file
stringlengths 18
26
| data
stringlengths 3
1.04M
|
|---|---|
the_stack_data/196072.c | #include <stdio.h>
#include <stdlib.h>
int allDone( char * argv[] ) {
for ( int i = 2; i < sizeof(argv); i+=2 ) {
if ( argv[i] != 0 ) {
return 0;
}
}
return 1;
}
int main( int argc, char * argv[] ) {
printf('%i', allDone(argv));
}
|
the_stack_data/139830.c | /* This file was automatically generated by CasADi.
The CasADi copyright holders make no ownership claim of its contents. */
#ifdef __cplusplus
extern "C" {
#endif
/* How to prefix internal symbols */
#ifdef CODEGEN_PREFIX
#define NAMESPACE_CONCAT(NS, ID) _NAMESPACE_CONCAT(NS, ID)
#define _NAMESPACE_CONCAT(NS, ID) NS ## ID
#define CASADI_PREFIX(ID) NAMESPACE_CONCAT(CODEGEN_PREFIX, ID)
#else
#define CASADI_PREFIX(ID) crane_dae_impl_ode_jac_x_xdot_u_ ## ID
#endif
#include <math.h>
#ifndef casadi_real
#define casadi_real double
#endif
#ifndef casadi_int
#define casadi_int int
#endif
/* Add prefix to internal symbols */
#define casadi_f0 CASADI_PREFIX(f0)
#define casadi_s0 CASADI_PREFIX(s0)
#define casadi_s1 CASADI_PREFIX(s1)
#define casadi_s2 CASADI_PREFIX(s2)
#define casadi_s3 CASADI_PREFIX(s3)
#define casadi_s4 CASADI_PREFIX(s4)
#define casadi_s5 CASADI_PREFIX(s5)
/* Symbol visibility in DLLs */
#ifndef CASADI_SYMBOL_EXPORT
#if defined(_WIN32) || defined(__WIN32__) || defined(__CYGWIN__)
#if defined(STATIC_LINKED)
#define CASADI_SYMBOL_EXPORT
#else
#define CASADI_SYMBOL_EXPORT __declspec(dllexport)
#endif
#elif defined(__GNUC__) && defined(GCC_HASCLASSVISIBILITY)
#define CASADI_SYMBOL_EXPORT __attribute__ ((visibility ("default")))
#else
#define CASADI_SYMBOL_EXPORT
#endif
#endif
static const casadi_int casadi_s0[13] = {9, 1, 0, 9, 0, 1, 2, 3, 4, 5, 6, 7, 8};
static const casadi_int casadi_s1[6] = {2, 1, 0, 2, 0, 1};
static const casadi_int casadi_s2[29] = {11, 9, 0, 3, 7, 8, 10, 13, 13, 15, 16, 17, 4, 8, 9, 0, 1, 4, 10, 1, 4, 9, 3, 4, 10, 5, 6, 6, 9};
static const casadi_int casadi_s3[22] = {11, 9, 0, 2, 3, 4, 5, 6, 7, 8, 9, 10, 0, 10, 1, 2, 3, 4, 5, 6, 7, 8};
static const casadi_int casadi_s4[11] = {11, 2, 0, 4, 6, 4, 7, 8, 10, 2, 9};
static const casadi_int casadi_s5[8] = {11, 2, 0, 2, 3, 8, 9, 10};
/* crane_dae_impl_ode_jac_x_xdot_u:(i0[9],i1[9],i2[2],i3[2])->(o0[11x9,17nz],o1[11x9,10nz],o2[11x2,6nz],o3[11x2,3nz]) */
static int casadi_f0(const casadi_real** arg, casadi_real** res, casadi_int* iw, casadi_real* w, void* mem) {
casadi_real a0, a1, a10, a11, a12, a13, a14, a2, a3, a4, a5, a6, a7, a8, a9;
a0=4.7418203070092001e-02;
a1=arg[2] ? arg[2][0] : 0;
a2=(a0*a1);
a3=arg[0] ? arg[0][3] : 0;
a4=cos(a3);
a5=(a2*a4);
a6=9.8100000000000005e+00;
a7=sin(a3);
a7=(a6*a7);
a5=(a5+a7);
a7=2.;
a8=arg[0] ? arg[0][1] : 0;
a9=(a7*a8);
a10=arg[0] ? arg[0][4] : 0;
a11=(a9*a10);
a5=(a5+a11);
a11=arg[0] ? arg[0][0] : 0;
a5=(a5/a11);
a5=(a5/a11);
if (res[0]!=0) res[0][0]=a5;
a5=(a11+a11);
a12=sin(a11);
a5=(a5-a12);
if (res[0]!=0) res[0][1]=a5;
a5=-1.;
if (res[0]!=0) res[0][2]=a5;
a12=1.;
if (res[0]!=0) res[0][3]=a12;
a13=-4.0493711676434543e+01;
if (res[0]!=0) res[0][4]=a13;
a13=(a7*a10);
a13=(a13/a11);
a13=(-a13);
if (res[0]!=0) res[0][5]=a13;
a13=arg[1] ? arg[1][0] : 0;
a14=(a1*a8);
a13=(a13-a14);
a14=(a13+a13);
a14=(a14*a1);
if (res[0]!=0) res[0][6]=a14;
a14=1.3803228073658729e+00;
if (res[0]!=0) res[0][7]=a14;
a14=cos(a3);
a6=(a6*a14);
a14=sin(a3);
a2=(a2*a14);
a6=(a6-a2);
a6=(a6/a11);
a6=(-a6);
if (res[0]!=0) res[0][8]=a6;
a6=1.2500000000000000e-01;
a3=(a3+a3);
a6=(a6*a3);
a6=(-a6);
if (res[0]!=0) res[0][9]=a6;
if (res[0]!=0) res[0][10]=a12;
a9=(a9/a11);
a9=(-a9);
if (res[0]!=0) res[0][11]=a9;
a9=1.0000000000000001e-01;
a10=(a10+a9);
a10=sin(a10);
if (res[0]!=0) res[0][12]=a10;
if (res[0]!=0) res[0][13]=a12;
a10=-7.8182378879940387e+01;
if (res[0]!=0) res[0][14]=a10;
a10=3.7072679182318851e+00;
if (res[0]!=0) res[0][15]=a10;
a10=-8.;
if (res[0]!=0) res[0][16]=a10;
if (res[1]!=0) res[1][0]=a5;
a10=(a13+a13);
a10=(-a10);
if (res[1]!=0) res[1][1]=a10;
if (res[1]!=0) res[1][2]=a5;
if (res[1]!=0) res[1][3]=a5;
if (res[1]!=0) res[1][4]=a5;
if (res[1]!=0) res[1][5]=a5;
if (res[1]!=0) res[1][6]=a5;
if (res[1]!=0) res[1][7]=a5;
if (res[1]!=0) res[1][8]=a5;
if (res[1]!=0) res[1][9]=a5;
a0=(a0*a4);
a0=(a0/a11);
a0=(-a0);
if (res[2]!=0) res[2][0]=a0;
if (res[2]!=0) res[2][1]=a12;
a1=(a1+a1);
if (res[2]!=0) res[2][2]=a1;
a13=(a13+a13);
a13=(a13*a8);
if (res[2]!=0) res[2][3]=a13;
if (res[2]!=0) res[2][4]=a12;
a13=arg[2] ? arg[2][1] : 0;
a13=cos(a13);
a13=(-a13);
if (res[2]!=0) res[2][5]=a13;
if (res[3]!=0) res[3][0]=a5;
if (res[3]!=0) res[3][1]=a12;
if (res[3]!=0) res[3][2]=a7;
return 0;
}
CASADI_SYMBOL_EXPORT int crane_dae_impl_ode_jac_x_xdot_u(const casadi_real** arg, casadi_real** res, casadi_int* iw, casadi_real* w, void* mem){
return casadi_f0(arg, res, iw, w, mem);
}
CASADI_SYMBOL_EXPORT void crane_dae_impl_ode_jac_x_xdot_u_incref(void) {
}
CASADI_SYMBOL_EXPORT void crane_dae_impl_ode_jac_x_xdot_u_decref(void) {
}
CASADI_SYMBOL_EXPORT casadi_int crane_dae_impl_ode_jac_x_xdot_u_n_in(void) { return 4;}
CASADI_SYMBOL_EXPORT casadi_int crane_dae_impl_ode_jac_x_xdot_u_n_out(void) { return 4;}
CASADI_SYMBOL_EXPORT const char* crane_dae_impl_ode_jac_x_xdot_u_name_in(casadi_int i){
switch (i) {
case 0: return "i0";
case 1: return "i1";
case 2: return "i2";
case 3: return "i3";
default: return 0;
}
}
CASADI_SYMBOL_EXPORT const char* crane_dae_impl_ode_jac_x_xdot_u_name_out(casadi_int i){
switch (i) {
case 0: return "o0";
case 1: return "o1";
case 2: return "o2";
case 3: return "o3";
default: return 0;
}
}
CASADI_SYMBOL_EXPORT const casadi_int* crane_dae_impl_ode_jac_x_xdot_u_sparsity_in(casadi_int i) {
switch (i) {
case 0: return casadi_s0;
case 1: return casadi_s0;
case 2: return casadi_s1;
case 3: return casadi_s1;
default: return 0;
}
}
CASADI_SYMBOL_EXPORT const casadi_int* crane_dae_impl_ode_jac_x_xdot_u_sparsity_out(casadi_int i) {
switch (i) {
case 0: return casadi_s2;
case 1: return casadi_s3;
case 2: return casadi_s4;
case 3: return casadi_s5;
default: return 0;
}
}
CASADI_SYMBOL_EXPORT int crane_dae_impl_ode_jac_x_xdot_u_work(casadi_int *sz_arg, casadi_int* sz_res, casadi_int *sz_iw, casadi_int *sz_w) {
if (sz_arg) *sz_arg = 4;
if (sz_res) *sz_res = 4;
if (sz_iw) *sz_iw = 0;
if (sz_w) *sz_w = 0;
return 0;
}
#ifdef __cplusplus
} /* extern "C" */
#endif
|
the_stack_data/95450838.c | /* PR c/64279 */
/* { dg-do compile } */
/* { dg-options "-Wduplicated-branches" } */
extern int *g;
extern const int *q;
void
f (int i)
{
int j;
if (i == 0)
for (j = 0; j < 10; j++)
++*g;
else
for (j = 0; j < 10; j++)
++*g;
if (i == 1)
{
int i = 10;
*g = i;
}
else
{
int i = 10;
*g = i;
}
if (i == 3)
q = (const int []){1};
else
q = (const int []){1};
}
|
the_stack_data/18887304.c | // PASS: *
// RUN: ${CATO_ROOT}/src/scripts/cexecute_pass.py %s -o %t
// RUN: diff <(mpirun -np 4 %t) %s.reference_output
#include <stdio.h>
#include <stdlib.h>
#include <omp.h>
int main()
{
int result = 100;
#pragma omp parallel reduction(-:result)
{
result -= omp_get_thread_num();
}
printf("Result: %d\n", result);
}
|
the_stack_data/89200657.c | /*
* esp32 gpio.
*/
/* empty placeholder */
|
the_stack_data/34513721.c | typedef unsigned int __kernel_size_t;
typedef __kernel_size_t size_t;
typedef unsigned int __u32;
struct compstat
{
__u32 unc_bytes;
__u32 unc_packets;
__u32 comp_bytes;
__u32 comp_packets;
__u32 inc_bytes;
__u32 inc_packets;
__u32 in_count;
__u32 bytes_out;
double ratio;
};
struct ppp_comp_stats
{
struct compstat c;
struct compstat d;
};
int main()
{
struct ppp_comp_stats cstats;
void *point;
point = (void *)(&cstats);
memset(point, 0, 81UL);
return 0;
}
|
the_stack_data/57950930.c | /* ============ LATEST ===============
// number_6e7.txt : 16.847s
*/
/* ============ OLD ===============
// number_1e7.txt : 3.324s
// number_6e7.txt : 31.219s
// number_7e7.txt : 3m27.213s == 207s
// number_8e7.txt : 5m10.414s == 310s
// number_1e8.txt : 10m38.628s == 638s
*/
// Command : sudo perf stat -I100 -M Summary,Frontend,Frontend_Bandwidth,Memory_BW,Memory_Bound,Memory_Lat,Pipeline -x, -o mergesort_xinput.csv ./mergesort.out 700000000 < ../numbers_7e7.txt
#include <stdio.h>
#include <stdlib.h>
#include <time.h>
void merge(int *a, int lo, int mid, int hi) {
int *aux = (int *) malloc((hi-lo+1) * sizeof(int));
int i = lo, j = mid+1, k = 0;
while(k < hi-lo+1) {
if (i > mid) aux[k++] = a[j++];
else if (j > hi) aux[k++] = a[i++];
else if (a[i] < a[j]) aux[k++] = a[i++];
else aux[k++] = a[j++];
}
for(int i = lo; i < hi-lo+1; i++) {
a[i] = aux[i];
}
free(aux);
}
void mergesort(int *a, int lo, int hi) {
if (lo < hi) {
// find the middle value
int mid = lo + (hi-lo)/2;
// Sort first and second halves
mergesort(a, lo, mid);
mergesort(a, mid+1, hi);
// Merge the two halves
merge(a, lo, mid, hi);
}
}
int main(int argc, char *argv[]) {
if (argc < 2) {
printf("One argument missing.\n");
return -1;
}
int n = atol(argv[1]);
int *a = (int *) malloc(n * sizeof(int));
for (int i = 0; i < n; i++) {
scanf("%d", &a[i]);
}
mergesort(a, 0, n-1);
// for (int i = 0; i < n; i++) {
// printf("%d ", a[i]);
// }
// printf("\n");
free(a);
return 0;
} |
the_stack_data/14794.c | /* */
#include <sys/types.h>
#include <fcntl.h>
#include <malloc.h>
#include <inttypes.h>
#include <limits.h>
#include <stdint.h>
#include <stdio.h>
#include <stdlib.h>
#include <string.h>
#include <sys/stat.h>
#include <time.h>
#include <signal.h>
int main(void){return 0;}
|
the_stack_data/192331443.c | // RUN: %llvmgcc -S %s -o - | llvm-as -o /dev/null
static int foo(int);
static int foo(C)
char C;
{
return C;
}
void test() {
foo(7);
}
|
the_stack_data/582445.c | int foo(int x) {
return x + 1;
}
int main() {
int a = 1;
return foo(a);
}
|
the_stack_data/232955049.c | #include <math.h>
#include <stdlib.h>
#include <string.h>
#include <stdio.h>
#include <complex.h>
#ifdef complex
#undef complex
#endif
#ifdef I
#undef I
#endif
#if defined(_WIN64)
typedef long long BLASLONG;
typedef unsigned long long BLASULONG;
#else
typedef long BLASLONG;
typedef unsigned long BLASULONG;
#endif
#ifdef LAPACK_ILP64
typedef BLASLONG blasint;
#if defined(_WIN64)
#define blasabs(x) llabs(x)
#else
#define blasabs(x) labs(x)
#endif
#else
typedef int blasint;
#define blasabs(x) abs(x)
#endif
typedef blasint integer;
typedef unsigned int uinteger;
typedef char *address;
typedef short int shortint;
typedef float real;
typedef double doublereal;
typedef struct { real r, i; } complex;
typedef struct { doublereal r, i; } doublecomplex;
#ifdef _MSC_VER
static inline _Fcomplex Cf(complex *z) {_Fcomplex zz={z->r , z->i}; return zz;}
static inline _Dcomplex Cd(doublecomplex *z) {_Dcomplex zz={z->r , z->i};return zz;}
static inline _Fcomplex * _pCf(complex *z) {return (_Fcomplex*)z;}
static inline _Dcomplex * _pCd(doublecomplex *z) {return (_Dcomplex*)z;}
#else
static inline _Complex float Cf(complex *z) {return z->r + z->i*_Complex_I;}
static inline _Complex double Cd(doublecomplex *z) {return z->r + z->i*_Complex_I;}
static inline _Complex float * _pCf(complex *z) {return (_Complex float*)z;}
static inline _Complex double * _pCd(doublecomplex *z) {return (_Complex double*)z;}
#endif
#define pCf(z) (*_pCf(z))
#define pCd(z) (*_pCd(z))
typedef int logical;
typedef short int shortlogical;
typedef char logical1;
typedef char integer1;
#define TRUE_ (1)
#define FALSE_ (0)
/* Extern is for use with -E */
#ifndef Extern
#define Extern extern
#endif
/* I/O stuff */
typedef int flag;
typedef int ftnlen;
typedef int ftnint;
/*external read, write*/
typedef struct
{ flag cierr;
ftnint ciunit;
flag ciend;
char *cifmt;
ftnint cirec;
} cilist;
/*internal read, write*/
typedef struct
{ flag icierr;
char *iciunit;
flag iciend;
char *icifmt;
ftnint icirlen;
ftnint icirnum;
} icilist;
/*open*/
typedef struct
{ flag oerr;
ftnint ounit;
char *ofnm;
ftnlen ofnmlen;
char *osta;
char *oacc;
char *ofm;
ftnint orl;
char *oblnk;
} olist;
/*close*/
typedef struct
{ flag cerr;
ftnint cunit;
char *csta;
} cllist;
/*rewind, backspace, endfile*/
typedef struct
{ flag aerr;
ftnint aunit;
} alist;
/* inquire */
typedef struct
{ flag inerr;
ftnint inunit;
char *infile;
ftnlen infilen;
ftnint *inex; /*parameters in standard's order*/
ftnint *inopen;
ftnint *innum;
ftnint *innamed;
char *inname;
ftnlen innamlen;
char *inacc;
ftnlen inacclen;
char *inseq;
ftnlen inseqlen;
char *indir;
ftnlen indirlen;
char *infmt;
ftnlen infmtlen;
char *inform;
ftnint informlen;
char *inunf;
ftnlen inunflen;
ftnint *inrecl;
ftnint *innrec;
char *inblank;
ftnlen inblanklen;
} inlist;
#define VOID void
union Multitype { /* for multiple entry points */
integer1 g;
shortint h;
integer i;
/* longint j; */
real r;
doublereal d;
complex c;
doublecomplex z;
};
typedef union Multitype Multitype;
struct Vardesc { /* for Namelist */
char *name;
char *addr;
ftnlen *dims;
int type;
};
typedef struct Vardesc Vardesc;
struct Namelist {
char *name;
Vardesc **vars;
int nvars;
};
typedef struct Namelist Namelist;
#define abs(x) ((x) >= 0 ? (x) : -(x))
#define dabs(x) (fabs(x))
#define f2cmin(a,b) ((a) <= (b) ? (a) : (b))
#define f2cmax(a,b) ((a) >= (b) ? (a) : (b))
#define dmin(a,b) (f2cmin(a,b))
#define dmax(a,b) (f2cmax(a,b))
#define bit_test(a,b) ((a) >> (b) & 1)
#define bit_clear(a,b) ((a) & ~((uinteger)1 << (b)))
#define bit_set(a,b) ((a) | ((uinteger)1 << (b)))
#define abort_() { sig_die("Fortran abort routine called", 1); }
#define c_abs(z) (cabsf(Cf(z)))
#define c_cos(R,Z) { pCf(R)=ccos(Cf(Z)); }
#ifdef _MSC_VER
#define c_div(c, a, b) {Cf(c)._Val[0] = (Cf(a)._Val[0]/Cf(b)._Val[0]); Cf(c)._Val[1]=(Cf(a)._Val[1]/Cf(b)._Val[1]);}
#define z_div(c, a, b) {Cd(c)._Val[0] = (Cd(a)._Val[0]/Cd(b)._Val[0]); Cd(c)._Val[1]=(Cd(a)._Val[1]/df(b)._Val[1]);}
#else
#define c_div(c, a, b) {pCf(c) = Cf(a)/Cf(b);}
#define z_div(c, a, b) {pCd(c) = Cd(a)/Cd(b);}
#endif
#define c_exp(R, Z) {pCf(R) = cexpf(Cf(Z));}
#define c_log(R, Z) {pCf(R) = clogf(Cf(Z));}
#define c_sin(R, Z) {pCf(R) = csinf(Cf(Z));}
//#define c_sqrt(R, Z) {*(R) = csqrtf(Cf(Z));}
#define c_sqrt(R, Z) {pCf(R) = csqrtf(Cf(Z));}
#define d_abs(x) (fabs(*(x)))
#define d_acos(x) (acos(*(x)))
#define d_asin(x) (asin(*(x)))
#define d_atan(x) (atan(*(x)))
#define d_atn2(x, y) (atan2(*(x),*(y)))
#define d_cnjg(R, Z) { pCd(R) = conj(Cd(Z)); }
#define r_cnjg(R, Z) { pCf(R) = conjf(Cf(Z)); }
#define d_cos(x) (cos(*(x)))
#define d_cosh(x) (cosh(*(x)))
#define d_dim(__a, __b) ( *(__a) > *(__b) ? *(__a) - *(__b) : 0.0 )
#define d_exp(x) (exp(*(x)))
#define d_imag(z) (cimag(Cd(z)))
#define r_imag(z) (cimagf(Cf(z)))
#define d_int(__x) (*(__x)>0 ? floor(*(__x)) : -floor(- *(__x)))
#define r_int(__x) (*(__x)>0 ? floor(*(__x)) : -floor(- *(__x)))
#define d_lg10(x) ( 0.43429448190325182765 * log(*(x)) )
#define r_lg10(x) ( 0.43429448190325182765 * log(*(x)) )
#define d_log(x) (log(*(x)))
#define d_mod(x, y) (fmod(*(x), *(y)))
#define u_nint(__x) ((__x)>=0 ? floor((__x) + .5) : -floor(.5 - (__x)))
#define d_nint(x) u_nint(*(x))
#define u_sign(__a,__b) ((__b) >= 0 ? ((__a) >= 0 ? (__a) : -(__a)) : -((__a) >= 0 ? (__a) : -(__a)))
#define d_sign(a,b) u_sign(*(a),*(b))
#define r_sign(a,b) u_sign(*(a),*(b))
#define d_sin(x) (sin(*(x)))
#define d_sinh(x) (sinh(*(x)))
#define d_sqrt(x) (sqrt(*(x)))
#define d_tan(x) (tan(*(x)))
#define d_tanh(x) (tanh(*(x)))
#define i_abs(x) abs(*(x))
#define i_dnnt(x) ((integer)u_nint(*(x)))
#define i_len(s, n) (n)
#define i_nint(x) ((integer)u_nint(*(x)))
#define i_sign(a,b) ((integer)u_sign((integer)*(a),(integer)*(b)))
#define pow_dd(ap, bp) ( pow(*(ap), *(bp)))
#define pow_si(B,E) spow_ui(*(B),*(E))
#define pow_ri(B,E) spow_ui(*(B),*(E))
#define pow_di(B,E) dpow_ui(*(B),*(E))
#define pow_zi(p, a, b) {pCd(p) = zpow_ui(Cd(a), *(b));}
#define pow_ci(p, a, b) {pCf(p) = cpow_ui(Cf(a), *(b));}
#define pow_zz(R,A,B) {pCd(R) = cpow(Cd(A),*(B));}
#define s_cat(lpp, rpp, rnp, np, llp) { ftnlen i, nc, ll; char *f__rp, *lp; ll = (llp); lp = (lpp); for(i=0; i < (int)*(np); ++i) { nc = ll; if((rnp)[i] < nc) nc = (rnp)[i]; ll -= nc; f__rp = (rpp)[i]; while(--nc >= 0) *lp++ = *(f__rp)++; } while(--ll >= 0) *lp++ = ' '; }
#define s_cmp(a,b,c,d) ((integer)strncmp((a),(b),f2cmin((c),(d))))
#define s_copy(A,B,C,D) { int __i,__m; for (__i=0, __m=f2cmin((C),(D)); __i<__m && (B)[__i] != 0; ++__i) (A)[__i] = (B)[__i]; }
#define sig_die(s, kill) { exit(1); }
#define s_stop(s, n) {exit(0);}
static char junk[] = "\n@(#)LIBF77 VERSION 19990503\n";
#define z_abs(z) (cabs(Cd(z)))
#define z_exp(R, Z) {pCd(R) = cexp(Cd(Z));}
#define z_sqrt(R, Z) {pCd(R) = csqrt(Cd(Z));}
#define myexit_() break;
#define mycycle() continue;
#define myceiling(w) {ceil(w)}
#define myhuge(w) {HUGE_VAL}
//#define mymaxloc_(w,s,e,n) {if (sizeof(*(w)) == sizeof(double)) dmaxloc_((w),*(s),*(e),n); else dmaxloc_((w),*(s),*(e),n);}
#define mymaxloc(w,s,e,n) {dmaxloc_(w,*(s),*(e),n)}
/* procedure parameter types for -A and -C++ */
#define F2C_proc_par_types 1
#ifdef __cplusplus
typedef logical (*L_fp)(...);
#else
typedef logical (*L_fp)();
#endif
static float spow_ui(float x, integer n) {
float pow=1.0; unsigned long int u;
if(n != 0) {
if(n < 0) n = -n, x = 1/x;
for(u = n; ; ) {
if(u & 01) pow *= x;
if(u >>= 1) x *= x;
else break;
}
}
return pow;
}
static double dpow_ui(double x, integer n) {
double pow=1.0; unsigned long int u;
if(n != 0) {
if(n < 0) n = -n, x = 1/x;
for(u = n; ; ) {
if(u & 01) pow *= x;
if(u >>= 1) x *= x;
else break;
}
}
return pow;
}
#ifdef _MSC_VER
static _Fcomplex cpow_ui(complex x, integer n) {
complex pow={1.0,0.0}; unsigned long int u;
if(n != 0) {
if(n < 0) n = -n, x.r = 1/x.r, x.i=1/x.i;
for(u = n; ; ) {
if(u & 01) pow.r *= x.r, pow.i *= x.i;
if(u >>= 1) x.r *= x.r, x.i *= x.i;
else break;
}
}
_Fcomplex p={pow.r, pow.i};
return p;
}
#else
static _Complex float cpow_ui(_Complex float x, integer n) {
_Complex float pow=1.0; unsigned long int u;
if(n != 0) {
if(n < 0) n = -n, x = 1/x;
for(u = n; ; ) {
if(u & 01) pow *= x;
if(u >>= 1) x *= x;
else break;
}
}
return pow;
}
#endif
#ifdef _MSC_VER
static _Dcomplex zpow_ui(_Dcomplex x, integer n) {
_Dcomplex pow={1.0,0.0}; unsigned long int u;
if(n != 0) {
if(n < 0) n = -n, x._Val[0] = 1/x._Val[0], x._Val[1] =1/x._Val[1];
for(u = n; ; ) {
if(u & 01) pow._Val[0] *= x._Val[0], pow._Val[1] *= x._Val[1];
if(u >>= 1) x._Val[0] *= x._Val[0], x._Val[1] *= x._Val[1];
else break;
}
}
_Dcomplex p = {pow._Val[0], pow._Val[1]};
return p;
}
#else
static _Complex double zpow_ui(_Complex double x, integer n) {
_Complex double pow=1.0; unsigned long int u;
if(n != 0) {
if(n < 0) n = -n, x = 1/x;
for(u = n; ; ) {
if(u & 01) pow *= x;
if(u >>= 1) x *= x;
else break;
}
}
return pow;
}
#endif
static integer pow_ii(integer x, integer n) {
integer pow; unsigned long int u;
if (n <= 0) {
if (n == 0 || x == 1) pow = 1;
else if (x != -1) pow = x == 0 ? 1/x : 0;
else n = -n;
}
if ((n > 0) || !(n == 0 || x == 1 || x != -1)) {
u = n;
for(pow = 1; ; ) {
if(u & 01) pow *= x;
if(u >>= 1) x *= x;
else break;
}
}
return pow;
}
static integer dmaxloc_(double *w, integer s, integer e, integer *n)
{
double m; integer i, mi;
for(m=w[s-1], mi=s, i=s+1; i<=e; i++)
if (w[i-1]>m) mi=i ,m=w[i-1];
return mi-s+1;
}
static integer smaxloc_(float *w, integer s, integer e, integer *n)
{
float m; integer i, mi;
for(m=w[s-1], mi=s, i=s+1; i<=e; i++)
if (w[i-1]>m) mi=i ,m=w[i-1];
return mi-s+1;
}
static inline void cdotc_(complex *z, integer *n_, complex *x, integer *incx_, complex *y, integer *incy_) {
integer n = *n_, incx = *incx_, incy = *incy_, i;
#ifdef _MSC_VER
_Fcomplex zdotc = {0.0, 0.0};
if (incx == 1 && incy == 1) {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc._Val[0] += conjf(Cf(&x[i]))._Val[0] * Cf(&y[i])._Val[0];
zdotc._Val[1] += conjf(Cf(&x[i]))._Val[1] * Cf(&y[i])._Val[1];
}
} else {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc._Val[0] += conjf(Cf(&x[i*incx]))._Val[0] * Cf(&y[i*incy])._Val[0];
zdotc._Val[1] += conjf(Cf(&x[i*incx]))._Val[1] * Cf(&y[i*incy])._Val[1];
}
}
pCf(z) = zdotc;
}
#else
_Complex float zdotc = 0.0;
if (incx == 1 && incy == 1) {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc += conjf(Cf(&x[i])) * Cf(&y[i]);
}
} else {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc += conjf(Cf(&x[i*incx])) * Cf(&y[i*incy]);
}
}
pCf(z) = zdotc;
}
#endif
static inline void zdotc_(doublecomplex *z, integer *n_, doublecomplex *x, integer *incx_, doublecomplex *y, integer *incy_) {
integer n = *n_, incx = *incx_, incy = *incy_, i;
#ifdef _MSC_VER
_Dcomplex zdotc = {0.0, 0.0};
if (incx == 1 && incy == 1) {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc._Val[0] += conj(Cd(&x[i]))._Val[0] * Cd(&y[i])._Val[0];
zdotc._Val[1] += conj(Cd(&x[i]))._Val[1] * Cd(&y[i])._Val[1];
}
} else {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc._Val[0] += conj(Cd(&x[i*incx]))._Val[0] * Cd(&y[i*incy])._Val[0];
zdotc._Val[1] += conj(Cd(&x[i*incx]))._Val[1] * Cd(&y[i*incy])._Val[1];
}
}
pCd(z) = zdotc;
}
#else
_Complex double zdotc = 0.0;
if (incx == 1 && incy == 1) {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc += conj(Cd(&x[i])) * Cd(&y[i]);
}
} else {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc += conj(Cd(&x[i*incx])) * Cd(&y[i*incy]);
}
}
pCd(z) = zdotc;
}
#endif
static inline void cdotu_(complex *z, integer *n_, complex *x, integer *incx_, complex *y, integer *incy_) {
integer n = *n_, incx = *incx_, incy = *incy_, i;
#ifdef _MSC_VER
_Fcomplex zdotc = {0.0, 0.0};
if (incx == 1 && incy == 1) {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc._Val[0] += Cf(&x[i])._Val[0] * Cf(&y[i])._Val[0];
zdotc._Val[1] += Cf(&x[i])._Val[1] * Cf(&y[i])._Val[1];
}
} else {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc._Val[0] += Cf(&x[i*incx])._Val[0] * Cf(&y[i*incy])._Val[0];
zdotc._Val[1] += Cf(&x[i*incx])._Val[1] * Cf(&y[i*incy])._Val[1];
}
}
pCf(z) = zdotc;
}
#else
_Complex float zdotc = 0.0;
if (incx == 1 && incy == 1) {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc += Cf(&x[i]) * Cf(&y[i]);
}
} else {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc += Cf(&x[i*incx]) * Cf(&y[i*incy]);
}
}
pCf(z) = zdotc;
}
#endif
static inline void zdotu_(doublecomplex *z, integer *n_, doublecomplex *x, integer *incx_, doublecomplex *y, integer *incy_) {
integer n = *n_, incx = *incx_, incy = *incy_, i;
#ifdef _MSC_VER
_Dcomplex zdotc = {0.0, 0.0};
if (incx == 1 && incy == 1) {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc._Val[0] += Cd(&x[i])._Val[0] * Cd(&y[i])._Val[0];
zdotc._Val[1] += Cd(&x[i])._Val[1] * Cd(&y[i])._Val[1];
}
} else {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc._Val[0] += Cd(&x[i*incx])._Val[0] * Cd(&y[i*incy])._Val[0];
zdotc._Val[1] += Cd(&x[i*incx])._Val[1] * Cd(&y[i*incy])._Val[1];
}
}
pCd(z) = zdotc;
}
#else
_Complex double zdotc = 0.0;
if (incx == 1 && incy == 1) {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc += Cd(&x[i]) * Cd(&y[i]);
}
} else {
for (i=0;i<n;i++) { /* zdotc = zdotc + dconjg(x(i))* y(i) */
zdotc += Cd(&x[i*incx]) * Cd(&y[i*incy]);
}
}
pCd(z) = zdotc;
}
#endif
/* -- translated by f2c (version 20000121).
You must link the resulting object file with the libraries:
-lf2c -lm (in that order)
*/
/* Table of constant values */
static integer c__1 = 1;
/* > \brief \b DSYCON */
/* =========== DOCUMENTATION =========== */
/* Online html documentation available at */
/* http://www.netlib.org/lapack/explore-html/ */
/* > \htmlonly */
/* > Download DSYCON + dependencies */
/* > <a href="http://www.netlib.org/cgi-bin/netlibfiles.tgz?format=tgz&filename=/lapack/lapack_routine/dsycon.
f"> */
/* > [TGZ]</a> */
/* > <a href="http://www.netlib.org/cgi-bin/netlibfiles.zip?format=zip&filename=/lapack/lapack_routine/dsycon.
f"> */
/* > [ZIP]</a> */
/* > <a href="http://www.netlib.org/cgi-bin/netlibfiles.txt?format=txt&filename=/lapack/lapack_routine/dsycon.
f"> */
/* > [TXT]</a> */
/* > \endhtmlonly */
/* Definition: */
/* =========== */
/* SUBROUTINE DSYCON( UPLO, N, A, LDA, IPIV, ANORM, RCOND, WORK, */
/* IWORK, INFO ) */
/* CHARACTER UPLO */
/* INTEGER INFO, LDA, N */
/* DOUBLE PRECISION ANORM, RCOND */
/* INTEGER IPIV( * ), IWORK( * ) */
/* DOUBLE PRECISION A( LDA, * ), WORK( * ) */
/* > \par Purpose: */
/* ============= */
/* > */
/* > \verbatim */
/* > */
/* > DSYCON estimates the reciprocal of the condition number (in the */
/* > 1-norm) of a real symmetric matrix A using the factorization */
/* > A = U*D*U**T or A = L*D*L**T computed by DSYTRF. */
/* > */
/* > An estimate is obtained for norm(inv(A)), and the reciprocal of the */
/* > condition number is computed as RCOND = 1 / (ANORM * norm(inv(A))). */
/* > \endverbatim */
/* Arguments: */
/* ========== */
/* > \param[in] UPLO */
/* > \verbatim */
/* > UPLO is CHARACTER*1 */
/* > Specifies whether the details of the factorization are stored */
/* > as an upper or lower triangular matrix. */
/* > = 'U': Upper triangular, form is A = U*D*U**T; */
/* > = 'L': Lower triangular, form is A = L*D*L**T. */
/* > \endverbatim */
/* > */
/* > \param[in] N */
/* > \verbatim */
/* > N is INTEGER */
/* > The order of the matrix A. N >= 0. */
/* > \endverbatim */
/* > */
/* > \param[in] A */
/* > \verbatim */
/* > A is DOUBLE PRECISION array, dimension (LDA,N) */
/* > The block diagonal matrix D and the multipliers used to */
/* > obtain the factor U or L as computed by DSYTRF. */
/* > \endverbatim */
/* > */
/* > \param[in] LDA */
/* > \verbatim */
/* > LDA is INTEGER */
/* > The leading dimension of the array A. LDA >= f2cmax(1,N). */
/* > \endverbatim */
/* > */
/* > \param[in] IPIV */
/* > \verbatim */
/* > IPIV is INTEGER array, dimension (N) */
/* > Details of the interchanges and the block structure of D */
/* > as determined by DSYTRF. */
/* > \endverbatim */
/* > */
/* > \param[in] ANORM */
/* > \verbatim */
/* > ANORM is DOUBLE PRECISION */
/* > The 1-norm of the original matrix A. */
/* > \endverbatim */
/* > */
/* > \param[out] RCOND */
/* > \verbatim */
/* > RCOND is DOUBLE PRECISION */
/* > The reciprocal of the condition number of the matrix A, */
/* > computed as RCOND = 1/(ANORM * AINVNM), where AINVNM is an */
/* > estimate of the 1-norm of inv(A) computed in this routine. */
/* > \endverbatim */
/* > */
/* > \param[out] WORK */
/* > \verbatim */
/* > WORK is DOUBLE PRECISION array, dimension (2*N) */
/* > \endverbatim */
/* > */
/* > \param[out] IWORK */
/* > \verbatim */
/* > IWORK is INTEGER array, dimension (N) */
/* > \endverbatim */
/* > */
/* > \param[out] INFO */
/* > \verbatim */
/* > INFO is INTEGER */
/* > = 0: successful exit */
/* > < 0: if INFO = -i, the i-th argument had an illegal value */
/* > \endverbatim */
/* Authors: */
/* ======== */
/* > \author Univ. of Tennessee */
/* > \author Univ. of California Berkeley */
/* > \author Univ. of Colorado Denver */
/* > \author NAG Ltd. */
/* > \date December 2016 */
/* > \ingroup doubleSYcomputational */
/* ===================================================================== */
/* Subroutine */ int dsycon_(char *uplo, integer *n, doublereal *a, integer *
lda, integer *ipiv, doublereal *anorm, doublereal *rcond, doublereal *
work, integer *iwork, integer *info)
{
/* System generated locals */
integer a_dim1, a_offset, i__1;
/* Local variables */
integer kase, i__;
extern logical lsame_(char *, char *);
integer isave[3];
logical upper;
extern /* Subroutine */ int dlacn2_(integer *, doublereal *, doublereal *,
integer *, doublereal *, integer *, integer *), xerbla_(char *,
integer *, ftnlen);
doublereal ainvnm;
extern /* Subroutine */ int dsytrs_(char *, integer *, integer *,
doublereal *, integer *, integer *, doublereal *, integer *,
integer *);
/* -- LAPACK computational routine (version 3.7.0) -- */
/* -- LAPACK is a software package provided by Univ. of Tennessee, -- */
/* -- Univ. of California Berkeley, Univ. of Colorado Denver and NAG Ltd..-- */
/* December 2016 */
/* ===================================================================== */
/* Test the input parameters. */
/* Parameter adjustments */
a_dim1 = *lda;
a_offset = 1 + a_dim1 * 1;
a -= a_offset;
--ipiv;
--work;
--iwork;
/* Function Body */
*info = 0;
upper = lsame_(uplo, "U");
if (! upper && ! lsame_(uplo, "L")) {
*info = -1;
} else if (*n < 0) {
*info = -2;
} else if (*lda < f2cmax(1,*n)) {
*info = -4;
} else if (*anorm < 0.) {
*info = -6;
}
if (*info != 0) {
i__1 = -(*info);
xerbla_("DSYCON", &i__1, (ftnlen)6);
return 0;
}
/* Quick return if possible */
*rcond = 0.;
if (*n == 0) {
*rcond = 1.;
return 0;
} else if (*anorm <= 0.) {
return 0;
}
/* Check that the diagonal matrix D is nonsingular. */
if (upper) {
/* Upper triangular storage: examine D from bottom to top */
for (i__ = *n; i__ >= 1; --i__) {
if (ipiv[i__] > 0 && a[i__ + i__ * a_dim1] == 0.) {
return 0;
}
/* L10: */
}
} else {
/* Lower triangular storage: examine D from top to bottom. */
i__1 = *n;
for (i__ = 1; i__ <= i__1; ++i__) {
if (ipiv[i__] > 0 && a[i__ + i__ * a_dim1] == 0.) {
return 0;
}
/* L20: */
}
}
/* Estimate the 1-norm of the inverse. */
kase = 0;
L30:
dlacn2_(n, &work[*n + 1], &work[1], &iwork[1], &ainvnm, &kase, isave);
if (kase != 0) {
/* Multiply by inv(L*D*L**T) or inv(U*D*U**T). */
dsytrs_(uplo, n, &c__1, &a[a_offset], lda, &ipiv[1], &work[1], n,
info);
goto L30;
}
/* Compute the estimate of the reciprocal condition number. */
if (ainvnm != 0.) {
*rcond = 1. / ainvnm / *anorm;
}
return 0;
/* End of DSYCON */
} /* dsycon_ */
|
the_stack_data/51700313.c | #include <sys/types.h>
#include <sys/ipc.h>
#include <sys/sem.h>
#include <sys/stat.h>
#include <unistd.h>
#include <stdio.h>
#include <fcntl.h>
#include <stdlib.h>
#include <errno.h>
#include <string.h>
#include <time.h>
//Dead lock as example from presentation
int main() {
int semid;
int i = 0;
struct sembuf mybuf;
char pathname [] = "lw13.c";
key_t key;
key = ftok ( pathname, 0 );
if ( ( semid = semget ( key, 2, 0666 | IPC_CREAT ) ) < 0 ) {
printf("Can\'t create semaphore set\n");
exit(-1);
}
mybuf.sem_num = 0;
mybuf.sem_op = 1;
mybuf.sem_flg = 0;
if(semop(semid, &mybuf, 1) < 0){
printf("fuck Can\'t add 1 to semaphore\n");
exit(-1);
}
mybuf.sem_num = 1;
if(semop(semid, &mybuf, 1) < 0){
printf("suck Can\'t add 1 to semaphore\n");
exit(-1);
}
if ( fork() > 0 ) {
printf ( "I'm inside parent)))\n" );
while ( 1 ) {
printf ( "Iteration a %d\n", i);
mybuf.sem_num = 0;
mybuf.sem_op = -1;
semop(semid, &mybuf, 1);
mybuf.sem_num = 1;
semop(semid, &mybuf, 1);
mybuf.sem_num = 0;
mybuf.sem_op = 1;
semop(semid, &mybuf, 1);
mybuf.sem_num = 1;
semop(semid, &mybuf, 1);
i++;
}
}
else {
printf ( "I'm inside child)))\n" );
while ( 1 ) {
printf ( "Iteration b %d\n", i );
mybuf.sem_num = 0;
mybuf.sem_op = -1;
semop(semid, &mybuf, 1);
mybuf.sem_num = 1;
semop(semid, &mybuf, 1);
mybuf.sem_num = 0;
mybuf.sem_op = 1;
semop(semid, &mybuf, 1);
mybuf.sem_num = 1;
semop(semid, &mybuf, 1);
i++;
}
}
return 0;
}
|
the_stack_data/64199252.c | // SKIP PARAM: --set ana.activated[+] apron
extern int __VERIFIER_nondet_int();
#include <assert.h>
extern void magic();
int g;
int h;
void main() {
int r = __VERIFIER_nondet_int();
int x = __VERIFIER_nondet_int();
if (r < 1000) { // avoid overflow
x = r;
g = r;
h = r + 1;
assert(g < h);
magic(); // invalidates (forgets) globals
assert(g < h); // UNKNOWN!
assert(x == r); // shouldn't forget locals
}
}
|
the_stack_data/977982.c | #include <assert.h>
#include <inttypes.h>
#include <stdbool.h>
#include <stddef.h>
#include <stdio.h>
#include <string.h>
// Maps an English word to a number using linear search.
static int_fast32_t wordToNumber(const char* const word)
{
assert(word && strlen(word) >= 3 && strlen(word) <= 9);
static const struct
{
const char* literal;
uint_fast32_t value;
} alphabet[][6] =
{
#ifdef V
#error
#endif
#define V(literal, value) {#literal, value},
// Group the literals by their string lengths to speed up search a little.
{V(one, 1) V(two, 2) V(six, 6) V(ten, 10)},
{V(zero, 0) V(four, 4) V(five, 5) V(nine, 9)},
{
V(three, 3) V(seven, 7) V(eight, 8)
V(forty, 40) V(fifty, 50) V(sixty, 60)
},
{
V(eleven, 11) V(twelve, 12) V(twenty, 20)
V(thirty, 30) V(eighty, 80) V(ninety, 90)
},
{V(fifteen, 15) V(sixteen, 16) V(seventy, 70)},
{
V(thirteen, 13) V(fourteen, 14)
V(eighteen, 18) V(nineteen, 19)
},
{V(seventeen, 17)}
#undef V
};
static const size_t alphabetRowWidth = sizeof *alphabet / sizeof **alphabet;
const size_t i = strlen(word) - 3;
for(size_t j = 0; j < alphabetRowWidth && alphabet[i][j].literal; ++j)
{
if(!strcmp(alphabet[i][j].literal, word)) return alphabet[i][j].value;
}
return -1;
}
// Converts numbers written in English words that fall within the (-1e9, 1e9]
// interval into integers.
static int_fast32_t interpretNumber(char* words)
{
assert(words);
int_fast32_t result = 0, chunkSum = 0;
for(char* chunk = strtok(words, " \n"); chunk; chunk = strtok(NULL, " \n"))
{
const bool is1e2 = !strcmp(chunk, "hundred"),
is1e3 = !is1e2 && !strcmp(chunk, "thousand"),
is1e6 = !is1e2 && !is1e3 && !strcmp(chunk, "million");
if(!is1e2 && !is1e3 && !is1e6)
{
const int_fast32_t value = wordToNumber(chunk);
if(value >= 0) chunkSum += value;
}
else if(is1e2) chunkSum *= 100;
else
{
const uint_fast32_t magnitude = is1e3 ? 1e3 :
is1e6 ? 1e6 : 1;
result += chunkSum * magnitude;
chunkSum = 0;
}
}
// Don't forget the last chunk.
result += chunkSum;
const bool isNegative = !strcmp(words, "negative");
return (isNegative) ? (-result) : (result);
}
int main(const int argc, const char* const argv[])
{
// Getting away with no error checking throughout because CodeEval makes some
// strong guarantees about our runtime environment. No need to pay when we're
// being benchmarked. Don't forget to define NDEBUG prior to submitting!
assert(argc >= 2 && "Expecting at least one command-line argument.");
static char stdoutBuffer[512] = "";
// Turn on full output buffering for stdout.
setvbuf(stdout, stdoutBuffer, _IOFBF, sizeof stdoutBuffer);
FILE* inputStream = fopen(argv[1], "r");
assert(inputStream && "Failed to open input stream.");
for(char lineBuffer[256] = "";
fgets(lineBuffer, sizeof lineBuffer, inputStream);)
{
printf("%" PRIdFAST32 "\n", interpretNumber(lineBuffer));
}
// The CRT takes care of cleanup.
}
|
the_stack_data/73574687.c | double A[100];
void foo() {
#pragma dvm actual(A)
#pragma dvm region in(A)out(A)
{
#pragma dvm parallel([I]) tie(A[-I]) across(A [0:1])
for (int I = 98; I >= 0; --I)
A[I] = A[I + 1];
}
#pragma dvm get_actual(A)
}
|
the_stack_data/1235117.c | /* This testcase is part of GDB, the GNU debugger.
Copyright (C) 2012-2020 Free Software Foundation, Inc.
This program is free software; you can redistribute it and/or modify
it under the terms of the GNU General Public License as published by
the Free Software Foundation; either version 3 of the License, or
(at your option) any later version.
This program is distributed in the hope that it will be useful,
but WITHOUT ANY WARRANTY; without even the implied warranty of
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
GNU General Public License for more details.
You should have received a copy of the GNU General Public License
along with this program. If not, see <http://www.gnu.org/licenses/>. */
static int
function (void)
{
return 1; /* step stops here */
}
int
main ()
{
function ();
return 0;
}
|
the_stack_data/1052403.c | // KASAN: use-after-free Write in dst_release
// https://syzkaller.appspot.com/bug?id=bf967d2c5ba62946c61152534c8b84823d848f05
// status:fixed
// autogenerated by syzkaller (http://github.com/google/syzkaller)
#define _GNU_SOURCE
#include <arpa/inet.h>
#include <endian.h>
#include <errno.h>
#include <errno.h>
#include <errno.h>
#include <fcntl.h>
#include <linux/if.h>
#include <linux/if_ether.h>
#include <linux/if_tun.h>
#include <linux/ip.h>
#include <linux/net.h>
#include <linux/tcp.h>
#include <net/if_arp.h>
#include <netinet/in.h>
#include <sched.h>
#include <signal.h>
#include <signal.h>
#include <stdarg.h>
#include <stdarg.h>
#include <stdarg.h>
#include <stdbool.h>
#include <stdbool.h>
#include <stdio.h>
#include <stdio.h>
#include <stdio.h>
#include <stdlib.h>
#include <sys/ioctl.h>
#include <sys/prctl.h>
#include <sys/prctl.h>
#include <sys/resource.h>
#include <sys/socket.h>
#include <sys/stat.h>
#include <sys/syscall.h>
#include <sys/time.h>
#include <sys/time.h>
#include <sys/uio.h>
#include <sys/wait.h>
#include <sys/wait.h>
#include <time.h>
#include <unistd.h>
__attribute__((noreturn)) static void doexit(int status)
{
volatile unsigned i;
syscall(__NR_exit_group, status);
for (i = 0;; i++) {
}
}
#include <errno.h>
#include <stdarg.h>
#include <stdint.h>
#include <stdio.h>
#include <string.h>
const int kFailStatus = 67;
const int kRetryStatus = 69;
static void fail(const char* msg, ...)
{
int e = errno;
va_list args;
va_start(args, msg);
vfprintf(stderr, msg, args);
va_end(args);
fprintf(stderr, " (errno %d)\n", e);
doexit((e == ENOMEM || e == EAGAIN) ? kRetryStatus : kFailStatus);
}
#define BITMASK_LEN(type, bf_len) (type)((1ull << (bf_len)) - 1)
#define BITMASK_LEN_OFF(type, bf_off, bf_len) \
(type)(BITMASK_LEN(type, (bf_len)) << (bf_off))
#define STORE_BY_BITMASK(type, addr, val, bf_off, bf_len) \
if ((bf_off) == 0 && (bf_len) == 0) { \
*(type*)(addr) = (type)(val); \
} else { \
type new_val = *(type*)(addr); \
new_val &= ~BITMASK_LEN_OFF(type, (bf_off), (bf_len)); \
new_val |= ((type)(val)&BITMASK_LEN(type, (bf_len))) << (bf_off); \
*(type*)(addr) = new_val; \
}
struct csum_inet {
uint32_t acc;
};
static void csum_inet_init(struct csum_inet* csum)
{
csum->acc = 0;
}
static void csum_inet_update(struct csum_inet* csum, const uint8_t* data,
size_t length)
{
if (length == 0)
return;
size_t i;
for (i = 0; i < length - 1; i += 2)
csum->acc += *(uint16_t*)&data[i];
if (length & 1)
csum->acc += (uint16_t)data[length - 1];
while (csum->acc > 0xffff)
csum->acc = (csum->acc & 0xffff) + (csum->acc >> 16);
}
static uint16_t csum_inet_digest(struct csum_inet* csum)
{
return ~csum->acc;
}
static uint64_t current_time_ms()
{
struct timespec ts;
if (clock_gettime(CLOCK_MONOTONIC, &ts))
fail("clock_gettime failed");
return (uint64_t)ts.tv_sec * 1000 + (uint64_t)ts.tv_nsec / 1000000;
}
static void vsnprintf_check(char* str, size_t size, const char* format,
va_list args)
{
int rv;
rv = vsnprintf(str, size, format, args);
if (rv < 0)
fail("tun: snprintf failed");
if ((size_t)rv >= size)
fail("tun: string '%s...' doesn't fit into buffer", str);
}
static void snprintf_check(char* str, size_t size, const char* format, ...)
{
va_list args;
va_start(args, format);
vsnprintf_check(str, size, format, args);
va_end(args);
}
#define COMMAND_MAX_LEN 128
#define PATH_PREFIX \
"PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin "
#define PATH_PREFIX_LEN (sizeof(PATH_PREFIX) - 1)
static void execute_command(bool panic, const char* format, ...)
{
va_list args;
char command[PATH_PREFIX_LEN + COMMAND_MAX_LEN];
int rv;
va_start(args, format);
memcpy(command, PATH_PREFIX, PATH_PREFIX_LEN);
vsnprintf_check(command + PATH_PREFIX_LEN, COMMAND_MAX_LEN, format, args);
rv = system(command);
if (panic && rv != 0)
fail("tun: command \"%s\" failed with code %d", &command[0], rv);
va_end(args);
}
static int tunfd = -1;
static int tun_frags_enabled;
#define SYZ_TUN_MAX_PACKET_SIZE 1000
#define TUN_IFACE "syz_tun"
#define LOCAL_MAC "aa:aa:aa:aa:aa:aa"
#define REMOTE_MAC "aa:aa:aa:aa:aa:bb"
#define LOCAL_IPV4 "172.20.20.170"
#define REMOTE_IPV4 "172.20.20.187"
#define LOCAL_IPV6 "fe80::aa"
#define REMOTE_IPV6 "fe80::bb"
#define IFF_NAPI 0x0010
#define IFF_NAPI_FRAGS 0x0020
static void initialize_tun(void)
{
tunfd = open("/dev/net/tun", O_RDWR | O_NONBLOCK);
if (tunfd == -1) {
printf("tun: can't open /dev/net/tun: please enable CONFIG_TUN=y\n");
printf("otherwise fuzzing or reproducing might not work as intended\n");
return;
}
const int kTunFd = 252;
if (dup2(tunfd, kTunFd) < 0)
fail("dup2(tunfd, kTunFd) failed");
close(tunfd);
tunfd = kTunFd;
struct ifreq ifr;
memset(&ifr, 0, sizeof(ifr));
strncpy(ifr.ifr_name, TUN_IFACE, IFNAMSIZ);
ifr.ifr_flags = IFF_TAP | IFF_NO_PI | IFF_NAPI | IFF_NAPI_FRAGS;
if (ioctl(tunfd, TUNSETIFF, (void*)&ifr) < 0) {
ifr.ifr_flags = IFF_TAP | IFF_NO_PI;
if (ioctl(tunfd, TUNSETIFF, (void*)&ifr) < 0)
fail("tun: ioctl(TUNSETIFF) failed");
}
if (ioctl(tunfd, TUNGETIFF, (void*)&ifr) < 0)
fail("tun: ioctl(TUNGETIFF) failed");
tun_frags_enabled = (ifr.ifr_flags & IFF_NAPI_FRAGS) != 0;
execute_command(1, "sysctl -w net.ipv6.conf.%s.accept_dad=0", TUN_IFACE);
execute_command(1, "sysctl -w net.ipv6.conf.%s.router_solicitations=0",
TUN_IFACE);
execute_command(1, "ip link set dev %s address %s", TUN_IFACE, LOCAL_MAC);
execute_command(1, "ip addr add %s/24 dev %s", LOCAL_IPV4, TUN_IFACE);
execute_command(1, "ip -6 addr add %s/120 dev %s", LOCAL_IPV6, TUN_IFACE);
execute_command(1, "ip neigh add %s lladdr %s dev %s nud permanent",
REMOTE_IPV4, REMOTE_MAC, TUN_IFACE);
execute_command(1, "ip -6 neigh add %s lladdr %s dev %s nud permanent",
REMOTE_IPV6, REMOTE_MAC, TUN_IFACE);
execute_command(1, "ip link set dev %s up", TUN_IFACE);
}
#define DEV_IPV4 "172.20.20.%d"
#define DEV_IPV6 "fe80::%02hx"
#define DEV_MAC "aa:aa:aa:aa:aa:%02hx"
static void initialize_netdevices(void)
{
unsigned i;
const char* devtypes[] = {"ip6gretap", "bridge", "vcan", "bond", "veth"};
const char* devnames[] = {"lo", "sit0", "bridge0", "vcan0",
"tunl0", "gre0", "gretap0", "ip_vti0",
"ip6_vti0", "ip6tnl0", "ip6gre0", "ip6gretap0",
"erspan0", "bond0", "veth0", "veth1"};
for (i = 0; i < sizeof(devtypes) / (sizeof(devtypes[0])); i++)
execute_command(0, "ip link add dev %s0 type %s", devtypes[i], devtypes[i]);
execute_command(0, "ip link add dev veth1 type veth");
for (i = 0; i < sizeof(devnames) / (sizeof(devnames[0])); i++) {
char addr[32];
snprintf_check(addr, sizeof(addr), DEV_IPV4, i + 10);
execute_command(0, "ip -4 addr add %s/24 dev %s", addr, devnames[i]);
snprintf_check(addr, sizeof(addr), DEV_IPV6, i + 10);
execute_command(0, "ip -6 addr add %s/120 dev %s", addr, devnames[i]);
snprintf_check(addr, sizeof(addr), DEV_MAC, i + 10);
execute_command(0, "ip link set dev %s address %s", devnames[i], addr);
execute_command(0, "ip link set dev %s up", devnames[i]);
}
}
static int read_tun(char* data, int size)
{
if (tunfd < 0)
return -1;
int rv = read(tunfd, data, size);
if (rv < 0) {
if (errno == EAGAIN)
return -1;
if (errno == EBADFD)
return -1;
fail("tun: read failed with %d", rv);
}
return rv;
}
#define MAX_FRAGS 4
struct vnet_fragmentation {
uint32_t full;
uint32_t count;
uint32_t frags[MAX_FRAGS];
};
static uintptr_t syz_emit_ethernet(uintptr_t a0, uintptr_t a1, uintptr_t a2)
{
if (tunfd < 0)
return (uintptr_t)-1;
uint32_t length = a0;
char* data = (char*)a1;
struct vnet_fragmentation* frags = (struct vnet_fragmentation*)a2;
struct iovec vecs[MAX_FRAGS + 1];
uint32_t nfrags = 0;
if (!tun_frags_enabled || frags == NULL) {
vecs[nfrags].iov_base = data;
vecs[nfrags].iov_len = length;
nfrags++;
} else {
bool full = true;
uint32_t i, count = 0;
full = frags->full;
count = frags->count;
if (count > MAX_FRAGS)
count = MAX_FRAGS;
for (i = 0; i < count && length != 0; i++) {
uint32_t size = 0;
size = frags->frags[i];
if (size > length)
size = length;
vecs[nfrags].iov_base = data;
vecs[nfrags].iov_len = size;
nfrags++;
data += size;
length -= size;
}
if (length != 0 && (full || nfrags == 0)) {
vecs[nfrags].iov_base = data;
vecs[nfrags].iov_len = length;
nfrags++;
}
}
return writev(tunfd, vecs, nfrags);
}
static void flush_tun()
{
char data[SYZ_TUN_MAX_PACKET_SIZE];
while (read_tun(&data[0], sizeof(data)) != -1)
;
}
static void loop();
static void sandbox_common()
{
prctl(PR_SET_PDEATHSIG, SIGKILL, 0, 0, 0);
setpgrp();
setsid();
struct rlimit rlim;
rlim.rlim_cur = rlim.rlim_max = 128 << 20;
setrlimit(RLIMIT_AS, &rlim);
rlim.rlim_cur = rlim.rlim_max = 8 << 20;
setrlimit(RLIMIT_MEMLOCK, &rlim);
rlim.rlim_cur = rlim.rlim_max = 32 << 20;
setrlimit(RLIMIT_FSIZE, &rlim);
rlim.rlim_cur = rlim.rlim_max = 1 << 20;
setrlimit(RLIMIT_STACK, &rlim);
rlim.rlim_cur = rlim.rlim_max = 0;
setrlimit(RLIMIT_CORE, &rlim);
if (unshare(CLONE_NEWNS)) {
}
if (unshare(CLONE_NEWIPC)) {
}
if (unshare(0x02000000)) {
}
if (unshare(CLONE_NEWUTS)) {
}
if (unshare(CLONE_SYSVSEM)) {
}
}
static int do_sandbox_none(void)
{
if (unshare(CLONE_NEWPID)) {
}
int pid = fork();
if (pid < 0)
fail("sandbox fork failed");
if (pid)
return pid;
sandbox_common();
if (unshare(CLONE_NEWNET)) {
}
initialize_tun();
initialize_netdevices();
loop();
doexit(1);
}
#define XT_TABLE_SIZE 1536
#define XT_MAX_ENTRIES 10
struct xt_counters {
uint64_t pcnt, bcnt;
};
struct ipt_getinfo {
char name[32];
unsigned int valid_hooks;
unsigned int hook_entry[5];
unsigned int underflow[5];
unsigned int num_entries;
unsigned int size;
};
struct ipt_get_entries {
char name[32];
unsigned int size;
void* entrytable[XT_TABLE_SIZE / sizeof(void*)];
};
struct ipt_replace {
char name[32];
unsigned int valid_hooks;
unsigned int num_entries;
unsigned int size;
unsigned int hook_entry[5];
unsigned int underflow[5];
unsigned int num_counters;
struct xt_counters* counters;
char entrytable[XT_TABLE_SIZE];
};
struct ipt_table_desc {
const char* name;
struct ipt_getinfo info;
struct ipt_replace replace;
};
static struct ipt_table_desc ipv4_tables[] = {
{.name = "filter"}, {.name = "nat"}, {.name = "mangle"},
{.name = "raw"}, {.name = "security"},
};
static struct ipt_table_desc ipv6_tables[] = {
{.name = "filter"}, {.name = "nat"}, {.name = "mangle"},
{.name = "raw"}, {.name = "security"},
};
#define IPT_BASE_CTL 64
#define IPT_SO_SET_REPLACE (IPT_BASE_CTL)
#define IPT_SO_GET_INFO (IPT_BASE_CTL)
#define IPT_SO_GET_ENTRIES (IPT_BASE_CTL + 1)
struct arpt_getinfo {
char name[32];
unsigned int valid_hooks;
unsigned int hook_entry[3];
unsigned int underflow[3];
unsigned int num_entries;
unsigned int size;
};
struct arpt_get_entries {
char name[32];
unsigned int size;
void* entrytable[XT_TABLE_SIZE / sizeof(void*)];
};
struct arpt_replace {
char name[32];
unsigned int valid_hooks;
unsigned int num_entries;
unsigned int size;
unsigned int hook_entry[3];
unsigned int underflow[3];
unsigned int num_counters;
struct xt_counters* counters;
char entrytable[XT_TABLE_SIZE];
};
struct arpt_table_desc {
const char* name;
struct arpt_getinfo info;
struct arpt_replace replace;
};
static struct arpt_table_desc arpt_tables[] = {
{.name = "filter"},
};
#define ARPT_BASE_CTL 96
#define ARPT_SO_SET_REPLACE (ARPT_BASE_CTL)
#define ARPT_SO_GET_INFO (ARPT_BASE_CTL)
#define ARPT_SO_GET_ENTRIES (ARPT_BASE_CTL + 1)
static void checkpoint_iptables(struct ipt_table_desc* tables, int num_tables,
int family, int level)
{
struct ipt_get_entries entries;
socklen_t optlen;
int fd, i;
fd = socket(family, SOCK_STREAM, IPPROTO_TCP);
if (fd == -1)
fail("socket(%d, SOCK_STREAM, IPPROTO_TCP)", family);
for (i = 0; i < num_tables; i++) {
struct ipt_table_desc* table = &tables[i];
strcpy(table->info.name, table->name);
strcpy(table->replace.name, table->name);
optlen = sizeof(table->info);
if (getsockopt(fd, level, IPT_SO_GET_INFO, &table->info, &optlen)) {
switch (errno) {
case EPERM:
case ENOENT:
case ENOPROTOOPT:
continue;
}
fail("getsockopt(IPT_SO_GET_INFO)");
}
if (table->info.size > sizeof(table->replace.entrytable))
fail("table size is too large: %u", table->info.size);
if (table->info.num_entries > XT_MAX_ENTRIES)
fail("too many counters: %u", table->info.num_entries);
memset(&entries, 0, sizeof(entries));
strcpy(entries.name, table->name);
entries.size = table->info.size;
optlen = sizeof(entries) - sizeof(entries.entrytable) + table->info.size;
if (getsockopt(fd, level, IPT_SO_GET_ENTRIES, &entries, &optlen))
fail("getsockopt(IPT_SO_GET_ENTRIES)");
table->replace.valid_hooks = table->info.valid_hooks;
table->replace.num_entries = table->info.num_entries;
table->replace.size = table->info.size;
memcpy(table->replace.hook_entry, table->info.hook_entry,
sizeof(table->replace.hook_entry));
memcpy(table->replace.underflow, table->info.underflow,
sizeof(table->replace.underflow));
memcpy(table->replace.entrytable, entries.entrytable, table->info.size);
}
close(fd);
}
static void reset_iptables(struct ipt_table_desc* tables, int num_tables,
int family, int level)
{
struct xt_counters counters[XT_MAX_ENTRIES];
struct ipt_get_entries entries;
struct ipt_getinfo info;
socklen_t optlen;
int fd, i;
fd = socket(family, SOCK_STREAM, IPPROTO_TCP);
if (fd == -1)
fail("socket(%d, SOCK_STREAM, IPPROTO_TCP)", family);
for (i = 0; i < num_tables; i++) {
struct ipt_table_desc* table = &tables[i];
if (table->info.valid_hooks == 0)
continue;
memset(&info, 0, sizeof(info));
strcpy(info.name, table->name);
optlen = sizeof(info);
if (getsockopt(fd, level, IPT_SO_GET_INFO, &info, &optlen))
fail("getsockopt(IPT_SO_GET_INFO)");
if (memcmp(&table->info, &info, sizeof(table->info)) == 0) {
memset(&entries, 0, sizeof(entries));
strcpy(entries.name, table->name);
entries.size = table->info.size;
optlen = sizeof(entries) - sizeof(entries.entrytable) + entries.size;
if (getsockopt(fd, level, IPT_SO_GET_ENTRIES, &entries, &optlen))
fail("getsockopt(IPT_SO_GET_ENTRIES)");
if (memcmp(table->replace.entrytable, entries.entrytable,
table->info.size) == 0)
continue;
}
table->replace.num_counters = info.num_entries;
table->replace.counters = counters;
optlen = sizeof(table->replace) - sizeof(table->replace.entrytable) +
table->replace.size;
if (setsockopt(fd, level, IPT_SO_SET_REPLACE, &table->replace, optlen))
fail("setsockopt(IPT_SO_SET_REPLACE)");
}
close(fd);
}
static void checkpoint_arptables(void)
{
struct arpt_get_entries entries;
socklen_t optlen;
unsigned i;
int fd;
fd = socket(AF_INET, SOCK_STREAM, IPPROTO_TCP);
if (fd == -1)
fail("socket(AF_INET, SOCK_STREAM, IPPROTO_TCP)");
for (i = 0; i < sizeof(arpt_tables) / sizeof(arpt_tables[0]); i++) {
struct arpt_table_desc* table = &arpt_tables[i];
strcpy(table->info.name, table->name);
strcpy(table->replace.name, table->name);
optlen = sizeof(table->info);
if (getsockopt(fd, SOL_IP, ARPT_SO_GET_INFO, &table->info, &optlen)) {
switch (errno) {
case EPERM:
case ENOENT:
case ENOPROTOOPT:
continue;
}
fail("getsockopt(ARPT_SO_GET_INFO)");
}
if (table->info.size > sizeof(table->replace.entrytable))
fail("table size is too large: %u", table->info.size);
if (table->info.num_entries > XT_MAX_ENTRIES)
fail("too many counters: %u", table->info.num_entries);
memset(&entries, 0, sizeof(entries));
strcpy(entries.name, table->name);
entries.size = table->info.size;
optlen = sizeof(entries) - sizeof(entries.entrytable) + table->info.size;
if (getsockopt(fd, SOL_IP, ARPT_SO_GET_ENTRIES, &entries, &optlen))
fail("getsockopt(ARPT_SO_GET_ENTRIES)");
table->replace.valid_hooks = table->info.valid_hooks;
table->replace.num_entries = table->info.num_entries;
table->replace.size = table->info.size;
memcpy(table->replace.hook_entry, table->info.hook_entry,
sizeof(table->replace.hook_entry));
memcpy(table->replace.underflow, table->info.underflow,
sizeof(table->replace.underflow));
memcpy(table->replace.entrytable, entries.entrytable, table->info.size);
}
close(fd);
}
static void reset_arptables()
{
struct xt_counters counters[XT_MAX_ENTRIES];
struct arpt_get_entries entries;
struct arpt_getinfo info;
socklen_t optlen;
unsigned i;
int fd;
fd = socket(AF_INET, SOCK_STREAM, IPPROTO_TCP);
if (fd == -1)
fail("socket(AF_INET, SOCK_STREAM, IPPROTO_TCP)");
for (i = 0; i < sizeof(arpt_tables) / sizeof(arpt_tables[0]); i++) {
struct arpt_table_desc* table = &arpt_tables[i];
if (table->info.valid_hooks == 0)
continue;
memset(&info, 0, sizeof(info));
strcpy(info.name, table->name);
optlen = sizeof(info);
if (getsockopt(fd, SOL_IP, ARPT_SO_GET_INFO, &info, &optlen))
fail("getsockopt(ARPT_SO_GET_INFO)");
if (memcmp(&table->info, &info, sizeof(table->info)) == 0) {
memset(&entries, 0, sizeof(entries));
strcpy(entries.name, table->name);
entries.size = table->info.size;
optlen = sizeof(entries) - sizeof(entries.entrytable) + entries.size;
if (getsockopt(fd, SOL_IP, ARPT_SO_GET_ENTRIES, &entries, &optlen))
fail("getsockopt(ARPT_SO_GET_ENTRIES)");
if (memcmp(table->replace.entrytable, entries.entrytable,
table->info.size) == 0)
continue;
}
table->replace.num_counters = info.num_entries;
table->replace.counters = counters;
optlen = sizeof(table->replace) - sizeof(table->replace.entrytable) +
table->replace.size;
if (setsockopt(fd, SOL_IP, ARPT_SO_SET_REPLACE, &table->replace, optlen))
fail("setsockopt(ARPT_SO_SET_REPLACE)");
}
close(fd);
}
#include <linux/if.h>
#include <linux/netfilter_bridge/ebtables.h>
struct ebt_table_desc {
const char* name;
struct ebt_replace replace;
char entrytable[XT_TABLE_SIZE];
};
static struct ebt_table_desc ebt_tables[] = {
{.name = "filter"}, {.name = "nat"}, {.name = "broute"},
};
static void checkpoint_ebtables(void)
{
socklen_t optlen;
unsigned i;
int fd;
fd = socket(AF_INET, SOCK_STREAM, IPPROTO_TCP);
if (fd == -1)
fail("socket(AF_INET, SOCK_STREAM, IPPROTO_TCP)");
for (i = 0; i < sizeof(ebt_tables) / sizeof(ebt_tables[0]); i++) {
struct ebt_table_desc* table = &ebt_tables[i];
strcpy(table->replace.name, table->name);
optlen = sizeof(table->replace);
if (getsockopt(fd, SOL_IP, EBT_SO_GET_INIT_INFO, &table->replace,
&optlen)) {
switch (errno) {
case EPERM:
case ENOENT:
case ENOPROTOOPT:
continue;
}
fail("getsockopt(EBT_SO_GET_INIT_INFO)");
}
if (table->replace.entries_size > sizeof(table->entrytable))
fail("table size is too large: %u", table->replace.entries_size);
table->replace.num_counters = 0;
table->replace.entries = table->entrytable;
optlen = sizeof(table->replace) + table->replace.entries_size;
if (getsockopt(fd, SOL_IP, EBT_SO_GET_INIT_ENTRIES, &table->replace,
&optlen))
fail("getsockopt(EBT_SO_GET_INIT_ENTRIES)");
}
close(fd);
}
static void reset_ebtables()
{
struct ebt_replace replace;
char entrytable[XT_TABLE_SIZE];
socklen_t optlen;
unsigned i, j, h;
int fd;
fd = socket(AF_INET, SOCK_STREAM, IPPROTO_TCP);
if (fd == -1)
fail("socket(AF_INET, SOCK_STREAM, IPPROTO_TCP)");
for (i = 0; i < sizeof(ebt_tables) / sizeof(ebt_tables[0]); i++) {
struct ebt_table_desc* table = &ebt_tables[i];
if (table->replace.valid_hooks == 0)
continue;
memset(&replace, 0, sizeof(replace));
strcpy(replace.name, table->name);
optlen = sizeof(replace);
if (getsockopt(fd, SOL_IP, EBT_SO_GET_INFO, &replace, &optlen))
fail("getsockopt(EBT_SO_GET_INFO)");
replace.num_counters = 0;
table->replace.entries = 0;
for (h = 0; h < NF_BR_NUMHOOKS; h++)
table->replace.hook_entry[h] = 0;
if (memcmp(&table->replace, &replace, sizeof(table->replace)) == 0) {
memset(&entrytable, 0, sizeof(entrytable));
replace.entries = entrytable;
optlen = sizeof(replace) + replace.entries_size;
if (getsockopt(fd, SOL_IP, EBT_SO_GET_ENTRIES, &replace, &optlen))
fail("getsockopt(EBT_SO_GET_ENTRIES)");
if (memcmp(table->entrytable, entrytable, replace.entries_size) == 0)
continue;
}
for (j = 0, h = 0; h < NF_BR_NUMHOOKS; h++) {
if (table->replace.valid_hooks & (1 << h)) {
table->replace.hook_entry[h] =
(struct ebt_entries*)table->entrytable + j;
j++;
}
}
table->replace.entries = table->entrytable;
optlen = sizeof(table->replace) + table->replace.entries_size;
if (setsockopt(fd, SOL_IP, EBT_SO_SET_ENTRIES, &table->replace, optlen))
fail("setsockopt(EBT_SO_SET_ENTRIES)");
}
close(fd);
}
static void checkpoint_net_namespace(void)
{
checkpoint_ebtables();
checkpoint_arptables();
checkpoint_iptables(ipv4_tables, sizeof(ipv4_tables) / sizeof(ipv4_tables[0]),
AF_INET, SOL_IP);
checkpoint_iptables(ipv6_tables, sizeof(ipv6_tables) / sizeof(ipv6_tables[0]),
AF_INET6, SOL_IPV6);
}
static void reset_net_namespace(void)
{
reset_ebtables();
reset_arptables();
reset_iptables(ipv4_tables, sizeof(ipv4_tables) / sizeof(ipv4_tables[0]),
AF_INET, SOL_IP);
reset_iptables(ipv6_tables, sizeof(ipv6_tables) / sizeof(ipv6_tables[0]),
AF_INET6, SOL_IPV6);
}
static void execute_one();
extern unsigned long long procid;
static void loop()
{
checkpoint_net_namespace();
int iter;
for (iter = 0;; iter++) {
int pid = fork();
if (pid < 0)
fail("clone failed");
if (pid == 0) {
prctl(PR_SET_PDEATHSIG, SIGKILL, 0, 0, 0);
setpgrp();
flush_tun();
execute_one();
doexit(0);
}
int status = 0;
uint64_t start = current_time_ms();
for (;;) {
int res = waitpid(-1, &status, __WALL | WNOHANG);
if (res == pid) {
break;
}
usleep(1000);
if (current_time_ms() - start < 3 * 1000)
continue;
kill(-pid, SIGKILL);
kill(pid, SIGKILL);
while (waitpid(-1, &status, __WALL) != pid) {
}
break;
}
reset_net_namespace();
}
}
uint64_t r[1] = {0xffffffffffffffff};
unsigned long long procid;
void execute_one()
{
long res = 0;
res = syscall(__NR_socket, 0x18, 1, 2);
if (res != -1)
r[0] = res;
*(uint16_t*)0x20000180 = 0x18;
*(uint32_t*)0x20000182 = 2;
*(uint16_t*)0x20000186 = htobe16(0);
*(uint8_t*)0x2000018a = 0xac;
*(uint8_t*)0x2000018b = 0x14;
*(uint8_t*)0x2000018c = 0x14;
*(uint8_t*)0x2000018d = 0xaa;
syscall(__NR_bind, r[0], 0x20000180, 0x20);
*(uint16_t*)0x20000080 = 0x18;
*(uint32_t*)0x20000082 = 2;
*(uint16_t*)0x20000086 = htobe16(0);
*(uint8_t*)0x2000008a = 0xac;
*(uint8_t*)0x2000008b = 0x14;
*(uint8_t*)0x2000008c = 0x14;
*(uint8_t*)0x2000008d = 0xaa;
syscall(__NR_connect, r[0], 0x20000080, 0x20);
memcpy((void*)0x200010c0,
"\x69\x70\x36\x5f\x76\x74\x69\x30\x00\x00\x00\x00\x00\x00\x00\x00",
16);
syscall(__NR_setsockopt, r[0], 1, 0x19, 0x200010c0, 0x10);
*(uint8_t*)0x20000040 = 0xaa;
*(uint8_t*)0x20000041 = 0xaa;
*(uint8_t*)0x20000042 = 0xaa;
*(uint8_t*)0x20000043 = 0xaa;
*(uint8_t*)0x20000044 = 0xaa;
*(uint8_t*)0x20000045 = 0xaa;
memcpy((void*)0x20000046, "\x6b\x02\xf8\xee\x59\x3d", 6);
*(uint16_t*)0x2000004c = htobe16(0x800);
STORE_BY_BITMASK(uint8_t, 0x2000004e, 5, 0, 4);
STORE_BY_BITMASK(uint8_t, 0x2000004e, 4, 4, 4);
STORE_BY_BITMASK(uint8_t, 0x2000004f, 0, 0, 2);
STORE_BY_BITMASK(uint8_t, 0x2000004f, 0, 2, 6);
*(uint16_t*)0x20000050 = htobe16(0x30);
*(uint16_t*)0x20000052 = htobe16(0);
*(uint16_t*)0x20000054 = htobe16(0);
*(uint8_t*)0x20000056 = 0;
*(uint8_t*)0x20000057 = 0x33;
*(uint16_t*)0x20000058 = 0;
*(uint32_t*)0x2000005a = htobe32(0);
*(uint32_t*)0x2000005e = htobe32(-1);
*(uint8_t*)0x20000062 = 0x21;
*(uint8_t*)0x20000063 = 0;
*(uint16_t*)0x20000064 = 0;
*(uint8_t*)0x20000066 = 0;
*(uint8_t*)0x20000067 = 0;
*(uint16_t*)0x20000068 = 0;
STORE_BY_BITMASK(uint8_t, 0x2000006a, 5, 0, 4);
STORE_BY_BITMASK(uint8_t, 0x2000006a, 4, 4, 4);
STORE_BY_BITMASK(uint8_t, 0x2000006b, 0, 0, 2);
STORE_BY_BITMASK(uint8_t, 0x2000006b, 0, 2, 6);
*(uint16_t*)0x2000006c = htobe16(0);
*(uint16_t*)0x2000006e = htobe16(0);
*(uint16_t*)0x20000070 = htobe16(0);
*(uint8_t*)0x20000072 = 0;
*(uint8_t*)0x20000073 = 0;
*(uint16_t*)0x20000074 = htobe16(0);
*(uint8_t*)0x20000076 = 0xac;
*(uint8_t*)0x20000077 = 0x14;
*(uint8_t*)0x20000078 = -1;
*(uint8_t*)0x20000079 = 0xbb;
*(uint32_t*)0x2000007a = htobe32(0xe0000002);
*(uint32_t*)0x20000080 = 0;
*(uint32_t*)0x20000084 = 0;
*(uint32_t*)0x20000088 = 0;
*(uint32_t*)0x2000008c = 0;
*(uint32_t*)0x20000090 = 0;
*(uint32_t*)0x20000094 = 0;
struct csum_inet csum_1;
csum_inet_init(&csum_1);
csum_inet_update(&csum_1, (const uint8_t*)0x20000062, 28);
*(uint16_t*)0x20000064 = csum_inet_digest(&csum_1);
struct csum_inet csum_2;
csum_inet_init(&csum_2);
csum_inet_update(&csum_2, (const uint8_t*)0x2000004e, 20);
*(uint16_t*)0x20000058 = csum_inet_digest(&csum_2);
syz_emit_ethernet(0x3e, 0x20000040, 0x20000080);
}
int main()
{
syscall(__NR_mmap, 0x20000000, 0x1000000, 3, 0x32, -1, 0);
for (procid = 0; procid < 8; procid++) {
if (fork() == 0) {
for (;;) {
int pid = do_sandbox_none();
int status = 0;
while (waitpid(pid, &status, __WALL) != pid) {
}
}
}
}
sleep(1000000);
return 0;
}
|
the_stack_data/231394179.c | /*
Declaracao de ponteiro para inteiro com atribuicao e impressao
Helena Caseli
2010
*/
#include <stdio.h>
#include <stdlib.h>
int main() {
int x;
int* endx;
x = 0;
printf("%d",x);
printf(" e ");
endx = &x;
*endx = 1;
printf("%d",x);
return 0;
}
|
the_stack_data/45854.c | /* Check that the vec_init expander does its job. */
/* { dg-do compile } */
/* { dg-options "-O3 -mzarch -march=z13" } */
typedef __attribute__((vector_size(16))) signed int v4si;
extern v4si G;
v4si
f (signed int a)
{
return G == a;
}
/* { dg-final { scan-assembler-times "vrepf" 1 } } */
v4si
g (signed int *a)
{
return G == *a;
}
/* { dg-final { scan-assembler-times "vlrepf" 1 } } */
v4si
h ()
{
return G == 1;
}
/* { dg-final { scan-assembler-times "vgmf\t%v.*,31,31" 1 } } */
v4si
i ()
{
return G == -1;
}
/* { dg-final { scan-assembler-times "vone" 1 } } */
v4si
j ()
{
return G == 0;
}
/* { dg-final { scan-assembler-times "vzero" 1 } } */
v4si
k ()
{
return G == (v4si){ 0xff80, 0xff80, 0xff80, 0xff80 };
}
/* { dg-final { scan-assembler-times "vgmf\t%v.*,16,24" 1 } } */
v4si
l ()
{
return G == (v4si){ 0xf000000f, 0xf000000f, 0xf000000f, 0xf000000f };
}
/* { dg-final { scan-assembler-times "vgmf\t%v.*,28,3" 1 } } */
v4si
m ()
{
return G == (v4si){ 0x00ff00ff, 0x0000ffff, 0xffff0000, 0xff00ff00 };
}
/* { dg-final { scan-assembler-times "vgbm\t%v.*,21450" 1 } } */
|
the_stack_data/103369.c | /* ************************************************************************** */
/* */
/* ::: :::::::: */
/* ft_toupper.c :+: :+: :+: */
/* +:+ +:+ +:+ */
/* By: zkubli <[email protected]> +#+ +:+ +#+ */
/* +#+#+#+#+#+ +#+ */
/* Created: 2019/09/18 13:10:52 by zkubli #+# #+# */
/* Updated: 2019/09/18 13:50:44 by zkubli ### ########.fr */
/* */
/* ************************************************************************** */
int ft_toupper(int c)
{
if (c < 123 && c > 96)
c -= 32;
return (c);
}
|
the_stack_data/90763131.c | #include <stdio.h>
#include <stdlib.h>
void update(int *a,int *b) {
// Complete this function
int x = ((*a)+(*b));
int y = abs((*a)-(*b));
*a=x;
*b=y;
}
int main() {
int a, b;
int *pa = &a, *pb = &b;
scanf("%d %d", &a, &b);
update(pa, pb);
printf("%d\n%d", a, b);
return 0;
}
|
the_stack_data/198581647.c | /*
* $PostgreSQL: pgsql/src/backend/port/dynloader/unixware.c,v 1.3 2009/06/11 14:49:00 momjian Exp $
*
* Dummy file used for nothing at this point
*
* see unixware.h
*/
|
the_stack_data/23188.c | // Semmle test case for rule ArithmeticUncontrolled.ql (Uncontrolled data in arithmetic expression).
// Associated with CWE-190: Integer Overflow or Wraparound. http://cwe.mitre.org/data/definitions/190.html
int rand(void);
void trySlice(int start, int end);
void add_100(int);
#define RAND() rand()
#define RANDN(n) (rand() % n)
#define RAND2() (rand() ^ rand())
#define RAND_MAX 32767
void randomTester() {
int i;
for (i = 0; i < 1000; i++) {
int r = rand();
// BAD: The return from rand() is unbounded
trySlice(r, r+100);
}
for (i = 0; i < 1000; i++) {
int r = rand();
// GOOD: put a bound on r
if (r < 100000) {
trySlice(r, r+100);
}
}
{
int r = RAND();
r += 100; // BAD: The return from RAND() is unbounded
}
{
int r = RANDN(100);
r += 100; // GOOD: The return from RANDN is bounded
}
{
int r = rand();
r += 100; // BAD
}
{
int r = rand() / 10;
r += 100; // GOOD
}
{
int r = rand();
r = r / 10;
r += 100; // GOOD
}
{
int r = rand();
r /= 10;
r += 100; // GOOD
}
{
int r = rand() & 0xFF;
r += 100; // GOOD
}
{
int r = rand() + 100; // BAD [NOT DETECTED]
}
{
int r = RAND2();
r = r + 100; // BAD
}
{
int r = (rand() ^ rand());
r = r + 100; // BAD
}
{
int r = RAND2() + 100; // BAD [NOT DETECTED]
}
{
int r = RAND();
int *ptr_r = &r;
*ptr_r += 100; // BAD [NOT DETECTED]
}
{
int r = 0;
int *ptr_r = &r;
*ptr_r = RAND();
r += 100; // BAD
}
{
int r = rand();
r = ((2.0 / (RAND_MAX + 1)) * r - 1.0);
add_100(r);
}
}
void add_100(int r) {
r += 100; // GOOD
}
void randomTester2(int bound, int min, int max) {
int r1 = rand() % bound;
r1 += 100; // GOOD (`bound` may possibly be MAX_INT in which case this could
// still overflow, but it's most likely fine)
int r2 = (rand() % (max - min + 1)) + min;
r2 += 100; // GOOD (This is a common way to clamp the random value between [min, max])
}
void moreTests() {
{
int r = rand();
r = r * 100; // BAD
}
{
int r = rand();
r *= 100; // BAD
}
{
int r = rand();
int v = 100;
v *= r; // BAD
}
{
int r = rand();
r <<= 8; // BAD [NOT DETECTED]
}
{
int r = rand();
r = r - 100; // GOOD
}
{
unsigned int r = rand();
r = r - 100; // BAD
}
}
|
the_stack_data/937490.c | #include <stdio.h>
int calculate_factorial(int n)
{
int n_n1;
if (n) {
n_n1 = calculate_factorial(n-1);
return n * n_n1;
}
return 1;
}
int main (void)
{
int i;
int facts[] = {1, 2, 3, 4, 5, 6};
for (i = 0; i < 6; ++i) {
printf("The %i", facts[i]);
if (facts[i] < 4 && facts[i] > 0) {
if (facts[i] == 1) {
printf("st ");
}
else if (facts[i] == 2) {
printf("nd ");
}
else if (facts[i] == 3) {
printf("rd ");
}
}
else {
printf("th ");
}
printf("factorial: %i\n", calculate_factorial(facts[i]));
}
return 0;
}
|
the_stack_data/181392684.c | // RUN: %check %s -pedantic -ffold-const-vlas
/* not a constant expression
* C11, 6.6/6:
* An integer constant expression shall have integer type and shall only have
* operands that are integer constants, enumeration constants, character
* constants, sizeof expressions whose results are integer constants, _Alignof
* expressions, and floating constants that are the immediate operands of
* casts. Cast operators in an integer constant expression shall only convert
* arithmetic types to integer types, except as part of an operand to the
* sizeof or _Alignof operator.
*/
int x[(int)(1.2 + 3.2)]; // CHECK: /warning: operator-expr is a non-standard/
// ^ addition of non-ints
int y[1.5 > 1.4]; // CHECK: /warning: operator-expr is a non-standard/
int z1[1 > 1]; // CHECK: !/warn|err/
int z2[2 * 5]; // CHECK: !/warn|err/
|
the_stack_data/22200.c | /*
Copyright (c) 2019 Piotr Trzpil [email protected]
Permission to use, copy, modify, and distribute
this software for any purpose with or without fee
is hereby granted, provided that the above copyright
notice and this permission notice appear in all copies.
THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR
DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE
INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE
FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL
DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS
OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF
CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING
OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE
OF THIS SOFTWARE.
*/
// TODO change the outputed format so it looks *better*
#include <stdio.h>
#include <stdlib.h>
#include <string.h>
#include <errno.h>
#include <time.h>
#include <ctype.h>
#include <unistd.h>
#define BUFF_SIZE 1024
#define NOWENNA_PATH ".novena"
char novena_name[ BUFF_SIZE ];
time_t novena_start_time;
long long int novena_start_time_int;
void end_program( void ) {
exit( EXIT_SUCCESS );
}
void fail( const char *const estr ) {
perror( estr );
exit( EXIT_FAILURE );
}
int open_file_novena( void ) {
FILE *f_now = fopen( NOWENNA_PATH, "r" );
if( f_now == NULL ) {
if( errno != ENOENT ) fail( "file open fail" );
puts( "\nNo novena file found!" );
puts( "Do you want to create new novena?" );
puts( "Y for yes other respond will mean no" );
int ans;
ans = getchar();
if( ans != 'Y' ) end_program();
puts( "Choose, novena name" );
int its_ok = 0;
while( fgets( novena_name, BUFF_SIZE, stdin ) != NULL ) {
for( size_t i = 0; i < BUFF_SIZE; i++ ) {
if( isalnum( novena_name[i] ) ) {
its_ok = 1;
break;
}
if( isalnum( novena_name[i] == '\0' ) ) break;
}
if( its_ok ) break;
}
puts( "Maybe novena started some time ago already?" );
puts( "Insert how many days ago if today just put in zero" );
int day_lag = 0;
scanf( "%d", &day_lag );
novena_start_time = time( NULL ) - day_lag * 60 * 60 * 24;
novena_start_time_int = ( int long long ) novena_start_time;
f_now = fopen( NOWENNA_PATH, "w" );
if( f_now == NULL ) fail( "fail on write new novena" );
if( fprintf( f_now, "%lld\n%s",
novena_start_time_int, novena_name ) < 0 )
fail( "fprintf fail - writing to new novena file" );
puts( "New novena was saved" );
end_program();
}
if( fscanf( f_now, "%lld", &novena_start_time_int ) != 1 ) {
fclose( f_now );
remove( NOWENNA_PATH );
return -1;
}
novena_start_time = ( time_t ) novena_start_time_int;
int data_char;
memset( novena_name, 0, BUFF_SIZE );
for( size_t i = 0;; i++ ) {
data_char = fgetc( f_now );
if( data_char == EOF ) break;
novena_name[i] = data_char;
}
fclose( f_now );
if( novena_name[0] == '\0' ) {
remove( NOWENNA_PATH );
return -1;
}
return 0;
}
int main( void ) {
// use glob
puts( "Nowenna for today, to restart novena remove .novena file" );
char *ptr = getenv( "HOME" );
if( ptr == NULL ) fail( "getenv fail" );
if( chdir( ptr ) ) fail( "chdir fail" );
if( open_file_novena() != 0 ) fail( "broken file novena" );
puts( "\nCurrent novena:" );
puts( novena_name );
puts( "" );
time_t current_time = time( NULL );
printf( "Nowenna was set on :%s\n", ctime( &novena_start_time ) );
struct tm *novena_tm = localtime( &novena_start_time );
struct tm buff_tm = *novena_tm;
novena_tm = &buff_tm;
struct tm *current_tm = localtime( ¤t_time );
// novena takes 9 days.. So it can't take more than few years.
int day_diff = 0;
int leap_year = 0;
int novena_year = novena_tm->tm_year;
if( ! ( novena_year % 400 ) ) leap_year = 1;
else {
if( ( ! ( novena_year % 4 ) ) && ( novena_year % 100 ) ) leap_year = 1;
}
int year_diff = current_tm->tm_year - novena_tm->tm_year;
if( year_diff ) {
if( year_diff != 1 ) {
puts( "Nowenna has ended long time ago" );
remove( NOWENNA_PATH );
return 0;
}
// 364 for normal year and than we add onem ore day if leap year.
day_diff = current_tm->tm_yday + 364 - novena_tm->tm_yday;
if( leap_year ) day_diff++;
} else {
day_diff = current_tm->tm_yday - novena_tm->tm_yday;
}
day_diff++;
printf( "Current novena day: %d\n", day_diff );
if( day_diff > 9 ) {
puts( "Nowenna, has ended. removing old novena" );
remove( NOWENNA_PATH );
}
return 0;
}
|
the_stack_data/113233.c | #include<stdio.h>
#include<string.h>
#include<pthread.h>
#include<stdlib.h>
#include<unistd.h>
#include<stdbool.h>
pthread_mutex_t lock;
int* counters;
void* thread_code(void *arg)
{
while(true) {
pthread_mutex_lock(&lock);
int id = *((int*) arg);
counters[id] += 1;
pthread_mutex_unlock(&lock);
}
return NULL;
}
int main(int argc, char *argv[])
{
long num_threads = strtol(argv[1], NULL, 10);
counters = malloc(num_threads*sizeof(int*));
pthread_t tid[num_threads];
int err;
if (pthread_mutex_init(&lock, NULL) != 0)
{
printf("\n mutex init failed\n");
return 1;
}
//pthread_mutex_lock(&lock); // locking the mutex for the creation causes all-0 counters?
for (int i=0; i < num_threads; i++)
{
err = pthread_create(&(tid[i]), NULL, thread_code, (void *) &i);
printf("Creating thread %d\n", i);
if (err != 0)
printf("\ncan't create thread :[%s]", strerror(err));
}
sleep(1);
//pthread_mutex_unlock(&lock);
sleep(3);
for (int i=0; i < num_threads; i++) {
printf("Thread %d got mutex %d times\n", i, counters[i]);
counters[i] = 0;
}
pthread_mutex_destroy(&lock);
free(counters);
return 0;
} |
the_stack_data/93886.c | #include <stdio.h>
#include <assert.h>
// inputs
int f= 6;
int e= 5;
int d= 4;
int b= 2;
int a= 1;
int c= 3;
// outputs
int u = 21;
int v = 22;
int w = 23;
int x = 24;
int y = 25;
int z = 26;
int a3 = 1;
int a4 = 17;
int a25 = 1;
int a1 = 1;
int a26 = 18;
int a28 = 15;
int a7 = 1;
int a14 = 19;
int calculate_output(int input) {
if((((a25==1)&&((a1==1)&&((input==5)&&((((((a4==17)&&(a26==19))&&(a28==17))&&!(a7==1))&&(a14==20))||(((a7==1)&&(((a26==17)&&(a4==18))&&(a28==15)))&&(a14==18))))))&&(a3==1))){
a28 = 15;
a26 = 17;
a4 = 16;
a14 = 18;
a7 = 1;
return -1;
} else if((((a25==1)&&(((a28==16)&&((a4==17)&&((a1==1)&&(((((a7==1)&&(a26==18))||((a26==19)&&(a7==1)))||(!(a7==1)&&(a26==17)))&&(input==4)))))&&!(a3==1)))&&(a14==20))){
a26 = 19;
a28 = 15;
a7 = 0;
return -1;
} else if(((a28==17)&&((a1==1)&&((a25==1)&&((a7==1)&&((a4==17)&&(((a14==18)&&((input==4)&&((a26==17)||(a26==18))))&&!(a3==1)))))))){
a28 = 15;
a4 = 16;
a26 = 17;
a3 = 1;
return -1;
} else if((!(a7==1)&&(!(a3==1)&&(((a28==16)&&((a25==1)&&((a4==17)&&((((a26==17)||(a26==18))&&(input==6))&&(a1==1)))))&&(a14==19))))){
a7 = 1;
a26 = 17;
a28 = 15;
a4 = 16;
a3 = 1;
a14 = 18;
return -1;
} else if(((a28==16)&&((((a14==18)&&((!(a7==1)&&((a26==18)&&((a3==1)&&(input==1))))&&(a1==1)))&&(a25==1))&&(a4==18)))){
a7 = 1;
a28 = 15;
a4 = 16;
a26 = 17;
return -1;
} else if((!(a3==1)&&((a28==17)&&((a25==1)&&((((input==5)&&((((a14==18)&&((a26==19)&&!(a7==1)))||((a14==19)&&((a7==1)&&(a26==17))))||((a14==19)&&((a26==18)&&(a7==1)))))&&(a4==17))&&(a1==1)))))){
a28 = 15;
a4 = 16;
a7 = 1;
a14 = 18;
a26 = 17;
a3 = 1;
return -1;
} else if(((a1==1)&&((a26==17)&&((a4==18)&&(!(a7==1)&&((((a25==1)&&((input==3)&&(a28==15)))&&(a3==1))&&(a14==20))))))){
a14 = 18;
a4 = 16;
a7 = 1;
return -1;
} else if(((((((a1==1)&&(((a14==20)&&((input==2)&&(a26==17)))&&!(a7==1)))&&(a28==15))&&(a25==1))&&(a4==17))&&!(a3==1))){
a7 = 1;
a28 = 17;
a4 = 16;
a14 = 19;
a26 = 18;
return -1;
} else if(((a28==17)&&((a4==17)&&((a25==1)&&((a3==1)&&((a14==20)&&((a1==1)&&((input==6)&&((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))||(!(a7==1)&&(a26==18))))))))))){
a28 = 15;
a14 = 18;
a4 = 16;
a7 = 1;
a26 = 17;
return -1;
} else if(((((a4==17)&&((((((!(a7==1)&&(a26==19))&&(a14==19))||((a14==20)&&((a7==1)&&(a26==17))))&&(input==3))&&(a28==15))&&(a25==1)))&&(a3==1))&&(a1==1))){
a14 = 18;
a26 = 17;
a7 = 1;
a4 = 16;
return -1;
} else if((((a28==16)&&((!(a7==1)&&((a1==1)&&((a4==17)&&((((a26==18)||(a26==19))&&(input==5))&&!(a3==1)))))&&(a14==18)))&&(a25==1))){
a4 = 16;
a28 = 15;
a7 = 1;
a3 = 1;
a26 = 17;
return -1;
} else if(((a25==1)&&(((a1==1)&&(((a7==1)&&((((input==2)&&(a4==17))&&(a28==15))&&(a3==1)))&&(a26==18)))&&(a14==19)))){
a26 = 17;
a14 = 20;
return 24;
} else if((((a26==18)&&((a7==1)&&((a28==16)&&(((((a25==1)&&(input==2))&&(a4==18))&&(a14==19))&&(a1==1)))))&&!(a3==1))){
a7 = 0;
a4 = 16;
a3 = 1;
return -1;
} else if(((a4==18)&&((a7==1)&&(!(a3==1)&&((a14==19)&&(((a1==1)&&((a28==16)&&((input==1)&&(a26==18))))&&(a25==1))))))){
a28 = 15;
a3 = 1;
a7 = 0;
a4 = 16;
a14 = 20;
return -1;
} else if(((a25==1)&&(!(a3==1)&&((a28==16)&&(((((input==3)&&((!(a7==1)&&(a26==17))||(((a7==1)&&(a26==18))||((a7==1)&&(a26==19)))))&&(a14==20))&&(a1==1))&&(a4==17)))))){
a7 = 1;
a14 = 18;
a28 = 15;
a4 = 16;
a26 = 17;
a3 = 1;
return -1;
} else if(((a4==17)&&((a25==1)&&((a14==20)&&(((!(a3==1)&&((input==5)&&((((a7==1)&&(a26==18))||((a26==19)&&(a7==1)))||((a26==17)&&!(a7==1)))))&&(a1==1))&&(a28==16)))))){
a26 = 18;
a28 = 15;
a7 = 0;
return 26;
} else if(((((((((a7==1)&&(((a26==19)||((a26==17)||(a26==18)))&&(input==5)))&&(a1==1))&&!(a3==1))&&(a25==1))&&(a14==20))&&(a4==18))&&(a28==15))){
a4 = 16;
a26 = 17;
a3 = 1;
a14 = 18;
return -1;
} else if((((a26==19)&&((a7==1)&&(((((a14==18)&&((input==4)&&(a1==1)))&&!(a3==1))&&(a25==1))&&(a28==15))))&&(a4==16))){
a3 = 1;
a26 = 17;
return -1;
} else if(((a26==18)&&(((a28==15)&&((a7==1)&&((a25==1)&&(((a4==17)&&((a14==19)&&(input==6)))&&(a3==1)))))&&(a1==1)))){
a7 = 0;
a26 = 17;
return 21;
} else if((((a14==20)&&(((a28==15)&&((((a4==17)&&((input==5)&&(a3==1)))&&(a26==19))&&(a25==1)))&&(a1==1)))&&(a7==1))){
a4 = 16;
a14 = 18;
a26 = 17;
return -1;
} else if((((a1==1)&&(((((a14==19)&&((input==4)&&(((a26==18)&&!(a7==1))||(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1))))))&&(a28==16))&&(a4==16))&&(a25==1)))&&!(a3==1))){
a26 = 18;
a14 = 20;
a7 = 0;
a28 = 17;
return -1;
} else if(((a28==17)&&(((a3==1)&&((a25==1)&&((a4==18)&&((input==1)&&((((a26==19)&&!(a7==1))&&(a14==19))||(((a26==17)&&(a7==1))&&(a14==20)))))))&&(a1==1)))){
a26 = 17;
a4 = 16;
a7 = 1;
a14 = 18;
a28 = 15;
return -1;
} else if(((!(a7==1)&&(((!(a3==1)&&(((((a26==18)||(a26==19))&&(input==2))&&(a1==1))&&(a14==18)))&&(a25==1))&&(a4==16)))&&(a28==16))){
a26 = 17;
a7 = 1;
a3 = 1;
a28 = 15;
return -1;
} else if((((a1==1)&&(((a14==20)&&(((a28==17)&&(((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))||((a26==18)&&!(a7==1)))&&(input==3)))&&(a4==17)))&&(a3==1)))&&(a25==1))){
a26 = 17;
a14 = 18;
a4 = 18;
a7 = 1;
return 22;
} else if((((a25==1)&&((a28==16)&&(((a1==1)&&((((((a26==18)&&!(a7==1))&&(a14==19))||(((a26==19)&&!(a7==1))&&(a14==19)))||((a14==20)&&((a7==1)&&(a26==17))))&&(input==5)))&&(a3==1))))&&(a4==17))){
a4 = 16;
a7 = 1;
a28 = 15;
a14 = 18;
a26 = 17;
return -1;
} else if(((a1==1)&&((a4==16)&&((((((((a26==17)||(a26==18))&&(input==3))&&(a28==16))&&(a7==1))&&(a25==1))&&!(a3==1))&&(a14==19))))){
a3 = 1;
a28 = 15;
a14 = 18;
a26 = 17;
return -1;
} else if(((a4==16)&&((a25==1)&&((a28==17)&&((((a14==19)&&(((input==1)&&((a26==18)||(a26==19)))&&(a7==1)))&&!(a3==1))&&(a1==1)))))){
a3 = 1;
a28 = 15;
a14 = 18;
a26 = 17;
return -1;
} else if(((a25==1)&&(((((a3==1)&&((((((a26==19)&&!(a7==1))&&(a14==19))||((a14==20)&&((a7==1)&&(a26==17))))||(((a7==1)&&(a26==18))&&(a14==20)))&&(input==3)))&&(a28==15))&&(a1==1))&&(a4==18)))){
a14 = 18;
a7 = 1;
a26 = 17;
a4 = 16;
return -1;
} else if(((a28==16)&&((a3==1)&&((a14==19)&&((((a4==18)&&(!(a7==1)&&((input==5)&&((a26==18)||(a26==19)))))&&(a25==1))&&(a1==1)))))){
a26 = 17;
a14 = 18;
a7 = 1;
a4 = 16;
a28 = 15;
return -1;
} else if(((!(a3==1)&&((((((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==2))&&(a4==17))&&(a25==1))&&(a28==15))&&(a14==19)))&&(a1==1))){
a26 = 17;
a7 = 1;
a3 = 1;
a4 = 16;
a14 = 18;
return -1;
} else if(((((a28==17)&&(((((input==2)&&((((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))||(!(a7==1)&&(a26==17))))&&(a14==18))&&(a25==1))&&(a4==18)))&&(a3==1))&&(a1==1))){
a28 = 15;
a26 = 17;
a4 = 16;
a7 = 1;
return -1;
} else if((((((a3==1)&&(((a25==1)&&(((input==4)&&(a7==1))&&(a14==20)))&&(a1==1)))&&(a4==17))&&(a28==17))&&(a26==18))){
a14 = 18;
a4 = 16;
a28 = 15;
a26 = 17;
return -1;
} else if(((a1==1)&&((a4==18)&&(((!(a7==1)&&((a14==19)&&(((input==5)&&((a26==17)||(a26==18)))&&(a25==1))))&&(a28==15))&&(a3==1))))){
a7 = 1;
a14 = 18;
a26 = 17;
a4 = 16;
return -1;
} else if(((a25==1)&&((a4==18)&&((a1==1)&&((a28==16)&&((((input==2)&&((!(a7==1)&&(a26==18))||(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))))&&(a14==18))&&!(a3==1))))))){
a26 = 17;
a4 = 16;
a28 = 15;
a7 = 1;
a3 = 1;
return -1;
} else if((((a4==18)&&(((a28==16)&&((a3==1)&&((a14==18)&&(((!(a7==1)&&(a26==17))||(((a26==18)&&(a7==1))||((a7==1)&&(a26==19))))&&(input==2)))))&&(a1==1)))&&(a25==1))){
a26 = 17;
a28 = 15;
a4 = 16;
a7 = 1;
return -1;
} else if(((!(a7==1)&&((a28==16)&&((a25==1)&&((a1==1)&&(!(a3==1)&&(((input==5)&&(a14==19))&&(a26==18)))))))&&(a4==18))){
a26 = 19;
a7 = 1;
a14 = 20;
return 23;
} else if(((((((a28==15)&&(((a1==1)&&((input==2)&&((a26==17)||(a26==18))))&&!(a3==1)))&&(a25==1))&&(a14==19))&&(a7==1))&&(a4==16))){
a3 = 1;
a14 = 18;
a26 = 17;
return -1;
} else if(((((((!(a7==1)&&((a14==20)&&(((a26==17)||(a26==18))&&(input==6))))&&(a25==1))&&(a4==16))&&(a1==1))&&!(a3==1))&&(a28==15))){
a26 = 17;
return -1;
} else if(((a14==19)&&((a26==19)&&((a28==15)&&(((a4==16)&&(!(a3==1)&&(((a25==1)&&(input==2))&&!(a7==1))))&&(a1==1)))))){
a14 = 18;
a26 = 17;
a7 = 1;
a3 = 1;
return -1;
} else if((((((a25==1)&&((a4==18)&&((((((a7==1)&&(a26==18))||((a26==19)&&(a7==1)))||((a26==17)&&!(a7==1)))&&(input==4))&&(a14==18))))&&(a28==17))&&(a3==1))&&(a1==1))){
a28 = 15;
a7 = 1;
a26 = 17;
a4 = 16;
return -1;
} else if((((a28==16)&&((((a14==19)&&((((((a7==1)&&(a26==18))||((a7==1)&&(a26==19)))||(!(a7==1)&&(a26==17)))&&(input==1))&&(a3==1)))&&(a25==1))&&(a1==1)))&&(a4==17))){
a26 = 17;
a4 = 18;
a28 = 15;
a7 = 1;
a14 = 20;
return 22;
} else if(((a25==1)&&((((((a28==15)&&(((input==6)&&(a14==19))&&(a26==18)))&&!(a7==1))&&(a4==17))&&(a1==1))&&!(a3==1)))){
a4 = 16;
a26 = 17;
a7 = 1;
a3 = 1;
a14 = 18;
return -1;
} else if(((a3==1)&&(((((input==4)&&(((a14==18)&&((a7==1)&&((a26==17)&&(a28==16))))||(((a14==20)&&(((a26==18)&&(a28==15))&&!(a7==1)))||((!(a7==1)&&((a26==19)&&(a28==15)))&&(a14==20)))))&&(a1==1))&&(a25==1))&&(a4==18)))){
a28 = 15;
a7 = 1;
a4 = 16;
a3 = 0;
a26 = 17;
a14 = 19;
return 22;
} else if(((a14==20)&&((a25==1)&&(((a7==1)&&((((a4==16)&&((input==5)&&((a26==17)||(a26==18))))&&(a1==1))&&!(a3==1)))&&(a28==15))))){
a3 = 1;
a14 = 18;
a26 = 17;
return -1;
} else if((!(a3==1)&&(((a25==1)&&((a28==17)&&(((input==5)&&(((a14==20)&&((a26==18)&&(a7==1)))||(((!(a7==1)&&(a26==19))&&(a14==19))||((a14==20)&&((a26==17)&&(a7==1))))))&&(a4==16))))&&(a1==1)))){
a26 = 17;
a7 = 1;
a28 = 15;
a14 = 18;
a3 = 1;
return -1;
} else if(((a14==18)&&((a28==16)&&(((((!(a7==1)&&((input==6)&&((a26==18)||(a26==19))))&&(a4==16))&&!(a3==1))&&(a1==1))&&(a25==1))))){
a26 = 18;
a28 = 15;
a14 = 20;
return 26;
} else if(((a4==18)&&((a26==17)&&((a25==1)&&((a1==1)&&((((a7==1)&&((a28==16)&&(input==6)))&&(a14==20))&&(a3==1))))))){
a4 = 17;
a28 = 17;
return -1;
} else if((((a25==1)&&((a28==16)&&(!(a3==1)&&((a4==16)&&(((input==1)&&(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1))))&&(a1==1))))))&&(a14==20))){
a7 = 1;
a28 = 15;
a4 = 17;
a14 = 19;
a26 = 19;
return 24;
} else if(((a1==1)&&((a3==1)&&(((a14==20)&&((a28==16)&&(((input==3)&&((((a7==1)&&(a26==18))||((a26==19)&&(a7==1)))||((a26==17)&&!(a7==1))))&&(a25==1))))&&(a4==18))))){
a26 = 17;
a14 = 18;
a4 = 16;
a7 = 1;
a28 = 15;
return -1;
} else if(((((a4==18)&&((((input==6)&&(((a14==18)&&(!(a7==1)&&(a26==19)))||((a14==19)&&((a26==17)&&(a7==1)))))&&(a1==1))&&!(a3==1)))&&(a25==1))&&(a28==16))){
a28 = 15;
a14 = 18;
a7 = 1;
a4 = 16;
a26 = 17;
a3 = 1;
return -1;
} else if(((a7==1)&&((a25==1)&&((((a1==1)&&(((a28==17)&&((input==2)&&((a26==17)||(a26==18))))&&(a14==18)))&&(a4==18))&&!(a3==1))))){
a4 = 16;
a3 = 1;
a26 = 19;
a28 = 16;
a14 = 20;
return -1;
} else if(((((((a28==16)&&((a25==1)&&((input==6)&&(((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))))))&&(a1==1))&&(a3==1))&&(a14==19))&&(a4==18))){
a26 = 17;
a14 = 18;
a4 = 16;
a7 = 1;
a28 = 15;
return -1;
} else if((((a14==19)&&((a25==1)&&((!(a7==1)&&((a28==16)&&((a4==17)&&((input==3)&&!(a3==1)))))&&(a26==19))))&&(a1==1))){
a28 = 15;
a14 = 18;
a7 = 1;
a26 = 17;
a3 = 1;
a4 = 16;
return -1;
} else if(((((a1==1)&&((((a3==1)&&((a14==19)&&((input==2)&&(a4==18))))&&(a7==1))&&(a28==15)))&&(a26==18))&&(a25==1))){
a26 = 17;
a4 = 16;
a14 = 18;
return -1;
} else if(((a4==16)&&((!(a3==1)&&((a14==19)&&((a1==1)&&(((((a26==17)||(a26==18))&&(input==4))&&(a28==15))&&!(a7==1)))))&&(a25==1)))){
a28 = 17;
a26 = 17;
a14 = 18;
return 24;
} else if(((((((a14==18)&&((((input==1)&&(a3==1))&&(a28==17))&&(a4==18)))&&!(a7==1))&&(a26==18))&&(a1==1))&&(a25==1))){
a26 = 17;
a28 = 15;
a7 = 1;
a4 = 16;
return -1;
} else if(((a7==1)&&((a26==19)&&((a1==1)&&((a14==19)&&((a25==1)&&((a28==15)&&((a4==16)&&(!(a3==1)&&(input==5)))))))))){
a3 = 1;
a14 = 18;
a26 = 17;
return -1;
} else if((!(a7==1)&&(((a1==1)&&(((!(a3==1)&&((a14==18)&&((input==6)&&((a26==19)||((a26==17)||(a26==18))))))&&(a4==16))&&(a25==1)))&&(a28==15)))){
a3 = 1;
a26 = 17;
a7 = 1;
return -1;
} else if(((a4==16)&&((!(a3==1)&&((a14==20)&&((((((a26==17)||(a26==18))&&(input==4))&&(a28==15))&&(a25==1))&&(a1==1))))&&!(a7==1)))){
a7 = 1;
a14 = 19;
a3 = 1;
a26 = 19;
a28 = 17;
a4 = 18;
return 22;
} else if((((a4==16)&&((((a14==19)&&((a7==1)&&(((input==1)&&((a26==17)||(a26==18)))&&!(a3==1))))&&(a25==1))&&(a1==1)))&&(a28==15))){
a3 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if((((((a26==19)&&((a4==18)&&((!(a7==1)&&((a28==16)&&(input==2)))&&(a1==1))))&&(a14==18))&&(a25==1))&&(a3==1))){
a3 = 0;
a14 = 19;
a28 = 15;
a4 = 16;
return 26;
} else if(((((a1==1)&&((a28==17)&&((a14==20)&&((a3==1)&&(((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))||((a26==18)&&!(a7==1)))&&(input==5))))))&&(a4==17))&&(a25==1))){
a28 = 15;
a4 = 16;
a14 = 18;
a26 = 17;
a7 = 1;
return -1;
} else if((((a25==1)&&((a4==18)&&((((a7==1)&&(((input==6)&&(a3==1))&&(a1==1)))&&(a14==19))&&(a26==17))))&&(a28==16))){
a28 = 15;
a4 = 16;
a14 = 18;
return -1;
} else if(((((a1==1)&&(((((((a26==18)||(a26==19))&&(input==4))&&(a25==1))&&!(a3==1))&&(a14==18))&&(a28==16)))&&!(a7==1))&&(a4==16))){
a28 = 15;
a26 = 17;
a7 = 1;
a3 = 1;
return -1;
} else if(((a1==1)&&(((a14==19)&&((((a7==1)&&(((input==6)&&((a26==18)||(a26==19)))&&(a28==17)))&&!(a3==1))&&(a25==1)))&&(a4==16)))){
a14 = 18;
a3 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if(((((a25==1)&&((((a7==1)&&(((input==2)&&(a14==20))&&(a4==17)))&&(a28==15))&&(a26==18)))&&(a1==1))&&(a3==1))){
a14 = 18;
a28 = 17;
return 24;
} else if(((((a1==1)&&((a14==20)&&((!(a7==1)&&(((a28==15)&&(input==5))&&(a26==17)))&&(a25==1))))&&(a3==1))&&(a4==17))){
a26 = 18;
a28 = 17;
return 22;
} else if(((a1==1)&&((a4==17)&&((a25==1)&&((a28==16)&&(!(a7==1)&&((!(a3==1)&&(((a26==18)||(a26==19))&&(input==5)))&&(a14==20)))))))){
a26 = 19;
return 24;
} else if((((a14==19)&&((a3==1)&&((a1==1)&&(((a25==1)&&(((!(a7==1)&&(a26==17))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))&&(input==1)))&&(a4==18)))))&&(a28==17))){
a28 = 15;
a26 = 17;
a14 = 18;
a7 = 1;
a4 = 16;
return -1;
} else if(((a28==16)&&(((a1==1)&&((a4==17)&&((a3==1)&&((a25==1)&&((input==6)&&(((a26==17)&&!(a7==1))||(((a7==1)&&(a26==18))||((a26==19)&&(a7==1)))))))))&&(a14==20)))){
a28 = 15;
a4 = 16;
a7 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if((((a25==1)&&((((a1==1)&&((((input==6)&&((a26==18)||(a26==19)))&&(a4==18))&&(a14==20)))&&!(a7==1))&&(a28==15)))&&!(a3==1))){
a14 = 18;
a7 = 1;
a26 = 19;
a28 = 16;
return 22;
} else if(((a28==16)&&(((((a4==16)&&((a7==1)&&(((input==6)&&(a14==18))&&!(a3==1))))&&(a25==1))&&(a1==1))&&(a26==18)))){
a26 = 17;
a3 = 1;
a28 = 15;
return -1;
} else if((((a28==15)&&((a1==1)&&((a4==16)&&(!(a3==1)&&(((((a26==17)||(a26==18))&&(input==1))&&(a25==1))&&(a14==20))))))&&(a7==1))){
a28 = 17;
a26 = 19;
a14 = 18;
a7 = 0;
return 21;
} else if(((a1==1)&&((a28==15)&&(((a4==17)&&(((a26==19)&&(((a14==19)&&(input==4))&&(a25==1)))&&!(a3==1)))&&!(a7==1))))){
a3 = 1;
a14 = 18;
a4 = 16;
a26 = 17;
a7 = 1;
return -1;
} else if(((a14==19)&&(((a7==1)&&((((((a4==18)&&(input==4))&&(a26==18))&&(a28==15))&&(a25==1))&&(a1==1)))&&(a3==1)))){
a4 = 16;
a14 = 18;
a26 = 17;
return -1;
} else if(((((a1==1)&&((a28==16)&&((a7==1)&&((a4==18)&&(!(a3==1)&&(((a26==17)||(a26==18))&&(input==6)))))))&&(a25==1))&&(a14==18))){
a26 = 17;
a28 = 15;
a3 = 1;
a4 = 16;
return -1;
} else if((((a4==16)&&(((a1==1)&&((a26==18)&&((!(a3==1)&&((a25==1)&&(input==3)))&&(a14==18))))&&(a7==1)))&&(a28==16))){
a26 = 17;
a28 = 15;
a3 = 1;
return -1;
} else if(((a28==17)&&((a14==19)&&((a26==18)&&(!(a7==1)&&((a25==1)&&((((input==3)&&(a3==1))&&(a4==18))&&(a1==1)))))))){
a7 = 1;
return 26;
} else if(((((a1==1)&&(((((input==3)&&(((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))))&&(a28==17))&&(a4==18))&&(a3==1)))&&(a25==1))&&(a14==20))){
a7 = 1;
a26 = 17;
a4 = 16;
a28 = 15;
a14 = 18;
return -1;
} else if((((a4==18)&&((((input==6)&&((((((a28==16)&&(a26==18))&&!(a7==1))&&(a14==20))||((!(a7==1)&&((a28==16)&&(a26==19)))&&(a14==20)))||(((a7==1)&&((a28==17)&&(a26==17)))&&(a14==18))))&&(a3==1))&&(a1==1)))&&(a25==1))){
a14 = 18;
a26 = 17;
a7 = 1;
a28 = 15;
a4 = 16;
return -1;
} else if(((((a1==1)&&(((a25==1)&&(((((!(a7==1)&&(a26==19))&&(a14==19))||(((a26==17)&&(a7==1))&&(a14==20)))||((a14==20)&&((a7==1)&&(a26==18))))&&(input==6)))&&(a28==17)))&&(a4==16))&&!(a3==1))){
a3 = 1;
a28 = 15;
a26 = 17;
a14 = 18;
a7 = 1;
return -1;
} else if(((((((a1==1)&&((a4==17)&&(!(a7==1)&&((input==6)&&((a26==18)||(a26==19))))))&&(a25==1))&&!(a3==1))&&(a14==20))&&(a28==16))){
a26 = 17;
a28 = 15;
return -1;
} else if(((((a14==20)&&(((a4==18)&&(((input==2)&&((((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))||((a26==17)&&!(a7==1))))&&(a25==1)))&&(a28==16)))&&(a1==1))&&(a3==1))){
a7 = 1;
a26 = 17;
a4 = 16;
a28 = 15;
a14 = 18;
return -1;
} else if(((a14==20)&&((a4==17)&&((a28==16)&&(!(a3==1)&&((a1==1)&&((a25==1)&&((((a26==18)||(a26==19))&&(input==2))&&!(a7==1))))))))){
a26 = 19;
return -1;
} else if(((a4==16)&&(!(a3==1)&&(((((a28==17)&&(((a1==1)&&(input==6))&&(a26==18)))&&(a14==19))&&!(a7==1))&&(a25==1))))){
a28 = 15;
a7 = 1;
a14 = 18;
a26 = 17;
a3 = 1;
return -1;
} else if(((((((((((a7==1)&&(a26==18))&&(a14==19))||(((a14==18)&&(!(a7==1)&&(a26==19)))||((a14==19)&&((a26==17)&&(a7==1)))))&&(input==2))&&(a4==17))&&(a1==1))&&(a28==17))&&!(a3==1))&&(a25==1))){
a28 = 15;
a26 = 17;
a7 = 1;
a14 = 18;
a3 = 1;
a4 = 16;
return -1;
} else if(((a4==16)&&(!(a7==1)&&((a25==1)&&(((a14==19)&&(!(a3==1)&&((a1==1)&&((a26==19)&&(input==3)))))&&(a28==15)))))){
a7 = 1;
a26 = 17;
a3 = 1;
a14 = 18;
return -1;
} else if(((a7==1)&&(((a28==15)&&((((((input==6)&&(a1==1))&&(a14==19))&&(a4==18))&&(a25==1))&&(a3==1)))&&(a26==17)))){
a4 = 16;
a14 = 18;
return -1;
} else if((((a1==1)&&((((a4==17)&&(!(a7==1)&&(((input==1)&&((a26==17)||(a26==18)))&&!(a3==1))))&&(a25==1))&&(a14==19)))&&(a28==16))){
a26 = 17;
a14 = 18;
a7 = 1;
a3 = 1;
a4 = 16;
a28 = 15;
return -1;
} else if((((a1==1)&&(((!(a3==1)&&((a28==17)&&(!(a7==1)&&((a14==19)&&(input==4)))))&&(a25==1))&&(a4==16)))&&(a26==18))){
a26 = 17;
a14 = 18;
a28 = 15;
a7 = 1;
a3 = 1;
return -1;
} else if(((!(a3==1)&&((!(a7==1)&&((a1==1)&&((a25==1)&&(((input==5)&&((a26==18)||(a26==19)))&&(a4==16)))))&&(a28==16)))&&(a14==18))){
a3 = 1;
a26 = 17;
a28 = 15;
a7 = 1;
return -1;
} else if((((((a28==17)&&((((((a26==18)&&(a7==1))&&(a14==19))||(((!(a7==1)&&(a26==19))&&(a14==18))||((a14==19)&&((a26==17)&&(a7==1)))))&&(input==4))&&(a1==1)))&&(a25==1))&&(a4==17))&&!(a3==1))){
a4 = 16;
a14 = 18;
a28 = 15;
a26 = 17;
a3 = 1;
a7 = 1;
return -1;
} else if((((a4==17)&&(((a28==17)&&((((((a14==19)&&((a26==18)&&!(a7==1)))||((!(a7==1)&&(a26==19))&&(a14==19)))||(((a26==17)&&(a7==1))&&(a14==20)))&&(input==1))&&(a3==1)))&&(a1==1)))&&(a25==1))){
a28 = 15;
a4 = 16;
a7 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if(((((a25==1)&&(((((!(a7==1)&&((a28==15)&&(a26==19)))&&(a14==20))||(((a7==1)&&((a28==16)&&(a26==17)))&&(a14==18)))&&(input==1))&&(a4==16)))&&!(a3==1))&&(a1==1))){
a14 = 18;
a28 = 15;
a7 = 1;
a3 = 1;
a26 = 17;
return -1;
} else if((((a25==1)&&((((a3==1)&&((input==2)&&(((((a26==18)&&!(a7==1))&&(a14==19))||((!(a7==1)&&(a26==19))&&(a14==19)))||(((a7==1)&&(a26==17))&&(a14==20)))))&&(a4==17))&&(a1==1)))&&(a28==16))){
a4 = 16;
a14 = 18;
a7 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if((((((a25==1)&&(((a28==15)&&((a1==1)&&((input==3)&&(a4==18))))&&!(a3==1)))&&!(a7==1))&&(a26==17))&&(a14==20))){
a3 = 1;
a14 = 18;
a4 = 16;
a7 = 1;
return -1;
} else if((((a25==1)&&((((a28==15)&&(((a1==1)&&((a3==1)&&(input==3)))&&(a4==18)))&&(a14==19))&&(a7==1)))&&(a26==19))){
a4 = 16;
a14 = 18;
a26 = 17;
return -1;
} else if(((a4==18)&&((a14==18)&&((a1==1)&&((a26==18)&&(!(a3==1)&&(((a25==1)&&((input==4)&&(a28==15)))&&!(a7==1)))))))){
a3 = 1;
a7 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if(((((a1==1)&&(((((input==1)&&((((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))||((a26==18)&&!(a7==1))))&&(a28==17))&&!(a3==1))&&(a4==18)))&&(a14==18))&&(a25==1))){
a26 = 18;
a7 = 0;
return -1;
} else if(((((a4==18)&&(!(a3==1)&&((a25==1)&&((((input==1)&&((a26==18)||(a26==19)))&&(a1==1))&&(a14==19)))))&&!(a7==1))&&(a28==15))){
a14 = 20;
a26 = 17;
return 24;
} else if(((a14==19)&&((((a28==17)&&((a1==1)&&((a4==17)&&((input==1)&&((!(a7==1)&&(a26==17))||(((a26==18)&&(a7==1))||((a7==1)&&(a26==19))))))))&&(a25==1))&&(a3==1)))){
a7 = 1;
a28 = 16;
a4 = 18;
a26 = 18;
return 26;
} else if((((a25==1)&&(((a28==17)&&((((input==4)&&((((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))||((a26==17)&&!(a7==1))))&&(a4==17))&&(a14==19)))&&(a1==1)))&&(a3==1))){
a7 = 1;
a26 = 17;
a14 = 18;
a28 = 15;
a4 = 16;
return -1;
} else if(((a1==1)&&((a28==17)&&((a14==19)&&((a4==17)&&(((((input==6)&&(a25==1))&&!(a3==1))&&(a26==18))&&!(a7==1))))))){
a26 = 17;
a7 = 1;
a14 = 18;
a28 = 15;
a4 = 16;
a3 = 1;
return -1;
} else if(((((((((a25==1)&&((input==6)&&(a28==15)))&&(a1==1))&&(a26==18))&&!(a3==1))&&(a4==18))&&(a7==1))&&(a14==19))){
a26 = 17;
a14 = 20;
a4 = 16;
a7 = 0;
return 26;
} else if(((a26==19)&&((a28==16)&&((a3==1)&&((a1==1)&&((a14==18)&&(((a25==1)&&((input==3)&&(a4==18)))&&!(a7==1)))))))){
a4 = 16;
a7 = 1;
a26 = 17;
a28 = 15;
return -1;
} else if((((a28==16)&&((a14==18)&&((a4==17)&&((a3==1)&&((((((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))||(!(a7==1)&&(a26==17)))&&(input==3))&&(a25==1))))))&&(a1==1))){
a28 = 15;
a14 = 19;
a4 = 18;
a26 = 17;
a7 = 1;
return 24;
} else if((!(a3==1)&&(((a14==19)&&((a1==1)&&((a28==16)&&(((((a26==17)||(a26==18))&&(input==4))&&(a25==1))&&(a4==16)))))&&(a7==1)))){
a14 = 20;
a26 = 19;
a28 = 17;
return 23;
} else if((((a14==20)&&((a1==1)&&((a28==17)&&((!(a3==1)&&((a4==17)&&((input==5)&&(((a26==17)||(a26==18))||(a26==19)))))&&(a7==1)))))&&(a25==1))){
a26 = 17;
a14 = 18;
a3 = 1;
a28 = 15;
a4 = 16;
return -1;
} else if(((a1==1)&&((a14==19)&&(((a25==1)&&((a3==1)&&((a26==18)&&(((input==5)&&(a28==17))&&!(a7==1)))))&&(a4==18))))){
a26 = 17;
a4 = 16;
a28 = 15;
a7 = 1;
a14 = 18;
return -1;
} else if((((a4==17)&&(!(a3==1)&&(((((((a26==18)&&!(a7==1))||(((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17))))&&(input==2))&&(a25==1))&&(a1==1))&&(a14==18))))&&(a28==17))){
a26 = 19;
a14 = 20;
a7 = 1;
a28 = 16;
return 24;
} else if((((a4==18)&&((a14==20)&&((a25==1)&&((a1==1)&&((a28==16)&&((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))&&(input==5)))))))&&!(a3==1))){
a28 = 17;
a7 = 0;
a26 = 18;
a14 = 19;
a4 = 16;
a3 = 1;
return -1;
} else if((!(a3==1)&&((a14==19)&&((a25==1)&&(((a1==1)&&(((((a26==18)&&!(a7==1))||(((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17))))&&(input==1))&&(a4==16)))&&(a28==16)))))){
a28 = 15;
a4 = 17;
a7 = 1;
a26 = 18;
a14 = 18;
return 23;
} else if(((a4==16)&&((a28==15)&&(!(a3==1)&&(((!(a7==1)&&((((a26==19)||((a26==17)||(a26==18)))&&(input==3))&&(a25==1)))&&(a14==18))&&(a1==1)))))){
a7 = 1;
a26 = 17;
a3 = 1;
return -1;
} else if((((a1==1)&&((a3==1)&&(((a7==1)&&(((a14==18)&&(((a26==18)||(a26==19))&&(input==4)))&&(a25==1)))&&(a28==15))))&&(a4==18))){
a4 = 16;
a26 = 17;
return -1;
} else if(((a28==16)&&((a4==17)&&((((a1==1)&&((((((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))||((a26==17)&&!(a7==1)))&&(input==4))&&(a25==1)))&&(a14==18))&&(a3==1))))){
a26 = 18;
a28 = 15;
a7 = 0;
a4 = 18;
return 24;
} else if((!(a3==1)&&((((a1==1)&&((a25==1)&&((input==5)&&((((a7==1)&&(a26==18))&&(a14==20))||((((a26==19)&&!(a7==1))&&(a14==19))||(((a7==1)&&(a26==17))&&(a14==20)))))))&&(a28==16))&&(a4==18)))){
a14 = 19;
a4 = 17;
a26 = 17;
a7 = 0;
return -1;
} else if(((a7==1)&&(((((a25==1)&&(!(a3==1)&&((a28==16)&&((a4==17)&&(input==5)))))&&(a1==1))&&(a26==17))&&(a14==20)))){
a28 = 15;
a14 = 18;
a3 = 1;
a4 = 16;
return -1;
} else if((((((((((a14==19)&&(!(a7==1)&&(a26==19)))||(((a7==1)&&(a26==17))&&(a14==20)))&&(input==4))&&(a4==17))&&(a1==1))&&(a28==15))&&(a3==1))&&(a25==1))){
a7 = 0;
a26 = 18;
a28 = 16;
a14 = 18;
return 23;
} else if((!(a3==1)&&((((a28==17)&&((a14==18)&&((((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))||((a26==18)&&!(a7==1)))&&(input==5))&&(a1==1))))&&(a4==18))&&(a25==1)))){
a14 = 20;
a7 = 0;
a4 = 17;
a28 = 16;
a26 = 17;
return 23;
} else if(((a14==19)&&(((a4==17)&&(((a3==1)&&((((a7==1)&&(input==4))&&(a28==15))&&(a25==1)))&&(a26==18)))&&(a1==1)))){
a26 = 17;
a14 = 18;
a4 = 16;
return -1;
} else if((((a14==20)&&((((a4==17)&&(((((a26==18)&&!(a7==1))||(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1))))&&(input==2))&&(a25==1)))&&(a3==1))&&(a1==1)))&&(a28==17))){
a7 = 1;
a14 = 18;
a4 = 16;
a26 = 17;
a28 = 15;
return -1;
} else if((((a28==15)&&((a7==1)&&(!(a3==1)&&((a25==1)&&(((a26==19)&&((a14==20)&&(input==6)))&&(a1==1))))))&&(a4==16))){
a3 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if((((a26==18)&&(((((a28==17)&&((a4==16)&&((a7==1)&&(input==6))))&&(a1==1))&&(a14==18))&&!(a3==1)))&&(a25==1))){
return -1;
} else if((((a7==1)&&(((a28==15)&&((a4==17)&&((a1==1)&&((a14==19)&&((input==3)&&(a26==18))))))&&(a25==1)))&&(a3==1))){
a14 = 18;
a26 = 17;
a4 = 16;
return -1;
} else if(((a28==17)&&((a4==18)&&((a25==1)&&(((a3==1)&&((input==3)&&(((!(a7==1)&&(a26==19))&&(a14==18))||(((a26==17)&&(a7==1))&&(a14==19)))))&&(a1==1)))))){
a14 = 18;
a7 = 0;
a26 = 19;
return 26;
} else if((((a14==20)&&(((((a4==18)&&((input==1)&&(((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))))&&(a3==1))&&(a28==16))&&(a1==1)))&&(a25==1))){
a7 = 1;
a26 = 17;
return -1;
} else if((((((a28==16)&&(((input==3)&&((((a7==1)&&(a26==17))&&(a14==19))||(((a14==18)&&((a26==18)&&!(a7==1)))||((a14==18)&&(!(a7==1)&&(a26==19))))))&&(a1==1)))&&(a25==1))&&(a4==17))&&(a3==1))){
a4 = 16;
a28 = 15;
a7 = 1;
a14 = 18;
a26 = 17;
return -1;
} else if((((a14==19)&&(((((a1==1)&&((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==5)))&&(a4==17))&&!(a3==1))&&(a25==1)))&&(a28==17))){
a3 = 1;
a14 = 18;
a7 = 1;
a28 = 15;
a4 = 16;
a26 = 17;
return -1;
} else if((!(a7==1)&&((a1==1)&&(((a3==1)&&((a25==1)&&(((((a26==18)||(a26==19))&&(input==2))&&(a28==16))&&(a14==20))))&&(a4==17))))){
a7 = 1;
a28 = 15;
a26 = 17;
a4 = 16;
a14 = 18;
return -1;
} else if(((!(a3==1)&&((((((((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))&&(input==2))&&(a4==17))&&(a28==17))&&(a25==1))&&(a1==1)))&&(a14==19))){
a28 = 15;
a14 = 18;
a4 = 16;
a3 = 1;
a7 = 1;
a26 = 17;
return -1;
} else if((!(a3==1)&&((a28==16)&&(((a1==1)&&((((input==2)&&(((a26==18)&&!(a7==1))||(((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))))&&(a14==19))&&(a25==1)))&&(a4==16))))){
a7 = 1;
a26 = 17;
a3 = 1;
a14 = 18;
a28 = 15;
return -1;
} else if(((!(a3==1)&&((a28==16)&&((((a14==19)&&((a1==1)&&((input==1)&&((a26==17)||(a26==18)))))&&(a25==1))&&(a4==16))))&&(a7==1))){
a3 = 1;
a28 = 15;
a14 = 18;
a26 = 17;
return -1;
} else if((((a1==1)&&(((a25==1)&&(((a7==1)&&(((a4==16)&&(input==2))&&!(a3==1)))&&(a14==18)))&&(a26==19)))&&(a28==15))){
a26 = 18;
a28 = 16;
a14 = 20;
return 24;
} else if(((a14==18)&&(!(a3==1)&&((((((a1==1)&&(((a26==17)||(a26==18))&&(input==5)))&&(a25==1))&&(a7==1))&&(a28==15))&&(a4==18))))){
a3 = 1;
a26 = 17;
a4 = 16;
return -1;
} else if(((!(a3==1)&&((a28==17)&&(((a1==1)&&((a25==1)&&((!(a7==1)&&(input==4))&&(a14==18))))&&(a4==16))))&&(a26==18))){
a7 = 1;
a28 = 15;
a3 = 1;
a26 = 17;
return -1;
} else if(((a4==17)&&((((a26==19)&&(((((input==4)&&(a25==1))&&(a28==17))&&(a14==19))&&!(a7==1)))&&(a1==1))&&!(a3==1)))){
a3 = 1;
a7 = 1;
a28 = 15;
a26 = 17;
a14 = 18;
a4 = 16;
return -1;
} else if((((a25==1)&&((a7==1)&&((a14==19)&&((((((a26==18)||(a26==19))&&(input==5))&&(a4==16))&&(a28==17))&&!(a3==1)))))&&(a1==1))){
a26 = 18;
return 26;
} else if((!(a3==1)&&((a25==1)&&((a4==17)&&(((input==5)&&(((a14==18)&&(((a26==17)&&(a28==16))&&(a7==1)))||(((a14==20)&&(((a28==15)&&(a26==18))&&!(a7==1)))||((!(a7==1)&&((a26==19)&&(a28==15)))&&(a14==20)))))&&(a1==1)))))){
a7 = 1;
a14 = 20;
a28 = 16;
a26 = 19;
return 22;
} else if((((a25==1)&&((((a14==19)&&(((input==3)&&(((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17))))&&(a1==1)))&&(a28==17))&&(a4==17)))&&!(a3==1))){
a14 = 18;
a7 = 1;
a3 = 1;
a26 = 17;
a4 = 16;
a28 = 15;
return -1;
} else if(((a4==17)&&(((a25==1)&&(((!(a7==1)&&(((input==5)&&(((a26==17)||(a26==18))||(a26==19)))&&(a14==20)))&&(a1==1))&&!(a3==1)))&&(a28==17)))){
a7 = 1;
a14 = 18;
a26 = 17;
a28 = 15;
a4 = 16;
a3 = 1;
return -1;
} else if(((a1==1)&&(((a25==1)&&((a28==17)&&((a3==1)&&((((!(a7==1)&&(a26==18))||(((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17))))&&(input==1))&&(a14==20)))))&&(a4==17)))){
a14 = 18;
a7 = 1;
a26 = 17;
a4 = 16;
a28 = 15;
return -1;
} else if(((a4==18)&&((a25==1)&&((a1==1)&&((a28==15)&&((((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==1))&&(a14==18))&&!(a3==1))))))){
a4 = 16;
a3 = 1;
a7 = 1;
a26 = 17;
return -1;
} else if(((a1==1)&&((a25==1)&&(((((((!(a7==1)&&((a28==15)&&(a26==18)))&&(a14==20))||((((a26==19)&&(a28==15))&&!(a7==1))&&(a14==20)))||((((a26==17)&&(a28==16))&&(a7==1))&&(a14==18)))&&(input==5))&&(a4==17))&&(a3==1))))){
a4 = 18;
a7 = 1;
a26 = 17;
a14 = 18;
a28 = 15;
return 26;
} else if((((a28==15)&&((((a25==1)&&((a4==16)&&(((((a26==17)||(a26==18))||(a26==19))&&(input==2))&&!(a3==1))))&&!(a7==1))&&(a14==18)))&&(a1==1))){
a3 = 1;
a26 = 17;
a7 = 1;
return -1;
} else if(((((((a4==17)&&((input==4)&&(((((a26==19)&&!(a7==1))&&(a14==18))||(((a26==17)&&(a7==1))&&(a14==19)))||(((a26==18)&&(a7==1))&&(a14==19)))))&&(a28==15))&&(a1==1))&&!(a3==1))&&(a25==1))){
a7 = 1;
a26 = 17;
a4 = 16;
a14 = 18;
a3 = 1;
return -1;
} else if(((a14==19)&&((a25==1)&&(((!(a7==1)&&((a4==17)&&(((input==2)&&(a28==17))&&!(a3==1))))&&(a26==19))&&(a1==1))))){
a7 = 1;
a28 = 15;
a4 = 16;
a26 = 17;
a3 = 1;
a14 = 18;
return -1;
} else if((((a14==20)&&((a1==1)&&(((a25==1)&&((a4==18)&&((input==6)&&(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1))))))&&(a28==16))))&&!(a3==1))){
a26 = 17;
a4 = 16;
a7 = 1;
a28 = 15;
a3 = 1;
return -1;
} else if((!(a7==1)&&((((!(a3==1)&&((a28==15)&&(((a4==16)&&(input==1))&&(a26==19))))&&(a1==1))&&(a14==19))&&(a25==1)))){
a14 = 18;
a26 = 18;
a28 = 17;
return 21;
} else if(((!(a3==1)&&((a1==1)&&((a7==1)&&((a25==1)&&((((input==3)&&((a26==19)||((a26==17)||(a26==18))))&&(a14==20))&&(a28==15))))))&&(a4==17))){
a26 = 17;
a28 = 16;
a7 = 0;
a14 = 19;
return -1;
} else if((!(a3==1)&&((((a14==19)&&((((a25==1)&&(((a26==17)||(a26==18))&&(input==5)))&&(a28==16))&&(a4==17)))&&(a1==1))&&!(a7==1)))){
a28 = 15;
a4 = 16;
a26 = 17;
a7 = 1;
a3 = 1;
a14 = 18;
return -1;
} else if((((a25==1)&&((!(a3==1)&&((a7==1)&&((a4==17)&&((a1==1)&&(((a26==17)||(a26==18))&&(input==5))))))&&(a14==18)))&&(a28==17))){
a26 = 17;
a28 = 15;
a4 = 16;
a3 = 1;
return -1;
} else if(((a1==1)&&((((a25==1)&&(((!(a3==1)&&(((a26==18)||(a26==19))&&(input==3)))&&(a14==18))&&(a28==16)))&&!(a7==1))&&(a4==17)))){
a7 = 1;
a28 = 15;
a4 = 16;
a3 = 1;
a26 = 17;
return -1;
} else if((((a14==20)&&(((!(a7==1)&&((a1==1)&&((a4==17)&&(((a26==18)||(a26==19))&&(input==4)))))&&(a25==1))&&(a3==1)))&&(a28==16))){
a26 = 19;
a4 = 18;
a28 = 15;
return 26;
} else if((((((a28==16)&&(((a4==18)&&((input==3)&&((((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))||((a26==17)&&!(a7==1)))))&&(a3==1)))&&(a25==1))&&(a14==18))&&(a1==1))){
a4 = 16;
a3 = 0;
a26 = 19;
a14 = 19;
a7 = 1;
a28 = 15;
return 26;
} else if(((a25==1)&&((a4==18)&&((a26==19)&&(((a3==1)&&((a28==16)&&(((input==1)&&(a1==1))&&(a14==18))))&&!(a7==1)))))){
a26 = 17;
a28 = 15;
a4 = 16;
a7 = 1;
return -1;
} else if((((((a3==1)&&((a1==1)&&((!(a7==1)&&((input==4)&&((a26==17)||(a26==18))))&&(a28==15))))&&(a14==19))&&(a25==1))&&(a4==18))){
a4 = 16;
a14 = 18;
a7 = 1;
a26 = 17;
return -1;
} else if(((((((((input==6)&&(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1))))&&(a25==1))&&!(a3==1))&&(a14==19))&&(a4==18))&&(a1==1))&&(a28==16))){
a14 = 18;
a3 = 1;
a4 = 16;
a7 = 1;
a26 = 17;
return -1;
} else if((((a28==15)&&((a25==1)&&((a4==17)&&(((input==1)&&(((!(a7==1)&&(a26==19))&&(a14==19))||(((a7==1)&&(a26==17))&&(a14==20))))&&(a1==1)))))&&(a3==1))){
a7 = 1;
a26 = 17;
a14 = 18;
a4 = 16;
return -1;
} else if((!(a3==1)&&(((!(a7==1)&&((((a1==1)&&((input==5)&&((a26==18)||(a26==19))))&&(a14==19))&&(a28==15)))&&(a4==18))&&(a25==1)))){
a3 = 1;
a7 = 1;
a26 = 17;
a4 = 16;
a14 = 18;
return -1;
} else if(((a28==17)&&(((!(a3==1)&&((a4==18)&&((((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))||(!(a7==1)&&(a26==18)))&&(input==4))&&(a25==1))))&&(a1==1))&&(a14==18)))){
a4 = 16;
a26 = 18;
a7 = 1;
return 24;
} else if(((a1==1)&&(((a26==17)&&((a28==16)&&((a3==1)&&((a4==18)&&((a7==1)&&((a14==19)&&(input==3)))))))&&(a25==1)))){
a3 = 0;
a4 = 16;
a14 = 20;
a28 = 15;
return 24;
} else if((((((a25==1)&&((((a1==1)&&((input==6)&&((a26==18)||(a26==19))))&&(a14==18))&&(a4==17)))&&(a7==1))&&(a28==15))&&!(a3==1))){
a26 = 18;
return 23;
} else if((((a4==18)&&(!(a7==1)&&((a26==18)&&((a25==1)&&(((a14==18)&&((a28==15)&&(input==2)))&&(a1==1))))))&&!(a3==1))){
a7 = 1;
a26 = 17;
a3 = 1;
a4 = 16;
return -1;
} else if((((a1==1)&&((a25==1)&&(((a28==15)&&(((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))&&(input==2))&&(a4==18)))&&!(a3==1))))&&(a14==19))){
a7 = 1;
a4 = 16;
a14 = 18;
a26 = 17;
a3 = 1;
return -1;
} else if((((((a25==1)&&((!(a3==1)&&((a4==18)&&((input==4)&&((a26==18)||(a26==19)))))&&(a14==20)))&&(a1==1))&&!(a7==1))&&(a28==16))){
a26 = 19;
return 23;
} else if(((((((a28==16)&&(((input==5)&&((!(a7==1)&&(a26==17))||(((a7==1)&&(a26==18))||((a26==19)&&(a7==1)))))&&(a3==1)))&&(a25==1))&&(a4==18))&&(a14==19))&&(a1==1))){
a7 = 1;
a4 = 16;
a28 = 15;
a14 = 18;
a26 = 17;
return -1;
} else if((!(a7==1)&&(((((a1==1)&&(!(a3==1)&&((a25==1)&&((input==6)&&(a4==17)))))&&(a14==19))&&(a28==15))&&(a26==19)))){
a4 = 16;
a26 = 17;
a14 = 18;
a7 = 1;
a3 = 1;
return -1;
} else if(((a1==1)&&((!(a3==1)&&((((((a14==20)&&((a7==1)&&(a26==18)))||(((a14==19)&&((a26==19)&&!(a7==1)))||(((a7==1)&&(a26==17))&&(a14==20))))&&(input==6))&&(a28==16))&&(a25==1)))&&(a4==16)))){
a3 = 1;
a14 = 18;
a26 = 17;
a28 = 15;
a7 = 1;
return -1;
} else if(((a4==18)&&((a3==1)&&(((a14==18)&&(((a1==1)&&((((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))&&(input==6)))&&(a28==17)))&&(a25==1))))){
a4 = 16;
a28 = 16;
a3 = 0;
a26 = 18;
a7 = 1;
return 23;
} else if(((a1==1)&&((a14==18)&&(((((a4==17)&&((input==6)&&(((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))))&&(a28==17))&&(a3==1))&&(a25==1))))){
a26 = 17;
a7 = 1;
a4 = 16;
a28 = 15;
return -1;
} else if(((a1==1)&&((a7==1)&&(!(a3==1)&&((a28==15)&&((a25==1)&&(((((a26==17)||(a26==18))&&(input==4))&&(a4==16))&&(a14==20)))))))){
a3 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if((((a28==16)&&((a4==17)&&((a25==1)&&((a3==1)&&(((input==1)&&((((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))||(!(a7==1)&&(a26==17))))&&(a14==20))))))&&(a1==1))){
a28 = 15;
a14 = 18;
a26 = 17;
a4 = 16;
a7 = 1;
return -1;
} else if((((((a4==17)&&((a1==1)&&(((((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))&&(input==4))&&(a14==18))))&&(a3==1))&&(a28==17))&&(a25==1))){
a4 = 16;
a28 = 15;
a7 = 1;
a26 = 17;
return -1;
} else if(((a28==17)&&(((a25==1)&&((a3==1)&&((a1==1)&&((input==3)&&((((a26==19)&&!(a7==1))&&(a14==19))||(((a26==17)&&(a7==1))&&(a14==20)))))))&&(a4==18)))){
a4 = 16;
a26 = 17;
a28 = 15;
a7 = 1;
a14 = 18;
return -1;
} else if((((((((a28==15)&&(((input==1)&&(((a26==17)||(a26==18))||(a26==19)))&&(a4==18)))&&(a1==1))&&(a25==1))&&(a7==1))&&!(a3==1))&&(a14==20))){
a14 = 18;
a26 = 17;
a4 = 16;
a3 = 1;
return -1;
} else if(((a3==1)&&((a1==1)&&((a25==1)&&((((a26==17)&&((a14==20)&&((a4==18)&&(input==5))))&&!(a7==1))&&(a28==15)))))){
a4 = 16;
a14 = 18;
a7 = 1;
return -1;
} else if((((a3==1)&&((a28==16)&&((a26==18)&&((a1==1)&&(!(a7==1)&&((a25==1)&&((a14==18)&&(input==3))))))))&&(a4==18))){
a3 = 0;
a28 = 15;
a4 = 16;
a14 = 19;
return 24;
} else if(((a25==1)&&(((a4==16)&&(((input==6)&&(((((a26==17)&&(a28==17))&&(a7==1))&&(a14==18))||(((!(a7==1)&&((a26==18)&&(a28==16)))&&(a14==20))||((((a26==19)&&(a28==16))&&!(a7==1))&&(a14==20)))))&&(a1==1)))&&!(a3==1)))){
a3 = 1;
a28 = 15;
a26 = 17;
a14 = 18;
a7 = 1;
return -1;
} else if(((a25==1)&&(!(a3==1)&&((a1==1)&&((a4==16)&&((input==2)&&((((((a26==18)&&(a28==16))&&!(a7==1))&&(a14==20))||((!(a7==1)&&((a26==19)&&(a28==16)))&&(a14==20)))||((((a26==17)&&(a28==17))&&(a7==1))&&(a14==18))))))))){
a7 = 0;
a4 = 17;
a14 = 19;
a26 = 18;
a28 = 15;
return 26;
} else if(((a4==16)&&(((a25==1)&&((((a1==1)&&(((a26==18)&&(input==5))&&(a28==16)))&&(a7==1))&&(a14==18)))&&!(a3==1)))){
a28 = 17;
a7 = 0;
a14 = 19;
return 24;
} else if(((a14==20)&&((((a4==18)&&(((a26==18)&&(((input==6)&&(a28==17))&&(a1==1)))&&!(a7==1)))&&(a25==1))&&(a3==1)))){
a26 = 17;
a7 = 1;
a14 = 18;
a28 = 15;
a4 = 16;
return -1;
} else if(((((a3==1)&&((((a1==1)&&((a28==16)&&((a25==1)&&(input==4))))&&(a4==18))&&(a14==19)))&&(a26==17))&&(a7==1))){
a14 = 18;
a28 = 15;
a4 = 16;
return -1;
} else if(((((a4==17)&&((((((input==5)&&(a28==16))&&(a25==1))&&(a26==19))&&!(a7==1))&&(a1==1)))&&!(a3==1))&&(a14==19))){
a4 = 16;
a26 = 17;
a14 = 18;
a7 = 1;
a28 = 15;
a3 = 1;
return -1;
} else if(((a1==1)&&((a25==1)&&((!(a3==1)&&((a4==16)&&(((((a14==19)&&(!(a7==1)&&(a26==19)))||((a14==20)&&((a7==1)&&(a26==17))))||(((a26==18)&&(a7==1))&&(a14==20)))&&(input==3))))&&(a28==16))))){
a14 = 18;
a26 = 19;
a7 = 0;
a4 = 17;
a28 = 15;
return 26;
} else if((((((((a26==18)&&(((input==5)&&(a25==1))&&(a3==1)))&&(a7==1))&&(a28==17))&&(a4==17))&&(a1==1))&&(a14==20))){
a28 = 15;
a4 = 16;
a14 = 18;
a26 = 17;
return -1;
} else if(((a25==1)&&((((a4==18)&&((a28==16)&&((input==4)&&(((!(a7==1)&&(a26==19))&&(a14==18))||(((a26==17)&&(a7==1))&&(a14==19))))))&&(a1==1))&&!(a3==1)))){
a4 = 16;
a7 = 1;
a28 = 15;
a26 = 17;
a3 = 1;
a14 = 18;
return -1;
} else if(((((((a14==18)&&((a4==18)&&(((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))||(!(a7==1)&&(a26==18)))&&(input==5))))&&(a1==1))&&(a25==1))&&!(a3==1))&&(a28==16))){
a3 = 1;
a4 = 16;
a26 = 17;
a7 = 1;
a28 = 15;
return -1;
} else if((((a25==1)&&((((((((a26==18)||(a26==19))&&(input==2))&&(a14==18))&&(a1==1))&&(a4==18))&&(a7==1))&&(a3==1)))&&(a28==15))){
a7 = 0;
a26 = 19;
a28 = 17;
return 26;
} else if(((((a25==1)&&((a1==1)&&((a4==18)&&((((!(a7==1)&&(a26==19))&&(a14==18))||((a14==19)&&((a7==1)&&(a26==17))))&&(input==5)))))&&(a28==17))&&(a3==1))){
a26 = 17;
a7 = 1;
a14 = 19;
return -1;
} else if((((((((a14==19)&&(((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))||((a26==18)&&!(a7==1)))&&(input==2)))&&(a4==17))&&(a25==1))&&(a28==15))&&(a3==1))&&(a1==1))){
a26 = 17;
a4 = 16;
a14 = 18;
a7 = 1;
return -1;
} else if((((((((a14==18)&&((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==5)))&&(a4==16))&&!(a3==1))&&(a25==1))&&(a1==1))&&(a28==16))){
a7 = 1;
a28 = 15;
a3 = 1;
a26 = 17;
return -1;
} else if((!(a7==1)&&(((a4==17)&&((((a28==15)&&((a1==1)&&((a26==17)&&(input==2))))&&(a3==1))&&(a14==20)))&&(a25==1)))){
a26 = 18;
a28 = 17;
a7 = 1;
return 24;
} else if(((((a1==1)&&(!(a3==1)&&((a14==19)&&((a4==16)&&((a26==19)&&((input==6)&&!(a7==1)))))))&&(a25==1))&&(a28==15))){
a7 = 1;
a3 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if(((a14==19)&&(((a4==17)&&(((a25==1)&&((a1==1)&&(((input==5)&&(((a26==17)||(a26==18))||(a26==19)))&&(a7==1))))&&(a28==16)))&&!(a3==1)))){
a4 = 16;
a3 = 1;
a26 = 17;
a14 = 18;
a28 = 15;
return -1;
} else if((((((a25==1)&&(((a4==18)&&(((((a26==17)||(a26==18))||(a26==19))&&(input==6))&&(a28==15)))&&(a1==1)))&&(a7==1))&&!(a3==1))&&(a14==20))){
a26 = 17;
a4 = 16;
a3 = 1;
a14 = 18;
return -1;
} else if(((a4==16)&&((!(a3==1)&&((((((input==3)&&((a26==17)||(a26==18)))&&(a25==1))&&(a14==20))&&(a1==1))&&(a7==1)))&&(a28==15)))){
a26 = 17;
a14 = 18;
a3 = 1;
return -1;
} else if(((!(a3==1)&&((((((((a26==17)||(a26==18))&&(input==1))&&(a1==1))&&(a14==18))&&(a4==18))&&(a25==1))&&(a28==15)))&&(a7==1))){
a14 = 19;
a26 = 17;
return 24;
} else if(((a14==20)&&(((((a26==17)&&((a1==1)&&((a7==1)&&((input==2)&&!(a3==1)))))&&(a28==16))&&(a25==1))&&(a4==17)))){
a3 = 1;
a14 = 18;
a4 = 16;
a28 = 15;
return -1;
} else if((((a4==17)&&(((a3==1)&&(((input==2)&&(((((a26==18)&&!(a7==1))&&(a14==18))||((a14==18)&&((a26==19)&&!(a7==1))))||((a14==19)&&((a26==17)&&(a7==1)))))&&(a28==16)))&&(a25==1)))&&(a1==1))){
a26 = 17;
a4 = 16;
a28 = 15;
a7 = 1;
a14 = 18;
return -1;
} else if(((a28==17)&&((a25==1)&&((a3==1)&&((a14==19)&&((a1==1)&&((a4==18)&&(((((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))||((a26==17)&&!(a7==1)))&&(input==3))))))))){
a28 = 15;
a14 = 18;
a26 = 17;
a7 = 0;
return -1;
} else if(((a1==1)&&((a4==16)&&(((((!(a7==1)&&((input==5)&&((a26==17)||(a26==18))))&&(a14==20))&&(a28==15))&&!(a3==1))&&(a25==1))))){
a14 = 18;
a3 = 1;
a7 = 1;
a26 = 17;
return -1;
} else if((((a4==18)&&(((a28==15)&&((a1==1)&&((a7==1)&&((a3==1)&&((a25==1)&&(input==5))))))&&(a26==18)))&&(a14==19))){
a26 = 19;
a7 = 0;
a28 = 17;
return 24;
} else if(((((a25==1)&&(((a28==15)&&(((a26==18)&&((input==4)&&!(a3==1)))&&(a1==1)))&&(a4==18)))&&(a14==19))&&(a7==1))){
a14 = 18;
a3 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if(((a3==1)&&((a1==1)&&(((a4==18)&&((a28==17)&&((((a14==19)&&(!(a7==1)&&(a26==19)))||(((a26==17)&&(a7==1))&&(a14==20)))&&(input==5))))&&(a25==1))))){
a7 = 1;
a26 = 17;
a14 = 19;
return 26;
} else if(((((a4==16)&&((a26==19)&&(((a14==20)&&(!(a3==1)&&((a7==1)&&(input==5))))&&(a25==1))))&&(a1==1))&&(a28==15))){
a14 = 18;
a3 = 1;
a26 = 17;
return -1;
} else if(((a25==1)&&((a1==1)&&(((a4==17)&&((a3==1)&&((input==2)&&((((a26==19)&&!(a7==1))&&(a14==19))||(((a7==1)&&(a26==17))&&(a14==20))))))&&(a28==15))))){
a14 = 18;
a4 = 16;
a26 = 17;
a7 = 1;
return -1;
} else if((((a4==18)&&((a28==16)&&((a25==1)&&(((input==5)&&(((a14==18)&&(!(a7==1)&&(a26==19)))||((a14==19)&&((a7==1)&&(a26==17)))))&&!(a3==1)))))&&(a1==1))){
a7 = 1;
a14 = 19;
a26 = 19;
return 22;
} else if(((a25==1)&&((a28==15)&&(((a14==18)&&((a4==17)&&((((input==5)&&((a26==17)||(a26==18)))&&(a1==1))&&!(a3==1))))&&!(a7==1))))){
a26 = 17;
a14 = 19;
a28 = 16;
return -1;
} else if(((((a4==18)&&(((a28==17)&&(((((!(a7==1)&&(a26==19))&&(a14==18))||(((a26==17)&&(a7==1))&&(a14==19)))||((a14==19)&&((a26==18)&&(a7==1))))&&(input==1)))&&(a1==1)))&&!(a3==1))&&(a25==1))){
a26 = 17;
a14 = 18;
a7 = 0;
return 26;
} else if(((a25==1)&&((a1==1)&&((((((((a14==18)&&((a26==19)&&!(a7==1)))||((a14==19)&&((a26==17)&&(a7==1))))||(((a7==1)&&(a26==18))&&(a14==19)))&&(input==6))&&(a4==17))&&(a28==17))&&!(a3==1))))){
a14 = 20;
a7 = 1;
a26 = 19;
return 22;
} else if(((((a28==17)&&((a1==1)&&((a4==17)&&((input==1)&&(((a14==19)&&((a26==18)&&(a7==1)))||(((a14==18)&&(!(a7==1)&&(a26==19)))||((a14==19)&&((a7==1)&&(a26==17)))))))))&&(a25==1))&&!(a3==1))){
a26 = 17;
a3 = 1;
a4 = 16;
a14 = 18;
a7 = 1;
a28 = 15;
return -1;
} else if(((a28==15)&&((a25==1)&&((a3==1)&&(!(a7==1)&&(((((a1==1)&&(input==4))&&(a14==20))&&(a26==17))&&(a4==17))))))){
a28 = 17;
a7 = 1;
a26 = 19;
a14 = 19;
return 22;
} else if((((a25==1)&&((((a28==15)&&((a1==1)&&(!(a3==1)&&((input==1)&&((a26==17)||(a26==18))))))&&(a4==17))&&!(a7==1)))&&(a14==18))){
a28 = 17;
a7 = 1;
a4 = 16;
a26 = 18;
return -1;
} else if(((a25==1)&&((a1==1)&&((input==6)&&((((((a28==17)&&((a26==19)&&((a4==18)&&(a3==1))))&&!(a7==1))&&(a14==20))||((((a28==15)&&((!(a3==1)&&(a4==16))&&(a26==17)))&&(a7==1))&&(a14==18)))||((a14==18)&&((a7==1)&&((a28==15)&&((a26==18)&&(!(a3==1)&&(a4==16))))))))))){
a28 = 15;
a26 = 17;
a7 = 1;
a14 = 18;
a3 = 1;
a4 = 16;
return -1;
} else if(((a1==1)&&((((((a14==19)&&((a28==15)&&((a7==1)&&(input==6))))&&(a4==16))&&(a26==19))&&!(a3==1))&&(a25==1)))){
a3 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if((((a25==1)&&((((((a4==17)&&((((a26==17)||(a26==18))||(a26==19))&&(input==6)))&&(a28==17))&&(a14==20))&&(a1==1))&&(a7==1)))&&!(a3==1))){
a14 = 18;
a4 = 16;
a3 = 1;
a26 = 17;
a28 = 15;
return -1;
} else if(((!(a3==1)&&((((a25==1)&&(((((a26==18)||(a26==19))&&(input==4))&&(a14==18))&&(a7==1)))&&(a4==17))&&(a28==15)))&&(a1==1))){
a26 = 19;
return 23;
} else if(((a25==1)&&(((((!(a3==1)&&(!(a7==1)&&((input==6)&&((a26==18)||(a26==19)))))&&(a28==15))&&(a4==18))&&(a1==1))&&(a14==19)))){
a14 = 18;
a7 = 1;
a26 = 17;
a3 = 1;
a4 = 16;
return -1;
} else if(((a28==15)&&(!(a3==1)&&((a4==18)&&(((a1==1)&&((((!(a7==1)&&(a26==19))&&(a14==18))||(((a7==1)&&(a26==17))&&(a14==19)))&&(input==3)))&&(a25==1)))))){
a4 = 16;
a3 = 1;
a14 = 18;
a26 = 17;
a7 = 1;
return -1;
} else if(((a4==16)&&((a1==1)&&((a14==20)&&((!(a3==1)&&((a28==16)&&((input==3)&&(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1))))))&&(a25==1)))))){
a28 = 15;
a3 = 1;
a14 = 18;
a26 = 17;
a7 = 1;
return -1;
} return calculate_output2(input);
}
int calculate_output2(int input) {
if((((a28==16)&&((((a25==1)&&(((a1==1)&&((a4==18)&&(input==4)))&&(a14==18)))&&(a26==18))&&!(a7==1)))&&(a3==1))){
a28 = 15;
a7 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if(((a25==1)&&((a4==17)&&((a28==15)&&((((((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))||(!(a7==1)&&(a26==18)))&&(input==1))&&(a3==1))&&(a14==19))&&(a1==1)))))){
a14 = 20;
a26 = 17;
a7 = 0;
return 22;
} else if(((a4==16)&&((!(a3==1)&&(((a14==19)&&((((input==3)&&(a28==15))&&(a26==19))&&(a25==1)))&&(a1==1)))&&(a7==1)))){
a26 = 17;
a3 = 1;
a14 = 18;
return -1;
} else if(((!(a3==1)&&((((((a26==18)&&((input==1)&&(a4==16)))&&(a1==1))&&(a28==17))&&(a14==18))&&(a7==1)))&&(a25==1))){
return -1;
} else if((((!(a7==1)&&((a14==18)&&(((!(a3==1)&&((input==3)&&(a1==1)))&&(a25==1))&&(a28==17))))&&(a4==16))&&(a26==18))){
a7 = 1;
return 24;
} else if(((a28==16)&&(((((a14==20)&&((((input==4)&&((a26==18)||(a26==19)))&&!(a7==1))&&!(a3==1)))&&(a1==1))&&(a4==17))&&(a25==1)))){
a26 = 18;
a28 = 15;
a7 = 1;
return -1;
} else if(((!(a3==1)&&((a25==1)&&((a28==17)&&((a14==18)&&((a4==17)&&(((input==3)&&((a26==17)||(a26==18)))&&(a7==1)))))))&&(a1==1))){
a26 = 17;
a4 = 16;
a28 = 15;
a3 = 1;
return -1;
} else if((((a3==1)&&(((((((a14==19)&&(!(a7==1)&&(a26==19)))||(((a7==1)&&(a26==17))&&(a14==20)))&&(input==2))&&(a1==1))&&(a25==1))&&(a4==18)))&&(a28==17))){
a14 = 18;
a26 = 17;
a28 = 15;
a4 = 16;
a7 = 1;
return -1;
} else if(((a14==20)&&((((!(a3==1)&&((a4==17)&&(((input==1)&&((a26==19)||((a26==17)||(a26==18))))&&(a28==17))))&&!(a7==1))&&(a25==1))&&(a1==1)))){
a26 = 18;
a14 = 18;
a28 = 15;
a4 = 18;
return 22;
} else if((((a3==1)&&((((((input==5)&&((((a7==1)&&(a26==18))||((a7==1)&&(a26==19)))||((a26==17)&&!(a7==1))))&&(a25==1))&&(a28==16))&&(a14==20))&&(a1==1)))&&(a4==17))){
a14 = 18;
a28 = 15;
a26 = 17;
a4 = 16;
a7 = 1;
return -1;
} else if((((((((a25==1)&&((((a26==17)||(a26==18))&&(input==6))&&(a1==1)))&&(a4==17))&&!(a3==1))&&(a14==18))&&!(a7==1))&&(a28==15))){
a26 = 18;
a4 = 16;
a7 = 1;
a28 = 17;
return -1;
} else if(((a4==17)&&(((((a25==1)&&(((((a26==18)&&!(a7==1))||(((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17))))&&(input==3))&&(a1==1)))&&(a3==1))&&(a28==15))&&(a14==19)))){
a4 = 16;
a7 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if((((a25==1)&&((a26==19)&&((a14==20)&&((a3==1)&&(((a1==1)&&((input==2)&&(a4==18)))&&(a7==1))))))&&(a28==15))){
a14 = 18;
a4 = 16;
a26 = 17;
return -1;
} else if(((a26==19)&&((a28==15)&&((a25==1)&&(((a1==1)&&((!(a3==1)&&((a4==16)&&(input==3)))&&(a14==20)))&&(a7==1)))))){
a3 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if((((((a1==1)&&((a26==17)&&((a25==1)&&(((input==2)&&(a7==1))&&(a14==19)))))&&(a28==16))&&(a3==1))&&(a4==18))){
a4 = 16;
a14 = 18;
a28 = 15;
return -1;
} else if((!(a7==1)&&((a25==1)&&(((a1==1)&&(((((a14==20)&&(input==4))&&!(a3==1))&&(a4==18))&&(a26==17)))&&(a28==15))))){
a14 = 18;
a4 = 16;
a3 = 1;
a7 = 1;
return -1;
} else if(((a28==15)&&((a1==1)&&((a4==18)&&(!(a3==1)&&((((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==5))&&(a25==1))&&(a14==18))))))){
a7 = 1;
a4 = 16;
a26 = 17;
a3 = 1;
return -1;
} else if((((a14==19)&&((a4==18)&&((a28==16)&&((a25==1)&&(!(a7==1)&&((a1==1)&&((input==2)&&((a26==18)||(a26==19)))))))))&&(a3==1))){
a28 = 17;
a26 = 17;
return 26;
} else if((((((a28==16)&&((((((a26==17)||(a26==18))&&(input==3))&&(a1==1))&&(a4==17))&&!(a7==1)))&&(a14==19))&&!(a3==1))&&(a25==1))){
a26 = 18;
return -1;
} else if((((((a25==1)&&((a4==17)&&((((((a26==18)&&!(a7==1))&&(a14==19))||((!(a7==1)&&(a26==19))&&(a14==19)))||((a14==20)&&((a7==1)&&(a26==17))))&&(input==2))))&&(a3==1))&&(a28==17))&&(a1==1))){
a14 = 18;
a28 = 15;
a4 = 16;
a26 = 17;
a7 = 1;
return -1;
} else if((((a25==1)&&(((((a4==18)&&(((input==1)&&(a26==19))&&(a28==15)))&&(a7==1))&&(a14==20))&&(a1==1)))&&(a3==1))){
a4 = 16;
a26 = 17;
a14 = 18;
return -1;
} else if(((a28==15)&&((a26==19)&&((a4==17)&&((!(a7==1)&&(!(a3==1)&&(((a1==1)&&(input==5))&&(a14==19))))&&(a25==1)))))){
a14 = 18;
a7 = 1;
a4 = 16;
a3 = 1;
a26 = 17;
return -1;
} else if(((a1==1)&&((a25==1)&&(((a3==1)&&(((a4==17)&&(((!(a7==1)&&(a26==17))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))&&(input==3)))&&(a28==16)))&&(a14==20))))){
a28 = 15;
a7 = 1;
a14 = 18;
a4 = 16;
a26 = 17;
return -1;
} else if(((a25==1)&&(((a14==19)&&(((((a3==1)&&((a4==18)&&(input==2)))&&(a26==19))&&(a28==15))&&(a1==1)))&&(a7==1)))){
a28 = 17;
a26 = 17;
a7 = 0;
a14 = 20;
return 22;
} else if((((a25==1)&&((a4==17)&&((a1==1)&&(((((a7==1)&&((a28==16)&&(a26==17)))&&(a14==18))||(((a14==20)&&(!(a7==1)&&((a28==15)&&(a26==18))))||((a14==20)&&(!(a7==1)&&((a26==19)&&(a28==15))))))&&(input==6)))))&&!(a3==1))){
a7 = 0;
a28 = 15;
a26 = 17;
a14 = 20;
return 23;
} else if(((a25==1)&&((((!(a3==1)&&((a4==18)&&((a28==15)&&((a26==17)&&(input==1)))))&&(a1==1))&&(a14==20))&&!(a7==1)))){
a28 = 16;
a7 = 1;
a14 = 18;
return 22;
} else if((((a28==17)&&(((a4==18)&&((a26==18)&&((a3==1)&&((a1==1)&&((a14==19)&&(input==6))))))&&!(a7==1)))&&(a25==1))){
a7 = 1;
a28 = 15;
a14 = 18;
a26 = 17;
a4 = 16;
return -1;
} else if(((((a3==1)&&((((a26==18)&&(((a25==1)&&(input==5))&&(a28==16)))&&!(a7==1))&&(a1==1)))&&(a4==18))&&(a14==18))){
a7 = 1;
a28 = 15;
a26 = 17;
a4 = 16;
return -1;
} else if(((a3==1)&&((a4==18)&&(((!(a7==1)&&((a14==19)&&((a1==1)&&((input==3)&&((a26==17)||(a26==18))))))&&(a25==1))&&(a28==15))))){
a4 = 16;
a26 = 17;
a14 = 18;
a7 = 1;
return -1;
} else if((((a28==15)&&((a25==1)&&((a7==1)&&((((a3==1)&&((input==1)&&(a1==1)))&&(a26==19))&&(a4==18)))))&&(a14==19))){
a4 = 16;
a14 = 18;
a26 = 17;
return -1;
} else if(((!(a3==1)&&((((((a4==16)&&((a25==1)&&(input==5)))&&(a26==19))&&(a7==1))&&(a1==1))&&(a14==18)))&&(a28==15))){
a26 = 17;
a3 = 1;
return -1;
} else if((((((a28==16)&&(((a14==20)&&(((!(a7==1)&&(a26==17))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))&&(input==2)))&&!(a3==1)))&&(a4==17))&&(a25==1))&&(a1==1))){
a7 = 0;
a26 = 17;
a28 = 15;
return -1;
} else if(((a3==1)&&((((((a1==1)&&((input==2)&&((((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))||((a26==17)&&!(a7==1)))))&&(a25==1))&&(a28==16))&&(a4==17))&&(a14==18)))){
a4 = 16;
a7 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if(((a28==17)&&((!(a7==1)&&((a25==1)&&((a1==1)&&((a26==18)&&(((a14==18)&&(input==6))&&(a4==16))))))&&!(a3==1)))){
a3 = 1;
a28 = 15;
a7 = 1;
a26 = 17;
return -1;
} else if(((a1==1)&&((a25==1)&&((((((a26==18)&&((input==5)&&(a28==17)))&&(a14==19))&&!(a7==1))&&!(a3==1))&&(a4==16))))){
a4 = 17;
a14 = 18;
a28 = 16;
a7 = 1;
return 23;
} else if(((a1==1)&&((a25==1)&&(((a3==1)&&((a28==15)&&((((a14==19)&&((a26==19)&&!(a7==1)))||((a14==20)&&((a26==17)&&(a7==1))))&&(input==5))))&&(a4==17))))){
a7 = 0;
a26 = 17;
a14 = 19;
a28 = 16;
return 24;
} else if(((a28==17)&&(((a25==1)&&(((((((a14==18)&&(!(a7==1)&&(a26==19)))||((a14==19)&&((a7==1)&&(a26==17))))||((a14==19)&&((a7==1)&&(a26==18))))&&(input==2))&&(a4==18))&&(a1==1)))&&!(a3==1)))){
a7 = 1;
a26 = 19;
a14 = 18;
return -1;
} else if(((a1==1)&&(((a7==1)&&((a28==15)&&((a14==20)&&((((a26==19)&&(input==2))&&(a3==1))&&(a4==17)))))&&(a25==1)))){
a26 = 17;
a14 = 18;
a4 = 16;
return -1;
} else if(((!(a3==1)&&((a4==17)&&(!(a7==1)&&(((((input==5)&&(a14==19))&&(a26==19))&&(a25==1))&&(a1==1)))))&&(a28==17))){
a28 = 15;
a4 = 16;
a7 = 1;
a26 = 17;
a14 = 18;
a3 = 1;
return -1;
} else if(((((a1==1)&&((((((input==2)&&(a28==17))&&!(a7==1))&&(a26==18))&&(a25==1))&&!(a3==1)))&&(a4==16))&&(a14==19))){
a3 = 1;
a7 = 1;
a28 = 15;
a26 = 17;
a14 = 18;
return -1;
} else if((((a4==18)&&(((a14==18)&&((a1==1)&&(!(a7==1)&&((a25==1)&&((a26==18)&&(input==2))))))&&(a3==1)))&&(a28==16))){
a28 = 15;
a7 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if(((((a25==1)&&((((a14==20)&&((input==4)&&(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))))&&(a28==16))&&!(a3==1)))&&(a1==1))&&(a4==16))){
a14 = 18;
a26 = 17;
a28 = 15;
a7 = 1;
a3 = 1;
return -1;
} else if(((a4==17)&&((!(a3==1)&&((a25==1)&&((a28==16)&&((((((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))||(!(a7==1)&&(a26==17)))&&(input==5))&&(a14==18)))))&&(a1==1)))){
a26 = 17;
a28 = 15;
a4 = 16;
a3 = 1;
a7 = 1;
return -1;
} else if(((a1==1)&&((a14==20)&&((a25==1)&&((!(a3==1)&&((a4==16)&&((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==4))))&&(a28==17)))))){
a26 = 18;
a4 = 17;
a28 = 16;
a14 = 19;
a7 = 1;
return 24;
} else if(((((((input==3)&&(((((a26==17)&&(a28==17))&&(a7==1))&&(a14==18))||(((a14==20)&&(!(a7==1)&&((a26==18)&&(a28==16))))||((((a28==16)&&(a26==19))&&!(a7==1))&&(a14==20)))))&&!(a3==1))&&(a4==16))&&(a25==1))&&(a1==1))){
a3 = 1;
a7 = 1;
a14 = 18;
a28 = 15;
a26 = 17;
return -1;
} else if((((((a25==1)&&((a1==1)&&((((((a7==1)&&(a26==18))||((a26==19)&&(a7==1)))||(!(a7==1)&&(a26==17)))&&(input==4))&&(a14==19))))&&(a28==16))&&(a4==18))&&(a3==1))){
a28 = 15;
a7 = 1;
a4 = 16;
a26 = 17;
a14 = 18;
return -1;
} else if((((a28==15)&&((a26==18)&&((((((input==1)&&(a4==17))&&(a1==1))&&(a7==1))&&(a14==19))&&(a25==1))))&&(a3==1))){
a14 = 20;
return 26;
} else if((!(a3==1)&&((((((((((a26==19)&&!(a7==1))&&(a14==19))||(((a7==1)&&(a26==17))&&(a14==20)))||(((a26==18)&&(a7==1))&&(a14==20)))&&(input==4))&&(a28==16))&&(a25==1))&&(a4==18))&&(a1==1)))){
a26 = 19;
a14 = 20;
a7 = 0;
return 26;
} else if(((a25==1)&&((a14==18)&&(((((a4==18)&&(((((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))||(!(a7==1)&&(a26==17)))&&(input==6)))&&(a28==16))&&(a3==1))&&(a1==1))))){
a7 = 1;
a4 = 16;
a28 = 15;
a26 = 17;
return -1;
} else if(((a25==1)&&((a4==16)&&(!(a3==1)&&(((((a14==20)&&(!(a7==1)&&((a26==19)&&(a28==15))))||((a14==18)&&(((a28==16)&&(a26==17))&&(a7==1))))&&(input==5))&&(a1==1)))))){
a26 = 17;
a14 = 18;
a28 = 15;
a7 = 1;
a3 = 1;
return -1;
} else if(((a28==15)&&((a4==17)&&((!(a3==1)&&((a14==18)&&((a1==1)&&(((input==3)&&((a26==18)||(a26==19)))&&(a7==1)))))&&(a25==1))))){
a4 = 16;
a26 = 18;
a28 = 17;
return -1;
} else if(((a14==18)&&((((((a4==16)&&((!(a3==1)&&(input==1))&&(a25==1)))&&(a28==17))&&(a1==1))&&!(a7==1))&&(a26==18)))){
a26 = 17;
a7 = 1;
a3 = 1;
a28 = 15;
return -1;
} else if((((((((a25==1)&&((a7==1)&&((input==6)&&(((a26==17)||(a26==18))||(a26==19)))))&&(a1==1))&&(a4==17))&&(a28==15))&&!(a3==1))&&(a14==20))){
a26 = 18;
a4 = 16;
a14 = 19;
a28 = 17;
return -1;
} else if((((a3==1)&&((a28==17)&&((a4==18)&&(((a25==1)&&((input==6)&&((!(a7==1)&&(a26==17))||(((a26==18)&&(a7==1))||((a7==1)&&(a26==19))))))&&(a14==20)))))&&(a1==1))){
a14 = 18;
a26 = 18;
a28 = 16;
a3 = 0;
a7 = 0;
a4 = 16;
return 24;
} else if(((a26==18)&&((a14==19)&&(((a4==17)&&((!(a3==1)&&((a1==1)&&((input==2)&&!(a7==1))))&&(a28==17)))&&(a25==1))))){
a3 = 1;
a4 = 16;
a14 = 18;
a26 = 17;
a7 = 1;
a28 = 15;
return -1;
} else if((((((a4==17)&&(((((!(a7==1)&&(a26==18))||(((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17))))&&(input==4))&&(a1==1))&&(a25==1)))&&(a3==1))&&(a28==15))&&(a14==19))){
a26 = 17;
a28 = 16;
a7 = 1;
a14 = 18;
return 22;
} else if(((((((a25==1)&&((a26==18)&&((a7==1)&&((input==1)&&(a14==20)))))&&(a3==1))&&(a1==1))&&(a4==17))&&(a28==15))){
a4 = 16;
a26 = 17;
a14 = 18;
return -1;
} else if(((a14==19)&&((a26==19)&&((a7==1)&&((((a3==1)&&(((a25==1)&&(input==6))&&(a4==18)))&&(a1==1))&&(a28==15)))))){
a14 = 18;
a26 = 17;
a4 = 16;
return -1;
} else if((((a4==17)&&(((a1==1)&&((((((!(a7==1)&&(a26==18))&&(a14==19))||(((a26==19)&&!(a7==1))&&(a14==19)))||((a14==20)&&((a26==17)&&(a7==1))))&&(input==4))&&(a3==1)))&&(a25==1)))&&(a28==16))){
a28 = 15;
a14 = 20;
a7 = 1;
a4 = 18;
a26 = 19;
return 26;
} else if(((a14==19)&&((a4==18)&&(!(a7==1)&&((a25==1)&&(((((a1==1)&&(input==2))&&(a28==16))&&(a26==18))&&!(a3==1))))))){
a14 = 18;
a7 = 1;
a4 = 16;
a28 = 17;
a3 = 1;
return -1;
} else if(((!(a3==1)&&(((a4==18)&&(((input==1)&&((((a26==19)&&!(a7==1))&&(a14==18))||(((a26==17)&&(a7==1))&&(a14==19))))&&(a28==16)))&&(a25==1)))&&(a1==1))){
a14 = 18;
a3 = 1;
a28 = 15;
a7 = 1;
a26 = 17;
a4 = 16;
return -1;
} else if(((a28==15)&&(((a25==1)&&(((((((a26==18)&&(a7==1))&&(a14==20))||((((a26==19)&&!(a7==1))&&(a14==19))||(((a7==1)&&(a26==17))&&(a14==20))))&&(input==6))&&(a4==18))&&(a1==1)))&&(a3==1)))){
a26 = 17;
a4 = 16;
a14 = 18;
a7 = 1;
return -1;
} else if(((!(a7==1)&&((a4==18)&&((a1==1)&&(((a26==18)&&(((input==1)&&(a14==19))&&(a28==17)))&&(a3==1)))))&&(a25==1))){
a14 = 18;
a7 = 1;
a4 = 16;
a28 = 15;
a26 = 17;
return -1;
} else if((((a4==18)&&(((((a1==1)&&((a25==1)&&((a14==18)&&(input==5))))&&(a3==1))&&!(a7==1))&&(a26==19)))&&(a28==16))){
a7 = 1;
a4 = 16;
a26 = 17;
a28 = 15;
return -1;
} else if(((a28==16)&&(((a25==1)&&(((a4==18)&&((((a14==20)&&((a7==1)&&(a26==18)))||((((a26==19)&&!(a7==1))&&(a14==19))||(((a7==1)&&(a26==17))&&(a14==20))))&&(input==2)))&&(a1==1)))&&!(a3==1)))){
a28 = 17;
a4 = 16;
a26 = 19;
a7 = 0;
a3 = 1;
a14 = 18;
return -1;
} else if(((a4==18)&&(!(a3==1)&&((((a25==1)&&((a28==16)&&((input==6)&&(((a26==18)&&!(a7==1))||(((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))))))&&(a1==1))&&(a14==18))))){
a3 = 1;
a4 = 16;
a26 = 17;
a28 = 15;
a7 = 1;
return -1;
} else if((!(a7==1)&&((a28==15)&&((((a25==1)&&(((a14==18)&&((((a26==17)||(a26==18))||(a26==19))&&(input==4)))&&(a1==1)))&&(a3==1))&&(a4==18))))){
a7 = 1;
a26 = 17;
a4 = 16;
return -1;
} else if(((a3==1)&&((a25==1)&&((a26==18)&&((a4==18)&&(((a7==1)&&(((a28==15)&&(input==3))&&(a14==19)))&&(a1==1))))))){
a14 = 18;
a4 = 16;
a26 = 17;
return -1;
} else if(((a1==1)&&(((((a28==16)&&((input==1)&&(((a14==20)&&((a26==17)&&(a7==1)))||(((!(a7==1)&&(a26==18))&&(a14==19))||(((a26==19)&&!(a7==1))&&(a14==19))))))&&(a4==17))&&(a25==1))&&(a3==1)))){
a14 = 18;
a28 = 15;
a26 = 17;
a7 = 1;
a4 = 16;
return -1;
} else if(((((a28==15)&&((a1==1)&&((a4==17)&&(((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))&&(input==1))&&(a14==19)))))&&!(a3==1))&&(a25==1))){
a7 = 1;
a26 = 17;
a3 = 1;
a4 = 16;
a14 = 18;
return -1;
} else if((((a14==19)&&(((((a1==1)&&((input==3)&&(((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))))&&(a3==1))&&(a28==17))&&(a4==17)))&&(a25==1))){
a7 = 1;
a28 = 15;
a14 = 18;
a4 = 16;
a26 = 17;
return -1;
} else if(((a28==17)&&(((a3==1)&&((a25==1)&&((a1==1)&&((input==6)&&(((a14==18)&&((a26==19)&&!(a7==1)))||((a14==19)&&((a26==17)&&(a7==1))))))))&&(a4==18)))){
a26 = 19;
a14 = 18;
a7 = 0;
return -1;
} else if((((a25==1)&&((a4==18)&&((a1==1)&&((input==4)&&((((a7==1)&&((a26==17)&&(a28==17)))&&(a14==18))||(((a14==20)&&(!(a7==1)&&((a28==16)&&(a26==18))))||((a14==20)&&(!(a7==1)&&((a26==19)&&(a28==16))))))))))&&(a3==1))){
a7 = 1;
a28 = 15;
a26 = 17;
a4 = 16;
a14 = 18;
return -1;
} else if(((a28==15)&&(((((((a4==16)&&((a14==18)&&(input==3)))&&(a25==1))&&(a7==1))&&!(a3==1))&&(a1==1))&&(a26==19)))){
a26 = 17;
a3 = 1;
return -1;
} else if((((((((a28==15)&&(((input==6)&&(a4==17))&&(a14==20)))&&(a7==1))&&(a26==19))&&(a3==1))&&(a25==1))&&(a1==1))){
a28 = 17;
a14 = 18;
return 23;
} else if(((a14==19)&&(((a1==1)&&(((!(a7==1)&&((a4==18)&&((input==1)&&(a28==16))))&&(a26==18))&&!(a3==1)))&&(a25==1)))){
a7 = 1;
a26 = 19;
a4 = 17;
a3 = 1;
a28 = 15;
a14 = 18;
return -1;
} else if(((a28==17)&&((((!(a3==1)&&((input==3)&&((((a14==18)&&(!(a7==1)&&(a26==19)))||((a14==19)&&((a7==1)&&(a26==17))))||((a14==19)&&((a26==18)&&(a7==1))))))&&(a25==1))&&(a4==17))&&(a1==1)))){
a14 = 18;
a28 = 15;
a7 = 1;
a26 = 17;
a4 = 16;
a3 = 1;
return -1;
} else if(((a28==16)&&(((a7==1)&&((a25==1)&&((a14==19)&&((a1==1)&&((((a26==17)||(a26==18))&&(input==5))&&(a4==16))))))&&!(a3==1)))){
a28 = 15;
a14 = 18;
a26 = 17;
a3 = 1;
return -1;
} else if(((a4==16)&&(((((a7==1)&&((a25==1)&&(((input==4)&&(a1==1))&&!(a3==1))))&&(a14==19))&&(a28==15))&&(a26==19)))){
a14 = 18;
a26 = 17;
a3 = 1;
return -1;
} else if(((a28==17)&&((a3==1)&&(((a4==17)&&((((((!(a7==1)&&(a26==18))&&(a14==18))||((a14==18)&&(!(a7==1)&&(a26==19))))||(((a7==1)&&(a26==17))&&(a14==19)))&&(input==2))&&(a25==1)))&&(a1==1))))){
a28 = 15;
a7 = 1;
a26 = 17;
a4 = 16;
a14 = 18;
return -1;
} else if((((a3==1)&&(((((((((a26==18)&&(a28==16))&&!(a7==1))&&(a14==20))||((!(a7==1)&&((a28==16)&&(a26==19)))&&(a14==20)))||((a14==18)&&((a7==1)&&((a26==17)&&(a28==17)))))&&(input==3))&&(a25==1))&&(a1==1)))&&(a4==18))){
a26 = 19;
a4 = 16;
a3 = 0;
a28 = 15;
a7 = 0;
a14 = 20;
return 22;
} else if(((a1==1)&&((a3==1)&&(((a28==16)&&((a25==1)&&((a14==20)&&((a4==17)&&(((a26==18)||(a26==19))&&(input==5))))))&&!(a7==1))))){
a4 = 16;
a26 = 17;
a14 = 18;
a7 = 1;
a28 = 15;
return -1;
} else if(((a4==18)&&(((a14==18)&&((a28==15)&&(!(a7==1)&&(((a25==1)&&((((a26==17)||(a26==18))||(a26==19))&&(input==2)))&&(a1==1)))))&&(a3==1)))){
a26 = 17;
a7 = 1;
a4 = 16;
return -1;
} else if((((a4==17)&&((a28==16)&&(((a3==1)&&(((((a26==17)&&(a7==1))&&(a14==20))||((((a26==18)&&!(a7==1))&&(a14==19))||(((a26==19)&&!(a7==1))&&(a14==19))))&&(input==3)))&&(a1==1))))&&(a25==1))){
a26 = 17;
a28 = 15;
a4 = 16;
a7 = 1;
a14 = 18;
return -1;
} else if(((a14==19)&&((!(a3==1)&&((((a1==1)&&((a7==1)&&((input==4)&&((a26==18)||(a26==19)))))&&(a28==17))&&(a25==1)))&&(a4==16)))){
a14 = 20;
a28 = 15;
a26 = 18;
a4 = 17;
return 23;
} else if(((((a1==1)&&(((a3==1)&&((a14==19)&&((a4==18)&&((a7==1)&&(input==4)))))&&(a28==15)))&&(a26==19))&&(a25==1))){
a26 = 17;
a4 = 16;
a14 = 18;
return -1;
} else if((((a1==1)&&(!(a3==1)&&((((a4==17)&&((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==4)))&&(a14==19))&&(a28==15))))&&(a25==1))){
a7 = 1;
a26 = 17;
a28 = 16;
a14 = 20;
return 24;
} else if((((a28==15)&&(((((a25==1)&&((((a26==18)||(a26==19))&&(input==5))&&(a4==18)))&&(a7==1))&&(a14==18))&&(a3==1)))&&(a1==1))){
a4 = 16;
a26 = 17;
return -1;
} else if(((a25==1)&&(((a28==15)&&(((a7==1)&&(!(a3==1)&&((((a26==18)||(a26==19))&&(input==2))&&(a4==17))))&&(a14==18)))&&(a1==1)))){
a26 = 19;
return 23;
} else if((((a14==19)&&(((!(a3==1)&&((((input==5)&&((a26==17)||(a26==18)))&&(a7==1))&&(a28==15)))&&(a4==16))&&(a25==1)))&&(a1==1))){
a28 = 17;
a14 = 18;
a26 = 17;
return 22;
} else if(((a25==1)&&(((a1==1)&&(!(a3==1)&&(((a4==17)&&((a28==16)&&(((a26==18)||(a26==19))&&(input==2))))&&(a14==18))))&&!(a7==1)))){
a4 = 16;
a28 = 15;
a3 = 1;
a7 = 1;
a26 = 17;
return -1;
} else if(((a14==20)&&((((a3==1)&&(((((input==1)&&(a25==1))&&(a28==16))&&(a1==1))&&(a7==1)))&&(a26==17))&&(a4==18)))){
a14 = 18;
a4 = 16;
a28 = 15;
return -1;
} else if(((a25==1)&&(((a14==18)&&(!(a3==1)&&((a4==17)&&((a28==16)&&(((((a7==1)&&(a26==18))||((a7==1)&&(a26==19)))||((a26==17)&&!(a7==1)))&&(input==3))))))&&(a1==1)))){
a4 = 16;
a3 = 1;
a7 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if((((a1==1)&&((((!(a7==1)&&((a25==1)&&((input==4)&&(a14==19))))&&(a4==17))&&!(a3==1))&&(a26==18)))&&(a28==15))){
a4 = 16;
a26 = 17;
a14 = 18;
a7 = 1;
a3 = 1;
return -1;
} else if(((((((a1==1)&&(((((a26==18)||(a26==19))&&(input==5))&&(a14==20))&&!(a3==1)))&&!(a7==1))&&(a28==15))&&(a25==1))&&(a4==18))){
a14 = 18;
a4 = 16;
a26 = 17;
a7 = 1;
a3 = 1;
return -1;
} else if((!(a7==1)&&(((a14==19)&&((a4==17)&&(((!(a3==1)&&((input==4)&&(a25==1)))&&(a28==17))&&(a26==18))))&&(a1==1)))){
a4 = 16;
a7 = 1;
a3 = 1;
a28 = 15;
a26 = 17;
a14 = 18;
return -1;
} else if(((a28==17)&&((a25==1)&&((((((input==3)&&((!(a7==1)&&(a26==18))||(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))))&&!(a3==1))&&(a1==1))&&(a4==17))&&(a14==18))))){
a7 = 1;
a4 = 16;
a26 = 17;
a3 = 1;
a28 = 15;
return -1;
} else if((((!(a7==1)&&((a28==16)&&((a14==18)&&(((a1==1)&&((input==1)&&((a26==18)||(a26==19))))&&!(a3==1)))))&&(a25==1))&&(a4==16))){
a7 = 1;
a26 = 17;
a28 = 15;
a3 = 1;
return -1;
} else if(((a25==1)&&((a1==1)&&(((((a7==1)&&((a28==15)&&(((a4==16)&&!(a3==1))&&(a26==18))))&&(a14==18))||(((a14==20)&&(!(a7==1)&&((((a3==1)&&(a4==18))&&(a26==19))&&(a28==17))))||(((a7==1)&&((((a4==16)&&!(a3==1))&&(a26==17))&&(a28==15)))&&(a14==18))))&&(input==3))))){
a28 = 15;
a7 = 1;
a14 = 18;
a3 = 1;
a26 = 17;
a4 = 16;
return -1;
} else if(((a25==1)&&((((a28==15)&&((a26==17)&&((a4==18)&&((a14==19)&&((a3==1)&&(input==1))))))&&(a1==1))&&(a7==1)))){
a4 = 16;
a14 = 18;
return -1;
} else if(((a1==1)&&((!(a7==1)&&(((a14==19)&&(((a3==1)&&((input==6)&&((a26==18)||(a26==19))))&&(a4==18)))&&(a28==16)))&&(a25==1)))){
a7 = 1;
a26 = 17;
a28 = 15;
a14 = 18;
a4 = 16;
return -1;
} else if(((((a1==1)&&((input==2)&&(((a14==20)&&(!(a7==1)&&((a28==17)&&((a4==17)&&(a26==19)))))||(((a7==1)&&(((a26==17)&&(a4==18))&&(a28==15)))&&(a14==18)))))&&(a3==1))&&(a25==1))){
a4 = 18;
a26 = 18;
a14 = 18;
a7 = 0;
a28 = 17;
return 22;
} else if(((a4==17)&&(!(a3==1)&&((((((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))&&(input==6))&&(a28==15))&&(a1==1))&&(a25==1))&&(a14==19))))){
a14 = 18;
a3 = 1;
a26 = 17;
a7 = 1;
a4 = 16;
return -1;
} else if(((((a4==16)&&((a25==1)&&((((a7==1)&&((a14==18)&&(input==4)))&&(a26==18))&&(a28==17))))&&(a1==1))&&!(a3==1))){
a3 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if(((((a28==17)&&((a1==1)&&(((input==4)&&((((a26==17)&&(a7==1))&&(a14==19))||(((a14==18)&&(!(a7==1)&&(a26==18)))||((a14==18)&&((a26==19)&&!(a7==1))))))&&(a25==1))))&&(a3==1))&&(a4==17))){
a28 = 15;
a7 = 1;
a26 = 17;
a4 = 16;
a14 = 18;
return -1;
} else if((((a25==1)&&((a1==1)&&((a4==17)&&((input==2)&&((((!(a7==1)&&((a28==15)&&(a26==18)))&&(a14==20))||((((a28==15)&&(a26==19))&&!(a7==1))&&(a14==20)))||(((a7==1)&&((a26==17)&&(a28==16)))&&(a14==18)))))))&&!(a3==1))){
a26 = 19;
a14 = 20;
a28 = 16;
a7 = 0;
return 24;
} else if(((a1==1)&&((((a25==1)&&((((((a7==1)&&(a26==17))&&(a14==19))||(((!(a7==1)&&(a26==18))&&(a14==18))||(((a26==19)&&!(a7==1))&&(a14==18))))&&(input==6))&&(a3==1)))&&(a28==16))&&(a4==17)))){
a26 = 17;
a28 = 15;
a4 = 16;
a14 = 18;
a7 = 1;
return -1;
} else if(((((!(a3==1)&&((a25==1)&&((a14==18)&&((input==3)&&((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))||((a26==18)&&!(a7==1)))))))&&(a28==17))&&(a1==1))&&(a4==18))){
a7 = 0;
a26 = 19;
return 24;
} else if((!(a3==1)&&((((a1==1)&&(((a7==1)&&((a28==16)&&((a14==20)&&(input==6))))&&(a4==17)))&&(a26==17))&&(a25==1)))){
a14 = 19;
a7 = 0;
a26 = 19;
a28 = 17;
return 24;
} else if(((((a25==1)&&(((((((a26==17)||(a26==18))&&(input==5))&&!(a3==1))&&(a4==18))&&(a14==18))&&(a28==17)))&&(a7==1))&&(a1==1))){
a26 = 18;
a3 = 1;
a7 = 0;
a4 = 16;
return -1;
} else if(((a28==16)&&(((!(a3==1)&&((a4==18)&&((((input==1)&&((a26==17)||(a26==18)))&&(a25==1))&&(a7==1))))&&(a14==18))&&(a1==1)))){
a28 = 15;
a3 = 1;
a26 = 17;
a4 = 16;
return -1;
} else if(((((((a3==1)&&((((((a26==19)&&!(a7==1))&&(a14==19))||((a14==20)&&((a26==17)&&(a7==1))))||(((a26==18)&&(a7==1))&&(a14==20)))&&(input==1)))&&(a25==1))&&(a1==1))&&(a28==15))&&(a4==18))){
a7 = 0;
a28 = 17;
a26 = 19;
a14 = 20;
return 21;
} else if((((a28==16)&&(!(a3==1)&&((a14==19)&&((a4==17)&&(!(a7==1)&&(((a26==19)&&(input==1))&&(a1==1)))))))&&(a25==1))){
a28 = 15;
a3 = 1;
a4 = 16;
a7 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if(((a1==1)&&((a3==1)&&((a25==1)&&((a4==18)&&((((a14==18)&&((a7==1)&&((a28==16)&&(a26==17))))||(((a14==20)&&(((a28==15)&&(a26==18))&&!(a7==1)))||((!(a7==1)&&((a28==15)&&(a26==19)))&&(a14==20))))&&(input==2))))))){
a7 = 1;
a4 = 16;
a14 = 18;
a28 = 15;
a26 = 17;
return -1;
} else if((((a3==1)&&(((a4==18)&&(((a1==1)&&((a14==18)&&((input==6)&&!(a7==1))))&&(a28==16)))&&(a26==19)))&&(a25==1))){
a4 = 16;
a28 = 15;
a7 = 1;
a26 = 17;
return -1;
} else if(((((((a25==1)&&((a26==18)&&(((a4==18)&&(input==4))&&(a28==16))))&&(a1==1))&&!(a7==1))&&(a14==19))&&!(a3==1))){
a4 = 16;
a14 = 18;
a3 = 1;
a7 = 1;
return -1;
} else if((((a1==1)&&((((((((a14==18)&&((a26==18)&&!(a7==1)))||((!(a7==1)&&(a26==19))&&(a14==18)))||((a14==19)&&((a26==17)&&(a7==1))))&&(input==1))&&(a4==17))&&(a28==17))&&(a25==1)))&&(a3==1))){
a4 = 16;
a7 = 1;
a28 = 15;
a26 = 17;
a14 = 18;
return -1;
} else if(((a4==16)&&((!(a3==1)&&(((((a1==1)&&((input==5)&&(a25==1)))&&!(a7==1))&&(a28==17))&&(a14==19)))&&(a26==17)))){
a14 = 18;
a7 = 1;
a3 = 1;
a28 = 15;
return -1;
} else if(((a4==16)&&((a25==1)&&(((a1==1)&&(((((input==3)&&((a26==17)||(a26==18)))&&!(a3==1))&&(a28==15))&&!(a7==1)))&&(a14==20))))){
a26 = 17;
a3 = 1;
a7 = 1;
a14 = 18;
return -1;
} else if((!(a3==1)&&((a1==1)&&((a25==1)&&(((((input==6)&&((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))||(!(a7==1)&&(a26==18))))&&(a4==17))&&(a28==17))&&(a14==18)))))){
a7 = 1;
a26 = 17;
a28 = 15;
a3 = 1;
a4 = 16;
return -1;
} else if(((a1==1)&&((a4==16)&&(!(a7==1)&&(((((a26==17)&&((a25==1)&&(input==1)))&&!(a3==1))&&(a14==18))&&(a28==17)))))){
a26 = 18;
a7 = 1;
return 21;
} else if(((((((a28==15)&&(((((a26==17)||(a26==18))&&(input==6))&&!(a3==1))&&!(a7==1)))&&(a1==1))&&(a14==19))&&(a25==1))&&(a4==16))){
a7 = 1;
a14 = 18;
a3 = 1;
a26 = 17;
return -1;
} else if(((a28==16)&&((a14==19)&&(((a7==1)&&(((((input==1)&&(a26==17))&&(a1==1))&&(a4==18))&&(a3==1)))&&(a25==1))))){
a4 = 16;
a28 = 15;
a14 = 18;
return -1;
} else if((((((a4==17)&&((a28==16)&&(((input==2)&&(((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))))&&(a25==1))))&&(a1==1))&&(a14==20))&&(a3==1))){
a7 = 0;
a26 = 17;
a4 = 18;
a28 = 15;
return 22;
} else if(((((a4==18)&&((a25==1)&&((a1==1)&&((((a14==18)&&((a26==19)&&!(a7==1)))||((a14==19)&&((a7==1)&&(a26==17))))&&(input==1)))))&&(a3==1))&&(a28==17))){
a14 = 20;
a28 = 16;
a7 = 1;
a26 = 17;
return -1;
} else if(((a25==1)&&((((a14==18)&&((!(a3==1)&&((input==6)&&((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))||((a26==18)&&!(a7==1)))))&&(a1==1)))&&(a4==18))&&(a28==17)))){
a4 = 16;
a26 = 18;
a7 = 1;
return 24;
} else if((((a4==17)&&(((a28==15)&&(((a1==1)&&((((a26==17)||(a26==18))&&(input==4))&&(a14==18)))&&(a25==1)))&&!(a7==1)))&&!(a3==1))){
a26 = 18;
return -1;
} else if(((a25==1)&&(((a1==1)&&((((((input==3)&&((a26==17)||(a26==18)))&&!(a7==1))&&(a28==15))&&!(a3==1))&&(a4==16)))&&(a14==19)))){
a14 = 18;
a26 = 17;
a7 = 1;
a3 = 1;
return -1;
} else if((((a4==16)&&((a1==1)&&(((((((!(a7==1)&&(a26==19))&&(a14==19))||(((a7==1)&&(a26==17))&&(a14==20)))||(((a7==1)&&(a26==18))&&(a14==20)))&&(input==4))&&(a28==17))&&!(a3==1))))&&(a25==1))){
a26 = 17;
a14 = 18;
a3 = 1;
a7 = 1;
a28 = 15;
return -1;
} else if(((a28==15)&&((a4==17)&&((a14==20)&&((a1==1)&&(((((((a26==17)||(a26==18))||(a26==19))&&(input==1))&&!(a3==1))&&(a7==1))&&(a25==1))))))){
a4 = 16;
a26 = 17;
a14 = 18;
a3 = 1;
return -1;
} else if(((!(a7==1)&&(((((a4==18)&&((a1==1)&&((a3==1)&&(input==6))))&&(a14==18))&&(a26==18))&&(a28==16)))&&(a25==1))){
a26 = 17;
a4 = 16;
a7 = 1;
a28 = 15;
return -1;
} else if((!(a7==1)&&(((!(a3==1)&&((((a14==18)&&((input==6)&&(a4==18)))&&(a25==1))&&(a28==15)))&&(a1==1))&&(a26==18)))){
a7 = 1;
a26 = 17;
a3 = 1;
a4 = 16;
return -1;
} else if(((((a14==19)&&(((((a1==1)&&((input==3)&&((a26==18)||(a26==19))))&&(a25==1))&&(a4==18))&&(a28==15)))&&!(a3==1))&&!(a7==1))){
a4 = 16;
a3 = 1;
a26 = 17;
a14 = 18;
a7 = 1;
return -1;
} else if(((((((a7==1)&&((a4==17)&&((a25==1)&&(((a26==19)||((a26==17)||(a26==18)))&&(input==2)))))&&!(a3==1))&&(a1==1))&&(a28==17))&&(a14==20))){
a4 = 16;
a26 = 17;
a14 = 18;
a28 = 15;
a3 = 1;
return -1;
} else if(((a4==16)&&((a28==15)&&(((a1==1)&&(((((input==2)&&((a26==17)||(a26==18)))&&!(a7==1))&&(a14==20))&&!(a3==1)))&&(a25==1))))){
a26 = 17;
a14 = 18;
a7 = 1;
a3 = 1;
return -1;
} else if((((((a1==1)&&((((((a26==19)&&!(a7==1))&&(a14==18))||(((a7==1)&&(a26==17))&&(a14==19)))&&(input==2))&&(a28==17)))&&(a25==1))&&(a4==16))&&!(a3==1))){
a7 = 1;
a14 = 18;
a28 = 15;
a26 = 17;
a3 = 1;
return -1;
} else if((((((a3==1)&&((input==1)&&((((a7==1)&&((a28==17)&&(a26==17)))&&(a14==18))||(((((a28==16)&&(a26==18))&&!(a7==1))&&(a14==20))||((!(a7==1)&&((a28==16)&&(a26==19)))&&(a14==20))))))&&(a25==1))&&(a1==1))&&(a4==18))){
a28 = 15;
a4 = 16;
a14 = 18;
a7 = 1;
a26 = 17;
return -1;
} else if(((a1==1)&&((a26==17)&&(!(a7==1)&&(((((a3==1)&&((a25==1)&&(input==2)))&&(a4==18))&&(a28==15))&&(a14==20)))))){
a14 = 18;
a7 = 1;
a4 = 16;
return -1;
} else if(((a26==18)&&(!(a3==1)&&((a14==19)&&(((a25==1)&&((a7==1)&&(((input==6)&&(a28==16))&&(a4==18))))&&(a1==1)))))){
a3 = 1;
a26 = 17;
a4 = 16;
a28 = 15;
a14 = 18;
return -1;
} else if(((((a4==16)&&(((!(a3==1)&&((input==5)&&(((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))))&&(a28==16))&&(a1==1)))&&(a25==1))&&(a14==20))){
a28 = 15;
a3 = 1;
a7 = 1;
a14 = 18;
a26 = 17;
return -1;
} else if((((((a25==1)&&(((a1==1)&&((input==5)&&(((a26==17)&&!(a7==1))||(((a7==1)&&(a26==18))||((a26==19)&&(a7==1))))))&&(a4==18)))&&(a3==1))&&(a14==18))&&(a28==16))){
a4 = 16;
a26 = 17;
a28 = 15;
a7 = 1;
return -1;
} else if((((a4==18)&&((((a25==1)&&((a26==17)&&(((input==3)&&(a28==16))&&(a14==20))))&&(a7==1))&&(a1==1)))&&(a3==1))){
a4 = 16;
a28 = 15;
a14 = 18;
return -1;
} else if((((a25==1)&&(((a14==18)&&(!(a3==1)&&(((input==4)&&(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1))))&&(a28==15))))&&(a1==1)))&&(a4==18))){
a26 = 18;
a7 = 1;
a14 = 19;
return 22;
} else if((((((a1==1)&&((a4==18)&&((a14==19)&&((a3==1)&&((a26==17)&&(input==4))))))&&(a28==15))&&(a25==1))&&(a7==1))){
a14 = 18;
a4 = 16;
return -1;
} else if(((a25==1)&&((((a28==17)&&(((a1==1)&&((input==5)&&((((a7==1)&&(a26==18))||((a26==19)&&(a7==1)))||((a26==17)&&!(a7==1)))))&&(a4==17)))&&(a14==19))&&(a3==1)))){
a14 = 18;
a28 = 15;
a26 = 17;
a7 = 1;
a4 = 16;
return -1;
} else if(((a1==1)&&((a25==1)&&((a4==16)&&((a28==17)&&((!(a7==1)&&((a14==19)&&(!(a3==1)&&(input==1))))&&(a26==17))))))){
a26 = 19;
a28 = 15;
a14 = 20;
a4 = 17;
return 24;
} else if(((a25==1)&&((((a1==1)&&((((a14==18)&&(((a28==16)&&(a26==17))&&(a7==1)))||(((((a26==18)&&(a28==15))&&!(a7==1))&&(a14==20))||((!(a7==1)&&((a26==19)&&(a28==15)))&&(a14==20))))&&(input==5)))&&(a3==1))&&(a4==18)))){
a4 = 16;
a14 = 18;
a28 = 15;
a26 = 17;
a7 = 1;
return -1;
} else if(((a26==18)&&((a7==1)&&((((((a28==17)&&((a3==1)&&(input==3)))&&(a25==1))&&(a1==1))&&(a4==17))&&(a14==20))))){
a4 = 18;
a28 = 16;
return 26;
} else if(((a26==17)&&((a1==1)&&(((a28==15)&&((a3==1)&&((a14==20)&&(((input==4)&&(a25==1))&&(a4==18)))))&&!(a7==1))))){
a3 = 0;
a14 = 18;
a4 = 16;
return 26;
} else if((!(a3==1)&&((a4==18)&&(((a28==17)&&((a25==1)&&(((((a7==1)&&(a26==18))&&(a14==19))||(((a14==18)&&((a26==19)&&!(a7==1)))||(((a26==17)&&(a7==1))&&(a14==19))))&&(input==5))))&&(a1==1))))){
a3 = 1;
a4 = 16;
a7 = 1;
a14 = 20;
a26 = 18;
a28 = 15;
return -1;
} else if(((a26==19)&&(((a25==1)&&(!(a3==1)&&((a28==15)&&((a1==1)&&(((input==1)&&(a7==1))&&(a4==16))))))&&(a14==20)))){
a14 = 19;
a28 = 17;
a26 = 18;
return 24;
} else if(((((((((a14==20)&&(((a28==15)&&(a26==19))&&!(a7==1)))||((((a28==16)&&(a26==17))&&(a7==1))&&(a14==18)))&&(input==6))&&(a4==16))&&(a25==1))&&(a1==1))&&!(a3==1))){
a7 = 1;
a3 = 1;
a26 = 17;
a28 = 15;
a14 = 18;
return -1;
} else if((((a7==1)&&(((a25==1)&&(((a28==15)&&((a4==16)&&(((a26==17)||(a26==18))&&(input==2))))&&(a1==1)))&&!(a3==1)))&&(a14==20))){
a26 = 17;
a3 = 1;
a14 = 18;
return -1;
} else if((!(a3==1)&&((((a28==16)&&((a4==16)&&(((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==2))&&(a1==1))))&&(a25==1))&&(a14==18)))){
a28 = 15;
a3 = 1;
a26 = 17;
a7 = 1;
return -1;
} else if(((((a4==17)&&((a25==1)&&((a26==18)&&(((a14==20)&&((input==3)&&(a1==1)))&&(a7==1)))))&&(a3==1))&&(a28==15))){
a4 = 16;
a26 = 17;
a14 = 18;
return -1;
} else if((!(a3==1)&&((!(a7==1)&&((a1==1)&&(((a25==1)&&(((input==2)&&((a26==17)||(a26==18)))&&(a4==17)))&&(a14==18))))&&(a28==15)))){
a7 = 1;
a28 = 17;
a4 = 16;
a26 = 18;
return -1;
} else if(((a25==1)&&((((a28==15)&&(((a4==18)&&(!(a3==1)&&((input==1)&&((a26==18)||(a26==19)))))&&(a1==1)))&&(a14==20))&&!(a7==1)))){
a26 = 17;
a3 = 1;
a14 = 18;
a7 = 1;
a4 = 16;
return -1;
} else if(((a4==17)&&(((a3==1)&&((a1==1)&&((a25==1)&&((input==1)&&((((a7==1)&&(a26==17))&&(a14==19))||((((a26==18)&&!(a7==1))&&(a14==18))||(((a26==19)&&!(a7==1))&&(a14==18))))))))&&(a28==16)))){
a28 = 15;
a26 = 17;
a4 = 16;
a7 = 1;
a14 = 18;
return -1;
} else if(((!(a3==1)&&((a14==18)&&(((a1==1)&&(((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==2))&&(a28==15)))&&(a25==1))))&&(a4==18))){
a4 = 16;
a7 = 1;
a3 = 1;
a26 = 17;
return -1;
} else if(((a4==17)&&((a14==19)&&(((a1==1)&&(((a28==16)&&(!(a3==1)&&((input==2)&&((a26==17)||(a26==18)))))&&(a25==1)))&&!(a7==1))))){
a26 = 18;
a28 = 17;
a4 = 16;
a7 = 1;
return 26;
} else if(((a14==20)&&((a1==1)&&((a25==1)&&(((((a4==17)&&((a28==15)&&(input==3)))&&(a26==19))&&(a3==1))&&(a7==1)))))){
a7 = 0;
a28 = 17;
a26 = 18;
a14 = 18;
return 24;
} else if((((a25==1)&&(((a1==1)&&((a4==16)&&(((input==4)&&(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1))))&&(a28==16))))&&!(a3==1)))&&(a14==18))){
a7 = 1;
a3 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if(((a25==1)&&((a28==17)&&((a1==1)&&((a7==1)&&((a14==18)&&((((input==1)&&!(a3==1))&&(a26==19))&&(a4==16)))))))){
a26 = 18;
return -1;
} else if(((a3==1)&&(((a25==1)&&(((((((a4==17)&&(a26==19))&&(a28==17))&&!(a7==1))&&(a14==20))||((a14==18)&&(((a28==15)&&((a4==18)&&(a26==17)))&&(a7==1))))&&(input==1)))&&(a1==1)))){
a7 = 1;
a26 = 17;
a14 = 18;
a28 = 15;
a4 = 16;
return -1;
} else if((((a1==1)&&(((((((!(a7==1)&&(a26==19))&&(a14==18))||((a14==19)&&((a7==1)&&(a26==17))))&&(input==6))&&(a4==16))&&(a25==1))&&(a28==17)))&&!(a3==1))){
a14 = 18;
a3 = 1;
a7 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if((((a28==16)&&(!(a3==1)&&((a4==18)&&((((input==1)&&(((a26==19)&&(a7==1))||((a26==17)&&!(a7==1))))&&(a14==19))&&(a25==1)))))&&(a1==1))){
a7 = 0;
a28 = 15;
a14 = 18;
a4 = 17;
a26 = 18;
return 21;
} else if((((a28==15)&&((((!(a3==1)&&((a25==1)&&(((a26==18)||(a26==19))&&(input==2))))&&(a1==1))&&!(a7==1))&&(a14==20)))&&(a4==18))){
a7 = 1;
a4 = 16;
a3 = 1;
a14 = 18;
a26 = 17;
return -1;
} else if((((a7==1)&&(((a1==1)&&(!(a3==1)&&((((input==1)&&(a26==18))&&(a25==1))&&(a28==15))))&&(a4==18)))&&(a14==19))){
a14 = 20;
a7 = 0;
a4 = 16;
return 26;
} else if((((a14==19)&&(((!(a7==1)&&(((a1==1)&&(((a26==18)||(a26==19))&&(input==1)))&&(a3==1)))&&(a28==16))&&(a4==18)))&&(a25==1))){
a14 = 18;
a4 = 16;
a7 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if((((a4==17)&&((a28==17)&&(!(a3==1)&&((((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==6))&&(a14==19))&&(a1==1)))))&&(a25==1))){
a14 = 18;
a7 = 1;
a3 = 1;
a26 = 17;
a28 = 15;
a4 = 16;
return -1;
} else if(((a28==16)&&(((a4==17)&&((((((((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))||(!(a7==1)&&(a26==17)))&&(input==6))&&(a14==20))&&(a1==1))&&!(a3==1)))&&(a25==1)))){
a14 = 19;
a26 = 18;
a7 = 0;
return 26;
} else if((((((a25==1)&&(((((input==3)&&(a1==1))&&(a7==1))&&(a4==16))&&(a14==18)))&&(a28==17))&&(a26==19))&&!(a3==1))){
a28 = 15;
a3 = 1;
a26 = 17;
return -1;
} else if((((a1==1)&&(((((a28==15)&&((a14==20)&&((((a26==17)||(a26==18))||(a26==19))&&(input==3))))&&!(a3==1))&&(a4==18))&&(a25==1)))&&(a7==1))){
a26 = 18;
a7 = 0;
return 26;
} else if((((a28==16)&&(!(a7==1)&&(((a14==20)&&((a1==1)&&((a4==17)&&(((a26==18)||(a26==19))&&(input==3)))))&&!(a3==1))))&&(a25==1))){
a26 = 17;
a28 = 15;
return -1;
} else if(((a28==17)&&((a7==1)&&(((a25==1)&&(!(a3==1)&&(((a14==20)&&((input==3)&&(((a26==17)||(a26==18))||(a26==19))))&&(a1==1))))&&(a4==17))))){
a14 = 18;
a3 = 1;
a26 = 17;
a4 = 16;
a28 = 15;
return -1;
} else if((((a4==18)&&((a14==20)&&((a3==1)&&((a1==1)&&((a28==17)&&(((input==2)&&(a26==18))&&!(a7==1)))))))&&(a25==1))){
a14 = 18;
a7 = 1;
a28 = 15;
a4 = 16;
a26 = 17;
return -1;
} else if(((a26==19)&&(((a7==1)&&(!(a3==1)&&((a4==16)&&(((a1==1)&&((a25==1)&&(input==1)))&&(a14==19)))))&&(a28==15)))){
a14 = 18;
a26 = 18;
a28 = 17;
return 22;
} else if((((a25==1)&&(((((a14==20)&&(((a28==17)&&((a26==19)&&((a4==18)&&(a3==1))))&&!(a7==1)))||((a14==18)&&((a7==1)&&((a28==15)&&((a26==17)&&((a4==16)&&!(a3==1)))))))||((a14==18)&&(((a28==15)&&((a26==18)&&(!(a3==1)&&(a4==16))))&&(a7==1))))&&(input==5)))&&(a1==1))){
a4 = 16;
a28 = 15;
a14 = 18;
a3 = 1;
a7 = 1;
a26 = 17;
return -1;
} else if(((((a7==1)&&((a4==17)&&(((a28==17)&&((a25==1)&&(((a26==17)||(a26==18))&&(input==2))))&&(a3==1))))&&(a1==1))&&(a14==18))){
a4 = 16;
a28 = 15;
a26 = 17;
return -1;
} else if(((a28==16)&&((((a25==1)&&(((a7==1)&&(((a26==18)&&(input==4))&&!(a3==1)))&&(a14==19)))&&(a1==1))&&(a4==18)))){
a28 = 15;
a4 = 16;
a14 = 18;
a26 = 17;
a3 = 1;
return -1;
} else if((((a4==18)&&((((((a26==17)&&((input==2)&&(a3==1)))&&(a28==15))&&(a14==19))&&(a7==1))&&(a25==1)))&&(a1==1))){
a4 = 16;
a14 = 18;
return -1;
} else if((((a1==1)&&((a25==1)&&((input==1)&&((((a14==20)&&(!(a7==1)&&((a28==17)&&((a4==16)&&(a26==18)))))||((a14==20)&&(((a28==17)&&((a26==19)&&(a4==16)))&&!(a7==1))))||((a14==18)&&((a7==1)&&((a28==15)&&((a26==17)&&(a4==17)))))))))&&!(a3==1))){
a7 = 1;
a14 = 18;
a4 = 16;
a26 = 18;
a28 = 17;
return -1;
} else if(((a1==1)&&((a3==1)&&(((a26==18)&&((a4==18)&&(((a25==1)&&((input==4)&&(a28==17)))&&!(a7==1))))&&(a14==18))))){
a28 = 15;
a26 = 17;
a4 = 16;
a7 = 1;
return -1;
} else if(((a26==18)&&((a25==1)&&((((a1==1)&&(!(a3==1)&&(((input==1)&&(a14==19))&&(a28==15))))&&!(a7==1))&&(a4==17))))){
a14 = 18;
return 21;
} else if(((a4==17)&&(((((!(a3==1)&&((a1==1)&&(((a26==17)||(a26==18))&&(input==3))))&&(a28==15))&&(a14==18))&&!(a7==1))&&(a25==1)))){
a7 = 1;
a26 = 18;
a28 = 17;
a4 = 16;
return 26;
} else if(((a4==17)&&(((a14==20)&&(((a28==15)&&((a7==1)&&((a25==1)&&((input==2)&&((a26==19)||((a26==17)||(a26==18)))))))&&!(a3==1)))&&(a1==1)))){
a26 = 18;
a14 = 19;
a4 = 16;
a28 = 17;
return -1;
} else if(((a26==18)&&((((a14==18)&&(((((a4==16)&&(input==4))&&(a7==1))&&!(a3==1))&&(a25==1)))&&(a1==1))&&(a28==16)))){
a28 = 15;
a3 = 1;
a26 = 17;
return -1;
} else if(((!(a3==1)&&((a25==1)&&((a14==19)&&((a4==16)&&(((a28==17)&&((input==1)&&(a26==18)))&&(a1==1))))))&&!(a7==1))){
a14 = 18;
a26 = 17;
a28 = 15;
a3 = 1;
a7 = 1;
return -1;
} else if((((a25==1)&&((a4==18)&&(((((((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a7==1)&&(a26==19))))&&(input==2))&&(a28==16))&&(a1==1))&&(a14==19))))&&(a3==1))){
a4 = 16;
a14 = 18;
a26 = 17;
a7 = 1;
a28 = 15;
return -1;
} else if(((((((a14==19)&&(!(a3==1)&&((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))&&(input==3))))&&(a25==1))&&(a28==16))&&(a1==1))&&(a4==18))){
a26 = 17;
a7 = 1;
a4 = 16;
a28 = 17;
a3 = 1;
a14 = 18;
return -1;
} else if(((a14==19)&&(((a3==1)&&((a25==1)&&(((a28==17)&&((input==2)&&((!(a7==1)&&(a26==17))||(((a26==18)&&(a7==1))||((a7==1)&&(a26==19))))))&&(a4==18))))&&(a1==1)))){
a14 = 20;
a28 = 16;
a7 = 1;
a26 = 17;
return -1;
} else if((((a28==16)&&((!(a3==1)&&(((((a26==18)&&(input==3))&&(a4==18))&&(a14==19))&&!(a7==1)))&&(a1==1)))&&(a25==1))){
a3 = 1;
a28 = 15;
a14 = 20;
a7 = 1;
a26 = 19;
a4 = 16;
return -1;
} else if(((!(a7==1)&&((((a25==1)&&((a1==1)&&((((a26==18)||(a26==19))&&(input==1))&&(a4==18))))&&(a28==16))&&!(a3==1)))&&(a14==20))){
a26 = 18;
a14 = 18;
a28 = 15;
a4 = 17;
return 23;
} else if(((a25==1)&&((a4==16)&&((a26==19)&&((a1==1)&&((((a28==15)&&((input==5)&&!(a3==1)))&&(a14==19))&&!(a7==1))))))){
a14 = 18;
a7 = 1;
a3 = 1;
a26 = 17;
return -1;
} else if((((a1==1)&&(!(a3==1)&&((((input==3)&&(((((a26==19)&&!(a7==1))&&(a14==18))||((a14==19)&&((a26==17)&&(a7==1))))||((a14==19)&&((a26==18)&&(a7==1)))))&&(a28==15))&&(a4==17))))&&(a25==1))){
a26 = 17;
a3 = 1;
a4 = 16;
a14 = 18;
a7 = 1;
return -1;
} else if(((a4==18)&&((a14==20)&&(((((a1==1)&&(!(a7==1)&&((a28==15)&&(input==5))))&&(a26==17))&&(a25==1))&&!(a3==1))))){
a14 = 18;
a7 = 1;
a4 = 16;
a3 = 1;
return -1;
} else if((((a25==1)&&(!(a3==1)&&((input==5)&&(((a14==18)&&((a7==1)&&((a28==15)&&((a4==17)&&(a26==17)))))||(((!(a7==1)&&(((a4==16)&&(a26==18))&&(a28==17)))&&(a14==20))||((!(a7==1)&&((a28==17)&&((a4==16)&&(a26==19))))&&(a14==20)))))))&&(a1==1))){
a7 = 1;
a4 = 16;
a26 = 17;
a3 = 1;
a28 = 15;
a14 = 18;
return -1;
} else if(((a7==1)&&((a4==18)&&((((a25==1)&&((a28==16)&&((a14==20)&&((input==4)&&(a3==1)))))&&(a26==17))&&(a1==1))))){
return -1;
} else if(((((a25==1)&&((a4==16)&&(((((a14==20)&&(((a26==18)&&(a28==16))&&!(a7==1)))||((((a26==19)&&(a28==16))&&!(a7==1))&&(a14==20)))||((a14==18)&&((a7==1)&&((a28==17)&&(a26==17)))))&&(input==4))))&&(a1==1))&&!(a3==1))){
a7 = 1;
a28 = 15;
a14 = 18;
a26 = 17;
a3 = 1;
return -1;
} else if((((a4==17)&&((((input==3)&&((((a14==20)&&(((a26==18)&&(a28==15))&&!(a7==1)))||((!(a7==1)&&((a26==19)&&(a28==15)))&&(a14==20)))||((a14==18)&&((a7==1)&&((a26==17)&&(a28==16))))))&&(a3==1))&&(a25==1)))&&(a1==1))){
a14 = 18;
a28 = 15;
a26 = 17;
a4 = 16;
a7 = 1;
return -1;
} else if(((((((a14==18)&&((a7==1)&&((a26==18)&&((input==5)&&(a1==1)))))&&!(a3==1))&&(a28==17))&&(a25==1))&&(a4==16))){
a26 = 17;
a3 = 1;
a28 = 15;
return -1;
} else if(((a4==18)&&(((a25==1)&&((((a3==1)&&(!(a7==1)&&(((a26==17)||(a26==18))&&(input==6))))&&(a1==1))&&(a28==15)))&&(a14==19)))){
a7 = 1;
a26 = 17;
a14 = 18;
a4 = 16;
return -1;
} else if((((a25==1)&&(!(a3==1)&&(((a1==1)&&((a28==17)&&((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))&&(input==1))))&&(a4==17))))&&(a14==19))){
a28 = 15;
a4 = 16;
a3 = 1;
a7 = 1;
a14 = 18;
a26 = 17;
return -1;
} else if(((((((a28==15)&&((((input==2)&&!(a3==1))&&(a4==18))&&(a1==1)))&&!(a7==1))&&(a14==20))&&(a26==17))&&(a25==1))){
a7 = 1;
a4 = 16;
a14 = 18;
a3 = 1;
return -1;
} else if((((((a1==1)&&((a4==17)&&(!(a7==1)&&(((input==3)&&(a14==19))&&(a25==1)))))&&(a26==19))&&!(a3==1))&&(a28==17))){
a7 = 1;
a26 = 17;
a28 = 15;
a14 = 18;
a4 = 16;
a3 = 1;
return -1;
} else if(((a25==1)&&(((a3==1)&&((a7==1)&&(((a14==18)&&((((a26==18)||(a26==19))&&(input==3))&&(a28==15)))&&(a4==18))))&&(a1==1)))){
a26 = 17;
a4 = 16;
return -1;
} else if(((a1==1)&&((a4==18)&&((a28==16)&&((a14==20)&&(((a25==1)&&(((((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))||((a26==17)&&!(a7==1)))&&(input==5)))&&(a3==1))))))){
a4 = 16;
a26 = 17;
a28 = 15;
a14 = 18;
a7 = 1;
return -1;
} else if(((((a1==1)&&((a3==1)&&((((input==4)&&((!(a7==1)&&(a26==17))||(((a7==1)&&(a26==18))||((a26==19)&&(a7==1)))))&&(a4==18))&&(a25==1))))&&(a28==16))&&(a14==20))){
a4 = 16;
a28 = 15;
a14 = 18;
a26 = 17;
a7 = 1;
return -1;
} else if(((a25==1)&&((a1==1)&&((((a3==1)&&((a14==18)&&((((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))&&(input==1))))&&(a28==17))&&(a4==18))))){
a4 = 16;
a7 = 1;
a26 = 17;
a28 = 15;
return -1;
} else if((((a4==17)&&(((a14==19)&&((a3==1)&&((a1==1)&&((input==5)&&((!(a7==1)&&(a26==18))||(((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17))))))))&&(a25==1)))&&(a28==15))){
a7 = 0;
a28 = 16;
a14 = 18;
a26 = 17;
return 23;
} else if((((((((!(a7==1)&&(((a26==19)||((a26==17)||(a26==18)))&&(input==3)))&&(a25==1))&&(a14==20))&&(a4==17))&&(a28==17))&&!(a3==1))&&(a1==1))){
a3 = 1;
a14 = 18;
a26 = 17;
a4 = 16;
a7 = 1;
a28 = 15;
return -1;
} else if(((a26==17)&&((a3==1)&&((((a14==20)&&((a1==1)&&(((input==6)&&!(a7==1))&&(a28==15))))&&(a25==1))&&(a4==17))))){
a14 = 18;
a4 = 16;
a7 = 1;
return -1;
} else if(((a4==17)&&(((((a1==1)&&((a14==20)&&(((input==3)&&((a26==18)||(a26==19)))&&(a25==1))))&&!(a7==1))&&(a28==16))&&(a3==1)))){
a7 = 1;
a14 = 18;
a26 = 17;
a4 = 16;
a28 = 15;
return -1;
} else if(((a14==19)&&((!(a3==1)&&(((((input==6)&&((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))||((a26==18)&&!(a7==1))))&&(a25==1))&&(a28==16))&&(a4==16)))&&(a1==1)))){
a3 = 1;
a28 = 15;
a7 = 1;
a14 = 18;
a26 = 17;
return -1;
} else if(((!(a3==1)&&((a1==1)&&((a4==16)&&((((((a7==1)&&(a26==18))&&(a14==20))||(((!(a7==1)&&(a26==19))&&(a14==19))||(((a26==17)&&(a7==1))&&(a14==20))))&&(input==1))&&(a28==17)))))&&(a25==1))){
a14 = 18;
a26 = 17;
a7 = 1;
a28 = 15;
a3 = 1;
return -1;
} else if(((((a25==1)&&((((a14==20)&&((a7==1)&&((input==5)&&(((a26==17)||(a26==18))||(a26==19)))))&&(a1==1))&&(a28==15)))&&!(a3==1))&&(a4==17))){
a3 = 1;
a14 = 18;
a26 = 17;
a4 = 16;
return -1;
} else if((((a4==17)&&((a1==1)&&(((input==2)&&((((!(a7==1)&&((a28==15)&&(a26==18)))&&(a14==20))||((a14==20)&&(!(a7==1)&&((a26==19)&&(a28==15)))))||((((a26==17)&&(a28==16))&&(a7==1))&&(a14==18))))&&(a25==1))))&&(a3==1))){
a4 = 18;
a14 = 18;
a28 = 15;
a26 = 19;
a7 = 1;
return 24;
} else if((((((((!(a7==1)&&((a28==17)&&(((a4==18)&&(a3==1))&&(a26==19))))&&(a14==20))||((a14==18)&&((a7==1)&&((a28==15)&&((a26==17)&&(!(a3==1)&&(a4==16)))))))||((((a28==15)&&(((a4==16)&&!(a3==1))&&(a26==18)))&&(a7==1))&&(a14==18)))&&(input==4))&&(a1==1))&&(a25==1))){
a14 = 18;
a4 = 16;
a26 = 17;
a3 = 1;
a7 = 1;
a28 = 15;
return -1;
} else if((((((a3==1)&&((((((a26==17)||(a26==18))&&(input==4))&&(a28==17))&&(a25==1))&&(a1==1)))&&(a4==17))&&(a14==18))&&(a7==1))){
a4 = 18;
a28 = 16;
a7 = 0;
a26 = 18;
return 22;
} else if((((a28==15)&&((a25==1)&&((((input==5)&&(((a14==18)&&((a26==19)&&!(a7==1)))||((a14==19)&&((a26==17)&&(a7==1)))))&&!(a3==1))&&(a1==1))))&&(a4==18))){
a3 = 1;
a14 = 18;
a7 = 1;
a26 = 17;
a4 = 16;
return -1;
} return calculate_output3(input);
}
int calculate_output3(int input) {
if((!(a3==1)&&((((a14==18)&&((a7==1)&&(((a4==17)&&(((a26==17)||(a26==18))&&(input==1)))&&(a28==17))))&&(a1==1))&&(a25==1)))){
a28 = 15;
a26 = 17;
a3 = 1;
a4 = 16;
return -1;
} else if(((a7==1)&&((a1==1)&&(((a14==20)&&((((a28==17)&&(((a26==19)||((a26==17)||(a26==18)))&&(input==1)))&&!(a3==1))&&(a25==1)))&&(a4==17))))){
a7 = 0;
a26 = 17;
a28 = 15;
a4 = 18;
a14 = 18;
return 21;
} else if((((((((a14==20)&&((a4==18)&&((a25==1)&&(input==3))))&&(a3==1))&&(a7==1))&&(a1==1))&&(a28==15))&&(a26==19))){
a4 = 16;
a26 = 17;
a14 = 18;
return -1;
} else if(((((a25==1)&&((a14==20)&&(((a1==1)&&((input==2)&&((!(a7==1)&&(a26==17))||(((a7==1)&&(a26==18))||((a26==19)&&(a7==1))))))&&(a3==1))))&&(a4==18))&&(a28==17))){
a4 = 16;
a7 = 1;
a14 = 18;
a26 = 17;
a28 = 15;
return -1;
} else if(((((((((a28==15)&&((input==6)&&((a26==17)||(a26==18))))&&!(a3==1))&&(a4==18))&&(a25==1))&&(a1==1))&&(a7==1))&&(a14==18))){
a4 = 16;
a26 = 17;
a3 = 1;
return -1;
} else if((((a25==1)&&(!(a3==1)&&((a4==16)&&(((input==1)&&(((a14==18)&&(!(a7==1)&&(a26==19)))||(((a26==17)&&(a7==1))&&(a14==19))))&&(a1==1)))))&&(a28==17))){
a4 = 17;
a14 = 19;
a7 = 0;
a28 = 15;
a26 = 19;
return 21;
} else if((!(a7==1)&&(((a14==18)&&((a3==1)&&((((a25==1)&&((input==2)&&(a1==1)))&&(a4==18))&&(a26==18))))&&(a28==17)))){
a26 = 17;
a4 = 16;
a28 = 15;
a7 = 1;
return -1;
} else if(((((a4==17)&&((a14==20)&&((a1==1)&&((((((a7==1)&&(a26==18))||((a7==1)&&(a26==19)))||(!(a7==1)&&(a26==17)))&&(input==1))&&(a28==16)))))&&!(a3==1))&&(a25==1))){
a26 = 19;
a7 = 1;
return -1;
} else if(((((a7==1)&&((((((input==1)&&!(a3==1))&&(a4==16))&&(a28==16))&&(a14==18))&&(a1==1)))&&(a26==18))&&(a25==1))){
a26 = 17;
a3 = 1;
a28 = 15;
return -1;
} else if((!(a7==1)&&(((a1==1)&&(((a3==1)&&(((a25==1)&&(((a26==18)||(a26==19))&&(input==3)))&&(a14==19)))&&(a28==16)))&&(a4==18)))){
a26 = 17;
a4 = 16;
a7 = 1;
a14 = 18;
a28 = 15;
return -1;
} else if((((a3==1)&&((((input==6)&&(((a14==18)&&(((a28==16)&&(a26==17))&&(a7==1)))||(((a14==20)&&(!(a7==1)&&((a26==18)&&(a28==15))))||((!(a7==1)&&((a26==19)&&(a28==15)))&&(a14==20)))))&&(a4==18))&&(a25==1)))&&(a1==1))){
a26 = 17;
a14 = 18;
a4 = 16;
a7 = 1;
a28 = 15;
return -1;
} else if(((a4==18)&&(((a28==15)&&((a25==1)&&(((((a14==19)&&(input==5))&&(a7==1))&&(a3==1))&&(a26==19))))&&(a1==1)))){
a4 = 16;
a14 = 18;
a26 = 17;
return -1;
} else if(((a1==1)&&((a4==17)&&((((((((a26==17)&&(a7==1))&&(a14==19))||(((a14==18)&&((a26==18)&&!(a7==1)))||((a14==18)&&(!(a7==1)&&(a26==19)))))&&(input==5))&&(a25==1))&&(a3==1))&&(a28==16))))){
a4 = 16;
a14 = 18;
a7 = 1;
a26 = 17;
a28 = 15;
return -1;
} else if(((!(a7==1)&&(!(a3==1)&&(((a14==18)&&(((a4==16)&&((a25==1)&&(input==4)))&&(a28==17)))&&(a26==17))))&&(a1==1))){
a28 = 15;
a7 = 1;
a3 = 1;
return -1;
} else if(((((a14==20)&&(((((a4==17)&&((input==3)&&(a26==17)))&&(a3==1))&&(a25==1))&&(a1==1)))&&!(a7==1))&&(a28==15))){
a7 = 1;
a14 = 18;
a4 = 16;
return -1;
} else if((((((a1==1)&&(!(a3==1)&&((input==3)&&(((a14==19)&&((a7==1)&&(a26==18)))||(((!(a7==1)&&(a26==19))&&(a14==18))||(((a7==1)&&(a26==17))&&(a14==19)))))))&&(a28==17))&&(a25==1))&&(a4==18))){
a4 = 17;
a28 = 15;
a7 = 0;
a26 = 18;
a14 = 18;
return 24;
} else if(((a4==17)&&(((((input==6)&&((((((a28==15)&&(a26==18))&&!(a7==1))&&(a14==20))||((((a26==19)&&(a28==15))&&!(a7==1))&&(a14==20)))||(((a7==1)&&((a28==16)&&(a26==17)))&&(a14==18))))&&(a25==1))&&(a3==1))&&(a1==1)))){
a4 = 16;
a28 = 15;
a14 = 18;
a26 = 17;
a7 = 1;
return -1;
} else if(((a14==19)&&(((a1==1)&&(((!(a3==1)&&((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))&&(input==5)))&&(a25==1))&&(a28==16)))&&(a4==18)))){
a4 = 16;
a3 = 1;
a7 = 0;
a26 = 18;
a28 = 15;
return -1;
} else if(((((a3==1)&&((((((((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))||(!(a7==1)&&(a26==17)))&&(input==5))&&(a25==1))&&(a4==17))&&(a1==1)))&&(a28==16))&&(a14==18))){
a26 = 18;
a28 = 15;
a4 = 18;
a7 = 1;
a14 = 19;
return 22;
} else if(((((a14==18)&&(((((a3==1)&&((input==5)&&((a26==19)||((a26==17)||(a26==18)))))&&(a4==18))&&(a28==15))&&(a25==1)))&&!(a7==1))&&(a1==1))){
a7 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if(((a14==20)&&((((a4==17)&&(((a28==17)&&(((a1==1)&&(input==2))&&(a26==18)))&&(a3==1)))&&(a25==1))&&(a7==1)))){
a4 = 16;
a14 = 18;
a28 = 15;
a26 = 17;
return -1;
} else if(((((((a28==15)&&((((a14==20)&&((a7==1)&&(a26==18)))||(((a14==19)&&(!(a7==1)&&(a26==19)))||(((a26==17)&&(a7==1))&&(a14==20))))&&(input==4)))&&(a1==1))&&(a4==18))&&(a25==1))&&(a3==1))){
a26 = 17;
a7 = 1;
a14 = 18;
a4 = 16;
return -1;
} else if(((((a28==16)&&((a3==1)&&((a1==1)&&((a4==18)&&(((((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))||(!(a7==1)&&(a26==17)))&&(input==4))))))&&(a14==18))&&(a25==1))){
a4 = 16;
a7 = 1;
a26 = 17;
a28 = 15;
return -1;
} else if(((a1==1)&&((a28==16)&&(((a25==1)&&(!(a3==1)&&((a14==18)&&(((input==2)&&((a26==17)||(a26==18)))&&(a7==1)))))&&(a4==18))))){
a4 = 16;
a26 = 17;
a28 = 15;
a3 = 1;
return -1;
} else if(((a4==18)&&((a1==1)&&(((a25==1)&&((input==2)&&((((a7==1)&&((a28==17)&&(a26==17)))&&(a14==18))||(((a14==20)&&(((a28==16)&&(a26==18))&&!(a7==1)))||((((a28==16)&&(a26==19))&&!(a7==1))&&(a14==20))))))&&(a3==1))))){
a4 = 16;
a14 = 18;
a7 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if(((a28==17)&&((((a25==1)&&((a14==19)&&((((input==2)&&!(a3==1))&&!(a7==1))&&(a26==17))))&&(a1==1))&&(a4==16)))){
a14 = 18;
a7 = 1;
a3 = 1;
a28 = 15;
return -1;
} else if(((a3==1)&&(((((a1==1)&&((((a25==1)&&(input==2))&&(a4==18))&&(a14==20)))&&(a7==1))&&(a28==16))&&(a26==17)))){
return -1;
} else if((((a4==18)&&(((a28==15)&&(!(a3==1)&&((input==6)&&(((a14==18)&&(!(a7==1)&&(a26==19)))||(((a26==17)&&(a7==1))&&(a14==19))))))&&(a25==1)))&&(a1==1))){
a14 = 18;
a3 = 1;
a26 = 17;
a4 = 16;
a7 = 1;
return -1;
} else if(((a1==1)&&((a25==1)&&(((a4==18)&&((((input==5)&&(((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17))))&&!(a3==1))&&(a14==19)))&&(a28==15))))){
a3 = 1;
a4 = 16;
a26 = 17;
a7 = 1;
a14 = 18;
return -1;
} else if((((a4==18)&&(((!(a3==1)&&(((a1==1)&&((input==3)&&((a26==17)||(a26==18))))&&(a25==1)))&&(a7==1))&&(a28==17)))&&(a14==18))){
a28 = 15;
a4 = 17;
a3 = 1;
a26 = 19;
a7 = 0;
return -1;
} else if((!(a3==1)&&((((a28==15)&&((a1==1)&&((((a26==19)&&(input==1))&&(a7==1))&&(a25==1))))&&(a14==18))&&(a4==16)))){
a26 = 17;
a3 = 1;
return -1;
} else if(((a25==1)&&((((((a28==16)&&(((input==5)&&(a26==18))&&(a14==19)))&&(a1==1))&&(a7==1))&&(a4==18))&&!(a3==1)))){
a14 = 18;
a26 = 17;
a28 = 15;
a3 = 1;
a4 = 16;
return -1;
} else if((!(a3==1)&&((a25==1)&&((a1==1)&&((input==4)&&((((((a28==17)&&((a26==18)&&(a4==16)))&&!(a7==1))&&(a14==20))||((a14==20)&&((((a26==19)&&(a4==16))&&(a28==17))&&!(a7==1))))||((((a28==15)&&((a26==17)&&(a4==17)))&&(a7==1))&&(a14==18)))))))){
a28 = 15;
a14 = 18;
a26 = 17;
a7 = 1;
a4 = 16;
a3 = 1;
return -1;
} else if(((a14==19)&&(((a1==1)&&((((a25==1)&&((input==2)&&((!(a7==1)&&(a26==17))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))))&&(a4==17))&&(a3==1)))&&(a28==17)))){
a28 = 15;
a26 = 17;
a4 = 16;
a14 = 18;
a7 = 1;
return -1;
} else if(((a4==17)&&((a1==1)&&(((((((a14==20)&&(((a28==15)&&(a26==18))&&!(a7==1)))||((a14==20)&&(((a26==19)&&(a28==15))&&!(a7==1))))||(((a7==1)&&((a28==16)&&(a26==17)))&&(a14==18)))&&(input==1))&&(a25==1))&&(a3==1))))){
a4 = 16;
a7 = 1;
a26 = 17;
a28 = 15;
a14 = 18;
return -1;
} else if((((a1==1)&&(!(a3==1)&&(((a14==20)&&(((input==6)&&(((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17))))&&(a25==1)))&&(a28==16))))&&(a4==16))){
a28 = 15;
a7 = 1;
a26 = 17;
a14 = 18;
a3 = 1;
return -1;
} else if(((((((a25==1)&&(((a28==15)&&((input==6)&&(a14==20)))&&(a4==18)))&&!(a7==1))&&(a1==1))&&!(a3==1))&&(a26==17))){
a7 = 1;
a14 = 18;
a4 = 16;
a3 = 1;
return -1;
} else if((((((((a4==16)&&(!(a3==1)&&((input==4)&&((a26==17)||(a26==18)))))&&(a25==1))&&(a14==19))&&(a1==1))&&(a28==15))&&(a7==1))){
a14 = 18;
a26 = 17;
a3 = 1;
return -1;
} else if(((a25==1)&&((!(a7==1)&&((((a4==17)&&((a14==18)&&(((a26==18)||(a26==19))&&(input==4))))&&(a28==16))&&(a1==1)))&&!(a3==1)))){
a26 = 19;
a28 = 17;
a7 = 1;
return 26;
} else if((((((a1==1)&&((input==1)&&(((a14==18)&&(((a26==17)&&(a28==16))&&(a7==1)))||(((((a26==18)&&(a28==15))&&!(a7==1))&&(a14==20))||((((a26==19)&&(a28==15))&&!(a7==1))&&(a14==20))))))&&(a25==1))&&!(a3==1))&&(a4==17))){
a26 = 17;
a28 = 16;
a14 = 19;
a7 = 0;
return 22;
} else if(((a4==17)&&((a3==1)&&((a14==18)&&((a25==1)&&((((a28==17)&&((input==3)&&((a26==17)||(a26==18))))&&(a7==1))&&(a1==1))))))){
a4 = 16;
a26 = 17;
a28 = 15;
return -1;
} else if((((a14==18)&&(!(a3==1)&&((a1==1)&&(((a4==17)&&((input==6)&&((!(a7==1)&&(a26==17))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))))&&(a28==16)))))&&(a25==1))){
a28 = 17;
a7 = 1;
a26 = 18;
return 24;
} else if((((a25==1)&&((((((((a26==17)||(a26==18))&&(input==6))&&(a3==1))&&(a1==1))&&(a4==17))&&(a28==17))&&(a7==1)))&&(a14==18))){
a28 = 15;
a26 = 17;
a4 = 16;
return -1;
} else if(((a1==1)&&((a4==16)&&(!(a3==1)&&(((((((a26==19)&&(a28==15))&&!(a7==1))&&(a14==20))||((a14==18)&&(((a26==17)&&(a28==16))&&(a7==1))))&&(input==3))&&(a25==1)))))){
a14 = 18;
a26 = 17;
a28 = 15;
a7 = 1;
a3 = 1;
return -1;
} else if(((((a26==19)&&((((((a14==19)&&(input==2))&&(a7==1))&&(a1==1))&&(a28==15))&&(a25==1)))&&(a4==16))&&!(a3==1))){
a28 = 17;
a14 = 18;
return 24;
} else if(((((a1==1)&&((a14==19)&&((a28==15)&&(((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))&&(input==3))&&(a4==17)))))&&(a25==1))&&!(a3==1))){
a7 = 1;
a3 = 1;
a14 = 18;
a4 = 16;
a26 = 17;
return -1;
} else if(((((a25==1)&&((((((((a26==19)&&!(a7==1))&&(a14==18))||(((a7==1)&&(a26==17))&&(a14==19)))||((a14==19)&&((a26==18)&&(a7==1))))&&(input==5))&&!(a3==1))&&(a1==1)))&&(a28==15))&&(a4==17))){
a7 = 1;
a3 = 1;
a26 = 17;
a14 = 18;
a4 = 16;
return -1;
} else if(((a4==18)&&((a14==20)&&(((((a1==1)&&((((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))&&(input==1)))&&(a25==1))&&(a28==16))&&!(a3==1))))){
a26 = 19;
a3 = 1;
a7 = 0;
a28 = 15;
a4 = 16;
a14 = 18;
return -1;
} else if(((a28==17)&&((a25==1)&&((a1==1)&&((a7==1)&&((!(a3==1)&&((a26==18)&&((input==3)&&(a14==18))))&&(a4==16))))))){
a3 = 1;
a28 = 16;
a26 = 19;
a4 = 18;
return -1;
} else if((((a4==17)&&((a25==1)&&(((a28==16)&&((((((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))||(!(a7==1)&&(a26==17)))&&(input==5))&&(a3==1)))&&(a1==1))))&&(a14==19))){
a4 = 16;
a14 = 18;
a7 = 1;
a26 = 17;
a28 = 15;
return -1;
} else if((((a28==17)&&((a4==18)&&(!(a3==1)&&((a7==1)&&((((input==1)&&((a26==17)||(a26==18)))&&(a1==1))&&(a25==1))))))&&(a14==18))){
a26 = 17;
a7 = 0;
return 21;
} else if((((a14==19)&&(((a25==1)&&(((((((a26==17)||(a26==18))||(a26==19))&&(input==1))&&(a4==17))&&!(a3==1))&&(a28==16)))&&(a7==1)))&&(a1==1))){
a26 = 17;
a4 = 16;
a3 = 1;
a14 = 18;
a28 = 15;
return -1;
} else if((((a25==1)&&((((a3==1)&&((a1==1)&&((input==4)&&((!(a7==1)&&(a26==17))||(((a7==1)&&(a26==18))||((a7==1)&&(a26==19)))))))&&(a28==17))&&(a4==18)))&&(a14==20))){
a26 = 17;
a28 = 15;
a7 = 1;
a4 = 16;
a14 = 18;
return -1;
} else if(((a3==1)&&((a4==17)&&(((a1==1)&&((a26==17)&&(((a25==1)&&((a28==15)&&(input==1)))&&!(a7==1))))&&(a14==20))))){
a28 = 17;
a14 = 19;
a26 = 19;
return 24;
} else if(((a4==17)&&(((a1==1)&&((a14==20)&&((!(a7==1)&&(((a28==15)&&(input==6))&&!(a3==1)))&&(a26==17))))&&(a25==1)))){
a26 = 18;
a7 = 1;
a28 = 17;
a4 = 16;
a14 = 19;
return -1;
} else if(((a25==1)&&(((a28==15)&&((((a14==18)&&(!(a7==1)&&((input==4)&&((a26==19)||((a26==17)||(a26==18))))))&&!(a3==1))&&(a1==1)))&&(a4==16)))){
a14 = 20;
a28 = 16;
a26 = 17;
return 24;
} else if(((((a14==20)&&((((a1==1)&&((a26==17)&&((input==4)&&!(a7==1))))&&(a4==17))&&!(a3==1)))&&(a25==1))&&(a28==15))){
a4 = 16;
a7 = 1;
a14 = 18;
a3 = 1;
return -1;
} else if((((((a3==1)&&((input==5)&&(((a14==18)&&(((a28==17)&&(a26==17))&&(a7==1)))||(((((a28==16)&&(a26==18))&&!(a7==1))&&(a14==20))||((((a26==19)&&(a28==16))&&!(a7==1))&&(a14==20))))))&&(a25==1))&&(a4==18))&&(a1==1))){
a26 = 17;
a7 = 1;
a4 = 16;
a14 = 18;
a28 = 15;
return -1;
} else if((((a14==19)&&(((a28==15)&&((a25==1)&&((a3==1)&&(((!(a7==1)&&(a26==18))||(((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17))))&&(input==6)))))&&(a1==1)))&&(a4==17))){
a4 = 16;
a14 = 18;
a26 = 17;
a7 = 1;
return -1;
} else if((((a14==18)&&((a25==1)&&((((a4==18)&&((a3==1)&&(((a26==18)||(a26==19))&&(input==1))))&&(a7==1))&&(a1==1))))&&(a28==15))){
a26 = 17;
a4 = 16;
return -1;
} else if(((((((a1==1)&&((((input==6)&&(a25==1))&&(a26==17))&&!(a3==1)))&&!(a7==1))&&(a4==16))&&(a28==17))&&(a14==19))){
a14 = 18;
a7 = 1;
a3 = 1;
a28 = 15;
return -1;
} else if(((((a14==18)&&((a4==18)&&((((((a26==18)&&!(a7==1))||(((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17))))&&(input==2))&&!(a3==1))&&(a25==1))))&&(a28==17))&&(a1==1))){
a28 = 15;
a26 = 17;
a7 = 0;
a4 = 17;
return 23;
} else if(((((((!(a3==1)&&((((a26==17)||(a26==18))&&(input==3))&&(a1==1)))&&(a14==19))&&(a7==1))&&(a25==1))&&(a4==16))&&(a28==15))){
a26 = 17;
a3 = 1;
a14 = 18;
return -1;
} else if(((a25==1)&&((((input==2)&&((((!(a7==1)&&((a28==17)&&((a26==18)&&(a4==16))))&&(a14==20))||((a14==20)&&(!(a7==1)&&((a28==17)&&((a26==19)&&(a4==16))))))||(((a7==1)&&(((a4==17)&&(a26==17))&&(a28==15)))&&(a14==18))))&&!(a3==1))&&(a1==1)))){
a28 = 15;
a14 = 18;
a26 = 17;
a4 = 16;
a3 = 1;
a7 = 1;
return -1;
} else if((((a25==1)&&((((((input==6)&&((((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))||((a26==17)&&!(a7==1))))&&(a14==20))&&(a3==1))&&(a4==18))&&(a1==1)))&&(a28==16))){
a28 = 15;
a3 = 0;
a7 = 0;
a4 = 16;
a26 = 18;
return 23;
} else if(((a28==16)&&(((!(a3==1)&&((((a25==1)&&(((a26==18)||(a26==19))&&(input==1)))&&(a4==17))&&!(a7==1)))&&(a1==1))&&(a14==18)))){
a3 = 1;
a26 = 17;
a4 = 16;
a7 = 1;
a28 = 15;
return -1;
} else if((((a25==1)&&(!(a7==1)&&(((a14==18)&&((((((a26==17)||(a26==18))||(a26==19))&&(input==1))&&!(a3==1))&&(a4==16)))&&(a1==1))))&&(a28==15))){
a26 = 17;
a7 = 1;
a3 = 1;
return -1;
} else if(((((((a1==1)&&((a25==1)&&((input==3)&&(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1))))))&&(a4==17))&&(a28==17))&&(a14==18))&&(a3==1))){
a28 = 15;
a4 = 16;
a7 = 1;
a26 = 17;
return -1;
} else if((((a1==1)&&((!(a3==1)&&((a28==15)&&((a4==18)&&((input==6)&&(((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))))))&&(a14==18)))&&(a25==1))){
a26 = 17;
a7 = 1;
a3 = 1;
a4 = 16;
return -1;
} else if(((((a7==1)&&((((!(a3==1)&&((a26==17)&&(input==4)))&&(a14==20))&&(a25==1))&&(a28==16)))&&(a4==17))&&(a1==1))){
a3 = 1;
a28 = 15;
a14 = 18;
a4 = 16;
return -1;
} else if((((a28==17)&&(((a4==17)&&((a3==1)&&((input==6)&&((((a7==1)&&(a26==17))&&(a14==20))||(((a14==19)&&(!(a7==1)&&(a26==18)))||((!(a7==1)&&(a26==19))&&(a14==19)))))))&&(a25==1)))&&(a1==1))){
a14 = 20;
a4 = 18;
a26 = 17;
a7 = 1;
a28 = 16;
return 26;
} else if(((a4==17)&&(((((a28==15)&&(!(a7==1)&&(!(a3==1)&&((a1==1)&&(input==3)))))&&(a25==1))&&(a26==18))&&(a14==19)))){
a26 = 17;
a14 = 18;
a4 = 16;
a7 = 1;
a3 = 1;
return -1;
} else if(((a28==17)&&((a25==1)&&((a3==1)&&(((a4==17)&&(((((a14==19)&&(!(a7==1)&&(a26==18)))||(((a26==19)&&!(a7==1))&&(a14==19)))||((a14==20)&&((a7==1)&&(a26==17))))&&(input==5)))&&(a1==1)))))){
a28 = 15;
a14 = 18;
a4 = 16;
a26 = 17;
a7 = 1;
return -1;
} else if(((a4==18)&&(((((((a3==1)&&((a14==19)&&(input==5)))&&(a7==1))&&(a1==1))&&(a26==17))&&(a28==16))&&(a25==1)))){
a4 = 16;
a14 = 18;
a28 = 15;
return -1;
} else if(((a25==1)&&(((a1==1)&&((a4==17)&&(((a7==1)&&(((input==5)&&((a26==17)||(a26==18)))&&(a14==18)))&&(a3==1))))&&(a28==17)))){
a4 = 16;
a28 = 15;
a26 = 17;
return -1;
} else if((((((a25==1)&&(((a4==17)&&(((a26==19)&&(input==6))&&(a14==19)))&&!(a7==1)))&&!(a3==1))&&(a28==17))&&(a1==1))){
a4 = 16;
a14 = 18;
a7 = 1;
a3 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if((((a28==15)&&(((((a25==1)&&(!(a7==1)&&((input==3)&&((a26==19)||((a26==17)||(a26==18))))))&&(a14==18))&&(a1==1))&&(a3==1)))&&(a4==18))){
a4 = 16;
a26 = 17;
a7 = 1;
return -1;
} else if(((a26==18)&&(((a14==20)&&((((a3==1)&&((a1==1)&&((a4==18)&&(input==5))))&&!(a7==1))&&(a28==17)))&&(a25==1)))){
a4 = 16;
a7 = 1;
a26 = 17;
a28 = 15;
a14 = 18;
return -1;
} else if((((a1==1)&&((a4==18)&&((a25==1)&&((a7==1)&&((a14==20)&&(((input==2)&&(((a26==17)||(a26==18))||(a26==19)))&&!(a3==1)))))))&&(a28==15))){
a4 = 16;
a14 = 18;
a3 = 1;
a26 = 17;
return -1;
} else if((((a14==18)&&(((a28==15)&&((a3==1)&&((a4==18)&&(((((a26==17)||(a26==18))||(a26==19))&&(input==1))&&(a1==1)))))&&(a25==1)))&&!(a7==1))){
a7 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if(((((a28==16)&&((a1==1)&&(((input==2)&&(((a14==18)&&((a26==19)&&!(a7==1)))||(((a7==1)&&(a26==17))&&(a14==19))))&&!(a3==1))))&&(a25==1))&&(a4==18))){
a14 = 19;
a26 = 18;
a7 = 0;
return 24;
} else if((((a25==1)&&(!(a3==1)&&(((((((a14==19)&&((a26==19)&&!(a7==1)))||((a14==20)&&((a7==1)&&(a26==17))))||((a14==20)&&((a7==1)&&(a26==18))))&&(input==3))&&(a4==18))&&(a28==16))))&&(a1==1))){
a7 = 1;
a26 = 18;
a14 = 20;
return -1;
} else if(((a4==18)&&((((a25==1)&&((a28==16)&&(((input==2)&&(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1))))&&!(a3==1))))&&(a1==1))&&(a14==20)))){
a28 = 17;
a7 = 0;
a3 = 1;
a14 = 18;
a26 = 17;
a4 = 16;
return -1;
} else if((((((a3==1)&&((a28==16)&&((a1==1)&&(!(a7==1)&&(((a26==18)||(a26==19))&&(input==1))))))&&(a4==17))&&(a25==1))&&(a14==20))){
a26 = 18;
a14 = 18;
a4 = 18;
a7 = 1;
return 21;
} else if(((((((((a25==1)&&((input==6)&&((a26==17)||(a26==18))))&&(a28==16))&&(a4==16))&&(a7==1))&&(a1==1))&&!(a3==1))&&(a14==19))){
a3 = 1;
a14 = 18;
a26 = 17;
a28 = 15;
return -1;
} else if((((a28==16)&&(!(a3==1)&&((a25==1)&&(((input==4)&&(((((a26==19)&&!(a7==1))&&(a14==19))||(((a7==1)&&(a26==17))&&(a14==20)))||(((a7==1)&&(a26==18))&&(a14==20))))&&(a1==1)))))&&(a4==16))){
a14 = 18;
a28 = 15;
a3 = 1;
a26 = 17;
a7 = 1;
return -1;
} else if((((a7==1)&&((((a25==1)&&((a14==20)&&((a1==1)&&((((a26==17)||(a26==18))||(a26==19))&&(input==4)))))&&(a28==15))&&(a4==18)))&&!(a3==1))){
a4 = 16;
a3 = 1;
a14 = 18;
a26 = 17;
return -1;
} else if((!(a3==1)&&(((((a4==18)&&((input==3)&&((((a26==19)&&!(a7==1))&&(a14==18))||((a14==19)&&((a26==17)&&(a7==1))))))&&(a1==1))&&(a25==1))&&(a28==16)))){
a3 = 1;
a14 = 18;
a26 = 17;
a28 = 15;
a7 = 1;
a4 = 16;
return -1;
} else if((((a28==15)&&(((a3==1)&&((((a14==18)&&((input==6)&&((a26==19)||((a26==17)||(a26==18)))))&&!(a7==1))&&(a4==18)))&&(a1==1)))&&(a25==1))){
a7 = 1;
a26 = 19;
a28 = 17;
a14 = 19;
return 26;
} else if((((a25==1)&&(((((((a26==18)&&(input==1))&&(a4==18))&&(a14==20))&&(a1==1))&&(a3==1))&&(a28==17)))&&!(a7==1))){
a14 = 18;
a7 = 1;
a28 = 15;
a26 = 17;
a4 = 16;
return -1;
} else if(((a4==18)&&((((((a7==1)&&(!(a3==1)&&((input==3)&&(a14==19))))&&(a25==1))&&(a28==16))&&(a1==1))&&(a26==18)))){
a14 = 20;
return 21;
} else if(((!(a7==1)&&(((a14==18)&&((a28==15)&&((((input==5)&&(a26==18))&&(a25==1))&&!(a3==1))))&&(a4==18)))&&(a1==1))){
a7 = 1;
a14 = 19;
a26 = 19;
return 24;
} else if(((a26==19)&&((a28==15)&&(((a4==16)&&((a1==1)&&((a25==1)&&(((input==6)&&(a14==18))&&!(a3==1)))))&&(a7==1))))){
a26 = 17;
a3 = 1;
return -1;
} else if((((a4==16)&&((!(a3==1)&&(((((input==3)&&(a26==17))&&(a14==19))&&(a25==1))&&(a28==17)))&&(a1==1)))&&!(a7==1))){
a14 = 18;
a28 = 15;
a3 = 1;
a7 = 1;
return -1;
} else if(((a4==17)&&((a1==1)&&(((a14==19)&&((((a28==16)&&((((a26==17)||(a26==18))||(a26==19))&&(input==3)))&&(a25==1))&&!(a3==1)))&&(a7==1))))){
a4 = 16;
a26 = 17;
a14 = 18;
a3 = 1;
a28 = 15;
return -1;
} else if((((a3==1)&&(((a4==17)&&((a1==1)&&(((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))&&(input==2))&&(a28==17))))&&(a25==1)))&&(a14==18))){
a26 = 17;
a28 = 15;
a4 = 16;
a7 = 1;
return -1;
} else if((((a7==1)&&((a14==19)&&((((a28==15)&&(!(a3==1)&&((input==6)&&((a26==17)||(a26==18)))))&&(a4==16))&&(a1==1))))&&(a25==1))){
a3 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if((((a28==15)&&((((!(a3==1)&&((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))&&(input==3)))&&(a25==1))&&(a1==1))&&(a14==18)))&&(a4==18))){
a26 = 17;
a3 = 1;
a4 = 16;
a7 = 1;
return -1;
} else if(((((a28==16)&&(((a1==1)&&(((((a14==19)&&(!(a7==1)&&(a26==19)))||((a14==20)&&((a7==1)&&(a26==17))))||((a14==20)&&((a7==1)&&(a26==18))))&&(input==1)))&&(a4==18)))&&(a25==1))&&!(a3==1))){
a26 = 17;
a14 = 20;
a7 = 1;
return -1;
} else if((!(a7==1)&&(((((!(a3==1)&&((a14==19)&&(((a26==18)||(a26==19))&&(input==2))))&&(a1==1))&&(a28==15))&&(a4==18))&&(a25==1)))){
a26 = 17;
a7 = 1;
a3 = 1;
a4 = 16;
a14 = 18;
return -1;
} else if(((((((input==1)&&((((((a26==18)&&(a28==15))&&!(a7==1))&&(a14==20))||((((a28==15)&&(a26==19))&&!(a7==1))&&(a14==20)))||((a14==18)&&((a7==1)&&((a28==16)&&(a26==17))))))&&(a25==1))&&(a3==1))&&(a4==18))&&(a1==1))){
a4 = 16;
a14 = 18;
a7 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if((((((a14==18)&&(((a25==1)&&((((a26==17)||(a26==18))&&(input==2))&&(a1==1)))&&(a28==17)))&&(a7==1))&&!(a3==1))&&(a4==17))){
a14 = 19;
a4 = 18;
a26 = 19;
a3 = 1;
return 26;
} else if((((a25==1)&&(((a1==1)&&((input==1)&&((((!(a7==1)&&((a26==18)&&(a28==16)))&&(a14==20))||((!(a7==1)&&((a26==19)&&(a28==16)))&&(a14==20)))||((a14==18)&&((a7==1)&&((a26==17)&&(a28==17)))))))&&(a4==16)))&&!(a3==1))){
a7 = 1;
a14 = 18;
a28 = 15;
a3 = 1;
a26 = 17;
return -1;
} else if(((a1==1)&&(((((a4==17)&&((a28==16)&&((((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a7==1)&&(a26==19))))&&(input==4))))&&(a14==18))&&(a25==1))&&!(a3==1)))){
a26 = 17;
a7 = 1;
a3 = 1;
a28 = 15;
a4 = 16;
return -1;
} else if((((((a14==19)&&(((((input==5)&&(a26==18))&&(a1==1))&&(a25==1))&&(a28==15)))&&!(a3==1))&&(a7==1))&&(a4==18))){
a28 = 17;
a3 = 1;
a26 = 17;
return 26;
} else if(((a25==1)&&((a14==18)&&((a1==1)&&((a7==1)&&(((a28==16)&&((a4==18)&&(((a26==17)||(a26==18))&&(input==4))))&&!(a3==1))))))){
a4 = 16;
a26 = 17;
a3 = 1;
a28 = 15;
return -1;
} else if(((((a7==1)&&((a4==18)&&(((!(a3==1)&&(((a26==17)||(a26==18))&&(input==2)))&&(a28==15))&&(a14==18))))&&(a25==1))&&(a1==1))){
a3 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if(((((a3==1)&&((a14==18)&&((a26==18)&&((a4==18)&&((a28==17)&&((input==5)&&(a1==1)))))))&&(a25==1))&&!(a7==1))){
a7 = 1;
a28 = 16;
a4 = 16;
a26 = 19;
a3 = 0;
return 22;
} else if((((a25==1)&&((a1==1)&&((a28==15)&&(!(a3==1)&&((a4==18)&&((a14==19)&&((input==4)&&((a26==18)||(a26==19)))))))))&&!(a7==1))){
a26 = 17;
a4 = 16;
a7 = 1;
a3 = 1;
a14 = 18;
return -1;
} else if(((!(a7==1)&&((a25==1)&&((a4==16)&&((a14==20)&&((a28==15)&&(!(a3==1)&&((input==1)&&((a26==17)||(a26==18)))))))))&&(a1==1))){
a4 = 18;
a28 = 17;
a26 = 19;
a3 = 1;
a14 = 18;
return -1;
} else if(((a25==1)&&((a4==17)&&((a7==1)&&((((a28==15)&&(((a26==19)&&(input==4))&&(a3==1)))&&(a1==1))&&(a14==20)))))){
a4 = 16;
a26 = 17;
a14 = 18;
return -1;
} else if(((a28==16)&&((a3==1)&&((a1==1)&&((a25==1)&&(((((!(a7==1)&&(a26==17))||(((a7==1)&&(a26==18))||((a7==1)&&(a26==19))))&&(input==4))&&(a4==17))&&(a14==20))))))){
a14 = 18;
a7 = 1;
a4 = 16;
a28 = 15;
a26 = 17;
return -1;
} else if(((a14==19)&&(((((a28==16)&&((a25==1)&&((((a26==17)&&!(a7==1))||(((a7==1)&&(a26==18))||((a7==1)&&(a26==19))))&&(input==1))))&&(a1==1))&&(a3==1))&&(a4==18)))){
a14 = 20;
a28 = 15;
a26 = 19;
a7 = 1;
a4 = 16;
a3 = 0;
return 26;
} else if(((a14==18)&&(!(a3==1)&&((a1==1)&&(((a28==17)&&((a4==17)&&(((!(a7==1)&&(a26==18))||(((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17))))&&(input==4))))&&(a25==1)))))){
a4 = 16;
a7 = 1;
a3 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if(((a28==15)&&(((((a25==1)&&((a14==18)&&((a4==18)&&((input==3)&&((a26==17)||(a26==18))))))&&!(a3==1))&&(a7==1))&&(a1==1)))){
a26 = 17;
a4 = 16;
a3 = 1;
return -1;
} else if((((a1==1)&&(((((a4==17)&&((input==1)&&((((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))||((a26==17)&&!(a7==1)))))&&!(a3==1))&&(a14==18))&&(a25==1)))&&(a28==16))){
a3 = 1;
a4 = 16;
a7 = 1;
a26 = 17;
a28 = 15;
return -1;
} else if(((a28==15)&&(!(a7==1)&&((a25==1)&&(!(a3==1)&&((a1==1)&&((a26==17)&&(((input==5)&&(a4==17))&&(a14==20))))))))){
return -1;
} else if(((a25==1)&&((a4==18)&&(((a28==15)&&(!(a3==1)&&((((a14==18)&&(!(a7==1)&&(a26==19)))||(((a7==1)&&(a26==17))&&(a14==19)))&&(input==1))))&&(a1==1))))){
a4 = 16;
a26 = 17;
a7 = 1;
a14 = 18;
a3 = 1;
return -1;
} else if(((((a26==18)&&(((a4==17)&&((!(a7==1)&&((input==2)&&(a28==15)))&&(a25==1)))&&(a1==1)))&&!(a3==1))&&(a14==19))){
a4 = 16;
a3 = 1;
a14 = 18;
a7 = 1;
a26 = 17;
return -1;
} else if(((((!(a3==1)&&((a14==20)&&((a4==16)&&((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))&&(input==2)))))&&(a25==1))&&(a1==1))&&(a28==16))){
a14 = 18;
a3 = 1;
a7 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if(((((((a4==16)&&((((input==2)&&((a26==17)||(a26==18)))&&(a25==1))&&!(a7==1)))&&(a14==19))&&(a28==15))&&(a1==1))&&!(a3==1))){
a14 = 18;
a7 = 1;
a26 = 17;
a3 = 1;
return -1;
} else if(((a28==15)&&((a25==1)&&(!(a3==1)&&((a4==17)&&(((input==2)&&(((a14==19)&&((a26==18)&&(a7==1)))||((((a26==19)&&!(a7==1))&&(a14==18))||(((a7==1)&&(a26==17))&&(a14==19)))))&&(a1==1))))))){
a3 = 1;
a14 = 18;
a26 = 17;
a4 = 16;
a7 = 1;
return -1;
} else if((((a25==1)&&((a14==18)&&(((a28==17)&&((a1==1)&&((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))&&(input==5))))&&(a3==1))))&&(a4==17))){
a26 = 19;
a28 = 16;
a4 = 18;
a7 = 0;
return 22;
} else if((((a4==17)&&(((a28==17)&&(((a1==1)&&((a25==1)&&((input==5)&&!(a7==1))))&&(a14==19)))&&!(a3==1)))&&(a26==18))){
a14 = 18;
a7 = 1;
a28 = 15;
a4 = 16;
a3 = 1;
a26 = 17;
return -1;
} else if(((a14==19)&&(((a7==1)&&((((a26==18)&&((a1==1)&&((input==2)&&(a28==15))))&&(a25==1))&&(a4==18)))&&!(a3==1)))){
a14 = 20;
a28 = 16;
a3 = 1;
a26 = 17;
return 26;
} else if((((a14==19)&&(!(a3==1)&&((((a1==1)&&((input==1)&&(((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))))&&(a25==1))&&(a4==18))))&&(a28==15))){
a7 = 1;
a4 = 16;
a26 = 17;
a3 = 1;
a14 = 18;
return -1;
} else if(((a4==17)&&(!(a3==1)&&((((a25==1)&&((((!(a7==1)&&(a26==17))||(((a7==1)&&(a26==18))||((a7==1)&&(a26==19))))&&(input==2))&&(a28==16)))&&(a1==1))&&(a14==18))))){
a26 = 17;
a4 = 16;
a28 = 15;
a7 = 1;
a3 = 1;
return -1;
} else if(((a7==1)&&((!(a3==1)&&((((((a14==18)&&(input==2))&&(a25==1))&&(a1==1))&&(a4==16))&&(a26==19)))&&(a28==17)))){
a26 = 17;
a3 = 1;
a28 = 15;
return -1;
} else if((((((a1==1)&&(((a28==16)&&((((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))&&(input==3)))&&(a4==18)))&&(a14==20))&&!(a3==1))&&(a25==1))){
a4 = 16;
a3 = 1;
a7 = 0;
a26 = 17;
a14 = 19;
return -1;
} else if(((a28==16)&&(((a4==17)&&(!(a3==1)&&((((a25==1)&&((input==4)&&((a26==19)||((a26==17)||(a26==18)))))&&(a1==1))&&(a14==19))))&&(a7==1)))){
a4 = 16;
a3 = 1;
a26 = 17;
a28 = 15;
a14 = 18;
return -1;
} else if((((a4==17)&&((a14==19)&&((a25==1)&&((((a1==1)&&((input==3)&&(a28==17)))&&!(a3==1))&&(a26==18)))))&&!(a7==1))){
a14 = 18;
a7 = 1;
a26 = 17;
a3 = 1;
a4 = 16;
a28 = 15;
return -1;
} else if(((a4==18)&&((a25==1)&&(((a1==1)&&((input==3)&&((((!(a7==1)&&((a26==18)&&(a28==15)))&&(a14==20))||((a14==20)&&(!(a7==1)&&((a26==19)&&(a28==15)))))||((((a26==17)&&(a28==16))&&(a7==1))&&(a14==18)))))&&(a3==1))))){
a7 = 1;
a26 = 17;
a28 = 15;
a4 = 16;
a14 = 18;
return -1;
} else if(((a3==1)&&((a25==1)&&(((a1==1)&&((a28==17)&&((((a14==19)&&((a26==19)&&!(a7==1)))||((a14==20)&&((a7==1)&&(a26==17))))&&(input==4))))&&(a4==18))))){
a14 = 18;
a4 = 16;
a28 = 15;
a26 = 17;
a7 = 1;
return -1;
} else if(((a3==1)&&((a25==1)&&(((input==3)&&(((a14==20)&&((((a4==17)&&(a26==19))&&(a28==17))&&!(a7==1)))||(((((a26==17)&&(a4==18))&&(a28==15))&&(a7==1))&&(a14==18))))&&(a1==1))))){
a28 = 15;
a26 = 17;
a7 = 1;
a14 = 18;
a4 = 16;
return -1;
} else if((((a25==1)&&(((a1==1)&&((a4==17)&&((((((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))||(!(a7==1)&&(a26==18)))&&(input==4))&&(a14==20))))&&(a3==1)))&&(a28==17))){
a7 = 0;
a14 = 18;
a26 = 17;
a4 = 18;
return 26;
} else if(((((((a1==1)&&((input==6)&&(((a14==19)&&((a7==1)&&(a26==18)))||(((!(a7==1)&&(a26==19))&&(a14==18))||((a14==19)&&((a26==17)&&(a7==1)))))))&&!(a3==1))&&(a25==1))&&(a28==17))&&(a4==18))){
a7 = 0;
a14 = 18;
a26 = 17;
a4 = 17;
a28 = 15;
return 24;
} else if(((a4==16)&&((!(a3==1)&&((a1==1)&&(!(a7==1)&&((((a26==17)&&(input==6))&&(a28==17))&&(a14==18)))))&&(a25==1)))){
a28 = 15;
a3 = 1;
a7 = 1;
return -1;
} else if((((((a1==1)&&((a28==17)&&((a25==1)&&(((input==3)&&(a14==20))&&(a26==18)))))&&(a3==1))&&!(a7==1))&&(a4==18))){
a28 = 16;
a7 = 1;
a4 = 16;
a3 = 0;
a14 = 19;
return 22;
} else if(((a1==1)&&((a4==18)&&((a14==20)&&((a28==16)&&((!(a7==1)&&(!(a3==1)&&(((a26==18)||(a26==19))&&(input==6))))&&(a25==1))))))){
a3 = 1;
a26 = 19;
a4 = 16;
a14 = 18;
a7 = 1;
return -1;
} else if(((!(a3==1)&&(((a1==1)&&(((((input==3)&&((a26==17)||(a26==18)))&&(a7==1))&&(a14==18))&&(a28==16)))&&(a25==1)))&&(a4==18))){
a14 = 19;
a26 = 17;
return 24;
} else if((((a1==1)&&((a28==15)&&(((a3==1)&&(((((a14==19)&&((a26==19)&&!(a7==1)))||(((a26==17)&&(a7==1))&&(a14==20)))||((a14==20)&&((a7==1)&&(a26==18))))&&(input==2)))&&(a25==1))))&&(a4==18))){
a26 = 17;
a14 = 18;
a7 = 1;
a4 = 16;
return -1;
} else if(((a1==1)&&(((a4==17)&&((a25==1)&&((input==3)&&(((a14==18)&&(((a28==16)&&(a26==17))&&(a7==1)))||(((a14==20)&&(((a26==18)&&(a28==15))&&!(a7==1)))||((((a28==15)&&(a26==19))&&!(a7==1))&&(a14==20)))))))&&!(a3==1)))){
a14 = 18;
a4 = 16;
a7 = 1;
a26 = 17;
a3 = 1;
a28 = 15;
return -1;
} else if((!(a7==1)&&((a25==1)&&(!(a3==1)&&(((a14==18)&&(((a1==1)&&(((a26==18)||(a26==19))&&(input==3)))&&(a28==16)))&&(a4==16)))))){
a28 = 15;
a26 = 18;
a14 = 20;
return 26;
} else if((!(a3==1)&&(((a1==1)&&((a25==1)&&(((((a14==18)&&((a26==19)&&!(a7==1)))||(((a7==1)&&(a26==17))&&(a14==19)))&&(input==4))&&(a28==17))))&&(a4==16)))){
a7 = 1;
a14 = 18;
a3 = 1;
a26 = 17;
a28 = 15;
return -1;
} else if((((a1==1)&&((a28==15)&&((a14==19)&&((a4==18)&&(((input==6)&&(((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17))))&&!(a3==1))))))&&(a25==1))){
a14 = 18;
a3 = 1;
a7 = 1;
a26 = 17;
a4 = 16;
return -1;
} else if(((a28==15)&&((a14==19)&&(((((a26==18)&&((a1==1)&&((a25==1)&&(input==1))))&&(a3==1))&&(a7==1))&&(a4==18))))){
a14 = 18;
a4 = 16;
a26 = 17;
return -1;
} else if((((a3==1)&&((((a1==1)&&((input==6)&&((((a7==1)&&(a26==17))&&(a14==19))||(((!(a7==1)&&(a26==18))&&(a14==18))||((!(a7==1)&&(a26==19))&&(a14==18))))))&&(a25==1))&&(a28==17)))&&(a4==17))){
a14 = 19;
a28 = 16;
a4 = 18;
a26 = 17;
a7 = 1;
return 26;
} else if((((a1==1)&&((a25==1)&&((a4==18)&&(((input==6)&&(((a14==20)&&((a26==18)&&(a7==1)))||((((a26==19)&&!(a7==1))&&(a14==19))||(((a26==17)&&(a7==1))&&(a14==20)))))&&(a28==16)))))&&!(a3==1))){
a26 = 17;
a4 = 17;
a7 = 0;
a14 = 18;
a28 = 15;
return 21;
} else if(((((a25==1)&&((a7==1)&&((((a1==1)&&((a4==18)&&(input==4)))&&(a3==1))&&(a26==19))))&&(a14==20))&&(a28==15))){
a14 = 18;
a4 = 16;
a26 = 17;
return -1;
} else if(((a28==15)&&((a14==20)&&((((a7==1)&&((((input==4)&&(a1==1))&&(a25==1))&&!(a3==1)))&&(a26==19))&&(a4==16))))){
a3 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if((((a3==1)&&((a4==17)&&((((((input==1)&&(a7==1))&&(a1==1))&&(a26==19))&&(a25==1))&&(a14==20))))&&(a28==15))){
a4 = 16;
a14 = 18;
a26 = 17;
return -1;
} else if((((a25==1)&&(!(a3==1)&&((a1==1)&&(((((a14==18)&&(!(a7==1)&&(a26==19)))||(((a7==1)&&(a26==17))&&(a14==19)))&&(input==2))&&(a4==18)))))&&(a28==15))){
a3 = 1;
a14 = 18;
a26 = 17;
a7 = 1;
a4 = 16;
return -1;
} else if((((a4==16)&&((a25==1)&&(((a1==1)&&((((a14==18)&&(!(a7==1)&&(a26==19)))||(((a26==17)&&(a7==1))&&(a14==19)))&&(input==3)))&&!(a3==1))))&&(a28==17))){
a26 = 17;
a14 = 18;
a3 = 1;
a7 = 1;
a28 = 15;
return -1;
} else if(((a25==1)&&((a1==1)&&((a14==20)&&(!(a3==1)&&((a4==17)&&((a7==1)&&(((a28==16)&&(input==3))&&(a26==17))))))))){
a28 = 15;
a3 = 1;
a4 = 16;
a14 = 18;
return -1;
} else if(((a4==18)&&(((a28==15)&&(((a7==1)&&((((input==4)&&((a26==17)||(a26==18)))&&(a14==18))&&(a1==1)))&&(a25==1)))&&!(a3==1)))){
a4 = 16;
a26 = 17;
a3 = 1;
return -1;
} else if(((a14==20)&&(((((a7==1)&&((((input==6)&&((a26==17)||(a26==18)))&&(a28==15))&&(a25==1)))&&!(a3==1))&&(a1==1))&&(a4==16)))){
a3 = 1;
a14 = 18;
a26 = 17;
return -1;
} else if(((a14==19)&&(!(a3==1)&&(((((a1==1)&&((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))&&(input==5)))&&(a28==15))&&(a25==1))&&(a4==17))))){
a7 = 1;
a14 = 18;
a4 = 16;
a3 = 1;
a26 = 17;
return -1;
} else if(((a25==1)&&(!(a3==1)&&(((((a14==20)&&((((a26==19)||((a26==17)||(a26==18)))&&(input==4))&&(a1==1)))&&(a7==1))&&(a28==15))&&(a4==17))))){
a14 = 18;
a3 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if(((a1==1)&&(((a3==1)&&(((a4==18)&&(((((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))&&(input==5))&&(a25==1)))&&(a28==17)))&&(a14==18)))){
a7 = 1;
a4 = 16;
a28 = 15;
a26 = 17;
return -1;
} else if(((a28==17)&&(((((a4==17)&&((a3==1)&&(((input==1)&&(a1==1))&&(a25==1))))&&(a7==1))&&(a14==20))&&(a26==18)))){
a28 = 15;
a4 = 16;
a14 = 18;
a26 = 17;
return -1;
} else if(((a28==17)&&(((a1==1)&&((a3==1)&&(((a25==1)&&(((!(a7==1)&&(a26==17))||(((a26==18)&&(a7==1))||((a7==1)&&(a26==19))))&&(input==5)))&&(a4==18))))&&(a14==19)))){
a14 = 18;
a26 = 19;
a7 = 0;
return 24;
} else if(((((a1==1)&&((a25==1)&&((((input==3)&&(((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17))))&&(a14==18))&&(a28==16))))&&(a4==16))&&!(a3==1))){
a26 = 17;
a7 = 1;
a3 = 1;
a28 = 15;
return -1;
} else if(((a28==15)&&((((a3==1)&&((((((!(a7==1)&&(a26==19))&&(a14==19))||((a14==20)&&((a7==1)&&(a26==17))))||(((a7==1)&&(a26==18))&&(a14==20)))&&(input==5))&&(a25==1)))&&(a4==18))&&(a1==1)))){
a7 = 1;
a14 = 18;
a4 = 16;
a26 = 17;
return -1;
} else if(((((a25==1)&&(((input==4)&&(((a14==18)&&((a7==1)&&((a28==16)&&(a26==17))))||(((!(a7==1)&&((a26==18)&&(a28==15)))&&(a14==20))||((!(a7==1)&&((a28==15)&&(a26==19)))&&(a14==20)))))&&(a3==1)))&&(a4==17))&&(a1==1))){
a14 = 18;
a26 = 17;
a7 = 1;
a4 = 16;
a28 = 15;
return -1;
} else if((((a4==18)&&((((a26==18)&&((!(a7==1)&&((input==3)&&(a28==15)))&&!(a3==1)))&&(a14==18))&&(a25==1)))&&(a1==1))){
a26 = 17;
a3 = 1;
a4 = 16;
a7 = 1;
return -1;
} else if((((((a4==17)&&((a14==19)&&(((((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))&&(input==4))&&!(a3==1))))&&(a1==1))&&(a25==1))&&(a28==17))){
a14 = 20;
a7 = 0;
a26 = 17;
return 24;
} else if((!(a3==1)&&((((a28==16)&&((((a1==1)&&((input==3)&&((a26==18)||(a26==19))))&&!(a7==1))&&(a14==20)))&&(a4==18))&&(a25==1)))){
a7 = 1;
a4 = 16;
a28 = 17;
a26 = 18;
a14 = 18;
return 24;
} else if(((a25==1)&&(((a1==1)&&((a3==1)&&((a28==17)&&((input==6)&&(((a14==19)&&((a26==19)&&!(a7==1)))||(((a7==1)&&(a26==17))&&(a14==20)))))))&&(a4==18)))){
a26 = 18;
a14 = 19;
a7 = 1;
return 26;
} else if((((((((!(a7==1)&&((a28==17)&&(((a4==18)&&(a3==1))&&(a26==19))))&&(a14==20))||((a14==18)&&((a7==1)&&(((!(a3==1)&&(a4==16))&&(a26==17))&&(a28==15)))))||(((a7==1)&&((a28==15)&&(((a4==16)&&!(a3==1))&&(a26==18))))&&(a14==18)))&&(input==1))&&(a25==1))&&(a1==1))){
a4 = 16;
a14 = 19;
a26 = 19;
a3 = 0;
a7 = 1;
a28 = 16;
return 26;
} else if(((a1==1)&&((a25==1)&&(((a4==17)&&((a28==16)&&(((input==2)&&((((a7==1)&&(a26==18))||((a7==1)&&(a26==19)))||(!(a7==1)&&(a26==17))))&&(a3==1))))&&(a14==19))))){
a14 = 18;
a26 = 17;
a7 = 1;
a28 = 15;
a4 = 16;
return -1;
} else if(((a28==16)&&(((a14==20)&&((!(a3==1)&&(((a1==1)&&((a7==1)&&(input==1)))&&(a26==17)))&&(a4==17)))&&(a25==1)))){
a14 = 18;
a4 = 16;
a3 = 1;
a28 = 15;
return -1;
} else if((!(a7==1)&&((((((a14==20)&&((a28==15)&&((input==1)&&(a3==1))))&&(a26==17))&&(a25==1))&&(a1==1))&&(a4==18)))){
a7 = 1;
a4 = 16;
a14 = 18;
return -1;
} else if((!(a3==1)&&((a14==19)&&(((a4==16)&&(((a25==1)&&(((input==2)&&((a26==17)||(a26==18)))&&(a28==16)))&&(a7==1)))&&(a1==1))))){
a26 = 17;
a3 = 1;
a14 = 18;
a28 = 15;
return -1;
} else if(((((a4==18)&&((((((((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))||((a26==17)&&!(a7==1)))&&(input==5))&&(a28==17))&&(a1==1))&&(a25==1)))&&(a3==1))&&(a14==20))){
a26 = 17;
a14 = 18;
a7 = 1;
a4 = 16;
a28 = 15;
return -1;
} else if((((a14==20)&&((a1==1)&&((a4==16)&&(((a28==17)&&((input==2)&&(((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))))&&!(a3==1)))))&&(a25==1))){
a7 = 1;
a26 = 17;
a14 = 18;
a28 = 15;
a3 = 1;
return -1;
} else if(((((a28==15)&&(((a4==18)&&(((a26==19)&&((input==5)&&(a14==20)))&&(a1==1)))&&(a3==1)))&&(a25==1))&&(a7==1))){
a3 = 0;
a14 = 18;
a4 = 16;
return 26;
} else if(((((a28==15)&&(((a4==18)&&(((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))&&(input==3))&&(a25==1)))&&(a1==1)))&&!(a3==1))&&(a14==19))){
a3 = 1;
a14 = 18;
a4 = 16;
a7 = 1;
a26 = 17;
return -1;
} else if(((a1==1)&&((a25==1)&&(((((a7==1)&&(((a14==20)&&(input==2))&&(a26==19)))&&(a4==16))&&!(a3==1))&&(a28==15))))){
a14 = 18;
a26 = 17;
a3 = 1;
return -1;
} else if(((a4==16)&&((!(a3==1)&&(((input==2)&&(((!(a7==1)&&((a26==19)&&(a28==15)))&&(a14==20))||(((a7==1)&&((a28==16)&&(a26==17)))&&(a14==18))))&&(a1==1)))&&(a25==1)))){
a14 = 19;
a7 = 0;
a28 = 17;
a26 = 17;
return 26;
} else if((((a1==1)&&((!(a3==1)&&((a14==19)&&((a28==16)&&((a26==19)&&((input==2)&&!(a7==1))))))&&(a25==1)))&&(a4==17))){
a26 = 17;
a28 = 15;
a4 = 16;
a7 = 1;
a3 = 1;
a14 = 18;
return -1;
} else if((((a1==1)&&(((input==4)&&((((((a4==17)&&(a26==19))&&(a28==17))&&!(a7==1))&&(a14==20))||(((a7==1)&&((a28==15)&&((a26==17)&&(a4==18))))&&(a14==18))))&&(a3==1)))&&(a25==1))){
a14 = 18;
a28 = 15;
a4 = 16;
a7 = 1;
a26 = 17;
return -1;
} else if(((a14==19)&&((a1==1)&&((a3==1)&&((a4==17)&&(((a25==1)&&((((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))&&(input==4)))&&(a28==16))))))){
a4 = 16;
a26 = 17;
a7 = 1;
a28 = 15;
a14 = 18;
return -1;
} else if(((!(a3==1)&&(((((!(a7==1)&&((input==1)&&(a4==17)))&&(a25==1))&&(a26==18))&&(a1==1))&&(a14==19)))&&(a28==17))){
a7 = 1;
a4 = 18;
a14 = 18;
a28 = 15;
return 24;
} else if(((((((((((a26==17)&&!(a7==1))||(((a7==1)&&(a26==18))||((a7==1)&&(a26==19))))&&(input==1))&&(a4==17))&&(a14==18))&&(a25==1))&&(a1==1))&&(a3==1))&&(a28==16))){
a26 = 17;
a28 = 15;
a7 = 1;
a4 = 16;
return -1;
} else if(((((((a14==18)&&((a28==16)&&((((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))&&(input==6))))&&(a25==1))&&(a1==1))&&(a4==16))&&!(a3==1))){
a28 = 15;
a7 = 1;
a3 = 1;
a26 = 17;
return -1;
} else if(((a4==16)&&(((a7==1)&&((!(a3==1)&&(((a14==18)&&((a26==19)&&(input==4)))&&(a28==17)))&&(a25==1)))&&(a1==1)))){
a3 = 1;
a26 = 17;
a28 = 15;
return -1;
} else if(((a28==16)&&(((a4==17)&&((((input==6)&&((((a7==1)&&(a26==17))&&(a14==20))||((((a26==18)&&!(a7==1))&&(a14==19))||((!(a7==1)&&(a26==19))&&(a14==19)))))&&(a25==1))&&(a3==1)))&&(a1==1)))){
a7 = 1;
a14 = 18;
a28 = 15;
a4 = 16;
a26 = 17;
return -1;
} else if(((a1==1)&&((!(a7==1)&&(((((((a26==18)||(a26==19))&&(input==5))&&(a25==1))&&!(a3==1))&&(a28==16))&&(a14==20)))&&(a4==18)))){
a26 = 17;
a28 = 15;
a4 = 17;
return 24;
} else if((((!(a3==1)&&((a28==15)&&(((input==1)&&(((a14==19)&&((a26==18)&&(a7==1)))||(((a14==18)&&(!(a7==1)&&(a26==19)))||(((a7==1)&&(a26==17))&&(a14==19)))))&&(a4==17))))&&(a1==1))&&(a25==1))){
a4 = 16;
a14 = 18;
a3 = 1;
a7 = 1;
a26 = 17;
return -1;
} else if(((a25==1)&&((a1==1)&&(!(a3==1)&&(((input==4)&&(((!(a7==1)&&((a26==19)&&(a28==15)))&&(a14==20))||(((a7==1)&&((a28==16)&&(a26==17)))&&(a14==18))))&&(a4==16)))))){
a3 = 1;
a26 = 17;
a7 = 1;
a28 = 15;
a14 = 18;
return -1;
} else if(((((((!(a3==1)&&(((input==1)&&(a25==1))&&(a28==15)))&&(a14==20))&&(a1==1))&&(a4==17))&&(a26==17))&&!(a7==1))){
a7 = 1;
a26 = 19;
return -1;
} else if((((!(a3==1)&&((a14==20)&&((a4==17)&&(((a1==1)&&(((a26==18)||(a26==19))&&(input==1)))&&(a28==16)))))&&!(a7==1))&&(a25==1))){
a26 = 17;
return -1;
} else if((((a4==16)&&(((((a28==15)&&((a14==19)&&(((a26==17)||(a26==18))&&(input==1))))&&!(a3==1))&&!(a7==1))&&(a1==1)))&&(a25==1))){
a3 = 1;
a26 = 17;
a7 = 1;
a14 = 18;
return -1;
} else if(((!(a7==1)&&((a25==1)&&((a1==1)&&((a3==1)&&((a4==18)&&(((input==4)&&((a26==18)||(a26==19)))&&(a28==16)))))))&&(a14==19))){
a7 = 1;
a28 = 15;
a26 = 17;
a14 = 18;
a4 = 16;
return -1;
} else if(((a28==15)&&((((a7==1)&&((a4==17)&&(((a25==1)&&(((a26==18)||(a26==19))&&(input==1)))&&(a1==1))))&&!(a3==1))&&(a14==18)))){
a26 = 18;
return 23;
} else if(((a26==19)&&((a28==16)&&((!(a7==1)&&((a3==1)&&(((a25==1)&&((input==4)&&(a4==18)))&&(a1==1))))&&(a14==18))))){
a7 = 1;
a4 = 16;
a26 = 17;
a28 = 15;
return -1;
} else if(((((a25==1)&&((a28==17)&&(!(a3==1)&&(((((a14==19)&&((a26==19)&&!(a7==1)))||((a14==20)&&((a26==17)&&(a7==1))))||((a14==20)&&((a7==1)&&(a26==18))))&&(input==3)))))&&(a1==1))&&(a4==16))){
a7 = 1;
a26 = 17;
a3 = 1;
a14 = 18;
a28 = 15;
return -1;
} else if(((((((a25==1)&&((!(a7==1)&&((input==1)&&(a28==15)))&&(a1==1)))&&(a4==17))&&!(a3==1))&&(a14==19))&&(a26==19))){
a3 = 1;
a7 = 1;
a4 = 16;
a14 = 18;
a26 = 17;
return -1;
} else if(((((a1==1)&&((a28==15)&&((a4==17)&&((input==6)&&(((((a26==19)&&!(a7==1))&&(a14==18))||((a14==19)&&((a7==1)&&(a26==17))))||(((a7==1)&&(a26==18))&&(a14==19)))))))&&(a25==1))&&!(a3==1))){
a7 = 0;
a28 = 16;
a26 = 19;
a14 = 19;
return 22;
} else if(((a14==18)&&((a28==17)&&((((a25==1)&&(!(a3==1)&&((a1==1)&&(((a26==17)||(a26==18))&&(input==4)))))&&(a4==18))&&(a7==1))))){
a14 = 19;
a26 = 18;
a28 = 15;
a3 = 1;
a4 = 16;
return -1;
} else if((!(a7==1)&&((a28==17)&&((a14==18)&&(((a1==1)&&((a26==18)&&(!(a3==1)&&((input==2)&&(a25==1)))))&&(a4==16)))))){
a28 = 15;
a3 = 1;
a26 = 17;
a7 = 1;
return -1;
} else if(((!(a3==1)&&(((((((((a26==17)||(a26==18))||(a26==19))&&(input==4))&&!(a7==1))&&(a25==1))&&(a1==1))&&(a28==17))&&(a14==20)))&&(a4==17))){
a3 = 1;
a4 = 16;
a14 = 18;
a28 = 15;
a26 = 17;
a7 = 1;
return -1;
} else if((((((((a4==17)&&(((input==5)&&(a25==1))&&(a1==1)))&&(a14==20))&&(a3==1))&&(a26==18))&&(a7==1))&&(a28==15))){
a4 = 16;
a26 = 17;
a14 = 18;
return -1;
} else if(((a4==16)&&(((a25==1)&&((a1==1)&&((input==5)&&(((a14==18)&&((a7==1)&&((a28==17)&&(a26==17))))||(((((a26==18)&&(a28==16))&&!(a7==1))&&(a14==20))||((a14==20)&&(((a26==19)&&(a28==16))&&!(a7==1))))))))&&!(a3==1)))){
a14 = 18;
a26 = 17;
a3 = 1;
a28 = 15;
a7 = 1;
return -1;
} else if(((a25==1)&&((a3==1)&&((((a4==17)&&(((((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))&&(input==6))&&(a28==16)))&&(a14==19))&&(a1==1))))){
a28 = 15;
a7 = 1;
a26 = 17;
a4 = 16;
a14 = 18;
return -1;
} else if(((((((a4==16)&&(!(a7==1)&&((a14==18)&&((input==5)&&(a1==1)))))&&!(a3==1))&&(a28==17))&&(a25==1))&&(a26==18))){
a28 = 15;
a7 = 1;
a3 = 1;
a26 = 17;
return -1;
} else if((((((((a28==15)&&(((input==3)&&((a26==18)||(a26==19)))&&(a25==1)))&&!(a3==1))&&!(a7==1))&&(a4==18))&&(a1==1))&&(a14==20))){
a7 = 1;
a3 = 1;
a4 = 16;
a14 = 18;
a26 = 17;
return -1;
} else if(((a14==19)&&(((a1==1)&&((((a4==18)&&((input==6)&&(((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a7==1)&&(a26==19))))))&&(a3==1))&&(a28==17)))&&(a25==1)))){
a26 = 17;
a7 = 0;
return 22;
} else if(((a4==18)&&(((((((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))&&(input==2))&&(a28==16))&&(a14==19))&&(a25==1))&&!(a3==1))&&(a1==1)))){
a26 = 17;
a4 = 16;
a7 = 1;
a14 = 18;
a28 = 15;
a3 = 1;
return -1;
} else if(((a25==1)&&((((a1==1)&&((a14==18)&&(((input==5)&&((((a26==19)&&(a7==1))||(!(a7==1)&&(a26==17)))||((a26==18)&&!(a7==1))))&&(a4==17))))&&!(a3==1))&&(a28==17)))){
a3 = 1;
a4 = 16;
a7 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if((((a25==1)&&((a7==1)&&(((((a14==18)&&(((a26==17)||(a26==18))&&(input==6)))&&(a4==17))&&!(a3==1))&&(a1==1))))&&(a28==17))){
a26 = 17;
a4 = 18;
a28 = 16;
a14 = 20;
a3 = 1;
return 26;
} else if(((a4==16)&&((!(a3==1)&&((a28==17)&&((a1==1)&&((input==5)&&(((a14==18)&&(!(a7==1)&&(a26==19)))||(((a26==17)&&(a7==1))&&(a14==19)))))))&&(a25==1)))){
a7 = 1;
a28 = 15;
a3 = 1;
a26 = 17;
a14 = 18;
return -1;
} else if(((a28==17)&&(((a26==18)&&(!(a7==1)&&((a4==18)&&((((a3==1)&&(input==4))&&(a25==1))&&(a1==1)))))&&(a14==19)))){
a7 = 1;
a28 = 16;
a26 = 17;
a14 = 20;
return 26;
} else if(((a25==1)&&(((a28==16)&&((a3==1)&&(((a4==17)&&((input==3)&&((!(a7==1)&&(a26==17))||(((a7==1)&&(a26==18))||((a26==19)&&(a7==1))))))&&(a1==1))))&&(a14==19)))){
a4 = 16;
a14 = 18;
a26 = 17;
a7 = 1;
a28 = 15;
return -1;
} else if((((a25==1)&&(((a14==20)&&(((a28==15)&&(((input==4)&&((a26==18)||(a26==19)))&&(a4==18)))&&(a1==1)))&&!(a3==1)))&&!(a7==1))){
a14 = 18;
a7 = 1;
a3 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if((!(a3==1)&&(((a14==19)&&((a4==17)&&(((a1==1)&&(!(a7==1)&&((a25==1)&&(input==2))))&&(a28==15))))&&(a26==19)))){
a7 = 1;
a14 = 18;
a3 = 1;
a26 = 17;
a4 = 16;
return -1;
} else if(((a1==1)&&(((((((a14==19)&&((a4==18)&&(input==6)))&&(a25==1))&&(a28==16))&&(a26==18))&&!(a3==1))&&!(a7==1)))){
a26 = 17;
a28 = 15;
a14 = 20;
a3 = 1;
a4 = 16;
return -1;
} else if(((a4==18)&&((a1==1)&&(((a14==20)&&(((((!(a7==1)&&(a26==17))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))&&(input==1))&&(a25==1))&&(a3==1)))&&(a28==17))))){
a14 = 18;
a7 = 1;
a26 = 17;
a28 = 15;
a4 = 16;
return -1;
} else if(((a26==19)&&(!(a7==1)&&((a4==17)&&((a1==1)&&((((a28==17)&&((input==1)&&!(a3==1)))&&(a25==1))&&(a14==19))))))){
a14 = 18;
a26 = 17;
a28 = 15;
return 21;
} else if(((a28==17)&&((((a25==1)&&(((input==2)&&((((a7==1)&&(a26==18))&&(a14==20))||(((a14==19)&&(!(a7==1)&&(a26==19)))||(((a7==1)&&(a26==17))&&(a14==20)))))&&(a4==16)))&&!(a3==1))&&(a1==1)))){
a4 = 17;
a7 = 0;
a14 = 18;
a26 = 18;
a28 = 16;
return 22;
} return calculate_output4(input);
}
int calculate_output4(int input) {
if(((a25==1)&&((a28==17)&&((a14==18)&&(((((a26==17)&&((a4==16)&&(input==5)))&&!(a3==1))&&!(a7==1))&&(a1==1)))))){
a3 = 1;
a7 = 1;
a28 = 15;
return -1;
} else if(((a3==1)&&(((a1==1)&&((a28==16)&&(((a4==18)&&((input==1)&&((((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))||(!(a7==1)&&(a26==17)))))&&(a14==18))))&&(a25==1)))){
a4 = 16;
a26 = 17;
a7 = 1;
a28 = 15;
return -1;
} else if(((!(a7==1)&&(((a25==1)&&(((((input==2)&&(((a26==17)||(a26==18))||(a26==19)))&&(a1==1))&&!(a3==1))&&(a28==17)))&&(a4==17)))&&(a14==20))){
a26 = 17;
a3 = 1;
a4 = 16;
a14 = 18;
a28 = 15;
a7 = 1;
return -1;
} else if(((a4==17)&&((a28==17)&&((a25==1)&&((a3==1)&&(((input==3)&&((((a14==19)&&(!(a7==1)&&(a26==18)))||(((a26==19)&&!(a7==1))&&(a14==19)))||(((a7==1)&&(a26==17))&&(a14==20))))&&(a1==1))))))){
a4 = 16;
a7 = 1;
a26 = 17;
a28 = 15;
a14 = 18;
return -1;
} else if(((a28==15)&&((a1==1)&&(((a25==1)&&(((a4==16)&&(((((a26==17)||(a26==18))||(a26==19))&&(input==5))&&!(a7==1)))&&!(a3==1)))&&(a14==18))))){
a26 = 17;
a3 = 1;
a7 = 1;
return -1;
} else if((((!(a7==1)&&((a4==17)&&((a14==19)&&((a1==1)&&((((a26==17)||(a26==18))&&(input==4))&&!(a3==1))))))&&(a28==16))&&(a25==1))){
a4 = 16;
a26 = 18;
a7 = 1;
a28 = 17;
return 26;
} else if((!(a3==1)&&(((a14==20)&&((a25==1)&&((a1==1)&&(((input==4)&&(((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17))))&&(a4==18)))))&&(a28==16)))){
a28 = 17;
a26 = 18;
a14 = 18;
a7 = 1;
return 24;
} else if(((((a1==1)&&((((a14==19)&&((input==3)&&((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))||((a26==18)&&!(a7==1)))))&&(a28==16))&&!(a3==1)))&&(a25==1))&&(a4==16))){
a28 = 15;
a3 = 1;
a26 = 17;
a7 = 1;
a14 = 18;
return -1;
} else if(((a3==1)&&((((a28==17)&&(((a14==18)&&((input==3)&&(((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a7==1)&&(a26==19))))))&&(a1==1)))&&(a25==1))&&(a4==18)))){
a4 = 16;
a28 = 15;
a26 = 17;
a7 = 1;
return -1;
} else if(((a28==16)&&(((a4==16)&&(((a25==1)&&((input==5)&&((((a7==1)&&(a26==18))&&(a14==20))||(((a14==19)&&(!(a7==1)&&(a26==19)))||((a14==20)&&((a26==17)&&(a7==1)))))))&&(a1==1)))&&!(a3==1)))){
a3 = 1;
a14 = 18;
a7 = 1;
a28 = 15;
a26 = 17;
return -1;
} else if(((a4==16)&&((((a14==20)&&(!(a3==1)&&((a28==17)&&((((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))&&(input==6)))))&&(a25==1))&&(a1==1)))){
a26 = 17;
a3 = 1;
a14 = 18;
a7 = 1;
a28 = 15;
return -1;
} else if(((((a14==19)&&((a1==1)&&((a28==16)&&(((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==4))&&(a4==18)))))&&!(a3==1))&&(a25==1))){
a4 = 16;
a26 = 17;
a7 = 0;
a3 = 1;
a14 = 20;
return -1;
} else if(((a25==1)&&(((!(a3==1)&&((((a28==16)&&((input==6)&&(((a26==17)||(a26==18))||(a26==19))))&&(a1==1))&&(a4==17)))&&(a14==19))&&(a7==1)))){
a14 = 18;
a7 = 0;
a28 = 17;
a26 = 19;
return 26;
} else if((((a7==1)&&((a25==1)&&(!(a3==1)&&((((((a26==17)||(a26==18))&&(input==5))&&(a28==16))&&(a14==18))&&(a1==1)))))&&(a4==18))){
a4 = 16;
a28 = 15;
a26 = 17;
a3 = 1;
return -1;
} else if((((a4==17)&&(((((((((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))||(!(a7==1)&&(a26==18)))&&(input==1))&&(a25==1))&&(a1==1))&&(a14==18))&&!(a3==1)))&&(a28==17))){
a14 = 19;
a7 = 0;
a28 = 16;
a26 = 18;
return 24;
} else if(((a28==16)&&(!(a7==1)&&((a26==19)&&((a25==1)&&(!(a3==1)&&((a14==19)&&(((input==4)&&(a1==1))&&(a4==17))))))))){
a26 = 18;
a28 = 17;
return 23;
} else if((((a4==18)&&(((a28==16)&&((a25==1)&&((a14==18)&&((input==4)&&((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))||((a26==18)&&!(a7==1)))))))&&!(a3==1)))&&(a1==1))){
a7 = 1;
a3 = 1;
a26 = 17;
a4 = 16;
a28 = 15;
return -1;
} else if(((a28==15)&&(!(a3==1)&&((a1==1)&&((a4==18)&&(((((!(a7==1)&&(a26==19))&&(a14==18))||(((a7==1)&&(a26==17))&&(a14==19)))&&(input==4))&&(a25==1))))))){
a26 = 19;
a14 = 19;
a7 = 0;
return 22;
} else if((((a25==1)&&((a28==16)&&((a4==16)&&((a1==1)&&((input==2)&&(((a14==20)&&((a26==18)&&(a7==1)))||((((a26==19)&&!(a7==1))&&(a14==19))||((a14==20)&&((a26==17)&&(a7==1))))))))))&&!(a3==1))){
a14 = 18;
a7 = 1;
a28 = 15;
a26 = 17;
a3 = 1;
return -1;
} else if(((a4==18)&&(!(a7==1)&&(((a26==18)&&(((((a3==1)&&(input==2))&&(a28==17))&&(a1==1))&&(a14==19)))&&(a25==1))))){
a26 = 17;
a4 = 16;
a28 = 15;
a14 = 18;
a7 = 1;
return -1;
} else if((((a14==20)&&(((a3==1)&&(!(a7==1)&&((a25==1)&&(((input==6)&&((a26==18)||(a26==19)))&&(a28==16)))))&&(a4==17)))&&(a1==1))){
a28 = 15;
a14 = 18;
a26 = 17;
a4 = 16;
a7 = 1;
return -1;
} else if((((a1==1)&&((((a7==1)&&((a14==18)&&((a28==17)&&(((a26==17)||(a26==18))&&(input==6)))))&&(a4==18))&&(a25==1)))&&!(a3==1))){
a7 = 0;
a4 = 16;
a26 = 19;
a14 = 20;
a3 = 1;
return -1;
} else if((((((a1==1)&&((a4==17)&&((input==6)&&(((!(a7==1)&&(a26==19))&&(a14==19))||(((a26==17)&&(a7==1))&&(a14==20))))))&&(a25==1))&&(a28==15))&&(a3==1))){
a14 = 19;
a7 = 0;
a26 = 18;
a28 = 16;
return 23;
} else if((((a28==17)&&((((a3==1)&&((input==4)&&(((!(a7==1)&&(a26==19))&&(a14==18))||((a14==19)&&((a26==17)&&(a7==1))))))&&(a4==18))&&(a1==1)))&&(a25==1))){
a7 = 0;
a14 = 20;
a28 = 16;
a26 = 17;
return -1;
} else if(((a28==17)&&((a1==1)&&((a4==18)&&((a3==1)&&(((a25==1)&&(((input==6)&&!(a7==1))&&(a26==18)))&&(a14==18))))))){
a4 = 16;
a7 = 1;
a26 = 17;
a28 = 15;
return -1;
} else if(((((a3==1)&&((a14==19)&&((a28==15)&&(((a1==1)&&((input==1)&&((a26==17)||(a26==18))))&&!(a7==1)))))&&(a25==1))&&(a4==18))){
a14 = 18;
a4 = 16;
a7 = 1;
a26 = 17;
return -1;
} else if(((a1==1)&&(((a25==1)&&(((!(a3==1)&&((input==5)&&((!(a7==1)&&(a26==18))||(((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17))))))&&(a28==16))&&(a4==16)))&&(a14==19)))){
a14 = 18;
a7 = 1;
a28 = 15;
a26 = 17;
a3 = 1;
return -1;
} else if((((((a25==1)&&(((a26==18)&&((a4==18)&&((input==1)&&(a1==1))))&&(a28==15)))&&!(a3==1))&&!(a7==1))&&(a14==18))){
a7 = 1;
a26 = 17;
a3 = 1;
a4 = 16;
return -1;
} else if(((a4==17)&&((a28==16)&&(((a14==18)&&((!(a7==1)&&((a25==1)&&(((a26==18)||(a26==19))&&(input==6))))&&!(a3==1)))&&(a1==1))))){
a28 = 15;
a3 = 1;
a26 = 17;
a4 = 16;
a7 = 1;
return -1;
} else if((((a3==1)&&((a28==16)&&(((a1==1)&&((a14==18)&&(((((a26==18)&&(a7==1))||((a26==19)&&(a7==1)))||(!(a7==1)&&(a26==17)))&&(input==6))))&&(a4==17))))&&(a25==1))){
a26 = 19;
a4 = 18;
a28 = 15;
a14 = 19;
a7 = 1;
return 23;
} else if((((a25==1)&&((a1==1)&&((a4==17)&&((a3==1)&&((input==4)&&((((!(a7==1)&&(a26==18))&&(a14==18))||((a14==18)&&(!(a7==1)&&(a26==19))))||((a14==19)&&((a7==1)&&(a26==17)))))))))&&(a28==16))){
a14 = 19;
a28 = 15;
a26 = 17;
a4 = 18;
a7 = 0;
return 23;
} else if(((a14==19)&&((a25==1)&&(((a1==1)&&((((a28==15)&&((input==5)&&((a26==17)||(a26==18))))&&!(a3==1))&&!(a7==1)))&&(a4==16))))){
a3 = 1;
a14 = 18;
a7 = 1;
a26 = 17;
return -1;
} else if(((a28==16)&&((a14==18)&&((a4==16)&&((!(a3==1)&&((a25==1)&&((input==1)&&(((a7==1)&&(a26==19))||((a26==17)&&!(a7==1))))))&&(a1==1)))))){
a14 = 20;
a7 = 1;
a28 = 17;
a26 = 17;
return 26;
} else if(((((a26==19)&&((a7==1)&&((a3==1)&&((a25==1)&&((a28==15)&&((a1==1)&&(input==6)))))))&&(a14==20))&&(a4==18))){
a26 = 17;
a14 = 18;
a4 = 16;
return -1;
} else if(((((a4==17)&&((a14==19)&&((a7==1)&&(!(a3==1)&&((((a26==19)||((a26==17)||(a26==18)))&&(input==2))&&(a1==1))))))&&(a25==1))&&(a28==16))){
a28 = 17;
a7 = 0;
a26 = 17;
return 22;
} else if(((a4==17)&&(!(a3==1)&&(((a1==1)&&((input==4)&&((((!(a7==1)&&((a26==18)&&(a28==15)))&&(a14==20))||((!(a7==1)&&((a26==19)&&(a28==15)))&&(a14==20)))||(((a7==1)&&((a26==17)&&(a28==16)))&&(a14==18)))))&&(a25==1))))){
a26 = 17;
a14 = 19;
a28 = 16;
a7 = 0;
return 26;
} else if((((((((((input==3)&&(a26==17))&&(a25==1))&&(a1==1))&&(a14==20))&&!(a7==1))&&(a4==17))&&!(a3==1))&&(a28==15))){
a7 = 1;
a4 = 16;
a3 = 1;
a14 = 18;
return -1;
} else if(((((a3==1)&&((a28==17)&&((a14==19)&&((a4==17)&&((((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))&&(input==6))))))&&(a1==1))&&(a25==1))){
a28 = 15;
a26 = 17;
a7 = 1;
a4 = 16;
a14 = 18;
return -1;
} else if(((a7==1)&&((a1==1)&&((a28==17)&&((((a4==16)&&(((input==2)&&((a26==18)||(a26==19)))&&(a25==1)))&&!(a3==1))&&(a14==19)))))){
a7 = 0;
a4 = 17;
a28 = 15;
a26 = 17;
a14 = 20;
return 26;
} else if(((((a7==1)&&((a14==19)&&((a1==1)&&(!(a3==1)&&(((a4==18)&&(input==3))&&(a28==15))))))&&(a25==1))&&(a26==18))){
a26 = 17;
a28 = 16;
a14 = 20;
a3 = 1;
return 26;
} else if((((a4==17)&&((a28==17)&&((a14==20)&&((!(a7==1)&&((a1==1)&&((((a26==17)||(a26==18))||(a26==19))&&(input==6))))&&!(a3==1)))))&&(a25==1))){
a14 = 18;
a3 = 1;
a28 = 15;
a4 = 16;
a7 = 1;
a26 = 17;
return -1;
} else if(((((((a1==1)&&(((((a14==18)&&((a26==18)&&!(a7==1)))||((a14==18)&&(!(a7==1)&&(a26==19))))||(((a7==1)&&(a26==17))&&(a14==19)))&&(input==3)))&&(a3==1))&&(a4==17))&&(a28==17))&&(a25==1))){
a26 = 17;
a4 = 16;
a14 = 18;
a7 = 1;
a28 = 15;
return -1;
} else if((((a3==1)&&((a25==1)&&((a1==1)&&(((a14==18)&&((a4==18)&&((a26==18)&&(input==3))))&&(a28==17)))))&&!(a7==1))){
a28 = 15;
a4 = 16;
a7 = 1;
a26 = 17;
return -1;
} else if((((a14==19)&&((a4==17)&&((((!(a3==1)&&((input==3)&&!(a7==1)))&&(a1==1))&&(a26==19))&&(a25==1))))&&(a28==15))){
a26 = 18;
a7 = 1;
a14 = 18;
return 26;
} else if(((a4==17)&&(((a7==1)&&((((a3==1)&&((a25==1)&&((input==4)&&(a14==20))))&&(a28==15))&&(a26==18)))&&(a1==1)))){
a28 = 16;
a7 = 0;
return 24;
} else if(((a4==18)&&((a3==1)&&(((((input==2)&&((((a26==19)&&!(a7==1))&&(a14==18))||((a14==19)&&((a26==17)&&(a7==1)))))&&(a28==17))&&(a25==1))&&(a1==1))))){
a7 = 1;
a28 = 16;
a14 = 20;
a26 = 19;
return -1;
} else if(((a25==1)&&((a1==1)&&((((a26==18)&&((((a14==20)&&(input==6))&&(a3==1))&&(a4==17)))&&(a28==17))&&(a7==1))))){
a4 = 16;
a28 = 15;
a14 = 18;
a26 = 17;
return -1;
} else if(((((a26==19)&&(((((a1==1)&&((input==4)&&(a28==15)))&&!(a7==1))&&(a4==16))&&(a25==1)))&&!(a3==1))&&(a14==19))){
a26 = 17;
a3 = 1;
a14 = 18;
a7 = 1;
return -1;
} else if(((((input==2)&&((((!(a7==1)&&((a28==17)&&((a26==19)&&((a3==1)&&(a4==18)))))&&(a14==20))||((a14==18)&&((a7==1)&&((a28==15)&&((!(a3==1)&&(a4==16))&&(a26==17))))))||(((a7==1)&&((a28==15)&&((a26==18)&&((a4==16)&&!(a3==1)))))&&(a14==18))))&&(a1==1))&&(a25==1))){
a28 = 15;
a14 = 18;
a3 = 1;
a7 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if(((a4==18)&&(((a1==1)&&((!(a7==1)&&((a14==19)&&((a25==1)&&((input==2)&&((a26==17)||(a26==18))))))&&(a28==15)))&&(a3==1)))){
a26 = 18;
a14 = 20;
a28 = 17;
return 24;
} else if(((((a25==1)&&((a4==16)&&(((a14==20)&&((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))&&(input==1)))&&!(a3==1))))&&(a28==17))&&(a1==1))){
a7 = 1;
a28 = 15;
a14 = 18;
a26 = 17;
a3 = 1;
return -1;
} else if((((a4==18)&&((((a14==18)&&(((((a26==18)||(a26==19))&&(input==6))&&(a28==15))&&(a1==1)))&&(a25==1))&&(a7==1)))&&(a3==1))){
a4 = 16;
a26 = 17;
return -1;
} else if(((a3==1)&&((a25==1)&&((a28==17)&&((((input==4)&&((((a14==19)&&((a26==18)&&!(a7==1)))||((a14==19)&&(!(a7==1)&&(a26==19))))||(((a7==1)&&(a26==17))&&(a14==20))))&&(a1==1))&&(a4==17)))))){
a4 = 18;
a28 = 16;
a26 = 19;
a7 = 0;
a14 = 19;
return 23;
} else if(((((((a26==19)&&((a14==19)&&((a4==17)&&((input==6)&&(a25==1)))))&&!(a7==1))&&(a1==1))&&(a28==16))&&!(a3==1))){
a4 = 16;
a7 = 1;
a28 = 15;
a14 = 18;
a3 = 1;
a26 = 17;
return -1;
} else if(((a26==17)&&((a1==1)&&((((((!(a3==1)&&(input==3))&&(a14==18))&&(a28==17))&&!(a7==1))&&(a25==1))&&(a4==16))))){
a7 = 1;
a3 = 1;
a28 = 15;
return -1;
} else if(((a4==16)&&(((a26==17)&&((a14==19)&&(((a28==17)&&((!(a7==1)&&(input==4))&&(a1==1)))&&!(a3==1))))&&(a25==1)))){
a14 = 18;
a7 = 1;
a28 = 15;
a3 = 1;
return -1;
} else if(((a4==17)&&(((((((a1==1)&&((a3==1)&&(input==5)))&&(a14==19))&&(a7==1))&&(a26==18))&&(a25==1))&&(a28==15)))){
a14 = 20;
a26 = 19;
return 22;
} else if((!(a3==1)&&((a4==18)&&((((a14==18)&&((a28==16)&&((input==1)&&((((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))||(!(a7==1)&&(a26==18))))))&&(a25==1))&&(a1==1))))){
a14 = 19;
a26 = 18;
a7 = 1;
return 22;
} else if((((a7==1)&&((a3==1)&&((a14==20)&&((a25==1)&&((a4==17)&&(((input==6)&&(a26==18))&&(a28==15)))))))&&(a1==1))){
a26 = 17;
a7 = 0;
a28 = 16;
return 24;
} else if(((a25==1)&&(((a1==1)&&((a28==15)&&((a26==17)&&((a4==18)&&(((a14==20)&&(input==6))&&(a3==1))))))&&!(a7==1)))){
a4 = 16;
a7 = 1;
a14 = 18;
return -1;
} else if((((a4==18)&&((a3==1)&&((a28==15)&&((((a25==1)&&((a1==1)&&(input==5)))&&(a7==1))&&(a26==17)))))&&(a14==19))){
a28 = 17;
a7 = 0;
a26 = 18;
return 22;
} else if((((a26==19)&&((a1==1)&&((a14==18)&&(((((input==5)&&(a25==1))&&!(a3==1))&&(a4==16))&&(a7==1)))))&&(a28==17))){
a3 = 1;
a26 = 17;
a28 = 15;
return -1;
} else if((((a1==1)&&((a4==17)&&((a28==17)&&((a14==20)&&((!(a3==1)&&((((a26==17)||(a26==18))||(a26==19))&&(input==4)))&&(a7==1))))))&&(a25==1))){
a3 = 1;
a28 = 15;
a14 = 18;
a26 = 17;
a4 = 16;
return -1;
} else if((!(a7==1)&&((!(a3==1)&&((((a28==17)&&((a14==19)&&((a26==18)&&(input==3))))&&(a25==1))&&(a1==1)))&&(a4==16)))){
a3 = 1;
a7 = 1;
a14 = 18;
a28 = 15;
a26 = 17;
return -1;
} else if((((a4==18)&&((a14==20)&&((a26==18)&&(((a1==1)&&((a25==1)&&((a3==1)&&(input==4))))&&!(a7==1)))))&&(a28==17))){
a4 = 16;
a14 = 18;
a28 = 15;
a7 = 1;
a26 = 17;
return -1;
} else if((!(a3==1)&&((a4==18)&&(!(a7==1)&&((a25==1)&&((a28==16)&&(((a1==1)&&((input==2)&&((a26==18)||(a26==19))))&&(a14==20)))))))){
a14 = 18;
a28 = 15;
a4 = 17;
a26 = 18;
return 23;
} else if(((a4==18)&&((a26==17)&&(((a14==19)&&(((a25==1)&&(((a7==1)&&(input==3))&&(a3==1)))&&(a28==15)))&&(a1==1))))){
a4 = 16;
a14 = 18;
return -1;
} else if(((a25==1)&&(((a4==18)&&((((a3==1)&&((((a26==17)&&!(a7==1))||(((a26==18)&&(a7==1))||((a26==19)&&(a7==1))))&&(input==3)))&&(a28==16))&&(a1==1)))&&(a14==19)))){
a26 = 17;
a28 = 15;
a14 = 18;
a4 = 16;
a7 = 1;
return -1;
} else if((!(a3==1)&&(!(a7==1)&&((a25==1)&&((a1==1)&&((a28==17)&&((a14==18)&&(((input==2)&&(a26==17))&&(a4==16))))))))){
a3 = 1;
a28 = 15;
a7 = 1;
return -1;
} else if((((a14==18)&&((((a1==1)&&((a4==17)&&((((a26==19)&&(a7==1))||((a26==17)&&!(a7==1)))&&(input==1))))&&(a28==17))&&(a25==1)))&&(a3==1))){
a28 = 15;
a7 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if((((a1==1)&&((((((((!(a7==1)&&(a26==19))&&(a14==18))||(((a7==1)&&(a26==17))&&(a14==19)))||((a14==19)&&((a26==18)&&(a7==1))))&&(input==4))&&(a28==17))&&(a25==1))&&(a4==18)))&&!(a3==1))){
a26 = 18;
a14 = 19;
a7 = 1;
return 24;
} else if(((a1==1)&&(!(a3==1)&&((a4==16)&&(((a14==19)&&(((a28==17)&&(((a26==18)||(a26==19))&&(input==3)))&&(a7==1)))&&(a25==1)))))){
a14 = 18;
a28 = 15;
a3 = 1;
a26 = 17;
return -1;
} else if(((a25==1)&&((a1==1)&&((((a28==17)&&((input==5)&&((((!(a7==1)&&(a26==18))&&(a14==18))||((a14==18)&&((a26==19)&&!(a7==1))))||(((a7==1)&&(a26==17))&&(a14==19)))))&&(a3==1))&&(a4==17))))){
a14 = 18;
a28 = 15;
a7 = 1;
a4 = 16;
a26 = 17;
return -1;
} else if(((a25==1)&&((a26==18)&&(((a4==16)&&(((((input==2)&&(a28==16))&&(a1==1))&&(a7==1))&&!(a3==1)))&&(a14==18))))){
a26 = 17;
a28 = 15;
a3 = 1;
return -1;
} else if(((!(a3==1)&&((((a7==1)&&((((a14==18)&&(input==6))&&(a1==1))&&(a4==16)))&&(a26==19))&&(a28==17)))&&(a25==1))){
a28 = 15;
a26 = 17;
a3 = 1;
return -1;
} else if(((a25==1)&&(((a4==18)&&((a28==15)&&((a1==1)&&(((a26==18)&&((a3==1)&&(input==6)))&&(a7==1)))))&&(a14==19)))){
a26 = 17;
a4 = 16;
a14 = 18;
return -1;
} else if(((a14==18)&&((a25==1)&&((a28==16)&&(((((input==3)&&(((a26==18)&&!(a7==1))||(((a7==1)&&(a26==19))||(!(a7==1)&&(a26==17)))))&&(a1==1))&&(a4==18))&&!(a3==1)))))){
a28 = 15;
a3 = 1;
a26 = 17;
a7 = 1;
a4 = 16;
return -1;
} else if((((a3==1)&&((((((((a26==19)&&(a4==17))&&(a28==17))&&!(a7==1))&&(a14==20))||((a14==18)&&((((a26==17)&&(a4==18))&&(a28==15))&&(a7==1))))&&(input==6))&&(a1==1)))&&(a25==1))){
a28 = 15;
a14 = 18;
a26 = 17;
a7 = 1;
a4 = 16;
return -1;
} else if(((a14==20)&&((a1==1)&&((((a25==1)&&(((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))&&(input==5))&&(a28==17)))&&(a4==16))&&!(a3==1))))){
a7 = 1;
a14 = 18;
a26 = 17;
a28 = 15;
a3 = 1;
return -1;
} else if(((!(a3==1)&&((a7==1)&&(((((((a26==18)||(a26==19))&&(input==5))&&(a4==17))&&(a14==18))&&(a25==1))&&(a1==1))))&&(a28==15))){
a28 = 16;
a14 = 20;
a4 = 18;
a3 = 1;
a26 = 17;
return -1;
} else if((((a4==16)&&((!(a3==1)&&((a25==1)&&((((a14==20)&&((a26==18)&&(a7==1)))||((((a26==19)&&!(a7==1))&&(a14==19))||((a14==20)&&((a7==1)&&(a26==17)))))&&(input==1))))&&(a1==1)))&&(a28==16))){
a26 = 18;
a14 = 18;
a4 = 17;
a7 = 0;
a28 = 15;
return 21;
} else if(((a1==1)&&((((((a28==15)&&((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))&&(input==4)))&&(a14==19))&&!(a3==1))&&(a25==1))&&(a4==18)))){
a7 = 1;
a26 = 18;
a14 = 20;
return 24;
} else if((((!(a3==1)&&((((((((a4==16)&&(a26==18))&&(a28==17))&&!(a7==1))&&(a14==20))||((a14==20)&&((((a26==19)&&(a4==16))&&(a28==17))&&!(a7==1))))||((a14==18)&&((((a26==17)&&(a4==17))&&(a28==15))&&(a7==1))))&&(input==6)))&&(a1==1))&&(a25==1))){
a26 = 17;
a14 = 18;
a4 = 16;
a7 = 1;
a28 = 15;
a3 = 1;
return -1;
} else if((((a26==18)&&((((a14==19)&&((a25==1)&&((a1==1)&&((a4==17)&&(input==5)))))&&(a28==15))&&!(a3==1)))&&!(a7==1))){
a3 = 1;
a14 = 18;
a7 = 1;
a26 = 17;
a4 = 16;
return -1;
} else if(((a1==1)&&((a25==1)&&(((a28==17)&&(((a14==18)&&((a7==1)&&((input==2)&&(a26==18))))&&(a4==16)))&&!(a3==1))))){
return 22;
} else if((((a25==1)&&((a3==1)&&((a4==18)&&((a14==20)&&((((input==5)&&(a1==1))&&(a26==17))&&(a7==1))))))&&(a28==16))){
a4 = 16;
a14 = 18;
a28 = 15;
return -1;
} else if((((a3==1)&&((a25==1)&&((a7==1)&&((a14==18)&&((a28==17)&&((a4==17)&&((input==1)&&((a26==17)||(a26==18)))))))))&&(a1==1))){
a28 = 15;
a4 = 16;
a26 = 17;
return -1;
} else if(((a1==1)&&((a25==1)&&(!(a3==1)&&((((a14==18)&&((((a4==17)&&(a26==17))&&(a28==15))&&(a7==1)))||(((!(a7==1)&&(((a26==18)&&(a4==16))&&(a28==17)))&&(a14==20))||((a14==20)&&(!(a7==1)&&(((a4==16)&&(a26==19))&&(a28==17))))))&&(input==3)))))){
a3 = 1;
a14 = 18;
a7 = 1;
a28 = 15;
a26 = 17;
a4 = 16;
return -1;
} else if(((a28==17)&&((a14==20)&&((a4==16)&&((((a25==1)&&((((a7==1)&&(a26==19))||((a26==17)&&!(a7==1)))&&(input==3)))&&(a1==1))&&!(a3==1)))))){
a26 = 17;
a7 = 1;
a28 = 15;
a14 = 18;
a3 = 1;
return -1;
} else if((((a4==18)&&((a14==19)&&((a28==17)&&((a25==1)&&(((input==4)&&((((a26==18)&&(a7==1))||((a7==1)&&(a26==19)))||(!(a7==1)&&(a26==17))))&&(a3==1))))))&&(a1==1))){
a7 = 1;
a14 = 20;
a28 = 16;
a26 = 18;
return -1;
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==15))&&(a7==1))&&(a14==20))){
error_12: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==16))&&(a7==1))&&(a14==18))){
error_19: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==16))&&(a7==1))&&(a14==20))){
error_31: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==17))&&!(a7==1))&&(a14==18))){
error_39: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==17))&&!(a7==1))&&(a14==20))){
error_52: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==15))&&(a7==1))&&(a14==19))){
error_6: assert(0);
}
if(((((((((a3==1)&&(a4==17))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==15))&&!(a7==1))&&(a14==18))){
error_58: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==17))&&!(a7==1))&&(a14==18))){
error_40: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==15))&&!(a7==1))&&(a14==18))){
error_4: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==17))&&!(a7==1))&&(a14==18))){
error_38: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==17))&&!(a7==1))&&(a14==19))){
error_45: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==15))&&(a7==1))&&(a14==20))){
error_11: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==16))&&!(a7==1))&&(a14==19))){
error_26: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==15))&&(a7==1))&&(a14==18))){
globalError: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==15))&&!(a7==1))&&(a14==19))){
error_9: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==16))&&(a7==1))&&(a14==18))){
error_17: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==16))&&!(a7==1))&&(a14==20))){
error_32: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==17))&&(a7==1))&&(a14==18))){
error_35: assert(0);
}
if(((((((((a3==1)&&(a4==17))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==15))&&(a7==1))&&(a14==18))){
error_55: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==17))&&(a7==1))&&(a14==18))){
error_36: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==15))&&!(a7==1))&&(a14==20))){
error_14: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==16))&&(a7==1))&&(a14==18))){
error_18: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==15))&&(a7==1))&&(a14==20))){
error_13: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==15))&&!(a7==1))&&(a14==20))){
error_15: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==16))&&!(a7==1))&&(a14==19))){
error_27: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==16))&&(a7==1))&&(a14==20))){
error_30: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==17))&&!(a7==1))&&(a14==19))){
error_44: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==15))&&(a7==1))&&(a14==19))){
error_5: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==16))&&(a7==1))&&(a14==20))){
error_29: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==15))&&!(a7==1))&&(a14==18))){
error_3: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==17))&&(a7==1))&&(a14==20))){
error_47: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==17))&&!(a7==1))&&(a14==20))){
error_51: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==16))&&!(a7==1))&&(a14==20))){
error_34: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==15))&&(a7==1))&&(a14==19))){
error_7: assert(0);
}
if(((((((((a3==1)&&(a4==17))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==15))&&(a7==1))&&(a14==19))){
error_59: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==17))&&(a7==1))&&(a14==20))){
error_49: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==17))&&!(a7==1))&&(a14==19))){
error_46: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==16))&&!(a7==1))&&(a14==18))){
error_20: assert(0);
}
if(((((((((a3==1)&&(a4==17))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==15))&&!(a7==1))&&(a14==18))){
error_57: assert(0);
}
if(((((((((a3==1)&&(a4==17))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==15))&&(a7==1))&&(a14==18))){
error_53: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==16))&&!(a7==1))&&(a14==18))){
error_21: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==16))&&(a7==1))&&(a14==19))){
error_25: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==17))&&(a7==1))&&(a14==19))){
error_43: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==15))&&!(a7==1))&&(a14==20))){
error_16: assert(0);
}
if(((((((((a3==1)&&(a4==17))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==15))&&!(a7==1))&&(a14==18))){
error_56: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==15))&&(a7==1))&&(a14==18))){
error_0: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==15))&&!(a7==1))&&(a14==18))){
error_2: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==16))&&(a7==1))&&(a14==19))){
error_24: assert(0);
}
if(((((((((a3==1)&&(a4==17))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==15))&&(a7==1))&&(a14==18))){
error_54: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==16))&&(a7==1))&&(a14==19))){
error_23: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==17))&&(a7==1))&&(a14==20))){
error_48: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==15))&&!(a7==1))&&(a14==19))){
error_8: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==16))&&!(a7==1))&&(a14==19))){
error_28: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==15))&&(a7==1))&&(a14==18))){
error_1: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==15))&&!(a7==1))&&(a14==19))){
error_10: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==17))&&(a7==1))&&(a14==19))){
error_41: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==16))&&!(a7==1))&&(a14==20))){
error_33: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==16))&&!(a7==1))&&(a14==18))){
error_22: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==18))&&(a28==17))&&(a7==1))&&(a14==19))){
error_42: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==19))&&(a28==17))&&(a7==1))&&(a14==18))){
error_37: assert(0);
}
if(((((((((a3==1)&&(a4==16))&&(a25==1))&&(a1==1))&&(a26==17))&&(a28==17))&&!(a7==1))&&(a14==20))){
error_50: assert(0);
}
return -2;
}
int main()
{
// default output
int output = -1;
// main i/o-loop
while(1)
{
// read input
int input;
scanf("%d", &input);
// operate eca engine
output = calculate_output(input);
if(output == -2)
fprintf(stderr, "Invalid input: %d\n", input);
else if(output != -1)
printf("%d\n", output);
}
}
|
the_stack_data/134575.c | /*
* Copyright (c) 2020-2021 Xuhpclab. All rights reserved.
* Licensed under the MIT License.
* See LICENSE file for more information.
*/
#include <stdio.h>
static int exe_num = 0;
void moo() {
for(int i = 0; i < 100; i++){
exe_num ++;
}
return;
}
void foo() {
for(int i = 0; i < 10000; i++){
moo();
}
}
int main(){
foo();
for(int i = 0; i < 20000; i++){
moo();
}
return 0;
} |
the_stack_data/45449692.c | #include <stdio.h>
#include <math.h>
#include <assert.h>
#include <stdlib.h>
#define byte unsigned char
#define uint16 unsigned short
#define uint unsigned int
#define uint64 unsigned long long
#define real double
#define bool uint
#define TRUE (0<1)
#define FALSE (1<0)
/****
Code by Warren D. Smith, Dec 2011, to implement Lehman integer-factorization
algorithm. Rigorous O(N^(1/3)) step factoring (also prime-proving) algorithm
invented by RS Lehman 1974.
COMPILE:
========
gcc LehmanClean.c -Wall -O6 -o lehcl
gcc LehmanClean.c -Wall -DNDEBUG -O6 -o lehcl
SPEED:
======
79 microsec avg factor time for "hard" 43-bit integers (zero failures in
1 million factorizations tested) using LehTune=3.0 and HartOLF=FALSE (DoTrial=FALSE)
on Apple iMac 2.0 GHz intel core duo. If DoTrial=TRUE then 190 microsec avg factor time.
In contrast, a (poor) implementation of SQUFOF that I stole from Dario Alpern plus
then improved to speed up its inner loop, performs the same 1 million factorizations
in 82 microsec avg factor time but with a 4.5% failure rate. I think the best SQUFOF
implementations run about 1.5X faster and fail way less often than mine. One way
to reduce SQUFOF's failure rate is to add a trial division (TD) stage to it; but mine
has no trial division.
"Hard" Ns are products of two random primes with half the number of bits each.
Average factoring times to factor "hard" Ns:
#bits..LEHMAN(TD).......LEHMAN(No TD)....PoorSQUFOF
43.....190(tune=2.8)....85.9(tune=3.0)...82usec(4.5% fail)
42.....152..............56.8(tune=4.0)...69....(4.6% fail)
41.....122..............41.5(tune=5.0)...58....(4.6% fail)
40......98..............31.8(tune=6.0)...49....(4.7% fail)
39......79..............24.3(tune=6.0)...41.5..(4.8% fail)
38......63..............18.7(tune=6.0)...35....(4.9% fail)
37......51(tune=2.8)....14.2(tune=6.0)...30....(4.9% fail)
All Lehman runs shown have zero failures in 1 million factorizations.
(A "failure" is failing to return a valid nontrivial factor of a composite N,
or failing to return N when N is prime, though all our N in this test are composite.
Lehman *without* TD *would* sometimes fail if given "easy" N, but all N in this test hard.)
Above Lehman runs with ASSERTs turned on; turning them off will speed up Lehman 3-11%, e.g.
the following are (re)done with asserts off:
#bits..LEHMAN(full TD)..LEHMAN(No TD)....PoorSQUFOF
43.....182(tune=2.8)....78.9(tune=3.0)...82usec(4.5% fail)
37......49.4(tune=2.8)..13.9(tune=6.0)...30....(4.9% fail)
36......39.8(tune=2.8)..10.5(tune=6.0)...25.4..(5.0% fail)
35......32.1(tune=2.8)..7.26(tune=7.0)...21.6..(5.1% fail)
34......25.7(tune=2.65)..................18.6..(5.3% fail)
33......20.8(tune=2.8)...................16.1..(5.3% fail)
32......16.8(tune=2.8)...................13.9..(5.6% fail)
31......13.48(tune=2.65).................11.7..(5.6% fail)
30......10.91(tune=2.65)..................9.22.(5.6% fail)
29......8.88(tune=2.65)...................7.32.(6.2% fail)
28......7.15(tune=2.65)...................6.13.(6.7% fail)
EFFECT OF W.B.HART'S (APPARENTLY USELESS) OLF SPEEDUP HEURISTIC:
=================================================================
All above runs with with HartOLF=0. If we turn it on, here is what happens:
32-bit hard N, asserts off, Tune=2.75, TD=TRUE:
HartOLF: 0 0.001 0.01 0.1 0.2 0.4 0.8
AvgTime: 16.73 16.72 17.23 18.69 19.15 19.54 19.87 usec.
40-bit hard N, asserts off, Tune=2.75, TD=FALSE:
HartOLF: 0 0.01 0.1 0.2 0.4 0.8
AvgTime: 41.52 42.17 51.31 53.64 55.13 57.04
As you can see, directly contradicting Hart's paper's claim that HartOLF will
speed up Lehman dramatically (he says as much as 500%),
I actually find that HartOLF always makes it slower, and the
more OLFing you do, the worse it gets, monotonically. This is for "hard N." I've
also tested other N-distributions; and with the others, HartOLF looks even worse than
it does here. (With old versions of this code I was occasionally able to find some
locales where HartOLF helped slightly, but with the current version I know of no such locale.)
HUGE WIN USING CutFrac=0.1:
===========================
All above runs were using CutFrac=1.0 and are disappointing if DoTrial=TRUE.
However, it then occurred to me that we could employ CutFrac=0.1 to get a
speedup. Using 0.1, Lehman will omit the last 90% of the trial factoring then just go directly
to square-finding. If square finding fails (which is rare), Lehman then returns to
trial dividing to do the missing 90%. Here is what happens:
40-bit hard composite N, asserts off, Tune=2.75:
CutFrac: 1.0 0.1 0.05 NoTrialDivision RECOMMENDED(0.1)
Time: 93.7 48.27 45.12 41.4 48.27
40-bit random N not divisible by 2 or 3 (include many prime N), asserts off, Tune=2.75:
CutFrac: 1.0 0.4 0.2 0.1 0.01 RECOMMENDED(0.1)
Time: 24.66 25.16 26.29 27.91 35.06 27.91
40-bit N=A*B, where A,B 20-bit randoms not divisible by 2 or 3, asserts off, Tune=2.75:
FirstCut: 1.0 0.8 0.6 0.4 0.2 0.1 0.01 RECOMMENDED(0.1)
Time: 28.22 27.99 27.81 27.85 28.61 29.95 38.26 29.95
For most serious uses of Lehman you are going to apply a pseudoprimality test before
trying to factor N so that N will almost always be composite. I therefore
recommend CutFrac=0.1 for general purpose use.
With CutFrac=0.1, Lehman is clearly superior to my SQUFOF for 42-bit integers (or less).
(For 43 bits, it may be debatable which is superior.)
For Ben Buhrman's best-in-world SQUFOF implementation, the crossover point also
appears to be 43 bits provided optimum tuning and CutFrac both are employed by Lehman.
(However that claim is preliminary and Buhrman may do more testing later.)
TESTING:
========
(Some of these comments about tests may be out of date since pertain to older code versions,
but hopefully still true.)
Experimentally: Always returns N if N=prime<65536 and DoTrial=FALSE and 0.1<=Tune<=9.6.
But: If Tune<=0.8 then the gcd(a+b, N) can return N as its mode of success if N=3.
I.e. the theorem that the special prime-detect return always will fire for N prime can thus
be violated if Tune<0.8 and N=3 (but still correctly returns N in these cases), but it's
valid if Tune>=0.8 and N>2.
Also valid if Tune>=0.25 and N>31.
Also valid if Tune>=0.10 and N>83.
Current code forces trial division for primes<=83 unless explicitly turned off.
Using Tune too large will cause error exits galore due to overflows. Do not use
Tune>9, that regime seems useless at best and bogus at worst. Tune=2.8 to 9.0
can cause overflow if N is large enough.
High end: if N < 2^43.000049 = 8796393022207 then with good choice of Tune
integer overflows are extremely rare.
But I nevertheless have seen such rare overflows with some code versions and some parameters
for N as small as 1991049599221 = 2^40.85
but I currently believe that the rare overflows that arise for N<2^43.01 do not
ever hurt correctness. (Comments inside code discuss why I believe that.)
Factor Validity: testing 100 million N with N=A*B with
2611953 <= A <= B <= 2965920
LehmanFactor always succeeded in factoring.
This is highly reassuring but could be deceptive since
(a) changing the tuning constants could alter the failure set.
(b) It appears that Lehman can be sensitive to the distribution of N and
there are "hard locales" and "easy locales" which are not obvious.
***/
byte issq1024[1024];
byte issq4199[4199];
uint64 gcd64(uint64 a, uint64 b){
uint64 t;
if(a<b){ t=b; b=a; a=t; }
while(b != 0){
t = b;
b = a % b;
a = t;
}
return( a );
}
void MakeIssq(){
int i;
for(i=0; i<1024; i++){ issq1024[i] = 0; }
for(i=0; i<1024; i++){ issq1024[(i*i)%1024] = 1; }
for(i=0; i<4199; i++){ issq4199[i] = 0; }
for(i=0; i<3465; i++){ issq4199[(i*i)%3465] |= 2; }
for(i=0; i<4199; i++){ issq4199[(i*i)%4199] |= 1; }
printf("Square tables built.\n");
}
uint16 prime[6543]; //the 6542 primes up to 65536=2^16, then sentinel 65535 at end
void MakePrimeTable(){
uint i,j,k;
prime[0]=2;
prime[1]=3;
prime[2]=5;
k=3;
for(i=7; i<65536; i+=2){
for(j=0; prime[j]*(uint)prime[j] <= i; j++){
if(i%prime[j]==0) goto NONPRIME;
}
prime[k]=i;
k++;
NONPRIME: ;
}
assert(k==6542);
prime[k] = 65535; //sentinel
printf("Prime table[0..%d] built: ", k);
for(i=0; i<20; i++){ printf("%d,", prime[i]); }
printf("%d,...,%d,(%d)\n", prime[20],prime[6541],prime[6542]);
}
uint64 LehmanFactor(uint64 N, real Tune, real HartOLF, bool DoTrial, real CutFrac){
uint b,p,k,r,B,U,Bred,Bred2,inc,FirstCut,ip;
uint64 a,c,kN,kN4,B2,N480,UU;
real Tune2, Tune3, x;
if((N&1)==0) return(2); //N is even
if(Tune<0.1){
printf("Sorry0, Lehman only implemented for Tune>=0.1\n");
return(0);
}
B = Tune * cbrt((real)N);
FirstCut = CutFrac*B;
if(FirstCut<84){ FirstCut=84; } //assures prime N will not activate "wrong" Lehman return
if(FirstCut>65535){ FirstCut = 65535; }
if(DoTrial){
for(ip=1; ; ip++){ //trial division
p = prime[ip];
if(p>=FirstCut) break;
if(N%p==0) return(p);
}
}
if(N>=8796393022207ull){
printf("Sorry1, Lehman only implemented for N<8796393022207\n");
return(0);
}
Tune2 = Tune*Tune;
Tune3 = Tune2*Tune;
Bred = B / Tune3;
if(HartOLF>0.0){ // Hart's "OLF" algorithm is tried to get more speed on average...?
assert(gcd64(480ull, N)==1);
N480 = N*480;
UU = 18446744073709551615ull / N480;
Bred2 = B * HartOLF;
if(UU>Bred2) UU=Bred2;
UU *= N480;
for(kN=N480; kN<UU; kN+=N480){
a = sqrt((real)kN)+0.999999999999999;
c = (uint64)a*(uint64)a-kN;
assert(c>=0);
if(issq1024[c&1023]){
if(issq4199[c%3465]&2){
if(issq4199[c%4199]&1){
b = sqrt(c+0.9);
if(b*b==c){
if(a>=b){
B2 = gcd64((uint64)(a-b), N);
if(1<B2 && B2<N){ return(B2); }
}
B2 = gcd64((uint64)(a+b), N);
if(1<B2 && B2<N){ return(B2); }
}
}
}
}
}
}
B2 = B*B;
kN = 0;
//Lehman suggested (to get more average speed) trying highly-divisible k first. However,
//my experiments on trying to to that have usually slowed things down versus this simple loop:
for(k=1; k<=Bred; k++){
if(k&1){ inc=4; r=(k+N)%4; }else{ inc=2; r=1; }
kN += N;
assert(kN == k*N);
if(kN >= 1152921504606846976ull){
printf("Sorry2, overflow, N=%llu is too large\n", N);
return(0);
}
//Actually , even if overflow occurs here, one could still use approximate
//arithmetic to compute kN4's most-signif 64 bits only, then still exactly compute x...
//With appropriate code alterations is should be possible to extent the range... but
//I have not tried that idea for trying to "cheat" to gain more precision.
kN4 = kN*4;
x = sqrt((real)kN);
a = x;
if((uint64)a*(uint64)a==kN){
B2 = gcd64((uint64)a, N);
assert(B2>1);
assert(B2<N);
return(B2);
}
x *= 2;
a = x+0.9999999665; //very carefully chosen.
//Let me repeat that: a = x+0.9999999665. Really.
b=a%inc; b = a + (inc+r-b)%inc; //b is a but adjusted upward to make b%inc=r.
assert( b%inc == r );
assert( b>=a );
assert( b<=a+4 );
c = (uint64)b*(uint64)b - kN4; //this is the precision bottleneck.
//At this point, I used to do a test:
//if( c+kN4 != (uint64)b*(uint64)b ) //overflow-caused failure: exit!
// printf("Sorry3, unrepairable overflow, N=%llu is too large\n", N);
// return(0);
//However, I've now reconsidered. I claim C language computes c mod 2^64 correctly.
//If overflow happens, this is irrelevant because c is way smaller than 2^64, kN4, and b*b.
//Hence c should be correct, despite the overflow. Hence I am removing this error-exit.
U = x + B2/(2*x);
//old code was U = sqrt((real)(B2+kN4+0.99)); and was 4% slower.
//Below loop is: for(all integers a with 0<=a*a-kN4<=B*B and with a%inc==r)
for(a=b; a<=U; c+=inc*(a+a+inc), a+=inc ){
//again, even though this assert can fail due to overflow, that overflow should not matter:
//assert( c == (uint64)a*(uint64)a-kN4 );
/** Programming trick: naive code: c = a*a-kN4;
In the inner loop c is bounded between 0 and T^2*N^(2/3)
and can be updated additively by adding inc*(anew+aold) to it
when we update a to anew=a+inc. This saves a multiplication in
the inner loop and/or allows us to reduce precision. **/
if(issq1024[c&1023]){
if(issq4199[c%3465]&2){
if(issq4199[c%4199]&1){
b = sqrt(c + 0.9);
if(b*b==c){ //square found
B2 = gcd64((uint64)(a+b), N);
assert(B2>1);
if(B2>=N){ printf("theorem failure: B2=%llu N=%llu\n", B2,N); }
return(B2);
}
}
}
}
}
}
//square-finding has failed so resume missing part of trial division:
if(DoTrial){
if(B>65535) B = 65535;
for( ; ; ip++){
p = prime[ip];
if(p>=B) break;
if(N%p==0) return(p);
}
}
return(N); //N is prime
}
main(){
uint64 N, M;
MakeIssq();
MakePrimeTable();
//Here are some typical calls to LehmanFactor.
// LehmanFactor(N, (tune from 0.1 to 9.6), (tune from 0 to 5.0),
// (TRUE unless want to skip trial factoring which would be unusual),
// (TRUE if want to try OLF speculative speedup FALSE if skip it) );
N=3141592651ull;
M = LehmanFactor(N, 2.5, 0.0, TRUE, 0.4);
printf("A factor of %llu is %llu.\n", N, M);
N=3141592661ull; //prime
M = LehmanFactor(N, 2.5, 0.0, TRUE, 0.5);
printf("A factor of %llu is %llu.\n", N, M);
N = 7919; N *= 10861;
M = LehmanFactor(N, 1.0, 0.0, TRUE, 0.1);
printf("A factor of %llu is %llu.\n", N, M);
N = 1299709; N *= 2750159;
M = LehmanFactor(N, 1.0, 0.0, FALSE, 0.1);
printf("A factor of %llu is %llu.\n", N, M);
printf("All done.\n");
}
|
the_stack_data/964603.c | /*
* String manipulation functions
* Created by: Marco Túlio
* */
#include <stdio.h>
#include <stdlib.h>
/* Function to get a delimiter from an string */
int str_get_rowNumber(char *array, char delimiter)
{
int pos, count_row;
pos = count_row = 0;
for (pos=0; array[pos]!='\0'; pos++)
if (array[pos] == delimiter)
count_row++;
// check line is not finishing with delimiter. Eg. delimiter=',': [A,B,]
if (array[pos-1]!=delimiter)
count_row++;
return count_row;
}
int main(void)
{
char array[] = "10,20,30,a";
printf("%d", str_get_rowNumber(array, ','));
exit (0);
}
|
the_stack_data/136826.c | void print_diagonal(int n);
int main(void)
{
print_diagonal(0);
print_diagonal(2);
print_diagonal(10);
print_diagonal(-4);
return (0);
}
|
the_stack_data/18888312.c | /*
* Copyright 1993-2020 NVIDIA Corporation. All rights reserved.
*
* NOTICE TO LICENSEE:
*
* This source code and/or documentation ("Licensed Deliverables") are
* subject to NVIDIA intellectual property rights under U.S. and
* international Copyright laws.
*
* These Licensed Deliverables contained herein is PROPRIETARY and
* CONFIDENTIAL to NVIDIA and is being provided under the terms and
* conditions of a form of NVIDIA software license agreement by and
* between NVIDIA and Licensee ("License Agreement") or electronically
* accepted by Licensee. Notwithstanding any terms or conditions to
* the contrary in the License Agreement, reproduction or disclosure
* of the Licensed Deliverables to any third party without the express
* written consent of NVIDIA is prohibited.
*
* NOTWITHSTANDING ANY TERMS OR CONDITIONS TO THE CONTRARY IN THE
* LICENSE AGREEMENT, NVIDIA MAKES NO REPRESENTATION ABOUT THE
* SUITABILITY OF THESE LICENSED DELIVERABLES FOR ANY PURPOSE. IT IS
* PROVIDED "AS IS" WITHOUT EXPRESS OR IMPLIED WARRANTY OF ANY KIND.
* NVIDIA DISCLAIMS ALL WARRANTIES WITH REGARD TO THESE LICENSED
* DELIVERABLES, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY,
* NONINFRINGEMENT, AND FITNESS FOR A PARTICULAR PURPOSE.
* NOTWITHSTANDING ANY TERMS OR CONDITIONS TO THE CONTRARY IN THE
* LICENSE AGREEMENT, IN NO EVENT SHALL NVIDIA BE LIABLE FOR ANY
* SPECIAL, INDIRECT, INCIDENTAL, OR CONSEQUENTIAL DAMAGES, OR ANY
* DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS,
* WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS
* ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE
* OF THESE LICENSED DELIVERABLES.
*
* U.S. Government End Users. These Licensed Deliverables are a
* "commercial item" as that term is defined at 48 C.F.R. 2.101 (OCT
* 1995), consisting of "commercial computer software" and "commercial
* computer software documentation" as such terms are used in 48
* C.F.R. 12.212 (SEPT 1995) and is provided to the U.S. Government
* only as a commercial end item. Consistent with 48 C.F.R.12.212 and
* 48 C.F.R. 227.7202-1 through 227.7202-4 (JUNE 1995), all
* U.S. Government End Users acquire the Licensed Deliverables with
* only those rights set forth herein.
*
* Any use of the Licensed Deliverables in individual and commercial
* software must include, in the user documentation and internal
* comments to the code, the above Disclaimer and U.S. Government End
* Users Notice.
*/
#include <cuda_runtime_api.h> // cudaMalloc, cudaMemcpy, etc.
#include <cusparse.h> // cusparseSpMV
#include <stdio.h> // printf
#include <stdlib.h> // EXIT_FAILURE
#define CHECK_CUDA(func) \
{ \
cudaError_t status = (func); \
if (status != cudaSuccess) { \
printf("CUDA API failed at line %d with error: %s (%d)\n", \
__LINE__, cudaGetErrorString(status), status); \
return EXIT_FAILURE; \
} \
}
#define CHECK_CUSPARSE(func) \
{ \
cusparseStatus_t status = (func); \
if (status != CUSPARSE_STATUS_SUCCESS) { \
printf("CUSPARSE API failed at line %d with error: %s (%d)\n", \
__LINE__, cusparseGetErrorString(status), status); \
return EXIT_FAILURE; \
} \
}
int main(void) {
// Host problem definition
const int A_num_rows = 4;
const int A_num_cols = 4;
const int A_num_nnz = 9;
int hA_csrOffsets[] = { 0, 3, 4, 7, 9 };
int hA_columns[] = { 0, 2, 3, 1, 0, 2, 3, 1, 3 };
float hA_values[] = { 1.0f, 2.0f, 3.0f, 4.0f, 5.0f,
6.0f, 7.0f, 8.0f, 9.0f };
float hX[] = { 1.0f, 2.0f, 3.0f, 4.0f };
float hY[] = { 0.0f, 0.0f, 0.0f, 0.0f };
float hY_result[] = { 19.0f, 8.0f, 51.0f, 52.0f };
float alpha = 1.0f;
float beta = 0.0f;
//--------------------------------------------------------------------------
// Device memory management
int *dA_csrOffsets, *dA_columns;
float *dA_values, *dX, *dY;
CHECK_CUDA( cudaMalloc((void**) &dA_csrOffsets,
(A_num_rows + 1) * sizeof(int)) )
CHECK_CUDA( cudaMalloc((void**) &dA_columns, A_num_nnz * sizeof(int)) )
CHECK_CUDA( cudaMalloc((void**) &dA_values, A_num_nnz * sizeof(float)) )
CHECK_CUDA( cudaMalloc((void**) &dX, A_num_cols * sizeof(float)) )
CHECK_CUDA( cudaMalloc((void**) &dY, A_num_rows * sizeof(float)) )
CHECK_CUDA( cudaMemcpy(dA_csrOffsets, hA_csrOffsets,
(A_num_rows + 1) * sizeof(int),
cudaMemcpyHostToDevice) )
CHECK_CUDA( cudaMemcpy(dA_columns, hA_columns, A_num_nnz * sizeof(int),
cudaMemcpyHostToDevice) )
CHECK_CUDA( cudaMemcpy(dA_values, hA_values, A_num_nnz * sizeof(float),
cudaMemcpyHostToDevice) )
CHECK_CUDA( cudaMemcpy(dX, hX, A_num_cols * sizeof(float),
cudaMemcpyHostToDevice) )
CHECK_CUDA( cudaMemcpy(dY, hY, A_num_rows * sizeof(float),
cudaMemcpyHostToDevice) )
//--------------------------------------------------------------------------
// CUSPARSE APIs
cusparseHandle_t handle = NULL;
cusparseSpMatDescr_t matA;
cusparseDnVecDescr_t vecX, vecY;
void* dBuffer = NULL;
size_t bufferSize = 0;
CHECK_CUSPARSE( cusparseCreate(&handle) )
// Create sparse matrix A in CSR format
CHECK_CUSPARSE( cusparseCreateCsr(&matA, A_num_rows, A_num_cols, A_num_nnz,
dA_csrOffsets, dA_columns, dA_values,
CUSPARSE_INDEX_32I, CUSPARSE_INDEX_32I,
CUSPARSE_INDEX_BASE_ZERO, CUDA_R_32F) )
// Create dense vector X
CHECK_CUSPARSE( cusparseCreateDnVec(&vecX, A_num_cols, dX, CUDA_R_32F) )
// Create dense vector y
CHECK_CUSPARSE( cusparseCreateDnVec(&vecY, A_num_rows, dY, CUDA_R_32F) )
// allocate an external buffer if needed
CHECK_CUSPARSE( cusparseSpMV_bufferSize(
handle, CUSPARSE_OPERATION_NON_TRANSPOSE,
&alpha, matA, vecX, &beta, vecY, CUDA_R_32F,
CUSPARSE_MV_ALG_DEFAULT, &bufferSize) )
CHECK_CUDA( cudaMalloc(&dBuffer, bufferSize) )
// execute SpMV
CHECK_CUSPARSE( cusparseSpMV(handle, CUSPARSE_OPERATION_NON_TRANSPOSE,
&alpha, matA, vecX, &beta, vecY, CUDA_R_32F,
CUSPARSE_MV_ALG_DEFAULT, dBuffer) )
// destroy matrix/vector descriptors
CHECK_CUSPARSE( cusparseDestroySpMat(matA) )
CHECK_CUSPARSE( cusparseDestroyDnVec(vecX) )
CHECK_CUSPARSE( cusparseDestroyDnVec(vecY) )
CHECK_CUSPARSE( cusparseDestroy(handle) )
//--------------------------------------------------------------------------
// device result check
CHECK_CUDA( cudaMemcpy(hY, dY, A_num_rows * sizeof(float),
cudaMemcpyDeviceToHost) )
int correct = 1;
for (int i = 0; i < A_num_rows; i++) {
if (hY[i] != hY_result[i]) { // direct floating point comparison is not
correct = 0; // reliable
break;
}
}
if (correct)
printf("spmv_csr_example test PASSED\n");
else
printf("spmv_csr_example test FAILED: wrong result\n");
//--------------------------------------------------------------------------
// device memory deallocation
CHECK_CUDA( cudaFree(dBuffer) )
CHECK_CUDA( cudaFree(dA_csrOffsets) )
CHECK_CUDA( cudaFree(dA_columns) )
CHECK_CUDA( cudaFree(dA_values) )
CHECK_CUDA( cudaFree(dX) )
CHECK_CUDA( cudaFree(dY) )
return EXIT_SUCCESS;
}
|
the_stack_data/176707023.c | #include <stdio.h>
#include <stdlib.h>
#include <string.h>
void rref(int row, int col, double mat[][col]) {
int i = 0, j = 0, t, p;
double matTJ, matIJ, temp;
while (i < row && j < col) {
if (mat[i][j] != 0) {
for (t = i + 1; t < row; t++) {
if (mat[i][j] != 0) {
matTJ = mat[t][j];
for (p = j; p < col; p++) {
mat[t][p] -= matTJ * mat[i][p] / mat[i][j];
}
}
}
matIJ = mat[i][j];
for (p = j; p < col; p++) {
mat[i][p] /= matIJ;
}
for (t = 0; t < i; t++) {
matTJ = mat[t][j];
for (p = j; p < col; p++) {
mat[t][p] -= mat[i][p] * matTJ;
}
}
i++;
j++;
} else {
for (t = i + 1; t < row; t++) {
if (mat[t][j] != 0) {
break;
}
}
if (t == row) {
j++;
} else {
for (p = j; p < col; p++) {
temp = mat[t][p];
mat[t][p] = mat[i][p];
mat[i][p] = temp;
}
}
}
}
}
|
the_stack_data/206393793.c | #include <unistd.h>
unsigned alarm(unsigned seconds) {
return 0;
}
|
the_stack_data/18959.c | #include <stdio.h>
#include <stdlib.h>
#include <string.h>
#include <sys/stat.h>
#include <elf.h>
#define BASE_ADDR 0x08000000
#define N_PROGRAM_HEADER 1
#define N_SECTION_HEADER 0
#define HEADER_SIZE (sizeof(Elf32_Ehdr) + sizeof(Elf32_Phdr) * N_PROGRAM_HEADER)
int
main(void)
{
unsigned int str_addr = BASE_ADDR + HEADER_SIZE + 30;
Elf32_Ehdr ehdr;
Elf32_Phdr phdr;
char code[] =
/* mov $0x04,%eax */
"\xb8\x04\x00\x00\x00"
/* mov $0x0d,%edx */
"\xba\x0d\x00\x00\x00"
/* mov $0x********,%ecx */
"\xb9\x00\x00\x00\x00"
/* mov $0x01,%ebx */
"\xbb\x01\x00\x00\x00"
/* int 0x80 */
"\xcd\x80"
/* mov 0x04,%eax */
"\xb8\x01\x00\x00\x00"
/* dec %ebx */
"\x4b"
/* int 0x80 */
"\xcd\x80"
/* String data */
"Hello World!\n";
FILE *f = fopen("a.out", "wb");
if (f == NULL) {
fputs("Failed to open a.out\n", stderr);
return EXIT_FAILURE;
}
/* ELF header */
memset(ehdr.e_ident, 0, sizeof(ehdr.e_ident));
ehdr.e_ident[EI_MAG0] = ELFMAG0;
ehdr.e_ident[EI_MAG1] = ELFMAG1;
ehdr.e_ident[EI_MAG2] = ELFMAG2;
ehdr.e_ident[EI_MAG3] = ELFMAG3;
ehdr.e_ident[EI_CLASS] = ELFCLASS32;
ehdr.e_ident[EI_DATA] = ELFDATA2LSB;
ehdr.e_ident[EI_VERSION] = EV_CURRENT;
ehdr.e_ident[EI_OSABI] = ELFOSABI_LINUX;
ehdr.e_ident[EI_ABIVERSION] = 0x00;
ehdr.e_ident[EI_PAD] = 0x00;
ehdr.e_type = ET_EXEC;
ehdr.e_machine = EM_386;
ehdr.e_version = EV_CURRENT;
ehdr.e_entry = BASE_ADDR + HEADER_SIZE;
ehdr.e_phoff = sizeof(Elf32_Ehdr);
ehdr.e_shoff = 0;
ehdr.e_flags = 0x00000000;
ehdr.e_ehsize = sizeof(Elf32_Ehdr);
ehdr.e_phentsize = sizeof(Elf32_Phdr);
ehdr.e_phnum = N_PROGRAM_HEADER;
ehdr.e_shentsize = 0;
ehdr.e_shnum = N_SECTION_HEADER;
ehdr.e_shstrndx = SHN_UNDEF;
fwrite(&ehdr, sizeof(ehdr), 1, f);
/* Program header */
phdr.p_type = PT_LOAD;
phdr.p_flags = PF_R | PF_X;
phdr.p_offset = 0x00000000;
phdr.p_vaddr = BASE_ADDR;
phdr.p_paddr = BASE_ADDR;
phdr.p_filesz = HEADER_SIZE + sizeof(code);
phdr.p_memsz = HEADER_SIZE + sizeof(code);
phdr.p_align = 0x00000100;
fwrite(&phdr, sizeof(phdr), 1, f);
/* Put string data address into code */
memcpy(code + 11, &str_addr, sizeof(str_addr));
/* Write .text section */
fwrite(code, 1, sizeof(code), f);
fclose(f);
f = NULL;
/* Show file size */
printf("Size of a.out: %u bytes\n", HEADER_SIZE + sizeof(code));
fflush(stdout);
/* Give execution permission */
chmod("a.out", 0755);
/* Execute created binary */
system("./a.out");
return EXIT_SUCCESS;
}
|
the_stack_data/71093.c | #include <stdio.h>
#include <stdlib.h>
#include <string.h>
#define here m[0]
#define rp m[1]
/* m[2] /* Always zero. Fake word for pushint. */
#define _x m[3]
#define _y m[4]
#define _z m[5]
#define c m[here++] =
char tokens[5000] = ":\0immediate\0_read\0@\0!\0-\0*\0/\0<0\0exit\0echo\0key\0_pick";
int tokens_size = 64;
int m[20000] = {32};
int last_word = 1;
int ip;
int data_stack[500];
int *sp = data_stack;
int w;
int top_of_stack;
void
add_word(int x)
{
/* Index of previous word definition in dictionary. */
c last_word;
/* Advance last_word to this word. */
last_word = here-1;
/* Save index of word's textual name. */
c tokens_size;
/* Code pointer of primative that implements the word. */
c x;
(void) scanf("%s", tokens + tokens_size);
tokens_size += strlen(tokens + tokens_size) + 1;
}
void
r(int x)
{
switch (m[x++]) {
case 5:
/* internal _read part 2 */
for (w = scanf("%s", tokens) < 1 ? exit(0),0 : last_word; strcmp(tokens, &tokens[m[w+1]]) != 0; w = m[w])
;
w-1 ? r(w+2) : (c 2, c atoi(tokens));
break;
case 12:
/* exit ( R: x -- ; ip = x ) return from call */
ip = m[rp--];
break;
case 15:
/* _pick ( x -- y ) nth element from top of stack */
top_of_stack = sp[-top_of_stack];
break;
case 1:
/* _read; read a space-delimited word, find it in the
* dictionary, and compile a pointer to that word's
* code pointer onto the current end of the dictionary.
*/
c x;
break;
case 9:
/* * ( n1 n2 -- n3 ) multiply */
top_of_stack *= *sp--;
break;
case 7:
/* ! ( x a-addr -- ) store */
m[top_of_stack] = *sp--;
top_of_stack = *sp--;
break;
case 0:
/* pushint ( -- n1 ) push literal value */
*++sp = top_of_stack;
top_of_stack = m[ip++];
break;
case 8:
/* - ( n1 n2 -- n3 ) subtract */
top_of_stack = *sp-- - top_of_stack;
break;
case 2:
/* run me ( R: -- ip ; ip = x ) call */
m[++rp] = ip;
ip = x;
break;
case 11:
/* <0 ( n1 -- bool ) less than zero */
top_of_stack = 0 > top_of_stack;
break;
case 4:
/* immediate; when used immediately after a name following a ':',
* makes the word being defined run whenever it is typed.
*/
here -= 2;
c 2;
break;
case 6:
/* @ ( a-addr -- x ) fetch */
top_of_stack = m[top_of_stack];
break;
case 10:
/* / ( n1 n2 -- n3 ) divide */
top_of_stack = *sp-- / top_of_stack;
break;
case 3:
/* : define word; read in the next space-delimited word,
* add it to the end of our string storage, and generate
* a header for the new word so that when it is typed it
* compiles a pointer to itself so that it can be executed.
*/
add_word(1);
c 2;
break;
case 13:
/* echo ( c1 -- ) */
putchar(top_of_stack);
top_of_stack = *sp--;
break;
case 14:
/* key ( -- x ) */
*++sp = top_of_stack;
top_of_stack = getchar();
}
}
int
main(int argc, char **argv)
{
add_word(3);
add_word(4);
add_word(1);
w = here;
c 5;
c 2;
ip = here;
c w;
c ip-1;
for (w = 6; w < 16; ) {
add_word(1);
c w++;
}
/* Start of return_stack. */
rp = here;
here += 512;
for (;;)
r(m[ip++]);
return 0;
}
|
the_stack_data/20449261.c | // Variadic macro argument counting and overloading
// This specific example is meant to provide a simple interface for allocating
// VLAs on the heap. It comes also with a sample code.
// References:
// <http://stackoverflow.com/questions/5365440/variadic-macro-trick>
// <http://efesx.com/2010/07/17/variadic-macro-to-count-number-of-arguments/>
// This only works for 7 arguments, but can be expanded
// Alexandre Lopes
#define VA_NARGS_IMPL(_1, _2, _3, _4, _5, _6, _7, N, ...) N
#define VA_NARGS(...) VA_NARGS_IMPL(__VA_ARGS__, 7, 6, 5, 4, 3, 2, 1)
#define ALLOCATE_IMPL2(count, ...) ALLOCATE ## count (__VA_ARGS__)
#define ALLOCATE_IMPL(count, ...) ALLOCATE_IMPL2(count, __VA_ARGS__)
#define ALLOCATE(...) ALLOCATE_IMPL(VA_NARGS(__VA_ARGS__), __VA_ARGS__)
#define ALLOCATE1(ARRAY)
#define ALLOCATE2(ARRAY, DIM1) double (*ARRAY) = malloc((sizeof *ARRAY) * DIM1);
#define ALLOCATE3(ARRAY, DIM1, DIM2) double (*ARRAY)[DIM2] = malloc((sizeof *ARRAY) * DIM1 * DIM2);
#define ALLOCATE4(ARRAY, DIM1, DIM2, DIM3) double (*ARRAY)[DIM2][DIM3] = malloc((sizeof *ARRAY) * DIM1 * DIM2 * DIM3);
#define ALLOCATE5(ARRAY, DIM1, DIM2, DIM3, DIM4) double (*ARRAY)[DIM2][DIM3][DIM4] = malloc((sizeof *ARRAY) * DIM1 * DIM2 * DIM3 * DIM4);
#define ALLOCATE6(ARRAY, DIM1, DIM2, DIM3, DIM4, DIM5) double (*ARRAY)[DIM2][DIM3][DIM4][DIM5] = malloc((sizeof *ARRAY) * DIM1 * DIM2 * DIM3 * DIM4 * DIM5);
#define ALLOCATE7(ARRAY, DIM1, DIM2, DIM3, DIM4, DIM5, DIM6) double (*ARRAY)[DIM2][DIM3][DIM4][DIM5][DIM6] = malloc((sizeof *ARRAY) * DIM1 * DIM2 * DIM3 * DIM4 * DIM5 * DIM6);
#define ALLOCATE8(ARRAY, DIM1, DIM2, DIM3, DIM4, DIM5, DIM6, DIM7) double (*ARRAY)[DIM2][DIM3][DIM4][DIM5][DIM6][DIM7] = malloc((sizeof *ARRAY) * DIM1 * DIM2 * DIM3 * DIM4 * DIM5 * DIM6 * DIM7);
#include <stdio.h>
#include <stdlib.h>
int main(){
int dim1, dim2, dim3;
int i, j, k;
dim1 = 5;
dim2 = 5;
dim3 = 5;
// allocate VLA on the heap
ALLOCATE(array,dim1,dim2,dim3)
// fill in array
for ( i = 0; i < dim1; i++)
{
for ( j = 0; j < dim1; j++)
{
for ( k = 0; k < dim1; k++)
{
array[i][j][k] = i+j+k;
}
}
}
// print result
for ( i = 0; i < dim1; i++)
{
for ( j = 0; j < dim1; j++)
{
for ( k = 0; k < dim1; k++)
{
printf("%f \n", array[i][j][k]);
}
}
}
return 0;
}
|
the_stack_data/48511.c | // REQUIRES: system-linux
// RUN: clang -o %t %s -O2
// RUN: llvm-mctoll -d %t
// RUN: clang -o %t1 %t-dis.ll
// RUN: %t1 2>&1 | FileCheck %s
// CHECK: Test cmovno 0xbd
// CHECK-NEXT: Result : 0xdeadbeef
// CHECK-NEXT: Test cmovno 0x7fffffff
// CHECK-NEXT: Result : 0x80000001
// CHECK-NEXT: Test cmovo 0xbd
// CHECK-NEXT: Result : 0x800000be
// CHECK-NEXT: Test cmovo 0x80000000
// CHECK-NEXT: Result : 0xdeadbeef
// CHECK-EMPTY:
#include "stdint.h"
#include "stdio.h"
/* Test raising cmovno and cmovo.
*/
// Return val+2 upon overflow; 0xdeadbeef otherwise
uint32_t __attribute__((noinline)) cmov_no(uint32_t val) {
uint32_t result;
printf("Test cmovno 0x%x\n", val);
__asm__("mov %1, %%eax\n"
"mov %2, %%ecx\n"
"add $2, %%eax\n"
"cmovno %%ecx, %%eax\n"
"mov %%eax, %0\n"
: "=r"(result) /* output */
: "r"(val), "i"(0xdeadbeef) /* input */
: "%eax", "%ecx" /* clobbered register */
);
printf("Result : 0x%x\n", result);
return result;
}
// Return val-2147483649 upon overflow; 0xdeadbeef otherwise
int32_t __attribute__((noinline)) cmov_o(int32_t val) {
int32_t result;
printf("Test cmovo 0x%x\n", val);
__asm__("mov %1, %%eax\n"
"mov %2, %%ecx\n"
"sub %3, %%eax\n"
"cmovo %%ecx, %%eax\n"
"mov %%eax, %0\n"
: "=r"(result) /* output */
: "r"(val), "i"(0xdeadbeef), "i"(-2147483649) /* input */
: "%eax", "%ecx" /* clobbered register */
);
printf("Result : 0x%x\n", result);
return result;
}
// Test raising of rotate instruction
int main() {
// No overflow - output should be 0xdeadbeef
uint8_t v = cmov_no(0xbd);
// Triggers an overflow - output should be 0x80000001
v = cmov_no(0x7fffffff);
v = cmov_o(0xbd);
v = cmov_o(-2147483648);
return 0;
}
|
the_stack_data/7950826.c | //@ ltl invariant negative: (<> ([] (AP(x_4 - x_18 >= 3) && AP(x_25 - x_18 > -3))));
float x_0;
float x_1;
float x_2;
float x_3;
float x_4;
float x_5;
float x_6;
float x_7;
float x_8;
float x_9;
float x_10;
float x_11;
float x_12;
float x_13;
float x_14;
float x_15;
float x_16;
float x_17;
float x_18;
float x_19;
float x_20;
float x_21;
float x_22;
float x_23;
float x_24;
float x_25;
float x_26;
float x_27;
int main()
{
float x_0_;
float x_1_;
float x_2_;
float x_3_;
float x_4_;
float x_5_;
float x_6_;
float x_7_;
float x_8_;
float x_9_;
float x_10_;
float x_11_;
float x_12_;
float x_13_;
float x_14_;
float x_15_;
float x_16_;
float x_17_;
float x_18_;
float x_19_;
float x_20_;
float x_21_;
float x_22_;
float x_23_;
float x_24_;
float x_25_;
float x_26_;
float x_27_;
while(1) {
x_0_ = ((((1.0 + x_1) > ((10.0 + x_4) > (13.0 + x_6)? (10.0 + x_4) : (13.0 + x_6))? (1.0 + x_1) : ((10.0 + x_4) > (13.0 + x_6)? (10.0 + x_4) : (13.0 + x_6))) > (((18.0 + x_7) > (1.0 + x_11)? (18.0 + x_7) : (1.0 + x_11)) > ((1.0 + x_13) > (8.0 + x_14)? (1.0 + x_13) : (8.0 + x_14))? ((18.0 + x_7) > (1.0 + x_11)? (18.0 + x_7) : (1.0 + x_11)) : ((1.0 + x_13) > (8.0 + x_14)? (1.0 + x_13) : (8.0 + x_14)))? ((1.0 + x_1) > ((10.0 + x_4) > (13.0 + x_6)? (10.0 + x_4) : (13.0 + x_6))? (1.0 + x_1) : ((10.0 + x_4) > (13.0 + x_6)? (10.0 + x_4) : (13.0 + x_6))) : (((18.0 + x_7) > (1.0 + x_11)? (18.0 + x_7) : (1.0 + x_11)) > ((1.0 + x_13) > (8.0 + x_14)? (1.0 + x_13) : (8.0 + x_14))? ((18.0 + x_7) > (1.0 + x_11)? (18.0 + x_7) : (1.0 + x_11)) : ((1.0 + x_13) > (8.0 + x_14)? (1.0 + x_13) : (8.0 + x_14)))) > (((16.0 + x_19) > ((6.0 + x_20) > (15.0 + x_21)? (6.0 + x_20) : (15.0 + x_21))? (16.0 + x_19) : ((6.0 + x_20) > (15.0 + x_21)? (6.0 + x_20) : (15.0 + x_21))) > (((18.0 + x_22) > (3.0 + x_25)? (18.0 + x_22) : (3.0 + x_25)) > ((16.0 + x_26) > (15.0 + x_27)? (16.0 + x_26) : (15.0 + x_27))? ((18.0 + x_22) > (3.0 + x_25)? (18.0 + x_22) : (3.0 + x_25)) : ((16.0 + x_26) > (15.0 + x_27)? (16.0 + x_26) : (15.0 + x_27)))? ((16.0 + x_19) > ((6.0 + x_20) > (15.0 + x_21)? (6.0 + x_20) : (15.0 + x_21))? (16.0 + x_19) : ((6.0 + x_20) > (15.0 + x_21)? (6.0 + x_20) : (15.0 + x_21))) : (((18.0 + x_22) > (3.0 + x_25)? (18.0 + x_22) : (3.0 + x_25)) > ((16.0 + x_26) > (15.0 + x_27)? (16.0 + x_26) : (15.0 + x_27))? ((18.0 + x_22) > (3.0 + x_25)? (18.0 + x_22) : (3.0 + x_25)) : ((16.0 + x_26) > (15.0 + x_27)? (16.0 + x_26) : (15.0 + x_27))))? (((1.0 + x_1) > ((10.0 + x_4) > (13.0 + x_6)? (10.0 + x_4) : (13.0 + x_6))? (1.0 + x_1) : ((10.0 + x_4) > (13.0 + x_6)? (10.0 + x_4) : (13.0 + x_6))) > (((18.0 + x_7) > (1.0 + x_11)? (18.0 + x_7) : (1.0 + x_11)) > ((1.0 + x_13) > (8.0 + x_14)? (1.0 + x_13) : (8.0 + x_14))? ((18.0 + x_7) > (1.0 + x_11)? (18.0 + x_7) : (1.0 + x_11)) : ((1.0 + x_13) > (8.0 + x_14)? (1.0 + x_13) : (8.0 + x_14)))? ((1.0 + x_1) > ((10.0 + x_4) > (13.0 + x_6)? (10.0 + x_4) : (13.0 + x_6))? (1.0 + x_1) : ((10.0 + x_4) > (13.0 + x_6)? (10.0 + x_4) : (13.0 + x_6))) : (((18.0 + x_7) > (1.0 + x_11)? (18.0 + x_7) : (1.0 + x_11)) > ((1.0 + x_13) > (8.0 + x_14)? (1.0 + x_13) : (8.0 + x_14))? ((18.0 + x_7) > (1.0 + x_11)? (18.0 + x_7) : (1.0 + x_11)) : ((1.0 + x_13) > (8.0 + x_14)? (1.0 + x_13) : (8.0 + x_14)))) : (((16.0 + x_19) > ((6.0 + x_20) > (15.0 + x_21)? (6.0 + x_20) : (15.0 + x_21))? (16.0 + x_19) : ((6.0 + x_20) > (15.0 + x_21)? (6.0 + x_20) : (15.0 + x_21))) > (((18.0 + x_22) > (3.0 + x_25)? (18.0 + x_22) : (3.0 + x_25)) > ((16.0 + x_26) > (15.0 + x_27)? (16.0 + x_26) : (15.0 + x_27))? ((18.0 + x_22) > (3.0 + x_25)? (18.0 + x_22) : (3.0 + x_25)) : ((16.0 + x_26) > (15.0 + x_27)? (16.0 + x_26) : (15.0 + x_27)))? ((16.0 + x_19) > ((6.0 + x_20) > (15.0 + x_21)? (6.0 + x_20) : (15.0 + x_21))? (16.0 + x_19) : ((6.0 + x_20) > (15.0 + x_21)? (6.0 + x_20) : (15.0 + x_21))) : (((18.0 + x_22) > (3.0 + x_25)? (18.0 + x_22) : (3.0 + x_25)) > ((16.0 + x_26) > (15.0 + x_27)? (16.0 + x_26) : (15.0 + x_27))? ((18.0 + x_22) > (3.0 + x_25)? (18.0 + x_22) : (3.0 + x_25)) : ((16.0 + x_26) > (15.0 + x_27)? (16.0 + x_26) : (15.0 + x_27)))));
x_1_ = ((((1.0 + x_2) > ((18.0 + x_7) > (14.0 + x_9)? (18.0 + x_7) : (14.0 + x_9))? (1.0 + x_2) : ((18.0 + x_7) > (14.0 + x_9)? (18.0 + x_7) : (14.0 + x_9))) > (((13.0 + x_10) > (13.0 + x_12)? (13.0 + x_10) : (13.0 + x_12)) > ((3.0 + x_13) > (10.0 + x_16)? (3.0 + x_13) : (10.0 + x_16))? ((13.0 + x_10) > (13.0 + x_12)? (13.0 + x_10) : (13.0 + x_12)) : ((3.0 + x_13) > (10.0 + x_16)? (3.0 + x_13) : (10.0 + x_16)))? ((1.0 + x_2) > ((18.0 + x_7) > (14.0 + x_9)? (18.0 + x_7) : (14.0 + x_9))? (1.0 + x_2) : ((18.0 + x_7) > (14.0 + x_9)? (18.0 + x_7) : (14.0 + x_9))) : (((13.0 + x_10) > (13.0 + x_12)? (13.0 + x_10) : (13.0 + x_12)) > ((3.0 + x_13) > (10.0 + x_16)? (3.0 + x_13) : (10.0 + x_16))? ((13.0 + x_10) > (13.0 + x_12)? (13.0 + x_10) : (13.0 + x_12)) : ((3.0 + x_13) > (10.0 + x_16)? (3.0 + x_13) : (10.0 + x_16)))) > (((3.0 + x_17) > ((11.0 + x_18) > (13.0 + x_22)? (11.0 + x_18) : (13.0 + x_22))? (3.0 + x_17) : ((11.0 + x_18) > (13.0 + x_22)? (11.0 + x_18) : (13.0 + x_22))) > (((6.0 + x_23) > (7.0 + x_24)? (6.0 + x_23) : (7.0 + x_24)) > ((14.0 + x_25) > (20.0 + x_26)? (14.0 + x_25) : (20.0 + x_26))? ((6.0 + x_23) > (7.0 + x_24)? (6.0 + x_23) : (7.0 + x_24)) : ((14.0 + x_25) > (20.0 + x_26)? (14.0 + x_25) : (20.0 + x_26)))? ((3.0 + x_17) > ((11.0 + x_18) > (13.0 + x_22)? (11.0 + x_18) : (13.0 + x_22))? (3.0 + x_17) : ((11.0 + x_18) > (13.0 + x_22)? (11.0 + x_18) : (13.0 + x_22))) : (((6.0 + x_23) > (7.0 + x_24)? (6.0 + x_23) : (7.0 + x_24)) > ((14.0 + x_25) > (20.0 + x_26)? (14.0 + x_25) : (20.0 + x_26))? ((6.0 + x_23) > (7.0 + x_24)? (6.0 + x_23) : (7.0 + x_24)) : ((14.0 + x_25) > (20.0 + x_26)? (14.0 + x_25) : (20.0 + x_26))))? (((1.0 + x_2) > ((18.0 + x_7) > (14.0 + x_9)? (18.0 + x_7) : (14.0 + x_9))? (1.0 + x_2) : ((18.0 + x_7) > (14.0 + x_9)? (18.0 + x_7) : (14.0 + x_9))) > (((13.0 + x_10) > (13.0 + x_12)? (13.0 + x_10) : (13.0 + x_12)) > ((3.0 + x_13) > (10.0 + x_16)? (3.0 + x_13) : (10.0 + x_16))? ((13.0 + x_10) > (13.0 + x_12)? (13.0 + x_10) : (13.0 + x_12)) : ((3.0 + x_13) > (10.0 + x_16)? (3.0 + x_13) : (10.0 + x_16)))? ((1.0 + x_2) > ((18.0 + x_7) > (14.0 + x_9)? (18.0 + x_7) : (14.0 + x_9))? (1.0 + x_2) : ((18.0 + x_7) > (14.0 + x_9)? (18.0 + x_7) : (14.0 + x_9))) : (((13.0 + x_10) > (13.0 + x_12)? (13.0 + x_10) : (13.0 + x_12)) > ((3.0 + x_13) > (10.0 + x_16)? (3.0 + x_13) : (10.0 + x_16))? ((13.0 + x_10) > (13.0 + x_12)? (13.0 + x_10) : (13.0 + x_12)) : ((3.0 + x_13) > (10.0 + x_16)? (3.0 + x_13) : (10.0 + x_16)))) : (((3.0 + x_17) > ((11.0 + x_18) > (13.0 + x_22)? (11.0 + x_18) : (13.0 + x_22))? (3.0 + x_17) : ((11.0 + x_18) > (13.0 + x_22)? (11.0 + x_18) : (13.0 + x_22))) > (((6.0 + x_23) > (7.0 + x_24)? (6.0 + x_23) : (7.0 + x_24)) > ((14.0 + x_25) > (20.0 + x_26)? (14.0 + x_25) : (20.0 + x_26))? ((6.0 + x_23) > (7.0 + x_24)? (6.0 + x_23) : (7.0 + x_24)) : ((14.0 + x_25) > (20.0 + x_26)? (14.0 + x_25) : (20.0 + x_26)))? ((3.0 + x_17) > ((11.0 + x_18) > (13.0 + x_22)? (11.0 + x_18) : (13.0 + x_22))? (3.0 + x_17) : ((11.0 + x_18) > (13.0 + x_22)? (11.0 + x_18) : (13.0 + x_22))) : (((6.0 + x_23) > (7.0 + x_24)? (6.0 + x_23) : (7.0 + x_24)) > ((14.0 + x_25) > (20.0 + x_26)? (14.0 + x_25) : (20.0 + x_26))? ((6.0 + x_23) > (7.0 + x_24)? (6.0 + x_23) : (7.0 + x_24)) : ((14.0 + x_25) > (20.0 + x_26)? (14.0 + x_25) : (20.0 + x_26)))));
x_2_ = ((((19.0 + x_0) > ((19.0 + x_7) > (11.0 + x_10)? (19.0 + x_7) : (11.0 + x_10))? (19.0 + x_0) : ((19.0 + x_7) > (11.0 + x_10)? (19.0 + x_7) : (11.0 + x_10))) > (((20.0 + x_11) > (7.0 + x_12)? (20.0 + x_11) : (7.0 + x_12)) > ((9.0 + x_14) > (2.0 + x_15)? (9.0 + x_14) : (2.0 + x_15))? ((20.0 + x_11) > (7.0 + x_12)? (20.0 + x_11) : (7.0 + x_12)) : ((9.0 + x_14) > (2.0 + x_15)? (9.0 + x_14) : (2.0 + x_15)))? ((19.0 + x_0) > ((19.0 + x_7) > (11.0 + x_10)? (19.0 + x_7) : (11.0 + x_10))? (19.0 + x_0) : ((19.0 + x_7) > (11.0 + x_10)? (19.0 + x_7) : (11.0 + x_10))) : (((20.0 + x_11) > (7.0 + x_12)? (20.0 + x_11) : (7.0 + x_12)) > ((9.0 + x_14) > (2.0 + x_15)? (9.0 + x_14) : (2.0 + x_15))? ((20.0 + x_11) > (7.0 + x_12)? (20.0 + x_11) : (7.0 + x_12)) : ((9.0 + x_14) > (2.0 + x_15)? (9.0 + x_14) : (2.0 + x_15)))) > (((7.0 + x_16) > ((8.0 + x_17) > (17.0 + x_18)? (8.0 + x_17) : (17.0 + x_18))? (7.0 + x_16) : ((8.0 + x_17) > (17.0 + x_18)? (8.0 + x_17) : (17.0 + x_18))) > (((10.0 + x_19) > (4.0 + x_22)? (10.0 + x_19) : (4.0 + x_22)) > ((7.0 + x_24) > (1.0 + x_25)? (7.0 + x_24) : (1.0 + x_25))? ((10.0 + x_19) > (4.0 + x_22)? (10.0 + x_19) : (4.0 + x_22)) : ((7.0 + x_24) > (1.0 + x_25)? (7.0 + x_24) : (1.0 + x_25)))? ((7.0 + x_16) > ((8.0 + x_17) > (17.0 + x_18)? (8.0 + x_17) : (17.0 + x_18))? (7.0 + x_16) : ((8.0 + x_17) > (17.0 + x_18)? (8.0 + x_17) : (17.0 + x_18))) : (((10.0 + x_19) > (4.0 + x_22)? (10.0 + x_19) : (4.0 + x_22)) > ((7.0 + x_24) > (1.0 + x_25)? (7.0 + x_24) : (1.0 + x_25))? ((10.0 + x_19) > (4.0 + x_22)? (10.0 + x_19) : (4.0 + x_22)) : ((7.0 + x_24) > (1.0 + x_25)? (7.0 + x_24) : (1.0 + x_25))))? (((19.0 + x_0) > ((19.0 + x_7) > (11.0 + x_10)? (19.0 + x_7) : (11.0 + x_10))? (19.0 + x_0) : ((19.0 + x_7) > (11.0 + x_10)? (19.0 + x_7) : (11.0 + x_10))) > (((20.0 + x_11) > (7.0 + x_12)? (20.0 + x_11) : (7.0 + x_12)) > ((9.0 + x_14) > (2.0 + x_15)? (9.0 + x_14) : (2.0 + x_15))? ((20.0 + x_11) > (7.0 + x_12)? (20.0 + x_11) : (7.0 + x_12)) : ((9.0 + x_14) > (2.0 + x_15)? (9.0 + x_14) : (2.0 + x_15)))? ((19.0 + x_0) > ((19.0 + x_7) > (11.0 + x_10)? (19.0 + x_7) : (11.0 + x_10))? (19.0 + x_0) : ((19.0 + x_7) > (11.0 + x_10)? (19.0 + x_7) : (11.0 + x_10))) : (((20.0 + x_11) > (7.0 + x_12)? (20.0 + x_11) : (7.0 + x_12)) > ((9.0 + x_14) > (2.0 + x_15)? (9.0 + x_14) : (2.0 + x_15))? ((20.0 + x_11) > (7.0 + x_12)? (20.0 + x_11) : (7.0 + x_12)) : ((9.0 + x_14) > (2.0 + x_15)? (9.0 + x_14) : (2.0 + x_15)))) : (((7.0 + x_16) > ((8.0 + x_17) > (17.0 + x_18)? (8.0 + x_17) : (17.0 + x_18))? (7.0 + x_16) : ((8.0 + x_17) > (17.0 + x_18)? (8.0 + x_17) : (17.0 + x_18))) > (((10.0 + x_19) > (4.0 + x_22)? (10.0 + x_19) : (4.0 + x_22)) > ((7.0 + x_24) > (1.0 + x_25)? (7.0 + x_24) : (1.0 + x_25))? ((10.0 + x_19) > (4.0 + x_22)? (10.0 + x_19) : (4.0 + x_22)) : ((7.0 + x_24) > (1.0 + x_25)? (7.0 + x_24) : (1.0 + x_25)))? ((7.0 + x_16) > ((8.0 + x_17) > (17.0 + x_18)? (8.0 + x_17) : (17.0 + x_18))? (7.0 + x_16) : ((8.0 + x_17) > (17.0 + x_18)? (8.0 + x_17) : (17.0 + x_18))) : (((10.0 + x_19) > (4.0 + x_22)? (10.0 + x_19) : (4.0 + x_22)) > ((7.0 + x_24) > (1.0 + x_25)? (7.0 + x_24) : (1.0 + x_25))? ((10.0 + x_19) > (4.0 + x_22)? (10.0 + x_19) : (4.0 + x_22)) : ((7.0 + x_24) > (1.0 + x_25)? (7.0 + x_24) : (1.0 + x_25)))));
x_3_ = ((((13.0 + x_4) > ((6.0 + x_5) > (17.0 + x_6)? (6.0 + x_5) : (17.0 + x_6))? (13.0 + x_4) : ((6.0 + x_5) > (17.0 + x_6)? (6.0 + x_5) : (17.0 + x_6))) > (((7.0 + x_7) > (18.0 + x_10)? (7.0 + x_7) : (18.0 + x_10)) > ((20.0 + x_11) > (16.0 + x_13)? (20.0 + x_11) : (16.0 + x_13))? ((7.0 + x_7) > (18.0 + x_10)? (7.0 + x_7) : (18.0 + x_10)) : ((20.0 + x_11) > (16.0 + x_13)? (20.0 + x_11) : (16.0 + x_13)))? ((13.0 + x_4) > ((6.0 + x_5) > (17.0 + x_6)? (6.0 + x_5) : (17.0 + x_6))? (13.0 + x_4) : ((6.0 + x_5) > (17.0 + x_6)? (6.0 + x_5) : (17.0 + x_6))) : (((7.0 + x_7) > (18.0 + x_10)? (7.0 + x_7) : (18.0 + x_10)) > ((20.0 + x_11) > (16.0 + x_13)? (20.0 + x_11) : (16.0 + x_13))? ((7.0 + x_7) > (18.0 + x_10)? (7.0 + x_7) : (18.0 + x_10)) : ((20.0 + x_11) > (16.0 + x_13)? (20.0 + x_11) : (16.0 + x_13)))) > (((2.0 + x_15) > ((9.0 + x_17) > (19.0 + x_18)? (9.0 + x_17) : (19.0 + x_18))? (2.0 + x_15) : ((9.0 + x_17) > (19.0 + x_18)? (9.0 + x_17) : (19.0 + x_18))) > (((9.0 + x_19) > (15.0 + x_20)? (9.0 + x_19) : (15.0 + x_20)) > ((16.0 + x_25) > (10.0 + x_27)? (16.0 + x_25) : (10.0 + x_27))? ((9.0 + x_19) > (15.0 + x_20)? (9.0 + x_19) : (15.0 + x_20)) : ((16.0 + x_25) > (10.0 + x_27)? (16.0 + x_25) : (10.0 + x_27)))? ((2.0 + x_15) > ((9.0 + x_17) > (19.0 + x_18)? (9.0 + x_17) : (19.0 + x_18))? (2.0 + x_15) : ((9.0 + x_17) > (19.0 + x_18)? (9.0 + x_17) : (19.0 + x_18))) : (((9.0 + x_19) > (15.0 + x_20)? (9.0 + x_19) : (15.0 + x_20)) > ((16.0 + x_25) > (10.0 + x_27)? (16.0 + x_25) : (10.0 + x_27))? ((9.0 + x_19) > (15.0 + x_20)? (9.0 + x_19) : (15.0 + x_20)) : ((16.0 + x_25) > (10.0 + x_27)? (16.0 + x_25) : (10.0 + x_27))))? (((13.0 + x_4) > ((6.0 + x_5) > (17.0 + x_6)? (6.0 + x_5) : (17.0 + x_6))? (13.0 + x_4) : ((6.0 + x_5) > (17.0 + x_6)? (6.0 + x_5) : (17.0 + x_6))) > (((7.0 + x_7) > (18.0 + x_10)? (7.0 + x_7) : (18.0 + x_10)) > ((20.0 + x_11) > (16.0 + x_13)? (20.0 + x_11) : (16.0 + x_13))? ((7.0 + x_7) > (18.0 + x_10)? (7.0 + x_7) : (18.0 + x_10)) : ((20.0 + x_11) > (16.0 + x_13)? (20.0 + x_11) : (16.0 + x_13)))? ((13.0 + x_4) > ((6.0 + x_5) > (17.0 + x_6)? (6.0 + x_5) : (17.0 + x_6))? (13.0 + x_4) : ((6.0 + x_5) > (17.0 + x_6)? (6.0 + x_5) : (17.0 + x_6))) : (((7.0 + x_7) > (18.0 + x_10)? (7.0 + x_7) : (18.0 + x_10)) > ((20.0 + x_11) > (16.0 + x_13)? (20.0 + x_11) : (16.0 + x_13))? ((7.0 + x_7) > (18.0 + x_10)? (7.0 + x_7) : (18.0 + x_10)) : ((20.0 + x_11) > (16.0 + x_13)? (20.0 + x_11) : (16.0 + x_13)))) : (((2.0 + x_15) > ((9.0 + x_17) > (19.0 + x_18)? (9.0 + x_17) : (19.0 + x_18))? (2.0 + x_15) : ((9.0 + x_17) > (19.0 + x_18)? (9.0 + x_17) : (19.0 + x_18))) > (((9.0 + x_19) > (15.0 + x_20)? (9.0 + x_19) : (15.0 + x_20)) > ((16.0 + x_25) > (10.0 + x_27)? (16.0 + x_25) : (10.0 + x_27))? ((9.0 + x_19) > (15.0 + x_20)? (9.0 + x_19) : (15.0 + x_20)) : ((16.0 + x_25) > (10.0 + x_27)? (16.0 + x_25) : (10.0 + x_27)))? ((2.0 + x_15) > ((9.0 + x_17) > (19.0 + x_18)? (9.0 + x_17) : (19.0 + x_18))? (2.0 + x_15) : ((9.0 + x_17) > (19.0 + x_18)? (9.0 + x_17) : (19.0 + x_18))) : (((9.0 + x_19) > (15.0 + x_20)? (9.0 + x_19) : (15.0 + x_20)) > ((16.0 + x_25) > (10.0 + x_27)? (16.0 + x_25) : (10.0 + x_27))? ((9.0 + x_19) > (15.0 + x_20)? (9.0 + x_19) : (15.0 + x_20)) : ((16.0 + x_25) > (10.0 + x_27)? (16.0 + x_25) : (10.0 + x_27)))));
x_4_ = ((((13.0 + x_1) > ((18.0 + x_2) > (6.0 + x_4)? (18.0 + x_2) : (6.0 + x_4))? (13.0 + x_1) : ((18.0 + x_2) > (6.0 + x_4)? (18.0 + x_2) : (6.0 + x_4))) > (((7.0 + x_5) > (12.0 + x_6)? (7.0 + x_5) : (12.0 + x_6)) > ((18.0 + x_8) > (15.0 + x_10)? (18.0 + x_8) : (15.0 + x_10))? ((7.0 + x_5) > (12.0 + x_6)? (7.0 + x_5) : (12.0 + x_6)) : ((18.0 + x_8) > (15.0 + x_10)? (18.0 + x_8) : (15.0 + x_10)))? ((13.0 + x_1) > ((18.0 + x_2) > (6.0 + x_4)? (18.0 + x_2) : (6.0 + x_4))? (13.0 + x_1) : ((18.0 + x_2) > (6.0 + x_4)? (18.0 + x_2) : (6.0 + x_4))) : (((7.0 + x_5) > (12.0 + x_6)? (7.0 + x_5) : (12.0 + x_6)) > ((18.0 + x_8) > (15.0 + x_10)? (18.0 + x_8) : (15.0 + x_10))? ((7.0 + x_5) > (12.0 + x_6)? (7.0 + x_5) : (12.0 + x_6)) : ((18.0 + x_8) > (15.0 + x_10)? (18.0 + x_8) : (15.0 + x_10)))) > (((9.0 + x_14) > ((12.0 + x_15) > (17.0 + x_17)? (12.0 + x_15) : (17.0 + x_17))? (9.0 + x_14) : ((12.0 + x_15) > (17.0 + x_17)? (12.0 + x_15) : (17.0 + x_17))) > (((11.0 + x_19) > (9.0 + x_23)? (11.0 + x_19) : (9.0 + x_23)) > ((10.0 + x_26) > (19.0 + x_27)? (10.0 + x_26) : (19.0 + x_27))? ((11.0 + x_19) > (9.0 + x_23)? (11.0 + x_19) : (9.0 + x_23)) : ((10.0 + x_26) > (19.0 + x_27)? (10.0 + x_26) : (19.0 + x_27)))? ((9.0 + x_14) > ((12.0 + x_15) > (17.0 + x_17)? (12.0 + x_15) : (17.0 + x_17))? (9.0 + x_14) : ((12.0 + x_15) > (17.0 + x_17)? (12.0 + x_15) : (17.0 + x_17))) : (((11.0 + x_19) > (9.0 + x_23)? (11.0 + x_19) : (9.0 + x_23)) > ((10.0 + x_26) > (19.0 + x_27)? (10.0 + x_26) : (19.0 + x_27))? ((11.0 + x_19) > (9.0 + x_23)? (11.0 + x_19) : (9.0 + x_23)) : ((10.0 + x_26) > (19.0 + x_27)? (10.0 + x_26) : (19.0 + x_27))))? (((13.0 + x_1) > ((18.0 + x_2) > (6.0 + x_4)? (18.0 + x_2) : (6.0 + x_4))? (13.0 + x_1) : ((18.0 + x_2) > (6.0 + x_4)? (18.0 + x_2) : (6.0 + x_4))) > (((7.0 + x_5) > (12.0 + x_6)? (7.0 + x_5) : (12.0 + x_6)) > ((18.0 + x_8) > (15.0 + x_10)? (18.0 + x_8) : (15.0 + x_10))? ((7.0 + x_5) > (12.0 + x_6)? (7.0 + x_5) : (12.0 + x_6)) : ((18.0 + x_8) > (15.0 + x_10)? (18.0 + x_8) : (15.0 + x_10)))? ((13.0 + x_1) > ((18.0 + x_2) > (6.0 + x_4)? (18.0 + x_2) : (6.0 + x_4))? (13.0 + x_1) : ((18.0 + x_2) > (6.0 + x_4)? (18.0 + x_2) : (6.0 + x_4))) : (((7.0 + x_5) > (12.0 + x_6)? (7.0 + x_5) : (12.0 + x_6)) > ((18.0 + x_8) > (15.0 + x_10)? (18.0 + x_8) : (15.0 + x_10))? ((7.0 + x_5) > (12.0 + x_6)? (7.0 + x_5) : (12.0 + x_6)) : ((18.0 + x_8) > (15.0 + x_10)? (18.0 + x_8) : (15.0 + x_10)))) : (((9.0 + x_14) > ((12.0 + x_15) > (17.0 + x_17)? (12.0 + x_15) : (17.0 + x_17))? (9.0 + x_14) : ((12.0 + x_15) > (17.0 + x_17)? (12.0 + x_15) : (17.0 + x_17))) > (((11.0 + x_19) > (9.0 + x_23)? (11.0 + x_19) : (9.0 + x_23)) > ((10.0 + x_26) > (19.0 + x_27)? (10.0 + x_26) : (19.0 + x_27))? ((11.0 + x_19) > (9.0 + x_23)? (11.0 + x_19) : (9.0 + x_23)) : ((10.0 + x_26) > (19.0 + x_27)? (10.0 + x_26) : (19.0 + x_27)))? ((9.0 + x_14) > ((12.0 + x_15) > (17.0 + x_17)? (12.0 + x_15) : (17.0 + x_17))? (9.0 + x_14) : ((12.0 + x_15) > (17.0 + x_17)? (12.0 + x_15) : (17.0 + x_17))) : (((11.0 + x_19) > (9.0 + x_23)? (11.0 + x_19) : (9.0 + x_23)) > ((10.0 + x_26) > (19.0 + x_27)? (10.0 + x_26) : (19.0 + x_27))? ((11.0 + x_19) > (9.0 + x_23)? (11.0 + x_19) : (9.0 + x_23)) : ((10.0 + x_26) > (19.0 + x_27)? (10.0 + x_26) : (19.0 + x_27)))));
x_5_ = ((((14.0 + x_2) > ((19.0 + x_8) > (8.0 + x_9)? (19.0 + x_8) : (8.0 + x_9))? (14.0 + x_2) : ((19.0 + x_8) > (8.0 + x_9)? (19.0 + x_8) : (8.0 + x_9))) > (((4.0 + x_10) > (11.0 + x_13)? (4.0 + x_10) : (11.0 + x_13)) > ((12.0 + x_15) > (13.0 + x_17)? (12.0 + x_15) : (13.0 + x_17))? ((4.0 + x_10) > (11.0 + x_13)? (4.0 + x_10) : (11.0 + x_13)) : ((12.0 + x_15) > (13.0 + x_17)? (12.0 + x_15) : (13.0 + x_17)))? ((14.0 + x_2) > ((19.0 + x_8) > (8.0 + x_9)? (19.0 + x_8) : (8.0 + x_9))? (14.0 + x_2) : ((19.0 + x_8) > (8.0 + x_9)? (19.0 + x_8) : (8.0 + x_9))) : (((4.0 + x_10) > (11.0 + x_13)? (4.0 + x_10) : (11.0 + x_13)) > ((12.0 + x_15) > (13.0 + x_17)? (12.0 + x_15) : (13.0 + x_17))? ((4.0 + x_10) > (11.0 + x_13)? (4.0 + x_10) : (11.0 + x_13)) : ((12.0 + x_15) > (13.0 + x_17)? (12.0 + x_15) : (13.0 + x_17)))) > (((19.0 + x_18) > ((11.0 + x_19) > (7.0 + x_21)? (11.0 + x_19) : (7.0 + x_21))? (19.0 + x_18) : ((11.0 + x_19) > (7.0 + x_21)? (11.0 + x_19) : (7.0 + x_21))) > (((4.0 + x_22) > (18.0 + x_23)? (4.0 + x_22) : (18.0 + x_23)) > ((1.0 + x_25) > (4.0 + x_27)? (1.0 + x_25) : (4.0 + x_27))? ((4.0 + x_22) > (18.0 + x_23)? (4.0 + x_22) : (18.0 + x_23)) : ((1.0 + x_25) > (4.0 + x_27)? (1.0 + x_25) : (4.0 + x_27)))? ((19.0 + x_18) > ((11.0 + x_19) > (7.0 + x_21)? (11.0 + x_19) : (7.0 + x_21))? (19.0 + x_18) : ((11.0 + x_19) > (7.0 + x_21)? (11.0 + x_19) : (7.0 + x_21))) : (((4.0 + x_22) > (18.0 + x_23)? (4.0 + x_22) : (18.0 + x_23)) > ((1.0 + x_25) > (4.0 + x_27)? (1.0 + x_25) : (4.0 + x_27))? ((4.0 + x_22) > (18.0 + x_23)? (4.0 + x_22) : (18.0 + x_23)) : ((1.0 + x_25) > (4.0 + x_27)? (1.0 + x_25) : (4.0 + x_27))))? (((14.0 + x_2) > ((19.0 + x_8) > (8.0 + x_9)? (19.0 + x_8) : (8.0 + x_9))? (14.0 + x_2) : ((19.0 + x_8) > (8.0 + x_9)? (19.0 + x_8) : (8.0 + x_9))) > (((4.0 + x_10) > (11.0 + x_13)? (4.0 + x_10) : (11.0 + x_13)) > ((12.0 + x_15) > (13.0 + x_17)? (12.0 + x_15) : (13.0 + x_17))? ((4.0 + x_10) > (11.0 + x_13)? (4.0 + x_10) : (11.0 + x_13)) : ((12.0 + x_15) > (13.0 + x_17)? (12.0 + x_15) : (13.0 + x_17)))? ((14.0 + x_2) > ((19.0 + x_8) > (8.0 + x_9)? (19.0 + x_8) : (8.0 + x_9))? (14.0 + x_2) : ((19.0 + x_8) > (8.0 + x_9)? (19.0 + x_8) : (8.0 + x_9))) : (((4.0 + x_10) > (11.0 + x_13)? (4.0 + x_10) : (11.0 + x_13)) > ((12.0 + x_15) > (13.0 + x_17)? (12.0 + x_15) : (13.0 + x_17))? ((4.0 + x_10) > (11.0 + x_13)? (4.0 + x_10) : (11.0 + x_13)) : ((12.0 + x_15) > (13.0 + x_17)? (12.0 + x_15) : (13.0 + x_17)))) : (((19.0 + x_18) > ((11.0 + x_19) > (7.0 + x_21)? (11.0 + x_19) : (7.0 + x_21))? (19.0 + x_18) : ((11.0 + x_19) > (7.0 + x_21)? (11.0 + x_19) : (7.0 + x_21))) > (((4.0 + x_22) > (18.0 + x_23)? (4.0 + x_22) : (18.0 + x_23)) > ((1.0 + x_25) > (4.0 + x_27)? (1.0 + x_25) : (4.0 + x_27))? ((4.0 + x_22) > (18.0 + x_23)? (4.0 + x_22) : (18.0 + x_23)) : ((1.0 + x_25) > (4.0 + x_27)? (1.0 + x_25) : (4.0 + x_27)))? ((19.0 + x_18) > ((11.0 + x_19) > (7.0 + x_21)? (11.0 + x_19) : (7.0 + x_21))? (19.0 + x_18) : ((11.0 + x_19) > (7.0 + x_21)? (11.0 + x_19) : (7.0 + x_21))) : (((4.0 + x_22) > (18.0 + x_23)? (4.0 + x_22) : (18.0 + x_23)) > ((1.0 + x_25) > (4.0 + x_27)? (1.0 + x_25) : (4.0 + x_27))? ((4.0 + x_22) > (18.0 + x_23)? (4.0 + x_22) : (18.0 + x_23)) : ((1.0 + x_25) > (4.0 + x_27)? (1.0 + x_25) : (4.0 + x_27)))));
x_6_ = ((((6.0 + x_1) > ((7.0 + x_3) > (10.0 + x_5)? (7.0 + x_3) : (10.0 + x_5))? (6.0 + x_1) : ((7.0 + x_3) > (10.0 + x_5)? (7.0 + x_3) : (10.0 + x_5))) > (((17.0 + x_7) > (9.0 + x_9)? (17.0 + x_7) : (9.0 + x_9)) > ((16.0 + x_11) > (17.0 + x_14)? (16.0 + x_11) : (17.0 + x_14))? ((17.0 + x_7) > (9.0 + x_9)? (17.0 + x_7) : (9.0 + x_9)) : ((16.0 + x_11) > (17.0 + x_14)? (16.0 + x_11) : (17.0 + x_14)))? ((6.0 + x_1) > ((7.0 + x_3) > (10.0 + x_5)? (7.0 + x_3) : (10.0 + x_5))? (6.0 + x_1) : ((7.0 + x_3) > (10.0 + x_5)? (7.0 + x_3) : (10.0 + x_5))) : (((17.0 + x_7) > (9.0 + x_9)? (17.0 + x_7) : (9.0 + x_9)) > ((16.0 + x_11) > (17.0 + x_14)? (16.0 + x_11) : (17.0 + x_14))? ((17.0 + x_7) > (9.0 + x_9)? (17.0 + x_7) : (9.0 + x_9)) : ((16.0 + x_11) > (17.0 + x_14)? (16.0 + x_11) : (17.0 + x_14)))) > (((16.0 + x_18) > ((11.0 + x_19) > (13.0 + x_20)? (11.0 + x_19) : (13.0 + x_20))? (16.0 + x_18) : ((11.0 + x_19) > (13.0 + x_20)? (11.0 + x_19) : (13.0 + x_20))) > (((9.0 + x_22) > (5.0 + x_23)? (9.0 + x_22) : (5.0 + x_23)) > ((11.0 + x_24) > (16.0 + x_25)? (11.0 + x_24) : (16.0 + x_25))? ((9.0 + x_22) > (5.0 + x_23)? (9.0 + x_22) : (5.0 + x_23)) : ((11.0 + x_24) > (16.0 + x_25)? (11.0 + x_24) : (16.0 + x_25)))? ((16.0 + x_18) > ((11.0 + x_19) > (13.0 + x_20)? (11.0 + x_19) : (13.0 + x_20))? (16.0 + x_18) : ((11.0 + x_19) > (13.0 + x_20)? (11.0 + x_19) : (13.0 + x_20))) : (((9.0 + x_22) > (5.0 + x_23)? (9.0 + x_22) : (5.0 + x_23)) > ((11.0 + x_24) > (16.0 + x_25)? (11.0 + x_24) : (16.0 + x_25))? ((9.0 + x_22) > (5.0 + x_23)? (9.0 + x_22) : (5.0 + x_23)) : ((11.0 + x_24) > (16.0 + x_25)? (11.0 + x_24) : (16.0 + x_25))))? (((6.0 + x_1) > ((7.0 + x_3) > (10.0 + x_5)? (7.0 + x_3) : (10.0 + x_5))? (6.0 + x_1) : ((7.0 + x_3) > (10.0 + x_5)? (7.0 + x_3) : (10.0 + x_5))) > (((17.0 + x_7) > (9.0 + x_9)? (17.0 + x_7) : (9.0 + x_9)) > ((16.0 + x_11) > (17.0 + x_14)? (16.0 + x_11) : (17.0 + x_14))? ((17.0 + x_7) > (9.0 + x_9)? (17.0 + x_7) : (9.0 + x_9)) : ((16.0 + x_11) > (17.0 + x_14)? (16.0 + x_11) : (17.0 + x_14)))? ((6.0 + x_1) > ((7.0 + x_3) > (10.0 + x_5)? (7.0 + x_3) : (10.0 + x_5))? (6.0 + x_1) : ((7.0 + x_3) > (10.0 + x_5)? (7.0 + x_3) : (10.0 + x_5))) : (((17.0 + x_7) > (9.0 + x_9)? (17.0 + x_7) : (9.0 + x_9)) > ((16.0 + x_11) > (17.0 + x_14)? (16.0 + x_11) : (17.0 + x_14))? ((17.0 + x_7) > (9.0 + x_9)? (17.0 + x_7) : (9.0 + x_9)) : ((16.0 + x_11) > (17.0 + x_14)? (16.0 + x_11) : (17.0 + x_14)))) : (((16.0 + x_18) > ((11.0 + x_19) > (13.0 + x_20)? (11.0 + x_19) : (13.0 + x_20))? (16.0 + x_18) : ((11.0 + x_19) > (13.0 + x_20)? (11.0 + x_19) : (13.0 + x_20))) > (((9.0 + x_22) > (5.0 + x_23)? (9.0 + x_22) : (5.0 + x_23)) > ((11.0 + x_24) > (16.0 + x_25)? (11.0 + x_24) : (16.0 + x_25))? ((9.0 + x_22) > (5.0 + x_23)? (9.0 + x_22) : (5.0 + x_23)) : ((11.0 + x_24) > (16.0 + x_25)? (11.0 + x_24) : (16.0 + x_25)))? ((16.0 + x_18) > ((11.0 + x_19) > (13.0 + x_20)? (11.0 + x_19) : (13.0 + x_20))? (16.0 + x_18) : ((11.0 + x_19) > (13.0 + x_20)? (11.0 + x_19) : (13.0 + x_20))) : (((9.0 + x_22) > (5.0 + x_23)? (9.0 + x_22) : (5.0 + x_23)) > ((11.0 + x_24) > (16.0 + x_25)? (11.0 + x_24) : (16.0 + x_25))? ((9.0 + x_22) > (5.0 + x_23)? (9.0 + x_22) : (5.0 + x_23)) : ((11.0 + x_24) > (16.0 + x_25)? (11.0 + x_24) : (16.0 + x_25)))));
x_7_ = ((((15.0 + x_0) > ((14.0 + x_2) > (17.0 + x_6)? (14.0 + x_2) : (17.0 + x_6))? (15.0 + x_0) : ((14.0 + x_2) > (17.0 + x_6)? (14.0 + x_2) : (17.0 + x_6))) > (((13.0 + x_8) > (12.0 + x_13)? (13.0 + x_8) : (12.0 + x_13)) > ((16.0 + x_18) > (16.0 + x_19)? (16.0 + x_18) : (16.0 + x_19))? ((13.0 + x_8) > (12.0 + x_13)? (13.0 + x_8) : (12.0 + x_13)) : ((16.0 + x_18) > (16.0 + x_19)? (16.0 + x_18) : (16.0 + x_19)))? ((15.0 + x_0) > ((14.0 + x_2) > (17.0 + x_6)? (14.0 + x_2) : (17.0 + x_6))? (15.0 + x_0) : ((14.0 + x_2) > (17.0 + x_6)? (14.0 + x_2) : (17.0 + x_6))) : (((13.0 + x_8) > (12.0 + x_13)? (13.0 + x_8) : (12.0 + x_13)) > ((16.0 + x_18) > (16.0 + x_19)? (16.0 + x_18) : (16.0 + x_19))? ((13.0 + x_8) > (12.0 + x_13)? (13.0 + x_8) : (12.0 + x_13)) : ((16.0 + x_18) > (16.0 + x_19)? (16.0 + x_18) : (16.0 + x_19)))) > (((12.0 + x_20) > ((3.0 + x_21) > (4.0 + x_22)? (3.0 + x_21) : (4.0 + x_22))? (12.0 + x_20) : ((3.0 + x_21) > (4.0 + x_22)? (3.0 + x_21) : (4.0 + x_22))) > (((18.0 + x_23) > (20.0 + x_24)? (18.0 + x_23) : (20.0 + x_24)) > ((20.0 + x_25) > (1.0 + x_27)? (20.0 + x_25) : (1.0 + x_27))? ((18.0 + x_23) > (20.0 + x_24)? (18.0 + x_23) : (20.0 + x_24)) : ((20.0 + x_25) > (1.0 + x_27)? (20.0 + x_25) : (1.0 + x_27)))? ((12.0 + x_20) > ((3.0 + x_21) > (4.0 + x_22)? (3.0 + x_21) : (4.0 + x_22))? (12.0 + x_20) : ((3.0 + x_21) > (4.0 + x_22)? (3.0 + x_21) : (4.0 + x_22))) : (((18.0 + x_23) > (20.0 + x_24)? (18.0 + x_23) : (20.0 + x_24)) > ((20.0 + x_25) > (1.0 + x_27)? (20.0 + x_25) : (1.0 + x_27))? ((18.0 + x_23) > (20.0 + x_24)? (18.0 + x_23) : (20.0 + x_24)) : ((20.0 + x_25) > (1.0 + x_27)? (20.0 + x_25) : (1.0 + x_27))))? (((15.0 + x_0) > ((14.0 + x_2) > (17.0 + x_6)? (14.0 + x_2) : (17.0 + x_6))? (15.0 + x_0) : ((14.0 + x_2) > (17.0 + x_6)? (14.0 + x_2) : (17.0 + x_6))) > (((13.0 + x_8) > (12.0 + x_13)? (13.0 + x_8) : (12.0 + x_13)) > ((16.0 + x_18) > (16.0 + x_19)? (16.0 + x_18) : (16.0 + x_19))? ((13.0 + x_8) > (12.0 + x_13)? (13.0 + x_8) : (12.0 + x_13)) : ((16.0 + x_18) > (16.0 + x_19)? (16.0 + x_18) : (16.0 + x_19)))? ((15.0 + x_0) > ((14.0 + x_2) > (17.0 + x_6)? (14.0 + x_2) : (17.0 + x_6))? (15.0 + x_0) : ((14.0 + x_2) > (17.0 + x_6)? (14.0 + x_2) : (17.0 + x_6))) : (((13.0 + x_8) > (12.0 + x_13)? (13.0 + x_8) : (12.0 + x_13)) > ((16.0 + x_18) > (16.0 + x_19)? (16.0 + x_18) : (16.0 + x_19))? ((13.0 + x_8) > (12.0 + x_13)? (13.0 + x_8) : (12.0 + x_13)) : ((16.0 + x_18) > (16.0 + x_19)? (16.0 + x_18) : (16.0 + x_19)))) : (((12.0 + x_20) > ((3.0 + x_21) > (4.0 + x_22)? (3.0 + x_21) : (4.0 + x_22))? (12.0 + x_20) : ((3.0 + x_21) > (4.0 + x_22)? (3.0 + x_21) : (4.0 + x_22))) > (((18.0 + x_23) > (20.0 + x_24)? (18.0 + x_23) : (20.0 + x_24)) > ((20.0 + x_25) > (1.0 + x_27)? (20.0 + x_25) : (1.0 + x_27))? ((18.0 + x_23) > (20.0 + x_24)? (18.0 + x_23) : (20.0 + x_24)) : ((20.0 + x_25) > (1.0 + x_27)? (20.0 + x_25) : (1.0 + x_27)))? ((12.0 + x_20) > ((3.0 + x_21) > (4.0 + x_22)? (3.0 + x_21) : (4.0 + x_22))? (12.0 + x_20) : ((3.0 + x_21) > (4.0 + x_22)? (3.0 + x_21) : (4.0 + x_22))) : (((18.0 + x_23) > (20.0 + x_24)? (18.0 + x_23) : (20.0 + x_24)) > ((20.0 + x_25) > (1.0 + x_27)? (20.0 + x_25) : (1.0 + x_27))? ((18.0 + x_23) > (20.0 + x_24)? (18.0 + x_23) : (20.0 + x_24)) : ((20.0 + x_25) > (1.0 + x_27)? (20.0 + x_25) : (1.0 + x_27)))));
x_8_ = ((((7.0 + x_0) > ((1.0 + x_3) > (9.0 + x_4)? (1.0 + x_3) : (9.0 + x_4))? (7.0 + x_0) : ((1.0 + x_3) > (9.0 + x_4)? (1.0 + x_3) : (9.0 + x_4))) > (((4.0 + x_6) > (12.0 + x_7)? (4.0 + x_6) : (12.0 + x_7)) > ((6.0 + x_9) > (15.0 + x_10)? (6.0 + x_9) : (15.0 + x_10))? ((4.0 + x_6) > (12.0 + x_7)? (4.0 + x_6) : (12.0 + x_7)) : ((6.0 + x_9) > (15.0 + x_10)? (6.0 + x_9) : (15.0 + x_10)))? ((7.0 + x_0) > ((1.0 + x_3) > (9.0 + x_4)? (1.0 + x_3) : (9.0 + x_4))? (7.0 + x_0) : ((1.0 + x_3) > (9.0 + x_4)? (1.0 + x_3) : (9.0 + x_4))) : (((4.0 + x_6) > (12.0 + x_7)? (4.0 + x_6) : (12.0 + x_7)) > ((6.0 + x_9) > (15.0 + x_10)? (6.0 + x_9) : (15.0 + x_10))? ((4.0 + x_6) > (12.0 + x_7)? (4.0 + x_6) : (12.0 + x_7)) : ((6.0 + x_9) > (15.0 + x_10)? (6.0 + x_9) : (15.0 + x_10)))) > (((2.0 + x_11) > ((4.0 + x_12) > (16.0 + x_14)? (4.0 + x_12) : (16.0 + x_14))? (2.0 + x_11) : ((4.0 + x_12) > (16.0 + x_14)? (4.0 + x_12) : (16.0 + x_14))) > (((11.0 + x_20) > (4.0 + x_22)? (11.0 + x_20) : (4.0 + x_22)) > ((15.0 + x_23) > (13.0 + x_25)? (15.0 + x_23) : (13.0 + x_25))? ((11.0 + x_20) > (4.0 + x_22)? (11.0 + x_20) : (4.0 + x_22)) : ((15.0 + x_23) > (13.0 + x_25)? (15.0 + x_23) : (13.0 + x_25)))? ((2.0 + x_11) > ((4.0 + x_12) > (16.0 + x_14)? (4.0 + x_12) : (16.0 + x_14))? (2.0 + x_11) : ((4.0 + x_12) > (16.0 + x_14)? (4.0 + x_12) : (16.0 + x_14))) : (((11.0 + x_20) > (4.0 + x_22)? (11.0 + x_20) : (4.0 + x_22)) > ((15.0 + x_23) > (13.0 + x_25)? (15.0 + x_23) : (13.0 + x_25))? ((11.0 + x_20) > (4.0 + x_22)? (11.0 + x_20) : (4.0 + x_22)) : ((15.0 + x_23) > (13.0 + x_25)? (15.0 + x_23) : (13.0 + x_25))))? (((7.0 + x_0) > ((1.0 + x_3) > (9.0 + x_4)? (1.0 + x_3) : (9.0 + x_4))? (7.0 + x_0) : ((1.0 + x_3) > (9.0 + x_4)? (1.0 + x_3) : (9.0 + x_4))) > (((4.0 + x_6) > (12.0 + x_7)? (4.0 + x_6) : (12.0 + x_7)) > ((6.0 + x_9) > (15.0 + x_10)? (6.0 + x_9) : (15.0 + x_10))? ((4.0 + x_6) > (12.0 + x_7)? (4.0 + x_6) : (12.0 + x_7)) : ((6.0 + x_9) > (15.0 + x_10)? (6.0 + x_9) : (15.0 + x_10)))? ((7.0 + x_0) > ((1.0 + x_3) > (9.0 + x_4)? (1.0 + x_3) : (9.0 + x_4))? (7.0 + x_0) : ((1.0 + x_3) > (9.0 + x_4)? (1.0 + x_3) : (9.0 + x_4))) : (((4.0 + x_6) > (12.0 + x_7)? (4.0 + x_6) : (12.0 + x_7)) > ((6.0 + x_9) > (15.0 + x_10)? (6.0 + x_9) : (15.0 + x_10))? ((4.0 + x_6) > (12.0 + x_7)? (4.0 + x_6) : (12.0 + x_7)) : ((6.0 + x_9) > (15.0 + x_10)? (6.0 + x_9) : (15.0 + x_10)))) : (((2.0 + x_11) > ((4.0 + x_12) > (16.0 + x_14)? (4.0 + x_12) : (16.0 + x_14))? (2.0 + x_11) : ((4.0 + x_12) > (16.0 + x_14)? (4.0 + x_12) : (16.0 + x_14))) > (((11.0 + x_20) > (4.0 + x_22)? (11.0 + x_20) : (4.0 + x_22)) > ((15.0 + x_23) > (13.0 + x_25)? (15.0 + x_23) : (13.0 + x_25))? ((11.0 + x_20) > (4.0 + x_22)? (11.0 + x_20) : (4.0 + x_22)) : ((15.0 + x_23) > (13.0 + x_25)? (15.0 + x_23) : (13.0 + x_25)))? ((2.0 + x_11) > ((4.0 + x_12) > (16.0 + x_14)? (4.0 + x_12) : (16.0 + x_14))? (2.0 + x_11) : ((4.0 + x_12) > (16.0 + x_14)? (4.0 + x_12) : (16.0 + x_14))) : (((11.0 + x_20) > (4.0 + x_22)? (11.0 + x_20) : (4.0 + x_22)) > ((15.0 + x_23) > (13.0 + x_25)? (15.0 + x_23) : (13.0 + x_25))? ((11.0 + x_20) > (4.0 + x_22)? (11.0 + x_20) : (4.0 + x_22)) : ((15.0 + x_23) > (13.0 + x_25)? (15.0 + x_23) : (13.0 + x_25)))));
x_9_ = ((((13.0 + x_1) > ((15.0 + x_2) > (1.0 + x_3)? (15.0 + x_2) : (1.0 + x_3))? (13.0 + x_1) : ((15.0 + x_2) > (1.0 + x_3)? (15.0 + x_2) : (1.0 + x_3))) > (((11.0 + x_4) > (2.0 + x_5)? (11.0 + x_4) : (2.0 + x_5)) > ((13.0 + x_6) > (18.0 + x_9)? (13.0 + x_6) : (18.0 + x_9))? ((11.0 + x_4) > (2.0 + x_5)? (11.0 + x_4) : (2.0 + x_5)) : ((13.0 + x_6) > (18.0 + x_9)? (13.0 + x_6) : (18.0 + x_9)))? ((13.0 + x_1) > ((15.0 + x_2) > (1.0 + x_3)? (15.0 + x_2) : (1.0 + x_3))? (13.0 + x_1) : ((15.0 + x_2) > (1.0 + x_3)? (15.0 + x_2) : (1.0 + x_3))) : (((11.0 + x_4) > (2.0 + x_5)? (11.0 + x_4) : (2.0 + x_5)) > ((13.0 + x_6) > (18.0 + x_9)? (13.0 + x_6) : (18.0 + x_9))? ((11.0 + x_4) > (2.0 + x_5)? (11.0 + x_4) : (2.0 + x_5)) : ((13.0 + x_6) > (18.0 + x_9)? (13.0 + x_6) : (18.0 + x_9)))) > (((3.0 + x_13) > ((18.0 + x_14) > (4.0 + x_15)? (18.0 + x_14) : (4.0 + x_15))? (3.0 + x_13) : ((18.0 + x_14) > (4.0 + x_15)? (18.0 + x_14) : (4.0 + x_15))) > (((14.0 + x_16) > (14.0 + x_17)? (14.0 + x_16) : (14.0 + x_17)) > ((17.0 + x_19) > (10.0 + x_21)? (17.0 + x_19) : (10.0 + x_21))? ((14.0 + x_16) > (14.0 + x_17)? (14.0 + x_16) : (14.0 + x_17)) : ((17.0 + x_19) > (10.0 + x_21)? (17.0 + x_19) : (10.0 + x_21)))? ((3.0 + x_13) > ((18.0 + x_14) > (4.0 + x_15)? (18.0 + x_14) : (4.0 + x_15))? (3.0 + x_13) : ((18.0 + x_14) > (4.0 + x_15)? (18.0 + x_14) : (4.0 + x_15))) : (((14.0 + x_16) > (14.0 + x_17)? (14.0 + x_16) : (14.0 + x_17)) > ((17.0 + x_19) > (10.0 + x_21)? (17.0 + x_19) : (10.0 + x_21))? ((14.0 + x_16) > (14.0 + x_17)? (14.0 + x_16) : (14.0 + x_17)) : ((17.0 + x_19) > (10.0 + x_21)? (17.0 + x_19) : (10.0 + x_21))))? (((13.0 + x_1) > ((15.0 + x_2) > (1.0 + x_3)? (15.0 + x_2) : (1.0 + x_3))? (13.0 + x_1) : ((15.0 + x_2) > (1.0 + x_3)? (15.0 + x_2) : (1.0 + x_3))) > (((11.0 + x_4) > (2.0 + x_5)? (11.0 + x_4) : (2.0 + x_5)) > ((13.0 + x_6) > (18.0 + x_9)? (13.0 + x_6) : (18.0 + x_9))? ((11.0 + x_4) > (2.0 + x_5)? (11.0 + x_4) : (2.0 + x_5)) : ((13.0 + x_6) > (18.0 + x_9)? (13.0 + x_6) : (18.0 + x_9)))? ((13.0 + x_1) > ((15.0 + x_2) > (1.0 + x_3)? (15.0 + x_2) : (1.0 + x_3))? (13.0 + x_1) : ((15.0 + x_2) > (1.0 + x_3)? (15.0 + x_2) : (1.0 + x_3))) : (((11.0 + x_4) > (2.0 + x_5)? (11.0 + x_4) : (2.0 + x_5)) > ((13.0 + x_6) > (18.0 + x_9)? (13.0 + x_6) : (18.0 + x_9))? ((11.0 + x_4) > (2.0 + x_5)? (11.0 + x_4) : (2.0 + x_5)) : ((13.0 + x_6) > (18.0 + x_9)? (13.0 + x_6) : (18.0 + x_9)))) : (((3.0 + x_13) > ((18.0 + x_14) > (4.0 + x_15)? (18.0 + x_14) : (4.0 + x_15))? (3.0 + x_13) : ((18.0 + x_14) > (4.0 + x_15)? (18.0 + x_14) : (4.0 + x_15))) > (((14.0 + x_16) > (14.0 + x_17)? (14.0 + x_16) : (14.0 + x_17)) > ((17.0 + x_19) > (10.0 + x_21)? (17.0 + x_19) : (10.0 + x_21))? ((14.0 + x_16) > (14.0 + x_17)? (14.0 + x_16) : (14.0 + x_17)) : ((17.0 + x_19) > (10.0 + x_21)? (17.0 + x_19) : (10.0 + x_21)))? ((3.0 + x_13) > ((18.0 + x_14) > (4.0 + x_15)? (18.0 + x_14) : (4.0 + x_15))? (3.0 + x_13) : ((18.0 + x_14) > (4.0 + x_15)? (18.0 + x_14) : (4.0 + x_15))) : (((14.0 + x_16) > (14.0 + x_17)? (14.0 + x_16) : (14.0 + x_17)) > ((17.0 + x_19) > (10.0 + x_21)? (17.0 + x_19) : (10.0 + x_21))? ((14.0 + x_16) > (14.0 + x_17)? (14.0 + x_16) : (14.0 + x_17)) : ((17.0 + x_19) > (10.0 + x_21)? (17.0 + x_19) : (10.0 + x_21)))));
x_10_ = ((((10.0 + x_0) > ((5.0 + x_1) > (5.0 + x_2)? (5.0 + x_1) : (5.0 + x_2))? (10.0 + x_0) : ((5.0 + x_1) > (5.0 + x_2)? (5.0 + x_1) : (5.0 + x_2))) > (((6.0 + x_3) > (18.0 + x_4)? (6.0 + x_3) : (18.0 + x_4)) > ((20.0 + x_6) > (8.0 + x_12)? (20.0 + x_6) : (8.0 + x_12))? ((6.0 + x_3) > (18.0 + x_4)? (6.0 + x_3) : (18.0 + x_4)) : ((20.0 + x_6) > (8.0 + x_12)? (20.0 + x_6) : (8.0 + x_12)))? ((10.0 + x_0) > ((5.0 + x_1) > (5.0 + x_2)? (5.0 + x_1) : (5.0 + x_2))? (10.0 + x_0) : ((5.0 + x_1) > (5.0 + x_2)? (5.0 + x_1) : (5.0 + x_2))) : (((6.0 + x_3) > (18.0 + x_4)? (6.0 + x_3) : (18.0 + x_4)) > ((20.0 + x_6) > (8.0 + x_12)? (20.0 + x_6) : (8.0 + x_12))? ((6.0 + x_3) > (18.0 + x_4)? (6.0 + x_3) : (18.0 + x_4)) : ((20.0 + x_6) > (8.0 + x_12)? (20.0 + x_6) : (8.0 + x_12)))) > (((2.0 + x_14) > ((17.0 + x_15) > (11.0 + x_17)? (17.0 + x_15) : (11.0 + x_17))? (2.0 + x_14) : ((17.0 + x_15) > (11.0 + x_17)? (17.0 + x_15) : (11.0 + x_17))) > (((4.0 + x_18) > (17.0 + x_20)? (4.0 + x_18) : (17.0 + x_20)) > ((20.0 + x_21) > (11.0 + x_25)? (20.0 + x_21) : (11.0 + x_25))? ((4.0 + x_18) > (17.0 + x_20)? (4.0 + x_18) : (17.0 + x_20)) : ((20.0 + x_21) > (11.0 + x_25)? (20.0 + x_21) : (11.0 + x_25)))? ((2.0 + x_14) > ((17.0 + x_15) > (11.0 + x_17)? (17.0 + x_15) : (11.0 + x_17))? (2.0 + x_14) : ((17.0 + x_15) > (11.0 + x_17)? (17.0 + x_15) : (11.0 + x_17))) : (((4.0 + x_18) > (17.0 + x_20)? (4.0 + x_18) : (17.0 + x_20)) > ((20.0 + x_21) > (11.0 + x_25)? (20.0 + x_21) : (11.0 + x_25))? ((4.0 + x_18) > (17.0 + x_20)? (4.0 + x_18) : (17.0 + x_20)) : ((20.0 + x_21) > (11.0 + x_25)? (20.0 + x_21) : (11.0 + x_25))))? (((10.0 + x_0) > ((5.0 + x_1) > (5.0 + x_2)? (5.0 + x_1) : (5.0 + x_2))? (10.0 + x_0) : ((5.0 + x_1) > (5.0 + x_2)? (5.0 + x_1) : (5.0 + x_2))) > (((6.0 + x_3) > (18.0 + x_4)? (6.0 + x_3) : (18.0 + x_4)) > ((20.0 + x_6) > (8.0 + x_12)? (20.0 + x_6) : (8.0 + x_12))? ((6.0 + x_3) > (18.0 + x_4)? (6.0 + x_3) : (18.0 + x_4)) : ((20.0 + x_6) > (8.0 + x_12)? (20.0 + x_6) : (8.0 + x_12)))? ((10.0 + x_0) > ((5.0 + x_1) > (5.0 + x_2)? (5.0 + x_1) : (5.0 + x_2))? (10.0 + x_0) : ((5.0 + x_1) > (5.0 + x_2)? (5.0 + x_1) : (5.0 + x_2))) : (((6.0 + x_3) > (18.0 + x_4)? (6.0 + x_3) : (18.0 + x_4)) > ((20.0 + x_6) > (8.0 + x_12)? (20.0 + x_6) : (8.0 + x_12))? ((6.0 + x_3) > (18.0 + x_4)? (6.0 + x_3) : (18.0 + x_4)) : ((20.0 + x_6) > (8.0 + x_12)? (20.0 + x_6) : (8.0 + x_12)))) : (((2.0 + x_14) > ((17.0 + x_15) > (11.0 + x_17)? (17.0 + x_15) : (11.0 + x_17))? (2.0 + x_14) : ((17.0 + x_15) > (11.0 + x_17)? (17.0 + x_15) : (11.0 + x_17))) > (((4.0 + x_18) > (17.0 + x_20)? (4.0 + x_18) : (17.0 + x_20)) > ((20.0 + x_21) > (11.0 + x_25)? (20.0 + x_21) : (11.0 + x_25))? ((4.0 + x_18) > (17.0 + x_20)? (4.0 + x_18) : (17.0 + x_20)) : ((20.0 + x_21) > (11.0 + x_25)? (20.0 + x_21) : (11.0 + x_25)))? ((2.0 + x_14) > ((17.0 + x_15) > (11.0 + x_17)? (17.0 + x_15) : (11.0 + x_17))? (2.0 + x_14) : ((17.0 + x_15) > (11.0 + x_17)? (17.0 + x_15) : (11.0 + x_17))) : (((4.0 + x_18) > (17.0 + x_20)? (4.0 + x_18) : (17.0 + x_20)) > ((20.0 + x_21) > (11.0 + x_25)? (20.0 + x_21) : (11.0 + x_25))? ((4.0 + x_18) > (17.0 + x_20)? (4.0 + x_18) : (17.0 + x_20)) : ((20.0 + x_21) > (11.0 + x_25)? (20.0 + x_21) : (11.0 + x_25)))));
x_11_ = ((((17.0 + x_0) > ((3.0 + x_2) > (8.0 + x_4)? (3.0 + x_2) : (8.0 + x_4))? (17.0 + x_0) : ((3.0 + x_2) > (8.0 + x_4)? (3.0 + x_2) : (8.0 + x_4))) > (((14.0 + x_5) > (4.0 + x_6)? (14.0 + x_5) : (4.0 + x_6)) > ((1.0 + x_9) > (6.0 + x_11)? (1.0 + x_9) : (6.0 + x_11))? ((14.0 + x_5) > (4.0 + x_6)? (14.0 + x_5) : (4.0 + x_6)) : ((1.0 + x_9) > (6.0 + x_11)? (1.0 + x_9) : (6.0 + x_11)))? ((17.0 + x_0) > ((3.0 + x_2) > (8.0 + x_4)? (3.0 + x_2) : (8.0 + x_4))? (17.0 + x_0) : ((3.0 + x_2) > (8.0 + x_4)? (3.0 + x_2) : (8.0 + x_4))) : (((14.0 + x_5) > (4.0 + x_6)? (14.0 + x_5) : (4.0 + x_6)) > ((1.0 + x_9) > (6.0 + x_11)? (1.0 + x_9) : (6.0 + x_11))? ((14.0 + x_5) > (4.0 + x_6)? (14.0 + x_5) : (4.0 + x_6)) : ((1.0 + x_9) > (6.0 + x_11)? (1.0 + x_9) : (6.0 + x_11)))) > (((14.0 + x_12) > ((4.0 + x_13) > (1.0 + x_14)? (4.0 + x_13) : (1.0 + x_14))? (14.0 + x_12) : ((4.0 + x_13) > (1.0 + x_14)? (4.0 + x_13) : (1.0 + x_14))) > (((9.0 + x_16) > (11.0 + x_18)? (9.0 + x_16) : (11.0 + x_18)) > ((19.0 + x_26) > (10.0 + x_27)? (19.0 + x_26) : (10.0 + x_27))? ((9.0 + x_16) > (11.0 + x_18)? (9.0 + x_16) : (11.0 + x_18)) : ((19.0 + x_26) > (10.0 + x_27)? (19.0 + x_26) : (10.0 + x_27)))? ((14.0 + x_12) > ((4.0 + x_13) > (1.0 + x_14)? (4.0 + x_13) : (1.0 + x_14))? (14.0 + x_12) : ((4.0 + x_13) > (1.0 + x_14)? (4.0 + x_13) : (1.0 + x_14))) : (((9.0 + x_16) > (11.0 + x_18)? (9.0 + x_16) : (11.0 + x_18)) > ((19.0 + x_26) > (10.0 + x_27)? (19.0 + x_26) : (10.0 + x_27))? ((9.0 + x_16) > (11.0 + x_18)? (9.0 + x_16) : (11.0 + x_18)) : ((19.0 + x_26) > (10.0 + x_27)? (19.0 + x_26) : (10.0 + x_27))))? (((17.0 + x_0) > ((3.0 + x_2) > (8.0 + x_4)? (3.0 + x_2) : (8.0 + x_4))? (17.0 + x_0) : ((3.0 + x_2) > (8.0 + x_4)? (3.0 + x_2) : (8.0 + x_4))) > (((14.0 + x_5) > (4.0 + x_6)? (14.0 + x_5) : (4.0 + x_6)) > ((1.0 + x_9) > (6.0 + x_11)? (1.0 + x_9) : (6.0 + x_11))? ((14.0 + x_5) > (4.0 + x_6)? (14.0 + x_5) : (4.0 + x_6)) : ((1.0 + x_9) > (6.0 + x_11)? (1.0 + x_9) : (6.0 + x_11)))? ((17.0 + x_0) > ((3.0 + x_2) > (8.0 + x_4)? (3.0 + x_2) : (8.0 + x_4))? (17.0 + x_0) : ((3.0 + x_2) > (8.0 + x_4)? (3.0 + x_2) : (8.0 + x_4))) : (((14.0 + x_5) > (4.0 + x_6)? (14.0 + x_5) : (4.0 + x_6)) > ((1.0 + x_9) > (6.0 + x_11)? (1.0 + x_9) : (6.0 + x_11))? ((14.0 + x_5) > (4.0 + x_6)? (14.0 + x_5) : (4.0 + x_6)) : ((1.0 + x_9) > (6.0 + x_11)? (1.0 + x_9) : (6.0 + x_11)))) : (((14.0 + x_12) > ((4.0 + x_13) > (1.0 + x_14)? (4.0 + x_13) : (1.0 + x_14))? (14.0 + x_12) : ((4.0 + x_13) > (1.0 + x_14)? (4.0 + x_13) : (1.0 + x_14))) > (((9.0 + x_16) > (11.0 + x_18)? (9.0 + x_16) : (11.0 + x_18)) > ((19.0 + x_26) > (10.0 + x_27)? (19.0 + x_26) : (10.0 + x_27))? ((9.0 + x_16) > (11.0 + x_18)? (9.0 + x_16) : (11.0 + x_18)) : ((19.0 + x_26) > (10.0 + x_27)? (19.0 + x_26) : (10.0 + x_27)))? ((14.0 + x_12) > ((4.0 + x_13) > (1.0 + x_14)? (4.0 + x_13) : (1.0 + x_14))? (14.0 + x_12) : ((4.0 + x_13) > (1.0 + x_14)? (4.0 + x_13) : (1.0 + x_14))) : (((9.0 + x_16) > (11.0 + x_18)? (9.0 + x_16) : (11.0 + x_18)) > ((19.0 + x_26) > (10.0 + x_27)? (19.0 + x_26) : (10.0 + x_27))? ((9.0 + x_16) > (11.0 + x_18)? (9.0 + x_16) : (11.0 + x_18)) : ((19.0 + x_26) > (10.0 + x_27)? (19.0 + x_26) : (10.0 + x_27)))));
x_12_ = ((((15.0 + x_1) > ((1.0 + x_2) > (6.0 + x_3)? (1.0 + x_2) : (6.0 + x_3))? (15.0 + x_1) : ((1.0 + x_2) > (6.0 + x_3)? (1.0 + x_2) : (6.0 + x_3))) > (((17.0 + x_5) > (6.0 + x_6)? (17.0 + x_5) : (6.0 + x_6)) > ((10.0 + x_7) > (17.0 + x_9)? (10.0 + x_7) : (17.0 + x_9))? ((17.0 + x_5) > (6.0 + x_6)? (17.0 + x_5) : (6.0 + x_6)) : ((10.0 + x_7) > (17.0 + x_9)? (10.0 + x_7) : (17.0 + x_9)))? ((15.0 + x_1) > ((1.0 + x_2) > (6.0 + x_3)? (1.0 + x_2) : (6.0 + x_3))? (15.0 + x_1) : ((1.0 + x_2) > (6.0 + x_3)? (1.0 + x_2) : (6.0 + x_3))) : (((17.0 + x_5) > (6.0 + x_6)? (17.0 + x_5) : (6.0 + x_6)) > ((10.0 + x_7) > (17.0 + x_9)? (10.0 + x_7) : (17.0 + x_9))? ((17.0 + x_5) > (6.0 + x_6)? (17.0 + x_5) : (6.0 + x_6)) : ((10.0 + x_7) > (17.0 + x_9)? (10.0 + x_7) : (17.0 + x_9)))) > (((3.0 + x_11) > ((3.0 + x_12) > (1.0 + x_14)? (3.0 + x_12) : (1.0 + x_14))? (3.0 + x_11) : ((3.0 + x_12) > (1.0 + x_14)? (3.0 + x_12) : (1.0 + x_14))) > (((10.0 + x_18) > (12.0 + x_19)? (10.0 + x_18) : (12.0 + x_19)) > ((13.0 + x_23) > (12.0 + x_25)? (13.0 + x_23) : (12.0 + x_25))? ((10.0 + x_18) > (12.0 + x_19)? (10.0 + x_18) : (12.0 + x_19)) : ((13.0 + x_23) > (12.0 + x_25)? (13.0 + x_23) : (12.0 + x_25)))? ((3.0 + x_11) > ((3.0 + x_12) > (1.0 + x_14)? (3.0 + x_12) : (1.0 + x_14))? (3.0 + x_11) : ((3.0 + x_12) > (1.0 + x_14)? (3.0 + x_12) : (1.0 + x_14))) : (((10.0 + x_18) > (12.0 + x_19)? (10.0 + x_18) : (12.0 + x_19)) > ((13.0 + x_23) > (12.0 + x_25)? (13.0 + x_23) : (12.0 + x_25))? ((10.0 + x_18) > (12.0 + x_19)? (10.0 + x_18) : (12.0 + x_19)) : ((13.0 + x_23) > (12.0 + x_25)? (13.0 + x_23) : (12.0 + x_25))))? (((15.0 + x_1) > ((1.0 + x_2) > (6.0 + x_3)? (1.0 + x_2) : (6.0 + x_3))? (15.0 + x_1) : ((1.0 + x_2) > (6.0 + x_3)? (1.0 + x_2) : (6.0 + x_3))) > (((17.0 + x_5) > (6.0 + x_6)? (17.0 + x_5) : (6.0 + x_6)) > ((10.0 + x_7) > (17.0 + x_9)? (10.0 + x_7) : (17.0 + x_9))? ((17.0 + x_5) > (6.0 + x_6)? (17.0 + x_5) : (6.0 + x_6)) : ((10.0 + x_7) > (17.0 + x_9)? (10.0 + x_7) : (17.0 + x_9)))? ((15.0 + x_1) > ((1.0 + x_2) > (6.0 + x_3)? (1.0 + x_2) : (6.0 + x_3))? (15.0 + x_1) : ((1.0 + x_2) > (6.0 + x_3)? (1.0 + x_2) : (6.0 + x_3))) : (((17.0 + x_5) > (6.0 + x_6)? (17.0 + x_5) : (6.0 + x_6)) > ((10.0 + x_7) > (17.0 + x_9)? (10.0 + x_7) : (17.0 + x_9))? ((17.0 + x_5) > (6.0 + x_6)? (17.0 + x_5) : (6.0 + x_6)) : ((10.0 + x_7) > (17.0 + x_9)? (10.0 + x_7) : (17.0 + x_9)))) : (((3.0 + x_11) > ((3.0 + x_12) > (1.0 + x_14)? (3.0 + x_12) : (1.0 + x_14))? (3.0 + x_11) : ((3.0 + x_12) > (1.0 + x_14)? (3.0 + x_12) : (1.0 + x_14))) > (((10.0 + x_18) > (12.0 + x_19)? (10.0 + x_18) : (12.0 + x_19)) > ((13.0 + x_23) > (12.0 + x_25)? (13.0 + x_23) : (12.0 + x_25))? ((10.0 + x_18) > (12.0 + x_19)? (10.0 + x_18) : (12.0 + x_19)) : ((13.0 + x_23) > (12.0 + x_25)? (13.0 + x_23) : (12.0 + x_25)))? ((3.0 + x_11) > ((3.0 + x_12) > (1.0 + x_14)? (3.0 + x_12) : (1.0 + x_14))? (3.0 + x_11) : ((3.0 + x_12) > (1.0 + x_14)? (3.0 + x_12) : (1.0 + x_14))) : (((10.0 + x_18) > (12.0 + x_19)? (10.0 + x_18) : (12.0 + x_19)) > ((13.0 + x_23) > (12.0 + x_25)? (13.0 + x_23) : (12.0 + x_25))? ((10.0 + x_18) > (12.0 + x_19)? (10.0 + x_18) : (12.0 + x_19)) : ((13.0 + x_23) > (12.0 + x_25)? (13.0 + x_23) : (12.0 + x_25)))));
x_13_ = ((((17.0 + x_0) > ((2.0 + x_4) > (17.0 + x_6)? (2.0 + x_4) : (17.0 + x_6))? (17.0 + x_0) : ((2.0 + x_4) > (17.0 + x_6)? (2.0 + x_4) : (17.0 + x_6))) > (((13.0 + x_7) > (19.0 + x_8)? (13.0 + x_7) : (19.0 + x_8)) > ((1.0 + x_10) > (4.0 + x_12)? (1.0 + x_10) : (4.0 + x_12))? ((13.0 + x_7) > (19.0 + x_8)? (13.0 + x_7) : (19.0 + x_8)) : ((1.0 + x_10) > (4.0 + x_12)? (1.0 + x_10) : (4.0 + x_12)))? ((17.0 + x_0) > ((2.0 + x_4) > (17.0 + x_6)? (2.0 + x_4) : (17.0 + x_6))? (17.0 + x_0) : ((2.0 + x_4) > (17.0 + x_6)? (2.0 + x_4) : (17.0 + x_6))) : (((13.0 + x_7) > (19.0 + x_8)? (13.0 + x_7) : (19.0 + x_8)) > ((1.0 + x_10) > (4.0 + x_12)? (1.0 + x_10) : (4.0 + x_12))? ((13.0 + x_7) > (19.0 + x_8)? (13.0 + x_7) : (19.0 + x_8)) : ((1.0 + x_10) > (4.0 + x_12)? (1.0 + x_10) : (4.0 + x_12)))) > (((18.0 + x_13) > ((10.0 + x_14) > (10.0 + x_16)? (10.0 + x_14) : (10.0 + x_16))? (18.0 + x_13) : ((10.0 + x_14) > (10.0 + x_16)? (10.0 + x_14) : (10.0 + x_16))) > (((7.0 + x_20) > (8.0 + x_22)? (7.0 + x_20) : (8.0 + x_22)) > ((20.0 + x_26) > (19.0 + x_27)? (20.0 + x_26) : (19.0 + x_27))? ((7.0 + x_20) > (8.0 + x_22)? (7.0 + x_20) : (8.0 + x_22)) : ((20.0 + x_26) > (19.0 + x_27)? (20.0 + x_26) : (19.0 + x_27)))? ((18.0 + x_13) > ((10.0 + x_14) > (10.0 + x_16)? (10.0 + x_14) : (10.0 + x_16))? (18.0 + x_13) : ((10.0 + x_14) > (10.0 + x_16)? (10.0 + x_14) : (10.0 + x_16))) : (((7.0 + x_20) > (8.0 + x_22)? (7.0 + x_20) : (8.0 + x_22)) > ((20.0 + x_26) > (19.0 + x_27)? (20.0 + x_26) : (19.0 + x_27))? ((7.0 + x_20) > (8.0 + x_22)? (7.0 + x_20) : (8.0 + x_22)) : ((20.0 + x_26) > (19.0 + x_27)? (20.0 + x_26) : (19.0 + x_27))))? (((17.0 + x_0) > ((2.0 + x_4) > (17.0 + x_6)? (2.0 + x_4) : (17.0 + x_6))? (17.0 + x_0) : ((2.0 + x_4) > (17.0 + x_6)? (2.0 + x_4) : (17.0 + x_6))) > (((13.0 + x_7) > (19.0 + x_8)? (13.0 + x_7) : (19.0 + x_8)) > ((1.0 + x_10) > (4.0 + x_12)? (1.0 + x_10) : (4.0 + x_12))? ((13.0 + x_7) > (19.0 + x_8)? (13.0 + x_7) : (19.0 + x_8)) : ((1.0 + x_10) > (4.0 + x_12)? (1.0 + x_10) : (4.0 + x_12)))? ((17.0 + x_0) > ((2.0 + x_4) > (17.0 + x_6)? (2.0 + x_4) : (17.0 + x_6))? (17.0 + x_0) : ((2.0 + x_4) > (17.0 + x_6)? (2.0 + x_4) : (17.0 + x_6))) : (((13.0 + x_7) > (19.0 + x_8)? (13.0 + x_7) : (19.0 + x_8)) > ((1.0 + x_10) > (4.0 + x_12)? (1.0 + x_10) : (4.0 + x_12))? ((13.0 + x_7) > (19.0 + x_8)? (13.0 + x_7) : (19.0 + x_8)) : ((1.0 + x_10) > (4.0 + x_12)? (1.0 + x_10) : (4.0 + x_12)))) : (((18.0 + x_13) > ((10.0 + x_14) > (10.0 + x_16)? (10.0 + x_14) : (10.0 + x_16))? (18.0 + x_13) : ((10.0 + x_14) > (10.0 + x_16)? (10.0 + x_14) : (10.0 + x_16))) > (((7.0 + x_20) > (8.0 + x_22)? (7.0 + x_20) : (8.0 + x_22)) > ((20.0 + x_26) > (19.0 + x_27)? (20.0 + x_26) : (19.0 + x_27))? ((7.0 + x_20) > (8.0 + x_22)? (7.0 + x_20) : (8.0 + x_22)) : ((20.0 + x_26) > (19.0 + x_27)? (20.0 + x_26) : (19.0 + x_27)))? ((18.0 + x_13) > ((10.0 + x_14) > (10.0 + x_16)? (10.0 + x_14) : (10.0 + x_16))? (18.0 + x_13) : ((10.0 + x_14) > (10.0 + x_16)? (10.0 + x_14) : (10.0 + x_16))) : (((7.0 + x_20) > (8.0 + x_22)? (7.0 + x_20) : (8.0 + x_22)) > ((20.0 + x_26) > (19.0 + x_27)? (20.0 + x_26) : (19.0 + x_27))? ((7.0 + x_20) > (8.0 + x_22)? (7.0 + x_20) : (8.0 + x_22)) : ((20.0 + x_26) > (19.0 + x_27)? (20.0 + x_26) : (19.0 + x_27)))));
x_14_ = ((((1.0 + x_1) > ((19.0 + x_4) > (12.0 + x_6)? (19.0 + x_4) : (12.0 + x_6))? (1.0 + x_1) : ((19.0 + x_4) > (12.0 + x_6)? (19.0 + x_4) : (12.0 + x_6))) > (((6.0 + x_7) > (19.0 + x_9)? (6.0 + x_7) : (19.0 + x_9)) > ((19.0 + x_11) > (17.0 + x_12)? (19.0 + x_11) : (17.0 + x_12))? ((6.0 + x_7) > (19.0 + x_9)? (6.0 + x_7) : (19.0 + x_9)) : ((19.0 + x_11) > (17.0 + x_12)? (19.0 + x_11) : (17.0 + x_12)))? ((1.0 + x_1) > ((19.0 + x_4) > (12.0 + x_6)? (19.0 + x_4) : (12.0 + x_6))? (1.0 + x_1) : ((19.0 + x_4) > (12.0 + x_6)? (19.0 + x_4) : (12.0 + x_6))) : (((6.0 + x_7) > (19.0 + x_9)? (6.0 + x_7) : (19.0 + x_9)) > ((19.0 + x_11) > (17.0 + x_12)? (19.0 + x_11) : (17.0 + x_12))? ((6.0 + x_7) > (19.0 + x_9)? (6.0 + x_7) : (19.0 + x_9)) : ((19.0 + x_11) > (17.0 + x_12)? (19.0 + x_11) : (17.0 + x_12)))) > (((19.0 + x_13) > ((6.0 + x_14) > (9.0 + x_18)? (6.0 + x_14) : (9.0 + x_18))? (19.0 + x_13) : ((6.0 + x_14) > (9.0 + x_18)? (6.0 + x_14) : (9.0 + x_18))) > (((3.0 + x_19) > (7.0 + x_22)? (3.0 + x_19) : (7.0 + x_22)) > ((14.0 + x_24) > (17.0 + x_25)? (14.0 + x_24) : (17.0 + x_25))? ((3.0 + x_19) > (7.0 + x_22)? (3.0 + x_19) : (7.0 + x_22)) : ((14.0 + x_24) > (17.0 + x_25)? (14.0 + x_24) : (17.0 + x_25)))? ((19.0 + x_13) > ((6.0 + x_14) > (9.0 + x_18)? (6.0 + x_14) : (9.0 + x_18))? (19.0 + x_13) : ((6.0 + x_14) > (9.0 + x_18)? (6.0 + x_14) : (9.0 + x_18))) : (((3.0 + x_19) > (7.0 + x_22)? (3.0 + x_19) : (7.0 + x_22)) > ((14.0 + x_24) > (17.0 + x_25)? (14.0 + x_24) : (17.0 + x_25))? ((3.0 + x_19) > (7.0 + x_22)? (3.0 + x_19) : (7.0 + x_22)) : ((14.0 + x_24) > (17.0 + x_25)? (14.0 + x_24) : (17.0 + x_25))))? (((1.0 + x_1) > ((19.0 + x_4) > (12.0 + x_6)? (19.0 + x_4) : (12.0 + x_6))? (1.0 + x_1) : ((19.0 + x_4) > (12.0 + x_6)? (19.0 + x_4) : (12.0 + x_6))) > (((6.0 + x_7) > (19.0 + x_9)? (6.0 + x_7) : (19.0 + x_9)) > ((19.0 + x_11) > (17.0 + x_12)? (19.0 + x_11) : (17.0 + x_12))? ((6.0 + x_7) > (19.0 + x_9)? (6.0 + x_7) : (19.0 + x_9)) : ((19.0 + x_11) > (17.0 + x_12)? (19.0 + x_11) : (17.0 + x_12)))? ((1.0 + x_1) > ((19.0 + x_4) > (12.0 + x_6)? (19.0 + x_4) : (12.0 + x_6))? (1.0 + x_1) : ((19.0 + x_4) > (12.0 + x_6)? (19.0 + x_4) : (12.0 + x_6))) : (((6.0 + x_7) > (19.0 + x_9)? (6.0 + x_7) : (19.0 + x_9)) > ((19.0 + x_11) > (17.0 + x_12)? (19.0 + x_11) : (17.0 + x_12))? ((6.0 + x_7) > (19.0 + x_9)? (6.0 + x_7) : (19.0 + x_9)) : ((19.0 + x_11) > (17.0 + x_12)? (19.0 + x_11) : (17.0 + x_12)))) : (((19.0 + x_13) > ((6.0 + x_14) > (9.0 + x_18)? (6.0 + x_14) : (9.0 + x_18))? (19.0 + x_13) : ((6.0 + x_14) > (9.0 + x_18)? (6.0 + x_14) : (9.0 + x_18))) > (((3.0 + x_19) > (7.0 + x_22)? (3.0 + x_19) : (7.0 + x_22)) > ((14.0 + x_24) > (17.0 + x_25)? (14.0 + x_24) : (17.0 + x_25))? ((3.0 + x_19) > (7.0 + x_22)? (3.0 + x_19) : (7.0 + x_22)) : ((14.0 + x_24) > (17.0 + x_25)? (14.0 + x_24) : (17.0 + x_25)))? ((19.0 + x_13) > ((6.0 + x_14) > (9.0 + x_18)? (6.0 + x_14) : (9.0 + x_18))? (19.0 + x_13) : ((6.0 + x_14) > (9.0 + x_18)? (6.0 + x_14) : (9.0 + x_18))) : (((3.0 + x_19) > (7.0 + x_22)? (3.0 + x_19) : (7.0 + x_22)) > ((14.0 + x_24) > (17.0 + x_25)? (14.0 + x_24) : (17.0 + x_25))? ((3.0 + x_19) > (7.0 + x_22)? (3.0 + x_19) : (7.0 + x_22)) : ((14.0 + x_24) > (17.0 + x_25)? (14.0 + x_24) : (17.0 + x_25)))));
x_15_ = ((((19.0 + x_2) > ((9.0 + x_4) > (20.0 + x_6)? (9.0 + x_4) : (20.0 + x_6))? (19.0 + x_2) : ((9.0 + x_4) > (20.0 + x_6)? (9.0 + x_4) : (20.0 + x_6))) > (((15.0 + x_9) > (16.0 + x_10)? (15.0 + x_9) : (16.0 + x_10)) > ((7.0 + x_12) > (12.0 + x_15)? (7.0 + x_12) : (12.0 + x_15))? ((15.0 + x_9) > (16.0 + x_10)? (15.0 + x_9) : (16.0 + x_10)) : ((7.0 + x_12) > (12.0 + x_15)? (7.0 + x_12) : (12.0 + x_15)))? ((19.0 + x_2) > ((9.0 + x_4) > (20.0 + x_6)? (9.0 + x_4) : (20.0 + x_6))? (19.0 + x_2) : ((9.0 + x_4) > (20.0 + x_6)? (9.0 + x_4) : (20.0 + x_6))) : (((15.0 + x_9) > (16.0 + x_10)? (15.0 + x_9) : (16.0 + x_10)) > ((7.0 + x_12) > (12.0 + x_15)? (7.0 + x_12) : (12.0 + x_15))? ((15.0 + x_9) > (16.0 + x_10)? (15.0 + x_9) : (16.0 + x_10)) : ((7.0 + x_12) > (12.0 + x_15)? (7.0 + x_12) : (12.0 + x_15)))) > (((12.0 + x_16) > ((11.0 + x_17) > (17.0 + x_20)? (11.0 + x_17) : (17.0 + x_20))? (12.0 + x_16) : ((11.0 + x_17) > (17.0 + x_20)? (11.0 + x_17) : (17.0 + x_20))) > (((4.0 + x_21) > (15.0 + x_22)? (4.0 + x_21) : (15.0 + x_22)) > ((20.0 + x_25) > (15.0 + x_27)? (20.0 + x_25) : (15.0 + x_27))? ((4.0 + x_21) > (15.0 + x_22)? (4.0 + x_21) : (15.0 + x_22)) : ((20.0 + x_25) > (15.0 + x_27)? (20.0 + x_25) : (15.0 + x_27)))? ((12.0 + x_16) > ((11.0 + x_17) > (17.0 + x_20)? (11.0 + x_17) : (17.0 + x_20))? (12.0 + x_16) : ((11.0 + x_17) > (17.0 + x_20)? (11.0 + x_17) : (17.0 + x_20))) : (((4.0 + x_21) > (15.0 + x_22)? (4.0 + x_21) : (15.0 + x_22)) > ((20.0 + x_25) > (15.0 + x_27)? (20.0 + x_25) : (15.0 + x_27))? ((4.0 + x_21) > (15.0 + x_22)? (4.0 + x_21) : (15.0 + x_22)) : ((20.0 + x_25) > (15.0 + x_27)? (20.0 + x_25) : (15.0 + x_27))))? (((19.0 + x_2) > ((9.0 + x_4) > (20.0 + x_6)? (9.0 + x_4) : (20.0 + x_6))? (19.0 + x_2) : ((9.0 + x_4) > (20.0 + x_6)? (9.0 + x_4) : (20.0 + x_6))) > (((15.0 + x_9) > (16.0 + x_10)? (15.0 + x_9) : (16.0 + x_10)) > ((7.0 + x_12) > (12.0 + x_15)? (7.0 + x_12) : (12.0 + x_15))? ((15.0 + x_9) > (16.0 + x_10)? (15.0 + x_9) : (16.0 + x_10)) : ((7.0 + x_12) > (12.0 + x_15)? (7.0 + x_12) : (12.0 + x_15)))? ((19.0 + x_2) > ((9.0 + x_4) > (20.0 + x_6)? (9.0 + x_4) : (20.0 + x_6))? (19.0 + x_2) : ((9.0 + x_4) > (20.0 + x_6)? (9.0 + x_4) : (20.0 + x_6))) : (((15.0 + x_9) > (16.0 + x_10)? (15.0 + x_9) : (16.0 + x_10)) > ((7.0 + x_12) > (12.0 + x_15)? (7.0 + x_12) : (12.0 + x_15))? ((15.0 + x_9) > (16.0 + x_10)? (15.0 + x_9) : (16.0 + x_10)) : ((7.0 + x_12) > (12.0 + x_15)? (7.0 + x_12) : (12.0 + x_15)))) : (((12.0 + x_16) > ((11.0 + x_17) > (17.0 + x_20)? (11.0 + x_17) : (17.0 + x_20))? (12.0 + x_16) : ((11.0 + x_17) > (17.0 + x_20)? (11.0 + x_17) : (17.0 + x_20))) > (((4.0 + x_21) > (15.0 + x_22)? (4.0 + x_21) : (15.0 + x_22)) > ((20.0 + x_25) > (15.0 + x_27)? (20.0 + x_25) : (15.0 + x_27))? ((4.0 + x_21) > (15.0 + x_22)? (4.0 + x_21) : (15.0 + x_22)) : ((20.0 + x_25) > (15.0 + x_27)? (20.0 + x_25) : (15.0 + x_27)))? ((12.0 + x_16) > ((11.0 + x_17) > (17.0 + x_20)? (11.0 + x_17) : (17.0 + x_20))? (12.0 + x_16) : ((11.0 + x_17) > (17.0 + x_20)? (11.0 + x_17) : (17.0 + x_20))) : (((4.0 + x_21) > (15.0 + x_22)? (4.0 + x_21) : (15.0 + x_22)) > ((20.0 + x_25) > (15.0 + x_27)? (20.0 + x_25) : (15.0 + x_27))? ((4.0 + x_21) > (15.0 + x_22)? (4.0 + x_21) : (15.0 + x_22)) : ((20.0 + x_25) > (15.0 + x_27)? (20.0 + x_25) : (15.0 + x_27)))));
x_16_ = ((((4.0 + x_3) > ((12.0 + x_4) > (16.0 + x_5)? (12.0 + x_4) : (16.0 + x_5))? (4.0 + x_3) : ((12.0 + x_4) > (16.0 + x_5)? (12.0 + x_4) : (16.0 + x_5))) > (((18.0 + x_6) > (13.0 + x_7)? (18.0 + x_6) : (13.0 + x_7)) > ((12.0 + x_8) > (19.0 + x_9)? (12.0 + x_8) : (19.0 + x_9))? ((18.0 + x_6) > (13.0 + x_7)? (18.0 + x_6) : (13.0 + x_7)) : ((12.0 + x_8) > (19.0 + x_9)? (12.0 + x_8) : (19.0 + x_9)))? ((4.0 + x_3) > ((12.0 + x_4) > (16.0 + x_5)? (12.0 + x_4) : (16.0 + x_5))? (4.0 + x_3) : ((12.0 + x_4) > (16.0 + x_5)? (12.0 + x_4) : (16.0 + x_5))) : (((18.0 + x_6) > (13.0 + x_7)? (18.0 + x_6) : (13.0 + x_7)) > ((12.0 + x_8) > (19.0 + x_9)? (12.0 + x_8) : (19.0 + x_9))? ((18.0 + x_6) > (13.0 + x_7)? (18.0 + x_6) : (13.0 + x_7)) : ((12.0 + x_8) > (19.0 + x_9)? (12.0 + x_8) : (19.0 + x_9)))) > (((17.0 + x_10) > ((4.0 + x_11) > (17.0 + x_12)? (4.0 + x_11) : (17.0 + x_12))? (17.0 + x_10) : ((4.0 + x_11) > (17.0 + x_12)? (4.0 + x_11) : (17.0 + x_12))) > (((1.0 + x_19) > (15.0 + x_23)? (1.0 + x_19) : (15.0 + x_23)) > ((15.0 + x_25) > (14.0 + x_26)? (15.0 + x_25) : (14.0 + x_26))? ((1.0 + x_19) > (15.0 + x_23)? (1.0 + x_19) : (15.0 + x_23)) : ((15.0 + x_25) > (14.0 + x_26)? (15.0 + x_25) : (14.0 + x_26)))? ((17.0 + x_10) > ((4.0 + x_11) > (17.0 + x_12)? (4.0 + x_11) : (17.0 + x_12))? (17.0 + x_10) : ((4.0 + x_11) > (17.0 + x_12)? (4.0 + x_11) : (17.0 + x_12))) : (((1.0 + x_19) > (15.0 + x_23)? (1.0 + x_19) : (15.0 + x_23)) > ((15.0 + x_25) > (14.0 + x_26)? (15.0 + x_25) : (14.0 + x_26))? ((1.0 + x_19) > (15.0 + x_23)? (1.0 + x_19) : (15.0 + x_23)) : ((15.0 + x_25) > (14.0 + x_26)? (15.0 + x_25) : (14.0 + x_26))))? (((4.0 + x_3) > ((12.0 + x_4) > (16.0 + x_5)? (12.0 + x_4) : (16.0 + x_5))? (4.0 + x_3) : ((12.0 + x_4) > (16.0 + x_5)? (12.0 + x_4) : (16.0 + x_5))) > (((18.0 + x_6) > (13.0 + x_7)? (18.0 + x_6) : (13.0 + x_7)) > ((12.0 + x_8) > (19.0 + x_9)? (12.0 + x_8) : (19.0 + x_9))? ((18.0 + x_6) > (13.0 + x_7)? (18.0 + x_6) : (13.0 + x_7)) : ((12.0 + x_8) > (19.0 + x_9)? (12.0 + x_8) : (19.0 + x_9)))? ((4.0 + x_3) > ((12.0 + x_4) > (16.0 + x_5)? (12.0 + x_4) : (16.0 + x_5))? (4.0 + x_3) : ((12.0 + x_4) > (16.0 + x_5)? (12.0 + x_4) : (16.0 + x_5))) : (((18.0 + x_6) > (13.0 + x_7)? (18.0 + x_6) : (13.0 + x_7)) > ((12.0 + x_8) > (19.0 + x_9)? (12.0 + x_8) : (19.0 + x_9))? ((18.0 + x_6) > (13.0 + x_7)? (18.0 + x_6) : (13.0 + x_7)) : ((12.0 + x_8) > (19.0 + x_9)? (12.0 + x_8) : (19.0 + x_9)))) : (((17.0 + x_10) > ((4.0 + x_11) > (17.0 + x_12)? (4.0 + x_11) : (17.0 + x_12))? (17.0 + x_10) : ((4.0 + x_11) > (17.0 + x_12)? (4.0 + x_11) : (17.0 + x_12))) > (((1.0 + x_19) > (15.0 + x_23)? (1.0 + x_19) : (15.0 + x_23)) > ((15.0 + x_25) > (14.0 + x_26)? (15.0 + x_25) : (14.0 + x_26))? ((1.0 + x_19) > (15.0 + x_23)? (1.0 + x_19) : (15.0 + x_23)) : ((15.0 + x_25) > (14.0 + x_26)? (15.0 + x_25) : (14.0 + x_26)))? ((17.0 + x_10) > ((4.0 + x_11) > (17.0 + x_12)? (4.0 + x_11) : (17.0 + x_12))? (17.0 + x_10) : ((4.0 + x_11) > (17.0 + x_12)? (4.0 + x_11) : (17.0 + x_12))) : (((1.0 + x_19) > (15.0 + x_23)? (1.0 + x_19) : (15.0 + x_23)) > ((15.0 + x_25) > (14.0 + x_26)? (15.0 + x_25) : (14.0 + x_26))? ((1.0 + x_19) > (15.0 + x_23)? (1.0 + x_19) : (15.0 + x_23)) : ((15.0 + x_25) > (14.0 + x_26)? (15.0 + x_25) : (14.0 + x_26)))));
x_17_ = ((((14.0 + x_0) > ((20.0 + x_1) > (5.0 + x_2)? (20.0 + x_1) : (5.0 + x_2))? (14.0 + x_0) : ((20.0 + x_1) > (5.0 + x_2)? (20.0 + x_1) : (5.0 + x_2))) > (((3.0 + x_3) > (2.0 + x_5)? (3.0 + x_3) : (2.0 + x_5)) > ((13.0 + x_6) > (12.0 + x_13)? (13.0 + x_6) : (12.0 + x_13))? ((3.0 + x_3) > (2.0 + x_5)? (3.0 + x_3) : (2.0 + x_5)) : ((13.0 + x_6) > (12.0 + x_13)? (13.0 + x_6) : (12.0 + x_13)))? ((14.0 + x_0) > ((20.0 + x_1) > (5.0 + x_2)? (20.0 + x_1) : (5.0 + x_2))? (14.0 + x_0) : ((20.0 + x_1) > (5.0 + x_2)? (20.0 + x_1) : (5.0 + x_2))) : (((3.0 + x_3) > (2.0 + x_5)? (3.0 + x_3) : (2.0 + x_5)) > ((13.0 + x_6) > (12.0 + x_13)? (13.0 + x_6) : (12.0 + x_13))? ((3.0 + x_3) > (2.0 + x_5)? (3.0 + x_3) : (2.0 + x_5)) : ((13.0 + x_6) > (12.0 + x_13)? (13.0 + x_6) : (12.0 + x_13)))) > (((7.0 + x_14) > ((6.0 + x_16) > (5.0 + x_18)? (6.0 + x_16) : (5.0 + x_18))? (7.0 + x_14) : ((6.0 + x_16) > (5.0 + x_18)? (6.0 + x_16) : (5.0 + x_18))) > (((1.0 + x_21) > (4.0 + x_22)? (1.0 + x_21) : (4.0 + x_22)) > ((14.0 + x_24) > (9.0 + x_27)? (14.0 + x_24) : (9.0 + x_27))? ((1.0 + x_21) > (4.0 + x_22)? (1.0 + x_21) : (4.0 + x_22)) : ((14.0 + x_24) > (9.0 + x_27)? (14.0 + x_24) : (9.0 + x_27)))? ((7.0 + x_14) > ((6.0 + x_16) > (5.0 + x_18)? (6.0 + x_16) : (5.0 + x_18))? (7.0 + x_14) : ((6.0 + x_16) > (5.0 + x_18)? (6.0 + x_16) : (5.0 + x_18))) : (((1.0 + x_21) > (4.0 + x_22)? (1.0 + x_21) : (4.0 + x_22)) > ((14.0 + x_24) > (9.0 + x_27)? (14.0 + x_24) : (9.0 + x_27))? ((1.0 + x_21) > (4.0 + x_22)? (1.0 + x_21) : (4.0 + x_22)) : ((14.0 + x_24) > (9.0 + x_27)? (14.0 + x_24) : (9.0 + x_27))))? (((14.0 + x_0) > ((20.0 + x_1) > (5.0 + x_2)? (20.0 + x_1) : (5.0 + x_2))? (14.0 + x_0) : ((20.0 + x_1) > (5.0 + x_2)? (20.0 + x_1) : (5.0 + x_2))) > (((3.0 + x_3) > (2.0 + x_5)? (3.0 + x_3) : (2.0 + x_5)) > ((13.0 + x_6) > (12.0 + x_13)? (13.0 + x_6) : (12.0 + x_13))? ((3.0 + x_3) > (2.0 + x_5)? (3.0 + x_3) : (2.0 + x_5)) : ((13.0 + x_6) > (12.0 + x_13)? (13.0 + x_6) : (12.0 + x_13)))? ((14.0 + x_0) > ((20.0 + x_1) > (5.0 + x_2)? (20.0 + x_1) : (5.0 + x_2))? (14.0 + x_0) : ((20.0 + x_1) > (5.0 + x_2)? (20.0 + x_1) : (5.0 + x_2))) : (((3.0 + x_3) > (2.0 + x_5)? (3.0 + x_3) : (2.0 + x_5)) > ((13.0 + x_6) > (12.0 + x_13)? (13.0 + x_6) : (12.0 + x_13))? ((3.0 + x_3) > (2.0 + x_5)? (3.0 + x_3) : (2.0 + x_5)) : ((13.0 + x_6) > (12.0 + x_13)? (13.0 + x_6) : (12.0 + x_13)))) : (((7.0 + x_14) > ((6.0 + x_16) > (5.0 + x_18)? (6.0 + x_16) : (5.0 + x_18))? (7.0 + x_14) : ((6.0 + x_16) > (5.0 + x_18)? (6.0 + x_16) : (5.0 + x_18))) > (((1.0 + x_21) > (4.0 + x_22)? (1.0 + x_21) : (4.0 + x_22)) > ((14.0 + x_24) > (9.0 + x_27)? (14.0 + x_24) : (9.0 + x_27))? ((1.0 + x_21) > (4.0 + x_22)? (1.0 + x_21) : (4.0 + x_22)) : ((14.0 + x_24) > (9.0 + x_27)? (14.0 + x_24) : (9.0 + x_27)))? ((7.0 + x_14) > ((6.0 + x_16) > (5.0 + x_18)? (6.0 + x_16) : (5.0 + x_18))? (7.0 + x_14) : ((6.0 + x_16) > (5.0 + x_18)? (6.0 + x_16) : (5.0 + x_18))) : (((1.0 + x_21) > (4.0 + x_22)? (1.0 + x_21) : (4.0 + x_22)) > ((14.0 + x_24) > (9.0 + x_27)? (14.0 + x_24) : (9.0 + x_27))? ((1.0 + x_21) > (4.0 + x_22)? (1.0 + x_21) : (4.0 + x_22)) : ((14.0 + x_24) > (9.0 + x_27)? (14.0 + x_24) : (9.0 + x_27)))));
x_18_ = ((((11.0 + x_1) > ((4.0 + x_2) > (6.0 + x_7)? (4.0 + x_2) : (6.0 + x_7))? (11.0 + x_1) : ((4.0 + x_2) > (6.0 + x_7)? (4.0 + x_2) : (6.0 + x_7))) > (((15.0 + x_9) > (6.0 + x_11)? (15.0 + x_9) : (6.0 + x_11)) > ((11.0 + x_12) > (11.0 + x_13)? (11.0 + x_12) : (11.0 + x_13))? ((15.0 + x_9) > (6.0 + x_11)? (15.0 + x_9) : (6.0 + x_11)) : ((11.0 + x_12) > (11.0 + x_13)? (11.0 + x_12) : (11.0 + x_13)))? ((11.0 + x_1) > ((4.0 + x_2) > (6.0 + x_7)? (4.0 + x_2) : (6.0 + x_7))? (11.0 + x_1) : ((4.0 + x_2) > (6.0 + x_7)? (4.0 + x_2) : (6.0 + x_7))) : (((15.0 + x_9) > (6.0 + x_11)? (15.0 + x_9) : (6.0 + x_11)) > ((11.0 + x_12) > (11.0 + x_13)? (11.0 + x_12) : (11.0 + x_13))? ((15.0 + x_9) > (6.0 + x_11)? (15.0 + x_9) : (6.0 + x_11)) : ((11.0 + x_12) > (11.0 + x_13)? (11.0 + x_12) : (11.0 + x_13)))) > (((4.0 + x_14) > ((3.0 + x_17) > (20.0 + x_18)? (3.0 + x_17) : (20.0 + x_18))? (4.0 + x_14) : ((3.0 + x_17) > (20.0 + x_18)? (3.0 + x_17) : (20.0 + x_18))) > (((11.0 + x_22) > (1.0 + x_25)? (11.0 + x_22) : (1.0 + x_25)) > ((15.0 + x_26) > (9.0 + x_27)? (15.0 + x_26) : (9.0 + x_27))? ((11.0 + x_22) > (1.0 + x_25)? (11.0 + x_22) : (1.0 + x_25)) : ((15.0 + x_26) > (9.0 + x_27)? (15.0 + x_26) : (9.0 + x_27)))? ((4.0 + x_14) > ((3.0 + x_17) > (20.0 + x_18)? (3.0 + x_17) : (20.0 + x_18))? (4.0 + x_14) : ((3.0 + x_17) > (20.0 + x_18)? (3.0 + x_17) : (20.0 + x_18))) : (((11.0 + x_22) > (1.0 + x_25)? (11.0 + x_22) : (1.0 + x_25)) > ((15.0 + x_26) > (9.0 + x_27)? (15.0 + x_26) : (9.0 + x_27))? ((11.0 + x_22) > (1.0 + x_25)? (11.0 + x_22) : (1.0 + x_25)) : ((15.0 + x_26) > (9.0 + x_27)? (15.0 + x_26) : (9.0 + x_27))))? (((11.0 + x_1) > ((4.0 + x_2) > (6.0 + x_7)? (4.0 + x_2) : (6.0 + x_7))? (11.0 + x_1) : ((4.0 + x_2) > (6.0 + x_7)? (4.0 + x_2) : (6.0 + x_7))) > (((15.0 + x_9) > (6.0 + x_11)? (15.0 + x_9) : (6.0 + x_11)) > ((11.0 + x_12) > (11.0 + x_13)? (11.0 + x_12) : (11.0 + x_13))? ((15.0 + x_9) > (6.0 + x_11)? (15.0 + x_9) : (6.0 + x_11)) : ((11.0 + x_12) > (11.0 + x_13)? (11.0 + x_12) : (11.0 + x_13)))? ((11.0 + x_1) > ((4.0 + x_2) > (6.0 + x_7)? (4.0 + x_2) : (6.0 + x_7))? (11.0 + x_1) : ((4.0 + x_2) > (6.0 + x_7)? (4.0 + x_2) : (6.0 + x_7))) : (((15.0 + x_9) > (6.0 + x_11)? (15.0 + x_9) : (6.0 + x_11)) > ((11.0 + x_12) > (11.0 + x_13)? (11.0 + x_12) : (11.0 + x_13))? ((15.0 + x_9) > (6.0 + x_11)? (15.0 + x_9) : (6.0 + x_11)) : ((11.0 + x_12) > (11.0 + x_13)? (11.0 + x_12) : (11.0 + x_13)))) : (((4.0 + x_14) > ((3.0 + x_17) > (20.0 + x_18)? (3.0 + x_17) : (20.0 + x_18))? (4.0 + x_14) : ((3.0 + x_17) > (20.0 + x_18)? (3.0 + x_17) : (20.0 + x_18))) > (((11.0 + x_22) > (1.0 + x_25)? (11.0 + x_22) : (1.0 + x_25)) > ((15.0 + x_26) > (9.0 + x_27)? (15.0 + x_26) : (9.0 + x_27))? ((11.0 + x_22) > (1.0 + x_25)? (11.0 + x_22) : (1.0 + x_25)) : ((15.0 + x_26) > (9.0 + x_27)? (15.0 + x_26) : (9.0 + x_27)))? ((4.0 + x_14) > ((3.0 + x_17) > (20.0 + x_18)? (3.0 + x_17) : (20.0 + x_18))? (4.0 + x_14) : ((3.0 + x_17) > (20.0 + x_18)? (3.0 + x_17) : (20.0 + x_18))) : (((11.0 + x_22) > (1.0 + x_25)? (11.0 + x_22) : (1.0 + x_25)) > ((15.0 + x_26) > (9.0 + x_27)? (15.0 + x_26) : (9.0 + x_27))? ((11.0 + x_22) > (1.0 + x_25)? (11.0 + x_22) : (1.0 + x_25)) : ((15.0 + x_26) > (9.0 + x_27)? (15.0 + x_26) : (9.0 + x_27)))));
x_19_ = ((((4.0 + x_0) > ((6.0 + x_2) > (2.0 + x_3)? (6.0 + x_2) : (2.0 + x_3))? (4.0 + x_0) : ((6.0 + x_2) > (2.0 + x_3)? (6.0 + x_2) : (2.0 + x_3))) > (((7.0 + x_4) > (3.0 + x_10)? (7.0 + x_4) : (3.0 + x_10)) > ((9.0 + x_11) > (8.0 + x_16)? (9.0 + x_11) : (8.0 + x_16))? ((7.0 + x_4) > (3.0 + x_10)? (7.0 + x_4) : (3.0 + x_10)) : ((9.0 + x_11) > (8.0 + x_16)? (9.0 + x_11) : (8.0 + x_16)))? ((4.0 + x_0) > ((6.0 + x_2) > (2.0 + x_3)? (6.0 + x_2) : (2.0 + x_3))? (4.0 + x_0) : ((6.0 + x_2) > (2.0 + x_3)? (6.0 + x_2) : (2.0 + x_3))) : (((7.0 + x_4) > (3.0 + x_10)? (7.0 + x_4) : (3.0 + x_10)) > ((9.0 + x_11) > (8.0 + x_16)? (9.0 + x_11) : (8.0 + x_16))? ((7.0 + x_4) > (3.0 + x_10)? (7.0 + x_4) : (3.0 + x_10)) : ((9.0 + x_11) > (8.0 + x_16)? (9.0 + x_11) : (8.0 + x_16)))) > (((3.0 + x_17) > ((12.0 + x_20) > (1.0 + x_21)? (12.0 + x_20) : (1.0 + x_21))? (3.0 + x_17) : ((12.0 + x_20) > (1.0 + x_21)? (12.0 + x_20) : (1.0 + x_21))) > (((11.0 + x_23) > (17.0 + x_24)? (11.0 + x_23) : (17.0 + x_24)) > ((12.0 + x_25) > (11.0 + x_27)? (12.0 + x_25) : (11.0 + x_27))? ((11.0 + x_23) > (17.0 + x_24)? (11.0 + x_23) : (17.0 + x_24)) : ((12.0 + x_25) > (11.0 + x_27)? (12.0 + x_25) : (11.0 + x_27)))? ((3.0 + x_17) > ((12.0 + x_20) > (1.0 + x_21)? (12.0 + x_20) : (1.0 + x_21))? (3.0 + x_17) : ((12.0 + x_20) > (1.0 + x_21)? (12.0 + x_20) : (1.0 + x_21))) : (((11.0 + x_23) > (17.0 + x_24)? (11.0 + x_23) : (17.0 + x_24)) > ((12.0 + x_25) > (11.0 + x_27)? (12.0 + x_25) : (11.0 + x_27))? ((11.0 + x_23) > (17.0 + x_24)? (11.0 + x_23) : (17.0 + x_24)) : ((12.0 + x_25) > (11.0 + x_27)? (12.0 + x_25) : (11.0 + x_27))))? (((4.0 + x_0) > ((6.0 + x_2) > (2.0 + x_3)? (6.0 + x_2) : (2.0 + x_3))? (4.0 + x_0) : ((6.0 + x_2) > (2.0 + x_3)? (6.0 + x_2) : (2.0 + x_3))) > (((7.0 + x_4) > (3.0 + x_10)? (7.0 + x_4) : (3.0 + x_10)) > ((9.0 + x_11) > (8.0 + x_16)? (9.0 + x_11) : (8.0 + x_16))? ((7.0 + x_4) > (3.0 + x_10)? (7.0 + x_4) : (3.0 + x_10)) : ((9.0 + x_11) > (8.0 + x_16)? (9.0 + x_11) : (8.0 + x_16)))? ((4.0 + x_0) > ((6.0 + x_2) > (2.0 + x_3)? (6.0 + x_2) : (2.0 + x_3))? (4.0 + x_0) : ((6.0 + x_2) > (2.0 + x_3)? (6.0 + x_2) : (2.0 + x_3))) : (((7.0 + x_4) > (3.0 + x_10)? (7.0 + x_4) : (3.0 + x_10)) > ((9.0 + x_11) > (8.0 + x_16)? (9.0 + x_11) : (8.0 + x_16))? ((7.0 + x_4) > (3.0 + x_10)? (7.0 + x_4) : (3.0 + x_10)) : ((9.0 + x_11) > (8.0 + x_16)? (9.0 + x_11) : (8.0 + x_16)))) : (((3.0 + x_17) > ((12.0 + x_20) > (1.0 + x_21)? (12.0 + x_20) : (1.0 + x_21))? (3.0 + x_17) : ((12.0 + x_20) > (1.0 + x_21)? (12.0 + x_20) : (1.0 + x_21))) > (((11.0 + x_23) > (17.0 + x_24)? (11.0 + x_23) : (17.0 + x_24)) > ((12.0 + x_25) > (11.0 + x_27)? (12.0 + x_25) : (11.0 + x_27))? ((11.0 + x_23) > (17.0 + x_24)? (11.0 + x_23) : (17.0 + x_24)) : ((12.0 + x_25) > (11.0 + x_27)? (12.0 + x_25) : (11.0 + x_27)))? ((3.0 + x_17) > ((12.0 + x_20) > (1.0 + x_21)? (12.0 + x_20) : (1.0 + x_21))? (3.0 + x_17) : ((12.0 + x_20) > (1.0 + x_21)? (12.0 + x_20) : (1.0 + x_21))) : (((11.0 + x_23) > (17.0 + x_24)? (11.0 + x_23) : (17.0 + x_24)) > ((12.0 + x_25) > (11.0 + x_27)? (12.0 + x_25) : (11.0 + x_27))? ((11.0 + x_23) > (17.0 + x_24)? (11.0 + x_23) : (17.0 + x_24)) : ((12.0 + x_25) > (11.0 + x_27)? (12.0 + x_25) : (11.0 + x_27)))));
x_20_ = ((((9.0 + x_1) > ((5.0 + x_2) > (3.0 + x_4)? (5.0 + x_2) : (3.0 + x_4))? (9.0 + x_1) : ((5.0 + x_2) > (3.0 + x_4)? (5.0 + x_2) : (3.0 + x_4))) > (((18.0 + x_5) > (9.0 + x_6)? (18.0 + x_5) : (9.0 + x_6)) > ((8.0 + x_7) > (11.0 + x_10)? (8.0 + x_7) : (11.0 + x_10))? ((18.0 + x_5) > (9.0 + x_6)? (18.0 + x_5) : (9.0 + x_6)) : ((8.0 + x_7) > (11.0 + x_10)? (8.0 + x_7) : (11.0 + x_10)))? ((9.0 + x_1) > ((5.0 + x_2) > (3.0 + x_4)? (5.0 + x_2) : (3.0 + x_4))? (9.0 + x_1) : ((5.0 + x_2) > (3.0 + x_4)? (5.0 + x_2) : (3.0 + x_4))) : (((18.0 + x_5) > (9.0 + x_6)? (18.0 + x_5) : (9.0 + x_6)) > ((8.0 + x_7) > (11.0 + x_10)? (8.0 + x_7) : (11.0 + x_10))? ((18.0 + x_5) > (9.0 + x_6)? (18.0 + x_5) : (9.0 + x_6)) : ((8.0 + x_7) > (11.0 + x_10)? (8.0 + x_7) : (11.0 + x_10)))) > (((12.0 + x_11) > ((18.0 + x_13) > (7.0 + x_14)? (18.0 + x_13) : (7.0 + x_14))? (12.0 + x_11) : ((18.0 + x_13) > (7.0 + x_14)? (18.0 + x_13) : (7.0 + x_14))) > (((7.0 + x_18) > (4.0 + x_22)? (7.0 + x_18) : (4.0 + x_22)) > ((15.0 + x_23) > (20.0 + x_26)? (15.0 + x_23) : (20.0 + x_26))? ((7.0 + x_18) > (4.0 + x_22)? (7.0 + x_18) : (4.0 + x_22)) : ((15.0 + x_23) > (20.0 + x_26)? (15.0 + x_23) : (20.0 + x_26)))? ((12.0 + x_11) > ((18.0 + x_13) > (7.0 + x_14)? (18.0 + x_13) : (7.0 + x_14))? (12.0 + x_11) : ((18.0 + x_13) > (7.0 + x_14)? (18.0 + x_13) : (7.0 + x_14))) : (((7.0 + x_18) > (4.0 + x_22)? (7.0 + x_18) : (4.0 + x_22)) > ((15.0 + x_23) > (20.0 + x_26)? (15.0 + x_23) : (20.0 + x_26))? ((7.0 + x_18) > (4.0 + x_22)? (7.0 + x_18) : (4.0 + x_22)) : ((15.0 + x_23) > (20.0 + x_26)? (15.0 + x_23) : (20.0 + x_26))))? (((9.0 + x_1) > ((5.0 + x_2) > (3.0 + x_4)? (5.0 + x_2) : (3.0 + x_4))? (9.0 + x_1) : ((5.0 + x_2) > (3.0 + x_4)? (5.0 + x_2) : (3.0 + x_4))) > (((18.0 + x_5) > (9.0 + x_6)? (18.0 + x_5) : (9.0 + x_6)) > ((8.0 + x_7) > (11.0 + x_10)? (8.0 + x_7) : (11.0 + x_10))? ((18.0 + x_5) > (9.0 + x_6)? (18.0 + x_5) : (9.0 + x_6)) : ((8.0 + x_7) > (11.0 + x_10)? (8.0 + x_7) : (11.0 + x_10)))? ((9.0 + x_1) > ((5.0 + x_2) > (3.0 + x_4)? (5.0 + x_2) : (3.0 + x_4))? (9.0 + x_1) : ((5.0 + x_2) > (3.0 + x_4)? (5.0 + x_2) : (3.0 + x_4))) : (((18.0 + x_5) > (9.0 + x_6)? (18.0 + x_5) : (9.0 + x_6)) > ((8.0 + x_7) > (11.0 + x_10)? (8.0 + x_7) : (11.0 + x_10))? ((18.0 + x_5) > (9.0 + x_6)? (18.0 + x_5) : (9.0 + x_6)) : ((8.0 + x_7) > (11.0 + x_10)? (8.0 + x_7) : (11.0 + x_10)))) : (((12.0 + x_11) > ((18.0 + x_13) > (7.0 + x_14)? (18.0 + x_13) : (7.0 + x_14))? (12.0 + x_11) : ((18.0 + x_13) > (7.0 + x_14)? (18.0 + x_13) : (7.0 + x_14))) > (((7.0 + x_18) > (4.0 + x_22)? (7.0 + x_18) : (4.0 + x_22)) > ((15.0 + x_23) > (20.0 + x_26)? (15.0 + x_23) : (20.0 + x_26))? ((7.0 + x_18) > (4.0 + x_22)? (7.0 + x_18) : (4.0 + x_22)) : ((15.0 + x_23) > (20.0 + x_26)? (15.0 + x_23) : (20.0 + x_26)))? ((12.0 + x_11) > ((18.0 + x_13) > (7.0 + x_14)? (18.0 + x_13) : (7.0 + x_14))? (12.0 + x_11) : ((18.0 + x_13) > (7.0 + x_14)? (18.0 + x_13) : (7.0 + x_14))) : (((7.0 + x_18) > (4.0 + x_22)? (7.0 + x_18) : (4.0 + x_22)) > ((15.0 + x_23) > (20.0 + x_26)? (15.0 + x_23) : (20.0 + x_26))? ((7.0 + x_18) > (4.0 + x_22)? (7.0 + x_18) : (4.0 + x_22)) : ((15.0 + x_23) > (20.0 + x_26)? (15.0 + x_23) : (20.0 + x_26)))));
x_21_ = ((((10.0 + x_1) > ((8.0 + x_2) > (15.0 + x_3)? (8.0 + x_2) : (15.0 + x_3))? (10.0 + x_1) : ((8.0 + x_2) > (15.0 + x_3)? (8.0 + x_2) : (15.0 + x_3))) > (((7.0 + x_6) > (13.0 + x_7)? (7.0 + x_6) : (13.0 + x_7)) > ((16.0 + x_10) > (7.0 + x_11)? (16.0 + x_10) : (7.0 + x_11))? ((7.0 + x_6) > (13.0 + x_7)? (7.0 + x_6) : (13.0 + x_7)) : ((16.0 + x_10) > (7.0 + x_11)? (16.0 + x_10) : (7.0 + x_11)))? ((10.0 + x_1) > ((8.0 + x_2) > (15.0 + x_3)? (8.0 + x_2) : (15.0 + x_3))? (10.0 + x_1) : ((8.0 + x_2) > (15.0 + x_3)? (8.0 + x_2) : (15.0 + x_3))) : (((7.0 + x_6) > (13.0 + x_7)? (7.0 + x_6) : (13.0 + x_7)) > ((16.0 + x_10) > (7.0 + x_11)? (16.0 + x_10) : (7.0 + x_11))? ((7.0 + x_6) > (13.0 + x_7)? (7.0 + x_6) : (13.0 + x_7)) : ((16.0 + x_10) > (7.0 + x_11)? (16.0 + x_10) : (7.0 + x_11)))) > (((5.0 + x_12) > ((17.0 + x_15) > (8.0 + x_17)? (17.0 + x_15) : (8.0 + x_17))? (5.0 + x_12) : ((17.0 + x_15) > (8.0 + x_17)? (17.0 + x_15) : (8.0 + x_17))) > (((1.0 + x_18) > (4.0 + x_21)? (1.0 + x_18) : (4.0 + x_21)) > ((17.0 + x_24) > (9.0 + x_27)? (17.0 + x_24) : (9.0 + x_27))? ((1.0 + x_18) > (4.0 + x_21)? (1.0 + x_18) : (4.0 + x_21)) : ((17.0 + x_24) > (9.0 + x_27)? (17.0 + x_24) : (9.0 + x_27)))? ((5.0 + x_12) > ((17.0 + x_15) > (8.0 + x_17)? (17.0 + x_15) : (8.0 + x_17))? (5.0 + x_12) : ((17.0 + x_15) > (8.0 + x_17)? (17.0 + x_15) : (8.0 + x_17))) : (((1.0 + x_18) > (4.0 + x_21)? (1.0 + x_18) : (4.0 + x_21)) > ((17.0 + x_24) > (9.0 + x_27)? (17.0 + x_24) : (9.0 + x_27))? ((1.0 + x_18) > (4.0 + x_21)? (1.0 + x_18) : (4.0 + x_21)) : ((17.0 + x_24) > (9.0 + x_27)? (17.0 + x_24) : (9.0 + x_27))))? (((10.0 + x_1) > ((8.0 + x_2) > (15.0 + x_3)? (8.0 + x_2) : (15.0 + x_3))? (10.0 + x_1) : ((8.0 + x_2) > (15.0 + x_3)? (8.0 + x_2) : (15.0 + x_3))) > (((7.0 + x_6) > (13.0 + x_7)? (7.0 + x_6) : (13.0 + x_7)) > ((16.0 + x_10) > (7.0 + x_11)? (16.0 + x_10) : (7.0 + x_11))? ((7.0 + x_6) > (13.0 + x_7)? (7.0 + x_6) : (13.0 + x_7)) : ((16.0 + x_10) > (7.0 + x_11)? (16.0 + x_10) : (7.0 + x_11)))? ((10.0 + x_1) > ((8.0 + x_2) > (15.0 + x_3)? (8.0 + x_2) : (15.0 + x_3))? (10.0 + x_1) : ((8.0 + x_2) > (15.0 + x_3)? (8.0 + x_2) : (15.0 + x_3))) : (((7.0 + x_6) > (13.0 + x_7)? (7.0 + x_6) : (13.0 + x_7)) > ((16.0 + x_10) > (7.0 + x_11)? (16.0 + x_10) : (7.0 + x_11))? ((7.0 + x_6) > (13.0 + x_7)? (7.0 + x_6) : (13.0 + x_7)) : ((16.0 + x_10) > (7.0 + x_11)? (16.0 + x_10) : (7.0 + x_11)))) : (((5.0 + x_12) > ((17.0 + x_15) > (8.0 + x_17)? (17.0 + x_15) : (8.0 + x_17))? (5.0 + x_12) : ((17.0 + x_15) > (8.0 + x_17)? (17.0 + x_15) : (8.0 + x_17))) > (((1.0 + x_18) > (4.0 + x_21)? (1.0 + x_18) : (4.0 + x_21)) > ((17.0 + x_24) > (9.0 + x_27)? (17.0 + x_24) : (9.0 + x_27))? ((1.0 + x_18) > (4.0 + x_21)? (1.0 + x_18) : (4.0 + x_21)) : ((17.0 + x_24) > (9.0 + x_27)? (17.0 + x_24) : (9.0 + x_27)))? ((5.0 + x_12) > ((17.0 + x_15) > (8.0 + x_17)? (17.0 + x_15) : (8.0 + x_17))? (5.0 + x_12) : ((17.0 + x_15) > (8.0 + x_17)? (17.0 + x_15) : (8.0 + x_17))) : (((1.0 + x_18) > (4.0 + x_21)? (1.0 + x_18) : (4.0 + x_21)) > ((17.0 + x_24) > (9.0 + x_27)? (17.0 + x_24) : (9.0 + x_27))? ((1.0 + x_18) > (4.0 + x_21)? (1.0 + x_18) : (4.0 + x_21)) : ((17.0 + x_24) > (9.0 + x_27)? (17.0 + x_24) : (9.0 + x_27)))));
x_22_ = ((((8.0 + x_3) > ((6.0 + x_5) > (20.0 + x_6)? (6.0 + x_5) : (20.0 + x_6))? (8.0 + x_3) : ((6.0 + x_5) > (20.0 + x_6)? (6.0 + x_5) : (20.0 + x_6))) > (((9.0 + x_7) > (2.0 + x_8)? (9.0 + x_7) : (2.0 + x_8)) > ((10.0 + x_10) > (18.0 + x_11)? (10.0 + x_10) : (18.0 + x_11))? ((9.0 + x_7) > (2.0 + x_8)? (9.0 + x_7) : (2.0 + x_8)) : ((10.0 + x_10) > (18.0 + x_11)? (10.0 + x_10) : (18.0 + x_11)))? ((8.0 + x_3) > ((6.0 + x_5) > (20.0 + x_6)? (6.0 + x_5) : (20.0 + x_6))? (8.0 + x_3) : ((6.0 + x_5) > (20.0 + x_6)? (6.0 + x_5) : (20.0 + x_6))) : (((9.0 + x_7) > (2.0 + x_8)? (9.0 + x_7) : (2.0 + x_8)) > ((10.0 + x_10) > (18.0 + x_11)? (10.0 + x_10) : (18.0 + x_11))? ((9.0 + x_7) > (2.0 + x_8)? (9.0 + x_7) : (2.0 + x_8)) : ((10.0 + x_10) > (18.0 + x_11)? (10.0 + x_10) : (18.0 + x_11)))) > (((6.0 + x_13) > ((19.0 + x_14) > (16.0 + x_18)? (19.0 + x_14) : (16.0 + x_18))? (6.0 + x_13) : ((19.0 + x_14) > (16.0 + x_18)? (19.0 + x_14) : (16.0 + x_18))) > (((12.0 + x_21) > (2.0 + x_22)? (12.0 + x_21) : (2.0 + x_22)) > ((2.0 + x_23) > (14.0 + x_24)? (2.0 + x_23) : (14.0 + x_24))? ((12.0 + x_21) > (2.0 + x_22)? (12.0 + x_21) : (2.0 + x_22)) : ((2.0 + x_23) > (14.0 + x_24)? (2.0 + x_23) : (14.0 + x_24)))? ((6.0 + x_13) > ((19.0 + x_14) > (16.0 + x_18)? (19.0 + x_14) : (16.0 + x_18))? (6.0 + x_13) : ((19.0 + x_14) > (16.0 + x_18)? (19.0 + x_14) : (16.0 + x_18))) : (((12.0 + x_21) > (2.0 + x_22)? (12.0 + x_21) : (2.0 + x_22)) > ((2.0 + x_23) > (14.0 + x_24)? (2.0 + x_23) : (14.0 + x_24))? ((12.0 + x_21) > (2.0 + x_22)? (12.0 + x_21) : (2.0 + x_22)) : ((2.0 + x_23) > (14.0 + x_24)? (2.0 + x_23) : (14.0 + x_24))))? (((8.0 + x_3) > ((6.0 + x_5) > (20.0 + x_6)? (6.0 + x_5) : (20.0 + x_6))? (8.0 + x_3) : ((6.0 + x_5) > (20.0 + x_6)? (6.0 + x_5) : (20.0 + x_6))) > (((9.0 + x_7) > (2.0 + x_8)? (9.0 + x_7) : (2.0 + x_8)) > ((10.0 + x_10) > (18.0 + x_11)? (10.0 + x_10) : (18.0 + x_11))? ((9.0 + x_7) > (2.0 + x_8)? (9.0 + x_7) : (2.0 + x_8)) : ((10.0 + x_10) > (18.0 + x_11)? (10.0 + x_10) : (18.0 + x_11)))? ((8.0 + x_3) > ((6.0 + x_5) > (20.0 + x_6)? (6.0 + x_5) : (20.0 + x_6))? (8.0 + x_3) : ((6.0 + x_5) > (20.0 + x_6)? (6.0 + x_5) : (20.0 + x_6))) : (((9.0 + x_7) > (2.0 + x_8)? (9.0 + x_7) : (2.0 + x_8)) > ((10.0 + x_10) > (18.0 + x_11)? (10.0 + x_10) : (18.0 + x_11))? ((9.0 + x_7) > (2.0 + x_8)? (9.0 + x_7) : (2.0 + x_8)) : ((10.0 + x_10) > (18.0 + x_11)? (10.0 + x_10) : (18.0 + x_11)))) : (((6.0 + x_13) > ((19.0 + x_14) > (16.0 + x_18)? (19.0 + x_14) : (16.0 + x_18))? (6.0 + x_13) : ((19.0 + x_14) > (16.0 + x_18)? (19.0 + x_14) : (16.0 + x_18))) > (((12.0 + x_21) > (2.0 + x_22)? (12.0 + x_21) : (2.0 + x_22)) > ((2.0 + x_23) > (14.0 + x_24)? (2.0 + x_23) : (14.0 + x_24))? ((12.0 + x_21) > (2.0 + x_22)? (12.0 + x_21) : (2.0 + x_22)) : ((2.0 + x_23) > (14.0 + x_24)? (2.0 + x_23) : (14.0 + x_24)))? ((6.0 + x_13) > ((19.0 + x_14) > (16.0 + x_18)? (19.0 + x_14) : (16.0 + x_18))? (6.0 + x_13) : ((19.0 + x_14) > (16.0 + x_18)? (19.0 + x_14) : (16.0 + x_18))) : (((12.0 + x_21) > (2.0 + x_22)? (12.0 + x_21) : (2.0 + x_22)) > ((2.0 + x_23) > (14.0 + x_24)? (2.0 + x_23) : (14.0 + x_24))? ((12.0 + x_21) > (2.0 + x_22)? (12.0 + x_21) : (2.0 + x_22)) : ((2.0 + x_23) > (14.0 + x_24)? (2.0 + x_23) : (14.0 + x_24)))));
x_23_ = ((((19.0 + x_1) > ((7.0 + x_6) > (12.0 + x_7)? (7.0 + x_6) : (12.0 + x_7))? (19.0 + x_1) : ((7.0 + x_6) > (12.0 + x_7)? (7.0 + x_6) : (12.0 + x_7))) > (((16.0 + x_9) > (13.0 + x_11)? (16.0 + x_9) : (13.0 + x_11)) > ((18.0 + x_13) > (10.0 + x_15)? (18.0 + x_13) : (10.0 + x_15))? ((16.0 + x_9) > (13.0 + x_11)? (16.0 + x_9) : (13.0 + x_11)) : ((18.0 + x_13) > (10.0 + x_15)? (18.0 + x_13) : (10.0 + x_15)))? ((19.0 + x_1) > ((7.0 + x_6) > (12.0 + x_7)? (7.0 + x_6) : (12.0 + x_7))? (19.0 + x_1) : ((7.0 + x_6) > (12.0 + x_7)? (7.0 + x_6) : (12.0 + x_7))) : (((16.0 + x_9) > (13.0 + x_11)? (16.0 + x_9) : (13.0 + x_11)) > ((18.0 + x_13) > (10.0 + x_15)? (18.0 + x_13) : (10.0 + x_15))? ((16.0 + x_9) > (13.0 + x_11)? (16.0 + x_9) : (13.0 + x_11)) : ((18.0 + x_13) > (10.0 + x_15)? (18.0 + x_13) : (10.0 + x_15)))) > (((19.0 + x_16) > ((5.0 + x_17) > (8.0 + x_19)? (5.0 + x_17) : (8.0 + x_19))? (19.0 + x_16) : ((5.0 + x_17) > (8.0 + x_19)? (5.0 + x_17) : (8.0 + x_19))) > (((3.0 + x_24) > (1.0 + x_25)? (3.0 + x_24) : (1.0 + x_25)) > ((11.0 + x_26) > (2.0 + x_27)? (11.0 + x_26) : (2.0 + x_27))? ((3.0 + x_24) > (1.0 + x_25)? (3.0 + x_24) : (1.0 + x_25)) : ((11.0 + x_26) > (2.0 + x_27)? (11.0 + x_26) : (2.0 + x_27)))? ((19.0 + x_16) > ((5.0 + x_17) > (8.0 + x_19)? (5.0 + x_17) : (8.0 + x_19))? (19.0 + x_16) : ((5.0 + x_17) > (8.0 + x_19)? (5.0 + x_17) : (8.0 + x_19))) : (((3.0 + x_24) > (1.0 + x_25)? (3.0 + x_24) : (1.0 + x_25)) > ((11.0 + x_26) > (2.0 + x_27)? (11.0 + x_26) : (2.0 + x_27))? ((3.0 + x_24) > (1.0 + x_25)? (3.0 + x_24) : (1.0 + x_25)) : ((11.0 + x_26) > (2.0 + x_27)? (11.0 + x_26) : (2.0 + x_27))))? (((19.0 + x_1) > ((7.0 + x_6) > (12.0 + x_7)? (7.0 + x_6) : (12.0 + x_7))? (19.0 + x_1) : ((7.0 + x_6) > (12.0 + x_7)? (7.0 + x_6) : (12.0 + x_7))) > (((16.0 + x_9) > (13.0 + x_11)? (16.0 + x_9) : (13.0 + x_11)) > ((18.0 + x_13) > (10.0 + x_15)? (18.0 + x_13) : (10.0 + x_15))? ((16.0 + x_9) > (13.0 + x_11)? (16.0 + x_9) : (13.0 + x_11)) : ((18.0 + x_13) > (10.0 + x_15)? (18.0 + x_13) : (10.0 + x_15)))? ((19.0 + x_1) > ((7.0 + x_6) > (12.0 + x_7)? (7.0 + x_6) : (12.0 + x_7))? (19.0 + x_1) : ((7.0 + x_6) > (12.0 + x_7)? (7.0 + x_6) : (12.0 + x_7))) : (((16.0 + x_9) > (13.0 + x_11)? (16.0 + x_9) : (13.0 + x_11)) > ((18.0 + x_13) > (10.0 + x_15)? (18.0 + x_13) : (10.0 + x_15))? ((16.0 + x_9) > (13.0 + x_11)? (16.0 + x_9) : (13.0 + x_11)) : ((18.0 + x_13) > (10.0 + x_15)? (18.0 + x_13) : (10.0 + x_15)))) : (((19.0 + x_16) > ((5.0 + x_17) > (8.0 + x_19)? (5.0 + x_17) : (8.0 + x_19))? (19.0 + x_16) : ((5.0 + x_17) > (8.0 + x_19)? (5.0 + x_17) : (8.0 + x_19))) > (((3.0 + x_24) > (1.0 + x_25)? (3.0 + x_24) : (1.0 + x_25)) > ((11.0 + x_26) > (2.0 + x_27)? (11.0 + x_26) : (2.0 + x_27))? ((3.0 + x_24) > (1.0 + x_25)? (3.0 + x_24) : (1.0 + x_25)) : ((11.0 + x_26) > (2.0 + x_27)? (11.0 + x_26) : (2.0 + x_27)))? ((19.0 + x_16) > ((5.0 + x_17) > (8.0 + x_19)? (5.0 + x_17) : (8.0 + x_19))? (19.0 + x_16) : ((5.0 + x_17) > (8.0 + x_19)? (5.0 + x_17) : (8.0 + x_19))) : (((3.0 + x_24) > (1.0 + x_25)? (3.0 + x_24) : (1.0 + x_25)) > ((11.0 + x_26) > (2.0 + x_27)? (11.0 + x_26) : (2.0 + x_27))? ((3.0 + x_24) > (1.0 + x_25)? (3.0 + x_24) : (1.0 + x_25)) : ((11.0 + x_26) > (2.0 + x_27)? (11.0 + x_26) : (2.0 + x_27)))));
x_24_ = ((((18.0 + x_1) > ((9.0 + x_4) > (17.0 + x_10)? (9.0 + x_4) : (17.0 + x_10))? (18.0 + x_1) : ((9.0 + x_4) > (17.0 + x_10)? (9.0 + x_4) : (17.0 + x_10))) > (((18.0 + x_11) > (1.0 + x_12)? (18.0 + x_11) : (1.0 + x_12)) > ((7.0 + x_13) > (12.0 + x_15)? (7.0 + x_13) : (12.0 + x_15))? ((18.0 + x_11) > (1.0 + x_12)? (18.0 + x_11) : (1.0 + x_12)) : ((7.0 + x_13) > (12.0 + x_15)? (7.0 + x_13) : (12.0 + x_15)))? ((18.0 + x_1) > ((9.0 + x_4) > (17.0 + x_10)? (9.0 + x_4) : (17.0 + x_10))? (18.0 + x_1) : ((9.0 + x_4) > (17.0 + x_10)? (9.0 + x_4) : (17.0 + x_10))) : (((18.0 + x_11) > (1.0 + x_12)? (18.0 + x_11) : (1.0 + x_12)) > ((7.0 + x_13) > (12.0 + x_15)? (7.0 + x_13) : (12.0 + x_15))? ((18.0 + x_11) > (1.0 + x_12)? (18.0 + x_11) : (1.0 + x_12)) : ((7.0 + x_13) > (12.0 + x_15)? (7.0 + x_13) : (12.0 + x_15)))) > (((18.0 + x_16) > ((2.0 + x_17) > (7.0 + x_21)? (2.0 + x_17) : (7.0 + x_21))? (18.0 + x_16) : ((2.0 + x_17) > (7.0 + x_21)? (2.0 + x_17) : (7.0 + x_21))) > (((20.0 + x_23) > (6.0 + x_25)? (20.0 + x_23) : (6.0 + x_25)) > ((19.0 + x_26) > (5.0 + x_27)? (19.0 + x_26) : (5.0 + x_27))? ((20.0 + x_23) > (6.0 + x_25)? (20.0 + x_23) : (6.0 + x_25)) : ((19.0 + x_26) > (5.0 + x_27)? (19.0 + x_26) : (5.0 + x_27)))? ((18.0 + x_16) > ((2.0 + x_17) > (7.0 + x_21)? (2.0 + x_17) : (7.0 + x_21))? (18.0 + x_16) : ((2.0 + x_17) > (7.0 + x_21)? (2.0 + x_17) : (7.0 + x_21))) : (((20.0 + x_23) > (6.0 + x_25)? (20.0 + x_23) : (6.0 + x_25)) > ((19.0 + x_26) > (5.0 + x_27)? (19.0 + x_26) : (5.0 + x_27))? ((20.0 + x_23) > (6.0 + x_25)? (20.0 + x_23) : (6.0 + x_25)) : ((19.0 + x_26) > (5.0 + x_27)? (19.0 + x_26) : (5.0 + x_27))))? (((18.0 + x_1) > ((9.0 + x_4) > (17.0 + x_10)? (9.0 + x_4) : (17.0 + x_10))? (18.0 + x_1) : ((9.0 + x_4) > (17.0 + x_10)? (9.0 + x_4) : (17.0 + x_10))) > (((18.0 + x_11) > (1.0 + x_12)? (18.0 + x_11) : (1.0 + x_12)) > ((7.0 + x_13) > (12.0 + x_15)? (7.0 + x_13) : (12.0 + x_15))? ((18.0 + x_11) > (1.0 + x_12)? (18.0 + x_11) : (1.0 + x_12)) : ((7.0 + x_13) > (12.0 + x_15)? (7.0 + x_13) : (12.0 + x_15)))? ((18.0 + x_1) > ((9.0 + x_4) > (17.0 + x_10)? (9.0 + x_4) : (17.0 + x_10))? (18.0 + x_1) : ((9.0 + x_4) > (17.0 + x_10)? (9.0 + x_4) : (17.0 + x_10))) : (((18.0 + x_11) > (1.0 + x_12)? (18.0 + x_11) : (1.0 + x_12)) > ((7.0 + x_13) > (12.0 + x_15)? (7.0 + x_13) : (12.0 + x_15))? ((18.0 + x_11) > (1.0 + x_12)? (18.0 + x_11) : (1.0 + x_12)) : ((7.0 + x_13) > (12.0 + x_15)? (7.0 + x_13) : (12.0 + x_15)))) : (((18.0 + x_16) > ((2.0 + x_17) > (7.0 + x_21)? (2.0 + x_17) : (7.0 + x_21))? (18.0 + x_16) : ((2.0 + x_17) > (7.0 + x_21)? (2.0 + x_17) : (7.0 + x_21))) > (((20.0 + x_23) > (6.0 + x_25)? (20.0 + x_23) : (6.0 + x_25)) > ((19.0 + x_26) > (5.0 + x_27)? (19.0 + x_26) : (5.0 + x_27))? ((20.0 + x_23) > (6.0 + x_25)? (20.0 + x_23) : (6.0 + x_25)) : ((19.0 + x_26) > (5.0 + x_27)? (19.0 + x_26) : (5.0 + x_27)))? ((18.0 + x_16) > ((2.0 + x_17) > (7.0 + x_21)? (2.0 + x_17) : (7.0 + x_21))? (18.0 + x_16) : ((2.0 + x_17) > (7.0 + x_21)? (2.0 + x_17) : (7.0 + x_21))) : (((20.0 + x_23) > (6.0 + x_25)? (20.0 + x_23) : (6.0 + x_25)) > ((19.0 + x_26) > (5.0 + x_27)? (19.0 + x_26) : (5.0 + x_27))? ((20.0 + x_23) > (6.0 + x_25)? (20.0 + x_23) : (6.0 + x_25)) : ((19.0 + x_26) > (5.0 + x_27)? (19.0 + x_26) : (5.0 + x_27)))));
x_25_ = ((((2.0 + x_0) > ((13.0 + x_2) > (13.0 + x_3)? (13.0 + x_2) : (13.0 + x_3))? (2.0 + x_0) : ((13.0 + x_2) > (13.0 + x_3)? (13.0 + x_2) : (13.0 + x_3))) > (((9.0 + x_7) > (19.0 + x_9)? (9.0 + x_7) : (19.0 + x_9)) > ((12.0 + x_11) > (14.0 + x_12)? (12.0 + x_11) : (14.0 + x_12))? ((9.0 + x_7) > (19.0 + x_9)? (9.0 + x_7) : (19.0 + x_9)) : ((12.0 + x_11) > (14.0 + x_12)? (12.0 + x_11) : (14.0 + x_12)))? ((2.0 + x_0) > ((13.0 + x_2) > (13.0 + x_3)? (13.0 + x_2) : (13.0 + x_3))? (2.0 + x_0) : ((13.0 + x_2) > (13.0 + x_3)? (13.0 + x_2) : (13.0 + x_3))) : (((9.0 + x_7) > (19.0 + x_9)? (9.0 + x_7) : (19.0 + x_9)) > ((12.0 + x_11) > (14.0 + x_12)? (12.0 + x_11) : (14.0 + x_12))? ((9.0 + x_7) > (19.0 + x_9)? (9.0 + x_7) : (19.0 + x_9)) : ((12.0 + x_11) > (14.0 + x_12)? (12.0 + x_11) : (14.0 + x_12)))) > (((12.0 + x_14) > ((19.0 + x_17) > (10.0 + x_20)? (19.0 + x_17) : (10.0 + x_20))? (12.0 + x_14) : ((19.0 + x_17) > (10.0 + x_20)? (19.0 + x_17) : (10.0 + x_20))) > (((7.0 + x_24) > (2.0 + x_25)? (7.0 + x_24) : (2.0 + x_25)) > ((9.0 + x_26) > (17.0 + x_27)? (9.0 + x_26) : (17.0 + x_27))? ((7.0 + x_24) > (2.0 + x_25)? (7.0 + x_24) : (2.0 + x_25)) : ((9.0 + x_26) > (17.0 + x_27)? (9.0 + x_26) : (17.0 + x_27)))? ((12.0 + x_14) > ((19.0 + x_17) > (10.0 + x_20)? (19.0 + x_17) : (10.0 + x_20))? (12.0 + x_14) : ((19.0 + x_17) > (10.0 + x_20)? (19.0 + x_17) : (10.0 + x_20))) : (((7.0 + x_24) > (2.0 + x_25)? (7.0 + x_24) : (2.0 + x_25)) > ((9.0 + x_26) > (17.0 + x_27)? (9.0 + x_26) : (17.0 + x_27))? ((7.0 + x_24) > (2.0 + x_25)? (7.0 + x_24) : (2.0 + x_25)) : ((9.0 + x_26) > (17.0 + x_27)? (9.0 + x_26) : (17.0 + x_27))))? (((2.0 + x_0) > ((13.0 + x_2) > (13.0 + x_3)? (13.0 + x_2) : (13.0 + x_3))? (2.0 + x_0) : ((13.0 + x_2) > (13.0 + x_3)? (13.0 + x_2) : (13.0 + x_3))) > (((9.0 + x_7) > (19.0 + x_9)? (9.0 + x_7) : (19.0 + x_9)) > ((12.0 + x_11) > (14.0 + x_12)? (12.0 + x_11) : (14.0 + x_12))? ((9.0 + x_7) > (19.0 + x_9)? (9.0 + x_7) : (19.0 + x_9)) : ((12.0 + x_11) > (14.0 + x_12)? (12.0 + x_11) : (14.0 + x_12)))? ((2.0 + x_0) > ((13.0 + x_2) > (13.0 + x_3)? (13.0 + x_2) : (13.0 + x_3))? (2.0 + x_0) : ((13.0 + x_2) > (13.0 + x_3)? (13.0 + x_2) : (13.0 + x_3))) : (((9.0 + x_7) > (19.0 + x_9)? (9.0 + x_7) : (19.0 + x_9)) > ((12.0 + x_11) > (14.0 + x_12)? (12.0 + x_11) : (14.0 + x_12))? ((9.0 + x_7) > (19.0 + x_9)? (9.0 + x_7) : (19.0 + x_9)) : ((12.0 + x_11) > (14.0 + x_12)? (12.0 + x_11) : (14.0 + x_12)))) : (((12.0 + x_14) > ((19.0 + x_17) > (10.0 + x_20)? (19.0 + x_17) : (10.0 + x_20))? (12.0 + x_14) : ((19.0 + x_17) > (10.0 + x_20)? (19.0 + x_17) : (10.0 + x_20))) > (((7.0 + x_24) > (2.0 + x_25)? (7.0 + x_24) : (2.0 + x_25)) > ((9.0 + x_26) > (17.0 + x_27)? (9.0 + x_26) : (17.0 + x_27))? ((7.0 + x_24) > (2.0 + x_25)? (7.0 + x_24) : (2.0 + x_25)) : ((9.0 + x_26) > (17.0 + x_27)? (9.0 + x_26) : (17.0 + x_27)))? ((12.0 + x_14) > ((19.0 + x_17) > (10.0 + x_20)? (19.0 + x_17) : (10.0 + x_20))? (12.0 + x_14) : ((19.0 + x_17) > (10.0 + x_20)? (19.0 + x_17) : (10.0 + x_20))) : (((7.0 + x_24) > (2.0 + x_25)? (7.0 + x_24) : (2.0 + x_25)) > ((9.0 + x_26) > (17.0 + x_27)? (9.0 + x_26) : (17.0 + x_27))? ((7.0 + x_24) > (2.0 + x_25)? (7.0 + x_24) : (2.0 + x_25)) : ((9.0 + x_26) > (17.0 + x_27)? (9.0 + x_26) : (17.0 + x_27)))));
x_26_ = ((((7.0 + x_2) > ((6.0 + x_4) > (3.0 + x_6)? (6.0 + x_4) : (3.0 + x_6))? (7.0 + x_2) : ((6.0 + x_4) > (3.0 + x_6)? (6.0 + x_4) : (3.0 + x_6))) > (((10.0 + x_7) > (6.0 + x_9)? (10.0 + x_7) : (6.0 + x_9)) > ((18.0 + x_10) > (4.0 + x_12)? (18.0 + x_10) : (4.0 + x_12))? ((10.0 + x_7) > (6.0 + x_9)? (10.0 + x_7) : (6.0 + x_9)) : ((18.0 + x_10) > (4.0 + x_12)? (18.0 + x_10) : (4.0 + x_12)))? ((7.0 + x_2) > ((6.0 + x_4) > (3.0 + x_6)? (6.0 + x_4) : (3.0 + x_6))? (7.0 + x_2) : ((6.0 + x_4) > (3.0 + x_6)? (6.0 + x_4) : (3.0 + x_6))) : (((10.0 + x_7) > (6.0 + x_9)? (10.0 + x_7) : (6.0 + x_9)) > ((18.0 + x_10) > (4.0 + x_12)? (18.0 + x_10) : (4.0 + x_12))? ((10.0 + x_7) > (6.0 + x_9)? (10.0 + x_7) : (6.0 + x_9)) : ((18.0 + x_10) > (4.0 + x_12)? (18.0 + x_10) : (4.0 + x_12)))) > (((6.0 + x_14) > ((3.0 + x_15) > (2.0 + x_20)? (3.0 + x_15) : (2.0 + x_20))? (6.0 + x_14) : ((3.0 + x_15) > (2.0 + x_20)? (3.0 + x_15) : (2.0 + x_20))) > (((3.0 + x_22) > (20.0 + x_24)? (3.0 + x_22) : (20.0 + x_24)) > ((12.0 + x_26) > (16.0 + x_27)? (12.0 + x_26) : (16.0 + x_27))? ((3.0 + x_22) > (20.0 + x_24)? (3.0 + x_22) : (20.0 + x_24)) : ((12.0 + x_26) > (16.0 + x_27)? (12.0 + x_26) : (16.0 + x_27)))? ((6.0 + x_14) > ((3.0 + x_15) > (2.0 + x_20)? (3.0 + x_15) : (2.0 + x_20))? (6.0 + x_14) : ((3.0 + x_15) > (2.0 + x_20)? (3.0 + x_15) : (2.0 + x_20))) : (((3.0 + x_22) > (20.0 + x_24)? (3.0 + x_22) : (20.0 + x_24)) > ((12.0 + x_26) > (16.0 + x_27)? (12.0 + x_26) : (16.0 + x_27))? ((3.0 + x_22) > (20.0 + x_24)? (3.0 + x_22) : (20.0 + x_24)) : ((12.0 + x_26) > (16.0 + x_27)? (12.0 + x_26) : (16.0 + x_27))))? (((7.0 + x_2) > ((6.0 + x_4) > (3.0 + x_6)? (6.0 + x_4) : (3.0 + x_6))? (7.0 + x_2) : ((6.0 + x_4) > (3.0 + x_6)? (6.0 + x_4) : (3.0 + x_6))) > (((10.0 + x_7) > (6.0 + x_9)? (10.0 + x_7) : (6.0 + x_9)) > ((18.0 + x_10) > (4.0 + x_12)? (18.0 + x_10) : (4.0 + x_12))? ((10.0 + x_7) > (6.0 + x_9)? (10.0 + x_7) : (6.0 + x_9)) : ((18.0 + x_10) > (4.0 + x_12)? (18.0 + x_10) : (4.0 + x_12)))? ((7.0 + x_2) > ((6.0 + x_4) > (3.0 + x_6)? (6.0 + x_4) : (3.0 + x_6))? (7.0 + x_2) : ((6.0 + x_4) > (3.0 + x_6)? (6.0 + x_4) : (3.0 + x_6))) : (((10.0 + x_7) > (6.0 + x_9)? (10.0 + x_7) : (6.0 + x_9)) > ((18.0 + x_10) > (4.0 + x_12)? (18.0 + x_10) : (4.0 + x_12))? ((10.0 + x_7) > (6.0 + x_9)? (10.0 + x_7) : (6.0 + x_9)) : ((18.0 + x_10) > (4.0 + x_12)? (18.0 + x_10) : (4.0 + x_12)))) : (((6.0 + x_14) > ((3.0 + x_15) > (2.0 + x_20)? (3.0 + x_15) : (2.0 + x_20))? (6.0 + x_14) : ((3.0 + x_15) > (2.0 + x_20)? (3.0 + x_15) : (2.0 + x_20))) > (((3.0 + x_22) > (20.0 + x_24)? (3.0 + x_22) : (20.0 + x_24)) > ((12.0 + x_26) > (16.0 + x_27)? (12.0 + x_26) : (16.0 + x_27))? ((3.0 + x_22) > (20.0 + x_24)? (3.0 + x_22) : (20.0 + x_24)) : ((12.0 + x_26) > (16.0 + x_27)? (12.0 + x_26) : (16.0 + x_27)))? ((6.0 + x_14) > ((3.0 + x_15) > (2.0 + x_20)? (3.0 + x_15) : (2.0 + x_20))? (6.0 + x_14) : ((3.0 + x_15) > (2.0 + x_20)? (3.0 + x_15) : (2.0 + x_20))) : (((3.0 + x_22) > (20.0 + x_24)? (3.0 + x_22) : (20.0 + x_24)) > ((12.0 + x_26) > (16.0 + x_27)? (12.0 + x_26) : (16.0 + x_27))? ((3.0 + x_22) > (20.0 + x_24)? (3.0 + x_22) : (20.0 + x_24)) : ((12.0 + x_26) > (16.0 + x_27)? (12.0 + x_26) : (16.0 + x_27)))));
x_27_ = ((((8.0 + x_1) > ((15.0 + x_2) > (5.0 + x_3)? (15.0 + x_2) : (5.0 + x_3))? (8.0 + x_1) : ((15.0 + x_2) > (5.0 + x_3)? (15.0 + x_2) : (5.0 + x_3))) > (((16.0 + x_5) > (18.0 + x_7)? (16.0 + x_5) : (18.0 + x_7)) > ((7.0 + x_9) > (1.0 + x_11)? (7.0 + x_9) : (1.0 + x_11))? ((16.0 + x_5) > (18.0 + x_7)? (16.0 + x_5) : (18.0 + x_7)) : ((7.0 + x_9) > (1.0 + x_11)? (7.0 + x_9) : (1.0 + x_11)))? ((8.0 + x_1) > ((15.0 + x_2) > (5.0 + x_3)? (15.0 + x_2) : (5.0 + x_3))? (8.0 + x_1) : ((15.0 + x_2) > (5.0 + x_3)? (15.0 + x_2) : (5.0 + x_3))) : (((16.0 + x_5) > (18.0 + x_7)? (16.0 + x_5) : (18.0 + x_7)) > ((7.0 + x_9) > (1.0 + x_11)? (7.0 + x_9) : (1.0 + x_11))? ((16.0 + x_5) > (18.0 + x_7)? (16.0 + x_5) : (18.0 + x_7)) : ((7.0 + x_9) > (1.0 + x_11)? (7.0 + x_9) : (1.0 + x_11)))) > (((2.0 + x_15) > ((8.0 + x_17) > (13.0 + x_18)? (8.0 + x_17) : (13.0 + x_18))? (2.0 + x_15) : ((8.0 + x_17) > (13.0 + x_18)? (8.0 + x_17) : (13.0 + x_18))) > (((17.0 + x_20) > (9.0 + x_21)? (17.0 + x_20) : (9.0 + x_21)) > ((7.0 + x_24) > (8.0 + x_25)? (7.0 + x_24) : (8.0 + x_25))? ((17.0 + x_20) > (9.0 + x_21)? (17.0 + x_20) : (9.0 + x_21)) : ((7.0 + x_24) > (8.0 + x_25)? (7.0 + x_24) : (8.0 + x_25)))? ((2.0 + x_15) > ((8.0 + x_17) > (13.0 + x_18)? (8.0 + x_17) : (13.0 + x_18))? (2.0 + x_15) : ((8.0 + x_17) > (13.0 + x_18)? (8.0 + x_17) : (13.0 + x_18))) : (((17.0 + x_20) > (9.0 + x_21)? (17.0 + x_20) : (9.0 + x_21)) > ((7.0 + x_24) > (8.0 + x_25)? (7.0 + x_24) : (8.0 + x_25))? ((17.0 + x_20) > (9.0 + x_21)? (17.0 + x_20) : (9.0 + x_21)) : ((7.0 + x_24) > (8.0 + x_25)? (7.0 + x_24) : (8.0 + x_25))))? (((8.0 + x_1) > ((15.0 + x_2) > (5.0 + x_3)? (15.0 + x_2) : (5.0 + x_3))? (8.0 + x_1) : ((15.0 + x_2) > (5.0 + x_3)? (15.0 + x_2) : (5.0 + x_3))) > (((16.0 + x_5) > (18.0 + x_7)? (16.0 + x_5) : (18.0 + x_7)) > ((7.0 + x_9) > (1.0 + x_11)? (7.0 + x_9) : (1.0 + x_11))? ((16.0 + x_5) > (18.0 + x_7)? (16.0 + x_5) : (18.0 + x_7)) : ((7.0 + x_9) > (1.0 + x_11)? (7.0 + x_9) : (1.0 + x_11)))? ((8.0 + x_1) > ((15.0 + x_2) > (5.0 + x_3)? (15.0 + x_2) : (5.0 + x_3))? (8.0 + x_1) : ((15.0 + x_2) > (5.0 + x_3)? (15.0 + x_2) : (5.0 + x_3))) : (((16.0 + x_5) > (18.0 + x_7)? (16.0 + x_5) : (18.0 + x_7)) > ((7.0 + x_9) > (1.0 + x_11)? (7.0 + x_9) : (1.0 + x_11))? ((16.0 + x_5) > (18.0 + x_7)? (16.0 + x_5) : (18.0 + x_7)) : ((7.0 + x_9) > (1.0 + x_11)? (7.0 + x_9) : (1.0 + x_11)))) : (((2.0 + x_15) > ((8.0 + x_17) > (13.0 + x_18)? (8.0 + x_17) : (13.0 + x_18))? (2.0 + x_15) : ((8.0 + x_17) > (13.0 + x_18)? (8.0 + x_17) : (13.0 + x_18))) > (((17.0 + x_20) > (9.0 + x_21)? (17.0 + x_20) : (9.0 + x_21)) > ((7.0 + x_24) > (8.0 + x_25)? (7.0 + x_24) : (8.0 + x_25))? ((17.0 + x_20) > (9.0 + x_21)? (17.0 + x_20) : (9.0 + x_21)) : ((7.0 + x_24) > (8.0 + x_25)? (7.0 + x_24) : (8.0 + x_25)))? ((2.0 + x_15) > ((8.0 + x_17) > (13.0 + x_18)? (8.0 + x_17) : (13.0 + x_18))? (2.0 + x_15) : ((8.0 + x_17) > (13.0 + x_18)? (8.0 + x_17) : (13.0 + x_18))) : (((17.0 + x_20) > (9.0 + x_21)? (17.0 + x_20) : (9.0 + x_21)) > ((7.0 + x_24) > (8.0 + x_25)? (7.0 + x_24) : (8.0 + x_25))? ((17.0 + x_20) > (9.0 + x_21)? (17.0 + x_20) : (9.0 + x_21)) : ((7.0 + x_24) > (8.0 + x_25)? (7.0 + x_24) : (8.0 + x_25)))));
x_0 = x_0_;
x_1 = x_1_;
x_2 = x_2_;
x_3 = x_3_;
x_4 = x_4_;
x_5 = x_5_;
x_6 = x_6_;
x_7 = x_7_;
x_8 = x_8_;
x_9 = x_9_;
x_10 = x_10_;
x_11 = x_11_;
x_12 = x_12_;
x_13 = x_13_;
x_14 = x_14_;
x_15 = x_15_;
x_16 = x_16_;
x_17 = x_17_;
x_18 = x_18_;
x_19 = x_19_;
x_20 = x_20_;
x_21 = x_21_;
x_22 = x_22_;
x_23 = x_23_;
x_24 = x_24_;
x_25 = x_25_;
x_26 = x_26_;
x_27 = x_27_;
}
return 0;
}
|
the_stack_data/22013651.c |
#include <stdio.h>
int main() {
void swap(int *a, int *b);
int array[20] = {0};
int size = 0;
int i = 0;
scanf("%d", &i);
while (i != -1) {//鬼 tm 信 0 是正整数
array[size++] = i;
scanf("%d", &i);
}
int pass = 1;
if (size < 2) {
if (size < 1) {
printf("\n");
return 0;
}
printf("%d\n", array[0]);
return 0;
}
while (pass) {
pass = 0;
for (i = 1; i < size; ++i) {
if (array[i - 1] % 2) {
if (array[i] % 2) {
if (array[i] < array[i - 1]) {
swap(array + i, array + i - 1);
pass = 1;
}
} else {
//do nothing
}
} else {
if (array[i] % 2) {
swap(array + i, array + i - 1);
pass = 1;
} else {
//do nothing
}
}
}
}
for (i = 0; i < size; ++i) {
printf("%d%s", array[i], i + 1 == size ? "\n" : " ");
}
return 0;
}
void swap(int *a, int *b) {
int tmp = *a;
*a = *b;
*b = tmp;
}
|
the_stack_data/11076494.c | #include <string.h>
#include <strings.h>
int bcmp(const void *s1, const void *s2, size_t n)
{
return memcmp(s1, s2, n);
}
/*
XOPEN(400,700)
*/
|
the_stack_data/486975.c | #include <stdlib.h>
#include <stdio.h>
/*
** A function to provide a command interface with gnuplot
*/
int gnuplot(const char *gnucommand)
{
char syscommand[1024];
/* Build the gnuplot command: leaving gnuplot running after the
program finishes execution. */
sprintf(syscommand, "echo \"%s\" | gnuplot -persist", gnucommand);
/* Use a system call to run gnuplot and return the return value. */
return system(syscommand);
}
|
the_stack_data/141328.c | // BUG: Dentry still in use [unmount of fuse fuse]
// https://syzkaller.appspot.com/bug?id=8683b7c75512cf582f3b
// status:0
// autogenerated by syzkaller (https://github.com/google/syzkaller)
#define _GNU_SOURCE
#include <endian.h>
#include <errno.h>
#include <fcntl.h>
#include <pthread.h>
#include <sched.h>
#include <stdarg.h>
#include <stdbool.h>
#include <stddef.h>
#include <stdint.h>
#include <stdio.h>
#include <stdlib.h>
#include <string.h>
#include <sys/mount.h>
#include <sys/prctl.h>
#include <sys/resource.h>
#include <sys/stat.h>
#include <sys/syscall.h>
#include <sys/time.h>
#include <sys/types.h>
#include <sys/wait.h>
#include <time.h>
#include <unistd.h>
#include <linux/capability.h>
#include <linux/futex.h>
static void sleep_ms(uint64_t ms)
{
usleep(ms * 1000);
}
static uint64_t current_time_ms(void)
{
struct timespec ts;
if (clock_gettime(CLOCK_MONOTONIC, &ts))
exit(1);
return (uint64_t)ts.tv_sec * 1000 + (uint64_t)ts.tv_nsec / 1000000;
}
static void thread_start(void* (*fn)(void*), void* arg)
{
pthread_t th;
pthread_attr_t attr;
pthread_attr_init(&attr);
pthread_attr_setstacksize(&attr, 128 << 10);
int i = 0;
for (; i < 100; i++) {
if (pthread_create(&th, &attr, fn, arg) == 0) {
pthread_attr_destroy(&attr);
return;
}
if (errno == EAGAIN) {
usleep(50);
continue;
}
break;
}
exit(1);
}
typedef struct {
int state;
} event_t;
static void event_init(event_t* ev)
{
ev->state = 0;
}
static void event_reset(event_t* ev)
{
ev->state = 0;
}
static void event_set(event_t* ev)
{
if (ev->state)
exit(1);
__atomic_store_n(&ev->state, 1, __ATOMIC_RELEASE);
syscall(SYS_futex, &ev->state, FUTEX_WAKE | FUTEX_PRIVATE_FLAG, 1000000);
}
static void event_wait(event_t* ev)
{
while (!__atomic_load_n(&ev->state, __ATOMIC_ACQUIRE))
syscall(SYS_futex, &ev->state, FUTEX_WAIT | FUTEX_PRIVATE_FLAG, 0, 0);
}
static int event_isset(event_t* ev)
{
return __atomic_load_n(&ev->state, __ATOMIC_ACQUIRE);
}
static int event_timedwait(event_t* ev, uint64_t timeout)
{
uint64_t start = current_time_ms();
uint64_t now = start;
for (;;) {
uint64_t remain = timeout - (now - start);
struct timespec ts;
ts.tv_sec = remain / 1000;
ts.tv_nsec = (remain % 1000) * 1000 * 1000;
syscall(SYS_futex, &ev->state, FUTEX_WAIT | FUTEX_PRIVATE_FLAG, 0, &ts);
if (__atomic_load_n(&ev->state, __ATOMIC_ACQUIRE))
return 1;
now = current_time_ms();
if (now - start > timeout)
return 0;
}
}
static bool write_file(const char* file, const char* what, ...)
{
char buf[1024];
va_list args;
va_start(args, what);
vsnprintf(buf, sizeof(buf), what, args);
va_end(args);
buf[sizeof(buf) - 1] = 0;
int len = strlen(buf);
int fd = open(file, O_WRONLY | O_CLOEXEC);
if (fd == -1)
return false;
if (write(fd, buf, len) != len) {
int err = errno;
close(fd);
errno = err;
return false;
}
close(fd);
return true;
}
static void setup_common()
{
if (mount(0, "/sys/fs/fuse/connections", "fusectl", 0, 0)) {
}
}
static void loop();
static void sandbox_common()
{
prctl(PR_SET_PDEATHSIG, SIGKILL, 0, 0, 0);
setsid();
struct rlimit rlim;
rlim.rlim_cur = rlim.rlim_max = (200 << 20);
setrlimit(RLIMIT_AS, &rlim);
rlim.rlim_cur = rlim.rlim_max = 32 << 20;
setrlimit(RLIMIT_MEMLOCK, &rlim);
rlim.rlim_cur = rlim.rlim_max = 136 << 20;
setrlimit(RLIMIT_FSIZE, &rlim);
rlim.rlim_cur = rlim.rlim_max = 1 << 20;
setrlimit(RLIMIT_STACK, &rlim);
rlim.rlim_cur = rlim.rlim_max = 0;
setrlimit(RLIMIT_CORE, &rlim);
rlim.rlim_cur = rlim.rlim_max = 256;
setrlimit(RLIMIT_NOFILE, &rlim);
if (unshare(CLONE_NEWNS)) {
}
if (mount(NULL, "/", NULL, MS_REC | MS_PRIVATE, NULL)) {
}
if (unshare(CLONE_NEWIPC)) {
}
if (unshare(0x02000000)) {
}
if (unshare(CLONE_NEWUTS)) {
}
if (unshare(CLONE_SYSVSEM)) {
}
typedef struct {
const char* name;
const char* value;
} sysctl_t;
static const sysctl_t sysctls[] = {
{"/proc/sys/kernel/shmmax", "16777216"},
{"/proc/sys/kernel/shmall", "536870912"},
{"/proc/sys/kernel/shmmni", "1024"},
{"/proc/sys/kernel/msgmax", "8192"},
{"/proc/sys/kernel/msgmni", "1024"},
{"/proc/sys/kernel/msgmnb", "1024"},
{"/proc/sys/kernel/sem", "1024 1048576 500 1024"},
};
unsigned i;
for (i = 0; i < sizeof(sysctls) / sizeof(sysctls[0]); i++)
write_file(sysctls[i].name, sysctls[i].value);
}
static int wait_for_loop(int pid)
{
if (pid < 0)
exit(1);
int status = 0;
while (waitpid(-1, &status, __WALL) != pid) {
}
return WEXITSTATUS(status);
}
static void drop_caps(void)
{
struct __user_cap_header_struct cap_hdr = {};
struct __user_cap_data_struct cap_data[2] = {};
cap_hdr.version = _LINUX_CAPABILITY_VERSION_3;
cap_hdr.pid = getpid();
if (syscall(SYS_capget, &cap_hdr, &cap_data))
exit(1);
const int drop = (1 << CAP_SYS_PTRACE) | (1 << CAP_SYS_NICE);
cap_data[0].effective &= ~drop;
cap_data[0].permitted &= ~drop;
cap_data[0].inheritable &= ~drop;
if (syscall(SYS_capset, &cap_hdr, &cap_data))
exit(1);
}
static int do_sandbox_none(void)
{
if (unshare(CLONE_NEWPID)) {
}
int pid = fork();
if (pid != 0)
return wait_for_loop(pid);
setup_common();
sandbox_common();
drop_caps();
if (unshare(CLONE_NEWNET)) {
}
loop();
exit(1);
}
#define FUSE_MIN_READ_BUFFER 8192
enum fuse_opcode {
FUSE_LOOKUP = 1,
FUSE_FORGET = 2,
FUSE_GETATTR = 3,
FUSE_SETATTR = 4,
FUSE_READLINK = 5,
FUSE_SYMLINK = 6,
FUSE_MKNOD = 8,
FUSE_MKDIR = 9,
FUSE_UNLINK = 10,
FUSE_RMDIR = 11,
FUSE_RENAME = 12,
FUSE_LINK = 13,
FUSE_OPEN = 14,
FUSE_READ = 15,
FUSE_WRITE = 16,
FUSE_STATFS = 17,
FUSE_RELEASE = 18,
FUSE_FSYNC = 20,
FUSE_SETXATTR = 21,
FUSE_GETXATTR = 22,
FUSE_LISTXATTR = 23,
FUSE_REMOVEXATTR = 24,
FUSE_FLUSH = 25,
FUSE_INIT = 26,
FUSE_OPENDIR = 27,
FUSE_READDIR = 28,
FUSE_RELEASEDIR = 29,
FUSE_FSYNCDIR = 30,
FUSE_GETLK = 31,
FUSE_SETLK = 32,
FUSE_SETLKW = 33,
FUSE_ACCESS = 34,
FUSE_CREATE = 35,
FUSE_INTERRUPT = 36,
FUSE_BMAP = 37,
FUSE_DESTROY = 38,
FUSE_IOCTL = 39,
FUSE_POLL = 40,
FUSE_NOTIFY_REPLY = 41,
FUSE_BATCH_FORGET = 42,
FUSE_FALLOCATE = 43,
FUSE_READDIRPLUS = 44,
FUSE_RENAME2 = 45,
FUSE_LSEEK = 46,
FUSE_COPY_FILE_RANGE = 47,
FUSE_SETUPMAPPING = 48,
FUSE_REMOVEMAPPING = 49,
CUSE_INIT = 4096,
CUSE_INIT_BSWAP_RESERVED = 1048576,
FUSE_INIT_BSWAP_RESERVED = 436207616,
};
struct fuse_in_header {
uint32_t len;
uint32_t opcode;
uint64_t unique;
uint64_t nodeid;
uint32_t uid;
uint32_t gid;
uint32_t pid;
uint32_t padding;
};
struct fuse_out_header {
uint32_t len;
uint32_t error;
uint64_t unique;
};
struct syz_fuse_req_out {
struct fuse_out_header* init;
struct fuse_out_header* lseek;
struct fuse_out_header* bmap;
struct fuse_out_header* poll;
struct fuse_out_header* getxattr;
struct fuse_out_header* lk;
struct fuse_out_header* statfs;
struct fuse_out_header* write;
struct fuse_out_header* read;
struct fuse_out_header* open;
struct fuse_out_header* attr;
struct fuse_out_header* entry;
struct fuse_out_header* dirent;
struct fuse_out_header* direntplus;
struct fuse_out_header* create_open;
struct fuse_out_header* ioctl;
};
static int fuse_send_response(int fd, const struct fuse_in_header* in_hdr,
struct fuse_out_header* out_hdr)
{
if (!out_hdr) {
return -1;
}
out_hdr->unique = in_hdr->unique;
if (write(fd, out_hdr, out_hdr->len) == -1) {
return -1;
}
return 0;
}
static volatile long syz_fuse_handle_req(volatile long a0, volatile long a1,
volatile long a2, volatile long a3)
{
struct syz_fuse_req_out* req_out = (struct syz_fuse_req_out*)a3;
struct fuse_out_header* out_hdr = NULL;
char* buf = (char*)a1;
int buf_len = (int)a2;
int fd = (int)a0;
if (!req_out) {
return -1;
}
if (buf_len < FUSE_MIN_READ_BUFFER) {
return -1;
}
int ret = read(fd, buf, buf_len);
if (ret == -1) {
return -1;
}
if ((size_t)ret < sizeof(struct fuse_in_header)) {
return -1;
}
const struct fuse_in_header* in_hdr = (const struct fuse_in_header*)buf;
if (in_hdr->len > (uint32_t)ret) {
return -1;
}
switch (in_hdr->opcode) {
case FUSE_GETATTR:
case FUSE_SETATTR:
out_hdr = req_out->attr;
break;
case FUSE_LOOKUP:
case FUSE_SYMLINK:
case FUSE_LINK:
case FUSE_MKNOD:
case FUSE_MKDIR:
out_hdr = req_out->entry;
break;
case FUSE_OPEN:
case FUSE_OPENDIR:
out_hdr = req_out->open;
break;
case FUSE_STATFS:
out_hdr = req_out->statfs;
break;
case FUSE_RMDIR:
case FUSE_RENAME:
case FUSE_RENAME2:
case FUSE_FALLOCATE:
case FUSE_SETXATTR:
case FUSE_REMOVEXATTR:
case FUSE_FSYNCDIR:
case FUSE_FSYNC:
case FUSE_SETLKW:
case FUSE_SETLK:
case FUSE_ACCESS:
case FUSE_FLUSH:
case FUSE_RELEASE:
case FUSE_RELEASEDIR:
case FUSE_UNLINK:
case FUSE_DESTROY:
out_hdr = req_out->init;
if (!out_hdr) {
return -1;
}
out_hdr->len = sizeof(struct fuse_out_header);
break;
case FUSE_READ:
out_hdr = req_out->read;
break;
case FUSE_READDIR:
out_hdr = req_out->dirent;
break;
case FUSE_READDIRPLUS:
out_hdr = req_out->direntplus;
break;
case FUSE_INIT:
out_hdr = req_out->init;
break;
case FUSE_LSEEK:
out_hdr = req_out->lseek;
break;
case FUSE_GETLK:
out_hdr = req_out->lk;
break;
case FUSE_BMAP:
out_hdr = req_out->bmap;
break;
case FUSE_POLL:
out_hdr = req_out->poll;
break;
case FUSE_GETXATTR:
case FUSE_LISTXATTR:
out_hdr = req_out->getxattr;
break;
case FUSE_WRITE:
case FUSE_COPY_FILE_RANGE:
out_hdr = req_out->write;
break;
case FUSE_FORGET:
case FUSE_BATCH_FORGET:
return 0;
case FUSE_CREATE:
out_hdr = req_out->create_open;
break;
case FUSE_IOCTL:
out_hdr = req_out->ioctl;
break;
default:
return -1;
}
return fuse_send_response(fd, in_hdr, out_hdr);
}
struct thread_t {
int created, call;
event_t ready, done;
};
static struct thread_t threads[16];
static void execute_call(int call);
static int running;
static void* thr(void* arg)
{
struct thread_t* th = (struct thread_t*)arg;
for (;;) {
event_wait(&th->ready);
event_reset(&th->ready);
execute_call(th->call);
__atomic_fetch_sub(&running, 1, __ATOMIC_RELAXED);
event_set(&th->done);
}
return 0;
}
static void loop(void)
{
int i, call, thread;
for (call = 0; call < 7; call++) {
for (thread = 0; thread < (int)(sizeof(threads) / sizeof(threads[0]));
thread++) {
struct thread_t* th = &threads[thread];
if (!th->created) {
th->created = 1;
event_init(&th->ready);
event_init(&th->done);
event_set(&th->done);
thread_start(thr, th);
}
if (!event_isset(&th->done))
continue;
event_reset(&th->done);
th->call = call;
__atomic_fetch_add(&running, 1, __ATOMIC_RELAXED);
event_set(&th->ready);
event_timedwait(&th->done, 50);
break;
}
}
for (i = 0; i < 100 && __atomic_load_n(&running, __ATOMIC_RELAXED); i++)
sleep_ms(1);
}
uint64_t r[2] = {0xffffffffffffffff, 0x0};
void execute_call(int call)
{
intptr_t res = 0;
switch (call) {
case 0:
memcpy((void*)0x20000400, "./file0\000", 8);
syscall(__NR_mkdir, 0x20000400ul, 0ul);
break;
case 1:
memcpy((void*)0x20002080, "/dev/fuse\000", 10);
res = syscall(__NR_openat, 0xffffffffffffff9cul, 0x20002080ul, 0x42ul, 0ul);
if (res != -1)
r[0] = res;
break;
case 2:
memcpy((void*)0x200042c0, "./file0\000", 8);
memcpy((void*)0x20002000, "fuse\000", 5);
memcpy((void*)0x200021c0, "fd", 2);
*(uint8_t*)0x200021c2 = 0x3d;
sprintf((char*)0x200021c3, "0x%016llx", (long long)r[0]);
*(uint8_t*)0x200021d5 = 0x2c;
memcpy((void*)0x200021d6, "rootmode", 8);
*(uint8_t*)0x200021de = 0x3d;
sprintf((char*)0x200021df, "%023llo", (long long)0x4000);
*(uint8_t*)0x200021f6 = 0x2c;
memcpy((void*)0x200021f7, "user_id", 7);
*(uint8_t*)0x200021fe = 0x3d;
sprintf((char*)0x200021ff, "%020llu", (long long)0);
*(uint8_t*)0x20002213 = 0x2c;
memcpy((void*)0x20002214, "group_id", 8);
*(uint8_t*)0x2000221c = 0x3d;
sprintf((char*)0x2000221d, "%020llu", (long long)0);
*(uint8_t*)0x20002231 = 0x2c;
*(uint8_t*)0x20002232 = 0;
syscall(__NR_mount, 0ul, 0x200042c0ul, 0x20002000ul, 0ul, 0x200021c0ul);
break;
case 3:
memcpy((void*)0x200002c0, "./file0\000", 8);
memcpy((void*)0x20000000, "./file0\000", 8);
memcpy((void*)0x20000340, "incremental-fs\000", 15);
syscall(__NR_mount, 0x200002c0ul, 0x20000000ul, 0x20000340ul, 0ul, 0ul);
break;
case 4:
res = syscall(__NR_read, r[0], 0x20004340ul, 0x2020ul);
if (res != -1)
r[1] = *(uint64_t*)0x20004348;
break;
case 5:
*(uint32_t*)0x20004200 = 0x50;
*(uint32_t*)0x20004204 = 0;
*(uint64_t*)0x20004208 = r[1];
*(uint32_t*)0x20004210 = 7;
*(uint32_t*)0x20004214 = 0x20;
*(uint32_t*)0x20004218 = 0;
*(uint32_t*)0x2000421c = 0;
*(uint16_t*)0x20004220 = 0;
*(uint16_t*)0x20004222 = 0;
*(uint32_t*)0x20004224 = 0;
*(uint32_t*)0x20004228 = 0;
*(uint16_t*)0x2000422c = 0;
*(uint16_t*)0x2000422e = 0;
*(uint32_t*)0x20004230 = 0;
*(uint32_t*)0x20004234 = 0;
*(uint32_t*)0x20004238 = 0;
*(uint32_t*)0x2000423c = 0;
*(uint32_t*)0x20004240 = 0;
*(uint32_t*)0x20004244 = 0;
*(uint32_t*)0x20004248 = 0;
*(uint32_t*)0x2000424c = 0;
syscall(__NR_write, r[0], 0x20004200ul, 0x50ul);
break;
case 6:
memcpy(
(void*)0x20000000,
"\x9e\xda\x43\x88\x38\x74\x3b\xd4\xe9\x72\x0b\xee\x57\x09\x35\x15\xdc"
"\x18\x9a\x5e\xa6\x85\xe9\x55\x6c\x1c\x2c\x3c\xfc\x4d\xf5\x0d\x66\xd3"
"\x1a\x48\xaa\x31\x26\x63\xb6\x8d\x18\xc5\x82\x6b\x5b\x55\xfb\x73\x82"
"\x08\x86\x3d\xac\x0f\x10\xf4\x23\xae\xe7\xa5\xd8\xdd\xc4\x5e\xbd\xfe"
"\xb7\x42\x4b\xae\x85\x9d\x7c\x37\xec\xfc\x4b\x63\x91\x4d\x5a\x56\xd9"
"\x10\x17\xdd\x22\xbc\x84\xf7\x59\xa1\x59\x69\x95\x1a\xef\x9d\x5c\x88"
"\xc9\x65\x60\x89\x69\x88\xfa\x18\xcd\x94\x6c\xfc\xc3\xa0\xf1\xc9\x93"
"\x34\x83\x77\x90\x4e\xac\x32\xc9\x80\xbd\xf7\x97\x6e\xbc\xa2\xb4\x99"
"\xca\xb6\x3c\x4e\x84\x15\x14\x27\x7f\xc7\x1d\x46\x20\xe2\x9a\x92\x52"
"\x34\x02\x48\x5d\xe0\xe8\x28\x96\x48\x4c\x0a\xe4\x97\xa4\xd6\x86\xdf"
"\x23\xca\x7b\x68\xc3\xfd\x5e\x62\x4d\x35\x10\xd7\xf9\x48\x38\xe5\x4a"
"\xf8\x77\xca\x58\xa0\x0c\x5a\x67\x2b\xba\x11\xf5\xaa\x1e\xd1\x98\x0d"
"\xfe\xf4\x7b\x99\x73\xd0\xbf\x45\x6d\xed\x5e\x72\xf1\x70\x2b\x3d\xc5"
"\x19\x7f\xce\x39\xcb\xa5\x3a\x03\x8d\x8d\xc0\xec\x78\x3c\xe7\x05\x77"
"\x10\x7d\xc5\xe8\xb2\x99\xe6\x4a\x0b\x7f\x11\x91\xf0\x92\x6b\xd2\x57"
"\x62\x37\x01\x91\x71\x0b\xab\x2f\x44\xe9\x06\x9f\x55\xf8\xa3\xf8\x7e"
"\x4c\xb4\x88\xa2\xfb\x33\x48\xc0\xbf\x3b\x38\x74\x29\x1f\x83\xe4\x77"
"\x6b\x16\x0e\xa7\x3a\xaf\xa3\x91\x9c\x7c\x06\x9c\x73\xc0\x05\x21\x73"
"\xa6\x31\x58\xdb\x8b\x65\x54\x1d\x16\x1f\x9c\x96\x49\x26\xad\x7f\x06"
"\xbd\xd6\xcb\x6a\x32\x13\x5b\x04\xe3\x57\x01\xc2\xe1\x3c\x49\xc1\xf7"
"\x5d\xc7\xa2\x5d\x62\x33\x78\x86\x06\x92\xd1\x72\xec\x3f\x1e\x1f\x2d"
"\x9d\xc7\x7c\x01\x5c\x13\x72\x1e\xfc\xb1\x01\xc2\x39\x0a\xbb\x84\x7e"
"\x87\x11\x32\xf4\x72\xa3\x7c\xc0\x16\x3b\x39\xb1\xd5\x75\xa5\x44\x4e"
"\x24\x6a\x08\xa1\xaf\xb1\xa6\x96\xca\xba\xb2\x94\x98\xa3\x14\x42\x9a"
"\x3b\x9f\x44\xc4\x3b\xa2\x9f\x71\xfa\xc1\xfb\xe0\xd0\x1c\x3c\x16\xd2"
"\x27\x30\x93\x27\x04\xbc\xfb\x0c\x1b\x7a\x43\x2b\xc5\x1d\xd3\xf5\xdd"
"\x5a\xfc\x3b\x34\x2c\xbe\x6a\x6f\xf8\x99\x03\x9e\x28\xf9\xa5\x18\x81"
"\xb1\xd4\x6f\xdc\xf3\x17\x67\xcb\x6f\x5c\x5c\x69\xab\x3c\x80\x61\x5d"
"\x77\xc4\xd1\x66\x4f\xc4\xec\x83\x1b\x8c\xea\x2e\x75\x2b\xbb\x7a\x9c"
"\xe7\x9d\xf8\x75\xb2\x9f\x1e\x23\x27\x51\xda\xf3\x2a\x1a\x0c\x4f\xf8"
"\xbd\x06\x88\xe2\xb8\xe2\xd6\x68\xb8\xa7\x7e\x20\xa9\xeb\x6e\xc2\xe2"
"\xc2\x3b\x94\xe5\x07\xba\xea\xcb\xcf\xa3\x1f\xb6\xe1\xca\x33\x43\x66"
"\x8f\x43\xe3\xaa\x6d\x85\xe7\xc2\x9b\xf0\xbb\x4d\xbd\xab\xdd\xc9\x2b"
"\xe7\xf4\xa6\xf5\xd2\x1b\x19\xe6\xda\x17\xbf\xb6\xcc\x92\x6e\x38\x47"
"\x53\x2f\xae\x29\xc7\xb6\x2f\xb9\x09\x13\x0e\xc3\x72\xd3\xc1\x6c\xfe"
"\x6a\xaf\x3c\xe2\xaf\x0f\xe7\x61\x0f\xde\x7a\xad\x61\xbc\x80\xd2\xf9"
"\x6b\x99\x9c\x8c\xcf\x6d\x22\xcf\x90\x3c\xa8\xae\x8b\x87\x9e\xc4\xa4"
"\x16\xf3\x34\x98\x2e\x98\x10\xc0\x14\x0a\x18\xd4\xdc\x81\xb5\xed\xaa"
"\xe2\x3e\x9f\x4a\xba\xf4\x0e\xd7\x15\x12\xae\xbb\xba\x5b\xb2\x51\x54"
"\x5e\x18\x8d\xb7\x89\x55\x8a\x84\x5a\x28\x77\xb1\x4b\xda\xee\xc3\xc7"
"\x38\xb7\xd7\x30\xc0\x86\x05\x31\xbf\x55\x17\xd4\xf0\xe8\xf9\x5e\xd3"
"\x57\x1f\x8a\x35\x81\x6d\x51\x16\xfc\xb8\xd7\xcb\xf4\x2b\x7d\x5d\x5e"
"\x65\x54\x15\x08\xc8\x98\xbb\x2e\x0f\xe9\x62\x97\xd2\xab\x71\x35\x66"
"\x2d\xe3\x9d\xf0\x99\xeb\xae\xd5\x87\x11\x11\xf5\x34\x62\x78\xce\xe5"
"\x72\x8c\xec\x51\x2e\x6c\x0a\x0d\x65\xb5\x1e\x3d\x62\x78\x73\x19\x5b"
"\x84\x10\x33\x41\xc2\xbc\x83\xb6\xc8\xfd\xd8\xba\x17\xf5\x95\x74\x13"
"\xf6\x1c\x69\xd6\x18\xc9\xb9\xd0\xb1\xf0\x8d\xc8\x19\x21\xb6\xc6\x62"
"\xee\x1d\xa3\xbf\xa0\x19\xb0\x95\xe9\xa0\x3c\x2d\xb4\xd6\x45\xcc\xb7"
"\x36\x4e\x89\x50\x98\xcb\xf7\xd9\x32\xc7\x2d\x80\x66\x3c\x7a\x16\x94"
"\xd1\x22\xf7\x34\x83\x93\x07\x92\x23\xc1\x1d\x36\xc6\x4a\x58\x56\xea"
"\xe0\x39\x7a\xb9\xa9\xd9\x48\x20\x4b\x74\xe5\x65\x25\xa9\xd5\x52\xdd"
"\x09\x16\xde\x81\xcb\xb5\xaf\x3c\x59\xb3\xd7\xf8\xf9\x15\x44\x23\xce"
"\x2c\xb4\x5a\x5b\xc8\x08\xe2\x4b\xef\x13\x21\x20\x19\xa1\x95\x45\xfe"
"\x54\xba\x84\xd0\x15\x34\x35\x83\x80\x19\x2b\x8c\x7b\x0e\xda\x90\x78"
"\x10\x37\x5b\xb6\x6a\x57\x8a\x58\xfe\xc3\x92\xb4\x79\x91\x27\x1c\x83"
"\x67\xb9\x1d\x71\x0e\x8a\x17\x6b\xc1\xa4\xe9\x6f\x0e\x13\x7d\x4c\x25"
"\xfb\xb0\x3e\xdd\xc3\x92\xf9\xf1\x70\xdd\x74\x44\x72\xb8\x64\xfb\xba"
"\xe7\xc9\x3d\x86\xe6\x82\x30\x8b\x21\xb7\x3c\x56\x52\x06\x5d\x72\xcf"
"\x02\xe1\x15\x2b\x44\x02\x4a\x90\xa3\xb5\x2e\xb0\xbb\x3c\xb4\x12\xe5"
"\x18\xd3\x7a\x68\xaa\x4c\x7f\x46\x78\x9c\x54\xab\x30\xd3\xa7\x3d\x0a"
"\x87\x12\xfd\xe6\x12\x29\x4c\xda\x2a\xa1\xcc\xf1\x64\x93\x0b\x9b\x1d"
"\x17\x80\x1d\x4f\xbb\x06\xe8\x49\xd3\x9b\xf2\xb5\x14\x13\x30\xca\xa0"
"\xd2\x61\x8b\x61\x6f\x1c\x67\xe1\xca\x57\x08\x0e\x79\xed\x90\x92\xba"
"\x7a\x55\xe8\x12\x1c\xfc\x82\x5c\xd2\x6a\x01\x99\xa4\x79\xa7\xab\x1b"
"\x7b\x23\xd2\xa4\xdd\x82\xfa\x6d\x04\xee\x41\xca\x68\x04\x35\xef\xc9"
"\x34\xf0\x45\x1e\x86\x5e\x86\x32\xac\x2f\x11\x15\xf4\xcd\xd3\x3b\x0f"
"\xcc\xb7\xa2\x32\x61\x27\xfa\xf2\x0c\xba\x37\xc8\x28\x61\x3d\xba\x5a"
"\x98\xf4\xe1\xad\x25\xeb\x6b\x91\x07\x8c\xf7\x3d\x87\x3d\xf9\xef\x91"
"\x53\x14\x76\xf6\x4b\x83\x55\x9f\xf7\xcc\xdc\x4c\x07\x0d\x47\x8b\x18"
"\x19\x6e\xa0\x5f\xe8\xd4\xea\x02\x16\xee\x52\x73\xdf\xab\xbd\x04\x58"
"\x2f\x40\xf0\x64\xc9\x78\x1a\xfd\x2c\xbf\x30\x90\x1f\x28\xcd\x09\xcc"
"\x93\x4f\x1b\x2d\x50\x88\x37\x78\x27\x41\x77\xe3\xdb\xa8\xaf\x0a\x1b"
"\x93\x1d\x80\xce\x1a\x6c\x40\x85\x78\x0e\xa2\x19\x5b\x65\xec\xfd\x29"
"\x53\xf7\x8a\x52\x90\xfe\x56\x0d\x0c\xd6\xa5\xe7\x38\x90\xa5\xa8\x2d"
"\xc4\x10\xb9\x2a\x3e\xf2\xbe\x05\xec\x56\x07\x82\x0f\xd4\xca\x6b\x9c"
"\x3a\xa2\x58\xd5\x90\x22\xfd\xcb\x21\x66\x5f\x1c\xe4\xe8\xaa\xd8\xfd"
"\x91\x8c\x43\xbd\x3c\x2a\xfe\x3d\xc2\x23\xff\x9f\x48\x83\x1d\x40\x1c"
"\x8b\x69\x96\x19\x07\x93\xd1\xdd\x75\x51\xf8\x51\x1b\x69\x28\x39\x92"
"\x39\x8d\x8f\x9b\x4b\xd2\xb3\x39\x8d\x3b\x8c\x6f\x3c\x5d\x8b\x80\x2c"
"\xa5\x28\x2b\x70\x24\x2d\xf2\xb7\xbe\x4b\x38\xe7\x0c\x30\x65\xf8\xda"
"\x88\x86\x31\x37\x5a\xfc\xc0\x5c\xe5\x78\x08\x9c\x4f\x78\x37\x76\xb2"
"\x86\xb7\xa6\x0d\x1b\x5e\x18\x9e\x27\x42\xa3\x24\x0c\x10\x36\xa9\x53"
"\xd8\x86\x88\x54\x22\xee\xf0\x14\x13\xc3\x80\x99\xb6\x45\x05\xfd\x5a"
"\x73\x48\x8a\xcb\x4e\x61\x18\x20\x67\x4c\x58\xae\x74\xd6\xc6\x4a\x88"
"\x5d\x4b\xed\xa9\xbd\x79\x03\xbc\xdc\x71\xe3\x71\x1e\x2a\x05\x7c\x0e"
"\xab\x21\x00\xc3\x21\x05\x0a\xb1\x4c\x6e\x45\x3c\x53\x18\x25\x77\xad"
"\x31\x78\x60\x3c\xd9\xaf\xde\x40\xa7\x01\x12\x0e\x9a\x36\x07\x4f\xd5"
"\x82\x42\x8c\x74\xe0\x27\x81\x31\x8e\x6c\x65\x45\x0f\x8f\x02\x0b\xd2"
"\x24\x75\x69\x6f\xe1\x3b\x8c\x59\x26\x0e\x53\xa0\x6d\x16\xea\xbd\x13"
"\x5e\x88\x7a\x0a\x6b\xbc\x8a\xd2\x1b\xe7\x66\x1d\xf7\x6f\xec\x5b\x13"
"\x84\x4f\x68\xb8\xee\xd1\xa7\x37\x97\x13\x73\x8b\xea\xc9\xf2\x3c\x7a"
"\x26\x52\x0e\x19\x79\x7a\x91\x0c\xde\x9f\xb2\x85\x17\x95\x26\x88\x9b"
"\x90\x8b\x7e\xb4\x9b\xb0\x6f\x70\xf6\x27\x1f\xba\x87\x12\xc1\xa4\x26"
"\x9e\xbc\xf4\xb7\xd0\x43\xe9\x24\xe3\xd2\xc4\xc7\x53\xfd\x7e\x54\x7d"
"\x95\x84\x1e\x33\x51\x79\x83\x6f\x76\x42\x4e\x72\x88\x10\xd7\xf3\x2b"
"\x78\x25\x6e\xa3\x0c\x79\xd9\x23\x8a\x65\x88\x42\x6e\x1f\x2d\x4c\x0b"
"\x03\xd5\x60\x5b\xd8\x26\xed\x24\xf0\xf1\x13\x26\xb4\xcf\x95\x86\x32"
"\xb8\x6e\x01\x7a\xa8\x0e\x14\x2d\xb1\x58\x0c\x44\xf7\x6d\x9c\x98\x19"
"\x6f\x3f\x68\x52\xab\x2b\xfc\x6a\x01\xa3\x55\x3a\x13\x0c\x2d\x17\x19"
"\x57\xf5\xa4\x5c\x35\x50\xfb\xbc\x99\x0e\xf8\x74\x2a\x98\xa8\x6b\x28"
"\x0a\x57\xb9\xf1\x98\xff\x43\x6b\xc0\x11\x61\xad\xa5\x0e\x6f\x23\x02"
"\x6c\x32\x54\xad\xf2\x32\x1b\xff\x7e\x20\xaa\x54\x08\x0b\xbb\x57\xd8"
"\xd5\x2c\x6a\x6d\xf6\x10\x77\x06\xa2\xe5\xbc\x6d\xa6\x8f\x17\xb4\x74"
"\xc0\xed\xd3\x94\x01\xd7\x65\x08\x6e\x88\x5c\xf7\x99\x24\x05\xf8\x56"
"\x55\x79\x15\x60\x3c\xbe\x88\x94\x67\x6e\x99\x6b\xba\xdb\xb6\x49\xa5"
"\xe7\x49\x8b\x91\xf9\xbd\x2f\x69\x7d\xd9\xeb\xbe\x4d\x38\x60\x50\x25"
"\x8b\x9f\x4c\x94\x78\x1e\x61\xc6\x60\x65\x1c\x3f\x1e\x3a\xe5\x1f\x8c"
"\x03\x5e\xca\x36\x5b\xf1\x5d\x6d\xb4\x8e\xa9\xce\x18\x35\x15\xf4\xa2"
"\x08\xd0\x10\xf7\xc2\x3d\xca\xcb\xd6\xe2\x25\x49\x0d\x7e\x9c\x13\x35"
"\x25\xf5\xc9\x01\x8d\x75\x2b\x21\xb4\x89\x7b\xf1\x8b\x64\xb6\xa9\x93"
"\x6f\x53\x8a\x0a\x89\x58\xfc\x93\x44\x40\xae\xea\xad\x2b\x68\xac\x84"
"\x4d\x76\xf0\x90\x0a\x6c\x95\xbd\x0b\x35\x3d\x85\xd4\xfb\x62\xeb\x88"
"\x36\x01\x12\x23\x7f\xd8\xc6\x36\xa8\x0e\x31\x30\xb2\x1d\x66\xae\x8e"
"\xc5\x8a\x4b\x76\xcb\xa0\x60\x2f\x96\xda\x91\x9f\x7e\x84\xfd\x37\xe3"
"\xec\x23\x79\xf5\x8e\x38\x9a\x39\xc7\x8d\x24\x82\xe0\x3c\x37\x9e\x3c"
"\x46\x49\xad\x63\xa7\x6e\x37\x07\xec\xff\x07\xd2\xfc\xb0\xc9\xdf\xc5"
"\x24\xca\xb4\x9e\x69\xa0\x9c\x92\xe4\xf8\x87\x14\x33\x5c\xb5\x7d\x3f"
"\x61\x84\xd0\x7b\xef\x96\x57\x28\x0f\xb5\xc9\xfd\x2d\x8f\x94\x0f\x7a"
"\xc6\xc5\x40\x7e\x30\x77\xaa\x2e\x4b\xa8\xe2\x17\xe0\xee\x19\xe3\x02"
"\xd6\xd9\x0e\x3b\xe0\x5a\x86\xda\xde\x35\xd2\xe4\x54\xe5\x11\xaf\xb5"
"\xcf\x59\x36\xf1\xd1\x1f\x2f\xa6\xbe\x6c\xea\xa8\x17\xdb\xdc\x7a\x6a"
"\xab\xf2\xfa\xd8\xff\x3e\xfa\x83\x82\xa2\x50\x99\xf0\xc5\x98\x9d\x2a"
"\xd5\x6a\xe0\xf4\x96\x8b\x2c\xfc\xfc\x67\xb4\xf1\xc1\x61\xc7\x59\x00"
"\xb4\x84\x8f\x59\xa3\xc0\x37\x6d\xfc\xb7\x99\x7b\xf2\x8e\x9e\x85\xd6"
"\xdd\x94\x2a\x36\x05\x16\xde\x38\xe1\xc1\xa0\x38\xa7\x96\xf9\xa7\x7f"
"\xf2\xb0\xc7\xe5\xe8\xf4\x93\x23\x91\xa0\xe5\x8e\x76\xda\xcc\x6f\x97"
"\x64\x17\x8a\x21\x1d\xfd\xe3\xe7\x5d\x36\x7d\x29\x11\xff\x39\x81\x26"
"\xff\xdf\x83\xcf\x2f\xbd\xf1\xad\x52\x32\xbe\xd9\x15\x5f\x7a\x16\x86"
"\x38\xa5\x72\x09\x4a\x9e\x93\x4d\x49\x69\xb3\x58\xcf\x6e\x12\x1d\x7f"
"\xd2\xae\xae\x2f\x49\x90\x68\xb4\x2c\x15\x2f\x0e\x34\x03\xa2\x30\x88"
"\x5d\x6f\x92\xf0\x38\xdd\xaa\x23\x49\x9f\x80\x4f\xfb\x06\xab\xdb\xab"
"\xb5\x1f\x6c\x38\xc9\x2f\xb1\xa6\x27\x1a\x4b\x13\xd6\xd1\x11\x25\xb8"
"\xec\x12\xef\xa5\x90\x7d\xc6\x50\x62\x79\x7f\xb9\xcc\xa1\x5e\x2f\x25"
"\x4e\x76\xb1\x82\xd3\xfc\xdb\x4e\x96\xac\x4d\xe3\x6d\x6d\xf7\xe7\xbb"
"\xa5\xc3\x2f\x42\x22\x86\xb1\xbe\x3b\x79\xbf\xfb\x6f\xd6\x93\x76\x19"
"\x52\xd1\x95\xa8\x4a\xd9\xce\xb0\x72\x87\xa0\xfb\xef\xab\x9e\x03\x47"
"\xb5\x13\xc5\xf6\x02\x33\xcc\xd4\xb5\x2d\x90\xec\x14\x4a\x2f\x89\x6d"
"\x9d\xc7\xf2\x79\xf8\xaa\x93\x03\x8f\x3e\xfa\x28\x6e\x1c\x30\x06\x93"
"\x3a\x4d\x71\x83\xd9\x52\xf8\xd2\x8b\x14\x1b\x28\xb2\xaf\x35\x5b\x5b"
"\xd8\x19\x8d\xfd\xe1\xff\xb8\xd0\x92\x02\xaf\xf0\xd1\x6c\xa3\xfe\xc1"
"\x94\x66\x28\x92\xa4\x9f\x82\x98\x13\x97\x0a\x45\x20\xf1\x22\x8a\xa0"
"\x3d\x21\x1a\x45\xbe\xd3\xb2\xe0\x5b\xf1\xf1\x0b\x1a\x15\x27\x61\xe7"
"\xb6\xc6\xdd\xea\x86\x3a\x3c\x02\x22\x42\x56\x09\x2c\x70\xca\x70\xdc"
"\x18\x5c\x4c\x38\x5d\xd9\x8b\x09\xe2\x68\x26\x61\xe1\xe6\x6f\x71\xd9"
"\xc4\x03\x70\x48\xeb\x70\xe8\xa1\xcb\xe5\x7d\xe8\x7e\xc4\x37\x13\xab"
"\xf5\xfd\xcf\x63\xb9\xc4\x82\xf3\x18\xe3\xbe\xc3\x7e\x87\x8d\xad\xba"
"\xe1\x5a\x02\xd7\x31\xe6\xc8\x57\x4e\xb1\x4c\x05\x9d\x72\xf7\x3b\xe5"
"\x17\x4a\xdd\x78\x6d\x06\xb5\x85\xa2\x8a\x06\xd3\x49\xd8\xe4\x34\xa4"
"\x91\xb3\x48\x97\xb3\xc1\xad\x78\x6e\xc8\x28\x0d\x7f\x57\xed\xd4\xfb"
"\xc6\xae\xa5\x48\x5d\x65\x9b\x59\xd3\x93\xe3\x31\xcf\x91\xe6\xed\x76"
"\xf3\x40\xfc\xf7\xcf\x46\x08\x92\xfa\x73\x18\xfc\x42\xb8\x83\xf6\x1d"
"\x88\x8a\xd9\x82\xa7\x51\xac\xcb\x61\x3c\x66\x66\x1f\xba\x5f\x3d\x6d"
"\xe7\x51\xa6\xa9\xef\x8a\x47\x00\x31\x6a\xaa\xd0\x4e\x99\x1a\xab\x79"
"\x03\xf4\xef\x01\x2e\xc2\xa8\xc0\x92\x23\x4e\x74\xef\x33\x5d\xaf\x36"
"\x0a\xe4\x7b\xbd\x2b\xbc\x6a\xd8\xc1\xa4\xf8\x1e\xfe\x8b\xbd\x70\x3c"
"\xb5\x5e\xf3\x6b\x32\xb4\xe3\x0c\xb5\xa3\xb1\x65\xc0\x2b\xa2\x95\xd0"
"\xe1\xc4\x0c\xe6\xff\x8f\x47\x9a\x74\xf0\x12\x75\xf1\x13\xeb\xfa\x8a"
"\xde\x37\xa5\x9c\xe7\x0e\x6c\xa2\xa6\xf4\x8f\x1b\xe0\x85\xf6\x1b\xf7"
"\x72\xe2\xc2\xda\x52\x3a\x2c\xfe\x63\xe9\x9c\x57\xbd\xb1\xff\x23\x13"
"\x9d\x4f\xca\x49\xef\xf7\x54\x7e\x98\x80\xee\xfd\x3f\x75\x11\xa6\x77"
"\xef\xa2\x3b\x52\x09\x8b\xa8\x90\x37\xc4\x8d\xfc\xda\x2e\x8c\x1c\xfb"
"\x9f\x89\x21\x61\x04\x9e\x53\xf8\xce\xe5\x52\x56\x27\x95\x12\xae\xca"
"\xb8\xc4\x41\x60\x0d\xae\x0f\xd9\x57\x88\x32\x73\x04\x7c\xf5\xc6\x6b"
"\xa2\x09\xf8\x30\xaa\x2c\xe0\xcb\xe4\x1c\xa0\x8c\x0c\xef\x4a\xed\x7f"
"\x43\x24\x00\x92\x00\x66\x1a\x7c\xe6\x80\xe5\xa8\xdf\x2d\x05\x1c\x1d"
"\x8b\x2f\x63\xd2\x5d\x8d\x74\xd0\x5c\x75\xc4\x6c\x8f\x3f\x24\xd6\x25"
"\x53\x9e\x63\x45\x96\x50\x96\x04\x98\xa5\x4e\xc3\xb1\x62\x25\xbb\xbf"
"\x4d\x39\x30\x00\x9d\xf2\x65\x83\x9d\x72\x61\x1f\x53\x32\xa9\x04\xcd"
"\xeb\xad\xa1\x08\x23\x6e\x44\x14\xa2\x90\x9a\xd0\x1e\xc4\x4b\x9d\x7f"
"\x75\xde\x43\x85\xad\x7c\xa5\x15\x2e\x89\x0a\x09\x19\xb3\x63\x9f\xd1"
"\xbc\xbc\xa3\xb7\x37\xeb\xb8\xd9\xae\x54\x1b\x12\x71\xcf\x21\x66\xba"
"\x15\x83\x0e\x66\xf3\xd3\xaf\xd3\xb7\x54\xa7\xf8\x1a\xd4\xf0\x99\x97"
"\x04\xae\x99\xc1\x14\x90\x7c\x5b\xe4\xa4\x79\x7f\x13\xb8\x05\x64\xf2"
"\x34\x72\x3a\x34\xdb\xe1\x37\xda\xbf\xd7\xfa\x23\x56\x2d\xf6\x79\xf5"
"\x4a\x6a\xb5\x4d\xef\x6d\x63\xde\xae\x98\x44\xf7\x2f\xd7\x3e\xfd\x04"
"\x13\x55\x1f\x5c\x4b\x9e\xe8\x26\xeb\x3b\x7f\xaf\x92\xa5\x9e\xa3\x4a"
"\x16\x72\x3b\x4f\xea\x14\xd1\xc8\x81\x5a\x4e\x2d\x39\xfc\x48\xd1\xdb"
"\xce\x52\x6a\x7c\x53\xf5\xa9\x6d\x0e\xf6\x46\x3a\x0c\xee\x73\xfd\x35"
"\x05\xf5\xc7\x64\xa2\x64\xb8\x3c\x4a\x21\xf8\x0e\x8b\x61\xc8\x2d\x24"
"\x44\x2d\x13\xda\x99\xd1\x8d\xc1\xb2\x53\x8e\x7a\x51\x0f\x60\x93\xd9"
"\xef\x2b\xc5\xcc\x77\x7d\x4f\x98\x41\x1e\x93\x91\x9e\xdd\xfd\x69\xd6"
"\xe2\x0d\x22\x7c\xb6\x1c\x50\xf3\x58\xea\x22\x7f\x4d\xe9\x41\xfb\x08"
"\x0c\x1c\xf6\xb1\xf6\xe2\x55\x33\x76\x8f\xe1\x33\xdb\xfc\x3f\x9d\x29"
"\xc6\x03\xbe\xd3\x8a\xa3\xc5\xaf\x5b\x81\xa7\x06\xb0\x06\x7b\x40\xb8"
"\x8f\x99\x26\x10\xd0\x4c\x7c\xc3\x6b\x8f\x64\x96\x97\xcd\x6a\x93\xfa"
"\xe5\x11\x38\x16\x18\x91\xae\x75\xa7\x14\x77\x80\xfc\x59\xaf\x5a\x6e"
"\x18\xc5\x4f\x9d\x2a\x4f\xe7\xfa\x92\x31\x4b\x39\x9a\xfb\xa9\xa4\x0d"
"\x0c\xc2\x4f\x70\xa2\x59\x3a\xcf\x8d\x17\x92\x15\xe0\x6b\x7a\x9a\x88"
"\x22\x4b\xaf\xcb\x2c\xbf\x60\xca\xf5\xfe\x4f\xf3\x82\x08\xa7\x07\x93"
"\xb5\xdc\x33\xcd\x57\x29\x56\x26\x0e\x1c\x86\x31\x2d\x3b\xa9\xb3\xa4"
"\xb2\xb4\x43\x76\xf2\xe7\x8c\x61\x6a\x6c\x08\x80\xac\x8d\xcb\xaa\x30"
"\xb9\xf7\x61\xd5\x00\xfd\x03\xa8\x51\x8d\xd0\x50\x91\x57\xb1\x84\xa2"
"\xd9\x5e\x0c\xaf\x3f\xfc\x8a\xc2\xdb\x6c\x54\xd8\x0c\x71\xa1\xe5\xb9"
"\xea\x3b\xf5\x10\x71\xe2\x11\x8a\xf2\x04\x12\x3d\xac\xee\xb0\x4e\x4f"
"\x6f\x31\xf3\x2a\x4d\x3f\xbb\x76\xee\x49\x44\x0c\xab\xda\x2c\x12\x1c"
"\x1b\x99\xac\xab\x5b\x87\xce\xcc\x37\xc3\xf9\x06\x6a\xf3\x4a\xb2\x9d"
"\x65\x98\xbb\xfd\x91\x04\x7a\x2a\xc7\xce\x3a\x8f\x30\x27\xff\x5e\x6d"
"\x74\x35\x06\xf1\x61\x08\x72\x78\x89\x6a\x98\xed\x37\x12\x2b\xa2\x08"
"\xb6\x1c\xf5\x4d\x39\x29\x55\x5a\xb0\x6b\x56\x4c\xd5\xe4\xf4\x6f\x47"
"\x55\xa6\xcf\xa2\xef\x2b\x30\xd2\x9e\xa6\x6f\x27\x49\xd4\x06\x0d\x41"
"\x1f\xa9\x16\x0c\x91\xb6\xf5\x5c\xf0\x71\xac\x82\x22\xc6\x31\x3d\xf1"
"\x87\x59\xe2\x95\x8c\xdd\xfe\x3d\xb4\xcb\xeb\x9c\xd3\x9a\xbc\xf5\xf0"
"\xbe\xae\xca\xe8\x43\x78\x13\x99\x5c\xb7\xed\x0b\x87\xd4\x2c\xa9\x42"
"\xff\x72\x45\xec\xe2\x04\x79\x8d\x01\x36\x1c\x5f\x00\x8e\x0d\x82\xbd"
"\xf7\x66\x60\x51\x5b\xc7\x8f\x7f\x8f\x40\x9c\xcf\x68\x61\x4b\x2c\xb5"
"\x0f\x5a\xf2\x61\x56\x61\x32\x6f\xd9\x71\xbc\x57\xee\xea\xde\x60\xea"
"\x90\x6b\x8d\xf1\xcb\x0d\xfa\xfd\x31\x8c\xd2\xc3\x96\x30\x9c\x32\x9d"
"\x04\x69\xca\x19\x2a\xa8\xf5\x1d\x7c\x42\x27\x68\x54\x40\xf0\x73\x98"
"\x32\x55\xba\xf0\x54\xb9\x7b\x9d\x7b\xe1\xd1\x47\x0d\x7e\xab\xd5\xc0"
"\x9b\x21\x16\xb4\xe8\x6b\x05\x67\xb7\xe9\x7e\x08\x87\x17\xa4\xfe\x3d"
"\xbd\xd3\x10\xa1\xc3\x91\x36\xea\x4d\x2c\x47\x49\x20\x01\xf9\x88\x5d"
"\xba\x03\xbf\x97\xe7\xda\x37\x61\x71\xd6\x66\x44\x1c\xdc\x2f\x99\x9d"
"\xb1\x37\x60\x3d\x57\xdf\x32\xb4\x26\x0f\xa0\x16\x5e\x82\x91\x7b\xb1"
"\x63\x1e\xa3\x14\xe7\xa7\x43\x7e\x66\xfc\x68\xce\xf2\x2c\xda\x8f\x45"
"\x6d\x6e\x58\x3f\x6e\x32\x37\xe0\xbc\x79\x98\x7a\x91\x03\xf7\xcf\x09"
"\x18\xe2\x68\x81\xf6\x7e\xa5\x82\xe1\xff\x3a\x49\x17\x75\x99\xd3\x85"
"\xbf\x6e\x42\x57\x2a\x25\x47\x93\x3a\xed\xdb\x82\x65\x30\xe9\xad\xf3"
"\x0d\xd8\x4c\x3a\x7f\xae\x5c\x4c\x26\xf6\xc6\xf3\xa9\xf0\x90\x6d\xec"
"\xd3\x14\xe2\x40\x78\x25\xab\xef\x95\x9c\x54\x16\xd1\x8a\x92\xff\x34"
"\xe6\xc5\x21\xa1\x6e\x8a\x0a\x29\x93\x7c\x77\xd4\xee\x99\xb4\x1d\x53"
"\x0a\x73\x2a\xcb\xe0\xbf\x5d\x27\x4d\xf9\xd4\x96\xb4\x7a\x9a\x62\x45"
"\x46\xbd\xcf\x99\x76\xcd\xe1\x2e\xc9\x89\xcb\x2a\x70\xb3\x3a\x7c\x8a"
"\x3a\x77\x65\x20\x23\x16\x46\x95\xf9\xdb\x30\xdf\xcf\x58\x7f\x0c\xd4"
"\xf7\x3e\x38\x57\x30\xbc\xbd\xd6\x88\xf6\xdc\xb0\x8b\xa0\xef\xbb\x9f"
"\x57\x92\x20\xaf\xef\xa4\xac\xfe\xa5\x22\xe8\x64\xfc\xe9\xb1\x78\x2c"
"\xe9\xf1\x48\x24\xd1\x6e\x9d\x33\xa2\x60\x9c\x23\xba\x3c\x5a\x1a\xf0"
"\x25\x49\x35\x7a\x0d\xcc\x12\xe3\x78\x19\xd7\x78\x02\x17\x62\xcf\x89"
"\x5a\xbe\xac\x11\x25\xb7\x44\xc8\xb8\x22\x5a\x09\x1e\x7b\xe9\xde\xd9"
"\x99\x3c\xfa\x3c\xa9\xab\xb8\x3e\x25\xc8\xf5\x59\x00\x99\x77\xa2\xed"
"\x93\x74\xa8\x96\x19\xfa\xe5\xef\x6d\x16\x4b\xb7\x3d\x24\x20\x04\xdc"
"\x84\x28\xe4\x46\x89\xb3\x3e\xe3\xbb\xe8\x8b\xb4\x96\x2a\xb0\xa3\x2a"
"\x90\xe7\xae\xa0\x44\xf0\x84\x10\x75\x2c\xb2\xd7\xae\xaf\x31\x96\x64"
"\x8a\x3a\x99\x09\x26\x65\xb4\x78\xbb\x39\x4b\x48\xf7\x9b\x36\xdb\x0e"
"\xfc\x7f\x50\xd6\xa5\x17\x9c\x94\x5f\x52\x98\xcf\xaa\xc5\xe5\xde\xa7"
"\x15\x29\x6f\x92\xab\xce\x72\x81\xd4\x8a\x0c\x9c\x6b\x78\x5a\x35\xef"
"\x5f\x16\x97\xc0\x47\xdd\xb2\x54\xfe\x9a\x8a\xb9\xf4\x98\xb0\xc1\xae"
"\x09\xff\xd0\x1a\x3d\x8d\x42\x7f\xee\x7e\x36\xc5\x1e\x0e\x5c\x2f\xee"
"\x22\x45\xfb\x84\x64\x62\x6a\xb5\xc9\x85\x7e\xbc\xe9\x1f\x7d\x22\xbf"
"\x02\x4d\x10\xc2\xdf\x10\x21\xcd\x69\x26\x84\x72\xde\x41\x9e\x6c\xef"
"\xd9\x70\xcc\x3a\x8e\x4d\x1b\xbe\x64\x96\x79\x9a\xa7\xf1\x00\x41\x17"
"\x66\xe7\x12\xaf\xf0\x8b\x73\x14\x60\xf1\x4f\x9d\x73\x56\xdb\x12\xcf"
"\x8e\x1c\x61\x21\x96\x8d\xc6\x8b\x1d\x81\xc0\x86\xb3\x25\xca\x4c\xe6"
"\xfe\x1f\x47\x67\x07\xe0\x8f\xa9\x13\x14\x4b\x75\x7c\x6b\xe1\x7c\xf9"
"\x31\x50\xdb\x29\x54\x4d\x20\x7f\x09\xa8\x96\xf3\x3b\x73\x35\xd9\x33"
"\x92\x15\xda\x75\x1e\x7a\xf2\xc6\xbd\xd1\x9d\xb6\xf5\x21\xaf\x2c\x8a"
"\x59\x98\xdc\x60\x7f\x97\x02\x6d\x07\x11\x14\x88\x74\x11\x34\xc1\xc8"
"\x6e\xba\x12\x32\x73\xd1\xfd\x5e\xe4\xb4\x71\xe8\x6f\x9a\xe9\x47\x8a"
"\x04\xc7\x48\x20\x76\xab\x34\xa1\xec\xa5\xc6\x4f\x89\xe5\x10\x6e\xed"
"\x44\xbc\xee\xc0\x19\xc6\x7c\x12\xfb\x4d\xb4\xfd\xac\x15\x3f\x4a\xc3"
"\xb6\x3f\xfe\xb6\xd3\x0d\xe5\x8e\xc0\x39\xe2\xdd\x3c\x18\x1e\x25\x4c"
"\xd9\x4d\x0a\x2b\x0b\x44\x49\x03\x84\xcc\x59\x15\xb5\x4e\xe1\xdb\x2b"
"\x6d\x05\x98\x79\xbf\x81\x26\xc9\xca\x97\x6d\x0f\x78\x62\xda\x07\xec"
"\xd3\x50\x93\x0a\x08\x18\x10\xa7\xaf\xd7\x2b\x2a\xd3\xf6\x5b\x96\xae"
"\x9c\x7f\x91\x22\x7a\x2b\x55\x13\xa5\x59\xf3\x6b\x90\xfe\x01\xbe\x9a"
"\xe5\xad\x3c\xa6\x5e\x2c\x26\xf3\x58\xfc\x26\xb8\x58\xa3\x63\x3f\xda"
"\x7a\xe4\x9a\x5f\xb7\x05\x22\x0a\x58\x19\xb3\xcc\xa4\x1b\x1c\xcc\x21"
"\xd7\xc4\x0f\x5f\xa9\xc4\x22\x28\x8e\xfa\x53\x94\xe4\x31\x26\x75\x89"
"\x9d\x70\x4a\x2a\xab\x62\xb8\x36\x3f\x58\xfd\x4b\xc1\x2a\x8b\xea\x6f"
"\xfc\x45\xb4\x41\x42\x37\xbf\x5f\x01\x93\x21\x20\x6d\xbb\xa4\x39\xac"
"\xb5\xef\x26\x64\x1f\x30\xfd\xac\x20\xf9\x64\x35\x4b\xce\x94\xe4\xc9"
"\xd7\x3e\x13\x7f\x98\x06\xde\xef\xaf\x6f\x4a\xca\xa0\xe7\x6a\xd4\xfe"
"\xf9\xf6\xcb\x7f\xc0\x1b\xba\xbd\xa9\x61\x2c\x05\xad\xbe\x46\xaf\xcf"
"\x94\x81\x9e\x8a\x4b\x4b\x49\xff\x76\x47\x84\xfa\x43\x2d\x47\xfb\x6d"
"\x42\x30\x90\x00\x43\xd1\xb4\x52\x1c\xd6\x83\x9f\xe8\xc5\xdf\x4d\x18"
"\x99\xfd\xfb\x13\x88\x0e\x20\x7c\xac\x73\xf0\xa2\x90\x20\xbd\xd5\x63"
"\xbd\x9c\x2f\x6b\xcd\x1e\xc5\x23\xb3\xe0\x3e\xbf\x61\x64\xfc\x65\xaf"
"\x00\x18\x30\xc5\x13\x96\xf9\xdf\x2d\x34\x6f\x83\xa5\x9c\xfc\x82\x20"
"\x1c\xf1\x15\x0e\xa5\x72\x59\xd5\x79\xfc\x2e\xd1\x99\xb3\xfb\xe4\x2d"
"\x51\x88\xc8\x4e\x43\x54\x61\x07\x43\xe5\xb2\x3a\x26\x52\x46\x31\x3c"
"\xc6\x39\x13\xf1\x74\x12\xfa\x00\xd9\x8b\x37\x9b\x80\xb9\x6d\x93\x69"
"\x69\x57\x2e\x11\x31\x6b\xc8\x92\x6c\xb2\x31\x15\x18\x6f\x3b\x23\x87"
"\xb8\x2c\x38\x98\xfa\x41\xbf\x16\xa3\x08\xda\x62\xd5\xa3\xeb\x36\x09"
"\xaf\x19\x43\xfd\xdd\xe0\x8a\x40\x36\xeb\x2a\x41\xb7\x29\x2c\xaa\xd9"
"\xeb\x08\x26\x14\xb0\x2a\x1f\xa2\x55\xbc\x7a\xbd\x4d\x0e\x3b\x4e\xc1"
"\x80\x1e\x13\x1e\x68\xc7\xaa\x9d\xa1\xa0\xff\x10\xf9\xde\x87\xde\xc8"
"\xfa\xd1\xad\x8b\xfa\x99\xca\xa4\x9e\x20\x3a\x7b\x9c\x33\xe0\x44\xd4"
"\x54\x4a\x53\x74\x71\xe7\xa4\x52\x46\x8b\x82\x19\x59\xbc\x48\x8c\x6b"
"\x8c\xbf\x81\xe9\x00\x81\xa2\x6d\xe2\x73\xad\x12\x03\xcc\x06\xad\xb6"
"\xaf\x24\x2a\xb1\x9f\x96\xc1\xc6\x6b\x58\xc3\x7e\x2c\x93\x09\x70\x4f"
"\xba\x63\xaf\x99\xa8\xd9\xc5\xef\xc6\x51\xaf\xb6\x31\xfe\x9f\x54\x6b"
"\x93\x8c\xc3\xb8\xe5\x26\xc4\x15\x9e\x5c\x9f\x7a\xfb\x29\xfd\x1d\x55"
"\xfa\xbf\x09\x36\x7c\xe2\xa6\x3a\x35\xe7\xa2\x06\x2d\x1c\x77\x2e\xd9"
"\x81\xfd\x77\x15\x7a\x84\x7f\x68\x7a\x17\x7c\xf9\x88\x6c\xe4\x1d\xf8"
"\xcc\x50\x93\x02\xb4\x6b\xc1\xe2\xba\x89\x6b\x1c\x16\x56\xa1\xbb\xfd"
"\xf4\xcd\x9a\xc3\x9c\xf8\x51\x0d\x1c\x82\x30\x75\xf1\x65\x50\xfd\x04"
"\x4a\xac\xc8\xd4\x2a\x56\xf0\x37\x18\xf7\xb1\x84\x75\xcd\xc3\x99\x9f"
"\xae\xb2\x5a\xb3\xdd\x8a\x80\x7e\xe0\x4d\x8e\x5d\x83\x1d\x08\xb4\xe3"
"\x09\xdf\xf5\x03\x30\x68\x51\x38\x79\x7e\x10\xc6\x36\x26\x36\xf5\x3f"
"\x22\xbf\xc1\xf3\xd5\x09\x0a\x5d\x36\x92\x82\xd9\xde\x36\xbb\x4e\x25"
"\x05\x41\x1c\xcc\x6e\xa3\x95\xaf\xa1\x56\x7b\x15\xa2\xfb\x4b\xe2\xad"
"\xee\xa7\x12\x6b\x1a\x8e\x80\x03\x41\x05\xe0\xd9\x8b\xdd\x78\xe7\x96"
"\xce\x1c\xdc\x06\xa4\xae\x66\x6f\xc0\xba\xec\x5c\x52\x61\x43\x40\xed"
"\x99\x76\x73\xe2\x6e\xc4\x7c\x88\x84\x6c\x00\x0b\xb7\xc9\x07\x73\x37"
"\xcd\x44\xf5\xc0\x41\xfd\xcc\x64\x98\x6e\x5e\x1c\x0f\x48\x81\x48\xf0"
"\xee\x6f\x84\x2c\x44\xc0\xb7\x2e\x82\x10\x92\x70\x34\x1b\xba\x6e\x90"
"\x80\xb7\x0f\xcf\x93\x0d\x0f\x10\xbe\x5a\x36\x79\x8e\x70\x11\x1f\xed"
"\x72\x72\x7b\x72\x28\x2f\xf1\x64\xfc\x08\x31\x9d\x74\xf1\xf5\x7c\xde"
"\x71\xb5\x7c\xb3\x97\xa9\xe7\x53\xf8\x7b\x97\x72\x9b\xaf\xba\x01\x7a"
"\x24\xcb\xfd\xee\x5d\xfe\x7f\xc2\x96\xc1\x12\xe9\x3b\xb8\xfc\xe5\x60"
"\xca\x80\xa3\xaf\xd8\x37\x0b\xaa\xa7\x9a\xd7\x83\xb5\x13\x52\xb5\x44"
"\x0b\x14\x4a\x47\x37\x8c\x9a\xe2\x2e\xda\x57\x94\x32\x8e\x95\xbc\xca"
"\x22\x0f\xd0\x7b\xb5\x69\x15\x52\x9b\x15\x5c\x61\x85\x8e\xfe\x89\xad"
"\x36\xa7\x92\x88\xe7\x4c\x0e\x25\x1a\xdd\xcf\xaf\x79\x74\x32\x17\x5a"
"\x55\x62\xb4\x6e\xff\x5e\x3a\xeb\xeb\x74\x62\x3e\x18\xbe\xef\x85\x38"
"\x93\x83\xc6\x04\xd8\x88\x44\x31\xb0\x7d\xc4\xbe\xa0\x17\x4a\xad\xc3"
"\x37\xff\x41\xf5\x58\xa6\x3f\x16\x69\x0f\xea\xe4\x7e\xfa\x2a\x5d\x13"
"\x18\xb7\x39\x7e\x1e\x4b\xa3\x98\x72\x7d\x28\x67\x91\xb7\x16\x10\xe1"
"\xd7\x8d\x32\x80\x0e\x7e\x11\x3c\x12\xab\xf0\xf6\x0b\x6c\xa4\x40\x1e"
"\xcd\x23\xb7\xaa\xcd\x99\x06\x33\xb2\xb0\x17\xda\xf6\xbf\xef\x1b\x23"
"\x61\xec\xe7\x4b\x7d\xbc\xbb\x1a\x73\xd4\xbc\x1f\x9d\x2e\x5c\x9f\xb0"
"\xb7\x98\x0d\x25\xcc\x44\xd1\xb1\x0c\x09\xef\x5a\x6a\x05\xc8\x46\x69"
"\x29\x4a\x5c\xad\xf0\xcd\x88\xab\x44\x9f\x9f\x0b\xcd\xd8\xc4\x85\x90"
"\xd4\x16\xc5\xc1\xfe\xaa\x49\x4a\x21\x45\x94\x9c\x2a\x33\x73\xdf\x7c"
"\x60\x14\x22\x5f\x27\x45\xbb\xeb\x20\xff\x29\x4d\x22\xc0\xd9\x6c\xa1"
"\x11\xe6\x92\x69\x46\x20\x7c\xab\x56\xa0\x31\x62\xa4\x9e\x68\x96\x8e"
"\x39\x8f\x70\x69\x01\x88\xee\x3c\xa8\x47\xef\x42\x17\x42\xd6\x0b\x9a"
"\x6a\xd0\x29\xe8\xa3\xd6\x07\x95\x0b\x2b\xf8\xad\x8f\xf2\x97\xcb\x39"
"\xac\xc9\x49\x05\x63\x57\x70\x43\x6e\x13\x44\x35\xe2\x82\x05\x14\x03"
"\x31\xb5\x10\x0d\x9f\x64\x46\x97\x92\xff\xfa\xc8\x7b\xca\x08\x35\xcb"
"\xc6\x17\x44\x6f\xf8\x6a\x7b\x50\x41\x8c\x30\x5f\x32\xe6\x58\xb3\x21"
"\x30\xe4\x91\xe3\x87\x09\xfd\x36\x97\x01\x7a\xc8\x08\x4c\xdf\x1e\xd8"
"\x1a\x28\x37\x5a\xed\x09\x2a\xb4\xe3\x2c\xa8\x8a\x93\x31\x54\xdd\x3a"
"\x9e\x99\x35\x1a\xcb\xad\xa9\x26\xb6\x7b\x31\x0c\x70\x70\xac\x1a\x41"
"\x4a\x28\xc5\xab\xfe\x1f\x45\x47\x62\x49\xa1\x2f\x18\xca\x2d\x98\x15"
"\x28\xd8\x81\xed\x3c\x50\x72\xe4\x6a\x6e\xff\x3c\xdf\x37\xdc\xbc\x89"
"\xc7\xf7\x9c\x88\xa1\xf8\xd1\x5d\x15\xbe\xb6\x6a\x0e\x44\x40\xc7\xb9"
"\x3e\x37\x9c\x4e\x2b\xac\x1d\x5c\x8e\x85\xf1\x85\x28\x87\xe2\xcf\xeb"
"\x17\x8f\xba\x1c\x67\xdc\x2a\xdb\x0c\x87\xdf\x8c\xa4\x44\x4c\xa7\xf4"
"\x55\x50\x9f\x49\x2e\xff\xb5\x00\x13\x28\xb8\xcc\x69\x6e\x29\x33\x20"
"\x7a\x2d\x78\xbb\xce\x85\x62\xca\x34\xa2\x48\x19\x3c\x91\x44\x06\xb1"
"\x61\xc8\x14\x14\x79\xd8\x91\xb0\xc6\x11\x0e\xc1\xe2\x5c\xad\x38\x29"
"\x9b\x48\x9f\x2e\xc4\x37\x01\x7c\xad\xba\x67\xdc\xb5\x8a\xbd\x49\x33"
"\xc9\x5b\x35\x26\xf1\xd4\x74\x7b\x87\x01\xa7\xd7\x1e\x44\x6e\x4b\x62"
"\xe2\x94\x1d\x42\x81\xfa\xca\x0c\xf2\x29\x14\xbe\x5a\xad\x80\xf4\x71"
"\x00\x00\x00\x00\xce\xb2\x4e\x82\x50\x8f\xe5\x5a\x92\xfb\x6d\xb7\x0d"
"\x03\xd1\xc1\xec\x09\xcf\xee\x31\x63\x93\x41\x75\x6a\x46\x30\xa0\xea"
"\xae\xca\xc7\xbf\xbd\xdf\x9d\x30\xc4\x2c\xbd\x45\xeb\x18\x1d\x5b\xd3"
"\x41\x30\x7a\xd2\x6f\x49\x6b\xb0\x42\xe2\xb6\x55\xc0\x3a\xc3\xdc\xc5"
"\x87\xac\xbf\x50\xf7\x9b\x5c\x23\x9b\xe9\x93\x8b\x62\xd3\x25\x1b\x19"
"\x9f\x84\x13\xb0\x20\x60\x5d\x5d\x05\x52\xcf\xd9\xc3\x9c\x91\x32\x71"
"\x9d\x6d\x0a\x32\x6b\x00\x0e\x12\xfc\xb5\x1b\xc2\x74\xdf\x79\xd1\x14"
"\x30\x06\x0d\x05\x97\x8c\xdd\x50\x58\x3f\x1b\xca\x82\xc5\x7d\xbe\xe6"
"\x05\xe2\xd0\x0f\xcb\x54\x14\xaf\x13\xa5\x96\xd3\x5c\xb5\xba\x62\xde"
"\x6a\x28\xcb\xcc\xc8\x57\xd2\x35\x47\xb1\xc7\xfd\x5a\xc8\xfb\xf6\x75"
"\x8d\x5b\x84\x51\xfa\x46\xd9\xac\xc0\x03\x44\xdc\x2e\x56\x56\x74\xb1"
"\xdd\x35\x47\xeb\x8f\x8a\xa5\xff\xf9\x90\x42\xf8\xd1\xd5\x9e\x6a\xd2"
"\xf5\x33\x79\x21\x1e\x68\x32\xfc\xb6\x8f\x57\x77\xeb\x2d\xb8\x5b\x28"
"\xf7\x24\xf4\xe4\xce\x63\x42\xcf\x55\x71\x3f\xf7\xb0\xcb\x4f\x7f\x47"
"\xdd\x12\xa6\x56\x6b\x86\x70\x9e\xae\xfa\xe0\x24\x37\x32\x67\xce\x72"
"\xa8\x9e\x7f\x3e\x42\xab\x48\xed\xcc\xcc\x96\xb5\xd0\x40\x3f\xe9\x3a"
"\x92\x7e\x5c\xcf\x47\x00\x14\xf2\x20\xb8\x25\x73\x93\x22\x6c\xd7\xb9"
"\x96\xf2\x0e\x6a\x34\xf8\x12\x06\x73\x3a\x9f\xdc\xe0\x3b\x70\x19\x43"
"\xc1\xb5\x60\xd3\xea\xb6\x8c\x2c\x22\x5c\xf7\xf7\xf2\xb5\x61\x23\xbe"
"\x2b\xb1\x73\xe9\xe5\xb3\x7f\x4d\x33\x48\xf6\xb9\x87\x76\x4a\xd0\x7c"
"\x2a\xcd\x44\x51\x4f\xf2\x64\xd7\xed\xa3\x1e\x5e\x51\x7a\x17\x94\x14"
"\x84\x1a\xd4\x55\x3d\x51\xc0\x8f\x43\x5e\x05\xf1\x0a\xa8\x2d\x74\xb9"
"\x7a\x9b\xa3\xa1\x33\xe6\xc9\x17\x5f\xdc\xd4\xf3\xdc\x9c\x16\xd3\xbe"
"\x1d\x5b\xba\xf1\x32\x40\x17\x70\x81\xac\x1d\x56\x68\x1b\xfa\x98\x8a"
"\x93\xaf\x09\x86\x8a\xfd\x60\x85\x20\xc0\xbf\xd7\x1d\x85\x7a\x66\x61"
"\xfd\xaf\x6f\x2e\x16\x69\x87\xeb\x00\x74\x49\xdd\x26\x33\x4a\xe9\x32"
"\xc5\x00\x3f\xef\xc0\xf9\x83\xb9\xe4\x9c\xbf\xce\xa3\x25\xf2\xde\x16"
"\xa9\xae\x93\x5c\xaa\x46\xf5\xb3\x43\x39\x57\xfb\x37\x09\x71\xed\x95"
"\x7f\x13\x8f\x08\xa6\x0f\xed\x5b\x84\x99\x5e\x42\x8e\x7a\xe7\xd5\xc2"
"\x20\x21\xff\x01\x6b\xae\xf0\xe7\x13\xa1\x18\x34\x4c\x01\x6a\x99\xad"
"\x46\x93\x13\xba\x7f\x24\x52\xda\x0d\xd8\x2e\x01\x9f\x64\xaa\x22\x9c"
"\xf8\x0a\x69\xb3\xe0\x8a\xc5\x84\x7f\x10\xd2\x47\x17\x98\x55\x54\x63"
"\x13\x23\x2f\x23\xe0\x55\xc2\xf7\x4e\xce\xf1\x4e\x0f\xdc\xc2\x9a\x9b"
"\xf0\x97\x6f\xbb\x24\x9b\xd5\xc7\x90\x31\x83\xd2\xa5\x3c\x70\x96\x0a"
"\x18\x36\x30\xe7\xd4\x92\x8d\xaa\x70\x91\xa8\x5a\xd9\x87\xd2\xa4\xa5"
"\xb8\xf6\xbe\x66\x12\xfa\x72\xd9\xfb\xb3\x3c\x67\xbb\x38\xef\xf1\x9f"
"\x2e\x78\x4f\x94\xe0\x35\x4c\xf6\xd3\x5a\x5b\x2c\x62\x23\x3c\x03\x9d"
"\xe3\x73\x4b\x38\xe9\x7e\xc7\x2b\xd6\x73\xfe\xf0\x9f\xd5\x6f\xec\x32"
"\x98\x18\xcc\x68\xcd\xf1\x2c\xb5\x2f\x7d\x37\xa8\x35\x0c\x16\xe9\x42"
"\x08\x88\x0b\xfc\xd3\xe8\x95\xd7\xaa\x44\x89\xe3\xdd\x15\xdb\x4a\x90"
"\x26\xf0\xd2\xa4\x6f\x1e\x89\xc3\x58\x45\xdb\xd9\x76\xa1\x99\x2b\x87"
"\xc1\x5a\x0c\x75\x80\xe6\x42\x4b\x87\x92\xa7\xbb\x7b\x93\x3d\x7c\x54"
"\x33\xd4\x13\x3b\xa4\xdb\xbc\xf7\x99\x5d\x6e\xd3\xfe\xaa\x32\xf8\x76"
"\xa2\x87\xfe\xeb\x9c\xc6\x10\x77\x78\xc1\xf8\x3e\x01\x19\xd9\x80\xb9"
"\xe9\x94\xc2\xa3\xae\x3d\xe2\x4a\x10\x3e\xfb\x3c\xac\xb7\x46\xb4\x9d"
"\x1a\xd8\x57\x46\xb2\x33\xab\x4a\xaf\x0e\x98\x8e\xc2\xa7\x86\xbc\x93"
"\xf3\x20\x40\xd3\xbd\xc3\x00\x80\x31\x63\x4c\xdf\xde\xd5\xac\x95\xb2"
"\x27\x9e\x09\x62\x43\x22\x82\x96\x59\x1e\x7b\xa5\x3c\x4a\x12\x77\x72"
"\xcc\x46\x20\xe6\xb2\x38\xcc\xad\x25\x06\x29\x19\x45\x33\xd0\xa6\x69"
"\xff\x33\x66\xc5\x2d\x64\x92\x86\x93\xe0\xb0\xcb\xb0\xb8\xe2\xc6\x02"
"\x90\x89\xd4\xdf\xe2\xb4\xb6\xc5\xdc\xd8\x5f\x1a\x02\x77\x06\x11\xe6"
"\x50\x01\xe4\x8a\x32\xa8\xb0\x43\x1a\x3b\x9d\x77\xfa\x3a\x95\xbe\x38"
"\xa0\x43\x6a\x70\x4c\x05\xa8\xe0\x18\x3f\x32\x14\xc2\x55\x31\xa6\x37"
"\x96\xf6\x79\xbf\x72\x88\x5a\xa7\x66\x46\x8d\x42\xb2\x54\x35\x42\xd7"
"\xe8\x25\x44\xef\xc5\xc5\xe8\x1e\x6a\x91\xa0\xf5\xd4\xe6\x80\x00\xcf"
"\xf6\x87\xd6\x3e\x45\xc9\xa1\x1d\x4e\xf5\x15\x05\x0d\xaa\x59\x2c\x9a"
"\x82\x8a\xc7\xc0\x48\x8e\x7c\xdb\x3d\x6f\xda\xef\x5e\x91\x76\xee\x68"
"\xd9\x81\xea\x50\xd3\x86\xd7\x4d\xf3\xb4\x06\x60\x35\x17\x36\xde\xb0"
"\x3b\xfc\xeb\x72\x18\x78\xcf\x98\x94\xb0\x30\x2d\xf1\x59\x64\x24\x2a"
"\xb6\xb9\xf7\x7f\x98\xba\x1c\x79\x93\x73\x59\x83\xd2\xb0\x22\x60\x0a"
"\xb7\x4a\x19\xe3\x63\x6e\x14\x00\xd0\x8b\xa4\x5d\x3a\x5c\x27\x74\xcb"
"\x06\xa1\xc3\x58\xbb\xfc\x11\xd2\x7e\xfa\xf7\xca\x53\xc2\xe7\x75\x7c"
"\x8c\x76\xda\x24\x70\x7d\x91\xa4\xa5\x24\x42\x62\x89\x8d\x68\x08\x3f"
"\xf9\x1c\x51\x4d\x9b\x9b\x1e\xba\xa0\xcb\x0b\x10\x25\x4f\xda\x1b\x1e"
"\x82\xb9\xa1\xa4\x7f\x11\x7b\x5b\x28\x0d\xdb\xec\x1f\x67\x32\xd1\x11"
"\x17\xef\x1a\x7a\x67\x46\x99\xdf\x87\xfe\x79\x5d\x12\x43\xcb\x9c\x45"
"\x27\xe3\x64\xe2\xb7\x11\xb6\x56\x2a\x87\xfa\xfc\x13\x0c\xe0\xba\xf1"
"\x70\x16\x86\x63\x9b\x05\xf0\xc8\xdc\x70\x8f\x00\x8b\x1e\x6a\xb8\x9e"
"\x8d\x62\x3b\xb8\x3f\x3d\x54\xb7\xbc\xdb\xda\xcd\x05\x5a\xc4\xec\xcb"
"\xd3\x6b\xbe\x0a\xf0\xf6\x5a\x00\xe3\xd6\xdd\x98\x5a\xe8\x85\x1d\x17"
"\x69\x76\xcf\xb5\x81\x6d\x1f\xc2\xa6\x3d\x35\x46\xae\xca\xa4\xe7\x12"
"\xca\x69\x61\xd1\xf1\x81\x31\x5d\x55\x3d\xe6\xb5\x34\x85\xfa\xed\x0d"
"\xcf\xcf\x81\x9a\x1b\xa3\xba\xdf\xfe\x79\x73\x77\xd3\xd1\xdd\xae\xd8"
"\xe7\xa0\xac\xc0\xc3\xd2\x77\x76\x22\x62\xa1\x39\xf9\x4d\xe4\x9f\xac"
"\xa1\x67\xb1\x1b\xf0\x4f\x21\x04\xa5\xab\x9a\x73\x36\x7a\x64\x61\xf7"
"\x12\x4c\x91\xa2\xc4\x22\x9e\xf9\x8e\x6e\xbd\xe9\xaa\xc2\x83\xc7\xd0"
"\x29\x40\x0d\x71\x29\x3f\x48\x8b\xa1\x69\xb6\x2c\x1e\x94\x68\x9c\xf5"
"\xb2\x48\xed\x4a\xea\x62\xb8\x8d\x65\xbb\x76\x4c\xfe\x27\xd5\x23\x1a"
"\x58\x48\x6e\x73\x81\xdf\x51\x8f\x4e\xd8\x1c\xb9\x05\x10\x8c\x54\xa5"
"\x05\x0a\x94\xca\x0e\x94\xda\x20\xd3\x79\x4b\xc5\xfa\xb9\x12\x7d\xc9"
"\x5b\x64\x04\xb1\xe2\x7b\x4e\x28\x13\x6f\xc2\x78\x06\xf7\xbe\x79\x84"
"\x44\xc3\x3a\xca\x88\xff\xd4\x5b\x86\x0e\xba\x0d\x50\x33\x83\x9f\x5a"
"\x09\x28\x63\x95\x46\x04\xf1\x95\x2b\xd6\x1d\xad\x23\xb1\x16\x43\xfe"
"\x14\xf3\xad\xe0\x81\x16\xaa\x2c\x13\xee\xe7\x01\xcc\xd1\x3e\x50\x6b"
"\xd6\x5a\x10\x60\xbf\x69\x57\x9a\xea\x8c\x81\x43\xcd\x38\xc0\x89\x1a"
"\x30\x65\xf2\x51\xeb\xa0\xc2\x0a\xb9\xc6\x9d\xdf\x28\xe3\xbd\x64\x00"
"\xcc\x20\x3b\xac\x8d\xe1\x88\x22\x39\xad\x4e\x1b\x97\xb0\xae\x2f\x1a"
"\xbb\x7b\xac\x7c\x0d\x8e\xf8\x2b\x97\xeb\xfb\x1f\x55\x77\xf0\x6a\x3a"
"\x13\x77\xb0\x9a\xda\x4d\xb8\x7d\x34\x2f\x20\xab\x0e\xca\x4b\x9c\x20"
"\x60\x42\x47\x13\x07\x51\x14\x29\xcb\x57\xa5\x78\x21\x1f\x92\xd3\x64"
"\x71\x89\x86\x1c\xad\x91\x45\xf5\xeb\x26\xab\x69\x6a\xbe\x50\xa2\xa6"
"\xc1\xb4\x69\xdf\x97\xda\x28\xab\xa4\xe7\x9b\x58\x6c\x34\x8a\x43\x0f"
"\x5e\xa6\x1c\x4b\xe1\x03\x2f\xa6\x1d\x18\x58\x1f\x05\xa0\x7f\xb8\x70"
"\x7c\x89\x96\xe0\xff\xf1\xc3\xed\xa5\x9b\x99\x26\x87\xfa\x12\x48\x3b"
"\x93\x27\xe1\x02\x24\xb2\x0d\x42\xe8\xb3\xfc\x46\x70\xbf\x07\x0c\xed"
"\x60\x22\x83\x27\x3d\x68\x18\xac\xd1\xf6\xda\x56\x7c\x44\xd3\xf5\xe1"
"\x37\x70\x65\xd4\x3d\x87\xd8\x89\x84\x3a\xe4\x8e\x7f\xa8\xba\x16\x34"
"\x81\x56\x95\xb8\xc4\x80\xca\x27\x1e\x6e\x83\x37\x99\xc7\x0d\xa8\x0f"
"\xd7\x9a\xcc\x09\xb9\x89\x66\x7a\x22\x94\xde\x5d\xa7\x3f\x03\x63\xdf"
"\x9a\x33\xad\x4d\xab\x8d\x27\xcf\x7b\xed\x0a\x06\x83\x86\x72\xe3\xd0"
"\x7d\x52\xb6\x39\x6e\x9b\x55\x76\x02\x1d\x5e\x92\x5a\xbd\x53\x3b\xf1"
"\x61\xc9\x44\x79\x50\x65\xfd\xd4\x4e\x84\x62\xe3\x07\x0c\x47\x9f\x1c"
"\x11\x82\x76\x65\x34\x88\xdd\x9b\x2f\x1a\x67\x3f\x8c\xad\x36\x12\xca"
"\x1f\xab\x43\x88\xec\x9c\x8f\x83\x4a\x01\xa4\x99\xad\xb7\xb3\xa9\xa9"
"\x77\x67\x2f\x6d\x75\xb4\x1b\xbd\xd7\xf9\x1c\xeb\x7e\x7a\x88\x56\x8d"
"\x17\xbb\x43\x2b\xe9\xe4\xe9\x6e\x11\x50\x75\xbc\xe1\x97\xef\x47\x54"
"\xd2\x91\x4c\x2c\x59\xe2\xd7\xf4\xc0\x8f\x0d\xbe\x34\xd3\x1f\x22\x94"
"\x28\xf2\x11\xbf\x1d\x7e\x8f\x5c\x31\x9e\xd4\xa8\x27\x3c\xb6\x25\x5e"
"\xb3\x18\x85\x1a\xc4\x55\x7b\x02\x78\xfa\xc6\x31\x07\xa5\x4d\x40\x7c"
"\x42\xf3\x00\xb8\x43\xa1\x2a\xbd\x3b\x89\x3b\x46\xc7\xef\xac\x2e\x38"
"\x8a\xb4\x2b\x87\xae\xbe\x25\x43\xbd\x4c\x15\xf4\x59\xbc\x50\xaa\xd1"
"\x0f\xfe\x1c\x11\x96\xfb\x52\xc2\x6e\x54\xbd\xaa\x7f\xbd\x52\x45\x1f"
"\x20\x7f\xfb\x07\x3e\xf4\xb3\xf7\x1e\xed\xd7\xda\x40\xc8\x95\x05\x01"
"\x97\x39\xe3\xfa\x73\x3b\xcd\xc8\x4f\xf4\x91\x9e\x8f\xe2\x35\x81\x29"
"\xef\x28\x29\x1b\xe1\xd6\x42\x6b\x8b\xaf\xe8\x84\x63\xb1\xd3\xcd\x72"
"\x73\x74\x53\x81\xc7\xf6\x52\x21\x89\x8e\x6a\xd3\x61\xe8\x8b\x24\xc5"
"\x4c\xcc\x7a\xc9\xa8\x30\x14\x5b\x6d\xc0\x96\xe2\xd7\x1e\xf7\x1e\xc4"
"\xf0\x35\x24\xcb\x87\x0b\x72\x4e\x08\xd2\x23\xbd\xec\x2f\x6f\xdd\xe6"
"\x20\x02\x17\xa1\x3b\x51\x36\x00\x4d\x45\x5d\x66\x54\x7f\x5a\x17\x93"
"\xe0\xca\xd8\x56\x77\xd4\x9e\x5c\x55\x88\x52\x10\x70\x07\xc8\x13\x68"
"\x12\xcf\x02\x1a\xfa\xf6\xf7\xe8\xf5\x98\x83\x37\x1b\xe4\x6c\xda\x41"
"\x2d\xd9\xc6\xfc\xf1\x87\xc3\x12\x52\xce\xb5\x75\x89\x01\xd3\x9c\xd5"
"\x35\x5a\xb3\x86\xd9\xa7\xfe\x6e\xa4\x6e\xbf\x27\x7a\xaf\x80\x9c\x30"
"\x23\x21\x1e\xa9\xaa\x18\x9d\xe4\xd4\x22\x08\x0e\xbb\x9f\xec\x50\xff"
"\xab\x6b\x95\xba\x4a\xe5\x01\x8a\xcc\xc4\x97\xe7\x91\x49\xed\x60\x47"
"\xce\x56\x1c\xcc\x10\xe9\x19\x4c\xdc\xcd\x5c\x9f\xb7\x51\x75\xc8\xdb"
"\xc9\xd0\xa9\x16\xad\x59\x28\x8f\x01\x0d\xef\xbb\xb5\x0d\x26\x30\x41"
"\xab\x37\xaa\xc0\xf9\x32\x53\xbe\xf6\xf8\x98\xcd\x08\x25\xd9\x9d\x27"
"\x22\x4f\x26\x18\x1f\x97\x13\xb8\x97\x9d\xa6\x47\x56\xc9\x5e\x75\x05"
"\xf2\x5a\x26\x88\x96\x0d\x61\x55\xc3\x61\x3d\xcc\x31\xb6\xc3\x37\xa6"
"\xdb\xfc\x6b\x12\xcf\xde\x1d\xb2\x2b\x93\xbb\xd5\xe4\x85\x34\xfb\x0b"
"\xda\x8b\x21\x25\x77\xa1\x4d\xcf\x66\x5c\x83\x4b\x0b\xd2\x4e\x5f\x62"
"\x4d\x24\x55\xfe\x04\x8d\xbe\x93\x03\x28\xd7\xcb\x63\x2d\xb3\xb0\xe2"
"\x44\xbb\x5d\x43\x39\x0b\x42\x0b\x15\x15\x7a\x33\x94\x87\xfc\x78\x97"
"\x6f\x86\x7d\x3a\x36\x1a\xaf\xdd\x3f\x50\xa9\x3c\x01\x88\x2d\xa7\xc2"
"\x20\x08\x9a\x54\x43\x81\xdb\x22\xe2\xc8\x6b\x22\x8d\xc2\xbe\x01\x82"
"\x04\x68\x46\x04\x37\x58\x89\x52\xa5\x49\xd3\x74\x98\xe5\x29\xe6\x2a"
"\xa6\x2b\xad\x15\x80\x54\x6b\xcb\x1e\x9a\x6e\xd1\x87\x0b\x78\x38\xd0"
"\x5d\x12\xf6\xe3\xa0\x41\xe7\x8b\x1b\xdb\x80\x89\x46\x26\xf2\x08\x89"
"\xcc\xb3\xa4\x68\xaa\x4f\xb2\x4b\x9c\x87\xcb\xb2\x86\x23\xce\x59\xc6"
"\xb3\xc6\x28\x6d\xb3\x66\xd0\x80\x04\x55\x1a\x25\xfe\x4d\x8d\x19\x4a"
"\x2b\xb7\xc5\x2e\x1c\x85\xa5\xfb\xe4\xcb\x15\xb1\x71\x48\x9d\xa1\x21"
"\xbe\xa1\xc4\x69\xa6\xbb\x18\x5d\x63\x21\x30\x84\xe3\xa8\x1e\xe5\x4d"
"\xc0\x3a\x94\xdc\x5e\xcd\xda\x7b\xfa\xad\x1d\xf6\x80\x21\xaa\xf4\x62"
"\x7c\x9d\x52\x9f\x13\xe5\xc8\x1b\x5e\xe4\xdd\x22\x89\x49\xca\x16\xb9"
"\xa6\x1d\x18\x62\x11\xd1\x53\x29\x44\x70\x90\x75\x57\xe5\xe1\x4a\xe6"
"\x65\x01\x3f\x28\x5f\xe4\xd3\x76\x6e\x7b\x3d\x8c\xe5\xe2\xa1\x46\x92"
"\x07\x2d\x4d\x8f\x79\x35\x4b\xcc\x8d\xb8\xa2\xa3\x6c\x8b\xcd",
8192);
*(uint64_t*)0x200069c0 = 0;
*(uint64_t*)0x200069c8 = 0;
*(uint64_t*)0x200069d0 = 0;
*(uint64_t*)0x200069d8 = 0;
*(uint64_t*)0x200069e0 = 0;
*(uint64_t*)0x200069e8 = 0;
*(uint64_t*)0x200069f0 = 0;
*(uint64_t*)0x200069f8 = 0;
*(uint64_t*)0x20006a00 = 0;
*(uint64_t*)0x20006a08 = 0;
*(uint64_t*)0x20006a10 = 0;
*(uint64_t*)0x20006a18 = 0x20002480;
*(uint32_t*)0x20002480 = 0x90;
*(uint32_t*)0x20002484 = 0;
*(uint64_t*)0x20002488 = 0;
*(uint64_t*)0x20002490 = 0;
*(uint64_t*)0x20002498 = 0;
*(uint64_t*)0x200024a0 = 0;
*(uint64_t*)0x200024a8 = 0;
*(uint32_t*)0x200024b0 = 0;
*(uint32_t*)0x200024b4 = 0;
*(uint64_t*)0x200024b8 = 0;
*(uint64_t*)0x200024c0 = 0;
*(uint64_t*)0x200024c8 = 0;
*(uint64_t*)0x200024d0 = 0;
*(uint64_t*)0x200024d8 = 0;
*(uint64_t*)0x200024e0 = 0;
*(uint32_t*)0x200024e8 = 0;
*(uint32_t*)0x200024ec = 0;
*(uint32_t*)0x200024f0 = 0;
*(uint32_t*)0x200024f4 = 0;
*(uint32_t*)0x200024f8 = 0;
*(uint32_t*)0x200024fc = 0;
*(uint32_t*)0x20002500 = 0;
*(uint32_t*)0x20002504 = 0x800;
*(uint32_t*)0x20002508 = 0;
*(uint32_t*)0x2000250c = 0;
*(uint64_t*)0x20006a20 = 0;
*(uint64_t*)0x20006a28 = 0;
*(uint64_t*)0x20006a30 = 0;
*(uint64_t*)0x20006a38 = 0;
syz_fuse_handle_req(r[0], 0x20000000, 0x2000, 0x200069c0);
break;
}
}
int main(void)
{
syscall(__NR_mmap, 0x1ffff000ul, 0x1000ul, 0ul, 0x32ul, -1, 0ul);
syscall(__NR_mmap, 0x20000000ul, 0x1000000ul, 7ul, 0x32ul, -1, 0ul);
syscall(__NR_mmap, 0x21000000ul, 0x1000ul, 0ul, 0x32ul, -1, 0ul);
do_sandbox_none();
return 0;
}
|
the_stack_data/49699.c | // Copyright (c) Microsoft. All rights reserved.
// Licensed under the MIT license. See LICENSE file in the project root for full license information.
#ifndef USE_EDGE_MODULES
//tryping to compile iothub_client_edge.c while the symbol USE_EDGE_MODULES is not defined
#else
#include "azure_c_shared_utility/gballoc.h"
#include "azure_c_shared_utility/xlogging.h"
#include "azure_c_shared_utility/constbuffer.h"
#include "azure_c_shared_utility/httpapiex.h"
#include "azure_c_shared_utility/httpapiexsas.h"
#include "azure_c_shared_utility/uniqueid.h"
#include "azure_c_shared_utility/shared_util_options.h"
#include "azure_c_shared_utility/crt_abstractions.h"
#include "azure_c_shared_utility/envvariable.h"
#include "parson.h"
#include "internal/iothub_client_private.h"
#include "internal/iothub_client_authorization.h"
#include "iothub_client_core_common.h"
#include "iothub_client_version.h"
#include "internal/iothub_client_edge.h"
#define HTTP_HEADER_KEY_AUTHORIZATION "Authorization"
#define HTTP_HEADER_VAL_AUTHORIZATION " "
#define HTTP_HEADER_KEY_MODULE_ID "x-ms-edge-moduleId"
#define HTTP_HEADER_VAL_MODULE_ID " "
#define HTTP_HEADER_KEY_REQUEST_ID "Request-Id"
#define HTTP_HEADER_KEY_USER_AGENT "User-Agent"
#define HTTP_HEADER_VAL_USER_AGENT CLIENT_DEVICE_TYPE_PREFIX CLIENT_DEVICE_BACKSLASH IOTHUB_SDK_VERSION
#define HTTP_HEADER_KEY_CONTENT_TYPE "Content-Type"
#define HTTP_HEADER_VAL_CONTENT_TYPE "application/json; charset=utf-8"
#define UID_LENGTH 37
#define SASTOKEN_LIFETIME 3600
static const char* const URL_API_VERSION = "?api-version=2020-09-30";
static const char* const RELATIVE_PATH_FMT_MODULE_METHOD = "/twins/%s/modules/%s/methods%s";
static const char* const RELATIVE_PATH_FMT_DEVICE_METHOD = "/twins/%s/methods%s";
// Note: The timeout field specified in this JSON is not honored by IoT Edge. See
// https://github.com/Azure/azure-iot-sdk-c/issues/1378 for details.
static const char* const PAYLOAD_FMT = "{\"methodName\":\"%s\",\"timeout\":%d,\"payload\":%s}";
static const char* const SCOPE_FMT = "%s/devices/%s/modules/%s";
static const char* ENVIRONMENT_VAR_EDGEHUB_CACERTIFICATEFILE = "EdgeModuleCACertificateFile";
typedef struct IOTHUB_CLIENT_EDGE_HANDLE_DATA_TAG
{
char* hostname;
char* deviceId;
char* moduleId;
IOTHUB_AUTHORIZATION_HANDLE authorizationHandle;
} IOTHUB_CLIENT_EDGE_HANDLE_DATA;
IOTHUB_CLIENT_EDGE_HANDLE IoTHubClient_EdgeHandle_Create(const IOTHUB_CLIENT_CONFIG* config, IOTHUB_AUTHORIZATION_HANDLE authorizationHandle, const char* module_id)
{
IOTHUB_CLIENT_EDGE_HANDLE_DATA* handleData;
if ((config == NULL) || (authorizationHandle == NULL) || (module_id == NULL))
{
LogError("input cannot be NULL");
handleData = NULL;
}
else if ((handleData = malloc(sizeof(IOTHUB_CLIENT_EDGE_HANDLE_DATA))) == NULL)
{
LogError("memory allocation error");
handleData = NULL;
}
else
{
memset(handleData, 0, sizeof(IOTHUB_CLIENT_EDGE_HANDLE_DATA));
handleData->authorizationHandle = authorizationHandle;
if (mallocAndStrcpy_s(&(handleData->deviceId), config->deviceId) != 0)
{
LogError("Failed to copy string");
IoTHubClient_EdgeHandle_Destroy(handleData);
handleData = NULL;
}
else if (mallocAndStrcpy_s(&(handleData->moduleId), module_id) != 0)
{
LogError("Failed to copy string");
IoTHubClient_EdgeHandle_Destroy(handleData);
handleData = NULL;
}
else if (mallocAndStrcpy_s(&(handleData->hostname), config->protocolGatewayHostName) != 0)
{
LogError("Failed to copy string");
IoTHubClient_EdgeHandle_Destroy(handleData);
handleData = NULL;
}
}
return (IOTHUB_CLIENT_EDGE_HANDLE)handleData;
}
void IoTHubClient_EdgeHandle_Destroy(IOTHUB_CLIENT_EDGE_HANDLE methodHandle)
{
if (methodHandle != NULL)
{
free(methodHandle->hostname);
free(methodHandle->deviceId);
free(methodHandle->moduleId);
//Do not free authorizationHandle for now, since its a pointer to something owned by Core_LL_Handle
free(methodHandle);
}
}
static const char* generateGuid(void)
{
char* result;
if ((result = malloc(UID_LENGTH)) != NULL)
{
result[0] = '\0';
if (UniqueId_Generate(result, UID_LENGTH) != UNIQUEID_OK)
{
LogError("UniqueId_Generate failed");
free((void*)result);
result = NULL;
}
}
return (const char*)result;
}
static HTTP_HEADERS_HANDLE createHttpHeader()
{
HTTP_HEADERS_HANDLE httpHeader;
const char* guid;
if ((httpHeader = HTTPHeaders_Alloc()) == NULL)
{
LogError("HTTPHeaders_Alloc failed");
}
else if (HTTPHeaders_AddHeaderNameValuePair(httpHeader, HTTP_HEADER_KEY_AUTHORIZATION, HTTP_HEADER_VAL_AUTHORIZATION) != HTTP_HEADERS_OK)
{
LogError("HTTPHeaders_AddHeaderNameValuePair failed for Authorization header");
HTTPHeaders_Free(httpHeader);
httpHeader = NULL;
}
else if (HTTPHeaders_AddHeaderNameValuePair(httpHeader, HTTP_HEADER_KEY_MODULE_ID, HTTP_HEADER_VAL_MODULE_ID) != HTTP_HEADERS_OK)
{
LogError("HTTPHeaders_AddHeaderNameValuePair failed for module ID header");
HTTPHeaders_Free(httpHeader);
httpHeader = NULL;
}
else if ((guid = generateGuid()) == NULL)
{
LogError("GUID creation failed");
HTTPHeaders_Free(httpHeader);
httpHeader = NULL;
}
else if (HTTPHeaders_AddHeaderNameValuePair(httpHeader, HTTP_HEADER_KEY_REQUEST_ID, guid) != HTTP_HEADERS_OK)
{
LogError("HTTPHeaders_AddHeaderNameValuePair failed for RequestId header");
free((void*)guid);
HTTPHeaders_Free(httpHeader);
httpHeader = NULL;
}
else if (HTTPHeaders_AddHeaderNameValuePair(httpHeader, HTTP_HEADER_KEY_USER_AGENT, HTTP_HEADER_VAL_USER_AGENT) != HTTP_HEADERS_OK)
{
LogError("HTTPHeaders_AddHeaderNameValuePair failed for User-Agent header");
free((void*)guid);
HTTPHeaders_Free(httpHeader);
httpHeader = NULL;
}
else if (HTTPHeaders_AddHeaderNameValuePair(httpHeader, HTTP_HEADER_KEY_CONTENT_TYPE, HTTP_HEADER_VAL_CONTENT_TYPE) != HTTP_HEADERS_OK)
{
LogError("HTTPHeaders_AddHeaderNameValuePair failed for Content-Type header");
free((void*)guid);
HTTPHeaders_Free(httpHeader);
httpHeader = NULL;
}
else
{
free((void*)guid);
}
return httpHeader;
}
static IOTHUB_CLIENT_RESULT populateHttpHeader(HTTP_HEADERS_HANDLE httpHeader, IOTHUB_CLIENT_EDGE_HANDLE moduleMethodHandle)
{
IOTHUB_CLIENT_RESULT result;
STRING_HANDLE scope;
const char* scope_s;
STRING_HANDLE moduleHeader;
const char* moduleHeader_s;
char* sastoken;
if ((scope = STRING_construct_sprintf(SCOPE_FMT, moduleMethodHandle->hostname, moduleMethodHandle->deviceId, moduleMethodHandle->moduleId)) == NULL)
{
LogError("Failed constructing scope");
HTTPHeaders_Free(httpHeader);
result = IOTHUB_CLIENT_ERROR;
}
else if ((scope_s = STRING_c_str(scope)) == NULL)
{
LogError("SasToken generation failed");
HTTPHeaders_Free(httpHeader);
STRING_delete(scope);
result = IOTHUB_CLIENT_ERROR;
}
else if ((sastoken = IoTHubClient_Auth_Get_SasToken(moduleMethodHandle->authorizationHandle, scope_s, SASTOKEN_LIFETIME, NULL)) == NULL)
{
LogError("SasToken generation failed");
HTTPHeaders_Free(httpHeader);
STRING_delete(scope);
result = IOTHUB_CLIENT_ERROR;
}
else if (HTTPHeaders_ReplaceHeaderNameValuePair(httpHeader, HTTP_HEADER_KEY_AUTHORIZATION, sastoken) != HTTP_HEADERS_OK)
{
LogError("Failure updating Http Headers");
HTTPHeaders_Free(httpHeader);
STRING_delete(scope);
free(sastoken);
result = IOTHUB_CLIENT_ERROR;
}
else if ((moduleHeader = STRING_construct_sprintf("%s/%s", moduleMethodHandle->deviceId, moduleMethodHandle->moduleId)) == NULL)
{
LogError("Failure updating Http Headers");
HTTPHeaders_Free(httpHeader);
STRING_delete(scope);
free(sastoken);
result = IOTHUB_CLIENT_ERROR;
}
else if ((moduleHeader_s = STRING_c_str(moduleHeader)) == NULL)
{
LogError("Failure updating Http Headers");
HTTPHeaders_Free(httpHeader);
STRING_delete(scope);
free(sastoken);
STRING_delete(moduleHeader);
result = IOTHUB_CLIENT_ERROR;
}
else if (HTTPHeaders_ReplaceHeaderNameValuePair(httpHeader, HTTP_HEADER_KEY_MODULE_ID, moduleHeader_s) != HTTP_HEADERS_OK)
{
LogError("Failure updating Http Headers");
HTTPHeaders_Free(httpHeader);
STRING_delete(scope);
free(sastoken);
STRING_delete(moduleHeader);
result = IOTHUB_CLIENT_ERROR;
}
else
{
STRING_delete(scope);
STRING_delete(moduleHeader);
free(sastoken);
result = IOTHUB_CLIENT_OK;
}
return result;
}
static IOTHUB_CLIENT_RESULT parseResponseJson(BUFFER_HANDLE responseJson, int* responseStatus, unsigned char** responsePayload, size_t* responsePayloadSize)
{
IOTHUB_CLIENT_RESULT result;
JSON_Value* root_value;
JSON_Object* json_object;
JSON_Value* statusJsonValue;
JSON_Value* payloadJsonValue;
char* payload;
STRING_HANDLE jsonStringHandle;
const char* jsonStr;
unsigned char* bufferStr;
if ((bufferStr = BUFFER_u_char(responseJson)) == NULL)
{
LogError("BUFFER_u_char failed");
result = IOTHUB_CLIENT_ERROR;
}
else if ((jsonStringHandle = STRING_from_byte_array(bufferStr, BUFFER_length(responseJson))) == NULL)
{
LogError("STRING_construct_n failed");
result = IOTHUB_CLIENT_ERROR;
}
else if ((jsonStr = STRING_c_str(jsonStringHandle)) == NULL)
{
LogError("STRING_c_str failed");
STRING_delete(jsonStringHandle);
result = IOTHUB_CLIENT_ERROR;
}
else if ((root_value = json_parse_string(jsonStr)) == NULL)
{
LogError("json_parse_string failed");
STRING_delete(jsonStringHandle);
result = IOTHUB_CLIENT_ERROR;
}
else if ((json_object = json_value_get_object(root_value)) == NULL)
{
LogError("json_value_get_object failed");
STRING_delete(jsonStringHandle);
json_value_free(root_value);
result = IOTHUB_CLIENT_ERROR;
}
else if ((statusJsonValue = json_object_get_value(json_object, "status")) == NULL)
{
LogError("json_object_get_value failed for status");
STRING_delete(jsonStringHandle);
json_value_free(root_value);
result = IOTHUB_CLIENT_ERROR;
}
else if ((payloadJsonValue = json_object_get_value(json_object, "payload")) == NULL)
{
LogError("json_object_get_value failed for payload");
STRING_delete(jsonStringHandle);
json_value_free(root_value);
result = IOTHUB_CLIENT_ERROR;
}
else if ((payload = json_serialize_to_string(payloadJsonValue)) == NULL)
{
LogError("json_serialize_to_string failed for payload");
STRING_delete(jsonStringHandle);
json_value_free(root_value);
result = IOTHUB_CLIENT_ERROR;
}
else
{
*responseStatus = (int)json_value_get_number(statusJsonValue);
*responsePayload = (unsigned char *)payload;
*responsePayloadSize = strlen(payload);
STRING_delete(jsonStringHandle);
json_value_free(root_value);
result = IOTHUB_CLIENT_OK;
}
return result;
}
static BUFFER_HANDLE createMethodPayloadJson(const char* methodName, unsigned int timeout, const char* payload)
{
STRING_HANDLE stringHandle;
const char* stringHandle_c_str;
BUFFER_HANDLE result;
if ((stringHandle = STRING_construct_sprintf(PAYLOAD_FMT, methodName, timeout, payload)) == NULL)
{
LogError("STRING_construct_sprintf failed");
result = NULL;
}
else if ((stringHandle_c_str = STRING_c_str(stringHandle)) == NULL)
{
LogError("STRING_c_str failed");
STRING_delete(stringHandle);
result = NULL;
}
else
{
result = BUFFER_create((const unsigned char*)stringHandle_c_str, strlen(stringHandle_c_str));
STRING_delete(stringHandle);
}
return result;
}
static STRING_HANDLE createRelativePath(const char* deviceId, const char* moduleId)
{
STRING_HANDLE result;
if (moduleId != NULL)
{
result = STRING_construct_sprintf(RELATIVE_PATH_FMT_MODULE_METHOD, deviceId, moduleId, URL_API_VERSION);
}
else
{
result = STRING_construct_sprintf(RELATIVE_PATH_FMT_DEVICE_METHOD, deviceId, URL_API_VERSION);
}
return result;
}
static IOTHUB_CLIENT_RESULT sendHttpRequestMethod(IOTHUB_CLIENT_EDGE_HANDLE moduleMethodHandle, const char* deviceId, const char* moduleId, BUFFER_HANDLE deviceJsonBuffer, BUFFER_HANDLE responseBuffer)
{
IOTHUB_CLIENT_RESULT result;
HTTPAPIEX_HANDLE httpExApiHandle;
HTTP_HEADERS_HANDLE httpHeader;
STRING_HANDLE relativePath;
const char* relativePath_s;
char* trustedCertificate;
unsigned int statusCode = 0;
// The environment variable ENVIRONMENT_VAR_EDGEHUB_CACERTIFICATEFILE is *optional*; it will not be present in
// fact in the vast majority of production scenarios. Its presence has underlying layer override where it
// retrieves trusted certificates from.
const char* caTrustedCertificateFile = environment_get_variable(ENVIRONMENT_VAR_EDGEHUB_CACERTIFICATEFILE);
if ((httpHeader = createHttpHeader()) == NULL)
{
LogError("HttpHeader creation failed");
result = IOTHUB_CLIENT_ERROR;
}
else if (populateHttpHeader(httpHeader, moduleMethodHandle) != IOTHUB_CLIENT_OK)
{
LogError("HttpHeader creation failed");
result = IOTHUB_CLIENT_ERROR;
}
else if ((relativePath = createRelativePath(deviceId, moduleId)) == NULL)
{
LogError("Failure creating relative path");
HTTPHeaders_Free(httpHeader);
result = IOTHUB_CLIENT_ERROR;
}
else if ((relativePath_s = STRING_c_str(relativePath)) == NULL)
{
LogError("HTTPAPIEX_Create failed");
HTTPHeaders_Free(httpHeader);
STRING_delete(relativePath);
result = IOTHUB_CLIENT_ERROR;
}
else if ((httpExApiHandle = HTTPAPIEX_Create(moduleMethodHandle->hostname)) == NULL)
{
LogError("HTTPAPIEX_Create failed");
HTTPHeaders_Free(httpHeader);
STRING_delete(relativePath);
result = IOTHUB_CLIENT_ERROR;
}
else if ((trustedCertificate = IoTHubClient_Auth_Get_TrustBundle(moduleMethodHandle->authorizationHandle, caTrustedCertificateFile)) == NULL)
{
LogError("Failed to get TrustBundle");
HTTPHeaders_Free(httpHeader);
STRING_delete(relativePath);
HTTPAPIEX_Destroy(httpExApiHandle);
result = IOTHUB_CLIENT_ERROR;
}
else
{
if (HTTPAPIEX_SetOption(httpExApiHandle, OPTION_TRUSTED_CERT, trustedCertificate) != HTTPAPIEX_OK)
{
LogError("Setting trusted certificate failed");
result = IOTHUB_CLIENT_ERROR;
}
else if (HTTPAPIEX_ExecuteRequest(httpExApiHandle, HTTPAPI_REQUEST_POST, relativePath_s, httpHeader, deviceJsonBuffer, &statusCode, NULL, responseBuffer) != HTTPAPIEX_OK)
{
LogError("HTTPAPIEX_ExecuteRequest failed");
result = IOTHUB_CLIENT_ERROR;
}
else
{
if (statusCode >= 200 && statusCode < 300)
{
result = IOTHUB_CLIENT_OK;
}
else
{
LogError("Http Failure status code %d.", statusCode);
result = IOTHUB_CLIENT_ERROR;
}
}
HTTPHeaders_Free(httpHeader);
STRING_delete(relativePath);
HTTPAPIEX_Destroy(httpExApiHandle);
free(trustedCertificate);
}
return result;
}
static IOTHUB_CLIENT_RESULT IoTHubClient_Edge_GenericMethodInvoke(IOTHUB_CLIENT_EDGE_HANDLE moduleMethodHandle, const char* deviceId, const char* moduleId, const char* methodName, const char* methodPayload, unsigned int timeout, int* responseStatus, unsigned char** responsePayload, size_t* responsePayloadSize)
{
IOTHUB_CLIENT_RESULT result;
BUFFER_HANDLE httpPayloadBuffer;
BUFFER_HANDLE responseBuffer;
if ((httpPayloadBuffer = createMethodPayloadJson(methodName, timeout, methodPayload)) == NULL)
{
LogError("BUFFER creation failed for httpPayloadBuffer");
result = IOTHUB_CLIENT_ERROR;
}
else if ((responseBuffer = BUFFER_new()) == NULL)
{
LogError("BUFFER_new failed for responseBuffer");
BUFFER_delete(httpPayloadBuffer);
result = IOTHUB_CLIENT_ERROR;
}
else if (sendHttpRequestMethod(moduleMethodHandle, deviceId, moduleId, httpPayloadBuffer, responseBuffer) != IOTHUB_CLIENT_OK)
{
LogError("Failure sending HTTP request for device method invoke");
BUFFER_delete(responseBuffer);
BUFFER_delete(httpPayloadBuffer);
result = IOTHUB_CLIENT_ERROR;
}
else if ((parseResponseJson(responseBuffer, responseStatus, responsePayload, responsePayloadSize)) != IOTHUB_CLIENT_OK)
{
LogError("Failure parsing response");
BUFFER_delete(responseBuffer);
BUFFER_delete(httpPayloadBuffer);
result = IOTHUB_CLIENT_ERROR;
}
else
{
result = IOTHUB_CLIENT_OK;
BUFFER_delete(responseBuffer);
BUFFER_delete(httpPayloadBuffer);
}
return result;
}
IOTHUB_CLIENT_RESULT IoTHubClient_Edge_DeviceMethodInvoke(IOTHUB_CLIENT_EDGE_HANDLE moduleMethodHandle, const char* deviceId, const char* methodName, const char* methodPayload, unsigned int timeout, int* responseStatus, unsigned char** responsePayload, size_t* responsePayloadSize)
{
IOTHUB_CLIENT_RESULT result;
if ((moduleMethodHandle == NULL) || (deviceId == NULL) || (methodName == NULL) || (methodPayload == NULL) || (responseStatus == NULL) || (responsePayload == NULL) || (responsePayloadSize == NULL))
{
LogError("Input parameter cannot be NULL");
result = IOTHUB_CLIENT_INVALID_ARG;
}
else
{
result = IoTHubClient_Edge_GenericMethodInvoke(moduleMethodHandle, deviceId, NULL, methodName, methodPayload, timeout, responseStatus, responsePayload, responsePayloadSize);
}
return result;
}
IOTHUB_CLIENT_RESULT IoTHubClient_Edge_ModuleMethodInvoke(IOTHUB_CLIENT_EDGE_HANDLE moduleMethodHandle, const char* deviceId, const char* moduleId, const char* methodName, const char* methodPayload, unsigned int timeout, int* responseStatus, unsigned char** responsePayload, size_t* responsePayloadSize)
{
IOTHUB_CLIENT_RESULT result;
if ((moduleMethodHandle == NULL) || (deviceId == NULL) || (moduleId == NULL) || (methodName == NULL) || (methodPayload == NULL) || (responseStatus == NULL) || (responsePayload == NULL) || (responsePayloadSize == NULL))
{
LogError("Input parameter cannot be NULL");
result = IOTHUB_CLIENT_INVALID_ARG;
}
else
{
result = IoTHubClient_Edge_GenericMethodInvoke(moduleMethodHandle, deviceId, moduleId, methodName, methodPayload, timeout, responseStatus, responsePayload, responsePayloadSize);
}
return result;
}
#endif /* USE_EDGE_MODULES */
|
the_stack_data/234518935.c | /*
#include <stdio.h>
#include <stdlib.h>
*/
int Fibonacci(int n) {
if(n < 0) return -1;
if(n == 0 || n == 1) return n;
if(n > 1) return Fibonacci(n-1)+Fibonacci(n-2);
}
/*
int main(int argc, char** argv) {
if(argc > 1) {
int n = atoi(argv[1]);
if(n < 0) {
printf("%d\n", Fibonacci(n));
} else {
printf("Sequenza di Fibonacci fino al %d-esimo elemento:\n", n);
for(int i = 0; i <= n; i++)
printf("%d\n", Fibonacci(i));
}
}
else
puts("Serve un parametro");
}
*/ |
the_stack_data/1037304.c | /* Copyright (C) 2008-2020 Free Software Foundation, Inc.
Contributor: Joern Rennecke <[email protected]>
on behalf of Synopsys Inc.
This file is part of GCC.
GCC is free software; you can redistribute it and/or modify it under
the terms of the GNU General Public License as published by the Free
Software Foundation; either version 3, or (at your option) any later
version.
GCC is distributed in the hope that it will be useful, but WITHOUT ANY
WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
Under Section 7 of GPL version 3, you are granted additional
permissions described in the GCC Runtime Library Exception, version
3.1, as published by the Free Software Foundation.
You should have received a copy of the GNU General Public License and
a copy of the GCC Runtime Library Exception along with this program;
see the files COPYING3 and COPYING.RUNTIME respectively. If not, see
<http://www.gnu.org/licenses/>. */
/* We use a polynom similar to a Tchebycheff polynom to get an initial
seed, and then use a newton-raphson iteration step to get an
approximate result
If this result can't be rounded to the exact result with confidence, we
round to the value between the two closest representable values, and
test if the correctly rounded value is above or below this value.
Because of the Newton-raphson iteration step, an error in the seed at X
is amplified by X. Therefore, we don't want a Tchebycheff polynom
or a polynom that is close to optimal according to the maximum norm
on the errro of the seed value; we want one that is close to optimal
according to the maximum norm on the error of the result, i.e. we
want the maxima of the polynom to increase linearily.
Given an interval [X0,X2) over which to approximate,
with X1 := (X0+X2)/2, D := X1-X0, F := 1/D, and S := D/X1 we have,
like for Tchebycheff polynoms:
P(0) := 1
but then we have:
P(1) := X + S*D
P(2) := 2 * X^2 + S*D * X - D^2
Then again:
P(n+1) := 2 * X * P(n) - D^2 * P (n-1)
*/
static long double merr = 42.;
double
err (long double a0, long double a1, long double x)
{
long double y0 = a0 + (x-1)*a1;
long double approx = 2. * y0 - y0 * x * y0;
long double true = 1./x;
long double err = approx - true;
if (err <= -1./65536./16384.)
printf ("ERROR EXCEEDS 1 ULP %.15f %.15f %.15f\n",
(double)x, (double)approx, (double)true);
if (merr > err)
merr = err;
return err;
}
int
main (void)
{
long double T[5]; /* Taylor polynom */
long double P[5][5];
int i, j;
long double X0, X1, X2, S;
long double inc = 1./64;
long double D = inc*0.5;
long i0, i1, i2, io;
memset (P, 0, sizeof (P));
P[0][0] = 1.;
for (i = 1; i < 5; i++)
P[i][i] = 1 << i-1;
P[2][0] = -D*D;
for (X0 = 1.; X0 < 2.; X0 += inc)
{
X1 = X0 + inc * 0.5;
X2 = X0 + inc;
S = D / X1;
T[0] = 1./X1;
for (i = 1; i < 5; i++)
T[i] = T[i-1] * -T[0];
#if 0
printf ("T %1.8f %f %f %f %f\n", (double)T[0], (double)T[1], (double)T[2],
(double)T[3], (double)T[4]);
#endif
P[1][0] = S*D;
P[2][1] = S*D;
for (i = 3; i < 5; i++)
{
P[i][0] = -D*D*P[i-2][0];
for (j = 1; j < i; j++)
P[i][j] = 2*P[i-1][j-1]-D*D*P[i-2][j];
}
#if 0
printf ("P3 %1.8f %f %f %f %f\n", (double)P[3][0], (double)P[3][1], (double)P[3][2],
(double)P[3][3], (double)P[3][4]);
printf ("P4 %1.8f %f %f %f %f\n", (double)P[4][0], (double)P[4][1], (double)P[4][2],
(double)P[4][3], (double)P[4][4]);
#endif
for (i = 4; i > 1; i--)
{
long double a = T[i]/P[i][i];
for (j = 0; j < i; j++)
T[j] -= a * P[i][j];
}
#if 0
printf ("A %1.8f %f %f\n", (double)T[0], (double)T[1], (double)T[2]);
#endif
#if 0
i2 = T[2]*1024;
long double a = (T[2]-i/1024.)/P[2][2];
for (j = 0; j < 2; j++)
T[j] -= a * P[2][j];
#else
i2 = 0;
#endif
long double T0, Ti1;
for (i = 0, i0 = 0; i < 4; i++)
{
i1 = T[1]*4096. + i0 / (long double)(1 << 20) - 0.5;
i1 = - (-i1 & 0x0fff);
Ti1 = ((unsigned)(-i1 << 20) | i0) /-(long double)(1LL<<32LL);
T0 = T[0] - (T[1]-Ti1)/P[1][1] * P[1][0] - (X1 - 1) * Ti1;
i0 = T0 * 1024 * 1024 + 0.5;
i0 &= 0xfffff;
}
#if 0
printf ("A %1.8f %f %f\n", (double)T[0], (double)T[1], (double)T[2]);
#endif
io = (unsigned)(-i1 << 20) | i0;
long double A1 = (unsigned)io/-65536./65536.;
long double A0 = (unsigned)(io << 12)/65536./65536.;
long double Xm0 = 1./sqrt (-A1);
long double Xm1 = 0.5+0.5*-A0/A1;
#if 0
printf ("%f %f %f %f\n", (double)A0, (double)A1, (double) Ti1, (double)X0);
printf ("%.12f %.12f %.12f\n",
err (A0, A1, X0), err (A0, A1, X1), err (A0, A1, X2));
printf ("%.12f %.12f\n", (double)Xm0, (double)Xm1);
printf ("%.12f %.12f\n", err (A0, A1, Xm0), err (A0, A1, Xm1));
#endif
printf ("\t.long 0x%x\n", io);
}
#if 0
printf ("maximum error: %.15f %x %f\n", (double)merr, (unsigned)(long long)(-merr * 65536 * 65536), (double)log(-merr)/log(2));
#endif
return 0;
}
|
the_stack_data/151706084.c | #include<stdio.h>
int main()
{
int i;
for(i=1;i==5;i++){
printf("%d ",i);
}
return 0;
}
|
the_stack_data/161079985.c | /****************************************************************************
* program for create QChem function for create default qchemBasis file
*
* compile createQChemFuncForGabedit :
* gcc -o createQChemFuncForGabedit createQChemFuncForGabedit.c
* createQChemFuncForGabedit and enter for create the qchem.cc file
* for Gabedit.
*****************************************************************************/
#include <stdio.h>
#include <stdlib.h>
#include <string.h>
#include <sys/stat.h>
#include <ctype.h>
#ifndef G_OS_WIN32
#include <dirent.h>
#else
#include <windows.h>
#endif
#define NBASIS 120
#define BSIZE 1024
typedef struct _Atom
{
char symb[10];
int nbas;
char basisName[NBASIS][BSIZE];
}Atom;
typedef struct _Basis
{
char name[BSIZE];
int nAtoms;
char symbols[NBASIS][BSIZE];
}Basis;
/***********************************************************************************/
#define NROW 18
#define NCOL 10
char *SymbAtoms[18][10]={
{"H" ,"Li","Na","K" ,"Rb","Cs","Fr","00","00","00"},
{"00","Be","Mg","Ca","Sr","Ba","Ra","00","X","00"},
{"00","00","00","Sc","Y" ,"La","Ac","00","00","00"},
{"00","00","00","Ti","Zr","Hf","00","00","00","00"},
{"00","00","00","V" ,"Nb","Ta","00","Ce","Th","00"},
{"00","00","00","Cr","Mo","W" ,"00","Pr","Pa","00"},
{"00","00","00","Mn","Tc","Re","00","Nd","U" ,"00"},
{"00","00","00","Fe","Ru","Os","00","Pm","Np","00"},
{"00","00","00","Co","Rh","Ir","00","Sm","Pu","00"},
{"00","00","00","Ni","Pd","Pt","00","Eu","Am","00"},
{"00","00","00","Cu","Ag","Au","00","Gd","Cm","00"},
{"00","00","00","Zn","Cd","Hg","00","Tb","Bk","00"},
{"00","B" ,"Al","Ga","In","Tl","00","Dy","Cf","00"},
{"00","C" ,"Si","Ge","Sn","Pb","00","Ho","Es","00"},
{"00","N" ,"P" ,"As","Sb","Bi","00","Er","Fm","00"},
{"00","O" ,"S" ,"Se","Te","Po","00","Tm","Md","00"},
{"00","F" ,"Cl","Br","I" ,"At","00","Yb","No","00"},
{"He","Ne","Ar","Kr","Xe","Rn","00","Lu","Lr","00"},
};
/***********************************************************************************/
static char** get_list_of_files(char* dirname, int* n)
{
DIR* dir;
struct stat st;
struct dirent *File;
int nFiles = 0;
char** filesList = NULL;
dir = opendir(dirname);
if(dir)
{
File = readdir(dir);
while(File)
{
if( strlen(File->d_name)>0 && File->d_name[0] != '.' )
{
char all_name[BSIZE];
printf("%s\n",File->d_name);
sprintf(all_name,"%s%s%s",dirname,"/",File->d_name);
stat(all_name,&st);
if(!(st.st_mode & S_IFDIR))
{
nFiles++;
filesList = realloc(filesList, nFiles*sizeof(char*));
filesList[nFiles-1] = strdup(all_name);
printf("allname = %s\n",all_name);
}
}
File = readdir(dir);
}
closedir(dir);
}
*n = nFiles;
return filesList;
}
/***********************************************************************************/
Basis* addOneBasis(Basis* listOfBasis, char* basis, char* atom)
{
int n = 1;
int i,j;
if(listOfBasis==NULL)
{
listOfBasis = malloc(1*sizeof(Basis));
listOfBasis[0].nAtoms = -1;
}
for(i=0;listOfBasis[i].nAtoms>=0; i++)
{
n++;
if(strcmp(listOfBasis[i].name,basis)==0)
{
for(j=0;j<listOfBasis[i].nAtoms; j++)
if(strcmp(listOfBasis[i].symbols[j],atom)==0)
{
return listOfBasis;
}
sprintf(listOfBasis[i].symbols[j],"%s",atom);
listOfBasis[i].nAtoms++;
return listOfBasis;
}
}
listOfBasis = realloc(listOfBasis,(n+1)*sizeof(Basis));
listOfBasis[n].nAtoms = -1;
listOfBasis[n-1].nAtoms = 1;
sprintf(listOfBasis[n-1].symbols[0],"%s",atom);
sprintf(listOfBasis[n-1].name,"%s",basis);
return listOfBasis;
}
/***********************************************************************************/
Atom* newAtomList()
{
Atom* listOfAtoms=NULL;
int n = 0;
int i, j;
for(i=0;i<NCOL;i++)
for(j=0;j<NROW;j++)
{
if(strcmp(SymbAtoms[j][i],"00")==0) continue;
n++;
}
n++;
listOfAtoms = (Atom*)malloc(n*sizeof(Atom));
listOfAtoms[n-1].nbas = -1;
n = 0;
for(i=0;i<NCOL;i++)
for(j=0;j<NROW;j++)
{
if(strcmp(SymbAtoms[j][i],"00")==0) continue;
n++;
listOfAtoms[n-1].nbas = 0;
sprintf(listOfAtoms[n-1].symb,"%s",SymbAtoms[j][i]);
}
return listOfAtoms;
}
/***********************************************************************************/
void printAllAtomsList(Atom listOfAtoms[])
{
int i=0;
int j=0;
for(i=0;listOfAtoms[i].nbas>=0; i++)
{
printf("%s : %d ",listOfAtoms[i].symb, listOfAtoms[i].nbas);
for(j=0;j<listOfAtoms[i].nbas; j++)
printf("%s ",listOfAtoms[i].basisName[j]);
printf("\n");
}
}
/***********************************************************************************/
void printAllBasisList(Basis listOfBasis[])
{
int i=0;
int j=0;
for(i=0;listOfBasis[i].nAtoms>=0; i++)
{
printf("%s : ",listOfBasis[i].name);
for(j=0;j<listOfBasis[i].nAtoms; j++)
printf("%s ",listOfBasis[i].symbols[j]);
printf("\n");
}
}
/***********************************************************************************/
Basis* createBasisList(Atom listOfAtoms[])
{
Basis* listOfBasis = NULL;
int i=0;
int j=0;
for(i=0;listOfAtoms[i].nbas>=0; i++)
{
for(j=0;j<listOfAtoms[i].nbas; j++)
listOfBasis =addOneBasis(listOfBasis,listOfAtoms[i].basisName[j], listOfAtoms[i].symb);
}
return listOfBasis;
}
/***********************************************************************************/
void str_delete_n(char* str)
{
char *s;
if(str == NULL)
return;
if (!*str)
return;
for (s = str + strlen (str) - 1; s >= str && ((unsigned char)*s)=='\n'; s--)
*s = '\0';
}
/**********************************************/
void delete_last_spaces(char* str)
{
char *s;
if(str == NULL)
return;
if (!*str)
return;
for (s = str + strlen (str) - 1; s >= str && isspace ((unsigned char)*s); s--)
*s = '\0';
}
/**********************************************/
void delete_first_spaces(char* str)
{
unsigned char *start;
int i;
int lenSpace = 0;
if(str == NULL)
return;
if (!*str)
return;
for (start = str; *start && isspace (*start); start++)lenSpace++;
for(i=0;i<(int)(strlen(str)-lenSpace);i++)
str[i] = str[i+lenSpace];
str[strlen(str)-lenSpace] = '\0';
}
/***********************************************************************************/
void getBasisAndAtoms(char* t, char* basis, char* atoms)
{
int i;
int j;
int k;
int OkBasis = 0;
int OkAtoms = 0;
k = 0;
for(i=k;i<strlen(t);i++)
{
if(t[i]!='<') break;
for(j=i+1;j<strlen(t);j++)
if(t[j]=='>') { i = j; break;}
}
for(k=j+1;k<strlen(t);k++)
{
if(t[k]=='<') break;
basis[k-j-1] = t[k];
}
basis[k] = '\0';
for(i=k;i<strlen(t);i++)
{
if(t[i]!='<') break;
for(j=i+1;j<strlen(t);j++)
if(t[j]=='>') { i = j; break;}
}
for(k=j+1;k<strlen(t);k++)
{
if(t[k]=='<') break;
atoms[k-j-1] = t[k];
}
atoms[k] = '\0';
/*printf("Basis = %s Atoms = %s\n",basis,atoms);*/
}
/***********************************************************************************/
char** getListOfGroups(char* atoms)
{
int n=0;
int i;
int j;
char** m = malloc(1*sizeof(char*));
m[0] = NULL;
for(i=0;i<strlen(atoms);i++)
{
if(atoms[i]==',') {continue;}
n++;
m = realloc(m,(n+1)*sizeof(char*));
m[n] = NULL;
m[n-1] = malloc(BSIZE*sizeof(char));
for(j=i;j<strlen(atoms);j++)
{
if(atoms[j]==',') {break;}
m[n-1][j-i] = atoms[j];
}
i=j;
m[n-1][j] = '\0';
delete_last_spaces(m[n-1]);
delete_first_spaces(m[n-1]);
}
return m;
}
/***********************************************************************************/
char** getListOfAtoms(char* oneList)
{
if(!strstr(oneList,"-"))
{
char** m = malloc(2*sizeof(char*));
m[1] = NULL;
m[0] = strdup(oneList);
return m;
}
else
{
char* atomMin = malloc(BSIZE*sizeof(char));
char* atomMax = malloc(BSIZE*sizeof(char));
int i,j;
int iMin=-1,jMin=-1;
int iMax=-1,jMax=-1;
char** m = malloc(1*sizeof(char*));
int n=0;
m[0] = NULL;
for(i=0;i<strlen(oneList);i++)
{
if(oneList[i]=='-')break;
atomMin[i] = oneList[i];
}
atomMin[i] = '\0';
for(j=i+1;j<strlen(oneList);j++)
{
atomMax[j-i-1] = oneList[j];
}
atomMin[j] = '\0';
for(i=0;i<NCOL;i++)
for(j=0;j<NROW;j++)
{
if(strcmp(SymbAtoms[j][i],atomMin)==0)
{
iMin = i;
jMin = j;
}
if(strcmp(SymbAtoms[j][i],atomMax)==0)
{
iMax = i;
jMax = j;
}
}
if(iMin>=0 && jMin>=0 && iMax>=0 && jMax>=0)
{
for(i=iMin;i<=iMax;i++)
{
if(i==iMin) j = jMin;
else j = 0;
for( ; (i==iMax)?j<=jMax:j<NROW ; j++)
{
if(strcmp(SymbAtoms[j][i],"00")==0)continue;
{
n++;
m = realloc(m,(n+1)*sizeof(char*));
m[n] = NULL;
m[n-1] = strdup(SymbAtoms[j][i]);
}
}
}
}
return m;
return NULL;
}
}
/***********************************************************************************/
static void strup(char* str)
{
int i=0;
if(!str) return;
for(i=0;i<strlen(str);i++)
str[i] = toupper(str[i]);
}
/***********************************************************************************/
static int atomInFile(FILE* file, char* symb)
{
int ok = 0;
char t[BSIZE];
char s1[10];
char s2[10];
int i;
int k;
char* ss = strdup(symb);
strup(ss);
while(!feof(file))
{
if(!fgets(t,BSIZE,file)) break;
strup(t);
k = sscanf(t,"%s %d %s",s1,&i,s2);
if(k != 2) continue;
if(strcmp(s1,ss)==0)
{
ok = 1;
break;
}
}
return ok;
}
/***********************************************************************************/
void createQChemFunction(Atom* listOfAtoms, Basis* listOfBasis)
{
int nBasis = 0;
int nAtoms = 0;
FILE* file;
int i;
int j;
file = fopen("qchemBasis.cc","w");
if(!file) return;
fprintf(file,"gboolean create_libqchem_file(gchar* filename)\n");
fprintf(file,"{\n");
fprintf(file,"\tFILE* file = fopen(filename,\"w\");\n\n");
fprintf(file,"\tif(file==NULL)\n");
fprintf(file,"\t{\n");
fprintf(file,"\t\treturn FALSE;\n");
fprintf(file,"\t}\n");
/*
for(i=0;listOfBasis[i].nAtoms>=0;i++) nBasis++;
fprintf(file,"\tfprintf(file,\"Begin List of basis\\n\");\n");
fprintf(file,"\tfprintf(file,\"Nbasis = %d\\n\");\n",nBasis);
printf("nBasis = %d\n",nBasis);
for(i=0;i<nBasis;i++)
{
int j=0;
fprintf(file,"\tfprintf(file,\"Basis %s\\n\");\n",listOfBasis[i].name);
fprintf(file,"\tfprintf(file,\"%d\\n\");\n",listOfBasis[i].nAtoms);
for(j=0;j<listOfBasis[i].nAtoms;j++)
{
int k = 0;
fprintf(file,"\tfprintf(file,\"%s %s", listOfBasis[i].name, listOfBasis[i].symbols[j]);
fprintf(file,"\\n\");\n");
}
}
fprintf(file,"\tfprintf(file,\"End List of basis\\n\\n\");\n\n");
*/
for(i=0;listOfAtoms[i].nbas>=0;i++) nAtoms++;
/* fprintf(file,"\tfprintf(file,\"Begin List of atoms\\n\");\n");*/
fprintf(file,"\tfprintf(file,\"NAtoms = %d\\n\");\n",nAtoms);
for(i=0;i<nAtoms;i++)
{
int j=0;
fprintf(file,"\tfprintf(file,\"Atom %s\\n\");\n",listOfAtoms[i].symb);
fprintf(file,"\tfprintf(file,\"%d\\n\");\n",listOfAtoms[i].nbas);
for(j=0;j<listOfAtoms[i].nbas;j++)
{
int k = 0;
fprintf(file,"\tfprintf(file,\"%s %s ", listOfAtoms[i].symb, listOfAtoms[i].basisName[j]);
fprintf(file,"\\n\");\n");
}
}
/* fprintf(file,"\tfprintf(file,\"End List of atoms\\n\");\n");*/
fprintf(file,"\tfclose(file);\n");
fprintf(file,"\treturn TRUE;\n");
fprintf(file,"}\n");
fclose(file);
}
/***********************************************************************************/
static void setBaseNameFromFileName(char* baseName, FILE* file, char* fileName)
{
int k;
char t[BSIZE];
int i;
int begin;
int end;
fseek(file, 0L, SEEK_SET);
sprintf(baseName,"UNK");
while(!feof(file))
{
if(!fgets(t,BSIZE,file)) break;
if(strstr(t,"BASIS="))
{
char* p = strstr(t,"BASIS=")+7;
for(i=0;i<strlen(t);i++)
{
if(t[i] == '"') t[i] = ' ';
if(t[i] == '(') t[i] = ' ';
if(t[i] == ')') t[i] = ' ';
}
p = strstr(t,"BASIS=")+7;
k = sscanf(p,"%s",baseName);
if(k!=1)
sprintf(baseName,"UNK");
break;
}
}
if(strcmp(baseName,"Pople")!=0 && strcmp(baseName,"UNK")!=0) return;
printf("baseName = %s\n", baseName);
printf("fileName = %s\n", fileName);
for(i=0;i<strlen(fileName);i++)
{
if(fileName[i] == '/') begin = i;
if(fileName[i] == '.') end = i;
}
begin++;
for(i=0;i<end-begin;i++)
{
baseName[i] = fileName[i+begin];
}
baseName[end] = '\0';
}
/***********************************************************************************/
static void swap(char* x, char* y)
{
char buffer[BSIZE];
sprintf(buffer,"%s",x);
sprintf(x,"%s",y);
sprintf(y,"%s",buffer);
}
/***********************************************************************************/
static void sort0(Atom* atom)
{
int nbas = 0;
int i;
int j;
int k;
nbas = atom->nbas;
for(i=0; i<nbas-1; i++)
{
k = i;
for(j=i+1; j<nbas; j++)
if(strcasecmp(atom->basisName[k],atom->basisName[j])>0) { k = j;}
if(k != i)
{
swap(atom->basisName[i],atom->basisName[k]);
}
}
}
/***********************************************************************************/
static void sortBasisForAnAtom(Atom* atom)
{
int nbas = 0;
int i;
int j;
int k;
nbas = atom->nbas;
for(i=0; i<nbas-1; i++)
{
for(j=i+1; j<nbas; j++)
if(strcasecmp(atom->basisName[i],atom->basisName[j])==0)
sprintf(atom->basisName[j],"ZZZZZZZZZZZ");
if(strstr(atom->basisName[i],"STO"))
{
char buffer[100];
sprintf(buffer,"00-%s",atom->basisName[i]);
sprintf(atom->basisName[i],"%s",buffer);
}
if(strstr(atom->basisName[i],"5Z"))
{
char* p = strstr(atom->basisName[i],"5Z");
*p = 'Y';
}
if(strstr(atom->basisName[i],"6Z"))
{
char* p = strstr(atom->basisName[i],"5Z");
*p = 'Z';
}
if(strstr(atom->basisName[i],"QZ"))
{
char* p = strstr(atom->basisName[i],"QZ");
*p = 'X';
}
}
sort0(atom);
k = 0;
for(i=0; i<nbas; i++)
{
if(strcasecmp(atom->basisName[i],"ZZZZZZZZZZZ")==0)
{
if(k==0) k = i;
}
if(strstr(atom->basisName[i],"00-"))
{
int len = strlen(atom->basisName[i]);
for(j=3;j<len;j++)
atom->basisName[i][j-3] = atom->basisName[i][j];
atom->basisName[i][len-3] ='\0';
}
if(strstr(atom->basisName[i],"YZ"))
{
char* p = strstr(atom->basisName[i],"YZ");
*p = '5';
}
if(strstr(atom->basisName[i],"ZZ"))
{
char* p = strstr(atom->basisName[i],"ZZ");
*p = '6';
}
if(strstr(atom->basisName[i],"XZ"))
{
char* p = strstr(atom->basisName[i],"XZ");
*p = 'Q';
}
}
atom->nbas = k;
}
/***********************************************************************************/
int main(int argc,char* argv[])
{
Atom* atom = malloc(NROW*NCOL*sizeof(Atom));
FILE* file;
char* fileName = "qchem.bas";
char* dirName = "usr/local/QChem/aux/basis";
Atom* listOfAtoms = NULL;
Basis* listOfBasis = NULL;
char** listOfFiles = NULL;
int nFiles = 0;
int l,c,k,i,n = 0;
if(argc < 2)
{
printf("Sorry, You should the directory name of Q-Chem basis\n");
printf(" Example : createQChemFuncForGabedit $QC/aux/basis\n");
return 1;
}
dirName = argv[1];
listOfFiles = get_list_of_files(dirName, &nFiles);
if(!listOfFiles)
{
printf("Error, a void directory\n");
printf("No files found in %s directory\n",dirName);
return 1;
}
listOfAtoms = newAtomList();
for(i=0;i<nFiles;i++)
{
file = fopen(listOfFiles[i],"r");
if(!file)
{
printf("Sorry, I can not open %s file\n",listOfFiles[i]);
return 1;
}
n = 0;
for(c=0;c<NCOL;c++)
for(l=0;l<NROW;l++)
{
if(strcmp(SymbAtoms[l][c],"00")==0) continue;
n++;
if(atomInFile(file, SymbAtoms[l][c]))
{
listOfAtoms[n-1].nbas++;
k = listOfAtoms[n-1].nbas-1;
setBaseNameFromFileName(listOfAtoms[n-1].basisName[k],file, listOfFiles[i]);
}
}
fclose(file);
}
i = 0;
for(c=0;c<NCOL;c++)
for(l=0;l<NROW;l++)
{
if(strcmp(SymbAtoms[l][c],"00")==0) continue;
sortBasisForAnAtom(&listOfAtoms[i]);
i++;
}
/* printAllAtomsList(listOfAtoms);*/
listOfBasis = createBasisList(listOfAtoms);
printf("Fin de listOfBasis \n");
/* printAllBasisList(listOfBasis);*/
createQChemFunction(listOfAtoms, listOfBasis);
return 0;
}
|
the_stack_data/181393447.c | /*
* Compile with:
* cc -I/usr/local/include -o time-test time-test.c -L/usr/local/lib -levent
*/
#include <sys/types.h>
#include <sys/stat.h>
#include <sys/time.h>
#include <sys/socket.h>
#include <fcntl.h>
#include <stdlib.h>
#include <stdio.h>
#include <string.h>
#include <unistd.h>
#include <errno.h>
#include <event.h>
int test_okay = 1;
int called = 0;
void
read_cb(int fd, short event, void *arg)
{
char buf[256];
int len;
len = read(fd, buf, sizeof(buf));
printf("%s: read %d%s\n", __func__,
len, len ? "" : " - means EOF");
if (len) {
if (!called)
event_add(arg, NULL);
} else if (called == 1)
test_okay = 0;
called++;
}
int
main (int argc, char **argv)
{
struct event ev;
char *test = "test string";
int pair[2];
if (socketpair(AF_UNIX, SOCK_STREAM, 0, pair) == -1)
return (1);
write(pair[0], test, strlen(test)+1);
shutdown(pair[0], SHUT_WR);
/* Initalize the event library */
event_init();
/* Initalize one event */
event_set(&ev, pair[1], EV_READ, read_cb, &ev);
event_add(&ev, NULL);
event_dispatch();
return (test_okay);
}
|
the_stack_data/282213.c | #ifdef STM32G0xx
#include "stm32g0xx_hal_usart_ex.c"
#endif
#ifdef STM32H7xx
#include "stm32h7xx_hal_usart_ex.c"
#endif
#ifdef STM32L4xx
#include "stm32l4xx_hal_usart_ex.c"
#endif
#ifdef STM32WBxx
#include "stm32wbxx_hal_usart_ex.c"
#endif
|
the_stack_data/198580484.c | #include <stdio.h>
#include <stdlib.h>
#include <string.h>
#include <CL/cl.h>
unsigned char *read_buffer(char *file_name, size_t *size_ptr)
{
FILE *f;
unsigned char *buf;
size_t size;
/* Open file */
f = fopen(file_name, "rb");
if (!f)
return NULL;
/* Obtain file size */
fseek(f, 0, SEEK_END);
size = ftell(f);
fseek(f, 0, SEEK_SET);
/* Allocate and read buffer */
buf = malloc(size + 1);
fread(buf, 1, size, f);
buf[size] = '\0';
/* Return size of buffer */
if (size_ptr)
*size_ptr = size;
/* Return buffer */
return buf;
}
void write_buffer(char *file_name, const char *buffer, size_t buffer_size)
{
FILE *f;
/* Open file */
f = fopen(file_name, "w+");
/* Write buffer */
if(buffer)
fwrite(buffer, 1, buffer_size, f);
/* Close file */
fclose(f);
}
int main(int argc, char const *argv[])
{
/* Get platform */
cl_platform_id platform;
cl_uint num_platforms;
cl_int ret = clGetPlatformIDs(1, &platform, &num_platforms);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clGetPlatformIDs' failed\n");
exit(1);
}
printf("Number of platforms: %d\n", num_platforms);
printf("platform=%p\n", platform);
/* Get platform name */
char platform_name[100];
ret = clGetPlatformInfo(platform, CL_PLATFORM_NAME, sizeof(platform_name), platform_name, NULL);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clGetPlatformInfo' failed\n");
exit(1);
}
printf("platform.name='%s'\n\n", platform_name);
/* Get device */
cl_device_id device;
cl_uint num_devices;
ret = clGetDeviceIDs(platform, CL_DEVICE_TYPE_GPU, 1, &device, &num_devices);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clGetDeviceIDs' failed\n");
exit(1);
}
printf("Number of devices: %d\n", num_devices);
printf("device=%p\n", device);
/* Get device name */
char device_name[100];
ret = clGetDeviceInfo(device, CL_DEVICE_NAME, sizeof(device_name),
device_name, NULL);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clGetDeviceInfo' failed\n");
exit(1);
}
printf("device.name='%s'\n", device_name);
printf("\n");
/* Create a Context Object */
cl_context context;
context = clCreateContext(NULL, 1, &device, NULL, NULL, &ret);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clCreateContext' failed\n");
exit(1);
}
printf("context=%p\n", context);
/* Create a Command Queue Object*/
cl_command_queue command_queue;
command_queue = clCreateCommandQueue(context, device, 0, &ret);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clCreateCommandQueue' failed\n");
exit(1);
}
printf("command_queue=%p\n", command_queue);
printf("\n");
/* Program source */
unsigned char *source_code;
size_t source_length;
/* Read program from 'min_uintuint.cl' */
source_code = read_buffer("min_uintuint.cl", &source_length);
/* Create a program */
cl_program program;
program = clCreateProgramWithSource(context, 1, (const char **)&source_code, &source_length, &ret);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clCreateProgramWithSource' failed\n");
exit(1);
}
printf("program=%p\n", program);
/* Build program */
ret = clBuildProgram(program, 1, &device, NULL, NULL, NULL);
if (ret != CL_SUCCESS )
{
size_t size;
char *log;
/* Get log size */
clGetProgramBuildInfo(program, device, CL_PROGRAM_BUILD_LOG,0, NULL, &size);
/* Allocate log and print */
log = malloc(size);
clGetProgramBuildInfo(program, device, CL_PROGRAM_BUILD_LOG,size, log, NULL);
printf("error: call to 'clBuildProgram' failed:\n%s\n", log);
/* Free log and exit */
free(log);
exit(1);
}
printf("program built\n");
printf("\n");
/* Create a Kernel Object */
cl_kernel kernel;
kernel = clCreateKernel(program, "min_uintuint", &ret);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clCreateKernel' failed\n");
exit(1);
}
/* Create and allocate host buffers */
size_t num_elem = 10;
/* Create and init host side src buffer 0 */
cl_uint *src_0_host_buffer;
src_0_host_buffer = malloc(num_elem * sizeof(cl_uint));
for (int i = 0; i < num_elem; i++)
src_0_host_buffer[i] = (cl_uint)(2);
/* Create and init device side src buffer 0 */
cl_mem src_0_device_buffer;
src_0_device_buffer = clCreateBuffer(context, CL_MEM_READ_ONLY, num_elem * sizeof(cl_uint), NULL, &ret);
if (ret != CL_SUCCESS)
{
printf("error: could not create source buffer\n");
exit(1);
}
ret = clEnqueueWriteBuffer(command_queue, src_0_device_buffer, CL_TRUE, 0, num_elem * sizeof(cl_uint), src_0_host_buffer, 0, NULL, NULL);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clEnqueueWriteBuffer' failed\n");
exit(1);
}
/* Create and init host side src buffer 1 */
cl_uint *src_1_host_buffer;
src_1_host_buffer = malloc(num_elem * sizeof(cl_uint));
for (int i = 0; i < num_elem; i++)
src_1_host_buffer[i] = (cl_uint)(2);
/* Create and init device side src buffer 1 */
cl_mem src_1_device_buffer;
src_1_device_buffer = clCreateBuffer(context, CL_MEM_READ_ONLY, num_elem * sizeof(cl_uint), NULL, &ret);
if (ret != CL_SUCCESS)
{
printf("error: could not create source buffer\n");
exit(1);
}
ret = clEnqueueWriteBuffer(command_queue, src_1_device_buffer, CL_TRUE, 0, num_elem * sizeof(cl_uint), src_1_host_buffer, 0, NULL, NULL);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clEnqueueWriteBuffer' failed\n");
exit(1);
}
/* Create host dst buffer */
cl_uint *dst_host_buffer;
dst_host_buffer = malloc(num_elem * sizeof(cl_uint));
memset((void *)dst_host_buffer, 1, num_elem * sizeof(cl_uint));
/* Create device dst buffer */
cl_mem dst_device_buffer;
dst_device_buffer = clCreateBuffer(context, CL_MEM_WRITE_ONLY, num_elem *sizeof(cl_uint), NULL, &ret);
if (ret != CL_SUCCESS)
{
printf("error: could not create dst buffer\n");
exit(1);
}
/* Set kernel arguments */
ret = CL_SUCCESS;
ret |= clSetKernelArg(kernel, 0, sizeof(cl_mem), &src_0_device_buffer);
ret |= clSetKernelArg(kernel, 1, sizeof(cl_mem), &src_1_device_buffer);
ret |= clSetKernelArg(kernel, 2, sizeof(cl_mem), &dst_device_buffer);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clSetKernelArg' failed\n");
exit(1);
}
/* Launch the kernel */
size_t global_work_size = num_elem;
size_t local_work_size = num_elem;
ret = clEnqueueNDRangeKernel(command_queue, kernel, 1, NULL, &global_work_size, &local_work_size, 0, NULL, NULL);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clEnqueueNDRangeKernel' failed\n");
exit(1);
}
/* Wait for it to finish */
clFinish(command_queue);
/* Read results from GPU */
ret = clEnqueueReadBuffer(command_queue, dst_device_buffer, CL_TRUE,0, num_elem * sizeof(cl_uint), dst_host_buffer, 0, NULL, NULL);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clEnqueueReadBuffer' failed\n");
exit(1);
}
/* Dump dst buffer to file */
char dump_file[100];
sprintf((char *)&dump_file, "%s.result", argv[0]);
write_buffer(dump_file, (const char *)dst_host_buffer, num_elem * sizeof(cl_uint));
printf("Result dumped to %s\n", dump_file);
/* Free host dst buffer */
free(dst_host_buffer);
/* Free device dst buffer */
ret = clReleaseMemObject(dst_device_buffer);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clReleaseMemObject' failed\n");
exit(1);
}
/* Free host side src buffer 0 */
free(src_0_host_buffer);
/* Free device side src buffer 0 */
ret = clReleaseMemObject(src_0_device_buffer);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clReleaseMemObject' failed\n");
exit(1);
}
/* Free host side src buffer 1 */
free(src_1_host_buffer);
/* Free device side src buffer 1 */
ret = clReleaseMemObject(src_1_device_buffer);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clReleaseMemObject' failed\n");
exit(1);
}
/* Release kernel */
ret = clReleaseKernel(kernel);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clReleaseKernel' failed\n");
exit(1);
}
/* Release program */
ret = clReleaseProgram(program);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clReleaseProgram' failed\n");
exit(1);
}
/* Release command queue */
ret = clReleaseCommandQueue(command_queue);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clReleaseCommandQueue' failed\n");
exit(1);
}
/* Release context */
ret = clReleaseContext(context);
if (ret != CL_SUCCESS)
{
printf("error: call to 'clReleaseContext' failed\n");
exit(1);
}
return 0;
} |
the_stack_data/225142806.c | #include <stdio.h>
const int DIM = 5;
void lerArray(int v[DIM]) {
for (int i = 0; i < DIM; i++) {
printf("v[%d]? ", i);
scanf("%d", &v[i]);
}
}
void copia(int a[DIM], int b[DIM]) {
for (int i = 0; i < DIM; i++)
b[i] = a[i];
}
void escreverArray(int v[DIM]) {
for (int i = 0; i < DIM; i++)
printf("v[%d] = %d\n", i, v[i]);
}
int main(void) {
int a[DIM], b[DIM];
lerArray(a);
copia(a, b);
escreverArray(b);
return 0;
}
|
the_stack_data/92328698.c | static struct parse_smatch *check_sample() {
int res;
res = 0;
return ERR_PTR(res);
}
|
the_stack_data/182952577.c | #include <stdio.h>
#include <pthread.h>
#include <stdlib.h>
int *array; //Global integer array
int sum; //Global sum variable
int counter = 0;
pthread_mutex_t mutex = PTHREAD_MUTEX_INITIALIZER;
void *front_to_back( void *val )
{
int SIZE;
SIZE = *((int *) val);
while (1)
{
pthread_mutex_lock(&mutex);
if( counter != SIZE )
{
sum = sum + array[counter];
printf("Thread_1 > read %d, sum is = %d \n", array[counter], sum);
counter++;
}else
{
printf("Thread_1 > End. \n");
pthread_mutex_unlock(&mutex);
break;
}
pthread_mutex_unlock(&mutex);
}
return NULL;
}
void *back_to_front( void *val )
{
int SIZE;
SIZE = *((int *) val);
int i=1;
while (1)
{
pthread_mutex_lock(&mutex);
if( counter != SIZE )
{
sum = sum + array[SIZE - i];
printf("Thread_2 > read %d, sum is = %d \n", array[SIZE - i], sum);
counter++;
i++;
}else
{
printf("Thread_2 > End. \n");
pthread_mutex_unlock(&mutex);
break;
}
pthread_mutex_unlock(&mutex);
}
return NULL;
}
int main(void) {
int SIZE;
printf("Array size? :");
scanf("%d", &SIZE);
array = malloc(SIZE*sizeof(int));
int i=0;
printf("Array of contents? :");
for (; i<SIZE ; i++)
{
scanf("%d", &array[i]);
}
pthread_t t[2];
pthread_create(&t[0], NULL, front_to_back, (void *) &SIZE );
pthread_create(&t[1], NULL, back_to_front, (void *) &SIZE );
pthread_join(t[0],NULL);
pthread_join(t[1],NULL);
free(array);
return 0;
} |
the_stack_data/103266094.c | /* Test pointer arithmetic*/
int expect(int a, int b)
{
if (!(a == b)) {
printf("Failed\n");
printf(" %d expected, but got %d\n", a, b);
exit(1);
}
}
int t1()
{
char *s = "abcdefghi";
char *x = s;
char *t = x + 1;
expect(98, *t);
}
int t2()
{
char *s = "abcdefghi";
int *x = s;
char *t = x + 1;
expect(101, *t);
}
int t3()
{
char *s = "abcdefghi";
long *x = s;
char *t = x + 1;
expect(105, *t);
}
int t4()
{
char *s = "abcdefghi";
void *x = s;
char *t = x + 1;
expect(98, *t);
}
int main()
{
t1();
t2();
t3();
t4();
}
|
the_stack_data/592454.c | //Copyright (c) 1998-2013, Brian Gladman, Worcester, UK. All rights reserved.
#include <stdint.h>
#if defined(__cplusplus)
extern "C"
{
#endif
#define TABLE_ALIGN 32
#define WPOLY 0x011b
#define N_COLS 4
#define AES_BLOCK_SIZE 16
#define RC_LENGTH (5 * (AES_BLOCK_SIZE / 4 - 2))
#if defined(_MSC_VER)
#define ALIGN __declspec(align(TABLE_ALIGN))
#elif defined(__GNUC__)
#define ALIGN __attribute__ ((aligned(16)))
#else
#define ALIGN
#endif
#define rf1(r,c) (r)
#define word_in(x,c) (*((uint32_t*)(x)+(c)))
#define word_out(x,c,v) (*((uint32_t*)(x)+(c)) = (v))
#define s(x,c) x[c]
#define si(y,x,c) (s(y,c) = word_in(x, c))
#define so(y,x,c) word_out(y, c, s(x,c))
#define state_in(y,x) si(y,x,0); si(y,x,1); si(y,x,2); si(y,x,3)
#define state_out(y,x) so(y,x,0); so(y,x,1); so(y,x,2); so(y,x,3)
#define round(rm,y,x,k) rm(y,x,k,0); rm(y,x,k,1); rm(y,x,k,2); rm(y,x,k,3)
#define to_byte(x) ((x) & 0xff)
#define bval(x,n) to_byte((x) >> (8 * (n)))
#define fwd_var(x,r,c)\
( r == 0 ? ( c == 0 ? s(x,0) : c == 1 ? s(x,1) : c == 2 ? s(x,2) : s(x,3))\
: r == 1 ? ( c == 0 ? s(x,1) : c == 1 ? s(x,2) : c == 2 ? s(x,3) : s(x,0))\
: r == 2 ? ( c == 0 ? s(x,2) : c == 1 ? s(x,3) : c == 2 ? s(x,0) : s(x,1))\
: ( c == 0 ? s(x,3) : c == 1 ? s(x,0) : c == 2 ? s(x,1) : s(x,2)))
#define fwd_rnd(y,x,k,c) (s(y,c) = (k)[c] ^ four_tables(x,t_use(f,n),fwd_var,rf1,c))
#define sb_data(w) {\
w(0x63), w(0x7c), w(0x77), w(0x7b), w(0xf2), w(0x6b), w(0x6f), w(0xc5),\
w(0x30), w(0x01), w(0x67), w(0x2b), w(0xfe), w(0xd7), w(0xab), w(0x76),\
w(0xca), w(0x82), w(0xc9), w(0x7d), w(0xfa), w(0x59), w(0x47), w(0xf0),\
w(0xad), w(0xd4), w(0xa2), w(0xaf), w(0x9c), w(0xa4), w(0x72), w(0xc0),\
w(0xb7), w(0xfd), w(0x93), w(0x26), w(0x36), w(0x3f), w(0xf7), w(0xcc),\
w(0x34), w(0xa5), w(0xe5), w(0xf1), w(0x71), w(0xd8), w(0x31), w(0x15),\
w(0x04), w(0xc7), w(0x23), w(0xc3), w(0x18), w(0x96), w(0x05), w(0x9a),\
w(0x07), w(0x12), w(0x80), w(0xe2), w(0xeb), w(0x27), w(0xb2), w(0x75),\
w(0x09), w(0x83), w(0x2c), w(0x1a), w(0x1b), w(0x6e), w(0x5a), w(0xa0),\
w(0x52), w(0x3b), w(0xd6), w(0xb3), w(0x29), w(0xe3), w(0x2f), w(0x84),\
w(0x53), w(0xd1), w(0x00), w(0xed), w(0x20), w(0xfc), w(0xb1), w(0x5b),\
w(0x6a), w(0xcb), w(0xbe), w(0x39), w(0x4a), w(0x4c), w(0x58), w(0xcf),\
w(0xd0), w(0xef), w(0xaa), w(0xfb), w(0x43), w(0x4d), w(0x33), w(0x85),\
w(0x45), w(0xf9), w(0x02), w(0x7f), w(0x50), w(0x3c), w(0x9f), w(0xa8),\
w(0x51), w(0xa3), w(0x40), w(0x8f), w(0x92), w(0x9d), w(0x38), w(0xf5),\
w(0xbc), w(0xb6), w(0xda), w(0x21), w(0x10), w(0xff), w(0xf3), w(0xd2),\
w(0xcd), w(0x0c), w(0x13), w(0xec), w(0x5f), w(0x97), w(0x44), w(0x17),\
w(0xc4), w(0xa7), w(0x7e), w(0x3d), w(0x64), w(0x5d), w(0x19), w(0x73),\
w(0x60), w(0x81), w(0x4f), w(0xdc), w(0x22), w(0x2a), w(0x90), w(0x88),\
w(0x46), w(0xee), w(0xb8), w(0x14), w(0xde), w(0x5e), w(0x0b), w(0xdb),\
w(0xe0), w(0x32), w(0x3a), w(0x0a), w(0x49), w(0x06), w(0x24), w(0x5c),\
w(0xc2), w(0xd3), w(0xac), w(0x62), w(0x91), w(0x95), w(0xe4), w(0x79),\
w(0xe7), w(0xc8), w(0x37), w(0x6d), w(0x8d), w(0xd5), w(0x4e), w(0xa9),\
w(0x6c), w(0x56), w(0xf4), w(0xea), w(0x65), w(0x7a), w(0xae), w(0x08),\
w(0xba), w(0x78), w(0x25), w(0x2e), w(0x1c), w(0xa6), w(0xb4), w(0xc6),\
w(0xe8), w(0xdd), w(0x74), w(0x1f), w(0x4b), w(0xbd), w(0x8b), w(0x8a),\
w(0x70), w(0x3e), w(0xb5), w(0x66), w(0x48), w(0x03), w(0xf6), w(0x0e),\
w(0x61), w(0x35), w(0x57), w(0xb9), w(0x86), w(0xc1), w(0x1d), w(0x9e),\
w(0xe1), w(0xf8), w(0x98), w(0x11), w(0x69), w(0xd9), w(0x8e), w(0x94),\
w(0x9b), w(0x1e), w(0x87), w(0xe9), w(0xce), w(0x55), w(0x28), w(0xdf),\
w(0x8c), w(0xa1), w(0x89), w(0x0d), w(0xbf), w(0xe6), w(0x42), w(0x68),\
w(0x41), w(0x99), w(0x2d), w(0x0f), w(0xb0), w(0x54), w(0xbb), w(0x16) }
#define rc_data(w) {\
w(0x01), w(0x02), w(0x04), w(0x08), w(0x10),w(0x20), w(0x40), w(0x80),\
w(0x1b), w(0x36) }
#define bytes2word(b0, b1, b2, b3) (((uint32_t)(b3) << 24) | \
((uint32_t)(b2) << 16) | ((uint32_t)(b1) << 8) | (b0))
#define h0(x) (x)
#define w0(p) bytes2word(p, 0, 0, 0)
#define w1(p) bytes2word(0, p, 0, 0)
#define w2(p) bytes2word(0, 0, p, 0)
#define w3(p) bytes2word(0, 0, 0, p)
#define u0(p) bytes2word(f2(p), p, p, f3(p))
#define u1(p) bytes2word(f3(p), f2(p), p, p)
#define u2(p) bytes2word(p, f3(p), f2(p), p)
#define u3(p) bytes2word(p, p, f3(p), f2(p))
#define v0(p) bytes2word(fe(p), f9(p), fd(p), fb(p))
#define v1(p) bytes2word(fb(p), fe(p), f9(p), fd(p))
#define v2(p) bytes2word(fd(p), fb(p), fe(p), f9(p))
#define v3(p) bytes2word(f9(p), fd(p), fb(p), fe(p))
#define f2(x) ((x<<1) ^ (((x>>7) & 1) * WPOLY))
#define f4(x) ((x<<2) ^ (((x>>6) & 1) * WPOLY) ^ (((x>>6) & 2) * WPOLY))
#define f8(x) ((x<<3) ^ (((x>>5) & 1) * WPOLY) ^ (((x>>5) & 2) * WPOLY) ^ (((x>>5) & 4) * WPOLY))
#define f3(x) (f2(x) ^ x)
#define f9(x) (f8(x) ^ x)
#define fb(x) (f8(x) ^ f2(x) ^ x)
#define fd(x) (f8(x) ^ f4(x) ^ x)
#define fe(x) (f8(x) ^ f4(x) ^ f2(x))
#define t_dec(m,n) t_##m##n
#define t_set(m,n) t_##m##n
#define t_use(m,n) t_##m##n
#define d_4(t,n,b,e,f,g,h) ALIGN const t n[4][256] = { b(e), b(f), b(g), b(h) }
#define four_tables(x,tab,vf,rf,c) \
(tab[0][bval(vf(x,0,c),rf(0,c))] \
^ tab[1][bval(vf(x,1,c),rf(1,c))] \
^ tab[2][bval(vf(x,2,c),rf(2,c))] \
^ tab[3][bval(vf(x,3,c),rf(3,c))])
d_4(uint32_t, t_dec(f,n), sb_data, u0, u1, u2, u3);
#if !defined(STATIC)
#define STATIC
#endif
#if !defined(INLINE)
#define INLINE
#endif
STATIC INLINE void aesb_single_round(const uint8_t *in, uint8_t *out, uint8_t *expandedKey)
{
uint32_t b0[4], b1[4];
const uint32_t *kp = (uint32_t *) expandedKey;
state_in(b0, in);
round(fwd_rnd, b1, b0, kp);
state_out(out, b1);
}
STATIC INLINE void aesb_pseudo_round(const uint8_t *in, uint8_t *out, uint8_t *expandedKey)
{
uint32_t b0[4], b1[4];
const uint32_t *kp = (uint32_t *) expandedKey;
state_in(b0, in);
round(fwd_rnd, b1, b0, kp);
round(fwd_rnd, b0, b1, kp + 1 * N_COLS);
round(fwd_rnd, b1, b0, kp + 2 * N_COLS);
round(fwd_rnd, b0, b1, kp + 3 * N_COLS);
round(fwd_rnd, b1, b0, kp + 4 * N_COLS);
round(fwd_rnd, b0, b1, kp + 5 * N_COLS);
round(fwd_rnd, b1, b0, kp + 6 * N_COLS);
round(fwd_rnd, b0, b1, kp + 7 * N_COLS);
round(fwd_rnd, b1, b0, kp + 8 * N_COLS);
round(fwd_rnd, b0, b1, kp + 9 * N_COLS);
state_out(out, b0);
}
#if defined(__cplusplus)
}
#endif
|
the_stack_data/75138206.c | #include <stdio.h>
/*
* This the program entry function. The parameters provide a means to access the
* command line arguments.
* argc - The number of command line arguments
* argv - A pointer to the first argument (text string)
*/
int main (int argc, char* argv[]) {
switch (argc) {
// In case of no extra arguments
case 1:
printf("Hello world!\n");
break;
// In case of one argument
case 2:
printf("Hello %s!\n", argv[1]);
break;
// Else
default:
printf("Wrong usage\n");
break;
}
return 0;
}
|
the_stack_data/26699293.c | /* Test for the bad usage of "nonnull" function attribute parms. */
/* */
/* { dg-do compile } */
/* { dg-options "-Wnonnull-compare" } */
#include <stddef.h>
#include <stdlib.h>
void foo(void *bar) __attribute__((nonnull(1)));
void foo(void *bar) { if (!bar) abort(); } /* { dg-warning "'nonnull' argument" "bar compared to NULL" } */
extern int func (char *, char *, char *, char *) __attribute__((nonnull));
int
func (char *cp1, char *cp2, char *cp3, char *cp4)
{
if (cp1) /* { dg-warning "'nonnull' argument" "cp1 compared to NULL" } */
return 1;
if (cp2 == NULL) /* { dg-warning "'nonnull' argument" "cp2 compared to NULL" } */
return 2;
if (NULL != cp3) /* { dg-warning "'nonnull' argument" "cp3 compared to NULL" } */
return 3;
return cp4 != 0 ? 0 : 1; /* { dg-warning "'nonnull' argument" "cp4 compared to NULL" } */
}
__attribute__((nonnull (1))) int
func2 (char *cp)
{
return (cp != NULL) ? 1 : 0; /* { dg-warning "'nonnull' argument" "cp compared to NULL" { xfail c++ } } */
}
|
the_stack_data/113378.c | //
// AOJ2006.c.c
//
//
// Created by knuu on 2014/05/13.
//
//
#include <stdio.h>
#include <string.h>
int main(void) {
int flag,i,j,num,count,maxcount[10]={0,4,2,2,2,2,2,3,2,3};
char key[10][6]={"",".,!? ","abc","def","ghi","jkl","mno","pqrs","tuv","wxyz"},input[1025];
scanf("%d",&num);
for (j=0; j<num; j++) {
scanf(" %s",input);
flag=0,count=0;
for (i=0; i<strlen(input); i++) {
if (flag==0&&input[i]=='0') {
continue;
} else if (flag==1&&input[i]=='0') {
if (count==0) {
count=maxcount[input[i-1]-'0'];
} else {
count--;
}
printf("%c",key[input[i-1]-'0'][count]);
count=0;
flag=0;
} else {
flag=1;
if (count==maxcount[input[i]-'0']) {
count=0;
} else {
count++;
}
}
}
printf("\n");
}
return 0;
} |
the_stack_data/55845.c | #include <stdio.h>
#include <stdlib.h>
#include <time.h>
#include <string.h>
#define MAX_PIPS 100
#define MAX_FREQUENCE 1000
int main(int argc, char *argv[])
{
int i, j, m, max_cycles, max_pips, cast, res = 0;
time_t t;
int pips[100] = {0};
int frequence[MAX_FREQUENCE] = {0};
max_pips = (argc > 1 ? atoi(argv[1]) : 6);
max_cycles = (argc > 2 ? atoi(argv[2]) : 10);
if (max_pips > MAX_PIPS)
max_pips = MAX_PIPS;
int cycles[max_cycles];
/* Intializes random number generator */
srand((unsigned)time(&t));
for (i = 0; i < max_cycles; i++)
{
for (cast = j = 0; j < max_pips; ++j, ++cast)
{
while (pips[m = (rand() % max_pips)] != 0)
{
cast++;
}
pips[m] = 1;
}
res += cast;
cycles[i] = cast;
for (j = 0; j < max_pips; ++j)
pips[j] = 0;
}
for (m = j = i = 0; i < max_cycles; ++i)
{
if (j < cycles[i])
j = cycles[i];
if (cycles[i] == max_pips)
m++;
frequence[cycles[i]]++;
}
printf("Gesamtläufe: %d -- Durchschnitt: %f -- maximal: %d -- Minimum: %d\n",
res, (float)res / max_cycles, j, m);
for (i = 0; i < MAX_FREQUENCE; ++i)
{
if (frequence[i])
printf("%d: %d\n", i, frequence[i]);
}
return (0);
} |
the_stack_data/132954307.c | #include <stdio.h>
#include <stdlib.h>
#include <string.h>
int extractTags(char string[]) {
char ch;
char stringAux[256] = "";
int j = 0;
for (int i = 0; i < strlen(string); i++) {
if (string[i] == '\n')
continue;
if (string[i] == '<') {
while(string[i] != '>')
i++;
} else
stringAux[j++] = string[i];
}
strcpy(string, stringAux);
return j; // the length of our new string
}
int main() {
char inputFileName[] = ".\\pag1.html";
char outputFileName[] = ".\\arquivoDeSaida.html";
FILE *f1 = fopen(inputFileName, "r");
FILE *f2 = fopen(outputFileName, "w");
char string[256];
while(fgets(string, 256, f1)) {
if (extractTags(string)) {
fprintf(f2, "%s\n", string);
}
}
puts("Pronto, agora e so conferir o arquivo de saida");
fclose(f1);
fclose(f2);
return 0;
}
|
the_stack_data/572112.c | #if 0
#include <stdio.h>
#include <stdint.h>
#include <stdbool.h>
#include <stdlib.h>
#include <assert.h>
void rill_print_int32(int32_t v)
{
printf("%d", v);
fflush(stdout);
}
void rill_print_uint32(uint32_t v)
{
printf("%u", v);
fflush(stdout);
}
void rill_print_bool(bool v)
{
printf("%b", v);
fflush(stdout);
}
void rill_print_char(char v)
{
printf("%c", v);
fflush(stdout);
}
void rill_print_string(char const* v)
{
printf("%s", v);
fflush(stdout);
}
void rill_println_string(char const* v)
{
printf("%s\n", v);
fflush(stdout);
}
void rill_print_addr(void const* v)
{
printf("%p\n", v);
fflush(stdout);
}
void rill_assert(bool b)
{
assert( b );
}
int32_t rill_read_int32()
{
int32_t i;
scanf("%d", &i);
return i;
}
char rill_read_char()
{
char c;
scanf("%c", &c);
return c;
}
#endif
|
the_stack_data/98576244.c | #include <stdio.h>
#include <unistd.h>
int main (int argc, char *argv[]) {
char buffer[4096];
ssize_t nbytes;
FILE *fp = fopen("/tmp/code.ijs", "w");
if (fp == 0)
return 1;
if (argc > 1 && strcmp(argv[1], "-v") == 0) {
argv[1] = "/tmp/code.ijs";
fputs("echo JLIB", fp);
}
else {
while ((nbytes = fread(buffer, sizeof(char), sizeof(buffer), stdin)) > 0)
if (fwrite(buffer, sizeof(char), nbytes, fp) != nbytes)
return 2;
}
fclose(fp);
execv("/usr/bin/jconsole", argv);
perror("execv");
}
|
the_stack_data/1202640.c | #include <errno.h>
#include <stdbool.h>
#include <stdint.h>
#include <stdlib.h>
static int digit(char c)
{
if ('0' <= c && c <= '9') {
return (c - '0');
} else if ('a' <= c && c <= 'z') {
return ((c - 'a') + 10);
} else if ('A' <= c && c <= 'Z') {
return ((c - 'A') + 10);
} else {
return -1;
}
}
static bool is_digit(char c, int base)
{
return digit(c) < base;
}
long long int strtoll(const char *nptr, char **endptr, int base)
{
long long int ret = 0;
bool neg = false;
if (base == 0) {
// TODO: Bullshit auto-detection that is apparently expected.
}
if (base < 2 || base > 36) {
// TODO: errno = EINVAL;
return -1;
}
if(*nptr == '-') {
neg = true;
nptr++;
}
for(; is_digit(*nptr, base); nptr++) {
int d = digit(*nptr);
if (d == -1) {
// TODO: errno = ERANGE;
if (endptr != NULL) {
*endptr = (char*)nptr;
}
break;
}
ret = base * ret + d;
}
if(endptr != NULL) {
*endptr = (char*)nptr;
}
return neg ? -ret : ret;
}
long int strtol(const char *nptr, char **endptr, int base)
{
return (long int)strtoll(nptr, endptr, base);
}
int atoi(const char *nptr)
{
return (int)strtol(nptr, NULL, 10);
}
long atol(const char *nptr)
{
return (long)strtoll(nptr, NULL, 10);
}
long long atoll(const char *nptr)
{
return strtoll(nptr, NULL, 10);
}
|
the_stack_data/200143761.c | /*
Project 35
Create, in C language, an algorithm that operates a calculator, performing the
four basic mathematical operations. A menu should appear on the screen
the 4 options, and the user will choose the option they want. For the choice of
operation, use the conditional IF (if).
Menu Example:
1 - addition;
2 - subtraction;
3 - multiplication;
4 - division.
****************************************************
Output:
Calculator v1 - Welcome!
Please, Enter the first number: 1
Now, the second number: 2
Menu
1 - Addition
2 - Subtraction
3 - Multiplication
4 - Division
Please, choose the required option: 1
The result of Addition is: 3.00
****************************************************
Author: Borin (https://br.linkedin.com/in/borinvini)
Edited by j3
Date: First Day, 07/2020
*/
#include <stdio.h>
float x, y, res;
int opr, c;
main()
{
printf("Calculator v1 - Welcome!\n");
printf("Please, Enter the first number: ");
scanf("%f", &x);
while ((c = getchar())!= '\n' && c != EOF) { }
printf("Now, the second number: ");
scanf("%f", &y);
while ((c = getchar())!= '\n' && c != EOF) { }
printf("\n\tMenu\n");
printf("1 - Addition\n");
printf("2 - Subtraction\n");
printf("3 - Multiplication\n");
printf("4 - Division\n\n");
printf("Please, choose the required option: ");
scanf("%i", &opr);
while ((c = getchar())!= '\n' && c != EOF) { }
if(opr == 1)
{
// Addition
res = x + y;
printf("The result of Addition is: %.2f", res);
} else
{
if( opr == 2)
{
// Subtraction
res = x - y;
printf("The result of Subtraction is: %.2f", res);
}
else
{
if(opr == 3 )
{
// Multiplication
res = x * y;
printf("The result of Multiplication is: %.2f", res);
}
else
{
// Division
res = x / y;
printf("The result of Division is: %.2f", res);
}
}
}
//system("pause");
return 0;
}
|
the_stack_data/206392550.c | /* main.c
*
* simple opencl example.
* reference:
* https://www.fixstars.com/en/opencl/book/OpenCLProgrammingBook/first-opencl-program/
*/
#include <stdio.h>
#include <stdlib.h>
#ifdef __APPLE__
#include <OpenCL/opencl.h>
#else
#include <CL/cl.h>
#endif
#ifdef AOCL
#include "CL/opencl.h"
#include "AOCLUtils/aocl_utils.h"
using namespace aocl_utils;
void cleanup();
#endif
#define MEM_SIZE (128)
#define MAX_SOURCE_SIZE (0x100000)
int main()
{
cl_device_id device_id = NULL;
cl_context context = NULL;
cl_command_queue command_queue = NULL;
cl_mem memobj = NULL;
cl_program program = NULL;
cl_kernel kernel = NULL;
cl_platform_id platform_id = NULL;
cl_uint ret_num_devices;
cl_uint ret_num_platforms;
cl_int ret;
char string[MEM_SIZE];
FILE *fp;
char fileName[] = "./mykernel.cl";
char *source_str;
size_t source_size;
/* Load the source code containing the kernel*/
fp = fopen(fileName, "r");
if (!fp) {
fprintf(stderr, "Failed to load kernel.\n");
exit(1);
}
source_str = (char*)malloc(MAX_SOURCE_SIZE);
source_size = fread(source_str, 1, MAX_SOURCE_SIZE, fp);
fclose(fp);
/* Get Platform and Device Info */
ret = clGetPlatformIDs(1, &platform_id, &ret_num_platforms);
ret = clGetDeviceIDs(platform_id, CL_DEVICE_TYPE_DEFAULT, 1, &device_id, &ret_num_devices);
/* Create OpenCL context */
context = clCreateContext(NULL, 1, &device_id, NULL, NULL, &ret);
/* Create Command Queue */
command_queue = clCreateCommandQueue(context, device_id, 0, &ret);
/* Create Memory Buffer */
memobj = clCreateBuffer(context, CL_MEM_READ_WRITE,MEM_SIZE * sizeof(char), NULL, &ret);
/* Create Kernel Program from the source */
program = clCreateProgramWithSource(context, 1, (const char **)&source_str,
(const size_t *)&source_size, &ret);
/* Build Kernel Program */
ret = clBuildProgram(program, 1, &device_id, NULL, NULL, NULL);
/* Create OpenCL Kernel */
kernel = clCreateKernel(program, "hello", &ret);
/* Set OpenCL Kernel Parameters */
ret = clSetKernelArg(kernel, 0, sizeof(cl_mem), (void *)&memobj);
/* Execute OpenCL Kernel */
ret = clEnqueueTask(command_queue, kernel, 0, NULL,NULL);
/* Copy results from the memory buffer */
ret = clEnqueueReadBuffer(command_queue, memobj, CL_TRUE, 0,
MEM_SIZE * sizeof(char),string, 0, NULL, NULL);
/* Display Result */
puts(string);
/* Finalization */
ret = clFlush(command_queue);
ret = clFinish(command_queue);
ret = clReleaseKernel(kernel);
ret = clReleaseProgram(program);
ret = clReleaseMemObject(memobj);
ret = clReleaseCommandQueue(command_queue);
ret = clReleaseContext(context);
free(source_str);
return 0;
}
#ifdef AOCL
// Altera OpenCL needs this callback function implemented in main.c
// Free the resources allocated during initialization
void cleanup() {
}
#endif
|
the_stack_data/90716.c | #include <unistd.h>
#include <stdio.h>
#include <stdlib.h>
#include <string.h>
#include <sys/ptrace.h>
static int detect_ptrace2()
{
int ret = 0;
asm("xorl %ebx, %ebx\n" // %ebx = 0
"movl %ebx, %ecx\n" // movl %ebx, %ecx
"movl %ebx, %edx\n" // %edx = 0
"incl %ecx\n" // %ecx = 1
"movl $0x1A, %eax\n" // ptrace
"int $0x80\n" // s y s c a l l
"movl %eax,-4(%ebp )\n" // addr ret
);
return ret;
} |
the_stack_data/18812.c | /* { dg-do compile } */
/* { dg-options "-O0 -Werror-implicit-function-declaration -mmmx" } */
/* { dg-add-options bind_pic_locally } */
/* Test that the intrinsics compile without optimization. All of them are
defined as inline functions in mmintrin.h that reference the proper
builtin functions. Defining away "extern" and "__inline" results in
all of them being compiled as proper functions. */
#define extern
#define __inline
#include <mmintrin.h>
|
the_stack_data/36075960.c | #include <stdarg.h>
#include <stdio.h>
#include <stdlib.h>
#include <time.h>
#define MIN_ELEMENT 1
#define MAX_ELEMENT 1000000
int sum (int count,...) {
va_list arr;
int sum = 0;
va_start(arr, count);
while (count--){
sum += va_arg(arr, int);
}
return sum;
}
int min(int count,...) {
va_list arr;
int min = MIN_ELEMENT;
va_start(arr, count);
while (count--){
if (min > va_arg(arr, int))
min = va_arg(arr, int);
}
return min;
}
int max(int count,...) {
va_list arr;
int max = MAX_ELEMENT;
va_start(arr, count);
while (count--){
if (max < va_arg(arr, int))
max = va_arg(arr, int);
}
return max;
}
int test_implementations_by_sending_three_elements() {
srand(time(NULL));
int elements[3];
elements[0] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[1] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[2] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
fprintf(stderr, "Sending following three elements:\n");
for (int i = 0; i < 3; i++) {
fprintf(stderr, "%d\n", elements[i]);
}
int elements_sum = sum(3, elements[0], elements[1], elements[2]);
int minimum_element = min(3, elements[0], elements[1], elements[2]);
int maximum_element = max(3, elements[0], elements[1], elements[2]);
fprintf(stderr, "Your output is:\n");
fprintf(stderr, "Elements sum is %d\n", elements_sum);
fprintf(stderr, "Minimum element is %d\n", minimum_element);
fprintf(stderr, "Maximum element is %d\n\n", maximum_element);
int expected_elements_sum = 0;
for (int i = 0; i < 3; i++) {
if (elements[i] < minimum_element) {
return 0;
}
if (elements[i] > maximum_element) {
return 0;
}
expected_elements_sum += elements[i];
}
return elements_sum == expected_elements_sum;
}
int test_implementations_by_sending_five_elements() {
srand(time(NULL));
int elements[5];
elements[0] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[1] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[2] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[3] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[4] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
fprintf(stderr, "Sending following five elements:\n");
for (int i = 0; i < 5; i++) {
fprintf(stderr, "%d\n", elements[i]);
}
int elements_sum = sum(5, elements[0], elements[1], elements[2], elements[3], elements[4]);
int minimum_element = min(5, elements[0], elements[1], elements[2], elements[3], elements[4]);
int maximum_element = max(5, elements[0], elements[1], elements[2], elements[3], elements[4]);
fprintf(stderr, "Your output is:\n");
fprintf(stderr, "Elements sum is %d\n", elements_sum);
fprintf(stderr, "Minimum element is %d\n", minimum_element);
fprintf(stderr, "Maximum element is %d\n\n", maximum_element);
int expected_elements_sum = 0;
for (int i = 0; i < 5; i++) {
if (elements[i] < minimum_element) {
return 0;
}
if (elements[i] > maximum_element) {
return 0;
}
expected_elements_sum += elements[i];
}
return elements_sum == expected_elements_sum;
}
int test_implementations_by_sending_ten_elements() {
srand(time(NULL));
int elements[10];
elements[0] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[1] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[2] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[3] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[4] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[5] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[6] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[7] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[8] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
elements[9] = rand() % (MAX_ELEMENT - MIN_ELEMENT + 1) + MIN_ELEMENT;
fprintf(stderr, "Sending following ten elements:\n");
for (int i = 0; i < 10; i++) {
fprintf(stderr, "%d\n", elements[i]);
}
int elements_sum = sum(10, elements[0], elements[1], elements[2], elements[3], elements[4],
elements[5], elements[6], elements[7], elements[8], elements[9]);
int minimum_element = min(10, elements[0], elements[1], elements[2], elements[3], elements[4],
elements[5], elements[6], elements[7], elements[8], elements[9]);
int maximum_element = max(10, elements[0], elements[1], elements[2], elements[3], elements[4],
elements[5], elements[6], elements[7], elements[8], elements[9]);
fprintf(stderr, "Your output is:\n");
fprintf(stderr, "Elements sum is %d\n", elements_sum);
fprintf(stderr, "Minimum element is %d\n", minimum_element);
fprintf(stderr, "Maximum element is %d\n\n", maximum_element);
int expected_elements_sum = 0;
for (int i = 0; i < 10; i++) {
if (elements[i] < minimum_element) {
return 0;
}
if (elements[i] > maximum_element) {
return 0;
}
expected_elements_sum += elements[i];
}
return elements_sum == expected_elements_sum;
}
int main ()
{
int number_of_test_cases;
scanf("%d", &number_of_test_cases);
while (number_of_test_cases--) {
if (test_implementations_by_sending_three_elements()) {
printf("Correct Answer\n");
} else {
printf("Wrong Answer\n");
}
if (test_implementations_by_sending_five_elements()) {
printf("Correct Answer\n");
} else {
printf("Wrong Answer\n");
}
if (test_implementations_by_sending_ten_elements()) {
printf("Correct Answer\n");
} else {
printf("Wrong Answer\n");
}
}
return 0;
} |
the_stack_data/18888259.c | /* Special Pythagorean Triplet
A Pythagorean triplet is a set of three natural numbers, a < b < c, for which,
a^2 + b^2 = c^2
For example, 3^2 + 4^2 = 9 + 16 = 25 = 5^2.
There exists exactly one Pythagorean triplet for which a + b + c = 1000.
Find the product abc.
*/
#include <stdio.h>
int main(void) {
long c, sum;
long count1, count2;
for (count1 = 1; count1 <= 1000; count1++) {
for (count2 = 1; count2 <= count1; count2++) {
c = 1000 - (count1 + count2);
sum = count1 * count1 + count2 * count2;
//printf("%li %li = %li\n", count1 * count1, count2 * count2, c * c);
if ((c * c ) == sum)
break;
}
}
printf("%li %li %li\n", count1, count2, c);
} |
the_stack_data/70250.c | // REQUIRES: powerpc-registered-target
// RUN: %clang_cc1 -O2 -triple powerpc64-unknown-linux-gnu \
// RUN: -emit-llvm %s -o - -target-cpu pwr7 | \
// RUN: FileCheck %s
// RUN: %clang_cc1 -O2 -triple powerpc64le-unknown-linux-gnu \
// RUN: -emit-llvm %s -o - -target-cpu pwr8 | \
// RUN: FileCheck %s
// RUN: %clang_cc1 -O2 -triple powerpc-unknown-aix \
// RUN: -emit-llvm %s -o - -target-cpu pwr7 | \
// RUN: FileCheck %s
// RUN: %clang_cc1 -O2 -triple powerpc64-unknown-aix \
// RUN: -emit-llvm %s -o - -target-cpu pwr7 | \
// RUN: FileCheck %s
extern int ia, ib;
// td
void test_tw(void) {
// CHECK: void @llvm.ppc.tw(i32 %0, i32 %1, i32 1)
__builtin_ppc_tw(ia, ib, 1);
}
void test_xl_tw(void) {
// CHECK: void @llvm.ppc.tw(i32 %0, i32 %1, i32 1)
__tw(ia, ib, 1);
}
// trap
void test_trap(void) {
// CHECK: void @llvm.ppc.trap(i32 %0)
__builtin_ppc_trap(ia);
}
void test_xl_trap(void) {
// CHECK: void @llvm.ppc.trap(i32 %0)
__trap(ia);
}
|
the_stack_data/57516.c | // RUN: %clang_cc1 -triple x86_64-apple-darwin10 -emit-llvm -o - %s | FileCheck %s
void test0() {
// CHECK-LABEL: define void @test0()
// CHECK: [[F:%.*]] = alloca float
// CHECK-NEXT: [[REAL:%.*]] = load volatile float, float* getelementptr inbounds (%complex._ZTSf, %complex._ZTSf* @test0_v, i32 0, i32 0), align 4
// CHECK-NEXT: load volatile float, float* getelementptr inbounds ({{.*}} @test0_v, i32 0, i32 1), align 4
// CHECK-NEXT: store float [[REAL]], float* [[F]], align 4
// CHECK-NEXT: ret void
extern volatile _Complex float test0_v;
float f = (float) test0_v;
}
void test1() {
// CHECK-LABEL: define void @test1()
// CHECK: [[REAL:%.*]] = load volatile float, float* getelementptr inbounds ({{.*}} @test1_v, i32 0, i32 0), align 4
// CHECK-NEXT: [[IMAG:%.*]] = load volatile float, float* getelementptr inbounds ({{.*}} @test1_v, i32 0, i32 1), align 4
// CHECK-NEXT: store volatile float [[REAL]], float* getelementptr inbounds ({{.*}} @test1_v, i32 0, i32 0), align 4
// CHECK-NEXT: store volatile float [[IMAG]], float* getelementptr inbounds ({{.*}} @test1_v, i32 0, i32 1), align 4
// CHECK-NEXT: ret void
extern volatile _Complex float test1_v;
test1_v = test1_v;
}
|
the_stack_data/696624.c | /******************************************************************************
* FILE: omp_reduction.c
* DESCRIPTION:
* OpenMP Example - Combined Parallel Loop Reduction - C/C++ Version
* This example demonstrates a sum reduction within a combined parallel loop
* construct. Notice that default data element scoping is assumed - there
* are no clauses specifying shared or private variables. OpenMP will
* automatically make loop index variables private within team threads, and
* global variables shared.
* AUTHOR: Blaise Barney 5/99
* LAST REVISED: 04/06/05
******************************************************************************/
/**
* This program computes the dot product of two vectors.
* Online source:
* https://computing.llnl.gov/tutorials/openMP/samples/C/omp_reduction.c
**/
#include <omp.h>
#include <stdio.h>
#include <stdlib.h>
int main (int argc, char *argv[])
{
int i, n;
float a[8], b[8], sum;
/* Some initializations */
n = 8;
for (i=0; i < n; i++)
a[i] = b[i] = i * 1.0;
sum = 0.0;
#pragma omp parallel for reduction(+:sum)
for (i=0; i < n; i++){
sum = sum + (a[i] * b[i]);
printf("loop %d\n", i);
}
printf(" Sum = %f\n",sum);
}
|
the_stack_data/326.c | #include <stdio.h>
main()
{
int c;
while(1) {
c=getchar();
if (c==EOF) exit(1);
if (c != '<') putchar(c);
else
while (c != '>') {
c=getchar();
if (c==EOF) exit(1);
}
}
}
|
the_stack_data/22012492.c | /* fastcopy.c 1.1 86/01/12 */
/* fastcopy.c */
#define BSIZE 1024
#define FACTOR 32 /* 32k bytes in one i/o */
char buffer[BSIZE * FACTOR];
main()
{
char in_dev[50];
char out_dev[50];
char blocks[50];
register int input;
register int output;
register int count;
register int firstread = 1;
register int blk_siz = BSIZE * FACTOR;
register int blk_num = 0;
register int read_count = 0;
register int write_count = 0;
register int transfers = 0;
in_dev[0] = 0;
out_dev[0] = 0;
blocks[0] = 0;
for(;;) {
/* get input and output devices */
printf("Source device : ");
gets(in_dev);
if((input = open(in_dev, 0)) > 0)
break;
printf("Cannot open input file '%s'\n", in_dev);
}
for(;;) {
printf("Copy to device : ");
gets(out_dev);
if((output = open(out_dev, 1)) > 0)
break;
printf("Cannot open output file '%s'\n", out_dev);
}
for(;;) {
printf("Number of blocks : ");
gets(blocks);
count = number(blocks);
if(count > 0)
break;
}
printf("\nCopy %d blocks from %s to %s\n", count, in_dev, out_dev);
do {
if ((transfers > 0) && !(transfers % 25))
printf("%d blocks\n", blk_num);
transfers++;
read_count = read(input, buffer,
((count*BSIZE) > blk_siz) ? blk_siz : count*BSIZE);
if (firstread) {
if (read_count != blk_siz) {
blk_siz = read_count;
}
firstread = 0;
printf("Block size from input = %d bytes\n", blk_siz);
}
if (read_count > 0) {
if (read_count != blk_siz)
printf("Short read! Block %d: %d read, %d bytes requested\n", blk_num, read_count, blk_siz);
write_count = write(output, buffer, read_count);
if (write_count != read_count)
printf("Short write! Block %d: %d bytes written of %d bytes possible\n", blk_num, write_count, read_count);
count -= read_count / BSIZE;
blk_num += read_count / BSIZE;
}
} while((read_count > 0) && (write_count > 0) && (count > 0));
printf ("Total of %d blocks copied\n", blk_num);
close(input);
close(output);
}
int number (response)
char *response;
{
int total;
total = 0;
while (*response == ' ' || *response == '\t') response++;
while (*response >= '0' && *response <= '9') {
total = total * 10 + (*response - '0');
response++;
}
return (total);
}
|
the_stack_data/520009.c | //
// main.c
// words
//
// Created by xiaonizi on 2018/5/21.
// Copyright © 2018年 xiaonizi. All rights reserved.
//
#include <stdio.h>
#include <string.h>
#include <stdlib.h>
struct node{
char word[20];
int count;
struct node *lchild, *rchild;
};
typedef struct node Node;
Node *root;
void tolowercase(char word[]){
int i=0;
while(word[i]!='\0'){
if(word[i]>='A' && word[i] <= 'Z')
word[i]+=32;
i++;
}
}
Node* insert(Node *p, char word[]){
if(p == NULL){
p = (Node *)malloc(sizeof(Node));
strcpy(p->word, word);
p->count=1;
p->lchild=NULL;
p->rchild=NULL;
}
else if(strcmp(p->word, word) == 0){
p -> count++;
}
else if (strcmp(p->word, word) > 0){
p->lchild = insert(p->lchild, word);
}
else{
p->rchild = insert(p->rchild, word);
}
return p;
}
void output(Node *node){
if(node != NULL){
output(node->lchild);
printf("%s %d\n", node->word, node->count);
output(node->rchild);
}
}
int main() {
char letter, word[20];
int i=0;
root = NULL;
FILE *fp = fopen("article.txt", "r");
while((letter = fgetc(fp)) != EOF){
if((letter >= 'A' && letter <= 'Z') || (letter >= 'a' && letter <= 'z')){
while((letter >= 'A' && letter <= 'Z') || (letter >= 'a' && letter <= 'z')){
word[i++] = letter;
letter = fgetc(fp);
}
word[i]='\0';
i=0;
tolowercase(word);
root = insert(root, word);
}
}
fclose(fp);
Node *temp = root;
for(i = 0; i < 3; i++){
if(temp != NULL){
printf("%s", temp->word);
if(temp -> rchild != NULL && i<2){
printf(" ");
}
else{
printf("\n");
}
temp = temp->rchild;
}
}
output(root);
return 0;
}
|
the_stack_data/181391914.c | /*
* POK header
*
* The following file is a part of the POK project. Any modification should
* be made according to the POK licence. You CANNOT use this file or a part
* of a file for your own project.
*
* For more information on the POK licence, please see our LICENCE FILE
*
* Please follow the coding guidelines described in doc/CODING_GUIDELINES
*
* Copyright (c) 2007-2022 POK team
*/
/* @(#)s_tanh.c 5.1 93/09/24 */
/*
* ====================================================
* Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
*
* Developed at SunPro, a Sun Microsystems, Inc. business.
* Permission to use, copy, modify, and distribute this
* software is freely granted, provided that this notice
* is preserved.
* ====================================================
*/
#ifdef POK_NEEDS_LIBMATH
/* Tanh(x)
* Return the Hyperbolic Tangent of x
*
* Method :
* x -x
* e - e
* 0. tanh(x) is defined to be -----------
* x -x
* e + e
* 1. reduce x to non-negative by tanh(-x) = -tanh(x).
* 2. 0 <= x <= 2**-55 : tanh(x) := x*(one+x)
* -t
* 2**-55 < x <= 1 : tanh(x) := -----; t = expm1(-2x)
* t + 2
* 2
* 1 <= x <= 22.0 : tanh(x) := 1- ----- ; t=expm1(2x)
* t + 2
* 22.0 < x <= INF : tanh(x) := 1.
*
* Special cases:
* tanh(NaN) is NaN;
* only tanh(0)=0 is exact for finite argument.
*/
#include "math_private.h"
#include <libm.h>
static const double one = 1.0, two = 2.0, tiny = 1.0e-300;
double tanh(double x) {
double t, z;
int32_t jx, ix;
/* High word of |x|. */
GET_HIGH_WORD(jx, x);
ix = jx & 0x7fffffff;
/* x is INF or NaN */
if (ix >= 0x7ff00000) {
if (jx >= 0)
return one / x + one; /* tanh(+-inf)=+-1 */
else
return one / x - one; /* tanh(NaN) = NaN */
}
/* |x| < 22 */
if (ix < 0x40360000) { /* |x|<22 */
if (ix < 0x3c800000) /* |x|<2**-55 */
return x * (one + x); /* tanh(small) = small */
if (ix >= 0x3ff00000) { /* |x|>=1 */
t = expm1(two * fabs(x));
z = one - two / (t + two);
} else {
t = expm1(-two * fabs(x));
z = -t / (t + two);
}
/* |x| > 22, return +-1 */
} else {
z = one - tiny; /* raised inexact flag */
}
return (jx >= 0) ? z : -z;
}
#endif
|
the_stack_data/141263.c | #define _BSD_SOURCE
#include <ncurses.h>
#include <stdlib.h>
#include <time.h>
#define MAX 23
int main(void)
{
WINDOW *alpha;
int rows[MAX];
int c,r,total;
srandom((unsigned)time(NULL)); /* seed randomizer */
for(c=0;c<MAX;c++) /* initialize array */
rows[c] = 0;
total = 0; /* initialize counter */
/* Curses setup stuff */
initscr();
start_color();
init_pair(1,COLOR_WHITE,COLOR_BLUE);
alpha = newwin(0,0,0,0);
wbkgd(alpha,COLOR_PAIR(1));
untouchwin(alpha); /* pretend win is updated */
addstr("Press Enter to touch and display window alpha\n");
refresh();
getch();
/* Loop to gradually reveal the blue window */
while(total<=MAX)
{
r = random() % (MAX + 1);
if( rows[r]==0 )
{
rows[r] = 1;
touchline(alpha,r,1);
wrefresh(alpha); /* update the line */
napms(100); /* pause 1/10 sec */
total++;
}
}
getch();
endwin();
return 0;
}
|
the_stack_data/93888314.c |
struct X {};
typeof(struct X) X_array[42];
void foobar(void)
{
typeof(&X_array) __ptr;
}
|
the_stack_data/689768.c | #include <stdio.h>
int S[4] = {};
void solve() {
int n, p;
scanf("%i%i", &n, &p);
int i;
for (i = 0; i < p; ++i) S[i] = 0;
int x;
for (i = 0; i < n; ++i) {
scanf("%i", &x);
S[x % p]++;
}
int res = 0;
if (p == 2) {
res = S[0] + (S[1] + 1) / 2;
}
else if (p == 3) {
res = S[0];
int min = S[1];
if (S[2] < min) min = S[2];
res += min;
S[1] -= min;
S[2] -= min;
res += (S[1] + 2) / 3;
res += (S[2] + 2) / 3;
}
printf("%i\n", res);
}
int main() {
freopen("a.in", "r", stdin);
freopen("a.out", "w", stdout);
int t, ti;
scanf("%i", &t);
for (ti = 1; ti <= t; ++ti) {
printf("Case #%i: ", ti);
solve();
}
}
|
the_stack_data/129821.c | #include <sys/types.h>
#include <sys/stat.h>
#include <stdlib.h>
#include <stdio.h>
#include <dirent.h>
#include <errno.h>
int main(void)
{
int res = mkdir("/sandbox/a", 0755);
if (res != 0) {
exit(1);
}
res = mkdir("/sandbox/b", 0755);
if (res != 0) {
exit(2);
}
res = mkdir("/sandbox/c", 0755);
if (res != 0) {
exit(3);
}
DIR* dir = opendir("/sandbox");
if (dir == NULL) {
printf("opendir failed: %d\n", errno);
exit(4);
}
res = 0;
struct dirent * entry = NULL;
while ((entry = readdir(dir)) != NULL) {
if (entry->d_name[0] == '.') {
res += 1000;
} else {
res++;
}
}
if (res != 2003) {
printf("readdir result: %d, errno: %d\n", res, errno);
exit(5);
}
res = closedir(dir);
if (res != 0) {
exit(6);
}
exit(0);
}
|
the_stack_data/93887302.c | #include <stdio.h>
int main() {
int v;
scanf("%d", &v);
printf("Speed: %d - %s", v, v <= 60 ? "OK" : "Speeding");
return 0;
} |
the_stack_data/154830056.c | #include <stdio.h>
#include <sys/types.h>
#include <sys/stat.h>
#include <fcntl.h>
#include <stdlib.h>
int main()
{
int testdev;
int i, ret;
char buf[15];
testdev = open("/dev/mapfile", O_RDWR);
if (-1 == testdev) {
printf("cannot open file.\n");
exit(1);
}
if (ret = read(testdev, buf, 15) < 15) {
printf("read error!\n");
exit(1);
}
printf("%s\n", buf);
close(testdev);
return 0;
}
|
the_stack_data/211080292.c | /*An Efficient code to print all the sum of all numbers that are multiples of 3 & 5 below N.*/
/********************************************************************************************
author - siddharth pandey
****************************************************************************************/
#include <stdio.h>
int main(){
int t;
printf("Enter number of times you want to try");
scanf("%d",&t);
while(t--)
{
unsigned long long N,p=0,sum=0;
printf("Enter the value of N ");
scanf("%lld",&N); //Take input of N from user
p = (N-1)/3;
sum = ((3*p*(p+1))/2);
p = (N-1)/5;
sum = sum + ((5*p*(p+1))/2);
p = (N-1)/15;
sum = sum - ((15*p*(p+1))/2);
printf("%lld\n", sum); //print the sum of all numbers that are multiples of 3 & 5 below N
}
return 0;
}
|
the_stack_data/126837.c |
/*
SipHash reference C implementation
Copyright (c) 2016 Jean-Philippe Aumasson <[email protected]>
To the extent possible under law, the author(s) have dedicated all copyright
and related and neighboring rights to this software to the public domain
worldwide. This software is distributed without any warranty.
You should have received a copy of the CC0 Public Domain Dedication along
with
this software. If not, see
<http://creativecommons.org/publicdomain/zero/1.0/>.
*/
#include <assert.h>
#include <inttypes.h>
#include <stdint.h>
#include <stdio.h>
#include <string.h>
/* default: SipHash-2-4 */
#ifndef cROUNDS
#define cROUNDS 2
#endif
#ifndef dROUNDS
#define dROUNDS 4
#endif
#define ROTL(x, b) (uint32_t)(((x) << (b)) | ((x) >> (32 - (b))))
#define U32TO8_LE(p, v) \
(p)[0] = (uint8_t)((v)); \
(p)[1] = (uint8_t)((v) >> 8); \
(p)[2] = (uint8_t)((v) >> 16); \
(p)[3] = (uint8_t)((v) >> 24);
#define U8TO32_LE(p) \
(((uint32_t)((p)[0])) | ((uint32_t)((p)[1]) << 8) | \
((uint32_t)((p)[2]) << 16) | ((uint32_t)((p)[3]) << 24))
#define SIPROUND \
do { \
v0 += v1; \
v1 = ROTL(v1, 5); \
v1 ^= v0; \
v0 = ROTL(v0, 16); \
v2 += v3; \
v3 = ROTL(v3, 8); \
v3 ^= v2; \
v0 += v3; \
v3 = ROTL(v3, 7); \
v3 ^= v0; \
v2 += v1; \
v1 = ROTL(v1, 13); \
v1 ^= v2; \
v2 = ROTL(v2, 16); \
} while (0)
#ifdef DEBUG
#define TRACE \
do { \
printf("(%3zu) v0 %08" PRIx32 "\n", inlen, v0); \
printf("(%3zu) v1 %08" PRIx32 "\n", inlen, v1); \
printf("(%3zu) v2 %08" PRIx32 "\n", inlen, v2); \
printf("(%3zu) v3 %08" PRIx32 "\n", inlen, v3); \
} while (0)
#else
#define TRACE
#endif
int halfsiphash(const void *in, const size_t inlen, const void *k, uint8_t *out,
const size_t outlen) {
const unsigned char *ni = (const unsigned char *)in;
const unsigned char *kk = (const unsigned char *)k;
assert((outlen == 4) || (outlen == 8));
uint32_t v0 = 0;
uint32_t v1 = 0;
uint32_t v2 = UINT32_C(0x6c796765);
uint32_t v3 = UINT32_C(0x74656462);
uint32_t k0 = U8TO32_LE(kk);
uint32_t k1 = U8TO32_LE(kk + 4);
uint32_t m;
int i;
const unsigned char *end = ni + inlen - (inlen % sizeof(uint32_t));
const int left = inlen & 3;
uint32_t b = ((uint32_t)inlen) << 24;
v3 ^= k1;
v2 ^= k0;
v1 ^= k1;
v0 ^= k0;
if (outlen == 8)
v1 ^= 0xee;
for (; ni != end; ni += 4) {
m = U8TO32_LE(ni);
v3 ^= m;
TRACE;
for (i = 0; i < cROUNDS; ++i)
SIPROUND;
v0 ^= m;
}
switch (left) {
case 3:
b |= ((uint32_t)ni[2]) << 16;
case 2:
b |= ((uint32_t)ni[1]) << 8;
case 1:
b |= ((uint32_t)ni[0]);
break;
case 0:
break;
}
v3 ^= b;
TRACE;
for (i = 0; i < cROUNDS; ++i)
SIPROUND;
v0 ^= b;
if (outlen == 8)
v2 ^= 0xee;
else
v2 ^= 0xff;
TRACE;
for (i = 0; i < dROUNDS; ++i)
SIPROUND;
b = v1 ^ v3;
U32TO8_LE(out, b);
if (outlen == 4)
return 0;
v1 ^= 0xdd;
TRACE;
for (i = 0; i < dROUNDS; ++i)
SIPROUND;
b = v1 ^ v3;
U32TO8_LE(out + 4, b);
return 0;
}
|
the_stack_data/1038259.c | #ifdef STM32F0xx
#include "stm32f0xx_hal_pcd.c"
#elif STM32F1xx
#include "stm32f1xx_hal_pcd.c"
#elif STM32F2xx
#include "stm32f2xx_hal_pcd.c"
#elif STM32F3xx
#include "stm32f3xx_hal_pcd.c"
#elif STM32F4xx
#include "stm32f4xx_hal_pcd.c"
#elif STM32F7xx
#include "stm32f7xx_hal_pcd.c"
#elif STM32G0xx
#include "stm32g0xx_hal_pcd.c"
#elif STM32G4xx
#include "stm32g4xx_hal_pcd.c"
#elif STM32H7xx
#include "stm32h7xx_hal_pcd.c"
#elif STM32L0xx
#include "stm32l0xx_hal_pcd.c"
#elif STM32L1xx
#include "stm32l1xx_hal_pcd.c"
#elif STM32L4xx
#include "stm32l4xx_hal_pcd.c"
#elif STM32L5xx
#include "stm32l5xx_hal_pcd.c"
#elif STM32WBxx
#include "stm32wbxx_hal_pcd.c"
#endif
|
the_stack_data/168894182.c | /* { dg-skip-if "not yet" { c++ } } */
int i, j, k;
extern int foo (void);
void
f1 (void)
{
#pragma acc parallel
#pragma acc loop collapse (2)
for (i = 0; i < 5; i++)
; /* { dg-error "not enough perfectly nested" } */
{
for (j = 0; j < 5; j++)
;
}
}
void
f2 (void)
{
#pragma acc parallel
#pragma acc loop collapse (2)
for (i = 0; i < 5; i++)
{
{
{
for (j = 0; j < 5; j++)
{
}
}
}
}
}
void
f3 (void)
{
#pragma acc parallel
#pragma acc loop collapse (2)
for (i = 0; i < 5; i++)
{
int k = foo (); /* { dg-error "not enough perfectly nested" } */
{
{
for (j = 0; j < 5; j++)
{
}
}
}
}
}
void
f4 (void)
{
#pragma acc parallel
#pragma acc loop collapse (2)
for (i = 0; i < 5; i++)
{
{
for (j = 0; j < 5; j++)
;
foo (); /* { dg-error "collapsed loops not perfectly nested before" } */
}
}
}
void
f5 (void)
{
#pragma acc parallel
#pragma acc loop collapse (2)
for (i = 0; i < 5; i++)
{
{
for (j = 0; j < 5; j++)
;
}
foo (); /* { dg-error "collapsed loops not perfectly nested before" } */
}
}
void
f6 (void)
{
#pragma acc parallel
#pragma acc loop collapse (2)
for (i = 0; i < 5; i++)
{
{
for (j = 0; j < 5; j++)
;
}
}
foo ();
}
|
the_stack_data/234517868.c | /* PR middle-end/29965 */
/* Test that OpenMP construct bodies which never return don't cause ICEs. */
/* { dg-do compile } */
/* { dg-options "-O2 -fopenmp" } */
extern void baz (void) __attribute__ ((noreturn));
void
foo1 (void)
{
#pragma omp sections
{
for (;;)
;
}
}
void
bar1 (void)
{
#pragma omp sections
{
#pragma omp section
baz ();
#pragma omp section
baz ();
}
}
void
foo2 (void)
{
#pragma omp sections
{
;
#pragma omp section
for (;;)
;
}
}
void
bar2 (void)
{
#pragma omp sections
{
#pragma omp section
baz ();
#pragma omp section
;
}
}
void
foo3 (void)
{
#pragma omp parallel sections
{
for (;;)
;
}
}
void
bar3 (void)
{
#pragma omp parallel sections
{
#pragma omp section
baz ();
#pragma omp section
baz ();
}
}
void
foo4 (void)
{
#pragma omp parallel sections
{
;
#pragma omp section
for (;;)
;
}
}
void
bar4 (void)
{
#pragma omp parallel sections
{
#pragma omp section
baz ();
#pragma omp section
;
}
}
|
the_stack_data/61082.c | #include <stdio.h>
#include <stdlib.h>
#include <string.h>
int main()
{
char nomes1[4][10], nomes2[4][10], quadrilha[4][2][10];
system("clear");
printf("Informe os primeiros 4 nomes (sem acentuação):\n");
for (int i = 0; i < 4; i++)
{
scanf("%10[^\n]s", nomes1[i]);
getchar();
}
printf("\nInforme os últimos 4 nomes (sem acentuação):\n");
for (int i = 0; i < 4; i++)
{
scanf("%10[^\n]s", nomes2[i]);
getchar();
}
for (int i = 0; i < 4; i++)
{
for (int j = 0; j < 2; j++)
{
if (j == 0)
{
strcpy(quadrilha[i][j], nomes1[i]);
}
else if (j == 1)
{
strcpy(quadrilha[i][j], nomes2[i]);
}
}
}
system("clear");
for (int i = 0; i < 4; i++)
{
for (int j = 0; j < 2; j++)
{
if (j == 0)
{
printf("|");
}
printf(" %-10s ", quadrilha[i][j]);
if (j == 1)
{
printf("|");
}
}
printf("\n");
}
printf("\n\n");
return 0;
} |
the_stack_data/100140837.c | /* { dg-do compile } */
/* { dg-options "-Wc++-compat" } */
struct { int f1; } g1; /* { dg-warning "C\[+\]\[+\]" } */
static struct { int f2; } g2;
struct s { int f3; } g3;
union { int f4; } g4; /* { dg-warning "C\[+\]\[+\]" } */
static union { int f5; } g5;
union u { int f6; } g6;
enum { A } g7; /* { dg-warning "C\[+\]\[+\]" } */
static enum { B } g8;
enum E { C } g9;
|
the_stack_data/126703321.c | #include <stdint.h>
#include <unistd.h>
#define STRT_E 0x0b0b /* round constant of first encryption round */
#define STRT_D 0xb1b1 /* round constant of first decryption round */
#define NMBR 11 /* number of rounds is 11 */
typedef struct {
uint32_t k[3],ki[3] , ercon[NMBR+1] ,drcon[NMBR+1];
} twy_ctx;
/* Note: encrypt and decrypt expect full blocks--padding blocks is
caller’s responsibility. All bulk encryption is done in
ECB mode by these calls. Other modes may be added easily
enough. */
/* destroy: Context. */
/* Scrub context of all sensitive data. */
void twy_destroy(twy_ctx *);
/* encrypt: Context, ptr to data block, # of blocks. */
void twy_enc(twy_ctx *, uint32_t *, int);
/* decrypt: Context, ptr to data block, # of blocks. */
void twy_dec(twy_ctx *, uint32_t *, int);
/* key: Context, ptr to key data. */
void twy_key(uint32_t *, twy_ctx *);
/* ACCODE----------------------------------------------------------- */
/* End of AC code prototypes and structures. */
/* ----------------------------------------------------------------- */
void mu(int32_t *a) /* inverts the order of the bits of a */
{
int i ;
int32_t b[3] ;
b[0] = b[1] = b[2] = 0 ;
for( i=0 ; i<32 ; i++ )
{
b[0] <<= 1 ; b[1] <<= 1 ; b[2] <<= 1 ;
if(a[0]&1) b[2] |= 1 ;
if(a[1]&1) b[1] |= 1 ;
if(a[2]&1) b[0] |= 1 ;
a[0] >>= 1 ; a[1] >>= 1 ; a[2] >>= 1 ;
}
a[0] = b[0] ; a[1] = b[1] ; a[2] = b[2] ;
}
void gamma(int32_t *a) /* the nonlinear step */
{
int32_t b[3] ;
b[0] = a[0] ^ (a[1]|(~a[2])) ;
b[1] = a[1] ^ (a[2]|(~a[0])) ;
b[2] = a[2] ^ (a[0]|(~a[1])) ;
a[0] = b[0] ; a[1] = b[1] ; a[2] = b[2] ;
}
void theta(int32_t *a) /* the linear step */
{
int32_t b[3];
b[0] = a[0] ^ (a[0]>>16) ^ (a[1]<<16) ^ (a[1]>>16) ^ (a[2]<<16) ^
(a[1]>>24) ^ (a[2]<<8) ^ (a[2]>>8) ^ (a[0]<<24) ^
(a[2]>>16) ^ (a[0]<<16) ^ (a[2]>>24) ^ (a[0]<<8) ;
b[1] = a[1] ^ (a[1]>>16) ^ (a[2]<<16) ^ (a[2]>>16) ^ (a[0]<<16) ^
(a[2]>>24) ^ (a[0]<<8) ^ (a[0]>>8) ^ (a[1]<<24) ^
(a[0]>>16) ^ (a[1]<<16) ^ (a[0]>>24) ^ (a[1]<<8) ;
b[2] = a[2] ^ (a[2]>>16) ^ (a[0]<<16) ^ (a[0]>>16) ^ (a[1]<<16) ^
(a[0]>>24) ^ (a[1]<<8) ^ (a[1]>>8) ^ (a[2]<<24) ^
(a[1]>>16) ^ (a[2]<<16) ^ (a[1]>>24) ^ (a[2]<<8) ;
a[0] = b[0] ; a[1] = b[1] ; a[2] = b[2] ;
}
void pi_1(int32_t *a)
{
a[0] = (a[0]>>10) ^ (a[0]<<22);
a[2] = (a[2]<<1) ^ (a[2]>>31);
}
void pi_2(int32_t *a)
{
a[0] = (a[0]<<1) ^ (a[0]>>31);
a[2] = (a[2]>>10) ^ (a[2]<<22);
}
void rho(int32_t *a) /* the round function */
{
theta(a) ;
pi_1(a) ;
gamma(a) ;
pi_2(a) ;
}
void rndcon_gen(int32_t strt,int32_t *rtab)
{ /* generates the round constants */
int i ;
for(i=0 ; i<=NMBR ; i++ )
{
rtab[i] = strt ;
strt <<= 1 ;
if( strt&0x10000 ) strt ^= 0x11011 ;
}
}
/* Modified slightly to fit the caller’s needs. */
void encrypt(twy_ctx *c, int32_t *a)
{
char i ;
for( i=0 ; i<NMBR ; i++ )
{
a[0] ^= c->k[0] ^ (c->ercon[i]<<16) ;
a[1] ^= c->k[1] ;
a[2] ^= c->k[2] ^ c->ercon[i] ;
rho(a) ;
}
a[0] ^= c->k[0] ^ (c->ercon[NMBR]<<16) ;
a[1] ^= c->k[1] ;
a[2] ^= c->k[2] ^ c->ercon[NMBR] ;
theta(a) ;
}
/* Modified slightly to meet caller’s needs. */
void decrypt(twy_ctx *c, int32_t *a)
{
char i ;
mu(a) ;
for( i=0 ; i<NMBR ; i++ )
{
a[0] ^= c->ki[0] ^ (c->drcon[i]<<16) ;
a[1] ^= c->ki[1] ;
a[2] ^= c->ki[2] ^ c->drcon[i] ;
rho(a) ;
}
a[0] ^= c->ki[0] ^ (c->drcon[NMBR]<<16) ;
a[1] ^= c->ki[1] ;
a[2] ^= c->ki[2] ^ c->drcon[NMBR] ;
theta(a) ;
mu(a) ;
}
void twy_key(uint32_t *key, twy_ctx *c){
c->ki[0] = c->k[0] = key[0];
c->ki[1] = c->k[1] = key[1];
c->ki[2] = c->k[2] = key[2];
theta(c->ki);
mu(c->ki);
rndcon_gen(STRT_E,c->ercon);
rndcon_gen(STRT_D,c->drcon);
}
/* Encrypt in ECB mode. */
void twy_enc(twy_ctx *c, uint32_t *data, int blkcnt){
uint32_t *d;
int i;
d = data;
for(i=0;i<blkcnt;i++) {
encrypt(c,d);
d +=3;
}
}
/* Decrypt in ECB mode. */
void twy_dec(twy_ctx *c, uint32_t *data, int blkcnt){
uint32_t *d;
int i;
d = data;
for(i=0;i<blkcnt;i++){
decrypt(c,d);
d+=3;
}
}
/* Scrub sensitive values from memory before deallocating. */
// void twy_destroy(twy_ctx *c){
// int i;
// for(i=0;i<3;i++) c->k[i] = c->ki[i] = 0;
// }
// void printvec(char *chrs, int32_t *d){
// printf("%20s : %08lx %08lx %08lx \n",chrs,d[2],d[1],d[0]);
// }
static uint32_t in_key[3] __attribute__((aligned(64))) = {0xffffffff, 0xffffffff, 0xffffffff};
static uint32_t in[3] __attribute__((aligned(64))) = {0};
int main(int argc, char *argv[])
{
read(0, in_key, 12);
read(0, in, 12);
twy_ctx gc;
twy_key(in_key, &gc);
encrypt(&gc,in);
write(1, in, 12);
} |
the_stack_data/666238.c | //Given an array of n elements, where each element is at most k
// away from its target position. The task is to print array in sorted form.
#include<stdio.h>
int main()
{
int test,i,j,k,l,a,b,c,d,e,n,m,o,temp;
//printf("Enter the test cases");
scanf("%d",&test);
while(test--)
{
printf("Enter the value of n and k");
scanf("%d%d",&n,&k);
int arr[n];
printf("now enter the value of the elements");
for(i=0;i<n;i++)
{
scanf("%d",&arr[i]);
}
// we have to do bubble short but in a different form means if n>k then we do the
// bubble short till k only
for(i=0;i<n-1;i++)
{
if(n-i>k)
b=i+k+1;
else
b=n;
for(j=i+1;j<b;j++)
{
if(arr[i]>arr[j])
{
temp=arr[i];
arr[i]=arr[j];
arr[j]=temp;
}
}
}
for(i=0;i<n;i++)
{
printf("%d",arr[i]);
}
printf("\n");
}
}
|
the_stack_data/92324855.c | /* C Primer Plus Ch.6 - Problem 14
* @reproduced by yoonBot
*/
#include <stdio.h>
#define MAX 255
int main(){
char input, new[MAX];
int count = 1;
printf("Enter a line of input: ");
scanf("%c", &input);
while(input != '\n'){
count++;
new[count] = input;
scanf("%c", &input);
}
while(count > 0){
printf("%c ", new[count]);
count--;
}
printf("\n");
return 0;
}
|
the_stack_data/219296.c | #include <stdio.h>
#include <math.h>
// You are given High of the cylinder (h) and Radius of
// the cylinder base area (r). Write a C program to
// calculate and display all the cylinder parameters.
// -----Charlene Ng Andrew, SX180355CSJS04-----
int main()
{
float high, radius, diameter, perimeter, baseArea, latSurface, surface, volume;
printf("Please enter high: ");
scanf("%f", &high);
printf("Please enter radius: ");
scanf("%f", &radius);
diameter = 2 * radius;
perimeter = 2 * M_PI * radius;
baseArea = M_PI * pow(radius, 2);
latSurface = 2 * M_PI * radius * high;
surface = 2 * M_PI * radius * (radius + high);
volume = M_PI * pow(radius, 2) * high;
printf("\nDiameter of the cylinder: %.2f\n", diameter);
printf("Perimeter of the cylinder: %.2f\n", perimeter);
printf("Base area of the cylinder: %.2f\n", baseArea);
printf("Lateral surface of the cylinder: %.2f\n", latSurface);
printf("Surface of the cylinder: %.2f\n", surface);
printf("Volume of the cylinder: %.2f\n", volume);
}
// --- Testing --- //
// Please enter high: 5
// Please enter radius: 3
// Diameter of the cylinder: 6.00
// Perimeter of the cylinder: 18.85
// Base area of the cylinder: 28.27
// Lateral surface of the cylinder: 94.25
// Surface of the cylinder: 150.80
// Volume of the cylinder: 141.37
// ----------------------------- //
// Please enter high: 10
// Please enter radius: 50
// Diameter of the cylinder: 100.00
// Perimeter of the cylinder: 314.16
// Base area of the cylinder: 7853.98
// Lateral surface of the cylinder: 3141.59
// Surface of the cylinder: 18849.56
// Volume of the cylinder: 78539.81
// --- Testing End --- //
|
the_stack_data/243894034.c | #include <stdio.h>
int main(){
short int a,b; // range at least 16-bits [-32768, 32767] [0,65535]✅
scanf("%hu %hu",&a,&b);
printf("a=%hu b=%hu\n",a,b);
do
{
printf("%hu ",a); // hi =singed intger; hu=unsigned =+ve
a++;
} while (a<b);
return 0;
} |
the_stack_data/3264117.c | #define _GNU_SOURCE
#include <sys/mman.h>
#include <stdio.h>
#include <string.h>
#include <fcntl.h>
#include <stdlib.h>
#include <unistd.h>
#include <errno.h>
#include <sys/mman.h>
#include <math.h>
#include <string.h>
#include <sys/types.h>
#include <asm/unistd.h>
#include <inttypes.h>
#include <sched.h>
#include <sys/time.h>
#include <sys/resource.h>
#include <sys/stat.h>
#include <sys/prctl.h>
#include <sys/wait.h>
#include <assert.h>
#include <sys/syscall.h>
#include <dirent.h>
//fallocates 4096 bytes each iteration
#define FSIZE (1ULL*1024*1024*1024)
#define IOSIZE (128*1024*1024)
#define BLKSIZE (4*1024)
#define CLSIZE (64)
char *addr;
struct timeval start,end;
/* Example usage: ./a.out read seq 4096 */
void parseArgs(char *argv[], uint32_t *num_iter) {
char datasizestr[100];
strcpy(datasizestr, argv[1]);
*num_iter = atoi(datasizestr);
}
int main(int argc, char *argv[]) {
DIR* d;
int fd;
int err;
time_t curtime;
unsigned int i,t;
char *buf;
uint32_t num_iter;
int operation = 2;
char file_name[256];
float numops = 0.0;
uint32_t datasize = 4096;
if(argc < 2) {
perror("Usage: ./bench.out <num_iter>");
exit(-1);
}
parseArgs(argv, &num_iter);
//d = opendir("home1/06333/aroraish/bbThemis");
//int d_fd = dirfd(d);
struct stat sbuf;
gettimeofday(&start, NULL);
for(int i = 0; i < num_iter; i++){
err = lstat("test_link.txt", &sbuf);
if(err < 0){
perror("Error in lxstat");
exit(-1);
}
}
gettimeofday(&end, NULL);
t =(end.tv_sec-start.tv_sec)*1000000 + (end.tv_usec-start.tv_usec);
printf("\nLatency of lxstat: %6.2lf us\n", 1.0*(t/num_iter));
return 0;
}
|
the_stack_data/95450973.c | /*
* private(including lastprivate) scalars can be recognized by liveness analysis
* They are dead (not belong to live-in variable sets) with respect to the loop body
* If they are live-out with respect to the loop, it is lastprivate.
*/
int g;
void foo()
{
int i,x;
int a[100];
int b[100];
// x should be recognized as a private variable during parallelization
// yet it introduces a set of dependencies which can be eliminated
for (i=0;i<100;i++)
{
int y=i+1;
// g = y;
x= a[i]+g;
//b[i]=x+1+y;
}
}
/*
*
dep SgExprStatement:x =(a[i]); SgExprStatement:x =(a[i]); 1*1 SCALAR_DEP; commonlevel = 1 CarryLevel = 0 Scalar dep type OUTPUT_DEP;SgVarRefExp:x@13:6->SgVarRefExp:x@13:6 == 0;||::
dep SgExprStatement:x =(a[i]); SgExprStatement:b[i] =(x + 1); 1*1 SCALAR_DEP; commonlevel = 1 CarryLevel = 1 Scalar dep type TRUE_DEP;SgVarRefExp:x@13:6->SgVarRefExp:x@14:10 == 0;||::
dep SgExprStatement:b[i] =(x + 1); SgExprStatement:x =(a[i]); 1*1 SCALAR_BACK_DEP; commonlevel = 1 CarryLevel = 0 Scalar dep type ANTI_DEP;SgVarRefExp:x@14:10->SgVarRefExp:x@13:6 <= -1;||::
*/
|
the_stack_data/125141750.c | /* ************************************************************************** */
/* */
/* ::: :::::::: */
/* ft_iterative_factorial.c :+: :+: :+: */
/* +:+ +:+ +:+ */
/* By: mghazari <[email protected]> +#+ +:+ +#+ */
/* +#+#+#+#+#+ +#+ */
/* Created: 2016/12/03 13:34:26 by mghazari #+# #+# */
/* Updated: 2016/12/05 10:40:43 by mghazari ### ########.fr */
/* */
/* ************************************************************************** */
int ft_iterative_factorial(int nb)
{
int res;
if (nb < 0)
return (0);
res = 1;
while (nb > 1)
res *= (nb--);
return (res);
}
|
the_stack_data/699632.c | #include<stdio.h>
#include<stdlib.h>
void swap (int*a, int *b)
{
int t = *a;
*a = *b;
*b = t;
}
void Heap(int a[], int n)
{
int sh=0,i,b=0;
while (1)
{
b = 0;
for (i = 0; i < n; ++i)
{
if (i*2 + 2 + sh < n)
{
if (a[i+sh] > a[i*2 + 1 +sh] || a[1+ sh] > a[i*2 + 2 + sh])
{
if (a[i*2+1+sh] < a[i*2+2+sh])
{
swap (&a[i+sh], &a[i*2+1+sh]);
b = 1;
}
else if (a[i*2+3+sh] < a[i*2+1+sh])
{
swap (&a[i+sh],&a[i*2+2+sh]);
b = 1;
}
}
}
else if (i * 2 + 1 * sh < n)
{
if (a[i+sh] > a[i*2+1+sh])
{
swap (&a[i+sh], &a[i*2+1+sh]);
b=1;
}
}
}
if (!b) sh++;
if (sh+2==n)
break;
}
}
int main()
{
int n,i;
scanf("%d",&n);
int *mass = (int*)malloc(n * sizeof(int));
for (i = 0; i<n; i++)
{
scanf("%d", &mass[i]);
}
Heap(mass,n);
for (i=0;i<n;++i)
{
printf ("%i%c", mass[i], (i!=n-1)?' ':'\n');
}
free (mass);
printf("\n");
return 0;
}
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.