 Four letters picked without replacement from jjdjjjdjjjd. Give prob of sequence jjjj. 7/33 Three letters picked without replacement from {b: 7}. Give prob of sequence bbb. 1 Four letters picked without replacement from yynyynyyyyqnynnny. Give prob of sequence ynyq. 9/952 Two letters picked without replacement from {k: 2, p: 5, o: 2}. Give prob of sequence oo. 1/36 Three letters picked without replacement from sssvspsksksssksstk. What is prob of sequence kpv? 1/1224 What is prob of sequence ggqq when four letters picked without replacement from qggggqgqgggg? 2/55 Four letters picked without replacement from jjjoxyjjjxjjotjjoxo. Give prob of sequence jxyj. 15/5168 What is prob of sequence zzff when four letters picked without replacement from {a: 2, z: 3, f: 12}? 33/2380 What is prob of sequence bfff when four letters picked without replacement from {b: 1, f: 6, k: 11}? 1/612 What is prob of sequence jqqj when four letters picked without replacement from jjjjjjqjjqjjj? 1/78 Three letters picked without replacement from llllll. Give prob of sequence lll. 1 Two letters picked without replacement from uuuguuuhggggghu. What is prob of sequence ug? 1/5 Four letters picked without replacement from {d: 9, v: 4, o: 1}. What is prob of sequence vovv? 1/1001 What is prob of sequence tt when two letters picked without replacement from {t: 2, n: 1}? 1/3 Calculate prob of sequence lmll when four letters picked without replacement from umuhuuumllul. 1/990 Two letters picked without replacement from zqzszzcssss. Give prob of sequence qz. 2/55 Three letters picked without replacement from ahoeaoagdaeoeo. What is prob of sequence hed? 1/728 What is prob of sequence nn when two letters picked without replacement from nunnnnnnu? 7/12 Three letters picked without replacement from rrviiiiroo. What is prob of sequence rvi? 1/60 Four letters picked without replacement from heheyhyeyeje. Give prob of sequence hyyh. 1/330 What is prob of sequence nvvn when four letters picked without replacement from {l: 1, k: 1, n: 1, w: 1, v: 1}? 0 Three letters picked without replacement from eetzz. What is prob of sequence eze? 1/15 What is prob of sequence ooo when three letters picked without replacement from {o: 6, x: 2}? 5/14 What is prob of sequence do when two letters picked without replacement from {f: 3, o: 5, z: 1, g: 2, d: 1}? 5/132 Two letters picked without replacement from wbbhhwhee. What is prob of sequence wb? 1/18 Three letters picked without replacement from llmllllllhmllhl. What is prob of sequence hlm? 22/1365 What is prob of sequence wdda when four letters picked without replacement from {d: 2, a: 1, w: 1, r: 1, u: 1, m: 1}? 1/420 What is prob of sequence lb when two letters picked without replacement from {g: 5, k: 3, l: 2, y: 1, b: 7}? 7/153 What is prob of sequence riri when four letters picked without replacement from {i: 7, r: 2}? 1/36 Three letters picked without replacement from dpptsmdtmtmpstdptds. Give prob of sequence ttm. 10/969 Two letters picked without replacement from dldddjj. What is prob of sequence ld? 2/21 Three letters picked without replacement from {l: 6}. What is prob of sequence lll? 1 Two letters picked without replacement from {l: 1, z: 1, t: 2}. What is prob of sequence lt? 1/6 What is prob of sequence yn when two letters picked without replacement from {n: 4, r: 3, y: 2}? 1/9 What is prob of sequence qisi when four letters picked without replacement from {i: 2, p: 1, s: 1, q: 1}? 1/60 What is prob of sequence gn when two letters picked without replacement from {n: 1, g: 3, w: 3, y: 1, d: 3}? 3/110 Two letters picked without replacement from {r: 2, w: 2, u: 1, h: 1, x: 1}. Give prob of sequence xx. 0 Three letters picked without replacement from {h: 5, n: 5, s: 1, b: 4, o: 1}. What is prob of sequence snh? 5/672 Two letters picked without replacement from keeeekeeeee. Give prob of sequence ke. 9/55 Two letters picked without replacement from zzzzwzzucwuzwfuzzcu. Give prob of sequence zu. 2/19 Calculate prob of sequence hi when two letters picked without replacement from hffihfhfifiihii. 4/35 Three letters picked without replacement from {c: 2, o: 2, v: 2}. What is prob of sequence ovv? 1/30 What is prob of sequence cv when two letters picked without replacement from {v: 4, c: 7}? 14/55 Two letters picked without replacement from qzozoozdqdz. Give prob of sequence zq. 4/55 Two letters picked without replacement from xmxmw. What is prob of sequence xm? 1/5 Three letters picked without replacement from wmw. Give prob of sequence mww. 1/3 Two letters picked without replacement from {p: 3, f: 4, r: 5, o: 1, u: 5}. Give prob of sequence fp. 2/51 Four letters picked without replacement from {f: 2, m: 1, g: 4}. Give prob of sequence mmfm. 0 What is prob of sequence ll when two letters picked without replacement from {l: 7, r: 2}? 7/12 What is prob of sequence ooi when three letters picked without replacement from {l: 1, i: 1, q: 2, g: 1, o: 5}? 1/36 Three letters picked without replacement from {d: 6, p: 6, z: 4, e: 1}. Give prob of sequence dzp. 3/85 What is prob of sequence qhx when three letters picked without replacement from {q: 1, y: 3, x: 3, h: 3}? 1/80 What is prob of sequence rhq when three letters picked without replacement from {r: 1, q: 1, i: 2, p: 2, h: 1, x: 1}? 1/336 What is prob of sequence vos when three letters picked without replacement from {d: 2, s: 2, o: 3, v: 4}? 4/165 Two letters picked without replacement from iif. Give prob of sequence if. 1/3 What is prob of sequence jjnn when four letters picked without replacement from jjnnjjjj? 1/28 Calculate prob of sequence ne when two letters picked without replacement from {t: 3, n: 4, g: 9, e: 2}. 4/153 Two letters picked without replacement from {d: 1, z: 2, k: 3, g: 2, p: 3, c: 3}. Give prob of sequence zd. 1/91 Three letters picked without replacement from gsgsgsffcgs. What is prob of sequence sgf? 16/495 Three letters picked without replacement from {v: 1, e: 1, u: 2, k: 2, x: 1}. What is prob of sequence xex? 0 What is prob of sequence tttp when four letters picked without replacement from cttctgtpopp? 1/110 Calculate prob of sequence jjrr when four letters picked without replacement from {j: 2, s: 1, r: 1}. 0 Two letters picked without replacement from lzlzlllllllll. Give prob of sequence zl. 11/78 Calculate prob of sequence cdd when three letters picked without replacement from {c: 13, d: 3}. 13/560 Calculate prob of sequence bbcc when four letters picked without replacement from {t: 2, b: 2, c: 4}. 1/70 Three letters picked without replacement from {f: 5, j: 1, x: 1, t: 3, s: 3, r: 1}. What is prob of sequence fff? 5/182 Calculate prob of sequence kskk when four letters picked without replacement from {s: 1, k: 12}. 1/13 Calculate prob of sequence hh when two letters picked without replacement from {s: 4, p: 8, h: 4}. 1/20 Two letters picked without replacement from ijdtimv. Give prob of sequence dm. 1/42 Four letters picked without replacement from ssiiiiiidddvmissdvdd. What is prob of sequence sidi? 14/1615 Two letters picked without replacement from {k: 1, n: 1, g: 1}. What is prob of sequence kg? 1/6 Three letters picked without replacement from rrfrffrrrrrrrfrfrrr. What is prob of sequence frr?	{ "pile_set_name": "DM Mathematics" }
- 16 = -p. Suppose 2z + d = 11, d + f = z - 4d. What is the units digit of z? 6 Let f = -10 - -6. Let k = f + 7. Suppose 2g + kg = 15. What is the units digit of g? 3 Let p = 13 - 23. What is the units digit of p/3(-3)/2? 5 Let h(l) = l + 11. Let t be h(-8). Suppose -tp = -36 - 30. What is the tens digit of p? 2 Let o(s) = 5s2 - 8s - 1. Let a be o(-4). What is the units digit of (6/(-18))/((-1)/a)? 7 What is the units digit of (-13)/(32/12 + -3)? 9 Let p be ((-10)/(-3))/(12/18). Suppose -py = -2y - 135. What is the tens digit of y? 4 Let y be (3/3 - 2)-2. Let d be 0(1 - (1 + 1)). Suppose -5c + a = -28, -26 = -dc - 4c + ya. What is the units digit of c? 5 Suppose -5v - 2 = -12. Let t(b) = 5b*3 + 2b*2 + 2b - 3. What is the units digit of t(v)? 9 Suppose -9i + 13i = 152. What is the units digit of i? 8 Let b = -9 + 19. What is the tens digit of b? 1 Suppose -k - 47 = -2k. What is the units digit of k? 7 Suppose -10 = 2u + 2x, -1 = u - 4x + 9. What is the units digit of 17/3 - 2/u? 6 Let x = 96 - 48. Suppose -d = 3d - x. What is the tens digit of d? 1 Let b = -2 - -3. Let v be b/(-4) - 245/(-20). Suppose 42 - v = 3n. What is the units digit of n? 0 Let o(j) = j - 2. Let c = 2 - 0. Let p be o(c). Suppose n = -py + 4y - 26, 5y - 33 = n. What is the units digit of y? 7 What is the units digit of ((-48)/40)/(4/(-30))? 9 Let k(m) = m3 + 10m*2 + 6m - 8. Let n = -19 + 10. What is the units digit of k(n)? 9 Let a be (-4)/(-14) + (-246)/(-21). Suppose a = 2g + g. What is the units digit of g? 4 Suppose 5p - 26 = -0p + 4q, 0 = 3p - 4q - 22. Let s be (-1 - p)/((-1)/3). Suppose -3l + s = -24. What is the tens digit of l? 1 Suppose -2q + 15 = q. Suppose 0 = -a + qa - 36. What is the units digit of a? 9 Suppose 5q + 4u - 3u - 565 = 0, -q - 5u = -113. What is the hundreds digit of q? 1 Suppose 7y = 5y + 98. What is the units digit of y? 9 Let v = -366 + 564. What is the hundreds digit of v? 1 Let m(u) = -2u + 2. Let y be m(-10). Suppose 69 - y = k. What is the units digit of k? 7 Suppose 2g + k - 4k - 18 = 0, g - 3k = 15. Suppose 3 + g = 3f. What is the units digit of f? 2 Suppose -5w = 2g + 2g - 888, -5w - 666 = -3g. Suppose -6y + 2y = -u - 182, 5y - g = 4u. What is the tens digit of y? 4 Let n(m) = m3 + 3m*2 - m + 4. Let w be n(-3). Suppose 4h = w - 3, 4h + 44 = 4v. What is the units digit of v? 2 Suppose p + 4v + 16 = 0, -2v = -p + v + 19. What is the units digit of p? 4 Let y(k) = -k3 + k2 + 2. Let r be y(0). Let w(t) = t - 2. Let s be w(r). Suppose s = -4i - 17 + 57. What is the tens digit of i? 1 Suppose u - 2 - 4 = 0. Suppose 4j + 16 = -2q, -4j + 2q + 3 - 35 = 0. Let c = u - j. What is the tens digit of c? 1 Let m(v) = -v2 - 9v + 10. Let z be m(-11). Let j = 13 + z. What is the units digit of j? 1 Let i(g) = 4g - 1. What is the units digit of i(12)? 7 Let w be (-2)/20/(-2). Suppose w = -3c - c + 172. What is the units digit of c? 3 Let t be (-66)/(2 + -5) - 0. Suppose -4k + 5w = -44, t = 4k - 2k + 3w. What is the units digit of k? 1 Suppose -d = q - 67, 0d = d - 4q - 87. What is the units digit of d? 1 Suppose -2u + 3u = 5. Suppose 0 = 3r - 4 - u. What is the units digit of r? 3 Let r(v) = 4v*2 + 2v + 1. Let m be r(-1). Suppose -7i + mi = 36. What is the units digit of (-3)/(i/(-3)) + 3? 2 Let b be 175/(-28) - 1/(-4). Let s be -2(-3 - (-57)/b). Suppose 2a = -3a + s. What is the units digit of a? 5 Let h = 5 + -5. Let k(m) be the third derivative of m5/60 - m4/24 + m3 - 3m2. What is the units digit of k(h)? 6 Let n(h) = -h2 - 2h - 5. Let v be n(-7). What is the tens digit of v/(-3) - 4/(-6)? 1 Let g(n) = n3 - 3n*2 - 5n - 4. Let l(h) = h - 9. Let o be l(14). What is the units digit of g(o)? 1 Suppose 3u = -3r, -2u - 3r - 1 = -0. Let z = 7 + u. Let w = 0 + z. What is the units digit of w? 8 Let q(y) = -3y2 - 16 + y + 3y + 10y + 2y2. Let c = -4 - -16. What is the units digit of q(c)? 8 What is the units digit of 12/60 - (-208)/10? 1 Let j(x) = x2 + 2x + 3. Let m be 10/45 + (-20)/9. What is the units digit of j(m)? 3 Suppose -2c + 3o + 28 = 9, -5o - 25 = -2c. Suppose -3v = u - 2u - 4, cu - 12 = -v. What is the units digit of u? 2 Let u(m) = 13m2 + m + 5. What is the hundreds digit of u(3)? 1 Suppose 3v - 32 = 97. What is the units digit of v? 3 Let x be -5((-232)/20 + -2). Let l = x - 40. What is the units digit of l? 8 Let k(b) = -5b. Let r be k(-1). Suppose rn = -25, -h + n = 4 - 2. Let p = 12 + h. What is the units digit of p? 5 Let i(y) = y2 + 3y + 2. Let z be i(-3). Suppose 2x - 5x - 21 = -zl, -4l + 4x + 36 = 0. What is the units digit of l? 6 Let y = 19 + -22. What is the units digit of (-3)/(0 + y) - -9? 0 Let i = -300 + 439. What is the hundreds digit of i? 1 Let z be (-3 - 15/(-6))-24. What is the units digit of (-1 - -2)/(4/z)? 3 Let s(j) = -9j2 + j. Let r(w) = -8w*2 + w. Let g(f) = -7r(f) + 6s(f). Suppose -2u + 4o - 12 = 0, 4u - 3o + 2 = -u. What is the units digit of g(u)? 6 Suppose -2t - 10 = 0, -4t = -3w - 0w - 1. Let p = w - -27. What is the units digit of p? 0 Let f = 142 + -79. What is the tens digit of f? 6 Let z = -8 - -13. Let h = 46 - 30. Suppose zb + h = 61. What is the units digit of b? 9 Suppose 0 = v - 4 - 4. Suppose 4b = 5c - 34, -b - 10 = -0b - 2c. Let h = v + b. What is the units digit of h? 2 Suppose -3k + 5 + 1 = 0. Suppose -3r + 2t + 2 = -kr, t - 26 = -4r. What is the units digit of r? 6 Suppose 0 = 5p + 3c + 5, c + 2 = -2p + 3c. What is the units digit of -5(56/(-20) - p)? 9 Let h(c) = -2c3 - c2 + 5c + 4. What is the units digit of h(-4)? 6 Let y = 83 - -25. What is the hundreds digit of y? 1 Suppose 3r + j = 2j + 306, -j - 104 = -r. What is the tens digit of r? 0 Suppose -2s = -s - 3. Suppose sm = -m - 16. What is the tens digit of m/(-10) + (-272)/(-20)? 1 Let i = -3 + -4. Let v = i + 10. Suppose 10 = vr - 5. What is the units digit of r? 5 Suppose 2f = -t + 224, 2t - 4f = -9f + 448. What is the hundreds digit of t? 2 Suppose 0 = -3n - 0n + 18. Let m = n - -13. What is the tens digit of m? 1 Suppose -3h + 3k - 4 = -19, -3 = -3h - k. Suppose g + 48 = 2s - g, -4s + hg = -90. What is the units digit of s? 1 Let x(i) = 3i*3 - 3i*2 - 4i - 2. Let f be x(-2). What is the units digit of ((-40)/f)/((-4)/(-6))? 2 Let a = -578 - -827. What is the hundreds digit of a? 2 Suppose 7 + 11 = 3f. Suppose 7 = 3w - ft + t, -4t + 16 = 0. What is the units digit of w? 9 Suppose c - 4 = 4. What is the units digit of (c/12)/(8/372)? 1 Let n = -24 + 26. What is the units digit of n? 2 Let c = 5 + 0. Suppose -cw + 3w + 5a - 9 = 0, -2a + 9 = w. What is the units digit of w? 3 Suppose 2y = -3r + 269, 2r = -0y - 3y + 406. What is the hundreds digit of y? 1 Let y = 139 + -43. What is the units digit of y? 6 Suppose 3u = -3u + 444. What is the units digit of u? 4 Let a(y) = y2 - 10y - 8. Let u be a(10). Let p = u + 16. Suppose 5 = q - p. What is the tens digit of q? 1 Suppose 0d + 6 = -3d. Suppose -3x - w = w + 12, -3w + 3 = x. Let r = d - x. What is the units digit of r? 4 Let t(h) = -h*3 + 7h*2 - 8h + 4. What is the tens digit of t(5)? 1 Suppose 4a - 20 = 28. Suppose 11s = as - 37. What is the tens digit of s? 3 Suppose 2h + 56 = 4x, 5x + 0x = -5h + 70. Suppose 5n + 3p = 28, -n + 9 = 2p + 2p. Let o = x + n. What is the tens digit of o? 1 Suppose 5z - 34 = 3z + y, -4 = -y. What is the tens digit of z? 1 Let b = 107 + -16. What is the units digit of b? 1 Let a(f) = -f*3 + 3f*2 + 3f - 4. Suppose 2j - 1 = -3w, -j - 3w = -5w + 10. Let g be (6/4)/(j/(-8)). What is the units digit of a(g)? 5 Let d(t) = -t*2 - 14t. What is the units digit of d(-6)? 8 What is the units digit of (1 - 3)21/(-14)? 3 Let n be -20(-2)/4 - -2. What is the units digit of (-64)/n30/(-8)? 0 Suppose 4x = 21 + 47. Suppose -40 + 10 = 3k. Let r = k + x. What is the units digit of r? 7 Let s(p) = p2 + 5p + 3. Let h be s(-8). Suppose -6d + h = -5d. What is the tens digit of d? 2 Let h(z) = -z*2 + 13z - 12. Let k = -26 - -34. What is the units digit of h(k)? 8 Let g be 1(9/3 - 1). Suppose -7v + 85 = -g*v. Wha	{ "pile_set_name": "DM Mathematics" }
is the smallest value? (a) -0.1 (b) f (c) d b Let h be 8/20 - 36/(-10). Let p = -4.99 + -0.01. What is the smallest value in 2, p, h? p Let x = -143.1 + 136. Let h = x + 7. Let k = -2 - -1.6. Which is the second smallest value? (a) h (b) k (c) 3/2 a Let g = -9 + 1. Let q = 8 - 6. Let p be 1 + 2/gq. Which is the smallest value? (a) p (b) -0.5 (c) -4 c Let z = 1/12 + 1/4. Let p be (-8)/(-28) + 4/(-63). Which is the third smallest value? (a) p (b) 4 (c) z b Let p(f) = -f - 4. Let u be p(5). Let o be (-2)/(-70) + u/15. What is the third smallest value in o, 2, -1/4? 2 Let w = 140/3 - 47. What is the smallest value in 1/6, w, 2? w Suppose 0 = -6p + 2p - 16. Let q = 4 + -1. What is the biggest value in q, 1/5, p? q Let m = -1.1 + 0.8. What is the fourth smallest value in 1/4, -2/5, m, -3? 1/4 Let w = 14 - 16. Which is the second biggest value? (a) 2 (b) 2/7 (c) w b Let g = -4 + 3.8. Let q be (-22)/(-5) + (-4)/10. Let p = -7 + q. What is the third smallest value in -2/3, p, g? g Let d = 13/11 + -329/297. What is the biggest value in 3, d, 4? 4 Let d = 0.15 + -0.65. Let z be (-2)/(-60)-22. Which is the third biggest value? (a) 2/3 (b) z (c) d c Let b = -1/40 + -77/120. What is the third smallest value in 0.6, b, -5? 0.6 Let q = 2 + -3. Let u = 4 + 0. Let j be u/16 - q/4. What is the third smallest value in 0.4, j, -4? j Let i = 10.7 - 11. Let w = i + 0.5. Which is the second smallest value? (a) -1 (b) 0.1 (c) w b Let j be ((-6)/2 - 3)/(-2). Suppose 3l - 6 = x - 4, jx = -4l - 19. Let t = 10 + -11. Which is the second biggest value? (a) x (b) -2/7 (c) t c Suppose -4g = 5h - 54, -h + 14 = -0g + 4g. Let b = 6 - h. What is the second biggest value in b, -2, -0.4? -2 Let q = 4 - 4.2. Let k = 0.3 - q. Let z = -39 + 35. What is the biggest value in k, -2/5, z? k Let l = 58 + -61. Let p = -0.05 - -4.05. What is the biggest value in l, -1/4, p? p Let f = 1.8 - 11.8. Let y = 9.8 + f. Which is the third biggest value? (a) y (b) -3/8 (c) -2/5 c Let k = -0.02 - 0.98. Let u be (4/6)/(-13 + 10). Which is the second biggest value? (a) k (b) -1/2 (c) u b Let a = -1/8 - 3/40. What is the smallest value in 0, 32, a? a Let t = 36.1 - 36. Let w be 4/5(-2)/8. Which is the smallest value? (a) t (b) 1/6 (c) w c Let r be (-6)/((-180)/(-25)) - 4/(-6). Which is the biggest value? (a) 2/3 (b) -4 (c) r a Let o = 1.2 + 1.8. Which is the biggest value? (a) o (b) 2/11 (c) -6/7 a Let f = -44 + 44.02. Which is the third smallest value? (a) f (b) 3/8 (c) 0 b Let l = -12.8 - 1.2. Let y = l + 18. Which is the third smallest value? (a) y (b) -3/4 (c) 0.3 a Let d = 0 - -1. Let z = 220/321 + -2/107. Which is the second smallest value? (a) 0.4 (b) z (c) d b Suppose -4f = -3f. Suppose -2p + 10 = 3p. Suppose f = -pc + c + 5. What is the third smallest value in 0, -2, c? c Let k = 1.3 + 0.7. Which is the second biggest value? (a) 0.2 (b) -4 (c) k a Let l = 3 - 0. Let d = -0.05 + -7.95. Let q = d - -8.1. Which is the second biggest value? (a) q (b) 0.5 (c) l b Let f = 0 - 0. Let i = 0.403 + -0.033. Let y = -0.03 - i. Which is the second biggest value? (a) y (b) f (c) 1/6 b Let b = 3/3115589260 - 487202496197/252985847912. Let j = 494/245 + b. Let h = j + 1/29. What is the smallest value in h, 2/13, 3/2? h Let s = 3 - 3.06. Let l = 5.06 + s. Let u be (-23)/7 - (-2)/7. Which is the smallest value? (a) u (b) l (c) -2 a Let x = 27 - 26.6. Which is the fourth smallest value? (a) -2 (b) x (c) -3 (d) -4 b Suppose 0t - b - 3 = 2t, 3b = -5t - 8. Let w be (2 - (4 + t))-3. What is the second biggest value in 1, w, 5? w Let l = 0.2 - 0.3. Let f = -8 - -12. What is the second biggest value in l, f, -1? l Let i be (4 + -1)/(6/(-20)). Let s be i/456/(-4). Which is the biggest value? (a) s (b) -0.1 (c) 0.4 c Let p = 1 + 0. Let s = -1/6 - 1/30. What is the second biggest value in s, -2/3, p? s Let n = 0.21 + 4.29. Let q = n + -0.5. Let h = q - 6. Which is the second smallest value? (a) h (b) -2/7 (c) 0 b Let u = 58 + -63.6. Let h = 6 + u. Which is the biggest value? (a) -0.5 (b) h (c) -5 b Let m = -49 + 45. What is the second smallest value in 5, 1/9, -1, m? -1 Let a be (-6)/14 - (-7 - -7). What is the second smallest value in -4, a, -2? -2 Let k = 0.072 + 5.028. Let v = 5 + -10. Let h = v + k. Which is the second biggest value? (a) -0.3 (b) h (c) -1 a Let n be ((-12)/72)/((-2)/4)-3. Let v(y) = -y3 + 5y*2 - 3y - 1. Let t be v(4). Which is the second biggest value? (a) n (b) 5 (c) t c Let c = -5.9 - -1.9. What is the third smallest value in c, 4/3, -2/5? 4/3 Let h(g) = g*2 + g. Let l(z) = 4z*2 + 8z - 1. Let o(j) = 3h(j) - l(j). Let p be o(-4). Which is the smallest value? (a) -0.1 (b) -1/3 (c) p b Let j be 6/7-1 - -1. Which is the third smallest value? (a) j (b) 1 (c) -2/3 b Let g(y) = -y*2 - 7y + 29. Let v be g(-10). Suppose -i - 3 + 1 = 0. Let z be i + (31/11 - 1). Which is the second biggest value? (a) 5 (b) z (c) v b Suppose -60 = 3d + 3m + 27, 2m - 128 = 4d. What is the smallest value in 2/19, -5, d? d Let k = 0.31 + -0.61. What is the smallest value in k, -0.4, 2? -0.4 Let a = 2 - -3. Let n = -1 - -1.5. What is the third smallest value in n, 1/3, a? a Let g = 7 - 4. Let q = -4.5 - -4. Let u = q + -0.5. Which is the third smallest value? (a) g (b) 5 (c) u b Let w = -18.5 - 2.5. Let n = w + 16.92. Let q = -0.08 - n. Which is the second smallest value? (a) -0.1 (b) 1 (c) q b Suppose -2t + 12 = -6t. Let q = -5.3 + 5. Let i = 2.5 - 3. What is the second biggest value in i, q, t? i Suppose -3i + 7 = -b, -4b + 7b + 3 = 0. Suppose -io + 9 = -5o. Let j be (-2)/o + 26/6. What is the second biggest value in -1, -2/5, j? -2/5 Let z = 0.7 - -2.3. Which is the third smallest value? (a) z (b) -0.1 (c) -7 a Let x = 4 - 3.9. What is the second biggest value in x, 2, 0.3? 0.3 Let l = 0.09 - -7.41. Let r = -8 + l. Which is the smallest value? (a) r (b) 0.4 (c) -2 c Let v(q) = q2 + 5q. Let r be v(-5). Let j = 105.2 + -105. Suppose -16 = -3y - 5u, 5u = -5 + 15. What is the third biggest value in r, y, j? r Let w be (27/6 - 0) + 4. What is the biggest value in 0.1, -2, w? w Let d = 0.73 - 0.5. Let r = d + 0.07. Let h = -7 - -2. What is the third biggest value in 0.4, h, r? h Let n = -2 - -1.7. What is the second smallest value in n, -2/11, 2/19, 0.5? -2/11 Let r = 2/79 + 227/395. Let q = 0.205 - -4.675. Let d = -0.12 - q. Which is the smallest value? (a) d (b) -1/6 (c) r a Suppose 3h - 4 = -10. What is the second biggest value in h, 2/29, -0.4? -0.4 Suppose 0 = -3o + 7 + 5. Let v be (o - 2) + (1 - 0). Suppose 5 = m - 0m. What is the third smallest value in v, m, -2/9? m Let f = 212.85 + -224. Let s = 0.15 + f. Which is the biggest value? (a) -0.5 (b) s (c) 3 c Let l = 23 - 14. Let x be (-10)/(-2)l/15. Which is the biggest value? (a) x (b) 0.4 (c) -3/2 a Let r = 0.2 + 10.8. Let i = -6 + r. Which is the second smallest value? (a) -3 (b) 4 (c) i b Let x be -2 - ((-28)/24 + -1). What is the second smallest value in x, 2, 1, -4? x Let r = -83.5 - -83. Which is the biggest value? (a) -0.16 (b) r (c) 4 c Let f = -5 - 1. Let k = -5.8 - f. Let i = 0.2 + 0.8. Which is the smallest value? (a) i (b) 0.4 (c) k c Let h = 28.38 - 28. Let z = 0.08 - h. Let o = z - -0.7. Which is the second biggest value? (a) o (b) -3/4 (c) 1 a Let u = 2 - 4. Let f = 2.2 + u. Let t = 4.7 - -0.3. What is the third smallest value in t, -5, f? t Let h = -16.2 - -15. Let d = h + 1. Let w = 0.93 - 0.73. Which is the second biggest value? (a) 2 (b) w (c) d b Let s = -6 + 2. Let u = s - -4.05. Which is the second biggest value? (a) u (b) -0.5 (c) -3 b Let z = 1.2 + -0.3. Let q = -0.1 - z. Which is the third biggest value? (a) q (b) -4 (c) 0.2 b Let n = 6 - 2. Which is the biggest value? (a) -1 (b) n (c) -2 b Let d = 17 + -17.4. Which is the smallest value? (a) 2/7 (b) -1 (c) d b Let d be 4/(40/138)-2. Let x = d + 28. What is the smallest value in -3, -1/5, x? -3 Suppose z - 4z - 3h - 12 = 0, 0 = -4*h. Let x = 49/65 + -2/13. What is the third smallest value in x, z, 1/3? x Let n = -7.1 + 7. Which is the second smallest value? (a) 1/3 (b) n (c) 2 a Let x = 3 - 3.1. Let	{ "pile_set_name": "DM Mathematics" }
.53. Let w = q - -0.1658453. What is w rounded to 5 dps? 0.00015 Let i = -0.01043246 - -0.009632. Round i to 5 decimal places. -0.0008 Suppose 28j - 778949980 = -5w + 32j, 623159980 = 4w - 4j. What is w rounded to the nearest one million? 156000000 Let a = 3.3326 - 0.1176. Let g = a - 2.61. Round g to one decimal place. 0.6 Suppose 14c - 19c + 90 = 0. Suppose -3m = -2g - c, 0g - 23 = -5m + g. Suppose -mu - 1036000 = -0u. What is u rounded to the nearest 10000? -260000 Let d = 22.14045593397 - -10371.85953646703. Let c = d - 10394. What is c rounded to 6 decimal places? -0.000008 Let q = -20.16 - -29.672. Let t = 0.188 + q. Let u = t - 18.8. What is u rounded to 0 dps? -9 Let b = -30316.4813 - -30314. What is b rounded to the nearest integer? -2 Let y = -49.48 + -4.92. Let b = y + 54.4000622. What is b rounded to five decimal places? 0.00006 Let a = 179921.870299838 - 179926.2703. Let r = a + 4.4. What is r rounded to seven dps? -0.0000002 Let p = 7.2488798998 - -132356350930.7511201002. Let i = 132356351107.999999822 - p. Let w = i + -170. What is w rounded to seven decimal places? -0.0000002 Let z = -115.72846115893 + -23256424.27146484107. Let k = -23256489 - z. Let u = -51 + k. What is u rounded to 5 dps? -0.00007 Suppose -138 - 148 = 13c. Let l be 500/(67568/(-370656) + (-4)/c). What is l rounded to the nearest 10000? -1050000 Let i(z) = -1470005z + 5. Let l(u) = -2940011u + 11. Let g(a) = -11i(a) + 6l(a). Let w be g(1). What is w rounded to the nearest 1000000? -1000000 Suppose 0 = 22c - 8c - 56. Suppose 3s = -t + 2810000, 2709164 = 3t - cs - 5720836. What is t rounded to the nearest 100000? 2800000 Let z = -856 - -3679. Let p = z - 1723. What is p rounded to the nearest one thousand? 1000 Let l(b) = 5b + 700. Let x = -110 + 105. Let u(o) = o + 5. Let w be u(x). Let f be l(w). What is f rounded to the nearest 100? 700 Let g = 27425.77478 + -27426. What is g rounded to 3 dps? -0.225 Let m(u) = u*3 - 7u*2 - 25u + 13. Let k be m(10). Let a = -60 + k. Let p be ((-16000)/(-12))/(a/(-5310)4). What is p rounded to the nearest 100000? -600000 Let d = -319.33548119 - -0.34042119. Let b = -751 + 1070. Let a = d + b. Round a to four decimal places. 0.0049 Let p = 3.2214 - 3.33. Let j = p - -0.0633. Round j to two decimal places. -0.05 Let i = 245.26 - 257.1249. Let s = 0.0249 + i. What is s rounded to the nearest integer? -12 Suppose -36k = -45 - 135. Suppose -s = 2s - 18. Let l be 40/((3/(-2568750))/(s/k)). Round l to the nearest 1000000. -41000000 Let s = 301 + -301.0498. Let h = s + -38.3202. Let k = h - -39. What is k rounded to 1 dp? 0.6 Let v = 0.3112 + -0.3194. Round v to four dps. -0.0082 Let g = 30605313284 - 30605313920.95978134. Let u = -730.9597804 - g. Let o = u - -94. What is o rounded to 7 decimal places? 0.0000009 Let g be (-466)/(-8) - (-4 + 26/8). Suppose -d + 59 = -5q, 0 = d + 4q - q - g. Let z = d + -22. Round z to the nearest ten. 40 Suppose n = -16 + 164. Suppose 52x = 19x + 2376. Let o = x - n. Round o to the nearest ten. -80 Let t = -5034802.6 + 5034515.60119. Let j = t + 287. What is j rounded to 4 dps? 0.0012 Let r be 18/(-4) - ((-52)/8 - -6). Let g(q) = -16 - 12230q - 8 + 4670q - 11946q. Let w be g(r). What is w rounded to the nearest one hundred thousand? 100000 Suppose -32g + 16479 = -30g - k, k = -5g + 41194. Suppose -6p = 538361 + g. What is p rounded to the nearest 10000? -90000 Let r = -180.8 + 0.8. Let a = 180.00018 + r. What is a rounded to three decimal places? 0 Let x = -2621934303.99999458 + 2621933891. Let c = -1204 - -791. Let r = c - x. Round r to 7 decimal places. -0.0000054 Let m = 2179.63 + -21.63. Let c = 2158.0001607 - m. What is c rounded to 5 dps? 0.00016 Let l = -70.7 - -70.9362. Let i = -0.0102 + l. What is i rounded to 2 dps? 0.23 Let c(a) = -88998a3 + 6a*2 - 2a + a + 27281a3 - 2a + 4. Let t be c(-4). What is t rounded to the nearest 100000? 4000000 Let f = -291.66 - -291. Let a = f + -0.081. What is a rounded to two decimal places? -0.74 Let y = -22.39 - 97.36. Round y to the nearest 10. -120 Let p = -0.084 + -10.136. Let j = -110.52 - p. Round j to the nearest 10. -100 Let z = -128.35568 + 128.49468194. Let i = 0.139 - z. What is i rounded to seven dps? -0.0000019 Let q = -27847 + 27846.999974081. What is q rounded to 7 decimal places? -0.0000259 Let z = -117.5 + 28.5. Let u = z - -88.999999777. Round u to 7 dps. -0.0000002 Let d(i) = 4i - 1. Let j be d(-2). Let n(z) be the first derivative of -6z*2 - 9z - 233. Let u be n(j). What is u rounded to the nearest ten? 100 Let b = -5399 + 5398.96761. Round b to 3 dps. -0.032 Let a = 18289.00011954 + -18289. What is a rounded to 5 dps? 0.00012 Let v = 2534.4 - 412.4. Let y = v + -2121.97298. Round y to 3 decimal places. 0.027 Let t = 1064882310 - 1064881560.999203. Let p = t + -749. What is p rounded to four decimal places? 0.0008 Let h = -73 + 76.95. Let y = h - 467.95. Let n = y + 463.99999609. What is n rounded to 7 dps? -0.0000039 Let y = 0.0009 - -0.0026. Let x = 1.3535 - y. What is x rounded to zero decimal places? 1 Let p(a) = -9252a2 + 40a. Suppose -5v + 244 + 66 = 0. Suppose v = 11c - 158. Let l be p(c). What is l rounded to the nearest 1000000? -4000000 Let p = -1252.5 - -1251.6367. Let h = 142.7643 + p. Let d = -142 + h. Round d to two dps. -0.1 Let y = -372.9 + 372.4218. Let b = -0.142 + -0.338. Let v = b - y. What is v rounded to three decimal places? -0.002 Suppose -183 = -3t + 447. Let v be (0 + t)18/(-36). Let y = 52 + v. Round y to the nearest 10. -50 Let s = 527.01898 + -0.40998. Let i = s + -526. What is i rounded to 2 dps? 0.61 Let b = 0.2317 + -0.30983. What is b rounded to three dps? -0.078 Let c(t) = 66t3 - 52t*2 + t + 65. Let d be c(-15). What is d rounded to the nearest ten thousand? -230000 Let y = -0.0937 + 0.026. Let g = y + -0.0429. Round g to two decimal places. -0.11 Let a = -8.664 - 8.238. What is a rounded to one decimal place? -16.9 Suppose -7727795 = -2u + i, 5i - 1151764 - 6576061 = -2u. Round u to the nearest 1000000. 4000000 Let a = -170.6574777022 - -1.6574761922. Let l = a + 169. What is l rounded to 7 decimal places? -0.0000015 Let c(o) = 56287o + 336. Let l(n) = -9381n - 57. Let f(s) = -2c(s) - 13l(s). Let g be f(-11). Round g to the nearest 10000. -100000 Let w = -7234 + 2094. Round w to the nearest one thousand. -5000 Let d = 2452.116 + -2402. Let i = 50 - d. Let h = i + 0.1159834. What is h rounded to five dps? -0.00002 Let x = 31071 - 25923. What is x rounded to the nearest one thousand? 5000 Let r(z) = -3z3 - 204z*2 + 111z - 20. Let o be r(-50). What is o rounded to the nearest 10000? -140000 Let x = -4111654.31104 + 4114069. Let b = x - 2415. Let o = 0.31 + b. Round o to 4 dps. -0.001 Let m be (-6)/(-2) - (-15 - 4350). Let b = 42290 - 15922. Let o = m - b. Round o to the nearest 100000. 0 Let x = 1917.87838 + 0.02162. Round x to the nearest 100. 1900 Let t = 400 + -924. Let d = t - -463.1. Round d to zero dps. -61 Let y = 434721.745871 + -434722. What is y rounded to 2 dps? -0.25 Let a be 2/(-8 - (-848)/104). Suppose -233400000 = -ab + b. Round b to the nearest 1000000. 19000000 Let t = -399.16 + 9.16. Let f = 13.46 + -407.55. Let z = t - f. What is z rounded to 0 decimal places? 4 Let d(w) = -3w*2 + 130w + 673. Let p be d(62). Round p to the nearest one hundred. -2800 Let b = -5.2 - -1.5. Let v = 6.4 + b. Let z = v - 2.686. What is z rounded to 2 decimal places? 0.01 Let x = -605.345 + 1.345. Let y = x - -657.8. What is y rounded to the nearest 10? 50 Let y = 53517 + -54146.43. Let d = y + 625. Let r = 4.5 + d. What is r rounded to 1 decimal place? 0.1 Suppose 2c - 26849674 = -0c - 2g, -2c = -2g - 26849658. Let f = -5154833 + c. Round f to the nearest 1000000. 8000000 Let g = -0.35037 - -0.350446172. Round g to six decimal places. 0.000076 Let h = -265.2316 + -0.9284. Round h to the nearest 10. -270 Let v = 2306.7 + -2302.8172. Let s = v + -3.99. What is s rounded to 2 dps? -0.11 Let t = 217.004122233 - 217.004. What is t rounded to six decimal places? 0.000122 Let u = 296.07 + -279. Let q = -6.35 - u. Let o = q + 25. What is o rounded to zero dps? 2 Suppose 30c = 33c - 673800. Suppose 0 = -2d - 2a + c, -4a	{ "pile_set_name": "DM Mathematics" }
r of 12773 and 10604. 241 Calculate the greatest common divisor of 221 and 92. 1 Calculate the highest common factor of 33855 and 930. 15 What is the greatest common divisor of 177 and 6343? 1 Calculate the highest common divisor of 2205 and 1806336. 441 What is the greatest common factor of 3074193 and 729? 729 Calculate the highest common factor of 3509804 and 89. 89 What is the highest common factor of 46 and 3841? 23 What is the highest common factor of 2018855 and 4975? 995 Calculate the highest common divisor of 56245 and 27319. 1607 What is the greatest common divisor of 63304 and 4439? 193 Calculate the highest common divisor of 15507 and 2. 1 What is the highest common divisor of 3 and 1110900? 3 What is the greatest common factor of 117 and 5463? 9 Calculate the highest common divisor of 424 and 169865. 53 What is the greatest common factor of 11 and 720269? 11 Calculate the highest common divisor of 329 and 705047. 329 Calculate the highest common factor of 14784 and 252. 84 Calculate the highest common factor of 306 and 21182. 34 What is the highest common divisor of 1056 and 5379? 33 What is the greatest common divisor of 263 and 15? 1 Calculate the highest common divisor of 52896 and 35148. 348 What is the highest common factor of 528 and 37224? 264 What is the greatest common factor of 38 and 378974? 38 Calculate the greatest common factor of 26 and 1903902. 26 What is the highest common factor of 1022 and 487129? 73 What is the greatest common divisor of 642945 and 105? 15 Calculate the highest common factor of 448 and 6944. 224 Calculate the greatest common factor of 2607 and 21567. 237 What is the greatest common factor of 700 and 255136? 28 Calculate the greatest common factor of 3078 and 92397. 57 What is the greatest common divisor of 33 and 326502? 33 What is the greatest common divisor of 67913 and 1803? 601 Calculate the greatest common divisor of 282975 and 3185. 245 What is the greatest common factor of 18 and 3951? 9 What is the highest common factor of 120645 and 1295? 35 Calculate the highest common factor of 5784408 and 966. 966 What is the greatest common divisor of 608 and 232769? 19 Calculate the greatest common factor of 21771 and 27. 9 What is the highest common divisor of 90080 and 1440? 160 Calculate the highest common factor of 14852 and 17484. 188 What is the highest common factor of 48645 and 15? 15 Calculate the greatest common factor of 100664 and 104. 8 Calculate the greatest common factor of 213192 and 36. 36 Calculate the greatest common factor of 96 and 48288. 96 Calculate the highest common divisor of 111 and 4809112. 37 What is the highest common factor of 471 and 137375? 157 What is the highest common factor of 99960 and 196? 196 What is the greatest common divisor of 79776 and 64? 32 What is the greatest common divisor of 695520 and 30? 30 What is the highest common factor of 385189 and 98? 49 Calculate the highest common divisor of 31783 and 74. 37 What is the highest common factor of 153 and 20529? 9 Calculate the highest common divisor of 22846 and 2. 2 What is the greatest common divisor of 452 and 534377? 113 Calculate the highest common factor of 141 and 21009. 141 What is the greatest common factor of 5933 and 901? 17 Calculate the greatest common factor of 34117 and 9483. 109 Calculate the greatest common divisor of 1063 and 24. 1 What is the greatest common factor of 88700 and 3650? 50 Calculate the highest common factor of 118639 and 667. 29 What is the highest common divisor of 664 and 14093400? 664 Calculate the greatest common divisor of 8027 and 3059. 23 What is the greatest common factor of 489 and 246130? 163 What is the highest common divisor of 37 and 2504863? 37 What is the greatest common factor of 538524 and 756? 252 What is the greatest common factor of 128973 and 39? 39 Calculate the highest common divisor of 1510984 and 536. 536 What is the highest common factor of 8742 and 12? 6 Calculate the highest common divisor of 2040 and 10836. 12 Calculate the greatest common divisor of 36 and 555912. 36 What is the greatest common factor of 70 and 298150? 10 What is the highest common factor of 3096 and 903? 129 Calculate the highest common factor of 95 and 4253. 1 Calculate the highest common divisor of 6441 and 4068. 339 Calculate the greatest common factor of 249 and 48. 3 What is the highest common divisor of 29350 and 625? 25 Calculate the greatest common divisor of 90 and 7515. 45 Calculate the highest common divisor of 6 and 2194098. 6 What is the highest common factor of 96885 and 720? 45 Calculate the greatest common divisor of 2200 and 707300. 1100 What is the highest common divisor of 131036 and 34? 34 Calculate the highest common factor of 170 and 283660. 10 Calculate the highest common divisor of 91205 and 51. 17 Calculate the greatest common divisor of 3358 and 76291. 23 Calculate the highest common divisor of 2783304 and 696. 696 Calculate the highest common factor of 1347 and 696399. 1347 What is the highest common divisor of 33300 and 777? 111 Calculate the highest common divisor of 645 and 8686. 43 Calculate the greatest common divisor of 29678 and 77. 11 Calculate the greatest common factor of 112772 and 699. 233 Calculate the greatest common divisor of 1015 and 36743. 203 What is the highest common divisor of 16668 and 6612? 12 Calculate the greatest common factor of 158 and 42186. 158 What is the greatest common divisor of 5397 and 2372367? 771 What is the highest common divisor of 49 and 276752? 49 What is the greatest common divisor of 4563 and 2379? 39 What is the greatest common factor of 848 and 5777? 53 What is the greatest common factor of 56651 and 14? 7 What is the greatest common factor of 159391 and 19? 19 Calculate the highest common divisor of 1 and 23627. 1 Calculate the highest common factor of 4194 and 78754. 466 Calculate the highest common factor of 1400 and 26936. 56 Calculate the highest common divisor of 19954 and 6. 2 Calculate the highest common divisor of 6739854 and 1122. 1122 Calculate the greatest common factor of 19585 and 15. 5 What is the highest common factor of 34 and 3111? 17 What is the greatest common divisor of 112845 and 285? 15 Calculate the greatest common factor of 30940 and 30719. 221 Calculate the greatest common factor of 200 and 4700. 100 What is the highest common factor of 909 and 920817? 909 Calculate the greatest common factor of 26247 and 546. 39 What is the highest common divisor of 480 and 13136? 16 Calculate the highest common divisor of 363276 and 27. 9 What is the highest common factor of 652 and 10269? 163 Calculate the highest common divisor of 15106 and 78. 26 What is the greatest common divisor of 1806 and 1344? 42 Calculate the highest common factor of 120043 and 1771. 77 What is the greatest common factor of 4875 and 67125? 375 Calculate the highest common divisor of 9048 and 870. 174 Calculate the highest common factor of 208 and 1113073. 13 What is the greatest common factor of 12963 and 1192? 149 What is the highest common divisor of 3332 and 63749? 49 What is the greatest common factor of 1769109 and 82? 41 Calculate the greatest common factor of 78970 and 1590. 530 Calculate the highest common factor of 33038 and 2. 2 What is the greatest common factor of 275162 and 816? 34 Calculate the greatest common factor of 1240 and 42935. 155 Calculate the greatest common factor of 1936 and 128. 16 What is the highest common divisor of 1428 and 81753? 357 Calculate the highest common factor of 28 and 2485. 7 What is the greatest common divisor of 48 and 219216? 48 Calculate the highest common factor of 428616 and 2520. 72 Calculate the highest common divisor of 2605 and 145. 5 What is the highest common factor of 115872 and 192? 96 What is the highest common divisor of 139 and 1042778? 139 Calculate the highest common divisor of 91525 and 70. 35 Calculate the highest common factor of 162 and 2973240. 54 Calculate the greatest common divisor of 77670 and 36. 18 Calculate the greatest common divisor of 22317 and 77331. 519 Calculate the greatest common divisor of 2279630 and 10. 10 What is the greatest common factor of 743104 and 34? 34 What is the greatest common divisor of 2745 and 88938? 549 What i	{ "pile_set_name": "DM Mathematics" }
x - 101. Let z(w) = 6w*2 + 55w - 25. Let r(u) = -2n(u) + 9z(u). Let v be r(-10). Solve -l = -5i + v, -2l + 2 = 3i - 9 for l. -2 Suppose -2s + 7 = 3s + 4q, -8 = 4q. Suppose 2m - si - 57 = 0, -19m + 5i + 87 = -16m. Solve -6p - m = -4j - 4p, j - 4p = 20 for j. 4 Let x be -4 + 4 + (1 + -3 - -5). Suppose -1 = -p - 4i, 2p + 5i = xi + 8. Solve 0 = -k + 3v + 9, -pk + 17 = -v for k. 3 Let m = 91 - 95. Let k be (9 - (1 + (5 - 1))) + m. Solve 5q + 5 = k, a - 5 = 4q - 2 for a. -1 Suppose 18j - 19j - 465 = -5i, 0 = 3i - 3j - 291. Solve -84 = 4k - i, 3o = -k - 1 for o. -1 Let m(i) = 21i*2 - 256i + 52. Let s be m(12). Solve -59f - sc - 24 = -57f, -5f + 3c + 31 = 0 for f. 2 Let d = -15352 - -15370. Solve -4m = 5c + d - 24, 5c = 4m - 26 for c. -2 Let j be 2 - ((-11 - -2) + 2). Suppose 2 = js - 8s. Let h be ((-3)/5)/(33/(-330)). Solve -hr + w = -sr - 21, 12 = 3r + 3w for r. 5 Suppose -5p + 246 = 3x, 239 = 5p - 155x + 157x. Solve 0 = -4n + 4o + p - 49, 3n + o - 21 = 0 for n. 5 Suppose 147q - 142q - 155 = 0. Suppose -15d = -14 - q. Solve 3x = -3u + d, 3x - 8 = -4u - 0x for u. 5 Let y = 89 + -86. Suppose -2d - 7p = -2p + 12, 2d + yp = -4. Solve -5 = 2b + t, 0 = -4b - 7t + dt - 15 for b. 0 Let g = 276 + -277. Let o be (0 + g - (-140)/84)3. Solve -3j - 6 = -2z, oz + 6 + 16 = -4j for z. -3 Let r = 841 + -827. Solve 10 = 2p - 5b - 1, -4p - r = 2b for p. -2 Let h be -23 + (10 - -179) - -25. Solve 0 = 5b - 192n + hn + 14, -5b + 3n - 22 = 0 for b. -2 Let f(m) = 2m2 + 19m - 7. Let x be f(-10). Suppose 0b + 24 = xb. Suppose -r + 2r - q - b = 0, -8 = -4r - 2q. Solve 3o = rl + 25, -5 - 4 = -3o for l. -4 Suppose 7s - s = 6. Let v(g) = 12g - 5. Let l be v(s). Let z = 11 - l. Solve 3c + 6 = -3j, -zc - c = 4j + 9 for j. -1 Suppose 166 + 39 = 41z. Solve 0 = -0v - 5v - 5l + 20, 0 = -4v - zl + 16 for v. 4 Let l be (-14 - -16) + 0 + (-3 - -6). Solve 2t = -31o + 30o - 1, lo - 4t - 37 = 0 for o. 5 Let w be ((-2)/(-2))/((-6)/21482). Let a = -177 - w. Solve -5 = 5n - ar - 4, -2r + 10 = 4n for n. 1 Suppose 145 = -5c + 5v, -v + 0v = -3. Let y(h) = h3 + 26h*2 - 2h - 40. Let i be y(c). Solve p = -2m + 4 - 0, p = -4m + i for p. -4 Let c(d) = d*3 - 2d*2 - 4. Let k be c(3). Suppose -11a = -4a + 483. Let i = 72 + a. Solve -ir = 9, 0r = -kl + 4r + 32 for l. 4 Let v(k) = 26k + 319. Let p be v(-12). Solve m - 16 = -5b, b + pm - 2m = -16 for b. 4 Let p(o) = -2o2 - o - 1. Let s(a) = a2 + 9a + 12. Let v(r) = p(r) + s(r). Let n be v(8). Solve -5 = -i + 3k - n, -3k - 3 = 2i for i. -3 Let n be -2(-10 + (-135)/(-18)). Solve nc + 1 = 4z - 14, -2z = 0 for c. -3 Let y = 784 + -780. Suppose -104g = -105g + y. Solve -s + 24 = 3s + 2v, gv = 5s - 4 for s. 4 Let b be 48/25 - 11(-4)/550. Solve -34t - bj + 16 = -36t, -24 = 2t - 4j for t. -4 Let p(y) be the second derivative of 9y2 + 0 - 9y - 11/6y3 - 1/12y*4. Let j be p(-10). Solve 4d = -4g - j, g - 11 = -0g + 5d for g. -4 Let j = -3577 + 3579. Solve 5s + 5q = 15, -5s + 23 = -q - jq for s. 4 Let q = 173 + -104. Let j = -66 + q. Solve 2h - 3h - 2x + 8 = 0, -jh = 2x - 16 for h. 4 Let m(r) = 15r2 - 16r - 90. Let c be m(-4). Let t = c - 212. Let u = 7 - 2. Solve -uk = ta - 14, -3a + 2a + 8 = 3k for k. 2 Let a(x) = -18x + 185. Let n be a(10). Let v = 218 + -214. Solve 10k - nk - 10 = -c, -3c = -2k + v for k. 2 Let n be (-1 - -5) + ((-2)/(-16) - (-61)/(-488)). Solve 2p + 5w = 5, -22 + 14 = 4p + nw for p. -5 Let m be (-7)/((-35)/(-30)) + 7 + 3. Let p = -13 - -15. Let q = 5 + 0. Solve ml = ph - 17 - 5, -qh + 25 = 0 for l. -3 Let t(m) = -m2 + 24. Suppose 1 = 2i + u, -5i - 5u = -0u - 5. Let s be t(i). Let a = 27 - s. Solve 5q = -az - 7, 0z - z = 4 for q. 1 Let n(j) = -j + 13. Let b be n(11). Suppose -x - b = 2p - 5, -p + 2x = 6. Suppose p = 5w - 0w - 60. Solve 4i - 16 = -5l, 6i - w = -4l + 2i for l. 4 Let h be (5/10)/((-7)/(-2926)). Let x = h + -207. Solve -3m + xy + 10 = 2m, -4y - 20 = 3m for m. 0 Let f(h) = -h*3 - 5h*2 + 338h - 28. Let g be f(16). Solve 14o + 7 = -4z + 15o, -5o = -gz + 13 for z. -3 Suppose 4c - r + 15 = 48, 0 = 3c - 4r - 28. Solve 3a - 2g = 20, cg + 4 = 2a + 9g for a. 4 Let y = -38 + 74. Let q = -32 + y. Suppose 4l - v - 12 = 0, l - v = qv + 22. Solve -3i - lu = -10, -u = -i - 0u - 5 for i. 0 Let h be -41 + 29 - (-20 - -1). Solve -2x + 2g - 6 = 2x, 0 = -5x + 3g - h for x. -2 Let y(v) = 4v + 113. Let d be y(-27). Suppose 13n + dz - 15 = 8n, -4n + z = 3. Solve c + 2 + 2 = n, 0 = 5i + c + 19 for i. -3 Let o be 3 + (1 + -2)-2. Suppose 459 = 10i + 7i. Let y be (-1 - i/(-12))(0 - -4). Solve oj + 71 = -yb + 26, -b - 19 = 3j for b. -4 Let t(r) = -r*3 + 9r*2 + 54r - 21. Let k be t(13). Solve 2w - 6w - 20 = 0, -4z - kw - 13 = 0 for z. 3 Let t(x) = -x*3 - 5x*2 + x - 7. Suppose -78a - 30 = -73a. Let u be t(a). Suppose 2f = 33 - u. Solve 25 = -i + fw, 0i + 4w - 36 = 4i for i. -5 Let t be (6/9)/(84/(-63)) + (-22)/(-4). Solve 5m = -0m + 2u - 2, tu - 5 = m for m. 0 Let q = -6811 + 6814. Solve -3z - z - 5 = -qb, 2z - 1 = 5b for z. -2 Let k be 382 + -1 + -3. Let y = -803 + 865. Suppose -5r + k = y. Solve 0 = 2d + 3h + rh - 2, 3d + 2h - 3 = 0 for d. 1 Suppose -4z + 5m = -51, 5z - 304m = -302m + 34. Solve 3a + 13 = zj, -276 + 280 = 4j for a. -3 Let g(n) = 12n + 2. Let c be g(6). Let b be 14/91 - c/(-26). Suppose 79 = -13i + 17i + 5x, -4i - 2x = -82. Solve -i = 3d - bt, -27 = d - 4t - t for d. -2 Let z(i) = -3i2 - 45i + 51. Let q(v) = 12v - 4. Let n be q(-1). Let g be z(n). Solve 5o + 5f = 0, -gf + 2 = 4o - 1 for o. 3 Let p = -2915 + 2915. Suppose 9 + 1 = 5g. Suppose 0 = a - g. Solve f = -ad + 3 - 1, d + 3f + 4 = p for d. 2 Let x be (((-2720)/(-119))/40)/(18/14 - 1). Solve 2g + i = -3i - 18, -3i - 16 = xg for g. -5 Let l = -189 - -217. Suppose -3n + 13 + 9 = 5q, 5n - l = -4q. Solve 2y + nh = -2y + 20, 3y - 5h - 15 = 0 for y. 5 Suppose -803 + 206 = -5i - 3x, 4i = 5x + 448. Suppose 3d - 109 = n, 2n + 226 = -0d + 2d. Let b = i + n. Solve bg + 3t + 12 = -g, g - t = -4 for g. -4 Let f be (-7 - -12 - 6) + (-44 + 2)/(-3). Solve -2h - 89 + 102 = -5j, 0 = -4h - 3j + f for h. 4 Let n be (3/(-5))/((-108)/3060). Suppose o - 3w = n, 5w + 26 = o - 1. Solve 6v = -r + 3v - o, -v = r for r. 1 Let n be -12((-5)/4 + -2). Let d = n + -29. Suppose -o - d = -6o. Solve o = 3j - 10, -14 = -2s - 3j for s. 1 Suppose 7q - 55 = -426. Let w = 53 + q. Solve 3p + 12 = -y - wy, 5y = 2p + 8 for p. -4 Let z be 2/8 - (-31)/4. Let b = 356 - 363. Let r be (b/((-56)/12))/(4/8). Solve 7m - z = 4g + rm, g + 10 = 5m for g. 0 Suppose -4l - 10q + 10 = 0, -l + 0q - q + 4 = 0. Solve l = -d + 15m - 13m, -5d = -2m + 9 for d. -1 Let f = -66 - -70. Suppose 3z + 5y - 32 = -z, 0 = -3z + fy + 24. Suppose -4 = -6x + z. Solve i - a = 5, -xi + 17 = 3i - a for i. 3 Suppose 4 = 2w, -j + 3 = -2j + 4w. Suppose -2x = -h - 4 + j, 3 = 3h - x. Solve 0 = f - 6m + 4m - h, 5f - 2m = -19 for f. -5 Suppose 3t - 21 = -i, -2t + 41 = 3i - 22. Solve 5l + 8 = -2r, 15 = 5r - 26l + il for r. 1 Suppose 15h + 220 = 29h + 164. Solve -3c - 3 = 0, -hk + 26 - 7 = 5c for k. 6 Let p be (-7 - 612/32) + (-4)/(-32). Let i(h) = -h2 - 18h + 213. Let y be i(p). Solve 3a = -5k - 13, -ya = -4k - 0a - 3 for k. -2 Let p = -175 - -209. Let t be p/10 - 6/15. Solve 3o - 3f = 18, 2o + tf = -f for o. 4 Let z be 4(-1 + (-121)/(-110)) - (-4)/(-10). Solve -4s + 14x - 16x = 12, -5s - 2x - 14 = z for s. -2 Suppose -4i - z = -11, -z - 35 = -3i - 18. Solve -3s - 15 = -4k, -4s - 26 = ik - 6 for s. -5 Let h = 256 - 261. Let w be -10(h - 45/(-10)). Solve -wy - 2a + 7 = 0, 2y + 4 = 7y - a for y. 1 Let f(l) = -l*3 - 18l*2 - 72l + 38. Let k be f(-7). Solve -ks - 4o + 1 = 0, -20s + 3 = -25s - 2o for s. -1 Let q(o) = -o + 20. Let r be q(-8). Suppose -a - 3a = -r. Solve 2 = -4y - f + a, 9 = 5y + 4f for y. 1 Suppose -4m = 6c - 7c - 28, 7m - 59 = 3c. Solve 21l = 20l - mq + 30, -2q + 5 = -l for l. 5 Suppose -3*i + 21 =	{ "pile_set_name": "DM Mathematics" }
ainder when 181 is divided by 53? 22 What is the remainder when 290 is divided by 21? 17 Calculate the remainder when 292 is divided by 37. 33 What is the remainder when 4 is divided by 1? 0 What is the remainder when 1678 is divided by 56? 54 What is the remainder when 179 is divided by 51? 26 Calculate the remainder when 44 is divided by 20. 4 Calculate the remainder when 4536 is divided by 89. 86 What is the remainder when 445 is divided by 123? 76 What is the remainder when 41 is divided by 12? 5 Calculate the remainder when 64 is divided by 36. 28 What is the remainder when 782 is divided by 23? 0 Calculate the remainder when 38 is divided by 8. 6 What is the remainder when 538 is divided by 12? 10 Calculate the remainder when 116 is divided by 8. 4 What is the remainder when 81 is divided by 17? 13 Calculate the remainder when 1622 is divided by 45. 2 What is the remainder when 37 is divided by 15? 7 What is the remainder when 19699 is divided by 10? 9 What is the remainder when 3353 is divided by 21? 14 What is the remainder when 80 is divided by 19? 4 What is the remainder when 31 is divided by 31? 0 What is the remainder when 24 is divided by 14? 10 Calculate the remainder when 1957 is divided by 48. 37 What is the remainder when 570 is divided by 22? 20 Calculate the remainder when 287 is divided by 10. 7 Calculate the remainder when 608 is divided by 71. 40 Calculate the remainder when 20 is divided by 1. 0 What is the remainder when 318 is divided by 29? 28 Calculate the remainder when 399 is divided by 20. 19 What is the remainder when 350 is divided by 126? 98 Calculate the remainder when 461 is divided by 126. 83 What is the remainder when 216 is divided by 51? 12 Calculate the remainder when 1198 is divided by 394. 16 What is the remainder when 227 is divided by 139? 88 What is the remainder when 288 is divided by 97? 94 What is the remainder when 169 is divided by 82? 5 Calculate the remainder when 988 is divided by 11. 9 What is the remainder when 91 is divided by 47? 44 Calculate the remainder when 999 is divided by 326. 21 What is the remainder when 301 is divided by 38? 35 Calculate the remainder when 313 is divided by 40. 33 Calculate the remainder when 305 is divided by 13. 6 Calculate the remainder when 1752 is divided by 117. 114 Calculate the remainder when 193 is divided by 33. 28 What is the remainder when 156 is divided by 73? 10 Calculate the remainder when 853 is divided by 36. 25 Calculate the remainder when 225 is divided by 119. 106 Calculate the remainder when 218 is divided by 44. 42 What is the remainder when 87 is divided by 9? 6 Calculate the remainder when 328 is divided by 16. 8 What is the remainder when 543 is divided by 259? 25 Calculate the remainder when 2694 is divided by 14. 6 Calculate the remainder when 233 is divided by 88. 57 What is the remainder when 4407 is divided by 6? 3 Calculate the remainder when 723 is divided by 337. 49 What is the remainder when 843 is divided by 169? 167 Calculate the remainder when 683 is divided by 341. 1 Calculate the remainder when 722 is divided by 29. 26 What is the remainder when 137 is divided by 54? 29 Calculate the remainder when 116 is divided by 21. 11 What is the remainder when 865 is divided by 143? 7 Calculate the remainder when 237 is divided by 15. 12 Calculate the remainder when 3750 is divided by 121. 120 What is the remainder when 349 is divided by 25? 24 What is the remainder when 621 is divided by 25? 21 Calculate the remainder when 1759 is divided by 252. 247 Calculate the remainder when 443 is divided by 89. 87 What is the remainder when 648 is divided by 109? 103 Calculate the remainder when 235 is divided by 25. 10 What is the remainder when 526 is divided by 64? 14 Calculate the remainder when 112 is divided by 102. 10 What is the remainder when 166 is divided by 53? 7 What is the remainder when 1205 is divided by 90? 35 What is the remainder when 334 is divided by 67? 66 Calculate the remainder when 11531 is divided by 124. 123 Calculate the remainder when 234 is divided by 62. 48 Calculate the remainder when 1919 is divided by 64. 63 What is the remainder when 175 is divided by 22? 21 Calculate the remainder when 1744 is divided by 223. 183 What is the remainder when 703 is divided by 229? 16 What is the remainder when 559 is divided by 17? 15 Calculate the remainder when 1379 is divided by 73. 65 What is the remainder when 72 is divided by 27? 18 Calculate the remainder when 76 is divided by 1. 0 Calculate the remainder when 644 is divided by 17. 15 Calculate the remainder when 1193 is divided by 80. 73 What is the remainder when 196 is divided by 46? 12 What is the remainder when 259 is divided by 85? 4 What is the remainder when 5335 is divided by 157? 154 Calculate the remainder when 962 is divided by 14. 10 What is the remainder when 613 is divided by 121? 8 Calculate the remainder when 62 is divided by 19. 5 What is the remainder when 1148 is divided by 142? 12 Calculate the remainder when 1169 is divided by 59. 48 What is the remainder when 325 is divided by 83? 76 Calculate the remainder when 192 is divided by 10. 2 Calculate the remainder when 634 is divided by 53. 51 What is the remainder when 656 is divided by 92? 12 What is the remainder when 1287 is divided by 73? 46 Calculate the remainder when 2858 is divided by 65. 63 What is the remainder when 1169 is divided by 78? 77 What is the remainder when 138 is divided by 43? 9 Calculate the remainder when 483 is divided by 81. 78 What is the remainder when 569 is divided by 109? 24 What is the remainder when 8422 is divided by 162? 160 Calculate the remainder when 517 is divided by 131. 124 Calculate the remainder when 1322 is divided by 34. 30 What is the remainder when 3657 is divided by 105? 87 Calculate the remainder when 186 is divided by 21. 18 What is the remainder when 4991 is divided by 16? 15 Calculate the remainder when 446 is divided by 123. 77 Calculate the remainder when 2134 is divided by 270. 244 Calculate the remainder when 507 is divided by 57. 51 Calculate the remainder when 842 is divided by 276. 14 Calculate the remainder when 758 is divided by 193. 179 Calculate the remainder when 3550 is divided by 178. 168 Calculate the remainder when 134 is divided by 3. 2 Calculate the remainder when 2027 is divided by 52. 51 What is the remainder when 812 is divided by 5? 2 What is the remainder when 3339 is divided by 88? 83 Calculate the remainder when 128 is divided by 15. 8 Calculate the remainder when 1029 is divided by 12. 9 Calculate the remainder when 74 is divided by 22. 8 Calculate the remainder when 704 is divided by 103. 86 Calculate the remainder when 943 is divided by 27. 25 What is the remainder when 35 is divided by 5? 0 Calculate the remainder when 1299 is divided by 42. 39 What is the remainder when 11302 is divided by 127? 126 What is the remainder when 401 is divided by 84? 65 What is the remainder when 187 is divided by 174? 13 What is the remainder when 119 is divided by 34? 17 Calculate the remainder when 213 is divided by 77. 59 What is the remainder when 629 is divided by 7? 6 What is the remainder when 37 is divided by 19? 18 Calculate the remainder when 445 is divided by 56. 53 Calculate the remainder when 129 is divided by 68. 61 Calculate the remainder when 131 is divided by 129. 2 Calculate the remainder when 17295 is divided by 31. 28 What is the remainder when 100 is divided by 36? 28 Calculate the remainder when 483 is divided by 123. 114 What is the remainder when 251 is divided by 35? 6 What is the remainder when 436 is divided by 74? 66 What is the remainder when 40 is divided by 15? 10 Calculate the remainder when 435 is divided by 41. 25 What is the remainder when 3164 is divided by 96? 92 What is the remainder when 708 is divided by 33? 15 What is the remainder when 364 is divided by 192? 172 What is the remainder when 392 is divided by 86? 48 What is the remainder when 371 is divided by 39? 20 Calculate the remainder when 573 is divided by 23. 21 Calculate the remainder when 4398 is divided by 80. 78 What is the remainder when 5725 is divided by 83? 81 Calculate the remainder when 268 is divided by 54. 52 What is the remai	{ "pile_set_name": "DM Mathematics" }
-3 (d) 2/19 a What is the nearest to 0.1 in 1, -2/25, 2? -2/25 What is the closest to -1 in -1, -2, -87, 1? -1 Which is the closest to 0? (a) 0.048 (b) 0.2 (c) 1/2 a Which is the nearest to -1? (a) 5/2 (b) 1/10 (c) 3 b What is the closest to 8 in 2/3, 2/5, 7, 1/5? 7 Which is the nearest to 2/7? (a) -0.4 (b) -4 (c) -3/7 (d) -9 a Which is the closest to -1? (a) 0 (b) -1/5 (c) -7 (d) -2/11 b What is the nearest to 0 in -2, 111, 0, 4? 0 What is the closest to 2/7 in -4, -5, -4/5, -9/5? -4/5 Which is the closest to 0.1? (a) -5 (b) -0.8 (c) 4/3 b Which is the nearest to -0.1? (a) -0.5 (b) -457 (c) 2/13 c Which is the closest to 0? (a) 1 (b) -0.1 (c) 14/47 b Which is the nearest to -0.8? (a) 0.2 (b) -0.1 (c) 2/19 b Which is the nearest to 0.3? (a) -5 (b) 2 (c) 1/12 c What is the closest to -0.1 in 0.1, 3/10, 0.07? 0.07 Which is the closest to -1? (a) -3/7 (b) -1 (c) 1/3 (d) -0.2 b Which is the nearest to 0.1? (a) -9 (b) -0.2 (c) 2/17 c Which is the nearest to 5/4? (a) -1/5 (b) 2/3 (c) 1 (d) -4 c What is the nearest to -0.12 in -0.5, -0.07, 5/2, 0.3? -0.07 What is the nearest to -34 in 4/7, -4/5, 5? -4/5 Which is the closest to 0.2? (a) -1/3 (b) 0.5 (c) -123 b Which is the nearest to 1? (a) -1.7 (b) -0.5 (c) -4 (d) 1 d What is the closest to -2 in -3, 4, 0.21? -3 What is the closest to 1/3 in 0.3, 2/23, 1? 0.3 Which is the nearest to 27? (a) -0.4 (b) -9/5 (c) -5 (d) -0.3 d What is the nearest to 2/13 in 0.6, -0.2, 4, 0.2? 0.2 Which is the closest to 0.1? (a) -2 (b) 30 (c) -3/5 (d) -1 c Which is the closest to -1? (a) 0.05 (b) -0.5 (c) 34 (d) 1 b Which is the nearest to -13? (a) -3/4 (b) 7/6 (c) -3 c What is the closest to 13 in 8, 1, -1/5? 8 Which is the nearest to 2/13? (a) -3 (b) -8 (c) 1 c What is the nearest to -0.1 in 4, -0.5, -2, 3? -0.5 Which is the closest to 2? (a) 1.3 (b) -1/4 (c) -0.2 a What is the closest to 4/7 in -2, -0.1, -2/7, 1/3? 1/3 Which is the closest to 0? (a) -2/5 (b) -4 (c) -1/3 (d) 2/3 c Which is the closest to -1/3? (a) 0 (b) 0.3 (c) -0.4 (d) 30 c Which is the nearest to -4/47? (a) -2/11 (b) 5 (c) 0.7 (d) 0.02 a What is the nearest to 0.1 in 174, -1/4, -0.4? -1/4 Which is the nearest to -1? (a) 10 (b) -0.05 (c) 2 b What is the closest to -1.2 in -27, -1, 2/11? -1 What is the closest to -4 in 1, -5, 0? -5 Which is the nearest to 2/25? (a) -1/6 (b) -3 (c) 0.5 a What is the closest to 0 in -1, -0.16, 1/2? -0.16 What is the closest to -2/5 in 0.473, 5, -1/9? -1/9 Which is the closest to 0? (a) 41 (b) 3 (c) 3/10 c What is the closest to -1 in 49, -0.16, 0.2, -2/13? -0.16 What is the nearest to -18 in -2/11, -0.1, -2, 1? -2 Which is the nearest to -82? (a) -1/17 (b) -4 (c) -3 b Which is the closest to 5? (a) 2 (b) 2.8 (c) 2/3 b What is the closest to 6 in -4, -0.2, 5? 5 Which is the closest to 5? (a) 30 (b) -5 (c) 7 c What is the nearest to -0.2 in 0.4, -69, 0, 2? 0 Which is the closest to 10? (a) 0.1 (b) -4 (c) -69 a Which is the nearest to 1? (a) -5/4 (b) 0.1 (c) 4 (d) -270 b Which is the closest to -1? (a) -0.6 (b) 2 (c) -1 (d) -5 c What is the nearest to 1.1 in -1, -3, 2/7, 3? 2/7 Which is the closest to -18? (a) 4 (b) 1 (c) 1/4 c Which is the closest to 2/3? (a) 70 (b) -1/2 (c) -1 b What is the nearest to 0.36 in 0.4, 1/2, -4/3? 0.4 What is the closest to -3 in 1, 48, 0.5? 0.5 What is the closest to -3/8 in -1/10, 2/5, 8, -0.2? -0.2 Which is the nearest to 0? (a) 0.5 (b) -3/7 (c) 1.5 (d) -2 b What is the nearest to 1 in -5/4, -14, 0.4? 0.4 Which is the nearest to -1? (a) 0.52 (b) -2/3 (c) 0.1 (d) -1/6 b Which is the closest to -0.1? (a) -0.16 (b) 0.3 (c) 3/2 a Which is the closest to -1/4? (a) -3 (b) -5 (c) 165 (d) 2 d Which is the closest to 3? (a) -0.2 (b) -0.3 (c) -5 (d) 20 a Which is the closest to 0? (a) 0 (b) 4/5 (c) 0.4 a What is the nearest to 1 in -14/5, 0.3, 5? 0.3 What is the nearest to 1/3 in -0.5, -3, 0, -0.3? 0 What is the nearest to 1 in 5/3, 5, 0.3, -9? 5/3 What is the closest to -0.1 in -5/4, -4, -3/4, 2.1? -3/4 Which is the nearest to -5? (a) -0.1 (b) -5 (c) 12 (d) -1/3 b What is the nearest to 1/4 in 1, -2/11, 4/9, 1/3? 1/3 What is the nearest to -2 in 0.3, -4, -0.18? -0.18 What is the closest to -0.1 in -2, 0.2, -0.358? -0.358 What is the closest to 0.5 in 0.4, -3, 21? 0.4 Which is the closest to 86? (a) 7 (b) 0.2 (c) 4 a What is the nearest to 0 in -34, -0.3, 18? -0.3 What is the closest to -1 in 2, 4, 1/4, -2/13? -2/13 Which is the nearest to -14? (a) -53 (b) 1 (c) 4/5 c Which is the nearest to 11? (a) 2 (b) 0.4 (c) -0.04 (d) -3 a Which is the closest to 2/5? (a) 0 (b) -2/5 (c) -1 a What is the nearest to -1 in -1.9, 5, 0? -1.9 Which is the closest to -2/7? (a) 4 (b) -5 (c) -0.2 (d) 0.3 c Which is the nearest to 5? (a) -5 (b) -1 (c) 2/9 (d) 1.4 d Which is the closest to 1? (a) 9 (b) 2 (c) 3 (d) 0.2 d Which is the closest to 202? (a) -0.8 (b) -4/9 (c) 4 c What is the nearest to 5 in 2/5, -0.8, 5, -0.3? 5 What is the closest to -0.1 in -0.6, 3/8, -0.04, -2/45? -2/45 What is the closest to 0 in 586, 1, -7/3? 1 Which is the closest to -3? (a) 0 (b) 4 (c) -3 c What is the closest to -3 in -526, 0.4, -2? -2 What is the closest to 0.1 in -5, -1.27, 5? -1.27 What is the closest to 19 in 2/11, -3, 1? 1 Which is the closest to -0.077? (a) -2/9 (b) 0.01 (c) 2 b What is the closest to -0.06 in 0.1, -5, -10, 2? 0.1 Which is the nearest to 0.4? (a) -2 (b) -10 (c) 0.4 c Which is the nearest to -1? (a) 2/3 (b) 3 (c) 4 (d) -2/3 d What is the closest to 0.4 in 404, -3/4, 2/7, -3? 2/7 Which is the closest to 0? (a) -5 (b) -0.2 (c) 2 b What is the nearest to -2/149 in -2, 3, 9? -2 What is the nearest to 12 in -35, -5, -1/2? -1/2 Which is the closest to -1/8? (a) 1/3 (b) 0.2 (c) -4 (d) -1 b What is the closest to 2/5 in 2/7, -5, 317, -1/11? 2/7 What is the closest to -1 in 0, -215, 2/9, -0.5? -0.5 What is the nearest to -0.1 in -0.5, -4, 1/2, -0.1052? -0.1052 What is the nearest to 7 in -0.5, 1/2, 3/5? 3/5 Which is the closest to -6/11? (a) -2/173 (b) 0.1 (c) 1 a What is the nearest to -2/13 in 0.5, -1/34, -5? -1/34 What is the closest to 0 in -1/2, 5, 21? -1/2 Which is the closest to -2? (a) -3/8 (b) -7/4 (c) 3 (d) -1 b Which is the closest to 2/7? (a) -4 (b) 0.04 (c) -2/13 (d) -2 b What is the nearest to 28 in 0, -0.5, -3/5? 0 What is the closest to 5 in 0.05, 8, 0.1, -5? 8 Which is the closest to 7? (a) -11 (b) -0.3 (c) -2 b What is the nearest to -0.02 in 0.2, 2/7, 5? 0.2 Which is the closest to -1? (a) -0.5 (b) -1 (c) -28 (d) -2/13 b Which is the closest to 0.1? (a) -0.5 (b) 2/7 (c) 12 b Which is the nearest to -0.3? (a) -32 (b) 0.2 (c) 5 b Which is the closest to -10? (a) 15 (b) 2 (c) -0.1 (d) 0.2 c Which is the nearest to -0.1? (a) -1/2 (b) 2 (c) -0.4 (d) -12 c What is the closest to 0 in 0.3, 0, 28, -3/2? 0 Which is the closest to -2/3? (a) 0.02 (b) 0 (c) 118 b What is the nearest to -0.4 in 111, 11, -5? -5 Which is the nearest to -0.1? (a) -0.3 (b) 3 (c) -12 (d) 1/4 a Which is the nearest to 0? (a) 5 (b) 162 (c) 0.3 c Which is the closest to 1? (a) -3 (b) 2/5 (c) -27 (d) -1/6 b Which is the nearest to 5/4? (a) -3 (b) -42 (c) -4 a Which is the nearest to 0.2? (a) 0.5 (b) -2/3 (c) -5 (d) -2/17 a Which is the closest to -0.2? (a) -2/37 (b) -2/7 (c) 2 (d) 4 b Which is the closest to -2/5? (a) 1 (b) -2 (c) 5 (d) 57 a What is the nearest to -139/5 in 4, 0.1, -0.2? -0.2 What is the nearest to 0.2 in -4, 3, 2? 2 Which is the closest to -0.1? (a) -1 (b) -13 (c) 28 (d) -1/3 d What is the nearest to 12 in 1/6, -5, 10, -0.3? 10 Which is the closest to 0.1? (a) -3/4 (b) 3 (c) -1/3 c Which is the nearest to 0.2? (a) -4 (b) 1.6 (c) 5 (d) 0 d Which is the closest to -2? (a) -9 (b) 10 (c) 4 c What is the nearest to 0.02 in -1, -0.3, -15? -0.3 Which is the nearest to 1? (a) -7 (b) -5 (c) -2/5 c Which is the closest to 8/9? (a) -1/5 (b) 0 (c) 3 (d) -1/10 b Which is the nearest to -3/28? (a) 3 (b) 5 (c) -2 c Which is the nearest to 0.3? (a) 2/3 (b) 2/723 (c) 0.4 c What is the nearest to 1/3 in 2, 3/7, -1, 16? 3/7 Which is the nearest to 2? (a) -152 (b) -3	{ "pile_set_name": "DM Mathematics" }
assuming a is positive. a(-217/15) Simplify (((p(-4/3)p)/p(6/5))/(p/(p/(p/(pp*(2/7)/pp))))*(-2))/(((p/((pp(-1/2))/p))/p)(-1/4)/(p/p(-1/4))(-33)) assuming p is positive. p*(-36313/840) Simplify (ff(-2/7))(-2)(ff5/f)/(f/((f/(f/f(-8)))/f)f)(f/f*(-2/41)(ff8)/f)12 assuming f is positive. f(29032/287) Simplify (l(1/24)/ll*13)/(ll*(-1/48)l/(ll3ll)l) assuming l is positive. l(241/16) Simplify (o(2/3)/oo)(-14/11)(o/(oo(-4)o)o)/(oo*(-4))oo0/ooo/(o(-1)/o)(o(-1/4))(-3/2) assuming o is positive. o(2779/264) Simplify (l(-5/7)/l(6/7))(1/19)/((((l/l0)/l)/l)(-13/3)(l/(l(-4/7)/ll))/ll/l(-3)) assuming l is positive. l(-3586/399) Simplify ((g3g(g(1/2)/g)/gg)/(gg(-1))35)/(((gg*(2/7))/(g/(g/(gg5/g))))/(((g(5/4)/g)/g)/(g*(1/6)/gg))) assuming g is positive. g(529/84) Simplify ((h/h(-1/12)h/((((h(4/17)h)/h)/h)/h))(1/2))0 assuming h is positive. 1 Simplify (ss1s*5)/(s(ss(2/15))/sssss(-4)/ss)((s/((s/s(2/5))/s))(1/2))11 assuming s is positive. s(437/30) Simplify (b(-5)bb(-6)/b(bb/((b2/bb)/b))/(b/b*6))/((bb0)(-21)b(1/11)b2) assuming b is positive. b(153/11) Simplify (b/b(-2/3))(-1/9)/(bb(5/6)b*(-2/15))((bb1b)/(b*(-8)b))/(((b/(bb(-1/2)))/bb)/((b*(1/2)b)/b)) assuming b is positive. b*(2191/270) Simplify ((j/(j(j*(-2/9)j)/j)(jj*(-1/2))/jj)/((j*(2/9)/jj)/jj(((jjjj6)/j)/j)/j))/(j7/(j(-3)j))26 assuming j is positive. j(-479/2) Simplify ((f*23/ffff(f/f(-40))/fff)/(f/f(-15/7))(22/5))(-13/3) assuming f is positive. f(-24193/105) Simplify (l5l/l(-2/9))/(((l(2/7)l)/l)/l)(11/4)((ll(3/5)/ll)/l3)/(l(2/7))11 assuming l is positive. l(4591/1260) Simplify ((n*(-2/3)n/(n/(nnn5)))/((n(-3)n)/(n0/n)))/(((n(1/2)n)/n(3/5))/(n(2/9))(-2/9)) assuming n is positive. n(5171/810) Simplify (r*(2/39)rr(-15)(r*0r)(-8))(-34) assuming r is positive. r(29104/39) Simplify ((x/(x/x(2/7)))*(6/37)(x/(x*4/xx))(-9))(-22) assuming x is positive. x(-154110/259) Simplify ((x(-1))(2/91))(2/15)((xx*(5/6)xx)/(x(2/9)/xx))/((x(xxx(-1))/xx)/x)33 assuming x is positive. x(-240719/8190) Simplify ((j5/((j(2/59)/j)/j))/(((jj(-7/3))/jj)/j(j4j)/j))(-1/4) assuming j is positive. j(-469/354) Simplify (((i*(-5/2)/i)/ii)(-39)/(i/i(-1/5))(-34))(-22) assuming i is positive. i*(-19503/5) Simplify ((hh1)50/(hh(-1/4)h)(-21))/((h(-1))*(-1/9)(h(-2)/h)(1/4)) assuming h is positive. h(2473/18) Simplify (o(-2/17)/oo/o(-7))17/(((o/((oo*(-6))/o))/oo)/o*(-1/4)(oooo4)/(oo*(-1)o)) assuming o is positive. o(415/4) Simplify k(-3/7)/((((k(k/(k/(kk*(-4))k))/k)/kk)/k)/k)k1/(((k(-5)k)/k)/k)(k*(-2)kkk(-5))/(k/k(-1/2))22 assuming k is positive. k(-178/7) Simplify ((qq(-2)q(-14))(2/5))(-6) assuming q is positive. q36 Simplify (((i/i(-1/2))(-39)(iii(1/2))(-4/31))(5/2))21 assuming i is positive. i(-382935/124) Simplify ((s(-2/3))40/(s2(sss/((s/s*(-7))/s)s)/ss))/((s(-1/3))(-45))(-4/19) assuming s is positive. s(-1283/57) Simplify ((k(1/5))(2/41))(-45)((k*(-10/7)k)/((kk/k1)/k))(-10/13) assuming k is positive. k(-408/3731) Simplify g(3/29)/((g(2/67)g)/g)g(4/9)((g/g(16/5))/g)/g assuming g is positive. g(-321932/87435) Simplify (u/(u*(2/9)u))*(1/11)u*(1/6)u*7u((u/(u/((u(1/3)/u)/u)))3)27 assuming u is positive. u(-25117/198) Simplify (f(-35))(-11/5)(f/f(-5/8))(-2/27) assuming f is positive. f*(8303/108) Simplify ((ff*11/ffff)/(f/f*(1/14))f((f(-1/3)f)/f)/ff(2/13)ff)(-6) assuming f is positive. f(-8131/91) Simplify (u/(u(-5)u)u(2/5))(17/5)(u*3u*(-1/7))/(uu*(-4)u/(u/u(-1/3))) assuming u is positive. u(12889/525) Simplify (g(2/5)/g)(-42)(g/(gg5))/g(-4)(gg*0/gg)(11/3)/(g(1/3))(35/6) assuming g is positive. g(2333/90) Simplify jj(-6)j*(-1)(j0/j)(-1)(j1/(j(-2/3)j))/(j/j*(2/13)(jj3)/j) assuming j is positive. j(-319/39) Simplify (d2d/d*(-6))/((d/(d/(d/(dd*(-1)/d))d))/d*(-4))((d*4/d)/dd/(d*(-2/5)d)d)(-48) assuming d is positive. d(-796/5) Simplify ((i6/i(-6))/(i1)(-40))/(((i(-6)/i)/(iii(-5)))/(i/(ii(-2)))(-1/12)) assuming i is positive. i(335/6) Simplify (f/((f(1/11)/f)/f)ff/f*10f)*(-28)(f(-2))(4/9)(ff/f*1)/(f(((fff/f(-2))/f)/f)/f) assuming f is positive. f(11054/99) Simplify (((o/o(-2/5))(2/15)/((o/(oo(-3/7))oo)/(o(-3)/o)))(-6))(1/2) assuming o is positive. o(3277/175) Simplify (k(-2)kk)(7/4)k*(-7)k*(-2/13)/k(k*(1/4)kk)2/((kkk(-1)k)/(kkk/k*8k)) assuming k is positive. k*(-251/26) Simplify cc*6c(c/(c/(c(-2/13)c)))/cc(cc4)/c(-2/19)(c(-1/4))(1/8)/((cc0)/(c5/c)) assuming c is positive. c(133737/7904) Simplify (n/n8nn5)40(n(-1/4))(1/30)/(nn(-1/8)nnn4) assuming n is positive. n(-2813/60) Simplify ((s/(s/(ss2/s)))(-33)((s/(s/(s/(ss(-1/3))))ss)/s)(-2/23))/((s5ssss(-2))/(ss*(-2/9)s)(25/2)) assuming s is positive. s(-10328/207) Simplify ((o2)10)9/(o(5/4)ooo(2/13)o(o/((o(-2/5)o)/o))(-49)) assuming o is positive. o(63491/260) Simplify ((t0)(-9/7))(-13)/((t/(t/t(1/7)t))/t(tt(2/11)/t)/t)32 assuming t is positive. t(6592/77) Simplify (i2ii(1/11))(1/38)/(((ii*(1/11))/(i(iii*(2/11))/i))/((i/((ii*(-2/5)i)/i))/(i/i(-1/2)))) assuming i is positive. i(151/2090) Simplify (o(-3/4))6/(o/(((o/o(2/9))/o)/o))(9/10) assuming o is positive. o(-13/2) Simplify ((l(-2/17)/(l*(-1/4)l))/(l*(6/5)lllll((l/l(-1))/l)/lll))/(l(4/3)l*(-1/10)l*(-3)l5) assuming l is positive. l(-12547/1020) Simplify (((k(-1/5))(-28)/(k*(-2)k)(2/45))(-2/93))(-48) assuming k is positive. k(8128/1395) Simplify (p/p*(-2/9))/ppp(1/2)p(p(pp/(pp/p(1/2)))/p)(12/7)p/(ppp6p)p(2/5)pp4ppp*(3/4)p assuming p is positive. p(5959/1260) Simplify ((t4)*(-1/52)t(-2/3)/t(-8/9))(-2/9) assuming t is positive. t(-34/1053) Simplify (b*(-4)bb/(b(3/7)b))/(b*1b)*(2/7)b*(3/5)/(bb/(bbb/(bb(1/4)b))b)(b/(b*2/b)b)/bb(-3) assuming b is positive. b(-173/20) Simplify ((((f/(f(ff(2/9)f)/f)f)(4/11))42)(-21))(-38) assuming f is positive. f(-29792/11) Simplify (s1)37/(s/(s1s))*(9/8)(s(2/7))(1/25)s(-6)/s(2/25) assuming s is positive. s(44879/1400) Simplify (((uu0)/u)(2/17))*(-1)(uu5/uu(-4))/(u(-4)u/(uu/(u/((u/u*(1/8))/u)))u) assuming u is positive. u(31/8) Simplify (o(-7)o(-7))(-1/37)(o*(-2/21)o*(-5)/oo)(-18) assuming o is positive. o(23852/259) Simplify ((uu/u6u)(-21)/(u(2/15)/((uuu*(3/10)u)/u)))(-36) assuming u is positive. u(-2346) Simplify (x/(x*(10/13)x))*(-5/3)(x/(x/(x/(x*(15/4)xx))))/x(8/5) assuming x is positive. x(-3953/780) Simplify (n(-3/2)nn/(n/n2n))*(3/38)(n(-1/9)/(n8/n))/(nn(-2/11)nn3n) assuming n is positive. n(-96983/7524) Simplify z0zz*4z*6z*7(((zz/((z/(z(-1/20)/zz))/z)z)/z)/(zz(-1)))(-2/63) assuming z is positive. z(3767/210) Simplify (a(1/32)/aa)(-3/2)/(a(4/7)/a40) assuming a is positive. a(17643/448) Simplify ((r(r/(r*(1/7)r))/rrr)(-2/41)/((r/(r/r(-1/5)))/(r/(r/(r*(-9)r)))))(2/93) assuming r is positive. r(-22646/133455) Simplify (s9/(s(-6)/s))(-3/4)/((s(-1)s)(10/7)/(s(-2/19)s/(s(1/8)/s))) assuming s is positive. s(-1555/152) Simplify ((tt6/t)/(t(-1/4)/t))(9/7)((t2/t)/(t/t7))/(t/(t/t*(1/4)t)tt)36 assuming t is positive. t(-803/28) Simplify (f*20/(f/(f/((fff(12/7)f)/f))))/(ff/(f1ff)fff*(-2)/fff) assuming f is positive. f(114/7) Simplify (x(1/8)/(((xxx6x)/x)/xx))(-10/9)/(x(5/6)x/(x/x*(-4)x)xx/(xxxx1x)x(-6)) assuming x is positive. x(263/12) Simplify g(-3)g/((g/(g/((((g/(g*(-8)/g))/g)/g)/g)))/g)(g*6/g)/(gg**(-	{ "pile_set_name": "DM Mathematics" }
- z(v). 2v3 - v - 2 Let o(x) = -x. Let l(y) = -y + 8. Let p be l(5). Let t(m) = m3 + m - 2. Let u be t(0). Let w(v) = -2v. What is po(c) + uw(c)? c Let p(r) = -5r3 - 4r*2 + r - 2. Let c(s) = 9s*3 + 7s*2 - 2s + 3. Give -4c(j) - 7p(j). -j*3 + j + 2 Let x be ((-24)/16)/(3/8). Let d(w) = -3w - 2. Let n(t) = t + 1. What is xd(p) - 9n(p)? 3p - 1 Let h(n) = -n2 - 6n - 6. Let x(p) = p*2 + p + 7. Let g be x(0). Let k(i) = -2i2 + i2 - 4 - gi - 3. Let t = -191 + 184. Determine th(y) + 6k(y). y2 Let a(i) = -7i*2 - 4i - 8. Let d(w) = -15w2 - 9w - 17. Suppose 3b = -p + b + 6, 4p - 4 = -3b. Let l be 2 - 11/2p. Give la(o) - 6d(o). -o*2 + 2o - 2 Let w(t) = -3t + 2. Let y(a) = -a - 1. Suppose -2 = -5v + 3. What is vw(m) + y(m)? -4m + 1 Let r = 4 - 2. Suppose 0 = -ro + 50 - 18. Let h(d) = 3 - 4 + 10d - 5. Let q(s) = -3s + 2. Calculate oq(c) + 5h(c). 2c + 2 Let p(a) = 3a2 - 1. Suppose -1 = -u, -8z - 2u = -10z + 2. Let s(f) = 11f2 - 4. Calculate zs(j) - 9p(j). -5j*2 + 1 Let g(q) be the second derivative of -7q*4/12 + 7q*2/2 - 2q. Let n(o) = -8o2 + 8. Let m be -1 - (6/(-2 - 0) - 3). Determine mn(h) - 6g(h). 2h*2 - 2 Let q(z) = 2z*3 + 3z*2 + 3z - 4. Let t(p) = -5p3 - 8p*2 - 9p + 11. Calculate 8q(j) + 3t(j). j*3 - 3j + 1 Let n(q) = -6q2 - q2 + 3 + 8q*2. Let c(j) = 2j*2 + 8. Suppose 2f - 16 = -3l, 0l + 4l = 0. Let d be -5 + -1 - 21/(-7). Determine dc(r) + fn(r). 2r*2 Let r(w) = 5w*2 + 4w + 7 + 5w - 2w. Let u(n) = 2n2 + 3n + 3. Suppose 2d + c = 11, -7d + 2c + 5 = -2d. Give dr(j) - 7u(j). j*2 Let k(y) = 7y*2 + 5. Let s(n) = -7n*2 - 6n - 7. Let l(d) = d*2 + d + 1. Let b(x) = 6l(x) + s(x). Let z = 9 - -5. Let u = -8 + z. Determine ub(j) + k(j). j2 - 1 Let m(b) = 4b*2 - 7. Let o(p) be the first derivative of -2p + 1/3p3 + 1 + 0p*2. Determine -2m(r) + 7o(r). -r2 Suppose 5i - m + 14 = -5m, i = 3m + 1. Let b(f) = f3 + f2 - f. Let u(c) be the second derivative of c5/20 + c4/6 + 12c. What is ib(s) + u(s)? -s*3 + 2s Let w(m) = -8m. Suppose 1 = f, -3f - 15 = -2z + 10. Let k(t) = -t + 0t + 0t. Suppose -4n = 1 + 7. What is nw(a) + zk(a)? 2a Let f(x) = 155x*2 + 25x - 25. Let u(j) = 13j2 + 2j - 2. Determine 2f(c) - 25u(c). -15c2 Let c(g) = 9g*3 + 5. Let v(r) = -2r*3 - 1. What is -6c(a) - 26v(a)? -2a*3 - 4 Let d(n) = 3n - 7. Let j(t) = 3t - 8. Give -6d(z) + 5j(z). -3z + 2 Let h(l) = -7l2 + 2l - 8. Let b(c) = 13c2 - 4c + 15. Let j = 5 - 0. Suppose 14 = p + 5s - 7, 0 = 5p - js - 45. Determine ph(v) + 6b(v). v2 - 2v + 2 Let o(f) = -4f + 25. Let c(q) = -13q + 75. Give 2c(d) - 7o(d). 2d - 25 Let m(h) = -3h*3 + 5h*2 - 5h + 5. Let a(r) = 3r3 - 6r*2 + 6r - 6. Let g(v) = v*3 - 8v*2 - 2v + 10. Let x be g(8). Calculate xm(f) - 5a(f). 3f3 Suppose 0 = 5d + o + 3o - 25, 2d - 3o + 13 = 0. Let k(g) = -6g*3 - 5g*2 + 7g - 3. Let x(i) = -i3 - i2 + i - 1. Determine dk(r) - 5x(r). -r*3 + 2r + 2 Let l(k) = 3k2 - 4k + 4. Suppose 2v + 16 = -2v. Let p(w) = 4w2 - 5w + 1 - 1 + 5. Calculate vp(t) + 5l(t). -t*2 Let i(j) = -11j - 2. Let n(x) = -21x - 5. Give -7i(z) + 3n(z). 14z - 1 Let d(p) = -2p3 + 4p*2 - 5p + 1. Let l(g) = -4g2 + 4g. Let o(c) = -c*2 + c. Let y = -7 - -6. Let b(t) = yl(t) + 3o(t). What is 4b(x) - d(x)? 2x3 + x - 1 Let q be 0 + 1/(-3)3. Let g(j) = j3 - j2. Let l(r) = -4r3 - r2. Determine qg(s) - l(s). 3s3 + 2s2 Let o(c) = -c2 - c + 1. Let d(k) = -3k3 + 9k*2 + 9k - 9. Suppose l - 1 = -2s + 13, -5s = -5l + 100. Give lo(g) + 2d(g). -6g*3 Let u(c) = -115c + 8. Let t(g) = -230g + 15. Determine -6t(p) + 11u(p). 115p - 2 Let g(x) = 2x - 4x - 75x2 + 73x*2 - 3. Let q(z) = -3z*2 - 3z - 4. Determine 4g(v) - 3q(v). v*2 + v Let o(x) = 11x*3 - 2x*2 - 2. Let h(d) = 45d*3 - 9d*2 - 9. Determine 2h(k) - 9o(k). -9k*3 Let l(s) = 2s3 + s2 - 4s + 5. Let d(o) = 4o*3 + 2o*2 - 7o + 9. Calculate 4d(n) - 7l(n). 2n3 + n2 + 1 Let x(a) = -13a + 11. Suppose 2l - 4n - 22 = n, 4l - 44 = -3n. Let w be (-6)/24 - (-100)/16. Let y(p) = -2 + 7p + 4 - 2 - 6. Calculate ly(k) + wx(k). -k Let l(h) = 6h*3 + 4h*2 - 2h + 2. Let p(k) = 5k3 + 3k*2 - k + 1. What is -3l(t) + 4p(t)? 2t*3 + 2t - 2 Let h(d) be the first derivative of -2d3/3 + 3d*2/2 + 6d + 7. Let x(b) = -b*2 + b + 1. Determine -h(q) + 4x(q). -2q2 + q - 2 Let m(u) = -7u - 6. Let d(v) = -6v - 6. What is 4d(x) - 3m(x)? -3x - 6 Let m(y) be the second derivative of -y4/12 + y3/3 + y*2 + 5y. Let k(h) = h. Give -4k(l) + m(l). -l2 - 2l + 2 Let o(p) = -2p2 - 4. Let d(i) = -i2 - 1. Let h = 7 - 4. Let m(l) = -l + 2. Let z be m(h). Calculate zo(j) + 3d(j). -j2 + 1 Let c(v) = 4v*3 - 2v*2 - 2v + 3. Let p(a) = -a + 1. Determine c(h) - 2p(h). 4h*3 - 2h*2 + 1 Let w(x) = -1. Let i(f) = 3f - 4. Determine -i(o) + 3w(o). -3o + 1 Let b(y) = -y*2 + y + 1. Suppose c + 0c = 3d - 22, c - 2d = -24. Let j(o) = -8o2 + 7o + 7. Give cb(n) + 4j(n). -4n2 Let q(j) = j2 - j - 1. Suppose -15 - 5 = -4z. Let t be (z/10)/(2/4). Let b(k) = -k*3 + k + 1. What is tb(u) + q(u)? -u3 + u2 Let m(z) = z*3 - 6z - 5. Suppose 5a + 10 = 4w, -6a = -2w - a. Let j = -4 - -7. Let c(v) = -v*j + 1 + 5v + 0v3 + 3. Give wm(x) + 6c(x). -x3 - 1 Let i(z) = 10z*2 + 2z - 3. Let w(y) = -41y2 - 9y + 13. What is -9i(s) - 2w(s)? -8s2 + 1 Let j(h) = 2 + 3 - h + 1. Suppose 12 = b - 2b + 2f, 8 = -4b - 2f. Let o(t) = -t2 - 5t + 2. Let k be o(b). Let a(g) = 1. Calculate ka(y) - j(y). y Let i(d) = 1. Let w be 1 + (-5 - 10/(-5)). Let u(j) = -3j*2 + j + 3. Calculate wi(k) + u(k). -3k2 + k + 1 Let g(i) = i - 1. Let j(b) = -12b + 24. Calculate -24g(o) - j(o). -12o Let d be 8/(-12) + (-1)/3. Suppose -5k - 18 = p - 0k, 0 = -3p - 5k - 14. Suppose 4j = 3j - p. Let y(r) = r. Let g(u) = -u - 1. What is dy(a) + jg(a)? a + 2 Let y(z) = -z + 4. Let v be (-96)/52 + 4/(-26). Let c(r) = 1. Calculate vc(n) + y(n). -n + 2 Let t(f) = -16f*2 + 16f + 10. Let p(h) = -3h2 + 3h + 2. What is -11p(j) + 2t(j)? j*2 - j - 2 Let n(l) = 8l + 5. Let k(t) = 4t + 2. Calculate -5k(u) + 2n(u). -4u Let v(w) = -11w. Let c(a) = -18a + a + 5a. Give 6c(s) - 7v(s). 5s Let l(s) be the second derivative of s*4/6 - 5s*3/6 + 8s. Let m(x) be the first derivative of -2x3 + 7x*2 - 1. Calculate 14l(d) + 5m(d). -2d2 Let h(u) be the third derivative of -u4/24 - 2u2. Let x(l) = l3 - 7l*2 + 6l - 1. Let p be x(6). Let n(g) = -g*2 - g. What is ph(y) + n(y)? -y*2 Let r(n) = 2n*2 + 5n + 2. Let s(o) be the first derivative of o*3/3 + 2o*2 + 2o - 34. Suppose -3 = -5b + 12. What is bs(c) - 2r(c)? -c2 + 2c + 2 Let h be 3((-15)/(-9) + 0). Let n(p) = -p3 - 2p + 2. Let s(x) = 2x3 + x2 + 3x - 5. Determine hn(r) + 2s(r). -r*3 + 2r*2 - 4r Let o = 1 - 2. Let c(v) = -v*2 - v - 4. Let d(j) be the first derivative of 5 + 4 + j - 5. Determine oc(n) - 4d(n). n2 + n Let u(d) = d + 8. Let v be (-148)/28 - 4/(-14). Let z be u(v). Let f(t) = zt - 2t2 + t2 - 5t. Let l(n) = 2n2 + 3n. Give 3f(m) + 2l(m). m*2 Suppose 3n - 3 = 4x + 25, 4n - 14 = 3x. Let h = x + 4. Let o = -1 - h. Let y(z) = 7z*2 + 5z + 5. Let w(c) = -4c2 - 3c - 3. Determine ow(l) + 3y(l). l*2 Let u(m) = -m + 4. Let g(y) = -5 + 2 + 0. Give -3g(z) - 2u(z). 2z + 1 Let y(o) = -70o3 - 21o*2 - 21. Let a(u) = -7u*3 - 2u*2 - 2. Give -21a(w) + 2y(w). 7w3 Let l(t) = -t2 + t - 1. Let y(j) = -3j3 + 3j*2 - 3j + 3. Calculate 3l(m) + y(m). -3m3 Let m(l) = -l2 + l - 1. Suppose 0 = -5j - 5. Let q(h) = -2h*3 + 4h*2 - 5h + 4. Calculate jq(r) - 4m(r). 2r3 + r Let x(o) be the second derivative of -o4/3 + o3/3 - o2 - 20o. Let k(w) = -w*2. Determine 2k(r) - x(r). 2r2 - 2r + 2 Let y(a) = 4a - 1. Let q(i) = -5i + 1. Let n be (8/6)/((-1)/(-3)). Give ny(c) + 3q(c). c - 1 Let b(k) = 8k3 - k2 + 4k. Let v(t) = 8t3 - t2 + 3t. Determine -3b(j) + 4v(j). 8j3 - j*2 Let i(y) = y - 1. Let n be 1 + -	{ "pile_set_name": "DM Mathematics" }
b*2. -1075b*2 Collect the terms in -8 + 4 + 8 + 3k. 3k + 4 Collect the terms in 3o*2 + 0o*2 - 11o*2. -8o*2 Collect the terms in 95823 + z - 95823. z Collect the terms in -2 - 33g + 35g + 2. 2g Collect the terms in -k3 + k3 - 36 + 2k3. 2k3 - 36 Collect the terms in 20 - 42 + x3 + 22. x*3 Collect the terms in 6f*3 + 1565 - 1565. 6f*3 Collect the terms in 1373 - 1373 + 8m. 8m Collect the terms in m - 5142 + 5142. m Collect the terms in -2b*2 + 11b2 - b2 + 2b2 - 7b*2. 3b*2 Collect the terms in 13s*3 - 104s*2 + 206s*2 - 102s*2. 13s*3 Collect the terms in -17v + 6v + 39 + 10v. -v + 39 Collect the terms in 8 - 3d - 3 + 5 - 2. -3d + 8 Collect the terms in -254s2 + 0 + 1 + 269s*2. 15s*2 + 1 Collect the terms in 0 + 5g + 20 - 3g. 2g + 20 Collect the terms in 426b3 - 215b*3 - 206b*3. 5b*3 Collect the terms in 27q*3 - 82q*3 + 27q*3 + 27q3. -q3 Collect the terms in -9m2 - 3m - 4m2 + 16m*2 + 3m. 3m2 Collect the terms in 1373s*2 + 1374s*2 + 2s - 2s - 2743s*2. 4s*2 Collect the terms in 79k*2 - 36k*2 - 37k*2. 6k*2 Collect the terms in 49y*3 - 183y*3 + 141y*3. 7y*3 Collect the terms in -1387x*3 - 1388x*3 - 1386x*3 + 4163x*3. 2x*3 Collect the terms in 3u*2 + 11u*2 + 2u*2. 16u*2 Collect the terms in 3x - 18x + 25x*3 + 9x + 4x. 25x*3 - 2x Collect the terms in -7163c2 + 7163c*2 - 7c*3. -7c*3 Collect the terms in -7w*2 - 4w*2 - 11w*2 + 19w*2. -3w*2 Collect the terms in 2d + 57956 - 57956. 2d Collect the terms in 68q*2 + 71q*2 + q - 151q*2. -12q*2 + q Collect the terms in -2y - y - 162649 + 162649. -3y Collect the terms in -3n - 2n + 5n - 5n. -5n Collect the terms in 2 + 44045w - 2 - 44058w. -13w Collect the terms in 163216 - 163216 - 2v*2. -2v*2 Collect the terms in -3q*2 + 13q*2 - 1 + 9q2 + q2. 20q2 - 1 Collect the terms in -327w + 158w + 163w. -6w Collect the terms in 2o*3 + 3o*3 + 10o - 4o3. o3 + 10o Collect the terms in 11j2 - 1 + 1. 11j*2 Collect the terms in 6z*3 - 4z*3 - 14z*3. -12z*3 Collect the terms in 4466 + 3j - 4466. 3j Collect the terms in 2h - 4378 + 4378. 2h Collect the terms in -3o - 4o - 169 + 5o. -2o - 169 Collect the terms in 9s - 7 - 5 + 6. 9s - 6 Collect the terms in -1075 + 536 + 539 - 5j + 19j. 14j Collect the terms in -3j + 3862 + 4j - 3862. j Collect the terms in -3x3 + 1706 - 1706. -3x*3 Collect the terms in -261g*3 + 258g*3 - 461g*2 + 461g*2. -3g*3 Collect the terms in -8 + 8 + 102f*2 - 90f*2. 12f*2 Collect the terms in -15j*2 - 25j*2 + 42j*2. 2j*2 Collect the terms in -205m*2 - 172m*2 + 322m*2. -55m*2 Collect the terms in -207 + 207 + 17v*2. 17v*2 Collect the terms in 243 - 407i*2 - 243 + 405i*2. -2i*2 Collect the terms in -103i*2 - 331i*2 - 23i*2 - 136i*2. -593i*2 Collect the terms in -10560 + 10560 - 3x*2. -3x*2 Collect the terms in 160i*3 - 54i*3 + 107i*3. 213i*3 Collect the terms in 19 - 6t*2 - 41 + 22. -6t2 Collect the terms in q3 + 2q3 - 22053q*2 + 3q*3 + 22053q*2. 6q*3 Collect the terms in -2o + 4o + 28o - 4o. 26o Collect the terms in -17 + p*2 + 17 + 72p3 + p2. 72p3 + 2p*2 Collect the terms in 56610 - 5h - 56610. -5h Collect the terms in -156 + 156 + 9l*2. 9l*2 Collect the terms in -199z + 400z - 199z. 2z Collect the terms in -3g + 2g3 + 9g - 6g. 2g*3 Collect the terms in -9 + 9 + 0n*2 - 6n*2. -6n*2 Collect the terms in 5504r - 5504r - 5r*2. -5r*2 Collect the terms in 23 - 49l - 23. -49l Collect the terms in -3j*3 - 7j*3 - 10j*3 + 4j*3. -16j*3 Collect the terms in 39 + 46 - 8m - 85. -8m Collect the terms in 11n2 - n3 + 23n2 + 11n2. -n3 + 45n2 Collect the terms in 9f*2 + 16f - 16f. 9f*2 Collect the terms in -200c + 90c + 111c. c Collect the terms in 2a3 + 64 + 19a*2 - 19a*2. 2a*3 + 64 Collect the terms in -2 + 1 + 8 - 80h*3. -80h*3 + 7 Collect the terms in -32w - 40w + 1 + 24w. -48w + 1 Collect the terms in -27p*3 + 21 - 8 - 13. -27p*3 Collect the terms in 19g*3 - 65g*3 + 3 - 3. -46g*3 Collect the terms in 35 + 4o - 2o - 74 + 39. 2o Collect the terms in -26h + 63h - 31h. 6h Collect the terms in -6y + 2y - 3y + 3y. -4y Collect the terms in g - 10g - 27g. -36g Collect the terms in 103 - 103 - 7v. -7v Collect the terms in -621t3 - 622t*3 + 1241t*3. -2t*3 Collect the terms in -3197 - 5q - 8q3 + 3197 + 5q. -8q3 Collect the terms in -q3 - 2q*3 + 2q*3 - 5q*3. -6q*3 Collect the terms in 22x - 6x + 16x. 32x Collect the terms in 46y + 19 - 15 - 4 - 54y. -8y Collect the terms in -61l3 + 26l*3 + 25l*3. -10l*3 Collect the terms in -9z + 23z3 - 19z*3 - 7z*3 + 9z. -3z3 Collect the terms in 24g*2 + 0g + 0g + 10g*2. 34g2 Collect the terms in -381 + 381 + i2 - 4i2. -3i2 Collect the terms in c2 - 113907c + 113907c. c*2 Collect the terms in 10z*2 - 23z*2 - 18z*2. -31z*2 Collect the terms in -6b*3 + 7b*3 - 13b*3 - 13b*3. -25b3 Collect the terms in h3 + 6h3 + 8h*3 - 10h*3. 5h*3 Collect the terms in 5o*3 - 12o*3 + 9o*3. 2o*3 Collect the terms in 14l*3 + 13l*3 - 3 + 4 - 5. 27l*3 - 4 Collect the terms in -7 - 9h*2 + 14 - 7. -9h*2 Collect the terms in -6m*2 + 5m*2 + 6m*2. 5m*2 Collect the terms in 4u*2 + 97u*3 - 4u*2 + 0u*2. 97u*3 Collect the terms in 1939m*2 + 44m*3 - 22m*3 - 1939m*2. 22m*3 Collect the terms in -6z*2 - 108z*2 - 64z*2. -178z*2 Collect the terms in -513j*2 + 1554j*2 - 518j*2 - 524j2. -j2 Collect the terms in 57y3 - 81y*3 - 24y*3. -48y*3 Collect the terms in -45h*3 - 61h + 61h. -45h*3 Collect the terms in 1005k*2 - 131k*2 + 2973k*2 - 643k*2. 3204k*2 Collect the terms in 94y - 33y - 31y. 30y Collect the terms in -5 + 1 + 366b + 4. 366b Collect the terms in -3 - 15 + 4o*3 + 18 - 2o*3. 2o*3 Collect the terms in 14h*3 + 39h*3 + 119h*3. 172h*3 Collect the terms in -17c - 2 - 5c + 0. -22c - 2 Collect the terms in -2r2 - 4r*2 + 6r2 + r2. r*2 Collect the terms in 5p - 13207p3 - 4p + 13217p3 - p. 10p*3 Collect the terms in -7088o*3 + 14170o*3 - 7088o*3. -6o*3 Collect the terms in 4f - f - 5f + 0f. -2f Collect the terms in 18477a - 18477a + 3a*3. 3a*3 Collect the terms in 8r - 24r - 13r. -29r Collect the terms in 5 + 0f - 14 + f + 9. f Collect the terms in -v - 2v + v + v + 3v. 2v Collect the terms in -4i*2 + 6i*2 + 5i*2 + 0i*2. 7i*2 Collect the terms in 54 - 182 + 67 + 61 - 5l. -5l Collect the terms in 5 + 0 - 6 - 23o. -23o - 1 Collect the terms in 3q + 0q + 0q - 59 + 59. 3q Collect the terms in 4v + 12v + 5v - 22v. -v Collect the terms in x2 + 24665 - 24665. x2 Collect the terms in 21v*2 + 2v*3 - 18v*3 + v - v. -16v*3 + 21v*2 Collect the terms in 26y*2 + 23y*2 + 48y*2. 97y*2 Collect the terms in 0a*2 + 4a*2 + 2a - 2a - 2a*2. 2a*2 Collect the terms in 2y*3 - 11y*3 - 7y*3. -16y*3 Collect the terms in -4a*2 - 3 + 0a2 + a2 + 2a2. -a2 - 3 Collect the terms in -16y - 234 + 234. -16y Collect the terms in 7 - 10x + 32x - 10x - 11x. x + 7 Collect the terms in -212x*3 + 2229 - 2229 - 7x*3. -219x*3 Collect the terms in -2f + 0f - 2f*2 + 2f. -2f2 Collect the terms in 2s - 2s + 2s - 31 + 31. 2s Collect the terms in 1047o*3 - 1046o3 - 2 + 2. o3 Collect the terms in 5g + 1680 - 1680. 5g Collect the terms in 9t + 2t + 0t. 11t Collect the terms in -207m2 + 2449m*2 + 200m*2. 2442m*2 Collect the terms in 386l2 + l3 + 2l3 - 386l*2. 3l*3 Collect the terms in -244f + 244f + 54f*2. 54f*2 Collect the terms in 180k - 87k - 91k. 2k Collect the terms in -114c*2 + 114c*2 + 10c*3. 10c*3 Collect the terms in -5 + 0h + 0h - h. -h - 5 Collect the terms in 87r - 87r + 10r*2. 10r*2 Collect the terms in 8 - 165n + 4 + 167n. 2n + 12 Collect the terms in -i*3 + 0i3 + i3 + 2i3. 2i**3 Col	{ "pile_set_name": "DM Mathematics" }
ng 2 s. 2/5 What is prob of picking 1 k and 1 d when two letters picked without replacement from {h: 1, j: 2, s: 3, d: 1, k: 1, l: 3}? 1/55 Three letters picked without replacement from rrrrpgjrruvvurrrrru. What is prob of picking 1 v, 1 p, and 1 r? 22/969 Three letters picked without replacement from tggrtrggrgrggrrtgtgg. Give prob of picking 2 g and 1 r. 9/38 What is prob of picking 1 d, 1 v, 1 z, and 1 i when four letters picked without replacement from dvzkvkiivdvzvzd? 6/91 Calculate prob of picking 2 t when two letters picked without replacement from {t: 2, l: 3, a: 1, q: 1, g: 5, m: 3}. 1/105 What is prob of picking 1 d, 2 r, and 1 q when four letters picked without replacement from darqqrqqdladaalrqpq? 9/646 Three letters picked without replacement from {j: 1, p: 11, e: 1, z: 2, o: 3, c: 1}. Give prob of picking 1 c, 1 j, and 1 o. 1/323 What is prob of picking 3 r when three letters picked without replacement from {k: 1, r: 11}? 3/4 What is prob of picking 1 f and 1 j when two letters picked without replacement from {n: 1, f: 1, i: 2, j: 2, a: 2}? 1/14 Two letters picked without replacement from {y: 2, t: 2, f: 1}. What is prob of picking 1 t and 1 f? 1/5 Three letters picked without replacement from xyggqyjj. Give prob of picking 1 y, 1 j, and 1 x. 1/14 Three letters picked without replacement from {v: 6, l: 13}. What is prob of picking 1 l and 2 v? 65/323 What is prob of picking 2 w when two letters picked without replacement from kwdwwwkwk? 5/18 Calculate prob of picking 1 n and 1 i when two letters picked without replacement from nhwhhiwhihciwihnhih. 10/171 Three letters picked without replacement from qiqiqqqqiqiqjjqi. Give prob of picking 1 i and 2 q. 9/28 Calculate prob of picking 3 i when three letters picked without replacement from {i: 6}. 1 Two letters picked without replacement from owowwoo. What is prob of picking 2 w? 1/7 Three letters picked without replacement from {u: 5, l: 1, h: 4, j: 8}. What is prob of picking 1 j and 2 h? 1/17 Calculate prob of picking 1 f and 1 o when two letters picked without replacement from fzzzwozzwzozfz. 4/91 Three letters picked without replacement from opiipiipop. What is prob of picking 2 o and 1 p? 1/30 What is prob of picking 2 y and 2 n when four letters picked without replacement from vvvnoznvznnyvvvy? 3/910 What is prob of picking 1 d, 1 j, and 1 p when three letters picked without replacement from {p: 1, d: 1, j: 1, k: 1, t: 3}? 1/35 Calculate prob of picking 3 y when three letters picked without replacement from hyhyyhyyyyyyyy. 165/364 Four letters picked without replacement from {i: 5, s: 5, w: 3, y: 1, k: 2}. What is prob of picking 2 s, 1 k, and 1 i? 5/91 What is prob of picking 1 g, 2 r, and 1 l when four letters picked without replacement from rglrgttk? 1/35 Two letters picked without replacement from {m: 11, t: 3}. Give prob of picking 2 t. 3/91 Three letters picked without replacement from wwwwww. What is prob of picking 3 w? 1 What is prob of picking 4 r when four letters picked without replacement from {b: 6, r: 12}? 11/68 Two letters picked without replacement from pftgtlo. Give prob of picking 1 p and 1 g. 1/21 Four letters picked without replacement from {w: 1, p: 3, b: 1, l: 3, f: 1, g: 2}. What is prob of picking 1 l, 1 p, 1 w, and 1 b? 3/110 What is prob of picking 2 p and 1 u when three letters picked without replacement from {p: 3, u: 5}? 15/56 What is prob of picking 1 y and 1 n when two letters picked without replacement from {y: 1, g: 1, s: 2, n: 1, a: 2}? 1/21 Two letters picked without replacement from {e: 2, t: 9}. Give prob of picking 2 t. 36/55 What is prob of picking 2 p and 2 f when four letters picked without replacement from {h: 3, f: 6, p: 6}? 15/91 Three letters picked without replacement from {k: 7, t: 3, e: 8, n: 2}. Give prob of picking 2 t and 1 e. 2/95 What is prob of picking 3 q when three letters picked without replacement from qqqqqqq? 1 Three letters picked without replacement from {h: 1, e: 4, y: 8}. What is prob of picking 3 e? 2/143 Two letters picked without replacement from kggklggyyygl. What is prob of picking 1 l and 1 k? 2/33 Four letters picked without replacement from mqqqmqqmmqqqsqsq. What is prob of picking 4 m? 1/1820 Four letters picked without replacement from sppppspgsspppppss. What is prob of picking 1 g, 1 s, and 2 p? 27/238 Three letters picked without replacement from yzyeezxxx. What is prob of picking 3 x? 1/84 Two letters picked without replacement from {s: 2, p: 4, x: 1, a: 8}. What is prob of picking 1 x and 1 s? 2/105 Two letters picked without replacement from {l: 6, d: 2, e: 1, u: 3}. What is prob of picking 1 d and 1 e? 1/33 Four letters picked without replacement from {s: 6, d: 9, a: 2}. Give prob of picking 1 a, 1 s, and 2 d. 108/595 Three letters picked without replacement from {z: 1, o: 6, x: 3, v: 3, a: 1}. What is prob of picking 1 v and 2 o? 45/364 Four letters picked without replacement from {x: 2, i: 5, r: 13}. Give prob of picking 2 i and 2 x. 2/969 What is prob of picking 2 w when two letters picked without replacement from {m: 15, w: 3}? 1/51 Four letters picked without replacement from {v: 1, s: 3, d: 1, k: 4, q: 1, y: 4}. What is prob of picking 1 k, 1 y, 1 s, and 1 d? 48/1001 What is prob of picking 3 a and 1 k when four letters picked without replacement from ajkcjjjjkjkjjkaaaajk? 10/969 Four letters picked without replacement from {m: 3, c: 4}. Give prob of picking 2 m and 2 c. 18/35 Calculate prob of picking 1 x and 2 g when three letters picked without replacement from {x: 3, o: 3, t: 3, g: 2, e: 3, y: 1}. 3/455 Calculate prob of picking 1 n and 3 g when four letters picked without replacement from gnxxngggggxngsngggng. 55/323 Two letters picked without replacement from {t: 3, w: 1, q: 9, j: 1}. What is prob of picking 1 q and 1 t? 27/91 Three letters picked without replacement from hvvvhvhvhvhv. What is prob of picking 3 h? 1/22 Four letters picked without replacement from lfutrlffrfulrtrrrr. What is prob of picking 1 f, 2 u, and 1 r? 7/765 Three letters picked without replacement from jjjjrjjjjjjrj. Give prob of picking 3 j. 15/26 Calculate prob of picking 2 m and 1 j when three letters picked without replacement from pjmjm. 1/5 Calculate prob of picking 1 x and 1 b when two letters picked without replacement from xxunvevvbvvbebvvve. 2/51 Two letters picked without replacement from cqqccrrcrkkxkccpkxcr. Give prob of picking 2 x. 1/190 Calculate prob of picking 4 v when four letters picked without replacement from {v: 2, o: 2, g: 1, t: 1}. 0 Three letters picked without replacement from ixmjuexuuxmxuux. Give prob of picking 2 u and 1 x. 10/91 What is prob of picking 2 a when two letters picked without replacement from {z: 5, h: 2, j: 1, a: 3, w: 1}? 1/22 Four letters picked without replacement from ippfftqpppizptpppfi. What is prob of picking 2 t, 1 p, and 1 f? 9/1292 What is prob of picking 2 z when two letters picked without replacement from {f: 7, i: 2, z: 8, p: 3}? 14/95 Calculate prob of picking 1 a and 1 w when two letters picked without replacement from {w: 1, c: 10, i: 1, a: 1}. 1/78 Calculate prob of picking 2 v and 1 o when three letters picked without replacement from uvofduffffvfdv. 3/364 Three letters picked without replacement from xdxxxxxxxxxxxdxzxxdx. Give prob of picking 3 d. 1/1140 Three letters picked without replacement from {g: 2, e: 1, c: 1, j: 7, k: 4}. What is prob of picking 1 c, 1 k, and 1 j? 4/65 What is prob of picking 1 c and 1 n when two letters picked without replacement from cccccnnccccccccn? 13/40 Calculate prob of picking 1 y and 1 h when two letters picked without replacement from {y: 1, b: 3, r: 7, q: 1, h: 2}. 2/91 Calculate prob of picking 1 k and 1 y when two letters picked without replacement from {m: 4, k: 3, y: 2}. 1/6 What is prob of picking 2 f when two letters picked without replacement from fffggffggff? 21/55 Calculate prob of picking 2 d when two letters picked without replacement from {i: 1, d: 3, a: 6, j: 3}. 1/26 Four letters picked without replacement from {d: 8, e: 3}. What is prob of picking 3 d and 1 e? 28/55 Three letters picked without replacement from {l: 2, n: 6}. What is prob of picking 3 n? 5/14 Four letters picked without replaceme	{ "pile_set_name": "DM Mathematics" }
2. 296411h2 Collect the terms in 141 - 171r*2 + 97 - 340 + 199r*2 + 102. 28r*2 Collect the terms in -12d - 12660 + 6330 + 3774d3 + 11d + 6331. 3774d3 - d + 1 Collect the terms in 142n + 134n - 285n - 128 - 423. -9n - 551 Collect the terms in 695g*2 - 2 + 0 + 111g - 690g2. 5g*2 + 111g - 2 Collect the terms in -36046 + 36046 + 55c2 + 2c - 2c - 59c*2. -4c*2 Collect the terms in 77s*3 + 56s*2 + 5s*3 - 84s*3 - s + 91s*2. -2s*3 + 147s*2 - s Collect the terms in -302j*3 + 444j*3 - 333j*3 - 152j*3. -343j*3 Collect the terms in 4 + 4 + 11 + 1020d*2 - 1022d*2 - 26 + 7. -2d*2 Collect the terms in 13a*2 + 8a*2 - 21a*2 + 778a*3 - 1289a*3 + 505a*3. -6a*3 Collect the terms in -2118423343 + 2118423338 - 178f*2 + 176f*2. -2f*2 - 5 Collect the terms in 1120h*3 - 2 + 2 - 1658h*3 + 424h*3. -114h*3 Collect the terms in 6913g + 13351g - 1155g + 1707g - 2698g. 18118g Collect the terms in -2125 - 26i - 3231 - 1628 - 27i + 52i. -i - 6984 Collect the terms in 64651k3 + 4 - 2k*2 + 18 - 20 + 2k. 64651k3 - 2k*2 + 2k + 2 Collect the terms in -269l - 97l - 173l. -539l Collect the terms in -765 - 49u + 28u - 1874 - 51u. -72u - 2639 Collect the terms in -2563v2 - 7v + 23v - 5v - 13v - 493v*2. -3056v*2 - 2v Collect the terms in 33 + 110y3 - 29 - 229y*3 + 117y*3. -2y*3 + 4 Collect the terms in -29m + 6915m2 + 6919m*2 + 34m - 13867m2. -33m*2 + 5m Collect the terms in -5347520h2 + 1782526h*2 + 1782513h*2 + 1782476h*2. -5h*2 Collect the terms in -571257d + 571257d + 2d*3. 2d*3 Collect the terms in -528452o + 528452o - 71o*2. -71o*2 Collect the terms in 352332w*3 + 561w - 561w - 352388w*3. -56w*3 Collect the terms in -13b*2 + 2 - 1 - 22b*2 - 1194b*3. -1194b*3 - 35b*2 + 1 Collect the terms in 2s - 6068 - 2s + 3s*2 + 0s + 6091. 3s2 + 23 Collect the terms in 2982v*2 + 2981v*2 - 8945v*2 - 28v*3 + 34 + 2982v*2. -28v*3 + 34 Collect the terms in 7350 - 7350 - 12930p + 12965p. 35p Collect the terms in 255973h2 - 52 + 110 - 56 + h. 255973h*2 + h + 2 Collect the terms in 668r*3 + 371555094r*2 + 3 - 371555094r*2 - 5. 668r*3 - 2 Collect the terms in 83199l + 179916l - 127427l + 194654l. 330342l Collect the terms in -36614j + 18364j + 16620j. -1630j Collect the terms in 8738b + 49952b + 7491b - 1. 66181b - 1 Collect the terms in -502t3 + 2005t*3 + 1994t*3 - 3493t*3. 4t*3 Collect the terms in 2m*3 + 1297 - 12487m + 12487m. 2m*3 + 1297 Collect the terms in -681u*2 + 21202u*3 - 21443u*3 - 247u*2. -241u*3 - 928u*2 Collect the terms in -1 - 14569h*3 + 7093h*3 + 7128h*3. -348h*3 - 1 Collect the terms in -20211f*2 - 20212f*2 - 20004f*2 + 60419f*2. -8f*2 Collect the terms in 48192 - 74q - 48194 - 505q. -579q - 2 Collect the terms in -6440t + 19530t - 24t2 - 10t*2 - 6546t - 6542t. -34t*2 + 2t Collect the terms in -7d3 + 200 + 23d*3 - 19d*3 + 0d*3 - 200. -3d*3 Collect the terms in 82142489958191v + 21v2 - 82142489958191v. 21v2 Collect the terms in -6935b*2 - 6898b*2 + 686b*3 + 13833b*2 + 112b*3. 798b*3 Collect the terms in -15838 - 24672 - 49919 - 3y*3 - 30088. -3y*3 - 120517 Collect the terms in -390h - 71 + 168 - 45 - 51. -390h + 1 Collect the terms in -49008b - 51443b + 88873b + 140468b + 215947b. 344837b Collect the terms in -20008472h - 26h3 + 20008472h. -26h3 Collect the terms in -6 + 3 + 296i*3 - 454i*3. -158i*3 - 3 Collect the terms in -30f*2 + 43f + 107f - 44f*2 + 4f*2. -70f*2 + 150f Collect the terms in -2 - 4744h + 2h*2 - 4h*2 - 4706h + 9408h + 2. -2h*2 - 42h Collect the terms in 85x + 736179 - 125x + 319x - 736179. 279x Collect the terms in 7648 + 7q2 + 7653 - 19028 + 3727. 7q*2 Collect the terms in 1 + 95 - 11 - 12 - 19 - 17 + 5v. 5v + 37 Collect the terms in 164v + 481v - 257v*2 - 645v. -257v2 Collect the terms in -4m - 11278 + 0m - 10m - 17437. -14m - 28715 Collect the terms in 77 - 3342g*2 + 451 - 528. -3342g*2 Collect the terms in -150d*3 - 905d*3 - 1177d*3. -2232d*3 Collect the terms in -6792532n*2 + 1598112n*2 - 3316648n*2. -8511068n*2 Collect the terms in 106149031n*2 - 184n*3 + 20n*3 - 106149031n*2 + 2. -164n*3 + 2 Collect the terms in -1220083 - 1220196 + 50y*2 - 55y*2 + 2440279. -5y*2 Collect the terms in 396b + 365b - 761b - 2 - 6701b3 + 6696b*3. -5b*3 - 2 Collect the terms in 6s - 93s3 + 6s*2 - 23s*2 - 14s. -93s3 - 17s*2 - 8s Collect the terms in 70v + 78v - 10 + 184v + 8. 332v - 2 Collect the terms in 204 - 26 + 1252b2 - 180. 1252b*2 - 2 Collect the terms in -159g + g*2 - 3g*2 - 185g + 5g2 - 7g*2 - 2. -4g*2 - 344g - 2 Collect the terms in -272908911969 + 272908911969 - 2i. -2i Collect the terms in -1018 + 3221 - 3d2 + 5d*2 - 1190 - 1013 - 5d*2. -3d*2 Collect the terms in -16d*3 + 19d*3 - 6470 + 6470 + 17d*3. 20d*3 Collect the terms in 597763n - 1195529n + 597766n - 2n2 - 554n*3. -554n*3 - 2n*2 Collect the terms in -225i*3 - 193i*3 - 196i*3 + 606i*3. -8i*3 Collect the terms in -790q*2 + 397q*2 - 5550q*3 + 393q*2 + 2773q*3 + 2787q*3. 10q*3 Collect the terms in -440y*2 + 24y + 66 + 8y + 443y*2 - 32y. 3y2 + 66 Collect the terms in 66642173 - 22214063 - 22214047 + 2b - 22214048. 2b + 15 Collect the terms in -26765185k*2 - 1 - 450k*3 + 1 + 26765185k*2. -450k*3 Collect the terms in -2945d + 2945d - 409d*3 - 181d*3. -590d*3 Collect the terms in -2066m*2 + 717m*2 + 409m*2. -940m*2 Collect the terms in -2r*3 + 4r*3 - 2 - 52091r*2 + 0r*3 - 5568r*2. 2r*3 - 57659r*2 - 2 Collect the terms in 59571w*3 + 59673w*3 - 119363w*3. -119w*3 Collect the terms in 347n*2 - 346n*2 - 92 + n + 0n - 3n. n2 - 2n - 92 Collect the terms in -367s3 + 1841s*3 + 634s*3. 2108s*3 Collect the terms in 506514j*2 - 506514j*2 - 7127j*3. -7127j*3 Collect the terms in -272481g*3 + 136361g*3 + 136111g*3. -9g*3 Collect the terms in 308k*2 + 297k*2 - 882k*2 + 290k*2 + 1440k - 1440k. 13k*2 Collect the terms in -640q*3 + 1804q*3 - 653q*3 - 33q - 467q3 + 33q. 44q3 Collect the terms in -6152k - 5511k + 1251k + 106k - 1119k + k2. k2 - 11425k Collect the terms in 2w + 95w2 - 8w - 5w + 3w*3 + 17w - 6w. 3w*3 + 95w*2 Collect the terms in -596474y - 596485y + 2386052y - 596517y - 596484y. 92y Collect the terms in 61 + 23053i - 61. 23053i Collect the terms in -165p - 11 - 50 - 35 - 112p + 22. -277p - 74 Collect the terms in 266t + 369t - 1935t2 + 1971t*2 - 635t. 36t2 Collect the terms in 226434w*2 - 113159w*2 - 113021w*2. 254w*2 Collect the terms in -3q + 64q2 + 3q + 12q2 - 125q*2 + 22q*2. -27q*2 Collect the terms in -a + 288a*3 - 713a*3 + 422a*3 + 2a - a. -3a3 Collect the terms in 32d*2 - 32d - 27d - 88d*2 + 23d*2 + 63d. -33d2 + 4d Collect the terms in -149 + 29t3 - 14t*3 + 147 + 17t*2 - 23t*3 - 17t*2. -8t*3 - 2 Collect the terms in 36265 + 2y - 108800 + 36269 + 36266. 2y Collect the terms in -249 - 9843q*2 - 261 + 9826q*2 + 510. -17q*2 Collect the terms in -6z*2 + 27z*3 + 11z*2 + 4z*2 - 9z*2. 27z*3 Collect the terms in -57u - 85u - 70u - 68u + 166u. -114u Collect the terms in -110590v*2 + 5v + 36804v2 + 36971v*2 + 36806v*2 - 5v. -9v2 Collect the terms in 11v - 2v + 73v*2 - 2v + 2v + 4v. 73v2 + 13v Collect the terms in -15888338 + 1126j3 + 15888338. 1126j*3 Collect the terms in 601i - 467 + 468 + 582i. 1183i + 1 Collect the terms in 427812 + 2b - 142568 - 142600 - 4b - 142602. -2b + 42 Collect the terms in -3z + 17 - 1746z2 + 17 - 41. -1746z*2 - 3z - 7 Collect the terms in 11209u + 57584u + 75868u. 144661u Collect the terms in 6 + 3 - 63r - 6372r*2 + 6375r*2 - 5 - 4. 3r*2 - 63r Collect the terms in -45 + 214388687o3 + 36 + 0 - 214388685o*3 + 0 + 9. 2o*3 Collect the terms in -8d - 6*d +	{ "pile_set_name": "DM Mathematics" }
number? False Is 98765981 a composite number? True Is 301258051 a composite number? True Is 9483997 prime? False Is 135964009 prime? False Is 194843731 composite? True Is 1355407 prime? False Is 19268087 composite? False Is 89102911 a composite number? True Is 53782657 composite? False Is 1482707 a composite number? False Is 678435599 a prime number? False Is 1832801 prime? False Is 1946369 composite? False Is 207256913 composite? True Is 7239301 prime? False Is 818659 prime? True Is 50867533 a composite number? False Is 270029 a prime number? True Is 55310693 a prime number? True Is 1901869 prime? False Is 7209187 a composite number? False Is 778979 a composite number? False Is 468007367 composite? False Is 5316167 prime? False Is 17317963 a prime number? False Is 12128869 a prime number? True Is 150940163 composite? True Is 185987 a prime number? True Is 8895659 a composite number? True Is 110909 prime? True Is 193017845 a composite number? True Is 380591 a composite number? False Is 3607061 prime? False Is 15069634 prime? False Is 12448859 a composite number? True Is 795669599 a composite number? False Is 1114599923 composite? False Is 4614713 a composite number? False Is 5350341 a prime number? False Is 1851391 a composite number? False Is 401475257 a prime number? True Is 42760378 composite? True Is 140813479 a composite number? False Is 7071283 a prime number? True Is 7371491 a composite number? False Is 68606121 prime? False Is 19005911 a prime number? True Is 379241 a prime number? False Is 139827277 prime? False Is 33364181 prime? False Is 18365573 prime? True Is 9442877 a prime number? True Is 3898358 a composite number? True Is 185114162 a composite number? True Is 31290167 a composite number? False Is 5947759 a composite number? False Is 14348149 composite? False Is 449846171 a prime number? True Is 2724599 composite? False Is 5624979 prime? False Is 13393417 composite? False Is 70034429 composite? False Is 115245701 a prime number? True Is 6683431 composite? True Is 2727623 prime? True Is 5514937 a prime number? False Is 64349179 a composite number? True Is 671416607 prime? True Is 17751121 a prime number? True Is 138739 prime? True Is 10170373 composite? False Is 2427847 a composite number? False Is 27704227 composite? False Is 33694337 composite? False Is 1190402 a prime number? False Is 690419 a prime number? True Is 85678819 composite? False Is 27684043 a composite number? True Is 2866189 composite? False Is 4541249 composite? True Is 1452047 composite? False Is 3062833 a composite number? False Is 3989261 composite? False Is 1544563 prime? True Is 54457927 a prime number? False Is 14867359 a composite number? True Is 89728997 prime? True Is 137128309 composite? False Is 2842907 composite? True Is 86915369 a composite number? False Is 11451227 a composite number? False Is 12719407 prime? True Is 82769 a prime number? False Is 36581609 composite? False Is 36879431 a composite number? True Is 11125319 a prime number? True Is 88539289 a prime number? False Is 118776497 prime? False Is 6194299 a prime number? True Is 12538355 prime? False Is 2465962373 composite? True Is 3602279 prime? True Is 23220833 a composite number? False Is 59635294 composite? True Is 19670381 prime? False Is 919129 composite? False Is 10422647 a prime number? True Is 4780241 prime? True Is 169339763 a prime number? False Is 35799167 composite? False Is 1575897 composite? True Is 9153337 a composite number? False Is 88931 prime? False Is 5234789 a composite number? True Is 1919699 a composite number? True Is 1325359 a prime number? False Is 3324913 a prime number? True Is 8647323 composite? True Is 27711553 a prime number? True Is 103045057 composite? False Is 55494311 composite? False Is 10068907 a prime number? True Is 5970763 prime? True Is 12899659 composite? False Is 5139859 a prime number? True Is 91475642 composite? True Is 20219689 prime? False Is 242103007 a prime number? True Is 15650369 a composite number? True Is 4136483 a composite number? True Is 202471 composite? False Is 20538317 prime? True Is 24363818 a composite number? True Is 1423823 a prime number? False Is 2205787 a composite number? False Is 13685327 prime? True Is 8462309 a composite number? True Is 1807523 prime? False Is 2000783 prime? False Is 1491917 a composite number? True Is 2084413 a prime number? True Is 113759435 a prime number? False Is 48060407 a prime number? False Is 268117 prime? False Is 32534659 a prime number? True Is 30176917 prime? False Is 4051741 a composite number? False Is 1067527 a composite number? True Is 3620039 prime? False Is 144435527 prime? True Is 4973411 prime? True Is 57479287 a composite number? True Is 233009 prime? False Is 4066441 prime? True Is 15675047 prime? True Is 2784689 composite? False Is 115880813 composite? False Is 2887711 prime? True Is 766553 composite? False Is 639319933 a composite number? True Is 5229767 a composite number? False Is 43190827 a composite number? False Is 6818797 a composite number? False Is 93307 a composite number? False Is 3822967 a composite number? False Is 124318769 prime? True Is 33904207 prime? True Is 10611479 composite? False Is 660227 prime? True Is 135980173 a composite number? True Is 190020763 a composite number? True Is 220125953 prime? True Is 1015118765 a prime number? False Is 39176861 prime? True Is 3808591 a composite number? False Is 102523 a composite number? False Is 106702469 prime? True Is 2778373 a prime number? False Is 5523211 a composite number? False Is 2268029 a prime number? False Is 152111 a prime number? True Is 10705103 a composite number? False Is 23992579 a composite number? True Is 85752343 a prime number? False Is 43870769 composite? True Is 3309563 a prime number? True Is 340448642 a prime number? False Is 3343733 composite? False Is 4659097 a composite number? True Is 75947189 prime? True Is 2396941 a prime number? True Is 8036383 composite? True Is 241763411 composite? False Is 12556613 a composite number? False Is 1775047 composite? True Is 4492346 a composite number? True Is 16735577 prime? False Is 15129889 a prime number? True Is 1355191 prime? True Is 21124321 prime? True Is 4649477 a prime number? False Is 63328861 a composite number? False Is 12977009 prime? True Is 11106971 composite? True Is 37703753 composite? False Is 266259209 composite? True Is 31355413 a prime number? True Is 2031353 prime? True Is 270535759 composite? True Is 226416443 a prime number? False Is 10646321 prime? False Is 956078 a composite number? True Is 1594093 composite? False Is 13198957 prime? True Is 48951753 a composite number? True Is 201007483 a composite number? True Is 7461739 composite? True Is 3582179 composite? False Is 3736333 prime? False Is 3916645 composite? True Is 5234819 a composite number? True Is 1965993 a composite number? True Is 5628713 a prime number? True Is 111010899 prime? False Is 9596903 composite? True Is 4497771 composite? True Is 3051199 composite? True Is 1256131 a prime number? False Is 8185123 a prime number? True Is 31568723 prime? True Is 6820417 composite? True Is 3553373 a composite number? True Is 1374133 prime? True Is 9288109 a composite number? True Is 884917 a composite number? True Is 5926507 a composite number? True Is 625474 a prime number? False Is 1211129 a composite number? True Is 74348773 a prime number? True Is 2508238 prime? False Is 14094671 prime? True Is 74278747 composite? False Is 24296681 a prime number? False Is 503614819 a prime number? True Is 137142097 prime? True Is 104577469 composite? True Is 995611 a composite number? False Is 2729029 a prime number? True Is 9742451 composite? True Is 13693511 composite? True Is 2200579 a prime number? False Is 1547251 a prime number? True Is 19796713 a composite number? False Is 9326699 prime? False Is 947579 a prime number? True Is 50988599 a composite number? True Is 12411599 a prime number? True Is 74445263 composite? True Is 51322003 a prime number? True Is 306543433 composite? True Is 235629247 a composite number? True Is 2233309 a composite number? True Is 104488355 prime? False Is 182144149 prime? False Is 529798859 composite? True Is 11275193 composite? False Is 1246147 a comp	{ "pile_set_name": "DM Mathematics" }
Simplify ((i*(-2/3)/(ii*9/ii))/((i/(i/(i/(ii(1/16))i)))/i(3/2)))(-13) assuming i is positive. i(6305/48) Simplify (x(-1/4))*(3/25)/((x/(xx9))/(((x(-2/3)x)/x)/x)) assuming x is positive. x(2191/300) Simplify ((n((n/n*(-2/13)n)/n)/nn(n(1/8)/n)/n)/((n/n3)/n)(-40))(-8/5) assuming n is positive. n*(12451/65) Simplify ((jj(-25))/(j(2/21)/jj))/((jj(-17/3))/j(4/3)) assuming j is positive. j*(-380/21) Simplify q(qq14)/qqq(qqq*13)/q(qqqq(-3/5))/q(-7) assuming q is positive. q(202/5) Simplify ((g(-15)/g)/g(-2/41))/(g(1/10)g)(-2/85) assuming g is positive. g(-277499/17425) Simplify (x(x(x((xx/((x/(((xx(-10/7))/x)/x))/x))/x)/x)/x)/x)45x36/(x(23/4)/x) assuming x is positive. x(-925/28) Simplify (g/(g/(g(-14)g)))(-7/6)(g(-24)/g)(-25) assuming g is positive. g*(3841/6) Simplify (((rr*(2/3))/rr)/(r/(rr1/r))rr/(rr*(1/5)rr)rr/r(1/5))(4/9) assuming r is positive. r(136/135) Simplify (b(-5)bb)/bbb/b(-2/101)(bbb*(-31)b)/(b/((b(2/67)/b)/b)) assuming b is positive. b(-222975/6767) Simplify (j/(((jj(2/7))/jj)/j)jj*(-3))/(jj*(-12)jj/(j10/j)) assuming j is positive. j(117/7) Simplify (f(2/5)f)*(-7/5)(f/(ff(1/7)))/(f/(f/(f(f*3f)/ff))) assuming f is positive. f(-1243/175) Simplify r9/(r(-3/13)/r)r/r*10r*(-5/4)r assuming r is positive. r(51/52) Simplify (v(-8))(1/15)/(v28/(v/(v/(v(-13)/v)))) assuming v is positive. v(-638/15) Simplify ll(-2/31)/lll((l*(-21)/l)/ll)/l(lll/((l28ll)/l))/l(2/15) assuming l is positive. l(-21947/465) Simplify (g/g(4/7)g)(-1/57)/(g(-1/7)/g1) assuming g is positive. g(446/399) Simplify ((j/(((j(jj13)/j)/j)/j))(27/4))32 assuming j is positive. j(-2376) Simplify (g*24g(gg/(g*(-3/20)/g)g)/gg)/((g/(gg/(g*30gg)gg)g)/(g/((g/g*(-28)g)/g)g)) assuming g is positive. g(-557/20) Simplify (h/(h(-4)hh))(1/13)(h(2/17))(-13/5) assuming h is positive. h(-83/1105) Simplify ((j(-27))(2/11))(-12/11) assuming j is positive. j(648/121) Simplify x(-1/22)xxxx*3xx28/xxx(-1/3)x assuming x is positive. x*(2351/66) Simplify (xx*13xx(1/7)x)(-11) assuming x is positive. x(-1243/7) Simplify x*(2/27)(xx7)/x((x/x(-2/17))/x)/x(-8) assuming x is positive. x*(6973/459) Simplify ((vv/(v/(v/(vv10)v)))/(v/v21))/((v/((v/v(-7))/vv))/v)15 assuming v is positive. v132 Simplify ((n/(n20/n))/n(-3/25))/(n(4/9))(14/11) assuming n is positive. n(-45653/2475) Simplify ((o/(o/((oo/(o*(-10/9)o)o)/o))o)/o)/oo(2/77)o*(-11/3)/oo/o(-30) assuming o is positive. o(19037/693) Simplify ((ii17)/i(ii(-3/7))/i)(-2/5) assuming i is positive. i(-232/35) Simplify w(2/19)/(ww*9w)(w(-22))(-39) assuming w is positive. w(16095/19) Simplify (r/(r(r/((rr(2/17))/r))/r)r/r(15/2))/((r/(r(-25)r))/(rr*13r)) assuming r is positive. r(-557/34) Simplify (k/(k(1/11)/k))/k*(12/11)(k/(kkk(kk(-3/10))/k))12 assuming k is positive. k(-1077/55) Simplify (k(-3)k/(k10k))/(k/k*(-1/21)k(-1/4)) assuming k is positive. k(-1159/84) Simplify ((l/((l*(3/5)l)/l)l)/((ll*(3/22))/ll))(-30) assuming l is positive. l(-87/11) Simplify ((((ffff/(f/(fff(1/7)))f)/f)22)(1/9))*0 assuming f is positive. 1 Simplify ((uuu/u4)/(uu/u*(-1/4)u))/(u(-3/5))(2/31) assuming u is positive. u(-2611/620) Simplify (i(-2/5))*10/((ii*(-13)ii)/(ii/i2)) assuming i is positive. i6 Simplify ((g*(1/11)g/g*(-10)g)/((g*(-2/5)g)/gg(-5)))(-16/3) assuming g is positive. g(-15392/165) Simplify (p(2/17)/pp*(1/2)p)/((((pp28)/p)/p)/(p/p(-2/31))) assuming p is positive. p(-26685/1054) Simplify (c4/c)(2/33)(c/(ccc/(cc(-15))))/(c(-1/6)/c) assuming c is positive. c(-967/66) Simplify ((o7o)/o)/o*9(oo(-17)oo)/o(5/4) assuming o is positive. o(-69/4) Simplify ((x20/xxxxx((x/(x/(x/x*(8/7)x)))/x)/xxxx)41)(2/45) assuming x is positive. x(4756/105) Simplify (s(3/5))(2/75)/(s/((s/(ss*28s))/s)s/s25s) assuming s is positive. s(-998/125) Simplify k(-2/55)/(kk29)k(k(-17)k)/kk/k(14/5) assuming k is positive. k(-2631/55) Simplify (h/h(-1/39)((h(hh(3/13))/h)/h)/h)/(h(-1))(-1) assuming h is positive. h(-29/39) Simplify (h/h*(1/4)h(-2))/(h(-3/8))(-15/8) assuming h is positive. h(-125/64) Simplify (rr/r(-8))12/(r2r)(-2/3) assuming r is positive. r122 Simplify (xxx*(-13/2)xx(-1/3)x)/((xxx(-3)/x)/x(4/7)) assuming x is positive. x(-11/42) Simplify ((x(-20))(-2/107))(-11) assuming x is positive. x(-440/107) Simplify ((q8/q)/qq2)/(q(-2/19))(-14) assuming q is positive. q(124/19) Simplify (s(-3/2)ss(5/4))/(s/(s/((s(-13)/s)/s))s(-18)) assuming s is positive. s(135/4) Simplify (v(-1/4))(-33)v(-10)/v(1/13) assuming v is positive. v(-95/52) Simplify ((d(-5/6)d*7d)(3/13))(3/32) assuming d is positive. d(129/832) Simplify (f(-5/2)f)/(f/(f/(f/((ff*(-1/2))/ff)))f)(f/f(-19))(1/17) assuming f is positive. f*(-31/17) Simplify (f/(ff*(-1/40)/ff)f/((ff*(1/2))/f))/((((ff*(-9/7))/f)/f)/ff)5 assuming f is positive. f(3347/280) Simplify (uu(uu(-11/5)u)/uu2(u(-1))(-34))(33/4) assuming u is positive. u(1518/5) Simplify ((d/d18)/(d/d(-4/5)))/((d/(d/(dddd(-12)d)))/dd/(d(-1/9)/d)d) assuming d is positive. d(-581/45) Simplify (j/(j(2/13)j)j(-16)/j)/(j(4/15)j/(jj15)) assuming j is positive. j(-472/195) Simplify (((n/(nn/(nn*(-3/4))n)nn)/nn)/n)(-3/16)(n/n*4)/nnn(-12)n assuming n is positive. n(-887/64) Simplify ((r(2/5)rrr/(((rr*(-4)/r)/rrr)/rrr))/(r(-7/2)rr(3/5)))(-19/2) assuming r is positive. r(-1387/20) Simplify ((oo/o*(-12)o*(6/7))/((oo(-10)/o)/(o(-2)o)))(-1/5) assuming o is positive. o(-167/35) Simplify ((b(-1/4))(-14/5)b5/b11)(1/89) assuming b is positive. b(-53/890) Simplify (f/(f/(f/f(-3/2))))(2/45)f(-23/2)f/f(-9) assuming f is positive. f(-25/18) Simplify (((vv/(vv*(-4))vv)/(vv(2/15)))/(v(2/3)v)3)(-1/59) assuming v is positive. v(-13/885) Simplify (x/(x(-19)x)x(x(xx*(-2/39)/xxx)/xx)/x)(-42) assuming x is positive. x(-11984/13) Simplify bb4/bb*4(bb/(b/b(-2/19)))/b(2/9) assuming b is positive. b(1483/171) Simplify (l(-4/7)lll*(-9)l/((l/l*(-11))/l)l(-1/15))18 assuming l is positive. l*(-11112/35) Simplify ((r/(r/(rrr(-15))))32)(-21) assuming r is positive. r8736 Simplify (((hh*(1/3))/hh/((hh(-3/10))/h))/(h(2/7)h)3)(-13/6) assuming h is positive. h*(6071/1260) Simplify (u/(uu/(uu/(uuu(u/(u*17u)u)/u))))(-1/5)(u/((uu(-24))/u)u)/((u/(u/((u*(1/28)/u)/u)u))/u) assuming u is positive. u(755/28) Simplify (g(-2/5)g)/g(2/7)(g/(g*(-3)g))(-38) assuming g is positive. g(-3979/35) Simplify (x/(x*(-3/19)x)xx(-1/56))/((x(-5/3)/x)/((xxx/x*(-31)x)/x)) assuming x is positive. x(120679/3192) Simplify ((r(1/11)/(rr4r))/(r2)(5/2))(2/149) assuming r is positive. r(-240/1639) Simplify (ooo*(1/11)/ooo(-1/2)(o*(-2/9)o)/o(((o(-1/9)o)/o)/oo)/o)(-14) assuming o is positive. o(-119/33) Simplify (d(-2)/d)/(d(d*(-5)d)/dd)(d/(dd8))(-10/7) assuming d is positive. d(80/7) Simplify (h11h4/h)/(h2hh/(hh(h((h/h(2/11))/h)/h)/h)hh) assuming h is positive. h(97/11) Simplify ((a(1/2))(-4)a(-2/9)/(a(-1)aaa))2 assuming a is positive. a(-76/9) Simplify i(2/3)/i(-9/4)((ii(-7))/i)(2/11) assuming i is positive. i(217/132) Simplify (((y(1/2))10)(-17))(-15) assuming y is positive. y1275 Simplify (w/(w(1/6)w)w25/w)(-40) assuming w is positive. w(-2860/3) Simplify ((rr/(rr/((r/r(5/8))/r)rr))/r5)/(r(2/7))38 assuming r is positive. r(-1035/56) Simplify ((l/(l(1/5)l)ll/((l/((l/(l/l*(-3)))/lll))/l))(-5))12 assuming l is positive. l12 Simplify ((t/(tt*12)t)(-11))19 assuming t is positive. t**2299 Simpl	{ "pile_set_name": "DM Mathematics" }
lify (0 + sqrt(2299) + sqrt(2299))6 + 3(sqrt(2299) - (1sqrt(2299) - sqrt(2299))) - (4 + -4(-2 + sqrt(2299) + sqrt(2299)))*2. -147280 + 2277sqrt(19) Simplify (6-4(2 + 2(2 + sqrt(1331))))2. 152064sqrt(11) + 3087360 Simplify -1 + (1(sqrt(108)/sqrt(4) + sqrt(27)))/(sqrt(9) - (-1sqrt(9)1 + sqrt(9))) + 4. 3 + 2sqrt(3) Simplify ((3sqrt(50)/sqrt(5))/((sqrt(200)/sqrt(4))/sqrt(10)))2. 18 Simplify 3(-3sqrt(78)2)/(sqrt(6)-21). 9sqrt(13) Simplify 3(-4 + sqrt(847))2 + 1 + (sqrt(847) + 4)2. -176sqrt(7) + 3453 Simplify (52sqrt(2016))/(-1sqrt(162) - 5sqrt(8)). -120sqrt(7)/19 Simplify (-2(sqrt(70) + -4(sqrt(70) - (sqrt(70) - (sqrt(70) - (sqrt(70) + 1sqrt(70))))) + sqrt(70)))/(2sqrt(640)-1) + -1. -1 + 3sqrt(7)/4 Simplify 2sqrt(405) + sqrt(405) + ((sqrt(320) + 2)2 - sqrt(320)) + sqrt(20)/(sqrt(24)/sqrt(6)-2). 101sqrt(5)/2 + 324 Simplify (-1(sqrt(13) + -1) + 3 - (((sqrt(143)-1 - sqrt(143)) + sqrt(143))/sqrt(11) + sqrt(13) + (sqrt(325) - sqrt(13)) + 4))2. 325 Simplify (6(1 + sqrt(637) + sqrt(637) + 5 + sqrt(637)))*2-4. -830736 - 36288sqrt(13) Simplify (((sqrt(931) + sqrt(931) + 3)-4)*2 - -6-2sqrt(931))5. 6300sqrt(19) + 298640 Simplify sqrt(396) + 1 + (sqrt(176)/(sqrt(20)/sqrt(5) + sqrt(4)))2. 12 + 6sqrt(11) Simplify -2((2sqrt(11))*25 + 4) + 3. -445 Simplify (4(sqrt(17) + 2sqrt(17))-6 - sqrt(136)/(1sqrt(8)-3))2. 785825/9 Simplify (2-5sqrt(91))/(1sqrt(7)4). -5sqrt(13)/2 Simplify (4 + sqrt(162)1 + sqrt(162) + 1 + sqrt(162) + 4 - ((sqrt(162) - (1 + sqrt(162) - sqrt(162)))5 + -4))*2. -648sqrt(2) + 972 Simplify (sqrt(6)/(-2sqrt(2)) + sqrt(3) + (1 + sqrt(3) - sqrt(3) - sqrt(3)) + -4 - (1 + 1 + 2sqrt(3)))-6 + -4. 15sqrt(3) + 26 Simplify (1(sqrt(352) - sqrt(352)-1))/((sqrt(2200) - -1sqrt(2200))/sqrt(11)). 2sqrt(11)/5 Simplify (1 + (4 + 4 + sqrt(7) - (sqrt(70) - (sqrt(70) + 1sqrt(70)))/sqrt(10)))2. 36sqrt(7) + 109 Simplify -6((sqrt(637) - -1sqrt(637))4 + 5sqrt(637)-1 + sqrt(637))2. -61152 Simplify (sqrt(500)-1 + -3 + -1(sqrt(500) + 2sqrt(500))*2)-2. 20sqrt(5) + 9006 Simplify -2 + -3 + (-23sqrt(11) + -1 + sqrt(11) + 0)2. 10sqrt(11) + 271 Simplify -2 + (sqrt(567) + 2 + (sqrt(35)2)/sqrt(5) - (sqrt(7) + 1sqrt(7) + -3 + sqrt(1008)-1))2. 210sqrt(7) + 3110 Simplify (sqrt(15)/sqrt(3)4)2 + -3 + 5 - (2sqrt(5)25 + -2). -20sqrt(5) + 84 Simplify -4(sqrt(48)/sqrt(6)6 + (-2sqrt(16) + sqrt(16))/sqrt(8) + 1)2. -88sqrt(2) - 8 Simplify ((sqrt(21)/(sqrt(7)-1) - sqrt(3))-43-1)*2. 1728 Simplify (-3 + -2(sqrt(75) + 1 + sqrt(75))3)-1. 9 + 60sqrt(3) Simplify (3 + sqrt(567) + -3sqrt(567) + sqrt(567) + sqrt(567) - sqrt(567)) + -3 + -4sqrt(567). -45sqrt(7) Simplify -2 + ((sqrt(72) + sqrt(72) + -5(0 + sqrt(72)))23 - (2sqrt(72) + 5 + -5)). -12sqrt(2) + 1942 Simplify 34(-5 + (-2 + sqrt(275) - sqrt(275)) + -4(-2sqrt(275) + sqrt(275)))*2-2. -106776 + 6720sqrt(11) Simplify ((-5 + -3 + -2sqrt(363))3)2. 3168sqrt(3) + 13644 Simplify (-6((5 + 2 + sqrt(13) - -2sqrt(637)) + (sqrt(325) + 3 + sqrt(13))-4))2. 3240sqrt(13) + 38808 Simplify (5(-1sqrt(252) + 5)2 + -5)2. -5400sqrt(7) + 27225 Simplify (-2 + (1(0 + sqrt(300)) - sqrt(300)2-2)3)*2. -600sqrt(3) + 67504 Simplify (1(1 + sqrt(1216) + -2 + sqrt(1216))4)*2. -512sqrt(19) + 77840 Simplify ((3 + sqrt(1216) + -1 + sqrt(1216) - sqrt(1216))-1 + -1 + (sqrt(1216) - (2(sqrt(1216)3 - sqrt(1216)) - sqrt(1216))))2. 144sqrt(19) + 10953 Simplify ((-2 + sqrt(190)/(sqrt(30)/sqrt(3)))6 + -3 + -3)2. -216sqrt(19) + 1008 Simplify 2 + -6(sqrt(425) + 2) - (-2sqrt(6171))/(5sqrt(27)). -428sqrt(17)/15 - 10 Simplify (sqrt(108) + (sqrt(108)-3)2 + -1 + 3 + 1)-1. -975 - 6sqrt(3) Simplify (-2sqrt(20) - (sqrt(5) - ((sqrt(80) - (-1 + sqrt(80))) + sqrt(80))) - (((sqrt(5) + sqrt(20)/sqrt(4) + sqrt(5))-6 - sqrt(5)) + 3))26. -432sqrt(5) + 9744 Simplify (sqrt(9) - -6sqrt(90)/sqrt(10))/((sqrt(270)/sqrt(9))/sqrt(10)). 7sqrt(3) Simplify (-5(sqrt(132) - sqrt(132)1-3))/((sqrt(288)/(sqrt(32)/sqrt(4)))/sqrt(3)). -20sqrt(11) Simplify ((-5sqrt(176) - sqrt(44)/(sqrt(16)/sqrt(4))) + (-2 + (3 + sqrt(11) - sqrt(11)) - (1 + sqrt(176))))*2. 6875 Simplify (sqrt(99) - (sqrt(99) + (sqrt(99) - (sqrt(99) + (sqrt(99) + sqrt(99)-1 - sqrt(99))))-5))/sqrt(9)2 + -51sqrt(1331) + 2. -45sqrt(11) + 2 Simplify -1 + ((sqrt(126) - (sqrt(126) - -1sqrt(126)))/sqrt(7))/(sqrt(24)/(sqrt(4)4)). -4sqrt(3) - 1 Simplify (-5(sqrt(19) + 1) + 2 + sqrt(76)/(sqrt(24)/sqrt(6)) + -4)2. 56sqrt(19) + 353 Simplify (sqrt(2016) + -4sqrt(2016)2)/(sqrt(8)2-4 - (sqrt(8) + sqrt(16)/(1sqrt(2) + sqrt(2)))). 84sqrt(7)/19 Simplify 5(3 + sqrt(2736) + 0 + 2)2 + 3. 600sqrt(19) + 13808 Simplify ((sqrt(143) - (2sqrt(143) + sqrt(143)))6 - 3(sqrt(143) - ((-2sqrt(143) - sqrt(143)) + sqrt(143))))/(1sqrt(704)4). -21sqrt(13)/32 Simplify ((sqrt(95) + sqrt(95)1 + sqrt(95))/sqrt(5) + -3 - -6(-2 + sqrt(931)))2. -1350sqrt(19) + 38700 Simplify (-5 + sqrt(80) + 4 - (sqrt(80) - (sqrt(80) - ((sqrt(80)6 + sqrt(80))2 + -5)))) + 4. -3912 + 4sqrt(5) Simplify (sqrt(5) + ((2sqrt(15))/sqrt(3))2 + sqrt(5))5 + (sqrt(15)/(sqrt(3) + sqrt(21)/(sqrt(7)1) + sqrt(3)))2. 10sqrt(5) + 905/9 Simplify (4(-1 + sqrt(112) + -3))2 + -4 + sqrt(28) + ((sqrt(1792) + 1sqrt(1792))*2 - sqrt(1792)). -526sqrt(7) + 9212 Simplify (sqrt(21)/(sqrt(3) + sqrt(147)-4) + -2(5 + (sqrt(14)/sqrt(2) - sqrt(7) - sqrt(7) - sqrt(7))))*2. -2140sqrt(7)/27 + 153043/729 Simplify (sqrt(49)/((sqrt(70) - sqrt(70)4)/sqrt(10)) + -4 + sqrt(28) + sqrt(28) + 4)2. 847/9 Simplify (-2 + -5 + sqrt(425)3 + 2 + 5)*2. 3825 Simplify -6(-2sqrt(10)-26)/((sqrt(90)/sqrt(3))/sqrt(6) + (sqrt(5) - sqrt(20))-2). -48sqrt(2) Simplify (-3sqrt(135)/sqrt(9))/(sqrt(3) + sqrt(21)/sqrt(343)). -21sqrt(5)/8 Simplify sqrt(156)/sqrt(3) + -2 + (sqrt(13) - sqrt(117)) + -3 + 3 + (2sqrt(13))*2. 50 Simplify -5 + (-2sqrt(65))/sqrt(5) - ((sqrt(1573) + 0)*2 - (sqrt(468)2 - sqrt(13))). -1578 + 9sqrt(13) Simplify (1(sqrt(704) + -1) - sqrt(704) - 5(sqrt(704) + 0) - 3sqrt(704)26)*21. 656sqrt(11) + 1183425 Simplify -5 + ((2 + sqrt(162) + 5)-6 + 4)*2. 4104sqrt(2) + 7271 Simplify -5sqrt(6)/sqrt(18) - (-6sqrt(12) + 4). -4 + 31sqrt(3)/3 Simplify (-63sqrt(9))/(-55sqrt(3)). 18sqrt(3)/25 Simplify ((-1(2(sqrt(6) + sqrt(96)) - sqrt(6)))/(sqrt(432)-3 + sqrt(432)))2. 9/32 Simplify (1(sqrt(78)1 + sqrt(78)) + -31sqrt(78))/((sqrt(4860)3)/sqrt(10)). -sqrt(13)/27 Simplify (((sqrt(84)3 + sqrt(84))5 - sqrt(84))/sqrt(12)-2)2 + 2. 10110 Simplify (-3 + -1 + sqrt(75) + 1sqrt(75) + -2 - (-2 + (sqrt(75) + (sqrt(75) + sqrt(75) + 0 - sqrt(75)))-4))2. -400sqrt(3) + 7516 Simplify (sqrt(68) + sqrt(68) + sqrt(68) + 1 + 1)*2 + ((1 + sqrt(68))5)*2 + -16(1 + sqrt(68)). 112sqrt(17) + 2335 Simplify (sqrt(192)-2)/sqrt(6) + (sqrt(256)1 + sqrt(256) + sqrt(256))/sqrt(8) + 5. 5 + 4sqrt(2) Simplify 5(sqrt(275) + -5 - (sqrt(11) - (-3sqrt(11) + -2)))5. -175 + 25sqrt(11) Simplify 1-2sqrt(684) + sqrt(684) + 4 + -5. -6sqrt(19) - 1 Simplify (sqrt(225)-2)/(sqrt(45)/(sqrt(9)2)) - ((sqrt(750) - (sqrt(750) - (sqrt(750) + sqrt(750)-2)))/(4sqrt(54)))*2. -12sqrt(5) - 125/144 Simplify (sqrt(484) + (sqrt(484) + sqrt(484) + 3sqrt(484)3 - sqrt(484)) + sqrt(484))/((-3sqrt(55))/sqrt(5))-2. 16sqrt(11) Simplify (-5((sqrt(425) - (-1 + sqrt(425))) + -1))*2 - ((sqrt(425) + 1sqrt(425))2 - (sqrt(425)1 + 4))*2. -3841 + 120sqrt(17) Simplify (sqrt(588)/(sqrt(24)/sqrt(2)))/((sqrt(70)1)/sqrt(10)) + -2 + -2sqrt(343) + 2. -13sqrt(7) Simplify (1 + sqrt(1053) + (sqrt(1053) - 4sqrt(1053)))*2 - (sqrt(130)/(sqrt(10)-1) + (sqrt(13) - (3 + sqrt(52))))*2. -48sqrt(13) + 4152 Simplify 4 + sqrt(5) + -12sqrt(5) + (sqrt(125) + 1)*2-4. -500 - 41sqrt(5) Simplify (sqrt(150)/(-2sqrt(3)-2))/(-1sqrt(1210)-5). sqrt(5)/220 Simplify ((sqrt(180) - (sqrt(180) + (2sqrt(180) - sqrt(180))5 - sqrt(180)) - sqrt(180))/sqrt(9))/((sqrt(120)/sqrt(3))/sqrt(10) + 6sqrt(36)). -5sqrt(5)/19 Simplify (5 + 1 + 2 + sqrt(272) + 3(sqrt(272) + -2(sqrt(272) - sqrt(272)3)))*2. 1024sqrt(17) + 69696 Simplify 5 + sqrt(28)/(sqrt(36)/(sqrt(9) + sqrt(36) + sqrt(9))) + 1. 6 + 4sqrt(7) Simplify (-3 + sqrt(162)-1	{ "pile_set_name": "DM Mathematics" }
293. Round t to 3 decimal places. -0.079 Let a = 2496.999985772 + -2497. Round a to 6 decimal places. -0.000014 Let r = 15823 - 15823.00001724. Round r to five dps. -0.00002 Let v = -3649 - -3649.006347. What is v rounded to 4 dps? 0.0063 Let z(u) = -13477u2 - 7u - 14. Let r be z(-4). Let m = r - -152618. Round m to the nearest ten thousand. -60000 Let l = -19.2 - -27. Let p = l - -7.7. What is p rounded to 0 decimal places? 16 Suppose 2h = 2t - 18720978, 4h - 2t + 20524413 + 16917551 = 0. Suppose 0 = -45r + 56r - 36965423. Let d = h + r. What is d rounded to the nearest 1000000? -6000000 Let p = -13674.353 + 13658. Round p to one decimal place. -16.4 Let k = 1423.959008 - 1424. What is k rounded to three dps? -0.041 Let v = -125.39 + -1.61. Let i = 437 - v. Let u = i - 614.3. What is u rounded to 0 decimal places? -50 Let u = -12317.833689 - -12317.7. Let f = -226.739689 - u. Let x = f - -227. Round x to 1 decimal place. 0.4 Let r = -3 + 3.1. Let h = 8.2589 - 8.37. Let q = h + r. What is q rounded to three decimal places? -0.011 Let c = -29.06 - 37.94. Let n = -66.92654775 - 0.07562225. Let s = n - c. Round s to four decimal places. -0.0022 Let j = 85.5 - 92.29. Let h = j + -26.11. What is h rounded to the nearest ten? -30 Let x = -175787923913 + 175787923134.99999653. Let j = x - -778. Round j to 7 dps. -0.0000035 Let h = 46089920 - -1690752. Suppose 0 = 12z - 153219328 - h. Round z to the nearest 1000000. 17000000 Let z = 15064 - 15064.22253. Let q = z + 0.223. What is q rounded to five decimal places? 0.00047 Let y = 83 - 41. Let k = 6342.29841843 - 6300.298418. Let p = k - y. What is p rounded to 7 decimal places? 0.0000004 Let s = 36314 + -18873. What is s rounded to the nearest 1000? 17000 Suppose -4d = j + 201 + 1269, -d = 5j + 358. Let k = -1109 - d. Let m = 5541 + k. What is m rounded to the nearest 1000? 5000 Let t = -5.832994156 - -5.833. What is t rounded to seven dps? 0.0000058 Let k = 9.46483 - 9.0492. Round k to three dps. 0.416 Let j = -10611.095 + 10536. Let b = -57.2 - 17.8. Let s = j - b. What is s rounded to two decimal places? -0.1 Let p = 123.65 - 123.639219. What is p rounded to three decimal places? 0.011 Suppose 1557299 = 3c - o, -2954o - 1038205 = -2c - 2959o. Round c to the nearest 1000. 519000 Let o(d) = 3228d + 40. Suppose s - 21 = 5y, 4s - 9s - 15 = -y. Let v be o(y). What is v rounded to the nearest 1000? -16000 Suppose -8h + 9j - 12j = -12195979, 7 = -j. Round h to the nearest one hundred thousand. 1500000 Let f = 169019.079 + -169133. Round f to the nearest 10. -110 Let d = -2244.9 - -2267.364. What is d rounded to the nearest 10? 20 Let a = 14.7 - 14.639. Let y = 1056.37 + -1056.3089924. Let m = y - a. Round m to 6 decimal places. 0.000008 Let b = -13.16093 - -0.33913. Let f = b - -16.42144. Let a = f - 3.6. What is a rounded to four dps? -0.0004 Let d(o) = -o2 + o. Let l(s) = s2 - 7s + 13. Let z(x) = -4d(x) - l(x). Let b be z(-5). Let n = 112 - b. What is n rounded to the nearest integer? 65 Let m(i) = -314i + 25. Let f be m(-4). Let y be (f + 2 + -2 - -2) + -2. Suppose 1759 = 4t - y. Round t to the nearest one hundred. 800 Let s = 42.89521 - 43.08. Round s to 2 dps. -0.18 Let u = 5807172022 - 5807172028.000000378. Let h = u - -6. Round h to seven dps. -0.0000004 Suppose 4c = -9a + 8a + 10093, -a + c = -10088. Let v = a - 5379. What is v rounded to the nearest one thousand? 5000 Let c = 2356.00000050305 - 2356. What is c rounded to seven decimal places? 0.0000005 Let n = 446 - 446.3184. Let v = -0.318398601 - n. Round v to 7 dps. 0.0000014 Let l = -1503231.0287 + 1503135. Let x = l + 96.1. What is x rounded to 3 decimal places? 0.071 Let z = 8681795139517.2399134574 + -8681795138471. Let l = z + -0.2394524574. Let s = 1046 - l. What is s rounded to four decimal places? -0.0005 Let r = 4772 - 8949. What is r rounded to the nearest 100? -4200 Let d = 35.1 + -176.1. Let g = d - -141.00000535. What is g rounded to seven decimal places? 0.0000054 Let p = -862.3 + 879.805. What is p rounded to 1 dp? 17.5 Let z = -9.3 - -8.904. Let h = z - -0.3757. Round h to 3 decimal places. -0.02 Let r = 2830.3851 + -2831. Round r to the nearest integer. -1 Let f = -10719932 + 10719958.401042. Let o = 24.43 + 1.97. Let r = o - f. What is r rounded to 4 dps? -0.001 Let j = 828 + -833.27. Let h = j + 0.63. Let a = 2.7 + h. Round a to one dp. -1.9 Let l = 35716.645 + -35886. Let p = 20.165 + l. Let g = p - -148. Round g to 1 dp. -1.2 Suppose -v = -0d + 5d - 397, -3d + 2v + 246 = 0. Let f = 79 - d. Let x be f - 612 - 30/(-30). What is x rounded to the nearest 100? -600 Let j = 8095 + -8095.0000021285. What is j rounded to 7 decimal places? -0.0000021 Let w = 3037.93244 + -3038. Let i = -0.07 - w. Round i to 4 dps. -0.0024 Suppose 1648575466 = 71o + 5067466. What is o rounded to the nearest 1000000? 23000000 Let a = -161 - -167. Let s(g) = g + 2. Let z be s(0). Suppose av - 2b - 2387992 = zv, v - 5b - 596980 = 0. What is v rounded to the nearest 100000? 600000 Let p = -82 - -81.918. Let q = 0.03 + p. Let z = 0.778 - q. What is z rounded to one decimal place? 0.8 Suppose -1 = 7x - 36. Suppose -10 = -xd - 10. Suppose d = -m + f - 12800004, -3f + 63999996 = -5m - 4f. What is m rounded to the nearest one million? -13000000 Let l = 134.99 - 135.14634. Round l to 3 decimal places. -0.156 Let w be (-7)/(-14) + 3 + (-7)/2. Suppose wr - 3r + 105300000 = 0. What is r rounded to the nearest one million? 35000000 Let y = -8633602 - -8633606.830191. Let k = y - 4.83. Round k to four dps. 0.0002 Let c = 71.98 + -21.53. Round c to zero dps. 50 Let d(i) = 95 - 78 + 5i + 688890i2 - 12. Suppose -y = -6z + 4z + 7, 2z = -4y - 8. Let w be d(y). Round w to the nearest 1000000. 6000000 Let l = 51.9 - 1.9. Let b = l - 50.021. Let x = -0.0210482 - b. What is x rounded to 6 dps? -0.000048 Let r = -6295.9060022 - -6296.606. Let n = 0.667 - -0.033. Let x = n - r. What is x rounded to 6 decimal places? 0.000002 Suppose -5k + 47800 = 2w, 24281 = 3k - 3w - 4399. Suppose 2j - k = -4n, 2j + 11941 = 5n - 0j. Round n to the nearest one hundred. 2400 Let y = 7369490 - 7369501.100146. Let f = 10.34 + -21.44. Let j = y - f. Round j to five dps. -0.00015 Let f = -42 + 461. Suppose 416v + 76860 = fv. Round v to the nearest one thousand. 26000 Let f(z) = -z*2 - 16z + 20. Let y be f(-17). Suppose -2 - 2 = -2x. Let s be ((-1)/x)/(1/(-1294)) + y. What is s rounded to the nearest 1000? 1000 Let r = -2559.19448 + -12.21692. Let f = 2532.67 + r. Let c = f - -0.0414. Round c to zero dps. -39 Let r = 8627 - 8626.999993657. What is r rounded to six decimal places? 0.000006 Let b = 4011.0000001955 - 4011. What is b rounded to seven dps? 0.0000002 Let z be ((-174)/30)/(1/(-131255)). Let a = 492234 + -273513. Let v = z + a. Round v to the nearest one hundred thousand. 1000000 Let v(n) = -12142n*3 - 7n*2 + 4n + 28. Let g be v(-18). Suppose 14m + g + 28170168 = 0. Round m to the nearest 100000. -7100000 Let m(j) = -j3 + j2 + j + 8. Let a be m(0). Let g(c) = -523c - 608c2 + 23 + 256c - 31 + 257c. Let z be g(a). Round z to the nearest 10000. -40000 Let z(q) = 13414q*2 - 100q - 1050. Let y be z(-15). Round y to the nearest 100000. 3000000 Let y = -8969.4 - -10105. Round y to the nearest 100. 1100 Let k = 14311.999999975 + -14312. What is k rounded to 7 dps? 0 Let v = 27 + 40. Let g = -5840670 + 5840736.9999965. Let j = v - g. What is j rounded to five decimal places? 0 Suppose 0 = 5s - 80 + 85. Let q be ((-127400)/(-78))/(31/30 + s). Round q to the nearest 100000. 0 Let t be (436352/(-39))/((-1)/1501). What is t rounded to the nearest 10000? 870000 Let b = 446285.9999800357 - 446286. What is b rounded to 7 dps? -0.00002 Let o be (6 + -5)/((-1)/4) + 4. Let s(d) = d3 - 8d*2 - 2d + 32500. Let p be s(o). Round p to the nearest 1000. 33000 Suppose -3r - 5 = 10. Suppose -87 - 343 = 4g + 2p, 3g + 330 = p. Let w be -4 + 0 + (r - g). Round w to the nearest 1000. 0 Suppose -14h = 6h - 763000000. Suppose 174r - h = 167r. Round r to the nearest 100000. 5500000 Let l = 4735.99983224 + -4736. What is l rounded to five dps? -0.00017 Let d = -5.3 + -177.7. Let x = d + 183.0919. Round x to three	{ "pile_set_name": "DM Mathematics" }
*2 - 17o + 51. Calculate a(11). -15 Let p(r) = -r*2 + 28r + 48. Calculate p(24). 144 Let q(i) = -337i - 1328. Give q(-4). 20 Let s(t) = 2t*2 + 539t + 35717. What is s(-152)? -3 Let a(l) = -l*3 - 22l*2 + 20l - 83. Determine a(-23). -14 Let v(g) = g*3 - 7g*2 - 28g + 9. Determine v(10). 29 Let h(a) = 3475a + 45182. Determine h(-13). 7 Let j(b) = b2 + 122b + 9. Calculate j(0). 9 Let w(m) = -m*2 - 4m + 686. Calculate w(27). -151 Let v(c) = -90c - 11071. Give v(-123). -1 Let g(m) = -m2 - 548m - 2172. What is g(-4)? 4 Let k(n) = n*3 + 56n*2 + 386n + 95. What is k(-48)? -1 Let x(o) = 33o - 665. Determine x(20). -5 Let n(k) = -5906k - 35422. Give n(-6). 14 Let w(c) = -c*3 + 2c*2 - 3c - 1. Give w(-1). 5 Let a(f) = -f*3 - 11f*2 - 6f - 18. Calculate a(-9). -126 Let r(o) = -6635o - 39802. Give r(-6). 8 Let u(i) = -3i + 14. Determine u(-16). 62 Let v(s) = -29s - 426. Determine v(-8). -194 Let o(t) = t2 + 96t + 2131. Calculate o(-59). -52 Let t(j) = -3j2 + 9j - 23. Calculate t(3). -23 Let q(r) = r*3 + 22r*2 + 78r - 83. Calculate q(-17). 36 Let g(f) = -5f2 - 167f - 653. Calculate g(-29). -15 Let x(u) = -3u2 - 111u + 1. Calculate x(-8). 697 Let s(f) = -22f2 - 15f + 29. Determine s(2). -89 Let q(b) = b*3 + 55b*2 + 54b - 1. Determine q(-54). -1 Let s(y) = y*2 + 58y - 260. Determine s(-62). -12 Let i(x) = 3x2 + 10x + 154. Determine i(-8). 266 Let w(h) = -3h2 + 29h + 26. Determine w(9). 44 Let a(c) = 15c3 - 65c*2 + 34c - 49. Determine a(4). 7 Let s(p) = -3p2 + 27p - 17. What is s(11)? -83 Let m(y) = -10y - 44. Determine m(1). -54 Let r(c) = -581c - 39522. Give r(-68). -14 Let l(f) = -f*3 + 2f*2 + 4f - 2. What is l(-4)? 78 Let s(b) = b*2 + 43b + 424. Determine s(-18). -26 Let o(c) = 100c + 488. What is o(-5)? -12 Let n(r) = -33r - 620. Give n(-20). 40 Let y(q) = -11q2 - 11q - 80. What is y(-5)? -300 Let f(n) = n*3 + 34n*2 + 67n + 171. What is f(-32)? 75 Let f(c) = -8c2 + 12c + 34. Calculate f(6). -182 Let z(h) = 3h2 + 25h - 80. Calculate z(3). 22 Let r(y) = -y*3 - 8y*2 - 19y - 34. Give r(-6). 8 Let u(l) = 1286l - 145313. Give u(113). 5 Let k(w) = -w3 - 113w*2 + 361w + 1524. What is k(-116)? 16 Let j(u) = 3u3 - 14u*2 - 14u - 59. Give j(6). 1 Let y(b) = -8b3 - 49b*2 - 132b - 755. Calculate y(-6). 1 Let a(z) = -4z2 - 222z + 949. Give a(4). -3 Let x(v) = -v*3 - 4v*2 + 170v - 516. What is x(9)? -39 Let v(j) = 2j2 - 19j + 48. What is v(3)? 9 Let x(n) = n*3 + 22n*2 + 44n - 246. What is x(-19)? 1 Let j(z) = 28z + 227. Give j(-7). 31 Let u(w) = 15w*2 + 162w - 75. Determine u(-12). 141 Let q(l) = -35l + 284. Determine q(7). 39 Let a(f) = f2 + 303f - 17663. What is a(50)? -13 Let d(a) = 139a + 4405. Calculate d(-31). 96 Let x(s) = -483s - 2918. What is x(-6)? -20 Let z(p) = -5p2 + 51p - 63. Give z(8). 25 Let s(b) = -4b2 + 102b + 76. Give s(25). 126 Let p(k) = 48k + 394. Calculate p(-9). -38 Let x(s) = s3 - 15s*2 + 33s - 499. Determine x(15). -4 Let d(i) = 182i - 1823. Calculate d(10). -3 Let j(l) = l3 + 11l*2 - 51l - 290. What is j(-10)? 320 Let y(s) = -147s - 10. Calculate y(-1). 137 Let s(u) = -u2 + 16u + 73. What is s(-5)? -32 Let r(a) = a*3 - 21a*2 + 52a + 4. Calculate r(3). -2 Let z(q) = 52q + 732. Calculate z(-14). 4 Let a(c) = -c2 - 4c + 122. Determine a(8). 26 Let o(r) = r*3 + 11r*2 - 9r - 92. Determine o(-12). -128 Let k(q) = -67q2 + 13q + 8. What is k(-1)? -72 Let x(f) = 2f2 - 267f - 3307. Give x(-12). 185 Let b(h) = 361h + 2878. Calculate b(-8). -10 Let g(b) = -3b*2 + 482b + 10836. Determine g(-20). -4 Let p(l) = 63l2 + 19l + 4. Determine p(1). 86 Let h(c) = -23c - 183. What is h(-6)? -45 Let k(u) = -11u*2 - 52u - 26. Determine k(-7). -201 Let c(w) = -228w + 1513. Give c(7). -83 Let s(j) = 17j*3 + 312j*2 + 110j + 26. Determine s(-18). -10 Let j(z) = z - 1. Give j(0). -1 Let k(t) = 2t2 - 16t + 79. What is k(4)? 47 Let m(q) = q*2 - 130q - 494. What is m(-4)? 42 Let k(b) = 6b2 + 369b - 573. What is k(-63)? -6 Let n(t) = -13t2 + 522t + 1669. What is n(-3)? -14 Let q(l) = l*2 + 19l - 415. Determine q(-29). -125 Let n(u) = -5u2 - 55u - 10. What is n(-12)? -70 Let c(w) = -w + 45. Determine c(9). 36 Let m(y) = y*3 - 18y*2 - 33y + 219. Determine m(19). -47 Let o(i) = i*3 + 34i*2 + 76i - 79. Calculate o(-31). 448 Let f(m) = m*2 - 419m + 4940. Give f(12). 56 Let a(b) = 4b2 + 851b + 4202. What is a(-5)? 47 Let d(a) = 5a - 126. Determine d(29). 19 Let v(u) = u3 - 17u*2 - 19u + 26. Give v(18). 8 Let c(b) = 16b + 41. Calculate c(-4). -23 Let o(g) = g2 - 19g + 21. Determine o(9). -69 Let q(g) = -210g + 10289. Give q(49). -1 Let i(l) = -49l - 208. Determine i(-6). 86 Let x(t) = -17t + 24. Calculate x(-3). 75 Let u(m) = m2 + 8m - 9. Calculate u(-11). 24 Let c(g) = 112g2 - 256g + 10. Determine c(2). -54 Let f(q) = -5q - 271. Give f(-51). -16 Let h(m) = 37m - 1405. Calculate h(38). 1 Let s(i) = -25i + 1535. What is s(46)? 385 Let s(q) = -q3 - 4q*2 - 292q + 1203. Determine s(4). -93 Let z(u) = -u*3 + 21u*2 - 100u + 4. Calculate z(7). -10 Let n(m) = -100m - 18. What is n(0)? -18 Let t(o) = -478o + 37768. Calculate t(79). 6 Let s(p) = 332p - 3661. Give s(11). -9 Let t(k) = 5k*2 - k + 34. Determine t(-2). 56 Let y(r) = 3r*2 - 21. Calculate y(4). 27 Let p(l) = 2l*2 + 14l - 517. What is p(13)? 3 Let w(f) = -3f2 - 9f - 16. What is w(18)? -1150 Let n(h) = h*3 - 36h*2 - 59h - 629. What is n(38)? 17 Let v(i) = -2i3 + 19i*2 + 10i + 15. Calculate v(10). 15 Let c(g) = 2g3 + 26g*2 + 36g - 10. Calculate c(-11). 78 Let p(q) = 629q - 608. Determine p(1). 21 Let x(p) = -72p*2 + 366p - 20. Determine x(5). 10 Let j(o) = 4o2 + 20o + 133. Determine j(10). 733 Let q(p) = 123p2 - 1119p + 103. What is q(9)? -5 Let h(t) = 3t3 - t2 - 9t - 79. What is h(-5)? -434 Let u(x) = -6x + 520. Give u(99). -74 Let w(z) = z3 - 7z*2 + 29z + 37. Calculate w(-1). 0 Let r(n) = -n3 - n2 + 44n + 124. Give r(-4). -4 Let g(q) = -18q + 411. Calculate g(29). -111 Let r(p) = -p*3 - 7p*2 + 81p - 75. What is r(5)? 30 Let o(y) = 153y - 295. Calculate o(2). 11 Let d(s) = 6s*3 + 272s*2 + 86s - 167. What is d(-45)? 13 Let p(u) = -u*3 - 4u2 - 12. Give p(-4). -12 Let g(a) = -a2 - 163a + 5655. Give g(29). 87 Let i(x) = x2 + 3x - 94. Calculate i(-8). -54 Let t(p) = 2p3 + 57p*2 - 37p - 90. Determine t(-29). 142 Let p(x) = 6972x + 62742. Calculate p(-9). -6 Let s(m) = -2m*2 - 120m + 140. Determine s(-60). 140 Let t(f) = f*2 - 117f + 1865. Give t(19). 3 Let x(d) = -61d - 386. What is x(-6)? -20 Let v(z) = -z3 + 15z*2 - 45z + 1339. What is v(17)? -4 Let f(p) = -6926p - 96959. Calculate f(-14). 5 Let t(y) = 255y + 2773. Give t(-11). -32 Let n(r) = r*2 - 97r + 471. Give n(5). 11 Let v(g) = -3g2 - 72g + 2273. Calculate v(-42). 5 Let n(j) = -j*2 + 28j - 158. What is n(7)? -11 Let p(v) = v*3 - 14v*2 + 30v - 13. What is p(8)? -157 Let c(v) = 14v2 - 169v - 1356. Calculate c(-8). 892 Let t(b) = -106b + 2286. Determine t(22). -46 Let n(c) = 9c*3 + 93c*2 + 37c + 102. Give n(-10). 32 Let u(c) = -1274c + 7633. What is u(6)? -11 Let j(d) = 5d*2 + 543d + 2099. Determine j(-4). 7 Let h(b) = -9b2 + 447b + 174. Determine h(50). 24 Let q(i) = 7i2 + 34i + 5. Give q(-4). -19 Let k(u) = -u - 60. Determine k(14). -74 Let u(v) = v*2 + 5v + 18. Give u(-6). 24 Let y(g) = 4g3 + 24g*2 + 10g + 11. Determine y(-7). -255 Let r(n) = -5n - 227. Determine r(-38). -37 Let k(v) = -v3 - 13v*2 + 9v + 25. Give k(0). 25 Let a(o) = 257o2 - 268o + 2. Give a(1). -9 Let p(k) = -2k2 - 60k + 1490. Determine p(16). 18 Let w(c) = -c*3 - 24c*2 - 50c - 209. Determine w(-22). -77 Let m(q) = 46q - 5892. Give m(128). -4 Let p(x) = x2 + 99x + 556. Give p(-6). -2 Let p(f) = f*3 + 38f*2 - 360f - 44. Give p(-46). -412 Let d(j) = -24j - 122. Determine d(-9). 94 Let l(n) = -n3 - 18n*2 + 31n - 223. Determine l(-20). -43 Let a(z) = -1474z + 20595. Determine a(14). -41 Let h(p) = -6p - 3. Calculate h(-7). 39 Let x(h) = h*3 + 6h*2 - 59h - 1	{ "pile_set_name": "DM Mathematics" }
gf = -11f + 8 for f. 4 Let x(k) = k*2 - 6k - 24. Let v be x(10). Let m = 1 - -13. Let h = v - m. Solve 2d + 0 + h = 0 for d. -1 Suppose -3g - 2p + 43 = 0, 4g = 2g - 3p + 37. Suppose 4h = -3m + g, -h + 3m + 0m - 1 = 0. Solve i + h = 4 for i. 2 Let c(i) = i*2 - 4i + 2. Let f be c(4). Suppose fy = 6y - 4. Solve -4g - 15 = y for g. -4 Suppose -3z + 0b + 38 = 4b, 20 = 3z - 5b. Let f = -102 - -97. Let t = z + f. Solve -t = -3d + 10 for d. 5 Suppose 8 = 4i - 0. Let a be (-6)/45 - 160/(-75). Suppose 5c = ab, 5c + 0b = -b. Solve c = -2j - 2 - i for j. -2 Let f(i) = -i3 - 6i*2 - 1. Let d be f(-6). Let l be 3/(d/(-3 + 2)). Let n = 523 - 519. Solve -h - lh = -n for h. 1 Let r(y) = 15y - 358. Let f be r(25). Suppose 5b = 2w + 17, 52 = 4b + 3w + 20. Solve ba + 8 = -f for a. -5 Let c(m) = 2m2 + 2m + 1. Let r be c(1). Solve 0 = b + 4b - r for b. 1 Suppose -10q = -12q - 60. Let i = -26 - q. Solve 2u + i = -0u for u. -2 Let l be (0 - 3)2/(-6). Let h = 21 - 16. Suppose -hk - k = 0. Solve i - l = -ki for i. 1 Let l(t) = -t*3 + 6t*2 + 7t + 2. Suppose 15x = 18x - 21. Let d be l(x). Solve 0 = dw - 6 for w. 3 Suppose -4t = 2r - 14, 1 = -0t + t + 3r. Suppose 2p - td = -0d, 6 = -p + 4d. Solve o - p = -2o for o. 2 Suppose 4d = -8, 0d - d = -4o + 18. Let v(b) = -b3 - 8b*2 - b + 2. Let x be v(-8). Solve op + x = -p for p. -2 Suppose -3z - 52 = 5l, -3z = l - 0l + 32. Let j be (40/3)/2z/(-6). Solve -jo - 12 = -7o for o. -4 Let y = -1277 - -1291. Solve yt = 2t - 36 for t. -3 Suppose 0 = -5p + 630 + 130. Solve -3u = -143 + p for u. -3 Suppose 3 = 3i, -38 = 5y - 0i - 3i. Let n = y - -7. Solve 4r - 5r = n for r. 0 Let i be (-399)/(-84) + 3/(-4). Solve iy - 21 = -17 for y. 1 Suppose 10 = -5i + 7i. Suppose 4d - 128 = -4d. Suppose 0 = -2q + 8. Solve -q = -iv + d for v. 4 Let x(h) = -2h2 + 5h + 71. Let s be x(-4). Solve -4d = sd for d. 0 Suppose -6r - 4 = -10r. Let d be -3 - ((3 - r) + -5). Suppose d = -2n - 0n + 6. Solve nj + 3 = -12 for j. -5 Suppose 6o = 10o - 236. Suppose -55q - 28 = -oq. Solve -10 = 2a - qa for a. 2 Let z = 823 + -815. Solve -7j + 11j + z = 0 for j. -2 Let f be ((-89)/(-2))/((-1)/(-2)). Let i = f + -86. Solve -2g - ig - 5 = 0 for g. -1 Suppose -5z = 0, -z - 7 = -4h - 19. Let a be 1/1 + (0 - -2). Let u be (h - (-3)/a) + 6. Solve uv = 8v + 8 for v. -2 Let f be (110/7 - 0) + (-2)/(-7). Suppose 0 = -3k - k + 148. Suppose -4q = q - 15, k = 5u + 4q. Solve -un = -n - f for n. 4 Let f(m) = m + 15. Let y be f(-7). Let i be -8(-4)/y - -3. Suppose 4x - 47 = -i. Solve -2l + 7l - x = 0 for l. 2 Suppose -6z + 3z = z. Solve -7h + 23 - 2 = z for h. 3 Let u be (4/(-14))/((-4)/56). Suppose u = 3q + g, -5g = 2q - 2g + 2. Suppose -3m + 2m = -q. Solve mv = -0 - 2 for v. -1 Let o(b) = 5b + 92. Let j be o(-18). Solve -3a - j = 7 for a. -3 Let b = 355 + -350. Solve -bo = -14 - 6 for o. 4 Let m be (-113)/(-5) - (-9)/(-15). Let j = 25 - m. Solve 3a + 0 = j for a. 1 Let z(w) = w + 2. Let b(t) = t*2 - 11t - 5. Let y(f) = b(f) + 3z(f). Let a be y(8). Solve a = 4s + 9 for s. -2 Let w be (-5)/2(-96)/15. Suppose -u - w - 2 = 0. Let f be ((-11)/33)/(2/u). Solve 2o + 3 + f = 0 for o. -3 Let k(p) = -p*3 + 12p*2 - 4p + 16. Let b be k(12). Let d be b/(-6) - 8/(-12). Suppose -6i = -0i - d. Solve -4f + 3 = -i for f. 1 Let l be -17 - (-826)/42 - 4/(-3). Solve 19b = 15b + l for b. 1 Suppose -4c = -2s, 0 = 7c - 8c - 5s. Solve -8l + 6l = c for l. 0 Let t be (-30)/(-4)8/12. Suppose to + 4 = 19. Solve y - oy = 8 for y. -4 Suppose 0 = 2u - 32 - 182. Let j = 112 - u. Solve jz = -1 - 19 for z. -4 Let v(l) = -l2 - 8l - 9. Let w be v(-5). Let m be (31)/1-1. Let j = m + w. Solve -3z + j = -12 for z. 5 Suppose -30u = -26u + 84. Let w(j) = 3j*2 + 62j - 18. Let m be w(u). Solve mz = -1 + 4 for z. 1 Let o = 842 + -837. Solve -oj + 21j + 16 = 0 for j. -1 Let b = -417 - -426. Solve 8z + 4 = bz for z. 4 Let w(k) = -k2 + 9k + 4. Let o be w(9). Solve r + o = 3 for r. -1 Suppose -21 = -4y + 3y. Let m = 12 - y. Let v(w) = w*2 + 9w + 3. Let k be v(m). Solve -i + ki = 4 for i. 2 Let z be 0 + ((-26)/91 - (-6)/21). Solve 56l - 49l + 21 = z for l. -3 Let x(y) = y2 - 20y - 19. Let f be x(21). Solve -fm = -3m for m. 0 Let x(s) = -s*2 + 13s + 3. Let c(b) = -2b2 + 27b + 5. Let u(y) = -6c(y) + 13x(y). Let t = 370 + -362. Let f be u(t). Solve f - 5 = 2h for h. -2 Suppose 4u + 6 = 58. Let n(q) = -q*2 + 14q - 11. Let d be n(u). Let i = -5 + 5. Solve 2m + 0 + d = i for m. -1 Let t(m) = m2 - 6m + 10. Let j be t(2). Solve jb = -3b - 25 for b. -5 Suppose -7f = -6f. Solve f = -10v - 62 + 12 for v. -5 Suppose 0q - 9q = 441. Let b = q + 49. Solve bd + 2d = 4 for d. 2 Let o(m) = 3m*2 - 10m - 19. Let k(l) = -4l2 + 10l + 20. Let a(y) = -4k(y) - 5o(y). Let z be a(-9). Let b = 9 - 5. Solve -bf + 6 + z = 0 for f. 3 Let d be 2/(9/(-3) - 82/(-26)). Solve -dq - 8 = 44 for q. -4 Suppose -4k = -6 - 10. Suppose ku = -2x - 0u - 12, 0 = 3x + 3u + 9. Solve -t + 6t - 5 = x for t. 1 Let u be (-10)/(-50) + (-834)/(-30). Solve -8q - u = 12 for q. -5 Let q be ((-18)/(-27))/(1/6). Suppose qw - 17 + 9 = 0. Solve 4m = -w + 18 for m. 4 Let i be (-3)/(-7) - 852/(-21). Suppose -7u - g = -3u - i, 4u + 3g = 51. Let c be (-6)/u(-1 - 2). Solve -ca = 3a - 15 for a. 3 Suppose 3k + 6 = 0, 5c + 13 = 6c - 5k. Solve -ca - 5 = -8a for a. 1 Suppose -15 = 6v - 51. Let p be ((-2)/v)/(9/(-1135)). Solve 4o + p + 3 = 0 for o. -2 Suppose 2o + h - 65 = 0, 4o - 165 = 18h - 13h. Solve -o + 7 = 7a for a. -4 Suppose 14t = 264 - 824. Let h = -35 - t. Solve -hf = -3f + 8 for f. -4 Let j = -13 + 17. Let v(n) = n*2 - 5n + 6. Let c be v(j). Solve 0 = g + c - 3 for g. 1 Suppose 2z - 9 = 5z. Let q be (-3)/2 - z/(-6). Let w be (1/(-2))/(q/48). Solve -2k - k = -w for k. 4 Let j be (-3)/(-7) - 51040/(-1120). Solve -29 = -15x + j for x. 5 Suppose 3d = -5l - d + 754, 295 = 2l - 5d. Let t be (1 - -1)/(60/l). Solve q = tq for q. 0 Suppose 5y - 43 = 4a, 22 = 2y - a - 3a. Suppose yp = 4p + 75. Suppose -4j + 3o + 1 = 0, -j - 4j - o + p = 0. Solve 0 = ju - 0 - 4 for u. 1 Suppose -2f - 10 = 0, 4 = -q + 3f - 0f. Let r = 23 + q. Solve rk + 7 = 27 for k. 5 Suppose 3f + 52 = 5k, -5 = 5f - 10f. Suppose -3l - n + k = -17, 0 = -3l - 3n + 36. Solve -b = b + l for b. -4 Let c(m) = 7m + 6 - 9 - 10 - 2m. Let d be c(5). Solve 5l - 2l = d for l. 4 Let q be (-6)/(-14)21/1. Solve 0 = l + 4 - q for l. 5 Suppose 4r + 7 = 11. Let h = -508 + 511. Solve y + h = -r for y. -4 Let h = 8 - 13. Let c = 9 + h. Suppose -12 = -ca - 0a. Solve 0 = af + 5 - 2 for f. -1 Let i = -4 + 7. Let x(w) = 3w - 3. Suppose 3t = 5n - 16, 2t + 2n - 14 = 2. Let u be x(t). Solve -6 = -ic + u for c. 4 Let w(h) = -h2 - 17h + 4. Let m be w(-17). Suppose 3i + 9 = -5k, -2k + 5i + 19 - m = 0. Solve k = 3r - r - 2 for r. 1 Suppose -3 = 2x + g - 4g, -12 = -4g. Solve xj + 17 - 26 = 0 for j. 3 Let t(f) = f2 - 2f + 1. Let p be t(1). Suppose -r + 56 = 3r + 2b, -4r - 3b = -60. Suppose r = 3u - pu. Solve -m = u - 5 for m. 1 Let i = 5 - 3. Suppose -5d - 2n = -3n - 183, n - 2 = 0. Let t = 43 - d. Solve -t = iv - 0v for v. -3 Let q be (0 - -6) + -23/6. Let i(f) = -f + 3. Let o be i(-5). Suppose -2 = -qm + o. Solve mw + 2w = -20 for w. -5 Let v(t) = t3 + 11t*2 + 25t + 12. Let m be v(-8). Solve -mo - 121 = -101 for o. -5 Let i(w) = w2 - 5w + 4. Suppose -6a + 25 = -a. Suppose 0m + 20 = am. Let g be i(m). Solve 3d = -gd for d. 0 Let n(m) = -22m + 218. Let d be n(9). Solve -12v + 8v = -d for v. 5 Let x be -4 + 40/(-2) + 3. Let y = x - -28. Solve -y = -2z + 1 for z. 4 Suppose 817a - 815a = 18. Solve 6l + 15 = al for l. 5 Let u be ((-26)/4)/((-4)/40)-1. Let z = u + 75. Let v be 2/8 - 2/8. Solve v = -3t + 5t - z for t. 5 Let h be ((-250)/(-15))/((-2)/(-3)). Suppose s - 2s = h. Let v = -22 - s. Solve 0 = -7b + 4b + v for b. 1 Suppose -4a + 16 = 4q, -2q - q - a = -12. Let z(n) = -3n - 6. Let o be z(-4). Suppose -4r = 5f - 3 + o, -9 = -f + qr. Solve 3 = -4*w - f for w. -1 Let g = -41 + 41. Sup	{ "pile_set_name": "DM Mathematics" }
-12 Rearrange 3n - n + 13n*3 - 3n - 11n3 + 5n*2 to the form on + jn2 + un*3 + g and give j. 5 Rearrange 9 - 3 - j + j - 3j to the form zj + s and give s. 6 Rearrange -a2 + a2 + 25a*3 - 2a*4 - 3a*2 - 8a - 23a3 to s + ga*2 + qa*3 + oa*4 + fa and give g. -3 Rearrange -1 - 5k3 + 1 + 0 - 1 to the form n + vk*3 + bk*2 + ik and give n. -1 Express -r*3 + 6r*2 + 4 - 1 - 4r*2 - 7 as c + lr + dr2 + tr*3 and give c. -4 Express (3 - 1 + 0)(6 + 0 - 3)(-2y + 2y - y) in the form h + my and give m. -6 Rearrange -1 + l*2 - 11 + 4 to the form zl + t + jl2 and give j. 1 Rearrange -k - 5k - 33 + 33 to ak + v and give a. -6 Express -4c + 29c + 4c + (4 - 4 - c)(2 - 3 + 3) in the form i + vc and give v. 27 Rearrange ((3x - 2x - 2x)(-1 + 4 - 2) + 2x - 3x - x - 2x + 1 - 1 - 3x + 2x + 2x - 8x + 4x + 3x)(-1 + 2 + 1) to the form sx + k and give s. -10 Express 2i*3 - 4i + i*2 + 5i - 6i - 2i*4 in the form fi + xi2 + qi*4 + vi*3 + d and give f. -5 Rearrange -15g*3 + 27g*2 - 26g*2 + 12g*3 - 4 to the form x + og*3 + lg + jg2 and give o. -3 Express (26 - 54 + 23)(-2j4 + 0j*3 + 0j*3) as rj + nj2 + hj*3 + t + xj*4 and give x. 10 Express -15y*2 - 11y*2 - 6y*2 in the form iy*2 + b + ay and give i. -32 Express -40 - 10y + y + 5y + 6y in the form k + jy and give k. -40 Express (8 + 1 + 0)(4 + 0 - 1)(-f + 2f + f) in the form a + jf and give j. 54 Rearrange 2m - 4m + 2 - 3m + (2 + 3 - 6)(-3m + 0m + 4m) to r + jm and give r. 2 Express -116n4 - 113n*4 + 2n - n*2 + 224n*4 + 3n*3 as f + ln*3 + in*2 + xn + mn4 and give l. 3 Express -2j + j + j*2 + 4j + 13 - 2j as qj + aj2 + v and give v. 13 Express (-16t + 38t - 1 + 31t)(-4 - 1 + 3) as nt + r and give n. -106 Express (n*3 + 2n4 - n3)(-3 + 2 - 1) + 36n*2 - 13n*4 - 36n*2 in the form dn*3 + q + wn*2 + cn + pn4 and give p. -17 Express (-4c + 5c - 2c)(1 - 26c + 8c2 + 16c*2 - 23c*2) as pc*3 + j + gc*2 + fc and give g. 26 Rearrange 2 + 2 - 32h3 - 1 + 40h*3 to oh*2 + ah + sh3 + i and give s. 8 Express (-2w + 15w - 2w)(17w - 29w - 17 + 11w) as qw2 + s + pw and give p. -187 Rearrange -2x - 4x + 10x + 4x - x - 5x + (-3x - 2x + 3x)(-2 + 2 - 2) to i + hx and give h. 6 Express 2s2 + 2s*2 - 2s*2 + (-1 - 4 + 0)(3s2 - 3s2 + s2) - 2s2 - 3 + 3 in the form w + fs*2 + ds and give f. -5 Express (0x2 - 10x*2 + 0x*2)(5x - 3x + 2x) in the form p + fx*2 + cx*3 + mx and give c. -40 Express -2 + 38x - 2 - 9x + 2 as n + dx and give n. -2 Rearrange 39 + 10l - 39 to bl + h and give b. 10 Express -2 - 24v + 24v + v3 + 5 as kv + a + xv3 + fv2 and give x. 1 Rearrange a2 + 2a3 + 3a*2 - 2a2 + a3 to the form ga3 + wa + h + ta2 and give g. 3 Express -205 - i3 + 2i*2 - 199 + 436 as si + v + ti2 + xi*3 and give t. 2 Express 2t*4 - 4 - 3 + 8t*3 + 3t2 + 9 + t2 in the form zt3 + h + lt*2 + pt*4 + ft and give p. 2 Express -m*2 + 2 + 0m*2 + 14 as rm*2 + km + b and give b. 16 Rearrange 3o - 8o - 7o + (2o + 0 + 0)(2 - 3 + 0) to the form z + ko and give k. -14 Express (2s + s - s)(2 - 3 + 3)(-65s - 34s + 4s) in the form us2 + m + ts and give u. -380 Express (-6 - 3d + 6d + 5)(-4d*3 + 9d*3 + 2d*3) in the form q + pd*2 + xd*4 + fd*3 + md and give x. 21 Express (-11h - 7h - 2h)(h - 5h + 3h)(0 + 3 - 4) in the form uh + k + jh2 and give j. -20 Rearrange 44 - 65 + h + h to the form d + ph and give d. -21 Express -u*2 - 10u*3 + 3u + 9u3 + 0u*2 in the form cu*3 + zu*2 + j + nu and give j. 0 Rearrange -31l2 + 2l + 0l - 2l to rl2 + sl + d and give r. -31 Express -4z + z - 1 + z + 143z*2 + (2z + 2z - 2z)(-3z + 0z + z) + 4z*2 - 5z*2 + 0z2 - z2 - 1 + 1 as fz2 + bz + j and give b. -2 Express -c*2 + 17c + 4c4 - 2c*4 - 2 - 18c in the form yc2 + u + xc*4 + pc*3 + ic and give y. -1 Express 145n - 88n - 145n in the form mn + z and give m. -88 Rearrange 6f - 29f + 6f + 3f + 4 to jf + c and give j. -14 Express -6a - 16a3 + 1 + 14a*3 + 5a in the form ma3 + oa*2 + ba + s and give b. -1 Rearrange -2y + y - 1 - 19y*2 - 2y*3 + 3y to the form ly2 + t + py + uy3 and give u. -2 Rearrange (-2 + 1 + 3)(2x - 2x - 2x) + 1 - 6x - 1 + 155x to c + ax and give a. 145 Rearrange -6b + 3b - 3b - 11b to the form gb + a and give a. 0 Rearrange 336 - 15y - 336 to s + ty and give t. -15 Rearrange 7 + 35u - 7 + (1 + u - 1)(1 + 2 - 5) to fu + q and give f. 33 Express 182t + 189t - 404t + t2 - 2 in the form ht + v + gt2 and give h. -33 Express (-4 + 5 - 2)(57m - 24m - 3 - 31m) as im + q and give q. 3 Rearrange (2c2 - 4c2 + c2)(-2c - 1 + 1) + (-c*3 + 6c*3 + 2c*3)(-1 - 5 + 4) to the form mc3 + zc + gc2 + l and give l. 0 Rearrange -4v*2 + 1 + 6 - 7 to the form qv + ov2 + b and give o. -4 Rearrange 0k*3 + 2k3 - k3 + (-5 + 0 + 6)(-34k*3 + 14k*3 + 12k*3) to the form hk*2 + ck*3 + dk + b and give c. -7 Rearrange 3v2 - 32v - 15v3 + 13v*3 + 31v to the form ov3 + u + dv*2 + av and give o. -2 Rearrange 2i4 + 3i*4 - 10i + i*2 - 4i*4 + 0i*4 to the form wi*2 + v + ni*4 + bi + zi3 and give v. 0 Rearrange (3j + 2j - 3j)(-j2 + 4j*2 - 2j*2) + 2j - 4j3 - 2j to the form lj + m + vj*3 + uj*2 and give v. -2 Express -2y + 16y + 4y + 0y in the form x + ty and give t. 18 Rearrange 15q2 - 2 - 7q2 - q3 - 4q - 6q*2 to the form i + aq + kq3 + xq*2 and give a. -4 Express (o - o + 2o)(6o + 4o - 4o) - 1 + o*2 + 1 + (-3o + 3o - o)(o + 0 + 0) as ao2 + l + co and give a. 12 Express (-2549 - 50h + 2549)(-3h2 + 4h*2 - 2h*2) in the form l + oh*3 + yh*2 + mh and give o. 50 Rearrange d*4 + 0d*3 + 5d - 1 - 5d + d3 to nd*3 + gd*2 + sd + z + od4 and give n. 1 Express -2w + 0w - w4 - 8w*4 + (4w2 - w2 - 2w2)(-4w2 + 3w*2 + 2w*2) in the form cw*3 + zw*4 + gw*2 + uw + y and give z. -8 Rearrange (-2 - 1 + 6)(3z*3 + 10z*3 - 6z*3) to the form uz*2 + s + wz*3 + hz and give w. 21 Express (-1 - c + 1)(-c - 2c + 4c)(0c2 - 5c*2 + 3c*2 + (3c + 3 - 3)(-1 - 2c + 1)) in the form ac4 + pc + m + lc2 + vc*3 and give p. 0 Rearrange (-2u + u - 3u)(-u*2 + 3u*2 - 3u*2) - 24u*3 + 18u*3 - 13u*3 to lu + a + yu2 + gu*3 and give g. -15 Rearrange 4g*2 - 2g + 5g - 8g*2 + 9g*2 to zg + b + rg2 and give b. 0 Rearrange 2d*2 + 3d*4 + 3 - 2d + d - 2 - d*2 to td*2 + o + ld*4 + ud*3 + qd and give o. 1 Rearrange 2 - 2 - 6g - 3g to r + bg and give b. -9 Rearrange 4c2 + c3 - 3c2 - 3c*2 to the form mc*3 + rc*2 + sc + q and give r. -2 Rearrange -109y2 - 2 - y4 - 1 + y + 108y*2 to the form jy*4 + fy*3 + x + ty + ry2 and give t. 1 Rearrange 148n*2 + 2n*4 + 2n*3 - 149n2 - n3 to d + wn + fn*3 + vn*4 + yn*2 and give f. 1 Express -6y*2 - 9y*3 + 5y*2 - 3y*3 + 3y*2 in the form py + xy2 + dy*3 + l and give d. -12 Rearrange -4 - p + 0p*2 - 2p*2 - 338p*3 + 337p*3 to the form yp*3 + mp + zp2 + b and give y. -1 Express -r - 4r + 0r + (-r - r + 4r)(2 + 2 - 6) + 4r - 2r - 4r + 3 - 4r - 3 + (-4 + 0 + 2)(-1 + 1 + 2r) as j + wr and give w. -19 Express 8p2 + 10p + 9p2 - 9p*2 as lp + dp2 + y and give l. 10 Express 51 + 81u*2 - 51 as wu*2 + y + ku and give w. 81 Rearrange 4 - 3 + 0n - 2n*2 + 2n - 4 to the form fn2 + pn + d and give d. -3 Express -2 + 3y3 + 2y - 5 + 6 as ay3 + o + wy*2 + hy and give o. -1 Express 3 - 2v3 + 0v - v + 4v4 - 15v*4 + 12v*4 in the form dv + y + cv3 + sv*4 + jv*2 and give c. -2 Rearrange 23h + 0h + 19h to the form xh + d and give x. 42 Express 5y*3 - 8y*2 - 3y*3 + 0y*3 + 10y*2 - y in the form u + hy + qy2 + xy3 and give h. -1 Express (-a2 + a2 + a2)(15 - 2 + 19) as ga*2 + v + za and give g. 32 Rearrange (-10b + 3b - 3b)(4b - 2b	{ "pile_set_name": "DM Mathematics" }
8 = -3j + 3i, -3j + i = -0i - 22. What is the units digit of j? 8 Suppose 0m + 4m = -4x - 48, x - 4m = -27. What is the units digit of 2(x/(-6))/1? 5 Let o be 26/8 + 3/(-12). Suppose on = 5c - 23, -3n + 22 = 4c + 9. Suppose m - c = -m. What is the units digit of m? 2 Let s = 21 - -6. What is the units digit of s? 7 Let h = -2 + -11. Let a(p) = p2 - 4p - 1. Let w be a(7). Let r = h + w. What is the units digit of r? 7 Suppose 4p - 85 = -p. Suppose 4t - 24 = -4l, 4t - p + 49 = 3l. What is the units digit of l? 8 Suppose 2j + 4t = 64, 3j - 2t - 97 - 15 = 0. What is the units digit of j? 6 Suppose -n = -3q + 8, -3q - 4n + 2n + 2 = 0. Suppose 7 = m + 5w, m = -qw - 1 - 1. What is the units digit of 8/m + (0 - -2)? 1 Suppose 0 = -h - 1 + 6. What is the units digit of 29/2 + h/10? 5 Let k(h) = 14h + 6. Let q be k(7). Suppose 4g + 5w = 2w + q, 2g + w - 50 = 0. Suppose 5i + g = 4j, -5i + 26 = 2j + j. What is the units digit of j? 7 Let j be 1(2 - -4)/3. Suppose t - 14 = 3f, 4t = -2f - jf + 104. What is the units digit of t? 3 Let t(f) = 13f. What is the units digit of t(1)? 3 Let n = -8 + 14. What is the units digit of 10/(23/n)? 0 Let q = -10 - -14. Suppose -3h + 106 = -5v, -5h + qh + 2v + 36 = 0. What is the units digit of h? 2 Let b(t) = -2t + 11. Let f be b(8). What is the units digit of (-12)/f + (-4)/10? 2 Suppose -d - 3d - 52 = 0. Let g(l) = -l*2 - 17l - 1. What is the tens digit of g(d)? 5 Suppose 0 = 3x + 3y - 4y - 15, 0 = -5x + y + 25. Suppose 0 = -5h, 3h = -xd - 0d + 50. What is the units digit of d/2(-16)/(-10)? 8 Suppose 3w - 2w = 2. Let v be (1 - (3 - w))-1. Suppose 23 = g + 4g + a, 4g + 2a - 16 = v. What is the units digit of g? 5 Let s(o) = -2o + 22. What is the units digit of s(-10)? 2 Let v(r) = -r*2 + 3r + 5. What is the units digit of v(3)? 5 What is the units digit of (78/(-5))/((-5)/25)? 8 Let q be 4/(2/41). Let k = 2 + q. Suppose 8r - k = 3r. What is the units digit of r? 2 Let s(k) = -5k + 1. Let t be s(-2). Let i = t - 0. What is the units digit of i? 1 What is the units digit of 4/(-12) - (-3 + (-145)/3)? 1 Let c(d) = d*3 - 2d*2 - 2d + 2. Let k be c(3). Let b = 3 + k. What is the units digit of b? 8 Let b(v) = 2v2 + 2v - 7. What is the units digit of b(4)? 3 Suppose 0 = v + 8 - 2. Let j(t) = -2t + 7. What is the tens digit of j(v)? 1 Let j = -11 - 9. What is the units digit of (88/j)/(6/(-15))? 1 Let g = -36 + 118. What is the tens digit of g? 8 Let v = 24 + -15. Let h be (48/v)/1-3. What is the units digit of (-8)/(-12) + h/(-3)? 6 Let g(z) = -z - 13 - z*2 + 16 + 2z*2. What is the tens digit of g(5)? 2 Let c(x) = -x + 3. What is the units digit of c(-9)? 2 Let t = 11 + -15. What is the tens digit of t - -6(3 + 2)? 2 Suppose -5g - 218 = -2s - 74, -5s + 3g + 398 = 0. What is the units digit of s? 2 Let n(c) = 3c + 9. What is the tens digit of n(13)? 4 Let a(b) = 2b*2 - 5b - 37. What is the hundreds digit of a(13)? 2 Let f be (24/20)/((-4)/(-10)). Suppose -p = -1 + 4, -fm + 15 = -5p. Suppose m = -0b - 2b + 6. What is the units digit of b? 3 What is the units digit of ((-2)/(-4))/(2/156)? 9 Let f(n) = -3n2 - n + 1. Let r be f(1). Let m = -3 + 4. What is the units digit of (4 - r)1/m? 7 Let x = 5 + -3. Suppose -xm - 3k + 2k = 0, 14 = 5m - k. Suppose -mj = -0j - 10. What is the units digit of j? 5 Let r = 12 + -23. Let c = 22 + r. What is the tens digit of c? 1 Let b = 15 - 11. Suppose -x - bi = 8 - 22, -i = -4x + 5. Suppose 3 = xy + 1. What is the units digit of y? 1 Suppose -3s + 4d = -227, 0 = -2s + 5d + 142. Suppose 5m + 5z = 45, -2m - 3m + 4z = -s. What is the tens digit of m? 1 Suppose -4q + 10 = -2. Let a be 1/q - (-7)/(-3). What is the units digit of (-2 + a)2/(-8)? 1 Let l(y) = y - 1. Let m be l(5). Suppose -3w + 2 = -m. Suppose 0z + 22 = wz. What is the tens digit of z? 1 Let v(y) = -2 + 2y*2 - 34y*3 - 4y*2 + 9y + 5y3 - 12y. What is the tens digit of v(-1)? 2 Let l(n) = n*2 - 2n. Let u be l(2). Suppose -4k = -u - 16. What is the units digit of k? 4 Suppose 4p + 39 = 5v - 105, -5p - 180 = 3v. Suppose 4u + 170 = o + 2o, 0 = 4o + u - 195. Let n = p + o. What is the units digit of n? 4 Let k = -3 - -6. Suppose -21 = -kv + 18. What is the units digit of v? 3 Let t(b) = 1. Let m(a) = -4a - 4. Let k(q) = -m(q) - 6t(q). What is the units digit of k(9)? 4 Let t(o) = 4o + 4. Let v be t(4). Let a be 12/v - (-23)/(-5). What is the units digit of (-50)/a + 3/(-6)? 2 What is the tens digit of 3/2 + (-87)/18-9? 4 Let l(n) = n3 + 4n*2 - 2n + 5. Let u(y) = -5 - 4y2 + y3 + y - 2y*3 + 0y*2. Let r(x) = -2l(x) - 3u(x). What is the units digit of r(-4)? 1 Let m(t) = 10t + 12. What is the tens digit of m(5)? 6 What is the units digit of 2/5 - 32/(-20)? 2 Suppose -n = -3n + 4, -5u - n = -27. Suppose -2o = -3 - u. Suppose g - 1 + 6 = 3v, 4v = 4g + o. What is the units digit of v? 2 Let t(j) = 66j + 7. What is the units digit of t(4)? 1 Suppose 0q + 9 = 3q. Suppose -3r + 4r - q = 0. What is the units digit of r? 3 What is the tens digit of -36/(-27) - 1488/(-9)? 6 Let f = 109 + -9. Let j = -48 + f. What is the units digit of j? 2 Suppose -1863 = 15t - 24t. What is the hundreds digit of t? 2 Let w = -24 + 47. Suppose f - n - 26 = -6n, 0 = 2f - 5n + w. What is the units digit of 35/284f? 5 Let h(w) = w3 + 4w*2 - 4w + 3. Let v be h(2). Let c be (0/(-4))/(1-1). Suppose 6g - 4g - 3z - v = 0, c = 3g + 2z - 22. What is the units digit of g? 8 Let x(a) be the third derivative of -a*5/60 - 5a*4/8 + 13a3/6 + a2. What is the tens digit of x(-13)? 3 Suppose -6 = 2r + r. Let o be 1/(3 - 24/9). What is the units digit of ((-4)/r)/(o/9)? 6 Let d = -5 - -10. Let n(u) be the first derivative of u4/4 - 4u*3/3 - 5u*2/2 + 2u + 2. What is the units digit of n(d)? 2 Suppose -g = -2g + 5. What is the units digit of g? 5 Suppose 4a = -k + 101, 2k - 2a + 415 = 7k. What is the tens digit of k? 8 Let i(c) = c2 + 6c*2 + c - 5c*2 - 1. What is the units digit of i(-2)? 5 Suppose 0 = -3z - 0z + 6. Suppose -y = f + 3 - 9, -5f = y - z. What is the units digit of y? 7 Suppose -4w + b = -5w + 6, b - 10 = -5w. What is the units digit of (w(-4)/(-2))/2? 1 Let c = 5 + -2. Suppose 2g = -cm - 16, 3m + 2g - 16 = 8m. Let d = m - -5. What is the units digit of d? 1 Let w be (-1)/(-1) - (-22 + 1). Let j be 6/9 + w/3. Suppose 2i + 2 = j, -3v + 3 = -2i. What is the units digit of v? 3 Suppose -i + 244 = 3l, -4i = -2l + 3l - 965. What is the tens digit of i? 4 Let r be (-1)/((-9)/6 + 1). Suppose -b - 2b - 4v - r = 0, -5b + 40 = -2v. Suppose -1 = 4i - 5m + b, -4i + 2m + 2 = 0. What is the units digit of i? 2 Let d be -2(-1)/46. Suppose -dl - l = -88. What is the tens digit of l? 2 What is the units digit of (-8)/(-20) - 3732/(-20)? 7 Let m(w) = w3 - 7w*2 - 4. Let n be m(7). Let q be 5/n - (-3)/(-4). What is the units digit of 60/(-25)5/q? 6 Suppose -3l + 5l - 81 = 3u, -4u = -3l + 120. Let t = -13 + l. What is the tens digit of t? 2 Let b(s) = 15s - 16. Let g(o) = 5o - 5. Let v(a) = -2b(a) + 7g(a). What is the units digit of v(3)? 2 Suppose -2s + 4s = -3p + 18, -3 = -3p + 3s. Suppose 0 = pl + l - 10. Suppose 0 = -lg + 18. What is the units digit of g? 9 Let w(t) = 7t + 1. Let h be w(2). Suppose q + q + 6 = 4m, -5q = -h. What is the units digit of m? 3 Let r = 1 - 2. Suppose 74 = -4c - 3g, -5c + 4g - 86 + 9 = 0. Let l = r - c. What is the units digit of l? 6 Suppose 3f - 5f = -4s + 6, -4f - 2s = -38. Suppose -7g + 3g + 32 = 5w, -3w = g - 15. Suppose 0 = -gv + fv - 32. What is the units digit of v? 8 Suppose -c + 4 = -5c + 5n, -5c = -2n + 5. Let v = 20 - c. Let t = -11 + v. What is the units digit of t? 0 Let v(i) = i*2 + 5i - 5. Suppose -3k + 4 = 31. What is the units digit of v(k)? 1 Let a = -12 - -17. Suppose -11 = 4b + a. Let k(c) = -c*3 - 4c2 + 3. What is the units digit of k(b)? 3 What is the tens digit of 498/4 + (-6)/(-4)? 2 Let j(t) = -t3 - 7t2 - 7t - 2. Let l(f) = f*2 + 9f - 6. Let o be l(-9). What is the units digit of j(o)? 4 Let d = 15 + -10. Suppose -2z - 227 = -d	{ "pile_set_name": "DM Mathematics" }
se 10 0 What is 1 (base 12) in base 2? 1 What is 2001 (base 3) in base 8? 67 -24 (base 11) to base 3 -222 Convert 20 (base 3) to base 10. 6 What is 3 (base 9) in base 12? 3 What is -7 (base 15) in base 9? -7 121 (base 5) to base 6 100 4 (base 6) to base 7 4 What is 30 (base 12) in base 9? 40 321 (base 5) to base 4 1112 What is -12202 (base 3) in base 11? -131 What is -20 (base 4) in base 12? -8 -3 (base 9) to base 13 -3 Convert -6 (base 8) to base 7. -6 What is 6 (base 13) in base 4? 12 Convert -170 (base 8) to base 9. -143 What is 1a (base 14) in base 16? 18 Convert -74 (base 13) to base 16. -5f Convert -1 (base 8) to base 4. -1 What is -31 (base 5) in base 9? -17 What is 110 (base 3) in base 13? c -3 (base 12) to base 6 -3 Convert 1010 (base 2) to base 4. 22 What is -1 (base 15) in base 6? -1 What is -166 (base 7) in base 2? -1100001 Convert 0 (base 5) to base 12. 0 Convert -8 (base 12) to base 15. -8 -44 (base 8) to base 15 -26 Convert 59 (base 14) to base 10. 79 64 (base 10) to base 8 100 Convert -3 (base 10) to base 6. -3 What is 0 (base 15) in base 2? 0 Convert -1 (base 16) to base 5. -1 -44 (base 14) to base 11 -55 0 (base 10) to base 13 0 Convert 1 (base 12) to base 13. 1 Convert 1d (base 14) to base 6. 43 Convert -6 (base 9) to base 12. -6 What is -131 (base 5) in base 12? -35 Convert 6 (base 8) to base 7. 6 Convert -11 (base 8) to base 14. -9 What is 98 (base 16) in base 3? 12122 Convert 0 (base 3) to base 4. 0 What is -24 (base 7) in base 13? -15 Convert 41 (base 15) to base 8. 75 Convert -3 (base 11) to base 12. -3 What is 27 (base 10) in base 2? 11011 12 (base 16) to base 14 14 Convert 12 (base 10) to base 8. 14 What is -10 (base 5) in base 12? -5 Convert 7 (base 11) to base 9. 7 What is -3 (base 12) in base 13? -3 1 (base 6) to base 16 1 Convert -2 (base 4) to base 6. -2 What is -68 (base 9) in base 3? -2022 14a (base 11) to base 8 257 What is 14 (base 14) in base 13? 15 What is -120 (base 3) in base 16? -f Convert -125 (base 7) to base 2. -1000100 What is -13 (base 5) in base 3? -22 What is 4f (base 16) in base 7? 142 3 (base 6) to base 5 3 What is -312 (base 7) in base 12? -110 What is 111001 (base 2) in base 13? 45 0 (base 2) to base 13 0 Convert 2 (base 14) to base 16. 2 6 (base 12) to base 8 6 140 (base 9) to base 12 99 -3 (base 13) to base 12 -3 Convert -5 (base 7) to base 6. -5 What is 346 (base 9) in base 12? 1b9 What is 3d (base 16) in base 2? 111101 123 (base 4) to base 16 1b -2 (base 3) to base 5 -2 What is -4 (base 7) in base 10? -4 What is 0 (base 6) in base 11? 0 What is -2a (base 16) in base 7? -60 What is 14 (base 8) in base 2? 1100 -12 (base 10) to base 16 -c What is 37 (base 15) in base 2? 110100 Convert -10 (base 3) to base 9. -3 Convert 311 (base 5) to base 16. 51 What is 23 (base 11) in base 4? 121 Convert 50 (base 6) to base 3. 1010 8c (base 14) to base 16 7c -20212 (base 3) to base 9 -225 What is 3 (base 14) in base 6? 3 What is 2032 (base 4) in base 16? 8e What is -11 (base 4) in base 13? -5 -4 (base 16) to base 7 -4 124 (base 6) to base 16 34 What is -13 (base 6) in base 12? -9 -51 (base 13) to base 6 -150 Convert -3 (base 12) to base 13. -3 Convert 21 (base 10) to base 12. 19 What is 272 (base 9) in base 2? 11100011 130 (base 5) to base 11 37 -2 (base 4) to base 9 -2 -1 (base 10) to base 5 -1 What is 7 (base 14) in base 10? 7 1 (base 7) to base 16 1 0 (base 7) to base 13 0 Convert -34 (base 10) to base 5. -114 Convert 2 (base 7) to base 9. 2 -12 (base 4) to base 16 -6 -100 (base 2) to base 14 -4 -1110 (base 2) to base 16 -e Convert -1b (base 16) to base 2. -11011 What is 324 (base 5) in base 4? 1121 -2 (base 3) to base 6 -2 16 (base 9) to base 15 10 -6 (base 11) to base 12 -6 What is -3 (base 5) in base 8? -3 -1120 (base 3) to base 16 -2a -1 (base 5) to base 11 -1 Convert 2a (base 16) to base 11. 39 10 (base 4) to base 14 4 Convert -23 (base 5) to base 4. -31 2 (base 15) to base 7 2 What is 5 (base 16) in base 11? 5 -13 (base 11) to base 4 -32 Convert -3 (base 5) to base 13. -3 -46 (base 8) to base 12 -32 What is -13 (base 9) in base 5? -22 52 (base 6) to base 4 200 Convert -41 (base 14) to base 3. -2010 Convert 18b (base 12) to base 14. 13d What is -11 (base 2) in base 3? -10 What is -2 (base 5) in base 16? -2 43 (base 14) to base 10 59 What is -5 (base 8) in base 3? -12 2 (base 6) to base 12 2 What is -101010 (base 2) in base 11? -39 6 (base 7) to base 10 6 -c1 (base 15) to base 10 -181 24 (base 11) to base 14 1c What is 6 (base 11) in base 12? 6 Convert -47 (base 8) to base 12. -33 What is -1 (base 16) in base 13? -1 What is -201 (base 6) in base 11? -67 What is -4 (base 8) in base 2? -100 3 (base 9) to base 10 3 1b (base 12) to base 4 113 What is 30 (base 16) in base 10? 48 What is -105 (base 10) in base 11? -96 Convert 3a (base 15) to base 8. 67 0 (base 4) to base 2 0 0 (base 7) to base 14 0 122 (base 3) to base 4 101 -8 (base 13) to base 2 -1000 What is 0 (base 12) in base 9? 0 -1a (base 12) to base 10 -22 Convert -1 (base 14) to base 16. -1 What is 26 (base 7) in base 3? 202 Convert 7 (base 11) to base 13. 7 What is 3 (base 14) in base 3? 10 -3 (base 10) to base 4 -3 -1110 (base 2) to base 15 -e -8 (base 12) to base 6 -12 Convert 5 (base 7) to base 11. 5 What is 0 (base 3) in base 2? 0 4 (base 9) to base 13 4 What is -18 (base 15) in base 12? -1b Convert -2 (base 7) to base 15. -2 What is -111 (base 2) in base 5? -12 What is -505 (base 6) in base 15? -c5 -10 (base 8) to base 5 -13 Convert 175 (base 8) to base 4. 1331 What is -240 (base 6) in base 2? -1100000 What is 111 (base 2) in base 9? 7 Convert 363 (base 8) to base 2. 11110011 2 (base 10) to base 7 2 Convert -15 (base 10) to base 13. -12 Convert -a (base 15) to base 7. -13 Convert -4 (base 15) to base 13. -4 Convert 0 (base 5) to base 9. 0 What is -18 (base 15) in base 3? -212 Convert 3 (base 4) to base 7. 3 What is 10000 (base 2) in base 16? 10 What is -47 (base 9) in base 14? -31 What is -20 (base 3) in base 2? -110 What is -5 (base 6) in base 15? -5 Convert 3013 (base 4) to base 3. 21101 Convert 13 (base 4) to base 7. 10 Convert 5 (base 15) to base 8. 5 What is -13 (base 15) in base 9? -20 Convert 210 (base 4) to base 3. 1100 What is -12 (base 6) in base 4? -20 What is -1 (base 2) in base 6? -1 1 (base 14) to base 2 1 -2 (base 8) to base 3 -2 What is 3 (base 8) in base 5? 3 What is -3 (base 15) in base 6? -3 Convert 341 (base 6) to base 4. 2011 Convert -4 (base 6) to base 4. -10 Convert 1000010 (base 2) to base 13. 51 -b9 (base 16) to base 13 -113 What is 100011101 (base 2) in base 11? 23a 2 (base 4) to base 13 2 Convert 24 (base 13) to base 2. 11110 -3 (base 9) to base 5 -3 -1 (base 7) to base 5 -1 Convert -7 (base 14) to base 5. -12 12 (base 7) to base 10 9 Convert -4 (base 9) to base 3. -11 12 (base 7) to base 11 9 Convert -35 (base 14) to base 2. -101111 What is -26 (base 12) in base 16? -1e What is 23 (base 5) in base 12? 11 -15 (base 10) to base 13 -12 What is -1 (base 12) in base 5? -1 What is 410 (base 6) in base 14? aa 37 (base 8) to base 5 111 -16 (base 11) to base 8 -21 -4 (base 15) to base 3 -11 What is -42 (base 14) in base 7? -112 Convert 39 (base 12) to base 4. 231 What is -11 (base 11) in base 16? -c -10 (base 4) to base 16 -4 What is -51 (base 6) in base 5? -111 What is -6 (base 11) in base 13? -6 b (base 15) to base 12 b 1 (base 8) to base 12 1 What is 22 (base 12) in base 10? 26 Convert -5 (base 14) to base 11. -5 3 (base 15) to base 14 3 Convert 1 (base 13) to base 11. 1 Convert 67 (base 8) to base 7. 106 What is 19 (base 15) in base 11? 22 -1212 (base 5) to base 4 -2312 Convert 10001 (base 2) to base 13. 14 Convert 111 (base 2) to base 4. 13 Convert -14 (base 10) to base 16. -e What is -1 (base 6) in base 12? -1 Convert 146 (base 8) to base 16. 66 What is 1010 (base 2) in base 8? 12 What is -10 (base 3) in base 15? -3 What is 161 (base 9) in base 6? 344 What is 43 (base 16) in base 8? 103 Convert 10 (base 10) to base 5. 20 What is -351 (base 8) in base 15? -108 -37 (base 11) to base 15 -2a 11021 (base 3) to base 10 115 What is 2 (base 8) in base 15? 2 Convert 4 (base 12) to base 13. 4 What is 5 (base 14) in base 2? 101 Convert -316 (base 7) to base 8. -240 Convert -13 (base 16) to base 8. -23 -20211 (base 3) to ba	{ "pile_set_name": "DM Mathematics" }
om {b: 4, i: 3, e: 2, h: 1}? 1/45 Calculate prob of sequence tata when four letters picked without replacement from taat. 1/6 Calculate prob of sequence ye when two letters picked without replacement from eyyyyeeeeeeeyeyyyye. 5/19 What is prob of sequence lll when three letters picked without replacement from lsllllslllsllsllllls? 91/228 Two letters picked without replacement from {z: 1, n: 1, u: 1}. What is prob of sequence un? 1/6 Three letters picked without replacement from cyllljclluycclc. What is prob of sequence lly? 2/91 Three letters picked without replacement from qgjjxkjqsjjjjjkkjs. Give prob of sequence jgs. 1/272 Four letters picked without replacement from yjjyyyjyyyyjyjyjyyj. Give prob of sequence jyjy. 77/1292 Two letters picked without replacement from {j: 1, n: 4, u: 1, x: 1, f: 5, p: 3}. What is prob of sequence pu? 1/70 Calculate prob of sequence fu when two letters picked without replacement from rvrvfrrvuuunu. 1/39 Two letters picked without replacement from {s: 5, f: 5, a: 2, v: 3, e: 4}. Give prob of sequence av. 1/57 What is prob of sequence yhhg when four letters picked without replacement from {h: 2, g: 1, m: 9, y: 1}? 1/8580 What is prob of sequence vxix when four letters picked without replacement from xiviivxvxixvvv? 12/1001 Two letters picked without replacement from yyyoyyyyyyo. Give prob of sequence yo. 9/55 Calculate prob of sequence jjjj when four letters picked without replacement from {x: 1, j: 12}. 9/13 Four letters picked without replacement from bkhjzzjzkjo. What is prob of sequence kkjh? 1/1320 Four letters picked without replacement from fwffvvvfffwvfffvfv. Give prob of sequence fffv. 1/17 What is prob of sequence lpls when four letters picked without replacement from spssllsl? 1/70 Two letters picked without replacement from rixxi. Give prob of sequence ii. 1/10 Two letters picked without replacement from jjjjjjjujjjjjujjjj. What is prob of sequence jj? 40/51 Four letters picked without replacement from {q: 6, j: 1, i: 1, p: 8, l: 4}. Give prob of sequence pqli. 8/4845 Four letters picked without replacement from {k: 1, g: 2, y: 4, o: 1, b: 2}. What is prob of sequence bkgo? 1/1260 Calculate prob of sequence vooo when four letters picked without replacement from {v: 1, o: 4, w: 2, m: 1}. 1/70 Three letters picked without replacement from etijxeieeotoiit. Give prob of sequence eje. 2/455 Three letters picked without replacement from {i: 3, w: 8}. What is prob of sequence wwi? 28/165 What is prob of sequence wk when two letters picked without replacement from {c: 4, h: 7, w: 3, r: 2, k: 2}? 1/51 Two letters picked without replacement from bcsgj. Give prob of sequence cg. 1/20 Calculate prob of sequence ae when two letters picked without replacement from feraf. 1/20 Three letters picked without replacement from {i: 2, f: 1, h: 1}. What is prob of sequence fii? 1/12 Two letters picked without replacement from {k: 4, v: 7, w: 3}. Give prob of sequence vk. 2/13 Four letters picked without replacement from {w: 12, u: 7}. What is prob of sequence uwwu? 77/1292 Two letters picked without replacement from frfffvmmdfdmmnnmdnm. What is prob of sequence nm? 1/19 Three letters picked without replacement from {i: 1, w: 4, z: 2, b: 10}. Give prob of sequence zwi. 1/510 What is prob of sequence fmp when three letters picked without replacement from {i: 2, p: 1, f: 2, m: 9}? 3/364 Two letters picked without replacement from bibgwigubuuuigx. What is prob of sequence ug? 2/35 Three letters picked without replacement from {j: 2, s: 2}. What is prob of sequence ssj? 1/6 What is prob of sequence jj when two letters picked without replacement from jcj? 1/3 Calculate prob of sequence hz when two letters picked without replacement from {z: 1, b: 1, q: 2, n: 1, p: 1, h: 1}. 1/42 Calculate prob of sequence tqqt when four letters picked without replacement from {q: 3, t: 2, n: 1, l: 1}. 1/70 Four letters picked without replacement from ysyyeghsgrg. Give prob of sequence yryy. 1/1320 What is prob of sequence gq when two letters picked without replacement from grrqqlrqgqrgrgqrq? 3/34 What is prob of sequence hzg when three letters picked without replacement from {z: 2, h: 4, g: 3}? 1/21 What is prob of sequence qaq when three letters picked without replacement from {a: 5, q: 7, x: 1}? 35/286 What is prob of sequence rr when two letters picked without replacement from rddrdd? 1/15 Three letters picked without replacement from {v: 3, z: 1}. What is prob of sequence vvv? 1/4 What is prob of sequence fj when two letters picked without replacement from {b: 5, e: 5, x: 4, j: 1, f: 1}? 1/240 Calculate prob of sequence rtrt when four letters picked without replacement from {r: 13, t: 5}. 13/306 Three letters picked without replacement from {l: 5, m: 2}. Give prob of sequence lll. 2/7 Two letters picked without replacement from {v: 1, o: 1, r: 9, g: 7}. What is prob of sequence gg? 7/51 Four letters picked without replacement from txwfvxxtxfwwxbxxw. What is prob of sequence xfwb? 1/1020 What is prob of sequence cdu when three letters picked without replacement from {c: 4, d: 2, e: 2, u: 4}? 4/165 What is prob of sequence kkvv when four letters picked without replacement from vkvvxvpxxxxxpxxxxkx? 1/3876 Two letters picked without replacement from ddwzddwdwwwdwzdwwdd. What is prob of sequence zz? 1/171 Calculate prob of sequence hh when two letters picked without replacement from hhhhhhh. 1 What is prob of sequence xc when two letters picked without replacement from {x: 4, s: 2, c: 2}? 1/7 Three letters picked without replacement from vvcvcccvchvvchv. What is prob of sequence vvh? 2/65 What is prob of sequence rrdi when four letters picked without replacement from {x: 1, i: 1, r: 4, d: 2, u: 3, m: 7}? 1/3060 Calculate prob of sequence tkx when three letters picked without replacement from {t: 3, p: 1, h: 3, y: 4, k: 6, x: 1}. 1/272 Calculate prob of sequence ddd when three letters picked without replacement from ddudddduddd. 28/55 What is prob of sequence mh when two letters picked without replacement from hmmfh? 1/5 What is prob of sequence qpbv when four letters picked without replacement from fvzqbvpp? 1/420 Calculate prob of sequence ww when two letters picked without replacement from jjwwwwwjwww. 28/55 What is prob of sequence vv when two letters picked without replacement from bbvvbv? 1/5 What is prob of sequence ssm when three letters picked without replacement from {m: 4, s: 3}? 4/35 Three letters picked without replacement from {p: 9}. What is prob of sequence ppp? 1 What is prob of sequence pbbb when four letters picked without replacement from {b: 17, p: 1}? 1/18 What is prob of sequence gb when two letters picked without replacement from {b: 2, u: 1, s: 2, g: 2, f: 1}? 1/14 What is prob of sequence shhh when four letters picked without replacement from {w: 1, y: 2, h: 6, s: 4}? 4/143 Calculate prob of sequence idwi when four letters picked without replacement from {w: 4, p: 4, d: 4, i: 2}. 4/3003 Four letters picked without replacement from jxjxjxjxjjxxjcj. Give prob of sequence xjjc. 2/195 What is prob of sequence uub when three letters picked without replacement from ssbsusssbpspbusspbs? 4/2907 Four letters picked without replacement from {l: 12, b: 6}. What is prob of sequence bblb? 1/51 What is prob of sequence mgg when three letters picked without replacement from {m: 15, g: 3}? 5/272 Four letters picked without replacement from ggwqqwqwqgqgg. Give prob of sequence wgww. 1/572 Calculate prob of sequence ft when two letters picked without replacement from ytsatffu. 1/14 What is prob of sequence fyyw when four letters picked without replacement from {y: 5, f: 1, w: 3, d: 3}? 1/198 Two letters picked without replacement from kfhvhkz. Give prob of sequence zk. 1/21 Calculate prob of sequence qlq when three letters picked without replacement from {q: 7, l: 1}. 1/8 What is prob of sequence joeo when four letters picked without replacement from {q: 1, j: 3, x: 1, b: 4, e: 6, o: 3}? 1/680 What is prob of sequence ji when two letters picked without replacement from {v: 4, j: 2, i: 1, k: 6, q: 3}? 1/120 Three letters picked without replacement from xxmx. Give prob of sequence mxx. 1/4 Calculate prob of sequence jew when three lett	{ "pile_set_name": "DM Mathematics" }
k). 539k3 - 3k*2 - k + 1 Let h(v) = -164265v*2 - 235v - 2115. Let t(y) = 2106y2 + 3y + 27. What is -3h(q) - 235t(q)? -2115q2 Let s(n) = -588152n*2 + 444n - 444. Let a(r) = 13217r2 - 10r + 10. Determine 222a(q) + 5s(q). -6586q2 Let c(m) = -54m - 482. Let g(p) = -52p. Give c(w) - g(w). -2w - 482 Let i(m) = -2182m + 4. Let c(b) = -716b + 1. Give -14c(w) + 5i(w). -886w + 6 Let n(f) = f2 - 6f - 10. Suppose -798d + 808d = -60. Let t(z) be the first derivative of -z*2/2 - z + 5. Give dt(r) + n(r). r*2 - 4 Let y(z) = 100z + 87. Let k(u) = 14u + 12. Let d(p) = 15k(p) - 2y(p). Let s(l) = l + 1. Give -2d(c) + 22s(c). 2c + 10 Let o(x) = -2x2 + 5x + 5. Let s(a) = -3a2 + 29a - 132. Let z(h) = -9h2 + 83h - 373. Let w(u) = 17s(u) - 6z(u). What is 4o(v) + 3w(v)? v*2 + 5v + 2 Let m(o) = -4o - 6. Let a(k) = 6k - 17. Let i be a(8). Suppose 2s - n - 9 = 0, -30s + is = n + 4. Let x(f) = -4f - 5. Determine sx(b) - 4m(b). -4b - 1 Let n(b) = -6b*2 + 6b - 3. Let z(i) = i*2 - i. Let q(v) = 2v*2 - 70v + 601. Let f be q(20). What is fn(t) + 5z(t)? -t*2 + t - 3 Let a(w) = -4w*3 + 41w*2 + 7. Let m(n) = 5n*3 - 40n*2 - 9. What is -3a(y) - 2m(y)? 2y*3 - 43y*2 - 3 Let z(i) = -i - 3. Let w be z(-4). Let c(x) = -x - 12. Let n(g) = 4g + 42. Let y(q) = 7c(q) + 2n(q). Let k(v) = -4v. Give wk(r) + 6y(r). 2r Let r(q) = -28q3 + 20q*2 + 20. Let l be (16/240 - 2/(-6))5. Let k(y) = 3 + ly3 - 6y*3 - 26y*2 + 29y*2. Determine 20k(i) - 3r(i). 4i*3 Let g(r) = 35r*2 + 5r + 5. Let m(j) = -36j2 - 6j - 6. Suppose 1840 = 9c + 1795. Calculate cm(v) + 6g(v). 30v*2 Let b(m) = 16m*2 - 10m - 10. Let f(q) be the first derivative of 5q3/3 - 3q*2/2 - 3q + 377. Let r be (45/(-12))/((-6)/(-16)). Give rf(x) + 3b(x). -2x2 Let r(l) = l - 11226. Let u(v) = -v + 11228. Determine -5r(p) - 4u(p). -p + 11218 Let z(j) = -j3 - j2 + 1. Let f = -253 + 255. Suppose 4r = -2g - 90, 3g = -5 + f. Let t(l) = 11l3 + 22l*2 - 22. What is rz(h) - t(h)? 11h3 Let f(z) = -27z - 9z + 41z - 56z. Let b(w) = 943w. Calculate -5b(h) - 92f(h). -23h Let s(j) = -j + 15. Let t(n) = -5. Let r(m) = 6s(m) + 17t(m). Let i(h) be the first derivative of -h2/2 - h + 300620. Determine -5i(k) + r(k). -k + 10 Let h(c) = -6c3 + 7c*2 + 6c + 6. Let y(g) = -9g3 + 11g*2 + 9g + 7. Determine 8h(n) - 5y(n). -3n3 + n2 + 3n + 13 Let c = 62 + -37. Suppose 6 = -31t + ct. Let l(r) = r - 1. Let s(b) = 3b - 1. Determine ts(i) + 4l(i). i - 3 Let z(r) = -r2 + r - 1. Let n(h) = -2h*2 - 7h + 195. Calculate n(s) + 6z(s). -8s*2 - s + 189 Let s(c) = 232c + 231. Let n be s(-1). Let k(x) = -6x3 - 3x*2 + 4x - 3. Let h(m) = -m3 - m2 + m - 1. What is nk(l) + 3h(l)? 3l3 - l Let j(f) = 7f + 1372. Let w(n) = 2n - 2. Determine -j(k) + 3w(k). -k - 1378 Let d(j) = j + 1. Let o(y) = y - 20 - 20 - 26 - 28 + 79. What is 3d(n) - o(n)? 2n + 18 Let v(u) be the third derivative of -u5/60 + u4/4 - u*3/3 + 42367u2. Suppose 0 = -o - 3. Let j(c) = -c2 + 7c - 2. Calculate ov(z) + 2j(z). z2 - 4z + 2 Let l(n) = 442n - 9. Let m(p) = 876p - 20. What is 7l(x) - 3m(x)? 466x - 3 Let f(a) = 10 - 12a + 4a + 7. Let i(g) = 3 + 12 - 2g + 4 - 15. Let p = 245 - 236. Give pi(q) - 2f(q). -2q + 2 Let d(p) = -140p + 20. Let q(v) be the third derivative of -5v4/6 + v3/2 + 1230v*2. Give 3d(n) - 20q(n). -20n Let d(s) = -48s + 127. Let p(a) = -31a + 84. Determine 5d(o) - 8p(o). 8o - 37 Let g = -863 + 864. Let v(y) = 1. Let p(d) = -18d*2 + 5. Give gp(l) - 5v(l). -18l*2 Suppose -10u - u = -11. Let l(q) = -2q - 7. Let h(k) = 11k + 16. Let n(r) = 9r + 13. Let v(b) = 4h(b) - 5n(b). Let m = 5 - 9. Give mv(a) + ul(a). 2a - 3 Let s(g) = 3g + 5. Let v be -7 + 15 + 4 + (-28)/4. Let j(p) = 8p + 12. What is vj(y) - 12s(y)? 4y Let i(q) = 48q + 7. Suppose 140 = -7u + 7u + 28u. Let y(f) = 24f + 3. What is uy(t) - 2i(t)? 24t + 1 Let t(x) be the first derivative of x3/3 - 7x - 10. Let q(j) = j + 1. Let v be q(-6). Let d = 324 - 317. Let l(a) = a*2 - 5. What is dl(k) + vt(k)? 2k*2 Let a(j) = -75j*2 - 9j + 3. Let h(g) = -758g2 - 92g + 30. What is -21a(d) + 2h(d)? 59d2 + 5d - 3 Let b(l) = 2l2 + 4l + 8. Let o(n) be the first derivative of 2n3 + 11n*2/2 + 24n + 765. What is -11b(i) + 4o(i)? 2i2 + 8 Let l(o) = -o2 - 24o. Let w(t) = 152t + 4. What is -8l(y) - w(y)? 8y2 + 40y - 4 Let i(j) = 2j2 + 12j - 3. Let u(h) be the first derivative of -h*3/3 + h + 1167. Give i(z) + 4u(z). -2z2 + 12z + 1 Let q(y) = -16y2 - 6 + 6. Let l(n) = -4n + 150. Let o be l(38). Let m be -4 + -20o/(-1 + 5). Let d(f) = 3f*2. Calculate mq(k) + 33d(k). 3k*2 Let o(w) = 38w*2 + 2w + 2. Let x(c) = 260c - 95 - 268c*2 - 355c - 819c2 - 699c*2. Give -95o(g) - 2x(g). -38g*2 Suppose -4k + 37 - 5 = 0. Let z(r) = -14r + r - 2 + 7 - k. Let j(b) = 8b - 1. Let u(h) = 25h - 4. Let g(l) = 7j(l) - 2u(l). Give 7g(f) + 3z(f). 3f - 2 Let u(w) = 8w + 482. Let n(f) = -f - 39. Determine -9n(v) - u(v). v - 131 Let q(x) = x + 8. Let s(f) = -1241f - 20. Determine 2q(v) + s(v). -1239v - 4 Let t(b) = -17b + 3316. Let s(v) = 25v - 3301. Determine -2s(n) - 3t(n). n - 3346 Let b(m) = 29m + 2. Let l = 528 + -524. Let i(y) = 30y + 3. What is lb(f) - 3i(f)? 26f - 1 Let t(d) = -25d + 25. Let h(i) be the second derivative of i2/2 + 882i. What is -25h(q) + t(q)? -25q Let w(y) = 12y3 - 3y*2 + 4y + 15. Let b(t) = -10t3 + 3t*2 - 5t - 20. What is -3b(o) - 4w(o)? -18o3 + 3o*2 - o Let u(w) = w + 7. Let k(p) = 1. Let t(c) = -4k(c) + u(c). Let o(i) = -2i - 3. Let r be (-207)/(-69)90/54. Give rt(m) + 4o(m). -3m + 3 Let b(c) = -c2 - 4c + 1. Let o(i) = 33i2 + 14i - 4. Determine -3b(d) - o(d). -30d*2 - 2d + 1 Let l(g) = -g*2 - g + 21. Let p(w) = 8w*2 + 6w - 168. Give -5l(h) - p(h). -3h*2 - h + 63 Let j(f) = 17f*3 + 17f*2 + 898. Let l(n) = -20n*3 - 20n*2 - 898. Calculate -6j(i) - 5l(i). -2i*3 - 2i*2 - 898 Let z(s) = -14s*3 - 45s. Let c(m) = 86m3 - m2 + 272m - 1. Calculate -2c(t) - 13z(t). 10t3 + 2t*2 + 41t + 2 Suppose 6 = 2w + 2. Let m(k) = -6k + 0k - 2k + kw + 14 - 6. Let b(r) be the first derivative of r3/3 - 9r2/2 + 9r + 366. Give 6b(a) - 7m(a). -a*2 + 2a - 2 Let z(g) = -42g - 2. Let r(w) = 43w + 2. Suppose -2p = -3x + 31, -4p = 83x - 80x - 1. What is pz(h) - 6r(h)? -48h - 2 Let s(u) = -u*2 + u. Suppose -16 = -2b - 2n, -35b = -34b - n. Let c(v) = v2 + 3v + 2. Determine bs(q) - c(q). -5q*2 + q - 2 Let z(v) = -56v - 16. Let r(i) = 67i + 19. Let j(k) = -5r(k) - 6z(k). Let f(y) = -3y - 5. Give -f(a) - 4j(a). -a + 1 Let h(g) = -5g + 1. Let u(n) be the third derivative of 5n4/12 - n3/3 - 2342n*2. Give 5h(r) + 3u(r). 5r - 1 Let x(s) = 53s2 + 6s. Let j(l) = 2056l2 + 223l - 6. Let v(h) = 563342h2 + 61100h - 1645. Let f(q) = 1645j(q) - 6v(q). Calculate 6f(a) - 235x(a). -47a2 Let h(s) be the first derivative of -10s*3/3 + 2s*2 - 10s - 103. Let k(r) = 3r2 - r + 3. Determine 2h(z) + 7k(z). z2 + z + 1 Let h(v) = 5v*3 + 14v + 6. Let c(t) = 6t3 + 15t + 7. Let n be -1 + 1 + (-1902)/(-270) + 22/(-495). Determine nh(l) - 6c(l). -l*3 + 8l Suppose -73y = -2t - 78y - 1, 0 = 5t - y - 11. Let j(z) = -31z - 2. Let h(p) = 125p + 9. Determine th(i) + 9j(i). -29i Let i(k) = -7k*2 + 9k - 19. Let j(r) = 5r2 - 11r + 23. Determine 5i(n) + 4j(n). -15n2 + n - 3 Suppose -7w = -13w + 24. Let l(d) = -wd*2 - 2d + 5d2 + 3d + 1 + 0d. Let m(t) = -3t*2 - 5t - 9. Calculate 5l(u) + m(u). 2u*2 - 4 Let t(q) = -5q + 8. Let w(i) be the third derivative of -i*4/4 + 7i*3/6 + 2i*2 + 35i + 18. Determine 5t(o) - 4w(o). -o + 12 Let l(o) = 11o2 + 7o. Suppose -4h + 0w - 2w = 26, h + 19 = 2w. Suppose b + 33 = 38. Let f(g) = -2g + 0g + bg2 + 5g. Calculate hf(q) + 4l(q). -q2 + q Let m(r) = -r3 + r*2 + r. Let i(y) = -3y*3 - 48y*2 + 2y + 32. Let d(p) = -p*3 - 16p*2 + p + 12. Let o(t) = 8d(t) - 3i(t). Determine 2m	{ "pile_set_name": "DM Mathematics" }
er when 10 + (2 - 1) + u is divided by (-16)/(-168)3512/5? 2 Suppose -4r = 2j - 126, 27j + 75 = 3r + 22j. Suppose -p + 5 = 13. Let o = p + r. What is the remainder when o is divided by 9? 4 Calculate the remainder when ((-844)/(-5))/((-3440)/575 - -6) is divided by 17. 16 Let n = -173 + 170. Calculate the remainder when ((-1)/n)/((-6)/1980-2) is divided by 20. 15 Suppose -5b + 2k = -335, 3k - 10 = -25. Calculate the remainder when 242 is divided by b. 47 Let q = -1790 - -1795. Calculate the remainder when 467 is divided by q. 2 What is the remainder when 978 is divided by -93 + 572 - (2 + (-10 - -1))? 6 Let b(l) = 8l*3 - 6l*2 + l + 5. Suppose 68m - 43m - 325 = 0. Calculate the remainder when b(4) is divided by m. 9 Let i(z) = 2z*2 + 13z - 6. Let k(w) = w*2 + 13w - 5. Let j(s) = -2i(s) + 3k(s). What is the remainder when 116 is divided by j(6)? 38 Suppose -365s = -35635 - 6705. Calculate the remainder when 923 is divided by s. 111 Suppose 53 = q - 3m, -119m = -q - 121m + 38. Let v(g) = 10g2 + 6g - 10. What is the remainder when v(-7) is divided by q? 42 Let w(n) be the third derivative of 1/8n4 - 3/10n*5 - 18n*2 + 1/120n*6 - 19/6n*3 + 0 + 0n. Calculate the remainder when 171 is divided by w(18). 31 Let o(l) = l*2 + 23l + 94. Let i be o(21). Let y = -443 + i. What is the remainder when y is divided by 72? 71 Let o = 259 - 139. Suppose -19n = 5n - o. What is the remainder when n is divided by 3? 2 Suppose 0 = -4j - 0j. Let a(o) = -23o + 140. Let z be a(6). Suppose zc + m + 0m - 22 = j, -c + 16 = -2m. Calculate the remainder when 35 is divided by c. 11 Let l be (38/18)/((-6)/(-81)). Suppose -19m + lm + 37 = 0. Let b = -84 - -231. Calculate the remainder when b is divided by m. 36 Let w(l) = l2 + 14l + 4. Let h be w(-14). Suppose hj - 6200 = -16j. Calculate the remainder when j is divided by 109. 92 Let y = -4974 + 5202. Calculate the remainder when 862 is divided by y. 178 Let d be ((-15)/2)/((-3)/(-16 + 4)). Let k = d - -49. Suppose -2a - 30 = 4b - 88, -51 = -3b - 3a. Calculate the remainder when k is divided by b. 7 Suppose -3z - 10 = -55. Let b = 2388 + -2387. Suppose -z = -2p - 4c - c, -p + b = -4c. Calculate the remainder when 19 is divided by p. 4 Suppose -15x + 1852 - 2 = -5x. Calculate the remainder when x is divided by 22. 9 Suppose -3d = 3h + 2d - 54, -5h + 130 = -5d. What is the remainder when 480/(2 - -1) - 2 is divided by h? 20 Suppose 2v - 5n = -79, v - 3n = -3v - 193. Let b = v - -57. Suppose 0 = -z + bz - 44. Calculate the remainder when 41 is divided by z. 8 Let s(k) = -k*2 - 10k - 16. Let i be s(-5). What is the remainder when i/(-10 + 1) + 43 is divided by 42? 0 Let v(y) = 3y3 - 16y*2 - 10y - 2. Let k(r) = r*2 + 6. Let z be k(0). What is the remainder when 33 is divided by v(z)? 3 Calculate the remainder when ((-920)/(-80) + -13)82/(-3) is divided by 31. 10 Suppose -4a + 1405 = 3x, -a + x = -3x - 375. What is the remainder when a is divided by 16? 3 Suppose -2 = 4s + 4c - 18, 4c = s - 24. Suppose 0 = sw - 9w - 254. Let t = -157 - w. Calculate the remainder when t is divided by 20. 17 Let x be (2 - (-90)/(-25))-53. What is the remainder when 7/(196/x)(33 + 2) is divided by 8? 6 Let p(m) = m2 - 152m - 734. Let y(q) = -3q3 - 7q*2 - q - 2. What is the remainder when y(-5) is divided by p(-5)? 50 Suppose -u + 54 = y - 23, 0 = 5y - 4u - 385. Suppose -y = -f - 34. What is the remainder when 84 is divided by f? 41 Let k be 64/(-6)21/(-2). Let o = 2031 + -1993. What is the remainder when o is divided by ((k - 0)/(-4))/(-2)? 10 Calculate the remainder when 1254 is divided by ((-42)/77)/(18/(-132)). 2 Suppose 4z + 795 = 5t, -4z = t + 91 - 250. Let b = -49 - -103. What is the remainder when t is divided by b? 51 Let f(s) = -60s*3 + 4s*2 - 2s - 2. What is the remainder when f(-1) is divided by 9-1(-5 + 3)? 10 What is the remainder when ((-12)/(-4) + -2)/(6/(38832 + 12)) is divided by 1293? 9 Suppose -3s = j - 169, -340 = -2j - 39s + 32s. Calculate the remainder when 801 is divided by j. 149 Let i(n) = -n*3 + 243n*2 + 240n + 1053. Calculate the remainder when 1307 - 0/1 is divided by i(244). 76 Let b(n) = 43n*2 - 7n + 4. Let i be -2 - 1 - (-8 + 3). Calculate the remainder when b(i) is divided by 41. 39 Let k = -66 - -36. Suppose c + 2c = -3r + 105, -2r + 178 = 5c. Let g = c + k. Calculate the remainder when g is divided by 2. 0 Let h(j) = -3j + 2. What is the remainder when -8 - (31 + 1540/(-50) + 2471/(-5)) is divided by h(-2)? 6 Let p = 28 - 28. Calculate the remainder when 53 is divided by -24 + 26 + -1(-7 - p). 8 Let o = 7058 - -222. Calculate the remainder when o is divided by 560. 0 What is the remainder when 616 + (-23)/1155 is divided by 91? 1 Suppose 5y + 65584 = o, -302627 = -5o - y + 25189. Calculate the remainder when (-2)/13 + o/962 is divided by 9 + 1 - (0 - 0). 8 Let z = 293 - 124. Suppose 5n + l = 1421, -3l - 413 - z = -2n. What is the remainder when n is divided by 32? 29 Suppose -4o = -5z - 55, 0z - 3o = 2z + 22. Let l(k) = k*2 + 14k + 62. Calculate the remainder when 608 is divided by l(z). 28 Suppose -c - 783 = 5k - 871, -5c - k + 176 = 0. Suppose 0 = -0f + 4f - 1968. Calculate the remainder when f is divided by c. 30 Suppose 5d + 352 = 32. Let m = d - -46. What is the remainder when (m/(-24))/((-3)/(-144)) is divided by 10? 6 Suppose -7l = -4l + 288. Let z = 103 + l. What is the remainder when 40 is divided by z? 5 Let m be ((-24)/(-20))/(12/20). Suppose -322 = -5l + mt - 1, 5l = 5t + 330. Calculate the remainder when l is divided by 17. 12 Let y be (51 - 51)(1 + -2). Suppose -52 = -4j + 5l, -5j - 2l - l + 28 = y. What is the remainder when 86 is divided by j? 6 Suppose 6t = 13 + 59. Suppose 0 = 8z - 3z - 80. Calculate the remainder when (158 + 0)t/24 is divided by z. 15 Let m(u) = 41 + 6u2 + 11u + 26u + 6. What is the remainder when 114 is divided by m(-6)? 32 What is the remainder when 685 is divided by (-518)/2331 + 3766/18? 58 Suppose 24 = 4z - 2z. Calculate the remainder when (308/(-231) - (-2)/3)-66 is divided by z. 8 Let j = -5794 + 5945. What is the remainder when j is divided by 116? 35 Calculate the remainder when 6/(-27) - ((-6 - -1) + 70547/(-711)) is divided by (15/4)/(2/8). 14 Let m = -16 + 86. Suppose 2h - 79 = 5p, 2h - 38 = h + p. Let o = h + -18. What is the remainder when m is divided by o? 13 Let p(z) = -z2 + 7z + 10. Let x(f) = 5f - 98. Let q be x(21). Calculate the remainder when 21 is divided by p(q). 1 Suppose 2b + 3w + 6 = 5w, 5b - 4w = -10. Suppose -b = z + 4r - 64, -2z - r + 89 = 0. What is the remainder when 375 is divided by z? 39 Suppose 4t + x - 3x - 10 = 0, 3x = -3. Let p(n) = -12n*t + 3n*3 + n - 3n + 2n - 2 + 4n. What is the remainder when p(5) is divided by 19? 17 Let p = 4952 + -4932. Calculate the remainder when 1032 is divided by p. 12 Let y(p) = 2p3 + 34p*2 + 27p - 33. Let b be (-56)/(-35)3/(12/(-40)). What is the remainder when y(b) is divided by 16? 15 Calculate the remainder when 121841/17 + 2 + -1318/1989 is divided by 163. 160 Suppose 6137 = 65l - 1728. Calculate the remainder when l is divided by 47. 27 Let k(m) = 5m*3 + 191m*2 + 37m + 28. Suppose -230 = -5z - 2n, 0 = 4z - 3n + 6n - 191. Calculate the remainder when k(-38) is divided by z. 22 Let k(r) = -496r - 2644. Calculate the remainder when k(-8) is divided by 78. 76 Let v = -4 + -19. Let m = 41 + v. Suppose -my + 15y + 36 = 0. Calculate the remainder when 56 is divided by y. 8 Let c = -100 - -170. Let i = -148 + 199. Calculate the remainder when c is divided by -4(i/12-2 + 4). 16 Let f be (-680)/32 + 3/12. What is the remainder when 67 is divided by ((-28)/f)/((-4)/(-69))? 21 Suppose 0 = -5z + 67p - 70p + 12, -5z - 5p + 20 = 0. Suppose z = -w + 1, -25a - 64 = -27a - 4w. What is the remainder when a is divided by 9? 3 Let v(s) = -2s + 5. Let l(f) = f - 3. Let x(d) = 10l(d) + 6v(d). Suppose -13 = -6g - 103. What is the remainder when 118 is divided by x(g)? 28 Suppose d = 3d - 14. Calculate the remainder when 41 is divided by 99/d + (45/(-21) - -2). 13 Suppose -15 = 5z, -4u + 4	{ "pile_set_name": "DM Mathematics" }
64 + -3? -1034267 In base 11, what is -62 - -790a42? 790990 In base 5, what is 1034241141 - 14? 1034241122 In base 12, what is 156 + -15952? -157b8 In base 9, what is 42305 + 73? 42378 In base 13, what is 4504 - b1? 4423 In base 8, what is 4 - -4443532? 4443536 In base 2, what is 101 - 101011101111010011011100111? -101011101111010011011100010 In base 11, what is 1228 - 15170? -13a43 In base 8, what is 2026 - 143311? -141263 In base 16, what is -3893c - -3? -38939 In base 8, what is -657757065 - 1? -657757066 In base 3, what is 202022222202 + 202? 202100000111 In base 10, what is 349 - -28895? 29244 In base 2, what is 11111010110 + 101111010101000? 110011001111110 In base 4, what is -1213121132332 - -10? -1213121132322 In base 15, what is -15a9 + -245? -17ee In base 8, what is 1 - -10571752? 10571753 In base 10, what is -73106051 + 5? -73106046 In base 6, what is 152211500 - -4? 152211504 In base 11, what is -189a + 2501? 712 In base 7, what is 3026512042 + -1? 3026512041 In base 7, what is -443234 - -3060? -440144 In base 12, what is -3 + -3233153? -3233156 In base 11, what is -19381168 - -15? -19381153 In base 4, what is 1001130 - 12012000? -11010210 In base 4, what is -10 - 3213211113323? -3213211113333 In base 15, what is 4 - -1c12ce? 1c12d3 In base 14, what is 40917a - b? 40916d In base 2, what is 10010000001 - 110000010001? -11110010000 In base 16, what is 29 - -5a3e59? 5a3e82 In base 15, what is 363 + 4d66? 51c9 In base 11, what is 8625 + -1617? 7009 In base 14, what is -225 + -6c9655? -6c987a In base 9, what is -3824052 + 47? -3824004 In base 16, what is -1724d + -25b? -174a8 In base 4, what is 0 - -1301303322? 1301303322 In base 9, what is -56 - -2166468? 2166412 In base 6, what is -4012333021 + -23? -4012333044 In base 8, what is -12 + 36407750? 36407736 In base 4, what is -2000201112 - -11003? -2000130103 In base 11, what is 16 - 1666994? -1666979 In base 16, what is -d55ace - -50? -d55a7e In base 13, what is -9877 + 1316? -8561 In base 12, what is -200835 + 82? -200773 In base 4, what is -20223 - 111030131? -111111020 In base 12, what is 28 - -589813? 58983b In base 10, what is 150 - -2976126? 2976276 In base 5, what is -220313021 - 20? -220313041 In base 14, what is -a5 + 1240b5? 124010 In base 7, what is -151005 - 46443? -230451 In base 15, what is -3245a - -d00? -3165a In base 15, what is -7a1d + 352a? -44e3 In base 11, what is -9387 - 33? -940a In base 3, what is 100 + 100110200002? 100110200102 In base 13, what is 1078 + 6295? 7340 In base 14, what is a9065 + -3? a9062 In base 11, what is -5557 + -32440? -37997 In base 10, what is 162526 - -355? 162881 In base 14, what is 1024 + -112c? -108 In base 9, what is -716113184 - 5? -716113200 In base 12, what is -23 - 1159b? -11602 In base 9, what is 22 + 1452480? 1452512 In base 15, what is -951 + 5b93? 5242 In base 12, what is -77aa059 - b? -77aa068 In base 6, what is 4 - -25021235305? 25021235313 In base 4, what is -11130303 - 1212? -11132121 In base 15, what is 6334b1 - 0? 6334b1 In base 7, what is 1264 - -4205442? 4210036 In base 11, what is 35 + 97336? 97370 In base 16, what is -5893e + 4d7? -58467 In base 16, what is -3 - a66818? -a6681b In base 14, what is 83070 - b? 83063 In base 12, what is -2 - -1903b22? 1903b20 In base 11, what is -48068329 - -5? -48068324 In base 9, what is -14333000 - -2? -14332887 In base 3, what is 22020211 - -112001000? 211021211 In base 7, what is 121023 - 25614? 62106 In base 15, what is -140c1b - 6? -140c22 In base 10, what is 278 + -15796? -15518 In base 14, what is -1832844 + d? -1832835 In base 13, what is 8a57 - 465? 85c2 In base 7, what is 12 + -123112? -123100 In base 15, what is 2bd - 2eb8ac? -2eb5de In base 14, what is 2797b2 - 1? 2797b1 In base 9, what is -1216834 - 1508? -1218443 In base 3, what is -10011112211 - 22121? -10011212102 In base 11, what is -150a544 + 7a? -150a475 In base 2, what is -111011100 - -100001011000100? 100000011101000 In base 12, what is 3a069 + -1367? 38902 In base 13, what is 11c4c + -9252? 59ca In base 6, what is -2043 - 2404023? -2410110 In base 12, what is 799893 - 5? 79988a In base 12, what is -16313a96 + -2? -16313a98 In base 14, what is -2ad4c5c9 + 6? -2ad4c5c3 In base 2, what is 1000110011110110 + -110010010? 1000101101100100 In base 5, what is 121 - -20340401? 20341022 In base 15, what is -35921dd - -3? -35921da In base 12, what is -325b124 - 1? -325b125 In base 5, what is -34033322010 + 1? -34033322004 In base 13, what is -4345 - -cca? -3348 In base 16, what is -66 - 1736f? -173d5 In base 7, what is -10 - -2424266? 2424256 In base 10, what is -16622333 - 5? -16622338 In base 6, what is 4 + 25324132503? 25324132511 In base 16, what is -6 - -4e74e? 4e748 In base 8, what is -22114 - -1020? -21074 In base 12, what is 5 + -17823452? -17823449 In base 12, what is 306195 - -a? 3061a3 In base 14, what is -97 - -8700b7? 870020 In base 10, what is 2 - 1319928? -1319926 In base 14, what is -4 + 826c3b? 826c37 In base 4, what is 203 - -2031013201? 2031020010 In base 16, what is 4dee9a2 - 5? 4dee99d In base 13, what is -88631 + 23? -8860b In base 15, what is 1809 + -2279a? -20e91 In base 13, what is 5 + 1453c14? 1453c19 In base 15, what is -6d050 + 1a? -6d035 In base 12, what is 4a54 + b26? 597a In base 3, what is -11020111002021110 + 1? -11020111002021102 In base 9, what is -611550830 - 5? -611550835 In base 12, what is 3a8b27 + a? 3a8b35 In base 12, what is 1153 - -568b? 6822 In base 8, what is 243 - -26235? 26500 In base 8, what is -4553434 + 2? -4553432 In base 7, what is -10162434 + -104? -10162541 In base 15, what is 61 - -2a4? 315 In base 10, what is 517675 - 12? 517663 In base 13, what is c2 + -42318c? -42309a In base 12, what is -2 - 229ab029? -229ab02b In base 14, what is 14 + -9d81b? -9d807 In base 14, what is 1a + 24bb? 24d7 In base 13, what is 79c + 3c46? 4715 In base 2, what is 10011100100110000010 - -111001? 10011100100110111011 In base 7, what is -60343340 + -144? -60343514 In base 2, what is 10001111011010111 - -1110001? 10001111101001000 In base 14, what is 1cc951a - 0? 1cc951a In base 3, what is 12 + -10110020010010120? -10110020010010101 In base 4, what is 21000120 - 1101302? 13232212 In base 13, what is 15 + 95446c? 954484 In base 12, what is 286575 - aa? 286487 In base 11, what is -123 - -4267? 4144 In base 11, what is 3 - 3323523? -3323520 In base 4, what is -20300 - -112102030? 112021130 In base 9, what is 587 + 5621? 6318 In base 2, what is 1011010000110100100100 - 0? 1011010000110100100100 In base 15, what is -7de7c - -294? -7dbd8 In base 13, what is 2748a45 + -2b? 2748a17 In base 7, what is -22 - 6162144? -6162166 In base 11, what is -18 - 7147958? -7147975 In base 7, what is 335435234 + -3? 335435231 In base 6, what is 1 - 13142521252? -13142521251 In base 13, what is -37 - 1100471? -11004a8 In base 12, what is 765 + 60b13? 61678 In base 13, what is 864 + -30591? -2ca2a In base 15, what is cab598d - 3? cab598a In base 4, what is 1020323322022 + 10? 1020323322032 In base 10, what is -5 + -4177936? -4177941 In base 16, what is -59c6e4 + 6? -59c6de In base 16, what is -5 + -74c592c? -74c5931 In base 6, what is -3 - 1313333243? -1313333250 In base 4, what is 1002333202211 + -3? 1002333202202 In base 3, what is -11 - -2112120221200? 2112120221112 In base 10, what is -25 + -2019791? -2019816 In base 3, what is -22121 - -1010202201012? 1010202101121 In base 5, what is -23400110 + 1? -23400104 In base 14, what is 0 - 54bc57? -54bc57 In base 7, what is 16235614 + -1246? 16234335 In base 2, what is -100001000001000101001110111 + 0? -100001000001000101001110111 In base 6, what is 21 - -210101453? 210101514 In base 2, what is 10110 + 101001001010110101000? 101001001010110111110 In base 2, what is 100100100 + -10000100001011010? -10000011100110110 In base 10, what is -1 + 2159178? 2159177 In base 16, what is 33b4 + 187f? 4c33 In base 13, what is 3 - 80c2c98? -80c2c95 In base 13, what is -31 + -5b19? -5b4a In base 14, what is -2 - -b51569? b51567 In base 6, what is -25554 + 3040353? 3010355 In base 2, what is -1100111111100110100101 + -100100000? -1100111111101011000101 In base 16, what is 1 + -464a351? -464a350 In base 6, what is -35 - 222311222? -222311301 In base 4, what is -300010031 - -101? -30	{ "pile_set_name": "DM Mathematics" }
rt(12)/sqrt(3))) - (sqrt(7) - sqrt(252) - (sqrt(567) + 2 + sqrt(7))))5)2. 84000sqrt(7) + 649600 Simplify -3-4((1 + sqrt(475) + 1)*2 - (sqrt(475) + (sqrt(475)1-2)2) - (2sqrt(475) + -4 + 1))1. -17016 + 60sqrt(19) Simplify (2sqrt(153)3-56)/(sqrt(72)/(sqrt(54)/sqrt(3))). -270sqrt(17) Simplify (sqrt(35) + sqrt(560) + (sqrt(560) - -1sqrt(560)))/(1sqrt(500)) - ((6(sqrt(77) + sqrt(77) + (sqrt(77) - -1sqrt(77))))/sqrt(11)-1)*21. -4032 + 13sqrt(7)/10 Simplify 0 + (sqrt(2299) + -1sqrt(2299)6 + -1 + sqrt(2299) + 5 + -2(sqrt(2299) - (sqrt(2299) + -3)) + 2)*2. 36784 Simplify 4 + sqrt(2420) + 1 + -1 - ((sqrt(5) - -2(0 + sqrt(5))*2) + 0 + (sqrt(50)/(sqrt(30)/sqrt(3)4))*2). -101/16 + 21sqrt(5) Simplify (3-3-1sqrt(121)-1)/(2(sqrt(11) + -2sqrt(11)-3)1). -9sqrt(11)/14 Simplify (-2(3(1 + sqrt(75)) + -1sqrt(75) + -5 + 4 + (sqrt(75) - 5(0 + sqrt(75))) + sqrt(75)))2. -80sqrt(3) + 316 Simplify (1((sqrt(2) + (sqrt(24) + 3sqrt(24))/sqrt(12) - sqrt(8)6) + -6(sqrt(128)1 + 1)))2. 660sqrt(2) + 6086 Simplify ((4 + 1 + 3(3 + sqrt(1100) - sqrt(1100))2 + 4 + 5)6)2. 36864 Simplify (1sqrt(6897)-1 - (sqrt(6897) + (1sqrt(6897) - sqrt(6897)))5)/((-1sqrt(1080) - sqrt(1080))/(sqrt(160)3)). 66sqrt(19) Simplify (sqrt(24)/sqrt(8)-4 - (-2 + sqrt(3) + 4)) + (((sqrt(432) - ((sqrt(432)-4 - sqrt(432)) + sqrt(432)))*2 + sqrt(432))2 - sqrt(432))-6. -129602 - 77sqrt(3) Simplify ((6-1sqrt(684) + sqrt(684) - (sqrt(684) + 4 + -3)) + (3 + -61sqrt(684))-5)2. -4608sqrt(19) + 394240 Simplify (((sqrt(17)-2 + 5 + sqrt(17) - (0 + sqrt(17))6) + (sqrt(85) + (sqrt(85) - 1sqrt(85)-5))/((-2sqrt(35) - sqrt(35))/sqrt(7)))2)*2. -1120sqrt(17)/3 + 54212/9 Simplify -2((((2 + sqrt(1100) + -1)-5 + 2 + 0)6)2 + -2). -1980644 - 21600sqrt(11) Simplify ((sqrt(980) + 1 + sqrt(980))-6-2-3-6)*2-3-3. 23514624sqrt(5) + 1646443584 Simplify (sqrt(72)/(sqrt(9)/sqrt(3)))/(-1sqrt(9)/sqrt(3)) + (-2sqrt(300))/sqrt(6) + (sqrt(90)/sqrt(5) - sqrt(2)) + (sqrt(200) + 1)*2 + sqrt(2). 11sqrt(2) + 201 Simplify (6(sqrt(60) + sqrt(180)/sqrt(3)) - 5sqrt(8640))/((1sqrt(120)2)/sqrt(10)2). -12sqrt(5) Simplify (-4(-1(-5(sqrt(21) + sqrt(756)-1))/((sqrt(14) - (sqrt(14) - sqrt(14)1))/sqrt(2) + (sqrt(567) + sqrt(567)2 - sqrt(7))) + -5))*2. 4000sqrt(3)/27 + 107200/243 Simplify -3 + (((sqrt(5) - sqrt(10)/sqrt(2)-4 - sqrt(5)) + 3 + 4(5 + (sqrt(20) + sqrt(5) - sqrt(5))))1 + 5)2 + -5. 1496 + 672sqrt(5) Simplify ((sqrt(700) + -2)3 + -3)2 + (-2sqrt(175) - (sqrt(42)/sqrt(6) + -2)*2). -546sqrt(7) + 6370 Simplify 1 + (-4-4((2 + -3sqrt(500) - sqrt(500) - sqrt(500)) + sqrt(500) - sqrt(500)) - (-3 + sqrt(500) + sqrt(500) + 1 + -4)-4)*2. -11520sqrt(5) + 2592065 Simplify (-6(sqrt(384) - sqrt(384)-1 - sqrt(384))3)/(-6(sqrt(32)1 + sqrt(8)-1-3)). 12sqrt(3)/5 Simplify (-4(sqrt(72)2 + -3 + -5-1sqrt(72) + 2 + 4(sqrt(72) - (-2 + sqrt(72) + sqrt(72)) - sqrt(72)) + -2))2. -960sqrt(2) + 1552 Simplify -5 + 6((sqrt(833) - sqrt(833)2)-5)2 + 2(sqrt(833) - (0 + sqrt(833))1). 124945 Simplify -5 + -1 + 2sqrt(11) + sqrt(11) + sqrt(99)1 + (2sqrt(77)1)/(-6-2sqrt(7)). -6 + 37sqrt(11)/6 Simplify (0 + (sqrt(240)/(sqrt(10)-3 - sqrt(10)))/sqrt(12) + sqrt(1458) + 4 + 1)2. 535sqrt(2)/2 + 11649/8 Simplify (-6sqrt(336)-2-1)/(-2sqrt(192) - sqrt(84)/(sqrt(14)/sqrt(2))). 8sqrt(7)/3 Simplify (-5 + (sqrt(125) + -1 + sqrt(125) + 1 - -4(1sqrt(125) - sqrt(125)) - (((sqrt(125) + 1 - sqrt(125)) + sqrt(125))4 - sqrt(125))2) + 1)2. 480sqrt(5) + 2144 Simplify (((4sqrt(117) - sqrt(117) - sqrt(117)) + 0)2 - (sqrt(117)4 + 5)) + (1sqrt(39)1)/((sqrt(243) - 3sqrt(243)) + sqrt(3) - sqrt(3)). -217sqrt(13)/18 + 463 Simplify ((-3sqrt(378)-1 - (6(sqrt(378) + (sqrt(378) - (sqrt(378) + (sqrt(378)-1 + sqrt(378) - sqrt(378))))) - sqrt(378)))/(61sqrt(96))-3)2. 63 Simplify (0 + sqrt(192) + 5 + (sqrt(192) + 0 + 4)2 + sqrt(192))6-4-4 + -2. 7680sqrt(3) + 20446 Simplify (3 + -3 + sqrt(171) + -2 + (sqrt(171) + sqrt(171) + -1sqrt(171))1-6 + -2)*2. 120sqrt(19) + 4291 Simplify ((sqrt(540) - ((sqrt(540) - sqrt(540)1 - sqrt(540))4 + sqrt(540) + sqrt(540)))/(3sqrt(300)))/(2(sqrt(216)/sqrt(6) + sqrt(36))-1). -sqrt(5)/40 Simplify ((sqrt(15)/sqrt(3) + 4)-1 + -3 + sqrt(180)-1 + -3sqrt(5)-3)2. -28sqrt(5) + 69 Simplify 5(-5 + (((sqrt(20)/(sqrt(4)2) + sqrt(5))*2 - sqrt(5)) + 5 + sqrt(5)2 - ((1 + sqrt(180))*2 - sqrt(45)6))) + -1. -3399/4 + 35sqrt(5) Simplify -3(((sqrt(19) + sqrt(19)1)-4 - (-1 + sqrt(2736)))*2 + (((sqrt(19) + sqrt(171))3 + 1)-5)2). -228078 - 1680sqrt(19) Simplify (((sqrt(54)/sqrt(3) + 5 - (2sqrt(18)-2 + sqrt(18))) + sqrt(54)/sqrt(3)-5 + -1sqrt(288))-1)2. -150sqrt(2) + 475 Simplify (((4(1sqrt(200) + sqrt(200)))/(sqrt(8) + ((sqrt(64)2)/sqrt(8) - sqrt(8))))/((sqrt(45)/sqrt(48))/(sqrt(147)-2)) + 3)*2. -1344sqrt(5) + 250889 Simplify -1 + (((-1(sqrt(245) + sqrt(245) + sqrt(245)3 + sqrt(245) + sqrt(245)))/sqrt(5)4)/(sqrt(49)/(sqrt(252)/sqrt(4))1))2. 49391 Simplify -5 + (sqrt(320) + -1)2 + 1 + ((1sqrt(240) - sqrt(240))3)/(sqrt(108)-2). -16sqrt(5) + 317 Simplify (5(-5 + -1 + sqrt(1900))-6)*2 + (-5((sqrt(133)1 - sqrt(133))/sqrt(7) + -4 + 0 + sqrt(19)))2 + -4. -108200sqrt(19) + 1743271 Simplify 5 + 0 + (sqrt(1568) + 2 - sqrt(1568)) + -5 + -1 + -3. -2 Simplify -1 + 3 + ((sqrt(7488) + sqrt(7488) + -3-1sqrt(7488) - sqrt(7488))*2 - (sqrt(65)-1-5)/(sqrt(40)/(sqrt(72) + sqrt(8)) + sqrt(5))). -4sqrt(13) + 119810 Simplify ((sqrt(72)/sqrt(3) + sqrt(24))-2)/(sqrt(8) + (sqrt(8) - -5(sqrt(8) - sqrt(32)))) + (-4 + sqrt(300) + -2 + sqrt(300) + 2 + sqrt(300))*2. -716sqrt(3)/3 + 2716 Simplify (-2 + -4sqrt(153) + 5)2 - (-3 + -3(sqrt(153) - (-2 + sqrt(153))))*2. -72sqrt(17) + 2376 Simplify ((sqrt(448) + 1 + sqrt(448) + 5 - sqrt(448)) + 5 + (sqrt(448)1 - sqrt(448) - sqrt(448)) - -2(0 + 1 + sqrt(448))) + 0 + -5. 8 + 16sqrt(7) Simplify (-5 + 3 + (-5(sqrt(68) + sqrt(68)-2)6)/(sqrt(36)22)-1)2. 10sqrt(17) + 441/4 Simplify (sqrt(405) - (3 + sqrt(405))) + 1 - (4 + sqrt(405)1) - ((sqrt(405) - (sqrt(405) - -2sqrt(405))*2)-6 - (6(sqrt(405) + -1))2)2. -14514 - 1197sqrt(5) Simplify 4-3(-3(sqrt(77) - (sqrt(77) - 3sqrt(77)4)))/((sqrt(42)-2)/sqrt(6) + (sqrt(7) - sqrt(7)2)6). -54sqrt(11) Simplify (((-3-3sqrt(228) + sqrt(228) + sqrt(228))5)/(3-2sqrt(48))1)*2. 57475/144 Simplify 5((sqrt(7) + (sqrt(567) - sqrt(7)))-2 + (sqrt(7) - -6-2sqrt(7)) - (sqrt(189)/(sqrt(9)1))/((sqrt(24)/sqrt(4))/sqrt(2)))*2. 31500 Simplify (-4 + (-1(1 + -1sqrt(192) + 6-2sqrt(192)))2)3. -624sqrt(3) + 97335 Simplify sqrt(68) + -3 + -3 + 1sqrt(68) + 5 + -3((-5(-1sqrt(68) - sqrt(68)) - sqrt(68) - sqrt(68) - sqrt(68)) + sqrt(68)24)2. -45901 + 4sqrt(17) Simplify 5((sqrt(125) + 0 - sqrt(125)) + sqrt(125))2-3 + sqrt(4500) + (sqrt(4500) + 2)*24 + sqrt(4500). 540sqrt(5) + 16141 Simplify 6(-2(-3sqrt(91)-2 + sqrt(91) - sqrt(91))-3)/((sqrt(112) + sqrt(112) + 6(sqrt(112) + sqrt(112)1) - sqrt(112))1). 54sqrt(13)/13 Simplify -5((((sqrt(171) + (sqrt(171)-2 - sqrt(171)) + sqrt(171))-6 - (sqrt(171) - 1(sqrt(171) + -1))) + 3 + -1(sqrt(171) + 0))2)*2. -85580 - 1200sqrt(19) Simplify (-4-3(1 + sqrt(108) + (sqrt(108) + 0 - sqrt(108)) + 1 + 1sqrt(108))5)*2. 172800sqrt(3) + 1569600 Simplify ((0 + 2sqrt(13) - (sqrt(468) - (-1sqrt(468))*2 - sqrt(468))) + 4 - (-4(sqrt(13) + 1 + sqrt(13)) + 3 + (sqrt(4719)-1)/sqrt(3))) + -4. 21sqrt(13) + 469 Simplify 0 + ((sqrt(136) + 4sqrt(136)-2 + 1-2sqrt(136))/((sqrt(96)/(sqrt(3)-3))/sqrt(4)))2. 12393 Simplify (sqrt(48)/sqrt(6))2 - (sqrt(2) - sqrt(14)/sqrt(112)) - (-4sqrt(12)/sqrt(3))/((sqrt(30)/sqrt(3))/sqrt(5)). 13sqrt(2)/4 + 8 Simplify -6(1 + 5((sqrt(1216) - (sqrt(1216) + (-5(sqrt(1216) + 0) - sqrt(1216))) - sqrt(1216)) + 12sqrt(1216) + -5)3)2. -80471256 + 745920sqrt(19) Simplify (-4 + 1((-13sqrt(110) + sqrt(110))3)/(sqrt(160)1-4 - sqrt(160)))*2. -12sqrt(11)/5 + 1699/100 Simplify 2(sqrt(343) + 0 - (sqrt(21)/sqrt(3) + sqrt(7))6)*2 + -51(-5(sqrt(175) + -1))*2. -21650 + 1250sqrt(7) Simplify 6(sqrt(6912) + 0 + (sqrt(6912)3 - sqrt(6912))*2) - ((0 + 1 + sqrt(4800))-3)**	{ "pile_set_name": "DM Mathematics" }
he s'th term of -264256531, -528513060, -792769589? -264256529s - 2 What is the x'th term of -16541233, -66164943, -148871127, -264659785? -16541237x*2 + x + 3 What is the t'th term of 30232888, 60465775, 90698662, 120931549, 151164436, 181397323? 30232887t + 1 What is the o'th term of 594563, 594589, 594623, 594671, 594739, 594833, 594959, 595123? o*3 - 2o*2 + 25o + 594539 What is the n'th term of -15980, -33075, -50170, -67265, -84360, -101455? -17095n + 1115 What is the g'th term of -25908, -24764, -23620, -22476, -21332, -20188? 1144g - 27052 What is the r'th term of -190515, -380878, -571241, -761604? -190363r - 152 What is the j'th term of 28512, 58214, 89112, 121206? 598j*2 + 27908j + 6 What is the y'th term of 2237, 17935, 60479, 143291, 279793, 483407, 767555? 2237y3 + y2 + 36y - 37 What is the k'th term of -29829677, -29829676, -29829675, -29829674, -29829673, -29829672? k - 29829678 What is the x'th term of -61510, -61504, -61514, -61552, -61630, -61760, -61954? -2x3 + 4x*2 + 8x - 61520 What is the a'th term of 303744, 303794, 303864, 303948, 304040? -a*3 + 16a*2 + 9a + 303720 What is the y'th term of -316, -152, 244, 974, 2140? 17y3 + 14y*2 + 3y - 350 What is the b'th term of -2541882, -2541886, -2541890, -2541894, -2541898? -4b - 2541878 What is the a'th term of 9048, 9142, 9292, 9498? 28a*2 + 10a + 9010 What is the m'th term of 7554958, 15109953, 22664948? 7554995m - 37 What is the b'th term of -20417, -21914, -23411? -1497b - 18920 What is the b'th term of 2797328, 2797787, 2798246? 459b + 2796869 What is the w'th term of 12287, 24604, 36925, 49256, 61603, 73972? w3 - 4w*2 + 12322w - 32 What is the t'th term of 491417064, 491417063, 491417062? -t + 491417065 What is the j'th term of 60745, 92328, 123899, 155452, 186981, 218480, 249943, 281364? -j*3 + 31590j + 29156 What is the y'th term of -6609, -4280, -1951, 378, 2707, 5036? 2329y - 8938 What is the s'th term of 27299, 27350, 27403, 27458? s2 + 48s + 27250 What is the u'th term of -15952, -18908, -21864, -24820, -27776, -30732? -2956u - 12996 What is the g'th term of 4325601, 8651192, 12976775, 17302350? -4g*2 + 4325603g + 2 What is the r'th term of -107030, -214014, -321008, -428012, -535026, -642050, -749084? -5r2 - 106969r - 56 What is the b'th term of 7247, 7030, 6789, 6512, 6187? -2b3 - 203b + 7452 What is the j'th term of 20972, 168536, 569050, 1348988, 2634824? 21079j3 + j2 + 8j - 116 What is the a'th term of 103168330, 103168324, 103168318? -6a + 103168336 What is the s'th term of -5270, -10567, -15864? -5297s + 27 What is the u'th term of 3903, 9126, 15655, 23490, 32631, 43078, 54831? 653u2 + 3264u - 14 What is the u'th term of 423117, 423103, 423089, 423075, 423061? -14u + 423131 What is the k'th term of 2003, 2890, 3837, 4868, 6007, 7278, 8705, 10312? 4k*3 + 6k*2 + 841k + 1152 What is the y'th term of -6308, -6458, -6724, -7106, -7604? -58y2 + 24y - 6274 What is the s'th term of 3677, 3815, 4169, 4847, 5957, 7607? 18s3 + 12s + 3647 What is the k'th term of -16482, -32946, -49378, -65778? 16k2 - 16512k + 14 What is the z'th term of 276017, 276831, 278181, 280061, 282465, 285387? -z*3 + 274z*2 - z + 275745 What is the p'th term of -1135127, -1135155, -1135201, -1135265, -1135347, -1135447, -1135565? -9p*2 - p - 1135117 What is the d'th term of -5358, -10423, -15488, -20553, -25618? -5065d - 293 What is the k'th term of 1123080, 1122852, 1122228, 1121010, 1119000? -33k3 + 3k + 1123110 What is the k'th term of 7560695, 7560546, 7560397? -149k + 7560844 What is the z'th term of -8282491, -8282493, -8282495, -8282497, -8282499, -8282501? -2z - 8282489 What is the v'th term of 3055, 10510, 22935, 40330, 62695? 2485v2 + 570 What is the o'th term of 9371, 9244, 9055, 8822, 8563, 8296? 3o*3 - 49o*2 - o + 9418 What is the j'th term of 754, 1240, 1484, 1504, 1318, 944, 400, -296? 3j*3 - 139j*2 + 882j + 8 What is the b'th term of -8551, -34327, -77321, -137527, -214939, -309551, -421357, -550351? b*3 - 8615b*2 + 62b + 1 What is the g'th term of 114320, 457206, 1028662, 1828688? 114285g2 + 31g + 4 What is the y'th term of -212753, -212640, -212527, -212414, -212301, -212188? 113y - 212866 What is the k'th term of -765, -1559, -2063, -2133, -1625? 24k3 + k2 - 965k + 175 What is the i'th term of 45615, 47587, 50885, 55515, 61483, 68795, 77457, 87475? i3 + 657i*2 - 6i + 44963 What is the p'th term of 2223, 4670, 7125, 9582, 12035, 14478, 16905? -p*3 + 10p*2 + 2424p - 210 What is the s'th term of -50489, -50093, -49697, -49301, -48905, -48509? 396s - 50885 What is the b'th term of -64520, -64520, -64522, -64526, -64532, -64540? -b2 + 3b - 64522 What is the l'th term of 287372, 287386, 287416, 287462, 287524, 287602? 8l2 - 10l + 287374 What is the p'th term of -3079, -5731, -8391, -11059, -13735, -16419, -19111? -4p2 - 2640p - 435 What is the r'th term of -554922, -1109846, -1664768, -2219688, -2774606, -3329522? r*2 - 554927r + 4 What is the s'th term of -3476, -9024, -16646, -26342, -38112, -51956, -67874? -1037s2 - 2437s - 2 What is the q'th term of -537, -3069, -10005, -23547, -45897, -79257? -367q3 + 37q - 207 What is the r'th term of 1117, 1191, 1319, 1501? 27r2 - 7r + 1097 What is the u'th term of 1996, 4106, 6330, 8668, 11120, 13686? 57u2 + 1939u What is the d'th term of 45362246, 90724491, 136086736, 181448981, 226811226? 45362245d + 1 What is the d'th term of -119, -398, -837, -1436, -2195, -3114? -80d*2 - 39d What is the q'th term of 619030, 1238077, 1857124? 619047q - 17 What is the i'th term of -465448, -930892, -1396326, -1861750, -2327164, -2792568? 5i*2 - 465459i + 6 What is the m'th term of 74194, 74028, 73862, 73696, 73530? -166m + 74360 What is the x'th term of -355, -626, -1147, -2044, -3443, -5470? -21x3 + x2 - 127x - 208 What is the r'th term of 4768170, 9536369, 14304568, 19072767, 23840966? 4768199r - 29 What is the h'th term of -1528, -6009, -13444, -23833, -37176? -1477h2 - 50h - 1 What is the g'th term of 13454321, 13454323, 13454325, 13454327? 2g + 13454319 What is the l'th term of 105246, 105263, 105288, 105321, 105362? 4l*2 + 5l + 105237 What is the q'th term of -15046563, -30093123, -45139683? -15046560q - 3 What is the k'th term of 84579939, 84579933, 84579915, 84579879, 84579819? -k3 + k + 84579939 What is the s'th term of 772, 5760, 18732, 43498, 83868, 143652? 635s*3 + 182s*2 - 3s - 42 What is the s'th term of 275902, 275826, 275750, 275674, 275598, 275522? -76s + 275978 What is the i'th term of 11267, 22496, 33725? 11229i + 38 What is the i'th term of -490, -4472, -15304, -36412, -71222, -123160? -571i3 + i2 + 12i + 68 What is the z'th term of -5317756, -21270971, -47859664, -85083835? -5317739z2 + 2z - 19 What is the c'th term of -6934, -6725, 624, 15113, 36742? 3570c2 - 10501c - 3 What is the l'th term of -173144, -346219, -519294, -692369, -865444, -1038519? -173075l - 69 What is the z'th term of -55210, -220891, -497038, -883651, -1380730? -55233z*2 + 18z + 5 What is the f'th term of -259312, -1037277, -2333886, -4149139, -6483036, -9335577? -259322f2 + f + 9 What is the u'th term of -57015, -57003, -56991, -56979, -56967, -56955? 12u - 57027 What is the z'th term of 180701535, 361403069, 542104603, 722806137? 180701534z + 1 What is the o'th term of 237466, 474905, 712316, 949699, 1187054? -14o*2 + 237481o - 1 What is the m'th term of 21731, 21671, 21569, 21425, 21239, 21011, 20741? -21m2 + 3m + 21749 What is the g'th term of -29387, -58773, -88159? -29386g - 1 What is the i'th term of -59392, -237570, -534532, -950278, -1484808, -2138122, -2910220? -59392i*2 - 2i + 2 What is the z'th term of 44925773, 44925736, 44925699, 44925662? -37z + 44925810 What is the b'th term of -2017126, -2017193, -2017260, -2017327, -2017394? -67b - 2017059 What is the a'th term of -11658, -11660, -11672, -11700, -11750, -11828, -11940? -a3 + a2 + 2a - 11660 What is the x'th term of 2683349, 5366630, 8049911, 10733192, 13416473? 2683281x + 68 What is the b'th term of 188021, 188043, 188075, 188117? 5b2 + 7b + 188	{ "pile_set_name": "DM Mathematics" }
cond derivative of y(m) wrt m? 780m3 What is the third derivative of 11y*6 + 78y*3 + 5y*6 - 20y*6 + 96y*2 - 18y*2 - 17y*3 wrt y? -480y3 + 366 Let g(f) be the first derivative of f8/280 + 7f6/90 + 19f*3/3 + 23. Let v(r) be the third derivative of g(r). What is the third derivative of v(o) wrt o? 144o Let c be ((-800)/360)/(2/(-3)). Let s(n) be the first derivative of 0n - 5 - 5/2n*2 + cn3. Find the second derivative of s(h) wrt h. 20 Let p(w) be the first derivative of w6/24 + 17w3/6 - 9w*2/2 + 14. Let s(m) be the second derivative of p(m). Differentiate s(v) wrt v. 15v*2 Find the second derivative of 5d*4 - 3d*4 - 4d*4 - 4d - 88d2 + 83 - 17d*2 - 87 wrt d. -24d*2 - 210 What is the third derivative of 166l*3 - 54l*3 - 55l*3 - 56l*3 + 9l*5 + 83l*2 wrt l? 540l*2 + 6 Suppose h - 6 = 4h. Let i be ((-2)/4)/(h/16). What is the second derivative of 3u4 + 2u - u*2 - 2ui + u2 wrt u? 12u2 Let p(d) be the third derivative of 37d5/30 + d4/24 + 33d3/2 - 236d*2. What is the second derivative of p(b) wrt b? 148 Let w(g) = 5g - 27. Let z be w(6). What is the second derivative of 3v + 26v*z + 0v + 0v - 38v*3 wrt v? -72v Suppose -5u - 2g = -2, -4u = -2u + g. Find the second derivative of -15y2 + uy - 3y - 5y wrt y. -30 Let s(v) be the second derivative of 4v5 - 61v*2/2 - 3v - 7. What is the derivative of s(x) wrt x? 240x2 What is the third derivative of -24g*2 + 32g*5 + 55g*2 + 47g*2 + 0g4 - g4 wrt g? 1920g2 - 24g Let u(x) = -3x2 - 2. Let l(t) = -54t*2 + 33t + 10. Let j(p) = l(p) + 5u(p). Find the second derivative of j(i) wrt i. -138 Let n(y) be the first derivative of -5y*6/6 + 7y5/5 + y2/2 + 328y + 183. What is the second derivative of n(v) wrt v? -100v*3 + 84v*2 Let d(n) = -n + 3. Let a(q) = q - 5. Let p(i) = -2a(i) - 3d(i). Let h(r) = -45r - 26. Let j(m) = h(m) + 3p(m). Find the first derivative of j(c) wrt c. -42 Let m = 1/51 - -4/85. Let x(v) be the second derivative of mv*6 - 2v*2 + 0v*5 + 0 - 4v + 0v4 + 0v*3. What is the derivative of x(s) wrt s? 8s*3 Let a(n) = -6n - 2. Let v be a(-2). Let x(y) = y*3 - 9y*2 - 9y - 3. Let f be x(v). What is the third derivative of 7j4 + 4j*2 - 3j*6 - fj*4 wrt j? -360j*3 Let g(b) = 3933b + 3243. Let r(m) = 787m + 650. Let n(u) = -4g(u) + 21r(u). Differentiate n(s) wrt s. 795 What is the first derivative of -6q*4 + 11q*4 + 222 + 0q + 9q - 4q*4 wrt q? 4q*3 + 9 Let s(p) = -2p - 23. Let b be s(-18). What is the third derivative of 267r3 - 244r*3 - br2 + r2 wrt r? 138 Let t be 1/(4/8) + 3. Suppose 2d = td - 102. What is the first derivative of -30 + 2c - 3c + d wrt c? -1 Let u(b) be the second derivative of 0 - 2b + 0b*3 + 1/15b*6 - 6b*2 - 1/4b*4 + 0b*5. Differentiate u(y) wrt y. 8y*3 - 6y Let x(z) be the first derivative of 41z8/1680 - z4/12 + 11z*3/3 + 1. Let w(o) be the third derivative of x(o). Differentiate w(s) with respect to s. 164s*3 Let y(g) = -8g*2 + 5g. Let h(r) = r*2 - r. Let o = -22 - -30. Suppose 5z - 3 = -o. Let u(i) = zy(i) + 3h(i). What is the second derivative of u(p) wrt p? 22 Let c(d) = -d*3 + 13d*2 - 6d - 24. Let i be c(11). What is the third derivative of 80 - 10b2 - i + 72 + 10b*4 wrt b? 240b Let v(k) be the first derivative of 0k5 + 0k + 0k2 - 11/3k*3 - 7/6k*6 + 0k*4 - 5. What is the third derivative of v(b) wrt b? -420b*2 Find the third derivative of -192x*2 + 117x*2 - 192x*3 - 46x*2 - 232x*2 + 39x*3 wrt x. -918 Find the first derivative of -163 - 172 + 2401x*3 - 2138x*3 wrt x. 789x*2 Let p(m) be the first derivative of 101m*4/4 + 86m - 200. What is the derivative of p(j) wrt j? 303j2 Let v = -7 - -12. Suppose f = 6f + vu - 100, 4f = 3u + 52. Find the first derivative of 7c*2 - 16c - 2 + 0 + fc wrt c. 14c Suppose 0 = -0j + j - 162. What is the derivative of -5k*4 + j + 0k*4 + 0k*4 - 185 wrt k? -20k*3 Find the third derivative of -214n*6 - 1821n*2 + 1047n*2 + 55n*6 wrt n. -19080n3 Let p(r) = -r4 - r3 - r2 - r + 1. Let j(i) = -62i4 - 2i*3 - 2i*2 - 87i + 2. Let h(m) = -j(m) + 2p(m). Find the second derivative of h(w) wrt w. 720w*2 Let u be 3 + ((-3)/(-6))/(2/4). Let n(w) = 39w*2 + 28. Let m(z) = 1. Let r(t) = um(t) + n(t). Differentiate r(f) wrt f. 78f Let j(b) be the second derivative of -9b + 0b3 + 0b*2 + 0b*5 + 0 - 1/2b*4 - 1/3b*7 + 0b*6. What is the third derivative of j(z) wrt z? -840z*2 Let b(z) = 194z*2 + 223z + 2. Let n(j) = -388j2 - 444j - 5. Let k(d) = -5b(d) - 2n(d). What is the second derivative of k(h) wrt h? -388 Let q be (-2)/64-4 + 69/24. Let i(d) be the first derivative of 0d - d*q + 0d*4 + 2 + 0d*2 - 3/5d*5. What is the third derivative of i(f) wrt f? -72f Let v(f) = 2f4 + f3. Let u(z) = -z4 + 5z3 - z2 + 9. Let g(k) = u(k) - 4v(k). What is the third derivative of g(q) wrt q? -216q + 6 Let m(x) be the first derivative of x*4 - 4x*3/3 - 93x*2/2 + x - 19. What is the second derivative of m(t) wrt t? 24t - 8 Suppose 176 = -5y - 744. Let n be -3(-4 + y/4). What is the derivative of -13z4 - 11 - nz*3 + 150z*3 + 3 wrt z? -52z*3 Let f(w) = 1. Suppose 2v = 5 - 1. Let s(j) = -5j2 - 17j + 2. Let n(u) = vf(u) - s(u). Find the second derivative of n(i) wrt i. 10 Suppose u = -3l - 2l + 31, -2u = 4l - 32. What is the second derivative of c - 9 + 34c*4 + 4 + 1 + u wrt c? 408c*2 Suppose 0 = 2g + 4y, 2y + 6 = -0y. What is the third derivative of ng - 2n*6 - 12n*2 - 8n*6 wrt n? -1080n3 Let b(l) be the third derivative of l7/105 - 7l5/3 + 12l*3 - 5l*2 - 20. Differentiate b(p) with respect to p. 8p*3 - 280p Let c be (-4)/((-24)/75)-2. Let x = c - -48. What is the third derivative of 3f*2 - 18f*6 + xf6 + f2 wrt f? 600f3 Let v(l) be the first derivative of -4l*6/3 - 261l*2 + 553. What is the second derivative of v(g) wrt g? -160g*3 Suppose 16 = -7g + 30. Find the third derivative of 17x3 - 33 + 58x*g - 16x*2 + 33 wrt x. 102 Let q(l) = 58l*2 + 5l - 53. Let x(p) = 29p2 + 2p - 26. Let d = 60 - 58. Let v(h) = dq(h) - 5x(h). Find the first derivative of v(a) wrt a. -58a Let w(f) = -f2 + 1. Let p(y) = 148y*3 + 2y*2 + 201. Let m(d) = -3p(d) - 6w(d). What is the first derivative of m(u) wrt u? -1332u*2 Let z(c) = 9c*5 + 4c4 - c2 + 10c. Let u(h) = -8h*5 - 3h4 + h2 - 11h. Let s(i) = 3u(i) + 4z(i). What is the third derivative of s(w) wrt w? 720w*2 + 168w Suppose p - 6 = 6. Differentiate -14 + 3b4 + 0b*4 + pb*4 with respect to b. 60b*3 Differentiate -56 + 5h + h*2 - 90 + 351 - 5h wrt h. 2h Let y(r) = 7r*3 - 9r - 1. Let a be 2 - 2/(-4)-22. Let f(i) = 4i*3 - 4i - 1. Let t(p) = af(p) + 4y(p). Differentiate t(m) with respect to m. -24m2 Let m = -6 + 9. Let u be (26/6 + -3)m. What is the second derivative of -2v5 - 36v*2 - uv + 36v2 wrt v? -40v*3 Let c(g) = -3g + 31. Let y be c(6). Find the second derivative of -9s2 + ys*3 + 12s*2 - 3s*2 - 5s wrt s. 78s Let w(u) be the first derivative of -382u*5/5 + 41u + 322. Differentiate w(m) wrt m. -1528m3 Let b(o) be the first derivative of -56o*4 + 167o*2 - 13. Find the second derivative of b(m) wrt m. -1344m Let l(x) be the third derivative of 0x + 2/3x*4 + 0x*5 + 0x*3 + 0x*6 + 0 - 1/42x*7 - 15x*2. Find the second derivative of l(c) wrt c. -60c*2 Let n(c) = -c + 1. Let x be n(-1). Suppose 3s - 2 = -2l, 1 = xl - l + s. Find the third derivative of 10v3 + 3 + 3v*2 + l - 4 wrt v. 60 Find the first derivative of 3b - 8b + 5 + 8 - 4b*2 - 1 + 3b*2 wrt b. -2b - 5 Suppose 4l - 35 = -5s, -4s + 13 = 5l - 24. Find the third derivative of -2ws + 7w*2 + 11w*2 - 7w2 wrt w. -12 Let f(h) be the first derivative of -h6/6 + 107h4/4 + 170h*3/3 + 26. Find the third derivative of f(q) wrt q. -60q*2 + 642 Let g(y) = 149y*3 + 18y*2 - 7. Let f(x) = 224x*3 + 27x*2 - 10. Let n(t) = 5f(t) - 7g(t). Find the third derivative of n(j) wrt j. 462 Suppose -138 = -12i + 6. D	{ "pile_set_name": "DM Mathematics" }
h. What is the third biggest value in -4, -2/5, z, 0.1? -2/5 Let d(p) = -p*2 + 13p + 202. Let b be d(-9). Suppose -bm - 46 + 66 = 0. What is the third biggest value in 1/2, 5/3, m? 1/2 Let g = 227/3 - 75. Suppose 11u + 2u = 858. Let q be u/(-63) + (240/42 - 6). Which is the fourth biggest value? (a) 10 (b) g (c) q (d) 3 c Let q = -0.31 - -0.11. Let h = 397 + -276. Let g = 119 - h. Which is the fourth biggest value? (a) q (b) g (c) 4/7 (d) 0.1 b Let m be (-286)/1287 - 61/9. Let j = -1.1 - -8.1. Which is the second biggest value? (a) m (b) j (c) -1 c Let z = -3325 - -3326. Which is the smallest value? (a) -26 (b) z (c) 4 (d) -11 a Suppose -g + 3r + 7 = 0, -2g - 2r = 2739 - 2729. Which is the biggest value? (a) g (b) -3 (c) -1.2 (d) -6/7 d Let y = 1.25 + -0.9. Let g = y - 0.05. Let k = -1296 + 1295.9. Which is the second smallest value? (a) g (b) k (c) -2 b Suppose -36f + 34f - 4 = 0. Let j be f(-4)/(-40) + (-16)/20. Let d be (-18)/8j/(-3). Which is the smallest value? (a) 1 (b) d (c) -1 c Let r = 2919 - 2799. Which is the third smallest value? (a) 0.3 (b) -4 (c) -1.5 (d) r (e) 0.1 e Let u(y) = 34y + 436. Let j be u(-43). Let g = j - -13340/13. Let v be 25/(-72) - 2/(-9). What is the smallest value in v, 7, g? v Let w = -520 + 156. Let m = w + 363.5. Let r = 6 + -1. Which is the second biggest value? (a) r (b) 0.1 (c) m b Let f = 1421 + -914. Let k = -508.1 + f. Which is the biggest value? (a) 0.5 (b) -1 (c) k a Let h be (-31)/((-6)/(-4)). Suppose -4b - 12 = -4t, 4t - 7b - 13 = -4b. Let i be (2 - 0)(-12)/(-8). What is the biggest value in -1/3, h, i, t? t Let s = -11 + 10.7. Let h = -4 - -7. Which is the second biggest value? (a) -4 (b) s (c) h (d) 0.25 d Let y = 154.92 + -176.92. What is the second biggest value in y, -3, 0.068? -3 Let z = 10 + -6. Let f = z + 1. Let s = -15019/3 - -5006. Which is the biggest value? (a) f (b) 0.3 (c) s a Let w = 39.6 - -5.4. Let o = w - 44.7. Let j = -0.4 + 0.2. What is the third biggest value in j, o, 0.5? j Let p = 2625/10468 + -2/2617. Suppose 0 = h + 2h + 5r - 10, -5h = 5r. Let j = -9 - h. What is the third smallest value in j, p, 5? 5 Suppose 350 = 51z + 6z - 7z. What is the second biggest value in 12, -2, z? z Let r = -25.16 - -24.16. Let y = -1/19709 + 26331269/886905. Let g = -266/9 + y. What is the second smallest value in -7, r, g, -2/7? r Let s = 48.3 - 48.2. What is the second smallest value in s, 8, -8? s Suppose -1 = 5y - 3k - 6, -7y - 3k = -43. Which is the third smallest value? (a) -1/4 (b) 0.193 (c) y c Let i = -13/341 + -276/1705. Let y = -8 - -8.3. Let d = 0.6 - y. Which is the biggest value? (a) 2/13 (b) d (c) i b Let j = -32.4 - -21. Let i = 10.9 - 22.2. Let d = i - j. Which is the smallest value? (a) 3/2 (b) d (c) 12 b Let p = -10455.5 - -10455. What is the second biggest value in 1/116, -3, p? p Let z = -204.4 - -204. Let p = -1/12 - 7/60. Which is the second smallest value? (a) -40 (b) z (c) -2 (d) p c Let l = 0.0277 - 358.0277. Let a = -357.95 - l. What is the third smallest value in 0.3, a, -3? 0.3 Let q be 181 - 1(2 - -4). Let n be (-210)/q5/(-3). Which is the third biggest value? (a) -0.1 (b) -3/47 (c) -0.3 (d) n a Suppose 259h - 305h = 138. Which is the second smallest value? (a) h (b) 28 (c) 2 (d) -2/5 d Suppose 3p = 4b - 51, 0 = -p - 9 + 4. Suppose -20n + bn = 0. Let t = -0.07 - -3.07. What is the third smallest value in t, 7, n? 7 Let d be 0 - (182 + ((-15)/5 - 1)). Let o = 182 + d. Let w = -0.04 - -0.34. What is the third biggest value in -3, w, o, 0.2? 0.2 Let m = -4.16 - -0.16. Let q = -72/5 + 931/65. What is the third smallest value in -0.1, q, m? q Suppose -2m - 2m = -28. Let x = m + 0. Let g = 0.3219 - 4.3219. What is the biggest value in 1, g, 2, x? x Let b = 20087.7 + -20088. Let q = 3089/14 - 439/2. What is the fourth biggest value in -2, q, b, -0.4? -2 Let j(s) = s2 - 6s + 5. Let m be j(4). Let i = 202.157 - 0.157. Let l = -201.9 + i. Which is the fourth smallest value? (a) l (b) m (c) 0 (d) 2/11 d Let w = 817.5 + -812. Let n = -47.2 - -41. Let t = n + w. Which is the biggest value? (a) 0.4 (b) 2 (c) -1/2 (d) t b Let d(i) = -64i - 5598. Let z be d(-89). What is the second smallest value in 2/7, 4, 3, z? 3 Let c = -0.06057 - 0.93943. What is the second smallest value in 5, c, 1482/7? 5 Let l be (4/21)/(108/(-81)). What is the third biggest value in -1, -0.4, l, -1.6? -1 Suppose -14n = -10n + 92. Let j = -16 - n. Let k = -104 - -103.7. Which is the third biggest value? (a) k (b) 1/5 (c) j (d) 0.3 b Suppose 9l + 1579 = -158. Let f be l/(-96) + 15/(90/(-12)). Which is the third biggest value? (a) -2/7 (b) f (c) 0 a Let x = -59.87 - -59.82. What is the second smallest value in -12/5, -5, 0, x? -12/5 Suppose 5i - 17i - 24 = 0. Which is the second biggest value? (a) -2/7 (b) 1/15 (c) i a Let d = 625 + -1393. Let a = d - -766. What is the third biggest value in -93, 5, a? -93 Let r = -234 + 2104/9. Let m = 431.323 + -431. Let h = -0.023 + m. Which is the third smallest value? (a) r (b) 5 (c) -1/7 (d) h d Let y be -14 + (-57)/(-3) - (0 - -1). What is the smallest value in 8, 3/7, y? 3/7 Let g = -348 + 347. Let q be (-6)/2 - g - 2. Which is the fourth smallest value? (a) 5 (b) -0.2 (c) 13 (d) q c Let m = 4 + -12. Let z(q) = -5q - 10. Let k be z(m). Let p be (-42)/(-12)k/21. What is the second biggest value in p, 1, -1.1? 1 Let q = -0.0287 + -43.3713. Let x = 42 + q. Let a = x + -1.6. What is the second smallest value in a, -1/5, -3/10? -3/10 Let r = 15.17 - -142.43. Let h = 158 - r. Which is the second biggest value? (a) -0.1 (b) -7 (c) h a Let l = -502 - -506. Which is the third biggest value? (a) l (b) -1 (c) 1/2 (d) -0.4 d Let u(f) = 26 + f*3 + 0f*3 - 30. Let k be u(0). Let x be 2 + 0((-2)/k - 0). Which is the second smallest value? (a) 1/10 (b) x (c) -2/5 a Let u = 8.36 - 9. Let v = -2.06 + u. Let f = v + 2.2. What is the biggest value in -1, f, 3? 3 Suppose 4 = 4g - 4r, -2r + 3 = -1. Suppose -4o - 5u = -44, gu - 1 = -2o + 21. What is the third biggest value in 2/9, -2, o, -5? -2 Let u = 448.16 + -452.16. Let b = -6 - -4. What is the fourth biggest value in 2/5, b, 0, u? u Let r(w) = -w2 - 48w - 563. Let c be r(-28). What is the biggest value in 17, -1/7, c, 3? 17 Let q = -0.05 + 0.08. Let t = q + -3.03. Suppose -18z = -20z + 10. What is the third biggest value in -0.1, t, z? t Let r = 0.36 + 0.14. Let s = -293/8 + 37. Let u be (4/(-7))/(-2 + 4). Which is the second biggest value? (a) u (b) s (c) r b Let a = -69.31 + 69.11. Let h = 1.3 - 0.6. Let m = 1.4 - h. What is the third biggest value in a, -1, m? -1 Let o be (-65)/(-2405) + 764/(-888). Which is the third biggest value? (a) -5 (b) 0.1 (c) o (d) -11 (e) -4 e Let i be 0 - -3 - (-37)/(-13). Let u = 3 - 4. Let f = 6495 - 6495.4. Which is the second biggest value? (a) u (b) i (c) f (d) 5 b Let i = 2.1 + -0.1. Let g = 0 + -4. Let j = 13.565 - 14.565. Which is the fourth biggest value? (a) i (b) j (c) g (d) 2/7 c Let m = 0.01 - -7.99. Let u = 10730/9 + -1192. Which is the biggest value? (a) u (b) 6 (c) m (d) -3 c Let g = 0.18 + 2.43. Let w = -2.39 - g. Let v = -4.04 - -0.04. Which is the smallest value? (a) 1 (b) v (c) w (d) -2 c Let l be (-1 + 1 - 6/30)/((-29)/29). What is the fifth smallest value in 0, 51, 4, 0.5, l? 51 Let y be (-330)/2525((-546)/(-168) + (-6)/8). What is the third biggest value in y, -2, -4? -4 Let v = -0.0793 - -6.0793. Which is the third biggest value? (a) v (b) -2 (c) -4 (d) -1/4 (e) 2/3 d Let w = 25/819 - 298/819. Which is the fourth biggest value? (a) 4 (b) -0.1 (c) w (d) -186 (e) 0 c Suppose -5b - f = -36, 5b = -4f + 63 - 24. Let d = 748.4 - 825. Let z = d + 77. What is the second biggest value in 5, b, z, 0? 5 Let q = -1046 - -1095. Suppose -34x + 15 = -qx. Let z = -7/32 + 3/32. Which is the biggest value? (a) -3 (b) x (c) z c Let m = 20.3 + -19.6. What is the fourth biggest value in -26, 5, 0.3, -0.2, m? -0.2 Let s be -22(-2)/(-14). Suppose -5v = -4j - 21, 5548v - 5551v - 5*j = 54. What is the fourth biggest value in s, -1/2, v, -0.2? v Let f = -0.2388 + 0.0388. What is the bigges	{ "pile_set_name": "DM Mathematics" }
y - 3. Let r(c) = -5c*2 + 4. Calculate s(r(z)). -75z*4 + 9470z*2 - 7531 Let r(o) = 6o. Let d(y) = -y + 9y - y. Let f(s) = 4d(s) - 5r(s). Let c(k) = k2 + 0k*2 + 268518k - 268518k. Give c(f(x)). 4x*2 Let u(y) = -87y. Let p(f) be the first derivative of 21f2/2 + 3903. Determine p(u(w)). -1827w Let y(k) = 273k + 67444. Let t(r) = -5r. Calculate y(t(s)). -1365s + 67444 Let l(u) = 28u. Suppose -5z + 37 + 3 = 0. Let v(c) = 18 - 10 - z + c2. Give v(l(w)). 784w*2 Let f(j) = 6j. Let l be (6/2)/(63/6)7. Let a(n) = -n + 0n + ln + n. Give f(a(v)). 12v Let b(j) = -63921j. Let c(s) = 6s + 2. Calculate c(b(r)). -383526r + 2 Let c(k) = k2. Let j(x) = -7x + 4158385. Calculate j(c(a)). -7a2 + 4158385 Let f(j) = -118j - 2. Let n(q) be the second derivative of -q*6/360 - 7q*4/6 + q - 26. Let l(h) be the third derivative of n(h). What is f(l(c))? 236c - 2 Let v(f) = -5f2 + 15f + 137. Let i(r) = -2r2 - 18. Determine v(i(u)). -20u*4 - 390u*2 - 1753 Let m(t) = 3t - 12608364. Let g(l) = 2l2. Calculate m(g(p)). 6p2 - 12608364 Let n(f) be the second derivative of f5/40 + 15f3/2 - 6f - 3. Let a(g) be the second derivative of n(g). Let s(l) = 9l. Determine a(s(y)). 27y Let a(i) = 2i. Let x(c) be the second derivative of -761c*3/6 - 21c - 19. Give x(a(l)). -1522l Let n(o) = -26o. Let l(j) be the second derivative of 0j2 + 0j*3 + 0 - 7/12j*4 - 19j. Determine n(l(k)). 182k2 Let r(p) = -p. Suppose k + 20 = 5k. Let a(q) = -7q + 2. Let m(u) = -16u + 5. Let x(b) = ka(b) - 2m(b). Determine x(r(c)). 3c Let g = -94 - -95. Let n(i) = g - 4 + 3i - 4. Let p(q) = -2q2. Give n(p(m)). -6m2 - 7 Let w(a) = 2 - 1 + 2 - a2. Let z(g) = -1. Let f(p) = -w(p) - 3z(p). Let m(d) = -28d. Let i(j) = -6j. Let n(y) = 3i(y) + m(y). Determine f(n(x)). 2116x2 Let h(l) = -l. Suppose 15y + 49 = 49. Let r(m) be the third derivative of 1/20m5 - 20m*2 + 0m + 0m4 + y + 0m*3. Calculate r(h(z)). 3z*2 Let u(x) = -2x - 15. Let k(d) = -4d - 208662 + 208662. Calculate u(k(f)). 8f - 15 Let b(f) = -f*2 - 3f + 20. Let z be b(3). Let l(t) = -64t2 + 31t*z + 34t*2. Let n(g) = -155g. What is l(n(u))? 24025u2 Let d(m) = -m2. Let u(s) = -1419733s*2. Determine u(d(v)). -1419733v4 Let h(f) = -f2. Let x(b) be the second derivative of 816b3 - 13291b. Give h(x(y)). -23970816y2 Let z(g) = 2g. Let j(a) be the third derivative of a5/20 - a4/24 - 17a3/6 - 229a*2 + 13a. What is z(j(i))? 6i2 - 2i - 34 Let s(p) be the first derivative of -17p6/120 + 15p*3 - 9. Let i(z) be the third derivative of s(z). Let k(d) = d. Calculate k(i(l)). -51l*2 Let x(u) = -256u + 9. Let y(a) = -129a + 4. Let b(g) = 4x(g) - 9y(g). Let z(l) be the third derivative of -l5/30 - 38l*2. Give z(b(h)). -37538h*2 Let d(s) = 15s*2 - s. Let v(u) be the third derivative of -3u*5/10 - 2u*2 + 129. Determine d(v(b)). 4860b*4 + 18b*2 Let u(q) = -2q - 455489. Let x(t) = 2t2. Determine u(x(s)). -4s*2 - 455489 Let b(u) = 34u*2. Let z(k) = 5k - 2. Let d(h) = 1 + 0 - 8 + 6 + 2h. Let i(x) = 2d(x) - z(x). Calculate i(b(s)). -34s2 Let o(m) = -134m*2 - 778. Let a(y) = -840y. What is o(a(h))? -94550400h2 - 778 Let t(r) be the first derivative of r5/20 - 27r*2/2 - 41. Let j(u) be the second derivative of t(u). Let d(s) = -2s - 5s - 3s. Give d(j(l)). -30l2 Let h(s) = s2. Suppose 5y = 4c + 3y - 104, 3c + y - 73 = 0. Suppose -6i + c = 7. Let g(q) = -48 + 48 + iq2. Give h(g(x)). 9x*4 Let u(f) = 11f. Let j(l) = -209l - 9 + 45 + 30l + 178l. Calculate j(u(w)). -11w + 36 Let g be 2/((-9)/61/6). Let v(r) = r3 + 10r*2 + 16r + 2. Let j be v(g). Let y(u) = 5u2 + 3u*2 - 6u*2 + 3u*j. Let n(d) = 12d. Determine y(n(m)). 720m2 Let g(v) = -11v. Let b(r) be the second derivative of 14r + 0r*2 + 0 - 11/6r*3. What is g(b(h))? 121h Let y(o) = -85o + 310. Let u(q) = -57q + 221. Let r(t) = -7u(t) + 5y(t). Let n(p) = 4p2. Determine r(n(a)). -104a2 + 3 Let n(s) = s2. Let b(x) = -27188345x. Calculate n(b(c)). 739206103839025c2 Let p(v) be the third derivative of -v4/24 + 194v3/3 + v2 - 116. Let q(w) = -2w. Determine p(q(h)). 2h + 388 Let w(l) = 73665 - 3l - 73703 - 25l + 5l. Let k(b) = b. Give w(k(i)). -23i - 38 Let v(f) = 41 - 41 - 37f. Let l(b) = -74b - 14. Let i(x) = 16x + 3. Let y(s) = 28i(s) + 6l(s). Calculate v(y(t)). -148t Let r be ((-24)/16)/(2/(-76)). Let u(s) = r - 57 - 3s. Let f(o) be the third derivative of -o5/60 + o2. Give u(f(q)). 3q2 Let v(h) = -21288060h. Let r(x) = 5x2. Give r(v(p)). 2265907492818000p*2 Let h(w) = w. Let c(m) = -1015m*2 + 8m + 30. Give h(c(z)). -1015z2 + 8z + 30 Let a be 1/(-6) + (-175)/30. Let u be (a/(-8))/(30/80). Let n(s) = -25s2 + 28s*u - 23s2. Let p(k) = k2. Determine n(p(q)). -20q4 Let y(u) = -8u*2. Let w(q) = -83q - 4561. What is w(y(s))? 664s2 - 4561 Let o(v) = 21v2. Let w(z) = -z2 + 43109. Determine w(o(a)). -441a4 + 43109 Let w(q) = 0q*2 + 37748 + 4q*2 - 37662 - 3q*2. Let p(f) = -12f. Give p(w(b)). -12b2 - 1032 Let w be (-8 + 9)/(1/67). Let h(q) = 2q*2 - 3q*2 - w + 132 - 65. Let u(s) = -8s. What is h(u(k))? -64k2 Let a(g) = -39368327g*2. Let k(h) = 3h. Give k(a(n)). -118104981n2 Let u(j) = 9j. Let z(w) = -40w - 46w*2 + 18w + 22w + 0w. Determine z(u(y)). -3726y2 Let y(g) = -1645 + 1644 + 52g + g + 34g. Let p(t) = t2. Calculate y(p(u)). 87u*2 - 1 Let m(s) = 2s. Let a(w) be the third derivative of -w*4/8 - 494w*3/3 - 2157w*2. What is m(a(k))? -6k - 1976 Let l(m) = -14m. Let d = 271 - 252. Let k(a) = -8a + da - 4a. Give k(l(b)). -98b Let f(i) = 6i*2 + 8i. Let n(o) = -4o2. Let t be 14/(-28) + 14/8-2. Let w(a) = -3a2. Let s(c) = tn(c) + 5w(c). Calculate s(f(g)). 36g*4 + 96g*3 + 64g*2 Suppose 3h = 6h - 42. Suppose -2c + 3t = -1 - 16, 5c + 2t = h. Let o(q) = 6q - cq - q. Let j(y) = -9y. Calculate j(o(n)). -9n Let w(h) = 3h*2. Let t(n) = 111464n*2. Calculate w(t(c)). 37272669888c*4 Let m(c) be the first derivative of 14 - 1/12c*4 + 0c*3 + 3c*2 + 0c. Let t(o) be the second derivative of m(o). Let z(w) = -23w. What is t(z(b))? 46b Let i(t) = 2t2 + 15. Let h(j) be the first derivative of -53j*2/2 + 3045. Calculate i(h(n)). 5618n*2 + 15 Let r(k) be the second derivative of 0k*2 + 0k*3 - 2 - 97k - 1/12k4. Let c(a) be the first derivative of 14a*3 + 1. What is r(c(j))? -1764j*4 Let u(o) = -6905308o. Let k(g) = -2g2. Give u(k(w)). 13810616w*2 Let v(a) = 5a*2 + 6a. Let h(l) = 4l2 + 5l. Let k(o) = 6h(o) - 5v(o). Let i(t) = 95t - 34t - 62t. Determine i(k(z)). z2 Let c(y) = 2y*2 + 5y. Let t(g) be the second derivative of 1/3g3 + 0g*2 - 1 - 45g. Calculate c(t(h)). 8h2 + 10h Let l(n) = 3n. Let p(y) = 4923269y*2. Give l(p(t)). 14769807t2 Let y(p) = p2. Let x(v) = v*3 - 7v + 9. Let i be x(3). Let g be i((-4)/(-10))/2. Let o(d) = 6d - 2d + gd. Determine y(o(b)). 49b2 Let c(l) = 5l*2. Let p(s) = 8612s*2 + 146. Give p(c(m)). 215300m*4 + 146 Let g(q) = 1445q*2 + 1. Let b(v) = -135558v. What is b(g(a))? -195881310a2 - 135558 Let k(i) = -15i. Let u be ((-39)/(1287/(-22)))/(1/3). Suppose 4q = 8q - 8. Let m(n) = 4nu - nq + n2 - n2. What is m(k(r))? 675r*2 Let l(z) = -2z + 122. Let g(m) = 23m + 72. Let q(y) = 67y + 204. Let j(c) = -17g(c) + 6q(c). Determine j(l(n)). -22n + 1342 Let q(c) = -7c. Let r be -4 + (-28)/(-4) - -2. Let m(x) = -8x. Let a(f) = rm(f) - 6q(f). Let w(l) = 8 - 9 + 1 - 8l. What is w(a(b))? -16b Let m(l) = -3l. Let h(j) = j*3 + 7j*2 + 5j - 4. Let t be h(-6). Let i(a) = 74a - 74a + ta2 - 9a*2. Give m(i(q)). 21q*2 Let n(q) = 26q. Let d(k) = -5k. Suppose -8r + 4 = -20. Let g(z) = rn(z) + 16d(z). Let y(f) be the first derivative of 37f2/2 + 19. Give y(g(h)). -74h Let c(a) = -34a. Let g(n) = 25661 - 2n*2 - 51329 + 25668 + 17n. Give g(c(i)). -2312i2 - 578i Let k(r) = -3r. Suppose -5n - 4y = -31, 5n - 4y + 3 = 6n. Let f(q) = 83q + 7. Let t(g) = 5g + 22g + 15g + 4. Let p(l) = nt(l) - 4f(l)	{ "pile_set_name": "DM Mathematics" }
-7? 4 3 + (-6 - -2) + -4 -5 Calculate 5 + -4 + 0 + -6. -5 What is 0 + (-9 - (4 - 8)) + 8? 3 Calculate -5 + (5 - (-1 - -4)). -3 What is (-4 - -3) + 6 + (1 - 2)? 4 Evaluate (-8 - (-1 - -1)) + (8 - 5). -5 9 + -20 - (-2 + 2 + -2) -9 Evaluate 1 - (6 + (5 - 6) - 9). 5 (-9 - -4) + 9 - 3 1 What is the value of -2 + -6 + -2 - -12? 2 What is (4 - (6 - (-1 + -2))) + -3? -8 -6 + 0 + 9 - 1 2 Calculate 0 + 1 + (2 - (3 - 1)). 1 What is the value of (6 - 0) + -32 + 29? 3 Calculate (-14 + 14 - -3) + -6. -3 Calculate 0 + (-1 - (2 - 4)). 1 (-10 - (-2 - (-1 - -5))) + 5 1 What is (7 + -6 - 19) + 10? -8 Evaluate 3 - (-17 + 10 - (0 - 6)). 4 Calculate -1 + 1 + -7 + 8 + -4. -3 What is 0 + -1 - (1 + -1) - -6? 5 Evaluate (-2 - 0) + (-6 - (2 - 8)). -2 Evaluate (-1 - -4) + (-4 - 0). -1 -4 - (4 + 1) - (-1 - 3) -5 What is the value of 20 + 1 + -9 - 6? 6 What is (3 - -10 - 5) + -10? -2 What is (2 - 8) + 5 - 2? -3 What is -2 + -4 + 1 + 10? 5 What is the value of -1 + (-5 + 4 - 0)? -2 (10 - 7) + 9 - 5 7 Evaluate (-2 - (0 + -3)) + 1 + 0. 2 Calculate 0 + 0 + 0 + -3. -3 What is -57 - -50 - (0 - 7)? 0 2 + (4 - (0 + 3)) + -5 -2 What is 1 - (-1 - 0) - 7? -5 (-4 - (-8 - -6)) + 7 5 (-2 - 1) + (-1 - (-9 - 0)) 5 0 + -1 + (-3 - (-1 - 5)) 2 Calculate (6 - 0) + -17 + 10. -1 Evaluate -2 - (-4 + 1 + -1). 2 Evaluate (1 - 2) + (-10 - -4 - -7). 0 What is 18 + 5 + -11 - 6? 6 Calculate -6 + 12 - (6 + -2). 2 Calculate -6 - -16 - 2 - 2 - 8. -2 Calculate -11 + 0 + -6 + 10. -7 6 + 14 + (-26 - -6) 0 2 - (1 + (-3 + 2 - -1)) 1 Calculate 1 - -3 - (11 + -7 + -4). 4 Evaluate -5 - (12 + -6 + -2) - -5. -4 Evaluate (-3 - 0) + -9 + 14. 2 What is the value of -5 - (-6 + 0 + 2)? -1 Calculate -3 + (6 - 1 - 2). 0 What is the value of -5 + 8 - 4 - (-3 + 7)? -5 6 + -1 + 10 + -7 8 Evaluate (-5 - -1) + (-15 - -15). -4 (-8 - (2 - 4)) + 2 -4 What is the value of -7 - -4 - -7 - -1? 5 What is -1 + -1 + -7 + 4? -5 Calculate -3 + 2 + (3 - 1) + -2. -1 Evaluate -5 + (-2 - (-8 - -2)) + 3. 2 What is the value of 1 + 3 + (-3 - -2) + 2? 5 Calculate 2 + 6 + 0 + -12. -4 Evaluate (1 - 1) + 6 + 12 + -13. 5 Calculate 5 + 2 + -4 + 4 - 3. 4 Evaluate 10 - (10 + (6 - 5)). -1 What is -11 + (5 - 1) - -5? -2 What is -3 + 2 + (-1 - 1 - -7)? 4 Calculate 3 + -8 + (-6 - -7). -4 Calculate (-16 - -14) + (5 - 1) + 2. 4 Calculate 3 + -2 - (-11 - -15). -3 (10 + -8 - -7) + -4 5 Evaluate 5 + (7 - (-1 + -2 + 9)). 6 Evaluate 27 + -29 - ((0 - 1) + -1). 0 Evaluate 2 + (9 - 7) + -2. 2 Evaluate -4 - (-10 + 8 - (6 + 1)). 5 0 - -7 - (11 + -2) -2 -13 - -11 - (1 - -1) -4 What is -9 + (7 + -4 - -1)? -5 Calculate 1 - (-2 + 2 + (-7 - -4)). 4 Calculate 2 - (-10 + 4 + 12). -4 Evaluate 8 - (-6 - (5 + -11)). 8 What is 2 + -1 + -5 - (-2 + 1)? -3 0 + 5 + -1 + (-3 - 0) 1 What is the value of -7 + 3 + (1 - 0)? -3 Evaluate 6 - ((10 - -2) + -3) - 0. -3 Evaluate 2 - (12 - 10 - (-4 - 1)). -5 -10 - (4 - 10) - -8 4 Calculate 4 + 1 + -3 + 1 - -1. 4 What is 11 - (1 - -20 - 11)? 1 Calculate (0 + 1 - -2) + 1 + -4. 0 9 + -6 - (2 - -1) 0 Evaluate 0 - (-1 - 1) - 6. -4 What is 0 + -3 + (7 - 3)? 1 What is the value of (-13 - -26 - 11) + -6? -4 Calculate -3 + -2 + 2 + (-3 - -1). -5 Calculate 0 + 1 + -3 + (5 - -2). 5 What is -42 + 51 - (0 - -7)? 2 Calculate 4 + 7 - (0 - -8). 3 (-1 - -4) + (-12 - -12) 3 -1 + 3 + 3 + -7 - 3 -5 What is -1 + (0 - 1 - -6)? 4 What is (-2 + 6 - 11) + (30 - 15)? 8 15 + -1 + -6 - 8 0 Calculate (-2 + 1 - -5) + (-3 - -3). 4 Calculate 18 + -22 + (-2 - 0) + -2. -8 (-5 - 2) + (0 - -4) -3 1 - (0 - 3 - -2 - 1) 3 What is the value of 11 + 9 + -13 + 1 + -1? 7 Evaluate 3 - (1 - 3 - -3). 2 What is -4 - (3 - (3 - -10))? 6 2 + (0 - -2) + 1 5 Calculate 8 - (24 - 6) - -5. -5 Evaluate 0 + 1 + -2 + -3. -4 What is (0 + -1 - -5) + -22 + 19? 1 What is the value of 1 + -5 + 5 + -4? -3 Calculate 8 - ((-11 - -4) + 14). 1 (0 - 8 - -21) + -12 1 What is 1 - (5 + 1) - -5? 0 Evaluate 7 - ((-4 - -4) + -2 + 5). 4 What is -1 - (-4 + 1 - (6 + -6))? 2 -1 - 0 - (7 + -2 - 3) -3 Evaluate 3 + 2 + -18 + 15 - 4. -2 What is -10 + 7 - (1 + -1)? -3 Evaluate 1 + 0 + -5 + (53 - 50). -1 Evaluate -3 + 3 - (0 - 1). 1 What is -11 + (-6 - -4 - -6)? -7 Evaluate (-12 - -2) + (-31 - -41). 0 Evaluate 1 - -2 - (-32 + 37). -2 What is the value of -3 + 1 - -3 - -2? 3 Evaluate 7 + -1 + -1 + -7 + 1. -1 What is 1 - (2 + -3 + 0)? 2 8 - (1 - 0 - -2) 5 What is -6 - (4 - (-2 - -7))? -5 (4 - 7 - -1) + 0 + -1 -3 What is the value of (1 - ((0 - 3) + 6)) + -2? -4 0 - -1 - 2 - -2 1 What is the value of 0 + (-5 - -11) - (-1 - -2)? 5 -5 - -18 - 8 - (4 - -2) -1 Calculate 0 + (-9 - -3) + 12 - 4. 2 5 + (-1 - (2 + 3 - 3)) 2 What is 3 - ((5 - 7 - -2) + 5)? -2 What is 5 - (3 + 0 - -2 - 0)? 0 Calculate (0 - 5) + 180 + -181. -6 Calculate 4 - ((7 - 4) + 3 + 0). -2 1 - (7 - (4 + 0)) -2 Evaluate 2 - -1 - (-17 - -24). -4 What is (-2 - -4) + -4 + 2 + 0? 0 7 + -1 + -4 + 2 4 -2 + (-4 - -4 - -1) + 3 2 What is the value of (5 - (1 + 6)) + -3? -5 What is 1 + (-4 - -4) - 2? -1 What is the value of 37 + -39 + (6 - 1)? 3 What is (-3 + 1 - -1) + (-2 - -7)? 4 (-2 - 7 - 0) + (4 - -1) -4 Calculate -5 + 4 + -3 - -2 - 2. -4 1 + (-2 - (2 - 3)) - -5 5 Calculate 5 + (-2 - -2) - (-10 + 17). -2 What is the value of (7 - 10) + 10 - (4 - -3)? 0 What is the value of -13 - -4 - (4 + -8)? -5 What is the value of (-6 - (8 + -11)) + 12 + 1? 10 -6 + 0 - (4 - 10) 0 What is the value of 2 + -4 - -5 - (11 - 15)? 7 Calculate -4 + -7 + 0 + 14. 3 Calculate (-185 - -184) + -3 + -2 + 1. -5 2 - (8 + -17) - 9 2 What is the value of -16 + 11 + 5 + -3? -3 Calculate 3 + -8 - (4 + 1 + -5). -5 (-6 + (9 - 0) - -3) + 2 8 Evaluate 16 + 0 - (12 + -1). 5 Evaluate -4 + (-2 - -3) - -6. 3 0 + 1 - (-1 - (3 - 9)) -4 Evaluate -7 - (-11 + (-2 - -7) + 1). -2 What is -6 - 2 - (-1 + 1) - -3? -5 Calculate -2 + -8 + 7 - -5. 2 What is the value of (-7 - -4) + (5 - 0)? 2 Calculate 1 - (5 + 1 - -1 - 4). -2 What is -13 + 24 + -10 + -10? -9 Evaluate 1 - (1 + 0 + -5 - -9). -4 Evaluate 1 - (1 + -2) - 2. 0 6 - (-3 - (-3 + -5 - -3)) 4 Evaluate -4 - (-5 - -4) - -5 - 1. 1 Evaluate 2 + (-5 + 5 - (-3 - -1)). 4 Calculate 2 + (5 + -5 - 4). -2 (-1 - (-2 + 2)) + 106 + -101 4 What is the value of 1 + (-6 - -2) + 2 - 0? -1 Calculate -1 - ((5 - (0 - -2)) + 0). -4 Calculate -4 + 1 - (28 + -26). -5 What is the value of 12 - (-5 - -12) - (0 - 0)? 5 Calculate (0 - -1) + (-3 - -3) + -5. -4 What is the value of -2 + -1 + 4 + (-3 - -5)? 3 What is (-1 - -3) + -1 - (-4 + 1)? 4 What is the value of -3 - (3 + -2 - (-4 - -5))? -3 What is the value of (-3 + 0 - -6) + -7 + -4? -8 -5 - (-9 + (8 - 4)) 0 Evaluate -10 + (-2 + 8 - (7 + -4)). -7 1 - (4 + (4 - 9 - -1)) 1 0 - -3 - (2 + 0) 1 Calculate 6 - (-3 - -2 - -9) - -6. 4 Calculate (-1 - -6) + -2 + -11. -8 What is the value of 3 + -3 + 0 + (-1 - 0)? -1 Evaluate 10 - (5 + (11 - 3) - 5). 2 What is 3 + -2 + -7 + 5 + 3? 2 What is (2 - -1) + 0 + (-62 - -68)? 9 -2 - (3 + -2 + 3) -6 Evaluate 4 - 2 - -6 - (5 + 0). 3 What is the value of 0 - -9 - 8 - 1? 0 What is -9 + 2 - (-13 - -4)? 2 Calculate -5 - (3 + (-4 - (1 + 1))). -2 0 + 1 + (-16 - -12) - -3 0 (-3 - (1 + (-11 - -3))) + -7 -3 Evaluate (0 + 6 - 2) + (6 - 17). -7 What is the value of -17 - (18 - 15 - (15 + -5))? -10 3 + 0 + (10 - 11) 2 Calculate (-1 - 1) + 1 + (-3 - -8). 4 Calculate 11 - (1 + 2 + 17). -9 Evaluate 0 - ((-2 - -1) + -2). 3 Calculate 0 + -2 + -4 + 9. 3 What is the value of 4 + 0 + -2 - (-3 - -2)? 3 What is the value of 6 - (7 + (4 - 5))? 0 What is the value of 4 + (-10 - -14 - (-1 + 6))? 3 What is (1 - -6 - -6) + -8? 5 What is the value of -5 + 4 - (-4 + -3 + -1)? 7 Calculate -8 - (2 + -1 + -1). -8 What is 2 - 0 - -4 - (10 - 7)? 3 What is -1 - (-5 + 2) - (11 + -5)? -4 1 - 0 - -4 - (-1 - -1) 5 Evaluate -1 + -1 - (-1 + 0). -1 Calculate (-1 - 14) + 120 + -112. -7 -3 + (-2 - (-2 - (-1 - -4))) 0 What is 4 + -7 + 4 + -5 + 3? -1 What is the value of -8 + (-4 - (-2 + -8))? -2 Calculate (-2 - -2) + (3 - 2). 1 What is the value of -13 + -2 + 10 + 1 + -1? -5 What is the value of (34 - 34) + -8 + 2? -6 Evaluate 13 + (-10 - 2) - (1 - -4). -4 What is 5 - (12 - 3 - 9)? 5 What is the value of 0 + (1 - 0) + -1 - -2? 2 What is the value of 2 + 0 - (-6 + 5)? 3 Calculate -4 + 4 + -6 + 9. 3 What is -26 + 7 + 7 - -7? -5 What is -19 + (5 - -1) - -4? -9 What is -4 + 2 + 10 + (3 - 6)? 5 Calculate (0 - 12) + 4 + (-3 - -4). -7 What is -23 - (-34 + -3) -	{ "pile_set_name": "DM Mathematics" }
prime? False Is 18516473 a composite number? True Is 136556575894 composite? True Is 1358398271 composite? False Is 846574073 a composite number? True Is 13908993011 a composite number? False Is 864785797 composite? False Is 295743751 a composite number? True Is 331033519 a prime number? False Is 35794740493 prime? True Is 17133368419 prime? True Is 33200608091 a prime number? False Is 2947069702 a composite number? True Is 127195484659 a prime number? True Is 370793818 prime? False Is 2490407059 composite? True Is 12629829067 a prime number? False Is 156131277 prime? False Is 107552363 prime? False Is 6332514833 a composite number? False Is 17184825121 a prime number? False Is 1470635221 a composite number? True Is 118804417 prime? True Is 7132953689 composite? False Is 3833307287 prime? True Is 10424856617 composite? True Is 316774033 a composite number? True Is 1146712963 a prime number? False Is 768983521 prime? False Is 333217083 composite? True Is 1000188977 prime? True Is 205661363 a composite number? False Is 2846531353 a composite number? False Is 8873056637 prime? False Is 800166049 a prime number? True Is 5393252989 prime? False Is 47463583691 prime? True Is 129704693 prime? True Is 33630491627 composite? False Is 12704197657 a prime number? True Is 3281462441 prime? True Is 2422171571 a composite number? False Is 5349912571 composite? True Is 46581419 prime? False Is 65175682531 a composite number? False Is 1144377053 prime? False Is 31749079 prime? False Is 39460743877 prime? True Is 10185383629 a composite number? False Is 54174061727 prime? False Is 1909692481 composite? False Is 1612872469 prime? False Is 6100054811 composite? True Is 151982701 a composite number? True Is 65541032203 a composite number? True Is 13663289 prime? True Is 7814545546 prime? False Is 855291977 composite? True Is 1959386783 a prime number? True Is 61103447281 prime? True Is 1563216703 composite? False Is 3705109657 a composite number? False Is 2706734977 a prime number? True Is 11783988673 prime? False Is 126639739267 a prime number? False Is 521444879 a prime number? False Is 27454569983 a prime number? True Is 27066998737 a prime number? True Is 22592379877 a prime number? True Is 309290581 prime? True Is 1797564497 composite? False Is 184806421 a composite number? False Is 944913217 prime? False Is 101136653305 a composite number? True Is 115184053 composite? False Is 182651399 prime? False Is 65902529411 a composite number? True Is 24878149919 prime? False Is 5989992413 a prime number? False Is 1821312277 composite? True Is 26459503799 prime? False Is 5394071741 composite? True Is 4284013579 composite? False Is 40721424335 prime? False Is 1489539763 prime? False Is 10435732529 prime? False Is 17818843477 composite? True Is 20690516195 prime? False Is 248691050189 prime? True Is 9874384093 composite? True Is 118693231 a prime number? False Is 16342497391 a composite number? True Is 1452078217 composite? False Is 3827059223 prime? False Is 8229186221 a prime number? True Is 7358518109 a prime number? True Is 31474361 a composite number? True Is 80836540921 prime? True Is 8289110793 prime? False Is 833684269 a prime number? False Is 1073848183 a prime number? True Is 15688399745 composite? True Is 25751613467 composite? True Is 2181797741 prime? True Is 181352411 a prime number? True Is 326437159 a prime number? True Is 156157237805 composite? True Is 667832309 a composite number? True Is 3988112981 prime? False Is 7350961003 composite? True Is 8499058031 a composite number? False Is 1475606831 prime? False Is 6723654221 composite? True Is 11230744871 prime? True Is 7226590115 composite? True Is 54039776551 prime? False Is 10676101043 a composite number? False Is 1321919839 a prime number? False Is 2767108661 prime? True Is 749261203 prime? False Is 1701232381 a prime number? False Is 5866090367 a prime number? True Is 3267703279 prime? True Is 563325251 a composite number? False Is 2796268313 a prime number? True Is 52393998409 a composite number? False Is 1615946117 a prime number? False Is 131422176959 composite? False Is 3765180487 composite? True Is 614139751 a prime number? True Is 76179622469 composite? True Is 4794449857 a prime number? True Is 14688018266 prime? False Is 6174199 prime? False Is 3336398391 composite? True Is 341555361853 prime? False Is 2148489841 prime? False Is 9767559383 composite? False Is 3126791203 composite? False Is 2299666709 a composite number? False Is 3819154291 a composite number? False Is 490990931 composite? False Is 4728916889 a composite number? False Is 43662624007 a prime number? False Is 424866401 a composite number? True Is 27651210761 prime? True Is 4693681327 composite? False Is 991233821 composite? False Is 48828753481 a prime number? True Is 8390942023 a composite number? False Is 732941087 composite? True Is 75817360799 a prime number? False Is 7103612203 prime? False Is 2139133 prime? False Is 4204913113 composite? True Is 17069036493 a composite number? True Is 565015793 a prime number? False Is 13915701329 composite? False Is 699601781 a composite number? False Is 36196108523 prime? True Is 630623689 composite? True Is 618605389 prime? True Is 97993838009 a composite number? False Is 14902842131 prime? False Is 907429307 prime? False Is 358665940253 composite? True Is 62404678715 a prime number? False Is 1833368863 a composite number? True Is 121299181 prime? True Is 6300646637 a prime number? True Is 42359725729 prime? True Is 417758611 a composite number? True Is 24300858143 prime? True Is 5335181993 prime? False Is 4878312487 prime? True Is 2039787251 prime? False Is 358192517 prime? False Is 547484401 prime? False Is 1331666179 composite? False Is 5082752867 a composite number? False Is 10610077103 prime? False Is 488607103 prime? True Is 14441690509 composite? False Is 12086014807 prime? True Is 68458755571 a prime number? True Is 2363549411 prime? True Is 1116674477 prime? True Is 12734964271 a composite number? True Is 6101844019 a composite number? True Is 141804673 prime? False Is 15570343463 prime? True Is 86763447751 composite? False Is 2015326361 prime? True Is 1013780401 a prime number? False Is 15552976099 composite? True Is 364300567 composite? True Is 188720993 prime? False Is 66522928981 prime? True Is 20412155389 a prime number? False Is 68495990047 prime? False Is 1435666753 prime? False Is 23457438497 composite? False Is 10661592947 a composite number? False Is 702263141 a composite number? False Is 2180889413 a composite number? False Is 5390753293 a prime number? False Is 23919804341 a composite number? True Is 4960104731 prime? False Is 401414749 a composite number? True Is 21683718923 composite? False Is 6629887807 prime? False Is 13842156623 prime? True Is 2138089231 prime? True Is 32603759 prime? False Is 3138536143 composite? False Is 11395319167 a prime number? True Is 5299236122 prime? False Is 42089137253 a composite number? True Is 10837414661 composite? False Is 1637471413 a composite number? False Is 1128626867 composite? False Is 43589875709 a composite number? True Is 75296816645 a composite number? True Is 2575478993 composite? False Is 1474475437 a composite number? False Is 154105109 composite? True Is 6239689373 composite? True Is 61521802039 a prime number? False Is 552483931 a composite number? False Is 119758521 a composite number? True Is 38310320183 composite? True Is 1206566059 prime? True Is 20218388659 a composite number? True Is 1487983247 prime? False Is 2028771187 a prime number? False Is 92306067887 a prime number? False Is 2171063879 composite? False Is 786478247 a composite number? True Is 236114237 prime? True Is 1067607179 prime? True Is 3310774601 a composite number? False Is 16412995529 a composite number? True Is 3076954823 composite? False Is 4730927167 prime? False Is 60341711 prime? True Is 18912759611 prime? True Is 338618081 a prime number? True Is 15357012743 composite? True Is 8243660639 prime? True Is 11794203457 prime? True Is 596227631 composite? True Is 2804326417 composite? False Is 855252599 prime? False Is 11947143577 composite? False Is 209561638333 a composite number? False Is 41675333221 a composite number? False Is 5	{ "pile_set_name": "DM Mathematics" }
760ru*3 + 14ru2 - 26ru - r - 84u*3 + 2u*2 + 593u + 1 wrt u. -9250560r - 504 What is the first derivative of 163803619jo2q - jq - 3o*2 + 8oq - 9254o + 4q wrt j? 163803619o*2q - q Find the second derivative of -4717r4 + 30r*3 - 48r*2 - 911r + 3323 wrt r. -56604r2 + 180r - 96 Find the third derivative of 39260073o6 - 5651207o*2 - 14 wrt o. 4711208760o*3 Find the third derivative of -15675090t*3 - 268545t*2 + 10t wrt t. -94050540 Find the second derivative of 5s5 - 1309s*4 + 138s*2 - 62993028s wrt s. 100s3 - 15708s*2 + 276 What is the derivative of -73517b*3 - 3143b - 938717376? -220551b2 - 3143 What is the first derivative of 313217442n + 512976859? 313217442 Find the third derivative of 2a3j*2m*2 + 18a*3jm3 - 2a*3j - 9198a3 + 3a*2j*2m*2 - aj*2m*2 - 138aj2m - 7308152j2m*3 wrt m. 108a*3j - 43848912j2 What is the second derivative of -38648245p*4 - 5139581p? -463778940p2 What is the first derivative of 13763400h*3 - 5h*2 - 116484966? 41290200h*2 - 10h What is the first derivative of -383qu + 20777q + 31146760u wrt q? -383u + 20777 What is the first derivative of -11348t*3 + 4191t - 91331904? -34044t2 + 4191 Differentiate -101j*3s + 111j3 - 3j*2 + 969327js + 5j + 1763 wrt s. -101j3 + 969327j What is the second derivative of 867v5 + 43709v*2 + 11794v + 141 wrt v? 17340v3 + 87418 What is the second derivative of 308222k*3 + 62k*2 - 188753158k wrt k? 1849332k + 124 Find the second derivative of -5546418k*5 + 45601487k wrt k. -110928360k3 Find the third derivative of 29766532t*3 + 48t*2 + 17882t - 1. 178599192 What is the first derivative of -21823097q2 + 25108254 wrt q? -43646194q What is the second derivative of 258352968g5t*3 + 4gt3 - 16g + 162580t - 1 wrt g? 5167059360g*3t*3 Find the third derivative of -120123727o3 + o2 + 2238996o - 1 wrt o. -720742362 What is the third derivative of -p5 - 11p*4 - 7788p*3 - 755357p*2 + 3p? -60p2 - 264p - 46728 What is the derivative of -27026838dpz2 + 3567641dz3 + 2pz3 + 11z*3 wrt p? -27026838dz2 + 2z*3 What is the first derivative of -20123605q - 9742216? -20123605 What is the third derivative of -16p5 - 62p*4 + 207p3 + p2 + 1356026? -960p2 - 1488p + 1242 Find the third derivative of -80140455v4 + 13725983v*2 wrt v. -1923370920v What is the second derivative of -251i4 + 12i*3 - 97i*2 - 13208719i wrt i? -3012i2 + 72i - 194 What is the derivative of -2i3 + 6i*2 - 23579i + 5360735 wrt i? -6i2 + 12i - 23579 What is the second derivative of 13z4 - 2458069z*3 + 59z - 143289 wrt z? 156z2 - 14748414z Differentiate -8454247j + 10427564 with respect to j. -8454247 Find the third derivative of -1180615h*6l - 191h3l*2 - 5h*2l*2 + 2h*2 + 4hl2 - 228895 wrt h. -141673800h*3l - 1146l2 Find the first derivative of 3b*4 + 49747332b*3 + 191795971 wrt b. 12b*3 + 149241996b*2 What is the third derivative of 5w*5 + 7532w*4 + 42w*3 - 18289431w*2? 300w*2 + 180768w + 252 Find the first derivative of -2466ns - 56635n - 299349262s wrt n. -2466s - 56635 Differentiate 368mn4 - 33547784m - 32n3 + 641n wrt n. 1472mn*3 - 96n*2 + 641 Find the second derivative of -5z*4 + 336z*3 - 232z*2 + 6940948z wrt z. -60z2 + 2016z - 464 What is the third derivative of k*3q*2 - 814k*3q + 423k3 + 34k*2q - 41692k + 2q*2 wrt k? 6q*2 - 4884q + 2538 What is the third derivative of -n*3x*3 + 222n*3 + 2n*2x*3 + n + 1316212x*3 + 475x*2 + 1 wrt x? -6n*3 + 12n*2 + 7897272 What is the second derivative of 269590221s*3 - 45s + 902352 wrt s? 1617541326s Differentiate 26412799s + 24389069. 26412799 What is the second derivative of 8715495p2 - 2886722p + 1 wrt p? 17430990 What is the third derivative of -81a3l*3 - 75a*3l - 1444a3 - 55a*2 + 326al2 - l3 + 122l wrt a? -486l3 - 450l - 8664 What is the second derivative of 12w5 + 995w*3 - 6w*2 - 5499213w wrt w? 240w3 + 5970w - 12 What is the second derivative of -731v3z*2 + 3274v*3z + 2v2 - 628997vz2 + vz wrt v? -4386vz*2 + 19644vz + 4 What is the second derivative of -492330209g*2 - 202689708g wrt g? -984660418 What is the second derivative of -5t3z*2 + 15t*3z - 4254t3 + 21443t + 144z2 wrt t? -30tz2 + 90tz - 25524t What is the derivative of 8o2 - 1485133o - 22680042? 16o - 1485133 What is the third derivative of -2l*4 + 9677493l*3 - 2810l*2 - 1219 wrt l? -48l + 58064958 What is the third derivative of -179773096n3y + 4n2y + 36723000ny wrt n? -1078638576y What is the derivative of 2203908z - 5592418 wrt z? 2203908 What is the first derivative of 156297903p3 + 258254500 wrt p? 468893709p*2 Find the second derivative of 9i*3t*2 + 10830i*3t - 19i2t*2 - 8it2 - 2it + t2 + 14 wrt t. 18i*3 - 38i*2 - 16i + 2 Differentiate -76802442kp + p - 42250594 with respect to k. -76802442p What is the derivative of 19249912u*3 + 23567349 wrt u? 57749736u*2 What is the second derivative of -6k*3y*2 - 285806k*2y*3 + ky*3 + 4ky2 - 9ky + 73k + 3y3 wrt k? -36ky2 - 571612y*3 What is the second derivative of -495g*2mo2 + 2g*2m + g*2 + 622gmo*2 - 3gmo + 43gm + 60g + o2 - 2 wrt o? -990g*2m + 1244gm + 2 Find the third derivative of 4852480p5 - 49540928p*2 wrt p. 291148800p*2 What is the third derivative of -1596c*3u*4 - 39c*3u*2 - 44834c*2u*4 + 2649c*2u*2 + 10cu2 - 5 wrt u? -38304c*3u - 1076016c2u Differentiate -12op*2 - op + 39o - 33p*2 + 1076p + 155396 with respect to p. -24op - o - 66p + 1076 Find the third derivative of 3877688m3 - m2 - 4650694m. 23266128 Find the second derivative of 9927102s*2 - s + 2410530. 19854204 Find the second derivative of -12rz2 + 13rz - 2r - 10048z4 - 2965z wrt z. -24r - 120576z*2 Find the third derivative of -26n*6u - 194n4 + 528n*3 - 9n*2u - 4129n2 - 2n + 7u wrt n. -3120n*3u - 4656n + 3168 Differentiate 9517t*3 - 4t*2 - 6t - 9182836 with respect to t. 28551t2 - 8t - 6 Find the third derivative of -162027731k3 + 373451847k*2 wrt k. -972166386 What is the third derivative of -117v*3x - 9645v3 + 436v*2x - 4v2 + vx - v + 4x wrt v? -702x - 57870 Differentiate -614708t4 + 3t - 99772946. -2458832t3 + 3 Differentiate 2917042aw3 + 8494w*3 - 2w*2 - 21w + 3 with respect to a. 2917042w3 Differentiate -5v*4 - 809420v*2 - 40315106 wrt v. -20v*3 - 1618840v Find the third derivative of 15405620s3 + 80925471s*2 wrt s. 92433720 What is the third derivative of 6g*6 - 2g*5 - 1681277g3 + g2 + 191164075 wrt g? 720g3 - 120g*2 - 10087662 What is the third derivative of 280p*3q - 314939p3 + 2p*2q - 5p2 + 17pq - 2p + 2q - 142 wrt p? 1680q - 1889634 What is the second derivative of -21041901c3k*2 - 7c*3k - 232619c2k + c + 1 wrt k? -42083802c3 Find the second derivative of 4026c*5 + 2284c*4n*3 - 4687cn3 + 12cn - 171c wrt c. 80520c3 + 27408c*2n*3 Differentiate -4904i*3n + 17i3 - 95i*2 - 656in + i - 2073 with respect to n. -4904i*3 - 656i What is the first derivative of -965524g + 40283032 wrt g? -965524 What is the first derivative of -218778827k - 117706771? -218778827 What is the third derivative of -25s6 + 8214132s*3 - 30602250s*2 - 2s? -3000s3 + 49284792 Find the second derivative of 57006c*5 - 1219c*2z*2 + 3188268c + 80z2 wrt c. 1140120c*3 - 2438z*2 What is the first derivative of 13b*4 - 11223b*3 + 4b - 4257405? 52b3 - 33669b*2 + 4 What is the third derivative of -709135o*4 - 2o3 + o2 + 7o + 5642? -17019240o - 12 What is the second derivative of -1351584y2 - 5875900y wrt y? -2703168 Find the third derivative of 420g4 - 2221g*3 + 5794492g*2. 10080g - 13326 Find the third derivative of -5j4u*3 + 3j*4u - 53538j3 - 54j*2u*2 + 2j*2u - 1178ju*3 + 6j*u	{ "pile_set_name": "DM Mathematics" }
s picked without replacement from {f: 7, n: 1, e: 5, t: 6}? 70/323 Calculate prob of picking 3 z when three letters picked without replacement from zhzhhzhhzhzzhz. 5/52 What is prob of picking 2 r and 1 u when three letters picked without replacement from {f: 2, r: 2, u: 2, h: 7, w: 5}? 1/408 Four letters picked without replacement from {g: 1, j: 8, x: 1, z: 2, c: 6}. What is prob of picking 1 g, 2 j, and 1 x? 7/765 Four letters picked without replacement from {b: 3, x: 3}. Give prob of picking 3 b and 1 x. 1/5 What is prob of picking 3 m when three letters picked without replacement from mbimmgamumm? 4/33 What is prob of picking 2 v when two letters picked without replacement from dddmmjdjvv? 1/45 Three letters picked without replacement from gmlogxtx. Give prob of picking 1 x, 1 o, and 1 l. 1/28 Four letters picked without replacement from vbmbbbggbvdgddb. Give prob of picking 1 m, 1 v, and 2 g. 2/455 Calculate prob of picking 1 s and 2 f when three letters picked without replacement from {s: 4, f: 10}. 45/91 Three letters picked without replacement from {r: 10, q: 1, n: 1, v: 2}. What is prob of picking 3 n? 0 Three letters picked without replacement from {x: 9, i: 1, z: 1, v: 1, o: 4, y: 1}. What is prob of picking 1 i, 1 o, and 1 v? 1/170 Calculate prob of picking 1 u, 1 t, and 1 p when three letters picked without replacement from txpxxuxxuu. 1/40 What is prob of picking 2 m and 1 q when three letters picked without replacement from mmfxluuluqllufmuuu? 1/272 Two letters picked without replacement from cumni. Give prob of picking 1 c and 1 m. 1/10 Three letters picked without replacement from {h: 9, u: 2}. Give prob of picking 2 u and 1 h. 3/55 Calculate prob of picking 1 t and 1 y when two letters picked without replacement from {y: 5, z: 2, t: 1, o: 5, p: 6}. 5/171 Two letters picked without replacement from {b: 3, i: 1, y: 7, v: 5, a: 2}. Give prob of picking 2 a. 1/153 What is prob of picking 1 s and 2 u when three letters picked without replacement from {u: 7, s: 4}? 28/55 Calculate prob of picking 1 a, 1 p, and 2 z when four letters picked without replacement from {b: 2, z: 3, a: 1, r: 2, c: 2, p: 2}. 2/165 What is prob of picking 1 z, 2 n, and 1 p when four letters picked without replacement from {i: 6, s: 1, p: 1, n: 2, z: 3}? 3/715 Three letters picked without replacement from {v: 2, c: 1, f: 2, g: 1}. Give prob of picking 2 v and 1 c. 1/20 Calculate prob of picking 2 z when two letters picked without replacement from zzpzzpzzpzzzzzzz. 13/20 Calculate prob of picking 3 i and 1 a when four letters picked without replacement from {i: 5, f: 4, a: 2}. 2/33 What is prob of picking 2 m and 1 k when three letters picked without replacement from vtkdmmtkdltm? 3/110 Two letters picked without replacement from {q: 3, m: 2, i: 3, b: 5}. Give prob of picking 2 i. 1/26 Three letters picked without replacement from {e: 7, b: 2}. What is prob of picking 3 e? 5/12 What is prob of picking 2 u when two letters picked without replacement from ueuuueueueuue? 14/39 Two letters picked without replacement from xrttucrrut. What is prob of picking 1 x and 1 t? 1/15 Two letters picked without replacement from {a: 4, z: 6, o: 1}. Give prob of picking 1 a and 1 z. 24/55 What is prob of picking 2 u, 1 g, and 1 a when four letters picked without replacement from {u: 9, n: 1, a: 6, g: 1, d: 2}? 18/323 What is prob of picking 3 l when three letters picked without replacement from lfllfllfffflllfflflf? 2/19 Four letters picked without replacement from cuuyjjjucu. What is prob of picking 2 y, 1 c, and 1 j? 0 Two letters picked without replacement from ththtthbhhbmmmhhmbbh. What is prob of picking 1 t and 1 m? 8/95 What is prob of picking 3 i when three letters picked without replacement from {h: 5, i: 7}? 7/44 What is prob of picking 1 d and 1 a when two letters picked without replacement from {d: 6, a: 12}? 8/17 Calculate prob of picking 3 q when three letters picked without replacement from {q: 3, g: 2}. 1/10 Three letters picked without replacement from txtdtxtxttxttttd. What is prob of picking 2 t and 1 d? 9/56 Two letters picked without replacement from {k: 1, n: 1, q: 1, j: 1, v: 1}. What is prob of picking 1 n and 1 j? 1/10 Three letters picked without replacement from {b: 2, l: 6}. Give prob of picking 2 l and 1 b. 15/28 Calculate prob of picking 1 f and 1 m when two letters picked without replacement from hfmhfhhhhfhphhhpfphh. 2/95 Calculate prob of picking 4 r when four letters picked without replacement from {r: 4, f: 1, a: 1, h: 1, v: 3, u: 4}. 1/1001 What is prob of picking 1 z and 1 l when two letters picked without replacement from {l: 2, z: 5}? 10/21 Two letters picked without replacement from eue. Give prob of picking 2 e. 1/3 Two letters picked without replacement from {e: 1, b: 4, d: 9}. Give prob of picking 1 b and 1 d. 36/91 Three letters picked without replacement from {b: 2, w: 2}. What is prob of picking 1 b and 2 w? 1/2 Four letters picked without replacement from {l: 1, k: 3, f: 7, q: 4, d: 2}. What is prob of picking 2 k and 2 f? 9/340 What is prob of picking 2 x when two letters picked without replacement from {k: 2, x: 2}? 1/6 Two letters picked without replacement from {o: 1, h: 2, r: 14}. What is prob of picking 2 h? 1/136 Three letters picked without replacement from xxxxefe. Give prob of picking 1 x and 2 e. 4/35 Calculate prob of picking 1 v and 1 f when two letters picked without replacement from {f: 2, t: 1, v: 1, l: 1}. 1/5 Calculate prob of picking 2 b and 2 m when four letters picked without replacement from {b: 2, z: 2, m: 6, u: 2}. 1/33 What is prob of picking 2 m when two letters picked without replacement from {m: 3, p: 1}? 1/2 What is prob of picking 1 f, 1 d, and 1 r when three letters picked without replacement from ddqiiiqfqir? 2/165 Three letters picked without replacement from lppnn. Give prob of picking 1 l and 2 n. 1/10 Four letters picked without replacement from {z: 13, s: 3}. Give prob of picking 3 z and 1 s. 33/70 Three letters picked without replacement from {x: 4, z: 14}. Give prob of picking 3 z. 91/204 What is prob of picking 2 s, 1 b, and 1 a when four letters picked without replacement from sarbshh? 1/35 Four letters picked without replacement from ndnkkkkdnnkdkkkkddd. What is prob of picking 3 d and 1 k? 15/323 Two letters picked without replacement from {z: 5, o: 5}. What is prob of picking 2 z? 2/9 What is prob of picking 1 w and 1 o when two letters picked without replacement from bcocrcowcbbcwb? 4/91 Four letters picked without replacement from gnbngbnbnnynibsbgnni. Give prob of picking 1 b, 1 n, 1 y, and 1 s. 8/969 Three letters picked without replacement from {m: 3, p: 1, n: 1, k: 6, e: 3}. What is prob of picking 1 m, 1 k, and 1 e? 27/182 Calculate prob of picking 1 a and 3 w when four letters picked without replacement from wwaaaaaaaawa. 1/55 What is prob of picking 1 k and 1 w when two letters picked without replacement from {t: 12, w: 2, k: 3}? 3/68 Three letters picked without replacement from {m: 3, a: 3, q: 2}. What is prob of picking 2 m and 1 a? 9/56 Two letters picked without replacement from wjuco. What is prob of picking 1 u and 1 w? 1/10 Calculate prob of picking 1 m, 1 l, and 1 p when three letters picked without replacement from {v: 5, l: 1, m: 2, g: 5, p: 3}. 3/280 Calculate prob of picking 1 a and 3 w when four letters picked without replacement from {r: 2, a: 7, w: 3}. 7/495 Calculate prob of picking 1 u, 1 q, and 2 k when four letters picked without replacement from {v: 2, k: 8, q: 3, u: 3}. 9/65 Two letters picked without replacement from zgggggzzzg. Give prob of picking 1 z and 1 g. 8/15 Calculate prob of picking 2 w when two letters picked without replacement from wwww. 1 What is prob of picking 4 x when four letters picked without replacement from wxgxxwwffxgxg? 1/143 What is prob of picking 1 b, 2 u, and 1 a when four letters picked without replacement from dagddbddaudbbaauada? 3/646 Calculate prob of picking 2 t when two letters picked without replacement from {p: 5, j: 6, t: 4, y: 4}. 2/57 Two letters picked without replacement from {l: 13, m: 5}. What is prob of picking 1 l and 1 m? 65/153 Calculate prob of picking 1 d and 3 f when four letters picked without repla	{ "pile_set_name": "DM Mathematics" }
c Which is the nearest to -17? (a) -3 (b) 4 (c) -58 (d) 0.3 a Which is the closest to 2/5? (a) 1/170 (b) 3 (c) 5 (d) -12 a Which is the closest to -1.4? (a) 1/3 (b) 100 (c) 1/7 c Which is the closest to 21.3? (a) -0.4 (b) -0.5 (c) 3 (d) 0.1 c Which is the closest to -2/19? (a) -0.3 (b) -15 (c) -0.59 a What is the nearest to -1 in 5/3, -0.14, -0.09, -3? -0.14 Which is the closest to -0.3? (a) 3/4 (b) -14 (c) 0.6 (d) -3 c Which is the nearest to -5? (a) 0.0273 (b) -33 (c) -2/3 c Which is the closest to -0.1? (a) -0.5 (b) -615.3 (c) -3 (d) -2 a What is the nearest to -103 in 47/54, -2/3, -0.3? -2/3 Which is the nearest to 18/89? (a) 4 (b) -2/9 (c) 3/2 b What is the nearest to -38 in -14, 2, -0.1? -14 What is the nearest to -1/3 in -1/6, 5, 2/9, -5/29, -1? -5/29 What is the nearest to 1 in -2, 5/2, -0.99, -7? 5/2 What is the nearest to -114 in 2/5, 1/6, 1/5? 1/6 What is the closest to 9 in 47, -2/7, -0.04? -0.04 What is the nearest to -0.1 in -0.2, -293/2, 0.3, -1? -0.2 What is the closest to 1 in -0.07, 99/4, -2/7? -0.07 Which is the nearest to 0.3? (a) -18 (b) 4 (c) 0.7 (d) -3 (e) -2/5 c Which is the nearest to -8? (a) -28 (b) 0 (c) -2/7 (d) 5 c Which is the closest to -2/5? (a) -5 (b) -4 (c) -1494 (d) 2/15 d What is the closest to 0.14 in 2177, 1/3, 4? 1/3 Which is the nearest to -1/7? (a) -0.3 (b) -66 (c) -670 a Which is the closest to 0.069? (a) 6 (b) -1/3 (c) -0.1 c Which is the closest to 0? (a) -2/9 (b) -1 (c) 0 (d) 1.72 c Which is the nearest to -1/3? (a) -2027 (b) -0.3 (c) 1 b What is the nearest to 0 in -94, 0.22, -2/9, -7? 0.22 What is the closest to -6/157 in 2, 0.3, 2/9, -3? 2/9 Which is the nearest to 0.07? (a) -2/5 (b) -0.3 (c) -2.48 (d) -3 (e) -5 b Which is the nearest to -1? (a) -5 (b) 2/11 (c) -1/4 (d) 1/13 (e) 0.51 c What is the closest to -0.2 in -931, 0.4, -5, 0.07? 0.07 Which is the closest to 0? (a) -3 (b) 1/9 (c) 11 (d) 4 (e) -6/5 b Which is the nearest to -0.1? (a) 20 (b) -1 (c) 1/4 (d) -80/19 (e) 6 c Which is the nearest to -0.1? (a) 37 (b) 5 (c) -2 (d) 9 c What is the nearest to -2/3 in 0.08, -240, 0.5? 0.08 What is the closest to 2 in 3/5, 6/11, -0.04, 268? 3/5 What is the closest to -0.1 in 4/5, 2/3, -1519, -3? 2/3 Which is the closest to 3/5? (a) 14 (b) 2 (c) 5213 b Which is the nearest to 1.976? (a) -2 (b) 9 (c) -2/9 c What is the closest to -0.2 in -0.4, -0.3, 0.04, -28/67? -0.3 Which is the nearest to 2/3? (a) 207 (b) 0.2 (c) -1.2 (d) 0.3 (e) 0.06 d Which is the closest to 42? (a) 0.2 (b) -1/7 (c) -1.5 (d) -2/15 a Which is the closest to 1/3? (a) 4/5 (b) -19/4 (c) 0.12 (d) -3.1 c Which is the nearest to 1? (a) -2/41 (b) 4 (c) -4444 a Which is the closest to -3/2? (a) -3/7 (b) 4 (c) -105/4 (d) 2/3 a What is the nearest to -0.1 in -3, -2, -2/407, 3? -2/407 Which is the closest to 1/3? (a) 0.054 (b) -4 (c) 2 a What is the closest to -1/2 in -0.1221, -5, 0.5, -1/2? -1/2 Which is the closest to -1/12? (a) -4 (b) -2/9 (c) 1/2 (d) 4 b Which is the nearest to -3? (a) -16 (b) -27 (c) -0.07 c What is the closest to 0 in -3, -4, -1/142, 0.016, -2? -1/142 Which is the nearest to 4.3? (a) -4 (b) -0.1 (c) 2747 b What is the nearest to -0.44 in 4/9, 2/5, -0.3, -4, -1/3? -1/3 What is the closest to -1 in 4/3, 5, -1/6, 53, 1/4? -1/6 Which is the nearest to -0.15? (a) -1/3 (b) -1/538 (c) 1/6 b What is the closest to -1 in 0.2, -0.2, 5, -11/15, -0.15? -11/15 What is the closest to 10 in -2.5, -725, 2? 2 What is the nearest to -1/396 in -1/4, 0.3, -17? -1/4 What is the nearest to 0.1 in -3/11, 0, -0.2331, -1/7? 0 Which is the nearest to -880? (a) 4/3 (b) 4/7 (c) -3.7 c Which is the closest to -0.1? (a) -1/4 (b) 3 (c) 0.4 (d) 19 (e) 5 a What is the nearest to 25 in -4, 0, 3, 9? 9 What is the closest to 6 in 0.05, 0.3, -1/7, 3? 3 Which is the nearest to -0.1? (a) 1/308 (b) -0.04 (c) -0.4 (d) 4 (e) 1 b What is the nearest to -10 in 3, 0.065, -4, 39? -4 Which is the nearest to 1? (a) -0.15 (b) 3 (c) -4/5 (d) -3 a Which is the nearest to 1? (a) -2 (b) 3640 (c) 0 (d) -5 c What is the closest to -1/4 in 26, -2, -0.05, 1/22? -0.05 What is the nearest to -3 in -14, 2/19, -1, 419? -1 What is the nearest to -0.02 in 0.19, 5, -17? 0.19 What is the closest to -9 in -0.3, 4, 6, 46? -0.3 What is the nearest to -1 in -30, -2/5, -1, 2.7? -1 Which is the nearest to 0? (a) -0.2 (b) 0.3 (c) -1/4 (d) -1 (e) 2/5 a What is the nearest to 1/3 in -8128, 2/11, 4, 1? 2/11 Which is the closest to 1? (a) 481 (b) 1/5 (c) -0.1 (d) -2/3 b What is the nearest to 48 in 4, -0.5, 499? 4 Which is the nearest to -309/5? (a) -5/32 (b) 0 (c) 5/18 a Which is the nearest to -14? (a) -4/11 (b) 2 (c) -0.04 (d) -0.3 (e) 0.9 a Which is the nearest to 0.1? (a) -1/4 (b) 27 (c) 0.4 (d) -63 c Which is the closest to -1? (a) -15/2 (b) -1 (c) -7 (d) -16/3 b What is the nearest to 1 in 279, 5/2, -0.1? -0.1 Which is the nearest to -1675? (a) 3/7 (b) -1 (c) 3 b Which is the closest to 3.3? (a) -41/27 (b) -1/3 (c) -0.5 b What is the nearest to -0.1 in -2, 0.07, -4, 0.1, -2/9? -2/9 Which is the nearest to -2/5? (a) 0 (b) 954/7 (c) 5 (d) 0.4 a What is the closest to 0.18 in 11, -19/12, -1/6? -1/6 Which is the closest to -2? (a) 3 (b) -0.009 (c) 1 (d) -0.17 d Which is the closest to 0? (a) -15373 (b) 2/3 (c) -1/5 c Which is the nearest to -0.1? (a) 1/7 (b) 0.5 (c) 8 (d) -25/3 a Which is the nearest to -1? (a) 0.3 (b) 3574 (c) 3 (d) 2/7 d Which is the nearest to 18.7? (a) 1/236 (b) -2/7 (c) 0.2 c What is the nearest to -3 in -3, 0.6, 39, -1? -3 What is the closest to 20 in 0.8, 7/3, 1, 4? 4 What is the nearest to 1/2 in -2/3, -3/5, 5, -3? -3/5 Which is the nearest to 1? (a) -3 (b) -24 (c) 1/7 c What is the nearest to -0.9 in -27, -2, -4, 2? -2 What is the closest to -1/3 in -2/11, -0.059, -370? -2/11 Which is the nearest to 1? (a) 95 (b) 0.4 (c) -2/21 (d) -2/7 b What is the closest to 1 in 0.368, 0.5, -0.06? 0.5 Which is the nearest to 38/9? (a) 0.1 (b) -0.3 (c) -14/39 a What is the closest to 0 in 49, -0.1, -7464? -0.1 What is the closest to -2/3 in 1/57, -148, -1.3, 0, -2/11? -2/11 Which is the closest to 22? (a) -0.6 (b) -0.3 (c) -10 (d) 2 d Which is the closest to -4? (a) -3 (b) 5 (c) -30 (d) 19 a What is the closest to -2 in 202, 10/13, -3/7? -3/7 What is the nearest to 0.05 in 7.4, -1, 20, 0.1? 0.1 Which is the nearest to 1/3? (a) 0.06 (b) 4/3 (c) -20/11 (d) 6/25 d Which is the nearest to 6? (a) -0.2 (b) -1 (c) 1/137 c Which is the closest to 0.1? (a) 3 (b) 875547 (c) 5 (d) -0.2 d What is the nearest to -1 in -0.3, -4, -1, -231? -1 Which is the nearest to 148/19? (a) -0.09 (b) 0.1 (c) -2 (d) -2/9 b What is the closest to 2 in 0, 1/21, 2, 1, -2/9? 2 Which is the closest to 0.1? (a) -0.62 (b) 1/332 (c) -3 b Which is the nearest to 9/4? (a) -1/6 (b) 0.0877 (c) 4 c What is the closest to 1 in 0.2, -0.115, -2, -32/7, 0.4? 0.4 What is the closest to -0.662 in 15, -0.7, -2/13, 0.1, -2? -0.7 Which is the nearest to 1? (a) -7 (b) 346 (c) -7/6 c Which is the closest to -2? (a) 7 (b) 3 (c) 2 (d) 1/4 d Which is the nearest to -8? (a) 4/7 (b) -30 (c) 0.1 (d) 0.3 c What is the nearest to -1/2 in 6/5, -2858, -0.04, 0.4? -0.04 Which is the nearest to -3/4? (a) -5 (b) 1 (c) 0.5 (d) 26/45 (e) 1/7 e Which is the nearest to -0.1? (a) 563 (b) 2 (c) -1/4 (d) -0.5 c Which is the closest to 617? (a) 0.012 (b) -0.1 (c) 2/3 (d) 0.1 (e) 2 e What is the nearest to 1 in -4, 171, -1/6, -8/7, 20? -1/6 What is the nearest to 2.3 in 0.05, 11, 8, 4, 5? 4 What is the closest to -4 in 0.3, -32, 1, 2? 0.3 What is the closest to -0.9 in -0.3, -5, 4/3, 0.31, 4.7? -0.3 Which is the closest to -1/3? (a) -2/5 (b) -5 (c) 3 (d) -2/15 (e) 3/8 a Which is the closest to -0.2? (a) 5395 (b) -5 (c) 4/5 (d) -2/13 d What is the closest to -217 in -27, 0.4, 0.3, 1/5? -27 Which is the closest to 15? (a) 29 (b) 0.3 (c) -0.5 (d) 7 (e) 2/5 d What is the closest to 36 in -0.06, -2, 0.4, -5? 0.4 What is the nearest to -2/7 in 2.8, 2, 3/8, 48? 3/8 What is the nearest to -1/2 in 11, 35, -2/9, 0.2? -2/9 Which is the closest to -1? (a) 0.12302 (b) -19 (c) 1/6 a Which is	{ "pile_set_name": "DM Mathematics" }
3619, -53658, -53709, -53778, -53871, -53994, -54153, -54354? -54603 What comes next: -133974, -267930, -401872, -535800, -669714, -803614? -937500 What is next in 46215897, 46215899, 46215901, 46215903, 46215905, 46215907? 46215909 What is the next term in -78103, -312340, -702735, -1249288, -1951999? -2810868 What is the next term in 33126, 33135, 33122, 33087? 33030 What comes next: 63689, 59946, 56211, 52490, 48789, 45114, 41471, 37866? 34305 What comes next: 1780, 4324, 6868, 9412, 11956, 14500? 17044 What is next in 3399, 13361, 29883, 52971, 82631, 118869, 161691? 211103 What comes next: 8102, 32626, 73536, 130832, 204514, 294582? 401036 What is next in 1076, 3268, 9216, 20798, 39892, 68376, 108128? 161026 What is the next term in -21730, -86945, -195600, -347665, -543110, -781905? -1064020 What comes next: -2921, -1052, 817? 2686 What is next in -350061211, -350061214, -350061217? -350061220 What is the next term in 31641, 63276, 94939, 126630, 158349? 190096 What is next in -15109, -15140, -15209, -15334, -15533? -15824 What comes next: -116, 62, 526, 1420, 2888, 5074, 8122? 12176 What is next in 5466767, 5466775, 5466783, 5466791, 5466799, 5466807? 5466815 What is next in -85066, -176954, -268842? -360730 What is next in 229710, 459316, 688922, 918528, 1148134, 1377740? 1607346 What is the next term in -1644, -3178, -4664, -6078, -7396, -8594, -9648? -10534 What is the next term in -3245351, -6490692, -9736035, -12981380, -16226727, -19472076? -22717427 What comes next: -422421, -1689660, -3801729, -6758628, -10560357? -15206916 What comes next: -116299453, -116299455, -116299459, -116299465, -116299473, -116299483? -116299495 What comes next: -3907588, -7815172, -11722756, -15630340, -19537924? -23445508 What is the next term in -11049, -12331, -13613, -14895? -16177 What comes next: 8461, 31278, 68467, 120028, 185961, 266266? 360943 What is the next term in -1433581, -1433439, -1433201, -1432867, -1432437? -1431911 What is next in 4254, 16010, 35272, 62040, 96314? 138094 What comes next: -45189, -47093, -48999, -50907, -52817? -54729 What is next in 22998, 46648, 70298, 93948, 117598? 141248 What is next in 142583, 142738, 142891, 143042, 143191? 143338 What is next in -4554417, -4554419, -4554421, -4554423? -4554425 What comes next: -1455343, -2910484, -4365625, -5820766? -7275907 What is next in -4387559, -8775084, -13162609, -17550134? -21937659 What is the next term in -986141, -986175, -986231, -986309? -986409 What comes next: -4112722, -8225451, -12338180? -16450909 What comes next: 290312, 290496, 290796, 291206, 291720? 292332 What is the next term in -249, -1907, -3561, -5211? -6857 What is next in 16007170, 16007126, 16007082, 16007038, 16006994? 16006950 What is the next term in 15486176, 15486174, 15486172, 15486170, 15486168? 15486166 What is next in 8078, 15956, 23474, 30452, 36710, 42068, 46346? 49364 What is next in -567, -3363, -8423, -15771, -25431, -37427, -51783? -68523 What comes next: 2363, 10020, 22775, 40628, 63579, 91628? 124775 What comes next: -257642, -515267, -772892, -1030517, -1288142? -1545767 What is the next term in -306028, -305807, -305496, -305089, -304580, -303963, -303232? -302381 What is next in 63510, 62491, 61490, 60513, 59566, 58655, 57786? 56965 What is next in -489125, -489219, -489313, -489407, -489501? -489595 What is the next term in -99864, -99911, -99954, -99993, -100028, -100059? -100086 What is next in -930421, -3721676, -8373767, -14886694, -23260457, -33495056, -45590491? -59546762 What is the next term in 516124, 516297, 516470, 516643, 516816? 516989 What comes next: 282414, 1129629, 2541652, 4518483, 7060122? 10166569 What is next in -22583, -22421, -22277, -22157, -22067, -22013, -22001? -22037 What is the next term in 15857, 63664, 143343, 254894, 398317, 573612, 780779? 1019818 What is the next term in -7161, -13837, -20015, -25689, -30853, -35501, -39627, -43225? -46289 What comes next: -228564, -456870, -685176, -913482, -1141788? -1370094 What is next in -1976, -3666, -5290, -6806, -8172, -9346? -10286 What is next in -2865440, -5731008, -8596576, -11462144, -14327712? -17193280 What is next in 12973, 25194, 36665, 47380, 57333, 66518, 74929? 82560 What is the next term in -5166, -21095, -47666, -84897, -132806, -191411, -260730, -340781? -431582 What comes next: -5003007, -10006017, -15009025, -20012031, -25015035? -30018037 What comes next: 50650, 98397, 146154, 193927, 241722, 289545, 337402, 385299? 433242 What is next in -147829, -296995, -446161, -595327? -744493 What comes next: -2176, -2118, -2040, -1942, -1824? -1686 What is the next term in 3953, 4422, 4993, 5666? 6441 What comes next: 622481, 1245425, 1868369, 2491313, 3114257? 3737201 What comes next: -394099061, -394099065, -394099069, -394099073? -394099077 What comes next: -2236, -2995, -4264, -6043? -8332 What is next in -33588, -33623, -33674, -33741, -33824, -33923, -34038? -34169 What is next in 560320, 1120660, 1681000? 2241340 What is next in -683907, -1368279, -2052651, -2737023, -3421395? -4105767 What comes next: -4086, -16339, -36770, -65385, -102190, -147191? -200394 What comes next: 10041, 38739, 86115, 152175, 236925, 340371, 462519? 603375 What comes next: -16469, -33206, -49943? -66680 What comes next: -252300576, -504601148, -756901720? -1009202292 What comes next: 101864, 101655, 101302, 100805, 100164? 99379 What is the next term in 13802, 109886, 370244, 876872, 1711766, 2956922? 4694336 What comes next: 642096884, 1284193769, 1926290654, 2568387539, 3210484424? 3852581309 What comes next: 95357750, 190715503, 286073256, 381431009? 476788762 What comes next: -1716674, -3433281, -5149888? -6866495 What is the next term in -217045, -868136, -1953287, -3472498? -5425769 What is the next term in 36394, 78015, 119636, 161257, 202878, 244499? 286120 What is the next term in -3652, -2255, -858, 539? 1936 What is the next term in 24287, 76997, 164871, 287927, 446183, 639657, 868367? 1132331 What is the next term in 113017, 452002, 1017003, 1808044, 2825149, 4068342, 5537647? 7233088 What is the next term in -881590, -1763232, -2644888, -3526564, -4408266, -5290000, -6171772, -7053588? -7935454 What comes next: 6060, 9897, 16296, 25263, 36804, 50925? 67632 What is next in 147956, 147864, 147772? 147680 What is next in 10424, 10758, 11092? 11426 What comes next: 16613, 16367, 16121, 15875? 15629 What is next in 2089, 19323, 66101, 157195, 307377? 531419 What is the next term in 385755, 386144, 386793, 387702? 388871 What comes next: -3641428, -3641432, -3641436? -3641440 What is the next term in -107, -417, -895, -1517, -2259, -3097, -4007? -4965 What is the next term in -260, -803, -1554, -2387, -3176, -3795, -4118, -4019? -3372 What is next in 771, 8137, 28717, 69117, 135943, 235801, 375297? 561037 What is next in -592211, -1184252, -1776315, -2368412, -2960555? -3552756 What comes next: 679824, 1359642, 2039460, 2719278? 3399096 What is the next term in 2323407, 2322852, 2322297, 2321742? 2321187 What is the next term in -10728, -26382, -42036? -57690 What comes next: 112365, 224370, 336387, 448422, 560481, 672570, 784695, 896862? 1009077 What is the next term in -61173, -60177, -59177, -58173, -57165? -56153 What comes next: -8752, -35156, -79166, -140782? -220004 What is the next term in 43889, 43843, 43797, 43751? 43705 What comes next: -1870, -4089, -6972, -10525, -14754? -19665 What is the next term in 71979, 143466, 214943, 286404, 357843, 429254? 500631 What is the next term in -1767, -2724, -3705, -4722, -5787, -6912, -8109? -9390 What is the next term in 68554, 67490, 66426? 65362 What comes next: -100686, -101577, -102468, -103359? -104250 What comes next: 9792041, 19584013, 29375985, 39167957, 48959929, 58751901? 68543873 What is next in -9575624, -9575626, -9575628? -9575630 What is next in 57, -530, -2183, -5454, -10895? -19058 What is next in -1538, -2156, -2860, -3692, -4694, -5908, -7376, -9140? -11242 What comes next: 9366, 18757, 28170, 37605? 47062 What comes next: 1856, 14155, 47466, 112295, 219148, 378531? 600950 What is the next term in 1634, 3418, 5246, 7142, 9130, 11234, 13478, 15886? 18482 What is next in -1114191, -1114331, -1114473, -1114617, -1114763, -1114911	{ "pile_set_name": "DM Mathematics" }
y years are there in 1/5 of a decade? 2 How many nanograms are there in 5/8 of a microgram? 625 What is 21/4 of a meter in millimeters? 5250 How many litres are there in 855731.1 millilitres? 855.7311 How many nanograms are there in eleven eighths of a microgram? 1375 What is 7/2 of a second in milliseconds? 3500 Convert 27.197685 months to centuries. 0.0226647375 How many seconds are there in 3/5 of a minute? 36 How many microseconds are there in 1/4 of a millisecond? 250 What is three eighths of a litre in millilitres? 375 What is 11/8 of a century in months? 1650 How many weeks are there in 177.344748 minutes? 0.017593725 What is 8765.154 grams in nanograms? 8765154000000 How many millilitres are there in 0.3184303 litres? 318.4303 What is 6.717314um in meters? 0.000006717314 What is five eighths of a litre in millilitres? 625 How many nanoseconds are there in 3/40 of a millisecond? 75000 How many minutes are there in one fifth of a hour? 12 What is 7/4 of a centimeter in micrometers? 17500 How many micrometers are there in 1/5 of a millimeter? 200 What is 31.88502 months in millennia? 0.002657085 How many years are there in 1/20 of a century? 5 How many micrometers are there in 5/4 of a millimeter? 1250 How many millilitres are there in 9/10 of a litre? 900 How many nanometers are there in 3/25 of a micrometer? 120 Convert 332.9403 seconds to microseconds. 332940300 What is 2.385151cm in nanometers? 23851510 What is six fifths of a litre in millilitres? 1200 What is three eighths of a litre in millilitres? 375 How many hours are there in 4/7 of a week? 96 How many litres are there in 1.225653 millilitres? 0.001225653 How many millilitres are there in 5/8 of a litre? 625 What is 3/5 of a litre in millilitres? 600 What is three eighths of a millisecond in microseconds? 375 What is 120079.8 millennia in months? 1440957600 What is 15/4 of a litre in millilitres? 3750 What is seven quarters of a milligram in micrograms? 1750 What is 682.78113ms in days? 0.000007902559375 How many months are there in 0.3532451 centuries? 423.89412 What is 1277.8 micrograms in milligrams? 1.2778 Convert 61710.83 micrograms to nanograms. 61710830 Convert 30003.54 centuries to decades. 300035.4 How many tonnes are there in 0.971362 micrograms? 0.000000000000971362 What is 21/2 of a micrometer in nanometers? 10500 How many centimeters are there in three eighths of a kilometer? 37500 How many nanograms are there in 8005.97t? 8005970000000000000 Convert 73828.11ug to tonnes. 0.00000007382811 Convert 4034.079g to kilograms. 4.034079 How many kilometers are there in 163623.8 meters? 163.6238 What is twenty-five quarters of a microsecond in nanoseconds? 6250 What is fifty-one halves of a century in months? 30600 What is 25/4 of a milligram in micrograms? 6250 What is seventeen halves of a millisecond in microseconds? 8500 What is 13/5 of a kilogram in grams? 2600 What is 12/25 of a day in seconds? 41472 What is 5.297743 decades in months? 635.72916 Convert 3.528464ml to litres. 0.003528464 Convert 54.58598 litres to millilitres. 54585.98 What is 49/5 of a meter in millimeters? 9800 What is eleven halves of a tonne in kilograms? 5500 How many milligrams are there in seventy-one quarters of a gram? 17750 How many seconds are there in 77.48303 weeks? 46861736.544 How many years are there in seven halves of a century? 350 Convert 0.7324515mm to centimeters. 0.07324515 What is 5834.239 kilometers in millimeters? 5834239000 What is twenty-five halves of a kilometer in meters? 12500 How many millilitres are there in 3/10 of a litre? 300 What is nineteen quarters of a litre in millilitres? 4750 Convert 3543.659 milligrams to kilograms. 0.003543659 How many nanometers are there in 3/10 of a micrometer? 300 What is 988894.9km in micrometers? 988894900000000 How many millilitres are there in 31/2 of a litre? 15500 Convert 36.03995 millennia to centuries. 360.3995 How many months are there in six fifths of a decade? 144 How many months are there in one sixth of a century? 200 How many nanoseconds are there in 0.1827968 microseconds? 182.7968 What is three eighths of a centimeter in micrometers? 3750 How many milligrams are there in 0.861334ng? 0.000000861334 What is 13/5 of a litre in millilitres? 2600 How many tonnes are there in 21693.02g? 0.02169302 Convert 70.27629 minutes to microseconds. 4216577400 How many centimeters are there in 3/5 of a meter? 60 How many millilitres are there in five quarters of a litre? 1250 How many grams are there in one quarter of a kilogram? 250 What is 206.92385 days in weeks? 29.56055 What is thirty-seven halves of a gram in milligrams? 18500 How many centuries are there in 22.01619 years? 0.2201619 What is twenty-seven halves of a litre in millilitres? 13500 How many millilitres are there in 7/8 of a litre? 875 How many hours are there in 6080682.6 milliseconds? 1.6890785 What is eleven quarters of a decade in months? 330 How many kilograms are there in one tenth of a tonne? 100 How many millilitres are there in twenty-seven fifths of a litre? 5400 What is 4.303373 weeks in microseconds? 2602679990400 What is eleven tenths of a week in minutes? 11088 Convert 17003.91l to millilitres. 17003910 How many millennia are there in 479404.3 decades? 4794.043 How many kilometers are there in 808.5908 meters? 0.8085908 What is one twentieth of a gram in milligrams? 50 How many micrograms are there in eleven quarters of a milligram? 2750 Convert 94.45606 centuries to years. 9445.606 How many centimeters are there in three eighths of a kilometer? 37500 How many tonnes are there in 0.7415734ug? 0.0000000000007415734 How many nanometers are there in 159840.5um? 159840500 What is 3.012088 years in millennia? 0.003012088 How many nanoseconds are there in eleven quarters of a microsecond? 2750 What is 1737.922um in millimeters? 1.737922 What is three tenths of a gram in milligrams? 300 What is six fifths of a milligram in micrograms? 1200 What is 21/5 of a litre in millilitres? 4200 What is 8/3 of a century in months? 3200 Convert 0.675118ng to kilograms. 0.000000000000675118 How many millilitres are there in one fifth of a litre? 200 How many micrograms are there in 2446.688g? 2446688000 What is three tenths of a microsecond in nanoseconds? 300 Convert 0.2308569 millilitres to litres. 0.0002308569 What is 24.06645g in micrograms? 24066450 How many centuries are there in 15.66 decades? 1.566 How many millilitres are there in seventeen quarters of a litre? 4250 What is 199.1645 millennia in years? 199164.5 How many years are there in 4687.905 decades? 46879.05 What is 3/8 of a litre in millilitres? 375 How many millimeters are there in twenty-seven halves of a meter? 13500 How many hours are there in 329.1246 seconds? 0.0914235 How many millimeters are there in twenty-one halves of a meter? 10500 Convert 7595.266 grams to micrograms. 7595266000 Convert 5.11405 kilometers to nanometers. 5114050000000 Convert 0.3962932 grams to milligrams. 396.2932 How many weeks are there in 348.02187 hours? 2.07155875 Convert 33.50581 centimeters to nanometers. 335058100 How many kilometers are there in 27.19656 millimeters? 0.00002719656 How many nanograms are there in one fifth of a microgram? 200 Convert 42.84299 microseconds to nanoseconds. 42842.99 What is seven halves of a litre in millilitres? 3500 What is one twentieth of a litre in millilitres? 50 How many millilitres are there in 11/10 of a litre? 1100 How many micrometers are there in 13/5 of a millimeter? 2600 What is 43837.49 years in millennia? 43.83749 How many centimeters are there in 5/8 of a kilometer? 62500 How many millilitres are there in 45/4 of a litre? 11250 How many minutes are there in one quarter of a day? 360 Convert 65.33865ns to microseconds. 0.06533865 How many meters are there in six fifths of a kilometer? 1200 What is 51/5 of a decade in years? 102 How many nanograms are there in 3/8 of a microgram? 375 Convert 36987.9 centuries to months. 44385480 Convert 834383.9 millilitres to litres. 834.3839 Convert 490.9191mm to kilometers. 0.0004909191 What is 1/10 of a milligram in nanograms? 100000 What is one fifth of a gram in milligrams? 200 How many litres are there in 505.9222 millilitres? 0.50592	{ "pile_set_name": "DM Mathematics" }
9? False Does 11 divide 2846129? True Does 146 divide 63828? False Does 193 divide 63173? False Is 61538 a multiple of 58? True Does 31 divide 138446? True Is 291963 a multiple of 21? True Is 71091 a multiple of 15? False Is 762161 a multiple of 17? True Is 7 a factor of 6657? True Does 151 divide 53379? False Does 13 divide 335231? True Is 30799 a multiple of 19? True Is 3 a factor of 623397? True Does 98 divide 80901? False Is 613 a factor of 19427528? False Does 21 divide 15570408? True Is 128 a factor of 94619? False Is 35 a factor of 38854? False Is 5599122 a multiple of 16? False Is 6 a factor of 43140? True Does 1225 divide 7862253? False Is 2352 a multiple of 14? True Is 324568 a multiple of 19? False Is 16 a factor of 1480496? True Is 10 a factor of 16012860? True Is 14 a factor of 713188? True Is 3 a factor of 117190? False Does 83 divide 860438? False Is 22 a factor of 12432750? True Is 290940 a multiple of 30? True Is 607338 a multiple of 621? True Is 3184440 a multiple of 210? True Is 61746 a multiple of 6? True Is 84 a factor of 2758736? False Is 1177 a factor of 9937667? False Does 13 divide 119483? True Is 56568 a multiple of 33? False Is 245785 a multiple of 148? False Is 1146184 a multiple of 104? True Is 29 a factor of 54398? False Is 38 a factor of 250800? True Is 535 a factor of 101538? False Does 800 divide 4213600? True Is 192 a factor of 123456? True Does 22 divide 249568? True Does 61 divide 1023763? True Is 894170 a multiple of 164? False Does 102 divide 228888? True Is 11 a factor of 2372362? False Is 64320 a multiple of 7? False Does 262 divide 61996? False Is 1072754 a multiple of 17? False Is 53 a factor of 277084? True Is 12 a factor of 1871844? True Does 65 divide 652340? True Does 27 divide 3468777? False Is 11520187 a multiple of 68? False Does 16 divide 23828? False Is 523710 a multiple of 90? True Is 77175 a multiple of 35? True Is 88510 a multiple of 53? True Is 1175799 a multiple of 44? False Does 29 divide 44602? True Is 1366 a factor of 2136424? True Is 120994 a multiple of 13? False Is 34464 a multiple of 61? False Is 560196 a multiple of 57? True Is 7760535 a multiple of 309? True Does 7 divide 2758579? False Is 197 a factor of 270150? False Is 14 a factor of 21379400? True Is 2042507 a multiple of 29? False Is 1443145 a multiple of 11? True Is 34 a factor of 30292? False Is 293173 a multiple of 213? False Is 12246388 a multiple of 1818? False Is 7 a factor of 70910? True Is 5 a factor of 225939? False Is 477963 a multiple of 67? False Is 1401288 a multiple of 878? True Is 3804021 a multiple of 369? True Does 14 divide 2872226? True Does 136 divide 1869204? False Does 14 divide 4613056? True Is 2631794 a multiple of 46? False Is 755 a factor of 585215? False Does 38 divide 82423? False Is 10758164 a multiple of 479? False Does 5 divide 115140? True Is 5794344 a multiple of 24? True Does 16 divide 377899? False Is 6 a factor of 6666432? True Does 3 divide 2747883? True Does 10 divide 6160? True Is 11084490 a multiple of 485? False Does 134 divide 14722283? False Is 6926020 a multiple of 1273? False Is 7 a factor of 180047? True Does 908 divide 5820280? True Is 30606 a multiple of 63? False Does 46 divide 1594038? True Is 1283856 a multiple of 21? True Is 447 a factor of 836337? True Is 2272 even? True Is 12 a factor of 12588? True Does 327 divide 9141285? True Does 4 divide 80990? False Is 4812115 a multiple of 385? True Is 13 a factor of 4497574? False Is 903397 a multiple of 216? False Is 10 a factor of 15634? False Does 114 divide 773148? True Is 2521026 a multiple of 9? True Is 175 a factor of 411600? True Is 16 a factor of 8588320? True Is 465366 a multiple of 726? True Is 14 a factor of 1659440? False Is 31382 a multiple of 71? True Is 4758781 a multiple of 126? False Is 3885 a multiple of 227? False Is 8299650 a multiple of 30? True Is 964335 a multiple of 13? False Is 23 a factor of 280761? True Is 399 a factor of 153189? False Is 3525126 a multiple of 16? False Is 41331 a multiple of 5? False Is 451068 a multiple of 429? False Is 15 a factor of 4263760? False Does 2 divide 128595? False Does 2 divide 68442? True Is 623938 a multiple of 4? False Is 592650 a multiple of 383? False Does 17 divide 14532? False Is 191018 a multiple of 149? True Is 69258 a multiple of 42? True Is 279 a factor of 16685147? False Is 29 a factor of 7269982? False Is 11 a factor of 58190? True Is 22 a factor of 140136? False Does 323 divide 2751637? True Is 118 a factor of 4602? True Is 12 a factor of 2119488? True Does 5 divide 563648? False Does 5 divide 25019? False Does 34 divide 25357? False Is 135287 a multiple of 59? True Is 57320 a multiple of 111? False Is 267288 a multiple of 296? True Is 91 a factor of 1347255? True Is 11631 a multiple of 30? False Is 197014 a multiple of 105? False Is 12 a factor of 13535807? False Does 7 divide 85603? True Does 132 divide 244728? True Does 192 divide 2196672? True Does 14 divide 1568010? False Does 651 divide 899682? True Is 103969 a multiple of 149? False Is 472 a factor of 2037869? False Is 17691 a multiple of 14? False Is 47 a factor of 191056? False Is 24921 a multiple of 24? False Does 34 divide 47862? False Is 5917 a multiple of 2? False Does 29 divide 44486? True Is 9 a factor of 19872? True Is 14 a factor of 11746? True Is 107510 a multiple of 26? True Is 137965 a multiple of 222? False Is 172 a factor of 1551149? False Is 308 a factor of 3166240? True Does 447 divide 3007794? False Does 15 divide 7718152? False Does 55 divide 3231557? False Is 61480 a multiple of 20? True Does 102 divide 1212665? False Does 8 divide 76700? False Is 71608 a multiple of 135? False Does 374 divide 1662056? True Is 508368 a multiple of 105? False Is 1326639 a multiple of 74? False Is 374 a factor of 11206995? False Does 27 divide 189756? True Is 86 a factor of 11267376? True Does 3 divide 8817? True Is 9 a factor of 13605039? True Is 12 a factor of 565260? True Is 2992 a multiple of 68? True Does 81 divide 45617? False Is 97 a factor of 69258? True Is 300620 a multiple of 88? False Does 3 divide 17356? False Is 7494685 a multiple of 43? True Is 962784 a multiple of 32? True Does 4 divide 78468? True Is 106 a factor of 126528? False Is 26 a factor of 5151536? True Is 8496338 a multiple of 735? False Is 16 a factor of 17168? True Is 15126249 a multiple of 16? False Does 7 divide 50386? True Does 125 divide 2238166? False Is 5916934 a multiple of 19? False Is 493 a factor of 518636? True Is 173400 a multiple of 340? True Is 46569 a multiple of 6? False Does 33 divide 1040160? True Is 52225 a multiple of 17? False Does 6 divide 294800? False Is 286 a factor of 13508782? False Is 199 a factor of 229845? True Is 220 a factor of 250948? False Does 68 divide 5556892? True Is 1114 a factor of 6023410? False Is 5267552 a multiple of 16? True Is 1409777 a multiple of 5? False Is 902880 a multiple of 120? True Is 13 a factor of 19642? False Is 118 a factor of 190626? False Does 80 divide 146606? False Is 4582 a multiple of 2? True Does 150 divide 1742250? True Does 11 divide 536767? True Is 24 a factor of 661277? False Is 711 a factor of 145755? True Is 476 a factor of 2727004? True Is 161296 a multiple of 17? True Is 374 a factor of 173910? True Is 492135 a multiple of 96? False Is 13 a factor of 19864? True Does 361 divide 170392? True Does 10 divide 396950? True Does 37 divide 20239? True Is 75 a factor of 298800? True Is 431 a factor of 254099? False Is 2501248 a multiple of 64? True Does 13 divide 11679900? False Is 223443 a multiple of 12? False Is 454960 a multiple of 242? True Is 6039954 a multiple of 9? True Is 1293065 a multiple of 1190? False Is 665658 a multiple of 13? False Is 1839929 a multiple of 5? False Is 17100126 a multiple of 18? True Is 354 a factor of 1633002? True Is 9 a factor of 588699? True Is 5 a factor of 2834395? True Is 16 a factor of 123184? True Does 993 divide 13037354? False Does 49 divide 520135? True Is 11608091 a multiple of 274? False Is 223 a factor of 59271? False Is 28 a factor of 660296? True Is 1149456 a multiple of 22? True Is 21844721 a multiple of 15? False Does 32 divide 179456? True Is 879026 a multiple of 289? False Is 76 a factor of 3662820? Tr	{ "pile_set_name": "DM Mathematics" }
766649s2 - 21s*3 + 2 + 40017766649s*2. -21s*3 + 2 Collect the terms in 639 + 28388j*3 - 1272 + 633. 28388j*3 Collect the terms in -1128o - 232 + 707 + 103o - 235 - 240. -1025o Collect the terms in -91 + 44 + 46 + 1189j - 182j + 929j. 1936j - 1 Collect the terms in 53p - 47p - 282p - 69p*3 - 65p*3 + 12 + 135p3. p3 - 276p + 12 Collect the terms in -53694p*2 + 17798p*2 + 17952p*2 + 17942p*2 + 34p. -2p2 + 34p Collect the terms in 24062d - 27 + 24053d - 48112d. 3d - 27 Collect the terms in -2729j2 - 3213j*2 - 3 - 5626j*2. -11568j*2 - 3 Collect the terms in 217116h + 166681h - 226728h + 611284h. 768353h Collect the terms in -287n3 - 58725374447n + 58725374447n. -287n*3 Collect the terms in -1530z + 632 - 609 + 1530z - 9z*2. -9z*2 + 23 Collect the terms in -459s + 796s - 365s. -28s Collect the terms in 148696p - 49497p - 49487p - 49728p. -16p Collect the terms in -209402626786w2 + 3w*3 + 209402626786w*2. 3w*3 Collect the terms in 7d*3 - 103d*2 + 322d*2 - 105d*2 + 27d - 111d2. 7d*3 + 3d*2 + 27d Collect the terms in 1061732p3 + 1061755p*3 - 2123459p*3. 28p*3 Collect the terms in 4 + 49487x + 48638x - 97201x. 924x + 4 Collect the terms in 1483p - 2705p - 4490p. -5712p Collect the terms in -23k*2 - 19k*2 + 124k*2 - 88k*2. -6k*2 Collect the terms in 130t*3 - 46t*2 + 306t*2 + 97t*2. 130t*3 + 357t*2 Collect the terms in -48566x*2 + 48567x*2 + 84x - 127x - 170x. x*2 - 213x Collect the terms in 106s2 - 2754s*3 + 5504s*3 - 2745s*3 + 213s*2. 5s*3 + 319s*2 Collect the terms in -14i*3 - 5i*3 - 46i*3 - 19i*3 + 9 - 39. -84i*3 - 30 Collect the terms in -137 + 50 + 1126745n - 1126727n + 87. 18n Collect the terms in 39 - 133 + 37 + 74w3 + 57. 74w*3 Collect the terms in -2y*2 - 873y - 430 - 428 + 859. -2y2 - 873y + 1 Collect the terms in -421t2 - 125183t*3 + 421t*2 + 125233t*3. 50t*3 Collect the terms in -31z*2 + 6 + 15z*2 - 2z + 4993z3 + 16z*2. 4993z*3 - 2z + 6 Collect the terms in 62374 - 4j - 124133 + 61759. -4j Collect the terms in 371s2 - 628s*2 - 171s*2. -428s*2 Collect the terms in 770g*3 + 5g*2 + 6g - 9g2 - 10g*2 - 8g*2 - 5g. 770g3 - 22g*2 + g Collect the terms in 454q - 4 + 599q - 1369q + 498q + 6. 182q + 2 Collect the terms in 308x3 + 3x + 3x3 - 29 - 315x*3 - 3x. -4x3 - 29 Collect the terms in 61a + 41a + 3912 - 100a - 3910. 2a + 2 Collect the terms in -39572 - 18726a*2 + 39572. -18726a*2 Collect the terms in -2k*3 + 20 - 210k + 107k + 90k + 3469. -2k3 - 13k + 3489 Collect the terms in 822020136138x + 52x*2 - 822020136138x. 52x2 Collect the terms in 1713 - 1713 + 127m + 5m3 - 2m*3. 3m*3 + 127m Collect the terms in -187 - 37 - 235c + 224. -235c Collect the terms in 2a + 1189a*2 - 2a - 1112a2. 77a*2 Collect the terms in -3137 + 764 + 936 + 1056 + 872 + r. r + 491 Collect the terms in 90l - 275l + 118l + 106l + 87l. 126l Collect the terms in 2548t*2 - 448t + 1340t - 444t - 448t + 649t*2. 3197t*2 Collect the terms in -1855348m*3 - 1803644m*3 - 1738565m*3 + 850906m*3. -4546651m*3 Collect the terms in -464041856 + 464041856 + 7f*2 + 4f*2. 11f*2 Collect the terms in -53v + 22v + 2v - 64v - 160v + 39v. -214v Collect the terms in 410j + 4 + 67j - 5 + 357j - 197j. 637j - 1 Collect the terms in 4u2 - u2 - u*2 - 4u*2 - 3u*3 + 0u*3. -3u*3 - 2u*2 Collect the terms in 117i - 44i - 3 - 21i - 35i - 22i. -5i - 3 Collect the terms in -7 + 134w + 251w - 263w + 81w. 203w - 7 Collect the terms in -1 - 780a2 - 1602a*2 - 6a - 204a2 + 4a. -2586a2 - 2a - 1 Collect the terms in -12d + 61d - 13d - 8d - 2d - 19d - 14d. -7d Collect the terms in 798959k + 3 - 798276k - 3. 683k Collect the terms in 53009p + 44834p - 97844p. -p Collect the terms in 13 - 880579n - 880582n - 13 - 880594n + 2641756n. n Collect the terms in 88 + 247t - 120t + 81 - 122t - 169. 5t Collect the terms in -145g + 42g + g + 61g + 37g. -4g Collect the terms in 11578367 - 23156568 - l + 11578356. -l + 155 Collect the terms in 296 - 14z*3 - 540 + 248. -14z*3 + 4 Collect the terms in 18028w*2 + 1355w*2 + 45267w*2. 64650w*2 Collect the terms in -12w*2 + 11 + 35w - 1 + 6w - 27w. -12w2 + 14w + 10 Collect the terms in -141 + 6330777s - 6330794s + 422. -17s + 281 Collect the terms in 251 - 104g*2 - 485 + 111g*2 + 234. 7g*2 Collect the terms in 6022r - r*3 - 3746r - 2276r + 0r*3 - 28r2. -r3 - 28r2 Collect the terms in 28c3 + c3 + 26c3 + 12c*3 + 4544c - 70c3. -3c*3 + 4544c Collect the terms in 22 - 90 - 2624h + 29 + 40. -2624h + 1 Collect the terms in 33c2 + 50c - 10c2 - 20c*2. 3c*2 + 50c Collect the terms in 71r + 1215r*2 - 2519r*2 + 1270r*2 - 39r. -34r2 + 32r Collect the terms in -2 + 67x2 + 32x - 22x + 10 - 4x. 67x2 + 6x + 8 Collect the terms in 786 - 2370 + 791 + 793 - 50796p3. -50796p*3 Collect the terms in -59w*3 + 182w*3 - 350w*3. -227w*3 Collect the terms in -13355z*2 - 13361z*2 - 13380z*2 + 40082z*2. -14z*2 Collect the terms in -38567 + 12y + 97421 - 58855. 12y - 1 Collect the terms in -529 - 624 - 531 - 3d*3 + 1936 - 252. -3d*3 Collect the terms in -5a - 8146 - 3a - 3a - 6043. -11a - 14189 Collect the terms in 20h*2 + 25h*2 + 15 + 36 + 38h*2 - 92h*2 - 51. -9h*2 Collect the terms in -9272 + 111r + 111r - 60r - 160r. 2r - 9272 Collect the terms in 7470h2 - 29596h*2 - 2h + 2h - 3278h*2. -25404h*2 Collect the terms in -30l + 7l + 3601l*3 - 3611l*3 + 12l + 11l. -10l*3 Collect the terms in -7269 + 14536 - 7267 + 8906n. 8906n Collect the terms in -20424597r*3 + 10212150r*3 + 10212449r*3. 2r*3 Collect the terms in 21465j*3 + 34j*2 - 34j*2 - 7199j*3 - 7040j*3 - 7209j*3. 17j*3 Collect the terms in -11 + 96 - 85 + 2117t*2. 2117t*2 Collect the terms in 124m - 124m + 4m*2 + 1979m*3 - 2m*2 - 1943m*3. 36m*3 + 2m*2 Collect the terms in -5820c - 5804c - 5814c + 29035c - 5786c - 5812c. -c Collect the terms in 592 - 186 - 132 - 13x - 138 - 136. -13x Collect the terms in -21 + 77 - 35 - 24 - 988v. -988v - 3 Collect the terms in -434037 + 434037 - 103n*2 + 17n. -103n2 + 17n Collect the terms in 64z - 14152z*2 - 14z*3 + 10z*3 + 14152z*2 - 131z + 67z. -4z*3 Collect the terms in -356520h - 356510h - 356523h + 1069639h + 3. 86h + 3 Collect the terms in 6370z3 + 6595z*3 - 13102z*3. -137z*3 Collect the terms in 50572471861 - 6z - 50572471861. -6z Collect the terms in -11x*3 + 99x - 319x - 590 + 584. -11x*3 - 220x - 6 Collect the terms in 12p + 251 - 43p + 15p + 4794 + 15p. -p + 5045 Collect the terms in -3790a3 + 8401a*3 - 1496a*3. 3115a*3 Collect the terms in 3u - 72 + 51 + 3u - 4u + 38 + 11. 2u + 28 Collect the terms in -338b*3 + 175b*3 + 240b*3 + 119b*3. 196b*3 Collect the terms in 154h - 68204021 + 68204021. 154h Collect the terms in -4626066 - 6c - 4626168 + 9252234. -6c Collect the terms in 11 - 11 + 6n*2 - 8n*2 + 5205310n*3. 5205310n*3 - 2n*2 Collect the terms in -18271n*2 - 7957n*2 - 13010n*2. -39238n*2 Collect the terms in -21811791 - 5605853 + 3676689 - 2m. -2m - 23740955 Collect the terms in 26838g - 7862g - 6143g. 12833g Collect the terms in 148f*2 + 11 - 133 + 11 - 147f2 + 111. f2 Collect the terms in -22j2 + 302j*2 - 9j*2 - 245j*2 - 36j*2. -10j*2 Collect the terms in 199w*2 - 368w*2 - 104w + 104w + 188w*2. 19w*2 Collect the terms in -24038824u*2 - 1 + 5 + 24038871u*2. 47u*2 + 4 Collect the terms in -224 - 222 + 3990t - 221 - 3992t + 667. -2t Collect the terms in f*2 - 506f + 2053f - 505f + 25f2 - 529f - 513f. 26f*2 Collect the terms in 98795r*2 - 2 - 291r*3 - 98795r*2. -291r*3 - 2 Collect the terms in 299b + 0 - 3 - 379b + 250b. 170b - 3 Collect the terms in -918u + 49 + 927u + 1 - 28 - 22. 9u Collect the terms in -1253z*3 + 130668 +	{ "pile_set_name": "DM Mathematics" }
inator of -82/120099 and 71/12? 480396 Find the common denominator of -47/50 and 79/591990. 2959950 What is the lowest common multiple of 4 and 1017300? 1017300 Calculate the common denominator of 4/170169 and -1/10. 1701690 Calculate the least common multiple of 16290 and 11403. 114030 Calculate the smallest common multiple of 12 and 52116. 52116 Calculate the least common multiple of 2068 and 9. 18612 Find the common denominator of 125/132 and 43/4716. 51876 What is the lowest common multiple of 1488 and 72? 4464 Calculate the common denominator of 57/25 and 9/3250. 3250 Find the common denominator of 87/2920 and 24/10585. 84680 Find the common denominator of -69/7990 and 117/20. 15980 What is the common denominator of -117/110 and 63/1420? 15620 Calculate the common denominator of -157/14400 and 143/22500. 360000 What is the common denominator of -32/6265 and 31/264920? 1854440 Calculate the lowest common multiple of 825 and 2310. 11550 What is the common denominator of 71/184328 and 35/4? 184328 What is the common denominator of -61/6831 and 125/17928? 4535784 Calculate the common denominator of -97/35074 and 35/213. 105222 Calculate the smallest common multiple of 6 and 13016. 39048 Calculate the common denominator of -19/308 and -99/64. 4928 What is the common denominator of -87/15632 and -99/604? 2360432 What is the common denominator of -27/157115 and 121/1340? 628460 What is the smallest common multiple of 8202 and 12303? 24606 Find the common denominator of 63/2276 and 19/3983. 15932 What is the common denominator of -47/156248 and -57/10? 781240 What is the lowest common multiple of 247760 and 40? 247760 Calculate the common denominator of 191/7260 and 23/23760. 261360 Find the common denominator of -99/30862 and 23/16618. 216034 Calculate the common denominator of 85/594 and -85/434592. 4780512 What is the least common multiple of 10800 and 2250? 54000 What is the common denominator of -43/3056 and 47/11842? 94736 Calculate the common denominator of -67/121128 and -39/7828. 2301432 Calculate the common denominator of 11/28728 and -101/1106. 2269512 Find the common denominator of -91/324 and 3/44. 3564 Calculate the common denominator of -107/7134 and 48/134357. 806142 What is the least common multiple of 25715 and 8325? 1157175 What is the lowest common multiple of 2196 and 19764? 19764 What is the smallest common multiple of 47700 and 11925? 47700 Calculate the common denominator of 41/985 and -2/8895. 1752315 Calculate the least common multiple of 66 and 2070. 22770 What is the common denominator of 59/382 and 65/14516? 14516 What is the common denominator of 33/3841 and -40/1083? 4159803 What is the lowest common multiple of 17488 and 61208? 122416 Calculate the lowest common multiple of 624 and 117. 1872 What is the smallest common multiple of 429 and 1359? 194337 Calculate the smallest common multiple of 36556 and 130. 182780 What is the lowest common multiple of 18212 and 36424? 36424 What is the lowest common multiple of 15 and 21115? 63345 Calculate the least common multiple of 4257 and 495. 21285 What is the common denominator of -13/3633 and -4/519? 3633 What is the common denominator of 113/2376 and -157/3036? 54648 Calculate the lowest common multiple of 12 and 3792. 3792 What is the common denominator of -65/153 and -28/142539? 7269489 Calculate the common denominator of -151/6 and -41/1376. 4128 Calculate the smallest common multiple of 89951 and 6739. 2068873 Find the common denominator of 43/432 and -23/1233. 59184 What is the least common multiple of 2262 and 390? 11310 What is the lowest common multiple of 66 and 22826? 753258 What is the lowest common multiple of 980 and 1617? 32340 Find the common denominator of 17/6144 and 17/105. 215040 What is the common denominator of -59/858 and -89/124? 53196 Find the common denominator of 47/199704 and -3/8321. 199704 Calculate the smallest common multiple of 34510 and 6. 103530 Calculate the least common multiple of 11 and 3051794. 33569734 What is the smallest common multiple of 12762 and 10635? 63810 Find the common denominator of 71/1918 and -61/2740. 19180 Find the common denominator of -22/31255 and -103/17766. 1687770 What is the common denominator of -52/121193 and -50/153? 1090737 Find the common denominator of 17/4 and -85/1176732. 1176732 What is the least common multiple of 438192 and 537? 438192 Calculate the common denominator of 10/7 and -67/105717. 740019 What is the common denominator of 21/310925 and -11/9? 2798325 Calculate the common denominator of -42/1157 and 8/491191. 6385483 What is the lowest common multiple of 16203 and 363? 178233 What is the smallest common multiple of 12208 and 608? 463904 Calculate the common denominator of 69/450806 and 61/22. 4958866 Calculate the least common multiple of 2 and 1589. 3178 Calculate the common denominator of 93/5924 and -35/164. 242884 Calculate the common denominator of 43/28420 and 5/1276. 312620 Find the common denominator of -31/8910 and -23/19035. 418770 Calculate the lowest common multiple of 565 and 150. 16950 What is the least common multiple of 53811 and 819? 4896801 What is the common denominator of -105/44 and 31/22352? 22352 What is the smallest common multiple of 144 and 1026? 8208 Calculate the least common multiple of 34275 and 41130. 205650 Calculate the least common multiple of 47425 and 1425. 2703225 What is the least common multiple of 6030 and 20? 12060 Calculate the least common multiple of 360350 and 2. 360350 What is the lowest common multiple of 101871 and 3? 101871 Find the common denominator of -6/5 and -27/1313056. 6565280 What is the smallest common multiple of 1474 and 56012? 56012 Find the common denominator of -16 and 40/34273. 34273 What is the lowest common multiple of 126 and 10983? 65898 What is the lowest common multiple of 10476 and 36666? 73332 Calculate the lowest common multiple of 1220 and 490. 59780 What is the least common multiple of 43848 and 38367? 306936 What is the least common multiple of 465 and 3596? 53940 What is the smallest common multiple of 910 and 14560? 14560 Calculate the common denominator of 163/802080 and 51/98032. 8822880 Find the common denominator of -61/4662 and -97/1332. 9324 Calculate the common denominator of 43/310 and 5/49724. 248620 What is the lowest common multiple of 612 and 311304? 933912 Calculate the smallest common multiple of 5 and 760819. 3804095 Calculate the common denominator of 37/160650 and 79/9520. 1285200 What is the common denominator of 8/11135 and 30/118031? 590155 Calculate the common denominator of 76/21903 and -61/2235. 109515 Calculate the least common multiple of 14 and 4606. 4606 What is the common denominator of -9/31072 and 27/13594? 217504 What is the common denominator of -61/48 and -77/64422? 515376 Calculate the smallest common multiple of 882 and 168. 3528 What is the common denominator of 133/36 and 167/16800? 50400 What is the common denominator of -17/11408 and 101/248? 11408 What is the lowest common multiple of 157688 and 37708? 1734568 What is the smallest common multiple of 4458 and 8? 17832 What is the common denominator of 23/7040 and 49/8800? 35200 Find the common denominator of -37/234 and -115/1165242. 3495726 Calculate the smallest common multiple of 180212 and 2. 180212 Find the common denominator of 55/48 and -109/240. 240 Calculate the smallest common multiple of 159471 and 468. 637884 Find the common denominator of -73/4050 and 79/36. 8100 Calculate the lowest common multiple of 11844 and 84. 11844 Find the common denominator of -139/210276 and 121/95580. 1051380 Find the common denominator of 5/2877 and 61/12516. 1714692 What is the lowest common multiple of 3386 and 388? 656884 Find the common denominator of -103/684 and -131/198. 7524 Calculate the lowest common multiple of 5427 and 36180. 108540 Calculate the common denominator of 37/97305 and -49/510. 3308370 Calculate the lowest common multiple of 19124 and 63. 172116 Calculate the smallest common multiple of 3750 and 67. 251250 Calculate the lowest common multiple of 6804 and 56. 13608 Find the common denominator of 117/448 and -163/336. 1344 What is the common denominator of -43/93808 and -71/20? 469040 What is the common deno	{ "pile_set_name": "DM Mathematics" }
n multiple of ((-234)/(-7) - (-156)/273) + -4 and 546? 2730 Let h(t) = 2t2 + 6t + 7. Let q be h(-3). Suppose -qk = -8k + 22. Calculate the least common multiple of (-1)/(-3) - (-94)/6 and k. 176 Let n = 507 + -387. What is the lowest common multiple of n and 6? 120 Let u(q) = 5q - 16. Let x be u(5). Suppose -5t = xo - 5o - 169, -3o + 3 = 0. What is the lowest common multiple of 15 and t? 165 Let j(d) = 2d + 16. Let n be j(-8). What is the lowest common multiple of 2 and (-3)/12n + 8? 8 Let m = -6582 + 184277/28. Find the common denominator of m and -151/12. 84 Let w = 5415 + -54089/10. Let s = 11480643/11 + -16945345171/16236. Let f = s + -1/1476. Find the common denominator of f and w. 30 Suppose 4h - 14 = -p, -8h + 10 = -3h. Calculate the smallest common multiple of 90 and p. 90 Let k = -163/11 + 11311/770. Find the common denominator of k and 41/18. 630 Let b = 85 + -91. Suppose 0 = 3p - 4p + 12. Let c = b + p. Calculate the smallest common multiple of c and 3. 6 Find the common denominator of 12/(-14)99/77 and -26/7. 49 Suppose -4o = -7o + 4z - 436, -20 = 4z. Let r be 16/o + (-742533)/(-304). Let t = -2439 + r. What is the common denominator of 3/4 and t? 16 Let y = -10 + 16. Let k be (-1)/(-5) - 14/(-5). Suppose -60 = -2r + 4n, -2n = -5r + kn + 125. What is the least common multiple of y and r? 60 Let q be (-185492/32)/(10107/(-6)). Let d = -3/1123 + q. What is the common denominator of -109/20 and d? 60 Let f = 392 - 821/2. Calculate the common denominator of 55/6 and f. 6 Let z(j) = 4j + 35. Let m be z(-9). Let f = -2 - -10. Calculate the lowest common multiple of (-4)/2m2 and f. 8 Let g = 11 + -6. Let j = -1 - -1. Suppose gf - f - 24 = j. What is the smallest common multiple of f and 6? 6 Let g = -7625/1738 + 27/79. Find the common denominator of g and 0 - 0 - 5 - (-84)/(-192). 176 Suppose 2b + 2b = 2v + 132, 0 = -2b + 2v + 68. Suppose -b = 9x - 13x. What is the smallest common multiple of x and 2? 8 Suppose 0r - 2r = 4. Find the common denominator of 9/20 and ((-995)/100 - r) + 2. 20 Let j(a) = 6a2 - 6a - 6. Let r be j(6). What is the common denominator of (r/(-8))/((-18)/3) and (-16)/3(5 - 3)? 24 Suppose -4y + w = -111, 5y + 5w = -0y + 120. What is the least common multiple of y and 72? 216 Suppose -3v - 2v - 80 = 0. Let r = -1705 + 27287/16. What is the common denominator of r and ((-25)/(-3))/(v/18)? 16 Let j(u) = u - 21. Let s be j(26). Let q(g) = 4g + 20. What is the least common multiple of q(s) and 12? 120 Let x(q) = 12q2 + 3q*3 + 2 + 0q*3 - 2q*3. Let a be x(-12). Suppose -au + 10 = n, 5n = -2u - 0u - 6. What is the lowest common multiple of u and 1? 7 Let m be (12/(-8) - -1)-8. Suppose -mc + 2804 = -2256. Let a = 24017/19 - c. Find the common denominator of 73/9 and a. 171 Calculate the common denominator of 103/282 and 254/42 - (-7 - 114/(-12)). 1974 Let d = -2196 - -17609/8. Find the common denominator of (2/16)/((-1)/(-182)) and d. 8 Let f be ((-630)/(-188) - 3)(-10)/15. Let k = 4117/282 - f. Find the common denominator of 568/32 - (1 - -1) and k. 12 Find the common denominator of 48 and (-1517)/(-1430) - (-102)/(-187). 130 Suppose 5q + 8y - 6y = 99, -4q + 5y + 99 = 0. What is the lowest common multiple of q and 36? 252 Let i = 26186439/1973 - 403035329003/30287523. Let t = i - -16/2193. Let d = t + 5023/154. Calculate the common denominator of d and 51/2. 22 Suppose 54 = 7c - 4c. Let l = 24 - c. Suppose 4w = -w + 50. What is the smallest common multiple of l and w? 30 Suppose -112u = 34u + 20u - 3320. What is the smallest common multiple of (-1)/3 + 219/9 and u? 120 What is the common denominator of (-10 - 867/(-120))/1 and 9/32? 160 Calculate the lowest common multiple of 891/18(8 - 4) and 5. 990 Let u be (-1 + -1)(2 - -1)/(-3). Calculate the least common multiple of (-1)/(u/8) + 12 and 28. 56 Suppose -3v + 2v = 0. Suppose v = 6a - 4a - 112. Find the common denominator of 23/22 and ((-20)/6)/(a/(-21)). 44 Let h(n) = -9n*3 + n. Suppose -4y = -0 - 16. Suppose yx + 2 + 2 = 0. What is the least common multiple of 10 and h(x)? 40 Let g = -74 - -65. Let m(t) = -2t - 14. Calculate the smallest common multiple of m(g) and 21. 84 Let m be (-2)/1 + 3730 + 2. Let v be (-3 + 4)/((-1)/(-55)). Find the common denominator of 1/4m/v and -89/10. 110 Let x = 7646 + -137719/18. Let p = -22/29 + 929/116. Calculate the common denominator of p and x. 36 Let b = 9115307/6 - 1513382. Let m = b + -5859. Calculate the common denominator of (-75)/62/3 and m. 6 Let v = 7/19 + -1833/76. Let d = 1/3278421485 + 47237463805732/9963122892915. Let h = d + -8/1013. What is the common denominator of h and v? 60 Let o be (0 - 2829)1/8. Let m = -1453/4 - o. What is the common denominator of -12/11 and m? 88 Let c = -18 + -1. Let n = c + 16. What is the common denominator of 91/8 and 19 + 0 - (n + 3)? 8 Let p = 35 + -32. Find the common denominator of -49/11 and (p/60)/(6/1035). 88 Let h = 166/7 + -2676/91. Let l = -759/26 - h. Let w = -410 - -787/2. Calculate the common denominator of w and l. 2 Let x = -1560773/50 - -31213. Find the common denominator of x and 161/90. 450 Let x(d) = -158d - 10. Let h be x(-7). Let o = -2235/2 + h. Let c = 1801 - 7105/4. Calculate the common denominator of o and c. 4 Suppose 0i - i + 7 = -4a, -40 = -4i + 4a. Calculate the lowest common multiple of 20 and i. 220 Suppose 0 = -5d + 7d - 146. Let u = d + -55. Suppose 5 = -m + 21. What is the lowest common multiple of u and m? 144 Suppose 3m - 68 = -4p, 17 = 2m - 3p - 51. Suppose 66 + 6 = -4w. Let v = w + m. What is the least common multiple of v and 14? 70 Let y be (2 - (-2)/1) + 25. Suppose -4 = -2f + 2q, -3f + 0q - y = 4q. Let j = 18 + f. What is the least common multiple of j and 3? 15 Let i(r) = -r - 2. Let s be i(-5). What is the common denominator of -69/14 and (-36)/7 + ((-21)/(-14) - s)? 14 Suppose -u + 11 = 4v, -3v - 36 = -u - 39. Calculate the smallest common multiple of u and 90. 90 Let x = 2035 - 2028. Calculate the lowest common multiple of 1330 and x. 1330 Let x = 6175 - 61803/10. Calculate the common denominator of 137/144 and x. 720 Suppose -2c + 61 = -n, 0 = 5c - 2n - 137 - 18. Calculate the smallest common multiple of c and 88. 264 Suppose 44l = 43l - 3, -2l + 64 = 5o. Calculate the smallest common multiple of 54 and o. 378 Let y be (-10 - -5)/(-5) + (-41694)/41698. Let l = y - -1021569/333584. Let h = 8359/2736 + 5/684. Find the common denominator of l and h. 16 Let v = 882 - 867. What is the smallest common multiple of 5 and v? 15 Let y(z) = -z*2 + z + 12. Let n be y(4). Suppose -5b = -n - 50. What is the least common multiple of 1 - -5(3 - 2) and b? 30 Let c = -776 - -92. Calculate the common denominator of ((-4)/(-6))/((-80)/c) and 39/10. 10 Suppose -2g = 8 - 6. What is the smallest common multiple of ((-14)/3)/(1/(-3)) and (-1 - 17/1)g? 126 What is the common denominator of (-103)/249/(-2412) and -95/2? 134 Let r(k) be the first derivative of k2 + k - 3. Let o be r(1). Let p = o + 3. What is the smallest common multiple of p and 11? 66 Let y = 493 - 4414/9. Let s = -2123/225 + 147/25. What is the common denominator of y and s? 9 Suppose 2o + 100 = 184. Calculate the lowest common multiple of 12 and o. 84 Let b = 10 - 11. Find the common denominator of (675/(-6))/5 - 2 and (364/80)/b + -1. 20 Let h(g) = -6g - 6. Let k be ((-26)/(-39))/(2/(-9)). What is the smallest common multiple of h(k) and 28? 84 Let i be (11414/(-9080) + 1)/((-7)/(-238)). Let l = -9/227 - i. Calculate the common denominator of l and -57/20. 20 Let n = 3 - 6. Let q(b) = -b3 - 4b*2 - 5b - 4. Let l be q(n). What is the common denominator of 274/12-1 + l and -7/10? 30 Let m be 23916/(-19120) + (-10)/(-8). Let o = m + 87241/7170. Calculate the common denominator of (-158)/(-2)(-1)/4 and o. 12 Let l(w) be the third derivative of -w4/6 - w3/2 + 8w2. Calculate the least common multiple of 15 and l(-6). 105 Suppose 2r - 14 = -3k, 4r - 17 = -4k + 7. Suppose -23 = rx - 55. What is the least common multiple of x and (1 - -4) + (-38)/19? 24 Let c(q) = q*2 + 5q - 3. Let r be c(-7). Suppose 0 = 2k - 5t - r, -3t - 7 = -4k + 2*t. Calculate the	{ "pile_set_name": "DM Mathematics" }
Find the first derivative of 1293276g2 - 166013 wrt g. 2586552g Find the second derivative of 11pu*3 - 3pu2 + pu + 20p + 337u*2 - 109 wrt u. 66pu - 6p + 674 Differentiate -13bl*2 - 6559b - 16l2 - 3l - 14 wrt b. -13l2 - 6559 What is the third derivative of 385f*5 - 120f*2 - f - 1 wrt f? 23100f*2 What is the first derivative of -ah - 11a - 50h*4 + 46h - 30982 wrt h? -a - 200h3 + 46 What is the second derivative of -4t*3z*2 - 358t*3 + 2t*2z - 2095tz*4 - 6tz - 2 wrt z? -8t*3 - 25140tz2 Differentiate -39998d + 98934. -39998 Find the third derivative of -43066z4 + 3202z*2. -1033584z What is the second derivative of 16ch*2p*3 + 1658ch2p + 7ch - 6cp - 2430h2p*3 + p wrt p? 96ch2p - 14580h2p What is the second derivative of 191626b3o*2w2 - b3ow*2 + 2b*2ow - bow2 + 7bw2 - 4bw wrt o? 383252b*3w*2 Find the third derivative of -307158c*3r*3 + 2c*2r*3 - 2c*2r*2 - 30c*2r - 298cr*3 wrt c. -1842948r*3 What is the third derivative of -24x*5 + 1058x*4 - 58024x*2? -1440x*2 + 25392x Differentiate -4u2x*3 + 2u*2 - 464105x*3 - 241332 wrt x. -12u*2x*2 - 1392315x2 Differentiate -l2w3 - 263020l*2w*2 - 2423w*3 + 39w*2 wrt l. -2lw3 - 526040lw2 What is the second derivative of 1658506l*2 + 121l + 6422? 3317012 Find the second derivative of 1589785p3 - 1082208p wrt p. 9538710p What is the third derivative of -81141l*3s*2 - 8061l*2s*2 + ls wrt l? -486846s2 Find the second derivative of -85833a*3 + 59a - 57 wrt a. -514998a Find the first derivative of -ci*3 + 276ci - 31c + 48211i3 wrt c. -i3 + 276i - 31 Find the third derivative of -6m5 + 7m*4 - 21m*3 + 2m*2 + 115m + 2. -360m2 + 168m - 126 What is the second derivative of 236z4 + 3z3 - z2 + 7754z + 5 wrt z? 2832z*2 + 18z - 2 Find the third derivative of 107525h3i*6 + 25606h*3i + i*2 wrt i. 12903000h*3i*3 Find the second derivative of 33u*4 + 406u3 + u2 - 214u - 303 wrt u. 396u*2 + 2436u + 2 Find the second derivative of -107v3w*2 + 14v*3w + v*2w - 2vw*2 + 33497 wrt v. -642vw2 + 84vw + 2w Find the third derivative of 6072o4 - 4o*2 + 561o. 145728o Find the second derivative of 3474f*3 + 4f*2 + 56357f wrt f. 20844f + 8 What is the derivative of 52437p*3v - 140815p3 + 2p*2v wrt v? 52437p3 + 2p*2 Differentiate -601791x*4 - 150321. -2407164x*3 What is the derivative of 712085p*2 - 1287555 wrt p? 1424170p What is the third derivative of -2v4z - v4 - v3z - 435v*3 - 24v*2z - 2v2 + 486 wrt v? -48vz - 24v - 6z - 2610 Find the third derivative of 29n*3v*3 - 46n*3v - 2414nv5 + v2 - 57 wrt v. 174n3 - 144840nv2 What is the third derivative of 37525l3 - l2 - 8l - 1553? 225150 What is the third derivative of 2z*5 - 25817z*4 + 5z*3 + 982705z*2 + 2z + 2 wrt z? 120z2 - 619608z + 30 What is the third derivative of -100368an*4 + 12an2 + 4an - 2a + 3n2 wrt n? -2408832an Find the third derivative of 7752m*3t*4 + 6m*3t*2 + 126m*3 + 4mt6 - 26t*2 wrt t. 186048m*3t + 480mt*3 Find the third derivative of -216558s*4 + 1107s*2 + 38 wrt s. -5197392s What is the derivative of 606548c + 634140? 606548 Find the second derivative of 1264144s*2 + 2s + 1001769. 2528288 What is the first derivative of 818521a3 - 1181802 wrt a? 2455563a*2 Find the third derivative of -780295a*3x*2 + 2a*2x2 - a2 + 3ax - 37x2 - 206x wrt a. -4681770x2 Find the second derivative of -47y*5 + 359y4 + y2 + 52y - 3501. -940y*3 + 4308y*2 + 2 What is the derivative of 38b*3q + 364b3 + 529bq3 + 19b wrt q? 38b3 + 1587bq2 Find the second derivative of -57h*5 - 40h*2 + 74402h wrt h. -1140h3 - 80 Find the second derivative of -364m*3n2 + m3n - m3 - 59m*2n*2 + 59m*2n - 2mn*2 - 11n wrt n. -728m3 - 118m*2 - 4m Find the third derivative of g*4 - 763g*3 - 27g*2 - 144. 24g - 4578 What is the second derivative of 1097046r2 - 135117r? 2194092 What is the first derivative of -392219f - 260365? -392219 Find the third derivative of 4z*6 + 2z*5 + 44886z*3 + 38z*2 - 140z - 1. 480z3 + 120z*2 + 269316 What is the second derivative of 53o*4 - 23o*3 - 2o*2 + 236868o? 636o2 - 138o - 4 What is the second derivative of 168455n2 + 4511n + 1? 336910 What is the third derivative of 2h4 - 270533h*3n - 5h2 + 8844hn + 4n wrt h? 48h - 1623198n What is the derivative of -6317gh + 54440h wrt g? -6317h Find the second derivative of -gn3 + 243gn2 + 1679475gn + 526n*2 wrt n. -6gn + 486g + 1052 Differentiate -46813bqt - 15617bt + t with respect to q. -46813bt What is the third derivative of -4i*3z*2 - 94458i*3z - 17i2z*2 + 3555i*2 + i wrt i? -24z*2 - 566748z What is the first derivative of 36419c2r*3 - 7c*2r*2 + 628079r*3 wrt c? 72838cr3 - 14cr2 Differentiate 398j*2l - 8009j2 - 16l with respect to l. 398j2 - 16 What is the second derivative of 2968573hr2u*2 + 2hr2 + 211318hru*2 - 2hu2 - h - 2u*2 - 2 wrt r? 5937146hu2 + 4h Find the third derivative of d*3f*2l - 2814d3fl - 4d*3 + 3d*2l + d*2 - 1674f*2 wrt d. 6f*2l - 16884fl - 24 Find the second derivative of 79453b2f*3 - 8bf2 + 106f*3 wrt b. 158906f*3 What is the third derivative of 2127973s*4 - 2053417s*2? 51071352s Find the first derivative of 2b4 - 4b*3 + 1769b*2 - 4b + 1060473. 8b3 - 12b*2 + 3538b - 4 What is the third derivative of -h*3l*2z*3 - 5h*3l*2z*2 - 48h*3lz2 + h3z*2 + 66379hl2z*3 wrt z? -6h*3l*2 + 398274hl2 Find the second derivative of 2065564k*5 + 776k + 319. 41311280k3 What is the derivative of 36oz3 - oz + 10o + 100z*2 - 11 wrt z? 108oz2 - o + 200z What is the third derivative of -56303a3yz3 + 3a*3y + a*2yz2 + ayz - az*3 + 13370z*3 wrt a? -337818yz3 + 18y Find the first derivative of -2a4 + 22a*2y*3 - 232a*2 + 2y*3 - 116y*2 - 21 wrt a. -8a*3 + 44ay3 - 464a What is the second derivative of 470715d3 + 572951d wrt d? 2824290d What is the second derivative of -3mu4 - 877mu3 - 124m + 30u + 3 wrt u? -36mu2 - 5262mu What is the derivative of -910019ow + 82o + 973 wrt w? -910019o Find the third derivative of 195286s*3 - 173738s*2. 1171716 What is the second derivative of 93j*2tw2 - 56j*2w*2 - 2j*2 + jtw - 2048jt + jw*2 wrt j? 186tw2 - 112w*2 - 4 Find the second derivative of 4q*2t2 - q2t - 48q*2 - 2qt + 35q - 9683t4 + t wrt t. 8q*2 - 116196t2 What is the second derivative of -a2h3 - 17a*2h + 10a2 + 17949ah4 + 7ah + 20a - 4h2 wrt h? -6a*2h + 215388ah*2 - 8 Find the third derivative of -1064842g*4 + 6g*2 + 25g + 34. -25556208g Find the second derivative of -17683i*3 - 46299i wrt i. -106098i What is the derivative of 185t*4 + 95t*3 - 2t*2 - 90880? 740t*3 + 285t*2 - 4t Find the third derivative of -7294g4 - 9g*3 - 106180g*2. -175056g - 54 What is the third derivative of -8560h6 - 4h*5 + 103129h*2 - 2? -1027200h*3 - 240h*2 Find the second derivative of -3h*4 + 35483h*2 - 26779h - 15 wrt h. -36h2 + 70966 What is the second derivative of 118743k*4 + 12222k - 25 wrt k? 1424916k2 What is the second derivative of 522858n*2 - 802414n? 1045716 What is the derivative of -37225d2ox2 - 1021d*2x2 - d2x + 6x*2 wrt o? -37225d*2x*2 Find the first derivative of -40m*2 - 738m - 391798. -80m - 738 What is the third derivative of -2o*3y - 314734o3 - 25o*2y + 1929o2 + oy + 1 wrt o? -12y - 1888404 Find the second derivative of 11944n*4 + 36494n. 143328n2 What is the derivative of 8l*3q*3 - 39l*3 + 19l + 85112q3 + q wrt l? 24l*2q*3 - 117l*2 + 19 What is the second derivative of -102247c*3l*3n + 11c3ln - 11c*3l - 29c2n + 2l3 - 3l*n wrt l? -	{ "pile_set_name": "DM Mathematics" }
e 5i - 17 = -2c, -sc + 8i = 7i + 17 for c. -4 Let s be 18/(-30)(0 - 5). Let t = -2 + -1. Let b be t + -1 + 2 - -24. Solve -y + 2d + 16 = -sy, -y + 5d = -b for y. -3 Let d = -322 - -328. Solve 3p + 3r = 0, -26 + d = -4r for p. -5 Let y be 153/4 + 1/(-4). Let x = y + -34. Let c be (x + -6 + -3)-1. Solve -k - 4 = cd - 3, k - 3d + 1 = 0 for k. -1 Let v(h) = -10h + 18. Let g(j) = -j. Let f(a) = -8g(a) + v(a). Let k be f(8). Solve -2z = -5z - 15, kq + 5z = -25 for q. 0 Let o = 55 - 43. Suppose -8p + o = 4p. Let a(c) = -c3 + 6c*2 - 4c - 2. Let k be a(5). Solve 4q - 3r - 7 = 0, -5q = r - k - p for q. 1 Let b(r) = -r3 - 4r*2 + 6r + 6. Let c be b(-5). Let x = 272 + -270. Solve 3j - 5 = -5d, -c = 2j + d - x for j. 0 Let k be 8 + (-180)/22 + (-24)/(-11). Solve 0 = 4r - 2b - 14, 3b + k + 13 = 0 for r. 1 Let q be (-6)/(-12) + 3/(-6). Suppose 3m - 16 + 7 = q. Solve -3t - mz - 9 = -4z, 0 = 5t + 5z + 35 for t. -4 Let y be 2 - (29 + (-2 - -3) + -1). Let w be (8/16)/(y/(-24) + -1). Solve wl + 13 = 3a, -4a + 8 = -3l - 0l for a. -1 Suppose -14 = -3g + 1. Solve -5x - 7 = -4k - 15, 5x - 35 = -gk for x. 4 Let v be ((-27)/2)/(8/(-16))-1. Let y = v - -47. Solve -2k = 2k + h + y, k - 12 = 4h for k. -4 Let j(p) = -2p - 3. Let d be 2/(-5) - 36/10. Let s be j(d). Let n be 28/6 - 1/(-3). Solve -40 = -5u + sc, u - 3u - 5c - n = 0 for u. 5 Let d(i) = i3 - i2 + 2i + 2. Let j be d(3). Let r(l) = 11l + 9. Let k be r(-3). Let p = k + j. Solve -4w + 3w = -px + 8, -2x + 14 = -4w for x. 3 Suppose -54 = -21m - 6m. Solve 3 + 0 = 4k - w, 2 = -4k + mw for k. 2 Let t(k) = 8k - 45. Suppose 0 = -25r + 13r + 72. Let b be t(r). Suppose q - 4l = 4, -q - 1 - 4 = 5l. Solve -4y - u - b = 0, qu + 9 = -3u for y. 0 Let d(g) = -g2 - 22g - 108. Let r be d(-8). Solve 3y = 4y - 4q, rq = 3y for y. 0 Let t = -121 - -152. Solve h - t = -3o - 3h, h = -3o + 19 for o. 5 Suppose -5l - 5n = -30, 40l + 14 = 45l - 3n. Solve 4g - 6t = -2t - 12, lg = t + 3 for g. 2 Let y(t) = -t3 - 11t*2 + 4t + 47. Let l be y(-11). Solve 2 = la + v, 3v - 14 = 4a + v for a. -1 Let v be 35/11 - (13/11 + -1). Solve -3r + 2n + 25 = -vn, 4r = -4n + 12 for r. 5 Let t = -70 - -70. Solve -5p - 22 = 4x, t = p - 0x + 5x + 17 for p. -2 Suppose 0w = -4w. Suppose 3f + 5c - 45 = w, -4c - 13 = 3f - 58. Solve -3g = 5h + f, 0h + 2g + 10 = -2h for h. 0 Suppose l + 15 = t, -4l + 2t + t - 61 = 0. Suppose -552h + 545h - 140 = 0. Let u = l - h. Solve 0 = 2w - 5m - 25, 3m + 6 + 9 = -uw for w. 0 Suppose f - 4l + l - 20 = 0, 4f + 2l = 80. Let k = 47 - 42. Suppose 3c - 2c = k. Solve -4m + 3m = -cw + f, -2m + 20 = 2w for w. 5 Let a be (-27 - -27)2/(-4). Solve -2h + ah = -5g + 17, -h - 1 = 0 for g. 3 Suppose 5o - 1 - 24 = 0. Solve -4s + 6v - v - 32 = 0, -v - 11 = os for s. -3 Let h(r) = r2 - 8r + 6. Let f be h(7). Let u be 5/(-2)2/f. Solve -4k = -3m - 13, 5m - uk + 19 + 1 = 0 for m. -3 Let o(s) = -s + 4. Let y be 112/63 + 6/27. Let h be y/8 + (-21)/(-12). Let d be o(h). Solve u = 3t - 10, 0 = -dt + t - 3u + 10 for t. 4 Suppose -59 + 23 = -6c. Let s = 4 + -7. Let g be 3 - (1 - (-2 - s)). Solve -4r - 25 = -w, -cr + 3r + gw - 30 = 0 for r. -5 Let t be 3/142 - (-432)/168. Solve -16 = td - 5m, 2d - 4 = -4m - 0m for d. -2 Let n = 38 + 20. Suppose n = 2i + 30. Solve t - 6t = 4d - 18, 0 = -3d - 4t + i for d. 2 Suppose 2i = 5w - 479, -w + 4w - 294 = -i. Let g = w + -89. Solve 3m + 2m + 24 = 2x, -m - g = -2x for x. 2 Suppose -3i - 153 = -2l + 32, 43 = -i - 4l. Let c = i + 75. Solve -3o + j = 4 - 16, -4o = 2j - c for o. 4 Let h be 9/(-1 + 3 + -1). Suppose -25r + 22r = -h. Solve 0m = rm + 5l + 16, 5m - 2l - 25 = 0 for m. 3 Let n(r) = r*2 - 10r - 12. Let j = 17 + -5. Let p be n(j). Solve -4m = 4v + p, m = -m + v for m. -1 Suppose -4k = -h - 114, -h - 31 = -5k + 111. Suppose -o + 0o = -2w + k, 3w = 5o + 28. Let p = w - 12. Solve 2s = px - 2, -3s - 20 = s for x. -2 Let f(n) = 12 + n + 5n*2 + 11n + 4 - n*3 + 0n*3. Let p be f(7). Solve 5 = -3a + 2a + 2z, pz = 3a + 15 for a. -5 Suppose -t = 2g - 4g, 0 = -5g - 5t. Let b(q) = -4q. Let c be b(-1). Let d = c - g. Solve -x - 8 = 4n, n - 3n - 2x = d for n. -2 Suppose 9 = -v + 49. Solve 0 = -3r + 5y + v, -r + 5y + 10 = -20 for r. 5 Let t(z) be the first derivative of -3z*2/2 - 2. Let d be t(-1). Suppose -2p = 5j - 28, -7j + 4p = -dj. Solve 0 = -i - 2 - 0, -u = ji + 3 for u. 5 Let j(q) = -4 - 2q*2 - 383q + 4 + 372q. Let f be j(-5). Solve -1 = -fc - 2w, -2c - w = -3c + 3 for c. 1 Let a(y) = 6y - 3. Let u(s) = -s + 1. Let z(h) = a(h) + 5u(h). Let k be z(2). Solve 3r - 5 = 2g - 0, 3g - r = -k for g. -1 Let u = 4 - -1. Suppose 12 = -5s - 0s - 4g, -2g = 6. Suppose s = 4h - 4, -7h + 2h = 3w - 50. Solve 3y - u - 7 = n, 4y - n - w = 0 for y. 3 Let k = -6 + 8. Let m = -15 - -24. Suppose c + p = m, 2p = -4c - c + 39. Solve b - 5j = -12, -k = cb - 2b + 4j for b. -2 Let m be ((-6)/(-10))/(((-8)/(-20))/2). Solve -4u - 4o + 28 = 0, mu - 4 = 3o - 13 for u. 2 Let y = -158 + 181. Solve g + y = -2g + 2t, -2g = -4t + 26 for g. -5 Let g(b) = -4b3 + 2b*2 + 2b + 1. Let y be g(-1). Let p = 30 - 27. Let d be 14((-12)/(-14))/p. Solve o = 2f + 9, do - 1 = -yf - 4 for f. -3 Let i = -85 + 89. Solve -ih = -5n, -3h = -2h + 5n + 25 for h. -5 Let y(h) = -h3 - 14h*2 - 13h + 5. Let a be y(-13). Solve 3j - 2j + 5i - 5 = 0, -5 = -ai for j. 0 Let a = -1810 - -1813. Solve -3s = -x + 14, s + 0s = -ax - 8 for x. -1 Let c(x) = 5x - 34. Let m be c(14). Let s = 38 - m. Solve 0 = -sk - y - 0 - 1, -5k - 22 = -4y for k. -2 Let w be (2 + -1)/(5/20). Suppose -8 + 16 = wr. Solve 3t + 2t - 20 = 5a, rt = 10 for a. 1 Suppose 0 = -6l + 3l - 225. Let p = -61 - l. Solve -3q - 9 = d, 5 = 3d + p for q. -2 Suppose 69 - 25 = 11d. Solve 6b + 3 = 3b, 23 = -dl - 3b for l. -5 Let s(j) = j + 1. Let f be s(-3). Let b be (-169)/(-52) - f/(-8). Solve bh - 3o = 0, 0o - o = -3h + 8 for h. 4 Let l = 7 - 6. Let v be (l + 0)/((-2)/(-14)). Suppose r - 5 = -t, -3t = -t - 4. Solve o = -4, -vo = u - ro + 18 for u. -2 Let a be 3/(-2)4/(-3). Suppose -5 = -5k + 5. Suppose -79 = -4p + 3i - ki, -3i = 9. Solve aq - p = 3c - 3q, 4c = 4q - 20 for c. -3 Let o(c) = 3c + 13. Let q be o(2). Suppose -3u = 1 - 10. Let p be (4 - 22)(-4)/3. Solve -4f - p = um, -q - 8 = 5f + 3m for f. -3 Let x(t) = -t*3 + 7t*2 - 4t - 4. Let v be x(6). Solve 3k - 11 = s, 3s - 3k + 13 = -v for s. -5 Let j(h) = 5h*2 + h - 2. Let n be j(1). Solve nz = 3w, -w + 0z = -3z - 5 for w. -4 Suppose 0 = -386o + 377o. Solve 3w = -5n - o + 5, -n = w - 3 for n. -2 Suppose -12 = -2f + 4f. Let r be 2/f + 28/21. Let z be 43/9 - (-4 + (-68)/(-18)). Solve z = 5a - 2i, -9 + r = 3a + i for a. -1 Let y(f) = -f*2 + 3f + 18. Let c be y(6). Solve 3n - 11 = 5j, -n = 4j - cj + 19 for j. -4 Let v = 8 + 0. Suppose -x + 3x = 4k - v, -3x = 3k - 24. Solve -5y + 5j + 10 = 0, -y = 2y + kj - 27 for y. 5 Let i be (-30)/(-7) - 140/(-196). Solve -4 = 2b + 2b, 3z + ib - 7 = 0 for z. 4 Suppose -9k + 507 - 480 = 0. Solve t + 2 = 4, 4 = 2n - kt for n. 5 Let d be (-189)/(-35) - 2/5. Let l = d - 7. Let g(n) = -4n3 - n2 + n - 1. Let o be g(l). Solve -45 = -5b + 4w - 0w, -4b + w + o = 0 for b. 5 Suppose 521w = 494w + 540. Solve 4p = v + 3v - w, -6 = -3v for p. -3 Suppose -5c - c + 18 = 0. Suppose -10h = -ch + 189. Let r be ((-6)/9)/(6/h). Solve 0 = 5d + 2u + 2u, -ru = 4d + 1 for d. -4 Let x(l) = -l2 - 4l + 2. Let v be x(-3). Suppose -6i - 20 = -74. Suppose -w = 3r - 66 + i, -vw = 2r - 51. Solve 3t + 2k = t + 14, -2t + r = 3k for t. 3 Let s = -998 - -1000. Solve 2l - 5 = su + 5, -u = -4l + 17 for u. -1 Let c(y) = y2 - y + 3. Let u be c(-6). Let a = -39 + u. Solve 3m - 25 = 2k, -m = 3k - am + 40 for k. -5 Suppose 308 = 3j + 2t, -3j - 6t + 304 = -2t. Let f = j + -104. Solve -2a - 9 = -3o - fa, 6 = 2a for o. 5 Suppose 9p - 2p = 2p. Solve pc + 12 = 4c + 3k, -c + 5k + 3 = 0 for c. 3 Let w = -283 + 283. Solve 6 = -3u + 3c - wc, -2*c	{ "pile_set_name": "DM Mathematics" }
f*5 - 15f*6 - 19f*k - lf*5 + 7f*5 wrt f? -1800f*3 Let p(k) = -613k*4 + 2k*3 - 68k + 1235. Let b(z) = z*3 - 34z. Let n(x) = -2b(x) + p(x). What is the derivative of n(f) wrt f? -2452f*3 Let c be (8 + -4)/(6/3). Find the second derivative of 71x*c + 36x - 144x + 46x*2 wrt x. 234 Suppose 321 = 7l + 111. Let x = 46 + -22. Find the second derivative of lh2 - 21h*2 + 19h + xh wrt h. 18 Let v be 2 + -1 + (-15)/5-1. Find the second derivative of 56u4 + 4u - 33uv - 2u + 59 + 13u4 wrt u. 432u*2 Let s(f) be the first derivative of -36f*2 - 41 + 0f - 67/3f3. Find the second derivative of s(q) wrt q. -134 Suppose -180w - 167 = -707. Let j(h) be the second derivative of 13h2 + 0 + 1/4h*5 + 24h + 0h4 + 0h*w. Differentiate j(q) with respect to q. 15q*2 Let u(h) be the second derivative of 755h*3/6 - 1481h*2 + 24h - 26. Find the first derivative of u(v) wrt v. 755 What is the derivative of 495s + 2899 + 474s - 18s - 97s wrt s? 854 Let l(i) be the third derivative of 49i6/60 - 13i5/60 + i4/12 + 1430i3/3 + 13i*2 - 38. Find the second derivative of l(a) wrt a. 588a - 26 Let s(w) be the second derivative of -7 - 5/2w2 + 0w*5 + 2/3w*3 + 13/30w*6 - 7/12w*4 + w. Find the second derivative of s(r) wrt r. 156r*2 - 14 Let w(p) be the first derivative of 2351p*5/5 + 1923p + 2324. What is the first derivative of w(u) wrt u? 9404u3 Suppose 2v = -i + 20, 3v = -4i - i + 65. What is the second derivative of ij3 - 80j + 6j3 + 17j*3 wrt j? 198j Differentiate 459v3 - 120v*2 + 482v*3 + 9v - 8924 - 939v3 with respect to v. 6v*2 - 240v + 9 Let i(k) = 3k2 - 3k - 3. Let p be i(-2). Suppose -po = -11o - 4. Differentiate 13 - 1 - 1 + o - 7s3 wrt s. -21s*2 Let p(k) = 6k*4 - 19k*3 - 59k2. Let i(j) = -j4 + j*3. Let s(m) = i(m) - p(m). Find the third derivative of s(t) wrt t. -168t + 120 What is the second derivative of 1291p2 + 1587p - 4924 + 4924 wrt p? 2582 Find the first derivative of -4150w3 + 45808w*2 + 1102 + 2781 - 45808w*2 wrt w. -12450w*2 Suppose -5i = 5c + 305, 3c = 5c - 2. Let s be (-1)/(2 + 3) - i/10. Find the third derivative of -7w*2 + 2w*4 + sw*2 + 18w*2 wrt w. 48w Let d(h) be the second derivative of 69/5h5 + 0h*2 + 2 + 0h*4 + 127h - 41/3h3. Find the second derivative of d(m) wrt m. 1656m Let s(x) = -48x2 + 12055x + 14675. Let d(y) = 17y2 - 4019y - 4891. Let r(p) = 17d(p) + 6s(p). What is the derivative of r(f) wrt f? 2f + 4007 Let j(z) = -1 - 17z*3 - 2 + 9 + 28. Let t(w) = -80 + 3w*3 - 2w*3 - 57 + 136. Let f(b) = -j(b) + 5t(b). What is the derivative of f(g) wrt g? 66g2 Suppose -d = 3x - 39, 0 = d - 2d + 4x + 11. What is the second derivative of 13r - dr + 108r3 - 92r wrt r? 648r Let y = -407 - -409. What is the first derivative of -63m*y + 157 - 2m + 82m2 + 3m + 2m wrt m? 38m + 3 Let s(z) be the third derivative of -z*3/6 + 108z*2. Let k(w) = -115w - 91. Let u(g) = k(g) + s(g). Find the first derivative of u(b) wrt b. -115 Suppose -8b - 203 = -37b. What is the third derivative of 56n3 + 213n*2 - 57n*3 + 24n*5 + 7n - bn wrt n? 1440n*2 - 6 Let j(b) be the third derivative of 61b6/120 + b5/30 - 19b4/24 - 1761b*3/2 + 12b*2 - 147b. Differentiate j(w) with respect to w. 183w2 + 4w - 19 Let t(o) be the second derivative of -413o5/20 + o4/3 - 185o*2/2 + 6o - 124. Find the third derivative of t(j) wrt j. -2478 Let z(d) = d + 1. Let k(l) = 16l + 23. Let m(t) = k(t) - 2z(t). Let v(c) = -14c - 21. Let s(a) = -5m(a) - 4v(a). Differentiate s(o) with respect to o. -14 Suppose -5v = -4 - 6. Let q be 14 - ((-108)/(-6) - 6). What is the second derivative of -20c + 7c + c - vcq wrt c? -4 Let c(n) be the first derivative of 1589n*3/3 + 3233n*2/2 + 309. What is the second derivative of c(j) wrt j? 3178 Suppose -b + 2j + 9 = 0, 0 = 5b + j - 21 - 2. Find the third derivative of 48d*5 - 80d*2 + 35d*b + 2d*5 wrt d. 5100d*2 Let u(h) be the third derivative of 173h*6/20 + 2167h*4/24 - 5788h*2. What is the second derivative of u(c) wrt c? 6228c Let j(h) be the second derivative of 36h - 17/10h*6 - 14h*2 - 1/3h*3 + 0h*4 + 0h*5 + 0. What is the second derivative of j(m) wrt m? -612m*2 Let u(r) be the second derivative of -58r*6/15 + 3r*5/20 - 7r*4/12 + 1236r*2 + 6672r. What is the first derivative of u(w) wrt w? -464w3 + 9w*2 - 14w Let x(p) = 68p3 - 4p*2 + 6p + 3. Let r(k) = 0 + 485k2 + 1 - 487k*2. Let t(i) = -3r(i) + x(i). What is the third derivative of t(l) wrt l? 408 Let w = -81 - -83. Find the first derivative of 27 - y2 - yw + 4y - 77 - 5y wrt y. -4y - 1 Let d(v) be the first derivative of -v6/6 + 2v*5/5 + 229v4/4 - v3/3 - 19v2/2 - 13v + 889. Find the third derivative of d(g) wrt g. -60g2 + 48g + 1374 Let u(t) be the third derivative of -4031t4/24 + 1103t*3/2 + 4535t*2. What is the derivative of u(l) wrt l? -4031 Suppose -4 - 17 = -7r. Let u be 1r - (-19 + 18). Find the first derivative of 11b*3 - 7b*3 + 13 - 7b*4 - ub*3 wrt b. -28b*3 Let k(o) = -814o*3 - 2906o*2 - 9o - 9. Let m(h) = -198h3 - 727h*2 - 2h - 2. Let r(s) = 2k(s) - 9m(s). Find the third derivative of r(t) wrt t. 924 Let n(g) be the third derivative of 102g5/5 + 163g*4/6 - 793g*2. Find the second derivative of n(d) wrt d. 2448 Let m(s) be the third derivative of -691s*5/20 + 527s*4/12 - 2s*2 + 368s. What is the second derivative of m(u) wrt u? -4146 Let d(t) = t*3 - 6t*2 - 6t - 2. Let f be d(7). Let y be ((-63)/18 + 4)(-3 + 9). Differentiate fj*3 - 15j*3 - 7j*y - 3 wrt j. -51j2 Let u(o) = o3 + 25o2 + 0o*3 - 13o*2 - 13o*2. Let r(x) = 2x*3 - 12x*2. Let m(c) = -r(c) - 10u(c). What is the third derivative of m(n) wrt n? -72 Let p(t) be the second derivative of -t*4/6 - 348t*3 + 350t*2 + 1105t. What is the derivative of p(k) wrt k? -4k - 2088 Let b(z) be the second derivative of 169z*4 + 1461z*2 - 100z - 13. Find the first derivative of b(i) wrt i. 4056i Let k(m) = -5m - 378. Let u be k(-76). Let w be (-15)/(-2) - 3/6. What is the second derivative of 3n + 0n - wn - 7n + n*u wrt n? 2 Let v(n) be the first derivative of 261n*5/5 + 3n*2/2 - 638n - 1647. Find the first derivative of v(f) wrt f. 1044f3 + 3 Let h(w) be the third derivative of -8851w*5/60 - 437w4/8 - w3/2 + 1857w2. What is the second derivative of h(r) wrt r? -17702 Let k(y) = -540y*4 + 3y*3 - 51y - 11. Let n(l) = -538l4 + 2l*3 - 52l - 9. Let o(v) = -2k(v) + 3n(v). What is the second derivative of o(d) wrt d? -6408d2 Let w(s) be the third derivative of 707s*4/12 + 6073s*3/6 - 7s*2 + 3s + 4. Find the first derivative of w(g) wrt g. 1414 Let l(x) be the third derivative of -701x6/60 - 117x4/8 - x3/3 - 418x2 - x. What is the second derivative of l(o) wrt o? -8412o Let s(f) = -10f3 - 2f*2 + 13f + 3345. Let h(y) = -10y3 - 2y*2 + 8y + 3344. Let c(r) = -5h(r) + 4s(r). Find the first derivative of c(u) wrt u. 30u2 + 4u + 12 Suppose 10r - 12r + 112 = 0. Find the third derivative of -9 + 5c6 + 3c*2 - rc*3 + 56c*3 wrt c. 600c*3 Let t be 2 + -4 - 2 - -7. What is the third derivative of 0i*4 - 60 + 13i + 17i4 + 5i + 2it + i2 - 18i wrt i? 408i + 12 What is the second derivative of 3365g - 1688g + 1316g*2 - 2771g wrt g? 2632 Suppose 9 = v - 0v. Let c(t) be the first derivative of -vt + 8t2 - 27 + 2t - 18t. Differentiate c(x) with respect to x. 16 Let g(f) = 2f*2 - 6f - 3. Let y be g(4). Suppose -yb = 4b. Find the third derivative of -2v + 2v + 15v3 + bv*2 - 9v*2 wrt v. 90 Find the third derivative of 596a*4 - 32a*2 + 5 + 116a - 59a - 59a - 5 wrt a. 14304a Let t(b) be the second derivative of -53b*2 + 29/3b*3 + 1/12b*4 + 5 - 8b. Differentiate t(s) wrt s. 2s + 58 Let m be -2 + (-3 - (1 + -29)). What is the first derivative of -11101o*3 + 2o*4 - m + 11039o*3 - 18 wrt o? 8o*3 - 186o*2 What is the second derivative of 2450b + 424 + 358b4 - 2453b + 2329b4 + 1798b**4 - 72	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.