Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
3 - 3j*2 - 2j - 1. Let k(i) = -2i3 + 3i*2 + 3i + 2. What is 3k(u) + 4m(u)? -2u3 - 3u*2 + u + 2 Let f be (13 + -17)6/(-4). Let u(k) = 7k - 1. Let q(w) = w - 3. Let v be q(3). Let r(l) = l - l - l + v. Determine fr(d) + u(d). d - 1 Let s(i) be the second derivative of -i*3/2 - 3i*2 + 2i. Suppose 5u = 2 + 38. Let k = -72 - -69. Let p(z) = -z - 2. Calculate ks(b) + up(b). b + 2 Let x(m) = m2 - 4m + 18. Let a(u) = -u*2 + 5u - 18. Give -4a(j) - 5x(j). -j*2 - 18 Let l(u) = -8u3 + u2 - 6. Let o(v) = -16v3 + 2v*2 - 11. Give -11l(g) + 6o(g). -8g3 + g2 Let z(c) = 2c2 - c + 6. Let r(g) = -g2 + g - 5. Give 5r(b) + 4z(b). 3b*2 + b - 1 Let f(d) = -7d*3 + 5d*2 + 5d - 5. Let l = 12 - 7. Let o(x) = -10x3 + 7x*2 + 7x - 7. Determine lo(v) - 7f(v). -v3 Let f(b) = -b2 + 7b - 9. Let k = 2 - -4. Let c be f(k). Let u(v) = 3v*2 + 3. Let d(a) = -6a*2 - 7. What is cd(y) - 7u(y)? -3y2 Let a(p) be the second derivative of p2/2 - 7p. Let i(n) = 2n*2 - 2n - 3. Calculate 3a(c) + i(c). 2c*2 - 2c Let b(t) = -189t3 + 72t*2 - 72t + 72. Let c(g) = 13g3 - 5g*2 + 5g - 5. Give 5b(d) + 72c(d). -9d3 Let q(i) = -7i*2 + i + 1. Let j(g) = 6g*2 + 0 + 1 - 10g*2 + g + 0. Give -5j(n) + 3q(n). -n2 - 2n - 2 Let v(y) = -y*2 + 1. Let i(u) = 4u*2 - u. What is -i(c) - 2v(c)? -2c2 + c - 2 Let o(s) = -s - 5. Suppose -74r + 12 = -68r. Let q(l) = -4. Let w(g) = -g - 3. Let m be w(0). Calculate mq(p) + ro(p). -2p + 2 Let i(u) = 8u3 - 7u*2 + 5u - 5. Let h(c) = 8c3 - 6c*2 + 4c - 4. Calculate 5h(w) - 4i(w). 8w3 - 2w*2 Let v(d) = d + 1. Let m = -13 + 37. Suppose -3n - 2 - 11 = w, m = -2w - 4n. Let h be (8/(-10))/(4/w). Let t(c) = c + 1. Give ht(x) - 3v(x). -x - 1 Let j(s) = 5s2 - 9s - 5. Let i(y) be the first derivative of y3/3 - y2 - y - 17. Let p = 4 + -13. Give pi(m) + 2j(m). m*2 - 1 Let d(w) = -3w - 4. Let j(i) be the first derivative of -i*2 - 3i - 21. Determine 4d(h) - 5j(h). -2h - 1 Suppose 3 + 3 = -t. Let d(q) be the second derivative of -q4/12 - q3/6 - q2/2 + 2q. Let o(p) = 4p2 + 3p + 3. Give td(x) - 2o(x). -2x2 Let m(r) be the second derivative of -r5/20 + 5r3/6 - r2/2 + r. Let l(h) = -2h3 + 6h - 1. Determine 3l(t) - 4m(t). -2t3 - 2t + 1 Suppose -4a + 3 = -5. Let w(k) = -k3 + 2k*2 - 2k - 2. Let t(p) = -12p3 + 27p*2 - 27p - 27. What is at(l) - 27w(l)? 3l3 Let h(x) = -11x - 4. Let k(t) = -5t - 2. What is 2h(n) - 5k(n)? 3n + 2 Let u(o) = 3o2 + o - 1. Let i(q) = -2q*2 + 1. Determine 4i(g) + 3u(g). g2 + 3g + 1 Let y(x) = 8x3 - 7x*2 - 7x + 6. Suppose 4h - 28 = -0h. Let w(b) = -7b3 + 6b*2 + 6b - 5. What is hw(z) + 6y(z)? -z3 + 1 Let z(h) = -h2 - 3h. Let b(o) = -o2 - o. Determine 6b(p) - 2z(p). -4p2 Let t(i) = -i3 + 3i2 - 3. Let z(p) be the first derivative of 0p*2 + 2 - 7/3p*3 + 7p + 3/4p4. Determine -7t(f) - 3z(f). -2f*3 Let j(b) = -4b*3 + 5b*2 - 4b - 3. Let x(o) = 9o3 - 11o*2 + 9o + 7. Give 7j(z) + 3x(z). -z*3 + 2z*2 - z Let x(f) = -6f + 7. Let d(o) = -5o + 6. Determine -3d(u) + 2x(u). 3u - 4 Let x(i) be the first derivative of i*2/2 - 3i - 3. Let f(w) = -w*2 + 3w - 7. What is 2f(u) - 5x(u)? -2u2 + u + 1 Let i(b) = 8 - 19b*2 + 38b*2 - 22b*2. Let n(y) = -2y*2 + 5. What is 5i(k) - 8n(k)? k2 Let h = 1 - 11. Let v(w) = w. Let n(o) = -2o. Let j(f) = -12f. Let x(i) = -3j(i) + 16n(i). Determine hv(z) + 3x(z). 2z Let f(w) = 8w + 1. Let r(a) = -15a - 2. Calculate -9f(s) - 4r(s). -12s - 1 Let g(m) be the third derivative of -m5/60 + 3m*2. Let w be (3/(-5))/(3/15). Let j(i) = 2i + 0i2 + 2 + 0i*2 - 5i*2. Give wg(k) + j(k). -2k2 + 2k + 2 Let g(n) = n - 2. Let h(u) = u - 2. Suppose 18 = 5r + r. Give rg(s) - 4h(s). -s + 2 Let b(m) = -m2 + m - 1. Let u = -21 + 41. Let d(l) = 4l*3 + 20l*2 - 20l + 20. Give ub(x) + d(x). 4x*3 Let f(c) = -5 - 2 + 16c + 28. Let h(l) be the first derivative of -3l2/2 - 4l - 2. Let d(w) = w*2 - 2w - 2. Let r be d(2). Give rf(q) - 11h(q). q + 2 Let v(d) = 3d. Let l(m) = -19m. Determine -6l(r) - 34v(r). 12r Let l be 15 + -2(-2)/4. Let c(t) = 6t2 - 1. Let v be c(1). Let n(g) = -6g*2 - 16. Let h(f) = 2f*2 + 5. Determine lh(r) + vn(r). 2r*2 Let i(m) = -5m + 8. Let k(b) = 6b - 8. Calculate 4i(x) + 3k(x). -2x + 8 Let i(w) = -6w2. Let f(r) be the second derivative of r4/12 - 29r. Calculate f(s) + i(s). -5s2 Suppose -g + 3g = -3o - 19, -3o - 4g = 23. Let q(j) = -4j. Let l(y) = -3y. Determine oq(x) + 6l(x). 2x Let x(d) = -6d2 - d - 1. Let l be x(-1). Let b(p) = -15p*3 + 11. Let o(h) = 7h*3 - 5. What is lb(w) - 13o(w)? -w3 - 1 Let l(h) = 3h*3. Let m(o) = -21o*3. What is -30l(g) - 4m(g)? -6g*3 Let v(w) = -6w*3 + 2w. Let z(p) = -5p3 + 2p. Let n = 14 + -16. Let m be ((-24)/(-4))/3n. Calculate mz(l) + 3v(l). 2l*3 - 2l Let c(f) = -2f3 + 4f*2 - 2f - 8. Let d(o) = o*3 - 3o*2 + o + 7. Give -3c(g) - 4d(g). 2g*3 + 2g - 4 Let l = -4 - 0. Let w(c) = -c*2 + 1. Let m(o) = -2o*3 + 4o*2 - 4. Suppose 2r = -1 - 1. Calculate lw(x) + rm(x). 2x3 Let z = -34 + 58. Let g(n) = -7n. Let b(p) = -p. Determine zb(s) - 3g(s). -3s Let y = -3 - -5. Let i(u) = -yu + 7u + 3u. Let x(m) = -9m. Let g(h) = h3 - 3h*2 - 18h + 6. Let t be g(6). Give tx(k) + 7i(k). 2k Let d(r) = -r2 + r. Let w(g) = -3g*2 + 6g - 1. Suppose -5p - 3t - 9 = -48, 0 = 5p - 5t - 15. Let j = 7 - p. Give jw(n) - 6d(n). 3n2 - 1 Let o(p) = 8p*2 - 11p + 4. Let g(n) = 7n2 - 10n + 3. Give 6g(a) - 5o(a). 2a2 - 5a - 2 Let t(h) = -h*2 + h + 5. Let p(s) = 2s*2 - 2s - 11. Give 3p(c) + 7t(c). -c*2 + c + 2 Let g(t) = -3t + 4. Suppose -3d - 17 = -k, -41 = 3d - k + 6k. Let v(z) = 4z - 6. Calculate dg(p) - 5v(p). p + 2 Let c(p) = 2p + 0 - 2p*2 + 9p*2 - 1 - 2p2. Let n(r) = -r2 - r. What is c(f) + 2n(f)? 3f*2 - 1 Let h(d) = 5d*3 + 5. Let r(p) = -6p*3 - 6. Suppose 5j - 20 = -5. Suppose 8 = 5k + 3s, -k + 8 = jk + 2s. Calculate kr(i) + 5h(i). i*3 + 1 Let i(p) = 14p + 1. Let m be i(-1). Let u = -7 - m. Let v(z) = z2 - 2. Let t(b) = -b2 + 3. Calculate uv(w) + 4t(w). 2w2 Suppose 2k + 4 = 6. Let b(a) = 1. Let j(c) = -c + 1. Calculate kj(d) + b(d). -d + 2 Let c = -10 - -11. Suppose -t - 2t = 9. Let s(f) = -f - 1. Let k(u) = -u. Determine cs(d) + tk(d). 2d - 1 Let f(u) = 19u*2 + 2u - 2. Let g(s) = 171s2 + 19s - 19. What is -57f(c) + 6g(c)? -57c2 Suppose -i + 5i + 32 = 0. Let g(h) = -11h2 - 2h - 3. Let m(n) = -4n2 - n - 1. Let s be 0 + 15/(9 - 4). Determine im(a) + sg(a). -a2 + 2a - 1 Let c(p) = -p*2 - 4 - 7p + 2 + 3 + 6p. Let o(f) = 14f*2 + 14f - 10. Give -12c(i) - o(i). -2i*2 - 2i - 2 Let b(t) = -11t2 - 2t + 2. Let f(z) = 32z2 + 7z - 7. Calculate 7b(i) + 2f(i). -13i2 Let u(z) = 9z*3 - 9z + 2. Let g(r) = -5r3 + 5r - 1. What is 11g(p) + 6u(p)? -p*3 + p + 1 Let i be 2 + (4 - 2) + -2. Let j(h) = -2h + 4 - ih - 3h*2 + 0h. Let z be 10/3(-6)/(-5). Let s(t) = 2t*2 + 3t - 3. What is zs(x) + 3j(x)? -x*2 Let x(s) = 2s - 10. Let g = 1 - 2. Let t(f) be the first derivative of f - 13. What is gx(k) - 10t(k)? -2k Let p(f) = -2f*2 - 2f + 2. Let x(a) = a*2 + a - 1. Give -3p(v) - 5x(v). v2 + v - 1 Let b(p) = 3p. Let m(n) be the second derivative of 2n3/3 - 11n. Calculate -3b(j) + 2m(j). -j Let l(y) = 5y - 8. Let b(m) = 2m - 3. Calculate 11b(x) - 4l(x). 2x - 1 Let y(j) = j2 + 5. Let b(d) be the first derivative of d4/12 + 3d*2/2 - d + 2. Let c(z) be the first derivative of b(z). Give 5c(f) - 3y(f). 2f*2 Let n(s) = 3s + 1. Let r(b) = 6b + 2. Determine -5n(m) + 3r(m). 3m + 1 Let c(k) = k*3 - 11k*2 + 11k - 8. Let m be c(10). Let j(w) = -2w - 3. Let q(y) = -y - 1. Give mj(s) - 5q(s). s - 1 Let z(t) = -2t3 + t + 1. Let v(q) = -q3 + q. Suppose 3p - 4x + 16 = 4p, 0 = 2p - x - 5. Give pv(o) - z(o). -2o*3 + 3o - 1 Let p(m) = -14m - 8. Let i(w) = -5w - 3. Let h be -611/(-2) - 3. Let a = 45 - h. Suppose -7x = -2*x - a. D	{ "pile_set_name": "DM Mathematics" }
value in 1.26154, -0.2, -3, 2, -0.3? -0.2 Which is the smallest value? (a) 3 (b) -3/4 (c) 2 (d) -111.8 (e) -1 d What is the third smallest value in -0.5, -3, 1/4, 197? 1/4 What is the third smallest value in -28/3, -6/7, 10? 10 What is the third smallest value in -2/5, 3, 1/4, -1/18, 9/5, 14? 1/4 What is the smallest value in -1/12, 0.006, -5, -14757? -14757 What is the second smallest value in 8021, -4, -9? -4 What is the fourth biggest value in 2/33, -8, 3/7, -4, 13? -4 What is the fifth smallest value in -5, 1142, 5, 0.5, -2? 1142 Which is the third biggest value? (a) -1/8 (b) -3 (c) -0.197 (d) 4 (e) -1 (f) -10 c Which is the third smallest value? (a) -0.01 (b) -1/4 (c) 0.0528 c What is the fourth biggest value in 0.4, 1/422, -5.2, -4, 0.3? -4 What is the fourth smallest value in 1, 1/20, 8/21, -17/6? 1 Which is the fifth smallest value? (a) 2/5 (b) 2 (c) 0 (d) -0.9 (e) 6 e What is the smallest value in -1/4, 229/16, 0.5? -1/4 Which is the second smallest value? (a) 0.2 (b) -0.3 (c) -39 (d) 2/3 (e) -0.5 e What is the smallest value in 5, -54620, 4/5? -54620 Which is the smallest value? (a) 2 (b) -5 (c) -3/4 (d) 20 b What is the third biggest value in 2/3, 304, -3/4, 53? 2/3 What is the second smallest value in -5/6, 2/7, -380? -5/6 Which is the biggest value? (a) -170 (b) -2 (c) 0.8 c What is the second biggest value in -0.06, -3, 0.5, -3/4, -4/7? -0.06 What is the third biggest value in -3.5, -71, -6, 0.4, 0.3, 3/4? 0.3 What is the third smallest value in 5898, -0.2, 0.2? 5898 Which is the biggest value? (a) -4.9 (b) 4 (c) -0.2 (d) 1496 d Which is the third smallest value? (a) -1/7 (b) 3 (c) 4/34027 b What is the third biggest value in 465, -0.4, 24? -0.4 What is the smallest value in -4, 0.0274, 4, 8? -4 What is the fifth biggest value in -3, -0.3, -1/5, 2, 104/3? -3 What is the third smallest value in -0.5, 1.8314, -8? 1.8314 Which is the fifth smallest value? (a) 4 (b) -1 (c) 0.3 (d) 0 (e) 54 e What is the third biggest value in 128, 47, 0? 0 What is the smallest value in 1591, -4, 1/3? -4 What is the fifth smallest value in -4, 42, -19, 0.36, -2/17? 42 What is the second biggest value in 0.3, 9, -2/5, -22/9? 0.3 What is the second smallest value in 1, 1/3, -0.6, 62? 1/3 What is the biggest value in -1, -158, 63? 63 What is the fifth biggest value in 0.3, -204, 1, -3/4, 4? -204 Which is the smallest value? (a) 0.041 (b) -2/31 (c) 0.3 (d) -66/5 d Which is the sixth smallest value? (a) 1 (b) 0.387 (c) 25 (d) 0.06 (e) -3 (f) 0.1 c What is the second biggest value in -5/4, 0.77, 0.25? 0.25 What is the biggest value in 16, 24.8, -3? 24.8 What is the smallest value in 5, 0, 4, 4/1209, 0.5, 3? 0 Which is the fifth smallest value? (a) 2 (b) 664 (c) 4 (d) 5 (e) -398 b Which is the third smallest value? (a) -13/4 (b) 6 (c) 160 c Which is the third smallest value? (a) -2 (b) -1/3 (c) -2/6811 (d) -4 b Which is the smallest value? (a) 1/2 (b) 2 (c) -12 (d) -0.042 (e) 0 (f) -7/2 c Which is the fourth biggest value? (a) 0.5 (b) 4/5 (c) -30 (d) -2858 (e) 0.07 (f) -2 f Which is the third biggest value? (a) -0.32 (b) -14 (c) 3 (d) -12 (e) -4 (f) -0.2 a Which is the second biggest value? (a) -4 (b) 0 (c) -0.39 (d) -3/10 (e) -0.02 e Which is the third smallest value? (a) -5/2 (b) 0.4 (c) 6/7 (d) -3/14 (e) 4 (f) -92 d What is the fifth biggest value in 1/2, -6, -0.02, 3.218, -2/17? -6 What is the smallest value in 42, 38, 1/2, -1/174? -1/174 Which is the second smallest value? (a) 3 (b) 1832 (c) 2 (d) -154 c Which is the second biggest value? (a) -4 (b) 20 (c) -0.29 c Which is the fourth biggest value? (a) -0.08 (b) 0 (c) -0.2 (d) -3570 (e) 0.5 c Which is the second smallest value? (a) 2 (b) -1.8 (c) 1/2 (d) 5/4 (e) 12/11 c What is the fourth biggest value in -3, 7054, -23, -0.03? -23 What is the fourth smallest value in -2, 0, -0.5, -6, -27? -0.5 What is the fourth biggest value in -6/5, -1/8, -1.3, 35, 1/4, 0? -1/8 Which is the smallest value? (a) 3/2 (b) 0 (c) -5 (d) -0.4 (e) -3 (f) -13/5 c What is the third smallest value in 4, 0.1, 1/1286, -2, -0.3? 1/1286 Which is the smallest value? (a) 1 (b) 2/7 (c) -10357 c What is the smallest value in 298, -2/7, -9, 0.3, -0.037, 1? -9 What is the smallest value in -4, -56, -0.3, 3, 53? -56 What is the third biggest value in -906, -690, 1? -906 What is the fourth biggest value in 0, 5, -25/37, -1/20? -25/37 What is the smallest value in -213, -4425, -1? -4425 Which is the third smallest value? (a) 11 (b) 30 (c) -201 b Which is the third biggest value? (a) 0.1 (b) 2/29 (c) -29253 (d) -1/3 d Which is the second biggest value? (a) -0.5 (b) -18 (c) 2 (d) 55/17 c Which is the biggest value? (a) 0.5 (b) 2 (c) -0.0027 (d) 4 (e) 1 (f) -2 d What is the fourth smallest value in -0.5, -8, 0.21, -0.3, -4, 2? -0.3 Which is the third biggest value? (a) -2 (b) -3855 (c) -2/7 b What is the sixth biggest value in -6/7, -0.4, 4, -1/4, 6, 5? -6/7 What is the third biggest value in -5, 1, -908014, 0? -5 What is the fourth smallest value in 0.04, -0.5, -3/2, 0, 6/11? 0.04 What is the second biggest value in -215/56, 2/5, -2/13? -2/13 What is the smallest value in 5, 1826, 0.07, -1? -1 Which is the fourth biggest value? (a) 1.097 (b) -2 (c) -0.076 (d) 1/4 b What is the third biggest value in -223, -1, 3177? -223 Which is the biggest value? (a) 0.05 (b) 3 (c) -3.89 (d) -3/5 b Which is the sixth smallest value? (a) -2/5 (b) -5/23 (c) 3/5 (d) -0.5 (e) -0.7 (f) 0.5 c Which is the biggest value? (a) -2 (b) 0.0228 (c) 13 c Which is the sixth smallest value? (a) -1 (b) 23/2 (c) -0.3 (d) 61 (e) 5/3 (f) 2 d What is the second smallest value in 0.4, -4/5, -48, -355, -0.1, -0.5? -48 Which is the biggest value? (a) 6/77 (b) 17 (c) 5 (d) -1/5 (e) 1/16 b What is the fourth biggest value in 1/9, -1/5, 3/5, 3/4, -1? -1/5 Which is the second biggest value? (a) 0.068 (b) 0 (c) 0.11 (d) -1 a Which is the smallest value? (a) -5 (b) -40 (c) -6.09 (d) 0.04 b Which is the smallest value? (a) -9/7 (b) -90 (c) -9 (d) -1 b Which is the fifth smallest value? (a) -2 (b) 3 (c) 4/7 (d) -0.19 (e) -0.4 (f) -1/818 c Which is the third biggest value? (a) -29 (b) 3 (c) 0.1 (d) -1 (e) -0.0299 (f) -0.5 e Which is the fourth biggest value? (a) 1/4 (b) -5 (c) 4 (d) 5 (e) 1136.4 (f) -2 a Which is the second biggest value? (a) -1/142 (b) -0.3 (c) -0.02 (d) -0.1 c What is the biggest value in 0.2, -1, 18, -0.014, 0.04, -1/6? 18 What is the third smallest value in 0.1, 3, -14, 4/87, 1, -0.1? 4/87 What is the second smallest value in 0.4, 20/21, 5.7, -0.17, -0.1? -0.1 What is the second biggest value in -2.48, 194, -1? -1 Which is the second biggest value? (a) 10 (b) -6991 (c) -4 c What is the third smallest value in 0.7, -3.2, -3990? 0.7 Which is the fifth smallest value? (a) 2/127 (b) -0.2 (c) -1 (d) 5 (e) 0 d Which is the biggest value? (a) 7 (b) 3 (c) -0.4 (d) 0.4 (e) -0.39 (f) -3 a Which is the fourth smallest value? (a) -4 (b) -1144 (c) -7 (d) -1/3 d What is the fourth biggest value in 107, -0.4, 0.18, -1/5? -0.4 What is the fourth biggest value in -8, -1, -14, 1? -14 What is the smallest value in 2, -54.7, -4, -1/3, -525? -525 What is the third smallest value in -1/2, 1, -0.1, -1/33, -0.0906? -0.0906 What is the second biggest value in 11, -3, 2, -3/49, -1, -0.06? 2 What is the biggest value in 411833, 4, -1/2? 411833 Which is the third biggest value? (a) 147 (b) -1205 (c) -10 b What is the second smallest value in -2/155, 6, 4, -20? -2/155 Which is the smallest value? (a) 31 (b) 0.8 (c) 1 (d) 5 (e) 8.9 b Which is the second smallest value? (a) -7/4 (b) -5 (c) 25 (d) -1 (e) -1/3 (f) -3 f What is the biggest value in 402, 0.5, -0.4, -3, 3/10? 402 Which is the fourth smallest value? (a) -11 (b) -1.6 (c) 3/5 (d) -0.2 c Which is the third smallest value? (a) 0 (b) -0.2 (c) 14 (d) -16 (e) -4 (f) -0.1 b What is the second smallest value in -3, 1/4, 2/11, 67/44, 0.2? 2/11 Which is the fifth biggest value? (a) -465 (b) -0.1 (c) 1 (d) 6 (e) 0.4 (f) -2/5 f What is the third smallest value in 4/7, 5/7, 5/1669? 5/7 Which is the small	{ "pile_set_name": "DM Mathematics" }
-y + 3a + 32 = 4y, 0 = 4a + 16. What is the closest to 1/3 in -1, 6, y? -1 Let z = -0.11 + 0.11. Which is the closest to 0.1? (a) 1 (b) 2 (c) z c Let r = 15/7 + -149/63. Let v = 3 + 1. What is the nearest to -2 in v, r, 3/2? r Let u be -31 + 1 - -7. Let m = 0 + 0.1. Suppose 4d + 4 = -0d. Which is the closest to m? (a) d (b) -0.2 (c) u b Let h = -12.1 - -2.1. Let y = h + 6. Which is the closest to -1/4? (a) -1 (b) y (c) 4 a Let p = -0.3 + 0.2. What is the closest to 2/11 in 2, -0.3, p? p Let q = -1 + 2. Let v = 147 - 147. What is the nearest to v in q, -2, 1/3? 1/3 Let p = 270/1417 - 4/109. Which is the closest to 0.1? (a) p (b) 1 (c) 5 a Let f = -4.9 - -3.9. Which is the closest to f? (a) -2/5 (b) 5 (c) -2 a Let m = 0.6 + -0.7. What is the nearest to m in 2, 0.1, -3? 0.1 Suppose -10 = -5p + 15. Let u be (2 - 58/18) + 1. Let q = -7 - -7.1. Which is the nearest to q? (a) p (b) -1 (c) u c Let p = 2 + -1.6. What is the nearest to p in 7, 3, 2? 2 Let p = -41/148 - -1/37. Suppose -9 = -4b + b. Let a be (2/4)/((-30)/(-15)). What is the closest to -1 in a, p, b? p Suppose -i - 3i = 5u + 49, -2i - 32 = 4u. Let v = 3 - 0. Let t be ((-2)/(-6))/(v/i). Which is the closest to -0.2? (a) 4 (b) -0.2 (c) t b Let f = -44.8 - -45. Which is the nearest to -2? (a) 0.1 (b) f (c) 5 a Let z = 2.104 - 0.004. Let u = z + -2. Let d = -1/4 + 1. Which is the closest to -1/3? (a) -1/2 (b) d (c) u a Let r be (-1)/(-1) + (-10)/16. Let z be (-2 - -3)-5 + 6. Which is the nearest to 2/5? (a) -0.1 (b) r (c) z b Let b = -9 + 8.9. Let x = b + 0.1. What is the closest to x in -1, -5, 0? 0 Let j be 13 - (-56)/8. Suppose -j + 19 = -3f. Which is the closest to -1? (a) f (b) 0.3 (c) 3 b Suppose -5p = 5o, -2p + 24 + 0 = -4o. Let d be ((-9)/(-12))/(6/4). Let n be -2 + 1 + (0 - -1). Which is the closest to d? (a) 0.1 (b) p (c) n a Let g be (3/2)/((-2)/4). Let z = -28 + 29. Let x = 0.2 + -0.5. Which is the nearest to z? (a) g (b) x (c) 0 c Let o = -1 + 5. What is the nearest to 2 in 0.5, -2/13, o? 0.5 Suppose 3p - 1 = -o, -2o - 12 = -0o - p. Which is the nearest to -2/5? (a) -3 (b) o (c) 0.3 c Suppose -p - 2p + 7 = -4h, 3p + 9 = 0. Let d = -145 - -147. What is the closest to 2 in d, 2/7, h? d Let g(w) = -w3 - 13w*2 + 10. Let p be g(-13). Let l be ((-1)/(-10))/(4/p). Let d = -1/133 + 275/1197. Which is the nearest to 0.1? (a) l (b) -0.2 (c) d c Let z be 3/(-18) + 76/168. Let y = 3/14 + z. Which is the closest to -0.1? (a) -0.4 (b) 1/4 (c) y a Let z be (0 - -2) + 1 + 10. Let n = z - 20. Let m be (-39)/(-63) + 2/n. Which is the nearest to -0.1? (a) m (b) 1/4 (c) 0.1 c Let r = -4.6 + 4.29. Let t = r - -0.01. Let i = t - -0.2. Which is the nearest to 1? (a) 1/2 (b) i (c) -1 a Let l = -2.6 - 8.4. Let o = l + 11.5. What is the nearest to 1 in 0.2, 3/4, o? 3/4 Let x be (-9)/(-6)(-20)/(-24). Let p = 96/7 + -14. What is the nearest to p in x, -5, -0.3? -0.3 Let k = -22.9 - -23. What is the closest to k in -2, 1/8, -0.3? 1/8 Suppose -5 = -2l + 3l. Let q = -1 + 1. Which is the closest to q? (a) 0.3 (b) l (c) -3 a Suppose 4n - 5n = 0. Suppose -2d + 10 = n, 9 = 2r - 4d + 21. Let h = -3 + 3. Which is the nearest to h? (a) r (b) -0.3 (c) 2 b Let x = 43 - 42. What is the nearest to 0 in 2, x, 0.2? 0.2 Let l be (3 + -1)-1 - -2. Let r be (-2)/(2 + l + -1). Which is the closest to r? (a) -2/19 (b) -5 (c) 3 a Let i be (-16)/562/(-2). Suppose 0 = 3o - 4 + 1. Which is the nearest to 1? (a) 0 (b) o (c) i b Let x(v) = 3v - 5v - 5 - 9 + 2. Let b be x(-7). What is the nearest to 0.1 in b, -4, -4/7? -4/7 Let o = 36 - 18. Let r be (12/o)/((-20)/18). What is the closest to -1/2 in -0.5, r, 0.1? -0.5 Let n = -93 - -93.1. What is the nearest to -5 in -1, -0.3, n? -1 Let l = -7 - -18.1. Let k = 11 - l. What is the closest to k in 3/7, -4, 4? 3/7 Let o = 40 - 40. Which is the closest to -0.1? (a) -0.1 (b) o (c) 0.1 a Suppose -4j = -2j. Let o = -5.2 + 2.2. What is the nearest to 2/3 in j, 1, o? 1 Let o = 0.1 - 0.2. Let c be 2 - (3 - (1 + 0)). Let i = 1/7 - 3/7. What is the closest to 0.1 in o, i, c? c Let l = 6.9 + -3.6. Let r = l + -3. Which is the nearest to 1/4? (a) -1/4 (b) r (c) -0.4 b Let j = -2.8 + 3. Let k = j - 0.2. Let i be (-2 - -3)/(-3)-9. Which is the closest to k? (a) 4/3 (b) 0.1 (c) i b Let h(w) = 4w - 1. Let p be h(1). Suppose -s = p + 2. Which is the closest to 0.1? (a) -3 (b) -0.4 (c) s b Let f = 3 - 6. Let v = f - -2. Let k = 1.1 + v. What is the closest to k in 1, 0.3, 0.5? 0.3 Let u be (-11 + 11)(-1)/(-2). Which is the nearest to u? (a) -0.3 (b) 0 (c) -3 b Let m = -17 + 22. Which is the closest to -2/5? (a) -5 (b) 0.1 (c) m b Let s = 0.06 + -0.05. Let f = s - -0.09. What is the closest to 0 in -1/4, 4, f? f Let s = 28.8 + -29. What is the closest to s in 0.2, 0.5, 0? 0 Suppose 17 = -d - 2v - 3v, 5d = 2v + 23. Let j = -16 - -24. Let p = -12 + j. What is the nearest to 2/3 in 2, d, p? 2 Let x = 0.2 - 1.2. Let n = x + 1. Suppose -s = -0 + 2. Which is the nearest to 2/5? (a) -5 (b) s (c) n c Suppose 12 = -0z - 4z. Let v = -2.4 - 0.6. Which is the nearest to z? (a) -2/9 (b) v (c) 0.1 b Let n be (18/(-4))/3-2. Let q be ((-2)/(-6))/(3/(-9)). Let s be 1 + 0 - (2 + q). Which is the nearest to -0.2? (a) n (b) 0.5 (c) s c Let l be 4(6/(-3) + 3). What is the nearest to 1/2 in 0.1, 0.08, l? 0.1 Let l = 4948/15 + -330. Let t(m) = m2 + 6m + 5. Let u be t(-5). Let j be -2 + 12/5 - u. What is the closest to j in l, 2, -2/3? l Let s = 10.4 - 9.9. Which is the nearest to 8? (a) s (b) 2/7 (c) -2/17 a Let o = 2/195 + -589/390. Let i = o - -13/6. Suppose 4s - 6 = 4y + 14, 3y = -5s + 17. What is the closest to i in 1, s, 1/2? 1/2 Let h = -17 - -17. Suppose -3g - 2u = -2, -u = 4g - 6 - 5. Let n = -223 - -2451/11. Which is the nearest to h? (a) -1 (b) g (c) n c Let b(z) = 6z + 25. Let h be b(-4). What is the nearest to -5 in 0.1, h, -0.3? -0.3 Let p = 29.5 - 30. Which is the nearest to 1? (a) 5 (b) 1 (c) p b Suppose 21 = 4r + m, 2r = -2r + 2m + 30. Suppose -4u + r = -10. Let h = -134/3 + 46. Which is the closest to -0.1? (a) 1/8 (b) u (c) h a Let m = 0.043 - -0.017. What is the closest to 0.1 in m, 1/3, -2? m Let k be 6/3 - (-16)/(-10). Let a = -2 - -1.5. Let b = -104/261 - -18/29. What is the closest to k in b, a, 0.2? b Let x = -0.11 + -0.89. Which is the closest to 1? (a) 5 (b) 1/2 (c) x b Let l = 20 - 19.95. What is the closest to 1 in l, -3, 0.1? 0.1 Let o(s) = -2s*3 + 2s*2 + 2s - 1. Let x be o(2). Let j = 6 + x. Which is the closest to j? (a) 0.4 (b) 2/3 (c) 0.3 b Let t = -2.3 + 2. Let u = -0.2 - 0.8. Which is the nearest to u? (a) t (b) 3 (c) -4 a Suppose -2 = -5j + 3j. Suppose -y - 5v = -42, 0 = -4y - 4v - 23 + 127. Suppose 3f = -y + 7. Which is the nearest to j? (a) -1 (b) f (c) -2 a Let w = -2 - -1.9. Let r = 10 - 14. Which is the nearest to w? (a) r (b) -2/5 (c) -3 b Let m = 9 + -9.5. Let a = 1.2 + -1.4. What is the nearest to a in 6/5, -1, m? m Let y = -0.2 + 5.2. Which is the closest to -0.1? (a) y (b) 3 (c) 4 b Let m = 7 - 6.4. Let t = m + -0.4. Which is the closest to 0? (a) 2/3 (b) t (c) 0 c Let v = -82 - -83. Let u = 6 - 4. Suppose -2w + w = d - u, -3d - w = 0. Which is the nearest to -1? (a) v (b) d (c) 2/7 b Let k = 0.1 - 0.1. Let z = -28/41 + 2/123. Which is the nearest to k? (a) -2 (b) 3/2 (c) z c Let n be 2/(-3) - (-6)/36. What is the closest to n in -6, 0.4, 2? 0.4 Let f = -0.109 + 5.209. Let g = 5 - f. What is the nearest to g in 1, 6/11, 0.3? 0.3 Let f = 7553/24 + -17193/56. Let q = f - 62/7. Let i = -13/10 - q. What is the nearest to -1 in -3/2, -1, i? -1 Let v = -9/7 + 157/133. Which is the nearest to 0.3? (a) -1/6 (b) v (c) 4 b Let r = -6.5 + 6. Let c = 0.29 + -0.49. What is the nearest to -0.1 in c, r, 2/9? c Let x = 522683 - 189734044/363. Let t = x + -2/121. What is the nearest to -2 in 1/2, t, 3/8? t Let z = -1.3 + 6.3. Let j(v) = -v*2 - 9v - 10. Let u be j(-7). Which is the closest to -2? (a) z (b) u (c) -3 c Let m = -0.1 - -0.1. Let q(x) be the second derivative of -x5/20 + x3/6 + x*2/2 + 3x. Let y be q(-1). Which is the nearest to y? (a) 0.1 (b) m (c) 5 a Let	{ "pile_set_name": "DM Mathematics" }
for u. -69 Solve -1161 = -316677h + 316407h + 2889 for h. 15 Solve 98s = -34s + 113s - 143s + 2916 for s. 18 Solve -1521y + 1503y + 468 = 0 for y. 26 Solve 1583v - 1933v = 596v + 4539v + 493650 for v. -90 Solve 1385c - 61717 = -551c + 16365 + 5166 for c. 43 Solve 0 = 290l + 10093 + 16877 for l. -93 Solve 482771m + 150 = 482777m for m. 25 Solve -1113y + 4090 = 1081y - 2603y for y. -10 Solve 100d + 1052 + 2084 = -464 for d. -36 Solve -2676k - 1267 = -2626k - 467 for k. -16 Solve -17535 = -1053i - 375i - 1077i for i. 7 Solve 59925 + 10948 = 736s + 3029s - 42077 for s. 30 Solve 7485 = 3485n - 14057 - 191043 for n. 61 Solve 115q + 17q + 65q + 4629 = -2660 for q. -37 Solve 72o - 303 + 2156 + 624 = -43 for o. -35 Solve 126c + 12193 - 792 - 1541 = -44c for c. -58 Solve -865f - 36935 = -4461f - 16362 + 18983 for f. 11 Solve -65v - 5724 = 5429 - 5758 for v. -83 Solve -650080 = 5753x + 2373x for x. -80 Solve 1239s + 273s - 12097 = -2388s + 7403 for s. 5 Solve 592j - 6499 = 229j + 266j for j. 67 Solve 9g + 29g - 18g - 1188 = 74g for g. -22 Solve 663l - 13240 + 967 - 16525 = -184l for l. 34 Solve 0 = -1722t + 1678t + 1540 for t. 35 Solve 1101l = -849l - 2335l - 156962 + 41267 for l. -27 Solve 152241 = -4619v - 112090 - 149939 + 63226 for v. -76 Solve 545 = 21h - 82h + 385 + 1685 for h. 25 Solve 3709l + 140905 - 4550 = -456l + 11405 for l. -30 Solve -1271f = -990273 + 845379 for f. 114 Solve 16226c + 493672 - 74916 - 105314 = -286920 for c. -37 Solve 0 = -11453g - 126609 - 56639 for g. -16 Solve -47q = -38q + 34q - 3010 for q. 70 Solve -2845f = 175660 + 245400 for f. -148 Solve 0 = 3616v + 135928 + 44872 for v. -50 Solve -10524t - 3768 - 3234 = -11302t for t. 9 Solve 2441t + 636867 = -3534t - 2296t for t. -77 Solve -295n - 274n + 1598 = -210n + 440n for n. 2 Solve 5241 = 97b + 7b + 1497 for b. 36 Solve 4014j + 204156 = -88866 for j. -73 Solve 0 = 2611d - 220d + 1205d + 17980 for d. -5 Solve 19i + 82i + 13380 = 50i - 172i for i. -60 Solve 68j - 2781 + 1466 = 972 + 2065 for j. 64 Solve 160173n = 159985n - 1982 + 478 for n. -8 Solve 20o - 520736 = -521096 for o. -18 Solve -1149p - 4375p + 744800 = 2316p for p. 95 Solve 0 = 323p - 10753 - 6043 for p. 52 Solve -177m + 433 = -901m - 13323 for m. -19 Solve 0 = 88i - 34885 + 41661 for i. -77 Solve 0 = -329m - 140m - 70m + 2334 + 14914 for m. 32 Solve 4753231 = 10d + 4752851 for d. 38 Solve -3234b + 395658 = 4093b for b. 54 Solve -414p + 53p - 491 = 7090 for p. -21 Solve -1031a + 164135 - 58973 = 0 for a. 102 Solve 614u - 66304 = 86u - 255u - 1289u for u. 32 Solve 0 = 810y + 638y - 25499 - 38213 for y. 44 Solve 0 = -561h - 39003 + 37320 for h. -3 Solve 279w - 336w = -2995 + 202 for w. 49 Solve -151c = -98c - 435c - 534c - 79692 for c. -87 Solve 11d + 36d = -28d - 2775 for d. -37 Solve 88n + 10719 = 485n for n. 27 Solve -3180 = -38q + 64q + 57q + 1551 for q. -57 Solve -2991n + 63430 - 619 = 0 for n. 21 Solve -381z - 3140 = -538z for z. 20 Solve 16127o + 3707o + 254496 + 211922 + 1060800 = 0 for o. -77 Solve -336i + 5164 = 65i - 2983i for i. -2 Solve -202654 = -776f - 741f - 1759f + 62702 for f. 81 Solve 28526u = 29290u - 48896 for u. 64 Solve 58j - 1604 = 657j - 6396 for j. 8 Solve -3465d - 4087d - 390816 = 590d for d. -48 Solve -482a - 566a + 172224 = 608a for a. 104 Solve -442552f + 441177f + 49500 = 0 for f. 36 Solve 0 = -53z + 10718 - 10241 for z. 9 Solve -30388b = -30320b + 408 for b. -6 Solve 5420610 = -138c + 5437446 for c. 122 Solve 1588 - 4052 = 47y + 9y for y. -44 Solve 0 = 26580g - 26595g + 1290 for g. 86 Solve 18m + 416 + 8008 = -17m + 116m for m. 104 Solve 1254q + 43278 = -18168 for q. -49 Solve 16484 = -317y - 8559 for y. -79 Solve -58s - 169s - 8414 - 794 = -1036 for s. -36 Solve -6u + 96 = u - u + 426 for u. -55 Solve -112t - 43t = -38t - 63t - 1188 for t. 22 Solve -307421 + 51741 = 6392u for u. -40 Solve 25m + 1027 = -298 for m. -53 Solve -122w - 294w + 1174 + 731 = -1839 for w. 9 Solve 1113l + 1042l + 46921 + 1758 = -26746 for l. -35 Solve 18758q = 855q + 2046734 + 477589 for q. 141 Solve 0 = -25q + 39q - 46q - 128 for q. -4 Solve 2932 + 7299 = 128r - 8642 + 3385 for r. 121 Solve 309p - 1102686 + 1133895 = 0 for p. -101 Solve 0 = -33x - 189x - 300x - 34976 - 40714 for x. -145 Solve -348 + 253 = -42l + 1648 + 609 for l. 56 Solve 1348c = 46466 + 2062 for c. 36 Solve -153u + 1950 = 149u - 503u + 162u for u. -50 Solve -4732n = -1171n + 8792n + 1148829 for n. -93 Solve -46l + 9695 = -113l - 166l - 44l for l. -35 Solve -2924 = 493k + 7429 for k. -21 Solve 53472 = 23838x - 24952x for x. -48 Solve -37z - 826 = 16z - 84 for z. -14 Solve -41490p - 23994 = -42264p for p. 31 Solve -65279 - 14343 - 77374 = -2492z for z. 63 Solve 59u - 2490u - 2789u + 229680 = 0 for u. 44 Solve -158y - 36y - 644 = 4982 for y. -29 Solve 56i + 476 + 632 = 5140 for i. 72 Solve -35119 = 10263j + 14676 + 32309 for j. -8 Solve 19568 = 163f + 27718 for f. -50 Solve -78s + 14304 = -21s + 148s + 93s for s. 48 Solve -6345085n + 6344938n = 11466 for n. -78 Solve -44029 = 12606r - 47761 + 365331 + 369549 for r. -58 Solve -31386w = -32625w + 20074 + 34442 for w. 44 Solve -336f - 32022 = -1689f - 10374 for f. 16 Solve -168b + 22828210 = 22834090 for b. -35 Solve 664a + 27225 + 14553 = -258a + 289a for a. -66 Solve -1575o = 6479 + 8289 + 7282 for o. -14 Solve 1326 + 3279 + 1613 + 1504 = -594n for n. -13 Solve 243l + 254l - 743l + 125l + 1210 = 0 for l. 10 Solve 66198 - 159142 = -3343p + 378419 for p. 141 Solve -3418453o + 3418365o = 5808 for o. -66 Solve 982h + 29494 + 35767 + 13713 = 20054 for h. -60 Solve -1225v - 715v - 24498 = 45985 + 9057 for v. -41 Solve 975054 = -295t + 966499 for t. -29 Solve -1029q - 29419 = -171q + 91q for q. -31 Solve -14137 = -707u - 6869 + 12528 for u. 28 Solve -5087a + 18443 + 102377 = -3361a for a. 70 Solve 688n - 9433 - 17946 = 17641 - 7868 for n. 54 Solve -4950 + 3833 = -356d - 40277 for d. -110 Solve -532q - 3112q + 14695 + 135119 = -77q for q. 42 Solve -5222v + 2068 = -71040 for v. 14 Solve 2630h + 66560 = 1798h for h. -80 Solve -5834768j = -5834707j + 732 for j. -12 Solve -11i - 25 - 3 - 64 + 4 = 0 for i. -8 Solve 5087 - 3937 = -46y for y. -25 Solve 1182u - 3189 - 1945 + 16743 = -10849 for u. -19 Solve -709h - 9728 - 4832 = 4583 for h. -27 Solve 3781d = 5541d - 66880 for d. 38 Solve 85i + 13896 = -152i + 132i - 281i for i. -36 Solve 102g - 981375 = -984639 for g. -32 Solve 51i + 242 = -232 + 2055 for i. 31 Solve 3380h + 79675 + 82565 = 0 for h. -48 Solve 5696 = -408804z + 408893z for z. 64 Solve -4245v = -4010v - 12690 for v. 54 Solve -30a + 173407 - 174697 = 0 for a. -43 Solve -55a = -2043 + 143 - 1762 + 197 for a. 63 Solve -93p - 88024 = -88489 for p. 5 Solve 3409t + 5327 = -141260 for t. -43 Solve 922 - 4686 - 7396 = 226r + 146r for r. -30 Solve 354k - 15601 + 8125 = -11k + 14059 for k. 59 Solve -98w = 168 + 204 + 363 - 49 for w. -7 Solve 47m + 6503 = 7490 for m. 21 Solve 31602d - 31634d = 128 for d. -4 Solve 0 = 1007l - 35488 - 49813 - 8350 for l. 93 Solve 1278x - 362758 = -1340x - 17182 for x. 132 Solve -2f - 5492 = -5590 for f. 49 Solve 222w - 207w - 619w - 40468 = 0 for w. -67 Solve -468 + 2119 + 1508 - 207 = -123r for r. -24 Solve 8405 = 72r + 13445 for r. -70 Solve -11505z - 2096849 = -8859z + 18971z for z. -97 Solve -18257p = -17713p - 544 for p. 1 Solve 384r + 1426r + 233r - 370r = 0 for r. 0 Solve 286r + 783r = 55r + 40560 for r. 40 Solve 144m = 63m - 59m - 7280 for m. -52 Solve 0 = -30917w + 31102w + 8510 for w. -46 Solve -993n - 2891n = -704n - 122403 - 71577 for n. 61 Solve -162 - 434 = -19q + 31q + 232 for q. -69 Solve 0 = -563i + 12268 - 15637 - 19714 for i. -41 Solve -1481 - 1135 - 3663 = 17o + 74o for o. -69 Solve 0 = 85543a - 85182a + 8303 for a. -23 Solve -4892b = -8765 - 152671 for b. 33 Solve 529 + 34675 = -2708v for v. -13 Solve -187u + 196u = -38 + 110 for u. 8 Solve 4376h - 4653h = -7952h - 191875 for h. -25 Solve -1002*x = -17756 - 17314 for x. 35 S	{ "pile_set_name": "DM Mathematics" }
, 226? 18m2 + 3m - 74 What is the s'th term of 29012, 29005, 28998, 28991? -7s + 29019 What is the f'th term of 2662705, 2662707, 2662709, 2662711? 2f + 2662703 What is the d'th term of 176, 431, 686, 941, 1196? 255d - 79 What is the p'th term of 186788, 373545, 560302, 747059, 933816? 186757p + 31 What is the x'th term of -9839, -19680, -29521, -39362? -9841x + 2 What is the n'th term of -363334, -726672, -1090010? -363338n + 4 What is the o'th term of -4029, -16103, -36221, -64383, -100589, -144839? -4022o2 - 8o + 1 What is the l'th term of -19, -85, -273, -649, -1279? -11l3 + 5l*2 - 4l - 9 What is the w'th term of 71, 370, 1177, 2744, 5323? 42w3 + 2w*2 - w + 28 What is the g'th term of 51, 111, 195, 303? 12g*2 + 24g + 15 What is the q'th term of 2324, 2331, 2342, 2357, 2376? 2q2 + q + 2321 What is the b'th term of 38481, 153906, 346273, 615576, 961809, 1384966, 1885041, 2462028? -b3 + 38477b2 + b + 4 What is the k'th term of -81, -225, -385, -567, -777? -k3 - 2k2 - 131k + 53 What is the s'th term of -499, -3952, -13323, -31570, -61651, -106524, -169147? -493s3 - s2 + s - 6 What is the b'th term of 927, 1931, 2935, 3939, 4943, 5947? 1004b - 77 What is the q'th term of 137388, 137392, 137396, 137400, 137404, 137408? 4q + 137384 What is the x'th term of 34677, 34637, 34597? -40x + 34717 What is the q'th term of 912, 804, 644, 450, 240, 32, -156, -306? 3q3 - 44q*2 + 3q + 950 What is the u'th term of -1218, -1027, -822, -597, -346, -63, 258? u3 + u2 + 181u - 1401 What is the z'th term of -391, -421, -521, -727, -1075, -1601, -2341, -3331? -6z3 + z2 + 9z - 395 What is the r'th term of -1477, -1471, -1465? 6r - 1483 What is the q'th term of -97, -25, 79, 203, 335, 463, 575? -2q3 + 28q*2 + 2q - 125 What is the r'th term of 395, 412, 429, 446, 463? 17r + 378 What is the s'th term of -6673, -6641, -6609, -6577, -6545, -6513? 32s - 6705 What is the x'th term of -75, -232, -329, -366, -343? 30x2 - 247x + 142 What is the u'th term of 2136, 4225, 6278, 8295? -18u2 + 2143u + 11 What is the r'th term of -46, -201, -600, -1363, -2610, -4461, -7036? -20r3 - 2r*2 - 9r - 15 What is the t'th term of -182, -231, -306, -407, -534, -687? -13t2 - 10t - 159 What is the v'th term of 715523, 715516, 715495, 715454, 715387, 715288? -v3 - v2 + 3v + 715522 What is the k'th term of -1429713, -1429714, -1429715? -k - 1429712 What is the t'th term of -33822, -33820, -33818, -33816, -33814? 2t - 33824 What is the y'th term of 12380, 24753, 37126, 49499, 61872, 74245? 12373y + 7 What is the t'th term of 1418, 3292, 5166, 7040, 8914, 10788? 1874t - 456 What is the g'th term of -2518, -2524, -2564, -2656, -2818? -3g3 + g2 + 12g - 2528 What is the c'th term of 165, 436, 921, 1620, 2533, 3660? 107c2 - 50c + 108 What is the c'th term of -940, -1751, -2576, -3421, -4292, -5195, -6136, -7121? -c3 - c2 - 801c - 137 What is the b'th term of -7, -473, -1247, -2329, -3719, -5417, -7423? -154b*2 - 4b + 151 What is the r'th term of 72, 313, 708, 1251, 1936, 2757, 3708, 4783? -r*3 + 83r*2 - r - 9 What is the p'th term of 31217, 62427, 93637, 124847, 156057? 31210p + 7 What is the m'th term of -1441, -5855, -13217, -23527, -36785, -52991, -72145? -1474m2 + 8m + 25 What is the f'th term of 2175, 4353, 6521, 8685, 10851, 13025? f*3 - 11f*2 + 2204f - 19 What is the w'th term of 44, 260, 622, 1124, 1760, 2524, 3410, 4412? -w*3 + 79w*2 - 14w - 20 What is the i'th term of -48, -122, -228, -366, -536, -738? -16i2 - 26i - 6 What is the h'th term of -27661, -27645, -27627, -27607, -27585, -27561? h*2 + 13h - 27675 What is the z'th term of -218, -216, -206, -182, -138, -68, 34? z*3 - 2z*2 + z - 218 What is the u'th term of 5745, 22927, 51585, 91737, 143401, 206595? 3u*3 + 5720u*2 + u + 21 What is the v'th term of -8783, -17592, -26401? -8809v + 26 What is the c'th term of -25538, -25851, -26372, -27101, -28038, -29183? -104c2 - c - 25433 What is the h'th term of -1182, -1264, -1334, -1386, -1414, -1412? h3 - 89h - 1094 What is the d'th term of 115702, 115699, 115692, 115681, 115666, 115647, 115624? -2d2 + 3d + 115701 What is the p'th term of -8392, -8442, -8482, -8506, -8508, -8482, -8422? p3 - p2 - 54p - 8338 What is the j'th term of 249709, 249713, 249717, 249721, 249725? 4j + 249705 What is the f'th term of -36192, -72357, -108522, -144687, -180852? -36165f - 27 What is the f'th term of 416721, 833447, 1250173, 1666899? 416726f - 5 What is the m'th term of -1135, -2257, -3367, -4465, -5551, -6625? 6m2 - 1140m - 1 What is the f'th term of 10477, 10450, 10395, 10306, 10177, 10002? -f*3 - 8f*2 + 4f + 10482 What is the q'th term of 451, 1688, 3755, 6658, 10403? q*3 + 409q*2 + 3q + 38 What is the q'th term of 4310, 4311, 4314, 4319, 4326? q*2 - 2q + 4311 What is the l'th term of 22, 1, -88, -281, -614? -6l3 + 2l*2 + 15l + 11 What is the d'th term of 4150, 8299, 12450, 16603, 20758, 24915? d*2 + 4146d + 3 What is the a'th term of 7791, 7626, 7173, 6288, 4827, 2646? -24a3 + 3a + 7812 What is the s'th term of 20728, 20741, 20762, 20791, 20828, 20873? 4s2 + s + 20723 What is the l'th term of -387899, -387893, -387883, -387869, -387851, -387829? 2l*2 - 387901 What is the g'th term of -70, -311, -726, -1315, -2078, -3015, -4126? -87g*2 + 20g - 3 What is the a'th term of -15, 84, 245, 468, 753, 1100, 1509? 31a2 + 6a - 52 What is the h'th term of 53340, 106678, 160020, 213366, 266716, 320070, 373428? 2h2 + 53332h + 6 What is the f'th term of -8209, -8180, -8133, -8068, -7985? 9f2 + 2f - 8220 What is the i'th term of 332, 652, 972, 1292? 320i + 12 What is the a'th term of -1087, -2423, -4015, -5857, -7943? a3 - 134a*2 - 941a - 13 What is the l'th term of 28442, 28451, 28464, 28481, 28502? 2l2 + 3l + 28437 What is the x'th term of -5402, -6717, -8032, -9347, -10662, -11977? -1315x - 4087 What is the u'th term of -1880, -7487, -16816, -29855, -46592, -67015, -91112? 2u*3 - 1873u*2 - 2u - 7 What is the t'th term of 25319, 25312, 25303, 25292, 25279, 25264, 25247? -t*2 - 4t + 25324 What is the a'th term of 713, 1448, 2203, 2978, 3773? 10a2 + 705a - 2 What is the x'th term of 25, 41, 3, -143, -451? -9x3 + 27x*2 - 2x + 9 What is the o'th term of -33, 44, 173, 354, 587, 872, 1209? 26o2 - o - 58 What is the j'th term of 11124, 22314, 33502, 44688, 55872, 67054? -j2 + 11193j - 68 What is the n'th term of 13798, 13732, 13666, 13600? -66n + 13864 What is the s'th term of -8, -13, -22, -35? -2s*2 + s - 7 What is the x'th term of -605, -875, -1327, -1961, -2777, -3775? -91x*2 + 3x - 517 What is the a'th term of -13532, -54103, -121724, -216389, -338092, -486827, -662588, -865369? a*3 - 13531a*2 + 15a - 17 What is the v'th term of -1020, -1110, -1210, -1326, -1464, -1630, -1830? -v3 + v2 - 86v - 934 What is the i'th term of 4555, 9103, 13653, 18205? i2 + 4545i + 9 What is the k'th term of 163, 377, 587, 787, 971, 1133? -k*3 + 4k*2 + 209k - 49 What is the p'th term of 17114, 34280, 51446, 68612, 85778, 102944? 17166p - 52 What is the l'th term of 1451, 1866, 2271, 2660, 3027, 3366, 3671, 3936? -l3 + l2 + 419l + 1032 What is the b'th term of -1260, -998, -736? 262b - 1522 What is the s'th term of -28, -146, -474, -1120, -2192? -18s*3 + 3s*2 - s - 12 What is the n'th term of 22808, 45516, 68224? 22708n + 100 What is the n'th term of 67, 210, 447, 778, 1203, 1722? 47n2 + 2n + 18 What is the w'th term of -1388, -5543, -12468, -22163, -34628? -1385w2 - 3 What is the a'th term of -133, -294, -549, -886, -1293, -1758? 2a*3 - 59a*2 + 2a - 78 What is the s'th term of 406, 375, 346, 319, 294, 271? s*2 - 34s + 439 What is the l'th term of -15029, -15024, -15007, -14972, -14913, -14824? l*3 - 2l - 15028 What is the r'th term of -1588, -1572, -1552, -1528, -1500, -1468, -1432? 2r2 + 10r - 1600 What is the w'th term of 4936, 9722, 14508, 19294? 4786w + 150 What is the c'th term of 3147, 6372, 9597? 3225c - 78 What is the p'th term of 171, 580, 1263, 2220? 137p2 - 2p + 36 What is the x'th term of 125014, 250023, 375032, 500041, 62505	{ "pile_set_name": "DM Mathematics" }
nd (-c2 - c2 + 0c2)(-2c + 7c - 6c) - 3c*3 + 2c*3 + 1 + 22c*2 - c - 23c2. c3 - c*2 - c + 1 Expand 42 - 42 + 7n*5 + (0 + 1 - 7 + (-5 + 5 + 1)(-5 - 6 + 3))(0 + 0 - n5 - n). 21n*5 + 14n Expand (3o - o3 - 3o)(4 - 7o - 4 + (-1 + 1 + o)(6 - 2 - 2)) + 4o3 + o4 + 3o4 - 3o*4. 6o*4 + 4o*3 Expand ((0u + 6u - 5u)(6u - 3u - 2u) - u + u + u*2)(-59u3 - 16u*3 + 23u*3). -104u*5 Expand (-2g - 2g + 6g)(-2g*4 + 0g*4 + 4g*4) + 163g*5 + 6g*3 - 6g*3 + 172g*5. 339g*5 Expand (0 + 2 + 0)(-7x5 + 4x*5 - 4x*5) - 141x*5 + 205x*5 - 247x*5. -197x*5 Expand 5n*3 - 31n*3 + 17n*3 + (2n + n + 2n)(n*2 - 1 + 1). -4n*3 Expand (-411 + 22 - 348 - 81)(-5u + 5u + u). -818u Expand (-3b*2 + 32b*2 - 4b*2)(-4b - 1 + 1)(3b - 3b - 7b2). 700b*5 Expand (3 - 8 - 7)(4x - 4x + 2x)(-4x + 4x + 2x). -48x*2 Expand ((3p - 2p - 2p)(-p - 3p + 5p) + 0p*2 + 0p*2 - 2p*2)(25 - 25 - 76p). 228p*3 Expand (-3 - 4 + 1 + (-1 + 2 - 3)(1 - 1 + 2) - 2 + 2 + 5)(-3 + 0 + 4 + 5 - 3 + 0 + (3 + 2 - 4)(-1 - 2 + 2))(-4 + 4 + x2). -10x2 Expand (-u2 + u*2 - 2u*3)(0u2 + 2u2 - u2) - 81u5 - 31u*5 - 19u*5 + (3u*3 - 3u*3 - 2u*5)(1 + 3 - 2) + 3u5 - 3u*5 - 2u*5. -139u*5 Expand 2z*4 - 2z + 2z5 - 2z*4 + (205z*3 - 117z*2 + 238z*2 - 124z*2)(3 + z*2 - 3). 207z*5 - 3z*4 - 2z Expand (-5 + q + 5)(4 - 2 - 1 + (-3 - 2 + 4)(7 + 0 + 3) + (-3 + 5 - 4)(1 - 3 - 10)). 15q Expand (-k*2 + 0 + 4k*2 - 2)(-3 + 1 - 5 + (3 - 3 - 1)(-5 + 5 - 3)). -12k*2 + 8 Expand -8w*3 + 4w*4 + 8w*3 + (-2 + 5w*3 + 2)(0 - w + 0) - 3w4 + 3w*4 + 2w*4 + 4 - 2w*4 - 2 + 4w*4. 3w*4 + 2 Expand (-158 + 75 - 131)(1 + 4t3 - 2t*3 - 2). -428t*3 + 214 Expand (-1 + 4 - n - 5)(-2 + 4 - 1)(-12n - 10n - 6n). 28n2 + 56n Expand (8 + 2 + 5)((1 + 3 - 3)(1 - 3 + 3) + 2 + 2 - 3)(-g + 0 + 0). -30g Expand -2d3 + 3d - 3d + (3d + 3d - 5d)(-3d - d*2 + 3d) + d - d - 2d3 + 2 - 2 - d3 - 2d*3 + 2d*3 + 2d*3 - 220d*3 + 730d*3 + 626d*3. 1132d*3 Expand (26 + 6 + 6)(-1 + 4 + 0 - 53v2 - 3). -2014v*2 Expand (-37 - 23 - 7)(10p - 4p - p). -335p Expand (-2u*2 - 2u + 2u)(-u2 - u2 + 0u2) + 107u - 34u4 + 84u - 189u. -30u*4 + 2u Expand 0 + 0 + c*3 + (-1 - 2 + 0)(-5c3 + 4c - 4c). 16c*3 Expand (4 - 3 - 3)(-647y2 + 1042y*2 - 580y*2). 370y*2 Expand (-3 - 6 + 3)(-128 - d + 128)(-2 + 3 + 0). 6d Expand (0t + 0t - 9t2)(-t + t - 2t) + (1 - 1 + t3)(1 - 7 - 3) + (-4t - t + 3t)(-2t*2 + 4t*2 - 4t*2). 13t3 Expand u2 + 0 + 0 + u*2 - 4u*2 + 2u2 - u2 + 6u2 - 3u*2 + (-3u + 3 - 3)(25u - 20u + 8u). -37u2 Expand (-213m*2 + 31m*4 + 213m*2)(-m - 5m + 5m)(2 - 5 + 5). -62m*5 Expand (3j*2 - 3j2 + j2)(-6 - 1 + 2) + j2 - 9 + 9. -4j*2 Expand (2a - 2a + a)(-8 + 3a + 0a + 12)(3 + 2a + 2a - 6a). -6a3 + a2 + 12a Expand (-3w2 + 2w*2 + 0w*2)(90w3 - 12516w + 12516w). -90w*5 Expand (3g + g - 6g + (2g + g - g)(5 - 4 + 1) + 11 - 3g - 11)(42 + 17 + 3). -62g Expand (2 - 2 - 1)(-2f + 2f - 2f) + (11 - 8 - 2)(3f - 2f - 2f) + (3 - 2 + 1)(3f + f + 2f) + f + 4 - 4. 14f Expand (2z + 1 - 3 + z)((-2z + 4 - 4)(-3z + z + z) + 0z*2 + 8z*2 - 3z*2 - 2z*2 + 0z*2 + 4z*2 + 2z*2 + 1 - 1). 33z*3 - 22z*2 Expand (-3i + 7i - 3i)(-2i3 - i3 + 4i3) - 7i*4 - 2186i + 1 + 2186i. -6i*4 + 1 Expand 71a3 - 1236 + 1236 + a2 + a3 - a2 + (3a2 - 3a*2 + 2a*2)(8a - 3a - 3a). 76a*3 Expand (-3t + 4t + 0t)(-152 + 222 - 123). -53t Expand ((-b + 0 + 0)(b2 - b2 - b2) + 48b*2 - 48b*2 + 10b3 - 2 + 2 + b3)(22b + 6b + 31b). 708b4 Expand (-3 + 2 + 4)(-4q + 2 - 4q + 0q). -24q + 6 Expand (-19 + 5g + 19)(-17g4 - 6g*4 + 38g*4). 75g*5 Expand (-2p*4 - 2p*3 + 2p*3)(1 - 6 + 3) - p + 2p4 + p + 19p*2 - 52p*4 - 19p*2. -46p*4 Expand (-5t*2 + 2t*2 + 4t*2)((1 + 2t - 1)(-10t + 2 - 2) - 4t - t*2 + 4t). -21t4 Expand (5 + 1 - 4)(124 + 141 - 77)(159r + 0r4 + r4 - 1 - 164r). 376r4 - 1880r - 376 Expand (s + s - s)(-2234 + 2234 - 84s*2) + 3s*3 - 2s*3 - 3s*3. -86s*3 Expand 151i - 151i + 72i*3 + 84i*3 + (-3i*2 + 2i*2 + 3i*2)(2 - i - 2) - 2i3 + 3 - 3. 152i*3 Expand (-11y + 43y + 8y)(-4 + 2 - 1) + (-y - 1 + 1)(0 - 2 + 0) - 5y + 3y + 3y. -117y Expand ((k - k + 2k)(k + 0k - 2k) - 9k2 - k2 - 6k*2)(-k + 2k2 + k). -36k*4 Expand (0o + 0o + o)(5o + 0o - 6o) + 0o2 + o2 - 4o2 + (0 + 2 - 1)(4o2 + o2 - 3o*2) + 0o2 - 2 + o + o2 + 7o. -o2 + 8o - 2 Expand -2m - 13m + 3m + (-m + 3 - 3)(2 - 3 - 3)(-22 - 23 + 35). -52m Expand (2d3 - 3d*3 + 2d*3)(-2d + 8 - 8) + 0d*4 - 5d4 - d4 - 8d2 + 8d*2 + 6d*4. -2d*4 Expand (23z2 + z2 - 61z2)(-2z3 + 0z3 + z3). 37z5 Expand 2a*4 + 4a*2 - 4a*2 + (-13 + 31 + 2a + 38)(-4a - a + 3a)(-2 + 2 + 3a2). -10a*4 - 336a*3 Expand 6y*5 + 11y*5 + 9y*5 + (0 + 0 - 2y)(y2 - y4 - y2) - 3y*5 + 4y*5 - 2y*5. 27y*5 Expand 17a + 9a + 7a + (0 + 1 - 2)(13a + 14a + 4a). 2a Expand ((5 - 1 - 3)(1 - 2 - 1) - 17 - 10 + 54 - 1 - 1 + 3)(h + 2h - 2h)(2 + 3 - 4 + 4 - 1 + 5 + (-1 + 2 + 1)(-1 + 3 - 1) + 2 + 2 - 2). 338h Expand (-3m - 3m + 4m)(11 - 5 - 5) + m - 4m + 4m + 0 + m + 0 + (0m + m - 3m)(3 + 0 - 5) + 4 + 2m - 4. 6m Expand 5 - 5 - 2u + (-2 + 2 - u)(-1 - 4 + 7) + (0u + u - 2u)(1 + 0 - 5) + 39 - 22 + 21u - 19. 21u - 2 Expand (-3l + 2l + 0l)(-4l2 + l2 + l2)(l - 6l - 2l)(6l + l - 4l). -42l*5 Expand (2z + 1 - 1 + (-2z + 5z + 7z)(0 + 5 - 4))(-4 + 6 - 4). -24z Expand (1 - 3 - 4)(-2 + 2 + 2c + (-1 + 1 - c)(8 + 5 - 1)). 60c Expand (-2 - 3 + 3)(12z - 2z + z)(-7 + 2 + 1)(-4 - 7 + 0)(3z3 - 4z3 - z3 + 2z). 1936z*4 - 1936z*2 Expand -393u*3 - 77u + 74u + 316u*3 - 3u*3 + 0u3 + u3 + (0u + 3u - u)(2u - 2u - u2) + u3 + 1 - 1. -80u*3 - 3u Expand (-966 - 36d2 + 966)(-13 - 11 + 5). 684d2 Expand (0 + 7 - 5 + v2)(-8v3 - 3 + 3). -8v*5 - 16v*3 Expand 2v4 + v4 - 5v4 + (2v + 5v - 6v)(-60v - 28v + 194v)(v2 - 2v*2 + 0v*2) + 0 + 0 + 3v*4. -105v*4 Expand (-1 + 3 + 4)(-10m + 19 - 2m - 20) - 1 + 1 + 2m. -70m - 6 Expand ((2 - 2 + p*3)(2p - 5p + p) + 0p3 + p4 + 0p*3)((2 - 2 - 1)(1 + 1 + 0) - 39 - 24 + 4). 61p*4 Expand (-4k*2 + 5k2 + k2)(57k*3 + 16k*3 - 17k*3). 112k*5 Expand (z + 4z - 3z)(0 - z*2 + 0) - 57z*3 + 9z*3 - 38z3 + z3 + 2 - 2. -87z3 Expand (-6 - 5 - 3)(3a - 4a - a)(-19 + 7 - 8 - 4). -672a Expand (28 + 4k - 28 + (-k + 44k + 36k)(0 + 3 - 2))(-3k - 3k + 5k). -83k2 Expand -j2 + 3j*2 + 0j*2 + (2 + 0 + 0)(11612j - 56j*2 - 11612j). -110j2 Expand (-k4 - 2k*4 + 4k*4)(0k - k - 4k) + (0k5 - 2k*5 + 4k*5)(-1 - 1 + 1) - 6k5 + k5 + 3k*5. -9k*5 Expand -9r*2 - 45r*2 + 21r*2 + (0r - r + 0r)(-2r + 3 - 3). -31r*2 Expand (-2 + 2 - 9n)(-11 - 18 - 1) + (n + n - n)(2 + 2 - 3) - 2n + 0n + 0n - 4n + 2n + 4n + 0n - 4n + 5n. 272n Expand (7o - 4 + 4)(o*2 + 2o2 - o2) - 272o + 3o*3 - 1 + 278o + 4o3. 21o*3 + 6o - 1 Expand 2 + i*2 - 25i - 18i + 57i + (-3 + 5 - 1)(-4i*2 + 6i*2 + 4i*2). 7i*2 + 14i + 2 Expand (-2h + 2h + h)(-3h - 3h + 5h) + 5h2 - 26h2 - h2 + 2 - 2 - 2h2. -25h*2 Expand (0j*2 + 0j2 - j4)(2 + j - 2) - 180 + 180 - 6j*5. -7j*5 Expand ((h + 3 - 3)(20 + 2 - 4) - 4h + 2h + 0h)(2h4 + 2h - 2h). 32h*5 Expand (-2v2 + v2 + 3v2)(-65v - 30v - 88v). -366v*3 Expand (-2o*2 + 0 + 0)(-1622o + 286o + 854o - 1742o). 4448o3 Expand (4d3 - d3 - 2d3)(0d - d + 0d) + (-370 + 105d4 + 370)(2 - 2 - 4)(4 - 3 + 1). -841d4 Expand (a2 - a*2 - 2a*4)(1 - 1 - 3a) + 12a*4 - 21a*5 - 12a4 + a5 + 3a5 + a5. -10a*5 Expand (-3w4 - w4 + 2w4)(-33w - 116w - 15w). 328w5 Expand (137 + f3 - 137)*(2	{ "pile_set_name": "DM Mathematics" }
without replacement from mkmokkmkkmk. 1/55 Calculate prob of sequence lt when two letters picked without replacement from {t: 4, b: 4, l: 2}. 4/45 Three letters picked without replacement from {j: 1, p: 4, v: 3, u: 6, c: 2}. What is prob of sequence ucv? 3/280 Calculate prob of sequence ppd when three letters picked without replacement from {j: 1, c: 1, a: 1, p: 2, d: 1, g: 2}. 1/168 Calculate prob of sequence ce when two letters picked without replacement from {y: 3, c: 2, o: 3, e: 1, g: 1, n: 1}. 1/55 Two letters picked without replacement from {s: 1, t: 18, i: 1}. What is prob of sequence tt? 153/190 Calculate prob of sequence qqq when three letters picked without replacement from {w: 17, q: 3}. 1/1140 Two letters picked without replacement from {w: 6, x: 1, p: 6, f: 3, i: 1}. What is prob of sequence px? 3/136 Calculate prob of sequence vm when two letters picked without replacement from {v: 2, m: 3, k: 2, o: 8, z: 2}. 3/136 Two letters picked without replacement from kkkkkkkpppspkk. Give prob of sequence kp. 18/91 Calculate prob of sequence pu when two letters picked without replacement from qwppuuwuuuwquwipuw. 7/102 What is prob of sequence cuo when three letters picked without replacement from zocezehzuheooh? 1/728 Three letters picked without replacement from feefwkgkrfkkrffff. What is prob of sequence fke? 7/510 What is prob of sequence zvz when three letters picked without replacement from zvvzz? 1/5 What is prob of sequence ko when two letters picked without replacement from {k: 1, l: 3, o: 1}? 1/20 What is prob of sequence tek when three letters picked without replacement from ekektektteetktekkeke? 7/171 Calculate prob of sequence iji when three letters picked without replacement from ijiij. 1/5 Three letters picked without replacement from {u: 5, x: 1, n: 2, o: 7, t: 1, g: 4}. Give prob of sequence tog. 7/1710 Four letters picked without replacement from dddaddadadadddda. What is prob of sequence addd? 165/1456 Three letters picked without replacement from {d: 1, u: 1, x: 1, l: 2}. Give prob of sequence dul. 1/30 Four letters picked without replacement from {l: 3, j: 4, r: 5}. What is prob of sequence jljj? 1/165 What is prob of sequence ybx when three letters picked without replacement from xikikeybe? 1/504 What is prob of sequence rem when three letters picked without replacement from amvvmaemamreamamafm? 7/2907 Two letters picked without replacement from rrkkrrrkrrrr. What is prob of sequence kr? 9/44 Four letters picked without replacement from {d: 4, g: 14}. What is prob of sequence ddgd? 7/1530 Calculate prob of sequence ffb when three letters picked without replacement from fbswbffsbfswwbwsfwbb. 1/57 What is prob of sequence rdax when four letters picked without replacement from {d: 1, x: 8, r: 8, a: 1}? 2/2295 Three letters picked without replacement from qbbqbopqpzzqof. Give prob of sequence pqz. 2/273 Three letters picked without replacement from ccocccyhyj. Give prob of sequence cyc. 1/18 Three letters picked without replacement from {a: 2, y: 3}. Give prob of sequence aya. 1/10 What is prob of sequence rrsu when four letters picked without replacement from {s: 2, q: 2, u: 1, n: 1, r: 1}? 0 Four letters picked without replacement from xxzxxzx. Give prob of sequence xxxz. 1/7 Three letters picked without replacement from {d: 1, a: 1, x: 2, s: 2, h: 1}. What is prob of sequence sds? 1/105 Three letters picked without replacement from mkmkrgmmrrg. Give prob of sequence kmg. 8/495 Four letters picked without replacement from {b: 2, q: 2, s: 1, g: 6, j: 7}. Give prob of sequence jsjg. 7/2040 What is prob of sequence lsk when three letters picked without replacement from lakldllsalklll? 2/273 Two letters picked without replacement from {s: 1, t: 1, y: 2, i: 1}. What is prob of sequence iy? 1/10 Three letters picked without replacement from jhypbyybyppbpybyyqph. What is prob of sequence jpj? 0 Calculate prob of sequence gtjt when four letters picked without replacement from nlgngtgljtlggggljlg. 1/2907 Two letters picked without replacement from {d: 11, q: 1}. Give prob of sequence qd. 1/12 What is prob of sequence vjxj when four letters picked without replacement from bbxxxjwjbbv? 1/1320 Three letters picked without replacement from {i: 2, n: 1, b: 4, t: 2, j: 7}. Give prob of sequence jjj. 1/16 What is prob of sequence bfmi when four letters picked without replacement from sfbmsrsrribssrbfss? 1/12240 What is prob of sequence hhq when three letters picked without replacement from xexeehhxqqexqeqhehq? 10/969 Two letters picked without replacement from fntcfftjnf. Give prob of sequence jc. 1/90 Calculate prob of sequence ewf when three letters picked without replacement from wwwefzwwwyewfwfwz. 9/680 What is prob of sequence oo when two letters picked without replacement from {o: 7, m: 2}? 7/12 Four letters picked without replacement from {j: 4, m: 14}. What is prob of sequence jjmm? 91/3060 Three letters picked without replacement from {d: 5, h: 2, g: 3}. What is prob of sequence ddd? 1/12 Four letters picked without replacement from iniirrurinunnnur. What is prob of sequence nrii? 1/182 Two letters picked without replacement from frfxc. Give prob of sequence cr. 1/20 Four letters picked without replacement from {u: 2, q: 7, b: 3}. What is prob of sequence qqbq? 7/132 Two letters picked without replacement from {f: 4, z: 3, c: 1, d: 4, m: 3, n: 2}. What is prob of sequence fz? 3/68 Three letters picked without replacement from xlrlttrjtrtlllr. What is prob of sequence lxl? 2/273 Calculate prob of sequence nxo when three letters picked without replacement from {z: 4, o: 1, q: 2, n: 1, x: 2, g: 4}. 1/1092 Four letters picked without replacement from {u: 5, x: 5, n: 4}. Give prob of sequence xxun. 50/3003 Two letters picked without replacement from mxxxmxmxmximix. Give prob of sequence ix. 1/13 Two letters picked without replacement from uzumzmzzzu. What is prob of sequence mm? 1/45 Calculate prob of sequence kk when two letters picked without replacement from kkkkkkkkfkfkkkkkkk. 40/51 Two letters picked without replacement from txttxxttttxtxt. What is prob of sequence tt? 36/91 Four letters picked without replacement from {q: 5, g: 3, e: 3}. Give prob of sequence gqeg. 1/88 Four letters picked without replacement from {p: 2, y: 11, x: 1, q: 1}. What is prob of sequence qpyx? 11/16380 Calculate prob of sequence szuz when four letters picked without replacement from izzziizuspz. 1/396 Two letters picked without replacement from jzjibjwwbjjoizjbwzw. Give prob of sequence wb. 2/57 Three letters picked without replacement from aaaauutaaafata. Give prob of sequence auu. 3/364 Calculate prob of sequence aj when two letters picked without replacement from eltamaletjeat. 1/52 Two letters picked without replacement from {s: 2, h: 1, m: 1, b: 2, e: 1}. What is prob of sequence em? 1/42 Two letters picked without replacement from ysurmux. Give prob of sequence my. 1/42 Two letters picked without replacement from ipdiijj. What is prob of sequence dp? 1/42 Three letters picked without replacement from {r: 3, d: 1, t: 4}. Give prob of sequence ttt. 1/14 Two letters picked without replacement from {p: 2, a: 1, d: 4, k: 2}. What is prob of sequence pk? 1/18 What is prob of sequence iqhi when four letters picked without replacement from iqilqllllqlhq? 1/2145 What is prob of sequence tz when two letters picked without replacement from zztztzzzzzzztzzttzzz? 15/76 What is prob of sequence ala when three letters picked without replacement from {i: 3, h: 1, a: 8, l: 5, c: 2}? 140/2907 What is prob of sequence lh when two letters picked without replacement from {l: 6, h: 4}? 4/15 What is prob of sequence jjju when four letters picked without replacement from ujuuuujujj? 1/35 What is prob of sequence bpt when three letters picked without replacement from {t: 5, p: 7, b: 1}? 35/1716 Calculate prob of sequence jjm when three letters picked without replacement from {m: 7, j: 2, a: 5}. 1/156 Three letters picked without replacement from {l: 2, i: 6, q: 5}. Give prob of sequence lqq. 10/429 Two letters picked without replacement from jkhjtnpnnttn. Give prob of sequence tp. 1/44 Four letters picked without replacement from {a: 3, j: 5}. Give prob of sequen	{ "pile_set_name": "DM Mathematics" }
) q (c) 4 c Suppose -5w - 626 = 4t + 591, -2t = 3w + 729. Let o = -245 - w. What is the second smallest value in 39, -5, o? o Let z be ((-24)/(-30))/(1/(-20)). Let d be (-12)/z + (-17)/(-4). What is the second biggest value in -1/2, d, 16? d Let r be 8/(-28) - 69/(-21). Let v = 250 + -85. Let f = 165.1 - v. What is the biggest value in -2, r, f, -0.3? r Let k be 3410680/(-3120)9/(-7). What is the third biggest value in 0.4, 0, k, 2? 0.4 Let w = -48 - -34. Let v be ((52/84)/13)/((-1)/3). What is the second biggest value in w, -3, v? -3 Let n = 8.067 + -0.067. Let r = n + -8.2. Suppose 14l = 16l - 6. Which is the second biggest value? (a) r (b) l (c) -1/3 a Let j = -161 - -160.8. Let k = 5.3 + -7.3. Let s = k + 2.3. Which is the second biggest value? (a) -0.3 (b) s (c) j (d) 0.2 d Let v = 60.86 + -2.86. Let p = v - 58.4. What is the biggest value in 13, p, -1/4? 13 Let t be 9(88/9 + (-37 - -28)). Suppose -j + 1 = -4. Which is the smallest value? (a) 1 (b) t (c) j a Let u = -49 - -169. Let p be (-100)/u + (-1)/(-2). What is the biggest value in 1/5, p, -3? 1/5 Let r = -0.6021 - -0.5821. What is the third smallest value in -0.04, -0.05, 0, r? r Let h = 434071/10 + -43407. Suppose 0 = -0q - 3q + 3. Let o be 63/15 + q/(-5). Which is the third biggest value? (a) o (b) h (c) 2/13 b Let h = 1/17434 - -34865/52302. Let y = 5.04 + -0.04. Let o = y + -9. Which is the third biggest value? (a) h (b) o (c) 3/2 b Let r = -1.3 + 2. Let b(z) = -z*2 - z + 6. Let m be b(0). Suppose 0 = 5j + j + m. What is the second biggest value in -5, 0.3, j, r? 0.3 Let f be 1/4 + 9/12. Let b = 90/659 + -354243/2636. Let o = 134 + b. What is the smallest value in f, o, 0.3? o Let n = 420.83 - 419. Let u = n - 1.49. Which is the fourth smallest value? (a) 1 (b) 4 (c) u (d) -3/8 b Suppose x = -p - 76, 4p - 2x + 300 = -7x. Let d be (1 + -2)512/p. Let h be (-1 - 105/(-100))(-1 + 3). What is the third smallest value in 4, 0.3, d, h? d Let x = 0.07 - 2.57. Let y = -0.5 + x. Let q = 15 - 15.1. Which is the third biggest value? (a) y (b) q (c) 1 a Let n = -49 + 134. Let h = 849/10 - n. Let f = -5/76 - -53/228. Which is the third biggest value? (a) -4 (b) -1/4 (c) h (d) f b Let z(o) = 1834o3 - 3667o*3 - 8o + 1832o3 - 6o*2 - 15. Let x be z(-5). Which is the second biggest value? (a) -15 (b) -3 (c) x (d) 0.2 c Let k = -57.4 - -69. Let r = -10.83 + k. Which is the second biggest value? (a) -3/5 (b) r (c) -1 a Let n = -4237 - -4234. Which is the biggest value? (a) 1/24 (b) n (c) -1/56 a Let p = -58.37 + 0.37. Let c = p + 58.1. Let l = -0.3 + -0.1. What is the second biggest value in l, 30, c? c Suppose -3v - 8 = -2. Let o = 4 + v. Let j be (-18)/(-6327)19 + (-476)/(-777). Which is the biggest value? (a) 0.5 (b) o (c) j b Let v = 0.18 + 0.06. Let c = v - -41.76. Let d = 46 - c. What is the biggest value in -0.4, d, 2? d Let i = 3761/2 - 1880. What is the third biggest value in 3/7, i, 0.03, 0.16, -2? 0.16 Let b = 494 - 279. Let s = 215.05 - b. What is the second smallest value in -5, s, 0? 0 Let o = -2.8 - -3. Let h be (-19)/((-209)/20) + 8/44. Let a = 0.11 + -0.11. What is the fourth smallest value in a, o, -0.2, h? h Let g = 0.678 + -0.152. Let l = g + -1.026. Which is the third biggest value? (a) 0.4 (b) -2/11 (c) l (d) -0.02 b Let s = -2.1548 - -2.5548. Which is the fifth biggest value? (a) s (b) -45 (c) -5 (d) 4 (e) 2 b Let v = 8 + -7.7. Let r = -50.5 + 47.5. What is the second smallest value in 7, v, r? v Let j = 65.7 + -66. Let w = -2.089 - -0.089. What is the second smallest value in w, 3, 1.4, j? j Suppose 0 = 2k + 2i - 167 - 301, 12 = -3i. Let n = 238 - k. Which is the biggest value? (a) 1/7 (b) n (c) -5.6 a Let f = 0.178 + 0.433. Let z = f - -2.389. Which is the third biggest value? (a) -0.5 (b) 1 (c) z (d) 4 b Let x = 0.534 - 0.334. Which is the second biggest value? (a) -3/8 (b) x (c) -46 a Let g = -35.31 - -37.31. Let j = -5 + 5. Suppose j = 3y + 3z, 5y - y - 5z + 36 = 0. Which is the second biggest value? (a) g (b) 1 (c) -0.5 (d) y b Let i = -9 - -5. Let g = -0.681 + 0.581. What is the second smallest value in 0, 0.4, i, g? g Let r(t) = -t*3 - 4t*2 + 9t - 18. Let o be r(-6). Which is the second biggest value? (a) -0.1 (b) o (c) -46 (d) 0.2 b Let s = 300545 - 300550. Let z(i) = i*2 + 5i + 3. Let u be z(-2). Which is the third smallest value? (a) -4 (b) 5 (c) u (d) s c Let a = 65919.8 + -65920. Let v be 44/7 + (-4)/14. Suppose -v = -4y - 2. What is the fourth smallest value in a, -4, -0.06, y? y Let f = -13.34 - -12.34. Which is the third biggest value? (a) 1 (b) 93 (c) f c Suppose 0 = 5x + 1 - 41. Let t be -2 + 1 + 30/x. Suppose 11o = o. Which is the third biggest value? (a) t (b) -1 (c) o b Let z be 1 + (-1724)/90 + (38 - 42). Let d = z + 194/9. What is the biggest value in 0.7, d, 8, -0.1? 8 Let r = -1 + 4. Let s = 107.06 + -109.06. Let f = -14 - -19. Which is the second biggest value? (a) f (b) r (c) s b Suppose -4z - 631 = 29. Let v = z + 179. Which is the third biggest value? (a) -2/15 (b) -2 (c) v (d) -0.3 d Let l = 632/3 + -273/2. Let g = l - 74. Let w = -0.0119 - 0.1881. Which is the third biggest value? (a) -13 (b) w (c) g a Let v(w) = -w*3 - 6w*2 - 8w - 13. Let b be v(-5). Let t be (-1)/7 + (-7 - -9 - 2). What is the biggest value in 2/43, t, b, 5? 5 Let x(i) = -10i2 - 119i + 12. Let j be x(-12). What is the third biggest value in -1/3, -89, j? -89 Let p = -0.24 - 0.16. Let l = 0.6 - p. Let m be (-33)/36 + 1 + 315/(-1188). Which is the third biggest value? (a) -3 (b) l (c) m a Let x be (-8)/(-10)3730/(-10444). Let h = -94755/4 + 23555. Let s = h - -133. Which is the second smallest value? (a) 4/5 (b) -2/11 (c) x (d) s c Let j = 2605.9 - 2606. Which is the smallest value? (a) -4/197 (b) 1/2 (c) j c Let v(k) = 62k - 1856. Let x be v(30). Which is the third smallest value? (a) 3 (b) x (c) -3 b Let y = 0.0474 - -101.9526. Let l = y + -101.8. Which is the biggest value? (a) 2 (b) l (c) 4/7 a Let a = -581.5 - -468. Let p = a - -114. What is the third biggest value in 5, -1/9, 9, p? p Let x(n) = 2n2 + 57n - 51. Let b be x(-29). Let s be b/55((-13)/(-8) - 1). Let m = 250 - 995/4. What is the fourth biggest value in -1, m, -0.5, s? -1 Let s(u) = -u3 + u2 + u - 1. Let t be s(-2). Let l = 1/6098 - 6105/42686. What is the third smallest value in t, l, -2? t Let l = -2 - -2.3. Let s = l - 0.3. Let g = -0.303738 - -0.203738. Which is the second smallest value? (a) s (b) 8 (c) g a Let k(j) = j3 + 3j*2 - 9j + 6. Let r be k(6). Let p be (r/28)/(-3) + 3. Let n = 1.2 + -0.8. Which is the second smallest value? (a) p (b) n (c) 0.02 c Let u be (-4)/(-7)(-15)/20. Let h = 9.8 - 9. Let z = h + 1.2. Which is the biggest value? (a) z (b) 0.4 (c) u a Let s = 0.0105 + 655.9895. Let q = s + -655.9. Let b be (-2)/(-9) - 123/(-54). What is the biggest value in 0, 0.2, q, b? b Let y(z) = -5z - 12. Let k be y(-10). Suppose -33h = k + 127. Which is the biggest value? (a) 0 (b) -4 (c) h (d) 1 d Let y = 3.54 - -147.46. Let q = 156 - y. Which is the smallest value? (a) -1 (b) 0 (c) -5 (d) q c Let f = -159/25 - -2449/275. Let v = -67/22 + f. Let i = 0.1 + -1.1. Which is the third smallest value? (a) 1 (b) v (c) i a Let v = 692 + -374. Let k = v - 317.9. Let s(t) = -t3 + 7t*2 - 5t - 8. Let n be s(6). Which is the third biggest value? (a) n (b) 1/5 (c) k a Let o = 995.5 - 996. What is the second biggest value in -2/7, -0.04, 94, o, -0.1? -0.04 Let c = 1088/11 - 99. Let g = -0.5067 - 0.0933. What is the second smallest value in 0, c, g? c Let i = 75.07 - 78.07. What is the smallest value in -1/4, 0, -0.1, 10/7, i? i Let w(p) = 8 + 94p2 + 2p*3 - 3p*3 + 5p - 97p*2. Let a be w(-4). What is the third smallest value in 0.1, a, -0.5? a Let o = 2569 - 2241. What is the fourth biggest value in -3/7, o, 0.3, 1? -3/7 Let j be (-116)/96 + 18 + -13 + -4. What is the smallest value in j, 0.4, 9, 0.5, 1/6? j Let o = 7402 - 7401. What is the second biggest value in -9, -3, 1/5, -20/13, o? 1/5 Let z = 420.3 + -417.3. Which is the fourth smallest value? (a) -0.1 (b) 89 (c) z (d) -2/11 b Let k be (-20)/3	{ "pile_set_name": "DM Mathematics" }
terms in 3a2 + 0a + 4a - 38a*2 - a. -35a*2 + 3a Collect the terms in 91s2 + 0s + 13s2 + 0s. 104s2 Collect the terms in 109 - 109 - 57i*2. -57i*2 Collect the terms in -2r*3 - 9r*3 - 23r*3. -34r*3 Collect the terms in -219t - 11 + 11. -219t Collect the terms in -20f + 138f3 + 20f. 138f3 Collect the terms in -4c + 4c - c2 - 21c*2. -22c*2 Collect the terms in 26p*2 - 35p*2 + 7p*2. -2p*2 Collect the terms in 81b - 84b - 6 + 6. -3b Collect the terms in 2q2 - 13q*2 + 33q*2 - 4q*3 - 22q*2. -4q3 Collect the terms in -262 + 131 + r3 + 131 + r*3. 2r*3 Collect the terms in -28u*2 + 17u*3 + 28u*2. 17u3 Collect the terms in -x3 + 11x3 + 25x*3. 35x*3 Collect the terms in 75k - 106k + 37k. 6k Collect the terms in -6n + 8n2 - 5n*2 + 6n. 3n2 Collect the terms in 4b*2 - 3 + 2 + 1 - 5b2. -b2 Collect the terms in r + 9r + 2r + 2r3 - 12r. 2r3 Collect the terms in -6b + 2b - b - 3b2 - b2. -4b2 - 5b Collect the terms in 9 + 22 + 11s3 - 31. 11s*3 Collect the terms in 25f - 41f + 22f. 6f Collect the terms in 17 - 5d3 - d3 + 0. -6d3 + 17 Collect the terms in -15 + 16x + 17 - 5x. 11x + 2 Collect the terms in 1 - 558m + 1 - 1. -558m + 1 Collect the terms in 32b2 - 18b*2 + 45b*2 + 9b*2. 68b*2 Collect the terms in -169l*3 - 4 + 4 + 179l*3. 10l*3 Collect the terms in 4 - 370p*2 + 0 - 4. -370p*2 Collect the terms in 83n*2 - 28n*2 - 25n*2 - 24n*2. 6n*2 Collect the terms in 333f - 107f - 116f - 109f. f Collect the terms in -169u + 0u3 + 5u*3 + 169u. 5u3 Collect the terms in -4t + 5t - 15832 + 15832. t Collect the terms in 1 + 29t*2 - 26t*2 + 51t*2. 54t*2 + 1 Collect the terms in 28515j - 28515j - 17j*3. -17j*3 Collect the terms in -821w - 338w - 169w. -1328w Collect the terms in 12y - 38y + 18y + 5y. -3y Collect the terms in 7p - 5p*3 - 3p - 3p. -5p*3 + p Collect the terms in -406k - 2 + 403k + 2. -3k Collect the terms in 8b + 7b - 16b. -b Collect the terms in 11081j - 5j2 + 3j*2 - 11081j. -2j2 Collect the terms in -88a + 3a3 - 56a*3 + 88a. -53a3 Collect the terms in 0 + 8 - 3 + 26o. 26o + 5 Collect the terms in 12l3 + l3 + l*3 - 9l*3. 5l*3 Collect the terms in 9 - 9 + 312o - 146o - 157o. 9o Collect the terms in 4l*3 + 5038l*2 - 5038l*2. 4l*3 Collect the terms in 490 - 72x*2 - 490. -72x*2 Collect the terms in 6o*2 + 4o*2 + o - o - 9o2. o2 Collect the terms in -c2 - c2 + 26c + 12c + 0c2. -2c*2 + 38c Collect the terms in 3n3 + 2n3 - n3. 4n3 Collect the terms in -z + 11z + 5z - 5z. 10z Collect the terms in 140 + 2z - 60 - 80. 2z Collect the terms in 33m*2 + 47m*2 - 99m*2. -19m*2 Collect the terms in -8s - 2s + 3s + s + 0s. -6s Collect the terms in 3440w - 3440w - 2w2 + w2. -w2 Collect the terms in -25k - 20k2 + 12k + 13k. -20k*2 Collect the terms in 48 - 34 + 2m + 49 - m. m + 63 Collect the terms in -5 - 25 + 20m - 11m - 8m. m - 30 Collect the terms in -27j - 20j - 40j. -87j Collect the terms in -4m + 0m2 + 8m*2 + 2m. 8m2 - 2m Collect the terms in 169 + 170 + 6m2 - 339. 6m*2 Collect the terms in 7 - 4h3 - 7 - h3. -5h3 Collect the terms in x3 - 5x*3 + 214x*2 - 214x*2 + 6x*3. 2x*3 Collect the terms in 20h*3 - 14h3 + h3 + 2h3. 9h*3 Collect the terms in -p - 3 - 4 + 7p. 6p - 7 Collect the terms in -6a*3 + 7a*3 - 4a*3. -3a*3 Collect the terms in -9 + 26x*2 - 25x2 - 3. x2 - 12 Collect the terms in 100q3 - 206q*3 + 105q3. -q3 Collect the terms in -194y + 363y - 184y. -15y Collect the terms in -10 + 16y + 10. 16y Collect the terms in 6 - 12 + 6 - 9l2. -9l*2 Collect the terms in -25 + 6t - 9t + 4t - 24. t - 49 Collect the terms in -2f + 4f - 5f + 0 + 0. -3f Collect the terms in -102j2 + j - j + 98j*2. -4j2 Collect the terms in o2 - 4o2 - 6o*2. -9o*2 Collect the terms in -63 + 63 - 3t*2 - 4t. -3t2 - 4t Collect the terms in -13v + 16v*3 + 13v. 16v3 Collect the terms in 4u + u + u - u. 5u Collect the terms in m2 - 4m*2 + 0m + 2m - 4m. -3m2 - 2m Collect the terms in -u - 2507 + 2498 + 3u. 2u - 9 Collect the terms in 446 - 8x3 + 7x*3 - 2x*3 - 446. -3x*3 Collect the terms in 16k + 508 - 508. 16k Collect the terms in 3j*3 + 2j*3 - 14j*3. -9j*3 Collect the terms in 4i*3 - 6i*3 - 13i*2 + 13i*2. -2i*3 Collect the terms in -3492x*2 - 3486x*2 + 6976x*2. -2x*2 Collect the terms in 1 + 2912z - 1. 2912z Collect the terms in -7o - 5o + 3o. -9o Collect the terms in 4o*2 - 25 + 12 + 6. 4o*2 - 7 Collect the terms in 5k*2 - 4k*2 - 5k*2. -4k*2 Collect the terms in -3f - 3f + 17f + 11f. 22f Collect the terms in 43 - 23 + 3v - 20. 3v Collect the terms in -5t3 + 8t*3 - 6t*3 + 20t*3. 17t*3 Collect the terms in -77t*2 - 175t*2 + 250t*2. -2t*2 Collect the terms in -3y*3 + 5y*3 - 65y - 33y. 2y*3 - 98y Collect the terms in 7o3 - 3o*2 - 4o*3 + 5o*2 - 13o*3. -10o*3 + 2o*2 Collect the terms in -13r*3 - 12r*3 + 6r*3 + 3r*3. -16r*3 Collect the terms in -5474 + 5474 - d. -d Collect the terms in 17g*2 - 16g*2 - 17g*2. -16g*2 Collect the terms in 61s*2 - 36s*2 + 6s*2. 31s*2 Collect the terms in -286 + 574 - 4b*2 - 288. -4b*2 Collect the terms in -53u*2 - 56u*2 + 106u*2. -3u*2 Collect the terms in -9y*3 + 2 - 4 + 14y*3 - 3y*3. 2y*3 - 2 Collect the terms in -2g*2 + 15g*2 - 2g*2 - 8g*2. 3g*2 Collect the terms in -49j - 37j2 + 49j. -37j2 Collect the terms in -26f - 25f - 28f + 84f. 5f Collect the terms in -21p + 46p + 32 - 15p - 11p. -p + 32 Collect the terms in 1185 - 1185 - 5i. -5i Collect the terms in -13p - 8 + 8 - 5. -13p - 5 Collect the terms in -253j3 + 131j*3 + 124j*3. 2j*3 Collect the terms in 57y + 13y3 - 29y - 28y. 13y*3 Collect the terms in -68y + 39y + 23y. -6y Collect the terms in -8u + 5u + 3u - 12u. -12u Collect the terms in -2307r2 + 4r*3 + 2307r*2. 4r*3 Collect the terms in 6f + 2f + 2f. 10f Collect the terms in -26p - 40p + 66p - 30p3. -30p*3 Collect the terms in 65c2 - c3 - 129c2 + 64c2. -c3 Collect the terms in 3 + 5682k3 - 3. 5682k*3 Collect the terms in 72w*2 - 43w*2 + 69w*2 + 18w*2. 116w*2 Collect the terms in -5w*3 - 3w3 + w3 - 3w3. -10w*3 Collect the terms in -4g*2 + 4g*2 - 74g*3. -74g*3 Collect the terms in -19k + 36k - 19k - 13. -2k - 13 Collect the terms in -6c + 4c + 4c - 5c. -3c Collect the terms in g*3 + 15g - 34g - 12g. g*3 - 31g Collect the terms in 131z3 - z - 35z*3 + z. 96z*3 Collect the terms in 458i - 458i + 33i*2. 33i*2 Collect the terms in 15u*3 - 29u*3 - 26u*3. -40u*3 Collect the terms in 56g*3 - 25g*3 - 5 - 37g*3 + 5. -6g*3 Collect the terms in -3q + 2q - 322558 + 322558. -q Collect the terms in -41a + 41a - a2. -a2 Collect the terms in -13j*2 - 30j - 25j + 55j. -13j2 Collect the terms in 58 - 2x*2 - 3x*2 - 58. -5x*2 Collect the terms in -184o - 115o3 + 184o. -115o3 Collect the terms in 12n*3 - 28n*3 - 10n*3. -26n*3 Collect the terms in -46r*3 - 6r*2 - 5r*2 + 8r*2. -46r*3 - 3r*2 Collect the terms in -9s*2 - 13s*2 - 86s*2. -108s*2 Collect the terms in -261y*2 - 17y + 17y. -261y*2 Collect the terms in -213x + 430x - 212x. 5x Collect the terms in -6074y + 3036y + 3036y. -2y Collect the terms in 14w*2 + 4280 - 4280. 14w*2 Collect the terms in -34u - 10u + 12u - 16u. -48u Collect the terms in -114c2 - 122c*2 + 233c*2. -3c*2 Collect the terms in -52w*3 + 25w*3 - 44w*3. -71w*3 Collect the terms in -6c*2 + 97c - 97c. -6c*2 Collect the terms in -4x - 9x + 2x + 0x. -11x Collect the terms in 77q2 + q - q + 88q*2. 165q*2 Collect the terms in -4 + 3 - 6r - 6. -6r - 7 Collect the terms in 87q2 - q3 - 87q2. -q3 Collect the terms in 10b - 23b3 - 15b + 5b	{ "pile_set_name": "DM Mathematics" }
of 325 and d. 5 Let o be 66 - (-4)/((-2)/(-9) - 114/27). Let x be 3110/18 - 8/(-36). Let r = x - o. What is the highest common factor of r and 12? 12 Suppose -5a = 16l - 13l - 418, 280 = 2l + 3a. What is the greatest common factor of l and 876? 146 Let y(s) = -s3 - 15s*2 + 20s + 58. Let k be y(-16). Let z(m) = 20 + 26 - 10 - 16m. Let h be z(k). What is the highest common divisor of 12 and h? 12 Suppose -2t - 165 = -2c + 165, 2c + 4t - 282 = 0. What is the greatest common divisor of 7379 and c? 157 Suppose -280m + 324m = 30800. Calculate the highest common factor of 200 and m. 100 Let l(q) = 20q + 1. Let h be l(4). Let d be 289 + -284 + 13 + 0. Calculate the greatest common divisor of d and h. 9 Let m be (-8 + 8/8)/(-1). Suppose -md - 206 = -1571. Calculate the highest common divisor of 260 and d. 65 Suppose 4p = -p. Let t(a) = 5a2 - 96a + 21. Let j be t(19). Suppose pr = -r + 4h + 30, 2h = -jr + 70. What is the greatest common divisor of 51 and r? 17 Suppose 20w - 14w - 42 = 0. Let n(m) = m*3 - 2m*2 + 9m + 17. Let t be n(w). Calculate the greatest common factor of t and 125. 25 Let m be 45/(-30)(-26)/(-3)-17. Let s = 244 - m. Calculate the greatest common factor of 69 and s. 23 Suppose -11063x = -11068x - 2 + 182. What is the highest common factor of 477 and x? 9 Let l = -4 + 13. Suppose 0 = -21r + 14r - 1512. Let w be r/30(-35)/14. What is the greatest common divisor of w and l? 9 Let y = -2214 - -2329. What is the greatest common factor of y and 4876? 23 Let t(l) = 3l*3 - 5l*2 + l + 10. Let b be t(5). Suppose 0 = 5z + 5k - b, -2k - k = z - 43. What is the greatest common divisor of z and 29? 29 Suppose -3i + 6i = 1404. Suppose 17k - i = -k. What is the greatest common divisor of k and 78? 26 Let k(g) = 18g*2 - 69g + 4. Let v be k(4). Let m = 219 - 163. What is the highest common divisor of m and v? 8 Suppose 52l = 44l - 34l + 9702. Calculate the greatest common factor of 759 and l. 33 Suppose -6y - 228 = -5g - 5y, -4g = 4y - 192. Calculate the greatest common factor of 5221 and g. 23 Suppose -10r = -221 - 99. Let b(n) = n + 38. Let c be b(r). What is the highest common divisor of c and 15? 5 Suppose -2t + 103 = -3x - 49, 176 = 2t + 3x. Suppose -3n + 121 = -3d + d, -5d = -3n + 118. Calculate the highest common factor of t and n. 41 Suppose 8o = 26 + 1318. Let r(c) = -c3 - 1 - c2 + 7 - 15c + 18c. Let u be r(-4). Calculate the highest common factor of o and u. 42 Let q be 17986 + (-161)/230-10. What is the greatest common factor of 38 and q? 19 Let z = -184 - -184. Suppose z = v + 4j - 18, -14v + 6 = -15v + 4j. Calculate the highest common divisor of v and 246. 6 Suppose 3g + 189 = 3s, -15s - 3g = -8s - 431. Calculate the highest common divisor of s and 15407. 31 Suppose 24c - 72 = 48. Suppose -ct = 4b - 1157 - 23, 4b + 908 = 4t. Calculate the highest common divisor of t and 29. 29 Suppose -159h + 27h + 890340 = 0. What is the greatest common divisor of 190 and h? 95 Let z(a) = -10a - 10. Let p be z(9). Let i = p - -151. Calculate the greatest common factor of i and 153. 51 Let p be (1/(-2))/((-4)/48). Let j(o) = 14o + o2 + 7 + 17 + 29. Let a be j(-9). Calculate the greatest common factor of a and p. 2 Suppose -12 = 4g, -2g - 25 - 41 = -4q. Let f be (-2)/(-9)30q. What is the greatest common factor of f and 75? 25 Suppose 0 = -3l - 9, 32f + 3l + 2440 = 33f. Suppose -39t + 572 + f = 0. Calculate the greatest common factor of t and 847. 77 Suppose -q + 9 = 5i + 3, 4q - 24 = 3i. Let o be (-172)/q75/(-50). Suppose 9y = 6y + 387. Calculate the greatest common factor of o and y. 43 Suppose -2m - q + 659 - 162 = 0, m = -5q + 235. What is the highest common factor of 120 and m? 10 Let h(b) = 2b*2 + 99b + 735. Let o be h(-8). Calculate the highest common divisor of o and 781. 71 Let r = 47 + -45. Suppose -5j - 7 = 4d, -j + 0d - r = d. Suppose -2p = n - j, 18 = -2p - 5n + 7. Calculate the greatest common factor of p and 3. 1 Let a = -427 - -447. Let p(i) = 10i - 182. Let n be p(a). What is the highest common factor of 78 and n? 6 Let j(w) = -2 + 30w + 4 + 113w. Let a be 36/(-102) - 760/(-323). Let h be j(a). Calculate the greatest common divisor of 36 and h. 36 Let u be 7938/51860/744. What is the highest common factor of u and 648? 81 Suppose 1274 = 52d + 46d. What is the greatest common divisor of d and 2483? 13 Let r be (1 + (-9)/15)5 - 37. Let o = 37 + r. Suppose -5j - f = -110, -f = oj - j - 26. What is the greatest common factor of j and 7? 7 Let p = 326 - 322. Suppose -w + 967 = pl + 4w, l - 3w = 246. What is the greatest common divisor of 27 and l? 27 Let u(r) = r*3 - 3r*2 - 3r - 20. Let i be u(6). Let p(j) = -11j - 56. Let h be p(-21). What is the highest common divisor of h and i? 35 Let g(i) = -i2 - 268i - 2753. Let m be g(-11). What is the highest common divisor of 6771 and m? 37 Suppose -18 = j - 4o, 4o - 38 = -4j - 10. Suppose -c = -3c + 6. Let t be j/(-3) + 74/c. Calculate the highest common divisor of 48 and t. 24 Suppose -2x = -7 + 3. Suppose -xk = k. Suppose k = -4i + 57 + 7. Calculate the highest common factor of i and 4. 4 Let j = 45 + -57. Let q be (-10)/3(-840)/100. Let w be (j(-91)/q)/((-1)/(-1)). Calculate the highest common factor of 117 and w. 39 Let t = -1717 + 1727. Suppose -2x + 1800 = 4x. What is the greatest common factor of t and x? 10 Let t be -8 + (-8 - -50)/(6/14). Calculate the greatest common divisor of t and 1215. 45 Let g = 222 + -159. Let w = 117 + -96. Suppose wv = 15v + 42. Calculate the highest common divisor of g and v. 7 Suppose -x = -4g + 224 + 56, 4g + x = 288. Suppose 4m = 4u + 6m - 74, g = 4u + 3m. Suppose u = 3l - 55. What is the highest common factor of 100 and l? 25 Let n be (387 - 2/2)/(-1). Let b be (-1)/(-3 - 1156/n) + -4. Calculate the greatest common factor of 21 and b. 21 Suppose -4u - 2p + 4660 = -4p, 5u - 3p - 5822 = 0. What is the greatest common divisor of 949 and u? 73 Let n(v) = v*2 + 3v + 3. Let i be n(-3). Suppose 0 = 2u - iz - 162, 5u + 4z = -0u + 451. What is the highest common factor of u and 3? 3 Suppose 56d - 1656 = -128d. Calculate the highest common factor of d and 3357. 9 Let k = 15 - -16. Suppose -2t - 15 = -w, 0 = -4w + 4t + 87 - k. Suppose 0 = 2m - 2f - 8, 56 = m - 5f + 44. What is the greatest common factor of m and w? 1 Let o = 9621 - 9377. Calculate the highest common factor of 10126 and o. 122 Let p = -6427 - -6715. What is the greatest common factor of 3648 and p? 96 Let j(u) = 2u*3 - 9u*2 - 3u - 4. Let v be j(5). Suppose s = 3l - 5, -l - 3s + v = s. Calculate the highest common divisor of 11 and l. 1 Suppose -6i + 2 + 10 = 0. Let f be 190/(i + -6 + 6). Calculate the greatest common factor of 5 and f. 5 Suppose 193 + 287 = 16n. Suppose nk + 84 = 28k. Let a be 324/(-189)k/4. Calculate the highest common factor of a and 117. 9 Let q(z) = -589z + 1244. Let x be q(2). Calculate the highest common factor of x and 473. 11 Suppose 4d = 11823 - 3951. Calculate the greatest common divisor of 123 and d. 123 Suppose -9b - 304 = -47b. Suppose 3t - 14 = -53. Let x be (3 - 5t/(-3))-3. Calculate the highest common factor of b and x. 8 Let f be 2/(-15) - (13/15 + -1). Suppose f = 5n + s - 107, -18 + 97 = 4n + 3s. Suppose 90 = v + n. What is the highest common divisor of 17 and v? 17 Let r be 9/2439 - (-16182)/54. What is the highest common divisor of r and 5550? 150 Suppose -191 = -2x + 125. Let h = -111 + x. Let u be (8 + (-2396)/(-32) - -11) + 3/24. Calculate the highest common divisor of h and u. 47 Suppose 2h - 4p - 1402 = p, -5h + 3567 = 3p. Suppose -h = -4g - 51. Let z = g + -137. Calculate the greatest common divisor of 28 and z. 28 Suppose 3i - 8i + 3c + 40 = 0, 4i - 3c - 32 = 0. Let v = 434 + 7. Suppose u = iu - v. What is the greatest common divisor of u and 9? 9 Let a = 17 - 14. Suppose -4l = 5x - 25, 2x - 1 - 9 = -al. Suppose 2j - 439 - 29 = l. Calculate the greatest common divisor of j and 26. 26 Let o = -65 + 177. Suppose -6y = 10y - o. Calculate the greatest common divisor of 63 and y. 7 Let o = 44 - -1. Let z = o + -43. Let a be 13 + (z + 14 -	{ "pile_set_name": "DM Mathematics" }
46 + 43 - ok + 3k + 2k. Determine j(0). -3 Suppose -35v + 28v = 18v + 75. Let f(l) = l*3 + 3l*2 + 2l - 3. Calculate f(v). -9 Let d(u) = -4053792 - u + u*2 + 4053791 + 2u*2. Suppose 0 = -w - 3w - 4. Calculate d(w). 3 Let h be (1 - -8) + (-1 - 1). Suppose -3y - 6 = 3a, 16a = 14a - 4y - 8. Suppose a = -o + 11 - h. Let u(r) = r2 - 3r - 2. Give u(o). 2 Suppose -i = -u + 1, 2i + 4u = -i + 18. Let o(d) = 57630 - 57632 + 2di + 0d*2 - 3d. Give o(-3). 25 Let v(i) = -644i - 9 + 656i + 2i2 + 4i*2 + 10. Determine v(-2). 1 Let m(w) = 3w*2 - 53w + 50. Let j(s) = 16s + 183. Let o be j(-11). Let p(r) = r2 - 17r + 16. Let z(n) = op(n) - 2m(n). Determine z(10). -18 Suppose -7s - 21 = 12 + 9. Let j(y) = 5y3 + y3 + 5y2 - 4y + 4y3 - 9y3 + 2. Give j(s). -10 Let w(l) be the third derivative of -l6/120 - 13l5/60 - 2l*4/3 - 41l*3/6 + 1113l*2. Determine w(-12). 7 Suppose -29 = 254h - 283h. Let j(l) = 58l*2 + 2l + 1. Give j(h). 61 Suppose -3g = -4g + 7. Let w(h) = -53h2 - 96h - 30. Let v(n) = -3n2 - 5n - 2. Let i(d) = 18v(d) - w(d). Determine i(g). -13 Let t be -3(3 + 6/(-3)). Let m(i) be the second derivative of -2i2 + 40i + 1/3i3 + 0 - 1/20i*5 + 0i*4. Calculate m(t). 17 Let f(l) = 8649l*2 + 26l - l*3 - 8636l*2 - 46 + 54. Give f(15). -52 Let g(r) = 2r - 12. Suppose 10m - 343 = 11m - u, 4m + 1379 = -3u. Let v be 3/(-4) - 4730/m. Calculate g(v). 14 Suppose 45j - 53j + 144 = 0. Let p(n) = 77n2 - 5n - jn2 - 27n2 - n3 - 26n2 + 2. What is p(3)? 14 Let j(p) = 2. Let w(q) = -q + 9. Let t(c) = -2c + 8. Let f(g) = -4t(g) + 5w(g). Let d(s) = -f(s) + 6j(s). Calculate d(-1). 2 Suppose -6q + 5q = -8. Let v(h) = 4 + 2 + 4 + 655h - 667h + h2 + 1. Give v(q). -21 Suppose 16i - 15i + 25 = 3j, 7i = 4j - 39. Let h(n) = n + 1. Let f(r) = -r - 2. Let o(t) = 5f(t) + 4h(t). Calculate o(j). -14 Let j = -252 - -257. Suppose -2i - 12w = -17w + 24, jw = -2i + 16. Let t(a) be the first derivative of -a4/4 - a3 - 2a*2 - 2a + 2. Give t(i). 2 Let l(p) be the second derivative of 2p3/3 + 3p*2 + 15p + 1. Suppose -29x = -30x + 6. What is l(x)? 30 Let o(y) = -1066y2 - 11y + 0y - 14 + 1055y2 + y3. Suppose 310 = 5r + 250. Calculate o(r). -2 Let i be ((56 + 4)/6)/(-12)(10 - 16). Let k(s) = -33s - 8. Calculate k(i). -173 Let f(g) be the third derivative of -g5/30 + g4/6 - g3/6 - g2. Let w = -17 + 21. Suppose -x + 0j = -3j, 0 = wx + 3j - 15. Determine f(x). -7 Let n(r) = -19r*3 - 23r*2 - 73r + 1. Let a(l) = 8l3 + 9l*2 + 30l - 1. Let q(m) = -12a(m) - 5n(m). Determine q(8). -17 Let w(t) = 4t - 3. Let p(m) = 3m - 2. Let v(n) = 3p(n) - 2w(n). Suppose -4100 = -5j + 5x, -10j + 5x - 4060 = -15j. Let d = j + -815. What is v(d)? 1 Let x = -847 + 1517. Let g = x - 665. Let a(s) = s2 - 8s + 2. Determine a(g). -13 Let n(p) be the first derivative of 3p4 - p3/3 + p2 - p + 1. Let g be ((-26)/63)/(-1) - 3. Suppose 3k + 11 = -h, -h + 11k = gk - 5. Determine n(h). 12 Let g = 974 + -972. Let l(n) = 27n*2 + 2n + 1. Let w be l(-1). Let m(k) = 28 - w + 3k - 3k*2 + 0k*g + 6k*2. Determine m(-2). 8 Let m be 1/((-2 + -1)/(-15)). Suppose mr - 7 = 3. Let o(a) = -6 + 11a - a2 - 16a + ra2. What is o(5)? -6 Let n(v) = v2 + 210v + 10979. Let r be n(-112). Let h(c) = -1 - 5 + 1 + 1 + c. Give h(r). -1 Let p(w) = -w*3 + 6w*2 - 2w - 5. Suppose 11 = 2r - i, -2r + 4i + 29 = 3r. Let v = r + -38. Let m = v + 38. Calculate p(m). 10 Let g(o) = -o*3 - 2o*2 + 6o - 1. Let a = -33 - -28. Let u be g(a). Suppose 0 = -4c - u + 36. Let r(d) = -d3 + d2 - 2. Give r(c). 10 Let s(y) = y2 - y - 1. Let z(q) = q + 2. Let r(v) = 2s(v) + 3z(v). Let u = -34992 - -34989. Give r(u). 19 Let u be ((-5)/(-3) - 1)(-600)/400. Let c(r) = 5r3 + 3r*2 - 7r + 3. Let b(g) = 3g3 + g2 - 3g + 1. Let x(w) = -5b(w) + 2c(w). What is x(u)? 6 Let l(q) = -2q3 - 4. Let z(h) = 11h*3 - 2h*2 + 25. Let u(n) = 5l(n) + z(n). Give u(5). 80 Let s = -82 + 84. Let f(j) = -84 + sj2 - j2 - j + 80. Calculate f(4). 8 Let h(u) = 3u3 - u2 + 2u. Let k = 319 - 305. Let n be (1 + (-3)/(-1))/(k - 12). Calculate h(n). 24 Let w = 179 + -178. Suppose 14n + 4q = 13n + w, -4n + 4 = -3q. Let h(p) = 2p2. Calculate h(n). 2 Let f(k) = k + 26. Suppose 33r + 543 = -117. Determine f(r). 6 Let d(a) be the second derivative of a*3/6 - 5a*2/2 + 3104a. Give d(7). 2 Let d(m) = -m*2 + 9m + 7. Let g be (-4)/((-30)/15) - -6. Calculate d(g). 15 Let j be ((5 + -1)/(-4))/(1/(-2)). Let w(d) be the first derivative of 4d + d3 + d2 + 14 - 2d*2 - jd - 2d3. What is w(-2)? -6 Let k(s) = -682 + 4s + 3s2 - s2 + 1206 - 525. Suppose n + 3q = -15, n + 3q + 11 = q. What is k(n)? 5 Let n = -135 - -204. Let a = -68 + n. Let o be a(-3 + 0 - -4). Let z(v) = 8v3 - 2v*2 + 2v - 1. Give z(o). 7 Let r(l) = l + 1. Let c be 4(-14)/2130/(-4). Let y be 16/(-40)(-3)/((-6)/c). Calculate r(y). -3 Let n(t) = -t2 - 5t - 20. Let i = -28318 + 28315. Calculate n(i). -14 Let i(s) = 20s - 3478. Let q be i(174). Let f(w) = -25w*2 + 6w - 3. What is f(q)? -91 Let q(b) = -367b2 + 109b + 777. Let i(m) = -102m2 + 31m + 222. Let t(l) = -18i(l) + 5q(l). Determine t(-6). 3 Let i(k) be the second derivative of -k*5/20 - 11k4/12 - k3 + 51k2/2 + 1059k. Give i(-10). 11 Let g(r) = -2. Let u(l) = -l + 21. Let b(m) = -m + 22. Let k(z) = 3b(z) - 4u(z). Let o(c) = 24g(c) - 3k(c). Determine o(3). -3 Let y(f) = 2f + 2. Let s be 3/5 - 66/(-10)-26. Let t = 169 + s. Determine y(t). -2 Let l(x) = x*2 - 10x - 22. Let r(t) = -t*2 - 6t + 4. Let m be r(-4). Let b be l(m). Let s(w) = -20 - 20 + bw + w3 - 4w + 43 + 3w2. Give s(-3). 9 Let x(i) = -3i + 4. Let s(t) = 2t + 1. Let b(a) = 1. Let w(p) = 4b(p) - s(p). Let k(d) = -10w(d) + 6x(d). Calculate k(7). 8 Let z(s) = s - 15. Let w = 281 + -279. Suppose f = -34y + 39y + 25, wf - 2 = -2y. What is z(f)? -10 Let c(j) = 13j2 + 277j + 54. Let h(n) = -2n2 + 2n + 4. Let a(y) = -c(y) - 2h(y). Calculate a(-31). 0 Let i(h) = -9h. Let q be -10 - -10 - -7 - 7. What is i(q)? 0 Let h(g) = -g*2 + 21g - 80. Let r(p) = 49p + 848. Let q be r(-17). What is h(q)? 10 Let n(g) = 10869g - 86942. Let a be n(8). Let l(h) = 10h - 17. Let t(b) = 7b - 11. Let v(d) = -5l(d) + 7t(d). Calculate v(a). -2 Let m(r) = -r*3 + 13r*2 + 11r - 17. Let s(j) be the second derivative of -j4/12 + j3/6 + 2j + 1. Let h(v) = -m(v) - 2s(v). Give h(12). 5 Let t(s) be the first derivative of s*4/4 + 13s*3/3 + 10s*2 - 8s + 821. Calculate t(-11). 14 Let q(x) = -3x - 3764 + 9x + 3762 + 6x - 8x*2 - 3x - 11x. Let f be -2 + 1(0 - -1). What is q(f)? -8 Let h(c) be the third derivative of -c6/24 - c5/60 + 1115c2 - 2c. Let w(v) = v - 5. Let o be w(4). Calculate h(o). 4 Let t(c) = 874 + 10c + 879 - 1753. Let h be (4/(-12))/(1/(-3)). What is t(h)? 10 Let i(j) be the first derivative of -3j*4/4 + 3j3 - j2 + 13j + 71. Let o(d) = -2d*3 + 5d*2 - d + 7. Let l(t) = -3i(t) + 5o(t). Give l(-3). 2 Suppose -p - 22 - 36 = 0. Let j = p - -52. Let x(q) = q3 + q - 7q + 5q2 + 40 - 36. What is x(j)? 4 Let i(x) be the third derivative of x6/120 + 7x5/60 + x4/3 - 5x3/6 + x2 + 87. Give i(-4). 11 Let f(p) be the second derivative of p3 - 13p*2/2 + 3p - 4057. Suppose 3j + 3c = -c + 1, -2c = -j + 7. Calculate f(j). 5 Let m(h) be the third derivative of 7h*4/24 + 10h*3 + 4552h*2. What is m(-4)? 32 Let a(p) = -8p - 7164 - 7171 - 7189 - 7184 + 28744. Give a(10). -44 Let p(d) = 64d3 + 3d*2 + 5d + 3. Let b = 9587 - 9588. Give p(b). -63 Let i(m) be the second derivative of -m*5/20 - 13m*4/12 - 2m*3 + 15m2 - m + 475. Calculate i(-12). 30 Let y(n) = -n2 + 4n - 6. Let p = 202 + -202. Let d be (p - -2) + -5 + 9. Give y(d). -18 Let b(a) be the third derivative of a6/120 + 7a5/60 + a4/2 + 27a3/2 - 2a*2 - 63. Give b(-7). -3 Let f(l) = 6l*3 - 11l + 12. Let i be f(1). Suppose -6k + 4 = -2k. Let w(z) = 4z2 + k - 3z*2 - 6z + z. Determine w(i). 15 Suppose 0 = 269g + 161g + 4730. Let y(k) = -2*k - 4 - 1 - 2. Calcul	{ "pile_set_name": "DM Mathematics" }
44710009 -75158 times 461 -34647838 -0.2 times -209610.8 41922.16 2452.31283 * 0.4 980.925132 Multiply -1.119 and -65.19. 72.94761 -0.042 * -21.81546 0.91624932 Product of -0.88117 and -9. 7.93053 Product of 3 and 0.0901743. 0.2705229 Calculate 19478149-0.23. -4479974.27 What is the product of 125539 and 0.04? 5021.56 Product of 22 and 488809. 10753798 What is 0.31 times 151634.33? 47006.6423 What is -24873 times -0.030344? 754.746312 Product of -937 and 6703. -6280711 What is the product of 1.363231 and 142.2? 193.8514482 What is the product of -6189 and 28.8? -178243.2 312 times -1.99318 -621.87216 Calculate 0.11304-3.181. -0.35958024 Calculate -94653371-0.2. 18930674.2 Product of 1.782175 and 1.33. 2.37029275 Multiply -47 and -1309629. 61552563 3822513990.5 191125699.5 Work out -12 * 3424372. -41092464 Calculate -0.1-12643723.2. 1264372.32 What is the product of -6 and -1350753.6? 8104521.6 -66.7528 times 0.026 -1.7355728 Work out -38 155142. -5895396 Product of -6.03275 and -0.05. 0.3016375 -77.92-1114 86802.88 7828593.5 times 0.1 782859.35 What is -2161 times 10867? -23483587 Product of 3 and -2217.4744. -6652.4232 What is 1083.252 times 0.3? 324.9756 Product of 3663 and -8721. -31945023 110.3832 152 16778.2464 Calculate 5248810.3. 157464.3 Product of 0.56 and -13.13519. -7.3557064 3401708 times 3.9 13266661.2 -0.0418 -1030311 43066.9998 What is -148 times 1706252? -252525296 Calculate 0.4-806807.9. -322723.16 Work out -2 -270199.8. 540399.6 Calculate 1562717011. 171898870 324.293621 6810.1656 Product of 0.257 and -2.5453. -0.6541421 What is -22360606 times 2.5? -55901515 -1.41 times -4271.591 6022.94331 What is -0.7 times -11290276? 7903193.2 Work out 12.4368 * -0.7. -8.70576 Work out 0.733 * 4108.04. 3011.19332 What is the product of 2.193 and 1.44? 3.15792 What is the product of 30576 and -0.0015? -45.864 Product of 145609866 and -0.5. -72804933 Multiply 302 and -197.36. -59602.72 Work out 19.988 * -1854. -37057.752 3671.793 times -8 -29374.344 Product of -2725 and 6106. -16638850 -41902941 -7611764 1.026 -9543 -9791.118 Product of 169.8 and 8037. 1364682.6 What is 86162.66 times -22? -1895578.52 0.2 * 0.061185894 0.0122371788 Product of 0.5 and 3969795.9. 1984897.95 Multiply -31575 and 0.194. -6125.55 98 * -475368 -46586064 -3948709221 -872664689 -56460.1684 -950.7864 Work out -0.0097 * -97792. 948.5824 Work out 0 * 39854.16. 0 -86315-118 10185170 Product of 195 and -2.8582. -557.349 What is the product of -997 and 2445.55? -2438213.35 Calculate 0.61692-5.7. -3.516444 Multiply -171971 and -2.7. 464321.7 Calculate -13736280.7. -11085113.4 What is the product of -128335 and -10.8? 1386018 0.605214 times -1.65 -0.9986031 Work out -77.5 -8270.18. 640938.95 -15533 times -421 6539393 Calculate -0.9-3304531. 2974077.9 Product of 0.01982 and 0.3832. 0.007595024 Work out 43.367419 -0.2. -8.6734838 Product of -642086.1 and 0. 0 21245072 5146512 Multiply -338866 and -0.061. 20670.826 What is the product of 0.7 and -13772549? -9640784.3 What is 126 times -121506? -15309756 What is 24 times -780719? -18737256 Calculate -89.18528. -713.4816 -0.5 times 16216836 -8108418 634091835 317045915 Multiply 0.007 and 0.091563. 0.000640941 What is the product of 35 and 246.546? 8629.11 What is the product of -2564813 and 1.7? -4360182.1 0.22-106.8509 -23.507198 Multiply -2.412929 and -0.02. 0.04825858 -520154 times 68.6 -35682564.4 Calculate -217291051.6. -63158197.2 -0.3-64419304 19325791.2 What is 27750.7 times -24? -666016.8 Calculate 568072-6. -3408432 Product of 8297308 and 5. 41486540 Calculate 0.074348560.6. 25793.4844 Multiply 1.2 and 3620281. 4344337.2 Work out 213 * 171.096. 36443.448 What is 767 times 71402? 54765334 Work out 0.036048 * 0.0791. 0.0028513968 Work out 25.89337 * 26. 673.22762 -494.90.99909 -494.449641 5303154 -0.5 -2651577 10.4475 * 372 3886.47 Product of 11.46 and 8523. 97673.58 What is -3.096083 times -14? 43.345162 Work out -55.3 * 1691.2. -93523.36 Multiply 0.7 and 0.044512863. 0.0311590041 What is -4174187 times -0.2? 834837.4 What is 0.017 times -118304? -2011.168 Multiply -102543 and -29. 2973747 Multiply -46630724 and -0.1. 4663072.4 Multiply 4 and 2473.581. 9894.324 22839 times 228 5207292 What is the product of -0.4 and -48.1508? 19.26032 0.00838-9231 -77.35578 What is the product of -348 and 0.5526? -192.3048 What is the product of -96514.4 and -0.964? 93039.8816 What is the product of 726 and -315.7? -229198.2 Work out -118 57.5351. -6789.1418 What is 8714.268 times 4? 34857.072 61246 times 308.5 18894391 Product of -0.3 and -3423160. 1026948 -295169 * 0.04 -11806.76 What is the product of 1 and -0.6168123? -0.6168123 Product of 209.859 and -142. -29799.978 0.00741-0.1017 -0.000753597 What is -2.2373 times -6.629? 14.8310617 What is -7.8500278 times 7? -54.9501946 Work out 0.01950994 -2. -0.03901988 4254281.81 770024.68 Multiply -69 and -352787. 24342303 1242-6187 -7684254 -0.261 times -1423092 371427.012 85.561 times -9.2 -787.1612 Product of -131986 and 486. -64145196 0.0346 * -22.054 -0.7630684 29174741 * -5 -145873705 Work out 46108.136 * -0.2. -9221.6272 Calculate -57-0.2017316. 11.4987012 0.01 -5047.8478 -50.478478 180-47.213 -8498.34 -976826.51 times 2 -1953653.02 -0.23060689 times 2 -0.46121378 Calculate 2-118214.1. -236428.2 Calculate -670897852. -134179570 6 times 332727165 1996362990 -4 times -5419552 21678208 What is -3450.7 times -9? 31056.3 Product of 218 and -789.13. -172030.34 -3308585 5 -16542925 0.032435368 73061.04 -1.91571459.2 -2795.38944 -365260.08434 -3080.60284 1264 -16485 -20837040 Work out 71430900 * -0.3. -21429270 Multiply -25921 and -1735. 44972935 Multiply -55190.48 and -16. 883047.68 Multiply 2.383 and 16394. 39066.902 Multiply -5778424 and 1.1. -6356266.4 Product of 19236234 and 0.5. 9618117 Calculate 0-10791986. 0 Multiply -1064 and -8165. 8687560 -2.569 8501 -21839.069 Product of 0.15 and -3109.64. -466.446 Calculate -1515.8-15.3. 23191.74 6 0.1145077 0.6870462 -1041.5 * 492 -512418 What is the product of 31 and -0.79857? -24.75567 Multiply -0.0252 and 12.0053. -0.30253356 Multiply -13 and -2.5087. 32.6131 What is 0.105 times -1750031? -183753.255 What is 1191190 times 6? 7147140 Product of 28647.69 and -3. -85943.07 Product of -5327 and -21.78. 116022.06 What is 3.37 times -11.0503? -37.239511 Work out 64028 * 14. 896392 Product of -0.00684971 and 36. -0.24658956 Calculate -179.66919-0.13. 23.3569947 -25946 -2474 64190404 Work out 0.00411559 * -0.3. -0.001234677 Multiply -75976 and -1.7. 129159.2 Calculate -32070870.6. -1924252.2 3090990-0.2 -618198 0 times -116874609 0 -3829332 * -25 95733300 What is -1246100 times -0.008? 9968.8 Calculate -11.64342438. -28386.6092 Multiply -0.07 and -1405.02. 98.3514 What is the product of -13033504 and 2? -26067008 -3874654.5 times -3 11623963.5 What is the product of -9408 and 2.4? -22579.2 Calculate 5-15328771. -76643855 What is 0.584 times 396522? 231568.848 Work out -0.4 * -13242009. 5296803.6 Calculate 1.50932.635. 49.246215 -346 225668 -78081128 Multiply -7.3801 and -37. 273.0637 Product of 0.3 and -94.49909. -28.349727 9.13 times 32.14 293.4382 Product of 1 and 156483645. 156483645 Multiply 37917.984 and 0. 0 0.53444 times 13 6.94772 -951543-1 951543 36865470 24092960 What is the product of -2343.4 and -325? 761605 12215.3762 1875.8964 What is the product of 16861 and -3.174? -53516.814 What is -56073103 times -2? 112146206 0.1 13560188 1356018.8 What is the product of -11 and -352.3253? 3875.5783 Multiply 1 and -78594490. -78594490 38 times 1.283664 48.779232 Work out 0 * -119255.227. 0 5222510.4 times -0.1 -522251.04 Work out -9294 * 1543. -14340642 Work out -0.1 * -9102970. 910297 Multiply -1.5 and 53.81156. -80.71734 72653 times 30.61 2223908.33 Work out -1366286 * 71. -97006306 Work out 0.1 * 1808618.38. 180861.838 What is the product of 0.3 and -8.254816? -2.4764448 -699484-1 699484 Multiply -0.23 and 20891.2. -4804.976 Calculate -9.765340.5. -4.88267 Multiply 21.38679 and 7. 149.70753 Product of -2.832 and 159.81. -452.58192 Work out -0.14 * 0.0249139. -0.003487946 What is -44617 times 0.0415? -1851.6055 Calculate 2321416*-0.2. -464283.2 What is th	{ "pile_set_name": "DM Mathematics" }
2 in descending order. t, -0.2, -2 Let l = -103 + 102. Sort 9, -3, l in decreasing order. 9, l, -3 Let v = -2775/4 + 30487/44. Let t = -10/9 - -74/99. Let b = v - t. Sort -2/7, b, -0.2 in ascending order. b, -2/7, -0.2 Let o be 2/5 - (-57)/(-5). Let w(u) = -u*2 - 13u - 18. Let c be w(-11). Suppose cx = 3x + 5. Put x, o, -3 in increasing order. o, -3, x Let m(g) = g*2 + 4. Let i be m(-4). Suppose 5r = r - i. Sort r, 1, 0 in decreasing order. 1, 0, r Let p(u) = -12u - 97. Let n be p(-8). Sort -4, 3, -14, n. -14, -4, n, 3 Let n = 5 + -8. Let c = -0.146 + 0.066. Put n, c, 2 in descending order. 2, c, n Let f(b) = -9b + 448b2 - 447b*2 - 36 + 28b. Let v be f(-21). Let n(k) = k*2 + 3k - 4. Let p be n(-3). Sort p, v, -3 in decreasing order. v, -3, p Let o = 155.5 + -155.2. Suppose -4g = -g + 21. Let q be 16/g - (0 + -2). Put q, -5, o in ascending order. -5, q, o Suppose 0b - 4b + 19 = s, b - 19 = -5s. Sort -40, s, -1 in decreasing order. s, -1, -40 Suppose 0w - 10 = 5w. Let g = -3178 + 3175. Sort w, g, -4, 3 in descending order. 3, w, g, -4 Let g = 2.061 - -0.099. Let u = 0.84 + g. Put 0.4, u, 30 in increasing order. 0.4, u, 30 Let a = 678 - 818. Sort -3/5, 1, a. a, -3/5, 1 Let k = 3.22 - 4.22. Put -4, 3, k, -13 in descending order. 3, k, -4, -13 Let g be 7 - 2256/224 - (-1)/14. Suppose -7i + 16 = -3i. Put i, 2, g in descending order. i, 2, g Suppose 6v + 8 = -40. Let x be 3/((-1)/v6). Put 13, x, 0 in descending order. 13, x, 0 Suppose 2r = -3r. Suppose 3n - 15 = -rn. Suppose 0 = -y + ny. Put y, 3, -13 in decreasing order. 3, y, -13 Let u = 37.3 - 37.8. Sort -4, u, 0.2, 6 in increasing order. -4, u, 0.2, 6 Let r = -118.4 + 119. Sort -25, -5, r in descending order. r, -5, -25 Let r = -18.64 + -27.36. Sort -1, 4, r, 3 in descending order. 4, 3, -1, r Let g(p) = -3p - 10. Let k be g(-6). Let i be ((-2)/k)/((-6)/(-16)). Let t = 4.044 + -0.044. Sort i, -2/11, t in descending order. t, -2/11, i Let c(r) = 2r2 - 3r - 3. Suppose 2x - 17 = -5q, -5x + 20 = 3q + 2q. Let o be c(q). Suppose 3z + o + 0 = 0. Sort z, -4, -1. -4, z, -1 Let a be (-1)/(3/(-13)) - 1184/888. Sort -68, -3, a, 2. -68, -3, 2, a Suppose -672 = -114g + 82g. Sort g, 13, -4 in increasing order. -4, 13, g Let x(p) = -p*2 - 19p + 36. Let n be x(-15). Let h be (-1)/6 - 2/n. Sort -4, h, 1. -4, h, 1 Let h be (-12)/(-18)6/4. Let r be (9/6 - h)-2. Let i be (-1 - -6)/((2 + -3)1). Put i, r, 0 in ascending order. i, r, 0 Let v be -2 + (-1(3 + -1) - -6). Sort 4, -6, -3, v in descending order. 4, v, -3, -6 Let g(r) = r3 - r2 - 5r - 2. Let a be g(3). Let l = 9 - 2. Suppose -lp = -2p. Put 4, p, a in descending order. 4, a, p Let h(p) = 35p + 486. Let b be h(-14). Let j be (-8)/3 + (-1)/3. Put b, 4, j, -6 in decreasing order. 4, j, b, -6 Let a(b) be the second derivative of -b*4/12 - 3b*3 - 35b*2/2 + 24b. Let o be a(-16). Put 2, -1, o in descending order. 2, -1, o Suppose -231n = -226n - 45. Let d be (2-2)/(1/(-1)). Put d, -1, n, 3 in decreasing order. n, d, 3, -1 Let o = -71.5 + 70.3. Sort o, -0.4, 4, 5 in ascending order. o, -0.4, 4, 5 Let f = 330 - 334. Sort f, 0, 7 in descending order. 7, 0, f Suppose -209y - 25 = -214y. Sort 4, -1, y in decreasing order. y, 4, -1 Let t(k) = -6k + 31. Let d be t(5). Let q = d - 4. Put q, 5, 3 in increasing order. q, 3, 5 Let c(j) = -j*3 + 11j*2 + 13j - 9. Let o be c(12). Let u be o + 12/4-3 - -3. Let w be 36(-2)/9. Put w, u, 6 in decreasing order. 6, u, w Let k be 4 + -2 + 3-2. Let x be (-50)/15 + (-1)/(-3). Put 0, k, x in ascending order. k, x, 0 Let f = -61.7 + 57.7. Sort 5/3, 0.017, f, 2/5 in increasing order. f, 0.017, 2/5, 5/3 Let w = -4/133 - -6/19. Sort w, -3, 3 in decreasing order. 3, w, -3 Suppose 5q - 26 = -2l - 41, 4l = -2q - 22. Suppose c + 2p + 3 = -p, -5c = 2p - 11. Put l, c, 1 in decreasing order. c, 1, l Suppose -25k + 28k = -18, 2w + 16 = -4k. Suppose -4c - 1 + 21 = -4n, 3n + 2c = 0. Let v = 0 + 1. Put w, n, v in decreasing order. w, v, n Let i(q) = 2q - 20. Let g(f) = -f + 10. Let w(a) = -7g(a) - 3i(a). Let d be w(8). Sort -3, d, -13 in decreasing order. d, -3, -13 Suppose -2h + 2 + 8 = 0. Suppose -z = 2z + hs, 4s - 2 = -2z. Let g = z - -6. Put g, 2, 9 in decreasing order. 9, 2, g Let d(f) = -17f - 17. Let p be d(-1). Suppose -4k = k + 10. Put k, p, 5 in decreasing order. 5, p, k Let z = 1670 + -1672. Put 5, 155, z, -5 in decreasing order. 155, 5, z, -5 Let v(q) = 378q - 1139. Let g be v(3). Suppose -5t - 5k = -3k - 30, k = 5. Sort -4, g, 12, t in descending order. 12, t, -4, g Let v(x) = 2x*2 + 17x + 5. Suppose -25 = -5y - 80. Let d = y + 3. Let p be v(d). Put 3, p, -4 in descending order. 3, p, -4 Let o = 1068.581 - 1068. Let x = -0.081 + o. Sort 2/17, 3/5, x, 3 in decreasing order. 3, 3/5, x, 2/17 Let r be 4/6(-3)/2. Let a = 16947 + -16940. Put 2/21, r, a in descending order. a, 2/21, r Let k = -9.5 - 1.3. Let t = 35 + -24. Let p = t + k. Sort p, -4, -2 in ascending order. -4, -2, p Let s = 1.32 + 5.68. Put -1/4, s, -5, 0 in ascending order. -5, -1/4, 0, s Let o(d) = -4d - 4. Let g(k) = k - 1. Let n(i) = -3g(i) - o(i). Let u = -6 + -5. Let q be n(u). Put q, 3, 1 in descending order. 3, 1, q Let t = -3 + 5. Let j(n) = n*3 + 2n*2 - 10n - 1. Let h be j(-4). Let c(w) = w*2 - 3w - 27. Let o be c(h). Put t, 0, o in descending order. t, o, 0 Let c(x) = -11x2 - 22x - 2. Let j be c(-2). Put j, -32, 4, -1 in descending order. 4, -1, j, -32 Let m = 0 + 1. Let i be (3/(-1) + (-20)/(-4))/(-9). Sort i, -3, -11/2, m in increasing order. -11/2, -3, i, m Let p be 12/6 - 4/(-1). Suppose 10o - 13o - p = 0. Sort o, 3, 2 in ascending order. o, 2, 3 Let v = 1.75 + 1. Let z = 2.7 - v. Sort 3/7, z, -0.1 in decreasing order. 3/7, z, -0.1 Let a = -397 - -1193/3. Put 2/61, 4, a in ascending order. 2/61, a, 4 Let u = -86.7 + 90. Let b = -19 - -16.2. Let d = u + b. Put -4, -1, d in decreasing order. d, -1, -4 Let r be (-300)/(-70) + 2/(-7). Suppose -5k = -rp + 31, -5 = -p - p - k. Suppose 2u + 3u = -10. Sort p, u, 1 in ascending order. u, 1, p Let l = 560 - 562. Sort -11, l, -24, 0 in increasing order. -24, -11, l, 0 Let g(v) = -v - 12. Let y be g(5). Let a = 130 - 129. Sort 5, a, y. y, a, 5 Let c = 4 - -1. Let q = 5 - c. Sort 1/4, 0.4, q in ascending order. q, 1/4, 0.4 Let d = -214 + 202. Put 2, d, 3 in increasing order. d, 2, 3 Let k = -13 + 9.7. Let r = -3.2 - k. Sort -1/7, -1, r, 1/3. -1, -1/7, r, 1/3 Let l = -276 - -161. Let o = l + 114. Sort 0, 3, o, -2/5 in descending order. 3, 0, -2/5, o Let i be 1-1 + 23. Suppose c = -20 + 21, 6 = -2x + 2c. Sort i, x, 2 in ascending order. x, 2, i Let s(f) = -7 + 4f2 + 3 - 3f*2 + 1 - 5f. Let o be s(5). Let i(x) = -2x2 + 1. Let l be i(-1). Sort l, 0.5, o. o, l, 0.5 Let i be ((-96)/(-10))/((-9)/(-60)). Let r = i + -255/4. Sort 0.4, 0.3, 0, r in increasing order. 0, r, 0.3, 0.4 Suppose j - 9 = -4. Suppose -4n + 17 = -n + 2s, 4n = js - 8. Put -4, n, 1 in decreasing order. n, 1, -4 Let v = -4.26 - 6.74. Put 3, v, 2, 1 in descending order. 3, 2, 1, v Let i = -1.0738 - 0.0262. Sort -0.4, i, -6 in descending order. -0.4, i, -6 Let r = -4 + 5. Let n = -33.0082 - -0.0082. Sort -0.1, r, n in decreasing order. r, -0.1, n Let r = -2 - 1. Let w be 460/23 + -2 + 0. Let h = w + -14. Sort r, -4, h in decreasing order. h, r, -4 Let b = -233 + 230. Sort 4, -2/11, b, 1/2. b, -2/11, 1/2, 4 Suppose -o = -5t + 29, -14 = -4t - 2o - 2. Suppose -9q + 7q = 0. Sort q, -5, -2, t in descending order. t, q, -2, -5 Suppose w + 3d - 97 = -2d, -2w + 4d + 138 = 0. Let n = w + -80. Put -5, n, 4, 0 in decreasing order. 4, 0, n, -5 Let n = -2499/4 + 624. Sort 0.4, 20, 0.2, n in descending order. 20, 0.4, 0.2, n Let h be ((-2)/6)/(76/(-57)). Sort -0.3, 4, 3, h in descending order. 4, 3, h, -0.3 Let f = 2/21 + -3/7. Sort -0.5, -0.1, f, -6. -6, -0.5, f, -0.1 Suppose -3s = -11 - 1. Let z(f) = 2f*2 - 2f. Let t be z(2). Suppose -tm = -0m + s. Sort -5, m, -6 in decreasing order. m, -5, -6 Let y = 65 + -127/2. Let i = -62.8 - -63. Sort 0.3, i, -0.2, y in decreasing order. y, 0.3, i, -0.2 Let l be 0 - ((-72)/(-32) + -2). Put l, 1/4, 2/25, -3 in descending order. 1/4, 2/25, l, -3 Let w(m) = 7*m + 105. Let h be w(-15). Put	{ "pile_set_name": "DM Mathematics" }
(t) = -bt + 1 + 4t + 0t - 2. Let f(s) = -5s + 2. Calculate f(v) + 3j(v). -2v - 1 Let g(z) = 2z2 + z - 5. Let v(f) = f2 - 4. Let m(x) = -18x - 2. Let h be m(0). Determine hg(j) + 3v(j). -j*2 - 2j - 2 Suppose -a - 1074 = -4a. Let q(k) = -2k - ak2 + 357k*2 - 2k. Let n(j) = -j. Calculate -5n(h) + q(h). -h2 + h Let g(b) = 16b*3 + 3b*2 + 2b + 1. Let q(k) = 33k3 + 8k*2 + 4k + 2. Determine 5g(i) - 2q(i). 14i3 - i2 + 2i + 1 Let v(m) = -14m2 - 11m - 23. Let z(j) = -6j + 96j*2 + 15 - 87j*2 + 13j. Let r(b) = -5v(b) - 8z(b). Let o(k) = 1. What is -5o(q) - r(q)? 2q*2 + q Let p(s) = -2s*2 - 69s - 588. Let a be p(-16). Let w(l) = -l*2 + l - 5. Let g(d) = -d + 6. Let m = -3 + 6. What is aw(r) + mg(r)? -4r*2 + r - 2 Let a be -4 + -2 + 4/(-2) + 5. Let o(x) = 18x*3 - 9x*2 - 5x - 7. Let s(m) = 9m3 - 5m*2 - 3m - 4. Calculate ao(t) + 5s(t). -9t3 + 2t2 + 1 Let u(f) = -f3 - f*2 - 2. Let k(m) = 447m*3 + 3m*2 + 6. Determine k(h) + 3u(h). 444h3 Let z(w) = -15w - 6. Let n(q) = -6q. Determine 2n(d) - z(d). 3d + 6 Let u(v) = 352v*2 - 8v - 4. Let z(b) = 2b2 - 2b - 1. What is -u(c) + 4z(c)? -344c*2 Let d(k) = -6k - 53. Let l(f) = f + 13. Determine -2d(p) - 9l(p). 3p - 11 Let r(c) = 16c + 675. Let b(k) = 27k + 1350. Calculate -3b(d) + 5r(d). -d - 675 Let z(y) = 2y - 4. Let l(k) = 3 - 2k - 3 + 4k - 5. What is -5l(w) + 6z(w)? 2w + 1 Let q(x) = -2x*2 + 2x - 41. Let p(s) = 2s2 - 3s + 42. What is 4p(a) + 6q(a)? -4a2 - 78 Let i(t) = 20t*2 - 6t. Let b(z) = -4z2 + z. Let g = 7 + 4. Determine gb(f) + 2i(f). -4f*2 - f Let l(o) = -5o3 + o2 + 2o + 1. Let m(q) = q3 - q2 + 1. Calculate -l(b) - 2m(b). 3b3 + b2 - 2b - 3 Let p(l) be the first derivative of -3l2/2 + 2. Let y(q) = -2q*2 - 26q - 30. Let u be y(-13). Let s = u + 32. Let t(g) = 12g. What is st(c) + 9p(c)? -3c Let a(h) = 2h3 + 0h*3 - 2 - 1. Suppose -5j + 15 = -0. Let o(x) be the third derivative of -x*6/40 + 2x*3/3 + 31x*2. Give jo(k) + 4a(k). -k3 Let d = 19 + -21. Let f(z) = -21z*3 - 11z*2 - 10z - 6. Let q(r) = 4r3 + 2r*2 + 2r + 1. Let j be 18/(-42) + (-74)/7. Calculate df(k) + jq(k). -2k3 - 2k + 1 Let q = 41 - 39. Let a(s) = s*2 - s - 1. Let n(g) = 5g*2 - 4g - 3. What is qn(x) - 6a(x)? 4x2 - 2x Let s(g) = -15g3 - 2g*2 - 4g + 1. Let z(l) = 14l3 + 2l*2 + 5l - 1. Determine 5s(j) + 4z(j). -19j3 - 2j*2 + 1 Let k(u) = 20u*2 - 50u - 12. Let g(i) = 21i2 - 50i - 14. Determine 6g(z) - 7k(z). -14z2 + 50z Let d(u) = 7u3 + 1274 + 4u + 4u2 - 2553 + 1276 + 0u. Let z(q) = q3 - q2 - q + 1. Calculate -d(b) - 3z(b). -10b3 - b2 - b Let w(x) = 3x3 + 6. Let r(g) = -7g3 + g2 - 13. Suppose 5y = 2d + 2, 2d + 2d - 16 = 0. Give yr(f) + 5w(f). f*3 + 2f*2 + 4 Let o(p) = -11p + 3. Let w(h) = 7h3 - h2 + h - 1. Let n be w(1). Let q(x) = 3x - 3x + nx + 0x - 2. What is 3o(g) + 5q(g)? -3g - 1 Let d(a) = -111a2 - 3a - 1. Let f(j) = j*3 - 331j*2 - 10j - 4. What is 7d(l) - 2f(l)? -2l3 - 115l*2 - l + 1 Let q(j) = 2j*2 + 4j - 13. Let x(v) = 2v2 - v + 1. Determine q(m) + 3x(m). 8m2 + m - 10 Let d(t) = 6t*3 + 4t*2 - 11t. Let u(n) = n3 - n2 + 3n. Let l(j) = -j3 + 3j*2 - 6j. Let b(x) = -l(x) - 2u(x). Give -4b(g) - d(g). -2g3 + 11g Let r(n) = 20n + 13. Suppose -2o = 3o - 45. Let s(j) = 5j + 3. Let q(z) = z*2 - 125z + 1354. Let m be q(12). Calculate mr(b) + os(b). 5b + 1 Let c(i) = 3i*2 - i - 2. Let q(g) = -g. Give c(t) - 3q(t). 3t2 + 2t - 2 Let v(a) = a2 + a + 6 - 4 - 2. Let d = 6 - 9. Let x(f) = f - 2. Let h be x(d). Let r(y) = y3 + 5y2 + 5y. Determine hv(q) + r(q). q3 Let m be ((-16)/56)/((-16)/56). Let r(n) = 3n*3 + 4n*2 + 4n - 10. Let x(d) = d3 + d2 + d - 1. Calculate mr(f) - 4x(f). -f*3 - 6 Let z be 5/(-2)((-360)/(-6))/2. Let b = -74 - z. Let r(y) = y*2 + y. Let m(h) = 2h*3 - 6h*2 - 8h + 1. What is bm(o) + 6r(o)? 2o3 - 2o + 1 Let c(w) = 2w + 4. Let q = 91 + -94. Let n(m) = m + 3. Determine qn(s) + 2c(s). s - 1 Let w(s) = s + 3. Let b(k) = -k - 2. Let x be (0 - 0) + (-5 - -24) + -15. Determine xb(v) + 3w(v). -v + 1 Let k(i) = 4i + 2. Let z(g) = 3g + 2. Let d be 332/6. Let t(v) = -v2 - 19v + 40. Let u be t(-21). What is dz(f) + uk(f)? f + 2 Let v(b) = 8b2 - 5b - 2. Suppose 25h - 29h - 16 = 0, -2r - 3h = 30. Let l(m) = -15m2 + 9m + 3. What is rv(f) - 5l(f)? 3f2 + 3 Suppose -10 = 3v + 4s, -4s + 43 = 47. Let r(g) = -g + 1. Let n(o) = -o + 2. What is vr(u) + n(u)? u Let w(h) = -36h - 21. Let o(u) = -5u - 3. Calculate -15o(l) + 2w(l). 3l + 3 Let p(q) = 3q + 3. Let i(f) = -f + 2. Suppose -5 = j, -3r + 4j = -4 - 25. Let k(c) = -c + 1. Let o(h) = rk(h) - 2i(h). Determine -2o(d) - p(d). -d - 1 Let k(y) = -7y3 + 6y + 7. Let p(s) = -13s3 + 11s + 13. Let b be 0 - 2/657. Let f = 13 + b. Give fp(h) + 11k(h). h3 - 1 Let x(b) = b3 + b2 + 2b + 2. Let v(u) = -78u3 + u2 + 2u + 1. What is v(p) - x(p)? -79p3 - 1 Let y(b) = -25b - 5. Let z(v) = 9v + 2. Give -3y(d) - 10z(d). -15d - 5 Let l(i) = 240i + 400. Let x(b) = -b - 1. Calculate l(q) + 400x(q). -160q Let z(l) be the third derivative of 11l*6/360 - 2l3/3 + l2. Let j(o) be the first derivative of z(o). Let h(r) = 6r2. Give -7h(m) + 4j(m). 2m*2 Let q(k) = 7k - 1. Let s(h) be the first derivative of -4h2 + h + 104. Calculate -6q(v) - 5s(v). -2v + 1 Let u(s) = -859s2 - 6. Let b(x) = 263712x*2 + 1845. Determine 2b(p) + 615u(p). -861p*2 Let q(y) be the first derivative of -7y*4/2 - 7y*3/3 + 17y*2/2 + 20y - 476. Let i(p) = -5p3 - 2p*2 + 6p + 7. What is -17i(l) + 6q(l)? l*3 - 8l*2 + 1 Let a(x) = 3x*3 + 5x*2 + 5x + 5. Let u be (-94)/18 - (-2)/9. Let k be (-30)/18(-60)/(-50). Let y(i) = -i3 - 2i*2 - 2i - 2. Calculate ka(w) + uy(w). -w*3 Let v(f) = f + 4. Let j(x) = -3x - 8. Let y(k) = 2j(k) + 5v(k). Let u(d) be the third derivative of -d4/24 + d3 - 9d2. What is 5u(z) - 8y(z)? 3z - 2 Suppose 0 = 103z - 663 - 161. Let q(f) = 12f*3 - 4f*2 - 4f. Let x(j) = j3 - j2 - j. What is zx(o) - 2q(o)? -16o3 Let b(n) = -6n*2 - 25n + 4. Let h(q) = -2q2 - 8q + 1. Give -2b(r) + 7h(r). -2r2 - 6r - 1 Let j(r) = 4. Let n(c) = -1264c + 1580. Give 395j(z) - n(z). 1264z Let s(y) = -8y*3 - 28y*2 - 5. Let o(n) = 7n*3 + 27n*2 + 4. What is 6o(w) + 5s(w)? 2w*3 + 22w*2 - 1 Let q(v) = -v - 4. Let z(t) be the second derivative of 0 + 3t*2 + 1/6t*3 - 18t. Give 7q(y) + 5z(y). -2y + 2 Let a(d) = -5d*3 + 3d*2 + 2d + 4. Let x = 1012 - 1004. Let c(v) = -15v3 + 8v*2 + 5v + 11. Determine xa(k) - 3c(k). 5k3 + k - 1 Let l(b) = -b. Let g(j) = -6j. Determine g(m) - 12l(m). 6m Let w(b) = 3b3 + 6b - 6. Let k(h) = -5h3 - h2 - 6h + 6. Let i(d) = -3k(d) - 4w(d). Let x(j) = 6j3 + 7j*2 - 13j + 13. Give 13i(t) - 6x(t). 3t3 - 3t*2 Let h(k) = -k + 4. Let v be h(5). Let a(t) = 28t - 129t + 35t - 1 + 34t + 33t. Let g(o) = o*2 - 6o + 10. Calculate vg(p) - 6a(p). -p*2 - 4 Let k be (-1)/(-7) - (-301)/(-49). Let i(t) = 9t*3 - 6t*2 + 6t - 6. Let n(z) = 11 - 5z2 + 17z*3 + 11z + 9 - 6z2 - 31. Give kn(c) + 11i(c). -3c3 Let m(d) = -d2 + 2. Let f(a) = -6 + 16 - a*2 - 7. Let g be (-5)/(-20) + (-11)/(-4). Calculate gf(l) - 5m(l). 2l*2 - 1 Let z(h) = 74h - 25 - 33h - 21h. Let k(n) = 1 - 2n + n + 0. Calculate -25k(i) - z(i). 5i Let r(y) = -2y + 4. Let m = -1998 - -2003. Let w(a) = 1. Determine mw(d) + r(d). -2d + 9 Let y(q) = q*3 - 25q*2 + 3q - 74. Let t be y(25). Let c(v) = 2v3 - 3v2 + 6. Let s(j) = j2 - 1. What is tc(x) + 4s(x)? 2x3 + x2 + 2 Let p(u) = 28u*3 - 7u - 7. Let t(b) = -12b3 - 3b*2 - b + 2. Let m(g) = -11g*3 - 2g*2 + 2. Let d(s) = -3m(s) + 2t(s). Give 7d(o) - 2p(o). 7o*3 Let z(r) = -26r*3 + 11r - 11. Let c(s) = 5s3 - 2s + 2. Let l be 194/(-6) + 166/(-249). Calculate lc(n) - 6z(n). -9n3 Let j(m) = 4m*3 - 9m*2 - 3. Let i(f) = -7f*3 + 19f*2 + 7. Give -3i(q) - 5*j(q).	{ "pile_set_name": "DM Mathematics" }
Let r = -15 - -23. Solve -5x - r - 2 = 0 for x. -2 Suppose 3t = t. Suppose -o - 3 = -to. Let b(j) = 2j*2 + 4j - 1. Let f be b(o). Solve -fg - 30 = -5 for g. -5 Let n = -15 - -7. Let d = n - -11. Let o be (-6)/44/(-3). Solve -du - ou = -20 for u. 4 Let n(a) = -a*3 - 15a*2 - 17a - 17. Let s be n(-14). Solve 7t - 2t + s = 0 for t. -5 Let s = -38 - -38. Solve s = -5i + 12 - 2 for i. 2 Suppose -15 = -15d + 14d. Solve -d = -v + 6v for v. -3 Let a(o) = -o*2 + 7o. Let s be a(5). Suppose -3w + 5 = -2w. Let c be ((-5)/(-2))/(w/s). Solve 0 = -3k - c - 7 for k. -4 Let a be 0/(-3)(0 + 1). Solve a = -5h - 19 + 4 for h. -3 Suppose 0 = 4p + 3y + 29, 2p = 3y + 2 - 3. Let m(d) = d3 + 3d*2 - 9d + 5. Let u be m(p). Solve u = -r - r - 6 for r. -3 Let a(i) = -3 - 5i + 3i + 4 + 10. Let k be a(5). Solve -4s + k = -7 for s. 2 Suppose 0 = -5q - 2d + 16, 1 = 5q + 2d - 5d. Solve y = qy + 2 for y. -2 Let s be (3 + 12)/(3/(-10)). Let n = -34 - s. Suppose n = b - 0b - 4i, 3i + 12 = -b. Solve -2x + 3x = b for x. 0 Let z(n) = -2n - 16. Let f be z(-8). Let v(d) = -2d - 2. Suppose 0 = -5r - q - 15, 0 = -2r + 3r + q + 3. Let w be v(r). Solve wu + u + 10 = f for u. -2 Let s = 1 + 1. Let r be 2 + (s + -3)-2. Let f be (-1)/((0 + 2)/(-2)). Solve 5u + r = -f for u. -1 Suppose 3 = -3o - 3g, 3o + 0g + 11 = 5g. Let f be 1/o(4 + -8). Suppose -4w - q + 0q = -34, 4w - 5q = 22. Solve fa + 2a = -w for a. -2 Let p = 6 + -4. Suppose -4d + 18 = -3x + 5, -px = -2d + 6. Let v be x/1 - (-3 - 0). Solve -va = -a for a. 0 Let z be 1/3 - (-22)/6. Let w(n) = 1 + zn - 3 + 2n2 - 6n. Let j be w(2). Solve -jy = -y for y. 0 Let j(z) = -z3 + 5z*2 + 5z + 3. Let a be j(6). Let h be (1-2)/((-4)/(-6)). Let x = a - h. Solve x = -4d + d - 3 for d. -1 Let k(i) = -i + 12. Let p be k(6). Solve -3j = -5j + p for j. 3 Let w = 83 + -67. Solve 0 = 3l - w + 1 for l. 5 Let k = 24 + -11. Solve -5l - 2 = k for l. -3 Let j(c) = c*2 + 2c - 1. Let d be j(-3). Let r = d - 2. Solve rk + k = -1 for k. -1 Let p be (-40)/(-28)(9 - 2). Solve p = -4f - f for f. -2 Suppose 4u - 1 = 5c + 4, 0 = 2u + 3c - 19. Suppose -4h + 2b = b - 83, -uh + 5b = -100. Let j be (-28)/(-6) - 14/h. Solve -ji = 7 + 5 for i. -3 Let h = 53 - 52. Solve 5q + h + 14 = 0 for q. -3 Let o be 0(-3)/(-9)1. Suppose 4x = -3j + 13 - 1, -x = o. Solve -5d - j = 6 for d. -2 Suppose m - 10 = -9j + 11j, 0 = -3m + 3j + 18. Solve 2 = -ms + 3s for s. 2 Let s be 0 - -5 - (-3 - -5). Solve -2k - 2 = -sk for k. 2 Let d be (-1)/(4/20-1). Suppose -26 = -p - p + 4o, -p - do - 22 = 0. Let h = 0 + 0. Solve 3v + 0v + p = h for v. -1 Let d be (-4)/(-10) + 46/10. Suppose dg + 18 = 7g. Solve 4 = -h + g for h. 5 Suppose 0 = -4k - 5j + 38, 3j + 12 = -5k + 53. Solve -3z - 1 + k = 0 for z. 2 Let c be (-3)/(-1) - 13/13. Solve -n = cn - 9 for n. 3 Let m = 13 + -12. Solve 0 = -f - 5 + m for f. -4 Let x(c) = c - 10. Let s be -1 + (1 - 0) - -11. Let w be x(s). Suppose -5p + 5d - 5 = 0, w = 4d - 11. Solve pj = j for j. 0 Let s be (-2)/(-3) - 8/(-6). Let g = 2 - s. Solve -2j + 7j - 20 = g for j. 4 Suppose 5d + 20 = -t, d - 3d - 8 = 5t. Solve 6 = 2z - t for z. 3 Suppose 2p + u = -7, p - 4u = 3p + 16. Let m(q) = q + 5. Let g be m(p). Solve -g = -4r + 1 for r. 1 Let p = 22 + -9. Solve -7 = -4j + p for j. 5 Let c = 4 + 1. Let v be -1 - (2 - (c - 1)). Let a = 2 + v. Solve t = at + 2 for t. -1 Let f = -78 + 127. Let g be 112/f + (-2)/7. Solve -3 = -a - g for a. 1 Let q(t) = -t3 + 9t*2 + 2t - 13. Let h be q(9). Solve -w + 2w = -h for w. -5 Suppose -3f + 3u + 21 = 0, -f - 4u = 1 + 2. Suppose 3b = fo - 0o + 45, -b - 3o + 29 = 0. Solve -g - b = 4g for g. -4 Let h(s) = -6s + 9. Let u be h(0). Solve -5z = -8z + u for z. 3 Let z = 15 - 11. Solve 0 = -3r + z - 1 for r. 1 Let t(x) = x3 + 2x*2 - 3x + 4. Let n be t(-3). Let q be 4/n + 0 + 0. Let d be 10/2 + (q - 4). Solve -dz = z for z. 0 Suppose -6g - 62 = -2c - g, 0 = -3c + 5g + 93. Let f = c + -12. Suppose 0 = 3i - h - f, i + 5h - 6 = -21. Solve -j - i = -0 for j. -5 Let p(z) = z - 12. Let h(s) = s2 - 4s - 7. Let r be h(7). Let q be p(r). Solve -u + 1 = q for u. -1 Let f = 2 + -5. Let q = -2 + f. Let b be ((-3)/q)/((-5)/(-75)). Solve -w + b = 2w for w. 3 Let p(o) = o2 + 2o - 3. Let g be p(-3). Suppose 0 = 3n + 2n. Suppose -4d = 3h + 9, n = d - h - 5 + 2. Solve m + 3 + d = g for m. -3 Let h = -57 - -94. Suppose 5y + 4n - h = -0n, 5n = -y + 20. Suppose 2c + 3i - 4 - y = 0, -5c + 16 = i. Solve -c = f - 0 for f. -3 Let r be ((-4)/(-6))/(20/1170). Let y = r - 19. Solve -q = 3q + y for q. -5 Suppose 0 = -2x - 0x. Solve -3k + xk = -15 for k. 5 Let w be 6/2(3 - 20/12). Let r(c) = -7c. Let q be r(-1). Suppose -wg = -qg + 24. Solve -2f + g = -2 for f. 5 Suppose -q + 9 = 2h, q - 3q = 5h - 22. Solve -4k = -2k - h for k. 2 Let s = -41 - 58. Let o be s/(-6)(-4)/(-6). Solve -4l - o = 1 for l. -3 Let w(d) = -4 + 0 + 8d - 7d - 7d2 + d3. Let c be w(7). Solve 0 = -cj + 2j - 3 for j. -3 Suppose -7x + 2x + 150 = 0. Let p = -21 + x. Let n(t) = -t2 + 5t + 8. Let u be n(6). Solve y + p = -uy for y. -3 Let o(m) = m + 7. Let c be o(-5). Let d be -12-1(-1)/(-3). Solve -ci = -di for i. 0 Let u = -17 + 19. Solve 0 = b + 3 - u for b. -1 Suppose -5g - 4w + 0w + 137 = 0, -g + 34 = 3w. Solve 4s - 13 + g = 0 for s. -3 Suppose 3b + 12 = 5p, 2p - 3b - 10 = -7b. Solve -pt + 8t = 10 for t. 2 Suppose 2z = 3p - z - 12, 3p + 4z - 12 = 0. Suppose pq - 5 = -1. Solve 3 = -2c - q for c. -2 Let j(x) = 3x*2 - x + 1. Let l be j(1). Suppose -5q + 6q - 3 = 0. Solve -qs + l = -2s for s. 3 Let t = 40 - 28. Solve -4q - t = -0q for q. -3 Suppose 7 = -j + 2j + 3d, -5 = -j - d. Suppose -5m - jl - 8 = -3, 4m - 37 = 5l. Let k = 6 - 2. Solve -mt = -t + k for t. -2 Let t(m) = -m*2 - 6m + 4. Let w be t(-6). Solve -wq = q - 25 for q. 5 Suppose 10 = -4x - 6. Let j = -6 - x. Let f be -2 + j/1-1. Solve fb + 4b = 16 for b. 4 Let b(h) be the first derivative of h3 - h2 + h - 3. Let x be b(1). Solve m + x = 3 for m. 1 Let k(p) = p3 - 7p*2 + p - 7. Let h be k(7). Suppose 2y = -0y - 4j, 4y - 2j = h. Solve y = -3t - t - 4 for t. -1 Let w(r) = r + 12. Let q be w(-4). Solve 5z + q + 7 = 0 for z. -3 Let m(a) = a + 8. Let u be m(-5). Suppose 4k - uk = 0. Suppose k = -b - 2j - 3, -b = -j - 0 - 3. Solve -i - 3 = -b for i. -2 Let z = 2 + -1. Let f be ((3 + -3)/(-1))/z. Solve -4x + 11 + 1 = f for x. 3 Suppose -k + 16 = -5k. Let u = 6 + k. Solve uw - 4 = -12 for w. -4 Let a = 51 + -51. Solve as - 2 = -s for s. 2 Let i be 12/(-6) + 0/(-1). Let p be (-4)/(8/3 + i). Let m = 11 + p. Solve 0 = -0w + mw - 20 for w. 4 Let o(n) = -2n*2 - 3n. Let m be o(-3). Let b(h) = h + 9. Let j be b(m). Solve -3 = u - j for u. -3 Let f = -105 - -109. Solve -fo = -o - 9 for o. 3 Let f = -2 - 7. Let w = 13 + f. Suppose t - 10 = -wt. Solve -10 = -to + 7o for o. -2 Suppose 0 = -4l - z + 29, 0 = 4z - 12 - 8. Solve -4 = -5v + l for v. 2 Suppose u - v = 2v + 6, 5u = -4v - 65. Let c be (3/u)/((-2)/48). Let f = -4 - -7. Solve -fn - c = -5n for n. 4 Let g(d) = -d*3 - 24d*2 + 3. Let q be g(-24). Solve -qm - 2 = 1 for m. -1 Suppose 5s + 2p + 4 = 0, -3p - 8 = -5s - 2. Solve s = -4x + 4 + 8 for x. 3 Let g be (1 + 0)(-1 + 7). Let u(l) = l - 5. Let n be u(g). Let b be (-3 + 2 - (-2 + 1))/(-1). Solve a = n - b for a. 1 Let c(j) = -j*2 + 11j + 1. Let w be c(10). Solve 1 = -5d + w for d. 2 Let w be (20/2)/2 - -1. Solve wo = o for o. 0 Let u(x) = -6x - 3. Let r be u(-3). Let w be 2((-45)/6)/3. Let n be 2/w + 6/r. Solve -8 = -2s - ns for s. 4 Let n = 29 + -24. Solve no - o = -16 for o. -4 Suppose 4d - 4 + 0 = 0. Solve -t = -0 - d for t. 1 Let m = -44 + 52. Solve m = -c + 4 for c. -4 Suppose 4y - 6 = 7y. Let c be -2 + (-9)/6y. Solve 0 = -v + 2 - c for v. 1 Let k be (3 + -2)/(2/4). Suppose ky - 4y + 4m + 18 = 0, 11 = 4y - 3m. Let g be y - -29/6. Solve -x + g = x for x. 1 Suppose -2v - v + 9 = 0. Suppose 5p - vp = 0. Solve 6q - 4q - 4 = p for q. 2 Let m = -15 - -16. Solve m = -p - 3 for p. -4 Suppose -n - n = 12. Let q(o) = o + 6. Let c be q(n	{ "pile_set_name": "DM Mathematics" }
mes next: -770, -5797, -19126, -44807, -86890? -149425 What is the next term in -233, -232, -219, -188, -133, -48, 73, 236? 447 What is next in 24212, 24160, 24104, 24044? 23980 What is next in 1160, 1060, 960, 860, 760, 660? 560 What is next in 218, 308, 398, 488, 578? 668 What comes next: -356, -739, -1122, -1505? -1888 What comes next: -114, -467, -1188, -2385, -4166? -6639 What is next in -292195, -292188, -292177, -292162? -292143 What comes next: 572, 2748, 8654, 20156, 39120, 67412, 106898, 159444? 226916 What is next in -2400, -2333, -2266? -2199 What is next in -617, -646, -713, -836, -1033, -1322, -1721? -2248 What is next in -2682, -3002, -3536, -4284? -5246 What is next in -590, -595, -600? -605 What comes next: 2455, 19499, 65765, 155863, 304403? 525995 What comes next: -7710, -8204, -8698, -9192, -9686, -10180? -10674 What is the next term in 604, 637, 670, 703? 736 What is the next term in 169, -148, -1015, -2708, -5503, -9676, -15503, -23260? -33223 What is the next term in -4898, -19826, -44706, -79538? -124322 What is next in -70585, -70597, -70621, -70663, -70729, -70825? -70957 What is the next term in 52611, 52650, 52691, 52734, 52779? 52826 What comes next: -4, 6, 40, 98? 180 What comes next: 1140, 2362, 3606, 4884, 6208, 7590, 9042? 10576 What is the next term in 2398, 2898, 3398, 3898, 4398? 4898 What is next in 2406, 4814, 7228, 9648, 12074? 14506 What is next in -1872, -1664, -1458, -1254, -1052? -852 What comes next: -59167, -118325, -177483? -236641 What is the next term in -1613, -2997, -4369, -5723, -7053, -8353, -9617? -10839 What is the next term in 4551, 18152, 40821, 72558, 113363? 163236 What is next in 1182686, 1182681, 1182676? 1182671 What is next in -2115, -2110, -2115, -2136, -2179, -2250? -2355 What comes next: 37711, 75426, 113141, 150856, 188571, 226286? 264001 What comes next: -392, -772, -1174, -1604, -2068? -2572 What is next in -33, -52, -51, -36, -13, 12, 33? 44 What comes next: -7601, -7603, -7605, -7607, -7609, -7611? -7613 What comes next: -572, -404, -126, 262, 760, 1368? 2086 What is next in -128, -278, -428, -578, -728, -878? -1028 What is next in -286, -501, -656, -751? -786 What comes next: -1907, -3819, -5731, -7643, -9555, -11467? -13379 What comes next: -2388, -2379, -2366, -2349? -2328 What is next in 31, -336, -703, -1070? -1437 What comes next: -396, -556, -822, -1194, -1672? -2256 What is the next term in -7, 53, 165, 341, 593, 933, 1373, 1925? 2601 What is the next term in 3237, 13034, 29363, 52224, 81617? 117542 What is next in 7011, 14060, 21109, 28158, 35207? 42256 What is next in -15708918, -15708920, -15708922, -15708924, -15708926? -15708928 What comes next: 429, 808, 1197, 1602, 2029? 2484 What is the next term in 5643037, 5643036, 5643035, 5643034? 5643033 What is the next term in 254, 227, 218, 239, 302? 419 What is the next term in -10883, -21774, -32665, -43556, -54447? -65338 What is the next term in -253, -433, -735, -1159, -1705? -2373 What comes next: -28779, -28825, -28901, -29007? -29143 What is next in 538, 993, 1448? 1903 What is next in 59370, 59370, 59374, 59382, 59394, 59410? 59430 What is the next term in 115, 47, -79, -275, -553, -925, -1403, -1999? -2725 What comes next: -16430, -16250, -15950, -15530, -14990, -14330? -13550 What is the next term in 259670, 259666, 259662, 259658, 259654, 259650? 259646 What is the next term in 6546, 6517, 6488, 6459, 6430? 6401 What is the next term in 19971, 19921, 19873, 19827, 19783? 19741 What is next in 1129, 1939, 2751, 3565? 4381 What is the next term in 99730, 99735, 99744, 99757, 99774, 99795, 99820? 99849 What is the next term in -15751, -31523, -47323, -63151, -79007, -94891, -110803? -126743 What comes next: -4040, -4043, -4046? -4049 What comes next: 15893, 31779, 47675, 63587, 79521, 95483, 111479, 127515? 143597 What is the next term in -7787, -15491, -23195, -30899? -38603 What is the next term in -3520, -3512, -3504, -3496? -3488 What comes next: 253, 400, 547, 694, 841? 988 What is the next term in -51064, -102152, -153302, -204544, -255908, -307424? -359122 What is next in 3573, 3512, 3451, 3390, 3329, 3268? 3207 What is the next term in 4781, 9559, 14335, 19109, 23881? 28651 What is the next term in 901, 3616, 8137, 14464? 22597 What comes next: -496516, -496514, -496512? -496510 What is the next term in -52356, -104709, -157062? -209415 What comes next: 8609, 34591, 77895, 138515, 216445, 311679, 424211? 554035 What is next in 17793, 17999, 18203, 18405, 18605, 18803, 18999? 19193 What comes next: 79, 71, -7, -155, -373, -661? -1019 What is the next term in -2580, -5164, -7748, -10332? -12916 What comes next: 32139, 32119, 32099, 32079, 32059, 32039? 32019 What is the next term in -674, -1066, -1700, -2570, -3670, -4994, -6536, -8290? -10250 What is next in -230, -190, -100, 58, 302, 650? 1120 What is next in 27545, 27519, 27475, 27413, 27333, 27235, 27119? 26985 What is next in 1008949, 1008951, 1008953, 1008955? 1008957 What is the next term in -294, -344, -426, -540? -686 What is the next term in -1605, -1514, -1363, -1152? -881 What is next in 803, 1659, 2515, 3371? 4227 What comes next: 2798, 2812, 2836, 2870, 2914, 2968? 3032 What is the next term in 1734, 6743, 15094, 26787? 41822 What is the next term in 1332, 1393, 1454? 1515 What is the next term in 395285, 790571, 1185857, 1581143, 1976429, 2371715? 2767001 What is next in 7780659, 7780649, 7780625, 7780581, 7780511? 7780409 What comes next: 78342, 156683, 235024? 313365 What is next in 333630, 1334502, 3002620, 5337984, 8340594? 12010450 What comes next: -43063, -43055, -43047, -43039, -43031? -43023 What is next in 1080, 1454, 2076, 2946, 4064, 5430? 7044 What is the next term in 958, 1049, 1308, 1819, 2666? 3933 What comes next: 708, 397, 84, -231, -548, -867? -1188 What comes next: 3346, 5542, 7738? 9934 What comes next: 556, 2214, 4972, 8830? 13788 What is next in -27670, -55343, -83018, -110695? -138374 What is the next term in 562, 2231, 5006, 8887, 13874, 19967? 27166 What is next in -180, -440, -770, -1206, -1784? -2540 What is the next term in -2484, -2494, -2510, -2532, -2560, -2594, -2634? -2680 What is the next term in -4, -20, -80, -208, -428, -764? -1240 What is the next term in -567, -402, -239, -78, 81, 238, 393? 546 What comes next: -206, -330, -470, -626, -798? -986 What is next in -84466, -84467, -84468? -84469 What is next in -242, -154, -8, 196, 458? 778 What is the next term in 490, 481, 474, 469, 466, 465, 466? 469 What is the next term in -4929, -5897, -6865, -7833, -8801? -9769 What comes next: -36872, -73740, -110608, -147476, -184344? -221212 What is next in -365546, -731093, -1096640? -1462187 What is next in 17, 42, 63, 80, 93, 102? 107 What comes next: 11801, 23566, 35333, 47102, 58873, 70646, 82421? 94198 What is the next term in -2040, -3471, -4902, -6333? -7764 What is the next term in -3245, -5913, -8579, -11243, -13905? -16565 What is next in 2558, 5092, 7622, 10148, 12670? 15188 What comes next: -30, 5, 54, 117, 194? 285 What is next in 20204, 20216, 20240, 20276? 20324 What is the next term in -5509, -11002, -16487, -21964, -27433, -32894, -38347? -43792 What is next in 30216, 60424, 90632, 120840, 151048? 181256 What comes next: -191850, -191849, -191848, -191847, -191846, -191845? -191844 What is next in 300, 1359, 3182, 5775, 9144, 13295? 18234 What is the next term in 6138, 6174, 6210, 6246? 6282 What comes next: 127, 182, 205, 196, 155, 82? -23 What is the next term in -376, -388, -402, -418, -436, -456, -478? -502 What is the next term in 4888, 19533, 43934, 78091? 122004 What is next in 45089, 45133, 45177? 45221 What is next in 76, 210, 446, 784, 1224? 1766 What is next in 46438, 92887, 139346, 185821, 232318? 278843 What is the next term in -1147, -7429, -24487, -57709, -112483, -194197? -308239 What is next in -622, -693, -762, -829, -894? -957 What is next in -176, -663, -1470, -2597? -4044 What comes next: -15933, -31877, -47821, -63765, -79709? -95653 What is next in -1773, -1713, -1653, -1593, -1533, -1473? -1413 What comes next: -1119, -1593, -2077, -2577, -3099, -3649? -4233 What is the next term in -169, -592, -1297, -2284, -3553? -5104 What is next in 104, 700, 1300, 1904, 2512, 3	{ "pile_set_name": "DM Mathematics" }
. Suppose 3y = 25c - 28c + 16335, y + 5c = d. Is y a composite number? False Suppose -28k + 30945487 = 42k + 11287457. Is k prime? False Let y(m) = m + 28. Suppose 5w - 5w - 3w = 0. Let u be y(w). Is (-7)/(u/12) - -982 a composite number? True Let j(i) = i3 + 10i*2 - 2i - 146. Let p be j(-8). Suppose 0 = t + 2. Is t(p - -3) - -565 a prime number? True Let x be 12/36 + (-5)/(-3). Suppose 4f - 3c = -8c + 1034, 0 = -xf - 3c + 518. Suppose 11y - 7y - 5k = 335, -3y + f = k. Is y a composite number? True Suppose -r + 2s - 3 = 0, -3r + 4r + 2s - 13 = 0. Is (4/(-3))/(40/(-1472940)) + r a composite number? False Let n be ((-13)/2)/13108236/1. Let y = -36599 - n. Is y a prime number? True Let y(s) = 6718s + 176. Is y(17) composite? True Suppose 0 = -31o + 35o - 5l - 112, 3o = l + 84. Suppose -3f + 4v = -42717, -of = -29f - 5v + 14258. Is f composite? False Let u = -49566 + 128153. Suppose 154625 + u = 28w. Is w prime? True Let k = 334 - 337. Let y(i) = -261i3 + 2i*2 - 3i - 5. Is y(k) composite? False Suppose -28m + 5u - 1034376 = -29m, m - 2u - 1034362 = 0. Is m composite? True Suppose 0 = -50m - 327950 + 96919 + 4721381. Is m a composite number? True Let m(f) = -4f*3 - 15f*2 - 21f - 1621. Is m(-36) prime? True Let d = -54 - -104. Is (2 - 1)/(d/532550) a prime number? True Let w(s) = 1333s + 7340. Is w(7) composite? True Let t = 491 + -451. Suppose 4648 = -32a + ta. Is a a composite number? True Let m(w) = 946w*2 - 3w + 4. Let z(y) = y*3 - 33y*2 - 68y - 67. Let a be z(35). Is m(a) composite? True Let a(q) = 3500q2 + 15q - 66. Is a(5) a prime number? True Let j(o) = 149o2 + 66o + 26. Is j(7) prime? True Is 356 + -365 + (-1031146)/(3/(-3)) prime? True Let m(o) = -127o + 43. Let u(n) = 2n + 42. Let v be u(-28). Is m(v) a composite number? True Let r(g) = -g*2 - 10g + 3. Let k be r(-10). Suppose -3y - kj - 69 = 2j, 2y = 5j - 21. Is 3/((-3)/(-986)) - (-18)/y prime? False Suppose -3672 - 38538 = 21i. Let a = i + 3647. Is a composite? False Is (29 + -15082)/((-6)/(-9)-3 + 1) a prime number? True Let u(o) = -4o*3 - 6o*2 - o - 20. Let h be (-2)/(396/195 - 2). Let v = h - -60. Is u(v) a composite number? True Let q(k) = 141k*2 - 3k + 25. Suppose 2n = -3f + 11, 0 = -6f + 9f + 9. Is q(n) prime? False Suppose -3h + 4m = -1477, 337h = 342h - 2m - 2443. Is h a prime number? True Let h = 299 + -354. Is (-3992076)/h + 2/(-10) a composite number? True Let w(b) be the first derivative of -27b4/4 + b3/3 - b*2/2 - 6b + 6. Let m be w(-5). Suppose z - m - 196 = 0. Is z a composite number? True Let o(f) = f*3 - 17f*2 + 15f + 17. Let t be o(16). Is (25206/3)/(3 + -1)t a prime number? True Suppose 0 = -s - 3t + 4525, -38t + 4549 = s - 41t. Suppose 3h = s + 41009. Is h prime? False Let q(k) = -3035k + 44. Is q(-13) prime? True Let o(y) = 12y2 + 19y. Let k(s) = -6s2 - 10s. Let v(d) = 5k(d) + 3o(d). Let i be v(-5). Is (i/(-25))/((-1)/5) prime? True Suppose 4q - 17056 = -4l, 2l - 3l = 5q - 21332. Suppose 2k = k + 184. Suppose 3u + k = q. Is u a prime number? True Let w(d) = -d3 - 14d*2 - 29d - 13. Let j be w(-12). Suppose jg + 22566 = 53g. Is g prime? True Let x = -18779 - -35028. Is x a prime number? True Suppose 36k - 10k = -1034020 + 3018522. Is k a prime number? False Suppose -8770 = 3d - 0s + s, 3s = -3. Let t = d + 7410. Is t a composite number? True Let o be 7/(-4)(-9228)/3. Let u = -2418 + o. Let s = -1706 + u. Is s prime? True Let v(c) = 200139c - 1232. Is v(1) composite? True Let s(v) = 6v - 111. Let f be s(19). Suppose -6852 = -15y + fy. Is y composite? False Let p be ((-2)/3)/((-74)/(-111)). Is (4 + 0)19444/(-16)p composite? False Suppose 7q - 330 - 251 = 0. Let n = -15 + q. Let p = n - -219. Is p a composite number? True Let y(m) be the second derivative of -19m + 235/2m2 + 0 + 1/6m*3. Is y(0) composite? True Let c(q) = 52329q - 935. Is c(2) a prime number? True Suppose 0 = 3k + 19 - 16. Let a(m) be the first derivative of 42m*3 + 3m*2/2 + 4. Is a(k) prime? False Let c(o) = -86 + 261o*2 - 11o - 81 + 142. Is c(-4) prime? False Let t be 2/((-2)/(-397)) + 0. Suppose -81c + 66c = 0. Suppose c = 3o + 2o - b - t, 148 = 2o + 5b. Is o a composite number? False Suppose 21v - 25v + 10074 = 19v. Let g = 798 + -393. Suppose -1681 = -4z + 5f, -2z + v = -5f - g. Is z a composite number? False Let j be ((-80)/6)/(-4)3/2. Suppose -21 = -jh + 4. Suppose hb - 348 = b. Is b a composite number? True Suppose -228i - 1995710 = -233i. Is 3 + (-31)/11 - i/(-22) a prime number? True Suppose -t - 644 = -2152. Suppose 5s - 2256 = -3q, 2q - 2s = 4q - t. Is q a composite number? False Let l = 223749 - 83251. Is l composite? True Let u = -138842 + 372093. Is u a prime number? True Let m(l) = 4l*2 - 4l - 13. Let i be m(-2). Suppose -3526 = -n - r, 6n - in - r = -17634. Is n a prime number? True Let a = -109 + 421. Suppose -2y = -3p - 6y + 168, -4y = -5p + a. Let h = p - -922. Is h composite? True Suppose -13 = -4b - 1, 0 = 2s - 5b - 3. Suppose -30 = g + s. Let q = g - -126. Is q prime? False Let t be 199 + 2 + -3 + 6. Let k be (54/12)/(-64/(-32)). Suppose 3u = -3i + t, -5u = ki - 8i - 361. Is u prime? True Suppose 5020 = 2s + 2d, 6s - s - d - 12550 = 0. Suppose -13 = -h + 4p + 2, 2h = 3p + 15. Suppose s = hz + 2z. Is z a prime number? False Let y = -23028 - -46507. Is y/9 - (-18)/81 prime? True Suppose 270744 = 50p - 643906. Is p a composite number? True Let y = 472 + 915. Is y - 6 - 5 - 3 prime? True Let a(h) = -3h + 20. Let w be a(6). Suppose 9 = r + wr, 2k + 549 = -3r. Let m = 400 - k. Is m prime? False Suppose 6j + 275 = 287. Suppose -2f + 19728 = jp, -f - 15p + 9865 = -13p. Is f a composite number? True Suppose 5b = -4g + 7189 + 13052, -4g = 4. Is b a composite number? False Is (8/6 + -2)38/(2888/(-24464058)) a prime number? False Let c = 28 + -27. Suppose c + 1 = l. Suppose 4f + 434 = lr + 3238, -2r = -8. Is f prime? False Let z = 20832 + -12019. Is z a prime number? False Suppose 5006z - 5029z = -1769689. Is z composite? False Suppose -253919 = -28h + 18792437. Is h a prime number? False Suppose -u = -4t + 96555, 13t - 12t = -u + 24140. Is t composite? True Let j(h) = 4h*3 + 8h*2 - 6h - 13. Let i be (-10 - -4) + 3 + 0. Let l(v) = 3v + 16. Let m be l(i). Is j(m) a prime number? True Let f(s) = -s3 + 2s*2 + 3. Let k be f(2). Let x(r) = 23 - 2r*3 + 10r + 3rk + 20r*2 + 18r - 14r. Is x(-19) prime? False Suppose -4j = -a + 172, 4j = -0a - a - 172. Let m = 41 + j. Is -2(m - (-252)/(-8)) composite? False Suppose -5t - 300982 = -2k, 5k + 3t = 802536 - 50143. Suppose 0 = 5y + 20, 5a - k = 2y + 2y. Is 4/10 - a/(-105) a composite number? True Suppose 0 = -16o - 25o + 334765. Let s = 17262 - o. Is s a prime number? False Let q(t) = -27429t - 91. Is q(-12) prime? False Is 2/58322990/52 composite? True Let v = 9 + -11. Let o be 382 + -4 + (v - -2). Is (o - (-4 - -8)) + -1 prime? True Suppose -z = -4l - 99665, -22z = -17z - 4l - 498309. Is z prime? True Let m = -113862 - -317731. Is m prime? True Suppose 176 = -2t - 30. Let q = 105 + t. Suppose b + 5s = 8583, 34260 = -b + 5b + qs. Is b a composite number? False Let n(q) = q3 + 5q*2 + 9q - 9. Let r = -141 + 134. Let z be n(r). Let y = z - -361. Is y a composite number? False Let s(o) = 33 + 30 + 17 - 1059o - 27. Is s(-4) a composite number? False Suppose 8x - 3x = 500. Suppose -32 = -xq + 96q. Suppose -4722 = -14p + qp. Is p composite? False Let u(r) = -29r*2 + 2r - 34. Let q be u(7). Let h = q + 2430. Is h composite? True Let l(h) = 591h - 4. Let f(r) = r2 - 2r + 2. Let w be f(2). Let u be l(w). Suppose -d + u = 2t, -5t + 2947 = d + 2d. Is t a composite number? False Is ((-27096436)/102)/((-28)/42) a composite number? False Suppose 89f - 5776939 - 19786570 = 15933542. Is f prime? False Suppose 7 - 33 = -2a. Suppose an + 533 = -65. Let x = n + 339. Is x composite? False Let b(g) = 17g - 5. Let k be b(5). Let o = 51 + k. Suppose i - 106 - o = 0. Is i prime? False Let j(l) = 2l*2 - 2l - 7. Let o be j(0). Let y(a) = a + 9. Let s be y(o). Suppose 4*	{ "pile_set_name": "DM Mathematics" }
666z2)(-2z + 0z + 0z)(1 + 1 + 2) to the form sz3 + l + vz*2 + jz and give s. 5328 Express (0 + 3k + 0)(-346k - 449k - 25k) in the form u + ck + yk2 and give c. 0 Rearrange (2836a*3 - 1439a*3 - 1399a*3 - 13356a)(3a + 0a - 2a) to sa2 + ma + ua4 + y + fa*3 and give s. -13356 Express -9p*3 + 27 - 1107p*2 - 28 + 1112p*2 - 5p - p*3 in the form hp*2 + lp*3 + o + yp and give l. -10 Rearrange -7b - 51b*4 + 4b*3 + 52b*4 + 12 - 3b*2 + 10b - 3b3 - 7b to gb4 + hb*2 + m + qb + kb3 and give k. 1 Express -273 - 112 - 2w*2 - 123 - 139 + 3w*2 as h + cw + lw2 and give l. 1 Express (-80778 + 80778 + 449r*2)(r + 7r - 2r - 3r) as q + fr*3 + kr + ar2 and give f. 1347 Rearrange (-1029w - 487w + 588w)((-3 + 2 + 3)(-3 - 2w + 3) + w + 0 + 7w + 0) to the form b + aw + uw*2 and give u. -3712 Express 8231c*2 - 30c + 28c + 10c - 8c in the form dc + u + fc2 and give u. 0 Express 0 + 2f + 0 + 6 - 6 - 4f + (5 - 2 - 4 + (-2 + 5 - 4)(1 + 0 + 1))(3f + 0f + 0f) - 2f + 1 - 1 as n + lf and give l. -13 Express (-48n + 162n - 80n)((-1 - 1 + 4)(1 + 1 + 0) + 16 - 24 + 6) in the form xn + f and give x. 68 Rearrange -2s3 - 375s*2 + 6369718s - 1 - 6369718s to k + js*2 + ys*3 + ms and give j. -375 Express 1 - 1 - 2l + (l - 1 + 1)(0 + 0 - 2) + l + l - l - 758 - 21l + 758 + (30 + 0 + 12)(-2l + l + 0l) as al + u and give u. 0 Express 47 + 47i - 22i2 + 109 - 257 + 107 as di*2 + l + oi and give l. 6 Rearrange -32w3 - 6w*3 - 15w*3 + (-4w*2 + 3w*2 + 0w*2)(0 + 0 + 3w)(-1 + 3 + 1) to bw2 + mw*3 + rw + u and give r. 0 Rearrange -975q - 201601 - 1969q + 201601 to g + mq and give m. -2944 Express -4w*3 - 2w - 20 + 54 + 5w3 + 5w + 23w4 - 22w*4 + 2w*2 in the form o + dw*2 + yw + uw4 + lw*3 and give l. 1 Express -738z*3 - 2z + 25z4 + 1446z*3 - 719z*3 - 5z*4 in the form gz*4 + xz*2 + q + uz + dz3 and give d. -11 Express v2 - 3v*3 + 5v*3 - 2v*2 - 10 + v - 4v*2 + 9 as bv + kv2 + n + hv3 and give k. -5 Rearrange (-3 + u2 + 3)(-2 + 5 + 1)(1502u - 308u + 419u) to mu*3 + du + bu2 + a and give m. 6452 Rearrange 562596c*2 + c + 2 - 562604c*2 + 28c*4 + c - 2c*3 + 13c*4 to the form mc*4 + h + dc*2 + tc + vc3 and give v. -2 Rearrange -2g*4 + 2g - 3432897g2 + 0g*4 + 3g*3 - 2 + 3433167g*2 to bg*2 + v + fg*4 + ug*3 + pg and give v. -2 Rearrange (-9z2 - 53 + 53)(-69 - 16 - 150) to the form n + az + lz*2 and give l. 2115 Rearrange -3u + 1473u2 - 835u*2 + 3 - 741u*2 to lu*2 + j + qu and give q. -3 Rearrange -132 + 22 + 64 + 24i to xi + k and give x. 24 Express 1573m - 70m + 2985m + 94m in the form gm + s and give g. 4582 Rearrange 0d*3 - 1465d*2 + 2968d*2 + 15d*4 + 18d*4 - 1501d2 + 1 + d3 to jd2 + xd + vd3 + ud*4 + o and give o. 1 Express -37n + 5 + 7n - 21290n*2 + 21292n*2 in the form y + rn + in2 and give y. 5 Rearrange (-2z + 9z + z)(-1 - 2z + 1) + (0z + z + 0z)(4z - 6z - z) to the form jz + a + iz*2 and give i. -19 Rearrange -176s*2 - 532s - 2 + 1 + 2 + 341s2 - 163s*2 to m + os*2 + ds and give m. 1 Rearrange -66 + 104 + 3c2 - 50 - 2c*2 + 4c - 6c2 to the form hc + q + ac2 and give h. 4 Rearrange (b + 0b + 2b)(156 - 156 - 10b) - 155 + 155 - 19b*2 to o + tb*2 + zb and give t. -49 Rearrange 1 - 1 + j + (-6 + 2 + 2)(2987 - 7606 + j + 3332) to the form vj + z and give v. -1 Express j - 3023j4 + 6957j*4 - 2589j*4 - 2j*3 in the form pj*4 + i + xj*2 + bj + hj3 and give x. 0 Express 15d + 347d3 + 16d + 6d - 150d*3 - 174d*3 as l + zd*2 + yd*3 + qd and give q. 37 Express (-m - m + 3m)(0 - 1 + 2) + (111m - 69m + 273m)(1 - 5 - 2) + (-5m + 3m + 0m)(4 + 2 - 5) as ym + a and give y. -1891 Rearrange m2 + 37m*3 + 10 - 51m*3 - 10m*3 + (-3m - 62 + 62)(0m*2 - 3m*2 + 4m*2) to sm*2 + i + pm + om3 and give s. 1 Express (-3a + 6a - a)((-2a2 + 5a*2 + 15a*2)(4 - 4 - 6) + 42a - 42a - 2a2)(2 + 2 - 6) in the form b + wa + ca*2 + sa*3 and give s. 440 Express 5x*2 + 36x*2 - 479x*4 - 2x*3 + 1 + 5x + 480x4 - 7x in the form wx + r + bx*4 + dx*3 + mx2 and give r. 1 Express -13407 + 13407 + m2 - 3981m + (-m2 + m2 - m2)(2 + 2 - 2) in the form cm2 + gm + l and give c. -1 Rearrange -3l + 4l + 4l + 149 - 9l + 27 to the form wl + x and give x. 176 Rearrange (16v + 14v + 12v)(-1 + 4 + 1)(-2v2 + 63v*2 + 42v*2) to f + uv + nv3 + jv*2 and give n. 17304 Rearrange -168w - 28w2 + 168w + (-w + 0w + 3w)(622w + 606w - 2480w) to the form bw2 + mw + o and give b. -2532 Rearrange (-63312a2 + 33757a*2 + 36812a*2)(-7 + 2 + 4) to the form ba2 + g + pa and give b. -7257 Rearrange -28 + 976i + 1553i - 10 + 38 to the form y + si and give s. 2529 Rearrange 1472k*4 + 904k + 4607k4 + 180k*4 - 903k + (2k + 0k - 3k)(k*2 + 2k3 - k2) to ck2 + lk + pk3 + f + ok*4 and give l. 1 Rearrange (-7x - 111 + 111)(79x - 40x - 44x) + (-2x + 2x - 3x)(-x - x + 4x) to wx*2 + h + fx and give w. 29 Rearrange -17 - 65j + 8 + 17 + 15 to cj + o and give o. 23 Rearrange 460y4 + 10321 - 10321 + (6y*4 - 3y*2 + 3y*2)(0 + 4 - 3) to the form ty + p + fy*3 + sy*2 + hy*4 and give h. 466 Express 436z - 857z + 421z + 781z2 in the form tz + f + iz2 and give i. 781 Express (285 + 277 - 561 - 48o)(3 + 1 + 2) in the form g + mo and give m. -288 Rearrange 1484234m3 - 47m*2 - 1484235m*3 - 544m*2 + 307m*2 - 632m*2 to the form tm*2 + wm + u + pm3 and give p. -1 Express 2a*3 - 27193a + 27197a - a4 + 3a*2 + 6 - 4 in the form la + g + ha4 + ma*3 + wa*2 and give w. 3 Rearrange -34 + 1 + 2h*2 + 3h + 62h3 - 28 + 59 to the form th*2 + oh + xh3 + j and give x. 62 Express (13423y + 25655y - 14046y + 18648y)(-5y + 4y + 0y) in the form uy + hy2 + b and give b. 0 Rearrange -6t - t + 3t + (2 - 2 + 1)(t - t - t) + 4t + 0 + 0 + 4t - 44t + 30 - 34 to the form i + jt and give i. -4 Express 2049m3 + 62m*2 - 61m*2 - 2052m*3 - 5m - m*4 as zm*2 + g + lm*3 + im*4 + rm and give z. 1 Rearrange (-28x + 16x - 18x)(2 - 17 + 8) + (-2 - 1 + 1)(4 - 4 - 2x) to the form tx + h and give t. 214 Express 2j*2 - 164639j + 164640j + 4j*4 - 12 - 2j*3 - 5j*2 + 2j*2 as lj*4 + w + rj*3 + nj*2 + kj and give n. -1 Rearrange (-199 + 327 + 490)(4i - 2i - 3i + (5 - 2 - 1)(-i - 1 + 1) - 2i - 1 + 1) to the form x + fi and give f. -3090 Express 17u - 43158392u3 - 47 + 49u + 43158390u3 - 2u*2 as fu*3 + ou*2 + zu + k and give o. -2 Express 62 + 326q - 3 - 67 as d + uq and give d. -8 Rearrange 9432801 - 9432801 - 2613v to the form yv + h and give y. -2613 Express (3m + 0 + 0 + (-m - 3 + 3)(-1 - 1 - 1))(-259 - 158 + 123) as gm + c and give c. 0 Rearrange -132v3 + 3v + 379v3 - 123v*3 - 125v*3 + 200 to a + yv*3 + sv + jv2 and give s. 3 Rearrange 1770c + 13923c + 881c + 5218c - 2060c to oc + x and give o. 19732 Rearrange (-178x - 350x - 255x)(-9 - 1 - 1 + 20 + 21) to the form k + dx and give d. -23490 Rearrange (3 - 2 + 0)(-208 - 104 - 397)(-b + 2b - 5b) to f + kb and give k. 2836 Rearrange (-2k + 4k + 0k)(23 - 31k - 23 + (5 - 2 + 0)(-k - 5k + 5k) - 74k + 168k - 95k + 151) to the form wk + o + nk*2 and give w. 302 Express -3p + p*3 + 3p + (0p2 + 3p2 + p2)(-2p + p + 2p) - 28p*3 + 11p*3 + 16p*3 - 461p in the form np3 + f + mp + sp2 and give m. -461 Express ((-1 + 5 - 2)(-3 + 0 + 4) + 7 + 12 - 2 - 110 + 226 - 105)(-j + j - 2j*2)(-j - j + j)(-1 - 10 + 2) as o + xj*3 + vj + bj2 and give x. -540 Express 3f + 211f2 - 115 - 107f*2 + 286 - 102f*2 in the form jf + uf2 + l and give j. 3 Express 108 - 5x + x*4 - 2x*3 + 4x*4 - 2x*2 + x - 12x*4 + 2x as n + ux2 + ax*4 + lx*3 + ix and give i. -2 Express 6m4 + 3m*3 - 89 + 89 + 78m + 3m2 - 77m as im2 + s + um + zm3 + hm**4 and give i. 3	{ "pile_set_name": "DM Mathematics" }
1184? 1 What is the hundred thousands digit of 436789275? 7 What is the hundred thousands digit of 1930823898? 8 What is the hundred thousands digit of 546901202? 9 What is the hundreds digit of 392979372? 3 What is the ten millions digit of 25689816? 2 What is the hundreds digit of 3871573042? 0 What is the thousands digit of 245069874? 9 What is the hundred thousands digit of 208889488? 8 What is the hundred millions digit of 662219080? 6 What is the hundred thousands digit of 518303563? 3 What is the hundreds digit of 6339403191? 1 What is the ten millions digit of 2606988084? 0 What is the units digit of 86325563? 3 What is the tens digit of 4024772924? 2 What is the tens digit of 43942631? 3 What is the hundred thousands digit of 2183137310? 1 What is the hundred thousands digit of 219395513? 3 What is the ten millions digit of 60111675? 6 What is the hundred millions digit of 396066801? 3 What is the units digit of 3024496687? 7 What is the millions digit of 1096461402? 6 What is the ten thousands digit of 2447094060? 9 What is the ten millions digit of 68528133? 6 What is the millions digit of 42923007? 2 What is the millions digit of 536958894? 6 What is the hundreds digit of 1357121304? 3 What is the millions digit of 61638079? 1 What is the hundreds digit of 413443449? 4 What is the tens digit of 2746566300? 0 What is the units digit of 46454544? 4 What is the hundred thousands digit of 4373370589? 3 What is the tens digit of 262743764? 6 What is the units digit of 75835125? 5 What is the hundred thousands digit of 112153152? 1 What is the hundreds digit of 1265143872? 8 What is the units digit of 2571453037? 7 What is the thousands digit of 112487451? 7 What is the hundred millions digit of 166905275? 1 What is the ten millions digit of 751657324? 5 What is the units digit of 24964313? 3 What is the ten thousands digit of 3281942509? 4 What is the units digit of 254021458? 8 What is the millions digit of 754954803? 4 What is the ten thousands digit of 5558435485? 3 What is the hundred millions digit of 677379994? 6 What is the hundreds digit of 64697576? 5 What is the hundred thousands digit of 305336959? 3 What is the ten millions digit of 675804671? 7 What is the tens digit of 32340666? 6 What is the units digit of 3391982760? 0 What is the hundred millions digit of 287200311? 2 What is the millions digit of 8221646? 8 What is the ten millions digit of 50258961? 5 What is the billions digit of 3932837296? 3 What is the units digit of 224485124? 4 What is the hundreds digit of 927674075? 0 What is the hundred thousands digit of 9036388? 0 What is the hundred millions digit of 112712895? 1 What is the hundred thousands digit of 112905993? 9 What is the tens digit of 522610966? 6 What is the millions digit of 249941198? 9 What is the hundreds digit of 345829984? 9 What is the ten thousands digit of 2546372658? 7 What is the ten millions digit of 2651281530? 5 What is the tens digit of 690821724? 2 What is the units digit of 89885696? 6 What is the ten thousands digit of 331662718? 6 What is the hundred thousands digit of 64972733? 9 What is the thousands digit of 99055646? 5 What is the hundred millions digit of 415473835? 4 What is the units digit of 54590399? 9 What is the tens digit of 23121829? 2 What is the ten millions digit of 49759463? 4 What is the ten millions digit of 309728023? 0 What is the tens digit of 5745989254? 5 What is the units digit of 38367572? 2 What is the millions digit of 63996065? 3 What is the hundreds digit of 56191968? 9 What is the hundred thousands digit of 451573470? 5 What is the ten millions digit of 73007206? 7 What is the hundreds digit of 67287986? 9 What is the units digit of 2127815236? 6 What is the hundred thousands digit of 820279249? 2 What is the hundred millions digit of 118784120? 1 What is the millions digit of 94706444? 4 What is the tens digit of 30722007? 0 What is the ten millions digit of 917018427? 1 What is the ten millions digit of 73929842? 7 What is the ten millions digit of 393907505? 9 What is the ten millions digit of 103105021? 0 What is the tens digit of 1887116392? 9 What is the ten thousands digit of 549679664? 7 What is the hundred thousands digit of 1509033051? 0 What is the ten thousands digit of 189464812? 6 What is the hundred millions digit of 389842144? 3 What is the hundred millions digit of 340683205? 3 What is the ten millions digit of 1124375205? 2 What is the units digit of 85312579? 9 What is the thousands digit of 2644094625? 4 What is the hundreds digit of 61682525? 5 What is the tens digit of 54044080? 8 What is the ten millions digit of 49174054? 4 What is the thousands digit of 240853257? 3 What is the millions digit of 80025547? 0 What is the tens digit of 111107043? 4 What is the ten thousands digit of 90360500? 6 What is the thousands digit of 51131050? 1 What is the thousands digit of 189955732? 5 What is the thousands digit of 23680657? 0 What is the millions digit of 90240414? 0 What is the hundred thousands digit of 64620161? 6 What is the hundred millions digit of 4675956298? 6 What is the tens digit of 216235755? 5 What is the hundred millions digit of 3765548410? 7 What is the ten millions digit of 7631743313? 3 What is the ten thousands digit of 375818022? 1 What is the millions digit of 177204828? 7 What is the hundred thousands digit of 30979848? 9 What is the ten millions digit of 43032638? 4 What is the hundreds digit of 14091718? 7 What is the billions digit of 4224568313? 4 What is the millions digit of 18266792? 8 What is the ten thousands digit of 52243510? 4 What is the ten thousands digit of 1952492858? 9 What is the hundreds digit of 342553754? 7 What is the hundred millions digit of 179605881? 1 What is the units digit of 1094143844? 4 What is the tens digit of 5223447228? 2 What is the tens digit of 508158305? 0 What is the units digit of 246523409? 9 What is the thousands digit of 3627684816? 4 What is the hundred thousands digit of 33740963? 7 What is the thousands digit of 49801399? 1 What is the billions digit of 1122024924? 1 What is the billions digit of 2095823663? 2 What is the millions digit of 88371233? 8 What is the hundreds digit of 770898091? 0 What is the ten millions digit of 243921491? 4 What is the ten millions digit of 113405909? 1 What is the thousands digit of 37395648? 5 What is the millions digit of 44713347? 4 What is the hundred millions digit of 649244434? 6 What is the tens digit of 19036019? 1 What is the hundred thousands digit of 74566714? 5 What is the ten millions digit of 21125320? 2 What is the ten millions digit of 5086569660? 8 What is the hundred thousands digit of 240868338? 8 What is the units digit of 256637381? 1 What is the billions digit of 2361596660? 2 What is the thousands digit of 35557028? 7 What is the ten millions digit of 55905071? 5 What is the hundreds digit of 25630500? 5 What is the millions digit of 644173713? 4 What is the hundred thousands digit of 74185913? 1 What is the hundreds digit of 298087674? 6 What is the units digit of 8459765? 5 What is the ten millions digit of 72484462? 7 What is the hundred millions digit of 165666763? 1 What is the hundred millions digit of 120078768? 1 What is the ten millions digit of 1017002411? 1 What is the millions digit of 130293861? 0 What is the hundred thousands digit of 6156544619? 5 What is the tens digit of 38423431? 3 What is the hundreds digit of 36988530? 5 What is the units digit of 3436394306? 6 What is the millions digit of 31686744? 1 What is the ten millions digit of 118916714? 1 What is the hundred thousands digit of 17882922? 8 What is the millions digit of 5361293? 5 What is the tens digit of 9583735? 3 What is the tens digit of 3455067282? 8 What is the units digit of 534857600? 0 What is the hundreds digit of 368192631? 6 What is the ten thousands digit of 395978284? 7 What is the ten millions digit of 27361847? 2 What is the hundreds digit of 57848636? 6 What is the millions digit of 483717098? 3 What is the units digit of 148752295? 5 What is the thousands digit of 1882415974? 5 What is the ten millions digit of 14355850? 1 What is the ten millions digit of 3219536230? 1 What is the ten millions digit of 259	{ "pile_set_name": "DM Mathematics" }
a5 - 4a*2 - 2/5a*3. Let d(u) = 0. What is u? -4, -3 Let r = 591/11 + -161/3. Let u(j) be the second derivative of rj*3 + 0 + 15j - 1/66j4 + 3/11j*2. Find b such that u(b) = 0. -1, 3 Suppose 18172 = 15v - 43v. Let y = -647 - v. Suppose 2/3k*y + 2/3 + 4/3k = 0. Calculate k. -1 Let i(l) = -40l2 - 5460l - 5370. Let d(f) = 5f2 + 682f + 671. Let o(c) = -25d(c) - 3i(c). Factor o(v). -5(v + 1)(v + 133) Let p(z) be the first derivative of -3z5/5 - 501z*4 + 2023. Determine w so that p(w) = 0. -668, 0 Let s be 0 - (-2 + -1 + 1). Factor 14 - 13a + 23 - 7 + 3as + 46a. 3(a + 1)(a + 10) Let h(i) be the first derivative of -i8/4032 + i7/2520 + i*6/720 - 3i*2/2 + 10i - 4. Let o(v) be the second derivative of h(v). Factor o(p). -p*3(p - 2)(p + 1)/12 Let z = 1975289 + -1104185673/559. Let y = z - 8/43. Factor 12/13d*2 + 8/13 - 2/13d*3 - yd. -2(d - 4)(d - 1)*2/13 Let q(y) be the third derivative of -2y*7/105 + 11y*6/15 - 97y*5/15 - 44y*4 - 96y*3 - 1148y*2. Factor q(u). -4(u - 12)*2(u + 1)*2 Let z(v) = 202v*2 + 68v + 253. Let o(a) = -55a2 - 17a - 63. Let i(f) = -22o(f) - 6z(f). Let i(w) = 0. What is w? -11, -6 Suppose -90 = 40m - 43m. Suppose 3l - 13l + m = 0. Factor 2p4 - 166p*3 + lp*4 + 151p*3 - 20p*2. 5p*2(p - 4)(p + 1) Let h be -25 + 39 - (-48 - -59). Let i be (-1)/(-4) + (-3)/12. Factor 0f - 2/9f2 - 1/9fh + i. -f2(f + 2)/9 Let g(t) be the first derivative of 4t*5/35 - 185t*4/7 - 1772t*3/7 - 5742t*2/7 - 6912t/7 + 7752. Find q such that g(q) = 0. -3, -1, 192 Let b be (-4)/15(-1587)/4232. Factor 1 + bs*2 + 11/10s. (s + 1)(s + 10)/10 Let b(t) be the first derivative of -t4 - 108t*3 - 3198t*2 + 6724t + 972. Factor b(q). -4(q - 1)(q + 41)*2 Determine o, given that 26877o*2 - 42o - o*3 + 26887o*2 - 53721o2 = 0. 0, 1, 42 Let m(k) be the second derivative of k7/27 - 131k6/135 + 361k*5/90 + 1339k*4/54 + 1036k*3/27 + 196k*2/9 - 1797k + 4. Let m(i) = 0. What is i? -1, -2/7, 7, 14 Let f(r) be the first derivative of -r*6/6 - 3r*5/5 + 22r4 + 1770. Factor f(h). -h3(h - 8)(h + 11) Let o be (-67 + (-1541)/(-23))/(-1 + 3). Let -i*4 - 1/3i*5 + 0 + 0i + oi2 + 4/3i*3 = 0. Calculate i. -4, 0, 1 Let g = -52 + 149. Factor -gm*5 - 440m*2 + 242m - 92m3 + 248m*3 + 40m*4 + 99m*5. 2m(m - 1)2(m + 11)*2 Let j(y) be the first derivative of -4y*3/3 + 221y*2/2 - 55y - 3415. Factor j(s). -(s - 55)(4s - 1) Let a = 430 - 294. Let -j*3 - a - 76j + 18j2 + 3j*3 + 182j*2 + 10j*3 = 0. What is j? -17, -2/3, 1 Let u = -22 - -34. Let h(c) = 8c*2 + uc + 1 - 1 - 14c2. Let t(g) = 6g*2 - 13g - 1. Let l(y) = 4h(y) + 3t(y). Factor l(b). -3(b - 1)(2b - 1) Solve -y3 - 1/3y*4 + 22 + 25y*2 - 137/3y = 0. -11, 1, 6 Suppose 42 = 5i - 6b + 14b - 6b, 0 = 5b - 80. Solve 0y + 1/5y3 - iy*2 + 0 = 0 for y. 0, 10 Let o be -47 + 14 - (-11 - 24). Factor 15/2 + 1/2a*3 - 7/2a*o + 7/2a. (a - 5)(a - 3)(a + 1)/2 Let i be -1(-6)/(5 - 3). Let c = -50628/5 - -10126. Factor -2/5v - 2/5 + 2/5v2 + cv*i. 2(v - 1)(v + 1)2/5 Let c(z) be the second derivative of 1/4z*4 + 65z + 1/4z5 + 1/30z*6 + 0 - 3/2z*3 + 0z*2. Factor c(l). l(l - 1)(l + 3)2 Let b(k) be the third derivative of -1/180k*5 - 7/9k*4 + 0k - 55/18k3 + 2k*2 + 71. Factor b(x). -(x + 1)(x + 55)/3 Let f be 272/78 - 282/1833. Let d(p) be the second derivative of -fp3 - 14p - 31/12p4 - 2p*2 - 3/4p*5 + 0. Factor d(q). -(q + 1)(3q + 2)(5q + 2) Suppose -21/4p + 21/4p3 - 1/4p*4 + 1/4p*2 + 0 = 0. Calculate p. -1, 0, 1, 21 Let j(w) be the second derivative of 297/20w*5 + 0w*2 - 121/4w*4 + 0w*3 + 21/10w*6 + 0 + 32w + 1/14w7. Solve j(z) = 0. -11, 0, 1 Factor 0 + 162/7j + 60/7j2 + 2/7j*3. 2j(j + 3)(j + 27)/7 Suppose -463 - 489 = 4899g - 5375g. Determine n, given that 4/17n4 + 0 + 2/17n*5 - 40/17n*g - 38/17n*3 + 0n = 0. -5, -1, 0, 4 Let c(a) = -52a2 + 4260a + 4408. Let s(g) = 8g2 - 655g - 678. Let p(i) = -5c(i) - 32s(i). Solve p(y) = 0 for y. -1, 86 Let b(g) be the third derivative of g*8/560 + 3g7/350 - g5/25 - 6243g2. Let b(a) = 0. What is a? -2, 0, 1 Let h(l) be the third derivative of l8/1176 - 4l*7/735 - 8l*6/35 + 6l*2 + 30l - 1. Find b such that h(b) = 0. -8, 0, 12 Let h(w) be the first derivative of -2w3/27 + 4w*2/9 + 280w/9 - 408. Determine a, given that h(a) = 0. -10, 14 Find g such that g + 1/2g5 + 0 + 5/2g*4 + 9/2g*3 + 7/2g*2 = 0. -2, -1, 0 Let a(x) be the first derivative of 10x - 15/2x2 + 149 - 5/16x*4 + 5/2x*3. Factor a(k). -5(k - 2)*3/4 Let z(t) = 665t - 3982. Let o be z(6). Let w(y) be the first derivative of oy + 7 + 2/3y*3 + 5y*2. Let w(u) = 0. Calculate u. -4, -1 Let y(x) = 6x*4 + 13x*3 - 153x*2 + 238x - 129. Let i(q) = 7q4 + 14q*3 - 156q*2 + 236q - 131. Let j(t) = -5i(t) + 6y(t). Factor j(s). (s - 7)(s - 1)2(s + 17) Let j(a) be the first derivative of -13/10a4 + 0a - 2/25a5 - 34 + 2/15a*3 + 13/5a*2. Determine s so that j(s) = 0. -13, -1, 0, 1 Let v = -701 - -704. Let a(j) be the first derivative of -5 + vj*2 + 2/3j*3 + 4j. Suppose a(q) = 0. What is q? -2, -1 Let p(b) = b*5 - 7b*4 - 3b*3 + 9b2 - b. Let o(z) = z4 - z*2 + z. Suppose 4n + 2 = 6, -3 = -2t - n. Let d(r) = tp(r) + 5o(r). Factor d(x). x(x - 2)*2(x + 1)*2 Determine z, given that 2/13z*2 - 1166/13z - 1168/13 = 0. -1, 584 Let b(a) be the second derivative of a4/12 + a3/3 + 17a. Let w(h) = 2h3 + h2 - 12h - 12. Let i(p) = 2b(p) + w(p). Find l, given that i(l) = 0. -2, -3/2, 2 Factor 151023n3 - 4039n + 36608 + 6672n2 - 4n*4 - 151547n*3 + 2796n - 25957n. -4(n - 4)*3(n + 143) Let f(n) be the third derivative of -n*6/240 - 83n*5/120 + 872n2. What is g in f(g) = 0? -83, 0 Let b(x) be the second derivative of -x5/80 - 7x4/4 - 27x*3/2 - 40x*2 + 692x. Suppose b(s) = 0. What is s? -80, -2 Factor 85849/4 + 1/4j2 + 293/2j. (j + 293)*2/4 Factor 1611 - 1065/2l - 3/2l2. -3(l - 3)(l + 358)/2 Let m = 1898057/6 + -316340. Find c such that 21/2c*2 + 0 - 27/2c + mc3 + 1/6c*4 = 0. -9, 0, 1 Let p be 39/11 + 96/(-176). Let k be (p - 2)/((-143)/(-26)). Factor -kl - 2/11l4 - 2/11l*5 + 4/11l*3 + 4/11l*2 - 2/11. -2(l - 1)*2(l + 1)*3/11 Let f = -3662 + 3662. Let c(o) be the second derivative of 0o*2 - 1/30o*6 + f + 6o - 1/4o4 + 1/6o*3 + 3/20o*5. Factor c(w). -w(w - 1)*3 Let u(a) be the first derivative of -5a*4 - 215a*3/3 - 305a*2/2 + 90a + 790. Solve u(o) = 0. -9, -2, 1/4 Let c(b) = -11b3 - 106b*2 + 208b + 4. Let y(x) = 42x3 + 423x*2 - 834x - 15. Let r(j) = 15c(j) + 4y(j). Factor r(v). 3v(v - 2)(v + 36) Let t be (-3 - (-124)/40)/((-836)/(-1045)). Determine j so that 5/4 + tj*3 - 7/8j - 1/2j2 = 0. -2, 1, 5 Solve -36/5n*2 - 122/5n + 2/5n3 - 84/5 = 0 for n. -2, -1, 21 Solve 1/4l*3 + 9/2l*2 - 21 + 65/4l = 0 for l. -12, -7, 1 Let y(z) be the first derivative of -64z + 4z*4 - 8/3z*6 - 132/5z*5 + 364/3z*3 - 84z*2 - 61. Suppose y(v) = 0. Calculate v. -8, -2, -1/4, 1 Factor 3h*2 + 180 - 90h + 110h + 37h. 3(h + 4)(h + 15) Let q(o) = -3o2 + 0o*2 + 1486o - 1465o + 21o*2 + 12o*3 + 5. Let z(u) = 38u*3 + 54u*2 + 64u + 16. Let v(h) = -16q(h) + 5z(h). Factor v(p). -2p(p + 1)(p + 8) Let o(m) be the second derivative of m6/90 + m5/4 + 3m*4/2 + 20m*3/9 + 424m. Factor o(p). p(p + 1)(p + 4)(p + 10)/3 Let k(i) be the third derivative of i6/300 + 397i*5/150 - 3429i*2 - i. Factor k(a). 2a*2(a + 397)/5 Factor -68o2 + 141o - 57o2 - o3 + 50o*2 - 237 + 172o + 0. -(o - 3)(o - 1)(o + 79) Let g = -219468/17 + 12910. Let r(w) be the first derivative of 1/34w4 - gw - 1/17w2 + 2/51w*3 - 13. Suppose r(j) = 0. What is j? -1, 1 Determine x, given that -526/9x - 32/9 + 11/3x2 = 0. -2/33, 16 Suppose 0 = -8a + 12a - 4i, 4a + i = 15. Let d(q) be the first derivative of -4/3q + 1/3q4 + 20 + 2/3qa - q2. Let d(o) = 0. What is o? -2, -1/2, 1 Suppose 0 = -4v - 4r - 288, 2v + 2v = 2*r - 258.	{ "pile_set_name": "DM Mathematics" }
+ 8h - 8h + 2h2 + 2h*2 + h - h + 3h*2 - 3h*2 - 4h*2 + 2h*2 + 4h - 4h. h2 Expand (77o + 62o - 163o)(o3 - 3o*3 + 3o*3)(0 + 0 + 2). -48o4 Expand (6h + 0h - 3h)(2 - 2 - 2) + 2h - 2h + h + 3h + 3h - 5h. -4h Expand (f3 - 2f*2 + 2f*2)(0 + 2 - 1)(58f - 6f - f). 51f*4 Expand 9 + 5a*5 - 9 + (97 + 12a - 97)(-2a*4 - 2a4 + a4). -31a5 Expand (-3l*2 + 2l2 - l2)(-5117l + 2811l + 3223l). -1834l3 Expand (-x - 3x + x)(87 + 157 - 173) - 2x - 7 + 4x + 5. -211x - 2 Expand (-2r4 + 5r4 - r4)((6 - 2 - 2)(2 + 1 - 2) - 18 - 1 - 5). -44r4 Expand (-2d + 0d + 4d)(-3d + d + 3d) + (-d - 2d + 4d)(-2d - 8d - 6d). -14d*2 Expand (0s + s + 0s)(-s*4 - 4s*4 + 4s*4) - 6s*4 - 8s*5 + 6s*4 - 3s*2 + 33s*3 - 2s*5 - 92s*4 + 92s*4. -11s*5 + 33s*3 - 3s*2 Expand 5d - d + 10d + (4 - 1 - 4)(1 - 1 - d) + d + 2 - 2 - d + 4d - 4d + 3d + 3d - 4d + d - 2d - 8d. 8d Expand (-2w + 5w + w)(2w - w + w)(4 - 4 - w3)(-13 - 17 + 1). 232w5 Expand (0d - 5d + 3d + (5d + 0d - 3d)(-1 - 2 + 1) + 2d + 3 - 3)(49d - 99 + 99). -196d*2 Expand (8 - 8 - 3w*2)(2 + 1 + 4 - 6). -3w2 Expand 8s*4 - 18s*2 + 18s*2 + (-5 + 3 + 3)(0s4 + s4 - 2s*4) + 3s*4 + 3s*4 - 4s4 + (s2 + s3 - s2)(-s - 2s + 2s). 8s*4 Expand (11 - 17 + 20)(-1 + 0 + 3)(22d*3 + 6d*4 - 22d*3). 168d*4 Expand (3x - 7x + 6x + 1)(6 - 37 - 5). -72x - 36 Expand (7k5 + 25k*5 - 15k*5)(16 - 7 + 21). 510k5 Expand (-3 + 3 + c)(-c + 2c + 0c) - c2 + c2 + 3c2 + (-3c - 3 + 3)(-5c + 5c + c). c2 Expand (-2 + 4 + 0)(0 + 6 - 9)(-19 + 39 - 2z + 4z). -12z - 120 Expand 2r5 - 2r5 - r5 + (2 - 2 + r*4)(-2r - 3r + 4r) + 5r*5 + 0r*5 - 3r*5 + (-3r*4 + 0r4 - r4)(-15r + r - 5r). 76r*5 Expand (-373 + 188 + 6t + 186)(2 + 1 - 6 - 2 + 1 + 3 + (-3 + 0 + 4)(-4 - 1 + 3)). -18t - 3 Expand -t - t5 + t + 0t*3 + 0t*3 - 5t*5 + (4t*2 - 2t*2 - 4t*2)(4 - 4 - t*3) + 5t*5 - 2t - 6 + 0t + 3 + 4t*5 - 2t*5 + 3t*5. 6t*5 - 2t - 3 Expand -161 + 161 - 31d + (2 + 1 - 5)(-4d - 4d - 2d) - 3 - 2d + 3. -13d Expand (2i*3 + 3i*4 - 2i*3)(-i - 2i + 4i) + 0i5 - 2i5 + i5 + (0i3 + 3i3 - i3)(31i*2 - 51i*2 - 18i*2). -74i5 Expand (-2 + 2 + w3 + 3w3 - 3w*3 + 2w*3 + (4w - 3w + w)(-2w2 + 3w - 3w) + 6w*3 + 9w*3 + 15w*3)(8 + 2 + 2). 348w3 Expand -o2 - 2o3 + o2 + (-3o + o2 + 3o)(1 - 1 + o) + 2o*3 + 2o*3 - 6o*3 - 33o + 33o + 8o3 + (-o2 + 2o - 2o)(3o - 5 + 5). 2o3 Expand 3z + 0z - 2z + (0 + 0 + 2)(-z - 1 + 1) + 59z + 35z + 13z - 22z. 84z Expand (b*2 + 4b*2 - 3b*2)(-3b2 - 5b*2 + 0b*2 + (0 - 7 + 0)(2b2 - 12 + 12)). -44b*4 Expand (2 + 5 + 14)(6j - 4j + 0j)(2 + 2j - 2). 84j*2 Expand ((5 - 2 - 1)(0 - 1 + 3) + 3 + 3 - 1)(2 - 2l*3 - 2)(-23 - 3 - 13). 702l3 Expand (j + 3j - 3j)(245 + 163 - 104). 304j Expand 126v*2 - 148v*2 - 2 + 1 + (2v*2 - v + v)(-4 + 0 + 2) + 5v2 - v2 + v2 + (5v - 3v + 0v)(-v - 4 + 4). -23v*2 - 1 Expand (-x + 5x + 0x)((-2x2 + x - x)(16 + 19 + 0) - 3x2 + 3x*2 + 2x*2). -272x*3 Expand ((-2 + 3 - 3)(4n3 - 2n*3 + 0n*3) + 3n*3 + 5n*3 - 5n*3 - 210n*3 - 86n*3 + 29n*3)(-4 + 2 + 1)(1 - 1 - 2). -536n*3 Expand 1 - v - 1 + (-450 + 450 - 172v)(3 - 3 + 1) - 2v + 1 - 1. -175v Expand (15r - 15r - 17r*3)(-11r2 - 7r*2 + 23r*2). -85r*5 Expand 76 + 8l*2 - 76 - 5l*2 - 14 + 14 + 2l*2 + 0l2 - l2 + (5 - l*2 - 5)(3 - 4 - 1) - 4l2 + 0l*2 + 5l*2 - l + 2l + 4l2 - 3l*2. 8l*2 + l Expand (-236 + 106 + 118)(2y - 3y + 5y). -48y Expand (-1 + 1 - 2)(-18 + 13 + 21)(z + 1 - 1). -32z Expand (3z - 2z - 2z)(3z*3 + 0z*3 - 2z*3) + 3z4 - z4 - 4z4 + z4 + 3z - 53 + 3z3 + 14423z*2 - 14423z*2. -2z*4 + 3z*3 + 3z - 53 Expand (22 + 2s - s - 29)((2 - 4 + 1)(1 - 2 - 1) + (1 - 3 + 4)(-5 + 7 + 8)). 22s - 154 Expand (-2970m + 2970m + 46m*2)((-1 - 3 + 2)(3 + 1 - 5) + 0 + 1 - 2 - 4 - 1 + 2). -92m*2 Expand (-2 + 1 + 2)(3 - 1 - 4)(f - f - f)(-3f2 - f - 16f - 8f). -6f*3 - 50f*2 Expand (-400k*2 - 992k + 992k)(0k + 6k - 3 - 8k). 800k*3 + 1200k*2 Expand (-9 + 0 + 4)(-5 + 5 + t*3) - 7t*3 - 5 + 5. -12t*3 Expand (-23640 + 23640 + 404h)(0 - 2h*3 + 0). -808h*4 Expand -23d*4 - 185d*5 + 366d*5 - 180d*5 + (-4 + 4 + 2d*3)(-d2 - d + d). -d5 - 23d4 Expand (3 + 4 - 5)(-3 + 0 + 2)(2j3 + j4 - 2j3)(64 + 16 + 1). -162j4 Expand -7w*3 + 3w*4 + 7w*3 + (1 + w - 1)(-21w3 + 20 - 20). -18w*4 Expand (-u - 1 + 1 + (2 - 1 - 2)(5 - 5 + 47u))(u + 3u + 0u). -192u2 Expand (-2b + b + 3b)(1 - 2 - 4)(23 + 5b - 5b + 4b). -40b2 - 230b Expand -33l + 0l*3 + 34l - 5l3 - 7l + 2l3 + 7l + (3l + 2l*3 - 3l)(-3 + 4 - 3). -7l3 + l Expand (v2 + 4v2 - 3v*2)(2v2 - v + v + (4v - v - 2v)(2v + 4v - 5v) - 3 + 3 - 2v*2 + 5v*2 - 433 + 433)(-v + 2v - 2v). -12v5 Expand (-3v*2 + 3 - 3)(4v - 4v - 2v). 6v*3 Expand (3p4 - p4 - 4p4)(-3p + p + 0p) - 183p4 + 183p*4 + 51p*5 - 3p5 + p5 + 3p5. 56p*5 Expand (-27 + 27 - 6p)(-268p*2 + 10 + 0 + 271p*2). -18p*3 - 60p Expand -28 + 45 + n2 - 25 + n2 + 0 + 0 + (4n2 - n2 - 2n*2)(-1 + 2 + 1) + 2n2 + n2 - 5n*2. 2n2 - 8 Expand i2 + 4i2 - 3i*2 + (139 + 8i - 139)(2i - 4i + 0i). -14i2 Expand (11 - 23 - 2)(0 + 1 - 2 + (-2 + 0 - 1)(2 - 1 - 2))(u + 3u - 2u) - 4u + 6u - 3u. -57u Expand (-1 + 2d + 1)(5 - 2 - 5)(3 + 2 - 2)(-3d2 + 3d - 3d). 36d*3 Expand (2i - 1 + 1)(-i + i + 3i) - 105i2 + 32i*2 - 45i*2. -112i*2 Expand (0i + 2i + 0i)(-266i - 43 + 22 + 21). -532i2 Expand (0p*4 - 3p4 + p4)(-1 - 2 + 1) + 504p*2 - 1007p2 + p3 + 307p4 + 505p*2. 311p4 + p3 + 2p2 Expand 2 - 2 + 2y + (6y + 0y - 3y + (-y + 3y - 3y)(2 - 1 - 2))(-3 + 1 - 4). -22y Expand (2 + 0 - 4)(-2 - 1 + 1)(3i - 3i - 3i)(-7i + 5 - 5). 84i*2 Expand -1342h + 2144h - 1155h - 5h + 3h + 3h + (-3 - 3 + 4)(-h - h + 0h) + 0h + 0h - h - h - 2 + 2 + 0h - h - h. -352h Expand (2 + 3 - 3)(3l + 0l - 4l) - 20l + 33 - 29l + 47l. -4l + 33 Expand ((-2w*2 - 3w + 3w)(2 + w*3 - 2) - 2w*5 - 3w*5 + 4w*5 + 2123w*4 + 7w*5 - 2115w4 - w2 - w*2)(-2 + 2 + 2). 8w5 + 16w*4 - 4w*2 Expand (-2z - 3z + 3z)(3 - 1 - 3 + 1 + 0 + 1 + (-2 + 2 - 2)(-1 - 3 + 2) - 1 + 1 - 2 + 2 - 1 - 3). -2z Expand (0 + 4 - 6 + d)(-5 + 6 + 8). 9d - 18 Expand (2x - 2x - x4)(0x - 2x - x) - 9732x4 - 15x*5 + 9732x*4. -12x*5 Expand (-30z*2 - 683z*2 - 339z*2 + 215z*2)(-2z + 3z + z). -1674z3 Expand (-63 - 16 + 7)(0 + 0 + x + (-3 + 2 - 1)(2x - 3x + 0x) + 2 - x - 2 - 3x + 3x + 2x - 2x - x + 2x). -216x Expand (-5l3 + 2l*3 + 4l*3)(-1 + 1 + 2l)(-9 + 15 + 10). 32l4 Expand (8 - 1 - 2)(4 - 7 + 1)(19w - 2w + 2w)(-w - 3w + 3w). 190w*2 Expand (-711r + 589r3 - 294r*3 - 293r*3)(-1 - r*2 + 1). -2r*5 + 711r3 Expand -f5 - f + f + (-2f3 - 3f*5 + 2f*3)((0 + 3 - 2)(5 - 2 + 3) - 4 + 0 + 2 - 2 + 0 + 0). -7f*5 Expand (-4 + 5 - 3)(-246n3 - 364n*3 - 3n + 520n3). 180n*3 + 6n Expand (-4 + 4 - 1)(3y + 2y - 3y + (2 - 3 + 11)(0y - 4y + 3y))(-1 + 5 - 3) - 6y + 0y + 2y. 4y Expand 2l + 0l - l + (2 - 4 + 0)(-6l + 11l - 6l) - 3l + l - 2l. -l Expand (-2g + 3g - 5g)((2 - 5 + 1)(4 + 2g - 4) - 71 + 10 - 5368g + 5365g). 28g*2 + 244g Expand (15l3 + 10l*2 - 10l*2)(-4 + 4 + 5). 75l3 Expand -14u*3 - 12u*3 - 5u*3 + (4u*2 - 6u2 + u2)(u + u + 0u) + 7u3 + u3 - 3u*3. -28u*3 Expand (2q*2 - 1 + 1)(-1 - 2q + 1) + q + 13q*3 + 2q*2 + q - 38q*3. -29q*3 + 2q*2 + 2q Expand (306y2 - 25495 + 25495)((-2 + 2 - 1)(-3 + 1 + 4) + 4 + 3 - 6). -306y*2 Expand ((1 - 4 + 1)(-3 + y + 3) - y + 4y - 2y - 2 + 2 + 2y - 7y + y + 2y)(-383y2 + 26y + 383y2 + 2y*4). -6y*5 - 78y*2 Expand (-49c - 2c + 138c	{ "pile_set_name": "DM Mathematics" }
688.5849706 to the nearest 10. 690 What is 0.00013739913 rounded to 7 decimal places? 0.0001374 Round -27220.7397 to 0 decimal places. -27221 Round 2150.5742 to the nearest 1000. 2000 What is -4392.347 rounded to the nearest 100? -4400 What is -65562 rounded to the nearest ten thousand? -70000 What is -2162094.2 rounded to the nearest ten thousand? -2160000 Round 511.54807 to 1 decimal place. 511.5 Round -0.003075998606 to seven decimal places. -0.003076 Round 0.893213887 to 2 dps. 0.89 Round -0.0000138560854 to six dps. -0.000014 Round 5166.8914 to the nearest ten thousand. 10000 Round 65.195998 to the nearest ten. 70 What is -0.000450666558 rounded to 7 decimal places? -0.0004507 What is -15.6418495 rounded to 0 dps? -16 Round -689.116234 to the nearest 100. -700 Round -42.04594126 to the nearest integer. -42 What is -147053.3798 rounded to the nearest 10? -147050 Round 0.0045692172 to three decimal places. 0.005 What is -7.1028905 rounded to 3 decimal places? -7.103 What is 0.00911642783 rounded to 5 decimal places? 0.00912 What is 25757.55356 rounded to the nearest one thousand? 26000 Round -0.0001165275949 to five dps. -0.00012 Round 0.000103786241 to six dps. 0.000104 What is 24574796 rounded to the nearest one thousand? 24575000 Round 0.16275136 to 3 decimal places. 0.163 Round 331690.402 to the nearest ten thousand. 330000 What is -0.2882139955 rounded to 5 decimal places? -0.28821 Round 0.198435247 to three dps. 0.198 What is 35631.113 rounded to the nearest 100? 35600 What is -0.00904889107 rounded to 4 decimal places? -0.009 Round -0.00655150544 to three dps. -0.007 What is 0.349258442 rounded to four dps? 0.3493 Round -0.001363794744 to 7 dps. -0.0013638 What is -0.685924974 rounded to one decimal place? -0.7 Round 439.64486 to the nearest 10. 440 What is 0.00222728307 rounded to five decimal places? 0.00223 Round -46931419 to the nearest 10000. -46930000 What is -0.0000000666124 rounded to 7 dps? -0.0000001 Round 4807.521432 to the nearest 10. 4810 Round 0.0000051926456 to 6 dps. 0.000005 Round 0.00002628861704 to six dps. 0.000026 Round -0.02030768191 to 3 dps. -0.02 What is -13958.989 rounded to the nearest 10000? -10000 What is 0.293012088 rounded to four dps? 0.293 Round 21086359 to the nearest 100000. 21100000 What is -0.000704675808 rounded to five decimal places? -0.0007 What is -1083.3395712 rounded to the nearest integer? -1083 Round -224.523313 to the nearest 10. -220 What is 0.00001373041309 rounded to 7 decimal places? 0.0000137 What is 0.00229765336 rounded to four decimal places? 0.0023 What is 0.00000173599555 rounded to 7 decimal places? 0.0000017 What is -1051.3111 rounded to the nearest one hundred? -1100 Round -155846953.3 to the nearest one hundred thousand. -155800000 Round -43173.15404 to the nearest 1000. -43000 Round 27405941 to the nearest 100000. 27400000 Round -21262240.73 to the nearest one hundred. -21262200 Round 0.908342093 to one decimal place. 0.9 Round 534.59911 to zero dps. 535 What is 263895.04 rounded to the nearest 10000? 260000 Round 0.0001982468087 to five dps. 0.0002 Round 847141.35 to the nearest one thousand. 847000 What is -49043872 rounded to the nearest one hundred thousand? -49000000 Round -7293.301865 to the nearest 100. -7300 What is -16634.25952 rounded to the nearest ten? -16630 Round 11.132335 to 2 dps. 11.13 Round -5491886.811 to the nearest 1000. -5492000 Round 61943169 to the nearest one hundred thousand. 61900000 What is 0.81155643 rounded to three dps? 0.812 Round -16765.68153 to the nearest one thousand. -17000 Round 0.414499178 to two dps. 0.41 Round 18108.283 to the nearest ten thousand. 20000 Round 406.63109 to the nearest one hundred. 400 What is 0.03407079746 rounded to 2 dps? 0.03 What is -158.6897493 rounded to the nearest 100? -200 Round -1454.6277936 to the nearest 100. -1500 Round -0.0010088081064 to 6 dps. -0.001009 Round 0.0001964214057 to seven decimal places. 0.0001964 What is 4212650280 rounded to the nearest 100000? 4212700000 Round -34735.9123 to the nearest one hundred. -34700 What is 3620.3462 rounded to the nearest one hundred? 3600 Round 1172.71498 to the nearest 10. 1170 Round 408472054 to the nearest 1000000. 408000000 Round 0.03314780711 to 6 decimal places. 0.033148 What is 39569586 rounded to the nearest 100000? 39600000 What is -0.001972290834 rounded to four dps? -0.002 What is 111158.145 rounded to the nearest 1000? 111000 Round 218.215469 to two dps. 218.22 Round -0.0060042339 to four decimal places. -0.006 What is -5854.848872 rounded to 0 decimal places? -5855 Round 261409520 to the nearest one hundred thousand. 261400000 Round 3284336.95 to the nearest 1000000. 3000000 Round 709.3735797 to zero decimal places. 709 Round -158.95803 to the nearest one hundred. -200 What is 0.00000002096222 rounded to seven decimal places? 0 What is -1.747591484 rounded to two decimal places? -1.75 Round -0.68010886 to one decimal place. -0.7 Round -8361944.1 to the nearest 10000. -8360000 What is 5.2113247 rounded to two dps? 5.21 Round -184.275723 to the nearest integer. -184 What is 654416.34 rounded to the nearest one hundred? 654400 Round -354906.1264 to the nearest 10000. -350000 What is 0.0386760725 rounded to four decimal places? 0.0387 What is -0.001506473 rounded to 4 dps? -0.0015 What is 10258.5174 rounded to the nearest integer? 10259 Round 0.04438760678 to 4 decimal places. 0.0444 Round -0.0000004481807014 to seven decimal places. -0.0000004 What is -235.417683 rounded to the nearest integer? -235 Round -0.0180178022 to 4 dps. -0.018 Round 68524.0982 to the nearest one thousand. 69000 Round -0.0001837183777 to seven decimal places. -0.0001837 What is 0.2198408873 rounded to 2 dps? 0.22 What is -430.43801 rounded to the nearest 100? -400 Round -295727604 to the nearest 100000. -295700000 Round -0.00018008174 to six decimal places. -0.00018 What is 17.2371257 rounded to the nearest integer? 17 What is -5411463.8 rounded to the nearest one million? -5000000 What is -0.010225420696 rounded to 4 decimal places? -0.0102 What is 483.58748 rounded to the nearest integer? 484 What is 305480.31 rounded to the nearest 100000? 300000 What is 0.00012495415 rounded to seven dps? 0.000125 What is -641373038 rounded to the nearest one million? -641000000 Round -0.02285513145 to 5 decimal places. -0.02286 What is 3.07692 rounded to 1 decimal place? 3.1 What is -8659.52658 rounded to the nearest one thousand? -9000 Round -46.99737521 to 3 decimal places. -46.997 What is 0.00075495847 rounded to 5 decimal places? 0.00075 Round -0.00001644665172 to 7 decimal places. -0.0000164 Round 0.00005181394551 to 5 dps. 0.00005 What is -0.022035965 rounded to 3 decimal places? -0.022 What is -0.001431470516 rounded to 3 decimal places? -0.001 Round -61313.587 to the nearest 1000. -61000 What is -0.180659784 rounded to 2 decimal places? -0.18 Round -7908484980 to the nearest 1000000. -7908000000 What is -0.00224860338 rounded to five dps? -0.00225 Round -0.00000993497324 to 6 decimal places. -0.00001 What is 5624.95305 rounded to the nearest one thousand? 6000 What is -0.4816301502 rounded to three dps? -0.482 What is -5675569.5 rounded to the nearest 1000000? -6000000 What is 0.842815148 rounded to four dps? 0.8428 Round -29300443300 to the nearest one million. -29300000000 Round 0.0005790257056 to 7 decimal places. 0.000579 Round 1563.0139 to the nearest integer. 1563 Round 0.0736669579 to 2 dps. 0.07 Round -699578.29 to the nearest 100. -699600 What is 4347718.08 rounded to the nearest 1000? 4348000 Round 240300.2932 to the nearest one hundred thousand. 200000 Round -149.870999 to 1 dp. -149.9 Round 0.0000275692103 to seven decimal places. 0.0000276 Round -2669026383 to the nearest 100000. -2669000000 Round 107.1097237 to the nearest integer. 107 What is 27.360177 rounded to the nearest 10? 30 What is 0.00002370415796 rounded to six dps? 0.000024 Round 5.52449413 to three dps. 5.524 What is -532884.359 rounded to the nearest 100000? -500000 Round 31831.07808 to one decimal place. 31831.1 What is 0.000233294859 rounded to seven decimal places? 0.0002333 Round 0.13810553 to four dps. 0.1381 Round 756206.62 to the nearest ten thousand. 760000 Round 0.000076287286 to 6 dps. 0	{ "pile_set_name": "DM Mathematics" }
by 17. 9 What is the remainder when 3708 is divided by 143? 133 Calculate the remainder when 347 is divided by 70. 67 What is the remainder when 117 is divided by 30? 27 Calculate the remainder when 536 is divided by 127. 28 What is the remainder when 189 is divided by 89? 11 What is the remainder when 245 is divided by 65? 50 Calculate the remainder when 1038 is divided by 26. 24 Calculate the remainder when 180 is divided by 27. 18 What is the remainder when 797 is divided by 16? 13 Calculate the remainder when 322 is divided by 42. 28 What is the remainder when 1147 is divided by 14? 13 What is the remainder when 220 is divided by 13? 12 Calculate the remainder when 2357 is divided by 17. 11 Calculate the remainder when 21 is divided by 6. 3 Calculate the remainder when 703 is divided by 24. 7 Calculate the remainder when 701 is divided by 3. 2 Calculate the remainder when 1252 is divided by 37. 31 Calculate the remainder when 501 is divided by 286. 215 Calculate the remainder when 823 is divided by 136. 7 What is the remainder when 129 is divided by 65? 64 Calculate the remainder when 850 is divided by 4. 2 What is the remainder when 1236 is divided by 263? 184 What is the remainder when 149 is divided by 14? 9 Calculate the remainder when 175 is divided by 15. 10 Calculate the remainder when 239 is divided by 227. 12 Calculate the remainder when 1247 is divided by 157. 148 Calculate the remainder when 292 is divided by 128. 36 What is the remainder when 913 is divided by 209? 77 What is the remainder when 3230 is divided by 147? 143 What is the remainder when 40 is divided by 30? 10 Calculate the remainder when 6011 is divided by 301. 292 What is the remainder when 76 is divided by 54? 22 What is the remainder when 146 is divided by 23? 8 Calculate the remainder when 1209 is divided by 393. 30 What is the remainder when 30536 is divided by 13? 12 What is the remainder when 2694 is divided by 35? 34 Calculate the remainder when 81 is divided by 19. 5 Calculate the remainder when 125 is divided by 21. 20 Calculate the remainder when 75 is divided by 49. 26 What is the remainder when 17 is divided by 16? 1 What is the remainder when 225 is divided by 19? 16 What is the remainder when 200 is divided by 111? 89 What is the remainder when 246 is divided by 52? 38 What is the remainder when 85 is divided by 67? 18 What is the remainder when 1759 is divided by 19? 11 Calculate the remainder when 6520 is divided by 96. 88 Calculate the remainder when 752 is divided by 28. 24 What is the remainder when 2037 is divided by 631? 144 Calculate the remainder when 97 is divided by 25. 22 Calculate the remainder when 1049 is divided by 34. 29 What is the remainder when 139 is divided by 96? 43 Calculate the remainder when 13 is divided by 13. 0 What is the remainder when 1783 is divided by 51? 49 Calculate the remainder when 1941 is divided by 243. 240 Calculate the remainder when 662 is divided by 84. 74 What is the remainder when 15736 is divided by 43? 41 What is the remainder when 66 is divided by 63? 3 Calculate the remainder when 59 is divided by 17. 8 What is the remainder when 2387 is divided by 795? 2 What is the remainder when 251 is divided by 27? 8 Calculate the remainder when 368 is divided by 74. 72 Calculate the remainder when 301 is divided by 103. 95 Calculate the remainder when 1404 is divided by 1404. 0 Calculate the remainder when 27 is divided by 11. 5 Calculate the remainder when 167 is divided by 55. 2 Calculate the remainder when 103 is divided by 5. 3 Calculate the remainder when 208 is divided by 19. 18 Calculate the remainder when 647 is divided by 21. 17 Calculate the remainder when 45 is divided by 39. 6 What is the remainder when 76 is divided by 65? 11 What is the remainder when 1581 is divided by 12? 9 Calculate the remainder when 976 is divided by 14. 10 Calculate the remainder when 1187 is divided by 31. 9 What is the remainder when 267 is divided by 148? 119 Calculate the remainder when 176 is divided by 65. 46 What is the remainder when 177 is divided by 34? 7 Calculate the remainder when 169 is divided by 50. 19 What is the remainder when 40 is divided by 22? 18 Calculate the remainder when 1517 is divided by 95. 92 Calculate the remainder when 863 is divided by 28. 23 Calculate the remainder when 814 is divided by 34. 32 What is the remainder when 605 is divided by 14? 3 Calculate the remainder when 55 is divided by 19. 17 Calculate the remainder when 80 is divided by 12. 8 Calculate the remainder when 160 is divided by 7. 6 Calculate the remainder when 218 is divided by 107. 4 Calculate the remainder when 1493 is divided by 63. 44 Calculate the remainder when 128 is divided by 54. 20 What is the remainder when 627 is divided by 88? 11 What is the remainder when 3128 is divided by 57? 50 What is the remainder when 21266 is divided by 139? 138 What is the remainder when 661 is divided by 37? 32 What is the remainder when 798 is divided by 135? 123 Calculate the remainder when 14507 is divided by 13. 12 Calculate the remainder when 74 is divided by 40. 34 Calculate the remainder when 752 is divided by 29. 27 What is the remainder when 2309 is divided by 33? 32 Calculate the remainder when 236 is divided by 40. 36 What is the remainder when 29698 is divided by 17? 16 What is the remainder when 153 is divided by 12? 9 Calculate the remainder when 42 is divided by 16. 10 What is the remainder when 1463 is divided by 183? 182 What is the remainder when 208 is divided by 82? 44 Calculate the remainder when 104 is divided by 59. 45 What is the remainder when 57 is divided by 9? 3 What is the remainder when 38 is divided by 19? 0 What is the remainder when 4669 is divided by 1555? 4 Calculate the remainder when 295 is divided by 53. 30 Calculate the remainder when 95 is divided by 53. 42 What is the remainder when 484 is divided by 80? 4 What is the remainder when 15 is divided by 8? 7 What is the remainder when 1834 is divided by 165? 19 Calculate the remainder when 2759 is divided by 345. 344 Calculate the remainder when 917 is divided by 64. 21 Calculate the remainder when 212 is divided by 45. 32 Calculate the remainder when 2009 is divided by 13. 7 What is the remainder when 218 is divided by 102? 14 What is the remainder when 348 is divided by 65? 23 Calculate the remainder when 42 is divided by 19. 4 Calculate the remainder when 766 is divided by 12. 10 Calculate the remainder when 4610 is divided by 53. 52 What is the remainder when 422 is divided by 5? 2 What is the remainder when 1303 is divided by 439? 425 Calculate the remainder when 525 is divided by 48. 45 What is the remainder when 929 is divided by 155? 154 What is the remainder when 1176 is divided by 206? 146 What is the remainder when 5177 is divided by 14? 11 Calculate the remainder when 1182 is divided by 199. 187 Calculate the remainder when 2075 is divided by 104. 99 What is the remainder when 229 is divided by 11? 9 Calculate the remainder when 591 is divided by 37. 36 Calculate the remainder when 229 is divided by 38. 1 What is the remainder when 157 is divided by 122? 35 Calculate the remainder when 12593 is divided by 247. 243 Calculate the remainder when 968 is divided by 10. 8 What is the remainder when 316 is divided by 6? 4 Calculate the remainder when 464 is divided by 23. 4 Calculate the remainder when 145 is divided by 51. 43 Calculate the remainder when 174 is divided by 114. 60 Calculate the remainder when 3151 is divided by 194. 47 What is the remainder when 8 is divided by 7? 1 What is the remainder when 56 is divided by 29? 27 Calculate the remainder when 489 is divided by 82. 79 What is the remainder when 361 is divided by 333? 28 Calculate the remainder when 100 is divided by 13. 9 Calculate the remainder when 445 is divided by 273. 172 Calculate the remainder when 93 is divided by 12. 9 Calculate the remainder when 90 is divided by 23. 21 What is the remainder when 266 is divided by 15? 11 Calculate the remainder when 234 is divided by 49. 38 What is the remainder when 565 is divided by 63? 61 Calculate the remainder when 139 is divided by 7. 6 What is the remainder when 1855 is divided by 913? 29 Calculate the remainder when 60 i	{ "pile_set_name": "DM Mathematics" }
Does 17 divide 94090835? True Does 1773 divide 1244117646? True Is 1097368700 a multiple of 58? True Does 120 divide 83587841? False Is 62174672 a multiple of 16? True Is 41259680 a multiple of 140? True Does 30 divide 84116760? True Is 12 a factor of 172236? True Is 111042490 a multiple of 60? False Is 365770372 a multiple of 15? False Does 131 divide 1528772227? True Does 503 divide 23948836? True Is 1007 a factor of 6034576? False Is 12698026 a multiple of 490? False Is 10109694 a multiple of 453? False Does 971 divide 579890910? True Is 3766 a factor of 699832856? False Is 1222950 a multiple of 31? True Is 325 a factor of 6815962725? True Is 10158384 a multiple of 34? True Is 384837706 a multiple of 1381? False Is 9 a factor of 5986737? True Does 942 divide 26714178? True Does 38 divide 12080314? True Does 80 divide 1842372? False Is 3739482692 a multiple of 1890? False Is 735141523 a multiple of 1409? True Does 179 divide 69390245? True Is 380480162 a multiple of 1855? False Is 415 a factor of 174812911? False Is 1676 a factor of 64452256? True Is 25374144 a multiple of 9? False Does 22 divide 132123489? False Is 582477 a multiple of 87? False Does 610 divide 35425906? False Is 9169893 a multiple of 31? True Is 135274131 a multiple of 59? False Is 3112245 a multiple of 2231? True Is 54 a factor of 1460824870? False Is 84839910 a multiple of 807? True Is 20613644 a multiple of 129? False Is 43119840 a multiple of 96? True Does 79 divide 2192306485? True Is 46849626 a multiple of 382? True Does 250 divide 350044583? False Does 62 divide 88904618? False Does 28 divide 35577416? True Is 402 a factor of 303361662? True Is 22 a factor of 784056922? True Is 190273846 a multiple of 13? False Does 15 divide 24414590? False Does 151 divide 328576? True Is 59 a factor of 27159765? True Is 26787768 a multiple of 1268? True Is 5 a factor of 448996795? True Is 332117066 a multiple of 34? True Does 22 divide 21396452? True Is 1124 a factor of 33437876? True Is 387928690 a multiple of 1655? True Does 60 divide 588117960? True Is 86 a factor of 8686344? True Does 72 divide 34520568? False Is 277 a factor of 18217182? True Is 1448378327 a multiple of 61? True Does 663 divide 54229982? False Is 12314098 a multiple of 142? True Does 4732 divide 4731886432? True Is 40264224 a multiple of 2184? True Is 4742 a factor of 2064306408? True Is 13399707 a multiple of 10? False Is 296335 a multiple of 235? True Does 477 divide 12714435? True Is 27287001 a multiple of 16? False Is 1796805 a multiple of 21? False Is 29045365 a multiple of 6? False Is 34915562 a multiple of 1723? False Does 11 divide 411487494? True Does 655 divide 564590922? False Is 35628853 a multiple of 528? False Is 99 a factor of 285130112? False Is 294 a factor of 602910581? False Does 2276 divide 326346536? True Is 96 a factor of 709465728? True Is 32252072 a multiple of 45? False Is 9322256 a multiple of 8? True Does 16 divide 13142704? True Does 410 divide 46777562? False Is 359 a factor of 75273084? False Does 1959 divide 686392461? True Is 284 a factor of 1357236? True Does 465 divide 384369794? False Is 818683890 a multiple of 8? False Is 70 a factor of 6458900? True Is 1636 a factor of 28515896? False Is 17 a factor of 315307177? True Is 40 a factor of 3487697141? False Does 118 divide 70277968? True Is 211234593 a multiple of 180? False Does 169 divide 196701668? False Is 172 a factor of 35622184? False Is 178 a factor of 81566316? False Is 145317142 a multiple of 40? False Is 94609914 a multiple of 426? True Is 12095416 a multiple of 5? False Is 21 a factor of 99780282? True Is 67399994 a multiple of 53? True Is 38 a factor of 21153343? False Is 13789295 a multiple of 130? False Does 9 divide 54919674? True Is 3742101090 a multiple of 15? True Is 122816200 a multiple of 13? True Does 14 divide 36485358? True Is 248 a factor of 120261321? False Does 80 divide 58016646? False Is 3311588 a multiple of 707? True Is 402769372 a multiple of 17? True Is 3910 a factor of 99912230? True Is 7830786 a multiple of 115? False Is 75 a factor of 247181517? False Is 5583 a factor of 5570161? False Is 11779266 a multiple of 69? True Is 467804232 a multiple of 3076? True Is 1901 a factor of 210596582? True Is 94441940 a multiple of 354? False Is 558 a factor of 10508101? False Does 8 divide 3993260049? False Is 158575823 a multiple of 807? False Does 227 divide 50546998? True Does 35 divide 159432420? True Does 51 divide 72778683? True Is 12 a factor of 20734060? False Is 1337852672 a multiple of 544? True Is 19399532 a multiple of 885? False Is 200098920 a multiple of 8? True Is 233 a factor of 560326788? True Does 56 divide 127792974? False Does 14 divide 296538648? True Is 412782019 a multiple of 109? True Is 15 a factor of 219197190? True Is 23 a factor of 1296559? False Is 20332253 a multiple of 23? True Does 19 divide 166091426? True Is 7 a factor of 139259645? True Is 196414304 a multiple of 944? True Does 1956 divide 50436110? False Is 2 a factor of 5397731? False Is 8714514 a multiple of 8? False Does 251 divide 25365056? True Does 14 divide 103189064? False Is 4083374912 a multiple of 26? False Is 91168540 a multiple of 10? True Is 369286982 a multiple of 67? True Is 6 a factor of 277557438? True Does 90 divide 523383066? False Does 2214 divide 995826204? True Is 54261102 a multiple of 22? False Does 12 divide 70158604? False Is 29 a factor of 149352262? True Is 622427653 a multiple of 42? False Is 18617043 a multiple of 87? True Does 324 divide 287563016? False Is 515956772 a multiple of 203? False Does 4193 divide 2929084? False Does 282 divide 42119802? True Is 43388071 a multiple of 876? False Is 20487804 a multiple of 370? False Does 22 divide 1311754739? False Is 84026304 a multiple of 192? True Is 57 a factor of 686631006? True Does 96 divide 502762223? False Does 2005 divide 8018419? False Is 1414844766 a multiple of 18? True Is 2716346324 a multiple of 38? True Is 1410 a factor of 342750301? False Is 2109 a factor of 13721154? True Is 76 a factor of 44903688? True Is 56 a factor of 207330144? True Is 2016726302 a multiple of 393? False Is 1865 a factor of 78217647? False Does 189 divide 19259028? False Is 20 a factor of 6062105680? True Does 25 divide 440042425? True Is 54247768 a multiple of 4? True Is 64 a factor of 964150886? False Is 763844186 a multiple of 574? True Is 1977154557 a multiple of 5053? False Does 241 divide 29469799? False Is 426 a factor of 55562652? False Is 118122867 a multiple of 27? True Is 15620776 a multiple of 7? False Is 115 a factor of 146291615? True Is 158 a factor of 119644710? True Is 5583 a factor of 175819836? True Is 578760103 a multiple of 2796? False Does 1367 divide 317439272? True Is 670 a factor of 174037506? False Does 721 divide 146897708? False Is 328048642 a multiple of 4? False Is 693542983 a multiple of 353? True Is 98 a factor of 87972532? False Does 4 divide 1666465? False Is 19 a factor of 2803166? False Does 28 divide 21838485? False Is 451 a factor of 46985973? False Is 13 a factor of 2289253422? False Does 21 divide 24482304? True Is 392 a factor of 3059576? False Does 78 divide 1396960578? True Is 776218 a multiple of 13? False Is 118188855 a multiple of 135? True Does 895 divide 628944245? True Is 63006496 a multiple of 2160? False Is 657 a factor of 129687858? True Does 1452 divide 952292748? True Does 969 divide 103584874? False Is 33714417 a multiple of 3553? True Is 7723760 a multiple of 110? True Is 131 a factor of 37926727? True Is 295 a factor of 15762599? False Is 11 a factor of 2750923442? False Is 81431129 a multiple of 169? True Is 1142870321 a multiple of 122? False Is 26 a factor of 444957493? False Does 54 divide 63688842? True Does 36 divide 126055944? True Is 52063988 a multiple of 61? True Is 391102625 a multiple of 98? False Does 760 divide 196903080? True Is 86975042 a multiple of 183? False Does 8 divide 26909936? True Does 23 divide 4066949259? False Is 4 a factor of 962246348? True Is 2 a factor of 96734976? True Is 605178192 a multiple of 16? True Does 10 divide 15650930? True Does 78 divide 6603255048? True Is 99 a factor of 180434826? True Does 207 divide 33418701? True Does 35 divide 35506030? True Is	{ "pile_set_name": "DM Mathematics" }
he lowest common multiple of o and d. 10 Let w = 545 - 10897/20. What is the common denominator of -59/10 and w? 20 Find the common denominator of 9/20 and ((-320)/22 + 5)/(-4). 220 Let m(l) = l*3 - 5l*2 - 6l + 2. Let y be m(6). What is the least common multiple of ((-7)/(-14))/(y/16) and 2? 4 Let w(n) = -2n - 5n + 2n + 6n + n*2 + 5. Calculate the lowest common multiple of 8 and w(0). 40 Suppose -2a = -3 - 21. Let o = 27 - 19. Calculate the smallest common multiple of a and o. 24 Suppose 0 = -o - 0 - 2, -4n + 5o = 242. What is the common denominator of 47/16 and (38/(-6))/((-56)/n)? 16 Let d be (-4)/(-6) - (-397)/9. Let i be 5/(-4)464/9. Let l = d + i. Calculate the common denominator of -48 and l. 3 What is the common denominator of ((-21)/(-66))/(8/18) and -55/6? 264 Let z(a) = 42a + 2. Let x be z(-1). Calculate the common denominator of -123/10 and -2 - (166/x - 3). 20 Let l = 16 + 2. Let h = 34 - l. Let y = 51 - 29. Calculate the lowest common multiple of y and h. 176 Suppose -2r + 3r = 3. Calculate the lowest common multiple of r and 6. 6 Let a = 7/76296 - 3056885/6936. Let f = a - -27889/66. Find the common denominator of f and -63/20. 60 Let p = -1147127/171210 - -2/17121. Find the common denominator of 45/89 and p. 890 What is the common denominator of (27/2 + -2)/(-4) and 10/4(381/165 + -2)? 88 Let l be 372/(-8) - 1/4. Let d = -34 - l. Calculate the common denominator of -27/4 and d. 4 Let j(c) = -c3 + 2c*2 + 2c - 2. Suppose -7 = -2g - 3o, 3o - 2o = 4g - 7. Let w be j(g). Calculate the common denominator of -19/10 and w - (588/27)/4. 90 Let g = 37052/1533 + -3/1022. Find the common denominator of g and -57/20. 60 Calculate the smallest common multiple of 2 + 9 + (-1)/1 and 32. 160 Let u = 6 + -2. Suppose 0 = -0b + 2b - 10. What is the least common multiple of u and b? 20 Suppose 3f - 38 = -2o, 0 = -2f + 4o - 7o + 32. What is the lowest common multiple of ((-12)/3 - 3)-2 and f? 70 Let t be 10/55 + (-26)/22. Let k be (t - 2) + 422/(-12). Let n = k - -34. What is the common denominator of 61/10 and n? 30 Let n = 111117/712 - -317/89. Let r = n + -4147/24. What is the common denominator of 242/(-4)(-1)/6 and r? 12 Let g = -21 - -32. Let o = g + -5. Let i = -3 + 8. What is the smallest common multiple of o and i? 30 Let n = 4343/4 + -1070. Let g be (30/(-3))/(12/5657). Let w = 4728 + g. Calculate the common denominator of w and n. 12 Let p be (-169)/(-26) - (-6)/(-4). Let g = 9 - p. Let t(f) = 3f. What is the lowest common multiple of t(4) and g? 12 Let x = 13154/7 + -1885. Find the common denominator of x and -83/10. 70 Let p = -1817/4 + 452. Calculate the common denominator of p and (-3341)/(-312) - 2/6. 8 Let y = 2 + 8. Let x(z) = -z + 7. Let w be x(6). Let j = 6 + w. Calculate the smallest common multiple of y and j. 70 Let x be 8468/(-20) + 6/(-10). Calculate the smallest common multiple of 2/(-13) + x/(-52) and 10. 40 Let v = 7 + -5. What is the lowest common multiple of (v - -1)5/3 and 4? 20 Suppose -3h - 9k + 11k = -367, -590 = -5h - k. Calculate the least common multiple of h and 8. 952 Let i be (-2)/(1/(3/(-6))). Let r(k) = 4k3. What is the lowest common multiple of r(i) and (-1)/(-1) - 1/(-1)? 4 Let i = 2424/5 - 18987/40. Find the common denominator of i and 4/20(-79)/2. 40 Let t(v) = -2v + 3. Suppose -n = q - 1, -5n - 11 + 32 = q. Calculate the least common multiple of t(q) and (-205)/(-20) + 2/(-8). 110 Let n = -8597/2020 - -3/505. Find the common denominator of 13/9 and n. 36 Let f be (8/(-5))/4-50. Suppose o = 36 + f. Suppose 4q - 5g = 26 + o, 74 = 4q - g. What is the lowest common multiple of q and 22? 198 Suppose 5s - 18 = -5t + 22, 0 = -3s + 2t + 24. Calculate the least common multiple of 10 and s. 40 Suppose -4q + 3t - 2t - 5 = 0, 5t - 5 = 0. Calculate the common denominator of (-14)/9 + -2 + 3 and 99/((-4)/(1 - q)). 18 Let x(q) = 130q3 - 3q*2 + 2q + 2. Let r be x(-4). Let n = r + 251041/30. Calculate the common denominator of -71/18 and n. 90 Let i = 63/61 + -3001/366. Let k be (-2316)/(-90) - (-4)/(-1). Let a = k + -313/30. Calculate the common denominator of i and a. 30 Suppose 0 = -3a + 36 - 3. Let w(u) = 2u - 5. What is the lowest common multiple of a and w(4)? 33 Suppose m + 5w = 4, -7 = 5m + 2w - 27. Suppose 2l - 12 = -2l + 4o, -12 = -4l - mo. Calculate the lowest common multiple of 5 and l. 15 Suppose 3k - 116 = -5p, -2k - 28 = -p + 3. Suppose 15 + p = 4w. Calculate the smallest common multiple of 22 and 1-1 + -7 + w. 22 Let n(u) = -u3 + 6u*2 - 4u + 2. What is the least common multiple of n(4) and 22? 198 Suppose -z - z + 219 = 3h, -z - 2h = -108. What is the least common multiple of z and 8? 456 Let n be ((-1)/2)/((-1)/4). Suppose 0 = -2v + nk, -6k + 3k = 4v - 21. Find the common denominator of -89/8 and 91/2v/12. 8 Let n = -42493 - -210449/5. Let q = n + 402. Let t = -2680 - -26767/10. What is the common denominator of q and t? 10 Let j = -519756/110267 + 14/3557. Let d = -26686/4929 - j. Let b = -2/53 - d. What is the common denominator of b and -56/11? 33 What is the common denominator of (190/4 - -1) + 1 and -25/16? 16 Suppose 37 = 4f - v, 2v + 0v = f - 4. What is the lowest common multiple of f and 10? 10 Calculate the lowest common multiple of (-64)/(-10) - (-2)/(-5) and (-2)/5 - (-32)/5. 6 Let q(v) = -8v*2 - v. Let r be q(1). Calculate the least common multiple of 2 and 14 + (-1)/((-3)/r). 22 Suppose 4w + 5l - 69 = 0, -w - 2l + 4l = -1. Suppose -2s - 4r = -24, r - w = -0s - 3s. Calculate the least common multiple of s and -3 - -9(-2)/(-2). 6 Let v = -1 + 5. Let w(x) = x + 6. What is the lowest common multiple of v and w(5)? 44 Let g = 3 - 21. Let v be ((-3918)/g)/((-4)/(-3)). Let p = -139 + v. What is the common denominator of 31/3 and p? 12 Calculate the lowest common multiple of 5 and (-11)/66 + (-110)/(-12). 45 Let i(l) = l*3 - 4l2 - l + 4. Let h be i(4). Let g(n) = n3 - n*2 + 8. Calculate the lowest common multiple of g(h) and 28. 56 Calculate the common denominator of 2/(-9) + 22/3 and -43/12. 36 Let h be 1/(-1) - (1 - 4). Let t(r) = 2r. Let k be t(h). Suppose n = -kn + 35. What is the lowest common multiple of 6 and n? 42 Let h = -136188 + 951339/7. Let k = -8587/28 - h. Let a = -544 - -1115/2. What is the common denominator of k and a? 4 Let f be (-8)/(-12) - (-2)/(-3). Suppose 0 = -fp - 2p + 32. What is the smallest common multiple of p and 18? 144 Let z = -22 + 25. Suppose zg = 6g - 24. What is the lowest common multiple of g and 106? 424 Suppose 36 = -2u + 4u. What is the lowest common multiple of u and 34? 306 Let g = 2 + -15. Let b = g + 24. Calculate the lowest common multiple of 2 and b. 22 Suppose -3m - 14 = -7q + 2q, -4q - 11 = 5m. Suppose -4 = -4v, 4y - 4v = -y + 36. What is the smallest common multiple of 23 + -3 + 2q and y? 88 Suppose b - 1 = -2. Find the common denominator of 49/4 and 0/b - (-366)/108. 36 Let s = 741 + -1531/2. What is the common denominator of 71/22 and s? 22 Let y be ((-148)/(-36))/(3/(-1383)). Let k = y - -1899. Calculate the common denominator of -18 and k. 9 Let h(m) = 7m - 13. Let g be h(-11). Find the common denominator of -19/16 and (-26)/60g/(-20). 80 Let f be 12/20 - 44/(-10). Let y(o) = fo2 + 0o - o + o. Calculate the least common multiple of y(-2) and 10. 20 Calculate the lowest common multiple of 8 + (-2 - 2) - 1264/(-4) and 14. 2240 Let l(a) = -a*3 + 6a*2 - 4a - 2. Let v be l(5). Let p = 2 + 18. Calculate the lowest common multiple of ((-6)/(-4))/(v/20) and p. 20 Let s = -956365583/40650 + 141161/6. Let t = 26835519/54200 + s. Let d = 500 - t. What is the common denominator of 59/4 and d? 8 Let w = 5 - 2. Find the common denominator of (w/42)/(2/88) and -133/6. 42 Suppose -32 = 4q + 16. What is the common denominator of q and 412/(-24) - (-1)/3? 6 Calculate the common denominator of (-5)/2184/(-110) and (-265)/70 + (3/(-2))/(-1). 77 Let a = 819/25 - 34311/1100. Calculate the common denominator of -79/36 and a. 396 Let y be -14 + (-9)/(-3) + 1. Let a be (2/y)/((-1512)/20). Let u = -913/189 - a. What is the common denominator of u and -27/16? 48 Suppose f - 2 = 3. Calculate the common denominator of 302/80 + (-	{ "pile_set_name": "DM Mathematics" }
uau? 10/143 What is prob of sequence aa when two letters picked without replacement from {a: 7}? 1 Calculate prob of sequence hhh when three letters picked without replacement from {n: 10, h: 4}. 1/91 Calculate prob of sequence jdd when three letters picked without replacement from dwdmjwqn. 1/168 Two letters picked without replacement from {h: 3, d: 5, c: 2}. What is prob of sequence ch? 1/15 Calculate prob of sequence dbb when three letters picked without replacement from bpdbbddmbdppbs. 10/273 Two letters picked without replacement from twnmwamt. What is prob of sequence mn? 1/28 Three letters picked without replacement from {m: 7, e: 4}. What is prob of sequence mee? 14/165 Calculate prob of sequence eec when three letters picked without replacement from {e: 3, c: 1}. 1/4 What is prob of sequence mms when three letters picked without replacement from ssmmmssmsmss? 7/66 What is prob of sequence euu when three letters picked without replacement from {e: 3, u: 2}? 1/10 Three letters picked without replacement from {y: 1, o: 4, b: 1, w: 1, i: 4}. Give prob of sequence yio. 8/495 What is prob of sequence qbcq when four letters picked without replacement from bbqqbqqcqcbcldql? 3/364 Three letters picked without replacement from rpppprp. Give prob of sequence ppr. 4/21 Calculate prob of sequence hhu when three letters picked without replacement from {h: 8, u: 5}. 70/429 Calculate prob of sequence sd when two letters picked without replacement from {b: 5, s: 11, d: 1, t: 3}. 11/380 What is prob of sequence dss when three letters picked without replacement from szzzsssssssssdzzz? 3/136 Calculate prob of sequence vceg when four letters picked without replacement from {e: 1, c: 1, v: 1, g: 2}. 1/60 Three letters picked without replacement from mlglmglgmgmmlm. Give prob of sequence lgl. 2/91 Calculate prob of sequence qqqq when four letters picked without replacement from qqqqq. 1 What is prob of sequence xmxj when four letters picked without replacement from xjxjjrjmrjxrmmxxxxjj? 49/6460 Three letters picked without replacement from {g: 3, c: 5, f: 1, s: 1, b: 1}. Give prob of sequence ggs. 1/165 What is prob of sequence xx when two letters picked without replacement from xrxpxxspspppxxxssp? 7/51 What is prob of sequence hitt when four letters picked without replacement from mmttmhibbtiibbmtmib? 1/1938 What is prob of sequence hh when two letters picked without replacement from {o: 2, a: 3, h: 3, g: 7, x: 1, w: 1}? 3/136 Two letters picked without replacement from {y: 1, c: 2, h: 2, f: 1}. Give prob of sequence fh. 1/15 Calculate prob of sequence lf when two letters picked without replacement from {f: 9, l: 7}. 21/80 Two letters picked without replacement from eereereeeeeeerrr. Give prob of sequence re. 11/48 Two letters picked without replacement from {f: 11, k: 3}. Give prob of sequence kf. 33/182 Four letters picked without replacement from {s: 1, t: 1, x: 1, l: 1, a: 2, d: 1}. Give prob of sequence axls. 1/420 Three letters picked without replacement from {q: 1, f: 1, e: 2}. What is prob of sequence eef? 1/12 What is prob of sequence jb when two letters picked without replacement from {b: 1, j: 7}? 1/8 Four letters picked without replacement from {c: 2, n: 1, v: 2}. What is prob of sequence vcvn? 1/30 Three letters picked without replacement from {z: 2, g: 4, s: 10}. Give prob of sequence gzs. 1/42 What is prob of sequence hhht when four letters picked without replacement from {h: 3, t: 13}? 1/560 Calculate prob of sequence qq when two letters picked without replacement from cqccccqcccqcccqq. 1/12 Three letters picked without replacement from {t: 4, h: 3, f: 2, p: 1}. What is prob of sequence pft? 1/90 Calculate prob of sequence yg when two letters picked without replacement from yppgyggyyyg. 2/11 What is prob of sequence ks when two letters picked without replacement from {v: 2, i: 1, s: 2, k: 1, n: 2}? 1/28 Four letters picked without replacement from ddooeeeeosx. Give prob of sequence esdo. 1/330 Three letters picked without replacement from {g: 1, z: 3}. What is prob of sequence gzz? 1/4 Calculate prob of sequence ppo when three letters picked without replacement from opppo. 1/5 Calculate prob of sequence mmym when four letters picked without replacement from ymymmmymymmy. 35/396 Three letters picked without replacement from ihghggthgbihth. Give prob of sequence tig. 2/273 Three letters picked without replacement from xxxjjjjdju. What is prob of sequence xxj? 1/24 What is prob of sequence eec when three letters picked without replacement from {c: 3, e: 5, g: 1}? 5/42 What is prob of sequence hiy when three letters picked without replacement from {g: 1, h: 1, w: 3, i: 1, y: 7}? 7/1716 What is prob of sequence bbcb when four letters picked without replacement from {x: 13, b: 5, c: 2}? 1/969 Two letters picked without replacement from mbgppggpggpgu. What is prob of sequence bg? 1/26 Two letters picked without replacement from {m: 3, c: 2, q: 1, g: 9, j: 4}. Give prob of sequence jj. 2/57 Four letters picked without replacement from oynnnrnnrrntotnqn. What is prob of sequence rnor? 1/595 Calculate prob of sequence jjaa when four letters picked without replacement from jaajaaaaaaajaajaaaa. 35/1292 Three letters picked without replacement from xgmggdcdmgm. Give prob of sequence mcx. 1/330 Calculate prob of sequence foko when four letters picked without replacement from okokkfokkoo. 5/396 What is prob of sequence yyy when three letters picked without replacement from {y: 4, x: 7}? 4/165 What is prob of sequence yus when three letters picked without replacement from {s: 1, y: 3, v: 1, u: 9}? 9/728 Four letters picked without replacement from {f: 2, a: 4, r: 4}. Give prob of sequence frrr. 1/105 Calculate prob of sequence oaqu when four letters picked without replacement from goaguagoagxgxoggq. 3/19040 Calculate prob of sequence pmv when three letters picked without replacement from {k: 3, v: 1, a: 1, m: 3, p: 2}. 1/120 What is prob of sequence utol when four letters picked without replacement from {u: 3, s: 2, l: 2, c: 1, o: 2, t: 4}? 2/1001 Calculate prob of sequence fd when two letters picked without replacement from {i: 3, f: 2, w: 2, d: 2}. 1/18 Calculate prob of sequence nnd when three letters picked without replacement from {d: 1, u: 1, n: 2, e: 1}. 1/30 What is prob of sequence ber when three letters picked without replacement from {b: 3, r: 12, e: 2}? 3/170 What is prob of sequence ww when two letters picked without replacement from {v: 3, w: 4}? 2/7 What is prob of sequence ujpp when four letters picked without replacement from {b: 1, p: 2, j: 1, v: 2, u: 1, q: 1}? 1/840 Calculate prob of sequence asas when four letters picked without replacement from kalkkslakkkkkkkkvk. 0 Calculate prob of sequence lcqa when four letters picked without replacement from glaacqq. 1/210 Four letters picked without replacement from nwqwwqqn. What is prob of sequence wqnn? 3/280 Three letters picked without replacement from hthrmhmhhth. What is prob of sequence trh? 2/165 Calculate prob of sequence bhdh when four letters picked without replacement from {d: 5, l: 4, b: 8, h: 2}. 5/5814 Two letters picked without replacement from eemfffmffeeekaaamf. Give prob of sequence ke. 5/306 What is prob of sequence dfv when three letters picked without replacement from {f: 1, j: 1, h: 2, d: 1, v: 1, y: 1}? 1/210 What is prob of sequence llt when three letters picked without replacement from {l: 5, x: 2, o: 5, t: 3}? 2/91 What is prob of sequence wjd when three letters picked without replacement from wddjddwjwjsljjwl? 1/42 What is prob of sequence tpyi when four letters picked without replacement from pyitx? 1/120 Three letters picked without replacement from hhhwhkwhwhkhhwwkw. Give prob of sequence wkw. 3/136 Three letters picked without replacement from {i: 2, c: 2}. What is prob of sequence cci? 1/6 Four letters picked without replacement from {z: 2, i: 8}. Give prob of sequence iizz. 1/45 Calculate prob of sequence pp when two letters picked without replacement from ggpppp. 2/5 Three letters picked without replacement from qpfppqppfpapflfppppf. What is prob of sequence fap? 11/1368 What is prob of sequence qqkg when four letters picked without replacement from {q: 3	{ "pile_set_name": "DM Mathematics" }
ided by w? 3 Let d(k) = 199k + 387. What is the remainder when d(5) is divided by 33? 29 Let m(i) = 76i - 5421. Let r(f) = 7f2 - 4f - 1. Calculate the remainder when r(-3) is divided by m(72). 23 Suppose -18k = 15k - 99. Suppose 7d - kd + 313 = 3p, -5d = -p + 108. Calculate the remainder when p is divided by 15. 13 Let l be (-15 - -12)/(2 - 3). Suppose 0 = lw - 11 - 4. Calculate the remainder when 22 is divided by w((-24)/(-15))/1. 6 Calculate the remainder when 18(1307 - (-2)/(-2))(-53)/(-318) is divided by 12. 6 Let o = -100 + 97. Let x(w) = 3w2 + 5w + 5. Calculate the remainder when x(-6) is divided by ((-5)/(-4 - 1))/(o/(-36)). 11 Let v = -49 - -51. Let x be (-3)/6356/v. Let r = x - -307. Calculate the remainder when r is divided by 13. 10 Let w = -55 - -55. Let n be ((-4)/(-3))/((-6)/(-9) - w). Suppose 2q - 136 = nm - 4m, m - q = 58. Calculate the remainder when m is divided by 22. 19 Suppose 2k - 9 = -3, 3k = -3w + 7167. Calculate the remainder when w is divided by 787. 25 Let n(r) = 9r*3 + 95r*2 + 41r + 8. What is the remainder when 403 is divided by n(-10)? 11 Let u = -38 - -41. Let y(r) = 3r + 15r*3 - 2 - 3r*3 + 10r*u - 127r*2 + 125r*2. Calculate the remainder when 80 is divided by y(1). 17 Suppose 5q - 4v - 135 = v, 57 = 3q + 5v. Suppose 0 = -3h + 4h - q. Suppose -h = -w - w. Calculate the remainder when 47 is divided by w. 11 Let g = -23919 - -25058. What is the remainder when g is divided by 379? 2 Calculate the remainder when 75/25 + (854/6 + 2)3 is divided by 23. 22 Suppose 1 = 3s + 10. Let o be 2 + s1/(-3). Calculate the remainder when 111 is divided by (-30)/(-2) + 12/o. 16 Suppose 0 = 2j - 11a + 8a - 295, -3a = 4j - 635. What is the remainder when 614 is divided by j? 149 Suppose -106s = -101s - 155. Suppose 22l + 189 = sl. What is the remainder when 62 is divided by l? 20 Let u(s) be the third derivative of -s6/120 - s5/15 - 3s*4/8 - 4s*2 + 4. Calculate the remainder when u(-3) is divided by 10. 8 Suppose 0 = -4l + 73 - 69. Let a be 381/(-1 + l/4). What is the remainder when 103 is divided by (-28)/126 - (1 + a/18)? 22 Suppose 4f - 194 = 59k - 61k, -4k + 400 = -4f. Calculate the remainder when 168 is divided by k. 69 Suppose -3p + 6p = -4x + 226, -5x + 265 = -5p. Let u = 553 - 542. What is the remainder when x is divided by u? 0 Suppose 0 = -933g + 876g + 97299. What is the remainder when g is divided by 7? 6 Let p(j) = j*3 - 2j*2 - 2j - 6. Let b be p(4). What is the remainder when 1606/b + -8 + 840/108 is divided by 14? 5 Let w = 344 + -136. Let f = w - -128. Let b = f + -228. Calculate the remainder when b is divided by 28. 24 Suppose r + 2r = o + 9893, -5o - 16475 = -5r. What is the remainder when r is divided by 15? 14 Let z = -445 + 465. Let h(l) = l2 - 14l - 68. Calculate the remainder when h(z) is divided by 11. 8 Suppose -24j + 3317 = -1099. What is the remainder when 3126 is divided by j? 182 Let f(l) = 7l*3 - 55l*2 + 24l - 11. Calculate the remainder when f(12) is divided by 135. 133 Let b(v) = -52v - 5. Let t be b(-1). Suppose l - t = 5d - 411, 4d - 308 = 5l. Let r = d + -47. Calculate the remainder when 99 is divided by r. 24 Let v(o) = 3o + 1. Calculate the remainder when (-70)/(-20)-2 - -89 is divided by v(18). 27 Let a(i) = -i*3 - 7i*2 - 27i - 44. Let w be (-52)/(-16)222. Let p = -69 + w. Calculate the remainder when p is divided by a(-4). 10 Suppose l = 5g + 329 - 186, -4g = -4l + 620. Calculate the remainder when l is divided by 95. 63 Let x(u) = -u2 + 9u - 2. Let c = 89 - 82. Suppose co = 8o - 33. What is the remainder when o is divided by x(7)? 9 Let r = 53495 + -53452. Calculate the remainder when (0 - 4)(-762)/24 is divided by r. 41 Let v = -2138 + 2174. Let m(w) be the second derivative of w5/20 - w4/2 + w3/3 + 3w*2 - 11w. What is the remainder when v is divided by m(6)? 0 Let x(d) = -7d2 + 5d + 17. Let o(a) = a*2 - a - 1. Let u(z) = -6o(z) - x(z). Let i = -125 - -135. Calculate the remainder when u(-6) is divided by i. 9 Let w = 4604 - 4238. What is the remainder when 1215 is divided by w? 117 Let n(g) = 64g2 - 6g - 1. Let f be n(-1). Let h = f + -64. Suppose -hr - 16 = -o, -o + 24 = -4r + r. Calculate the remainder when 69 is divided by o. 33 Let p(t) = -t*2 + 130t - 2694. What is the remainder when 4319 is divided by p(26)? 9 What is the remainder when 1170/18(-6 + 4 + 13) is divided by 24? 19 What is the remainder when 196 is divided by (10/(-4))/(895/(-3938))? 9 Suppose -832 = -12n + 4580. What is the remainder when n is divided by 13? 9 Let y(r) = -r*3 + 52r*2 - 134r - 9. Calculate the remainder when 77 is divided by y(3). 17 Let d be (546/(-10))/(1/(-5)). Let y be (3 + (-6627)/(-6))96/240. Suppose d = g + 2g - 3n, 5g - y = 2n. What is the remainder when g is divided by 10? 7 Suppose 4i = 5t + 31 - 653, -3t = -3i - 375. What is the remainder when 360 is divided by t? 116 Suppose -5t + 220 = 5p, t + 680 = 2p + 574. Calculate the remainder when 427 is divided by p. 27 Suppose 5k + 117 = 2l, -2k = 4l - 520 + 346. Suppose -3r = r - 364. What is the remainder when r is divided by l? 45 What is the remainder when (-6)/(-195) - (-9379787)/1235 is divided by 17? 13 Suppose -26 = -n - 5d + 4, 2n - 4d = 102. Suppose nq - 545 = 400. Let z = -15 - -33. Calculate the remainder when q is divided by z. 3 Suppose -5z = 5k - 105, -4z + k + 59 = -0k. Suppose 10g - 7g = -21. Let i(d) = d2 - d - 15. What is the remainder when i(g) is divided by z? 9 Suppose f = 5y - 24, -4y = 5f + 27 + 151. Let t = -38 - f. Calculate the remainder when ((-52)/(-10))/(t/(-10)) is divided by 6. 1 Suppose -2w + 38 = 14. Let p(s) = 453s - 1645. Calculate the remainder when p(4) is divided by w. 11 Let i(k) = 5k - 6. Let t(a) = 4a - 7. Let g(q) = 2i(q) - 3t(q). Suppose 20h = 387 - 287. Calculate the remainder when g(-6) is divided by h. 1 Suppose -5c + 2o - 29 = 0, -4o - 16 = 5c + 1. Let s(h) = -22h*3 - 2h*2 - 2h - 1. Calculate the remainder when s(-1) is divided by c + 16 + 0 + -5. 3 Suppose -6w = -594 + 132. Let t = -48 + w. Calculate the remainder when t is divided by (1/(-3))/((-3)/99). 7 Suppose 5l + 0x = 2x - 26, 2x - 20 = 4l. Let k be (28/(-8))/((l/4)/3). What is the remainder when 70 is divided by 9/(-2)(k + -15)? 34 Suppose 0 = -8p + 13p - 5f - 70, -25 = 5f. What is the remainder when 62 is divided by p? 8 Let m(l) = -5l - 40. Let q be m(-16). Suppose 2v + q = 2b, -5b - 2v + 82 = -v. Calculate the remainder when 334 is divided by b. 11 Let g(y) = 3y2 - 55y + 10. Let z be g(25). What is the remainder when (z/120)/((-1)/(-20)) is divided by 43? 42 Suppose 255f - 21f = 4446. Let n(a) be the first derivative of -a*4/4 - 4a*3/3 - 3a*2 - 8. What is the remainder when n(-6) is divided by f? 13 Let c(w) = 51w + 140. Let b(d) = -47d - 141. Let m(g) = 5b(g) + 4c(g). Let h(j) = 12j*2 + 1. What is the remainder when h(-1) is divided by m(-5)? 3 Let t(u) = 15u + 10. Let f be t(7). Suppose f - 21 = 2v. What is the remainder when 2 + 233 + 4 + -7 is divided by v? 44 Let q = 834 - 366. What is the remainder when q is divided by 129? 81 Let y = 25 + 90. Suppose -16x = -239 - 689. Calculate the remainder when y is divided by x. 57 Let u be ((-626)/(-4))/((-1)/(-2)). Let z = u + -209. Suppose 0 = m + m - z. Calculate the remainder when m is divided by 11. 8 Suppose 54v + 2572 = -4016. Let a(p) = p2 + 6p + 1. Let l be a(-4). What is the remainder when 89 is divided by v/(-4) - l/(-14)? 29 Let k(u) = -3u3 + u2 - 23u - 26. Let o(q) = q*3 + 8q + 9. Let l(m) = -6k(m) - 17o(m). Calculate the remainder when 44 is divided by l(6). 14 What is the remainder when 1/(-4 - -6)(-3 - -1637 - -2) is divided by 102? 2 Suppose 3k - 17 = -y - 1, k - 5y = 0. Suppose -s + q = -31, -158 = -ks - q + 15. What is the remainder when s is divided by 23? 11 What is the remainder when (-16 - 4263/(-168))16 + -5 is divided by (-2)/(-2)(-1 + 74)? 72 Let l = 88 + -83. Suppose -lo + 649 = -p, 3o + p = -o + 521. What is the remainder when o is divided by 33? 31 Suppose 4m = h - 696, -m - 5h - 13 = 182. Let v = m + 188. What is	{ "pile_set_name": "DM Mathematics" }
te a(c) - 4i(c). -9c3 + c - 9 Let g(u) = u3 + 13u2 - 14u - 4. Suppose -4t - 60 = 4x, 2t + 2t + 4 = 0. Let n be g(x). Let s(b) = 2b2 + b - 2. Let v(r) = r. Give nv(w) + s(w). 2w2 - 3w - 2 Let h(x) = 4x2 - 2x + 2. Let b(p) = -9p2 + 5p - 5. Let n = -39 + 14. Let q = -2 - n. Let y = q - 21. What is yb(g) + 5h(g)? 2g2 Let h(u) = -2u*3 + 7u*2 + 14u - 26. Let v(z) = z*3 - 4z*2 - 8z + 13. What is -3h(i) - 5v(i)? i3 - i2 - 2i + 13 Let m = 121 - 118. Suppose 0 = -2z + 3d - 9, 3 = mz - d - 1. Let i(k) = 6k3 + 2k*2 - 3k. Let h(y) = -13y3 - 4y*2 + 7y. Determine zh(f) + 7i(f). 3f3 + 2f*2 Let u(t) = 17t + 14. Let x(a) = -9a - 6. Determine 4u(m) + 10x(m). -22m - 4 Let n(f) = f + 1. Let g(u) = -2 - u - u + 2u - 3u - 3. Give -g(w) - 5n(w). -2w Let i be 24-1 + (-26 - -25). Let f(a) = -4a3 - 5a*2 - 9a - 3. Let c(t) = -t3 - t2 - 2t - 1. Give ic(y) + 2f(y). y3 - y2 + 3 Let z(b) = 43b*2 + 29b + 16. Let s(p) = -10p2 - 7p - 4. Calculate 26s(c) + 6z(c). -2c2 - 8c - 8 Let x(u) = 5u. Let a(w) be the third derivative of 3w4/8 - w3/2 - 29w2. Let h(f) = -16f + 5. Let m(r) = 5a(r) + 3h(r). Give 5m(o) + 2x(o). -5o Let m(z) be the first derivative of -z2/2 - 459. Let h(r) = 36r. Give -h(g) - 30m(g). -6g Let q(r) be the second derivative of -r4/4 + r2 - 7r. Let t(l) = 45 + 0l*2 - 46 + 2l*2 - 3l*2. Give q(s) + 2t(s). -5s2 Let d = 255 - 253. Let q(y) = -8y - 1. Let n(a) = -9a - 2. Calculate dn(i) - 3q(i). 6i - 1 Let y(j) = -4j + 5j*2 + 5j*2 + 0 - 2 - 9j2. Let b(d) = d2 - 5d - 3. Suppose -18 = -l + 5a + 11, 5l - a - 25 = 0. What is lb(t) - 5y(t)? -t2 - 2 Let r(f) = f2 - 6f + 13. Let i(q) = 4q2 - 17q + 37. What is 6i(k) - 17r(k)? 7k2 + 1 Let u(i) = -5i*3 - 2i + 2. Let k = -95 + 96. Let v be u(k). Let y(t) = 15t2 - 24t + 24. Let a(o) = 3o2 - 5o + 5. Give vy(l) + 24a(l). -3l2 Let q(c) = -c3 + 16c*2 + 3c - 51. Let d be q(16). Let s(u) = 4u + 3. Let r(k) = -k - 1. What is ds(f) - 8r(f)? -4f - 1 Let q(z) = 13z - 11. Let x(j) = -24j + 136. Let n(g) = -5g + 29. Let p(h) = -28n(h) + 6x(h). Give -7p(m) - 2q(m). 2m - 6 Let g(w) = -7w3 + 4w*2 - 5. Let j(z) = -22z*3 + 14z*2 + z - 16. Calculate -7g(i) + 2j(i). 5i*3 + 2i + 3 Let h(j) = -162j + 12. Let o(n) = -163n + 10. What is -5h(q) + 6o(q)? -168q Let d(p) = 1. Let u(a) = 1. Let b(r) = 5. Let s(t) = -b(t) + 4u(t). Let z(g) = -7d(g) - 6s(g). Let i(f) = 3f - 4. Calculate -i(k) + 3z(k). -3k + 1 Suppose 0 = -7m + 3m + 24. Let y(u) = -3u + 11 + 2u + 3u. Let j(a) = -1 + a + 3 + 7 - 3. Give my(c) - 11j(c). c Let i(b) = b*3 + 4b*2 + 3b - 3. Let x(l) = 3l3 + 3l*2 + 6l - 4. Let g(j) = -j3 + j2 - j. Let z(d) = 2g(d) + x(d). Calculate -4i(h) + 3z(h). -h3 - h2 Let c = -697 + 696. Let a(l) = l - 1. Let n(k) = -8k + 4. Give cn(b) - 3a(b). 5b - 1 Suppose -7z - 11 + 32 = 0. Suppose -6g + z + 3 = 0. Let w(r) = -r + 1. Let a(l) = l2 - 3l*2 + 6 + 3l*2 - 6l - 4l2. What is ga(h) - 6w(h)? -3h*2 Let l(o) = 531o*2 + 15o. Let d(q) = 111775q2 + 3156q. Give 5d(y) - 1052l(y). 263y2 Let q(h) = 11h + 4h - 3h + 35. Let f be q(-3). Let l(b) = -2b + 4. Let r(o) = 1. Give fl(n) + 3r(n). 2n - 1 Let l(g) = 5g2 - 2g - 9. Let m(k) = 5k2 - 2k - 8 + 0k - k + 0k. Let f(t) = 3l(t) - 2m(t). Let o(v) = -v*2 + 2. What is 2f(r) + 11o(r)? -r2 Let x(s) = -24 + 17 + 5. Let b(j) = 0j + 1 + 3j - 2j - 2j. Calculate 4b(a) + x(a). -4a + 2 Let l(y) = 23 - 16 + 15 - 38 + 15. Suppose -14 = 2w + 4x, 0x - x - 4 = 0. Let t(j) = -j + 3. Determine wt(q) + 2l(q). -q + 1 Let a(w) = -4w - 8. Let z(s) = 16s - 25. Let b(q) = 11q - 12. Let p(l) = -5b(l) + 3z(l). Calculate 5a(k) - 3p(k). k + 5 Let z(k) = 4k - 17. Let q(y) = -14y + 50. Give -3q(t) - 10z(t). 2t + 20 Let k(t) = 8t3 - 6t*2 - 182t + 6. Let m(n) = 15n3 - 11n*2 - 365n + 11. Give 11k(x) - 6m(x). -2x3 + 188x Let r(t) = -2t2. Let n(f) = -16f*2 + 2f - 3. What is -n(b) - r(b)? 18b2 - 2b + 3 Let f(l) = l. Let x(d) = 52d2 + 4d. What is 6f(m) - x(m)? -52m*2 + 2m Let c(a) = a*2 - a. Let t(h) = -302h + 21h2 + 287h - h*2. Determine 15c(w) - t(w). -5w2 Let f(h) = -17h + 14. Let b = -1696 + 1700. Let q(x) = 6x - 5. What is bf(n) + 11q(n)? -2n + 1 Let d = -682 - -683. Let b(c) = -c - 2. Let r(x) = -1. Determine db(l) + 4r(l). -l - 6 Let k(o) = -2o2 + 2. Let m(b) = 24b*2 + 9b - 9. Let n(x) = -13x2 - 5x + 5. Let l(r) = 6m(r) + 11n(r). Determine k(v) - 2l(v). -4v*2 + 2v Let y(r) = -7r - 3. Let c(k) = -9k - 5. Let f(i) = 2c(i) - 3y(i). Let l(m) = -5m + 2. Determine -7f(z) - 3l(z). -6z + 1 Let j(x) = -4029x + 187. Let c(v) = 130v - 6. What is -187c(a) - 6j(a)? -136a Let a(c) = -c2 - 207c + 2. Let v(q) = 5q2 + 1034q - 10. Give 11a(s) + 2v(s). -s*2 - 209s + 2 Let f(h) = 75h - 1. Let b(z) = -149z + 3. Determine 2b(y) + 5f(y). 77y + 1 Let a(n) = n3 - 2n*2 - 2n + 5. Let h be a(2). Let l(c) = c*2 + 3 + 2 - h - 3. Let s(p) = -8p*2 - 5. Suppose 5b - 34 = -4. What is bl(f) + s(f)? -2f*2 + 1 Let z(v) = -30v*2 + 3v + 10. Let d(x) = 6x2 - x - 2. Give 11d(i) + 2z(i). 6i*2 - 5i - 2 Let t(h) = -19h3 - h + 7. Let p(l) = 6l*3 - 2. What is -7p(q) - 2t(q)? -4q*3 + 2q Let u(z) = z - 7. Suppose 0w = -7w + 28. Let h(s) = s - 8. Determine wh(q) - 5u(q). -q + 3 Let g(v) = -37v - 6. Let p(j) = 38j + 9. What is -4g(a) - 3p(a)? 34a - 3 Let h(n) = -n2 - n. Let z be 10/633/55-1. Let c(r) = -r3 - 6r*2 - 6r. What is zc(s) + 4h(s)? s*3 + 2s*2 + 2s Suppose 10 = -u - q + 4q, 2u + 2q - 4 = 0. Let b be ((-1)/(u/6))/(-1). Let g(x) = 7x - 4. Let i(m) = 21m - 2 + 16m - 33m + 0. Give bg(t) + 11i(t). 2t + 2 Let f(k) = -9k3 + 13k*2 + 2k. Let c be (0 - (-1 + -6)) + 0. Let i(z) = -4z3 + 6z*2 + z. Calculate ci(q) - 3f(q). -q3 + 3q2 + q Let k(q) be the second derivative of -q2/2 - 4q + 2. Let y(c) = 2c - 14. Determine 28k(l) - 2y(l). -4l Let v(k) = 497k*2. Let t(d) = 16d*2. Calculate 63t(m) - 2v(m). 14m*2 Let l be (0 + 3)21/(-9). Let j(m) = -10m - 4. Let s = -1 - 5. Let d = s + 4. Let k(h) = 3h + 1. Determine dj(f) + lk(f). -f + 1 Let r(l) = -9l - 21. Let j be r(-3). Let c(w) = -w + 1. Let k be 0 - (1 - 2 - 2). Let a(x) = -4x + 4x2 - kx*2 + 6 - 2x. Calculate jc(d) - a(d). -d2 Suppose -4r = -12, -3a + 2r - 1 = 2. Let s(h) be the third derivative of h4/24 + h3/6 - h*2. Let z(d) = -5d - 6. Determine az(c) + 6s(c). c Let w(o) = -24o + 31287 + 8o - 31292. Let a(x) = 8x + 2. Calculate -5a(m) - 2w(m). -8m Let c(w) = -w + 2. Let x(g) = 3g - 9. What is -2c(b) - x(b)? -b + 5 Let b(z) = 8z2 + 5z - 7. Let y(t) = -156t2 - 171t*2 - 166t*2 + 484t*2 + 8 - 6t. Determine -7b(f) - 6y(f). -2f2 + f + 1 Let l(m) be the first derivative of m4/4 + 3m*3 - 4m + 197. Let k(s) = -s*3 - 5s*2 + 2. Determine -7k(i) - 4l(i). 3i3 - i2 + 2 Let z(p) = 2p2 - 11p + 19. Let d be z(5). Let k(c) = 10c + 3. Let a(f) = 49f + 14. Give dk(x) - 3a(x). -7x Let w(x) = 11 - 5 - 7 + 1 + 1. Let s(q) = 10q - 6. What is s(j) + 6w(j)? 10j Let k(h) be the third derivative of -3h4/8 + 11h*3/6 + 7h*2. Let n(j) be the first derivative of 13j*2/2 - 16j - 2. What is -7k(w) - 5n(w)? -2w + 3 Let o(v) = -20v + 9. Let x(d) = 22d - 10. Determine -5o(g) - 4x(g). 12g - 5 Let f(c) = 15c3 - 4c. Let o(g) = 779g3 - 209g. Suppose l - 4k = 0, 2l + 36k = 38k - 6. What is lo(u) + 209f(u)? 19u3 Let j(x) = -19x + 4. Let z(v) = -3v + 1. Calculate j(s) - z(s). -16s + 3 Let i(f) = 338f2 - 18f - 10. Let j(w) = -1016w2 + 51w + 28. Determine 17i(b) + 6j(b). -350b2 - 2 Let f(m) = m2 - m - 9. Let g(s) = s2 - s - 5. Let k(n) = 48n + 1. Let o be k(2). Let p = o - 92. What is pg(t) - 3f(t)? 2t2 - 2t + 2 Let t(a) = -5a. Let v(c) = -4c + 1. Let m be -3 + (-3)/(9/(-3)). What is mv(s) + 3t(s)? -7s - 2 Let y = -4 + 9. Suppose 93 = yq - 22. Let r(s) = 8s3 + 3s - qs3 + 13s*3 - 5s*2. Let x(z) = -2z*3 - 4z**2	{ "pile_set_name": "DM Mathematics" }
5, -728, -1103, -1606? -p*3 - 52p*2 + 26p - 311 What is the w'th term of 209340, 418725, 628110, 837495, 1046880, 1256265? 209385w - 45 What is the p'th term of 7747, 16323, 25731, 35971, 47043, 58947? 416p*2 + 7328p + 3 What is the k'th term of -1734, -2008, -2222, -2376, -2470, -2504, -2478? 30k2 - 364k - 1400 What is the d'th term of 28816260, 28816247, 28816220, 28816173, 28816100, 28815995, 28815852, 28815665? -d3 - d2 - 3d + 28816265 What is the b'th term of 421245, 1684989, 3791247, 6740019? 421257b*2 - 27b + 15 What is the d'th term of 8012, 63199, 212912, 504413, 984964, 1701827, 2702264, 4033537? 7877d3 + d2 + 45d + 89 What is the z'th term of 1029134, 1029006, 1028662, 1027994, 1026894, 1025254, 1022966, 1019922? -18z3 - 2z + 1029154 What is the h'th term of 7305, 14522, 21551, 28296, 34661, 40550, 45867? -16h3 + 2h*2 + 7323h - 4 What is the z'th term of 3473058, 3473056, 3473054, 3473052? -2z + 3473060 What is the c'th term of 19432, 38798, 58164, 77530, 96896? 19366c + 66 What is the u'th term of 142022910, 142022909, 142022908, 142022907, 142022906, 142022905? -u + 142022911 What is the p'th term of 47031, 93295, 139569, 185859, 232171? p3 - p2 + 46260p + 771 What is the z'th term of 273015, 545958, 818901? 272943z + 72 What is the t'th term of -33, -119, -231, -351, -461, -543? 3t3 - 31t*2 - 14t + 9 What is the y'th term of -211551374, -211551373, -211551372? y - 211551375 What is the y'th term of -51396, -51000, -50604, -50208, -49812, -49416? 396y - 51792 What is the q'th term of 2280661, 2280440, 2280219? -221q + 2280882 What is the r'th term of 326446, 653050, 979654, 1306258, 1632862, 1959466? 326604r - 158 What is the d'th term of -777, -2938, -6499, -11460, -17821, -25582? -700d*2 - 61d - 16 What is the u'th term of 296, 947, 1920, 3209, 4808, 6711, 8912, 11405? -u*3 + 167u*2 + 157u - 27 What is the v'th term of 6536, 26139, 58804, 104531, 163320? 6531v2 + 10v - 5 What is the p'th term of -419786, -419728, -419670, -419612, -419554? 58p - 419844 What is the s'th term of -375, -240, -105, 30, 165, 300? 135s - 510 What is the v'th term of -5148, -9243, -13336, -17427, -21516, -25603? v*2 - 4098v - 1051 What is the t'th term of 13430845, 26861691, 40292539, 53723389, 67154241? t*2 + 13430843t + 1 What is the v'th term of 346102, 692541, 1038994, 1385467, 1731966, 2078497? v3 + v2 + 346429v - 329 What is the u'th term of -1564868, -1564811, -1564754, -1564697, -1564640? 57u - 1564925 What is the y'th term of 14041, 56324, 126809, 225496, 352385? 14101y2 - 20y - 40 What is the q'th term of 5926072, 5926067, 5926058, 5926045, 5926028, 5926007? -2q2 + q + 5926073 What is the s'th term of 10517, 41465, 93045, 165257, 258101, 371577? 10316s*2 + 201 What is the f'th term of 450848, 903785, 1356698, 1809575, 2262404, 2715173, 3167870, 3620483? -2f*3 + 452951f - 2101 What is the g'th term of 766540, 1533102, 2299664, 3066226? 766562g - 22 What is the d'th term of 2202, 9111, 20738, 37083, 58146, 83927? 2359d*2 - 168d + 11 What is the w'th term of 6577210, 6577267, 6577420, 6577717, 6578206, 6578935, 6579952, 6581305? 8w3 + w + 6577201 What is the g'th term of 16442, 32375, 48308, 64241, 80174? 15933g + 509 What is the q'th term of -62326, -62327, -62328? -q - 62325 What is the w'th term of 1255043, 1255058, 1255073, 1255088, 1255103? 15w + 1255028 What is the w'th term of 19453, 38448, 56981, 75052, 92661, 109808, 126493? -231w*2 + 19688w - 4 What is the v'th term of 12264478, 24528957, 36793436? 12264479v - 1 What is the g'th term of 61, 63, 239, 679, 1473, 2711? 15g*3 - 3g*2 - 94g + 143 What is the c'th term of -771161, -3084660, -6940491, -12338654? -771166c2 - c + 6 What is the p'th term of -824307, -3297249, -7418827, -13189047, -20607915, -29675437? -p3 - 824312p*2 + p + 5 What is the s'th term of -67945, -272011, -612123, -1088281? -68023s*2 + 3s + 75 What is the v'th term of -572930, -1145876, -1718820, -2291762, -2864702, -3437640, -4010576? v*2 - 572949v + 18 What is the v'th term of 52654105, 210616417, 473886937, 842465665, 1316352601? 52654104v2 + 1 What is the r'th term of 160108, 1280969, 4323314, 10247887, 20015432, 34586693, 54922414? 160124r*3 - 2r*2 - r - 13 What is the t'th term of -667992, -5344031, -18036132, -42752325, -83500640? -668005t3 - t2 - t + 15 What is the a'th term of -91150, -182311, -273462, -364603, -455734? 5a2 - 91176a + 21 What is the y'th term of -9965, -19383, -28797, -38207? 2y2 - 9424y - 543 What is the o'th term of 315536, 631134, 946728, 1262318? -2o2 + 315604o - 66 What is the w'th term of -584, -1692, -4692, -10526, -20136, -34464, -54452? -157w3 - 4w*2 + 3w - 426 What is the r'th term of 6, 193, 490, 951, 1630? 9r3 + r2 + 121r - 125 What is the w'th term of -1415, -2941, -4489, -6071, -7699, -9385? -2w3 + w2 - 1515w + 101 What is the u'th term of -8166, -7787, -7386, -6957, -6494, -5991, -5442, -4841? u*3 + 5u*2 + 357u - 8529 What is the q'th term of 296790608, 296790607, 296790606, 296790605, 296790604, 296790603? -q + 296790609 What is the v'th term of 28959, 29004, 29107, 29268, 29487? 29v2 - 42v + 28972 What is the c'th term of 54256, 107397, 160538, 213679? 53141c + 1115 What is the n'th term of 71287, 71398, 71509, 71620? 111n + 71176 What is the s'th term of 87, -728, -3269, -8400, -16985, -29888? -144s3 + s2 + 190s + 40 What is the f'th term of -190855, -381720, -572585, -763450? -190865f + 10 What is the t'th term of 102555, 101943, 101329, 100713? -t2 - 609t + 103165 What is the i'th term of 1572, 4457, 9264, 15993, 24644? 961i2 + 2i + 609 What is the t'th term of 1648, 10415, 33428, 77815, 150704? 1188t3 - 5t*2 + 466t - 1 What is the k'th term of 23885, 22757, 21629, 20501, 19373? -1128k + 25013 What is the k'th term of 103440350, 206880701, 310321052, 413761403? 103440351k - 1 What is the q'th term of -5493300, -5493314, -5493328? -14q - 5493286 What is the z'th term of -472293, -944652, -1417011, -1889370, -2361729? -472359z + 66 What is the b'th term of 65296441, 130592878, 195889313, 261185746? -b*2 + 65296440b + 2 What is the d'th term of -32927, -32999, -33071? -72d - 32855 What is the i'th term of 4196, 4142, 4050, 3920, 3752, 3546? -19i*2 + 3i + 4212 What is the s'th term of 720, 4238, 13370, 30924, 59708? 468s3 - s2 + 245s + 8 What is the o'th term of 16882460, 16882466, 16882476, 16882490? 2o2 + 16882458 What is the h'th term of 2727137, 5454344, 8181575, 10908842, 13636157, 16363532, 19090979, 21818510? 2h*3 + 2727193h - 58 What is the w'th term of 356, 699, 1222, 2015, 3168, 4771, 6914, 9687? 15w3 + 238w + 103 What is the h'th term of 17603, 35451, 53511, 71789, 90291, 109023, 127991? h*3 + 100h*2 + 17541h - 39 What is the m'th term of -4771436, -9542870, -14314306, -19085744, -23857184? -m*2 - 4771431m - 4 What is the n'th term of 4973, 5548, 6123, 6698, 7273? 575n + 4398 What is the r'th term of -108965, -221629, -334293, -446957, -559621? -112664r + 3699 What is the l'th term of -88, -849, -3126, -7747, -15540, -27333? -138l3 + 70l*2 - 5l - 15 What is the g'th term of 206596, 413190, 619784, 826378, 1032972, 1239566? 206594g + 2 What is the s'th term of 12342, 13827, 16300, 19761, 24210, 29647, 36072? 494s*2 + 3s + 11845 What is the p'th term of -6188, -49585, -167418, -396917, -775312? -6205p3 + 12p*2 + 2p + 3 What is the s'th term of 308836, 617720, 926696, 1235812, 1545116, 1854656? 8s3 - 2s*2 + 308834s - 4 What is the m'th term of 61, 84, -29, -344, -927, -1844, -3161? -11m3 - 2m*2 + 106m - 32 What is the l'th term of -148, -746, -1788, -3274, -5204? -222l2 + 68l + 6 What is the c'th term of 244506674, 244506676, 244506678, 244506680? 2c + 244506672 What is the m'th term of 19833104, 19833113, 19833122? 9m + 19833095 What is the r'th term of -17627495, -35255004, -52882513, -70510022, -88137531, -105765040? -17627509r + 14 What is the l'th term of 116391, 116447, 116503, 116559, 116615, 116671? 56l + 116335 What is the b'th term of 18130, 17696, 17262, 16828? -434*b + 18564 What is the d'th term o	{ "pile_set_name": "DM Mathematics" }
s the smallest value? (a) -3 (b) 0.126 (c) m a Let v = 224 - 226. Which is the second smallest value? (a) v (b) -3 (c) 8 a Let x = 219 - 1536/7. Which is the third biggest value? (a) 5 (b) x (c) -2 (d) 5/4 b Let i = 2.186 + -0.186. Which is the smallest value? (a) i (b) 6 (c) -3 c Let w be (-1)/(4 - (1 + -5)). What is the third biggest value in 4, w, -3/35? w Let l be 180/(-40) + 2 + 3 + -1. Let p = 10.6 + -11.6. Which is the second biggest value? (a) -2/13 (b) -2/15 (c) p (d) l a Let u = -18668/9 + 2074. What is the smallest value in 2, 3/8, u, -0.3? -0.3 Let o = 349.7 - 352. Which is the fourth biggest value? (a) 0.4 (b) 1 (c) -3 (d) o c Let z = 7 + -11. What is the fourth smallest value in -1, -0.2, z, 1/5? 1/5 Let p = -633 - -8227/13. What is the third smallest value in 1, -0.02, -1, p? -0.02 Let c be (-5 - -1)(203/42)/(-29). What is the second biggest value in 20, c, 1? 1 Let z = -1.83 - -19.63. Let l = 1.8 - z. Let w = 12 + l. What is the third biggest value in w, -1, 2? w Let b = 46 - 15. Let z = 35 - b. What is the smallest value in -0.3, -2, -0.2, z? -2 Suppose 4n + 4 = 0, -5o - 39 = n - 38. Which is the third smallest value? (a) -0.4 (b) o (c) 3 (d) 28 c Let h(k) = 15k - 285. Let f be h(19). What is the second smallest value in f, -1/2, 0.02? f Suppose -4r = 0, 3u - 4r + 0r + 18 = 0. What is the third biggest value in -2/5, u, -8? -8 Let z = 14/15 + -3/5. Let w = 18032/45 - 2003/5. What is the third smallest value in 0, z, w? z Let r be -13(-1)/262. What is the biggest value in r, 0.1, 5, -3? 5 Let l = -11.07 + 0.07. Let n = 12 + l. Let w = -19 + 75/4. Which is the biggest value? (a) n (b) -1/3 (c) w a Suppose 0 = 12d - 7d - 40. Let r = d - -5. Suppose 2l + r = 3u, l - u = -8 + 4. What is the biggest value in 7, l, 2? 7 Let d = -10 + 4. Let m = -60 - -59.4. Let k = m - -5.6. What is the biggest value in k, d, -0.1? k Let t(u) = 2u - 26. Let i be t(11). Let v = -56 - -54. Which is the third biggest value? (a) v (b) 2 (c) i c Let q be ((-5)/(-2))/(-5)4. Let c = -0.1506 + 0.3506. What is the third smallest value in -9/2, q, c? c Let w = 310.15 - 310. Which is the third biggest value? (a) 0.7 (b) w (c) -0.2 c Let p(u) = u - 13. Let z be p(12). Let h = -39 + 46. Which is the smallest value? (a) 1 (b) h (c) z c Let i = -30.93 - -31. Let x = -21.22 + 0.22. Let v = x - -25. Which is the smallest value? (a) i (b) 3 (c) v a Let r = -56 - -56. Which is the third biggest value? (a) r (b) 146 (c) -1/9 (d) -1/4 c Let j = 198 + -198.266. Let d = -0.034 + j. Let x = -0.06 - -0.56. What is the biggest value in 7, d, x? 7 Let f = -215.8 - -216. Which is the third biggest value? (a) 153 (b) f (c) 5 b Let n = 162 + -162.5. Let p = -2 + 3. Let t = p + n. Which is the third smallest value? (a) 3/2 (b) -2 (c) t a Let p = -1.925 - 0.075. What is the second smallest value in p, 6/5, 0.4? 0.4 Let j = 649 - 651. What is the second smallest value in j, 0.58, -1/2? -1/2 Let q = 3.491 + -0.491. Which is the second biggest value? (a) 43 (b) q (c) 0 b Let w = -8 - -11. Let t = 8148 + -8150. Which is the smallest value? (a) w (b) t (c) -0.1 b Let q = -13947 - -13946.5. Let n = 2 - 6. Let k be (-6)/4n/6. Which is the second smallest value? (a) 0.1 (b) q (c) k a Let m = -0.02 + -0.08. Let u = -0.07 + 0.37. Let k be 3/((-2)/((-2)/7)). What is the third biggest value in k, m, u? m Let s be 5/((-250)/(-105)) - 3/5. Suppose -4y - 4f = 3 - 23, -2y - 3f + 15 = 0. What is the third smallest value in 1/4, y, s, -1/5? 1/4 Let i = -0.01 - -4.01. Let h = 1871.5 - 1872. Which is the biggest value? (a) 9/2 (b) h (c) i a Let l = -616/3 + 205. Suppose 20 = 5o - 5h, 5h = 3h - 2. Which is the fourth smallest value? (a) l (b) o (c) 1 (d) 6 d Let n = 0.821 + -1.121. What is the second smallest value in -14, 0.1, n? n Let f(u) = -10u*2 - 120u - 22. Let o be f(-12). Which is the second smallest value? (a) 2 (b) -1 (c) o (d) 3 b Let w = 376.142 + -375. Let j = w - 1.2. Which is the smallest value? (a) -0.1 (b) j (c) 4 a Let p = -23 - -15. Let w = -1.5 + -8.5. Let t = p - w. Which is the biggest value? (a) 10 (b) 0.2 (c) t a Let h = 18.9 - -4.1. Let z = h - 22.5. Let s = 83 + -335/4. Which is the second biggest value? (a) 1/3 (b) z (c) s a Let y = 302.5 - 303. What is the second smallest value in 0.1, y, 6, 2/5? 0.1 Let q be 3 - (-21 - 85/(-15)). Let h = -1 - -3. What is the second smallest value in h, q, -2/7? -2/7 Let h be 3/1565/52. What is the second biggest value in h, 186, -3/5? h Let v = 16.5 + -17. Let o = -26.72 - -26.7. Let u(r) = r*2 - 5r + 2. Let t be u(4). Which is the second biggest value? (a) t (b) o (c) v c Suppose -16 = -y - 0y - 4h, 3y = -2h + 98. Let o be (-42)/y + 2/(-12). Which is the smallest value? (a) 1/8 (b) o (c) 1/18 b Let u = -74 - -75. Which is the fourth smallest value? (a) 7 (b) u (c) 4 (d) -4 a Let p = -696 - -687. What is the smallest value in p, -2, -10? -10 Suppose 14p = 178 - 220. Let z = -0.05 + -0.11. Which is the second smallest value? (a) z (b) -5/6 (c) p b Let r(l) = l3 - 4l*2 - 6l + 5. Let y be r(5). Let p = -161 - -160.9. What is the second smallest value in y, -4, p? p Let k = -803 + 803.5. Let p be -1(-1)/(-3) + 0. Suppose v - 5 = 2v. What is the second smallest value in p, k, v? p Let x = 18.6 + -0.6. Let s = 17 - x. Which is the third smallest value? (a) s (b) 2/3 (c) -0.4 b Let g be -7 + -1(-261)/36. What is the third biggest value in -0.1, -0.3, g, -1/35? -0.1 Let g = 19 - -3. Let p = 22 - g. What is the third biggest value in -0.6, p, -3/2, -0.5? -0.6 Let g = 0.1381 - 0.1381. Which is the second biggest value? (a) g (b) -0.3 (c) 2/23 a Let d = -83 - -63. Let y = d - -19.7. Which is the second smallest value? (a) 1/7 (b) -1 (c) y c Let o(y) = 2y3 + y2 - 9y - 10. Let p be o(-3). Let v be p/(-7) + (-3)/1. What is the second smallest value in v, -2, 0.3? 0.3 Let p be (120/14)/2 - (-10 - -14). Let o be (3/(-10 + 1))/(-1). What is the third smallest value in -4, p, o? o Let k(g) = -g. Let x be k(-1). Let n = 260 + -259.94. Which is the biggest value? (a) n (b) x (c) -2/7 b Let q be ((-18)/544)/(0 - 2). Let p = 0.08 - -4.92. Which is the fourth biggest value? (a) 2/13 (b) p (c) 0.1 (d) q c Let o be (26/247 + (-15)/(-38))16. What is the fourth biggest value in 0.4, o, -1, 1/3? -1 Let w = -2.34 - -4.34. What is the smallest value in 5, w, -1? -1 Let p = 5 + -7. Let b = 93.3 - 93. What is the third smallest value in b, 2, p? 2 Let l = 12.13 + -11.93. Which is the third biggest value? (a) l (b) -4 (c) -118/7 (d) -3 b Let r = -281 + 274. Let v be (3 + 1)1/(-10). Which is the second biggest value? (a) v (b) r (c) 9 a Let n = 0.7 + 2.3. Let o = 38.64 + -38.6. Which is the third smallest value? (a) n (b) o (c) -4 a Let g be -2(2/5 - (-78)/(-170)). Let y = -4 + 0. Let a be (-2)/y - (-4)/8. What is the biggest value in a, g, -4/5? a Let x = 0.2 + -0.3. Let v be (14/15)/(6/5). Let k = v - 44/45. Which is the smallest value? (a) x (b) k (c) -1/2 c Let o = -0.28 - -2.3. Let n = 1.72 - o. Let r = -2 + 7. Which is the third smallest value? (a) 2 (b) n (c) r c Let k be (4/6-1)/((-10)/(-45)). Which is the second smallest value? (a) -11 (b) k (c) 3/5 b Let f = -1264 - -1267. Let x = 2 + 2. Which is the smallest value? (a) 0 (b) f (c) x a Let o = 771 + -5395/7. Which is the third biggest value? (a) o (b) -1 (c) 0.1 (d) -4 b Let h = -87 - -86. Suppose 4b - 25 = -5y, 4y - 3b + 16 = b. Let o = 9 - 14. What is the second smallest value in h, o, y? h Let i = 0.0176 - 0.5176. Let n = -0.21 - -0.14. Which is the third smallest value? (a) 3 (b) i (c) n a Let x = -303.986 + 301. Let v = x - 0.014. Let j be ((-6)/(-3)1)/5. Which is the second biggest value? (a) v (b) -0.2 (c) j b Suppose -68 = 3m + 4f, -57 = 4m - 5*f + 44. Let j = 5432/3 + -1835. Let y = j - m. What is the second biggest value in 5, 0.3, y? 0.3 Let x = -28/39 + 5/13. Let n = -9.8 - -9.902. Let t = n - -0.098. Which is the second biggest value? (a) -0.4 (b) x (c) t b Let h = -106 - -101.7. Let f = h + 4. What is the third smallest value in 2/7, -2/9, f? 2/7 Let u = -0.4523 - 0.0477. Which is the second	{ "pile_set_name": "DM Mathematics" }
cj2 - 2cj + 833495c + j*2 wrt j. -544574c + 2 What is the first derivative of 38g3 - 451gz2 - 89361z*2 + z wrt g? 114g*2 - 451z*2 Find the third derivative of 156b*3j*3n*2 + 20310b*3n4 + b2j3 - 3bj3n + 2j3n*4 - 2jn2 wrt n. 487440b*3n + 48j3n Find the first derivative of 200xy*2 + 10xy + 57x - 2y2 + 7081 wrt x. 200y*2 + 10y + 57 Differentiate 138k3 - 82k*2 + 116926 with respect to k. 414k*2 - 164k What is the derivative of 6k4 + 4213k - 91529? 24k3 + 4213 What is the first derivative of 303a*3l + 16777a3 + 13a*2il2 - 11a*2i + 2ai - 4l2 wrt l? 303a*3 + 26a*2il - 8l What is the second derivative of 3r5 + r4 + 1217r*3 + 93r + 147 wrt r? 60r3 + 12r*2 + 7302r Find the third derivative of -217377r6 + 7r*2 - 7373r. -26085240r3 Find the third derivative of i2st3 + i2st2 - 112i*2st - 6i*2s + 3it*4 + it*2 + 3013st3 wrt t. 6i*2s + 72it + 18078s What is the second derivative of -2j*4 - 288928j*2 + 18476j - 111? -24j2 - 577856 Find the second derivative of 3jo2q*2 + jo*2q - 10joq3 + 4727o*2q*3 + 19913oq3 wrt o. 6jq2 + 2jq + 9454q*3 Find the second derivative of 151828j*4 - j - 18621. 1821936j*2 Find the third derivative of 5m*6 + 4697m*3 + 2123m*2 + 3m - 1. 600m3 + 28182 Find the second derivative of -9o*3x - 11o3 - 128o*2x*2 - 3ox2 + 3o - 856x2 + 3x wrt o. -54ox - 66o - 256x*2 What is the first derivative of -4gm2r + 3gm - 21168gr - 4g - 146m*2r + 8mr + r - 3 wrt m? -8gmr + 3g - 292mr + 8r What is the second derivative of 10i*2uv2w - 21i2uw - 6i*2u - 2ivw - 2uv2 + 692uw - 2w wrt i? 20uv*2w - 42uw - 12u What is the second derivative of -63189co2 + 17co - 218o wrt o? -126378c Find the third derivative of -53181c*2x*5 - 2c*2x4 + c2x2 + 602c*2 wrt x. -3190860c*2x*2 - 48c*2x Find the first derivative of -1127384l2 + 752615 wrt l. -2254768l Find the second derivative of 2a4 - 9a*3 - 178a*2 - 2710a + 9. 24a2 - 54a - 356 What is the second derivative of -3p5y*3 + 28246p*4y - 14py3 + p - y3 - 67 wrt p? -60p3y*3 + 338952p*2y Find the second derivative of -47740r5 - r + 58411 wrt r. -954800r*3 Find the second derivative of -288g*2mo2 + 352g*2mo - 15gmo*2 - gmo + gm + 2mo2 + o2 + o wrt o. -576g2m - 30gm + 4m + 2 Find the first derivative of -22386m*2o - 90888m2 + 10mo2 - 3 wrt o. -22386m*2 + 20mo Find the third derivative of m5 - 2738m*4 - 3m*3 - 2m*2 + 26106. 60m*2 - 65712m - 18 Find the second derivative of 309792t3 + 52566t - 2. 1858752t Find the third derivative of -6iq2t*2y - 3iq*2y*2 - 307iqt*2y*3 - 11iqy*2 + it*2y + 9q3ty3 + 6q*3ty + 13q*2y*2 wrt y. -1842iqt*2 + 54q*3t Find the third derivative of 6c4 + 2104c*3 + 23538c*2 - c. 144c + 12624 What is the first derivative of 465v2 - 825v - 1134225 wrt v? 930v - 825 What is the third derivative of -78176f*3 + 3018f*2 + 35f - 2 wrt f? -469056 What is the derivative of 296877y4 - 427952 wrt y? 1187508y3 What is the second derivative of -n3p - 451632n*2p + n - 26269p wrt n? -6np - 903264p Find the first derivative of -2vy*2 - 83195vy - v + 549078y*2 wrt v. -2y*2 - 83195y - 1 Find the second derivative of 2239m5 + 9m*3 + 18551m. 44780m3 + 54m Find the third derivative of 6m4t - 2m4 - 15m*3t - 33m3 - 224m*2t - m*2 - 4t wrt m. 144mt - 48m - 90t - 198 What is the second derivative of -382232j3 + 493127j? -2293392j Find the second derivative of 17a*2x3 - a2x2 + 293a*2x - a*2 - 171707ax3 + 2a wrt a. 34x3 - 2x*2 + 586x - 2 Find the second derivative of 13264a5 + 56a*2 + 1667606a wrt a. 265280a3 + 112 Find the second derivative of 1791084r*2 + 181482r wrt r. 3582168 Find the third derivative of 2y6 + 2759y*4 + 10104y*2 - 2 wrt y. 240y*3 + 66216y What is the second derivative of 118098u3 - 349u + 352 wrt u? 708588u What is the derivative of -3030706v + 985726 wrt v? -3030706 What is the derivative of -144878p - 30975 wrt p? -144878 Find the third derivative of -36756s*3 - 169s*2 - 104s wrt s. -220536 What is the derivative of 1814358g4 + 2323269? 7257432g*3 Find the third derivative of -5i*4 - 11729i*3 - 3i*2 + 4027i - 7 wrt i. -120i - 70374 Find the second derivative of 50617h*2 + 67820h. 101234 Find the first derivative of -705d2y - d*2 + 5dy2 + 3d - 2y2 - 13y - 209 wrt d. -1410dy - 2d + 5y*2 + 3 Find the first derivative of -345231c*3p*2 + cg*3p - 3g3p*2 + 6g*3p - 2g3 + 934gp2 + 3p*2 wrt c. -1035693c*2p2 + g3p What is the third derivative of 47682o*5 + 4o*2 + 724o - 2? 2860920o2 Differentiate -194ap3 - ap*2 - 4ap - p3 - 97p*2 - 60 with respect to a. -194p3 - p2 - 4p What is the first derivative of 2w*2 - 76179w + 138530? 4w - 76179 Find the third derivative of 2d*4l - 20168d4 - d3l - 3d3 - 2d*2l + 1016d2 - 7dl - 1 wrt d. 48dl - 484032d - 6l - 18 Find the second derivative of -3060g*5 + g - 5351. -61200g*3 Differentiate -1118610z*3 - 2z*2 - 5379044. -3355830z*2 - 4z What is the derivative of -34245l - 53352? -34245 Find the third derivative of 194o*3z3 - o3z2 - 17o*3 + 823o*2z + 146z3 wrt o. 1164z*3 - 6z*2 - 102 What is the third derivative of 2h*4 - 19545h*3 - 77h*2 + 16h wrt h? 48h - 117270 Differentiate 17681f*4 - f - 42737 with respect to f. 70724f*3 - 1 Find the second derivative of 363r*4 - 11r*2w*3 + 162rw3 - 18r - 2 wrt r. 4356r2 - 22w*3 Find the first derivative of -76q*3 + 798q*2 + 4q - 2045618 wrt q. -228q2 + 1596q + 4 Find the first derivative of -195460j - 488528 wrt j. -195460 What is the second derivative of 3a*2b*2 - 11756a*2b - ab2 - 2ab + 24135b*2 wrt a? 6b*2 - 23512b Differentiate 99025b - 27024 with respect to b. 99025 Find the second derivative of 65099q*3 - 2013q + 25 wrt q. 390594q What is the first derivative of 51041b*2p - 84288b2 - 2b wrt p? 51041b2 Find the third derivative of 70385x*3 - 69023x*2 wrt x. 422310 What is the second derivative of -163627b*2p + 2bp + 91522 wrt b? -327254p What is the third derivative of i4 - 359606i*3 - 79i*2 - 5i - 101? 24i - 2157636 Differentiate 695164l*3 + 805187 with respect to l. 2085492l*2 What is the first derivative of -52g*3k + 99g2 - 3g + 33331k wrt g? -156g*2k + 198g - 3 What is the second derivative of -2207667n*2 + 6n - 185894? -4415334 What is the second derivative of -88b2pr + 733b*2p + 2b2 - 19bpr - 10pr + 11p - 1 wrt b? -176pr + 1466p + 4 Find the third derivative of 518ij*3t*3 - 5ij2t*2 - 2ij - 4im - 36j*3mt2 - 31j*2mt3 + 4jmt*3 + mt*3 - 3t*3 wrt j. 3108it3 - 216mt2 What is the third derivative of 2ar6 - 14018ar3 + 914ar2 + 8r wrt r? 240ar*3 - 84108a Find the third derivative of -521206k3 + k2 + 2k + 82994 wrt k. -3127236 Find the second derivative of -2168362n2 + 2058950n wrt n. -4336724 Find the first derivative of 13k3qt - 272k*3q + 31k3 - 1417kqt wrt t. 13k3q - 1417kq Differentiate 4mo - 13mv*2 + 1054m - ov3 + 600v*3 with respect to v. -26mv - 3ov2 + 1800v*2 Find the second derivative of jk*3 + jk*2 + 2jk + 69j + 783k3 - 12k*2 + 62k - 1 wrt k. 6jk + 2j + 4698k - 24 Differentiate 2y3 - 20294y*2 - y - 3262114. 6y*2 - 40588y - 1 What is the second derivative of 30m5 + 709m*2 - 565m + 44? 600m3 + 1418 Differentiate 189o*4 + 43o*2 + 30o + 2325882. 756o3 + 86o + 30 What is the derivative of 4d4m - 12483dm - 23541m - 43 wrt d? 16d*3m - 12483m Find the first derivative of -810781w + 963925 wrt w. -810781 Find the second derivative of 15w5 - 570w*3 - 34637w. 300w3 - 3420w What is the second deriva	{ "pile_set_name": "DM Mathematics" }
+ 9363s3 + 38 + 2s*4 - 16298261s*2 + 16298255s*2 wrt s? 48s + 56178 Find the third derivative of 317k2 + 216k*2 + 1108k*2 - 2612k*2 + 127k*3 wrt k. 762 Find the third derivative of -2k*2 + k + 13k*3 - 745 - 3k*2 + 3k*2 + 8k*5 - 22k*5 - 432 wrt k. -840k*2 + 78 Let m(l) be the second derivative of 1/2l*4 - 2l + 0l5 - 7/30l*6 + 0l*3 + 27l*2 + 6. Differentiate m(g) with respect to g. -28g*3 + 12g Let f(k) be the second derivative of -1424k7/21 - k4/3 - 255k*3/2 + 4k - 74. What is the third derivative of f(m) wrt m? -170880m2 Let d(p) be the third derivative of -11/12p*5 + 37/210p*7 + 0p*4 + 0p*3 - 10p*2 - 1 + 0p*6 + 0p. What is the third derivative of d(y) wrt y? 888y Suppose 7y = -y + 32. Let d(i) = 225i + 76. Let c(r) = 2r - 1. Let l(q) = yc(q) - d(q). Differentiate l(j) wrt j. -217 Suppose 4p - 89 = -d, -p + 18 = -4d - 17. Let f be 48/26 - (-2)/13. What is the second derivative of -11y*2 + 17y*f + py*2 + 27y wrt y? 58 Let b be (-8)/(120/5) - (-7)/3. Find the third derivative of 21lb + 74l*6 - 29l2 + l2 wrt l. 8880l3 Let p(t) be the second derivative of -1421t*6/30 - 214t*3/3 + 1257t. What is the second derivative of p(h) wrt h? -17052h2 Let t(j) = j3 - 32j*2 + 60j + 2. Let h be t(30). What is the third derivative of -70g5 - 3g*4 + 131g*h + 3g4 - g5 wrt g? -4260g2 Let n = -31 + 36. Suppose 5d - 6 = ng - 2g, 0 = -2d + 2g. What is the second derivative of -dr2 + 16r - 3r + 12r*3 + 3r*2 wrt r? 72r Let n(t) = 12t2 + 23t - 6455. Let i(z) = z*2 + z - 5. Let g(u) = 4i(u) + n(u). Differentiate g(q) wrt q. 32q + 27 Let a(n) = -6n*2 + 1. Let h(k) = 3692k*2 + 991k + 1. Let r(f) = a(f) - h(f). What is the second derivative of r(y) wrt y? -7396 Let l(y) = 3y3 + 54y + 17849 - 17849. Let t(z) = -3z3 + z2 - 55z. Let s(f) = 3l(f) + 2t(f). Find the second derivative of s(i) wrt i. 18i + 4 Let d(l) be the first derivative of 0l*2 - 81l + 71/3l3 - 49. What is the first derivative of d(t) wrt t? 142t Let u(q) = -25q + 11. Let z be u(-3). Suppose -3t + z = 74. Differentiate -18 - 280a3 + 15a*t + 140a*3 + 140a*3 wrt a. 60a*3 Let f be (-54)/135 - (-187)/5. Differentiate 4s4 - s3 - s + f - 201 + s3 - s4 with respect to s. 12s3 - 1 Let c be 72/(-90)(-3)/2. Let o(q) be the second derivative of -1/2q2 - 19q + 0 + 0q4 + cq*5 + 0q*3. Differentiate o(t) with respect to t. 72t2 Let l(v) = -v3 + v + 1. Suppose -15 = -5y - 5b, 4y = 4b + b - 24. Let f(s) = -17s3 + s - 29. Let g(o) = yl(o) + f(o). Differentiate g(i) wrt i. -48i2 Suppose 5f - y - 210 = 0, 4y - 149 = -12f + 9f. Find the third derivative of -203n*2 + fn*2 - 924n*5 + 779n*5 wrt n. -8700n*2 Let p(s) = -658s - 810. Let r(w) = 329w + 417. Let n(a) = -6p(a) - 13r(a). Find the first derivative of n(i) wrt i. -329 Let d = -26 - -103. Find the second derivative of -47o*4 - 18o*4 - o - 7o*4 - 33 - do*4 wrt o. -1788o*2 Let g(l) = 945l*3 - 11l*2 - 633l + 15. Let y(i) = 1418i3 - 17i*2 - 949i + 24. Let f(u) = -8g(u) + 5y(u). Find the third derivative of f(j) wrt j. -2820 Suppose 2r = -5m + r + 85, 10 = 2r. Let w = -13 + m. Find the second derivative of 13q - 19qw + 11q - 11q wrt q. -114q Let s(y) = 2684y2 - 13y + 52. Let p(b) = -13421b2 + 66b - 264. Let q(n) = 4p(n) + 21s(n). Find the second derivative of q(v) wrt v. 5360 Let h(f) = -9f4 - 523f - 4308. Let s(y) = 17y4 + 1047y + 8613. Let l(n) = -13h(n) - 7s(n). What is the first derivative of l(x) wrt x? -8x3 - 530 What is the third derivative of -p3 - 804p*2 - 86p*2 - 4726p*6 + 5010p*6 - 2p*3 + 2p*3 wrt p? 34080p*3 - 6 Let d be (3/(-4))/(23/(-92)). Find the third derivative of -12v*2 - 376v*3 + 177v*3 - 10v*2 + 165v*d wrt v. -204 What is the second derivative of 45q - 5q - 288q*3 + 45q*3 - 13q + 15 + 34q wrt q? -1458q Suppose -z - 31 = -5z - s, -3z = 2s - 27. Suppose 5k - 28 = -5x + 42, -4x = -2k - 32. Differentiate -zn + 3n + 2n - xn + 4 with respect to n. -12 Let r(p) = -6510p*2 + 48p + 41. Let v(u) = 3256u2 - 23u - 21. Let f(w) = 3r(w) + 7v(w). Find the second derivative of f(i) wrt i. 6524 What is the second derivative of 631m3 - 7825m - 2395m3 - 6658m*3 - 181m wrt m? -50532m What is the second derivative of 178p*4 + 1174p*4 - 1228p - 228p wrt p? 16224p*2 What is the second derivative of 16n + 1825n4 + 246n*4 + 627n*4 + 217n*4 - 4988n wrt n? 34980n2 Let n(i) = -9i*3 + 2i*2 + i - 1. Let r(u) = -1133u*3 - 6191u*2 - 5u + 5. Let v(x) = -5n(x) - r(x). Find the third derivative of v(q) wrt q. 7068 Let m(p) = 15p*3 - 2559p*2 - 10p + 5. Let a(l) = -17l3 + 2563l*2 + 8l - 4. Let x(d) = -5a(d) - 4m(d). What is the third derivative of x(y) wrt y? 150 Let s(m) be the first derivative of -231 - 250m - 2/5m*5 + 0m*2 + 0m*4 + 53/3m*3. Differentiate s(y) with respect to y. -8y*3 + 106y Let v(u) = -u*3 - 9u*2 - 19u - 1. Let x be v(-6). Find the second derivative of 40q5 - 82q*5 + 28q*x - 119q - 4q2 wrt q. -280q*3 - 8 Suppose 116 + 178 = 7t. Suppose t = 4b + 5z, -2b - b - 3z + 30 = 0. Find the first derivative of -1 + 23r - 6 - 4 - b wrt r. 23 What is the third derivative of 136z*3 - 1164z*3 + 386z - 719z3 + 4z*2 - 1281z*3 - 446z wrt z? -18168 Let r = 730 - 679. Find the third derivative of -ra5 + 0 - 101a*5 + 81a*2 - 134a*2 - 1 wrt a. -9120a*2 Suppose -4j - 4f + 707 = -3f, 2f = 4j - 698. Differentiate -9g2 + 4g*2 - 8 - 7g*2 + 13 - j - 9g with respect to g. -24g - 9 Let c(w) = -w2 + 25w + 37. Let x be c(26). What is the first derivative of -55v2 - 41 - 9v + xv + 63 + 40 wrt v? -110v + 2 Let f be (-2 - 7/(-2)) + 18/(-12). Let y(i) be the first derivative of -9 - 31i + 17/4i*4 + fi*2 + 0i*3. What is the derivative of y(a) wrt a? 51a*2 Let w = 391 - 386. What is the third derivative of 34t*2 + 12t*w + 79t*2 + 9t*2 wrt t? 720t*2 Differentiate 412 - 3d - 424148d3 - 2d*2 + 424239d*3 - 73 wrt d. 273d*2 - 4d - 3 Let c(k) = 5935k3 + 3558k*2 - 10. Let a(b) = -5941b*3 - 3560b*2 + 8. Let r(u) = -5a(u) - 4c(u). Find the third derivative of r(y) wrt y. 35790 What is the first derivative of 2931 + 3491 + 226 + 7023d*2 - 302 + 1080 wrt d? 14046d Find the first derivative of 2109 + 2068v4 - 1887 - 3692 wrt v. 8272v*3 Let o(d) = -31d*3 + 28d*2 + 22d - 13. Let f(a) = -67a3 + 54a*2 + 45a - 26. Let r(q) = 6f(q) - 13o(q). What is the second derivative of r(h) wrt h? 6h - 80 Let t(c) = 137c*4 + 2c*3 - 469c*2 - 4. Let g(i) = -5i*4 + 2i3 + i2 + 1. Let r(v) = -4g(v) - t(v). What is the third derivative of r(j) wrt j? -2808j - 60 Let q(m) be the first derivative of 498m6 + 185m*2 + 11m + 5165. What is the second derivative of q(h) wrt h? 59760h3 What is the third derivative of -c2 - 125 - 4c*4 + 982c*5 - 256 - 982c*5 - 62c*6 + 10c*6 wrt c? -6240c*3 - 96c Suppose 3i = 2z - 19, 5z + 3 - 28 = 0. Let f be (-1)/33 - (-6 - i). What is the third derivative of 5r5 - fr*5 + 3r*5 - 2r*2 - 5r*5 wrt r? 60r*2 Let o(t) be the third derivative of 113t*6/30 + 23t*3/3 - 11t*2 + 9t. Find the first derivative of o(s) wrt s. 1356s2 Let x(r) = -269r*2 - 19r + 79. Let k(g) = 279g2 + 18g - 78. Let f(a) = -3k(a) - 2x(a). What is the second derivative of f(i) wrt i? -598 Let n(x) be the first derivative of 203x6/6 - x2 - 1442x + 356. What is the second derivative of n(a) wrt a? 4060a3 Let i be ((-6)/(-12))/((-1)/2). Let h be (-97 - (-4 - i))/(-2). Find the third derivative of 23z - hz - 8z*3 + 24z + z*2 wrt z. -48 Let j be (8/(-7))/((-12)/42). Suppose -4x + 4a + 84 = -j, 0 = 4x - a - 103. Differentiate -19z3 - 10z*2 + 6z*2 + 4z*2 - x with respect to z. -57z*2 What is the third derivative of -2829t*6 - 39 + 42 + 38t*2 - 21 wrt t? -339480t*3 Let l(y) be the third derivative of -1007y*5/60 - 17y*4/24 - 5y*3 + 84y**2 + 1. What is the second derivative of l(p) wrt p? -2014 Let i(l)	{ "pile_set_name": "DM Mathematics" }
(d) 3 (e) 0.07 b Which is the fourth smallest value? (a) -0.07104 (b) 3 (c) -1/9 (d) -3 b What is the second smallest value in -2/29, 1/8, -4? -2/29 What is the second smallest value in 3/2, -2, 23? 3/2 Which is the biggest value? (a) 1/6 (b) 2/11 (c) 2/5 (d) 3 d What is the second biggest value in -8723, -5, -0.3, 4/7? -0.3 Which is the second biggest value? (a) -887 (b) -3 (c) 1 b What is the fifth biggest value in 4, 6, -4/3, -0.2, 0? -4/3 Which is the biggest value? (a) -0.08 (b) -5 (c) 4.6 (d) 0.5 c What is the fourth smallest value in 1.2, 278, 1/7, 2, -1/2? 2 What is the second biggest value in -1, -5, 5, 8, 0.18? 5 What is the smallest value in -2/35, -1/7, -0.04? -1/7 What is the smallest value in -7, -3, 10, 0.2? -7 What is the third smallest value in 219, -0.5, 2? 219 Which is the biggest value? (a) 25 (b) -0.27 (c) -4 a What is the third biggest value in 0.3, 112, -5, 7? 0.3 Which is the third biggest value? (a) -2/5 (b) 0.2 (c) -3 (d) 0.3 a What is the fourth biggest value in 4, -3/8, -3/10, -14/5? -14/5 Which is the smallest value? (a) 0.2 (b) -56 (c) -0.4 (d) 1 b Which is the second smallest value? (a) 5 (b) -10 (c) 0.3 (d) -1/8 d What is the second smallest value in 2/37, 5, -0.1, 4, 11/5? 2/37 Which is the smallest value? (a) -0.3 (b) -5 (c) 0.2 (d) 3/7 b Which is the second smallest value? (a) 0.1 (b) 100 (c) -0.5 a Which is the biggest value? (a) 1 (b) -5 (c) -0.1 (d) -4 (e) 3/5 a Which is the second biggest value? (a) 2 (b) 3 (c) 4/17 a What is the second smallest value in -0.2, -0.4, -3/7, -0.047? -0.4 Which is the fourth smallest value? (a) -0.02 (b) 2 (c) -1/11 (d) -0.04 b Which is the fourth biggest value? (a) -1 (b) -0.055 (c) -0.2 (d) -1/9 a What is the second biggest value in 3/2, -4, 2/9, 1? 1 What is the second smallest value in -2, -2/13, 2, 0? -2/13 What is the biggest value in 3, 2/5, -0.04? 3 What is the third biggest value in 0, 0.5, 13, -1, 4? 0.5 Which is the biggest value? (a) -0.1 (b) -2 (c) 11 (d) 2 (e) 0.3 c What is the second smallest value in 4, -1/9, 0.1, -1/2, 2? -1/9 What is the second biggest value in -0.2, 3, 4, -1? 3 Which is the smallest value? (a) -46 (b) -0.5 (c) 3/4 (d) 4 a Which is the second biggest value? (a) 4 (b) -0.2 (c) 338/3 (d) 1 (e) 0 a What is the second biggest value in -0.03, -5, 13, -0.1? -0.03 What is the smallest value in 0.2, -0.09, 87? -0.09 What is the fourth smallest value in 1, -2/11, -3/5, -5? 1 What is the third biggest value in 0.1, -75, -2/159? -75 What is the fourth smallest value in -2/5, 5, 41, 1? 41 What is the smallest value in 3, -0.3, 2.73, -0.5? -0.5 What is the third biggest value in -2/7, -7.9, 5, -2/11? -2/7 What is the third biggest value in -0.13, 5, -2, -2/17, 0? -2/17 Which is the biggest value? (a) -0.5 (b) -0.2 (c) 808/11 c Which is the second smallest value? (a) 22 (b) -1 (c) 11 c Which is the smallest value? (a) 3 (b) -4 (c) -6/233 (d) 0.3 b Which is the second smallest value? (a) 57/8 (b) -3 (c) 3 c Which is the third biggest value? (a) 0 (b) 2 (c) -21 c What is the third biggest value in -16, -0.02, 0, -1, 2? -0.02 What is the third biggest value in -1, -0.01, 3, -3? -1 What is the third biggest value in -0.3, -2/11, -5/2, -0.08? -0.3 Which is the second smallest value? (a) 24 (b) 14 (c) -4 (d) 1 d Which is the smallest value? (a) -14/355 (b) 3/4 (c) 3/5 (d) -4 d Which is the second biggest value? (a) 4172 (b) -2 (c) 2 c Which is the second biggest value? (a) 0 (b) -11 (c) 0.3 (d) -1/4 a What is the third biggest value in 3/7, -61, -1/2? -61 What is the second biggest value in -2/9, 2/9, -0.1, 2/19, 3? 2/9 What is the fifth biggest value in 5, 0.4, 30, 5/6, 0.2? 0.2 What is the fourth smallest value in -2.6, 58, 0.1, -4, 2/7? 2/7 Which is the fourth biggest value? (a) -1/3 (b) 0.12 (c) 6 (d) -0.2 a What is the third biggest value in 2, 2/13, -4, -2/51? -2/51 What is the third biggest value in 2/3, -0.4, 14? -0.4 Which is the biggest value? (a) -0.4 (b) 5/7 (c) 4 (d) 3 c What is the smallest value in -292, 2/9, 2? -292 What is the second biggest value in -1, 4, -2, -26? -1 Which is the third smallest value? (a) -0.8 (b) -3 (c) 0.3 c What is the fourth smallest value in 0.2, -0.4, -3/7, 1/7, -2/3? 1/7 What is the smallest value in -3/5, -0.06, 1, 5/2, -1/382? -3/5 Which is the biggest value? (a) 5 (b) -0.065 (c) -27/4 a Which is the third biggest value? (a) -0.3 (b) 2 (c) -11 c Which is the fourth biggest value? (a) -5 (b) -199 (c) 5 (d) 3 b What is the third biggest value in 4, -9, 12? -9 What is the fourth biggest value in 37.5, 0.3, 2, 2/5? 0.3 What is the third smallest value in -0.3, 2/13, 0.094, 1/42? 0.094 What is the biggest value in -1, 2/21, 1288? 1288 Which is the biggest value? (a) 5 (b) -0.1 (c) -10/3 (d) 0.2 a What is the second smallest value in -2, 4, -37/8, 3? -2 Which is the fourth smallest value? (a) 52 (b) -3 (c) 0 (d) -5 a What is the third smallest value in 70, -0.5, 0.3? 70 Which is the second biggest value? (a) 2/11 (b) -12/7 (c) 1 a What is the second biggest value in -0.83, 3, -13? -0.83 What is the third biggest value in -5, 1, 85? -5 Which is the second smallest value? (a) 2/7 (b) -925 (c) -1/3 c Which is the fourth smallest value? (a) 1/4 (b) 3/7 (c) -167 (d) -1 b What is the second smallest value in 0.1, -0.3, 2, 243? 0.1 What is the third biggest value in -5, -0.04, 0, 1/4? -0.04 Which is the second smallest value? (a) 1/14 (b) 5 (c) -2/7 (d) -0.2 d What is the fourth biggest value in 3/2, -0.1, -215, 0? -215 Which is the third smallest value? (a) 1 (b) 91 (c) -2/17 (d) 0.1 a What is the smallest value in -2/7, -0.5, 4, -24? -24 Which is the second smallest value? (a) 7/4 (b) -35 (c) 0.5 c Which is the second biggest value? (a) 285 (b) -0.1 (c) -2 b What is the second smallest value in -1, 1, 4, -1/4, 0.04? -1/4 What is the second smallest value in 0.2, 129, 0.4? 0.4 What is the biggest value in 3/5, 7, -6? 7 What is the smallest value in 1/6, -1.1, -5, 3? -5 Which is the fourth smallest value? (a) 2/11 (b) -0.6 (c) -5 (d) -1/4 a Which is the second smallest value? (a) 4 (b) 312 (c) -5/2 a What is the third biggest value in 5, -12657, -0.2? -12657 Which is the third biggest value? (a) 19688 (b) -0.4 (c) 3 b Which is the biggest value? (a) 5 (b) -2/13 (c) -1.066 a What is the smallest value in 5, 0.2, -8/19? -8/19 What is the biggest value in -5, 0, 3, 0.2? 3 What is the second biggest value in -0.3, -8, -2/7, 0.4? -2/7 Which is the third biggest value? (a) -505 (b) 0.3 (c) 0.15 a Which is the second smallest value? (a) 4 (b) 1/5 (c) -1 (d) -23 c Which is the second smallest value? (a) -2 (b) 6/7 (c) -0.2 (d) 0.7 c What is the second smallest value in 5, -0.3, -2, 362? -0.3 Which is the smallest value? (a) -3 (b) 3 (c) 58 a What is the second smallest value in 100, 0.09, -2? 0.09 Which is the third smallest value? (a) 14 (b) -1/3 (c) 5/27 a What is the third smallest value in 3, -2/9, -0.2? 3 Which is the third smallest value? (a) 0.78 (b) 1/27 (c) 1/2 a Which is the third smallest value? (a) -4 (b) -0.4 (c) 0.14 (d) 64 (e) -2 b What is the second smallest value in 1/3, -31, 2, -3? -3 Which is the third biggest value? (a) 3/2 (b) -9798 (c) 0.5 (d) 2/13 d Which is the third biggest value? (a) 3/7 (b) 2/9 (c) -20 c What is the second biggest value in 34/59, 0.4, 5? 34/59 Which is the third smallest value? (a) -276 (b) 0.1 (c) 2/5 (d) -3 (e) -0.5 e What is the third smallest value in -2, -4, -3, -1/2, -6? -3 What is the third biggest value in 31, 2, 14? 2 What is the second biggest value in 59, 0.03, -2? 0.03 What is the fourth biggest value in 0, 4, -1.11, 0.3? -1.11 Which is the smallest value? (a) 5 (b) 1.32 (c) 2/19 (d) -5 (e) 0.1 d Which is the second smallest value? (a) 2/9 (b) 0.04 (c) -1/4 (d) 5 b What is the second biggest value in 2, 3/7, -4? 3/7 Which is the biggest value? (a) 0.038 (b) 3 (c) -0.2 b Which is the fourth smallest value? (a) -0.3 (b) 1/4 (c) 0.2 (d) 5 (e) 4 e Which is the smallest value? (a) 0 (b) 0.1 (c) -2/13 (d) -0.22 d Which is the third biggest value? (a) 6 (b) 0.3 (	{ "pile_set_name": "DM Mathematics" }
026. -4.529 Add together -4.04 and 15548. 15543.96 Calculate -384708 - -973. -383735 Calculate 59.8516 + 3.022. 62.8736 What is the difference between 13 and -213056.33? 213069.33 What is -262 minus -110.4196? -151.5804 Add -9016232 and 52.2. -9016179.8 Add together 2335475398 and 0.5. 2335475398.5 Add together -210732711 and -2. -210732713 Work out 4.2 + 50.515. 54.715 Work out -9 - 74.25836. -83.25836 Sum 8413748 and -0.187. 8413747.813 Sum 0.067595295 and -139. -138.932404705 What is -1 plus 4673.8249? 4672.8249 Work out 3.05 - -724270. 724273.05 Sum 0.7 and -1865.594. -1864.894 What is -0.183704781 - -0.15? -0.033704781 Subtract -0.0070193 from 18.45. 18.4570193 What is 719457 - -0.6? 719457.6 0.1074682 + -111 -110.8925318 0.89+0.7512998 1.6412998 Add -5.511 and -0.06178. -5.57278 What is -54.4163293 take away 5? -59.4163293 What is -18 less than -1033503.45? -1033485.45 What is the distance between 447.80895 and 4? 443.80895 What is -280336 + 6204? -274132 -0.5 - -32467537738 32467537737.5 What is 0.107933 - 141? -140.892067 What is -170459.5 plus 5099? -165360.5 Add together -6406.8 and 27.64. -6379.16 Subtract -2 from -31586049892. -31586049890 What is 3 take away 627173? -627170 Calculate -0.406105 - 61.4. -61.806105 Add -2163403404 and 0.2. -2163403403.8 Calculate -117.4 - 45931. -46048.4 681909 - -0.076162 681909.076162 What is 0.9 - 364758.532? -364757.632 Total of -197508 and 279. -197229 What is the difference between -0.19 and -797057277? 797057276.81 Sum -12 and -37447. -37459 What is the distance between 0.2 and 2953449? 2953448.8 Calculate -4 - -67807933. 67807929 What is 3 plus -3964892.6? -3964889.6 Calculate -0.089 - 18359. -18359.089 Total of -0.71 and 14538. 14537.29 What is 0.24 minus -40928245? 40928245.24 What is -0.059 less than -14063.46? -14063.401 What is 31.8 less than -2648? -2679.8 Add -0.111175 and -2433. -2433.111175 Sum -6937582 and 0.968. -6937581.032 What is 5 less than -347.01368? -352.01368 0.78456 + -0.0078 0.77676 What is 72933 less than -1669.3? -74602.3 Put together 1.30179 and -1.13. 0.17179 Put together 1.630741 and 0.0096. 1.640341 What is -19115647306 - 0.3? -19115647306.3 What is -112 less than -6043.19? -5931.19 What is 0.07 - 32066.9017? -32066.8317 Calculate -11705771404 - -0.5. -11705771403.5 Work out -957 - 20368741. -20369698 -34757397 - -808 -34756589 What is 0.0575 take away 1104403? -1104402.9425 What is 0.561 + -2188063? -2188062.439 Add together 32971232726 and -0.4. 32971232725.6 Sum 0.2 and -32.5702. -32.3702 Calculate 0.0197790952 - 0.3. -0.2802209048 What is 8.1027 plus -311? -302.8973 Total of 89497 and -114702. -25205 Subtract 11 from 10048.759. 10037.759 2 - 122.93096 -120.93096 Put together -0.25161 and -175.7. -175.95161 Work out -0.2 - 2592.168. -2592.368 What is the distance between 76871.5245 and 22? 76849.5245 What is 61.35 + -804680? -804618.65 Put together -16.43 and -26712. -26728.43 What is 9607842 less than 0.1? -9607841.9 What is 8474.32303 take away 2? 8472.32303 Total of 0.007683 and 17.854. 17.861683 What is 0.5 + 102.32535544? 102.82535544 Work out 42290.3 + 47. 42337.3 Calculate -35 - 2506773. -2506808 What is 0.41196 minus 4.027? -3.61504 -184364 + 98.4 -184265.6 Calculate 28 + 401954. 401982 -4311+220616 216305 -0.2 - -9.3422993 9.1422993 What is -6 + -24.51806? -30.51806 What is the distance between -5943.8 and -5466? 477.8 Add together -11912 and 0.09511. -11911.90489 What is -4546324618 plus -0.6? -4546324618.6 Subtract -0.288 from -14901809. -14901808.712 4647386 - -6 4647392 -493179965 + 3 -493179962 Calculate 3 - -7908.1468. 7911.1468 Calculate -8352 - 808734. -817086 Put together -0.1 and 2797806. 2797805.9 Sum -171086051 and 2. -171086049 What is the difference between -98853157 and -0.2? 98853156.8 4632477 - 3 4632474 -0.0232 - 698.34228 -698.36548 What is 169.625809 minus -72? 241.625809 Total of 522843.3 and 0.087. 522843.387 Work out 0.444688 + -8.0521. -7.607412 Calculate -62.8 + 56176.72. 56113.92 Work out -151.5135 - 10. -161.5135 Add -18 and -121.8191. -139.8191 What is 0.3 - 3159665.4? -3159665.1 Sum -150.601841 and -4. -154.601841 2+-63192811 -63192809 Calculate -3 - -424855516. 424855513 Put together -70.19 and -705578. -705648.19 What is 3.58 + -916251? -916247.42 What is -4872.5034 minus 0.0567? -4872.5601 What is 7094.311 minus -0.3639? 7094.6749 Total of 521.187 and 144. 665.187 What is 3.863031334 + 4? 7.863031334 What is -551337252 take away 0.1? -551337252.1 What is -37 + 83.48817? 46.48817 -1032 - 29.617 -1061.617 What is -44284 + 13255? -31029 Add 6.5 and -195.8. -189.3 What is 0.13932498 minus -91.3? 91.43932498 What is 20 + -8.8372? 11.1628 Subtract 456.88 from -43094.3. -43551.18 Total of -1200618530 and -0.7. -1200618530.7 What is -109050 minus 179? -109229 Add together 1301.05 and -0.144093. 1300.905907 Calculate 5190910.6 + -4. 5190906.6 Add -1.212 and -586715. -586716.212 Total of -923877 and 8.25. -923868.75 8.2 + 3589.702 3597.902 What is -53 - 3364295.8? -3364348.8 What is -0.22468 - -2465.41? 2465.18532 What is -0.096 minus 11797.86? -11797.956 Total of 5 and 202391610. 202391615 What is 1892 plus -404990.6? -403098.6 What is -0.031 take away 854402? -854402.031 Total of -5 and -99383.35829. -99388.35829 What is 99 take away 249312.8? -249213.8 What is -10156288.9 + 1? -10156287.9 Sum -1017894 and -1254.1. -1019148.1 Add 245791 and -0.12198. 245790.87802 Sum 5277 and 174.023. 5451.023 Sum -146915739 and 4. -146915735 Total of 402.4 and -65133. -64730.6 Calculate -0.360443 + -554.6. -554.960443 Calculate 0.497 - 6211.1. -6210.603 Sum 2127 and 86.36. 2213.36 What is 0.2 take away 996.445039? -996.245039 Sum -458 and 64899.538. 64441.538 Calculate -12691175 + 23. -12691152 What is -626 plus 25668935? 25668309 What is -0.61195243 - 1386? -1386.61195243 What is -0.0381 take away 58103? -58103.0381 What is 0.04 + -336221954? -336221953.96 -56753+132.486 -56620.514 Work out 0.2 - -1615659. 1615659.2 What is -973546.524 - -0.8? -973545.724 Total of 2.9299 and 584. 586.9299 Subtract -22367639 from 19. 22367658 What is 24138161.4 less than 2? -24138159.4 What is -3426532 minus -16? -3426516 -215819 + 2968 -212851 Calculate 46.8 + -3096384. -3096337.2 55875899926 + -0.2 55875899925.8 Work out 0.13941 + -98.652. -98.51259 Calculate -141096 + -461253. -602349 Put together 9612217416 and -0.2. 9612217415.8 What is the distance between -106 and -0.02187968? 105.97812032 Calculate 15.3 + -653051. -653035.7 What is -0.39 take away -82403? 82402.61 Add -55 and -162632. -162687 What is 1.554 less than -0.11999? -1.67399 What is -0.063721 minus 0.213371? -0.277092 15 + 8397711 8397726 What is the difference between 0.0855 and -5602175? 5602175.0855 Add 3 and 2.157109182. 5.157109182 What is -1.1810839 - -255? 253.8189161 What is -27376 - -0.91317? -27375.08683 Subtract -6.370994061 from 0. 6.370994061 -6506366629 - 7 -6506366636 -3463 - 882140 -885603 What is -56 + 88.097? 32.097 What is the difference between 18473 and -318946? 337419 -20.2101935+-4 -24.2101935 Put together 36 and 9753635.8. 9753671.8 What is 239800 plus -5012? 234788 What is 57427888 less than -3? -57427891 Work out 183.94 + -104747. -104563.06 What is the distance between 0.051 and -5.67526? 5.72626 Calculate -6 - 343796.21. -343802.21 What is 1 take away -81193256.41? 81193257.41 Add 16 and 683514. 683530 Work out -52.27745 + 0.1. -52.17745 Total of -4291 and -118.207. -4409.207 Sum -1.3 and 19317059.2. 19317057.9 What is -332.3442 take away -438? 105.6558 Calculate -938 - -0.0199. -937.9801 Work out 8799766.8 + -5. 8799761.8 What is 1543.58 take away 7921? -6377.42 Put together 21620881.9 and 0.8. 21620882.7 What is -0.9 minus 38973793? -38973793.9 Calculate 0 + -9504151. -9504151 Subtract -28.332 from 835085. 835113.332 Calculate -522.07 - -306. -216.07 Calculate 6.09 + 4.419. 10.509 What is -1201 minus 2403644.2? -2404845.2 Calculate -28686176 + -0.09. -28686176.09 Work out -46.5 - -3.270577. -43.229423 Add together 0.3 and -165183637. -165183636.7 -84549800 + 0.8 -84549799.2 What is -91013 minus 5764? -96777 Sum 4 and 135.9064. 139.9064 Subtract -507187596 from -12. 507187584 6.06+96445 96451.06 -24741 - 0.6 -24741.6 What is the distance between -2246.6 and -553	{ "pile_set_name": "DM Mathematics" }
(1 - 5) - -15 14 What is the value of 651 - 657 - (18 + 2 - 1)? -25 Evaluate -54 + 64 - -5 - (2 + -8). 21 What is the value of -55 + (-9 - -33) - -23? -8 What is the value of -2 + 4 + -4 + 3 + (3 - -1)? 5 Calculate 25 - (63 + -28 + -15). 5 What is 18 + -31 + 35 - 11? 11 Calculate 10 - (6 - (39 + 0) - (-12 + 8)). 39 Evaluate 9 + (0 - 12 - (-10 - -5)). 2 -3 + -13 + -55 + 92 21 -805 + 816 - (0 + 0) 11 Evaluate -14 + 22 + 5 + -1 + -2. 10 What is the value of -1 + 0 + 15 + (-14 - 3)? -3 -8 - (-5 + -13) - (5 - 4) 9 -1 + (4 - -2) + -7 - (-14 + 1) 11 What is the value of (-17 - -7 - 6) + -7? -23 (-129 - -153) + (2 - 6 - (0 + -13)) 33 7 - (7 - (-1 + -2 + 2 + 6)) 5 (50 + (-15 - 9) - (0 + 0)) + -6 20 What is 29 - 14 - (30 - 8)? -7 What is the value of -5 - -7 - 9 - (-11 + 8 + 1)? -5 What is the value of -9 + (-28 - -10 - -35)? 8 What is (-11 - (26 - 52)) + -31? -16 What is 3 + 10 + 8 - ((2 - -1) + 2)? 16 What is 12 + 14 + 2 + -12 + (0 - -18)? 34 What is the value of -22 - (19 - 16 - 31)? 6 Evaluate 1 - (2 + -5 + 2 + 13 + -5). -6 What is the value of -20 - -42 - (2 + 7)? 13 Evaluate (-2 - -1) + -22 - (-20 - (13 + -28)). -18 What is (8 - (-2 - -3)) + (-3 - -2)? 6 What is 15 - (-8 + (1 - -25))? -3 What is the value of (-284 - -266) + 0 + 30? 12 Evaluate 4 + (1 - (30 + 1 + -4 + -7)). -15 Evaluate (-16 + 33 - 16) + 16 - 14. 3 Calculate -5 - (-1 + 2) - -12 - -5 - -1. 12 What is 9 + 23 + (-37 - -17)? 12 (0 - (14 + -20)) + -18 -12 Calculate 12 + -14 + 7 + -4 + -5 + 6. 2 What is the value of 1 + -19 - (-161 - -152)? -9 Evaluate -12 - (0 - (13 - 8)). -7 Evaluate -17 - -5 - ((1 - 1) + -4 + -2). -6 What is 21 + -23 + -40 + 21? -21 What is the value of -15 + 3 + 10 - 11? -13 What is 679 + -683 + 11 + (0 - 3)? 4 5 + -3 + -36 - (-7 + 5 - 2) -30 What is the value of 17 + -20 - (-6 - (-2 + 1))? 2 What is (-1 - 17 - -36) + -6? 12 -20 + 33 - (-12 - (-7 + 3)) 21 Evaluate -14 + -6 + 15 + -5 + 10. 0 17 - (-6 + 3) - (2 + 5 + -3) 16 Evaluate 4 + -25 + 9 + 12. 0 Calculate 4 - (-9 + -11 - -22). 2 Calculate -7 - -20 - 1 - (-2 + -5 - -12). 7 Calculate (12 - 7) + (-7 - -4) + (5 - -6). 13 -8 + 9 + (1 - -4 - (1 - -10)) -5 What is the value of 35 - ((-12 - 1) + 50)? -2 What is the value of 14 + (8 + 8 - 32) - (2 + -35)? 31 What is the value of 8 + 1 + (20 + -87 - -85)? 27 What is the value of 27 - 3 - 26 - (18 + -2)? -18 Evaluate 7 + -8 + (-5 - -6 - 2) + -13. -15 3 + (0 - -6 - (-13 + -10 + 45)) -13 Evaluate -13 - (1 + (7 - (29 + -9))). -1 Evaluate -9 + 7 - (2 + -7) - 4. -1 What is 8 - (-92 - -83 - (1 - 16))? 2 What is the value of (0 - 3) + (-8 - -1)? -10 What is 29 + (-8 - 8) + -23? -10 Evaluate 9 + -1 - (-231 + 219). 20 What is 14 + 29 + -6 - 20? 17 What is 2 - ((13 - 24) + -2 + 40)? -25 Calculate 1 - 8 - (-35 - -14). 14 Evaluate 5 - (32 - (16 - 18)). -29 What is the value of ((12 - 10) + 6 - -1) + 13? 22 Evaluate (13 - 0) + (-8 - -3) + -2 - -1. 7 0 + (-7 + 14 - 14) - (-1 - -4) -10 46 + (2 - 51) - (-18 - (-1 + 0)) 14 What is the value of (-3 - 20) + (1 - -28)? 6 What is the value of (-38 - -18 - -22) + -4? -2 0 - (-9 + (-3 - (0 + 13))) 25 What is 0 - 26 - (-8 - (11 - 27))? -34 Evaluate -5 - (-7 - (10 + -4 - 4)). 4 Evaluate (0 - 0 - ((6 - 2) + 2)) + -18. -24 What is 1 + 2 + (11 - 7) + -8? -1 What is the value of -33 - (11 + -28) - -12? -4 -3 - (-8 + 3 + 5 - 9) - 26 -20 What is the value of 8 - -14 - (-8 + 10 + 10)? 10 1 + -8 - (4 + -15 - (-1 + -8)) -5 What is the value of -2 - (24 + -21 - (-8 + 5))? -8 What is 1 - (-4 + (3 - -4) + (-25 - -12))? 11 What is 11 - ((7 - -2) + -6 + (35 - 25))? -2 11 - (9 + -4 + 5 + -13) 14 (-3 - 2) + (32 - 25) + 1 + -3 0 What is -6 + 9 + -4 - (-11 - -10)? 0 Calculate 19 + -12 + -6 + -4 + (3 - -2). 2 -4 + (-8 - (-15 - -14)) -11 What is -2 + 0 + (-13 + 10 + -3 - 3)? -11 What is (-15 - (-10 - (-6 + -3))) + (-1 - -1)? -14 13 - 7 - (2 - (3 - (-6 - 0))) 13 Calculate (3 + 7 - 20) + 23. 13 Evaluate 5 + (5 - 1) - (15 - 21 - -11). 4 Evaluate -22 + (-31 - -56) - 3. 0 Evaluate 5 - (3 - 11) - 5 - -14. 22 0 - (-6 + 18 + -6) -6 Calculate -13 - ((-5 - -11) + (8 - 9)). -18 Evaluate (-14 + 1 - (73 + -83)) + -4 - 20. -27 What is the value of 2 + (5 - 1) - (-28 - -30) - 13? -9 What is 16 - 1 - 6 - (-3 - -3)? 9 What is 3 - (4 - -6) - -22? 15 What is the value of (0 - 25) + (30 - 5)? 0 Evaluate 0 + -60 + (-135 - -169). -26 -4 - -22 - (26 + -32) - 11 13 What is the value of -3 - -12 - 0 - (-348 - -352)? 5 Evaluate -2 + 6 + (-1 - 11) + -4. -12 Evaluate -19 - (-45 + -3) - -7. 36 What is the value of 5 - (21 + -13) - -11? 8 4 + (16 - (3 + 7)) + -6 4 What is the value of 7 - (-3 + -7 + (4 + -9 - -8))? 14 What is the value of (34 - 23) + -34 + (5 - 2) + 1? -19 What is -1 + 10 - (6 + 3)? 0 What is the value of 14 - (-10 + 9) - (2 - (1 - 2))? 12 What is -466 + 438 + (14 - (0 + 0))? -14 (4 - ((2 - 9) + 8 + -2)) + 1 6 Evaluate -1 + (-8 + -4 - -14). 1 What is the value of 12 + 4 + (-3 - 3 - (6 - 6))? 10 What is the value of 7 + (-6 - 6 - (-1 + (2 - -1)))? -7 What is the value of (-1 - (-11 + 20)) + 14? 4 Evaluate -12 + 0 + 35 + -86 + 41. -22 Evaluate (-21 - -8) + 18 + (1 - -3). 9 Calculate (18 - 7 - 10) + 4. 5 Evaluate -4 + (32 - 18) + -5. 5 Evaluate 7 + (-41 - -37 - (-2 - (-2 - 1))). 2 What is the value of 9 - -6 - 44 - -14? -15 Evaluate -8 + (0 - -7 - (-1 + 3)) + 8. 5 What is 5 + (6 - 12) + 9 + -4? 4 What is the value of (-15 - ((4 - 5) + -2)) + (5 - 4)? -11 What is the value of 100 + -80 + 2 + -7? 15 What is the value of 18 - (3 + -7 + 3 + 6 + 3)? 10 Calculate (-22 - -55) + -6 + -17. 10 Calculate 2 + 0 + 1 + (-51 - -54). 6 What is the value of 2 - (-28 - (-4 + 2))? 28 What is the value of 31 - (-2 + 15 + 4)? 14 Calculate -13 - -1 - (-232 - -202). 18 What is (-3 + 1 - 20) + 11 + -3? -14 -4 - (-8 + (-3 + 9 - (-3 + 17))) 12 What is -4 - -4 - -2 - (-2 + -6 - -6)? 4 Calculate -50 - (-6 - 2) - (-28 + 12). -26 What is 72 + -68 - (3 - -3)? -2 What is the value of -2 + (-6 + -8 - -11) + -2? -7 (-11 - (32 + -19)) + -4 -28 11 - 5 - (-15 - (2 - 10)) 13 What is (-2 - -1 - 0) + 3 - (50 - 44)? -4 What is -21 + 5 + 18 - 2? 0 What is the value of 14 - -16 - (3 + -15 - -16)? 26 Calculate 78 - 73 - (5 - (3 - (-4 - -5))). 2 What is the value of 7 - (-8 - (4 + -18))? 1 What is (-8 + -3 + 8 - -7) + 5? 9 What is 3 + 16 + -1 + (4 - 11)? 11 Calculate -3 + (4 - -2 - 12 - -11) + -2. 0 What is -26 + -2 + (-90 - -107)? -11 -19 + 10 + 13 + -10 -6 Calculate 14 - ((22 - 29) + 38). -17 (6 - 1) + (-8 - 7) -10 (-52 - -82) + 1 + -30 1 Calculate 37 + -21 + 1 + -9 + 17. 25 Evaluate (5 - 3) + (20 - (-11 + 13 + -5)). 25 Evaluate 177 + -220 + (-5 - -82). 34 Calculate (-24 - -13) + -21 - -24. -8 Calculate 2 - (4 + 8 + -3 + -2) - -30. 25 (-1 + 19 + 0 - 6) + -16 + 11 7 Evaluate 6 - 10 - 0 - (-21 - 2 - -2). 17 What is 8 + -2 + -7 + -2 + 2 - 2? -3 What is 18 - 12 - -22 - 40? -12 What is the value of -12 + ((0 - 12) + 2 - (23 + -43))? -2 Calculate -2 - (-2 - -14) - (-20 + 16). -10 What is the value of 6 + 11 + (3 - 9) + (-27 - -25)? 9 What is 2 + (-4 - 3) - -18 - 2? 11 What is (3 - -2) + 15 + -16 + 4 + -7? 1 What is the value of (1 - -9) + (-8 + -8 + 5 - 8)? -9 Calculate 1 - (2 - 18) - (198 + -187). 6 Evaluate (-35 + 35 - -16) + -39. -23 Calculate -4 + (-1 - -2) + (-1 + 8 - 2). 2 What is the value of 9 + 5 + -15 + 9? 8 Calculate (2 - -6) + (18 + (0 - 10) - 38). -22 6 + 14 + (-23 - -22) - (8 - 1) 12 Evaluate (-3 - 2) + 69 + -58 + -27. -21 32 - (-35 + 22 + 32) 13 Evaluate 2 - (-7 + -14 + 14) - 16. -7 What is -1 + -8 + 2 + 1 + 17 + -16? -5 What is the value of -10 - (-4 + 3 - 2 - -21) - 11? -39 What is the value of 14 + (1 - (4 - -2)) - 9? 0 Evaluate 17 - (-6 + (-16 - -21) + 4). 14 What is (-1 - 6 - (-339 + 323)) + (-2 - -11)? 18 Evaluate 10 + (-4 - -6) - (9 + -5 - 6). 14 What is 1 + -30 - (961 - 987)? -3 What is the value of -50 + (28 - 3) - -3? -22 What is the value of -6 + 22 + (3 + 1 - 12)? 8 Calculate -281 + 224 + 31 + -4. -30 Calculate 21 - 10 - 21 - -22 - 32. -20 Calculate 5 - (4 + 10 + (-15 - 3)). 9 Calculate 0 + (0 - -8) - -3. 11 What is the value of 12 - (8 + 10 + -14 + 3) - 38? -33 What is the value of -9 + 6 + -1 + -2? -6 Evaluate -5 + (2 - -4 - 6) - 1 - -2. -4 13 - 21 - (-7 + 28 + -13) -16 Calculate 65 + -63 + (3 - (2 + (2 - -30))). -29 -12 + -15 + 30 + (-9 - 0) -6 What is the value of 25 + -30 + 1 + -2 + 1 + 18? 13	{ "pile_set_name": "DM Mathematics" }
e smallest common multiple of m(n) and k(-4). 30 Calculate the smallest common multiple of 10 and 40/(-4) - -4 - -14. 40 Suppose -294 = 72b - 78b. What is the least common multiple of 7 and b? 49 Let s be ((-1533993)/(-108600))/(3/2). Let g be ((-2)/40)/(3620/8). Let p = s + g. What is the common denominator of -61/12 and p? 12 Let w = -16 - -16. Suppose -5r + 2m = -0r - 392, 2m - 8 = w. Find the common denominator of 71/4 and 2(-4)/r-37. 20 Suppose -3w + 6w = -6. Find the common denominator of ((-1)/(-9))/(w/49) and 43/(-102)(-63)/(-21). 306 Let y be -1(-1)/((-4)/(-56)). Suppose q - 1 = -3l - l, 2q - 4l = y. Calculate the smallest common multiple of 2 and (24/q)/(36/90). 12 Let l be (16/20)/((-6)/795). Find the common denominator of l(-5)/(-120) - 0 and 81/40. 120 Let y(g) = g - 14. Let p be (-1 - -1) + 378/21. Let o(b) = b*2 + b + 2. Calculate the smallest common multiple of o(4) and y(p). 44 Suppose 3f - 44 = 4y - 351, 81 = y - 5f. Calculate the lowest common multiple of 16 and y. 304 Let p = 131 + -135. What is the least common multiple of 4/10 - (-16)/10 and (p/(-6))/((-6)/(-90))? 10 Let g = 16460 - 543220/33. Calculate the common denominator of g and 67/12. 132 Suppose 5 = 4b - 11, -2b - 124 = -3f. Calculate the lowest common multiple of 8(0 + -4)(-11)/44 and f. 88 Suppose 3b - h - 14 = 14, 4b - 36 = 2h. Calculate the least common multiple of 22 and (-4)/b10/(-1). 44 Let y be -115(-2)/(-2184)194. Let l be 3 - 460/(-364) - (3 - -1). Let h = l + y. What is the common denominator of h and 47/13? 78 Suppose 57 = 11j + 13. Calculate the lowest common multiple of 136 and j. 136 Let x(q) = -11q2 - 5q - 6. Suppose 3w = -2r + 1 - 20, 5r = -2w - 20. Let p be x(r). Find the common denominator of 3 - 1(-428)/p and -155/42. 210 Let g(m) = m3 - 4m*2 - 10m + 8. Let x be g(6). What is the common denominator of (221/(-104))/((-2)/x) and 9/10? 20 Let l = 17821/1370 + -97/137. Calculate the common denominator of l and 133/90. 90 Let o = -17/52 + 287/520. What is the common denominator of o and 81/28? 280 Let m be 0 - (-2)/((-4)/10). Let s be 2673/(-15) + (-1)/m. Calculate the common denominator of (s/(-10))/((-14)/5) and 29/12. 84 Let o(z) be the first derivative of 5z2/2 - z + 22. What is the lowest common multiple of o(5) and 24? 24 Find the common denominator of (6 - 16) + 14 - 142/32 and (-1426)/(-240) - 4/10. 48 Let y(g) = 169g3 - g2 + g - 1. Calculate the least common multiple of 18 and y(1). 504 Suppose 4d - 3d = 10. Suppose -d = 5g, -6z + 2z + 16 = 2g. What is the lowest common multiple of (110)/(z - 3) and 7? 35 Let g be ((-2)/(-3))/((-5)/60). Let r(v) = -v + 10. What is the smallest common multiple of 18 and r(g)? 18 Let c(s) = s3 + 24s*2 + 63s + 10. Let y be (8/(-10))/((-1)/5). Suppose ya + 0a = 80. Calculate the smallest common multiple of c(-21) and a. 20 Let p(u) = u*3 - 5u*2 + 3u + 1. Let r(g) = -2g + 25. Let m be r(10). Calculate the lowest common multiple of 32 and p(m). 32 Let r = -10 + 12. Suppose -3w = rw - 15. What is the lowest common multiple of 9 and w? 9 Let y be ((-219503134)/(-2))/(3455840/98). Let l = y + 29/215990. Let q = 3111 - l. Find the common denominator of -13/8 and q. 16 Calculate the least common multiple of 272 and (0 - -4 - (-116)/(-87))18. 816 Let b be 231/(-14)8/(-6). Suppose 4u = b - 70. Let n = 21 + u. Calculate the least common multiple of 8 and n. 72 Let k = -10613/216 - -375/8. Calculate the common denominator of -49/18 and k. 54 Let v be (6 + 6 + -8)-183. Find the common denominator of -83/20 and 3 + (-4)/((-128)/v). 40 Let w be 2/(-4) - 138/(-36)3. Suppose -ws + 0s = -132. Calculate the least common multiple of 5 and s. 60 Let g = -21933/185744 + 42/611. Find the common denominator of g and 67/304. 304 Let b be 18/10 - 25/(-125). Suppose -2v + 5v - z - 13 = 0, 3v - 21 = -3z. Let w = v - b. What is the lowest common multiple of 5 and w? 15 Find the common denominator of 121/18 and ((-15)/(-45) - 350/(-36)) + -2. 18 Let i = 5541/5 - 1102. Let t = -50/31 + 984/341. What is the common denominator of i and t? 55 Let d = 3 + -1. Suppose 3x + 4y - 46 = 0, dy + 115 - 17 = 4x. What is the common denominator of 71/(-20) - x/(-55) and -37/10? 20 Let s(v) = 232v*3 - 2v*2 - 3v - 2. Let p be s(-2). Let n = 12986/7 + p. Let q = 3082 - 30853/10. Find the common denominator of n and q. 70 What is the common denominator of -39/32 and (-2(-38)/(-192))/(24/(-32))? 288 Let l = 24/31 + 1475/217. Let t = 99 + -25. Find the common denominator of -2 + (-3)/(-24)t and l. 28 Let t be 13/78(-16437)/(-19). Let h = 144 - t. Find the common denominator of h and 133/18. 342 Let u(c) = -2c - 4. Let m be u(-4). Suppose 4i - 4s = 0, -i - m = 2i - 5s. Let t(r) = 113r + 1813. Calculate the least common multiple of t(-16) and i. 10 Let z be (-22)/(-14) + (-9)/(-21). Let w be z - (2 + 1 + 0). Calculate the lowest common multiple of 2 and -2 + w + 13 - 0. 10 Find the common denominator of (3/((-21)/(-4)))/((-45)/(-42)) and -49/24. 120 Let q be (-148)/(-28) + -5 + (-299)/(-7). Suppose 0 = -10h + 57 + q. What is the smallest common multiple of h and (-7)/(-2) - (-1)/2? 20 Let k = -3649/188 - 16/47. Let m = 72949/18 + -4054. Find the common denominator of m and k. 36 Let t = 38251/18 + -2127. Let d = 25 + -34. Calculate the common denominator of t and 11/d + (-2)/16-4. 18 Let s be (-9)/(-54) - 17/(-6). Let c be -9(16/6 - s). Suppose 3b + 20 = -b, -p = b + c. Calculate the smallest common multiple of p and 1. 2 Let p(d) = 6d + 11. Let s be p(-7). Let c = -12 + s. Calculate the common denominator of c and -61/6. 6 Find the common denominator of 49/11 and ((-34)/3077)/(1 - 148/132). 3982 Let s be (-2)/(-3) - (-542)/6. Suppose 5v - 14 - s = 0. Let m = -5 + v. What is the smallest common multiple of m and 18? 144 Suppose f + 4u + 24 = 3u, 0 = -3u - 15. Let r be 1/((-3 - -2) + 2)23. Let o = f + r. Calculate the lowest common multiple of o and 8. 8 Let y(a) = a + 31. Let i be -2(-2 + 3) - -5. Suppose -2d + 24 = 2x + id, -3x = 5d - 26. Calculate the smallest common multiple of y(-13) and x. 18 Let q(a) = -43a + 7. Let n be q(1). Suppose 0 = 5l + 3w - 101, -25 = -l + 4w - 3w. Calculate the smallest common multiple of (-1 - n)(-18)/(-63) and l. 110 Let c = -2545/2 + 1227. Calculate the common denominator of c and -1(-291)/(-54) + 31 + -29. 18 Let r be (-26)/(-13) + -1 + 1. Suppose -rq = 4h - 32, 2 = 4h - 2. Calculate the lowest common multiple of 22 and q. 154 Let c(p) = p3 + 6p*2 + 2p - 2. Let x be c(-5). Let f(a) = -a*3 + 13a*2 + a - 9. Calculate the least common multiple of f(x) and 16. 16 Suppose 2f - 3f + 37 = 0. Suppose -3l = -47 - f. Calculate the smallest common multiple of l and 18. 252 Let p = 28 + -34. Let r be ((-292112)/408)/((-592)/p). Let g = -4/629 - r. What is the common denominator of 21/34 and g? 68 Suppose -9f + 100 = 4v - 5f, 3f = 3v - 63. What is the least common multiple of 8 and v? 184 Calculate the common denominator of -91/46 and ((-107)/(-5))/((-46)/15) + 7. 46 Suppose 5 = j + 2. Let p = -54 - -64. Calculate the lowest common multiple of j and p. 30 Let w(a) = 2a*3 - 29a*2 + 16a - 27. Let h = 29 - 15. Calculate the least common multiple of 6 and w(h). 6 Suppose -4u - 2b = -14, -8 - 7 = -5u - 3b. Let y = -8 + u. What is the common denominator of 13/y6/(-18) and -95/22? 66 Suppose -2a + 53 = -3v - 10, 5a - 177 = v. Suppose -7m - 629 = -825. Suppose -4r = u - a, 5r - u = r + m. What is the smallest common multiple of r and 2? 8 Suppose -5d + 161 = 41. Calculate the smallest common multiple of 6(-2 - 54/(-12) - 2) and d. 24 Suppose -5k = -2k - 3o - 90, -5k + o + 166 = 0. What is the least common multiple of 4 and k? 68 Let n = -155 - -167. What is the smallest common multiple of 3 and n? 12 Let p be (6/5)/(6/200). Let l = p - 80. Calculate the common denominator of 37(-2)/l + -1 and -7/22. 220 Let u = 1/6305 - -308909/226980. Find the common denominator of u and -32/45. 180 Suppose 4b + 2g + g - 72 = 0, 0 = 4b - 4g - 44. Calculate the common denominator of 2/b - (3 + 6565/300) and 43/20. 20 Let s = 758 - 684. What is the smallest common multiple of 3 and s? 222	{ "pile_set_name": "DM Mathematics" }
th term of -2327, -2312, -2295, -2276, -2255, -2232, -2207? v*2 + 12v - 2340 What is the s'th term of -8626, -8613, -8598, -8581? s*2 + 10s - 8637 What is the r'th term of -2734, -5605, -8476, -11347, -14218? -2871r + 137 What is the h'th term of -368, -634, -896, -1154? 2h*2 - 272h - 98 What is the a'th term of 3423, 4912, 6401? 1489a + 1934 What is the o'th term of 2522, 2511, 2488, 2447, 2382? -o3 - 4o + 2527 What is the b'th term of -127, 10, 245, 578? 49b2 - 10b - 166 What is the x'th term of 188, 53, -716, -2437, -5428? -53x3 + x2 + 233x + 7 What is the z'th term of 886, 914, 942? 28z + 858 What is the g'th term of 1491, 1404, 1315, 1224, 1131, 1036, 939? -g2 - 84g + 1576 What is the u'th term of 626, 1289, 1988, 2729, 3518? u*3 + 12u*2 + 620u - 7 What is the u'th term of -1518, -6034, -13554, -24072, -37582? u*3 - 1508u2 + u - 12 What is the s'th term of -5644, -22807, -51424, -91501, -143044? -s3 - 5721s2 + 7s + 71 What is the l'th term of -2081, -2061, -2013, -1925, -1785, -1581, -1301? 2l3 + 2l*2 - 2085 What is the o'th term of -14, 69, 314, 805, 1626, 2861, 4594? 14o*3 - 3o*2 - 6o - 19 What is the l'th term of -1809656, -3619314, -5428972, -7238630, -9048288, -10857946? -1809658l + 2 What is the g'th term of -3423, -3411, -3391, -3363? 4g*2 - 3427 What is the g'th term of -328814, -328810, -328806, -328802, -328798? 4g - 328818 What is the o'th term of -7544, -15060, -22576, -30092? -7516o - 28 What is the g'th term of -92728, -92755, -92802, -92875, -92980, -93123, -93310? -g3 - 4g*2 - 8g - 92715 What is the m'th term of 12372, 12363, 12350, 12333, 12312, 12287? -2m2 - 3m + 12377 What is the j'th term of 940, 1247, 1552, 1855, 2156, 2455, 2752? -j*2 + 310j + 631 What is the d'th term of -74, -136, -260, -458, -742, -1124, -1616? -2d3 - 19d*2 + 9d - 62 What is the v'th term of 29, 2, -65, -190, -391? -3v3 - 2v*2 + 34 What is the o'th term of -140839, -140872, -140927, -141004, -141103? -11o2 - 140828 What is the u'th term of 793, 745, 717, 715, 745? u3 + 4u2 - 67u + 855 What is the b'th term of 24763, 24760, 24757, 24754? -3b + 24766 What is the w'th term of 19272, 19284, 19312, 19362, 19440? w3 + 2w2 - w + 19270 What is the f'th term of -752895, -1505775, -2258657, -3011541, -3764427, -4517315? -f2 - 752877f - 17 What is the j'th term of 2103, 8361, 18793, 33399, 52179? 2087j*2 - 3j + 19 What is the l'th term of -97723, -195337, -292941, -390529, -488095, -585633? l3 - l2 - 97618l - 105 What is the o'th term of 2858, 2853, 2848, 2843, 2838? -5o + 2863 What is the f'th term of 3796, 3762, 3742, 3742, 3768? f3 + f2 - 44f + 3838 What is the i'th term of -31787, -63559, -95313, -127043, -158743, -190407, -222029, -253603? i3 + 3i*2 - 31788i - 3 What is the u'th term of -21161, -21160, -21159, -21158? u - 21162 What is the n'th term of -78, -360, -830, -1488? -94n2 + 16 What is the q'th term of 55, 355, 1131, 2623, 5071, 8715, 13795? 40q*3 - 2q*2 + 26q - 9 What is the z'th term of -4706, -9410, -14114? -4704z - 2 What is the a'th term of -61654, -61654, -61652, -61648, -61642, -61634, -61624? a2 - 3a - 61652 What is the s'th term of -157, -97, 69, 395, 935? 9s3 - s2 - 165 What is the d'th term of -78, -58, -24, 24? 7d*2 - d - 84 What is the g'th term of -8247, -32991, -74233, -131973, -206211, -296947? -8249g*2 + 3g - 1 What is the u'th term of -35254, -70454, -105654? -35200u - 54 What is the a'th term of -4, -151, -336, -565, -844? -a3 - 13a*2 - 101a + 111 What is the f'th term of -793, -1570, -2327, -3064? 10f2 - 807f + 4 What is the j'th term of -152, -393, -726, -1151, -1668, -2277, -2978? -46j2 - 103j - 3 What is the t'th term of -323951, -323952, -323953? -t - 323950 What is the s'th term of -309, -1324, -3009, -5364, -8389? -335s2 - 10s + 36 What is the y'th term of 134, 500, 1106, 1964, 3086, 4484? 2y3 + 108y*2 + 28y - 4 What is the b'th term of -189654, -379307, -568960, -758613, -948266? -189653b - 1 What is the g'th term of 210787, 210786, 210785? -g + 210788 What is the x'th term of 389, 327, 207, 23, -231, -561? -x3 - 23x*2 + 14x + 399 What is the t'th term of -11025, -11039, -11071, -11127, -11213, -11335, -11499? -t*3 - 3t*2 + 2t - 11023 What is the j'th term of 130889, 130886, 130883, 130880, 130877? -3j + 130892 What is the t'th term of 4815409, 9630820, 14446231? 4815411t - 2 What is the a'th term of 190, 1592, 5438, 12952, 25358, 43880? 204a3 - 2a*2 - 20a + 8 What is the f'th term of -900, -904, -866, -768, -592, -320, 66, 584? 3f3 + 3f*2 - 34f - 872 What is the r'th term of 444, 856, 1230, 1560, 1840, 2064? -r*3 - 13r*2 + 458r What is the c'th term of 8250, 8073, 7898, 7725? c*2 - 180c + 8429 What is the j'th term of -44, -29, 14, 85, 184, 311, 466? 14j2 - 27j - 31 What is the b'th term of -36262, -36297, -36332, -36367, -36402, -36437? -35b - 36227 What is the x'th term of -1015408, -1015410, -1015412? -2x - 1015406 What is the p'th term of -2497, -2488, -2481, -2476, -2473? -p*2 + 12p - 2508 What is the h'th term of 33124, 132484, 298084, 529924, 828004? 33120h2 + 4 What is the y'th term of 5313, 10614, 15915, 21216, 26517? 5301y + 12 What is the k'th term of 38, -306, -658, -1024, -1410? -k*3 + 2k*2 - 343k + 380 What is the m'th term of 21, -69, -283, -615, -1059, -1609, -2259, -3003? m*3 - 68m*2 + 107m - 19 What is the b'th term of 56961, 113906, 170851? 56945b + 16 What is the i'th term of 395, 850, 1373, 1958, 2599, 3290? -i3 + 40i*2 + 342i + 14 What is the v'th term of -56336, -112670, -169004, -225338? -56334v - 2 What is the p'th term of -77, -199, -423, -803, -1393, -2247, -3419, -4963? -9p*3 + 3p*2 - 68p - 3 What is the l'th term of 171219, 342439, 513659, 684879, 856099, 1027319? 171220l - 1 What is the k'th term of 78161, 78162, 78163? k + 78160 What is the y'th term of -101, -149, -203, -263, -329? -3y*2 - 39y - 59 What is the m'th term of -1838, -1662, -1486, -1310? 176m - 2014 What is the i'th term of 1682, 6752, 15202, 27032, 42242, 60832, 82802? 1690i*2 - 8 What is the j'th term of 318, 947, 1912, 3213, 4850, 6823, 9132? 168j*2 + 125j + 25 What is the w'th term of -479, -383, -287, -191, -95, 1? 96w - 575 What is the x'th term of -377, -445, -561, -731, -961, -1257, -1625, -2071? -x3 - 18x*2 - 7x - 351 What is the t'th term of 2062, 1508, 954, 400, -154, -708? -554t + 2616 What is the p'th term of -97811, -97795, -97771, -97739, -97699, -97651? 4p*2 + 4p - 97819 What is the o'th term of 32, 66, 74, 56, 12, -58, -154? -13o2 + 73o - 28 What is the m'th term of 51, 103, 193, 327, 511? m*3 + 13m*2 + 6m + 31 What is the k'th term of -5147, -5144, -5129, -5096, -5039, -4952? k*3 - 4k - 5144 What is the l'th term of 181980, 181979, 181978, 181977, 181976? -l + 181981 What is the f'th term of 9324, 9316, 9304, 9288, 9268? -2f2 - 2f + 9328 What is the w'th term of -11, -44, -47, 22, 205? 7w3 - 27w*2 - w + 10 What is the y'th term of -18, -36, -60, -90? -3y*2 - 9y - 6 What is the w'th term of 728, 2722, 6052, 10724, 16744, 24118, 32852? w*3 + 662w*2 + w + 64 What is the o'th term of 19129, 38282, 57435, 76588? 19153o - 24 What is the k'th term of 4458, 4527, 4642, 4803, 5010? 23k2 + 4435 What is the a'th term of -322, -1099, -2324, -3997? -224a*2 - 105a + 7 What is the v'th term of 21692, 43392, 65092? 21700v - 8 What is the j'th term of 11983, 11990, 11997, 12004, 12011? 7j + 11976 What is the a'th term of 43944, 87955, 131956, 175941, 219904, 263839? -a3 + a2 + 44015a - 71 What is the d'th term of 263397, 263398, 263399, 263400? d + 263396 What is the z'th term of -51523, -51616, -51709? -93z - 51430 What is the h'th term of -346, -1697, -5380, -12565, -24422, -42121, -66832, -99725? -195h3 + 4h*2 + 2h - 157 What is the a'th term of -2038, -2870, -3686, -4480, -5246, -5978, -6670? a*3 + 2a*2 - 845a - 1196 What is the y'th term of 391, 788, 1183, 1576, 1967? -y*2 + 400y - 8 What is the t'th term of -113, -126, -165, -242, -369, -558, -821, -1170? -2t3 - t2 + 4t - 114 What is the s'th term of -122, -304, -492	{ "pile_set_name": "DM Mathematics" }
t h = 63.82 - 60.82. Which is the third biggest value? (a) h (b) -3220 (c) 0 b Let z = 547/1694 + -9/242. Let o = -9.1 - -13. Let n = o - -1.1. What is the second biggest value in n, 1.1, z? 1.1 Let p be 17 + -1 + (-114730)/7161. What is the third biggest value in p, -43, -2/17? -43 Let h = 6.6 - 5.96. Let v = h - 0.24. Which is the biggest value? (a) v (b) 0.09 (c) 2 c Suppose 5s = 3v + 17, -2v = s - 3 + 23. What is the second smallest value in -26.4, -0.07, s, -0.2, 5? s Let i = -329003/234 - -1406. Let w = i + 449/4446. Which is the second smallest value? (a) -1 (b) w (c) 0 c Suppose -5l = 3q + 32, -8q - 4l - 36 = -3q. Let n = 0.62 + -2.12. Which is the second smallest value? (a) q (b) n (c) 0.02 (d) 1 b Let k = -2092.9 + 2093.8. What is the third smallest value in -4, -0.3, k, -0.5? -0.3 Suppose 3y + 3p = 8p + 3, 0 = 4p. What is the third smallest value in -0.16, y, 5, -0.5? y Let v = 162.68 - 79.68. Which is the fifth smallest value? (a) -1/7 (b) v (c) 1/4 (d) -0.4 (e) 3 b Let y = -1.062 - -0.662. Let f = 5.7 - 7.7. Which is the second biggest value? (a) 0.2 (b) f (c) y (d) 22 a Let b = 118 + -115. Suppose 0 = -bc + 5l + 17, 3c = -2l - 0 + 10. What is the biggest value in 2, c, -0.041? c Let o = -35554 - -248876/7. What is the biggest value in o, -709, -1? o Let o be 22/(-55) + (-1194)/15. Let m = o + 319/4. Let s = 3.9 - 4.4. What is the third biggest value in -0.1, -4, m, s? s Let d = -402.926 + -0.074. Let h = d - -407. Which is the third smallest value? (a) h (b) -0.5 (c) -2/3 a Let x = 984 + -627. Let r = 356 - x. What is the fourth biggest value in 11, 2/5, 2/7, r? r Let x be 246 + -232 - 443. What is the third smallest value in x, 2/15, 2? 2 Let g = -26/9 + 139/45. Suppose -t + 4o - 4 = 9o, 0 = -5t - 3o + 2. Which is the fourth biggest value? (a) 5 (b) 24/7 (c) t (d) g d Let o = 10046 - 10048. What is the third smallest value in o, 16/5, -4, 3, 2/5? 2/5 Let z = 99 - 99.04. Let w = 0.54 + z. Which is the biggest value? (a) -1 (b) 8 (c) w b Let t = -0.4 + -0.6. Suppose 2g + 2x = -360, 0x + 2x = -4g - 710. Let w = 521/3 + g. Which is the smallest value? (a) t (b) 0.2 (c) -0.2 (d) w d Let v = 52215/7 + -7459. Which is the third biggest value? (a) 2 (b) v (c) -2/203 c Let v = -1834/5 - -366. Which is the third smallest value? (a) -1/9 (b) 2/3 (c) v (d) -5 (e) -0.9 c Let k = 31758/5 + -6351. Which is the smallest value? (a) 0.17 (b) -4 (c) k (d) 5 b Let q = 3767 - 3772. Let j be 3 - (-6)/(-9) - 2. Which is the biggest value? (a) q (b) j (c) 2 c Let i = -958/7 + 204040/1491. Let b = -48/71 - i. What is the second biggest value in 0.5, 0.3, 8/5, b? 0.5 Let u = 1555 - 1577.461. Let i = -0.139 + u. Let g = i - -23. Which is the second smallest value? (a) 0.07 (b) 5 (c) g c Let g = -976.5 - -977. Let r = 32 - 33. What is the smallest value in 0.06, g, r? r Let n = 4921/14757 - 2/14757. What is the third smallest value in 3/8, 4/5, -1/3, n, 0? n Let g = -995 + 1002.21. Let j = g - 3.21. Let n = 7 + -7.6. What is the second biggest value in -5, n, j? n Let n be ((-3)/25)/(796/(-135320)) + -21. Let g = 0 + 0.4. Which is the third biggest value? (a) g (b) -6 (c) n b Let n = 1/6 - 1/2. Let i = 71383 + -71387. Which is the second smallest value? (a) 2/13 (b) 1/14 (c) i (d) n d Let j be ((-24)/20)/((-21)/70). Let k be (8/14)/(j - (2 - 0)). Let p = 3 - 8. Which is the second smallest value? (a) k (b) -10 (c) p c Let r = 15943.6 - 15944. Let p be 44/(-52) + -1 + 2. What is the smallest value in -1/14, r, p? r Let x = 0.1 + 0. Let j = x + 0.4. Suppose 469 + 105 = 287k. Which is the biggest value? (a) j (b) k (c) -8 (d) 4 d Let p = -38.2 + -8.8. Let b = 0.0794 + -0.5794. What is the second biggest value in p, 4, 0.5, b? 0.5 Let d = 47.2 - 39.2. Which is the biggest value? (a) 0.2 (b) d (c) -82 b Let f be -22 - (-2533)/119 - 9/105. What is the smallest value in 0, -2, -141, f? -141 Let f = -409 - -408.2. Let z = -12 + 12.25. Let b = 0.25 + z. What is the third biggest value in -0.2, b, f, 4? -0.2 Let o = -15 + 2. Let y = o + 14. Let q = -0.08 + 0.08. Which is the smallest value? (a) q (b) y (c) -9 c Let z = 0.807 - 0.127. Let v = -40.08 - -39. Let j = z + v. Which is the third biggest value? (a) 0.5 (b) j (c) 2 b Let u = -692 - -9006/13. Let q = 0.28 + -0.58. What is the third biggest value in u, q, 2? q Let y = -150217.2 - -150220. Let a(w) = w2 - 5w - 2. Let b be a(6). What is the biggest value in -5, y, b? b Let s be (5/(-4) - -2)/(6363/7070). Let g = 0 + -1. Which is the fourth smallest value? (a) 4/19 (b) g (c) s (d) 3/2 d Let n = -0.02606 + -0.37394. What is the third biggest value in n, 3, -0.6, 10/19? n Let k = 0.07012 - -82.92988. What is the third biggest value in k, 0, 2/3? 0 Let a be -6 + -7 + (-530)/(-90). What is the smallest value in -2/7, 0.4, -2/3, a? a Suppose -5p + 4z - 9628 = 0, z = 8p - 9p - 1931. Let j = p + 13500/7. Let s be -13(-2)/22 + -1. What is the smallest value in j, 1/3, s, 0.3? s Let b = 479393 - 479394.5. Let m = 5 + -5.4. What is the third biggest value in -0.1, b, m? b Let n be (0 - 1115/(-25))/((-7)/(-35)) + -8. What is the smallest value in n, -1, -2, -5? -5 Let j = 4150 + -4145.603. Let r = j + -0.097. Let h = -4.36 + r. Which is the second biggest value? (a) -3/2 (b) -5/6 (c) h b Let c = 0.185 + -150.185. Let a = c + 150.8. What is the second smallest value in 0, a, 1? a Let g be (24/(-32))/(130/32 + -7 + 2). Which is the third smallest value? (a) -1 (b) g (c) -134 b Let d = 22999 - 22998. What is the second biggest value in 133, d, -0.01, -0.5? d Let j = -14413 - -14413.2. Which is the third biggest value? (a) 1 (b) 1/2 (c) j (d) 2 (e) -26 b Let o be (5/(-15))/((-11)/44). Let h be 42 - (-1 + (-1 - -2)). Let s be 5/3h/(-7). Which is the third smallest value? (a) 0 (b) s (c) o c Let l = -0.619 - 4.381. Let o = -15 + 29. Let f = 13 - o. Which is the third smallest value? (a) 1/4 (b) l (c) f a Let k be ((-2)/(-12))/((-4)/(-12)). Let q = -231 + 85. Let n = q - -145.5. Which is the fourth biggest value? (a) -4 (b) 3 (c) n (d) k a Let d = -26521 + 26621.285. Let m = -100 + d. Let r = m + -0.33. What is the third biggest value in r, 4, 5/4? r Let g = 666 - 962. Let l = -291 - g. Let k = -5 + 2. What is the second smallest value in l, k, 0.1? 0.1 Let j = 198.182 - 0.182. Let i be -24 + 32 + 66/(-8). What is the second smallest value in i, j, 3? 3 Let f = 368.2 + -475. Let n = f - -107. Which is the second smallest value? (a) 0 (b) -1.2 (c) n a Let q be ((-14)/(-21))/(12/271-2). Which is the second smallest value? (a) 2/23 (b) q (c) 3/2 a Let x = 527 + -510. Suppose -xn - 7n = -72. Suppose t + 1 - 3 = 0. Which is the smallest value? (a) t (b) n (c) -3 (d) 4/5 c Suppose 8 = -2o, -6o + 14 = -5u - 2o. Suppose -3d = 2 + 1. Which is the third biggest value? (a) u (b) -1/4 (c) d a Let o = -15620.7 - -16568. Let u = o + -947. Let h = -6 - -4. Which is the fourth biggest value? (a) u (b) h (c) 0.5 (d) 2 b Let v = -0.3 - -12.3. Let d be ((-2)/(-1))/(13/1). Let w = -44385.7 + 44386.2. Which is the smallest value? (a) v (b) d (c) w b Let b be (-2)/5((-795)/(-135) - 7). Let u be 8/(-3) + (-1)/3. What is the second smallest value in b, -0.4, u? -0.4 Let s = 11 - 10.82. Let q(i) = 893i - 20543. Let u be q(23). Which is the smallest value? (a) u (b) 0.2 (c) s (d) 0.1 a Let u = -168 + 159. Let b be 3/u + (2 - 7/(-3)). Let l = -23 - -22.3. What is the smallest value in l, b, 0.5, 3? l Let o = 46287/11 - 4208. Which is the third biggest value? (a) o (b) -1/7 (c) -16 c Let t = -11308 - -11307.9. Which is the second biggest value? (a) -3 (b) 1 (c) 0.5 (d) 322 (e) t b Let t be 21 - 11 - (-1 - -15). Which is the fourth biggest value? (a) -3 (b) 1 (c) t (d) -3/7 (e) -0.29 a Let a be 66/(-30)*(-65)/52. What is the third smallest value in a, -4, 19.9, 0.1? a Let t = -1.83 + 2.23. Let q = -0.084 + -0.116. What is the third biggest value in t, q, -0.06? q Let m = 296 + -297. Let l = -859/41668 + -2/947. Which is the fourth smallest value? (a) l (b) -4 (c) 2 (d) m c Let j = -45943 + 45923. Let p = 11 - 7. Which is the third biggest value? (a) j (b) p (c) 0	{ "pile_set_name": "DM Mathematics" }
48 - 48)(6 - 2 - 1). -96z*5 Expand (0m2 - m2 + 2m2)(5m - m - 2m) + (-2 + 4 - 6)(1 - 1 - m3). 6m*3 Expand (3 - 3 - 1)(x - 3x + 3x) + x + 2x - 5x + (-3 + 3 - 6)(-x + 2x - 3x). 9x Expand (w + 5w + 2w)(-3w + 2w - 2w*2 + 0w*2). -16w*3 - 8w*2 Expand (-3 + 0 - 7)(-2 + 0 - 1)(0i + 1 - 3i + i). -60i + 30 Expand (18 + 20 - 11)(2a*2 + 0a*2 + 0a*2). 54a*2 Expand 6l*5 + 4l*5 - 5l*5 + (2l3 - l3 + 2l3)(-l*2 + 2l*2 + 0l*2). 8l*5 Expand (-2g - 1 + 1 + (4g - 3g - 3g)(-1 - 4 + 3) - g + 0g + 0g - 5g + 6g - 3g)(-134g + 10g*2 + 134g). -10g3 Expand (2d5 - d5 + d*5)(0 + 4 - 2) + d*5 - 6d5 + d5 + (d2 - d2 + 2d3)(-3d2 + 6d*2 - 2d2) - d5 + 3d5 - 3d5. d5 Expand (-2h - 4h*5 - 22h*4 + 22h*4)(-1 - 3 + 0). 16h5 + 8h Expand (3p2 - 3p2 + p2)(-2p + 2p - 2p) - 19p3 - 6p*2 - 13p*3 + 30p*3. -4p*3 - 6p*2 Expand (-153i*5 + 2i*3 + 74i*5 + 125i*5)(-5 + 6 + 1). 92i5 + 4i*3 Expand (-2k + 2k - k)(6 - 2 - 1) + 0k + k - 6k + (-5 + 1 + 2)(-4 + 4 + 6k) - 3k + 6k - 4k. -21k Expand -2f - 1 + 1 - 2f + 2f + f - f + f + f + (f + f - 4f)(-3 + 2 + 0). 2f Expand (3 - 3 + 2x)(x2 + x2 + 0x2) - x3 - 3x*3 + 2x*3 + (-4x*2 + 3x*2 + 2x*2)(-2 + 2 - x) + 5x3 - 2x3 - x3. 3x3 Expand -c2 + c2 - 6c*2 + (-2c - c + 2c)(0 + 0 - 2c). -4c*2 Expand (-3 - 3 + 1)(o3 + o4 + 5o3 + o4). -10o*4 - 30o*3 Expand (0d2 - d2 + 5 - 8)(-2d*3 - 3d*3 + 6d3). -d5 - 3d3 Expand (-1 + 3k*4 + 1)(3 - 3 - 1) - 3k4 + 2k*4 + 0k*4 + (3k3 - k3 + 0 + 1)(-7k + 11k + 7k)(3 - 1 - 4). -48k*4 - 22k Expand (2 + 0 + 1)(0b*5 + 5b*5 - 11b*5) + 3b*5 - 2b*5 + 0b*5. -17b*5 Expand (1 - 5 + 0)(-a - 3 + 3) - 5 - a + 5. 3a Expand -3n*3 + 0n + 0n + (5n - 4n + 0n)(-2 - n2 + 2) - 3n*3 + 4n*3 - 4n*3. -7n*3 Expand (-1 - 1 + 4)(0 + 2 - 3)(2q + 7q - 15q). 12q Expand 2 - 2 - 2v5 - v5 + v*5 - 2v*5 + (3v2 - v2 - v*2)(-v3 + v3 - 2v3) + 0v5 - v5 + 0v5 - 2v5 - v5 + 5v5. -5v*5 Expand (-5 + 3u*2 + 5)(-2 + 2 - u - 2). -3u3 - 6u*2 Expand (j + 1 - 1)(-15j - 3 - 2 + 14j). -j*2 - 5j Expand (-1 + 3 - 1)(-q - q + 4q)(2q2 + q2 - q*2). 4q*3 Expand (2i - 3i + 0i)(-1 + 2 - 2) + (-7 + 4 + 4)(11i - i - 3i). 8i Expand (-4g*2 + 2g*2 + 4g*2)(-3g3 + g3 - 29 + 30). -4g*5 + 2g*2 Expand 6f*4 - 9f*2 + 9f*2 + (2 - 2 + f)(-2f3 - 5f*3 + 5f*3) - 2f4 + f4 + 2f4. 5f*4 Expand (-3 + 3 + 10x)(3x*2 + 2x*2 - 7x*2). -20x3 Expand -i3 + i*3 + 4i*3 + (2i*2 - 6i*2 + 2i*2)(0 - i + 0). 6i3 Expand (0 - 2q*2 + 0)(19 - 6 - 6 + q*2). -2q*4 - 14q*2 Expand (8m*2 - 2m2 + m2)(5m + 2m3 - 5m) + 0m5 + m5 - 2m*3 + 2m*5. 17m*5 - 2m*3 Expand (0u*4 - 2u*4 - 2u*4 + (0 - u + 0)(2u3 + 3 - 3))(0 - 1 - 2 + (1 - 4 + 1)(1 + 2 - 1) - 1 + 2 + 1 - 1 - 1 + 3 + (0 - 3 + 4)(0 + 2 - 3)). 30u4 Expand ((-3b + 0b + 2b)(0b + b + 0b)(3 + 0 - 1) + b*2 - 1 + 1)(-6b - 7b - 3b). 16b*3 Expand 10 - 2k*5 - 8 + 3k*5 - 2k*2 + (5k*3 - 3k*3 - 4k*3)(0 + 0 - 2k2) + 6k*5 - 2k*5 - 2k*5. 7k*5 - 2k*2 + 2 Expand (-2v + 2v3 + 2v)(-3v - 8v + 73v) - v*4 - 2v*4 + 5v*4. 126v*4 Expand (3l2 - l2 - 4l2)(3 + 0 - 1) + 8l2 + 6l2 - l2. 9l2 Expand -4j*3 - 4j3 + j3 + (4j - 2j - 3j)(j*2 + 3j*2 - 6j*2). -5j*3 Expand 3 - 3 - 2x*2 + (3x + 0x - 5x)(x + x - x) + (2 - 1 - 3)(-5x2 - x2 + 4x*2) - x + x + 5x*2. 5x*2 Expand (13 - 6 + 8 + (0 + 0 + 2)(1 - 2 + 0) - 3 + 3 - 2)(6z*3 + 2z3 + z3). 99z3 Expand (-2 + 4 + 0)(-2w5 - 5 + 5) + w5 - 10w5 - w5. -14w5 Expand (0 - v + 0)(v*2 + 3v*2 - 6v*2) + (0 + 1 + 0)(-11v3 + 37v*3 - 5v*3). 23v*3 Expand ((4m*2 - 3m*2 - 3m*2)(-2 + 2 + 2m2) + m4 - 5m*4 + 2m*4)(14m - 74m - 19m). 474m*5 Expand (2z - 2 - 4 + 4)(1 + 6 - 3). 8z - 8 Expand (-v2 + v2 - v*4)(1 + 0 - 3 - 1 - 3 + 2 + (0 - 3 + 2)(-3 + 2 + 3) + 1 + 3 - 3 + 3 + 1 - 5). 6v*4 Expand (-3 + 2 + 3)(-9x3 + 4x*3 + 2x*3). -6x*3 Expand (2 - 5 + 2)(y - 5y + 2y) + 2y - 2 + y - 4y. y - 2 Expand 330 - 2h3 - 321 + 4h*3 + (-2 - h + 2)(4h - 4h - 2h2). 4h*3 + 9 Expand ((-d + d + 2d)(1 - 3 + 3) + d - 4 + 4 + 0 + 0 - 2d)((2d + 2d - 3d)(2d - 3 + 3) + 2d2 + 0d*2 + 0d*2). 4d*3 Expand (-4i*2 + 4i*2 + 2i*2)(2i + 2i*3 - 2i) + (-8i + 12i - 2i)(-2 + 2 - 2i)(-3i2 + 3i*2 - 5i*3). 24i*5 Expand (3u - u + u)((2 + 1 - 5)(2 - 3 + 0) + 7 + 0 - 3). 18u Expand l3 + 0l*3 - 2l*3 + (2 - 2 - 2)(2l3 + 0l + 0l) - 2 - 3l*3 + 2 + (2l*2 - 5l*2 + 2l*2)(7l - 3l - 2l) + 3l*2 + 2l*3 - 3l*2. -8l*3 Expand (2 + 20 - 3 - 2g)(4g - 4g + g2). -2g*3 + 19g*2 Expand ((-4 + 1 + 2)(0u + 0u - u) + 2u + 0u + 0u + 5u - 5u - u)(5 - 5 - 3u2). -6u*3 Expand -4u*5 + 0u*4 + 0u*4 + (4u - u - 2u)(-4u4 + 4u*4 + 2u4) - 1 + u5 + 1 - u*5 + 0u*5 + 6u*5. 4u5 Expand -b2 + b*2 - 4b*2 + (0b + b - 6b)(3b + 1 - 1). -19b*2 Expand (7b - 3b + 5b)(2b - 3b - b)(-2b + 3 + b - 1). 18b*3 - 36b*2 Expand (6 + l + 1 - 2)(-4 + l*2 + 3 - 3l*2). -2l*3 - 10l*2 - l - 5 Expand 0m*4 + 4m*4 - 3m4 + (-m3 + 2m3 + m3)(-2m + 2m - 2m) - m4 - 4m*4 + 3m*4. -5m*4 Expand (-3 + 3o*2 + 3 + (-3o2 + o2 + 3o2)(2 - 5 + 1))(107 + 14o*3 - 107). 14o*5 Expand (2 + 3 - 3)(3f2 + 3f*2 - 5f*2)(4 - 4 - 5f). -10f*3 Expand (-3 + 2 + 2)(4d - 2d + 21d). 23d Expand (6 - 2 - 2)(-2 + 2 + y) + (5 - 4 + 3)(4y - 114 + 114). 18y Expand (-3 + 4 + 0)(1 + 4p - 1) - 4p + 4p + 3p. 7p Expand (2a - 3 + 3)(9a - 5 - 22a - 3a3 + 2). -6a*4 - 26a*2 - 6a Expand (-1 + 3 + 0)(3 + 0 - 2)(39g + 4g*3 - 39g). 8g3 Expand (6g - 4g - g)(68 - 40g3 - 68). -40g*4 Expand -3k*3 - 7k*3 - 1 - 6k*3 + (4k2 + k2 - 6k2)(-3k + 2k + 3k). -18k*3 - 1 Expand (2z + 2z + 0z)(-2 + 2 - 2) + (z + 0z + z)(-3 + 6 - 2) - 4z + z + 2z. -7z Expand (1 - 1 + b*2)((6 - 3 - 1)(5b*2 - 6b*2 - 10b*2) - 5b*2 + 0b*2 + 3b*2). -24b*4 Expand 2d*5 + 2d*3 - 2d*3 + (2d*4 + 0d*4 + 2d*4)(-d - 4 + 4) - d4 + d4 - 2d5. -4d*5 Expand (-5 + 2 + 2)(-2d - 3 + 0 + 0d)(2 - 1 + 5). 12d + 18 Expand (-2 + 4 - 3)(-3s + s + 4s)(-s*2 + 0 + 0 + (-s - s + 0s)(-5s + 3s + s) + 0s*2 - 4s2 + s2). 4s3 Expand x5 - 2x*5 + 0x*5 - 3x*5 - 6x*5 + 2x5 + (-1 + x2 + 1)(-3x*3 + 3x*3 - 2x*3). -10x*5 Expand (2a - 2a - 3a)(0 + 4 - 2)(-4a3 + 0a*3 + 2a*3)(-1 + 1 - 1). -12a4 Expand (h + 2 - 1 - 4)(-2h4 + 2h4 + h4 + (-1 - 1 + 1)(3h*4 + 3h*4 - 4h4) - h - h4 + h). -2h5 + 6h*4 Expand (-1 + 0 - 1)(0 - 2 + 0)(-11 - 130c - 161c + 307c). 64c - 44 Expand a2 + 2a*2 - 60a*2 + (0a2 + a2 - 2a2)(3 - 3 + 2) + a - 1 - a - a*2. -60a*2 - 1 Expand (-1 - 3 + 3)(-5c4 - c4 + 2c*4) + (5c*2 + 0c + 6c - 5c)(c2 + 3 - 3). 9c4 + c3 Expand (2s - 3s + 0s)(-1 - 1 + 1)(7 + 6 - 3). 10s Expand -m - 4m + 3m - m + 9 - 9 + (5 - 1 - 1)(1 - 1 - 2m) + 5 - 5 + 3m + 2m + 3m - 7m - 5m + 3m + 0m + 1 - 1 - 2m. -12m Expand (5f + 1 - 7f + 0)(1 - 5 + 3). 2f - 1 Expand (-2f + 3f - 2f)(f2 + 0f*2 - 2f2). f3 Expand (-2i + 0i + 0i + (5i - i - 6i)(-12 + 39 - 12))(3i*2 - 3i2 - i2). 32i3 Expand (-z2 + 0z*2 - 3z*2)(5z3 - z3 - 5z*3) + (-9z*2 + 22 - 22)(-3z3 + 3z*3 + 2z*3). -14z*5 Expand (2m*3 - 4m3 - m3)(-1 + 4 - 4). 3m*3 Expand (3w + w - 5w)((-2 + 5 - 1)(0w + w - 4w) + 2w - 3w - w). 8w*2 Expand (-23 + 3 + 8)(2 - 2 - 1)(2 + g - 1 + 0g). 12g + 12 Expand (3k*3 - 3k*3 - 2k*4)(-3k + 4k + k) - k*3 + 0k*3 + 2k5 - k3. -2k5 - 2k*3 Expand -2 + 2 - 10t*4 + (0t3 + t3 - 2t3)(-2t + 4t + 0t) + t4 - t4 - t4. -13t*4 Expand (11g + 11g - 4g)(1 + 0 - 3) + 2g - 1 + 1 + (2 + 3 -	{ "pile_set_name": "DM Mathematics" }
4r + 5w. Is 14 a factor of r? True Let d(i) = 141i2 + 5i - 2. Is d(1) a multiple of 7? False Let r(s) be the first derivative of -7/2s2 - 2s*3 + 4s + 1/4s4 - 1. Is r(7) a multiple of 3? False Suppose 0 = -4z + 2z + 20. Is 2 a factor of z? True Let t(x) = -5 + 0x + 2 - x*2 + 8x - 11x3 - 5x*2. Let n(s) = 5s*3 + 3s*2 - 4s + 1. Let i(d) = 9n(d) + 4t(d). Does 7 divide i(-3)? False Let u = -114 + 195. Does 9 divide u? True Let p(b) = b*2 - 2b + 1. Let i be p(4). Let q = 11 - i. Suppose -qs + s = -9. Is 4 a factor of s? False Let r(t) = 18t - 35. Is r(5) a multiple of 7? False Let u = -48 + 213. Suppose -9d + 14d = u. Does 7 divide d? False Is 11 a factor of ((-15)/(-3) + 27)2? False Suppose -5z + 3h = -155, 5h = z + 6 - 37. Suppose -v - z = -g + v, 5g + 2v = 143. Is 14 a factor of g? False Suppose 10 = -4u + 2. Let o be (8/(-2))/(1u). Is 14 a factor of 14/o(-2)/(-1)? True Let p(s) = -s2 - 5s + 4. Let u be p(-5). Suppose ui + 12 = 84. Does 9 divide i? True Does 16 divide 1/(-5) + (-243)/(-15)? True Suppose 9 = 3a, -2i + 109 = -0a + 5a. Is i a multiple of 19? False Let d be (-4)/6 + 730/15. Suppose -4i + 8i + 5h = 48, -4i + d = h. Suppose 0 = -s - 2p + 19, -i = -5p - 2. Is s a multiple of 11? False Let w(f) = 9f + 49. Let x(j) = -5j - 25. Let h(m) = 6w(m) + 11x(m). Does 3 divide h(9)? False Let i be -11 + 1 - 11/(88/(-32)). Let s be (-1)/(-1 + 28/30). Let u = i + s. Does 9 divide u? True Let g be (-16)/(-6) + 6/(-9). Suppose -57 = -a - 3i, 7a - 285 = ga - 2i. Is a a multiple of 18? False Let u(y) = -8y + 1. Let v be (-48)/(-40)(-5)/2. Is u(v) a multiple of 24? False Let n = 13 + -8. Suppose -117 = -ns - 27. Is s a multiple of 9? True Let v be -17 + 1/(-2)-2. Let u be ((-44)/(-5))/((-1)/(-5)). Let z = v + u. Does 14 divide z? True Suppose -8g = -256 - 384. Is g a multiple of 10? True Let i(m) = -m - 1. Let h be i(-6). Let l = -5 + h. Is 0 + (l - 6-3) a multiple of 16? False Let j = -85 + 121. Is j a multiple of 7? False Let o(u) be the second derivative of 2u + 0 - 5/6u3 + 0u*2. Is o(-1) a multiple of 2? False Suppose -5k + 10k = 10. Let m(n) = 0n*2 + 7 + 2n*k - 3n*2 + 2n*2. Is 16 a factor of m(-5)? True Let w(m) = -7m*3 + 4m*2 + 2m - 1. Let v be w(-2). Suppose v = 4j + x, -2j - x = -2x - 35. Is 6 a factor of j? False Suppose 0 = 5d - 64 - 16. Suppose d = q - 22. Is q a multiple of 38? True Let z(h) be the third derivative of h7/840 + h6/90 - h5/60 - h4/6 + h*3/3 - 2h2. Let d(q) be the first derivative of z(q). Does 8 divide d(-3)? False Let m(u) = u3 + 1. Let a be m(0). Is 16 a factor of 1 + 31/(1/a)? True Suppose 3u - 2u + 5 = 0. Let o(b) = -b*3 - 3b*2 + 5b - 1. Does 12 divide o(u)? True Let q(b) = 17b2 - 1. Let c be q(1). Let z be (4 + -1)/(3/c). Suppose 4j - z = 2j. Is 8 a factor of j? True Let l be 12/(-8)20/(-6). Suppose -236 = -lg + 34. Is g a multiple of 18? True Suppose -b - 358 = -3u, 0 = -2u - 3b + b + 228. Let z = u - 82. Is 18 a factor of z? True Let v = -102 + -1. Is 7 a factor of v/(-5) + (-8)/(-20)? True Suppose -4i + 2i = 14. Let n be 4/(-14) + (-16)/i. Suppose nr + 13 = 73. Does 15 divide r? True Let z(y) = 3y*3 + 2. Let f be z(2). Suppose 2b - 18 = f. Does 9 divide b? False Let h = -3 + 4. Is 13 a factor of (3h)/(11/143)? True Let s = 34 - 14. Is 5 a factor of s? True Let d(c) = -6c - 2. Is 4 a factor of d(-3)? True Suppose 0 = w - 4b - 31, w - 100 = -5b - 33. Suppose k + w = u - 2k, 4k - 330 = -5u. Is 8 a factor of u? False Let i(l) = 10l - 2. Let y be i(-1). Let u = y - -20. Does 4 divide u? True Let o(g) = -g*3 + 2g*2 + 3g + 3. Let m be o(-2). Suppose p = m + 2. Is 7 a factor of p? False Is 4 a factor of (-3 - -18) + -4 + (0 - 0)? False Suppose -2k - 4u - 3 = -k, -2u = 4. Let d = k + 2. Is d a multiple of 4? False Suppose 0 = 4g - 73 - 151. Is g a multiple of 14? True Let d(x) = -x*2 - 15x + 2. Let y = -4 + -7. Is 8 a factor of d(y)? False Let i be (-2 - -1)(-28 + 0). Suppose v + 3v - i = 0. Is 5 a factor of v? False Let l = 178 + -112. Is l22/6 a multiple of 22? True Suppose 5k - 61 = 89. Does 8 divide k? False Let r(w) be the second derivative of -2w*3/3 - 2w*2 + 2w. Is 10 a factor of r(-6)? True Let c(v) = -v*2 + v + 14. Is c(0) a multiple of 7? True Let k(u) = -3u - u + 5u + 7. Let g be k(-9). Is (g + 0)/(4/(-30)) a multiple of 15? True Is 28 a factor of 215/5(-1 + 3)? False Suppose -f + 21 - 2 = 0. Is 6 a factor of f? False Suppose 39 = 20z - 19z. Is 17 a factor of z? False Suppose 60 = d - 0t + 3t, -3d + 148 = t. Is d a multiple of 16? True Suppose 0o - 3o = 5n - 17, -2o = -n + 6. Does 5 divide n/(-18) - 195/(-27)? False Let b(q) = q3 - 9q*2 - q + 13. Is b(9) a multiple of 3? False Suppose -8b = -5k - 5b + 36, 3b = -6. Is k/10 + 2429/35 a multiple of 14? True Let t(n) = 2n + 16. Let p be t(-8). Is 28/2 - 2 - p a multiple of 6? True Let l be 38/5 + (-6)/(-15). Suppose -3 = v, -5 = -m - 3v - 15. Let n = m + l. Is 6 a factor of n? False Let p(j) = j - 7. Let d be p(8). Suppose -5l = -9 - d. Suppose -2r = 6v - v - 72, lv + 4r - 32 = 0. Does 5 divide v? False Let d(y) = -37y - 1. Let b be d(-4). Let a = 209 - b. Suppose l + 11 = a. Does 20 divide l? False Let z(b) = 4b - 1. Let p be z(7). Let i = -3 + p. Does 12 divide i? True Let o(p) = -4 + 10 + 6 + 3p - 4p. Is o(0) a multiple of 4? True Let b(t) = 2t + 22. Is b(7) a multiple of 6? True Is 7 a factor of (-2 + -1)(-49)/3? True Let v = -8 + 13. Suppose -14 = 3w + 4q, vw - 5q = 13 + 22. Is 8/((-3)/(-6)w) a multiple of 4? True Suppose 0 = -3t - t + 44. Suppose 2a - 3a - 8 = 0. Let k = a + t. Does 3 divide k? True Let f(i) = 6i - 2. Let m be f(3). Does 5 divide (-3)/(-4) - (-148)/m? True Let z(x) = -14x - x*2 + 2x - 6 - 4x + 0x. Let k be z(-10). Suppose 0y + k = 3y. Is y a multiple of 11? False Let k be 2 - -1 - 2/2. Suppose -o + 2o = k. Suppose oa - 28 = -0a. Does 7 divide a? True Let a(g) = g2 + g. Let w be a(1). Is 66((-3)/3 + w) a multiple of 33? True Suppose 2m + 3a + 63 = 3m, -a - 181 = -3m. Does 15 divide m? True Let s(a) = 16a2 - a. Let l be s(-1). Suppose -5u = 2 - l. Suppose q + un = -5, 2q = -2q + n + 45. Is q a multiple of 5? True Let d = -27 - -47. Suppose u + 3q - 16 = -q, 5q - d = -u. Suppose u = -4j + 31 + 121. Is j a multiple of 14? False Let x = -7 - -10. Suppose -4q = u - 33, -q - 13 = -3q + xu. Suppose -qm + 4m + 40 = 0. Is m a multiple of 5? True Let c(l) = l3 + 27l*2 + 22l - 30. Is c(-26) a multiple of 4? False Let x be ((-8)/5)/(1/5). Let g = x - -21. Does 13 divide g? True Suppose 0 = 3h + 4j - 201, -h - 4j + 0j + 59 = 0. Is 27 a factor of h? False Suppose 0 = -6t + 432 + 1404. Is t a multiple of 34? True Is 11 a factor of (624/(-42) + 2)/((-3)/14)? False Suppose 2d - 107 = 35. Suppose 4s = d + 25. Does 12 divide s? True Is ((-496)/6)/((-24)/36) a multiple of 22? False Suppose 776 = 3w - 202. Is 12 a factor of w? False Suppose -5v - 3w + 21 = -33, 3v - 5w - 12 = 0. Let m = 13 - v. Does 2 divide m? True Suppose -5f + 12 = 2p + 2p, 0 = 4p - 5f - 12. Let u = 2 - p. Is 7 a factor of 2/(2/(-11)u)? False Let t(d) = 2d + 31. Is 3 a factor of t(-13)? False Does 8 divide 2 + (-11)/(22/(-300))? True Let d(h) = h + 6. Let c be d(7). Let w = c + -8. Suppose -t = -wa + 4t + 30, -5t = a - 30. Is 7 a factor of a? False Let g = -17 - -35. Is g a multiple of 16? False Let g(z) = -3z. Let t be g(-1). Suppose 2u - 6u = -5i + 122, -5i - tu + 136 = 0. Does 13 divide i? True Let g(a) = -4a3 + 0 - 11a*2 + 2a*2 - 12a - 3 + 3a3. Is 9 a factor of g(-8)? False Suppose 6y = y. Suppose -3a + 6a - 30 = y. Is 4 a factor of a? False Suppose x + 3x - 5v - 146 = 0, 0 = 2v - 4. Suppose -5w = -j - 79, 28 + x = 4w + 3j. Does 8 divide w? True Let h(k) = -k*3 - 15k*2 - 14k + 9. Is 3 a factor of h(-14)? True Let d(a) = 2a2 - 2a - 2. Suppose 4m + 16 = 0, 3m - 1 = b + 4m. Suppose 0 = -5c - j + 14 + 3, -3c + bj = -3. Does 4 divide d(c)? False Suppose -p - 10p = -1100. Is 27 a factor of p? False Suppose -a - 4h + 9 = 0, a + 33 = 3a + 5h. Let u(d) = -d**2 - d + 1. Let o be u(3). Let m = a + o.	{ "pile_set_name": "DM Mathematics" }
? -7014.8 What is the third smallest value in -3/2191057, 4, 0? 4 What is the third biggest value in 11, -384, 5, 2/17, -12? 2/17 What is the fourth biggest value in 67, 0, -2488/9, -5? -2488/9 Which is the fourth smallest value? (a) 5 (b) 2.5 (c) 1 (d) -2679 (e) -1/2 b What is the second biggest value in -2/9, 1/2, 8569/4724, 5? 8569/4724 Which is the fourth smallest value? (a) -0.18 (b) -2.6 (c) -2/7 (d) -2/19 (e) -0.16 e Which is the third biggest value? (a) 4 (b) 424 (c) 5/126 (d) 1.8 d What is the fifth biggest value in -4/3, 6, -0.4, 2/15, -4, -0.387? -4/3 Which is the smallest value? (a) -5 (b) -1169814 (c) -8.8 (d) 4 (e) 0.1 b Which is the fourth biggest value? (a) 0.5 (b) -26 (c) 4 (d) 17 (e) -2/41 (f) 0.4 (g) 2 a Which is the second smallest value? (a) -32/3 (b) 6/37 (c) -23070 a What is the fourth smallest value in 54, 7.3, -0.4, -22? 54 Which is the third smallest value? (a) 5 (b) 0 (c) -0.3215 (d) 1 (e) 16 d Which is the smallest value? (a) 4 (b) -1/34 (c) 9 (d) 5 (e) -2.5 e What is the fourth biggest value in 3/4, -2/21, 24019, -5/9, -1? -5/9 Which is the fourth biggest value? (a) 2 (b) 1/4 (c) 4 (d) -6970.3 (e) 4/89 e Which is the fifth biggest value? (a) 0.019 (b) -0.5 (c) -228 (d) -2/21 (e) -1.2 (f) -0.1 e Which is the third smallest value? (a) 5 (b) -58.4 (c) -4/305 a Which is the third biggest value? (a) 3/101 (b) -1 (c) 0.29671 (d) 4 a Which is the second smallest value? (a) 12 (b) -3 (c) -48 (d) -0.2 (e) 82 (f) -1 b What is the biggest value in -11700, 10/9, -34? 10/9 What is the sixth biggest value in -5, -2/9, 10/3, -2, 0.02, 1/163? -5 Which is the third biggest value? (a) -0.80018 (b) -4 (c) -1/6 (d) -0.5 (e) 1/3 (f) -2 (g) 0.07 c What is the third smallest value in -26.7, -0.18, 0.69? 0.69 What is the second smallest value in 1, -3, 0.06, -0.1, 0.96, 5261, 2? -0.1 Which is the sixth smallest value? (a) 5 (b) 0.4 (c) -18.6 (d) 6 (e) 1 (f) 1.1 (g) -0.3 a What is the third smallest value in -166/105, -1/3, -4, 82? -1/3 What is the fifth smallest value in -2, -0.5, 5027, 3, -289, 0.4? 3 Which is the second biggest value? (a) 6569467 (b) -1 (c) 9 c Which is the smallest value? (a) -0.3 (b) 2 (c) 4/7 (d) -0.4 (e) -80 (f) 3 (g) -87 g What is the third smallest value in -816, -18, 1.6, 0.17, 1/4? 0.17 Which is the second smallest value? (a) -0.8 (b) -0.1 (c) 25/641 b Which is the second biggest value? (a) -598 (b) 121243/6 (c) -5 c Which is the fifth smallest value? (a) -138 (b) 1 (c) -1/4 (d) -0.4 (e) -2/7 (f) 1/3 (g) -3.9 c Which is the smallest value? (a) 1/6 (b) 0.4 (c) -5 (d) -2 (e) -1/6 (f) 8/9 (g) -23/4 g What is the biggest value in -44, -2, -42, -4/3, -2/563? -2/563 What is the seventh biggest value in -26, -0.7, 2/11, -60, -0.3, 14, -5? -60 Which is the fourth smallest value? (a) 5 (b) -3 (c) 4034.136 (d) 2 c What is the third biggest value in -0.4159, 0.09, 0.13? -0.4159 Which is the second smallest value? (a) -0.5 (b) -0.3 (c) -2 (d) -22 (e) 0.08 (f) 0.8 (g) -0.1 c What is the second smallest value in 1/6, 15, 42, 4/29, 0.4, -0.3? 4/29 Which is the second smallest value? (a) 2 (b) 0.2 (c) -24591 (d) -5 (e) 31 d What is the fifth biggest value in -0.1, 0.5, -1/2, -463, 1.86? -463 What is the smallest value in -108, 1/4, -4, 0.02, 56, 2? -108 Which is the third biggest value? (a) 71124 (b) -0.5 (c) -1.566 c Which is the third biggest value? (a) 895 (b) -1/11 (c) -20 (d) -3.6 d What is the second biggest value in 1, -5, 4/9, -0.07, -387, -2? 4/9 Which is the biggest value? (a) -217/5 (b) 0.1786 (c) 0.02 (d) 1 d What is the fourth smallest value in -7160, -0.0456, -5, -1? -0.0456 Which is the second smallest value? (a) 0.4 (b) 8/202325 (c) 0 b Which is the second biggest value? (a) 13135 (b) 0.5 (c) -0.3 (d) -10 (e) 9 e What is the fifth biggest value in -8, 3, 7, -3/20, -521? -521 What is the third biggest value in -1/4, -0.091, 0.3, -0.79, -12/7, 2, -6? -0.091 What is the third smallest value in -3, 2, 24/16435, 0.5, -4? 24/16435 What is the fifth smallest value in 3, -2060/13, 13/3, -4, 1/3? 13/3 What is the biggest value in 2, -1.491, -131/2, 63? 63 Which is the second smallest value? (a) 0.4 (b) -1/1773 (c) -0.083 b What is the seventh smallest value in -600736, -5, -2, 2, -6, 0.5, -1? 2 What is the second biggest value in 1/2, 2/11, 3, 8, -5, -306006, -1.1? 3 Which is the biggest value? (a) 0.141 (b) 1/7 (c) 3/10 (d) -0.4 (e) 2/11 (f) 0.5 f Which is the seventh smallest value? (a) 1/7 (b) 9 (c) -2 (d) 0 (e) -18500/3 (f) 2 (g) 0.2 b What is the biggest value in -1/2, 1, -1, -13/7, -2.4, -29/4, -0.1? 1 What is the third smallest value in 1/7, -0.0487125, -6, 9? 1/7 Which is the second biggest value? (a) 0.07 (b) -11 (c) 196514 (d) 0 a What is the fifth biggest value in 0.9, -5/6, -1995, 1/3, 149.8? -1995 What is the second smallest value in 2/7, -2/5, -6411215? -2/5 What is the second biggest value in -2/3, -1, 0.1, -2, 7086, 0? 0.1 What is the second biggest value in -0.1, 0.1, 221336/9, 15? 15 Which is the third smallest value? (a) 7 (b) 3 (c) 5076 (d) 0.28 (e) 36 a Which is the third biggest value? (a) -57 (b) 0.22 (c) 177 (d) -68 a What is the third smallest value in 3, 258, -22467? 258 What is the fourth biggest value in 0, 0.4, 2/7, 62, -0.5, 2, -34? 2/7 Which is the third smallest value? (a) 99 (b) 1668 (c) 2/7 (d) 1 (e) 4 e What is the seventh smallest value in -1/19, 1/4, -3, 1/6, -82, 0, -0.18? 1/4 What is the fourth smallest value in 1, 7, -10, -0.1, 0.01, 358? 1 Which is the biggest value? (a) -8 (b) 0.04335 (c) -3 (d) -5 (e) 1/6 e Which is the fifth smallest value? (a) -4/7 (b) -2/5 (c) -1/94 (d) 569/8 (e) -5 (f) 2/7 f What is the fourth biggest value in -6.96, 2, -3, 102? -6.96 Which is the second biggest value? (a) -1/2 (b) -19995 (c) 0.29 a Which is the fifth smallest value? (a) 6 (b) -1/4 (c) -8 (d) -0.016 (e) -124 a Which is the smallest value? (a) -4/5 (b) -24 (c) -7 (d) -3 (e) -0.2 (f) 2/5 (g) 2 b What is the second smallest value in 14788, 3/7, 0.4, 35? 3/7 Which is the second smallest value? (a) 420 (b) 11/52 (c) 1 c What is the third smallest value in -0.2, -726255, 1.5? 1.5 Which is the fourth smallest value? (a) 2 (b) 25 (c) 3/5 (d) 0.02 (e) 83 (f) -2/13 (g) 0.65 g What is the fourth biggest value in 6, -5/2, -1, 4, 67? -1 What is the third smallest value in -3, 21958/7, -30, -0.4, -2? -2 What is the third smallest value in -10/112343, 5, 6, -2? 5 What is the smallest value in -4, -212, 840.4? -212 Which is the biggest value? (a) -3 (b) 2/9 (c) -22760 b Which is the third biggest value? (a) -3 (b) 7977.1 (c) -15 c What is the sixth biggest value in 5/3, -0.1, -14/15, 1/2, -1, 5? -1 Which is the fifth smallest value? (a) -2/459 (b) -13/192 (c) 0.3 (d) 0.8 (e) -0.2 d Which is the biggest value? (a) -10/3 (b) 1/4 (c) -883 (d) -0.19 b What is the second biggest value in -6, 2087, -309, 0.3? 0.3 Which is the third smallest value? (a) 0.049 (b) -155/2 (c) 0.5 (d) -15.9 a Which is the biggest value? (a) 65 (b) -82/3 (c) -2609 (d) -1 a What is the fourth biggest value in -4/5, -1, -0.1, -0.37, -8, 9? -4/5 Which is the fourth biggest value? (a) -56 (b) 4 (c) -6590 (d) 2 c What is the second smallest value in 0.4, -71, -129632? -71 Which is the third smallest value? (a) -0.5 (b) -54 (c) 2 (d) 0.5 (e) 15 (f) 4 d What is the third smallest value in 25, 0.1, -271, 0.69? 0.69 What is the second biggest value in 489813, 1, -5? 1 Which is the third biggest value? (a) 2 (b) 568650 (c) -0.5 c Which is the fifth smallest value? (a) 3/14 (b) -1807 (c) -4/5 (d) -4 (e) -9 a What is the third biggest value in -3, -24234, 14? -24234 Which is the smallest value? (a) -3196 (b) -5/3 (c) -3 (d) -0.1 (e) 88 (f) 1 (g) -8 a Which is the smallest value? (a) -20 (b) -0.4 (c) -47/29 (d) 0.5 (e) 7 (f) 1 a What is the fourth smallest value in 2/11, 1238/41, 1/8, 0.1? 1238/41 Which is the second biggest value? (a) -7 (b) -1/4 (c) -467.36 (d) -0.1 (e) 4 (f) -2/9 d What is the third smallest value in 0.12, 1, 0.0578928? 1 What is the third smallest value in	{ "pile_set_name": "DM Mathematics" }
1430, -1622, -1916, -2318? -2834 What is next in -52608, -210370, -473336, -841530, -1314976, -1893698, -2577720, -3367066? -4261760 What comes next: 5668365, 5668334, 5668303, 5668272? 5668241 What comes next: -127753, -510943, -1149589, -2043691, -3193249, -4598263, -6258733? -8174659 What comes next: 622702, 622720, 622738? 622756 What is next in 1363, 6344, 14623, 26200, 41075, 59248, 80719? 105488 What comes next: 1715, 1010, -913, -4666, -10861, -20110? -33025 What is next in -9885, -19468, -29039, -38592, -48121, -57620? -67083 What is next in 5771, 7448, 10243, 14156, 19187, 25336? 32603 What comes next: 2449088, 2449015, 2448938, 2448857, 2448772, 2448683? 2448590 What is the next term in -182, -1003, -2836, -6053, -11026, -18127, -27728, -40201? -55918 What is the next term in 368260, 368379, 368498, 368617? 368736 What is the next term in 3863, 13474, 29509, 51980, 80899, 116278? 158129 What is the next term in 5151, 6875, 9725, 13701? 18803 What is next in -12593195, -12593194, -12593193, -12593192, -12593191, -12593190? -12593189 What comes next: -1299450, -1299479, -1299512, -1299549? -1299590 What is the next term in 16992, 17174, 17356, 17538, 17720, 17902? 18084 What is the next term in -1854, -3850, -5838, -7818? -9790 What is the next term in -87650, -87602, -87494, -87302, -87002? -86570 What is the next term in -712393249, -712393251, -712393253, -712393255, -712393257, -712393259? -712393261 What is next in 7938, 7947, 7930, 7875, 7770, 7603? 7362 What is next in -11575, -22767, -33959, -45151, -56343, -67535? -78727 What is next in -1885675, -3771386, -5657111, -7542856, -9428627, -11314430, -13200271, -15086156? -16972091 What is next in 780, 1490, 2012, 2226, 2012, 1250, -180, -2398? -5524 What is the next term in 1161463, 2322900, 3484307, 4645684, 5807031, 6968348, 8129635? 9290892 What is next in 157, 610, 1245, 1948, 2605, 3102, 3325, 3160? 2493 What is the next term in -251235, -502476, -753717, -1004958? -1256199 What is next in 341, 1068, 3031, 6848, 13137, 22516, 35603? 53016 What comes next: -9496, -10861, -12226? -13591 What comes next: -70446, -140966, -211486, -282006? -352526 What is next in 84938, 169845, 254742, 339623, 424482, 509313? 594110 What comes next: -128252, -255786, -383320? -510854 What comes next: 22971, 45959, 68947, 91935? 114923 What is the next term in -1027551, -1027506, -1027445, -1027362, -1027251? -1027106 What comes next: -914, -3465, -7372, -12353, -18126, -24409, -30920, -37377? -43498 What comes next: -65618, -65870, -66122, -66374, -66626? -66878 What is next in 1726592, 1726587, 1726582, 1726577, 1726572? 1726567 What is the next term in -7931, -9155, -11179, -13991, -17579, -21931, -27035? -32879 What comes next: -2694, -2809, -2992, -3231, -3514, -3829, -4164? -4507 What is next in -366, -1169, -2202, -3465, -4958, -6681, -8634? -10817 What is the next term in 162737, 325422, 488091, 650744, 813381, 976002, 1138607? 1301196 What is next in 5623, 1838, -1947, -5732? -9517 What is the next term in 33690, 33655, 33596, 33513, 33406, 33275? 33120 What is the next term in 9391, 9409, 9427, 9433, 9415? 9361 What is next in 18799, 37878, 57263, 76972, 97023, 117434, 138223, 159408? 181007 What is next in 1891985, 1891424, 1890865, 1890308, 1889753, 1889200, 1888649? 1888100 What is the next term in -9072138, -9072141, -9072144, -9072147, -9072150, -9072153? -9072156 What comes next: 777511, 778026, 778541, 779056, 779571, 780086? 780601 What is next in 340019, 340033, 340047? 340061 What is next in 18731, 21015, 23299, 25583, 27867? 30151 What is next in 1971, 7726, 17323, 30762, 48043? 69166 What is next in 3809553, 3809545, 3809549, 3809571, 3809617, 3809693, 3809805, 3809959? 3810161 What is next in -5570, -21890, -49088, -87164, -136118? -195950 What is next in -1755432, -7021996, -15799610, -28088280, -43888012, -63198812, -86020686? -112353640 What is the next term in -1736, -2565, -3932, -5831, -8256, -11201, -14660? -18627 What comes next: 85910, 87634, 89360, 91088, 92818? 94550 What comes next: -470, -3022, -9168, -20456, -38434? -64650 What is next in 26861, 107676, 242367, 430934, 673377, 969696, 1319891? 1723962 What is the next term in 7517756, 7517792, 7517890, 7518080, 7518392, 7518856, 7519502, 7520360? 7521460 What comes next: 91954, 185712, 279460, 373192, 466902, 560584? 654232 What is next in 31512378, 31512381, 31512386, 31512393, 31512402, 31512413? 31512426 What comes next: 12187, 12329, 12469, 12607, 12743, 12877? 13009 What is next in 528679, 1057480, 1586281, 2115082? 2643883 What comes next: -5657, -5743, -5839, -5945, -6061, -6187, -6323? -6469 What is the next term in 2545493, 2545492, 2545493, 2545496, 2545501? 2545508 What is the next term in 574208, 574194, 574156, 574082, 573960, 573778, 573524? 573186 What is the next term in 6191, 12764, 19337, 25910, 32483, 39056? 45629 What comes next: 8479, 8941, 9413, 9901, 10411, 10949? 11521 What is the next term in 105741, 422073, 949293, 1687401? 2636397 What is the next term in -179125, -716469, -1612031, -2865811, -4477809? -6448025 What is next in -1816, -8130, -18610, -33256, -52068, -75046? -102190 What is next in -702313, -702296, -702265, -702220, -702161, -702088, -702001? -701900 What comes next: -25940, -25659, -25380, -25103, -24828, -24555? -24284 What is the next term in -68639, -68436, -68091, -67598, -66951, -66144, -65171, -64026? -62703 What is next in 113, 729, 1749, 3173, 5001, 7233? 9869 What is next in -12670365, -25340732, -38011099? -50681466 What comes next: 32853337, 32853334, 32853329, 32853322, 32853313? 32853302 What comes next: -509, -4638, -15821, -37574, -73413, -126854? -201413 What comes next: -724757, -724787, -724819, -724853, -724889? -724927 What comes next: 19763, 19728, 19693? 19658 What is the next term in 86522, 86604, 86690, 86780? 86874 What comes next: -2637, -10303, -23075, -40953, -63937, -92027, -125223? -163525 What comes next: 19117, 37759, 56401? 75043 What comes next: 52087, 103880, 155673? 207466 What is the next term in -2442273, -4884543, -7326813, -9769083, -12211353? -14653623 What is the next term in 119868, 117895, 115922, 113949, 111976, 110003? 108030 What comes next: -150163530, -300327064, -450490598, -600654132, -750817666? -900981200 What comes next: 9226, 17811, 26404, 35005, 43614, 52231, 60856? 69489 What is next in -521893, -521903, -521913, -521923, -521933, -521943? -521953 What is the next term in 36788, 73572, 110356, 147140? 183924 What comes next: -9905, -10263, -10619, -10973, -11325, -11675? -12023 What is the next term in -5379, -7259, -9139, -11019, -12899? -14779 What is the next term in -88854, -710800, -2398914, -5686272, -11105950, -19191024, -30474570? -45489664 What is next in 8281, 8464, 8635, 8788, 8917, 9016, 9079, 9100? 9073 What is the next term in -3925430, -7850867, -11776304? -15701741 What comes next: -6607, -52821, -178249, -422497, -825171, -1425877, -2264221, -3379809? -4812247 What comes next: 300, 1966, 6506, 15360, 29968, 51770, 82206, 122716? 174740 What is next in -16489, -33051, -49613, -66175? -82737 What is next in 146235, 146364, 146497, 146634, 146775? 146920 What comes next: 4846, 19416, 43744, 77836, 121698, 175336, 238756? 311964 What is next in 25344, 101166, 227524, 404412, 631824, 909754, 1238196? 1617144 What is next in -158097, -159779, -161459, -163137, -164813? -166487 What comes next: -1745, -1165, -585, -5, 575? 1155 What is next in -17719048, -17719050, -17719052, -17719054, -17719056, -17719058? -17719060 What is next in -1709415, -6837697, -15384835, -27350829, -42735679? -61539385 What comes next: -2430029, -9720342, -21870935, -38881802, -60752937? -87484334 What comes next: 22656, 22994, 23370, 23778, 24212? 24666 What is the next term in 194859, 195268, 195959, 196938, 198211? 199784 What comes next: 3124150, 3124154, 3124170, 3124204, 3124262? 3124350 What is the next term in -3159, -12474, -27949, -49584, -77379, -111334, -151449? -197724 What comes next: -45509, -91048, -136585, -182120, -227653, -273184, -318713? -364240 What is the next term in 63609, 127213, 190817, 254421, 318025? 381629 What comes next: 3881, 3881, 3755, 3437, 2861? 1961 What is next in 1384, 2613, 3688,	{ "pile_set_name": "DM Mathematics" }
pr + 10p - 7r - 2 Find the third derivative of 56d*5 + 297d*4 - 2d3 + d2 + 74492. 3360d2 + 7128d - 12 What is the third derivative of 9971n5 + 2n*3 + 561n*2 - 4n + 105 wrt n? 598260n2 + 12 Find the second derivative of 856682h*2 - 783332h wrt h. 1713364 Find the third derivative of -74i4 + 2349i*3 - 31595i*2 - 13i. -1776i + 14094 Find the first derivative of -197916ist + 229is - 7i wrt t. -197916is Find the second derivative of 205r*3w3 + r3w2 - 72r*3 + rw*3 - 473r - 19w2 wrt r. 1230rw3 + 6rw2 - 432r What is the first derivative of -2g2lu + g2u - 23026g2 + 2gu - 154992lu + 2u wrt l? -2g2u - 154992u Find the second derivative of -38407i*2 + 11344i + 4. -76814 Find the third derivative of -57171v3 - 100525v*2 wrt v. -343026 What is the third derivative of 2960645d*3n*4 - 3d*3n*2 - 3d*3n + 5d3 + 145 wrt n? 71055480d*3n Find the second derivative of -103k5 + 77k*4 + 10k + 373 wrt k. -2060k3 + 924k*2 Differentiate -48d*3 - 101d*2 + 12011 with respect to d. -144d*2 - 202d What is the third derivative of -12500rv*3 + rv - 4r + 354v*2 + 2v wrt v? -75000r Differentiate 21f*2gis - 4f2i*2 + 26fgi*2 - 2692gi2s - gs + 2g + 20i wrt s. 21f*2gi - 2692gi2 - g What is the third derivative of 2142p*4z*3 - 2p*3z + 24p3 - 2p*2 - 24295pz3 wrt p? 51408pz3 - 12z + 144 What is the second derivative of d*5 - 82355d*2 + 351477d wrt d? 20d3 - 164710 What is the second derivative of -3k*5 + 82k*2q*2 + 28kq2 + 37k - 2q2 wrt k? -60k*3 + 164q*2 Find the third derivative of 1123839y*6 + 2y*5 - 44y*2 - 9830y. 134860680y3 + 120y*2 What is the derivative of -7d*2ms2 - 2ds2 + 141ds - 5ms2 - 6018ms - 5s - 1 wrt d? -14dms2 - 2s*2 + 141s What is the third derivative of 6641f4 + 5f*3 + 75417f*2? 159384f + 30 Differentiate -m*3 + 115353m*2s*3 + 217417s*3 with respect to m. -3m*2 + 230706ms3 What is the first derivative of -5b*2r*2 - 2579b*2r + 12r2 - 817r wrt b? -10br*2 - 5158br What is the third derivative of p5 + 548819p*4 + 269p*2 + 1067p wrt p? 60p2 + 13171656p What is the third derivative of 10o5r + 12o4r - 888o3r + 1546o2r + 4or - 11o wrt o? 600o*2r + 288or - 5328r Find the second derivative of -1243i*4 - 7i*3 + 36850i. -14916i2 - 42i What is the derivative of 47279x3 - x + 1581108 wrt x? 141837x*2 - 1 Find the third derivative of 612370k*6 + 4757k*2 - 51k + 1 wrt k. 73484400k3 What is the second derivative of -5873t*2z + 12t2 - 2tz - 87136t wrt t? -11746z + 24 Differentiate -4766965y*4 + 4118412 with respect to y. -19067860y*3 Find the second derivative of 12987y*5 - 5y4 + y3 - 1606628y wrt y. 259740y*3 - 60y*2 + 6y Find the first derivative of 2rt - 77r - 15297t + 14622 wrt t. 2r - 15297 What is the derivative of 21q*2x - q*2 + 2qx + 142q - 308599x wrt q? 42qx - 2q + 2x + 142 What is the second derivative of 4vz4 - 9vz3 + 684vz2 + 10vz + 3v - 2z - 158 wrt z? 48vz2 - 54vz + 1368v What is the second derivative of -30261w2 + 3w + 10745? -60522 Find the third derivative of 22147n5 + 10n*4 + 15n*2 - 86125. 1328820n*2 + 240n What is the first derivative of -40542h2 - 41047 wrt h? -81084h What is the third derivative of -36919h3 - 191h*2 - 10h wrt h? -221514 What is the first derivative of -30204l3 - 2l*2 + 14636? -90612l*2 - 4l Differentiate -158s3 + 2821s*2 - 4333063 wrt s. -474s*2 + 5642s What is the first derivative of 121a2t*2 - 732a*2 + 281744t*2 wrt a? 242at2 - 1464a Differentiate 26937c2r - 2cr + c + 3r + 344351 wrt c. 53874cr - 2r + 1 Find the second derivative of -h*3x*3 - 748606h*3 + hx*3 - 3h + 224x2 + 22 wrt h. -6hx3 - 4491636h What is the second derivative of 325211j2 + 65816j? 650422 What is the second derivative of -10453wyz3 - 3wyz*2 + 2wy - wz*3 - 3wz + 2y + 75z wrt z? -62718wyz - 6wy - 6wz Differentiate -1532v4 + 3v*3 - 30v*2 - 1421089 wrt v. -6128v*3 + 9v*2 - 60v Differentiate -1584m3 + 23m*2 - 5m + 1227039 with respect to m. -4752m2 + 46m - 5 Find the first derivative of 2d2r*3 - 83d*2rw + 131d*2w - 656d2 - 2r*3w + r*2 wrt w. -83d*2r + 131d2 - 2r*3 What is the derivative of 2alp - al - 191a + 150l + 40429p wrt p? 2al + 40429 Find the third derivative of 2k3t*3 - 157k*3t - 3k3 + 2k*2t3 - k2 - 11kt*2 - 108263t*4 wrt t. 12k*3 + 12k*2 - 2598312t What is the second derivative of -3z4 - 64630z*2 - z - 283757 wrt z? -36z*2 - 129260 What is the first derivative of -900hp + 28668h - 21p4 wrt p? -900h - 84p3 What is the first derivative of -b2ds - 117262b*2d + 7097ds wrt s? -b*2d + 7097d Find the third derivative of 129255k*3 + 119270k*2 wrt k. 775530 Differentiate 12793a*2 + 43a - 1217767. 25586a + 43 Find the third derivative of -46081bt4 + 47bt2 + t2 - 2t + 1 wrt t. -1105944bt What is the second derivative of -36or*3 + or*2 + 2282or - 100o - 1900r3 + 10r*2 + 1 wrt r? -216or + 2o - 11400r + 20 Find the second derivative of -69413y*2 - 11484y wrt y. -138826 What is the second derivative of 24p5 - 116p*4 - 2p*3 - 31534p wrt p? 480p3 - 1392p*2 - 12p What is the third derivative of 460789f4 + 26f*2 - 6507f wrt f? 11058936f What is the third derivative of -3415689d4 - d2 - 2d - 15300 wrt d? -81976536d Find the third derivative of 5j3s*3w + 51j3s - 29j3w + j3 + j2s3w + 2376j2s*3 - 3j*2 - 2j wrt j. 30s3w + 306s - 174w + 6 What is the third derivative of -352388z4 - 890z*2 - 71z? -8457312z Find the first derivative of 28640i*2y*2 + 21i*2y + 4y2 + 450y + 1 wrt i. 57280iy*2 + 42iy What is the third derivative of -182182a*3m*2 + 2a*2m*2 + 26a*2 - 3am2 + 247m wrt a? -1093092m2 Find the second derivative of -249653a*4 + 134176a wrt a. -2995836a2 Find the second derivative of k5w - 33k5 + 3422k*3 + kw + 3k + 694w wrt k. 20k3w - 660k3 + 20532k What is the second derivative of 5o2p*2x - 242o2px + 5o*2x - 132op*2x - 3310op*2 - 2o wrt o? 10p2x - 484px + 10x Differentiate 8156a*3h + 2a2h - 40593h with respect to a. 24468a*2h + 4ah What is the third derivative of 481cg*3o - cg3 - 2cg2o - 982cg*2 + co + 6c - 11g*3o wrt g? 2886co - 6c - 66o Find the third derivative of -16641h5 + 5h*4x*3 + 43h*2x*2 + 3hx3 - 5hx2 + x3 + 23x*2 wrt h. -998460h*2 + 120hx3 Differentiate -23374bt3 + 2t*3 - 5305t wrt b. -23374t3 What is the third derivative of -12bfo*3v + 2bfov + 2bo*2v - 35b + fo*3 - 11fo2v - 6fov + 16819o*4 - 2o wrt o? -72bfv + 6f + 403656o Find the second derivative of 586455c*5z2 - c3z2 - 2cz2 + 46z*2 - 2940z + 2 wrt c. 11729100c3z*2 - 6cz2 What is the third derivative of 1430168k*3 - 167557k*2 + 2k wrt k? 8581008 What is the third derivative of 916613a3k + 1342a2k - 7ak + 2a + 7k wrt a? 5499678k Differentiate 248872f + 2612434 wrt f. 248872 Find the second derivative of 772l2m + 100l2 - 2lm + 16573m wrt l. 1544m + 200 Find the third derivative of -40018h*3 + 29681h*2. -240108 Find the first derivative of -371591l - 117155. -371591 Find the third derivative of 30i5 - 3i*4 + 110i*3 - 3663i*2 - 5i wrt i. 1800i2 - 72i + 660 Find the first derivative of 948jx*3 + 5jx2 + 20j + 7424x3 - 33x*2 wrt j. 948x*3 + 5x*2 + 20 Find the third derivative of -12072c*4z*2 - 6c*3z*3 - 4c*2z*3 + 16c*2 + 477cz wrt c. -289728cz2 - 36z*3 Find the third derivative of -5b*4vw3 - 391b*4vw - 28b*2vw2 + 2bw3 + 95v wrt b. -120bvw3 - 9384bvw What is the derivative of 4ado + 81ao + a - 2079d + 35o + 24 wrt o? 4ad + 81a + 35 What is the	{ "pile_set_name": "DM Mathematics" }
13n(g). -g2 - 293g - 1 Suppose p - 4 = -l, 20 = 4l - 9l. Let n(m) = 53m - 46. Let a(v) = 12v - 11. Let o(h) = -13a(h) + 3n(h). Let z(t) = -t - 2. Give pz(f) + 3o(f). f - 1 Let h(i) = 205i2 - 2i + 54. Let x(q) = q*2 - 27. Calculate -h(d) - 2x(d). -207d2 + 2d Suppose -3t - t - 28 = 0. Let o(q) = 2q + 6. Let x = 3141 + -3144. Let p(a) = -a - 3. Calculate tp(r) + xo(r). r + 3 Let g(o) = -15o3 - 394o*2 + 6o. Let s(q) = -13q3 - 395q*2 + 5q. What is 6g(k) - 7s(k)? k*3 + 401k*2 + k Let r be ((3/15 - 0)0)/(-2). Suppose r = -3u, -4n + 3u - u = 72. Let i(f) = 1. Let m(k) = -3k - 6. Give ni(s) - 3m(s). 9s Let u(z) = -233z*2 - 10z - 19. Let h(r) = 125r2 + 6r + 9. Give 5h(j) + 3u(j). -74j2 - 12 Let d = -76 - -87. Let h(z) = 3 - 19 + d - z. Let u(t) = -t + 1. Let p(g) = 6g - 1. Let s(l) = p(l) + 5u(l). Determine -4h(i) - 5s(i). -i Let c(m) = -3m*2 + 3m - 2. Let d(s) = s*2 - 1. Let b be 12 - 21 - (-4 + 31/(-1)). Calculate bd(a) + c(a). -5a*2 + 3a Let m(x) = 4 + 4x - 6x + 11x. Let c(b) = -b2 + 48b - 98. Let y be c(2). Let p(f) = 2f + 1. Give ym(u) + 26p(u). -2u + 2 Let g(s) = 5s - 25. Suppose 26i - 154 = 12i. Let n(v) = 9v - 49. What is ig(x) - 6n(x)? x + 19 Let a be 2/3(-2 + 28/8). Let v be (9 + a)(-2)/(-4). Suppose -5h - v = -6h. Let o(d) = 8d + 4. Let g(s) = -9s - 5. Calculate ho(f) + 4g(f). 4f Let k(h) = 4h*2 - h + 4. Suppose -3u + 16 = -5u. Let g(l) = l3 + 9l*2 + 10l + 13. Let s be g(u). Let b(x) = -5x2 + x - 5. Determine sk(r) - 2b(r). -2r*2 + r - 2 Let b be 7/((-42)/(-24)) + -1 + -4 + 7. Let s(n) = 11n + 1. Let f(u) = -11u - 1. Determine bs(l) + 4f(l). 22l + 2 Let r(z) = 25z + 93. Let u(v) = 12v + 43. Let s(j) = -6r(j) + 13u(j). Let a(o) = -o. Let k be (-3 - (0 + -2))-5. Give ka(p) + s(p). p + 1 Let l(q) = -13q2 - 19q - 9. Let w(p) be the third derivative of -7p5/60 - 5p*4/12 - 5p*3/6 - 2281p*2. What is 3l(h) - 5w(h)? -4h*2 - 7h - 2 Let l(p) = 7p2 + p + 6. Let b(o) = -161o - 6o2 + 44o - 9 + 60o - 4o*2 + 55o. What is 5b(u) + 8l(u)? 6u2 - 2u + 3 Let a(b) = 818 + 4b - 817 + 0b*2 + 4b - 10b2. Suppose 2d + 22 - 10 = 0. Let m(y) = 21y2 - 17y - 2. Give dm(w) - 13a(w). 4w2 - 2w - 1 Suppose -5s - 3 = 7. Let h(l) be the first derivative of -2l3/3 + l2/2 - 2l + 24905. Let b(g) = g. Calculate sb(x) + h(x). -2x2 - x - 2 Let u(x) = 40x*3 - 6x*2 + 24x - 2771. Let n(z) = -87z3 + 13z*2 - 52z + 5541. What is -6n(v) - 13u(v)? 2v3 + 2777 Let u be ((-18)/8 - -3)-4 - 3. Let z be ((-28)/6)/(u/72). Let i(h) = -58 + z - 5h + h. Let n(r) = r + 1. What is i(w) + 3n(w)? -w + 1 Let s(a) = a3. Let k(z) be the first derivative of -z3 + 882. Determine -k(r) + 4s(r). 4r*3 + 3r*2 Let n(h) = -12h + 5. Let p(c) = 25c - 9. Suppose -x + 111 = -5i + 143, -2x = -6. Determine in(v) + 4p(v). 16v - 1 Let t(x) = 4x2 - 13x. Let i(b) = 2b2 - 7b - 1. What is -5i(j) + 2t(j)? -2j2 + 9j + 5 Let x(z) = -4z2 - 1. Let m = 2155 - 2150. Let u(j) be the second derivative of j4/12 + 11j. Let y be ((-2)/4)/(2/(-4)). Determine mu(t) + yx(t). t*2 - 1 Let y(c) = -2c + 1. Let d(l) = 3l2 - 24l - 5. Let j be d(0). Let k(v) = -v + 1. Calculate jk(q) + 4y(q). -3q - 1 Let o(w) = -24w*3 - 12w - 3. Let d(f) = 50f3 + 26f + 7. Calculate 4d(x) + 9o(x). -16x3 - 4x + 1 Let p(d) = -8d3 - 17d*2 + 5d + 93. Let k(n) = -5n3 - 14n*2 + 4n + 95. Determine 5k(i) - 4p(i). 7i3 - 2i*2 + 103 Let l = -3369 - -3372. Let x(u) = -3u*2 - 5u. Let d(g) = 2g2 + 3g. Determine lx(j) + 5d(j). j*2 Let x(k) = 22k*3 + 9k*2 + 1766k - 9. Let t(a) = -11a3 - 4a*2 - 883a + 4. Determine -9t(f) - 4x(f). 11f3 + 883f Let w(p) = -33p2. Let t(r) = -2132r*2 - 2r. Calculate t(k) + 3w(k). -2231k*2 - 2k Let n(j) = j*2 + 2. Suppose -3t - 2t + 529 = 419. Let p be (-1 + 0)6/(-2). Let c(d) = 15 + 4 - t - d*p. Determine -2c(z) - 3n(z). 2z*3 - 3z*2 Let o(r) = -3r - 41. Let f(l) = -l - 20. Suppose -4c - 3n + 12 = -11, 4c - 5n + 17 = 0. What is co(m) - 5f(m)? -m + 18 Let m(u) = -69u2 - 5u + 67. Let o(d) = -33d2 - 2d + 28. What is 4m(j) - 9o(j)? 21j2 - 2j + 16 Let j(w) = -2w + 5. Let c be (-13)/(-13)1-2. Let k(t) be the second derivative of -t2/2 + 340t. Determine ck(o) + j(o). -2o + 7 Let v(g) = 877g3 + 2g*2 - 2g - 1. Let b(n) = -878n3 - 3n*2 + 3n. Determine 2b(a) + 3v(a). 875a3 - 3 Suppose 0 = 866o - 887o - 42. Let v(b) = -9b - 2. Let r(n) = 10n + 1. Give ov(t) - 3r(t). -12t + 1 Let r(o) = 735o + 5. Let c(i) = -i - 2. Calculate -4c(y) - r(y). -731y + 3 Let l(m) = 2m3 - m2 + 2m. Let g(b) = -13b*3 + 3b*2 + 761b. Calculate g(j) + 6l(j). -j3 - 3j*2 + 773j Let d(o) = o*2 - o - 1. Let h(l) = 166l*2 + l + 2. Determine -2d(g) - h(g). -168g2 + g Let t(f) = 14f*2 - 3. Suppose -28k = -39 - 17. Let u(v) = 13v2 - 2. Calculate kt(s) - 3u(s). -11s*2 Let s = -157049 - -157045. Let k(b) = -5b*2 + 7 + 2b*2 + 11b - 17. Let r(d) = d*2 - 4d + 3. Calculate sk(t) - 11r(t). t*2 + 7 Let c(b) = -44b + 52. Let h(n) = -19n + 27. Calculate 2c(w) - 5h(w). 7w - 31 Let p be (-13 - 819/(-65))/(35/25 + -1). Suppose -3z - 2o - 22 = 0, 3z + 4o = -22 - 10. Let a(m) = m + 1. Let w(r) = -6r - 3. Give pw(f) + za(f). 2f - 1 Let z(w) = 3w - 2 + 3 - 2. Suppose 69a + 28a - 23a + 148 = 0. Let u(t) = 15t - 4. What is au(o) + 11z(o)? 3o - 3 Let h(s) = 18s3 + 5s*2 - 6s. Let k(p) = -16p3 - 5p*2 + 4p. Calculate 2h(i) + 3k(i). -12i3 - 5i*2 Let w(u) be the third derivative of 17u6/120 + u5/10 + u*3 + 2u2. Let s(i) = -i3 - i*2 - 1. Let n = 80851 - 80857. Determine ns(j) - w(j). -11j3 Let g(h) = 14h2 - 2. Let i(f) be the third derivative of f5/60 - f*3/6 + 9f*2 - 3. What is g(w) - i(w)? 13w2 - 1 Let t(r) = -r2 + 3r - 2. Let f(g) = -740g*2 + 9g - 7. What is f(v) - 3t(v)? -737v*2 - 1 Let g(o) = -162o*2 - 15o. Let j(s) = s*2 - 4s. What is g(l) - 4j(l)? -166l*2 + l Let p = 31934 - 31933. Let s(a) = -2a - 28. Let m(l) = -1. Calculate ps(y) - m(y). -2y - 27 Let h(i) = -36i - 724. Let x(q) = -29q - 723. Calculate -4h(t) + 5x(t). -t - 719 Let h(x) = -x*2 - 10x + 76. Let u(p) = -p*2 + 5p. Give h(c) + 2u(c). -3c*2 + 76 Let b(j) = 20j*2 - 13j + 27. Let g(c) = -89c2 + 51c - 109. Calculate -9b(d) - 2g(d). -2d2 + 15d - 25 Let i be (-4)/(-1)(-3)/(-6). Let p(m) be the third derivative of 0 - 45m*2 + 0m - 5/6m3 + 1/24m*4. Let b(x) = -2. Give ip(s) - 5b(s). 2s Let q(a) = -a*3 + 25a*2 - 17. Let y(k) = 47k*2 - 32. What is 11q(t) - 6y(t)? -11t*3 - 7t*2 + 5 Let r(j) be the first derivative of -8j + 1182. Let t(x) = -x - 8. Calculate -3r(v) + 2t(v). -2v + 8 Let j(w) = -6w*3 - 17w*3 + 6 + 34w*3 - 55w - 11w - 13w*2 + 7. Let n(q) = -5q*3 + 6q*2 + 33q - 6. Give -6j(v) - 13n(v). -v*3 - 33v Let h(k) = k*3 - 3k*2 + 2k + 1. Let t(c) = 3c3 - 6c*2 - 1402c + 2. Determine -4h(y) + 2t(y). 2y3 - 2812y Let g(j) = -3685j3 - 231j*2 - 231j + 77. Let r(c) = 194c3 + 12c*2 + 12c - 4. Calculate -4g(d) - 77r(d). -198d3 Let x(b) = -6b*2 + 5b + 9. Suppose 4f = f - 12. Let r(w) = w2 + 288w - 3918. Let s be r(13). Let i(h) = 5h2 - 4h - 8. Calculate fx(z) + si(z). -z*2 + 4 Let q(k) = 2080k. Let f(g) = 3692g - 7416g + 3667g. Calculate 182f(c) + 5q(c). 26c Suppose -3k + 42 = -5c + 10, c + 40 = 3k. Let j(q) = -k - q2 + 1 + 17 + q. Let l(n) = -n2 + 1. Determine j(u) - 4l(u). 3u2 + u Let a(d) = 6d*2 - 4d. Let j be (-204/(-8))/2. Let n(t) = 4t*2 + 0t - jt2 + 0t*2 + t. Let z be -4 - 30/(-6)1 - -2. Give zn(f) + a(f). 3f*2 - f Let h(s) = -3s*2 - 916839s - 13 + 16 + 916838s. Let r(a) = -6 + 9a*2 + 3a - a - 2. Determine 8h(m) + 3r(m). 3m2 - 2m Suppose -g + 54 = -2q + 38, 0 = 3g + 5q + 7. Let m(r) = -5r - 6. Let z(s) = -11s - 11. Give gz(x) - 11m(x). -11x Let b be (-1)/3 - ((-40)/12 + 4). Let m(g) = -g - 1. Let h(q) = q. Let i(v) = -v*2 - 9v + 11. Let o be i(-8). Let j = 17 - o. Calculate b*h(x)	{ "pile_set_name": "DM Mathematics" }
5:53 AM and 11:37 AM? 344 What is 402 minutes after 2:09 PM? 8:51 PM How many minutes are there between 11:09 PM and 12:05 AM? 56 How many minutes are there between 2:02 AM and 7:29 AM? 327 How many minutes are there between 12:23 AM and 2:56 AM? 153 How many minutes are there between 9:26 PM and 10:28 PM? 62 What is 410 minutes before 10:46 PM? 3:56 PM How many minutes are there between 4:35 PM and 11:16 PM? 401 How many minutes are there between 2:20 AM and 4:48 AM? 148 What is 160 minutes after 2:11 AM? 4:51 AM What is 528 minutes after 4:14 AM? 1:02 PM How many minutes are there between 7:23 AM and 6:53 PM? 690 What is 2 minutes before 8:00 PM? 7:58 PM What is 121 minutes after 1:01 AM? 3:02 AM What is 470 minutes after 8:40 PM? 4:30 AM What is 546 minutes before 11:23 AM? 2:17 AM What is 421 minutes before 10:25 PM? 3:24 PM How many minutes are there between 1:47 AM and 4:23 AM? 156 How many minutes are there between 11:16 AM and 3:40 PM? 264 How many minutes are there between 7:36 PM and 10:10 PM? 154 What is 408 minutes before 9:32 PM? 2:44 PM How many minutes are there between 5:04 AM and 6:33 AM? 89 What is 4 minutes after 5:45 AM? 5:49 AM How many minutes are there between 11:14 PM and 7:01 AM? 467 How many minutes are there between 5:27 PM and 6:09 PM? 42 What is 266 minutes before 12:58 AM? 8:32 PM What is 546 minutes before 9:27 AM? 12:21 AM How many minutes are there between 7:55 AM and 2:29 PM? 394 What is 266 minutes before 12:06 AM? 7:40 PM How many minutes are there between 4:49 AM and 5:42 AM? 53 How many minutes are there between 12:23 PM and 1:51 PM? 88 How many minutes are there between 1:04 PM and 11:27 PM? 623 How many minutes are there between 3:56 AM and 8:22 AM? 266 How many minutes are there between 1:37 PM and 8:22 PM? 405 How many minutes are there between 10:08 AM and 11:40 AM? 92 How many minutes are there between 4:45 AM and 7:56 AM? 191 What is 631 minutes after 9:55 PM? 8:26 AM How many minutes are there between 8:52 PM and 5:38 AM? 526 What is 121 minutes after 5:15 PM? 7:16 PM What is 399 minutes after 11:05 PM? 5:44 AM What is 559 minutes after 12:23 PM? 9:42 PM How many minutes are there between 11:28 PM and 6:38 AM? 430 How many minutes are there between 11:20 AM and 11:05 PM? 705 How many minutes are there between 4:52 PM and 2:49 AM? 597 What is 142 minutes after 11:25 PM? 1:47 AM How many minutes are there between 6:35 PM and 3:03 AM? 508 How many minutes are there between 1:53 AM and 8:47 AM? 414 How many minutes are there between 1:27 AM and 11:34 AM? 607 How many minutes are there between 12:59 PM and 7:49 PM? 410 What is 400 minutes after 8:24 PM? 3:04 AM How many minutes are there between 10:57 PM and 1:37 AM? 160 What is 503 minutes after 2:52 PM? 11:15 PM How many minutes are there between 3:21 PM and 1:38 AM? 617 What is 51 minutes after 6:15 AM? 7:06 AM How many minutes are there between 5:20 AM and 10:57 AM? 337 What is 624 minutes after 5:22 AM? 3:46 PM How many minutes are there between 9:24 PM and 2:37 AM? 313 How many minutes are there between 7:07 AM and 8:45 AM? 98 What is 644 minutes after 1:42 AM? 12:26 PM How many minutes are there between 11:11 AM and 5:04 PM? 353 How many minutes are there between 1:02 PM and 11:01 PM? 599 What is 304 minutes before 4:35 AM? 11:31 PM How many minutes are there between 10:51 PM and 9:08 AM? 617 How many minutes are there between 4:29 PM and 8:26 PM? 237 What is 524 minutes after 11:35 PM? 8:19 AM How many minutes are there between 9:32 PM and 12:06 AM? 154 What is 342 minutes after 4:58 PM? 10:40 PM How many minutes are there between 3:57 PM and 7:19 PM? 202 How many minutes are there between 6:57 PM and 12:21 AM? 324 How many minutes are there between 5:50 PM and 5:32 AM? 702 How many minutes are there between 1:32 PM and 7:45 PM? 373 What is 401 minutes after 11:23 AM? 6:04 PM What is 155 minutes after 7:47 AM? 10:22 AM How many minutes are there between 12:32 PM and 6:09 PM? 337 What is 176 minutes after 6:28 AM? 9:24 AM What is 549 minutes after 9:54 AM? 7:03 PM How many minutes are there between 3:22 PM and 5:43 PM? 141 What is 107 minutes after 2:23 AM? 4:10 AM How many minutes are there between 12:41 AM and 4:52 AM? 251 How many minutes are there between 3:42 AM and 2:59 PM? 677 How many minutes are there between 8:47 AM and 9:58 AM? 71 How many minutes are there between 5:29 AM and 12:07 PM? 398 What is 416 minutes after 1:14 AM? 8:10 AM What is 628 minutes after 12:16 AM? 10:44 AM How many minutes are there between 11:01 AM and 6:37 PM? 456 How many minutes are there between 6:51 AM and 2:28 PM? 457 What is 458 minutes before 12:58 PM? 5:20 AM How many minutes are there between 6:59 PM and 4:18 AM? 559 How many minutes are there between 2:22 PM and 7:20 PM? 298 How many minutes are there between 10:29 PM and 12:51 AM? 142 What is 154 minutes before 4:41 AM? 2:07 AM How many minutes are there between 8:30 PM and 3:58 AM? 448 What is 51 minutes after 1:55 AM? 2:46 AM What is 675 minutes before 7:27 AM? 8:12 PM How many minutes are there between 6:31 PM and 12:58 AM? 387 How many minutes are there between 9:11 PM and 5:19 AM? 488 How many minutes are there between 1:22 PM and 11:10 PM? 588 What is 655 minutes after 6:49 AM? 5:44 PM What is 153 minutes before 7:04 AM? 4:31 AM What is 578 minutes before 7:38 PM? 10:00 AM How many minutes are there between 11:29 AM and 4:31 PM? 302 How many minutes are there between 11:52 AM and 1:24 PM? 92 What is 318 minutes after 11:39 PM? 4:57 AM How many minutes are there between 7:42 AM and 8:38 AM? 56 How many minutes are there between 2:42 PM and 4:04 PM? 82 How many minutes are there between 5:57 AM and 12:58 PM? 421 How many minutes are there between 11:40 PM and 3:44 AM? 244 What is 421 minutes before 6:14 AM? 11:13 PM How many minutes are there between 11:13 AM and 6:03 PM? 410 How many minutes are there between 4:56 PM and 12:20 AM? 444 How many minutes are there between 6:46 PM and 2:36 AM? 470 How many minutes are there between 5:41 AM and 12:22 PM? 401 How many minutes are there between 11:16 AM and 10:21 PM? 665 How many minutes are there between 8:50 PM and 11:05 PM? 135 What is 553 minutes after 11:29 PM? 8:42 AM How many minutes are there between 7:06 PM and 2:49 AM? 463 How many minutes are there between 12:00 PM and 6:58 PM? 418 What is 130 minutes before 8:55 AM? 6:45 AM What is 231 minutes after 7:10 AM? 11:01 AM What is 539 minutes before 2:01 AM? 5:02 PM What is 88 minutes before 1:53 PM? 12:25 PM How many minutes are there between 10:03 PM and 1:34 AM? 211 What is 474 minutes after 3:30 AM? 11:24 AM What is 705 minutes before 5:44 PM? 5:59 AM What is 643 minutes after 10:42 PM? 9:25 AM How many minutes are there between 1:16 PM and 3:50 PM? 154 What is 63 minutes after 8:12 AM? 9:15 AM How many minutes are there between 8:05 PM and 1:36 AM? 331 How many minutes are there between 8:46 PM and 1:00 AM? 254 How many minutes are there between 9:41 PM and 1:47 AM? 246 How many minutes are there between 9:15 PM and 2:38 AM? 323 How many minutes are there between 5:52 PM and 2:14 AM? 502 What is 153 minutes before 4:14 PM? 1:41 PM How many minutes are there between 12:24 AM and 1:26 AM? 62 How many minutes are there between 9:52 PM and 3:02 AM? 310 How many minutes are there between 9:39 AM and 3:02 PM? 323 How many minutes are there between 10:19 AM and 5:55 PM? 456 What is 204 minutes before 7:53 AM? 4:29 AM What is 98 minutes before 2:28 AM? 12:50 AM How many minutes are there between 4:42 AM and 4:10 PM? 688 What is 175 minutes after 11:16 PM? 2:11 AM What is 502 minutes before 1:52 PM? 5:30 AM What is 298 minutes before 10:15 AM? 5:17 AM How many minutes are there between 10:50 PM and 6:38 AM? 468 How many minutes are there between 11:57 AM and 10:07 PM? 610 What is 631 minutes before 11:06 AM? 12:35 AM What is 137 minutes before 12:35 PM? 10:18 AM How many minutes are there between 1:33 PM and 9:20 PM? 467 How many minutes are there between 5:35 PM and 11:29 PM? 354 How many minutes are there between 6:45 PM and 4:29 AM? 584 How many minutes are there between 5:33 PM and 4:03 AM? 630 How many minutes are there between 7:20 AM and 5:48 PM? 628 How many minutes are there between 1:03	{ "pile_set_name": "DM Mathematics" }
j) = -25j2 - 4. Let n(o) = wg(o) + 4d(o). Calculate n(y(i)). 68i*2 Let i(f) be the second derivative of -53f*3/6 - f. Let g(t) = -58t - 26. Let s(n) = 18n + 8. Let x(d) = -4g(d) - 13s(d). Give x(i(z)). 106z Let o(f) = 17f. Let h(i) = -34i. Let l(b) = -2h(b) - 5o(b). Let u be 45/273 + 1257. Let g(a) = 634a + 630a - ua. What is g(l(k))? -34k Let c(m) = -2m*2 - 2m*2 + 2m*2. Let q(v) = 621v*2 - 713v*2 - 46 + 21 + 25. What is q(c(b))? -368b*4 Let c(y) = 67y - 17. Let h(b) = -6b - 98. Give c(h(t)). -402t - 6583 Let v(j) = 3j - 18. Let x be v(8). Suppose -b = -2f + 4, -3f + xf - 32 = -5b. Let p(g) = -8g - 5g + fg. Let k(w) = -3w2. Give k(p(s)). -243s*2 Let n(s) = 19s. Let z(q) = -199146q. What is n(z(j))? -3783774j Let b(l) = 53l. Let n(r) = 28 + 22 + 9r*2 - 65 + 15. What is n(b(u))? 25281u*2 Let o(k) be the second derivative of -59k*4/6 - 1671k. Let l(z) = 8z. Determine l(o(j)). -944j*2 Let s(b) = 6b2 - b2 + 0 + 0. Let a(r) = -768195 + 5r + 768195 - 5r + 18r. What is a(s(f))? 90f*2 Let j(u) be the first derivative of 3u*2/2 + 2033. Let s(q) = 63q - 1. What is j(s(a))? 189a - 3 Let u(l) = 89. Let z(n) = -2n + 267. Let o(t) = -3u(t) + z(t). Let p(b) = 3799b*2. Give p(o(x)). 15196x*2 Let l(k) = -2k*2. Let y(t) be the first derivative of -1173t*2/2 + 1300. Determine y(l(b)). 2346b*2 Let t(c) = -2c2 - 21. Let i(j) = j2 + 21. Let g(p) = -2i(p) - 2t(p). Let a(s) = -2785s2. Determine a(g(y)). -11140y4 Let h(x) be the second derivative of x3/2 - 17x. Let y(u) = 10u - 4u - 10u - 2u - u. Give h(y(w)). -21w Let j be (-1126)/(-12) - (-18)/108. Let f(o) = 46o - jo + 2o. Let d(t) = 3t*2. Give f(d(u)). -138u*2 Let o(j) = -2j. Let k(l) = l*2 - 10l + 24. Let h be k(11). Let m(s) = -hs - 50s - 45s + 195s. Give m(o(u)). -130u Let x(u) = 18u. Let z(w) = 1162870 - 175w - 1162870. What is z(x(p))? -3150p Let q(x) be the first derivative of -5x3/3 - 939. Let k(v) = -327v. Determine k(q(n)). 1635n2 Suppose -20z = -23z + 87. Let w(f) = -zf + 18f - 4f. Let x(n) = 5n2 - 6n + 6. Let v(q) = q*2 - q + 1. Let p(g) = 6v(g) - x(g). What is p(w(h))? 225h2 Let j(q) = -23q*2. Let n(v) = -290 + 592 + 10v - 302. Determine n(j(h)). -230h2 Let h(n) be the second derivative of 0n*2 + 0 + 1/2n*3 - 5n. Let x(w) = -8w2 - 296 + 594 - 298. Give h(x(s)). -24s*2 Let m(w) = 7w*2. Let x(f) be the third derivative of 0f - 63f2 + 0f*3 - 1/2f*4 + 0. What is m(x(r))? 1008r2 Let f(b) be the third derivative of -b4/24 + 22b3/3 + 132b*2 + b. Let p(a) = 5a. Calculate f(p(z)). -5z + 44 Let h(f) be the first derivative of f4/12 - 63f + 42. Let p(z) be the first derivative of h(z). Let n(r) = 177r. Determine p(n(l)). 31329l*2 Let m(s) = -2s + 36s - 30s - 5s. Let x(t) = 973t*2. Give m(x(r)). -973r*2 Let b(j) = -177j*2. Let s(v) = 57v*2 - 4502. Calculate s(b(z)). 1785753z*4 - 4502 Let p(a) = -64a. Let w(v) be the first derivative of -11v3/3 + 1542. Calculate p(w(o)). 704o*2 Let d(n) = 2n. Let s(m) = 127m - 2. Let x(k) = -81k + 5 - 8 + 463k - 3. Let g(a) = -10s(a) + 3x(a). Give g(d(p)). -248p + 2 Suppose 0 = 24r - 27r + 66. Let c(j) = -8 + r - 26j - 14. Let o(v) = -v2 + v + 1. Let x(h) = -2h*2 + h + 1. Let q(z) = o(z) - x(z). Give q(c(m)). 676m*2 Let t(s) = -s. Let a(h) = 38428h + 29. What is a(t(x))? -38428x + 29 Let s = -1 - -1. Let p(k) = k + sk - k - k. Let i(h) = -26h2 - 2h - 6. Let y(q) = -1508q2 - 117q - 351. Let d(m) = -117i(m) + 2y(m). Give p(d(f)). -26f2 Let w(h) be the third derivative of -219h*4/8 - 2116h*2. Let u(r) = 2r. What is w(u(k))? -1314k Let p(d) = -3 + 9d*2 + 6d*2 + 13d2. Let o(q) be the first derivative of -q2/2 - 109. Give p(o(a)). 28a2 - 3 Let y(f) = 5f - 2f + f. Let g(b) be the third derivative of -5b*4/12 - 14b*2 - 6b - 22. What is g(y(r))? -40r Let v(j) = -64j*2. Let q(b) = -1897132 + 1897132 - 84b. Give q(v(f)). 5376f2 Let o(f) be the third derivative of 203f*4/24 + 13f*2 + 17. Let n(t) = 2t. What is o(n(j))? 406j Let t(s) = -62s2. Let v(a) be the second derivative of a3/6 - 1125a. Give t(v(f)). -62f*2 Suppose -17j - 11 = -3d - 16j, 5d - 3j - 25 = 0. Let a(q) = -16q2 - 18q*2 + 53q*2 - 16q*d. Let h(y) = -213y - 2. Determine a(h(s)). 136107s2 + 2556s + 12 Let u(q) = -7q. Suppose -41 = -13y + 11. Let w(f) = -29f2 - 27f*2 + 48f*2 + yf - 4f. What is w(u(s))? -392s*2 Let p(q) = -821q + 7. Let w(r) = 697r - 6. Let t(f) = -6p(f) - 7w(f). Let s(o) = 49o*2. Give s(t(y)). 108241y*2 Let f(j) = 13j. Let g(r) = 524r + 623r - 1913r. Give f(g(v)). -9958v Let r(i) = 2902i. Let b(s) = -43s*2 - 46s. Let q(c) = -15c2 - 16c. Let g(z) = -16b(z) + 46q(z). What is g(r(k))? -16843208k2 Let b(q) = 106 + 122 - q - 228. Let k(a) = -150a*2 - 2. What is b(k(u))? 150u*2 + 2 Let l(t) = -2t. Let p(y) = 275490y2 + 9. Determine l(p(k)). -550980k*2 - 18 Let c(t) = -54756t. Let h(b) = 21b + 54. Calculate c(h(i)). -1149876i - 2956824 Let t(j) = -10j - 60. Let g(l) = -4l - 172. Determine t(g(y)). 40y + 1660 Let i(w) = -2w - 4. Let b(h) = 1884196h. Calculate i(b(c)). -3768392c - 4 Let n(a) be the third derivative of 0a4 + 0a*3 + 1/60a*5 + 0 + 19a*2 + 0a. Let t(c) = 107c. What is n(t(h))? 11449h*2 Let p(h) = -5h - 4. Let k(y) = 10y + 9. Let u(r) = -4k(r) - 9p(r). Let v = 9 - 6. Let d(n) = 2n - 7n + vn. Give d(u(j)). -10j Let v(m) = 5m + 78. Let w(i) = -3i + 5. Let u(z) = -v(z) - 2w(z). Let q(s) = -2s2. Give q(u(x)). -2x*2 + 352x - 15488 Let n(a) = -4a2. Let j(o) = -o + 8. Let z(m) = -2 - 16 - 12m + 13m. Let g(r) = -9j(r) - 4z(r). Determine g(n(f)). -20f2 Let p(q) = q3 + 2q + 3. Let k be p(2). Let a be (12/(-15))/(2/(-5)). Let c(r) = -15r + kr + ra. Let i(h) = h. Calculate c(i(x)). x2 Let j(y) = -81y + 141. Let h(r) = -194r + 353. Let m(n) = -5h(n) + 12j(n). Let g(x) = 10x. Calculate g(m(k)). -20k - 730 Let z(j) = 2j*2 - 1018j - 2. Let r(x) be the third derivative of -x*4/8 + 17x*2 + 19x + 1. What is z(r(i))? 18i2 + 3054i - 2 Let v(i) = -28007322i2. Let j(q) = -q2. Calculate j(v(d)). -784410085611684d*4 Suppose 641 = -371z + 1185 + 940. Let i(u) be the third derivative of -1 + 0u3 - 4/3u*z + 0u + 11u2. Let a(t) = -2t*2. Determine i(a(y)). 64y*2 Let r(t) = -3t*2 - 12t. Let g(w) = -3w2 + 3267 - 6532 + 3265. What is g(r(m))? -27m*4 - 216m*3 - 432m*2 Let v(t) = 8t*2. Let r(s) = 882 - 436 - 442 + 2s. What is r(v(a))? 16a2 + 4 Let l(a) be the first derivative of -4a*3/3 - 443. Let z(j) be the first derivative of 8 - 8/3j*3 + 0j + 0j2. Calculate l(z(d)). -256d*4 Let u(m) = -6m - 16. Let d(c) be the third derivative of -2c4/3 - 2c*2 - 20c. What is u(d(g))? 96g - 16 Let l(f) = -8f + 250. Let p(v) = -12v + 350. Let a(o) = 7l(o) - 5p(o). Let m(c) = 1621c + 1. What is a(m(h))? 6484h + 4 Let p(v) = -v2. Let b(a) = -4a - 790997. Calculate b(p(h)). 4h2 - 790997 Let h(v) be the third derivative of -v5/30 + v2 - 619v + 2. Let t(q) = 1829q. What is h(t(u))? -6690482u*2 Let h(s) be the third derivative of 337s*5/60 - 1047s*2. Let b(t) = -4t. Determine h(b(z)). 5392z2 Let l(f) = 5926f. Let s(m) = 120m2 - 12. Determine l(s(u)). 711120u*2 - 71112 Let x(y) = 348y*2 - 159y*2 - 178y*2. Let n(o) = 6o + 8o2 - 6o. Calculate n(x(u)). 968u4 Let f(x) = -9x. Let g(q) = -39q2 + 7q + 19995. Give f(g(w)). 351w2 - 63w - 179955 Let p(u) = -59u - 443. Let j(t) = 24 + 98 - 11 + 13t. Let y(m) = -9j(m) - 2p(m). Let n(g) = 4g. Give n(y(x)). 4x - 452 Let u(a) = -2a2. Let r(t) = 8964026t - 10. Determine r(u(v)). -17928052v2 - 10 Let f(p) be the first derivative of 3 + 10p*2 - 1 + 4p*2 + 35. Let z(c) = -5c*2. What is f(z(v))? -140v*2 Let x(p) = -9799p*2 + 20p + 3. Let u(i) = -3i. What is x(u(l))? -88191l*2 - 60l + 3 Let k(i) = 1414i + 6. Let s(p) = -6786p - 30. Let o(r) = 24k(r) + 5s(r). Let v(l) = -3l2 + 2l*2 + l - l. What is v(o(a))? -36a*2 + 72a - 36 Let z(g) = -2*g. Let h be 7 - (0	{ "pile_set_name": "DM Mathematics" }
u when four letters picked without replacement from {r: 1, o: 1, h: 2, u: 2, e: 6}? 2/33 Four letters picked without replacement from {q: 1, k: 5, x: 5}. Give prob of picking 3 x and 1 q. 1/33 Three letters picked without replacement from huuuuuhhihuuhhhhuiu. What is prob of picking 3 u? 28/323 Two letters picked without replacement from {m: 2, x: 10}. Give prob of picking 1 m and 1 x. 10/33 Two letters picked without replacement from {a: 2, z: 4, b: 1, t: 3}. What is prob of picking 1 z and 1 t? 4/15 Calculate prob of picking 1 t, 1 k, and 1 a when three letters picked without replacement from {a: 3, k: 1, t: 3}. 9/35 Three letters picked without replacement from gogsfsgsogfsgsgoos. What is prob of picking 1 o, 1 f, and 1 g? 1/17 Three letters picked without replacement from illlllilliimliiliii. Give prob of picking 2 l and 1 i. 108/323 Calculate prob of picking 2 m when two letters picked without replacement from {y: 7, w: 1, m: 6, s: 3, g: 2}. 5/57 Calculate prob of picking 1 w and 3 y when four letters picked without replacement from {w: 4, y: 7}. 14/33 Four letters picked without replacement from aaaaaoaaaoao. Give prob of picking 1 a and 3 o. 1/55 What is prob of picking 2 e and 1 y when three letters picked without replacement from {y: 3, e: 5}? 15/28 Calculate prob of picking 1 d and 2 r when three letters picked without replacement from drddrrdddd. 7/40 What is prob of picking 3 b when three letters picked without replacement from rjbycycbm? 0 Three letters picked without replacement from {f: 2, g: 1, y: 1, k: 1, o: 4}. Give prob of picking 1 y and 2 o. 1/14 Calculate prob of picking 2 l when two letters picked without replacement from bllkikhlullllhkl. 7/30 Three letters picked without replacement from wmhmomoomwoommwmohho. What is prob of picking 1 m, 1 h, and 1 o? 49/380 Calculate prob of picking 1 x and 1 b when two letters picked without replacement from xgggxxbxbbxbxhgexxbx. 9/38 Three letters picked without replacement from bdcsscccdsclz. What is prob of picking 3 s? 1/286 Calculate prob of picking 1 x and 1 s when two letters picked without replacement from sssssssxsssxxsssssx. 20/57 Calculate prob of picking 2 m when two letters picked without replacement from {i: 4, z: 1, n: 5, m: 8}. 28/153 Calculate prob of picking 1 r, 1 j, and 2 p when four letters picked without replacement from {j: 1, p: 1, v: 2, a: 2, r: 1, l: 2}. 0 Three letters picked without replacement from {w: 2, t: 4, s: 4, l: 1, i: 8}. Give prob of picking 1 t, 1 w, and 1 l. 8/969 Four letters picked without replacement from {l: 3, j: 12}. Give prob of picking 2 l and 2 j. 66/455 Four letters picked without replacement from {l: 2, j: 1, r: 2, a: 2, w: 2, y: 5}. What is prob of picking 2 w, 1 j, and 1 y? 5/1001 Four letters picked without replacement from {m: 3, x: 1, f: 3}. What is prob of picking 1 f and 3 m? 3/35 Four letters picked without replacement from {r: 1, l: 2, u: 4, d: 4, p: 1, i: 2}. What is prob of picking 2 l and 2 d? 6/1001 What is prob of picking 2 g when two letters picked without replacement from jgjjjgjjjjjjjjjjjjgg? 3/95 Four letters picked without replacement from {x: 2, s: 1, c: 3, v: 6, i: 2}. Give prob of picking 1 s, 1 i, and 2 v. 30/1001 Calculate prob of picking 2 j and 1 h when three letters picked without replacement from hjjcjhjjchcjjjhj. 9/35 Two letters picked without replacement from fbbbfbabbbffubabff. What is prob of picking 1 a and 1 f? 4/51 Two letters picked without replacement from cltlclele. What is prob of picking 1 e and 1 c? 1/9 What is prob of picking 3 i and 1 q when four letters picked without replacement from zfgiiizigq? 2/105 Calculate prob of picking 1 f and 2 c when three letters picked without replacement from xxffcc. 1/10 What is prob of picking 2 e and 1 k when three letters picked without replacement from eeeeeeeeeexkeee? 6/35 What is prob of picking 3 p when three letters picked without replacement from ccccpcccccpcccccpccc? 1/1140 Three letters picked without replacement from xjtdtjxxjlxljxxdtdx. Give prob of picking 1 l and 2 d. 2/323 Two letters picked without replacement from rrwrrgrrggg. Give prob of picking 1 r and 1 w. 6/55 Calculate prob of picking 1 i and 1 z when two letters picked without replacement from ijzjeeiileejee. 3/91 Three letters picked without replacement from bbctbbstb. Give prob of picking 1 s, 1 c, and 1 t. 1/42 What is prob of picking 1 l, 1 o, and 1 n when three letters picked without replacement from lqrqnqrlkqqorqn? 4/455 Three letters picked without replacement from {u: 3, h: 8}. Give prob of picking 3 u. 1/165 Calculate prob of picking 2 g when two letters picked without replacement from {u: 2, f: 9, b: 4, g: 3}. 1/51 Two letters picked without replacement from fnnvnnqvnvoffnfnoo. Give prob of picking 1 q and 1 f. 4/153 What is prob of picking 1 k and 1 d when two letters picked without replacement from bkdgkuob? 1/14 Calculate prob of picking 2 p when two letters picked without replacement from oooooppopooooo. 3/91 Four letters picked without replacement from {p: 17, x: 2}. What is prob of picking 4 p? 35/57 What is prob of picking 1 u and 2 f when three letters picked without replacement from nnfnnnfufuf? 4/55 Two letters picked without replacement from {g: 4, u: 1, f: 3}. Give prob of picking 1 f and 1 u. 3/28 Three letters picked without replacement from hwhvchccawhrhhhh. What is prob of picking 1 v and 2 w? 1/560 Three letters picked without replacement from {k: 4, g: 15}. What is prob of picking 3 k? 4/969 Four letters picked without replacement from gzgg. Give prob of picking 2 z and 2 g. 0 Four letters picked without replacement from {l: 1, z: 1, k: 2, v: 1, p: 2}. What is prob of picking 1 k, 1 z, 1 l, and 1 p? 4/35 Calculate prob of picking 1 b and 1 r when two letters picked without replacement from {r: 6, z: 2, f: 1, b: 4}. 4/13 Three letters picked without replacement from {s: 1, t: 1, m: 1, k: 1, h: 2, d: 1}. Give prob of picking 1 k, 1 t, and 1 d. 1/35 Calculate prob of picking 3 d when three letters picked without replacement from bdbddibdddbdlbdbdi. 7/68 Two letters picked without replacement from jkj. Give prob of picking 2 j. 1/3 Two letters picked without replacement from {n: 2, q: 4, b: 8, j: 1}. What is prob of picking 2 b? 4/15 Four letters picked without replacement from {n: 3, g: 7}. What is prob of picking 1 g and 3 n? 1/30 Four letters picked without replacement from xsgsgixuixgski. What is prob of picking 2 g, 1 s, and 1 x? 27/1001 Two letters picked without replacement from {j: 7, u: 9}. Give prob of picking 1 j and 1 u. 21/40 Calculate prob of picking 1 y and 1 t when two letters picked without replacement from {y: 1, m: 14, t: 1}. 1/120 Calculate prob of picking 3 z when three letters picked without replacement from {z: 6, u: 11, h: 1}. 5/204 Three letters picked without replacement from pqqssp. What is prob of picking 2 q and 1 s? 1/10 Calculate prob of picking 1 d and 3 p when four letters picked without replacement from pmpppqldllmzqlddzpd. 10/969 Calculate prob of picking 3 v and 1 o when four letters picked without replacement from {o: 2, v: 5, r: 7}. 20/1001 Two letters picked without replacement from quuqyudttq. What is prob of picking 1 y and 1 d? 1/45 Three letters picked without replacement from {i: 1, e: 2, n: 8, x: 2, b: 1}. Give prob of picking 1 x, 1 i, and 1 n. 4/91 What is prob of picking 3 y and 1 q when four letters picked without replacement from yyfyfqyfffyq? 4/99 What is prob of picking 1 s and 3 h when four letters picked without replacement from shsshhhsss? 4/35 What is prob of picking 1 w, 1 x, and 1 r when three letters picked without replacement from {x: 2, l: 3, r: 7, w: 7, s: 1}? 49/570 What is prob of picking 3 q and 1 g when four letters picked without replacement from qgqqggqggqgq? 8/33 What is prob of picking 2 h and 1 t when three letters picked without replacement from tjptthtthqjth? 9/143 Three letters picked without replacement from {p: 1, u: 6, l: 3, o: 1, y: 3, f: 3}. What is prob of picking 2 u and 1 y? 9/136 Two letters picked without replacement from bbjjmbb. Give prob of picking 1 m and 1 b. 4/21 What is prob of picking 1 d, 1 v, and 1 t when three letters picked without replacement from vdsutvvstv?	{ "pile_set_name": "DM Mathematics" }
1, 0.4, 2, -4, n? n Suppose 0 = 2v + 3 + 3. Let j be 1532/(-8)(-6)/(-297). Let z = 34/9 + j. What is the third biggest value in 1/6, v, z? v Let k = -3.85078 - 0.14922. What is the second smallest value in 1.24, k, -0.5? -0.5 Let i be -2 + 406/60 - (-1)/6. Let m = 94/15 - i. What is the third biggest value in m, -1/8, 2/5, -2/9? -1/8 Let s = -43 - -257/6. Let r = -567/4 - -142. Let c = 417/4 + -105. What is the third biggest value in s, r, c? c Let f = -8511 + 8512.9638. Let n = f + 0.0362. Which is the fourth smallest value? (a) -5 (b) n (c) 0 (d) 3 d Let m = 18682 + -18671. Which is the second biggest value? (a) 2 (b) 0.1 (c) m (d) -3/7 a Let g = -286 - -820. Let k = 533.8 - g. Let d = -3 - -2. What is the third biggest value in d, -0.5, k, -2/3? -2/3 Let k = -10.35705 - 0.17295. Which is the third biggest value? (a) k (b) -2 (c) 0.09 a Let y = -191 - -190. Let g = 0.52 + 2.39. Let z = g + 0.09. What is the third smallest value in 1, z, y? z Let r = -11653 + 11652.9. Which is the second biggest value? (a) 2/9 (b) r (c) 1/4 (d) 0 a Let s = 0.21 - 3.21. Let i = s - -2.956. Let l = -3.044 - i. Which is the biggest value? (a) 3 (b) l (c) -2/7 (d) -1/5 a Let h be ((-1)/(-12))/(14/(-14770)). Let v = h + 88. Let z = 1.6 - 1.1. What is the smallest value in v, -2, z? -2 Let i = -1.979 + 1.979. What is the second smallest value in -2/17, i, 16, -2? -2/17 Suppose 0 = -z - 3f - 9, -2f + 3f + 73 = -5z. Let p be ((-5)/z3)/(3/6). Let n(b) = -2b - 3. Let t be n(-2). What is the smallest value in -1/5, t, p? -1/5 Let a be 263 - (4 + 5 + -1). Suppose ak - 263k = 16. What is the smallest value in 3/7, k, 1.6, 1/5? k Let v = -28 + 290. Let l = -254 + v. Which is the third smallest value? (a) l (b) 7 (c) 0.2 a Let w = 2.25 + -8.25. Let s = -2.359 + 2.21. Let n = s + 0.049. Which is the smallest value? (a) n (b) w (c) 4 b Let h be ((-4)/(-2202))/((-2)/6). Let o be 3283602/(-461686) - (-7 - 0). Let f = h + o. Which is the fourth smallest value? (a) -2 (b) 2/5 (c) 1/2 (d) f c Let x = 3.01 + -0.01. Let w = 934.2239 + -0.2239. Let r = 934.8 - w. What is the second smallest value in x, -4, r? r Let u be 5/104/1. Let r = 20875/18 - 1160. Let q = 16/9 + r. What is the fourth biggest value in -1/5, q, u, 0.3? -1/5 Let w(v) = 4v*2 - 9v - 22. Let a be w(-2). Suppose -z - 5m + 7 = -0m, 0 = -4m + a. What is the third smallest value in 0.2, -1/3, 0, z? 0 Let r = 2988 - 2988.2. Which is the smallest value? (a) -169 (b) 3 (c) r (d) 0.3 a Let p = 10 + -9.5. Let x be (126/(-84) + 2/4)/3. Which is the second smallest value? (a) x (b) 4 (c) p c Let l = 3.54 + -346.54. Let h = l + 343.4. What is the second biggest value in -7, -1, h? -1 Let m = -11/4 - -13/4. Let s = 18 + -15. Let p be ((-1)/2)/((-78)/24). What is the third smallest value in m, p, s? s Let f = -15352 + 15351.9. What is the biggest value in f, 0.4, 1? 1 Let v be 32(-81)/2592(-1 - (-1)/2). Let s = 5 + -9. Which is the second biggest value? (a) v (b) s (c) -2/13 c Let m = -77 - -25. Let f = 477 - 480. What is the third smallest value in 0.5, m, f? 0.5 Let j = 5 - 5.2. Let l = -0.258 - -27.858. Let z = l - 27.6. What is the smallest value in z, 5, -25, j? -25 Let k = 18 - 36.1. Let z = 19.1 + k. Which is the second smallest value? (a) 6 (b) 5 (c) -2/3 (d) z d Let j = -0.03131 - 4.96869. What is the fifth biggest value in j, 4/5, -34, -3, 2? -34 Let n = -1096/5 - -220. Let f = -31 - -31.7. Let i(j) = j2 - 51j - 409. Let k be i(-7). Which is the second smallest value? (a) f (b) k (c) 0.2 (d) n c Let m = -1 - 4. Let q = 3 + m. Let v = 773/18 + -769/18. Which is the fourth smallest value? (a) -1/5 (b) 0.2 (c) q (d) v d Let j = 0.6 + -23.6. Let t = j - -22.58. Let o = t - -1.92. What is the third biggest value in 0.1, 0, o? 0 Let b = -4688 + 4688.4. What is the biggest value in 0.1, -522, b, -2/5? b Let h = -694.1 - -694.113. Which is the fourth smallest value? (a) -0.1 (b) 1/4 (c) -0.03 (d) 2 (e) h b Let h = -235.06 - -235. Let f = -0.46 - h. Let q(x) = 4x3 - x. Let u be q(1). Which is the smallest value? (a) 1/3 (b) f (c) -4 (d) u c Let w be (-8)/(-84) + (-3)/7 - 1. Let z = 141 + -69. Let h = z + -77. What is the biggest value in w, h, 0.1, 0.2? 0.2 Suppose r - 3r - 62 = 0. Let w = 98385.1 - 98385. Which is the second smallest value? (a) -3/4 (b) r (c) w a Let k = -0.71 + -3.29. Let h = 715 + -705.09. Let o = h + 0.09. Which is the second biggest value? (a) o (b) -5 (c) k c Let t = 0.72 - 0.66. Let z = -1.86 + t. Let x = 28 - 28. Which is the smallest value? (a) x (b) 2/19 (c) -4 (d) z c Let x = 1 - 3. Let f be (-18)/72(22 + -19). What is the third smallest value in x, 2, f, -64? f Let i be 7980/(-340) + 19 - (-5 + 0). Which is the fourth biggest value? (a) i (b) 9 (c) 0.3 (d) -2/5 d Let s be (173 - 170)/(3/(-4)). Which is the fourth smallest value? (a) s (b) 25/2 (c) 0.5 (d) 1/4 b Let d = -0.0298 - -409.0298. Let y = -409.2 + d. What is the third smallest value in 0, 8, y? 8 Let t = -1211.8 - -1216.8. Which is the fourth smallest value? (a) -6/11 (b) -0.3 (c) -34 (d) t d Suppose 31a - 754 = -661. Let q = -3.13 + 2.04. What is the biggest value in -2/11, 0, a, q? a Suppose 2t - 45200 = 5w, -5w + 0t = 4t + 45230. Let y be -7 + 3 + (-34920)/w. Let i = y - 6/137. Which is the biggest value? (a) i (b) -2 (c) 1 (d) 3/7 c Let x = -4016/9 - -446. Which is the fifth biggest value? (a) -2/35 (b) x (c) -3/2 (d) 3/5 (e) -0.5 c Let j = 0.31 - -0.36. Let b = j + -0.97. Let p = -6 + 6.2. What is the third smallest value in p, -3, -0.2, b? -0.2 Let y = 21553/15 + -1437. Which is the fifth biggest value? (a) 1/2 (b) y (c) -2/213 (d) 0.2 (e) -4 e Let t = 230.4 + -229.4. Which is the third biggest value? (a) -1/5 (b) t (c) 32/5 (d) -5 a Let x be 579/(-92) - 4-1. Let z = 24/23 + x. Which is the smallest value? (a) -2/13 (b) z (c) 0.4 b Suppose 161v + 1520 = 29v - 248v. Let l be 2 + 1(0 - -1). What is the fourth smallest value in 0.7, 1, l, v? l Let g = 7972.5 + -7972. What is the second biggest value in -0.4, 2/7, 3/4, 2/13, g? g Let m(l) = 4l + 14. Let f be m(-5). Suppose -h = -r + 6, 5h - r = -2r. Let j = f - h. Which is the third smallest value? (a) 9 (b) -2 (c) j a Let v = 5.646 - 0.646. What is the fourth biggest value in v, -5, -17, -4? -17 Let n(u) = -16u*2 - 65u - 7. Let t be n(-4). Which is the second biggest value? (a) 1.9 (b) 0 (c) t (d) -0.4 (e) 5 a Let j = 0.012 - -0.038. Let x = -320.2 - -320. What is the smallest value in 4, 2, x, j? x Let z = 20.03 - 0.03. Let s = -48 + z. Let t = s - -29.4. What is the second biggest value in t, -0.4, 0.2? 0.2 Let k = -247535 + 247538. Let x = -0.4 + 4.4. Which is the third smallest value? (a) x (b) k (c) 108 c Let t = -1706.7 + 1706.6. What is the third biggest value in t, 5, 0.4, 2.8? 0.4 Let g = 2.7 - -0.3. Let l be 8/12 + (-2)/6. Let q = -121531/6 + 607649/30. Which is the third smallest value? (a) q (b) l (c) 0.1 (d) g b Let a be 196/(-147)(-3)/(-14). Let q = -4 + 0. Let i = 3.8 + q. What is the second smallest value in a, -6/19, i? a Let w = 785/1842 + -57/614. What is the fifth biggest value in 0.3, w, -1/3, -84, -0.4? -84 Let y = -3587.4 + 3587. Which is the second biggest value? (a) -1/10 (b) -52 (c) y c Let s = 12686 + -38062/3. Which is the second biggest value? (a) s (b) -236 (c) -4 c Let j = -3696 - -3699. What is the second biggest value in -4/7, j, 2/11, 20/9? 20/9 Let s = 195 + -194. Let g = -12 - -33. Let j = -23 + g. Which is the third smallest value? (a) j (b) s (c) -0.4 b Let q = -4483 - -4482.5. Which is the fourth smallest value? (a) -0.1 (b) -2489 (c) 0.3 (d) q c Let o = 12.3 - 12.7. Let s = 153 - 137. What is the second biggest value in 4, s, o? 4 Let i be 17/(-36) + 2/8. Suppose 2d = -f + 46, -d - 39 = 3f - 167. Let r = f + -85/2. Which is the smallest value? (a) r (b) 5 (c) i a Let j = 43 + -41. Let t(v) be the first derivative of 3v*2 - 7v - 6. Let x be t(1). Which is the second biggest value? (a) j (b) 0 (c) -0.5 (d) x b Suppose 4*y + 5 = -y. Let f = -51775 + 51770. Which is the second biggest value? (a) f (b) y (c) -0.2 (d) -1/2 d Let s = 15740.7 + -15741. What is the	{ "pile_set_name": "DM Mathematics" }
2i + 10o - 40 = 4i, -6i + 4o = -o + 20 for i. 0 Solve -34 = -3y + 2u - 5 + 1, -22u = -2y + 392 for y. -2 Solve 0 = 3h - 33q + 54q - 23q - 24, -h - 3q = -8 for h. 8 Solve 47q - g = 46q + 19, 93q = -g + 1485 for q. 16 Solve -8s + 36 = 2z, 3z - 37 = -5s + 37 - 55 for s. 5 Solve 5o - o - 45 = 5j, j + 77 - 349 = 3o - 292 for o. 5 Solve 3d = 9d - d - 20g - 30, 4d = 5d - 9g + 7g for d. -6 Solve -s - 3q + 15 = 108, -3s - 13q - 295 = 0 for s. -81 Solve 4 - 73 - 11 = 3d + 5q, 19d + 3q - 32786 + 32834 = 0 for d. 0 Solve 8i + 88 = 2498l - 2502l, -i - 65 = 5l for l. -12 Solve j = -4p - 51, 5p - 232252j + 16 = -232249j - 35 for p. -12 Solve -5v = 156300a - 156297a - 3, 3a - v + 15 = 0 for a. -4 Solve r + 6 = -225k + 225k, -3k = 4r + 33 for k. -3 Solve 4y + 76 = -4k - 0k + 212, 40k + 2y = -122 for k. -5 Solve -9b + 0b = 18b - 28b - w + 19, -4b + 846 = 39w for b. -3 Solve 0 = 5m - 5v + 2298 - 2143, 4m = -4v + 140 for m. 2 Solve -21h = -5k - 88, h - 12754k = -12752k + 13 for h. 3 Solve 3h - 9 = 3s, 183 = -12h - s + 258 for h. 6 Solve -9p - 11 = -2k + 13 + 34, -p - 63 + 37 = -2k for p. -4 Solve -4d = -l + 48, 2156d - 5l = 2155d - 31 for d. -11 Solve 4t + 129 = -71j - 36, -33 = -j - 3t for j. -3 Solve 5i + 175 = 10q, -3q + 1873612 - 1873544 = -2i for i. -31 Solve -i - 27 = -13550a + 13545a, 0 = 3i - 3a + 21 for i. -2 Solve -3y - 5l + 28 = 0, 6l + 3776 = -2y + 3808 for y. 1 Solve -5i = -55, 6463r - 6474r + 33 = -2i for r. 5 Solve 584m - 588m - w - 81 = -6w, 5m + 5w - 59 + 14 = 0 for m. -4 Solve 95d = -4b + 178, -2b - 12 = b + b for d. 2 Solve -28w + 59w - 748 = -4s - 64w, 3w = 2s + 5w - 10 for s. -3 Solve 0 = -2z + 5l - 89, 4l + 18691 = 5z + 18752 for z. 3 Solve 2c = -c, -168x + 18x = 18x + 4c - 7c - c - 4704 for x. 28 Solve 135q - 124q - 2g - 65 = 0, g = 3q + 2g - 26 - 1 for q. 7 Solve 5b = -5v + 5, 238v - 242v + 28 = -4b for v. 4 Solve -233s + w + 26 = -237s - w, -6s = -3w - 4w + 5w - 6 for s. -2 Solve -35b + 39b = -23g - 65, 4g = b + 2b - 15 for b. 1 Solve -90922s - 2z = -90923s, s + 2z - 8 = 0 for s. 4 Solve -2x = -p - 2, -2x - 8512 = -46p - 8694 for x. -1 Solve -6n = 4r + 42, -4688825n + 25 = -4688823n - 3r for n. -1 Solve p = 4i - 51, -19i + 20i = 4p + 1662 - 1653 for p. 1 Solve -k - 62 = -2u, 2u + 6k - 26 + 43 = 3u - 25 for u. 30 Solve z = -29k + 34k - 44, 0 = 2k + 14z + 544 for k. 1 Solve -18k - 25k + 19k + 105 = 3t, 0 + 4 = -0k + k for t. 3 Solve -2u - 2 = a, -5a = 7261u - 7260u + 28 for a. -6 Solve 3h - 22 = y, 12 + 35 = -2y - h + 3 for y. -22 Solve 0j - 2o = -j + 7o + 5o + 239, -7o = -5j + 124 for j. 1 Solve 60n - 58n + 0q - 106 = 3q, -36q = n - 42q - 197 for n. 5 Solve -3o - 12 = 3n, 5o + 212 - 101 = n + 121 for o. 1 Solve -w + 3b - 10b = 2b - 4b - 46, -7b = 4w - 119 for w. 21 Solve -70 = -5k - 5i, -2166k + 2i - 434 = -1965k for k. -2 Solve 4r + 5y - 131 = 0, 4r - 7628 = 4y - 7524 for r. 29 Solve 20 = 5g + s, 0 = 100s - 95s - 20 - 105 for g. -1 Solve 2x + 106 = -13y, 3x + 2y + 158181 - 158162 = 0 for x. -1 Solve 0 = 5j + 4r + r + 170, -1526r + 1567r + 14 = 5j for j. -30 Solve -23m + 19m - 11 = -5m + 5u, 3m = 27u + 69 for m. -4 Solve -52235d - 36 = -52231d + 2r, 0 = 2d + 7r + 42 for d. -7 Solve y + 2y = 5u - 0y + 48, 3y - 19 = 2u + 2y for u. -9 Solve -15d - 30 = 0, 4780n - 2d = 4784n + 8 for n. -1 Solve 3r - 3i + 7246 = 7261, 4i = -10r + 22 for r. 3 Solve 4965f = 4969f - 2l - 70, 5f - l = 44 for f. 3 Solve -r = -4o - 14, 2645 = -2o - r + 2659 for o. 0 Solve -2o + 5956t = 5961t - 209, -3o + 5t + 139 = -137 for o. 97 Solve f + 44 = -g + 5f, 5g - 4f + 68 = 24 for g. 0 Solve 0 = 2q - b + 33, 2q - 186b = -183b - 23 for q. -19 Solve -22v + 5001 = -312w - 19v, -79 = -37w + 41w - 5v for w. -16 Solve 4i = -13q - 30, 5i - 9 - 4 = 3q - 12 for i. -1 Solve -2c - l = 18, 5c - 26l + 45 = 92l - 120l for c. -9 Solve 26s = 5l - 223, -5l - 25 = -559s + 564s for l. 3 Solve 4m = -l + 66, 6m - 2m - 5l - 3164 + 3110 = 0 for m. 16 Solve -3h = -36c + 43c + 19, -27h + 2c - 307 = -3c for h. -11 Solve 8c + 93 = o + 8c - 2c, -5o + 465 = -2c for o. 93 Solve -3l + 4d - 5d + 36 = 0, 2l + 528d = -3l + 526d + 61 for l. 11 Solve 4b = -u - 9, -3b + 1822u - 42 = 6b + 3658u - 1841u for b. -3 Solve -64g - 30 + 36 = -65g, -4i - 7g = 22 for i. 5 Solve t - 2o + 41 = 0, 277t = 279t + 65o - 1229 for t. -3 Solve -12d + 2a + 962 = 24d, -d + 63 + 2 = 4a + 18 for d. 27 Solve -2g = -5t - 11, -685826g - 11 = -685830g - t for g. 3 Solve -5s + 8k - 3k + 702 = 737, -3s - 2s - 17 = 4k for s. -5 Solve 6r + 4k = 22 + 14, 12 = -r + 10k + 3k - 23 for r. 4 Solve 9t = 3w + 84, 446w - 902w - 3t = -445w + 200 for w. -19 Solve -4g + 52 = -j, 5j - 5g = 23 - 94 - 129 for j. -36 Solve 0 = -4o - 5t - 18, 1119o = 1123o - t + 30 for o. -7 Solve 7t + 33 = g, -t - 24 = -5166340g + 5166336g for t. -4 Solve -4r + 84 = 13h - 9h - 0h, r - 2 = 0 for h. 19 Solve -3r + 37 = 2b, r + 171866b - 24 = 171863b for r. 9 Solve -18r - 105 = 3l, 12 = -4r - 3l - 51 for r. -3 Solve 5g = 4n + 243, n - 3675 = -959g + 887g for n. 3 Solve -2o + 39 = c, -6o - 28c = -35c - 127 for o. 20 Solve y = -5f - 0y - 55, 83y = -5f + 97y + 20 for f. -10 Solve -4 = -5r - 5b - 164, 0b - 5b = 6r + 188 + 5 for r. -33 Solve 0 = -5y + x - 15, -4y - 3120x + 3122x + 7 - 19 = 0 for y. -3 Solve -26 = -4a + b, -5a - 98460b + 98463b = -29 for a. 7 Solve 11v - 58 = 4f + 51 - 31, 2v - 96 = 4f for v. -2 Solve -20h - 2d - 48 = -23h, 0 = -19d + 57 for h. 18 Solve -2g + 3d = -15, -52g = -153d + 149d - 168 for g. 3 Solve 3x + 4b + 27 = 0, 217 = 2x - 4b + 417 - 222 for x. -1 Solve 0y + 5y - 21 = j, 9j = -7y + 6y - 51 for y. 3 Solve -8r + o - 125 = -156, 8r - 28 = 4o for r. 4 Solve -4r + 4w + 232 = 0, 4r + 5r - 253w + 252w - 98 = 0 for r. 5 Solve 2x = c - 8, 654x = 4c + 657x + 12 for c. 0 Solve -4c + 13k - 8k + 187 = 0, -4c + 26k - k - 29k + 196 = 0 for c. 48 Solve w - 641b + 638b - 9 + 31 = 0, 20 = -6w + 4b for w. 2 Solve 2t + 20 = -3g, 0t - 5g = -11t - 13t + 170 for t. 5 Solve f + 134 - 56 = g + 83, -31 = 3g + f for g. -9 Solve -41l = -2s - 44l - 46, 2l - 8l = 3s + 66 for s. -26 Solve 0 = -y - 0y + 376 - 377, 4n + 60y + 76 = 0 for n. -4 Solve -15 - 15 = 2i - 5i, 46 = -2m + 5i - i for m. -3 Solve 0 = 3h + 4a - 169, -12h - 244 = -34258a + 34254a for h. -5 Solve -8g - 4 = -6 + 2 - 40, -3p = -6g + 5g + 14 for p. -3 Solve 0 = 2q - 3n + 37, -5q + 17n = -5885 + 6063 for q. -5 Solve 10v + 341 = -3w + 105, 0 = -2w - 2v - 134 for w. -62 Solve 2428r + 34 = -8d + 2430r, 0 = 3d - 8d + 5r - 25 for d. -4 Solve 49 = w - 4d + 50 + 30, 23w + 49 = -2d - 83 - 17 for w. -7 Solve -37i + 261 = 4z + 7 + 111, 12 = -i - 2z + 31 for i. 3 Solve -44q = 20q - 9n - 70, -12n = -17n - 110 for q. -2 Solve -5v - 10 - 1 = 5f + 24, -2v + 4f - 32 = 0 for v. -10 Solve -2b = -5w + 2w + 2, 5b + 205 = 406 - 206 for w. 0 Solve -o - 4h - 10 + 52 = 0, 127 = 2o + 3h + 38 for o. 46 Solve 5n - 43j = -127j + 65j + 63, -2j + 9 = n for n. 5 Solve -7a = -2a - 4v - 26, 3a + 62v + 10 = 58v for a. 2 Solve i + 160 + 29 = 15u - 81, 0 = 7u + 4i - 126 for u. 18 Solve -t + 6962 - 6858 = -22b, -33 = 3t + 3b for t. -6 Solve 0i - 2 = 4i + 2m + 32, 3m + 27 = i - 3i for i. -6 Solve 9 + 31 = -14w - 8w + 6f + 4 - 12, -5w - 12 = -f for w. -3 Solve 4h - 31 = -i, -2i + 508195 - 508181 = 2h for h. 8 Solve -3m - 4y = -9y + 30, -1 = 11m - 6m + 8y for m. -5 Solve 8p - 4p - 50 = 2h, 91p = 92p - 2h - 41 for p. 3 Solve 106l - 102l + 78 = v, 4l + 36 = 9v - 26 for v. -2 Solve -64 = -543f + 545f - 3n, 5f + 61 = 3n - n for f. -5 Solve 32c = -3z + 1039, -4z + z + 2z = 2z + 10c - 335 for z. 5 Solve j - 3c + 20 = -3j - c, 4c = 160j - 160j for j. -5 Solve -30 = 2f + 3k, 196k + 100 = 146k for f. -12 Solve 3q - 2a + 6 = 0, 524q - 1560q = -518q - 515q - 4a + 12 for q. 0 Solve 4f = 2j + 5	{ "pile_set_name": "DM Mathematics" }
*2 + 2112k*2 - 189kn3u - kn2uw + 12kn2 - knw - 328n*3w + n*2w + nuw wrt n? -72k2 - 1134ku - 1968w Find the third derivative of 3b4 - 16691b*3x*3 + 4b*3 + 9b*2x*3 - 90b*2 + 24bx3 - 3bx + 3x*3 wrt b. 72b - 100146x3 + 24 Find the third derivative of -8528562c*3 - 422c*2 - c - 1302. -51171372 Differentiate -21598801h*3 + 22735938 with respect to h. -64796403h*2 What is the third derivative of 41600a*5r - 82a3r - 2a2r - a*2 + 6700290a + 1 wrt a? 2496000a2r - 492r Find the third derivative of -7976099m*3 + 1348m*2 - 301m wrt m. -47856594 What is the second derivative of 4582a3 - 2a*2q + 3620a2 + 4152690aq wrt a? 27492a - 4q + 7240 What is the second derivative of 31f*2u*2w - 1305f2 - 3fu2w + 25194fu*2 - 37fuw - uw wrt u? 62f*2w - 6fw + 50388f Find the third derivative of v2y*3 - 2v*2 + 141971vy3 - 3vy2 - 534117y*2 wrt y. 6v*2 + 851826v Find the second derivative of 730924b2d*2 + 898b*2d + 18b + 107d wrt d. 1461848b2 What is the first derivative of -5106o*3 + 132o - 97915262? -15318o2 + 132 Differentiate 5404z*2 - 958z - 3734497 with respect to z. 10808z - 958 Differentiate 131853831d*3 + 88294487. 395561493d*2 What is the second derivative of -7c*3 - 274742c*2 + 342400c + 36? -42c - 549484 Find the third derivative of 31700573v*4 - 352v*2 + 19v + 393 wrt v. 760813752v Differentiate -889965g*3 + 3g - 804919522 with respect to g. -2669895g2 + 3 What is the first derivative of 100989810c*3 - 28755587 wrt c? 302969430c*2 Find the second derivative of -6018166f*3r*2 + 2f*3r - f*2r + 5780327fr wrt r. -12036332f3 What is the second derivative of -68203u*2 + 111u + 50464? -136406 What is the second derivative of -13732779m2 + 130785m wrt m? -27465558 Find the second derivative of 14i3 - 3913i*2 - 17972i + 59 wrt i. 84i - 7826 Find the third derivative of 8q*3r + 19666823q3 - 10q*2r + 242q - 18r + 11 wrt q. 48r + 118000938 What is the second derivative of -14181941f*4 - 8034267f? -170183292f2 Find the third derivative of 89911661v*3 + 2044147v*2 + 26v. 539469966 What is the second derivative of -2gq*2 - gq - 48g + 49661497q*2 - 342q - 380 wrt q? -4g + 99322994 Find the third derivative of -68440471t*4 + 2475001t*2 wrt t. -1642571304t What is the second derivative of -536l2m*3 - 546l*2m*2 - 14698l*2m - 65l2 wrt m? -3216l*2m - 1092l2 What is the second derivative of 539432582x*5 - 6x - 42999878? 10788651640x3 What is the derivative of 9687724s - 12750214? 9687724 What is the third derivative of 951727517h3j + 2h2j - 773199h2 + 55j wrt h? 5710365102j What is the first derivative of 267317091z + 17247127 wrt z? 267317091 Find the third derivative of 38029069p3 - 57p*2 - 27p + 282 wrt p. 228174414 Differentiate 2hl*2 - 1117978hl - 8h + 14l2 - 5183615l + 1 wrt h. 2l2 - 1117978l - 8 Find the second derivative of -12769524i4 - 32i - 364347. -153234288i2 What is the first derivative of -15dv3 + 19031dv + 237d + 2v3 - 8707799v*2 + 3 wrt d? -15v*3 + 19031v + 237 Differentiate 1607130n2z - 7n2 - 298903n wrt z. 1607130n2 Find the second derivative of -24878568o*5 + 46112762o. -497571360o3 Find the third derivative of 5h*6 + 3577h*3 - 36075h*2 + 795h - 2. 600h3 + 21462 Differentiate -1741k*3o - 9901108k3 - 5ko + 9o - 1 with respect to o. -1741k3 - 5k + 9 What is the third derivative of 12828851k3 - 4k*2 - 1494130 wrt k? 76973106 Differentiate -22674iv2 + iv + 3598i - 255738094v*2 with respect to i. -22674v*2 + v + 3598 Differentiate -6g*3w - 15g2 - 38830gw3 + w3 - 59w*2 + 5w + 145756 wrt g. -18g2w - 30g - 38830w*3 Find the second derivative of 56115592s*2 + 73034s - 196 wrt s. 112231184 Find the first derivative of 957051430r + 17835654. 957051430 Find the second derivative of 416223568n*2 + 10691480n + 5. 832447136 Find the third derivative of -8081823n4 - n2 - 3n + 304948. -193963752n What is the second derivative of 31214824l*2 - l + 38727587? 62429648 What is the third derivative of -2i*4n + 6299726i4 - 2i*2n + 10i2 + 50i + n - 6 wrt i? -48in + 151193424i Find the first derivative of -13890jv3y + 1592jy - 2912v3y + 11767 wrt j. -13890v3y + 1592y What is the second derivative of -8g*3 - 400529g*2 - 2g - 2702881? -48g - 801058 Find the third derivative of -53981899a*3 - 3551a*2 + 1636a - 1 wrt a. -323891394 Differentiate 63454217z2 + 6157156. 126908434z Find the second derivative of -1040492906p5 + 17360p - 11130 wrt p. -20809858120p3 What is the first derivative of -4cm3 + cm*2 + 22cm + 17713c - 541240856m3 wrt c? -4m3 + m2 + 22m + 17713 What is the derivative of px - 660540p - 7904270x wrt p? x - 660540 Find the third derivative of -2b3p*3 - 2b*3 + 396b*2p3 + b2p2 + 3244bp3 - 4bp2 + 69927p wrt p. -12b3 + 2376b*2 + 19464b Find the third derivative of 591609a4 + 12690a*2 + 62a - 2. 14198616a Find the second derivative of -3d*2hr + 3d*2rv2 + 2d*2r + 3054d2 - 1285dv + 185hrv + 2hr + 4v2 wrt d. -6hr + 6rv2 + 4r + 6108 Differentiate 123677400d + 182969531. 123677400 What is the derivative of -490654850w - 205645978? -490654850 Differentiate 12529l2 + 444l + 477893 with respect to l. 25058l + 444 What is the third derivative of 2595k*3l3 + k3l2 - 5k*3 - 174l*5 - 4l*3 + 1059l*2 - 4l - 1 wrt l? 15570k3 - 10440l*2 - 24 Find the third derivative of -982s*5 + 122s*4 + 4s*3 + 11570857s*2 wrt s. -58920s*2 + 2928s + 24 Find the second derivative of 329150340b3 - b + 212817222. 1974902040b What is the first derivative of -3h2 - 524116h + 109440534? -6h - 524116 What is the derivative of -4553n*2t*3 + 553n*2t*2 + 10039551t*3 wrt n? -9106nt3 + 1106nt2 What is the first derivative of 38r*2z + 8r2 - 135rz - 2r + 542z - 11561 wrt r? 76rz + 16r - 135z - 2 Find the second derivative of -1947df4 - 7628df3w + 6dfw - 5df - 32608dw - 25fw wrt f. -23364df2 - 45768dfw What is the second derivative of 14469g2nu2 - 253g*2nv2 - 347gnv + 853gu*2v*2 - 2gu2 + gv*2 wrt g? 28938nu2 - 506nv2 What is the first derivative of -4498h*2 - 1273h + 15951016 wrt h? -8996h - 1273 What is the second derivative of 90235711x*3 - 261664072x wrt x? 541414266x What is the derivative of -11112436o*3p*3 - 2o*2p*2 - 18919p3 - p2 + 103p + 2 wrt o? -33337308o*2p*3 - 4op2 Find the third derivative of 24072a*6 + 325a*4 + 130a*2 + 116a - 2. 2888640a3 + 7800a What is the first derivative of 4gs*3 - 746gs2 + 168gs + 12878779s*3 wrt g? 4s*3 - 746s*2 + 168s What is the first derivative of 98wz*3 + 4858w - 6275655z3 wrt w? 98z*3 + 4858 Find the second derivative of -2f*3 + 19867141f*2 - 63289505f. -12f + 39734282 Find the third derivative of 71996570v6 - v2 - 1534v + 112. 8639588400v*3 Differentiate 428b*2o*2 + 353074b*2oy + 2554b2 + o2y - o with respect to y. 353074b*2o + o*2 What is the derivative of 98w3 - w2 + 416055w - 945690102? 294w*2 - 2w + 416055 What is the third derivative of 70931w4 - 500w*3 + 6016w*2 - 3w - 2743 wrt w? 1702344w - 3000 What is the first derivative of 1920443v + 3825154? 1920443 Find the third derivative of -563310024m3o*2 + 83m*2 - 2m - 572o2 - 355 wrt m. -3379860144o*2 Differentiate 6b*2n + 21488556b2 - 288115n with respect to n. 6b2 - 288115 What is the third derivative of 13170374g*3 + 80299g*2 - g - 11 wrt g? 79022244 What is the second derivative of 4h*2o*3 + 2h*2o*2 + 168h*2o - 3468h2 - 132700ho + 1691o*3 wrt h? 8o*3 + 4o*2 + 336o - 6936 What is the third derivative of 58g3n*3s*3 + 70g*3n*3s + 49845g3ns3 - 13g*3ns - g2n*2s - 2n3s*2 - ns*2 + 10s*2 wrt s? 348g*3n*3 + 299070g*	{ "pile_set_name": "DM Mathematics" }
+ 3t = 0, -4b - 3260 + 3256 = 2t for b. -2 Solve -w = 31j, -j + 28w - 32w = 0 for j. 0 Solve 58k = 60k - 7n - 59, 3k = -4n + 74 for k. 26 Solve 2h - 4 = -4k, -2h - 370 + 368 = k for h. -2 Solve 7s + 3f = 33, 3s = 8f - 328 + 370 for s. 6 Solve 294o + 10 = 3m + 295o, 3m - 24 = -3o for m. 1 Solve -f + 7 = n, -12f + 13f = n - 1 for n. 4 Solve -2x + 2c = 0, 3x - 6 = -3c + 12 for x. 3 Solve 3m - 5m = 3j - 0 + 10, 3m - 3 = 0 for j. -4 Solve 630v = 628v + 3p + 51, 10p = -30 for v. 21 Solve b + 3h - 2 = 0, -1059b - 4h + 8 = -1063b for b. -1 Solve 30j + 42 = 3l, 4j + 14 = -1169l + 1168l for l. -6 Solve 49y + 3s + 16 = 50y, 6y = 5s + 18 for y. -2 Solve 264m = 2y + 266m + 30, -5y - m = 75 for y. -15 Solve -3j = -3l - 18, 5l - 44 = 4j - 69 for l. -1 Solve h - 4p = 5, -4p - 2 = 19866h - 19868h for h. -3 Solve -b - 2o = -215 + 231, 2o + 6 = 4b for b. -2 Solve 15 = 3s, 5s + 3074 = -5p + 3079 for p. -4 Solve 14 = -2z - m, 3m + 7 = 41z - 40z for z. -5 Solve -5h + 7 = 4z - 6, -40 = -4z + 4h for z. 7 Solve -5k = -4a + 24, -5a + 30 = 136k - 141k for k. 0 Solve -2w + p - 2 = 0, 4w + 2p + 666 = 694 for w. 3 Solve 0 = 4z - 20, -7f - 3z + 39 = -3f for f. 6 Solve 3v - 372p = -371p, 0p + 4p + 36 = 0 for v. -3 Solve 0 = -2z + 3k - 105 + 127, 0 = 2k + 4 for z. 8 Solve 0 = 5s + 411 - 396, -4s - 17 = 5l for l. -1 Solve 4471p + 2s = 4469p + 6, 0 = -2p + 3s + 26 for p. 7 Solve 1905n - 1908n - 27 = 0, -143 = 2g + 15n for g. -4 Solve -2j + i = 14 - 9, 0 = -5j + 4i - 20 for j. 0 Solve 23 = -u + 20, 4x + 4u + 20 = 0 for x. -2 Solve 5d + 75 = 50, -13 = 3g + 5d for g. 4 Solve -57 = -3h + 3t - 45, 2h - 3t - 11 = 0 for h. 1 Solve -5f = -3q - 33, 1 = 34f - 22f - 11f + 5q for f. 6 Solve -4v - 109 + 119 = 2k, -4k + 60 = -2v for k. 13 Solve c = -2, 77u - 66u + 23 = 5c for u. -3 Solve 1155r - 2g = 1151r + 24, 0 = -r + g + 6 for r. 6 Solve 4j + 2061c + 13 = 2066c, 5c - 28 = -j for j. 3 Solve -246m - 1 = 4o - 249m, -3m - 3 = 0 for o. -1 Solve 27y + 4p = 22y - 7, -4y - 2p - 8 = 0 for y. -3 Solve 70 = 4g + 3z + 90, 3z = -36 for g. 4 Solve -60m = g - 59m + 8, 3m = 6g + 75 for g. -11 Solve k = -3c + 12, -2719k - 84 = -3c - 2724k for c. -2 Solve 4g - 30 = -2o, o - 512g = -516g + 29 for o. 1 Solve 2n = 10s + 4, 19n + 2s = 16n - 11 for n. -3 Solve -5k + 16 = -2o, -72692k = -72690k + 4o + 8 for k. 2 Solve -3o + 17 = -4o - 3d, 0 = -o + d + 3 for o. -2 Solve -2g + 10 = 0, 30g - 11 = 4c + 11g + 20g for c. -4 Solve -3w = -8 - 2 - 2, g + 5w - 9 = 18 for g. 7 Solve -5b - 30o = -34o - 6, 2b + 2o + 12 = 0 for b. -2 Solve 3w - 2 = -s, -7w + s - 2 = -9w for w. 0 Solve -h - 7 = -5q - 13, -5h + q = -6 for h. 1 Solve 372g = 369g - 2q, q - 3 = -3g for g. 2 Solve 12p - 15p + 9 = -2o, 4p = -4o + 32 for p. 5 Solve -4w - 2738 = j - 2731, -w - 3j = 10 for w. -1 Solve 0 = -2h - n - 5, -3n = 3419h - 3420h - 20 for h. -5 Solve 5n + 4b = 22, -2b = 9n - 10n - 4 for n. 2 Solve 4p - 27 = k + 42, 3p = 3k + 54 for k. -1 Solve -6o + 22u + 36 = 20u, -5u - 54 = 3o for o. 2 Solve -4z - 2l + 6l = -28, 2l = -z - 17 for z. -1 Solve 3d - 139p - 11 = -135p, d = -p + 6 for d. 5 Solve 14j + 82 = 4k + 16j, 3k = -4j + 64 for k. 20 Solve 15413 = m - 4c + 15437, -6m - 3c = 9 for m. -4 Solve 7h + 4 = -6g, -9g - 8 = 5h - 6g for h. -4 Solve -4a + 58 - 38 = -4t, -5t - 15 = -3a for t. 0 Solve -2m - 108 = -5l, 0 = -15l - 5m + 2m + 288 for l. 20 Solve 0 = -5j - 55, s = 3j - 1160 + 1195 for s. 2 Solve -4q = -16, 6d - q = -3q + 4q - 38 for d. -5 Solve 0n + 0n + 2o + 261 = -5n + 273, 0 = -2o + 2 for n. 2 Solve 2g + 17 = -5d + 2, 3g - 3d - 30 = 0 for g. 5 Solve 18w + 3v + 30 = 22w - 2v, 0 = -0v - 6v - 12 for w. 5 Solve 3i = 3w - 142 + 151, 0 = -4i - 2w + 24 for i. 5 Solve r - 4u = -8, -3r - 52 = -5u - 56 for r. 8 Solve -2p - 6 = 6j, 5p = -49j + 47j + 11 for p. 3 Solve -8z + 4z - 2u + 36 = 0, 0 = -3u + 24 for z. 5 Solve -53267u = -53282u + 4r + 14, 0 = -4u + 4r + 5 - 13 for u. 2 Solve -7n + 33b = 28b - 81, 0 = 3n - 5b - 49 for n. 8 Solve 340f = -4t + 338f - 2, 3t = 7f + 41 for t. 2 Solve 509t - 510t = 4a - 6, 5a - 2t - 14 = 0 for a. 2 Solve -d = -5w - 9, -359 + 373 = -5w - 4d for w. -2 Solve 4d - 8k = 0, -345d + 2k = -343d + 6 for d. -6 Solve -22p + 21 = -18p + 3z, 0 = 30p + 5z - 105 for p. 3 Solve 2k - 2 = 5y, -33y + 28y + 40 = 5k for y. 2 Solve -7w = -151x + 155x + 12, 2w - 3x + 20 = 0 for w. -4 Solve 34b + 5 = 29b - 5a, 0 = -4a - 8 for b. 1 Solve a - 4f - 6 = 0, -244a + 29f = -479a + 234a - 93 for a. -6 Solve 5u = -3i - 27, -6 = -u - 4i - 8 for u. -6 Solve 0 = 9j - 4y - 467 + 440, 4y = -4j + 12 for j. 3 Solve r - 30z + 7 = -34z, -3r + 9r = 3r - 5z for r. 5 Solve -3m = -3i - 109 + 91, 2i = m - 13 for m. -1 Solve 3128g = 3124g + 4x + 68, 0 = 5g - 4x - 72 for g. 4 Solve -5r + 3 = -10w + 6w - 2r + 2, 46r = 138 for w. 2 Solve 339n - 1 = 338n + 2l, 5n = -3l + 18 for n. 3 Solve -5v - 4m = -45, -3v + 714m = 716m - 25 for v. 5 Solve 4s + 30z + 12 = 31z, -2z = -3s - 2s - 15 for s. -3 Solve -7k - 35 = -5q, 45k - 50k + 4q - 25 = 0 for k. -5 Solve 5m = -4b - 5, 309m + 30 = -3b + 314m for b. -5 Solve -21j + 3b + 318 = 4b, -5j - 5b + 90 = 0 for j. 15 Solve -69152i = -69148i + 3k + 45, 0 = -2i + 5k + 75 for i. 0 Solve -3y = -z - 11, -18y + 14y - 2z + 18 = 0 for y. 4 Solve 4d - 15 = -h, 47h - 49h - 5d = -21 for h. 3 Solve 3f - 8 = n, 8f + 10n - 20 = 14n for f. 3 Solve -4d + 4c = 20, -7d + 5d = 5c - 18 for d. -1 Solve -6g + 39 = -3d, 3d + 313g + 34 = 318g for d. -3 Solve 2f = -5x + 53, 21f + 39 = 4x + 26f for x. 11 Solve -43b + 55b + 173 = 5t, -5t = -5 for b. -14 Solve -42o + 43o - 135 = -14a, -4o = -0a + 2a for a. 10 Solve -d = 836n - 840n + 11, -5d = -2n + 37 for n. 1 Solve -s = 8o - 20, -7o + 14o + 8 = 11o for s. 4 Solve -2029y + 2031y = 5b - 41, 2y - 2b = -26 for y. -8 Solve 4b + 5f + 0f = -39, 0 = -3b + 5f + 367 - 405 for b. -11 Solve 4l = 3c - 37, c + 3l + 3l = -83 for c. -5 Solve 21 = 5g - 3x, -282g + 285g = -3x + 3 for g. 3 Solve -46q + 42q + 55 = -3r, -5r = 13q - 105 for q. 10 Solve -5p - y = -19, 66 = 3p - 4y + 50 for p. 4 Solve -2o - 11 = -r, 0 = 2r - 2o - 2 - 14 for r. 5 Solve 1136f - 10 = -5c + 1133f, -2f = 5c - 15 for c. 5 Solve 4763w - 1 - 7 = 4764w + 3l, -4l = 16 for w. 4 Solve -3c = 9s - 21, 0 = 43s - 46s + 2c + 31 for s. 5 Solve 0 = 3i + 2w + 3, 0 = 240w - 238w + 6 for i. 1 Solve 26 = -13m, 7 - 10 = -5i + 2m - 19 for i. -4 Solve 0 = -5r + 5p + 15, 94r + 3p - 16 = 92r for r. 5 Solve 67 = 2t + b, -65t - 14b = -69t + 54 for t. 31 Solve 3j - 3 = 2u + 5, -12 = 4j + 3u for j. 0 Solve -3w + 23 - 31 = -v, 2v + 24 = -4w for w. -4 Solve 156t - 20 = 159t - 5j, -4j = -4 for t. -5 Solve 5a - 1 = 4x, -3a - 4x = -7x for a. 1 Solve -2n = -5g - 21, 13g - 15 = -n + 17g for n. 3 Solve 5m + 2 = -4k, -4m - 5k - 935 + 928 = 0 for m. 2 Solve 2v = -3p - 42, -131v + 130v = 5p + 63 for p. -12 Solve -2c = -f - 14, -c - 217f = -218f - 9 for c. 5 Solve 0 = 4u + 2o + 8, -u - o - 12 = 3u for u. -4 Solve -3 = 7f + 25, -m + 2f = -9 for m. 1 Solve -u - 90 = -2o - 96, u - 12 = 0 for o. 3 Solve 6 - 3 = -a, 0 = 4k - 2a - 18 for k. 3 Solve -16 = -5y + 4s, -368y - 18 = -372y - 2s for y. 4 Solve -3l - 18 = -3g, -215 = -3g + 4l - 191 for g. 0 Solve 3a = -5d - 8, 16a - 15a = -7d + 8 for a. -6 Solve 110d - 2b + 33 = 105d, 3b - 8b - 1 = 4 for d. -7 Solve 14a + 5z + 27 = 0, a + 7755z - 12 = 7750z for a. -3 Solve 64 = 4z + 5d, 74d = 6z + 77d - 78 for z. 11 Solve -9g = -3y + 4g - 3g - 89, -5g = 4y - 28 for y. -3 Solve -3o + 280m = 281m - 6, 2o - 4 = 2m for o. 2 Solve 0 = 2m + 2, 3g + 5m - 7 + 15 = 0 for g. -1 Solve 4s + 20 = 0, -56x + 5s + 34 = -52x + 5 for x. 1 Solve -8 = -5c + 7, 38l - 8 = 37l - 2c for l. 2 Solve -441r + 444r = -3i - 39, i + 8 = -2r for r. 5 Solve 3d + 3z = -39, 49d = 83d - 43*	{ "pile_set_name": "DM Mathematics" }
998. 2, 4999 List the prime factors of 2332. 2, 11, 53 What are the prime factors of 7803? 3, 17 What are the prime factors of 582? 2, 3, 97 What are the prime factors of 531? 3, 59 List the prime factors of 20597. 43, 479 What are the prime factors of 10522? 2, 5261 List the prime factors of 20568. 2, 3, 857 What are the prime factors of 18132? 2, 3, 1511 List the prime factors of 11473. 7, 11, 149 List the prime factors of 55. 5, 11 What are the prime factors of 1883? 7, 269 What are the prime factors of 56376? 2, 3, 29 List the prime factors of 36426. 2, 3, 13, 467 List the prime factors of 2060. 2, 5, 103 List the prime factors of 1866. 2, 3, 311 What are the prime factors of 2157? 3, 719 List the prime factors of 336. 2, 3, 7 List the prime factors of 12620. 2, 5, 631 What are the prime factors of 3446? 2, 1723 List the prime factors of 1127. 7, 23 What are the prime factors of 513? 3, 19 List the prime factors of 60277. 7, 79, 109 What are the prime factors of 1175? 5, 47 List the prime factors of 32510. 2, 5, 3251 What are the prime factors of 9031? 11, 821 What are the prime factors of 41278? 2, 20639 What are the prime factors of 15436? 2, 17, 227 List the prime factors of 1541. 23, 67 List the prime factors of 1832. 2, 229 What are the prime factors of 41931? 3, 1553 What are the prime factors of 4881? 3, 1627 List the prime factors of 17127. 3, 11, 173 List the prime factors of 4267. 17, 251 What are the prime factors of 353? 353 List the prime factors of 25585. 5, 7, 17, 43 What are the prime factors of 459? 3, 17 What are the prime factors of 11868? 2, 3, 23, 43 What are the prime factors of 27993? 3, 7, 31, 43 What are the prime factors of 711? 3, 79 List the prime factors of 12141. 3, 19, 71 What are the prime factors of 4775? 5, 191 What are the prime factors of 815? 5, 163 List the prime factors of 13749. 3, 4583 What are the prime factors of 748? 2, 11, 17 List the prime factors of 2259. 3, 251 What are the prime factors of 12742? 2, 23, 277 What are the prime factors of 24418? 2, 29, 421 What are the prime factors of 1062? 2, 3, 59 List the prime factors of 995. 5, 199 What are the prime factors of 30516? 2, 3, 2543 What are the prime factors of 42282? 2, 3, 29 What are the prime factors of 2113? 2113 What are the prime factors of 27197? 27197 What are the prime factors of 35718? 2, 3, 5953 List the prime factors of 196. 2, 7 What are the prime factors of 73405? 5, 53, 277 What are the prime factors of 20939? 20939 List the prime factors of 561. 3, 11, 17 List the prime factors of 16984. 2, 11, 193 What are the prime factors of 713? 23, 31 What are the prime factors of 3997? 7, 571 What are the prime factors of 105918? 2, 3, 127, 139 List the prime factors of 841. 29 What are the prime factors of 1253? 7, 179 List the prime factors of 199. 199 List the prime factors of 2306. 2, 1153 List the prime factors of 9086. 2, 7, 11, 59 List the prime factors of 741. 3, 13, 19 List the prime factors of 13637. 13, 1049 What are the prime factors of 1004? 2, 251 What are the prime factors of 1038? 2, 3, 173 What are the prime factors of 4976? 2, 311 List the prime factors of 318. 2, 3, 53 List the prime factors of 15201. 3, 563 List the prime factors of 399. 3, 7, 19 List the prime factors of 6592. 2, 103 What are the prime factors of 1508? 2, 13, 29 List the prime factors of 4303. 13, 331 List the prime factors of 296. 2, 37 List the prime factors of 20914. 2, 10457 What are the prime factors of 3270? 2, 3, 5, 109 List the prime factors of 5139. 3, 571 List the prime factors of 754. 2, 13, 29 List the prime factors of 48800. 2, 5, 61 What are the prime factors of 61249? 23, 2663 List the prime factors of 312. 2, 3, 13 List the prime factors of 51871. 51871 What are the prime factors of 1356? 2, 3, 113 What are the prime factors of 2701? 37, 73 What are the prime factors of 17026? 2, 8513 List the prime factors of 15520. 2, 5, 97 What are the prime factors of 5368? 2, 11, 61 What are the prime factors of 71926? 2, 35963 What are the prime factors of 30264? 2, 3, 13, 97 List the prime factors of 324. 2, 3 List the prime factors of 1309. 7, 11, 17 List the prime factors of 372. 2, 3, 31 List the prime factors of 1759. 1759 What are the prime factors of 89968? 2, 5623 What are the prime factors of 764? 2, 191 What are the prime factors of 77832? 2, 3, 23, 47 What are the prime factors of 52609? 52609 What are the prime factors of 148659? 3, 7, 7079 What are the prime factors of 1816? 2, 227 List the prime factors of 29961. 3, 3329 What are the prime factors of 9373? 7, 13, 103 What are the prime factors of 8827? 7, 13, 97 What are the prime factors of 564? 2, 3, 47 List the prime factors of 45. 3, 5 List the prime factors of 10662. 2, 3, 1777 List the prime factors of 15784. 2, 1973 List the prime factors of 3532. 2, 883 What are the prime factors of 37? 37 What are the prime factors of 21505? 5, 11, 17, 23 What are the prime factors of 1095? 3, 5, 73 List the prime factors of 275. 5, 11 What are the prime factors of 33917? 13, 2609 List the prime factors of 1233. 3, 137 What are the prime factors of 29049? 3, 23, 421 List the prime factors of 4956. 2, 3, 7, 59 What are the prime factors of 107? 107 What are the prime factors of 974? 2, 487 What are the prime factors of 105? 3, 5, 7 List the prime factors of 3741. 3, 29, 43 What are the prime factors of 5562? 2, 3, 103 List the prime factors of 773. 773 What are the prime factors of 6477? 3, 17, 127 List the prime factors of 5165. 5, 1033 What are the prime factors of 33505? 5, 6701 What are the prime factors of 2053? 2053 What are the prime factors of 15536? 2, 971 List the prime factors of 21790. 2, 5, 2179 What are the prime factors of 2558? 2, 1279 What are the prime factors of 3688? 2, 461 What are the prime factors of 1164? 2, 3, 97 List the prime factors of 9279. 3, 1031 List the prime factors of 1295. 5, 7, 37 What are the prime factors of 1642? 2, 821 List the prime factors of 1145. 5, 229 What are the prime factors of 22076? 2, 5519 What are the prime factors of 850? 2, 5, 17 What are the prime factors of 1202? 2, 601 What are the prime factors of 796? 2, 199 List the prime factors of 1190. 2, 5, 7, 17 List the prime factors of 3691. 3691 List the prime factors of 507. 3, 13 List the prime factors of 3116. 2, 19, 41 What are the prime factors of 153694? 2, 76847 List the prime factors of 96863. 13, 7451 What are the prime factors of 48243? 3, 13, 1237 List the prime factors of 2970. 2, 3, 5, 11 What are the prime factors of 15380? 2, 5, 769 List the prime factors of 2026. 2, 1013 What are the prime factors of 3321? 3, 41 List the prime factors of 6068. 2, 37, 41 What are the prime factors of 92128? 2, 2879 List the prime factors of 2856. 2, 3, 7, 17 List the prime factors of 23060. 2, 5, 1153 List the prime factors of 36714. 2, 3, 29, 211 List the prime factors of 1612. 2, 13, 31 What are the prime factors of 64038? 2, 3, 13, 821 What are the prime factors of 41227? 41227 List the prime factors of 20387. 19, 29, 37 What are the prime factors of 5958? 2, 3, 331 What are the prime factors of 41209? 7, 29 What are the prime factors of 1024? 2 What are the prime factors of 112810? 2, 5, 29, 389 List the prime factors of 46968. 2, 3, 19, 103 List the prime factors of 13123. 11, 1193 List the prime factors of 2543. 2543 List the prime factors of 151. 151 What are the prime factors of 23744? 2, 7, 53 List the prime factors of 9315. 3, 5, 23 List the prime factors of 6664. 2, 7, 17 List the prime factors of 189511. 7, 27073 List the prime factors of 1081. 23, 47 What are the prime factors of 155219? 155219 What are the prime factors of 726? 2, 3, 11 List the prime factors of 95487. 3, 7, 4547 What are the prime factors of 15196? 2, 29, 131 List the prime factors of 199663. 23, 8681 List the prime factors of 28063. 7, 19, 211 List the prime factors of 1016. 2, 127 What are the prime factors of 1505? 5, 7, 43 List the prime factors of 667. 23, 29 List the prime factors of 16379. 11, 1489 List the prime factors of 207. 3, 23 What are the prime factors of 2486? 2, 11, 113 What are the prime factors of 98291? 227, 433 List the prime factors of 45151. 163, 277 List the prime factors of 14	{ "pile_set_name": "DM Mathematics" }
)/i)/(i*9/ii)(((i(((i*(-2)/i)/i)/i)/i)/i)/ii)(-30) assuming i is positive. i(3247/19) Simplify ((l*0l)(3/25))(-42) assuming l is positive. l(-126/25) Simplify (y/y(1/9))/(yy/(y(-3/5)/y)yy)((y*7/y)/y)/yy/(((yyyy/(y/((yyy/y6y)/y)))/y)/yy)y assuming y is positive. y*(103/45) Simplify ((b/(bb/(bb(2/13))b))/(b/(bb(-1/7))))/(b(-1))48 assuming b is positive. b(4278/91) Simplify f42f/f33 assuming f is positive. f10 Simplify k*(-4)kk/(k/k(-4))k*(-6)kk(4/7) assuming k is positive. k(-80/7) Simplify ((d(2/3))(-12))(-49) assuming d is positive. d392 Simplify ((kk*1kk)/k)(-2)((k*(-2/13)k)/kk)/k(-2/11) assuming k is positive. k(-711/143) Simplify (i(-1)/ii)*(-29)/((ii(i/(iiii*(-1)i))/iii)/i)46 assuming i is positive. i29 Simplify k5/k(-2/17) assuming k is positive. k*(87/17) Simplify (((aa*(-2/7))/aa)(-3/25))(-6) assuming a is positive. a*(18/35) Simplify (vv/(v(-1)/v))(-50)/(v(1/6)/((v6/v)/v)) assuming v is positive. v(-1177/6) Simplify d27/(dddd/d(-4/11)) assuming d is positive. d(249/11) Simplify ((w4/w)/w(-2/17))(-35) assuming w is positive. w(-1855/17) Simplify (((yy(3/5))/y)22)(-3/35) assuming y is positive. y(-198/175) Simplify ((ss/(ss/((ss/s(2/17))/s)s)s)/(s/(s/(s(-5)sss))))36 assuming s is positive. s(1764/17) Simplify (g(1/5))(-10) assuming g is positive. g(-2) Simplify (m(1/4))*(-11/4)(mm(-3)/m)/(m/(mm(-4))) assuming m is positive. m(-123/16) Simplify (z/z(-1))31(zz1)(3/25) assuming z is positive. z(1556/25) Simplify (k(-12))(-20) assuming k is positive. k240 Simplify h*(-3)hh1/h(hh(-2/23))/((h/h10)/h) assuming h is positive. h(205/23) Simplify (u(6/5)u(-4)/u)/((u/u(-8))/u8) assuming u is positive. u(-24/5) Simplify w*9/ww20 assuming w is positive. w28 Simplify ((h7/h)/(h/((h/h(3/5)hh)/h)))15 assuming h is positive. h96 Simplify ((g/(gg(1/3)))/ggg(-1/2)g)/(g(-2))(-2/165) assuming g is positive. g(47/330) Simplify (k/((k(2/7)/k)/k))(5/6) assuming k is positive. k(95/42) Simplify (c2)22c6/c(-2/11) assuming c is positive. c(552/11) Simplify d(2/15)d(-5) assuming d is positive. d(-73/15) Simplify (f*(1/4)(ff(2/5))/f)/(ff(-2/7))(2/11) assuming f is positive. f(801/1540) Simplify (g(6/11)g)/gg(-2/5) assuming g is positive. g(8/55) Simplify (f*(-2/7)/ff(ff/f(-2/7))/f)/(f(-5)f(-2)) assuming f is positive. f8 Simplify (bb*(2/15)b*6)/(b/(bb/(b*(-3)b))b5) assuming b is positive. b(77/15) Simplify ((c(-1)/c)/c0)/(c/((((c(-1/6)cc)/ccc)/c)/c)cccc(-4)) assuming c is positive. c(-7/6) Simplify ((oo*(-1/3)/oo)/o)/o10 assuming o is positive. o(-31/3) Simplify ((ggg*(-3))/(gg(-1/5)))/((g/g(-1))/((g(-4)/g)/g)) assuming g is positive. g(-49/5) Simplify nn(-25)n*(1/3)n assuming n is positive. n(-68/3) Simplify (u(-1)/u)*(-30)((u/(u/(uu(-1))))/u)(-11/4) assuming u is positive. u(251/4) Simplify (bb/(b*(-2/5)b))*(-24)((b(1/11)/b)/b)/b(-8) assuming b is positive. b*(-1513/55) Simplify (p/(pp/((ppp*(-9))/p))p/(p/(p/(p/(ppp/((p*(2/5)p)/p))))))/(p(p(-6/5)/p)/ppp(-5/7)) assuming p is positive. p(-157/35) Simplify (((bb*(-9/5))/b)/bb(-2/7))(-8/9) assuming b is positive. b(96/35) Simplify ((i3i)/i(-4))/(i/(i(2/3)/i)i(-1/5)/i) assuming i is positive. i(118/15) Simplify (v15/(v5/v))(18/5) assuming v is positive. v(198/5) Simplify (u(-6)/u)/(u/((u/u6)/u))(uu*2u)(-2/49) assuming u is positive. u(-694/49) Simplify (x*(2/41)/x)/(x(x/x(-4/19))/x) assuming x is positive. x(-1684/779) Simplify (s*2s6)/(s/(s/s(2/3)))(-2/9) assuming s is positive. s(220/27) Simplify ((m/m(-1/46))/m)/m(-25) assuming m is positive. m*(1151/46) Simplify cc*(2/45)(c*35/cc)/c assuming c is positive. c(1577/45) Simplify ((x/(x/x(-2)))/(x*4/xx))/(x(-2/7))(-2/51) assuming x is positive. x(-2146/357) Simplify (u(1/5)u(u/((u/u*(2/3))/uu))/u)39 assuming u is positive. u(169/5) Simplify (s*(4/3)s*(-8)/s)/((s/((ss(-1))/s))/(s6/ss)) assuming s is positive. s(-11/3) Simplify (b(-20)/b(-4/17))(-2/59) assuming b is positive. b(672/1003) Simplify (k(-4)k14/k)(5/9) assuming k is positive. k5 Simplify (n(5/4)/nn/(nnn7/n))/(n/((n/(n/n(-1/5))n)/nnn)n(3/10)) assuming n is positive. n(-25/4) Simplify ((r(-9)/r)/r10)/(rr/((rr1)/r)rrrrrr(-10)rr) assuming r is positive. r(-18) Simplify (iii(-2/13)/i)/i(-2)i*(-6/11)ii(-4)/i assuming i is positive. i(-243/143) Simplify (z(-7)/(z(-7/6)zz))28 assuming z is positive. z(-658/3) Simplify (m(-6)m)/m*(-2)(mm/m(-1/2))(-2/61) assuming m is positive. m(-188/61) Simplify (g/g(11/4))(-38) assuming g is positive. g(133/2) Simplify ((((gg*(-1/4))/g)/g)/gg)*(-14)(g(g(2/19)/g)/g)/(gg/(gg1/g)) assuming g is positive. g(593/38) Simplify ((q/(qq*0qq)q)/(q/(q/(q/(q*(1/14)/q)q))))/((q/(qq(1/2)))/(q/(q(-3/2)/q))) assuming q is positive. q(1/14) Simplify ((a/(a(-11)/a))/aa(aa8)/a)(11/3) assuming a is positive. a*77 Simplify zz*(-8/5)zz/z3z assuming z is positive. z(-3/5) Simplify x(-24)/(x/(x*(-3/10)x)) assuming x is positive. x*(-243/10) Simplify (vv(-2/35))(-1) assuming v is positive. v(-33/35) Simplify (((a(-2/15)aa)/a)/aa)(-2/7) assuming a is positive. a(-26/105) Simplify (k/((k(kk0k)/kk)/k))/(((kk*(1/4))/k)/kk)(k/k(-2/7))(-1/7) assuming k is positive. k(-281/196) Simplify (q(1/3))(-11)(q(-1/4)/q)(-1/7) assuming q is positive. q*(-293/84) Simplify ((cc/c*(2/7)c)/c(5/2))/((c/c(1/4))/c(-3)) assuming c is positive. c(-99/28) Simplify ((s*(-3/5)s)/(s(s/(s/(s/s10)s))/ss))/(s(-6)s1) assuming s is positive. s(72/5) Simplify (n(-2/5))(-23) assuming n is positive. n(46/5) Simplify (c(4/3))(-6) assuming c is positive. c(-8) Simplify (u/(uuu(uu/(u/u*1)u)/u))*(-4)/(uu*0/uu)(1/2) assuming u is positive. u(31/2) Simplify f/((f*(-1/2)/f)/ff)f/(f(-3/10)/f)f(f/((f(fff*(-1))/ff)/f))(2/67) assuming f is positive. f(29/5) Simplify (o*13o)/oo(-4/5)/o assuming o is positive. o(56/5) Simplify (oo/(o(o/(o/o(-1/4)))/oo))*(4/11)/(oo/(o*(-2)/o)o(oo(-2/5))/o) assuming o is positive. o(-283/55) Simplify (p*21ppppp/p(14/9))19 assuming p is positive. p(4180/9) Simplify ((a(-4/9)/a)/(a(aa(-4)/a)/a))(-1/6) assuming a is positive. a*(-23/54) Simplify ((jj/(jj/(jj*0)jj))/j)(1/3) assuming j is positive. j(-2/3) Simplify ((w(-1/5)/w)/w(7/2))/((w/w(-1/2))/((w/(w/w0))/w)) assuming w is positive. w(-36/5) Simplify (g(-1/4))(-1/2)(gg(2/3)/gg)(3/41) assuming g is positive. g(81/328) Simplify (f/(ff(-4))f/(ff(-1/7)))/(f/(((f(-2)f)/ff)/f))14 assuming f is positive. f(-265/7) Simplify ((dd(3/2))(-2/5))(15/4) assuming d is positive. d(-15/4) Simplify ((((o/(((o/o*(-2/11))/o)/o))/o)/oo)(27/4))(-2/97) assuming o is positive. o(-243/2134) Simplify (u(-2/9)u(-19)/u)48 assuming u is positive. u(-2912/3) Simplify ((sss(1/5))/(s/(s/(s3/s))s))31 assuming s is positive. s(-124/5) Simplify (z13/z)/(z(-1/20)z) assuming z is positive. z(221/20) Simplify ((u/(u/u(3/4)u))/(u/u*9))/(uuuu*(-9)uuu(-1/9)) assuming u is positive. u(427/36) Simplify (u*(2/3)/(uu*4u))(1/24) assuming u is positive. u(-2/9) Simplify m/m*3m*(-2/9)(mmm/((mm/(m6/m))/m))/(m/m(-5)) assuming m is positive. m(-11/9) Simplify (((qq(-3/5))/q)/(q/q2))/((qq(-2/15))/(qq(-4/5))) assuming q is positive. q(-4/15) Simplify (p(-4/5)/p(1/4))(-23) assuming p is positive. p(483/20) Simplify m/m*(2/167)m/(m/(mm16)) assuming m is positive. m(3004/167) Simplify ((aa(1/4))/((a10/a)/a))(2/29) assuming a is positive. a(-27/58) Simplify (tt(-2/13)t(1/7))(-7) assuming t is positive. t*(-90/13) Simplify (s/(ss/(s*(-1/3)s)))**(-1/	{ "pile_set_name": "DM Mathematics" }
and -149/24? 168 Suppose 20 = 5m, 4m - 46 + 15 = -5t. Suppose -2i = ti. Suppose i = -6v + 3v + 27. Calculate the lowest common multiple of v and 10. 90 Let s(p) = -p3 + 3p*2 + 3p - 4. Let g be s(5). Calculate the common denominator of 1/(-3) + (-3608)/(-1230) and (-24)/(-22)g/9. 55 Let o be (-7 + 1)(-16)/48. Suppose c + k + 25 = oc, -4c + 55 = 5k. Calculate the smallest common multiple of 125/c - 1/4 and 2. 6 Suppose -2k + k = 5f, -3f = -3k + 36. Let c be (-20)/6(-18)/k. Suppose 5n = cn - 4. Calculate the lowest common multiple of n and 11. 44 Let q(a) = 21a - 239. What is the least common multiple of 16 and q(17)? 944 Let k = 4749/506 + -288/23. Let j(a) = -664a - 21. Let t be j(7). Let n = t - -46731/10. Find the common denominator of k and n. 110 Suppose 11i - 30 = 5i. Suppose 4h - 3a = 42, 2a + i = h - 3. What is the lowest common multiple of h and 4? 12 Let l = -5 + 9. Suppose 3o = 7o + l. What is the lowest common multiple of 2 and (13 - o)30/35? 12 Let b = 36/29 - -63/580. Suppose 5j + 3 - 8 = 0. What is the common denominator of b and (-381)/18j - 0? 60 Suppose 3t + 3720 = 27t. Calculate the least common multiple of 45 and t. 1395 Suppose -4v + 393 + 71 = 0. Suppose d + v = 5j, 4j - 2d = -3d + 100. Calculate the lowest common multiple of 24 and j. 24 Let b = -35697/25 + 1428. Find the common denominator of 24/125 and b. 125 Suppose r + 0r = -4i - 44, -r - i = 50. Let w = -20 - r. Suppose 0 = -0d - 4d + w. What is the smallest common multiple of d and 3? 24 Let t = 4250835486563/1040 + -4087357480. Let l = t - -15666. Let x = 37419/7280 + l. Calculate the common denominator of x and 13/9. 63 Let v(b) = -2b*2 + 35b. Calculate the smallest common multiple of 14 and v(16). 336 Let c(l) = -5l3 + 12l*2 - 12l + 1. Let n be c(-10). Let b = -2929/6 - -6790. Let s = b - n. Calculate the common denominator of 17/12 and s. 12 Calculate the common denominator of -37/3 and (-1266)/(-10234) + 104/(-728). 2193 Let m = -225 + -17. Find the common denominator of (66/m)/((-6)/(-76)) and -47/4. 44 Let l(s) = s*3. Let d be l(0). Suppose 33 = -dt + 3t. Calculate the least common multiple of 9 and t. 99 Let t(b) = -b2 - 4b + 4. Let o be t(-4). Let x(z) = -z*2 + 7z - 3. Let c be x(o). Calculate the smallest common multiple of (-6)/(-4)24/c and 20. 20 Let i be (1 - -1)/(2/20). Suppose -4s - i = -7s - 4m, -52 = -5s - 2m. What is the lowest common multiple of ((-6)/(-5))/(14/(-10) + (-6656)/(-4480)) and s? 84 Suppose -5f + 200 = -4k, f = 7k - 4k + 29. What is the smallest common multiple of f and 66? 132 Let r(w) = w + 2. Suppose a = 2b - 3, 0 = -2a - 3a + 2b - 55. Let u = a + 22. Calculate the smallest common multiple of u and r(4). 18 Let v = -903 + -21. Let j be (-3149214)/v - 2/7. Let b = 3403 - j. Find the common denominator of b and 29/6. 66 Suppose -708 + 36 = -16k. Calculate the lowest common multiple of 50 and k. 1050 Let n = 1128 - 18043/16. What is the common denominator of n and 5/388? 1552 Suppose -2n - 42 = -u - 124, -3u = n + 260. What is the lowest common multiple of u/(-18) - 10/135-3 and 21? 105 Let z(u) = -57u2 + 2u - 1. Let f be z(2). Calculate the least common multiple of 8 and ((-90)/f)/((-46)/(-45) - 1). 72 Suppose 9 = 3f - 9. What is the lowest common multiple of 31/1 - 8/2 and f? 54 Calculate the common denominator of -18 and (-7)/(147/(-6)) + (-558)/(-105). 5 Let k = 174 + -168. Let n = 59 + -41. What is the smallest common multiple of 1 + 1/(-1) + n and k? 18 Suppose 3m - 38 = 43. Suppose -2t + 5c - 4c = m, 3c - 33 = 2t. Let g = 10 - t. Calculate the lowest common multiple of g and 24. 264 Let a be (52749/12)/((-60)/32). Let j = -2337 - a. Find the common denominator of (2/(-12))/(4/(-297)) and j. 40 Let y = -1/1036 + 46103/1036. Find the common denominator of y and (0 + -7)/((-9)/(-5)). 18 Calculate the common denominator of (5/(-15) - -1)(-141)/126 and 85/6. 126 Calculate the common denominator of -6 - ((-245)/20 + -5) and -61/6. 12 Let t(w) = -w + 6. Let a be t(-6). Let b = 269/14 - 5/7. What is the common denominator of b and a/(-36)306/40? 20 Let x = -13 + 16. Let l be 12/(x - (-35)/(-15)). Calculate the least common multiple of 20 and 14/63 - (-284)/l. 80 Let c = -4720 + 47321/10. Find the common denominator of (-26)/56(-4 + 2) and c. 70 Let i(j) = -j*3 - 13j*2 - 12j + 9. Calculate the least common multiple of (-444)/(-18) - 6/9 and i(-12). 72 Let d = -70 - -21. Calculate the common denominator of -81/4 and ((-468)/(-98))/(28/d). 28 Let b(o) = -o*2 + 6o - 1. Let q be b(4). Let k = q + -5. Let p(z) = -2z2 - 31z + 7. Calculate the lowest common multiple of k and p(-15). 22 Let y = -1 - -4. Let l = -7566 - -7582. Calculate the least common multiple of (-7)/y6/(-1) and l. 112 Let n be 2(-7053)/22608 - 2. Let r = -1/942 + n. What is the common denominator of r and -75/8? 8 Let a be (-44)/(1/2). Let n be (-277534)/a + 6 + -5. Let v = n + -8669. Find the common denominator of 3/10 and v. 80 Suppose 471 + 285 = 28m. Calculate the lowest common multiple of m and 51. 459 Suppose 2g + l - 165 = 0, 5g - 2g - 255 = -3l. Let m = g + -76. What is the least common multiple of m and 60? 60 Suppose 48 = q + 3n, 0 = -5q + n + 176. What is the smallest common multiple of q and 60? 180 Calculate the lowest common multiple of (112/(-21) - -2)-12 and 88. 440 Let q(g) = 3g*2 + 19g + 50. Let s be q(-9). Let n = 105 - s. Find the common denominator of n and 47/14. 14 Find the common denominator of -1 - 66/9(-1)/(-42) and -23/54. 378 Suppose -2n - 2n = 24. Let y be ((-16)/n)/((-10)/(-15)). Suppose 0 = -z - 4k + 3k, -5z + yk = -18. What is the smallest common multiple of z and 4? 4 Let y(q) = -5q*2 - 4q - 3. Let b be y(-4). Calculate the common denominator of 1 - 1b/2 and 4/12(-70)/4. 6 What is the common denominator of -25/3 and 12/(-29)(-6 - -4)/2? 87 Let w = 211733 + -103537399/489. Find the common denominator of -97/24 and w. 3912 Let u = 9 - 7. Let z = 0 + u. What is the smallest common multiple of 5 and 1(z + 6 + -1)? 35 Let b = -1038 + 2023/2. What is the common denominator of (-44)/(-6) - (-2)/(-3) and b? 6 Let y = -17849 - -4265896/239. Let k = -168835953866/35929246903 - 28/13666507. Let g = y - k. What is the common denominator of g and 73/6? 66 Let n be -13 - 2 - 0/(-4). Let j = 17 + n. Suppose -y + jy - 2 = 0. What is the least common multiple of y and 6? 6 Calculate the least common multiple of -518/(-5) and 17. 136 Let x(l) = 3l - 3. Let i(w) = w*2 - 5w - 6. Let z be i(6). Suppose -3t - 2 + 11 = z. What is the least common multiple of x(2) and t? 3 Suppose -556 = -0l - 4l. Find the common denominator of ((-738)/(-225))/(4/5) and (2 + l/(-44))2. 110 Find the common denominator of -11 - 610/(-48) - 8 and -125/24. 24 Suppose -2f + 0f + 11 = -3b, 0 = 4f + 4b - 12. What is the lowest common multiple of 183/2 + f + -7 and 33? 264 Suppose -3w - h = -7, -4 - 3 = -w - 5h. Calculate the lowest common multiple of w and 50. 50 What is the common denominator of (-6(-133)/63)/((-8)/(-7)) and 5/2? 12 Let u(m) = -2m - 3. Let v be u(-7). Let a = 27 - v. Let y(o) = 3o3 - 118o*2 + 41o - 56. What is the least common multiple of y(39) and a? 176 Suppose 60j - 1248 = 44j. Calculate the lowest common multiple of j and 22. 858 Let w = 2542 + -17827/7. Let r = 497/33 - 140/11. What is the common denominator of r and w? 21 Let x = -83 - -85. Suppose 0 = -xn + 37 - 7. Calculate the lowest common multiple of 9 and n. 45 Let t(m) = 30m*2 - 59m + 1. Calculate the lowest common multiple of 690 and t(2). 690 Let s be 36/1182(-2)/282. Let y = -31980596/46295 - s. Let c = -688 - y. Find the common denominator of -49/3 and c. 15 Let m be (-3)/(-15) - (-1821111)/160020. Let i be 513/(-1778) - (-2)/7. Let l = i - m. Find the common denominator of l and -22/5. 60 Let d = -156821/3690 + -2/1845. Find the common denominator of 35/4470/(-25) and d. 22 Let v = 13 - 1. Find the common denominator of (2/4)/((-10)/v) and -5/6. 30 Let n(s) = -s + 10. Let r(c) be the third derivative of -c*4/12 - 2c*3/3 + 7c**2. Let p be r(-4). What is the lowest common multiple of 2 and n(p)? 6 Calculate the common denominator of	{ "pile_set_name": "DM Mathematics" }
utes after 1:09 AM? 4:02 AM How many minutes are there between 9:52 AM and 10:04 AM? 12 How many minutes are there between 1:51 AM and 12:16 PM? 625 How many minutes are there between 7:26 AM and 11:26 AM? 240 How many minutes are there between 6:15 PM and 8:40 PM? 145 How many minutes are there between 10:24 AM and 11:15 AM? 51 What is 688 minutes after 9:12 AM? 8:40 PM How many minutes are there between 5:26 AM and 5:16 PM? 710 What is 204 minutes before 12:34 AM? 9:10 PM How many minutes are there between 5:12 PM and 9:38 PM? 266 How many minutes are there between 8:18 PM and 5:46 AM? 568 What is 51 minutes after 10:17 AM? 11:08 AM How many minutes are there between 10:45 PM and 7:29 AM? 524 How many minutes are there between 6:48 PM and 6:59 PM? 11 What is 682 minutes after 3:39 PM? 3:01 AM What is 27 minutes after 3:42 PM? 4:09 PM How many minutes are there between 7:51 PM and 6:19 AM? 628 How many minutes are there between 8:54 PM and 2:12 AM? 318 How many minutes are there between 1:59 AM and 6:42 AM? 283 What is 505 minutes after 12:39 PM? 9:04 PM What is 175 minutes before 6:48 PM? 3:53 PM How many minutes are there between 4:33 PM and 9:56 PM? 323 How many minutes are there between 4:48 AM and 11:34 AM? 406 What is 618 minutes after 2:25 AM? 12:43 PM What is 60 minutes before 5:51 PM? 4:51 PM How many minutes are there between 6:56 PM and 5:59 AM? 663 How many minutes are there between 7:08 AM and 6:00 PM? 652 How many minutes are there between 7:40 AM and 8:43 AM? 63 What is 386 minutes after 6:46 AM? 1:12 PM What is 60 minutes before 4:06 AM? 3:06 AM How many minutes are there between 12:35 PM and 11:37 PM? 662 What is 699 minutes after 10:54 PM? 10:33 AM How many minutes are there between 5:11 AM and 10:14 AM? 303 How many minutes are there between 12:51 PM and 2:46 PM? 115 How many minutes are there between 5:05 PM and 4:00 AM? 655 What is 353 minutes after 9:48 AM? 3:41 PM How many minutes are there between 2:59 AM and 2:00 PM? 661 How many minutes are there between 3:44 PM and 11:27 PM? 463 How many minutes are there between 3:05 AM and 2:25 PM? 680 What is 35 minutes after 5:30 PM? 6:05 PM How many minutes are there between 3:48 PM and 1:58 AM? 610 How many minutes are there between 11:11 AM and 12:49 PM? 98 What is 10 minutes before 8:55 AM? 8:45 AM What is 445 minutes after 4:56 AM? 12:21 PM What is 514 minutes after 12:32 AM? 9:06 AM What is 547 minutes after 2:10 PM? 11:17 PM How many minutes are there between 3:25 AM and 2:01 PM? 636 How many minutes are there between 1:51 AM and 8:25 AM? 394 How many minutes are there between 8:31 PM and 9:22 PM? 51 What is 687 minutes after 5:57 PM? 5:24 AM How many minutes are there between 4:31 AM and 3:10 PM? 639 How many minutes are there between 4:03 PM and 5:33 PM? 90 What is 446 minutes before 7:57 PM? 12:31 PM How many minutes are there between 5:04 AM and 5:31 AM? 27 How many minutes are there between 11:04 PM and 6:16 AM? 432 What is 504 minutes before 6:27 PM? 10:03 AM How many minutes are there between 8:37 PM and 11:09 PM? 152 How many minutes are there between 3:39 AM and 2:18 PM? 639 What is 204 minutes after 2:51 AM? 6:15 AM How many minutes are there between 10:49 AM and 8:38 PM? 589 What is 404 minutes before 1:25 AM? 6:41 PM How many minutes are there between 4:31 AM and 8:55 AM? 264 How many minutes are there between 12:04 AM and 5:57 AM? 353 How many minutes are there between 10:21 PM and 8:45 AM? 624 What is 456 minutes after 2:26 AM? 10:02 AM What is 524 minutes after 1:14 PM? 9:58 PM How many minutes are there between 12:58 AM and 10:49 AM? 591 How many minutes are there between 10:23 PM and 7:29 AM? 546 What is 618 minutes before 8:45 AM? 10:27 PM How many minutes are there between 5:06 AM and 9:20 AM? 254 What is 386 minutes after 4:01 AM? 10:27 AM How many minutes are there between 12:54 PM and 10:49 PM? 595 What is 277 minutes before 5:21 AM? 12:44 AM What is 77 minutes before 4:24 PM? 3:07 PM How many minutes are there between 9:15 AM and 6:01 PM? 526 What is 560 minutes after 3:55 AM? 1:15 PM How many minutes are there between 6:17 PM and 7:09 PM? 52 How many minutes are there between 9:27 AM and 2:29 PM? 302 How many minutes are there between 2:45 PM and 5:00 PM? 135 How many minutes are there between 2:27 AM and 3:02 AM? 35 What is 62 minutes after 12:58 AM? 2:00 AM How many minutes are there between 9:22 AM and 5:59 PM? 517 How many minutes are there between 6:49 PM and 9:45 PM? 176 How many minutes are there between 10:42 AM and 9:25 PM? 643 How many minutes are there between 2:26 AM and 3:16 AM? 50 How many minutes are there between 4:35 AM and 3:11 PM? 636 How many minutes are there between 7:52 PM and 6:57 AM? 665 How many minutes are there between 5:05 AM and 7:41 AM? 156 How many minutes are there between 6:04 PM and 8:42 PM? 158 What is 353 minutes after 6:07 PM? 12:00 AM What is 166 minutes before 10:46 PM? 8:00 PM What is 526 minutes after 10:21 PM? 7:07 AM What is 454 minutes before 3:05 AM? 7:31 PM How many minutes are there between 2:08 PM and 9:42 PM? 454 What is 264 minutes after 11:25 PM? 3:49 AM What is 320 minutes before 2:35 AM? 9:15 PM What is 325 minutes after 6:06 AM? 11:31 AM How many minutes are there between 7:20 PM and 10:49 PM? 209 What is 324 minutes after 6:48 PM? 12:12 AM What is 399 minutes after 9:12 AM? 3:51 PM How many minutes are there between 2:55 AM and 12:41 PM? 586 How many minutes are there between 6:37 PM and 6:57 PM? 20 How many minutes are there between 2:49 PM and 11:05 PM? 496 How many minutes are there between 11:44 PM and 6:40 AM? 416 What is 456 minutes before 7:40 AM? 12:04 AM How many minutes are there between 11:35 AM and 10:47 PM? 672 What is 709 minutes before 7:02 AM? 7:13 PM How many minutes are there between 4:46 AM and 8:52 AM? 246 What is 634 minutes after 5:15 AM? 3:49 PM How many minutes are there between 8:55 PM and 6:23 AM? 568 How many minutes are there between 10:29 PM and 8:39 AM? 610 What is 681 minutes before 10:38 AM? 11:17 PM What is 289 minutes before 7:16 AM? 2:27 AM How many minutes are there between 1:48 PM and 12:06 AM? 618 How many minutes are there between 6:48 PM and 7:15 PM? 27 What is 366 minutes after 5:56 PM? 12:02 AM What is 328 minutes after 6:01 AM? 11:29 AM What is 90 minutes after 12:53 AM? 2:23 AM How many minutes are there between 6:53 PM and 8:53 PM? 120 How many minutes are there between 10:45 PM and 12:40 AM? 115 What is 664 minutes before 10:29 AM? 11:25 PM How many minutes are there between 4:26 PM and 2:23 AM? 597 How many minutes are there between 1:09 AM and 4:33 AM? 204 How many minutes are there between 12:32 PM and 12:01 AM? 689 What is 400 minutes after 5:46 PM? 12:26 AM How many minutes are there between 1:58 PM and 3:28 PM? 90 How many minutes are there between 9:04 AM and 8:34 PM? 690 What is 27 minutes before 9:03 AM? 8:36 AM What is 126 minutes before 3:22 AM? 1:16 AM How many minutes are there between 1:27 PM and 9:37 PM? 490 What is 252 minutes after 10:44 PM? 2:56 AM How many minutes are there between 4:06 PM and 10:34 PM? 388 What is 141 minutes before 9:32 AM? 7:11 AM How many minutes are there between 1:20 PM and 2:11 PM? 51 How many minutes are there between 12:18 AM and 4:24 AM? 246 What is 27 minutes before 3:09 PM? 2:42 PM How many minutes are there between 6:24 AM and 2:52 PM? 508 What is 444 minutes before 12:04 PM? 4:40 AM What is 597 minutes before 11:17 PM? 1:20 PM How many minutes are there between 10:30 PM and 4:37 AM? 367 How many minutes are there between 4:02 PM and 11:01 PM? 419 What is 324 minutes before 8:40 PM? 3:16 PM How many minutes are there between 8:55 AM and 10:50 AM? 115 How many minutes are there between 5:35 PM and 1:48 AM? 493 How many minutes are there between 9:20 PM and 6:56 AM? 576 What is 255 minutes after 8:40 PM? 12:55 AM How many minutes are there between 3:30 AM and 4:32 AM? 62 What is 236 minutes before 4:51 AM? 12:55 AM What is 458 minutes before 5:27 AM? 9:49 PM How many minutes are there between 10:59 AM and 5:44 PM? 405 What is 291 minutes before 9:20 AM? 4:29 AM How many minutes are there between 4:49 PM and 12:13 AM? 444 How many minutes are there between 8:43 PM and 11:22 PM? 159 How many minutes	{ "pile_set_name": "DM Mathematics" }
(-8)bb16b)(-38) assuming b is positive. b(-380) Simplify (i(i(i/(((i/i*37i)/i)/ii))/i)/i)/i30 assuming i is positive. i7 Simplify (h(-2/3))(-13) assuming h is positive. h(26/3) Simplify (m/(m36/m))/(m(3/10)m) assuming m is positive. m(-353/10) Simplify r/(r1/r)r(-9)(r(3/4))(-2) assuming r is positive. r*(-19/2) Simplify (ii(i16i)/i)/(i/i(-7/6)) assuming i is positive. i(95/6) Simplify (k2)(-1/18)(k(kk(kk((k/k*(3/2))/k)/kk)/k)/k)/kk/(kk(-9)) assuming k is positive. k(169/18) Simplify (y*(-7)/((yy3)/y))(9/7) assuming y is positive. y*(-90/7) Simplify (rr*(1/2)r)28/((r(2/13)/r)/r(1/6)) assuming r is positive. r(5539/78) Simplify (t/(t*(4/9)/t)t)/ttt(-26) assuming t is positive. t(-211/9) Simplify (nnn*(10/7)nn)/n(n/(nn(nn(-15))/nnnn))/n assuming n is positive. n(101/7) Simplify ((t(2/9))(-1/14))(-27) assuming t is positive. t(3/7) Simplify ((b3b)/b)/bb(1/2) assuming b is positive. b(5/2) Simplify (i/i11)45 assuming i is positive. i(-450) Simplify (x(3/7)/xxx(-3/10))(-5) assuming x is positive. x(-9/14) Simplify m(4/5)m(-9/7) assuming m is positive. m(-17/35) Simplify w(4/5)/www(-5)(ww5/w)/((w(-4)/ww)/w) assuming w is positive. w(29/5) Simplify k25/(k/(k*19k)) assuming k is positive. k*44 Simplify (cc*(4/3)c/c(-3))/(c6/(c/(c/c(2/21)))) assuming c is positive. c(3/7) Simplify (v*(-1/5)vv(-6))/(v/v2)(-23) assuming v is positive. v(-141/5) Simplify ((r(-32)/r)/r)3 assuming r is positive. r(-102) Simplify (r(r/r*(-2/33)r)/rr)/r17 assuming r is positive. r(-460/33) Simplify (f1ff)(29/3)/(f1)(-20/3) assuming f is positive. f(107/3) Simplify (j/(jj*1j))*(-15)(jjjj(3/8))/(jjjjj3jj) assuming j is positive. j(195/8) Simplify ((r/r(-10))/r3)(-2/53) assuming r is positive. r(-16/53) Simplify (j(-1/4))9(j(-1/5))(3/14) assuming j is positive. j*(-321/140) Simplify (i/(ii/(i/i*1))ii(-3))/(i/i(-1/4)i)(4/5) assuming i is positive. i(-24/5) Simplify o*(4/3)/(o/(o/((o(((oo(-2/5)o)/o)/o)/o)/o)))o4/(oo/((o/(o/(o/(oo(-1/2))))o)/oo)) assuming o is positive. o(187/30) Simplify (u/((u((uu33)/uuu)/u)/uu))/(uu(2/9)) assuming u is positive. u(-317/9) Simplify m/(m(-9)m)(m(11/2)m)/m assuming m is positive. m(29/2) Simplify (t(-2/5))(-9)/(t/(t/t(-2))t(1/11)/t) assuming t is positive. t(358/55) Simplify (h(4/5))(-7/3) assuming h is positive. h(-28/15) Simplify l(4/17)/((l(-7)l)/l) assuming l is positive. l(123/17) Simplify (n(-18))(-24/11) assuming n is positive. n(432/11) Simplify (bb(2/7)/bbb13bb)(-43) assuming b is positive. b(-4902/7) Simplify (g(3/7)g(1/9))(-1/4) assuming g is positive. g(-17/126) Simplify o(1/3)(o(-8)/o)/o assuming o is positive. o(-29/3) Simplify w3w(w/(ww/(ww(4/7)w)))/www2/w(-5) assuming w is positive. w(88/7) Simplify (s(-19)s)/(s/(ss*3)s) assuming s is positive. s(-16) Simplify ((d/d0)/d)*(4/11)(d(-1))(-4) assuming d is positive. d4 Simplify (a10/aaaaa(a/a(1/10))/a)/((a/(aa/(a/(aaa*(1/13)))))/aa/(a/((aa2/aa)/a))) assuming a is positive. a(1817/130) Simplify ((o(2/25)o)/o)/(o/(o(-26/3)o)) assuming o is positive. o*(-644/75) Simplify (ss*5s)12 assuming s is positive. s84 Simplify x*(-1/3)/xx*(3/5)(((x/(x/(x(-1)/x)))/x)/x)(2/11) assuming x is positive. x*(-241/165) Simplify h/((h/(h(h/h*(-25/2))/hhh))/h)(h*(-7/3)h)/h assuming h is positive. h(85/6) Simplify z(2/65)/(zz/(z/(z(-18/5)z)z)) assuming z is positive. z(171/65) Simplify aa*(-1/7)aaa/(a/(aaa*7)a)aa/((a/a*(2/19))/a)a(2/17) assuming a is positive. a(29574/2261) Simplify ss/(s/s(-8/9))((s/s(1/2))/s)/s assuming s is positive. s(-25/18) Simplify (bbb*9bb)/b(-34) assuming b is positive. b47 Simplify (a(3/2)/a(-1/19))(-1/58) assuming a is positive. a(-59/2204) Simplify ((l2)(-2/57))19 assuming l is positive. l(-4/3) Simplify hh(hhh(2/5)/hh)/hhhhh*7h assuming h is positive. h(72/5) Simplify (f(-6/13)ff*(-1/21)/ff)(-17) assuming f is positive. f(-2278/273) Simplify ((p/(p*(-1)pp))/p)19(pp(-4/7))/p1 assuming p is positive. p(-137/7) Simplify ((rr(-2))(11/2))(-24/11) assuming r is positive. r12 Simplify (((w/w*10)/w)/(ww((ww/w(-3/8))/w)/w))(-3/8) assuming w is positive. w(297/64) Simplify (r/(r(5/3)/r))(-32) assuming r is positive. r(-32/3) Simplify (j(5/4)/j(4/7))(-12) assuming j is positive. j(-57/7) Simplify (c(2/3)/(c9/c))(-3/20) assuming c is positive. c(11/10) Simplify (a*(2/11)a*(-2)a)/(a(-1))(-2/35) assuming a is positive. a*(-337/385) Simplify (f/(ff0))/f(1/8) assuming f is positive. f(-1/8) Simplify (s/s(1/3))*(-2/37)/((s((s/(s*(3/4)/s))/s)/s)/(ss*(2/9)ss)) assuming s is positive. s(3911/1332) Simplify ((ii*(-12/7)i)/(i/((i(-7)/i)/i)))(2/103) assuming i is positive. i(-136/721) Simplify (((u(-1)/u)/uu)(-8/9))(-30) assuming u is positive. u(-160/3) Simplify (a(1/5))(-21)/(aa1)(30/11) assuming a is positive. a*(-531/55) Simplify ((vv(-2/9))/(v/(v4v)v))/(v(3/7)/v8) assuming v is positive. v(715/63) Simplify n(-2/53)/n16 assuming n is positive. n(-850/53) Simplify (x/((xxx((x(-7)/x)/xxx)/xx)/xx))/(x/((((xxx(-1/4))/x)/x)/x))(x1)(-37) assuming x is positive. x(-137/4) Simplify (x/(x(-6/19)x))(43/4) assuming x is positive. x(129/38) Simplify s/(s/(ss*1))ss19s assuming s is positive. s23 Simplify (w0)(-35)/(w(-1/2))(-3/5) assuming w is positive. w(-3/10) Simplify (c*(7/3)c)5 assuming c is positive. c(50/3) Simplify (ww/w(2/11)w)/ww(2/103) assuming w is positive. w(2082/1133) Simplify (m/(mm/m*4)m/(m*(2/5)mmmm)mm)(1/2) assuming m is positive. m(4/5) Simplify (i/i0)(-2/9)(iii*(-1/4)ii)/ii/((i*(5/6)/i)/ii) assuming i is positive. i(133/36) Simplify (r2)(-10/9)/(r(-2/5)r(2/9)) assuming r is positive. r(-92/45) Simplify (q/q(4/17))(12/7) assuming q is positive. q(156/119) Simplify c(6/5)/(c/c(-32)) assuming c is positive. c(-159/5) Simplify (k39/k)/((k(-3/37)/k)/k) assuming k is positive. k(1483/37) Simplify (f(-7))(-2/201) assuming f is positive. f(14/201) Simplify ((m(m23/m)/m)/m)/m(1/4) assuming m is positive. m*(83/4) Simplify (a/(aa(2/7)))/(a/a(4/7))(a/(aa/(a/(a*1a))a))(-43) assuming a is positive. a(898/7) Simplify (x/(x5/x)x((xxx/((xx*1x)/x))/x)/x)(-3/4) assuming x is positive. x(9/4) Simplify a*(2/19)/(aa(-33)) assuming a is positive. a(610/19) Simplify c*(1/23)cc(-11) assuming c is positive. c(-229/23) Simplify ((uu(1/5))/u)/u(-2/5)(((uu/u*6uuu)/u)/uu)/((uu/((u(u(1/4)/u)/u)/u))/u) assuming u is positive. u(-83/20) Simplify (b(-1))(-2/147)/(b(-8)/bb(-1)) assuming b is positive. b(1472/147) Simplify (w/(w*(8/3)/w))/wwww*45w assuming w is positive. w(139/3) Simplify (k(-2/7))(22/5)/(k(-2))(-2/147) assuming k is positive. k(-944/735) Simplify (aaa/(aa/a(2/3)))(-16)(a/(a/(aa(-2/5))a))/a6 assuming a is positive. a(-496/15) Simplify (k*(-6/7)k0)(-29) assuming k is positive. k*(174/7) Simplify (kk*(-32)/k)/kkk(3/2) assuming k is positive. k(-61/2) Simplify ((k(-4))(-11/3))(-43) assuming k is positive. k(-1892/3) Simplify (u/((uu(uu(u(uu/u(-32))/u)/uuuu)/u)/u))/(u/(u*26u)) assuming u is positive. u(-11) Simplify ((p(3/7)pp)/ppp(-9))/(p(2/13)/p(-5)) assuming p is positive. p(-1067/91) Simplify (h/h7)(-2/81) assuming h is positive. h(4/27) Simplify g(-5/6)/g(-23) assuming g is positive. g(133/6) Simplify rr(-1/3)(r*(-2/9)/r)/rrr(-3)/rrr(1/2) assuming r is positive. r(-55/18) Simplify a22a(-13/3) assuming a is positive. a(53/3) Simplify (t*(-3/5)/tt(-6))/(t/(t/(t/(t/(t(-2)/tt))))tt/t2) assuming t is positive. t*(-28/5) Simplify (	{ "pile_set_name": "DM Mathematics" }
nearest integer? 11 What is the square root of 114380 to the nearest integer? 338 What is the seventh root of 570016 to the nearest integer? 7 What is the square root of 1052987 to the nearest integer? 1026 What is the third root of 20321893 to the nearest integer? 273 What is the third root of 391571 to the nearest integer? 73 What is the sixth root of 9333787 to the nearest integer? 15 What is the ninth root of 2524577 to the nearest integer? 5 What is 3624540 to the power of 1/2, to the nearest integer? 1904 What is 6064914 to the power of 1/6, to the nearest integer? 14 What is the third root of 3042442 to the nearest integer? 145 What is 312151 to the power of 1/3, to the nearest integer? 68 What is the ninth root of 146993 to the nearest integer? 4 What is the square root of 1803375 to the nearest integer? 1343 What is 3175953 to the power of 1/2, to the nearest integer? 1782 What is the third root of 399653 to the nearest integer? 74 What is the fourth root of 3053290 to the nearest integer? 42 What is 2162471 to the power of 1/6, to the nearest integer? 11 What is 469458 to the power of 1/3, to the nearest integer? 78 What is the third root of 1929410 to the nearest integer? 124 What is the fifth root of 274541 to the nearest integer? 12 What is the cube root of 247358 to the nearest integer? 63 What is 7896228 to the power of 1/2, to the nearest integer? 2810 What is the cube root of 1363183 to the nearest integer? 111 What is 3276015 to the power of 1/9, to the nearest integer? 5 What is the third root of 612678 to the nearest integer? 85 What is 1166751 to the power of 1/2, to the nearest integer? 1080 What is the ninth root of 801329 to the nearest integer? 5 What is 28979 to the power of 1/4, to the nearest integer? 13 What is the square root of 21240004 to the nearest integer? 4609 What is the cube root of 981394 to the nearest integer? 99 What is the eighth root of 1493101 to the nearest integer? 6 What is 20477058 to the power of 1/2, to the nearest integer? 4525 What is the tenth root of 366405 to the nearest integer? 4 What is the ninth root of 2809018 to the nearest integer? 5 What is the square root of 65679 to the nearest integer? 256 What is the fourth root of 486858 to the nearest integer? 26 What is the square root of 2165282 to the nearest integer? 1471 What is the fifth root of 322961 to the nearest integer? 13 What is the square root of 3137553 to the nearest integer? 1771 What is the fourth root of 3038346 to the nearest integer? 42 What is the third root of 568919 to the nearest integer? 83 What is 9357921 to the power of 1/2, to the nearest integer? 3059 What is the seventh root of 2169852 to the nearest integer? 8 What is the tenth root of 821818 to the nearest integer? 4 What is 4786068 to the power of 1/5, to the nearest integer? 22 What is 5841113 to the power of 1/3, to the nearest integer? 180 What is the fourth root of 284901 to the nearest integer? 23 What is 643727 to the power of 1/9, to the nearest integer? 4 What is the fifth root of 653914 to the nearest integer? 15 What is 1733473 to the power of 1/2, to the nearest integer? 1317 What is the ninth root of 2166993 to the nearest integer? 5 What is the third root of 741687 to the nearest integer? 91 What is the square root of 204816 to the nearest integer? 453 What is the ninth root of 1388224 to the nearest integer? 5 What is 284683 to the power of 1/2, to the nearest integer? 534 What is the third root of 84315 to the nearest integer? 44 What is the square root of 114174 to the nearest integer? 338 What is the fifth root of 4491272 to the nearest integer? 21 What is the cube root of 3892204 to the nearest integer? 157 What is the cube root of 6436110 to the nearest integer? 186 What is the square root of 705676 to the nearest integer? 840 What is the cube root of 33098652 to the nearest integer? 321 What is 472010 to the power of 1/8, to the nearest integer? 5 What is 214297 to the power of 1/8, to the nearest integer? 5 What is 134341 to the power of 1/5, to the nearest integer? 11 What is 19208261 to the power of 1/3, to the nearest integer? 268 What is the third root of 857903 to the nearest integer? 95 What is 3045399 to the power of 1/2, to the nearest integer? 1745 What is 3234654 to the power of 1/3, to the nearest integer? 148 What is the square root of 1791656 to the nearest integer? 1339 What is the third root of 3242283 to the nearest integer? 148 What is the square root of 299655 to the nearest integer? 547 What is 205512 to the power of 1/2, to the nearest integer? 453 What is the third root of 1231367 to the nearest integer? 107 What is 32860727 to the power of 1/2, to the nearest integer? 5732 What is the third root of 2213239 to the nearest integer? 130 What is 271170 to the power of 1/2, to the nearest integer? 521 What is 3783301 to the power of 1/2, to the nearest integer? 1945 What is 114572 to the power of 1/3, to the nearest integer? 49 What is the fifth root of 49118 to the nearest integer? 9 What is 3723244 to the power of 1/2, to the nearest integer? 1930 What is the square root of 39457071 to the nearest integer? 6281 What is 1636195 to the power of 1/2, to the nearest integer? 1279 What is the tenth root of 8266217 to the nearest integer? 5 What is 21917817 to the power of 1/6, to the nearest integer? 17 What is 126067 to the power of 1/2, to the nearest integer? 355 What is the third root of 1789900 to the nearest integer? 121 What is 208047 to the power of 1/2, to the nearest integer? 456 What is the third root of 3969528 to the nearest integer? 158 What is the square root of 148455 to the nearest integer? 385 What is the seventh root of 2155371 to the nearest integer? 8 What is the cube root of 212201 to the nearest integer? 60 What is 1699549 to the power of 1/8, to the nearest integer? 6 What is the fifth root of 17155566 to the nearest integer? 28 What is 27328341 to the power of 1/5, to the nearest integer? 31 What is 4420327 to the power of 1/4, to the nearest integer? 46 What is the seventh root of 386867 to the nearest integer? 6 What is 26262025 to the power of 1/2, to the nearest integer? 5125 What is 2102275 to the power of 1/2, to the nearest integer? 1450 What is 5479174 to the power of 1/8, to the nearest integer? 7 What is the ninth root of 115349 to the nearest integer? 4 What is 115787 to the power of 1/3, to the nearest integer? 49 What is the seventh root of 2066596 to the nearest integer? 8 What is the square root of 200067 to the nearest integer? 447 What is the cube root of 743462 to the nearest integer? 91 What is 646427 to the power of 1/7, to the nearest integer? 7 What is 1143847 to the power of 1/8, to the nearest integer? 6 What is 270744 to the power of 1/9, to the nearest integer? 4 What is 849200 to the power of 1/6, to the nearest integer? 10 What is the square root of 3151195 to the nearest integer? 1775 What is the square root of 2337966 to the nearest integer? 1529 What is the seventh root of 401454 to the nearest integer? 6 What is the sixth root of 1618887 to the nearest integer? 11 What is the third root of 12334293 to the nearest integer? 231 What is 109300 to the power of 1/8, to the nearest integer? 4 What is the square root of 447192 to the nearest integer? 669 What is 181527 to the power of 1/6, to the nearest integer? 8 What is the square root of 10835102 to the nearest integer? 3292 What is the square root of 251764 to the nearest integer? 502 What is 22055262 to the power of 1/3, to the nearest integer? 280 What is the ninth root of 8477101 to the nearest integer? 6 What is the third root of 22571102 to the nearest integer? 283 What is the third root of 4159589 to the nearest integer? 161 What is the square root of 2423576 to the nearest integer? 1557 What is 788855 to the power of 1/3, to the nearest integer? 92 What is 1529731 to the power of 1/10, to the nearest integer? 4 What is the cube root of 2464294 to the nearest integer? 135 What is the square root of 1790513 to the nearest integer? 1338 What is the square root of 534740 to the nearest integer? 731 What is 304411 to the power of 1/7, to the nearest integer? 6 What is the ninth root of 134477 to the nearest inte	{ "pile_set_name": "DM Mathematics" }
d derivative of -ra4 - 3a + 7a + 8a wrt a. -84a2 Differentiate -20 - 13 - 16v - 52v with respect to v. -68 Suppose 7w + 0w = 49. Find the third derivative of t2 - 15t*6 + 5t*6 + wt*6 wrt t. -360t*3 Differentiate 20 + 13l*2 + 11 + 36 + 77l*2 wrt l. 180l What is the third derivative of -45x5 + 87x*5 + 53x*2 + 5x*4 - 43x*5 wrt x? -60x*2 + 120x Let p be ((-4)/(-6))/(1/3). Suppose -c - 1 = pa, -2a = 3c + a - 3. Find the third derivative of 7z*2 + 4z3 + z3 + z*2 - cz*3 wrt z. 12 Let i = -6 - -10. What is the first derivative of -3q*i + 6 + 8q4 + q4 wrt q? 24q3 What is the third derivative of 3m*6 - 1902m*4 + 70m2 - m3 + 1902m4 wrt m? 360m*3 - 6 Let z be -4((-9)/(-6) + -2). Find the second derivative of 7a - 11a*2 + 0a*2 - 12a*z wrt a. -46 Suppose -2q + 124 = 2q. Let y be (q + 2)/((-3)/(-2)). Find the second derivative of -23c - 2 + 6c4 + yc + 2 wrt c. 72c2 Suppose -3u - 3f + 84 = 0, -u + 3f + 11 = -9. Differentiate 44y + u - 12 + 29 wrt y. 44 Let l(o) = -45o*2. Suppose -4d + 3j - 2j = 68, -4 = j. Let t(u) = -u*2 + 1. Let w(v) = dt(v) + l(v). Differentiate w(g) with respect to g. -54g Let y be -1 + -3 + (1 - -14). Suppose y - 29 = -3o. What is the third derivative of -3p6 - 3p2 - p6 + 5po + p2 wrt p? 120p*3 Find the second derivative of -2r + 234 - r*2 + 6r*3 + 11r*3 - 3r*3 wrt r. 84r - 2 Let g(z) = 29z3 - 37z + 4333. Let w(o) = -6o3 + 7o - 866. Let v(b) = 2g(b) + 11w(b). Differentiate v(p) with respect to p. -24p2 + 3 Let u(z) = 7z*2 + z - 2. Let b be u(1). Suppose bm - 17 = -3c + 2m, -5m - 5 = 0. What is the second derivative of 2h - 5h + ch*4 - 7h wrt h? 84h2 Let a(b) = -44b*3 + 10b*2 - 3b - 4. Let j(i) = 43i3 - 9i*2 + 3i + 5. Let w(p) = 5a(p) + 4j(p). What is the third derivative of w(l) wrt l? -288 Differentiate 88 + 81a - 33a + 18 + 19 with respect to a. 48 Let v(r) be the third derivative of r*7/105 - 13r6/30 + r5/15 - 2r3/3 - 7r*2 - 1. What is the third derivative of v(o) wrt o? 48o - 312 Let y(t) be the third derivative of 37t5/60 + 127t*3/2 + 310t*2. Differentiate y(u) wrt u. 74u Find the second derivative of -104y3 - 565y - 424y4 - 15y*3 + 119y*3 wrt y. -5088y*2 Let t(k) be the first derivative of -2k*5/5 + 37k4/4 + k2 - 5k + 251. What is the second derivative of t(y) wrt y? -24y*2 + 222y Let u(f) = 100f3 - 4f*2 + 2f + 1. Let h(p) = p*2 + p. Let z(j) = -4h(j) - u(j). What is the second derivative of z(r) wrt r? -600r Suppose -q + 10 = w + q, -3w + 28 = 5q. Let u be (-1 - w/(-9))-12. Find the second derivative of -uy - 2y + 7y2 + 9y*2 - 5y*2 wrt y. 22 Let g(m) be the third derivative of 3m*7/5 + 7m*3/6 + 69m*2. Differentiate g(k) with respect to k. 504k*3 What is the third derivative of 3d*3 - 80d - d*3 + 8d + 23d - 14d*2 + 27d - 297d5 wrt d? -17820d*2 + 12 Let s = 112 - 112. Let q(z) be the second derivative of 4/3z*3 + 5z + 0z2 + 0z*5 - 7/30z*6 + 0z*4 + s. Find the second derivative of q(o) wrt o. -84o*2 Let z(x) = -12x*4 - 6x*2 - 8. Let q(r) = -4r*2 + 0 + 1 + 5r2 + r4. Let c(f) = 12q(f) + 2z(f). What is the derivative of c(p) wrt p? -48p3 Let l(h) be the third derivative of 0h + 0h4 + 13/15h*5 + 1 - 5/21h*7 + 0h*6 + 19h*2 + 0h*3. What is the third derivative of l(t) wrt t? -1200t Let d(t) = t*2 - t + 1. Let y(r) = 213r*2 - 6r - 155. Let x(m) = -6d(m) + y(m). What is the derivative of x(v) wrt v? 414v Let d(s) be the first derivative of 0s5 + 0s*6 + 40/3s*3 + 0s*2 + 17/7s*7 + 0s - 30 + 0s4. Find the third derivative of d(a) wrt a. 2040a*3 Suppose 3 = t - 2o - 0, -4o = 4t + 36. Let y = -2 - t. What is the second derivative of yn2 - n + 2n + 3n wrt n? 6 Let c(p) = -2p*2 - 3p. Let a be c(-2). Let i(u) = u*2 + 2u. Let q be i(a). Find the third derivative of 2h2 + 4 - h5 + qh*2 - 4 wrt h. -60h*2 Suppose 2r + s = 10, -r - 1 = -0s + 2s. What is the second derivative of y5 + y5 - 4y - 5y*5 + ry wrt y? -60y3 Let j be -2 + -3 + 0 + 9 + -1. Find the second derivative of -23x - 12x3 - 7x*j - 2x wrt x. -114x Let c(d) = -d4 - d2 - d + 2. Let f(o) = 197o*4 + 2o*2 + 2o - 63. Let x(u) = 2c(u) + f(u). Find the first derivative of x(y) wrt y. 780y*3 What is the third derivative of -24r*3 + 7r - 9r3 + 21r*3 + 16r*2 + 52r*3 wrt r? 240 Let z(k) be the second derivative of -221k*3/6 - 108k*2 + 140k. Differentiate z(i) with respect to i. -221 Let y = 270 - 264. Let b(l) be the first derivative of 0l3 - 1/4l*4 + 0l*2 + yl - 2. Find the first derivative of b(h) wrt h. -3h2 Suppose 2u + 11 = -3y + 6y, 2y = 4u + 2. What is the third derivative of -21v2 - 20v*3 + 10v*u - 8v*2 wrt v? -120 What is the second derivative of -2981n*2 + 2637n*2 - 23n - 2 - 34n - 35n wrt n? -688 Let q(i) be the third derivative of 7i6/12 - i5/30 + 5i3/2 - i2 - 89. What is the third derivative of q(n) wrt n? 420 Suppose s - 5a = -11, s - 5s = -3a + 10. Let x(r) = -5r*3 - 1. Let p be x(s). Differentiate 10t*4 + p - 7t*4 - 1 with respect to t. 12t*3 Let g(d) = -38d*2 - 7d + 31. Let z(n) = 13n2 + 2n - 10. Let t(j) = j + 4. Let c be t(3). Let a(k) = cz(k) + 2g(k). Differentiate a(r) wrt r. 30r Let p(s) be the first derivative of -12s*5/5 + 9s*2 - 18. Find the second derivative of p(k) wrt k. -144k*2 What is the second derivative of -4z*2 - 4 - 83z*2 + 109z - 122z wrt z? -174 Suppose -3l - 23 + 26 = 0. Differentiate -4 - 4h3 + l + 3 + 3 wrt h. -12h*2 Let f be -3 - 1 - (-64)/16. Let k(h) be the second derivative of 1/2h*3 + 0 + 3/4h*4 + 8h + fh2. What is the second derivative of k(y) wrt y? 18 Let o(i) be the third derivative of 9i*5/4 - 5i*4/24 + 4i*3/3 + 95i*2. Find the second derivative of o(z) wrt z. 270 Let t(l) be the second derivative of 5/4l*5 + 3/2l*3 + 0l*2 - 9l + 0 + 0l4. What is the second derivative of t(b) wrt b? 150b Let a(n) be the second derivative of 4n6/15 - 7n*5/20 - 56n*2 - 2n + 37. What is the derivative of a(m) wrt m? 32m3 - 21m*2 Let g(v) be the third derivative of 0v*4 - 1/20v*5 + 0 - 7/6v*3 + 0v - v*2. What is the first derivative of g(f) wrt f? -6f Let j(v) = -v*2 + 2v + 4. Let n be j(4). Let d = n - -6. Find the second derivative of -p4 - p4 - dp + 5p*4 + 3p*4 wrt p. 72p*2 Let i = -272 - -272. Let m(x) be the first derivative of -1 + 0x*5 + 0x + 3/2x2 + ix*4 + 0x*3 - 1/2x*6. What is the second derivative of m(v) wrt v? -60v*3 Let i(u) = 46u - 157. Let n(v) = 51v - 158. Let c(t) = 5i(t) - 4n(t). Differentiate c(d) with respect to d. 26 Let b = -164 + 172. Let w(r) be the first derivative of b + 0r*6 - 8/7r*7 + 0r*4 + 0r*2 + 0r5 + r3 + 0r. Find the third derivative of w(o) wrt o. -960o*3 Differentiate -5l*2 - 33l - 2l2 + 6l + 0l2 - 2l*2 + 393 with respect to l. -18l - 27 Suppose 3b - 2b - 2l = 13, 5b = 5l + 45. Differentiate -12w + 2w - b - 7w + w with respect to w. -16 Let w(j) be the third derivative of 13j6/120 - 59j*5/60 + 74j*2. What is the third derivative of w(y) wrt y? 78 Suppose -2a + b = 2a - 14, -13 = -5a - b. Differentiate -13wa + 15 - 2 + 38w*2 - 38w*2 wrt w. -39w*2 Let g = -48 - -52. Let p(y) = y + 1. Let q(h) = 13h*2 + 3h - 4. Let m(k) = gp(k) + q(k). What is the second derivative of m(i) wrt i? 26 Suppose -3d = 2d. Suppose df = f - 3. What is the second derivative of 2y2 + 3y*2 + 2y*f - 5y*2 + 8y wrt y? 12y Differentiate 3u3 - u3 + 21u - 41u + 534 + 93u with respect to u. 6u*2 + 73 Let q = 11 + -10. Let l be -3 + 3 + q + 3. Differentiate 6 + 0s*3 - 14s*3 + ls*3 wrt s. -30s*2 Let c(y) be the second derivative of -33y*4/2 - 125y*2 - 2y - 110. Differentiate c(m) wrt m. -396m Find the second derivative of -160g + 35 + 301g3 + 351g - 189g wrt g. 1806g Let i = -763 - -9163/12. Let b(o) be the second derivative of -io4 + 0o*2 + 0 + 1/3o*3 - 8o. Find the second derivative of b(f) wrt f. -14 Wha	{ "pile_set_name": "DM Mathematics" }
). What is the third derivative of u*5 + su*5 + 2u*2 - 5u*5 wrt u? -60u*2 Let d(v) = -v - 2. Let u(l) = 29. Let q(m) = -3d(m) + u(m). What is the first derivative of q(s) wrt s? 3 Let m(p) be the second derivative of p*6/6 - 9p*2/2 + 21p. Find the first derivative of m(k) wrt k. 20k3 Suppose 2t - 14 = -5a, -6a + 16 = -a + 3t. Find the first derivative of -as - s + 2 + 5s wrt s. 2 Suppose 2v + 2 = 6. Find the third derivative of -2y2 + 3y*3 - 2y*2 + 3y*2 + 4y*v wrt y. 18 Let x(c) = 14c*2 - 2c + 1. Let i(z) = -z*2 + z. Let o(y) = 2i(y) + x(y). What is the first derivative of o(u) wrt u? 24u Let q(z) = -4z*3 - 4z*2 + 6z. Let y(g) = g3 - g2. Let t(k) = q(k) - 4y(k). Find the second derivative of t(n) wrt n. -48n Let f(x) = -3x3 + 3x + 5. Let s(y) = 4y3 - 2y - 4. Let j(z) = 4f(z) + 5s(z). What is the second derivative of j(o) wrt o? 48o Let c = -3 - -5. Find the third derivative of 3k2 + kc - 5k4 - 3k*2 + 3k*4 wrt k. -48k Let m(a) = a3 + a2 + a + 1. Let z(r) = 11r3 + 4r*2 + 3r + 3. Let h(n) = -3m(n) + z(n). What is the third derivative of h(g) wrt g? 48 Let j = -11 + 16. Find the third derivative of -3q*3 - 7q*2 + jq*2 + 5q*3 wrt q. 12 Let b be -47(3 + -5)/(-2). Let z be (-6)/(-21) + b/(-7). What is the second derivative of 5p5 + 4p - zp - p5 wrt p? 80p3 Let n be 76/12 + (-2)/6. Find the third derivative of -c2 + 4c2 - 2c2 - cn wrt c. -120c3 Let v(n) be the third derivative of -n6/12 - 17n*3/6 - 18n*2. Differentiate v(k) with respect to k. -30k2 Let d(m) be the second derivative of -m6/360 - m5/30 + m4/6 + 4m. Let i(q) be the third derivative of d(q). Differentiate i(z) wrt z. -2 Let j(l) be the third derivative of -l5/60 + 5l*4/24 + 7l*2. What is the second derivative of j(h) wrt h? -2 Suppose 0q + 4q = 84. What is the third derivative of -21 + q - 4z*4 - 4z*2 wrt z? -96z Find the second derivative of 9j - 4j*5 - 2j*5 + 3j wrt j. -120j3 Let w(d) be the third derivative of -d6/10 - 7d*4/6 + 22d*2. Find the second derivative of w(y) wrt y. -72y Let f = -13 + 22. Suppose fs - 4s - 10 = 0. What is the third derivative of y*3 - 5y*3 - sy*2 + 2y3 wrt y? -12 Let j(o) be the second derivative of o8/1120 + o*5/24 - 2o*4/3 - 3o. Let i(d) be the third derivative of j(d). What is the first derivative of i(a) wrt a? 18a2 Let m(n) be the first derivative of -7n*2/2 - 23n + 2. Let v(x) = 5x + 15. Let c(k) = 5m(k) + 8v(k). Differentiate c(p) wrt p. 5 Let m(t) = -t - 3. Let h be m(-9). Find the third derivative of 25x*4 - 25x*4 - 4xh - x2 wrt x. -480x3 Let m(p) = 6 - p - 4 + 0. Let k be m(0). What is the third derivative of -3rk + r4 + 4r2 + r2 wrt r? 24r Suppose 8i - 3i = 0. Let q = 11 + -8. Find the third derivative of 0r3 + irq + r5 + 2r2 wrt r. 60r*2 Let j be (-7 - -2)(5 - 6). What is the third derivative of -168f + 6f*j + 6f*2 + 168f wrt f? 360f2 What is the second derivative of -3x*2 - 11x - 4x2 + 5x*2 - 7x2 wrt x? -18 Let y(j) be the second derivative of -j7/6 - 7j3/6 + 3j. What is the second derivative of y(c) wrt c? -140c3 Let m(v) be the first derivative of 2v*7/7 + 2v*3 + 8. What is the third derivative of m(z) wrt z? 240z*3 Suppose -2v = 4o - 6, -2 = 2o - 4v - 10. Suppose 2h = -oh. What is the first derivative of -q + hq - 1 + 3q wrt q? 2 Find the second derivative of 4d + 11d - 18d*4 - 26d + 20d wrt d. -216d*2 Let j(k) be the second derivative of -43k*5/20 - 11k*4/4 - 8k. Find the third derivative of j(n) wrt n. -258 Suppose -3 = -5b + 22. Suppose 4y + b = 3y, -3y = -2g + 27. What is the third derivative of -2v*g + 4 - 4v*2 + 6v*2 - 4 wrt v? -240v*3 What is the third derivative of -4k - 2k2 + 3k*5 + 9k*5 - 3k - 8k3 + 7k*3 wrt k? 720k*2 - 6 Let v be 3 + -3(-2)/2. What is the first derivative of -2 - vt3 + 7t - 7t wrt t? -18t*2 What is the derivative of 25 - 9 - 3f*3 - 9 - 10 wrt f? -9f*2 Let w(r) be the second derivative of 9r*5/4 + 21r*2/2 + 2r - 1. Differentiate w(u) wrt u. 135u2 Find the second derivative of -5k + 9k + 6k + 3k3 - 31k*3 wrt k. -168k Suppose -3 = -0x - x. Let o = x - 1. Find the first derivative of 2y - oy - 2 - 3y*2 wrt y. -6y Let l(b) = 2b2 - 4. Let s(h) = h2 - 3. Let q(g) = 4l(g) - 5s(g). What is the derivative of q(o) wrt o? 6o Let f = 37 - 35. Let y(d) be the first derivative of -2/3d3 + 1 + 0d*f + 0d + 3/4d4. Find the third derivative of y(i) wrt i. 18 Let t(q) be the third derivative of q6/20 + 41q*3/6 - 24q*2. Find the first derivative of t(s) wrt s. 18s*2 What is the third derivative of -2j*2 - 11j*3 - 2j*2 + 5j*2 wrt j? -66 Find the second derivative of 2 + 8a*4 + 9a*4 + 2a - a - 7a4 wrt a. 120a*2 Let m(o) be the third derivative of -1/40o*6 + 5/24o*4 + 0o5 - o2 + 0o3 + 0o + 0. Find the second derivative of m(r) wrt r. -18r Let b be 0 + 1 - (-11 + 9). What is the second derivative of 0 - 5n*5 + 0n*5 + 0 - bn wrt n? -100n3 Let t(x) = 3x*2 + 2x - 11. Let b(o) = -2 + 67o - 54 - 56o + 15o2. Let v(f) = -2b(f) + 11t(f). What is the first derivative of v(w) wrt w? 6w Let a(r) be the third derivative of 0r4 + 0 + 5r*2 + 0r + r*3 - 7/120r*6 + 0r*5. What is the first derivative of a(y) wrt y? -21y*2 Find the first derivative of 845 - 5x - 883 + 61x wrt x. 56 Let x(m) = -m4 - m3 - m2 - m + 1. Let i(z) = -24z*4 + 5z*3 + 5z*2 - 15z - 5. Let s(t) = i(t) + 5x(t). Find the second derivative of s(u) wrt u. -348u*2 Suppose 8 - 36 = 4u. Let m = u + 12. Find the first derivative of 4y - 4 - 2y + m - 5 wrt y. 2 Let h = 10 + -8. Let q(x) be the first derivative of 0xh + 2/3x*3 - 2 - x. What is the derivative of q(a) wrt a? 4a What is the first derivative of -35x + 13 + 19x - 25x - 13x wrt x? -54 Let h(l) be the third derivative of -31l7/210 + l5/12 - 13l*2. What is the third derivative of h(z) wrt z? -744z Let o(m) = m*3 - 5m*2 - 3m - 4. Let a be o(6). Differentiate g*3 - 2 - 14g + ag wrt g. 3g*2 Find the third derivative of 12g*2 - 5g*2 + 15g*2 + 5g*4 wrt g. 120g Let o(i) be the first derivative of 7i3/3 - 7i*2/2 + 6. Find the second derivative of o(z) wrt z. 14 Let o(m) be the first derivative of 0m*2 + 2 + 2m - 4/3m3. What is the derivative of o(r) wrt r? -8r What is the second derivative of -3f - 2f*4 + 5f + 7f4 wrt f? 60f*2 Let u(z) = 13z*4 + 11z*3 - 15z2 + 11. Let j(s) = -s4 + s*3 + 1. Let b(y) = -22j(y) + 2u(y). What is the third derivative of b(v) wrt v? 1152v Let r(b) = -b*6 + 5b*5 - 10b2 + 5. Let a(j) = -j6 + 2j5 - 5j*2 + 2. Let q(t) = 5a(t) - 2r(t). What is the third derivative of q(k) wrt k? -360k*3 Let p(g) = -18g*2 - 5g + 4. Let o(y) = -y*2 - y - 1. Let c(l) = -5o(l) + p(l). Differentiate c(u) wrt u. -26u Find the second derivative of -954 + 7o*3 + 954 + 6o wrt o. 42o Let u(v) be the third derivative of v6/10 - 35v*3/6 + 23v*2. Differentiate u(k) wrt k. 36k*2 Let u(d) = -4d - 3d2 + 6d*3 - 11d*3 + 6d*3 + 2. Let c be u(4). What is the second derivative of -10 + 2j + cj2 + 10 wrt j? 4 What is the third derivative of 0c*6 - 9c*6 + 2 - 2 + 3c*2 wrt c? -1080c3 Let y(d) be the second derivative of -d6/30 + d*4/12 - 3d*2/2 - 2d. Let s(n) be the first derivative of y(n). Find the second derivative of s(i) wrt i. -24i Let v(u) be the second derivative of -5u*5/4 - 2u*4 + 6u. What is the third derivative of v(o) wrt o? -150 Let d(o) = -24o2 - 17o. Let h(u) = -u. Let x(b) = -d(b) + 3h(b). Find the second derivative of x(z) wrt z. 48 Differentiate 3 - 111h*3 - 12 + 118h*3 with respect to h. 21h*2 Suppose 2q - 5k - 50 = -13, -3k = 4q - 9. Find the second derivative of qc + 2c4 + 0c - 3c wrt c. 24c*2 Let k(t) be the third derivative of 7t6/360 + t4/6 - t3/2 + t2. Let j(v) be the first derivative of k(v). What is the first derivative of j(g) wrt g? 14g Let d(t) = t2. Let h be d(-2). What is the third derivative of hp**6 +	{ "pile_set_name": "DM Mathematics" }
= 1 - 1. Let j = 2102 + -2106. Sort j, f, 2, -0.4 in descending order. 2, f, -0.4, j Suppose 0 = 4k - 3 + 63. Let a be (-26)/8 + -2k/10. Put a, -0.4, -5 in descending order. a, -0.4, -5 Let d = -80.1 + 80.24. Put 2, 4/9, d, -1/4 in increasing order. -1/4, d, 4/9, 2 Let n be -7 - (25/(-5) - -4). Sort n, -5, -2 in descending order. -2, -5, n Let m(i) = -2i3 + 30i*2 - 4i + 61. Let t be m(15). Let l = 1 + -4. Put t, 18, l in ascending order. l, t, 18 Let m be -8 - -2 - 1 - -12. Sort 0, -1, m, -33 in descending order. 0, -1, m, -33 Let s = -43.4 + 45.8. Let r = 11.4 - 10. Let d = r - s. Sort d, 2, 0.1 in decreasing order. 2, 0.1, d Let u = 248/19 + -1202/95. Sort -4, -4/3, u. -4, -4/3, u Let j = -783 - -745. Suppose -4a - h - 3 = 0, 2h = 4a + a + 7. Sort a, 1, j in increasing order. j, a, 1 Let k(m) = m*3 + 18m*2 - m - 13. Let g be k(-18). Suppose -12 = 4r, gr = 3n - 24 + 3. Sort 10, n, 5. n, 5, 10 Let d = 120 - 175. Let r = -53.7 - d. Put 0.2, -3/4, r, 0.1 in increasing order. -3/4, 0.1, 0.2, r Suppose 0 = w + 4 - 5. Suppose -l - 1 - w = 0. Let s = 15 - 14. Sort l, 0, s in increasing order. l, 0, s Let u be 10/(-225) - 276/(-135). Put 0, u, 17 in decreasing order. 17, u, 0 Let l(f) = -f*3 + 5f*2 - 5f + 5. Let n be l(4). Put n, -55, -4 in ascending order. -55, -4, n Let p = 112 - 1567/14. Put -0.1, p, -1/9 in decreasing order. p, -0.1, -1/9 Suppose 5y = y. Let j(h) = h + 6. Let q be j(y). Let k = -2 + q. Sort -5, k, 1 in increasing order. -5, 1, k Suppose -12c = -4c - 56. Suppose 10 = -3l - cl. Let g be -2 + 1 - (-3)/3. Put g, 1, l in increasing order. l, g, 1 Let v = -848 - -848. Let h be 2/((-2)/1) + -2. Let r(j) = j3 + 4j*2 + 5j + 4. Let m be r(h). Sort v, 1, m in increasing order. m, v, 1 Let k = -30 - 41. Put -2, k, -3 in ascending order. k, -3, -2 Let s = 0 + 1. Let l = 0.7 - s. Let g(d) = d*3 - 4d2 - d + 7. Let u be g(4). Put l, -4, u in ascending order. -4, l, u Let d(b) = b3 + 19b2 + 19b + 13. Let n be d(-18). Let z be 30/9(-3)/(-2). Sort 1, z, n, -2 in descending order. z, 1, -2, n Suppose 0 = -3d - 5 + 17, 2f - 26 = -4d. Suppose -2k + 6k + 20 = 0. Let s be (2 - 1)-3 - 0. Sort k, s, f in ascending order. k, s, f Let g = 891 + -888. Put -4, 5, -0.03, g in decreasing order. 5, g, -0.03, -4 Let z be (-118)/5905/(-7). Sort -0.5, z, -5, 2/15 in increasing order. -5, -0.5, 2/15, z Let a be 8/1030/12. Let y be (2 + 1 + -3)/a. Suppose 3x + 4f - 9 = y, 3x = 6x + 2f - 3. Put 0, x, 5 in descending order. 5, 0, x Let h = 8.24 - 4.24. Put 3, h, -3/7 in descending order. h, 3, -3/7 Let t(v) = -5v2 - 7v + 16. Let b(l) = l*2 - 1. Let d(q) = -6b(q) - t(q). Let n be d(6). Let u = -2 - 0. Put -1/3, n, u in increasing order. n, u, -1/3 Let y = -0.5 - 5.5. Let x = 5.9 + y. Let q = -0.12 - x. Sort q, -1/4, -0.5 in increasing order. -0.5, -1/4, q Let s be (-28)/((2 + -6)/(-4)). Let p be -2 + 5/((-20)/s). Let c = 0 - -1. Put p, c, -1 in descending order. p, c, -1 Let z = 376 + -381. Put -4, 4, -1, z in decreasing order. 4, -1, -4, z Suppose -2 = -k, -b + 0k + 3k = -66. Let u be b/(-39) - 14/(-7). Sort u, -0.4, -2 in increasing order. -2, -0.4, u Let d = -2.93 + -0.07. Let k = -446 - -448. Put d, 8, k in ascending order. d, k, 8 Let b = -111066.07 - -110500. Let k = b - -551. Let s = k + 15. Put 2/7, s, 0.4 in descending order. 0.4, 2/7, s Let m = 3 + -3. Suppose -2h - 6 = m, 10 = 3z + h - 2. Suppose 4l + 3p = -1 - 2, -4l + 2 = -2p. Put l, z, -2 in descending order. z, l, -2 Suppose -m = -60f + 62f - 7, 25 = 5f. Put -5, m, 5, -4 in increasing order. -5, -4, m, 5 Let u(n) = -n2 - 6n + 8. Let s be ((-21)/6)/(5/10). Let x be u(s). Let f(h) = 3h. Let z be f(x). Sort z, -1, 2 in decreasing order. z, 2, -1 Let d be (-8)/28 + 66/(-14). Let i(f) = f3 - 14f*2 + 14f - 5. Let n be i(13). Sort n, d, -2 in descending order. n, -2, d Let o = -0.486 + 0.476. Sort -4, 0, o, 7/4 in increasing order. -4, o, 0, 7/4 Let j(x) = 3x + 17. Let a be j(-5). Suppose 3 = r + ar + 5v, 23 = -5r + v. Sort -3, r, 5 in descending order. 5, -3, r Let f(c) = -2c + 43. Let r be f(22). Sort -4, r, 5, 1. -4, r, 1, 5 Suppose k - 1 - 3 = 0. Suppose 6p + 40 = p - 5c, 32 = -kp + 4c. Let t = 4 + p. Sort -3, 1, t in descending order. 1, -3, t Let h be 0/(-10 - -6) - -1. Put -1, 8, h, 2 in ascending order. -1, h, 2, 8 Suppose 12 = -4t + 3s + s, 0 = 4t + 5s + 30. Sort t, -20, 4 in decreasing order. 4, t, -20 Let a = -5 - -5.4. Let d = 0.09 + 0.01. Put d, a, 5 in decreasing order. 5, a, d Suppose 27f + 14 = -13. Sort 3, f, -12, -4 in descending order. 3, f, -4, -12 Let b = -70 - -74. Let n = 3 + -13. Put b, -2, 5, n in increasing order. n, -2, b, 5 Let k = -3493 + 3485. Let o(i) = -i*3 - 8i*2 - i - 3. Let d be o(-8). Put 2, d, -3, k in increasing order. k, -3, 2, d Suppose 4l + 544 = 512. Put l, 15, -5 in increasing order. l, -5, 15 Let c = -217 - -214. Put 5, 326, c in descending order. 326, 5, c Let c be 40/(-440) + 3/11. Sort 0.9, 1/5, c in descending order. 0.9, 1/5, c Suppose -21w - 20w = 17w. Let b = 2 - -2. Put 2, b, w in descending order. b, 2, w Let t = -148 + 147.98. Let m = -8 - -4. Sort -0.5, m, t in descending order. t, -0.5, m Let d = 384.2 + -380. Sort d, -4, -5 in decreasing order. d, -4, -5 Let a = -3.4 + 3. Let z(m) = m2 - 20m - 5m2 + 4m*3 - 5m*3 + 17m. Let n be z(-3). Sort a, n, -1. -1, a, n Let w = 1116 + -1115. Sort w, 13, -1/3, -6. -6, -1/3, w, 13 Let t = -4 - -3. Let k(j) = -j*2 - 70j - 551. Let y be k(-9). Sort 3, y, t, -3. -3, y, t, 3 Let l = -279 + 282. Sort -1/5, l, 1/10, 0.4. -1/5, 1/10, 0.4, l Suppose -3h + 3w = 4w - 22, -5w + 14 = -h. Let t be h/4 + (-3)/(-6). Let o be (6/(-21))/(3/(-42)). Put -3, o, t in descending order. o, t, -3 Let p = -0.24 - -0.44. Let t = -46 + 54. Sort p, t, -1 in descending order. t, p, -1 Suppose 68u - 12u = 56. Put -4, 2, -8, u in descending order. 2, u, -4, -8 Let z be 9/(-18) + (675/10)/5. Sort -2, -5, 1, z in ascending order. -5, -2, 1, z Let h be ((-22)/55)/(7/(-5)). Sort 3, 29, 1/3, h in increasing order. h, 1/3, 3, 29 Let g be (-2)/((8/(-22))/(414/(-759))). Suppose -v = -5 + 6. Suppose -c + 2 = -z - 1, 0 = -5z - 2c - 22. Put g, v, z in descending order. v, g, z Let i be 2 + -7 + (-254)/(-50). Let v = 2/17 + 16/153. Sort i, v, 4/3, -3. -3, i, v, 4/3 Let a = -779 - -3909/5. Let n = a - 51/20. Sort -5, n, -2/9, -4. -5, -4, -2/9, n Let s be 3/(-4)1(-190 - -186). Put s, -3, -5 in descending order. s, -3, -5 Let d = -205 + 208. Let j(x) = x*2 - 3x. Let s be j(3). Let o(c) = -c3 - c2 - c - 1. Let l be o(s). Sort l, -6, d. -6, l, d Let m(j) = -j*3 + 8j*2 - 7j - 2. Let v be m(7). Let n = -82 - -89. Let z be (n/14)/(1/6). Put -3, v, z in increasing order. -3, v, z Let w = -38.022 - -0.022. Let m = w + 35. Let z = -0.4 - -0.3. Sort -1, m, z in decreasing order. z, -1, m Suppose 2133o + 155 = 2102o. Suppose r - 5 + 4 = 0. Put 5, r, 8, o in descending order. 8, 5, r, o Let z = 241 + -239. Sort 0, 1, -6, z in descending order. z, 1, 0, -6 Suppose -5u - 6 - 4 = 0. Let o be (-5)/(-2) - (-6)/4. Let p(r) = -r2 + 3r. Let s be p(o). Sort s, u, -5 in decreasing order. u, s, -5 Let b be (-2 + 6)/(-4)(-6)/(-2). Put b, -1, 6, 2 in decreasing order. 6, 2, -1, b Let k(j) = j3 - 6j*2 + 11j - 20. Let i be k(3). Put i, -4, -3, 0 in ascending order. i, -4, -3, 0 Suppose 8 = -18j + 98. Suppose -5y = -u + 25, -jy = -y + 2u + 6. Suppose -3m = 4p + m, 4p - 4m = 0. Sort -1, y, p. y, -1, p Suppose -3j + 32c = 36c + 4, 5c - 26 = 4j. Put -16, j, 0, 5 in descending order. 5, 0, j, -16 Let j = 109 - 111. Put 1, 74, -3, j in descending order. 74, 1, j, -3 Let u be (-36)/(-16)2/3. Let x = 0 + -0.6. Let v = -0.3 - x. Sort -5, u, v in decreasing order. u, v, -5 Let b be 1/(-3)(3 - 20 - -5). Suppose -2s - 2 = -2y + 2, -5y = 3s + 6. Sort -1, s, b, 0. s, -1, 0, b Let s = -324 + 320. Suppose 30 = -4m - 2o, 3m - o + 25 = -5o. Sort m, -1, s in decreasing order. -1, s, m Let j be (-5)/104/18. Sort -1/2, 5, -2/5, j in ascending order. -1/2, -2/5, j, 5 Let b be (-1)/2 - (21/(-6) + 3). Let a = 11 - 10. Sort a, b, 4, 5. b, a, 4, 5 Let b = -2/5637 + 22798/704625. Let n = 19262/375 - b. Let a = 1223/24 - n. Sort a, -1, 5. -1, a	{ "pile_set_name": "DM Mathematics" }
)/(-11)). 66 ((-20)/(-125)-101)/((1872/(-420))/26) 28/3 ((-1608)/(-96))/((-7)/((-56)/2)) 67 What is ((-203)/139664)/(4/(-64))? 1/43 Evaluate (-18132/891)/((-256)/480). 5 12/(-9)(-38)/((-8208)/81)90 -45 What is the value of (-90)/1004/6-7(-5)/(-42)? 1/2 Calculate (((-1838781)/18)/(-189))/23. 47/2 What is the value of (-201)/(-4)(-8(-279)/(-1488))/((-9)/8)? 67 Evaluate (16/4)/(((-15)/3600-36)/((-9)/(-5))). 48 What is (64/(-32))/(-18/(-100))? -25 What is the value of (-16)/323680/(-552)? 10/3 Evaluate -638/4835/(-35). 21/2 8/(-3)61/(11651/9741) -136 0/3(-118)/15341 0 Calculate -13-20(-127)/(-1766570). 2/107 Calculate ((-18)/(-16))/((-1452)/(-2420)((-3)/3)/(-2)). 15/4 Calculate (((-204)/50)/(1604/(-4010)))/((-6)/40). -68 Evaluate 126/2240(16/(-12))/((-104)/(-130)). -3/32 Evaluate (18/(-99))/((-64)/192(-5)/(20/16)). -3/22 Calculate (133/1311)/(420/(-360)). -2/23 What is (25/(-5)(-392)/(-20))/(-2)? 49 What is the value of (1518/30)/((-5838)/(-3892))? 6 What is the value of 122928/(-46098)(-78)/((-6)/(-3))? 104 (20000/3000)/(4/(-21)) -35 What is (272/(-8))/(-68)24/(-1266)? -2/211 What is (25/3)/(4580/(-5496))? -10 Evaluate (7/((-35)/2))/(31866/(-1695)). 1/47 (-45)/(-12)(-3696)/(-330) 42 What is (-2)/28(1872/(-1170))/(1/5)? 4/7 What is the value of ((-17268)/31658)/(3(-4)/2552)? 116 What is (((-1526952)/(-745))/84)/((-2)/(-5))? 61 What is the value of (-227)/(289425/(-255))4/46? 2/115 610(312/(-26))/(-120) 61 Calculate 1/((-6)/38432). -2 What is (-410)/630/(-3)(3780/(-500))/(-63)? 82 What is ((4/(4/(-2)))/(-1))/(58578/907959)? 31 Evaluate (2/(-4)2)/((-255)/1955-69). -1/9 Evaluate ((-3840)/3072)/(10/328). -41 What is the value of ((766/385)/((-3)/40))/(-18)? 8/9 Evaluate -1834/(-408)2/15535. 107 Calculate (-10)/(-5)31/((-744)/(-408)). 34 2/(-15)(-85305)/3619 22/7 Evaluate (((-1)/(-24))/(15/(-81)))/((-447)/8344016). 21/8 Calculate ((-201)/17353)/(39/(-4329)). 9/7 Calculate ((-50976)/(-295))/1230/84. 36/7 ((-240)/65)/(1428/(-24752)) 64 (-11)/142/(-22)26/26 1/14 Calculate ((668/(-18704))/(((-27)/80)/(-9)))/(3/18). -40/7 Calculate -1242/(-54)(-21)/28. -7 Calculate ((16/(-2))/(25/20))/((-65)/((-5525)/(-238))). 16/7 Calculate (-1276)/348(60/(-10))/198. 1/9 ((2/34)/1)/((-824)/(-14008)) 1 What is the value of 630/(-36)(1/(-7))/((-6)/(288/4))? -30 Calculate 60/9(-7416)/3090. -16 (((-416)/9)/(-26))/(16/(-864)) -96 Calculate (1-1)/(30/(-4)2986/(-1052565)). -47 What is ((51/10)/((-7332)/(-12220)))/(((-1)/(-2))/1)? 17 Evaluate (8568/195846/(-91))/(2/(-64)). 12/13 Evaluate ((-4)/(-4))/(27/(3780/(-28))). -5 What is 1/((-4)/29192-89)? 82 (2(-432)/482/32)/((-9)/(-12)) -3/2 Evaluate (770/5)/(3944/(-3451)(-7)/4). 77 Evaluate ((-56)/(-6)10162/(-2160))/1. -7 Calculate ((-690)/(-1150)230/(-6))/((-5)/51). 23 What is -10(64/24)/((-295)/(-1003))? -34 What is (((-17568)/108)/61)/(520/(-90))? 6/13 Calculate ((-76)/(-14))/(612/12248/(-7)). -19/2 What is the value of (28/10)/(((-109)/13080)/(3/24))? -42 What is the value of (-316)/8058-3(108/(-45))/(-12)? 2/85 Evaluate ((-3272)/10634)/(20/(-312)). 24/5 What is the value of 6/(-189)175107/(-4280)? 5/36 What is (56/(-1820))/((549/1830)/((-2)/(64/(-18))))? -3/52 What is the value of 2/(-1)75900/(-31625)? 24/5 ((-104)/(-12)(-1315)/(-10257))/(8/18) 5/2 Calculate ((18396/(-567))/(-73))/((-132)/6). -2/99 Calculate 273/91605/749. 65 What is -1(112/(-36))/((-96)/(-864))? 28 What is the value of ((122/(-98))/((-19)/(-133)))/((-864)/27216)? 54 What is the value of -58(-140)/(-7105)84? -96 What is ((-6)/55)/((-1457430)/(-2405))? -1/101 What is ((-1388)/(-36088))/((-5)/130)? -1 (2/40-65(-80)/520)/2 1/4 What is the value of (-420)/1750(-1725)/(-460)? -9/10 Calculate ((-1)/2)/((12/42)/(154(-46)/1127)). 11 Evaluate 2/((-48)/(-36))(-9)/((-216)/(-592)). -37 Evaluate (9(-17)/(-2329))/(-12)(-1)/((-9)/(-24)). 2/137 What is ((3/20)/((-72)/(144/6)))/(55/(-330))? 3/10 1019/665(-4340)/(-40) 31 What is 8300/9960(-16)/30? -4/9 33/(352/(-32))64/(-5952) 1/31 (-57)/(-266)-21(-7)/(-21)2 -3 Calculate ((-92)/69)/(32/140150/60). -7/3 Evaluate ((-240)/35)/((5(-20)/1200)/((-21)/(-48))). 36 (194/(-679))/((-2)/21) 3 What is (((-620)/(-52))/(-5))/((-3826)/149214)? 93 Evaluate (34276/2255)/((12/(-45))/((-24)/(-36))). -38 What is 63/(-45)(-80)/6(609/14)/29? 28 Calculate (8/(-18))/((-10)/(-375))((-24)/10)/(-2). -20 What is the value of ((20/(-80))/((21/16)/3))/(420/98)? -2/15 What is the value of (33/99)/((91/(-26))/((-45)/(-1)))? -30/7 Evaluate 90/4032176(-6)/(-5). 33/7 What is (((-1)/(-2))/(51300/(-7200)))/((-14)/(-3))? -2/133 Evaluate -184/2076(21/7)/9. -2/173 What is ((-660)/540(-2)/22)/(228/108)? 1/19 What is the value of (36/(-470))/((-93969)/(-104410))? -4/47 What is (6(-116)/(-12))/((-11562)/(-5781))? 29 What is (22/(-33))/((-17868)/(-16379))? -11/18 Calculate 6/(-10)45/(-270)130. 13 What is (1/(-15))/(88/1056)35? -28 Evaluate ((-656)/(-4264))/(((-14)/(-91))/23). 2/3 86(248/62)/(-4) -86 Evaluate (-331/3)/((-1276)/7192). 62 What is the value of ((-853)/2559)/(2/(-15))-1(-2)/(-2)? -5/2 Evaluate (-30)/120402/(-10). 0 What is the value of (48/288)/((19/6)/(-19))5? -5 (-45)/(-10)(-2470)/855 -13 What is ((4/35)/((-21)/(-49)))/(65/((-9100)/(-4872)))? 2/261 What is the value of ((-30)/90)/(2/6)1631/(-9424)? 1/19 Evaluate ((-1140)/(-399))/((46/(-736))/(7/4)). -80 Evaluate 6/(31/(-1302)18). -14 Evaluate (142/98)/((-8)/2044). -73 Evaluate -328130/1084(-2)/(-12). -40 Evaluate -91(-18)/56(-7168)/2688. -78 What is ((1092/448)/(-39)-48)/((-39)/(-20))? 20/13 ((-8)/380)/(996/1660) -2/57 8211/22010 41 What is ((-12)/(-3))/(6/(-21)(-6860)/3360)? 48/7 What is (5670/104328)/((-4)/(-16))? 5/23 200/(-180)31536/(-730) 48 Calculate 5/(-10)(7452/405)/((-3)/(45/6)). 23 Evaluate (((-1276)/(-66))/(-29))/(275/30). -4/55 What is the value of (-88)/(-209)(-7334)/(-196088)? 2/127 1/(65/12)((-3492)/1552)/(9/10) -6/13 (-10)/((-2200)/(-90))(-33)/(-9)(-154)/(-1694) -3/22 Evaluate ((-4)/((-80)/25))/(((-300)/(-8))/75). 5/2 Calculate 1/18114/(-494)-78. 1 Evaluate (17/(-34))/(39/2574). -33 What is the value of (-3)/((1080/(-3150))/(3/((-60)/8))-28)? 1/8 What is (4/176-30)/(93/341)? -5/2 What is (44/(-1056)-6)/(8/96141/(-2))? -2/47 What is the value of ((-311395)/11067)/(-287)(-9)/5? -3/17 Calculate 5/(15/9)(-137)/(4521/462). -42 Calculate (25/(-10))/((-285)/(-4218)). -37 (176/(-1848))/221 -1 What is 186/25916-192? -3/11 Evaluate 63030/(-360)(-4)/(-7). -30 (-4)/1284/2806-1 3/5 Evaluate ((-84)/(32340/2765))/(4/(-44)). 79 What is ((-1488)/248)/((-51)/442)? 52 What is ((((-4)/(-75))/(-4))/(162/729))/(6/8)? -2/25 Evaluate ((-62480)/8520)/((-2-6(-2)/3)/(-2)). -11/6 What is the value of 5/((((-1)/4)/((-60)/(-3600)-6))/22)? 44 What is the value of (3328/(-96))/((10/(-4))/((-1020)/272))? -52 Evaluate (-1215)/486-96(-5)/(300/9). -36 Calculate 530/2((11/110)/((-2)/12))/(-3). 53 39/6(-5360)/(-1236820) 2/71 (16/(-840)20)/6-1(-24)/80 -2/105 What is ((-104)/39)/(108/(-19845)5)? 98 What is the value of ((6/(-3))/((-38)/121624))/28? 2/21 Evaluate 56/40(-9)/189-150. 10 Calculate -7(-40)/(72/((-306)/(-17))). 70 (5/105166/(-4))/(874/(-133)) 4/23 What is (-35)/717/(1768/(-16))? 10/13 ((-1)/(-63))/((-449)/2694) -2/21 What is (1/(-3))/((5/(-120))/(-36/4))? -36 Calculate (-5)/2(-16020)/(-534). -75 What is 2/(-4)84/18(-660)/154? 10 Calculate ((4/8)/(16/4))/(15228/1728). 2/141 Calculate 3906/55552(-64)/(-12). 3/8 What is the value of ((-475)/(-50))/(3629/1719)? 9/2 What is 119/((-47124)/(-176))2? 8/9 Calculate (18/36)/(4417/1262). 1/7 What is (3337/282)/(-71)150? -25 What is the value of 2205/(-378)(-588)/70? 49 What is ((-820)/(-656)-4)/(25/(-12))? 12/5 2/7-498/140-10 8 Calculate (-39)/(-3)49/((-2646)/216). -52 What is (20/30)/(-2)366/915? -2/15 Calculate (-3)/1(9/24)/(((-21)/24)/(-7)). -9 Calculate (19/12255-80(-6)/(-4))/(2/1). -4/43 What is the value of (564/90)/(319/4785)? 94 Evaluate (-72)/66(-11)/(-2)-2(-21)/(-12). 21 Calculate (4/6)/(4308/213246). 33 What is the value of (((-48)/(-15))/(-4))/(133/570)? -24/7 ((-450)/(-22000))/(390/2860) 3/20 What is 120/12(1/(4/(-73)))/((-1630)/(-1304))? -146 (-294)/((-91)/13)(-702)/(-273)*(-2)/(-6	{ "pile_set_name": "DM Mathematics" }
a Which is the closest to 0.1? (a) -1 (b) 5 (c) -92/145 c Which is the nearest to -1/5? (a) -243 (b) 1 (c) 0.1 c Which is the nearest to 1/3? (a) -5 (b) -1/4 (c) -17/4 (d) 53 (e) 4 b What is the closest to -0.1 in -0.9, 0.8, -0.03, 0.3, -28? -0.03 What is the closest to -0.787 in -4, -3, 94? -3 Which is the nearest to -2? (a) 158 (b) -1 (c) 1 (d) -10 b Which is the nearest to -0.02? (a) -0.1 (b) -1/2 (c) 3/4 (d) 1.3 (e) -11 a What is the nearest to 1 in -1, -2/47, 2/17, 0.06, 2? 2/17 What is the closest to 0 in -6, 0.6, -0.147? -0.147 What is the closest to 770 in -2/15, -3, 5, 6? 6 Which is the nearest to 6? (a) 3970 (b) 0.07 (c) -0.3 b What is the closest to 4 in -3/4, 4/47, -0.7, -1? 4/47 What is the closest to 0.1 in -17, -0.03, 2, 5? -0.03 Which is the nearest to -0.2? (a) -2/15 (b) -0.3 (c) -2/729 (d) -1 a Which is the nearest to 433? (a) 3 (b) -0.14 (c) 0.06 a Which is the closest to 357? (a) -39 (b) 2/9 (c) 5 c Which is the closest to 2/9? (a) 4 (b) 12/19 (c) 10 (d) 237/2 b What is the nearest to 28/179 in -1/9, 0, 0.4, -2? 0 What is the closest to 0 in 1/3, 6, 22, -7129? 1/3 Which is the closest to 0.8? (a) 3/10 (b) 0 (c) 2 (d) 44 a Which is the closest to 1/37? (a) -5 (b) -1/7 (c) -0.3 (d) -6/11 b What is the nearest to -3 in 2, 0.0319, 1/3, 0.3, 3.2? 0.0319 What is the closest to 2/7 in -0.1, 320, -1/11, 0.3? 0.3 Which is the closest to 1/2? (a) 3 (b) -3753/23 (c) -5 (d) -2/7 d Which is the nearest to 1/2? (a) -4/3 (b) 3 (c) -67 (d) 118 a Which is the nearest to 1/2? (a) 1 (b) -0.0467 (c) 6/7 (d) 0.158 d What is the closest to -8 in -1242, -2/13, -5, 0? -5 What is the nearest to -5 in -3, -3/4, 6028/9? -3 Which is the nearest to 0? (a) 5 (b) -0.01 (c) -39/23 b What is the closest to 2 in -222, -0.1, -1, 1? 1 Which is the closest to -1? (a) -202 (b) -0.17 (c) -0.4 c What is the closest to -1/19 in -0.5, 0.04, 54? 0.04 What is the nearest to -0.2 in -3/7, -5/1458, 4/9? -5/1458 Which is the closest to 0? (a) -3 (b) -0.26 (c) 50 (d) -4 b What is the nearest to 2 in 2, -4, 5/39, 79/2? 2 What is the closest to 1 in -1, 5, 0.5, -4199.8? 0.5 What is the closest to 16/33 in -17, 0.5, 5/2, -6, 0.2? 0.5 Which is the nearest to 1/8? (a) -0.3 (b) -3 (c) 4/3 (d) -4/3 (e) -4 a Which is the closest to 9/2? (a) 2/125 (b) -0.5 (c) -4 (d) 0.2 d Which is the nearest to -109? (a) 28 (b) 13 (c) 0.6 (d) -1 d Which is the nearest to 1? (a) 3/19 (b) 70 (c) -2 a Which is the closest to 0.1? (a) -1/4 (b) 5/4 (c) 45 (d) 2 (e) -1 a What is the nearest to 0 in -0.3, -133, -1/65, -1? -1/65 What is the closest to 10 in 16, -2, 1? 16 Which is the closest to 7.2? (a) 6 (b) 0.3 (c) -29 a Which is the closest to 23050? (a) 0.1 (b) -1 (c) 0.5 c Which is the nearest to -2/7? (a) 30 (b) -7/4 (c) -7 b Which is the nearest to 5? (a) -5/4 (b) 0.57 (c) 3/8 b What is the closest to -49 in 0.4, 0.2, 0.01, -5/16? -5/16 Which is the nearest to -1? (a) 0 (b) -2/11 (c) 31 b What is the closest to 1 in 359, -10, 4? 4 What is the closest to 0.5 in 54, 9, 0.1, 0.05, 1? 0.1 What is the closest to -3 in 6, -7, -5, 1/5, 0.38? -5 What is the nearest to -3 in 0, -4/3, -1/939, 5? -4/3 Which is the nearest to 2/5? (a) -4 (b) 2/7 (c) 18/5 (d) -3/17 (e) -5 b Which is the nearest to 187? (a) 0.718 (b) -1/5 (c) 0.4 (d) 2 d Which is the nearest to 0.523? (a) 5 (b) -0.5 (c) -3/11 c Which is the closest to -0.2? (a) 4 (b) 0.2 (c) -1558 b Which is the closest to 3? (a) -6 (b) -16/359 (c) -4 b What is the closest to -2440 in 3, 2, -2? -2 Which is the closest to -2? (a) -6 (b) -2/809 (c) -2/9 c Which is the nearest to 2/11? (a) -9/47 (b) -3/5 (c) -5 (d) 1/5 d Which is the closest to -0.026? (a) -2/3 (b) -339 (c) -3 a Which is the closest to 0.2? (a) -1/2 (b) -3/2 (c) 7 (d) -4 a Which is the closest to 0.42? (a) -0.2441 (b) -3/2 (c) 4 a Which is the closest to 0.272? (a) 44.4 (b) 1 (c) 0.5 c What is the closest to 1/5 in 1/16, 3, -135? 1/16 Which is the closest to -0.2? (a) -4 (b) -12 (c) 1/451 c Which is the nearest to -4/5? (a) -4 (b) -319 (c) 2 (d) 2/11 d Which is the closest to 32? (a) 0 (b) 5 (c) -6 (d) -2/3 (e) 4/3 b Which is the closest to 0? (a) -5/4 (b) 2/9 (c) 2/17 (d) -2/5 c Which is the nearest to -0.4? (a) -5 (b) 0 (c) 1 (d) -27/35 d Which is the nearest to -182? (a) -96 (b) 3 (c) 4 a What is the nearest to -2 in -3436, 4, -17? 4 Which is the closest to -27? (a) 22/5 (b) 2/3 (c) 1267 b Which is the nearest to -198449? (a) 4 (b) -1/4 (c) 1/11 (d) 0.4 b What is the closest to 103 in 2/7, -1, 0.1, -0.4? 2/7 Which is the nearest to -2? (a) 6 (b) 7.4 (c) 0.04 c Which is the nearest to 2? (a) 0.3 (b) 1 (c) -2/3 (d) -185 b What is the closest to 4.9 in -4, 1, 32? 1 What is the closest to 0 in -0.3, 4.8, -0.2, -0.39, 40? -0.2 Which is the closest to 135? (a) 27/4 (b) 4/7 (c) 1 a Which is the nearest to 2? (a) -1/253 (b) -128 (c) -4 a What is the closest to -254 in -0.5, -137, -1/5, 4? -137 Which is the closest to -0.1? (a) -4 (b) 1/3 (c) 28 (d) 0 d What is the nearest to -0.2 in 1/3, 10, 0, -5.2, -1/3? -1/3 Which is the closest to 0? (a) 3 (b) -17/16 (c) -22 b What is the closest to 0.3 in 103, 0, -0.004? 0 Which is the nearest to 7? (a) 14 (b) -311 (c) 0.3 c What is the nearest to -1 in 1.5, 0.9, -4, 0.6? 0.6 Which is the nearest to -7? (a) -31 (b) -4 (c) 0.07 (d) -0.3 b Which is the closest to 1? (a) 1/5 (b) 63 (c) 89 a Which is the closest to -3? (a) -0.04 (b) 528.6 (c) 0.3 a Which is the nearest to -4? (a) -2 (b) -1/2 (c) 1 (d) 1048 a What is the closest to -39 in 17, 1, -2/1175? -2/1175 Which is the closest to -0.1? (a) -0.4 (b) 6814 (c) 0 c What is the closest to -0.1 in -5, 119, -3, -2/7? -2/7 Which is the closest to -0.1? (a) -2/25 (b) -1/6 (c) 3 (d) -3.9 a Which is the nearest to -0.1? (a) 0 (b) 8 (c) 20 (d) 5 (e) -0.5 a What is the nearest to 2 in 3/4, 9, 3/26? 3/4 Which is the nearest to 0? (a) 4 (b) -1044 (c) -5 (d) 0.93 d What is the closest to 1.5 in 0.05, 0.5, 4, 3, 1? 1 Which is the closest to -1/2? (a) -1/8 (b) -3/5 (c) 145 b What is the nearest to -0.1 in -5, -2/5, -79.7, -1/22? -1/22 What is the nearest to 382 in 0.4, -3, -224? 0.4 Which is the closest to 6/5? (a) -0.39 (b) 2/7 (c) 6 (d) -6/7 (e) 0 b What is the closest to -6 in 0.5, -10, 4, -1, 14? -10 What is the nearest to 3 in 0.5, 1, 2/3, 772? 1 What is the closest to -1 in -2/9, 7, -136, -1.2? -1.2 What is the nearest to -0.06 in -0.1, -1/6, -4/5, 0.53? -0.1 What is the nearest to 3 in 9, -2/7, -342? -2/7 What is the nearest to -26 in 0.3, -308, 2/13, -3? -3 What is the closest to -8/11 in -46, 0.2, -2/9, -5? -2/9 What is the nearest to -0.13 in 0.01, 10/13, 0? 0 What is the closest to -0.2 in 24, 3/2, 1683, 1/6, -2/9? -2/9 What is the closest to 0.1 in -11.2, -12, 6, 5, 2/7? 2/7 Which is the closest to -0.1? (a) -6 (b) -1 (c) 49 (d) -3 (e) -0.053 e What is the nearest to 1 in 0.4, -0.9, 2, -14? 0.4 Which is the nearest to -72? (a) 63 (b) -0.3 (c) -1/2 c Which is the closest to -3? (a) -2816 (b) -1 (c) -32 b Which is the closest to -7.5? (a) -2 (b) -5 (c) -0.2134 (d) -0.3 b Which is the closest to -2/7? (a) 0 (b) -3/7 (c) -27839 (d) -0.4 d Which is the nearest to 1? (a) -0.21 (b) -9 (c) -0.25 (d) -1 a What is the nearest to 1 in -2/1951, -2/5, 0.3, 2? 0.3 What is the closest to 168 in 4, 3, -14? 4 What is the closest to 0 in 85/6, 3, -2/5, 465/7? -2/5 What is the nearest to 0 in 36.1, -0.1, 9/17? -0.1 Which is the closest to -0.1? (a) 54 (b) 0.5 (c) 129 (d) -2 (e) -2/5 e What is the nearest to -4 in 0.0148, 5, -5/2? -5/2 Which is the closest to -1/2? (a) -3 (b) -711 (c) 5 a What is the closest to -4/9 in -0.2, 0, 4? -0.2 Which is the nearest to 51.4? (a) -1 (b) 24/11 (c) -2/7 b Which is the closest to 7? (a) -0.2 (b) 29 (c) 5/4 (d) -4 c Which is the closest to -1.8? (a) -0.5 (b) -31 (c) 4 (d) -2/3 d What is the closest to 1 in 2, -0.033, -8513? 2 Which is the closest to -0.263? (a) -0.5 (b) 5 (c) -4/3 (d) 0.94 a Which is the closest to -1? (a) -2 (b) 4 (c) 96 (d) -12/5 (e) -0.1 e What is the nearest to -2/7 in 212.1, -0.2, 4/27? -0.2 Which	{ "pile_set_name": "DM Mathematics" }
and give q. 2 Rearrange -28 + 38 - 10 - 1724u to the form su + q and give s. -1724 Rearrange 8771q4 - q + q3 + 0q*3 - 8773q*4 + 7q*2 to the form tq + vq4 + gq*2 + n + pq*3 and give v. -2 Express (40t + 32t - 21t)((-1 + 0 - 1)(0 + 2 - 1) + 3 - 2 - 3) as s + at and give a. -204 Express 107v*4 + 3v - 13v2 - 53v*4 - 55v*4 + 3v*2 as zv*3 + iv*2 + lv + s + kv4 and give l. 3 Express (-33 + 17 + 9)(-4r + 0r + 2r) in the form s + or and give o. 14 Rearrange 3z2 - 19z*3 + 2 + 0 + 12z*3 + 4z*2 to tz*2 + dz + v + rz3 and give t. 7 Express -79a*2 + 1 + 40a*2 + 0 + 41a*2 + 33a in the form ga2 + sa + m and give s. 33 Rearrange 166h2 - 62h*2 + 188h*2 - 72h*2 to the form rh + th2 + p and give t. 220 Rearrange 2a - 1 + 6785a4 + 3a*3 - 6842a*4 - 3a to the form ka2 + ia + m + ha4 + xa*3 and give k. 0 Express (-74 - 16 - 101)(2u2 + 2 - 2)(1 - 1 - 2u2) as du*2 + fu + tu3 + m + gu*4 and give g. 764 Rearrange 39d*2 + 50d*2 - 93d*2 - 22 to the form z + qd*2 + hd and give q. -4 Rearrange -9 - 5p2 + 4p*2 + 5p*2 + 0 to the form dp + mp2 + f and give m. 4 Rearrange a3 - a4 - 2a*3 + 2a4 + (-a2 - 21262 + 21262 + 2a)(-11 - a*2 + 11) to ia*3 + da*4 + ra*2 + ha + p and give i. -3 Express (1 + 3 - 3)(-3a + 4a + 2a + (-4a + a + 4a)(-3 + 3 + 1) + a + 33 - 33)(-a + a - 2a2) as xa + ia3 + n + ka*2 and give i. -10 Express -241 - 18r2 + r2 + 6r2 + 2r*3 + 5r*2 + 4r*2 in the form fr*2 + hr*3 + br + x and give f. -2 Express -22x3 + 13x*3 + 5x*3 + 30x*3 + 237x*3 + 4x*2 in the form ux*2 + tx + yx3 + g and give t. 0 Rearrange -127o*2 + 2o - 8o + 2o to the form vo2 + to + u and give t. -4 Rearrange -467t - 7t + 29t - 197t to j + wt and give w. -642 Express 26x*3 - 23 + 21 - 50x*3 in the form jx + mx2 + f + ux*3 and give u. -24 Express -298m*2 + 296m*2 + 22 + m + m in the form im + dm2 + j and give j. 22 Rearrange (7t - 9t - 2t - 19)(2t - 3t + 4t) to u + zt2 + at and give a. -57 Express 3 + 2u3 + 214u + 0u3 + u2 - 8u*2 - 211u + u*4 - 2 as fu*4 + hu*3 + qu*2 + y + su and give q. -7 Rearrange y - 21y2 + 19 - 21 + 40y*2 to the form dy + oy2 + p and give o. 19 Express (159 + 89 - 330)(0b2 + 2b*2 + 0b*2)(1 - 7 + 1) as cb + xb*2 + j and give x. 820 Rearrange 10o + 3o - 8o + 1 - 1 - o + (0 + 2 + 2)(4o + 2o - 5o) - 3o + 2o - o to the form v + zo and give z. 6 Express -r + 4848r*3 - 16r*4 - 4849r*3 + 2r as a + qr + nr*2 + lr*3 + pr*4 and give l. -1 Express (-2q + 1 - 1)(0q + q*3 + 0q) - 38q4 + 3q*4 + 12q*4 + (1 - 3 + 4)(-q*4 + 0q*4 + 3q*4) as xq + iq3 + j + uq*4 + nq*2 and give x. 0 Express -33v*2 + 69v*2 - 36v*2 + 6v*3 + 10 as q + ov + yv2 + kv*3 and give q. 10 Rearrange 2 + 3n - 2 + (5n + 4n - 8n)(-1 + 2 - 3) + 11n + 5 + 5 - 8 to the form ln + s and give l. 12 Express 71z - 28z - 38z + 76z + 70z in the form j + pz and give p. 151 Rearrange 26x2 + 36 - x - 23 - 14 to the form m + lx + nx2 and give l. -1 Express -9f + f*3 - 2f*2 + 6f - 2f4 + 5 + f2 as w + cf*4 + af*3 + rf*2 + mf and give m. -3 Express 4 - 1 + 507m - 1 in the form k + wm and give k. 2 Rearrange (-1 + 6p2 - 298p + 298p)(-7p + 3p*2 + 7p + (0p - 2p - p)(-p + 2 - 2)) to sp*4 + mp*2 + q + hp + ap3 and give m. -6 Rearrange 7g*3 + 0 + 0 + (-3g + g + 4g)(-g*2 + 3g2 + g2) + 0g3 - 2g*3 - 4g*3 to jg*3 + b + dg + wg2 and give j. 7 Express 482j*3 + 231j*3 - 13j3 + j2 + 201j3 in the form vj + q + sj2 + aj*3 and give a. 901 Rearrange -3w*3 + 3021w*2 - 2w + 1 + 6w4 - 3022w*2 + 3w*3 to the form qw*2 + lw*3 + s + mw*4 + bw and give s. 1 Express (0 + 0 - 2)(-22n - 324 + 324)((0 + 0 + 1)(1 - 2 + 4) + 1 + 0 + 1) as fn + k and give f. 220 Express 9 + 590i + 4 - 13 in the form ti + l and give t. 590 Express -2071c - 250c2 + 2071c in the form nc2 + o + mc and give n. -250 Express 49w + 1486w*2 + 54w - 1487w2 in the form p + xw + dw2 and give x. 103 Rearrange -k3 - k3 + k3 + (4 - 4 + 2k)(0 + 2k*2 + 0) + (4k + k*3 - 4k)(-881 + 208 - 332 - 504) to the form mk + wk3 + rk*2 + i and give w. -1506 Rearrange 4g + 5g + 2 + 2g - 43g + 13g to i + jg and give i. 2 Rearrange (3a*2 + 3a*2 + 10a*2)(-3 + 0 + 4)(-3a + 5a + 5a) to the form ia + o + ha*2 + ta*3 and give t. 112 Express -299844i + 299844i + 1393i*2 in the form zi + c + pi2 and give p. 1393 Rearrange 138t*2 + 69t*2 + 577t*2 to the form ft*2 + wt + o and give f. 784 Rearrange (3q3 + 2q*3 - 6q*3)(0 - 4 + 9)(4q - 36q - 98q) to i + vq3 + gq*2 + aq + hq4 and give h. 650 Express 555 + 6g + 98g3 - 557 + 4g*2 - 96g*3 in the form jg*3 + og*2 + zg + u and give u. -2 Rearrange (-2d - 6 + 2860d*2 - 2858d*2 - 38)(-2d2 + d - d) to the form fd + z + ad4 + sd*2 + wd*3 and give w. 4 Express -2p*3 + 5p*2 + p + 4p*3 - 1149p*4 + 10 + 1150p*4 in the form xp + np4 + c + mp*2 + kp*3 and give c. 10 Express (390 - 81 - 34 + 863)(2x3 - 8x*3 + 0x*3) in the form z + nx + jx2 + ix*3 and give n. 0 Express (570 + 3293 + 521)(-a*2 + 1 - 1) in the form da + ba2 + y and give b. -4384 Express 242f*2 - 242f2 - 130 + 123 - f3 - 8f as a + df*2 + yf*3 + lf and give a. -7 Rearrange -6 - 4k4 + 12k*3 - 10k*3 + 2k - k*3 to vk*3 + d + ck*4 + ik + zk2 and give d. -6 Rearrange -7f*3 - 15f*3 + 8f*4 - 52f*3 - 2f + 45f3 to u + if*2 + tf*4 + yf*3 + vf and give y. -29 Rearrange (-9 - 7 + 7 - 3s)(-6 + 2s2 + 6) to the form bs + ks3 + l + cs*2 and give k. -6 Rearrange (16 - 4j*3 - 16)(11j - 6j - 12j) + (-2 - 1 + 5)(-j*4 + 2j*4 - 2j*4) to fj*3 + oj*4 + k + yj*2 + lj and give o. 26 Express 3h3 - 8h - 43h2 + 2h + 43h2 as kh*3 + bh + f + ch2 and give b. -6 Rearrange -14j + 67j + 176j to uj + h and give u. 229 Express -15d - 11d + 3 + 7d + 42d in the form ld + n and give l. 23 Rearrange 1 + 4x3 + 122x + 0 + x*2 - 4x*4 - 121x - 2 to wx4 + tx*2 + kx*3 + a + jx and give w. -4 Rearrange 12 - 319g2 - 313g*2 + 634g*2 to the form jg*2 + o + ng and give j. 2 Express -17i + 242i*2 + 5 - 248i*2 - 7 in the form pi + n + zi2 and give n. -2 Rearrange 962w*2 - 2w - 445w2 + w3 - 452w*2 to the form rw*3 + bw + pw2 + h and give r. 1 Rearrange (1 - 1 + 3b)(8 + 16 - 105 - 90)(5b + b + 0b) to u + xb2 + ob and give x. -3078 Express -40q - 10q*4 - 29q*2 + 19q + 11q4 + 22q as mq + lq*3 + d + fq*2 + vq*4 and give m. 1 Rearrange (419 + 116 - 52)(4 - m3 - 4 + (m2 - m2 - m2)(2m + 3m - 4m) + 2m3 - 2m3 + m3) to the form xm + n + ym*2 + sm*3 and give n. 0 Rearrange (2 + 1 - 2)(-2 - 1 + 2)(4 - 4 + 2)(-32 + 7d + 2d*2 - 10d - 3d2) to the form w + td*2 + kd and give t. 2 Rearrange (-4b - 15b + 36b)(-27b + 13b - 72b - 5b) to m + rb + tb*2 and give t. -1547 Rearrange (-1 + 3 - 4 + 3j*2)(17j2 - 25j*2 - 23j*2) to the form o + ij*3 + bj*4 + gj + wj2 and give b. -93 Rearrange 53o*4 - 9 - 46o*4 - 4 + 11 + 2o + 2o3 to fo + w + io4 + no*3 + xo*2 and give n. 2 Rearrange 159w - 315w - 2w*3 + 145w to the form jw2 + z + qw*3 + vw and give q. -2 Rearrange 121u - 5u*2 + 6u*2 - 9u*3 - 129u + 87u to the form gu + q + ru2 + nu*3 and give g. 79 Express -7j*3 - 2j*3 + 4 - 2 + 3j3 - j2 in the form vj2 + wj + dj3 + y and give v. -1 Express -3 - 3 + 4j*3 + 6j - 6j - 8j - j*3 + 2j*2 in the form oj + ij2 + p + qj*3 and give o. -8 Express (0s - s - s)(-8 - 21 + 6) + (-2s + 2 - 2)(0 + 4 + 2) in the form as + n and give a. 34 Express -1081o + 26o*4 - 3o*2 - 1087o - 2o3 + o2 + 0o*3 + 2177o as fo + lo*4 + ko*2 + io*3 + b and give k. -2 Rearrange (4 - 1 - 2)(502r - 67r + 38r + 292r) to the form d*r + w and give w. 0 Express -264 -	{ "pile_set_name": "DM Mathematics" }
z(-35). What is the third biggest value in 0.4, c, -4? -4 Let w = -2.01 + 1.01. What is the fourth smallest value in 0.1, w, -0.1, -277? 0.1 Let v be (-3)/(42/77) - -4. What is the fourth smallest value in v, 0.2, -3, 0.3? 0.3 Let v be (-2 + -1)-12(-11)/396. Which is the third biggest value? (a) -0.03 (b) -1/8 (c) v (d) 0.06 b Let j = -1.06 + 0.56. What is the biggest value in -9, j, 3? 3 Let n(l) = 47l - 422. Let i be n(9). What is the biggest value in 38, i, -3? 38 Let q = -1314 - -1314.2. Let o = 0.05 - -3.95. Let m = -4.3 + o. What is the second smallest value in q, m, 3? q Let q = -8.42 + -1.58. What is the fourth biggest value in -0.4, -1/2, q, 1? q Let c be ((-1)/3)/(148/30 + -5). Suppose -2t = -cp + 2t - 27, 5p + 21 = 2t. What is the smallest value in -1/6, p, 0.4? p Let v = -9 - -9.14. Let f = -0.08 + v. Let a = -0.14 - f. What is the biggest value in -0.3, -4, a? a Let i = 4.56 + -2.5. Let h = 0.038 - 0.098. Let g = i + h. What is the second smallest value in -6/11, g, 4? g Let a = -8.24 + 0.24. Let t = 11.5 + a. Let u = t + -8.5. What is the biggest value in u, 1/4, -2? 1/4 Let y be (-19323)/266 + -1 + (-2)/4. Let d = y - -74. What is the fourth biggest value in 1/11, -2/17, d, 2/13? d Let l = -1 - -1.3. Let g = 33.7 + -34. What is the third biggest value in -0.4, 1, g, l? g Suppose -5q - 60 = 4r, 2q + 39 = 2r + 51. Which is the biggest value? (a) -9 (b) r (c) 5 c Let j = -4866 - -4871. Suppose 4h = 2h - 14. What is the smallest value in h, -1, j? h Let s = -4.1 + 3.1. Let y = 9/16 - 95/112. What is the second smallest value in s, -0.3, y? -0.3 Let t = -5.442 - -0.442. Let z be 3/4(-6)/9. What is the second smallest value in t, z, 1? z Let p = -10 - -16. Let j be p/(-8) - (-3)/(-12). Let x be (j/(-6))/((-17)/(-51)). Which is the smallest value? (a) 0.3 (b) -1 (c) x b Let c be -1 - (-1 - (-8)/(-10)). Let x = 2.97 + 0.03. Let m = -70.4 - -70.4. What is the second smallest value in c, m, x? c Suppose 4j - n = -25, 0 = -j - 3n + 15 - 5. Let t = 0.6 + -0.2. Which is the biggest value? (a) 2/3 (b) t (c) j a Let x be (-220)/(-88)(-1)/15-1. Which is the second smallest value? (a) -1 (b) -0.4 (c) 1/10 (d) x b Let h = 1871 + -1865. What is the smallest value in -7, -3/5, h? -7 Suppose -4k + 14 = -26. Suppose -kf = -2f - 16. What is the smallest value in f, -0.1, -0.01, -1? -1 Let c = -13 + 13. Suppose -2x + 2 = -3x. Let l be ((-21)/(-70))/(6/(-8)). What is the second biggest value in c, l, x? l Let k = 0.11 + -3.11. Suppose 0 = x + 5w + 5 - 24, -5x + 4w + 8 = 0. What is the third biggest value in k, x, 0.2? k Let h = 1 + -5/3. Let f(p) = p2 + 15p - 4. Let o be f(-12). Let z be (4/10)/((-8)/o). Which is the second smallest value? (a) 1 (b) z (c) h a Let q be 3/(((-9)/(-3))/3). Suppose 0 = 3k + p - 5p - 19, 2p + 7 = k. Let f = -9 + k. What is the second biggest value in f, 4, q? q Let k = 8.2 - -2.8. Let f = k - -2. Which is the smallest value? (a) 1/4 (b) f (c) 3/4 a Suppose r = -4l + 221, -4r - 124 = -2l - 0r. Let z = l - 276/5. Let m be 3 + -1 - (-12)/(-7). Which is the second smallest value? (a) 0 (b) m (c) z b Let q = -1 + 0.969. Let k = q + 5.831. What is the second smallest value in -1, -2/5, k? -2/5 Let m = -6 - -8. Let r = 1816 + -1813. Suppose rz = mk + 1, 4z = -0z + 4k + 8. What is the second biggest value in z, -3/4, -2/3? -3/4 Let x = 3.68 - 3.491. Let o = x - -0.011. Which is the smallest value? (a) o (b) -2 (c) 0.005 b Let n = 1118.01 + -1118. Which is the third smallest value? (a) n (b) 2/3 (c) 2 (d) 1/9 b Suppose 4q + 6 = 2k, 2q = -4k - 8 + 30. Let w be (-6)/(-15)(-14)/(-4). Let f = w - q. What is the smallest value in f, 0, 0.3? 0 Let u = 591 + -589. What is the third biggest value in u, 39, -5? -5 Let k = 10.7 + -10.5. What is the fourth smallest value in 1/4, k, -103, 0.1? 1/4 Let o = 762 - 766. Let s = 8.9 + -6.2. Let t = s + 0.3. What is the biggest value in o, -0.5, t? t Let k be (40/(-150))/((-4)/(-10)). Let s(n) = -3n*2 + 3n. Let h be s(3). What is the smallest value in k, -0.3, h? h Let k = -49 + 54. Let g be 69/(-33) + k + -3. Which is the third biggest value? (a) -4 (b) g (c) -0.5 (d) -21 a Suppose -13x + 11x = -10. Suppose 3z + 4q = -4, -6z + 4z - 2q = 0. Which is the smallest value? (a) x (b) -2/7 (c) z b Suppose -3n + 0n + 3 = 0. Let d = 7 + 7. Let p(h) = -h3 + 13h*2 + 15h - 16. Let k be p(d). Which is the second biggest value? (a) -0.1 (b) n (c) k a Let g = 1.59 - 1.39. Let y = -10 - -10.3. What is the third smallest value in 2, y, g? 2 Let z be 2/(-8) - (-3 + (-253)/(-88)). Which is the fourth biggest value? (a) z (b) -2/3 (c) 1 (d) -4 d Let h be (7 - 1)/((-20)/45). Let n = h + 85/6. Let i be (-2)/(-4) - 2/3. Which is the third biggest value? (a) -0.4 (b) i (c) n a Let g = 0.055 - 2.875. Let m = -0.82 - g. Which is the fourth smallest value? (a) 0 (b) m (c) -3 (d) 5 d Let d = -1.29 + 1.29. What is the second biggest value in 1, 1/4, -10, d? 1/4 Let d = -97 - -99. Suppose 0 = -2n + 10, 3u - 2u + dn = 10. What is the second biggest value in 1, u, -14, -4? u Let m be 6/75(12/7 - 1). Let u = m + 23/210. Which is the second biggest value? (a) 0.5 (b) 0.1 (c) u (d) -0.4 c Let s(g) = 4g. Let c be s(-11). Let z be (-15)/24-4c/(-10). What is the second biggest value in -0.2, z, 3? 3 Let o(u) = -u*3 + 21u*2 + 24u - 32. Let l be o(22). Suppose -18 = 10z + l. What is the smallest value in -1, -2/9, z, 1/7? z Let k be -5 + (-54)/(-12) - 28/(-8). What is the fourth smallest value in k, 0, -1, -110? k Let s = -0.96 - -0.8. Let u = s - -0.36. Let z = -1.1 - -0.9. What is the biggest value in z, -0.3, u? u Let f = 0.1 + -0.1. Let d = 120 + -123.2. Let o = 6.2 + d. Which is the biggest value? (a) o (b) f (c) -4 a Suppose 20p + 149 - 489 = 0. What is the third biggest value in 1/7, p, 3/7? 1/7 Let g = 3 - 0. Suppose 87u - 81u - 12 = 0. Let k be (4 - (-342)/(-84))u. Which is the second smallest value? (a) 4 (b) k (c) g c Let t be ((-535)/6)/(-5) + (-6)/(-36). Suppose t - 28 = -2n. What is the second biggest value in 0.1, -0.5, n, -3? 0.1 Let h = 5.11 - 0.11. Let l = -10 + h. Let q = -0.112 + -3.888. What is the biggest value in l, -1/4, q? -1/4 Let u = 0 - -10. Let w = 10 - u. Let t = w - -5. What is the third biggest value in -0.4, t, 0.3? -0.4 Let d = -1632 + 4892/3. What is the biggest value in -1/2, d, -1/8, -5? -1/8 Let r = -9.46 + 10.46. Which is the third smallest value? (a) r (b) -4 (c) 1.1 (d) -2/9 a Let o be 1/((-1 + 3)/(-4)). Let w = 3.07 + 0.03. Let z = 2.6 - w. Which is the biggest value? (a) o (b) z (c) -0.4 c Let m = 10 + 1. Let n be (-15)/(-8)m/55. What is the third smallest value in 0, -2, n? n Let u = -161.5 - -161. What is the second biggest value in -2, u, -3? -2 Let y be (-18)/(-2) + 0/2. Let k(c) = 2c + 1. Let w be k(2). Suppose g + 9 = wj, -j + y = -3g - 4. What is the third biggest value in 4/7, -1, g? g Let q = -478.04 - -478. What is the smallest value in -4, -0.5, q, -5? -5 Let v = 128.05 + -135. Let j = -0.05 + v. Let f = 7 + j. Which is the biggest value? (a) f (b) -1/10 (c) 2 c Let m = 25 - 25.09. Let u = m + -20.91. Let s = u + 24. What is the second biggest value in -2, 5, s? s Let g = 74.2 - 69.2. Let c be (-2)/(-7) - 13/(-28). What is the second smallest value in c, 0.5, g? c Let n = 5.03 + -0.03. Let q = n + -2. Let p = -122 - -119. What is the third biggest value in 5, p, q? p Let b = -0.587 - -5.606. Let o = 0.019 - b. What is the third smallest value in -0.1, -3/5, o? -0.1 Let q(w) = w*3 + 14w*2 + 15w + 30. Let f be q(-13). Let t be 4/(-18) - -5f/90. Which is the third smallest value? (a) 4/9 (b) t (c) -0.4 a Let m be 4/(-10)55/(-33). What is the third biggest value in m, 1/2, -2? -2 Let p be 9/3*(-127108)/12. Let r = p + 4131041/130. Let i = r - 1/26. Which is the second smallest value? (a) -1 (b) -0.3 (c) i b Let b = 3.97 - 0.97. What is the second biggest value in 99, b, 4? 4 Let v = 74/5 - 844/55. What is the second smallest value in v, -1/6, 3? -1/6 Let f = 1.294 + -1.394. What is the third biggest value in -0.5, -1, 3, f? -0.5 Let p = 2779 + -80575/29. What is the fourth smallest value in -0.4, p, 0, 2/5? p Let x	{ "pile_set_name": "DM Mathematics" }
+ 3)25/75. Put 5, z, -1, d in increasing order. -1, z, d, 5 Suppose -3w - 2x + 8 = -7w, -w + 5x - 20 = 0. Let r = 20 + w. Suppose -5c + 3y = r, -3y = 3c - 5y + 13. Sort 5, 4, c in descending order. 5, 4, c Let w = -71.9 - -74.9. Sort -3, 5, w, 13 in descending order. 13, 5, w, -3 Suppose -n - 26 = s - 5n, 0 = -2s - 4n + 8. Let t(x) = 2x*2 + 14x + 13. Let y be t(s). Sort -5, y, 12 in decreasing order. 12, y, -5 Suppose 5v - 6v = -27. Suppose 0 = -5s - 2 + v, 0 = -2z - s + 15. Sort z, -1/10, -1 in descending order. z, -1/10, -1 Suppose 3b = -2u + 2, 4u - 2u = -b + 2. Suppose -3g + 2 = 3d + 8, -d = 4g - u. Let w = 1046/9 - 116. Sort g, -0.3, w in descending order. g, w, -0.3 Let f be (-2)/(-6) - 50/15. Let n be (0 - 1)/((-11)/55). Put f, 0, n in increasing order. f, 0, n Let d = -3 + 2.8. Let r = -10.16 - -0.16. Let i = 10.3 + r. Put d, 2, i in descending order. 2, i, d Let a be -2(-1 + 25/10). Let l = a + 5. Suppose 1 = -3h - 5, 0 = 4p - 3h - 10. Sort l, 0.07, p. 0.07, p, l Let l be (2/(-3) + 1)-3. Let q be ((-7)/15)/(l/(-51)). Let b = 24 + q. Put 5/6, -0.3, b in increasing order. -0.3, b, 5/6 Let f be (-60)/(-9) - 8/12. Let v be -1(3 - (f + -4)). Sort -5, -2, v. -5, -2, v Let m = 40 + -43. Let x = -63.3 - -63. Sort x, -9, -0.2, m. -9, m, x, -0.2 Let h = -478 - -481. Sort 2/3, h, 0.52 in decreasing order. h, 2/3, 0.52 Let b = 2786/405535 + 4/1835. Sort -3, b, 2 in decreasing order. 2, b, -3 Let d = -961/2 + 480. Put d, 18, 4 in increasing order. d, 4, 18 Let o = -301/34 - -85673/510. Suppose 5d = 2s - 793, 5s - 82 + 882 = -5d. Let w = o + d. Sort -4, w, -0.05 in descending order. w, -0.05, -4 Let i = -0.1184 - -35.0384. Let x = i - 35. Put -2/9, 2/17, x in descending order. 2/17, x, -2/9 Let x = 4 + -6. Let u = 1 + -1.4. Put 4, x, u in descending order. 4, u, x Suppose -1370 = 9u + 925. Let s = u + 463. Let a be (-2)/8 + 20/s. Put 9, a, -2 in descending order. 9, a, -2 Suppose -5g = -3z + 321, z + 18 = g + 83. Let j = 63 + g. Put j, -5, 2, -4 in ascending order. -5, -4, j, 2 Let n = 3 - 0. Suppose 5p + 4 = -nd, p - 3p + 2 = 0. Let l = 1 - -2. Put l, -2, d in increasing order. d, -2, l Suppose 0 = -5w - w + 246. Let y = w + -37. Sort y, 3, -8 in ascending order. -8, 3, y Let x be (-3 - 4)(-52)/(-910). Sort 2/31, -10, x in increasing order. -10, x, 2/31 Let t = -7 + 7. Let a(i) = -i2 + 21i + 18. Let r be a(22). Put -5, r, t, 1 in decreasing order. 1, t, r, -5 Let c be (-1)/2(-2)/5. Let d = 234.46 - 234.5. Let w = 13 + -9. Put c, d, w in descending order. w, c, d Let a be (-2)/(-28)(23 + -15). Put a, 7, -2/9 in decreasing order. 7, a, -2/9 Let i = -81 - -77. Put -2/3, -44, 3, i in ascending order. -44, i, -2/3, 3 Suppose -l - 2l + 18 = 0. Suppose -2q - o = -l, -3o - o - 16 = -2q. Let p(t) = -t*3 - 4t*2 - 8t - 5. Let f be p(-2). Put q, f, -3 in increasing order. -3, f, q Let l = -105 - -104. Let m(i) = -i + 5. Let p be m(7). Put p, l, 3 in ascending order. p, l, 3 Suppose -3r - 43 = -52. Put 5, 1, -13, r in increasing order. -13, 1, r, 5 Let w = 1.2 - 1.9. Let x = -983.5 + 984. Put -2, x, 4, w in descending order. 4, x, w, -2 Let v = 36 - 32. Let w(x) = -x2 + 4x + 5. Let c be w(v). Suppose -12 = -0m + 2m - s, -2m + 3s - 16 = 0. Put c, 2, m in ascending order. m, 2, c Let f = -25 - -5. Let x = f - -21. Put x, 2/3, 1/4 in increasing order. 1/4, 2/3, x Let t(q) = q*3 + 2q*2 - 2q - 1. Let z be t(-3). Let g = 5 + z. Let f be (16/(-6) - -2)3. Sort 3, g, f in decreasing order. 3, g, f Let q(u) = -u + 6. Let g be q(12). Let r = 18 + g. Let l be 8/(-7)3/r. Put -1/5, l, -1/4 in descending order. -1/5, -1/4, l Let z = -3.981 - 0.019. Let c = 37 + -39. Sort c, z, 1/3 in increasing order. z, c, 1/3 Suppose 5z = s + 4, 8 = -s + 6s + 3z. Put -2, -3, s, 16 in ascending order. -3, -2, s, 16 Let r = 95 + -96. Let j be 1 - ((r - 26)1 + 1). Put -4, -1, j in decreasing order. j, -1, -4 Let n = 6 - 5.6. Let h = -3237/110 + 316/11. Let t = h + 1/5. Sort -2, t, n in decreasing order. n, t, -2 Let w = -1 + 1.5. Let l = 0.2 + -0.1. Put w, -2/13, l in descending order. w, l, -2/13 Let h = 23 - 2. Let w = h + -18. Sort w, -2, 7, 2/11. -2, 2/11, w, 7 Let l be (-70)/21((-4)/60 - 0). Sort l, -0.02, -1/2 in increasing order. -1/2, -0.02, l Let i = 34 + -69/2. Let c be 7/(-14)(-30)/(-25). Put i, c, -3 in descending order. i, c, -3 Let t be 357/204 + (-46)/8. Put -3, 2, t, -10 in decreasing order. 2, -3, t, -10 Let r = -58.32 - 0.68. Let g = 65 + r. Put g, -2/9, -2 in decreasing order. g, -2/9, -2 Let m = -1.1426 + -0.0574. Let l = 9 - 6. Sort m, l, -1. m, -1, l Let s = 15 + -10. Suppose -5c - 3n + 34 - 35 = 0, n = -4c - 5. Sort c, s, 8/13. c, 8/13, s Suppose -3c + 2c - 16 = 4g, -3c - 12 = 0. Put g, 1, -4, 0 in descending order. 1, 0, g, -4 Suppose -4a + 2n - 18 = 0, a - 2n = -2 - 7. Let u = 220 - 220.5. Sort u, a, 4 in increasing order. a, u, 4 Let s = 31 - 22. Let v = 6 - s. Let t be 18/(-8) - -2 - 14/(-56). Put t, v, -2 in descending order. t, -2, v Let y be 22/15 - 2/3. Suppose -5 = -5k, 4 - 67 = 5j - 3k. Let w be ((-3)/(-24))/(27/j - -3). Sort w, -4, y in descending order. y, w, -4 Let j(k) = k3 - 18k*2 + 32k + 1. Let m be j(16). Sort -4, m, 12 in descending order. 12, m, -4 Let l = 3355/7861 + 2/1123. Put l, 0.1, -3, 8/3 in descending order. 8/3, l, 0.1, -3 Let z(k) be the third derivative of k4/4 + k3/2 + 26k2. Let y be z(-1). Let g = 9/4 + -3/4. Sort 0.3, g, y in decreasing order. g, 0.3, y Let r = 346 - 336. Let f = 6 + -4. Put -3, f, r in increasing order. -3, f, r Let a = 17 + -15. Let s(l) = -l + 4. Let b be s(-8). Suppose c = -2c - b. Sort c, 5, a in descending order. 5, a, c Suppose 4q + 5 - 21 = 0. Suppose -2u + 9j - 6j = 13, j + 9 = -2u. Put -3, u, -1, q in increasing order. u, -3, -1, q Let f = 122 - 121.7. Suppose -q - g = 2g + 19, -3q + 4g - 18 = 0. Let c(u) = -u*2 - 9u + 9. Let a be c(q). Sort -3, a, f in decreasing order. f, a, -3 Let c be (75/10 - 5)-2. Let k = -23 + 32. Sort c, -3, k in ascending order. c, -3, k Let p = 1/28 + 23/140. Put -12, 0, p in descending order. p, 0, -12 Let p(v) = -2v*2 - 20v + 231. Let s be p(7). Sort 5, -5, 1, s in ascending order. s, -5, 1, 5 Suppose 5t = -2m - 2, -5m - 4t = -0t + 22. Let x(w) = w - 5. Let v be x(9). Put m, v, -5, 1 in ascending order. m, -5, 1, v Let h = -1116 + 1119. Put h, 1, 15 in descending order. 15, h, 1 Let l(w) = -w + 6. Suppose k - 31 = -3k - j, -3k + 21 = 3j. Let z be l(k). Let r(a) = -7a + 104. Let c be r(15). Sort z, c, 0. z, c, 0 Let z = 14 - 8. Let t = z - 5. Suppose -5b - 14 = -4f - 2b, 2f = 5b. Sort 0, f, t in increasing order. 0, t, f Let a = 1241 + -1246. Suppose -5u - 15 = -5x, u + 9 = 2x - 4u. Suppose 4q - 16 = 4k, 2q + 2k - 22 = -xq. Sort q, a, 3 in decreasing order. q, 3, a Let l = -248.69 - -248.8. Put -1/19, l, 2/7 in descending order. 2/7, l, -1/19 Let j = 30 - 147/5. Put 1.6, j, -2, 10 in ascending order. -2, j, 1.6, 10 Let u = -3.3 - -2.3. Suppose 4j - 29 = 2f - 7f, f = 3j + 2. Let h = j - 0. Sort h, 1/5, u in decreasing order. h, 1/5, u Suppose 0 = -3z + 6, -2z + 73 = -3y + 84. Put -7, y, -27 in decreasing order. y, -7, -27 Let d be 9/(-24) - 331/(-24)3. Sort -5, -2/11, -0.5, d in descending order. d, -2/11, -0.5, -5 Suppose -128 = -2x + 28. Let z be (-12)/91 + (6 - 480/x). Sort z, -5/3, -1. -5/3, -1, z Let k = -12 + 12.18. Let y = k + 0.02. Let g = -175/666 - -3/74. Sort g, 1/3, y in descending order. 1/3, y, g Let w(d) = -6d - 10. Let y(g) = -g - 1. Let c(h) = w(h) - 5y(h). Let u be c(-5). Sort 4, -5, 2, u. -5, u, 2, 4 Suppose i + 0i = 20. Let l = -2810 + 2808. Sort l, i, 1, 5. l, 1, 5, i Let w = -1.4 + 0.4. Suppose -80a + 120a = -400. Sort -0.5, w, a. a, w, -0.5 Let n be 18/(-8) + (-12)/16. Suppose -11s + 18 = -8s. Let l be 5/1(7 + s + -12). Sort 2, l, n in descending order. l, 2, n Let r = 15 - 12. Suppose -3n + 71 = -4p, -rp + 5p = 2. Suppose -n = 6z - z. Sort z, -3, -4. z, -4, -3 Suppose -376 = -118b + 120b. Let v = 181 + b. Let n(m) = -m3 - 3m*2 + 5m + 4. Let j be n(-4). Sort 3, j, v in descending order. 3, j, v Let w(t) = -t + 5. Let g be w(7). Let x(y) = -y**2 - 2. Let d be x(g). Let r be (-4)/22 - d/33. S	{ "pile_set_name": "DM Mathematics" }
M? 8:18 PM What is 661 minutes before 12:04 PM? 1:03 AM How many minutes are there between 12:38 AM and 9:03 AM? 505 What is 355 minutes before 11:42 PM? 5:47 PM What is 135 minutes after 1:08 PM? 3:23 PM How many minutes are there between 6:38 PM and 4:08 AM? 570 What is 223 minutes after 2:52 PM? 6:35 PM How many minutes are there between 8:08 AM and 1:39 PM? 331 What is 424 minutes before 2:02 PM? 6:58 AM How many minutes are there between 10:14 PM and 10:25 PM? 11 What is 19 minutes before 11:43 AM? 11:24 AM What is 586 minutes before 5:33 PM? 7:47 AM What is 612 minutes after 8:18 AM? 6:30 PM What is 353 minutes before 11:02 PM? 5:09 PM How many minutes are there between 1:27 AM and 6:06 AM? 279 How many minutes are there between 10:44 PM and 5:30 AM? 406 What is 300 minutes after 1:55 AM? 6:55 AM How many minutes are there between 1:25 AM and 7:31 AM? 366 How many minutes are there between 11:54 AM and 2:58 PM? 184 What is 582 minutes after 7:58 AM? 5:40 PM What is 231 minutes before 10:30 PM? 6:39 PM What is 578 minutes after 12:16 PM? 9:54 PM How many minutes are there between 6:20 AM and 7:49 AM? 89 How many minutes are there between 8:34 PM and 4:58 AM? 504 What is 704 minutes after 1:11 AM? 12:55 PM What is 466 minutes before 9:09 AM? 1:23 AM How many minutes are there between 11:12 PM and 2:49 AM? 217 What is 692 minutes after 1:20 AM? 12:52 PM What is 367 minutes after 3:09 AM? 9:16 AM How many minutes are there between 2:01 AM and 12:19 PM? 618 What is 60 minutes after 6:30 AM? 7:30 AM What is 341 minutes after 6:43 PM? 12:24 AM How many minutes are there between 11:56 PM and 11:38 AM? 702 What is 295 minutes after 1:00 AM? 5:55 AM What is 405 minutes after 1:24 AM? 8:09 AM How many minutes are there between 1:44 AM and 7:29 AM? 345 How many minutes are there between 7:44 AM and 9:44 AM? 120 What is 690 minutes after 9:09 AM? 8:39 PM How many minutes are there between 11:35 AM and 12:27 PM? 52 How many minutes are there between 11:33 AM and 4:57 PM? 324 How many minutes are there between 7:26 PM and 5:33 AM? 607 How many minutes are there between 4:21 PM and 11:11 PM? 410 What is 35 minutes before 6:27 PM? 5:52 PM What is 250 minutes before 2:11 AM? 10:01 PM How many minutes are there between 8:33 AM and 12:42 PM? 249 How many minutes are there between 3:17 PM and 12:05 AM? 528 How many minutes are there between 10:12 AM and 4:25 PM? 373 How many minutes are there between 9:59 PM and 11:30 PM? 91 What is 12 minutes after 1:45 AM? 1:57 AM What is 88 minutes after 8:13 AM? 9:41 AM How many minutes are there between 12:52 AM and 2:58 AM? 126 What is 405 minutes before 10:56 PM? 4:11 PM How many minutes are there between 9:20 AM and 4:05 PM? 405 What is 304 minutes after 8:24 PM? 1:28 AM What is 321 minutes after 10:21 AM? 3:42 PM How many minutes are there between 12:46 AM and 6:09 AM? 323 What is 342 minutes after 8:02 AM? 1:44 PM What is 644 minutes after 12:18 AM? 11:02 AM What is 324 minutes after 1:16 AM? 6:40 AM What is 647 minutes before 4:05 PM? 5:18 AM What is 664 minutes before 8:21 PM? 9:17 AM What is 176 minutes before 8:30 PM? 5:34 PM What is 296 minutes after 2:06 PM? 7:02 PM What is 584 minutes after 1:21 PM? 11:05 PM What is 40 minutes before 7:45 PM? 7:05 PM How many minutes are there between 12:27 PM and 7:15 PM? 408 How many minutes are there between 6:10 AM and 5:41 PM? 691 What is 97 minutes after 1:30 PM? 3:07 PM What is 355 minutes before 6:18 PM? 12:23 PM How many minutes are there between 10:19 AM and 8:11 PM? 592 How many minutes are there between 2:42 PM and 2:00 AM? 678 What is 184 minutes before 2:10 AM? 11:06 PM How many minutes are there between 10:39 AM and 4:04 PM? 325 How many minutes are there between 9:49 AM and 9:22 PM? 693 What is 371 minutes after 6:55 AM? 1:06 PM What is 344 minutes before 7:46 AM? 2:02 AM What is 689 minutes before 1:43 PM? 2:14 AM What is 456 minutes after 8:08 PM? 3:44 AM What is 322 minutes after 9:42 PM? 3:04 AM How many minutes are there between 10:00 AM and 3:13 PM? 313 How many minutes are there between 5:11 PM and 7:51 PM? 160 What is 277 minutes after 4:34 PM? 9:11 PM What is 176 minutes before 5:10 AM? 2:14 AM What is 708 minutes before 12:13 PM? 12:25 AM What is 394 minutes after 3:01 PM? 9:35 PM How many minutes are there between 9:38 PM and 12:24 AM? 166 How many minutes are there between 2:37 PM and 6:35 PM? 238 How many minutes are there between 2:02 PM and 2:08 PM? 6 What is 610 minutes after 2:37 AM? 12:47 PM How many minutes are there between 12:21 AM and 9:05 AM? 524 What is 160 minutes after 7:22 AM? 10:02 AM How many minutes are there between 5:00 AM and 6:07 AM? 67 What is 618 minutes after 10:35 AM? 8:53 PM How many minutes are there between 9:52 PM and 6:14 AM? 502 What is 578 minutes after 2:59 PM? 12:37 AM How many minutes are there between 3:28 PM and 4:10 PM? 42 What is 520 minutes before 1:11 AM? 4:31 PM How many minutes are there between 7:01 PM and 2:10 AM? 429 What is 19 minutes before 10:13 AM? 9:54 AM What is 145 minutes after 9:59 PM? 12:24 AM What is 353 minutes before 8:55 PM? 3:02 PM What is 419 minutes after 2:30 AM? 9:29 AM How many minutes are there between 2:01 AM and 12:17 PM? 616 How many minutes are there between 10:53 AM and 7:17 PM? 504 How many minutes are there between 10:06 PM and 6:16 AM? 490 What is 398 minutes after 5:30 PM? 12:08 AM How many minutes are there between 4:08 AM and 8:54 AM? 286 How many minutes are there between 2:35 AM and 1:00 PM? 625 How many minutes are there between 10:43 AM and 9:17 PM? 634 What is 49 minutes after 1:07 PM? 1:56 PM How many minutes are there between 8:57 AM and 6:39 PM? 582 How many minutes are there between 10:38 AM and 5:38 PM? 420 What is 121 minutes before 1:59 PM? 11:58 AM How many minutes are there between 11:46 AM and 12:55 PM? 69 What is 325 minutes before 3:36 AM? 10:11 PM How many minutes are there between 12:10 AM and 8:54 AM? 524 What is 660 minutes after 4:30 AM? 3:30 PM What is 705 minutes before 4:09 PM? 4:24 AM How many minutes are there between 7:27 AM and 10:44 AM? 197 How many minutes are there between 10:52 AM and 7:40 PM? 528 What is 33 minutes before 2:29 PM? 1:56 PM What is 702 minutes before 6:33 AM? 6:51 PM How many minutes are there between 3:34 AM and 9:46 AM? 372 How many minutes are there between 11:45 AM and 8:12 PM? 507 How many minutes are there between 3:52 PM and 8:06 PM? 254 How many minutes are there between 7:35 AM and 1:20 PM? 345 What is 492 minutes after 12:21 AM? 8:33 AM What is 265 minutes before 11:24 AM? 6:59 AM What is 699 minutes before 11:37 AM? 11:58 PM How many minutes are there between 7:51 AM and 8:35 AM? 44 How many minutes are there between 1:49 AM and 3:11 AM? 82 How many minutes are there between 10:27 PM and 7:43 AM? 556 How many minutes are there between 7:56 PM and 2:08 AM? 372 How many minutes are there between 8:56 PM and 2:27 AM? 331 How many minutes are there between 7:23 PM and 9:13 PM? 110 How many minutes are there between 4:45 PM and 2:21 AM? 576 How many minutes are there between 12:00 PM and 8:23 PM? 503 How many minutes are there between 10:51 PM and 2:55 AM? 244 What is 14 minutes before 5:36 PM? 5:22 PM What is 394 minutes after 3:04 AM? 9:38 AM What is 19 minutes before 11:32 AM? 11:13 AM How many minutes are there between 10:46 AM and 5:28 PM? 402 What is 709 minutes before 12:46 PM? 12:57 AM How many minutes are there between 6:14 AM and 4:00 PM? 586 What is 597 minutes before 3:18 PM? 5:21 AM How many minutes are there between 10:42 AM and 10:36 PM? 714 What is 685 minutes before 11:36 AM? 12:11 AM How many minutes are there between 7:36 AM and 5:28 PM? 592 What is 231 minutes before 4:36 AM? 12:45 AM How many minutes are there between 8:26 AM and 11:05 AM? 159 What is 107 minutes before 8:51 AM? 7:04 AM How many minutes are there between 8:21 AM and 5:05 PM? 524 What is 669 minutes before 3:48 AM? 4:39 PM How many minutes are there between 1:02 PM and 3:08 PM? 126 How many minutes are there between 6:20 PM and 4:05 AM? 585 What is 217 minutes after 7:29 PM? 11:06 PM What is 194 minutes before 3:58 AM? 12:44 AM How many minutes are there between 12:17 AM and 11:50 AM? 693 How many minutes are there between 6	{ "pile_set_name": "DM Mathematics" }
picking 1 c and 1 s. 2/3 What is prob of picking 1 m and 2 c when three letters picked without replacement from {r: 8, m: 2, p: 2, j: 1, c: 1}? 0 Three letters picked without replacement from fdddhdddaadhahhahsa. Give prob of picking 1 a, 1 s, and 1 h. 25/969 Three letters picked without replacement from nnni. What is prob of picking 2 n and 1 i? 3/4 Four letters picked without replacement from {e: 3, g: 4, p: 1}. Give prob of picking 1 g and 3 e. 2/35 Three letters picked without replacement from {g: 1, q: 1, h: 1, c: 1, p: 1}. What is prob of picking 1 c and 2 h? 0 Calculate prob of picking 3 t when three letters picked without replacement from tttttwtwt. 5/12 Two letters picked without replacement from zftrrzzz. Give prob of picking 1 z and 1 f. 1/7 Three letters picked without replacement from {i: 2, z: 4, t: 8, f: 3, e: 2, a: 1}. Give prob of picking 1 t and 2 e. 2/285 Two letters picked without replacement from iivxviwivixiaw. Give prob of picking 2 v. 3/91 What is prob of picking 1 r and 1 g when two letters picked without replacement from {g: 4, r: 1, y: 4, e: 2, i: 3}? 4/91 Two letters picked without replacement from yhuujyfhjshfffhfjjfs. What is prob of picking 1 y and 1 f? 6/95 Calculate prob of picking 1 c, 1 x, and 1 k when three letters picked without replacement from {r: 1, k: 4, c: 1, x: 9}. 36/455 Calculate prob of picking 2 n when two letters picked without replacement from nnpnpggnppg. 6/55 What is prob of picking 2 f, 1 m, and 1 b when four letters picked without replacement from mfbnffmf? 6/35 What is prob of picking 3 f when three letters picked without replacement from ffffffffff? 1 Calculate prob of picking 1 t, 1 y, and 2 n when four letters picked without replacement from ytxybyynnx. 2/105 Three letters picked without replacement from {g: 2, f: 4, l: 4}. What is prob of picking 2 g and 1 f? 1/30 Two letters picked without replacement from {m: 2, l: 1}. Give prob of picking 2 m. 1/3 Calculate prob of picking 1 m and 3 z when four letters picked without replacement from xmzdxxzxxdzdxxzzzmzz. 112/4845 What is prob of picking 3 w when three letters picked without replacement from kwkww? 1/10 What is prob of picking 2 l and 1 o when three letters picked without replacement from nllllofonffofnnlll? 21/272 Two letters picked without replacement from {d: 5, f: 1, l: 1, m: 2, e: 5, c: 1}. Give prob of picking 1 d and 1 l. 1/21 What is prob of picking 1 v, 1 o, and 1 h when three letters picked without replacement from {h: 2, g: 1, v: 3, o: 1}? 6/35 Three letters picked without replacement from kkkkkkkkdkkkkdkxd. What is prob of picking 2 d and 1 x? 3/680 Two letters picked without replacement from odoaoflol. What is prob of picking 1 a and 1 l? 1/18 Two letters picked without replacement from {p: 2, f: 2, g: 1, r: 1, m: 1}. What is prob of picking 1 f and 1 r? 2/21 What is prob of picking 1 z, 1 c, and 1 f when three letters picked without replacement from aayfjyycfzzyfajfyff? 4/323 Two letters picked without replacement from mjxjgnj. What is prob of picking 1 j and 1 m? 1/7 What is prob of picking 2 s and 2 e when four letters picked without replacement from {a: 7, n: 2, e: 3, s: 8}? 28/1615 What is prob of picking 4 y when four letters picked without replacement from jjjyjjyyjyjjjyjjjy? 1/204 What is prob of picking 1 g and 1 u when two letters picked without replacement from uuuguuuuggguugguuss? 22/57 Calculate prob of picking 1 w, 1 h, and 1 u when three letters picked without replacement from {h: 1, w: 1, u: 1, v: 1, e: 1}. 1/10 Calculate prob of picking 1 h and 2 q when three letters picked without replacement from rhrxrhxqxxhrrxxqrqr. 3/323 Calculate prob of picking 1 n and 1 u when two letters picked without replacement from {o: 1, n: 2, u: 1, g: 2, m: 1, h: 2}. 1/18 Two letters picked without replacement from mhaxamhaaxaxx. What is prob of picking 1 a and 1 x? 10/39 What is prob of picking 1 l and 1 m when two letters picked without replacement from mlmmllmmjjmmjmjljmj? 4/19 Calculate prob of picking 2 p and 1 d when three letters picked without replacement from {d: 1, t: 1, p: 3}. 3/10 What is prob of picking 2 f, 1 b, and 1 m when four letters picked without replacement from ftmmbmf? 3/35 Two letters picked without replacement from pbdmddddp. What is prob of picking 1 b and 1 d? 5/36 Two letters picked without replacement from phvhhhprhw. What is prob of picking 2 h? 2/9 What is prob of picking 3 r when three letters picked without replacement from {r: 3, z: 4, j: 9}? 1/560 Four letters picked without replacement from voooovoooov. What is prob of picking 2 v and 2 o? 14/55 Two letters picked without replacement from xwwxwxxxxxxxwxxxxxx. What is prob of picking 1 x and 1 w? 20/57 Calculate prob of picking 1 o, 2 x, and 1 r when four letters picked without replacement from {x: 1, r: 11, o: 2, h: 5}. 0 Calculate prob of picking 1 w and 3 k when four letters picked without replacement from {k: 5, m: 3, w: 1, h: 11}. 2/969 Calculate prob of picking 2 p, 1 y, and 1 r when four letters picked without replacement from nnyprpprpprrprvvrr. 7/204 Two letters picked without replacement from {l: 1, z: 2}. Give prob of picking 2 z. 1/3 Three letters picked without replacement from {c: 9, u: 3, r: 5, w: 1}. What is prob of picking 1 c, 1 u, and 1 r? 45/272 Three letters picked without replacement from iiiitataeiteiitiaik. Give prob of picking 1 k and 2 t. 2/323 Calculate prob of picking 1 j and 3 f when four letters picked without replacement from {j: 2, f: 16}. 56/153 Two letters picked without replacement from pdpqkipikipv. Give prob of picking 2 k. 1/66 Three letters picked without replacement from {w: 2, f: 2, x: 9}. Give prob of picking 1 f, 1 x, and 1 w. 18/143 Three letters picked without replacement from {d: 10, n: 1, e: 2, p: 3}. What is prob of picking 2 p and 1 e? 3/280 Calculate prob of picking 1 v and 2 d when three letters picked without replacement from bvaddbdvubd. 4/55 What is prob of picking 4 m when four letters picked without replacement from smmssmm? 1/35 What is prob of picking 1 u and 1 g when two letters picked without replacement from {g: 11, u: 3}? 33/91 What is prob of picking 3 g and 1 v when four letters picked without replacement from vggggvgggx? 1/3 Three letters picked without replacement from {k: 5, m: 2, q: 4}. What is prob of picking 2 k and 1 q? 8/33 Two letters picked without replacement from skxxsysvkykk. What is prob of picking 1 s and 1 k? 2/11 Four letters picked without replacement from xdxxhxxdxxda. What is prob of picking 1 a, 1 h, and 2 x? 7/165 Calculate prob of picking 1 q and 3 r when four letters picked without replacement from {q: 1, r: 11, i: 5, w: 2, d: 1}. 11/323 Calculate prob of picking 1 t, 1 v, and 1 c when three letters picked without replacement from cctttvvttvtcvcv. 24/91 Two letters picked without replacement from {g: 3, t: 1, m: 5, l: 1, k: 2}. Give prob of picking 1 k and 1 m. 5/33 Two letters picked without replacement from {j: 9, q: 1, a: 1, v: 6, z: 2}. What is prob of picking 1 a and 1 v? 2/57 What is prob of picking 1 p, 1 n, and 1 f when three letters picked without replacement from {p: 4, f: 7, n: 6}? 21/85 Calculate prob of picking 2 g when two letters picked without replacement from agug. 1/6 Three letters picked without replacement from {t: 4, n: 6}. Give prob of picking 3 n. 1/6 Three letters picked without replacement from {n: 1, z: 2, e: 2, r: 4, c: 3}. Give prob of picking 2 r and 1 c. 9/110 Three letters picked without replacement from chcchcc. What is prob of picking 2 c and 1 h? 4/7 Four letters picked without replacement from {i: 5, c: 1, b: 12}. Give prob of picking 2 i, 1 c, and 1 b. 2/51 Calculate prob of picking 2 c when two letters picked without replacement from {d: 1, s: 1, a: 5, c: 12}. 22/57 Two letters picked without replacement from nnannnbnbaanbnnnnnnb. Give prob of picking 1 b and 1 a. 6/95 Four letters picked without replacement from {s: 3, u: 1, j: 3, t: 5, g: 1}. Give prob of picking 3 j and 1 u. 1/715 Calculate prob of picking 1 b and 1 f when two letters picked without replacement from fhfffbbfbb. 4/9 What is prob of picking 2 m when two letters picked without replacement from ljmjjjvjmlmjjjjljvj? 1/57 Four letters picked withou	{ "pile_set_name": "DM Mathematics" }
) + 1309 Simplify 3sqrt(2) + 2 + -2(sqrt(2) + 1sqrt(2))2. -14 + 3sqrt(2) Simplify (5(sqrt(2) + 1) + 1 - 3(sqrt(2) + sqrt(18) + -3))*2. -210sqrt(2) + 323 Simplify (-2(sqrt(300) - (sqrt(300) - (sqrt(300) + -5))))2. -400sqrt(3) + 1300 Simplify -2((sqrt(255)/(sqrt(20)/sqrt(4)) - sqrt(51))/(sqrt(243)-1 + sqrt(3)))*2. 0 Simplify (2 + 1 + -1sqrt(147))*2. -42sqrt(3) + 156 Simplify (sqrt(1782)1)/(2sqrt(539)). 9sqrt(2)/14 Simplify 3 + sqrt(832) - 6sqrt(52). -4sqrt(13) + 3 Simplify -3 + sqrt(28)/((sqrt(32) + sqrt(128)/sqrt(4))/sqrt(8)). -3 + sqrt(7)/2 Simplify (-3sqrt(65)-1)/(sqrt(5) - (sqrt(605)2 - sqrt(605))). -3sqrt(13)/10 Simplify sqrt(17) + sqrt(68)/sqrt(4) + -5 + 6(sqrt(17) - sqrt(17)2). -4sqrt(17) - 5 Simplify sqrt(19)13 - (-1 + sqrt(19) + 0 - sqrt(19)). 1 + 3sqrt(19) Simplify (-3sqrt(528) + sqrt(528))/sqrt(3). -8sqrt(11) Simplify -4(-1 + sqrt(7) + -1). -4sqrt(7) + 8 Simplify (sqrt(100)-2 + sqrt(100))/(2sqrt(125)). -sqrt(5)/5 Simplify sqrt(8)/(sqrt(44)/(sqrt(33)/sqrt(3))). sqrt(2) Simplify (sqrt(34) + -3sqrt(136)/sqrt(4) + sqrt(34))/(sqrt(6)/sqrt(3)-5). sqrt(17)/5 Simplify sqrt(170)/(sqrt(250)-2 - sqrt(10)). -sqrt(17)/11 Simplify (sqrt(208) - (-1 + sqrt(208)) - (5 + sqrt(156)/sqrt(3)))*2. 16sqrt(13) + 68 Simplify (-4(-2(sqrt(1008) - -1sqrt(1008)) - (sqrt(1008) + -1sqrt(1008))2))2. 258048 Simplify (sqrt(1980)1)/(sqrt(55)/(sqrt(33)/sqrt(3)) + sqrt(5)) + 0. 3sqrt(11) Simplify sqrt(12)/(sqrt(4) - 2sqrt(324)). -sqrt(3)/17 Simplify -3(-1sqrt(832))*2. -2496 Simplify (sqrt(102) - 2-1sqrt(102))/(2sqrt(600)). 3sqrt(17)/20 Simplify 5 + sqrt(1100) + (1 + sqrt(1100) + sqrt(1100))-2. -30sqrt(11) + 3 Simplify (sqrt(189)/sqrt(3))2 + 5. 68 Simplify sqrt(80)/sqrt(4) + -5. -5 + 2sqrt(5) Simplify (((sqrt(114) - (1sqrt(114) - sqrt(114)))6)/(sqrt(24)1))2. 171 Simplify ((1sqrt(72) - sqrt(72)) + -1 + (sqrt(72) - (sqrt(72) - (sqrt(72) - (sqrt(72) + -1 + sqrt(72) - sqrt(72))4))))2. -108sqrt(2) + 657 Simplify (sqrt(2) + sqrt(2) + (1sqrt(4))/sqrt(2) + -1)4. -4 + 12sqrt(2) Simplify -4((sqrt(99)/sqrt(3))/sqrt(11) + sqrt(3)). -8sqrt(3) Simplify (-1sqrt(11)2)2 + 0. 44 Simplify (sqrt(50) + sqrt(5000)3 + sqrt(5000))/(4(-3sqrt(10) - sqrt(10))). -41sqrt(5)/16 Simplify (-4(sqrt(119) - (sqrt(119) - sqrt(119)-1)))/sqrt(7). 4sqrt(17) Simplify 2 + (sqrt(45) - (sqrt(45) + -1)) + -3 + -2. -2 Simplify (((-2sqrt(121) + sqrt(121) - sqrt(121))-6)/(sqrt(176)/sqrt(4)))*2. 396 Simplify -3(2sqrt(190))/sqrt(10). -6sqrt(19) Simplify -4 + sqrt(13) + -1 + (-3sqrt(78) - sqrt(78) - sqrt(78))/sqrt(6). -4sqrt(13) - 5 Simplify -4((sqrt(243) - -1sqrt(243)) + 1sqrt(243) + -5). -108sqrt(3) + 20 Simplify -1 + sqrt(75)1. -1 + 5sqrt(3) Simplify sqrt(66)/(sqrt(42)/sqrt(7)) + (sqrt(11) - (-5(sqrt(11) + 1))2). -300 - 48sqrt(11) Simplify (1sqrt(784) - sqrt(784))/(sqrt(128)-3). 0 Simplify (sqrt(78)3)/sqrt(6)-1. -3sqrt(13) Simplify 5((sqrt(147)-1 - sqrt(147) - sqrt(147)) + sqrt(147)). -70sqrt(3) Simplify (5(-1 + sqrt(300)) + -1sqrt(300)-2)2. -700sqrt(3) + 14725 Simplify (sqrt(2299)-3 + sqrt(19) - sqrt(19))-4. 132sqrt(19) Simplify (-3sqrt(117) - sqrt(117) - sqrt(117))/sqrt(9)-52. 50sqrt(13) Simplify (-2sqrt(119)4 + sqrt(119))/(sqrt(7) - (2sqrt(70))/sqrt(10)). 7sqrt(17) Simplify (sqrt(30) + sqrt(60)/sqrt(8))/((-1sqrt(110))/sqrt(11)). -3sqrt(3)/2 Simplify 4sqrt(117)5. 60sqrt(13) Simplify (sqrt(84)/sqrt(4)-4)/(sqrt(252)/sqrt(4)). -4sqrt(3)/3 Simplify 1 + sqrt(500) + (2sqrt(20)/sqrt(4))2. 21 + 10sqrt(5) Simplify sqrt(76) - (sqrt(76) + (sqrt(76) - (sqrt(76)1 + -1)))2. -77 - 2sqrt(19) Simplify (3 + (1(sqrt(153) + 1sqrt(153)))/sqrt(9))-6. -12sqrt(17) - 18 Simplify -4 + 5(sqrt(162) - (3 + sqrt(162)))2. 41 Simplify 4(sqrt(684)-5 + sqrt(684))-2. 192sqrt(19) Simplify (sqrt(17) + 1)2 + 3 + (1sqrt(17)-3)2. 2sqrt(17) + 174 Simplify (4sqrt(156)1)/(sqrt(24)/(sqrt(2)-2) + sqrt(12)). 8sqrt(13) Simplify 1(0 + -6sqrt(27)). -18sqrt(3) Simplify -2 + sqrt(2) + 4 - (sqrt(14)/sqrt(28))2. sqrt(2) + 3/2 Simplify 4 + (sqrt(675)2 - sqrt(27))/sqrt(9). 4 + 9sqrt(3) Simplify (-1(-1sqrt(84) + sqrt(84)))/sqrt(12) - ((sqrt(175) + (1sqrt(175))2 - sqrt(7)) + -2 + (sqrt(7) - sqrt(21)/sqrt(3))2). -173 - 4sqrt(7) Simplify (sqrt(720) - (sqrt(720) + (sqrt(720)1 + sqrt(720) - sqrt(720)) + sqrt(720) + sqrt(720)))/sqrt(10). -18sqrt(2) Simplify (-2 + sqrt(63))2 + (sqrt(7) - (sqrt(63)2)*2) + -4. -189 - 11sqrt(7) Simplify (sqrt(12)5)21. 300 Simplify (-2 + sqrt(6)/sqrt(3)3 + 5)2. 18sqrt(2) + 27 Simplify (-6(sqrt(180) + sqrt(180) + (sqrt(180) + -1 + sqrt(180))5))*2. -25920sqrt(5) + 934020 Simplify 2 + -2(sqrt(1300) + 2)2. -2606 - 80sqrt(13) Simplify (-1 + sqrt(44) + 5)5. 20 + 10sqrt(11) Simplify 51sqrt(2736) + sqrt(2736) + ((13sqrt(2736) - sqrt(2736))*2 - sqrt(2736)). 60sqrt(19) + 10944 Simplify 1sqrt(405) - (3 + sqrt(80)). -3 + 5sqrt(5) Simplify (sqrt(68) + (sqrt(68) - (sqrt(68) + sqrt(68)2)-5))/((sqrt(12) - sqrt(588))/sqrt(3)). -17sqrt(17)/6 Simplify sqrt(84)/((sqrt(132) - (sqrt(132) - sqrt(132)-3))/sqrt(11)). -sqrt(7)/3 Simplify (sqrt(114) + -6(1sqrt(114) + sqrt(114)))/(-5sqrt(18)/sqrt(3)). 11sqrt(19)/5 Simplify ((sqrt(1029) - (sqrt(1029) - (sqrt(1029) + sqrt(1029)-2) - sqrt(1029)))/(sqrt(24)/(sqrt(128) + sqrt(8))))2. 0 Simplify (-3 + sqrt(1539) + sqrt(228)/(sqrt(96)/sqrt(8)))2. -60sqrt(19) + 1909 Simplify (-6((sqrt(171) - sqrt(171)-2) + sqrt(171)) + sqrt(171) + sqrt(171) + sqrt(171))/(1sqrt(324) - sqrt(9)). -21sqrt(19)/5 Simplify sqrt(242)-2 + sqrt(242) + 2. -11sqrt(2) + 2 Simplify ((3 + 1 + sqrt(76))-1)2. 16sqrt(19) + 92 Simplify (sqrt(162) - (-1sqrt(162) - sqrt(162))) + -5 + -31sqrt(162). -5 Simplify 4 + -2(sqrt(35)/sqrt(5) + 2)*2. -8sqrt(7) - 18 Simplify sqrt(6)/(2sqrt(147)). sqrt(2)/14 Simplify (sqrt(572)/sqrt(99))2 + -4. 16/9 Simplify (1sqrt(11) - sqrt(11))*2 + -2 - 2sqrt(88)/sqrt(8). -2sqrt(11) - 2 Simplify sqrt(95)/(sqrt(5) - (sqrt(5)-2-2 - sqrt(5) - sqrt(5))). -sqrt(19) Simplify (2 + sqrt(88)/sqrt(8) + sqrt(11) + sqrt(11))2 + sqrt(55)/(sqrt(5)-1). 11sqrt(11) + 103 Simplify (-3sqrt(91)1)/sqrt(7). -3sqrt(13) Simplify ((sqrt(25) - sqrt(100)/sqrt(4))/sqrt(5) + sqrt(5))2 + (sqrt(180)/sqrt(3))/sqrt(12). sqrt(5) + 5 Simplify 3 + (sqrt(160)/(sqrt(56)/(sqrt(28)/sqrt(4))))2. 23 Simplify 4(sqrt(200)-3)*2 + 0. 7200 Simplify 5-2sqrt(3) - (sqrt(3) - (2 + sqrt(6)/sqrt(2))). -10sqrt(3) + 2 Simplify sqrt(208) - (sqrt(208) + 2) - -1sqrt(6292). -2 + 22sqrt(13) Simplify ((sqrt(300) + 3sqrt(300))/sqrt(6))/(4sqrt(10)-2). -sqrt(5)/2 Simplify sqrt(28)/(sqrt(16)-4). -sqrt(7)/8 Simplify (4(2sqrt(9072) + sqrt(63) + sqrt(63) + sqrt(63))/sqrt(9))*2. 81648 Simplify (sqrt(704)-2 - (sqrt(110)/sqrt(2))/sqrt(5))*2. 3179 Simplify ((sqrt(68)-2)/sqrt(4))*2 - ((sqrt(17) + sqrt(272) - sqrt(17)) + -2). -4sqrt(17) + 70 Simplify (-6(sqrt(1377) + -3)-6)*2. -69984sqrt(17) + 1796256 Simplify (sqrt(1617)-2 + sqrt(33) + sqrt(33))/((-1sqrt(36))/sqrt(12)). 12sqrt(11) Simplify 4 + (sqrt(242) - (5 + -1 + sqrt(242))2). -254 - 77sqrt(2) Simplify (sqrt(1700) + sqrt(1700) + -2 + sqrt(1700)-2)2. 4 Simplify sqrt(32)1 + (sqrt(14)/(sqrt(14)/sqrt(2)) + sqrt(2))*2 + (sqrt(242) - (sqrt(242)2-3)2). -8704 + 15sqrt(2) Simplify ((sqrt(5) + -61sqrt(5))5)2. 3125 Simplify ((-5sqrt(330)/sqrt(6))/sqrt(720))*2. 275/144 Simplify -2((sqrt(405) - (sqrt(405) - (sqrt(405) + 0))) + sqrt(5))*2. -1000 Simplify (sqrt(132) + sqrt(132) + sqrt(132)-2 + sqrt(132) - sqrt(33))/sqrt(3) + sqrt(275)1-2. -9sqrt(11) Simplify -1 + 3 + sqrt(11) + sqrt(11) + sqrt(99). 2 + 5sqrt(11) Simplify (4(sqrt(63) + sqrt(126)/sqrt(2)))/(sqrt(9) - sqrt(324)3). -8sqrt(7)/17 Simplify sqrt(52)/(sqrt(24)/sqrt(6)) + (sqrt(468) + 4 - sqrt(13) - sqrt(13))2. 33sqrt(13) + 224 Simplify sqrt(20)/(sqrt(360) + (sqrt(360) - sqrt(360)-1) + sqrt(360)). sqrt(2)/24 Simplify 2 + (3 + sqrt(11) + 0 - sqrt(11))-4. -10 Simplify (sqrt(98) + sqrt(98)3 - sqrt(72)2)*2. 512 Simplify ((-1sqrt(1088)-4 - sqrt(1088)) + -1)2. -48sqrt(17) + 9793 Simplify 6(0 + sqrt(5) + 0). 6sqrt(5) Simplify (2(sqrt(605) + 0))*2. 2420 Simplify (((sqrt(153) - (sqrt(153	{ "pile_set_name": "DM Mathematics" }
89 composite? False Is 1852111 a prime number? True Is 17304223 a composite number? False Is 53631271 a prime number? False Is 824203 a prime number? False Is 97662023 a composite number? False Is 1063282177 a composite number? False Is 3702367 prime? False Is 563591 composite? True Is 7427561 prime? True Is 2451907 composite? False Is 66952349 a prime number? True Is 61281163 a prime number? True Is 3993205 composite? True Is 446287 a composite number? True Is 1361219 a composite number? True Is 29980543 composite? False Is 30203671 composite? False Is 34959697 a composite number? True Is 4206091 a composite number? False Is 6687839 a composite number? True Is 33340105 a composite number? True Is 78089545 composite? True Is 14270521 composite? False Is 29708677 a composite number? False Is 465739 prime? True Is 27706307 a prime number? True Is 11162509 a prime number? False Is 600443 composite? True Is 1322709 a composite number? True Is 1765507 prime? True Is 72686 prime? False Is 4667813 composite? False Is 1079711 a composite number? False Is 32892109 a prime number? False Is 128577349 a prime number? False Is 1968521 a prime number? True Is 559914569 a prime number? False Is 1417573 prime? True Is 4501117 composite? True Is 19187437 a composite number? False Is 11013221 a composite number? True Is 963461 prime? True Is 1477 a composite number? True Is 16805707 a composite number? True Is 75672061 a composite number? True Is 13160339 composite? False Is 165363851 a composite number? False Is 35365481 prime? False Is 38934527 a prime number? True Is 2373691 composite? False Is 1692283 a composite number? False Is 1030291 prime? True Is 1141801 a composite number? False Is 4568687 prime? False Is 360121 composite? True Is 6898483 prime? True Is 53094179 prime? False Is 71171029 prime? True Is 1238423 composite? False Is 186437 composite? False Is 55279339 prime? True Is 42897839 prime? False Is 5806217 a composite number? False Is 183050782 prime? False Is 260155477 a prime number? True Is 146081549 a prime number? True Is 2864713 a prime number? True Is 4038131 a prime number? False Is 157757937 composite? True Is 10075439 a composite number? True Is 351997483 composite? False Is 59231521 composite? False Is 61186951 a prime number? False Is 104650311 a prime number? False Is 982643 a composite number? False Is 209617901 prime? True Is 383533 composite? False Is 3482851 a composite number? False Is 11993403 composite? True Is 283801543 a prime number? True Is 1925087 prime? True Is 1821907 a prime number? False Is 17285893 a composite number? False Is 5575387 a composite number? False Is 79875511 a composite number? False Is 264261091 prime? True Is 17804503 composite? False Is 15302681 prime? True Is 55778231 composite? False Is 2201123 a composite number? True Is 35169419 a composite number? False Is 18283207 composite? True Is 66857137 composite? False Is 157027057 prime? False Is 18551459 a composite number? False Is 63069771 a composite number? True Is 10706987 a prime number? False Is 18224149 a prime number? True Is 626341 composite? False Is 128894501 composite? False Is 727713967 a prime number? True Is 22022389 prime? True Is 275611127 a composite number? True Is 314286101 a composite number? False Is 1864331 prime? False Is 69008669 composite? True Is 42526609 composite? True Is 152203119 a composite number? True Is 6442199 a prime number? False Is 1990867 prime? True Is 2910487 a composite number? False Is 131421947 a composite number? False Is 128737619 a composite number? True Is 2374261 a composite number? False Is 12967601 composite? False Is 16435103 a composite number? False Is 15680723 composite? True Is 261403 composite? True Is 3862 prime? False Is 395873 composite? False Is 114619213 composite? False Is 1429173541 a composite number? False Is 285720517 a prime number? True Is 3758691 composite? True Is 2956019 a composite number? True Is 100244099 prime? True Is 31804999 a composite number? False Is 376183 prime? True Is 2012597 prime? True Is 914918 composite? True Is 3551511 prime? False Is 10006151 a prime number? True Is 7043017 composite? False Is 7432223 prime? False Is 372971 a composite number? False Is 80788849 composite? False Is 78906557 composite? False Is 7610563 a composite number? False Is 20778431 a composite number? True Is 142961941 a prime number? True Is 159597091 a composite number? True Is 210437 a composite number? False Is 47684627 a composite number? False Is 26834849 prime? True Is 59361917 a prime number? True Is 280886 a composite number? True Is 81875951 prime? True Is 2998063 a prime number? True Is 8372369 a composite number? True Is 16998607 a prime number? False Is 1290999 a prime number? False Is 9316239 composite? True Is 237341371 a prime number? True Is 5278841 composite? True Is 69561151 composite? True Is 4261837 a composite number? False Is 40559299 a composite number? True Is 1598327 a composite number? False Is 762697874 a prime number? False Is 32074993 prime? False Is 4125817 composite? True Is 5625922 composite? True Is 18907921 prime? False Is 44184187 composite? False Is 6126391 a composite number? False Is 131597 a composite number? True Is 11821787 a composite number? False Is 3137003 prime? True Is 113761771 a composite number? True Is 584205379 a composite number? True Is 179055049 composite? False Is 13519781 prime? False Is 22890394 a prime number? False Is 91379681 composite? True Is 6567247 composite? True Is 1118105 a composite number? True Is 20201251 prime? False Is 28204829 prime? True Is 60962749 composite? False Is 1645529 composite? False Is 12472799 a prime number? True Is 3035677 composite? False Is 8469079 composite? True Is 30269371 composite? True Is 5533847 prime? False Is 1008241 prime? False Is 3809369 prime? True Is 30648283 a composite number? True Is 48901583 composite? False Is 5081579 composite? False Is 24419069 a prime number? False Is 17510215 composite? True Is 1538941 a composite number? True Is 10885901 composite? True Is 1046519 composite? False Is 6171509 composite? False Is 3649729 a composite number? True Is 53276467 a prime number? False Is 278653 prime? False Is 4179893 a prime number? True Is 498331 a prime number? True Is 20496701 a composite number? False Is 11666983 a composite number? False Is 5741261 a composite number? False Is 44483 prime? True Is 2201359 a composite number? True Is 300834823 a prime number? False Is 363641561 a composite number? False Is 108873049 prime? False Is 3500571 composite? True Is 824527133 a prime number? True Is 252974483 prime? True Is 7229333 a composite number? False Is 63474233 a prime number? False Is 1803047 a prime number? False Is 45038109 prime? False Is 127475167 a composite number? False Is 87801803 a composite number? False Is 30284321 composite? False Is 148525019 a composite number? False Is 18143237 a composite number? True Is 4370129 a composite number? False Is 47335703 a composite number? False Is 64686917 a composite number? False Is 2708479 composite? True Is 3317329 prime? False Is 4395829 a composite number? True Is 12489047 composite? False Is 4187203 prime? False Is 18860173 a prime number? False Is 77687065 a composite number? True Is 106365253 a prime number? False Is 1009322 a prime number? False Is 30650861 composite? False Is 601430209 a prime number? True Is 9030397 a prime number? False Is 319036721 prime? True Is 5166723 prime? False Is 171247033 a composite number? False Is 148233593 a prime number? True Is 12356033 a composite number? False Is 383261 composite? False Is 29442803 prime? False Is 2047849 a composite number? True Is 2052917 a prime number? True Is 880151 a prime number? True Is 9998663 composite? True Is 43004789 a prime number? False Is 11629031 composite? True Is 11741909 a composite number? True Is 106382293 composite? False Is 20312141 a prime number? False Is 19143727 prime? False Is 450677 composite? False Is 570719 a prime number? True Is 88603 composite? True Is 83329951 composite? True Is 1185179 a composite number? False Is 7357765 composite? True Is 27608803 prime? True Is 14065411 prime? False Is 75493933 prime? True Is 20882087 a co	{ "pile_set_name": "DM Mathematics" }
. Determine q, given that g(q) = 0. -1/4, 0, 1, 2 Let l = 3313/36 - 361/4. Find c, given that 0 + 4/9c2 - 2/3c*5 + lc*4 - 14/9c*3 + 0c = 0. 0, 2/3, 1 Let l(n) = 12n4 + 10n*3 - 2n*2 - 6n - 2. Let d(b) = -13b4 - 10b3 + b2 + 5b + 2. Let w(r) = 4d(r) + 5l(r). Factor w(k). 2(k - 1)(k + 1)2(4k + 1) Factor -6/7c*3 + 0c + 3/7c5 + 0c*2 + 0 + 3/7c*4. 3c*3(c - 1)(c + 2)/7 Suppose 0s + 4s = -g + 234, 0 = -4s + 5g + 246. Factor f - sf*2 + 5f + 61f2. 2f(f + 3) Find i such that 3/4i*2 + 3i + 3 = 0. -2 Let t(n) be the first derivative of -196n6/15 + 126n*5/25 + 6n*4/5 - 8n3/15 + 3. Let t(r) = 0. Calculate r. -1/4, 0, 2/7 Let j(t) be the third derivative of t5/60 - t4/12 + t3/6 + 6t2. Factor j(c). (c - 1)2 Solve -1/6n*2 - 1/2n*4 + 0 + 0n + 1/6n5 + 1/2n*3 = 0 for n. 0, 1 Let b(x) = 6x*2 + 4x + 5. Let a(k) = -k*2 - k - 1. Let u(g) = -10a(g) - 2b(g). Factor u(m). -2m(m - 1) Let s(v) be the third derivative of -v9/75600 + v7/12600 + v4/12 + 6v2. Let i(o) be the second derivative of s(o). Factor i(x). -x2(x - 1)(x + 1)/5 Let b = 7 - 5. Suppose k*2 - bk - k + 0k2 = 0. What is k? 0, 3 Let t be 5/((-15)/(-6)) + 1. Let j(m) = m2 + m - 4. Let x be j(-3). Determine o so that 9ox + o2 - 1 - t - 6o = 0. -2/5, 1 Let j(h) be the first derivative of h6/3 + 4h*5/5 - 4h3/3 - h2 + 8. Let j(f) = 0. What is f? -1, 0, 1 Let i(d) be the second derivative of 7d7/5 + 406d*6/75 - 709d*5/50 + 16d*4/5 + 76d*3/15 - 16d*2/5 + 12d. Let i(a) = 0. Calculate a. -4, -1/3, 2/7, 1 Let z be (2/(-6))/((-3)/27). Determine j, given that 4j3 - 3j*3 + 2j - zj2 + 0 + 0 = 0. 0, 1, 2 Suppose 2x = 7x + 4r - 10, -3r - 10 = -5x. Determine u, given that 2ux + 1 + 1 - 4u*2 = 0. -1, 1 Let m be (2 - 0)40/(-50)-7. Determine w so that 0 + 8/5w*2 + mw*3 + 98/5w*4 + 0w = 0. -2/7, 0 Let j(x) be the second derivative of x*4/3 - 2x*3/3 - 4x*2 - x. Factor j(c). 4(c - 2)(c + 1) Let d be (10/(-8))/((-1)/4). Suppose 0 = 2m + 1 - d. Factor 2x3 - x - x4 - x5 + 2x*m + 1 + 0x - 2. -(x - 1)*2(x + 1)*3 Let f = 312/755 - 2/151. Find s, given that 3/5s*3 + 0 + 0s - 12/5s4 + fs*2 + 7/5s*5 = 0. -2/7, 0, 1 Factor 6/5 + 3/5k*2 + 9/5k. 3(k + 1)(k + 2)/5 Factor 22/5x4 + 146/5x*2 + 2/5x*5 + 86/5x*3 + 32/5 + 112/5x. 2(x + 1)3(x + 4)2/5 Let n(k) = k3 - 3k. Let c(w) = w3. Let a(h) = 2c(h) + n(h). Factor a(y). 3y(y - 1)(y + 1) Suppose s - 21 = 12. Let d be -4 - s/(-30)4. Factor 0q2 + dq*3 + 0q + 0. 2q3/5 Factor -7/3z*2 - z + 4/3. -(z + 1)(7z - 4)/3 Suppose -3b + 2b = -5b. Let a(k) be the first derivative of 0k2 + 0k*3 + 1/12k*4 + bk + 2 + 2/15k5. Let a(y) = 0. What is y? -1/2, 0 Suppose 4b = -4x - 48, -4x = -5x + 2b + 3. Let c be 0(x/2 - -4). Solve 1/2j - 1/2j3 + cj*2 + 0 = 0 for j. -1, 0, 1 Let d = 14 - 9. Suppose l = dl. Factor 0j + 1/2j*2 + 3j*3 + 6j*4 + l + 4j5. j2(2j + 1)*3/2 Factor 2/23h*2 - 4/23h + 2/23. 2(h - 1)2/23 Let l(u) be the second derivative of -1/42u*4 - 2u + 0u2 + 1/21u*3 + 0. What is t in l(t) = 0? 0, 1 Determine d so that -4/9d*3 - 2/9d + 2/3d5 - 8/9d*4 + 0 + 8/9d2 = 0. -1, 0, 1/3, 1 Let v(o) = -o3 - 2o2 + 8o + 2. Let x be v(-4). Suppose j + x = 5. Solve 0p + 1/4p*2 + 0 + 1/4p*4 + 1/2p*j = 0. -1, 0 Let r(q) be the second derivative of 1/30q*3 + 0 + 1/150q*6 - 1/100q*5 - 3q - 1/60q4 + 0q2. Let r(b) = 0. Calculate b. -1, 0, 1 Let l = -6 + 8. Let o(y) = y2. Let s be o(-2). Suppose -4 - 3w - 5w - s - lw2 = 0. What is w? -2 Let v(i) = 9i*2 + 8i - 8. Let f(g) = -7g2 - 7g + 9. Let z(b) = -4f(b) - 3v(b). Factor z(s). (s - 2)(s + 6) Let q be (0 - -2)(-3)/(-2). Let j be q/(6/4) + 0. Factor -5/2k4 + k + 5/2kj - k3 + 0. -k(k - 1)(k + 1)(5k + 2)/2 Let s(o) be the second derivative of o6/165 - o5/110 - o4/66 + o3/33 + 3o. Suppose s(u) = 0. What is u? -1, 0, 1 Let d be 2/(-7) + 426/21. Suppose 0 = -4w + d + 4. Factor v*4 + wv*3 - 4v*3 + 4v*3 + 13v*2 + 12v + 4. (v + 1)*2(v + 2)2 Let d(c) = -c3 - c*2 - c + 1. Let o(g) = -4g*3 + 3g*2 - 15g + 11. Suppose -5p + 6 = 1. Let a(u) = po(u) - 3d(u). Determine f, given that a(f) = 0. 2 Let w(a) be the second derivative of -a5/50 - a4/15 + a3/15 + 2a*2/5 - 7a. Factor w(q). -2(q - 1)(q + 1)(q + 2)/5 Let b(z) be the first derivative of -z3/12 - z2/8 - 25. Solve b(d) = 0 for d. -1, 0 Factor -1/6s*4 + 0s + 0s3 + 0 + 2/3s2. -s2(s - 2)(s + 2)/6 Let s(w) be the first derivative of -w*8/560 - 3w7/280 - w6/40 - w5/40 + w3/3 + 1. Let k(z) be the third derivative of s(z). Factor k(b). -3b(b + 1)*3 Let y be 15/(-10) - (18/(-4) + 3). Find m, given that 0m + y + 15/2m3 - 3/2m2 = 0. 0, 1/5 Let g(l) = -l2 - 3l + 4. Let d be g(-3). Let a(k) be the second derivative of -2k + 0k2 - 4/3k*3 - 1/10k*5 - 2/3k*d + 0. Factor a(x). -2x(x + 2)2 Let s(j) = j2 + 2j - 6. Let f be s(2). Factor 1/3m3 + 0m + 0 + m*4 + 0mf. m3(3m + 1)/3 Let x(w) be the first derivative of 2w3/27 - 8w*2/9 - 2w - 3. Factor x(a). 2(a - 9)(a + 1)/9 Let q(h) be the first derivative of 9h8/56 - 9h*7/35 + 2h*5/15 - 3h*2/2 + 1. Let u(j) be the second derivative of q(j). Suppose u(n) = 0. Calculate n. -1/3, 0, 2/3 Let w be (-5)/(10/12)-1. Let h be (-3)/(w/(-8)) + -2. Factor -4r + 5r - 2rh - 3r. -2r(r + 1) Suppose -n + 7x + 18 = 2x, 2x + 6 = 0. Let t(f) be the second derivative of 0 + 0f*4 + 0f*2 + 0f*n + f - 1/10f*5. Find c, given that t(c) = 0. 0 Factor -2/3i*2 + 8/3i - 2. -2(i - 3)(i - 1)/3 Let w(t) be the third derivative of -t*5/12 + 5t*4/4 - 15t*3/2 - 13t*2. Factor w(f). -5(f - 3)2 Let q(f) be the third derivative of f5/5 + f4/4 + f3/8 + 6f2. Suppose q(v) = 0. What is v? -1/4 Let q(h) = -h2 + h + 6. Let t be q(0). Factor 18n*2 - 28n*2 + 2n4 + n5 + n*5 - tn*3 - 4n. 2n(n - 2)(n + 1)3 Let z(s) be the second derivative of s3/6 + 6s*2 + 2s. Let o be z(-7). Factor 2v3 - 2v - 2v + 3v - v*o. -v(v - 1)*2(v + 1)*2 Suppose 0 = -2j + 5j - 15. Let b(k) = 3k*3 - 8k*2 - 4k. Let u(d) = -5d3 + 16d*2 + 8d. Let w(z) = jb(z) + 2u(z). Factor w(h). h(h - 2)(5h + 2) Let z(y) be the first derivative of y6/8 - 3y*4/8 + 3y*2/8 - 1. What is p in z(p) = 0? -1, 0, 1 Solve 0q - 2/13q2 - 2/13q*3 + 0 = 0 for q. -1, 0 Let s(n) be the third derivative of 0n*6 + 0n*3 + 0 + 3n*2 + 0n - 1/105n7 + 1/30n*5 + 1/24n*4 - 1/336n*8. Factor s(b). -b(b - 1)(b + 1)3 Let c be ((-72)/(-45))/(3/6). Factor -2/5m - cm2 + 0 - 32/5m*3. -2m(4m + 1)*2/5 Factor 4/15h - 6/5h2 + 0 + 4/3h*3. 2h(2h - 1)(5h - 2)/15 Let m(h) be the third derivative of h6/24 + h5/3 + 25h4/24 + 5h*3/3 - 15h2. Find y such that m(y) = 0. -2, -1 Factor y2 - 3y4 + y2 + 6y*3 - 9y*4 + 4y*4. -2y*2(y - 1)(4y + 1) Let d = -1 - -2. Factor r*2 + r - d + 3 - 2r*2 + 0. -(r - 2)(r + 1) Let p(g) be the first derivative of -g*3 - 3g*2/2 + 18g + 7. Factor p(v). -3(v - 2)(v + 3) Let v(a) = -9a2 - 9a + 13. Let d be 1/(2/5)-2. Let t(j) = -4j*2 - 4j + 6. Let k(c) = dt(c) + 2v(c). Factor k(n). 2(n - 1)(n + 2) Solve -10/9l2 + 4/9l + 0 + 8/9l3 - 2/9l*4 = 0 for l. 0, 1, 2 Let h(y) be the third derivative of 5y*8/168 + 11y*7/42 + 5y*6/12 - 5y*5/3 - 5y*4/2 + 15y3/2 - y2. Find i such that h(i) = 0. -3, -1, 1/2, 1 Let b = -28 - -31. Suppose b = u - 0, 5u = -j + 17. Let -1/6a*j + 0 - 1/3a = 0. What is a? -2, 0 Suppose -5a + 25 = 0, -5j + 35 = a + 4a. Let v be 0 + (-2)/(-3)6. Factor hv - h5 - h*4 - h - 2h2 + h4 + 1 + jh3. -(h - 1)3(h + 1)2 Let o(r) = r3 + 6r2 - r - 3. Let z be o(-6). Determine c so that 2c + 4c2 - 4c - 4cz + 2c*3 = 0. 0, 1 Suppose -z + 1 - 12 = 0. Let i = -9 - z. What is x in 1/5 + 3/5x*i + 3/5x + 1/5x3 = 0? -1 Let m(c) be the first derivative of 2c*5/25 + 3c*4/10 - 4c*2/5 + 3. What is j in m(j) = 0? -2, 0, 1 Let w(s) be the first derivative of 8s5/35 + s4/14 -	{ "pile_set_name": "DM Mathematics" }
, -2a = 2r - 66. Is a a prime number? False Let x = -228 + 225. Is 3307/(-1)(3/x + 0) prime? True Let q(v) = 2v - 19. Let x be q(9). Is 0/x - (-5)/((-30)/(-2718)) a composite number? True Suppose -59d + 6522744 = -7992259. Is d a composite number? False Let x = -132 + 132. Suppose y + 4 = -x, 2h - 4664 = -5y. Is h prime? False Let y(g) = 2g*2 - 354g + 651127. Is y(0) a prime number? True Suppose 52584 = 532t - 544t. Let z = -2725 - t. Is z prime? True Is (22151240/32)/1 + -5 + (-5)/20 a composite number? False Let f(v) = 27 + 27v - 27v - v*3 - 3v + 34v + 28v*2. Is f(22) a composite number? False Let x(r) = -268r - 97. Suppose 0 = -2o - 4l - 110, 2l = -2o + 3o + 39. Is x(o) prime? False Let s = 13312 + 26207. Suppose 13v - 22v = -s. Is v a composite number? False Suppose 40h - 27h - 208 = 0. Suppose -hs + 234974 = -176274. Is s a composite number? False Suppose -920017 = -o + 42p - 44p, 4o = 2p + 3680058. Is o prime? False Suppose 76575 = 3x + 2k, k + 2k = -5x + 127624. Is x prime? True Let v(y) = 91y2 + 19y - 7. Is v(20) a prime number? False Suppose 5u - 12550 = 17055. Is u a composite number? True Let s = 29 - 26. Suppose sq = 657 + 465. Suppose 58o = 60o - q. Is o a prime number? False Let q(g) = -2g2 - 24g - 16. Let p be q(-10). Suppose -35r + pr = -22. Is (-711)/12-78 - r/4 composite? False Let w = -72706 + 158419. Is w composite? True Let z(s) = s - 12. Let f be z(12). Suppose f = 8w - 1348 - 5364. Is w a prime number? True Is (11/((-308)/(-8475663)))/(126/168) a prime number? True Let y(v) = 212v2 + 29v + 2445. Is y(-38) a composite number? False Let c be (-110)/(-25) - (-2)/(-5). Suppose -i + j = 1, 0 = ci + 4j - 0 - 28. Suppose -5m - 3x = -2428, 0x = -ix + 3. Is m a prime number? False Let h = 84835 + -49458. Is h a prime number? False Suppose -7g + 0g + 147 = 0. Suppose -5w - 4v + 59803 = 0, 0 = gw - 20w + 5v - 11948. Is w prime? False Suppose 4y - 2h - 1050468 = 0, -258925 = -5y - 4h + 1054108. Is y prime? False Let g = 49048 + -28618. Suppose 0 = 4m - 8966 - g. Is m composite? False Let q(h) = h*3 + 10h - 7. Let m be q(-13). Let w = 7361 + m. Is w composite? True Let a(g) = 2g2 + 15g + 11. Let z be a(-7). Is (-4)/z(-2931)/3 prime? True Is 15/(-9) - (-33971548)/258 prime? True Let g(l) = 31l + 45. Let c(t) = -17t + 67. Let s be c(3). Is g(s) a prime number? True Let l(k) be the second derivative of -k5/20 - 19k*4/12 + 14k*3/3 + 45k*2/2 - k + 10. Is l(-26) composite? False Let c(t) = -13 + 346t + 145 + 120t - 5. Is c(7) composite? False Let t be (7 + 328/(-48))/(3/36). Suppose -3m = tn - 15031 - 14998, 3m + 5n = 30041. Is m a composite number? False Suppose -a + 84121 = 4i - 159464, -3i + 4a + 182665 = 0. Suppose -h + i = 18h. Is h a prime number? False Suppose -3z - 35 = -5i, 0 = 2i - 3i - 3z - 11. Let m be -1 + 5 + (-21744)/(-40)5. Suppose -2x + m = ip, -4x + 7x - p = 4062. Is x a composite number? True Suppose -3l = -4f + 12, -2l - f + 5f - 12 = 0. Let z(g) = 921g - 10132. Let b be z(11). Is (677 + l - -3) + b prime? False Let s(n) = -300064n - 929. Is s(-3) a composite number? False Suppose -79q + 20821724 + 13395467 = 0. Is q a prime number? False Suppose -q - 18328 = 5w, -4169 - 6823 = 3w - q. Let l = -1482 - w. Is l a composite number? True Suppose 5q - 363901 = 4o - 858675, -q - 2 = 0. Is o a prime number? False Let x = 134028 - 79069. Is x a prime number? True Suppose -28266 = -31a + 657. Let h = a + 2040. Is h a prime number? False Let v(t) = -t3 + 14t*2 + 15t + 5. Let o be v(15). Suppose oh = 2d + 7591, -h + 0h + 1520 = -d. Is h prime? False Suppose 5q + 5k - 17 - 8 = 0, -5k + 19 = 3q. Suppose -p + 1508 = qr + 204, -p = 5r - 2176. Suppose -f = l - r, 2f + 4l + 234 = 1116. Is f prime? True Let t = 1494 - 2427. Suppose -x + 3f = x + 1127, -f - 551 = x. Let w = x - t. Is w a prime number? False Suppose 2o - 4o = 0. Suppose 23s - 21s - 1840 = o. Is -3 + 0 + 1s prime? False Let f(d) = 41d*2 + 15d + 57. Let z(s) = -s + 1. Let l(p) = f(p) + 4z(p). Is l(-5) composite? False Suppose 5f = -5j + 40, -4j + 3 = -3j + 2f. Let h(l) = 21l + 24. Let x be h(j). Let q = -50 + x. Is q composite? True Let g be 93588/(-198)-13. Suppose 1428 = 2c - 2q, 40c - g = 38c + 4q. Is c a prime number? True Let w(c) = 3909c - 61. Let k(d) = 1304d - 21. Let l(u) = -11k(u) + 4w(u). Is l(4) a prime number? False Suppose -2d = 3d. Suppose d = -14q - 2896 + 21950. Is q a prime number? True Is (-148305)/208/142030/(-30) a composite number? True Let x = -14 + -14. Let l = x + 53. Suppose -l = 4d - 4z - 149, 73 = 3d + z. Is d a prime number? False Suppose 10p = 8p + 340. Let t = 421 - p. Is t prime? True Let v(s) = -944s - 493. Let y = 137 - 168. Is v(y) prime? True Let n(w) = 12w*2 - 23w + 1. Let i be n(2). Suppose 5x + 24760 = -16b + 18b, 3x - 37161 = -ib. Is b composite? True Let g be 18/10 - 7/(-35). Suppose 0 = -2j - 5i + 15614, -8 = 4i - gi. Is j a composite number? False Let x(y) = 6y*3 + 10y*2 - 16y + 1. Let n(d) = -d*3 + 10d*2 + 7. Let t = -98 - -108. Let q be n(t). Is x(q) prime? True Let p(z) = 307z + 0z3 - 291z - 8z2 - 44 + 3z*3. Let h(r) = -2r*3 + 4r*2 - 8r + 22. Let l(i) = 5h(i) + 3p(i). Is l(-11) a prime number? False Let i(k) = -12839k - 12045. Is i(-68) composite? True Let t be 1 + 1 + (45 - -11). Suppose 0 = 4y - 8, 5f = 4f - 3y + t. Suppose -85u + f = -83u. Is u a prime number? False Suppose -15 = 2l - 3n, 3l + 27n + 15 = 30n. Is l + 4(-17059)/(-28) prime? True Suppose 201z = 7q + 203z - 5963179, 0 = 5z - 30. Is q a prime number? True Let r(k) = -500k - 19. Let v be r(10). Let g = v - -2962. Let f = 3156 + g. Is f a prime number? False Suppose 66m - 9 = 63m. Is (60872/12)/(2/m) composite? True Is (16 - 171/9)/(3 - (-198240)/(-66076)) a composite number? False Suppose 3d - 514709 = 6a - 4a, d - 171579 = -4a. Is d composite? False Let g = -9990 + 18346. Let x = -3314 + g. Is x composite? True Suppose 4l + 2s - 37562 = 0, -3s + s = 6. Suppose -3d - l = -19d. Is d prime? True Suppose -10814 = -4o - 2366. Let t = 4445 - o. Is t composite? False Let d(z) = -3z - 19z - 9 - 5z + 10z. Suppose 0p = -p - 4. Is d(p) a prime number? True Let f(n) = 50n + 15. Suppose -9w + 10 = -7w. Suppose m - 13 = 3g, 2m - 5g + w = 3m. Is f(m) prime? False Suppose -14o + 5o - 36 = 0. Let x(v) = v*2 + 2v - 6. Let f be x(o). Suppose 0 = -2u + 3a + 3372, -fa = -5u - 3a + 8447. Is u prime? False Let k be 28/3 + (-4)/(-6). Let z be (-4)/(-18) - k/45. Suppose z = -4n - 4w + 812, -w + 258 = 3n - 343. Is n a composite number? False Let j(l) = 569l + 988. Is j(41) a prime number? True Suppose 2597911 = 46m - 1064103. Is m a composite number? False Suppose 4w = -o + 238317, 5o - 53 = -48. Is w composite? True Suppose 5i - 3547 - 1038 = 0. Suppose -103 - 199 = -m - 5n, i = 3m + 4n. Is m a prime number? True Let o be (-3)/((-72)/(-16))(-15)/2. Suppose -1952 = -i - 3j, oj - j + 20 = 0. Let n = i + -1038. Is n composite? False Let u(h) = -48h*2 + 8h - 6. Let d be u(-20). Is (-1)/6 - d5/12 a prime number? True Suppose b - g = 3, -g = 4b + 4g - 30. Suppose 0a + a + 4 = 4z, 0 = 3a - bz + 5. Suppose aj = -10j + 1660. Is j a prime number? False Let f be (5 - (-7)/1)41/2. Suppose -6i + 288 = -f. Is i a composite number? False Let c = -237751 + 414444. Is c prime? False Let d(u) be the first derivative of -5u*4/4 - 7u*3/2 - 13u*2/2 - 8. Let s(t) be the second derivative of d(t). Is s(-6) a composite number? True Let z(r) = -3891r*3 - 55r*2 - 238r + 7. Is z(-4) composite? False Let j(n) = -n*3 - 5n*2 - 3n + 11. Let f(s) = s*2 - 4s - 10. Let k be f(8). Suppose k = -4i - 18. Is j(i) prime? True Suppose 5x - 3p = -2p - 11, x + 3 = p. Let w be x/((-44)/12 - -3). Suppose -9q + wq + 32610 = 0. Is q composite? True Suppose 8 = -2y, 0 = -0z + 5z + 3y + 22. Let t be 1/((-238)/(-118) + z). Suppose w - t - 894 = 0. Is w a composite number? False Let k(m) be the first derivative of 7m4/4 - 6m*3 + 5m*2/2 - 6m - 24. Let b be k(7). Suppose -271 = h - b. Is h a composite number? Fa	{ "pile_set_name": "DM Mathematics" }
v = 1.1 + -19.1. Sort 0.4, -0.2, v in descending order. 0.4, -0.2, v Let p = 1 + -2. Suppose 4 = -2k - 0k. Put 1/2, k, p in increasing order. k, p, 1/2 Let y = 0.02 - -2.98. Sort 2/3, -1, y in ascending order. -1, 2/3, y Let g(s) = -s*2 + 6s + 4. Let u(z) = z*2 - 7z + 13. Let r be u(6). Let w be g(r). Put w, -5, -4 in decreasing order. w, -4, -5 Let h = 2971 + -8824/3. Let u = h + -30. Sort u, 0, -2. -2, u, 0 Let h = 0.69 - 1.49. Let k = -7 + 6.4. Let w = k - h. Put -1, w, 1 in descending order. 1, w, -1 Let h be 37 + -33 + 42/(-10). Sort h, 0.1, 1/2, 0.6. h, 0.1, 1/2, 0.6 Let j be 3/(2/(-4)3). Let a = 9 + -4. Suppose -5h - 30 = -4o, -16 = -o + ah - 1. Sort j, 2, o in ascending order. j, 2, o Suppose 0 = -4l, 5a + l = -2l. Let z = -1 + -2. Put a, -4, z in descending order. a, z, -4 Let l be (1 + -2)-2 - 5. Suppose 4c = i - 14, -16 = -i + 5i + 2c. Sort l, i, 1. l, i, 1 Let m be (5/(-4))/(5/(-20)). Suppose mz = 12 - 2. Sort z, -3, 4. -3, z, 4 Let g = -119.1 - -138. Let n = g - 19. Sort 6/7, 0.5, n in descending order. 6/7, 0.5, n Suppose -2j = j - 63. Let f be (-2 - j/(-6))-24. Let a be (-2)/9 - 188/f. Put a, 0, -5 in ascending order. -5, 0, a Let j = -10 - -14. Let x be (-76)/308 - 2/11. Put j, x, 1 in increasing order. x, 1, j Suppose 8 = 4u, 4u = 2w + 7 + 3. Let m(j) = j2 - j - 2. Let y be m(-2). Put y, w, 1 in descending order. y, 1, w Let y = -26.8 - -23. Let j = y - -4. Suppose -14 + 34 = -4l. Sort j, l, 5. l, j, 5 Let a = -0.065 - -0.565. Let k = 0.06 - 0.02. Sort -0.4, a, k in increasing order. -0.4, k, a Let z = -22 + 21.6. Sort -5, z, 0.04 in ascending order. -5, z, 0.04 Let k(v) = v*2 + v + 2. Let y be k(0). Suppose -3h + 9 = -5q, yh = -3q - 4 + 10. Sort 1, h, -3. -3, 1, h Suppose -5k = 4w - 9w + 25, 4k + 4w = 12. Sort -5, k, -2. -5, -2, k Let h be ((-8)/24)/((-5)/(-3)). Sort 1, h, -2/3, 3. -2/3, h, 1, 3 Suppose 0s = 3s. Let i be 2 + s - (-24)/(-15). Sort 3, i, 1 in ascending order. i, 1, 3 Let x be (-4)/(-14) + 19/7. Let o be -2 - (3/3 - x). Suppose o = u - 1. Sort u, -1/4, 1/4 in decreasing order. u, 1/4, -1/4 Let t = 0 - -5. Let a = 4.6 - t. Let x be 3 + -6 + (-82)/(-26). Put a, 1, x in decreasing order. 1, x, a Let v = 6.8 + -6.8. Sort -3, -0.12, -5, v in ascending order. -5, -3, -0.12, v Suppose 2f = -a + 8, -4a - 2 = -5f - 8. Suppose -2m - 2m = a. Put m, 4, 2 in descending order. 4, 2, m Suppose 7 = 3y - 8. Let n(m) = 5m3 - m2. Suppose 2k + 2p - 8 = 0, k + 3p - 6 = 4k. Let c be n(k). Sort y, -4, c in descending order. y, c, -4 Let b be 23/(-12)2. Suppose 1 = r - 1, -3r + 15 = -3z. Sort z, 0, b in descending order. 0, b, z Let c = -0.024 - 0.976. Sort 5, 1/6, 12, c in decreasing order. 12, 5, 1/6, c Let z = 2 - -2. Suppose -7b = -zb + 3. Put b, -7, 2 in decreasing order. 2, b, -7 Let s(o) = -o2 - 8o + 17. Let z be s(-8). Let w = z - 16. Suppose 3 = -3h + 4k, 4k + 9 = k. Sort 3, h, w in increasing order. h, w, 3 Let g(u) = u2 - 12u + 20. Let s be g(10). Sort -3, -2, s. -3, -2, s Let c = -4 + 2. Suppose w + 4d = 14, 0 = 2w + 2w - 3d + 20. Let x be ((-4)/(-5))/(w/10). Put 3, c, x in descending order. 3, c, x Let w = 0.94 - 0.44. Put -3/4, -0.2, -4, w in increasing order. -4, -3/4, -0.2, w Suppose 4a + 11 = 3s, -2s - 4a + 5 = 11. Suppose -3w + 2r = 2, 4w - 3w = -r - 4. Sort w, s, 3 in descending order. 3, s, w Let c = -4.2 - -4. Let p = -0.4 + -0.1. Let o = 1.3 - 1.4. Sort o, p, c. p, c, o Suppose 18 = 18g - 16g. Sort 0.1, -2/3, g, -4 in increasing order. -4, -2/3, 0.1, g Let r = -28 + 27.5. Sort 12, r, 5 in descending order. 12, 5, r Let b be 0 - (1 + 0 + -1). Let w = 0.01 + 8.99. Let q = w - 7. Put q, 3/5, b in descending order. q, 3/5, b Let s(n) = n - 1. Let c be s(4). Let f be 2/10 - (-1 - -1). Put -3, f, c in decreasing order. c, f, -3 Let r be ((-8)/(-18))/(-2) + 1140/513. Put -5, r, 7, -3 in decreasing order. 7, r, -3, -5 Let x = 6 - 10. Let c = 0.76 - -0.24. Sort c, x, -3 in decreasing order. c, -3, x Let n(c) = -c*2 - 6c + 9. Let q be n(-7). Let y be (1 - 1) + (-12)/q. Let z be (1/y)/(3/24). Put z, -4, 3 in descending order. 3, z, -4 Let u(t) = t*2 + 14t + 10. Let b be u(-13). Put 5, -4, 0, b in ascending order. -4, b, 0, 5 Let p(n) = -n*2 - n + 1. Let u be p(-1). Sort 3, 0, u, 6 in ascending order. 0, u, 3, 6 Suppose 6w + w = -28. Put 5/4, 2, w in increasing order. w, 5/4, 2 Suppose -4a + 12 = 0, 5h - 4a + 15 = -7. Let u = 7 + h. Suppose 2g - 15 = 4d - 1, d - 5g = 10. Sort u, -4, d. d, -4, u Let c = -0.28 - -0.5. Let o = 0.08 + c. Let t = 1.7 + o. Put 1/4, -0.4, t in ascending order. -0.4, 1/4, t Let j = 8 - 3. Put -4, 3, j in decreasing order. j, 3, -4 Let q(u) = u - 1 - u*3 - 3u*2 + 2u2 - 3. Let i be q(0). Let c(l) = -l2 - 7l - 5. Let k be c(-6). Put i, k, -1 in ascending order. i, -1, k Let k = -26.1 - -26. Sort -1, k, 3, -4 in descending order. 3, k, -1, -4 Suppose -2o + 5o = -5i - 17, -12 = 3i. Suppose 0 = -r + o. Put -1, r, -3 in decreasing order. r, -1, -3 Let s = 2 + -3. Sort 3, s, 1. s, 1, 3 Let q(k) = -k2 + 9k + 11. Let x be q(10). Suppose -2z + x = -3. Let m = -15 - -11. Put m, z, -2 in descending order. z, -2, m Let j be 56/10 - 4/(-10). Let n(b) = -2b + 7. Let r be n(j). Let g = r + 2. Put -4, 1, g in ascending order. -4, g, 1 Let u be 1/3 - (-3)/(-9). Let v be 15/(-30) + (-11)/(-2). Sort u, v, 3/4 in descending order. v, 3/4, u Let u = -83.57 - -83. Let b = 2 - 1.93. Let n = b + u. Sort n, 1/2, -6. -6, n, 1/2 Suppose -4z = z - 5. Let q be 0/(0 + -5 - -3). Let c = 10 - 6. Sort z, c, q in ascending order. q, z, c Let i(h) = -h3 - h - 4. Let j be i(0). Put 1, -0.3, j in descending order. 1, -0.3, j Suppose -3i - 5m + 1 - 12 = 0, -4i - 2m = 10. Let v be (-2 - 0)10/4. Put 1, i, v in ascending order. v, i, 1 Let j be -5 + 3 - (3 + -1). Sort j, 2, 4. j, 2, 4 Suppose -5p + 3 - 1 = 4i, -2 = 3p + 4i. Suppose x = px. Let w(m) = m + 5. Let k be w(-4). Sort 2, k, x. x, k, 2 Suppose 0 = 3r - 5 - 4. Let i be 1 + -3 - -6 - 1. Let l be (i/(-2))/((-5)/(-10)). Sort r, l, -4. -4, l, r Suppose 15s + 18 = 9s. Put 3, s, -4 in decreasing order. 3, s, -4 Let p = -0.33 + 20.33. Let d = p - 20.4. Put d, 0.4, -1/20 in decreasing order. 0.4, -1/20, d Let g = -8 + 11. Let n = -2 + 2. Suppose 2q = -4 + 12. Sort g, q, n in increasing order. n, g, q Let c(u) = -u. Let h be c(3). Let j(o) be the third derivative of o4/8 + 5o*3/3 + 9o*2. Let z be j(-3). Sort h, 0.5, z in descending order. z, 0.5, h Let a(k) = -9k + 1. Let c be a(-1). Suppose -3i + 5x + 10 = 0, -2i + 5x = -3i + c. Sort 0.1, i, -3 in ascending order. -3, 0.1, i Let u be (2 + 0)(-5)/5. Sort -1, 1, u in decreasing order. 1, -1, u Let k = 4 - 7. Let n = -4 - -2. Let x = n - -2. Sort k, x, -5. -5, k, x Let b be (-4)/80/(-1). Let t be b/(6/(-31)). Let x = 3 - 0. Sort -3, x, t in decreasing order. x, t, -3 Let m(u) be the first derivative of -u*2/2 - 7u + 1. Let g be m(-7). Sort -6, g, -2. -6, -2, g Let m(n) = -3n3 - 3n - 2. Let p be m(-1). Put 1, 5, p in decreasing order. 5, p, 1 Suppose 22 = -5f + 2k + 3, 5f + k + 28 = 0. Put -2, f, 4 in ascending order. f, -2, 4 Let m = -8 + 5. Let j = 0 + 1. Let c be (j/2)/(3/(-15)). Sort m, c, 3/7 in descending order. 3/7, c, m Let y = -18 - -24. Suppose 3m - y = -2h, -4m - m + 10 = 4h. Sort -3, h, -7 in ascending order. -7, -3, h Suppose -2m - 4y + 4 + 8 = 0, m - y - 3 = 0. Suppose -4 = -0o + mo. Put -3, o, 2 in ascending order. -3, o, 2 Let x = 24 - 20. Let n be x/515/(-20). Put 1, 1/5, n in increasing order. n, 1/5, 1 Let o be (-10)/(-2)(-9)/(-15). Let m = 0.6 + 1.4. Let l = 41 + -44. Put o, m, l in descending order. o, m, l Let w be 133/9 - 4/(-18). Let n = -1 - -1. Let r be 6/w + n - 1. Sort r, 3, 2/7. r, 2/7, 3 Let z(j) = 3j*2 + 4j + 3. Let w(h) = -3h + 1. Let s be w(1). Let q be z(s). Sort q, -1, 0 in ascending order. -1, 0, q Let x = 2.9 + -3. Let l = 5 - 5.4. Let g = l - -1.4. Sort x, g, 1/5 in descending order. g, 1/5, x Suppose 5l = -3t - 64, 2t - 3l + 1 = 2l. Let r = t - -13. Put -1, r, 4 in ascending order. -1, r, 4 Let i = 0.19 - -0.11. Let k = 0.1 - i. Sort -5, k, 5. -5, k, 5 Suppose 3b - 16 = g - 6, 2g - 2 = -5b. Let f = 5 - 2. Suppose -5n + 15 = 5*h, 8	{ "pile_set_name": "DM Mathematics" }
uppose -2q = -a + 46, -7 + 53 = -2q - 2a. Which is greater: -1/5 or q? -1/5 Let g(b) = -b2 + 9b - 8. Let p(m) = 7m. Let x be p(1). Let j be g(x). Let t = j - 3. Is 5 <= t? False Let r(s) = -s3 + 3s*2 - 1. Let v be r(2). Suppose 5q = vc - 12, c = -q - 0q - 4. Let j be 16/20 + c/(-5). Is j greater than or equal to -1/7? True Let u = 944 - 922. Is u less than 33? True Let v(w) = -3w + 9. Let z be v(3). Suppose 4t + 80 = 4q, z = -3q + q + 6. Let r(m) = -m*2 + 5m - 4. Let a be r(7). Is a not equal to t? True Suppose 0 = -o + 8 - 40. Let t = o - -30. Is 7/6 less than or equal to t? False Let j be (-1)/2665(-2)/((-72)/(-4444)). Let y = j - 1/533. Which is bigger: y or 0.1? 0.1 Let c(x) = -5x*3 + 6x*2 + 22x + 5. Let m be c(-4). Which is greater: m or 332? m Suppose -6h = -0h - 18. Let i be (-1008)/507 - h4/(-6). Are -1 and i nonequal? True Let h = 146 + -140. Let l(v) be the third derivative of v6/120 - v5/10 - 7v3/6 - v2. Let s be l(h). Are -1/4 and s nonequal? True Suppose 13c + 140 = 8c. Let g = 10 + c. Let n be 2/g6/4. Which is bigger: -2 or n? n Let w = 1605 + -1595. Let g = 1 - 0.6. Which is bigger: w or g? w Suppose 0 = -33f + 38f + 5. Let v be 20/50 - f/35. Which is greater: v or -1/17? v Let d = -103 - -100. Let u = -96 + 98.04. Let x = u + -0.04. Is d greater than or equal to x? False Let g = 3.9 + 0.1. Let q = 93 + -95. Which is smaller: q or g? q Let c = 61 - 45. Which is smaller: 21 or c? c Let f = 0.75 - 0.85. Do 1/37 and f have different values? True Let i = -46/7 - -12427/1890. Which is bigger: i or 0? i Let i(p) = -38p - 249. Let l be i(-14). Is l at least 284? False Let f(r) = -2r3 + r - 1 + 3r*3 + 2r*2 - 6r*2. Let t be f(3). Let b be 0/t + -2 + -1. Is -4 <= b? True Suppose 5u - 52 - 8 = 0. Suppose i - u = -i. Let y be (-2)/i(-15)/(-5). Which is smaller: y or 2/13? y Let o(d) = d2 + d + 1. Let p be o(-3). Suppose -112 = -4u - 2n, 6u - 2u = 3n + 112. Let w be 152/u - 4/(-7). Which is bigger: w or p? p Let q = -236 - -236. Is q bigger than -25/52? True Let p be (80 - 6)/(6/(-15)). Let k = p - -363/2. Which is smaller: k or -3? k Suppose -20i - 8 = -22i. Suppose -12w = -10w + i. Let u = 16 - 19. Which is smaller: w or u? u Suppose 10 = -2z, -z - 46 = 3x + z. Is x less than or equal to 1? True Let j be 15/(-25) - 348/(-5). Suppose -2b = j - 9. Let f be (-1 - 34/b)6. Which is bigger: 3 or f? 3 Let j = 2367/2 - 7777/6. Is -112 greater than or equal to j? True Suppose -3m - 1 = -16. Suppose 18r - 663 = mr. Is r > 51? False Let r(t) = 2t*3 - 4t*2 + 30t + 110. Let l be r(-3). Is l < -74? False Let t = 901/88 - 114/11. Is -17 not equal to t? True Let a = 166 - -58. Which is smaller: a or 2/11? 2/11 Let x = -100 + 144. Let i be 3/2((-10)/15 + 4). Let w be x/(1 - i) + -4. Is -15 != w? False Let x = 36 + -1. Suppose -b + 0b = x. Is b bigger than -36? True Let j = 23420 - 116697/5. Suppose -134 - 28 = -2o. Let n = o - j. Is n greater than -2? True Let x(o) = -8o*2 + 3o - 2. Let d be x(-6). Let n be ((-1)/(-4))/(55/d). Are -2 and n nonequal? True Let i(t) = 39 - t - 11 - 7. Let m be i(12). Let c(b) = -b + 8. Let d be c(m). Is d < 3/10? True Suppose -d - 6 = -5g, d = 5g + 2d - 14. Suppose 2j - 88 = 52. Suppose o - 6 = go - 3n, 5o + 5n + j = 0. Is -12 less than o? False Let m be (32/(-12))/(300/9 + 1). Let n be 6472/(824/6). Let c = m - n. Are -9 and c equal? False Let o = -2.555 + 7.492. Let j = 0.063 + o. Is 2 > j? False Let g(w) = -3w*2 - 12w + 1. Let d be g(-5). Let v be d((-315)/80 + 4). Which is greater: -1 or v? v Let w be (-5 - 848/(-28)) + -4. Let k = -19533/917 + w. Is k at most as big as -1? False Let s be 10/45 - (-15329)/(-9). Let q = s - -5060/3. Is -16 at least as big as q? True Let t = -55 + 90. Let c = 36 - t. Which is bigger: c or 18? 18 Let p(x) = 32x. Let q be p(0). Are q and 402 non-equal? True Let p = 1 + 0. Suppose -4s + 5d - 6d = 81, -3s = 5d + 65. Let w be 0/2 - (1 - (-14)/s). Which is greater: w or p? p Suppose 0 = 5h + s + 4s + 25, 2s - 10 = 0. Let w be (12/(-10))/((-4)/(-35)). Let l = h - w. Which is bigger: l or -0.1? l Let y = -1454/711345 + -4/5045. Which is greater: 1 or y? 1 Let z be ((-21)/(-9) - 2)12. Let n be 212 - 0/(-6) - 3. Let a be (z/(-6))/(n/(-33)). Is 1 >= a? True Let x = -359 + 360. Is x smaller than -3/5? False Let o be (4/(-6))/(104/156). Is o equal to -3/80? False Let r(h) = h3 + 5h*2 - 2h + 14. Let m be r(-8). Let a be (-3)/(-7) - m/(-819). Let b(x) = x*2 + 7x - 1. Let z be b(-7). Is z smaller than a? True Let p = -17 - -24. Let k(j) = -2 + p + 1 + 2j + 2. Let l be k(-7). Is -5 less than l? False Let h = 24.4 + -7.4. Let y = 11 + 8. Let d = y - h. Which is smaller: d or 0.07? 0.07 Suppose k + 11h = 10h + 33, 3h + 86 = 2k. Which is bigger: k or 35? k Let a(o) = -o2 - 2o + 1. Let x be a(-7). Suppose 0 = 23p - 21p + 66. Does x = p? False Suppose -28 = -2y - m, -3m = y + m - 14. Let p = 18 - y. Suppose 6 = -7s + ps. Is -6/5 greater than s? True Suppose 0 = l + 3p - 2p - 5, -4l - p + 35 = 0. Let w be 130/50 + 4/l. Is 9 not equal to w? True Let l(m) = -m2 + 7m + 5. Suppose -28 = -0n - 4n. Let b be l(n). Suppose 0 = -3y - 2y - v + 3, -4v = -y - 12. Which is greater: y or b? b Suppose -5 = -2h + 5. Suppose 5w = -hz - 60, -3w = -3z + z + 16. Is w equal to -7? False Let j be ((-4)/3)/(112/(-24)). Let m = -38 + 38.11. Is j at most as big as m? False Suppose -6g - 51 = -3g - s, 4g + 5s = -49. Is g at least 0? False Let z(b) = -b*2 + 0b*2 + 2 - 1. Let c be z(-1). Is c at most 9/17? True Let p be (-5 - -1)/(11/(-44)). Suppose -5k + p = -19. Which is smaller: k or 9? k Suppose -o = -2o + 1, 2p = -5o - 1. Suppose t + 8 - 2 = 0. Are t and p equal? False Suppose -4k = 53 + 31. Let z = -140 + 171. Let o = z + k. Do 1 and o have the same value? False Let m be ((-2)/(1 + 0))/(-1). Suppose t = 4n - 2t - 17, -mn = -2t - 8. Suppose -nx - 29 = 2r - 9, -5r + 2x + 8 = 0. Which is smaller: -1/5 or r? -1/5 Suppose -2r - 3b + 12 = 8, 3b - 24 = 3r. Let d = -209 - -89. Let l be (-132)/d + 6/r. Which is smaller: 4 or l? l Let f = 73.9 - 73.9. Which is bigger: 4/53 or f? 4/53 Let z = -0.1 - -1.1. Let y be 2/6 + (-46)/3. Let p be (2 + 20/y)/(-3). Is z < p? False Suppose 4t - 40 = m, -m - 2m + 34 = 2t. Let d(r) = r3 - 11r*2 + 3r - 36. Let q be d(t). Suppose -5s - 1 = 4. Which is bigger: q or s? s Suppose 20 = 4p - 2f - 4, f = -2. Let x(v) = -v3 - 25v*2 - 22v + 48. Let t be x(-24). Suppose -20y + 19y + 6 = t. Is p at least as big as y? False Let z = 21.6 + -1.6. Let q = 9 - z. Suppose -4 + 16 = 12o. Which is bigger: o or q? o Let t be 492/1353 + (-36)/(-22). Which is smaller: t or 2/123? 2/123 Let q = -22 + 31. Let p = q - -7. Let l = -42 + p. Which is greater: l or -0.1? -0.1 Let i be (-12)/(-54) - 7/((-189)/(-6)). Which is smaller: i or 2/681? i Let a be (-6)/(-10) + (4068/10)/(-18). Which is greater: -12 or a? -12 Suppose 0 = -3f - 2k - 1, -4f = 3k + 1 + 1. Let o be f + -3 + -1 + 4. Which is greater: o or 7/4? 7/4 Suppose -49 = -5h + 4l, 0h + l = -2h + 17. Let i be h/7 + -1 - 54/42. Which is smaller: i or 0.01? i Let k = -162.5 + 51.4. Let f = 104 + k. Let o = f + 7. Which is greater: o or 3? 3 Let s = -25.9752 - 0.0248. Is -0.06 bigger than s? True Let f = 0.0521 + 1.6979. Which is greater: -2 or f? f Let l(s) = 2s - 2. Suppose -7 + 1 = -6t. Let o be l(t). Suppose -2a - 3 = -3y + 7, o = -3a - y + 7. Does a = -3? False Let g be (-11 + 49)/(1 + -16). Are -4 and g equal? False Let c = -1 - 3. Let b = c + 9. Suppose -o = -l, 3o = -bl + 3 - 35. Which is bigger: l or -3? -3 Let f(l) = -l*3 - 2l*2 - 2l. Let y be f(-2). Suppose 13 = 3x + y. Let q be -1 + x/(-2 - -5). Is 9 less than or equal to q? False Suppose g - 1 = -8. Let a(w) = -w3 - 23w*2 - 60w + 3. Let k be a(-20). Which is smaller: g or k? g Let z = 355217 - 163336. Let r = z + -225844118/1177. Let o = r - 3/107. Is o greater than or equal to -3/5? True Let i = -2509 + 2485.06. Let l = -24 - i. Which is smaller: l or 3? l Suppose 0s + 5a = s - 12, 0 = -3s - 5a - 4. Suppose 6p + 5q = sp + 25, -p - q = -5. Is p < -2/11? False Suppose -164 = 5g - 3g. Suppose 2b - 23	{ "pile_set_name": "DM Mathematics" }
he second biggest value in 4, r, i? i Let t = -5 - -2. Let x be (-2)/(-9) - 40/990. What is the third smallest value in 3/4, t, x? 3/4 Let m be -11 - 0/(-5 + 2). Let g be m/72 - 2/9. Which is the third biggest value? (a) -2/5 (b) -1/4 (c) g a Suppose 3r - r = 4. Suppose -q = 2q - 156. Let m be (-6)/q(-8)/(-6). What is the second smallest value in r, -0.5, m? m Let n = 4.9 + 0.1. Let h = 8 - n. Which is the third biggest value? (a) 4 (b) h (c) -0.3 c Suppose b + 4 = -3b. Let v = -3 - 0. Let i be 5/(-6) + v/(-6). What is the biggest value in b, i, -0.1? -0.1 Let f = 0.97 - 0.47. Let t = 1 + -1.1. What is the third biggest value in -2, t, f? -2 Let d be (-181)/75 + -5 + 7. Let f = d - -2/25. Let o = 1.9 + -2. Which is the third biggest value? (a) f (b) o (c) 0.4 a Suppose -y + 5x - 11 - 1 = 0, -3y + 4x = 3. Which is the fourth biggest value? (a) y (b) 0.4 (c) -3 (d) 0.5 c Let v = 0.3 + -0.1. Let m = -16.22 + 16. Let i = m + -0.08. What is the biggest value in -1, i, v? v Let k(j) = -j2 + 9j + 2. Let q be k(9). Let o(h) = -h2 + 1. Let v be o(q). Let m = -4 - -3.8. What is the third biggest value in v, -1/8, m? v Let i = -5 + 8. Let t(w) = -w3 - 3w2 + 16w + 4. Let d be t(-7). Let u be (-16)/d + 34/66. What is the smallest value in i, u, -0.2? -0.2 Let p(d) = d + 4. Let v be p(-4). Suppose 4s + s - 20 = v. What is the biggest value in 0.4, s, 0.2? s Suppose i = -5p + 11, -2p - 3 + 6 = -i. What is the biggest value in -3/4, p, -0.4? p Let b = 20 + -25. Let m = b - -6. What is the second biggest value in 2/5, -0.2, m? 2/5 Let z = 3 + -4. Let d = z + -1. Which is the smallest value? (a) d (b) -0.2 (c) 4/5 a Let k = 0.5 + 0. What is the second biggest value in -4, -3/8, k? -3/8 Let j = 2.66 + 0.34. What is the third smallest value in 1/7, 5, 0.3, j? j Let n be 77/(-98) - (-2)/4. Let l be 3/(-2)(-8)/54. Which is the biggest value? (a) -5 (b) l (c) n b Let x = 47 - 47. What is the third smallest value in -0.4, x, -1/3, 0.4? x Let x = 15.5 - 9.8. Let j = x - 6. Which is the second biggest value? (a) 3 (b) -0.5 (c) j c Let t(d) = -5d3 + 2d*2 - d. Let y be t(1). Let q be (-2 + 3 + 1)1. Suppose -qv = 3v + 25. Which is the second smallest value? (a) v (b) y (c) 3 b Let c(u) = -2u3 - 12u*2 + 3. Let t be c(-6). What is the smallest value in 0.6, t, -1? -1 Let h = -0.05 - -0.35. Suppose -2 = -2x - 8, s + 4x = -16. Which is the second biggest value? (a) h (b) 4 (c) s a Let f = 6.8 - 2.8. Which is the biggest value? (a) -1 (b) f (c) -1/10 (d) -2 b Let v = 29 + -18.5. Let h = v + -11. Let m = 0.6 - 0.1. What is the second smallest value in -0.2, m, h? -0.2 Let p = 56.7 - 52. Let i = 5 - p. Which is the third biggest value? (a) 5 (b) 3 (c) i c Suppose -z = -3d, 4z + 8 + 0 = 4d. Let k be d/(-5)(-2 + 3). Let p = -0.04 + -0.06. Which is the second biggest value? (a) -5/4 (b) p (c) k b Let z = 71.3 - 71. What is the biggest value in z, 0.04, -4/3? z Let f = 127 - 123. Suppose 10 = -3p - 0d - 5d, -2p = 3d + 5. Which is the second biggest value? (a) p (b) f (c) -0.02 b Let t = -6.12 + 0.12. Let w = t - -6.2. Which is the second smallest value? (a) 0.4 (b) w (c) -1/6 b Let y = -0.08 + 0.29. Let q = y + -0.11. Let r(o) = -o*3 + 7o*2 - 6o - 4. Let m be r(6). Which is the third biggest value? (a) q (b) 4 (c) m c Let k be (4/55)/(2 - 16/10). Let h = -6.8 + -0.2. Let u = h - -4. Which is the second biggest value? (a) u (b) k (c) 0 c Let v = -136/15 + 26/3. Let u = -9.2 - -9. Which is the third biggest value? (a) 1/4 (b) u (c) v c Suppose -3j = -14 + 2. What is the third smallest value in -1/6, j, -0.1? j Let v = -2.1 - 1.2. Let x = -3 - v. Which is the biggest value? (a) -1/3 (b) 1/3 (c) x b Let h be ((-6)/(-45))/(2/3). Which is the second biggest value? (a) h (b) 3/7 (c) 5 b Suppose 2g - 6 = 4g. Let z = 6 + -4. Let k = z - 2. Which is the second smallest value? (a) k (b) 0.1 (c) g a Let s(r) = 2r*2 + 10r - 5. Let w(i) = -i*2. Let k(x) = s(x) + 3w(x). Let l be k(10). Let o = -2325/13 + 179. What is the third biggest value in l, o, 1? l Suppose 11 = 4g + 35. What is the second biggest value in g, 0, -1? -1 Let y = 1.4 + -0.4. What is the smallest value in -5, y, -2? -5 Let q = -13 - -12.9. Let b = -1 + 5. What is the second smallest value in -4, b, q? q Let x = 0.06 + 0.24. Let f be (-1)/5 - 8/160. What is the second smallest value in f, -5, x? f Let f be (-1)/3 + 38/78. Let u = -2.8 - 0.2. Let m be 165/(-210) + (-2)/(-7). Which is the second smallest value? (a) f (b) u (c) m c Let k = 985/6 + -428/3. Let v = k + -213/10. Suppose 2p - p = 2. Which is the smallest value? (a) v (b) p (c) 3 a Let g(k) = -k*2 + 5k + 2. Let l be g(6). Let q(m) = 218m. Let o be q(-1). Let z = o - -1964/9. Which is the third smallest value? (a) z (b) 0.2 (c) l a Let i = -1.1 + 0.1. Let y = -25/6 - -14/3. Let h = -0.1 + 0.2. Which is the third biggest value? (a) i (b) y (c) h a Let w = 0 - 0. Let m = 66.5 + -83. Let d = m - -16. What is the smallest value in w, d, -5? -5 Let s = -4.1 + 5. Let p = s + -1.2. Which is the second smallest value? (a) 5 (b) -1/3 (c) p c Let z = -11 + 9. Let v = 2.1 + z. Which is the biggest value? (a) v (b) 3/4 (c) 1 c Let v = -54 + 272/5. Let u = -0.9 + 5.9. Which is the second biggest value? (a) u (b) 1 (c) v b Suppose 19v - 16v = 0. Suppose -1 = 3r + 2. What is the second smallest value in r, v, 5/6? v Let p = -120 - -119.9. What is the second smallest value in 5, p, -0.7? p Let q(d) = -d*3 - 14d*2 + 14d - 19. Let r be q(-15). What is the third smallest value in -1/2, r, -0.3, 2/7? -0.3 Suppose 3j = -j. Let s = -2 - -3. Let y = s + 1. What is the third smallest value in 1, y, j? y Let u = 0.04 + 0.5. Let f = u + -0.04. What is the biggest value in 2, 2/3, f? 2 Let d = -10.4 + 10. Let p = -6 - -1. Let w = -0.1 + 0.4. Which is the smallest value? (a) p (b) w (c) d a Let z be (-42)/110 - (-3)/15. Let r = 3/107 - -306/535. What is the smallest value in z, r, -0.5? -0.5 Let k = 0.19 + 0.01. Let u = -2.2 + k. What is the third biggest value in u, 2, -2/9? u Suppose -4f + 6 = -f. Let m = 11.3 + -0.3. Let p = m + -13. Which is the second biggest value? (a) p (b) f (c) -4 a Let i = 14 + -41/3. Let d(t) = t*3 + 4t2 + t - 1. Let o be d(-4). What is the third biggest value in i, o, -0.5? o Let a(f) = -f3 + 5f2 - 2f - 4. Let c be a(4). Let b be (6/(-9))/(c/6). What is the third smallest value in -4, 0.1, b? 0.1 Let s = -0.06 + -0.24. Suppose -3y - 18 = -x, -2 - 4 = 3y + 3x. What is the smallest value in y, 0.4, s? y Let y = 0 + 0.4. Let f = y - 0. Let i = -0.08 + -1.92. Which is the second smallest value? (a) -4 (b) f (c) i c Let m = 0.0154 - 0.0654. Let v be ((-2)/(-4))/((-14)/(-4)). Which is the second smallest value? (a) v (b) m (c) 0.1 c Let v = -2.5 - -3. Let w = -0.2 - 0.3. Let q = 29 - 24. Which is the biggest value? (a) v (b) w (c) q c Let j be (6 + (-3)/(-1))/1. Suppose h - 4h - j = 0. What is the smallest value in -0.2, 5, h? h Suppose 5q + 0q + 15 = 0. Let x be (-146)/210 - (-3)/5. Which is the second smallest value? (a) 4 (b) x (c) q b Let s be ((-44)/6)/(4/6). What is the smallest value in -0.4, 2/17, s? s Let j be 38/95(-1)/(-2). What is the biggest value in -2/99, j, -4? j Let j be 1 + 1 + (-3 - -3). Let t = -11/7 + j. Let n = 3627/19 + -191. Which is the third smallest value? (a) n (b) -0.3 (c) t c Let o = -14 + 12. Let f = -0.8 + 1. Let z be -2 + 4/3 - (-56)/(-24). Which is the third biggest value? (a) f (b) o (c) z c Let p(m) = 2m*2 - 7m + 7. Let h be p(2). What is the biggest value in -0.4, h, 4/9? h Let g = -60 - -239/4. What is the third smallest value in 6, 2/15, -3, g? 2/15 Let z(f) = -3f + 5. Let c be z(-5). Let d be 14/(-35) - (-13)/c. What is the third biggest value in -0.1, d, 5? -0.1 Let h = -6 + 4. Let z = -0.04 - -0.23. Let f = 0.01 + z. What is the biggest value in -4, h, f? f Let r be (9 - 8)/(14/82). Which is the third smallest value? (a) 5 (b) r (c) 25 c Let z = 1.22 - 0.02. Let u = 1.2 - z. Let q = 3 + -8. Which is the third biggest value? (a) 2 (b) u (c) q c Let t = 0.058 + -0.158. Which is the fourth smallest value? (a) t (b) 3/2 (c) -2/11	{ "pile_set_name": "DM Mathematics" }
. Give i(y(q)). -75q2 Let x(v) = -171470v - 126. Let t(k) = -k. Calculate x(t(n)). 171470n - 126 Let z(c) = 3c. Let s(a) = -148854a + 51. Determine z(s(d)). -446562d + 153 Let l(j) = -43j. Let v(x) = -108x. Let u(b) = -12l(b) + 5v(b). Let q = 235 + 229. Let c(r) = -r - 464 + q. Give c(u(n)). 24n Let v(s) be the third derivative of s4/8 - 11s*2. Let z(g) = 5g - 4. Let o(t) = t*2 + 8t - 6. Let n(x) = -2o(x) + 3z(x). Determine n(v(l)). -18l2 - 3l Let w(f) = 12f2 + 2133. Let h(v) = -122v. What is h(w(o))? -1464o2 - 260226 Let n(l) = 93l - 21l2 + 32l*2 - 93l. Suppose 2x + 4j = 0, 7x - 2x - 11 = j. Let f(m) = -25m + 25m + m*x. Calculate f(n(i)). 121i*4 Let z(j) be the first derivative of -15j*3 + 246. Let r(y) = -3y. What is z(r(n))? -405n2 Let k(w) = 2w. Suppose -u + 3u = -4o + 286, o + 5u = 49. Let i(d) = -od*2 - 8 + 1 + 7. What is i(k(j))? -296j*2 Let r(u) be the second derivative of -14u + 0u2 + 0u*3 - 1/6u*4 + 1. Let y(j) = 2j*2. Give r(y(x)). -8x*4 Let r(x) = -37 + 37 + 47x*2 - 64x*2. Let g = -14 + 16. Let z(p) = 3p2 + pg + 79 - 79. Determine r(z(m)). -272m4 Let p(z) = 4z + 12. Let l(i) = -3i2 - 19887i + 1. What is l(p(u))? -48u2 - 79836u - 239075 Let o(c) = -c*2 - 2945c + 5887c + 2c*2 - 2942c. Let d(f) = 2f - 2322. Calculate d(o(k)). 2k*2 - 2322 Suppose 20s - 15s = 5. Let g(i) = -i. Let d(c) = 26c. Let u(f) = sd(f) + 10g(f). Let r(v) = 2v. Determine u(r(x)). 32x Let o(b) = -4b. Let k(i) = -51837356i. Calculate k(o(a)). 207349424a Let q(w) = -w + 0w - 438555w2 + 438432w*2. Let n(h) = -2h. Determine n(q(g)). 246g2 + 2g Let i(l) = 3l. Let y(u) be the third derivative of -1049u*4/8 - 4u*2 - u + 5. What is i(y(n))? -9441n Let f(l) = -27017l2. Let i(d) = -3968d*2 + 2. What is i(f(j))? -2896315770752j*4 + 2 Let h(g) be the third derivative of -11g5/60 - g2 - 67g. Let l(m) = -56m*2 - 77m. Let a(c) = 3c2 + 4c. Let d(q) = 77a(q) + 4l(q). Give h(d(o)). -539o4 Let y(m) = -17m - 16. Let l(z) = -8. Let g(a) = 2l(a) - y(a). Let d(s) be the second derivative of 2s*3/3 - 3s. What is d(g(t))? 68t Let z(y) = -y. Let j(i) = -8i + 20 - 30 - 114i2 + 6i. Let l(g) = -2. Let u(n) = j(n) - 5l(n). What is z(u(v))? 114v*2 + 2v Let o(i) = 28i. Let j(v) be the second derivative of 7v*3/2 + 58v - 2. Determine o(j(r)). 588r Let z(l) = -2l*2 + 19845479. Let r(x) = 3x. Give z(r(q)). -18q2 + 19845479 Let i(j) = -177j. Let d(h) = 1747863h. What is i(d(s))? -309371751s Let t(y) = 634817y. Let i(b) = 9b + 3. Determine t(i(f)). 5713353f + 1904451 Let y(o) = -4o*2 - 1. Let g(c) = 20c*2 + 4. Let t(r) = g(r) + 4y(r). Let a(b) be the first derivative of b*3/3 + 9. Give a(t(h)). 16h*4 Let z(v) = -57v*2 - 32v + 8. Let f(j) = -19j2 - 12j + 3. Let m(y) = 8f(y) - 3z(y). Let p(x) = -21 + 46 - 25 - x. Calculate m(p(u)). 19u2 Let o(d) = -d. Let p(f) = 3405f*2 - 75f - 75. Let g(z) = 92z2 - 17z + 30z - 15z - 3 + 1. Let n(k) = 75g(k) - 2p(k). What is o(n(c))? -90c2 Let v(h) = -59736h. Let s(y) = 633y - 2. Calculate s(v(j)). -37812888j - 2 Let h(t) = 163093053t. Let l(k) = -k2. Determine h(l(d)). -163093053d*2 Let u(z) = 2z*2. Let y = 376 - 444. Let h(k) = -153k*2. Let g(x) = yu(x) - h(x). Let f(o) = -18o2. Give g(f(s)). 5508s*4 Let i(x) = -23x. Let u(o) = 51674877o - 1. Give u(i(v)). -1188522171v - 1 Let d be (-504)/(-126)1/211. Let m(i) = 139i2 - 27i - di + 76i - 27i. Let c(k) = -k. Determine c(m(r)). -139r*2 Let m(j) = 20j*2. Let b(w) = 4865709w + 10w2 - 4865709w. Determine m(b(l)). 2000l4 Let l(t) = 5t*2 + 12t. Let r(x) = 2x2 + 4x. Let o(m) = 2l(m) - 6r(m). Let g(f) = -22f - 11f + 9f - 2f*2 + 3f*2. What is g(o(i))? 4i*4 + 48i*2 Let s(a) = 2a*2. Let w(k) be the first derivative of 5 + 5 - 7 + 6 - 2k*3. Give w(s(j)). -24j*4 Let c(q) = -9q. Suppose 114g - 5 = -5. Let t(m) be the first derivative of 1/2m*2 + gm + 7. Calculate c(t(r)). -9r Let h = -81 - -112. Let q(c) = -25c*2 + 55c*2 - hc*2. Let d(u) = 2 - 2 + 12u*2. Give q(d(s)). -144s*4 Let d(j) = -3j. Let i(m) = 4m - 1650736. What is d(i(s))? -12s + 4952208 Let g(l) be the third derivative of -l*5/120 - 19l*3/2 - 26l*2 + l. Let m(z) be the first derivative of g(z). Let r(p) = -4p*2 - 15. Determine r(m(j)). -4j*2 - 15 Let s(w) = -170w + 3. Let p(r) = -284r + 5. Let q(v) = 3p(v) - 5s(v). Let m(l) = 2l + 1. Calculate m(q(u)). -4u + 1 Let w(o) = -3o. Suppose -24 = -9s - 42. Suppose -3p - 9 + 0 = 0. Let l(u) = u*2 + 2u. Let q(g) = pl(g) + sw(g). Let r(f) = 2f. What is q(r(v))? -12v*2 Let j(f) = -9f*2 - 24f. Let q(m) = -4540m. Calculate j(q(u)). -185504400u*2 + 108960u Let s(b) = 5005b2. Let x(t) = 1636t. What is x(s(i))? 8188180i2 Let s(z) = 5z. Let r(o) = -25 - 2o2 - 15 - 13. Give r(s(h)). -50h*2 - 53 Let t(z) = -17158z*2. Let q(d) = 5d + 18. Calculate q(t(i)). -85790i2 + 18 Let p(n) be the first derivative of -68n*2 - 6611. Let i(q) = 16q. Give i(p(r)). -2176r Let d(h) = h2 + 2265h + 2. Let t(g) = g. Determine t(d(x)). x*2 + 2265x + 2 Let c(l) = -3l. Let k(a) be the first derivative of -a5/20 - 12a*3 + 40. Let f(h) be the third derivative of k(h). Determine c(f(r)). 18r Let o(t) = -11t - 2492. Let n(k) = 27k + 4984. Let s(f) = 2n(f) + 5o(f). Let z(b) = 2b. What is z(s(u))? -2u - 4984 Let o(l) = -72l - 42. Let c(f) = 31f + 18. Let g(a) = 7c(a) + 3o(a). Let t(y) = 472y2 - 12y. Let p(b) = b. Let n(j) = -12p(j) - t(j). Give n(g(s)). -472s*2 Let n(s) = -24s*2. Let z(j) = 765j - 1780. Determine z(n(t)). -18360t2 - 1780 Let i(t) = 4772t*2 + 4t + 2. Let o(w) = 39831885w2 + 33390w + 16695. Let n(v) = -16695i(v) + 2o(v). Let z(h) = -h. Determine n(z(c)). -4770c2 Let q(z) = -z2. Let f(l) = 17749445 + 2321l*2 - 17749445. Give q(f(u)). -5387041u*4 Let k(c) = -187c*2 + 5. Let i(q) = -150q*2 + 4. Let z(h) = 5i(h) - 4k(h). Let j(v) = 1 - 2v*2 + 2v*2 - 4v*2. What is j(z(y))? -16y*4 + 1 Let n(h) = 22h*2 - 24h. Let c(a) = -640a2. Determine n(c(m)). 9011200m*4 + 15360m*2 Let o(h) = -4h + 1988438. Let p(u) = -u*2. Give o(p(d)). 4d*2 + 1988438 Let u(v) = 9v - 7v + 0v. Suppose -79 = -3o + 5r, 4o + 3r - 117 = -2r. Let p(q) = 135 - 135 + oq. Calculate u(p(h)). 56h Let j(l) be the second derivative of -l4/12 - 245l. Let x(d) = 1. Let a(s) = -11s + 1. Let t(k) = -a(k) + 2x(k). Calculate j(t(o)). -121o2 - 22o - 1 Let g(q) = 23520072q. Let k(v) = -8v*2. Determine k(g(o)). -4425550295081472o*2 Let z(k) = -2k. Let u(s) = 5940s + 136. Let y(f) = 1979f + 48. Let t(d) = -6u(d) + 17y(d). Calculate z(t(n)). 3994n Let h(i) = 7i - 17. Let t(c) = -16c + 66. Let b be t(4). Let v(l) = 3l + 1. Let q(z) = -7z - 2. Let x(r) = bv(r) + q(r). Calculate h(x(m)). -7m - 17 Let a(o) = -1118o*2 - 1068o*2 + 2500o*2. Let r(d) = 3d*2. Calculate a(r(n)). 2826n*4 Let a(g) = 3370g. Let f(c) = -1353c - 3. Calculate a(f(b)). -4559610b - 10110 Let i(c) be the second derivative of 0 + 0c3 + 3/8c*4 - 3c*2 + 19c. Let m(u) be the first derivative of i(u). Let n(a) = -a*2. Determine n(m(d)). -81d*2 Let i(w) = 1892w*2. Let t(c) = 52841c*2. Give t(i(q)). 189153025424q*4 Let v(l) = -545l*2 + 21732l. Let n(g) = 6g2. Give v(n(j)). -19620j*4 + 130392j*2 Let q(t) be the third derivative of 0 + 0t*3 + 0t - 1/12t4 + 283t*2. Let i(f) = 3f + 152. What is q(i(d))? -6d - 304 Let g(x) = 27x + 21. Let r(l) = 8l + 6. Let s(p) = -2g(p) + 7r(p). Let k(j) = -151j*2. Give s(k(y)). -302y*2 Let i(w) = 8w. Let v(q) = 40q - 2400. Let y be v(60). Let z(o) be the first derivative of yo + 3/2o2 - 13. What is z(i(h))? 24h Let g(j) be the first derivative of 2j3 - 1. Let h(o) = -22o + 925. Let l(u) = -19u + 785. Let r(t) = 6h(t) - 7l(t). Calculate g(r(x)). 6x*2 + 660x + 18150 Let l(q) = -17q - 13. Let s(v) = 3. Let r be ((-5)/(-15))/((-1)/(-3)). Let g(n) = rl(n) + 4s(n). Let i(x) = -3x. Determine g(i(o)). 51o - 1 Let k(i) be the first derivative of 3i*2 - 5. Let d(w) = 7w - 19. Let	{ "pile_set_name": "DM Mathematics" }
)) + -4? -1 What is the value of 24 - 37 - 1 - (-2 + 0)? -12 8 + -10 + 9 - ((7 - 9) + 9) 0 What is ((-3 - 3) + 7 - 6) + -9 + -2? -16 What is the value of 4 - 7 - 1 - (15 + (15 - 29))? -5 Calculate -8 - (-6 + -2 + (9 - 4)). -5 Calculate (-3 - -3 - 31) + (20 - (32 - 18)). -25 (-3 - (-1 - 17)) + 1 - (51 + -47) 12 Calculate 10 + -46 - (-77 - -50). -9 Evaluate (6 - (-6 + 4 + 8)) + -7. -7 What is 61 - 69 - ((-6 - 29) + (-1 - -1))? 27 What is the value of 10 + (41 - (75 - 25)) + 1 + 2? 4 Calculate -3 + (12 - 15) + 4. -2 Evaluate (-7 + -18 - -31) + 12. 18 What is -14 + (0 - -6) + -2 + -1? -11 6 + (14 - (22 + 0)) -2 What is 440 + -457 - (1 + 21)? -39 What is the value of -10 - (3 - (-9 + 11))? -11 Calculate -49 + 51 - (1 - (-3 + 9)). 7 Calculate 2 + 12 + (15 - 9). 20 Calculate 20 + (-3 - (2 + -10)) + -13. 12 Evaluate (-68 - -54) + 1 + 1 + 4 - -4. -4 What is -2 - (-5 - (5 + -4 + -4 + 4))? 4 Calculate -20 - (-20 - (-15 + -3 + 15)). -3 Evaluate 133 + -140 + (3 + -3 - -7). 0 Calculate 12 + (-47 - -38 - (-3 + 1)). 5 What is 2 - (12 + (-22 - -3))? 9 -17 + -17 + 9 + -3 + -5 -33 Evaluate -61 - -84 - (27 + 2). -6 Evaluate 6 - 0 - -17 - 15. 8 What is 22 - (8 + 16) - (0 + 4)? -6 6 + (-5 - (5 - (14 + -3))) 7 What is 0 - (5 - 0 - (2 - (14 - 4)))? -13 2 + -8 + 44 + -36 2 What is 70 + 8 + -56 + 12? 34 Calculate 10 + (14 - 26) - -18. 16 What is -2 + 0 - (4 + (-27 - -25)) - -24? 20 Evaluate 0 + (11 - (35 + -27)). 3 -4 + (19 + -4 - (-13 - -13)) 11 What is -4 - (10 + -9) - (-12 + 2) - 2? 3 Calculate -4 - (0 + -4 - -4) - 3. -7 (-14 - -24) + -27 - -12 -5 Evaluate -1 + 10 - (-24 + 4 + 14). 15 -29 - (-35 - 0 - -28) -22 -11 + -6 + 2 - -10 -5 Calculate -1 - (-14 - (-30 - -3) - 51). 37 9 + (25 + (18 - 29) - 53) -30 Evaluate (-48 - -2) + 165 + -139. -20 Calculate 14 + (0 - ((6 - 24) + 11)). 21 Calculate 10 - ((-198 - -227) + -4 + -1). -14 What is 3 + 3 + -5 + -7 - (7 + -6)? -7 Calculate 10 - (0 - 2 - (-51 + 40)). 1 Evaluate (14 - (13 + 4)) + -2 + 1 + -3. -7 What is -46 - (1 - 24) - -4? -19 What is 19 + (-10 - -7) + -14? 2 Evaluate 4 + 0 - (448 + -434 + (-7 - 0)). -3 Evaluate -6 - (-3 - -3) - (-10 + (-8 - -21)). -9 Calculate (9 + 0 + 0 + -2 - -7) + 0. 14 Calculate 9 - (5 - -5) - 12 - -17. 4 Calculate 20 + -49 + 25 - -25. 21 (27 - 17) + (-1 - 2) + 2 + -31 -22 Calculate (5 - (-7 + 14)) + 8 + -4 + 1. 3 What is (415 - 462) + -4 + 6 + 14? -31 What is the value of -15 - ((-1 - -5 - 2) + -21)? 4 What is the value of -8 - ((-3 - (2 - 3)) + 14)? -20 Evaluate 13 - (-6 - -4 - -8) - 5. 2 What is the value of (6 - 3 - -2) + (-23 - -5) + 12? -1 What is -433 - -436 - (1 + -2 - 1)? 5 What is the value of -18 - (7 - 18) - -3 - -2? -2 Evaluate 24 + 7 - (29 + -12). 14 (-2 - -16) + (-3 + 12 - (34 - 17)) 6 What is the value of 2 - 22 - 0 - -26? 6 2 + -17 + 63 + -8 + -28 12 What is (47 - 66) + (20 - 36)? -35 Evaluate -26 + 1 - (-289 - -275). -11 Calculate -8 + -11 + 57 + -19. 19 What is -1 - (-7 - (-7 - 9))? -10 Evaluate (-9 - -7) + -15 - (-3 + 18). -32 What is -7 + (2 - -5 - (2 - -5))? -7 What is the value of (0 + -3 + 3 - (0 + -5)) + 6? 11 Calculate -28 - ((15 - (-9 - -29)) + (-5 - 0)). -18 What is (6 + 0 + -4 - -5) + -1 + 4? 10 What is 39 + -2 + (-1295 - -1231)? -27 What is the value of (3 + (-15 - -4) - 0) + 0 + 20? 12 Evaluate (-62 - -101) + -21 + -2. 16 Evaluate 5 + 1 - (3 + -9 - -2). 10 Calculate (-35 - (-70 + 30)) + (-41 - (-4 - -1)). -33 Calculate -5 + (-2 - 7) + 8 - (20 - 1). -25 What is the value of -5 - (19 + -10 + 2)? -16 Evaluate 12 - -1 - -25 - 14. 24 What is the value of -5 + -3 + -5 + 7 - (-9 - -1)? 2 What is -6 + 0 - (3 + 5)? -14 What is -13 - (-10 - (-3 - 2))? -8 5 + -3 + -12 + 4 + -1 + 2 -5 Calculate 11 - (-13 - -21 - (1 - (-6 + 3))). 7 1 + (-20 - -8) + 23 12 5 - (10 - (13 - (1 - 14))) 21 Evaluate (-7 - (-6 + (7 - 0))) + 21 + -42. -29 What is the value of (-4 - (10 + 15)) + 0 + 11? -18 What is the value of -1 + 0 - (-22 + 22 + -12)? 11 -4 + 0 + (4 - -16) 16 Evaluate -2 + -1 - -2 - (-2 + -11 + -1). 13 Calculate 9 + -22 + (-2 - -1). -14 What is the value of -13 + 0 + 17 + -26 + (1 - -12)? -9 9 + -31 + (12 - 1) + 25 14 Calculate 1 + -1 + (0 - (-7 + 1)) - -8. 14 Calculate -15 + -35 + 36 + (-4 - -3 - -1). -14 3 + (32 - (59 - 18)) -6 What is the value of 48 - 49 - (4 + -1)? -4 What is -13 + 8 + (-12 - -5)? -12 Calculate 45 - (17 - (-24 + 11)). 15 What is (-4 + 13 - -2) + -6? 5 5 + -8 + -2 + 5 + -10 -10 What is 149 - 168 - (-2 - 6)? -11 (-32 - 2) + 30 + (-8 - 0) + 1 -11 What is 14 + (1 - 2) - (-40 - -44) - 2? 7 Evaluate (0 - -13) + 26 + -48. -9 What is 1 + (-3 - -12) + 9 + -8 + -6? 5 What is -2 + -33 + -33 + (51 - 6)? -23 What is 5 - (0 + 13) - (29 + -33)? -4 Calculate 23 - (-24 - -8) - 29. 10 Calculate -4 - (-21 + 2) - 18 - -11. 8 Evaluate -9 + (3 + -7 - (-5 - -1) - -7). -2 Calculate -8 + (7 + -10 - (-16 - 2)). 7 Evaluate -3 - (10 + -1) - (14 - (7 - -1)). -18 Calculate -3 + (27 + -2 - (10 + -1)). 13 What is (-11 + -8 - -11 - -18) + -7 + -6? -3 Calculate (-217 - -223) + 2 + -14. -6 What is the value of (-4 + 29 - 11) + -6? 8 What is the value of (-7 - (10 - 5 - 9)) + 7? 4 Evaluate -16 - (10 + -13 - 3). -10 Evaluate (3 - 2) + 13 + (17 + -19 - -2). 14 Calculate (-7 - (36 - 41)) + (12 - 0) - -5. 15 -5 + 0 - (-4 - (20 + -14)) 5 (27 + 3 - 38) + 10 + -1 + -3 -2 What is the value of 48 + -42 + (-25 - -1) - (1 + 5)? -24 8 + (-5 + 0 - 11) - -8 0 -16 - (-8 + -3) - (2 + -7) - 5 -5 What is (19 + 0 - (396 - 378)) + (-5 - -1)? -3 -13 - (-21 + (17 - -9)) -18 Calculate 1 - (0 + (-2 + -4 - 10 - -8)). 9 -1 + -13 - (-153 - -147) -8 What is 62 + -74 - (-17 - 3)? 8 What is 1 - (22 + 2 + -5)? -18 0 + -15 - (1029 + -1034) -10 -26 + (147 - 161 - (2 - 15)) -27 What is the value of (26 - 27) + 1 + -10? -10 (-136 - -125) + 7 + (1 - 2) -5 Evaluate -6 - (-8 - (-4 - 10)). -12 Calculate -8 + 2 + -4 - -16. 6 What is 2 + (-8 - (6 - 11)) - 0? -1 What is the value of -1 - 1 - (72 - 44 - 29)? -1 Calculate (-26 - -6) + (4 + -3 - 10) - 0. -29 What is the value of 11 - 24 - (-15 - (-2 - 2))? -2 Evaluate (-8 - 3) + (-13 - (-29 + 9)). -4 Evaluate -9 + (1 - (0 - 1 - -7)). -14 What is the value of 23 + -1 + -4 + -8 - 24? -14 What is the value of 16 + -10 + (4 + -15 - -5) + 9? 9 Evaluate (5 - (-1 + -2)) + -5 - 0. 3 What is 1 + 7 + (-7 - (-24 - -25))? 0 Evaluate (0 - (-9 - -18)) + 20. 11 -31 + -2 + (31 - 12) -14 Evaluate -3 + 3 + (-33 - -3) + 12. -18 What is the value of -9 - (11 + (28 + -26 - (3 + 8)))? -11 What is 2 - (11 - 22 - 1 - -5)? 9 Evaluate 11 - ((-5 - -21) + -6) - (-4 - -14). -9 What is the value of -44 + 75 + -71 + 1 + 8? -31 Evaluate -6 - (16 - 5 - 8 - 7). -2 4 - (-6 + 27 + -9 + -14) 6 What is 9 + -14 - (-18 + 1)? 12 What is -2 + -2 - -7 - 14? -11 -1 - -2 - 12 - ((21 - 23) + 7) -16 What is the value of (-4 - 2 - (-5 - -6 - 2)) + -5? -10 What is (-228 - -223) + 0 + (14 - 0)? 9 What is the value of 1 + (-10 - -1) + -171 + 180? 1 What is (42 + -15 - 32) + 0 + 4? -1 What is the value of 3 + 5 - (-17 - (7 + -14) - 0)? 18 What is the value of 10 - (19 + -29 - (4 - 16))? 8 Evaluate 90 + -66 - (-7 - -24). 7 What is the value of -88 + 91 + 6 + 2 + -1 + 2? 12 Calculate 1494 + -1528 - (-19 - 0). -15 Calculate -7 + 1 + -1 + -2 + 7 - 4. -6 Evaluate -3 + -1 + 0 - (16 - (5 - -16)). 1 (1 - 40) + (-1561 - -1576) -24 What is (1 - 8) + 1 + (-15 - -15 - -21)? 15 What is 1 - (15 - -1) - (-61 - (36 - 92))? -10 19 + (-93 - -23) + 28 -23 What is the value of -23 + 6 + -10 + -10 + 8? -29 (2 - 0) + 5 + (80 - 90) -3 Evaluate (11 - 4) + -4 - -5 - 1. 7 Evaluate 13 - 21 - (0 + (5 - -1) + -36). 22 49 + -69 + 31 + (24 - 1) + 1 35 Calculate (2 - 5 - (8 + 10 + -11)) + 8. -2 What is the value of (404 - 408) + -1 + 6 - (1 + 3)? -3 Calculate (-21 - -37) + -5 + 0 + -24. -13 (-55 - -38) + 10 + 8 1 Evaluate 4 + -6 + (0 - 18) + (-18 - -26). -12 What is -22 + 1 + (3 - -6) + 37 + -39? -14 8 + 26 + -3 + 9 + -15 25 Evaluate 1 + -44 + 26 - -2. -15 What is -6 + 0 + 2 + -4 + 0 + 17? 9 What is 190 - 94 - 104 - (1 - (4 + -1))? -6 30 + -28 - (11 + -6 - 2) - 11 -12 What is -1 - -6 - (1 + 21 - 22)? 5 1 + -21 + (12 - (26 + (-9 - -6))) -31 Evaluate (13 - -1 - 9) + 1 + -2. 4 What is -980 + 998 - (1 - -31)? -14 What is the value of 17 + (-2 + -2 - -5 - 0)? 18 Evaluate (-6 - (-6 - 4)) + (3 - 0) - 4. 3 What is 21 - (19 + 7 + -17)? 12 Evaluate -3 - (-2 + (7 - -3)). -11 What	{ "pile_set_name": "DM Mathematics" }
+ 41. Let q(f) = 116f + 20. Let t(p) = -6l(p) + 11q(p). Let k(r) = -24r*2. Determine k(t(s)). -96s*2 - 2496s - 16224 Let b(x) be the third derivative of -x4/12 - x2. Let i(o) be the third derivative of 7o5/12 + 10o*2 - 1051. Give b(i(z)). -70z*2 Let h(k) = 3k*2. Let i(o) = -1054064o + 8264o2 + 1054064o. Give i(h(q)). 74376q4 Let s(z) be the second derivative of -4z*3/3 - 43z - 5. Let j(a) be the first derivative of -7a2/2 + 1. Determine j(s(g)). 56g Let p(d) = 2d + 3. Let b(w) = -13w - 15. Let x(z) = b(z) + 5p(z). Let k(r) = -150r. Give k(x(y)). 450y Let n(l) = 1006l + 2. Let x(p) = 71p - 369. Give n(x(k)). 71426k - 371212 Let x(h) = -h*2. Let d(f) = -93125338f. Calculate d(x(u)). 93125338u2 Let l(y) = 4y*2 - 5y*2 + 4y*2 + 3y*2 + 0y*2. Let c(z) = 596z - 307z - 312z. What is l(c(q))? 3174q2 Suppose 3c + 5k = 29, -3k = -c - 7k + 19. Let j(b) be the second derivative of -12b - 4bc + 3b*3 + 18b. Let v(g) = -2g. Determine v(j(d)). 12d Let z(x) = -56 - 133 - 8x2 + 189. Let h(w) = -370w*2. Calculate h(z(i)). -23680i*4 Let i(r) = -3742993r*2. Let x(f) = 18f. Calculate i(x(n)). -1212729732n2 Let h(t) = -864t + 215t + 219t + 212t + 216t. Let d(x) = 265x + 1. Determine d(h(f)). -530f + 1 Let s(d) be the first derivative of -5901d2/2 - 3385. Let p(i) = i. Give p(s(l)). -5901l Let w(a) = 3a2 + 25a + 5. Let l(o) = 3o2 + 25o + 3. Let r(i) = 6l(i) - 4w(i). Let d(n) = 2n. Give r(d(b)). 24b*2 + 100b - 2 Let f(b) = -212b + 12577. Let d(h) = -h. Calculate d(f(i)). 212i - 12577 Let u(r) = -35 + 22 + 9r2 + 20 - 7. Let m(c) = 53c*2. Give m(u(k)). 4293k*4 Let r(t) = 1006434t. Let g(w) = 8w - 2. Give r(g(v)). 8051472v - 2012868 Let h(w) be the second derivative of -w*4/24 + 2w*2 - 16w. Let i(d) be the first derivative of h(d). Let u(v) = 4v2 + 49v - 49v + 0v*2. Give u(i(c)). 4c2 Let b(i) be the first derivative of i3/3 - 39. Suppose 3x - 16 = 6z - 8z, 3x = 12. Let y(n) = 5n + 0n - 5n - 17n*z. Give b(y(m)). 289m*4 Let z(l) = -3l. Let v(a) = a*2 - 6a - 1. Let s be v(7). Let c(m) = -2m + 61 - 61 + sm. Determine c(z(b)). -12b Let i(z) = -39z - 2. Let f(m) = -5032m - 259. Let n(b) = -2f(b) + 259i(b). Let l(o) be the second derivative of 0o*2 + 0 + 38o - 1/3o3. Give n(l(t)). 74t Let j(t) = 3t2. Let h(c) be the first derivative of -c2/2 - 226c + 876. Give h(j(n)). -3n2 - 226 Let p(n) be the first derivative of n - 6n - 4 + 5n + n3. Let c(g) = -8g*2 + 0g*2 + 0g*2 + 0g*2 + 3g*2. Determine c(p(h)). -45h4 Let f(k) = -k3 - 2k2 + 2. Let x be f(-2). Let h(t) = 3 + 2 - 5 + xt. Let y(n) = -36n2 + 29n - 29n. Give h(y(v)). -72v*2 Let v(n) = 2n. Let h(b) be the first derivative of -14453b2/2 + 1682. Calculate h(v(z)). -28906z Let u(t) = -100t + 4. Let o(d) be the third derivative of -5d*4/24 + 12d*2 - 188d. Calculate o(u(k)). 500k - 20 Let a(j) = j2. Let o(v) = -148729999v*2. Determine a(o(x)). 22120612602540001x*4 Let o(h) = -2h. Let m(t) be the second derivative of 87/2t3 + 2t + 0t2 + 180. What is m(o(b))? -522b Let y(j) be the third derivative of j4/12 + j2. Let x(a) = 13a + 33. Let w(t) = -28t - 71. Let b(r) = 7w(r) + 15x(r). Calculate y(b(z)). -2z - 4 Let o(j) = 4j. Let p(y) = -129y + 364y - 106y - 349y. What is o(p(v))? -880v Suppose 2b = 3q - 1 - 315, -4b + 286 = 3q. Let y(z) = 2 + 78z + qz - 34z. Let c(w) = -2w. Calculate c(y(n)). -292n - 4 Let o(s) = -9240s. Let l(q) = -428q. What is o(l(x))? 3954720x Let l(d) be the first derivative of 0d*2 + 1/3d*3 + 0d + 44. Let m(z) = 129z2. What is l(m(t))? 16641t*4 Let o(d) = 16d + 43. Let w(m) = 18m2 + 6m*2 + 9m*2 - 37m*2. Determine o(w(x)). -64x*2 + 43 Let h(v) = 113976794v*2 + 1. Let g(f) = 3f. Calculate h(g(o)). 1025791146o2 + 1 Let n(j) be the third derivative of -j4/8 - 2j*2 + 1310. Let a(r) = 46r*2 + 2r. What is n(a(h))? -138h2 - 6h Let s(i) = -5i. Let c(t) = 45508 + 691t + 302t - 45508. Determine s(c(q)). -4965q Let u(q) = -96q + 28q + 39q - 68 + 68. Let c(v) be the third derivative of -v4/12 + v2. What is u(c(x))? 58x Let z(t) = 9t2 + 104t - 9317. Let k(y) = -y. What is z(k(x))? 9x2 - 104x - 9317 Let y(t) be the third derivative of t*5/15 + 2341t*2. Let q(b) = -962b*2. What is y(q(o))? 3701776o*4 Let y(g) = -2g*2 - 25. Let p(t) = 118t + t*2 - 44t - 37t - 37t. Give p(y(l)). 4l4 + 100l*2 + 625 Let w(u) = -1396u. Let h(t) = 8t2 - t - 1. Let g(f) = -47f*2 + 6f + 6. Let s(r) = -g(r) - 6h(r). Give s(w(b)). -1948816b*2 Let i(y) = 25y. Let o(a) = -8172534a. Give i(o(j)). -204313350j Let d(u) = 51u2 - 5u - 78. Let f(a) = 253a2 - 27a - 429. Let k(m) = 11d(m) - 2f(m). Let b(y) = -24y2. Calculate k(b(q)). 31680q*4 + 24q*2 Let w(s) be the first derivative of -25s*3/3 - 7s*2/2 + 122. Let f(k) = -4k - 1. Let c(x) = 19x + 5. Let u(r) = -c(r) - 5f(r). Calculate w(u(j)). -25j2 - 7j Let u(x) = -2x. Suppose -4n - 4j - 12 = 0, -3j - j - 10 = 5n. Let s(b) be the second derivative of 0 + 5/2b*3 - 27b + 0bn. Determine s(u(g)). -30g Let h(x) be the second derivative of 3/4x4 + 0x*3 - 9/2x*2 + 0 - 211x. Let v(i) = -3i2. Calculate h(v(g)). 81g*4 - 9 Let r(g) = -10g. Let u(h) = 224h - 30. Let q(y) = -99y + 14. Let k(a) = -7q(a) - 3u(a). What is r(k(l))? -210l + 80 Let s(t) = 59t + 12t - 72t. Let a(f) = 106f. Calculate a(s(w)). -106w Let n(g) = -g + 4. Let x(k) = -6k + 30. Suppose -143o + 141o - 4 = 0. Let m(b) = ox(b) + 15n(b). Let d(z) = -5z - z - 5z. Give m(d(s)). 33s Let p(g) = -2g2. Let w(x) be the first derivative of 0x*2 + x - 46 + 14/3x*3. Determine w(p(k)). 56k*4 + 1 Let h(v) = -40v. Let t(m) be the second derivative of m*3/2 + 2m + 353. Determine t(h(a)). -120a Let y(k) = 13k + 6. Let a(q) be the first derivative of -156q2 - 143q + 18. Let t(z) = -6a(z) - 143y(z). Let d(r) = -6r2. Give t(d(g)). -78g*2 Let m = 51 - -659. Let n(g) = -m + 7g2 + 710. Let i(z) = -z2. What is n(i(j))? 7j4 Let o be (2 - 0) + -3 + 2. Let l(v) = -o + 1 - 3v. Let z(u) be the third derivative of -25u4/24 + 4601u*2. Determine l(z(h)). 75h Let s(p) = -2p2. Let v = 197 - 190. Let i(q) = 3q*2 + 9 - v - 2. Give s(i(u)). -18u*4 Let i(f) = -11f*2 - 4f + 4. Let n(m) be the first derivative of -11m3/3 - 3m*2/2 + 3m + 42. Let w(h) = 3i(h) - 4n(h). Let p(b) = -16b. Give p(w(v)). -176v*2 Let c(a) = 22a. Let s(d) = -583d2 + 4835d + 2. Determine s(c(k)). -282172k2 + 106370k + 2 Let b(m) = 110m. Let s = 443 + -443. Let h(a) = a + 10a - 15a + sa + 3a. What is h(b(n))? -110n Let s(u) = 6u2. Let c(n) be the third derivative of n4/12 + n3/6 + 2064n*2. Give c(s(k)). 12k2 + 1 Let s(m) be the third derivative of m4/12 + 3m2 - 125. Let b(u) = 3u*2 + 82. Give b(s(l)). 12l*2 + 82 Let t(s) = -3s. Let w(n) = -2n2 - 2n - 1. Let a(q) = 51q + 121q + 50q + 197q*2 + 53q*2 + 78q + 150. Let j(g) = a(g) + 150w(g). Calculate j(t(d)). -450d*2 Let i(f) = 764767f. Let n(j) = 6j2. Determine i(n(k)). 4588602k*2 Let n(y) = 16y*2 + 7y - 7. Let t(h) = 7h2 + 3h - 3. Let l(j) = 6n(j) - 14t(j). Let w(u) = 477u. Give l(w(i)). -455058i*2 Suppose -6l = -5l - 2. Let x(f) = -3f*3 + 3f*2 + 6f + 11. Let w be x(-2). Let t(v) = -3 - 37v2 + 3 - 31v + wvl. Let z(y) = 2y*2. Give t(z(m)). -8m*4 - 62m2 Let h(u) = u2. Let n(x) = -1047668057x2. Give h(n(c)). 1097608357658155249c*4 Let c(u) = -u. Let l(d) = -3991387d*2. Determine c(l(s)). 3991387s*2 Let c(v) = v. Let r(l) = 2142898l + 33. Calculate r(c(k)). 2142898k + 33 Let f(c) = 59c*2 + 18c. Let j(y) = 162y + 1. Determine f(j(b)). 1548396b*2 + 22032b + 77 Let b(u) = 1. Let n(x) = -x - 4. Let y(c) = 4b(c) + n(c). Let f(h) be the second derivative of 2h*4 + 6h - 7. What is f(y(o))? 24o2 Let h(j) = -195j*2 - 24j - 120. Let i(o) = -o*2 + o + 5. Let z(p) = h(p) + 24i(p). Let b(f) = -4f. Determine b(z(t)). 876t*2 Let m(w) = 31w. Let b(j) = -45j2 - 51j*2 + 107j**2. Determine b	{ "pile_set_name": "DM Mathematics" }
vided by t(10). 21 Calculate the remainder when -1(-11 + (-3984 - -12)) is divided by 1326. 5 Let w = 6876 + -1638. What is the remainder when w is divided by 169? 168 Let c(f) = 4f*2 - 9f - 8. Let d be c(-8). Let n be 5 + -3 + d/5. Suppose 5z = -h - 4 + 12, -5h + z = -n. What is the remainder when 36 is divided by h? 10 Let a = 63 - 43. Suppose -a = -3h - 4p + 8, 3p = -6. Suppose 90 = 2z + 2y, 3y + 2y - 99 = -2z. Calculate the remainder when z is divided by h. 6 Suppose 1922z + 331695 = 1987z. Calculate the remainder when z is divided by 1700. 3 Let x = 123 + 164. Let b(d) = 11d - 136. Calculate the remainder when x is divided by b(15). 26 Let b(o) = o2 - 174o - 287. Calculate the remainder when 665 is divided by b(176). 15 Let o(j) = 2j3 + 31j*2 + 51j + 562. Calculate the remainder when 767 is divided by o(-15). 19 Suppose -2i + 77 = -21n + 16n, -n + 124 = 3i. Calculate the remainder when 1766 is divided by i. 3 Let c be 24/64 - (-87)/24. Suppose 6i + ci = 220. Suppose r + 14 = 25. What is the remainder when i is divided by r? 0 Let n = 3799 - 3781. Calculate the remainder when 64 is divided by n. 10 What is the remainder when 40 is divided by 40(-8)/(-40) - (-7 - 1)? 8 Let j = -24 - -34. Let t = -4 - 11. What is the remainder when (3/(-4))/((t/(-108))/(-5)) is divided by j? 7 Let s(n) = n3 + 60n*2 - 132n - 488. Calculate the remainder when 3093 is divided by s(-62). 5 Let m = 88805 - 88793. Suppose -4q + 5u = -1071, -q + 4u + 254 = -0q. Calculate the remainder when q is divided by m. 10 Let d = 2216 + -2166. What is the remainder when 123 is divided by d? 23 Suppose 213n + 1460 = 217n. Let h = 388 - n. Suppose -2o + 257 = 5v, 4v = 4o - o + 201. Calculate the remainder when v is divided by h. 5 Let y be (-10 - 24)/(4/(-14)). Suppose 15p - y = 241. Calculate the remainder when p is divided by 11. 2 Let y(l) = -125l - 439. Calculate the remainder when y(-24) is divided by 15. 11 Let q(c) = 11c - 4. Let i be q(0). What is the remainder when (1/(-3))/(i/300) is divided by 7? 4 Suppose 44d = -38d + 22d + 3060. Calculate the remainder when 12902 is divided by d. 50 Let w = 7128 - 5055. What is the remainder when w is divided by 51? 33 Suppose -2n = 3i + n - 27, 3n = -i + 5. Suppose iu + 2q = 15u - 400, -4q = 2u - 210. What is the remainder when 1512 is divided by u? 98 Let y be ((-16)/10)/((-2)/10) + 2. Let d be y/3(-330)/(-25). Suppose -3c - c = -d. Calculate the remainder when 31 is divided by c. 9 Let u(x) = -3x2 - 11x + 9. Let v(g) = -g*2. Let d(w) = u(w) - 2v(w). Suppose 2279 = -82j + 125j. What is the remainder when j is divided by d(-11)? 8 Suppose 43061 + 175060 = 37y - 22860. Calculate the remainder when y is divided by 181. 178 Suppose 2y + 5o - 158 = 0, 12o = -2y + 9o + 162. What is the remainder when 176 is divided by y? 8 Suppose 0 = 5p - 58 - 47. Calculate the remainder when 2/(-4)(-3)/(27/1098) is divided by p. 19 Let u(p) = 568p - 2213. Calculate the remainder when 576 is divided by u(4). 45 Suppose 6p = 2p + 2m + 22, 22 = 5p + 3m. Let r(a) = -3a3 - 2a*2 + 7a + 5. Calculate the remainder when r(-4) is divided by p414/10. 25 Let u = -372 - -666. What is the remainder when u is divided by 13? 8 Suppose -2942 = -79z + 297. Calculate the remainder when 326 is divided by z. 39 Let v = -31557 + 31615. What is the remainder when v is divided by 14? 2 Suppose 81 = 38c - 109. Suppose ca - 10a + 161 = b, 4 = 4b. Calculate the remainder when a is divided by 0 + 2 - (0 + -10). 8 Let k(s) be the first derivative of -19s*4/4 - 2s3/3 - s2/2 + 1. Suppose 3800 = 53y + 1256. What is the remainder when y is divided by k(-1)? 12 Let g = 530 - 331. Suppose -6a - 26 + 434 = 0. What is the remainder when g is divided by a? 63 Let i(f) = 2f2 - f - 240. Let u be i(0). Suppose y + 676 = -y. Let p = u - y. What is the remainder when p is divided by 25? 23 Let a(f) = 2f*3 - 5f*2 - 14f + 10. Let k be a(4). What is the remainder when 287 is divided by (-11 - -1)/k - -79? 65 Let p(m) = m*3 + 24m*2 - 15m - 133. Suppose 4t - 33 = 3d + 40, 0 = 5t + 5d - 100. Calculate the remainder when p(-24) is divided by t. 18 Let d(y) = y*2. Let s(h) = -2h*3 + 24h*2 + 27h - 48. Let g(z) = 2d(z) - s(z). Calculate the remainder when 175 is divided by g(12). 7 Let j = -3572 + 3714. What is the remainder when j is divided by 16? 14 Suppose 116 = 2u - 3t, 5u = -4t + 278 + 35. Let n = u + -42. Calculate the remainder when n is divided by 5/(15/13)(2 - -1). 6 Let f be ((-76)/(-133))/((-2)/(-14)). Suppose 4w + 140 = fz, -z + 34 = 4w + 4. Calculate the remainder when 234 is divided by z. 30 Suppose -11541b - 38 - 394 = -11550b. What is the remainder when 147 is divided by b? 3 Let w(g) = -36g + 31. Calculate the remainder when 243 is divided by w(0). 26 What is the remainder when 5633 is divided by 1 + 35/(-10) + (-844)/(-8) + 12? 113 Suppose -62p = -379 - 117. Let v be 24/132 - 216/(-22). Suppose -2o = -46 + v. Calculate the remainder when o is divided by p. 2 Let a(p) be the first derivative of 5p3/3 + 3p*2/2 - 3p + 9. Let c(h) = h*3 + 5h*2 - 6h - 16. Calculate the remainder when a(3) is divided by c(-5). 9 Let a(b) = -2b + 3. Let s = 112 + -119. Let m(h) = -2h*2 - 25h - 72. What is the remainder when a(-6) is divided by m(s)? 0 Suppose 60y - 1019 = 4921. What is the remainder when y is divided by 98? 1 Let m(i) = -3i + 29. Let x be m(9). What is the remainder when 235 is divided by (12/24)/(x/2043)? 14 Suppose f + 84z = 85z + 454, 5z + 10 = 0. Calculate the remainder when f is divided by 16. 4 Calculate the remainder when (-110908)/(-153) + 43/108 is divided by 10. 5 Let z = -1661 - -1675. Let j = 211 + -181. What is the remainder when j is divided by z? 2 Let t(v) = v3 - 20v*2 + 35v + 19. Let d be -1824/(-18) - 6. What is the remainder when 11 is divided by t(d)? 0 Let l = 6 - 3. Let z(h) = 14h - 3. Suppose 12k = -28k + 840. Calculate the remainder when z(l) is divided by k. 18 Let g(d) = d*3 - 11d*2 - 12d - 27. Let u be g(12). Let a = 91 - u. Calculate the remainder when a is divided by 52. 14 Suppose -14o - 10793 = -752o + 13561. Suppose 0n - 20 = -4g + n, 0 = -4n - 16. Calculate the remainder when o is divided by g. 1 Let j = 36 - 72. What is the remainder when 88(-4 + 270/60) is divided by (j/(-10))/(6/40)? 20 Suppose -7d = 14d - 147. Suppose 4t = -0 + 12. Suppose -tb + 2x + 188 = -2x, -b + 3x = -61. Calculate the remainder when b is divided by d. 1 Suppose 0 = 2h - 12, -c + 440h - 445h = -468. Calculate the remainder when c is divided by 116. 90 Suppose 8t + 3 = 11t. Let m(c) = c*2 + 8c + 3. Let y be m(-8). Suppose yo + 3 = -3r + 24, 0 = -r + 5o - 23. What is the remainder when r is divided by t? 0 Let d(n) be the third derivative of 1/60n*5 - 13n*2 + 1/3n*3 + 0 - 1/3n*4 + 0n. What is the remainder when 87 is divided by d(10)? 21 Suppose -18 = -5g + 37. Suppose 0 = -3v - 3r + 687, 4v = 4r + 104 + 804. What is the remainder when v is divided by g? 8 Calculate the remainder when 43(3 - (-11 + 10)) is divided by 156. 16 Let a(b) = -b*3 + 8b*2 - 6b - 5. Suppose 135 = -3y - 6. Let c = y + 52. Calculate the remainder when a(c) is divided by 21. 19 Suppose 26 - 8 = 3p. Suppose 0 = -5c - m + 3, 2m = -2c + 8c - 10. What is the remainder when p is divided by c? 0 Suppose -37j + 23j = -3430. Suppose -679f = -672f - j. What is the remainder when 99 is divided by f? 29 Let t(k) be the third derivative of -k4/3 - k3/2 + 2k2. Calculate the remainder when -2 - -56 - (-7 - (-1 - 4)) is divided by t(-3). 14 Suppose -56 = 32d - 34d. Suppose 214 = 4t - 5j, 5t - 254 = -j + d. Let n(k) = 3k2 - k - 4. Calculate the remainder when t is divided by n(3). 16 Suppose 3p - 5p + 4l = -338, -2p - 4l + 306 = 0. What is the remainder when 1764 is divided by p? 154 Let f(l) = 28l3 - 4l*2 + 3l. Let d be (-64)/10 - 6/(-15). Let m(t) = -t*3 - 7t*2 - 7t. Calculate the remainder when f(1) is divided by m(d). 3 Suppose -141h - 40 = -143h. Suppose 0 = -5x + 4x + 119. Suppose h = -3*s + x. What is the remainder when s is divided by 12? 9 Calculate the rem	{ "pile_set_name": "DM Mathematics" }
0i + 1 + 1/3i*3 + 0i*2. Calculate o(c(v)). -133v*2 + 2 Suppose -w + 33 = 3z, 4w - 7z + 2z = 115. Let q = w - 13. Let t(s) = -q + 41s + 17. Let l(a) = -2a. Calculate t(l(r)). -82r Let u(a) = 41829730a. Let i(s) = -11s*2. Calculate i(u(p)). -19246989430601900p*2 Let p(m) = 3480m*2. Let r(f) = -191f. Let g(z) = -82z. Let k(a) = 7g(a) - 3r(a). Calculate k(p(n)). -3480n*2 Let c(t) = -1 + 1 - 1358t*2 + 1353t*2. Let p(l) = l - 1540. Determine c(p(o)). -5o*2 + 15400o - 11858000 Let v(j) = 90672j. Let q(y) = -6y*2 - 8. Calculate v(q(t)). -544032t*2 - 725376 Let p(g) be the first derivative of 29g*3/3 - 1095. Let r(w) be the second derivative of 0w*2 + 0 + 1/12w*4 - w + 0w*3. Calculate p(r(f)). 29f*4 Suppose -104 = -2g + 3w - 2w, 0 = 4w - 8. Suppose 193 = 3m + 2z, m + g = 2m - 5z. Let d(v) = 63 + 37v - v - m. Let q(h) = 2h2. What is d(q(c))? 72c2 Let x(r) be the second derivative of r4/3 + 2r + 58. Suppose 0l + 2l - 8 = 0. Let y(n) = 12n*2 - l + 4. Determine y(x(h)). 192h*4 Let a(c) be the first derivative of 26/3c*3 + 0c*2 + 0c - 56. Let r(g) = -4g. Calculate a(r(q)). 416q2 Let v(h) = -h. Let f(d) be the second derivative of -d3 + 2d2 + 3d + 67. Determine f(v(x)). 6x + 4 Let o(x) be the third derivative of 37x*4/24 - 2x*2 - 47x - 2. Let z(p) = 5p + 2p - 8p. Determine o(z(w)). -37w Let g(n) = -3n2. Let r(y) = -24009596y*2. Determine g(r(o)). -1729382100249648o4 Let g(c) be the second derivative of c3/3 + 13c2/2 - 24c - 31. Let s(q) = 4q2 - 1. Determine s(g(w)). 16w*2 + 208w + 675 Let u(y) be the first derivative of 4y3/3 + 28. Let o(j) = -j2. Let w(z) = -8o(z) + 4u(z). Let d(q) = -q + 3q - q. Give w(d(c)). 24c2 Let w(x) = 2x. Let a(r) = -51710803r2 + r. Calculate w(a(v)). -103421606v*2 + 2v Let h(z) = 4z + 2. Let u = -1 - 2. Let b(w) = -14w - 3 + 17w - 8w. Let k(j) = uh(j) - 2b(j). Let c(a) = 9a. Give k(c(v)). -18v Let g(i) = -7606i. Let q(r) = 2r*2 - 6r - 6. What is g(q(d))? -15212d2 + 45636d + 45636 Let v(r) = -5204434 + 5204434 + 226r2. Let a(k) = -5k + 7k - 6k + k. Calculate v(a(w)). 2034w2 Let b(a) = -259a. Let g(n) = 181063n. What is b(g(k))? -46895317k Let a(v) = -23v2. Let q(u) = -5u + 7u2 + u - 440 + 436. Let h(b) = 9b*2 - 5b - 5. Let j(k) = 4h(k) - 5q(k). Determine a(j(r)). -23r4 Let m(c) = -504c + 676c - 288c. Let i(f) = -21f. Give m(i(k)). 2436k Let p(o) = -6o. Let r(y) = 11y*2 - 8. Let i(c) = -2c + 10. Let w be i(7). Let m(l) = -10l2 + 6. Let v(d) = wm(d) - 3r(d). What is v(p(q))? 252q*2 Let t(u) = -63u*2. Let h(z) = 5z - 290158. Calculate h(t(a)). -315a2 - 290158 Suppose -3u + 6u + 9 = 4t, 5t - 9 = 3u. Let n be ((-9)/6-1 + t)6. Let p(c) = 17 - 8 - n - 22c. Let h(o) = 2o*2. Calculate p(h(m)). -44m2 Let m(t) be the second derivative of t6/360 + 19t4/12 + 17t. Let j(y) be the third derivative of m(y). Let u(w) = 8w2 - 18 + 18. Determine u(j(h)). 32h*2 Let z(w) = 3w2. Let x(t) = -t2. Let r(p) = -21x(p) - 6z(p). Let l(c) be the second derivative of 17c3/6 - 25c - 4. Calculate l(r(b)). 51b2 Let s(o) = 2o*2 - 37o + 758. Let n(a) = 9a. Give n(s(t)). 18t*2 - 333t + 6822 Let d(c) be the second derivative of -c7/1260 - c4/12 + 45c3/2 + 29c. Let a(w) be the third derivative of d(w). Let u(b) = 41b. What is a(u(f))? -3362f*2 Let p(u) be the first derivative of -3u - 138 + u*2 + 3u + 155. Let x(f) = -197f2. What is p(x(v))? -394v2 Let t(f) = -f2. Let y(n) = n + 2094902. Determine y(t(j)). -j*2 + 2094902 Let t(m) = 14880183m*2 + 2. Let q(z) = -2z*2. Determine t(q(x)). 59520732x*4 + 2 Let p(r) = -403r. Let c(w) be the first derivative of -w*2/2 - 1331. What is p(c(k))? 403k Let a(q) = -115q2 - 6q - 3. Suppose 236w - 18 = 239w. Let n(y) = 24839y2 + 1298y + 649. Let b(d) = wn(d) - 1298a(d). Let j(u) = u. Give j(b(p)). 236p2 Let i(b) = -b. Let s(v) = 241148v. Calculate s(i(c)). -241148c Let v(b) = -15520077b. Let m(u) = -4u. What is m(v(q))? 62080308q Let c(j) be the second derivative of j*3/2 - 4j + 119. Let x(t) = 228t - 1. What is c(x(q))? 684q - 3 Let r(u) = u. Let x(f) be the second derivative of f*7/2520 - 23f*5/60 - 7f*4/3 - 59f. Let o(v) be the third derivative of x(v). Give o(r(t)). t*2 - 46 Let u(l) = -7l*2 - l. Let j(n) be the first derivative of -79n*2 + 7358. Give j(u(r)). 1106r*2 + 158r Let r = -361 - -370. Let c(p) = rp - 2p - 31789 + 31788. Let m(h) = 2h. What is m(c(w))? 14w - 2 Let i(a) = 2773088a2. Let u(g) = -2g. Give u(i(z)). -5546176z2 Let d(x) = 2x*2 + 19x + 1. Let m(b) = -21b2 - 95b - 5. Let h(k) = 5d(k) + m(k). Let q(i) be the second derivative of -5i*3/6 + i. What is h(q(f))? -275f*2 Let f(z) be the second derivative of -7z*3/6 - 33z + 13. Let h(t) = 17t2. Let k(g) = 341g*2. Let x(i) = 121h(i) - 6k(i). Give f(x(s)). -77s2 Let g(p) = -p2 - 2060p. Let k(r) = -193r*2 - 194r*2 - 193r*2 + 581r2. Calculate g(k(t)). -t4 - 2060t2 Let g(z) = -8z. Let h(m) = -53m - 31m - 65m - 30m - 59m. Calculate h(g(i)). 1904i Let c(s) = s*2. Let u(l) be the third derivative of 213l*4/4 + 76l*2 - 59. Calculate u(c(j)). 1278j*2 Let w(s) = 3s*2. Let z(m) be the first derivative of -2123m*3/3 + 12410. Determine w(z(q)). 13521387q*4 Let k(s) = 6s + 352. Let l(i) = i + 64. Let m(a) = -4k(a) + 22l(a). Let v(f) = 82f. Give v(m(w)). -164w Let l(s) = -28s2. Let j(b) = 2b*2. Suppose -59 = 7f + 81. Let q = 25 + f. Let k(t) = 4t2. Let h(g) = qj(g) - 3k(g). What is l(h(z))? -112z*4 Let c be (3 + -9)/(9/(-6)). Let v(l) be the third derivative of -1/60l*5 + 0 + 0l*c + 17l*2 + 0l*3 + 0l. Let d(h) = -13h. Calculate v(d(f)). -169f*2 Let y(w) = -26w. Let h(a) = 0a + 12a + 2a + 0a - 1. Give y(h(d)). -364d + 26 Let i(y) = y2. Let l(j) = -5216j*2 + 4081j*2 - 11852j*2 - j + j. Calculate i(l(s)). 168662169s*4 Let z(i) = -2i + 297 - 2i - 297. Let l(j) be the third derivative of 13j*5/60 - 2j*2 + 216j. Give l(z(x)). 208x2 Let g(b) = 6b - 7. Let r(z) = 6z2 - 12z - 12. Let o(j) = -3j2 + 4j + 4. Let l(q) = -9o(q) - 3r(q). What is l(g(n))? 324n2 - 756n + 441 Let j(u) = 2u2. Let t(k) = 1965k + 51. Let c(l) = -3928l - 85. Let q(o) = 3c(o) + 5t(o). What is j(q(d))? 7675362d2 Let h(n) = n2. Let y(i) = 15900018i2. Give y(h(f)). 15900018f4 Let z(f) be the second derivative of -f4/6 - 7f. Let u(c) be the third derivative of 1/3c*3 + 0 - 2c*2 + 0c - 19/24c4. What is z(u(a))? -722a*2 + 152a - 8 Let x(b) = 4b2 - 3b*2 - 2b*2 + 6b*2. Let h(a) = -8a - 17. Let q be h(-4). Let n(p) = qp2 - 13p*2 + 5p*2. What is n(x(o))? 175o*4 Let z(s) = 71s*2 + 721s. Let c(x) = 12x + 2. Calculate c(z(f)). 852f*2 + 8652f + 2 Let k(b) be the second derivative of -b*4/4 + 73b. Let v(n) = 21n2 - 42n*2 - 30n*2 - 3n*2. Calculate v(k(g)). -486g*4 Let j(a) = 3a. Let i(w) = 4w2 + w - 4. Let h(p) = 969p*2 + 238p - 952. Let m(z) = 3h(z) - 714i(z). Give j(m(y)). 153y2 Suppose -6w + 6 = -3w. Let k(c) = 119 + 6c*w - 119 - 4c. Let r(o) = -5o2 + 3o. Let x(u) = -3k(u) - 4r(u). Let g(l) = -11l2. Calculate g(x(z)). -44z4 Let u(s) be the second derivative of -s3/6 + s. Let w(m) = -99m - 3 + 35m + 52m - 6 + 9. What is u(w(d))? 12d Let p(i) = i*2 - 7. Let k(v) be the first derivative of -2v*2 - 921. What is k(p(g))? -4g*2 + 28 Let d(p) = -2p + 2347. Let q(g) = -34g + 1. Determine q(d(i)). 68i - 79797 Let u(m) = 3m2. Let i(z) = 6507 + 1338z - 3257 - 3252. Determine i(u(l)). 4014l2 - 2 Let j(i) = -i. Let r = -637 - -1206. Let h(b) = 520b - 1123b + rb. What is h(j(f))? 34f Let r(l) = -3l*2. Let f(i) = 43i*2 + 6999i. What is f(r(q))? 387q4 - 20997q*2 Let t(b) = 14249b*2. Let z(h) = -8h*2 - 26h. What is z(t(x))? -1624272008x4 - 370474x2 Let l(n) be the third derivative of n5/15 - 2632n2 + 2. Let b(u) = 100 - 100 - 16u*2. Calculate b(l(o)). -256o*4 Let q be (20/10 - -3) + 41. Let t(p) = 1328 - 662 - qp2 - 666. Let h(n) = -8n**2. De	{ "pile_set_name": "DM Mathematics" }
- 0h + 18, 0 = -5o - 3h - 22. Let u(g) = -4g*3 + 5g - 5. Let f(a) = -a*3 + a - 1. Determine of(r) + u(r). r*3 Let l(k) = 4 - 2 + 9k + 5k2 + 7. Let c(h) = -h2 - 2h - 2. Let o be (-2)/(-4)(-3 + 38 + 1). Give oc(z) + 4l(z). 2z*2 Let k(o) = -3o. Suppose 6 = 5z + 26. Let f(c) = 11c - 6. Let n(v) = -10v + 5. Let g(a) = -5f(a) - 6n(a). Determine zg(q) - 7k(q). q Let z(h) = h. Let l(g) = g2 + 2g. Let s = 38 - 39. Determine sl(m) + 4z(m). -m*2 + 2m Let o(w) be the first derivative of -16w3 + 33w*2/2 - 5. Let z(u) = 3u*2 - 2u. Calculate -2o(h) - 33z(h). -3h2 Let l(i) = -5 - 5i - i*2 + 0i + 0 + 0i. Let b(c) = 2c + 2. Let h be (-136)/24 - 2/(-3). What is hb(z) - 2l(z)? 2z2 Let c(d) = -2d*3. Let p = -21 - -24. Let u(f) = 33 - 33 - 2f*p + 0f*3. Let s = -15 - -10. Determine sc(h) + 4u(h). 2h*3 Let k(r) = -3r + 1. Let x(m) = 2m. Calculate -k(i) - 2x(i). -i - 1 Let a(l) = -2l2 + 15l - 13. Let q be ((-10)/3)/((-6)/(-27)). Let f = q + 4. Suppose 2v = -13 + 1. Let h(j) = j2 - 8j + 7. Give fh(p) + va(p). p*2 - 2p + 1 Let t(u) = -u3 + u2 - u + 1. Let z(k) = -k3 - k2 + 2k + 1. Suppose 0 = -3p - 2 - 1. What is pz(f) - t(f)? 2f*3 - f - 2 Let v(n) = -4n - 9. Let z(g) = -9g - 18. Give -7v(l) + 3z(l). l + 9 Let n(l) = 3l*2 + l. Let r(z) = -9z*2 - 3z. Give 8n(s) + 3r(s). -3s2 - s Let f(a) = -4a*2 + 8a + 4. Let j(q) = q*2 - 1. Give f(d) + 5j(d). d*2 + 8d - 1 Let w(b) = -b - 5. Let s(q) = -6q - 24. Determine 5s(r) - 24w(r). -6r Let n(h) = h - 1. Let a(x) = -4x + 5. Suppose 5t - 16 = t, -4f + 5t - 64 = 0. Calculate fn(c) - 2a(c). -3c + 1 Let l(w) = 5 + 2 + 3w - 1 - 2. Let t(y) = 1. Give -l(i) + 4t(i). -3i Let c(v) = -5v - 8. Let g(f) = 6f + 9. What is 4c(p) + 3g(p)? -2p - 5 Let r(c) = 2c*3 - 5c + 6. Let z(n) = 4n3 - 10n + 11. Calculate -5r(t) + 3z(t). 2t3 - 5t + 3 Let l(z) = -42z - 4. Let m(k) = -42k - 3. Calculate 3l(s) - 4m(s). 42s Let u(x) = -x2 - 2x - 6. Let f(n) = 13 + 0n - 2n + 5n + 2n*2 + n. Let t be 51/4 - (-1)/4. What is tu(b) + 6f(b)? -b2 - 2b Let o(i) = -14i3 - 5i*2 + 3i - 9. Let r(h) = -21h3 - 8h*2 + 5h - 14. What is -8o(x) + 5r(x)? 7x3 + x + 2 Let j(k) = k2 - k. Let t(c) = -6c*2 + 6c. Let n(f) = -11j(f) - 2t(f). Let h(x) = 6x2 - 4x. What is h(m) - 4n(m)? 2m*2 Let u(g) = -4g*3 - 3. Let x(m) = 12m*3 + 10. Give 10u(s) + 3x(s). -4s*3 Let o(a) = a + 3. Let b(g) = g + 2. Let z be 6 - 1/((-3)/(-6)). Let h = 6 - z. Suppose -4n + 2m - 5m - 18 = 0, 0 = -n + 2m + 1. What is ho(u) + nb(u)? -u Let m(n) = 2n + 3. Let x(f) = 11f + 17. Let c(u) = -22u - 34. Let p(r) = -6c(r) - 11x(r). Suppose -2z = z + 102. Calculate zm(d) + 6p(d). -2d Let q(s) be the third derivative of -s*5/15 + 2s*3/3 + 6s2. Let f(j) = -j2 + 1. Determine -2f(m) + q(m). -2m*2 + 2 Let c(p) = -4p*3 + 6p*2 - 5p + 2. Let k(s) = 5s3 - 7s*2 + 6s - 2. Determine 4c(d) + 3k(d). -d*3 + 3d*2 - 2d + 2 Let a(t) be the first derivative of -5t3 + 9t*2/2 + 29. Let b(g) = 7g*2 - 4g. Calculate 6a(r) + 13b(r). r*2 + 2r Let c(a) = 6a2 - 4a + 5. Let z(j) = 5j2 - 3j + 4. Let n be 6/3(1/2 + 2). What is nz(i) - 4c(i)? i2 + i Let h(a) = a3 - 3a*2 - 3a - 3. Let s(m) = m*2 + m + 1. Let f be (-6)/((27/(-6))/3). Suppose 2 = -x + f. Determine xh(c) + 6s(c). 2c*3 Let p = -150 + 141. Let w(t) = -7t*2 - 4t - 2. Let m(n) be the second derivative of n4/4 + n3/3 + n*2/2 - n. Give pm(k) - 4w(k). k2 - 2k - 1 Let a(b) = 10b + 31. Let t be a(-3). Let o(f) = 5f2 - 1. Let j(i) = i2. Suppose 3g = g - 12. Determine gj(y) + to(y). -y2 - 1 Let p(k) = -7k*3 - 3k*2 - 3k - 3. Let l(b) = 16b3 + 16b*2 + 10b + 10. Let v(n) = n3 - n2. Let s(f) = l(f) + 6v(f). Give 10p(m) + 3s(m). -4m*3 Let g(b) = -4b*3 + 3b*2 + 3. Let o(w) = -30w*3 + 22w*2 + 22. Let t(z) = -45z*3 + 33z*2 + 33. Let p(u) = -8o(u) + 5t(u). Give -22g(x) - 6p(x). -2x*3 Let f = -15 + 12. Let o(r) = 2r*3 + 3r - 3. Let u = 9 - 6. Let x(a) = -a + 3a3 + 0au - a3 + 3a - 2. Calculate fx(y) + 2o(y). -2y*3 Let j(d) = -2d*3 + 2d*2 + 8d - 5. Let w(x) = x*3 - x + 1. Calculate -j(q) - 5w(q). -3q3 - 2q*2 - 3q Let s(y) = -y2 - 7 - y2 + y + 0y2 - 7y. Let b(r) = -r - 1. Determine -5b(m) + s(m). -2m*2 - m - 2 Let v(x) = 4x*2 - x - 3. Let p(f) = 17f*2 - 4f - 13. Let q(s) = -4p(s) + 18v(s). Let a = 4 - -7. Let b(c) = 7c2 - 4c - 4. Calculate aq(n) - 6b(n). 2n2 + 2n + 2 Suppose -5p + 2p - 3 = 0. Let o(u) = 10u - 1 + 0 + 8u - 19u. Let z(i) = 4i + 5. Give pz(j) - 6o(j). 2j + 1 Let i(n) = 16n*2 - 7n - 7. Let c(q) = 11q2 - 5q - 5. Suppose 5m + 2 = 2z - 18, -2 = m. Determine zi(v) - 7c(v). 3v2 Let t(q) = -3q*3 + 2. Let j(m) = 7m*3 - m + 1. Let l(y) = 14y*3 - 2y + 1. Let f(h) = -11j(h) + 6l(h). Determine -2f(z) - 5t(z). z*3 + 2z Let c(x) = 4x. Let w(j) = j. Let m(f) = f2 - 8f + 9. Let h be m(7). Let o(z) = -13z. Let d be o(h). Let b = -12 - d. Give bw(r) - 3c(r). 2r Let x be (-15)/(-4) + 1/4. Let r(u) = -2u2 - 6u + 1. Let p(h) = 3h - 16. Let g be p(7). Let f(s) = 2s*2 + 7s - 1. Determine gr(k) + xf(k). -2k2 - 2k + 1 Let t(i) = -i. Suppose -3d + 4g = 30, -2d - 3 - 15 = -2g. Let v(q) = -8q. Calculate dt(l) + v(l). -2l Let v(o) = -13o + 5. Let l(g) = 3g - 1. Let r(j) = 2j*2 - 4j + 2. Let k = 14 + -12. Let m be r(k). Give mv(w) + 9l(w). w + 1 Let v(p) = 2p3 - 11p + 2. Let f(w) = w*3 - 6w + 1. Determine 11f(j) - 6v(j). -j*3 - 1 Let p(v) = v + 1. Let b(i) = 4i + 5. Calculate 2b(c) - 6p(c). 2c + 4 Let h(m) = 2m. Suppose 0 = 2g - 2y + 1 - 7, 3 = -g - 2y. Let q(s) = -s. Let l(t) = -t2 + 16t - 1. Let d be l(16). Determine dh(c) + gq(c). -3c Let c(t) = 6t*2 + 10t - 12. Let u(a) = -2a2 - 3a + 4. Let j(f) = -2c(f) - 7u(f). Let m(h) = -h*2 - h - h + h + 1. Give -j(r) - 3m(r). r*2 + 2r + 1 Let k(c) = c*2 + c. Let a(o) = 3o*2 + 4o + 2. Determine -a(w) + 6k(w). 3w*2 + 2w - 2 Let u(a) = 3a + 1. Let q = -19 - -26. Let n(h) = h2 + 10h + 3. What is qu(g) - 2n(g)? -2g2 + g + 1 Let w(c) = 2c*2 - 2c + 2. Let t(a) = a*2 - 2a + 2. Suppose -2l + 4 + 1 = 3i, -5i = 3l - 10. Suppose is = 4s - 3. What is sw(g) + 4t(g)? -2g2 - 2g + 2 Let x(i) = 1. Let o(m) = -5m2 - 4m + 2. Let k(g) = -o(g) + 4x(g). Let s(f) = -f2 - f. What is -k(j) - 4s(j)? -j*2 - 2 Let u = 5 + -11. Let y(x) = -23x*3 + 23x + 17. Let h(v) = 4v3 - 4v - 3. Determine uy(k) - 34h(k). 2k3 - 2k Let w(b) = -b - 1. Let m(y) = 3y2 + 4y + 1. Let o(s) = -16s2 - 21s - 5. Let i(r) = 22m(r) + 4o(r). Give -i(u) - 3w(u). -2u2 - u + 1 Let y(c) = -c2 - c + 1. Let g(n) = 14n2 + 4n - 4. What is -3g(j) - 12y(j)? -30j2 Let k(c) = -4c - 9. Let v(h) = 2h + 5. Calculate -4k(r) - 9v(r). -2r - 9 Suppose -t - 2t = 4r - 33, -18 = -4r + 2t. Let h(i) = -4 - 2i3 + 2i + 5 - 2i. Let o(b) = 2b*3 - 1. Determine rh(u) + 7o(u). 2u*3 - 1 Let p(k) = -1. Let m(q) = -2q + 7. Determine m(c) + 6p(c). -2c + 1 Let b be 2 + -1 - (2 - 6 - -1). Let g(f) = -1. Let p(n) = -n + 4. Determine bg(t) + p(t). -t Let f(i) = -8i + 1. Let s(k) = k - 1. Give -f(q) - 6s(q). 2q + 5 Let i = -11 + 17. Let m(l) = -l*3 + 8l*2 + 9l + 1. Let y be m(9). Let w(z) = -1. Let s(c) = -c*3 - c + 8. Calculate iw(q) + ys(q). -q3 - q + 2 Let h be (24/30)/(2/151). Let u(p) = -8p2 - 5p - 6. Let t(w) = -w*2 - w - 1. Calculate ht(a) - u(a). 2a2 - a Let l(z) = -1. Let d(x) = 14x + 14. Let r(o) = 9o + 9. Let v(k) = 5d(k) - 8r(k). What is -5l(b) + v(b)? -2b + 3 Let g(a) = -a + 1. Let s(o) = 1. Determine 6g(c) - 5s(c). -6c + 1 Suppose 14 = -g + 4. Let n(d) = 2d3 + 10d*2 - 2. Suppose f = 3f - 4. Let l(t) = -4tf + 2t*2 + 3t*2 - 2t*2. What is gl(v) - n(v)? -2v3 + 2 Let b be ((-39)/(-15) + -3)15. Let a = b + 8. Let g(m) = -2m2 + 1 - 4 + 0m*a - 2m - 8. Let d(p) = -p*2 - p - 6. Calculate -11d(y) + 6g(y). -y2 - y Let k(y) be the first derivative of 7y3/3 - y2 + 11y + 1. Let x = 2 + -1. Let q be x(-9)/1*1.	{ "pile_set_name": "DM Mathematics" }
82p2w + p*2 - 1632pw - 2w wrt p. 48pw - 264p + 349614w - 30 What is the derivative of 52043h3 - 479h*2 - 2429235 wrt h? 156129h*2 - 958h What is the derivative of -123554431v - 184516153? -123554431 What is the first derivative of -g2k + 4g2 + 160gk - 1024g + 126357015k wrt g? -2gk + 8g + 160k - 1024 What is the third derivative of 274850017m*5 + 69003m*2 + 1829? 16491001020m*2 Find the second derivative of -2z*5 - 194450z*3 + 641z*2 - 992z - 218027. -40z3 - 1166700z + 1282 Find the third derivative of i*4j - i*4 + 3i*3j + 163637i3 - 1009230i*2j + 29ij wrt i. 24ij - 24i + 18j + 981822 What is the derivative of 5293f4j + 204f2j*2 + 22374j*2 + 71j wrt f? 21172f3j + 408fj2 What is the third derivative of -g3s3 - 71g*3 + 6g*2s*3 + 2g*2s*2 + 2787g*2 + 161gs - 47063s*3 wrt s? -6g*3 + 36g*2 - 282378 What is the derivative of -119112457d + 44153906 wrt d? -119112457 Find the first derivative of -4144y3 - 2702y - 53742403 wrt y. -12432y2 - 2702 Find the first derivative of -1392051635ks - 280649126k wrt s. -1392051635k What is the second derivative of -263889aqy*2 + 2aqy + 2ay*2 + qy*2 - qy + 6y2 + 2y - 946403 wrt y? -527778aq + 4a + 2q + 12 What is the second derivative of -2i4 - 20033i*3 + 864i*2 - 143432596i wrt i? -24i2 - 120198i + 1728 Differentiate 56014364ko3 - o3 - 8o2 + 2384o + 69 wrt k. 56014364o3 What is the derivative of -20904032l*3 + 38550105 wrt l? -62712096l*2 What is the second derivative of 32866938os5 + 160242845os - 4s*5 wrt s? 657338760os3 - 80s*3 What is the third derivative of 11971111t*6 - 6t*2 + t + 332564? 1436533320t*3 Find the third derivative of 46774300b*5 + 4102839b*2 wrt b. 2806458000b*2 Find the second derivative of -4659828c*4 - 429781c. -55917936c2 Find the third derivative of 1279124d*4y*2 - 2d*4 - 1914852d*2y*2 + 3d*2y wrt d. 30698976dy*2 - 48d What is the third derivative of -7315g3i*2m + 3059g3im - 2g*2i*2m - 404g2i*2 + 2g*2im + 5g*2i + 3g2 + gi wrt g? -43890i2m + 18354im Find the third derivative of -135457746c3p - c*2p - 2c2 - cp - 51608c + p - 25 wrt c. -812746476p Differentiate 7392693j - 6358558. 7392693 Find the second derivative of -425o*3s*3 - 2o*3s - 27os - 43300o + 53706s*2 wrt s. -2550o*3s + 107412 Differentiate 10105403t + 2118904. 10105403 Find the second derivative of -58055245w*2 + 71476330w wrt w. -116110490 Find the third derivative of -33647q5 + 1542q*4 - 109431q*2 + 25q - 4. -2018820q2 + 37008q Find the first derivative of 6782x2 - 555x - 33199828. 13564x - 555 What is the derivative of -31r*2t*2 + 2r*2tz - 406r*2 - 7rt3z - 5rt*3 + 14t*2 + 41230z wrt z? 2r2t - 7rt*3 + 41230 What is the derivative of -2516858i*3 - i - 8068055? -7550574i*2 - 1 What is the third derivative of 880j*5 - 2j*4 + 34j*3 - 1716562j*2? 52800j*2 - 48j + 204 Find the third derivative of 2p5 - 6372p*4 - 366p*3 - 6989372p*2. 120p*2 - 152928p - 2196 What is the derivative of -5v2 + 13955214v - 130350751 wrt v? -10v + 13955214 What is the second derivative of 468718b*4 - 171b*2 - 1897133b - 28 wrt b? 5624616b2 - 342 What is the third derivative of -9759322b3 + b2 - 36b + 8747 wrt b? -58555932 What is the third derivative of 934509306y*3 - 31344y*2 - 226y + 6 wrt y? 5607055836 Find the first derivative of -4g3w + 12041972g3 - 3g*2w + 51179gw wrt w. -4g3 - 3g*2 + 51179g What is the third derivative of 3gjl3 - gjl2 + 36gjl + 4gl*3 + 2gl2 + 5g - 2jl*3 - jl*2 - 635832l*3 - 4l*2 - 49l wrt l? 18gj + 24g - 12j - 3814992 What is the third derivative of 181h5 + 12673h*3 - 7h*2 - 92h + 268 wrt h? 10860h2 + 76038 Find the third derivative of -3753004d*6 - 8389893d*2. -450360480d*3 What is the third derivative of 5041783d*3f*3 - 7751d*3f*2 + 5df3 - df + 3f3 + 14213f*2 wrt f? 30250698d*3 + 30d + 18 Differentiate 2500l3 + 8lw3 - w3 + 117w*2 - 63w - 34 with respect to l. 7500l2 + 8w*3 Find the third derivative of 249830k*4 + 5k*3y + 597k2y - 6k2 - 2y - 71 wrt k. 5995920k + 30y What is the second derivative of -3a5 + 31471a*4 - 4a*3 - 14245a - 69? -60a3 + 377652a*2 - 24a What is the second derivative of -39628449x5 + 57668595x? -792568980x3 What is the first derivative of 2020l*2py + 113l*2y - 46l2 + 11lp - 2ly + l + 20py + p + 3y - 1 wrt p? 2020l2y + 11l + 20y + 1 Find the second derivative of -2n3 + 10201167n*2 - 16870993n - 2. -12n + 20402334 Find the first derivative of -8676627z + 46103766. -8676627 What is the third derivative of -4s4 + 237696s*3 - 20s*2 + 20981 wrt s? -96s + 1426176 Find the third derivative of 452667480l3 + 586424973l*2. 2716004880 What is the first derivative of -38019967a*3 - 47606321 wrt a? -114059901a*2 Find the first derivative of 88632754q + 34329207 wrt q. 88632754 Differentiate 29569439w2 + 12773834 with respect to w. 59138878w What is the third derivative of -149795942i3 + 3685i*2 + 424? -898775652 Differentiate -14712869b + 87685133. -14712869 What is the second derivative of 7106577b2l + 126256914bl wrt b? 14213154l Differentiate -10399314s + 6556457 with respect to s. -10399314 What is the first derivative of 85624552u3 + 400302176? 256873656u*2 Find the third derivative of -694670115y*3 + 128219466y*2 wrt y. -4168020690 What is the first derivative of 26851361q + 26310479? 26851361 What is the first derivative of -81955s2w + 15s2 + 48sw + 7551s + 3w + 108 wrt w? -81955s*2 + 48s + 3 What is the first derivative of 13820454o - 22879420 wrt o? 13820454 Differentiate -1465bm + 48412b + 327036803m with respect to b. -1465m + 48412 Find the second derivative of -24a3r*4 - 47827a*3r*3 + 452a*3r - 2283a3 wrt r. -288a*3r*2 - 286962a*3r Differentiate 11285769t2 - 1984105 wrt t. 22571538t Find the second derivative of -298265f3 + 26f*2 - 813f - 22481. -1789590f + 52 Find the second derivative of -2c*2p*2 - 2c*2p - 6cp - 40244c - 19414700p*5 - 1 wrt p. -4c*2 - 388294000p*3 Differentiate 181ny2 - 2ny - 664n - 2191059y2 - 2y wrt n. 181y2 - 2y - 664 What is the second derivative of -c*4 - 8247597c*2 + 100743833c wrt c? -12c2 - 16495194 What is the third derivative of -81990496t*5 - 228530738t*2 wrt t? -4919429760t*2 Differentiate -171748i*2 + 7i - 14649314. -343496i + 7 What is the second derivative of 18b*3r - 158b3 - b2r - 324b2 + 331br - 8b - 5r + 105 wrt b? 108br - 948b - 2r - 648 Differentiate -ab - 465ad*2j + 12ad - aj + 97bd2 - 20bdj - 457bd + d*2 - dj + 57d - j wrt b. -a + 97d*2 - 20dj - 457d Differentiate 88008225i3 + 158261584. 264024675i*2 What is the second derivative of -18858746m*4 - 15011874m wrt m? -226304952m2 What is the second derivative of -10196183a*4 + 14565666a? -122354196a2 What is the derivative of 262867659w*3 + 137742531 wrt w? 788602977w2 Find the third derivative of u6 - 4725605u3 + 54602u*2 + 117u wrt u. 120u3 - 28353630 Find the first derivative of 327014612q + 324590812. 327014612 Find the third derivative of -6017299r3 - 17776492r*2 wrt r. -36103794 Find the second derivative of -20726609h*2 - 1626452h - 6. -41453218 Find the second derivative of 43iy*3 - iy + i + 560994y3 + 3129951y wrt y. 258iy + 3365964y Find the third derivative of 5w*3z*3 + 12314187w*3z*2 + 2w*2z*3 - 47w*2z*2 - 785637w wrt w. 30z3 + 73885122z*2 What is the first derivative of 2k*3 + 1405604k*2 - 2916246 wrt k? 6k*2 + 2811208k What is the second derivative of -33200b3r*2t*2 - 48b*3r*2t - 3b3 - 16b*2rt2 - b2r + 16b2t*2 + 6br + rt*2 wrt r? -66400b*3t*2 - 96b*3t What is the first derivative of -2gi*3 + 2gi2 + 35318gi - g - 3i*3 - 34657i wrt g?	{ "pile_set_name": "DM Mathematics" }
-0.2 d Which is the second smallest value? (a) 4 (b) 12/23 (c) 0.5 (d) -401 c Which is the smallest value? (a) 1056 (b) 38 (c) 5 c Which is the fourth biggest value? (a) -3/7 (b) -6536 (c) -5 (d) 3 (e) 0.3 c What is the fourth biggest value in 3/7, 201, 0.1, -5, 0? 0 Which is the third biggest value? (a) -2/12217 (b) 5 (c) 0.08 a Which is the biggest value? (a) 0 (b) -0.3 (c) -2 (d) 4/7 (e) -786 d Which is the biggest value? (a) 425 (b) 0.2 (c) 0.3 (d) 0 (e) 2 a What is the biggest value in -71, -1/4, 4, -0.3, -1/2, 1/5? 4 What is the sixth biggest value in 5/6, 4, -2, -3/1298, 0, -4? -4 What is the second smallest value in 8, -2/939, 28? 8 Which is the fourth smallest value? (a) -0.5 (b) 98.6 (c) -5 (d) 3 (e) 9/8 d Which is the fifth smallest value? (a) 0.12 (b) -1/5 (c) -0.5 (d) 1/2 (e) 0.1 (f) -59 a What is the second smallest value in 0.27, 154, 0.1, 0.4? 0.27 What is the second smallest value in 2614, -4.6, 0.4? 0.4 What is the fifth smallest value in -5, 0.2, -0.5, -4, 1456? 1456 Which is the fourth biggest value? (a) -9 (b) -2/11 (c) 5 (d) -2 (e) -0.09 (f) 1/5 b Which is the smallest value? (a) -9 (b) 2/7 (c) 0 (d) -8 (e) -3 a Which is the third smallest value? (a) -0.4 (b) -1 (c) -0.3 (d) 2961 (e) 0.6 (f) -0.2 c Which is the fifth biggest value? (a) 5 (b) 4 (c) -3/152 (d) -5 (e) 4/3 (f) 0.6 c What is the second smallest value in -1, -407, 1/6? -1 Which is the fourth smallest value? (a) -0.1 (b) 98 (c) -1 (d) 0 (e) 39 e What is the fourth smallest value in -0.3, -0.036, 0.5, -1? 0.5 Which is the third biggest value? (a) 0.5 (b) 3 (c) -5/7 (d) -0.4 (e) -1106 (f) -1 d What is the fifth biggest value in 3, -2, -1, -4, -15, -23.5? -15 Which is the biggest value? (a) -208 (b) 1 (c) -0.1 (d) 106 d Which is the second smallest value? (a) 5/8 (b) 18 (c) 137 b What is the fifth biggest value in -0.04, 4, 3, 4/11, -5, 0.4? -0.04 What is the fourth smallest value in -5, -4, 1/3, 3/2, 6/5? 6/5 Which is the second biggest value? (a) 4 (b) 0.02 (c) 1/7 (d) -5 (e) 17 a What is the fourth biggest value in 0.3, -0.003, 0.1, -6/11? -6/11 Which is the second smallest value? (a) -0.415 (b) -0.2 (c) 36 (d) 1 (e) 1/3 b What is the sixth smallest value in 464, -4, -2, 5/4, 0.3, -0.3? 464 What is the fourth biggest value in -3, -1/5, -26328, 0, -0.5? -3 What is the second biggest value in -0.589, 4, 2/9? 2/9 Which is the second biggest value? (a) -174/11 (b) -26 (c) 0.4 a Which is the third smallest value? (a) 0.1 (b) -78175 (c) -2 a Which is the second biggest value? (a) 0 (b) -0.0625 (c) 65 a What is the smallest value in -24, -1.4, -2/3, 0.1, -3? -24 What is the second smallest value in 1/4, 4, 5, -87181, -0.5? -0.5 Which is the second smallest value? (a) 2/7 (b) -2189 (c) -3 c What is the smallest value in 4, -1/53, -0.04722? -0.04722 What is the sixth biggest value in -0.2, 230, 3, -1, -3, -5? -5 Which is the third smallest value? (a) -2 (b) 15405 (c) -6 b Which is the second smallest value? (a) -2/3 (b) -0.18 (c) -0.07 (d) -0.1 (e) 0.5 (f) 1/4 b What is the sixth smallest value in -0.15, -3, 5, -3/283, 1/4, -0.1? 5 What is the second smallest value in -9, -0.02, 0.829? -0.02 What is the third smallest value in -3, -1473, -0.2? -0.2 Which is the fourth smallest value? (a) -229 (b) -2 (c) 9/2 (d) -5 c Which is the third smallest value? (a) 1 (b) -387 (c) 4 c What is the second smallest value in 527, 0.1, 0.5, -7, -1/2? -1/2 What is the biggest value in 1.1, 1/2, -0.3, 2114? 2114 Which is the fourth smallest value? (a) 0.3 (b) -2 (c) -42 (d) -1.84 a Which is the third smallest value? (a) 0.5 (b) -1/36 (c) 3 (d) 2/9 (e) -9.9 d What is the second biggest value in 2.5, -1, 1/7, 2/5, 1/2? 1/2 Which is the smallest value? (a) -4 (b) -0.2 (c) -3/5 (d) -255 (e) 4 d Which is the fifth smallest value? (a) -18 (b) 0.165 (c) -5 (d) -4/5 (e) 3 e Which is the second smallest value? (a) 17373 (b) 0 (c) -2/19 b Which is the second biggest value? (a) -8/827 (b) -0.3 (c) -2 b Which is the fifth biggest value? (a) 0.3 (b) 21 (c) 1 (d) 38 (e) 10 (f) -0.4 a What is the smallest value in -4, -14, -3, 5.7, 6/83? -14 Which is the second smallest value? (a) -0.4 (b) 0.5 (c) -224/15 (d) 0.02 (e) 2/19 (f) -3 f Which is the third biggest value? (a) -1 (b) -23/3 (c) -2 (d) -3/16 (e) -3 c Which is the biggest value? (a) 4 (b) 0 (c) 87837 c What is the smallest value in 0.12, -7924, -0.5? -7924 Which is the fourth biggest value? (a) -1/26 (b) -20 (c) 5 (d) 4/11 b What is the fourth smallest value in -0.2, 1, 4.58, 2, 0.2, -1/178? 1 What is the smallest value in -105/4, -1/11, -4, 29/3? -105/4 What is the second biggest value in 29, 7.5, 0.1, 23, 3? 23 What is the second biggest value in -0.203, 0, 0.06, -5, -4/9? 0 Which is the third biggest value? (a) 388/3 (b) 0.2 (c) -0.4 c What is the smallest value in -107458, -7, 5? -107458 What is the smallest value in 8/13, -1565, 1? -1565 What is the third biggest value in -727, -1, 2/11, -0.2? -1 What is the third biggest value in 22.9, -2/3, 3? -2/3 Which is the smallest value? (a) -20 (b) 0.1434 (c) 1 (d) -3/7 a What is the second biggest value in -5700, -5, -2, 3, -2/3? -2/3 Which is the fourth biggest value? (a) 19 (b) -2/13 (c) 15 (d) 0.09 b Which is the fifth biggest value? (a) -3 (b) -5 (c) 2 (d) 1 (e) 0.32 b What is the second smallest value in -7, -1/6047, -3? -3 What is the third biggest value in 0, -0.1, 117/10, 2, -1/8? 0 What is the second smallest value in -3, -406, -1/4, -22? -22 Which is the biggest value? (a) 367 (b) -1 (c) 77 a What is the smallest value in -16, 7, -17? -17 What is the fourth biggest value in 31, -3, -1/4, -485? -485 Which is the smallest value? (a) -1 (b) -0.3 (c) 5 (d) -4.358 d Which is the third biggest value? (a) 1/8 (b) -28 (c) -1.4 b Which is the smallest value? (a) 117 (b) -1/5 (c) -104 (d) -3/4 c What is the second biggest value in 0, -971/8, -2/7, -3? -2/7 Which is the second biggest value? (a) 4 (b) -2/8453 (c) 2 c What is the second biggest value in 1.4, -3/8, -0.4, -2, -3? -3/8 Which is the second smallest value? (a) -0.3 (b) -0.35 (c) 3 (d) 0.17 (e) 0.021 a Which is the smallest value? (a) -4 (b) -9 (c) 553 (d) -0.03 (e) -2/23 b Which is the third smallest value? (a) 0.2 (b) 0.16 (c) 5 (d) 13 c What is the third smallest value in 9, -7/1856, -2/11? 9 What is the fourth biggest value in 5, -5, -0.0437, 24, 0.1, -1/6? -0.0437 What is the second smallest value in -9.3, 2, -0.7, 10? -0.7 Which is the fifth smallest value? (a) 5 (b) -3 (c) -16 (d) 1/6 (e) 0.02 a Which is the second smallest value? (a) 1 (b) -10 (c) -0.03 (d) 17 c Which is the fourth biggest value? (a) 26 (b) 0.148 (c) -5 (d) -2/37 (e) 2/3 d Which is the second smallest value? (a) 0.3 (b) 50.7 (c) -2/5 a What is the smallest value in 0.1, -2/79, -18.9? -18.9 Which is the fourth smallest value? (a) 1 (b) -2/9 (c) -3 (d) -256 a Which is the third smallest value? (a) 2/5 (b) 3 (c) -2.301 (d) 2/11 a What is the third smallest value in -2/9, 0.1, -0.05, 1/3, 0.13, -0.064? -0.05 Which is the second smallest value? (a) -1/2 (b) 15.1 (c) -0.496 c What is the smallest value in -1, 7/62, -3/5, 8, -0.3? -1 What is the third smallest value in -2, -7, 4, -3/2, -333? -2 Which is the third biggest value? (a) -1/2 (b) 0.19 (c) -1 (d) -4/81 a What is the third smallest value in -31, 268, 0, 3, -2, -0.1? -0.1 Which is the third smallest value? (a) -3/8 (b) 5 (c) 1 (d) -4 (e) 0 (f) -34 a What is the second smallest value in -3/7, -1959/4, -11? -11 Which is the second smallest value? (a) -3/5 (b) -2.18 (c) 2/1365 a What is the second biggest value in 2, 4, 466, -0.24? 4 What is the second smallest value in 0.3, -1, 12, -46, 5, -4? -4 Which is the third biggest value? (a) -0.4 (b) 2/13 (c) 2/3 (d) -879 (e) -0.3 (f) 0 f Which is the third biggest value? (a) -2.2 (b) 3/4 (c) 566/5 a What is the biggest value in 187, 4, 0.4, -2/35? 187 Which is the fourth smallest value? (a) 4 (b) 0.5 (c) 112 (d) -2/11 c What is the third biggest value in 0, 3/2, 3/4, -1/19? 0 What is the third biggest value i	{ "pile_set_name": "DM Mathematics" }
z. 5 Let l be 36/9 - 1. Let c be (4 - l)/(-3 + 4). Solve 0 = 3u - 5o - 3, 2u = -u - 4o + c for u. 1 Suppose -s = 0, 5u = 4s + 8 + 2. Solve -r = -2m + 2, m + ur = -r + 15 for m. 3 Let l = 135 - 142. Suppose -5n = -3m + 4m + 25, -m + 5n = -15. Let c = m - l. Solve -4x + cx = p - 15, -2p = -4x + 10 for x. 5 Let t(l) = l3 + 5l*2 - 6l + 4. Let k be t(-6). Suppose -o + 6 = -3h, -ko + 0o - 2h + 10 = 0. Solve -2i - 5a - 7 = -3, -i + oa + 9 = 0 for i. 3 Let y = -29 + 36. Let f(n) = 4n + n - 4n + 3. Let j be f(y). Solve 3c - 3m + 0m = 6, 3c - j = 5m for c. 0 Let d(s) = s*2 + 2s - 2. Let h be d(2). Suppose 0 = -2z + 5a + 31, -ha = -2a + 20. Solve 5q + 17 = u, -q - zu + 2u - 1 = 0 for q. -3 Let f be 109/6 + (-9)/54. Let l be 12/f - (-14)/6. Solve 3s + j = -14, -5 = -ls - 4j - 16 for s. -5 Suppose 4 = 3w - w. Solve 2f - 7f = s - 17, -5f - ws = -14 for f. 4 Suppose -10w + 9w = -2. Solve ws + n + 6 = 0, s = -4n - n + 15 for s. -5 Suppose -4u - u + 5 = 0. Solve -s + 0s + 5c = -5, -4s - c - u = 0 for s. 0 Let j(q) = q2 - 2q + 1. Let h be j(4). Let z = 6 - h. Let o = 4 + z. Solve 0 = -m - g - 7 - o, 4m = 4g for m. -4 Let n(z) = z*2 + 4z. Let u be n(-4). Let q be (u - 0)4/8. Solve -2i = f + 2, qi + 11 = 2f - i for f. 4 Let c(b) = b*2 + b. Let y be c(-1). Solve -2x + x = y, 12 = 4h + x for h. 3 Let f be (6 + -1 - 4)6/3. Solve 0 = -5z + 4z - 2j + 11, fj = 8 for z. 3 Suppose -8 = x - 3u, -2x - 3u = -7u + 10. Let g be (1 - 2) + 9x. Solve 4 + 1 = j + b, 0 = 4j + b - g for j. 1 Let q = 23 - 15. Solve -5k - q = -4h, 1 = -h - 2 for k. -4 Suppose -4c - v = -36, -3c = -3v + 2v - 34. Solve 0l - l + c = 5m, -5m - 5l - 10 = 0 for m. 3 Let k be 7/((-28)/(-12)) - 0. Solve f = -2, -3j - 3 = -kf - 0 for j. -3 Let t = 1 - -2. Suppose 6n - tn = 0. Solve -4r = -4s + 16, 5s - 20 = -ns - r for s. 4 Let n be (1 + 3)/(6/3). Suppose 0 = -9v + 4v + 25. Let c(p) = -2p - 2. Let q be c(-3). Solve 2r = -nz, vz = qr + r for z. 0 Suppose 3j = -5 + 20. Solve jz = -2l + 14, z - 13 = -l + 4l for l. -3 Suppose 4h = 8, 4 = -j + 2h - 0h. Solve -2l = -2d + 2, -d + j + 11 = -3l for d. -4 Let z(j) = j + 9. Let w be z(-9). Suppose m - 4 + 0 = w. Solve 2s + p + 10 = ms, 4s - 16 = p for s. 3 Let o = 17 - 5. Solve -6 = 2r + 2b, 4r + 3b = 7b + o for r. 0 Let n = -5 - -7. Solve 2i = -3o + 2, -ni - 4o = 2i + 4 for i. -5 Let t = 31 + -27. Solve -6 = 3x + tq, 2q - 16 = -2x + 6q for x. 2 Suppose p = -u - 3p - 6, 0 = 5u - 5p - 20. Suppose -5 = -5h, -4h + 1 = uf - 7. Solve 4k - t = -8, 5k = ft - 7t - 35 for k. -3 Let g = 26 + -24. Suppose -12 = -4x + x. Solve 0 = -xr - 3o - 26, 7o - go = 2r for r. -5 Suppose 5a - 90 = 2o, 3a + 5o = -a + 39. Let i be 1/4 + (-22)/(-8). Solve -3d = -3n + d + a, 2d - 10 = -in for n. 4 Suppose 0 = 7g - 2g + 3v - 40, 4v = 3g + 5. Suppose 2z + 4 = 4z, -gz + 6 = -y. Solve 2f - 24 = -5w, w - yf - 8 = -3w for w. 4 Let b be 3 + -1 + 0 + 0. Suppose -4l + 6 = -b. Let c be (4 + -5)/((-1)/7). Solve -3f + 5 = -5a, -la + ca = 10 for f. 5 Let l be (-7)/((-28)/16) - -3. Solve b + 8 = 2t - 3, 2t + l = -5b for b. -3 Let y = -13 - -14. Solve 4r = 2k + y - 3, 0 = -2k + 3r + 4 for k. 5 Let s = -2 + 1. Let l = s + 1. Solve l = -5x - 3b - 27, 2x - b - 1 = x for x. -3 Suppose -5h = 4g - 12, 3h + g = 2g - 3. Suppose 110 - 14 = 3l. Suppose -3n - l = -5u, 0n - 4 = -2u - n. Solve h = -5p - m + 17, up - 6 = m + 4 for p. 3 Let y = -1 - -4. Suppose 0 = -yc + 2c. Solve 2a = u + 9 - 0, u - 5a + 15 = c for u. -5 Let l(d) = 4d - 15. Suppose -3q + 57 - 5 = 4g, -2q = -5g + 42. Let i be l(g). Solve m - 2m - 5y + 23 = 0, 5m + i = 3y for m. -2 Suppose 2k = -k + 15. Suppose -16 = -kj + j. Solve 4b - 32 = -3i, -2i = -6i + jb - 4 for i. 4 Suppose 3o - 13o + 20 = 0. Solve 2f - 2 = -j, of = -4j + j + 6 for j. 2 Suppose -4m + 4 = -3r - r, -4m - 4r = -20. Solve mj + 5b + 4 = 6j, 5b = 5j - 10 for j. 3 Let h be (-1)/3(1 + -16). Suppose 0 - 6 = 3a, 0 = -hn - 2a + 16. Suppose 16 = -nd + 80. Solve -4z - 3k - d = 0, 0z - z = k + 4 for z. -4 Let r be 0(-3)/(-6)-1. Solve 0 = -rv - 4v - n - 1, n = 5v + 8 for v. -1 Let x(b) = -2b + 27. Let p be x(11). Solve 5c = -5g - p, -4c = 3g + 2g + 9 for g. -5 Suppose -3k + 4k = 5. Let i(b) = 2b2 + 9b + 10. Let q be i(-5). Solve 4z = -km + q, 6 = 2z + 3m - 3 for z. 0 Suppose c - 2 = -3. Let g be c/((-2)/1)38. Solve -g = 5l + p - 3p, l + p = -1 for l. -3 Let x = -4 - -7. Let s = 3 - 0. Suppose sr - 8 = -r. Solve -i + x = -2l - 4i, l + ri + 3 = 0 for l. 3 Let k = 11 - 8. Suppose w + 4 = kw. Suppose 3p - 4p - 5f = -53, 125 = 5p - 3f. Solve -wc + 5r - p = 0, -r - 8 = 5c + 2r for c. -4 Suppose -2z - 16 = -2s, -4 - 33 = -4s + 5z. Solve -2o - 2o + 3y = -17, 0 = -so - 2y for o. 2 Suppose 2b = 2 - 24. Let l be b(2 - 1) + 2. Let h = 9 + l. Solve 4z + 4x + 20 = 0, -z - 5 = 4x - hx for z. -5 Suppose -x + 4t + 34 = 2x, -4x - 2t + 16 = 0. Solve -z - 18 = 4g, -xg - 19 = -2z - 3g for z. 2 Let f be (-13)/(-4) - 3/12. Suppose -fs - 4 = -4s. Solve 2o - 10 = -5t + so, 3t + 25 = -5o for t. 0 Let o be 62/(-22) + (-10)/55. Let x be 2 + -4 - (-1 + o). Solve -6 = -xc + 4c + 2k, -c - 2k - 6 = 0 for c. 0 Let k be 24/15 + 2/5. Solve -kr = -m - 5, -6m = 5r - 4m - 26 for r. 4 Let g = 11 - 7. Let j(q) = q3 + 10q*2 + 10q + 12. Let o be j(-9). Solve 8t = ot - 4h - 1, -5 = gt - h for t. -1 Suppose 0 = 3u + 2q - 45, 2u + 5 = 3q + 22. Let s = u + -11. Solve -5c = -3h - 31, -3 = -3c + sc - h for c. 5 Let p be (1/1)/((-1)/(-5)). Let t(m) = m + 20. Let d be t(-12). Solve 2k - 3 = pl, -k + 4l = 2k - d for k. 4 Suppose c = -0c + 2. Solve cm = -0t + 3t, -4m - 2t = -16 for m. 3 Let w be (-1)/(-3) + 24/9. Suppose -6b = -wb - 9. Solve -p - 8 = 2y, 2y + 2p = by + 9 for y. -5 Let v be ((-10)/8)/((-2)/8). Suppose -2i = -i - v. Let t be (-14)/(-2)1/7. Solve -2j = -5g - j + t, 5j = -i for g. 0 Suppose 5c + 3 = -3x, -x - 5 = -3c + 6c. Solve -2l = -xl - 5q, 4q - 12 = -4l for l. 5 Let f be 8/(-24) + 13/3. Solve -c + 23 = fm, -6 - 6 = -3m + c for m. 5 Let i = -13 - -17. Solve -v + 3s + 13 = 0, 6s - 2s = -4v + i for v. 4 Let s(h) = -h + 1. Let y be s(-3). Let q be (2 + (-5 - -4))0. Solve q = -m - yf - 2, -f + 4f = 4m - 11 for m. 2 Suppose 2g - 3j + 10 = -2, -3j + 12 = 0. Let s be g - (-1 + -4 + 1). Solve 5m = 3k - s - 4, -5k - 3m = -2 for k. 1 Let m(k) = -k3 - 13k*2 - 12k - 3. Let w be m(-12). Let z be 6 + (2-3 - w). Solve 14 = zo + 5s - 3s, o - 2s = -6 for o. 2 Let w be -3 + (1 - 3)-2 + 16. Solve 5m + 2c = w, 4c - 7 + 0 = -m for m. 3 Let h(r) = 2r*2 + 63r + 36. Let m be h(-31). Solve -ms + 39 - 14 = 0, -22 = -3g - 5s for g. -1 Let y(a) = -4a - 6. Let c be y(-2). Solve 2j + 15 = -3k, -7 = 3j + ck + 3 for j. 0 Let w be (-312)/(-40) - (-2)/10. Let g(x) = x*3 + 5x*2 + 3x. Let f be g(-4). Let y = 4 + -1. Solve h = -yn + f, -4n = 3h + h + w for h. -5 Let j = -13 - -18. Let n(w) = -2w - 7. Let d be n(-5). Suppose -5k + 11 = dv, 0k + 5k = v + 3. Solve -p - 12 = -5a, p - j + 3 = -va for a. 2 Let v(m) = -12m - 21. Let d be v(-2). Solve 4 = -dy + 4j, -j + 3 = 5y - 21 for y. 4 Let c = 25 + -22. Suppose cx - 6 = -0. Solve 2b - xr + 18 = 0, 4b + 16 = r - 2r for b. -5 Suppose 7z = 2z + 10. Solve -6 = -zd + v + 4, d - 5 = v for d. 5 Suppose 9 + 7 = 4g. Let m be ((-16)/20)/(1/(-5)). Suppose -3d + 5r = -15, 5r + 10 = -2d + md. Solve -g + d = -2z + c, -4 = 5z - c for z. -1 Let x = -57 + 58. Solve q - x - 1 = -p, 2p + 6 = 0 for q. 5 Let o be (8/10)/((-6)/(-45)). Let n(m) = 2m - 7. Let f be n(o). Solve 4v = -16, v = -fa + 2v - 21 for a. -5 Suppose -23f = -24f. Solve f = x - 4c + 10, 0 = -2x + 2c + c - 5 for x. 2 Let g(p) = 61p + 1. Let n be g(2). Let z = n + -81. Let h = z - 29. Solve -2 = x, h = -a - 2a + x for a. -5 Suppose 4z - 3x = -2, -x + 3 = -z + x. Solve 2i - 3v = z, -2v - 3 = -v for i. -4 Let w be (3 - -1)(-9)/2. Let b be (-40)/w + (-2)/9. Suppose -3c + 0z - 4z = -7, 29 = 5c - bz. Solve 0 = 5d - 5*p - c,	{ "pile_set_name": "DM Mathematics" }
k - qz + 18 = 6k for k. -5 Let d(s) be the second derivative of 0 + 11/12s*4 + 1/3s*3 - 1/20s*5 + 11s - 6s2. Let o be d(11). Solve 4 = -4x, -f + 4x - 3 = -o for f. 3 Let l = -767 - -770. Suppose -3w + 7 = 1, 2q - 20 = -5w. Solve 0 = 2n - qk + 8, 2k - 20 = 2n + ln for n. -4 Suppose 0 = 2d + 35 + 159. Let v = d + 100. Solve 2z + y - 1 = 0, -vz + 1 = y + y for z. 1 Suppose -17 = t + 4w, -1172 = -4w - 1192. Solve tz + 3 = -3n, -5z - 2n + 4 = -0 for z. 2 Suppose 0 = 4x - 2c + 3c - 18, 3x - 4 = 4c. Suppose -2q = p + 2p - 20, -xq = -5p + 4. Solve 0 = -pz + 8, 2w + 2w + 4z + 4 = 0 for w. -3 Let a = 8813 + -8811. Let h = 12 - 7. Solve -hj = -2c + 23, aj + c = -c - 12 for j. -5 Let h(i) = -3i3 + 38i*2 - 105i + 9. Let d be h(4). Solve -3 = -c + 19p - 21p, -dp + 5 = 5c for c. -1 Let r(c) = -8 - 4c + 2c*2 - 4 + 0c*2 + 0c. Let b be r(6). Suppose 2x - 8x = -b. Solve 0 = -5k - 5y + 40, -x + 1 = 5k - 4y for k. 3 Suppose 3y - 8y = -n - 22, 10 = 3y + n. Let t be (-35)/(-70) + 6/y. Solve -3 = -r, -tf + 4f = -5r + 9 for f. -3 Let h be ((-64)/48)/((-4)/9). Solve -5z + 4 = -3z + 4p, -6 = hz + 2p for z. -4 Let b = -33 + 41. Let g(q) = 14q - 109. Let i be g(b). Solve -k - r = -i, 5k - 4r - 30 = -6 for k. 4 Suppose -d + 2l - 3l - 2 = 0, -10 = -d + 3l. Suppose 5o - s = 24, 2s + d = 3. Let y = -153 + 157. Solve 3x - 7 = -n, 0x - ox + yn - 11 = 0 for x. 1 Suppose -24 = 166g - 148g - 150. Solve 0 = -4s + r + 6, -5r + 8 = 4s - gr for s. 1 Suppose 21096 = -26b + 21694. Solve 5 = j, -30y + b = -34y + 3j for y. -2 Let d = -639 + 1042. Suppose 30q - d = -q. Solve -3k - 14 = -3m + q, -m = 4k + 11 for k. -4 Let b be 3/(-6)-6-1(1 - 2). Solve br - 2m = -59 + 80, -13 = -2r + m for r. 5 Let c be 590/20 - 1/(-2). Suppose 3v - m = 2m + c, 5m = -5v. Suppose vy - g = 4g, 4y - 3g = 2. Solve 4s - yw + 1 = w, -w = -3s - 7 for s. -4 Let f be ((-8)/7)/(1112/(-1946)). Solve -fp + v + 14 = -4v, 0 = 2v + 4 for p. 2 Let u be 3/5 - (-85)/25. Solve -4h + 24 = -5n, -un - 5 = -2n + 3h for n. -4 Let c(z) = 0z - 4z - 7 + 18 + 3z. Let i be c(7). Suppose -3n + 10 = -is - 0, 4s + 16 = 4n. Solve -2a = -k + 9, -2a - 5 - n = k for k. -1 Let y be 126/1323 - (2490/(-63))/5. Solve -6 = -2a + v, 5v - 22 = -a - y for a. 4 Let t(n) = n3 + 5n*2 - 12n - 7. Let j be t(-6). Suppose 5i + j = b, 3i + 9 + 3 = 0. Solve -4s - 16 = 0, -3g + 4g - s = b for g. 5 Let k be 0(-4)/16 + -3. Let i be (-4)/(-12) - k/(-9). Let b = -49 - -54. Solve i = w - 2f - 4, -w + bf + 10 = 4w for w. 0 Let q(r) = -52r + 166. Let d be (-6)/(-162)18 - (-14)/6. Let g be q(d). Solve 3o + n + 1 + 4 = 0, g = 3o - 2n for o. 0 Let v be ((-12)/(-15))/((-2)/(-10)). Suppose 3t - 38 = -h, vh - 3t = -h + 208. Suppose 43z = hz. Solve 4y - 2q + 22 = z, -2y + 0q + 3q - 21 = 0 for y. -3 Let z(n) = -n*2 - 150n - 717. Let t be z(-5). Solve 0 = -4g + 4, j - 4g = t - 12 for j. 0 Suppose 2912 = 118u - 41u + 602. Solve 0 = 3a - 7a + 5j + u, -4a + 26 = -3j for a. 5 Let r(t) = 22t - 162. Let x be r(6). Let h be (9 - 6/2)x/(-45). Solve 5w + 5o = 10, -w + 3o = -3w + h for w. 2 Suppose c - 26 = -5n, c - 6 = -66n + 71n. Solve 9 = 5m + 3k, 0 = -2m - 54k + 59k + c for m. 3 Suppose 418 = 3q - 13p + 6p, -4p = 3q - 374. Solve 5w - 16 = -2i, 0 = -qi + 126i - 8 for w. 4 Let u be (-2196)/(-120) - 3/10. Solve 16 = -4r + 6v - 4v, -3v = -3r - u for r. -2 Suppose 3i = u + 11, -3u = i - 8u - 13. Let p(z) = -2z + 1. Let l be p(-7). Suppose 9 = 6b - 3b - 3j, -ij = -l. Solve 0 = 5g, 2w + g - b = -3g for w. 4 Let l(v) = -5v3 - 527v*2 - 212v - 206. Let p be l(-105). Suppose -z + 2z = 0. Solve 3 = -3x + w, -3x + px + 5w - 15 = z for x. 0 Let q = 34 + -70. Let v = -34 - q. Suppose 3k - vk = -2d - 2, 25 = 4k - 3d. Solve -3s + 2 + 7 = ki, -4i = -12 for s. -1 Suppose -v - 2u = -8, -39v = -36v + u - 29. Solve 0 = -5k + 5, -2f - 5k = -vk + 13 for f. -4 Let y(m) = 3m2 + 9m - 52. Let z be y(-6). Solve 5f - 12 = -zq, 0 = f + q - 6 for f. 0 Let b be 8/(-10) - 899/(-155). Solve -3g + 2h + 13 = 0, 0 = bh - 3h - 2 for g. 5 Let j = 572 + -571. Let v(w) = -25w + 27. Let o be v(j). Solve -2g + 3 = -3u, -5u - 7g + og = 5 for u. -1 Let n be (4 - 2) + (-4 + 4 - -1). Suppose nx - x = 3o + 14, -o + 42 = 4x. Solve 5s - 20 = 0, s + s = -2y + x for y. 1 Let r = -194 + 233. Let u be (65/r)/((-5)/(-15)). Solve -w + 3p = 19, uw - 2w = 2p - 22 for w. -4 Let v = -660 - -681. Suppose -396j = -403j + v. Solve b = 4p - 3, jp - 4 = -b - 0 for b. 1 Let u(s) = 21 + 8s - 4s2 + 4s2 + s2. Let m be u(-6). Let q = m + -4. Solve -25 = -5w - 5b, b - qb = -2w - 2 for w. 3 Suppose -5d = c + 73 - 0, -c = d + 57. Let b = c + 67. Suppose 9m + 10 = bm. Solve -mt - 5s + 26 = 0, 5t - 31 = s - 5s for t. 3 Let s(f) = f2 - 5f - 21. Let o be s(8). Suppose oj - 15j = -156. Solve -5p - 3u = 32, -2p - 3u - j = 7 for p. -4 Let s(w) = w - 3w - 27 + 7w. Let n be s(6). Suppose na = -12, 0d + 32 = 4d - 5a. Solve -k = -c + 7, -dk = -8k + 2c - 20 for k. -2 Let u(y) = y2 - y. Let g be u(0). Suppose g = -3r - 39 + 45. Solve -5m - 45 = -4p, -p + 8 = -m - r for m. -5 Let b be (-18)/90 - 12/(-10). Let z(r) = 3r3 + 2r*2. Let q be z(b). Solve qt + 0v - 2v = -5, 4v = 3t - 11 for t. -3 Let j(l) = l*2 + 19l + 30. Let b be j(-8). Let w = b - -66. Solve 4o - 5p = w, -2p - 10 = 2o - p for o. -3 Let g(r) = r*2 + 3r - 2. Let v = 0 - -1. Let o be g(v). Suppose 0 = p + 3p - 20, op = -s + 10. Solve q - 3d + 18 - 3 = s, 5q - 5 = -d for q. 0 Suppose 9d - 889 = 2d. Let r = -125 + d. Solve -3t = t - 16, 4k - 12 = -rt for k. 1 Let v(i) = i3 - 6i*2 + 5i + 2. Let d be v(5). Suppose -354m = 620m - 460m - 8224. Solve -db = -3u + 8, 3b + m = -b for u. 0 Let f = -427 - -593. Suppose -ft = -168t + 6. Solve 0 = 2o - 4w + 24, tw - 6 = o + 10 for o. -4 Let c(z) = 118z + 8737. Let d be c(-74). Let x(q) = -q*2 - 7q - 2. Let u be x(-6). Solve 3p = um - 4, 2p - 5 = -2p - dm for p. 0 Let o = 4 - 0. Let l(j) = -41j*3 - 50 + 42j*3 - 19j + 2j2 + 4. Let p be l(-3). Solve p = -7m + om + t, 0 = 3m + 5t + 26 for m. -2 Let z = 1406 + -1404. Solve 0 = -3x - l - 16, 4x + zl = -l - 28 for x. -4 Let c(u) = u - 17. Let y be c(15). Let k be (y/(-24))/(12/48)12. Suppose -o + 17 - 6 = 0. Solve 0m + m = -kw - o, m = -2w - 5 for w. -3 Let k(f) = -33f - 132. Let s be k(-4). Solve s = 3g - b - 7, -5g = -3b - b - 21 for g. 1 Suppose -19d + 1586 = -17d + 59d. Solve -5k - 14 = -2w, -w - 28k + dk = 2 for w. 2 Let x = 51 + -52. Let f be (-41 - (1 - 5))/x. Let z = f - 27. Solve -j = 3k - z, 0 = -3j + j - 2k + 8 for j. 1 Let o(f) = 313f3 - f2 + f - 1. Let i be o(1). Suppose -s = i - 330. Solve -h = 5b + s, -b - b = -2h for h. -3 Suppose 139z - 6301 + 537 = -621. Solve 2r + z = x + 32, 4x = r - 1 for x. -1 Let w = -52 + 40. Let a(o) = -6o - 70. Let k be a(w). Solve -x + 3n + 0 - k = 0, -15 = 4x - 5n for x. -5 Suppose 7f + 45 = 31. Let b be (-1 - f - 6)594/(-165). Solve 5u = -6a + 2a - 8, -2a = -3u - b for a. 3 Let v(o) = 20o*3 - 8o*2 - 2 + 11o - 21o3 + 24. Let s be v(-9). Let u = 8 - -1. Solve y = -3z - u, -18 = sz - y - 6 for z. -3 Suppose -2x = 6 - 0, 5x = u - 31. Let m be u/(-20) - 209/(-55). Solve 4v = mr + 18, 0 = 2r - 3v + 22 - 9 for r. -2 Let m(t) be the first derivative of 5t*2/2 - 3t - 2. Let p = -228 + 231. Let r be m(p). Solve -z + 7 - 1 = -2i, -z + 4i + r = 0 for z. 0 Suppose 0m = 3c + m - 54, -2m = 0. Solve -2k + 5p = -16, -20k = -ck - p for k. -2 Let s be (34/4 - 9/6)5. Let o be (-110)/s-7 - -1. Solve 5k + o = 3j - 5, -2j - 5k - 23 = 0 for j. 1 Suppose -44 - 46 = -45f. Let d be 1 + (-35)/(-14) + 3/f. Solve 46 = 5y - dj + 6, 3y - j = 16 for y. 4 Let o(p) = p3 + 37p*2 - 164p + 4. Let q be o(-41). Solve 4 = -4b + ql, 6b - 9b - 18 = 2l for b. -4 Suppose -4z = -7 - 13. Suppose -9c = -12c - 3r + 18, 2c - 3 = r. Solve -zm = -5n - 10, 4 = cn - 2 for m. 4 Let s be (-42)/(-10) - (-3)/(-15). Let c = -61 - -73. Suppose sk = -0*k + c. Solve -	{ "pile_set_name": "DM Mathematics" }
4r - 2w - 56 = -6. What is the highest common factor of 36 and r? 12 Let f be (3/((-15)/(-5)))/(-1) + 53. What is the greatest common divisor of f and 260? 52 Suppose 13u + 128 = 17u. What is the highest common factor of u and 8? 8 Suppose q + 8 = 3q, -3f - 4q = -328. Let x = -8 + 21. Calculate the greatest common divisor of f and x. 13 Let g(x) = x2 + 10x + 11. Let r be g(-11). Calculate the highest common divisor of r and 11. 11 Let v(j) = -2j - 6. Let y be v(-4). Suppose -u + 3 = -0. Suppose -uf + yf + 18 = 0. Calculate the greatest common divisor of 12 and f. 6 Let d be -5(-2 - ((-1)/(-1) - 0)). What is the greatest common factor of 60 and d? 15 Suppose -318 = -3k + 4p, p - 14 = -k + 99. Suppose -n = 5g - 1, 5n = g - 5g + k. Let v = 34 + n. What is the highest common divisor of 24 and v? 12 Suppose -9 - 41 = -5b. What is the highest common factor of b and 70? 10 Let f = -6 + 22. What is the highest common factor of f and 80? 16 Suppose -24 = -4o + 32. Suppose 7y + 160 = 5c + 2y, 0 = 4c + 2y - 104. Calculate the highest common factor of o and c. 14 Suppose 0 = -4o + 42 + 6. What is the highest common factor of 12 and o? 12 Let s = 3 - 8. Let k = 8 + s. Suppose kb = -b + 80. Calculate the greatest common divisor of b and 8. 4 Let x = -152 + 165. Calculate the highest common divisor of x and 2. 1 Let h(i) = -i3 + i2 - i + 12. Let g be h(0). Calculate the highest common factor of g and 60. 12 Let m be (-2)/((-6)/3) - 97. Let k be (-1)/(2/3)m. What is the greatest common factor of k and 16? 16 Let w(p) = -p2 + 7p + 14. Let s be w(8). Let j be (-58)/(-2) + 4/4. What is the highest common factor of s and j? 6 Let d(t) = -t*2 + 35t + 34. Let b be d(33). What is the greatest common factor of 50 and b? 50 Suppose 0y - 13 = 3y + 5w, -2y - 4w - 12 = 0. What is the highest common factor of 36 and y? 4 Let p(a) = -57a + 3. Let v be p(-1). Calculate the greatest common divisor of 20 and v. 20 Suppose -7j + 90 + 43 = 0. Calculate the highest common factor of 247 and j. 19 Suppose 19g - 17g = 3q - 77, 2q - 3g - 48 = 0. Calculate the greatest common factor of q and 243. 27 Let t(m) = 2m3 - 26m*2 + 2m - 19. Let o be t(13). Calculate the greatest common factor of o and 28. 7 Suppose 3p + 75 = -198. Let j be (-1)/(-3)-1273. Let h = p - j. Calculate the highest common factor of h and 4. 4 Suppose -3k - k = 0, -5y = k - 60. Calculate the greatest common factor of y and 12. 12 Suppose 0 = 5f + 2 - 12, 5k - 20 = 5f. What is the greatest common factor of k and 2? 2 Suppose -5z = -2p + 2, -z = -5p + 1 + 27. Calculate the highest common divisor of 6 and p. 6 Let y(m) = 35m - 1. Let n = -2 + 3. Let l be y(n). Suppose -5k + 5b = -400, -4b + 179 + 181 = 4k. Calculate the highest common factor of l and k. 17 Let g(i) be the third derivative of i*4/24 + 2i*3 + 3i*2. Let m be g(-8). What is the highest common factor of m and 8? 4 Let v be (-18)/(-12) + -1 + 22/4. Let j(r) = 55r*2 - r. Let g be j(1). What is the greatest common factor of v and g? 6 Let l be (-2)/5 + 22/5. Let i be (-4)/33/(-1). Suppose iu + 0m = 2m + 92, -5m - 80 = -lu. What is the highest common factor of u and 5? 5 Let x(f) = -f2 - 5f. Let g be x(-5). Suppose g = -4j - 0j + 104. Calculate the greatest common factor of j and 39. 13 Let r(y) = -y*3 + 13y*2 + 15y - 11. Let j be r(14). Calculate the highest common divisor of j and 27. 3 Let z be 2/(-11) - (-4212)/297. What is the greatest common divisor of z and 2? 2 Let k be (-2)/(0 + 2/(-4)). Suppose d + k = 19. Calculate the highest common factor of d and 105. 15 Let p be ((-114)/(-8))/((-6)/(-16)). Let k = p + 10. What is the greatest common divisor of k and 16? 16 Suppose -2x + 210 = 3x. Calculate the highest common divisor of x and 28. 14 Let s(p) = 177p2 + p. Let k be s(-1). Suppose 0d + 4d = k. Calculate the greatest common factor of 22 and d. 22 Suppose 29 = -2y + 109. Let c(x) = x*2 - 12x + 16. Let o be c(12). Calculate the greatest common factor of o and y. 8 Suppose 3u = 5v - 28 + 719, 4u = -v + 929. Calculate the highest common divisor of u and 29. 29 Let u be 23 - (-4)/(-1 + 5). Let x = u + -9. What is the greatest common factor of x and 3? 3 Let m(t) = -7t - 5. Let k be m(-2). Let x(y) = -22y - 3. Let p be x(-3). Calculate the greatest common divisor of p and k. 9 Let i(s) = 8s - 74. Let r be i(10). Let v be (-5 + 2)/(-3)48. Calculate the highest common divisor of v and r. 6 Suppose -d + 70 = -2c, c = 2d - 95 - 45. What is the greatest common divisor of 10 and d? 10 Suppose 136 = 2l - 4y, -l + 3y = 5y - 76. Calculate the highest common divisor of 9 and l. 9 Suppose -21 - 1 = -11l. What is the greatest common divisor of l and 8? 2 Let d be (-2 - (-86)/(-3))-3. Suppose 7 = 4s - 85. Calculate the greatest common factor of d and s. 23 Let k be -1 + 0 - (-4 - -1). Suppose 4m = 3m + 10. Calculate the greatest common factor of k and m. 2 Suppose 8 = 5o + 93. Let w = -10 - o. What is the highest common divisor of 28 and w? 7 Let p = -50 + 104. Calculate the greatest common factor of 6 and p. 6 Let n = -582 - -286. Let o be (n/(-12))/((-2)/(-3)). Suppose -5y - o + 107 = 0. Calculate the highest common factor of 126 and y. 14 Let n(w) = w*2 - 2w. Let h be n(-2). Let x be (2 + -6)(-78)/h. Calculate the highest common factor of 13 and x. 13 Suppose -5y + 486 = -2u, 3y + 2u + 7 = 289. What is the greatest common factor of 36 and y? 12 Suppose -4v + 40 + 24 = 0. Calculate the greatest common factor of 144 and v. 16 Let r(b) = -b + 11. Let s be r(10). Let t = -4 + 6. Suppose t = i - 1. Calculate the greatest common factor of i and s. 1 Let m be 26 + -15 - (-2 - -1 - 0). What is the greatest common divisor of 84 and m? 12 Let w(l) = l - 1. Let g(d) = 53d + 3. Let c(z) = -g(z) - 6w(z). Let r be c(-3). What is the highest common factor of 20 and r? 20 Suppose -3v = v - 56. Let g = 154 + -98. What is the greatest common divisor of g and v? 14 Suppose 3b = 4a - 31, -a - a = -4b - 28. Let k(o) = -o*3 + 5o*2 - 3o + 2. Let t be k(4). What is the highest common divisor of a and t? 2 Suppose 0 = -c + 5c - 56. Suppose 13j - 412 = 862. What is the highest common factor of j and c? 14 Let m be 4 - 12/4 - -1. Suppose 4d - 1 = 4f + 11, md - f = 7. What is the highest common factor of 1 and d? 1 Let w = -40 + 19. Let y be 2/((2/(-51))/1). Let h = w - y. Calculate the greatest common factor of h and 6. 6 Let z = 11 + -8. Suppose 4r - 4c = 28, 0 = r + 5c + 8 + 15. Suppose -ry = -5q + 14, y + q - zq = -5. Calculate the highest common factor of 9 and y. 3 Let s(h) = 16 - h + 2 + 88 - 16 + h3 - h2. Let z be s(0). What is the highest common factor of 10 and z? 10 Let o(f) = f3 - 13f*2 + 14f - 19. Let v be o(12). What is the greatest common factor of v and 5? 5 Suppose 3c + 11c = 686. Suppose g = 2g + 5o + 8, -4 = -g - o. Calculate the greatest common divisor of c and g. 7 Let y = 1 - -3. Suppose 2h - 5s - 8 = -2, 0 = 5h - ys - 32. What is the highest common factor of 40 and h? 8 Let c = 28 + -16. Suppose 132 = 5t + c. Calculate the highest common factor of 48 and t. 24 Let q be (-5)/((-25)/(-55))-1. Suppose 266 = 3t - 2b, -2b - 3 = b. What is the greatest common divisor of t and q? 11 Let u(j) = -j3 - 6j*2 - 10j - 15. Let x be u(-5). Calculate the highest common factor of 290 and x. 10 Let u(s) = s + 150. Let h be u(-40). Let k(l) = 2l2 - 5l - 2. Let a be k(4). What is the greatest common divisor of a and h? 10 Let f be -2(-1)/(-4)-10. Let u = 26 + -11. What is the greatest common divisor of u and f? 5 Suppose -6j + 2j = -100. Suppose 2i - j - 31 = 0. Suppose 2v - 22 = -h, -h - 4v + i = -0v. What is the highest common factor of h and 24? 8 Suppose -4f = -4g - 16, -f = 2f + 3g - 18. Suppose -fr = 2h - 5h + 16, 3h - 4r = 14. What is the greatest common divisor of 16 and h? 2 Let w be 3314/6. Suppose -5f + 2 = -3u - 14, -f = -2u - 6. Suppose fx + 0 - 14 = 0. What is the greatest common factor of x and w? 7 Let v(q) = -2q - 2. Let m be v(-2). Let r be (1 + -4)(-2)/m. Suppose 5c - r - 31 = -2o, -24 = -3c - 3*o. What is the greatest common divisor of 6 and c? 6 Let d be (-3	{ "pile_set_name": "DM Mathematics" }
-2u - 4j = -16 for u. 0 Solve -4t = k - 22, -40 = 6727k - 6732k - 6t for k. 2 Solve -275 = -j - 3t - 291, 3j + 2t + 55 = 0 for j. -19 Solve -56271j + 56243j - 5a = -21, 2j + 17 = -3a for j. 2 Solve 2f = -5o - 200, -2f - 168 = -539952o + 539949o for o. -4 Solve 8c = -2q + 236, 160q + 160q = 5c + 319q + 73 for c. 5 Solve 3b - 346 = 4n - n - 382, -b + 332 = -0b - 87n for b. -16 Solve 433v + 0x + 93 = 430v - x - 0x - 2x, -5v - 170 = 2x for v. -36 Solve s - 88 = 6528k - 6498k, 5s - 4k = 2 for s. -2 Solve 10i - 12i = -9o - 37, 4o - 10 = -i for o. -1 Solve 15l = -w + 3582 - 3620, 4w - 100 = 3l for w. 22 Solve 2s - 220 + 246 = -2r, -3s = 2r + 25 for s. 1 Solve -137 = -2q - 5k, 420q + 122 + 119 = 424q - k for q. 61 Solve 4b + a - 7a - 48 = 112, -2b - 5b - a - 65 = 0 for b. -5 Solve 14c - 10c - 20 = -4y, 2y + 20 = -8c + 12c for y. 0 Solve 3p + 4i = 209, -5p - 427i + 423i + 199 = 0 for p. -5 Solve -7 + 13 - 46 = -6g + 56, 11g + 46 = 4s + 242 for s. -5 Solve t = -7g + 355, -256g - 5t = -252g - 194 for g. 51 Solve -2t - 9764 = 3f - 2f - 9782, -3t - 27 = -3f for f. 12 Solve 4z - 2c - 42 = 0, -c = 67z - 32z - 33z + 17 for z. 1 Solve -4p = -5526i + 5531i + 21, 5p + 10i + 45 = 0 for p. 1 Solve 14 = -n, 161n - 37 = 17g + 160n for g. -3 Solve -460032a + 4x - 44 = -460030a - 12, 6a + 11 = -5x for a. -6 Solve 22j + 6624q - 3 = 6619q, -15 = -3q for j. -1 Solve -4i + 5425q = 5421q - 104, -i + 3q + 22 = 0 for i. 28 Solve -12 = 3x + 3s, -257x + 255x + 7s = 4s + 8 for x. -4 Solve -6o - 5v - 45 = 0, 12o - 15v = 3v - 17v + 9 for o. 0 Solve 37c - 567 = -4s - 205, -68 = 2c - s for c. 2 Solve -14j + 6j + 8 = -4q, -4j - 15 + 19 = -37q + 33q for j. 1 Solve -41l - 1952g + 1951g = -87, 0 = 3l - 2g + 5g - 21 for l. 2 Solve -1417u + 1422u - 43 = 4m, -7m = -46u + 45u + 21 for u. 7 Solve 5y - 35t + 32t - 43 = 0, -4y - 28t + 127 - 427 = 0 for y. 2 Solve -2u - 2v + 42 = 84, 7u + 14v = 3u - 114 for u. -18 Solve 4t + 4l - 72 = 0, 0 = 4045t - 4041t - 8l + 120 for t. 2 Solve -2x + 50 = 4v, -282v + 30 = -279v - 38x + 39x for v. 5 Solve -52 = 5p - 9o, -8p - 5065 = 4o - 5129 for p. 4 Solve 3i - 136 = -4m - 25 + 176 - 37, -i - 4m = -70 for i. 90 Solve 2v - 3h - 1 + 6 = -0v, -v = -12h - 50 for v. -10 Solve -187j + 5t - 1865 + 838 = -36j + 3956, -3j = -5t + 99 for j. -33 Solve 918w - 922w + 5b = -24, 10w + 21w = -4b + 15 for w. 1 Solve 5k = -8x + 71, -271444k = -271440k - 2x + 4 - 2 for k. 3 Solve 4j - 4 = -64732f + 64731f, -f + 0 + 5 = 5j - 3f for j. 1 Solve 7m - 4l + 38 = 0, -92 = 16m - m + 2l for m. -6 Solve -4k - 122 = -5m - 165, -2k + 11 = -m for m. -7 Solve 2f - 43 = 3x + 7f, -x + 0x + 196f - 21 = 199f for x. -6 Solve -144b - 3k = -147b - 60, 0 = 4b - 59k + 1070 for b. -2 Solve 20 = -4o - 2s, -3s = 3o + 957449 - 957419 for o. 0 Solve 2d - c = 13, 22d - 5d - 13d - 41 = -c for d. 9 Solve -18b + 133 = -5o, 0b + 2b + 4o + 236 - 228 = -0b for b. 6 Solve 0 = -5g + 4v + 13v - 14v + 71, -4g + 5v = -62 for g. 13 Solve -158 = -5b + 4j, -249487j + 115 = 2b - 249490j for b. 2 Solve -6y - 4v = 50 + 72, 2v + 53 = 5y for y. -1 Solve -10n + 63 = 15d + 8, 1147 = 5n + 5d + 1127 for n. 1 Solve 1709s + 5n = 1712s - 25 - 19, 0 = s + 3n + 4 for s. 8 Solve 5s + 56 = 2h, -67 = 177h - 4s + 7s - 568 for h. 3 Solve 5m + 106 - 113 = 3i, 101i - 9m - 6 + 25 = 102i for i. 1 Solve 6j - 48j - 9j - b = 1276, -2b = 4j + 102 for j. -25 Solve -6q - 26 = y - 21, 2y = 4y + q - 12 for y. 7 Solve 8385h = 2s + 8386h - 11, 4s - 15 = -h for s. 2 Solve -3a = -23u + 144 - 40, 0 = 3u + 13a + 1202 - 1162 for u. 4 Solve 3p + 0f = 2f - 3, -5p - 97 = -6f + 2f - 96 for p. -5 Solve 1183x = -5l + 1184x + 43, 45l - 2x - 366 = 0 for l. 8 Solve y + 63 - 68 = 0, -5x - 2y - 55 = 10x - 5y - 2y for x. -2 Solve h - l + 5 = -5l, -52l + 196l - 46l + 3 = 48l + 47l for h. -1 Solve 0z + 2z + z + 11 + 11 = -4h + 8, 0 = -7h - 3z - 11 for h. 1 Solve 1490y + 14 = 1491y + 5p, 3y + p = 0 for y. -1 Solve 1058676l - j - 50 = 1058672l, -2l = 4j - 16 for l. 12 Solve 4g = 33287h - 33282h - 81, 5g = -3h + 56 for g. 1 Solve 7w + 3g + 181 = 0, 38549w + 4g + 36 = 38547w for w. -28 Solve 142s = -5m + 137s, -4s - 8 = 0 for m. 2 Solve -196g = 200g - 397g - 5c + 8c - 20, 0 = g - 2c + 24 for g. -32 Solve -3940d - 4m - 8 = -3938d, -6d = 4m - 20 + 4 for d. 6 Solve -5l + 2 = -z - 1 - 7, -6l + 3961 = z + 3982 for z. -15 Solve -5u + 17m - 15m = -156, 6u - 740m + 741m - 194 = 0 for u. 32 Solve -2158p - 73m = -2157p + 354, 3m + 26 = p for p. 11 Solve -3d + 6 = 10 + 14, z + 39d = -32d - 424 for z. 2 Solve 0 = 21k - 35k - 4g - 20, 3g = 27 for k. -4 Solve 49328o - 49341o - 2m = 250, 0 = 5o - 87m + 535 for o. -20 Solve 266y = -2s + 258y + 294, -2s - y = -42 for s. 3 Solve -2d - 46 = -l, -1049246l + 191 = -1049241l + 3d for l. 40 Solve -5z - 15v = 35, 26962z + v = 26965z + 11 for z. -4 Solve -3z + o + 69 = 0, -91963 + 91924 = 13o for z. 22 Solve 3v + 9 = 27, 0 = -2w + 120v - 118v + 7 - 19 for w. 0 Solve -u + 19 = 3i, 5i + 74u + 70u = 221u - 81u + 62 for i. 2 Solve -26361o = w - 26362o - 3, -6w = 3o + 9 for w. 0 Solve 13b - 3l + 7l - 90 = 0, 78 = 3b - 4b + 5l for b. 2 Solve 3i - 55 = 7b, 1503b + 3i - 13 = 1504b for b. -7 Solve -g + 5w + 2 = 44 + 101, -w + 28 = 0 for g. -3 Solve b + 5016c - 5003c + 4 - 39 = 3b, 3b = -c - 32 for b. -11 Solve -8c = -4z + 788, -2z - 69c + 65c - 374 = 0 for z. 5 Solve 2n = -18g + 92, 112n = 109n - 3g + 18 for n. 1 Solve 39 = -60523w + 60520w + 3n, -5w = -4n - 3n + 77 for w. -7 Solve 2i + 10 - 9 = c + 6, -596 = -199i + c for i. 3 Solve 3v + 27 = -4k, v + 10k = -129 + 250 - 130 for v. -9 Solve -s - 259935 + 259954 = 3u, 0s - 6s + 3s + 4u = 47 for s. -5 Solve 0 = l + 19, -2a - 38l - 16l = -51l + 53 for a. 2 Solve 0 = y + y + 5f - 14, -80f + 124f = 5y - 261 for y. 17 Solve -3k - q = 5, 42k = 17k + 30k - q + 19 for k. -3 Solve 56z - 3 = 3c, -261c + 4z + 1 = -262c for c. -1 Solve -51u - 60u + 114u - 18 = 3k, -k - 9 = -6u + 27 for u. 6 Solve -295 = 20n - 5o, 479n - 474n = -3o - 95 for n. -16 Solve 3b + 26v - 22v - 44 = 0, 3973b = 3981b - 2v - 16 for b. 4 Solve -672 + 642 = -3y + 2s, -3y = -s - 15 for y. 0 Solve -5j - 40 = 0, 81029r - 81032r + 0j - 49 = 5j for r. -3 Solve 32 = 31l - 29l - 2v, -88 = -37l + 27l + 4v for l. 4 Solve 462 = 33w, 3w + 33 + 18 + 11 = -z + 103 for z. -1 Solve 22g - v + 28 + 430 = -0, v - 59 = 3g for g. -21 Solve l = -2v + 19, -v = -5l - 4788 + 4806 for v. 7 Solve -b = 2b + 81, 15s = 3s - 4b + 3b + 33 for s. 5 Solve 8638d = 8633d - 5l - 95, 31 = 5d - 3l + 94 for d. -15 Solve -2t + 6k = -64, -5979t + 26 = -5978t - k for t. 23 Solve 5k + r - 91 = 0, -281826k + 281827k - 11r = 7 for k. 18 Solve -5h - 53 = -3p, -1891390h + 105 = -5p - 1891401h for p. 1 Solve -3b - 1 - 18 = 2i - 87, -i + 3b = 74 for i. -2 Solve r = 10u + 295, -r - 34u = -0r - 5r - 37u - 67 for r. 5 Solve -2o - 4d = 9005054 - 9005048, 9 = 2o - d for o. 3 Solve -55q + 15 = -22l - 52q - 69, 2l + 2l = 4q - 36 for l. -3 Solve -h - 8 = 2k, -4h + 11 + 0 = -1100k + 1097k - 12 for k. -5 Solve -4p - 2128 = 2s - 2160, -p = -3s + 6 for s. 4 Solve -2g - 7b - 27 = 0, 234g + b - 927 + 918 = 238g + 6b for g. 4 Solve -3k + 47b - 41 = 0, 5k = -b + 154 - 143 for k. 2 Solve -12v + 2n = -9v - 5v - 521 + 553, 69 = 4v + 3n for v. 21 Solve 2t - 34 = -6u, -2t + 15660u + 24 = 15656u for t. 14 Solve -2b = 4u + 58, -2b + 3b - 13u = 12u + 349 for b. -1 Solve -m - 732 = -4f - 647, 3m - 60 = -3f for m. -1 Solve -13u - 14u + 27u + 4f - 16 = 0, 3f - 12 = -3u for u. 0 Solve -619t = 7p - 5p - 616t + 49 + 12, -p = -5t + 24 for p. -29 Solve -3m - 2z + 298 = 14, 19z - 18z + 2204 = 24m for m. 92 Solve -544d + 534d - 4c - 268 = 0, -3c = 216 for d. 2 Solve 0 = -z - 4w + 68, -252 = -4z - 143119w + 143123w for z. 64 Solve 8p - 5v = 3p + 135, 1	{ "pile_set_name": "DM Mathematics" }
ut c, -2, 3 in descending order. 3, -2, c Let g = 1 - 0.9. Let y = g + -1.1. Let d = 272 + -2173/8. Sort y, d, 5 in ascending order. y, d, 5 Let v = 3/46 + 7/69. Sort 4/3, -12, v. -12, v, 4/3 Let j = 296 - 297. Put -17, 3/7, j in ascending order. -17, j, 3/7 Let y = -1114 - -1112. Sort 285, y, 1/10 in decreasing order. 285, 1/10, y Let u = 136 + -133. Put 5, -5, u, 7 in decreasing order. 7, 5, u, -5 Suppose 0g + 3g - 19 = 5f, -3g = 2f + 16. Sort -4, -15, f in ascending order. -15, f, -4 Let w(q) = -q2 - 20q - 45. Let h be w(-17). Let n = 3 - 5. Sort 2, h, n. n, 2, h Let z = 1 - 1. Let w be (-3)/((9/2)/(-3)). Suppose -33t + 6 = 2q - 31t, 4q - 4t = 28. Put w, q, z in decreasing order. q, w, z Let c = -0.3 - -1.3. Let o = c - 0.8. Let q = 0.109 - 3.109. Sort o, -0.1, q. q, -0.1, o Suppose -8b + 5b = -o - 3, -4b = 0. Sort -3/4, 2/9, o, 6 in ascending order. o, -3/4, 2/9, 6 Let y = 0.0225 + 2.0775. Sort 1/2, -3, y. -3, 1/2, y Let f = -14/223 - 376/1115. Sort 1/5, f, 1/3, 127 in decreasing order. 127, 1/3, 1/5, f Suppose 3i = -2j - 13, 78i - 73i - 5j + 5 = 0. Put 1, -63, i in decreasing order. 1, i, -63 Let b be -1(-1 - (-111)/12). Let j = b + 91/12. Let s = 0.94 - -0.06. Put j, -5, s in ascending order. -5, j, s Let u = -1 + 2. Suppose 3278z = 3280z + 6. Put z, -6, u in decreasing order. u, z, -6 Suppose 0 = -s + 3 - 0. Suppose -2j - 8 = -2t, 4t = -j + 29 - 8. Suppose 0f - j = f. Put s, 4, f in ascending order. f, s, 4 Suppose -6j = 11 - 35. Let l be (2/(-4) + 2)2. Sort l, j, 5 in ascending order. l, j, 5 Let c(k) = k*3 + 6k*2 + k + 7. Let o be -7((-100)/(-35) - 2). Let u be c(o). Sort -5, u, 2. -5, u, 2 Let o = 369 - 357. Sort -2, -1, o in descending order. o, -1, -2 Let b = -3267853/433 + 7547. Let u = b - -880/3031. Sort -0.4, u, -0.2, -1. -1, -0.4, -0.2, u Let o(s) = -9s2 - 23s - 2. Let z(x) = 5x2 + 11x + 1. Let r(b) = -3o(b) - 5z(b). Let j be r(-7). Sort 5, j, -3, -1. -3, -1, j, 5 Let w = 0.532 - 0.132. Put -3, w, -12 in descending order. w, -3, -12 Let l(w) = -w*2 - 8w - 1. Let s(f) = f - 12 + 12. Let d(p) = -l(p) - 4s(p). Let r be d(-4). Put r, -5, 2 in descending order. 2, r, -5 Let k = 8684 - 8688. Let c = -0.3 - 0.2. Let s = -0.3 - c. Sort s, 5, k in ascending order. k, s, 5 Let h be 1/(3 - (4 + 32/(-24))). Put -10, h, -4, 13 in ascending order. -10, -4, h, 13 Let u be 3/(24/(-14))41/(-287). Sort u, 1, -2/31 in decreasing order. 1, u, -2/31 Let g = -309 + 619/2. Put 22, -0.04, g in decreasing order. 22, g, -0.04 Let k(m) = 4m - 32. Let z be k(9). Suppose -1 - z = 5l, -4l - 8 = w. Put w, -2, 8 in descending order. 8, -2, w Let u be 24/(-12 + -36) + 52/72. Let f be 16/(-7) - (-4)/14. Let j = -2.3 - -2. Sort j, f, u. f, j, u Let l(k) = k3 + 49k*2 - 53k - 150. Let x be l(-50). Put -4, -47, x in ascending order. -47, -4, x Let o be (-1)/((-150)/(-9))6. Let r = o - -4/25. Put -6, 1, r, -3 in ascending order. -6, -3, r, 1 Let v = 11 + -9. Let b = -4.9 + 3.9. Sort b, v, -0.5 in increasing order. b, -0.5, v Let f = -6.2 + 1.2. Let q be (32/24)/((-28)/6). Let s = -8 + 13. Put s, q, f in ascending order. f, q, s Suppose 0 = 4u + 5v - 1, 1 = -67u + 65u - 3v. Let y be -3 - 0/11. Sort y, 1, u in ascending order. y, 1, u Let q = 17189/230 - 374/5. Put -2, q, 2/9 in increasing order. -2, q, 2/9 Suppose 0 = -5c + 3v - 115 - 26, -3v = 2c + 48. Sort 3, c, -2. c, -2, 3 Let s(q) = q3 - 11q*2 + 12q + 10. Let n = -19 - -29. Let v be s(n). Suppose 10 - v = -5m. Sort m, 2, -1 in descending order. m, 2, -1 Let p = 992 - 996.945. Let z = -0.055 + p. Let y be (1 - (-2 + -1))/1. Sort z, y, 1/5 in decreasing order. y, 1/5, z Let y be 0 + (-10)/(-2) + 1. Let b = 794 - 792. Sort b, -0.4, y in ascending order. -0.4, b, y Let u = 2 + -5. Let w(j) = j3 + 4j*2 - 10j + 12. Let h be w(-6). Put -4, 3, h, u in ascending order. -4, u, h, 3 Suppose 0 = z + 5q + 8, 0q = -2z - 2q. Let d = 24 - 29. Put 1, -1, d, z in ascending order. d, -1, 1, z Let a = -11.82 + 12. Let u = 0.12 + a. Let m be -42/(-3)(-6)/(-136). Put 1/2, u, m in increasing order. m, u, 1/2 Let u(x) be the third derivative of x4/24 + x3/2 + x*2. Let b be u(0). Let d(m) = m - 3. Let c be d(-1). Put c, b, 0 in descending order. b, 0, c Let l = 2160.9 + -2161. Put 4, -1870, l in decreasing order. 4, l, -1870 Suppose -4l - 5i - 20 = 0, 0l - 5 = l - 4i. Suppose 0 = 5c + 7 + 3. Let o be c + (2 - 0 - -1). Put o, 2, l in descending order. 2, o, l Let m = -0.02 - 0.08. Let t = -34.2 - -32.2. Sort 3/2, t, m. t, m, 3/2 Suppose 0 = -2k - 3k - 20. Let q(v) = -v*2 - 70v - 201. Let w be q(-3). Put k, w, -5 in decreasing order. w, k, -5 Let t = 2120/189 - 78/7. Sort t, -2, 0.3 in decreasing order. 0.3, t, -2 Let d(y) = y3 + y2 - y - 1. Let o be d(0). Put 4, o, 6, 2 in ascending order. o, 2, 4, 6 Let w(v) = v*2 + 36v + 101. Let p be w(-33). Sort 1, 4, -7, p. -7, 1, p, 4 Let s = -203 + 610/3. Sort s, -4, -8, 4 in descending order. 4, s, -4, -8 Suppose 5q - 18 + 8 = 0. Suppose -q = 2m + 2. Let n be (1/m)/((-5)/(-10)). Sort 4, 3, n in increasing order. n, 3, 4 Let d = 703 - 706. Sort -4, -11, d, 0 in decreasing order. 0, d, -4, -11 Let m be (-8)/10(17 + 4 + -1). Let p be (8/m)/((-2)/4). Put -3, p, 0, -4 in ascending order. -4, -3, 0, p Let x be (140/56)/(2/4). Sort 1, x, -2, -25 in decreasing order. x, 1, -2, -25 Let g = -217 + 222. Sort 2, g, 0 in increasing order. 0, 2, g Let y = -4.158 - -4. Let r = y + -0.042. Put 3/4, r, 7 in decreasing order. 7, 3/4, r Suppose -10 = o - 6o. Let u = 24.6 + 8.4. Let m = u - 30. Put 0.1, m, o in descending order. m, o, 0.1 Let a = -14 - -25. Let g be (-24)/(-110) + 2/a. Sort -2, g, 3/7 in ascending order. -2, g, 3/7 Let y = 353/90 + -37/10. Put 2, 0.04, y in increasing order. 0.04, y, 2 Let c be ((-2)/2)/((-6)/(-4)). Let q = -62/99 + 4/9. Sort -2, q, c in descending order. q, c, -2 Let f = -1 - -0.8. Let i = 55.7 + -50.5. Let s = i + f. Put 0.8, s, -1 in increasing order. -1, 0.8, s Suppose 377h - 381h + 4 = 0. Put -5, 12, 2, h in increasing order. -5, h, 2, 12 Let i = -5.8 - -2.8. Let f = 17 + -17.56. Let j = f - -0.06. Put i, 5, j in descending order. 5, j, i Let o = 1456 + -7279/5. Sort -0.01, o, -0.1, -3. -3, -0.1, -0.01, o Suppose 2f + 2f - 2q = 4, 0 = 3f - 2q - 3. Let u be 0 - 1/((-7)/(-21)). Sort u, 12, f. u, f, 12 Let m(h) = -79h + 390. Let k be m(5). Suppose s - 3s = 0. Sort s, k, -3. k, -3, s Let y = -213/62 - -60/31. Let p = -3 + 3.1. Sort p, y, -0.5 in decreasing order. p, -0.5, y Let h(l) = l + 19. Let f be h(17). Suppose -15m + 19m = f. Sort m, -2/11, 5 in descending order. m, 5, -2/11 Suppose -7 + 4 = -t. Suppose -4c + 4b = c + 12, 5c - t = -b. Let k be -2 + c - (-126)/60. Put 2/7, 4, k in increasing order. k, 2/7, 4 Let n(s) = -11s - 61. Let x be n(-6). Sort x, -3, -54. -54, -3, x Let h = 180 + -173.48. Let n = 0.52 - h. Sort -0.1, 2, n, -0.5. n, -0.5, -0.1, 2 Let d = 3 + -3. Let h(g) = -2g*3 + 14g*2 - 11g - 1. Let z be h(6). Suppose dy = -zy. Sort 4, y, -2. -2, y, 4 Let b(z) = 4z2 + 57z + 15. Let j be b(-14). Put 4, j, 3 in decreasing order. 4, 3, j Let i be 2/(-8) + (-15)/4. Let s = -1369 + 1374. Sort i, 7, s, -1 in increasing order. i, -1, s, 7 Let r = -0.12 - 4.88. Let j = 1.6 - -3.4. Sort r, 1/6, j in decreasing order. j, 1/6, r Suppose -v + 5v - 16 = 0. Let w = 3041 + -3042. Put w, v, 0, 6 in decreasing order. 6, v, 0, w Let j = 0 - 4. Suppose -56g = -21g + 22g - 228. Put j, g, 2, -17 in ascending order. -17, j, 2, g Let s(n) = -58n - 1162. Let w be s(-20). Suppose 27 = 5g + 4o, 0g - 2g + 18 = 4o. Sort -1, g, w. w, -1, g Let n(t) = t + 4. Let v be n(4). Suppose 11p + v = 9p. Put -1/7, p, 12/13 in increasing order. p, -1/7, 12/13 Suppose -3g - 3q - 9 = 0, -g - 3q + 40 = -5g. Suppose 0 = -3y + 2y + b + 3, 2y - 9 = 3b. Let s be (y/(-2) - g) + -3. Sort s, -5, -4 in decreasing order. s, -4, -5 Let v be 4/(-6)6/7. Let n = -283/70 - -51/14. Put -1/3, -4, v, n in increasing order. -4, v, n, -1/3 Suppose 29a = -19a + 624. Sort 1, -5, a in descending order. a, 1, -5 Let z = 149/4 - 261/7. Sort 4, z, -0.1 in descending order. 4, z, -0.1 Let z(t) = -t2 + 10t + 6. Let h be z(11). Let r = -138 - -142. Sort h, r, 6. h, r, 6 Suppos	{ "pile_set_name": "DM Mathematics" }
a be c(5). Suppose 3l + 21 = 6l. Sort a, 3, l in ascending order. 3, a, l Suppose 0 = -10g - 13 + 3. Suppose -5w = -4w. Sort w, -5, g in decreasing order. w, g, -5 Let f = -4.25 + 5.25. Suppose 7t - 41 = -3k + 2t, 2t = -3k + 56. Let a = 67/3 - k. Sort a, 2, f in increasing order. a, f, 2 Let p(h) = 2h - 3. Let o be p(3). Suppose -2d - o = -7. Suppose 0 = m - 3t - 12, -2t - 2 = 4m - 8. Sort d, 4, m in ascending order. d, m, 4 Let a = -47 + 46.6. Let x = 170 - 169.93. Sort x, 5, a, 2 in descending order. 5, 2, x, a Let h = 1332/143 + -114/13. Sort 1/3, -2/5, h, 13. -2/5, 1/3, h, 13 Let n = 1.265 + -18.565. Put 0.4, -0.1, n in decreasing order. 0.4, -0.1, n Suppose -2t - 2i - 94 = 0, 5i - 24 = 1. Let c = 56 + t. Put c, 5, 26 in descending order. 26, 5, c Let b = -2.82 - -0.82. Sort 0, b, 1.91 in increasing order. b, 0, 1.91 Suppose 3u = -4s + 3, -3u + u = -4s - 2. Let y be (-1)/3 + 22/(-6). Let t be (y + 0)3/3. Sort s, 5, t in increasing order. t, s, 5 Let w = 46.42 + -1.02. Let l = w - 45. Let m = -0.04 - -3.04. Put m, l, -4/7 in ascending order. -4/7, l, m Let d = -3 - -3.4. Suppose -4v = -2v - 12. Let x be 2(v + (-1 - 6)). Sort d, 8/5, x in decreasing order. 8/5, d, x Let d be (0 - 2/4)/((-137)/(-274)). Sort 1, 5, d, 0 in ascending order. d, 0, 1, 5 Let w = -119.4 + 125.4. Put 8, -2, 1, w in decreasing order. 8, w, 1, -2 Suppose 6p - 46 + 52 + 60 = 0. Suppose 13 = -4x - 3. Sort x, -3, 4, p in decreasing order. 4, -3, x, p Let p = -14.99 + 15. Put p, -2/5, -0.3 in ascending order. -2/5, -0.3, p Let q = -0.15 - -1.23. Let t = -1.18 + q. Put t, 0, 17 in decreasing order. 17, 0, t Suppose 19a = -3w + 21a - 57, 5w + a = -95. Let z be -1 + -1 + (3 - -1). Sort 1, w, z in ascending order. w, 1, z Suppose -j - 5k = 4, 2j = -4k + 3k - 8. Sort 3/5, -4/17, j in ascending order. j, -4/17, 3/5 Let p(d) = -d - 9. Let l be p(-8). Suppose 95 = -2x - 25. Let w be (2-1 - -1)/((-5)/x). Sort w, l, 0 in decreasing order. 0, l, w Let t = -211/4 + 661/12. Let j = -0.1 + -0.4. Sort -0.4, j, t in descending order. t, -0.4, j Suppose 0 = -3x - 5j - 22, 7 - 11 = -x + 4j. Sort 2, -5, x, 9. -5, x, 2, 9 Suppose -7q = q - 40. Suppose -2b - qn = 3b - 15, -5b + 15 = 4n. Sort b, 6, -2 in increasing order. -2, b, 6 Let l be (7 - -5(-3)/3) + 1. Suppose 21 = z + 2z. Let t = -8 + z. Put 2, t, l in decreasing order. l, 2, t Let t(c) = -2c*2 + 16c - 1. Let j be t(8). Let l = -11 - -8. Sort -4, l, j, 5 in decreasing order. 5, j, l, -4 Let h = 30 + -123/4. Suppose -8r + 47 = -3u, -3r - 4u + 19 = -14. Let i be (2/33)/(2/6). Sort h, i, r in decreasing order. r, i, h Let n = 4.41 + -9.41. Sort n, -3/4, -1/6, 5. n, -3/4, -1/6, 5 Let a(f) = f*3 + 4f*2 + f + 2. Let l be a(-4). Suppose -z - 2d = 3 + 1, 3d = -2z - 6. Put -1, l, z in descending order. z, -1, l Let z(c) = 36c - 622. Let l be z(17). Put l, 3, -5, 7 in descending order. 7, 3, -5, l Let c(s) = 6s*2 - 40s + 42. Let u be c(5). Put 0.02, 0, 2/9, u in ascending order. u, 0, 0.02, 2/9 Let s = 0.361 + 0.039. Let f = 5 + -5.09. Let w = f - -4.09. Sort w, 0, s in descending order. w, s, 0 Let v = 0.977 + -0.677. Put -2, v, 0.23 in increasing order. -2, 0.23, v Let i = 1787 - 1829. Sort -6, i, 1 in increasing order. i, -6, 1 Let f = -8.3 - -8. Let s(c) = -c*2 + 3c + 2. Let w be s(2). Suppose 5i = 2i - 2y - 12, -wi = -3y + 33. Sort f, i, 0.2. i, f, 0.2 Suppose -14y = -1 - 27. Let v = -15 + 15. Sort 4, v, 5, y in descending order. 5, 4, y, v Let v be 39/65 + (-36)/(-15). Sort 0, -9, v, -1 in decreasing order. v, 0, -1, -9 Let o be (-22)/(-26) - 1 - (-102)/156. Sort 3/13, o, 1/6 in increasing order. 1/6, 3/13, o Let u be (-24)/297(-15)/(-10). Sort 3, u, 2/3. u, 2/3, 3 Let m = 32 - 57. Let v = m - -25. Put -1, 11, v in descending order. 11, v, -1 Let u = -867 + 6945/8. Let y = -65/72 + u. Sort y, -1.9, -4/7 in descending order. y, -4/7, -1.9 Let b(o) = 196 - 395 - o2 - 6o + 203. Let u be b(-6). Put 1, u, -1 in descending order. u, 1, -1 Let i = -12 + 6.5. Let x = 6 + i. Let y be 2/(-12)(-16)/(-24). Sort y, 4, x. y, x, 4 Let n = -12 + -4. Let z = n + 17. Sort z, -2, 3 in descending order. 3, z, -2 Suppose 2m = -m - 81. Let h = m + 24. Put -1, h, 0 in descending order. 0, -1, h Let o = -5 + 7. Let f(d) = d*2 + 7d + 10. Let y be f(-6). Put -3, o, 3, y in descending order. y, 3, o, -3 Let i = -1.25 - -0.16. Let y = 0.79 + i. Sort -4, 2/11, y, -0.4 in descending order. 2/11, y, -0.4, -4 Let c = 32.4 - 32. Let m = -27 + 25. Put -2/19, m, c, 5/6 in descending order. 5/6, c, -2/19, m Suppose 12p + 39 - 15 = 0. Let z = -3 - -3.1. Put p, 5, z in descending order. 5, z, p Let g(h) = h2 - 6h - 3. Let v be g(6). Suppose -4t + 5t - 22 = 5m, -3m - 18 = -3t. Sort v, t, 3 in ascending order. v, t, 3 Let m = -672 - -677. Sort 525, -5, m in decreasing order. 525, m, -5 Suppose 10 = 2l - v, 10l - 13l - 2v + 8 = 0. Sort l, -25, -15. -25, -15, l Let h be (3/4)/(556/32 - 17). Let m = 1.2 - 1. Let w = -0.2 + m. Put w, h, -0.2 in ascending order. -0.2, w, h Let j = 78 + -82. Let x = 983/5 - 196. Sort -4/5, x, j, -0.4 in descending order. x, -0.4, -4/5, j Let x(u) = -u3 - 7u*2 - 6u - 42. Let h be x(-7). Sort -1/5, 3/2, 4, h in increasing order. -1/5, h, 3/2, 4 Let a(p) = 7p + 44. Let z be a(-7). Sort z, 0, -13, -3 in increasing order. -13, z, -3, 0 Let y = -288 + 291. Let z(v) = -v - 3. Let p be z(-7). Put y, 1/2, -8, p in decreasing order. p, y, 1/2, -8 Let c = -297 + 297.2. Put c, 0.1, -3/7, 0.3 in ascending order. -3/7, 0.1, c, 0.3 Let m be (3 - -1)/((-7)/56). Let v = m + 36. Sort 1, 3, v in decreasing order. v, 3, 1 Let s(k) = -k + 6k*3 - 7k*3 + 0k + 4k2. Let m be s(4). Let h be (-1)/(m + (3 - 4)). Sort 3/2, -2/9, h in descending order. 3/2, h, -2/9 Let x be (-2)/(-18)(2 - -1). Suppose 0 = n - 3n + 32. Let q = 19 - n. Sort 0.4, q, x in descending order. q, 0.4, x Let m = -58 + 35. Let l = -17 - m. Sort -0.1, l, 2/3. -0.1, 2/3, l Let n be ((-2)/348)/(42/(-18) + 2). Put -0.3, -3/5, n in descending order. n, -0.3, -3/5 Let t(j) = j3 + 2j*2 - 2j + 5. Let d be t(-3). Let l be d/21/12. Sort l, 1, 17 in ascending order. 1, l, 17 Let y = 307493 + -180046. Let k = 14911480/117 - y. Let b = -23/13 + k. Put 0.4, b, -1/4 in descending order. 0.4, b, -1/4 Let s = -205 + 206. Sort -35, -4, 0, s in increasing order. -35, -4, 0, s Let i = 1 - 1. Let a = 5/317 - -19327/634. Let q = a - 29. Sort q, 4, i in ascending order. i, q, 4 Let s be (-943)/820 - 4/(-10). Suppose 2k + 1 = 3. Put k, 5, s in descending order. 5, k, s Let v = 33.7 - 7.7. Let i = 26.5 - v. Put 0, -2/107, i in decreasing order. i, 0, -2/107 Suppose 0 = 8x - x - 42. Let p be (x/(-5))/(4/(-10)). Let a = -1.5 - -2. Sort a, 1, p. a, 1, p Suppose -o - 15 = -4h - 5, 25 = 5o + 5h. Put -5, o, 3, -14 in ascending order. -14, -5, o, 3 Let a = -18937 - -18938. Let w be -1 - 0/(-2) - -1. Let s(b) = b2 - 5b + 2. Let d be s(2). Sort w, a, d in descending order. a, w, d Suppose 4y - 16 = -4b, -2b = -4y + 3b + 16. Sort 5, y, -5, 40. -5, y, 5, 40 Let m = 28 + -32. Let q be (66/69 + -1)/((-3)/6). Sort 1/4, m, q, -2/7. m, -2/7, q, 1/4 Let q = 5726/5 + -1150. Put -5, q, 0.4 in descending order. 0.4, q, -5 Let b be 60/14-8 - 10/(-35). Let w be -2(b/(-11) - 3). Put 4, w, -1 in descending order. 4, w, -1 Suppose 3a - 27 = -2r, -r + a + 52 = 31. Put -4, -1, 6, r in descending order. r, 6, -1, -4 Let l = -0.71 + -0.29. Let u = -543.09 + 547. Let b = -0.09 - u. Put -3, b, l in decreasing order. l, -3, b Let a be 8 - 1 - 286/44. Sort -1/11, a, -4, 5 in descending order. 5, a, -1/11, -4 Suppose -6s + 6 + 24 = 0. Sort -2, s, -1. -2, -1, s Suppose -8f + 4f = -8. Let a be (f - 3)0/(-8). Let d be 2/8 - (-5)/(-4). Sort a, d, 3 in descending order. 3, a, d Let m be (-1 + 3/6)/1. Let p = 0.98 - 1. Let u = 0.22 + p. Sort u, m, -4 in descending order. u, m, -4 Suppose -4170o + 4175o - 615 = 0. Sort o, 4, 3 in decreasing order. o, 4, 3 Let n be (-4 + 44)/5 + 2. Suppose -nw + 6w + 8 = 0. Put w, -9, -5 in ascending order. -9, -5, w Suppose -2o + 16 = 2f, f - 5o + 12 = -2o. Let t be ((-5)/(-2))/(f/(-2)). Let h = 0.1 - -0.1. Sort t, 4, h in increasing order. t, h, 4 Suppose -9y + 0 = 27. Let n = 24 + -25.	{ "pile_set_name": "DM Mathematics" }
6222 to the nearest integer? 599 What is the eighth root of 94880560 to the nearest integer? 10 What is the square root of 991134128 to the nearest integer? 31482 What is the cube root of 529674823 to the nearest integer? 809 What is 58659574 to the power of 1/4, to the nearest integer? 88 What is the cube root of 1621100216 to the nearest integer? 1175 What is 1907865714 to the power of 1/8, to the nearest integer? 14 What is the third root of 606120336 to the nearest integer? 846 What is the ninth root of 1573036715 to the nearest integer? 11 What is the tenth root of 28283112 to the nearest integer? 6 What is 57547961 to the power of 1/4, to the nearest integer? 87 What is the square root of 255776050 to the nearest integer? 15993 What is 1063270517 to the power of 1/2, to the nearest integer? 32608 What is the third root of 1657345127 to the nearest integer? 1183 What is the cube root of 2377213717 to the nearest integer? 1335 What is 193494032 to the power of 1/7, to the nearest integer? 15 What is the square root of 304462300 to the nearest integer? 17449 What is 146649022 to the power of 1/5, to the nearest integer? 43 What is 36198795 to the power of 1/3, to the nearest integer? 331 What is 17998683 to the power of 1/2, to the nearest integer? 4242 What is 5289844025 to the power of 1/3, to the nearest integer? 1742 What is the third root of 655034316 to the nearest integer? 868 What is the cube root of 819024711 to the nearest integer? 936 What is the fifth root of 408281672 to the nearest integer? 53 What is the cube root of 111624638 to the nearest integer? 481 What is the tenth root of 107560391 to the nearest integer? 6 What is the cube root of 104628160 to the nearest integer? 471 What is the square root of 444943678 to the nearest integer? 21094 What is 38778032 to the power of 1/5, to the nearest integer? 33 What is 7333514739 to the power of 1/3, to the nearest integer? 1943 What is 1059025356 to the power of 1/4, to the nearest integer? 180 What is 661128661 to the power of 1/8, to the nearest integer? 13 What is 53838940 to the power of 1/9, to the nearest integer? 7 What is the cube root of 104470512 to the nearest integer? 471 What is 105527643 to the power of 1/2, to the nearest integer? 10273 What is 94642051 to the power of 1/2, to the nearest integer? 9728 What is the third root of 3442040489 to the nearest integer? 1510 What is the square root of 111413036 to the nearest integer? 10555 What is the square root of 149246580 to the nearest integer? 12217 What is the square root of 1082033695 to the nearest integer? 32894 What is the sixth root of 4234723330 to the nearest integer? 40 What is the square root of 81349872 to the nearest integer? 9019 What is the ninth root of 166514647 to the nearest integer? 8 What is the square root of 635644225 to the nearest integer? 25212 What is the square root of 602882188 to the nearest integer? 24554 What is 33925661 to the power of 1/8, to the nearest integer? 9 What is the cube root of 155347318 to the nearest integer? 538 What is the fifth root of 167078163 to the nearest integer? 44 What is 1018043771 to the power of 1/2, to the nearest integer? 31907 What is 146787871 to the power of 1/2, to the nearest integer? 12116 What is 13971932 to the power of 1/2, to the nearest integer? 3738 What is 4103807355 to the power of 1/3, to the nearest integer? 1601 What is the third root of 1091575390 to the nearest integer? 1030 What is 147951076 to the power of 1/2, to the nearest integer? 12164 What is the square root of 129260294 to the nearest integer? 11369 What is 355129936 to the power of 1/3, to the nearest integer? 708 What is the third root of 2082931662 to the nearest integer? 1277 What is 471110908 to the power of 1/2, to the nearest integer? 21705 What is the square root of 88617117 to the nearest integer? 9414 What is 341843311 to the power of 1/3, to the nearest integer? 699 What is 2368448 to the power of 1/9, to the nearest integer? 5 What is 18129443 to the power of 1/4, to the nearest integer? 65 What is 78441859 to the power of 1/4, to the nearest integer? 94 What is the seventh root of 870799117 to the nearest integer? 19 What is the square root of 22985077 to the nearest integer? 4794 What is 300421391 to the power of 1/10, to the nearest integer? 7 What is the square root of 505235537 to the nearest integer? 22477 What is the cube root of 31487898 to the nearest integer? 316 What is the square root of 326690049 to the nearest integer? 18075 What is the cube root of 17969713 to the nearest integer? 262 What is 1142063742 to the power of 1/3, to the nearest integer? 1045 What is the sixth root of 55426872 to the nearest integer? 20 What is 54798409 to the power of 1/2, to the nearest integer? 7403 What is the sixth root of 190258431 to the nearest integer? 24 What is the square root of 942829 to the nearest integer? 971 What is 404697009 to the power of 1/2, to the nearest integer? 20117 What is 211766326 to the power of 1/9, to the nearest integer? 8 What is the square root of 2765812033 to the nearest integer? 52591 What is the third root of 619447474 to the nearest integer? 852 What is the square root of 140579060 to the nearest integer? 11857 What is 90609108 to the power of 1/10, to the nearest integer? 6 What is 1478911850 to the power of 1/2, to the nearest integer? 38457 What is 7744396 to the power of 1/2, to the nearest integer? 2783 What is 144060681 to the power of 1/8, to the nearest integer? 10 What is 42649313 to the power of 1/6, to the nearest integer? 19 What is the cube root of 926311988 to the nearest integer? 975 What is the fourth root of 182118161 to the nearest integer? 116 What is the eighth root of 164792959 to the nearest integer? 11 What is the square root of 44288653 to the nearest integer? 6655 What is the cube root of 29473672 to the nearest integer? 309 What is the cube root of 1749436792 to the nearest integer? 1205 What is 14746213 to the power of 1/3, to the nearest integer? 245 What is 38502482 to the power of 1/2, to the nearest integer? 6205 What is 5291959802 to the power of 1/4, to the nearest integer? 270 What is the sixth root of 1054747383 to the nearest integer? 32 What is the cube root of 121506286 to the nearest integer? 495 What is the third root of 141547584 to the nearest integer? 521 What is the square root of 1317933653 to the nearest integer? 36303 What is 1078855512 to the power of 1/3, to the nearest integer? 1026 What is 13474004 to the power of 1/5, to the nearest integer? 27 What is the third root of 2454518636 to the nearest integer? 1349 What is the third root of 560110316 to the nearest integer? 824 What is 5610914755 to the power of 1/4, to the nearest integer? 274 What is 38203622 to the power of 1/3, to the nearest integer? 337 What is the third root of 20114793 to the nearest integer? 272 What is 20956918 to the power of 1/10, to the nearest integer? 5 What is 94746578 to the power of 1/3, to the nearest integer? 456 What is the cube root of 22889110 to the nearest integer? 284 What is the cube root of 1391139331 to the nearest integer? 1116 What is the square root of 42122567 to the nearest integer? 6490 What is the square root of 5250515756 to the nearest integer? 72460 What is the square root of 852409349 to the nearest integer? 29196 What is the cube root of 264865875 to the nearest integer? 642 What is 107825685 to the power of 1/2, to the nearest integer? 10384 What is the seventh root of 1704620374 to the nearest integer? 21 What is 9705911 to the power of 1/2, to the nearest integer? 3115 What is the eighth root of 48291502 to the nearest integer? 9 What is the third root of 527008919 to the nearest integer? 808 What is 5465534912 to the power of 1/8, to the nearest integer? 16 What is the third root of 546790464 to the nearest integer? 818 What is 894167241 to the power of 1/6, to the nearest integer? 31 What is the square root of 644231155 to the nearest integer? 25382 What is 108507655 to the power of 1/2, to the nearest integer? 10417 What is the square root of 224386681 to the nearest integer? 14980 What is the third root of 34214818 to the nearest integer? 325 What is the cube root of 49	{ "pile_set_name": "DM Mathematics" }
In base 12, what is -20 - -545a? 543a In base 15, what is 1b64 + 123? 1c87 In base 16, what is -3e9b8 - 3? -3e9bb In base 15, what is -9d - -34? -69 In base 16, what is df - 574f? -5670 In base 5, what is 223 - 3004? -2231 In base 4, what is 102100311 + 1? 102100312 In base 5, what is 2104 + 12122? 14231 In base 9, what is -1126 + -188? -1325 In base 15, what is -51 + 17e? 12d In base 8, what is 4 + -555663? -555657 In base 3, what is -1021 - 212010002? -212011100 In base 3, what is 20101110022 + -1? 20101110021 In base 11, what is -2 - -111132? 111130 In base 16, what is 73b - 10? 72b In base 10, what is 373 + 126? 499 In base 7, what is -5 + -114655? -114663 In base 3, what is 201222002 + 2? 201222011 In base 16, what is d7 + -386f? -3798 In base 11, what is 1aa - 29? 181 In base 2, what is 11 - 1110010010011100? -1110010010011001 In base 8, what is -1403545 - 1? -1403546 In base 2, what is 101 - -100100100000011? 100100100001000 In base 4, what is -10 - -11030110? 11030100 In base 4, what is 10012320 + -10? 10012310 In base 12, what is -3b1827 + 0? -3b1827 In base 16, what is -8317 - 0? -8317 In base 11, what is 5 - -5a3a? 5a44 In base 11, what is 24579 - 1? 24578 In base 12, what is -24b9 + -4? -2501 In base 7, what is 4 + -45225? -45221 In base 14, what is 2 + -3492a? -34928 In base 16, what is 3b1d - -3? 3b20 In base 10, what is 25 + 64654? 64679 In base 12, what is 21a05a + -3? 21a057 In base 8, what is -20413 - -503? -17710 In base 11, what is 21 + a778? a799 In base 9, what is -173 + -205? -378 In base 2, what is 101 + 1001100001101111? 1001100001110100 In base 8, what is 5604406 - 5? 5604401 In base 6, what is 4252 + 532? 5224 In base 4, what is -2 - -100213032? 100213030 In base 15, what is -c0 + -348? -418 In base 11, what is 29 + -274a? -2721 In base 2, what is -11001011 + 11010101101110? 11010010100011 In base 3, what is -2 + -121221221? -121222000 In base 3, what is -2122221 + -10? -2200001 In base 5, what is 100341 - 11344? 33442 In base 10, what is -342732 - -5? -342727 In base 4, what is 1122 + 3310331? 3312113 In base 15, what is 8 - -c44? c4c In base 7, what is -143005 + -10? -143015 In base 14, what is 46651 + 8? 46659 In base 9, what is -4 - -653301? 653286 In base 7, what is -314 + 1415? 1101 In base 7, what is 1 - -4404631? 4404632 In base 15, what is -1ab09 + -2? -1ab0b In base 9, what is -5 + 28701? 28685 In base 2, what is -101 - -10000000101110? 10000000101001 In base 13, what is -1 + 8223? 8222 In base 12, what is -1735 + -3? -1738 In base 8, what is -204 + 2024? 1620 In base 10, what is 68 - 1281? -1213 In base 12, what is -6514b - -14? -65137 In base 13, what is 4 + -174628? -174624 In base 7, what is 15324 + -4? 15320 In base 9, what is -1047 + 378? -558 In base 14, what is -2 + -2154? -2156 In base 12, what is -1b0 - 797? -987 In base 15, what is 335 + -1? 334 In base 13, what is -4 + bc40? bc39 In base 7, what is 1 + 102152? 102153 In base 7, what is 20 - 3221? -3201 In base 15, what is b6 - -8d? 154 In base 16, what is -5754 + -1? -5755 In base 10, what is 147 + -237? -90 In base 5, what is 10 + 1324041? 1324101 In base 3, what is 12121002 + 12100? 12210102 In base 7, what is -1 + -356445? -356446 In base 13, what is 3aa6 + 4? 3aaa In base 5, what is 1441234 + -14? 1441220 In base 12, what is -8a50 + 20? -8a30 In base 11, what is 79395 + 8? 793a2 In base 11, what is 3 + 7210? 7213 In base 11, what is -92734 - -2? -92732 In base 7, what is -1006 + -36? -1045 In base 13, what is cc03 - 3? cc00 In base 8, what is -115446 - 1? -115447 In base 8, what is -471 + 2513? 2022 In base 8, what is 152 - -635? 1007 In base 11, what is -2 + 32753? 32751 In base 13, what is 45 + -555? -510 In base 8, what is -4565 + -167? -4754 In base 13, what is -a - 1695? -16a2 In base 15, what is 47 + -3c8? -381 In base 11, what is -63274 - 2? -63276 In base 3, what is -1 - 122002210? -122002211 In base 13, what is 78 - -1760? 1808 In base 3, what is 1021220211 + -10? 1021220201 In base 8, what is -3 + -222544? -222547 In base 15, what is -4 - -2e24? 2e20 In base 7, what is -5530 + 0? -5530 In base 7, what is 11 - -1162335? 1162346 In base 4, what is -2323311 + 2? -2323303 In base 12, what is 5 - 10607? -10602 In base 4, what is -1010112230 + -11? -1010112301 In base 13, what is 4693 - -b? 46a1 In base 9, what is 7514 + 20? 7534 In base 7, what is -105102 + -53? -105155 In base 8, what is -10430 - 4? -10434 In base 2, what is 11 + -111101100111? -111101100100 In base 10, what is 210 + -2352? -2142 In base 12, what is -1 + -16097? -16098 In base 15, what is -13 - 904e? -9062 In base 12, what is 11229 + -5? 11224 In base 12, what is 6245b + 1? 62460 In base 14, what is -27 - 200? -227 In base 6, what is -2 - -34451? 34445 In base 4, what is 2002321 - 22? 2002233 In base 13, what is 1a0b + 9? 1a17 In base 13, what is 4 + 1b331? 1b335 In base 4, what is -120312023 - 0? -120312023 In base 13, what is 146 + -1a2? -59 In base 6, what is -12504 + -2? -12510 In base 5, what is -120 + -1011031? -1011201 In base 15, what is 6 - 3116? -3110 In base 11, what is -2aa867 - 4? -2aa870 In base 10, what is 2355 - 205? 2150 In base 10, what is 3094 + -139? 2955 In base 15, what is -1b + -194? -1b0 In base 14, what is -740 - 88? -7c8 In base 9, what is 2 + -607567? -607565 In base 16, what is -1d + -2a0c? -2a29 In base 10, what is 2773 - -70? 2843 In base 6, what is 5 + -21532? -21523 In base 11, what is -3043 - a9? -3141 In base 15, what is -104 - 34? -138 In base 6, what is 2 - -155150? 155152 In base 15, what is -17c53d - -5? -17c538 In base 14, what is 122 - -4a? 16c In base 16, what is 2 - -2c97? 2c99 In base 15, what is -3 + 2e91? 2e8d In base 5, what is 4343242 - -113? 4343410 In base 3, what is 2 - 220211102012? -220211102010 In base 2, what is -101 + -1010010101111011? -1010010110000000 In base 3, what is -12001100100 - -12? -12001100011 In base 10, what is -8 + 15886? 15878 In base 9, what is -2 + 755? 753 In base 10, what is -1161 + 170? -991 In base 11, what is 6976 + -17? 695a In base 13, what is 4 - 8a48? -8a44 In base 4, what is 202003321023 + 1? 202003321030 In base 14, what is -4 - -11aa06? 11aa02 In base 5, what is 310201 + -12? 310134 In base 6, what is -12525041 + -3? -12525044 In base 8, what is 53 - -4315? 4370 In base 14, what is 70b - 8? 703 In base 3, what is 200012210 + 1? 200012211 In base 12, what is 4 + 4abb7? 4abbb In base 13, what is 3c - -68c9? 6938 In base 16, what is 8b7 + -1bb? 6fc In base 9, what is 18251 - -4? 18255 In base 15, what is ec3b3 + 3? ec3b6 In base 5, what is 2103 + 1442? 4100 In base 3, what is -10212120210 - 0? -10212120210 In base 11, what is 60 - a15? -965 In base 2, what is -1100 + 1101001001101? 1101001000001 In base 5, what is 22 + 340? 412 In base 14, what is 26 - 4d4? -4ac In base 13, what is 340 + -6? 337 In base 5, what is -22 + 30313? 30241 In base 8, what is -2207154 + -2? -2207156 In base 16, what is 4e894 + 2? 4e896 In base 7, what is 5 - 15634? -15626 In base 4, what is -11223 - -130? -11033 In base 3, what is 1111020 - -2010? 1120100 In base 4, what is -20202013 + -2? -20202021 In base 10, what is 44 - 154? -110 In base 12, what is -369735 - 0? -369735 In base 8, what is -461 - -10735? 10254 In base 15, what is -27 + -38? -60 In base 6, what is -1225 - -445? -340 In base 14, what is d + 20402? 20411 In base 3, what is -112 - 102120222? -102121111 In base 15, what is 48c6 - -2? 48c8 In base 11, what is -5 - 1076? -1080 In base 15, what is 5 - 175860? -17585a In base 12, what is -11 + 98476? 98465 In base 8, what is -17236441 - 0? -17236441 In base 8, what is 127 + 4675? 5024 In base 3, what is 11 - -11122022? 11122110 In base 6, what is 1145504 + -20? 1145444 In base 2, what is 110 - 1111101101111? -1111101101001 In base 8, what is -66233 + -2? -66235 In base 9, what is 1253 + 174? 1437 In base 5, what is -42 - -114034? 113442 In base 13, what is -556 - 0? -556 In base 15, what is 3 - 1460? -145c In base 5, what is 31142034 - 21? 31142013 In base 16, what is -3 + -12503? -12506 In base 12, what is -a + 110486? 110478 In base 5, what is 4 + -333344? -333340 In base 6, what is -3143 + 2223? -520 In base 16, what is 4bb + 9f? 55a In base 3, what is 210120020212 - 2? 210120020210 In base 12	{ "pile_set_name": "DM Mathematics" }
l(w) = w5 - w4 - w*3 + 4w*2. Let u(a) = 3l(a) - r(a). Find the third derivative of u(q) wrt q. 60q2 - 768 Let g(r) = r2 - 6r + 10. Let y be g(8). Let v = y + -26. What is the third derivative of 7z2 - 7z*2 + 10z*2 + 7z*5 + vz*5 wrt z? 420z2 What is the third derivative of -w3 - 129w2 - 14w*5 + 114w2 - w3 wrt w? -840w2 - 12 Find the second derivative of 1 - 20 - 151a + 19 + 114a2 wrt a. 228 Let i(t) = -2t3 - t2 + 2t. Let u(p) = -553p*3 - 2p - 587. Let v(h) = -i(h) - u(h). Differentiate v(q) with respect to q. 1665q2 + 2q Let k = 337 - 332. Let t(g) be the first derivative of k + 5/4g4 + 5/3g*3 + 0g + 0g2. Find the third derivative of t(h) wrt h. 30 Let n(g) be the first derivative of 37/2g*2 + 0g*4 - 8 + 0g*3 - 14/5g*5 + 0g. Find the second derivative of n(p) wrt p. -168p2 Let q be 2((7 + -5)/4 + 1). Let j(o) be the first derivative of o*2 + q - 5/3o*3 + 0o. Find the second derivative of j(g) wrt g. -10 What is the second derivative of -66c2 + 32c*2 - 596c - 1 + 1 - 29c2 + 2c*3 wrt c? 12c - 126 Let i(q) = 5q3 - 41q*2 + 19q - 3. Let y(s) = 3s3 - 40s*2 + 18s - 2. Let x(k) = 2i(k) - 3y(k). Find the second derivative of x(h) wrt h. 6h + 76 Let r(z) be the second derivative of -141z*4/4 - 199z*2 - 3z - 9. What is the derivative of r(w) wrt w? -846w Let r(f) = 56f*2 - 2f - 94. Let o(u) = 167u2 - 7u - 282. Let q(j) = -2o(j) + 7r(j). Find the first derivative of q(n) wrt n. 116n Let s = 40 - 18. Find the third derivative of -158d + 158d - 10d*6 - sd*2 wrt d. -1200d3 Let u(t) = -t3 + 3t2 + 5t - 4. Let m be u(4). What is the second derivative of -12d2 - 7d*2 - 14d + md wrt d? -38 Let r(z) be the first derivative of 157z*7/7 + 4z*3/3 - 11z - 72. Find the third derivative of r(q) wrt q. 18840q3 Let d(x) be the third derivative of 0x*3 - 30x*2 - 13/20x*5 + 0x*4 + 1/12x*6 + 0x + 0. Find the third derivative of d(p) wrt p. 60 Suppose 5 = -4l + 29. Suppose -8m + l = -6m. Differentiate 5 + 0c - 2 - 4 + mc with respect to c. 3 Let n(y) = -26y*3 + 30y*2 - 7y - 7. Let t(q) = 13q3 - 15q*2 + 4q + 4. Let z(l) = 4n(l) + 7t(l). What is the third derivative of z(k) wrt k? -78 Let i(b) be the second derivative of -b*3/3 - 6b. Let w be i(-1). Find the third derivative of 3 - 3 + 5x5 + 15x*w - 21x*2 wrt x. 300x*2 Let g(l) = 9l*4 - 17l*3 + 8l*2 + 56l. Let f(a) = 4a4 - 8a*3 + 5a*2 + 28a. Let k(v) = -5f(v) + 3g(v). Find the third derivative of k(u) wrt u. 168u - 66 What is the first derivative of -130q + 492q - 21 - 135q - 154q + 3q*2 - 144q wrt q? 6q - 71 What is the third derivative of -52f*5 - 69f*5 - 4 - 3 + 3f*2 + 0 wrt f? -7260f*2 Let v be -1 - (2-4 - -3). Find the second derivative of 85u3 - 5u*v + 4u*4 - 9u - 85u3 wrt u. -12u*2 Let x be 111/18 + (-1)/6. Let g = 10 - x. Find the third derivative of -3r*g - 2r*2 + 0r*4 - 2r*4 wrt r. -120r Let a(u) = -2u3 + 56u*2 + 2u + 38. Let v(d) = d*2 - 1. Let p(o) = -a(o) - 5v(o). Find the second derivative of p(y) wrt y. 12y - 122 Let r = 21 + 0. Suppose 5v = 2g + 18, -7v + r = -2v + g. Find the first derivative of -vh*4 + 8h*4 + 2h*4 + 2h*4 + 8 wrt h. 32h*3 Find the second derivative of -4 - 5p + 4 + 34p + 5 - 261p*2 wrt p. -522 Let h(w) be the third derivative of -5w9/504 + w6/8 + 169w5/60 + 63w*2. Find the third derivative of h(g) wrt g. -600g3 + 90 Let i(h) be the second derivative of h5/10 + 43h4/2 + 32h*2 - 4h + 13. Find the first derivative of i(o) wrt o. 6o2 + 516o Suppose -4w + 4 = r - 2r, -w = 5r - 1. Find the first derivative of 13z*3 + w + 74z*2 - 74z*2 wrt z. 39z*2 Let l(u) be the second derivative of -199u4/12 + u3 + 3u2/2 + 10u - 2. What is the second derivative of l(f) wrt f? -398 Let o(y) be the second derivative of 2y5/15 + y3 + 4y*2 - 2y. Let n(h) be the first derivative of o(h). Find the first derivative of n(q) wrt q. 16q Find the third derivative of 8p*4 + 4p*4 - 41p*6 - 1 + 18p*2 - 12p*4 - 28p*6 wrt p. -8280p*3 Let n(o) be the first derivative of -72o*5/5 - 14o*3 - 26. Find the third derivative of n(q) wrt q. -1728q Find the second derivative of -4h3 + 209h + 29221h2 - 29224h*2 - 19h*3 wrt h. -138h - 6 Let i(u) = 5u - 35. Let d be i(8). What is the second derivative of -24t*3 + 24t*3 - 3t*2 - 51t - 3td + 0t*2 wrt t? -60t3 - 6 Let f(j) = -j3 - 13j2 + 4j + 19. Let o be f(-13). Let r be (-3 + -1)o/12. What is the first derivative of -r + 9 - 2 + 2v*4 wrt v? 8v*3 What is the second derivative of 33 + 4u - 124 - 2u - 2378u*5 + 2412u*5 wrt u? 680u*3 What is the second derivative of -12 + 2 + 3 + 5 - 119l*2 - 12l wrt l? -238 Suppose -3a - 4 = -6d + d, 5d - 2 = 4a. What is the third derivative of 4x3 + 0x*3 + 5x*2 - 8x*2 + 15x*d wrt x? 24 Let d be ((-2 - -3)-3)/(0 + -1). Suppose j = 5u - 13, 5u + j - 3j = 11. Differentiate -11r*u + 4 + 5r*d - 8 with respect to r. -18r*2 Differentiate 1335 + 4x*2 - 1260 - 88x*3 - 4x*2 with respect to x. -264x*2 Let v(f) be the first derivative of -11f*7/420 - 5f*4/12 + 3f*3 - 3. Let k(b) be the third derivative of v(b). Differentiate k(t) with respect to t. -66t*2 Let j be (3 + 65/(-20))-12. Find the first derivative of -2 + 0o - 5 + 6o + j wrt o. 6 What is the derivative of 224 + 24z + 335 + 137 - 1308 + 169z wrt z? 193 Let n = 110 - 80. Find the second derivative of nr3 + r3 + 7r - 173 + 175 wrt r. 186r Let n(a) = a3 - 5a2 - a + 7. Let v be (2/(-3))/((-18)/135). Let i be n(v). Find the first derivative of 4 - yi + 2y2 + 0y*2 wrt y. 2y Suppose -10f = -8f - 14. Let a = f - 5. Find the second derivative of -7m5 + 0m*2 + 5m + 0ma wrt m. -140m*3 Suppose 5w = -3h + 57, 2w = 3w + 5h - 7. What is the second derivative of -7f + 9f*2 + 2f - 9f2 - wf*4 wrt f? -144f*2 Suppose -10 + 0 = -2o. Suppose v - oc = -4v, 3v = 2c + 3. What is the second derivative of 13m - 15m + 3m3 - vm*3 + 6m*4 wrt m? 72m*2 Let m be ((-6)/(-12))/((-2)/(-32)). Suppose m = 3h - 4. Find the second derivative of 15l + 0l*4 - 3l*h - 6l + 0l4 wrt l. -36l*2 What is the first derivative of 12 - 16 + 99 + 20 + 342s wrt s? 342 Let l(k) be the first derivative of k*6/6 + 13k*2/2 + 11k - 4. Let w(f) be the first derivative of l(f). Differentiate w(b) with respect to b. 20b3 Let t = 167 - 137. What is the derivative of 31j*3 + 10 + 2j + t + 3j3 - 10j*3 wrt j? 72j*2 + 2 Let l(z) be the first derivative of -14 + 0z + 0z5 - 5/6z*6 + 0z*4 - 6z*3 + 0z*2. Find the third derivative of l(k) wrt k. -300k*2 What is the second derivative of -212g*4 + 129g - 444g4 + 62g*4 wrt g? -7128g*2 Let i(t) be the first derivative of 76t*6/3 + 478t*3/3 + 297. What is the third derivative of i(h) wrt h? 9120h*2 Let k = -5 - -7. Suppose -11 + k = -3i. Find the second derivative of -r*2 - 6r*3 - 9r - 5ri + r2 wrt r. -66r Let x(k) be the first derivative of 114k5 - 208k*3 - 26. What is the third derivative of x(l) wrt l? 13680l Let g(f) be the first derivative of -17f5/5 - f4/4 + 26f*3/3 + 20. Find the third derivative of g(t) wrt t. -408t - 6 Let x be (-4)/40 + 242/20. Differentiate xf4 - 1243 + 14f*4 + 1288 wrt f. 104f*3 Let j(l) be the second derivative of 181l*6/30 + 49l4/4 - l2 - 257l. What is the third derivative of j(s) wrt s? 4344s Let l(v) be the third derivative of 5/6v3 + 4v*2 + 0 + 0v + 13/24v4. What is the first derivative of l(o) wrt o? 13 Let p(i) be the first derivative of 27i*4/4 + 4i*3 - i + 33. What is the third derivative of p(u) wrt u? 162 Suppose -f + 8 = 6. Find the second derivative of 2d + 2d - fd + 2d2 - 5d wrt d. 4 Let g(c) = c*3 - 8c*2 + 3. Let p be g(8). Suppose 0 - 4 = -2w - pz, -3 = -w - z. Differentiate -3 - 6v + 0 - w with respect to v. -6 Suppose 4 = -4n + 6n. Suppose 5f - 9 = 1. What is the third derivative of -4g*5 + 3g*f + 5g*5 + 2g*3 - ng*3 wrt g? 60g**2 Suppose -646 =	{ "pile_set_name": "DM Mathematics" }
4 Let k be (2/13 - (-66)/(-260))-2. Suppose 0 = -4i + 31 + 5. Suppose 2z + z - i = 0. Which is the closest to -0.1? (a) 1 (b) k (c) z b Let y = -1295.2 - -1298.2. Let f = 5/33 + 2/11. What is the nearest to 1 in y, 0.5, -0.01, f? 0.5 Let q(r) = -r2 + r. Let o be q(2). Let h = -56073 - -56072.94. What is the nearest to o in 0.3, h, 2/3? h Let p = 20.3 + -5.3. Let u be (-4)/(8/(-6)) - -1. Suppose -ur + 3 = -1. What is the closest to 0 in 2/3, p, r? 2/3 Let v = -241 + 161. Let k = 80.5 + v. Which is the closest to -2? (a) -8 (b) 0.3 (c) k b Let d = 462 + -690. Let s = d + 227.9. Let b = -0.09 - 4.91. What is the closest to -0.1 in s, 2/21, b? s Let q = -0.25 - -0.25. Let s = 20705/21 + -6890/7. What is the nearest to 0.3 in s, q, -1/4? q Let f be (-2)/5(-725)/(-1160). Let n(x) = 4x - 12. Let o be n(4). Which is the nearest to f? (a) -5 (b) -3 (c) o b Let i = 7.6 + -7.7. Let j = 14/97 - 520/4947. Suppose -9 = 3g - 3. Which is the closest to i? (a) -1 (b) g (c) j c Suppose 0 = -4x - 21 + 5. Let o be (-262)/(-14) + (-6)/(-21). Let j = -74/313 - 569/1565. Which is the closest to 0.1? (a) x (b) j (c) o b Let w = 1278 + -1283.91. Let v = w + 6.01. Let y be (3/(-66))/((-1)/(-4)). Which is the closest to 3? (a) y (b) 1/5 (c) v b Let q = 4.4 - 4. Let h be (4/6)/(640/120) + (-15)/40. What is the nearest to h in q, 3, 5? q Let a = -10.0402 - -0.0402. Let g = -889/12 - -74. What is the nearest to -1 in g, a, 4? g Suppose -45 - 9 = -16n + 74. What is the nearest to n in -0.039, -3, -2/11, -3/4? -0.039 Let b be (-540)/(-110) + (-1)/(-11). Suppose 3v - 10 = -t + 7, -4v = -bt + 104. What is the closest to 1 in t, -0.1, 2? 2 Suppose 202o - 197o - 23 = 4i, 2i + 3o - 5 = 0. What is the closest to i in 4/5, 3, 21, 0.4? 0.4 Let d = -294 - -119. Let y = -174 - d. Which is the nearest to y? (a) 0.3 (b) -1 (c) 2 a Let c = -11 - -10.8. Let g = -4500 + 4500. What is the closest to g in 0.1, c, 4/5? 0.1 Let w = -47 - -29. Let k = w + 13. Suppose -f - f = 6. Which is the nearest to 3/2? (a) 0.3 (b) k (c) f a Let d be 1/(-5)(-6 + 1512/297). Let g be 2/(-24)(9 + 1). Which is the closest to -1? (a) -2 (b) d (c) g c Let q(n) be the first derivative of 11n + 0 + 16n - 28n + n*3 - 12. Let x be q(1). Which is the closest to x? (a) -1/8 (b) 0.4 (c) 5 b Let d = -20783/2 + 10392. Let p = -0.2 + 0.4. Let n = -6 + 10. What is the closest to p in n, d, 5? d Let y = -48.3 - -48.8. Let b(q) = -2q*2 - 23q - 34. Let r be b(-10). What is the closest to -1/3 in r, -1, y? -1 Let h = -75 - -66. Let i be (-3)/5(494/(-117))/19. Which is the nearest to -1? (a) i (b) 0.3 (c) h (d) -4 a Let u = -23 + 21. Let r = -315.4 - -315. Which is the nearest to 1/3? (a) r (b) u (c) 0.16 c Let o = 0.2 - 0.7. Let y = -609 + 613. Suppose 5 - 7 = a + 2b, 0 = -a + yb + 4. What is the nearest to 0 in o, a, 12? a Suppose 2z + 4z = 4z + 3z. Which is the closest to z? (a) 2/3 (b) -0.8 (c) 0.2 (d) -4 c Suppose -5w - 141 = -3x, 0 - 21 = w - 3x. Let c = w - -24. Let j be ((-2)/(-3))/((-1)/c). What is the nearest to 0.3 in -1, j, 2/7? 2/7 Let n = -9405 + 56429/6. What is the closest to -2 in n, 12, -1/5, 2? -1/5 Let h = 48.734 - 48.8. Let s = h - 0.934. Let p = -2.95 + -0.05. Which is the closest to s? (a) p (b) -3/7 (c) 1/5 b Let h = 17 + -12. Suppose 322 = 96l - 62. Which is the closest to -1? (a) h (b) 0.5 (c) l b Let k(n) = n3 + 10n*2 + 12n. Let l be k(-8). Suppose -l + 8 = -4j. Suppose jm + 4 = 2m. Which is the closest to -1/5? (a) 2 (b) m (c) 2/7 c Let z = -5077/480174 + 10/1257. Let b = -193/764 - z. What is the closest to b in 1/8, -0.4, 0.1? -0.4 Let m = 273.6 - 346. Let v = m + 72. Let a be (-20)/36(-4)/10. What is the closest to 0.1 in a, 19, v? a Let k = 10955 - 11127. What is the closest to -2 in 5, k, -0.3? -0.3 Let n = 74227/4 - 18556. What is the nearest to 26/3 in 0.1, 5, n? 5 Let g be 10/(-2)(-12)/(-4). Let n be 1 - (22/(-121) + g/(-22)). Let r = -0.24 + -0.06. Which is the closest to n? (a) -3/7 (b) 1 (c) r b Let m = 31 - 26. Let i = 19781/10 + -9893/5. Which is the closest to -1/4? (a) -1/3 (b) -3/7 (c) i (d) m a Let k = -386405/19 - -20337. What is the closest to 0 in k, 0.005, -0.3? 0.005 Let u be 3 + -2 + (-1)/(-9) + 25/45. Which is the closest to -0.01? (a) u (b) 4 (c) 1/10 (d) 2/15 c Suppose -196t + 39t - 976 = 87t. Which is the closest to 1? (a) -3/8 (b) t (c) -1 (d) 1/140 d Let f = -139 - -138.968. Let g = f + -0.068. What is the nearest to 0.2 in g, -0.4, 0.4? 0.4 Let t = -421 + 230. Let q = -192.37 - t. Let h = q + 0.37. Which is the closest to -0.2? (a) -6 (b) h (c) -0.2 c Let u = -1133 + 9063/8. Which is the closest to -4? (a) u (b) -4 (c) -2 (d) 4 b Let v = -398.11 + 398.05. Let k = 0.07 - -2.93. What is the nearest to 1 in k, 0.04, v? 0.04 Let o be (-4)/(-10)(-3)/(-2). Let n = -436802.3 + 436802. What is the nearest to o in n, 0.1, 0.4? 0.4 Let p be 20/7 + -1 - ((-522)/(-21) + -25). Which is the closest to -1.7? (a) 0.01 (b) 6/11 (c) p (d) 0.3 a Let a be 560/(-1953) + (1 - 174/186). What is the nearest to -11 in -1/4, a, 14? -1/4 Let y = 51 - -368. Let j = y + -417. What is the nearest to -1 in 1/2, j, -1/4, 2/11? -1/4 Let g be (-14)/6(-4)/14. Let f be 318/27432 + (14/(-8) - -2). Let h = f - 5/127. Which is the nearest to h? (a) -4 (b) 5 (c) g c Let s(f) = 4f3 - f2 - 2f - 2. Let i be s(-1). Let t = 95.5 - 86. Let u = 9.2 - t. Which is the nearest to 0.2? (a) -0.2 (b) i (c) u a Let l = 7.96 + -9.96. Which is the closest to -1/4? (a) -2/7 (b) -1/6 (c) -16 (d) l a Let o be (18/(-7))/(-9)60/(-48). What is the closest to o in -5, 2/13, -12? 2/13 Let o = 259 - 259.13. Let u = o + 0.04. What is the closest to u in 0.3, 0.2, 0? 0 Let g = 905/2724 + 1/908. Let h = -0.15 + 4.15. What is the nearest to g in 6, -7, h? h Let r = -4291 - -4290. Which is the nearest to 180? (a) -1/3 (b) -1/4 (c) r b Let d = 71135/4 - 17784. What is the closest to -33/2 in 0.5, -2, -3, d? -3 Let k be ((-24)/(-10))/3 - 1. Let q(v) = -v3 - 2v*2 + 5v + 4. Let u be q(-3). Which is the closest to -0.1? (a) k (b) 1 (c) u a Let r = 133/447 - -55/149. Let q = 0.01 - 4.01. What is the closest to 13 in r, q, 2? 2 Let t = 217/36 - 241/36. What is the nearest to t in 4, 5, -73, 2? 2 Let m = 157.02 - 157.08. Let u = -0.2 - -0.2. Which is the nearest to m? (a) u (b) -5 (c) -2/7 a Let d = -2603 - -2603.2. Which is the closest to -1/4? (a) d (b) 0.7 (c) 0.5 a Let y be -3 - (5 + (3 - 5) + -28). Let i be -21(-7 + y/3). Which is the nearest to 5? (a) 5 (b) i (c) 4 (d) -1 a Let f = 0.0143 + -210.0143. Let d = 211.4 + f. What is the nearest to 2/7 in -3, d, -2? d Let p = 1.065 + -1.1. Let t = -0.0579 + 0.0929. Let f = t + p. Which is the closest to -0.1? (a) f (b) 0.4 (c) 0.1 a Let z = 1727 - 1176. Let u = 547 - z. Which is the closest to -1? (a) -2/17 (b) 0.4 (c) -0.2 (d) u c Let m be (5 - (-116)/(-32))/(-4 + (-196)/(-48)). Which is the nearest to m? (a) 1/3 (b) -2 (c) 4 (d) -3 c Let s be 4 + (-6 - 9/(-3)). Let g be (85/30)/((-3)/(-3)). Let n = -5/2 + g. Which is the closest to -2/9? (a) n (b) -0.2 (c) s b Let m be 18/(-68)8/3. Let h = m - -26/85. Which is the closest to h? (a) -0.5 (b) -0.13 (c) -0.4 c Let z = -2.9119 - 0.4881. Which is the closest to -1? (a) -1 (b) z (c) -1/3 (d) 5/4 a Suppose 2y = 3h - h - 36, 0 = h + 5y + 6. Let p be h/(-63) + (-2)/(-9). Let n = 0.087 - 0.187. Which is the closest to -1? (a) n (b) -5 (c) p a Let l = -0.23 - -0.13. Let h = 0 - -3. Let a = -907 + 907.5. What is the nearest to l in 0.2, h, a? 0.2 Let u = -132 - -134. Let z = -7 + u. Which is the nearest to -3? (a) 1/2 (b) -0.1 (c) z c Let y = -3.97226 - 0.02774. Which is the closest to 8? (a) y (b) -3/7 (c) 3 (d) -0.11 c Let h = -679 - -680. Which is the nearest to h? (a) 6 (b) -8 (c) -2 c Let o = 23895.2 + -23895. Let x = -113/320 - 3/64. Which is the nearest to x? (a) 2 (b) o (c) -2/13 c Let x = 0.013 - 29.013. Let z = 14 + x. Let g = 12 + z. Which is the closest to 1? (a) -5 (b) g (c) -4 b Let h be (-90)/(-12)(-10)/(-5). What is the closest to -0.18 in 5, 2/7, h? 2/7 Let r be 9590/(-1225) - -1*8. Which is the closest to -2/7? (a) -2/7 (b	{ "pile_set_name": "DM Mathematics" }
. -5 Suppose -11b - 8b + 127 = 89. Solve bm = -23m - 150 for m. -6 Suppose 4l - 23 = -r, -2r + 5 = 5l - 26. Suppose -3o = u - 50, 0o + 2u = -lo + 83. Solve 5v + o + 3 = 0 for v. -4 Suppose 5387 = 83i + 92i - 7213. Solve i = -17v - 13 for v. -5 Let j(p) = 7p + 16. Let c be j(7). Suppose 12r - c = -17. Solve -rt - t + 15 = 0 for t. 3 Let b be 66 + (18 - 6) - -6. Solve b = 5p + 79 for p. 1 Let k(x) = -20x + 81. Let w be k(4). Suppose w = -2o + 7. Solve 0q - 9 = oq for q. -3 Let p = 30 - 26. Let k be (p/(-12))/(-1)-15. Let g be 13 - (7 + 3)/k. Solve 6f - f = g for f. 3 Let d(z) = 4z - 1. Let h be d(1). Suppose hr - 2j = -6j + 32, -5r + j + 15 = 0. Suppose 6v + 26v + 49v = 0. Solve vn - 2n + r = 0 for n. 2 Let p(j) = -j3 + 8j*2 - 51j + 313. Let y be p(7). Solve -i - 1 = -y for i. 4 Let d = -32 - -34. Suppose 0u + 2u = 5m + 20, 8 = 3u - dm. Suppose r + 3a - a - 2 = 0, 4a + 20 = u. Solve -3v + r = 27 for v. -5 Suppose 199 + 326 = -7q. Suppose 5d + 101 = -264. Let x = d - q. Solve x = 2h + 6 for h. -2 Let u(t) = -6t - 97t3 + 5 - 2t*2 - 4 + 101t*3. Let c(q) = -3q*3 + 3q*2 + 6q. Let y(n) = 3c(n) + 2u(n). Let k be y(6). Solve o = k - 0 for o. 2 Let g(c) = 2c3 + 3c*2 + 2c - 9. Let m be g(4). Let q = 219 - m. Solve q = 2d + 38 for d. 3 Suppose -2z + 516 = -19z + 5616. Solve 49s = -s + z for s. 6 Let w(o) = -o*2 - 19o + 132. Let k be w(-24). Solve -kb = 7 + 5 for b. -1 Let b(g) = -g3 - 11g*2 + 13g + 11. Let f be b(-12). Let i be (-48)/15f5. Let s be 4 + -8 - ((-6 - -3) + -1). Solve su = -4u - i for u. -4 Suppose -22b + 361 = -1596 + 263. Solve 4a = 65 - b for a. -3 Suppose k - 3m = -19, 2k = 6k - 5m + 41. Let w be 20/7 + -3 + k/(-28). Suppose w = -g + 4x - 8, -4g + 2x = -0g + 4. Solve gt = 2t - 10 for t. 5 Suppose -45z + 33z + 324 = 0. Suppose -8 = -28h + zh. Let k = 8 + -8. Solve k = -10b + hb - 2 for b. -1 Let q = 2608 + -2447. Solve 15z + q - 266 = 0 for z. 7 Let b(j) = -j3 - 8j*2 + 6j - 22. Let y be b(-9). Suppose -4c - 58 = -2h, -h + 4c + 23 = yc. Solve h = v + 4v for v. 5 Suppose 0 = 2d + 5b - 55, -4d - 2b = -6b - 68. Suppose -15a + da - 20 = 0. Suppose 40 = v + av. Solve v = -3k - k for k. -2 Suppose -96w + 420 = -9 + 45. Solve 3u + w = u for u. -2 Let d(a) be the second derivative of -31a3/6 - 85a*2/2 - 119a. Let c be d(-3). Solve -6v = -4v + c for v. -4 Let s = 53 + -50. Suppose -sb - 72 = -6. Let h = 37 + b. Solve -h = -0p + 5p for p. -3 Let g be (-225)/12550/(-4)8. Solve 41q = 57 - g for q. -3 Let t = 353 + -354. Let h(q) = 20q2 - 1. Let r be h(t). Solve 0 = -2i + r - 17 for i. 1 Suppose 8v - 20 = 4v. Let f = 100 + -98. Suppose fc + 5 = -0c - 3x, -vc - 2x = -15. Solve c + 0 = -5k for k. -1 Suppose -18j - 2430 = -13j. Let t = j + 492. Solve -17x + 11 = -tx for x. 1 Suppose -105p = 5l - 110p - 45, p - 15 = -3l. Solve -538b = -540b - l for b. -3 Suppose 0 = 2f + 3f. Suppose 0 = 1010s - 1396s + 5018. Solve f = -sa + 3a - 50 for a. -5 Let i(h) = 6h2 + 66h + 3. Suppose -176 = 19f + 33. Let a be i(f). Solve 2b + 1 - a = 0 for b. 1 Let q(w) be the second derivative of w*3/6 - 3w*2/2 - 11w. Let d be q(10). Solve -5o + d - 17 = 0 for o. -2 Suppose -5k - 8 = 7. Let g be (2 - (-7)/k)-36. Let i be 20/2 + g/(-4) + -3. Solve if = -0f - 12 for f. -3 Suppose t = 3f, 2f + 862 = -3t + 895. Solve -t = -3w - 30 for w. -7 Let y = -389 + 405. Suppose 0 = 3n - y + 10. Solve -k = nk for k. 0 Let j be 1332/108 - 4/(-6). Solve 7w + j = 13 for w. 0 Let r be (2 - -1)(-3 - 40/(-6)). Suppose -r = -5i + 14. Suppose -17 = -4w - 4h + h, -2w + 3h = i. Solve 2n = -2 - w for n. -2 Let l(u) = -200u - 10076. Let a be l(-52). Solve 268 = -7w + a for w. 8 Suppose 4r - 17 = -i, 5i + 5r = 9i - 5. Let k be 4/(-6)(41 + (3 - i)). Let p = k + 38. Solve -z = 2z - p for z. 4 Let j be 855/513 + ((-20)/(-6) - -1 - -3). Solve jd + 1002 = 1056 for d. 6 Let x be ((-16)/(-4))/84. Suppose -5a - 3g = -9, 5 = -xa + g + 2. Solve -3z + az = -12 for z. 4 Let m be (0 + 8/(-6))/((-2)/411). Suppose 82 = g + m. Let p be (1/3)/((-4)/g1). Solve -a = -5a + p for a. 4 Suppose 4b - 36 = -0u + u, 4b - 36 = -3u. Let h(n) = -bn + 7n*3 + 3 + 0n*2 - 8n*3 - 3n*2 - 7n*2. Let j be h(-9). Solve 2m = -jm for m. 0 Let y be (-6)/342/(-28). Suppose -4w - yd + 20 = -d, 3w + 5d - 22 = 0. Solve 2f + 10 = wf for f. 5 Let z(k) = k*3 + 7k*2 - 11k - 23. Let y be z(-8). Suppose -y - 8 = -3r. Solve rv = 9 - 3 for v. 2 Let w(a) = -3a - 4a - 3 - 14 - a. Let s be w(6). Let b = s - -65. Solve 0 = 4f - bf for f. 0 Suppose -2r + 12 + 48 = 0. Let d = r + -26. Suppose 3y = 2x + 7, 0 = -5y + x + dx + 5. Solve 6o - o = y for o. 1 Let m be 14/(-3)-3 + -2. Suppose p = 3n - 30 + 69, n - 22 = -2p. Solve -pb = -mb - 9 for b. 3 Suppose -7i + 18 = 2i. Suppose -24 = -a + 5r, 3a - 4r - 28 = -0a. Suppose 3z = -5p + 2, 2p = 4p - iz - a. Solve p = -h - 1 for h. -2 Suppose -4o - 5w - 220 = 0, -2o - o + 3w = 138. Let f be (o/40)/(2/(-8)). Suppose 0 = i - f, 3y + 2i - 12 = 2y. Solve -y - 2 = 4q for q. -1 Let n(z) = 49 - 406 - 43z + 127 + 40. Let t be n(-5). Solve t = -13y + 18y for y. 5 Let y = -47 + 49. Let r(n) = 9n - 2. Let l(j) = -4j + 1. Let p(z) = 7l(z) + 3r(z). Let b be p(-1). Solve -y = bw - 0 for w. -1 Suppose -2c - c = -12. Let t be -2 + 3 + -13(3 - c). Suppose -19 + t = -w. Solve -wl = -5 - 0 for l. 1 Let x be (-8)/(-12) + 1-4 + 140/42. Solve 0u - 13u + 104 = x for u. 8 Let w(z) = -41z + 267. Let g be w(5). Solve 60t - 6 = gt for t. -3 Suppose -2g = -5g + 21. Suppose 14 = -gz + 35. Solve 3q - 12 + z = 0 for q. 3 Let d(m) = -m3 + 6m*2 + 205m - 416. Let h be d(2). Solve 27 = -hw - 3 for w. -3 Suppose 72 = 9h - 0. Suppose -12n = -hn - 48. Solve l + 2l - n = 0 for l. 4 Let b(z) = 2z*2 - 2z + 1. Let g be b(1). Let r = 30 + -17. Suppose -26 = -2q - 3u, -16q - q - 3u = -86. Solve -r + g = -qw for w. 3 Let l(d) = d2 - 8d - 8. Let m be l(0). Let t be 0/(-2) + 12 + m. Solve 8 = tp - 4 for p. 3 Let f be 6/4(3 + -1). Suppose 6l - 5 = a + 8l, -3l = -fa + 12. Solve c + a = 2 for c. 1 Suppose 4b - 24 = 2h, -b - 3h = 4b - 19. Suppose 2i - 5 = ba, 4i - 3a = 2i + 3. Suppose -4m = -im. Solve m = -2k + 4 + 2 for k. 3 Let l be (-4 - -8)5/4. Suppose z - 5d + d = 18, 15 = 5d. Let q = 30 - z. Solve q = lu - 4u + 1 for u. -1 Let i be 0/((89/90)/((-2)/5)). Solve i = -46p + 8p - 190 for p. -5 Let g(o) = -6o2 + 36o + 32. Let y(q) = -q*2 + q + 1. Let i(n) = -g(n) + 8y(n). Let x be i(-13). Solve 5k + 27 = x for k. -5 Let i(l) = 14 + 10l - 34l3 + 0l + 33l3 + l2. Let c be i(-2). Solve cj + 13 + 5 = 0 for j. -3 Let v = 727 + -715. Let w be (-14)/(-21)v/(-16)-12. Solve -wc + 3c = 15 for c. -5 Let g = 21241 + -21241. Solve 18h - 43 - 11 = g for h. 3 Suppose -43u - 1 + 8 = 7. Solve -50y + 78y = u for y. 0 Let z(g) = g*2 + 4 - 23 + 9 - 7g - 23. Let k be z(11). Let n = k + -7. Solve 0y - ny = 20 for y. -5 Let k = 433 + -385. Solve 0 = -8x - 64 + k for x. -2 Let l(k) = -2k*3 + 3k*2 + 3k + 14. Let g be l(4). Let t be (-5 - -2)(g + 52). Solve t = 54a - 52a for a. 3 Let f = -46 + 55. Suppose 0 = -5l + fl - 12. Suppose lt = 1 + 74. Solve 5k + 5 = t for k. 4 Suppose 3y - r - 70 = 0, 56 = -5y - 2r + 180. Solve 11a = y - 68 for a. -4 Suppose 15 = 2t + t. Suppose tr - 22 = -j - 7, 2r - 52 = -5j. Let g = -6 + j. Solve -3d + gd = 4 for d. 4 Suppose -7g - 33 - 30 = 0. Let p(x) = -8x - 61. Let u be p(g). Solve uy - 6y = -15 for y. -3 Suppose -n + 425 = 5g, -5n = -5g + 122 + 303. Solve 0 = 22a - ga + 378 for a. 6 Suppose -j + 2195 = 2d, 1 = 5j + 26. Let t be d/90 - 1 - 2/9. Solve 1 = -ts - 10 for s. -1 Suppose -5x + 25 = 5m, 10x - 13x - 5 = -m. Let f(g) = g3 + 17g*2 + 13g - 39. Let d be -48-11/(-2). Let z be f(d). Solve x = -3w + z for w. 3 Suppose -5o - 41 = -41. Let f be 0 + 1 - (3 - 0). Let s be (-4)/(-24) - f/(-12). Solve -a + oa = s for a. 0 Let j be 4/6 + (-20)/(-6). Suppose -15 = 196f - 191f. Let d be (f + (-20)/(-12))(-3)/2. Solve -3z + j = -d for z. 2 Suppose 5*o	{ "pile_set_name": "DM Mathematics" }
What comes next: 4977926, 4977978, 4978030, 4978082, 4978134? 4978186 What comes next: 4937, 19481, 43135, 75419, 115853? 163957 What is next in 112, 540, 1280, 2332, 3696, 5372? 7360 What is the next term in 17904, 16647, 15416, 14223, 13080, 11999? 10992 What is next in 25785233, 51570460, 77355683, 103140902, 128926117, 154711328? 180496535 What comes next: -645, -1899, -3963, -6837? -10521 What is the next term in -21153, -23665, -26179, -28695, -31213, -33733, -36255? -38779 What comes next: -447, -672, -1083, -1674, -2439, -3372, -4467? -5718 What comes next: -256554, -1026284, -2309166, -4105200, -6414386? -9236724 What is next in -1032, -3905, -8270, -13779, -20084, -26837, -33690, -40295? -46304 What is the next term in 422344, 422007, 421670, 421333, 420996? 420659 What is next in -481621739, -963243480, -1444865221, -1926486962, -2408108703? -2889730444 What is next in 2870, 10759, 22560, 37169, 53482, 70395, 86804, 101605? 113694 What comes next: 56470, 57736, 59862, 62860, 66742? 71520 What is next in -22482, -90324, -203522, -362064, -565938, -815132, -1109634, -1449432? -1834514 What is next in 41287, 82628, 124005, 165418, 206867? 248352 What comes next: -11569, -22914, -34259, -45604, -56949, -68294? -79639 What comes next: 9, 138, 379, 750, 1269, 1954, 2823, 3894? 5185 What is next in 2817092, 2817114, 2817138, 2817164, 2817192? 2817222 What is the next term in -464811, -464858, -464943, -465078, -465275? -465546 What comes next: -4613, -4634, -4655, -4676, -4697, -4718? -4739 What comes next: 1391, 1570, 1897, 2372, 2995, 3766, 4685? 5752 What is the next term in -67510298, -67510311, -67510332, -67510361, -67510398? -67510443 What is next in -933, -7172, -24091, -57030, -111329? -192328 What comes next: -1638, -3925, -6206, -8481? -10750 What comes next: -175425, -701394, -1578003, -2805246, -4383117, -6311610? -8590719 What is next in 3015, 5823, 8741, 11769? 14907 What is the next term in -14726326, -29452581, -44178832, -58905079, -73631322? -88357561 What is the next term in -1505, -8003, -24471, -55895, -107261, -183555, -289763, -430871? -611865 What comes next: -20314507, -20314509, -20314513, -20314519, -20314527, -20314537, -20314549? -20314563 What is the next term in 2655006, 5310010, 7965010, 10620006, 13274998, 15929986? 18584970 What comes next: -236375, -472707, -709035, -945353, -1181655? -1417935 What comes next: 11517, 45278, 101525, 180258? 281477 What is the next term in 17965, 71809, 161543, 287167, 448681, 646085, 879379? 1148563 What is the next term in 5941, 11953, 18093, 24421, 30997, 37881? 45133 What comes next: -17225, -34686, -52385, -70322, -88497, -106910, -125561? -144450 What is the next term in -7028, -13943, -20854, -27761, -34664, -41563? -48458 What is the next term in -645923, -5167349, -17439789, -41338751, -80739743? -139518273 What comes next: -36120, -73785, -112992, -153741, -196032, -239865, -285240? -332157 What is next in 35447, 54973, 74499, 94025, 113551, 133077? 152603 What is next in -6988658, -6988656, -6988652, -6988646, -6988638, -6988628? -6988616 What is the next term in -20222, -80325, -180498, -320741, -501054, -721437, -981890? -1282413 What is the next term in 43437, 187774, 428335, 765120, 1198129, 1727362, 2352819? 3074500 What comes next: -54, -2254, -8438, -20598, -40726, -70814? -112854 What is the next term in -307, -652, -1151, -1816, -2659, -3692, -4927? -6376 What is the next term in 6791, 44894, 148299, 349658, 681623? 1176846 What is next in -96, -25, 254, 867, 1940, 3599, 5970? 9179 What comes next: -207371, -414761, -622159, -829565, -1036979? -1244401 What comes next: -8307, -8058, -7867, -7740, -7683, -7702, -7803? -7992 What comes next: -4859, -10279, -15709, -21155, -26623, -32119? -37649 What is the next term in 6026326, 12052648, 18078970, 24105292, 30131614? 36157936 What is next in -117829, -117705, -117581? -117457 What is next in -7476928, -29907705, -67292332, -119630809, -186923136, -269169313, -366369340? -478523217 What is next in 120603, 241230, 361857, 482484, 603111? 723738 What is the next term in 23093, 92318, 207689, 369206, 576869, 830678? 1130633 What comes next: 1659869, 1659876, 1659879, 1659878, 1659873, 1659864, 1659851? 1659834 What is next in 195637671, 195637669, 195637667, 195637665? 195637663 What is the next term in 154218, 163881, 173556, 183249, 192966, 202713, 212496? 222321 What is the next term in -1847348, -1847370, -1847408, -1847462, -1847532, -1847618, -1847720? -1847838 What is next in -262626380, -262626379, -262626378? -262626377 What is the next term in -523, -696, -1045, -1582, -2319, -3268, -4441, -5850? -7507 What is the next term in -586337, -586278, -586181, -586046, -585873, -585662, -585413? -585126 What comes next: 1807371, 1807374, 1807377, 1807380, 1807383? 1807386 What is next in 320790, 641577, 962364, 1283151, 1603938? 1924725 What comes next: -36111, -72310, -108525, -144762, -181027? -217326 What is next in -176453, -705711, -1587809, -2822747, -4410525, -6351143? -8644601 What is next in -13081539, -26163077, -39244615? -52326153 What is next in -4320837, -4320834, -4320837, -4320852, -4320885, -4320942, -4321029, -4321152? -4321317 What is the next term in 11325443, 11325416, 11325373, 11325314, 11325239? 11325148 What is the next term in 53979, 215324, 484261, 860790, 1344911, 1936624? 2635929 What is next in -1195153, -4780611, -10756383, -19122475, -29878893? -43025643 What comes next: -727, 192, 1233, 2396, 3681, 5088? 6617 What is next in -1184, -1937, -3054, -4535, -6380, -8589? -11162 What comes next: -5138, -40982, -138236, -327596, -639758, -1105418, -1755272, -2620016? -3730346 What is the next term in -2925, -5691, -8445, -11187, -13917? -16635 What is next in 119463, 119475, 119495, 119529, 119583? 119663 What comes next: 127844251, 127844254, 127844259, 127844266, 127844275, 127844286? 127844299 What comes next: -11848375, -23696752, -35545127, -47393500, -59241871? -71090240 What is the next term in 2281548, 9126068, 20533608, 36504174, 57037772? 82134408 What is the next term in 90654, 90843, 91120, 91455, 91818, 92179? 92508 What is the next term in 37313, 38119, 38925? 39731 What is the next term in -5158, -12441, -23974, -41881, -68286, -105313, -155086? -219729 What comes next: -3035, -12145, -27339, -48623, -76003, -109485, -149075? -194779 What comes next: 10631, 36418, 77365, 133472, 204739, 291166? 392753 What is the next term in 3009377, 6018757, 9028137? 12037517 What is next in -35574, -35589, -35602, -35613, -35622, -35629? -35634 What comes next: -29378718, -29378719, -29378720, -29378721, -29378722? -29378723 What comes next: 409, 1423, 2857, 4711, 6985? 9679 What is next in 565, 2368, 5413, 9706, 15253, 22060, 30133, 39478? 50101 What comes next: 741680, 741430, 741180? 740930 What comes next: -1403187, -2806375, -4209563, -5612751, -7015939? -8419127 What comes next: 179, 3374, 8681, 16100, 25631, 37274? 51029 What is next in -199078, -198520, -197962, -197404? -196846 What comes next: 153989, 154000, 154011, 154022, 154033, 154044? 154055 What is the next term in 1349, 3292, 5239, 7190, 9145, 11104, 13067? 15034 What is next in 40636, 78869, 117102, 155335? 193568 What comes next: -32370, -129592, -291632, -518490, -810166, -1166660, -1587972? -2074102 What is the next term in 18829, 37678, 56589, 75592, 94717, 113994? 133453 What comes next: 462, 1035, 1706, 2469, 3318, 4247? 5250 What is the next term in -83507, -160528, -237551, -314576, -391603, -468632, -545663? -622696 What is next in 2203541, 2203539, 2203539, 2203541? 2203545 What is next in 116123, 116062, 116013, 115976? 115951 What is next in -126325422, -252650845, -378976268, -505301691? -631627114 What is the next term in -294377, -294376, -294375, -294374? -294373 What comes next: -3379418, -13517758, -30414992, -54071120? -84486142 What is the next term in -151788, -147582, -143376? -139170 What comes next: -113895, -119135, -124373, -129609, -134843, -140075, -145305? -150533 What is the next term in -150, -2076, -7332, -17592, -34530, -59820, -95136, -142152? -202542 What is next in 281963, 563920, 845877? 1127834 What is the next term in 252, 264, 260, 228, 156, 32? -156 What comes next	{ "pile_set_name": "DM Mathematics" }
2). Suppose 5o + l - 6 - i = 0, 3 = o - 5l. Suppose 2b - o = 3. Calculate v(b). -2 Let o(v) = 22v - 17v - 2v2 - 5 - 2 + 5. Let h(t) = t3 - 2t2 - 2t. Let f be (2 - (2 - 1))3. Let i be h(f). Calculate o(i). -5 Let k(g) be the first derivative of g2/2 - g - 1. Let s = -25 - -19. Determine k(s). -7 Suppose 0 = -4i + 2j - 24, -2i - 11 = 4j + 1. Let z(t) be the third derivative of t6/120 + t5/12 - 5t4/24 - t3/3 - 4t2. Calculate z(i). -8 Let k(i) = 1 - 5 - 3 + 4. Let p(z) = -z2 - 11z - 23. Let d be p(-6). Let r(n) = n - 8. Let l(h) = dk(h) - 2r(h). Calculate l(4). -13 Let v(b) = 18 - 10b2 - 5 - 21b + 11b2 + 30. Give v(19). 5 Let b(m) = -4m*3 - 5m*2 + 2m + 5. Let z(i) = i3 + i2 - 1. Let l(f) = -b(f) - 3z(f). Suppose 2j - 7 = 11. Let o = 6 - j. Determine l(o). -5 Let n(i) = 2i - 1. Suppose -7c - 20 = -34. Give n(c). 3 Let k(l) = 4l + 4l - l. Let w = 38 - 36. Suppose -wf - 4x = -2, 0 = -f + 3f - 5x - 2. Determine k(f). 7 Let x(q) = -q*3 + 4q*2 - q - 2. Suppose 3i - 15 + 6 = 0. Let c be x(i). Let o(l) = cl + 2l*2 + 2l2 + 5 - l2 - 4l2. Give o(4). 5 Let h(d) = -d3 + 268 + 2d*3 - 267 - 4d*2. What is h(5)? 26 Let j(p) = 20p*2 - p. Suppose -5g + 175 = i, 2g - 4i - 97 = i. Let f = 37 - g. Determine j(f). 19 Let q(j) = j*2 - 12j + 1. Let c(r) = 2r2 - 22r. Let b(d) = -3c(d) + 5q(d). What is b(5)? 10 Let f(o) = 9o + 1. Let s be f(1). Suppose 5z - 44 = -9. Let t = s - z. Let l(x) = x*3 - 3x*2 + 2. Calculate l(t). 2 Let n(y) = -19y*3 + 2y*3 + 9y*3 - 2y*2 + 2y + 9y3. Give n(2). 4 Let m(u) be the third derivative of u6/360 + u5/30 - 17u*4/24 + 9u*2. Let i(n) be the second derivative of m(n). What is i(-3)? -2 Let z(r) = 8r + 11. Let x(f) = -17f - 23. Let c(v) = 6x(v) + 13z(v). What is c(-5)? -5 Suppose -32m + 36m = 8. Let b(s) = 7 - s + 0s + s*m - s - 6s. Determine b(5). -8 Let z(l) = 24l - 7. Let p(v) = -11v + 3. Let s(t) = 13p(t) + 6z(t). What is s(11)? 8 Suppose -3p + 16 = 6z - 8z, 0 = -5z - p - 40. Let o(b) = -b*3 - 9b*2 - 9b - 9. Determine o(z). -1 Let o(d) = 34d2 - 5d*2 - 17 + 12d - 8d2 - 9d*2 - 13d*2. Determine o(10). 3 Let y be (30/105)/(-42/(-224)). Let i(t) = t - 11. What is i(y)? -3 Let i(l) = -2l + 7. Let d(b) = -2b*2 + 17b - 15. Let m be d(8). Give i(m). 21 Let a(h) = -h*3 + 8h*2 + 9h + 2. Let l be a(9). Suppose -lj - 33 + 39 = 0. Let r(t) = 2t*2 - 3t + 2. What is r(j)? 11 Let k(m) = -m - 4. Suppose -12 = -g - g - 2l, -5l + 21 = 2g. What is k(g)? -7 Let a(i) = 0i - 2 + 10i2 - 8i*2 - 2i + 5i2. Let v(l) = 217l*2 - 63l - 63. Let g(h) = 63a(h) - 2v(h). Calculate g(1). 7 Let s(t) = -t*2 + 4t + 4. Let i = 51 - 52. Let r(c) be the second derivative of -7c3/6 - c2/2 + c. Let g be r(i). Give s(g). -8 Let w(t) = -t2 + 7t + 9. Let p be 3(0 - (-3)/(-6))-6. Determine w(p). -9 Suppose 2j = j + 4. Let p be 0 + (-4 + 0)/(-2). Let a(m) = 2m + m*2 + jm*p - 2m2. Calculate a(-2). 8 Let t(j) be the second derivative of -j4/6 + 17j3/6 - 9j*2/2 + 2j - 4. Determine t(8). -1 Let o(k) be the third derivative of k5/60 + k4/3 - k*3/3 - 16k2. Let f(p) be the first derivative of o(p). Give f(-7). -6 Let r(o) be the third derivative of -o4/24 - 3o3/2 - 16o*2. What is r(-10)? 1 Let y(d) = 7d*2 - d + 7. Let m(z) = -9z*2 - 7. Let s(q) = -4m(q) - 5y(q). Let h = 2 - 2. Let t be 0 + h + 2 - 8. Calculate s(t). -1 Let x(i) = -i3 - 7i*2 - 4i + 5. Let b(u) = 2u - 10. Let y be b(7). Suppose 3a - 5 = -4f, -2a = -y - 2. Let z be (-6 - 0) + 0/f. Calculate x(z). -7 Let r be (-11/3)/(18/(-9)). Let h(o) be the second derivative of -ro*3 - 9/2o*2 - o + 0. What is h(-6)? -3 Let f = -11 + 12. Let y(l) = 3 + 11l + 7 - 1 - 8. Give y(f). 12 Suppose -4l - 77 = 5r, l - 20 = -r - 38. Let k(a) = -4a + 4. Calculate k(l). 56 Let b(g) = g2 + 15g - 11. Let c(q) = -4q + 4. Let x(k) = -b(k) - 3c(k). Let i = 3 + 9. Suppose 5w = w - i. Determine x(w). -1 Let v(f) = -28f + f*2 + 27f - 4 + 0 + 2. Determine v(-2). 4 Let z(a) = a*2 + a. Let n = 44 + -44. Suppose 3j + 15 = 5d + 2, -j - 4d + 7 = n. Determine z(j). 0 Let c = -7 - -7. Let s(k) = c - 4 + 3. Let z(q) = q + 6. Let a(d) = 5s(d) + z(d). Give a(-6). -5 Let h(r) = -r3 + 5r*2 - 5r + 4. Let d be (76/(-8) - -9) + (-2)/(-4). Suppose d = -5k - 51 + 76. What is h(k)? -21 Suppose -5f - 400 = -m - 2m, 2f + 181 = -3m. Let b = 83 + f. Let c(q) = -q2 - q. What is c(b)? 0 Let p(r) be the third derivative of r6/120 + r5/60 - r4/12 + r3/3 + 165r*2. Give p(-3). -10 Suppose 1 + 1 = -2t. Let k be t/(-3) + (-136)/(-24). Let u(m) = m*3 - 7m*2 + 6m - 6. What is u(k)? -6 Let k(z) = 16 - 4 - 5 + 14z - 17 - 6z. Give k(7). 46 Suppose -4p + o = -15, p + 10o = 8o + 15. Let z(a) = a2 + a + 1. Let c(w) = 2w*2 + 7w + 8. Let x(j) = c(j) - 3z(j). Calculate x(p). 0 Let s(z) be the second derivative of -z3/3 - 5z*2/2 + 165z. Determine s(4). -13 Let i(f) be the third derivative of 3f2 + 0f + 1/30f5 + 0 + 0f*4 + 0f*3. Determine i(-2). 8 Let z(q) = 19q*2 - 14q - 16. Let i(l) = 22l2 - 16l - 16. Let b(t) = -6i(t) + 7z(t). Determine b(5). -1 Let z(h) = -6 + 6h + 4 - 4h. Let j be (-1 + 0)/(6/(-24)). Suppose 5u - w = -15, 3w = ju + u + 25. Determine z(u). -6 Let s(m) = 2m - 41. Let d(y) = 2y3 - 6y*2 - 17y + 4. Let r be d(5). Give s(r). -3 Let h(m) = -18m2 - 9m + 4. Let r(y) = 3y2 + y - 1. Let q(a) = h(a) + 7r(a). Determine q(3). 18 Let p(j) = -11j3 - 5j*2 - 23j + 12. Let w(k) = 9k3 + 4k*2 + 20k - 11. Let c(y) = 5p(y) + 6w(y). Determine c(3). -27 Let r = 26 - 14. Let k(l) = -8 + 5l + l3 + 3l + 9l + 7l*2 - rl. Give k(-6). -2 Let s(m) = 2m2 - m - 1. Let c = 8 - 19. Let i be (c - -1)/5 + 0. Give s(i). 9 Let c(d) be the first derivative of -d3/3 + 5d*2/2 - 6d + 83. Give c(5). -6 Let n(h) be the third derivative of h4/8 + h3/2 + 3h2. Let t be n(-3). Let g(v) = -4 + 6 + 2v + 2. What is g(t)? -8 Let s(b) = -b*3 - 3b*2 + 5b - 3. Let a(l) = l*3 + 2l*2 - 8l + 3. Let z be a(-4). Suppose 4g + k + 11 = 2g, -zg = 4k + 24. Calculate s(g). -7 Let z(t) be the second derivative of -2t3/3 - 21t*2/2 + 13t. Let j be z(-6). Suppose -2s = -15 + j. Let k(i) = -i2 + 8i - 5. Determine k(s). 7 Let d(r) be the second derivative of -r3/6 + r2/2 + 3r + 694. Suppose 5l - 4o - 9 = 0, -2l - 6 = -5o + 4. Give d(l). -4 Let z(k) = k2 - 13k + 14. Let q be z(12). Suppose -5n - 30 = 2c, 5c = qn - 0n - 17. Let w(l) = -2l - 6. What is w(n)? 2 Let l(y) be the second derivative of -2y2 + 0 - 1/12y*4 + 22y + y*3. Calculate l(5). 1 Let k be 3/7 - (76/7)/2. Let m(b) = 3b2 - b3 - 6b2 + 4 - 5b*2 - 5b + 2b2. Determine m(k). 4 Let h(l) = 5l. Let f(v) = v*2 + 9v - 7. Let d be f(-10). Suppose dq + 46 = 43. Determine h(q). -5 Suppose -2f + 12 = f. Suppose fj - 17 = n, -3n + 2n = 3j - 11. Let m(k) = -4k + 0k - 1 + 3k + jk. Give m(-1). -4 Let a(g) = 2g3 - g + 10466 - 10470 - 2g2 + g2. Determine a(3). 38 Suppose -36 = -94h + 82h. Let m(r) = -r*2 + 3r + 1. Determine m(h). 1 Let u(v) = 5v2 - 2v - 8. Let q(n) = 8n2 - 2n - 16. Let k(p) = -3q(p) + 5u(p). Calculate k(7). 29 Let n(q) = -q*3 + 7q*2 - 5q + 6. Suppose -28p - 30 + 170 = 0. What is n(p)? 31 Suppose -83k = -105k + 44. Let n = -7 - -2. Let p(h) = h3 + 2h*2 + 2h + 6. Let z(d) = -d3 - d2 - 2d - 5. Let m(b) = nz(b) - 4p(b). Give m(k). 1 Let w(y) = 5y2 - y2 + 7y - 5 - 5y2. Let c = -78 + -18. Let g be (-4)/12 + c/(-18). What is w(g)? 5 Let c(x) = -x3 - 6x2 - x - 5. Let g be c(-6). Let i(f) = -4f + 2f + g + 3f. Give i(3). 4 Let s(a) be the first derivative of 5/2a2 - 14 - 3a. Give s(2). 7 Let z = 425 + -429. Let n(k) = -2k2 - 4k - 6. Give n(z). -22 Let s(m) = -m. Let f(z) = z*3 + 4z*2 + 2z + 1. Let c be f(-3). Let b = 8 - c. Let i = b - 3. What is s(i)? -1 Suppose -4f + 4 = -4j - 9f, 2j + 4 = -3f. Suppose -r + j + 2 = 0. Let o(w) = -2w - 6. Give o(r). -18 Let a(k) = -k - 2. Let d = 2 + -27. Let j = d + 21. Give a(j). 2 Suppose 11v - 6v - 10 = 0. Let d(b) = 3 - vb + 0b + b - 2*b	{ "pile_set_name": "DM Mathematics" }
rd biggest value? (a) s (b) z (c) -1 (d) 0.4 a Suppose u = -4v - 24, 4u = 2v - 6 - 0. Let h = -1.4516 - -1.7516. What is the second smallest value in v, h, 1? h Let c = -1105.32 - -1105.4. Let m be (-2)/(-4)(-4)/(-6). What is the third smallest value in 3/2, c, m, 5? 3/2 Let k = -0.0329 - 291.9671. Let l = 288 + k. Which is the third smallest value? (a) l (b) 0.2 (c) -2/15 b Let u be (-4)/33 + (-1596)/(-406). What is the second biggest value in 3, -35, u? u Let h be (-45)/(-12) - 15/12 - (-30)/(-4). Let t = 1 + -0.5. Which is the second biggest value? (a) t (b) 42 (c) h a Let p = -17815 - -17804. Which is the second smallest value? (a) 30 (b) p (c) 0.3 c Let z = 1.1 - -3.9. Let b = z - 1. Let l be ((-8)/40 + 3/5)/(-2). What is the second biggest value in b, l, 1, 2/11? 1 Suppose -3h - 48 = -5d, -906d + 910d - 4h - 48 = 0. What is the biggest value in -2/43, 5, 3/2, d? d Suppose 5t = -k + 1792, 4t = 7t + k - 1076. Let g = 1298783113/3626535 - 3/241769. Let q = g - t. Which is the second biggest value? (a) q (b) 5/4 (c) -14 a Let a(m) = m3 - 24m*2 + 8m - 185. Let i be a(24). What is the smallest value in 4/7, 3/2, -2/9, i? -2/9 Let q = -1798 + 1797.5. Let t = -8 - -9. Let d = 871/7 + -124. What is the second smallest value in d, t, q? d Let p = -13058 + 13056. Let i = -2 + 1.5. What is the biggest value in 3, p, i, -1/5? 3 Suppose -5d - 16 = -9d. Suppose l - 40 = -d. Let q be (-15)/16(-48)/l. Which is the second biggest value? (a) -5/6 (b) q (c) 1 c Suppose 2w + 5 = 15. Suppose 2o + 0n - wn = -11, 2n - 16 = -5o. Let x = -4.2 - -4. Which is the biggest value? (a) x (b) -10 (c) o c Let i = -2.546 + 2.5. Let o = 0.052 + i. Let u = o - 0.006. Which is the smallest value? (a) u (b) -2/11 (c) -0.5 (d) 0.5 c Let w be (618/(-412))/((-9)/(-4)). What is the second biggest value in 5, -327/4, w? w Suppose 0 = -3f - 71 + 800. Let i = -243 + f. Which is the second biggest value? (a) -4/5 (b) i (c) -0.4 (d) -1 c Let m = 8.56 + -0.61. Let n = m + -7.99. What is the smallest value in -6, -1/2, n, -0.1? -6 Let p = 0.016256 + -2.016256. Let x = 0.5 + -1. Which is the third biggest value? (a) x (b) p (c) 4 b Let r = -487.833 + -0.167. Let i = r + 452. What is the biggest value in i, -3, 1/2? 1/2 Let t = -5.8 - -9.8. Let z(b) = -3b2 - 1. Suppose 15 = -5v - 5x, -4v + x - 3x = 8. Let w be z(v). What is the third biggest value in 0.5, t, w? w Let r = 339/329 + -35/47. Which is the biggest value? (a) 22 (b) 1 (c) r a Let p = -0.021 + 0.321. Let o = 0.34 + -0.34. Let k = -0.8 - -3.8. What is the fourth smallest value in o, k, p, 2? k Let u be ((-10)/(-4) + -3)(1157/221 - 5). Which is the smallest value? (a) u (b) 7 (c) 1/5 (d) 4 a Let s = 0.4 + -0.4. Let v = -172.31 + 168.31. Which is the biggest value? (a) v (b) s (c) 1 c Let z = -0.17 - 6.83. Let j = -0.0427 - -5.0427. What is the second biggest value in j, z, -0.3, -2? -0.3 Let p = -1303/14 + 93. Let i(y) = y*2 + 8y - 34. Let j be i(3). Which is the smallest value? (a) 1/7 (b) p (c) j c Suppose -5i = -l + 14, 3l - 15 = 6l + 4i. Let v = -1599 + 1603. Let b = -0.78 + 0.28. What is the fourth biggest value in b, l, -4, v? -4 Let t = 0.7 - 0.2. Let m = -5737/8607 - 1/8607. Let g = 1873/804 + 1/268. Which is the second biggest value? (a) g (b) t (c) m b Suppose 3f = -31n + 28n - 51, -4n = -f + 63. Let q = n + 44/3. Which is the third smallest value? (a) 1 (b) -4 (c) -0.06 (d) q c Let u = 2897 + -2916. Which is the second biggest value? (a) -3 (b) u (c) -0.4 (d) -0.07 c Let d = 3 + -2. Let f(s) = -10s. Let q be f(1). Let z = -74175/44 - -18552/11. Which is the second smallest value? (a) d (b) q (c) z c Let i = 850573/30 + -28357. Let x = 22/5 + i. What is the third biggest value in 0.1, x, -3? -3 Let b(h) = 75h - 988. Let y be b(12). What is the third smallest value in -8, y, 0? 0 Suppose q - 3 = 3y - 1, 5y - 4q + 15 = 0. Let x be ((-2)/(-3))/y243/(-810). What is the second biggest value in 0.12, -1/4, x, 1/2? 0.12 Let u be (-100)/(-40)8/303/13. Let i = -2.9 - -7.2. Let p = i + -4. What is the second smallest value in 4, p, u? p Let d = -0.481 + -60.519. Let o = d + 61.51. What is the biggest value in 1/6, o, 0.5? o Let u be (-8)/(-24)153. Let l be ((-4)/(-70))/(-2 - u/(-7)). Which is the third smallest value? (a) -0.2 (b) 0.5 (c) -11 (d) l d Let h be (-53)/(-7) - (24 + 1 - 18). What is the second biggest value in 5, h, 21? 5 Let u be (10/(-50))/((14/(-5))/2). Let q = -80 - -56. Let n = q + 24.5. Which is the smallest value? (a) n (b) -2 (c) u b Let j = -72.15 + 75.15. What is the second smallest value in -2, 135, j? j Let w = 575 + -748. Let z = w - -174. Which is the second biggest value? (a) 4 (b) -12 (c) z (d) -4 c Let q = 3/7162 + 7147/35810. What is the biggest value in 3/5, 0, -7.4, q? 3/5 Let g(q) = -2q3 + 10q*2 - 23q + 33. Let m be g(3). Which is the smallest value? (a) -4 (b) -1210 (c) m (d) -3 b Suppose 0 = x + 3o + 6 - 2, 3x - 5o - 16 = 0. Let v = 58560.2 + -58568.2. Let c = 6 - 6.03. What is the second smallest value in c, x, v? c Let p = 5128/128643 + -14/313. What is the second biggest value in 0.5, -0.3, p? p Let j = -3538 + 3538.4. Which is the second smallest value? (a) -0.5 (b) 5 (c) -0.4 (d) -11/2 (e) j a Let z = -3580 - -3580.3. Let m = 2 + 3. What is the third biggest value in z, 0, m? 0 Let d = 0.628 - 0.128. Let j be 5/(-3) + (-2)/(-3). Let b be ((-196)/(-350))/(j/(-5)). What is the second smallest value in d, 2, b? 2 Let f(u) = -30u - 628. Let x be f(-21). Which is the third biggest value? (a) x (b) 17 (c) -2/13 c Let p(m) = m*2 + 32m + 231. Let q be p(-11). Let w = -0.08 + 5.08. Let t = w + -7. Which is the third smallest value? (a) t (b) -2/15 (c) 7 (d) q d Let p = 4049 - 4049. Which is the smallest value? (a) 83 (b) -25 (c) p b Let r = 6091/40 - 762/5. Which is the second smallest value? (a) -3/232 (b) 3 (c) r a Let d = 14 + -33. Let z = -5322.7 + 5303. Let q = z - d. Which is the third biggest value? (a) q (b) 4 (c) -5 c Let w be (176/12)/(-11)((-2)/16 - (-87)/(-24)). Let y = -4 - -1. Let a = 1.5 - 2. What is the biggest value in w, 1/3, y, a? w Let g be (-18)/(-852)(-8)/(-6). Let b = 1/14901 + -14906/74505. What is the third biggest value in b, 1, -1, g? b Suppose 5i - 8 + 6 = -3k, 0 = -5k + 2i + 24. Which is the second smallest value? (a) k (b) 0.08 (c) 0.5 c Let g = 28 - 42. Suppose 290y + 1280 = 19 + 101. Let o be (-18)/(-24) - (-2 - -2). What is the second biggest value in g, o, y? y Let r = -597.4 + 597. Let x = -0.005 - 7.795. Let a = -0.2 + x. What is the smallest value in 0.3, a, r? a Let w = -35116.4 - -35114. Which is the second biggest value? (a) 0.33 (b) w (c) 3/10 c Let t = 525 - 596.1. Let r = -72.1 - t. Let s = -0.4 - -0.2. What is the second smallest value in 0.3, s, r? s Let x = -8.6 - -19.4. Let a = x - 10.6. Let t(m) = -m2 + 4m - 3. Let l be t(3). What is the biggest value in l, a, -0.4? a Let z = -8.21 - -7.21. Suppose 6x + 12 = 3x. What is the second smallest value in x, z, 2, -12? x Suppose -71h = -122h + 765. What is the biggest value in 25, h, 6? 25 Let t = 0.13 - 3.13. Let a(o) = o*3 - 20o*2 + 37o - 23. Let d be a(18). What is the biggest value in -12/7, d, t? -12/7 Let k = 76 - 834/11. What is the second biggest value in 1, -5, k, 0? k Let o = 0.03 + -55.03. Let d = 27 + o. Let q = 28.3 + d. Which is the second smallest value? (a) q (b) -5 (c) 3 a Let z be (-2)/((-18)/(-14) - 1). Let l = 5 - 2. Let h be l - ((-114)/4 - -3)/(-9). What is the smallest value in 0.1, h, z? z Suppose -5v + 20 = 5g, 3v - g - 14 = 10. Let p = 1.8 + -2. Which is the second biggest value? (a) 1 (b) p (c) v (d) -2 a Let l be 2/(-3) + 2401/24. Suppose 3787r = 3818r - 3069. Let y = r - l. What is the fourth smallest value in 0.1, 9, 0, y? 9 Let g = -0.5156 + 2.6026. Let h = g + -0.087. What is the biggest value in 1, h, 8, 3? 8 Let x = -36.4 + 36.5. Suppose -9m + 10 = -4m. Let w be -7 + m/4-1*-2. What is the second smallest value in x, w, -3? -3 Let w be (243/(-2))/((-27)/(-36)). Let y = 161 + w. Which is the biggest value? (a) -0.3 (b) y (c) 4 (d) -10 c Let u = 31.946 + -32. Let l = 0.02	{ "pile_set_name": "DM Mathematics" }
7d2 + 29d - 7. What is 8s(o) - 5z(o)? o3 + o2 + 2o - 6 Let l be (-2 - -202)/(4/8). Let i = l - 402. Let m(q) = -5q + 2. Let j(f) = -f. Give ij(d) + m(d). -3d + 2 Let v(b) = -6b3 + 4b*2 - 3b - 1. Let n(q) = 17q3 - 11q*2 + 8q + 3. Suppose z - 20 = -3x - 33, -3z = -x + 9. Determine zn(d) - 11v(d). -2d3 + d - 1 Let s(j) = j2 + j. Let g(d) = -521d + 1043. Let n be g(2). Let t(o) = -37o2 + 6o. Give nt(b) - 6s(b). -43b2 Let g(h) = -645h*2 - 16h + 6. Let k(c) = 1290c2 + 36c - 13. Determine 9g(u) + 4k(u). -645u2 + 2 Let o(z) = z3 + 29z*2 + 39z + 313. Let t be o(-28). Let f(c) = 2c2 + 4c - 34. Let p(q) = -3q2 - 7q + 68. Determine tf(h) + 3p(h). h2 - h + 34 Let i(k) = k2 - k - 3. Let z be (1/((-30)/(-102)))/(2/10). Suppose u + 5j = z, 0j = -3u - 5j + 11. Let t(h) = h*2 - h - 2. Calculate ut(r) + 2i(r). -r2 + r Let g(q) = q2 - 59q. Let u(v) = 1485v + 1479v + 1482v - 4447v. What is -g(p) + 2u(p)? -p2 + 57p Let t = 3417 - 3418. Let h(c) = -7c. Let x(j) = j + 1. Determine tx(z) + h(z). -8z - 1 Let t(j) = -135j + 12. Let p(a) = -128a + 11. What is -6p(h) + 5t(h)? 93h - 6 Let o(d) = -15d2 - 9d + 7. Let f(k) = k*3 - 8k*2 - 10k + 13. Let w be f(9). Let n(l) = 6l2 + 3 - 14l*2 - 4l + l*2. Determine wo(x) - 9n(x). 3x*2 + 1 Suppose 0i + 16 = -2q + 3i, -5i = -3q - 26. Let b be -1 + -3 + (-9)/2q. Let k(l) = 6l - 5. Let x(o) = 3o - 3. Give bx(g) - 3k(g). -3g Let f(u) = 22085u3 - 10u + 8. Let t(p) = 3666108p3 - 1665p + 1332. What is -333f(w) + 2t(w)? -22089w3 Let s(k) be the third derivative of k5/60 + k4/4 - 1053k*2 - 2k. Let v(t) = 74 - 2t2 - 74 + 17t + 5t2. Calculate -8s(q) + 3v(q). q2 + 3q Let u(q) = -4q - 13. Let f(r) = -5r - 13. Let c be -1 - 2 - (12546/(-1845) + 4/5). Give cf(g) - 4u(g). g + 13 Let t(a) = -a. Suppose -120q + 122q + 12 = 0. Let s be q + 1 - (9 + -13). Let i(o) = -3o - 2. Determine si(f) + 4t(f). -f + 2 Let n(z) be the first derivative of z2/2 - 2z + 24. Let q = 82 + -85. Let c(h) = -h + 1. What is qn(w) - 6c(w)? 3w Let j(t) = -9t + 5. Let k(d) = 543d + 4. Let l(b) = 1360b + 9. Let i(g) = -10k(g) + 4l(g). What is -5i(f) - 4j(f)? -14f Let z be (1 + (-30)/45)42. Let j(r) = -7r2 + 3. Let w(y) = 13y*2 - 7. Determine zj(h) + 6w(h). -20h*2 Suppose 0 = -75p + 71p - 60. Let b(f) = f3 + 2f*2 - 2f - 2. Let r(y) = 5y - 15y*2 - 6y*3 + 2 + 13 - y + 11y. Determine pb(u) - 2r(u). -3u3 Let m(t) = -3t3 - t2 - 3t - 1. Let s(l) = -136l*3 + 8l*2 + 24l + 8. Calculate -40m(a) - 5s(a). 800a3 Let g(n) = 1359n - 1. Let f(q) = 5438q - 5. Determine 2f(t) - 9g(t). -1355t - 1 Let k(r) = -13r - 500. Let v(y) = 15y + 505. Calculate -6k(f) - 5v(f). 3f + 475 Let u(n) = -23950n*2 - 5. Let h(j) = 59870j*2 + 12. Determine -5h(p) - 12u(p). -11950p*2 Let q(i) = -283i*3 - 473i*2 + 74i - 5. Let w(l) = -94l3 - 172l*2 + 25l - 2. Determine 4q(d) - 11w(d). -98d3 + 21d + 2 Let o(r) = -7r3 + 1165r*2 - 578r*2 - 584r*2. Let l(d) = -8d*3 + 3d*2. What is -4l(q) + 5o(q)? -3q*3 + 3q*2 Let j(c) = -175c - 12. Let l(g) = 171g + 10. Determine 3j(h) + 4l(h). 159h + 4 Let o(h) = 103h - 2174. Let s(z) = -59z + 1087. What is 4o(q) + 7s(q)? -q - 1087 Let z(k) = 2k2 - 7k + 1. Let i(o) = -2o2 + 345o - 1 - 259o - 78o. Suppose -3j + 8j = 30. Determine jz(x) + 5i(x). 2x2 - 2x + 1 Let j(s) = 4s. Let u(v) = 5v + 1. Let d(c) = -j(c) + 2u(c). Let h(b) = -6b - 2. Determine -6d(n) - 5h(n). -6n - 2 Let n(f) = f2 - 8f + 7. Let w be (12/(-22) - -2(-468)/(-264)) + -1. Let l(r) = -3r + 2. Suppose 21 = -6x + 3x. Calculate wn(q) + xl(q). 2q2 + 5q Let l(u) = -3u2 + u + 1. Let b = -46 + -7. Let s = b - -55. Let w(h) = -54h*2 + 2 + 41h*s + 5h + 3. Calculate -9l(j) + 2w(j). j2 + j + 1 Let s(h) = h3 + 46h2 - 10h + 11. Let y = 376 - 378. Let v(u) be the second derivative of -3u4/4 + u3/3 - u2 + 65u - 1. Calculate ys(c) - 11v(c). -2c3 + 7c*2 - 2c Let r(m) = 2m2 + 2m. Let u(o) = 4o + 1 + 46o*2 - 114o*2 - 6o + 65o2. Determine -2r(a) - 3u(a). 5a*2 + 2a - 3 Let l(i) = 4260i3 + 5i*2 - 7i + 302. Let a(k) = -1420k3 - 2k*2 + 2k - 86. Determine -7a(p) - 2l(p). 1420p3 + 4p*2 - 2 Let n(u) be the first derivative of 4u3/3 - u2 + u + 859. Let i(a) = -3a2 + 3a - 1. Calculate 4i(z) + 5n(z). 8z2 + 2z + 1 Let y(n) be the second derivative of -10n + 0n*3 + 0n*4 + 1/4n5 + 0 - n2. Let g(a) = -1 - 1914a3 + 1915a*3 + 0. Determine 2g(v) - y(v). -3v3 Let s(a) = 6a*2 + a + 199. Let j(r) = -4r*2 - 192. What is 4j(d) + 3s(d)? 2d*2 + 3d - 171 Let j(y) = -3y - 153. Let w(a) = -2a - 78. Determine 6j(t) - 10w(t). 2t - 138 Suppose -148 + 28 = -5v. Let x = 21 - v. Let p(k) be the third derivative of k4/3 - k3/2 + 11k2. Let j(o) = o - 1. Give xj(u) + p(u). 5u Let j(x) be the first derivative of 11x*2 - 12x + 54. Let p(t) = t - 1. Let b be (-9)/12 - -109/(-360). Calculate bj(d) + 12p(d). -10d Suppose -35x + 89x + 54 = 0. Let c(r) = -r + 1. Let h(g) = -3g3 - g2 + 5g - 5. Give xh(t) - 5c(t). 3t3 + t2 Let t(m) = -49m*2 + 875m - 1. Let c(d) = -139d2 + 2626d - 3. What is 6c(h) - 17t(h)? -h*2 + 881h - 1 Let p(i) = -1104i + 4. Let v(w) = -1108w + 5. What is -6p(r) + 5v(r)? 1084r + 1 Let w(o) = 5o + 894. Let m(v) = 6v + 887. What is -3m(n) + 4w(n)? 2n + 915 Let g(d) = 2400d2 + 12d + 12. Let u(f) = 74404f2 + 374f + 374. Determine -187g(z) + 6u(z). -2376z2 Suppose -9 + 3 = -2w + r, -5r = -3w + 23. Let f be 0 - (16/(-4) + w). Let t(x) = x - 1. Let z(y) = 6y - 5. Determine ft(q) - z(q). -3q + 2 Let i be (75/10 - 6)/((-2)/(-4)). Suppose q - i = -0q. Let p(h) = 6h. Let t(d) = 3d. What is qp(j) - 5t(j)? 3j Let k(d) be the second derivative of d3/2 - 3d*2/2 + 11d. Let u(f) = 3f - 6. Let l(w) = w - 4. Let q(a) = -l(a) + u(a). Give 6k(p) - 10q(p). -2p + 2 Let x = 13 + -10. Let m(y) = -4y + 1. Let i = 4 + -2. Suppose 3d + 4h - 5 = 0, 6h - 3h - 8 = id. Let o(n) = -n + 1. Give dm(p) + xo(p). p + 2 Let c(d) = 2d + 256. Let x(t) = -2t - 261. Give -7c(h) - 6x(h). -2h - 226 Let n(r) = 2r + 6. Let x be (40/(-28))/(5/(-140)). Suppose -5l - x = 4j, 4j = -4l + 2j - 26. Let v(i) = 2i + 7. Give lv(h) + 5n(h). 2h + 2 Let o(u) = -3u + 3. Let v be ((3/4)/((-35)/56))/(94/(-235)). Let b(g) = 9g - 3g - 11 + 4. Calculate vb(s) + 7o(s). -3s Let r(q) = 4q3 + q2 + 8q + 2. Suppose -4j - 28 = 4b, 5j + 30b + 23 = 28b. Let f(w) = 5w3 + 2w*2 + 8w + 3. What is jr(c) + 2f(c)? -2c3 + c2 - 8c Let o(a) = 16a - 16. Let b(u) = -u + 22. Let p(f) = 66f - 1683. Let s(n) = 77b(n) + p(n). Give 5o(v) + 7s(v). 3v - 3 Let s(u) = -u - 1. Suppose 93c - 90c - 55c - 208 = 0. Let q(p) = 8p + 3. Give cs(k) - q(k). -4k + 1 Let s(u) = u + 10. Let l(c) = 14c - 14c + 17c + 11 - 16c. Determine -4l(a) + 5s(a). a + 6 Suppose -4x - 3j + 223 = 0, -4j = -0 - 4. Let z(o) = -x + 13 + 22 + 21. Let l(n) = 5n - 5. What is l(h) + 6z(h)? 5h + 1 Let v(d) = 4640242d + 42208. Let t(p) = -2638p - 24. Calculate -5276t(y) - 3v(y). -2638y Let k(n) = 15n*2 - 58n. Let u(a) = 7a2 - 3a. What is k(c) - 2u(c)? c2 - 52c Let n(q) be the third derivative of q5/20 + q4/8 - q*3/3 - 3274q*2 - 2q - 1. Let f(s) = -2s2 - s + 1. Determine -5f(r) - 3n(r). r2 - 4r + 1 Let q(m) = -318m + 137. Let i(n) = -225n + 139. Determine 4i(j) - 3q(j). 54j + 145 Let n(c) = 7c*3 - 2c*2 - 8c + 1. Let y(f) = -17f3 + 3f*2 + 18f - 2. What is -11n(i) - 5y(i)? 8i3 + 7i*2 - 2i - 1 Let a(p) = -2p2 + p. Let n(o) = o3 - 1033o*2 - 3o. Determine -3a(c) - n(c). -c3 + 1039c*2 Let p(o) = 25o*2 + 8o + 16. Let y(j) = -7j2 - 2j - 5. Calculate 2p(q) + 9y(q). -13q2 - 2q - 13 Let u(t) = -581t2 - t - 17. Let i(f) = -1742f*2 - 2f - 44. Give 3i(x) - 8u(x). -578x2 + 2x + 4 Let k(q) = q. Let b(u) = 7u - 1. Let n be 268/45 + (-74)/(-1665). Calculate nk(d) - b(d). -d + 1 Let j(p) = p + 15. Let t(i) = i + 10.	{ "pile_set_name": "DM Mathematics" }
x(-6). Suppose 7 - 3 = fg. What is the first derivative of b - 3 + g - 2 wrt b? 1 Suppose -v + 32 = 3v. What is the derivative of 6j4 + v - 2 - 1 wrt j? 24j*3 Find the third derivative of 290v*4 - 280v*4 - 10v2 - v2 wrt v. 240v Let u(n) = 3n*4 + 2n*3 + 2n*2 - 2n + 10. Let b(g) = g4 + g3 + g*2 - g. Let y(q) = -4b(q) + 2u(q). Differentiate y(p) wrt p. 8p*3 Suppose -2n = 3n. Suppose n = 2z + z - 9. What is the third derivative of -zk2 - 2k - 2k4 + 2k wrt k? -48k Find the second derivative of 2x*3 - 2x*3 - 7x + 11x - 5x*5 wrt x. -100x*3 What is the third derivative of -6k*2 - 3k*2 - 31k*3 + 31k*3 + 18k*4 wrt k? 432k What is the third derivative of 54w6 - 10w*2 - 28w*6 - 29w*6 wrt w? -360w3 Let x(f) be the third derivative of f7/21 - 3f3/2 + 11f*2. Differentiate x(g) wrt g. 40g*3 Find the first derivative of 341g*3 + 0g*2 - 20 - 351g3 + g2 wrt g. -30g2 + 2g Let s be ((-6)/(-9))/((-1)/(-3)). Let n = 34 - 32. What is the third derivative of 0q3 + 3q2 + qn + q*3 - 2q*s wrt q? 6 Let l(n) be the first derivative of 8n*5/5 - 4n*3/3 + 49n + 67. Differentiate l(c) with respect to c. 32c3 - 8c Let k = -6 + 8. Find the second derivative of 0y - 2y*2 - 5y - ky2 wrt y. -8 Let u = -5 - -5. Let w(b) be the first derivative of 2/3b*3 + ub*2 - 1/4b*4 + 0b - 1. Find the third derivative of w(d) wrt d. -6 Let b(j) be the first derivative of 0j - 2/3j*3 + 3 + 0j*4 - 2/5j*5 + 0j*2. What is the third derivative of b(c) wrt c? -48c Let d be 1/((-1)/(-2) + 0). Suppose 5m = -dx + 36, 18 - 3 = 5m - 5x. Differentiate m - 4 - 3 + 0 - y wrt y. -1 What is the first derivative of 4z + 11z - 30 + 12z wrt z? 27 Let k = -5 - -3. Let h = 4 + k. Find the third derivative of 0f*4 + 0f*4 - 2fh - f5 wrt f. -60f2 Suppose -3p = -6, -2p + 8 = k + p. What is the second derivative of -13 - vk + 13 + 2v wrt v? -2 Let m(l) be the first derivative of -l7/105 - l5/15 + 2l2 - 1. Let w(x) be the second derivative of m(x). What is the third derivative of w(b) wrt b? -48b Let g(x) = 36x2 + 6x + 1. Let w(h) = -h + 1. Let u(l) = -g(l) + w(l). What is the second derivative of u(f) wrt f? -72 Find the first derivative of -17 + 7 + d*3 + 8 wrt d. 3d*2 Let t(c) = 24c2 + 15. Let r(o) = -o2 - 1. Let b(a) = -18r(a) - t(a). Differentiate b(l) with respect to l. -12l Differentiate 1 - 5u - 2u + 3u - 2u wrt u. -6 Let l(s) = -s*2 - 3s + 2. Let m be l(-7). Let z = m + 44. Differentiate 0c + z - 15 + c wrt c. 1 Let x(z) be the first derivative of -4z*6/3 + 4z*3 + 6. Find the third derivative of x(n) wrt n. -480n*2 Suppose 5y - 10y - 20 = 0. Let a(s) = 14s*3 + 5s*2 + 5. Let m(h) = 13h*3 + 4h*2 + 5. Let d(f) = ya(f) + 5m(f). What is the derivative of d(z) wrt z? 27z*2 What is the first derivative of 10 + 4359f + 23f4 - 4359f wrt f? 92f3 Let x(y) = y - 3 - y3 + 1 + 0y. Let g be x(-2). Differentiate 2 + 4 - 3 + l*g - 2l*4 wrt l. -4l3 Let p(x) be the first derivative of -x4/12 - 2x3/3 - 2x + 3. Let a(i) be the first derivative of p(i). What is the second derivative of a(t) wrt t? -2 Suppose -4j - 1 = -3x, j = 4x + 2j - 14. Find the second derivative of f*5 - f + x - f - 3 wrt f. 20f*3 Let u = -9 - -13. Suppose -uq = -15 - 9. Find the third derivative of -17y + 3y*q - 2y*2 + 17y wrt y. 360y3 Let g(h) be the first derivative of 5h*6/3 - 4h*3/3 - 6. What is the third derivative of g(m) wrt m? 600m*2 Let u(z) = 4z - 7. Let q be u(3). What is the third derivative of 2d2 + qd*3 + 0d2 - d3 + 4d2 wrt d? 24 Let c be (-4)/(-14) + 24/14. Suppose -4z + 4 = -2z. What is the second derivative of -ch + h*2 + h - 2h*z wrt h? -2 Let a(c) = 5c*5 + 6c*4 + 11c. Let y(o) = -10o5 - 11o*4 - 21o. Let d(f) = -11a(f) - 6y(f). Find the second derivative of d(x) wrt x. 100x3 Let m(y) be the second derivative of -11y*6/15 - 9y*4/4 - 26y. What is the third derivative of m(u) wrt u? -528u Find the third derivative of -186o*3 - 31o*5 + 186o*3 + 19o*2 wrt o. -1860o2 Let x(t) be the second derivative of -t6/30 - 3t4/4 + 19t*3/6 + 43t. What is the second derivative of x(r) wrt r? -12r2 - 18 Let m(t) be the first derivative of 0t*3 + 2 - 9/2t*2 + 0t*4 + 5/3t*6 + 0t + 0t5. What is the second derivative of m(j) wrt j? 200j3 Let i(j) = -j2 + 7j. Let z(o) = 7o. Let h = -19 + 17. Let s(l) = hz(l) + 3i(l). What is the second derivative of s(n) wrt n? -6 What is the derivative of 5g4 - 136 + 7g4 + g2 + 4g4 + 95 wrt g? 64g*3 + 2g Let v(j) = j*3 + 3j*2 - 4j + 2. Let r be v(-4). Suppose -2m + 4n + 14 = 0, m = n + 3 + r. Differentiate -3o2 + 3o*2 + mo*3 + 3 wrt o. 9o*2 Let v(t) be the third derivative of 0 + 0t - 1/60t5 + 0t*3 + 1/24t*4 + 3t*2. What is the second derivative of v(j) wrt j? -2 Let a(t) = 24t*4 - 19t*2 + 3t. Let f(h) = -23h4 + 18h*2 - 2h. Let d(z) = 2a(z) + 3f(z). What is the third derivative of d(v) wrt v? -504v Find the second derivative of 21o*4 - o - 167o*3 + 167o*3 wrt o. 252o*2 Let p = 22 - 20. What is the second derivative of 5b*2 - 3b*p + b - 9b wrt b? 4 Let f(k) = k*2 - k + 7. Let o be f(0). What is the derivative of -o + 2v - 9 + 9 wrt v? 2 Suppose -19g + 21g = 4. Let q(f) be the second derivative of f + 0 - 1/3f3 + 3/2f*g. Differentiate q(h) with respect to h. -2 Let k = 10 + -6. Find the second derivative of -2n*4 - 25n + 24n + kn*4 wrt n. 24n*2 Suppose -9 = -4m + m. Suppose -x = ms - 8, -3s + 5 = -1. Find the third derivative of -3b2 - 7b*3 + 7b3 + bx + 2b4 wrt b. 48b Suppose 5c - 3f + f = 0, 5c - 5f + 15 = 0. What is the third derivative of -4u2 + 0u*2 + 2u*6 + 5u*c wrt u? 240u*3 Let r(j) = -21j*3 - 79j*2 - 12. Let v(p) = 62p*3 + 236p*2 + 34. Let c(g) = -17r(g) - 6v(g). Find the third derivative of c(b) wrt b. -90 Let r be 4/6 - 44/(-33). What is the third derivative of -5c*3 - 6c*2 - 2c*2 + 16c*r wrt c? -30 Let y(p) = -1. Let l be 232/12. Let q(d) = -3d - 6. Let w(m) = lq(m) - 3y(m). What is the derivative of w(b) wrt b? -3 Let r(j) be the first derivative of -29j5/5 + 33j*2/2 - 30. What is the second derivative of r(a) wrt a? -348a*2 Let v be (-24)/(-56) - (-78)/14. Let n be (-1 + -2)(-4)/6. What is the third derivative of -u*n - 2u*6 + 3u6 + uv wrt u? 240u3 Suppose -5 - 4 = -j. Differentiate -jr + 7 + 0 + 0r - 4 with respect to r. -9 Let h(a) = -19a*4 - 2a*3 - 40a*2 - 2a + 2. Let y(x) = -x*3 - x + 1. Let t(w) = h(w) - 2y(w). Find the third derivative of t(z) wrt z. -456z Let u(w) be the first derivative of -2w6/3 - w3 + 6. Find the third derivative of u(c) wrt c. -240c2 Let j(g) be the second derivative of -g5/10 - 5g*3 + 11g. What is the second derivative of j(m) wrt m? -12m Find the first derivative of 18d + 9d + 28 - 2d wrt d. 25 Let s(z) be the second derivative of 0z3 - 4z + 3/20z5 + 0z*4 + 0 - 3/2z*2. Find the first derivative of s(i) wrt i. 9i*2 What is the third derivative of -39d*2 - 5d*5 + 50d*2 + 17d*5 + 7d*5 wrt d? 1140d*2 Let c(y) = -3y + 2 - 3y2 - 6y*3 + 7y*3 + 3y*2 - 2y*2. Let v be c(3). Find the second derivative of -vi5 - i5 + 2i + 6i*5 wrt i. 60i3 Let l(v) = v2 - 10v + 6. Let z(u) = u2 - 9u + 6. Let x(r) = 2l(r) - 3z(r). Let o be x(6). Differentiate -i*2 + 0i - 1 + oi wrt i. -2i What is the first derivative of -367x3 + 9 + 367x*3 - 27x*4 wrt x? -108x*3 Suppose -3y - 10 = 3i + 2i, i + 5y = -24. Let m(c) = 3c + 1. Let s be m(i). Differentiate -sx + 3 - 4 - 3 with respect to x. -4 Let p = 2 + 0. Let x be 4/p9/6. Differentiate -2 + z*3 - 4z*x - 5 + 5 wrt z. -9z*2 Let w(k) be the first derivative of 23k*4/4 - 22k*3/3 - 8. Find the third derivative of w(p) wrt p. 138 Suppose -j - j = q + 5, -3j + 3q + 15 = 0. What is the second derivative of ju4 - u4 - 4u4 + 3u wrt u? -60u2 What is the derivative of -y4 - 3 - 21 + 9 - 10y*4 wrt y? -44y*3 Let d(s) be the third derivative of 2s*2 + 1/105s	{ "pile_set_name": "DM Mathematics" }
= 36 + -32. Put 2, x, -6 in descending order. x, 2, -6 Suppose -3s = -10s + 7. Let q(t) = -t*3 - 6t*2 + t + 8. Let n be q(-6). Suppose -nm = -3m - 4. Put 5, m, s in increasing order. m, s, 5 Let k = 0 + -4. Let t = 5 + k. Let f = -1 - -6. Sort f, 0, t in decreasing order. f, t, 0 Let b = -3 - -2.94. Let u = 0.46 + b. Put -2/9, u, 1/3 in decreasing order. u, 1/3, -2/9 Let j = -14 + 15. Put j, -2/7, -2 in descending order. j, -2/7, -2 Let x = 4 + -3. Suppose -3a = w - 1, 7a - 4a = 3w + 21. Put 4, w, x in ascending order. w, x, 4 Let x = -13 + 12. Let g be 5/(1 + (-2)/1). Put x, g, -1/9 in increasing order. g, x, -1/9 Let q be 2(-6)/54 - (-64)/45. Put 0.3, 4, q, 2 in descending order. 4, 2, q, 0.3 Suppose 320 = 5c - 0c. Let z = c - 190/3. Suppose 2t = o - 3 - 2, 4t + 2o = -6. Sort t, z, 0.2 in ascending order. t, 0.2, z Suppose 2b + 2b + 20 = 0. Sort b, 3, 4. b, 3, 4 Let n = -15 + 10. Let r = 20 - 22. Let l = 1 + 1. Put n, r, l in decreasing order. l, r, n Let x = -588613/770 + 7679/10. Let o = x - 35/11. Put o, 3, 0.5 in increasing order. o, 0.5, 3 Let u = -194 + 196. Suppose 1 = 4w + 21. Let i(r) = -r*3 - 7r*2 - 6r + 5. Let c be i(-6). Sort w, u, c in decreasing order. c, u, w Let s = -73 - -217/3. Sort -1, -2, s in descending order. s, -1, -2 Suppose g = -g - 14. Let u be 2 + (-1)/g-17. Put u, -2, 1 in descending order. 1, u, -2 Suppose 2h - 6 = 4w, 2h - 24 = -4w - 2h. Let m = 5 - 1. Suppose 0 = -mf - 9 - 3. Put w, -1, f in decreasing order. w, -1, f Let m = -0.08 - -0.28. Let h = -0.27 + -0.03. Sort -0.4, m, h in ascending order. -0.4, h, m Let v = -143 + 139. Sort 2/3, 0.3, 0, v in decreasing order. 2/3, 0.3, 0, v Let o be -3 + (3 - -1) + 0. Put 4, 5, -1, o in descending order. 5, 4, o, -1 Suppose -53v + 48v = -5. Sort 0, v, -2, -1 in descending order. v, 0, -1, -2 Let z(h) = -h3 + 6h*2 + 4h + 10. Let f be z(7). Let m(k) = k*3 + 11k*2 + k + 8. Let w be m(f). Sort w, -1, 0. w, -1, 0 Let h be -2 + 2 - (-12)/3. Suppose -2w + 0w - 6 = 0, 3 = hv - w. Let j = 4 - -1. Sort -5, j, v. -5, v, j Let q(w) = w*2 - 7w - 5. Let m be q(8). Suppose -mg - 5 = -2. Sort 1, -4, g. -4, g, 1 Let g(u) = -2u + 9. Let z be g(7). Suppose -4o - o = -5. Put 4, o, z in decreasing order. 4, o, z Let f = -0.1 + 2.9. Let n = 0.2 + f. Suppose 0 = 2k - 3k - 2. Put -0.5, n, k in descending order. n, -0.5, k Let k = -1 + 3. Let r be (-22)/(-42) - k/(-14). Sort -0.5, r, -0.3 in decreasing order. r, -0.3, -0.5 Let j = -0.4 + 0.1. Let h = -63/2 + 32. Sort -2, j, h. -2, j, h Let x(u) = 2u - 5. Let f be x(4). Let a = 9.7 - 14.6. Let k = a + 5. Put f, -5, k in ascending order. -5, k, f Let p = 1.8 - 1.8. Let q = 4.8 + 0.2. Let i = 8 - q. Sort i, p, -4 in decreasing order. i, p, -4 Suppose 3d - 4r = -9r + 16, -2r = -d - 2. Let j be (0 - 1)-91. Suppose 3k + 0k = -j. Put k, d, 3 in increasing order. k, d, 3 Let u(g) = g*3 + 4g*2 + 2g - 2. Let d be 2 - (-1)/(2/(-10)). Let c be u(d). Suppose -w + c + 0 = 0. Sort 4, -4, w in decreasing order. 4, w, -4 Suppose 4q - 6 = 26. Let h = -2 + -3. Sort q, 2, h in decreasing order. q, 2, h Let k = -2.04 - -0.04. Let q be (-2130)/(-28) + (-1)/(-2). Let o = q + -76. Put -3/2, o, k in decreasing order. o, -3/2, k Let l(w) = -w - 3. Let r be l(-6). Let i = 8 - r. Sort 2, i, -3 in descending order. i, 2, -3 Let r(m) = -m3 - 2m*2 - 2m. Let j(f) = f*3 + 2f*2 - 2f - 1. Let k be j(-2). Let i be k((-8)/3)/4. Let b be r(i). Sort b, -2, 1 in descending order. b, 1, -2 Let i(s) = -s2 + s + 1. Let l be i(0). Let g = -296 - -1771/6. Put -0.1, l, g in decreasing order. l, -0.1, g Suppose 10m = 8m - 10. Suppose -2v - i + 4 = 0, 4i + 6 = v + 2v. Sort -4, v, m in decreasing order. v, -4, m Let x = 5.3 - 5. Let t = -13 + 12.6. Put t, x, 1 in descending order. 1, x, t Suppose -5v = 3p - 15, 4v + 4p - 9 - 3 = 0. Let q be 31 + 4130/(-1275). Let a = 2/51 + q. Put v, a, 1 in descending order. v, 1, a Suppose -5o = o. Let u(i) = i*2 - 4i - 4. Let m(x) = x. Let d be m(4). Let q be u(d). Sort 2, q, o. q, o, 2 Let s = -17 - -35. Let d = -17.8 + s. Sort -1, 0, d in decreasing order. d, 0, -1 Let u = -1.3 - -4.3. Suppose 5v = 3t - 13, -6t + 2t = 5v + 6. Sort -2, t, u. -2, t, u Suppose h - 28 + 9 = 4q, 0 = -3q - 4h. Put q, 5, -1 in ascending order. q, -1, 5 Let p = -0.1 + 0. Let a = 0.23 + 0.23. Let m = -0.04 - a. Sort p, m, 2. m, p, 2 Let q(m) be the third derivative of -m5/60 + m2. Let n be q(-1). Put 7, 2, n in increasing order. n, 2, 7 Let c(g) = -g - 9. Let l be c(-9). Sort -1, l, 2 in descending order. 2, l, -1 Suppose -3s + 5 = -4y, -2 - 8 = -4y - 2s. Let p be 52/(-84) + y/3. Sort -4/3, p, 3 in decreasing order. 3, p, -4/3 Let y be (-35)/40 - (-2)/(-16). Sort y, 4, -5 in increasing order. -5, y, 4 Let i(x) = x. Let a be i(8). Let c = -5 + a. Put -3, c, -5 in ascending order. -5, -3, c Let c = 139 + -139.3. Put c, 3, 10 in descending order. 10, 3, c Let w = -338 + 2362/7. Sort w, -0.07, 5 in ascending order. w, -0.07, 5 Let n be -2(-2 + 1)2. Suppose -ns = -s + 3. Sort s, -5, 4 in descending order. 4, s, -5 Let k = 3.684 + 0.016. Let d = k + -4. Sort -3, d, -0.5 in decreasing order. d, -0.5, -3 Let u(j) = j - 5. Let f be u(5). Suppose f = 5q - 6 - 9. Suppose qo + 3 + 0 = 0. Sort o, -2, 2 in descending order. 2, o, -2 Let t = -70 - -488/7. Let k = 70.1 - 65. Let s = k - 0.1. Sort t, s, -1 in descending order. s, t, -1 Let b = -62 - -65. Put -4, b, -5, 5 in descending order. 5, b, -4, -5 Let f = -6.1 - -10.1. Put 1, 6/5, f, -4 in descending order. f, 6/5, 1, -4 Let z = -0.3 + -0.1. Let o = 1/2 - 1/6. Sort z, 6, o in descending order. 6, o, z Let t be (5/(-15))/((-2)/12). Suppose 0 = 5v - 2v + 15. Suppose 0 = 5h + 2x, -4x = -5x + 5. Put h, t, v in increasing order. v, h, t Let k(a) = -4a - 7. Let y be k(-3). Suppose 0 = yh - 4h + 4. Put -3, h, 1 in ascending order. h, -3, 1 Let o = 0.3 + 0.65. Let w = o + 0.05. Let p = 0.07 - 1.07. Put 4/5, p, w in ascending order. p, 4/5, w Suppose 4k = -k. Sort k, 5, -2. -2, k, 5 Suppose -k + 24 = 2. Let y be 70/(-22) + 4/k. Put y, 0.5, -0.3 in descending order. 0.5, -0.3, y Let a = 49.1 + -49. Sort 1/5, a, -0.2, -2/9. -2/9, -0.2, a, 1/5 Let z = -32 - -22. Let t = 10.9 + z. Let f = -0.4 + t. Put 0.3, f, -1/4 in descending order. f, 0.3, -1/4 Let p = 23 + -26. Let x = -0.1 - -0.1. Sort -1, p, x. p, -1, x Let z(r) = -r - 3. Let f be z(2). Sort f, 2, 0. f, 0, 2 Let s = 0.03 + -5.03. Let o = 5.6 + -6. Sort o, 2, s. s, o, 2 Let j be 74/14 - (-4)/(-14). Let b(r) = r2 + 5r + 2. Let a be b(-4). Put j, -5, a in descending order. j, a, -5 Let z = -10 - -12. Suppose -g + zg = -4. Sort 1, 4, g in descending order. 4, 1, g Let i = -0.96 + -0.04. Let g be 2/4 + 10/12. Put i, 5, g in descending order. 5, g, i Suppose k - 8 = -f - 2f, -3k - 20 = -2f. Suppose -fz - 8 = -2z. Let c = 4 + z. Put -2, -5, c in ascending order. -5, -2, c Let j be (1 + 0)/(-1 - -2). Let p(y) = -y*3 + 5y*2 - 6y + 5. Let z be p(3). Put j, -1, z in increasing order. -1, j, z Let i(b) = b*3 + b + 8. Let a be i(0). Let r = a - 13. Suppose h - 8 = -3z, 5h - z - 4 = 4h. Sort r, 0.2, h. r, 0.2, h Let o = -0.9 - -5.9. Let f be (-6)/(-4)(-8)/(-9). Sort 2/9, f, o in decreasing order. o, f, 2/9 Let w be (-6)/(-9)(-6)/(-12). Sort 2, w, -2/3 in decreasing order. 2, w, -2/3 Let o = -6.2 - -1.2. Let x = -1 - o. Put 5, -5, x in increasing order. -5, x, 5 Let z be ((-40)/16)/(1/2). Let t be z/(-2)(-30)/(-25). Suppose 5d + 20 = 2h, -4h - 4d - d + 10 = 0. Sort h, 0, t. 0, t, h Let u = -109/36 + 13/4. Sort -2, u, -6/7, -1/10. -2, -6/7, -1/10, u Suppose 0 = 4d + 12, -3r - 2r + 13 = 4d. Suppose -rq - 20 + 6 = -2a, 0 = -2a - q + 2. Put -3, -5, a in decreasing order. a, -3, -5 Let a be 21/7 + 3/(126/(-122)). Sort a, -1/2, -2/7, 0.1. -1/2, -2/7, a, 0.1 Suppose -m + 2 = -0. Sort m, -0.3, 3/5. -0.3, 3/5, m Let f(j) = -j*2 + j + 4. Let c be f(3). Let g be (-3 - -1 - 2)/(-6 - -4). Sort c, g, 4 in decreasing order. 4, g, c Let h(d) = d + 4. Let k be h(0). Put 1, -5, k in increasing order. -5, 1, k Let p be 3/(-8) + (-1 - -1). Put p, 2/7, -0.4 in descending order. 2/7, p, -0.4 Let x be (1-1)/(1 + -2). Let h be -1 - (-6 - (-3 + (6 - 3))). Sort -3, x, h in des	{ "pile_set_name": "DM Mathematics" }
- 670p What is the third derivative of -6s*4 - 44623430s*3 - 889025441s*2 wrt s? -144s - 267740580 What is the third derivative of 21l6 + 113675l*4v - l*2v + 198261l2 + 5l wrt l? 2520l3 + 2728200lv Find the third derivative of -9110039d*2o*3 + 2255d*2 + do*2 - 257do - 2d wrt o. -54660234d2 Differentiate 336744158h*2 + 490073280. 673488316h Find the third derivative of 10h5 - 156686h*3 - 160059h*2 - 14h + 1 wrt h. 600h2 - 940116 What is the derivative of -11924227a*3 - 2a + 116255913? -35772681a2 - 2 What is the third derivative of -63724z*4 + 28z3 + z2 - 14413636? -1529376z + 168 What is the second derivative of 10b*2qs + 6b*2s*2 - 6588bq2s*2 - 11bs + 1607b - 10q2s + 846s2 wrt s? 12b*2 - 13176bq2 + 1692 Find the third derivative of 86m*4q*3 + 25667m*4q*2 - 42m*2 - 181mq3 - 171q wrt m. 2064mq*3 + 616008mq2 What is the third derivative of 51stxz3 - stx + 82stz*2 + 24st + 3sx + 3tz4 + 2117xz4 + xz wrt z? 306stx + 72tz + 50808xz What is the third derivative of -207322j*4 - 47j*3 + 108j*2 - 637217? -4975728j - 282 Differentiate -2423923g2 - 2g - 80463353. -4847846g - 2 What is the second derivative of -268b*4 + 214b*3 + 6091512b - 3? -3216b2 + 1284b Find the third derivative of 555675156d2o*4 + 297d*2o2 - d2o - 12do - 859o wrt o. 13336203744d2o Differentiate -100lr*2 + 357lr - 256544946l - 1185r + 2 wrt r. -200lr + 357l - 1185 Find the second derivative of -238975s3 - 60s*2 + 91961227s wrt s. -1433850s - 120 What is the derivative of 326857082s*2 + 59553642 wrt s? 653714164s Find the third derivative of -189527561g4 - 385244g*2 - 4g - 30 wrt g. -4548661464g Differentiate 2a*2fz + 5a*2z - 9a2 - afz + 65587565af - 6az - 58a + 7z with respect to f. 2a*2z - az + 65587565a What is the third derivative of -17290m5 - 2m*4 - 321m*3 - 33m*2 - 1605839m wrt m? -1037400m2 - 48m - 1926 Find the first derivative of 3n2 - 2421507n - 20792649 wrt n. 6n - 2421507 What is the second derivative of 32943488c*5 - 4044c - 2490 wrt c? 658869760c3 Find the third derivative of -29279537mn3 + 21mn - m - 4n*2 + 1331n wrt n. -175677222m Find the third derivative of 8067495x*3 - 3x*2 + 252233 wrt x. 48404970 Find the third derivative of 3201393d*3o + 5522d2o - 31d2 - do - o wrt d. 19208358o What is the derivative of -1567l*4 - 1387l + 3208355 wrt l? -6268l3 - 1387 Differentiate -28798gn - 581g - 44745591n with respect to g. -28798n - 581 What is the first derivative of -401409bfw - bfy - 508031bwy - 3bw - fw + 6fy + 22w - 4y wrt y? -bf - 508031bw + 6f - 4 Differentiate 19899941l*4 - 92603 with respect to l. 79599764l*3 Differentiate 9193h*3 + 79h*2 - 7h - 10666572. 27579h2 + 158h - 7 Find the third derivative of -18499695a3 + 89660a*2 + 1 wrt a. -110998170 Find the second derivative of 26691748k*2 - 114370k + 27. 53383496 What is the third derivative of -556706019i3 - 701i*2 + 281221i? -3340236114 What is the derivative of 21f4 + 47f*3 - 409f + 78223242 wrt f? 84f3 + 141f*2 - 409 Find the second derivative of 26c*2j*2l - 133046c2j*2 - 16c*2jl - c2j + 7c2l + 112cjl + cl wrt j. 52c2l - 266092c2 Find the third derivative of 79731b*2c*3 - 2b*2c*2 - 6b*2 + 243bc4 - 6bc2 - 182b + 15c2 - 5 wrt c. 478386b*2 + 5832bc Find the first derivative of 53208042t*2w*2 + 71950905w*2 wrt t. 106416084tw2 What is the third derivative of 8r*6 - 106r*5 - 1225r*3 + 4258r*2 - 41365? 960r*3 - 6360r*2 - 7350 Find the third derivative of 41600779h*6t + h*3t - 7h2t + 9479h2 + 63t wrt h. 4992093480h3t + 6t Differentiate -73664741k + 10165540. -73664741 What is the second derivative of -13988378h2k - 125hk - 12h - 2k - 24 wrt h? -27976756k What is the third derivative of -12572o*5 + 140o*4 + 11202276o*2 wrt o? -754320o*2 + 3360o What is the second derivative of -63454955n5 + 64261375n - 2 wrt n? -1269099100n3 Find the first derivative of 305429160bz2 - 13532b + 4358 wrt z. 610858320bz What is the derivative of 19s4 + 521s*3 - 18s + 40664729? 76s3 + 1563s*2 - 18 What is the second derivative of -83p*4s*2 + 10930p*2s + p*2 + 5ps2 + 94321ps wrt p? -996p*2s*2 + 21860s + 2 Find the second derivative of 132532g2u*2 - 17g*2u - 2gu - 2599762u2 wrt g. 265064u*2 - 34u What is the second derivative of -225b5 + 1547b*4 - 3b*2 + 32889068b? -4500b3 + 18564b*2 - 6 Differentiate -47y*4 + 2y*3 - 12441y - 11962340. -188y3 + 6y*2 - 12441 Find the third derivative of -36106263z*3 - 5420z*2 + 521z - 4. -216637578 What is the third derivative of 16450341p3 + 10337959p*2? 98702046 Find the first derivative of -994p*3w*2 - 7798677p*3 + 21418p*2w*3 - 3p*2 - 3p - 1 wrt w. -1988p3w + 64254p2w*2 What is the third derivative of -2196104d*3j*3q*3 + 2d*3jq + 2d*3q*3 + 2d*2j*3q*2 - dj*3q - 9dj*2q + 4453j3 wrt q? -13176624d*3j*3 + 12d*3 Find the third derivative of -192672128t*4u - 4t2u - 5t2 + tu - 2t + 2105u - 2 wrt t. -4624131072tu Differentiate -32891876cm*2 - 2m*2 + 2m - 234276 with respect to c. -32891876m2 What is the second derivative of 41418588n*2 + 5n + 13362007? 82837176 Find the second derivative of -611777280r2 - 723158198r. -1223554560 Find the third derivative of 44a6v*2 - 42469a*3v*3 + 7a*2v*2 - 11av3 + av - 12a - 3v*3 - 135v wrt a. 5280a3v*2 - 254814v*3 What is the first derivative of 2sx3 - 6160sx + 1875s + 885x3 + 43168 wrt x? 6sx2 - 6160s + 2655x2 What is the derivative of -210w*4 + 2w*2 + 63645w - 542583602? -840w3 + 4w + 63645 Find the first derivative of 797004d3 - 7d - 17079978. 2391012d2 - 7 Find the third derivative of 107007q*3s2 + q3s - 4q*3 + 168401q*2 + 2qs2 + 20s wrt q. 642042s2 + 6s - 24 What is the second derivative of -50280883t2 + 90697018t? -100561766 What is the second derivative of 63427o3s*4 - 16o*3s*3 - 2o*3s + 2o2s - 11o2 + 28os + 2s + 8437 wrt s? 761124o3s*2 - 96o*3s What is the third derivative of 78cp*4 + 136155cp3 + 120cp2 - 49cp - 2p*3 - 2p*2 - 334 wrt p? 1872cp + 816930c - 12 Find the first derivative of -54628667i2 + 20811030. -109257334i What is the third derivative of -3050776m6 - 1032m*2 - 5471m wrt m? -366093120m3 What is the derivative of 16507880i*2 - 13988232? 33015760i What is the third derivative of -x*4 + 351548x*3 + 2327x*2 - 1199x wrt x? -24x + 2109288 What is the second derivative of -108cw2 + 3357032c - 27422w2 + w wrt w? -216c - 54844 Find the first derivative of -11iy*3 - 89845171i + y*3 - 142014y wrt y. -33iy*2 + 3y*2 - 142014 Find the second derivative of -291037818h*2 + 203864669h. -582075636 Find the second derivative of -16589082g2 + 14282399g. -33178164 What is the derivative of -cl3 + 1104cl + 66709216c - 2l2 + 79l wrt l? -3cl*2 + 1104c - 4l + 79 Find the second derivative of 56197l*5 - 3l*3 - 2l*2 - 11l + 1423406. 1123940l3 - 18l - 4 Differentiate -16709173d4k*2 + 5d*2 + 337041k*2 - 598k + 2 wrt d. -66836692d3k*2 + 10d Find the second derivative of 68474814p3 - p2 + 28p - 3184086 wrt p. 410848884p - 2 What is the derivative of -104221b*3v + 22374645b3 - 2bv + v wrt v? -104221b*3 - 2b + 1 Find the first derivative of -15501788g4 - 16455837. -62007152g*3 Differentiate 370066915a*4r*3 + 356581r*3 - 164 with respect to a. 1480267660a*3r*3 Differentiate -5684q*4s + 2989qs*2 + 18276968s*2 with respect to q. -22736q*3s + 2989s2 Find the third derivative of -424739o*3 + 3611911o*2. -2548434 Find the second derivative of -204038041j*2 + 2j - 108869965. -408076082 What is the first derivative of 484098146*w + 138879267? 484098146 Find the second d	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.