Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
s be x(-5). Let p be (68/s)/(1/5). Suppose -f + p = -0. Let b(a) = 6a2 + 2a + 4. Calculate fh(t) - b(t). -2t*2 + 2t Let f(z) = -2z + 21. Let s(g) = 8 + 7 + 22 - g - 26. What is -4f(y) + 7s(y)? y - 7 Let l(i) = -229i - 4. Let y(m) = -53m - 1. Let s(z) = 2l(z) - 9y(z). Let g(h) = -13h - 1. Determine -7g(c) - 5s(c). -4c + 2 Let b(v) = -24v + 12870. Let o(u) = -5u + 2557. Determine 3b(f) - 14o(f). -2f + 2812 Let r(g) = -20g - 85. Let l(j) = 5j + 23. Let p(b) = 15l(b) + 4r(b). Let c(q) = -11q + 11. Give -4c(n) + 9p(n). -n + 1 Let x(n) = -4 + 2n*2 - 1997n + 2n2 + 4 + 1998n. Let z(v) = 9v2 + 3v + 1. Give -5x(a) + 2z(a). -2a2 + a + 2 Let c(n) = -30n*2 + 4n - 5. Let r(w) = -73w2 + 15w - 8. Let b(t) = -48t2 + 10t - 5. Let s(j) = 10b(j) - 7r(j). Determine -5c(a) - 4s(a). 26a2 + 1 Let x(y) = -y3 - 4y*2 - 12y - 16. Let g be x(-3). Let b(j) = 22 + j - 16 + 0j - g. Let s(h) = -1. Give 2b(n) - 14s(n). 2n + 4 Let r(k) = -38k3 + k2 + 14k + 17. Let p(c) = 150c3 - 3c*2 - 52c - 66. What is 3p(w) + 11r(w)? 32w3 + 2w*2 - 2w - 11 Let k(r) = -20r3 - 13r - 156. Let a(l) = -9l3 - 6l - 78. Determine 13a(s) - 6k(s). 3s3 - 78 Let h(t) = 76t + 252. Let v(l) = -128l - 419. Let c(z) = -5h(z) - 3v(z). Let i(b) = 1. Let m be 6/21 + (-10)/(-14). Calculate mi(o) + c(o). 4o - 2 Suppose -16u = 146 - 20 + 146. Let y(f) = 100f3 + 17. Let x(p) = -33p*3 - 6. Give ux(r) - 6y(r). -39r3 Let j(i) = -i2. Let z(o) = 5o2. Suppose -h - 5 = 16 - 11. What is hj(u) - z(u)? 5u2 Let n(x) be the second derivative of -x3/2 - 621x. Let f(s) = 16s - 1. Suppose 3m + 3k + 4 = 2m, -5k = -4m + 69. Determine mn(d) + 2f(d). -d - 2 Let k(j) = 3j2 + j + 2. Let s = 717 - 719. Suppose -3n - 14 + 20 = 0. Let y(x) = x*2 + x + 1. What is ny(d) + sk(d)? -4d*2 - 2 Let u be (-450)/(-40) - (6/(-8) - -1). Let o(y) = -14y*3 - 10916y*2 - y - 7y + 10905y2 - 3y. Let m(x) = 3x3 + 2x*2 + 2x. Give um(q) + 2o(q). 5q3 Let z(y) = -24y*2 - 16y - 24. Let x(s) = 13s2 + 10s + 12. Give -5x(m) - 3z(m). 7m2 - 2m + 12 Let l be ((-10)/10)/((-3)/542). Let g(x) = 4 + 2x + lx - 20x. Let o(y) = -8y + 3. Determine 3g(v) - 4o(v). 5v Suppose -610b = -624b - 35 - 63. Let t(c) = 13c3 - 2c*2 - 2c + 2. Let a(p) = -39p3 + 7p*2 + 7p - 6. Calculate bt(z) - 2a(z). -13z3 - 2 Let x(m) = 556m - 8. Let a(n) = n. Give -16a(l) - x(l). -572l + 8 Let t(y) = -3y3 - 22y*2 + 806y - 19. Let z(s) = -s*3 - 8s*2 + 269s - 7. Give 4t(x) - 11z(x). -x*3 + 265x + 1 Suppose 18 = 5b - 17. Let z(h) = -6h - 14. Let t = -20022 + 20016. Let l(q) = -5q - 13. What is bl(s) + tz(s)? s - 7 Let m(y) = -4 + 17 - 5 + 5y - y. Let f(v) = v + 1. Suppose -37 = -w - 0w. Let c = w + -38. Calculate cm(g) + 5f(g). g - 3 Let u(c) = 10c*3 + 40c*2 - 30c + 5. Let o(q) = -q3 + q2 + 3q - 1. Determine 9o(a) + u(a). a*3 + 49a*2 - 3a - 4 Let j(a) = 49a. Suppose -l = -2l + 5, -4h - 2 = -2l. Suppose hs - 252 = 8s. Let p(x) = -x. Calculate sp(k) - j(k). -7k Let q(v) = 11 - 913v - 12 + 453v + 459v. Let o(y) = 2y*2. What is -o(t) - q(t)? -2t*2 + t + 1 Let o(x) = -49x*3 + 122x*2 + 31x - 55. Let i(y) = -10y3 + 22y*2 + 6y - 11. What is 11i(f) - 2o(f)? -12f3 - 2f*2 + 4f - 11 Let h(n) = -10n - 1. Suppose 0 = -21i - 18i - 50i - 356. Let r(s) = s. Determine ir(y) - h(y). 6y + 1 Let g(o) = -3o3 + 8o - 11. Let j(p) = p*3 - 3p + 4. Let d = -221 + 216. Let f be -2 + (-8 - d) + 2. Let h be 10((-1)/(-5) + -1). Give fg(k) + hj(k). k3 + 1 Let m(c) = 3c*3 + 10c*3 - 6c*2 - 6c - c - 2c2 + c2 + 7. Let a(i) = -1 + 3i*2 - 2 + 3i + 185i3 - 191i*3. What is -7a(r) - 3m(r)? 3r*3 Let f(m) = -m. Let q(o) = -11o*2 + 33o. Let l(a) = -a*3 + 9a*2 - 14a + 137. Let k be l(9). Suppose 13j + 2 + k = 0. What is jq(t) - 33f(t)? 11t*2 Let l(p) = -38p*3 - 4p + 28. Let i(b) = 76b3 + 7b - 46. Calculate 3i(r) + 5l(r). 38r3 + r + 2 Let k(o) = -90o + 945. Let r(h) = -22h. Calculate -k(d) + 4r(d). 2d - 945 Let u(m) = -4m - 1. Let z(k) = -42k + 7252. Give 10u(x) - z(x). 2x - 7262 Let w(p) = 0 - 20p - 3 + 10p + 8p. Let i(s) = -1. Let a be (-47)/((-2)/12 + (-6)/18). Let y = -93 + a. Give yw(l) - 3i(l). -2l Let c(g) = 4g*3 + 13g*2 + 79g + 8. Let y(k) = 5k3 + 10k*2 + 79k + 6. Determine 3c(q) - 4y(q). -8q3 - q2 - 79q Let g(x) = 799x3 + x2 - 12x + 2. Let l(r) = -2r3 - 6r + 1. Calculate 2g(o) - 4l(o). 1606o3 + 2o*2 Let j(u) = -27. Let t(r) = -r + 106. Let m(d) = 2d - 223. Let f(w) = 12m(w) + 25t(w). Give 2f(l) - 3j(l). -2l + 29 Let o(i) = -425i*2 - 51. Let q(x) = 56x - 2678. Let z be q(46). Let u(j) = 17j2 + 2. What is zu(n) - 4o(n)? -34n*2 Let g(m) = 81m*3 + 6m - 43. Let h(s) = 242s3 + 17s - 116. Give 8g(v) - 3h(v). -78v3 - 3v + 4 Let q(j) = 138j - 1. Let c(p) = 6p. Determine -2c(l) - q(l). -150l + 1 Suppose -5v - 2a = -6v - 13, -3v + 4a - 29 = 0. Let n(q) = -4q + 0 - 3 + 5q. Let x(r) = 3r + 9r + 1 - 3r - 8r. Calculate vx(t) - n(t). -4t Let j(n) = -13n*2 - 50n + 64. Let h be j(-5). Let b(d) = -78d2 - 11. Let v(u) = -39u*2 - 6. Calculate hv(p) + 6b(p). -39p*2 Let n(o) = -11o*3 - 30o + 5. Let u(r) = -1. Give n(p) + 5u(p). -11p*3 - 30p Let r(k) = 7k2 - 66k. Let g(y) = 7y2 - 70y. What is 6g(s) - 7r(s)? -7s2 + 42s Let x = 2 + -7. Let a be (3/(-10))/1 + (-26)/(-20). Let t(z) = -7z + 6. Let y(s) = -s + 1. Give at(n) + xy(n). -2n + 1 Let q(a) = 3a2 + 26a - 8. Let f(c) = 31c - 61c - 3 + 0 + 16c + c2 + 23c. Give -11f(k) + 4q(k). k*2 + 5k + 1 Let b(q) = -9462q + 17. Let m(w) = -1892w + 4. What is -3b(u) + 14m(u)? 1898u + 5 Let k be (-7(-6)/189)/((-16)/(-72)). Let d(u) = -2 + 4 + k - 5 + 11u - 7u. Let g(z) = -1. Give d(w) - 3g(w). 4w + 1 Let t be 2 - ((-3480)/(-5))/(-4). Let g(x) = 354 - t - 179. Let p(y) = -4y - 10. Determine 8g(v) - p(v). 4v + 2 Let i(k) = -k2 - 6. Let n = -102 + 96. Let q(f) be the first derivative of f3/3 + 7f - 528. Determine nq(m) - 7i(m). m*2 Let i(p) = 30p. Let c(j) = -j. Suppose 2u + 1 = u. Let w(f) = 4f*3 + 38f*2 + 95f + 8. Let y be w(-4). Determine ui(s) + yc(s). -10s Let c(n) = n3 - n2. Suppose 7g - 5 = 2g. Let y = -37828 - -37832. Let p(x) be the first derivative of -7x*4/4 + 4x*3/3 + 2. Give gp(l) + yc(l). -3l*3 Suppose -5g - b = 3, 21g = 23g + 7b - 12. Let d(r) = -r. Let y(n) = -2n + 1. Give gd(u) + y(u). -u + 1 Let c = -249 + 245. Let m be -2 - (-54 - c)/5. Let o(d) = 3d*3 + 8d*2 + 8d + 8. Let u(j) = j*3 + 3j*2 + 3j + 3. Calculate mu(v) - 3o(v). -v*3 Let j(k) = -k + 7. Let h be j(5). Suppose 2d = q + 9, -hd - 5q + 5 - 2 = 0. Let m(y) = y + 6y + 5 - dy - 4y. Let o(r) = 2. Determine 4m(f) - 10o(f). -4f Let w(q) = -8789q2 - 3q - 9. Let n(s) = -205987793s2 - 70312s - 210936. Give 3n(v) - 70312w(v). 8789v2 Suppose 0y - 2y = 8. Suppose -34g = -11g - 69. Let f(q) = -11q3 + 8 + 0 - 15 + g + q3. Let j(n) = -n*3 - 1. Determine yj(v) + f(v). -6v3 Let n(v) = 95v*3 + 7v - 7. Let j(m) be the second derivative of -47m5/20 - m3/2 + 3m*2/2 + 1497m. Calculate 7j(p) + 3n(p). -44p3 Let a(c) = 3c*2 - 86c - 91. Let p be a(30). Let k(b) = -26 + pb2 - 23 + 17 + 62b*2 - 3. Let r(f) = -10f*2 + 4. Give -4k(n) - 35r(n). -14n*2 Let o be (22/6 - 3)/((-2)/(-3)). Let t = -2731 + 2736. Let d(q) = -8q*2 - 6q - 2. Let c(l) = l*2 + l. Calculate od(p) + tc(p). -3p*2 - p - 2 Let w(x) = -16x*2 - 172x + 5. Let p(h) = 8h2 + 85h - 3. What is 5p(u) + 3w(u)? -8u2 - 91u Let h(p) be the first derivative of -45/2p2 + 55/2p*4 + 0p*3 + 45p - 295. Let b(j) = 5j3 - 2j + 2. Give -90b(n) + 4h(n). -10n3 Let t(k) = -5k*3 - 2k*2 + 43k - 2. Let b(w) = -6w3 - 2w*2 + 49w - 3. Determine -6b(l) + 7t(l). l*3 - 2l*2 + 7l + 4 Let l(m) = -6m3 + 4m*2 + 366m + 2. Let i(g) = 16g3 - 9g*2 - 731g - 5. Give -2i(n) - 5l(n). -2n3 - 2n*2 - 368n Let m(v) = -6v2 + 3v - 1. Let y(o) = -7o2 + 4o - 2. Suppose -718	{ "pile_set_name": "DM Mathematics" }
- w*2/2 - 3w + 2. Let k(b) be the first derivative of c(b). Factor k(s). (s - 1)(s + 1)3 Let u be 1433/(-36). Let i = u + 23/6. Factor im*3 + 1/3m*2 - 1/3m - 1/3. (m - 1)(m + 1)2/3 Let a(o) be the second derivative of 0 - 2o + 0o2 + 3/20o*5 + 1/2o*4 + 1/2o*3. Solve a(d) = 0. -1, 0 Suppose -7 = -16i + 41. Factor 15/2v - 21/2v*2 + i. -3(v - 1)(7v + 2)/2 Let d = -7 + 17. Let x be 24/d - (8 + -6). Factor 1/5k3 - 1/5k + 2/5k2 - x. (k - 1)(k + 1)(k + 2)/5 Let b be 3/54 + 1/9. Let f(t) be the second derivative of -1/2t*2 - 1/40t*5 - 5/12t*3 + 2t + 0 - bt4. Factor f(h). -(h + 1)2(h + 2)/2 Suppose 7i + 133 + 14 = 0. Let g = 26 + i. Suppose 0p*3 - 2/3p*4 + 2/3p*2 + 0 + 1/3p*g - 1/3p = 0. What is p? -1, 0, 1 Factor 6/7c + 2/7c*3 - 2/7 - 6/7c*2. 2(c - 1)*3/7 Let s = 285 + -3131/11. Determine y, given that 14/11y + s - 8/11y2 = 0. -1/4, 2 Let d be 1((-3)/(-3) + 1). Factor 72a - 72a + ad. a2 Let 7/9h + 1/3 + 1/9h*3 + 5/9h*2 = 0. What is h? -3, -1 Factor 0 + 1/4q - q*2. -q(4q - 1)/4 Let x be 4/(4 - 2 - 1). Solve 0j*3 + 0j - 1/2j2 + 1/2j*x + 0 = 0 for j. -1, 0, 1 Let n(h) be the third derivative of -1/70h*5 + 0h*6 - 1/784h*8 + 1/245h*7 + 0 + 1/56h*4 + 0h - 9h2 + 0h*3. Factor n(r). -3r(r - 1)3(r + 1)/7 Let m(o) be the third derivative of o10/75600 + o9/15120 - o8/10080 - o7/1260 - o*5/6 - 2o*2. Let q(f) be the third derivative of m(f). Factor q(t). 2t(t - 1)(t + 1)(t + 2) Let j(l) be the second derivative of 2l*7/21 + 2l6/15 - l5/5 - l*4/3 + 14l. Factor j(k). 4k2(k - 1)(k + 1)2 Let k(d) be the second derivative of 3d*6/50 - 6d*5/25 + 13d4/60 - d3/15 + 9d. Solve k(t) = 0 for t. 0, 1/3, 2 Let x(p) = p2 + p. Let u be x(-2). Let a = 128/497 + 2/71. Solve -2/7t*3 + at + 0tu + 0 = 0. -1, 0, 1 Let i(v) be the third derivative of -1/96v*4 + 0v + 0v3 + 1/120v*5 + 5v*2 - 1/480v*6 + 0. What is s in i(s) = 0? 0, 1 Let 3u*2 + 3/4u*5 + 3/4u - 3/2u4 - 3/2u3 - 3/2 = 0. Calculate u. -1, 1, 2 Let p(r) be the second derivative of -r4/6 - r*3 - 2r*2 - 6r. Suppose p(x) = 0. Calculate x. -2, -1 Let z(w) be the second derivative of -w7/14 + w6/10 + 3w5/20 - w4/4 + 6w. Let z(o) = 0. Calculate o. -1, 0, 1 Let o(b) = -4b3 + b - 3. Let k(j) = -9j3 + j2 + 3j - 7. Let h(q) = 6k(q) - 14o(q). Let h(z) = 0. Calculate z. -2, -1, 0 Let a(d) = 2d*2 - d - 1. Let m(z) = 4z2 - z - 3. Let g(v) = -v2 + 2. Let o be g(0). Suppose -f + 15 = of. Let p(b) = fa(b) - 3m(b). Factor p(q). -2(q - 1)(q + 2) Let v(q) = 14q*3 + 14q*2 + 2q - 14. Let i(u) = -5u3 - 5u*2 - u + 5. Let n(g) = 8i(g) + 3v(g). Factor n(y). 2(y - 1)(y + 1)2 Factor 5 + 7 - 20f*2 + 28f + 28f. -4(f - 3)(5f + 1) Let f(h) be the third derivative of h5/180 - h4/36 - h*3/6 - 7h*2. Factor f(i). (i - 3)(i + 1)/3 Let m(f) be the first derivative of -2/21f3 + 4/7f + 1 + 1/7f2. Factor m(u). -2(u - 2)(u + 1)/7 Let w(o) be the second derivative of -o6/30 + o5/16 + o4/16 - 5o3/24 + o2/8 - 18o. What is d in w(d) = 0? -1, 1/4, 1 Let j = 2 - 5. Let q = j - -5. Factor 0h*3 + qh*2 - 2h*4 + 0h*3 + 0h*2. -2h*2(h - 1)(h + 1) Suppose 2d + d - 21 = 0. Let t(b) be the second derivative of 1/30b3 + 1/30b*4 - 1/75b*6 + 0 + 0b*5 - 1/210b*d + b + 0b*2. Solve t(w) = 0. -1, 0, 1 Let w(y) be the first derivative of 0y + 0y2 - 1/5y*4 - 8/15y*3 - 4. Factor w(o). -4o*2(o + 2)/5 Let z(v) be the first derivative of 4v3/3 + 8v*2/3 - 28v/3 - 37. Factor z(o). 4(o - 1)(3o + 7)/3 Solve 16/5s + 14/5s4 + 8s*2 + 2/5s*5 + 36/5s*3 + 0 = 0. -2, -1, 0 Let x be (-94)/6 - (-8)/(-24). Let k = 32 + x. Let s(d) = -18d*2 - 14d + 4. Let p(o) = 6o2 + 5o - 1. Let m(q) = kp(q) + 5s(q). Factor m(b). 2(b + 1)(3b + 2) Suppose -7 + 1 = -3m. Determine x, given that -2/15xm - 4/5x - 6/5 = 0. -3 Let d = -3 - -5. Factor 3/2xd - x - 1/2. (x - 1)(3x + 1)/2 Suppose 0m*2 - 1/4m + 0 + 1/4m3 = 0. What is m? -1, 0, 1 Let k(u) be the third derivative of -u8/70560 + u6/2520 + 7u*5/60 + 9u2. Let m(b) be the third derivative of k(b). Suppose m(q) = 0. What is q? -1, 1 Let l(t) be the third derivative of t6/40 + 41t2. Factor l(j). 3j*3 Let i = 9 - 8. Let l be (-3 - i) + 76/18. Suppose -2/9 - lk*2 + 4/9k = 0. Calculate k. 1 Let g be (2/2)/((-3)/(-6)). Suppose 0 = 3s - 6s. Factor -1/3 + sp + 1/3p*g. (p - 1)(p + 1)/3 Let v be (-7 + 11)(-2)/(-12). Let l(r) be the first derivative of -2r + 1 + 2r2 - vr*3. Factor l(k). -2(k - 1)*2 Let t(p) be the third derivative of 8p*7/105 + 2p*6/5 + 3p*5/5 - 9p2. Find n such that t(n) = 0. -3/2, 0 Let z(i) be the third derivative of -i6/120 - i5/30 + i4/24 + i3/3 + i2. Factor z(g). -(g - 1)(g + 1)(g + 2) Let a = -6 - -13. Suppose p*5 + 9p*3 - ap*5 - 3p*4 + 4p*2 - 3p - p*2 = 0. What is p? -1, 0, 1/2, 1 Let h = -1/2 - -1. Let i(u) be the first derivative of 0u*2 - 1 + 2/5u*5 + 0u - 1/3u6 + hu*4 - 2/3u*3. Determine y so that i(y) = 0. -1, 0, 1 Let q(i) = -2 + 12 - i + 9 + 2i. Let p be q(-16). Factor 0z + 0 + 2/3z*4 + 0z*2 - 4/3z*p. 2z*3(z - 2)/3 Let m(o) be the second derivative of -o*7/126 + 2o6/45 - o5/20 + 36o. Determine d, given that m(d) = 0. 0, 1, 3 Let a be (-2)/(-9) + -2 + (-16)/(-9). Factor 2/3 + au - 2/3u2. -2(u - 1)(u + 1)/3 Let c(d) = -d2 - d - 1. Let i(z) = -16z*2 - 18z - 14. Let l(k) = 28c(k) - 2i(k). Factor l(g). 4g(g + 2) Let k(r) be the second derivative of 1/21r3 + 3/28r*4 + 0 + 0r*2 + 5r. Factor k(u). u(9u + 2)/7 Factor 1/3c + 0 - 1/3c*2. -c(c - 1)/3 Let c(w) = -6w5 + 4w*4 - 5w. Let g = -13 - -18. Let x(j) = -7j5 + 5j*4 - 6j. Let b(q) = gx(q) - 6c(q). Determine s so that b(s) = 0. -1, 0 Let r be -3 - (-64 + -2 - -3). Let m = 182/3 - r. Factor -5/3o - 4/3o*2 - m - 1/3o3. -(o + 1)2(o + 2)/3 Suppose -5s + 9 = x, -4s + 16 = 5x - 8. Suppose -b + xb = 0. Factor -o5 + bo*4 - 3o*4 + 3o + 6o2 + 6o*3 - 6o - 3 - 2o5. -3(o - 1)*2(o + 1)*3 Let m(t) = -5t + 64. Let c be m(12). Suppose 0h3 + 2/11h + 4/11hc - 2/11h*5 - 4/11h*2 + 0 = 0. Calculate h. -1, 0, 1 Let 75f*2 - 15f + 3/4 = 0. Calculate f. 1/10 Suppose -6l + l = 0. Let b(p) be the first derivative of lp + 0p4 - 1/5p5 + p3 - 2 + p*2. Let b(x) = 0. Calculate x. -1, 0, 2 Factor -14/19i*3 - 64/19 + 108/19i*2 - 192/19i. -2(i - 4)2(7i + 2)/19 Let f be 8/12(38/16 + -2). Let k(u) be the first derivative of 1/5u5 + 0u*2 - fu*4 - 1/3u*3 + 1/6u*6 + 4 + 0u. Solve k(n) = 0 for n. -1, 0, 1 Let u be -1 + (3 - 1) - 0. Let s be u/(-3) - 42/(-18). Factor 2w5 + 2w*3 - 2w*5 + 2w*2 - sw*5 - 2w*4. -2w*2(w - 1)(w + 1)2 Let f be 0/(-2 + (-6)/(-2)). Let s(v) be the first derivative of -2 - 4/3v*3 - 1/2v*4 + fv - v*2. Factor s(m). -2m(m + 1)2 Let u be (-27)/6(-2)/(-6). Let v = u - -11/6. Factor m*4 + 0m + 0 + 1/3m2 + m3 + vm5. m2(m + 1)3/3 Suppose 4b = -5v + 27, 0v - 5b + 30 = 5v. Let c be 3/31/v. Factor 2/3o*2 - 1/3o + 0 - co3. -o(o - 1)*2/3 Suppose -159 + 33 = -6x. Let c be 14/x - (-4)/3. Let 0 + 2/5rc - 2/5r = 0. Calculate r. 0, 1 Let q(k) = k - 3. Let n be q(6). Find v, given that 3v - 2v - 4v2 + 6v*2 - nv*3 = 0. -1/3, 0, 1 Factor 3u*4 - 3u*3 + 12u + u*5 + 3u*4 + 6 - 12u2 + u3 - 11u. (u - 1)2(u + 1)*2(u + 6) Let k(h) be the first derivative of h6/120 - h5/60 - 3h2 - 4. Let t(p) be the second derivative of k(p). Factor t(m). m2(m - 1) Suppose 7d - 4d = 462. Let g be (-4 + 0)/((-98)/d). Factor 4/7 + 6/7i - 16/7i*2 - gi*3 - 10/7i*5 - 36/7i*4. -2(i + 1)*4(5i - 2)/7 Let g be (-9)/(-3)(-4)/(-6). Let j = 6 - 3. Solve -2t4 - 3tj + t2 - 1 + 3t + g + 0t = 0 for t. -1, -1/2, 1 Let i(c) = -c*2 - 10c - 19. Let a be i(-5). Let o be (-3)/a3/(-6). Determine u, given that ou*4 - 1/2 + 1/4u*3 - 5/4u - 3/4u2 = 0. -1, 2 Let -4/7t*2 - 16/7t - 16/7 = 0. Calculate t. -2 Let z(i) = -13i2 + 24i - 16. Let x(c) = -6c2 + 12c - 8. Suppose 3a = 5w	{ "pile_set_name": "DM Mathematics" }
s of 2395149. 3, 798383 What are the prime factors of 2152408? 2, 43, 6257 What are the prime factors of 1807882? 2, 17, 53173 List the prime factors of 224136. 2, 3, 11, 283 List the prime factors of 432757. 13, 33289 What are the prime factors of 685128? 2, 3, 28547 What are the prime factors of 832338? 2, 3, 13, 3557 What are the prime factors of 6319945? 5, 41, 30829 What are the prime factors of 1981963? 1981963 What are the prime factors of 1474590? 2, 3, 5, 13, 19, 199 What are the prime factors of 3291300? 2, 3, 5, 23, 53 What are the prime factors of 159489? 3, 11, 179 List the prime factors of 166490. 2, 5, 16649 What are the prime factors of 7047968? 2, 257, 857 What are the prime factors of 60277? 7, 79, 109 List the prime factors of 571401. 3, 21163 List the prime factors of 3174697. 73, 157, 277 List the prime factors of 412980. 2, 3, 5, 6883 What are the prime factors of 308423? 308423 List the prime factors of 23994092. 2, 991, 6053 What are the prime factors of 5303343? 3, 1767781 List the prime factors of 2285131. 2285131 What are the prime factors of 307061? 67, 4583 What are the prime factors of 88391? 157, 563 List the prime factors of 1701391. 1701391 List the prime factors of 58579. 58579 What are the prime factors of 188376? 2, 3, 47, 167 What are the prime factors of 1235016? 2, 3, 17, 1009 What are the prime factors of 848623? 17, 49919 What are the prime factors of 1214125? 5, 11, 883 What are the prime factors of 857488? 2, 53593 List the prime factors of 8446278. 2, 3, 89, 15817 What are the prime factors of 10746? 2, 3, 199 List the prime factors of 5960283. 3, 7, 29, 9787 What are the prime factors of 24098909? 24098909 List the prime factors of 8392494. 2, 3, 11, 101, 1259 What are the prime factors of 1713549? 3, 17, 33599 List the prime factors of 632847. 3, 193, 1093 What are the prime factors of 480483? 3, 197, 271 What are the prime factors of 1752484? 2, 19, 23059 List the prime factors of 450600. 2, 3, 5, 751 List the prime factors of 179392. 2, 2803 List the prime factors of 163959. 3, 31, 41, 43 List the prime factors of 1863329. 13, 143333 What are the prime factors of 204730? 2, 5, 59, 347 List the prime factors of 2517936. 2, 3, 52457 What are the prime factors of 1121354? 2, 13, 17, 43, 59 List the prime factors of 344205. 3, 5, 7649 What are the prime factors of 208005? 3, 5, 7, 283 What are the prime factors of 25995539? 25995539 List the prime factors of 29385. 3, 5, 653 List the prime factors of 298141. 281, 1061 What are the prime factors of 9676833? 3, 19, 169769 What are the prime factors of 1141981? 61, 97, 193 What are the prime factors of 6939805? 5, 1387961 List the prime factors of 16163600. 2, 5, 17, 2377 What are the prime factors of 40665338? 2, 7, 2904667 What are the prime factors of 311930? 2, 5, 31193 List the prime factors of 605520. 2, 3, 5, 29 List the prime factors of 1991650. 2, 5, 61, 653 List the prime factors of 7190737. 7190737 List the prime factors of 85600. 2, 5, 107 List the prime factors of 498270. 2, 3, 5, 17, 977 What are the prime factors of 294742? 2, 7, 37, 569 What are the prime factors of 13602376? 2, 1700297 What are the prime factors of 436205? 5, 7, 11, 103 What are the prime factors of 704212? 2, 176053 What are the prime factors of 300100? 2, 5, 3001 What are the prime factors of 1305190? 2, 5, 47, 2777 List the prime factors of 24591. 3, 7, 1171 What are the prime factors of 2415397? 37, 97, 673 List the prime factors of 3216339. 3, 7, 19, 2687 List the prime factors of 2018895. 3, 5, 134593 List the prime factors of 15098. 2, 7549 List the prime factors of 3365835. 3, 5, 11, 20399 What are the prime factors of 16970484? 2, 3, 1414207 What are the prime factors of 357338? 2, 29, 61, 101 List the prime factors of 520601. 43, 12107 What are the prime factors of 6142053? 3, 2047351 List the prime factors of 339901. 151, 2251 What are the prime factors of 1154874? 2, 3, 7, 31, 887 List the prime factors of 192396. 2, 3, 16033 What are the prime factors of 1007? 19, 53 What are the prime factors of 17590337? 17590337 What are the prime factors of 929663? 7, 59, 2251 What are the prime factors of 2890533? 3, 31, 31081 What are the prime factors of 518757? 3, 19, 479 List the prime factors of 225869. 7, 41, 787 What are the prime factors of 4910206? 2, 7, 350729 What are the prime factors of 73023? 3, 101, 241 What are the prime factors of 501540? 2, 3, 5, 13, 643 List the prime factors of 395885. 5, 7, 11311 What are the prime factors of 57334? 2, 109, 263 List the prime factors of 6283012. 2, 1570753 What are the prime factors of 1209356? 2, 463, 653 What are the prime factors of 1855904? 2, 59, 983 What are the prime factors of 137198? 2, 181, 379 List the prime factors of 4532958. 2, 3, 251831 List the prime factors of 24668142. 2, 3, 41, 149, 673 List the prime factors of 9159843. 3, 7, 11, 19, 2087 What are the prime factors of 913373? 913373 What are the prime factors of 187964? 2, 7, 137 List the prime factors of 3028339. 37, 81847 What are the prime factors of 4320838? 2, 2160419 What are the prime factors of 743686? 2, 371843 What are the prime factors of 1196895? 3, 5, 7, 11399 List the prime factors of 1730967. 3, 7, 139, 593 List the prime factors of 304976. 2, 7, 389 List the prime factors of 2436891. 3, 812297 What are the prime factors of 1392911? 13, 109, 983 List the prime factors of 1806224. 2, 7, 16127 What are the prime factors of 29859? 3, 37, 269 List the prime factors of 2896119. 3, 83, 3877 What are the prime factors of 2373418? 2, 29, 151, 271 What are the prime factors of 96141? 3, 73, 439 What are the prime factors of 7587395? 5, 317, 4787 What are the prime factors of 4090976? 2, 127843 What are the prime factors of 2114221? 2114221 List the prime factors of 40439892. 2, 3, 3369991 List the prime factors of 634673. 13, 48821 What are the prime factors of 4375866? 2, 3, 11, 66301 What are the prime factors of 5127208? 2, 640901 List the prime factors of 1973568. 2, 3, 19, 541 What are the prime factors of 1311340? 2, 5, 173, 379 List the prime factors of 335239. 137, 2447 List the prime factors of 305031. 3, 17, 5981 What are the prime factors of 561520? 2, 5, 7019 List the prime factors of 7824. 2, 3, 163 List the prime factors of 9793021. 7, 1399003 What are the prime factors of 390937? 313, 1249 What are the prime factors of 141835? 5, 19, 1493 List the prime factors of 14233585. 5, 2846717 List the prime factors of 1231933. 173, 7121 List the prime factors of 37083. 3, 47, 263 List the prime factors of 1475290. 2, 5, 31, 4759 List the prime factors of 280475. 5, 13, 863 List the prime factors of 386999. 41, 9439 List the prime factors of 380652. 2, 3, 31721 What are the prime factors of 13500807? 3, 4500269 List the prime factors of 1562173. 1562173 List the prime factors of 589122. 2, 3, 23, 1423 List the prime factors of 795672. 2, 3, 43, 257 List the prime factors of 88907. 7, 13, 977 What are the prime factors of 4438189? 7, 29, 21863 What are the prime factors of 1240192? 2, 9689 List the prime factors of 1611711. 3, 59693 What are the prime factors of 1519903? 7, 11, 19739 List the prime factors of 2194210. 2, 5, 59, 3719 What are the prime factors of 8763046? 2, 23, 29, 6569 What are the prime factors of 722818? 2, 361409 List the prime factors of 1133502. 2, 3, 19, 61, 163 What are the prime factors of 1885437? 3, 7759 What are the prime factors of 450680? 2, 5, 19, 593 List the prime factors of 11494128. 2, 3, 239461 What are the prime factors of 1041757? 1041757 List the prime factors of 529410. 2, 3, 5, 7, 2521 List the prime factors of 13475195. 5, 1009, 2671 What are the prime factors of 441201? 3, 17, 41, 211 List the prime factors of 2245698. 2, 3, 7, 13, 457 What are the prime factors of 13518? 2, 3, 751 List the prime factors of 277625. 5, 2221 What are the prime factors of 402992? 2, 89, 283 What are the prime factors of 271181? 271181 List the prime factors of 2091769. 2091769 List the prime factors of 20740118. 2, 7, 67, 22111 What are the prime factors of 305282? 2, 152641 What are the prime factors of 57410? 2, 5, 5741 List the prime factors of 722138. 2, 361069 What are the prime factors of 4155934? 2,	{ "pile_set_name": "DM Mathematics" }
n. Let g(r) = 6 + 3r + 4r + r. Let y(i) = 23i + 17. Give ng(m) - 6y(m). -2m Let z(g) = g - 1. Let r(y) = -12y*2 - 6y + 3. Give r(k) + 4z(k). -12k*2 - 2k - 1 Let v(n) = -1. Let b(r) = 15r2 + 2r - 4. Give -b(o) + 3v(o). -15o*2 - 2o + 1 Let f = -1630 - -1632. Let r(m) = -3m2 + 2m + 1. Let d(o) = 2o2 - 3o - 1. Give fd(l) + 3r(l). -5l2 + 1 Let m(h) = 34h*3 - 8h*2 - 8h + 8. Let c(s) = 23s3 - 113 + s + 230 - s2 - 6s - 112 - 4s2. What is 8c(v) - 5m(v)? 14v*3 Let i(z) = -4z*3 - 7z*2 + 303. Let w(k) = -2k*3 - 4k*2 + 151. What is -4i(u) + 7w(u)? 2u*3 - 155 Let v(f) = -24720f*3 - 100f - 100. Let n(r) = -749r3 - 3r - 3. Calculate 100n(h) - 3v(h). -740h3 Suppose 0 = -o - 5c - 12, 6 + 6 = 3o - c. Let n(l) = 4l + 3. Let d(f) = f + 1. Let w(g) = od(g) - n(g). Let y(x) = 3x*2 + 6x. Calculate 6w(u) + y(u). 3u*2 Suppose 4y = -4 - 20. Let x(h) = 5 + 0h - 3h + 5h. Let k = -19575 + 19558. Let f(u) = -6u - 14. Calculate kx(s) + yf(s). 2s - 1 Let t(r) = -6r*2 + 4. Suppose 270 = 82s - 222. Let u(z) = 3z2 - 2. Suppose 0 = v - 2v + 11. Calculate st(w) + vu(w). -3w2 + 2 Let k(r) = -3r + 49. Let h(t) = 3t - 50. What is -3h(x) - 4k(x)? 3x - 46 Let t(h) = 3h - 15. Let z(d) = 6d - 28. Give -5t(f) + 2z(f). -3f + 19 Let i(n) = -2n*2 + 3n - 3. Let y(c) = -5c2 + 12c + 2 - 7 + 0 - 3c - 3. What is 8i(r) - 3y(r)? -r2 - 3r Let l(q) = -2 - 10q + 11q - 3q - 2q. Let t(m) = 5m + 3. Suppose 4v - 3 = 5. What is vt(z) + 3l(z)? -2z Let s(g) = 12g. Let x(q) = -q. Let n(r) = r + 5. Suppose 9h = 14h + 30. Let t be n(h). Determine ts(b) - 9x(b). -3b Let o(d) = 17d*3 - 7d*2 - 3d - 6. Let u(z) = 11z3 - 5z*2 - 2z - 4. Calculate -5o(l) + 8u(l). 3l3 - 5l*2 - l - 2 Let i(b) = 13b - 41. Let n(l) = -4l - 1. Determine i(c) + 3n(c). c - 44 Let h(t) = 10t3 + 7t*2 - 10. Let p(b) = -3b*3 - 2b*2 + 3. Suppose -3v + 82f - 26 = 78f, -v + 6 = -5f. Determine vp(j) - 4h(j). 2j*3 - 2 Let t(n) = 5n*2 + 5n + 4n2 - 12n + n2 + 2 + n2. Let w(u) = 6u2 - 4u + 1. What is -4t(x) + 7w(x)? -2x2 - 1 Let s(c) = 3c - 27. Let n be s(10). Suppose nk - 17k = -42. Let a(w) = -4w3 + 3w*2 - 4. Let l(u) = -5u*3 + 4u*2 - 5. Determine ka(m) - 2l(m). -2m3 + m2 - 2 Let f(g) = -g - 2. Let o be 65/(-25) - (-4)/(-10). Let s(l) = -6l - 10. Determine os(c) + 14f(c). 4c + 2 Let j(n) = -2n2 + 5n - 2. Let i(k) be the third derivative of -k5/30 + k4/4 - k*3/3 - 6k*2 + 4. Give -6i(r) + 7j(r). -2r*2 - r - 2 Let c(p) = -19p - 143. Let j(u) = -54u - 428. What is -17c(h) + 6j(h)? -h - 137 Let b(f) = -2f*2. Let l = -34 + 36. Let r(c) = -7c*2 - 2c*2 + 3c*2 + 3c*l. What is 11b(a) - 6r(a)? -4a*2 Let u(n) = -3n*2 + 3n - 1. Let g(r) = -16r2 + 14r - 4. Suppose -22x = -23x + 14. Calculate xu(b) - 3g(b). 6b2 - 2 Let k(g) = -25g*3 - 7g2. Let n(h) = h3 - h*2. Determine -5k(u) + 35n(u). 160u*3 Let a(l) = 40l - 12. Let p(w) = -37w + 10. Give -4a(r) - 5p(r). 25r - 2 Suppose -p - 7 = -2. Let b(a) = -22a + 9. Let x(r) = -11r + 5. Let i(n) = -4b(n) + 7x(n). Let z(q) = -6q + 1. Calculate pz(s) - 3i(s). -3s - 2 Let q(y) = -9y. Let z = -161 - -165. Let j(k) = -10k. What is zj(f) - 5q(f)? 5f Let u(x) = -7x - 53. Let m(b) = -8b - 54. Calculate -6m(f) + 7u(f). -f - 47 Let q(m) be the first derivative of -m2/2 + 3. Let f be (0 + 4)1/2. Let j(w) = w*2 + 7w - fw2 - 5w. Calculate -j(s) - 2q(s). s2 Let u(k) = -1048k - 22. Let r(j) = -698j - 14. What is 8r(q) - 5u(q)? -344q - 2 Let j = 4617 - 4619. Let q(s) = -s*2 + 4s + 3. Let a(u) = -3u2 + 14 - 4 + 5u + 8u. Give ja(h) + 7q(h). -h2 + 2h + 1 Let h(n) = 11n2 + 9n + 3. Let q be (2 - 2/4)2-3. Let z(g) be the first derivative of 2g2 - 4 + g + 5/3g*3. Give qz(b) + 4h(b). -b2 + 3 Let w(c) = 7c + 7. Let q(u) = 13u + 37. Let h(p) = -8. Let l(x) = 3h(x) + q(x). Suppose 57 = -5v + r, -4 = -r - r. Calculate vw(y) + 6l(y). y + 1 Let i(z) = 20z + 9. Let g(n) = 63n + 28. Let o(m) = 5g(m) - 14i(m). Let c(b) = 7b + 3. Give 14c(a) - 3o(a). -7a Let c(t) = t2. Let x(p) = 14p*2. Suppose 0 = 41j + 147 - 24. Determine jx(d) + 48c(d). 6d2 Let y(d) = -10d*3 - 4d + 4. Let n(i) = i*3 - 13i*2 + 27i - 30. Let u be n(11). Let h(v) = -60v3 - 25v + 25. What is uy(f) - 4h(f)? -10f3 Let m(f) = -4f - 16. Let b(r) = 5r + 19. Let d(n) = 5b(n) + 6m(n). Let k(x) = -36x + 30. Calculate -60d(p) - 2k(p). 12p Let m(a) = -73a*2 + 3. Let o(t) = 74t*2 - 2. Determine -4m(f) - 5o(f). -78f2 - 2 Let t(n) = 1. Let c(u) = u3 - 6u2 + 2u - 5. Let l = 64 - 69. What is lt(z) - c(z)? -z3 + 6z*2 - 2z Let p(j) be the third derivative of -j4/12 + j2. Let q(i) be the first derivative of -3i2 - 519. Give 14p(l) - 5q(l). 2l Let c(f) = 15f + 10. Let g(j) = 14j + 9. What is -3c(s) + 4g(s)? 11s + 6 Let d(l) = 15l*3 - 11. Let f = 383 - 385. Let a(o) = -3o*3 + 2. Determine fd(t) - 11a(t). 3t*3 Let x(v) = 2v*2 - 36v + 35. Let o be x(17). Let k(c) = -c3 + c2 + 1. Let w(i) = 11i3 + 2i*2 + 2. Give ow(f) - 2k(f). 13f*3 Let i(x) = -38x*2 + 6x - 13. Let r(q) = 39q2 - 5q + 11. Determine 5i(l) + 6r(l). 44l2 + 1 Let m(h) = -h2 + 3h + 1. Let f be m(-1). Let k(y) = -2y3 - 8y*2 + 3y. Let u(a) = -2a3 - 7a*2 + 2a. Give fu(v) + 2k(v). 2v3 + 5v*2 Let b(u) = -134u*3 - 3u*2. Let q(n) = -12193n*3 - 274n*2. Calculate -274b(r) + 3q(r). 137r*3 Let d be (-4 + 0)/(-9 + 7). Suppose -7g = -dg + 10. Let r(l) = 2l + 9l3 + 0 - 1 - 2l*2 - 10l3. Let y(w) = w3 + w*2 - w. What is gy(v) - r(v)? -v*3 + 1 Let r(l) = 4l*2 - 138l - 17. Let m(b) = -3b2 + 92b + 12. Calculate 7m(w) + 5r(w). -w*2 - 46w - 1 Let i(a) = -2a2 - a + 8. Suppose 5w - 3q = -2q + 12, 2w = -4q - 4. Let f(l) = -l*w + 81 + 2l - 88 + 3l2 - l. Determine -6f(b) - 5i(b). -2b2 - b + 2 Let x(u) = u2 - u + 1. Let i(m) = 12m3 + 15m*2 - 15m + 15. Let c(y) = -5y3 - 7y*2 + 7y - 7. Let q(l) = -5c(l) - 2i(l). Calculate -q(z) + 5x(z). -z3 Let a(v) = 3v*2 - 14v + 8. Let l(y) = 3y2 - 14y + 9. What is -4a(x) + 3l(x)? -3x2 + 14x - 5 Let v(c) = c*3 + 3c*2 + c. Suppose -5j - 73 = -3r, -r + 13 + 18 = -5j. Suppose -4k - r = -9. Let i(w) = 2w*3 + 5w*2 + 2w. Give ki(b) + 5v(b). -b*3 - b Let b be (-2)/(-30) + (-5852)/(-420). Let m(f) = -2f*3 - 5f*2 + 5f - 5. Let p = 1 + 4. Let u(n) = 6n3 + 14n*2 - 14n + 14. Determine bm(i) + pu(i). 2i3 Let v(y) = 14y*2 - 3y. Let p(i) = -27i2 + 7i + 1. Calculate 2p(k) + 5v(k). 16k2 - k + 2 Let o(h) = -h2 - h. Let g(m) = 3m*2 + 7m - 3. Let w(v) = -2v2 - 8v + 4. Let f(t) = 4g(t) + 3w(t). Give f(c) + 4o(c). 2c*2 Let l(f) = f + 1. Let a(i) = 13i + 5. Let n(r) = r. Let q(u) = a(u) - 6n(u). What is 5l(k) - q(k)? -2k Let s(k) = -20938 + k - k2 + 20938 + 5k - k*3 - 5k. Let x(b) = -4b3 - 3b*2 + 3b. Let p = -2 + 3. Determine px(h) - 3s(h). -h*3 Let m(g) = 3g*3 + 24g*2 + 4g + 3. Let v(b) = 4b3 + 23b*2 + 5b + 4. What is -5m(r) + 4v(r)? r*3 - 28r*2 + 1 Let s be (-1 - 6/(-14))(-7)/2. Let r(k) = k*2 + 7k + 2k2 - 12k - s + 7k. Let m(t) = t2 + t - 1. What is 2m(v) - r(v)? -v2 Let b(u) = u2 - 3u + 2. Let m(i) = 3i*2 - 8i + 5. Let a = 257 - 253. Suppose 3y + 7 = -26. Give am(q) + yb(q). q2 + q - 2 Let n(s) = 7s - 6. Let k(l) = 8l - 7. Let g(c) = 6k(c) - 7n(c). Suppose 4x - 2x = 0. Let d(b) = -11b - 2 + 7b + xb - 2b2. What is -d(t) + 4g(t)? 2t2 + 2 Let m(q) = 3q*2 - 5q - 3. Let d = 0 + -2. Let s be (1/(-3) - d)3. Let y(c) = -c - 1. Give sy(a) - m(a). -3a2 - 2 Let f(w) = -12w3 + w2 + 8w - 9. Suppose 13y - 17 = 9. Let k(n) = 3n3 - 2n + 2. What is yf(j) + 9k(j)? 3j3 + 2j*2 - 2j Let p = -237 - -240. Let f(w) = -9w + 7. Let g(y) = -5y + 4. Give pf(j) - 5g(j). -2j + 1 Let d(j) = -36359j*3 - 1442j*2 - 721j + 721. Let q(w) = -202w3 - 8w*2 - 4w + 4. Determine 4d(u) - 721q(u). 206u3 Let a(y) = 14y + 1702. Let g(l) = 6l + 680. Give 5a(v)	{ "pile_set_name": "DM Mathematics" }
20u2. -36u*2 Expand (y - 5y + 5y)((-2y + 5y - 2y)(4 + 0 - 3) + y - 3y + 0y). -y*2 Expand (0 + 0 - v)(17 + 8 - 16)(v + 2v - 2v). -9v*2 Expand (2s3 - s3 - 3s3)(-2 + s*2 + 2) + (1 - 4s*2 - 1)(-5s3 + 3s3 + s3). 2s5 Expand (4r*2 + 2r*2 - 5r*2 + (3r + 4r + 3r)(1 - 1 - r))(r - 3 + 3). -9r3 Expand (-2 - 1 + 2)(2c - 2c + c) + 7c + 12 - 2c - 10 + 2c - 3c - c. 2c + 2 Expand (3j*2 + 0j*2 - 4j*2)(0j2 - 2j*2 + 3j*2) + (3j*4 - 2j*4 - 2j*4)(-4 + 5 + 2) + 4j4 - 4j*4 + 2j*4. -2j*4 Expand (4i - 2i + 0i + (-3 - 2 + 6)(2i + 2 - 2) + (0 + 3 - 1)(2i - 4i - 2i))(0 - 4 + 3). 4i Expand (-71 - n + 71)(9n*3 + 2n*3 - 10n3). -n4 Expand -4l4 + 2l4 + l4 + (-l*3 + 0l*3 + 2l*3)(5l - 2l - l) + 2l4 + 2l - 2l. 3l*4 Expand (-2w*3 - 4w*3 + 5w*3)(-4w2 - 3w*2 - 2w*2) + (-w - w + 0w)(-2w*4 + 3w*4 + 2w*4) + 4w*5 + 2w*2 - 2w*2. 7w*5 Expand ((2 - 3 - 1)(3a - 1 + 1) - 3a - 1 + 1)(2a*2 - 2a*2 + 2a*3). -18a*4 Expand (3g + g - 3g)(-3 + 0 - 3)(-2g + 5g - 2g). -6g2 Expand 46f*3 + 11f*5 - 46f*3 - 3f*5 - 2f*5 + 4f*5 + (-3f*4 + 2f*4 + 2f*4)(-1 + 2f + 1). 12f*5 Expand (6 - 1 - 4)(-5 + 12i + 2 + 1)(-1 + 3 + 0) - 5i - 1 + 1. 19i - 4 Expand 22d2 + 8d*2 + 9d*2 + (-2d - d*2 + 2d)(3 - 3 + 2) - 3d*2 - 2d*2 + 3d*2. 35d*2 Expand (-3v - v + 8v)((-1 + 2v2 + 1)(-3v2 + 2v*2 + 3v2) - 2 - v4 + 2). 12v5 Expand -2 + 2 - f3 + (-3f + 2f - f)(-5f2 - f2 + 4f2) + f3 + 4f3 - 3f*3 + (0 - 3 - 1)(4f3 - 2f*3 + 0f*3). -3f3 Expand (v2 + v2 + v2)(v + 0v + v) + 8 - v*3 - 8. 5v*3 Expand 2v2 + v2 - 4v2 + (2v*2 - 4v*2 + 3v*2)(-1 + 2 - 2)(-1 + 3 - 9). 6v*2 Expand (15d*2 - 144d + 144d)((-1 + 1 + 1)(5d - d - 2d) + 2d + 2d - 3d). 45d3 Expand 4k*3 + 3k3 - k3 + (-2k - 2k*3 + 4k - k)(2 + 0 + 0). 2k*3 + 2k Expand (0 + 0 + 1)(-m - 3 + 3 + (1 - m - 1)(1 + 1 - 1) + 5m - 2m - 5m). -4m Expand (-2b2 + 0b*2 + 3b*2)(2b - 1 + 1)(-7b + 2b + 0b). -10b*4 Expand (0n*2 + 0n*2 + 2n*2 - 1)(5 - 1 - 2 + (-1 + 1 + 2)(1 + 0 - 2) + 3 - 2 + 0 + 3 + 0 - 2 - 5 + 2 + 5). 8n*2 - 4 Expand (-1 + 2 - 2)(1 + 2v3 - 1). -2v*3 Expand (2a*2 - 4a + 4a)(1 - 3 + 3) + 3a2 + 3a*2 - 4a*2. 4a*2 Expand (2c*2 - 4c2 + c2)(-1 + 2 - 3) - 3c*2 + 4c*2 - 2c*2 - 12c*2 - 17c*2 + 47c*2. 19c*2 Expand (-2 + 2 + 5 + s)(2 - 2 - s)(0s + 0s + 2s). -2s3 - 10s*2 Expand (-4i*2 + 2i*2 - 6i*2)(5 - i - 5). 8i3 Expand ((-3w*4 - 3w*4 + 4w*4)(4w + 1 - 1) + 3w*5 - 5w*5 + 3w*5)(-2 + 5 - 1). -14w5 Expand -4 + 4 + j + (0j - 4j + 3j)(2 + 0 + 1) - 2j - 5j + 6j. -3j Expand (2 - 2 + 2d)(2d*3 + 3d*3 - 4d*3) + (-16d*2 + 16d2 + d3)(6d - 3d + 2d). 7d4 Expand (f3 + 0f*3 + 0f*3)((2f - 4 + 4)(1 + 2f - 1) + 0f + 0f + f2). 5f*5 Expand 3g - g - g + (-4g - g + 3g)(1 - 3 + 1) + g + 4 - 4 + g - 4 + 4. 5g Expand (4 - 1 - 2)(-3b + 2b - b). -2b Expand (b*2 + 52 + 2b*2 - 79)(5 - 4 - 2). -3b2 + 27 Expand (0o - 5o - 2o)(-5o*2 - 1 + 1). 35o*3 Expand (2 + 13x - 13x + x3)(-2x + 2x + 4x2). 4x*5 + 8x*2 Expand (5f*3 + 2f*3 - 5f*3)(-f*2 + f - f) - 8f*5 + 10f - 10f. -10f5 Expand (-l4 + 0l4 - 4 + 6)(-14 + l - 2l + 58). l5 - 44l*4 - 2l + 88 Expand (-2 + 2 + 5)(5 - 4 - n + 0n). -5n + 5 Expand -k3 + 3k3 - k3 + (12k - 12k + 5k2)(-2k - 2k + 2k). -9k*3 Expand 0 - 2b + 0 + (-3 - 2 + 7)(b - 3b + 4b). 2b Expand 0 + v*2 + 0 + (v + 2v - 2v)(v - 7v - 8v). -13v2 Expand 3l*4 - 3l*4 + 2l*4 - 2l*2 + (0l2 + l3 + 0l2)(0 + 2l + 0). 4l*4 - 2l*2 Expand (-1 + 8 - 4 - 4v)(-1 + 0 + 0). 4v - 3 Expand 51m5 - 26m*5 - 6m5 + (m2 - 5m + 5m)(2m + m*3 - 2m) + 5m - 5m + m*5. 21m*5 Expand ((3 - 2 - 3)(1 - 1 + 2) - 4 + 2 + 1)(-d + 4d - 4d - 1). 5d + 5 Expand (-36 + 3 - 5)(-2 + 2 + x). -38x Expand (-2c3 - 4c*3 + 4c*3)(3c - c + 0c)(4 - 4 - 3c). 12c5 Expand 4x*2 + 2x*2 - 4x*2 + (2x + 0 + 0)(-5x + 3x + 0x) - 4 + x*2 + 4 + 0x2 - x2 - 2x2 + (-2x + 3x + 0x)(0x + x + 0x). -3x*2 Expand (60 + 42 - 63)(-2a3 - a4 + 2a*3). -39a*4 Expand (-24j - 20j - 9j)(-j3 - j3 + 0j*3). 106j*4 Expand (j + 4j - 4j)(5j + 8j - 2j). 11j*2 Expand (v + 5v - 4v)(-v*3 - 3v*3 + 6v*3 + 6). 4v*4 + 12v Expand -5y2 - y2 + 2y*2 + (0y2 + y2 + 0y2)(-4 + 2 + 4). -2y2 Expand (30a*2 - 38a*2 - 17a*2)(-1 + 3 - 4). 50a2 Expand (35t - 11t + 15t)(t + 4 - 4). 39t*2 Expand (-3k + k + 3k)(7 - 2 - 1)(-301 + 97 + 154). -200k Expand (3i - 2i*2 - 3i)(1 + i2 - 1) - 4i*4 + 16i*2 - 16i*2. -6i*4 Expand 3a*5 - 2a*4 + 2a*4 + (-4a*4 - 5a + 5a)(5a + 4a - 2a). -25a*5 Expand (0 - 2 + 0)(6 + 2 + 3t - 10). -6t + 4 Expand (2z + 2 - 3 + 3)(2z2 + 2z - 2z). 4z*3 + 4z*2 Expand (1 - 2 - 2)(-3f + 0f + f) + (-2f - f + 4f)(3 - 2 + 1) + 0f + 3f - f + 3f + 4f - 4f + (3 - 4 - 1)(f + 0f - 3f) - f - f + 4f. 19f Expand (2a*4 + 0a + 0a)(2a - a + 2a)(-1 - 8 + 26). 102a*5 Expand (4x - 6x + 3x)(-2x + 4x + x) - 8x*2 + 0x*2 + 6x2. x2 Expand (-6 + 3 + 0)(u4 - u4 - u5) + (-1 + u + 1)(-2 + 2u4 + 2). 5u*5 Expand (2d + 1 - 1)(11d*2 - 33d*2 + 11d*2)((1 - 3 + 3)(d - d - d2) + 0d*2 + 5d*2 - 3d*2). -22d*5 Expand (-4 + 14 - 30)(0h3 - 3h*3 + 4h*3). -20h*3 Expand (-4s - s + 6s)(-4 + 0 + 1). -3s Expand (2x + 3 + 2 - 3)(-6x*2 + 4x*2 - 2x*2). -8x*3 - 8x*2 Expand (3r - 2r + r)(87r2 - 87r*2 - 9r4 - r3). -18r5 - 2r*4 Expand (-k - 4k*2 + 3k*2 - 30 + 29)(-5k3 - 18k*2 + 18k*2). 5k*5 + 5k*4 + 5k*3 Expand -16p*3 + 8p*3 - 7p*3 + (4p + 0p - 2p)(p2 - 5 + 5) - p3 + 2p3 + p3. -11p3 Expand (270 + 43s - 270)(0s*3 - 2s*3 + 0s*3). -86s4 Expand v4 - 4v4 + 2v*4 + (v - 3v + v)(10v3 + v3 - 2v3). -10v*4 Expand 9g - 3g2 - 9g + (-1 + g + 1)(-2g + 4g - 3g) + (0 + 0 + 1)(4g*2 - 2g*2 - 3g*2). -5g*2 Expand (2 + 3j - 2)(6 + 3 + 1)(-1 + 0 - 1). -60j Expand (-2h + 2h + h)(4 - 8 - 1)(-h2 + 2h + 0h2 + 0h*2). 5h*3 - 10h*2 Expand 0q - 2q + 0q + (-q - 1 + 1)(4 + 0 - 3) + 0 - q + 0. -4q Expand (-1 - 1 + 1)(-5y + 4y + 8y)(-2y + 2y + 2y). -14y2 Expand (-489 - 35s*2 + 489)(0s + 0s - 2s3). 70s*5 Expand (0i3 - i3 + 2i3)(0i - 2i*2 + 0i) - 3i5 + 2i*4 - 2i*4 + 12i*3 - 12i3 - i5. -6i5 Expand (-9 + 7 - 12)(2a + 3a*3 - 3a + a*3 + 2a*4). -28a*4 - 56a*3 + 14a Expand (-7i2 + 4i*2 - 4i*2)(-i + 2i - 2i + 2i - i - 3i + i - 2i + 3i - 2i - 1 + 1 + (2 + 4 - 5)(-i + 4i - 5i) - 3i - 2i + 6i). 28i*3 Expand (4 + 1 - 4)(4 + 1 - 2)(0j*3 + 2j*3 + 4j*3). 18j*3 Expand (-9x - 8x + 8 + 19x)(0 + 2 - 4). -4x - 16 Expand (3w + 4 - 4)(3 - 3w - 3) + (-3 + 2 + 2)(3w2 - 3w*2 - 3w*2) + 0 + 0 - 2w*2. -14w*2 Expand (0u + u - 3u)(-2 - 2 + 2) - 2 + 2u + 2. 6u Expand (9d + d - 7d)(0d*2 - 4d*2 + 2d*2). -6d*3 Expand (1 + 0q + 2q - 4)(2 - 2 + 2 - 5q). -10q*2 + 19q - 6 Expand (-1 + 1 + 1)(c - 2c + 0c + 0c - 2c + 7c + c + 4c - 2c - 2c - 3c + 3c + (1 + 1 - 1)(-2c + 3c + 0c)). 6c Expand (2g - 4g + 3g)(0 - 3g + 0 + (2g + g - g)(5 - 4 + 0)). -g2 Expand o4 + 2 - 5 + 1 + (53o - 8o - 17o)(6o3 + o3 - 3o3). 113o*4 - 2 Expand (9a - 2a + 9a)(-2a*3 - 2a*3 + 2a*3). -32a*4 Expand (-4h + 4h - 2h + 70)(0h + h + 0h). -2h*2 + 70h Expand (11r2 + 39r - 39r)(2 + 2r3 - 2). 22r*5 Expand -6k + 5k + 0 + 2 - 4k + 4k - 2k + (0k + 2k + 0k)(-3 - 4 + 4). -9k + 2 Expand (9p - 16p + 4p)(6p - p - 3p)(5p3 - 4p3 + p3). -12p5 Expand -6b - 7b + 2b + (3 - 2 + 1)(4b + 3b + 7b). 17b Expand (3 - 1 - 1)(-q - 2q + 4q) + 11q + 2q - 1 - 9q. 5q - 1 Expand (0o2 + 0o2 + o2)(-6o + 4o + 3o)(-o + 4o - o)*(	{ "pile_set_name": "DM Mathematics" }
Let g be (-3 + 2)1 - c. Let j be (-1 - (-1 + 1))g. Is 1/32 < j? False Let u = -1546 + 109764/71. Let r = -24229 + 24228. Which is greater: u or r? u Let l(s) = 2s3 + 5s*2 - s - 2. Let p be l(2). Let z be 8/p + 3/(-12). Which is smaller: -2/1975 or z? -2/1975 Suppose -102 = 8y - 21y - 882. Which is bigger: y or -784/13? y Suppose -15s - 87 = -18s. Let c = s + -32. Let i be 0 - (0/3)/c. Is 2/7 < i? False Suppose -49a - 98 = -49. Let y be 0 - (-2 - -4)/(-12). Is a at least as big as y? False Let a be 195489/28 + 3/12. Let q = -90721/13 + a. Which is greater: q or 3? q Let y = 8 - 8. Suppose -5s + 2s = y. Suppose l + 44 = 5l + u, u = s. Is l less than 10? False Let n = 18331 + -7273. Is n >= 11057? True Let h = -406 + 406.04. Let d = -11 + 29. Suppose -13p + 20 = -dp. Which is smaller: p or h? p Let f = 690 + -691. Is f >= -7/626? False Let w be ((-30)/(-9))/(6/234-1). Let m be 104/w5/14. Which is bigger: m or 0.07? 0.07 Suppose 11d - 2595 = 2n + 10d, 4n + 5195 = 3d. Is n less than -1295? False Suppose 0 = -26q + 110 - 344. Let i be q/27-15 + 8. Which is bigger: i or -5? i Let t(v) = 3v2 - 50v - 402. Let p be t(-7). Which is greater: 111 or p? 111 Let v be (-2)/8 - (-14)/(-8). Let f be 2/7 - 54216/126. Let n = 434 + f. Is n at least as big as v? True Suppose 3w = 3c - 3, 2c + 2w - 3w - 6 = 0. Is 2592 smaller than c? False Let f(v) = 12v - 849. Let w be f(32). Is w <= 7? True Let t = -587 - -583. Let r be (2/(-12))/(t/3144). Do r and 395/3 have different values? True Suppose 5a = -3r - 2r + 25, 20 = 4a - r. Suppose -p - aj - 6 = 147, 0 = 5p + 2j + 765. Which is bigger: -154 or p? p Let l be (27250/(-70))/(21/147 + 12/14). Do -390 and l have the same value? False Let b = 818 - 1195. Let n = b - -16. Does -361 = n? True Let g = 887 - 287. Suppose -74n + 49n + g = 0. Suppose 3q - 5b - 82 = 0, -q = 2q + 5b - 62. Is q <= n? True Suppose -8l - 15 = -13l. Suppose 3h + 9 = -4x + x, lx + 2h = -9. Let n be x/(-9)(-1 - 11). Is n equal to -5? False Let u = -2.7325 - -2.69. Is u >= 6/5? False Let y(j) = 18j3 + 4j*2 - 4j. Let q be y(1). Let s(z) = -z*3 + 16z*2 + 36z + 22. Let m be s(q). Is 15 < m? True Suppose -124 - 14 = -s. Suppose 3a = 4u + 93, 5a - 2u - s = -u. Let b = a - -3. Is 30 less than or equal to b? True Suppose -14v + 723 + 1867 = 0. Which is smaller: v or -0.02? -0.02 Let d = 926 - 1194. Let q be (d/(-10))/((-66)/10 - -7). Is 67 > q? False Let z be (1 + 0 + -3)-5. Suppose 4c = 5o - 21, -2c - o + z = 3c. Suppose 0 = 4b + 3w - 13, 3w - c = b - 8. Is 4 < b? False Let s be 4/18 - 17(-10)/45. Let n(z) = -z*3 + 5z*2 - 6z + 9. Suppose -4y + 4 = -12. Let d be n(y). Is s != d? True Let f = -838/33 + -10891/165. Which is bigger: f or -91? -91 Let h be 6 - (2/(-10))/(4/(-20)). Suppose hz = -3y + 112, 56 = 5z + 5y - 54. Suppose 5t + 2q = -25, t - z = 5t + q. Are -7 and t equal? True Let k = -0.226 - 2.524. Let x = 3 + k. Which is bigger: -1 or x? x Let k be 6/(-24048)(-1048)/18. Let f = -44/19 + 22082/9519. Let z = k + f. Is 1 at least as big as z? True Let y(b) = 134b*2 - 26b + 293. Let u be y(10). Do u and 13434 have different values? True Let z(c) = -2c2 + 52c + 1625. Let j be z(-45). Which is bigger: -4766 or j? j Suppose -1248 = 11w + 1095. Which is bigger: w or -423/2? -423/2 Let r(x) = x2 + 3x - 3. Let b be 3 + -5 + -2 + (-1 - 0). Let v be r(b). Let h be 0 + 138/v + (-8)/(-28). Is 19 not equal to h? True Suppose 3f - 2w + 659 = 2w, 0 = 3f + 5w + 614. Is -3 less than or equal to f? False Let g = -435919/321 - -1358. Let m(o) = o3 - 8o*2 + 76o - 384. Let p be m(6). Which is greater: g or p? p Let n be 1 - (25195 - 2) - 4. Let b be n/(-14) - -2 - 0. Let m = b + -1806. Which is bigger: -3 or m? -3 Suppose -5f + 56 = 4p, -11p - 76 = -4f - 9p. Which is bigger: -8 or f? f Let t = -128372908/809 + 158681. Is -1 > t? False Let l = 9119 + -9201. Let x be 2792/(-34) - (-36)/306. Is x at most l? True Let b(d) = -d2 - 5d + 9. Let v be b(-4). Let a(g) = -g*2 + 39g + 89. Let f be a(41). Is f greater than or equal to v? False Suppose -2c + 60 = -128. Let u(f) = 92f*3 + 2f*2 - 3f + 2. Let r be u(1). Is c <= r? False Let w = -3023 - -3023. Let r = -4.7 + 5.75. Is r != w? True Suppose -3p + 77 = -6p - 5g, 6p + g = -118. Which is smaller: p or -161/9? p Let y be (4/14)/((9/14)/9). Let s be y4/8-11. Let f = -12 - s. Is 9 greater than f? False Let w = -4633.1 - -4626. Is w at least as big as -2? False Let j be 2/14 + 3289/(-483). Let c = -17 - -10. Is c < j? True Suppose -5t - 9 - 51 = 0. Let s be t/(-27)2/8. Let l(m) = -3m3 - 59m*2 + 111m + 566. Let h be l(-21). Is s at least h? True Let u = 9/1286 + -7779/9002. Is u bigger than -2/115? False Let s = 6574.22 - 6574. Let q = 0.3 + -1.3. Which is smaller: q or s? q Let p = 1263 + -1263.2. Which is greater: p or -53.9? p Let t = 1316819/12 + -109522. Let p = t + -213. Is p bigger than 6/7? False Let o be (-4)/(-50) + (-50080)/1000. Which is smaller: -45 or o? o Let c = -3.4 + 3. Let y = -15972 + 15907. Which is greater: c or y? c Suppose -21m + 7m + 2240 = -42m. Which is greater: m or -45? -45 Suppose 624 = -9s + s. Let n = s - -71. Let t be 18/(21/n) + 0 + 0. Which is bigger: -5 or t? -5 Suppose -429d + 3720 = -274d. Suppose j - 4 + 2 = 0. Suppose 0 = -jf + 4 + 42. Which is bigger: f or d? d Suppose 2h - 3o + 547 = -8o, -2h - 539 = -3o. Suppose 153 = -2v - 2c - 397, 5c = 4v + 1073. Which is bigger: h or v? h Let m = -4042 + 4042. Is m at most as big as -24/323? False Let b be (1 + -1)/(4 - 5). Suppose 5 = 3v - 9z + 10z, b = 3v - 2z + 10. Which is bigger: v or -12/53? v Let x(v) = v2 + 11v + 12. Let k be 2 - ((-16)/(-10))/((-8)/(-60)). Let o be x(k). Is o bigger than -34? True Let b(x) = 22x + 1253. Let y be b(-57). Is y > -0.591? False Let i = 7275 + -7278. Let c = 0.29 - 36.29. Which is smaller: i or c? c Suppose 0 = -7u - 2u + 540. Suppose -6n = 6n - u. Suppose -nz - 100 = 5z. Does z = -11? False Let b be (88 - -35) + (4 - -2). Suppose 17n - 18n = -b. Which is smaller: n or 128? 128 Let p = -487/3 + 165. Let t = 18472 + -18469. Which is greater: t or p? t Let p(w) = -104w - 16602. Let g be p(-140). Which is smaller: -4/5 or g? g Let n(q) = -471q + 2537. Let x be n(6). Are x and -288 non-equal? True Let c = 22574 - 22161. Is 414 >= c? True Let d = -186 - -198. Let n = 11 - 11. Suppose -48 = -nq + dq. Do -8/3 and q have the same value? False Let v = -19873 + 19915. Which is smaller: v or 64? v Suppose 5g = 4g - 5, -3t + 28 = -2g. Let s be (-40)/(-12) + (8/t)/(-4). Suppose sd = -y + 15, -2d - 49 + 3 = -2y. Are y and 23 unequal? True Suppose 28 = 2y + 20. Suppose 7 = yj + u + 28, 0 = -4j - 3u - 23. Let h = 6 + j. Is h smaller than -1/6? False Let j = -22564.19 - -22565. Is -1/2 at most j? True Let v be 110 + 4/12 + 4/6. Suppose 0 = -3y - 66 + v. Suppose 3 = 18d - yd. Is 1/87 greater than d? False Suppose -93d = -120d - 47736. Which is smaller: d or -1766? d Let j(b) = 3b*3 - 14b*2 - 17b - 80. Let f be j(-6). Is -1134 greater than f? False Suppose -467 = 72g + 19693. Which is greater: g or -287? g Let o = -77181767/51 + 1513882. Let r = o - 514. Let h(u) = u - 1. Let t be h(2). Which is greater: r or t? t Let h(u) = 3u*2 + 23u + 2. Let i be h(-7). Let p be 6 - 2 - -1 - (-39)/i. Suppose 3g = -5 + 11. Which is smaller: p or g? p Let o be 1 + -1 + (-3348)/(-9). Suppose -558c = -556c - 2, 2f = -2c + 748. Does o = f? False Let f = -7 - -9. Let p be f/(-2)1 + (-21)/(-9). Let h = 22/21 - p. Which is smaller: h or -2/5? -2/5 Let h be (56/(-6))/((-36)/54). Suppose -hc - 891 = 131. Are -73 and c nonequal? False Let p = 0.0705 + 10.9685. Let z = p - 0.039. Let f = z - 11. Which is smaller: f or 2/15? f Let k(m) be the second derivative of m4/12 - 9m*3/2 - 17m*2 + 30m. Let o be k(20). Let h be (3/(-3) - 2)/(o/(-4)). Which is smaller: h or -3? -3 Let k = 28.81 - 28.54. Which is greater: k or -24/11? k Let y = 186 + -56728/305. Suppose -9j - 5i = -8j - 20, -3i - 16 = -5j. Suppose 5 - j = 4d. Is y at most as big as d? False Let z = -4882 + 4229. Is z > -649? False Let h be (2 - (-4100)/(-35))*126/54. Is -270 smaller	{ "pile_set_name": "DM Mathematics" }
.25 - 7.22. Let x = v + -0.03. Sort -0.5, x, -0.3 in decreasing order. x, -0.3, -0.5 Suppose 3y + 10 = 2v + 3, -y + 3v - 7 = 0. Put -3, -2, y in descending order. y, -2, -3 Let m = -0.15 + 0.25. Sort -1/4, m, 4 in descending order. 4, m, -1/4 Let m = 16.24 + -0.24. Let t = m + -14. Let g = 0 - 1. Put -0.1, t, g in descending order. t, -0.1, g Let n be ((-14)/35)/(-1 - (-18)/20). Sort -3, n, 6 in increasing order. -3, n, 6 Let k be (-3)/(-6)-21. Let u = 17 + -15. Put k, -5, u in decreasing order. u, k, -5 Let t(o) = 2o - 8. Let d be t(7). Let g(m) = -m*3 + 5m*2 + 8m - 8. Let s be g(d). Sort s, -2, -4 in ascending order. -4, -2, s Suppose -10 = -4y + 10. Let m be (-64)/14 + (-52)/(-91). Sort y, m, -2 in increasing order. m, -2, y Suppose j - 4v - 4 = 0, -2j + 1 = v - 2v. Let y = 0 + 2. Sort j, 3, y in ascending order. j, y, 3 Let j be 1 - ((-15)/(-24) - 0). Suppose k = -2k + 3. Sort j, k, -0.2 in decreasing order. k, j, -0.2 Let t(x) = x - 8. Let u be t(8). Suppose -l - 4 + u = 0. Put l, -3, 0 in decreasing order. 0, -3, l Let n be 8/(-68) - (-96)/(-340). Sort 14, n, 0.3. n, 0.3, 14 Let x be ((-1)/1)/((-7)/35). Let w = -9 + x. Sort 1, w, 3 in descending order. 3, 1, w Let c = -102 + 97. Sort c, -9, 2, -4 in descending order. 2, -4, c, -9 Let t = 2/143 + 133/715. Sort 2, 5/4, t, -0.5 in descending order. 2, 5/4, t, -0.5 Let a = 4 - -1. Suppose -2o - 2o = 0. Put -2, o, a in descending order. a, o, -2 Let r(o) = -o2 + o + 1. Let h(p) = p3 - 7p*2 + 9. Let q(j) = h(j) - 2r(j). Let s be q(5). Sort 0.4, 1, s. s, 0.4, 1 Suppose 2d = 4x - 2d - 24, 21 = x - 4d. Let k be ((-12)/(3/x))/1. Let b = k - -6. Sort 3, b, -3 in ascending order. -3, b, 3 Suppose 5o + 19 = 2c, -c + 4o + 9 = -2. Put -2/13, 0.1, c in increasing order. -2/13, 0.1, c Let i = -15 + 11. Put i, 2, -5 in descending order. 2, i, -5 Let p = 5.97 - 6. Let n = 3.97 - p. Let w = 0.14 - -4.86. Put 0.2, n, w in descending order. w, n, 0.2 Let v = 0.3 - 0.35. Let y = -4.05 - v. Put -2/13, y, -2 in descending order. -2/13, -2, y Let u(c) = -c3 - c. Suppose 5o - f + 0f = -10, -4o + 3f - 19 = 0. Let x = o - -2. Let y be u(x). Put -3, y, 3 in increasing order. -3, y, 3 Suppose -5t + 12 = -t. Let d be t/(4/4) + -8. Put 5, 1, d in decreasing order. 5, 1, d Suppose 4f + 3w = -w + 36, 26 = 3f + 2w. Sort 1, f, 4, -4 in increasing order. -4, 1, 4, f Let h = 0.4 - -1.6. Let d = h + -5. Let b = -0.8 - -1. Put d, -1, b in ascending order. d, -1, b Let x be 0 - 1 - 3 - -9. Put x, 8, -5 in decreasing order. 8, x, -5 Let k be (3/(-1))/3-5. Let n = 0.03 - 0.03. Let b = n - 0. Sort k, b, -2 in descending order. k, b, -2 Let j = 17 - 18. Put -5, 5, j in decreasing order. 5, j, -5 Let m be (-256)/(-18)(-21)/2. Let s = m - -148. Let f be 2/(-6) + 2/6. Put 1, f, s in decreasing order. 1, f, s Let t = 11 - 11.21. Let g = t + 0.14. Sort g, 1/3, 2 in increasing order. g, 1/3, 2 Let z(v) = -2v2 - 5v + 9. Let h be z(-4). Sort 0, h, -6 in decreasing order. 0, h, -6 Let a = -0.8 - -0.9. Let y = 0.3 + a. Suppose -5 = 2h + 3h. Sort -3, h, y in descending order. y, h, -3 Suppose 2r = 4d - 6, -d + 45 = 4d + 5r. Suppose 0 = -5v + x - 4x + 12, -4v + 16 = -dx. Sort v, -2/11, 0.5 in decreasing order. v, 0.5, -2/11 Suppose 0 = 2s + s - 9. Let a be (8/32)/(2/(-8)). Sort s, 1, a in ascending order. a, 1, s Let b = 69 + -68.7. Put -0.3, b, 1/6 in ascending order. -0.3, 1/6, b Suppose 76 = b + 77. Let f = 2 + -1. Put f, 2, b in increasing order. b, f, 2 Let m = 5 - 3. Let v = -2.4 + m. Let t = 0.2 + v. Sort -5, 5, t. -5, t, 5 Let o(x) = x3 + x2 - x - 3. Let v be o(-3). Put v, -1, -3 in ascending order. v, -3, -1 Suppose d - 3 + 5 = 0. Put d, 0, -1 in ascending order. d, -1, 0 Let q = 4.6 - 5. Let l = -2.9 + 2.6. Sort q, -2/7, l in descending order. -2/7, l, q Let l = -4.6 - -9. Let k = l - 4. Let w = 11 - 6. Put -3/2, k, w in ascending order. -3/2, k, w Let w = 11 + -34/3. Let l = -0.9 - 9.1. Let h = 9.6 + l. Sort 0.3, w, h in increasing order. h, w, 0.3 Let r be ((-15)/(-6))/(-5)0. Let c = -2 - r. Let b be c/(1 - 9/6). Sort -1, -3, b in decreasing order. b, -1, -3 Let k = 0.2 - -0.3. Let w be (-1172)/(-30) - 4/10. Let o = w + -571/15. Sort -1/2, o, k in increasing order. -1/2, k, o Let t = 4 + 2. Let r = t + -5.9. Let p = -11 + 7. Put r, -3, p in descending order. r, -3, p Let k(u) = -u*2 - 3u - 1. Let m be k(-3). Let s be (-2)/6-3 + m. Put s, -4, 3 in descending order. 3, s, -4 Let j = -2 + 9. Let n(f) = -f3 + 8f*2 - 5f - 9. Let b be n(j). Put 2, -2, b in descending order. b, 2, -2 Suppose 0 = 6m - m + 60. Let y = m - -11. Sort y, 4, 0. y, 0, 4 Let c = 6.05 - 0.05. Let q = 8 - c. Let g = q - 1.9. Put -3, g, -5 in decreasing order. g, -3, -5 Let s(b) be the second derivative of b5/20 - b4/6 + b3/3 + b. Let l be s(3). Let o be l/12-22. Sort 1, 0, o in decreasing order. 1, 0, o Let h = 3 + -5. Let u = -121/50 - 2/25. Sort u, 1/7, h in descending order. 1/7, h, u Let j = 0 - -3. Let a be (10/(-4))/(j/(-6)). Sort -5, 2, a in increasing order. -5, 2, a Let p = -13.66 - 0.34. Let u = -9.13 - -0.13. Let n = p - u. Sort 2/17, 1/2, n in descending order. 1/2, 2/17, n Let s be (-44)/16 - 4/16. Sort -4/7, s, 0.4, -0.1 in decreasing order. 0.4, -0.1, -4/7, s Let y be 4/(-10) + 82/(-120). Let s = y + 119/132. Sort s, 0, 4 in increasing order. s, 0, 4 Suppose 3 = 2z + 5. Let k = 7/22 - -2/11. Let d = -2/59 + 128/295. Sort d, k, z in increasing order. z, d, k Let g(f) = 5f - 50. Let l(h) = h - 10. Let s(p) = -2g(p) + 11l(p). Let o be s(8). Let r = -2 - o. Sort 3, r, -5 in increasing order. -5, r, 3 Let c(v) = v2 + 5v - 3. Let f be c(-5). Let h(x) = x*2 + 2x - 7. Let y be h(-3). Put y, 1, f in decreasing order. 1, f, y Let w be 1/(-4) - 9/12. Sort -5, w, -3 in increasing order. -5, -3, w Let z = 19.9 + -20. Let l = -9/8 + -3/8. Let d = -538/5 + 108. Put z, d, l in ascending order. l, z, d Let a = 223.87 + -222. Let l = a + 0.03. Let o = l - 2. Put -0.3, 4, o in descending order. 4, o, -0.3 Let r = -8 + 11. Put r, -0.6, -4/3 in descending order. r, -0.6, -4/3 Let n = -0.13 + -0.87. Sort 26, n, -3/5 in descending order. 26, -3/5, n Let m be (15/12)/(-5) - (-26)/8. Put -17, m, 5 in decreasing order. 5, m, -17 Suppose 4s - 2s = 66. Sort s, -3, -4. -4, -3, s Let q = 3 - 6. Let a be 68/102 - (-5)/(-3). Sort q, a, -4 in ascending order. -4, q, a Suppose 3r - 4r = 0. Suppose r = 4p - 7p - 18. Let a be 1-2(-3)/p. Put a, 1, -2 in descending order. 1, a, -2 Let z be 10/40(0 - 0). Sort -3, z, 1 in ascending order. -3, z, 1 Let q(s) be the first derivative of s3 - 3s*2/2 + 3s - 2. Let j be q(6). Let b be -2 + -1 - j/(-33). Put -0.2, 5/4, b in ascending order. -0.2, b, 5/4 Let r = -20.7 - -21. Sort -1/5, -4/3, r. -4/3, -1/5, r Let f = 8 - 11. Let i = -269/1419 - -1/129. Put i, -1, f in ascending order. f, -1, i Suppose 0 = -2v + 4v. Let r(k) = k*3 + 5k*2 - 1. Let h be r(-5). Let t = h - v. Sort 3, t, 2 in decreasing order. 3, 2, t Let y be (8/(16/(-4)))/(-8). Suppose -5 = -5p + 5. Put y, -0.2, p in descending order. p, y, -0.2 Suppose 0 = -7t + 3t. Let x(l) = -2l - 4. Let n be x(-4). Suppose 0 = nr + 2f + 16, 0f + 4 = -r - 4f. Sort 3, r, t in increasing order. r, t, 3 Let c(u) = 5u*3 + 2u*2 - u - 2. Let m be c(2). Let s be -2(m/(-8) - -3). Sort -4, -1, s in increasing order. -4, -1, s Let p(r) = 4r2 + 9r + 10. Let g be p(-1). Suppose -1 = 3q - 7. Sort q, g, -5. -5, q, g Let n = 0.2 - 0.2. Let l be ((-56)/(-42))/((-2)/9). Let f be 1/((-3)/(2l)). Sort 1/3, n, f in decreasing order. f, 1/3, n Suppose -a + 1 + 12 = -3p, 4p - 8 = -5a. Let t be 4/22 - 210/66. Sort 5, a, t in increasing order. t, a, 5 Let d = 0.3 + -0.1. Let y = -8 + 5. Let p = 0 + y. Sort 5, p, d. p, d, 5 Let w = 1 + -1. Suppose -7a + 9 - 16 = 0. Put -4, w, a in decreasing order. w, a, -4 Let q = -85 - -84. Sort q, -2/3, -9, -1/2 in decreasing order. -1/2, -2/3, q, -9 Let u = 2 + -2.3. Let b = 2.4 + -1.7. Let t = -0.5 + b. Sort t, -0.5, u. -0.5, u, t Let u be 6/(-10) - 124/10. Let z = -16 - u. Sort z, 5, 1 in increasing order. z, 1, 5 Suppose 2j - 10 = 2b - 2j, -3j = 4b + 42. Let o be (0 + -3)(-3)/b. Put o, 4, 5 in descending order. 5, 4, o Let o = 170 - 339/2. Sort	{ "pile_set_name": "DM Mathematics" }
alue in k, 3, p? p Let m = 64.969 - -0.031. Let u = 64.9 - m. What is the biggest value in 5, -8, u? 5 Let l = -135 + 134.2. Which is the second biggest value? (a) 3 (b) l (c) -4 b Let w = 26 - 22. Let q = -10.3 - 0.7. Let b = q - -8. What is the biggest value in w, b, -2/9? w Let q = -14.774 + -0.026. Let u = 15 + q. Which is the smallest value? (a) -3 (b) u (c) -1/8 a Let s = 4.83 + -0.43. Let q = s - 0.4. What is the biggest value in 2/9, -2, q? q Let n = 2.08 - -8.92. Which is the third smallest value? (a) 0.1 (b) -1/8 (c) n (d) -3 a Let v = -2441 - -2443. Which is the fourth biggest value? (a) v (b) 3 (c) -4/9 (d) -0.1 c Let s(y) = -y*2 + 14y - 13. Let j be s(13). Let i be (j - -2) + 48/(-28). Let m = -42 - -127/3. What is the smallest value in i, m, -0.3? -0.3 Let l = -26 + 26.2. Let s = -0.1 - l. What is the biggest value in 2/13, s, -2/5? 2/13 Let l = 124 + -123.8. Suppose 1 = -3g + 4. Let t = 2 - g. Which is the second smallest value? (a) l (b) t (c) -4 a Let i(x) = -x - 16. Let p be i(-14). Let q be (p/(-3))/((-18)/(-27)). Let s be ((-3)/(-6)-1)/q. Which is the third biggest value? (a) 0.2 (b) 0.4 (c) s c Let u be ((-60)/40)/(2/(-4)). Let t be (135/50 + -3)2. What is the third smallest value in u, t, 0, 1/4? 1/4 Let m be (-2)/(-9) - 3248/15750. Let p = m - -121/250. Which is the third smallest value? (a) -0.5 (b) p (c) -0.3 b Let b = -4 + 3.5. What is the second biggest value in 52, -2, b? b Let r be (2 - 0)12/(-12). Let y(w) = 3w3 - w2 + w + 2. Let u be y(r). Let i be 6/10 - u/(-30). What is the third smallest value in 3, i, -5? 3 Let g = 0 + -2/5. Let m be 4/32 - 52/672. Let r = m + 19/42. Which is the biggest value? (a) r (b) 15 (c) g b Suppose 13 = -3j - 4o, 4j - 6j + 14 = -3o. Suppose b + b = 3v - 79, 4v - 82 = -2b. Suppose v = -4c + 7. What is the biggest value in j, c, -0.4? j Let d = 1192 - 1192.3. What is the second smallest value in 13, d, -1/4? -1/4 Let x = 15.81 - 16. Let o = 0.646 - 0.746. Which is the second biggest value? (a) -4 (b) x (c) 5 (d) o d Let x be (1 - 0)(-3 - -2). Let k be (-25 + 26)(110)/(-2). What is the second biggest value in x, 1/3, k? x Let p = -71 - -62. Let l = -8.7 - p. Let t = 0.08 + -0.08. What is the smallest value in t, -0.4, l? -0.4 Let x be (-2)/(-3) - ((-316)/84 + 5). Let a = 2 + -7. Let l = 8 + a. What is the biggest value in x, -0.3, l? l Let u be -1 - (-28)/14 - (-10)/(-16). What is the third biggest value in 4, -5/8, u? -5/8 Let p = -8 - -19. Let g = p + -11. What is the second smallest value in g, -0.1, 16? g Let p = 132 - 131.8. Which is the smallest value? (a) 2 (b) -0.08 (c) 9 (d) p b Let o(r) = r3 + 5r*2 - 7r - 5. Let w(f) = 2f + 20. Let b be w(-6). Suppose -7v = -bv - 6. Let z be o(v). What is the third smallest value in -2, 1/4, z? z Suppose -w - 23 = c + 4, -5w + 72 = -4c. What is the third biggest value in 4, 0.1, 1, c? 0.1 Suppose -11 = 4b - r, 10r + 25 = 5r. What is the third biggest value in -3/7, -0.9, b, 1/8? -0.9 Let i = -1.2 - 0.2. Let h = 3.6 - i. Which is the second biggest value? (a) -0.05 (b) h (c) -4 a Suppose 2m - 5 = 55. Suppose 26p = 24p + m. What is the third biggest value in p, -1/7, 5/3? -1/7 Let j = -128.2 + 128. Which is the third smallest value? (a) 2 (b) 9 (c) j b Let d be -3 + 4 - (-6)/2. Suppose 44l + 464 = -20. Which is the second biggest value? (a) d (b) 2/9 (c) l b Let p = 0.1798 - -20.8202. What is the third smallest value in 3, p, 1/12? p Let c = 209 + -1459/7. Let v = -1 - -3/2. What is the smallest value in v, c, 1? v Let y = -71 - -62. Let q = -215 - -218. Which is the second biggest value? (a) -0.5 (b) q (c) -1 (d) y a Let c = 105 - 101.24. Let y = c - -0.24. Let g be (1/(-5))/((-12)/10). What is the second smallest value in y, g, -0.05? g Let u = -328 + 333. Let w = 0.1 - 0.1. What is the second biggest value in u, w, -5? w Suppose -2t - s - 9 = 2, 0 = -3t + s - 9. Let q be ((-258)/63 - -4)/(t/(-6)). Which is the second smallest value? (a) q (b) -2 (c) 4 a Suppose 5r - 213 = -38. Let k be ((-2)/(-1))/(r/(-5)). Which is the biggest value? (a) 0.3 (b) k (c) 0.4 (d) -4 c Let d = -119/3 + 40. Let v = -2311 - -2311. Which is the second biggest value? (a) v (b) -1/3 (c) d a Let b = 0.5 + -0.58. Let j = -3.92 + b. Let d = -12971 - -12971.2. What is the third biggest value in j, d, 2? j Let r = -59/112 - -13/16. Which is the third biggest value? (a) r (b) 3 (c) 0.6 (d) -5 a Let v be (-12 - -8)(1/(-2) + 0). Let q be (6/3)/(7/v). What is the biggest value in 0.1, -0.4, 0.2, q? q Let d = -78.5 - -50. Let t = -28 - d. Which is the third biggest value? (a) -1/2 (b) 0 (c) t a Let l(h) = 8h + 71. Let j be l(-9). Let p be 5/1 + -2 + 2. Which is the second smallest value? (a) -0.3 (b) j (c) p a Let q be (-102)/110 + (-2)/(-10). Let i be (15/((-225)/2))/(22/(-10)). Let l = q + i. Which is the smallest value? (a) 3 (b) l (c) 0.3 b Suppose 114 = 4w + 2w. Let z = w - 97/5. Which is the second smallest value? (a) 2 (b) -6 (c) z c Let h = 10.89 - 11. Let s = -2 - -2.51. Let o = s + h. Which is the second biggest value? (a) -3 (b) 3/11 (c) o b Let h = 1 - 5. Let p = 849 + -856. Which is the smallest value? (a) h (b) p (c) -2 b Let k = -586.9 - -587. Let v = 7.2 + -1.2. What is the second smallest value in 0.5, k, v, -5? k Let y be (2 - -2)/((-4)/(-18)). Let h = -14 + y. Let t = 5.3 - 10.3. Which is the second biggest value? (a) t (b) h (c) 5/2 c Let g = -9 - 10. Let z = g + 19.02. Let v = 4.98 + z. Which is the third smallest value? (a) v (b) 4 (c) -0.5 a Let z = -6.1 + 18.1. Let q = 13 - z. Which is the smallest value? (a) q (b) 0.3 (c) -5 c Let i = 638 + -636.2. Which is the third smallest value? (a) -2 (b) -5 (c) i (d) -0.2 d Suppose 7 = -58a + 7. What is the second biggest value in 7, a, -5? a Let c = 756974 + -14378993/19. Suppose 0 = -5f + 2o - 915, o - 15 = 4o. Let m = c + f. What is the third smallest value in m, -3/7, 2/3? 2/3 Let v be 90/(-24)16/6. Let w = v + 14. Which is the second biggest value? (a) w (b) -3 (c) 2/5 c Suppose 0p - 423 = -3p. Let n = 1267/9 - p. What is the biggest value in -1, n, 2/11? 2/11 Let b = 16 + -12. Let i = 192.07 + -197. Let n = i - 0.07. What is the third biggest value in -2/9, b, n? n Let r = 1 - 0. Let i = -0.06 + 0.06. Let s be 1/(-4) - (-12)/(-16). Which is the second biggest value? (a) i (b) r (c) s a Let z = 4 - 4.6. Let r = 1 + z. Let o = 130.8 + -131. What is the second biggest value in r, 3/5, o? r Let t be ((-8)/(-14))/((-62)/217). Let n = 5.12 - 0.12. Which is the third smallest value? (a) t (b) 1/6 (c) n c Let m(y) = y*3 + 8y2 + 1. Let z(s) = s2 - 19s + 40. Let w be z(16). Let t be m(w). Which is the biggest value? (a) -2/7 (b) t (c) -2/11 b Let k(f) = f + 6. Let h be k(-7). Let r = 9.9 - -1.1. Which is the second smallest value? (a) r (b) 1/3 (c) h b Suppose 0 = -5s + 25, -5s - 32 = 3p - 9s. Which is the second smallest value? (a) -0.5 (b) -21 (c) p c Let z = -342.3 + 342. What is the second biggest value in -0.031, z, -2/5, 0.2? -0.031 Let o = -0.44 + 19.44. Let f = o - 24. Let t = -4 - -6. Which is the biggest value? (a) t (b) -1/4 (c) f a Let x = 0.71 + -12.71. Let r = -17 - x. Which is the smallest value? (a) 1/4 (b) -1 (c) r (d) 1/5 c Suppose 7q - 4q + 12 = 0. Let y be 3/3 + -1 + -3. Let w = 1.65 - -0.35. What is the third smallest value in y, q, w? w Let m = -104 - -104.4. What is the fourth smallest value in -3, 0.1, -0.1, m? m Let h(d) = -52d - 567. Let b be h(-11). What is the smallest value in 2/13, 7, b? 2/13 Let i = 6.49 + -3.49. Let p be (-3)/(-2) - 0/(-1). What is the second biggest value in p, -2/13, i? p Let q = 1.923 + 0.077. What is the smallest value in 14, 2/7, q? 2/7 Let j be (5/(-3))/(-4 - -2). Let w(x) be the third derivative of x4/12 + x3 + 13x*2. Let p be w(-2). Which is the biggest value? (a) p (b) j (c) -1 a Let m = 16 + -11. Let h = 56.888 - -0.112. Let r = 61 - h. Which is the second biggest value? (a) m (b) r (c) 2/17 b Let t be (-115)/(-45) - (-175)/(-75). Which is the smallest value? (a) t (b) 0.096 (c) 2/5 (d) 3 b Let o = 18 + -3. Let y be 3/o - (-104)/(-920). Let w be 11/5 - (0 - -	{ "pile_set_name": "DM Mathematics" }
7 PM? 663 How many minutes are there between 9:23 PM and 12:38 AM? 195 How many minutes are there between 1:59 AM and 8:27 AM? 388 What is 538 minutes after 12:49 AM? 9:47 AM How many minutes are there between 5:06 PM and 4:23 AM? 677 What is 630 minutes after 2:40 AM? 1:10 PM What is 453 minutes after 6:40 AM? 2:13 PM What is 691 minutes before 11:19 PM? 11:48 AM How many minutes are there between 5:00 PM and 3:18 AM? 618 What is 149 minutes after 11:46 PM? 2:15 AM How many minutes are there between 6:13 AM and 12:52 PM? 399 What is 139 minutes before 1:56 PM? 11:37 AM What is 153 minutes before 11:26 AM? 8:53 AM How many minutes are there between 9:19 AM and 6:37 PM? 558 What is 310 minutes after 7:56 PM? 1:06 AM How many minutes are there between 5:33 PM and 2:19 AM? 526 How many minutes are there between 12:07 PM and 5:44 PM? 337 How many minutes are there between 11:03 PM and 7:49 AM? 526 How many minutes are there between 11:21 PM and 12:05 AM? 44 What is 59 minutes before 8:50 PM? 7:51 PM What is 501 minutes before 6:46 AM? 10:25 PM What is 681 minutes after 5:48 AM? 5:09 PM What is 576 minutes after 1:39 PM? 11:15 PM What is 432 minutes after 7:55 PM? 3:07 AM How many minutes are there between 3:47 AM and 10:47 AM? 420 What is 250 minutes before 4:09 PM? 11:59 AM What is 549 minutes after 4:32 AM? 1:41 PM What is 217 minutes after 8:21 PM? 11:58 PM What is 293 minutes before 12:09 AM? 7:16 PM What is 265 minutes before 6:33 PM? 2:08 PM How many minutes are there between 5:56 AM and 3:40 PM? 584 How many minutes are there between 3:53 PM and 4:02 PM? 9 What is 443 minutes after 3:36 PM? 10:59 PM What is 661 minutes before 12:34 PM? 1:33 AM How many minutes are there between 10:36 PM and 5:14 AM? 398 How many minutes are there between 2:40 PM and 3:33 PM? 53 What is 707 minutes after 11:33 PM? 11:20 AM How many minutes are there between 11:02 AM and 5:30 PM? 388 How many minutes are there between 3:22 AM and 10:48 AM? 446 What is 136 minutes before 3:19 PM? 1:03 PM What is 538 minutes after 11:56 AM? 8:54 PM How many minutes are there between 12:24 AM and 7:18 AM? 414 How many minutes are there between 10:48 AM and 4:59 PM? 371 What is 400 minutes before 11:41 AM? 5:01 AM How many minutes are there between 3:09 PM and 10:46 PM? 457 How many minutes are there between 10:52 PM and 12:36 AM? 104 What is 628 minutes after 9:23 PM? 7:51 AM How many minutes are there between 11:09 PM and 12:08 AM? 59 What is 588 minutes after 12:24 AM? 10:12 AM What is 709 minutes after 6:02 PM? 5:51 AM What is 576 minutes before 11:30 AM? 1:54 AM How many minutes are there between 12:08 PM and 10:42 PM? 634 How many minutes are there between 6:18 PM and 6:22 PM? 4 What is 543 minutes before 8:13 PM? 11:10 AM How many minutes are there between 5:44 PM and 8:34 PM? 170 What is 186 minutes before 5:34 PM? 2:28 PM How many minutes are there between 12:11 PM and 8:51 PM? 520 What is 419 minutes after 8:01 AM? 3:00 PM What is 204 minutes before 7:56 PM? 4:32 PM How many minutes are there between 4:52 AM and 4:21 PM? 689 What is 337 minutes after 8:00 PM? 1:37 AM How many minutes are there between 9:47 PM and 9:49 PM? 2 What is 560 minutes before 5:39 AM? 8:19 PM What is 665 minutes after 7:21 AM? 6:26 PM How many minutes are there between 9:34 PM and 8:10 AM? 636 What is 693 minutes after 6:48 AM? 6:21 PM How many minutes are there between 5:28 PM and 6:28 PM? 60 What is 680 minutes before 9:07 PM? 9:47 AM What is 111 minutes before 8:15 PM? 6:24 PM What is 611 minutes after 1:21 PM? 11:32 PM How many minutes are there between 5:03 PM and 6:05 PM? 62 What is 388 minutes before 3:00 PM? 8:32 AM How many minutes are there between 10:23 PM and 7:42 AM? 559 What is 317 minutes after 1:31 AM? 6:48 AM How many minutes are there between 12:40 PM and 6:08 PM? 328 How many minutes are there between 4:41 AM and 1:53 PM? 552 What is 253 minutes after 9:54 PM? 2:07 AM How many minutes are there between 6:03 PM and 7:34 PM? 91 How many minutes are there between 10:40 AM and 1:31 PM? 171 How many minutes are there between 1:25 AM and 7:36 AM? 371 How many minutes are there between 10:09 PM and 11:51 PM? 102 What is 387 minutes before 4:19 AM? 9:52 PM How many minutes are there between 11:34 PM and 7:34 AM? 480 What is 110 minutes before 11:17 PM? 9:27 PM What is 353 minutes after 11:01 PM? 4:54 AM What is 9 minutes before 2:08 PM? 1:59 PM What is 414 minutes after 10:21 AM? 5:15 PM What is 139 minutes before 11:59 PM? 9:40 PM What is 453 minutes before 11:05 PM? 3:32 PM How many minutes are there between 10:30 PM and 1:31 AM? 181 How many minutes are there between 8:55 PM and 3:53 AM? 418 What is 371 minutes before 1:27 PM? 7:16 AM How many minutes are there between 4:27 AM and 1:36 PM? 549 How many minutes are there between 5:46 AM and 1:33 PM? 467 How many minutes are there between 2:53 PM and 5:22 PM? 149 How many minutes are there between 2:04 PM and 12:09 AM? 605 What is 60 minutes after 9:32 PM? 10:32 PM How many minutes are there between 8:01 PM and 1:14 AM? 313 How many minutes are there between 2:40 PM and 12:50 AM? 610 What is 130 minutes before 5:18 AM? 3:08 AM How many minutes are there between 9:05 AM and 1:19 PM? 254 What is 76 minutes before 10:48 PM? 9:32 PM How many minutes are there between 5:14 PM and 10:37 PM? 323 What is 296 minutes before 12:44 AM? 7:48 PM What is 327 minutes after 7:15 AM? 12:42 PM How many minutes are there between 9:31 AM and 5:44 PM? 493 What is 240 minutes after 10:32 PM? 2:32 AM How many minutes are there between 4:44 AM and 3:44 PM? 660 How many minutes are there between 5:29 PM and 5:16 AM? 707 What is 543 minutes before 1:09 PM? 4:06 AM How many minutes are there between 9:20 PM and 9:14 AM? 714 How many minutes are there between 4:22 AM and 9:32 AM? 310 How many minutes are there between 4:41 AM and 2:23 PM? 582 What is 401 minutes before 11:54 AM? 5:13 AM What is 328 minutes after 11:24 PM? 4:52 AM What is 404 minutes after 11:20 PM? 6:04 AM How many minutes are there between 10:15 PM and 11:06 PM? 51 How many minutes are there between 12:48 AM and 12:27 PM? 699 What is 277 minutes after 11:26 PM? 4:03 AM How many minutes are there between 1:39 PM and 12:02 AM? 623 How many minutes are there between 6:45 PM and 2:46 AM? 481 What is 39 minutes after 8:27 AM? 9:06 AM How many minutes are there between 5:08 AM and 11:50 AM? 402 How many minutes are there between 12:23 AM and 5:18 AM? 295 What is 665 minutes after 10:26 PM? 9:31 AM How many minutes are there between 2:53 PM and 4:36 PM? 103 How many minutes are there between 11:10 AM and 11:24 AM? 14 How many minutes are there between 8:00 AM and 10:03 AM? 123 What is 655 minutes after 6:10 PM? 5:05 AM How many minutes are there between 3:12 PM and 5:52 PM? 160 How many minutes are there between 10:45 PM and 5:30 AM? 405 How many minutes are there between 4:02 AM and 9:33 AM? 331 What is 154 minutes after 7:36 AM? 10:10 AM How many minutes are there between 3:50 PM and 6:24 PM? 154 How many minutes are there between 4:30 PM and 1:54 AM? 564 What is 62 minutes after 7:33 PM? 8:35 PM What is 665 minutes after 8:14 PM? 7:19 AM How many minutes are there between 10:26 AM and 8:22 PM? 596 What is 102 minutes after 10:27 PM? 12:09 AM What is 644 minutes after 5:15 AM? 3:59 PM How many minutes are there between 1:00 PM and 10:18 PM? 558 What is 680 minutes before 7:31 AM? 8:11 PM How many minutes are there between 11:29 AM and 4:32 PM? 303 How many minutes are there between 2:02 AM and 11:00 AM? 538 What is 572 minutes before 10:44 PM? 1:12 PM How many minutes are there between 10:17 PM and 11:58 PM? 101 How many minutes are there between 9:15 AM and 9:35 AM? 20 How many minutes are there between 1:36 PM and 6:38 PM? 302 How many minutes are there between 9:24 PM and 6:52 AM? 568 What is 253 minutes after 11:46 PM? 3:59 AM What is 446 minutes before 3:30 PM? 8:04 AM What is 184 minutes after 9:12 AM? 12:16 PM What is 231 minutes before 9:08 PM? 5:17 PM What is 467 minutes after 5:59 PM? 1:46 AM What is 488 minutes after 2:19 PM? 10:27 PM What is 715 minutes after 12:23 AM? 12:18 PM How many minutes are there between 1:22 PM and 8:23 PM? 421 How many minutes are there between 7:34 AM an	{ "pile_set_name": "DM Mathematics" }
(-280) - -69) + 5/104? 1/8 What is 104/(-130) - ((-18)/333 - 27126/3330)? 37/5 Evaluate ((-6)/10(-55)/1364)/(32/(-4)). -1/62 What is (-48)/272 - (17556/(-646) - 25)? 52 Calculate ((-192)/(-9))/8 - 2486/3729. 2 Calculate 598/(-52) + (-429)/(-66) + 21. 16 What is the value of 224/(13216/(-3363))(-2)/(-6)? -19 3003/1716 + -3(4 + 7/(-3)) -13/4 What is the value of 227/5406 - 0 - (-348)/(-11832)? 2/159 Evaluate 75/140(-2260)/1695. -5/7 (-1852)/(-41670) + (-1892)/45 + -3 -45 Calculate 6 - (-120536)/(-18759) - (-1968)/4264. 4/111 Evaluate -13 - ((-20)/3)/(47(-19)/5358). -53 What is the value of ((-4791)/146924)/(6/32)? -4/23 Calculate (-48 - -82)-49/108 + -7. -55/3 What is (-1652)/(-1092) + (-10 + 1 - (-572)/78)? -2/13 What is (54/621)/(72/27 + (-44)/12)? -2/23 Calculate (1 - 38/8)/((45/756)/((-930)/1085)). 54 What is 10/(-35)(-28)/(-6)8708/4976? -7/3 What is the value of (27/(-5))/(17/425(-17 - -12))? 27 What is the value of -9 - (-130)/1(-34)/(-85)? 43 What is the value of 16 - (107 + 4969)/(-54)? 110 What is (((-297)/(-27))/88)/(-2 - 605/(-200))? 5/41 (-12)/10 + 479683/98565 11/3 Evaluate -15(-1)/12((-818)/(-10) + -1). 101 Evaluate (676/42 + (-1664)/104)31/((-1705)/(-66)). 4/35 What is (13 + -3 - -83)2/(-3)108/216? -31 Evaluate (-963)/(-276) + -3 + (-2316)/3088. -6/23 2/(-8) + 51912/194464 1/59 What is the value of 1/((-2)/126(-8722)/6230)? 45 What is the value of (-1377240)/87824 - 3/44? -63/4 (200/(-16))/(18 - 31) - -31/(-6) 6/13 What is 1736/(-744)(-612)/(-42)? -34 What is the value of (-24924)/(-2340) + 5/15 + ((-122)/13 - -9)? 53/5 ((-30234)/100780)/(2 + -5) 1/10 4293/1855 - 351/135 -2/7 (1219/244 - (127 - (30 - -92)))-4 1/61 What is 7 - 15/((-75)/(-260))? -45 Calculate (-30)/370 - (-35633)/481. 74 What is the value of -20 - (379 + -3)/(-272 + 268)? 74 Evaluate ((-6370)/(-20))/(-49)(-7 - 22/(-1 + -1)). -26 Evaluate (207/1242)/((12/(-54))/((-156)/9)). 13 Evaluate (-10)/4-110152/(-5308600). -1/127 Calculate 153 + (-63 - (-34 - -61)). 63 What is (-6 - -3)((-521968)/(-408))/101? -38 Calculate 3084/42 - (126 - (-209609)/(-8197)). 73 What is the value of 10 - ((-60 - 4161/(-73)) + (-44)/2)? 35 (2211/(-470206))/(2/(-116)) 3/11 Calculate (-2)/244848 + (-94)/204. -1/2 Evaluate (1 + (-13)/(-15))/(112840/161200). 8/3 Evaluate (73147/5306 + (-9)/7)/((-315)/(-54) - 6). -75 What is 6/41425/(-513) + 75/(-90)? -5 Evaluate 1984189/(-18921) + 198/(-5247) + 2/(-21). -105 What is -24 + -10 - -51 - (-2)/(-8)12? 14 What is the value of (-2)/13((-1872)/(-54) + -12 - (-108)/(-4))? 2/3 Calculate (-15906)/(-37114) + (-2)/((-1680)/(-346)). 1/60 What is the value of ((-32)/(-24))/(1717/(-51) - -19)? -1/11 What is 3/13237016/(-22790)? -12/5 What is the value of (-519 + 516)(-18)/(-189)? -2/7 Calculate ((-2304)/384 - (3 + 310/(-39))) + 4/6. -5/13 What is (9 + 1 - 0)(-6870)/212970? -10/31 What is 967 + -954 + -3 + 18 + -3 + 0? 25 Evaluate (9152/4312)/52 - 30/(-1666). 1/17 (-4)/20 - (8/(-22) + (-767)/3835) 4/11 What is the value of ((-13338)/(-195))/(-18) + 3? -4/5 Calculate (-2)/(-4)0 - 1066/2750. -6/25 What is the value of 11 + (-9)/(-3)22/(-990)117? 16/5 25004/(-5358) + ((-22)/(-6) - 3) -4 ((-368)/160)/(133/(-2660)) 46 70 + (360/(-300))/((-12)/(-220)) 48 Evaluate (-252252)/(-5390) - (-102)/(-15). 40 What is 22 + -3392/(-759)? 26 What is the value of (53/5)/((-758)/3790)? -53 (-342)/34 + 30290/3029 -1/17 5/(135/24) + (-72416)/57816 -4/11 What is the value of (4/(12/69))/((22/33)/((-126)/189))? -23 Evaluate 10 + (9 + -1)/(-4)(4212/(-24))/3. 127 What is the value of (-2)/(-2)2/(-27) + 46391680/724032? 64 Evaluate (-293)/(26956/(-1932)) - (2 - -36)/2. 2 Evaluate 157/4553 + 19130/290. 66 Calculate (52/16)/(2/(-20))63(-144)/(-45360). -13/2 What is 5(99 - (-107153)/(-1079))? -20/13 What is the value of (90/24)/((-5915)/(-182))? 3/26 Evaluate ((-12)/(-10))/((-742152)/(-141610) - (-4)/(-98)). 3/13 Calculate (-11)/((-462)/(-896))78/(-104). 16 What is (-3800)/240 + 16/(-6)-2? -21/2 What is 254000/10160 - (6/3 + -1 + -11)? 35 (-21)/18 + (31339/924 - 32) 3/4 Calculate (2/14)/(((-540)/27)/(-840)) - -34. 40 What is the value of -1 + (2072/(-232) - -9) + 149196/406? 71 (-1 - (-140)/42)(-16)/(-3528) 2/189 What is the value of (-5)/(-2) + 16541/556-2? -57 What is (37 + -33)/(283/(-5660))? -80 What is (-830)/(-22825) + (-468)/3795? -2/23 ((-49266)/969)/161 - (-656)/2318 -2/61 ((-11189)/268)/(-167)164 41 Calculate 3/(33/(-2)) + (328/2788 - (-834)/(-4488)). -1/4 What is -11 + 423/(-1645) + (-3)/(-15) + (-1332)/(-84)? 24/5 (-21)/7 - ((12 - 17) + 68/60) 6/5 Calculate ((-51)/(-45) - 1)/(-391 - -385)6. -2/15 What is (-1630)/6194 + 16/133? -1/7 What is (15/(-4))/((-249)/(-498))(-16)/69 - 2? -6/23 What is the value of (-70)/5775010-3(-5)/3? -2/33 Evaluate (-21)/138770/2695. -1/23 What is (-5 - -61 - 2680/48)/(46/(-60) - -1)? 5/7 What is ((-640)/180010/(-4))/((-1547)/(-306) + -5)? 16 Evaluate (2/6)/(-309 - (-20853274)/67485). 55 Evaluate 698733/(-14788) - ((-15)/12 - -3). -49 What is the value of (((-1820)/30)/13)/((7/210)/(2/5))? -56 What is the value of (-16 - 316/(-20))(-30)/279? 2/93 Evaluate (-19)/(-950)10 - ((-8)/60 - (-272)/6). -45 Calculate (-400)/5 - ((-5)/2)/((-3040)/1216). -81 What is the value of (-144 + 101)/(-1376)-11? -1/32 (-520)/(-2800) - (4/28)/((-11)/(-22)) -1/10 What is (6/3 + 0)/(28 - (81 + -39))? -1/7 Calculate (-32 - (-825280)/26112) + 48/136. -1/24 Evaluate (-39)/84 + -321/9824/54. -3/4 What is 15/(-27)6 - (-1615)/(-285)? -9 Evaluate ((-4)/(-4))/((-187)/17 + 8). -1/3 What is 2092/28 + (-13)/((-7644)/70)-6? 74 What is (3/9 + -1)2/10(-103740)/1976? 7 Evaluate ((-2316)/(-1158))/((-10)/320). -64 Evaluate (1 - 2/(-1)) + (-58544)/(-248812) + (-694)/204. -1/6 What is the value of 1/10 + 39407/(-1570) + 3/124? -24 Evaluate ((-82)/41 + 28/10)250/(-4). -50 What is ((-6)/(-5))/(2705/148775)? 66 Calculate ((-20 - -7)/65)/(20/(-1100))2/(-6). -11/3 Calculate (-3312)/((-2592)/(-36)) + 34. -12 Calculate 98/(-2) - 14940/332. -94 What is (-54)/((-1080)/(-1735)) + 89? 9/4 Calculate (8155/3262)/(-152 - -2). -1/60 Calculate 3/(-2)1/(-492)(-790 - -782). -1/41 What is the value of ((130 + -58)/(-8))/(2/(-6))? 27 Evaluate (5 - 7)/(2/(-1)(-131)/(-3013)). 23 What is the value of 744/(-3906)27/(-6)9? 4 ((-5)/(-6))/(1/(1215/900)) 9/8 44/(56/((-4536)/(-891)) - 21/2) 88 Evaluate 33/(-9)(-71 + 62)/(12/76). 57 Calculate ((-182)/(-182) - (5 + -3 + -6)) + 42. 47 37076/816270 - (-6)/(-105)-1 4/39 Evaluate (-28864)/583020 - (6/108 + 1/(-10)). -2/395 (-63)/12 - (-147)/39212 -3/4 Calculate (((-60)/720)/(3/64))/(-82 + 78). 4/9 What is (-88 + (127 - 155))(-1)/82? 29 What is the value of (-1098)/11 + -1 - (1608390/4554 + -353)? -101 11175/(-700) + (-5 - 2224/(-448)) + 139 123 What is the value of ((-3)/55)/((-1445)/(-2975) + 4/(-14))? -3/11 39(-322)/82808/84 - (-2)/36 -4/45 What is (2/(-8))/((-40)/(-10))(-640)/1040? 1/26 What is (21210/240 - 21/(-18)) + 40 + -2? 48 What is the value of 248/(-682)(-42966)/124? 126 Calculate (-1)/(37 - 36 - 13/((-260)/2090)). -2/211 What is (1143575/(-721450) + (-4)/(-47))/(-61/(-68))? -17 16/136 + (-23548)/24157 -6/7 What is the value of 14 + (366/(-182))/((-446)/(-3122))? -1/13 Evaluate (9/195-5-1)/(-3). -1/13 Evaluate ((-439569)/(-2106) - 206)/(2/36). 49 Calculate (-52 + 54)(16/(-14) - -1 - 7831/(-574)). 27 What is 54876/11322 + (-15)/1110? 29/6 Evaluate -17 + 25 + (4 - (-9)/18)(-6)/(-1). 35 Evaluate (6/2 - (-2560)/(-1472)) + -12 + 2 - -9. 6/23 Calculate (-2)/(-28) + 1781/910 + ((-680)/25)/17. 3/7 Calculate ((-7)/(-35))/(936/(-73800)) - (2 + -17). -10/13 What is the value of (-54 - -59) + 2695/40 + (-21)/56 + -4? 68 What is the value of -7((-35432)/602)/4? 103 What is the value of (-8711)/155 + (-495)/(-9)? -6/5 2(-5)/85 - 39(936/6800)/(-39) 1/50 Calculate (-37)/333261 + -22 + 13. -38 What is the value of -10 + -21 - (316/(-474))/((-2)/57)? -50 -85 + (-20 - (-3484789)/33187) 2/431 (-6)/5(27 + (-2920)/60) 26 What is the value of 100/840417/(-50) - (192/(-42))/4? 3/20 What is -7 - (-222)/24 - (303/24)/((-1)/(-2))? -23 35/(-3)6/(-10) - 6 - 14 - 81 -94 Calculate (-13 + ((-15996)/40)/(-31))5/6. -1/12 Calculate 3060/2220*37 - 12/2. 45 Evaluate ((-1)/132)/(6687/72 + -93). 2/33 (-24)/1	{ "pile_set_name": "DM Mathematics" }
2. 4i*2 Collect the terms in 11 - 16 + q + 0q - 25. q - 30 Collect the terms in -18602p3 + 37207p*3 - 18603p*3. 2p*3 Collect the terms in 5w + 183w3 - 3w + 7w3. 190w*3 + 2w Collect the terms in -10k - 144 + 10k - 9k3. -9k*3 - 144 Collect the terms in 86j*2 - 16j*2 - 3j3 + j3. -2j3 + 70j*2 Collect the terms in -43j + 0j3 + 39j - 6j3. -6j*3 - 4j Collect the terms in 12j2 + 0j*2 - 13j2. -j2 Collect the terms in 2m + 3 - 3m - 3. -m Collect the terms in 2j3 - 4j*3 + 3j*3 + 3j*3. 4j*3 Collect the terms in i - 3i - 3i + 2i. -3i Collect the terms in 30d - 13 - 15 + 28. 30d Collect the terms in 5d*2 + 0 + 0. 5d*2 Collect the terms in -2936 + 11v*2 + 2936. 11v*2 Collect the terms in -359 - 2t*3 + 359. -2t*3 Collect the terms in 3m - 16558m3 + 16563m*3 - 3m. 5m3 Collect the terms in 29f*2 + 37f*2 + 47f*2. 113f*2 Collect the terms in 58v*2 - 31 + 31. 58v*2 Collect the terms in -76k*2 - 11k*3 + 10k*3 + 76k2. -k3 Collect the terms in 21c + 52c - 2c. 71c Collect the terms in -17h - 19h + 14h - 13h. -35h Collect the terms in -10s - 8 + 60s + 8. 50s Collect the terms in h - 2h + 3h - 3h + 4h. 3h Collect the terms in 251983 + 7c - 3c - 251983. 4c Collect the terms in 4n2 + 121n*3 - 4n*2 + 45n*3. 166n*3 Collect the terms in 0 + 76w + 0 - 87w. -11w Collect the terms in 486a - 246a - 246a. -6a Collect the terms in 30d + 28d + 33d - 128d + 27d. -10d Collect the terms in 5m + 7m - 10m. 2m Collect the terms in 7q2 + q2 - 2q*2 - 2q*2 + 2q*2. 6q*2 Collect the terms in 109 - 11t*3 - 109 - 7t*3. -18t*3 Collect the terms in 5p - 24p + 6p + 2p + 4p. -7p Collect the terms in 6h*3 - 50h*3 + 51h*3. 7h*3 Collect the terms in 6n + 5n - 7n. 4n Collect the terms in -2 + 421c + 2 - 419c. 2c Collect the terms in 11296y + 11299y - y*2 - 22595y. -y*2 Collect the terms in 15b + 4974 - 4974. 15b Collect the terms in -38s - 59s - 32s + 11s. -118s Collect the terms in -86 + 16t + 86. 16t Collect the terms in -4x + 2x + 20 - 11. -2x + 9 Collect the terms in 0 - 9 - 14y - 2 + 12 - 3. -14y - 2 Collect the terms in -101j + 202j - 5j*2 - 101j. -5j2 Collect the terms in 2m - 18m - 24m*3 - m + 19m*3. -5m*3 - 17m Collect the terms in -4722 + 4722 - 2i. -2i Collect the terms in -58 + 4w2 + 58. 4w*2 Collect the terms in 13n*2 - 23n*2 + 11n2. n2 Collect the terms in p + 186p3 + 0p - 183p3 - p. 3p*3 Collect the terms in 127o*2 + 118o*2 - 247o*2. -2o*2 Collect the terms in -10 - 24i + 10. -24i Collect the terms in -g + 3g + 12 + g. 3g + 12 Collect the terms in 5m*2 - 13m*2 - 7m*2 + 9m*2 + 5m2. -m2 Collect the terms in 2657s3 - 3 + 3 - 2656s3. s3 Collect the terms in -1243r - 1239r - 8r2 + 2482r. -8r2 Collect the terms in -2k*3 - 26913k*2 + 26913k*2. -2k*3 Collect the terms in -54630 + 54630 + 30x*3. 30x*3 Collect the terms in 4u*2 + 20u - u*2 - 5u*2. -2u*2 + 20u Collect the terms in 19p2 - 44p*2 - 29p*2 - 32p*2. -86p*2 Collect the terms in 181823x - 2x2 - 181823x. -2x2 Collect the terms in -12k*2 + 0k*2 + 11k*2 + 23k - 23k. -k2 Collect the terms in -2u + 5u + 39u*2 + 0u. 39u2 + 3u Collect the terms in 3f3 + 6f*3 - 3f*2 + 3f*2. 9f*3 Collect the terms in -29879 - 8u + 29879. -8u Collect the terms in 2 + 0k + k + 1 - 3. k Collect the terms in b - 93 - 96 + 189. b Collect the terms in -52 + 52 - k2. -k2 Collect the terms in -92l + 46l + l*2 - 3l*2 + 46l. -2l2 Collect the terms in 430 - 2v + 251 - 245. -2v + 436 Collect the terms in 29m*2 - 17m*2 - 15m*2. -3m*2 Collect the terms in -6n*2 + 3n*2 - 3n*2 + 4n*2 + 3n2. n2 Collect the terms in -13d2 + 5 + 10d*2 - 5. -3d*2 Collect the terms in -30h + 3h + 4h + 16h + 2h. -5h Collect the terms in -11p - 3p2 + 11p - 7p3. -7p*3 - 3p*2 Collect the terms in -26 + 26 - 7f*2. -7f*2 Collect the terms in -818 + 1630 - 812 - 2s*3. -2s*3 Collect the terms in -42 + 42 - 8g*2 - 4g*2. -12g*2 Collect the terms in 16g - 21g + 10g. 5g Collect the terms in 18w*3 - 198w*3 - 178w*3. -358w*3 Collect the terms in 6b*2 + 2b*2 - 2b*2. 6b*2 Collect the terms in -46d + 2d2 + 48d + 43d - d2. d2 + 45d Collect the terms in 97q - 2 - 3 + 5 - 101q. -4q Collect the terms in -68055 + 2t*2 - 68056 + 136111. 2t*2 Collect the terms in -9f - 13f + 31f - 8f. f Collect the terms in -197i*2 - 200i*2 + 595i*2 - 195i*2. 3i*2 Collect the terms in -61s*2 + 60s2 + 3 - 3. -s2 Collect the terms in -4125z2 + 2068z*2 + 2059z*2. 2z*2 Collect the terms in -306m + 74m + 79m + 82m + 69m. -2m Collect the terms in 27n + 30n - 83n + 27n. n Collect the terms in -104 - 10x - 105 + 209. -10x Collect the terms in 0f*2 - 2f*2 - 4f*2. -6f*2 Collect the terms in -6g - 3g + 19g - 11g. -g Collect the terms in 7u*3 + 15u*3 + 5u*3. 27u*3 Collect the terms in -20j*2 + 42j*2 - 25j*2. -3j*2 Collect the terms in a - 31 + 0a - 139. a - 170 Collect the terms in 56x - 157x + 52x + 52x. 3x Collect the terms in 90h*3 - 48h*3 - 41h3. h3 Collect the terms in 0 + 1 - 6b + 0 - 4. -6b - 3 Collect the terms in -52999 + 52999 - 25q3. -25q*3 Collect the terms in -16h*3 + 34h*3 - 17h3. h3 Collect the terms in -268 + 268 - p. -p Collect the terms in -4s3 - 8s2 + s3 + 7s2. -3s3 - s2 Collect the terms in 1160k - 1160k + 5k2. 5k*2 Collect the terms in -166j + 41j - 46j. -171j Collect the terms in 4c3 - c3 - 4c3 - 89 - 16. -c3 - 105 Collect the terms in 7t + 12t + t + 7t. 27t Collect the terms in -o - 44864 + 44864 - o. -2o Collect the terms in 124g + 213g + 0g. 337g Collect the terms in 21c3 + 30c*2 - 52c*2 + 28c*2 - 6c*2. 21c*3 Collect the terms in 2g*3 + 0g*3 + 4g*3 + 8g*3. 14g*3 Collect the terms in 7d*3 + 135d + 2d3 - 10d*3 - 32d. -d*3 + 103d Collect the terms in 328 + 28v - 328. 28v Collect the terms in -22i2 + 79i*2 - 17i*2 - 21i*2 - 16i*2. 3i*2 Collect the terms in -49 + 49 - 7y. -7y Collect the terms in 5 - k3 - k3 + 6k*3 - 2k*3. 2k*3 + 5 Collect the terms in 934o*3 + 37o*2 - 37o*2. 934o*3 Collect the terms in -3j + 11 + 7 + 0j + 6. -3j + 24 Collect the terms in -14 + 34 - 4 - 16 - 2p. -2p Collect the terms in -3a3 + 45a*3 + 7a*3. 49a*3 Collect the terms in 8v*2 + 9v*2 + 2v*2 - 3v*2. 16v*2 Collect the terms in -19r*3 + 4r - 4r + 23r*3. 4r*3 Collect the terms in 3r + 9r2 + 2r - 5r. 9r*2 Collect the terms in -13 + 2 - 3y + 11. -3y Collect the terms in -294b*3 + 592b*3 - 296b*3. 2b*3 Collect the terms in 13a + 6a - 10a. 9a Collect the terms in -2m*2 - 5m2 - m2 - 85 + 3m2. -5m*2 - 85 Collect the terms in -7 - 43s*3 + 19s*3 + 25s3. s3 - 7 Collect the terms in -8c3 + 0c*3 - 4c*3 - 7c*3. -19c*3 Collect the terms in -289u + 143u + 148u. 2u Collect the terms in 8y + 6y - 10y. 4y Collect the terms in -72o - 2o2 + 7o + 3 - 3. -2o2 - 65o Collect the terms in 10j3 - 11j*3 - 10j*3 - 4j*3. -15j*3 Collect the terms in -10 + 5i*2 - 4i2 + 5 + 32. i2 + 27 Collect the terms in 14j3 - 8j*2 + 8j*2. 14j3 Collect the terms in t2 + 76 + t*2 + 49 - 3t2. -t2 + 125 Collect the terms in 8h3 - 78h*3 - 57h*3. -127h*3 Collect the terms in q + 132 + 124 - 256. q Collect the terms in -3l*3 - 832l*2 + 832l*2 - 3l*3. -6l*3 Collect the terms in 253h*2 - 253h*2 + 23h*3. 23h*3 Collect the terms in -810 + 810 - 3k*2. -3k*2 Collect the terms in -200z - 95z + z2 + 295z + z*2. 2z*2 Collect the terms in -15d - 19d + 37d - 1. 3d - 1 Collect the terms in 4f*3 - 5f3 + f3 + 3f3 - 4f3. -f3 Collect the terms in -7h + 6 + 3h + 2h. -2h + 6 Collect the terms in -42 + 42 - 5b. -5b Collect the terms in -1101x3 - 1115x*3 + 2226x*3. 10x*3 Collect the terms in -2d*2 + 3d**2	{ "pile_set_name": "DM Mathematics" }
ich is greater: f or m? f Let o = -319 - -93. Let t = o - -220. Which is smaller: t or 2/3? t Let r be (-6264)/(-928) + 1/(8/(-6)). Suppose 6q - 34 + 232 = 0. Which is bigger: r or q? r Let v be 1/2 - (-3)/(-6). Suppose v = -7m - 685 + 90. Is -82 at most m? False Let p = -1753 - -976. Let c be p/(-27) - -5 - (-2)/9. Let s = 28 - c. Which is smaller: s or -10? -10 Suppose 25b + 24b = 84b - 2555. Suppose -4t = -158 - 134. Is b at most as big as t? True Suppose -80d + 188d - 30456 = 0. Which is greater: d or 284? 284 Let y = -1477 - 2461. Which is smaller: y or -1/2? y Suppose -20z = -131 - 229. Let p be 5 - 12 - -2 - z. Is p less than -23? False Let c(j) = 12j*2 - 349j - 32. Let p be c(28). Which is smaller: 9 or p? p Suppose 5i - 5c = 90, 4i + 0c - 74 = 5c. Let y be 36/(-286) + i/(-88). Let v = 996/7 + -3977/28. Is y >= v? False Suppose -6u = 220 - 1288. Let l = u + -26. Which is smaller: l or 151? 151 Suppose 8 = -2r - 4. Let z be 12(-3)/(-6)(-15)/r. Let q be 22/z15/18 - 1. Is -4 at least q? False Let i(j) = -449j - 1271. Let x be i(-33). Which is smaller: x or 13547? x Let l(f) = -5038f - 25161. Let y be l(-5). Let r(o) = o*2 + 6. Let g be r(-5). Which is smaller: g or y? y Let w = -5515 - -82663/15. Let s = w + 49/5. Which is smaller: 6 or s? s Suppose 11j + 67 = 78. Let u be (-6)/(-15) - 144/310. Which is smaller: j or u? u Let z be (-10)/3(12/(-10) + 0). Suppose -2t - 17 = w, -5w + 28 = -zt - w. Let p be -2 - (-11 - t/4). Are p and 5 equal? False Suppose 0 = 2b + 7 - 11. Let v = -2/12287 - -74276/3403499. Let r = v + 5221/1939. Which is bigger: r or b? r Let l be (76 - 2/(4/6))/(38/(-114)). Is l at least -226? True Let p(c) = -1046c + 5067. Let v be p(6). Is v equal to -1204? False Let y be (11 + -5)4/3. Suppose 29g = 37g + y. Which is smaller: g or -2/47? g Suppose 3s + 44 = -5i, 4s + 5i + 82 = 30. Let y be (-2)/s-29 - 9/(-36). Does y = -2/9? False Let h(y) = -6y2 - 7y + 1. Let d(q) = -5q2 - 6q + 1. Let w = -6 - -10. Let m(g) = wh(g) - 5d(g). Let a be m(-2). Which is greater: 62 or a? 62 Let u = 225.0459 - 0.0459. Let l = u + -243. Is l not equal to 6? True Suppose 0 = -d + 4m - 310, -4d - m - 707 = 618. Let l = d - -354. Is 118/5 <= l? True Let f = 0.2 - 0.4. Let a = 13141.8 - 13129. Is f < a? True Let c = 8435 - 8432. Which is bigger: 0.1259 or c? c Suppose 0 = -118y + 6 - 124. Which is greater: -6/2911 or y? -6/2911 Let j = -3.046 - -2.8. Let f = 0.146 + j. Is f greater than 104? False Let j = 34463/5 - 6895. Let t(d) be the second derivative of -d5/20 + d4/2 - d3/3 + 9d*2/2 + d. Let k be t(6). Which is greater: k or j? j Let s(z) = -2z*3 + 4z*2 + 2z - 2. Let h be s(2). Suppose 29 = -hl + 1. Let m be 2 - (2/4)/(l/(-28)). Which is bigger: m or 6/29? m Let w = 44.9389 + -45. Let b = 0.0911 + w. Is -45 less than b? True Let b = 2 - 2. Suppose b = -0d + 2d - 50. Suppose 2t = -w - 30, 3w = -3t + 2t - d. Which is smaller: -0.1 or t? t Let y = -2.26 - -0.26. Let z be (-120)/48(-48)/10. Let o(b) = -b*2 + 11b - 9. Let t be o(z). Is t greater than y? False Let d(j) = -183j2 + 81j - 240. Let x be d(3). Which is bigger: x or -1643? -1643 Let m be 9/30 + -12 + 12. Suppose w - 3t = 2w - 2, 2w + 4t = 4. Suppose -2s = 3a - 0a - 15, 3a - 15 = ws. Which is greater: s or m? m Let h = -316 + 318. Suppose 0 = -5j - x + 2x - 151, 4j + 122 = hx. Which is smaller: j or -29? j Let a(i) = 2i*3 + i + 1. Let p be a(0). Which is smaller: p or -2/2991? -2/2991 Suppose -2m - d + 1 + 9 = 0, -4m + d + 8 = 0. Let v(r) = -2r + 9. Let l(g) = -1. Let n(h) = ml(h) + v(h). Let f be n(4). Are f and 2/3 nonequal? True Let b(p) = -16p*2 + 3p - 7. Let c be b(8). Let l = c - -7022/7. Let n(z) = 5z3 - z2 - 3z - 2. Let r be n(-1). Is l < r? False Suppose 770 = 110w + 770. Which is smaller: -1/9517 or w? -1/9517 Let h be 7/(7/(-2)) + (-6)/(-1). Let u be (8 - 7)h/(-170). Suppose 8n - 13 = -5. Which is greater: u or n? n Let b(y) = -3y2 + y3 + 4 + 16y - 4y*2 - 11y. Let f be b(7). Suppose 4w - f = 5w. Is -39 >= w? True Let b(t) = t*2 + 2t - 3. Let n be b(-3). Let o be (n - (-356)/(-30)) + (-38)/285. Is -15 less than o? True Let q = -1280 - -1196. Let t = -134/3 + 45. Is t greater than q? True Let p be ((-12)/(-60))/(18/(-30)). Let u = 1.33 - 1.3. Let j = u - -0.47. Which is greater: j or p? j Suppose 4d + 456 = -5p, -448 = 4d - p + 4p. Let x = d - 10. Let w be 1 + (-6)/18 - x/(-192). Which is greater: w or -1? w Let s(q) = 337q + 159. Let o be s(-9). Let b be -6 + o/(-239) + -1 + -5. Which is greater: b or 1? 1 Let y be ((-27)/4)/((-26)/2704). Suppose -3g + 6g + y = 0. Let n be (g/(-27))/(13/(-9)). Is -26 at most as big as n? True Suppose 46f + 380804 = 378f. Are f and 10310/9 equal? False Let m = 8280 + -8064. Is m greater than 211? True Let l = -2.6079 + -0.3921. Which is smaller: 8/55 or l? l Let w(t) = 8t - 8. Let j be 26((-1)/(-2) + 0). Let y be w(j). Let v = y + -68. Which is bigger: v or 0? v Let w(p) = -33p + 53p*2 + 2p*3 + 44p*2 - 109p*2. Let j be w(8). Let f = -9 - 0. Which is smaller: j or f? f Suppose 7d + 200 = 9d. Suppose -23w = -28w + d. Is w at least as big as 22? False Let t = 445 - 434.65. Let k = t + 1.45. Let h = k + -11.804. Which is bigger: h or -0.1? h Let x = -188 + 192. Let w be (-216)/(-52) - x - (-75)/(-65). Which is greater: -5/71 or w? -5/71 Suppose 0v + 3v = 5q - 2, 2v + 6 = q. Let z(k) = 3k + 65. Let y be z(-17). Let n(s) = s - 13. Let p be n(y). Is q less than or equal to p? True Let v(o) = o*3 - 90o*2 - 286o + 669. Let n be v(93). Let p be (-6)/4(-544)/12. Suppose -4w + 0 = -p. Is w > n? False Suppose -x - 3w = -11102, -55630 = -0x - 5x + 5w. Is x at most as big as 11120? True Let p = -8518 + 42733/5. Let u = 36 - 8. Which is greater: u or p? p Let c = -117 + 117.55. Let s = c + -3. Let q = 2.4 + s. Which is greater: q or 0.04? 0.04 Let r(v) = 1083v - 11668. Let a be r(11). Which is smaller: a or 241? 241 Suppose -5o + 110 = -100. Let v be 2068/220-5 - -42. Is v smaller than o? True Suppose 6o - 30 = 5i + o, -4i - 2o - 24 = 0. Let a = -42 - -39. Let q be -13 + ((-3)/a)/((-3)/i). Is -12 greater than q? False Let r = -2183 - 5179. Is -7363 less than or equal to r? True Let d(m) = 52m*2 + 7m + 12. Let h be d(5). Let i = -6769/5 + h. Let c = 1.3 - 2.3. Which is smaller: i or c? i Suppose 449o = 447o - q + 2, -3q = -6. Are o and -2/8695 equal? False Let j = -858 + 857. Is -2535 bigger than j? False Let s be 43/((-9546)/185) - (-26081)/(-30). Which is smaller: s or -2/3? s Let a be 45152/(-4420) - 1-10. Which is bigger: 0 or a? 0 Suppose -19m + 7 = -x - 22m, -2m = 2x + 6. Let z be x(3 + 1 - (5 - 2)). Which is smaller: -1/228 or z? z Let t = -25 - 14. Let f = -18 - t. Which is greater: f or -0.05? f Let p be (-52)/(-91)(-1)/(2/61). Which is bigger: 2 or p? 2 Suppose -4z = 4a - 276, -11 + 1 = -5a. Suppose 4l = 2i - 30 - 4, 3i = -2l + z. Is i != 21? False Suppose -27384 = -812n + 815n. Is n greater than -9129? True Let v = -1935 - -1936. Let j be (-22)/2 + 1/v. Let h be ((-6)/(-3))/((-2)/4). Does j = h? False Suppose 4 = 4a + 8. Let j be ((-2)/(a + 7))/(2/6). Let q(o) = -o3 + o2 + 3o + 2. Let z be q(j). Is z greater than -1? True Let i(k) = 26k*3 - 15k*2 + 3k - 4. Let s be i(4). Suppose -283 = -35m + s. Let z = -111 + 160. Is m at most as big as z? True Suppose 157v - 576 = 163v. Let w be (1 + 5/4)/((-9)/v). Is w not equal to 12? True Let r = -3554563/13 + 436311025/1599. Let a = r + 563. Let s be 2 - 41/2. Is a bigger than s? True Let z = 129 + -125. Let f be z/(-8) - (-15)/102. Which is smaller: -1 or f? -1 Suppose -185 = 47a - 579 + 206. Are a and 60/19 unequal? True Let l = -20 + 116. Let o = l + -96. Which is smaller: 0.2 or o? o Let a = -359 - -356. Let n be (-96)/a(-2 - (0 + -3)). Is -2 greater than or equal to n? False Let o = -144.9 - 11.1. Let z = 155.3 + o. Is z less than or equal to -3/8? True Let s be (-9246)/14 + (-45)/(-9) - 0. Let c = s + 655. Which is bigger: 3 or c? 3 Let j be ((-1)/((-6)/4))/(77240/(-7725) - -10). Which is smaller: 514 or j? 514 Let f = 5232 - 5192. Which is smaller: f or -1.2? -1.2 Let f(x) be the third derivative	{ "pile_set_name": "DM Mathematics" }
t is the remainder when 16 is divided by t(4)? 1 Let q be (400/15)/(-5)39. Let g = q + 216. Calculate the remainder when 68 is divided by g. 4 Suppose 2o - 175 = -3t, -5t - 291 = -5o + 2o. Suppose 4b + 35 = -21. Let q(l) = 8l + 144. What is the remainder when o is divided by q(b)? 28 Suppose 0 = 7u - 235 - 94. Calculate the remainder when (1684/(-8))/((-1 + 2)/(-2)) is divided by u. 45 Let p(a) = 208a - 95a - 64 - 92a. What is the remainder when p(11) is divided by 28? 27 Let a = 57 - -39. Let l(f) = 22f + 1. Let u be l(-14). Let s = u - -332. What is the remainder when a is divided by s? 21 Suppose -15y = 1639 - 2074. What is the remainder when 8206 is divided by y? 28 Suppose -9i = -7i - 4s - 32, 5s - 142 = -4i. Calculate the remainder when 2407 is divided by i. 27 Suppose 80 = 5h + m, -3h - 4m + 35 = -2h. Suppose 38f - 299 = hf. Calculate the remainder when 270 is divided by f. 10 Let t(i) = i3 + 7i*2 + i + 12. Let y be t(-7). Suppose -34 = yg - 84. Suppose gf - 636 = -106. What is the remainder when f is divided by 28? 25 Let m = 484 - 480. Suppose -3b = -j - 172, 53 = b + mj - 0j. Calculate the remainder when b is divided by 38. 19 Let i(q) = q + 9. Let m be i(-7). Suppose -601 = -mt + 417. What is the remainder when t is divided by 64? 61 Let n(w) = 3w*2 - 28w - 20. What is the remainder when 692 is divided by n(11)? 27 Let j be (1 - 2) + 120/10. Suppose 3y = -5z + 7, -z + 5z = 3y + j. Suppose -z = l - 41. What is the remainder when 112 is divided by l? 34 Let u = -1396 - -3375. What is the remainder when u is divided by 11? 10 Let f(x) = 38x3 + 7x - 18. Let y be f(2). Suppose 0 = -3c + c + y. Calculate the remainder when c is divided by 8. 6 Suppose -6k - 15 + 9 = 0. Let l(p) = -24p3 + 2p*2 + 2p + 1. What is the remainder when 95 is divided by l(k)? 20 Suppose 3p + 609 = 14c - 15c, -4c = 3p + 618. Let k = p - -292. What is the remainder when k is divided by 48? 42 Suppose 0 = p - 8p - 91. Let k(l) = l*3 + 12l*2 - 13l - 5. Let z be k(p). What is the remainder when 51 is divided by z/(-30) + 483/18? 24 Calculate the remainder when ((-63172)/51)/((-12)/18) is divided by 5. 3 Let y = -1671 - -2433. What is the remainder when y is divided by 45? 42 Let r(s) = -13s3 - 4s*2 - 17s - 38. What is the remainder when 395 is divided by r(-2)? 59 Suppose -3a + 240 = 3m, -25a = -m - 27a + 86. What is the remainder when m is divided by 61? 13 Calculate the remainder when (51 - 154)/(1/(-3)) is divided by 63. 57 Suppose 5u + 87 + 13 = 0. Let m be (4 + 112/u)-35. Let x = m - 50. What is the remainder when 7 is divided by x? 1 Let h be 12/8 + 3/2. Suppose 0p - 21 = -hp. Calculate the remainder when 5183/213 + (-2)/(-3) is divided by p. 4 Let r = -38 - -11. Let z(t) = -15 + 554t - 583t - 10t2 - t3 - 18t*2 - 36. What is the remainder when 14 is divided by z(r)? 2 Let d(r) = 6r*2 - 16r - 49. Let x = 89 - 63. What is the remainder when d(6) is divided by x? 19 Suppose -112 = -2w + 132. Suppose -n = -4t + 61, -t + 6t = 4n + 90. What is the remainder when w is divided by t? 10 Suppose 2 = -6j + 26. Suppose -5d + 262 = 3x - 28, 5d = jx + 325. Calculate the remainder when -51(16/(-3) + 3) is divided by d. 58 Let d = -306 + 308. What is the remainder when (d + -1)(-2765)/(-35) is divided by 42? 37 Let m be (-1 - -1)/(-15 - -12). Suppose -10 = -2z - m. What is the remainder when 234/(z/26/10) is divided by 53? 50 Let d = -1228 - -2604. Calculate the remainder when d is divided by 60. 56 Let y(g) = -g2 - 43g + 2561. What is the remainder when y(30) is divided by 5? 1 Suppose 4h + 3y = 2615, 0 = 175h - 176h + 4y + 611. Calculate the remainder when 1304 is divided by h. 10 Let t = -10114 + 10144. Calculate the remainder when 18149 is divided by t. 29 Let l = -1 + 4. Suppose 3a + 3j - 57 = -0a, 4a - 2j = 52. Calculate the remainder when -6 + 85/a3 is divided by l. 2 Let c = -24 - -40. Suppose 3o - 3m - 127 = -100, 0 = 5o + 2m - 31. Calculate the remainder when c is divided by o. 2 Let c be ((-78)/15)/(5/(-50)4). Suppose cj - 606 = 863. Calculate the remainder when j is divided by 32. 17 Suppose -3y + 81 = m + 2y, 3m - y = 147. Calculate the remainder when 550 is divided by m. 40 Let c(r) = 45r + 4. Suppose 3p - 8 = -2a + p, 2a = 4p + 8. Calculate the remainder when c(2) is divided by 36/(2 - 2/a). 22 Suppose 5a - 67 = 8. Let y(r) = 73r - 440. Let s be y(-7). Let z = -926 - s. What is the remainder when z is divided by a? 10 Suppose 3s - 15 = 45. Let m(w) = -4w - 15. Let z be m(-7). Let h(f) = f3 - 14f*2 + 17f + 5. What is the remainder when h(z) is divided by s? 17 Let k = -21078 + 21087. What is the remainder when (1 - -28)/(3/12) is divided by k? 8 Let r(h) = -h*2 - 9h + 8. Let w be r(-7). Suppose wf = 19f + 33. Suppose -80 = -3j + 43. Calculate the remainder when j is divided by f. 8 Let n(w) = -1. Let y(r) = -4r - 26. Let t(u) = 4n(u) - y(u). What is the remainder when t(7) is divided by 6? 2 Suppose 5071 = -50b + 16821. Calculate the remainder when b is divided by 59. 58 Suppose -79 = -w - 9. Suppose 1844 = -4u - 5m - 529, 4m + 2376 = -4u. Let i = u - -634. What is the remainder when w is divided by i? 33 Suppose 5h - 1209 = -0l - 3l, -l - 2h = -402. Suppose -l = 14u - 16u. Calculate the remainder when u is divided by 72. 60 Let k(m) = m*2 + 21m + 56. Let u be k(-18). Suppose -2z + 5 = s - 41, -4s + 204 = -uz. What is the remainder when s is divided by 13? 11 Suppose 0 = 101u - 98u - 3y - 411, -254 = -2u - 2y. What is the remainder when 516 is divided by u? 120 Suppose v = 3i + 6125, -36838 = -6v + 3i - 7i. Calculate the remainder when v is divided by 18. 17 Suppose 3p + 117 = 657. Let a = p + -164. What is the remainder when 205 is divided by a? 13 What is the remainder when (-2124)/(3 + -9) + 3 + (-7 - -10) is divided by 221? 139 Suppose 22 = 2u + 14, 2u = 3m - 46. Suppose -mp = 17p - 1470. Calculate the remainder when 65 is divided by p. 23 Let x(j) = 2j2 + 8j + 4. Let p be x(-4). Let b be p/(-10)(-20)/(-8). What is the remainder when 12 is divided by 3/b + 2 - -3? 0 Let f(s) = 4s + 3. Suppose 152a - 24 = 153a. What is the remainder when f(3) is divided by (-2)/(-6)(a + 36)? 3 Let w be ((-3)/(-3))/((-8)/(-32)). Let d be (w - 4) + 3/1. Suppose -5t - 5 = 0, dt - 58 = -2s + 5t. What is the remainder when 55 is divided by s? 27 Suppose -12r + 18 = -30r. Calculate the remainder when 154 is divided by 0 + 415/10 - r/(-2). 31 Let y(l) = -8l*2 - 47l + 156. Let j(r) = 5r2 + 23r - 78. Let s(b) = -5j(b) - 3y(b). What is the remainder when s(20) is divided by 12? 6 Let n(i) = -i*3 + 14i*2 - 280i + 2838. What is the remainder when n(11) is divided by ((-1)/2)/((-2)/88)? 11 Calculate the remainder when 22/4-558198/(108/(-6)) is divided by 80. 79 Suppose -2d = g - 401, -3g + 202 + 965 = -3d. What is the remainder when g is divided by 57? 51 Suppose 5k - 2y = 2k + 149, -k + 55 = -2y. Let m(x) = -2x*2 + 5x + 11. Let c be m(5). What is the remainder when k is divided by 4/(c/4 + 4)? 7 Suppose 2x + 18 = 2y, -2y - 1 = 2x - 3. Let s(m) = 2m + 5. Let q be s(y). What is the remainder when (-84 + q/5)-1 is divided by 21? 18 Let i(w) = w*3 + 8w*2 - 5w + 57. Let a be i(-8). Suppose -2p + 2h = -297 - a, -973 = -5p + 2h. Calculate the remainder when p is divided by 67. 59 What is the remainder when 1722712/391 + 1 + 2/23 is divided by 116? 115 Let s be (-9 + 8)/((-1)/(-68)). Suppose 4d + g - 528 = -g, 2d - 268 = -2g. Let q = s + d. Calculate the remainder when q is divided by 13. 10 Suppose -112t - 53t - 20402 + 164777 = 0. Calculate the remainder when t is divided by 218. 3 Suppose 13y + 15 = 14y. Let s(o) = -yo*2 + 597o*3 - 3 + 4 - 596o*3 + 2o. Calculate the remainder when 121 is divided by s(15). 28 Suppose -21c - 531 + 3412 = 361. Calculate the remainder when 486 is divided by c. 6 Let w = 2623 - 2393. Calculate the remainder when 471 is divided by w. 11 Let j(u) = 253u*2 - 60u - 205. What is the remainder when j(-4) is divided by 95? 93 Let v(x) = x*3 - 326x*2 + 4071x + 30. Let z be ((-4)/(-2))/((-1)/(-4)). Suppose -t + 11 + z =	{ "pile_set_name": "DM Mathematics" }
. What is the nearest to -0.1 in v, -4, -6? v Let d = -11/6 - -13/6. Which is the closest to 1? (a) 3 (b) -3 (c) d c Let w = -2187 - -2185. What is the nearest to w in -2/3, -77, -0.3? -2/3 Let h be ((-75)/500)/(12/10). Let n = 2 + -1. What is the closest to n in h, -0.2, 0.1? 0.1 Let j(w) = w3 + w2 - 2w - 5. Let i be j(4). Let n = i + -67. Which is the nearest to -2/5? (a) -3/2 (b) n (c) 4 b Let c = 165/7 + -24. Let k be (-4)/(-22) - (5040/55)/(-2). Let t be (-39)/(-26) - 1/36k. What is the closest to t in -2/9, c, -4/3? -2/9 Let g = 11.5 - 11.1. What is the closest to 4 in g, -0.3, -2/305? g Let d be 6/(-5) - 0 - -2. Let w = 1 + -1. Let k be (-3 - 0/1) + 172/60. What is the closest to w in d, 3/2, k? k Let q be 5/4 + (8 - 9). Let s = -176 - -172.14. Let i = s + -0.14. Which is the closest to q? (a) 5 (b) i (c) 1/5 c Suppose 3l = -4x + 9x - 8, 2l + 14 = -x. Suppose 3y + 0y - 5s = -35, -17 = 5y + 2s. What is the closest to -12 in 4, y, x? y Let v be 16/(-8) + (10 - 5). Which is the closest to 1/3? (a) v (b) 1.2 (c) -3 b Let w = -570 - -570.4. Let r = -33 + 32.9. What is the closest to r in 5, w, -5? w Let n = 23.8 - 55. Let y = 31 + n. What is the nearest to -0.2 in y, -1, -5? y Let t(i) = 136i*2 - 5i - 6. Let z be t(-1). Let y be -14/20 + 42/z. Let u = 234/35 - 51/7. What is the closest to -1/2 in y, 0.5, u? u Let k = 264 + -261. What is the nearest to k in -14/3, 1/4, -1/4? 1/4 Let r(j) = j3 - 14j*2 - 14j - 20. Let f be r(15). What is the closest to 2/11 in -1/2, f, -13, -1/9? -1/9 Let r = -1 + 4. Let d be ((12/(-4))/(-12))/((-2)/(-12)). Let m be 9/(-21) + (-4)/(-14). Which is the nearest to 3? (a) m (b) d (c) r c Let k = 2 + -5. Let m be (-56)/(-64)6/21. Which is the nearest to -1/4? (a) -1 (b) k (c) m c Let d = 0 - -0.1. Let p = 0.698 + -0.148. Let t = -0.85 + p. What is the closest to 0 in d, -0.4, t? d Let h = 175 - 175.1. Which is the nearest to h? (a) -0.5 (b) -1/5 (c) -1/6 c Let r = 9910 - 9909.5. Let h = -17 - -67. What is the closest to h in r, 2, -2? 2 Let k = -11.5 + 16.5. What is the closest to 9 in 1, k, -0.3? k Let n = -1.5 - -1. Let t = 178 + -886/5. Let h = 1/1812 + 1207/1812. What is the closest to 2/3 in t, h, n? h Let l be 6(-4)/9-3. Which is the closest to 1? (a) -0.05 (b) l (c) -1 a Let w(d) = d + 9. Let g be w(-6). Let y(s) = 2s*2 + 5s - 4. Let t be y(g). Let x be (t/10 - 3)-2. Which is the nearest to 0? (a) -1 (b) x (c) 2/15 c Let n be (-5)/(-33) - 29/87. Which is the closest to -1? (a) 0.4 (b) -0.2 (c) n b Let v(l) = -7 + 0l - 5l + 4l. Let d be v(-5). Let p = -23.4 + 25.4. What is the nearest to p in d, 0.6, -0.1? 0.6 Let w = 192 + -191.6. What is the nearest to 0.1 in 0, -1, w? 0 Let g = 135 + -134. Which is the closest to g? (a) -5/6 (b) -0.12 (c) 0.2 (d) -4 c Let k = -2 - -2.5. Let d = 0 - -0.1. Let h = -91 - -90. Which is the nearest to h? (a) d (b) k (c) 0.4 a Let x = -16 - -13. Let k = -126 - -125.5. Let j = 0.1 + 2.9. Which is the closest to 1/4? (a) x (b) j (c) k c Suppose -2q - 2q - 29 = -5x, 0 = -5q - x. Let r be (0 - -2)(-1 - -3). Let j = -1384 - -1381. Which is the nearest to q? (a) j (b) 2/9 (c) r b Let u = -511 + 511. What is the nearest to -0.1 in -4, 4, -7, u? u Let y = -47.6 - -47.4. Which is the closest to y? (a) 2/5 (b) 5 (c) 0.5 (d) 2/11 d Let v be 66/165 - 16/901. Let y be 1/(-3) + (-26)/(-42). Which is the nearest to -1? (a) y (b) v (c) 2/3 b Suppose 2h = 6h + 4g - 4, -11 = -5h - 2g. Let w = 93.3 + -92.8. Which is the nearest to w? (a) h (b) -5 (c) 3/4 c Let o be (0 - (6 - 4))-2. Suppose 7i = oi. What is the nearest to 1 in i, -4/5, 1? 1 Let w = -20 - -18. Let f be 10/20 - 3/w. Which is the closest to 1/2? (a) 0.3 (b) 7 (c) f a Let x be (-4)/(-6) - (-4)/(-15). Suppose -4j + 45 = -5t + 4, -2j = 5t + 17. Let l = -10 - -9. Which is the nearest to l? (a) j (b) -1 (c) x b Let t be 2/(-8) + 6/8. Let p = 1543 + -1543.1. Which is the closest to t? (a) p (b) 1 (c) 0.4 c Let l = 0.1097 + -0.0097. What is the closest to l in -2, 4, 2/33? 2/33 Let x = 1556/7 - 222. Let o be 4/(-8)14/4. What is the closest to x in o, -5, 0.4? 0.4 Let z = -839/6 + 140. What is the closest to -2/3 in -1.3, 2, z? -1.3 Let t = -0.062 - -4.062. Let g = -1.74 - -1.6. Let d = g - -5.14. What is the closest to d in 5, t, 1/2? 5 Let l(u) = u3 - 13u*2 + 13u - 17. Let n be l(12). Let i = 5 + n. Let f = 717/8 + -90. Which is the nearest to i? (a) -0.4 (b) f (c) 0.2 c Let x = 13 + -13. Let r be 7/(-3(-1)/(-3)). Let s = r + 8. What is the closest to s in x, 5, -5? x Let z = -0.02 + 2.02. Let s be (-2)/3 + 51/63. Let j(o) = o2 - 14o - 32. Let u be j(16). Which is the nearest to u? (a) s (b) z (c) -0.2 a Let w = 1.801 + -1.901. Which is the closest to -1/3? (a) -3.4 (b) w (c) 2 b Let z = 0.11 - 7.01. Let m = z + 7. What is the closest to 1/3 in 1/4, 3/7, m? 1/4 Let l be (-9)/(-6)4/(-3). Let j(g) = -g3 - 2g*2 - g. Let o be j(l). Suppose -4h = -oh. What is the nearest to h in -0.5, 4/7, 0? 0 Let r = 144 + -64. Let n = r - 80. Which is the closest to 1/3? (a) n (b) 3/8 (c) 0.1 b Let x be 7/(21/96) + -3. Which is the closest to x? (a) 2 (b) 0 (c) 1 a Let j = -147/80 + 7/16. Which is the nearest to 0? (a) -0.5 (b) -0.4 (c) j (d) -2/9 d Let g = 0.45 - 0.65. Which is the nearest to g? (a) 5 (b) 3 (c) 0.1 c Let z = -4618/3459 - -2/1153. Which is the nearest to 0? (a) 5 (b) 1 (c) 0 (d) z c Let u = -195 + 587/3. What is the closest to 1/3 in -0.31, 3, u? u Let d = -0.51 - -0.01. Which is the closest to -0.2? (a) 0 (b) d (c) 1.7 a Let o = 105/4 + -26. Let b = 2.3 + -1.4. Let y = 0.1 + b. What is the nearest to o in y, -5, -3? y Let w be (-1 + (-1)/(-2))/(4 - 5). Which is the closest to 1/3? (a) w (b) 3 (c) -1 a Let j = -13 + 13.3. Suppose -q + 1 = 2. Let n = 2 + 1. What is the nearest to q in n, j, -4? j Let z be (-2)/9 + -2140/(-864). What is the closest to 2 in -0.2, 1/4, z, -3/4? z Let y = 2 - 5. Let t = -0.9 - -0.5. Let k = t - -0.9. What is the nearest to 2 in y, 0, k? k Let j = 0.12 - 0.42. What is the closest to 2 in j, -2, 17? j Let l = 52.066 + -0.066. Let i = l + -54. Which is the closest to 1? (a) 2/11 (b) 0.1 (c) i a Let n = 109/868 + -1/1736. Which is the nearest to -0.09? (a) 2/15 (b) n (c) 6 b Let x = 8 - 12. Let f = 0.12 + -0.42. Let n = 0.3 + f. Which is the nearest to n? (a) 2 (b) x (c) -0.5 c Let c = -4/349 - -726/2443. What is the nearest to -158 in c, -0.3, -0.2, -1/2? -1/2 Let v = -2378.6 - -2379. Suppose 2u + 3u = 0. Which is the closest to -0.1? (a) -8 (b) v (c) u c Let m be ((-3)/6)/(-7 + (-180)/(-25)). Which is the closest to -4/7? (a) 3/8 (b) m (c) -2 a Let j = -3 + 3.1. Suppose 10l = 89 - 59. Which is the nearest to 2/3? (a) j (b) 0.06 (c) l a Let o = 2.5 + -0.5. Let n = -5/1113 + 1133/4452. What is the closest to o in n, -4/3, -2/9? n Let x = 40.2 + -43.2. Which is the closest to -1? (a) -0.02 (b) 12 (c) x (d) 1/3 a Let v be (-28)/72(-1)/74. What is the nearest to v in -7, 0.4, 2? 0.4 Let j be ((-8)/18)/(-1016/120). Let h = -2818/15 - -188. What is the nearest to j in h, -7, -1? h Let g = 0.2 - 0.16. Let n = 0.44 - g. Let q = -1/747 - 2237/2988. What is the closest to 0.1 in n, -0.4, q? n Let g = -735 + 738. Which is the closest to 2/3? (a) 2/19 (b) g (c) -4 a Let j(h) = -h*2 + 119h + 363. Let m be j(-3). What is the nearest to 10 in 1, -1/2, m? 1 Let a = 149 - 1339/9. Let y(d) = d*2 - 3d + 1. Let x be y(4). Let j be 36/(-120)x/(-2). What is the nearest to a in -1/8, 5, j? -1/8 Let v = -15.6 - -0.6. Let z = v + 13. Let f = 23 - 23.1. What is the closest to 1/6 in f, -1/7, z? f Let q be -41/5105/(-252). What is the nearest to -2/9 in q, -3/5, -4, 9? -3/5 Suppose 3w = -2r + 48, 0 = 3r + 14 - 5. Which is the nearest to 1? (a) w (b) -4 (c) 5 c Let l = 26.998 + 0.002. Let w = 27.4 - l. Which is the closest to 0.1? (a) -0.4 (b) w (c) -4 b Let i = 0.1315 + 0.0685. Which is the closest to 0.2? (a) 5 (b) 0.3 (c) i (d) 2 c Let u = 22 + -24. Which is the nearest to -180? (a) u (b) 5 (c) -0.4 a Let t = -7613/105 + 363/5. Which is the closest to 0.1? (a) 5 (b) -0.1 (c) t (d) -1/7 c Let x = -3.48 - -0.18. Let w = x	{ "pile_set_name": "DM Mathematics" }
d*2 + 1 - 1)(6 + d*2 - 6). -52d*4 - 4d Expand (-3l - l + 2l)(0 + 1 + 1) - 3 + 2l + 3 + 4l - 10 - 8l + 2l. -4l - 10 Expand (-3m + 3m + m)(-4m*4 - 10 + 3m*4 + 0 + 2m). -m*5 + 2m*2 - 10m Expand (-5 + 1 + 1)(3v + 5v - 5v). -9v Expand (-5 + 11 - 24)(-1 + m + 1). -18m Expand (2 + 0 - 1)(-j - j - j + (0 + 1 - 3)(j - 4j + 2j)). -j Expand (0c4 + c4 + 2c4)(3 - 2 - 5c + 4c). -3c5 + 3c*4 Expand (-3 + 3 + z)(-3z + z + 0z) + 2z2 + 0z2 - z2 - z*2 + 0z*2 + 3z2. z2 Expand (r*5 + 2r*5 + 0r*5)(12 - 29 + 19). 6r5 Expand -28h*3 + 28h*3 - 3h*4 + (-2h*3 + 0h3 + h3)(0 + 0 + 2h) - 3h3 + 3h3 + h4. -4h4 Expand (3 + 0 - 6)(-4 + 4 + 2u) - u + 2 - 2 + 3u + 2u - 2u. -4u Expand (f2 - 1 + 1 + (f - 4f + f)(3 - 3 - f) - 3f*2 + 0f*2 + 5f*2 + 0f*2 - 7f*2 + 0f*2)(f*3 + 0f*3 - 3f*3). 4f5 Expand -f2 - 4f2 + 7f*2 + (2f - 16 + 16)(f - 2f + 3f). 6f*2 Expand (-o + 5 - 5)(3o - 3o + 2o) + o2 + o2 + 2o*2. 2o*2 Expand (-4w + 4w + w)(-2w + 3w + w2 - 3 + 2). w3 + w*2 - w Expand (-13 - 3 - 2)(4 - 4y2 - 4). 72y*2 Expand ((l - 1 + 1)(l - 5l + 3l) - l*2 + 2l*2 - 12l*2)(2l2 + 4 - 4 + (4 - 4 + 2l)(4l - 4l + l)) + 3l*2 - 2l*4 - 3l*2. -50l*4 Expand (-5d*2 - 5d*2 + 9d*2)((4 - 4 - d)(d - 2d + 2d) - d2 + 3d*2 + 0d*2) + (-2d + 2d + d3)(-d + 0d + 3d). d*4 Expand 0g*2 - 2g*2 + 9g*2 + (0 + g + 0)(g - g - 3g). 4g2 Expand -x5 + 5 - 5 - x*4 + 5x - 5x + x5 + (-x3 - 2x4 + x3)(3 - 3 - 2x) + 2x5 + 0x + 0x. 6x5 - x4 Expand (4a - 3 + 3)(2a2 - 9 + 9). 8a*3 Expand ((-3l + 8l - 7l)(-2 - 4 + 3) + 2l + 0l - 4l + 3 - l - 3 + (0l + 2l + 0l)(3 - 4 + 3) + 2l - l - 3l)(-4l + 4l - l2). -5l*3 Expand ((-6q + q + 3q)(q + q + 2q) + 4q*2 - 2q2 - q2)(-3q + 3q + 4q)(-5q + 4q + 0q). 28q4 Expand -x2 - 2x + 2x + (-4x - x + 3x)(-x - x + x) + 0 + x - 4x2 + x + 1. -3x*2 + 2x + 1 Expand 5a - 6a + 2a + (0 + 1 - 4)(2 - 1 - 3)(0 + 0 + 2a). 13a Expand (0 - 2h + 0)(h - 8 - 2h*4 + 8). 4h*5 - 2h*2 Expand (0 + 0 + b)(-4b - 3b + 5b + (4 - 6 - 1)(0 + 0 + b)). -5b2 Expand (-4c*2 + 3c*3 + 2 - 8c*2 + 13c*2)(-8 + 8 + 5c2). 15c*5 + 5c*4 + 10c*2 Expand (-1 + 3 - 3)(-x*2 - 3 + 3) - 6x*2 + 0x2 + x2 + 1 - 1 + 6x2. 2x*2 Expand (-2d*2 + 4d*2 - 3d*2)(-2 - 3 + 4)(9d - 9d - 13d*2). -13d*4 Expand (-3 + 3 + j)(0 - 2 + 1) + 0j - 4j + 0j + 0 + 0 + 2j + 4j - 6j + 0j + (0 - 3 + 1)(-3 + 3 + 2j) + j - j + j - 3j + j + 0j. -10j Expand (3 + 1 - 5)(-g4 - g5 + g4) - g3 + g3 + g5 + (-2g*2 - 2g*4 + 2g*2)(-3g + 2 - 2). 8g*5 Expand (0 - 3 + 5)(h + 4h - 7h) + (-1 + 0 - 1)(1 - h - 1). -2h Expand -o*4 + 0o*4 + 5o*4 + (3o*3 - 2o*3 + 0o*3)(-2o + 0o + 0o). 2o*4 Expand (t - t + 3t*2)(0t3 + 0t3 + t3) - 6t5 + 9 - 9. -3t*5 Expand (-2d - 4 - 5 + 6)((0 + 1 - 3)(-2d - 2d + 2d) - 2d + d - 2d). -2d*2 - 3d Expand (-1 - 3l2 + 4l2 + l2)(-16 + 2 + 0). -28l*2 + 14 Expand (-3s*2 + 7s2 + s2)(-4s + 5s + 0s - 1) - 2s2 + 2s2 - s3. 4s3 - 5s*2 Expand (-3f3 + f3 + 4f3)(3 + f - 3). 2f4 Expand (-9u + 2u + 3u)(-6u + 0u + 4u). 8u2 Expand (2v - 2v2 - 4v*2 + 2v*2)(4v3 + v3 - v3 + (-v2 + 2v - 2v)(-v + 3v - v)). -12v*5 + 6v*4 Expand (5 - 3 - 5)(-2j - 2 + 2) + 0j + 1 - 3 + 2j. 8j - 2 Expand -i + 0i - i + (0 + 1 - 3)(2 - 2i - 2) - 3i + 3i + 2i + 2i - 4i + 0i. 2i Expand (-5s + 0s + 3s)(0 + 1 + 0) - 3s - 2 + 2. -5s Expand (0n2 - n2 + 0n*2)(-7 - 6n3 + 7) - 2n*2 + 2n*2 + 6n*5. 12n*5 Expand (2n + 2n - 6n)(-27 + 105 + 97). -350n Expand (f - 5f + 5f)(-112f + 2f2 + 219f - 97f). 2f*3 + 10f*2 Expand (2 + 3 - 7s - 8)(0 + 2 + 0). -14s - 6 Expand (2a5 - a5 + 4a*5)(1 + 1 - 3) - 2a + a5 + 2a. -4a5 Expand (3n - n - 4n)(-18 + 18 - 22n)(-4n2 + n2 + 0n*2). -132n*4 Expand 0w*5 + 3w5 - w5 + (3w2 - 3w*2 - 3w*4)(w - 2w + 4w) + w*5 - 3w*5 + 0w*5. -9w*5 Expand (-6 - 7 + 0)(-2u3 + u3 - u3). 26u*3 Expand (1 - h - 1)(-1 + 2 - 2) + 2h + 1 - 1 + 6h + 4 - 3 + 5h. 14h + 1 Expand -19d4 - 10d*4 + 16d*4 - 4d*4 + 0d*4 + 2d4 + (3 - d2 - 3)(d2 - d + d). -16d*4 Expand ((3 - 1 - 1)(-10 + 10 + g) - 2 + 2 + 2g)(0 - 4 + 2). -6g Expand (2l*2 - 3l*5 - 2l*2)(-2 - 1 + 1) + 2l5 + 3l*2 - 3l*2 + 0l*5 + 7l5 + l5. 16l5 Expand (-6t3 + t3 + 3t3)(68t - 33t - 33t - 22). -4t*4 + 44t*3 Expand (-8 - 26 - 32)(2 - 2 + p*3) + 3p*3 - 2p*3 - 3p*3. -68p*3 Expand (0h + 0h - 2h)(0 + 1 + 2)(-38h - 14h*3 + 38h). 84h4 Expand 1 - 1 + 2d + (-1 + 1 - 2d)(4 + 0 - 2) - 3d + 5d - 4d. -4d Expand (-w + 0 + 0)(-17 + 31 - 7 - 2w) + (3w + w - 2w)(2w + w + 0w). 8w*2 - 7w Expand (17 - 17 - i)(-1 - i + 2 - i). 2i*2 - i Expand (4q*2 - 2q2 - q2)(-5q + 4q + 21q)(4 - 4 + 2q). 40q4 Expand (-3q*2 - 4q*2 + 2q*2)(7q + 3q - 7q)(3q - 5q + 0q). 30q*4 Expand (f + 20 - 3 - 35)(2f + 2f - 5f + (-5f - 3f + 6f)(-3 + 3 - 2) - 3f - 2f + 3f). f*2 - 18f Expand (-6y2 + 2y*2 + 2y*2)(y*2 - 3y + 3y) - 2y*4 + 3y*3 + 5y*4 - 3 - 5y*4. -4y*4 + 3y*3 - 3 Expand (0v*2 - 3v*2 + 2v*2)(v - 15 - 8 - 10). -v*3 + 33v*2 Expand (-4j2 + j2 + 2j2)(2 + 3 - 4)(-3 + 1 + 3). -j2 Expand (-3t*2 + 3t*2 + 2t*3)(7 - 2 - 2)(-1 - 2t + 1). -12t4 Expand (d3 - 6d*3 + 3d*3)(d + 3 - 3) + 25d4 + 12d*4 - 6d*4. 29d*4 Expand (1 - 1 + 3q)(7 - 3 + 0)(-3 + 1 + 0). -24q Expand (0f*2 + 4f*2 - 3f*2)(0f3 + 0f3 - f3) - 8f3 + 4f*5 + 8f*3 + 0f*5 - 5f5 + f5. -f*5 Expand -14q*2 - 20 + 20 + 0q*2 - 3q2 + q2 + (-q + q - 2q)(-2q + 1 - 1). -12q*2 Expand (-a + 2a + a + (4 - 6 + 0)(-2a - a + 5a) + 3a - 6a + a)(2 + 2a2 - 2)(-3a + 6a - 4a). 8a*4 Expand (12y - 10y + 11y)(-y2 + y4 + y2). 13y*5 Expand -2u*4 + 2u*3 - 2u*3 + 5u2 + u4 - 35u2 - 6u2 + (-1 + 1 + u4)(5 - 3 - 1) - 3u + 3u + 2u*4. 2u*4 - 36u*2 Expand (2c - 3c - c)(0 + 5 - 1). -8c Expand (-2i + 0 + 0)(i - i + 2i) + 3 + 17i2 - 35i*2 + 16i*2. -6i*2 + 3 Expand -3q - 3q + q + (0 + 5 - 1)(-4q - 2q + 4q). -13q Expand ((-2r + 0r + 4r)(-r - 3r + 2r) + 4r2 + 3r*2 - 4r*2)(2 - 5 - 5). 8r2 Expand (2x*4 - 2x*4 - 2x*5)(-2 - 4 - 2)(-7 + 2 + 3). -32x*5 Expand (-2h - 3h + 3h)(2 + 2 - 6) + 1 + 2h - 1. 6h Expand (-3q - 2q - 2q)(1 + 0 - 2 + (2 + 1 - 4)(3 - 2 + 0) + 0 + 1 - 3). 28q Expand -4y + 0y + 0y + (5 - 3 + 0)(0y + 0y + y). -2y Expand (-6w + 5w + 3w)(-2 + 0 + 0)(-w - 4w - w). 24w2 Expand (4 - 2 - 3)(-21 - 5 - 1)(p - p + p2). 27p*2 Expand (4 - 2 - 4)(-3i - 2i + 4i) + 4i - 4i - i + (-6 + 1 + 3)(0i - 3i + 5i) - 2i - i + 2i + i - i - 2i. -6i Expand (-4 + 3 + 0)(2 - 3w - 6w + 6w). 3w - 2 Expand (r*3 - 2r*3 + 2r*3)(-2 - 7r - r + 0r). -8r4 - 2r3 Expand r5 + 0r2 + 0r2 + (r5 - 3r5 + 3r*5)(6 + 3 + 0) + (3 - r - 3)(3r*4 - 2r*4 + 0r*4). 9r*5 Expand (-2j*3 - 2j + 2j)(-4j2 + 3j*2 + 3j*2) - 8j*5 - 341 + 341. -12j*5 Expand (-4 - 3 + 4 + (-2 + 2 - 1)(2 + 4 - 4) - 3 + 2 + 0)(0p + 0p + p). -6p Expand (0g2 + 4g2 + g2)(3g + 2g - 6g)(-2g - g + 0g). 15g*4 Expand -22m*2 + 22m2 + m3 + 2m + m3 - 2m + (0m + 3m - m)(4m2 - m2 - 2m2) + 4m3 - m3 + 0m3. 7m*3 Expand -12p*4 + 12p*4 + 10p*4 - 3 + 3 + 2p*4 + (-p + 1 - 1)(-2p + p3 + 2p). 11p4 Expand (-7 + 1 - 3)(-4n2 + 2n*2 + 4n2) - n2 + 5n2 - 3n*2. -17n*2 Expand -39j*2 - 12j*2 + 5j*2 + (-j + 0j + 0j)(2j - j + j) - 4j2 + j2 + 4j2. -47j*2 Expand 3t + 5t - t + 6t - 2t - 2t + (0t - t + 3t)(2 + 1 - 5). 5t Expand (x3 + x3 - x*3)(20x2 - 30x*2 + 17x*2). 7x*5 Expand (1 - 2j*2 + 3j*2 - 2)(-103 + 103 - 8j3). -8j*5 + 8j*3 Expand (10u +	{ "pile_set_name": "DM Mathematics" }
t u(l) be the first derivative of -l*3 + 1. Let g(i) = -2 + 29i - 6i + 2 - 20i. Give u(g(b)). -27b2 Let g(j) = -6j. Let f(t) be the second derivative of -t*4/12 - 8t*3/3 + 72t. What is f(g(m))? -36m2 + 96m Let w(s) = 15 - 11 + 316s2 - 325s*2. Let u(z) = -4z*2. Determine u(w(r)). -324r*4 + 288r*2 - 64 Suppose -2c = -12c + 100. Let l(a) = ca*2 + 10a*2 - 9a*2 + 9a2. Let y(o) = -o2. Calculate y(l(h)). -400h4 Let r(h) = -190h*2 - 95h. Let n(o) = -3o2 - o. Let u(g) = 95n(g) - r(g). Let w(p) = 2p2. Give w(u(x)). 18050x*4 Let s(u) = 10u*2. Let l(y) be the second derivative of 5y*3/3 + 3y*2 + 23y - 3. Calculate s(l(x)). 1000x2 + 1200x + 360 Let r(h) = -14h. Let q(s) be the third derivative of -s8/20160 - 3s*5/20 - 5s*2. Let b(w) be the third derivative of q(w). Give b(r(k)). -196k*2 Let p(i) = 2i. Let r(w) = 40997w2. What is p(r(k))? 81994k*2 Let d(l) = 93380l. Let b(v) = v*2. Determine b(d(j)). 8719824400j*2 Let v(s) = -3s + 18. Let r(f) = -6f2 - 11f + 4. Give v(r(i)). 18i2 + 33i + 6 Let a(x) = -2x2 - 18x*2 + 3x*2 + 3x + 12x2 + 4x*2. Let q(l) = -9l*2. Determine a(q(t)). -81t*4 - 27t*2 Let y(t) = -t. Suppose -4g + l + 8 = 0, g - 2l = 4 - 2. Let c(z) = -z - z - z - gz. What is c(y(q))? 5q Let v(z) = -15z. Let p(o) = -3034o + 7. Calculate v(p(u)). 45510u - 105 Let h(q) = 4q. Let t(f) be the first derivative of 4f3/3 - f2 - 2f + 6. Let g be t(-1). Let y(l) = -3l - 5l + gl. Determine y(h(p)). -16p Let v(a) be the third derivative of 0a*4 + 20a*2 + 0 - 1/20a*5 + 0a*3 + 0a. Let c(d) = 3d2. What is v(c(l))? -27l*4 Let o(l) = 4l2. Let r(i) be the first derivative of i3 - i + 114. Give r(o(c)). 48c4 - 1 Let i(p) be the second derivative of p4/12 - p. Let h(o) be the first derivative of 0o + 1/2o2 - 27. Calculate h(i(t)). t2 Let n(z) = -z2. Let i = 6 + -1. Let d = i - 10. Let y(m) = -3m*2 + 12m - 12. Let c(r) = r*2 - 5r + 5. Let u(b) = dy(b) - 12c(b). Determine n(u(a)). -9a4 Let w(t) = -t3 + 11t*2 - 13t. Let f be w(9). Let d(n) = -f - 23n + 7n + 45. Let g(h) = -2h. Determine d(g(b)). 32b Let b(q) be the first derivative of 4q3/3 - 156. Let c(t) = -29 - 9t*2 + 29. Give c(b(o)). -144o*4 Let o be 18/3(-4)/(-12). Let d(y) = 17y2 - 10y*o - 8y*2. Let g(v) = -26v*2 - 2v. Calculate d(g(l)). -676l4 - 104l*3 - 4l*2 Let d(o) = 0o - 7o - 15o - 40 + 39. Let z(u) = 3u. What is z(d(g))? -66g - 3 Let a(i) be the third derivative of -8i5/5 + i4/12 + 21i2 + 3. Let h(l) = l2. What is a(h(r))? -96r4 + 2r*2 Let w(i) = 2i - 64. Let d(r) = 12r2 - 19. Give w(d(o)). 24o*2 - 102 Let u(l) = 6l*2 + 6. Let k(v) = -22v + 18. Let j(s) = -5s + 4. Let y(p) = -18j(p) + 4k(p). Calculate y(u(r)). 12r*2 + 12 Let n(z) = 8z*2. Let t(l) = 2 + 5 + 2l*2 - 13 - 6l. Let b(x) = -6x2 + 17x + 17. Let a(f) = 6b(f) + 17t(f). Give a(n(u)). -128u4 Let l(t) = -1631t. Let w(y) = 2y2. Calculate l(w(o)). -3262o*2 Let v(o) = 13o*2 + 21o*2 - 14o*2 + 14o*2. Let q(l) = -2l*2 + 3l. Let h(u) = 2u2 - 2u. Let r(m) = -3h(m) - 2q(m). Calculate r(v(f)). -2312f4 Let h(a) = -16a + 23. Let u(w) = 8w - 13. Let m(r) = -6h(r) - 11u(r). Let k(s) = s2. Calculate k(m(f)). 64f*2 + 80f + 25 Let f(l) = 2l. Let x(m) = -233m - 17. Calculate f(x(b)). -466b - 34 Let s(r) = -4r*2. Let t = -6 + 12. Suppose 4m - tm = -20. Let c(n) = n + 14 + m - 24. Determine s(c(j)). -4j*2 Let k(a) = 0a - 5a + 14a - 8a. Let v(t) = 52t*2. Calculate v(k(w)). 52w*2 Let k(u) = u - 2. Let d(q) = 9q - 21. Let n(f) = 2d(f) - 21k(f). Let s(r) = 3r + 12. Let i(b) = 8b + 34. Let c(a) = -6i(a) + 17s(a). What is n(c(m))? -9m Let g(l) be the first derivative of -l2/2 - 1. Suppose -4s + 25 = 3j, j + 0j + 9 = 3s. Let x(o) = 2o*2 + 5o*2 - jo*2. Determine x(g(c)). 4c2 Let o(p) be the third derivative of -p6/180 - 5p4/24 + 11p*2. Let s(l) be the second derivative of o(l). Let n(q) = 6q*2. What is s(n(h))? -24h2 Let g(d) be the second derivative of d4/6 + 30d. Let z(c) = 16c*2 - 16c + 16. Let k(w) = w - 1. Let t(f) = -16k(f) - z(f). Calculate g(t(j)). 512j*4 Let a(o) = 0 + 0 - 3o. Let w(t) = -t3 + t2 + 2t + 2. Let u be w(2). Let m(j) = -4j + uj + j. What is a(m(h))? 3h Let w(v) be the third derivative of v*4/8 - 3v2. Let a(h) be the second derivative of h3/3 + 19h. What is a(w(u))? 6u Suppose o = 5r - 2r - 9, 3o = 2r - 6. Let z(y) = 0y - 9y + oy. Let n(s) = -2s*2. Calculate n(z(i)). -162i*2 Let k(j) be the third derivative of 28j*4/3 + 7j*2 + 32j. Let i(y) = -2y. Determine i(k(a)). -448a Suppose d = -2p + 9, 7 = 5p - 2d - 2. Let w(o) = 3 + 17o*2 - 18o*2 - p. Let u(y) = 3y + y*2 + 6y*2 - 3y. Give u(w(s)). 7s4 Let q(h) = -25h + 5. Suppose -z + 5b - 9 = -5z, -2z = 3b - 3. Let p(m) = 25m - 6. Let y(a) = zq(a) + 5p(a). Let w(j) = -3j*2. Calculate y(w(d)). 75d*2 Let x(l) = -210l*2 - 21l - 1. Let u(c) = 4c. Give x(u(a)). -3360a*2 - 84a - 1 Let i(y) be the first derivative of 2y3 + 88. Let g(v) = 7v. Give g(i(k)). 42k2 Let x(f) = -71f. Let v(m) = -29m + 72m - 44m. Determine v(x(w)). 71w Let p(h) = -27h - 1176. Let j(t) = -13t. What is j(p(s))? 351s + 15288 Let l(i) be the second derivative of 0 + 1/6i*4 + 0i*3 + 0i*2 + 11i. Let b(p) = 8p2. Calculate b(l(h)). 32h*4 Let k(h) = -8h - 73h2 - 17h + 74h2. Let i(r) = 3r. Determine i(k(g)). 3g2 - 75g Let g = -5 - -3. Let p(u) = 4u2 + 2u + 2. Let z(o) = -o - 1. Let a(w) = gz(w) - p(w). Let m(r) = -4r - 3r + 5r. Calculate m(a(v)). 8v2 Let m(n) = -2. Let w(i) = -i - 14. Let x(p) = -28m(p) + 4w(p). Let r(s) = -25s*2. Give x(r(u)). 100u2 Let v(o) be the second derivative of -o3/2 + 12o. Let p(r) = -12 + 12 + 6r. Determine v(p(k)). -18k Let x(q) = -6q. Let s(p) = 10p - 12. Let n be 2/((-5)/30-1). Let w(g) = -g + 1. Let z(j) = nw(j) + s(j). Calculate x(z(r)). 12r Let r(v) = v - 7. Let f(w) = -129w + 49. Let a(u) = -2f(u) - 14r(u). Let t(i) = -5i*2. What is a(t(x))? -1220x*2 Let u(v) = 217v - 2. Let p(x) = 71x2 - 2. Give p(u(h)). 3343319h*2 - 61628h + 282 Let x(m) = 3m + 4. Let o(h) = 8h + 11. Let n(l) = -4o(l) + 11x(l). Let u(s) = -57s2. Calculate n(u(f)). -57f2 Let z(f) = f2. Let s(n) = 516n2 + 156n*2 - 19n*2 + 55n*2 + 241n*2. Give s(z(h)). 949h*4 Let r(v) = 231v*2. Let l(a) = 62a + 2. Determine r(l(f)). 887964f2 + 57288f + 924 Let o(j) = 55j + 44. Let l(a) = 2a + 2. Let x(k) = 22l(k) - o(k). Let w(i) = 12i. Determine x(w(f)). -132f Let l(k) = k2 - k - 1. Let x(n) = 4n*2 - 3n - 3. Let m(i) = -6l(i) + 2x(i). Let o(j) be the second derivative of -2j4/3 + 6j - 13. Determine m(o(a)). 128a4 Let i(x) = -5x*2. Let u(c) be the third derivative of -11c*5/30 + 84c*2. Calculate u(i(q)). -550q*4 Let w(a) = 751a. Let h(y) = y - 2369267 + 2369267. Calculate w(h(k)). 751k Let w(a) be the second derivative of -a3/2 - 61a. Let b(r) = -24r2. What is b(w(v))? -216v*2 Let r(t) = 3t. Let f(n) be the third derivative of -n*6/360 + 2n*3/3 + 5n*2. Let b(c) be the first derivative of f(c). Determine r(b(g)). -3g*2 Let u(o) = 5o + 12. Let q(m) = m - 9. Calculate u(q(f)). 5f - 33 Let l be 2 + 3/((-3)/(-2)). Let d(i) = li + 0i - i. Let p(m) be the second derivative of -2m*4/3 + 299m. Calculate p(d(o)). -72o2 Let o(z) = -z2 + 6. Let n(q) = 7q - 27q + 15q. What is o(n(j))? -25j2 + 6 Let u(f) be the second derivative of 3f - 2/3f4 + 0f*3 + 0 + 0f2. Let p(s) = s2 + 3s2 - 3s*2. Give u(p(x)). -8x*4 Let d(z) = 87z - 87z + 8z*2. Let k(y) be the first derivative of 7y*2/2 - 3. What is d(k(l))? 392l*2 Let l(c) = 1405c - 173. Let u(p) = -7p. Calculate l(u(r)). -9835r - 173 Let i(s) = -158s. Let q(x) = -359x*2. Give i(q(n)). 56722n*2 Let j(g) = 3g. Let p(q) = 63q2 - 166q*2 - 63q*2 - 7q + 8q. What is p(j(a))? -1494a*2 + 3a Let d(q) = -2q2 + 7. Let b(k) = -959k*2. Determine d(b(j)). -1839362j*4 + 7 Let s = -5 - -7. Let w(h) = -2h*2 + 0h*2 - sh*	{ "pile_set_name": "DM Mathematics" }
the nearest integer? 27 What is the eighth root of 430 to the nearest integer? 2 What is 3678 to the power of 1/6, to the nearest integer? 4 What is the cube root of 9593 to the nearest integer? 21 What is 950 to the power of 1/2, to the nearest integer? 31 What is 5711 to the power of 1/3, to the nearest integer? 18 What is 103476 to the power of 1/2, to the nearest integer? 322 What is 115 to the power of 1/3, to the nearest integer? 5 What is the square root of 13017 to the nearest integer? 114 What is the cube root of 4747 to the nearest integer? 17 What is the sixth root of 84 to the nearest integer? 2 What is the eighth root of 550 to the nearest integer? 2 What is the ninth root of 139832 to the nearest integer? 4 What is 4246 to the power of 1/6, to the nearest integer? 4 What is 664 to the power of 1/5, to the nearest integer? 4 What is the sixth root of 1675 to the nearest integer? 3 What is the third root of 1124 to the nearest integer? 10 What is 777 to the power of 1/2, to the nearest integer? 28 What is the square root of 40734 to the nearest integer? 202 What is the third root of 3555 to the nearest integer? 15 What is 502 to the power of 1/2, to the nearest integer? 22 What is 3690 to the power of 1/2, to the nearest integer? 61 What is 1790 to the power of 1/2, to the nearest integer? 42 What is 515 to the power of 1/7, to the nearest integer? 2 What is the cube root of 7841 to the nearest integer? 20 What is 185 to the power of 1/4, to the nearest integer? 4 What is the square root of 1906 to the nearest integer? 44 What is the seventh root of 6004 to the nearest integer? 3 What is 2725 to the power of 1/7, to the nearest integer? 3 What is 1836 to the power of 1/7, to the nearest integer? 3 What is the cube root of 243 to the nearest integer? 6 What is 272 to the power of 1/5, to the nearest integer? 3 What is the ninth root of 2722 to the nearest integer? 2 What is the square root of 317 to the nearest integer? 18 What is 3588 to the power of 1/3, to the nearest integer? 15 What is the cube root of 263 to the nearest integer? 6 What is 1572 to the power of 1/10, to the nearest integer? 2 What is 64680 to the power of 1/2, to the nearest integer? 254 What is 4225 to the power of 1/3, to the nearest integer? 16 What is the eighth root of 87452 to the nearest integer? 4 What is the third root of 28877 to the nearest integer? 31 What is the third root of 3460 to the nearest integer? 15 What is 83 to the power of 1/8, to the nearest integer? 2 What is the square root of 51928 to the nearest integer? 228 What is the square root of 635 to the nearest integer? 25 What is 38121 to the power of 1/10, to the nearest integer? 3 What is the third root of 690 to the nearest integer? 9 What is 59623 to the power of 1/5, to the nearest integer? 9 What is the third root of 1678 to the nearest integer? 12 What is 7972 to the power of 1/3, to the nearest integer? 20 What is the sixth root of 1083 to the nearest integer? 3 What is 4742 to the power of 1/8, to the nearest integer? 3 What is the square root of 6425 to the nearest integer? 80 What is the fifth root of 11426 to the nearest integer? 6 What is 1892 to the power of 1/8, to the nearest integer? 3 What is 845 to the power of 1/8, to the nearest integer? 2 What is 26001 to the power of 1/3, to the nearest integer? 30 What is the square root of 5655 to the nearest integer? 75 What is the fourth root of 19869 to the nearest integer? 12 What is the square root of 743 to the nearest integer? 27 What is the square root of 2079 to the nearest integer? 46 What is 1654 to the power of 1/7, to the nearest integer? 3 What is 367 to the power of 1/6, to the nearest integer? 3 What is the sixth root of 49996 to the nearest integer? 6 What is 28656 to the power of 1/6, to the nearest integer? 6 What is 9882 to the power of 1/2, to the nearest integer? 99 What is 9158 to the power of 1/2, to the nearest integer? 96 What is the square root of 50677 to the nearest integer? 225 What is the third root of 1155 to the nearest integer? 10 What is 7963 to the power of 1/3, to the nearest integer? 20 What is 568 to the power of 1/5, to the nearest integer? 4 What is the third root of 17444 to the nearest integer? 26 What is the cube root of 1599 to the nearest integer? 12 What is the square root of 5656 to the nearest integer? 75 What is the cube root of 638 to the nearest integer? 9 What is 50084 to the power of 1/3, to the nearest integer? 37 What is 89857 to the power of 1/2, to the nearest integer? 300 What is the square root of 2335 to the nearest integer? 48 What is 3562 to the power of 1/5, to the nearest integer? 5 What is 3477 to the power of 1/2, to the nearest integer? 59 What is the cube root of 1877 to the nearest integer? 12 What is the square root of 8197 to the nearest integer? 91 What is the fourth root of 5217 to the nearest integer? 8 What is 3397 to the power of 1/2, to the nearest integer? 58 What is the square root of 82490 to the nearest integer? 287 What is the square root of 7664 to the nearest integer? 88 What is 10122 to the power of 1/2, to the nearest integer? 101 What is 81503 to the power of 1/4, to the nearest integer? 17 What is the cube root of 26438 to the nearest integer? 30 What is the square root of 1317 to the nearest integer? 36 What is 93834 to the power of 1/2, to the nearest integer? 306 What is 57845 to the power of 1/5, to the nearest integer? 9 What is 10275 to the power of 1/2, to the nearest integer? 101 What is 6500 to the power of 1/7, to the nearest integer? 4 What is 92382 to the power of 1/3, to the nearest integer? 45 What is 3389 to the power of 1/2, to the nearest integer? 58 What is 1848 to the power of 1/5, to the nearest integer? 5 What is the square root of 136 to the nearest integer? 12 What is the ninth root of 7735 to the nearest integer? 3 What is the cube root of 192402 to the nearest integer? 58 What is 62 to the power of 1/2, to the nearest integer? 8 What is the tenth root of 10602 to the nearest integer? 3 What is 299 to the power of 1/10, to the nearest integer? 2 What is 2095 to the power of 1/3, to the nearest integer? 13 What is 71187 to the power of 1/9, to the nearest integer? 3 What is the seventh root of 1681 to the nearest integer? 3 What is 8845 to the power of 1/8, to the nearest integer? 3 What is the cube root of 5871 to the nearest integer? 18 What is the cube root of 13257 to the nearest integer? 24 What is 63583 to the power of 1/10, to the nearest integer? 3 What is the tenth root of 8215 to the nearest integer? 2 What is the third root of 147 to the nearest integer? 5 What is 17398 to the power of 1/9, to the nearest integer? 3 What is 37375 to the power of 1/3, to the nearest integer? 33 What is the square root of 27241 to the nearest integer? 165 What is the tenth root of 76772 to the nearest integer? 3 What is 71962 to the power of 1/5, to the nearest integer? 9 What is the sixth root of 33393 to the nearest integer? 6 What is 4695 to the power of 1/2, to the nearest integer? 69 What is the cube root of 462 to the nearest integer? 8 What is 2130 to the power of 1/3, to the nearest integer? 13 What is 34949 to the power of 1/2, to the nearest integer? 187 What is the square root of 4217 to the nearest integer? 65 What is 1338 to the power of 1/7, to the nearest integer? 3 What is 2406 to the power of 1/2, to the nearest integer? 49 What is 3276 to the power of 1/3, to the nearest integer? 15 What is the square root of 138978 to the nearest integer? 373 What is 7480 to the power of 1/3, to the nearest integer? 20 What is the square root of 5330 to the nearest integer? 73 What is the sixth root of 5304 to the nearest integer? 4 What is the square root of 5695 to the nearest integer? 75 What is the third root of 3766 to the nearest integer? 16 What is 65302 to the power of 1/4, to the nearest integer? 16 What is 4731 to the power of 1/3, to the nearest integer? 17 What is 22789 to the power of 1/2, to the nearest integer? 151 What is the eighth root of 290 to the nearest integer? 2 What is 1026 to the power of 1/2, to the nearest integer? 32 What is the cube root of 861 to the nearest integer? 10 What is 1921 to the po	{ "pile_set_name": "DM Mathematics" }
03 -25618 divided by 20 -12809/10 946429 divided by -1067 -887 882700 divided by -970 -910 Calculate 2264649 divided by 3. 754883 Calculate -749 divided by 1744. -749/1744 Divide 167 by -2127. -167/2127 276690 divided by 46115 6 What is -170 divided by 3405? -34/681 Calculate 0 divided by 24136. 0 Calculate 1165882 divided by -24806. -47 What is -652495 divided by 3527? -185 Calculate 393624 divided by -252. -1562 What is -1567216 divided by -196? 7996 Divide -298540 by 74635. -4 -12960 divided by 15 -864 Calculate 716 divided by 714. 358/357 Calculate -2012 divided by -1. 2012 14839 divided by -1349 -11 -234320 divided by -14645 16 What is -100185 divided by -5? 20037 70376 divided by -463 -152 -47 divided by -8984 47/8984 Divide 1446060 by -70. -20658 Divide 57106 by -2. -28553 Divide 0 by -402826. 0 Divide 161 by 951. 161/951 What is 234311 divided by 3043? 77 What is 5076 divided by 180? 141/5 3405 divided by -5 -681 5 divided by 86543 5/86543 Divide -517 by -402. 517/402 Divide -247260 by -123630. 2 141 divided by 239 141/239 Calculate 18 divided by -20575. -18/20575 Calculate 2 divided by -35469. -2/35469 Divide 145535 by 13. 11195 -76671 divided by 10953 -7 3827 divided by 2015 3827/2015 957 divided by 1017 319/339 -44225 divided by -44225 1 Calculate 134041 divided by -431. -311 What is -1011270 divided by 1? -1011270 Calculate -40 divided by -5513. 40/5513 1 divided by -30324 -1/30324 What is 374 divided by -237? -374/237 What is -46659 divided by 15553? -3 What is -2146428 divided by -2? 1073214 -16 divided by 201 -16/201 Calculate -494768 divided by -123692. 4 What is -520212 divided by -4? 130053 Divide 3270922 by 3. 3270922/3 -2327692 divided by 5 -2327692/5 Calculate 0 divided by 437906. 0 Divide -6 by 522. -1/87 -19 divided by -949 19/949 -328556 divided by 5 -328556/5 What is 10175 divided by 185? 55 42550 divided by 25 1702 Divide 4 by -369991. -4/369991 What is 262930 divided by 21? 262930/21 What is -134704 divided by -1? 134704 Calculate -4509119 divided by -5. 4509119/5 What is -1952216 divided by 994? -1964 Divide 37888 by -45. -37888/45 What is 43327 divided by -19? -43327/19 Calculate -19537 divided by 4. -19537/4 Calculate -15948 divided by 18. -886 Calculate 1151170 divided by 5. 230234 11445 divided by 7 1635 Divide 6880 by -70. -688/7 Calculate 28194 divided by 28194. 1 Divide 2990 by 856. 1495/428 Divide 30381 by 779. 39 4536 divided by 14 324 738264 divided by -3 -246088 5136 divided by -5136 -1 281052 divided by 23421 12 Divide 23072 by -13. -23072/13 Calculate 713718 divided by -18. -39651 -4 divided by 2425 -4/2425 Divide -3 by 19391. -3/19391 Divide 2509143 by -101. -24843 Divide 6 by 147602. 3/73801 What is -2 divided by -46825? 2/46825 Calculate 1 divided by -13689. -1/13689 Calculate 2614571 divided by -113677. -23 -527380 divided by 52738 -10 Divide 1235 by 65. 19 What is 110 divided by 563? 110/563 What is -228098 divided by 6? -114049/3 Divide -201536 by 47. -4288 Divide 10 by -70. -1/7 Calculate 4199190 divided by -5. -839838 Divide -144540 by 219. -660 Calculate 12950 divided by 70. 185 Divide -12 by 8281. -12/8281 Divide 53417 by 4. 53417/4 Divide 1921 by 89. 1921/89 Divide 19 by -7349. -19/7349 Calculate -28943 divided by -7. 28943/7 282561 divided by 94187 3 Calculate -1937468 divided by -2756. 703 Calculate -329 divided by -45. 329/45 Divide -5944 by 5944. -1 What is 3794509 divided by 41? 92549 Divide 91845 by 7065. 13 44237 divided by -68 -44237/68 Divide 916 by -49. -916/49 Calculate -21 divided by 96. -7/32 What is -87896 divided by 43948? -2 Divide 79464 by 4. 19866 Divide 44759 by 3443. 13 Calculate -15650 divided by 2. -7825 What is 76 divided by 475? 4/25 Divide 109089 by 527. 207 What is 0 divided by 819683? 0 -19964 divided by -161 124 Divide -113512 by -14189. 8 Divide 14850 by -99. -150 What is -6465576 divided by -34? 190164 What is 169030 divided by 10? 16903 What is -92 divided by -92? 1 What is 3 divided by -105500? -3/105500 Calculate 37 divided by 4254. 37/4254 Calculate 31008 divided by -5. -31008/5 Divide 1 by 262291. 1/262291 58 divided by 23674 29/11837 What is -1790688 divided by -447672? 4 What is 436065 divided by -3? -145355 Calculate -384 divided by 1. -384 -65334 divided by -2 32667 Calculate -2169972 divided by -103332. 21 Calculate 4 divided by -244403. -4/244403 Divide 1 by 105993. 1/105993 31170 divided by -2078 -15 What is -137071 divided by 17? -8063 101 divided by 38 101/38 Calculate -4 divided by 186675. -4/186675 -596700 divided by -1700 351 What is 149247 divided by -927? -161 59 divided by 17277 59/17277 Calculate -14688 divided by 68. -216 What is -1 divided by 427589? -1/427589 Divide -2806 by -24. 1403/12 What is 15129 divided by 1681? 9 -2 divided by -31772 1/15886 -42 divided by 67159 -42/67159 What is -2 divided by 300126? -1/150063 -247500 divided by 27500 -9 280808 divided by -44 -6382 What is 155402 divided by 559? 278 Calculate 3344 divided by -209. -16 -2109468 divided by -1 2109468 Calculate 0 divided by 54905. 0 Divide -6404 by 7. -6404/7 Divide -1770 by -44. 885/22 What is 13610 divided by 71? 13610/71 Calculate -969 divided by 578. -57/34 Calculate 9050 divided by 6. 4525/3 What is 24755 divided by 4951? 5 What is 407438 divided by 2? 203719 Divide 0 by -11618. 0 -119022 divided by 3 -39674 Divide -428 by 737. -428/737 Divide -11 by -92080. 11/92080 Divide 0 by 7374. 0 Divide -23370 by 123. -190 Divide 6637 by -4. -6637/4 What is 125950 divided by 458? 275 Divide -2648 by 573. -2648/573 4 divided by 39691 4/39691 What is 572600 divided by 8? 71575 Divide -3 by -5396. 3/5396 Divide 864 by 4. 216 Divide -92594 by 1. -92594 Divide -180426 by -20. 90213/10 Divide 16229 by -9. -16229/9 Divide 455 by -57. -455/57 Calculate 0 divided by -11952. 0 Divide 1067181 by 381. 2801 Calculate 260183 divided by 8393. 31 Divide 14100 by -30. -470 27935 divided by -755 -37 -47888 divided by -11972 4 -870072 divided by 72506 -12 What is 77551 divided by -4? -77551/4 Calculate -61520 divided by -15380. 4 395125 divided by -2 -395125/2 What is -4401 divided by 9? -489 Calculate -3 divided by 33008. -3/33008 What is -57 divided by -32861? 57/32861 4711302 divided by 6 785217 Divide 1236552 by -412184. -3 What is -8585 divided by 5? -1717 51642 divided by -19 -2718 Divide 3133707 by 1044569. 3 Calculate -5302 divided by 10. -2651/5 Divide 348608 by 21788. 16 Calculate 38852 divided by -3532. -11 Divide -1044871 by 4. -1044871/4 -466 divided by -90 233/45 Calculate -62860 divided by -1. 62860 Divide 236260 by 47252. 5 Divide -18580 by 9290. -2 Calculate 178982 divided by 5. 178982/5 Divide 5 by 48798. 5/48798 What is -15797 divided by -15? 15797/15 Divide -62160 by 56. -1110 What is -182028 divided by 44? -4137 Divide 2688512 by 64. 42008 -88268 divided by 2 -44134 Divide 1491948 by -4. -372987 What is 32214 divided by 10738? 3 What is 9935 divided by -3? -9935/3 What is 552 divided by 513? 184/171 64663 divided by 2 64663/2 Calculate -20193882 divided by 3. -6731294 What is -504 divided by 441? -8/7 Calculate 10 divided by 56652. 5/28326 Divide 156345 by 5. 31269 -3 divided by -408777 1/136259 Calculate 72499 divided by 72499. 1 Calculate 53 divided by -194. -53/194 Divide 785429 by -83. -9463 What is -4513 divided by -366? 4513/366 -21736 divided by -3 21736/3 What is 1164280 divided by 11195? 104 What is 227435 divided by -227435? -1 -131 divided by 19705 -131/19705 What is -627966 divided by -69774? 9 -4 divided by 771336 -1/192834 Divide 121686 by -6. -20281 14 divided by -3713 -14/3713 Divide 3 by 271732. 3/271732 Calculate 392870 divided by -39287. -10 378 divided by 14 27 -3 divided by -67303 3/67303 Calculate 1366848 divided by 144. 9492 Divide -1 by 23306. -1/23306 What is -27878 divided by 11? -27878/11 -1 divided by 10717 -1/10717 12296 divided by 3 12296/3 Divide 39032 by -2296. -17 Divide 2249009 by -61. -36869 -12418 divided by 14 -887 Divide 107492 by -154. -698 Calculate 127743 divided by 869. 147 What is -27903 divided by 102? -9301/34 Calculate 1606080 divided by 5. 321216 1316518 divided by 1 1316518 -196 divided by -139 196/139 What is -57746 divided by 26? -2221 Calculate -1 divided by -7664. 1/7664 1107 divided by -2 -1107/2 Divide -201 by 18	{ "pile_set_name": "DM Mathematics" }
o the form sm3 + km*2 + v + bm and give s. 18 Rearrange 15r3 + 7139r*2 + 2r - 7139r2 - 3 to f + wr*2 + kr + ur3 and give f. -3 Express -12c*2 - 195c*2 + 11c*2 in the form xc + kc2 + f and give k. -196 Express -922 + 4588p*2 - 2291p*2 - 2295p*2 as kp + dp2 + m and give m. -922 Express -409l*2 + 143l*2 + 133l*2 - l + 136l*2 in the form ml + a + ol2 and give m. -1 Express v + v + 0v - 10v + v + 5v + (v - 3v + 11v)(4 - 3 + 0) in the form w + dv and give d. 7 Express 3p4 - 2p*4 + 15p*4 + (0p*2 + 3p2 - p2)(-p + p + p2) + 5p*4 + 11p - 11p as fp*2 + zp + lp4 + y + vp*3 and give l. 23 Express (83 - 75 + 208)(2k4 - 4k*4 - 4k*4) + (-5k*4 + 5k4 - k4)(2 - 5 + 4) in the form i + pk + jk4 + ck*2 + dk*3 and give j. -1297 Express 11g*2 - 3g*3 - 3g*2 - 8g*2 + 5 + 3 as wg*2 + y + cg*3 + mg and give c. -3 Express (0z + 0z + 8 - z)(2 + 3 - 1)(z + 2z - z) as rz + pz2 + t and give p. -8 Express 34u - 29 - 19 + 47 in the form xu + z and give z. -1 Rearrange -l3 + 2l*2 - 9l*2 + 2l*3 - 9l*3 - 29l*3 to a + sl + jl3 + il*2 and give j. -37 Express 1652c*2 - 3c*3 - 1651c*2 + 5c*3 - 1 - 11c*4 in the form tc*4 + hc*3 + a + bc*2 + dc and give a. -1 Rearrange -20 - 2t2 + 0t*2 + 3t*2 + 5t*4 + 11 - 27t*4 to the form kt*4 + ot*2 + y + it*3 + pt and give o. 1 Express 2y2 + 43 - 6y*2 + 41 - 4y*2 + 6y*2 in the form f + uy*2 + hy and give f. 84 Express -2l2 - 205 + 205 + 58l*3 + 4l*2 in the form ql + m + cl2 + jl*3 and give j. 58 Rearrange -7 + 25d*3 - 17d*3 - 10d - 7d3 to ld*2 + s + gd + id3 and give g. -10 Rearrange -37p*2 + 365p*2 + 214p*2 + 1 + 1 to x + up + gp2 and give x. 2 Rearrange (-24 + 5m + 24)(-2m*2 - 1 + 1)((2 + 0 - 1)(1 + 7 - 3) - 2 + 2 - 1) to the form pm + wm3 + cm*2 + s and give w. -40 Rearrange -2t*4 + 1 + 3t4 + 2 - t2 + 2t3 + 4t*4 to bt + mt3 + st*4 + qt*2 + d and give d. 3 Rearrange -19v*4 - 41v*4 + 110v*4 - 32v*4 - 3v + v*3 to the form pv*3 + d + uv*2 + yv*4 + ov and give u. 0 Express -2 - t*2 - 2t*3 - 279t - 5t4 - 299t + 575t as ut*2 + g + pt + xt3 + qt*4 and give g. -2 Rearrange 3 + 1 - 5 + 2h + (5 + 6 - 25)(2h - 4 + 5 + h) to s + xh and give x. -40 Express (-1 + 7 - 3)(15y + 12 - 12)(-2 - 1 + 13) in the form h + qy and give q. 450 Rearrange 0t*2 - 2t*4 + 0t*2 + (2t + 0t - t2 + 0t*2)(-3t + 356t*2 + 5 - 360t*2 + 0) to rt*4 + xt*2 + b + nt*3 + wt and give w. 10 Rearrange (-49591r2 + 49591r*2 + 3429r*3)(-2 - 2 + 2)(2r + 0 + 0) to br2 + hr*4 + nr + a + dr3 and give b. 0 Express -94g*2 + 185g*2 + 2g*3 - 91g*2 + 13g in the form yg3 + qg*2 + u + sg and give y. 2 Rearrange 119m - 33m*2 + 39m*2 + 5m - 7m2 to jm + dm2 + c and give d. -1 Rearrange -x - 36x*4 - 27x*4 + 6x*2 + 62x*4 to the form bx*3 + yx*4 + n + sx*2 + ax and give a. -1 Rearrange -44k - 28k - 43k - 50k + 1 + 25k to the form wk + h and give w. -140 Express -3 + 2o + 4 - 3o + 255o2 - 274o2 - o4 in the form go2 + io*3 + ko + r + ho4 and give i. 0 Express -250 - 441y*2 + 250 as ly*2 + n + oy and give o. 0 Rearrange (35z - 62z + z - 24z - 114z)(2 - 12 - 17) to the form m + wz and give w. 4428 Express 37n - 84 + 33n + 82 + 48n in the form yn + x and give y. 118 Express 42m + 49m + 9m as lm + q and give q. 0 Rearrange (0 - 5 + 0v + v)(-1 + 4 - 1)(3 - 2 + 4)(9v + 3 - 3) to the form x + av + gv2 and give a. -450 Express 3 - 1 - 370u*2 + 491u*2 as wu*2 + du + c and give w. 121 Rearrange (-895b3 - 1099b*3 + 2197b*3)((-3 + 1 + 3)(2 - 3 + 0) - 2 + 3 + 1 + 0 + 0 - 3) to the form gb + ob3 + jb*2 + d and give o. -406 Rearrange 6r2 - r2 - 3r2 + (-r - 2r + 2r)(-6r + 2r + 2r) + 0r2 + r2 - 1 - 178r + 211r to pr + i + sr*2 and give p. 33 Rearrange -88l - l*2 + 58 + 189l - 96l to the form m + jl*2 + ul and give u. 5 Express (36q - 9q + 9q)(-9q2 + 9q*2 + 27q*3) in the form r + oq + jq2 + aq*3 + nq*4 and give n. 972 Rearrange 3c2 + c2 - 3c2 + (7c - 11c - 14c)(2c - 6c + 0c) to qc + l + jc*2 and give q. 0 Express (3 - 5 - 1 + 4w)(0w + w - 3w) - 8w*2 + 2w*2 + 0w*2 + (-w + 4w - w)(4w - 3w + 0w) in the form zw2 + pw + t and give p. 6 Rearrange 603f - 603f + 161f2 to the form wf*2 + i + pf and give w. 161 Rearrange (0 + 0 - 2 - 2 + 3 + 0 + (3 - 3 + 1)(1 + 0 + 0) - 5 + 3 + 0)(-480 + 480 - 66k)(2k + k - k) to the form mk*2 + sk + t and give m. 264 Rearrange -2 + 1759p + p2 - 1834p - 2p3 + 3p*3 to the form lp + qp2 + up*3 + r and give q. 1 Rearrange 18v + 126v + 54v - v to k + hv and give h. 197 Rearrange ((0 + 0 - 2z)(-3 + 3 - 5) + (2z + 1 - 1)(1 + 3 - 2))(-7z + z + 0z) to the form jz + vz*2 + o and give v. -84 Rearrange -5x + 4x - 59x*2 + 3x - x - 780x2 to tx + z + rx2 and give r. -839 Rearrange (-y - y + 3y)(-4 + 5 + 0) - y - 2y + y + 34y + 36y - 170y to the form r + ly and give l. -101 Rearrange 8n2 - 2n - 11n2 - 1 + 19n*2 + 6n*2 to ln + t + fn2 and give f. 22 Express 253 - 254 + 3p2 - p2 - 210 as xp + z + lp*2 and give l. 2 Express -109b*3 + 140b - 3b4 + 66b*3 + 45b*3 as tb*2 + cb*3 + vb*4 + yb + d and give v. -3 Express (-1 + 9o + 1 + 2)(-4 + 4 + 3o) - 3 + 3o*2 + 3 + (2 - 2 - 2o)(0o + 2o - o) as jo*2 + g + io and give j. 28 Express 10 - 22 + 25v + 4 + 5 + 2 as dv + b and give d. 25 Express 0 + 3 - 17a2 + 9a*2 - 40a*2 + 0 in the form ta + ga2 + r and give g. -48 Express 4t*2 - 3t2 + t2 + (-7t2 - t2 + 7t*2)(0 + 2 + 4) as l + ht2 + rt and give h. -4 Express -4 + 3 - 10 + 2y2 - 9y*2 + 7 in the form wy + xy2 + u and give w. 0 Express 2n - 2n + 2n + (1 - 2n - 1)(3 + 0 - 1) + 13 - 327n - 13 - 110n as pn + k and give k. 0 Express 10 - 13b3 + 12 - b2 - 5 + 29b3 - 11b*3 in the form hb*2 + i + wb*3 + rb and give i. 17 Rearrange 21m2 - 16m*2 - 12m*2 + (2m + 0m - m)(0m - m - m) to the form qm + fm2 + s and give f. -9 Rearrange -2256 + 3c - c + 2359 to the form hc + j and give j. 103 Express -p4 + 14p*2 + 11p*2 - 18p - 24p2 + 4p*3 - 5p*3 as dp*4 + xp*3 + sp + v + np2 and give d. -1 Express 185 - 277l + 141l + 134l + 176 as ul + n and give n. 361 Express c3 + 103c - 99c - 28c*2 + 2c*2 as jc*2 + qc + oc3 + s and give j. -26 Rearrange 219m - 223m + 478m + 1086m to the form j + bm and give b. 1560 Rearrange -4 + 2i + 2i + 2 - 2 + 2 - 2i + (0 + 0 + i)(2 - 3 + 2) + 4i - i - 110 + 384 to the form q + ji and give j. 6 Express (-70 - 11 - 44 + 21)(0t*2 - 3t2 - t2) in the form r + dt + wt*2 and give w. 416 Express (351f - 30f - 31f)(-1 - 3 + 2)(2 + 0 - 1)(-f - 1 + 1) as hf*2 + of + k and give o. 0 Express -12z2 - 3z + 0z - 6 + z4 + 13z*2 in the form gz*2 + az + p + jz4 + lz*3 and give a. -3 Express -11a*4 - 10a*4 + 0a*3 - 5a*3 - 2 + 26a*4 - 7a*4 as oa*3 + ia*4 + u + qa*2 + pa and give u. -2 Rearrange -6q2 + 2q*2 - 5q*2 + (0q2 - q2 + 2q2)(4 + 3 - 3) to z + sq2 + rq and give r. 0 Rearrange 6 + 2h - 3h + 0h - 2h2 - 19 + h3 to the form b + ch2 + uh*3 + wh and give c. -2 Rearrange (-3 + 1 - 1 + 1 - 2 + 3 + (3 - 2 - 2)(3 - 2 - 4) + 4 - 3 + 0)(-23 + 36 - 48)(-3 - 3 + 4)(-r + 3 - 3) to the form gr + c and give g. -210 Rearrange (-3 + 16 + 17)(-16d4 - 2d4 - d4) to ld2 + vd*4 + h + jd + kd3 and give v. -570 Rearrange -56q + 142q + 284q + 59q - 64q to the form s + mq and give m. 365 Rearrange 5 - 279u*2 - 2 + 259u*2 + 0 to g + nu*2 + pu and give n. -20 Rearrange 111 - 111 + 251n - 80n to the form y + sn and give s. 171 Express (5 + 2a - 5)(-2 + 1 - 1)(2a - 2a - a)(-132 + 66 - 60a + 68) in the form na2 + da + ua3 + z and give u. -240 Rearrange (-2n + 6 + 5 - 5 + (5n + 3n - 4n)(6 - 2 - 1))(-n + n - n)(8 - 3 + 2) to the form	{ "pile_set_name": "DM Mathematics" }
? -2 Calculate -525 divided by 119565. -35/7971 -152 divided by -1243633 152/1243633 What is 3 divided by -24328780? -3/24328780 What is 78850151 divided by -1? -78850151 What is 48 divided by 7659277? 48/7659277 Calculate -58 divided by 211439. -2/7291 Divide 30753920 by 1856. 16570 What is -265 divided by -27734? 265/27734 What is 2710472 divided by 677618? 4 Divide -70801992 by -23229. 3048 -708747 divided by 13 -54519 Divide 2833860 by 30. 94462 Divide -551619 by -29. 551619/29 Calculate 75183826 divided by 46. 1634431 Calculate 41087495 divided by 5. 8217499 81081 divided by 1 81081 -29 divided by -679932 29/679932 Calculate -3523702 divided by -266. 13247 Divide 21 by -393609. -7/131203 Divide -799085573 by 23. -34742851 757574758 divided by -3 -757574758/3 Calculate 6869 divided by 27297. 6869/27297 16190495 divided by 4 16190495/4 Calculate 910 divided by 8281. 10/91 Divide 15108 by -3547. -15108/3547 Calculate 144 divided by 241178. 72/120589 What is -2166952 divided by 18364? -118 What is 2 divided by -30740803? -2/30740803 Divide 13981 by -20227. -13981/20227 -855241324 divided by -213810331 4 What is -965 divided by -160579? 965/160579 What is -2867 divided by -333149? 2867/333149 Divide -1926244 by 1926244. -1 What is -2304 divided by -2012? 576/503 What is -2 divided by -2819017? 2/2819017 Calculate -16002 divided by -14402. 8001/7201 Divide -106296339 by 3665391. -29 What is -1881759810 divided by 4? -940879905/2 Divide 14400319 by -4. -14400319/4 Divide 72595341 by 2. 72595341/2 Calculate 837867 divided by -4. -837867/4 Calculate 11902566 divided by 13. 915582 59677 divided by -1345 -59677/1345 Calculate 2242779 divided by 4. 2242779/4 59905440 divided by 6 9984240 Divide -1117 by -59583. 1117/59583 What is -5710 divided by 58? -2855/29 -14480856 divided by -108 134082 What is 208198353 divided by -5? -208198353/5 Calculate -5178 divided by -58511. 5178/58511 Divide -49034400 by -60. 817240 What is 10 divided by -11156023? -10/11156023 Divide 5165343 by 1693. 3051 Calculate -12 divided by 614136. -1/51178 28667908 divided by -1 -28667908 What is -579424 divided by -23? 579424/23 -17126 divided by 90 -8563/45 Divide -160952469 by -5. 160952469/5 What is -9155260 divided by -452? 20255 Divide -2484749 by -29. 85681 Calculate -237742071 divided by 79247357. -3 Divide 4 by -14960597. -4/14960597 Divide -1 by 3544603. -1/3544603 Calculate 16216288 divided by 64096. 253 -25783797 divided by 2 -25783797/2 Divide -172 by -128516. 43/32129 What is 45179568 divided by -6? -7529928 82239786 divided by 6 13706631 Calculate 46 divided by -241870. -23/120935 169 divided by 2403279 169/2403279 1 divided by -7426470 -1/7426470 What is -1 divided by -241722365? 1/241722365 Divide -112 by 2451520. -7/153220 -408870 divided by 16 -204435/8 73176222 divided by 203 360474 -1153132 divided by 4 -288283 Calculate -1 divided by -1763472. 1/1763472 -37630714 divided by 606947 -62 Divide -661591384 by 165397846. -4 5828597 divided by -593 -9829 What is -908224 divided by -227056? 4 -33793606 divided by 154 -219439 1742 divided by -42689 -1742/42689 What is -372960 divided by 93240? -4 Calculate -95539620 divided by -3. 31846540 Calculate 848000250 divided by -5653335. -150 Calculate 5025048 divided by 29911. 168 What is -41322377 divided by -37? 1116821 Divide 52188 by -5131. -52188/5131 What is 17 divided by 6003150? 17/6003150 Calculate -47 divided by -249337. 47/249337 Calculate 12405 divided by -101. -12405/101 5098428 divided by 12 424869 -7018506 divided by 4 -3509253/2 What is -1 divided by 98568462? -1/98568462 Divide 6113452 by -13204. -463 Divide 19018695 by 3. 6339565 Divide -838995 by -104. 838995/104 Divide 42603720 by 5. 8520744 Divide 17755704 by -8. -2219463 What is 0 divided by 650554? 0 Calculate -37742 divided by 342. -18871/171 Calculate 3325109 divided by 19. 3325109/19 What is -10762417 divided by -8? 10762417/8 Divide -1225519 by -32. 1225519/32 What is 40799379 divided by 3? 13599793 -2 divided by 306835 -2/306835 What is -20105 divided by -7000? 4021/1400 330420305 divided by 61405 5381 What is 2 divided by 3955346? 1/1977673 Divide 42151200 by -263445. -160 -96270507 divided by 1 -96270507 What is 14093135 divided by 305? 46207 What is 9192 divided by -182? -4596/91 -29859515 divided by 1 -29859515 Calculate -20231 divided by 4786. -20231/4786 Divide 36627630 by 12209210. 3 What is -947928 divided by 12? -78994 What is -17638672 divided by -4? 4409668 Divide -608064962 by 2. -304032481 -237260688 divided by 6 -39543448 Divide -152947064 by 4757. -32152 What is 1635333 divided by 129? 12677 -1570008 divided by -19 82632 Divide 159671 by -18. -159671/18 What is -8227527 divided by 249319? -33 Calculate 16 divided by 378270. 8/189135 Divide 232470 by -4. -116235/2 Calculate -2 divided by -1708780. 1/854390 -551526803 divided by -6197 88999 What is 488376 divided by 122094? 4 Divide 1917783 by -91323. -21 Calculate -444026 divided by -121. 40366/11 Divide 5870025 by 1. 5870025 Divide 5 by 2453667. 5/2453667 What is 5 divided by -3198676? -5/3198676 What is -4 divided by -28842805? 4/28842805 What is 3090 divided by -46362? -515/7727 What is -45 divided by -6776228? 45/6776228 Divide -177035460 by -7620. 23233 Divide -2 by -23667491. 2/23667491 Divide 3665417 by 7. 523631 Calculate -4381118 divided by 2190559. -2 What is -9676066 divided by -5? 9676066/5 What is -235292257 divided by 4? -235292257/4 Calculate 3354 divided by -20762. -1677/10381 Divide 260 by 80411. 260/80411 2494 divided by -287859 -2494/287859 Calculate -70464600 divided by -70464600. 1 Calculate 14712 divided by 6946. 7356/3473 Divide -4 by 4998329. -4/4998329 What is -3954380 divided by 326? -12130 What is 17 divided by 8018094? 17/8018094 Calculate 215481 divided by -1. -215481 Calculate 284045660 divided by 56809132. 5 What is 169694451 divided by 3? 56564817 Calculate -23479009 divided by -4727. 4967 Divide -341962476 by -56993746. 6 Calculate 3459049 divided by 33583. 103 -1757722090 divided by -5 351544418 Divide 3173322 by -528887. -6 -1042872028 divided by -419498 2486 What is 10 divided by -3988? -5/1994 Calculate -15 divided by 7680859. -15/7680859 23950902 divided by 17 23950902/17 Divide 328077512 by 280648. 1169 What is -2 divided by -10552427? 2/10552427 Calculate 975 divided by -35303. -975/35303 -57055608 divided by -34206 1668 Divide 881987 by 96. 881987/96 What is 10816098 divided by 1? 10816098 40316557 divided by -5 -40316557/5 -46 divided by -6479557 46/6479557 What is 690 divided by 600499? 690/600499 What is 204976368 divided by 796? 257508 -2757 divided by -1177 2757/1177 What is 1719276 divided by 28? 429819/7 Calculate -4 divided by -42897602. 2/21448801 Calculate -6 divided by 5196016. -3/2598008 508393 divided by 49 508393/49 Calculate 96277695 divided by -719. -133905 Divide -156059538 by 149054. -1047 Divide 62975133 by 62975133. 1 Divide 1 by 8530992. 1/8530992 -3074106 divided by 2226 -1381 What is -4 divided by -234405? 4/234405 -244463210 divided by 12214 -20015 What is 1041 divided by 95822? 1041/95822 What is -9306928 divided by 9306928? -1 Divide -16 by 66339. -16/66339 -4 divided by -29779224 1/7444806 Calculate 322 divided by -7618. -161/3809 -117774856 divided by -1252924 94 What is 684216 divided by 442? 1548 Calculate -6224120 divided by 28. -222290 What is -125935755 divided by -25187151? 5 Calculate 91985754 divided by -327. -281302 Divide 7495581 by 6. 2498527/2 Calculate -102329028 divided by -25582257. 4 Calculate 9291 divided by -1162. -9291/1162 Divide -5 by 250179366. -5/250179366 -4619 divided by 260 -4619/260 Calculate 626331 divided by -169. -626331/169 Calculate 33133825 divided by -6626765. -5 Divide -23982486 by 6. -3997081 Divide -1475061 by 70241. -21 What is -8050080 divided by 5? -1610016 2 divided by 51489624 1/25744812 Calculate -5482 divided by -27864. 2741/13932 Calculate 8349334 divided by 1. 8349334 1 divided by -157472208 -1/157472208 Divide 7 by 5189972. 7/5189972 What is 35702337 divided by 137? 260601 What is 140 divided by 19415? 28/3883 Calculate 173900 divided by 1. 173900 Divide -93147730 by -5. 18629546 What is -5 divided by 24188709? -5/24188709 -815 divided by -6502 815/6502 Divide 2	{ "pile_set_name": "DM Mathematics" }
86. Calculate the smallest common multiple of m and 6. 114 Let t(h) = -15h3 + 21h*2 - 2h - 13. Let c(l) = -7l3 + 10l*2 - l - 6. Let z(m) = 13c(m) - 6t(m). What is the least common multiple of 10 and z(2)? 30 Let x = 350 + -246. Calculate the least common multiple of x and 9. 936 Let z be (-2)/(-1)(2 + -1). Calculate the smallest common multiple of (6/(-15))/(z/(-50)) and 4. 20 Let h(z) = -z*3 - 8z*2 - 4z + 8. Calculate the smallest common multiple of 16 and h(-8). 80 Let x = -4 + 18. What is the common denominator of (-150)/(-16) + 7/x and 41/18? 72 Suppose 2z - 6z + 40 = 0. What is the common denominator of 47/10 and (-166)/(-90) + 6/z? 90 Suppose 4u = -12, 12u = -4i + 17u + 79. Calculate the lowest common multiple of i and 16. 16 Suppose -5r - 6 = 2l, 4l + 5r = 10r + 18. Calculate the smallest common multiple of l and 9. 18 Suppose 0 = -2n - 3n - 5. What is the common denominator of 3n + (-309)/(-54) and (-404)/(-24) + (-1)/(-3)? 18 Let x = -7 - -4. Find the common denominator of -2 - x - (-21)/(-20) and -19/12. 60 Let m(d) = d*2 + 5d - 3. Let p be m(-5). Let r = 2 + p. Let n(w) = 10w2 - 2w - 1. Calculate the lowest common multiple of 5 and n(r). 55 Let q be 6/2 - (1 + -1). Suppose s + qg - 20 = 0, 0 = 2s + 3s + 3g - 52. Let y(z) = z*2 - 7z + 12. What is the least common multiple of y(8) and s? 40 Suppose 6c - 2c - 28 = -4m, 5m - 34 = -4c. Calculate the lowest common multiple of 2 and m. 6 Let y be (2/3)/(2/(-6)). Let v be y/(-5) + 8/5. Calculate the common denominator of (v - 16)6/(-64) and 13/10. 80 Let q = 7835/2 + -2948. Let a = -6736/7 + q. Calculate the common denominator of a and 59/2. 14 Let d(o) = o*2 - 9o + 28. Calculate the lowest common multiple of 116 and d(5). 232 Suppose -29 = -4n - m, -2n + 13 = -4m + 3m. Suppose nu = 2u + 5. What is the lowest common multiple of 11 and u? 11 Suppose 0 = -5z - 14u + 17u + 984, u = z - 196. Calculate the smallest common multiple of 2 and z. 198 Let d(q) = q2 + 9q + 6. Let f be d(-6). Let k = 26 + -14. Find the common denominator of (-170)/k(-9)/f and 47/6. 24 Let j = 3 + 0. Suppose -i = 3b + 11, 5b + 5 = -ji - 8. What is the lowest common multiple of 1/i + 71/4 and 14? 126 Let x be 2/5 - 424/10. Find the common denominator of (-951)/(-126) - (-4)/14 and (-2)/8 - x/4. 12 What is the common denominator of (-5999)/588 + 3 - (-2)/7 and -99/20? 60 Let f = 467428/45 + -10386. What is the common denominator of 103/40 and f? 360 Let z = 278/63 + 15/7. What is the common denominator of -38/21 and z? 63 Let u = 3967/13 - 304. Find the common denominator of 55/9 and u. 117 Let v(r) = r*3 + 7r*2 - 7r + 10. Suppose 3g + 2g - 5 = 0. What is the lowest common multiple of (12/10)/(g/5) and v(-8)? 6 Find the common denominator of ((-2)/(-36))/(2 + (-1215)/610) and -61/24. 72 Suppose -5x + 30 = 2w, 5x - 34 = -w - 9. Calculate the least common multiple of x and 3. 12 Let w = 56/47109 - 177982898/4286919. Let a = 510/13 + w. What is the common denominator of -121/6 and a? 42 Let o be (2/4)/(2/(-24)). Calculate the common denominator of (-81)/(-5)10/(-4) and (6/(-9))/(o/51). 6 Let c = 73/2 - 831/22. What is the common denominator of 73/4 and c? 44 Let v = -10 - -12. Calculate the lowest common multiple of v and 7. 14 Let c = -62001/110 - -2813/5. Find the common denominator of c and (-2)/(-12)(-498)/(-26). 286 Let o(n) = n3 - 5n*2 - 7n. Let w be o(6). Find the common denominator of 45 and (w/(-28))/(6/(-12)). 7 Let l = -430/17 + 5011/102. Let q = -522151 + 4189343/8. Let m = 1521 - q. What is the common denominator of l and m? 24 Let k = -81/74 - 2081/296. Let l be (1014/(-16773))/((-24)/(-3209)). Let r = l - 1/11182. Calculate the common denominator of k and r. 24 Find the common denominator of (-9)/(-9)(26/20)/(-1) and 42/29. 290 Let s = 148 - 331/2. Let i = -359/12 - -30. Calculate the common denominator of i and s. 12 Suppose 4p = 0, 5o + 0p = -5p + 20. What is the lowest common multiple of 18 and o? 36 Calculate the least common multiple of 2 + -5 - (-19 + 5) and 7. 77 Suppose o = -3o + 8. Suppose -3a + 6 = -24. Calculate the least common multiple of o and a. 10 Let d(r) = -r + 8. Let w be d(8). Suppose w = 5x - 32 + 2. Calculate the smallest common multiple of x and (-3 + 4)/((-1)/(-4)). 12 Suppose -12 = -5v + 3c, 0v + 3c + 12 = -2v. Let n be 1/(-1 + v + 0). What is the lowest common multiple of 4 and -1 - n/(-1)-11? 20 Suppose 0 = -2a + 3 - 1. Suppose 5i - l = 19, -i + 3i - 10 = -2l. What is the smallest common multiple of a and i? 4 Let c = 2465 + -27083/11. Calculate the common denominator of c and 6/(-16) - (-3605)/(-168). 66 Let m(h) = -h - 8. What is the lowest common multiple of 4 and m(-16)? 8 Let o = 0 + 3. Let i(z) = -2z - 4. Let s be -1 - 1 - (4 - 2). Calculate the least common multiple of i(s) and o. 12 Let l(k) = -32k*3 - 2k*2 - 2k + 1. What is the least common multiple of l(-1) and 18? 198 Let u be (-902 - 0) + 1 + -1. Find the common denominator of -53/7 and 8/36 + u/(-72). 28 Let m = -32363/4004 + -2/3003. Find the common denominator of m and 11/12. 12 Let m = 2868892/75 + -38254. Let v = m - -1097/50. Find the common denominator of v and 38. 6 Let c = -2/13115 + 38824/23607. What is the common denominator of -59/5 and c? 45 Let b = 9296 - 130071/14. Find the common denominator of 33/28 and b. 28 Let u = -5/103 + 3861/1030. Let f = -109/4 - -13. What is the common denominator of f and u? 20 Find the common denominator of -56/11 and ((-36)/(-48))/((-5)/(-34)). 110 Let f be (-6)/21 - (-23)/7. Suppose -m - 4 = fm, -s - 5m = -4750. Let i = s + -52267/11. What is the common denominator of 91/4 and i? 44 Let f(o) = -7o2 - 1. Let r be f(1). Let l be (4/114)/(r/1176). Let p = -3019/228 - l. Find the common denominator of p and -83/6. 12 What is the common denominator of -25/18 and (175/16)/(-7) + -3? 144 Suppose -11 = -3f - 5h, 2f + 5h = -0f + 9. Suppose r + 3 + 5 = 0. Let p = r - -22. What is the smallest common multiple of p and f? 14 Let f be (4188/(-27) + 0)6. Let h = -916 - f. Find the common denominator of h and 3-21(-3)/(-24). 24 Let h = -1773436067/688860 - -22/34443. Let o = 4784 + -2212. Let g = o + h. What is the common denominator of g and -115/6? 60 Let k = -29 + 36. Calculate the least common multiple of k and 1. 7 Calculate the least common multiple of 12 and (-2 - (-3 + 10))-3. 108 What is the common denominator of 710/268 + ((-2)/(-2) - 4) and 109/12? 804 Suppose -22t + 560 = -14t. What is the lowest common multiple of 12 and t? 420 Let f be 14845/(-24)(-14)/460. Let u = 3/368 + f. Let g = -220267/18 - -12233. Calculate the common denominator of g and u. 18 Let a = -2/13173 - -10256/9708501. Let c = -3064007738035/345275968488 + -235/19520351. Let o = c - a. Calculate the common denominator of o and 89/4. 8 Let i be 2/(-9) + 56/9. Let l = -3 + i. Let x = -7 + 14. What is the smallest common multiple of x and l? 21 Let r = 235597/153050 + 2/3061. What is the common denominator of r and 123/20? 100 Calculate the least common multiple of 8 and (-11 - -10)(0 + -5). 40 Let n = 50 + -40. Let i be (1 - 2) + -13. Let w = 6 + i. Calculate the smallest common multiple of w and n. 10 Suppose -4b = 2t - 6t - 36, 0 = -t + 1. Suppose u = -10i + 6i + 9, 7 = 4i - u. What is the lowest common multiple of b and i? 10 Find the common denominator of 410/(-72) + (75/(-10))/(-5) and 73/6. 36 Let o = 37137000561/11 - 3371814694. Let v = o + -4270941. Let p = v - 5330. Find the common denominator of p and 1. 11 Let i = -10183983 + 163034557/16. Let l = -5673 + i. Calculate the common denominator of l and (-7)/4(-4)/(-6). 48 Suppose -2w = 3x - 2, -2x + 0 - 6 = 5w. Suppose -xc + 71 = -5j, 0 = -j - 3. Suppose 2a = -0a + c. What is the lowest common multiple of a and 6? 42 Let y = -6120 + 48891/8. What is the common denominator of (-1754)/(-84) - (-4)/14 and y? 24 Let o be (-20 + 21)/(1/3). Let j = 5 - -1. Suppose ou - 54 = -j. Calculate the smallest common multiple of u and 8. 16 Suppose -2s = -3*s - 5. Calculate the common denominator of -101/16 and (s/30)/((-4)/594). 16 Let d = 46 - 18. What is the common denominator of -93/2 and 589/d + (-6)/21? 4 What is the c	{ "pile_set_name": "DM Mathematics" }
3 = 0 for x. -5 Let l(j) = j3 + j2 + 5j + 2. Let k(v) = -v3 - 8v*2 + 8v - 9. Let p be k(-9). Let s be l(p). Solve -q - 22 = 2i + si, -q - 3i - 17 = 0 for q. -2 Let q = -49 - -19. Let l be 22/10 + (-24)/q. Suppose -lm + 0 + 2 = -h, -4m + 5h - 12 = 0. Solve 4s = 5j + 23, -ms - 2 = 3s + 4j for s. 2 Let j be (1/6)/(6/(-60))-3. Let r be (4/j)/(9/45). Solve 5x - a = -r, x - 2a + 2 - 3 = 0 for x. -1 Let j be (1 - (0 + 4))(-15)/9. Suppose -25 = -jy, 2y - 5y = 5t - 35. Let v be (-2)/(-6) - 22/(-6). Solve -vs + 3w + 2 = 24, 0 = -2w + t for s. -4 Suppose 3 = 2c + 2c + 3g, -c = 5g + 12. Suppose -7h + 8 = -3h - 4d, 8 = 4h - cd. Solve -5s + 6 = -3l, 4 + h = 2l for s. 3 Let b(x) be the second derivative of x4/4 - x2/2 - 14x. Let z be b(1). Solve -zk = 2s - 8, 4s - 4k - 20 = -s for s. 4 Let v = 44 + 67. Let h = v - 94. Solve -4r - 2y = -18, 2y - h = -4r + y for r. 4 Let d = 814 - 812. Solve 0 = 2f + f - dk + 3, 3k = 5f + 4 for f. 1 Suppose -3u = -2i + 30, -i - 4 = -u - 18. Suppose -5j - 7 = 2j. Let p = i + j. Solve n - 2l + p = 0, 20 = -3n - l + 8 for n. -5 Let f = 50 - 30. Let q(r) = -r + 26. Let k be q(f). Solve 4s + 4l + 24 = 0, -s + k + 0 = -5l for s. -4 Let d = 5 - 17. Let k = -7 - d. Let g be 315/(-252)(-8)/2. Solve -5c + g = 0, 1 = y + 5c - k for y. 1 Suppose 4y - 65 = 107. Let x = 50 - y. Solve 0 = g + g - t + 6, -x = -5g - 3t for g. -1 Suppose 2n - 11 = -1. Suppose 4 = nt - 11. Let x be ((-13)/(-13))/((-2)/(-4)). Solve 0g - tz = -4g - 21, -4g - 18 = -xz for g. -3 Let a be 9(-2)/6(-5)/15. Solve u = 2u - 2f + 8, 0 = -4u - 3f + a for u. -2 Suppose -8h = -2h. Solve 2i + 26 = -4p, -4i + 4p - 1 - 3 = h for i. -5 Let d(t) = 2t - 7. Let u be d(5). Let c(o) = -o*3 + 2o*2 + 2o + 5. Let b be c(u). Solve bl + 4s + 30 = 0, 3l = 2s - 5s - 30 for l. -5 Let t = 1376 + -1372. Solve tv - 29 = 5q - 5, 7 = -q + 3v for q. -4 Suppose -4v + 209 = 6r - r, -155 = -3r + 5v. Solve -5f = -4y - 40, 9f - 4f - 5y - r = 0 for f. 4 Let z(p) = -p3 + 3p*2 - 3p + 3. Let q be z(2). Let c be (-1 + 2)/(q/5). Solve 0 = -3h - 5n - 0n, 4h - cn = 0 for h. 0 Let l(v) = v + 11. Let g be l(-9). Let r(i) = -i3 + i + 8. Let x be r(0). Let a be 0-1g/x. Solve k + 4k - 5h - 10 = a, 8 = 4h for k. 4 Let g be 27(64/12 - 5). Solve 4s + 5a + 1 = 0, 5s + 5 - g = -a for s. 1 Let l(d) = d3 - d2. Let t be l(1). Let m = 4 - t. Solve 0 = -4h - 4p + 9 + 7, mp = -h + 19 for h. -1 Let f = -27 + 34. Let j(b) = -b + 12. Let y be j(f). Solve yi - 7 = 3a, -i + 21 - 6 = -4a for a. -4 Suppose 0 = 3c - c + 8. Let h be ((c - 0) + 2)-1. Solve f + 4 = -2x - hx, 5x + 5 = 5f for x. -1 Let i = 172 + -164. Suppose in - 24 = 2n. Solve nr = 4j + 8, r = -j - 0r for j. -1 Suppose -2w - 980 = 2w. Let g be (-686)/w + 0 + (-4)/5. Let c be 326/14 - 2/7. Solve 7q = 2q - gm - c, 13 = -2q + 3m for q. -5 Suppose 12m - 17m - 4c = -72, -2m + c + 21 = 0. Solve -4x - l - 1 = m, -3l + 3 = -2x for x. -3 Let b be (-36)/12/(-6). Suppose -2v = 2v - 3z + b, -5v + 16 = 4z. Solve v = -2t + 2w, 4t + 2w - w = 25 for t. 5 Let o be (-2)/6(14 - (19 + 1)). Solve x = 0, ox + 4 = -4n + x for n. -1 Suppose 24k - 79 = -7. Solve 0 = kn + 2n - 2y + 2, 2n - 2y - 4 = 0 for n. -2 Let s = -151 + 156. Solve l = st - 1, -4t = -0l - 4l - 4 for l. -1 Let t(h) = -h*3 + 6h*2 - 3h - 7. Let p be t(5). Suppose 0 = px - 3s + s - 14, 3s = -3. Let c = -30 - -50. Solve -2u + 14 = xw, -5w + c = -0 for u. -1 Suppose -2z + 18 = -4p, -2z + z + 3 = p. Let s be z/(-2)(12/10 + -2). Solve 7v = i + 2v + 23, 4 = -4i - sv for i. -3 Suppose -3 = -5t - 3a, 0 = -2t + a + 3a + 22. Solve -tz = -z + 3v + 3, 4v = -2z - 2 for z. -3 Let m = -4 - -4. Suppose 0 = -4v + s + 27, 4 = 3v - 2v - 3s. Solve -y + v = -3g - 7, -5y + g = m for y. -1 Let z be (-10)/(-1) + -5 + 4 + 0. Suppose -88 = i - zi. Let j(s) = -s2 - s + 4. Let d be j(0). Solve -l + 4v = -0v + 7, 0 = dl + v + i for l. -3 Suppose -273c = -278c. Let g be (-6)/2 + 9 + -6. Solve gv - 4t = 2v - 30, c = -4v - 5t + 45 for v. 5 Suppose 0 = 3w + 33 + 27. Let u be (-9)/(45/w) + 2. Solve l = 5i - 10, 8 = 4i + 2l - ul for i. 2 Let o be (5 - 15/4)4. Suppose -9 = -3v + w, ov - 16 = 3w - w. Solve -3k - 5h = -0h + 16, h + v = 0 for k. -2 Let y(o) = o + 6. Let a be y(-6). Suppose a = -2j + 2g + 4, -6j + 18 = -3j + 3g. Suppose j = -4n + 24. Solve -4m - 1 = 3c, -m - n = -3c + m for c. 1 Suppose 206 = 8x - 6x. Suppose -4v - l = -x, -l - 98 = -4v - 3l. Solve -3q = 4a - v, -2q + 0a = 2a - 16 for q. 5 Let t = -2471 - -2476. Solve -w + 1 = -2f, 14 + 2 = 3f - tw for f. -3 Suppose 3n - 42 = 2n. Let i = n + -39. Solve 4u - ia = -2a - 9, -2u + 3 = -3a for u. -3 Suppose 0 = -5q + 15, -5g + q = -3q + 122. Let p be (-4)/g + (-252)/(-66). Solve a + pu = -a - 12, -4a = -2u + 4 for a. -2 Let a(j) = -1. Let t(c) = 2c - 10. Let h(x) = -4a(x) - t(x). Let d be h(6). Solve 0 = -du + 5v + 10, 3v = 2u - 1 - 1 for u. -5 Let m = 1091 + -1089. Solve -mr = 0, 1 = -b + 2b - r for b. 1 Suppose 2p - 35 = -3w, 5p - 3w + 23 = 163. Solve -4y + b + 4 = -2y, 5y = -5b + p for y. 3 Suppose 2o - 2 = -j - 3j, -5j - 14 = -3o. Suppose -4z - 12 = 0, o - 6 = -3w - z. Solve 4h - 3 = -7d + 4d, d - wh - 1 = 0 for d. 1 Suppose 2s + 2s = 24. Suppose -7t = -st - 3. Suppose 5w + tz - 125 = 0, 5z - 47 = w - 2w. Solve 5f = -3p + 17, -4p + 2p + 5f - w = 0 for p. -1 Suppose 13z - 15z = -18. Let f be (-4 + 1)(8 - z). Solve -3s = -0h + 4h + 7, 2h = -fs - 5 for h. -1 Let j = 13 + 14. Let d = -24 + j. Suppose -2g + 6b - 2b = -8, g = db + 4. Solve 4v - 3z = -24, -3v - gz + 4 = -3 for v. -3 Let q = 8 + -6. Let z(u) = 114u + 1031. Let k be z(-9). Solve -qj - kl + 16 + 4 = 0, j = 4l - 3 for j. 5 Let g be ((-56)/5)/(32/(-80)). Suppose 1 + 3 = -d, -5a + 2d = -g. Solve -4j = -3n - 2j + 5, -5n + 5 = -aj for n. 5 Suppose 5g = -4p + 12 + 15, 3p - 5g = -6. Suppose pk + 15 = 0, 3k + 9 = -w - 2w. Suppose wb = -2b + 52. Solve -m + l + 1 = 0, 4m - b = -l + 2l for m. 4 Let o be (-35)/(-14) - 1/(-4)-2. Suppose 8 = n + r, 0 = n - on - 4r + 23. Solve -3v + nt + 2 = -10, 0 = -3t for v. 4 Let d(g) = -g3 + 3g*2 + 54g + 5. Let a be d(9). Solve 2k - a = q - 4q, -4k + 2q = 14 for k. -2 Let w = -220 + 223. Solve y = -wm - 4 - 10, -3y + m = 12 for y. -5 Suppose 5i = -2p, i - 44 = 5p - 17. Let k = 0 + 10. Suppose -36 = -kz + 14. Solve -h + 16 = -5h - 4y, -iy = -zh - 27 for h. -5 Let a be (-1 - -1)22/221. Suppose 2d = -4j - d + 42, -4j = -5d - 26. Solve l - 4t + 11 = 0, -5l + 4t + at = -j for l. 5 Let w(q) = -q - 18. Let r be w(-8). Let o = r + 12. Solve -4s - 4k + 2 + 2 = 0, -3s + ok = 17 for s. -3 Let z be (-2 - 0)(-33)/22. Suppose x = -5c + 19, 0 = 2x + zc + c - 20. Solve -5a - x = 4v, a + 3v = -a + 4 for a. -4 Suppose 0 = 8f - 1 - 15. Let j = 2 - -2. Solve jk + 8 = -l + 5l, 0 = -fk + 4l for k. -4 Let v(g) = -6g + 34. Let t be v(5). Suppose -3w + 4h = -t, 5w - 3h - 12 = h. Solve wd = -5z + 7, 4z - 2d - 2d + 16 = 0 for z. -1 Let i = -3 + -13. Let a be 12/i-4 + -3. Solve 4p - 4f = a, p - 3f - 14 = 5p for p. -2 Let p be 1/(-2 - -7 - 4)5. Solve -5 + 23 = 5i - k, pi = -k + 22 for i. 4 Let d be ((-2)/(-10))/((-9)/(-135)). Solve 7a - 2a = 5w, 0 = -dw + 5a + 10 for w. -5 Let a(l) = 28l*3 + 2l*2 - 1. Let x be a(1). Suppose -2n - 166 = 5k - 48, 2k - 5n = -53. Let o = k + x. Solve -2p + 4g + 5 = 3p, og + 2 = 2p for p. 1 Let c(p) = p*3 - 9p*2 - 9p - 8. Let i be c(10). Suppose -10 = 12n - 17n. Solve 0a - id = na + 4, d = -2a - 6 for a. -4 Let l(p) = p - 9. Let m be l(13). Suppose 10 - 14 = -2o. Suppose -3i = 4k + 6 + 2, -3k = 15. Solve mn + ib = 0, -1 - 1 = on + b for n. -2 Suppose -2g = 3z + 11, -3g - 2z = 3z + 19. Suppose -1 = 3t - 2a - 7, 8 = 5t - 4a. Solve -7 = -p - gc, -3p - 2p = tc - 29 for p. 5 Let h(l) = 2l3 - 17l*2 - 3l - 14. Let b be h(9). Solve -2p - x - 20 = -3x, -5p + 3x = b for p. -5 Suppose -154 = -20h - 134. Solve -5i - 5q = 0, -2q + 6*q - h = -3	{ "pile_set_name": "DM Mathematics" }
9)(-1)/(-9)6. Which is the third biggest value? (a) 0.2 (b) q (c) -0.4 (d) 2 b Let x = 31054.013 - 31054. Which is the second smallest value? (a) x (b) -95 (c) -2 c Suppose 7 = w - 3j, 0 = -2w + 5j - 2j + 5. Let y be 2 - -5w/6. Let l = -310 + 318. Which is the smallest value? (a) l (b) y (c) 4 b Let i = -235 - -196.4. Let m = -38.4 - i. What is the biggest value in -2/3, -31, -0.4, m? m Let i = -19/6 - -7/2. Let n be ((-3)/(-9)-1)/((-68)/(-6)). Let x be ((-3)/(-7))/(585 + -586). Which is the third smallest value? (a) n (b) x (c) -1/8 (d) i a Let u = -42844/13 + 3296. What is the third smallest value in u, 4/21, -5? u Let y = 107 + -275. Let o = y - -172. What is the third smallest value in o, 142, -1? 142 Let r be ((-720)/75 + 9)/(27/(-90)). Which is the third biggest value? (a) -18 (b) -22 (c) -1.6 (d) r a Let s = 1293 + -9047/7. Let d = -12 + 13.2. Let u = 1.6 - d. What is the second smallest value in u, -1/7, s, -0.3? -1/7 Suppose 148z - 1244 - 2752 = 0. Which is the fourth smallest value? (a) -1 (b) z (c) -0.1 (d) -1/7 b Let u(p) = -32p*2 - 22p - 68. Let x be u(-3). Which is the biggest value? (a) -4 (b) x (c) -1 c Let s be (1/(-4))/(309/206). What is the fourth biggest value in 1, -1/12, 2, s? s Let x = -2.8 - -3. Let v = 1.28 - 1.29. What is the biggest value in -4, x, v? x Let y = 672 - 460. Let n = y - 203. Let b be 1/(-3)(-6)/(-8). What is the third smallest value in n, b, 0.5? n Let i = -11387 + 11482. Let r = 13 + 79. Let l = r - i. Which is the third smallest value? (a) 1/6 (b) 4 (c) l (d) 5 b Let x = 0.19352 + -4.19352. What is the third biggest value in 0.1, x, 0.4, -4/29, 0.8? 0.1 Let i = 80.86 - 78. Let j = i - 2.86. Which is the smallest value? (a) j (b) 2/31 (c) -3/2 (d) -1/6 c Let w be (-2 + -1)-6 - (-6 - -4). Let r be (2/(-5))/(w/(-25)). Let o = -47/126 + -1/18. What is the smallest value in r, 4, o? o Let h = 0.54174 + 0.05826. What is the second smallest value in 28, h, 0.3? h Let i = -231282 + 231277. Let b = 0.81 - 0.11. Let h = -4.7 + b. What is the second smallest value in h, 2/5, i? h Let q = -7 + 11. Let r be ((-372)/(-186))/(1/(-10)-4). Which is the third biggest value? (a) 0.5 (b) r (c) 0.2 (d) q a Let j be 0 + -11 - ((-180)/(-15) + -20). Which is the fourth biggest value? (a) 30 (b) j (c) 3 (d) 0.3 b Let r = 236 - 239. Suppose -4s + 4 = -4j, s - 2j - j - 5 = 0. Which is the biggest value? (a) -2/3 (b) 2/21 (c) s (d) r b Let l = -40.1408 - -0.0408. Let q = l - -44.1. What is the smallest value in 0.5, q, 61? 0.5 Suppose 0 = 4t + 19 - 3. Let l = -23/82 + 14/123. Which is the second biggest value? (a) l (b) t (c) 0.1 a Suppose 172w + 220 = 150w. Suppose -3c = -30 - 21. Suppose -c = d + 4x, 0d - 6 = -2d + 2x. What is the second biggest value in -2/11, -0.2, w, d? -0.2 Let m be (-111 - -95)/(1 - 0). What is the biggest value in m, 5, -1/6? 5 Let f = 309.92 + -310.12. Let w = -193 - -1353/7. What is the biggest value in 0.22, f, w, -1? w Let s be 2/4-21. Let y = 1.081 - 0.081. Which is the fourth smallest value? (a) -0.1 (b) y (c) -22 (d) s b Let u = -21405 + 64213/3. Let h = 1 + -4. Let l = 2 + h. What is the third biggest value in -5, u, l? -5 Let o = -26.19 + 26.15. Which is the second biggest value? (a) -4 (b) -271 (c) o a Let p = -829.6 - -856.6. Which is the second smallest value? (a) p (b) 5 (c) -0.012 b Let l = 0.09 + -0.12. Let t = 0.53 + l. Let s = -0.03 + 0.06. What is the second biggest value in t, 4, s? t Let a be (1 + 1)/((-2)/4). Let y be (4/3)/(40/12). Let u = 230/3 - 77. What is the second smallest value in y, u, 4, a? u Let x = 0.2916 + -111.6716. Let p = x + 107. Let i = -0.38 - p. Which is the third biggest value? (a) 0.2 (b) 6 (c) i a Let s = 0.8909 + -0.8109. What is the smallest value in 1/7, s, 2/3, -5, -4/11? -5 Let r = -10 + 20. Suppose 8 = -3x - r. Let s be (-8)/x27/24. Which is the fourth smallest value? (a) 3 (b) -2/15 (c) s (d) -2/11 a Let q = 9088 - 9241. What is the smallest value in q, 1/2, 1? q Let o = 57.962 - -0.038. Let t = o + -63. Let s = -26/7 + 106/21. Which is the biggest value? (a) 4 (b) s (c) t (d) -0.3 a Let k = 34910 + -34800. Which is the smallest value? (a) -1 (b) -0.2 (c) k (d) 0 (e) 9 a Let q = -1.4609 - 0.5391. Which is the third smallest value? (a) 0.1 (b) q (c) 1 (d) -2/11 (e) -4/9 d Suppose -82f + 388 = 62f - 47f. Which is the second biggest value? (a) -0.4 (b) f (c) 13 (d) -9 (e) 2/7 b Let m = -1558 - -1558.2. Let g = 0.43 + -0.07. Let x = g - -0.04. What is the biggest value in x, 1, -0.5, m? 1 Let v = 3173 - 66631/21. What is the smallest value in 1, 2, v, -2/3? -2/3 Let v = 839/657 + -77/73. What is the fourth biggest value in -55, v, 0.3, 2? -55 Let q be (-515)/(-206)(114/260 + (-3)/6). Let i = -10 - -33. Which is the second biggest value? (a) i (b) q (c) -5 b Let o = 382/1631 + 12/233. Let f = -325/3 + 110. Which is the fourth smallest value? (a) -0.2 (b) f (c) -2 (d) o b Let s = -14467/57836 + 2/14459. What is the second biggest value in -71, -0.047, s? s Let r = -32.94 - -32.84. Let n = -214 - -12627/59. What is the third biggest value in -1/4, r, n, 4/9? r Suppose 10 - 20 = -5o. Suppose 1 = ok + 9. What is the second biggest value in k, 0.2, 5? 0.2 Let g be (2/4)/((-50)/(-4) + -147 + 135). Let x = -3.06 - -0.06. What is the biggest value in 1/4, x, g? g Let t = -49/2 - -24. Let x be -1756/81612/21. Let v = -9.2 - 2.8. Which is the fourth smallest value? (a) -3 (b) x (c) t (d) v c Let a = -171.5 + -344. Let y = a - -517. What is the second smallest value in y, -1/2, 3, -5? -1/2 Suppose -2p - 3p + 20 = 0. Let h = 0.4842 - 1271.6842. Let x = h - -1271. What is the third smallest value in 0.02, 5, p, x? p Let o be ((-2)/(-9))/(24/(1584/22)). Which is the third smallest value? (a) 2 (b) o (c) -31 (d) 0 b Let d = -75.0542 + 0.0542. Let k = 71 + d. Let q be (-69)/(-4) - 1/4. What is the smallest value in 1/2, q, k? k Let l = -3/94 + 72/47. Let h = 16 - 16.5. Let m = -122 + 125. Which is the third biggest value? (a) h (b) 5 (c) m (d) l d Let n = -6/49 + 152/441. Let b be 20/(-66)(-54)/30. Let k = 1.92 + 0.08. What is the third biggest value in k, b, n? n Let w be ((-6)/(-10) + 0)/(213/355 - -3). Let u = 2.4 + -3.7. Which is the third smallest value? (a) u (b) w (c) 4 c Let m = 105 + -100.7. Let i = 663.4 - 659. Let z = m - i. What is the second biggest value in 3, -0.5, z? z Let l be -1 + (299/92 - 6/(-8)). Let g be (4/(-8 + 28))/(l/(-5)). Which is the smallest value? (a) 0.1 (b) -2 (c) g (d) -0.3 b Let l be (-6)/(-2) + 8/12-6. Let v be ((-23)/(-483))/(l/3). Let f = -4.93 + -0.07. Which is the second smallest value? (a) f (b) 5 (c) v (d) 3 c Let c = -7.756 - 1.674. Let l = c - -9. Let n = l + 0.13. What is the biggest value in n, 1/2, -4? 1/2 Let x be 446/(-180) - ((-27)/9 + 1). Let z = x + 7/10. Which is the third smallest value? (a) 0.01 (b) 6/11 (c) -0.02 (d) z d Let t = 24179 - 217610/9. Let u = -1 + 1. What is the biggest value in u, -5, t? t Let g be (-5)/50-5 + (-2)/4. Let k(t) = -t3 - t2 - t + 3. Let u be k(g). Suppose -28 + u = 5c. What is the third biggest value in -4, c, -0.5, 2/5? -4 Let v = 98419/169125 - -14/6765. Let j = v + 2/125. Which is the third smallest value? (a) j (b) -4 (c) 2 (d) 0.5 a Suppose -z - 4o + 170 = 0, 0 = -4o + o + 9. Let q = z + -1108/7. Which is the second smallest value? (a) 3/8 (b) 1/6 (c) 2/5 (d) q b Let m(u) = u*2 + u - 78. Let g be m(12). Let y be 0 - 123/g - 18/(-12). Which is the smallest value? (a) 1 (b) y (c) -5 c Let i = -16167 - -16166.27. Let b = 4/183 - -521/1281. Let g = -3 + 2.7. What is the biggest value in b, g, i? b Let f be (13/(-3))/(7/(-3)). Let i be (2400/(-105) - -12) + 13. Let p = i - f. Which is the biggest value? (a) p (b) -1/3 (c) -0.2 a Let s = 4717/2 - 344337/146. What is the second smallest value in 2, -4, s, 4/7? s Let s be (-88)/(-16) + 2/216/(-32). Which is the smallest value? (a) s (b) 27 (c) 2 (d) 12 (e) 0 e Let w = -30.46 + 30. Let k = -0.36 - w. Let x = -25 + 25.01. Which is the smallest value? (a) -4 (b) -5 (c) k (d) x b Let x = 7019 + -7024. What is the biggest value in -7, 3, 0.3, x, 1? 3 Let q	{ "pile_set_name": "DM Mathematics" }
20052 is divided by 911? 10 Calculate the remainder when 19057 is divided by 794. 1 Calculate the remainder when 72007 is divided by 7. 5 Calculate the remainder when 39512 is divided by 3578. 154 Calculate the remainder when 6424 is divided by 2324. 1776 Calculate the remainder when 10636648 is divided by 667. 666 Calculate the remainder when 8832 is divided by 630. 12 What is the remainder when 6694 is divided by 247? 25 Calculate the remainder when 45073 is divided by 62. 61 What is the remainder when 389638 is divided by 51? 49 What is the remainder when 85688 is divided by 207? 197 Calculate the remainder when 4003 is divided by 3992. 11 Calculate the remainder when 15125 is divided by 685. 55 Calculate the remainder when 19893 is divided by 6622. 27 Calculate the remainder when 9150 is divided by 208. 206 What is the remainder when 1753 is divided by 697? 359 What is the remainder when 54537 is divided by 13? 2 What is the remainder when 7520 is divided by 1074? 2 Calculate the remainder when 31605 is divided by 157. 48 What is the remainder when 18444 is divided by 1? 0 What is the remainder when 795970 is divided by 50? 20 Calculate the remainder when 195183 is divided by 379. 377 What is the remainder when 16966 is divided by 14? 12 Calculate the remainder when 1822875 is divided by 303810. 15 What is the remainder when 135028 is divided by 5193? 10 What is the remainder when 23255 is divided by 3? 2 What is the remainder when 13811 is divided by 694? 625 What is the remainder when 103364 is divided by 19? 4 Calculate the remainder when 3189 is divided by 541. 484 Calculate the remainder when 1763 is divided by 126. 125 Calculate the remainder when 63007 is divided by 20. 7 Calculate the remainder when 354916 is divided by 149. 147 What is the remainder when 4468 is divided by 2467? 2001 Calculate the remainder when 152247 is divided by 30. 27 Calculate the remainder when 115426 is divided by 237. 7 What is the remainder when 4489 is divided by 194? 27 What is the remainder when 1879 is divided by 105? 94 Calculate the remainder when 1747 is divided by 863. 21 What is the remainder when 1524934 is divided by 946? 928 Calculate the remainder when 6358 is divided by 95. 88 Calculate the remainder when 227544 is divided by 22. 20 Calculate the remainder when 230591 is divided by 180. 11 What is the remainder when 120500 is divided by 1526? 1472 What is the remainder when 40630 is divided by 20268? 94 What is the remainder when 63200 is divided by 9019? 67 Calculate the remainder when 764 is divided by 168. 92 Calculate the remainder when 14953 is divided by 129. 118 What is the remainder when 5949 is divided by 1681? 906 What is the remainder when 16313 is divided by 308? 297 Calculate the remainder when 16638 is divided by 1847. 15 What is the remainder when 9468 is divided by 497? 25 What is the remainder when 215627 is divided by 383? 381 What is the remainder when 7450 is divided by 440? 410 What is the remainder when 5813 is divided by 1931? 20 What is the remainder when 187015 is divided by 427? 416 What is the remainder when 1413 is divided by 551? 311 Calculate the remainder when 22358 is divided by 69. 2 Calculate the remainder when 3549 is divided by 62. 15 What is the remainder when 727994 is divided by 182? 176 What is the remainder when 26162 is divided by 6536? 18 What is the remainder when 541827 is divided by 92? 39 Calculate the remainder when 20862 is divided by 3473. 24 What is the remainder when 22510 is divided by 237? 232 Calculate the remainder when 26917 is divided by 33. 22 Calculate the remainder when 7721 is divided by 623. 245 What is the remainder when 170850 is divided by 3635? 5 Calculate the remainder when 13105 is divided by 673. 318 Calculate the remainder when 12681 is divided by 4219. 24 Calculate the remainder when 76389 is divided by 24. 21 Calculate the remainder when 9579 is divided by 953. 49 Calculate the remainder when 2666083 is divided by 533216. 3 What is the remainder when 207657 is divided by 61? 13 Calculate the remainder when 9380 is divided by 28. 0 What is the remainder when 14637 is divided by 75? 12 What is the remainder when 3452 is divided by 949? 605 What is the remainder when 607859 is divided by 10? 9 What is the remainder when 1315 is divided by 186? 13 Calculate the remainder when 155247 is divided by 375. 372 Calculate the remainder when 1675714 is divided by 325. 14 Calculate the remainder when 998 is divided by 502. 496 Calculate the remainder when 536973 is divided by 34. 11 What is the remainder when 176 is divided by 27? 14 Calculate the remainder when 7605 is divided by 287. 143 Calculate the remainder when 11246 is divided by 36. 14 Calculate the remainder when 174047 is divided by 375. 47 Calculate the remainder when 6714 is divided by 562. 532 What is the remainder when 136701 is divided by 95? 91 Calculate the remainder when 33249 is divided by 35. 34 What is the remainder when 1097 is divided by 1071? 26 What is the remainder when 3545 is divided by 3499? 46 Calculate the remainder when 661946 is divided by 68. 34 What is the remainder when 4575 is divided by 51? 36 What is the remainder when 27510 is divided by 863? 757 Calculate the remainder when 81466 is divided by 262. 246 What is the remainder when 22336 is divided by 1171? 87 What is the remainder when 86396 is divided by 4799? 14 What is the remainder when 85574 is divided by 2041? 1893 Calculate the remainder when 14544 is divided by 14. 12 What is the remainder when 17188 is divided by 287? 255 Calculate the remainder when 59243 is divided by 59222. 21 Calculate the remainder when 4499 is divided by 555. 59 What is the remainder when 470755 is divided by 21? 19 What is the remainder when 36229 is divided by 68? 53 What is the remainder when 15595 is divided by 82? 15 Calculate the remainder when 92376 is divided by 374. 372 Calculate the remainder when 97419 is divided by 1709. 6 Calculate the remainder when 99774 is divided by 79. 76 What is the remainder when 244508 is divided by 547? 546 Calculate the remainder when 7064 is divided by 2347. 23 What is the remainder when 408 is divided by 135? 3 Calculate the remainder when 942 is divided by 805. 137 Calculate the remainder when 108728 is divided by 26. 22 What is the remainder when 840 is divided by 304? 232 What is the remainder when 2553134 is divided by 195? 194 What is the remainder when 34857 is divided by 383? 4 What is the remainder when 53535 is divided by 28? 27 Calculate the remainder when 2873 is divided by 602. 465 What is the remainder when 10687 is divided by 104? 79 What is the remainder when 51606 is divided by 846? 0 What is the remainder when 2533 is divided by 496? 53 Calculate the remainder when 2040105 is divided by 447. 444 What is the remainder when 65644 is divided by 44? 40 What is the remainder when 1867 is divided by 566? 169 What is the remainder when 14503 is divided by 4757? 232 Calculate the remainder when 3340 is divided by 15. 10 What is the remainder when 409469 is divided by 457? 454 What is the remainder when 1856 is divided by 415? 196 Calculate the remainder when 1046 is divided by 1038. 8 Calculate the remainder when 11383 is divided by 10970. 413 What is the remainder when 68011 is divided by 98? 97 What is the remainder when 34723 is divided by 457? 448 Calculate the remainder when 230873 is divided by 64. 25 What is the remainder when 3019 is divided by 602? 9 Calculate the remainder when 1425093 is divided by 184. 13 What is the remainder when 2206 is divided by 384? 286 Calculate the remainder when 1845 is divided by 77. 74 What is the remainder when 569684 is divided by 133? 45 What is the remainder when 18538 is divided by 772? 10 Calculate the remainder when 10699 is divided by 710. 49 What is the remainder when 136390 is divided by 12399? 1 Calculate the remainder when 148492 is divided by 49496. 4 What is the remainder when 5388 is divided by 5384? 4 What is the remainder when 9567 is divided by 159? 27 Calculate the remainder when 70207 is divided by 35. 32 What is the remainder when 33505 is divided by 17? 15 Calculate the remainder when 5045 is divided by 15. 5 What is the remainder when 149380 is	{ "pile_set_name": "DM Mathematics" }
s -52 + -1043423? -1043515 In base 9, what is 552 - -66? 628 In base 7, what is 411340 + 50? 411420 In base 14, what is -12db - -4? -12d7 In base 10, what is -994 - 1281? -2275 In base 2, what is -1110100001000000 + -111? -1110100001000111 In base 9, what is 31 + -6361? -6330 In base 15, what is -2cc2 + 2? -2cc0 In base 14, what is 3d + d6? 135 In base 4, what is -2113203000 - -20? -2113202320 In base 16, what is 5 + 31ebe? 31ec3 In base 15, what is -8 + -36e58? -36e61 In base 5, what is -23103 + 20411? -2142 In base 2, what is -11001110 - -11100101? 10111 In base 6, what is 15020 + -10? 15010 In base 14, what is 3b6 - 4d6? -120 In base 4, what is 222 + 103131? 110013 In base 10, what is -1137479 + 5? -1137474 In base 9, what is 8 - -7061? 7070 In base 2, what is -10110001011 - 110011100? -11100100111 In base 10, what is 35202 - -6? 35208 In base 14, what is 7c8 + 12? 7da In base 4, what is 1200333 + 10313? 1211312 In base 15, what is -44e - 2? -451 In base 16, what is 665 - 10? 655 In base 12, what is b + -42538? -42529 In base 16, what is 7f + -22e? -1af In base 10, what is -1609 - 50? -1659 In base 16, what is ac47 + -1? ac46 In base 2, what is 111001011010011 + 100? 111001011010111 In base 5, what is -130 + 302312? 302132 In base 10, what is -3829 - 102? -3931 In base 16, what is c2b - -1? c2c In base 10, what is -1 + -2418? -2419 In base 15, what is -5 + 3e51? 3e4b In base 8, what is -15 - 1004133? -1004150 In base 14, what is 178 - -7a? 214 In base 14, what is 183 - -1832? 19b5 In base 6, what is -1210322 - 10? -1210332 In base 3, what is -1 + -111212111? -111212112 In base 4, what is -2 + 1312133330? 1312133322 In base 6, what is 2104505 - 4? 2104501 In base 11, what is 15a + 10? 16a In base 2, what is 10001 - 1111001110101101? -1111001110011100 In base 5, what is 30124402 - -2? 30124404 In base 10, what is 252447 + -3? 252444 In base 3, what is 2201 - 12100? -2122 In base 14, what is 5 - -b59d? b5a4 In base 5, what is -20302210 + -1? -20302211 In base 14, what is -4ab9 + -19? -4ad4 In base 15, what is -b - -15d9? 15cd In base 3, what is -11010222 - 2? -11011001 In base 2, what is -11110 + 10001001111? 10000110001 In base 12, what is 1147 + 8? 1153 In base 14, what is 1 + 340d? 3410 In base 11, what is 18200 + -59? 18152 In base 7, what is -5 - 455133? -455141 In base 16, what is 6ddc - c? 6dd0 In base 9, what is 0 - 260524? -260524 In base 11, what is 8a08 - -1a? 8a27 In base 14, what is 2 + -42b7? -42b5 In base 8, what is -33 - -713? 660 In base 11, what is 0 - -2268? 2268 In base 8, what is 26225 + -2? 26223 In base 8, what is -603202 + 46? -603134 In base 12, what is -3a + 224? 1a6 In base 16, what is -2c + -b13e? -b16a In base 16, what is 3 - d1891? -d188e In base 14, what is 5 - -107a36? 107a3b In base 7, what is 51 - 323? -242 In base 3, what is 2001 + -10021022? -10012021 In base 13, what is 14c + -8b1? -762 In base 12, what is 81 + -29b9? -2938 In base 9, what is -31 + -27088? -27130 In base 6, what is 3 - 4012415? -4012412 In base 15, what is dec1d - 0? dec1d In base 14, what is -285d + 6? -2857 In base 16, what is -1a8 - 5? -1ad In base 4, what is 1222332 - 3? 1222323 In base 16, what is -31b - -19? -302 In base 12, what is 32040 - 1? 3203b In base 2, what is -1000 + 1110010001? 1110001001 In base 7, what is 11 + 104614? 104625 In base 15, what is 3e + -a43? -a04 In base 8, what is -73 - -352? 257 In base 15, what is -35e + -34? -393 In base 3, what is -1110201200122 - -10? -1110201200112 In base 13, what is 9 + 47a8? 47b4 In base 10, what is 120 + -102? 18 In base 5, what is 11012 - 12? 11000 In base 10, what is -512115 - 10? -512125 In base 16, what is -924 - 12? -936 In base 8, what is 4515215 + -1? 4515214 In base 2, what is -100 + -11101010001010001? -11101010001010101 In base 9, what is 1642 - 277? 1354 In base 2, what is 111111010010000 + -1000100? 111111001001100 In base 5, what is -31114 - 22? -31141 In base 6, what is 11253 - 25? 11224 In base 4, what is 1100330 - -313? 1101303 In base 3, what is -1 - -10121201000? 10121200222 In base 5, what is 341102412 + 2? 341102414 In base 3, what is 2011220121210 + 12? 2011220121222 In base 11, what is -6035 + 6? -602a In base 8, what is -2 + -21632? -21634 In base 4, what is 3 - -1003131? 1003200 In base 7, what is 2 - 2305131? -2305126 In base 2, what is -11000001101 - -111011110001? 100011100100 In base 3, what is 1020 + 10210020? 10211110 In base 15, what is -12 + -23675? -23687 In base 9, what is 82 - 2170? -2077 In base 6, what is -1032 - -3411? 2335 In base 11, what is -5186 + -55? -5230 In base 8, what is 4 + -1420? -1414 In base 8, what is 31347 + -33? 31314 In base 5, what is -1 + 3010031? 3010030 In base 5, what is 3220 + 104? 3324 In base 12, what is -7a + 2908? 284a In base 15, what is -1 - -3210? 320e In base 3, what is -2 - -1022201012? 1022201010 In base 8, what is 1762 + -4? 1756 In base 11, what is 393 - -78? 460 In base 9, what is -3 + 268825? 268822 In base 8, what is -1031 + -103? -1134 In base 2, what is 101000110000 + -10000111? 100110101001 In base 10, what is 225 + -375? -150 In base 12, what is b1748 - 3? b1745 In base 2, what is 101010111 - -100111101? 1010010100 In base 12, what is 15a8 - -5? 15b1 In base 15, what is 8c + -c8c? -c00 In base 10, what is 17 - -281? 298 In base 8, what is -6064 - -23? -6041 In base 9, what is -1085 - -102? -883 In base 8, what is -60325 + 4? -60321 In base 5, what is -212 + -23443? -24210 In base 14, what is -129 + 1ca? a1 In base 11, what is -119 - 74? -192 In base 16, what is -3 - b982? -b985 In base 7, what is -406006 + -2? -406011 In base 6, what is 12 - -22130? 22142 In base 12, what is 609727 - -4? 60972b In base 14, what is 8d340 + 2? 8d342 In base 11, what is 132 + -7166? -7034 In base 9, what is 13224 - -11? 13235 In base 16, what is -1e1 - 4d9? -6ba In base 4, what is 2220002323 + 2? 2220002331 In base 7, what is -13343 - -3? -13340 In base 3, what is 102021011212 - -210? 102021012122 In base 3, what is -102222100 + 110200? -102111200 In base 15, what is -1ce + 11a? -b4 In base 14, what is 4 - 64593? -6458d In base 7, what is -2 - 565300? -565302 In base 15, what is -401766 + 5? -401761 In base 7, what is 325 + 154? 512 In base 11, what is 2548 - -322? 286a In base 2, what is -1011110 - -1001101100001110? 1001101010110000 In base 16, what is 39 - 265? -22c In base 10, what is 2618 + 5? 2623 In base 12, what is 68 + -533? -487 In base 9, what is -4 - 68584? -68588 In base 7, what is 636 - -15? 654 In base 2, what is 10011 - -11010000111010? 11010001001101 In base 8, what is -1417 - 2164? -3603 In base 5, what is -13434432 + 4? -13434423 In base 7, what is 1313 + -12? 1301 In base 14, what is 1c1 - 3531? -3350 In base 11, what is 115229 + -4? 115225 In base 12, what is 50 - -2a8? 338 In base 16, what is -a5b7d + -2? -a5b7f In base 5, what is 34 - 14230? -14141 In base 12, what is -656 - 8b? -725 In base 11, what is -10 + 3475? 3465 In base 2, what is 1101 + -10000111011? -10000101110 In base 4, what is 1303 - 123210? -121301 In base 9, what is 48 + -1110? -1051 In base 7, what is -5034340 + -1? -5034341 In base 3, what is -10 + 10112100110? 10112100100 In base 15, what is 3 + -4e8? -4e5 In base 13, what is -35 + 72c? 6c7 In base 9, what is -5 + -160344? -160350 In base 3, what is 1121201 + -20? 1121111 In base 12, what is -4 - 3474? -3478 In base 12, what is -2a73 + 59? -2a16 In base 6, what is -3 + 54530? 54523 In base 8, what is 11 - -4677? 4710 In base 6, what is -333310 - 3? -333313 In base 6, what is -1 - -12401420? 12401415 In base 15, what is 3 - 825c? -8259 In base 10, what is -260895 - -2? -260893 In base 11, what is 7531 - 5? 7527 In base 13, what is -6b + 3c0? 352 In base 6, what is -5211 + 3424? -1343 In base 6, what is 111 + -13135? -13024 In base 3, what is -21 + 2111111220? 2111111122 In base 16, what is 0 + -98d8? -98d8 In base 4, what is 100 - 13121? -13021 In base 8, what is 5 - -645? 652 In base 10, what is -6 - -11333? 11327 In base 12, what is -1 + -35854? -35855 In base 12, what is a - -4701? 470b In base 3, what is -1222102102000 + -10? -1222102102010 In base 12, what is -2 + -2507b? -25081 In base 14, what is 18 - -4a? 64 In base 10, what is 147690 - -2? 147692 In base 6, what is 14	{ "pile_set_name": "DM Mathematics" }
ed without replacement from {h: 2, z: 1, w: 1, i: 4, u: 1, b: 6}. What is prob of sequence bwbz? 1/1092 Four letters picked without replacement from dopmoppmom. What is prob of sequence mdmo? 1/280 Calculate prob of sequence cr when two letters picked without replacement from {c: 2, r: 3, n: 1, h: 1, s: 1, x: 4}. 1/22 Two letters picked without replacement from wwwwwgwwwgfnwwwcfg. Give prob of sequence ww. 55/153 Three letters picked without replacement from nsa. Give prob of sequence nsa. 1/6 Four letters picked without replacement from {x: 4, s: 2, j: 1, z: 4, t: 7}. Give prob of sequence xzst. 7/2295 Calculate prob of sequence ssh when three letters picked without replacement from hhshshssshhhsshshssh. 5/38 What is prob of sequence kvfy when four letters picked without replacement from sfygvkvs? 1/840 What is prob of sequence dgy when three letters picked without replacement from {d: 3, g: 2, u: 6, k: 7, y: 1}? 1/969 Calculate prob of sequence kkl when three letters picked without replacement from {j: 1, z: 1, m: 1, l: 1, k: 2, o: 1}. 1/105 What is prob of sequence mp when two letters picked without replacement from pbbbbccvvbxcvpcpbvcm? 3/380 What is prob of sequence cko when three letters picked without replacement from kfroc? 1/60 What is prob of sequence susu when four letters picked without replacement from {s: 4, t: 4, w: 1, u: 2}? 1/330 Calculate prob of sequence zzz when three letters picked without replacement from {n: 4, z: 3}. 1/35 Two letters picked without replacement from lwzl. Give prob of sequence lz. 1/6 Four letters picked without replacement from {v: 2, o: 7, n: 1, u: 2}. What is prob of sequence ovoo? 7/198 Two letters picked without replacement from {o: 2, a: 7, f: 2, g: 1}. Give prob of sequence go. 1/66 Three letters picked without replacement from jjjjj. Give prob of sequence jjj. 1 Four letters picked without replacement from jfgjfjifggjfjgg. Give prob of sequence fgfj. 5/546 Three letters picked without replacement from {d: 17, u: 2}. What is prob of sequence duu? 1/171 Calculate prob of sequence non when three letters picked without replacement from nnoooo. 1/15 Calculate prob of sequence nohh when four letters picked without replacement from ohonnhhh. 1/35 Three letters picked without replacement from {i: 2, s: 2, d: 1, k: 1, j: 2, c: 1}. Give prob of sequence skj. 1/126 Four letters picked without replacement from ntggthguyht. What is prob of sequence gtgu? 1/440 Three letters picked without replacement from qqvvvqlvqhvvvvv. What is prob of sequence qlq? 2/455 Two letters picked without replacement from {t: 2, y: 13, f: 1, w: 3}. What is prob of sequence fy? 13/342 Two letters picked without replacement from fbbbbbfbfbfffbbbbfb. Give prob of sequence ff. 7/57 Four letters picked without replacement from ppwatpwwwwwpwawpt. What is prob of sequence tpap? 1/714 What is prob of sequence nn when two letters picked without replacement from {n: 5}? 1 Three letters picked without replacement from {c: 4, m: 6, k: 3}. Give prob of sequence mmc. 10/143 What is prob of sequence im when two letters picked without replacement from dbssdibbsiidmibimi? 2/51 Four letters picked without replacement from {j: 7, v: 4}. Give prob of sequence vvjj. 7/110 Four letters picked without replacement from {y: 1, g: 1, r: 2, u: 7, f: 2, l: 2}. What is prob of sequence rylf? 1/4095 Four letters picked without replacement from iiffffifiiffffffff. Give prob of sequence ifii. 13/1224 Calculate prob of sequence rssr when four letters picked without replacement from {s: 2, l: 14, b: 1, r: 2}. 1/23256 What is prob of sequence mm when two letters picked without replacement from {m: 9, f: 3}? 6/11 Three letters picked without replacement from nfm. What is prob of sequence fmn? 1/6 Two letters picked without replacement from {n: 1, y: 4, u: 6, z: 5, w: 4}. Give prob of sequence yu. 6/95 Three letters picked without replacement from {j: 3, k: 4, h: 7, b: 1, r: 2}. What is prob of sequence kjr? 1/170 Four letters picked without replacement from {d: 3, k: 12, x: 1}. What is prob of sequence dkxk? 33/3640 Four letters picked without replacement from neieneineien. What is prob of sequence ieei? 1/99 Two letters picked without replacement from {t: 1, l: 2, x: 1, y: 2}. Give prob of sequence lt. 1/15 Three letters picked without replacement from lolol. Give prob of sequence loo. 1/10 What is prob of sequence fvqa when four letters picked without replacement from fqvza? 1/120 Three letters picked without replacement from {v: 12, c: 3}. What is prob of sequence cvc? 12/455 What is prob of sequence kkkk when four letters picked without replacement from {k: 6, g: 2}? 3/14 What is prob of sequence ea when two letters picked without replacement from {c: 1, l: 4, e: 7, w: 4, k: 2, a: 2}? 7/190 What is prob of sequence hh when two letters picked without replacement from {y: 1, h: 2}? 1/3 Four letters picked without replacement from {t: 2, b: 2, s: 1, o: 1}. What is prob of sequence sttb? 1/90 Calculate prob of sequence rj when two letters picked without replacement from jxxrrxtxjrtxjxxx. 3/80 Four letters picked without replacement from {r: 3, h: 2}. What is prob of sequence rrhr? 1/10 Calculate prob of sequence pbb when three letters picked without replacement from tbmbpm. 1/60 Three letters picked without replacement from {i: 4, n: 2, e: 3, w: 1}. What is prob of sequence ein? 1/30 What is prob of sequence ua when two letters picked without replacement from zazzquzm? 1/56 Calculate prob of sequence bbbw when four letters picked without replacement from {h: 1, l: 5, w: 1, c: 1, s: 1, b: 5}. 5/2002 Two letters picked without replacement from {g: 2, l: 2}. Give prob of sequence ll. 1/6 Four letters picked without replacement from {p: 12, w: 6, v: 1}. What is prob of sequence ppwv? 11/1292 Two letters picked without replacement from {q: 9, y: 3, x: 2, a: 1, s: 1, o: 3}. Give prob of sequence so. 1/114 Calculate prob of sequence jpqp when four letters picked without replacement from {p: 3, u: 3, q: 4, s: 3, a: 1, j: 1}. 1/1365 What is prob of sequence ggg when three letters picked without replacement from {s: 2, g: 4, z: 5}? 4/165 Two letters picked without replacement from {y: 7, n: 2, h: 1}. What is prob of sequence yn? 7/45 What is prob of sequence pp when two letters picked without replacement from {p: 3, f: 1, s: 1}? 3/10 What is prob of sequence yy when two letters picked without replacement from {h: 9, y: 2}? 1/55 Four letters picked without replacement from qqereqqeqqqeeqeqqeq. Give prob of sequence eeqr. 77/15504 Calculate prob of sequence ldd when three letters picked without replacement from dtcltwdwclnw. 1/330 Two letters picked without replacement from {f: 1, v: 1, g: 2, w: 1, y: 1, m: 2}. What is prob of sequence wm? 1/28 Calculate prob of sequence swa when three letters picked without replacement from {u: 2, w: 1, a: 1, x: 1, s: 2}. 1/105 Four letters picked without replacement from {j: 1, i: 3, c: 2, p: 1}. What is prob of sequence cjpi? 1/140 Calculate prob of sequence eh when two letters picked without replacement from hehmhhhhhmphe. 4/39 Three letters picked without replacement from yhhpyvyvhyyhhvvvhhy. What is prob of sequence pvv? 10/2907 Two letters picked without replacement from {b: 1, y: 1, c: 1, q: 2}. What is prob of sequence qc? 1/10 Calculate prob of sequence wt when two letters picked without replacement from {w: 2, t: 1, r: 4, c: 2, u: 1, i: 4}. 1/91 Calculate prob of sequence vjhl when four letters picked without replacement from {l: 2, o: 1, j: 1, v: 1, h: 1, s: 2}. 1/840 Three letters picked without replacement from wsqlh. What is prob of sequence hwl? 1/60 What is prob of sequence yfk when three letters picked without replacement from kfvvy? 1/60 What is prob of sequence ix when two letters picked without replacement from {x: 5, i: 11}? 11/48 Four letters picked without replacement from ppprppppprpprppprrp. What is prob of sequence prpp? 455/3876 Calculate prob of sequence cxcx when four letters picked without replacement from {x: 5, y: 1, c: 3}. 5/126 Calculate prob of sequence edk when three letters picked without replacement from dekkkqdqddqkqqq. 8/1365 Calculate prob of sequence kak when three letters picked without replaceme	{ "pile_set_name": "DM Mathematics" }
152 for b. -2 Let m = 353 - 345. Let y be (-46)/m-2 + 41/82. Solve -y = -4q + 8q for q. -3 Let d be (-1068)/(-24)-122/(-6). Let h = d + -173. Solve 3l = hl + 4l for l. 0 Suppose -4s - 84 = -5b, -19b + 24b = 3s + 88. Solve -122 = -bu - 262 for u. -7 Suppose -a - 2z - z + 3 = 0, -a = z + 1. Let m be 0 + 1 - (a + 1). Suppose -4258c = -4278c. Solve c = mq + 10 - 4 for q. -2 Suppose -t = -0t - 1, 4m - 716 = 4t. Let q = -163 + m. Solve 3 = -4b - q for b. -5 Let t be (-34)/(1/2(-12)/21). Suppose -24 = 19g - t. Let l be (4 - 0)(-2)/(-1). Solve gm = lm + 15 for m. -5 Let q = -39878 - -39916. Solve -242 = qb - 52 for b. -5 Suppose -3p = b - p, p + 3 = b. Let x be 2(b + 21/(-14)). Let u(k) = -k*2 - 5k + 3. Let r be u(-5). Solve -ra - 4 = -x for a. -1 Suppose 2b = 5b - c - 14, 4b + c = 21. Suppose b = h - 4. Suppose 0 = 7a - 6a - h. Solve 3 - a = -2o for o. 3 Let a(i) = 14i*3 - 2i*2 + i + 3. Let r be a(-2). Let o = 119 + r. Suppose -6h - 16 = -10h + z, 4h - 2z - 12 = o. Solve 2 + 8 = -hd for d. -2 Suppose -4g + 0g = -20, 24 = 3u + 3g. Suppose 0 = -2b - 7 - u. Let n be 62/(-15)b. Solve nl - 4 = -0l for l. 1 Let i be (25 - -3)/1 + (40 - 36). Solve -103y = -99y - i for y. 8 Let t = 22369 + -22336. Solve -r = 32 - t for r. 1 Let u be 125/(-120)-422. Solve u = 2b + 223 for b. -6 Let z(d) = -891d + 5346. Let r be z(6). Solve r = 17a - 194 + 58 for a. 8 Let u be ((17712/(-1230))/(4/(-10)))/(4/270). Solve 5h = -2465 + u for h. -7 Suppose 79c = 1598 - 1361. Let k(l) be the second derivative of -l*4/12 - 2l*3/3 - l. Let q be k(-4). Solve qs + cs = -6 for s. -2 Let h = 6213 - 5783. Solve -3 = -427d + hd for d. -1 Suppose -o = -4b + 3, 4b + 3o = 1356 - 1333. Solve bn - 49 + 49 = 0 for n. 0 Let j = 161753 - 161750. Let c(u) = 4u - 2u - 4u - 6. Let a be c(-4). Solve 4 + a = -jn for n. -2 Let r(s) = -s2 - 11s - 17. Let j be r(-8). Suppose -10 = -ja + 18. Solve at = -t for t. 0 Let f(n) = -n*2 + 4n + 12. Let j(a) = -a*2 - 7a + 5. Let c be j(-7). Let g be f(c). Let q be (((-4)/3)/(g/21))/(-2). Solve -qu + 2 - 8 = 0 for u. -3 Suppose 6d + 2i = 4d, -3d + 2i = -20. Suppose -2n + 2u = u - d, 0 = 3n - 4u + 4. Solve 0y + n = y for y. 4 Let s = -43 + -7. Let j = s - -59. Let w(d) = d2 - 8d - 4. Let l be w(j). Solve 4g = -l - 3 for g. -2 Let x be 1/(-12) + 86198/168 + -14. Solve 8c = x - 555 for c. -7 Let k(z) = z*2 - 70z + 1068. Let y be k(56). Solve 0 = yu - 277u - 21 for u. 3 Suppose u - 5r + 40 = 3u, 2u + r - 24 = 0. Solve -uh = -3h for h. 0 Let t be 14/(-49) + (-4516)/(-224) + (-13)/(-104). Solve 0 = -12q - tq - 64 for q. -2 Let q be (-16)/(-7) - ((-63)/(-49) - 1). Suppose -qo - 1 + 9 = 0. Solve 4 = ok - 12 for k. 4 Let x(z) = z3 + 13z*2 - 142z + 36. Let y be x(-20). Solve 74 = -25w - y for w. -6 Let p be (-2530)/(-345) + 2/(-6) - 7. Solve 14q - 38 - 60 = p for q. 7 Suppose 10r - 7r = 5d - 24, 5d - 27 = 4r. Suppose dv = 6 + 117. Let m = v - 36. Solve -mz = -17 - 8 for z. 5 Let c(i) = -i + 5i2 - i3 + 21 + 10i2 - 2i*2. Let d be c(13). Solve -12f = -df for f. 0 Suppose -5a + 5l + 81 = -24, 28 = 3a + 4l. Let i(t) = -2t*2 + 29t - 4. Let o be i(a). Let c = 66 + o. Solve 6 = -5v - c for v. -4 Suppose 2691y = 2701y + 300. Let f = -220 - -104. Let m be (-4)/y + f/(-30). Solve 5r - m = -29 for r. -5 Let d = 17932 - 17823. Solve da = 66a - 344 for a. -8 Let p be 8 + 327 - 1/1. Suppose 6r - 56 = p. Suppose 2w - 97 = -r. Solve 0q - w = -4q for q. 4 Let t be ((-12)/(-9))/29. Suppose v - 5 = 3s, -2v + 2s = -v - 4. Suppose 0 = 25n - vn - 506. Solve -t = 4j - n for j. 4 Let w = 28434 + -28432. Solve 48o + wo - 200 = 0 for o. 4 Let q = -189 + 179. Let d be -2 + 20/(-8)16/q. Solve dr = 4r for r. 0 Let q(b) be the first derivative of -5b2/2 - 25b - 20. Let p be q(-5). Solve -5g + pg - 25 = 0 for g. -5 Let u be (-3680)/(-30) + (-8)/12. Suppose uy + 24 = 128y. Solve 4 = yd + 16 for d. -3 Let u(z) = z3 - 5z*2 - 13z - 7. Let x be u(7). Let l = 69 + -65. Solve -3d + ld - 3 = x for d. 3 Suppose u + 11 = -3g + 20, 3g = -3u + 9. Solve u = 2h - 6 - 4 for h. 5 Let d(r) be the second derivative of r5/20 - r4/3 - 8r3/3 + 9r*2/2 + 10r. Let v be d(7). Let f = v + -41. Solve -f - 3 = -2g for g. 3 Suppose 9925 = 5d - 5j, -4672 = -2d - 3j - 727. Solve d = -7n + 2036 for n. 8 Suppose 704r - 194204 + 28060 = 0. Solve 0 = 203z - rz - 264 for z. -8 Let j = 744 + -732. Solve jk = 41k - 116 for k. 4 Suppose -q = -3a + 1472, 77a + q - 1456 = 74a. Solve 27n + 34n = a for n. 8 Suppose -4u = 4f - 36, -4f + 93u - 94u = -51. Solve -2 = -8m + f for m. 2 Suppose z = 4l - 4z - 6, 0 = -2l - 3z + 14. Solve -7r = -6r + l for r. -4 Let l(c) = 1625c + 360. Let y be l(0). Solve -59z + y = z for z. 6 Let w be 2-2 - (4 + -1 - -176). Let d = w - -191. Solve -i - i = -d for i. 4 Suppose x + 67 = 20. Let l = -48 - x. Let o be l + 0 - (-12 - -11). Solve 0u + 3u = o for u. 0 Let z = 26 + -27. Let w be 186/18 - 2/(-6)z. Suppose 42 = 3a + 4a. Solve 4o + w = ao for o. 5 Let d = 230 + -225. Suppose 2f = 2a, da = 3f - 12 + 22. Solve -2r + 1 + a = 0 for r. 3 Let y = 349 - 342. Let m be 21y/(-21) - -9. Solve -m = -2h - 12 for h. -5 Let k be 1/7 + (-973)/(-49). Suppose -16v = -kv + 16. Suppose 2o = -vo. Solve -2y = -oy for y. 0 Let y be (12 + -12)(3 + -2). Suppose 3q - t - 27 = y, 3q + 3t - 15 = 8t. Solve -3r - q = 2 for r. -4 Let i be (-342)/(-21) - -42/(-28). Suppose -4y + id = 11d - 3, y + 5d - 7 = 0. Let z = -11 + 14. Solve zm + 10 = -ym for m. -2 Let u = -404 - -476. Let q be (-684)/u1-2. Solve 2t = -15 + q for t. 2 Suppose -2k = -5m - 0m - 1, 3m - 12 = -3k. Suppose 44x + 8 = 2u + 39x, 0 = -u + 3x + 4. Solve k = -ud + 5d for d. 3 Let u = -1432 + 1462. Solve -2w - u = 4w for w. -5 Let w be (2/7)/(1/7). Suppose -808 = 10a + 252. Let h = -79 - a. Solve -5b + w = h for b. -5 Let y(k) = -k*3 - 2k*2 - 7k - 24. Let t be 1/((15 - 19) + 11/3). Let u be y(t). Solve -uo + o = -3o for o. 0 Let j be (5 + 6)/((-1)/(-22)). Solve j - 42 = 40g for g. 5 Suppose -431x = -128493 + 8587 - 274028. Solve -8m + x = 938 for m. -3 Let y be 72/2495. Let l = y + -129. Solve lk - 2k = 12 for k. 3 Suppose 0 = 15r + 2r + 578. Let b = r - -49. Solve -2d - 9 = -b for d. 3 Suppose -11i - 70 = -16i. Let s(t) = -t*2 + 15t + 18. Let u be s(i). Suppose -27f + uf = 20. Solve f = -5b - 11 for b. -3 Let j(v) = 56v - 237. Let i be j(6). Suppose 0 = 85u - iu + 42. Solve -19 = -ud - 19 for d. 0 Suppose 42g = 2p + 37g - 121, -3p - 4g + 239 = 0. Solve pd + 6 = 67d for d. -1 Let k(w) = -30w + 4. Suppose 2b - 1 = 3y, -5y - 4b = -6b + 3. Let q be k(y). Solve -5n + 14 = q for n. -4 Let o(h) = -h3 - 5h*2 - 4h - 5. Let x be o(-4). Let b be x/(-2) + 2/(-4). Let s be b/7 + (-52)/(-14). Solve 4u = 4 + s for u. 2 Suppose 5v + 5c - 40 = 0, 5c - 16 = -0v - v. Let o be v - (2 - (5 - 5)). Solve 0 = -3f + 2 + o for f. 2 Let t = 314 - 278. Let k be 30(-3)/(2-3). Suppose 3h - kh = -t. Solve 0 = 2q + hq for q. 0 Let y be 0 - 4/(-26) - (-608)/104. Let c = -824 + 827. Solve cq + y = q for q. -3 Let y = -14088 - -14404. Solve -26p - 108 + y = 0 for p. 8 Let y = 7847 + -7775. Solve 0 = -20i + y - 92 for i. -1 Let l(f) = -11f*3 + 45f*2 - 2f + 10. Let r be l(3). Solve 84t = rt - 84 for t. 3 Suppose 2l = 5a - 35, 3l + 2 + 18 = a. Let q(p) = -p3 - 6p*2 - 14p + 5. Let v be q(l). Solve 53 - v = m for m. 3 Let y be 6 + (-1 - 0) + (26 - -8). Solve 79c = 39c + yc for c. 0 Let m = -4253 + 6138. Solve -5b - m = -1890 for b. 1 Suppose 4p = -4a + 100, -5p - 193a + 126 = -189a. Solve 8y + p = 21y for y. 2 Let d(z) = 9z*2 + 61z - 322. Let w(u) = -5u2 - 30u + 161. Let h(l) = -4d(l) - 7w(l). Let x be h(-38). Solve 5o - xo + 16 = 0 for o. 4 Let h(r) = r*3 + 30r*2 + 225r + 31. Let x be h(-14). Let n be 9(-4 + 2 - -4). Solve na + 3 = xa for a. -3 Suppose 372 + 1113 = 10l + 17l. Solve 11t - 88 = lt for t. -2 Let v(i) = -3i*3 + 20i*2 + 9i - 15. Let y be v(7). Let t be -41 - (-20)/(5 + y). Solve -11r = -10*r + t for r. -1 Let g be	{ "pile_set_name": "DM Mathematics" }
. Let k be (1 + h)15/(-10). Let l(v) = v3 - 4v*2 + 4v - 3. Give l(k). 0 Let i(u) be the third derivative of u6/720 - u5/40 + u4/24 + u2. Let o(q) be the second derivative of i(q). Let z = 1049 + -1052. Determine o(z). -6 Let r = -82 + 121. Let p = r - 29. Let g(h) = -2h + 14. Calculate g(p). -6 Suppose -10 = 10w - 12w. Let u(t) = 7t*2 - 5t + 1. Let a(y) = -10y2 + 8y - 2. Let n(k) = wa(k) + 7u(k). Give n(3). 3 Suppose s - 2 = 3. Let y(f) = -5f - 4. Let a(p) = -4p - 4. Let l(z) = -6a(z) + 5y(z). Determine l(s). -1 Let i(t) = t*3 - 7t*2 + t - 5. Suppose 76 = 9a + 4. Calculate i(a). 67 Let s(x) = 21x + 3. Let c be s(-1). Let l = -10 - c. Suppose 0 = m + m + l. Let a(v) = v + 6. Determine a(m). 2 Let l(x) be the second derivative of -6x + x*2 + 0 + 1/2x3. Calculate l(-3). -7 Let k(s) = -s2 + 7s - 6. Let h be k(6). Let l(y) be the third derivative of -1/60y*5 - 2/3y*3 + 0y + 0 + 1/24y4 - 10y*2. What is l(h)? -4 Suppose 0 = -37x - 5x - 210. Let c(r) = 2r. What is c(x)? -10 Let g(s) = s*3 - 9s*2 + 6s + 13. Let j be g(9). Let d = 102 - j. Let f(w) = w*3 + 1 - dw*2 - 3w + 0 + 34w2. What is f(2)? -1 Let f(u) = -u - 3. Let t(r) = 3r + 5. Let b(m) = 5f(m) + 2t(m). Let i be b(7). Let q(w) = 11 + 0wi - w - 2w + 4w + w2. What is q(0)? 11 Let h(w) = -5w - 4. Let q(c) = 2c + 3. Let p(v) = 3h(v) + 5q(v). Suppose -3o = -1 - 8. What is p(o)? -12 Suppose -609i + 28 = -613i. Let y = 10 + -6. Let s(a) = a*3 + 1 - y + 10a*2 - 3a2. What is s(i)? -3 Let c(k) = k3 - 6k2 + 7k - 4. Let j = 39 - 28. Let r = -8 + j. Suppose -10 = d - rd. Calculate c(d). 6 Let w(v) = 12v*2 + v + 6. Let f(r) = 7r + 13 - 30r2 + 55r*2 - 2r - 3r. Let y = -2 - 11. Let b(j) = yw(j) + 6f(j). Calculate b(-1). -5 Let u(o) = 5o*2 + 13o - 29. Let j(n) = -4n2 - 13n + 28. Let w(t) = 4j(t) + 3u(t). Determine w(-15). -5 Let l = -36 + 32. Let w be -2 - (2 - (-1 - l) - 1). Let a(p) = p + 1. Let m(d) = -3d + 3. Let r(u) = 2a(u) + m(u). Determine r(w). 5 Let i be ((-3)/(-6))/(1/(-2)). Let g(w) be the first derivative of -2w2 - 11 - 1 + 5w*2. Calculate g(i). -6 Suppose -50 = -4151l + 4141l. Let w(i) = -i3 + i2 + 7i - 1. Give w(l). -66 Suppose 0 = 4k - 98 + 14. Suppose v = 3s - 0v + 6, -k = 5s + 2v. Let r(j) = 1 + 79j*2 + 74j*2 - 151j*2 + 4j. What is r(s)? 7 Let u(f) = -f - 103 + 219 - 19 - 100. Let c = 13 - 21. Determine u(c). 5 Let b(r) = -r2 - r + 1. Let c(f) be the third derivative of f6/60 + f5/20 + f4/12 + f*2. Let d be c(-2). Let j = d + 8. Calculate b(j). 1 Let q(y) = y - 5 + 3y - 5y + 1. Let i be q(-4). Suppose -5p + 3p = i. Let v(g) = -g2 - 9. Give v(p). -9 Let o(m) = 2m - 4. Suppose 0 = 3h + 2h - 2n + 116, -4n = 5h + 98. Let s be 4/(-16) - h/(-8). Calculate o(s). -10 Let o(n) be the second derivative of n5/20 - 7n*4/6 + 2n3 - n2/2 - 139n. What is o(13)? -14 Let q(m) = -2m + 11. Let g(t) = t - 5. Let l(i) = 5g(i) + 2q(i). Suppose 12s - 13s = -3. Calculate l(s). 0 Let m(t) = t*2 - 5 + 2t + t*3 + 9t*2 - 20t*2 - 2t*3 + 4t*2. Determine m(-7). 30 Let t(x) be the first derivative of 3x*2/2 + x + 1. Suppose 0 = 4c + 16 - 4. Let i be 2/c - 20/15. Calculate t(i). -5 Let r(g) = -102g + 10. Let u(a) = 30a - 3. Let p(b) = -3r(b) - 10u(b). Determine p(2). 12 Let v(w) be the first derivative of -w4/4 - w2/2 + 24w - 51. Let x(o) = 2o*3 + 2o - 49. Let y(p) = -5v(p) - 2x(p). Give y(0). -22 Let v be (-6)/27 - 4162/(-18). Let n = -148 + v. Let j(h) = 0h2 - 76 + n - h2 + h3. Calculate j(0). 7 Let k(z) be the second derivative of -z6/720 - z5/12 - 29z4/12 - z - 5. Let p(l) be the third derivative of k(l). Determine p(-8). -2 Let k(t) = t2 + t + 2. Let y(u) = -3u2 + 22u + 47. Let z(v) = -2v2 + 11v + 23. Let l(n) = -3y(n) + 5z(n). Let g be l(-8). Calculate k(g). 4 Let i(o) = -151o + 1511. Let a be i(10). Let b(r) = -13r3 - r2 + 3r - 1. Let y(d) = d2 - d. Let z(s) = b(s) + 2y(s). Give z(a). -12 Let c(j) = -2j + 12. Let t be ((-21)/(-9))/((28/(-24))/(-7)). Give c(t). -16 Suppose 5o + 20 = 15o. Let y(z) = -2 - 6z*2 + 7z*2 + 4zo - z2. Determine y(-2). 14 Let h(l) be the third derivative of -l5/40 + l4/6 - l3 - l2. Let v(i) be the first derivative of h(i). Let c = -4 - -8. Give v(c). -8 Let j(u) be the first derivative of -u*2 + u + 13. Suppose -3z + 8z = 15. Calculate j(z). -5 Suppose -2f = -0f - 4. Suppose a = 3 + 1, 0 = fh - a + 4. Let m(z) = z + 10. Let b(n) = -n - 9. Let w(s) = 7b(s) + 6m(s). Give w(h). -3 Let k be (-692)/(-28) + 10/35. Suppose 21o = ko + 20. Let q(y) = -2y2 + 8y + 3. Let n(a) = -3a2 + 15a + 5. Let s(t) = 3n(t) - 5q(t). What is s(o)? 0 Let t(s) = -4s2 - s2 + 6 - 4s*3 + 2s - 2s3 - s3 + 6s*3. Let v(i) = -5i*2 + 2i - 1. Let c be v(1). What is t(c)? -18 Let x be (-15)/(-6)7/((-35)/10). Let p(i) be the first derivative of i3/3 + 3i*2 + 5. Give p(x). -5 Let c(x) = -6x + 1. Let o(d) = -3 + d*2 - 1 + 5d + 0d. Let g be o(-6). Suppose 0y + 2 = gy. Calculate c(y). -5 Let t(b) = b3 - b + 1. Let p(w) = 6w*3 + 4w*2 - 3w + 5. Let i(q) = p(q) - 5t(q). Let s = -2 + -1. Determine i(s). 3 Let q(w) be the first derivative of -w4/12 - w3/3 + w2/2 + 12w - 8. Let b(t) be the first derivative of q(t). Determine b(-3). -2 Let d(y) = y. Suppose 8 = -4a - 0. Let s(c) = -2c. Let t(b) = ad(b) - 2s(b). Suppose 0 = 2r, 0 = m + 4m + 4r + 10. Give t(m). -4 Let p(h) = -h3 - 10h2 - h - 2. Let w(r) = -r3 - 4r2 - 2r - 6. Let g be w(-2). Give p(g). 8 Let q(p) be the first derivative of 2p2 + 4p + 33. Determine q(-4). -12 Let n(y) = 23y2 + 6y - 2. Let c(b) = -34b2 - 8b + 3. Let q(j) = 5c(j) + 7n(j). Calculate q(-1). -10 Suppose 0 = d - 0w - w + 3, -5w = 5d - 35. Let i(g) = -3g + 9. Let n(k) = -k + 6. Let a(v) = -2i(v) + 3n(v). Calculate a(d). 6 Let p(x) = -x*3 - 10x*2 + x + 9. Suppose 4j = 3 + 5. Suppose 22 = -3o - 0d + 4d, -jd = 5o + 54. Determine p(o). -1 Let h(k) = 3 + 9 - k - 3. Suppose 2z = 7z - 25. Let t = 9 - z. Determine h(t). 5 Let p(v) = 106 - 39 + 6v - v - 2v2 - 30 - 29. Calculate p(6). -34 Let r = 27 - 15. Suppose -2x = 2k + 12, -r = 3x - x + k. Let i(d) = -d*2 - 5d + 8. Calculate i(x). 2 Let v(i) be the first derivative of 3i + 1/4i*4 - 1 + 2i*3 + 5/2i*2. Let p = 31 + -36. What is v(p)? 3 Let b(t) = -2t + 7. Let l be 5/(-1) + 2 - (-2 - 6). Give b(l). -3 Let g(z) = -15z3 - 17z*2 + 2z + 11. Let h = 7 + 6. Let f(p) = -7p3 - 8p*2 + p + 5. Let w(k) = hf(k) - 6g(k). Give w(-2). -3 Let v = -24 + 26. Let p(n) = 6n*3 - 4n3 - n2 - n*3 - v + n. Let d be (-1)/(-5) + 4/(-20). What is p(d)? -2 Suppose 3v + 1 = -5w, -5w + 13 = 3v - 7w. Suppose c = -f + 12, -c - 5f + 19 + 13 = 0. Let p(o) = -5o + 1 - vo + co - 3o + o2. What is p(4)? 1 Let a(c) = -2c*2 + 45c + 29. Let d be a(23). Suppose 0o = -do - 30. Let b(h) = h*3 + 4h*2 - 5h. Determine b(o). 0 Let f(g) = 11g - 1. Let m be 3/(-1) + 5/3012. Calculate f(m). -12 Let g = 42 - 39. Let a(v) = -3v3 - 5 - 26v + 24v - gv*2 + 4v3. Calculate a(4). 3 Let i(n) be the first derivative of -n2/2 + 15n + 196. Suppose -3v - v = -44. Give i(v). 4 Let r = 115 - 118. Let d(j) = j*2 + 8j + 3. Let k(q) = -q*2 - 7q - 3. Let t(g) = 3d(g) + 4k(g). Determine t(r). 0 Let j(n) = 7n + 8. Let t(h) = 4h + 4. Let l(a) = -3a - 3. Let q(p) = -5l(p) - 4t(p). Let f(b) = -5j(b) - 40q(b). Suppose -z + 2z = -1. Determine f(z). -5 Let i be (-68)/(-10) - (-5)/25. Let f(b) = -b + 4 + ib - 5b. Calculate f(-6). -2 Let c(w) = w*2 - 8w - 4. Let f(j) = -5j - 21. Let r be f(-6). Let v be c(r). Let k(n) = -n3 + 6n*2 - 6n - 1. Give k(v). -6 Let s(g) = 7 - 3g2 + g - 6 + 4g*2. Let z be ((-9)/(-3) - 3) + -41. Give s(z). 13 Let q(c) = 6c2 + 2c - 2. Suppose 4m - 94z - 8 = -98z, m + 2z - 3 = 0. Calculate q(m). 6 Let c(n) be the third derivative of n*5/60 + 3n4/8 - n3 - 193n2. Determine c(-11). 16 Let k = 20 + -15. Let y(u) be the first derivative of -2 + ku - u*2 - 1/3u*3. What is y(-4)? -3 Let v(y) = -3y*2 + y + 1. Let o(s) = 5s*2 - 3s - 3. Let n(z)	{ "pile_set_name": "DM Mathematics" }
picking 1 x and 2 m when three letters picked without replacement from cvxxvmvvvxmv? 3/220 What is prob of picking 3 e when three letters picked without replacement from {e: 3, i: 4}? 1/35 Two letters picked without replacement from cccccuuuuu. What is prob of picking 2 u? 2/9 Two letters picked without replacement from {u: 3, h: 1, i: 13}. Give prob of picking 2 i. 39/68 Three letters picked without replacement from fihvivi. What is prob of picking 3 i? 1/35 Calculate prob of picking 3 j when three letters picked without replacement from {w: 6, j: 7, q: 5, o: 1}. 35/969 Two letters picked without replacement from gkgegegngteeg. What is prob of picking 1 t and 1 k? 1/78 Two letters picked without replacement from {a: 4, k: 2, y: 2, q: 1, z: 1, r: 5}. What is prob of picking 1 y and 1 k? 4/105 Two letters picked without replacement from uiia. What is prob of picking 1 i and 1 u? 1/3 What is prob of picking 1 m and 1 t when two letters picked without replacement from {t: 7, m: 2}? 7/18 What is prob of picking 3 o when three letters picked without replacement from bbobboodod? 1/30 Two letters picked without replacement from {y: 1, i: 1, l: 5, o: 1, p: 2}. Give prob of picking 1 y and 1 l. 1/9 Three letters picked without replacement from {v: 4, k: 6, r: 2, f: 1}. What is prob of picking 1 v, 1 f, and 1 r? 4/143 Two letters picked without replacement from {y: 1, f: 1, b: 2, p: 1}. What is prob of picking 1 p and 1 y? 1/10 What is prob of picking 1 l and 1 y when two letters picked without replacement from {z: 5, a: 1, y: 1, l: 2, e: 3}? 1/33 Three letters picked without replacement from rrrrrgqqg. Give prob of picking 1 g and 2 r. 5/21 What is prob of picking 1 f and 1 s when two letters picked without replacement from stlftssllfs? 8/55 Two letters picked without replacement from ybyryyyuuyyyyubuyb. Give prob of picking 2 y. 5/17 Four letters picked without replacement from nkkkvukkvuknnurnk. What is prob of picking 3 n and 1 u? 3/595 Calculate prob of picking 2 s, 1 e, and 1 y when four letters picked without replacement from {v: 1, y: 2, l: 1, s: 4, e: 1}. 2/21 Three letters picked without replacement from sjzrjljrsbzr. Give prob of picking 2 j and 1 b. 3/220 Three letters picked without replacement from zzzzzlzzzzzzzlzzlz. What is prob of picking 3 z? 455/816 What is prob of picking 1 d and 2 r when three letters picked without replacement from rrdzdrgidrkrgrgrddkg? 7/76 Calculate prob of picking 1 s, 1 z, and 1 i when three letters picked without replacement from ooikiisizsizizoiiiki. 1/19 Calculate prob of picking 4 s when four letters picked without replacement from ssssssssss. 1 Four letters picked without replacement from araraarrrr. What is prob of picking 4 a? 1/210 Two letters picked without replacement from {q: 8, d: 2}. What is prob of picking 1 d and 1 q? 16/45 Calculate prob of picking 2 v and 2 g when four letters picked without replacement from ggvvgvv. 18/35 Four letters picked without replacement from {f: 7, q: 4, u: 2}. Give prob of picking 1 u, 2 q, and 1 f. 84/715 What is prob of picking 3 i when three letters picked without replacement from {b: 4, e: 3, i: 6}? 10/143 Two letters picked without replacement from {g: 1, i: 5, c: 1, v: 8, s: 5}. What is prob of picking 1 g and 1 i? 1/38 Two letters picked without replacement from {w: 1, m: 3, u: 5, x: 4, r: 1, i: 1}. What is prob of picking 1 m and 1 r? 1/35 Three letters picked without replacement from {j: 2, c: 2, f: 1}. What is prob of picking 1 f and 2 c? 1/10 Calculate prob of picking 2 l, 1 s, and 1 x when four letters picked without replacement from lssnsnnsxlsmnmxssxl. 21/1292 Three letters picked without replacement from ppnyepe. What is prob of picking 1 y, 1 p, and 1 e? 6/35 Three letters picked without replacement from wnnwwnwttnwtn. What is prob of picking 1 t and 2 n? 15/143 What is prob of picking 1 b and 1 z when two letters picked without replacement from okozkkkkzbkkkkkk? 1/60 Two letters picked without replacement from {s: 3, l: 8, i: 7}. Give prob of picking 2 i. 7/51 Two letters picked without replacement from uiisggsuguiegieisgss. Give prob of picking 1 u and 1 s. 3/38 Three letters picked without replacement from {p: 2, m: 4}. What is prob of picking 2 m and 1 p? 3/5 Two letters picked without replacement from {j: 2, g: 1, t: 6, y: 2, k: 7}. Give prob of picking 1 k and 1 y. 14/153 Calculate prob of picking 2 s and 1 p when three letters picked without replacement from snnps. 1/10 Calculate prob of picking 1 q, 1 h, and 1 f when three letters picked without replacement from qhhhf. 3/10 What is prob of picking 4 x when four letters picked without replacement from {v: 4, x: 14}? 1001/3060 Calculate prob of picking 1 h and 2 b when three letters picked without replacement from hhhhhhhhbhhhhhhhhhhb. 3/190 Three letters picked without replacement from yryyyyydyydrrddy. What is prob of picking 3 y? 3/20 Two letters picked without replacement from {y: 1, j: 4, t: 1, p: 2, g: 1, a: 3}. What is prob of picking 1 t and 1 j? 2/33 Calculate prob of picking 2 r when two letters picked without replacement from kkrkkkrrkkkkkkkkkk. 1/51 Four letters picked without replacement from wmwmqwqmqqm. Give prob of picking 3 q and 1 m. 8/165 What is prob of picking 1 k and 1 s when two letters picked without replacement from {s: 5, k: 2}? 10/21 What is prob of picking 1 p and 1 x when two letters picked without replacement from {l: 2, x: 4, g: 1, p: 1, f: 1}? 1/9 Two letters picked without replacement from ulplppupplpulu. What is prob of picking 2 l? 6/91 Calculate prob of picking 4 g when four letters picked without replacement from lsgsssgsusgusg. 1/1001 What is prob of picking 3 n and 1 t when four letters picked without replacement from {t: 4, n: 3}? 4/35 What is prob of picking 1 t, 1 x, and 1 g when three letters picked without replacement from {o: 1, x: 2, y: 1, t: 1, g: 2}? 4/35 Calculate prob of picking 3 v and 1 e when four letters picked without replacement from vellvvdvlvvlvl. 5/143 Calculate prob of picking 1 c and 1 t when two letters picked without replacement from {d: 1, t: 2, c: 4}. 8/21 Two letters picked without replacement from dttptttdp. What is prob of picking 2 d? 1/36 Calculate prob of picking 2 p and 1 g when three letters picked without replacement from kggpghhphh. 1/40 Two letters picked without replacement from kyymmmkmmymv. Give prob of picking 2 m. 5/22 Calculate prob of picking 1 b and 3 x when four letters picked without replacement from {b: 7, x: 6}. 28/143 Two letters picked without replacement from {y: 3, d: 5, n: 5, k: 1, f: 1}. Give prob of picking 1 k and 1 d. 1/21 Four letters picked without replacement from hwugggwhuughhgu. What is prob of picking 3 h and 1 u? 16/1365 What is prob of picking 2 t when two letters picked without replacement from tttttttttttlt? 11/13 What is prob of picking 1 t and 1 n when two letters picked without replacement from {v: 1, q: 1, t: 1, n: 6, e: 1, a: 1}? 6/55 Calculate prob of picking 1 f and 2 h when three letters picked without replacement from {r: 3, h: 2, f: 7}. 7/220 Calculate prob of picking 1 z and 1 p when two letters picked without replacement from nvzpa. 1/10 What is prob of picking 4 v when four letters picked without replacement from bvbvvvbvbvv? 7/66 Three letters picked without replacement from unhuhnhunnnq. Give prob of picking 2 n and 1 h. 3/22 Three letters picked without replacement from aaagiiqaqciiaaaaaa. Give prob of picking 1 c and 2 a. 15/272 Four letters picked without replacement from {d: 2, m: 8, q: 5, v: 1}. What is prob of picking 2 m and 2 d? 1/65 Four letters picked without replacement from unvqzvv. Give prob of picking 1 z, 1 n, 1 q, and 1 u. 1/35 Two letters picked without replacement from hyyy. Give prob of picking 2 y. 1/2 Four letters picked without replacement from dovvdkddvokkvdk. Give prob of picking 1 o and 3 d. 4/273 What is prob of picking 1 w and 3 l when four letters picked without replacement from lxlwl? 1/5 Two letters picked without replacement from {v: 1, j: 1, k: 1, u: 1, w: 1}. What is prob of picking 2 v? 0 What is prob of picking 1 v and 1 w when two letters picked without replacement from vwd? 1/3 Two letters picked without replacement from ttrrt. Give pr	{ "pile_set_name": "DM Mathematics" }
the prime factors of n. 2, 1949 Let m be (-8 - -558) + 4 + (-6 - -3). Let q = -214 + m. List the prime factors of q. 337 Let z(k) = 2037k2 + 88k - 444. What are the prime factors of z(4)? 2, 5, 13 Suppose -5h + 41 = -569. Let f = h - 136. Let m(a) = a2 + a - 2. List the prime factors of m(f). 2, 3, 5 Let w = 10543 + -6887. List the prime factors of w. 2, 457 Let c be (-6 - -1) + 26 + -25 + 1472. Suppose 2p = 4q + c, q + 3057 = 5p - 586. List the prime factors of p. 2, 7, 13 Suppose 7202l = 7199l + 89472. What are the prime factors of l? 2, 233 Suppose 0k = 5s + 3k - 42300, 3k = -4s + 33837. What are the prime factors of (s/(-155))/((-1)/5)? 3, 7, 13 Suppose -3l = 4m - 57305, 65m + 38196 = 2l + 64m. What are the prime factors of l? 71, 269 Let z(l) = -3l + 16l + 27 - 44l. What are the prime factors of z(-5)? 2, 7, 13 Let y = -46 - -50. Suppose 2c = 5n - 867, -c - 693 = -0n - yn. What are the prime factors of n? 173 Let k(c) = 118c*2 - c - 5. Let d be k(-2). Suppose 466h = dh - 1290. List the prime factors of h. 2, 5, 43 Let r(o) = o + 1681. Let v be r(0). Let d = v - 407. What are the prime factors of d? 2, 7, 13 Let k be (-120)/25(-5)/221. Let s = k - 155. List the prime factors of s. 97 Let q be (160/25)/(34/690). Suppose 0 = -7l + q + 1452. List the prime factors of l. 2, 5, 13 Suppose -2h + 9 = h, 0 = s - 2h + 60. List the prime factors of (-70)/(-7)(-4)/(16/s). 3, 5 Suppose -201785 = -3p - 4a, -4a = -5p + 168454 + 167801. What are the prime factors of p? 5, 13451 Let n = -70 + 72. Let p(v) = 355v - 14. Let a be p(n). Suppose 6s - a = 636. What are the prime factors of s? 2, 3, 37 Let z be (-5)/(-4)-2-2. Suppose 0 = -zq - 5w + 875, 0 = q - 2w - 138 - 49. Suppose q - 12 = 3i - 4j, 0 = 3j - 3. What are the prime factors of i? 3, 19 Suppose 3 = v, 2b - 3v - 1310 - 949 = 0. Let c = -512 + b. What are the prime factors of c? 2, 311 Let t(y) = y + 4. Let v be t(6). Suppose 0 = 2q - u - 5, -2q = -vu + 5u - 9. Suppose qx - 4x = -200. List the prime factors of x. 2, 5 List the prime factors of 1-9 - 2634984/(-594). 19, 233 Let a(i) = 11i - 35. Let u be a(41). Let o = 1136 - u. What are the prime factors of o? 2, 3, 5 Suppose -5f = 3j + 118, -41 = 5j - 4f + 131. List the prime factors of j/1(-5)/((-15)/(-18)). 2, 3 Suppose 4s - 3s = 4n - 137, 99 = 3n + 3s. Let g = n + -22. List the prime factors of 4 + 16 + g/(-3). 2 Suppose 0 = 25t - 125 + 25. Suppose -8a = -5a - 15, ta = -2r + 332. List the prime factors of r. 2, 3, 13 Suppose 14 = -3f + 5f + 5i, 3f = 2i + 2. Suppose -5t - 4099 = -2c, -ft + 0c - 1630 = 4c. Let s = -581 - t. What are the prime factors of s? 2, 7, 17 Let c = -499 - -546. Suppose 65449 = ca + 23055. What are the prime factors of a? 2, 11, 41 Let u(g) = 2g2 + 10g + 6. Let r be u(-8). Suppose 17q = 9616 - 8562. Let d = q + r. List the prime factors of d. 2, 29 Let l = -180 - -169. What are the prime factors of (-12 - l)-1 - (1 - 221)? 13, 17 Let j be (11/33)/(-1 + 20/18). Suppose -169 = -jg + 2g. What are the prime factors of g? 13 Suppose 0 = -2f + 3x + 16525, 150x = 5f + 145x - 41315. List the prime factors of f. 2, 1033 Suppose 12 = -4a + 4. Let c be -502(-3 + (-5)/a). Suppose 61 = 6x - c. List the prime factors of x. 2, 13 Suppose -2i = -l - 2l - 973, 2i - 978 = -2l. Suppose -18598 = -54d - 4504. Let y = i - d. What are the prime factors of y? 227 Suppose -3m = 5w - 91291 - 77815, 67673 = 2w - 9m. What are the prime factors of w? 149, 227 Let j(i) = -i2 - 2i - 8. Let m be j(0). Let a(o) = o*2 + 8o + 6. Let q be a(m). List the prime factors of 4/q - (-489)/9. 5, 11 Let v = 106 - 14. Let y = -87 + v. Suppose 23 + 157 = ym. What are the prime factors of m? 2, 3 Suppose -1213 - 6633 - 3970 = -14o. List the prime factors of o. 2, 211 Suppose 759a - 677a = 2064924. List the prime factors of a. 2, 3, 1399 Let c be (7/3 - 0)/((-10)/(-10980)). Let r = c - 1441. List the prime factors of r. 19, 59 Let w = -4058 - -5598. What are the prime factors of w? 2, 5, 7, 11 List the prime factors of (-219534)/(-13) - (-870)/(-3770). 3, 13, 433 Let n = 312 + -975. Let m = n - -1246. What are the prime factors of m? 11, 53 Suppose 0 = -32s + 29s - b + 71884, -3s - 2b + 71885 = 0. List the prime factors of s. 3, 7, 163 Suppose 14t - 11t + 32078 = 4t. What are the prime factors of t? 2, 43, 373 Let j(u) = u3 - 5u + 2. Let l be (8 - 4) + -4 + 2. Let k be j(l). Suppose -82 = -t - kt + 4a, -2t + a = -157. What are the prime factors of t? 2, 3, 13 Suppose -5m = -k - 258319, k = -3m + 3k + 154983. What are the prime factors of m? 5, 10333 Suppose 3q + 342 = 1140. Let p = -68 + q. List the prime factors of ((-45)/(-6))/(-3)p/(-15). 3, 11 Suppose 281 = q - 2n, -30n + 31n - 1416 = -5q. What are the prime factors of q? 283 List the prime factors of (-1)/(-3) + 0 + 2297470/105 - -3. 2, 5471 Let a = -10256 + 17569. What are the prime factors of a? 71, 103 Suppose -11 - 11 = -2b. Let h(w) = -w3 + 12w*2 - 11w + 5. Let q be h(b). Suppose 2t - 1064 = -qg, 5g - 4g = 2t + 220. List the prime factors of g. 2, 107 Let p = 2147 - 741. Suppose -i + 146 - 610 = -c, 3c + 4i - p = 0. What are the prime factors of c? 2, 233 Let l = -195 - 55. Let o = l - -518. Let z = 402 - o. What are the prime factors of z? 2, 67 Suppose 8v + 674 = -158. Let j = 512 + v. Suppose -4s + j = -5m, 2s = 6s + 4m - 372. What are the prime factors of s? 97 Let h = -24 + 30. Let b(r) = -r2 + r + 2. Let m(z) = 3z*2 - 2z - 6. Let n(i) = 8b(i) + 3m(i). List the prime factors of n(h). 2, 23 What are the prime factors of (-2 - 3/9)/((-46)/121578)? 7, 881 Let j = -190 + 345. Suppose -136x + j = -135x. List the prime factors of x. 5, 31 Let l(q) = -4q - 3. Suppose 2w - 3 = 5o, 3o = -0w - 3w - 6. Let s be l(o). What are the prime factors of (s/(-3))/(1/(-87))? 29 Suppose 174t - 169t - 10 = 0. Suppose -tu = 4h - 0 - 408, -u + 5h = -169. List the prime factors of u. 2, 97 Let l = -19063 + 42698. List the prime factors of l. 5, 29, 163 Let s be (-280)/8412/(-10). Suppose -4748 = -4i - sn, -5i + n = 3n - 5944. What are the prime factors of i? 2, 5, 7, 17 Let b = -237 - -254. Suppose -812 = -0j - 2j. Suppose 0 = 3a - ba + j. What are the prime factors of a? 29 Suppose 0 = 19q - 99184 - 103527. List the prime factors of q. 47, 227 Suppose -u - n + 15 = 0, -27 = 4u + 3n - 84. Let o(h) = -109h - 3. Let r(c) = 173c + 5. Let j(v) = -8o(v) - 5r(v). List the prime factors of j(u). 83 Let v = -159 - -214. Let n = v - -53. List the prime factors of n. 2, 3 List the prime factors of (-1 - (-3)/2) + (-148063223)/(-1694). 3, 5, 5827 Suppose -3w - w = -4i - 148, i = -4. Let x = -36 + w. List the prime factors of 1 + 1 - (-1 - x)-37. 2, 19 Suppose -85284 = -4s + 74n - 69n, 4s - 3n - 85284 = 0. List the prime factors of s. 3, 23, 103 Suppose -6 = 5t - 2t + 5f, -3 = -4t - 3f. Suppose -o = -2i + 15 + 9, -to = -2i + 32. Suppose 4q - 78 = i. List the prime factors of q. 2, 11 Let z be -695(-6 + 0 - -5). Suppose -4252 = -3l - 2m + z, 2l - 5m = 3279. List the prime factors of l. 3, 61 Suppose -22c + 101400 = 17c. List the prime factors of c. 2, 5, 13 Let k = 10553 - 3774. What are the prime factors of k? 6779 Let j = 10 - 8. Suppose 4u + 3107 = 3h - 747, ju = -2h + 2574. List the prime factors of h. 2, 643 Let c(x) = -165x - 112. Let w be c(-13). Suppose 5d - 3240 = -5h, 5h - 5d = w + 1227. What are the prime factors of h? 2, 5, 13 Suppose -6 = 4x + 2, 2y - 5x = 2072. Let b = y + -499. Suppose b = 4o + 32. What are the prime factors of o? 5 Suppose 2u - 2 = -2s, -7 = -4s - 6u + 5u. Suppose 5 = -4x - 3, sx = -4g + 2908. What are the prime factors of g? 2, 7, 13 List the prime factors of (32/4 - 1) + 7063 + -2. 2, 3, 19, 31 Let h(v) = 1704v2 + 16v - 42. What are the prime factors of h(2)? 2, 41, 83 Let b(u) = -2u - u3 - u3 - 3u2 + u3 + 10. Let j be b(-5). Let q = 148 - j. List the prime factors of q. 2, 3, 13 Let u = 55 - 10. Let m = -45 + u. Let w(n) = -n*2 + n + 89. What are the prime factors of w(m)? 89 Suppose -5m + 116i - 115i = -24426, -5*i = -20. What are the prime fac	{ "pile_set_name": "DM Mathematics" }
site number? True Is 981630229 a prime number? True Is 118638491 prime? False Is 30542011 a composite number? False Is 155371 a prime number? True Is 657911 a composite number? False Is 334080337 prime? True Is 31525247 composite? True Is 5661823 a composite number? False Is 8291443 prime? True Is 3348223 composite? False Is 18791683 a composite number? True Is 427012071 prime? False Is 112772717 prime? True Is 8497423 prime? False Is 23252947 a composite number? False Is 1403057 composite? False Is 8790781 a prime number? True Is 732521 a prime number? True Is 16083701 a prime number? False Is 3025031 a prime number? False Is 87428141 prime? True Is 13115229 composite? True Is 9246219 a composite number? True Is 1495063 a prime number? True Is 494370737 composite? True Is 7032667 a composite number? False Is 3744259 prime? False Is 374946959 a prime number? True Is 17423597 prime? False Is 21458951 composite? True Is 2964791 a composite number? True Is 252256033 composite? False Is 44374441 composite? False Is 2502947 a prime number? False Is 7688137 prime? False Is 12507581 a composite number? True Is 79366739 a prime number? False Is 3217429 a prime number? True Is 3842753 prime? False Is 102759583 a composite number? True Is 20002717 a composite number? True Is 200622283 prime? True Is 66946981 prime? True Is 37404241 prime? False Is 9853897 prime? False Is 41987461 a prime number? True Is 3168343 a prime number? True Is 141534697 prime? False Is 36741493 a composite number? False Is 4676129 prime? False Is 98108947 a prime number? True Is 2635643 composite? False Is 22830217 a prime number? True Is 5601293 a prime number? True Is 954461 prime? True Is 24629705 a prime number? False Is 3742007 a composite number? True Is 412891 composite? False Is 999041 a composite number? True Is 18375959 prime? False Is 44037619 prime? False Is 8260733 prime? False Is 426061 a prime number? True Is 1011719 composite? False Is 6560447 prime? True Is 63345839 composite? True Is 3512501 a composite number? False Is 50135957 prime? True Is 361763 composite? False Is 987199 composite? False Is 7401377 a composite number? True Is 14298783 a composite number? True Is 141266509 a prime number? True Is 333959 composite? False Is 8117717 composite? False Is 3063583 composite? False Is 20339197 a composite number? False Is 2818339 a composite number? True Is 540202478 composite? True Is 16010587 prime? True Is 3519433 prime? True Is 70359193 composite? False Is 120814819 a composite number? False Is 127637519 a prime number? False Is 488531621 a prime number? False Is 2827753 a composite number? False Is 6757033 a prime number? True Is 3868973 composite? False Is 136294667 prime? True Is 5565691 a composite number? False Is 1699601 composite? True Is 79933181 a composite number? False Is 8827031 a prime number? True Is 8958263 a composite number? True Is 507131 a composite number? True Is 20719499 a composite number? False Is 29547733 a prime number? False Is 3741997 composite? True Is 10900087 composite? True Is 84582709 prime? True Is 12718547 a prime number? True Is 19490529 composite? True Is 3596963 a prime number? False Is 3714307 prime? True Is 958469 a prime number? False Is 6158377 a composite number? True Is 1520401 composite? False Is 77921213 prime? True Is 426161 prime? True Is 3297053 prime? False Is 154504213 composite? False Is 29213713 a composite number? False Is 1026703 a composite number? True Is 153473893 a prime number? False Is 3920029 composite? False Is 382427 a prime number? True Is 15992579 a composite number? True Is 732261 prime? False Is 7917449 composite? False Is 877687 composite? True Is 1687087 composite? False Is 11214613 composite? False Is 23453357 prime? False Is 5912983 prime? True Is 8585329 a composite number? True Is 9617735 prime? False Is 1212241 composite? False Is 10208161 a composite number? False Is 5096759 prime? True Is 186837803 prime? False Is 49754769 a composite number? True Is 12797819 composite? True Is 97577627 a composite number? True Is 45541429 a prime number? False Is 677579 a composite number? True Is 11557099 a prime number? True Is 115171079 a prime number? True Is 21173851 a composite number? True Is 8387729 a composite number? True Is 2922833 a prime number? True Is 3191549 a prime number? False Is 1601399 composite? False Is 1954087 a prime number? True Is 12876467 prime? True Is 38385982 composite? True Is 145799747 a prime number? True Is 68932641 prime? False Is 89508031 composite? True Is 38665357 prime? True Is 3739697 a composite number? True Is 10561951 prime? True Is 40881581 a prime number? False Is 8384591 a composite number? False Is 677081689 composite? False Is 1497407 a composite number? False Is 32428961 a composite number? True Is 136261471 a composite number? False Is 4731203 a prime number? False Is 47371 prime? False Is 5539109 prime? False Is 12596105 composite? True Is 213403 a composite number? True Is 51019061 a prime number? True Is 2613407 composite? True Is 1717739 a composite number? False Is 26523499 a prime number? True Is 5333311 a prime number? True Is 424054259 a prime number? True Is 98297 a composite number? False Is 33567631 composite? False Is 40879 a prime number? True Is 24011677 a prime number? True Is 21531269 composite? False Is 310179957 a composite number? True Is 6290351 a composite number? False Is 237381037 a prime number? False Is 22520213 a prime number? True Is 1282051 a prime number? True Is 16901935 a prime number? False Is 12080543 composite? True Is 119712741 a prime number? False Is 64600657 a composite number? True Is 34303913 a prime number? False Is 4002797 a prime number? True Is 919859 a prime number? True Is 48977485 composite? True Is 74687729 a composite number? True Is 62747099 a composite number? False Is 10709029 prime? True Is 1432507 a composite number? True Is 13586269 prime? True Is 186931907 prime? False Is 347514971 prime? True Is 93498091 a composite number? False Is 65534641 prime? False Is 24971371 prime? True Is 14361803 composite? True Is 375223714 prime? False Is 111954169 a composite number? False Is 159020341 prime? True Is 15038735 a prime number? False Is 2575689 a composite number? True Is 922601 prime? True Is 9698321 prime? True Is 36739 prime? True Is 777073243 a composite number? False Is 130219897 composite? True Is 20631307 composite? True Is 1496673071 composite? False Is 3736589 prime? True Is 97772291 composite? False Is 15554873 a composite number? True Is 55773499 composite? False Is 17505731 a composite number? True Is 5448761 prime? False Is 10786019 a composite number? False Is 451849 a prime number? False Is 162333849 a prime number? False Is 2477171 a composite number? False Is 52412002 composite? True Is 574460713 a prime number? True Is 6114463 composite? False Is 33797251 prime? True Is 50186921 composite? True Is 20525753 prime? True Is 6835931 prime? True Is 11664263 a composite number? True Is 4318487 a composite number? False Is 2516339 prime? False Is 17162309 a composite number? False Is 679795937 composite? False Is 1792751 a composite number? True Is 454483 prime? True Is 2143147 prime? True Is 55414813 prime? True Is 131511281 a prime number? False Is 67117 prime? False Is 1403659 composite? True Is 97522673 prime? True Is 11234191 composite? False Is 662962133 prime? True Is 107205871 prime? False Is 112545709 a prime number? True Is 44911351 a prime number? True Is 154114383 prime? False Is 4204177 prime? False Is 41980907 prime? True Is 152452307 a composite number? True Is 18463069 a composite number? True Is 962981509 composite? True Is 27611291 composite? True Is 5326873 a prime number? False Is 12387721 prime? False Is 76309621 a prime number? True Is 283139 prime? True Is 59803823 a prime number? True Is 96210097 composite? False Is 4537373 composite? False Is 263696603 a composite number? False Is 7837301 a prime number? True Is 52449143 a prime number? True Is 22624349 prime? False Is 32092861 composite? False Is 325674689 a composite number? False Is 30099319 a composite number? False Is 115389991 prime? False Is 305378657 prime? True Is 42249854 a composite number? True Is	{ "pile_set_name": "DM Mathematics" }
ues? True Let h be 2952/(-1672) - (-14)/(-266). Which is smaller: -21 or h? -21 Let x(t) = -t*3 + t + 3. Let q be x(0). Suppose qr + 70 = -2r. Let w(o) = o + 30. Let i be w(r). Is i at most as big as 16? True Let u(x) = x2 + 9x + 6. Let i be u(-7). Let m be ((-3)/6)/(2/i). Let j(q) = q*3 - 9q*2 + 9q - 5. Let f be j(8). Which is smaller: m or f? m Let p(z) = 11z2 + 3z - 3. Let k be p(1). Let s = k - 10. Which is smaller: s or 1/10? 1/10 Let g be (13/(-3) + 1)(35 + -41). Suppose 5 = -k - 3f, 5f - 1 = 2k + g. Let j(h) = 4h + 1. Let o be j(-2). Is o at least as big as k? True Let l be (18 + -24)/(-1(-2)/(-6)). Let y be (1/2)/((-3)/l). Are y and -4 equal? False Let o be 18/30 + (-99)/15. Suppose 0 = -5p - 5n + 3 + 17, -n - 16 = -4p. Suppose -m = 4r + 1 - 4, 6 = -2m + pr. Do o and m have the same value? False Let m = 182.83 - -2.17. Let s = -128 + m. Let l = 33 - s. Which is smaller: 2/3 or l? l Let z = 10.4 - 6.1. Let q = -4 + z. Which is smaller: 5 or q? q Suppose -2l = 3m, 0l = -l. Let b = 3468 + -468178/135. Let z = b + 13/135. Is z at least m? True Let l = -37/6 + 167/6. Do -1 and l have different values? True Let q(x) = x - 3x + 2 + 14 + 0x. Let t be q(7). Do t and 2 have the same value? True Suppose 3j - 4w = 122, -3j - 86 = -5j - 2w. Which is smaller: j or 207/5? 207/5 Let d = 4 - 4.3. Let f be -5 - (-405)/55 - 2. Which is smaller: f or d? d Suppose 3u - w - 1 = 4u, -3w = -u + 3. Suppose -3a + 2a - 66 = 0. Let t be 4/22 + 78/a. Is u equal to t? False Let u be ((-12)/10)/(2/10). Let l = -0.72 + -34.28. Let v = l - -37. Is u > v? False Suppose 6l - 17 = 7. Suppose 0v = -2v + l. Let u be (-10 - -9)(-15)/v. Which is greater: u or 7? u Suppose 10 = -j - 0j - 5f, j = 2f - 38. Let n be j/(-9) + (-3)/((-9)/2). Which is bigger: n or 5? 5 Let j = -2.8809 + 0.0809. Is 0.5 less than or equal to j? False Let k = -33.1 + 32.9. Let g = -2 + -9. Which is smaller: k or g? g Let i = 1.1 + -0.1. Let k = -130 + 120.96. Let n = k + 9. Is i bigger than n? True Let m = 42 + -37.6. Let y = m + -6. Let o = y - -1.5. Which is smaller: o or -1? -1 Let i = 1.76 - -0.34. Let g = -2.1 + i. Is 0 less than or equal to g? True Let h be ((16/14)/(12/42))/2. Suppose -5j + 5i - 31 = 4, 0 = -2j + 3i - 17. Let m be (32/j)/2 - h. Are -6 and m non-equal? False Let h = -472 - -471. Let d = 4.12 - 4. Which is smaller: d or h? h Let r = -5.09 + 5. Let h = -0.1 - r. Let u = h - -0.01. Is u greater than or equal to 6? False Let c(t) = t*2 - 53t + 198. Let r be c(49). Let b = -32 - -5. Do b and r have the same value? False Let p = -256 + 261. Which is greater: -1 or p? p Let j(m) = -2m2 + 20m - 19. Let f be j(1). Is -6/25 bigger than f? True Let h = -824 - -825. Which is bigger: -3/221 or h? h Suppose -5c + 3l = -42, 2l = c + 5l + 6. Suppose 5z - c = 3z. Suppose 3k - 5k - 2 = 5a, -za = 2k - 6. Is 8 bigger than k? False Suppose 0 = x - 4g + 63, 8 = 2g - 4g. Let d = x - -97. Is 18 smaller than d? False Let g be ((-1)/(-2))/(2/200). Suppose -4m + g = -4k - 6, 44 = -3k + 5m. Let i = k - -19. Which is greater: i or 5? i Let c = 179 + 15. Let a = -962/5 + c. Let n = a + -27/20. Which is bigger: -10 or n? n Suppose -21l + 23 = 1010. Let r be 11/(-2)96. Which is smaller: l or r? r Suppose 3g - 3v - v - 4 = 0, 0 = -2g - 2v + 12. Suppose -4h + 4b - 56 = -0b, h + gb = 11. Let i be (-6)/h1/(-3). Which is greater: 0.2 or i? 0.2 Let u = 6 + 65. Let q be (-711)/((20-2)/4). Let f = q - u. Is f at most -1? False Let g = -8.14 + 9.14. Let r = 4.07 - 0.07. Which is smaller: r or g? g Let b be -5 - (-28)/23. Are b and 37 nonequal? False Let o = 1177.2 - 1177. Let k be ((-12)/(-30))/((-12)/(-25)). Which is smaller: o or k? o Let o = -2 - -2. Suppose 2u + 30 = 38. Let g be -5 + u + 84/82. Which is greater: o or g? g Suppose -48 = -7a + a. Let d be 2/a - (-623)/(-28). Which is smaller: d or -24? -24 Let f(g) be the third derivative of -g*4/12 + 3g*3/2 + 25g*2. Let w be f(4). Let d = -1627/8 - -203. Is d at most w? True Suppose 0 = -7c - 34 + 27. Is c at most as big as -14/9? False Let u be (2 - (0 - -3))-3. Suppose -9 - 6 = -us. Suppose -10 = -2b + o, -5b + so + 11 + 4 = 0. Which is smaller: b or 8? b Suppose 80t + 2018 = 5698. Which is smaller: t or 57? t Let m = 8 + -7. Let g = -193/559 - 5/43. Is m less than g? False Let z = -90 + 95. Suppose 0 = zt - 8t - 3. Is -5/7 less than t? False Let f = 5 - 18. Let c = f + 9. Let k be (c - -14)/2 + -4. Which is smaller: k or 3/17? 3/17 Let i = 16 - 29. Let z be (-18/14)/((-42)/147). Is i smaller than z? True Let w = 2 - 4. Let g(i) = 2i - 7. Let q be g(11). Let b = 13 - q. Is b not equal to w? False Let b = 45.9 - 46.1. Is b equal to -67? False Let h be 2/(-6 + 1111/184). Are 53 and h equal? False Let m be 7/2(7 + -9). Let j(s) = s + 4. Let t be j(m). Let l be 5/((-100)/12)(14 - -1). Is l not equal to t? True Suppose 5z - 17 = -3g, -9z + 3g - 14 = -11z. Which is smaller: z or -1/430? -1/430 Let m = -36 + -15. Let g = m - -46. Which is smaller: g or 2/9? g Let u = -1.872 - 0.128. Which is smaller: u or 23/4? u Let s be (2/2)/(1/(-13)). Let l = -16 - s. Is 5 not equal to l? True Let r(m) = m3 - 3m*2 - 17m - 17. Let d be r(6). Suppose -u = -5u - 44. Is u greater than d? False Suppose 5g - 11 = q, 5q + 33 = -g + 30. Which is bigger: -1/238 or q? -1/238 Let t(i) = -i2 - 8i - 11. Let s be t(-6). Suppose -4l + 11 + s = 0. Which is greater: l or -1? l Suppose -10h = -8h - 3c - 1125, h = -3c + 585. Is h at most as big as 569? False Let j be (14 - 15)2115/(-2). Let w = j - 111. Which is smaller: w or 27/7? 27/7 Suppose -8s - 10 = -13s. Suppose 5d = d, sd - 5 = -5w. Is w greater than or equal to -2/11? True Let c be (2/3)/(10/375). Suppose -26 = -29m + 28m. Is m > c? True Let m be ((-32)/12)/((-2)/6). Suppose -4h + 5h = -4y - m, -4y + 2h = -4. Let i be (-7)/(-9) - 2 - y. Is 4/5 less than i? False Let l = 64 + -93. Let p = l + 28. Are p and -1 equal? True Let c = 35.0214 + -0.0214. Is c bigger than 1? True Suppose 5x - 7z + 10 = -3z, 3x = -4z + 26. Let h be 2((-14)/4 + x). Suppose -2a + 2w = 4, a + 6 = -0a - w. Which is bigger: h or a? h Let j = -1 - -38. Let k = -36.8 + j. Let u = 0.2 - 0.22. Are k and u equal? False Suppose -s = 4s + t + 296, s + 5t = -40. Let a be ((-2)/(-5))/(72/s). Which is greater: a or 1? 1 Let j be 2339590/(-4850) - (-9)/(-15). Let m = -483 - j. Which is bigger: m or 0? 0 Suppose 4m + 0k - 44 = 3k, 3m - 5k - 22 = 0. Is m >= -2? True Let f be (-1092)/36 - (2 + 1). Are f and -32 non-equal? True Let d = 6.61 + -6.71. Is d != 627? True Suppose -5d = -5m - 60, -22m + 4 = -24m - 2d. Do m and -2 have the same value? False Let u = -26 + 35. Suppose -u - 2 = -y. Let k(h) = 2h - 17. Let l be k(y). Which is bigger: 4 or l? l Let u be (-12)/105-1. Let i = -192517/6 - -32093. Which is bigger: i or u? i Let c be (4/(-14))/(6/336-4). Let v be 12/(0 + c) + (-1 - 2). Is v smaller than 2/153? True Let a = 281.6 - 281.6. Is a <= -0.0091? False Suppose 0 = -130y + 127y - 270. Which is smaller: -89 or y? y Suppose -3l + 13 = 34. Let q be 300/21 - (-2)/l. Which is bigger: 1/4 or q? q Let z be (-6)/(-20) + (-117476)/1720. Which is smaller: z or -3? z Let r = -77.9687 + -0.0313. Is r smaller than -0.3? True Let r = -0.16 - 2.84. Are -0.039 and r equal? False Suppose 2u - 27 = 5u. Let o be u/27 - (-23)/(-3). Let w = o + 1. Do -7 and w have the same value? True Let p = 543.73 + -543. Is 2/15 less than p? True Let w = -696 + 250. Is w < -445? True Let o = -121 - -4963/41. Let n = -1 + 2. Which is greater: n or o? n Let n = 12/53 + 494/159. Suppose 2d = 3z, 2z = 4z - 4. Which is smaller: n or d? d Suppose -13 = 3f - 4p, -18 = 5f - p - 2. Let j(v) = v2 + 2. Let y be j(0). Let k be (1 + 5)/(y + -4). Are f and k non-equal? False Let d(b) = b2. Suppose -2g - 3g + 22 = 3s, 4 = 2g. Suppose 3t - 4 + 3 = -w, -3t = -4w + s. Let a be d(t). Are -12/11 and a non-equal? True Let d = -1224 - -1318. Which is smaller: d or 95? d Let p = 235 - 189. Which is smaller: 47 or p? p Let j = -4922/9 + 533. Which is smaller: -13 or j? j Let d(z) = -16z*2 - 2z + 1. Let j = 14 + -13. Let h be d(j). Let m = h +	{ "pile_set_name": "DM Mathematics" }
3 + 1/180p4 + 0 - 3p*2. Factor t(r). 2r(r + 1)2/15 Factor 3k*5 - 9k5 + k5 + 5k3. -5k*3(k - 1)(k + 1) Let j(z) = 2z*2 + 4z + 3. Let p be j(-3). Let h be (-3)/(-15) - p/(-5). Factor -2/7 - 4/7n - 2/7n*h. -2(n + 1)*2/7 Let h(j) = -2j*3 + 2j*2 + 6j*4 - 3j*4 - 2j4 - j3. Let d(c) = -c3 + c2. Let s(n) = d(n) - h(n). Factor s(v). -v*2(v - 1)*2 Suppose 9u*3 - 3u - 6u - 22u*2 + 19u*2 + 3 = 0. What is u? -1, 1/3, 1 Let z = 16 - 13. Factor 2 - 3i*2 + 4 - 5i + z - i. -3(i - 1)(i + 3) Let m be (-1)/10 + 0 - 16/(-32). Factor 0 - 4/5z4 - mz + 4/5z2 + 0z*3 + 2/5z*5. 2z(z - 1)3(z + 1)/5 Suppose w = 5w - 12. Let g(m) = m2 - 2m + 2. Let q be g(w). Determine x, given that -2x2 - x + q - 4 - x3 - 1 = 0. -1, 0 Factor 5/2n - 25/4n2 + 5n*3 - 5/4n*4 + 0. -5n(n - 2)(n - 1)*2/4 Suppose -2h - 14 = -5u + 19, -3u = -4h - 31. Let k be ((-1)/(-2))/((-2)/(-16)). Let -kr*4 - 2r*3 + 2r - 2ru - 2r = 0. What is r? -1, 0 Let h = 5 - 2. Suppose a - 5a = -hy - 20, -2a + 24 = -5y. Factor 2c2 - 2c - 3ca + 0c. -c(c + 2) Factor -j3 - 48j*2 - 11j*3 - 63j + 5 - 32. -3(j + 1)(2j + 3)2 Factor 12/7r*3 - 80/7r*4 + 50/7r*5 + 0 + 16/7r*2 + 2/7r. 2r(r - 1)*2(5r + 1)2/7 Let m = 66 + -105. Let j = -36 - m. Factor -6/11c - 4/11c2 + 6/11c*j + 4/11. 2(c - 1)(c + 1)(3c - 2)/11 Let v(h) be the second derivative of 1/21h*4 - 4h - 1/7h2 - 3/35h*5 + 1/7h*3 + 1/49h*7 + 0 - 1/105h*6. Solve v(s) = 0. -1, 1/3, 1 Let b be 114/(-60) + 2/1. Let v(o) be the third derivative of -bo*5 + 0o*6 + 0o*3 + 1/6o*4 + 0o + 0 + 2o2 + 1/105o*7. Factor v(k). 2k(k - 1)2(k + 2) Let m(h) be the second derivative of h10/30240 - h9/3780 + h8/1680 + h4/3 - h. Let r(t) be the third derivative of m(t). Factor r(v). v*3(v - 2)*2 Suppose 2f + 2r + 8 = 3f, -24 = -2f - 4r. Let j = f + -5. Solve -4n + 6n*4 + 0n*2 - 2n*2 - 2n*2 + 11n*3 - 9n*j = 0 for n. -2/3, 0, 1 Let p(c) be the first derivative of -2c5/35 - c4/7 - 2c3/21 - 3. Factor p(j). -2j*2(j + 1)*2/7 Let m = -30 - -30. Let c(g) be the first derivative of 0g*2 - 1/20g*4 + mg*5 + 1/30g*6 + 0g + 0g3 + 3. Factor c(f). f3(f - 1)(f + 1)/5 Let j(q) = 19q*2 + 6q - 4. Let w(b) = 18b2 + 7b - 3. Let s(v) = 3j(v) - 4w(v). Solve s(f) = 0 for f. -2/3, 0 Suppose -159f3 + 161f*3 - 16f*2 - 14 - 22 + 42f = 0. What is f? 2, 3 Let c(n) be the first derivative of 0n2 + 3 - 8/7n + 2/7n3 + 1/14n*4. Determine j, given that c(j) = 0. -2, 1 Let u(z) = -z + 6. Let m be u(4). Determine n, given that 0 + 2n*2 + 0n*2 + 6 + 8n + 0nm = 0. -3, -1 Let j(c) be the second derivative of c5/4 + c4/6 - c3/2 - 6c. Let y(q) = 4q3 + q2 - 3q. Let b(l) = -5j(l) + 6y(l). Let b(v) = 0. What is v? -3, -1, 0 Let h(r) be the first derivative of -1 - 8/3r3 + 2r - 3r2. Determine p, given that h(p) = 0. -1, 1/4 Let v(u) = u3 + 9u*2 + 17u + 21. Let i be v(-7). Determine y, given that -1/4y2 + 0 + 1/4y*3 + iy = 0. 0, 1 Let g = -1/27 - -7/27. Factor -gd4 - 2/9d*5 + 4/9d*3 + 4/9d*2 - 2/9 - 2/9d. -2(d - 1)2(d + 1)3/9 Let t(c) be the third derivative of -c5/120 + c4/24 + c3/4 - 18c2. What is h in t(h) = 0? -1, 3 Let j(g) = g4 - 2g*3 - 5g*2 - 6g. Let a(w) = -w*2 - w. Let o(n) = 6a(n) - j(n). Factor o(v). -v*2(v - 1)*2 Find l such that 0 - 5/6l*2 + 2/3l + 1/6l3 = 0. 0, 1, 4 Suppose -o - o + 4 = 0. Determine k, given that 14k*3 + 4 - 10k - ok2 - 2k*2 - 4k = 0. -1, 2/7, 1 Let a(y) = -y4 - y3 + 1. Let c(j) = -5j4 + 3j*2 - 2j + 2. Let h = 1 - 3. Let o(u) = ha(u) + c(u). Let o(t) = 0. Calculate t. -1, 0, 2/3, 1 Suppose 5g - 3g = 5u - 14, -g = -4u + 10. Let 12 - 12 + 3c*u = 0. What is c? 0 Let n be (-11)/(-132)4/2. Let p be (2/(-12))/((2 + 1)/(-3)). Suppose -1/6a3 + 0a + 1/6a4 - na*2 + 0 + pa5 = 0. Calculate a. -1, 0, 1 Let l(t) be the first derivative of -t4/4 - t3/3 + 7. Factor l(i). -i2(i + 1) Let l be (-44)/(-24) - (-5)/(-10). Solve 2/3 - lw*4 + 10/3w*3 - 2/3w - 2w2 = 0 for w. -1/2, 1 Let z(h) be the second derivative of 0h*2 + 1/42h*4 - 1/21h*3 - 1/105h*6 + 1/70h*5 - h + 0. Factor z(g). -2g(g - 1)2(g + 1)/7 Let u(i) be the third derivative of -i5/660 - i4/44 - 4i3/33 - 6i*2. Factor u(c). -(c + 2)(c + 4)/11 Suppose -5d - 13 = -4o, 2o - 3 = -2d + d. Determine n, given that 1/2no + 1/2 - n = 0. 1 Let p(w) be the first derivative of 2w*5 + 35w*4/4 + 10w*3 - 5w*2/2 - 10w - 14. Factor p(c). 5(c + 1)2(c + 2)(2c - 1) Let k(n) = n + 4. Let f be k(-4). Let w = f + 3. Factor -2/7p - 2/7p*2 + 0 + 2/7p*4 + 2/7p*w. 2p(p - 1)(p + 1)2/7 Let s(d) be the third derivative of -d6/40 + d*5/5 - 5d4/8 + d3 - 9d2. Find y, given that s(y) = 0. 1, 2 Let p(g) be the second derivative of 1/36g*4 + 0 + 0g*3 - 7g + 0g2 - 1/60g5. Factor p(r). -r2(r - 1)/3 Factor 1/3g*3 + 1/3g + 0 + 2/3g2. g(g + 1)*2/3 Let h(n) be the first derivative of -2n3/27 - n2/9 + 6. Factor h(b). -2b(b + 1)/9 Let h(p) be the second derivative of 0p2 - 1/9p*3 - 1/36p*4 + 0 - 3p. Find i, given that h(i) = 0. -2, 0 Suppose -k + 0 - 5 = -c, 0 = 2c - 3k - 15. Let z(r) = 4r3 - r2 + 1. Let t be z(1). Solve p2 - p4 + 4p + cp2 + 2p*2 - 2p*3 - t = 0 for p. -2, 1 Suppose -4g = 4h + 8, -2g + 1 = 11. Solve -16x4 - 16x*h + 18 - 4x*2 - 18 = 0. -1/2, 0 Determine m so that -32/3 + 625/3m*5 + 1000/3m*3 - 176/3m + 1750/3m4 - 80/3m*2 = 0. -2, -2/5, 2/5 Suppose 11h - 8h = 0. Factor 2/5o*3 + 0 + ho*2 + 0o. 2o3/5 Let r be (-3 - 0)/((-2)/(-30)). Let v be 4/(-10) - 36/r. Factor 0 - 2/5w + vw2. 2w(w - 1)/5 Let g(p) = 3p*2 - 2p + 2. Let l(y) = 10y2 - 7y + 7. Let j(u) = 21g(u) - 6l(u). Factor j(n). 3n2 Let d be (-2)/(-5) - 1/3. Let t(z) be the second derivative of -1/10z*2 + 0 + dz*3 + z - 1/60z*4. What is i in t(i) = 0? 1 Let p be -6 + 9 - 0/1. Suppose 0 = pm - m - 6. Factor 0 + 0h - 2/7h*2 + 0h*m + 2/7h*4. 2h*2(h - 1)(h + 1)/7 Let v(j) be the first derivative of -1/120j6 + j2 - 1/24j4 + 1/30j*5 + 2 + 0j + 0j3. Let n(y) be the second derivative of v(y). Factor n(b). -b(b - 1)2 Let j(u) be the third derivative of u8/168 - 4u7/105 + u6/60 + u5/3 - u4/3 - 8u*3/3 + 8u*2. Find y such that j(y) = 0. -1, 2 Let i = 0 + 2. Suppose -5a = -0a - 5y - 15, iy - 9 = -3a. Factor 0ra + r + 4r2 + r3 + r + r*3. 2r(r + 1)2 Let b(g) be the first derivative of -14g*4 - 44g*3/3 + 10g*2 + 8g + 8. Suppose b(i) = 0. Calculate i. -1, -2/7, 1/2 Let z be 18/12 - (-74)/(-60). Let t(u) be the third derivative of 0 - zu3 - 1/50u*5 + 1/10u*4 + 0u + 1/600u6 - 2u2. Factor t(y). (y - 2)3/5 Let h(p) be the second derivative of -p*6/75 - 3p5/50 - p4/10 - p*3/15 + 2p. What is g in h(g) = 0? -1, 0 Let a(r) be the first derivative of -18r6/5 + 216r*5/25 - 36r*4/5 + 8r*3/3 - 2r*2/5 - 7. Solve a(i) = 0. 0, 1/3, 1 Let b = 16 + -4. Let y = b - 12. Factor -2/7s*3 + 2/7s*4 + y - 2/7s*2 + 2/7s. 2s(s - 1)*2(s + 1)/7 Suppose 2f + f = -12. Let s be (-1)/(-5)(1 - f). Determine q so that 2q3 - 1 - 3q3 - q2 + s = 0. -1, 0 Let i(a) be the third derivative of a9/12096 - a8/3360 + a6/720 - a5/480 - 5a3/6 - a2. Let d(t) be the first derivative of i(t). Factor d(h). h(h - 1)*3(h + 1)/4 Let y(d) = 3d5 - d4 + d3 + 5d + 5. Let v(b) = -2b5 - b3 - 3b - 3. Let j(h) = -10v(h) - 6y(h). Solve j(w) = 0. -2, -1, 0 Let l be (30/(-20))/((-5)/2). Determine a so that 0 + 0a3 - 3/5a*5 + 0a*2 + la*4 + 0a = 0. 0, 1 Let j = 5/14 - -13/42. Let o be (-12)/(-4)4/18. Determine g, given that -2/3g*4 + 0 - jg*3 + 2/3g*2 + og = 0. -1, 0, 1 Let c(u) = -u*3 + u. Let o(t) = 5t*4 - 10t*3 + 15t*2 + 30t. Let k(v) = 30c(v) - o(v). Factor k(n). -5n*2(n + 1)(n + 3) Let g be 186/75 + (-20)/250. Let 4m*2 + 28/5m + 4/5m3 + g = 0. Calculate m. -3, -1 Let n(y) be the first derivative of y6/600 - y5/300 - y4/60 - 3y**2/2 + 1. Let d(k) be	{ "pile_set_name": "DM Mathematics" }
rom zyvawyr. Give prob of picking 1 r and 1 v. 1/21 Calculate prob of picking 2 v, 1 l, and 1 x when four letters picked without replacement from slixv. 0 Four letters picked without replacement from {n: 1, s: 4, v: 1, u: 2}. Give prob of picking 3 s and 1 n. 2/35 What is prob of picking 2 k and 1 y when three letters picked without replacement from {k: 2, u: 1, p: 7, y: 2}? 1/110 Three letters picked without replacement from {x: 1, h: 3, q: 4, n: 2, b: 1, o: 1}. Give prob of picking 2 h and 1 q. 3/55 Three letters picked without replacement from {j: 2, e: 2, a: 5, v: 2, x: 2}. Give prob of picking 2 a and 1 v. 10/143 What is prob of picking 1 g and 1 a when two letters picked without replacement from agawwwwwawgagggggw? 28/153 What is prob of picking 1 w and 1 a when two letters picked without replacement from wawvwogowwog? 5/66 Calculate prob of picking 2 r and 2 a when four letters picked without replacement from carcrqcacclcrc. 3/1001 Calculate prob of picking 1 s, 1 j, and 1 q when three letters picked without replacement from {d: 1, z: 2, h: 2, j: 2, q: 1, s: 1}. 1/42 Four letters picked without replacement from aaaa. What is prob of picking 4 a? 1 Four letters picked without replacement from {p: 2, z: 2, f: 11}. Give prob of picking 1 p, 1 z, and 2 f. 44/273 What is prob of picking 4 v when four letters picked without replacement from {s: 4, w: 2, v: 7}? 7/143 Four letters picked without replacement from {n: 1, c: 1, q: 7, u: 6}. What is prob of picking 1 n, 1 c, and 2 q? 1/65 What is prob of picking 1 i, 1 x, and 1 q when three letters picked without replacement from goqoqixogooo? 1/110 What is prob of picking 2 y when two letters picked without replacement from yyuouuuuuyxxux? 3/91 What is prob of picking 1 w, 1 q, 1 c, and 1 h when four letters picked without replacement from cucrcqhuwhu? 1/55 What is prob of picking 1 d and 1 x when two letters picked without replacement from ddxdvxxdxdvxvxdxx? 6/17 Three letters picked without replacement from {n: 7, p: 4, g: 2, l: 2, d: 2, u: 2}. What is prob of picking 2 d and 1 l? 2/969 Calculate prob of picking 1 i and 3 h when four letters picked without replacement from hhiiihhh. 3/7 Two letters picked without replacement from {e: 4, f: 15}. Give prob of picking 2 f. 35/57 Two letters picked without replacement from zjjzzjjjjjjjjj. Give prob of picking 2 z. 3/91 What is prob of picking 1 e and 1 d when two letters picked without replacement from {d: 1, e: 2, c: 1}? 1/3 Calculate prob of picking 2 f when two letters picked without replacement from {p: 2, f: 2, o: 4}. 1/28 What is prob of picking 1 o and 1 s when two letters picked without replacement from {k: 9, o: 4, g: 2, s: 4}? 16/171 What is prob of picking 2 f when two letters picked without replacement from {g: 2, f: 2, m: 4}? 1/28 Calculate prob of picking 1 l and 2 k when three letters picked without replacement from {l: 15, k: 5}. 5/38 Calculate prob of picking 2 n when two letters picked without replacement from {o: 2, n: 4, l: 4, a: 3, v: 3}. 1/20 Three letters picked without replacement from ootooooooooo. Give prob of picking 3 o. 3/4 What is prob of picking 1 r, 1 b, and 2 a when four letters picked without replacement from {a: 2, u: 1, o: 1, r: 2, f: 7, b: 1}? 2/1001 What is prob of picking 2 i when two letters picked without replacement from {v: 5, i: 5}? 2/9 What is prob of picking 1 q and 1 y when two letters picked without replacement from {w: 5, q: 1, y: 4}? 4/45 Calculate prob of picking 1 h, 1 c, and 1 x when three letters picked without replacement from {r: 2, b: 3, x: 2, c: 9, h: 1}. 9/340 Two letters picked without replacement from {z: 1, n: 1, u: 2, w: 1}. What is prob of picking 1 u and 1 w? 1/5 Calculate prob of picking 1 s and 1 f when two letters picked without replacement from gsxxmif. 1/21 Three letters picked without replacement from hhhhhhhhxhhh. Give prob of picking 2 h and 1 x. 1/4 Four letters picked without replacement from {g: 3, j: 2, z: 11, d: 3}. Give prob of picking 3 d and 1 j. 1/1938 Calculate prob of picking 2 j when two letters picked without replacement from hhjjh. 1/10 Calculate prob of picking 2 c and 2 j when four letters picked without replacement from jcpjjjjjbjjpjcjjjjj. 91/3876 Calculate prob of picking 3 r when three letters picked without replacement from ervreevvreeer. 2/143 Calculate prob of picking 1 v and 3 n when four letters picked without replacement from {n: 3, l: 1, v: 5}. 5/126 What is prob of picking 2 g and 1 l when three letters picked without replacement from ugyglhlhhuyhy? 1/143 Calculate prob of picking 2 x, 1 z, and 1 p when four letters picked without replacement from {z: 7, p: 1, x: 4, y: 2, r: 3}. 3/170 Calculate prob of picking 1 v, 1 e, and 1 k when three letters picked without replacement from kvmibmkimkimvikkemvi. 1/76 Calculate prob of picking 1 z and 2 k when three letters picked without replacement from kzpkkkzkzzzkkpzkkk. 45/136 Three letters picked without replacement from ggggtggggtt. Give prob of picking 1 g and 2 t. 8/55 Four letters picked without replacement from hhyyhhyhyyyyhyyh. What is prob of picking 4 h? 1/52 Three letters picked without replacement from {v: 3, n: 2, l: 2, m: 9}. Give prob of picking 1 m and 2 n. 9/560 What is prob of picking 1 s and 1 m when two letters picked without replacement from vmskfshfm? 1/9 Four letters picked without replacement from {c: 2, s: 3, r: 4, a: 1, h: 3, b: 4}. Give prob of picking 1 a, 2 h, and 1 b. 3/595 What is prob of picking 2 z when two letters picked without replacement from {z: 2, i: 2}? 1/6 Four letters picked without replacement from {o: 5, b: 7, k: 4}. What is prob of picking 1 k and 3 o? 2/91 Calculate prob of picking 1 t and 1 a when two letters picked without replacement from qaataqqaqa. 1/9 Calculate prob of picking 1 h and 1 r when two letters picked without replacement from {r: 6, h: 13}. 26/57 Calculate prob of picking 2 f when two letters picked without replacement from {x: 4, q: 1, f: 9}. 36/91 What is prob of picking 1 s and 3 w when four letters picked without replacement from {s: 2, w: 8}? 8/15 Two letters picked without replacement from {o: 8, e: 1, a: 8}. What is prob of picking 1 o and 1 e? 1/17 Calculate prob of picking 1 b, 1 h, and 1 v when three letters picked without replacement from {h: 2, l: 4, i: 4, b: 1, e: 2, v: 1}. 1/182 Calculate prob of picking 1 q and 1 o when two letters picked without replacement from {o: 1, q: 1, r: 2, f: 2, i: 4, u: 2}. 1/66 Two letters picked without replacement from {k: 3, b: 12, z: 2, a: 1, l: 1}. What is prob of picking 2 k? 1/57 What is prob of picking 2 s when two letters picked without replacement from sesaeasysyeyyys? 2/21 Two letters picked without replacement from xuypx. Give prob of picking 2 x. 1/10 What is prob of picking 2 l and 1 a when three letters picked without replacement from owvwwwwawlawwwwl? 1/280 Four letters picked without replacement from {r: 4, g: 6}. Give prob of picking 2 r and 2 g. 3/7 Four letters picked without replacement from aaamaaoroororoaa. Give prob of picking 1 a, 1 o, and 2 r. 3/52 Calculate prob of picking 1 n, 1 w, and 1 i when three letters picked without replacement from invnivvnnnvwnnvnnvnv. 1/57 Three letters picked without replacement from {z: 2, c: 18}. Give prob of picking 2 c and 1 z. 51/190 What is prob of picking 1 s, 2 x, and 1 p when four letters picked without replacement from {p: 2, x: 8, u: 1, s: 4}? 32/195 Two letters picked without replacement from {j: 2, i: 1, n: 1, a: 4, q: 3}. Give prob of picking 1 j and 1 n. 2/55 Calculate prob of picking 2 x when two letters picked without replacement from xxyxhuuxxygyk. 5/39 What is prob of picking 3 i when three letters picked without replacement from innniiinninnnniniini? 7/95 Calculate prob of picking 1 z, 1 v, and 2 u when four letters picked without replacement from {x: 9, v: 3, k: 2, u: 4, z: 1}. 3/646 What is prob of picking 1 p and 1 u when two letters picked without replacement from puuooptttpuo? 3/22 Two letters picked without replacement from yssyysdsdsysysuussys. What is prob of picking 1 s and 1 u? 2/19 Three letters picked without replacement from atmmuaammmmt. Give prob of picking 2 m and 1 u. 3/44 Two letters picked without replacemen	{ "pile_set_name": "DM Mathematics" }
closest to i? (a) -3 (b) -0.5 (c) 0 a Let i be (-11)/(-2) + (-7)/14. Suppose iv - 37 + 7 = 0. Let l = -2.92 - 0.08. Which is the nearest to -1? (a) v (b) l (c) 3 b Let p = 419 + -422. Which is the nearest to -1/7? (a) p (b) 5/3 (c) -2 (d) 1/4 d Let n(i) = 2i - 6 - 3i2 + 0i + 3 + 4. Let y be n(-1). Which is the nearest to 0? (a) -2/31 (b) y (c) -0.1 a Let z = 3 + -2. Let a = 6.8335 - 1.8335. What is the closest to -1 in -1, z, a? -1 Let j be ((-4)/(-42))/((-46)/138). What is the closest to 1 in 2, -0.2, 5, j? 2 Let o = -1289 + 1289.09. What is the closest to -1 in 0.04, o, 5, -3? 0.04 Let k be (-22)/(-7) + 4/(-28). Suppose 5r - 5 = 4p, 3r - kp + 2 - 5 = 0. Let y = -24.4 + 27.4. Which is the nearest to r? (a) y (b) 4 (c) -0.2 c Let u = 442.6 + -443. Let p = 0 - -0.1. Which is the nearest to p? (a) 0.04 (b) -5 (c) u a Suppose 25 = 4q - 3j + 60, 30 = -q + 5j. Let a be 15/(-4)32/(-2). Let h be 26/a - 2/(-5). What is the nearest to 0.4 in q, -3/5, h? h Suppose -50 = -4o - 5j, -j - 4j = 2o - 30. Let u be -3 + 3 + 0 + 4/o. Which is the nearest to -1? (a) u (b) -18/13 (c) -0.5 b Let b = 104 + -1350/13. What is the nearest to 0 in 2, 0.5, 0.7, b? b Suppose -i + 44 = -2i. Let v be 4/36/i. Let s = 0.09 + -4.09. Which is the nearest to -0.1? (a) v (b) -2/9 (c) s a Let u be (-3)/(-27) - (-190)/(-90). Which is the nearest to -0.1? (a) u (b) -33 (c) 2/9 c Let i = 0.3 - 0. Let k = i - 0.5. Let q = -2011 + 10057/5. Which is the nearest to 0? (a) q (b) 0.1 (c) k b Let v = -1.245 - -0.845. Which is the closest to 2? (a) -3/5 (b) 0.4 (c) 3 (d) v c Let i be (21/9 - (-1)/(-3)) + (182 - 181). Let g = 4/17 - 62/119. Let f = 0.06 - -1.94. What is the nearest to -1 in i, f, g? g Let s = 171 - 854/5. Which is the nearest to s? (a) 2/7 (b) 1/8 (c) 5/4 b Let c = -2.3 + 28.7. Let j = -26 + c. What is the nearest to 0.2 in -4, j, -1? j Let b = 162.4 - 162.6. Let j = -0.01 + -0.11. What is the closest to 0 in j, 0.4, b? j Let y(s) = -s + 3. Let g be y(-6). Suppose 2 = 4n - 0n + 3l, -g = 5n - 2l. Let d = 3.2 - 3. Which is the closest to -1? (a) n (b) 3/2 (c) d a Let h = 1.32 + 2.76. Let o = 0.92 + h. Which is the nearest to 0? (a) o (b) 2 (c) -6/7 c Let s = 0.4 + 2.6. Let p = -2/43 + 47/86. Which is the nearest to p? (a) s (b) -1/4 (c) -1/5 c Let i = 187.9 + -188. Let l = -14 + 57/4. What is the nearest to -2 in l, i, -5? i Suppose 8 + 8 = 3c + 4p, 3p + 5 = 2c. Let g(z) = -13z + 83. Let l be g(6). What is the closest to -1 in c, l, 3? 3 Let q = -31.07 - -31. Let t = 0.07 - q. Which is the closest to -1? (a) -3 (b) 2 (c) t c Suppose 4v + 38 = z, 4z - 41 = 2z + v. Suppose 3l + m + 54 = 185, 2l - 74 = 2m. Let h be (-2)/3z/l. Which is the closest to h? (a) 2/7 (b) 0.1 (c) 0 c Let t = -68666/485 + -2/97. Let k = -142 - t. Suppose -l + 4o + 14 = 0, 3o + 8 + 6 = -l. Which is the closest to k? (a) -2/7 (b) -2/19 (c) l a Suppose -5x + 5i = -20, 4x - i = 5x - 2. Suppose 11 = -xk - 4. Let g = 0.0598 + -0.0598. Which is the nearest to g? (a) k (b) 0.1 (c) -0.3 b Let g be 5/(22/(-4) - -2) + 1. Let f = 1 - 0.6. Which is the nearest to -1? (a) f (b) g (c) -5 b Suppose -l + 1 = 1. Let m be ((-4)/10)/(32/40). Which is the closest to l? (a) 1/4 (b) m (c) -3/7 a Let l be 15/(-10)(-16)/36. What is the nearest to 3 in l, 2/9, 2? 2 Let q = -13 - -9. Let o be (-38)/12 + ((-4)/2 - -5). Which is the nearest to 0.1? (a) o (b) q (c) -1.4 a Let y(m) = -2m + 1. Let o be y(-3). Suppose 2b + o = 5x + 18, -4 = -3b - 5x. Let v = -18.8 + 18.5. What is the nearest to -1 in b, -2, v? v Let p = -18 - -12. Let d = p - -8. Suppose 0 = 3z + 2 + 4. What is the nearest to z in d, 1/3, -0.4? -0.4 Let z = -7.44 - 73.36. Let u = 81 + z. Let t = 6 + -2. Which is the closest to u? (a) t (b) 2 (c) -2 b Let n = -1575 - -1572. What is the nearest to 0.23 in 0.1, n, -0.2, -4? 0.1 Suppose 7v + 1222 = 67. Let z be (v/35 - -5) + 33/7. Which is the nearest to 0.1? (a) z (b) 2/5 (c) 1/2 b Suppose 2s = -2m - 2m + 24, 0 = -m + 2s + 6. Let h = 61.4 - 58.4. Which is the closest to -1? (a) m (b) h (c) -0.2 c Let k = -0.52 + 0.09. Let t = -4.57 + k. Let y = -1 - -1. What is the nearest to y in -3, -0.3, t? -0.3 Suppose 12y - 15y = 0. What is the nearest to y in 0, 4, 3/4, 0.1? 0 Let t = -0.2 - -0.6. Let p = 92 + -175. Let y = -78 - p. Which is the closest to 1/2? (a) y (b) t (c) 4 b Let l = -2186 - -2186.5. What is the nearest to 16 in 2, l, 9? 9 Let h = 1681/16 - 39943/112. Let y = 252 + h. What is the nearest to -0.05 in y, 4, 0.2? 0.2 Let b be 1/(-3) + 8/(-672)-49. What is the closest to b in 4, 2, 0, 0.05? 0.05 Let z = 311 + -934/3. Let x = 3 - 2.7. Which is the nearest to -2/9? (a) z (b) x (c) -3 a Let d = -1.0819 + 0.0819. What is the closest to 1/5 in d, -4, 2/7, -0.18? 2/7 Let m = -12 - 0. Let b = -11.5 - m. What is the closest to 2/9 in -5, 0.4, b? 0.4 Let w(d) = -d2 + 13d - 10. Let p be w(12). Suppose -7f - p = 33. Which is the closest to -7? (a) f (b) -1 (c) 0.1 a Let p be (-74)/(-112) + ((-2046)/176)/31. Which is the nearest to 11? (a) -6 (b) p (c) 5 (d) -4 c Let r(v) = -3v - 322. Let q be r(0). Let s be 27/(-63) + (-110)/q. Which is the closest to 0.1? (a) s (b) 1/3 (c) 0.1 c Let f = 0.01 + -0.13. Let i = f - -0.02. Let j = -63/184 + 5/23. Which is the closest to 0.1? (a) j (b) i (c) -2/3 b Let r = 2.45 + -4.45. Which is the closest to r? (a) 2 (b) 0.3 (c) -0.3 (d) -0.08 c Let p = 1448 + -2895/2. What is the nearest to p in 0, -2/9, 7? 0 Let y = -3/14 - -5/7. Let d = 9 + -13. Which is the closest to y? (a) 2/13 (b) d (c) -0.4 a Let t = -1245 - -1245.3. Which is the nearest to t? (a) 5 (b) -5 (c) 8 a Let v = -152.4 + 152. Let y be (-96)/(-117) - 4/26. What is the closest to y in 2/7, v, 0? 2/7 Suppose -4x - 1 - 7 = 0. Let p = -155 + 154. Which is the nearest to x? (a) 5 (b) -5 (c) p c Let q = 0.2 + 0.1. Let h = 28 + -22. Let n = h - 4. What is the closest to -1/3 in q, n, 0? 0 Let u be -1((-3)/(-4) - 1). Let i be 3/(-6)(0/2 - 26). Suppose is = 17s + 12. What is the closest to u in s, 1, 5? 1 Let t be (-256)/238 - 4/(-4). Let y = t - 6/17. Let m = 1.4 + -1.1. What is the nearest to 1 in 2, m, y? m Let t = -34394.99 + 34950. Let v = 551 - t. Let i = v - -0.01. Which is the nearest to 5/3? (a) 0.3 (b) 1/3 (c) i b Suppose -2z - l + 6 = 0, 2l = -z + 17 - 8. Let j be (-12)/54 + 2/(-72). Which is the closest to -3? (a) z (b) -1 (c) j b Let z = 11.8 - 46.8. Which is the nearest to z? (a) 1 (b) 0.2 (c) -0.4 c Let n = -1.8 + -1.2. Let r = n + 9. Let w = -3.01 - 1.99. What is the nearest to r in w, 1/2, -3/2? 1/2 Let k = -0.07 - -0.17. Let d = -6 - -11. Let p = d + -1. Which is the closest to -2? (a) k (b) -4 (c) p b Let h = 371 + -368. Which is the closest to h? (a) 1 (b) 3 (c) 6 b Let r = 4.38 + -4.68. What is the closest to 4 in 0, -0.14, 2/5, r? 2/5 Let j(y) = -y2 + y + 3. Let g be j(2). Let n = 0.58 - 0.38. What is the nearest to n in -2, -2/7, g? -2/7 Let y = -45 - -45.1. Let q = -5 - -7. Suppose 0 = -6o + qo. What is the closest to 0 in o, -5, y? o Let q = 55.3 - 52.3. What is the nearest to q in -0.1, -4, 26? -0.1 Let g(d) = 10 + 0d*2 + 5d2 - 9 - d3 + 0d3. Let w be g(5). Let x = -11/65 + -2/65. Which is the closest to w? (a) x (b) 0 (c) -2 b Let i = 3.19 + 3.81. What is the nearest to -0.2 in i, 3, 0, 4? 0 Let m be (-152)/(-1815) + -5(-8)/(-300). Let t = m + -442/847. What is the nearest to -2 in -0.1, t, 1? t Let n = 0.26 + -0.3. Let u = 4.76 + -4.9. Let q = n - u. Which is the closest to 0? (a) 2 (b) 0.4 (c) q c Let c = 20.91 - 13.51. What is the nearest to 0 in 5, -2/7, c? -2/7 Let o = 2.17 - -1.83. Which is the nearest to 1? (a) o (b) 0 (c) 13 b Let a = -888.2 + 888. What is the nearest to 0.2 in -3, 0.14, -3/2, a? 0.14 Let d = -142.1 + 142. Which is the nearest to 2/5? (a) -0.8 (b) -0.14 (c) d c Let w = 0.394 - 0.194. What is the nearest to -6 in 0.1, 0.5, w? 0.1 Let s = -332/215 + -54/43. Let c = -11727/10 - -1175. Let v = c + s. What is the nearest to v in 0.5, -0.6, 2? -0.6 Let m = -102 - -79.1. Let d = -23 - m. Suppose 0 = -6j + 4j - 8. What is the nearest to d in j, -3, 2/15? 2/15 Let j = 152	{ "pile_set_name": "DM Mathematics" }
i2 - z + 24 wrt i. -24 Let n(f) be the second derivative of -f5/12 - 7f4/12 + 6f*2 + 4f. Let k(y) be the first derivative of n(y). What is the second derivative of k(a) wrt a? -10 Let v(c) be the second derivative of -83c6/15 - 3c*2/2 + 168c. Find the first derivative of v(q) wrt q. -664q3 Let x(n) = -8n*4 - 7n*2 - 18n - 1. Let s(c) = -8c4 - 8c*2 - 19c + 1. Let u(a) = 3s(a) - 2x(a). Find the second derivative of u(h) wrt h. -96h2 - 20 Suppose -8v = 7v. Let k(l) be the first derivative of 2l + vl2 - 1/2l*4 + 1 + 0l*3. Differentiate k(g) with respect to g. -6g*2 Let c = -12 + 17. Let z(p) be the first derivative of 0p - p*c + 2p + 1 + 1. Differentiate z(t) wrt t. -20t3 Let s(u) = 44u*3 + 20u. Let o(j) = 15j3 + 7j. Let w(a) = -3a + 9. Let y be w(4). Let p(v) = ys(v) + 8o(v). Find the second derivative of p(f) wrt f. -72f Let g = 0 - 13. Let u(v) = -7v2 - 3. Let w(d) = -14d*2 - 7. Let o(y) = gu(y) + 6w(y). Find the first derivative of o(n) wrt n. 14n Let p(q) be the first derivative of -74q5/5 - 165q - 10. Differentiate p(z) wrt z. -296z3 Let d = 12 - 7. Suppose 9 = -3s, dw - s + 3s = 9. What is the first derivative of -21c - w + 21c - 7c2 wrt c? -14c Let a = 4 - 2. Suppose -2h = l + al - 9, -3 = -l - 3h. Find the second derivative of 6i*3 - 7i*l - 5i + 3i - i3 wrt i. -12i Let f be (-4)/(-22) + 258/33. Suppose -3m + f = -u + 2m, 3m = -u + 8. What is the second derivative of 0h + 2h - 29h*2 + 27h*u wrt h? -4 Suppose 3q - 19 = -4. Find the third derivative of -29kq + 890 - 890 - 21k*2 wrt k. -1740k*2 What is the second derivative of -231a*2 + 192 - 377 - 6a + 195 wrt a? -462 Let g(w) = -w*2 + 29w - 26. Let l be g(28). What is the third derivative of -77m5 + 154m*5 - 72m*5 - 12m*l wrt m? 300m*2 Let c be ((-3)/(-1))/((-9)/(-12)). Find the third derivative of -19u*c + 19u*4 - 8u*6 + 2u*2 + 2u*2 wrt u. -960u*3 Find the second derivative of 53o*3 + 259o*3 - 15o*3 + 46o*3 + 2396o - 2391o wrt o. 2058o Let s(a) be the third derivative of 28a5/3 + 271a*3/6 + 236a*2. What is the first derivative of s(c) wrt c? 1120c What is the first derivative of 13 + 95w - 6 - 13 - 56 wrt w? 95 Let f(q) be the third derivative of 0q*4 - 13q*2 + 5/3q*3 - 47/60q*5 + 0 + 0q. Differentiate f(u) wrt u. -94u Differentiate 78f + 26f - 320 - 3f*4 + 331 + 0f - 16f with respect to f. -12f3 + 88 Let r(t) be the second derivative of t8/420 + 5t5/24 + 7t*4/2 + 38t. Let q(k) be the third derivative of r(k). Find the first derivative of q(w) wrt w. 48w2 Let f(a) be the first derivative of -19a*6/60 - 3a*3/2 + 11a*2/2 + 26. Let s(x) be the second derivative of f(x). Differentiate s(v) with respect to v. -114v2 Let w(s) be the second derivative of s7/42 - 6s5/5 - 97s*4/12 + 70s + 1. What is the third derivative of w(i) wrt i? 60i2 - 144 Let h = 45 + -42. Differentiate -28v + 12v + 5v*h - 8 + 16v wrt v. 15v2 Let k(p) = -4p*3 - 5. Let i(l) = -l + 1. Let v(o) = -8o + 29. Let b be v(4). Let z(m) = bk(m) - 15i(m). What is the second derivative of z(h) wrt h? 72h Find the third derivative of -17s*5 - 40s + 18s4 - 3s*2 + s - 39s - 13s4 wrt s. -1020s*2 + 120s What is the third derivative of -163q3 - 98q*2 - 16 + 16 + 1 wrt q? -978 Let c(z) be the second derivative of 196z*6/15 + 133z*3/2 - 279z. Find the second derivative of c(k) wrt k. 4704k2 Find the third derivative of 251y*6 - 90y*2 + 26y*6 + 307y*2 wrt y. 33240y*3 What is the first derivative of -321i + 207 + 531i - 298i wrt i? -88 Suppose 3a = 3c - 2c - 27, c - a = 35. Find the second derivative of -5d*2 + 74d*3 + 3d - cd3 + d2 - 40d*3 wrt d. -30d - 8 Let t be 41/13 + 1/((-26)/4). Find the second derivative of -31q3 - 23q*t + 505q - 514q wrt q. -324q Find the third derivative of -290c4 + 141c*4 + 1 + 2 - 29c*2 + 140c*4 + 6c*3 wrt c. -216c + 36 Differentiate -35u2 + 5u*2 - 58u*4 + 30u*2 + 170 + 2u wrt u. -232u3 + 2 Let d(t) = t3 - 7t*2 - 165t + 4. Let z(m) = m3 + m2 - 2. Let h(o) = d(o) + 2z(o). What is the second derivative of h(v) wrt v? 18v - 10 Let q(z) = 3z2 + 46z. Let m(n) = 2n2 + 45n. Let s(i) = 6m(i) - 7q(i). Find the second derivative of s(p) wrt p. -18 Let i(q) be the second derivative of q*6/15 - 127q*4/12 - 859q*3/6 - 109q + 1. Find the second derivative of i(c) wrt c. 24c2 - 254 Let z(w) = -3w - 13. Let i be z(-8). Suppose 12r - 2 = ir. Differentiate 8 - rb + 8b - b - 4b with respect to b. 1 Suppose j - 13 = -4t, 0 = -0t + 2t + 2j - 14. Let p = t + 0. Find the third derivative of -6w*6 + 41w*2 - 22w*2 - 24w*p wrt w. -720w*3 Let k(i) be the second derivative of 0i*3 - 10i + 13/12i4 + 6i*2 + 0. Find the first derivative of k(o) wrt o. 26o Let h(f) = 51f3 - 5f - 369. Let o(c) = -50c3 + 4c + 369. Let r(p) = -4h(p) - 5o(p). What is the first derivative of r(t) wrt t? 138t2 Let f(v) = 7v + 6. Let u(z) be the second derivative of -8z + 0 + 13/2z*2 + 5/2z*3. Let x(h) = -5f(h) + 2u(h). Find the first derivative of x(q) wrt q. -5 Find the third derivative of -10k*2 + 3k*3 + 469k*4 - k - 233k*4 - 235k*4 wrt k. 24k + 18 Suppose 9 = 5v + 4. Let o(s) = -s2. Let w(q) = -18q*2 + 5. Let f(h) = vw(h) - 2o(h). What is the first derivative of f(i) wrt i? -32i Let l(s) be the third derivative of -s8/84 + s6/20 - 7s4/8 + 75s*2. What is the second derivative of l(u) wrt u? -80u*3 + 36u Let k(c) be the second derivative of c*4/6 + 35c*3/6 - 2c*2 + 47c. What is the first derivative of k(g) wrt g? 4g + 35 Suppose -5 = 2f + 3t, 5 + 0 = -3f - 4t. Find the second derivative of 11w - 13w - 7w*2 + fw wrt w. -14 Let b(s) = -s - 4. Let w be (-4 - 2) + (5 - 5). Let k be b(w). What is the third derivative of -4j3 + 3j*2 - 3j*k - 3j*2 wrt j? -24 Let z be 32/(-12)9/(-12). Suppose -4j + 2n + 32 = 6n, -zj - 5n + 31 = 0. Find the third derivative of jh*4 - 5h*2 - 317 + 317 wrt h. 72h Suppose 7 = 3b - 5. What is the third derivative of -37v*2 - 36v*2 + 5v*b + 71v*2 wrt v? 120v Let v be 2/4 + (6 - 95/(-2)). Differentiate vo3 - 25o*3 + 0o*3 - 12 - 11 wrt o. 87o*2 Let z(d) be the first derivative of 11/5d*5 + 0d*3 + 13d - 20 + 0d4 + 0d*2. Differentiate z(n) with respect to n. 44n3 Let g(s) = -s3 - 4s2 + 11s - 3. Let b be g(-6). Find the second derivative of -5nb - 7n + 2n - 6n wrt n. -30n Find the third derivative of -81x*2 + 9064x - 28x5 - 9064x wrt x. -1680x2 Let o(v) = 35v*2 - 23v - 1. Let x(t) = 34t2 - 20t - 1. Let j(n) = 3o(n) - 4x(n). What is the second derivative of j(l) wrt l? -62 Let q(y) be the second derivative of 13y7/14 - 7y4/2 - y3/6 - 16y. Find the third derivative of q(g) wrt g. 2340g*2 Let c(o) be the second derivative of 155o*7/42 + 55o*3/6 + 2o - 9. What is the second derivative of c(n) wrt n? 3100n3 Let b be 444/(-4)4/((-48)/20). Find the second derivative of -185y4 - 37y*5 - y + by*4 wrt y. -740y*3 What is the second derivative of -201d*4 + 2 - 1 + 52d*4 - 7d*4 - 46d wrt d? -1872d2 Let r be (-84)/(-6) + 8/(-2). Let d be r/(-4)(-48)/20. Find the second derivative of q - q - 35q5 + dq + 30q5 wrt q. -100q*3 Let h = 192 + -767/4. Let t(q) be the first derivative of 0q - 5/2q2 + hq*4 + 3 + 0q*3. What is the second derivative of t(j) wrt j? 6j Let m(y) be the first derivative of 9y5/5 - y4/2 - 20y*3 + 74. Find the third derivative of m(x) wrt x. 216x - 12 Let w be 5 - (2 - (-2 + 2)). Suppose l + m = 5 + 5, wm + 10 = 5l. What is the second derivative of 4y + 2y - 3y - 3y*l wrt y? -60y*3 Suppose m + 0 = 2z + 2, z = -3m + 13. Let f(t) be the first derivative of 0t*3 - 7/4t*m + 7 + 0t - 3/2t2. Find the second derivative of f(b) wrt b. -42b Find the third derivative of -386l5 + 200l*2 - 55l*5 + 191l5 - l3 wrt l. -15000l2 - 6 Let q(c) be the first derivative of 29c*5/5 - 62c*3/3 - 15. What is the third derivative of q(o) wrt o? 696o Let	{ "pile_set_name": "DM Mathematics" }
-2z2 + 551z + 562. Let p(i) = 15i2 - 3860i - 3935. Let r(o) = -3p(o) - 20y(o). Determine m, given that r(m) = 0. -1, 113 Determine o, given that 815o + 2o*4 + 783o*3 - 343o - 116o2 - 805o*3 - 336 = 0. -6, 1, 2, 14 Suppose -5w = 4b - 30, -4w + 13 = 5b - 11. Suppose -13y + 28 = y. Factor 2i3 + wi*3 - yi*2 - 10i*3. -2i*2(i + 1) Determine d, given that -2d3 + 0 + 94/5d - 84/5d2 = 0. -47/5, 0, 1 Factor -2/3r*2 + 340/3 - 166/3r. -2(r - 2)(r + 85)/3 Suppose 140/3 - 4733/9m2 - 836/9m - 5m3 = 0. What is m? -105, -2/5, 2/9 Let h(i) be the second derivative of i4/120 - 89i*3/20 + 133i*2/10 - 642i + 2. Factor h(d). (d - 266)(d - 1)/10 Suppose 0 = -67f + 199 + 69. Let y(b) be the second derivative of 0 + 1/9b2 + 2/27b*3 + 1/54b*4 - fb. Factor y(v). 2(v + 1)2/9 Let d(u) be the second derivative of 0 - 23u - 1/42u4 + 3/35u*5 - 16/7u*2 - 8/7u*3 - 1/105u6. Suppose d(y) = 0. Calculate y. -1, 4 Let x(d) be the first derivative of d5/720 - d*4/48 - 7d*3/72 + 46d*2 - 45. Let m(c) be the second derivative of x(c). Factor m(v). (v - 7)(v + 1)/12 Suppose -9s - 12s + 693 = 0. Suppose 40m = 37m - 4p - 8, -5p = -2m + s. Let 3/2 + 1/2g*m + 3/4g*3 - 3/2g*2 - 5/4g = 0. What is g? -2, -3/2, 1 Let b = 36677 - 36658. Let x(t) be the first derivative of -2/3t3 - 242t + 22t2 + b. What is u in x(u) = 0? 11 Let r(f) be the second derivative of f5/60 - 11f*4/6 - 15f*3/2 + 99f*2 + 15f + 4. Let d(u) be the first derivative of r(u). What is v in d(v) = 0? -1, 45 Factor -23y2 + y3 + 7y*2 + 14 - 52 + 12y - 72y + 5y. (y - 19)(y + 1)(y + 2) Let o(l) = 25l3 - 100l*2 + 50l + 50. Let z(y) = -32y3 + 99y*2 - 48y - 49. Let t(i) = -6o(i) - 5z(i). Find k, given that t(k) = 0. -11, -1/2, 1 Solve -107/7n2 - 1/7n*4 - 156/7 + 20/7n*3 + 220/7n = 0 for n. 2, 3, 13 Solve -64/3 - 13/3y4 - 1/3y*5 - 148/3y*2 - 64/3y*3 - 160/3y = 0 for y. -4, -2, -1 Let n(d) be the second derivative of -d*6/75 + 38d*5/5 - 12159d*4/10 + 23814d*3/5 + 6310d. Find r, given that n(r) = 0. 0, 2, 189 Let u(p) = -3p3 + p2 + 31p - 69. Let f(d) = -d*3 - 3d*2 + d + 3. Let s(i) = f(i) - u(i). Factor s(x). 2(x - 3)*2(x + 4) Let y(a) be the first derivative of 0a - 4/25a*5 + 0a*2 - 8/15a*3 + 85 - 3/5a*4. Determine n so that y(n) = 0. -2, -1, 0 Let l(i) = -21i*4 - 2i*3 + 43i*2 + 63i + 34. Let b(a) = 4a4 + 2a*3 - a - 2. Let o(m) = 15b(m) + 3l(m). Factor o(p). -3(p - 12)(p + 1)2(p + 2) Let d(g) = 2g3 + 4g*2 + 3g + 5. Let o be d(3). What is u in -ou + 48 + 6u - 12u2 - 60u - 31u = 0? -16, 1/4 Let m(b) be the first derivative of -37/3b*3 + 5/24b*4 + 5/12b*5 - 38 + 25/72b*6 + 0b + 0b2. Let u(w) be the third derivative of m(w). Factor u(d). 5(5d + 1)2 Suppose 0 = 89d - 87d + f + 2, -f = -d + 2. What is w in 1/7w*5 + 0w + d - 2/7w4 + 0w*2 + 1/7w*3 = 0? 0, 1 Factor 1318707 + 20w*3 - 2262w*2 - 1713w*2 - 45w*3 + 28w*3 + 1314729w. 3(w - 663)2(w + 1) Let t(g) be the third derivative of -31g2 + 0g + 1/16g6 - 1/1344g*8 + 2/15g*5 + 0 + 0g*3 + 1/105g*7 + 11/96g*4. Factor t(r). -r(r - 11)(r + 1)3/4 Let c(y) be the second derivative of -529y*5/135 + 23y*4/27 - 2y*3/27 - 38y*2 - 72y. Let a(k) be the first derivative of c(k). Let a(s) = 0. What is s? 1/23 Let c be (-46)/(-138) - 15/(-9). Let h be (2/(272/(-10)))/((-2)/16). Factor -8/17rc - 4/17 + 2/17r*3 + hr. 2(r - 2)(r - 1)*2/17 Let x(u) = 4u*2 + 6u - 125. Let i(f) = f*2 - 4f - 1. Let w(s) = -5i(s) + x(s). Suppose w(g) = 0. What is g? 6, 20 Let n(c) = c2 - 9c - 13. Let v be n(11). Solve -3 + 51q - v + 52q + q*2 - 114q = 0 for q. -1, 12 Suppose -6i - 2j = -4i + 2, 4j + 16 = 0. Let d = 17692/3 + -5889. Factor -35/3b - 11/3b*2 - d - 1/3b*i. -(b + 1)(b + 5)*2/3 Let x(i) = -2i*5 - 23i*4 + 3i*2 + 3i + 3. Let t(m) = m*5 + 21m*4 - 2m*2 - 2m - 2. Let v(q) = -3t(q) - 2x(q). Solve v(s) = 0 for s. 0, 17 Let d(t) = -t*3 + 7t*2 - 2t - 2. Let g(f) = -164f3 - 670f*2 - 10f + 2. Let y(m) = d(m) + g(m). Factor y(q). -3q(q + 4)(55q + 1) Factor -5/3g5 - 10g*4 + 60g*3 + 0 + 0g - 200/3g2. -5g*2(g - 2)*2(g + 10)/3 Suppose 0 = -6d - 19 - 17. Let o be (-1190)/(-100) + -10 - d/10. Factor -5 + ol + 5l2 - 5/2l*3. -5(l - 2)(l - 1)(l + 1)/2 Let j be 1-2(-6)/4. Factor 36s + 66s*2 + 114s*2 + 45s*j - 108 + 8s*4 + 23s*3 + 72s. 4(s + 3)3(2s - 1) Suppose 71/3c*2 - 29/3c*3 + 0 - 14c = 0. Calculate c. 0, 1, 42/29 Let u be 3/(-1) + 1428/8. Let x = u + -35. Factor 0a*2 - 10a + 9a2 - xa*2. -2a(a + 5) Let f be ((-7310)/(-7))/(-1)(-21)/35. Let x = f - 626. Let -x - 2/7j2 - 6/7j = 0. What is j? -2, -1 Let f = 1041/80 + -157/16. Let i(k) be the first derivative of fk - 1/10k*4 + 2/15k*3 + 2k*2 + 26. Factor i(g). -2(g - 4)(g + 1)(g + 2)/5 Let i be 35/(-322)(-5 + 828/30). Let u = i + 114/23. Determine k, given that uk - 5 + 5k2 - 5/2k*3 = 0. -1, 1, 2 Let g be (-9024)/21056 + -2 + 17/7. Let l = -467/5 + 95. Factor ld - 2/5d3 + g + 6/5d*2. -2d(d - 4)(d + 1)/5 Let r be 4-1 - (15 + (-44)/2). Let v be 2 + -1(2 - 2). Determine i so that -6i - i - ri - 5iv = 0. -2, 0 Factor 6m*3 - 45520m*2 + 45562m*2 + 8 - 9m*3 + 100 - 147m. -3(m - 9)(m - 4)(m - 1) Factor s2 + 1/2s*4 - 3/2 + 5/2s - 3s3 + 1/2s5. (s - 1)3(s + 1)(s + 3)/2 Let g be 6/(-15)(-80)/9408. Let o(z) be the second derivative of 0z*2 + 3/140z*5 + 0z*3 - 1/42z*4 + 0 + 0z*6 - gz*7 - 26z. What is m in o(m) = 0? -2, 0, 1 Suppose 0 + 126l4 - 3/2l*5 - 2769l*3 - 5043/2l + 5166l2 = 0. Calculate l. 0, 1, 41 Factor -26676q*2 - 43941854268 + 4q*3 + 24695976q + 20327840q + 14626564q + 24358187q - 24707819q. 4(q - 2223)3 Let h(y) be the second derivative of y5/4 + 10y*4/3 - 95y*3/6 + 25y*2 - 1593y. Factor h(q). 5(q - 1)2(q + 10) Let c(m) be the second derivative of -25/18m3 + 131 - 1/3m*2 + 2m + 13/36m4. Factor c(o). (o - 2)(13o + 1)/3 Let j = 49 - 38. Let 20p*4 - 5p*3 + 0p*4 - 24p*5 - 8p*2 + jp*3 + 6p3 = 0. Calculate p. -2/3, 0, 1/2, 1 Let m(k) be the third derivative of k5/15 - 279k4/2 - k2 + 2951k. Factor m(x). 4x(x - 837) Factor 192535d2 - 27 + 33089d2 + d4 + 663d3 + 224676d + 27 + 286d3. d(d + 1)(d + 474)2 Let h(t) be the third derivative of t6/24 + 9t*5/2 + 775t*4/24 + 85t*3 - 2576t*2. Factor h(j). 5(j + 1)(j + 2)(j + 51) Find m such that -322m + 242/3 - 8/3m*2 = 0. -121, 1/4 Let z = -534 + 523. Let o(f) = -2f*2 - 17f + 58. Let i be o(z). Determine m so that 0 + 2/3m - im*2 = 0. 0, 2/9 Factor 1170450/19 + 3060/19h + 2/19h2. 2(h + 765)2/19 Let y(w) be the third derivative of -w9/12096 + w7/1008 + w5/12 + w*3/3 + 3w*2 - 2w. Let x(b) be the third derivative of y(b). Solve x(q) = 0. -1, 0, 1 Let i = -280007/4 - -70002. Find q, given that iq3 - 1/4q*2 - 9/4q + 9/4 = 0. -3, 1, 3 Let b(l) be the third derivative of l3 + l2 + 0 + 119/120l5 + 4/3l*4 + 5/672l*8 + 33/80l*6 + 0l + 37/420l7. Solve b(q) = 0 for q. -3, -2, -1, -2/5 Let q(j) be the first derivative of -125/4j - 34 - j*4 - 15/2j*3 - 1/20j*5 - 25j*2. What is t in q(t) = 0? -5, -1 Suppose 8y - 97y - 4y - 4y2 - 43y - 44y = 0. What is y? -45, 0 Let m(q) be the first derivative of 2q*5/65 + 97q*4/26 + 1600q*3/13 + 2304q*2/13 - 1699. Factor m(k). 2k(k + 1)(k + 48)*2/13 Let c(h) be the second derivative of 5h*4/4 - 2143h*3/2 - 1287h*2 + 7678h. Suppose c(w) = 0. Calculate w. -2/5, 429 Let w(d) = -47d2 + 538d + 70241. Let z(h) = 6h2 - h - 2. Let c(v) = 3w(v) + 24z(v). Factor c(m). 3(m + 265)*2 Let k be 5520/598 + (-3)/13. Suppose a = -2m + 2, 17 - k = 4a + m. Solve -3o + 0 + 1/2oa = 0. 0, 6 Let l(w) be the second derivative of -w4/48 + 8w*3 - 1152w*2 + 1042w. Factor l(g). -(g - 96)*2/4 Let c(a) be the first derivative of -33 - 2/15a*3 + 8/5a + 0a2. What is u in c(u) = 0? -2, 2 Let f(i) be the first derivative of i6/18 + 26i*5/15 + 22i*4/3 - 224i**	{ "pile_set_name": "DM Mathematics" }
= 8d(a) - 3n(a). Let w(b) = 5b - 1. Calculate xw(q) - 5s(q). -5q - 2 Let s(t) = 10t - 15. Let d(z) = -20z + 26. Let g(o) = -3d(o) - 5s(o). Let n(h) = -h + 1. Determine g(l) + 3n(l). 7l Let h(r) = -4r + 109. Let u(o) = 3o - 110. What is -5h(s) - 6u(s)? 2s + 115 Let a(f) = 554f - 8. Let g(z) = 38226z - 554. Give -277a(t) + 4g(t). -554t Let g(p) = 5p + 18. Let y(r) = -r - 4. Let s(q) = 2g(q) + 9y(q). Let z(a) = -a - 2. Determine -6s(m) + z(m). -7m - 2 Let l(r) = -r2 - r. Let n(w) = 5w*2 + 6w - 2. Let c(t) = -5t2 - 5t + 2. Let h(u) = 2c(u) + 3n(u). Give -h(f) - 6l(f). f2 - 2f + 2 Let v(c) = 8c. Let k = 106 - 141. Let z(w) = w. Calculate kz(m) + 5v(m). 5m Let j be (28/(-21))/(4/(-54)). Suppose 4w - j = -2. Let q(y) = -4y*2 + 13y*2 - 13y*2 - wy3 - 5. Let k(f) = -f3 - f*2 - 1. Give 3k(s) - q(s). s3 + s2 + 2 Let m(w) = w*2 - 29w + 5. Let o be m(29). Let f(r) = -r - 1. Let l(z) = -3z2 + 5z + 6. Give of(s) + l(s). -3s*2 + 1 Let j(z) = -2z*3 - 5z*2 + 3z + 6. Let s(f) = -2f3 - 6f*2 + 3f + 8. Calculate -4j(n) + 3s(n). 2n3 + 2n*2 - 3n Let v(n) = 44n2 + 3n - 9. Let j(h) = -2h2 + 2. What is -5j(y) - v(y)? -34y2 - 3y - 1 Let z = 2 + 0. Let d(k) = 0 + 0 + 2k - 1 - z. Let v(i) = -2 - 3i + 2i + 3i. Give 3d(c) - 4v(c). -2c - 1 Let x(v) = 5 - 1 - 5 - 11v. Let i(r) = 56r - 285. Let m be i(5). Let q(b) be the third derivative of 7b4/24 + b3/6 + b*2. Calculate mx(p) - 8q(p). -p - 3 Let y(t) = 9t*3 + 9t - 9. Let q(r) = 3r - 3. Let w(s) = -4s + 4. Let m(v) = -3q(v) - 2w(v). Determine -9m(o) - y(o). -9o*3 Let c(v) = 4v - 17. Let j(f) = -4f + 19. Give 4c(d) + 3j(d). 4d - 11 Let q(h) = -h - 1. Suppose 39x - 9 = 30x. Suppose 2r - 4a = x - 21, -2r = -2a + 12. Let u(s) = 5s + 2. Calculate ru(k) - 6q(k). -4k + 2 Let r(n) be the second derivative of n*4/3 + 3n*2/2 - 10n. Let o(m) be the third derivative of -m*5/15 - 2m*3/3 + 81m*2. Calculate 3o(b) + 4r(b). 4b*2 Let u(p) = p. Suppose -5g + 5 = o + 4o, o + 5g - 1 = 0. Let h be (1062/590)/(51/30 + -2). Let q(t) = 8t + 2. Calculate hu(r) + oq(r). 2r + 2 Let i(s) = -s3 - s2 + s. Let t(m) = 6m2 - 13m. Calculate 6i(j) + t(j). -6j*3 - 7j Let f(u) = -6u3 + 4u*2 + 3u. Let m(w) = -w - w*2 - 16w*3 + 13w*3 + 4w*3. Determine f(t) + 4m(t). -2t3 - t Let w(i) = 608i*3 - 128. Let t(k) = -29k*3 + 6. Give 64t(q) + 3w(q). -32q3 Let i(o) = -o + 2. Let g(z) be the third derivative of z4/12 - z*3/3 + 5z*2 - 6z. Determine -4g(k) - 3i(k). -5k + 2 Let a(o) = -6o - 6. Let r be (-39)/12 + (-5)/(-20). Let j(k) = -2k + 4. Let u(i) = 3i - 7. Let s(w) = -10j(w) - 6u(w). Determine ra(p) - 8s(p). 2p + 2 Let y(z) = 4z + 2. Let t = -3 + 1. Let x(d) = -13d - 7. Suppose -k + 5a = -197, -a = -2k - 5a + 366. Let i = 180 - k. What is iy(j) + tx(j)? -2j Let v(x) = x3 + x2 + x + 1. Let s(t) = -9t3 + t2 + 4t + 2. Give s(o) - 4v(o). -13o3 - 3o*2 - 2 Let t(d) = 58d + 8. Let b(y) = -39y - 5. Calculate 8b(u) + 5t(u). -22u Let n(u) = 8u3 + 12u*2 + 12u. Let j(r) = 8r3 + 15r*2 + 13r. Calculate 5j(y) - 6n(y). -8y3 + 3y*2 - 7y Let s(l) = l*3 + 4l*2 + 2l + 4. Let a be 0(3 - (-7)/(-2)). Let z be (a + (-1 - 3))1. Let c(v) = -2v3 - 7v*2 - 4v - 7. Determine zc(b) - 7s(b). b*3 + 2b Let i(u) = -u - 1. Let l(k) = k*2 + 6k + 4. Let w(h) = 2h3 - 11h*2 - 7h. Suppose 0j = -2j + 12. Let a be w(j). Calculate ai(b) - l(b). -b2 + 2 Let a(o) = 7o*2 - 7o - 16. Let s(p) = -3p2 + 3p + 7. What is -4a(b) - 9s(b)? -b*2 + b + 1 Let f(v) = -15v*3 + 3v. Let y(l) = 12l3 - 8l + 9. Let p(i) = 13i3 - 6i + 6. Let r(m) = -3p(m) + 2y(m). Determine 2f(x) - 3r(x). 15x3 Let l(v) = 4v + 1. Suppose 2q + 4n = 34, -4n = -4q + 29 - 9. Let u(b) = 302b + 300b - 586b + 4. Determine ql(z) - 2u(z). 4z + 1 Let h(f) = 312f + 143. Suppose -d - 5s = -s + 159, -2d = -s + 282. Let p(c) = 13c + 6. What is dp(t) + 6h(t)? 13t Let r(b) = -9b + 4. Let k(u) be the first derivative of -13u2 + 11u - 142. Calculate -4k(j) + 11r(j). 5j Let s(j) = -8j*2 - 25j - 3. Let q(b) = b*2 + 3b + 1. Determine -5q(x) - s(x). 3x*2 + 10x - 2 Let w(q) = -17q2 + 5q - 10. Let s(h) = 29h2 - 7h + 15. Let u(v) = 5s(v) + 8w(v). Let j(m) = 9m2 + 6m - 6. What is -5j(r) + 6u(r)? 9r2 Let g(a) be the first derivative of a3/3 - 2a - 22. Let h(w) = -w*2 - 2w + 5. Let j be h(-3). Let y(x) = -3. Calculate jy(m) - 3g(m). -3m2 Suppose 95 = 8b + 31. Let t be (b - 11) + 20 + -3. Let k(s) = 2s + 2. Let f(m) = 5m + 5. Calculate tk(a) - 6f(a). -2a - 2 Suppose 4u = 22u - 126. Let k(w) = -2w + 8. Let l(m) = -2m + 7. Calculate ul(f) - 6k(f). -2f + 1 Let a(j) be the first derivative of -3j4/4 - j3/3 + 3j*2/2 + 2j + 94. Let n(k) = -9k3 - 3k*2 + 8k + 6. Calculate 8a(m) - 3n(m). 3m3 + m2 - 2 Let y(i) = 4i3 + 11. Let n = -9 + 3. Let k(r) = r3 + 3. Let p be -33(-5 - -4)/((-21)/(-14)). What is ny(t) + pk(t)? -2t*3 Let i(t) = -2t*2 - 9t + 5. Let k(p) = 2 - 4 - 2p2 + 3p*2 + 3p. Let j = -145 + 148. Calculate ji(m) + 8k(m). 2m2 - 3m - 1 Let l(z) = -z*3 - 5z. Let v(s) = -s*2 + 2s + 5. Let f be v(4). Suppose -37 + 109 = -2y. Let p be f/2(-24)/y. Let o(r) = -r. Give pl(u) + 6o(u). u3 - u Let s(m) be the first derivative of m4/4 + m*3/3 - 3m + 271. Let r(t) = -2t3 + 2. Give 3r(q) + 2s(q). -4q*3 + 2q*2 Let w(k) = -5k*2 - 57k - 29. Let d be w(-11). Let i(x) = 11 + 5x + 4x + x - x. Let a(p) = -8p - 10. Calculate da(c) - 6i(c). 2c + 4 Suppose 4o - 6 = -3c + 3o, -c + 2 = -o. Let k(l) = -3 + 0 + c + 4. Let v(h) = h - 10. Determine -7k(w) - 2v(w). -2w - 1 Let z(v) = -33v3 + 5v. Let g(i) = -i. Give -3g(j) - z(j). 33j*3 - 2j Let v(r) = 64 - 7r + 10r - 64. Let l(b) be the third derivative of -7b4/24 + b2. Calculate -3l(n) - 6v(n). 3n Suppose 25b - 2d = 20b + 33, 5b - 34 = d. Let k(n) = 5n2 + 5n. Let a(z) = -4z2 - 4z. Determine ba(u) + 6k(u). 2u2 + 2u Let d = 375 + -372. Let k(z) = -z*2 - 3z + 3. Let m(l) = -l*2 - 4l + 3. Give dk(x) - 2m(x). -x*2 - x + 3 Let n(w) = -10w - 115. Let q(l) = -5l - 58. What is -3n(i) + 5q(i)? 5i + 55 Let m(s) = 2s2 - 13s + 1. Let g(n) = -1. What is -2g(a) + m(a)? 2a*2 - 13a + 3 Let l(q) = -17q3 - 890q*2. Let v(h) = -5h*3 - 297h*2. Give 2l(j) - 7v(j). j3 + 299j*2 Let g(y) = 81y + 3. Let c(h) = 41h + 2. Determine -5c(z) + 3g(z). 38z - 1 Let y(q) = 732 - 732 + 0q2 + 3q*3 - 5q + 7q2. Let j(l) = -2l*3 - 6l*2 + 4l. Give -7j(s) - 6y(s). -4s3 + 2s Let i(d) = 4d - 3d - 5 - d2 + 4 + d3. Let o = -1 - -5. Let y(l) = -4l3 + l2 - ol*2 + 1 + 6l*2 - 2l. Give -2i(b) - y(b). 2b3 - b2 + 1 Let o be (-1)/(-2) - 12/(-8). Suppose 0 = 4i - 9i + u - 29, 5i + ou + 17 = 0. Let g(c) = -1. Let p(b) = b*2 + 4. Give ig(a) - p(a). -a*2 + 1 Let l(n) = 3n*2 + 14n + 3. Let t(m) = -5m2 - 21m - 5. Calculate -8l(f) - 5t(f). f*2 - 7f + 1 Let t(z) = z*2 - 7z - 5. Let o be (12/(-2) + -1)-1. Let n(s) = s2 + 1. Let g(f) = -3f*2 + 6f + 2. Let m(b) = g(b) + 2n(b). Calculate om(a) + 6t(a). -a2 - 2 Let r(y) = 2y*2 + 2y + 2. Let l(x) = x*2 + x + 1. Let f(u) = -l(u) + r(u). Let b(k) = -4k*2 - 7k - 8. Suppose w - 5w = 24. Give wf(g) - b(g). -2g2 + g + 2 Let t(x) = 2x*2 - x + 4. Let o(q) = -2q*2 - 3. What is 4o(p) + 5t(p)? 2p*2 - 5p + 8 Let i(h) = 2h2 - 19h - 184. Let k be i(-6). Let n(x) = -2x2 + 2x - 4. Let a(v) = 1. What is ka(z) + n(z)? -2z*2 + 2z - 2 Let b(z) = -z*3 - 19z*2 - 3z - 13. Let r(v) = -5v2 - v - 1. Calculate b(w) - 3r(w). -w*3 - 4w*2 - 10 Let z(k) = -9k*3 + 11k2. Let i(w) = w2 + 10w - 3. Let s be i(-11). Let c(t) = 6t*3 - 7t*2. Calculate sc(q) + 5z(q). 3q3 - q2 Let m be 0 + 1 + 5 - 1. Let w(s) = 4s. Let n(z) = 4z - 5. Let x(c) = 6c - 2 - 1 - 4c. Let l(f) = -3n(f) + 5x(f). Determine ml(j) + 2w(j). -2j Let b(t) = 5t*2 - 3t + 8. Let g(f) = -3f2 + 4f - 9. Determine -4b(p) - 3g(p). -11p*2 - 5 Let o(q) = 212	{ "pile_set_name": "DM Mathematics" }
302 - 34/21. Let w = -55/434 + i. Which is the nearest to 21? (a) w (b) d (c) 3 c Let v = 312 - 310. Which is the nearest to -1? (a) -0.4 (b) v (c) -7 a Let s(t) = -t*3 - 2t + 1. Let p be s(1). Let x be 13 + (-5 - p)/(6/(-4)). Let z be (3 + (-66)/18)/(2/x). Which is the closest to -1? (a) 1/4 (b) 0.3 (c) z a Let g = 2.4 + 2.6. Let t = -4 + g. Let m be (1/3)/((-4)/120-5). What is the nearest to m in t, 5, -0.1? t Let b = -0.13 + -4.87. Let r = -0.988 + 0.656. Let q = r + 0.632. What is the nearest to 0.1 in b, q, -1/5? q Suppose -13y + 6y + 413 = 0. Let w = y + -60. Let x(c) = -c2 + 10c + 8. Let k be x(11). What is the nearest to w in -0.5, 0.4, k? -0.5 Let g be ((32/60)/(-4))/((-14)/42). Which is the nearest to -0.69? (a) -2/5 (b) -12 (c) g a Let d = 15836 - 15837. Let v = 6.9 - 7. Which is the nearest to 3? (a) v (b) d (c) 3 c Let w = 3194 - 3195. Let r = 1/6 - 0. Which is the nearest to w? (a) 2 (b) 0.3 (c) r c Let h = -23637/47270 + 1/23635. What is the nearest to -2 in 2, 20, h, 4? h Suppose 93f - 149f = 189f - 245. What is the nearest to 0.2 in -1/8, 2/11, f? 2/11 Suppose 2d + 52d = 11d. Which is the nearest to 3/4? (a) -0.2 (b) 45 (c) d c Suppose 5k + 12 + 8 = -3w, 20 = 4w. Let r be (((-28)/(-35))/4)/((-4)/5). What is the nearest to 1 in k, -0.1, r? -0.1 Let w be 308/(-357)-4 + 4/(-34). Let g = 0.09 - -0.02. Let y = 0.21 - g. What is the nearest to -0.1 in w, -1/4, y? -1/4 Let m be 351/(-51) + 2 - 2/17. Which is the nearest to 0.1? (a) -6 (b) m (c) 5 c Let c be (-5)/(-610)(-4)/5. Let v = c - 12497/1220. Let n = 10 + v. What is the closest to -14 in 0.1, n, -1? -1 Let r be ((-9)/(-6))/(135/(-10) + 8). What is the closest to r in -3/5, -1, 0.13, 4/7? -3/5 Let w = -17.006 - -529.006. Which is the closest to -0.08? (a) -0.5 (b) w (c) -4 a Let i = -125 - -124. Suppose l = 6l + 15. Which is the nearest to 0? (a) l (b) 5 (c) i c Let f be ((-8)/(-14))/((-770)/(-385)). Let i be (-1)/(6/(-21)) - 2. Let x = -0.2 + 0. What is the nearest to x in i, -0.1, f? -0.1 Let v = -2268.97 + 2269. Which is the closest to 0.4? (a) v (b) -0.3 (c) -0.5 (d) -9 a Let l = 17 + -25. Let s = 355 + -359. Let p = 18 - 17.7. Which is the closest to l? (a) 2/5 (b) s (c) p b Let p = -0.056 + -24.244. Let y = -22.3 - p. Let o = 9 + -11. What is the closest to -0.1 in o, 1, y? 1 Let f be 2/((76/(-4))/(-19)). Which is the closest to f? (a) 1/4 (b) -5/2 (c) 0.2 a Let d = 206.52 + -206. Let v = -27.52 + d. What is the closest to 2 in -1, v, -4? -1 Let h = -610.6 + 610.3. Which is the nearest to h? (a) 0.2 (b) 1 (c) 0.5 (d) -3 a Let d be (-7)/(-5) + (252/(-105))/(-4). Which is the closest to -1/2? (a) 0.3 (b) d (c) 2/27 c Let l be 3 - (-4 + (-13)/(-2)). Let h = -180 - -179.6. Which is the closest to -1? (a) l (b) 0.23 (c) h c Let z = 1882 - 1863. Let q be (-76)/(-66) - (-6)/993. Which is the nearest to z? (a) 4 (b) 0.4 (c) q a Let t = -7.5 + 7.48. Suppose 0 = 2o - 5z - 33 - 39, -3o - z = -142. Let h = o + -48. What is the nearest to t in 2, -3, h? h Let h = 20 - 18. Let f be (-24)/4 + h + 2. Let w = 4 + -35/9. What is the closest to 2/3 in f, w, 0.1? w Let y = -76.8 - -77. Let j be (13/39)/((-1)/(-181)). Let i = -60 + j. What is the nearest to y in -1/5, -7, i? i Let r = -328 - -331.216. Let o = -0.116 + r. What is the nearest to -2/7 in o, 2/11, 2/15? 2/15 Let q(t) = -t - 11. Let y be q(-4). Let p(x) = x*2 + 4x + 8. Let i be p(y). Let o = -32 + i. Which is the closest to 0? (a) o (b) 0 (c) 4 b Let i = 56075/7 + -8011. What is the nearest to -13 in -3/5, -4/3, -5, i? -5 Let v = 56.72 + -54. Let a = v + -2.62. What is the closest to a in -0.5, -0.2, -0.03? -0.03 Let s = 0.5 - 0.3. Let f = -153.9 + 154.2. What is the nearest to -0.3 in 1, f, s? s Let i(q) = -q*2 - 7q + 7. Suppose 13c - 17c = 32. Let v be i(c). Let d be (v/4 + -1)/(2/(-8)). What is the nearest to -1/3 in -8, d, -3? -3 Let q be (-13)/(-156)-45 - (-2)/(-8). Which is the nearest to 2? (a) -0.1 (b) -1 (c) q (d) 0.2 d Let y = -6598 + 6600. What is the nearest to -2/5 in -2/17, y, 0, -1/9? -2/17 Let k = -7.639 - -7.6. Let v = -45.039 - k. Let u = 45.2 + v. What is the nearest to -1/3 in u, 0.1, 1? 0.1 Let g = 0.24545 + -0.25865. What is the closest to g in 2/11, 2/7, 1/9? 1/9 Let z(p) = 2p + p*2 - 4p*3 + 6p3 + p2 + 0p3 + 8. Let o be z(-2). What is the closest to 9/14 in -5, o, -3? -3 Let t = -1.9162 + 1.9762. What is the nearest to 0.31 in -7, -3/4, t, -2/11? t Let b be 21 + 1869/(-63) + 9. What is the nearest to b in 3, 2/3, 172? 2/3 Let k = -4803 + 4804. What is the closest to k in -2, -1, -4? -1 Let z = 20729 - 20728.6. Which is the nearest to z? (a) 2 (b) -11.3 (c) -4 (d) -0.5 d Let v(n) = n2 + 6n - 4. Let x be v(-6). Let o = -3.8 - -4. Let r = -566638.89 + 566639. Which is the closest to -1? (a) r (b) x (c) o a Let j be (-9)/60 - (-4)/10. Let l be (144/(-54))/((-680)/(-34)). What is the closest to 0.3 in -7, j, l? j Let r = -103.5113 + -0.4987. Let v = r + 104. What is the nearest to v in -0.5, 0.5, -4? -0.5 Let t = 2.22 + -1.92. Let u be (-3 + 5)/(-1 + -1). What is the closest to 2 in u, 1/3, t? 1/3 Let z = 5687 + -5686.913. What is the nearest to -0.03 in 0.2, -0.3, z, -1/4? z Let o = -0.1 - -0.2. Let g = 1413 + -1416. Suppose -v - 5q - 1 - 16 = 0, 0 = 4q + 16. Which is the nearest to o? (a) v (b) 2 (c) g b Let u = 1.349 - 1.44. Let l = u - -65.091. Let p = l + -65.1. Which is the nearest to p? (a) 3 (b) 0.2 (c) 1/13 c Suppose 2z - 1 + 5 = 0. Let s = 2171/7 + -310. Let y = 1.7 - -0.3. What is the closest to -2/3 in s, z, y? s Suppose 4c = 3h + 68, -4h - 33c - 79 = -36c. What is the closest to h in -0.3, -4, 4/3? -4 Let y = -2409 - -2405. What is the nearest to 0 in 19, y, -5, -0.1? -0.1 Let q = 0.5 - 0.1. Suppose 0 = -5f - 40g + 35g + 30, 0 = 2g + 2. Suppose fy - 12y - j = 2, 0 = -3y + j - 6. What is the closest to y in 2/11, q, 7? 2/11 Let g = 0.6 + -1. Let m be (8/(-20))/(4564/760 - 6). Let i = m + 77. What is the closest to -4 in 0.3, i, g? g Let m = -0.31 - -100.31. Let f = m - 192. Let r = f + 92.09. Which is the nearest to r? (a) 3 (b) -4/3 (c) -2 b Let n = -286 + 268. Let x be 8/n + 368/504. What is the closest to x in 1, -0.3, 0.5? 0.5 Let s = 394.2 - 393.3. Which is the closest to 1? (a) s (b) -0.1 (c) -1 (d) -2 a Let o = -3370.9 + 3371. What is the nearest to -19 in 0, 0.4, o? 0 Let u be 0/(-6) + (7/(-6) - (-1)/6). Which is the nearest to u? (a) 4/5 (b) -0.4 (c) -2 (d) 6 b Let o be (-5)/(60/(-9)) + 32812/(-80). Let m = o + 408. What is the closest to -1 in m, 3/5, -3? m Let f be (-2)/(-4) + 1/2. Let q be -18(-20)/(-1260)-14. Which is the nearest to f? (a) -1/177 (b) -1/5 (c) q a Let n be 2 - ((-3)/2 + 2). Let x = 17 + -4. Suppose 0 = -3h - x + 16. Which is the closest to -1/3? (a) h (b) 0.5 (c) n b Let y = -638 + 637. What is the nearest to 0.01 in -0.3, y, 0.09, 5? 0.09 Let u = -1.2 - -1. Let w = 20947 - 146627/7. What is the nearest to -0.1 in u, 3, w? u Let x = 6809 - 6848. Which is the closest to x? (a) -0.2 (b) -2 (c) 1/2 (d) 0.3 b Let g = 10.655 + -15.294. Let d = g - -0.039. Let v = d - -0.6. What is the nearest to v in -0.1, 0.5, -1/7? -1/7 Let l = 30.09 - 0.09. Let j be (-30)/(-9) + ((-136)/(-340) - 19/(-15)). Which is the closest to 0.1? (a) j (b) l (c) -2 c Let v be (2/18)/((-6)/(-72)). Let m = -3.3 + 1.3. What is the closest to 12 in v, -5, m? v Let v be (-2 + 1)/(5 + 2). Let n = -4958 - -4958.3. Which is the nearest to 1/4? (a) -19 (b) v (c) n c Let a = -0.04908 + -2.95092. What is the closest to -10/3 in a, -3/5, 5, -2/5? a Let j = -57 + 5. Let b = 50.127 - 0.127. Let c = j + b. What is the closest to -1 in -1/4, 5, c? -1/4 Let r = 63194 + -189584/3. Let o = -0.06 - -0.46. Which is the nearest to r? (a) -18/7 (b) 1 (c) o c Let x = -2011/8 + 251. Let j = 38.17 + -39. Let q = -0.63 - j. Which is the nearest to -1/3? (a) -1 (b) x (c) q b Let u = 2.37 + -2.433. Let n = -0.563 - u. Suppose f + 2 + 3 = -2l, 3f + 3*l = -9. Which is the closest to 0? (a) f (b) -0.4 (c) n b Let r = -37449 - -37447. What is the closest to -637 in r, -0.3, 2? r Let v(k) = -k - 26. Let f be v(-18). Let m be 1/f - (-255)/120. Which is the clos	{ "pile_set_name": "DM Mathematics" }
dyp? 1/126 Four letters picked without replacement from {i: 11, f: 5}. Give prob of sequence iifi. 165/1456 What is prob of sequence fmf when three letters picked without replacement from {f: 19, m: 1}? 1/20 Two letters picked without replacement from ulullllluulllululll. Give prob of sequence lu. 13/57 What is prob of sequence pgp when three letters picked without replacement from ggpppgppgpgpppgpppp? 52/323 What is prob of sequence qq when two letters picked without replacement from lllqqlllqlqllqllql? 5/51 Calculate prob of sequence ba when two letters picked without replacement from {v: 6, a: 1, z: 3, q: 3, b: 2}. 1/105 Calculate prob of sequence la when two letters picked without replacement from gggflgaffff. 1/110 Three letters picked without replacement from {h: 11, u: 5}. Give prob of sequence uhh. 55/336 What is prob of sequence zs when two letters picked without replacement from qzqviqzqzqvzsssq? 1/20 Two letters picked without replacement from iiiiiiiiii. What is prob of sequence ii? 1 Four letters picked without replacement from vdvvqqvqvpqq. What is prob of sequence vqqd? 5/594 What is prob of sequence ssts when four letters picked without replacement from {r: 3, n: 1, s: 12, e: 2, t: 1}? 55/3876 Four letters picked without replacement from qoososqs. What is prob of sequence oosq? 3/140 Four letters picked without replacement from zaqqza. Give prob of sequence zqaa. 1/45 Three letters picked without replacement from zzzzxzzzzzzz. Give prob of sequence zxz. 1/12 Four letters picked without replacement from rtmai. Give prob of sequence mira. 1/120 Two letters picked without replacement from {d: 2, i: 6}. What is prob of sequence id? 3/14 Calculate prob of sequence cn when two letters picked without replacement from nngukuc. 1/21 What is prob of sequence uv when two letters picked without replacement from {v: 1, u: 1, e: 2, n: 1}? 1/20 Calculate prob of sequence tnpp when four letters picked without replacement from {n: 1, t: 4, z: 4, p: 2, j: 3}. 1/3003 What is prob of sequence jjjj when four letters picked without replacement from {j: 11, u: 3}? 30/91 What is prob of sequence www when three letters picked without replacement from rewweweewwewwerwewww? 11/76 Four letters picked without replacement from bxwxbwnnnnw. Give prob of sequence bxbn. 1/495 What is prob of sequence xg when two letters picked without replacement from xxxxxxxxxgxxxxx? 1/15 Two letters picked without replacement from {m: 1, k: 8, r: 5, t: 4}. Give prob of sequence tm. 2/153 Three letters picked without replacement from lllaaaalalaall. What is prob of sequence lll? 5/52 What is prob of sequence dggd when four letters picked without replacement from {d: 2, f: 5, g: 6}? 1/286 What is prob of sequence hv when two letters picked without replacement from sddhvdnssvhs? 1/33 What is prob of sequence ztj when three letters picked without replacement from {a: 1, j: 4, t: 1, b: 2, z: 2}? 1/90 Two letters picked without replacement from qqqqaqbqqbahqqbqba. What is prob of sequence bb? 2/51 What is prob of sequence bgtg when four letters picked without replacement from {b: 3, t: 4, g: 2, a: 1}? 1/210 Calculate prob of sequence pbpb when four letters picked without replacement from bjpbpbbbpjpbppp. 1/26 Two letters picked without replacement from {s: 1, q: 2, c: 1}. Give prob of sequence sc. 1/12 Two letters picked without replacement from ssooblwwsssslulss. Give prob of sequence wo. 1/68 What is prob of sequence zz when two letters picked without replacement from iiizizziiz? 2/15 Three letters picked without replacement from wodlwll. What is prob of sequence odw? 1/105 What is prob of sequence hr when two letters picked without replacement from {g: 1, r: 1, u: 2, h: 3}? 1/14 What is prob of sequence mz when two letters picked without replacement from {z: 3, m: 2, k: 12}? 3/136 What is prob of sequence kqgn when four letters picked without replacement from qgkfn? 1/120 Calculate prob of sequence mdy when three letters picked without replacement from dmy. 1/6 Calculate prob of sequence vvvv when four letters picked without replacement from vvvvv. 1 Calculate prob of sequence il when two letters picked without replacement from {l: 3, i: 1}. 1/4 Two letters picked without replacement from ppggppggqgqpppg. Give prob of sequence qp. 1/15 Three letters picked without replacement from {h: 2, g: 6, b: 2, c: 3, r: 1}. What is prob of sequence gbh? 1/91 Four letters picked without replacement from {y: 2, d: 1, i: 9, h: 7}. What is prob of sequence hdyi? 7/5168 What is prob of sequence kk when two letters picked without replacement from {k: 3, v: 1, u: 2, e: 1, d: 4, s: 4}? 1/35 Calculate prob of sequence xxx when three letters picked without replacement from eexexeeeex. 1/120 Calculate prob of sequence no when two letters picked without replacement from znznnnnnnnozzzz. 4/105 Three letters picked without replacement from vmmwymwmkmgwmkgmmmm. What is prob of sequence mkk? 10/2907 Four letters picked without replacement from tbttbbtt. Give prob of sequence bbbt. 1/56 Two letters picked without replacement from puxbuaubxx. What is prob of sequence bu? 1/15 Four letters picked without replacement from gggvvgvggggggggg. What is prob of sequence gggv? 33/280 What is prob of sequence vq when two letters picked without replacement from {o: 7, q: 8, v: 1, s: 1}? 1/34 Four letters picked without replacement from aaadaddaddadddda. Give prob of sequence dada. 9/130 Two letters picked without replacement from sossossss. Give prob of sequence so. 7/36 Calculate prob of sequence cac when three letters picked without replacement from aaaaaccccaca. 7/66 Three letters picked without replacement from {z: 2, c: 2, h: 1}. Give prob of sequence czc. 1/15 Two letters picked without replacement from ocuhuocchhchochcu. What is prob of sequence uc? 9/136 Three letters picked without replacement from {h: 2, i: 1, v: 1, e: 1}. What is prob of sequence ihh? 1/30 Two letters picked without replacement from cmczzzzzcczzzczcczzc. Give prob of sequence zc. 22/95 Two letters picked without replacement from {x: 2, i: 5}. Give prob of sequence xx. 1/21 Calculate prob of sequence kt when two letters picked without replacement from kttkt. 3/10 Calculate prob of sequence oh when two letters picked without replacement from {r: 4, o: 10, h: 2}. 1/12 Two letters picked without replacement from {n: 2, c: 2, p: 11}. What is prob of sequence cp? 11/105 Calculate prob of sequence qq when two letters picked without replacement from ggqggqg. 1/21 Calculate prob of sequence ao when two letters picked without replacement from {z: 2, a: 1, q: 2, o: 1}. 1/30 Calculate prob of sequence yeey when four letters picked without replacement from eeeeeyeyeee. 1/55 What is prob of sequence ayrr when four letters picked without replacement from rryttrvytat? 1/660 What is prob of sequence dkxu when four letters picked without replacement from {k: 3, f: 1, u: 2, d: 5, x: 6}? 3/952 What is prob of sequence vt when two letters picked without replacement from tueevuuutt? 1/30 What is prob of sequence sas when three letters picked without replacement from {s: 2, a: 1}? 1/3 What is prob of sequence yxxm when four letters picked without replacement from {m: 4, x: 8, y: 2}? 8/429 What is prob of sequence aaaa when four letters picked without replacement from aaazzaaaaaazazaaaa? 1001/3060 Two letters picked without replacement from {l: 8, f: 5, t: 2, j: 2}. What is prob of sequence jt? 1/68 What is prob of sequence sw when two letters picked without replacement from wssw? 1/3 Two letters picked without replacement from kyykkynkyyyyy. Give prob of sequence yk. 8/39 What is prob of sequence zz when two letters picked without replacement from sdssdszddzzszss? 2/35 What is prob of sequence ddum when four letters picked without replacement from {u: 11, d: 7, m: 2}? 77/9690 Two letters picked without replacement from uwkuuuuuwngggu. What is prob of sequence gw? 3/91 Three letters picked without replacement from {w: 9, r: 1, u: 1, y: 5}. What is prob of sequence yyy? 1/56 What is prob of sequence xxh when three letters picked without replacement from {h: 4, g: 3, b: 3, x: 3}? 2/143 Calculate prob of sequence bl when two letters picked without replacement fr	{ "pile_set_name": "DM Mathematics" }
nits digit of 163283? 3 What is the hundred thousands digit of 24208729? 2 What is the hundred thousands digit of 6281391? 2 What is the millions digit of 8639246? 8 What is the hundreds digit of 267477? 4 What is the thousands digit of 606623? 6 What is the hundreds digit of 14590653? 6 What is the hundred thousands digit of 721494? 7 What is the hundreds digit of 15228887? 8 What is the millions digit of 2374569? 2 What is the hundred thousands digit of 19317381? 3 What is the tens digit of 273692? 9 What is the tens digit of 12532027? 2 What is the ten thousands digit of 1806582? 0 What is the ten thousands digit of 85547? 8 What is the hundreds digit of 6217311? 3 What is the thousands digit of 87663? 7 What is the units digit of 598149? 9 What is the millions digit of 5674168? 5 What is the thousands digit of 17020? 7 What is the thousands digit of 1845649? 5 What is the units digit of 6267056? 6 What is the hundreds digit of 7862161? 1 What is the hundred thousands digit of 3160245? 1 What is the tens digit of 3680577? 7 What is the ten thousands digit of 493934? 9 What is the hundred thousands digit of 658996? 6 What is the ten thousands digit of 184165? 8 What is the thousands digit of 24049019? 9 What is the ten thousands digit of 23541838? 4 What is the thousands digit of 149419? 9 What is the units digit of 194253? 3 What is the units digit of 485218? 8 What is the hundred thousands digit of 7856182? 8 What is the ten millions digit of 11643164? 1 What is the ten thousands digit of 10241072? 4 What is the ten thousands digit of 7026005? 2 What is the hundred thousands digit of 19901142? 9 What is the ten thousands digit of 80172? 8 What is the thousands digit of 2901468? 1 What is the units digit of 1665577? 7 What is the hundreds digit of 4658918? 9 What is the hundreds digit of 163558? 5 What is the units digit of 297167? 7 What is the thousands digit of 685144? 5 What is the hundred thousands digit of 166602? 1 What is the hundreds digit of 341290? 2 What is the tens digit of 287406? 0 What is the units digit of 3662044? 4 What is the hundred thousands digit of 251977? 2 What is the thousands digit of 1277772? 7 What is the hundred thousands digit of 2129047? 1 What is the hundreds digit of 362804? 8 What is the tens digit of 1501382? 8 What is the hundreds digit of 331570? 5 What is the tens digit of 10380152? 5 What is the ten thousands digit of 24296169? 9 What is the hundreds digit of 815864? 8 What is the millions digit of 2377793? 2 What is the millions digit of 3306590? 3 What is the thousands digit of 31780710? 0 What is the tens digit of 4217467? 6 What is the units digit of 4142367? 7 What is the units digit of 3439275? 5 What is the tens digit of 999341? 4 What is the tens digit of 173263? 6 What is the hundred thousands digit of 18660156? 6 What is the ten thousands digit of 1732383? 3 What is the thousands digit of 1612545? 2 What is the thousands digit of 144262? 4 What is the hundreds digit of 126821? 8 What is the hundreds digit of 1308481? 4 What is the hundred thousands digit of 25722603? 7 What is the ten thousands digit of 10093607? 9 What is the thousands digit of 612763? 2 What is the units digit of 90848? 8 What is the millions digit of 1634914? 1 What is the millions digit of 1236493? 1 What is the tens digit of 1079918? 1 What is the units digit of 188042? 2 What is the hundred thousands digit of 8192240? 1 What is the hundred thousands digit of 100025? 1 What is the millions digit of 38616168? 8 What is the hundred thousands digit of 443304? 4 What is the tens digit of 31957781? 8 What is the ten thousands digit of 150786? 5 What is the ten thousands digit of 2657352? 5 What is the thousands digit of 445090? 5 What is the units digit of 6306379? 9 What is the ten thousands digit of 340614? 4 What is the hundreds digit of 216427? 4 What is the thousands digit of 486160? 6 What is the millions digit of 11188844? 1 What is the hundreds digit of 213936? 9 What is the hundreds digit of 23075? 0 What is the hundred thousands digit of 3640139? 6 What is the units digit of 90396? 6 What is the thousands digit of 10997339? 7 What is the tens digit of 1528201? 0 What is the tens digit of 13030719? 1 What is the ten thousands digit of 439934? 3 What is the tens digit of 1670348? 4 What is the units digit of 116677? 7 What is the tens digit of 100542? 4 What is the millions digit of 1638261? 1 What is the tens digit of 541258? 5 What is the hundreds digit of 22558531? 5 What is the hundreds digit of 2732054? 0 What is the units digit of 9467254? 4 What is the thousands digit of 635783? 5 What is the units digit of 2125454? 4 What is the hundreds digit of 2891382? 3 What is the hundreds digit of 194128? 1 What is the thousands digit of 3196794? 6 What is the ten thousands digit of 1739350? 3 What is the units digit of 749430? 0 What is the hundred thousands digit of 249078? 2 What is the hundred thousands digit of 698572? 6 What is the hundred thousands digit of 257764? 2 What is the hundred thousands digit of 7248789? 2 What is the hundred thousands digit of 387212? 3 What is the hundred thousands digit of 134339? 1 What is the millions digit of 6680731? 6 What is the hundreds digit of 22781? 7 What is the hundreds digit of 314639? 6 What is the hundreds digit of 4374928? 9 What is the units digit of 53936? 6 What is the ten thousands digit of 877332? 7 What is the ten thousands digit of 90106? 9 What is the hundred thousands digit of 178068? 1 What is the units digit of 4905640? 0 What is the hundred thousands digit of 108751? 1 What is the hundred thousands digit of 1199820? 1 What is the hundred thousands digit of 1855927? 8 What is the ten thousands digit of 122409? 2 What is the hundreds digit of 25449229? 2 What is the thousands digit of 6819526? 9 What is the thousands digit of 3283050? 3 What is the hundreds digit of 2376689? 6 What is the ten thousands digit of 10604? 1 What is the thousands digit of 7698567? 8 What is the hundreds digit of 3062266? 2 What is the units digit of 224835? 5 What is the hundreds digit of 2057573? 5 What is the thousands digit of 662008? 2 What is the tens digit of 16393518? 1 What is the hundreds digit of 4708012? 0 What is the millions digit of 18325232? 8 What is the hundreds digit of 635250? 2 What is the units digit of 880043? 3 What is the units digit of 14195010? 0 What is the units digit of 11331018? 8 What is the units digit of 1356177? 7 What is the ten thousands digit of 70894? 7 What is the units digit of 1993131? 1 What is the ten thousands digit of 256405? 5 What is the hundred thousands digit of 6283168? 2 What is the tens digit of 2333055? 5 What is the thousands digit of 8477469? 7 What is the ten thousands digit of 258943? 5 What is the ten thousands digit of 330534? 3 What is the units digit of 100429? 9 What is the hundreds digit of 287467? 4 What is the hundred thousands digit of 1627105? 6 What is the millions digit of 1756267? 1 What is the units digit of 319293? 3 What is the hundreds digit of 156897? 8 What is the hundred thousands digit of 7912714? 9 What is the millions digit of 1725897? 1 What is the hundreds digit of 4969433? 4 What is the thousands digit of 57505? 7 What is the hundreds digit of 3131746? 7 What is the ten thousands digit of 2184312? 8 What is the thousands digit of 792028? 2 What is the ten thousands digit of 423228? 2 What is the hundreds digit of 534039? 0 What is the thousands digit of 2754137? 4 What is the tens digit of 2806072? 7 What is the ten thousands digit of 583347? 8 What is the millions digit of 4851890? 4 What is the tens digit of 461487? 8 What is the ten thousands digit of 207535? 0 What is the ten thousands digit of 570972? 7 What is the tens digit of 4672456? 5 What is the hundred thousands digit of 1160329? 1 What is the hundred thousands digit of 154490? 1 What is the millions digit of 1759557? 1 What is the ten thousands digit of 6040861? 4 What is the thousands digit of 948557? 8 What is the ten millions digit of 17152498? 1 What is the hundred thousands digit of 7308310? 3 What is the millions digit of 6996005? 6 What is the units digit of 2883196? 6 What is the hundred thousands digit of 3229008? 2 What	{ "pile_set_name": "DM Mathematics" }
Give b(s). 1 Let r(y) be the first derivative of y*6/120 + 2y5/15 + y4/24 + y*3/6 + 6y*2 + 5. Let k(d) be the second derivative of r(d). Determine k(-8). -7 Let n(x) = 326x*2 - 643x*2 + 326x2 - x. Calculate n(1). 8 Let w(k) = k3 - 6k2 + 5k. Let i be (-3)/(-1)-1663/18. Let j = 88 + i. Calculate w(j). 0 Let s(h) = -12 + 12h + 12. Suppose 13u - 21 = -8. Determine s(u). 12 Suppose -4q = -37 - 15. Suppose 3l - 10 = -2l. Let z(v) = -7v - v*2 + 7 + qv + lv2. Calculate z(-5). 2 Let s(q) = 3q*2 - 5q*2 + 1 + 0q*3 - 6q3. Let t = -44 + 45. Calculate s(t). -7 Let l = -43 - -43. Let p(f) = f3 + f*2 + f - 2. Calculate p(l). -2 Let r(a) = 2a*3 + 3a*2 + a - 2. Let l(o) = o + 8. Suppose 0z = -3z - 36. Let f be l(z). Let k be (6/(-4))/((-3)/f). Calculate r(k). -8 Let f(h) be the first derivative of -h3/3 - 3h*2 + 221. Suppose 5i + 25 = 0, j + 5i + 12 = 3i. Let v be j/((-2)/(-3))2. Determine f(v). 0 Let x be (-10)/7 + ((-6)/14)/(-1). Let p(s) = -s. Determine p(x). 1 Suppose j = -5j. Suppose 2y - 5y + 3 = j. Let a(z) = 13z2 + 2z - 1. What is a(y)? 14 Let a(y) = 5y + 50. Let n(f) = 3f + 25. Let p(s) = 6a(s) - 11n(s). Calculate p(9). -2 Let s be (-9)/3(-4 - -3)4. Let a(v) = -v*2 + 15v - 39. What is a(s)? -3 Let b(w) = -w3 + w2 + 13. Suppose 34r - 39r = 0. Give b(r). 13 Let i(j) = -2j2 + 1 + 2j + 3j2 + 4j. Suppose 5l - 30 = -5q, 0q + q = -5l + 26. Suppose lp - 25 = 10p. Give i(p). -4 Let f(z) = -2z - 7z*3 + 1 + 2z*2 - 4z2 + z2 - 2. Suppose 0 = -2t - 3 - 5. Let m be 27/(-21) - t/14. What is f(m)? 7 Let x(z) = 2z*2 + 15z - 14. Let p(w) = -w*2 - 8w + 7. Let k(s) = -11p(s) - 6x(s). Suppose 0 = -3b, 11b - 13b = -v - 5. What is k(v)? -8 Let p(n) be the second derivative of 1/2n*2 - 1/3n*3 + 0 + n. Suppose 5k - 1 = 2g + 11, 4g + 12 = 4k. Determine p(g). 3 Suppose 2v = -3m + 2 + 14, -5m + 5v = 15. Let z(w) = w - 8w*3 + 2w*3 - mw*2 - 2w3. Let b be -1 + (0 - 6/(-3)). What is z(b)? -9 Let a(b) = -b3 + 7b2 + 8b - 11. Let i be -5 - (-17 - -3)/2. Let v(g) = -3g + 14. Let d be v(i). Give a(d). -11 Let h(d) = -d + 13. Let u be h(6). Let p(l) = 2l + 1. Let k(b) = -12b + 4. Let c(t) = -k(t) - 5p(t). Calculate c(u). 5 Suppose 16 = 5o - 28b + 22b, 0 = -2o - 4b. Let t(x) = 3x + 2x - 3x. Calculate t(o). 4 Let w(o) = -o*2 - 2o - 5. Suppose 5z - 2 = -2u + 8, -3u = -4z + 8. Suppose 2q + 3v + 8 = u, 4v = v. Give w(q). -13 Let m(o) be the first derivative of o4/12 - o2/2 - o + 1. Let d(w) be the first derivative of m(w). Suppose 0 = 3g - 7g. Calculate d(g). -1 Let a(j) = 3j + 5. Let c(s) = -3s2 + 4s - 3. Let g be c(1). Let x(u) = -3u - 5. Let k(d) = gx(d) - 3a(d). Give k(-4). 7 Let y(a) = -a3 + 3a + 2. Suppose 0 = 7v - 2v + 10. Calculate y(v). 4 Let m(x) = -x*3 - 6x*2 + 7x + 7. Let d be m(-7). Let c(q) = -5q - 3 - 6q*3 + dq3 - 5 + q2 + 4. Let r = -5 + 2. Give c(r). -7 Let x(j) be the third derivative of -j9/60480 + j8/5040 + j7/1260 - j6/360 + j*5/6 + 11j*2. Let z(v) be the third derivative of x(v). What is z(5)? -7 Let t(q) = -q - 6. Let z be ((-23)/(-5) - 5)/(1/(-5)). Suppose 5j + 31 = -zp, 3 = -3p + 2j - 15. Determine t(p). 2 Suppose -10a = -24a - 154. Let g(y) = y + 8. What is g(a)? -3 Let x = -4 - -11. Let l(q) = -q2 + 8q. Give l(x). 7 Let c(k) = -k*2 + 3k - 1. Let n(a) = -a*3 + 4a*2 + 12a + 2. Let o be n(5). Suppose 7t - o = -2. Calculate c(t). -11 Suppose -396v = -402v - 114. Let q(r) = -r - 31. What is q(v)? -12 Let x(v) = -v + 9. Let z = -460 + 455. Determine x(z). 14 Suppose -8u - 2 = -9u. Let g(l) = -l2 + 4l - 1. Let s be g(2). Let n(w) = -sw2 + 2 + 2w*2 + 0w + 0wu + 6w. Determine n(5). 7 Suppose 2v + 10 = -3v, -20 = 2p + 5v. Let g be 2 - (-1)/(p/20). Let l(i) = 4i2 + i - 2. Calculate l(g). 12 Let s(k) be the third derivative of -7k*4/24 + 2k*3/3 - 206k*2. Calculate s(4). -24 Let v(f) = 38f2 + 1. Let q(c) = c3 - 9c2 + 6c + 15. Let y be q(8). Give v(y). 39 Let n(f) = 13. Let v(m) = -7m + 9. Let z(g) = 2n(g) - v(g). Calculate z(-8). -39 Let k(f) be the second derivative of 1/2f3 + 1/2f*2 + 0 - 2f. Determine k(-2). -5 Let d(n) = n. Let u(s) = 4s + 1. Let q(r) = -6d(r) + u(r). Calculate q(3). -5 Let i = -26 - -28. Let o(a) = -2 + a*3 - 1 - 4a + 1 - 5ai. What is o(6)? 10 Let w = -5 - -6. Let n(j) = 3 + 0j + 2j - w - 3. Suppose -3 = d - 5. What is n(d)? 3 Let u(q) be the second derivative of q4/4 - q3 - q2 - 25q. Let p(x) = -4x2 + 6x + 3. Let a(z) = 2p(z) + 3u(z). Calculate a(6). 0 Let k(q) = -2q3 - q2. Let s be 1/(6 + -4)-2. Let x(c) = 11c2 + 1. Let b be x(s). Let l = -13 + b. Calculate k(l). 1 Suppose 4c - 134 = -2u, -3c = 3u - 0c - 195. Suppose 0 = -10i - u + 23. Let f(d) = d2 + 5d. Give f(i). -4 Let d(b) be the second derivative of -b*4/6 + 23b*3/3 + 23b*2 - 84b - 3. Determine d(24). -2 Suppose -5d = -4d. Let c(u) = -3u + 8u + du - u. Determine c(1). 4 Let y = 836 + -833. Let i(c) = c3 - 2c*2 - 6c + 7. What is i(y)? -2 Let i(g) = -370g + 3g*2 + 4 + 383g - 4g2. Calculate i(13). 4 Let m(q) = 4q + 3. Let a(y) = -3y + 1 + 2y - y*2 + y + 2y. Suppose 5z - 9z - 4 = 0. Let j be a(z). What is m(j)? -5 Let a(p) = -p2 + p - 7. Let b(y) = -y2 - 7 + 0y2 + y + 1. Let m(k) = 5a(k) - 6b(k). Suppose 7 = w - 2t - 4, -4t = -w + 19. What is m(w)? 7 Suppose 0 = -2u + 4 - 10, 4u = -5k + 118. Suppose 4p - 5o + 11 = -k, p + o = 2. Let t(g) = -g*2 + 3g + 2. Give t(p). -16 Let c(w) be the third derivative of -14w2 - 1/60w*5 - 1/6w*3 - 1/3w*4 + 0w + 0. What is c(-8)? -1 Let n(h) be the first derivative of 7h4/4 - 7h*3/3 + 5h*2/2 + 21h + 16. Let b(i) = -3i3 + 4i*2 - 2i - 10. Let k(a) = -5b(a) - 2n(a). Give k(6). 8 Let z(w) = 15w + 9. Let d be z(-5). Let h = 73 + d. Let n(r) = -r - 8. Give n(h). -15 Let x(r) be the first derivative of r3/3 - r2/2 - 2r - 57. Determine x(-2). 4 Let f(h) = h*3 + 2h - 3h + 150h*2 - 3 + 2 - 138h2. What is f(-12)? 11 Let q(p) = p2 - p - 9. Let t be q(-3). Let o(h) = 2h3 - 8h*2 + 7h + 2. Let l(n) = -3n3 + 9n*2 - 7n - 1. Let g(u) = tl(u) + 4o(u). What is g(-6)? -1 Let i(n) be the second derivative of -1/2n2 + 7/6n*3 + 1/20n*5 + 0 + 3/4n*4 + 4n. Let y be i(-8). Let v(b) = -b + 10. What is v(y)? 3 Let x be 6/4(-40)/(-12). Let l(h) = -3 - 7h + 31h2 - 29h*2 + 5. Give l(x). 17 Let r(j) = j + 4. Let w = -97 - -98. Suppose -o = -2c - w, -5o - 9 = 16. Determine r(c). 1 Let v(s) be the second derivative of 0 - 1/60s*5 + 0s*4 - 5s + 5/6s3 + 0s2. Let w(i) be the second derivative of v(i). Give w(2). -4 Let f = -742 + 746. Let l(w) = w3 - 6w2 + w - 5. Let z(u) = -u3 + 5u*2 + 5. Let j(x) = 2l(x) + 3z(x). Calculate j(f). -3 Let t(k) = 6 - 2k + 3k - 14k2 - 6. Let x(f) = f2 - 4. Let g be x(-2). Suppose -3p - 3j - 15 = g, 3p + j + 0 + 7 = 0. What is t(p)? -15 Let d(a) = -a3 - a2 - a + 4. Let o(q) = q2 - 4q - 32. Let p be o(-4). Determine d(p). 4 Let l(g) = 6g3 + 20g - 18g3 + 10g*3 + 1 - 16g - 2g2 + 3. Calculate l(-2). 4 Let g = -21 - -13. Let k(v) = 26v - 6. Let w(t) = -174t + 38. Let i(u) = 20k(u) + 3w(u). What is i(g)? 10 Suppose -7p + 45 = 10. Suppose pa = -2a. Let k(n) be the third derivative of -n5/60 - n4/24 + n3/2 - n2. Determine k(a). 3 Let f = 639 + -638. Let r(u) be the first derivative of 8u2 - u + 1. Determine r(f). 15 Let p(k) = k3 + 6k*2 + 5k + 3. Let z be (2/4)/(4/608). Suppose 9s = 5s - z. Let u = s - -16. Calculate p(u). 15 Let s(g) be the first derivative of -g7/840 + g6/45 - 7g5/120 + 5g4/24 - g3/3 - 10. Let z(u) be the third derivative of s(u). Determine z(7). 5 Let i = -3 + 8. Let g(v) = 1. Let f(w) = 3w + 5. Let p(s) = f(s) - 6g(s). Let m(y) = -5y + 2. Let q(a) = im(a) + 8p(a). What is q(-5)? 7 Let o(f) = -f3 + 2f*2 - f + 4. Let j be o(0). Let b be -2 + j + (4 - 3). Suppose 0 = -bc + 4c. Let a(v) = -v - 5. Calculate a(c). -5 Let a(g) = g + 20. Suppose r + 6 = -2y, y - 12 = -0r + 2r. Calculate a(r). 14 Let t be -13 - 5/(15/(-9)). Let f = 12 + t. Suppos	{ "pile_set_name": "DM Mathematics" }
vided by 25. 13 What is the remainder when 374 is divided by ((-11)/(495/1152))/(8/(-20))? 54 Suppose 3r = 5g - 238, 4718g - 4723g + 216 = -r. Suppose -4h = h - 35. Calculate the remainder when g is divided by h. 6 Calculate the remainder when (2452/7)/1 + (216/28 - 8) is divided by 168. 14 Let g(x) = 64x3 - x2 - 5x + 1. Let c be g(-2). Let o = 557 + c. Calculate the remainder when o is divided by 16. 4 Suppose -45 = -6i + 51. Let s = -24 + i. Let m(v) = -2v - 4. Calculate the remainder when 31 is divided by m(s). 7 Let g be ((-10)/3)/((-2)/3). Let z be (5/(245/84))/((-12)/(-56)). Suppose -gv - 30 = -zv. Calculate the remainder when 12 is divided by v. 2 Suppose 0 = -199y + 401y - 204y + 272. What is the remainder when 184 is divided by y? 48 Let t = -83 - -134. Suppose 75o + t = 78o. Calculate the remainder when 21 is divided by o. 4 Let f(p) = 2p2 + 17p - 5. Let a be f(-9). Calculate the remainder when 233 is divided by (-445)/(-10) - (30/a)/(-3). 45 Suppose -5u + 1594 = 3b, -4b + 2158 = -499u + 501u. Calculate the remainder when b is divided by 138. 129 Let z(h) = 15h*2 + 12h + 5. Let g be z(-4). Suppose 423 = 20q - g. What is the remainder when 185 is divided by q? 30 Let r(q) = -74q + 1. Let p be r(-1). Suppose 4h = 25 + p. What is the remainder when 299 is divided by h? 24 Let m = -320 - 189. Let h = -331 - m. Calculate the remainder when h is divided by 30. 28 Suppose 9h + 247 = 724. Suppose 3d = -r + h, 0d = -4d + 4. What is the remainder when r is divided by -43/(-36)51? 16 Let i be (-12)/(-14) + 27/(-7) + 5. Suppose 5f = 4p + 44 + 6, -f + ip = -4. What is the remainder when 67 is divided by f? 11 Suppose -2n + 1925 = 5q - 3n, 3q + 2n = 1142. Calculate the remainder when q is divided by (-35)/20(-9 + (-30)/(-6)). 6 Let q = 12592 + -12411. Calculate the remainder when q is divided by 19. 10 Let d(i) = 8i2 - 2. Suppose -3h + 3t = -8h - 5, -5 = -5h - t. Let s be d(h). Suppose -2k + 132 + s = 0. Calculate the remainder when k is divided by 14. 11 Let d(p) = p*3 + 56p*2 + 149p - 127. Calculate the remainder when d(-53) is divided by 86. 59 Suppose -87v = 135v - 11544. What is the remainder when 389 is divided by v? 25 Let q = -283 - -295. Let i(l) = -l*3 + 13l*2 - 18l + 85. Calculate the remainder when 48 is divided by i(q). 9 Let l(c) be the second derivative of 4c3/3 + 41c*2 + 89c. What is the remainder when 34/4(-6)/(-1) is divided by l(-8)? 15 Let i(t) = 26t + 5. Let g(r) = -5r - 1. Let a(q) = -11g(q) - 2i(q). Let k be a(0). What is the remainder when (-3 + k)(-548)/8 is divided by 35? 32 Let d be 2 + (-4 - -65) + 4/2. Calculate the remainder when d + (-15)/93 is divided by 7. 4 Let f = -49 + 62. Suppose -10a = -fa + 12. Suppose -113 = -ag - n, -12 = 3g - 5n - 68. Calculate the remainder when 132 is divided by g. 24 Let i be 44/(-10) - 4/(-10). Suppose -106q - 239q + 4830 = 0. Calculate the remainder when q is divided by 7 - (i/(-2) - 0). 4 Let v(w) = -3w - 3w + w*2 + 24 + 0w + 4w2. Let i be v(6). Suppose -b = 4y - 42, -b + i = 3b + y. What is the remainder when b is divided by 11? 9 Let t(z) = z2 + 2z + 4. Let j be t(-2). Suppose -2o + 162 = jo. Let n(c) = -c*2 + 6c - 3. What is the remainder when o is divided by n(3)? 3 Let n(f) = 94f2 + 1872f - 23. Let q(u) = 12u - 4. Calculate the remainder when n(-20) is divided by q(2). 17 Let n = 112 - 161. Let v = -16 - n. Calculate the remainder when 1/(-1) - (-131)/22 is divided by v. 31 What is the remainder when (10488/190)/(8/120) is divided by 210? 198 Suppose -3i + 329 = -307. Calculate the remainder when i is divided by 109. 103 What is the remainder when 37173 is divided by (-408)/(-54) + (-20)/990-22? 5 Suppose -c - 2b = 3b - 55, 0 = c - 5b - 25. What is the remainder when c is divided by ((-53)/4 - -13)-28? 5 Suppose 108 = -522v + 525v. What is the remainder when 1223 is divided by v? 35 Let q = 1996 + -1924. Calculate the remainder when q is divided by 24. 0 Let d(n) = -18n2 - 8n + 22 - 40 + 25 - n*3. What is the remainder when d(-18) is divided by 5? 1 What is the remainder when 37/((-6828)/(-504) + -12 - 3/2) is divided by 46? 41 Calculate the remainder when (-36080)/(-492)469/24 is divided by 38. 11 Let a = 5083 + -706. Calculate the remainder when a is divided by 12. 9 Let v(x) = 10x*2 + 79x + 548. Calculate the remainder when v(-7) is divided by 121. 1 Calculate the remainder when (-8 - (577 - -7))(3 + -4) is divided by 292. 8 Suppose 107g - 4959 = 98g. What is the remainder when g/87 - (-2)/(-6) is divided by 5? 1 Let z be 154/10 + -10 + (-3)/(-5). Calculate the remainder when 285 is divided by (z/(-7))/((-16)/336). 15 Let a(t) = -11t*3 - t. Suppose -2l = 97l - 479l + 44840. Calculate the remainder when l is divided by a(-1). 10 Let s(r) = -r*2 - 12r - 11. Let h be s(-11). Suppose h = j + 416 - 421. What is the remainder when 9 is divided by j? 4 Suppose 392x - 386x = 2076. Suppose -5l - 59 = -i, 5i + 53l - 49l - 179 = 0. Calculate the remainder when x is divided by i. 34 Let f(o) be the second derivative of -23o5/5 - o4/12 - o3/6 - o2/2 - o. Calculate the remainder when f(-1) is divided by 48((-4)/(-9) + 108/486). 27 Suppose -4v = 136 - 276. Let y = -94 + 134. Let f = y - v. Calculate the remainder when 7 is divided by f. 2 What is the remainder when (560/(-15))/7(-66)/4 is divided by (-60)/(-18)(3 + -12)-1? 28 Let j(l) = -l*2 + 3l - 3. Let y be j(2). Calculate the remainder when ((-4)/2)/(-67 - 38709/(-578)) is divided by (2 + -25 + -1)/y. 20 Calculate the remainder when 505 + (-11 - 2) + 4 is divided by 247. 2 Let o = 474 + -388. Let p = -66 - -86. What is the remainder when o is divided by p? 6 Suppose 129 - 3 = 7f. Suppose -3 - 24 = -a. Calculate the remainder when a is divided by f. 9 Suppose -7c + 4c = -78. Let q(k) = -15 + ck + 27k - 60k. What is the remainder when q(-10) is divided by 19? 17 Suppose 11 = 4q + 3m - 66, 5q - 2m = 125. Let z be 20/(-6)(-4 + 11/5). Suppose t = -a + z, -2a - 9 = -t + 6. What is the remainder when q is divided by t? 5 Let i(o) = 52o - 1. Let d = -165 - -166. What is the remainder when i(d) is divided by 7? 2 Let s = 4976 - 4950. What is the remainder when 73 is divided by s? 21 Let x be 10/(-20)(-3 + 3). Let l = -6 + 8. Suppose x = -3z - z + ln + 378, 0 = -3z - 2n + 301. Calculate the remainder when z is divided by 25. 22 Let z(f) = 7f3 + 54f*2 - 51f - 228. Calculate the remainder when -1 + -1 - (-105)/1 is divided by z(-8). 51 What is the remainder when 9308(-80)/(-64) is divided by 131? 130 Suppose -79 = -4c - 23. Let k be (-7)/c + 1362/(-4). Let r = -127 - k. Calculate the remainder when r is divided by 31. 28 Calculate the remainder when 4996 is divided by ((-8715)/(25 - 4))/((-2)/8). 16 Let d(t) = -2t + 14. Let w(z) = 10z + z2 - 3z + 8z + 4z + 3. Calculate the remainder when w(-22) is divided by d(0). 13 Let u(p) = -p*3 - 6p*2 - p + 3. Suppose 24 + 54 = -13c. Calculate the remainder when 44 is divided by u(c). 8 Let o(k) = 27k + 1190. Suppose 2j = 5b - 12, 5b - 15 = j + 4j. Suppose bf - 36 - 6 = 0. Calculate the remainder when o(-42) is divided by f. 14 Let n = -8249 + 8454. What is the remainder when 207 is divided by n? 2 Let j = -2597 - -3010. Calculate the remainder when j is divided by 138. 137 Let k be 111/(-18)23. Let t = 163 + k. Suppose 2w + 2w - 3f = t, 4 = -2f. Calculate the remainder when w is divided by 8. 6 Suppose -28t = 115 + 249. Let v(r) = 2r*2 + 15r + 46. What is the remainder when v(t) is divided by 67? 55 Let z be ((-162)/(-5))/(1/5). Suppose -5t = t - z. Let h(l) = -11l - 163. What is the remainder when h(-24) is divided by t? 20 Let w(n) = n*3 - 12n*2 + 70n - 353. Calculate the remainder when w(9) is divided by 154/8 + 1/(-4). 15 Calculate the remainder when 429 is divided by (-54)/36 - (-2)/(-5)255/(-12). 2 What is the remainder when 2 - 3/(-1)39 is divided by (-12)/(-22) - 10032/(-242)? 35 Suppose -11 = -s + 3. Let g = s - -11. Let d(r) = -2r3 - 5r*2 + 7r + 7. Calculate the remainder when d(-5) is divided by g. 22 What is the remainder when 643 is divided by (-63)/6*(500/(-15))/25?	{ "pile_set_name": "DM Mathematics" }
+ 26884 = -83348 - 6008. List the prime factors of p. 2, 1453 Let j be (((-72)/(-10))/(-3))/((-3)/75). Suppose -58s = -js + 308. List the prime factors of s. 2, 7, 11 Suppose -100 + 562 = -7b. Let h = b - -214. Suppose 3d - 5d = -h. List the prime factors of d. 2, 37 Let s = 648 - 1161. Let z = 834 + s. List the prime factors of z. 3, 107 Suppose -4 = -2x + i, 24i + 2 = -2x + 28i. Suppose 3a - y = 1873, 2a - xy = 895 + 349. List the prime factors of a. 5 Let t be -4 + (4 - -3) + -2. Suppose f + 5h = t, -4f + f - h = 11. Let r = f - -24. What are the prime factors of r? 2, 5 Let k(r) = -13r2 + r + 561. Let i(c) = 26c*2 - 2c - 1123. Let z(s) = -4i(s) - 7k(s). What are the prime factors of z(0)? 5, 113 Suppose 2b + b - 8 = -2k, 0 = 5b - 4k - 28. Suppose 0 = 3g - i - 628, -2g + bi - 400 = -4g. Suppose 5n - g = -38. List the prime factors of n. 2, 17 Suppose -2n + 5x = -13 - 8, 5n + 2x - 9 = 0. Let c = n - -1. Suppose -4s + k = -2k - 941, -4s = ck - 976. What are the prime factors of s? 239 Let i = 800 - 552. Let s be 132/142688/144. Let v = i - s. What are the prime factors of v? 2, 3 Let j(k) = -350k + 984. What are the prime factors of j(-6)? 2, 3, 257 Let k = 470 + -449. List the prime factors of (35/k - 1) + 904/3. 2, 151 Let z(q) = 2q*2 + 18q + 28. Suppose -30 = -8b + 2b. Suppose -4m = bp + 52, 3p = 5p - 4m + 32. What are the prime factors of z(p)? 2, 5 Let o be (-10)/4(-7 - (-54)/10). Suppose 2x + 4 = ow, -2x + 4w - 2 = -x. List the prime factors of (-28)/16 - x/(-8) - -48. 2, 23 Let g be -3(-4 - 10/(-3)). Suppose -4t + 10 = 5i, gi - 4t - 2 = i. Suppose -io + 220 = 48. List the prime factors of o. 2, 43 Let x(j) = 26j - 4. Let i be (8/(-3))/((50/(-45))/5). Suppose -22k - i = -26k. List the prime factors of x(k). 2, 37 Let i = -55 - -53. Let u be (188/(-12)3)/(i/4). Let f = 193 - u. List the prime factors of f. 3, 11 Suppose 3g + 7g - 12628 = 6g. What are the prime factors of g? 7, 11, 41 Let u(x) be the third derivative of x6/120 + 9x*5/20 + 11x*4/8 + 68x*3/3 - 62x*2 - 2x. List the prime factors of u(-25). 3, 11, 17 List the prime factors of 59094/10 - (-15)/25. 2, 3, 5, 197 Let l(o) = 13o + 16. Let r(p) = -7p - 9. Let j(h) = -4l(h) - 7r(h). Let i be j(-11). List the prime factors of i/(-8) - 31/(-1). 3 Let o = 329 - 275. Suppose 1134 = 10t + o. What are the prime factors of t? 2, 3 Let q(m) = -6 + 3 - 3 + 10m. Let b be q(5). Let f = 106 - b. What are the prime factors of f? 2, 31 Suppose -2425h - 144291 = -2446h. What are the prime factors of h? 6871 Let j = 47 - 40. Let a(k) = 2k. Let v be a(j). Suppose vm - 68 = 12m. What are the prime factors of m? 2, 17 Suppose -15 = -9g + 6g. Suppose t - g = 206. Suppose 4h = -l + 49, 4l + 3h = -l + t. List the prime factors of l. 41 Suppose 4w - 118883 = -3s, w - s = 47422 - 17710. List the prime factors of w. 29717 Let a be 153/27 - 2/(-6). Let h(k) = k*3 - 5k*2 - 6k + 3. Let o be h(a). Suppose -f + s + 83 = 6s, of - 265 = s. What are the prime factors of f? 2, 11 Let r = -34 - -60. Let g be 8/24 + r/(-6). What are the prime factors of (-15)/(-5)67 + g? 197 Suppose -2225k + 2240k - 19140 = 0. List the prime factors of k. 2, 11, 29 Suppose -2w - 244 = 4d, -43 - 76 = w + d. Let i = w + 121. Suppose v + 77 = 5f, 5f + 4v - 62 = i. What are the prime factors of f? 3, 5 Let l = 603 + 177. Suppose s = -g + 256, g + 10 = -3s + l. What are the prime factors of s? 257 Let c(q) = -5 - 6 + 3 + 214q + 429q. What are the prime factors of c(1)? 5, 127 Let p(s) be the third derivative of s5/20 - s4/12 - 7s*3/6 - 32s*2. Suppose 12 = -3h + 5r + 1, 6 = -2h + 4r. What are the prime factors of p(h)? 2, 7, 11 Suppose 51c - 53c - 4186 = q, 0 = -4q - c - 16758. Let o = -2228 - q. List the prime factors of o. 2, 3, 109 Let a(b) = 1 - 3b - 3b - 7 - b*2. Let i be a(-4). Suppose z = -im - 0z + 148, -2m + 156 = -z. What are the prime factors of m? 2, 19 Suppose -2s - 10 = 2p, -6p + 3p - 2s - 13 = 0. Let t be 70/30 - 2/p. Suppose 5o = to + 240. What are the prime factors of o? 2, 3, 5 Let s(v) = -v2 + 23v - 9. Let j(u) = u*3 - 3u*2 + 3u - 9. Let q be j(3). Suppose qd - 3 = 3d, 62 = 5n - 2d. List the prime factors of s(n). 3, 41 Suppose -3262v + 24676 = -3258v. List the prime factors of v. 31, 199 Suppose 52f - 46f - 18 = 0. Suppose -fr + 2075 = -5k, -4r - 4k + 0k + 2756 = 0. What are the prime factors of r? 2, 3, 5, 23 Let r = 184 - 164. Suppose -1871 = -rg + 14789. What are the prime factors of g? 7, 17 Suppose -2r - 2m - 30 = 0, -3r + 33 = -5r - 3m. List the prime factors of 1/(r/(-2829)) + 4/16. 2, 59 Suppose 5f = -n + 15, -2f + 2n = 4n + 2. Suppose d - fd = -12. Let m(y) = 5y3 - 7y*2 + 6y - 4. List the prime factors of m(d). 2, 3, 19 Suppose -i + 7i = 18. List the prime factors of (-3 + 2)(i - 3) + 89. 89 Suppose 2m - 2w - 2 = 0, 2 = 2m - 2w - 2w. Let r(v) = -m + 6v - 4v + 14 + 0. What are the prime factors of r(-5)? 3 List the prime factors of (7 + (-51)/9)(21020 - (1 + -2)). 2, 7, 11, 13 Let d(z) = -18z - 27. Let h be d(-3). Let j(g) = 11g - 94. What are the prime factors of j(h)? 7, 29 Suppose -231y = -226y - 2675. Suppose y = 3r + 3b - 5b, 713 = 4r - 3b. List the prime factors of r. 179 Suppose -341n + 7067643 + 3198234 - 104077 = 0. What are the prime factors of n? 2, 5, 149 Let g(d) = -d*3 + 3d*2 + d - 7. Let m be g(2). Let c be 4/(14/6 + m). What are the prime factors of (6 - (c - 0))/1? 3 Let v = -50 + 187. Suppose 5d - v - 303 = 0. List the prime factors of d. 2, 11 List the prime factors of 459/36596/3. 17, 149 Let b = 13466 + -6846. What are the prime factors of b? 2, 5, 331 Suppose 28 = 5z + 8. Let n(r) = 27r3 + 3r*2 + 18. Let p(f) = -33f*3 - 4f*2 - f - 20. Let t(u) = -6n(u) - 5p(u). What are the prime factors of t(z)? 2, 59 Let z(x) = -5020x - 3786. What are the prime factors of z(-7)? 2, 61, 257 Suppose -78w + 83w = 6990. Let z = w - 851. What are the prime factors of z? 547 Suppose 2a - 44340 = -2h, -18a - 66503 = -21a + 4h. What are the prime factors of a? 7, 3167 Let f(k) = -169k*2 + 43k - 4. Let q be f(3). What are the prime factors of (-1 + q)/(10/(-10))? 11, 127 Let x be (-6)/4 + (-8 - (-11046)/(-12)). Let m = -306 - x. What are the prime factors of m? 2, 3, 13 Let l = -5451 - -18142. List the prime factors of l. 7, 37 Suppose 7r + 600 = 15r. Let z = 143 - r. Suppose 0 = 4t + 20, -3u + 3t + z = -742. List the prime factors of u. 5, 53 Let w be 3/2(-2)/(-3). Suppose 0 = r + p + 12, -7 + w = 3r - 3p. Let s = r + 10. List the prime factors of s. 3 Let t = 32155 + -17519. What are the prime factors of t? 2, 3659 Let g(l) = 6l + 61. Let o be g(0). Suppose 0 = -4s - 3c - 0c + 95, 2s - 3c = o. Let j = s - -62. List the prime factors of j. 2, 11 Let u(y) = -10y3 - 21y*2 - 62y - 128. List the prime factors of u(-13). 71, 269 Let n = -13 - 14. Let o = 37 + n. Suppose 0 = -r + o + 119. What are the prime factors of r? 3, 43 Let v = 163 + -186. List the prime factors of 5 + -4 + 3 - v34. 2, 3, 131 Let i(j) = -j3 - 8j*2 + 11j - 12. Let x be i(-9). Let w = x + 29. What are the prime factors of (w - (-24)/(-3))-1? 3 What are the prime factors of (-48426)/8(-4912)/1842? 2, 7, 1153 Let z = -35850 + 61658. What are the prime factors of z? 2, 1613 Let j(x) = -27x - 13x*2 - 29 + 28x*2 - 6x*2. What are the prime factors of j(-7)? 601 Let q be (0/6)/6 + 0. Suppose q = -3t - g + 1152, 4t - 1615 + 79 = 3g. What are the prime factors of t? 2, 3 Suppose 0 = -5q, 3p + 35q - 39q = 10020. List the prime factors of p. 2, 5, 167 Suppose 189 = 26t - 5t. Let m = 71 - t. What are the prime factors of m? 2, 31 Let y = 32151 + -16176. What are the prime factors of y? 3, 5, 71 Let q(i) = 3i2 + 30i - 50. Let p(z) = z*2 + 10z - 17. Let l(y) = 8p(y) - 3q(y). Let f be l(-11). What are the prime factors of (63/(-12))/(f/(-28))? 7 Let f(g) = 10002g2 - 96g - 318. What are the prime factors of f(-3)? 2, 3, 7499 Let w = -18506 - -20087. List the prime factors of w. 3, 17, 31 Suppose -18o - 82524 = -41o. Let b = 11 + -3. Suppose bf - o = -5f. List the prime factor	{ "pile_set_name": "DM Mathematics" }
east common multiple of -12 - 1(-21 + (-3 - -11)) and (115/(-2) - r)-2? 113 Suppose -5b = -b + 60. What is the lowest common multiple of ((-1)/2)/((-2)/96) and 30/(-12) + 2 + b/(-2)? 168 Let j = 5592 + 7133. Let z be 3 + (-1)/(1360/j). Let i = -56/17 - z. What is the common denominator of -85/18 and i? 144 Suppose d - 5d - 3x + 501 = 0, 5x - 373 = -3d. What is the lowest common multiple of 15 and d? 630 Let v(g) = g3 + 49g*2 - 52g - 80. Calculate the lowest common multiple of v(-50) and 90. 180 Let m(y) = 14y + 64. Let u = -45 - -41. What is the lowest common multiple of 146 and m(u)? 584 Let i = -197419/376971 + -2/17951. Find the common denominator of i and -127/6. 42 Suppose -12i + 16i - 126850 = -39i. What is the least common multiple of 20 and i? 5900 Let n be (-28)/((-1)/6(-28)/(-7)). Calculate the common denominator of (n/336)/(15/(-62)) and -59/8. 120 Let w = 21653 + 4889. Suppose 0 = -4n + k + w, 4n - 4k = -n + 33172. Calculate the common denominator of 83/34 and n/(-72)((-6)/(-7) + -1). 102 Let b be (-5313)/(-69)(0/2 + 11). Suppose -9n - b = -20n. Calculate the smallest common multiple of n and 63. 693 Let m be 2/(-18) + 3553/(-99). Let a = m + 40. Suppose 0 = w + 5o - 29, -3w + 5 - 13 = -ao. What is the least common multiple of 10 and w? 20 Suppose 24t + 7283 = 66t - 5527. Calculate the smallest common multiple of t and 61. 305 Suppose 0 = -2i + d + 37, 0 = -2i - d + 27 + 16. Suppose 4o - 180 = -i. Suppose 14h = 18h - o. What is the least common multiple of h and 4? 20 Let k = 161/45 + -101257/90. Let j = k + 1083. What is the common denominator of j and 1 + (-133)/6 - -2? 6 Suppose 0 = 9w + 72 + 9. Let b be w/(((-6)/14)/((-8)/14)). Let x = b + 42. Calculate the least common multiple of 3 and x. 30 What is the least common multiple of 9875 and 45/12 - 39/((-2652)/85)? 9875 Suppose 0 = 55p - 28929 - 15951. What is the least common multiple of p and 96? 1632 Let s = 164 + -649. Find the common denominator of (-1 + s/30)/(-20) and 121/40. 120 Let v = 5229565/182 + -28734. Find the common denominator of -11/260 and v. 1820 Let q = -2504/391182983 + -431724209794327/702725022491030. Let m = q - -2/25663. What is the common denominator of 61/60 and m? 420 Let l be (7/((-98)/21))/(1/10). Let w = 20 + l. Find the common denominator of (19812/160)/13 - 2/w and -15/11. 88 Let z be (-1310)/329 - 0 - -4. Let w = 453/1645 - z. What is the common denominator of w and 67/45? 315 Suppose 5u = -22 + 62. Suppose 1394 = 81g - 1839 + 965. Calculate the lowest common multiple of g and u. 56 Let j(h) = 107h2 - 354h + 2079. What is the lowest common multiple of j(6) and 3807? 3807 Suppose -45v - 88 = -493. Suppose -va + 256 = -68. Calculate the smallest common multiple of a and 12. 36 Let f = 160 - 69. Let l = f + -58. Let t(g) = g*2 + 6g + 3. What is the least common multiple of t(-9) and l? 330 Suppose 0 = 4h + y - 284, -2h - 3y + 204 = h. Suppose 0 = 15w - 990 - 510. What is the smallest common multiple of h and w? 1800 Suppose 17x - 15x = 4. Suppose 3p - 15 = -xp. Suppose 7f - 2f + 4a - 67 = 0, 3f = -4a + 45. What is the least common multiple of p and f? 33 Let k(q) = 2q*3 + 6q*2 - 5q - 13. Let g be k(4). Let w = -101 + g. Suppose w = 4t + 18. What is the lowest common multiple of t and 168? 504 Suppose 0 = -4p - 3k + 3163, -619p - 5k = -615p - 3149. What is the lowest common multiple of p and 1194? 2388 Calculate the lowest common multiple of -135 + 139 + (17 - -1) and 80. 880 Let v(s) = -2s3 + 42s*2 + 48s - 8. Let k(i) = -i*2 - 23i - 98. Let n be k(-15). Calculate the smallest common multiple of v(n) and 40. 80 Let q be (3/6)/(2/3240). Suppose 25704 = -9i - q. Let y = i - -26480/9. Calculate the common denominator of -33/31 and y. 279 Let x = 14 + -11. Suppose -2c = 5m - 54, -2c + 2m = -43 + x. What is the common denominator of 8/25 - 11/c and 7/16? 400 Let y = -28213 + 30949. Calculate the least common multiple of y and 2052. 8208 Let c = 6 + 2. Let u be 0 + 1 + (10 - c). What is the common denominator of 77/12 and (1/u)/((-60)/(-530))? 36 What is the common denominator of 59/216 and (6/12)/(5346/(-2241))? 2376 Calculate the common denominator of (-3)/905025/(-100) and -109/696. 3480 Let p = 4456 - 4291. What is the least common multiple of p and 363? 1815 Calculate the common denominator of ((21/(-40))/(18/(-8)))/((-18)/15) and -27/80. 720 Let l = -3 - 2. Let n = -5455 + 5445. Calculate the smallest common multiple of 24 and 112(-1)/l + n/25. 264 Suppose -2o = 0, -o = -12k + 8k + 464. What is the least common multiple of 928 and k? 928 Calculate the common denominator of (4/240536)/(760/57) and 109/1660. 8300 Let k(h) = -2h*2 + 30h - 116. Let n be k(6). What is the common denominator of 2/(n/(-978))16/(-1440) and -143/12? 60 Let h = 116 + -176. Find the common denominator of 65/56 and (2 + 105/(-48))(-116)/h. 560 Let v(n) = 11n2 - 1 - 5n*2 - n - 3n*2 + 0n*2. Let b be v(-1). Find the common denominator of -123/10 and b/7 + (-3284)/280. 10 Calculate the lowest common multiple of 948 and (42/(-84))/((-862)/(-216) + -4). 8532 Suppose -4v = 4s + 10 - 2, 2v = -4s - 8. Suppose -80 = -i - 15i. Suppose il = -vl + 90. Calculate the least common multiple of l and 16. 144 Suppose -32p - 3680 = -37p. Suppose 737k - pk = 50. What is the least common multiple of k and 20? 100 Let g be 31/93 - (-1797680)/(-429). Let u = g - -4190. What is the common denominator of 43/65 and u? 715 Let m be ((-40)/(-363600))/(6/(-167121)). Let x = m - 1/404. Let k = -2387 + 50168/21. Calculate the common denominator of k and x. 105 Suppose -4q + 32 = -40. Let d be (-2044)/140 + (-4)/10. What is the smallest common multiple of q and (25/d)/((4/(-2))/12)? 90 Suppose 45r - 290 - 2084 = -484. Calculate the lowest common multiple of 42 and r. 42 Suppose 273 + 486 = 69i. Let z = 6 - -12. What is the lowest common multiple of z and i? 198 Let o = 1446113/23100 - 2633/42. What is the common denominator of 21/8 and o? 2200 What is the common denominator of (5/(-35))/((-144)/371) and -68/3? 144 Let d be (-420684)/(-192) - (5 + 5/(-1)). Let i = -2190 + d. What is the common denominator of i and 2/(-2) - (-7)/32? 32 Suppose 25 = -5c - 0c, 743 = -4p + c. Let i = p - -347. Calculate the smallest common multiple of 16 and i. 160 Let k = -998771/16 - -62503. Let h = -81 + k. Find the common denominator of 19/30 and h. 240 Let w = -30 - -34. Let k be (-4)/(-14) + w/((-56)/171238). Let v = -269009/22 - k. Calculate the common denominator of v and 107/18. 198 What is the common denominator of -37/72 and ((-9)/(-7))/(-3) + (-10403)/76356? 216 Suppose 5a + 2 = 6a. Calculate the lowest common multiple of a - (-55 - (-8 + 6)) and 35. 385 Suppose 0 = -2r + 11 + 9. Let u be -12/r - 69/5. Calculate the common denominator of -7/13 and (1 - u/(-12))/((-44)/(-4818)). 52 Let w = -581451/320 - -7267/4. Find the common denominator of -97/4160 and w. 4160 Let m = -1/105 - 58/35. Suppose 41g = 30g + 99. Find the common denominator of (-1)/g + 1126/90 and m. 15 Suppose 5y = 3x + 334, 993y - 988y + 2x = 319. Calculate the lowest common multiple of 1260 and y. 16380 Let n = -13369211053/764298954 + -10/3009051. Let c = 4969683/284480 + n. Find the common denominator of 115/12 and c. 6720 Let h(t) = 8t*2 + 3t - 2t3 + 3t - 3 + 3t3. Let c = 184 + -191. What is the lowest common multiple of h(c) and 6? 12 Let b = 16663 - 200009/12. What is the common denominator of b and 41/133? 1596 Suppose 35 = 9l - 2l. Suppose 0 = 9r - lr - 4. What is the common denominator of (r + (-226)/36)(-64)/(-120) and -133/24? 216 Suppose 0 = 3p + b - 3b - 30, -p = 4b - 24. Let k(x) = -18 + 18 + 18 + x3 + 15x - 17x2. Calculate the lowest common multiple of k(16) and p. 12 Let o = 377161 + -376797. Let c = -3 + 15. What is the smallest common multiple of o and c? 1092 Let d be 62/936/4. What is the common denominator of 1891/1860 + d/3 and (2/32)/(1/74)? 40 Let r = -9 + 24. What is the common denominator of ((-471)/(-24))/(r/(-4)) and 27/10? 30 Let i be 2/(-5915) + 8/(-80)*0. Let p = i - -41499/278005. Find the common denominator of p and 31/10. 470 Calculate the common denominator of 66	{ "pile_set_name": "DM Mathematics" }
246 = 807, o + 3h - 97 = 0. Let c = -70 + o. Is c prime? False Suppose -2g + 376 = -94. Is g composite? True Let q(j) be the first derivative of -j*4/4 + 3j*3 + 5j*2 + j - 3. Is q(7) composite? True Let k = -8 + 13. Suppose 0z - 5 = 5z, kw + z - 114 = 0. Is w prime? True Let v(y) be the second derivative of 27y5/20 + y2/2 - 3y. Is v(2) prime? False Suppose 5n - 3753 = -b, -3010 = 3n - 7n + 3b. Is n composite? False Let b(j) = 38j - 1. Let y(q) = q2 + 11q + 7. Let p be y(-11). Is b(p) composite? True Suppose 3g - 5 = 2g. Suppose gl + 44 = 7l. Is l a composite number? True Let u(b) be the second derivative of b4/12 + b3/6 + 5b2/2 + 2b. Let a be u(0). Suppose -13 = -z + 4i, -a - 47 = -4z + i. Is z prime? True Suppose 0 = -2i - 0i + 8. Let t(c) = c*2 - 5c + 4. Let u be t(4). Suppose un - 17 = -2p + 3n, ip - 32 = 4n. Is p composite? False Let t be (-3 - 0) + 31. Suppose t = -4f + 163 + 93. Let b = f - -51. Is b a composite number? True Is (-2)/11 - (-15045)/165 prime? False Suppose 0 = 2j - 3j + 5n + 27, -3n - 21 = -3j. Is 0/j - (-12 + 8) composite? True Suppose 0 = 4h + 8, -2x - 3x - 5h + 2335 = 0. Is x prime? False Suppose -3b + 121 = 1. Suppose 65 = 5c - b. Is c composite? True Let l(d) = d - 1. Let h be l(6). Let a(f) = 3f3 - 6f*2 - f + 3. Is a(h) a composite number? False Suppose 2j - 2 = -3g, 2 = -4j + 3g + 24. Suppose -4z = -j, -46 = -3m - z - 3z. Is m prime? False Let w(k) = -1. Let d(s) = s - 19. Let v(c) = -d(c) + 4w(c). Is v(8) composite? False Suppose -16 = -4k - w, -4k + w - 3w = -12. Let b(j) be the third derivative of j5/15 + j4/12 + 5j3/6 - j2. Is b(k) a prime number? False Let f = 4655 + -2092. Is f a prime number? False Let s be -12 - -11 - 1131. Let z = s - -235. Is z composite? False Let o = 261 - 140. Is o a composite number? True Let l(v) = -11v3 - 16v*3 - 4 + 5 - 28v3 - v2. Is l(-1) composite? True Let o(r) = 2r - 3. Let q be o(3). Suppose -20 = -qc + 7. Suppose cj = 4j + 105. Is j a prime number? False Let g(u) = -u*3 + 2u*2 + 5u + 6. Let q(c) = -c*2 - c - 1. Let t(n) = -g(n) - 3q(n). Is t(4) a prime number? False Suppose 0 = -v - l + 6, -5v - 6 = -5l + 4. Suppose 3c = vc. Let k(j) = j*2 - j + 23. Is k(c) prime? True Suppose -6j + 6700 = 1888. Is j a composite number? True Let x(b) = -b*2 - 5b - 4. Let p be x(-4). Let s be p - (-3)/(6/4). Suppose -sw + 5m + 21 = 2m, -4w - 3m - 3 = 0. Is w a prime number? True Let g(l) = -l3 + 19l*2 - 6l - 11. Is g(18) prime? False Suppose -3x + 20 = 8. Let u = x - -31. Is u composite? True Let x be -3 - (-702 - (-1 - -1)). Suppose -o = -4o + x. Is o a prime number? True Suppose 5t - 526 - 109 = 0. Is t composite? False Let i(d) = 22d*3 - 7d*2 + 15d - 19. Is i(6) a prime number? False Let x(q) = q*3 + 4q*2 - 7q - 4. Let g be x(-5). Is 37/(15/g - 2) composite? True Let r be 0 + -311 + (2 - 4). Let q = -204 - r. Is q composite? False Let k = -2 + 1. Is (587/k)/(-3 - -2) composite? False Let i = -2 - -5. Let h(q) = q*3 - 5q*2 - 6q + 2. Let w be h(6). Suppose 19 = iz - wz. Is z a composite number? False Let s(n) = 37n2 + n + 9. Is s(-4) composite? True Suppose -g + 4g = 15. Suppose 2y = gy, 4y + 52 = 4u. Is u prime? True Let b(j) = 5j2 - j + 1. Let i be b(3). Suppose 3u - 62 = 5n + 52, 2n - 2u + 44 = 0. Let q = n + i. Is q prime? True Let j = 11 + -11. Is j + -3(-422)/6 composite? False Let w = -10 - -11. Is 1/(w/(-3 - -40)) composite? False Is (-3)/6 + 17073/14 prime? False Let h(g) be the first derivative of -g6/120 + g5/12 + g4/8 + g2 + 3. Let n(l) be the second derivative of h(l). Is n(5) composite? True Suppose 3a = 6a. Suppose -4b + 543 + 1165 = a. Is b a prime number? False Let n(c) = c2 - 6c + 3. Let a be n(8). Suppose 2m = 3m - a. Is m prime? True Suppose -4x - 3t = -6812, -5x + x - 4t + 6812 = 0. Is x composite? True Let u(a) = -a*3 - 4a*2 - a + 5. Is u(-5) a prime number? False Let o(i) = -11i - 11. Suppose -3u - v + 5v = -51, 4u - 68 = 4v. Let s = 9 - u. Is o(s) prime? False Let o(d) = d*3 + 14d*2 + 10d - 6. Let t be o(-10). Suppose 3n + 3 = 0, l - n = -0l + t. Is l a prime number? True Let p(k) = 9k2 + 11k - 13. Is p(9) a prime number? False Let i = 131 - 3. Suppose 6o - g - 159 = o, g = 4o - i. Is o a composite number? False Suppose -2w - 1895 = -7w. Is w a composite number? False Suppose l = 3s + 1937, 0l = 3l - 3s - 5799. Is l prime? True Let v = 11 + -8. Suppose z - 2r = 13, -vz - 5 = 2r - 4. Suppose 0 = -2u + 5b + 73, zb = 5u - 2b - 190. Is u prime? False Suppose 0 = -4m + d - 1418, 1072 = -3m + 7d - 2d. Let b = -155 - m. Is b a prime number? True Suppose 5k - 397 = 238. Is k a prime number? True Let u(y) = 317y*2. Is u(1) a prime number? True Suppose -f = q + 3 + 2, -3q + 2f + 10 = 0. Suppose -4x + 2t + 362 = q, 2x - 5t = 3x - 118. Is x prime? False Let j(y) = -18y - 15. Let b be j(-6). Let n = 236 - b. Is n a composite number? True Is 3-1 - (-440 - 6) a composite number? False Let q(d) = -d*3 - 1 + 3 + d + 5. Suppose 7b = 4b. Is q(b) a composite number? False Suppose l = -3l + 16. Let t(s) = s*3 - 5s*2 + 2s - 3. Let p be t(l). Let x = p + 60. Is x a prime number? False Let v(d) be the first derivative of 28d3 + d2/2 + 6. Is v(1) a composite number? True Is -17(3 + 0 + -10) prime? False Let k = -88 + 147. Let c = 82 - k. Is c a composite number? False Let p be -43/(-4) - -6. Let n(b) = 11b - 8. Is n(p) prime? False Let n = -1098 + 1933. Is n a composite number? True Let m be 6/(-24) + 31/(-4). Let r = m - -19. Is r composite? False Let w(x) be the third derivative of x5/4 + x4/12 + x3/3 - x2. Suppose 5h + 4q + 31 = 0, -q + 6q + 14 = 2h. Is w(h) prime? True Let p be (0 + 0)/(-1 + 2). Let a = p + 21. Is (-7)/a + (-158)/(-6) prime? False Suppose 3n - 824 = -2o, -4o = 3n + 446 - 1260. Is n composite? True Let h = 1664 + -811. Suppose 257 = -4n + h. Is n prime? True Let u = 5 + -14. Let j be ((-42)/u)/((-2)/6). Is 4/j + (-919)/(-7) composite? False Let u = -2 + -6. Let l be (-2 - 1) + u/(-4). Is 2/l(-86)/4 prime? True Let i(f) = f*2 + 2f. Let m be (-8 - -11) + (-5 - 1). Let t be i(m). Suppose 3d - 4d = -tj - 22, -2d + 3j = -32. Is d prime? False Suppose -3u + 2f + 81 = 0, 3u + 4f - 99 = -0u. Suppose 3m + 5l - u = 0, -2l + 7l = -10. Is m a prime number? True Let z(a) = -a*3 - 3a*2 + 5a + 6. Let j be z(-4). Suppose -2x - 4i = -214, ji - 302 = -5x + 193. Is x composite? False Is (-64)/(-80)(-190)/(-4) prime? False Let c be -3 + 6 - (-2 - -2). Suppose 25 = -ch - 2. Is 2285/45 - 2/h prime? False Suppose 0 = 4p + 3w + 19, p - 3w + 1 = -0p. Is p/(-6)(-894)/(-4) a composite number? False Is (-16)/(-12) + (-226)/(-6) a composite number? True Let j = 6 + -6. Is j + 5 + -2 - -34 a prime number? True Let q = -14 - -17. Suppose -qy = -0y - 111. Is y a composite number? False Let u(o) be the first derivative of -7o*2/2 - 10o - 2. Suppose 8 = 5h + 53. Is u(h) composite? False Let m = 1 + -1. Suppose -4b = -k - 509, m = -5b + 4b - 5k + 122. Is b a composite number? False Let g = -113 - -336. Is g a composite number? False Suppose 3f - 5f = -4. Let a = 3 - f. Is 0 + 46/(1 + a) prime? True Suppose -12 = -3s - 0s. Suppose 3o + 4g - 112 - 541 = 0, -2o + sg = -442. Is o composite? True Let y be -1((-1 - 1) + 2). Suppose t - z - 172 = 0, 178 = t - yt + z. Suppose 4w + w = t. Is w composite? True Is (4016/(-24))/((-2)/3) a composite number? False Let a(u) be the third derivative of -1/6u3 + u2 + 0u - 1/4u4 + 0. Is a(-4) a prime number? True Suppose 0q + 12 = 2q. Suppose qo - 316 = 2o. Is o a prime number? True Let l(p) = 99p*2 + 13p + 6. Let w(z) = 33z2 + 4z + 2. Let b(d) = -2l(d) + 7w(d). Let r be b(-2). Let g = r - 92. Is g prime? False Suppose 2l + 2l - 1512 = -3k, -l - 3 = 0. Suppose -3v + k = v. Is v composite? False Suppose w + 389 = 3v - 3w, -2v = 4w - 246. Is v a composite number? False Let b(r) be the third derivative of -r6/60 - r5/20 - r4/24 + r3/6 - r*2. Is b(-3) a composite number? False Let x = -9 + 16. Let j = x + -5. Suppose -10 = -5c,	{ "pile_set_name": "DM Mathematics" }
+ 4. Let s(g) = -137g3 + 13g*2 - 2g + 6. Let f(m) = 7i(m) - 5s(m). What is the units digit of f(1)? 7 Suppose 16w - 6w = 0. Suppose -3y - x = -wx - 758, -3x + 1004 = 4y. What is the tens digit of y? 5 Suppose 0 = 3g + 2n + 7, -g + 2n + 0n = 5. Let z be (120/(-100))/(g/10). What is the tens digit of (-88)/z4/(-2)? 4 Let u(r) = 3r - 4r + 0r + 5r - 4. Let z(k) = -k2 - 8k - 7. Let g be z(-6). What is the units digit of u(g)? 6 Let u be (2 - -2) + (-82)/(-2). Let m be (-5)/(15/9) - -6. Suppose mh + 2t = 200, -5t - u = -h + 16. What is the tens digit of h? 6 Let p be 0 + 210 - 15/10-2. Suppose p - 7 = 2a. What is the units digit of a? 3 Suppose -b + 31 - 28 = 0, -2b = 2l - 876. What is the tens digit of l? 3 Let u(j) = -720j + 256. What is the thousands digit of u(-2)? 1 Suppose 9c - 6c = 3. What is the units digit of c/4 + 33/12 - -3? 6 Let m be 1 - (472/6)/((-8)/(-12)). Let s = m - -246. What is the hundreds digit of s? 1 Let u(q) = q*3 + 4q*2 - 5q - 3. Let f = 16 + -20. Let y be -3(f/(-12) + 1). What is the units digit of u(y)? 7 Let q(s) = -14s*3 - 38s*2 - s - 1. Let a(b) = 5b*3 + 13b*2. Let n(v) = 11a(v) + 4q(v). What is the tens digit of n(-9)? 3 Suppose -92 = 4l - 2b, 0 = 3l - 2b - b + 66. Let p = -13 - l. Let t = p + -1. What is the units digit of t? 0 Let f be (-6 - (-144)/27)/((-2)/708). What is the units digit of 3/(4 + (-932)/f)? 9 Let y = 6 - 14. Let m = 27 - y. What is the units digit of (m/(-21))/((-2)/18)? 5 Suppose -3496 = 927m - 935m. What is the tens digit of m? 3 Let l(s) = -104s - 227. What is the hundreds digit of l(-5)? 2 Let t be 1 + 3 + -5(-1)/(-5). Suppose -tw + 1248 = 3w. What is the units digit of w? 8 Let s(x) = 2x + 7 - 3x - 1 + 6. Let y be s(13). What is the units digit of -8 - -9 - 14/y? 5 Suppose 4n = 46 - 50. Let f(u) = 106u2 - u + 1. What is the hundreds digit of f(n)? 1 Let v = -25 - -24. Let x(j) = -2j + 1. What is the units digit of x(v)? 3 Suppose -468 = -11t - t. Let g = -28 + 2. Let v = g + t. What is the units digit of v? 3 Suppose -5j + 2x = -159, 0x + 39 = j - 4x. Let b = j + 3. What is the tens digit of b? 3 Suppose 0p - 36 = -4p. Let y(k) = 0k + k*3 - 8k*2 - 2k*3 + 0 - 4 - pk. What is the tens digit of y(-7)? 1 Let j = 0 + -3. Suppose 65a - 58a = -308. What is the tens digit of (-9)/ja/(-4)? 3 Let x be 84/10 + 3/5. Suppose -3u + 3 = -3j, 4u = 5u + 3j - x. Suppose -ur = 2r - 130. What is the tens digit of r? 2 Suppose -i = 4r - 2603, 644 = r - 24i + 22i. What is the hundreds digit of r? 6 Let b = 394 - 39. What is the units digit of b? 5 What is the units digit of (-1)/6 - 1/(-6) - -311? 1 Suppose 3o + 2p - 23 = 0, -o + 2p + 5 = -0. Let g(y) = y*3 - 5y*2 - 11y + 6. What is the tens digit of g(o)? 2 Suppose -360 - 178 = -2g. Let m = g - 143. Suppose -5q + 3q - 4h + m = 0, -q + 66 = -h. What is the tens digit of q? 6 Suppose -9 = -2u + 9. Let c be (-3)/u - (-170)/6. Suppose -5o + s + c = 3s, 17 = 3o + s. What is the units digit of o? 6 Let u(c) = -c*3 - 3c*2 + 7c + 14. Let h be u(-4). Suppose 4 = -hd, -r + 383 = 2r - d. What is the tens digit of r? 2 Let i = -710 - -1284. What is the tens digit of i? 7 Let l(x) = 10x - 20. Let u(d) = 7d - 13. Let z(y) = -5l(y) + 7u(y). Let h be z(5). What is the tens digit of 13 - h/(8/(-6))? 1 Let j(c) be the first derivative of -3c2/2 - 7c + 2. Suppose -3d - d - v = 11, 2v - 11 = 3d. What is the units digit of j(d)? 2 Suppose 4y - y = -2z + 7, 3z - 18 = -3y. Let i = 17 + z. What is the tens digit of i? 2 Let j = -78 - -816. What is the units digit of j? 8 Let q(a) = a3 - 5a*2 + 8a + 4. Suppose 1 = 3f - 11. Suppose fs - 5s + 4 = 0. What is the tens digit of q(s)? 2 Let w be (-4 + -1 + 4)-121. Suppose 0 = -5l + l + i + 517, l - 3i = w. Suppose 6c - c = 3k - 86, l = 4k + c. What is the units digit of k? 2 Suppose 2h + 2h + 68 = -3s, 2s - h + 38 = 0. Let t = s - -68. What is the units digit of t? 8 Suppose -4s + 8512 = -2b, 2115 + 13 = s + 2b. What is the tens digit of s? 2 Let t be (-15)/20(-8)/3. What is the units digit of 104 - (t + (2 - (-3 + 8)))? 5 Suppose 4u - 152 - 48 = 0. Suppose 0 = 2p - p - 2l - u, -50 = -p - 3l. What is the units digit of p? 0 Let x(r) = r3 - r2 + 11r + 19. What is the hundreds digit of x(9)? 7 Let x(w) be the second derivative of 16w3/3 + 7w*2 + 15w. What is the hundreds digit of x(3)? 1 Let r(k) = 2k2 + 18k - 35. Let b be r(-11). Let o(j) = 4j2 - 5j - 6. Let x be o(-4). Suppose 6i - bi = -x. What is the units digit of i? 6 Let u = -66 - -128. What is the units digit of u? 2 Let m = 63 - 62. Let y(i) be the first derivative of 22i3/3 - i2/2 + 3. What is the tens digit of y(m)? 2 Suppose 1098 = -21w + 22w. What is the tens digit of w? 9 Let i be ((-33)/15)/(6/30). Let o(x) = x2 + 8x - 4. What is the units digit of o(i)? 9 Suppose 5q - 12 = 4m + q, -3m + 2q = 4. Suppose 5x - 25 = 0, -4h + 3x - 9 = m. What is the units digit of h? 1 Suppose -28 = -2k - 0k. Suppose -3a - u = k, 0 = -3u - 5 - 1. What is the tens digit of a/6 + (-220)/(-15)? 1 Suppose 0 = 15w + 178 + 2. Let a(x) be the first derivative of -x*3/3 - 13x*2/2 + 13x - 1. What is the tens digit of a(w)? 2 Let y(r) = r*2 - r + 5. Let w be 6/2 + 0 + -3. Let q be y(w). Suppose -64 = -2n - 4z + 56, -230 = -qn + 4z. What is the units digit of n? 0 Let s = 3 + -5. Let h be (2 + s - 0)/1. What is the tens digit of 7(h + (-20)/(-14))? 1 Let w(j) = -j*3 - 8j*2 - j - 1. Let u(q) = -2q + 14. Let a be u(11). What is the units digit of w(a)? 7 Let m(w) = -7w - 3. Let p(j) = j. Let x(q) = -m(q) + 3p(q). What is the tens digit of x(8)? 8 Let o = -2177 + 4096. What is the units digit of o? 9 Suppose -3t + 0y - y = -5, -2y = 2. Suppose 5s - 7 = -u - u, ts = -3u - 6. Suppose -sc = 32 - 119. What is the tens digit of c? 2 Suppose z + 4y = 1588, -3y = -17 + 2. What is the tens digit of z? 6 Suppose -h = 4j - 837, h - 6h = -5j + 1040. Let k = 516 - j. What is the units digit of k? 7 Suppose -2s - 3d + 4 = -2, -3s - 3d + 6 = 0. Suppose 4v = -v + 3x + 1186, 2x - 6 = s. Suppose -6p + 55 = -v. What is the tens digit of p? 4 Suppose -2t = 5m - m - 1296, 4t = 2m + 2552. What is the tens digit of t? 4 Let c(o) = -2o + 578. What is the units digit of c(49)? 0 Suppose -78o = -69o - 9306. What is the units digit of o? 4 Let j be (-27)/45 - 573/(-5). Suppose -m + 3u + j = 0, 4u - 391 = -4m + 3u. What is the tens digit of m? 9 Let k = 2329 - 1646. What is the hundreds digit of k? 6 Suppose 0s - 3s = 6, 4g - 2s - 16 = 0. Suppose 4 = w + w. Suppose -gc - 2r + 66 = -0r, 6 = wr. What is the tens digit of c? 2 Let l(i) = i3 - i2 + i - 1120. Let a be l(0). Suppose 10b = 2d + 12b, d + 15 = 2b. What is the tens digit of (a/12)/d3? 5 Let k be 10/(-55) + (-48)/(-22). Suppose -5w = -5u + 15, kw + 9 = -u + 6u. Let v = w - -7. What is the units digit of v? 5 Let r(p) be the second derivative of -p5/5 + p4/6 - p3/3 + p2/2 + 7p. Let y be r(1). Let z = 3 - y. What is the units digit of z? 6 What is the tens digit of (38457/45)/((-4)/(-20))? 7 Suppose -7596 - 3861 = -19d. What is the units digit of d? 3 Let k be -1 + 20/((-8)/(-2)). Let u be (-14)/k12/(-21). What is the units digit of 2 + 3 + -2 - u? 1 Let w = -3542 + 4993. What is the units digit of w? 1 Suppose -3b - 21 + 27 = 0. Suppose 0n = 5s - bn - 148, 0 = 3s + 4n - 68. What is the units digit of s? 8 Let n be 6/2(-532)/(-21). Let t = n - 11. What is the tens digit of t? 6 Let j(s) = -15s + 3. Let c(u) = -45u + 9. Let m(n) = -6c(n) + 17j(n). What is the units digit of m(3)? 2 Suppose -j = 5h - 1094, -3h = -0h - 2j - 659. Let f = -97 + h. What is the tens digit of f? 2 Let n = -13 + 12. Let q(o) = 43o2 + 1. What is the tens digit of q(n)? 4 Let t(r) = -5r*2 + r - 13. Let n(x) = -11x*2 + 2x - 27. Let f(c) = 4n(c) - 9t(c). What is the tens digit of f(-9)? 9 Suppose 5h - 2520 = -3b, 2b + 4h = 718 + 964. What is the tens digit of b? 3 What is the hundreds digit of 42/441 + (-51824)/(-42)? 2 Let q = -4013 + 8073. What is the thousands digit of q? 4 Suppose -81m + 86m = 6560. What	{ "pile_set_name": "DM Mathematics" }
second biggest value in 1, 1/4, -126.11, 0.4, -1/8, 5? 1 What is the fourth smallest value in -0.02, 23/60, -3, -0.3, 4/5? 23/60 Which is the fifth biggest value? (a) 0.3 (b) -4/9 (c) -18 (d) 0.001 (e) -2 c What is the third smallest value in 377, -33, -3? 377 What is the biggest value in 8, 0, -85? 8 Which is the third biggest value? (a) 1/24 (b) 4 (c) 0.4 (d) 0.5 (e) 1/7 c What is the second smallest value in 0.47, -1/56, 13? 0.47 What is the fifth smallest value in 0, 1/4, 0.09, -1, -5/2, 3? 1/4 What is the third biggest value in 3, 5, -0.28, -1/2, 1/4, -256? 1/4 What is the smallest value in 0.02, 2/5, -216, -2/7? -216 Which is the second smallest value? (a) 196525 (b) 2 (c) 4 c Which is the biggest value? (a) -4 (b) 37747 (c) 3 b Which is the second smallest value? (a) -0.2 (b) 5 (c) 1/4 (d) -1796 a Which is the biggest value? (a) -612 (b) -5 (c) 0.06 c What is the third smallest value in 0, -2/7, -1, -5, 68.5, 1? -2/7 What is the biggest value in -5, -1/17, -1/3, -0.1? -1/17 What is the third smallest value in 0.045, -0.67, 0, -0.02? 0 What is the third smallest value in -2/3, -1562, -2, 3, 4? -2/3 What is the third smallest value in -1/3, 0, 1.66, 0.1, -0.1? 0 Which is the third smallest value? (a) -68 (b) -12 (c) 0 (d) -0.66 d Which is the second biggest value? (a) -0.09 (b) 2/3 (c) 16 (d) 5 d Which is the second biggest value? (a) -5 (b) 311 (c) -1/5 (d) -4 (e) 4 e What is the third smallest value in -30.7, -0.04, -29? -0.04 What is the fourth smallest value in 47, -0.1, 2/25, 2, -43? 2 Which is the third biggest value? (a) 1 (b) 0 (c) 14492 b What is the third smallest value in 0, 3/8, -2/15, 28, 5.2? 3/8 Which is the second biggest value? (a) 5 (b) -3898 (c) 4 c Which is the fourth smallest value? (a) 5 (b) 736/9 (c) -0.5 (d) 44 b What is the biggest value in 5, 1/3, -1424? 5 Which is the fourth smallest value? (a) 1 (b) -0.5 (c) 4 (d) 4/7 (e) -99 a What is the smallest value in 0.03, 12, 2/11, 5, 10? 0.03 What is the second biggest value in 0.1, -424/11, -0.3? -0.3 What is the fourth biggest value in -1, 5/3, 5.7, 1.1? -1 Which is the fifth smallest value? (a) 4 (b) -0.7 (c) -3 (d) 2 (e) -36 a What is the smallest value in -2884, -9, 0.2? -2884 What is the biggest value in -0.2, -2, -4, -38.5? -0.2 What is the second biggest value in 1.07, 3, -8.06? 1.07 Which is the second biggest value? (a) 0 (b) -303 (c) 6/31 (d) -2 a What is the fourth biggest value in 2, -0.1, 1, 0.58, -2? -0.1 Which is the fifth smallest value? (a) 13/8 (b) -0.2 (c) -3 (d) -10/3 (e) 3 e What is the third smallest value in -83, 17, 10, -4, 2/7? 2/7 What is the second biggest value in -0.226, 0.0212, -2/9? -2/9 What is the third biggest value in -0.4, 0.8, -19/10? -19/10 Which is the second biggest value? (a) 123.257 (b) 1 (c) -4 b What is the third biggest value in 45, 3/13, -7? -7 What is the third biggest value in 2/45, -2/9, 249.2, 0.5? 2/45 Which is the fourth biggest value? (a) -1 (b) -61686/5 (c) -3/2 (d) -5 b What is the third smallest value in 1/4, -9/25, -71, -4? -9/25 Which is the smallest value? (a) 11/2 (b) 2/1759 (c) 5/6 b Which is the second smallest value? (a) 1/5 (b) -0.2 (c) -4 (d) 0.0944 b Which is the smallest value? (a) -0.2 (b) -1 (c) -3 (d) 0.12 (e) -7/3 (f) -0.1 c Which is the biggest value? (a) -4 (b) -2/7 (c) -5 (d) 15 (e) -3 (f) 0.027 d Which is the second smallest value? (a) -7 (b) 369 (c) -3 c Which is the smallest value? (a) 3 (b) -4/8733 (c) 0.2 b What is the second biggest value in 0.1, 59, -10? 0.1 Which is the fourth biggest value? (a) -2 (b) 6 (c) 0.3 (d) -0.5 (e) -3/8 d What is the third smallest value in 124, 0, 7/25? 124 What is the fourth smallest value in -23, 11420, 5, -0.1? 11420 What is the fifth biggest value in -3/319, -3/23, -1/7, 0.07, -5, 0.3? -1/7 What is the smallest value in 0, -1/88, -4? -4 What is the third biggest value in -386, 1, 274? -386 What is the fifth biggest value in -0.4, -4/3, 1863, -5, -4, 66? -4 Which is the second smallest value? (a) 1/5 (b) 1/7 (c) 0.5 (d) -11 (e) -3 (f) -26 d What is the fourth smallest value in -3, -249, 5, 1/59, 0.3? 0.3 What is the third smallest value in 2, 10/3, 1368? 1368 Which is the third biggest value? (a) 1 (b) 9/5 (c) 2389 a Which is the smallest value? (a) 0.415 (b) 0 (c) 144 b Which is the second biggest value? (a) -2/9 (b) -198 (c) -0.02 (d) 0.2 c What is the third biggest value in 6, -985, 2/11, -7? -7 What is the second biggest value in 0.07449, -0.04, 3/5, 3, 4, -2? 3 Which is the third smallest value? (a) 0.2 (b) 1 (c) -5 (d) 2 (e) -1.03 a What is the fourth biggest value in -0.01, 2/17, 3/8, -3844/5? -3844/5 Which is the fourth smallest value? (a) -1/29 (b) 16 (c) 1/9 (d) 0.5 b What is the biggest value in 0, -4, 3, 3521, 4, -2/17? 3521 Which is the third biggest value? (a) -0.07 (b) 1 (c) 17 (d) 6/11 (e) 1/6 (f) -11 d What is the second biggest value in 2, 1/5, -3, -13, 0.5, 6.92? 2 What is the sixth smallest value in -2, -2/5, 21, 0.04, -1/8, 2/17? 21 Which is the third biggest value? (a) -3 (b) 0.1 (c) 0.9678 (d) 2/21 (e) -1 (f) 0 d What is the third smallest value in -137, -2, 37? 37 What is the third biggest value in -1, 9/10, 1/5, -26? -1 What is the fourth biggest value in -0.3, -1/145, -4/269, 1, -1/2? -0.3 Which is the fifth biggest value? (a) -0.04 (b) -2/9 (c) -32 (d) -2 (e) 12 (f) -0.1 d Which is the third smallest value? (a) 17 (b) -10/7 (c) 1.1 (d) 1 c What is the biggest value in 0.5, -1, -2382? 0.5 What is the third biggest value in 3, -60739, -0.5? -60739 What is the second smallest value in 5, -4/5, 7, 4, -264? -4/5 What is the biggest value in -5, -2/7, 62/15, 0.3, 2.4? 62/15 Which is the third biggest value? (a) 8 (b) -0.2 (c) 0.4 (d) 1.62 (e) -1/2 c What is the second biggest value in -0.1, 5, 0.562, 3/22? 0.562 Which is the third smallest value? (a) 0.2 (b) -1/16 (c) 69 c Which is the second smallest value? (a) 2.8 (b) -28 (c) -1 (d) 2 c What is the fourth biggest value in 1, -9, 0.1, -2/5, 674? -2/5 What is the third smallest value in 63, -5, 8, -2? 8 Which is the third smallest value? (a) -3/1820 (b) -0.06 (c) 2 c What is the second biggest value in 0.23, -2, 10/9? 0.23 Which is the second smallest value? (a) 1/117 (b) -279/8 (c) -0.5 (d) 0 c Which is the smallest value? (a) -2 (b) 11538 (c) 4 a What is the smallest value in -28.4, 8.8, 2/15, 3? -28.4 Which is the second biggest value? (a) 0.01 (b) 0.5 (c) -2/19 (d) -1/26 (e) -1/2 (f) 2 b What is the smallest value in -1/4, 3, 90/299, 0.2, 1/4? -1/4 What is the second smallest value in 48/131, -2/9, -6, 4, 0.1, 2? -2/9 Which is the third smallest value? (a) 1029 (b) 1 (c) -0.03 a Which is the third biggest value? (a) -1/3 (b) -4.41 (c) -3/4 (d) 16 (e) 0 a What is the sixth smallest value in 145, 0, -0.1, 27, 4/5, -2/17? 145 Which is the third smallest value? (a) -549867 (b) 0.5 (c) -2 b Which is the biggest value? (a) -0.03 (b) -4 (c) 20 (d) 0 (e) 3 (f) 0.1 c Which is the third smallest value? (a) 2 (b) 8 (c) 2/9 (d) 74 b Which is the second biggest value? (a) 2 (b) 14 (c) 4 (d) -2/13 c Which is the third smallest value? (a) 2/13 (b) -0.13 (c) 1/4 (d) 0.1 (e) 23 (f) -4 d Which is the fourth biggest value? (a) 0.5 (b) -2587/8 (c) -0.2 (d) -0.4 b What is the sixth smallest value in 1/3, 3/5, 86, 6, 1/4, -1.4? 86 What is the fourth biggest value in -16, -0.4, -5, -1/3, 2/25, 1/2? -0.4 Which is the third smallest value? (a) -0.2 (b) -1 (c) -0.05 (d) 1/13 (e) -0.9 a Which is the biggest value? (a) 13 (b) -2.5 (c) 7 (d) 1/4 a Which is the smallest value? (a) -103 (b) -4/5 (c) -0.388 a Which is the smallest value? (a) 32 (b) 5 (c) -5/3 (d) -3 (e) 1/3 d What is the fifth smallest value in -0.07, -4, 459/7, 2, 12? 459/7 Which is the biggest value? (a) -33 (b) -173/15 (c) 0.5 (d) -1/5 c Which is the third biggest value? (a) 954 (b) -2/15 (c) 9 b What is the fourth smallest value in -0.2, 0.2, -0.1, 0.074, -5? 0.074 Which is the second smallest value? (a) 3/2 (b) -112 (c) -24 (d) -1 c Which is the third biggest value? (a) -3 (b) -1/6 (c) -57105 c Whi	{ "pile_set_name": "DM Mathematics" }
prob of picking 1 d and 1 s. 1/17 Two letters picked without replacement from {w: 2, x: 2, h: 1, l: 1, k: 8, b: 1}. What is prob of picking 1 w and 1 l? 2/105 Four letters picked without replacement from {f: 1, j: 1, v: 2, m: 1, h: 6, w: 4}. What is prob of picking 1 v, 1 f, 1 h, and 1 m? 4/455 What is prob of picking 3 m when three letters picked without replacement from fmfmmfffffff? 1/220 Four letters picked without replacement from tqvvwvvvvctvvmwvvqv. Give prob of picking 1 w, 1 m, and 2 v. 55/1938 Calculate prob of picking 1 r, 1 v, and 1 q when three letters picked without replacement from {v: 4, k: 4, q: 3, r: 1, f: 4}. 3/140 Calculate prob of picking 1 p and 1 h when two letters picked without replacement from sshhhspss. 1/12 Three letters picked without replacement from iniiinnininnn. Give prob of picking 2 n and 1 i. 63/143 What is prob of picking 1 o and 1 s when two letters picked without replacement from {n: 4, s: 9, o: 2, l: 1}? 3/20 Two letters picked without replacement from qtkdrtbkktqrqbtd. Give prob of picking 2 k. 1/40 What is prob of picking 2 l when two letters picked without replacement from {z: 2, l: 5}? 10/21 What is prob of picking 3 k when three letters picked without replacement from {u: 7, k: 6}? 10/143 What is prob of picking 1 b and 1 q when two letters picked without replacement from {e: 4, r: 1, b: 1, q: 2}? 1/14 Three letters picked without replacement from {z: 1, c: 3}. Give prob of picking 1 z and 2 c. 3/4 Four letters picked without replacement from {l: 9, k: 5}. What is prob of picking 1 k and 3 l? 60/143 What is prob of picking 1 n, 1 c, and 1 x when three letters picked without replacement from {c: 4, u: 1, n: 1, x: 7}? 14/143 Four letters picked without replacement from aullalpahhi. Give prob of picking 1 p, 1 i, and 2 l. 1/110 What is prob of picking 1 t and 2 k when three letters picked without replacement from kksstotkksttssstt? 9/170 Calculate prob of picking 1 f, 2 i, and 1 k when four letters picked without replacement from kfiiiff. 9/35 Four letters picked without replacement from nknkknnkknnn. Give prob of picking 3 k and 1 n. 14/99 What is prob of picking 1 w and 1 m when two letters picked without replacement from mmkkwamkakwkzzzk? 1/20 Two letters picked without replacement from {e: 2, v: 1, s: 4}. What is prob of picking 1 s and 1 v? 4/21 Four letters picked without replacement from {q: 4, a: 2, k: 6, f: 3, y: 3}. What is prob of picking 1 a and 3 y? 1/1530 What is prob of picking 1 b and 1 q when two letters picked without replacement from {q: 5, r: 1, b: 4, y: 10}? 2/19 Calculate prob of picking 3 v and 1 z when four letters picked without replacement from {z: 2, v: 5, c: 12}. 5/969 Two letters picked without replacement from {k: 2, r: 1, p: 1, c: 3, m: 5, a: 1}. Give prob of picking 1 c and 1 m. 5/26 What is prob of picking 1 j and 2 f when three letters picked without replacement from {j: 1, o: 1, k: 2, h: 2, f: 2, p: 1}? 1/84 Calculate prob of picking 2 j when two letters picked without replacement from {j: 2, k: 5, t: 5}. 1/66 Calculate prob of picking 1 z and 1 p when two letters picked without replacement from {p: 1, z: 2, f: 1}. 1/3 Two letters picked without replacement from {c: 2, g: 5}. What is prob of picking 1 c and 1 g? 10/21 Two letters picked without replacement from ppjppddjppjdpjpxjjf. What is prob of picking 1 j and 1 p? 16/57 What is prob of picking 2 s and 1 j when three letters picked without replacement from sssssssssssssjs? 1/5 Four letters picked without replacement from {i: 5, j: 8, k: 2}. Give prob of picking 2 j and 2 k. 4/195 Four letters picked without replacement from pgpgggpgggpgp. Give prob of picking 1 p and 3 g. 56/143 Three letters picked without replacement from {x: 2, w: 9}. What is prob of picking 1 x and 2 w? 24/55 Two letters picked without replacement from xqqmqqpmqxqqmpmq. What is prob of picking 1 q and 1 p? 2/15 What is prob of picking 1 i and 2 q when three letters picked without replacement from qmeimqeqmqqqqqqm? 9/140 What is prob of picking 1 z and 2 h when three letters picked without replacement from {h: 2, z: 6}? 3/28 What is prob of picking 2 r and 2 p when four letters picked without replacement from {r: 6, p: 3, z: 4, b: 1}? 45/1001 Four letters picked without replacement from zvzzzvzzzzvzvvzvzzv. Give prob of picking 2 v and 2 z. 231/646 What is prob of picking 1 p and 3 g when four letters picked without replacement from {g: 3, p: 3, t: 1}? 3/35 Two letters picked without replacement from mpmpmppppkmkpmmm. What is prob of picking 1 p and 1 m? 49/120 Two letters picked without replacement from kkggkzkzyoxyoxo. Give prob of picking 2 o. 1/35 Four letters picked without replacement from {j: 2, c: 6, k: 2, u: 8}. What is prob of picking 3 c and 1 u? 8/153 What is prob of picking 2 j when two letters picked without replacement from {v: 2, g: 1, j: 1}? 0 What is prob of picking 2 p and 2 l when four letters picked without replacement from {t: 2, n: 2, l: 3, s: 6, p: 2, i: 2}? 3/2380 Three letters picked without replacement from zzxxwhhawghx. Give prob of picking 1 a and 2 h. 3/220 What is prob of picking 1 m and 2 x when three letters picked without replacement from xxmmxxmxxmmmxmxmxxm? 135/323 Three letters picked without replacement from {y: 2, l: 1, n: 1, u: 2, r: 4, q: 5}. Give prob of picking 1 q and 2 r. 6/91 What is prob of picking 1 v and 2 x when three letters picked without replacement from {x: 3, s: 1, l: 4, p: 1, v: 7}? 3/80 Three letters picked without replacement from kyffyrfsfhshyyhfshhf. What is prob of picking 2 h and 1 r? 1/114 Two letters picked without replacement from {a: 3}. Give prob of picking 2 a. 1 Two letters picked without replacement from {n: 1, v: 3}. What is prob of picking 1 n and 1 v? 1/2 Two letters picked without replacement from {m: 2, j: 6, b: 4, c: 1}. What is prob of picking 1 m and 1 b? 4/39 Calculate prob of picking 2 y and 1 l when three letters picked without replacement from llgyrrrlgrrryrrr. 3/560 Three letters picked without replacement from {a: 4, y: 4, x: 2, g: 4}. What is prob of picking 1 y and 2 g? 6/91 Calculate prob of picking 1 w, 1 g, and 1 b when three letters picked without replacement from wmqmggbbeqbwgebegq. 2/51 Two letters picked without replacement from {i: 1, m: 5, v: 1, c: 9}. What is prob of picking 1 i and 1 c? 3/40 Two letters picked without replacement from ooobddbodbb. Give prob of picking 1 o and 1 b. 16/55 What is prob of picking 3 r when three letters picked without replacement from {r: 4, g: 3}? 4/35 Two letters picked without replacement from thvhvzhhhhvhg. Give prob of picking 1 v and 1 g. 1/26 Four letters picked without replacement from {g: 4, s: 3}. Give prob of picking 1 s and 3 g. 12/35 Three letters picked without replacement from {g: 1, p: 3}. What is prob of picking 3 p? 1/4 Three letters picked without replacement from {c: 1, b: 2, f: 1, g: 1, z: 2}. What is prob of picking 1 c, 1 f, and 1 b? 2/35 What is prob of picking 2 i when two letters picked without replacement from jwwjjjjjjwjjjiwi? 1/120 Four letters picked without replacement from {x: 2, y: 3, t: 1, c: 4, u: 2}. What is prob of picking 1 t, 2 u, and 1 x? 2/495 What is prob of picking 1 g and 1 m when two letters picked without replacement from ghluhrmurrhr? 1/66 Four letters picked without replacement from {b: 1, m: 1, u: 2, t: 7, a: 2, j: 1}. Give prob of picking 1 t, 2 u, and 1 b. 1/143 Three letters picked without replacement from {i: 7}. What is prob of picking 3 i? 1 What is prob of picking 1 n and 1 q when two letters picked without replacement from unzuuuzznqnnznjznuz? 2/57 What is prob of picking 1 g, 2 y, and 1 z when four letters picked without replacement from ygjjbzy? 1/35 Calculate prob of picking 1 g and 1 i when two letters picked without replacement from gggigegta. 5/36 Calculate prob of picking 1 f and 1 v when two letters picked without replacement from {v: 17, f: 1}. 1/9 Two letters picked without replacement from {r: 4, o: 8, b: 4}. What is prob of picking 1 o and 1 r? 4/15 Three letters picked without replacement from okoekoa. Give prob of picking 3 o. 1/35 What is prob of picking 1 l and 1 r when two letters picked without replacement from iriirakiliirt? 1/26 Three lette	{ "pile_set_name": "DM Mathematics" }
n(v) be the second derivative of -v*3/6 + v. Let k be -2 - (78/(-65) - 2/(-10)). Let o(g) = -11g + 2 - 1 + 24g - 9g. Calculate ko(j) - 2n(j). -2j - 1 Let d = -130 + 129. Let y(k) = k - 1. Let f(w) = -7w + 6. Give df(n) - 6y(n). n Let a = -2 + 3. Let r(p) = 7 + 4p - 3p + p. Let n(x) = -17. Let z(u) = 8. Let h(f) = -n(f) - 2z(f). Calculate ar(o) - 5h(o). 2o + 2 Let j(m) = -m3 + m2 + m. Let c(g) be the third derivative of -1/12g4 + 0 + 0g*3 + 0g*5 - 19g*2 + 0g - 1/40g6. Calculate -c(t) + j(t). 2t3 + t2 + 3t Let a(j) = 10j + 6. Let h(w) be the second derivative of w3/6 + w2/2 + 225w. Calculate a(y) - 8h(y). 2y - 2 Let x = 352 + -346. Let a(u) = 3u*3 - 5u*2 + 2u - 2. Let z(q) = -4q3 + 4q*2 - 3q + 3. Determine xa(m) + 4z(m). 2m3 - 14m*2 Let d(g) = 9g + 5. Suppose 0 = 9n - 0n - 279. Suppose n + 11 = -7i. Let s(u) = 8u + 4. What is id(l) + 7s(l)? 2l - 2 Let j(h) = 1. Let p(u) = -145u + 4. Calculate 3j(f) - p(f). 145f - 1 Let j(g) = -20g - 2. Let c(m) = -37m - 4. Give 6c(r) - 13j(r). 38r + 2 Let x(j) = -14j*2 + 9j + 2. Let u(s) = 2s2 + s - 1. Determine -5u(h) - x(h). 4h2 - 14h + 3 Let t(y) = -3y - 1. Suppose 7j - 10 = -17. Let o(v) = v. Let q(g) = jt(g) - 2o(g). Let x(z) = z + 2. Calculate -4q(n) + 3x(n). -n + 2 Let a(s) = -s + 3. Let d(i) be the first derivative of -i*3/3 + 2i*2 + 2i + 9. Let x be d(3). Let t(m) = -3m - 7 + 12m - 6m. Determine xa(b) + 2t(b). b + 1 Let k(o) be the third derivative of -o5/20 - o4/8 + o3 - 2o*2 + 2o. Let g(w) = -4w2 - 4w + 7. Calculate -5g(t) + 6k(t). 2t2 + 2t + 1 Suppose -2x = -c + 4, -3c + 3x = -x - 2. Let m(d) = 2d + 3. Let l(p) = 1. Let b = -14 - -14. Suppose -2q + 0 + 2 = b. Calculate cl(r) + qm(r). 2r - 3 Let g(s) = -s3 + s2 - 63s. Let h(x) = x3 - x2 + 42x. Calculate 5g(y) + 7h(y). 2y3 - 2y*2 - 21y Let a(b) = -184b3 - b2 - 7b. Let g(i) = -123i3 - i2 - 5i. Determine -5a(r) + 7g(r). 59r3 - 2r*2 Let i(h) = 0h - 3h - 3h. Let a(o) = o. Let t(z) = -z*3 - 4z*2 + 3z + 7. Let n be t(-5). Let s = n - 14. What is si(q) + 15a(q)? -3q Let h(g) = -27g*3 + 2g*2 - 2g - 4. Let r(d) = 270d3 - 21d*2 + 21d + 42. Calculate 63h(v) + 6r(v). -81v3 Let q(p) = 4p - 75. Let i(s) = 2s - 38. What is 7i(o) - 3q(o)? 2o - 41 Let c be 5 + 1(-5 + 4). Let v(n) = 6n - 1. Let t(q) = 7q - 1. Give ct(x) - 5v(x). -2x + 1 Let m(r) = r*2 + 1. Let j = -9 + -7. Let x(i) = 2i + 31. Let p be x(j). Let u(n) = -3n + 2. What is pu(o) + 2m(o)? 2o*2 + 3o Let h = -28 - -12. Let s = -14 - h. Let j(m) = -m*2 - 2m + 2. Let n(t) = t*2 + 3t - 3. What is sn(x) + 3j(x)? -x*2 Let q(c) = 5c*3 - 4c*2. Let z(j) = 11j*3 - 7j*2. Suppose -7 = -a + 3g, -2a - 185 + 192 = g. What is az(p) - 7q(p)? 9p*3 Let f(a) = -2a*2 - a - 1. Let k(n) = -2n*2 + 20n - 2. What is -f(b) - k(b)? 4b2 - 19b + 3 Let z(h) = -4h - 1. Let s(a) = 2a - 2a + a - a + 1 + 4a. Give 3s(m) + 4z(m). -4m - 1 Let b = -1370 + 1364. Let r(x) = -3 + 5 + 3x*2 - 3 + x. Let s(l) = -4l*2 - l + 1. Give br(k) - 5s(k). 2k2 - k + 1 Let x(t) = t2. Suppose 269 - 219 = -10b. Let o(s) = -s - 1. Let i(z) = -5z*2 - 2z - 3. Let w(h) = -2i(h) + 6o(h). What is bx(r) + w(r)? 5r*2 - 2r Let a(y) = -9y3 + 5y*2 - 9y. Let v(f) be the second derivative of -f5/4 + f4/4 - 5f3/6 + 200f. What is 6a(t) - 11v(t)? t*3 - 3t*2 + t Let m(n) = -5n + 2. Let p(b) = b. Let h(a) = a*3 + 4a*2 + 3a - 4. Let w be 9/(-2)2/3. Let u be h(w). Determine up(l) - m(l). l - 2 Let n(o) be the second derivative of 7o4/12 - 2o*3/3 + 3o*2/2 - 198o. Let w(j) = -10j2 + 6j - 4. Determine -7n(b) - 5w(b). b*2 - 2b - 1 Let x(f) = -5f3 - 5f*2. Let o(w) be the first derivative of -3w*4/4 - 2w*3/3 + 1162. Suppose 13 = 5r - 12. Calculate ro(j) - 2x(j). -5j3 Let o(x) = 6. Let c(h) = 10h - 39. Let s(u) = -3u + 11. Let w(f) = 2c(f) + 7s(f). Give -o(i) - 3w(i). 3i - 3 Let v(m) = m2 - 6. Let c be 31/12. Let r(u) = -2u*2 + 13. Calculate cr(k) + 13v(k). k2 Let j = 827 - 828. Let t(a) = 3a + 1. Let w(l) = -l - 1. Calculate jt(q) - 2w(q). -q + 1 Let t(p) = -3p2 + 5p + 5. Let x(u) = -u*2 + 2u + 2. Let y = 18 + -17. Suppose 11 - y = -z. Calculate zx(l) + 4t(l). -2l2 Let p(n) = -34n*2 + 5n - 1. Let b(d) = -102d2 + 16d - 4. Give 5b(c) - 16p(c). 34c2 - 4 Let c(v) = -2v3 + v2 - v - 1. Let q(d) = -423d3 - 2d*2 + d + 1. Give c(f) + q(f). -425f3 - f2 Let z(a) = -2a3 + 2a2 + 2. Let l(o) be the second derivative of o5/10 - o4/4 - o2 + 272o. Give -5l(u) - 6z(u). 2u*3 + 3u*2 - 2 Let q(p) = -11p*2 + 3p - 5. Let j(y) = y - 1. What is -3j(b) + q(b)? -11b*2 - 2 Suppose -100 + 58 = -14v. Let n = 12 + -7. Let p(u) = -2u2 - 2u + 1. Let i(c) = 3c2 + 3c - 1. Determine np(j) + vi(j). -j2 - j + 2 Let d(u) be the second derivative of u4/6 - u*3 - 2u*2 + 8u. Let n = 14 - 6. Let b(r) = -3r2 + 7r*2 - 3r - 7 - nr. Give 6b(s) - 11d(s). 2s*2 + 2 Let s(b) = -2b - 3. Let h(g) = -10g - 16. Suppose -2v + 10 = q, 2q + 3v - 11 - 12 = 0. Calculate qs(u) - 3h(u). -2u Let t(s) = s2 + 3 - 17s*2 + 15s*2 - 2s. Let j(w) = -w. Let g(u) = -u*2 - 6u + 5. Let o(y) = g(y) - 2j(y). Calculate 3o(f) - 5t(f). 2f*2 - 2f Let s(a) = -1. Let n(c) = 5c + 4. Let z be ((-8)/22)/(6/(-66)). Determine zs(v) + n(v). 5v Let i(t) = -t - 2. Let p(d) = d + 3. Suppose -3u + u + 3f + 17 = 0, -4f - 24 = -3u. Let l = -126 + 129. Give lp(x) + ui(x). -x + 1 Let a(w) = -3w + 194. Let u(v) = v - 97. What is -3a(y) - 7u(y)? 2y + 97 Let i(f) = -4f*2 + 13f - 9. Let g(p) = -2p2 + 7p - 5. Let u be (2/(-1) - -13)(46 - 45). Calculate ug(k) - 6i(k). 2k*2 - k - 1 Let m(f) = -8f - 1. Let w(o) = 3o - 20. Let i be w(7). Let u be (i - -2)(-4)/3. Let x(q) = -q. Calculate ux(v) + m(v). -4v - 1 Let m(g) = -10g + 7. Let n(j) = 4j - 2. Give -3m(r) - 7n(r). 2r - 7 Let l = 2 - 1. Suppose 10f + 24 = 12f. Suppose 0 = -4v + f, 3v = 3p + 6v - 12. Let m(x) = -x. Let r(z) = z3 + z. What is lr(u) + pm(u)? u3 Let j(g) = 3g + 3. Suppose -4 + 3 = -y. Let z(u) be the first derivative of -u*2/2 - u - 1473. Determine yj(c) + 2z(c). c + 1 Let f(l) = -4l + 10. Let u(v) = -3v + 9. Let d(r) = r + 1. Let z be d(2). Give zu(i) - 2f(i). -i + 7 Let q(l) = -23l - 591. Let h(i) = 9i + 295. Calculate 5h(t) + 2q(t). -t + 293 Let h(v) = -4v*3 - 6v*2 - 9v. Let s(y) = -9y3 - 13y*2 - 20y - 1. Calculate -13h(z) + 6s(z). -2z3 - 3z - 6 Suppose -4i + 4j = -40, -5i = 4j + 4 - 27. Let x(y) = y + 3y - iy - 5 - 3y2 + y2. Let h(v) = v2 + v + 1. Give -5h(k) - x(k). -3k2 - 2k Let k(m) = -m*2 - 4m - 5. Let u = -12 - -16. Let g(t) = 2t. Let x(a) = -3a - 1. Let f(z) = -g(z) - x(z). Calculate uf(j) + k(j). -j2 - 1 Let u(y) = -y. Let a(h) be the third derivative of -h4/8 + 2h*2. Let l be (-12)/10 - -1(-68)/85. Determine la(f) + 7u(f). -f Let t(j) = 3j2 + 2j + 13. Let u(f) = 2f2 + f + 6. What is 3t(k) - 5u(k)? -k2 + k + 9 Let b(a) = -a2 + 1. Let t(n) = 15n*2 + 5. What is -10b(r) + 2t(r)? 40r*2 Let c(b) = b + 14. Let d be c(-7). Let h be (-4 - 2)4/6. Let w(o) = 6o - 3. Let y(m) = 11m - 5. What is dw(s) + hy(s)? -2s - 1 Suppose 2s - 3t = -7, -118 = 3t - 115. Let u(k) = -5k2 + k2 - 2 - 3k - 2. Let w(c) = 9c2 + 7c + 9. Calculate su(l) - 2w(l). 2l2 + l + 2 Suppose 14w + 32 = -2w. Let g(p) = 3p. Let i(b) = 7b. What is wi(k) + 5g(k)? k Let x(n) = n - 3. Let v(u) = 23u*2 + u + 1. Let k(s) = 63s*2 + 3s + 2. Let w(l) = 4k(l) - 11v(l). What is 3w(y) - 4x(y)? -3y2 - y + 3 Let m(b) = b2 + 2b. Let t(r) = -243r2 - 8r. Give 4m(v) + t(v). -239v*2 Let b(r) = 13r*2. Let y(d) = -40d*2. Suppose 229 = 31f - 19. What is fb(a) + 3y(a)? -16a2 Let w(p) = 2p*2 + 3p + 1. Let t(y) = -y*2 - 2y. Suppose 30d - 6d = -72. Let b be (-3)/3 - -2 - 3. Determine bw(g) + dt(g). -g*2 - 2 Let t(x) = 11x*2 + 19x - 17. Let v(b) = 9b2 + 19b - 14. Determine -5t(j) + 6v(j). -j*2 + 19j + 1 Let p(l) = 51l*2 +	{ "pile_set_name": "DM Mathematics" }
ulate the remainder when 136 is divided by h. 21 Let r(d) = 2d + 25. Let i be r(-6). Suppose 286 = iv + 78. What is the remainder when 75 is divided by v? 11 Suppose 0c + 423 = -4c + k, 4k = -5c - 534. Let j = -75 - c. Suppose 11 = d - 0d. What is the remainder when j is divided by d? 9 Let z = 191 - 131. Suppose d = -d + z. Suppose 132 = k + 45. Calculate the remainder when k is divided by d. 27 Suppose 2v - 41 = 25. Calculate the remainder when v is divided by 15. 3 Suppose l - 1734 = -l - 5p, 2p + 3516 = 4l. Let h = l - 613. What is the remainder when h is divided by 53? 52 Let r(m) = m3 - m2 - 19m - 10. Let k(w) = -w + 14. Let p be k(6). Suppose -2g + p = -g. Calculate the remainder when r(-3) is divided by g. 3 Let q(u) = u2 + 5u + 17. Let d = -8 + 14. Calculate the remainder when q(0) is divided by d. 5 Let j(u) = -8u2 + u + 1. Let k(c) = -c2. Let g(z) = j(z) - 3k(z). Let o be g(2). Calculate the remainder when 57 is divided by 3(-6)/9 - o. 12 Let t = -179 + -29. Calculate the remainder when t/(-12) + 4(-1)/(-6) is divided by 5. 3 Suppose -3a - 744 = -15a. What is the remainder when a is divided by 11? 7 Let h = 86 - 14. Calculate the remainder when h is divided by 30. 12 Calculate the remainder when 4 is divided by 6/(180/70) + (-2)/6. 0 Let s = -148 - -156. Let d = -59 - -114. Calculate the remainder when d is divided by s. 7 Let r(s) = 1. Let t(o) = -5o + 30. Let k(b) = 25r(b) - t(b). Calculate the remainder when 19 is divided by k(3). 9 Let k = -299 - -316. Calculate the remainder when 48 is divided by k. 14 Suppose -d + 12 + 0 = 0. What is the remainder when 58 is divided by d? 10 Let u = 78 + -113. Let w = u + 45. What is the remainder when w is divided by 5? 0 Suppose -4 = -a - 0. Let q be 0/(12/3) + -8. Let k(i) = -3i - 11. What is the remainder when k(q) is divided by a? 1 Suppose -290 - 242 = -19p. What is the remainder when 218 is divided by p? 22 Calculate the remainder when 7 is divided by (8 + 10 + -11)3/7. 1 Let f = -61 - -82. What is the remainder when 182 is divided by f? 14 Suppose 5t - 97 = -2x, 0 = 3t - 5x + 21 - 104. Let q = 42 - 24. What is the remainder when t is divided by (q/(-30))/(2/(-20))? 3 Let q be 0/(-2) + (-1 + 7 - 2). Suppose 11 = qi - 3p - 39, 0 = -4i + 2p + 52. Calculate the remainder when 24 is divided by i. 10 What is the remainder when 116 is divided by (84/(-98))/((-6)/56)? 4 Suppose -18 = -5z - h + 279, -5z + 2h + 291 = 0. Suppose 3x = 5c - 13 + z, 5x - 122 = -3c. What is the remainder when 152 is divided by x? 20 Suppose 16n + 2v - 604 = 13n, -2v = -n + 196. Calculate the remainder when n is divided by 71. 58 Let g(u) = -u + 6. Let j(v) = v + 11. Let f be j(-14). Let w be g(f). Let x = 17 - w. Calculate the remainder when 14 is divided by x. 6 Suppose p - 1 = 3, -p = -m + 106. What is the remainder when m is divided by 38? 34 Let w = -199 + 202. What is the remainder when 16 is divided by w? 1 Suppose 5b = 5g - 310, -3g + 2b - 108 = -5g. Suppose g = 10w - 9w. What is the remainder when w is divided by (-10)/(-12/4)? 18 Let o(y) = 5y3 + 4y - 36. Calculate the remainder when o(7) is divided by 38. 35 Let p = -2 + 3. Calculate the remainder when 122 is divided by p - 30(-1 + 0). 29 Let w be (-111)/6 - (-12)/(-8). Let a = w + 20. Suppose -7g + 9g - 8 = a. Calculate the remainder when 11 is divided by g. 3 Suppose -47n + 2980 = -2660. What is the remainder when 719 is divided by n? 119 Suppose -10i - 62 = -12i. Let l = i + -20. Calculate the remainder when 42 is divided by l. 9 Suppose 3b = 5b - 90. Suppose -14x + 10x = -28. Let v(u) = u*2 - 5u - 2. Calculate the remainder when b is divided by v(x). 9 Let h = -15 + 17. Suppose hm - 22 = 48. Calculate the remainder when 4/(-1((-104)/34 - -3)) is divided by m. 33 Let i(p) = 288p3 - p2 - 1. Calculate the remainder when i(1) is divided by 36. 34 Let a = 22 - -7. What is the remainder when a is divided by -8 - 598/(-35)? 5 Let n = -12 + 4. Let y = n + 39. What is the remainder when y is divided by 4/(-6) + (-26)/(-3)? 7 Let f = -62 - -93. Let t(m) be the first derivative of m*3/3 + 2m*2 + 6m - 23. What is the remainder when f is divided by t(-5)? 9 Suppose 0 = -3k + 4m + 53, 3m - 41 + 6 = -k. Let v = -17 + k. Calculate the remainder when 8 is divided by v. 2 Let v(d) = 2d*2 + 43d - 65. Let l = 3 + 14. Calculate the remainder when l is divided by v(-23). 1 Suppose 0 = -3y + 3m + 12, -2y - y + 40 = 4m. Calculate the remainder when 39 is divided by y. 7 Let t(u) = -u*2 + 8u + 9. Let v = -237 + 271. What is the remainder when v is divided by t(8)? 7 Let q(b) = b*2 + 83b + 873. What is the remainder when q(-72) is divided by (-1 - (-1 + 1)) + 22? 18 Suppose 5f - 4u + 35 = 0, 26 = -f - f + 4u. Let p(b) = -11b - 2. Let n be p(f). Suppose 3z - n = 122. What is the remainder when z is divided by 13? 12 Suppose 9n - 28 = 5n. Suppose -no + 0o = 0. Suppose o = 5d - 168 + 53. Calculate the remainder when 67 is divided by d. 21 Suppose -5 = v - 2v. Suppose -3t + vc - 3c = 315, 3t + 4c = -315. What is the remainder when 16 is divided by 2/5t/(-7)? 4 Let w be (1 + 5)1 + -2. Suppose -y + 2 = -2y + 5r, -y - r = -w. Calculate the remainder when 3 is divided by y. 0 Let n(g) = -g - 3. Let y be n(-14). Suppose 3d - y = 2d. Calculate the remainder when d is divided by 4. 3 Let j = 1355 + -642. What is the remainder when j is divided by 34? 33 Suppose 456 = 2x + 2f + 146, -2f - 306 = -2x. What is the remainder when x is divided by 4? 2 Suppose 419o = 417o + 134. What is the remainder when o is divided by 6? 1 Let y(g) = -g*3 - 3g*2 + 6g - 2. Suppose -4o = -20, 3z - 5o - 20 = -0z. Suppose -r - 4 + z = 0. Calculate the remainder when y(-5) is divided by r. 7 Let p(x) = 4 + 0x - x - x2 + 61 - x3. Let o(t) = 5t*3 - 2t*2 - t. Let a be o(0). What is the remainder when p(a) is divided by 17? 14 Let v = -109 + 182. Let l = v + -59. What is the remainder when ((-5)/4)/((-1)/20) is divided by l? 11 Suppose -f + 2f - 76 = 0. Let v = f - 34. What is the remainder when v is divided by 321/21 + 2/(-7)? 12 Let c(p) = -7p + 17. What is the remainder when 269 is divided by c(-4)? 44 Let u(o) = -o3 + 16o*2 + 7. What is the remainder when 12 is divided by u(16)? 5 Suppose 5 = 2i - 1. Suppose 36 = h - ib, 4b - 52 = h - 3h. Calculate the remainder when h is divided by 13. 4 Let g = -43 + 62. Suppose k - g = -5b, -2b + 12 - 2 = k. Suppose -2s - x + 10 = -13, 4s - bx - 21 = 0. What is the remainder when 17 is divided by s? 8 Suppose 6q = -4y + 10q + 48, 0 = y + 3q - 36. Let s(h) = h*2 + 4h + 8. What is the remainder when s(6) is divided by y? 14 Let h(y) = 4y - 31. Let j be h(9). Let s = j + 25. What is the remainder when 115 is divided by s? 25 Suppose -12k + 18 = -10k. Let j be (-4 + 2)/((-2)/10). Suppose -4b = 2h - 69 - 23, -5h - j = 0. What is the remainder when b is divided by k? 6 Let b = 31 - -38. What is the remainder when b is divided by 14? 13 What is the remainder when 3231 is divided by 4 + 146 + 2 - 5? 144 Let s = -24 - -27. Let c be (1/2)/(s/36). What is the remainder when 18 is divided by c/(-27) + 195/27? 4 Suppose -3i + 5m + 96 = 0, 6m = 4i + m - 128. Calculate the remainder when 369 is divided by i. 17 Let m = 147 - 105. Calculate the remainder when 246 is divided by m. 36 Let c(p) = -2p + 20. Let u be c(-6). Let z(j) = -j3 - 7j*2 - 5j. Let s be z(-5). Let r = u + s. What is the remainder when 19 is divided by r? 5 Let v = 40 + -27. Let a(j) = 3j2 + 2j + 3. Let x be a(-6). Let w = -38 + x. What is the remainder when w is divided by v? 9 Suppose 5l + 4o = 197, 13 - 5 = -4o. Suppose -g + 0g = -l. Calculate the remainder when g is divided by 11. 8 What is the remainder when 36 is divided by (2/6)/((-11)/(-462)) - 4? 6 Let k(g) = 34g3 - 7g*2 + 5g + 8. What is the remainder when k(2) is divided by 36? 10 Let r(a) = a*3 - 12a*2 - 7a - 75. Suppose 5u - 4u = -3. What is the remainder when 6 - 4/6u is divided by r(13)? 2 Suppose 3h - 756 = 810. What is the remainder when h is divided by 25? 22 Let j(s) = 11s2 - 5s - 10. Let y(b) = b*2 - 13b + 9. Let n be y(12). What is the remai	{ "pile_set_name": "DM Mathematics" }
tiple of 2 and (12/30)/(f/(-50)). 10 What is the smallest common multiple of 6 and 1630/8 - 9/(-36)? 204 Suppose w - 2 = 2w. Let j = w + -3. Let a(q) = -q3 - 6q*2 - 7q - 2. Calculate the least common multiple of a(j) and 6. 24 Let x be 404/(-20 - (1 - 0)). Let v = 10085/462 + x. Calculate the common denominator of -79/16 and v. 176 Let c be ((-22)/8)/((-1)/4). Let n = c - 9. What is the lowest common multiple of 5 and 0 + 6 - (6 - n)? 10 Find the common denominator of -52/11 and (12/8)/((-44)/231). 88 Let i = 239497/12 - 19970. Calculate the common denominator of -101/44 and i. 132 Let g(h) = h*2 - 10h + 3 + 0h2 - 4. What is the smallest common multiple of g(11) and 10? 10 Let n(p) = 25p - 16. Let r be n(8). Suppose 16 = -5k - r. What is the lowest common multiple of k/(-18) - (-16)/(-72) and 7? 14 Let x = 28 - 16. Suppose 8n = xn - 56. What is the least common multiple of n and 94? 658 Let t = 747023/1044 - 20049/29. Let g = t - 99/4. Find the common denominator of 73/33 and g. 99 Let w = 115/12 + -89/24. Let r = 15197/10 + -1523. What is the common denominator of r and w? 40 Let v be -1 - (-22)/3 - 7/21. What is the lowest common multiple of 56/v3(-30)/(-35) and 66? 264 Suppose 2q + 10q - 216 = 0. Suppose -4j + 26 = -q. Calculate the smallest common multiple of j and (3 - 5)/(-2 + 0). 11 Let m be (-3 + 1 - -3)-8565. Let k = 154267/18 + m. Calculate the common denominator of -23/30 and k. 90 Let i(c) = 7 - 14 + c2 + 0c + 2c - 4c. Calculate the smallest common multiple of i(4) and 2. 2 Suppose -80 = -2d - 2d. Let i = -118 + 172. Suppose -4g = -i - 34. What is the least common multiple of d and g? 220 What is the common denominator of ((-101065)/(-900))/(-17) + 7 and 19/33? 1980 Let d(n) = 28n + 32. Let t be d(-8). Let b = t - -1493/8. Calculate the common denominator of -21/26 and b. 104 Let d = 5190069/296 - 17534. Find the common denominator of 113/80 and d. 2960 Suppose 77 = 5q - 28. What is the smallest common multiple of q and 9? 63 Suppose 0 = -4w - 19 + 43. What is the least common multiple of 68 and w? 204 Let f = -304989/560 - -8743/16. Calculate the common denominator of -29/70 and f. 70 Let r = 686 - 278. Calculate the smallest common multiple of 12 and r. 408 Let i = 2671/12 - 221. Let z = -10027/4632 + -3/1544. What is the common denominator of i and z? 12 Let y(a) = 11a - 3. What is the lowest common multiple of y(3) and (32 - 0)/(-8 + 19 - 9)? 240 Let k(h) = 16h - 9h3 + 8h*3 - 3h*3 + 3h*3 + 14h*2 - 6. What is the least common multiple of k(15) and 2? 18 Let x = 66 - 30. Calculate the smallest common multiple of x and 60. 180 Suppose 3x + 3l - 6 = 5l, x + 4l = 2. Suppose xu = -24 + 56. Let r = -55 - -59. What is the smallest common multiple of r and u? 16 Suppose -5m + 4r = -16, 2m - 2r - 8 = 3m. Suppose m = 4a - 3a. Suppose -n + 1 = -a. What is the smallest common multiple of 9 and n? 9 Let i = 71/10 - 34/15. What is the common denominator of 125/12 and i? 12 Suppose 5 = -2d + 33. Calculate the least common multiple of d and 28. 28 Let k = 796 - 446. Let c = 158/69 + 46397/138. Let g = c - k. What is the common denominator of g and 3/4? 4 Let m(p) = 2p2 - p + 2. Let o be ((-2)/6)/((-5)/(-35 + 5)). What is the smallest common multiple of m(o) and 36? 36 Suppose 3n - 63 + 57 = 0. Let g(r) = -r*3 + 10r*2 - 9r + 9. Calculate the lowest common multiple of n and g(9). 18 Let r be -471/2(-7 - -3). Let t = r + -31. Calculate the smallest common multiple of 3 and t. 63 Let f be ((-6)/10)/1 + 6578/130. Suppose 12a = 7a + f. Suppose -4j + 1 = -3v, -j = v + 4j - 25. Calculate the lowest common multiple of v and a. 10 Let w = -1063/1320 - 292/165. Calculate the common denominator of (-6)/180126/(-10) and w. 200 Find the common denominator of -49/15 and (-116)/(-40) - ((-44)/30)/(-11). 30 Let v(u) = 2u + 21. Let b(c) = -c - 11. Let x(h) = 7b(h) + 3v(h). Let d be x(-10). What is the common denominator of -67/10 and (d/(-96))/((-1)/10)? 60 Calculate the common denominator of (-6510)/522 - -3 - -9 and 169/30. 870 Let a = -67821/272 + 4140/17. Calculate the common denominator of (-79)/(-3)6/(-28) and a. 112 Suppose -2q = -4, x - q + 5q - 20 = 0. Calculate the smallest common multiple of 6 and ((-18)/x)/(3/(-12)3). 6 Suppose -y + 15 = -3u, 4u = -0u + y - 20. What is the common denominator of ((-19)/u)/((-224)/40) and -109/18? 252 Let r = -6 - -41. Suppose 2m = -5x + r + 2, 4x = m + 14. Calculate the smallest common multiple of 58 and m. 174 Let x(p) = 89p*2 + p + 2. Let b be x(-1). Suppose 0 = 7r - 2r - b. Calculate the smallest common multiple of r and 12. 36 Calculate the smallest common multiple of (-316)/(-18) - 12/(-27) and 33. 198 What is the common denominator of 2378/168 + (-32)/(-336) and -47/60? 60 Let t = 5560/36163 - 168/1247. Let i = t + 120071/10092. Find the common denominator of i and (-130)/(-416)76/(-6). 24 Let j(t) = -9t2 + 4t + 234. Calculate the smallest common multiple of 72 and j(0). 936 Suppose -4t + 31 = -3f, 2t = -4f + 12 + 20. What is the smallest common multiple of 392 and t? 1960 Suppose 3z = 2z + 66. Let c be ((-98)/7)/(-1) - 3. Suppose cn = 8n + z. What is the smallest common multiple of 8 and n? 88 Suppose -2i - 180 = 36. What is the common denominator of (32/i)/(4/(-84)) and -33? 9 Suppose 3k - 20 = -8, -4k - 24 = -5y. What is the least common multiple of y and 44? 88 Let t = -1582 + 6255/4. Calculate the common denominator of t and -95/18. 36 Suppose 33d = -564 + 1653. Let g(j) = 5j*2 - 2j - 4. Calculate the least common multiple of g(2) and d. 132 Let k = 625538905496985841/242220 + -2582523761453. Let f = k - -2/20185. Calculate the common denominator of 32/15 and f. 60 Let q = -108003/16 - -6746. Calculate the common denominator of q and -45/14. 112 Let r = 529 + -527. Calculate the least common multiple of r and 249. 498 Let y be (3 + -1)(-35)/(-14). Suppose 0 = -3p - 5l + 43, -82 = -5p + 6l - 4l. Suppose -yz = -44 - p. Calculate the smallest common multiple of z and 8. 24 Let u(f) = -f2 - 8f. Let s be u(-8). Suppose s = 7w + 24 - 206. What is the smallest common multiple of w and 4? 52 Let f = 317/50 + -9/100. Calculate the common denominator of f and -2/11. 44 Let j = 5646001/3720 + -36359/24. Let h = j - 15/31. What is the common denominator of 63/8 and h? 40 Find the common denominator of 121/18 and ((-603)/144)/(10/2). 720 Suppose 0 = 4u - 5 - 7. Suppose 3j + 633 + 456 = uz, -2z - 5j + 698 = 0. Let c = z - 1817/5. Calculate the common denominator of c and 19/3. 15 Let y = -69 + 149. Suppose -5i + r - 21 = -y, 2r = -5i + 62. Find the common denominator of (-9)/i(-244)/(-42) and -38/3. 42 Suppose 2w + 20 = -4. Let d = 17 + w. Calculate the smallest common multiple of d and 10. 10 Let v(h) = -12h - 116. What is the smallest common multiple of 132 and v(-17)? 264 Suppose -8d + 47 = -4d - 5k, 65 = 5d - 5k. Suppose -3m + 100 = 4q, -7q + 5m = -10q + 86. What is the smallest common multiple of q and d? 198 What is the common denominator of 12/6(-1 + 106/80) and 41/(-6) - (16 + -17)? 60 Suppose -2p = -2a + 40, -2a - 2p + 40 + 16 = 0. Calculate the smallest common multiple of 8 and a. 24 Let o be 6/(-30) - 21/(-90). Let i = o - 10/3. Calculate the common denominator of i and -23/3. 30 Let m be 2 + (-12 + 2)2. Let n = -13 - m. Calculate the least common multiple of n and ((-2)/(-1))/(8/966). 20 Let j(d) = -d2 - 10d - 8. Calculate the lowest common multiple of 18 and j(-8). 72 Let x = 345707/94290 - -54/2245. Calculate the common denominator of -17/18 and x. 126 Let n(g) = 2g - 26. Let w be n(16). What is the smallest common multiple of w(78/9 + 1) and 12? 348 Suppose 0 = 2o - 3o + 1176. Suppose -4s - o - 2388 = 0. What is the common denominator of -31/9 and (s/88)/((-2)/(-8))? 18 Let n(m) = m2 - 6m + 6. Let q be n(6). Calculate the common denominator of 9/((-24)/(-4) - -4) and 2/8 + (-76)/q. 60 Let c(t) = 2t2 + 15t - 48. Let p(a) = a**2 - a - 1. Let q(j) = -c(j) + p(j). What is the lowest common multiple of q(-17) and 3? 30 Suppose 4966 + 979 = -o. Let x be (-7 - -9) + o + 0. Let d = 65418/11 + x. Calculate the common denominator of d and 1/8. 88 S	{ "pile_set_name": "DM Mathematics" }
4, -4892, -5288, -5772? -44l2 - 4188 What is the d'th term of -2584, -10342, -23274, -41380, -64660, -93114, -126742? -2587d*2 + 3d What is the u'th term of 1106, 1196, 1276, 1340, 1382, 1396? -u3 + u2 + 94u + 1012 What is the g'th term of 1499, 1526, 1553, 1580, 1607? 27g + 1472 What is the v'th term of 12, 98, 212, 336, 452? -3v3 + 32v*2 + 11v - 28 What is the i'th term of 9534, 38229, 86054, 153009? 9565i2 - 31 What is the w'th term of -20264, -20229, -20196, -20165, -20136, -20109, -20084? -w2 + 38w - 20301 What is the o'th term of 408, 1674, 3796, 6774? 428o2 - 18o - 2 What is the b'th term of 14577, 14635, 14787, 15081, 15565, 16287, 17295? 8b3 - b2 + 5b + 14565 What is the b'th term of -253441, -506883, -760325, -1013767? -253442b + 1 What is the n'th term of 2499, 2500, 2503, 2508, 2515? n2 - 2n + 2500 What is the q'th term of 4173, 4152, 4131? -21q + 4194 What is the u'th term of 85, -74, -339, -710, -1187, -1770? -53u*2 + 138 What is the p'th term of -89, -209, -397, -653, -977, -1369? -34p*2 - 18p - 37 What is the g'th term of -13177, -26335, -39495, -52657, -65821, -78987, -92155? -g*2 - 13155g - 21 What is the c'th term of -3855, -3605, -3189, -2607, -1859, -945, 135? 83c2 + c - 3939 What is the r'th term of -233, -621, -1021, -1433, -1857, -2293, -2741? -6r*2 - 370r + 143 What is the q'th term of 2828, 2820, 2820, 2834, 2868, 2928? q*3 - 2q*2 - 9q + 2838 What is the a'th term of -236, -228, -198, -140, -48, 84? a*3 + 5a*2 - 14a - 228 What is the u'th term of 155, 229, 225, 143, -17? -39u2 + 191u + 3 What is the j'th term of 355, 2940, 9939, 23554, 45987, 79440, 126115? 367j3 + 5j*2 + j - 18 What is the r'th term of 178410, 356829, 535248? 178419r - 9 What is the n'th term of 178, 1503, 5104, 12121, 23694, 40963, 65068, 97149? 190n3 - 2n*2 + n - 11 What is the q'th term of -7536, -15152, -22768, -30384, -38000, -45616? -7616q + 80 What is the h'th term of -152254, -304503, -456752, -609001, -761250? -152249h - 5 What is the g'th term of -2100, -2253, -2406? -153g - 1947 What is the f'th term of 1878, 3758, 5636, 7512, 9386, 11258, 13128? -f*2 + 1883f - 4 What is the q'th term of 191, 706, 1547, 2720, 4231? q*3 + 157q*2 + 37q - 4 What is the h'th term of -170, -248, -480, -950, -1742, -2940, -4628, -6890? -14h3 + 7h*2 - h - 162 What is the f'th term of -81955, -163912, -245869, -327826, -409783, -491740? -81957f + 2 What is the a'th term of -387, -316, -245, -174, -103, -32? 71a - 458 What is the d'th term of -2541, -5089, -7651, -10221, -12793, -15361? d3 - 13d*2 - 2516d - 13 What is the g'th term of 5274, 5268, 5264, 5262? g*2 - 9g + 5282 What is the a'th term of -377, -646, -751, -614, -157? 13a3 + 4a*2 - 372a - 22 What is the z'th term of 19, 264, 673, 1246? 82z2 - z - 62 What is the z'th term of 4023, 8035, 12047, 16059, 20071, 24083? 4012z + 11 What is the g'th term of 843565, 1687131, 2530697, 3374263, 4217829, 5061395? 843566g - 1 What is the p'th term of 4707, 18850, 42421, 75420? 4714p*2 + p - 8 What is the h'th term of -7915, -7951, -7987, -8023? -36h - 7879 What is the c'th term of -536, -2117, -4728, -8363, -13016? c*3 - 521c*2 - 25c + 9 What is the y'th term of -475416, -950836, -1426256, -1901676? -475420y + 4 What is the g'th term of 105, 115, 1, -261, -695, -1325? -4g*3 - 38g*2 + 152g - 5 What is the d'th term of 11, 67, 225, 533, 1039, 1791? 8d3 + 3d*2 - 9d + 9 What is the g'th term of 3175, 3111, 3047, 2983, 2919? -64g + 3239 What is the p'th term of 42, 280, 980, 2388, 4750, 8312, 13320? 41p*3 - 15p*2 - 4p + 20 What is the l'th term of -539, -629, -707, -767, -803, -809? l*3 - 97l - 443 What is the t'th term of -37821, -37871, -37933, -38013, -38117? -t*3 - 43t - 37777 What is the d'th term of -46, -59, -76, -97, -122, -151? -2d2 - 7d - 37 What is the f'th term of 41, 41, 43, 47, 53? f*2 - 3f + 43 What is the d'th term of -344, -154, 26, 190, 332, 446, 526, 566? -d3 + d2 + 194d - 538 What is the r'th term of -1711, -1739, -1773, -1813, -1859, -1911? -3r*2 - 19r - 1689 What is the x'th term of 193280, 386559, 579838, 773117, 966396? 193279x + 1 What is the n'th term of -2291, -3895, -5499, -7103? -1604n - 687 What is the f'th term of 247, 141, -135, -665, -1533, -2823, -4619, -7005? -14f3 - f2 - 5f + 267 What is the h'th term of -361, -664, -977, -1306, -1657, -2036? -h3 + h2 - 299h - 62 What is the h'th term of -737, -3224, -7371, -13178? -830h*2 + 3h + 90 What is the m'th term of 629398, 629397, 629400, 629407? 2m2 - 7m + 629403 What is the f'th term of -305262, -610521, -915780, -1221039? -305259f - 3 What is the t'th term of 806, 3218, 7236, 12860, 20090? 803t*2 + 3t What is the s'th term of -295, -321, -371, -457, -591? -2s3 - 12s - 281 What is the n'th term of 33, 160, 419, 804, 1309, 1928? -n*3 + 72n*2 - 82n + 44 What is the p'th term of 232725, 465455, 698187, 930921, 1163657, 1396395, 1629135? p*2 + 232727p - 3 What is the c'th term of 2062692, 4125385, 6188078, 8250771? 2062693c - 1 What is the s'th term of -617, -719, -863, -1067, -1349, -1727? -3s*3 - 3s*2 - 72s - 539 What is the d'th term of -60084, -60085, -60086, -60087? -d - 60083 What is the d'th term of 4794, 9471, 14148, 18825, 23502, 28179? 4677d + 117 What is the g'th term of 38, 180, 430, 794, 1278? g3 + 48g*2 - 9g - 2 What is the j'th term of -1438, -2860, -4280, -5698, -7114, -8528? j*2 - 1425j - 14 What is the p'th term of -47114, -47175, -47238, -47303, -47370, -47439, -47510? -p*2 - 58p - 47055 What is the b'th term of 321205, 642410, 963615, 1284820? 321205b What is the s'th term of 16459, 16571, 16685, 16801, 16919, 17039? s2 + 109s + 16349 What is the g'th term of 12840, 25683, 38518, 51339, 64140, 76915? -g*3 + 2g*2 + 12844g - 5 What is the d'th term of 19397, 77571, 174527, 310265, 484785? 19391d2 + d + 5 What is the y'th term of 1926, 15559, 52576, 124671, 243538? 1949y*3 - 2y*2 - 4y - 17 What is the t'th term of 1069, 2153, 3237, 4321, 5405? 1084t - 15 What is the s'th term of 7077, 14161, 21245, 28329, 35413? 7084s - 7 What is the n'th term of -38010, -76002, -113994? -37992n - 18 What is the x'th term of 96597, 193250, 289903, 386556, 483209? 96653x - 56 What is the n'th term of 341, 231, 121, 11? -110n + 451 What is the m'th term of -1343, -5024, -11033, -19364, -30011, -42968, -58229, -75788? m3 - 1170m*2 - 178m + 4 What is the h'th term of -4210, -16783, -37738, -67075? -4191h2 - 19 What is the m'th term of 2631, 5398, 8309, 11364, 14563, 17906, 21393? 72m*2 + 2551m + 8 What is the h'th term of -1816, -3604, -5392? -1788h - 28 What is the b'th term of -259, -321, -383, -445, -507? -62b - 197 What is the d'th term of 1158, 1106, 1052, 996, 938, 878, 816? -d*2 - 49d + 1208 What is the f'th term of -19305, -38611, -57915, -77217, -96517? f*2 - 19309f + 3 What is the d'th term of -1287, -2853, -4407, -5943, -7455? d*3 - 1573d + 285 What is the z'th term of -22148, -22176, -22204, -22232, -22260? -28z - 22120 What is the x'th term of 10851, 43314, 97419, 173166? 10821x*2 + 30 What is the g'th term of 7414, 7415, 7420, 7429, 7442, 7459? 2g*2 - 5g + 7417 What is the m'th term of -62, -78, -80, -62, -18, 58, 172, 330? m3 + m2 - 26m - 38 What is the z'th term of -331, -367, -427, -511, -619? -12z2 - 319 What is the i'th term of 38069, 38091, 38115, 38141, 38169? i2 + 19i + 38049 What is the z'th term of -736, -753, -770, -787, -804? -17z - 719 What is the p'th term of 1738, 3446, 5140, 6814, 8462, 10078, 11656? -p3 - p2 + 1718p + 22 What is the d'th term of 252, 463, 664, 861, 1060? d3 - 11d*2 + 237d + 25 What is the j'th term of 71, 163, 251, 323, 367? -2j3 + 10j*2 + 76j - 13 What is the r'th term of 14204, 14220, 14236, 14252, 14268? 16r + 14188 What is the g'th term of 61662, 61688, 61762, 61908, 62150? 4g*3 - 2g + 61660 What is the a'th term of -1659, -3303, -4947, -6591, -8235? -1644a - 15 What is the w'th term of 2381, 5018, 7655, 10292, 12929? 2637w - 256 What is the b'th term of -148, -299, -468, -667, -908, -1203? -2b3 + 3b*2 - 146b - 3	{ "pile_set_name": "DM Mathematics" }
t(2200) - (sqrt(2200) + (sqrt(2200) - (2sqrt(2200) - sqrt(2200)))3 + sqrt(2200)))-3)/(-33sqrt(2) - sqrt(16)/(3sqrt(8))). -45sqrt(11)/14 Simplify 3 + (2(2sqrt(3) + sqrt(3))2-2 + 5 + sqrt(3)1 + -3)6. -633 + 6sqrt(3) Simplify (sqrt(190) + -5(sqrt(190) + (sqrt(190) - (sqrt(190) - sqrt(190)-2 - sqrt(190)))) + 2sqrt(190)1)/(sqrt(90)-2 - (sqrt(10) - sqrt(10)-12))3. -sqrt(19) Simplify (sqrt(162) + (sqrt(162) + 1 + -3sqrt(162))*2 - ((sqrt(162)31)2 + sqrt(162))) + (0 + (sqrt(88)/sqrt(4))/sqrt(11) + (-1 + sqrt(2))4)*2. -743 - 76sqrt(2) Simplify -4 + -5((-3 + sqrt(242) - sqrt(242)) + -5 - ((2sqrt(242) - sqrt(242))*2 + -1))1. 1241 Simplify (-5(sqrt(40) + sqrt(10)))/(sqrt(1980)/sqrt(11)) - (sqrt(490)-3)/(sqrt(30)/(sqrt(384) - sqrt(6))). 289sqrt(2)/2 Simplify ((5sqrt(315)1 - sqrt(315))/sqrt(9)-6)/(-4(sqrt(245) - -13sqrt(245))). 3sqrt(7)/14 Simplify ((4((1sqrt(132) - sqrt(132)) + sqrt(132)))/(-3(sqrt(6) - sqrt(6)2)))/(-26-1sqrt(891)). sqrt(2)/81 Simplify ((sqrt(2176) + (sqrt(2176) - 1sqrt(2176)))5 + sqrt(2176) - 2sqrt(2176)-2)/(sqrt(6050) + (5(sqrt(6050) - sqrt(6050)-4) - sqrt(6050))). 16sqrt(17)/275 Simplify (5 + -1(sqrt(98) + -1 + 5))2 - -3((-4 + (sqrt(98) - (1 + sqrt(98))))*2 - (1 + sqrt(98))5). -119sqrt(2) + 159 Simplify (4 + 6(1sqrt(1280) + sqrt(180) + 5)1)1. 34 + 132sqrt(5) Simplify ((-1 + sqrt(425)2 + sqrt(425))2 + 2)4 - (-3(3-2sqrt(204))/sqrt(12) + -1). -138sqrt(17) + 15313 Simplify ((sqrt(1764) + (-1sqrt(1764) - sqrt(1764)))-2)/(-6sqrt(28) + sqrt(63)/(sqrt(9)1))2. -24sqrt(7)/11 Simplify ((sqrt(2) - (sqrt(2)3 + -4)) + sqrt(2) - (sqrt(300)/sqrt(6))2) + 3 + ((sqrt(2) - sqrt(20)/(sqrt(10)-2))*2 + sqrt(6)/(sqrt(3)-3))-3. -113/2 Simplify -5 + (1 + sqrt(147) - sqrt(147) - (-2 + sqrt(9)/sqrt(3)))2 - (-4 + -42sqrt(363)). 11 + 82sqrt(3) Simplify (5 + 1-1sqrt(847)1-5 - -6(sqrt(847)16-5 + -1))*2. 3850sqrt(7) + 25939376 Simplify (sqrt(1008) + -1 + sqrt(1008))*2 + sqrt(112)/sqrt(4) + 2(4 + (sqrt(700) - (3 + sqrt(700)) - sqrt(7)))*2. -50sqrt(7) + 4049 Simplify (2-2sqrt(14) + (1sqrt(56) - sqrt(56)))/(sqrt(343) + sqrt(343) + (sqrt(343) - (sqrt(343) - (-3sqrt(343)-5 - sqrt(343))))). -sqrt(2)/28 Simplify (1sqrt(2100) - sqrt(525)5)/(sqrt(21)/(sqrt(3) + sqrt(432) + sqrt(432) + (sqrt(432) - sqrt(432)3 - sqrt(432)) + sqrt(3) + sqrt(3))). 135sqrt(3) Simplify ((-2sqrt(550))/sqrt(10))/(sqrt(704)-2) + (sqrt(45) + sqrt(45) + (sqrt(45) + (2 + sqrt(45) - sqrt(45)))2 - (-4 + sqrt(30)/sqrt(6))). 137sqrt(5)/8 + 53 Simplify 6-2(-5 + 5 + (sqrt(605) - (3(-2 + sqrt(605)) - sqrt(605) - sqrt(605))) + 1)2. -588 Simplify -2 + (sqrt(704)3-2 - (0 + sqrt(704) + 0 + sqrt(704))) + -2 + -4. -64sqrt(11) - 8 Simplify ((sqrt(3) - (sqrt(147) + sqrt(147)-1))-4 + -2 - (3 + (sqrt(147) + -1)2))2 + 0. 108sqrt(3) + 981 Simplify 5((sqrt(6) + sqrt(24))2)/(sqrt(10)/(sqrt(5)-2))4. -240sqrt(3) Simplify ((sqrt(576) + 4(sqrt(576)-3 - sqrt(576)))-4)/(-1sqrt(768)2-6). 5sqrt(3)/2 Simplify (sqrt(352)/(sqrt(8) + sqrt(128)))/(sqrt(12)/sqrt(3)2) + ((-1sqrt(66)6)/(sqrt(36)/sqrt(6)4))*2. sqrt(11)/10 + 99/4 Simplify (sqrt(336)/sqrt(6)4 + sqrt(56))/(sqrt(40)/(sqrt(5) - sqrt(45))) + (sqrt(560)-1 - sqrt(560))/(sqrt(100)/sqrt(5) + sqrt(5)). -38sqrt(7)/3 Simplify (-6(1 + sqrt(208) - sqrt(208) - sqrt(208))-2 + 31sqrt(208)4 + 1)2-4 + -2. -678 Simplify -3 + (sqrt(275) + (-3 + sqrt(275))-6 + 1 + -2 + 1)2. -900sqrt(11) + 7196 Simplify -5(2(-5 + -2 + -4((sqrt(343) - (-1 + sqrt(343))-2) + sqrt(343)))4)2. -28098880 + 71680sqrt(7) Simplify (-5(sqrt(378)/(sqrt(36)/sqrt(216)) - (sqrt(1575)1 + sqrt(63) + -2sqrt(63)2)) + 5)*2. -600sqrt(7) + 25225 Simplify (-4 + 31((sqrt(192) - (1 + sqrt(192))3) + -5 + sqrt(192)2 + 3))*2. 361 Simplify ((sqrt(4)/(2sqrt(72))6 + sqrt(128)/(-6(sqrt(4) - 2sqrt(4))))6)*2. 98 Simplify (-6(-1 + sqrt(475)) + 5 + sqrt(19)-2 + (sqrt(19) - 2sqrt(19)-6) + -4 + 4(sqrt(228)/(sqrt(36)/sqrt(3)) - sqrt(19)) + 0)*2. -266sqrt(19) + 6908 Simplify (-41(sqrt(187)-1 + sqrt(187))-3)/(sqrt(539) - -5sqrt(539)2 - -4(sqrt(539) - 1sqrt(539))). 0 Simplify (sqrt(85)-13 - -5(-1sqrt(85) - sqrt(85)))/(4(4sqrt(5)2 + (sqrt(125) - (sqrt(125) + sqrt(125)-2 + sqrt(125))))). -sqrt(17)/4 Simplify -6((-2 + (sqrt(1216)-1 - sqrt(1216)))*2 + ((sqrt(1216) - (sqrt(1216) + 1))-4)*2 + -46sqrt(1216)5). -29304 + 5376sqrt(19) Simplify (-5 + 1((-1 + (sqrt(612) - (0 + sqrt(612))))-1 - (0 + (sqrt(612) + 0 + sqrt(612) + sqrt(612) - sqrt(612)) + 4)) + -5)2. 312sqrt(17) + 2617 Simplify 4(((sqrt(13) + sqrt(26)/sqrt(50))2 - (sqrt(91) + -2sqrt(91))/sqrt(7)) + (sqrt(104)/(sqrt(8) - (sqrt(88)/sqrt(11) + sqrt(8))))*2 + -5). 4sqrt(13) + 2672/25 Simplify (sqrt(468) + (2 + sqrt(468))-4 - (2sqrt(468) + 3) - 4((sqrt(468) + 1)-5 + 4))*2. -1260sqrt(13) + 105349 Simplify (sqrt(1573)-4-5 + (3 + sqrt(1573) + sqrt(1573) - sqrt(1573))4 - (4 + 4 + sqrt(1573)-1 + -2))*2. 3300sqrt(13) + 983161 Simplify (-4(6-2(-1 + sqrt(363)) - (-6(1 + sqrt(363)) + sqrt(363) - (1(sqrt(363) - (sqrt(363) + 0)) - sqrt(363)))) + -3)2. -52800sqrt(3) + 377337 Simplify (1 + -3 + sqrt(5) + -5sqrt(180) + -2 + 0 + sqrt(5) + 1sqrt(45))4. -100sqrt(5) - 16 Simplify (-4 + 3(-3 + 3sqrt(180) + sqrt(180) + (sqrt(180)-11 - sqrt(180) - sqrt(180)) + 4))*2 + 0. -36sqrt(5) + 1621 Simplify ((4(sqrt(297) - -2sqrt(297)) + sqrt(297))/(1sqrt(44)/sqrt(4)))/(sqrt(900) + sqrt(900) + (sqrt(900)-4-5 - sqrt(900))). 13sqrt(3)/210 Simplify ((6(sqrt(108) + 2sqrt(108)) + 6-2sqrt(108) + 1)*2 + -1)4 + 0. 288sqrt(3) + 15552 Simplify (-6(sqrt(560) + (sqrt(560) - 1sqrt(560)))/sqrt(10) - (3(sqrt(672) - sqrt(672)-1))/sqrt(12))/(-6sqrt(1152)3 - sqrt(1152) - 4-3sqrt(1152)). sqrt(7)/7 Simplify (6(-5 + 3 + (sqrt(475) - sqrt(475)-1-1) + sqrt(475) + 1 + sqrt(475) + 2 + 4))*2. 3600sqrt(19) + 69300 Simplify -1 + 1 + sqrt(1700) + (sqrt(1700) + 1)*2 - (sqrt(17) + sqrt(51)/(sqrt(12)/sqrt(4)) - ((sqrt(136)-3)/sqrt(8))*2). 28sqrt(17) + 1854 Simplify 1 + (-4 + sqrt(325)-1 + sqrt(325))2 - ((-2sqrt(65)-2)/(sqrt(20)-3))*2. 101/9 Simplify 5 + ((sqrt(539) + sqrt(539)35 - 2sqrt(539)-2) + 4 + 3(1-1sqrt(539) + sqrt(539)))*2. 1120sqrt(11) + 215621 Simplify ((2 + 2 + 5sqrt(99) - (-1 + (4 + sqrt(99) + sqrt(99))5)) + 1 + -4)*2. 540sqrt(11) + 2799 Simplify ((-5((3 + (sqrt(300) - (sqrt(300) + -3))-5 + sqrt(300))3 + 4) + 2)-4)*2. -777600sqrt(3) + 1499904 Simplify (sqrt(204)/(1sqrt(6)) + sqrt(34))/(sqrt(6)/sqrt(3)-6) + (-12sqrt(187))/(sqrt(396) + sqrt(396)4 + sqrt(396)). -7sqrt(17)/18 Simplify ((sqrt(6336) - sqrt(6336)-3 - sqrt(6336) - -5sqrt(2816))/(-4sqrt(484)-52))2. 361/1100 Simplify (sqrt(425)2 - (sqrt(272)-2 - sqrt(272)) - (4 + (sqrt(1700) - (sqrt(1700)-3 + 4))))*2. 5508 Simplify (-15-1sqrt(114)-4)/(5(sqrt(36) + (sqrt(36) - sqrt(108)/sqrt(3)) + sqrt(36))/sqrt(6)-3). 2sqrt(19)/3 Simplify (5 + -2 + -2 + sqrt(605) - (-1 + sqrt(605) + (sqrt(605)1 + 0 + sqrt(605))2))2-3. 14508 Simplify (0 + (6((sqrt(77) - (sqrt(77) - (sqrt(77)-1-3 - sqrt(77))))2)/(sqrt(891) + ((sqrt(891) - sqrt(891)-1) + sqrt(891))6))2)-1. -448/3249 Simplify (sqrt(192) - (sqrt(192) + sqrt(192) + 4 + -3)*2) + sqrt(192) + (sqrt(192) + -1)-6 - ((((2 + sqrt(192) - sqrt(192)) + -5)-6)2 + 3). -1090 - 64sqrt(3) Simplify ((3sqrt(2156))2 - (sqrt(308)/sqrt(7) + 5)2) + (-3(1 + sqrt(44)) + 3)*22. -20sqrt(11) + 20127 Simplify sqrt(136)/((sqrt(288) + sqrt(8) + sqrt(8))-4 + sqrt(8))-2 + 4 + (6-1sqrt(2057))2. 2sqrt(17)/31 + 74056 Simplify (-6sqrt(312)/(sqrt(8)22))/(-6(sqrt(243) - sqrt(243)1) + sqrt(243) - (sqrt(243) - (sqrt(243) + -1-2sqrt(243)))). -sqrt(13)/18 Simplify (-5(sqrt(40)-3)/sqrt(5)-1)/((sqrt(484) - (sqrt(484) - (1sqrt(484) + sqrt(484)))4) + 6(sqrt(484)1 - sqrt(484))). -3sqrt(2)/11 Simplify -2 + ((((0 + sqrt(468) - sqrt(468))-3 - (sqrt(468) + 0)2) + (sqrt(468)-3 + sqrt(468) + sqrt(468))-3-3)-26)*2. 8154430 Simplify ((((sqrt(891) - (-3(sqrt(891) + 2 - sqrt(891)) + sqrt(891) - sqrt(891))) + -1 - 1(1 + -2sqrt(891))) + -2)3)2. 972sqrt(11) + 72207 Simplify (sqrt(102) - -3*(sqrt(102) + (sqrt(102) - (sqrt(10	{ "pile_set_name": "DM Mathematics" }
ng o is positive. o(2143/774) Simplify ((s(2/7))(6/5)/((s(-1/2)/s)/ss((s/(s/(s/(s/(s/s*(3/4))))))/s)/s))/((ss/s*1(s*(-5)s)/s)/(s*3/(ss/(s*5/s)s))) assuming s is positive. s(1623/140) Simplify ((m(1/37)/m)/(mm/(mmm(-7/9))m))/(m*(-6/7)m(2/85)) assuming m is positive. m(-379852/198135) Simplify (f*(-4/11)f(f(-9)/f)/fff(-19)f(-11))(-1/36) assuming f is positive. f*(433/396) Simplify (((yy(-3/7))/(y(-2)/y))/(((y(yyy(-14))/y)/y)/(y(11/6)/yy)))(3/32) assuming y is positive. y(773/448) Simplify d/d*(-5)d*5d*(-4/9)/(d/((d/(d(d*(-1)d)/d))/ddd))((dd*(-1/2)d)(2/41))(11/6) assuming d is positive. d(8627/738) Simplify (f(-30))*(3/10)(f/(f/(f*(-36)f)))/((ff(1/9))/f) assuming f is positive. f(-397/9) Simplify (q/(q(2/7)/q))18/(qq*3(q*(-4)q)/q)((q(1/2))(-3/29))(37/3) assuming q is positive. q(12269/406) Simplify ((n(nn1)/n)(-7)/(n3n)(-26))45 assuming n is positive. n4050 Simplify ((((q(2/3)q)/q)(1/19)q6/q(-1/2))(2/17))(3/14) assuming q is positive. q(745/4522) Simplify ((k/k29k(k*(-3/5)k)/kkk)/((kk(-11/6))/(k(4/15)k)))(-9/4) assuming k is positive. k(423/8) Simplify ((f/(f/((((f*2f)/f)/f)/fff))fff(5/2))/(f/(f(-2/13)ff)ff(-3)))/((f1)24/(f(1/3)/ff(-3/5))) assuming f is positive. f(-6209/390) Simplify (b*6/bbb/(b/(b/(b(-1/24)/b)b))b(-34)/((bb(4/13))/b))(3/38) assuming b is positive. b*(-7883/3952) Simplify (((((gg/g*(-7/2)g)/g)/(g/g*3))/((gg/(g(g(-4)g)/ggg))/(g*(4/9)gg)))(-2/51))(10/7) assuming g is positive. g(-1250/3213) Simplify ((k(-2/31)k13)/(k/k(2/11))37)(-1/18) assuming k is positive. k*(2956/3069) Simplify (ppp1)(-1/5)/((p1/p)/p)(-3/20)(p/(ppp/p(1/2)))20/(pp/(p/(pp1)))(3/7) assuming p is positive. p*(-897/28) Simplify (bb*(-1/8)bb)/(b(-1/2)/b)(b/b(4/7))/b(-3)(b1)0/(bb/(bbbb(-2)/bb)b/b(-1/7)) assuming b is positive. b(317/56) Simplify (((l/(l/(l/(lll17/ll))))/ll/(l/l(-10)))/((l6/l)/((l(-1/26)l)/l)))(-2/105) assuming l is positive. l(59/91) Simplify (j*(-1/10)j/(j*(1/8)j)j)/(j/(j10j))(-50) assuming j is positive. j(-19969/40) Simplify k2/k(-1/8)k(-1/3)(kk(-1/3))/kk*8/(kk*(-4))(kkkk2)/((((k/(k/k(-5)))/k)/k)/kk) assuming k is positive. k(587/24) Simplify ((g(-1))37)(-44)/(g*1g/(g/g(5/4)))33 assuming g is positive. g*(6215/4) Simplify ((vv*(-32)v)/v*(-4/9))/(vvvv/(v*(-36)v))(-11) assuming v is positive. v(3595/9) Simplify (((s(((ss(s/(s/s5)sss)/ss)/s)/s)/s)/s(2/9)(ss(-2/3))/ss/s*6ss)(2/19))(-1/16) assuming s is positive. s(-37/1368) Simplify (((z/(z(zz(-5/3))/z))/z)/(z/(zz*(-3))))/(z(z1/z)/z)(-2)z(6/7)z/(z/z*(-3))(z/(zz(2/7)/z))43 assuming z is positive. z(551/21) Simplify ((a/(a(-7/4)/a)a)/aaa(a(-1/10)aa)/aa(a/(aa*(-6)/a))/((a(a/(a*(2/3)/a)aa)/a)/a))(-12) assuming a is positive. a(-739/5) Simplify ((z(2/7))24(zz0z)34)/(((z(-3/4)/z)/(zz/((zz/z*(-4)z)/z)))/(zzz*(-1)zzz(-4))) assuming z is positive. z(2005/28) Simplify (l(-2))41((l(l/l(-2/3))/l)/l)(2/59)((l3/l)(-2/7))31 assuming l is positive. l(-123518/1239) Simplify ((u(-1))(-2/83)((u*(-4)uu)/u)/(u(1/4)uu))/((uu*(2/3)(u*0/u)/u)/((uu*(-2/17)/uu)/u(-5/6))) assuming u is positive. u(-53791/16932) Simplify (u*6u/(u/(u/u(-1/5))))(-3/11)/(((u/(u/u*3))/uu6)/((u(2/11)u)/(u6/uu))) assuming u is positive. u(-813/55) Simplify (((((z/z12)/z)/z)/((z/z*(-2/39))/z))/(((zzz(-14))/z)/(zz/z*(-8/7)z)))18 assuming z is positive. z(6702/91) Simplify (f(6/11)/f9)(-3/7)/((f/f(2/5))/f*(-6)((f/f*(-4))/f)/(f(f/(ff(-4)))/f)) assuming f is positive. f(-1146/385) Simplify (((x/x(-4))/x(-5))/(x4/x)(-1/77))(-17/7) assuming x is positive. x(-13141/539) Simplify (ww*(-1/2)w*(2/13)w(8/7)/((w(-2)/w)/w))(-5) assuming w is positive. w(-5275/182) Simplify ((h(2/29)/h(-1/19))/((hh(-10))/(h(-16)/h)))(-2/15) assuming h is positive. h(2894/2755) Simplify o(-4/3)/oo*(1/11)(oo(-2)o)*(-2/57)((oo3)/o)/o(-7)(o*0o)43 assuming o is positive. o(1675/33) Simplify ((m(-6/5))(-15)((m(2/9)m)/m)/m43)(-6/5) assuming m is positive. m(446/15) Simplify (y(1/3)/y*(-4/7)(yy(4/7))/yy(4/3))/((y0)*(-7/5)/((yy*0y)/y(-7/5))) assuming y is positive. y(652/105) Simplify (kk1/kkk)(-28)(k*2k)/kk(2/21)/k(kk(k/k*0)/kkk)(-16)k(-3)/(k(1/3)/k) assuming k is positive. k(-3134/21) Simplify (s(-5)/(ss0))(12/13)/((s(2/5)s)*17/((s/(ss*(1/2)/s))/ss(-2/5))) assuming s is positive. s(-3931/130) Simplify x*9x*(-5)x*6xxx/x*(-2/25)(((x*2x)/x)/xx(1/13))/(x(-4)x3) assuming x is positive. x(4926/325) Simplify d/((dd/d7)/d)dd0(d(-2))(-10/11)((d(d/d(-2/5))/d)1)8 assuming d is positive. d(1156/55) Simplify (uu/(uu*2u)u(-3/8)(u(-8/3)/u)(-14))21 assuming u is positive. u(8225/8) Simplify (i*2i)/(i/(ii(-3)))ii/i(2/11)i*(-7)i(i(-4)ii(2/21)i)(-33) assuming i is positive. i(4518/77) Simplify ((((d/d*(-41))/d)/dd*(-22/5))/(((d/(dd(-2/3)))/d)/((d/(d/d(-2/37)))/d)))37 assuming d is positive. d(19358/15) Simplify (cc/c16c)*46/(ccc(26/5))(-2/19) assuming c is positive. c(-56738/95) Simplify ((s/s9)/(s(3/13)/sss))(10/11)/(s7((ss(-2/7)/s)/s)/s)(-36) assuming s is positive. s(161484/1001) Simplify ((hh/h*(1/2)h)/h*(3/4)(h(-2/15))47)(2/23) assuming h is positive. h(-271/690) Simplify ((rrr*8r)/(r(r(3/7)/r)/r)r(r/r(-2/3)r)/rr(-8)/r)/((rr/r(1/3))(-2/73)r4r/(rrr(-9)/r)) assuming r is positive. r(-3943/511) Simplify (((f(-4)/f(2/11))/(f(-2/5))(-32))(2/83))24 assuming f is positive. f(-44832/4565) Simplify ((((w/w(5/4))/w)/w(-1))/(w(-1)/(((w/(w*(1/6)w))/w)/w)))/((w*(-5)w(w4w)/w)/(w*6ww(-6))) assuming w is positive. w(-5/12) Simplify ((r36)(6/11)(rr/r(23/2)r)12)(-6/13) assuming r is positive. r(5436/143) Simplify (b4b(1/7)/b(b(-2/7))(-2/53))/((b*0b(-2/5))/(b(-3/5)/bb(b*(-3/8)b)/bbb)) assuming b is positive. b(67947/14840) Simplify (((((u(-9/4)u)/u)/((u6u)/uu))/(u(-2)u(2/3)))(2/57))(-1/5) assuming u is positive. u(1/18) Simplify (t*(-5)t/t(-3/5))(-15)(t/t(2/11)tt(-4/3))/(t(-2/11)/((t(-2/17)/tt)/t)) assuming t is positive. t*(2578/51) Simplify ((((x/(xx(-5/2)))/(((x0xxx)/x)/x))(3/5))(-14))(2/81) assuming x is positive. x(-14/45) Simplify (((h(3/2)h)/h)(1/9)/(h/(h(8/7)h))(3/7))3 assuming h is positive. h(193/98) Simplify ((k/(k(3/2)/k))/k(-2)(kk(-1/3)/kkk)/k(-2/7))/(((kk*0)/k)/kk*1(kk/(kk*1k)k)(-11/5)) assuming k is positive. k(187/42) Simplify (((vv*(-5/7)/v)/vv(-9/4))/(v(-2/33)v/v(2/25)))44 assuming v is positive. v(-111427/525) Simplify ((a(-9)a*(-11)(a/(a*(-5)a))/aa(-2))48)26 assuming a is positive. a(-22464) Simplify (((z1z(-2/21))/(z0)16)3)(8/3) assuming z is positive. z(152/21) Simplify ((b/b(3/7))/(b/(b/(b/b0))b))/(b(-9)/(b/(bbb/(bb/((bbbb(-7)b)/b)b))))((b(bb(-3))/b)(2/25))(2/29) assuming b is positive. b(63744/5075) Simplify (ii6((ii1)/i)/i)40(i8/(i/(i(2/5)/ii)i))46 assuming i is positive. i(2872/5) Simplify (((((q*(-2/5)q)/q)/qqq)/qq)/qq(1/10))(3/10)/(q*(-3/8)/(q/(qqq(-1/17)qq)q))(-50) assuming q is positive. q(33243/425) Simplify ((h4)(-11)(h(-6/11)h)/h(-1/35))35 assuming h is positive. h(-16754/11) Simplify ((d(2/15)/d)/(d/(d/(d/d*(1/17)))d)d(1/10)d(14/3))(-25) assuming d is positive. d*(-1665/34) Simplify ((ww*(-3)(w/(((wwww(-1/6)ww)/w)/www))/ww/(ww6)w(-7))21)(7/4) assuming w is positive. w(-5831/8) Simplify (((qqq/(q/(q(q/(q(-1/3)q))/q)q)q)/q)*(-1/28)/(qq*(24/11)/qqq(-22)))*(-1/8) assuming q is positive.	{ "pile_set_name": "DM Mathematics" }
m2. Factor x(p). (p + 36)2/4 Let p(z) be the second derivative of z6/15 - z5/2 + 5z4/6 + 5z*3/3 - 6z*2 + z - 6. Solve p(b) = 0 for b. -1, 1, 2, 3 Suppose -70 - 44 = -55i + 17i. Factor 1/2h*2 + h + 1/4h4 - 3/4 - hi. (h - 3)(h - 1)2(h + 1)/4 Let l(i) be the third derivative of -i*5/36 - 5i*4/6 - 80i*3/9 + 2i*2 + 145i. Factor l(z). -5(z + 4)(z + 8)/3 Let l(i) = -101i2 - 19i - 4. Let u(g) = -405g2 - 70g - 15. Let p(b) = -15l(b) + 4u(b). Determine h so that p(h) = 0. 0, 1/21 Let b(i) = -10i5 - 39i*4 - 21i3 - i2 - 9i. Let n(q) = 5q*5 + 19q*4 + 11q3 + q2 + 4q. Let j(g) = 4b(g) + 9n(g). Factor j(u). 5u*2(u + 1)*3 Factor 22 + 3x*3 + 8x*2 + 4x*2 + 15x + 25 - 41. 3(x + 1)2(x + 2) Let x(h) be the first derivative of h*4 + 20h*3 + 28h*2 + 115. What is z in x(z) = 0? -14, -1, 0 Let j(n) be the first derivative of -1/5n*5 + 1/4n*4 + 2/3n*3 - 19 + 0n + 0n2. Factor j(b). -b2(b - 2)(b + 1) Let y(w) be the second derivative of w6/60 + 11w*5/30 + 35w*4/12 + 25w*3/3 + 15w*2/2 - 6w - 4. Let r(c) be the first derivative of y(c). Factor r(s). 2(s + 1)(s + 5)*2 Let c be (2/3)/((-2072)/(-1332)). Factor -10/7 + cb*2 + 13/7b. (b + 5)(3b - 2)/7 Let l be (0 + (-1 - -2))3. Let z(t) = -t2 - 22t + 779. Let c be z(19). Factor c + 2/5g4 + 2g*2 - 8/5g*l - 4/5g. 2g(g - 2)(g - 1)2/5 Let u be ((-43)/(32637/(-13708)) - 18) + 128/66. Let h = 997/156 + -11/78. What is i in 5/4 + 5i*u - hi = 0? 1/4, 1 Let w(f) = -3f3 - 5f + f - 7f2 + 17f*2. Let v(b) = -24b*3 + 81b*2 - 33b. Let x(u) = -4v(u) + 33w(u). Suppose x(o) = 0. Calculate o. 0, 2 Let k = -81/10 - -41/5. Let m(j) be the second derivative of 1/3j3 + 6j + 1/6j4 + 0 - j2 - kj*5. Let m(v) = 0. What is v? -1, 1 Let s be (0 - (-1184)/(-36))/(7-18). Let c = 2/81 + s. Factor -4/7n + 2/7n*4 - c + 0n*2 + 4/7n*3. 2(n - 1)(n + 1)3/7 Let x(p) be the first derivative of -p5/90 - p4/36 + 2p*3/9 + 13p*2 + 11. Let m(j) be the second derivative of x(j). Factor m(s). -2(s - 1)(s + 2)/3 Let y(x) be the second derivative of -1/3x*3 + 1/24x*4 + 3/4x*2 - 12x + 0. Factor y(w). (w - 3)(w - 1)/2 Let 0k - 2/21k3 - 2/21k*4 + 4/21k2 + 0 = 0. Calculate k. -2, 0, 1 Let d(y) = y3 - 3y2 + 2y - 6. Let t be d(4). Let -r*5 - r + tr*3 + 0r*5 - 16r*3 = 0. What is r? -1, 0, 1 Let a be -454/(-45) - (1 + 3). Let -2/5h4 + 0 + ah*3 + 0h + 6/5h2 = 0. What is h? -1, 0, 3 Suppose 0 = -2f + 9f - 14. Factor -4z*f - 9z*2 + 16z*2. 3z*2 Let p = 1/2778 + 3703/2778. Factor 0g*2 - 4/3g + 0 + pg3. 4g(g - 1)(g + 1)/3 Let y = 24 + -71/3. Let p = -461/21 - -163/7. Solve p + 0c - yc*2 = 0 for c. -2, 2 Suppose 2y = 3i + 9, 5i - 6 = 6y - 5y. What is o in 33/2o4 + 3/2o - 3/2 + yo2 - 21o*3 - 9/2o*5 = 0? -1/3, 1 Let -121o - 11 + 11 - 63o2 - 15o*3 + 72o - o4 = 0. Calculate o. -7, -1, 0 Let f(j) be the third derivative of j6/780 - 58j5/65 + 3364j*4/13 - 1560896j*3/39 - 100j2. Suppose f(k) = 0. Calculate k. 116 Let a(r) be the third derivative of r5/300 + r*4/12 - 11r*3/30 + 147r*2. Factor a(t). (t - 1)(t + 11)/5 Let t(y) be the second derivative of 39y5/20 - 25y*4/2 + 31y*3/2 + 9y*2 + 17y - 5. Suppose t(i) = 0. Calculate i. -2/13, 1, 3 Let w(r) be the third derivative of -r*5/75 + 7r*4/5 - 10r2 + 34. Solve w(p) = 0 for p. 0, 42 Let k(l) be the third derivative of l8/1008 - l*7/30 - 23l*6/360 + 7l*5/60 + 11l*4/36 - 211l*2. Determine p, given that k(p) = 0. -1, 0, 1, 22 Let x(s) be the second derivative of -7s*6/6 - 37s*5/4 - 95s*4/6 - 20s*3/3 + 27s. Let x(k) = 0. What is k? -4, -1, -2/7, 0 Factor 14/5i + 2/15i*3 + 196/15 - 8/5i*2. 2(i - 7)*2(i + 2)/15 Factor -44u + 129u - 8u3 - 63u*2 + 40 + 150u - 17u3 + 233u*2. -5(u - 8)(u + 1)(5u + 1) Suppose 298o - 330o = 0. Factor o - 3/5x*5 + 0x - 12/5x4 + 0x*2 - 9/5x*3. -3x*3(x + 1)(x + 3)/5 Let f(r) be the second derivative of -4r*5/5 + 19r*4/6 - 19r*3/6 - 3r*2/2 + 154r. Factor f(y). -(y - 1)(2y - 3)(8y + 1) Solve 16b3 - 10294b*2 + 5b*3 - 3b*5 + 4b*5 + 10271b*2 + 8b - 5b4 - 2b5 = 0. -8, 0, 1 Let k(s) be the third derivative of -s5/150 + s4/30 + s3/5 - 8s2. Factor k(c). -2(c - 3)(c + 1)/5 Factor 12/5r*4 - 57/5r*3 + 72/5 + 134/5r*2 - 1/5r*5 - 156/5r. -(r - 3)*2(r - 2)*3/5 Let m be 23/7 - (-2)/(-7). Suppose 11 = 4u - 1. Factor 2rm - 4r*2 + 2r + 0ru + 0r*3. 2r(r - 1)2 Let g be (12/(20/(-5)))/(-1). Factor -13 + 8h*2 - 9h*g + 11h*3 + 17 + 10h. 2(h + 1)2(h + 2) Factor 0 + 0s + 4s*3 + 2s*2 + 1/2s*5 + 5/2s4. s2(s + 1)(s + 2)*2/2 Let y = 179 + -182. Let q be y((-1)/18)/((-16)/(-64)). Let qi3 + 0 - 8/3i*2 + 8/3i = 0. Calculate i. 0, 2 Let z(m) be the second derivative of -3m6/50 - 11m*5/100 + 7m*4/60 + 11m3/30 + m2/5 + 46m. Find f such that z(f) = 0. -1, -2/9, 1 Let f(y) be the third derivative of 25/12y*4 + 11y*2 + 0y + 0 + 125/6y3 + 1/12y*5. Factor f(n). 5(n + 5)*2 Factor 0 + 1/2c*3 + 3/2c - 2c2. c(c - 3)(c - 1)/2 Let m(v) = -3v*2 + 11v - 2. Let h(c) = -1. Let b(d) = d - 1. Let p(q) = b(q) - h(q). Let j(s) = -m(s) + 6p(s). Factor j(y). (y - 1)(3y - 2) Let x(t) be the first derivative of -t6/15 - 3t5/10 - t4/3 - 4t - 9. Let b(w) be the first derivative of x(w). Factor b(f). -2f*2(f + 1)(f + 2) Let s = -188 - -188. Let c(p) be the third derivative of -1/12p*4 + s - 1/30p*5 + 0p + 3p2 + 2/3p*3. Solve c(n) = 0. -2, 1 Let t = 124 - 122. Let g(j) be the third derivative of -5/84j*4 + 0j + 0 + 2/21j3 - 1/30j*5 + 5j*t. Factor g(l). -2(l + 1)(7l - 2)/7 Suppose d - 12 = -3r - 2r, 2d = -r + 6. Factor 8/11 - 6/11f*r + 2/11f*3 + 0f. 2(f - 2)2(f + 1)/11 Suppose 4t = t + 9. What is z in 729z*5 + 2515z*3 + 2453z*t - 94z + 2384z2 + 3402z*4 + 32 + 558z = 0? -2, -2/9 Let -4/7h5 + 0 - 48/7h*3 + 34/7h*2 - 8/7h + 26/7h4 = 0. What is h? 0, 1/2, 1, 4 Factor 121 - 3s5 + s4 - 128s2 + 110s*2 + 18s*3 + 2s*5 - 40 - 81s. -(s - 3)*2(s - 1)(s + 3)2 Let y = -42 - -45. Suppose -4h + 0h = yv - 10, -14 = -5v - 4h. Suppose -46/3s3 - 16/3 - 40/3s + 8/3s4 + 28sv = 0. Calculate s. -1/4, 2 Let o(q) be the third derivative of q6/480 + q5/48 - q4/16 - 96q2. Factor o(m). m(m - 1)(m + 6)/4 Let k = -583/12 - -209/4. Determine b so that -1/3 - 11/6b*5 - 10/3b*4 + kb*2 + 2/3b*3 + 7/6b = 0. -1, 2/11, 1 Let x(m) = -4. Let v(a) = a + 1. Let l(f) = -3v(f) - x(f). Let o be l(-1). Determine k so that -6k*4 - 4 - 4k*o - 18k*2 + 8k*4 + 10k*3 + 14k = 0. 1, 2 Let d be (-40)/(-24) - (-2)/(-3). Let b(o) = -o4 - o2 - o - 1. Let x(f) = -2f4 + 3f*3 - 4f*2 - 6f - 3. Let n(z) = dx(z) - 3b(z). Factor n(q). q(q - 1)(q + 1)(q + 3) Suppose -c - 4m + 19 = 1, 4c - 4m = -8. Factor -5qc - 5q*3 + 45q - 14q - 21q. -5q(q - 1)(q + 2) Solve -49d*2 - 21d*3 - 36d - 4d2 + 3d*5 - 7d*2 + 22d*4 - 16d*4 = 0 for d. -2, -1, 0, 3 Let z(y) = -6y*5 + 3y*4 - 3y*2. Let s(u) = -7u4 - u5 + 40u2 - 35u*2 + 12u5 + u3. Let o(f) = 3s(f) + 5z(f). Determine m so that o(m) = 0. 0, 1 Let r(v) = 6v3 - 170v*2 - 6v + 159. Let j(k) = k*3 - 34k*2 - k + 32. Let x(d) = -11j(d) + 2r(d). Factor x(q). (q - 1)(q + 1)(q + 34) Let p(r) = r3 + 4r*2 - 6r - 1. Let k be p(-5). Suppose -k = 5b - b, -3b = -3a + 9. Factor 6 + az + z - 6z2 + 15z - 2z. -2(z - 3)(3z + 1) Factor 3/5x4 + 1/5x*3 - 2/5x + 1/5x5 - 3/5x*2 + 0. x(x - 1)(x + 1)2(x + 2)/5 Let w(k) be the third derivative of -k7/12600 + k6/360 - k*5/24 + 11k*4/24 - 15k*2. Let b(h) be the second derivative of w(h). Solve b(j) = 0 for j. 5 Suppose -12 = -4y, -6w + 3w - 5y = -24. Factor 752 - 4l*w - 752 - 2l*4 - 2l*2. -2l*2(l + 1)*2 Solve -6s - 71/4s2 - 3/4s*5 + 19/4s*4 + 4 - 9/4s*3 = 0. -1, 1/3, 4 Suppose -2m + 4m = 6. Factor -w - w5 - 3w + 3w + 2w*m. -w(w - 1)*2(w + 1)*2 Find f such that -72/7f*2 + 33/7f*3 + 0 - 3/7f*	{ "pile_set_name": "DM Mathematics" }
11 + ((-2380)/(-12))/(-17) - (-4)/6. Solve 5z - 12r = -17r, 5z - 4r + 27 = n for z. -3 Let r(u) = u2 - 3u + 2. Let l be r(0). Suppose -t - 2 = -2q, -lq = -5t - 6q + 18. Solve 3b - 3 = 3a, 5b - t + 37 = -3a for a. -5 Suppose 0 = 3s + 6z - 120, 4s + 26z - 140 = 22z. Solve -g - 3 = -2i, -7 = 31g - sg - 4i for g. 1 Suppose 0 = -44h + 46h + 480. Let w = 243 + h. Solve -c + 3 = 3t, -5t + 21 - 2 = -wc for c. -3 Suppose 0 = 5t + a - 9 + 6, t - 2a = -6. Suppose 4s - p - 11 = 0, 3s + 2p - 16 + 5 = t. Solve sb = 9, -5v = -b + 19 - 1 for v. -3 Let r(k) = -2k*2 + 30k + 112. Let d be r(-3). Solve -4g = 4p - 28, -p + dg - 9 = -1 for p. 4 Suppose 0o + 13o = -64o + 154. Solve -5g + 9 = -3q, 52 = -g + oq + 51 for g. 3 Let q be (-4)/(46/24) + 8. Solve -4y - 2v - 9 - 3 = 0, qy - 2v - 4 = 0 for y. -1 Let g be (-15 - -1) + ((-9522)/23)/(-23). Suppose 4p - 3 - 9 = 0. Solve -q + pj + 2 = q, 0 = -gj for q. 1 Let r be 2/((-35)/(-49) - 1). Let j(k) = -k3 - 4k*2 + 19k - 14. Let i be j(r). Let v be 4/14 + 324/42. Solve -q = 5s + 2, -4q + 2s - s - v = i for q. -2 Suppose 3 = -2z - 5, 4z = 4n - 16. Suppose 0 = 2g - 8, -7l + 9l - 4g = n. Solve 0 = -2q - 0 - 6, q + l = h for h. 5 Suppose -14j + 1 = -13j - 2q, 2j + 5q = 20. Solve 4d = -ja + 9, 18 + 1 = -d + 3a for d. -4 Suppose -8f + 37 = -43. Suppose fz = -0z + 20. Let n be -1 + 12/18 + 12/9. Solve zr + 1 = -4b - n, b + 23 = -5r for r. -5 Let n = 12 + -11. Let a be n/((2/6)/1). Suppose -d = ai - 2 - 4, -4d = 0. Solve -4j = 4s - 16, 2 = ij - 0j - s for j. 2 Let x(m) = 143m3 + m2 - m + 2. Let i be x(1). Let w = i - 125. Solve -d + 4k = -w, -5k + 2k - 15 = 5d for d. 0 Suppose 0 = -39u + 500 + 124. Let t = -413 - -433. Solve -5q + t = -5d, -4d - u = -0d for q. 0 Let g(f) = -f2 - 6f + 3836. Let z be g(-65). Solve 7n + z = 6n, 4n + 24 = -5u for u. -4 Let l(h) = -h*3 + 6h*2 - 4h - 14. Let w = -64 - -68. Let z be l(w). Solve -4y = y - 2a + 20, -za = 0 for y. -4 Suppose 16 = -4n + 3q, -3n - 2q = q - 9. Let l = 30 - 32. Let k be (l - -12)1/(1 - n). Solve 0 = u - 4b - 23, -ku = 7b - 2b + 10 for u. 3 Let z(x) = -136x - 108. Let s be z(-1). Solve -5a - 40 = 5r, -sa + 3r + 12 = -27a for a. -3 Suppose -1 = -4m + 23. Suppose -9y + 7y + m = 0. Let k(n) = n3 - 3n*2 - n - 3. Let s be k(4). Solve -5g + s = -4d, -yd + 3 = 5g + 1 for d. -1 Let y = -24959 - -24959. Solve y = 8z - 4z + 2i - 20, 2i - 5 = z for z. 3 Let a = 8453 - 8452. Solve -3p - a = -4i + 5i, p = 2i - 12 for i. 5 Suppose -7a + 2 = -6a. Suppose -au + 81 = 3u - 3r, 4u - r = 69. Suppose 12w = 18w - u. Solve d - 19 = -3v, -3d + 0d = -wv + 3 for v. 5 Let w be ((-143)/39 + 4)/((-1)/(-30)). Suppose 5n = r + w, 2 = 3n - 2n - 4r. Solve 0l - 2 = i + nl, -18 = -5i + 4l for i. 2 Suppose -15g - 150 = -51g - 39g. Solve -q - 8 = -2b, 3b + 6 = -2q + gb for q. -4 Let s(g) = -141g + 1133. Let j be s(8). Solve jr + 28 = -2f + 13, 5f + 24 = r for f. -5 Suppose 2g = 7g + p - 35, p - 5 = 0. Suppose -z + g = 2z. Suppose 31q + 190 - 439 + 94 = 0. Solve 4b = -2d + 2, 4d - qb = zd - 25 for d. -5 Let m(v) = v3 + 9v*2 + v + 12. Let g be m(-9). Let q = -17 + 29. Suppose -q = -12h + 6h. Solve -gx = hx - 5s - 10, -5x + s = -2 for x. 0 Let y = -558 - -558. Suppose y = 8o - 7 - 153. Solve -2s = 3s + 5h + o, -2h = 3s + 7 for s. 1 Suppose 3z + 9 = -6. Suppose 126 - 1701 = -21p. Let g be (p/5)/z + 5. Solve 7o - 4o - 5v - 1 = 0, 0 = 4o - 5v + g for o. -3 Let c(u) = -u*3 + 15u*2 - 12u - 23. Suppose 4f - 18f + 196 = 0. Let y be c(f). Solve 3i = -5r - i + 21, -25 = -4r + yi for r. 5 Let a(b) = -b*3 + 6b*2 - 16b + 59. Let v be a(5). Solve 2j + 14t = 18t - 24, -4t = vj for j. -4 Let p be -42(-3)/31. Suppose 0x - 7x = -p. Let d(q) = -2q + 12. Let b be d(x). Solve 0 = -v - 2, b = -y + v - 0v + 2 for y. 0 Let b = -10919 - -10929. Let z(d) = d2 - 3d. Let n(x) = -x + 13. Let q be n(9). Let w be z(q). Solve -4a = 5h + 18, -wh + 2a - 3a = b for h. -2 Let h(l) = l2 - 34l + 253. Let c be h(11). Solve -7 = u - 13, c = 5m + 2u + 3 for m. -3 Suppose -126 - 90 = 4c. Let o(r) = r3 - 7r*2 + 23r - 10. Let q be o(5). Let x = c + q. Solve 4a + 4v + v + x = 0, -35 = 5a - 5v for a. -4 Let o(b) = 55b3 - 25b + 48b3 - 102b*3 + 48 - 22b*2. Let l be o(23). Solve -1 - 1 = -lq - 4x, 0 = -4x - 8 for q. 5 Let k(x) = x*3 - 7x*2 - 7x + 58. Let d be k(7). Suppose -2h + 23 + d = 4z, -92 = -5h + 2z. Solve -2u + 2r + 10 = 0, -3u - h = -u + 5r for u. 1 Let t = 15217 - 15215. Solve -tk + 6 = -5g + 7, 4k - 4g = -8 for k. -3 Suppose -p - 2p = -9. Suppose -5z + 2103 = -3n, -z + 416 = n + 3n. Let t be 7680/z - (-4)/(-14). Solve c = 2x + 11, -pc + t = -x - 2x for x. -5 Let g be 4/3(15/(-10))/(-1). Let l(y) = -2y - 33. Let b be l(-17). Suppose b = 2f - 5. Solve -5w = 3i - 13, 7 - g = -fi + 4w for i. 1 Let f(c) = -c*3 + 6c*2 - 5c - 4. Let u be f(4). Let h = 360490 - 360490. Solve -b - 2 = -d, h = -3b - d - 3d + u for b. 0 Let x be 112/(-4)(-10)/35 + -6. Suppose 2v - 8 = 4r, -4r - 10 = -3v + x. Solve 2u = 5a - 33, r = 3a + 2a - 4u - 41 for a. 5 Let d = -56 + 116. Let l = 64 - d. Suppose 4v = -0v + q + 28, -lq - 34 = -3v. Solve -2a = 2b - 2, -5a - v = -b - 23 for a. 3 Let q be 6/(-15) + 27/5. Let s be ((-18)/2 + q)(-6)/8. Let c be (-4 + 8)(2 - 1). Solve 5v = -4t - s, -v + cv - 9 = 3t for t. -2 Let p = 166 - 161. Solve -pq - 18 = 3h, 0 = -2q + 4h - 21 + 19 for q. -3 Let t(u) = -u3 + 2u*2 + 4u + 3. Let r be t(-2). Suppose 0 = 3a - 36 - 147. Suppose am - 21 = 54m. Solve -k - r = -my, 2k - 1 = k - 3y for k. -5 Suppose 30m = -3m + 66. Suppose 2o + 0o - 246 = 0. Suppose o = a + ma. Solve -2s - 3s = -4j + a, 0 = -5j - s + 15 for j. 4 Let f(j) = 7j*2 + 109j - 18. Let t be f(-16). Let s be t/6 + 1 + -1. Solve 4a + 4 = -c, 0 = sc - 2c + 4a + 12 for c. -4 Let k = 45 + -45. Suppose -2u + 6 = -4w - 0, -4w - 2u + 6 = k. Solve w = -5j - 5r - 5, 5j - 5r - 3 = 2 for j. 0 Let l(k) = -58k + 700. Let c be l(12). Solve -cd + 3r + 2r = -2, -r = -d for d. -2 Let c = -6 - -14. Let d(x) = x*2 + 68x + 761. Let h be d(-14). Solve -28 = -3y - hn, 2y - 3n + c = -5 for y. 1 Let p(w) = w*2 - 6w + 23. Let a be p(8). Suppose -7o = -46 + a. Solve -l - 3n = 14, -l + 2l - 2n - o = 0 for l. -5 Let g be ((-8)/(-6))/((-2)/81104/(-414)). Solve -14k + 3n - g = -9k, 3k = 3n for k. -1 Suppose 7t - 9t + 5p + 408 = 0, 20 = -5p. Let x = t + -191. Solve 2 = -a + n - 4, -xa + 2n = 15 for a. -3 Let t be ((-2)/(-4))/((-2)/(-8)). Let l(m) = 20m + 450. Let b be l(-20). Suppose 0 = -24k + b - 2. Solve -kp - q - 2 = p, q = -tp for p. -2 Let w(g) = -g*2 - 5g. Let z be w(-4). Let p(f) = 3f + 55. Let h be (-6)/((-24)/(-4)) + -34. Let v be p(h). Solve -n - v = 5x, -zx - x + n - 24 = 0 for x. -4 Let s be (-2)/(-5) - (13 + (-880)/50). Let x be (-7 - 0)(-2 + 1). Suppose 5m = -x + 32. Solve -mr - 15 = sc, 2c + 4 = -5r + 1 for c. -4 Let m(t) be the second derivative of -t*4/4 - 8t*3/3 - 5t*2/2 + 7t. Let s = -177 + 172. Let o be m(s). Solve -4d + 4x = o, -3d - d = 5x + 27 for d. -3 Suppose o + 4h + 76 = 206, -2o + 3h = -326. Solve m - os - 6 = -152s, 4m + 1 = 3s for m. -4 Let c be (-10)/(-15)391. Suppose -29w + cw = -36. Suppose 24 - w = 3b. Solve -3h + 24 = 5o, h = -h - bo + 18 for h. 3 Suppose 62 = -8o - 26. Let v = o + 17. Let x be 7(8/(-6))/((-28)/v). Solve 0 = -y - 4t - 5, -x = 3y + 5t - 1 for y. 3 Let o = 1075 + -1072. Solve 0 = 3k + 3d - 15, -2k - od + 20 = d for k. 0 Let s be 2463/(-11) - (-19)/(-209). Let a = 224 + s. Suppose -2q + b + 6 = -0, 0 = -3q - 5b + 22. Solve qj + 12 = -v, 5j = 2v - av - 2 for v. -4 Let b = 0 + 3. Suppose 79c = 77c - 10. Let k = -5 - c. Solve 5q + bj = -16, -4q + 5j - 35 = -kq for q. -5 Suppose 0 = 192n - 190n + 16, 2n = 4u - 32. Solve 2f + 3 = g, -ug + 299 - 287 = -4f for f. 0 Let k be (12 - 0)(-32 - (-2716)/84). Solve -o - 4 + 1 = kx, -2x = 5o - 21 for o. 5 Let v(j) be the first derivative of -7j*2/2 + 16j - 33. L	{ "pile_set_name": "DM Mathematics" }
i to the nearest one million. 3000000 Let f = 1338.04181 + -1252.035433. Let r = f - 87.7063. Let h = 1.7 + r. Round h to 5 decimal places. 0.00008 Suppose -3o - 4 = -1. Let l be (o + 32/12)/((-1)/3420). What is l rounded to the nearest 1000? -6000 Let c be (-4)/(-4) + 2 + -25. Let u be 14/4 - (-11)/c. Suppose -3g + up - 49 = -388, 3g - 318 = -4p. Round g to the nearest 100. 100 Suppose -65 = 5o + 5l, -4o + 4l = 9l + 47. Let t = o - -20. Let a be -3 + 7 - (14006 - t). Round a to the nearest one thousand. -14000 Let d = 680.1 - 679.7559. What is d rounded to 1 dp? 0.3 Let g = -639 + 593.3. Round g to zero dps. -46 Suppose -l - 3 = 82. Round l to the nearest ten. -90 Let o(q) = 123q2 - 4q + 36. Let h be o(-24). What is h rounded to the nearest one thousand? 71000 Suppose -m + 4b + 16950012 = 2m, 3m = -5b + 16949985. Round m to the nearest one million. 6000000 Suppose v + 9 = 4h, -2v - 3v + 30 = 5h. Suppose 4s = 4a - 316004, 2a + 2s = -hs + 157995. What is a rounded to the nearest ten thousand? 80000 Let s = -567.0214 + 567. What is s rounded to 2 decimal places? -0.02 Let v be -1(2 + (-8)/2). Suppose -vu + 444612 + 107388 = 0. Suppose -2p = p - u. What is p rounded to the nearest 10000? 90000 Let k = -209.18 - -163.9. Let p = k - -44. What is p rounded to one dp? -1.3 Let v = -80 + 28. Let g = 52.23 + v. Round g to 2 decimal places. 0.23 Let d = 0.54 + 9.46. Let j = d - 10.057. Round j to two dps. -0.06 Let y = -2905.27 + 2941. Let b = y + -36. Let k = b - -0.398. What is k rounded to two dps? 0.13 Let s(y) = y - 3. Let f be s(3). Suppose f = -3b - 2b - 5x - 18965, -4b = -x + 15152. Let u = -8211 + b. Round u to the nearest ten thousand. -10000 Let v be (-5)/(-1) + (1 - 2). Suppose -4i + i - 9369 = -3p, -vp - 9383 = 3i. Let o be i/((-1)/32 + 0). Round o to the nearest 100000. 100000 Let p = 0.0706 + 180.4294. Let u = p + -232. Round u to the nearest 10. -50 Suppose 2t = t - 39. Let m be (t - 4)/(2/6). Let y = -50 - m. What is y rounded to the nearest 10? 80 Let o = 65 - 39. Let q = 609 - 582.975. Let b = o - q. What is b rounded to 2 decimal places? -0.03 Let i = -8234 - -21491. Let o = -126 + 129. Suppose oj - 5943 - i = 0. Round j to the nearest one thousand. 6000 Let b = 161 + -165.06. Let f = b - 0.14. Round f to zero dps. -4 Let h = 124.1 + -0.1. Let i = 123.9999939 - h. Round i to six decimal places. -0.000006 Let q = -2 - 10. Let y be (-3307)/7 + q/(-28). Let m = y - 588. Round m to the nearest 100. -1100 Let i = -2.68 - -180.68. Let j = i - 177.99857. Round j to 4 dps. 0.0014 Let p = -0.053216 + 0.053. Round p to 5 decimal places. -0.00022 Let k = -64.7 + 16.8. Let q = -48.209 - k. Round q to 2 dps. -0.31 Suppose -5208 = 11u - 8u. Let n = u - -476. What is n rounded to the nearest 100? -1300 Let z = 0.07 - 0.05. Let w = 3.4 + -3.06. Let f = w + z. Round f to one decimal place. 0.4 Let k = -614.00000419 + 614. What is k rounded to 7 decimal places? -0.0000042 Let n be ((-54)/5)/((-3)/(-150)). What is n rounded to the nearest 10? -540 Let h = -194 + 278.3. Round h to the nearest ten. 80 Let j(o) = 191o2 + 3o + 2. Suppose -1 + 6 = 5l. Let v be -3 - -4 - 3/l. Let y be j(v). Round y to the nearest 100. 800 Let s = -8.6 + 9. Let h = s + 2. Let n = h + -2.4011. What is n rounded to three dps? -0.001 Suppose -3z = 5s - 233100015, -2s + 89313154 = 2z - 66086852. Round z to the nearest 1000000. 78000000 Let k = 4838.000003069 + -4838. What is k rounded to 7 decimal places? 0.0000031 Let u = 75 + -20. Let k = u + -55.04. What is k rounded to 2 decimal places? -0.04 Let r = -2413 - -2412.41008. Let j = 0.59 + r. Round j to 4 dps. 0.0001 Suppose -j + 2j = 0. Let o be -2 + j/1 + 102. What is o rounded to the nearest one hundred? 100 Let w = -72709670.999791 - -72709612. Let t = -59 - w. What is t rounded to 5 dps? -0.00021 Let u = -191 + 185. Suppose 0y - 5y + 50 = 0. Let h = u - y. Round h to the nearest ten. -20 Let w = -9 + 10.41. Let o = -1.41000122 + w. Round o to seven dps. -0.0000012 Let m = -410 + 216. Let z = m + 172.6. What is z rounded to the nearest integer? -21 Let b(h) = 898h2 + h - 22. Let o = 7 + 7. Let d be b(o). Round d to the nearest 100000. 200000 Let x = -76.6263 + 83.12. Let b = -6.52 + x. What is b rounded to 3 dps? -0.026 Let i = -3026352 + 4701352. Round i to the nearest one million. 2000000 Let w = -30.8 - -25. Let v = w - -2.6. Let z = 3.245 + v. What is z rounded to 2 dps? 0.05 Let c be ((-3)/9)/(6/18) + 1. Let i(a) = -7048a*3 + 3a*2 - 4a - 1. Let v be i(-4). Suppose -w + v - 1321135 = c. What is w rounded to the nearest 100000? -900000 Let q = 0.130296 - 0.132. What is q rounded to five decimal places? -0.0017 Let a = -90894.89985 + 90892. Let u = a + 2.9. What is u rounded to 4 decimal places? 0.0002 Let z = 2611 - 2610.7181. Round z to two decimal places. 0.28 Let i = 53 + -18. Let n = i - 35.00000005. Round n to seven dps. -0.0000001 Let b be (4000/(-3))/(200/(-2037600)). What is b rounded to the nearest 1000000? 14000000 Let o = -16.98 - -16.6078. Let x = o + 0.332. What is x rounded to 3 decimal places? -0.04 Let n = 0.05 - 0.055. Let p = -2 - -2. Let o = p - n. What is o rounded to 2 decimal places? 0.01 Let o = 0.971 - 0.6898. What is o rounded to two decimal places? 0.28 Let k = -124.43 + 126. Let w = k + 0.23. Let z = w + -1.8045. Round z to 3 dps. -0.005 Suppose -2 - 3 = -s + 4d, -5d = 5. Let m be (0 - -2) + ((-744)/s)/(-2). Round m to the nearest 10. 370 Let f = -175.24 + 183. Let o = 1.32 - -8.58. Let w = o - f. Round w to one decimal place. 2.1 Let u = 0.015 + 0.285. Round u to one dp. 0.3 Let j = -8 + 13. Suppose 5c - 1045 = 5q, 0 = jc + q - 3q - 1048. Let u be (350/(-3))/((-5)/c). Round u to the nearest 1000. 5000 Let d(p) = p*3 + 2p*2 - 5p - 1644. Let l be d(0). What is l rounded to the nearest 100? -1600 Let q = 1.8661 - 0.0661. Round q to 0 decimal places. 2 Let s = -29 + 29.674. Round s to 2 decimal places. 0.67 Let h(t) = t*3 + 18t*2 + 16t - 12. Let a be h(-17). Suppose -ax - 3272967 = -8822967. What is x rounded to the nearest one hundred thousand? 1100000 Let d = 917014 - 1319014. Round d to the nearest 10000. -400000 Let r = 8.3146 + -8.32. Round r to two dps. -0.01 Let r(n) = 2820n - 480. Let u be r(-44). Round u to the nearest 1000. -125000 Let n = 2.218 - 1.569. Round n to one dp. 0.6 Suppose -2u = 2u - 8. Let g(l) = 6l + 6 + 1110l*u - 3 + 1. Let y be g(6). Round y to the nearest 100000. 0 Let l = -241.8401 + -0.2599. Round l to the nearest 10. -240 Let d = -55.3008682 - -54.750868694. Let c = 0.55 + d. What is c rounded to 7 decimal places? 0.0000005 Suppose -2j + 6 = -n + 2n, -2n + 2j = -6. Suppose 24 = 2z + 2z. Suppose zg - g + nc = -274, 5g - 4c + 306 = 0. What is g rounded to the nearest 10? -60 Let j(t) = t2 - 9t + 6. Let i be j(7). Let c = i + 14. Let f be (160/c)/((-8)/(-468)). Round f to the nearest 100. 1600 Let z = 3047 + -1639. Let b = z - 1415.61. What is b rounded to the nearest integer? -8 Let k = 1.012 + -0.226. What is k rounded to one decimal place? 0.8 Let b = 2113219.2651 - 1961467.35510048. Let d = -151752 + b. Let k = d + 0.09. Round k to seven dps. -0.0000005 Let i = -1.64 + -0.26. Let q = 2.04 + i. Let l = -0.84 + q. What is l rounded to the nearest integer? -1 Suppose 4m - 8m + 20 = 0, 0 = 3g - 5m + 1830025. What is g rounded to the nearest ten thousand? -610000 Let t be (-41)/(9/(36/(-8))). Suppose -5x - 3000002 = -u, 0 = 2x - 0u - tu + 1200004. Round x to the nearest 1000000. -1000000 Let k = 94244127.967 + -94282280. Let p = -38185 - k. Let b = p + 33. What is b rounded to 2 decimal places? 0.03 Let m(a) = 32500a*2 - 12a + 144. Let z be m(12). What is z rounded to the nearest 100000? 4700000 Let x(z) = -272z + 112. Let g be x(-9). What is g rounded to the nearest 1000? 3000 Suppose -5y + v - 10735 = -182389, -68680 = -2y + 5v. Round y to the nearest one thousand. 34000 Let h = -3.586 - -3.6. Let n = 0 + h. What is n rounded to 3 dps? 0.014 Let k = -2.08 - -2. Let c = 108 + -109.57. Let i = k - c. What is i rounded to one dp? 1.5 Let c = 4572845.999995 + -4572897. Let t = c + 51. What is t rounded to 4 decimal places? 0 Let a be -3*(-1)/(-9) - 903/(-9). L	{ "pile_set_name": "DM Mathematics" }
18 + s. Solve -3k - 2o + 2 + 5 = 0, l = -k + 2o for k. 1 Let s be (-3808)/(-126) + 4/(-18). Let x = s + -2. Suppose xq - 25q = 120. Solve j + 45 = -3j + 5o, 5j = 3o - q for j. -5 Let n be ((-7)/(42/76))/((-8)/12). Let l(j) = -j3 + 20j*2 - 19j + 6. Let y be l(n). Solve -4h + u - 5u + 20 = 0, y = 4h - 3u for h. 3 Suppose -125 = -2z + 7. Suppose -4d - 12 = 0, -4r - 142 = -6r + 2d. Let m = r - z. Solve 3v + 0v + 8 = k, -6 = mv for k. -1 Let j be (-10)/(-4)34 - 2/(-1). Let o = -86 + j. Suppose 0 = v - 0v - 3. Solve -5c = z + 3, 3c - o = -vz + z for z. 2 Let a = -227 + 330. Suppose aj - 120j = 0. Solve -3r + 5 = 2z - j, -3r + 13 = 4z for z. 4 Suppose -2n = -4t + 59 + 331, -5t - 5n + 465 = 0. Let q be ((-2)/4)/(((-116)/t)/29). Solve -5g - 15 = -2k, 0 = 5g - 7g + 2k - q for g. -1 Suppose -9k + 12k + 4t - 53 = 0, 58 = 3k + 5t. Solve 15 = 3x, -2v + 2x - 5x = -k for v. -2 Let c(w) = -64w + 258. Let a(g) = -3g2 - 107g + 40. Let o be a(-36). Let z be c(o). Solve 2y + z = 3t, t - 4y + 1 = 15 for t. -2 Suppose 659 = -18v - 745. Let d = v - -90. Solve 4k + d = 3b, b + 2b - 12 = k for k. 0 Let u(k) = 2k - 4. Let y be u(3). Suppose -18t = -14t + 32, -16 = 4x - 0x + 5t. Solve yj - xj + 4 = 4q, -j - 11 = 4q for j. 5 Let o(d) = 2d*2 - 35d + 23. Let c be ((-35)/(-14) - (-2)/4)6. Let k be o(c). Let f = k + -38. Solve -4h + 9 = 3g - 6, 0 = -4g + fh + 20 for g. 5 Suppose 0 = k + 2h - 18, 27 = -5k + 2h + 69. Let v be k/6306/170. Solve -1 = -g - 5m, -g + v = -m + 2 for g. 1 Let f be ((-2)/3)/((-24)/108). Let w be (-87)/(-3)(-2 + f). Suppose -19 = 5n - w. Solve 5 = -nr - t, r + 5t + 25 = 5r for r. 0 Let g = 1531 + -1474. Suppose -2l - 65 - 9 = 0. Let b = l + g. Solve 3u + 40 = -u - 4f, 3u + f = -b for u. -5 Suppose 129c - 490 = 119c. Suppose -122 = -19z + c. Solve -4f = -6f - 3g + z, 0 = -f + 3g - 18 for f. -3 Suppose 6o - 14 - 16 = 0. Solve -2k - 5 - o = 0, 5 = -5a + 4k for a. -5 Suppose 102 = 2r - 4z, 4z + 149 = 3r - 12. Let w = 65 - r. Let s be (-1)/2((-12)/w - 6). Solve -1 = -x + 4, x - 17 = -sq for q. 3 Suppose -83n = 6n + 14n + 100n. Solve 4u - f - 4f + 17 = n, 0 = u - 5f + 8 for u. -3 Let k(x) = 25x - 202. Let m be k(-32). Let w = 1004 + m. Let y be 2 + 1 + 0 + 1. Solve -yz + 2g + 10 = -w, -3z = -g - 11 for z. 5 Let m be (-9 - (-49)/7)-1. Let a(u) = 6u2 + 3u - 9. Let i be a(2). Solve -mq + 4n - 28 = 0, 8q - n + i = 4q for q. -4 Suppose 0 = -4a, 0 = -11g - 5a + 46 + 75. Solve -2j - 9b - 10 = -gb, 4j + 20 = -5b for j. -5 Suppose 5k = -5a + 70, 3k - 3a = 5k - 32. Solve -4u + j = -3j + 16, k = 5j for u. -2 Let a be 5/55 - -4(-189)/(-396). Solve -2h + 8 = -r, ar + 30h - 27h = -2 for r. -4 Suppose -8 = -3r - 2h, -r + 3 = -h + 2. Suppose -24d + 6 = -42. Solve -4t + rv - 4 = -0v, d = -4t + 3v for t. -2 Let r be (2/1)/(31(-38)/(-589)). Solve 2t + 4z - 10 = 0, r = -4t + z - 24 for t. -5 Let s be (540/80)/(4/16). Suppose -s = -2q + 5x + 7, 0 = q - x - 11. Solve -2o - 4c + 18 = 0, -4c = 4o - q - 13 for o. 1 Suppose 2x + 52 + 86 = 0. Suppose 0 = -8c + 480 + 88. Let m = c + x. Solve 8 = -4v + 4k, 4v + mk - 5k = -6 for v. 0 Suppose 2x - 428 - 166 = 0. Suppose -2n + x = 5d, -2d + n = -37 - 80. Let f = -47 + d. Solve -2k = 5r - 0r - f, r + 5k + 16 = 0 for r. 4 Suppose -6k - 47 = -137. Let n(j) = -2j*2 - kj - 5 - 8 + 16. Let f be n(-7). Solve -5h + 20 = -0h, 5h - f = -5s for s. -2 Suppose k = 10 + 24. Let l = -23 + k. Suppose -8g + 41g = 99. Solve -4p - 8 = -0a + a, ga = p - l for a. -4 Let y be (-3)/(-4)-6(-8 + 408/54). Solve -5r = -5h + 3h - 4, y = r - h for r. 0 Let i(d) = 27d + 305. Let l be i(-11). Solve -l = -2u - 21o + 18o, -5u = -2o + 18 for u. -2 Suppose 0 = -3u + s + 8, -2s = -2u + s + 10. Suppose 16b + q = 19b - 6, -b + uq = -2. Solve -v = -0v - 3, -y + bv = 4 for y. 2 Let i be (11850/(-1425))/(4/(-38)). Solve -n - 18 = 4l, -74 = -l - i for n. 2 Suppose 7 = 4o + 3. Let s be o/((-2)/40-5). Suppose -5j + 0j + 34 = -sn, 0 = -5j + 2n + 42. Solve -2r = -j, -5v + 38 = 4r + 13 for v. 1 Suppose -4k - j + 16 = -3j, 30 = 5k - 5j. Let m = -152 + 154. Let w(h) = -12h - 68. Let g be w(-6). Solve -ma = 2n - g, -n = -3n + 4a - k for n. 1 Let d be 3 + 2 - (-7)/1. Suppose -d = 23t - 27t. Solve 2a - 13 = -5u, ta - 10 = 3u - 1 for u. 1 Suppose 2p = 0, 0 = 3j - 4p - 0p + 5p - 12. Solve -9 = -jo + 18r - 23r, 0 = -o - 2r + 3 for o. 1 Let v(s) = 2s + 14. Let g be v(-10). Let a = g + 10. Solve ad = -2w + 3w - 7, -29 = 4w + 3d for w. -5 Let m = 254 + -427. Let v = -171 - m. Solve vo + f = 10, -f = -3o - 1 + 11 for o. 4 Let f be 5/4 + (-2)/16-6. Suppose -4g + 12g = 8. Suppose -g = -4j + l, -5j - 2 + 4 = -l. Solve -fb = -v - 5, 0 = v + 4 + j for b. 0 Let a be 48/40(-15)/(-6). Suppose -p = -j + a, -p + 5p - 12 = -4j. Solve -3z = 2q - 21, 3z - 5q + 0q = p for z. 5 Suppose 2r = -5l + 3r + 8, 0 = -l + 4r - 6. Solve s - f = -6 - 1, -10 = ls - f for s. -3 Let d(r) = -r3 + r2 + 8r - 20. Let z be d(2). Let w = -8 - z. Solve -11 = h - 3o, 3o - 9 = -wo for h. -2 Let b = 9043 - 9043. Solve 2j - 5x - 93 + 114 = b, 0 = -j + x - 3 for j. 2 Let l = 278 - 260. Let f = -3 - -11. Suppose 2x = -2x + f. Solve 4u + 0u - l = -w, -2u + 5w - x = 0 for u. 4 Suppose 15r - 19r = -216. Suppose s + r = 5a, -35 = 10a - 13a - 2s. Solve 0x - 2l = 2x + 16, 2x + a = -l for x. -3 Let h be 4(0 - 4)/(-8). Let w be (-32 - 1)h/(-6). Suppose -6 = -14m + wm. Solve -3 - 3 = mt - 4k, 3t + 2k - 7 = 0 for t. 1 Let p(g) = -g + 14. Let d be p(10). Suppose u + 2u = 3q, -5q = -du - 5. Let i be q + -4 + 8 - 4. Solve -4l + 13 = -0l - k, -k = i for l. 2 Suppose -3w + 12w = 243. Let v be (w - 28)/((0 - 1)/71). Let x = -69 + v. Solve -3c = c + 4o, xc + 4o = 6 for c. -3 Let d be (1/(-5))/((-84)/40 - -2). Let u(k) = -k*3 - 2k*2 - 2k - 1. Let q be u(-2). Solve 2i + 3t = 10, di = t - 3 - q for i. -1 Suppose 4x - 25 = -d + 10, 4d + 4x - 152 = 0. Suppose 4h - 37 = -h - 4l, 5h + 3l = d. Solve 4f + 10 = -3p, 3f = -3p + 3 - h for p. 2 Let g = 5889 + -5887. Solve 3f = -gp, -2f = -11p + 12p for f. 0 Suppose 1337q - 138 = 1334q. Let o = 14 + -10. Suppose ow - g - 22 = 0, 0 = 4w + 5g + 12 - q. Solve -3s + 11 = -4u - ws, -4u = -3s - 19 for u. 1 Let o(k) = k3 - 11k*2 - 18k + 22. Let b be o(15). Suppose 645w = bw. Solve -v - 4 = -0v - 2i, 2v + 5i - 10 = w for v. 0 Let i = 350 - 344. Solve -i = -3k, 7y - 3y - k = 18 for y. 5 Suppose -5p = -i - 26, 2p - 15 = -0p + 5i. Suppose -36 = 5g - 6. Let q = g - -7. Solve 0 = -4w + pr + q, 5w + 2 + 0 = 3r for w. -1 Let s be ((-3)/(-4))/1(-1472)/(-552). Solve -5r + 26 = -2q, 12r - 10r - 2 = -sq for r. 4 Let g(d) = 3d - 17. Let b(k) = -42k + 2. Let h be b(1). Let o = h + 47. Let n be g(o). Solve 4s = -l - 7, -4l - ns + 5 = -3 for l. 5 Suppose 4g + 0 = -0. Suppose g = b + 4 - 7. Solve 2q = -bt - 3, -2t + 2q - 12 = -0t for t. -3 Let d be 5/(-4) - (-2)/8. Suppose 3r + r = -396. Let w be d + (-20)/(-8) - r/6. Solve k - p = -k - 11, 0 = -3k + 2p - w for k. -4 Suppose -124z - 113z = 93z - 3960. Solve -16 = -4a + 2g, 0 = 3a + zg - 11g - 17 for a. 5 Let h(j) = -38j + 139. Let r(c) = 19c - 70. Let k(n) = 2h(n) + 5r(n). Let z be k(4). Solve 4 = 5l - 5x - 1, 0 = 5l + zx - 23 for l. 3 Suppose -8y + y = 2079. Let x be (-2)/11 + (-945)/y. Solve -5d - 3 = -0j + j, -6 = -xd + 2j for d. 0 Suppose 0 = -u - 7t + 11t, -5t - 33 = -4u. Solve 8m = 2i + 7m + 7, -u = -3i - 3m for i. -1 Suppose -51z = 4b - 48z + 7, 2z = 5b - 20. Solve d - 3d = -4i - 24, 8 = -bi for d. 4 Suppose -5o + 3d - 3 = 0, 3d + 1 = 4o + 4d. Let j(v) = v2 - 7v - 28. Let c be j(10). Solve -y = -oy - 2g - 8, g = -y + c for y. 4 Let y be (2 + -7)/(-5) - -427. Suppose -4h + 436 = 4j, 0j = -4j - 2h + y. Let v = j + -81. Solve 3m + 0s + v = 3s, 4m - 3s + 28 = 0 for m. -4 Let u(z) = -z*3 + 3z*2 + 12z - 16. Let l(g) = -5g3 - 4g*2 - 3g. Let v be l(-1). Let s be u(v). Solve 0 = -4i - 3h - s, i - h + 4 = -3*h for i. -4 Sup	{ "pile_set_name": "DM Mathematics" }
85? False Which is smaller: -19096 or -19060? -19096 Is 1262117 at most 1262119? True Which is bigger: -3011 or 0.15? 0.15 Which is smaller: 23644/629 or 37? 37 Is 13927 < 13927? False Which is smaller: 0 or 8/10853? 0 Which is smaller: -2/719 or -2145? -2145 Which is smaller: 188791.9 or 0.2? 0.2 Is 2339/397 <= 6? True Which is bigger: 60612 or 60611? 60612 Is 0 greater than or equal to 108/1561? False Do -43352 and -823673/19 have the same value? False Is -1 at most 328/18173? True Is 522827 != 522828? True Do -65689/12 and -5473 have the same value? False Are 803884 and 803882 unequal? True Which is smaller: 12448 or 12449? 12448 Which is bigger: 8567 or 162780/19? 162780/19 Is -96 at least as big as -69048/727? False Which is smaller: -2.9726 or -2/503? -2.9726 Which is greater: -3/2 or 1/12910? 1/12910 Which is smaller: 12/77 or -2/13? -2/13 Is 2526/11 != -0.14? True Which is greater: 0 or 23200? 23200 Is -7129 bigger than -13? False Is 7 at most 0.1588? False Is 3/2 < 112673? True Which is smaller: 118 or -1266? -1266 Do -503446 and -503446 have the same value? True Is -0.2 greater than or equal to -894595? True Which is bigger: -3819741 or -3819742? -3819741 Is -2142 < 30? True Is -75547 at least as big as -1? False Which is smaller: -13260 or -66297/5? -13260 Is 5/52342 smaller than -1? False Is 56429 >= 56429? True Which is smaller: 1/236020 or -2? -2 Which is smaller: 9427 or 9422? 9422 Are -34/7765 and 0 non-equal? True Which is greater: 3747 or 3753? 3753 Is 2567/1262 >= 2? True Which is smaller: -245847 or 1? -245847 Which is greater: -3.602 or -8? -3.602 Is 0.0526 <= -2163? False Is -1304 at most as big as -61269/47? True Which is greater: 77 or 2476? 2476 Which is smaller: -26/3 or -400? -400 Which is greater: -6134 or -6133? -6133 Are -207596 and -207598 equal? False Is -1.9 smaller than 2685? True Is 0 > -181/777? True Is -512073 at most -512080? False Is 2773 greater than 13869/5? False Which is smaller: -56/55981 or -1? -1 Is 3205/1438 >= 2? True Which is greater: -166734 or -166730? -166730 Is -0.2 != 12.15? True Which is smaller: -0.69 or -1/21? -0.69 Is 0 < 14541? True Which is greater: 463275/2 or 231637? 463275/2 Is 1/31 smaller than -991? False Is -6145 at most as big as -49171/8? False Which is greater: 38382 or 38313? 38382 Which is bigger: 2/35 or 18524? 18524 Which is smaller: -65255/7 or -9323? -9323 Which is smaller: -26509 or -26501? -26509 Is 1 != 2/1396735? True Which is greater: 705 or 38818/55? 38818/55 Which is greater: -8 or 1861? 1861 Is 3780 at most as big as 3798? True Which is bigger: -0.2 or -15402/19? -0.2 Which is smaller: 201125 or 201126? 201125 Which is smaller: -37942 or -38021? -38021 Which is bigger: 7 or 508492? 508492 Are 381/2548 and 0 non-equal? True Is 13418 != 13417? True Which is smaller: -1 or 3/34969? -1 Is -1035 at least as big as -1106? True Is 126604 smaller than -0.2? False Is 529516 <= 529515? False Are -15745 and -110216/7 equal? False Which is smaller: 28099 or 28095? 28095 Is 8329195/6 less than or equal to 1388199? False Which is smaller: 25634 or 25717? 25634 Is 131697 less than or equal to 1053583/8? True Is -15682 at most as big as -15707? False Which is greater: 694/5 or 3? 694/5 Does 13583 = 13648? False Which is smaller: 108.4 or -22? -22 Which is smaller: 28/66671 or 1? 28/66671 Which is smaller: -52877 or -52862? -52877 Is -4079 at most as big as -121? True Is -5 < -64968? False Which is greater: 0.34 or 2.06? 2.06 Which is smaller: 3 or 14/6773? 14/6773 Which is smaller: 1 or -2/762551? -2/762551 Is 0.8 greater than or equal to -58878? True Is -390 smaller than -407? False Is -35/146464 bigger than 0? False Which is bigger: 1852 or 17? 1852 Is -499/857 less than or equal to -1? False Do -0.034 and 2/38903 have the same value? False Is 22213 at most as big as 22210? False Is -86538 smaller than -86537? True Is -2983 less than -38786/13? False Which is greater: 17069 or 17071? 17071 Which is smaller: -161 or -405? -405 Are 0.454 and -1792 nonequal? True Which is bigger: -12/2126591 or 1? 1 Which is smaller: -15 or -11680/787? -15 Is -21880 less than or equal to -21862? True Is 0.0173 < 3? True Which is smaller: 14/46803 or 1? 14/46803 Is 672 at least as big as 38302/57? True Is 1 not equal to 1/58680? True Is 277 equal to 1933/7? False Which is greater: -2/2039 or -9? -2/2039 Which is bigger: -16550/69 or -240? -16550/69 Which is greater: 3 or 4438/1961? 3 Is -1 greater than -395/348? True Which is greater: 1 or -7/83259? 1 Which is smaller: 167/942 or 1? 167/942 Is -2/209 less than or equal to -882? False Is 12 not equal to 1.5621? True Is -25.1 greater than -0.062? False Do -2/13 and 35837 have different values? True Is -33097 > 0.43? False Which is greater: 3038 or 3040? 3040 Is -9561088 smaller than 1? True Is -21/3049 smaller than 1? True Which is smaller: 1 or 2/10295? 2/10295 Which is smaller: 275 or -4227/4? -4227/4 Which is smaller: 1/14 or 0.3913? 1/14 Is 1820 less than 1492? False Is 25024 at most as big as 25158? True Which is greater: 75205 or 75220? 75220 Are 124538 and 2/3 equal? False Is -179 greater than or equal to -146? False Which is bigger: -2/5 or 0.047124? 0.047124 Is 75.76 greater than or equal to 60? True Are 5411 and 16235/3 non-equal? True Which is bigger: -159 or 4335? 4335 Which is smaller: -307/5113 or 0? -307/5113 Which is greater: -1 or 429/5095? 429/5095 Which is smaller: -459 or -8739/19? -8739/19 Is 113/104 less than 0.8? False Is 4250 less than -12? False Is -860 less than -1129? False Which is smaller: -3 or -55921? -55921 Is 10376/23 equal to 450? False Which is smaller: 27236 or -0.39? -0.39 Which is bigger: 1 or -1/2866447? 1 Which is greater: 1/9409884 or 0? 1/9409884 Are -185/2 and 0.3 equal? False Is -1 at least as big as -13/296? False Is -6385/38 at most -169? False Which is smaller: 7728 or 7731? 7728 Which is bigger: -4772981 or -4772982? -4772981 Is 0 greater than -4/34975? True Is -190636 >= -190634? False Is -2435 smaller than 468? True Is 46/4567 < 0? False Do -4 and -0.549557 have different values? True Which is bigger: -400/851 or 0? 0 Is 5248 <= 5252? True Which is smaller: 18536 or 18549? 18536 Which is smaller: -8236 or -8349? -8349 Which is smaller: -399 or 89.1? -399 Which is greater: -1 or -40/5477? -40/5477 Which is bigger: -309 or 2249? 2249 Is -156139 at most as big as -156140? False Is -49384 at least 2? False Which is smaller: 0 or 70/46989? 0 Does -2985 = 1.3? False Which is bigger: -8/429125 or 1? 1 Is 16661 less than 83299/5? False Which is smaller: -3670 or -3732? -3732 Which is bigger: 73/695 or -1? 73/695 Which is bigger: 7/46938 or 1? 1 Which is smaller: -108 or 319? -108 Is 791 > -773? True Which is smaller: 3/3922 or -2? -2 Which is smaller: 221 or -2962? -2962 Is -44380 != -44375? True Is -50/409 at most 0.001? True Which is smaller: -1/10256 or 1? -1/10256 Is -49302 greater than -49282? False Which is greater: 2/7130821 or 1? 1 Do 2/5 and 45843 have different values? True Is 3/263648 smaller than -1? False Is -157581 bigger than -157581? False Which is bigger: -75088 or 2/3? 2/3 Which is smaller: -739 or 3/550? -739 Which is bigger: -1/27282 or 2/9? 2/9 Which is bigger: -939/11 or -19? -19 Which is greater: -39050/53 or -736? -736 Which is smaller: -122459 or -122457? -122459 Are -70598 and -70596 non-equal? True Which is smaller: 13 or -127/46? -127/46 Is -175 at most 8/153? True Is 102076 at least 102076? True Do -5811471/4 and -1452869 have the same value? False Is 0.2 < -14970/767? False Is 3/93103 greater than 0? True Which is smaller: 3 or -2/80621? -2/80621 Which is greater: 0 or -324/1337? 0 Is 297747 > 2? True Which is bigger: 1191 or 37? 1191 Is -3/391172 less than or equal to 0? True Which is smaller: 4024330 or 4024331? 4024330 Which is smaller: 9138 or 9143? 9138 Which is smaller: -738151 or -738150? -738151 Is 0.03 at least 0.05268? False Which is smaller: -4/8685181 or 0? -4/8685181 Is -506.26 not equal to -3/5? True Is -86840 less than -347363/4? False Is 32997 > 33031? False Are -1 and -0.08419 non-equal? True Which is smaller: -14235 or -42707/3? -42707/3 Which is smaller: -32491 or -227443/7? -227443/7 Is 1 smaller than 2/74771? False Is 74793 greater than or equal to 748	{ "pile_set_name": "DM Mathematics" }
Simplify (-4(sqrt(132) - (sqrt(132) - (sqrt(132) + sqrt(132)-2 + sqrt(132)))) - sqrt(132))/sqrt(12). -sqrt(11) Simplify (sqrt(28) + (sqrt(168) + 1sqrt(168))/sqrt(6))/(sqrt(16)/(sqrt(16)/sqrt(4))). 3sqrt(7) Simplify (sqrt(70) + 2sqrt(70)-1 - sqrt(70))/(sqrt(10) + -5sqrt(10)-1 + sqrt(10)). -2sqrt(7)/7 Simplify sqrt(11)1-2 - (sqrt(11) - (sqrt(33)/sqrt(3) - sqrt(11))2)4. -6sqrt(11) Simplify -5 + sqrt(6)/(sqrt(300) - -1sqrt(300)). -5 + sqrt(2)/20 Simplify ((sqrt(78) - sqrt(78)-1)2)/(51sqrt(6)). 4sqrt(13)/5 Simplify -1(sqrt(7) + -1 + sqrt(7))*2 + (-5 + (2sqrt(7))*2 - sqrt(7)). -6 + 3sqrt(7) Simplify (1-1(-1 + sqrt(3)))*2. -2sqrt(3) + 4 Simplify (2(sqrt(228) + sqrt(228)3))/sqrt(12). 8sqrt(19) Simplify (sqrt(110)/((sqrt(10) - sqrt(30)/sqrt(3)) + sqrt(10)))23. 33 Simplify 1(0 + sqrt(39)/sqrt(3) + sqrt(13)). 2sqrt(13) Simplify (-4sqrt(2299)1)2. 36784 Simplify (sqrt(54)/sqrt(32) + 4)2. 6sqrt(3) + 283/16 Simplify (-4 + sqrt(27)-3)3. -27sqrt(3) - 12 Simplify 3(1 + sqrt(2000) + sqrt(2000)). 3 + 120sqrt(5) Simplify ((-41sqrt(95))/(sqrt(405) - (sqrt(405) + -1sqrt(405))))2. 304/81 Simplify 5(sqrt(147)1 + -1 + (-2sqrt(147)-5 - sqrt(147)))2. -700sqrt(3) + 73505 Simplify sqrt(19)-3-1 - (sqrt(19) + -1sqrt(76)). 4sqrt(19) Simplify (2 + (sqrt(1216) - sqrt(1216)1) + sqrt(1216) + sqrt(1216) - sqrt(1216)) + 5. 7 + 8sqrt(19) Simplify (sqrt(12) - (sqrt(12) - -4sqrt(192)))2 + (sqrt(6)/(-2sqrt(2)) - (sqrt(12) + -5)). -5sqrt(3)/2 + 3077 Simplify (sqrt(468) + -3 - (sqrt(13) - sqrt(208))-3)*2. 18sqrt(13) + 126 Simplify (2 + sqrt(44) - (sqrt(176) - sqrt(176)-1)2)-2. -4sqrt(11) + 1404 Simplify sqrt(11)23 - (-2 + sqrt(22)/sqrt(2))2. -15 + 10sqrt(11) Simplify (((sqrt(475)3)2 - sqrt(475)) + sqrt(475))-4. -17100 Simplify sqrt(50)/((sqrt(80)1 + sqrt(80))/sqrt(8)). sqrt(5)/2 Simplify (1 + 2 + (sqrt(272)3 - sqrt(272)))*2. 48sqrt(17) + 1097 Simplify (sqrt(18) - sqrt(2))*2-3 + -1sqrt(2) + 2. -22 - sqrt(2) Simplify (sqrt(153)1 + sqrt(153))/sqrt(9) + 2 + sqrt(17)-1. 2 + sqrt(17) Simplify (sqrt(2) - (sqrt(8)/sqrt(4))2)1 - sqrt(198)/sqrt(11). -2sqrt(2) - 2 Simplify (sqrt(117) + 3(sqrt(117) - sqrt(117)-1))/(sqrt(9) - (sqrt(324) + sqrt(324)2 + sqrt(324))). -7sqrt(13)/23 Simplify 3 + sqrt(3)4 - -6-2sqrt(3). -8sqrt(3) + 3 Simplify (-1sqrt(8)3)/(-1sqrt(144)). sqrt(2)/2 Simplify sqrt(24)/(sqrt(80)/(sqrt(20)/sqrt(2)))5. 5sqrt(3) Simplify (-2 + sqrt(1088))*2 + -2. -32sqrt(17) + 1090 Simplify sqrt(1331) - (-6(sqrt(1331) + -1))2. -47952 + 803sqrt(11) Simplify (sqrt(28)/(-5sqrt(4)))2 + 2. 57/25 Simplify (sqrt(99) + 3 + 1sqrt(99) + 2)*2. 60sqrt(11) + 421 Simplify -2-5sqrt(17)5. 50sqrt(17) Simplify (sqrt(91) + sqrt(91) + (sqrt(91)1 - sqrt(91))-1)/(sqrt(21)/sqrt(3)-3). -2sqrt(13)/3 Simplify ((sqrt(27) + sqrt(432))1)/sqrt(9) - 5(sqrt(3)2 + sqrt(3))-6. 95sqrt(3) Simplify ((1sqrt(70))/sqrt(5))/(-4sqrt(6)/sqrt(3)). -sqrt(7)/4 Simplify (5(sqrt(12) - 2sqrt(12)))/(4(sqrt(4) + (sqrt(4) - sqrt(8)/sqrt(2)))). -5sqrt(3)/4 Simplify (sqrt(187)-1-5)/(4(sqrt(11) + sqrt(33)/sqrt(3)) + sqrt(11)). 5sqrt(17)/9 Simplify sqrt(3888) + 0 + sqrt(3888). 72sqrt(3) Simplify (sqrt(63)-3 - sqrt(7)) + sqrt(567) + (sqrt(567) - (sqrt(567) - (-2 + sqrt(567)))) + sqrt(567). -2 + 17sqrt(7) Simplify 4 + (sqrt(147) + (sqrt(147) - (sqrt(147) + 1 + sqrt(147))-2) + -3)2. -84sqrt(3) + 5297 Simplify (-4 + 3 + sqrt(17) + sqrt(17) + 4)*2. 12sqrt(17) + 77 Simplify 3 + ((sqrt(91)/(sqrt(7) - (sqrt(7) - sqrt(7)-1)))2 - ((sqrt(13)1 - sqrt(13)) + 4)). 12 Simplify -5(2(sqrt(28)/sqrt(2) - sqrt(14)))/(sqrt(96)/sqrt(12)). 0 Simplify 4(1 + sqrt(13)) + (sqrt(13) + sqrt(52)/sqrt(4))-4. -4sqrt(13) + 4 Simplify 1 + (-3sqrt(2057) + sqrt(85)/(sqrt(5)3))2. 163277/9 Simplify (sqrt(176) + 2)2 + -5. 16sqrt(11) + 175 Simplify sqrt(288) + 2. 2 + 12sqrt(2) Simplify (sqrt(1331) + (1 + sqrt(1331) - sqrt(1331)) + sqrt(1584))2. 46sqrt(11) + 5820 Simplify sqrt(3)-3-3 - (sqrt(432) + 2 + sqrt(432))*2. -1732 - 87sqrt(3) Simplify (sqrt(1008) - (sqrt(1008)-2 + -1))22. 144sqrt(7) + 18146 Simplify 1 + (2sqrt(75))*2 + 1. 302 Simplify (sqrt(121) + sqrt(121) + sqrt(121)22 + sqrt(121))/(1sqrt(11)-2). -7sqrt(11)/2 Simplify (sqrt(84)/sqrt(3) - sqrt(7)) + 4 + sqrt(56)/sqrt(8). 4 + 2sqrt(7) Simplify (((-3 + sqrt(304))4 + sqrt(304))6)2. -17280sqrt(19) + 278784 Simplify sqrt(13) + sqrt(117)/(sqrt(9)-1) + 0. 0 Simplify (sqrt(165)/(sqrt(11) + 3sqrt(11)))/(sqrt(33)/sqrt(99)). 3sqrt(5)/4 Simplify (4(5 + (-2sqrt(288) - sqrt(288) - sqrt(288)) + 4))2. -13824sqrt(2) + 75024 Simplify 5(sqrt(500) - (-1 + sqrt(500))). 5 Simplify (-2sqrt(12) - (sqrt(24)/sqrt(4))/sqrt(2))*2. 75 Simplify 2sqrt(5)-2 + sqrt(25)/(1sqrt(5)). -3sqrt(5) Simplify ((sqrt(8)/sqrt(4) + -4)2 - sqrt(2)) + 1sqrt(128) + (sqrt(8) - sqrt(88)/(-2sqrt(11)))/sqrt(4). sqrt(2)/2 + 18 Simplify sqrt(15)/(sqrt(189)/sqrt(7)). sqrt(5)/3 Simplify ((sqrt(77) + sqrt(77) + -3sqrt(77))3 + sqrt(77))/sqrt(11). -2sqrt(7) Simplify (1 + (sqrt(396) - (-1 + sqrt(396)) - sqrt(396)))*2. -24sqrt(11) + 400 Simplify 2(sqrt(2448) + (0 + sqrt(2448))2) - (1sqrt(2448))*2-4. 24sqrt(17) + 14688 Simplify (-4(sqrt(16) + sqrt(400)))/sqrt(8). -24sqrt(2) Simplify ((sqrt(72)1 - sqrt(72))/sqrt(4) + -4)*2. 16 Simplify (((sqrt(28)/sqrt(2) - sqrt(14)) + sqrt(14))3)/(sqrt(28)/sqrt(4)5) + -3. -3 + 3sqrt(2)/5 Simplify (2(sqrt(1088) + -3 + sqrt(1088) + sqrt(1088)) - sqrt(1088))2. -480sqrt(17) + 27236 Simplify (sqrt(36)-1)/sqrt(12) - (sqrt(3) - (-1 + sqrt(3)1)). -sqrt(3) - 1 Simplify sqrt(48) + 2 - (sqrt(3) - (0 + sqrt(3) + -1))*2. 1 + 4sqrt(3) Simplify (sqrt(3500) + -2sqrt(3500))/(-1sqrt(320)). 5sqrt(7)/4 Simplify -3(sqrt(175) + 3). -15sqrt(7) - 9 Simplify ((sqrt(684) + (sqrt(684) - sqrt(684)1))4 + -1)2. -48sqrt(19) + 10945 Simplify 2(2sqrt(52))*2. 416 Simplify sqrt(65)/(sqrt(20)/sqrt(64)). 4sqrt(13) Simplify (sqrt(1900)-3-4 + -2 + (sqrt(1900) - (3 + sqrt(1900))))*2. -1200sqrt(19) + 273625 Simplify 2(((-5(sqrt(34)/sqrt(2) + sqrt(17)))2 - (-2 + sqrt(51)/sqrt(3))2) + 3). 8sqrt(17) + 3364 Simplify (-2sqrt(968))/(-2sqrt(484) - sqrt(484)). 2sqrt(2)/3 Simplify ((0 + sqrt(52))-2 + sqrt(52)2 + -1)*2. 1 Simplify -2(sqrt(14) - (sqrt(14) + (sqrt(14) - (sqrt(112)/(-1sqrt(8) + sqrt(8) - sqrt(8) - sqrt(8)) + sqrt(14)))))/sqrt(2). sqrt(7) Simplify ((sqrt(1216)3 + sqrt(1216) - sqrt(1216)) + -3 + sqrt(1216) + 5)*2. 128sqrt(19) + 19460 Simplify 3sqrt(72) + (sqrt(2) - ((sqrt(2) + -3)2 + 4)). -15 + 25sqrt(2) Simplify (1sqrt(2178))/sqrt(6)3. 33sqrt(3) Simplify 5sqrt(26)/sqrt(2)2. 10sqrt(13) Simplify (sqrt(1300)-2 - (1 + sqrt(26)/sqrt(2)))2. 42sqrt(13) + 5734 Simplify (sqrt(119)/(sqrt(84)/(sqrt(12) - sqrt(24)/sqrt(2) - sqrt(12))) + 3)-1. -3 + sqrt(17) Simplify -2 + (sqrt(1053) + 2 + sqrt(1053))2. 72sqrt(13) + 4214 Simplify sqrt(40)/(6(sqrt(72) - sqrt(8))). sqrt(5)/12 Simplify -3(4 + sqrt(5))6 + -1. -73 - 18sqrt(5) Simplify sqrt(30)/(sqrt(40)/sqrt(4)) - ((-2 + sqrt(12)/sqrt(4))*2 - sqrt(3)) - (sqrt(6)/sqrt(2) + 2 + 3). -12 + 5sqrt(3) Simplify 5 + sqrt(684)21 + 2. 7 + 12sqrt(19) Simplify -2 + (sqrt(130)2)/sqrt(10) + sqrt(13). -2 + 3sqrt(13) Simplify (sqrt(17) + sqrt(51)/sqrt(3))6 - (1 + ((2 + sqrt(17) - sqrt(17)) + sqrt(17))*2). -22 + 8sqrt(17) Simplify (sqrt(66)/(-1sqrt(6)5))2. 11/25 Simplify (1 + sqrt(19) + 1 - (sqrt(171) + -4))2. -24sqrt(19) + 112 Simplify sqrt(30)/(sqrt(24)/sqrt(4)) + 3. sqrt(5) + 3 Simplify ((sqrt(99)2 + -4)4)2. -768sqrt(11) + 6592 Simplify sqrt(33)/(sqrt(3) + sqrt(9)/(sqrt(6)/sqrt(2))). sqrt(11)/2 Simplify (-6((3 + sqrt(605) - sqrt(5)) + sqrt(15)/sqrt(48)))2. 2214sqrt(5) + 76941/4 Simplify (-4-5sqrt(6)/sqrt(3))*2. 800 Simplify (sqrt(720)1)*2 + 2. 722 Simplify sqrt(144)/sqrt(27) + -5 + sqrt(3) + sqrt(36)/(sqrt(24)/sqrt(2)). -5 + 10sqrt(3)/3 Simplify sqrt(700) + sqrt(700) + (sqrt(700) + -4)*26 + sqrt(700) - sqrt(700). -460sqrt(7) + 4296 Simplify (3 + sqrt(6)/(sqrt(18) + sqrt(2) + sqrt(2) + sqrt(2)) + 1 + sqrt(75) + sqrt(75))2. 244sqrt(3)/3 + 3913/12 Simplify (sqrt(6000) + -3sqrt(6000))/(sqrt(192) - sqrt(192)3 - sqrt(12)). 20*sqrt(5)/9 Simplif	{ "pile_set_name": "DM Mathematics" }
when 74 is divided by v? 24 Let p(n) = -17n2 - 19n - 10. Let c(j) = 8j2 + 9j + 5. Let l(z) = 13c(z) + 6p(z). Let f = 18 - -6. Calculate the remainder when l(5) is divided by f. 22 Let c = 9 - 19. Let q = -22 - c. Let f = 25 + q. Calculate the remainder when 37 is divided by f. 11 Suppose 3y - 15 + 45 = 3d, -y + 38 = 3d. What is the remainder when 33 is divided by d? 9 Let n = 79 - 34. Suppose 2b - 3l = 22, -3b - 5 = -0b + 5l. Suppose 13 = a - 0a + 3o, n = 5a + bo. What is the remainder when 13 is divided by a? 6 Let p(q) = -q*2 + 6q - 5. Let h be p(7). Let k be (-58)/3h/(-8). Let z = k + 40. What is the remainder when 41 is divided by z? 8 Let c = 67 - 42. Suppose r = -2v - 3, -5r + 0r - 1 = -4v. What is the remainder when (47-1)/v + 1 is divided by c? 23 Suppose -2v = 4 - 80. Calculate the remainder when v is divided by 13. 12 Let z = 16 + -2. What is the remainder when 40 is divided by z? 12 What is the remainder when 53 is divided by 1536/56 + ((-11)/(-7) - 1)? 25 Let s(x) = 4x*2 - 2x + 1. Let d(l) = 9l2 - 4l + 2. Let t(k) = 6d(k) - 13s(k). What is the remainder when (-17)/(-2) - 1/2 is divided by t(-2)? 2 Suppose -2j = 2i - 16, 2j + 9i - 16 = 4i. What is the remainder when 21 is divided by j? 5 Suppose -21 = -b + 3r, 0b = 4b + 2r - 14. Let l = b - -11. Calculate the remainder when l is divided by 6. 5 Suppose -3k - 4k = -1519. Calculate the remainder when k is divided by 55. 52 Suppose -5x + 18 = -2. Calculate the remainder when 4 is divided by x. 0 Suppose -3n + 192 = 3s, 79 + 213 = 4s - 5n. What is the remainder when s is divided by 23? 22 Let n = -11 - -118. What is the remainder when n is divided by 14? 9 Suppose -r - 18 = -4r. Suppose 0y = 4a - 3y - 3, -a = -2y + 3. What is the remainder when (-18)/(2 + (a - r)) is divided by 7? 4 Suppose -a - a + 4o = -18, -4a + o = -57. What is the remainder when 226/4 + (-4)/(-8) is divided by a? 12 Suppose -5q - 1 = 3h - 32, -2h + 3q + 46 = 0. What is the remainder when h is divided by 10? 7 Suppose 0 = -b - 3b + 64. Let r = 19 + -15. Suppose 0 = 2g - 2m + 40 - 104, rm + 157 = 5g. What is the remainder when g is divided by b? 13 Let k(x) = 21x - 1. Let g(t) = -t - 6 + 7 + 11. What is the remainder when k(1) is divided by g(5)? 6 Let y = -11 - -19. Let u = -24 - -38. Calculate the remainder when u is divided by y. 6 Suppose 0z = -4z + 272. Let v = 108 - z. Suppose -2i = -6i + v. What is the remainder when 37 is divided by i? 7 Let s(m) = -m2 - m + 1. Let g(u) = -u2. Let y(a) = -g(a) - s(a). Let j be y(-3). What is the remainder when 5 is divided by 2/7 - (-38)/j? 2 Suppose 0 = 5f + 29 - 99. Let s = -3 + f. Let r(l) = l - 3. Calculate the remainder when s is divided by r(7). 3 What is the remainder when 14 is divided by 52(-4)/(-8)? 4 Let z be 12/(-2)-4. Suppose -225 = -o - zo. What is the remainder when o is divided by 24? 21 Let s(c) = -c3 - 7c*2 + 4c - 2. Let k be s(-8). Suppose -2r + 5r = k. Calculate the remainder when 29 is divided by r. 9 Let o(p) be the first derivative of p3/3 + p2/2 - 3p - 6. Calculate the remainder when 53 is divided by o(5). 26 Suppose b + 3z - 69 = z, -b + z + 63 = 0. What is the remainder when b is divided by 34? 31 Let q = -39 + 20. Let w = 42 + q. What is the remainder when 43 is divided by w? 20 Let c(g) = 4g2 - 4g - 5. Let h(z) = 5z2 - 5z - 6. Let i(x) = 4c(x) - 3h(x). Let v = 42 - 28. What is the remainder when i(-6) is divided by v? 12 Suppose -3v - 2j = -147, -v + 5j - 62 = -2v. Let t = -21 - 10. Let m = t + v. Calculate the remainder when m is divided by 9. 7 Suppose -5r + 6z = 2z - 321, 4r + z = 240. Calculate the remainder when r is divided by 17. 10 Suppose 6v - 8 = 2v. Suppose vi = 5 + 83. Suppose -5g + 82 - 32 = -5d, -35 = -3g + 2d. What is the remainder when i is divided by g? 14 Suppose -12 = -5g - 3o, 4o - 1 + 20 = 5g. Suppose -4f + 0 = 5p - 15, 0 = f. Suppose -21 + 6 = -pz. Calculate the remainder when z is divided by g. 2 Suppose a + 343 = 4o, -4o - 2a + 6a = -328. Let d = o + -44. What is the remainder when d is divided by 16? 11 Let g(j) = -j + 3. Let i = 1 - 6. Calculate the remainder when g(i) is divided by 4. 0 Let w = -1 - -4. Suppose -wc + 8 = -13. Calculate the remainder when 41 + 42/2 is divided by c. 4 Let l = -5 - -7. Suppose 2p - j - 4 = 0, -p + l = -0p + 5j. Calculate the remainder when p is divided by 1. 0 Let j(y) = -y2 - 6y - 5. Let d be j(-5). Let g = d - -10. What is the remainder when g is divided by 6? 4 Let p = -5 + 9. Let c be (17 - -3)(-16)/(-5). Suppose pm = -0m + c. Calculate the remainder when 31 is divided by m. 15 Suppose 4n - 7 = b, -n - 6b = -3b - 5. Suppose -5z + 14 = 3a, -2a + 1 = -z - 4. Calculate the remainder when n is divided by z. 0 Suppose 39 = 2f - 29. Let t = 48 - f. Suppose l = 3b - 14, 4b - 25 + 0 = -5l. Calculate the remainder when t is divided by b. 4 Let b(j) = j2 + 15j + 8. Calculate the remainder when b(-16) is divided by 2. 0 Let d = 10 + -6. Suppose i = d, 5c + 5i = -0i + 30. Suppose f + 32 = 36. Calculate the remainder when f is divided by c. 0 Suppose -3c = 2c - 215. Calculate the remainder when c is divided by 22. 21 Let v(p) = -122p. What is the remainder when v(-1) is divided by 31? 29 Let w = -8 - -18. Calculate the remainder when 29 is divided by w. 9 Suppose 0 = -3k + 2g + 59, 2k + g + 0g - 44 = 0. What is the remainder when k is divided by 12? 9 Let s(n) = 2n + 9. Calculate the remainder when 99 is divided by s(8). 24 Let f = -33 + 49. Let j = 1 + f. Calculate the remainder when j is divided by 7. 3 Let p(t) = t3 - 3t*2 - 3t + 5. Let j be p(4). Let m(g) = g. What is the remainder when 26 is divided by m(j)? 8 Suppose s - 5s + 164 = 0. Calculate the remainder when s is divided by 22. 19 Let o = 136 + -54. What is the remainder when o is divided by 14? 12 Let k = -48 + 99. Calculate the remainder when 98 is divided by k. 47 Suppose 26 = 9q - 91. What is the remainder when q is divided by 5? 3 Let g(o) = o*2 + 5o + 9. What is the remainder when 34 is divided by g(-5)? 7 Let a(b) = -b*2 - 8b + 2. Let o be a(-8). Suppose -oh = 3h. What is the remainder when 1/1 + 0 - h is divided by 1? 0 Let h = 10 + -6. Suppose m + 3 - 12 = 0. Calculate the remainder when m is divided by h. 1 Let w(n) = 2n3 - 2n*2 - 3n + 4. Calculate the remainder when 15 is divided by w(2). 3 Let a = -117 - -62. Let i = a + 81. Calculate the remainder when i is divided by 9. 8 Calculate the remainder when (-302)/(-4) - 5/(-10) is divided by 39. 37 Let o = -22 - -34. What is the remainder when 18(-3 + (-44)/(-8)) is divided by o? 9 Let l(m) = -m2 - 8m - 3. Let u be l(-7). Suppose -uj = -3j - 11. What is the remainder when 31 is divided by j? 9 Let j = -3 + 8. Suppose t = 1 + j. What is the remainder when 22 is divided by t? 4 Let q = -4 - -20. Suppose -5v - 2 = -3i, -3i + 7 = -2v - 1. Suppose vc - 17 = 1. What is the remainder when q is divided by c? 7 Let x = -44 + 72. Calculate the remainder when 81 is divided by x. 25 Suppose 10b - 12b = -22. What is the remainder when 30 is divided by b? 8 Suppose d - 120 = 4r, -5r - d = -3d + 153. Let o = 122 + r. Calculate the remainder when o is divided by 24. 21 Suppose -5n - 6 = 4. Let a = n - -6. What is the remainder when 10 is divided by a? 2 Let r be (-36)/(-3)2/6. Let l be -2(2 + -3) + 93. Suppose -g + l = rg. Calculate the remainder when 56 is divided by g. 18 Suppose 4d = -5f + 20, 2d - 13 = -3f - 3. Suppose 0 = 5o - 0o + 50. Let n = o + 23. What is the remainder when n is divided by d? 3 Let k be -6((-4)/2 + 0). Let q = k + -7. What is the remainder when q is divided by 2? 1 Let r = -9 + 88. Suppose -9 - r = -2h. What is the remainder when (-2 - -5)h/6 is divided by 12? 10 Let t = 14 - -40. Suppose 70 = 5m + 2j, m + j - 56 = -3m. Calculate the remainder when t is divided by m. 12 Let r(x) = x + 5. Let l be r(-8). Calculate the remainder when -2 - 1120/l is divided by 13. 12 Let w(p) = -13p. Let x be w(2). Suppose -4g + 5r = 148, 5g + 2 = -5r - 183. Let u = x - g. What is the remainder when 21 is divided by u? 10 Let z(k) = -3k2 + 21k - 21. Let b(y)	{ "pile_set_name": "DM Mathematics" }
for k. 0 Let g(n) = n + 13. Let p = 13 + -21. Let m = p - 5. Let x be g(m). Solve r + 2r - 12 = x for r. 4 Let k be 8(2 - 28/16). Suppose -22 = -3p + k. Suppose -4g - 11 = 4a - 3, 3a - 26 = 5g. Solve 2w = -p + a for w. -3 Let b(i) = -16i + 102. Let j be b(6). Let a(u) be the first derivative of -u4/4 + 5u*3/3 + 9u*2/2 - 8u - 1. Let c be a(j). Solve c = -2g - 0g for g. -5 Suppose 5s - s = 12. Let l be (7/(-28))/((-1)/12). Suppose 0 = -2m - m - b + 8, lb = 5m - 4. Solve 0 = sa + ma + 15 for a. -3 Suppose 202 = -5m + 292. Solve 34 = -4q + m for q. -4 Suppose 99 = 5k - y - 2y, -5y = -5k + 95. Suppose -4q = 5 - k. Suppose -9m - q = -11m. Solve -c - 7 = -m for c. -5 Let o(b) = -11b + 124. Let m be o(11). Solve mc - 1 - 14 = 0 for c. 5 Suppose 0 = -14t - 45 + 157. Solve m - t = -m for m. 4 Suppose -25s + 26s = 2m, 4s - 20 = -2m. Solve -2 - m = 2k for k. -2 Suppose -3l + 34 = -4q - 6, 5q + l + 50 = 0. Let b = q + 10. Let k = 3 - b. Solve 0 = -z - 0z - k for z. -3 Let m(c) = -2c3 + 4c*2 + 6c - 3. Let q(k) = -3k3 + 4k*2 + 7k - 4. Let i(y) = -4m(y) + 3q(y). Let g be i(-3). Solve -7z + 6z + 2 = g for z. 2 Suppose -29x + 240 = -17x. Solve xv = 6v - 28 for v. -2 Let y(u) = 10u. Let c be y(1). Suppose -5l + 2 + 18 = -3z, -2l + 5z + 8 = 0. Suppose 2b + 4r + c = 0, 8 = -lr - 4. Solve -4 = w - b for w. -3 Let w(b) = -b*3 + 2b*2 + 7b - 7. Let f be w(3). Solve -8u = -7u - f for u. 5 Suppose 96 = 2c - 22. Solve 0 = 2x - 51 + c for x. -4 Let l(d) = -6d3 + 32d + 32. Let q be l(-1). Solve 0u = 3u - q for u. 2 Suppose 2o = -10, 3w + 3o - 15 = 6o. Let q(d) = 4d - 8. Let j be q(3). Solve jy + 0 + 16 = w for y. -4 Let r(n) = -n - 2. Let l(q) = 2q3 + 3q*2 - 2q + 7. Let v be l(-3). Let b be (v/8)/(12/48). Let j be r(b). Solve 8a = 3a + j for a. 1 Suppose -4k + 6 = 2c, 2c + c = -9. Solve 0 = kn + 4n + 28 for n. -4 Let a(w) = w + 26. Let h be a(-23). Suppose 0 = -2f + 4f - 40. Solve -hr + f = 2r for r. 4 Suppose 2k + 28 + 8 = 0. Let g be (18/(-4))/(k/24). Suppose -g = 3t - 5t. Solve tr - 1 - 11 = 0 for r. 4 Suppose 2b = -3u - 2u + 19, 5b - 1 = 3u. Suppose 0 = v + v - 4. Solve -10 - v = -uj for j. 4 Suppose 0 = n + 4, -3h = -0n + 3n - 78. Solve 15u - 9u = h for u. 5 Let p(g) = g*3 - 9g*2 - 22g + 5. Let d be p(11). Solve 0 = dy + 3y for y. 0 Suppose 28 = p - 4p + 5b, b = -p + 4. Let k be (-20)/p - (9 - 9). Let c be (k/6)/(4/6). Solve 0 = -0h - ch + 5 for h. 1 Suppose -m - 3c - 3 = 0, 2m + 16c = 14c + 6. Solve -16r - m = -14r for r. -3 Let u(o) = o*2 - 2o - 5. Let q be u(4). Let m(x) = 2x2 - x - 8. Let c be m(q). Let b = 16 + -3. Solve 5s - b = c for s. 4 Let t be 58/(-5) - 26/65. Let g = 21 + t. Suppose -4v + v + g = 0. Solve -y + 2 = -v for y. 5 Let j = 61 + -16. Let o = 47 - j. Solve -5b = -o + 22 for b. -4 Suppose 35x = 36x. Solve -3i = -xi for i. 0 Let x(l) = l*3 - 13l*2 - 3l - 6. Let a be x(13). Let w = 48 + a. Solve z = wz for z. 0 Let t = 0 - 0. Suppose -8y = -3y - 10. Suppose -4r + 3r + 24 = -4l, 2r + 2l + y = 0. Solve ro = -to + 8 for o. 2 Let q(x) be the second derivative of -x*3/6 + 19x*2/2 + 3x. Let d be q(15). Let o be -1 + (2 - d) + 7. Solve 0 = of - 7f + 6 for f. 2 Suppose -2r = -4r. Let f(c) = -c*2 - 68c + 527. Let v be f(7). Solve -i + 0 + v = r for i. 2 Suppose -5a + 53 = 3h, -h - 6a + 2a + 20 = 0. Solve hy + 4 = 52 for y. 3 Let s(o) = -o3 - 7o*2 + 15o - 25. Let v be s(-9). Solve -vf - 11 + 15 = 0 for f. 2 Let n(c) = -c2 + 15c + 15. Let p be n(12). Suppose -5i = -4z - 23 - 42, -3z = -4i + p. Solve 0 = -4l - i - 11 for l. -5 Suppose -o + 24 = 7o. Solve -1 = -4j + oj for j. 1 Let p(k) be the third derivative of -k5/60 + k4/4 - 4k3/3 + 37k*2. Let t be p(4). Solve t = 11d - 15d - 16 for d. -4 Suppose 40 = 32n - 27n. Solve -4f - n = -4 for f. -1 Suppose 0 = 2g + 5i - 48, -4i + 5i = 2g - 24. Solve 19q - 99 = -gq for q. 3 Suppose 2r + 2 = 0, 3t + 3r + 74 = -115. Let q = -61 - t. Solve -5h + 9 = -q for h. 2 Suppose 75 = 8c + 19. Solve -9k + ck + 2 = 0 for k. 1 Let l(p) = 8p + 20. Let g(a) = a. Let d(u) = -6g(u) + l(u). Let w be d(-10). Solve 0 = -wo - 5o - 15 for o. -3 Let j(s) = 11s2. Let f be j(2). Solve f = -9a + 8 for a. -4 Let p be 2/(-17) - (-22)/187. Solve p = -4k + 7k + 15 for k. -5 Let a(p) = p*3 + 13p*2 - 11p + 7. Let i be a(-14). Let h = 37 + i. Solve 4 = ht - 3t for t. -4 Suppose 77x = 72x. Solve x = -0i - 14i - 70 for i. -5 Let s = 11 - 5. Let i be s/10 - (-2)/5. Suppose 5q + 9 = 2b - 1, 10 = 3q + 2b. Solve q = -5a + 6 - i for a. 1 Suppose -3a + 38 = 4r - 8, -2r = -8. Solve -a = -0b - 2b for b. 5 Suppose 5t - 15 = -12f, -3t - 2t = f - 15. Suppose 0 = -5r + 4r + 12. Let g(l) = l*2 + 4l. Let s be g(-4). Solve tk + r = -sk for k. -4 Let r = -49 + 58. Let u(d) = -d*2 + 12d - 12. Let q be u(r). Solve 4s + q = -s for s. -3 Let n be (4/5)/((-63)/(-30) - 2). Solve -3i + n = -5i for i. -4 Let k(h) = -h3 + 5h*2 + 7h - 5. Suppose -4u + 20 = -0u. Suppose -30 = -uo - 2m, 2m = 3o - 4o + 6. Let n be k(o). Solve 0 = -w - 2 - n for w. -3 Suppose 3 + 0 = k, -2k - 8 = -2x. Let h = -177 + 173. Let f = x + h. Solve 3u - f = 4u for u. -3 Let r = -4 - -16. Let g be 104/28 - (-4)/14. Suppose gm - 2m - 10 = 0. Solve n - mn = r for n. -3 Let r be -5((-8)/10 - 0). Let b(k) = 9k*2 - r + 2k*3 - 3k3 - k - k3 + 3k3. Let z be b(-9). Solve 1 = zx - 4 for x. 1 Suppose x = -o - 3, 3x = -4o - 6 - 4. Let z be (4 - -1) + x + -1. Suppose 2t = -zc + t + 15, 2c - 30 = -4t. Solve 0 = -cm + 2m for m. 0 Let x = 343 + -338. Solve -4t = 15 + x for t. -5 Suppose 7a + 329 = 434. Solve 0 = 14g - ag - 2 for g. -2 Let u(s) = 4s + 4. Let a be u(-1). Solve w + 4w + 10 = a for w. -2 Suppose -23 = 19z - 24z + 4x, 1 = z + x. Solve 6t + 9 = -z for t. -2 Suppose 4b + 3g = 0, 4b - g = 3g + 28. Let w be 1 + (15/3 - 2). Suppose wf = 4u - 36, -3u + f - 11 + 30 = 0. Solve -u + b = x for x. -2 Let g be 53/(-1 - -4). Let q = 36 + -26. Solve -gt = -3t + q for t. -5 Let v(p) = p*3 + 11p*2 + 10p. Let b be v(-10). Let g be (-108)/(-14) + (-12)/(-42). Solve 3h - gh = b for h. 0 Suppose -a - 2a = 0. Suppose -2u + 8 = -au. Solve -n = -un for n. 0 Let u(y) = -y*2 + 3y + 21. Let h be u(-3). Solve hd - 1 - 14 = 0 for d. 5 Suppose -3f = -4f + 3. Suppose 5s + 0s + 3x - 105 = 0, s - 21 = -fx. Suppose 17n = sn. Solve -2k - 2 = -n for k. -1 Suppose 0 = 2h + 7h + 81. Let q = h + 11. Solve -s - 1 - q = 0 for s. -3 Let g(r) = -r - 2. Let q be g(-4). Suppose -19 = -5i + 4d, -qd = -3i + 7i - 10. Suppose 17 = 2t - s + 6, -t - is + 23 = 0. Solve -l = l - t for l. 4 Suppose 2h - p - 12 = 0, -6h + 3h + 12 = -3p. Solve 5r - 28 + h = 0 for r. 4 Let f be 6314/(-451)(10/14 - 1). Solve 3a - 2a = f for a. 4 Suppose -6k = -7k + 13. Solve 7 = -5t - k for t. -4 Let l = -10 + 17. Let w = 221 - 216. Suppose -5s = 4k - 8, k = 2s - k - 14. Solve sg + l + w = 0 for g. -3 Let t = -189 - -189. Solve 13n - 9n + 16 = t for n. -4 Suppose -9t + 33t = 120. Solve -16 - 9 = tx for x. -5 Suppose -12k = -9k - 21. Solve -k = -4w + 9 for w. 4 Suppose 2q + 25m - 20m = 0, -4m + 24 = 4q. Solve -qk = -47 + 7 for k. 4 Let c(b) = -44b + 3038. Let y be c(69). Let r be 16/(-6)3/(-2). Solve -y = m - r for m. 2 Suppose 2h + o = 7, -2 = 3h + 2o - 12. Suppose -6 = -7r + hr. Let t = 16 - 12. Solve ra + 0 = -t for a. -2 Let w = -246 - -246. Solve w = 7t - 0t for t. 0 Let y(x) be the first derivative of 3x2/2 - 9x + 7. Let l be y(8). Solve 6h = 3h + l for h. 5 Let o be (253/22)/((-1)/(-4)). Suppose 10q - 14 = o. Solve -6 = -ql + 3l for l. 2 Let m be ((-39)/(-2))/((186/4)/31). Solve -mi + 8i - 10 = 0 for i. -2 Let i(s) = s3 - 24s*2 + 42s + 46. Let w be i(22). Solve -wm + 4 = 2m for m. 1 Let r be (-4)/(-6)6/(-2). Let x(d) be the second derivative of d4/12 + d3/2 + 3d*2/2 - 8d. Let y be x(r). Solve -1 = o + y for o. -2 Let p(a) = -4a - 6. Let w be p(-6). Suppose x - 4 + 0 = 0. Let u be x/(-3)-3 - 1. Solve -3r = u - w for r. 5 Let o = 54 + -45. Suppose -o	{ "pile_set_name": "DM Mathematics" }
Simplify ((k*11k)*(-13/6)(k(1/23)/k)/(k(-15)k))(-1) assuming k is positive. k(298/23) Simplify (j(-9)/(jjj(-2)j))/(j8/j(-3))(jj/j*3j)/((j/(j*9j))/j)j(-2)(j/j*(-2/17))/jj assuming j is positive. j(-202/17) Simplify (p/p(-7)pp*9(pp(-5))/(((pp7/p)/p)/p))/((p1)*(-6)((pp(1/3))/p)/pp(-2/27)/p) assuming p is positive. p(452/27) Simplify ((a11)29/((aa(-9/4))/((a(-25)/a)/a)))(-27) assuming a is positive. a(-31671/4) Simplify ((((u/(u(-2/5)/u)u)(-2/9))(-31))(-2/21))(-2/53) assuming u is positive. u(4216/50085) Simplify ((l(-9)/(l/l*3))/(ll*(-3)/llll*(5/2)/l))/((lll/l8)/(l/l4l)((ll*2)/l)/ll/(ll(-8/5))) assuming l is positive. l(-71/10) Simplify (((r(rrr*(-7/9))/rr)/rr)/r24r*20r8)(-1/20) assuming r is positive. r(-14/45) Simplify j(1/4)j/(j(-7)j)j/j(2/9)jj/(jjj(1/5)jj)j/(jj7)jj4/jj/j*(-5)j(-1/6) assuming j is positive. j(1559/180) Simplify (((r/(r*(-2/11)/rr))/r)/r(-1))(-36)(rr*(-4)/r(r/r*4)/r)/((r/((r(r*(-1)r)/rr)/r)r)/r(-1/4)) assuming r is positive. r(-2323/44) Simplify ((k*(-3)k(1/5))/(k(1/4)/k)*(3/2))/((kk(1/4))(-12))(-6/5) assuming k is positive. k(-787/40) Simplify (j*(-2/9)j*8)/(jj(1/3))(3/2)j(1/3)/(jj*(-3))(j/(j/j*9))/(((j/(jj*(-5/2)))/j)/jj) assuming j is positive. j*(281/18) Simplify ((b/(bbb(-2/7)/bbb))(5/3)b*(2/37)b(-1/6))(-42) assuming b is positive. b(4615/37) Simplify (l(-6/7)/l(-1/11))14(((l(-1)/l)/l)/ll)*(-1/60)(l(-1/2))(1/26) assuming l is positive. l*(-7648/715) Simplify ((h(h/(hh/(h((h/(h/h*(3/4)hh))/h)/hh)hh))/hh)(2/49)/((hh(-5/2))/(h/((h/h(-2/15))/h)h)))(-1) assuming h is positive. h(-2377/735) Simplify (a(-14)/a(1/2))39(a*6a(-1))/(a(-1/5))28 assuming a is positive. a(-5549/10) Simplify (((k/k*2)/kkk(1/8))/(kk/k*(-3/5)k*(-2)))/((kk*1k*(3/7)k)/(k(2/7))(3/16)) assuming k is positive. k(-97/20) Simplify ((v0)(-48))(23/2)((vv(-1/3))/v)(-13/3)(v/(v1/v)v)/(v(-2/7)/v) assuming v is positive. v(298/63) Simplify (u*(-24)u*46(u(-8/5))(-6))(-31/4) assuming u is positive. u(-2449/10) Simplify (r(-31)/(r/(r/(r/(r/r21r))))r*(-19)/(rrrr22))(20/7) assuming r is positive. r*(-1900/7) Simplify ((gggg*1g)16)(-47)/(((g*(4/3)g)/g)/g(3/4))(-1/2) assuming g is positive. g*(-90233/24) Simplify ((ll(1/4))48l0l*(-1/6))/((ll*7l*(-7))/(l/((l/(lll/(ll*1/ll)))/l))(-25)) assuming l is positive. l(53/6) Simplify ((((qq/(q/(qq/(q*(-2/13)/q)q))q)(-42))45)35)(-49) assuming q is positive. q(259308000/13) Simplify (o(2/7)/oo/(o/o*(2/5)oo))(-14)((o*(3/7)o)/(oo(-3/5)/o))/(oo*7o/(oo(-3/4))o) assuming o is positive. o(691/28) Simplify (((u/u0u)(-3/8)/((uuu(-1))/u)40)(-1/29))(-1/9) assuming u is positive. u(-1/348) Simplify (((cc(-8))/c)(-26)/(c*(-25)cc41))(-24) assuming c is positive. c(-4584) Simplify (p/(ppp(-17)p)((pp*17)/p)/pp*(-8/3)p/(pp12)p)40 assuming p is positive. p(2080/3) Simplify ((oo(-5)/oo*(2/21)(oo(-2/7))48)(-1))(-3) assuming o is positive. o(617/7) Simplify (((k(k/(kkk*(-12)k))/kkk)/kk)/(kkk(-17)))/(kk*(-22)kk(-25)) assuming k is positive. k72 Simplify ((w(-1/2))16)(1/7)/((w(-1/4)/w)15(w(1/4))(-3/17)) assuming w is positive. w*(4201/238) Simplify (oo*0oo(-1)(o*0o)*(-40/7))/((ooo(-1/5)/oo(o(-2/15)/o)/o)/(o(-2/5))(5/2)) assuming o is positive. o(-113/21) Simplify (l2/(ll/l*(-8))l*(-1)/(lll/l(-2)))/((l/(llll/(ll/(l(-2/5)l))l))/(ll*(-1/5))(l*0l)(-40)) assuming l is positive. l(147/5) Simplify ((mm(-1/4))(-1/8)/(m(-1)m*(-7)))/(m/(mmm(-1/4))m/m*3(m/((mm(1/11))/m)m)/(mm/((mm2)/m))) assuming m is positive. m(3079/352) Simplify ((j(-4)/j)/j(-3/2))(2/123)/((((j5jjj)/j)/j)/j(-3))7 assuming j is positive. j(-7756/123) Simplify (((p(1/26)/pp)/p(4/7))/(p2p/p(-6)))(-1/4) assuming p is positive. p(1735/728) Simplify ((kkk(-14/3)k)/(kk/(k(-3/2)k))(k/k(3/7)k)(1/53))(-49) assuming k is positive. k*(64463/318) Simplify (((yy*(-1/20))/y)/y(y/(y*(-6)y))/yy(-1/8)y6)19 assuming y is positive. y*(7467/40) Simplify (xxx/x(7/2)x/x*6x/(xx1)x/x(1/10))/((x3)(9/8))(2/113) assuming x is positive. x(-12791/2260) Simplify ((((w/(w/w(4/7))w)/ww)/w*7)/(ww/(www1))(1/5))/(w*(-1/5)w/(w/w2))(2/9) assuming w is positive. w*(-197/35) Simplify (((ll*2)/l)/lll5)(2/75)(ll/(l(3/5)l)llll(-5))/((l/(((l0/l)/l)/l)ll)/l(2/7)) assuming l is positive. l(-3742/525) Simplify ((f(-2/7)/f)(-11/3)f/f(1/5)ff(-1/4)f)/((ff(3/7))42)13 assuming f is positive. f(-108183/140) Simplify ((dd/(d/d*9)d)*(-32)(d/(d*5/dd))(-2/91))(1/53) assuming d is positive. d(-32024/4823) Simplify (g(-6/7)gg(gg*1/g)/g(g(1/4))13)/((g1)3(g/g1)(-16)) assuming g is positive. g(39/28) Simplify (h(2/5)h/(h/h(1/3)))47/(h*1h(2/9))(-42) assuming h is positive. h(429/5) Simplify ((l16ll)*(-14)(l1)40)(7/8) assuming l is positive. l(-371/2) Simplify (vv(-6)v*(-5/4)v(1/2)/((((v(-3)vv)/v)/v)/v))/((vv/(v/(v0v)))(-33))5 assuming v is positive. v*(1313/4) Simplify (bbb(-8)bbb/(b/b*(1/3))b*(-7)b*(-2/25))/(((bb*(-12)b)/b)/b6)(-15/2) assuming b is positive. b(-20737/150) Simplify (b(3/7)/(b/b(-1)))(-44)((bb*(-2/13)b)/b*(-1/2))/((bb/b*(-1/4)b)/bbbbbb(bbb*(4/3)bb)/b) assuming b is positive. b(65417/1092) Simplify ((s1)50/(s(-3/2)/(s/(((sss(-2)s)/s)/s)s)))/((ss(-1)/s)(-17/3)/(ss/s(-3)sss(-3))) assuming s is positive. s(317/6) Simplify (k*(-3)kk/k(-8)kk9k*2)/(((kk/(k/(kkk*(-1/2))))/(kkkk/k*(-1/2)k))/(k/((k/(k(-1/4)/k))/k))(-31)) assuming k is positive. k(119/4) Simplify w2/(w/w*4w)(wwww(-3/4))/w7(w0/(w/(ww*(-2/13)wwww)))/(w(-6)/(w(2/11)/ww)) assuming w is positive. w(5307/572) Simplify x/(x/x(-1))x2((xx1)/x)/(xx*(2/3))(x/(x*(-7)/x)xxx*0x)/(x*(-6)xx/(x(-1/2)x)) assuming x is positive. x(101/6) Simplify (z(-1/13))*33z(-2/11)/(z/z(-1/21)) assuming z is positive. z(-11315/3003) Simplify (y(-7/5)/yy(yy(-9)/y)/y)48(y/y*1)/((yyy(-1)/yyy)/y)(yy(-1/8))/yy2 assuming y is positive. y(-21853/40) Simplify (((aa(5/4))/aa)/aa(-5)a*(-9/5)/(a/(aa/a*(-7)aa)))(2/33) assuming a is positive. a(89/330) Simplify ((n(-36)/nn/(n*(16/3)n))/(n(-2/25)/(n/n(-38)nn)))(2/3) assuming n is positive. n(-188/225) Simplify ((ssss(1/3)sss/s(-6))/(s(-3))35)(24/7) assuming s is positive. s*(2816/7) Simplify (((x/(x/(xx(2/13))))/(((x/x(-1))/x)/x))/(x(-1))(-13/8))/(x*(-1/4)/xxx4/x)(-35) assuming x is positive. x(9961/104) Simplify ((f/(ff/(f*(1/3)f)))*(-45)(f/(f*(1/4)f))/(f/(f/(f/(f/f*(1/5))))))/(((ff*5f)/f*3)/(f/(ff*(-1)/ff))(12/5)) assuming f is positive. f(-341/20) Simplify (((p(p/((p(-17/4)p)/p)pp)/pp)/p)/p)(-2/51)/(pp*40p(((p/(p/(p/p(-27))p))/p)/p)/p) assuming p is positive. p*(-6757/102) Simplify (((hh*(-6)hh(-5))/(h(-2/7))(7/2))16)4 assuming h is positive. h(-512) Simplify (pp*(3/4)pp(-1/5))(-2/31)(p(1/3))18(p(1/3))(2/49) assuming p is positive. p(266543/45570) Simplify ((uuu(-2/7))37)(7/10)/((u0uuu*(-2)/uu)/(u(-1))(-6/11)) assuming u is positive. u(2472/55) Simplify ((v(-2/3))*(-17/5)/(vv*(2/5)v)(-3/14))/((v(-2))(25/2))(40/7) assuming v is positive. v*(15292/105) Simplify (pp/p(1/2))(20/9)ppppp(-2/17)p*(-6/5)pp((p*(-4)/p)/((pp(-3/4))/p))(10/7) assuming p is positive. p(6941/3570) Simplify (((d(4/11)dd/(ddd*(4/9)d))(-3/11))(-3))(-1/8) assuming d is positive. d(107/968) Simplify (a*1aaa*0(a/(aa(-1/2)a))/(a/a*(2/15)a))/((a0)(-14)(aa**(-1/8))/	{ "pile_set_name": "DM Mathematics" }
+ 4x(p)? -53p*2 + 4p Let m(f) = 11f2 + 17f - 23. Let s = 5 + 1. Let o be -2 + s/(-3) + -13. Let g(c) = -4c2 - 6c + 8. Suppose -3j + 2 - 20 = 0. Give jm(d) + og(d). 2d2 + 2 Let p(k) = -k3 - k*2 + 1. Let w(u) = 25u*3 + 4u*2 + 9u - 21. Let q(s) = -4p(s) - w(s). Let i(o) = 5o*3 + 2o - 4. Give -9i(b) - 2q(b). -3b3 + 2 Let k(x) = -3x - 2. Let c(n) be the first derivative of -17 + 9/2n2 + 6n. Calculate -6c(h) - 17k(h). -3h - 2 Suppose 4d - 5 + 45 = 4b, -32 = -3b + 5d. Let y(p) = 4p + 1. Let s(n) = 8n + 2. Calculate by(m) - 4s(m). 4m + 1 Let v(b) = 4 + 50b2 - 51b*2 - 31b + 31b. Let x(k) be the third derivative of -k5/60 + 5k*3/6 + 6k*2. Give -5v(s) + 4x(s). s2 Let z(v) = 3v*2 + 4v - 11. Let x(r) = 4r2 + 6r - 16. Let d(f) = 5x(f) - 7z(f). Let u(i) = 2i2 - 3i + 3. Determine 4d(g) + 3u(g). 2g2 - g - 3 Let b(j) be the third derivative of 13j*5/60 + 7j*4/24 + 7j*2. Let i(n) = -9n*2 - 5n. Suppose 3k - 4k + 5 = v, -3v + 25 = 5k. Give kb(o) + 7i(o). 2o2 Let b(s) = 32s - 86. Let a(w) = 11w - 27. Calculate 11a(k) - 4b(k). -7k + 47 Let i(d) = 6d - 7. Let m(g) = -3g + 4. Let v(o) = -4i(o) - 7m(o). Let j(b) = -6b. Give -2j(f) + 5v(f). -3f Let d(y) = y*2 + 11. Let z(b) = -23. Let u(f) = -19. Let o(s) = 6u(s) - 5z(s). Suppose 5r + 30 = -60. Give ro(q) + 2d(q). 2q2 + 4 Let z(o) = -o3 + 3o*2 + o + 2. Suppose -5c + 2 + 8 = 0. Let w(u) = -u3 + u2 + u + 1. Determine cz(l) - 4w(l). 2l3 + 2l*2 - 2l Let r(j) = j*2 + 1. Let i(u) be the first derivative of 0u*2 + 4u + 1/3u3 - 1. Give i(c) - 4r(c). -3c2 Let k = -1 + 3. Let c(x) = -1. Let l(j) be the third derivative of j4/12 + j3/3 + j2 + 3j. What is kc(z) + l(z)? 2z Let w = -68 + 73. Suppose g = 3, -3i - 4g = -2g - 21. Suppose -it - w = 30. Let a(c) = -3c2 - 7. Let f(m) = -4m*2 - 10. Calculate ta(l) + 5f(l). l2 - 1 Let h(o) = -305856o*2 + 649o + 1947. Let m(b) = 944b2 - 2b - 6. Give -4h(y) - 1298m(y). -1888y2 Let r(w) = w3 - w2 - w + 1. Let d(x) = 5x*2 - 5 + 2 + 30x*3 - 35x3 + x - x2. Determine -d(z) - 3r(z). 2z3 - z2 + 2z Let p(y) = 69y + 8. Let l(f) = 23f + 3. Calculate 17l(c) - 6p(c). -23c + 3 Let o(n) = 13n - 3. Let z(m) = -1 - 4 + 3 + 8m - 6 + 31m. What is -8o(j) + 3z(j)? 13j Let x(m) = -11m + 3. Let a(d) = 5d - 1. Let n(c) = -c*2 - 54c + 116. Let g be n(-56). Give gx(t) + 9a(t). t + 3 Let l(r) = -142r3 + 7r*2 - 7r - 26. Let a(b) = -95b3 + 5b*2 - 5b - 18. Give -7a(y) + 5l(y). -45y3 - 4 Let z(w) = 13w*3 + 4w*2 + 8w + 2. Let q(h) = -h*2 - 2h - 1. What is -4q(o) - z(o)? -13o*3 + 2 Let k(b) = -5b*2 + 3b - 2 - 3b + 2b. Let m be (5 - 2)8/12. Let g(l) = 33l*2 + m - 34l*2 + l - 3. Give -2g(p) + k(p). -3p2 Let t(j) = 15j*2 - j - 220. Let z(m) = 41m*2 - 3m - 661. What is -11t(r) + 4z(r)? -r*2 - r - 224 Let v(u) = -7u*2 + 7u - 11. Let j(k) = -3k2 + 4k - 6. Give 11j(m) - 6v(m). 9m2 + 2m Let t(r) be the third derivative of 1/60r5 + 0 + 0r + 1/6r3 + 0r*4 + 13r*2. Let y(p) = -5p*2 - p - 4. Let a be 9/(-7) + 4/14. Give ay(i) - 4t(i). i2 + i Let w(l) = 2l*2 - l. Let a(j) = 7j*2 - 4j + 2. Give a(u) - 2w(u). 3u*2 - 2u + 2 Let a(s) = 7s + 22. Let l(m) = -3m - 12. Determine 2a(w) + 5l(w). -w - 16 Let p(w) = -2w2 + 3 + 3w - w + 6w2. Let d(o) = -o2 + o - 1. Let h be d(2). Let c = -234 + 232. Let k(z) = -3z*2 - z - 2. Calculate cp(f) + hk(f). f2 - f Let s = 61 + -57. Let k(t) = 4t - 3t2 - 6t - st + 0t2. Let u(j) = -j2 - j. What is -k(b) + 6u(b)? -3b*2 Let m(p) = -2p*2 - 47p - 17. Let x be m(-23). Let j(b) = 2b. Let i(g) = g. Determine xi(o) - 7j(o). -8o Let t(o) = -5 + 3 + 15o - 3 + 1. Let l(x) = 10x - 3. Give 7l(y) - 5t(y). -5y - 1 Let q(g) = g2 + 3. Let s(u) = 6u*2 - 2u*2 + 1 - 3u*2 + 4. Determine -10q(t) + 6s(t). -4t*2 Let t be (24/20)/((-2)/5). Let o(i) = -27i - 7. Let c(v) = 9v + 2. Let k(f) = to(f) - 8c(f). Let y(z) = 5z + 3. Calculate -6k(m) + 10y(m). -4m Let h(v) = 6v*2 + 5v - 5. Let o = -7 + 8. Let s be -14 + 20 + -1o. Let c(l) = 9l*2 + 7l - 7. Calculate sc(b) - 7h(b). 3b2 Let v(h) = h + 2. Let c(x) be the second derivative of -2x*3/3 - 3x*2 - 18x. Suppose 2l - 4 = j, 4j - l = -7 - 2. Calculate jc(o) - 7v(o). o - 2 Let m(r) be the first derivative of -r*4 - 3r*2/2 + 2. Let f(u) = u. Let n = 53 - 56. Suppose -15k + 4 = -19k. Give km(c) + nf(c). 4c*3 Suppose 2f - 25 = -5w - 3f, w - 4 = -2f. Let o(c) = -61c - 1 + 54c - 2 + 0. Let z(r) = -8r - 4. Give wo(m) - 5z(m). -2m + 2 Let o(a) be the second derivative of -5a*3/6 + 4a*2 + 26a. Let n(w) = w - 2. Let j = -1 + -1. Calculate jo(t) - 9n(t). t + 2 Let m(k) = -4k2 + 10k - 11. Let a(h) = 4h2 - 11h + 13. Let n(i) = 7a(i) + 8m(i). Let d(o) = -4o2 + 2o + 2. Calculate 3d(r) - 2n(r). -4r2 Let s(r) = 6r*3 + 5r*2 + 109r. Let l(z) = -3z3 - 3z*2 - 55z. What is -5l(d) - 3s(d)? -3d3 - 52d Let s(i) = i*2. Let o(u) = -6u*2 - u + 9. What is o(d) + 5s(d)? -d2 - d + 9 Let j(a) = a2 - a + 1. Let b(k) = 7k2 - 5k + 8. Suppose -4q - 5 = 10d - 5d, -1 = d + 2q. Calculate db(w) + 6j(w). -w*2 - w - 2 Let s(v) = 24v + 5. Let d(t) = 9t. Let y(c) = 4d(c) - s(c). Let q(x) = 60x - 24. What is 5q(n) - 24y(n)? 12n Let i(w) = -2w2 + 2w + 2. Let x(n) = -4n2 + 2n + 4. Calculate 5i(m) - 2x(m). -2m2 + 6m + 2 Let m(c) = -c*2 + 29c + 10. Let z(j) = -j*2 + 29j + 7. Give 2m(s) - 3z(s). s*2 - 29s - 1 Let a(v) = -59v3 + 9v*2 + 2v + 3. Let f(z) = 56z3 - 8z*2 - 2z - 3. Calculate 6a(l) + 7f(l). 38l3 - 2l*2 - 2l - 3 Let t(p) = -3p2 + 9p - 3. Let l be 16/4 + 0/(-5). Let d be (-6)/l64/24. Let v = d - -9. Let g(y) = 5y*2 - 14y + 5. Calculate vg(f) + 8t(f). f*2 + 2f + 1 Let g(s) = 5s + 2. Let u(f) = 4f + 2. Suppose -9x - 29x + 152 = 0. What is xg(a) - 6u(a)? -4a - 4 Suppose 14d - 10 = 4d. Let s(m) = -m2. Let z(j) = -19j - 18j + 38j - 5j2 + 1. What is dz(t) - 6s(t)? t2 + t + 1 Let o(h) = 3h*2 - 6h - 10. Let d(p) = 5p2 - 12p - 18. Calculate 6d(t) - 11o(t). -3t2 - 6t + 2 Let t(j) = -11j2 + 6j + 11. Let h(v) = 4v2 - 2v - 4. Suppose -4x - 179 - 9 = 0. Let q = -50 - x. Give qt(k) - 8h(k). k2 - 2k - 1 Let f(h) = -6h2 + 5h. Let z(v) be the third derivative of -v5/12 + v4/6 - v*2 + 63v. Determine 4f(t) - 5z(t). t*2 Let k(o) = -15o + 15. Suppose -7 = -32q - 7. Let n(x) be the second derivative of 4x*2 - 4/3x*3 + q - x. Determine 6k(c) - 11n(c). -2c + 2 Let s(n) = -5n + 1. Let c be -204(-2)/(-32). Let u(b) = -9b + 2. Give cs(w) + 3u(w). -2w + 1 Let q(j) = -j + 1. Let i(y) = -9y + 6. Let v be ((-3)/(-12))/((-1)/12). Let s be (-7)/(56/(-24))(-1)/v. Calculate si(k) - 6q(k). -3k Let q(p) = -3954p3 + 66p*2 - 99p - 81. Let x(f) = -247f3 + 4f*2 - 6f - 5. Calculate -2q(l) + 33x(l). -243l3 - 3 Let w(a) = a - 1. Let j(c) = 4c - 8. Give 2j(d) - 9w(d). -d - 7 Let o(y) = 3y2 - 4y + 9. Let l(m) = -2m2 + 6m - 10. What is 3l(x) + 4o(x)? 6x2 + 2x + 6 Let y(f) = -19f3 + 13f*2 + 19f + 4. Let q(c) be the first derivative of 9c4/4 - 2c*3 - 9c*2/2 - 2c - 532. Calculate 13q(l) + 6y(l). 3l3 - 3l - 2 Let o(a) = -10a - 16. Let t(z) = -2z - 3. Let d be 0 + (1 - -221/(-6)). Let y be -3 + -2 + 2/(-4)d. What is yo(h) + 11t(h)? -2h - 1 Let s(r) = -r + 8. Let o(i) = -2i + 2. Let y be o(5). Let q(a) = 26. Let w(t) = 15. Let j(l) = -3q(l) + 5w(l). What is yj(b) - 3s(b)? 3b Let n(x) = -x2 - x - 8. Suppose -117 = -w - 114. Let f(o) = 2o*2 + o + 9. Give wf(a) + 4n(a). 2a2 - a - 5 Let s(y) be the third derivative of y5/15 + 2y4/3 + 38y2. Let t(b) = -b2 - 3b. What is -3s(a) - 16t(a)? 4a*2 Let j(w) = 2w*2 + 2w + 2. Let a(k) = -k*2 - 3k - 3. Let d(y) = -3y - 17. Let z be d(-5). Give za(i) - 3j(i). -4i*2 Let j(g) be the second derivative of 4g*5/5 - 5g*3 - 11g*2/2 + 1006g. Let v(p) = 3p3 - 6p - 2. Determine -2j(t) + 11v(t). t*3 - 6t Suppose -4b - 5q + 10 = -9*	{ "pile_set_name": "DM Mathematics" }
j be o(13). Suppose -2x = -4n + 524, 2n + 4x - jx - 262 = 0. Is n a multiple of 5? False Let h(m) = -m3 + 15m*2 + 43m. Suppose -17q + 260 - 5 = 0. Does 15 divide h(q)? True Let u be (-14)/91 + (-770)/65. Does 12 divide 1346((-30)/u - 2)? False Let v = 2094 - 3056. Let w = v + 2343. Is w a multiple of 12? False Suppose -i - 2i - 3s = -4881, -3i + s + 4885 = 0. Suppose 3c - 8161 = -5d, -d + 5c = 7c - i. Does 38 divide d? True Let f = 2816 + -1781. Suppose -2j + 646 = 2d + 214, -f = -5d + 4j. Is d a multiple of 37? False Suppose 8 = -2s + 14. Let b(m) = 269m + 7. Let v be b(s). Suppose 13r - 8r + 2o - 1305 = 0, 3r - 5o = v. Is r a multiple of 51? False Let b(m) = 2m3 - m2 - 5m + 3. Let t be b(2). Suppose -td - 2g = 3g - 18925, 4d - g - 15140 = 0. Is (-26)/156 + (d/6)/5 a multiple of 6? True Suppose -121o + 116466 + 315504 = 0. Is 10 a factor of o? True Suppose 136 - 886 = 10r. Is 10/r - 392/(-15) a multiple of 7? False Suppose 8d + 2c = 6d + 10580, -4c - 21152 = -4d. Is d a multiple of 43? True Let v = 10525 - 5119. Does 17 divide v? True Let z(p) = 79p*2 + 233p - 1334. Does 98 divide z(6)? False Let h(c) be the first derivative of -c*2/2 + 8c - 7. Let g be h(5). Suppose -gt = 218 - 578. Is t a multiple of 30? True Does 6 divide (26/364)/((-2)/(-140680)) + 2/(-7)? False Let d(v) = 8v*2 - 117v + 479. Does 35 divide d(34)? False Let x = -252 + -68. Does 20 divide (-1)/((72/x)/9)? True Let f(z) = -30 - 274z2 - 6z + 275z2 - 4z. Is 9 a factor of f(13)? True Is 15 a factor of (16 + 5)(-4)/(-12) + 10432? False Let s be 4/30 - (-36198)/(-135). Let z = 150 + s. Let o = -50 - z. Is 17 a factor of o? True Let b = -329 - -332. Suppose -4y = -3v + 950 + 588, -by = v - 504. Is v a multiple of 51? True Suppose p = v + 7492, 5p + 120v = 122v + 37457. Is p a multiple of 11? True Suppose -2s = 23 + 9. Let y be (s/(-10))/(40/100). Suppose -2 + 86 = ym. Is 5 a factor of m? False Let n(w) = -w3 - 7w*2 - 9w - 3. Suppose 5p + 11 = -24. Let z be n(p). Suppose 3h + z = 5h. Is 4 a factor of h? False Let y(k) be the second derivative of k5/20 + k4 - 2k*3/3 - 11k*2/2 + 28k. Is y(-10) a multiple of 25? False Let n be -2 + (4 + -3 - -1) + 15. Let b = n + -11. Suppose -5w + 0f = bf - 86, -20 = -5f. Is 14 a factor of w? True Suppose 0c - 8c = -0c. Suppose -26t + 11061 + 2979 = c. Does 13 divide t? False Is 19 a factor of 76/(-6)72/3216596/(-54)? True Suppose 4t - 34 = 3f + 10, 0 = -5f - 20. Suppose -4z = -16, -2x = -0z + 3z - t. Let s(d) = 24d*2 + d - 2. Is 23 a factor of s(x)? True Let r(a) = -118a - 180. Let j be r(-25). Suppose 5o = -2f + 4414, -3o = 5f - j + 114. Is 63 a factor of o? True Let l be (-32)/112 - (4/(-14) + 0). Suppose 3y = f - 347, l = 2f - 0 - 4. Let i = y + 205. Is i a multiple of 18? True Let o(a) = a*3 + 7a*2 + 3a + 21. Let g be o(-7). Suppose g = 2i + 5y - 186 - 99, -2i = -2y - 292. Does 26 divide i? False Let k(h) = -257h + 4142. Is k(-119) a multiple of 15? True Let r(q) = 116q + 12. Suppose 0 = -4y - 20, 5j = -y - 7 + 17. Is r(j) a multiple of 8? True Is ((-15)/(-10))/(1/2295)156/78 a multiple of 153? True Suppose 22n = 27n + 2q - 6713, 2 = -2q. Is 2 a factor of n? False Is (-10200712)/(-213) - (4 - (-48)/(-9)) a multiple of 12? True Let r(p) = 2p*3 + 62p*2 - 19p - 143. Does 2 divide r(-31)? True Let o(d) = d*3 + 19d*2 - 75d - 46. Let p be o(-22). Let z = -6 + 8. Suppose 5k - 425 = 5n - n, -p = -2k - zn. Does 27 divide k? True Let x be (1 - 2)/(-2 - -1). Let j(p) = 0p2 + p + 3p2 - p2 + 2 - 3. Does 2 divide j(x)? True Suppose 2t = 8, -2n - t = t. Is (3 - 2)(-8)/n18 a multiple of 28? False Suppose -5j + 2m = -j - 20478, 3m - 10227 = -2j. Is j a multiple of 59? False Suppose 2x - r - 2198 = 0, x = 3r + 454 + 655. Suppose x - 15173 = -9p. Does 92 divide p? True Suppose -4k - 5z = -38144 - 30229, -3k + 51303 = -4z. Is 139 a factor of k? True Suppose -16z + 15z = -4. Suppose -3d - 1223 = -zt, 1531 = 6t - t - 3d. Is 14 a factor of t? True Let d = -356 + -151. Let a be (-2)/(-8) + (-6358)/(-8). Let f = d + a. Does 48 divide f? True Let k be (-196)/6372/(-8). Suppose 2259 = 3i + o, -2i - o + k = 4o. Is i a multiple of 64? False Let v(a) = a2 + 38a + 215. Let z be v(-34). Suppose 0 = -zp + 99p - 33000. Is p a multiple of 50? True Suppose 27 = -5w + 5o + 17, 3w + 5o - 10 = 0. Suppose w = -2a - 5q + 292, -40q + 45q = 2a - 272. Does 10 divide a? False Let i(b) = b2 - 1. Let c be i(-2). Let q be c/1 + 48/24. Suppose 0 = -qj, -3j - 468 = -3t + t. Does 33 divide t? False Let x(d) = d*2 + 40d - 439. Is 8 a factor of x(26)? False Let c = -521 + 519. Does 16 divide (3324/42)/(c/(-7))? False Suppose 0 = 20w - 76w + 4704. Does 3 divide w? True Let v be (2/(18/57))/(2/6). Let g(m) = -8 + v - 4 + 2m + 16. Is 11 a factor of g(5)? True Suppose -148920 = -4p - 56p. Is 34 a factor of p? True Let w(k) = 1579k*2 - 72k + 54. Is 195 a factor of w(-6)? True Suppose -11 + 1 = -5g. Suppose -3v = v - 12, -4v = gh - 84. Is h-41/(-8) a multiple of 4? False Let q(g) = 19g - 40g - 85 + 15g. Does 7 divide q(-31)? False Let p(b) = 3b*2 - 71b - 2312. Does 26 divide p(-28)? True Does 48 divide (-15)/40-4597388/33? False Suppose 3u + 61 = 70. Suppose uw - 3i + 83 = -2i, -5w + 2i - 139 = 0. Let r(v) = -v*3 - 27v*2 - 2v - 19. Does 18 divide r(w)? False Let a = 60 - 61. Let r be ((-56)/35)/a(-2 + -3). Does 10 divide -831(4/(-18))/(r/(-12))? False Suppose -97090 = -4z - 6p, -p + 72821 = -52z + 55z. Does 80 divide z? False Suppose 4r + 4 - 12 = 0. Let w(v) = 8 - 11v - 8v2 + 2v*2 + 5v*r. Is w(-11) even? True Suppose 0l = l - 4x + 93, -2l - 159 = x. Let a = -6834 - -3612. Does 20 divide a/l - (-6)/27? True Suppose -20u + 38306 = 8906. Is 21 a factor of u? True Let p(x) = -6x*3 - 5x*2 - 7x - 10. Let b(o) be the first derivative of -o*3/3 + 11o*2/2 - 3o + 10. Let m be b(11). Is p(m) a multiple of 8? True Let o be (-3)/(-18) + (1358/(-12))/1. Let p = o + 195. Suppose -p = -2t + 5f, -2f - 21 = -t + 19. Is t a multiple of 6? True Let j(c) = -3c + 24. Let q be j(4). Suppose x = -5m + 28, -9x + 10x + q = 3m. Does 2 divide m? False Suppose -o - 81 - 42 = 0. Let h = o + 156. Is h a multiple of 11? True Suppose 0 = 19u - 15u + 20. Let d(h) = -3h + h + 46 - 19 + 3h. Is d(u) a multiple of 22? True Let j = -90 - -94. Let f be 2/j + -2 + (-996)/(-8). Suppose fq = 124q - 23. Does 12 divide q? False Let n(k) = k + 21. Let t be n(28). Let x = 566 + t. Is x a multiple of 64? False Suppose -2h + 95 = 5u, -13 = h + 4u - 53. Let s be (-8)/h-5(-7 - 2). Let l(a) = a2 + 3a + 7. Does 9 divide l(s)? False Let v be ((-12)/(-20))/(5/25). Suppose 7o = vo + 8. Suppose 0 = -b + 2q - q + 52, -3b + oq + 152 = 0. Does 16 divide b? True Let g(h) = 3h3 - h2 - 2h - 5. Let o be g(2). Suppose 0 = ou - 3382 - 5880. Is 46 a factor of u? False Does 115 divide ((-222)/(-48) - 5 - 368043/(-8))1? False Suppose 2t - 6k = -2k + 848, 5k + 1267 = 3t. Suppose -5y + 984 = -9y. Let g = t + y. Is g a multiple of 20? False Suppose -69v - 31v - 70872 + 672872 = 0. Does 172 divide v? True Let r(v) be the first derivative of -v*3/3 + 7v*2/2 + 18v - 28. Suppose 3k - k - 16 = 0. Is 10 a factor of r(k)? True Let v(k) = 2k*2 - 7k*2 - 7k + 11k + 4k*2 + 19. Let h be v(6). Suppose h - 3 = -4a, -4a = -3l + 16. Does 2 divide l? True Let f = 758 + -762. Does 14 divide (8398/(-51))/(f/6)? False Suppose -2i = -3i + 4. Suppose -r + 573 = -h + 590, -3h = 4r - 16. Suppose il + hl - 2688 = 0. Is l a multiple of 12? True Suppose 2 + 4 = -5v + 2z, -4z + 12 = -2v. Let u be v/((-6 - -5)1). Suppose 2j - 3o - 161 = u, -3j = -5o - 366 + 122. Does 8 divide j? False Is 46(-25 + (-4706)/(-26)) a multiple of 13? True Suppose -2b = 3a - 25963 + 974, -2a - 24974 = -2b. Does 17 divide b? False Suppose 14n + 12n = -12428. Let l = -337 - n. Does 2 divide l? False Let c(n) = n*2 - 14n + 108. Let u be c(0). Is 56 a factor of u/6((-603)/6)/(-3)? False Let o be (4 + -1)/(12/8). Let s be 72 - (o/8)/((-3)/12). Suppose -sv + 80 = -68*v. Is v a multiple	{ "pile_set_name": "DM Mathematics" }
value in -0.4, -3298, -1/4, 0.4, -2/3? -1/4 What is the fourth biggest value in -0.5, 1, -15/1886, -4? -4 What is the fourth smallest value in 1, -17.71, -0.2, 6? 6 Which is the third biggest value? (a) -0.06 (b) 86 (c) 0.93 a What is the second biggest value in 2/17, 1/9, -5, -1/9, 56563? 2/17 What is the biggest value in -10954/5, -5, -0.5? -0.5 What is the second smallest value in 0.5, -0.4, 1/5, 8812? 1/5 What is the fourth biggest value in 2/23, -135, -4, 6/11, 0.5? -4 Which is the biggest value? (a) 4 (b) 6 (c) -3 (d) 1/58 (e) 0.17 (f) 1/5 b What is the biggest value in 0.462, -42, 0.2, -2/21, 4, 5? 5 Which is the third smallest value? (a) 2 (b) -1 (c) -21/2770 (d) 4 (e) -2 (f) 1 c What is the fifth biggest value in -2/7, -3, -2/233, -0.457, -2? -3 What is the third smallest value in 795, -1, -40/9? 795 Which is the fifth biggest value? (a) 4 (b) 10 (c) 0 (d) -4/5 (e) -332 e Which is the third biggest value? (a) -1 (b) 0.1 (c) 1/2 (d) -2/7 (e) 5/2 (f) -0.335 b Which is the third biggest value? (a) 2/11 (b) 15.6 (c) 0.2 a What is the second biggest value in 2.8, -870, -4? -4 Which is the sixth biggest value? (a) 4 (b) 3/2 (c) -2 (d) -1.1 (e) -3 (f) -149 f Which is the fourth smallest value? (a) 3 (b) 11 (c) -0.061 (d) -2/3 b What is the fourth smallest value in 1, 3/4, -3/2, 3/41, 0.9? 0.9 What is the fifth smallest value in 0.03, 5, -1.8, 2/7, 4? 5 What is the smallest value in 2/9, 3, 6, -46? -46 Which is the second smallest value? (a) 0.1 (b) 0.4 (c) -0.28 (d) -1.4 c What is the biggest value in -0.1173, 0.2, -1, 1/4, -13? 1/4 Which is the third biggest value? (a) -2 (b) -5 (c) -4 (d) -166 (e) -1 (f) 4/3 a Which is the third smallest value? (a) 3/2 (b) 18 (c) -1 (d) 3766 b What is the second smallest value in -3/2, -0.2, 153.2, -1? -1 Which is the third biggest value? (a) 504 (b) -5/4 (c) 0.3 (d) 4 (e) -5 c What is the smallest value in -0.4, -1065.1, -3, 0.4? -1065.1 What is the fifth biggest value in -0.4, 5, -1.79, -3, -0.15, -7? -3 Which is the biggest value? (a) -2/21 (b) -3 (c) -9/8 (d) 0.63 d Which is the second smallest value? (a) 4/7 (b) 1/6 (c) 4 (d) 0.4 (e) 144 d Which is the third biggest value? (a) -1.3 (b) -87 (c) -0.0172 b Which is the second biggest value? (a) 377/2 (b) -1.3 (c) 0.2 c What is the second smallest value in 159/5, 0, -2/3? 0 What is the second biggest value in 0.14, -12, -1/23, 1, 0.1, 2/3? 2/3 Which is the fifth smallest value? (a) 2/57 (b) -0.08 (c) -3 (d) -1 (e) -6 a What is the smallest value in -0.4, -9, 1.469, 1? -9 Which is the second smallest value? (a) -1 (b) -0.0063 (c) -53 (d) -2/5 (e) -0.2 (f) -8 f What is the biggest value in 523, 1, -6.8? 523 Which is the fourth biggest value? (a) 1/3 (b) -0.1877 (c) -1/13 (d) 3 (e) -3/5 b Which is the second smallest value? (a) 267/2 (b) -4 (c) 7 c Which is the biggest value? (a) 0.21 (b) 0.4 (c) 13 (d) -0.3 (e) 7/6 (f) 0.5 c Which is the fourth smallest value? (a) -2 (b) -4 (c) 5/6 (d) 4 (e) -0.056 (f) -6/11 e Which is the smallest value? (a) 7/39 (b) 3.3 (c) -3 (d) -11 d Which is the second biggest value? (a) -8 (b) 2 (c) -62 a Which is the third smallest value? (a) 3 (b) 21/5 (c) -13 b Which is the third biggest value? (a) -0.3 (b) -5 (c) -0.5 (d) -3/4 (e) 5573 (f) -0.2 a Which is the third smallest value? (a) -3 (b) 2 (c) 3002/89 c What is the fourth biggest value in -6, -4, 1, -1, -47/2? -6 Which is the third biggest value? (a) -3.4 (b) -1 (c) 6 (d) 1 b Which is the fifth smallest value? (a) 21 (b) 3 (c) 48 (d) 4 (e) 2 c Which is the fourth biggest value? (a) -0.2 (b) -0.4 (c) 141 (d) 1/8 (e) -29 b What is the smallest value in 11, 5, -134.6? -134.6 Which is the third biggest value? (a) -1 (b) -1.8 (c) -2/69 b Which is the third biggest value? (a) -93 (b) 0.3 (c) -2 (d) 5 (e) 0.1 e What is the second smallest value in 0.3, -0.4, -1.5, -2346, -0.3? -1.5 Which is the fifth smallest value? (a) 0.5 (b) 0.16 (c) 64 (d) 1/4 (e) 2/11 c What is the fourth smallest value in -1/6, -2/3, -3, 12/95? 12/95 Which is the third smallest value? (a) 1/2 (b) 6/443 (c) 361 (d) -0.3 a Which is the third biggest value? (a) 2/17 (b) 1/7 (c) -0.1 (d) 9 (e) -1/3 (f) -26 a What is the biggest value in 1, -0.4, -19.2, 1/45, -1? 1 Which is the third smallest value? (a) -1904 (b) 6.3 (c) -5 b Which is the third smallest value? (a) -24 (b) 0.1 (c) -2 (d) 2 (e) -2/7 (f) -12/7 f Which is the second smallest value? (a) -4 (b) 5/3 (c) 18806 (d) -3 (e) 5 d Which is the fourth biggest value? (a) 0.015 (b) -0.5 (c) 105/19 (d) -7 d Which is the biggest value? (a) 4 (b) -68 (c) -1284/11 a Which is the smallest value? (a) -14 (b) -3/2 (c) 16 (d) -1 (e) -2 a Which is the biggest value? (a) -1/5 (b) 407 (c) 4/7 (d) 0.025 b Which is the fourth smallest value? (a) 0.6 (b) 5 (c) 0.5 (d) 2/141 (e) 108 (f) -3/5 a What is the smallest value in 0.7, -0.7, 0.02, -0.4? -0.7 Which is the fourth biggest value? (a) -17.6 (b) 2/3 (c) 3 (d) 14 a Which is the biggest value? (a) -0.5564 (b) 2/9 (c) 2 (d) 0.5 c Which is the third smallest value? (a) -1 (b) 108322 (c) 4 b Which is the fourth biggest value? (a) 2/7 (b) -0.1 (c) 0 (d) -2/25 (e) 0.4 (f) 38 c What is the fifth smallest value in 1, -4054, -5, 4/5, -0.01, -0.1? 4/5 What is the fourth biggest value in -188, -4, -2, 0.3, 58? -4 Which is the fourth smallest value? (a) -7 (b) 0 (c) 5 (d) 0.29 c Which is the fifth biggest value? (a) -0.2 (b) 4 (c) -1568 (d) 3 (e) 0.4 c What is the second smallest value in -8, -0.05, 20.9, -4/3? -4/3 What is the second smallest value in -3, 840, 4, 33, -1? -1 What is the fifth smallest value in 7, 2, 0, -1648, 5? 7 What is the fourth biggest value in 1/3, -5, -1, -161, -7, 2? -5 Which is the fourth smallest value? (a) 1/23 (b) 13 (c) -127 (d) -4 b What is the second smallest value in 18, 1/3, -10.8? 1/3 What is the second biggest value in 4, -536/5, -0.2, 0, 6/7? 6/7 What is the second smallest value in 2/17, -38, -3, 0.16, -3/4? -3 Which is the fourth smallest value? (a) 1/6 (b) 2/3 (c) -4 (d) -182 (e) 5 b Which is the second smallest value? (a) -1 (b) 1.2312 (c) 2/13 (d) -3 a Which is the third biggest value? (a) -1/7 (b) -0.4 (c) -87533 c Which is the fourth smallest value? (a) 2/5 (b) -5 (c) -2 (d) -210 (e) 2/13 e What is the second biggest value in -784/85, 1/8, 0.5? 1/8 What is the second biggest value in -1/4, 84, -143/4, 0.6? 0.6 What is the second biggest value in 0.1, -69, 3/4, 0, 864/11? 3/4 What is the smallest value in 0, 4, -0.4, -43, 25? -43 Which is the fourth smallest value? (a) -3 (b) -0.7 (c) -1 (d) 4.8 (e) -0.2 e Which is the smallest value? (a) -1 (b) -30 (c) -9/10 (d) -1/4 b Which is the third smallest value? (a) -0.09 (b) -36.2 (c) -1/5 (d) 3.7 a Which is the fifth smallest value? (a) 183/4 (b) 3 (c) 2/7 (d) 11 (e) -1/5 a What is the second smallest value in -633, -0.4, -4, -5, 2/7, -3? -5 What is the second biggest value in 53, 15, 0.8? 15 Which is the second biggest value? (a) -0.235 (b) 0 (c) 1/4 b What is the third biggest value in 5, -23, -2/9, -4, -10/3? -10/3 What is the second smallest value in 2, 4, -0.72, 2/15, 1/3? 2/15 Which is the second smallest value? (a) 2/25 (b) 5/2 (c) -1 (d) 5 (e) 12 (f) 2 a Which is the second smallest value? (a) -0.22 (b) 5 (c) 24 (d) -4 (e) -1 e Which is the second smallest value? (a) 0.052 (b) -5 (c) -0.08 (d) -3 (e) 1 d What is the second biggest value in -23/2, 4/7, 0.0147, -4? 0.0147 Which is the fifth biggest value? (a) 91/2 (b) 1/3 (c) 1/2 (d) -2/25 (e) -0.07 d Which is the smallest value? (a) -6.9 (b) 2 (c) 2/111 a Which is the third smallest value? (a) -2/29 (b) 5/4 (c) 52 c Which is the fourth biggest value? (a) 328/9 (b) -0.86 (c) -0.1 (d) 4 b Which is the third biggest value? (a) 33 (b) 151 (c) -0.1 c Which is the biggest value? (a) -0.12 (b) -4/3 (c) -3/5 (d) -2 (e) 11 e What is the sixth biggest value in -2/17, -1, -3.4, -2, 2, -1/25? -3.4 What is the fourth biggest value in 7.2, -0.2, 2.1, -2/5? -2/5 Which is the second smallest value? (a) 1/26	{ "pile_set_name": "DM Mathematics" }
t r = 28 + -58. Let p be r/(-9) + 2/3. Suppose -20 = 4u, pg = 3u - u + 26. Is g a multiple of 3? False Let l = -13 + 8. Let y(s) = -6s + 3. Let c(r) = -r. Let a(p) = lc(p) + y(p). Does 8 divide a(-8)? False Let l(q) be the first derivative of q6/360 - q5/15 - 3q*4/8 - 2q3/3 - 1. Let w(k) be the third derivative of l(k). Is 11 a factor of w(10)? True Let n = 1 + 1. Let r = 5 + n. Let w(a) = -a2 + 9a - 1. Is w(r) a multiple of 8? False Let j be 7 + 0 - (-1 - -1). Let f(u) = -u3 + 9u*2 - 4u. Does 35 divide f(j)? True Suppose 50 + 4 = 2v - 4z, -5v + 103 = -2z. Let r = 45 - v. Does 13 divide r? True Let d = -4 + 6. Let g = 1 + d. Suppose -10 = gc - 82. Is c a multiple of 12? True Let r be 6/(-9) + 17/3. Does 13 divide 396/10 - 3/r? True Let i = 115 - 75. Is 10 a factor of i? True Suppose -7 + 1 = 3r. Let n = r + 4. Suppose -ng = 5m - 5, 4g + 0m - 2m - 22 = 0. Is g a multiple of 2? False Suppose 11w + 55 = -0w. Let l(b) = b3 - 4b + 1 + 3b2 + 2b + 2b2. Is l(w) a multiple of 8? False Suppose -2f - f = -6. Let x be ((-1)/(-2))/(1/f). Suppose -29 - x = -w. Is w a multiple of 12? False Let b = -7 - -7. Suppose b = d + 3d. Suppose -2g + 5a + 29 + 22 = d, -5a = g + 12. Does 13 divide g? True Let c be (4 + -8 - -3)-57. Suppose -3m - 4s + 29 - 7 = 0, -3s - c = -3m. Is m a multiple of 3? False Suppose 4g + 8 = -12, -168 = -3d - 3g. Let n = d + -33. Is n a multiple of 15? False Suppose -2g - 3r + 3 = -0, 1 = g + 2r. Is 3 a factor of (-2 - -3)g3? True Is (-1)/3 - (-55)/3 a multiple of 8? False Let h = -545 + 849. Does 38 divide h? True Let x(o) be the third derivative of 9o5/20 - o4/12 + o*3/6 - 4o2. Is 16 a factor of x(1)? False Let q(v) = v2 + 3v. Let b(g) = -g2 - 10g - 12. Let x be b(-9). Let d be q(x). Suppose dh + 105 = 5h. Is h a multiple of 10? False Let y(f) = -f*2 - 9f + 12. Let g be y(-10). Suppose 10 = -gt + 22. Does 6 divide t? True Let d be (-1 - 5/15)-3. Let a be 36 + (-1)/(2/2). Suppose 9m + 5w - a = dm, 0 = m - w - 3. Does 4 divide m? False Let a(s) = -10s2 + 8. Let x(n) = -n2 + 1. Let u(f) = a(f) - 12x(f). Suppose 0 = -2o + 4b - 3b + 5, -b - 14 = -5o. Does 7 divide u(o)? True Let q(v) = v3 + 7v*2 + 5v. Let d be q(-6). Let k(s) = -3s - 5. Let o be k(d). Let z = 64 + o. Is 15 a factor of z? False Let v(o) = o3 - 11o*2 + 10o + 4. Let n be v(10). Suppose -na + 29 - 9 = 0. Suppose 35 = 4x - a. Does 10 divide x? True Let u(n) = 3n3 + 7n + 12n2 - 3n*2 - 2n*3. Suppose -16 = t + t. Is u(t) a multiple of 4? True Suppose -5 = -c - 0. Suppose 0h + 180 = ch. Suppose 186 - h = 5m. Is m a multiple of 10? True Suppose -l + 0l + 10 = 0. Suppose 2h = 5s + 21, 0 = 3h - 5s + 2s - 18. Suppose -5j = l, y + 7j - 24 = hj. Is 17 a factor of y? False Suppose 0 = 3x + 8796 - 2271. Is 5 a factor of x/(-165) + (-4)/22? False Let k be (-5)/(-3) + 4/12. Let y(n) = 9n3 + 2n*2 - 1. Let l be y(-1). Is 67/k + 12/l a multiple of 19? False Suppose 129p - 134p = -205. Does 8 divide p? False Suppose 2f + 29 = 5a, -a + 35 = -5f + 4a. Let o(k) = -k3 + 2k*2 + 2k. Is 3 a factor of o(f)? True Let i be (-236)/10 + (-2)/5. Let z be i/9 + 2/3. Is 5 a factor of (-43)/(-4) - z/8? False Suppose 0 = 3j + 3v, 4 = 4j + 2v - 2. Suppose -2d + jm = -3d + 41, 5d - 3m - 223 = 0. Is d a multiple of 20? False Let j be 4(3/2)/3. Let g be 34/8 - j/8. Suppose 4a - 3a - 27 = -5c, 0 = 4a - gc - 84. Is 11 a factor of a? True Suppose 0 = 3t - 2t - 56. Does 28 divide t? True Suppose 0 = 5k - 1 - 9. Let h be 15/12(k + -6). Let v(y) = 2y*2 + 6y - 2. Is 9 a factor of v(h)? True Let i = 237 - 138. Is i a multiple of 5? False Let h(o) = 10o3 - 2o*2 + 2o - 1. Let u be h(1). Is 18/(u/(-6) - -2) a multiple of 18? True Let y = -15 - -144. Suppose -2x = -3k + y, 1 = -x - 2. Does 18 divide k? False Is 35 a factor of (-16)/112 - (-981)/7? True Let i be 10 - 0 - (0 + 0). Suppose -4v - v - i = 0. Is v((-5)/2 - 2) a multiple of 4? False Let y = 32 - -80. Does 16 divide y? True Suppose -2p = 2p + 2j - 18, 3p = -2j + 16. Let v(k) = k2 + pk*2 - 4k2 + 5. Is v(0) a multiple of 5? True Let q(m) = -m3 - 9m2 - 12m - 1. Let h be 32/63/(-2). Let i = h + 0. Is 23 a factor of q(i)? False Suppose -l + 6 = -3l, 2q = -4l + 80. Suppose -2y = -3y + q. Is 11 a factor of y? False Let z(m) = -m*2 + 9m + 12. Let b be z(9). Suppose -4v + 7v = b. Let w = v + -1. Does 3 divide w? True Suppose -12 = 3p, -3k + 8k - 5p = 45. Let q be (4/(-5))/((-1)/k). Suppose m - 2t = 4m - 86, 4m - qt - 128 = 0. Does 12 divide m? False Suppose b + 104 = 4k, 4k + 2b - 62 = 30. Let u = 2 - -1. Suppose 2g + ug - k = 0. Is 3 a factor of g? False Suppose 144 = i + i. Does 18 divide i? True Let a(b) be the second derivative of -b4/12 + 11b*3/6 + 2b*2 - 4b. Let i = -11 - -19. Is a(i) a multiple of 13? False Let s(f) = f + 73. Is s(0) a multiple of 34? False Let u(m) = -4m + 12. Is u(-7) a multiple of 8? True Let i be (-49)/(-2) - 3/6. Suppose 0 = 3h - h - i. Is 3 a factor of h? True Let n(x) = -x*2 - 10x - 6. Let g be n(-5). Let p be 2(-3 + 6) + -2. Suppose pw = g + 5. Does 3 divide w? True Let w be 153/45 + (-2)/5. Let a(b) = -3bw + 10b*2 + 5b*3 + 12 - 3b*3 + 3b. Is 21 a factor of a(10)? True Suppose -4p - 3z + 149 = -222, 5p - 463 = -3z. Suppose -2k = 2l - p, 6l - l - 2k - 230 = 0. Is l a multiple of 23? True Suppose 2z - z - 45 = 0. Suppose -2t - t = z. Is 6 a factor of (-3)/t - (-118)/10? True Let x(f) = -f + 71. Is x(10) a multiple of 4? False Suppose -150 = -6t + 222. Is t a multiple of 6? False Let i(h) be the second derivative of -h5/20 + 5h4/12 + h3/3 + 3h2/2 + 2h. Is i(5) a multiple of 13? True Suppose -7y - 1215 = -16y. Does 15 divide y? True Let g = 8 - 13. Let d = -6 + g. Let j = 17 - d. Does 14 divide j? True Let t(o) = -o*3 + 7o*2 - 7o + 5. Let l = -7 - -13. Suppose -lj = -j - 25. Is t(j) a multiple of 8? False Let h(w) = 8w - 21. Does 15 divide h(11)? False Let q(k) = k*2 + 2k + 1. Let z be q(-3). Suppose -2 = u + 3h - 15, -zh = -8. Let t = u - -23. Is t a multiple of 15? True Let n(g) = -g*3 + 7g*2 + 6g. Suppose 3b = 2b + 3j + 7, -5b + 65 = -5j. Suppose -4w - 3i + b = 0, -2 - 2 = i. Is n(w) a multiple of 14? True Suppose -58 = -7y + 362. Is 15 a factor of y? True Let y(n) = -n - 8. Let a(u) = -u*3 + 10u*2 + u - 5. Let d be a(10). Suppose 15 = -do - 40. Is y(o) a multiple of 3? True Is 12 a factor of 0 + -1 + 3 - -46? True Suppose -99 - 99 = -6g. Is 11 a factor of g? True Let b(g) = 6g. Is b(1) even? True Let a(o) be the third derivative of 0 + 0o - 1/6o3 + o2 - 13/24o4. Is 6 a factor of a(-1)? True Let l = 25 - 16. Suppose 0 = -3w - l. Is 2 a factor of (w - -1)1-1? True Let b be (-1)/(1 - 18/15). Suppose bi + 162 = 7i. Does 27 divide i? True Let g(t) = -t*3 - 6t*2 + 7t + 7. Let u be g(-7). Suppose -2y + y + u = 0. Is y a multiple of 7? True Is 14 + (7 - (5 + -1)) a multiple of 3? False Suppose -6 = 2u - 4. Is (9 - u)(-160)/(-50) a multiple of 16? True Let d = 129 - 76. Suppose 15 = 3a, -4a - 15 + d = -3t. Is (2/4)/((-1)/t) a multiple of 2? False Suppose -7t + 2t + 15 = 0. Suppose q + 0q - 17 = 4y, -5y + 51 = tq. Does 17 divide q? True Suppose -2v + 6v - 16 = 0. Suppose vd - 2 = 46. Is 5 a factor of d? False Suppose 5h = -4v + 20, 4h + 2 = -5v + 27. Suppose -z = -10 + 8. Suppose hw = -zw + 4. Is w a multiple of 2? True Let b(a) = -a3 + 16a*2 - 20a - 13. Does 11 divide b(14)? True Suppose -2a + 4o = -348, -a - o = -6a + 825. Suppose -4q + a = -2g, 3q - 66 = -3g + 66. Is q a multiple of 15? False Let t = -12 - -72. Does 21 divide t? False Let b be (24/(-6))/(-2 - -1). Suppose w - 140 = -5o + 68, b = -2w. Is o a multiple of 21? True Let w(d) = 38d*2 - 3d + 1. Does 53 divide w(-2)? True Let v(b) be the third derivative of 0 + 0b3 + 0b - 1/12b4 + 3b*2. Is v(-6) a multiple of 12? True Suppose 0 = l + 3l - 348. Suppose -3k + 147 = -b + 6, 3b = 2k - l. Does 12 divide k? True Let a = 164 - 69. Does 23 divide a? False Let x be ((-76)/(-12))/(1/(-9)). Suppose 5z = -221 + 66. Let q = z - x. Is 13 a factor	{ "pile_set_name": "DM Mathematics" }
on denominator of 1/(-51)(-996)/(-8) and (-10)/(-2)-1 - (-803)/88? 136 Suppose 2z + 3z = x - 31, 5z = 3x - 73. Let u = 1762 - 1758. What is the lowest common multiple of u and x? 84 Let w = 81977/27872 - -24/871. What is the common denominator of -13/128 and w? 128 Suppose 0 = 16k - 20k - 20. Let g be k - (-7 + 3 + 0). What is the lowest common multiple of (g/3)/((-1)/27) and 2? 18 Let k = 87987 + -29035667/330. What is the common denominator of k and 5/2? 330 Let y = -57028969/324 - -176015. What is the common denominator of y and -71/18? 324 Let s(w) = -6 + 0w + 0w - 2w. Suppose -4f = 2n + 36, 5f - 5n - 2 + 32 = 0. What is the lowest common multiple of 18 and s(f)? 90 Suppose l + 7 = 5n + 9, -6 = -3n. Calculate the least common multiple of l and 12. 12 Suppose -5y + 4y + 5p + 18 = 0, 0 = -4y - 5p - 3. Suppose 4j = -z + 30, 7z = 5j + yz - 27. Calculate the smallest common multiple of 2 and j. 14 Let a(m) = -m*3 + 6m*2 - 3m - 2. Let n be a(4). Let x be 24116/(-144) - (-4)/n. Let l = x + 168. What is the common denominator of l and 45/2? 4 Find the common denominator of ((-1)/48)/((-250)/5550) and 25/112. 560 Let l(q) = -4q + 2. Let b be l(1). Find the common denominator of b/(2((-96)/(-75) + -2)) and 77/20. 180 Let n(i) = i + 6. Let t be n(-9). Calculate the common denominator of (-2)/((-228)/89) + t/6 and 25/8. 456 Calculate the common denominator of (3 + (-249)/99)1-3 and 34/9. 99 Suppose -13o - i = -11o - 741, -5o = -5i - 1860. Let p = 1491/4 - o. Find the common denominator of p and 41/10. 20 Calculate the smallest common multiple of 256 and 106/(-689) + 288/13. 2816 What is the common denominator of 10/155/8 and (-2)/(-5) - (2187/1080 - 3)? 24 Let w(o) = 22o + 1. Let r = -2177/5 + 17011/40. Find the common denominator of r and w(1). 8 Let k = -265 - -283. Calculate the lowest common multiple of 126 and k. 126 Let r be 4/(-88)(-1028)/10. Let o = -102/11 + r. Let x = -315 - -4435/14. Find the common denominator of x and o. 70 Suppose 6k + 96 = 162. Calculate the lowest common multiple of k and 5. 55 Let v = -543/10 + 17439/320. Calculate the common denominator of 43/44 and v. 3520 Let o(w) = w + 2. Let u be o(-16). Let z = 8 - u. What is the least common multiple of z and 10? 110 Calculate the smallest common multiple of (-3)/6(-126 + 6) and 60. 60 Let b = -17869 + 393193/22. What is the common denominator of b and 143/18? 198 Suppose 86 + 46 = 22y. Let v = -5 - -8. What is the lowest common multiple of v and y? 6 Suppose 2m + 2g = 4g + 26, -3m = 2g - 24. What is the smallest common multiple of 55 and m? 110 Suppose 99 = -157o + 168o. Suppose y - 2y + 8 = 0. What is the lowest common multiple of o and y? 72 Let d be 8977/4340 + 1/(-2). Let s = -4/217 + d. Let g = 1689/80 - 361/16. Calculate the common denominator of s and g. 20 Suppose 73 + 855 = 8i. Calculate the lowest common multiple of 290 and i. 580 Find the common denominator of -44/9 and (46/(-72))/(3/141). 9 Let q(r) = -r*3 + 11r*2 + 12r + 9. What is the least common multiple of 868 and q(12)? 7812 Let z = -35 - -13. Calculate the common denominator of 150/z + 4 - 2 and 83/6. 66 Let q(b) = 14b2 - b - 3. Let s be q(-3). Let k = 172 + -803/5. Calculate the common denominator of (-232)/s + 6/21 and k. 45 Find the common denominator of 31/35 and 14308/(-8820) + -21/(-3). 315 Let u = -515 - -624. What is the least common multiple of 2 and u? 218 What is the lowest common multiple of 104 and (-10)/5 - 5/((-25)/595)? 936 Let w = -663 - -806. Calculate the smallest common multiple of 39 and w. 429 Let o(s) = -s*3 - 11s*2 - 14s - 10. Calculate the least common multiple of o(-10) and 102. 510 Let w = 1377/4 + -349. What is the common denominator of w and (4/30)/(9/(-45))? 12 Suppose 0 = 9l - 408 - 447. What is the least common multiple of 30 and l? 570 Calculate the lowest common multiple of (-1)/(8/(-156))(15 + -13) and 39. 39 Let s(p) = -3p3 + 9p - 6 - 26p + 19p*2 + 2p*3. Calculate the smallest common multiple of (-1 + 1)/2 - -22 and s(18). 132 Let i = 42 - 37. Suppose ia = 60 + 20. What is the lowest common multiple of 12 and a? 48 Let j(a) = -4a + 2. Let v be j(-6). Suppose 0 = -3c + 2r + v, c - 5r + 8 = 21. Let l = c + -6. Calculate the lowest common multiple of l and 4. 4 Let u = -1064857/1950 + 7113/13. Find the common denominator of u and 29/12. 300 Let c be 0 - -1 - -1 - 38. Let a = -33 - c. Let d(s) = 7s3 + 1. What is the least common multiple of d(1) and a? 24 Let p be (-2382)/160108/(-1028). Let c be -1 + 2/(5140/2574). Let u = p - c. What is the common denominator of 81/8 and u? 16 Let i = -21379/48 - -1333/3. What is the common denominator of -59/48 and i? 48 Let q = -3901 - -31295/8. What is the common denominator of q and 1/(-3) - 206/(-276)? 184 What is the common denominator of 9/10 and 4(-3)/30 - (-18)/55? 110 Let j = -5094/13 + 611189/1560. Calculate the common denominator of j and -91/240. 240 Let q be (-3318)/(-15)(-323)/20. Let g = q - -3572. Calculate the common denominator of 67/20 and g. 100 Suppose -5y + 2q + 7 = 0, 6q = 4y + 3q. Suppose -3f - 22 = -2d + f, f + 44 = 4d. Suppose 0 = 5u - d - 4. What is the least common multiple of y and u? 3 Let v be (8/(-6) - -4) + 1/3. Suppose 9n - 336 = -vn. What is the smallest common multiple of n and 8? 56 Let h = 3156 + -12725/4. What is the common denominator of (-36)/120 + (-892)/(-440) and h? 44 Let a = 17075 - 614791/36. Calculate the common denominator of (-1214/63)/(-4) and a. 36 Let u(k) = 1 + 3k2 - 2k*2 + 9k + 8 - 3. What is the least common multiple of u(-10) and 1? 16 Let b = 1268 + -1232. Calculate the least common multiple of b and 174. 1044 Let f = 2 - -6. Let z be (-27)/(-63) + (-4)/(-7). What is the smallest common multiple of f and (8 + -19)/(z-1)? 88 Let b be ((-91706)/210)/(24/20). Let g = -3200/9 - b. What is the common denominator of 386/(-16) - -4 and g? 28 Suppose -5y - 6 = -26. Let d(a) = 5a*2 - 7a + 6. Let l be d(y). Calculate the common denominator of -55/14 and 1 - 4/112l. 14 Let f be 2(-6)/(-4 + 1)8. Let g = f - 29. Calculate the smallest common multiple of g and 13. 39 Let b(t) = t3 + 18t*2 + 19t + 42. Calculate the smallest common multiple of 64 and b(-17). 64 Let r be (-20)/(-50) - (-3346)/60. Let n = -886/15 + r. Find the common denominator of -1 + 1 - (1 - 10/(-9)) and n. 90 Let z be 1148/(-98) - 2/7. Calculate the common denominator of 58/z - 46/(-23) and 8/33. 66 Find the common denominator of 16/12 + (-4)/24 and -151/12. 12 Let i be (4 - (3 + 3)) + -3. Find the common denominator of 390/(-8)2i/(-25) and 13/4. 4 Suppose -315 = -7m + 2m. Let w = -53 + m. What is the lowest common multiple of 16(-1)/4-5 and w? 20 Let g(b) = -3b2 - 10b - 25. Let u(p) = 2p2 + 10p + 25. Let i(v) = 3g(v) + 4u(v). Calculate the lowest common multiple of i(11) and (1 + (-4)/2)-6. 42 Suppose j - 4 = 4n, -j + 2n - 26 = -4j. Let r(h) = 3h3 - 23h*2 - 5h - 8. What is the least common multiple of r(8) and j? 16 Let c be 15/5 - -12. Suppose 2f - c - 3 = 0. Suppose 5m + 0w - fw + 110 = 0, -4w - 88 = 4m. Calculate the common denominator of -26/9 and m. 9 Let i = 179 - 176. Suppose -5l - ij = -7j - 126, 0 = -j - 4. Calculate the smallest common multiple of l and ((-2)/(-3))/((-3)/(-297)). 66 Let i(z) = -8z3 + 7z*2 + 3z + 2. What is the smallest common multiple of 16 and i(-2)? 176 Let d = -111045/2162 - -2695/47. Let s = d + -2468/207. Find the common denominator of 89/2 and s. 18 Let t = 4714/5 + -941. Calculate the common denominator of t and -93/184. 920 Let g be 65/(-25) + 2/(-5). Let z be ((-9)/6)/g0. Suppose -3u - 2f + 7f + 49 = 0, -4u - 2f + 74 = z. Calculate the smallest common multiple of 16 and u. 144 Let m = -2946 - -41317/14. What is the common denominator of m and -11/168? 168 Let r = -565 - -612. Find the common denominator of (1/3)/(2/(-118)) and r. 3 Suppose -2y + 5c = 63, 5y - c + 2c = -144. Let b = y + 31. Suppose -65 + 14 = 2f + 5r, 0 = 2r + b. Calculate the common denominator of -67/9 and f. 9 Suppose 37 + 13 = 5x. Suppose 5w - 2c = 28, 8 = c + 7. What is the least common multiple of x and w? 30 Let p be (14/(-4))/(-1 + (-466)/(	{ "pile_set_name": "DM Mathematics" }
- 363t2 - 575t*2. -1348t*2 Collect the terms in 39t*3 - 9t*3 - 12t*3 - 17t3. t3 Collect the terms in 10z2 - 13z*2 + 11z*2 + 7z*2. 15z*2 Collect the terms in -3690 + 3690 + 4p*3. 4p*3 Collect the terms in -3k*2 - 12 + 9 + 13 - 10. -3k*2 Collect the terms in -60k + 32k - 4k*2 + 28k. -4k2 Collect the terms in -8 - 3t*3 + 8 + 5t*3. 2t*3 Collect the terms in -13p*3 + 86 + 15p*3 - 86. 2p*3 Collect the terms in -2t*2 - 9t*2 - 2t*2. -13t2 Collect the terms in -6 + 6 - r3 + 41r3. 40r*3 Collect the terms in -2h + 272h3 + 3h - h. 272h3 Collect the terms in 4q + 6q + 6q. 16q Collect the terms in 7b - 10b - 26b*3 + 3b. -26b3 Collect the terms in 4q*3 - 716q + 716q - 2q*3. 2q*3 Collect the terms in -340o - 13o3 + 340o. -13o3 Collect the terms in -6n*3 - 9327n + 9327n. -6n*3 Collect the terms in 2 - 6h*3 + 7 - 9. -6h*3 Collect the terms in 2z - 2z - 370z*2 - 1130z*2. -1500z*2 Collect the terms in 168c - 7c2 - 17c*2 - 164c. -24c2 + 4c Collect the terms in g*2 - 122g + 122g. g2 Collect the terms in -4 + 7 - 3 - 13l*2. -13l*2 Collect the terms in 243z - 245z + 4z. 2z Collect the terms in 79i*3 + i + 0 + 0 + 126i*3. 205i*3 + i Collect the terms in 15 - 15 + 45b*2. 45b*2 Collect the terms in 6x*3 + 10x*3 - 22x*3 + 3x*3. -3x*3 Collect the terms in 3 - 16f - 2 + 0 + 2. -16f + 3 Collect the terms in -7 + 22l*2 - 1 - 2 + 4. 22l*2 - 6 Collect the terms in -137a*3 + 281a*3 - 138a*3. 6a*3 Collect the terms in 1 + 3f + 6 - 7. 3f Collect the terms in 212z - 212z - 39z*2 + 139z*2. 100z*2 Collect the terms in 162c - 320c + 158c - 11c2 + 38c*2. 27c*2 Collect the terms in -10t + 7t + 25t. 22t Collect the terms in 18t - 30t + 16t. 4t Collect the terms in 4z*2 + 6z*2 + 2z*2. 12z*2 Collect the terms in -29 - 128s*2 + 52 - 23. -128s*2 Collect the terms in -19 + 10b*2 + 19 - 8b*2. 2b*2 Collect the terms in 1 + 5751u*2 - 5748u*2 - 1. 3u*2 Collect the terms in 57 + 1 - b - 3 - 55. -b Collect the terms in -35n*2 + 4n - 5n3 + 35n*2. -5n*3 + 4n Collect the terms in -w*3 - 126w - 82w + 208w. -w3 Collect the terms in -y2 + 125y3 + y2. 125y*3 Collect the terms in 2c - 849 + 849. 2c Collect the terms in 2b*3 - 5b*3 - 7b*3 + 0b*3. -10b*3 Collect the terms in 7 - 7 + 10t. 10t Collect the terms in 494272r - 4r3 - 494272r. -4r3 Collect the terms in g3 - 6g*3 + 2 - 1 + 0g*3. -5g*3 + 1 Collect the terms in -8f - 60f - 17f + 177f. 92f Collect the terms in -13n - 2n - 4n - 13n. -32n Collect the terms in -14b + 7b - 5 - 3 + 8. -7b Collect the terms in -2768m2 + 2768m*2 - 2m*3. -2m*3 Collect the terms in 14r*3 + 18r*3 - 41r*3. -9r*3 Collect the terms in 2 - 5s - 10 + 8. -5s Collect the terms in 3 - 41g*2 - 1 - 2. -41g*2 Collect the terms in -8q*2 - 5q + 9q2 + 5q. q*2 Collect the terms in 2p + 4p + 2p + 3p + 3. 11p + 3 Collect the terms in 8154 + 3x - 8154. 3x Collect the terms in s*3 - 13s*3 - 18s*3 - 9s*3 - 8s*3. -47s*3 Collect the terms in -5s + 5s3 + 5s*3 + 5s - 5s3. 5s*3 Collect the terms in -72v*3 - 42v*3 + 99v*3. -15v*3 Collect the terms in -7i - 2i + 7i. -2i Collect the terms in 43410n*3 - 21703n*3 - 21705n*3. 2n*3 Collect the terms in -8 + 8 + 26u - 2u2. -2u*2 + 26u Collect the terms in -1769p2 + 1142p*2 - 1899p*2. -2526p*2 Collect the terms in 5k*3 - 3k*2 + 3k*2 - 5k*3 - 2k*3. -2k*3 Collect the terms in 115 + 6d - 115. 6d Collect the terms in 0 + u2 - 4 + 0. u2 - 4 Collect the terms in 58p*2 - 128p*2 + 40p*2 + 44p*2. 14p*2 Collect the terms in -68z*2 - 3 + 3 - 2 - 16z*2. -84z*2 - 2 Collect the terms in -4166m + 4166m - 4m*3 + 2m*3. -2m*3 Collect the terms in 5n + 0n - n - 2n. 2n Collect the terms in -4g + 14g - 5g. 5g Collect the terms in -3s*3 - 17s*3 - 4s*3. -24s*3 Collect the terms in -5c*3 - 7c*3 - 6c*3. -18c*3 Collect the terms in -1 + 41v + 1 - 38v. 3v Collect the terms in 0s3 - 16s*3 - 2s*3. -18s*3 Collect the terms in 8y + 6y + 6y. 20y Collect the terms in 31f*2 - 4 - 44f*2 + 4. -13f*2 Collect the terms in 26i - 3i3 - 26i + 4i3. i3 Collect the terms in 3 - 6f*2 - 2049f + 2049f. -6f*2 + 3 Collect the terms in -9p*2 + 5p*2 - 5p*2. -9p*2 Collect the terms in 38f*2 + 11f - 5f - 6f. 38f2 Collect the terms in 3 - 5 + 0 + 0 - 8k*3. -8k*3 - 2 Collect the terms in 49r - 22r - 26r. r Collect the terms in -488w + 488w + w*3 - 3w*3. -2w*3 Collect the terms in -7z - 10z - 22z - 8z. -47z Collect the terms in -70t3 - 73t*3 + 234t*3 - 94t*3. -3t3 Collect the terms in -8 + 16 - 8 - x2. -x*2 Collect the terms in -8v*3 + 2v3 - v3. -7v3 Collect the terms in 2 + 1699j*2 - 2 - 1693j*2. 6j*2 Collect the terms in -25n - 25n + 50n + 2n2. 2n*2 Collect the terms in -28x*2 + 70x*2 - 40x*2. 2x*2 Collect the terms in 21f + 8f2 - 45f + 24f. 8f*2 Collect the terms in -2p*3 - 2p*3 + 5p*3 + 236p2. p3 + 236p2 Collect the terms in -5 - 22f*2 + 5 + 19f*2. -3f*2 Collect the terms in 2 - 5g*3 + 3g*3 - 33g*3. -35g*3 + 2 Collect the terms in -7324i + 2437i + 2442i + 2438i. -7i Collect the terms in -21v + 37v - 14v. 2v Collect the terms in -3w2 + 2w*3 + 7w*3 + 3w*2 - 16w*3. -7w*3 Collect the terms in 11k - 2k - 11k. -2k Collect the terms in -2g - g + 0g + g. -2g Collect the terms in 79m + 39m*3 + 35m*3 - 79m - 79m3. -5m*3 Collect the terms in -4b + 3b - 21b - 18b. -40b Collect the terms in -8n3 + 31n*3 + 21n*3. 44n*3 Collect the terms in 76g - 152g + 74g. -2g Collect the terms in -15y*2 + 15966y - 15966y. -15y*2 Collect the terms in 142v*2 - 68v2 + v3 - 74v2. v3 Collect the terms in -216y*3 + 14y - 14y - 472y*3. -688y*3 Collect the terms in 4z*2 + 1782z*3 - 1803z*3 - 4z*2. -21z*3 Collect the terms in -12x - 2 - 5 + 7. -12x Collect the terms in -5h - 191h3 + 5h. -191h3 Collect the terms in -16p + 14 - 14. -16p Collect the terms in 9 - 6 - 3 - 60d*2. -60d*2 Collect the terms in 5i - 3i + 21i*2 - 2i. 21i2 Collect the terms in 4 - 6 + 304x - 3 - 303x. x - 5 Collect the terms in -1181 + 2d*3 + 1181. 2d*3 Collect the terms in 4t - 5t - 4t. -5t Collect the terms in 3336i*2 - 832i*2 - 833i*2 - 839i*2 - 835i*2. -3i*2 Collect the terms in -3772a + 2a2 + 3772a. 2a2 Collect the terms in 0u - 7u + 7u - 87u3. -87u*3 Collect the terms in -2d*3 + 10 - 47d*2 - 10. -2d*3 - 47d*2 Collect the terms in -17b + 4b + 4b + 7b. -2b Collect the terms in -5i - 1 + 0i + 3i + 6i. 4i - 1 Collect the terms in 13 + 12m - 13. 12m Collect the terms in -70k + 70k + 2k*3. 2k*3 Collect the terms in 4p*2 - 2 - 3 + 4. 4p*2 - 1 Collect the terms in 679886f - 679886f - 2f*3. -2f*3 Collect the terms in 47 + 0k2 - 47 - k2. -k*2 Collect the terms in -82d*2 + 247d*2 - 83d*2 - 77d*2. 5d*2 Collect the terms in 234k*3 - 5k + 5k - 71k*3. 163k*3 Collect the terms in 509 + 2y2 - 509 + y2. 3y2 Collect the terms in -9109b - 9113b - 2b*2 + 18222b. -2b2 Collect the terms in -2u*2 + 6u*2 - 5u*2 - 4u*2. -5u*2 Collect the terms in -5y*3 + 12y*3 - 4y*3. 3y*3 Collect the terms in -10c*3 + 27c*3 - 19c*3. -2c*3 Collect the terms in -136m - 66m + m. -201m Collect the terms in -2a3 - 7a*3 + 8a3. -a3 Collect the terms in 6b + 6b + 3b - 19b. -4b Collect the terms in -35i*2 + 6i*2 + 11i*2 + 3i*2 + 5i*2. -10i*2 Collect the terms in 16d + 14d - 22d. 8d Collect the terms in -203 + 203 + u. u Collect the terms in -2573x3 - x2 + x*2 + 2572x3. -x3 Collect the terms in -115w3 - 120w*3 + 233w*3. -2w3 Collect the terms in g3 - 2001g + 2001g. g*3 Collect the terms in 7i + 3i - 4i - 5i. i Collect the terms in 13g - 7g - 4g. 2g Collect the terms in 33 - 112o - 33.	{ "pile_set_name": "DM Mathematics" }
he tens digit of 213010? 1 What is the tens digit of 32620? 2 What is the hundreds digit of 22489? 4 What is the tens digit of 10938? 3 What is the units digit of 334? 4 What is the thousands digit of 3536? 3 What is the units digit of 9327? 7 What is the hundreds digit of 732? 7 What is the hundreds digit of 1021? 0 What is the tens digit of 1052? 5 What is the tens digit of 2765? 6 What is the hundreds digit of 487? 4 What is the units digit of 636? 6 What is the units digit of 68839? 9 What is the units digit of 23840? 0 What is the units digit of 6885? 5 What is the units digit of 22484? 4 What is the ten thousands digit of 13087? 1 What is the tens digit of 64? 6 What is the units digit of 65? 5 What is the units digit of 33792? 2 What is the hundreds digit of 5713? 7 What is the units digit of 18235? 5 What is the units digit of 847? 7 What is the tens digit of 13064? 6 What is the units digit of 6667? 7 What is the thousands digit of 6243? 6 What is the tens digit of 14834? 3 What is the hundreds digit of 1626? 6 What is the tens digit of 705? 0 What is the hundreds digit of 135727? 7 What is the tens digit of 462? 6 What is the units digit of 1726? 6 What is the tens digit of 35282? 8 What is the tens digit of 25052? 5 What is the ten thousands digit of 10609? 1 What is the hundreds digit of 16142? 1 What is the units digit of 4748? 8 What is the thousands digit of 3605? 3 What is the units digit of 60663? 3 What is the hundreds digit of 81955? 9 What is the units digit of 1386? 6 What is the thousands digit of 3519? 3 What is the ten thousands digit of 62847? 6 What is the thousands digit of 3005? 3 What is the units digit of 1803? 3 What is the tens digit of 12050? 5 What is the thousands digit of 9287? 9 What is the ten thousands digit of 110289? 1 What is the tens digit of 33? 3 What is the tens digit of 1293? 9 What is the thousands digit of 35786? 5 What is the hundreds digit of 998? 9 What is the thousands digit of 57671? 7 What is the ten thousands digit of 59774? 5 What is the thousands digit of 7166? 7 What is the units digit of 7106? 6 What is the hundreds digit of 151? 1 What is the hundreds digit of 1723? 7 What is the hundreds digit of 132572? 5 What is the hundreds digit of 53268? 2 What is the hundreds digit of 1223? 2 What is the tens digit of 1616? 1 What is the units digit of 30432? 2 What is the tens digit of 977? 7 What is the hundreds digit of 981? 9 What is the tens digit of 2689? 8 What is the units digit of 4453? 3 What is the units digit of 3287? 7 What is the units digit of 2934? 4 What is the tens digit of 33749? 4 What is the tens digit of 7712? 1 What is the hundreds digit of 86935? 9 What is the hundreds digit of 726? 7 What is the thousands digit of 123202? 3 What is the units digit of 16383? 3 What is the units digit of 77? 7 What is the hundreds digit of 8781? 7 What is the units digit of 2865? 5 What is the hundreds digit of 6979? 9 What is the units digit of 34556? 6 What is the thousands digit of 38648? 8 What is the tens digit of 2543? 4 What is the thousands digit of 6778? 6 What is the units digit of 7253? 3 What is the hundreds digit of 75856? 8 What is the hundreds digit of 403? 4 What is the units digit of 49295? 5 What is the hundreds digit of 859? 8 What is the ten thousands digit of 30505? 3 What is the tens digit of 2474? 7 What is the units digit of 101265? 5 What is the tens digit of 34262? 6 What is the thousands digit of 76210? 6 What is the tens digit of 21147? 4 What is the hundreds digit of 3394? 3 What is the ten thousands digit of 10364? 1 What is the units digit of 3816? 6 What is the units digit of 7114? 4 What is the hundreds digit of 7629? 6 What is the units digit of 66146? 6 What is the units digit of 5789? 9 What is the tens digit of 101642? 4 What is the tens digit of 52418? 1 What is the hundreds digit of 8093? 0 What is the units digit of 975? 5 What is the tens digit of 1090? 9 What is the thousands digit of 16165? 6 What is the thousands digit of 1097? 1 What is the units digit of 658? 8 What is the thousands digit of 30982? 0 What is the ten thousands digit of 37835? 3 What is the units digit of 90770? 0 What is the ten thousands digit of 10616? 1 What is the units digit of 335? 5 What is the tens digit of 59226? 2 What is the units digit of 194? 4 What is the thousands digit of 2107? 2 What is the units digit of 4640? 0 What is the units digit of 861? 1 What is the hundreds digit of 6212? 2 What is the thousands digit of 1616? 1 What is the units digit of 25658? 8 What is the hundreds digit of 41973? 9 What is the tens digit of 2746? 4 What is the ten thousands digit of 184503? 8 What is the hundreds digit of 1734? 7 What is the hundreds digit of 2855? 8 What is the units digit of 22045? 5 What is the thousands digit of 1326? 1 What is the thousands digit of 3794? 3 What is the units digit of 112? 2 What is the hundreds digit of 4124? 1 What is the hundreds digit of 4105? 1 What is the hundreds digit of 18676? 6 What is the thousands digit of 5012? 5 What is the ten thousands digit of 25497? 2 What is the hundred thousands digit of 104061? 1 What is the hundreds digit of 845? 8 What is the units digit of 4589? 9 What is the units digit of 9320? 0 What is the tens digit of 164? 6 What is the units digit of 1382? 2 What is the hundreds digit of 6055? 0 What is the hundreds digit of 8561? 5 What is the units digit of 54387? 7 What is the units digit of 935? 5 What is the units digit of 497? 7 What is the thousands digit of 47405? 7 What is the hundreds digit of 171? 1 What is the tens digit of 8151? 5 What is the units digit of 979? 9 What is the ten thousands digit of 12116? 1 What is the ten thousands digit of 50388? 5 What is the thousands digit of 167009? 7 What is the hundreds digit of 44953? 9 What is the hundreds digit of 5101? 1 What is the hundreds digit of 18485? 4 What is the units digit of 418? 8 What is the thousands digit of 66768? 6 What is the tens digit of 31974? 7 What is the units digit of 173? 3 What is the tens digit of 2419? 1 What is the thousands digit of 61683? 1 What is the thousands digit of 5978? 5 What is the units digit of 46253? 3 What is the units digit of 38422? 2 What is the ten thousands digit of 21988? 2 What is the thousands digit of 2318? 2 What is the thousands digit of 1222? 1 What is the tens digit of 1194? 9 What is the tens digit of 4446? 4 What is the thousands digit of 2500? 2 What is the hundreds digit of 1155? 1 What is the tens digit of 21411? 1 What is the tens digit of 2163? 6 What is the units digit of 6592? 2 What is the tens digit of 28329? 2 What is the units digit of 43064? 4 What is the units digit of 1551? 1 What is the tens digit of 77944? 4 What is the hundreds digit of 351? 3 What is the units digit of 1326? 6 What is the hundreds digit of 11429? 4 What is the tens digit of 984? 8 What is the hundreds digit of 264? 2 What is the tens digit of 28? 2 What is the tens digit of 2944? 4 What is the tens digit of 615? 1 What is the tens digit of 1250? 5 What is the units digit of 3556? 6 What is the hundreds digit of 800? 8 What is the thousands digit of 7302? 7 What is the hundreds digit of 104022? 0 What is the thousands digit of 7095? 7 What is the hundreds digit of 921? 9 What is the hundreds digit of 1160? 1 What is the tens digit of 24117? 1 What is the hundreds digit of 85105? 1 What is the ten thousands digit of 14761? 1 What is the tens digit of 5964? 6 What is the units digit of 41534? 4 What is the hundreds digit of 8757? 7 What is the ten thousands digit of 142100? 4 What is the units digit of 3882? 2 What is the tens digit of 1059? 5 What is the units digit of 843? 3 What is the tens digit of 1330? 3 What is the tens digit of 25817? 1 What is the tens digit of 7541? 4 What is the tens digit of 28? 2 What is the units digit of 61809? 9 What is the tens digit of 3745? 4 What is the units digit of 602? 2 What is the thousands digit of 2771? 2 What is the hundreds digit of 1460? 4 What is the tens digit of 127? 2 What is the tens digit of 13496? 9 What is the thousands digit of 35874? 5 What is the units digit of 1575? 5 What is the hundreds digit of 3519? 5 What is the thousands digit of 14304? 4 What	{ "pile_set_name": "DM Mathematics" }
-3)). Which is greater: 4/13 or b? 4/13 Let p = 5492/9 + -611. Which is greater: -2 or p? p Suppose -3y + 49 - 13 = 0. Which is smaller: y or 11? 11 Let c be (2/4)/(8/16). Which is smaller: 6/5 or c? c Let v(t) = t2 - 18t + 24. Let h be 70/4 + (-15)/10. Let u be v(h). Which is bigger: -10 or u? u Let m(f) = 0f + 3 + 2f*3 - 2f*2 + f + 5f. Let n be m(-4). Let q = 1269/7 + n. Which is bigger: q or 0? q Let d(r) = -r + 4. Let v = -20 - -34. Let s = v - 9. Let h be d(s). Which is greater: h or -1/2? -1/2 Suppose -4s - s = 4i - 11, 18 = 2s + 5i. Let g = 2 + s. Are -2/11 and g equal? False Let d be 21 + 3/(-2)12/(-6). Is d bigger than 22? True Suppose 4p - 4z + 60 = 0, -4p + 2z - 28 - 24 = 0. Is -10 at least as big as p? True Let k be 2/(-8)(-72)/15. Let z(x) = -2x + 19. Let n be z(9). Which is smaller: k or n? n Suppose -7k + 2d - 20 = -3k, -2k = d + 14. Let l be (5-1)/(3/k). Let q = l - 7. Is 3 >= q? True Suppose -30 = 4v - 7v. Suppose -14 = 4w + v. Which is greater: w or -7? w Suppose -5q + 6q - 2 = 0. Suppose -qm = -6m. Is 1 > m? True Let y be 1(0 + 0) + 84/(-30). Is -2 equal to y? False Let b = 7.054 + 0.046. Let p = -7 + b. Which is smaller: 5/4 or p? p Suppose 2t + 597 = -5y, 0 = y - t + 25 + 93. Let k = 1069/9 + y. Is 0 > k? True Suppose -5f - 5b = -3 - 2, -2b + 1 = f. Which is smaller: -3/58 or f? -3/58 Let p(o) = -2o2 - 4. Let u(l) = -l2 - l - 5. Let g(m) = -2p(m) + 3u(m). Let w be g(5). Let k(v) = v - 2. Let y be k(3). Which is bigger: y or w? w Let o = 36.9 - 37. Is o at least -55? True Let y = 0 - -1. Let n(q) be the first derivative of 2q3/3 + q2 - q + 6. Let r be n(y). Does r = 2? False Let r = 3/190 - 419/2470. Which is smaller: 1 or r? r Let k be (-1162)/15 + 8/12. Let u = k - -77. Suppose -5g - 3q - 2 = -0q, 4q - 1 = -3g. Which is smaller: u or g? g Let m(j) = -j - 8. Let t be m(-5). Which is bigger: -2 or t? -2 Let w be (-28)/21 + (-4)/6. Let p = w - -5. Suppose pn - 3 - 3 = 0. Is n != 3? True Let q be 2/3(-6)/(-2). Let p = 0.05 + -0.06. Let t = p - -0.11. Which is greater: t or q? q Let l(w) = -w*3 + 9w2 - w + 12. Let h be l(9). Let c = 5 - 2. Is c greater than h? False Let f = -34 - -53. Which is smaller: f or 20? f Let i(n) = n3 - 4n2 - 6n + 4. Let l be i(5). Is -7/3 at most as big as l? True Let n = -4.1 + 3.7. Which is smaller: n or -1/5? n Suppose -2a + a - 5 = 0. Let y(v) = v2 + 5v + 2. Let d be y(a). Is d <= 0? False Let k(r) = -17r + 3. Let l be k(4). Let z = 451/7 + l. Let i be 2/2 + 0 + -1. Is z at least i? False Let x(n) = n2 - 4. Let u be x(3). Suppose -5y + 0q + 82 = -3q, 34 = 3y + 2q. Suppose -um = -y - 6. Is 2 greater than m? False Let g = 1 + -3. Let k be g/(-6)18/82. Let z = 103/287 - k. Which is greater: z or 1? 1 Suppose 2a + 0a = -u + 26, 3u - 2a - 94 = 0. Is u bigger than -2? True Let m be 1/(-218/201). Let h = 19/3 + m. Which is bigger: 1 or h? 1 Let x(d) = -d - 4. Let z be x(-5). Suppose -2l = 1 + z. Suppose -7 + 15 = -4j. Which is smaller: j or l? j Suppose -5k - s - 26 = 0, -k + 6 = -2k - s. Let u be (-15)/(k + 3 - -3). Let y be (-5)/u + (-1)/3. Is 1/4 smaller than y? False Let h = 6 - 7. Let d = h + -1. Let c be (3 + d)/((-2)/(-2)). Which is bigger: c or -2/5? c Let o(j) = -j3 - 5j*2 - 6j. Let c be o(-4). Let d be (2/28)/((-2)/c). Which is smaller: d or 3? d Suppose 0 = 12p + 8 + 16. Suppose 4z + 5 = -r - 2, 3z - 2r = 3. Let y be (z - 0)(4 - 0). Is y less than p? True Suppose 3z = -z. Suppose o - 6o = z. Is -4 equal to o? False Let k(f) = f - 8. Let j be k(6). Let o be (-3 - j - 2) + 0. Let u(c) = 2c + 17. Let w be u(-9). Does w = o? False Suppose 3t - 28 = 4y, 2t = -5y - 16 - 19. Let r = y + 14. Is r > 8? False Suppose -20f + 26f - 6 = 0. Which is smaller: -2/121 or f? -2/121 Let v = 44 - 68. Let g be ((-2)/(-4))/((-18)/v). Which is smaller: g or -3? -3 Let r(s) = 2s - 7. Let h be r(3). Is h at most 1/4? True Let g = 3 + -5. Let z = 8 + -8.06. Let a = z + -0.04. Which is greater: a or g? a Let y = -10 - -10. Let h = 3 + -3. Let i = 1 - h. Which is bigger: i or y? i Let y = -32 - -48. Do y and 17 have different values? True Let r be 620/(-36) - (-2)/9. Which is smaller: r or -18? -18 Let o(l) = -2l - 16. Let u be o(-11). Let p = -7 + u. Suppose i = 4x + 16, 6x = -2i + 3x - 12. Which is bigger: p or i? i Let t = -5 - -1. Which is greater: t or -2? -2 Let r = 1 - 0. Let u be 70/(-22) - (2 + -5). Which is smaller: u or r? u Let x = -0.17 - -1.17. Is 0.03 > x? False Suppose 25 = -l + 6s - s, 0 = l - 2s + 13. Suppose -5 = t - 1. Which is smaller: t or l? l Let l be (4/5)/120/12. Is 0 > l? False Let r = 43 + -43.15. Is r greater than -0.1? False Let g = -4 + 6. Let l be (-3 + (g - 2))-1. Is l < -0.2? False Let v = -311571990409187483/6706840 - -789749544448/17. Let t = -1/11272 - v. Let m = -101/5 + t. Is m < 0.2? True Let j(v) be the second derivative of -v4/12 + v3/2 - v*2/2 + 9v. Suppose 0 = -0b - 2b + 4. Let r be j(b). Which is smaller: r or 2? r Suppose 27i = 17i + 30. Let l = 729/188 + -6/47. Is i > l? False Let s = -3 - -6. Suppose f = -2 + s. Which is bigger: f or 2? 2 Let q = 8 + -3. Which is smaller: 7/2 or q? 7/2 Let i(l) = -l*2 + 14l + 5. Let w be i(15). Let v = -8 - w. Let y be 34/10 - 2/5. Which is greater: y or v? y Let l = -10.771 + -0.229. Let d = -68/3 + 23. Does l = d? False Suppose 0 = -11b + 9b. Which is greater: b or 1/3? 1/3 Let u be (2 - 2/(-2)) + -2. Is u > 1? False Let h be (2/3)/(-6(-5)/45). Let b = -189/5126 - 2/233. Is h greater than b? True Let g be (2/(-1))/(-4)0. Let n be 96/(-190) + 4/10. Are n and g unequal? True Let s be 3/(-2)(-4)/(-3). Let t be s1 + 24/8. Let c be (-1)/(6/4) + 1. Is t greater than or equal to c? True Let r(l) = -2l - 55. Let h be r(-28). Which is smaller: h or 3? h Let l = 2 + -20. Let q = 13 + l. Let w = 3 + q. Is 0 bigger than w? True Suppose 4t + 6c - c = 1, 4 = -5t - c. Let g = -17754/581 + 70/83. Let j = g - -30. Is t at most as big as j? True Suppose 10 = -4x - x. Let n be (1x - -5)/1. Let g(z) = 3z3 + 2z*2 + z - 3. Let b be g(1). Is n smaller than b? False Let g = 1 - 0. Let y be g - ((3 - 0) + -2). Let l be 0(-4 + y + 3). Which is smaller: -1 or l? -1 Let z = -2.927 + -0.073. Is 3 != z? True Let p(o) = -o*2 - 7o + 4. Let c be p(-6). Let z be 2/(-16) + c/40. Is 1 at least as big as z? True Suppose 0 = 3s - 2s - 4. Let b be 2/s1/(-2). Let h be 3/9 - 1/(-6). Are b and h unequal? True Let m = -9.3 - -9. Let z = 0 + -0.4. Let y = z - m. Which is greater: y or 0? 0 Let o be 3(20/(-15))/2. Which is bigger: o or 7? 7 Let i = 8 - 6. Is 12/7 greater than or equal to i? False Let a be (-38)/(-8) + (-3)/(-12). Suppose -o = -ao - 4. Is -2 less than o? True Let o = -9 - -20. Is 0 greater than or equal to o? False Let r = 27 + -27. Let i be (-800)/410 + 2 + r. Which is smaller: i or 1? i Let d(u) be the first derivative of 2u3/3 + u2/2 + u - 1. Let v be d(-1). Which is smaller: v or 2/7? 2/7 Let q be ((-36)/408)/(((-45)/(-12))/5). Do q and 0 have the same value? False Let m = 109/5 - 629/30. Are 0 and m unequal? True Let y(d) = d*3 + 5d*2 + 4d + 2. Let a(b) = -b - 10. Let m be a(-6). Let p be y(m). Suppose 2s = -ps + 12. Are 3 and s equal? True Let v = -90 - -82. Which is bigger: 1/2 or v? 1/2 Let f be 3/(62/4). Suppose -k - f = -5. Suppose 2t - 8 = 3p + p, -5t = -2p + k. Which is smaller: -4 or p? -4 Let i be ((-18)/15)/((-4)/10). Suppose 0 = 4q - ia, -3q + 4a = q + 4. Which is smaller: q or 0? 0 Suppose v = -2b - 2 + 4, b + 3v - 11 = 0. Is -2/43 > b? True Let f = -2749/247 - -144/13. Is f at most as big as -1? False Let z = -1.1 + 0.9. Let p = 2 - 2. Let x = p - z. Is 1/5 greater than or equal to x? True Let s be 2 + (-2 - (-16)/4). Suppose 0 = -st - 7 - 9. Is t less than -4? False Suppose -4f = -5i + 23, 1 = 3f - 2i + 13. Let j be f/(-6) + 6/90. Which is greater: j or -1? j Let v = 39 + -40. Which is greater: v or -16/7? v Let r be (12/8)/((-1)/(-4)). Suppose 4h - r = 2. Let v(i) = -i3 + i2 + 2i. Let u be v(h). Which is smaller: u or -1? -1 Let y(o) = -o*3 - 5o*2 + 7o + 5. Let a = -22 - -16. Let m be y(a). Which is smaller: m or 2? m Suppose 0 = n + n - 4*b - 14, 0	{ "pile_set_name": "DM Mathematics" }
ween 8:11 PM and 10:43 PM? 152 How many minutes are there between 9:12 AM and 3:18 PM? 366 How many minutes are there between 3:17 PM and 1:41 AM? 624 How many minutes are there between 10:20 AM and 9:06 PM? 646 How many minutes are there between 4:33 PM and 4:01 AM? 688 How many minutes are there between 3:10 PM and 7:30 PM? 260 How many minutes are there between 1:07 PM and 12:10 AM? 663 How many minutes are there between 6:22 PM and 5:09 AM? 647 What is 652 minutes before 5:32 PM? 6:40 AM What is 139 minutes after 8:58 PM? 11:17 PM What is 293 minutes after 12:53 PM? 5:46 PM How many minutes are there between 4:19 PM and 3:47 AM? 688 What is 675 minutes after 6:45 PM? 6:00 AM How many minutes are there between 2:36 AM and 6:07 AM? 211 What is 197 minutes after 10:49 PM? 2:06 AM What is 418 minutes before 1:03 AM? 6:05 PM What is 207 minutes before 5:52 PM? 2:25 PM How many minutes are there between 7:08 AM and 12:39 PM? 331 What is 243 minutes after 5:58 PM? 10:01 PM What is 185 minutes after 2:14 AM? 5:19 AM How many minutes are there between 4:11 PM and 3:15 AM? 664 How many minutes are there between 9:20 PM and 6:00 AM? 520 What is 19 minutes before 8:29 PM? 8:10 PM How many minutes are there between 8:34 AM and 10:25 AM? 111 How many minutes are there between 6:41 PM and 1:50 AM? 429 How many minutes are there between 7:02 AM and 6:18 PM? 676 What is 665 minutes before 2:52 AM? 3:47 PM What is 274 minutes after 4:33 AM? 9:07 AM What is 53 minutes after 11:36 PM? 12:29 AM How many minutes are there between 2:04 PM and 1:16 AM? 672 How many minutes are there between 9:04 AM and 1:10 PM? 246 What is 103 minutes after 2:02 AM? 3:45 AM What is 309 minutes before 11:34 PM? 6:25 PM How many minutes are there between 9:10 AM and 9:05 PM? 715 How many minutes are there between 9:23 PM and 10:39 PM? 76 What is 374 minutes before 6:15 PM? 12:01 PM What is 345 minutes after 7:18 PM? 1:03 AM What is 204 minutes before 10:56 AM? 7:32 AM What is 508 minutes before 11:45 AM? 3:17 AM What is 546 minutes after 8:21 AM? 5:27 PM How many minutes are there between 2:51 AM and 4:20 AM? 89 What is 526 minutes before 7:48 PM? 11:02 AM What is 337 minutes before 10:51 PM? 5:14 PM How many minutes are there between 10:32 PM and 4:00 AM? 328 How many minutes are there between 9:26 AM and 1:46 PM? 260 How many minutes are there between 7:14 PM and 9:24 PM? 130 How many minutes are there between 3:15 PM and 7:54 PM? 279 What is 682 minutes before 1:34 PM? 2:12 AM How many minutes are there between 11:38 PM and 1:39 AM? 121 How many minutes are there between 10:55 AM and 4:12 PM? 317 How many minutes are there between 7:01 PM and 5:26 AM? 625 What is 82 minutes after 10:58 AM? 12:20 PM How many minutes are there between 11:05 PM and 2:10 AM? 185 What is 481 minutes after 9:12 PM? 5:13 AM What is 524 minutes after 4:09 PM? 12:53 AM How many minutes are there between 1:28 AM and 3:38 AM? 130 How many minutes are there between 2:45 PM and 12:28 AM? 583 How many minutes are there between 11:53 PM and 4:02 AM? 249 What is 92 minutes after 12:41 AM? 2:13 AM What is 154 minutes before 7:49 AM? 5:15 AM What is 298 minutes before 4:22 PM? 11:24 AM How many minutes are there between 2:41 PM and 3:35 PM? 54 How many minutes are there between 10:04 AM and 8:32 PM? 628 What is 353 minutes after 7:58 PM? 1:51 AM What is 391 minutes before 7:11 PM? 12:40 PM How many minutes are there between 11:57 PM and 12:07 AM? 10 How many minutes are there between 7:47 PM and 9:19 PM? 92 What is 385 minutes after 3:38 AM? 10:03 AM What is 27 minutes after 7:45 AM? 8:12 AM What is 4 minutes before 11:11 PM? 11:07 PM What is 295 minutes before 5:01 PM? 12:06 PM How many minutes are there between 1:42 PM and 10:10 PM? 508 What is 33 minutes after 3:23 PM? 3:56 PM What is 439 minutes before 2:39 PM? 7:20 AM How many minutes are there between 5:43 PM and 6:22 PM? 39 What is 643 minutes before 11:49 AM? 1:06 AM How many minutes are there between 2:21 AM and 8:46 AM? 385 What is 103 minutes after 7:07 AM? 8:50 AM How many minutes are there between 10:39 AM and 7:02 PM? 503 How many minutes are there between 12:55 PM and 3:28 PM? 153 What is 553 minutes before 6:02 AM? 8:49 PM What is 170 minutes before 3:51 AM? 1:01 AM How many minutes are there between 12:53 AM and 2:15 AM? 82 How many minutes are there between 7:09 AM and 7:51 AM? 42 What is 6 minutes after 7:19 AM? 7:25 AM How many minutes are there between 12:46 PM and 12:56 PM? 10 How many minutes are there between 8:06 AM and 3:53 PM? 467 How many minutes are there between 9:37 PM and 5:58 AM? 501 What is 243 minutes after 3:16 PM? 7:19 PM What is 421 minutes after 6:49 AM? 1:50 PM What is 231 minutes after 1:14 AM? 5:05 AM What is 700 minutes before 3:45 AM? 4:05 PM What is 458 minutes before 8:28 PM? 12:50 PM What is 558 minutes after 8:06 AM? 5:24 PM How many minutes are there between 2:08 PM and 7:25 PM? 317 How many minutes are there between 4:36 AM and 9:01 AM? 265 What is 243 minutes before 6:31 PM? 2:28 PM What is 538 minutes after 11:10 AM? 8:08 PM How many minutes are there between 5:19 AM and 7:53 AM? 154 What is 304 minutes after 5:10 PM? 10:14 PM How many minutes are there between 4:48 AM and 4:17 PM? 689 How many minutes are there between 5:08 AM and 2:26 PM? 558 What is 410 minutes after 7:09 AM? 1:59 PM How many minutes are there between 4:53 AM and 8:24 AM? 211 How many minutes are there between 8:56 PM and 1:21 AM? 265 What is 616 minutes before 11:21 PM? 1:05 PM What is 448 minutes after 1:52 AM? 9:20 AM What is 430 minutes after 7:17 PM? 2:27 AM What is 581 minutes after 7:33 AM? 5:14 PM How many minutes are there between 11:25 AM and 3:29 PM? 244 How many minutes are there between 5:50 AM and 9:04 AM? 194 How many minutes are there between 10:31 AM and 5:19 PM? 408 What is 634 minutes before 1:54 AM? 3:20 PM How many minutes are there between 4:11 AM and 4:53 AM? 42 What is 264 minutes before 6:16 PM? 1:52 PM What is 707 minutes after 5:02 PM? 4:49 AM How many minutes are there between 9:03 PM and 5:28 AM? 505 How many minutes are there between 6:31 PM and 9:55 PM? 204 How many minutes are there between 8:40 PM and 11:31 PM? 171 How many minutes are there between 8:31 PM and 4:09 AM? 458 How many minutes are there between 3:30 AM and 2:22 PM? 652 What is 354 minutes before 1:52 AM? 7:58 PM What is 152 minutes before 11:07 PM? 8:35 PM How many minutes are there between 10:00 AM and 4:26 PM? 386 How many minutes are there between 7:57 PM and 8:16 PM? 19 How many minutes are there between 11:05 AM and 1:41 PM? 156 How many minutes are there between 7:57 AM and 8:32 AM? 35 What is 289 minutes after 5:13 PM? 10:02 PM How many minutes are there between 6:22 AM and 9:14 AM? 172 What is 69 minutes before 4:05 PM? 2:56 PM What is 702 minutes before 3:51 AM? 4:09 PM What is 367 minutes before 4:30 PM? 10:23 AM What is 194 minutes before 1:10 PM? 9:56 AM What is 48 minutes after 1:50 AM? 2:38 AM What is 9 minutes after 2:27 AM? 2:36 AM What is 508 minutes before 11:26 AM? 2:58 AM What is 420 minutes after 12:03 PM? 7:03 PM How many minutes are there between 10:53 AM and 5:39 PM? 406 How many minutes are there between 5:11 AM and 3:28 PM? 617 What is 376 minutes before 12:31 AM? 6:15 PM What is 42 minutes before 1:00 AM? 12:18 AM How many minutes are there between 2:23 AM and 3:26 AM? 63 What is 145 minutes after 3:56 AM? 6:21 AM What is 354 minutes after 6:19 PM? 12:13 AM What is 611 minutes before 1:02 AM? 2:51 PM What is 681 minutes after 3:26 PM? 2:47 AM What is 243 minutes after 1:08 AM? 5:11 AM How many minutes are there between 3:04 AM and 1:09 PM? 605 How many minutes are there between 3:30 AM and 1:58 PM? 628 What is 641 minutes before 5:59 PM? 7:18 AM What is 25 minutes after 4:48 PM? 5:13 PM How many minutes are there between 4:03 PM and 9:45 PM? 342 What is 700 minutes before 6:29 AM? 6:49 PM What is 127 minutes before 3:21 PM? 1:14 PM How many minutes are there between 2:12 AM and 3:50 AM? 98 What is 681 minutes before 12:44 AM? 1:23 PM How many minutes are there between 3:27 AM and 1:24 PM? 597 How many minutes are there between 5:16 AM and 6:52 AM? 96 How many minutes are there between 11:48 AM and 12:44 PM? 56 What	{ "pile_set_name": "DM Mathematics" }
-3)/(-24)0. Which is the nearest to 2/5? (a) 0.1 (b) -4 (c) k a Suppose -w = -2s - 13, 0w = 4w + s - 34. Suppose 0 = -3n + w, 6z - z + 22 = 4n. Let c = 5/8 + 1/8. What is the nearest to 0 in -1/5, z, c? -1/5 Let g = -28 - -25. Let j = 75 + -73. Which is the nearest to -4? (a) 0.4 (b) j (c) g c Let u = 257 + -236.9. Let i = u + -20. Which is the closest to 2/3? (a) i (b) -1 (c) 0 a Let g = 969 + -972. Which is the nearest to -0.1? (a) -0.06 (b) 0.22 (c) g a Let h = -12.786 + 47.888. Let m = 0.102 - h. Which is the closest to 2/3? (a) m (b) 3/2 (c) -5 b Let s(m) = m - 1. Let h be s(6). What is the nearest to -1 in -2, h, 0.26? -2 Let m = -119.5 + 119.8. Which is the closest to 1? (a) m (b) 284 (c) 0 a Let o = 569.8 - 570. What is the nearest to -0.3 in -1, 2, o? o Let s = 2999/12 - 749/3. Which is the nearest to s? (a) -5 (b) 4/7 (c) -4 (d) 2.6 b Let t = 2.1 + -5. Let m = t + 3. Let l = -167 - -171. Which is the nearest to -1? (a) l (b) m (c) 2/15 b Let t be 10/(-12)38/95. Let n = 56 - 388/7. Which is the nearest to t? (a) 0.3 (b) 0.1 (c) n b Let u = 0.98 - -0.02. Let f be 4(-3)/((-48)/20). Suppose fl + v = 9, v + 2v = -l + 13. Which is the nearest to u? (a) -1/5 (b) l (c) -5 b Let d = -5.08 - -0.08. Let o = -8.16 + 8.36. Which is the closest to 2? (a) o (b) d (c) 1 c Let l = 43 + -43. Let m = l + -1. Suppose -h + 1 = -4. Which is the nearest to m? (a) 8 (b) 3 (c) h b Suppose 8k - 5 - 3 = 0. Let w = -0.2 - -0.5. Let o = -5574/17 + 328. Which is the closest to k? (a) o (b) w (c) -2 b Let q = -31 + 50. Let r = q + -18. What is the nearest to r in 1, 1/3, 0.2? 1 Suppose -12v + 24 = -4v. Suppose -vo + 3w + 6 = 0, -w - 9 = -4o + 4w. Which is the nearest to -6? (a) 0.2 (b) -5 (c) o b Suppose -4k - 40 = -q - q, 3k = 3q - 36. Let b be (-4)/(-6)(-6)/k. What is the closest to b in -0.3, 2/11, -2/17? 2/11 Let r = 713 - 632.8. Let t = 80 - r. What is the closest to t in -1, -0.7, -2/5? -2/5 Let p = -221.8 + 222. Which is the nearest to -1/2? (a) 100 (b) 2 (c) p (d) -3/8 d Let j = -2404/9 - -2410/9. Let q = 0.2 - 0.7. Which is the nearest to j? (a) -2 (b) q (c) -5 b Let l = 3 - 2. Suppose 5f - 59 = 2k, 0 = -5k - f - 0f - 134. Let v = -28 - k. Which is the nearest to 1/3? (a) l (b) v (c) 0 c Let v = -80 - -88.7. Let r = v + -7.7. What is the nearest to r in 5, -2/11, 0.2? 0.2 Let r = -0.231 + -0.169. Let i = 2.6 - 2.7. Let j = -4.6 + 5. Which is the closest to 2? (a) i (b) j (c) r b Let l = -312 - -316. What is the nearest to -2/5 in -5, -1/4, -1, l? -1/4 Let t = 18 + -22. Let y = -53 + 54. Which is the nearest to y? (a) t (b) -3/4 (c) -2/13 c Let n = -3 - -3/2. Let w = 216 + -212. Let x = -748/7 + 107. What is the nearest to 1/2 in x, n, w? x Suppose 5x = 15, 0 = 2r - 3x - 0x - 31. Let f be ((-3)/(-6))/(2/r). Let d = 2730 - 2728. Which is the nearest to -0.2? (a) d (b) -0.5 (c) f b Suppose 37r - 160 = -3r. What is the closest to 1/3 in r, -3/2, -2, 5? -3/2 Let j(u) = -3u + 26. Let k be j(8). Which is the nearest to -21? (a) 4 (b) k (c) 0.5 c Let f = 12283517/165 - 74446. Let s = f - -6/55. Which is the closest to -0.08? (a) 4/3 (b) s (c) 1 b Let i = 131/6 - 22. Let a = 297 - 297. What is the closest to a in i, -32/3, 0? 0 Suppose -18 = -3o + 3u - 6u, -2 = -o + u. What is the closest to 1/2 in o, -0.4, -14/9, 3? -0.4 Let k be (-4)/(((-20)/32)/(-5)). Let r = -35 - k. Which is the nearest to -1/2? (a) -2/7 (b) -0.4 (c) r b Suppose 13i - 35 - 108 = 0. Which is the nearest to 2/3? (a) -2 (b) -4 (c) 2/13 (d) i c Let l be (-228)/(-56)10/(-528). Let o = 1/176 + l. Let y = o + -3/7. Which is the nearest to y? (a) -4 (b) -0.4 (c) -0.2 b Let p = 5/24 - 3/40. Which is the nearest to 3? (a) 0 (b) p (c) -4 b Let n be 1(1 - 10/8). Let u = 3984 + -3983. Which is the closest to -2/7? (a) -0.4 (b) n (c) u b Let w = -51.3 - 13.7. Let j = w + 64.88. Which is the closest to j? (a) -1/2 (b) 2 (c) 0.5 a Let z = 2.9 + -2.9. Let m = 504 - 501. What is the nearest to -1/3 in z, m, -0.04? -0.04 Let o = 31 - 28. Let q be 2((-3)/(-11))/(-3). Which is the nearest to -0.04? (a) o (b) -0.2 (c) q c Let f be ((-9)/(-18))/((-21)/12). Which is the nearest to -0.1? (a) -1/5 (b) 0.2 (c) 10/9 (d) f a Let m = 0.4 - -1.6. Let f = -0.12 + 14.12. Let t = f - 11. Which is the nearest to m? (a) -3 (b) -1/10 (c) t c Let v be (-1)/((-14)/26) - 2. Which is the closest to 1/4? (a) v (b) -2 (c) -9 (d) -0.5 a Let o = 0.1 - -0.9. Let r = -1.1 + o. Let c = 13.3 + -12.3. What is the closest to -0.1 in -0.3, c, r? r Let t = -1.34 - 0.66. Which is the nearest to 0? (a) t (b) -2/7 (c) 59 b Suppose 4x = -4q - 20, -2x - 46 = 4q - 18. Which is the closest to -2/5? (a) 3 (b) q (c) 4/7 c Let n be (-52)/(-39)(-6)/(-4). What is the nearest to n in -2, 0, -0.04? 0 Let s = 19 - 21. Let v(t) = t3 - 5t*2 + t - 1. Let a be v(5). What is the nearest to s in -3/8, 3, a? -3/8 Let q = 0.2 - 0.3. Let o = 0.93 - 1.32. Let b = o + 0.29. What is the closest to b in q, 0.3, 0.2? q Let z = -23.1 + 27.1. Suppose -2n = -1 + 3. What is the nearest to n in 3, -0.05, z? -0.05 Let c be (-50)/(-136) + (-54)/459. What is the closest to c in 2, 8/3, 0.01? 0.01 Let k = 3 - 4. Let v = -118.2 + 118.1. Which is the nearest to k? (a) v (b) -2/3 (c) -0.5 b Let p = -6 - -4. Let k be 3/(-3 - 9/p). What is the closest to -2/7 in -3/7, k, 4? -3/7 Let h = -4.78 + -0.22. Let j = 13/36 - 1/9. Which is the closest to j? (a) h (b) 0.4 (c) -0.22 b Let x be (-21)/12 - -1 - (-3465)/2860. What is the nearest to 1/5 in 1/4, x, 4, 3? 1/4 Let p = -2361/7 + 338. Which is the nearest to -1/3? (a) 1/4 (b) 1 (c) p a Let d = 0.4 + 0.1. Let s = -2 + 3. Suppose -5r + 4 = -s. Which is the nearest to -0.1? (a) r (b) 2 (c) d c Let u = -0.8 - -0.7. Suppose 4m - 5s = 8, 0s + 2s + 2 = m. Suppose -2i = 4, mh = i + 3 + 3. What is the nearest to h in 3, u, -2? 3 Let d(v) = 48v - 293. Let a be d(7). What is the closest to 1/4 in a, 0.4, -0.2? 0.4 Let c = -64.2 - -64.561. Let a = -17.661 + c. Let j = -17 - a. What is the closest to -2 in j, 2/11, -4? -4 Let l be (60/56)/(-3 - (-916)/308). Let v = 42 + l. What is the nearest to 0 in v, 10, 4? v Let s = -7 - -41. Let h = 30 - s. Which is the nearest to -1? (a) h (b) 0.2 (c) 5 b Let y = -74/13 - -788/143. Which is the closest to 5? (a) -2/3 (b) y (c) -4 b Let l = -1.11 + -0.19. Let a = l - 0.7. Let c = 126 - 126. What is the closest to a in 2, -3, c? -3 Let a = 399 + -403. What is the closest to 1 in -0.4, 0.2, a, -2/7? 0.2 Let o = 23 - 18. Suppose -ot - 3 = -6t. Let c = 2/37 - -68/111. What is the nearest to 0 in 0.5, c, t? 0.5 Let f = -807 + 801. Which is the closest to 2? (a) f (b) 4/7 (c) 1.5 c Suppose -25i - 5j - 18 = -29i, -4i - 2 = 5j. What is the closest to i in -48, 0.4, 1/2? 1/2 Let j = 6.1 - -1.9. Let p = 11 - j. Let v be (4 - 0)/(-15 - -7 - -2). What is the closest to 0 in p, 3/8, v? 3/8 Let w be (-4)/(-8) + 325/(-2). Let n = w - -1456/9. Let h be 3/(-12)(-8)/(-3). Which is the nearest to -4? (a) h (b) 0.4 (c) n a Let d be (-8)/(-6)(-79)/316. What is the nearest to -0.1 in -28/17, 2/9, d? d Let z = 153 - 145. What is the nearest to 0 in -1, z, 5? -1 Let d = 8.99 + -9.19. Let g = 11 + -8. Which is the nearest to -0.2? (a) d (b) g (c) -2 a Let x = 2.2 + -2. Let z = -8767 - -8762. Which is the nearest to -0.1? (a) -4 (b) x (c) z b Suppose -4k + 7 = -v - 0v, 5v - 16 = 3k. Suppose 0i + i + 1 = vr, i - 2 = 2r. Which is the nearest to r? (a) 5/3 (b) -0.5 (c) 0.08 a Let w = 535 - 534.94. What is the closest to w in -3.9, 1/3, 2/3? 1/3 Let t = -0.28 + -0.02. Let a = -0.013 - -7.713. Let d = a - 9.7. What is the nearest to -6 in t, 1/2, d? d Let p be (18 - -2)/(-4) - -1. Let f be 172/(p/8-2). Let n = f - 863/5. Which is the closest to -2? (a) -1 (b) n (c) 0.1 a Let p be (2/3)/(4 + 39/(-9)). Let q be -2(39/(-12) + 3). What is the nearest to 1 in p, q, -4? q Let f = 16/43 - 58/387. Which is the closest to 0.1? (a) -0.08 (b) f (c) -4 (d) -0.1 b Let u be (-1 - -4) + (-46)/14. What is the nearest to 0 in -3, -2/15, u, 0.1? 0.1 Let n = 2/3537 + 2348/17685. What is the closest to n in -0.1, 0, -2/9, 3? 0 Let f = 0.195	{ "pile_set_name": "DM Mathematics" }
2/2 - 18476007j - 12310722 = 0. What is j? -2481, -2 Factor -4c*2 - 2252c - 13368. -4(c + 6)(c + 557) Solve 31x4/4 - 557x*3/2 + 1842x*2 + 12520x + 800 = 0. -4, -2/31, 20 Let -40s3/3 + 724s*2/9 - 340s/3 + 176/9 = 0. Calculate s. 1/5, 11/6, 4 Solve 2o3/19 - 544o*2/19 - 51040o/19 + 16262400/19 = 0 for o. -168, 220 Determine y, given that 2y4 - 5270y*3 - 111408y*2 - 382328y - 361216 = 0. -17, -2, 2656 Let 2k3/3 + 5120k*2/3 - 66958k/3 - 51460 = 0. Calculate k. -2573, -2, 15 Solve 2k2/3 + 298096k/3 + 11107653152/3 = 0 for k. -74524 Factor v*2 - 208586v + 10877029849. (v - 104293)*2 Factor 2u*3/5 + 342u*2/5 - 11948u/5 + 22512/5. 2(u - 28)(u - 2)(u + 201)/5 Determine z so that -z2 + 30037z + 120164 = 0. -4, 30041 Factor q*2/2 - 3313q + 19869/2. (q - 6623)(q - 3)/2 Determine k, given that 5k*2 - 2760k + 380880 = 0. 276 Factor -b*3 + 1397b*2 - 38528b + 268324. -(b - 1369)(b - 14)2 Factor p2/9 + 1531p/3 - 4594/9. (p - 1)(p + 4594)/9 Solve 2o*2 + 59144o = 0. -29572, 0 Solve -f*2 - 343f - 3006 = 0. -334, -9 Let 3j5/4 + 681j*4 + 201648j*3 + 36139095j*2/2 - 1652489667j/4 + 1504685079/2 = 0. What is j? -309, 2, 17 Factor -2r2/3 + 98r + 10208/3. -2(r - 176)(r + 29)/3 Factor -3u2 + 768u + 5523. -3(u - 263)(u + 7) Suppose 20q2 + 12415q + 9300 = 0. What is q? -620, -3/4 Let 94y4/9 + 626y*3/3 - 2014y*2/9 + 14y/3 = 0. What is y? -21, 0, 1/47, 1 Solve -z*2/4 - 1995z - 3980025 = 0. -3990 Find g such that 3g2 - 10176g = 0. 0, 3392 Determine i, given that i*2 + 3509i + 17520 = 0. -3504, -5 What is o in 7o5/3 - 22150o*4/3 + 17525389o*3/3 - 4983298o*2/3 - 17525396o/3 + 5005448/3 = 0? -1, 2/7, 1, 1582 Find u, given that 2u4 - 629u*3/3 + 16090u*2/3 + 1075u - 4500 = 0. -1, 5/6, 45, 60 Factor 5c2/4 + 2905c. 5c(c + 2324)/4 Suppose -2m3/19 - 290m*2/19 + 618m/19 + 4410/19 = 0. Calculate m. -147, -3, 5 Determine x, given that 2x4/19 - 1028x*3/19 + 9138x*2/19 - 24272x/19 + 16160/19 = 0. 1, 4, 505 Determine u, given that -32u5 + 620u*4 - 3236u*3 + 4968u*2 - 1440u = 0. 0, 3/8, 2, 5, 12 Find t, given that -18t5/17 - 1346t*4/17 + 3054t*3/17 - 1998t*2/17 + 308t/17 = 0. -77, 0, 2/9, 1 Solve -4w4 - 816w*3 - 2420w*2 - 1608w = 0 for w. -201, -2, -1, 0 Find x such that 225x5 - 365x*4 - 1235x*3 + 605x*2 + 1010x - 240 = 0. -8/5, -1, 2/9, 1, 3 Determine y, given that -4y3 + 33898y*2 - 71825624y + 35904338 = 0. 1/2, 4237 Factor 1682g2 + 1982g + 300. 2(g + 1)(841g + 150) Determine u, given that 3u*5 + 2394u*4 + 7110u*3 - 35832u*2 - 45225u + 71550 = 0. -795, -5, -2, 1, 3 Determine o so that -3o5/2 + 1761o*4/2 + 39957o*3/2 + 144639o*2/2 - 93177o = 0. -17, -6, 0, 1, 609 Determine i, given that -2i5/3 - 70i*4/3 + 1004i*3 - 21224i*2/3 - 24304i/3 = 0. -62, -1, 0, 14 Let 2a2/13 - 110a/13 - 62212/13 = 0. Calculate a. -151, 206 Factor 4s4 - 1280s*3 + 104928s*2 - 404480s + 399424. 4(s - 158)2(s - 2)*2 Solve -9m*3 + 94757m*2/5 - 67363m/5 + 1263 = 0. 1/9, 3/5, 2105 Let w*4/4 + 7w*3 - 961w*2/4 - 7w + 240 = 0. Calculate w. -48, -1, 1, 20 Solve -4r2/5 - 73196r/5 - 146376/5 = 0 for r. -18297, -2 Factor s*2/3 - 65729s/3 + 65728/3. (s - 65728)(s - 1)/3 What is t in -54t*4/19 - 12794t*3/19 - 24486t*2/19 - 10806t/19 + 940/19 = 0? -235, -1, 2/27 Find q, given that -4q2 + 45616q - 45612 = 0. 1, 11403 Determine x, given that -3x3 - 363x*2 - 2994x + 3360 = 0. -112, -10, 1 Suppose w*2 - 205320w + 10539075600 = 0. Calculate w. 102660 Factor 15u3 - 56755u*2 - 303095u - 94725. 5(u - 3789)(u + 5)(3u + 1) Find m, given that -2m4/15 + 62m*3 - 22774m*2/15 - 7902m/5 = 0. -1, 0, 27, 439 Factor h*5/9 - 112h*4/9 + 3457h*3/9 - 18134h*2/9 + 34556h/9 - 22472/9. (h - 53)*2(h - 2)*3/9 Factor 5q*3 + 700q*2 - 1415q + 710. 5(q - 1)2(q + 142) Determine a so that -12a5 + 339a*4 - 2319a*3 + 3765a*2 + 4275a = 0. -3/4, 0, 5, 19 Let 3t4/4 - 43185t*3 + 1243382517t*2/2 - 1243252965t + 2486419563/4 = 0. Calculate t. 1, 28789 Factor -p*2/5 - 21p/5 - 22. -(p + 10)(p + 11)/5 Factor -2u*3/19 + 632u*2/19 + 1914u/19. -2u(u - 319)(u + 3)/19 Factor -5u*3 + 385u*2 - 8620u + 59840. -5(u - 44)(u - 17)(u - 16) Determine t, given that 3t*2 + 229746t + 4398602043 = 0. -38291 Suppose n*3/5 - 472229n*2/5 - 944461n/5 - 472231/5 = 0. What is n? -1, 472231 Factor i*4/9 - 70i*3/9 - 533i*2/9 - 154i/3. i(i - 77)(i + 1)(i + 6)/9 Suppose -13k*2/5 + 69k/10 + 27/10 = 0. What is k? -9/26, 3 Suppose 15q5 + 30610q*4 - 194450q*3 + 30800q*2 + 194435q - 61410 = 0. Calculate q. -2047, -1, 1/3, 1, 6 Solve -t*4/3 - 92t*3/3 - 926t*2 - 8844t + 9801 = 0. -33, -27, 1 What is n in 3n5 + 245n*4 - 96n*3 - 1144n*2 + 336n + 656 = 0? -82, -2, -2/3, 1, 2 Suppose w*3/2 - 171w*2/2 + 1033w - 948 = 0. Calculate w. 1, 12, 158 Factor 4y3 + 984y*2 - 570780y + 49979792. 4(y - 151)2(y + 548) Find s such that 5s3 + 67840s*2 + 230045425s - 460362250 = 0. -6785, 2 Factor g*4 + 801g*3 + 109973g*2 - 21642981g - 21752154. (g - 106)(g + 1)(g + 453)*2 Find r such that 2r*4/25 - 662r*3/25 + 9492r*2/5 = 0. 0, 105, 226 Suppose -2z*3/3 + 232z*2/3 + 7462z/3 - 364364 = 0. What is z? -66, 91 Suppose 2d3/7 + 25796d*2/7 + 103142d/7 - 18420 = 0. What is d? -12894, -5, 1 Determine i, given that -2i2 - 55616i - 389214 = 0. -27801, -7 Factor -t*3/4 + 272t*2 + 7655t/4 + 5475/2. -(t - 1095)(t + 2)(t + 5)/4 Let 2436b4 - 740b*3 - 1648b*2 - 48b = 0. Calculate b. -2/3, -6/203, 0, 1 Factor 5f2/6 + 255f/2. 5f(f + 153)/6 Let -3t2/2 + 8679t + 34740 = 0. Calculate t. -4, 5790 Solve l*2/9 + 129962l/9 + 4222530361/9 = 0 for l. -64981 What is g in -244g4/5 - 2289g*3/5 - 1145g*2 - 1932g/5 - 32 = 0? -5, -4, -1/4, -8/61 Suppose -2k2/5 - 614k - 12120 = 0. What is k? -1515, -20 Factor -5m3/6 + 1337666m*2/3 - 357870600577m/6 + 71573906089/3. -(m - 267533)*2(5m - 2)/6 Factor 3c*4 - 138c*3 - 50325c*2 - 1875384c. 3c(c - 168)(c + 61)2 Factor j2/11 + 27j/11 - 90/11. (j - 3)(j + 30)/11 Let 2t*4/13 + 42t*3/13 - 482t*2/13 - 522t/13 = 0. What is t? -29, -1, 0, 9 Factor -2z2/13 + 7496z/13 + 75160/13. -2(z - 3758)(z + 10)/13 Let -s*3/9 + 4721s*2/9 + 9451s/3 + 4727 = 0. What is s? -3, 4727 Suppose 5p3 + 5300p*2 + 31620p = 0. Calculate p. -1054, -6, 0 What is o in 3o5 - 123o*4 + 1089o*3 - 2985o*2 + 300o + 4500 = 0? -1, 2, 5, 30 Determine n, given that 4n4/9 + 16772n*3/9 + 16760n*2/3 - 16n/9 - 67040/9 = 0. -4190, -2, 1 Factor 2o2 - 378o + 15748. 2(o - 127)(o - 62) Factor -7g2/2 + 3231g/2 - 922. -(g - 461)(7g - 4)/2 Find n such that -3n3 + 34380n2 = 0. 0, 11460 Suppose l4/2 - 337l3/2 - 680l*2 - 682l = 0. Calculate l. -2, 0, 341 Determine d so that -2d2/11 - 205168d/11 - 205166/11 = 0. -102583, -1 What is u in -2u5/5 + 434u*4 - 622908u*3/5 + 54328064u*2/5 - 106181824u/5 = 0? 0, 2, 196, 691 Factor -2k2/3 + 2950k/3. -2k(k - 1475)/3 Factor -y*3/10 - 441y*2/2 - 241995y/2 + 1221025/2. -(y - 5)(y + 1105)2/10 Factor s3/3 - 317s*2/3 + 3095s/3 - 7675/3. (s - 307)(s - 5)2/3 Determine a, given that -6a*5/7 + 6190a*4/7 + 252916a*3/7 - 24480a*2 = 0. -40, 0, 2/3, 1071 Factor -4d*2 - 6532d - 254880. -4(d + 40)(d + 1593) What is l in -2l4 + 682l*3 - 22066l*2 + 198254l - 176868 = 0? 1, 17, 306 Suppose -k*5/9 + 29k*4/9 + 283k*3/3 - 85k*2/9 - 2596k/9 - 188 = 0. Calculate k. -18, -1, 2, 47 Solve 9o5 + 96o*4 + 255o*3 - 60o*2 - 444o + 144 = 0 for o. -6, -4, -2, 1/3, 1 Suppose -8z3 - 211z*2/3 - 59z + 1390/3 = 0. What is z? -139/24, -5, 2 Solve y*5/4 + 263y*4/4 - 8331y*3/2 + 65371y*2 - 145366y - 214968 = 0. -318, -1, 4, 26 Factor 37m3/3 - 172m*2 + 1193m/3 + 22. (m - 11)(m - 3)(37m + 2)/3 Let 2z*3/11 - 180z*2 + 3954z/11 - 1976/11 = 0. What is z? 1, 988 What is u in -10u4 - 65u*3 + 490u*2 - 115u - 660 = 0? -11, -1, 3/2, 4 Suppose 5u3 + 6850u*2 + 3109440u + 467183520 = 0. Calculate	{ "pile_set_name": "DM Mathematics" }
- 5n2 + 3n - 8. Let r be a(-6). What is the highest common divisor of r and w? 10 Let o be (-142)/(-14) + (-7)/49. Calculate the highest common divisor of 10 and o. 10 Suppose -2s + 207 = -5g - 25, 3s - 371 = -4g. Let d be 211(-5)/(-10). What is the highest common factor of s and d? 11 Suppose 5h - 325 = o + 4o, 5o - 305 = -4h. Let q(z) = -11z - 1. Let s be q(-1). Calculate the greatest common divisor of h and s. 10 Suppose 0q + 4q - 650 = -2w, 4q - 3w - 675 = 0. Calculate the greatest common divisor of 15 and q. 15 Suppose -5n + 40 = 3s, 15 = n - 3n + 5s. Let f = -29 - -26. Let b = f + n. What is the greatest common divisor of 10 and b? 2 Let o = 791 + -527. Suppose 16r = 2r + 336. Calculate the highest common divisor of r and o. 24 Suppose 2q = -2q + 96. Suppose 15 = 4c - 49. Let v = q - c. What is the greatest common divisor of 56 and v? 8 Suppose -2c + 48 + 4 = 0. Let q be (-3)/(-2) + (-46)/(-4). Calculate the greatest common divisor of c and q. 13 Let t be (-4)/16 + 21/4. Suppose 5b + 3c = 234, -21 = -tc - 6. Let d = 7 - 2. Calculate the greatest common divisor of d and b. 5 Let n = 6 + -12. Let j be n/(-5)(-60)/(-18). Suppose jr - 16 = 28. Calculate the greatest common factor of r and 55. 11 Let p be 0/(-1 + 3 + -4) - -9. Calculate the greatest common divisor of 27 and p. 9 Let l = 9 + -7. Suppose -3o - lo + 2t + 90 = 0, 72 = 4o + 2t. Calculate the greatest common factor of o and 18. 18 Let b(a) = -a*2 - a + 3. Let q be b(0). Let r = q + 3. Suppose -2y + 3y - 6 = 0. Calculate the highest common divisor of y and r. 6 Let m = -13 + 21. Let t = -20 - -28. Calculate the highest common divisor of m and t. 8 Suppose -37 = -g - p, -4p - p - 175 = -4g. Suppose -26 = -3m + m - 4t, -4m + g = 4t. Let o = 919 + -842. Calculate the greatest common divisor of o and m. 7 Let z(o) = 3o - 7. Let w be z(5). Calculate the highest common divisor of 8 and w. 8 Let p(k) = -k*3 + 8k*2 - 6k - 4. Let n(z) = -z*2 + 4z + 4. Let g be n(3). Let h be p(g). What is the greatest common factor of 24 and h? 3 Let d = -61 - -232. Suppose 0 = -f - 5, -d = -4m - 4f - f. Let g = m - 7. What is the greatest common divisor of 28 and g? 14 Let d(p) = 2p - 3. Let r(j) = -j2 - 7j + 9. Let y(w) = -8d(w) - 3r(w). Let f be y(-6). Calculate the greatest common factor of f and 30. 15 Suppose 7i - 160 = -9i. Suppose 50 = t - 60. What is the highest common factor of t and i? 10 Suppose -w + 4 = 0, -3w + 4 = 2f - 4f. Suppose 0k + 5k = 3n + 41, -n - k - 11 = 0. Let i = n - -20. What is the greatest common factor of f and i? 4 Let l = -21 - -15. Let i(n) = -n. Let t be i(l). Let a(w) = -4w + 1. Let v be a(-2). Calculate the highest common divisor of v and t. 3 Let y be (-1 + 0)/((-3)/(-6)). Let a(x) = 22x*2 - 2x - 2. Let m be a(y). Let g be 18 - 0/(-2 + 0). What is the highest common divisor of m and g? 18 Let a be (4/3)/(14/21). Suppose 5h = w - 20, w - 7 - 7 = ah. What is the greatest common factor of 10 and w? 10 Let m = 187 + -77. Suppose 2g + 5y - 130 = -52, -3g + 3y = -138. Calculate the greatest common divisor of g and m. 22 Let d be (-1)/2(-1 - 3). Suppose 0 = dv - h - 10, 3h + 19 - 1 = 3v. Let y be (-79)/(-4) - (-7)/28. What is the greatest common factor of v and y? 4 Suppose 0h + h = 0. Suppose 4g = -hg + 36. Suppose -2w + 110 = -4j, -3j = 4w + 2j - 272. What is the highest common divisor of g and w? 9 Suppose -5i = -3o + 19, -i - o + 0 = -1. Let x(c) = -2c3 - 2c2 + c - 2. Let m be x(i). Calculate the highest common divisor of m and 16. 4 Let g = 20 - -12. Let u(j) = -j3 - 3j2 + 3j + 4. Let l be u(-4). Calculate the highest common factor of g and l. 8 Suppose -3b - z + 56 = -3z, -71 = -4b - z. Let v be 0 + 1 + 0 + 17. Let c = v + 0. Calculate the highest common factor of b and c. 18 Suppose -1 = 3t - 46. Suppose -4u + 923 - 263 = 0. Calculate the greatest common divisor of u and t. 15 Suppose 2m = 5m - 105. Let u = 26 - 12. Suppose g = -0g + u. What is the highest common divisor of m and g? 7 Let q(i) be the first derivative of -i*4/4 + 7i*3/3 + 4i*2 + 6i + 2. Let z be q(8). What is the greatest common factor of z and 3? 3 Suppose -j - 2j + 462 = -3q, 4j - 624 = 2q. Suppose 142 = 3m - j. Calculate the highest common divisor of m and 40. 20 Suppose 3j + 132 = 4v, -v + 1 = 4j - 32. What is the greatest common factor of v and 11? 11 Let u = 47 - 33. What is the highest common divisor of 14 and u? 14 Let m be (-3)/5 - (-392)/70. Calculate the greatest common factor of 3 and m. 1 Suppose -2j + 3k = -j - 234, -2j + 483 = -3k. Suppose 2z = -49 + j. Let r = -57 + 97. What is the greatest common divisor of r and z? 20 Let k(l) = l2 - l + 4. Let u be k(0). Let p(x) = -69 - 69 + 139 + 5x. Let o be p(u). What is the greatest common factor of 84 and o? 21 Let g(b) = b*2 + 5b - 10. Let o be g(-7). Let i = 9 - o. Suppose -2 = f + 4h, -2h + 0 = 5f - 8. What is the highest common divisor of f and i? 1 Suppose 2w + 9w = 220. Suppose -140 = -4n + 4k, k = 2n + 2n - 125. What is the greatest common divisor of n and w? 10 Suppose -27 - 1 = -2w. What is the greatest common divisor of 28 and w? 14 Let p be (-140)/(-8) + 1/2. Let z = 45 - p. Calculate the highest common divisor of 9 and z. 9 Suppose 2x + 4r - 60 = 0, 5x - 6r - 192 = -2r. What is the highest common factor of x and 4? 4 Suppose 0 = -3r + 2b + 168 + 44, 12 = -3b. Calculate the greatest common factor of 17 and r. 17 Let g(l) = -l*2 - 5l + 11. Let v be g(0). What is the highest common factor of 44 and v? 11 Let x = 0 - -1. Suppose 0 = u - 13 - x. Let d(g) = -11g - 1. Let i be d(-2). What is the greatest common divisor of i and u? 7 Let l be (1/(-2))/(23/(-276)). Calculate the highest common factor of 9 and l. 3 Let a be (-1)/(3/6 - 0). Let g be (2/(-4))/(a/64). Calculate the greatest common factor of g and 16. 16 Let c(k) be the first derivative of 10k*2 - 6k - 4. Let j be c(3). Let o(p) = p*2 - 4p - 3. Let m be o(-2). What is the highest common factor of m and j? 9 Let o = -4 + 6. Suppose 0 = oh + 10, -5u + 3h = -40. Let j = 24 - u. Calculate the greatest common divisor of j and 209. 19 Let w(j) be the first derivative of j4/2 - j2/2 - 2j - 4. Let b be w(2). Calculate the greatest common factor of b and 48. 12 Suppose 4z + z - 210 = 0. What is the greatest common factor of z and 378? 42 Let w be (-1)/6 - 402/(-36). Let j(g) = 10g*2 + g. Let u be j(5). Suppose u = 4o + 35. Calculate the greatest common factor of o and w. 11 Let r be (-465)/6(-112)/40. Calculate the highest common divisor of 31 and r. 31 Let b(q) = -18q. Let a(m) = m + 1. Let r(i) = 2a(i) + b(i). Let v be r(-4). What is the greatest common divisor of 44 and v? 22 Suppose -c - 4c = -120. What is the highest common divisor of c and 3? 3 Let y(c) = 2c3 + c2 - 2 - 5c*3 - c + 0c. Let n be y(2). Let u = n + 87. Calculate the greatest common factor of u and 42. 21 Suppose 6v = -0v + 48. Suppose k - 1 = 3. What is the highest common factor of v and k? 4 Let p = 41 - -22. Let v = 163 - p. Calculate the highest common divisor of v and 40. 20 Let i = -105 - -155. Let h = -32 + i. What is the greatest common divisor of 18 and h? 18 Let x = 24 + -3. Let v(f) = -f - 10. Let u be v(-10). Suppose u = -g - 4q - 17, 7 = -4g - 4q - 1. What is the greatest common factor of x and g? 3 Let l(d) be the first derivative of 5d*2 - d + 1. Suppose 3 - 28 = -5b. Let m be l(b). What is the greatest common factor of 7 and m? 7 Let p = 1 - -2. Let o be 6/(-4)(-3 - p). Suppose o + 3 = 2m. Calculate the greatest common factor of 48 and m. 6 Suppose -2a - 4y - 2 = 0, -56 = 4a - 2y - 2. Suppose 2z + 6 = 3o, -5o = -2z - 5 + 3. Let x = z - a. What is the greatest common divisor of x and 15? 5 Let l be (900/(-21))/5-7. Let i be (0/2)/(-6 + 4). Suppose i = o - 5 - 19. What is the greatest common factor of o and l? 12 Suppose i - 49 = 26. Suppose -i - 35 = -5g. Suppose -6r - 10 = -76. Calculate the highest common divisor of g and r. 11 Suppose 31 = 2o + 7. Calculate the greatest common factor of 96 and o. 12 Let v be (-18)/45 + 12/5. Let s be -2 + v(-33)/(-6). Let h be 1(2 + (-14)/(-2)). Calculate the	{ "pile_set_name": "DM Mathematics" }
est 10? 60 Let a = -199 + 198.999962. Round a to 4 decimal places. 0 Let r(c) = c*2 + 39c + 27550000. Let v be r(0). Round v to the nearest one million. 28000000 Let r = 76.09998239 - 76.1. Round r to 6 decimal places. -0.000018 Let u(v) = 8 + 0v - 2 + 2v - 5 - 2219997v2. Let h be u(-1). Let m be (-36)/54 + h/3. Round m to the nearest 100000. -700000 Let n = 0.151 + -67.651. Let j = n + 4.5. Let i = 57.6 + j. What is i rounded to zero dps? -5 Let o(m) = m2 - 10m + 11. Let d be o(9). Let b(q) = -10621q2 + 9868q*2 - 15047q*d. Let j be b(10). What is j rounded to the nearest 100000? -1600000 Let u be (-8)/(-6) + (-6980960)/(-3) + 12. Round u to the nearest ten thousand. 2330000 Let n = -0.205 - -0.20522. What is n rounded to five dps? 0.00022 Let y = -65.6 + 62.07. What is y rounded to 1 dp? -3.5 Let r = 3.3000079 - 3.3. What is r rounded to 6 dps? 0.000008 Let b = -8.3265 - -95.2695. Let k = b - 87. Let n = k + 0.028. Round n to 2 decimal places. -0.03 Let i(r) = -2r - 7. Let q be i(-9). Suppose 0 = -6l + ql + 3900. Round l to the nearest 100. -800 Let g = 11 + -42. Let b = g + 30.983. Let o = b - -0.01505. What is o rounded to four decimal places? -0.002 Let t = -0.24 - -0.295. Let h = 0.022 + -0.032. Let j = h + t. What is j rounded to two decimal places? 0.05 Let y be ((-2)/6)/((-1)/(-3))-2200000. Round y to the nearest one hundred thousand. 2200000 Let i = 12652.3867 - 12653. Round i to 1 decimal place. -0.6 Let i = 1788 - 1786.987. What is i rounded to 1 dp? 1 Let q = 484.0343 + -484. Let b = q + -0.034300271. What is b rounded to 7 dps? -0.0000003 Let n be (-5)/(-25) + (-928)/(-10). Suppose n - 1093 = 5j. What is j rounded to the nearest one thousand? 0 Let x = 0.07 + 0.93. Let b = 2 - x. Let a = b - 1.003. Round a to 2 decimal places. 0 Let d = -1400908471.9999782 + 1400908355. Let w = -117 - d. Round w to six decimal places. -0.000022 Let y = 734 + -733.999302. What is y rounded to 5 decimal places? 0.0007 Let y = 12.3 - 14. Let k = y + 1.1. Let u = -0.59999894 - k. Round u to seven decimal places. 0.0000011 Let n = 0.057119 - 5.056599. Let o = n - -5. Round o to four dps. 0.0005 Let z(p) = -7p2 - 4p + 4. Suppose -2j - 5n + 7 = 0, 8 = 4j + 3n - 13. Let b be z(j). Let a = b + 414. Round a to the nearest ten. 140 Let x = 14094.00015 + -14082. Let s = 12 - x. What is s rounded to four dps? -0.0002 Suppose 3s - 5i - 7736980 = 0, -12i - 10315988 = -4s - 9i. What is s rounded to the nearest 1000000? 3000000 Let i = 0.0447 - 0.04464495. What is i rounded to five decimal places? 0.00006 Let h = -801 + 799.882. Round h to 1 decimal place. -1.1 Let r be 0 - (4 + -8 + -133716285). Suppose -5z + 6716289 - r = 0. What is z rounded to the nearest 1000000? -25000000 Let m = 0.24304 - 0.04392. Let x = -0.221 - -0.421. Let f = x - m. What is f rounded to four decimal places? 0.0009 Let h = 311.779 + -312. Let j = h - -0.1846. What is j rounded to three dps? -0.036 Let r = -0.035 - -7.435. Let z = r + -7.4000134. Round z to 6 decimal places. -0.000013 Let x be 4/18 - 2/9. Suppose 0 = 3u - 5r - 1569, 5u - 4r + 8r - 2615 = x. Suppose 8323 = -3n + u. Round n to the nearest one thousand. -3000 Let x = -340.818 + -0.182. Let z = -265.1 - x. Let w = -70 + z. What is w rounded to zero dps? 6 Let y = 3330505.63800037 - 3330519.638. Let g = 14 + y. Round g to seven dps. 0.0000004 Let j = 1022.999998649 + -1023. Round j to seven decimal places. -0.0000014 Let f = 0.6 + -3.6. Let z = 113482 - 113479.00007. Let k = f + z. Round k to five dps. -0.00007 Let v = 1158 + -1130. Let k = 1478.2042 - 1450.2. Let m = k - v. Round m to three decimal places. 0.004 Let s = -869.7 + 779. Let t = 87 + s. What is t rounded to the nearest integer? -4 Let o(x) = -204x - 1. Let n be o(-4). Let c be (n/10)/(2/12). Let a = c - 346. What is a rounded to the nearest 10? 140 Let k = 54185008 - 36385008. What is k rounded to the nearest one million? 18000000 Let f = -0.554 + 0.88. Let q = -0.064 - f. Let s = 0.3959 + q. Round s to 3 decimal places. 0.006 Let k = -120 - -174. Suppose s = -0s + 1074. Let w be (360/k)/((-4)/s). What is w rounded to the nearest one hundred? -1800 Let o = 134 + -134.0365. Let n = 270.9635 - o. Let h = n + -271.000209. Round h to 5 dps. -0.00021 Suppose 0b + 4 = 2b. Suppose 0 = -bg - 0g + 10. Let l be -4 + (g - -1) - -579998. Round l to the nearest one hundred thousand. 600000 Let o be -1((-3)/1 - -7 - -694996). What is o rounded to the nearest one hundred thousand? -700000 Let c(q) = q3 - 13q*2 - 8q - 17. Let v be c(14). Let l = v - 40. Let y be 2400/(-9)375l. What is y rounded to the nearest 1000000? -3000000 Let p = -62.53 + 1.53. Let w = 61.00000074 + p. What is w rounded to seven decimal places? 0.0000007 Let x = 247.3108 + 0.0892. Round x to the nearest one hundred. 200 Let v = 4.4624 + -4.6. Round v to two decimal places. -0.14 Let u be -15000((-216)/(-10) - 14/35). Round u to the nearest 10000. -320000 Let u = 0.235601701 - 0.2356. Round u to 7 dps. 0.0000017 Let o = -25.618319 + 25.62. Round o to five dps. 0.00168 Let o = -59 - -65.73. What is o rounded to 1 dp? 6.7 Let o = 0.007999054 - 0.008. Round o to 7 decimal places. -0.0000009 Let j = -25.868969 + -155.130141. Let v = 181 + j. What is v rounded to four dps? 0.0009 Let i = -13362.006241 - -13362. Round i to 4 dps. -0.0062 Suppose 5k = -3b + k + 1, 4b - 3k - 18 = 0. Suppose 624000 = -4x + 5q, bx + 156000 = 2x + 4q. Round x to the nearest ten thousand. -160000 Let x(z) = -16z2 - 11z + 12. Let l be x(-7). Round l to the nearest ten. -700 Let k = -250 + 230.82. Let b = -0.12 + k. Round b to the nearest integer. -19 Let i = 1827.53 - 1842. Let r = i + 15.9. What is r rounded to 1 dp? 1.4 Let g = 31.9 + -30. Let q = g - -10.1. Let j = -10.4 + q. Round j to 0 dps. 2 Let i = -6.7 - -0.1. Let n = i - -6.022. What is n rounded to 1 decimal place? -0.6 Let s(m) = 9m3 + 2m + 1. Let d be s(-1). Let j = 13 + d. Suppose -2z - jz = -52000. Round z to the nearest one thousand. 10000 Let u = 22.198 - -0.002. Let h = -27 + u. Let a = h + 4.8042. Round a to 3 decimal places. 0.004 Let j = 0.8 + -0.855. Let p = -356367 + 356367.0550062. Let c = p + j. What is c rounded to 6 dps? 0.000006 Let r = 19 - 1. Let h = r + -18.000006. Round h to 5 decimal places. -0.00001 Suppose -7w = -4b - 3w - 156332, 8 = 2w. Suppose o - 40252 = 44827. Let k = b + o. Round k to the nearest ten thousand. 50000 Let f = 0.0637 - 0.0048. What is f rounded to three dps? 0.059 Let a = 17152774.923000008 + -17152775. Let i = 0.077 + a. Round i to 7 dps. 0 Let j = 9 - 9.12. Let s = j - 19.88. Let d = s + 19.9973. What is d rounded to three dps? -0.003 Let u(l) = 11l3 - l2. Let p be u(-1). Let z be 3(-8)/p - 0. Suppose -4d + 3a = 759994, 949994 = -3d - zd + 3a. Round d to the nearest ten thousand. -190000 Suppose 2b + 4 = -2l, 4l - b = -2b - 11. Let c be (-1)/6 + (1007285/30)/(-23). Let f be (c/l)/((-3)/(-900)). Round f to the nearest ten thousand. 150000 Let o = -2547.2072 + 2547. What is o rounded to one decimal place? -0.2 Let q = -0.021 + 20.021. Let n = q - 25. Let b = -5.2 - n. Round b to zero dps. 0 Let l = 2.78 - 3. Let x = 0.1 + 0.01. Let o = l + x. Round o to 1 decimal place. -0.1 Suppose -16 = 4x - 0. Let f be -2 + 2 + x + 30804. Suppose 2t - f = -2t. What is t rounded to the nearest one thousand? 8000 Let w = -179441 - -379766. Let v be 0/(0 - 7) + 133323 + 2. Let k = w - v. What is k rounded to the nearest ten thousand? 70000 Let c(g) = 12g2 + 8g - 44. Let b be c(7). What is b rounded to the nearest 100? 600 Let u = -0.0133 - 97.8867. What is u rounded to the nearest 10? -100 Let b = 49362936 + -49362957.999979. Let d = 22.47 - 0.47. Let w = b + d. What is w rounded to 5 decimal places? 0.00002 Let j = -132 + 73. Let i = j - -58.9999632. What is i rounded to 6 decimal places? -0.000037 Let l be -246603/(45/2500). Round l to the nearest 100000. -4100000 Suppose x = 4i - 29461, -2i - 2x = -6198 - 8530. Round i to the nearest one thousand. 7000 Suppose 4d = -2d + 1104. Let s = d - 56. Round s to the nearest 10. 130 Let g = -122 - -122.0000125. Round g to six decimal places. 0.000013 Let m = 213.978 + -214. What is m rounded to t	{ "pile_set_name": "DM Mathematics" }
6k + 26k. Solve -8 = kl + 2l for l. -1 Let x = -32339 + 33217. Solve -870s = -xs - 32 for s. -4 Suppose 126k - 19982 = -321k + 22483. Solve 16l + 111 - k = 0 for l. -1 Let d be (6/(-1))/(-1) + (-6)/(-66)33. Solve -29 = 19o + d for o. -2 Let i be 1/((-33)/22 - (-805)/546). Let r be (24/(-14))/(2/(-49)). Let m = r + i. Solve -h + 8 = -mh for h. -4 Suppose -q + 0q - 2 = 0, -k = 3q - 91. Let d = k + -97. Suppose df + 8f - 24 = 0. Solve -fs + 8 = 2 for s. 2 Let y(i) be the first derivative of i4/4 + i3 - i - 13. Let u be y(-2). Suppose -uv = -0v - 30. Solve -5t + v = -5 for t. 3 Let k(o) = -140o + 2535. Let x be k(18). Solve -13n = -xn + 6 for n. 3 Let i(j) = 28j*2 - 103j - 10. Let s(z) = -13z2 + 52z + 5. Let b(u) = 2i(u) + 5s(u). Let q be b(6). Solve qc = -33 + 13 for c. -4 Let l = 7328 - 7250. Solve 74a = la + 4 for a. -1 Let h(p) = -25p + 3. Let i(d) = 17d - 2. Let j(t) = -5h(t) - 7i(t). Let c be j(-7). Let z = c + 49. Solve 2m + z = 4m for m. 3 Let n be (3 + -2 - 1)6/12. Suppose 4b = -5o + 29, 5b - o + 0o = n. Let r be 112/24 + b/3. Solve -rm + 10m + 25 = 0 for m. -5 Suppose -15h + 571 - 376 = 0. Solve -h = -8n - 37 for n. -3 Let v = -6026 - -6066. Solve -26l - 56 = -vl for l. 4 Let p(z) = 34z + 5. Let i be p(5). Let x = 182 - i. Solve 0 = 3m - xm - 8 for m. -2 Suppose 15354 - 14922 = 12r. Solve 4 = -38i + ri for i. -2 Let m be (21/98 - 2/(-7))-6. Let z be (-9)/1(m + (-7)/(-3)). Let a be (4 + -1)-1 + 6. Solve zg + 12 = ag for g. -4 Let c = 1774 + -1157. Let d = 624 - c. Solve -d = z - 10 for z. 3 Let m = 8601 + -8563. Let k = 100 + -62. Solve -k + m = o for o. 0 Let u(v) = -v3 - 10v*2 + 10v + 1. Let j be u(-13). Suppose -324 - j = -18g. Solve -3i = -g + 36 for i. 1 Let r(d) = -4d3 - 4d*2 + 7d - 9. Let k(g) = g*3 + g + 1. Let z(i) = -3k(i) - r(i). Let f be z(-6). Let y be (4/(-6))/(2/f). Solve -yt + 6t = 8 for t. 2 Let b(y) be the third derivative of -23y2 + 0 - 1/4y*4 + 0y - 4y3. Let o be b(-5). Solve -3c - 15 + o = 0 for c. -3 Suppose -3u - 6t + 92 + 37 = 0, -3u + 5t = -173. Solve -6r = 27 - u for r. 4 Let k = -29 + 29. Let v be (k/(-2))/(-15 + 13). Suppose v = -8m - 0m. Solve 0 = -mg - 3g - 15 for g. -5 Suppose 6 = -g - 5n - 16, -5 = n. Suppose 0 = -5v + 5m - 52 + 607, -m + 585 = 5v. Let c = 118 - v. Solve -g = cl + 5 for l. -4 Let q be 30/(-35)(-56)/16. Suppose 5s - 302 = -qz, -2s - z + 122 = 1. Solve sw = 57w - 16 for w. -4 Let a(k) = -67k + 5. Let d be a(-1). Suppose 5i - 4m - 113 = 2i, 0 = 2i - m - d. Suppose g - 17 = -5q, 5q + 2g = 7g + i. Solve 7t = qt - 12 for t. -4 Suppose -265i = -h - 268i + 173, -16 = 2i. Solve 36l + h = 161 for l. -1 Let j(m) be the second derivative of -m5/20 + 25m*4/12 + 13m*3/3 + 3m*2/2 - 194m. Let q be j(26). Solve qc + 9 = 6c for c. 3 Suppose -16q + 2x + 70 = -15q, 5x = -5q + 395. Solve 0 = 4f - 64 + q for f. -3 Let g(x) = 25x - 175. Let s be g(7). Solve s = 19f + 2 + 36 for f. -2 Let v = 10 + -5. Let m be (-3)/(-15) - 1488/40. Let d = 47 + m. Solve vx + d + 15 = 0 for x. -5 Suppose 0 = w - j - 7, -4j = 2w - 5j - 12. Let p = 340 + -333. Solve 12 = po + w for o. 1 Let s be ((-11)/33)/(465/234 + -2). Let o = 135 + -88. Solve -o + s = 7k for k. -3 Let i(u) = -24u2 - 291u + 5. Let m be i(-12). Solve -6v - 41 = -m for v. 0 Let o(h) = -329h*2 - 415h + 1. Let y be o(-1). Solve -100 = 107j - yj for j. -5 Suppose 5o + 11 + 9 = 2j, -3j + 76 = 4o. Solve 35c - 40c + j = 0 for c. 4 Let w(d) = 10d + 5. Let n be w(11). Let a = n + -152. Let t be a/(-8) - 12/(-32). Solve -3v - t - 4 = 0 for v. -3 Let m be (0 - 6/(-36))-9-6. Let l(h) = -h3 - h2 - h - 1. Let y be l(-1). Solve -mz + 7z - 2 = y for z. -1 Suppose -11647 - 14852 = -203w + 6996. Solve -w + 165 = -2d for d. 0 Let o be (-189)/63-1(-4)/(-6). Suppose -u = d + u - 13, -3d = 2u - 51. Solve 17 - d = oh for h. -1 Let u = -206 - -220. Let n be (-8 + u)2 + -3 + 1. Solve ny - 13y = -15 for y. 5 Suppose 0 = 2r + 3i - 45, -5i - 462 = -5r - 412. Solve rl - 51 = 39 for l. 6 Let f(u) = -u3 + 21u*2 + 273u + 33. Let q be f(30). Solve 131p - qp + 16 = 0 for p. -2 Let a be ((-2)/8)/((-396)/6336). Let x(c) = c*3 - 5c*2 - 4c - 4. Let m be x(6). Let g = 11 - m. Solve -b = gb + a for b. -1 Let x be (7/(-14) - -1)(3 + -1). Let l(o) = 8o - 1. Let g be l(x). Solve -2 = -3v + g for v. 3 Suppose -107 + 83 = 4c, -5w + 45 = 5c. Solve 8k = 17 + w for k. 4 Suppose 120 = -37d + 67d. Suppose 0 = -4s - 3h + 116, -ds + 58 = -s - 5h. Solve -4p + 6 = s for p. -5 Let c be ((-4)/1)/((-2)/9186/1178). Solve -12z - 162 = -c for z. -4 Suppose 87x = 90x - 45. Let r be (12/(-16))/(3/(-12)). Suppose -2f + x = rf. Solve 0 = fh + 6 for h. -2 Suppose 40s - 14s - 2209 + 753 = 0. Solve 54p + 8 = sp for p. 4 Suppose -5f - m + 15 = 0, -5m + 6 = -f - 17. Let b = 224 + -206. Solve -b = -fr + 8r for r. -3 Let b(h) = h*3 - 25h*2 + h - 27. Let q = 24 - -1. Let t be b(q). Let z be 4/t-1 - (4 + -2). Solve -2i + zi = -4 for i. 2 Suppose -3b = -2b - 2z + 47, -b - 55 = 2z. Let n be (-6)/4 - b/6. Suppose -85 = -nf + 6. Solve 4w - 1 + f = 0 for w. -3 Suppose -6d + 3s - 8s + 3 = 0, 6 = -3d - 5s. Solve 21 = do + 39 for o. -6 Let p(b) = b*2 + 2b - 2. Suppose -2r + 7 = 4t - 13, 15 = 3t - r. Let i be p(t). Suppose 4l + 3d = i, -2l - 5d = -4l - 3. Solve w = lw + 10 for w. -2 Let m(y) be the third derivative of -20y*2 + 0y + 1/12y4 + 0 - 1/3y*3. Let t be m(2). Solve 0w - w = -t for w. 2 Suppose -25 = -5g + 65. Suppose 0 = -9w + 10w - 15. Suppose gh = wh + 6. Solve 0v + 10 = -hv for v. -5 Let f = -52 - -60. Suppose -fh + 12h - 20 = 0. Let j(g) = -2g*2 + 10g + 2. Let y be j(5). Solve ys + h = -5 for s. -5 Let h be 3 - (7 + -8 + 5). Let g be -3 + (9 + -17)/h. Solve 0 = 6v - g - 25 for v. 5 Let n be -10(-3)/(-4)60/(-50). Suppose n - 18 = -l. Suppose -3j + 3 - l = 3w, 3w = -j. Solve -4a = 19 + w for a. -5 Let w = 182 - 177. Solve -wz - 4z - 27 = 0 for z. -3 Suppose -3g + 92 = -4w, 4g - 197w + 192w = 121. Solve 231k - 227k = -g for k. -6 Suppose -3q + 15 = -2g, -3q - 2g = -g - 15. Solve -qx - 1 = -6x for x. 1 Let l(d) = 3d*2 + 4d - 19 + 4d2 + d3 - 3d. Let r be l(-6). Solve -ri + 15i = 12 for i. 3 Suppose -2b + 4u + 88 = 0, -5b - 292u + 291u = -198. Solve 0 = -bw - 4w + 264 for w. 6 Suppose s - 3s + 4 = 0. Suppose -2r + s = 2k, 0r - 3 = k + 5r. Suppose 2y - 13 + 9 = 0, 0 = -a - y + 5. Solve -au = -2u - k for u. 2 Let f = -12415 + 12442. Solve 10v - 19v = -f for v. 3 Let v(w) = 4w + 85. Let z = -104 - -86. Let i be v(z). Solve -1 = 3c - i for c. 4 Let d(y) = y2 - 8y - 161. Let x be d(18). Suppose 21 - x = f. Solve -h = h + f for h. -1 Let f = -304 + 323. Suppose 11r = -9r + 60. Solve f = -rx + 34 for x. 5 Let j(n) be the second derivative of -n5/20 + 13n*4/12 - 3n*3/2 - 8n*2 + 2n - 39. Let z be j(12). Solve 0 = 4r - 8r + z for r. 5 Suppose 27 = s - 4v + 2, -v = 4. Let g = 45 - 31. Suppose -gx + sx = -10. Solve 4 = xk - 6k for k. -1 Suppose -5s + 129 = 3a, -2s + 5a + 22 + 42 = 0. Let r = -4 - -7. Solve rh = -s + 24 for h. -1 Let k(c) = 3c2 - 7c + 3. Let a(r) = -2r2 + 6r - 3. Let j(l) = -4a(l) - 3k(l). Let u be j(0). Let f be -4 - (u - 0 - 9). Solve -fi - 10 = -4 for i. -3 Let q be 3/(54/8 + -6) - 192. Let o = -173 - q. Solve 0 = oi - 5i for i. 0 Suppose -3v - 1181 = -5g, -g = -3g + v + 472. Let q = g + -235. Solve 2b + b = q for b. 0 Suppose 53i + 35i - 90i = -130. Solve -58y = -iy for y. 0 Let i(m) = -9m + 3m*3 - 33m*2 - 3m2 - m2 - 14 + 15m2 - 6m*3. Let x be i(-7). Solve x = 4b + 4b + 32 for b. -4 Let g(f) = f3 + f2 - 8f - 9. Let h be 28/(-8) + (-3)/2. Let z be g(h). Let y = z - -69. Solve -5k + 8 - 13 = y for k. -1 Let u be (-18)/((-2)/(0 + 2)). Let m be (-6)/12(9/(-3) + -99). Suppose -54w + mw + 12 = 0. Solve 2 + u = -wr for r. -5 Let c(g) = 7g*2 + 3g - 12. Let b be c(5). Let m = 180 - b. Solve mo = -7 + 9 for o. 1 Let g(y) = -66y*2 + 276y + 14. Let k be g(4). Solve -16z = -kz - 230 for z. -5 Suppose 42h = 9h + 462. Solve	{ "pile_set_name": "DM Mathematics" }
- 145 = 10f - 12f. Suppose mw = 5w + 72. Solve 3j = 6, -j + wj + 21 = -5h for h. -5 Suppose -214012k + 266 = -213974k. Let u = -8 - -13. Suppose 0 = uz - 6 - 4. Solve -zq + 1 = -5i - 0q, -k = 2i - 3q for i. 1 Suppose 0 = 4o + y - 44, -46o = -41o - y - 46. Solve 2p - 2x + o = 0, -3 = 4x - 7 for p. -4 Let r be 0/((-10)/((-70)/(-21)) + 5). Let h(g) = 5g*3 - 2g*2 + 2. Let c be h(1). Solve rf + 2a + 13 = 3f, -cf = 5a - 5 for f. 3 Suppose 0 = -3n - n + 3d + 15, -5n = 4d - 11. Solve -nr + 3q = 0, -5r + 5q = q for r. 0 Let b = -282 + 284. Let f = -7 + 11. Let y = -292 + 306. Solve -k + 8 = -z, -fk + bz - 4z = -y for k. 5 Let s(v) be the third derivative of 0 - 7/24v*4 + 0v - 9v2 - 1/60v*5 + 2v*3. Let t be s(-8). Solve 4l + 12 = 4q - 8, tq - 20 = -2l for q. 5 Let n = 22 - 14. Let g = -101 + 100. Let w be g/(2/n)(12 + -13). Solve wv - 2r + 10 = 0, -2v + 4 = -6r + 2r for v. -4 Let r = -10174 - -10194. Solve -r = -4j, -i + j + 68 = 70 for i. 3 Suppose -123395 = 24h - 249h - 6620. Solve -518r = -hr - 2i - 7, 3i + 16 = 4r for r. 1 Suppose -251m + 203m = -240. Solve -4j - 9 = -5u, -36 = -4j - mu + 5 for j. 4 Suppose 5c = -b - 2b + 40, 0 = 3c - 4b + 5. Let o(s) = 3 + s2 + 11 + 2s + 2s + s. Let i be o(-4). Solve y + cr + i = 0, -r - r + 13 = -3y for y. -5 Let n = -6765 - -6767. Solve 4b = -m + 14, -nm + 5b - 9 - 2 = 0 for m. 2 Let g be ((-5)/(-15))/((-6)/(-72)). Suppose -4 = 5p + ga, 3p - 6a + 8a = -2. Solve 3l - y + 0y + 12 = p, 3 = 4l + 5y for l. -3 Let t be 9891/42(-4)/6. Let f = t + 157. Solve -2n = -fh + 2h - 8, -4 = -h + 4n for h. 4 Let p be (9/(-12))/((-3)/8). Suppose w + 3s - 32 = 0, -4w + 272s + 2 = 270s. Solve -2l + 16 = wi - 6, -pi + 7 = -l for l. 1 Let m = -70 + 68. Let o be 6/m((-20)/(-3))/(-4). Solve -ob + 6 = -3l, -4l - 2b = 3b + 8 for l. -2 Let f(p) = -2p*2 + 49p - 288. Let r be f(12). Solve 4w + r = 5n, n = -23w + 21w + 8 for w. 2 Let w(k) = k*2 - 17k - 57. Let s be w(11). Let q = 126 + s. Suppose j + 22 = 5g, 2 - 4 = -g + j. Solve -5c + h - 19 = 4h, -1 = gc - qh for c. -2 Let i be 896/336 + 2/(-3). Suppose ia + 12 = 5a. Solve 4x = ad - 20, x = -d + 1 + 2 for x. -1 Let k be 4 + -4 + 3 + 7. Let c be k/(-75) - 6/(-45). Suppose -3a + 2a = c. Solve 5s - 27 = 3v, av + 7 = -4v - 3s for v. -4 Let n(m) = -m*3 + 9m*2 + 11m + 2. Suppose -3z - 21 = -k, -2z + z - 5 = 0. Let f be 40/k6/4. Let v be n(f). Solve -s + 2 = -2s + q, v = -s - 4q for s. -4 Let c be (3/(-6))/(88/(-2816)). Solve 0 = -h + 5l + c, -l - 4 = -5h + 4h for h. 1 Suppose -1 = 4v + 7. Let g be v(-4)/(-8)6. Let x = g - -12. Solve -4n + 6 + 6 = 5k, 3n + x = 0 for k. 4 Let x(y) = -2y3 - 13y*2 + 6y - 2. Let q = 42 + -49. Let j be x(q). Let a = 17 - 12. Solve 2w + 7s - 2 = 2s, -js + a = 5w for w. 1 Let b(f) = f3 + 22f*2 - f + 1. Let o be b(-20). Let q = o - 818. Solve -d = 4p - 12, -5d - 24 = -2d - qp for d. -4 Let j be 8/(-32) - 52/(-16). Solve 0 = 3l + m - 0m - 7, jl - 4m + 13 = 0 for l. 1 Suppose -2y + u + 6 = 0, -u = -4y - 0u + 12. Suppose -yk = -2k - 22. Suppose 2a - k + 6 = 0. Solve -2i - 12 = 3z, 2z - 3i = -7i - a for z. -4 Let x = -15753 + 15756. Solve 5g = xd - 6, d + g + 2g = 2 for d. 2 Let d = 16 + -14. Let y = 6 - d. Suppose -3r + 35 = yr. Solve -s = -rq + 5, s = q - 2s - 15 for q. 0 Suppose -57 = b + 5u + 5, 4u + 61 = -b. Let v = -35 - b. Solve n = -5 - 0, v = -l - 4n for l. -2 Let s be (48/(-12))/((-48)/36). Let o(f) = f*3 + 4f*2 + 4. Let v = -15 - -11. Let n be o(v). Solve 0 = -a + 5y - s, na - 2y = 3y - 12 for a. -3 Suppose 4w + w - 8 = r, 10 = 2w + 3r. Let k be ((36/(-27))/2)/(w/(-48)). Solve -k = i + 4m, i + 4i + 11 = 3m for i. -4 Suppose -4m + 112 = 5b, 3m = m + b + 42. Let f be 56 + 4/(-3)63/42. Suppose 12k + 6k - f = 0. Solve -4n = -kc + 7 - m, -12 = -3n - c for n. 4 Let z be 187/(-7)4/(-6). Suppose -10y = -4s - 8y + z, 2s + 2y - 18 = 0. Solve 4h = 5o + 6h + 6, -4h - 2 = so for o. -2 Let o be (-4 + (-72)/(-15))(-195)/(-39). Solve oz = 5v - 7, 5v - 2v + 2z = -9 for v. -1 Let b(h) = 9h + 146. Let m be b(21). Let p = 339 - m. Solve 5f + p = -s, 2s + f + 0f = 1 for s. 1 Suppose 87l - 89l - 10 = -4n, 5n - 8 = -2l. Solve -z + 4o + 21 - n = 0, -3o - 15 = 0 for z. -1 Let f = -41681 - -41686. Solve 3t - 6 = 4w, -fw - 3t - 19 = -25 for w. 0 Let u(j) = -19j + 42. Let o(v) = 18v - 41. Let r(x) = -5o(x) - 4u(x). Let k be r(5). Let d = 34 + k. Solve 7 = -5c + b, -2 = 2c - b - d for c. -2 Let w(n) = n2 + 25n - 1169. Let q be w(24). Solve 4 = -2f + 2c, 2f + 0f - 5c = -q for f. -1 Let k be 4 - ((8 - 16) + 1/(5/35)). Solve -5h = -kg + 5, 4h + 9 = 25 for g. 5 Let k = -6255 + 6259. Solve -2r + 73 = s + 65, ks = -4r + 28 for r. 1 Let f(g) = -g2 - 69g + 3936. Let d be f(-106). Let r be 1 - (-5 + 2) - 2. Solve 6l - rl + 3 = -3b, -4b - 2l - d = 0 for b. -5 Let g be ((-1)/(-3) + 3)/((-9)/(-27)). Solve 4j - 4 = -13d + 9d, 4d - 2j = g for d. 2 Suppose s - 5p + 13 = 0, p - 7 = -12s + 10s. Solve 2d - 5b = -2d - 17, -sd = 3b + 3 for d. -3 Let s be ((-5)/(-11))/((-32)/(-352)). Solve d = 5n - 0n + 26, -2d - sn = 23 for d. 1 Suppose -u + 137 = 28. Suppose h = u - 46. Let x be h/15 - (-1)/(-5). Solve 5j = 5 - 0, 1 = -xv - 3j for v. -1 Let q = 123 - 76. Let x = -41 + q. Solve 2o + 0 = 4h - 2, 2o - 2h + x = 0 for o. -5 Let x be (-6)/4(2 + 4820/(-15)). Let a = x + -474. Solve 3m - 5d + a = 15, -m = -4d - 1 for m. 5 Suppose -20o - 55o - 11o = -430. Solve -418c + 415c + n = 20, 3c + on - 10 = 0 for c. -5 Let i(h) = -h*3 + 10h*2 + 117h + 4. Let f be i(17). Let o be 36/f30/(-18). Solve d + 3r - 2 + 3 = 0, -2d + 2 = or for d. 2 Let l be 1190/(-204) - (-1)/(-6) - -10. Let k = 7 + -3. Suppose 5d - 16 = k. Solve 15 = 5y + 2w - 16, -ly + 8 = -dw for y. 5 Let t(l) = -l2 - 296l + 1815. Let m be t(6). Solve -ma - 8 = 5k - 14, -2k - a + 2 = 0 for k. 0 Let c be (-2)/9 - (-9035)/117. Suppose -68 = 3l - c. Solve -lx - 3d - 2d = 7, 0 = 2d + 4 for x. 1 Let w = -81 + 87. Suppose -5 - w = -3a + d, -7 = -2a + d. Suppose 7k = b + 4k - 14, ab = -2k. Solve -bs + 7s - 12 = -2l, l = s - 1 for l. 1 Let q be -2 + 2/(-15) + -66(-98)/1260. Solve qf - 2o - 7 = 0, 11f - 20 = 6f + 5o for f. -1 Let f be (-84)/9814/(-6). Let l be 5(-2 - (f + -5)). Solve 7 = -lc + x, -2x = 3x - 10 for c. -1 Let r(q) = -25q + 379. Let a be r(15). Solve 5 = -l, 0 = -ao - 0l + 4l for o. -5 Suppose 3q = -5s + 145, 2q = -4s + s + 95. Let l be -42 + q - ((-9)/3 + 1). Solve -5f - a = -11 + 30, 4f + 3a + 13 = l for f. -4 Let y be 15 - (27/(-3) + 10)12. Solve 36k = -5s + 31k, -ys + 3k - 30 = 0 for s. -5 Let x = 52 + -67. Let y(o) = o2 + 17o + 4. Let z be y(x). Let t be (-25 - z) + (6 - 0)/2. Solve -ta = -5c + 4, -4a + 0c - 4 = -c for a. -1 Let h be -3(1 + (-15)/9). Let z = -139 + 144. Suppose -z + 1 = -hl. Solve -lm = -3i - m + 5, 0 = 4i + 4m + 4 for i. 1 Suppose 0 = 2a - 3a - 3b - 14, a + b = -16. Let i(j) = -j2 - 19j + 13. Let y be i(a). Let m = 65 - y. Solve -x = x + 2, -2x = 5w - m for w. 4 Suppose -278x + 236 = -160x. Solve 0 = 4n + 3q + 23, xq + 27 = -6n + n for n. -5 Suppose -11l + 12 = -7l. Suppose 0a + 30 = 5a - lx, 27 = 4a - 3x. Solve -m - 12 = 3m, -a = 3n + 3m for n. 2 Let w = 278 + -273. Let p be 1(w - 0/(-2)). Suppose 0r - 53 = -2x - r, 0 = -2x - 2r + 54. Solve x = pc + 2d - d, -15 = -2c - 5d for c. 5 Let g(y) = y3 + 8y*2 + 9y + 8. Let q be g(-7). Let m = q - 33. Let s = 42 + m. Solve -4 = 2f + sw - 2, -w = -5f + 12 for f. 2 Let x = -177 - -182. Suppose 3s + xh - 1 - 11 = 0, -4s + 16 = 5h. Solve 3q + 4 = sn - 0, -n + 5q = -1 for n. 1 Suppose 10 = 5k - 5c, -3c + 4c - 2 = 0. Let f = -114 + 90. Let m = f + 24. Solve -kq = m, -q = -2b - 4 - 4 for b. -4 Let r(l) = -5l3 - 215l*2 - l - 26. Let y be r(-43). Solve 12j - o + y = 17j, 5j = o + 23 for j. 4 Let c = -155 - -161. Let w(i) = 3i2 + i - 91. Let t be w(c). Solve 0 = -u + 4y - 5y + 1, 2y - t = 5u for u. -3 Let v(f) be the third derivative of -f*5/30 - 1	{ "pile_set_name": "DM Mathematics" }
4 = -h, -190 = 5u + 2n. Let x = u - -116. Calculate the greatest common factor of x and 10. 10 Let z(f) = -f*3 - 3f*2 + 19f + 129. Let k be z(-5). What is the greatest common divisor of k and 576? 12 Let b(p) = -558p - 384. Let d be b(-3). Calculate the greatest common divisor of d and 160. 10 Let u(a) = 488a + 13624. Let s be u(-27). Calculate the greatest common factor of 168 and s. 56 Let d be (-124 - -48)/(-42/716). What is the greatest common factor of d and 38? 38 Let a be (780/416)/((-3)/(-168)). Calculate the greatest common factor of a and 3129. 21 Let n = -144 - -235. Let p = 120 - n. Let y = p - 15. Calculate the greatest common divisor of 14 and y. 14 Let m = 61 + -61. Let s(r) = r3 - r2 + r + 49. Let a be s(m). Let d = a + -19. Calculate the greatest common divisor of d and 12. 6 Let n = -4630 - -4700. What is the greatest common divisor of n and 230? 10 Suppose 0 = 3f - 9 - 6. Suppose 5p + 5u + 5 = 765, 3p - 472 = fu. Calculate the highest common divisor of 7 and p. 7 Suppose 0 = 3m - 3x - 21, x = -3m - 2m + 65. Suppose z = p - 4z + m, 5p + 2z - 48 = 0. What is the highest common factor of p and 20? 4 Suppose -11j - 8294 = -59015. Suppose -j - 1716 = -37m. Calculate the highest common divisor of m and 9. 9 Suppose 6 + 99 = 3x. Let b = -289 - -290. Suppose b = r - 4. Calculate the highest common divisor of x and r. 5 Let z be 6 - (1 + (-2 - 2)). Let f = z + -6. Calculate the greatest common factor of f and 39. 3 Let p be 699200/2990 + (-2)/(-13). What is the greatest common divisor of p and 1092? 78 Let p(i) be the second derivative of -49i3/6 + i. Let g be p(-1). Suppose 28352 = 15338q - 79014. What is the greatest common divisor of g and q? 7 Suppose -3k + 23 = 8. Suppose -2t + 5m + 30 = -t, 210 = kt + 5m. Let n be -3 + (-18)/(-4) - 130/(-20). Calculate the highest common divisor of t and n. 8 Let v = 14 - -20. Suppose 0 = 5s + 4n - 6n - 164, 3n + 93 = 3s. Calculate the greatest common factor of s and v. 34 Suppose -73020 - 32282 + 17174 = -34m. Calculate the highest common factor of m and 405. 81 Let k be (-451 - -1)285/(-57). What is the highest common divisor of 36 and k? 18 Let l(w) = -w*2 - 8w - 5. Suppose 3t = 3, 4t + 31 = -0k - 5k. Let z be l(k). Let n = 1 + 1. What is the highest common factor of z and n? 2 Let k be -5(-16)/20 - 39. Let z = k - -125. Calculate the greatest common factor of 10 and z. 10 Let l = -379 + 631. Let z = -44 + l. Let o = z + -144. What is the greatest common divisor of o and 96? 32 Let s be (-16)/28 - 140/98 - -2161. What is the greatest common divisor of 127 and s? 127 Suppose 8x + 7 = x. Let k be (17 + -37)x/4. Let o be ((-14)/k)/((-24)/240). Calculate the greatest common divisor of 14 and o. 14 Let w(a) = 47a + 2092. Let v be w(-38). What is the greatest common factor of 1632 and v? 102 Suppose 0 = -5w + 44 + 16. Suppose -4t + 3f = -1212, t = -0t + f + 304. Let k = -276 + t. What is the highest common factor of k and w? 12 Let h be (-64)/(-6)(145/(-174))/((-30)/27). What is the greatest common factor of 3872 and h? 8 Suppose -46159 - 45191 = -79n - 124n. What is the highest common divisor of n and 1305? 45 Let h be 3/15 - (-268)/10. Suppose -4b = 2i + 300, -5i + 11 = 21. Let p = b - -77. What is the highest common divisor of p and h? 3 Let s be 47/(-282) + (-169)/(-6). Suppose 3m + 4o - 276 = 0, sm = 25m - 3o + 276. What is the greatest common divisor of 253 and m? 23 Let g = -8741 + 8853. What is the highest common factor of g and 1036? 28 Let g(u) = 16u*2 + 2u - 2. Let b be g(-3). Let y(r) = -r + 93. Let t be y(-9). What is the greatest common divisor of t and b? 34 Let x(d) = -15d - 60. Let v be x(-7). Let b be -161(v/(-35) - -1). Let g be 4/(-10) + (-117)/(-5). Calculate the greatest common factor of g and b. 23 Let d = 466 - 550. Let u be (-8)/d + 2508/126. What is the highest common divisor of u and 35? 5 Suppose 6w + 8w = 57w - 36765. Calculate the greatest common divisor of w and 551. 19 Let j(k) = 2k*3 - 16k*2 - 250k - 78. Let i be j(25). Calculate the highest common divisor of 36 and i. 18 Let f(m) = -3m + 90. Let a(q) = 16q + 171. Let j be a(-10). Let l be f(j). What is the greatest common divisor of l and 171? 57 Let b be 3906/56 + (-3)/(-12). Let o = -34 + 38. Let t = 10 + o. Calculate the greatest common factor of t and b. 14 Let o(h) = 6h + 14. Let m(z) = -3z - 7. Let x(q) = 9m(q) + 4o(q). Let y be x(-11). Suppose -3l = y - 86. Calculate the greatest common factor of l and 30. 10 Let w = -39 + 153. Suppose -3y + w = -3x, 2 - 8 = -3x. What is the greatest common divisor of 16 and y? 8 Suppose -7l + 11l - 647 = -f, 0 = l - 4f - 149. What is the highest common factor of l and 115? 23 Let l(g) = 2g*2 + 4g - 6. Let q be l(4). Let h be -20 + 40/4 - -72. Suppose -hc = -11c - 2142. What is the highest common factor of c and q? 42 Suppose 5o = -5s + 385, 3o + o = 5s + 263. What is the highest common factor of o and 80? 8 Suppose -l - 287 = 5b, b - 2l = 2b + 61. Let g = b - -61. Suppose -j + 24 = -2y, -gj - 25 = 3y - 77. Calculate the highest common divisor of j and 20. 4 Let f(a) = 18a2 + 37a + 46. Let y be f(-4). Calculate the highest common divisor of 14 and y. 2 Let c be 2 - (-20)/(-12)-3. Suppose 2i + 4h = 56, 3h = -ci + 4i + 93. Let f be 1715/104. Calculate the greatest common divisor of i and f. 34 Let o be 22 + (-200)/80(2/(-10) - -1). What is the greatest common divisor of o and 448? 4 Suppose 7k = 10k - 42. Let u be 2/2 + 0/k. Let r be 5 + 100 - u(4 + -1). What is the highest common factor of 34 and r? 34 Let b be (-64)/(2(-1)/8). Let q(p) = 498p + 7004. Let y be q(-14). What is the greatest common divisor of b and y? 32 Let j be 12-2(-2)/(-20)60775/(-442). What is the highest common factor of j and 720? 30 Let g be ((-1)/(-4))/((-6)/(-24))10. Suppose -gw + w + 1485 = 0. Let z(n) = n3 + 2n*2 - 1. Let d be z(2). What is the highest common factor of w and d? 15 Suppose -330w = -333w + 2436. Calculate the greatest common factor of w and 28. 28 Suppose -2v + 4v + 8 = 4c, -4c = -4v - 12. Let t be v - (28/(-4) + (1 - 5)). What is the highest common factor of 9 and t? 9 Suppose -t - 132 = -3q, 97q + 4t = 94q + 162. Let s be (-2572)/(-14) - (-4)/14. What is the highest common factor of s and q? 46 Let p be 25662/658 - ((-148)/(-14) - 6/(-14)). Suppose 4o + 0o + 124 = 0. Let d be o/(-4) - 1/(-4). Calculate the highest common factor of d and p. 4 Suppose -2z = -b - 2 + 1, 0 = 3b - 9. Suppose 0 = 34a - 37a + 90. Calculate the greatest common factor of z and a. 2 Let t(q) = -34q3 + q2 + 168q + 1202. Let u be t(-8). Calculate the greatest common divisor of 10 and u. 10 Let x be -2(-3)/(-2)(-3 + 4). Let a be 6(-10)/18x. Calculate the highest common divisor of 5 and a. 5 Let l be 1/((60/(-414))/(-10)). Let f = l - -246. Calculate the highest common divisor of 21 and f. 21 Let f be -6(-22)/(-4)-14. Let t(y) = 2y2 - 9y - 15. Let v be t(12). Let n be v/4 - 45/(-60). Calculate the greatest common factor of f and n. 42 Let x be (42/7)/(-2 - -4). Suppose 5p - 1160 = -g - g, xp - 697 = -g. What is the highest common divisor of p and 18? 18 Let t = 130 + -125. Suppose 6g = g + 125. Calculate the highest common divisor of t and g. 5 Let a be -7 + (-16980)/(-6) - 7. What is the highest common divisor of 16 and a? 16 Let d be (3/(-7))/((-117)/593775). Calculate the greatest common factor of d and 300. 75 Let c(p) = -21p - 6. Let s = 13 - 9. Let k be ((-40)/50)/(s/10). Let l be c(k). What is the greatest common factor of l and 4? 4 Let j(k) = -10k - 724. Let u be j(-74). What is the greatest common factor of u and 32? 16 Let p be (-12 + 5 - (-60)/4) + 1326. What is the highest common factor of p and 322? 46 Let n = 23036 + -22912. Let r be (-940)/6(-18)/15. Let i be r/6 - (-5)/(-15). Calculate the highest common factor of i and n. 31 Suppose -35z + 3574 - 1275 = 174z. Let d be (-1)/4 + (-2115)/(-12). What is the greatest common divisor of d and z? 11 Let c be (2/4)/((-1)/2) - -1. Suppose c = v - 12 - 38. Suppose -4h = -v + 2. Calculate the highest common factor of 108 and h. 12 Suppose -t = -3t - 12t. Suppose -13h + 633	{ "pile_set_name": "DM Mathematics" }
08, 33017, 41426, 49835? 8409g - 619 What is the o'th term of 207, 395, 569, 723, 851, 947? -o3 - o2 + 198o + 11 What is the o'th term of -1505, -1508, -1513, -1520, -1529, -1540, -1553? -o2 - 1504 What is the f'th term of 149540, 299078, 448604, 598112, 747596? -f3 + 149545f - 4 What is the l'th term of 94943, 189889, 284835, 379781, 474727? 94946l - 3 What is the y'th term of -504, -436, -322, -162, 44, 296? 23y2 - y - 526 What is the m'th term of 2368, 2362, 2354, 2344? -m2 - 3m + 2372 What is the s'th term of 2379, 2401, 2445, 2523, 2647, 2829, 3081, 3415? 2s3 - s2 + 11s + 2367 What is the l'th term of 1071, 4169, 9297, 16455, 25643, 36861? 1015l2 + 53l + 3 What is the g'th term of 1574747, 3149510, 4724271, 6299030, 7873787, 9448542, 11023295? -g*2 + 1574766g - 18 What is the n'th term of -400, -653, -1074, -1663, -2420, -3345? -84n2 - n - 315 What is the w'th term of 5073, 10141, 15209, 20277? 5068w + 5 What is the w'th term of 456, 488, 520, 552, 584? 32w + 424 What is the k'th term of -5725, -11383, -17039, -22693? k2 - 5661k - 65 What is the a'th term of -892, -865, -816, -733, -604, -417, -160? 2a3 - a2 + 16a - 909 What is the w'th term of -1187, -2301, -3415, -4529, -5643, -6757? -1114w - 73 What is the a'th term of -44357, -44356, -44353, -44348, -44341, -44332, -44321? a2 - 2a - 44356 What is the m'th term of 595, 727, 847, 943, 1003, 1015? -2m3 + 6m*2 + 128m + 463 What is the h'th term of 255, 524, 793, 1068, 1355, 1660, 1989? h*3 - 6h*2 + 280h - 20 What is the r'th term of 1769, 1775, 1785, 1799? 2r2 + 1767 What is the q'th term of -6791, -6804, -6821, -6842? -2q*2 - 7q - 6782 What is the t'th term of -1338, -1410, -1480, -1548, -1614? t*2 - 75t - 1264 What is the q'th term of 691, 1620, 3177, 5368, 8199, 11676, 15805, 20592? q*3 + 308q*2 - 2q + 384 What is the x'th term of -13729, -13734, -13729, -13708, -13665, -13594, -13489? x3 - x2 - 9x - 13720 What is the c'th term of 776, 3032, 6806, 12098, 18908, 27236, 37082? 759c*2 - 21c + 38 What is the z'th term of 507, 668, 837, 1014, 1199, 1392? 4z2 + 149z + 354 What is the i'th term of 216, 890, 2028, 3636, 5720, 8286, 11340? i*3 + 226i*2 - 11i What is the b'th term of 1040, 896, 752? -144b + 1184 What is the a'th term of -199, -432, -665, -898, -1131, -1364? -233a + 34 What is the k'th term of -841917, -1683831, -2525747, -3367665, -4209585, -5051507? -k*2 - 841911k - 5 What is the v'th term of -4228, -8465, -12702, -16939? -4237v + 9 What is the o'th term of -3764, -7528, -11292, -15056? -3764o What is the t'th term of 100, 124, 156, 196, 244? 4t2 + 12t + 84 What is the p'th term of -2589, -4307, -6029, -7755, -9485? -2p2 - 1712p - 875 What is the d'th term of -147094, -147103, -147124, -147163, -147226? -d*3 - 2d - 147091 What is the l'th term of -745128, -1490260, -2235396, -2980536, -3725680? -2l2 - 745126l What is the n'th term of 403490, 403484, 403480, 403478, 403478? n*2 - 9n + 403498 What is the o'th term of -6249, -12546, -18887, -25272, -31701? -22o2 - 6231o + 4 What is the g'th term of -109, -322, -601, -934, -1309, -1714? 2g3 - 45g*2 - 92g + 26 What is the a'th term of 80, 387, 898, 1607, 2508, 3595, 4862, 6303? -a*3 + 108a*2 - 10a - 17 What is the u'th term of -1278, -4916, -10980, -19470? -1213u2 + u - 66 What is the y'th term of -145, -190, -151, 14, 347, 890? 7y*3 - 94y - 58 What is the o'th term of 13229, 13228, 13227? -o + 13230 What is the v'th term of -98, -103, -28, 121, 338? -v*3 + 46v*2 - 136v - 7 What is the n'th term of -326, -696, -1054, -1394, -1710, -1996, -2246? n*3 - 377n + 50 What is the h'th term of -168642, -168639, -168624, -168591, -168534, -168447, -168324, -168159? h*3 - 4h - 168639 What is the o'th term of 152, -33, -232, -451, -696? -o3 - o2 - 175o + 329 What is the r'th term of 1477549, 1477545, 1477541, 1477537? -4r + 1477553 What is the k'th term of 355, 736, 1127, 1528, 1939? 5k2 + 366k - 16 What is the l'th term of 2852, 5615, 8378, 11141? 2763l + 89 What is the v'th term of 15, -656, -1775, -3342? -224v*2 + v + 238 What is the v'th term of 8700326, 8700325, 8700324, 8700323, 8700322, 8700321? -v + 8700327 What is the s'th term of -655, -1263, -1871, -2479? -608s - 47 What is the d'th term of -785, -811, -837, -863, -889? -26d - 759 What is the u'th term of 780, 1575, 2366, 3141, 3888? -2u*3 + 10u*2 + 779u - 7 What is the o'th term of -1972, -1901, -1754, -1495, -1088, -497? 6o3 + 2o*2 + 23o - 2003 What is the z'th term of -744, -2997, -6744, -11979, -18696, -26889, -36552, -47679? z*3 - 753z2 - z + 9 What is the b'th term of 60969, 60970, 60971, 60972? b + 60968 What is the w'th term of -24381, -23266, -22161, -21072, -20005, -18966? -w3 + w*2 + 1119w - 25500 What is the n'th term of -2103, -2097, -2083, -2055, -2007, -1933, -1827? n*3 - 2n*2 + 5n - 2107 What is the c'th term of -2813, -5698, -8665, -11720, -14869, -18118? -c*3 - 35c*2 - 2773c - 4 What is the x'th term of -100950, -403810, -908584, -1615278, -2523898, -3634450, -4946940? -x*3 - 100951x*2 + 2 What is the d'th term of -51690, -51672, -51654, -51636, -51618, -51600? 18d - 51708 What is the o'th term of -5295, -21190, -47683, -84774? -5299o2 + 2o + 2 What is the m'th term of 9420, 18840, 28258, 37674? -m*2 + 9423m - 2 What is the p'th term of -1862, -1841, -1820, -1799, -1778, -1757? 21p - 1883 What is the q'th term of 85152, 340606, 766362, 1362420, 2128780, 3065442? 85151q*2 + q What is the s'th term of 4034, 8102, 12170? 4068s - 34 What is the h'th term of 441, 1275, 2093, 2889, 3657, 4391, 5085? -h*3 - 2h*2 + 847h - 403 What is the y'th term of -520, -978, -1786, -2980, -4596? -6y3 - 139y*2 + y - 376 What is the r'th term of -120, -251, -364, -459, -536, -595? 9r*2 - 158r + 29 What is the g'th term of 71, 224, 639, 1448, 2783, 4776, 7559, 11264? 22g3 - g2 + 2g + 48 What is the o'th term of -29767, -29765, -29753, -29725, -29675, -29597, -29485, -29333? o3 - o2 - 2o - 29765 What is the v'th term of 3464, 3452, 3424, 3374, 3296, 3184, 3032, 2834? -v3 - 2v*2 + v + 3466 What is the r'th term of 8013, 32072, 72171, 128310, 200489, 288708, 392967? 8020r*2 - r - 6 What is the t'th term of -11100, -22046, -32988, -43926? 2t*2 - 10952t - 150 What is the g'th term of -303, -247, -195, -147, -103? -2g2 + 62g - 363 What is the n'th term of -7750, -30233, -67704, -120163? -7494n2 - n - 255 What is the t'th term of -3035, -6104, -9173, -12242, -15311? -3069t + 34 What is the n'th term of -13689, -13692, -13695, -13698, -13701, -13704? -3n - 13686 What is the h'th term of 638, 1082, 1544, 2030, 2546, 3098, 3692, 4334? h3 + 3h*2 + 428h + 206 What is the z'th term of 10385539, 10385545, 10385555, 10385569, 10385587, 10385609, 10385635? 2z2 + 10385537 What is the w'th term of -271, -519, -745, -943, -1107, -1231, -1309, -1335? w3 + 5w*2 - 270w - 7 What is the v'th term of 11902, 11904, 11908, 11914? v2 - v + 11902 What is the w'th term of -326989, -326992, -326997, -327004? -w2 - 326988 What is the x'th term of 1402, 1515, 1628, 1741, 1854, 1967? 113x + 1289 What is the y'th term of -2328, -2207, -2008, -1731? 39y*2 + 4y - 2371 What is the z'th term of 49795, 49797, 49799, 49801, 49803, 49805? 2z + 49793 What is the a'th term of 281, -27, -333, -643, -963, -1299? -a3 + 7a*2 - 322a + 597 What is the j'th term of -79925, -79930, -79947, -79982, -80041, -80130? -j*3 + 2j - 79926 What is the k'th term of -1804, -2293, -3108, -4249, -5716? -163k2 - 1641 What is the k'th term of 498712, 498711, 498710, 498709, 498708? -k + 498713 What is the u'th term of 12226, 12146, 12080, 12034, 12014, 12026, 12076? u3 + u2 - 90u + 12314 What is the g'th term of 26, -732, -2796, -6820, -13458, -23364, -37192, -55596? -109g3 + g2 + 2g + 132 What is the s'th term of -57860, -57859, -57844, -57803, -57724? 2s3 - 5s*2 + 2s - 57859 What is the a'th term of 888, 489, 88, -315, -720? -a*2 - 396a + 1285 What is the f'th term of -159468, -159467, -159466, -159465? f - 159469 What is the s'th term of 1886, 3772, 5658? 1886*s What i	{ "pile_set_name": "DM Mathematics" }
ppose 44 = -4p + 8p. Suppose 4i + p = 43. Let n = 10 + -2. What is the greatest common factor of i and n? 8 Let f(t) = -t3 + 2t*2 + 2t + 2. Let y be (-15)/(-4) - 3/4. Let z be f(y). Let b be 3 - (1 - z/1). Calculate the highest common factor of 7 and b. 1 Let r = 3 - 0. Suppose 13 = rj - 17. Suppose -5s = -25, 30 = 5m - s + 5s. What is the highest common divisor of m and j? 2 Let a be (33/2 - 6)(-20)/(-15). Calculate the greatest common divisor of 266 and a. 14 Let d(v) = v3 + 11v*2 - v - 5. Let z be 4/(-6)99/6. Let x be d(z). Calculate the highest common factor of 3 and x. 3 Suppose -84 = -3t - f, 2f + 2f = 3t - 84. Calculate the highest common divisor of 35 and t. 7 Let t(i) = -i3 - i2 + 32i + 20. Let a be t(0). Calculate the highest common factor of 2460 and a. 20 Suppose 4c + 102 = 342. Let w = 94 - c. What is the highest common divisor of w and 272? 34 Let c = -3 - -4. Let b be (c/(-2)0)/2. Suppose -2i + 58 + 118 = b. Calculate the highest common divisor of 8 and i. 8 Let l = -422 + 854. What is the highest common factor of l and 135? 27 Let x = 65 + -60. Suppose 4h - q = 153, 9h = xh + 2q + 150. What is the greatest common divisor of h and 312? 39 Let o(p) = -p*3 + 24p*2 - 22p - 21. Let d be o(21). Calculate the greatest common factor of 12 and d. 12 Let k = 592 - 528. Calculate the greatest common factor of 64 and k. 64 Suppose -22t + 3086 = -29078. Calculate the greatest common factor of t and 86. 86 Let n be 2 - (-2 + -30 - 2). Suppose -738 = -36g - 5g. Calculate the greatest common factor of n and g. 18 Suppose r - 20 = k, -r - 4k = -4r + 59. Let s(j) = -j3 + 17j*2 + 7j - 35. Let v be s(17). Calculate the greatest common factor of r and v. 21 Let d(j) = j + 2. Let k be d(3). Let s(q) = q2 - q3 - 1 - 2q + 5q*2 - 4 + 0q*2. Let b be s(k). Calculate the greatest common factor of 80 and b. 10 Let s = -19 - -24. Suppose 0 = 3j + sd - 515, -173 - 12 = -j + 5d. Suppose 0 = 3q, -6k - 2q = -k - j. Calculate the greatest common factor of k and 14. 7 Suppose 3z = -3x + 627, -z - 31x = -28x - 213. Calculate the highest common factor of z and 9. 9 Suppose 3l + 4 - 19 = 0. Suppose -d + lw + 606 = 0, -3d + 5w + 1808 = -0d. Suppose -169 = 4o - d. Calculate the highest common factor of 27 and o. 27 Suppose 17b = 18b - 51. Calculate the highest common divisor of b and 289. 17 Let u be (1 + 58/4)2. Let c = 343 - 2. Calculate the highest common divisor of u and c. 31 Suppose u - 36 = -4c + 4, 155 = 5u + 5c. Suppose y - 3 = -r - y, 0 = -5r + 3y + u. Let h = -2 + r. Calculate the highest common factor of h and 21. 3 Suppose 0 = -12w + 215 + 73. Calculate the greatest common factor of w and 68. 4 Let s(r) be the second derivative of 13/2r2 - 5/6r*4 - 7r + 0 - 3/2r3 - 1/20r5. Let h be s(-9). Calculate the greatest common divisor of h and 39. 13 Let k(w) = -w3 + 14w2 + 32w + 4. Let s be k(16). Let f be 101/(-1 + 2) + s. Calculate the greatest common factor of 30 and f. 15 Let v be (-96)/(-10)(-17)/(51/(-80)). Calculate the greatest common divisor of v and 16. 16 Let n(y) = y3 + 4y*2 - 6y - 6. Let l be n(-4). Let r(z) = z + 53. Let f be r(-18). Let c = f - 26. Calculate the highest common divisor of l and c. 9 Suppose 2b = 3m + 68, 5b + 9 = m + 205. Calculate the greatest common factor of 680 and b. 40 Suppose d + 4x = 1632, -299d + 1664 = -298d - 4x. What is the greatest common factor of 32 and d? 16 Let i be 3(-1)/1 + 290. Suppose 51f - 41f = 410. What is the highest common divisor of f and i? 41 Suppose -3f + 2w = -86, -25 + 65 = f + 5w. Suppose 0 = k + 5, 5h = 5k - 0 + f. Let j be 17(1 - 0). Calculate the highest common divisor of j and h. 1 Let y = 1108 + -1059. What is the highest common divisor of 189 and y? 7 Let p be 16/21 + 1004/14. Suppose -15d - p = -18d. What is the highest common divisor of d and 36? 12 Let h(p) = 5p2 + 12p - 7 - 3p + 13. Let d be h(-2). What is the highest common divisor of d and 56? 8 Let r = 26 - 59. Let y be -2 + (-304)/(-3) - 22/r. What is the highest common divisor of 20 and y? 20 Suppose -5n = 0, 0j - 5n - 34 = -2j. Let c(o) = o3 - 20o*2 - 41o + 19. Let u be c(22). What is the highest common divisor of j and u? 17 Let k(f) = 37f + 832. Let s be k(-22). Suppose -5m + 0 = -4a + 2, 2m - 4a = -8. Calculate the highest common divisor of m and s. 2 Suppose -x = 4t - 43, 4x - 5t + 1 = 152. What is the highest common divisor of x and 3? 3 Let n be -78(3 - 20/6). Let d = -1 - n. Let u be 20/6 + (-18)/d. Calculate the highest common factor of u and 2. 2 Let k be (76/16 - -8)/((-3)/(-8)). Calculate the greatest common factor of 1326 and k. 34 Let r(v) = 14v*3 + 2v*2 - 2. Let m be r(1). Let o be 1m + (-2 - -1). Calculate the highest common factor of o and 143. 13 Let y(l) = 3l2 - l + 26. Let t be y(5). What is the highest common factor of t and 3? 3 Let b be 1 + ((-15)/(-6))/(1/(-2)). Let i be (-189)/(-12) + -3 - 1/b. Calculate the highest common divisor of i and 117. 13 Suppose -3r + 244 = 88. What is the greatest common factor of r and 26? 26 Suppose 16v - 660 = 6v. Let m(s) = -3s. Let t be m(-2). What is the highest common factor of v and t? 6 Let s(d) = 1. Let n(o) = -o2 + 9o - 14. Let j(f) = n(f) + 4s(f). Let z be j(5). Suppose -5c + 27 = 2. Calculate the greatest common divisor of z and c. 5 Suppose 3m - 2u - 35 = 11, -5m + 80 = -4u. Suppose 5l + 4 = 3l. Let g be 3 - (l - -1 - 44). Calculate the highest common divisor of m and g. 12 Suppose 5c + 14 = 59. Suppose 6p + 9 = 75. Let v = p + c. Calculate the greatest common divisor of 160 and v. 20 Suppose 0 = -25t - t + 4420. Let g be (-1)/(-1 - (-36)/40). Calculate the highest common divisor of g and t. 10 Suppose v - 2 - 1 = 0. Suppose -vn - 177 - 40 = -2u, -2u - 3n + 223 = 0. Let x(r) = 9r - 26. Let g be x(4). Calculate the highest common factor of u and g. 10 Suppose -98d - 374 = -109d. Calculate the highest common divisor of d and 782. 34 Suppose 0h + 4h - 16 = 0. Suppose 0x - hx = -320. Suppose 595p - 614p = -380. Calculate the highest common divisor of x and p. 20 Let o(z) = z*2 + 3z - 1. Let i be o(-5). Let t(m) = 3m2 - 6m - 47. Let g be t(-9). Let u = -178 + g. Calculate the highest common factor of i and u. 9 Suppose 76o + 430 = 81o. Calculate the greatest common factor of o and 2. 2 Suppose -k + 5x + 8 = 0, -3k = -3x - 0x - 12. Suppose 3r - 19 = 4f, -5r - f + 10 = 9. Calculate the greatest common factor of k and r. 1 Suppose -4h = -5t - 2191, -h - 3t - t = -532. Calculate the greatest common divisor of 17 and h. 17 Let u be 19 + (41/13 - (-6)/(-39)). Calculate the greatest common divisor of 253 and u. 11 Let y(b) = -b*2 + 2b - 4. Let p be y(-5). Let o = 35 + p. Let s = o + 16. Calculate the greatest common divisor of 8 and s. 4 Let t be (4/10)/(11/(-55)) + 218. What is the greatest common factor of t and 24? 24 Suppose 3a = -2i - 7, -i + 2a = 7a + 21. Let f(v) = 7v2 - 3v + 20. Let s be f(i). What is the highest common divisor of 30 and s? 30 Suppose -3r - 14 = -5n - 0n, -5n - r + 22 = 0. Let s(z) = z*2 + 3z - 8. Let f be s(n). What is the greatest common factor of 4 and f? 4 Let n(f) = -f*2 - 5f + 7. Let t be n(-6). Suppose -3 = j + t. Let k be 57 + j + 3/3. What is the greatest common factor of k and 6? 6 Let b = -30 - -155. Suppose 4i + 5x - 116 = -1, 0 = -4i - 3x + 109. What is the highest common factor of i and b? 25 Let s(v) = -16v3 - 7v*2 - 7v + 13. Let y be s(-3). Calculate the greatest common divisor of y and 13. 13 Let p(s) = -4s - 4. Let b be p(-2). Suppose -2d = 3a - 5, -2a + b + 10 = -4d. Suppose 0 = l - 31 + a. What is the greatest common divisor of 4 and l? 4 Let p(y) = -19y - 13y3 + 42 - 15y*3 + 29y*3 - 17y*2. Let q be p(18). Let c = 8 - 5. Calculate the greatest common divisor of c and q. 3 Let o(i) = -11i + 27. Let g be o(-13). Suppose -5f - g = -0l - 4l, 110 = -3f + 4l. Let p be 4 - 1f/5. Calculate the greatest common factor of p and 4. 2 Let d(u) = 33u - 1. Let j be d(1). Let s = -7 - 1. Let a = 12 + s. Calculate the highest common factor of j and a. 4 Let y(z) = 2z**2 - z - 3. Let f be y(-3). L	{ "pile_set_name": "DM Mathematics" }
l: 4, z: 2}. What is prob of picking 1 l and 1 z? 8/171 Four letters picked without replacement from {l: 1, u: 2, k: 2}. What is prob of picking 2 k and 2 u? 1/5 Calculate prob of picking 2 a when two letters picked without replacement from uzziiziaia. 1/45 Calculate prob of picking 1 u, 2 z, and 1 j when four letters picked without replacement from {l: 11, w: 1, z: 5, j: 2, u: 1}. 4/969 Two letters picked without replacement from bfsfbbsbffffbffs. Give prob of picking 1 f and 1 b. 1/3 What is prob of picking 1 p and 1 r when two letters picked without replacement from tphrtztt? 1/28 Four letters picked without replacement from {q: 2, u: 8, p: 9}. What is prob of picking 2 u and 2 p? 84/323 Four letters picked without replacement from uulolllllllluxllu. What is prob of picking 3 l and 1 o? 33/476 What is prob of picking 1 b and 1 i when two letters picked without replacement from {b: 2, o: 4, k: 1, j: 2, y: 2, i: 4}? 8/105 Two letters picked without replacement from iiiieijqjiziqiggz. Give prob of picking 1 i and 1 q. 2/17 Three letters picked without replacement from oodoeqwoqjwdqqq. Give prob of picking 1 d, 1 j, and 1 q. 2/91 What is prob of picking 1 p, 1 i, and 2 b when four letters picked without replacement from bipibppbp? 4/21 Three letters picked without replacement from mimimii. What is prob of picking 2 m and 1 i? 12/35 Three letters picked without replacement from gglglnbblbylfb. Give prob of picking 1 n and 2 l. 3/182 Four letters picked without replacement from kffffkfkkkkk. Give prob of picking 2 k and 2 f. 14/33 Three letters picked without replacement from aaaajaajjjaaajaaaaaa. What is prob of picking 2 a and 1 j? 35/76 Calculate prob of picking 1 w and 1 f when two letters picked without replacement from {w: 4, b: 1, f: 5}. 4/9 Two letters picked without replacement from qhbkhdhqqkqqk. Give prob of picking 1 d and 1 q. 5/78 Calculate prob of picking 2 m and 1 j when three letters picked without replacement from mmmmggmmmjjg. 21/110 What is prob of picking 3 d and 1 r when four letters picked without replacement from rdrbdfbrbdbdbbrddf? 4/153 What is prob of picking 2 x when two letters picked without replacement from ggwxbghgx? 1/36 Calculate prob of picking 1 j and 1 c when two letters picked without replacement from {c: 18, j: 1}. 2/19 Two letters picked without replacement from {n: 1, e: 3, j: 3, i: 3}. Give prob of picking 1 j and 1 n. 1/15 What is prob of picking 2 f when two letters picked without replacement from {j: 6, f: 4}? 2/15 Calculate prob of picking 4 i when four letters picked without replacement from jijijjjjjijiiijjjjj. 5/1292 What is prob of picking 1 e and 3 j when four letters picked without replacement from {j: 3, e: 5}? 1/14 Calculate prob of picking 3 c when three letters picked without replacement from {y: 7, l: 1, c: 5}. 5/143 Two letters picked without replacement from {g: 1, e: 3}. What is prob of picking 2 e? 1/2 What is prob of picking 2 v when two letters picked without replacement from {e: 3, v: 12}? 22/35 Calculate prob of picking 1 x and 1 w when two letters picked without replacement from xlwwowylllooo. 1/26 Three letters picked without replacement from snnhhhsnnhhnnhnnhwhh. Give prob of picking 1 h, 1 n, and 1 w. 6/95 Two letters picked without replacement from {r: 2, l: 6, u: 4, b: 6}. What is prob of picking 1 r and 1 u? 8/153 Three letters picked without replacement from {b: 1, s: 12, a: 1}. What is prob of picking 1 a and 2 s? 33/182 Two letters picked without replacement from yfyjjyyeyyoyyh. Give prob of picking 1 h and 1 o. 1/91 What is prob of picking 2 x and 1 s when three letters picked without replacement from sxssssxsxsss? 27/220 Two letters picked without replacement from pgrmggmprpp. What is prob of picking 2 g? 3/55 What is prob of picking 2 h when two letters picked without replacement from hhvhvvvhhvvhhvhh? 3/10 Calculate prob of picking 2 r, 1 a, and 1 s when four letters picked without replacement from {e: 3, s: 1, d: 7, r: 2, a: 1}. 1/1001 Calculate prob of picking 1 v and 1 e when two letters picked without replacement from {c: 1, k: 5, s: 3, v: 1, e: 1}. 1/55 Calculate prob of picking 2 n when two letters picked without replacement from {x: 1, q: 6, n: 8}. 4/15 Three letters picked without replacement from {q: 2, o: 1, r: 1}. What is prob of picking 2 r and 1 q? 0 Three letters picked without replacement from aaalddlhldladll. What is prob of picking 2 l and 1 d? 12/91 Four letters picked without replacement from {x: 3, m: 15, q: 2}. Give prob of picking 2 x, 1 m, and 1 q. 6/323 Calculate prob of picking 2 f, 1 h, and 1 a when four letters picked without replacement from {h: 2, f: 2, v: 3, a: 5}. 2/99 Calculate prob of picking 1 l and 1 c when two letters picked without replacement from llllclll. 1/4 Calculate prob of picking 1 q, 1 y, and 1 b when three letters picked without replacement from {t: 3, p: 11, y: 1, q: 1, b: 2}. 1/408 What is prob of picking 1 w, 1 z, and 1 e when three letters picked without replacement from {b: 1, r: 1, e: 1, z: 1, w: 2, c: 1}? 2/35 Four letters picked without replacement from eemvehmvh. Give prob of picking 1 m, 1 h, and 2 v. 2/63 Four letters picked without replacement from htxkbbe. Give prob of picking 1 e, 1 k, and 2 b. 1/35 Calculate prob of picking 1 h and 2 w when three letters picked without replacement from mhrwopwhwhhwwmr. 8/91 What is prob of picking 1 m, 2 x, and 1 w when four letters picked without replacement from emememmxmweexeemwemx? 14/1615 What is prob of picking 1 m and 1 q when two letters picked without replacement from {d: 1, h: 6, q: 1, m: 5, s: 1}? 5/91 Calculate prob of picking 3 s and 1 j when four letters picked without replacement from szzjssjjzzzzzzsz. 3/455 What is prob of picking 1 s, 1 x, and 1 d when three letters picked without replacement from xmdddixsxxxxdxdimm? 35/816 Two letters picked without replacement from oussuousssuos. What is prob of picking 1 s and 1 u? 4/13 Two letters picked without replacement from {t: 1, e: 2, a: 1, j: 1}. Give prob of picking 1 j and 1 t. 1/10 Two letters picked without replacement from ummrrmuurmmf. What is prob of picking 1 r and 1 m? 5/22 Calculate prob of picking 1 t and 1 e when two letters picked without replacement from {t: 3, z: 3, b: 1, o: 3, e: 10}. 3/19 Four letters picked without replacement from ldljddddlljlj. What is prob of picking 3 l and 1 j? 6/143 What is prob of picking 1 n and 2 k when three letters picked without replacement from mnnmvmmzk? 0 Four letters picked without replacement from {t: 2, i: 3, l: 5, h: 2, v: 3}. Give prob of picking 2 h and 2 v. 1/455 What is prob of picking 1 u and 1 z when two letters picked without replacement from uuuuuuuuuuzuuzuuzz? 56/153 Two letters picked without replacement from {v: 13, q: 5}. Give prob of picking 2 v. 26/51 Three letters picked without replacement from {h: 3, x: 11}. Give prob of picking 3 h. 1/364 Two letters picked without replacement from llllllllhlllllly. What is prob of picking 1 y and 1 h? 1/120 Four letters picked without replacement from qttuqqttttuqtttt. What is prob of picking 2 t and 2 u? 9/364 Two letters picked without replacement from {z: 2, e: 1, k: 1, a: 2}. Give prob of picking 2 z. 1/15 What is prob of picking 2 x when two letters picked without replacement from lxxlxxxlxlxllxxxlxx? 22/57 Calculate prob of picking 3 d when three letters picked without replacement from {d: 6, p: 6}. 1/11 Four letters picked without replacement from {e: 2, b: 5}. What is prob of picking 4 b? 1/7 Four letters picked without replacement from bovyobboboobybobc. Give prob of picking 2 o, 1 b, and 1 c. 3/68 Four letters picked without replacement from {y: 17, s: 3}. Give prob of picking 4 y. 28/57 What is prob of picking 3 f when three letters picked without replacement from {s: 4, x: 3, f: 6}? 10/143 Two letters picked without replacement from {m: 11, h: 2}. Give prob of picking 2 h. 1/78 Two letters picked without replacement from qqiqiqiiqiiii. Give prob of picking 2 i. 14/39 Two letters picked without replacement from {p: 1, s: 2}. What is prob of picking 1 p and 1 s? 2/3 Two letters picked without replacement from ipqiqipoqooqpiqqqqo. What is prob of picking 2 i? 2/57 Calculate prob of picking 1 y,	{ "pile_set_name": "DM Mathematics" }
/(-18))/17)/1) -2 What is (60/(-10))/(216/(-684))? 19 10-2(-188)/472/10 16 Calculate 3/((-66)/11)(-506)/(-11). -23 (10/(-5))/((-2)/((-1)/(-2)1)) 1/2 Evaluate 2/(-3)(-6)/16688/(-3698). -2/43 Calculate ((-14)/(-4))/(15(-8)/48). -7/5 (18(-16)/(-432))/((-4)/(-6))10 10 What is (42/(-15))/(35/(-10))? 4/5 3/(-150)3/6-5 1/20 What is (336/63)/(7/21)? 16 Evaluate (-1694)/1768/(-44). 7/4 (14/(-1))/((-800)/(-200)) -7/2 What is the value of (23/(-10))/((1256/(-80))/157)? 23 Evaluate 45/162784/140. 14/9 What is the value of -24/(-2)(-17)/(1224/90)? -5 What is the value of (24/(-36))/((92/30)/23)? -5 Evaluate ((-11)/((-154)/(-49)))/3. -7/6 What is the value of 6/(-4)1/64732/(-91)? 13 Evaluate 0/((3/(-2))/(-1(-8)/(-16))). 0 ((-1)/(-9)2)/(31/((-11439)/(-2009))) 2/49 What is the value of (1((-12)/4)/(-6))/((-9)/234)? -13 Calculate 65/(-13)(-330)/75. 22 Evaluate 2(((-99)/(-55))/9)/(4/(-50)). -5 375/900((-48)/40)/6 -1/12 Calculate 12/(9/(-36)8). -6 (-1)/214/35110/22 -1 Calculate (26940/(-235725))/(-2(-2)/10). -2/7 What is (6/(-3)((-315)/(-30))/7)/11? -3/11 (-8)/(((-13440)/450)/56) 15 What is the value of ((-1296)/(-1620))/(((-2)/5)/2)? -4 What is the value of (-186)/5582/3034? -4/15 (-204)/(-51)45/(-20) -9 Calculate ((-40)/(-90))/(1886/(-69)). -2/123 (44/(-1100))/((-18)/(-30)) -1/15 -4(5/20)/((-1)/(-9)) -9 What is the value of ((-8)/12)/(24/1152136)? -4/17 Calculate 167/(-392)56. -16 Evaluate (-488)/(-366)(-195)/(-100). 13/5 What is (2/(-8))/((-147)/(-56)135/105)? -2/27 Evaluate (4/(-15))/(36/4214/10). -2/9 What is the value of ((-11)/(22/6))/(4/((-80)/6))? 10 What is (-43/(-15))/((-114)/57)? -2/5 (1764/490)/((-2)/10) -18 What is the value of (16/(-52))/((-152)/(-9880))? -20 What is 1(47430/(-34))/(-45)? 31 Evaluate (2/(2/(-5)))/(225/(-1215)3). 9 Calculate (4(-8)/112)/6. -1/21 Calculate ((3625/100)/(-29))/(2/(-8)). 5 What is the value of (105/(-126))/((4/(-30))/((-30)/(-250)))? 3/4 (12/91295)/(25/56) 14/5 Calculate ((-3)/4)/((-441)/(-6468)). -11 (28/(1568/308))/11 1/2 Calculate 1/(7/(-12))(-2352)/(-4536). -8/9 What is the value of (-34)/5130/(-32)? 5/8 Calculate -3(40/(-6))/(-10)15. -10 What is the value of 3/(96/(-256)1/1)? -8 (((85/17)/(-1))/3)/(7/3) -5/7 Calculate (-4)/(-175)(-16055)/6422. -2/35 What is ((-190)/665)/(-81/(-14))? -1/2 (-181/25)/(((-264201)/(-3220))/547) -24/5 What is the value of (1492/(-3357))/(-2(-1)/(-3))? 2/3 3/(28/(-147)117/104) -14 What is 12(-8)/(-480)280/8? 7 Evaluate (400/(-8))/(((-66)/12)/114). 25 Evaluate (26/(-91))/(16/336). -6 (5/(25/(-12)))/(((-17064)/810)/158) 18 Evaluate (4/(-7)14/(-36))/((-14)/(-7)). 1/9 What is 2/63132310/(-8975)? -18/5 Evaluate (412/(-120))/(2/(-20)). 4 What is the value of 4389/292608/(-15)? -2/25 What is the value of ((-30)/255-17)/(-2)6/14? -3/7 Evaluate 12/9((-18)/(-63))/((-70)/(-147)). 4/5 What is the value of 1/(3/2240/(-180))? -1/2 What is (38/(-14))/(((-1558)/(-287))/(-38))? 19 (183/(-122))/(((-2)/(-48))/((-3)/(-12))) -9 Evaluate (384/(-2112))/(2/(-11))-17. -17 What is the value of 5/1-224/(-20)? 12 Evaluate (1309/(-132))/17(-2)/(-6)6. -7/6 What is the value of (190/(-76))/((-15)/(-24))(-9)/78? 6/13 What is the value of (16/((-448)/(-546)))/(-6)? -13/4 Calculate ((-3)/486-27)/(2/((-36)/(-129))). 1/43 ((-4)/(-9))/((-140)/(-11970)1615) 2/85 Evaluate (8/(-140)-15)/(((-110)/140)/11). -12 14/(-16)(40/(-252))/((-12)/108) -5/4 Evaluate 5/(((-152)/(-120))/19-5). -15 Evaluate 1/(45/66)(-4700)/(-3760). 11/6 Evaluate (-44)/(-5)(-660)/264. -22 What is the value of (4/(-34))/(164835/50949)? -2/55 What is the value of 4/(19/((-57)/18))4/10? -4/15 What is (4879/(-123))/((-391)/207)? 21 What is the value of (6/(-4))/(((-238)/12)/(-119))? -9 Calculate ((-1014)/(-9126))/((2/(-20))/1). -10/9 Evaluate 54/(-24)24/(-18)(-32)/(-12). 8 Calculate (53/((-159)/(-4)))/(44(-2)/(-6)). 1/11 What is the value of (4/(-24))/((-34)/(-153))(-120)/10? 9 What is (192/144)/((-12)/81)? -9 What is the value of ((-1638)/(-195))/((-161)/(-690))? 36 What is the value of ((-42)/168)/(39/(-260))? 5/3 What is the value of ((10/(-105))/2)/((-42)/126)? 1/7 What is ((-3)/(-2)(-4)/(-9))/(289/51)? 2/17 What is 42/954/(-42)? -6 What is the value of (-9)/(-6)-52/18? -5/6 Calculate ((-4356)/(-756))/119. 33/7 What is the value of (-40)/(-14)1057/(-302)? -10 Calculate (34/(-17))/((-286)/(-39)). -3/11 Calculate (32/(-5))/(((-28)/7)/(-20)2). -16 Evaluate (7/(-28)-5)/((14/(-24))/7). -15 What is 12(13685/276)/(-35)? -17 84/(-15)19/((-380)/50) 14 Evaluate (-229/(-60))/(-1). -3/5 What is (-1672)/(-1463)(-7)/(-2)? 4 Calculate 93/372(-45)/(-210)(-16)/(-6). 1/7 (21/(-4))/(((-28)/(-14))/60) -15 What is the value of 12/(((-2484)/126)/23(-7)/4)? 8 Evaluate (120/(-28))/((-149)/(-1043)). -30 Calculate (1/((-6)/(-2)))/(67/((-17956)/(-201))). 4/9 What is (438/365)/((91/70)/13-3)? -4 What is ((-12)/45)/((-7)/((-63)/(-2)))? 6/5 Calculate 9(-7)/252-8-3. -6 (8/(-70))/(((-453)/1510)/(6/8)) 2/7 Evaluate (4/(-100))/11080/(-72). 3/5 Evaluate -74/(-56)(-9)/30616. -4/17 What is the value of (1027/26)/(-79)-20? 10 (6/14)/(190/9310) 21 ((-1000)/300)/(((-20)/24)/((-6)/(-9))) 8/3 Calculate ((-666)/(-370))/((-18)/(-4)). 2/5 Evaluate ((-2)/(-5))/((70/(-75))/(-14)-3). -2 Calculate ((-45)/(-6))/((-7)/(882/105)). -9 Calculate ((-96)/18)/((-3)/(18/20)). 8/5 (2/10)/((96/(-45))/(-4)) 3/8 Calculate -11(-1)/164/80. 4/5 0/(10/707) 0 (((-5)/(45/(-2)))/((-73)/219))/(-2) 1/3 Evaluate 72/10(-4635)/3708. -9 What is -11/52640/(-1672)? 6/19 What is (-7)/(5040/(-1248))(-2)/((-8)/(-6))? -13/5 Evaluate (2/36)/((-81)/162). -1/9 What is ((-99)/6)/((-504)/(-336))? -11 (-1100)/(-440)(-16)/10 -4 Evaluate (-8)/55(-20)/16. 2/11 Calculate ((-4)/(-4))/(8/(-288)-9). 4 ((-202)/8585)/(3/15) -2/17 Evaluate (7/(-6))/((-1)/(-4)10/5). -7/3 What is (6/33)/((-2)/(2/(-3)33))? 2 ((-8)/2(-6)/224)/(8/(-28)) -3/8 What is ((360/64)/15)/((-2)/(-48))? 9 Calculate 64/152(-11)/(-44). 2/19 2/(1018/(-990)) -11 Calculate (-12)/(-36)30(-2)/4. -5 What is ((28/(-6))/((-10)/(-5)))/((-168)/432)? 6 (-3)/(-2)3(-6)/217 -9 1038/(-4671)(-9)/(-2)-6 6 Evaluate 70/15(-24)/16. -7 What is the value of 483/(-322)((-2)/(-1))/(-2)-2? -3 Calculate (56/(-36))/((-26)/78)(-12)/(-238). 4/17 (((-6)/20)/((-30)/25))/(159/(-636)) -1 What is the value of ((-78)/9)/(2/(-3))(-14)/14? -13 Calculate ((1/(-2))/((-2)/(-9)))/((-71280)/665280). 21 What is (-5)/375-5(10080/27)/28? 8/9 Calculate (-11)/1547-398/(-12). -13 What is the value of ((-7)/126)/(8/968)? -1/12 3/4212(-21)/33 -6/11 Evaluate 2/(-7)((-210)/1440)/(3/6). 1/12 6/(-1)(-139)/10425 2/25 What is (-17)/(15470/(-175))192/40? 12/13 ((-366)/549)/((1/(-3))/(3/(-198))) -1/33 What is ((-21)/(-14))/((-378)/(-56))? 2/9 Calculate (-2)/24252/((-306)/17). 7/6 What is the value of ((-121)/((-7986)/(-220)))/(2/6)? -10 Calculate ((2312/51)/(-34))/(4/12). -4 -6((-5194)/(-21))/53 -28 Evaluate (((-9)/27)/((-4)/(-180)))/(189/(-28)). 20/9 Calculate (54/(-216))/((-2)/(-6))(-8)/2. 3 ((-43)/((-645)/(-130)))/((-4)/6) 13 What is ((-140)/(-50))/((-600)/(-750))? 7/2 What is ((-42)/(-15))/((-438)/(-3285))? 21 Evaluate (26/(-5))/(16/40). -13 Calculate 1/(-50)5-6. 3/5 Calculate 0/((11/(-55))/(1(-2)/10)). 0 Evaluate (-1813/(-130)(-5)/(-3))/7. 3/7 What is the value of 1584/(-792)2/2? -2 -26(-20)/((-240)/6) -13 What is 26656/1792((-18)/(-21))/3? 17/4 What is (-12)/20(-245)/(-49)? -3 What is the value of 78/12(-966)/(-10465)? 3/5 Calculate 30/(-8)5328/1665. -12 What is the value of 8/(-8)7/(-21)42? 14 What is 1624/(-6960)3/(-7)? 1/10 What is 28/(-105)39/(-26)? 2/5 11(-36)/(-891)-18 -8 What is the value of 6/(12/(-26))(-26)/(-26)? -13 What is ((-1)/81404/(-27))/(23/(-92))? -26 Calculate ((-26)/12)/(350/1050). -13/2 Evaluate (304/72)/((-62)/93). -19/3 ((-15)/25)/((-4407)/1130) 2/13 (28/((-3780)/(-1035)))/((-2)/6) -23 What is the value of ((-48)/(-4))/(60/(-45)1)? -9 Evaluate (-21)/2((-28)/(-56))/((-9)/(-12)). -7 Calculate ((-57)/(-570))/((-1)/(-4))10/(-94). -2/47 What is the value of (102/(-17)2/18)/(10/6)? -2/5 Calculate (-4728)/(-6895)(30/(-8))/(-3). 6/7 What is (25/10)/(-7(-5)/350)? 25 What is (8/12)/((-4)/9)40/(-10)? 6 Calculate (32/(-16))/(-4*(-6)/(-132)). 1	{ "pile_set_name": "DM Mathematics" }
pose -2l = 8, -4x = -4l + 2208 - 220. Let h = x - -61621/123. Let u(a) = -a3 - a2 - a - 6. Let y be u(-2). Is h <= y? True Let q(v) = -11 + 153v - 78v - 83v. Let l be q(2). Let h = -2 + -26. Is h less than l? True Let u(r) = -18r2 + 121r - 3. Let m be u(8). Is -181 < m? False Suppose -t = 6w - 4w - 4, 0 = 4w + t - 10. Suppose wq - 100 = -103. Which is smaller: q or -4/25? q Let y(w) = 11w2 + 127w + 167. Let c be y(-11). Which is smaller: c or 44? 44 Let x(t) be the third derivative of -t*5/60 - 7t*4/24 + 11t*3/3 + 97t*2. Suppose -3 = -2v + 3, 5v = -k + 3. Let p be x(k). Is p at least -37? False Let k = 15396/11 - 1400. Is k greater than 0.03? False Suppose 107y - 101y = -54. Let x be 3/y - 8/12. Is x greater than -2/11? False Let q be 23/7 + 6/(-21). Suppose -u = qu. Suppose u = 2s - 4 + 2. Which is smaller: 1/3 or s? 1/3 Let m be (34/68)/(3/(-582)). Which is smaller: -94 or m? m Suppose b = -s + 96, -20s - 4b - 116 = -21s. Which is bigger: 99 or s? s Suppose 20889 - 102465 = -63g + 14877. Are g and 1531 equal? True Let b = -9567/160 - 173/32. Is b not equal to -65? True Let p be (-5)/26(8/(-78))/((-25)/(-15)). Do p and -1 have the same value? False Let f = -345 - -346. Let v be (-1)/(-2)(3/699)/(-1). Which is smaller: v or f? v Let x be (3/(-6))/((-52)/(-1)). Let h(l) = -15l*2 - 64l - 58. Let c be h(-3). Does x = c? False Let x = 21974.05 - 22449. Let n = x - -475. Which is greater: -0.5 or n? n Let j = 11/112 + 45/112. Which is smaller: j or 2/511? 2/511 Let o = 11/1302 - -1/42. Let m(v) = 2 + 21 - 946v + 943v. Let s be m(8). Which is smaller: o or s? s Let o be ((-2115)/(-135))/(8/6). Let f = o - 12. Which is smaller: f or 3/7? f Let v be (-1 - 3) + -3 - 260186/(-34736). Which is smaller: 1 or v? v Suppose 5o = -0o. Suppose 0 = -x + 3i - 1 - 6, o = 2x + 2i + 6. Suppose 22q - 41 = 27q - 16. Are x and q unequal? True Let q be (-3)/21 + 775/35 + -2. Suppose 0 = -4t - 2i - q, 11i - 8i = -5t - 27. Does t = 14? False Let b = -4981198/46277 - -1184/11. Which is smaller: b or 1? b Suppose -z + 6z - 113 = -4h, -53 = -3z + 5h. Suppose -8p + 3 = 43. Which is bigger: p or z? z Let w = 250 + -262. Let r be (-60)/w - (-81)/(-15). Is -11 less than r? True Let p = 38 + 0. Let d be (-4)/(-7)(-6 - p/(-4)). Suppose -z + 147 = dz. Is 48 at most as big as z? True Let r be 28/21 + 2403820/(-666). Let v = r - -3608. Is v equal to 0? False Let l(b) = 18b + 219. Let r be l(-12). Suppose -100 = ro + 143. Is o at most as big as -81? True Let y be 54/126(-91)/130. Which is greater: -1/45 or y? -1/45 Let c be 74/4 + -4 - (-4)/8. Let f be (1/(-2))/(c/570). Which is bigger: -16 or f? -16 Let o be 406/7418/(-63). Which is greater: -3 or o? o Let y be -3(-5358 - -2)51/153. Which is smaller: 5355 or y? 5355 Let j = 3911 - 3912. Is 1/1720 greater than j? True Let x be -55316/(-15 + 7). Is 1109 less than x? False Suppose -17 = -a - u, 0u + u = -5a + 77. Let d(f) = f*2 - 12f - 34. Let c be d(a). Which is smaller: c or 14? c Let k be 0 - -2 - (-33980)/(-130). Let c(n) = 59n - 23. Let g be c(-4). Let q = g - k. Which is smaller: q or 1? q Let s be (-4)/(((-14)/(-21))/(((-6)/(-9))/(-1))). Let v(m) = -2m*2 + 7m - 3. Let t be v(5). Which is bigger: t or s? s Suppose 0 = 2m - 3m. Suppose 2h + 3i = 5, m = -h - i - i + 5. Let c(a) = 5a3 + 102a*2 - 61a + 48. Let t be c(-21). Which is bigger: t or h? t Let z(k) = -2k2 + k - 3. Let c(x) = x. Let u(s) = 4c(s) - z(s). Suppose 3t - 3a + 5 = 2t, -4t - 2a - 6 = 0. Let h be u(t). Which is bigger: h or 4? h Let b be 507/(0 + ((-18)/8)/3). Let j be b/(-13) + (-5 - -1). Let p be (-3)/(-1)(-517)/(-33). Which is smaller: p or j? p Let v(r) = r*2 - 8r. Let s be v(8). Let g be 60/10(-1 + s - -2). Let c be ((-7)/(-357))/(1/g). Which is bigger: -0.2 or c? c Let c = -1715 + 2865. Suppose -2p + 582 = 4n, 2p + n - c = -2p. Suppose -5g + p = 72. Is g at most 45? True Suppose 5j - 4z = 471, -3j + 23z + 291 = 22z. Suppose 0 = 5b + 2c - 493, 0b + 2b - 195 = -3c. Is j greater than b? False Let a(s) = -s*2 + 14s - 40. Let v be a(17). Let k = v + 104. Let l(j) = j*3 - 14j*2 + 12j + 14. Let m be l(k). Is m not equal to -0.1? True Let t be (474/(-159) - -3)(-1)/2. Is 12 at least t? True Let d be 9/16(-736 - -364). Which is bigger: -209 or d? -209 Suppose -4 = -7d + 10. Suppose -185 + 68 = b - 3l, -5b - 670 = dl. Is 1/4 < b? False Let o be 1 + 2502/14 + (-20)/(-70). Let v be o/168(0 - (-2)/(-3)). Which is smaller: v or 2/7? v Let o = -173 + 134. Let u = -610 + 609.6. Is o equal to u? False Suppose -d = -2d + 384. Let o = 469 - d. Which is smaller: 86 or o? o Let k(i) = 169i + 1366. Let v be k(-8). Which is bigger: 0.2 or v? v Let c(n) = -2n + 13. Let r be c(4). Suppose 2v + 2m = 0, -v - 6 = 4m - rm. Is v bigger than -13? True Suppose 0 = r + 47r - 37r. Let z be (-2)/(-3)(-90)/(-92). Which is greater: r or z? z Let r = 60.0133 - 60. Let g = -2.0133 + r. Which is bigger: g or -88? g Let z be (42/(-5))/((-21)/(-56))-45. Suppose -10m + 128 = z. Which is smaller: m or -1? m Suppose -1041m + 994m + 322138 = 0. Is 6855 at most m? False Suppose 3b + 506 = 5d, -17d = -b - 22d - 162. Is -166 at least as big as b? True Let d = -266.7 + 266.76. Is d <= 0.83? True Let y(v) = 4v*3 + 22v*2 + 7v - 22. Let u be y(-5). Suppose -3x + 2s - 6 = -2x, -5x - 2s = 18. Which is greater: x or u? x Let w(h) be the second derivative of -3h*3 + 73h*2/2 - 6h - 3. Let v be w(4). Let k = 50/3 + -17. Which is bigger: v or k? v Let z be (-2)/(-2) + 298508/(-147). Is z at most -2029? True Let y = -11100 - -10250. Is y > -5952/7? True Let l = -97 - -213. Suppose -4x + 341 = 3j, 0 = 96j - 101j - x + 574. Which is greater: j or l? l Let d be 4/4 - 3717/3969. Does d = 1? False Let y = -8 + 0. Let u = 11.9 + -29.9. Let m = u + 17.8. Does m = y? False Let r = 107 + -99. Let x be r + -2 - (-2 - -3). Suppose p - 5 = -3p + xw, 3w = -3p - 30. Which is smaller: p or 0.06? p Let g be ((-2)/6)/((-35)/(-15)). Let q(f) = -26f + 112. Let k be q(5). Let o be ((-50)/60)/((-3)/k). Which is smaller: o or g? o Let d(q) = -2q. Let t(a) = -2a2 - 15a + 10. Let g(h) = -3d(h) + t(h). Let k be g(-8). Is k >= -45? False Let j be -4 + 1/(10/80) + 840. Is j at most as big as 840? False Let f = 19.8 + -16.05. Let d = -2.75 + f. Is 0.15 at least as big as d? False Let z be 231/14 + (-6)/(-4). Suppose -63t = -60t + z. Let w be 1(1 + t/4). Which is smaller: 4 or w? w Let h = -47.78 + 34. Let r = h - -14. Which is smaller: r or 1? r Let u = 4.511 + -4.71. Let z = 125.199 + u. Let x = 127 - z. Do 4 and x have the same value? False Let h be 4/(-1360)-17 - 38/(-40). Which is greater: h or 116? 116 Suppose 0 = 157n - 41959 - 100911. Which is bigger: 912 or n? 912 Let k be -1(6/1)/(-3). Suppose -3i - kb + 30 = 2i, -30 = -5i - 5b. Which is smaller: 26/5 or i? 26/5 Let r be (-10)/(-4) + 11/(-22)(-1216 - -3). Does 2433/4 = r? False Suppose -2o + 3p + 11 = 3, -5o = -4p - 13. Which is smaller: 1/1232 or o? 1/1232 Let s = -24393 - -24393. Do s and 1/112 have different values? True Let v = 3215/203 + -460/29. Which is greater: v or 1? 1 Let s be (116)/(198/(-43362)). Is s at least as big as -3505? True Let o = -0.0556 + -269.9444. Let h = o - -269.99. Is -0.33 at most h? True Let y = -40 - -75. Let v = y + -31. Let n(u) = -u*2 + 31u + 223. Let b be n(-6). Are v and b equal? False Let x be (2/3)/((-4)/(-6)). Let g = 89 - 97. Let n be (0 + 3/g)8/(-60). Is x at most as big as n? False Let v = 114.47 + -115. Let l = v - -0.43. Let o = 0.3 + l. Which is greater: o or -6? o Suppose -3x + 156 = 24. Let z(j) = -4j3 + 71j*2 + 14j + 8. Let p be z(18). Let b = x + p. Is b at most -59/3? True Let o be 68/306-3 - 11/(-12). Let v = 2.2 + -2. Is v at least o? False Let q = -0.01 - 0.59. Let h = 1.4 - q. Let u be (-13 + 10)/(6/(-12)). Which is smaller: u or h? h Let c = 13 - 13.35. Let p = -2/2409 - -2641/279444. Let w = p + 113/348. Is c at least w? False Let r = 153 - 119. Suppose 12m = 10m - 3f + 3, -4m = -2f + r. Is -4 >= m? True Let g = -219 - -367. Let p = g - 148.5. Which is smaller: p or 4? p Let y be (-146)/(-282) + (-10)/15. Let p be (-24)	{ "pile_set_name": "DM Mathematics" }
+ 10. Calculate kd(n) - 2l(n). 2n + 1 Let z(s) = 9s*3 - 9s*2 - 11s - 4. Let x(q) = -5q3 + 5q*2 + 6q + 2. Give 5x(c) + 3z(c). 2c3 - 2c*2 - 3c - 2 Let m(h) = 3h + 4. Let t(c) = c + 8. Let l be t(-5). Let y(s) = s + 1. What is lm(w) - 12y(w)? -3w Let j(t) be the third derivative of -t5/30 + t4/6 + 5t3/6 - 3t*2 + 4. Let u(d) = -3d*2 + 7d + 9. Calculate -5j(m) + 3u(m). m*2 + m + 2 Let q(d) = -7d*3 - 14d*2 - 5. Let r(l) = -11l*3 - 21l*2 - 8. Determine -8q(v) + 5r(v). v3 + 7v*2 Let f(u) = 2u + 12 - 7u + 5u - 2u2. Suppose 5v - 9v - 3s = 54, 0 = 4v + 5s + 58. Let x(r) = 1. What is vx(o) + f(o)? -2o*2 Let u(a) be the second derivative of 5a4/12 + a3/3 - 19a. Let r(s) = -15s*2 - 7s. Calculate 2r(g) + 7u(g). 5g2 Let z(j) = -29j*2 - 7j + 8. Let m(q) = -58q2 - 13q + 15. Give -6m(t) + 11z(t). 29t2 + t - 2 Let t = -5 - -9. Let s(x) = -2x - t + 2 - 7x + x. Let c = 0 - 6. Let r(w) = -7w - 2. Give cr(b) + 5s(b). 2b + 2 Let y(b) = b3 + 6b*2 - 7b + 6. Let z be y(-7). Let v(r) = r3 - r2 - r. Let h(k) = -4k3 + 8k*2 + 6k - 2. Calculate zv(q) + h(q). 2q*3 + 2q*2 - 2 Let c(s) = s. Let b be 11/(-4) + 0 - 3/(-4). Let u(z) = 3z - 2. Let t(w) = -6w + 5. Let h(j) = 4t(j) + 10u(j). Calculate bh(g) + 11c(g). -g Let o(u) = 6u + 5. Let j(p) be the second derivative of 5p3/6 + 2p*2 + 5p. Suppose 0n = -4n + 28. What is nj(z) - 6o(z)? -z - 2 Let u(v) = -13v3 - 3v*2 - 4v + 4. Let l(b) = 27b3 + 5b*2 + 7b - 7. What is -4l(j) - 7u(j)? -17j3 + j2 Let b(x) = 26x*2 + 16x. Let y(p) = -5p2 - 3p. Suppose -3z + 4r - 3 = 0, 5z = 4r + 3 - 0. What is zb(l) + 16y(l)? -2l2 Let c(b) = -b2 - 6b. Let p(n) = 2n. Let l be (-1 + -7)/(22 - 23). Calculate lp(q) + 3c(q). -3q*2 - 2q Suppose 0 = -p - 2p + 36. Let y = -18 + p. Let j be -2 + (-3)/2y. Let k(n) = 5n2 - 7n - 3. Let s(b) = -3b2 + 4b + 2. Give js(o) + 4k(o). -o*2 + 2 Let r(o) = 15o*2. Let d(n) = -3n*2. Let y = 24 - 29. What is yr(c) - 24d(c)? -3c*2 Let c(t) = -72t*2 - 9t - 9. Let p(i) = -18i2 - 2i - 2. Give -2c(y) + 9p(y). -18y2 Let v(z) = -11z*3 - 3z*2 - 3z + 3. Let f(p) = -22p3 - 5p*2 - 5p + 5. Determine 3f(j) - 5v(j). -11j3 Let x(k) = -17k - 7. Let w(n) = 9n + 10. Let a(p) = -9p - 9. Let y(c) = 6a(c) + 5w(c). What is -6x(f) + 11y(f)? 3f - 2 Let j(v) = -2v + 5. Suppose -5u = 2y + 24, 4 = -5u + 2y - 32. Let g(x) = -1. Calculate ug(f) - j(f). 2f + 1 Let y = 28 + -17. Let w(a) = -2a2 - 15a + 2. Let b(m) = m*2 + 8m - 1. Suppose -6 = -2h + 2q, 2h - 4q = -0h. Give hw(t) + yb(t). -t2 - 2t + 1 Let y(v) = -5v + 2. Let u(t) = -5t + 1. Determine -4u(h) + 3y(h). 5h + 2 Let t(w) = 16w*3 - 3w*3 - 7 - 7w*2 - 66w + 73w. Let p(r) = -r - 12. Let f be p(-9). Let o(h) = -6h*3 + 3h*2 - 3h + 3. Calculate ft(n) - 7o(n). 3n3 Let q(g) be the first derivative of g4/2 + 3g*2/2 + 5g + 16. Let x(j) = -3j3 - 4j - 7. Give 7q(m) + 5x(m). -m3 + m Let x = 1 - -1. Let g be (8/(-12))/(x/9). Let k(q) = q3 + 2q. Let r(p) = -2p*3 - 3p. Give gr(u) - 4k(u). 2u3 + u Let x(o) = -2o*2 + 5o - 12. Let m(s) = -s*2 + 3s - 6. What is -5m(c) + 3x(c)? -c*2 - 6 Suppose 2z = -4y + 10, z + 2 + 1 = 0. Let h(q) = -7q. Suppose b + 9 = 2b. Let m(n) = 3n + b - 9. Determine yh(l) + 9m(l). -l Let o(v) = -6v3 + 8v*2 + 11v - 3. Let h(m) = 4m3 - 5m*2 - 7m + 2. What is 8h(i) + 5o(i)? 2i3 - i + 1 Let s(d) = 21d*2 - 9d - 5. Let t(u) = 5u2 - 2u - 1. Let z = 1 + -10. Give zt(v) + 2s(v). -3v2 - 1 Let j(q) = 6q + 26. Let p(n) = -n - 5. Determine 4j(k) + 22p(k). 2k - 6 Let y(o) = 2o*2 - 4o. Suppose 4h - 8 = -2g + 4g, 3h - g - 8 = 0. Let p(c) be the second derivative of 0 + 0c2 - 1/6c*3 - c. What is hp(f) - y(f)? -2f2 Let v(t) = -t2 + 9t - 3. Let n(s) = 4s - 2. What is -7n(q) + 3v(q)? -3q*2 - q + 5 Let o(d) = 5d - 3. Suppose -5f + 5k + 90 = 0, 0 = -4f - 2k + 29 + 25. Suppose 2z + f = -3z. Let b(a) = -a*2 + 14a - 8. What is zb(q) + 8o(q)? 3q2 - 2q Let w(r) = r*3 + 6r*2 - 2r - 8. Let s be w(-6). Let i(t) = t*2 + 3t - 2. Let p(a) = a. What is sp(u) - i(u)? -u2 + u + 2 Let j(a) = 5 + 8a*2 + 29392a - 29392a. Suppose 4w + 3v - v = 22, 0 = 4w + 5v - 31. Let r(i) = 7i*2 + 4. Give wj(y) - 5r(y). -3y2 Let m(v) = v3 + v*2 + v. Let i(d) = -14d3 - d2. Calculate i(s) + m(s). -13s3 + s Let z(c) = -11c - 2. Let a(b) = 78b + 15. Determine 2a(u) + 15z(u). -9u Let i(a) = a + 2. Let n(x) = 1. Suppose w = 4w - 3. Let v(p) = -p + 6. Let c(l) = wv(l) - 6n(l). What is -4c(g) - i(g)? 3g - 2 Let c(q) = q - 1. Let l(r) = -4r + 4. Let o = 8 + -7. Calculate ol(h) + 5c(h). h - 1 Let c(i) = i - 1. Let k = -15 - -25. Suppose 3w = -5m + 39, -2m - 3m + 53 = -4w. Let u(b) = -mb + b + 3 + 0 + 7. Determine kc(p) + u(p). 2p Let i(p) = -p - 1. Let t = -156 + 146. Let q(g) = -g + 3. Let n be q(0). Let s(u) = 12u + 10 - 3 + n. What is ti(o) - s(o)? -2o Let a(h) = -4 + 0h + 5h - 3h + 6. Let d(y) = -6y - 5. What is 8a(m) + 3d(m)? -2m + 1 Let d(a) = a*2 - a. Let z(n) = 40n*2 - 36n. Calculate -144d(r) + 4z(r). 16r2 Let o(k) = 17k - 6. Let u(y) = 33y - 13. What is 7o(b) - 3u(b)? 20b - 3 Let k(n) = 6n + 5. Let u(q) = -11q - 9. Give 5k(a) + 3u(a). -3a - 2 Suppose g - 22 = -24. Let n(w) = 3w*2 - 2w + 1. Let k(x) = x*3 - 7x*2 + 5x - 3. What is gk(t) - 5n(t)? -2t3 - t2 + 1 Let q(b) = 12b*3 - 8b. Let j(u) be the first derivative of u*4 - 3u*2/2 - 32. Determine 8j(f) - 3q(f). -4f*3 Let p(x) = 4x*3 - 9x*2 - 6x - 3. Let d(y) = -y3 + y2 + y. Give -6d(h) - p(h). 2h*3 + 3h2 + 3 Let n(h) = -h2 - 6h + 5. Let d be n(-6). Let z(v) = 2v + 7. Let s(l) = -l - 3. Give ds(x) + 2z(x). -x - 1 Let w(q) = -8q2 - q + 2. Let b(v) = -v2 + v. Give b(p) - w(p). 7p*2 + 2p - 2 Let t(n) = -n + 1. Let u(q) = -q*2 - 6q - 6. Let z be u(-5). Let v(d) = -4d - 1 - 1 + 10d + 0. What is zv(m) - 4t(m)? -2m - 2 Let p(d) = 13d*3 - 4d*2 - 3d. Let h(w) = 38w3 - 11w*2 - 8w. What is -4h(r) + 11p(r)? -9r3 - r Let z(q) be the second derivative of 2q*4/3 - 5q*3/6 + 2q*2 - 3q. Let w(f) = -f*2 + f - 1. Calculate -6w(j) - z(j). -2j2 - j + 2 Let f(w) = -3w*3 - 9w*2 + 4 + 3w2 + w3 + 5w + 2. Let p(z) = -z3 - 5z*2 + 4z + 5. What is 4f(m) - 5p(m)? -3m3 + m2 - 1 Let t(p) = 1. Let d(q) = -q2 - 3172 + 3q*2 + 3167. Calculate -3d(k) - 15t(k). -6k2 Let y(o) be the third derivative of -o6/24 - 2o5/15 - o4/4 - 7o*3/6 - 21o2. Let p(b) = b3 + b*2 + b + 1. What is -6p(u) - y(u)? -u*3 + 2u*2 + 1 Let b(n) = -n - 14. Let j(d) = -5. Calculate 3b(a) - 8j(a). -3a - 2 Let l(f) = -1. Let j(w) = 6w + 24. What is -j(i) - 24l(i)? -6i Let s(f) be the second derivative of f4/12 + f2/2 + 5f. Let l(p) = -2p - 3. Give l(m) + 3s(m). 3m2 - 2m Let g(o) = -o - 3. Let i(a) = -a - 3. Let x(h) = -3h - 9. Let u(d) = -17i(d) + 6x(d). Give -4g(l) + 5u(l). -l - 3 Let w(g) = 27g + 17. Let x(t) be the first derivative of 81t2/2 + 52t + 2. Let v(u) = 7w(u) - 2x(u). Let c(f) = -7f - 4. Calculate -15c(a) - 4v(a). -3a Let l(v) = -3v3 - 2v*2 + 4v. Let t(k) be the second derivative of k5/4 + k4/4 - 7k3/6 + 4k. Let x = 8 + 2. Let m = x - 14. Give mt(f) - 7l(f). f*3 + 2f*2 Let f(r) = 7r + 2. Let y be (-53)/17 + 14/119. Let l(m) = 8m + 3. Give yl(h) + 4f(h). 4h - 1 Let u(j) = 2j2 + 7j + 4. Let f be 0/(-5 + 3 + -1). Let c(m) be the third derivative of 1/24m4 + 1/6m*3 + 0m - 3m2 + f. Give -5c(t) + u(t). 2t2 + 2t - 1 Let d(p) = 11p - 5. Let o(b) = 22 - b - 43 + 22. Give -d(m) - 6o(m). -5m - 1 Let h(g) = 4g*2 - 2. Let k(t) = -7t*2 + t + 4. What is -5h(d) - 3k(d)? d2 - 3d - 2 Let w(r) = r*3 - 2r*2 - 2. Let q(u) be the first derivative of -5u*4/4 + 3u*3 + 9u + 7. Determine -2q(c) - 9w(c). c*3 Let d(x) = x + 1. Let c(b) = 7b + 9. Calculate c(m) - 6d(m). m + 3 Let z(b) = -3b*2 - 3. Let r(d) = 2d*2 + 7d + 6. Let n(a) = a*2 + 5a + 4. Let o(i) = 7n(i) - 5r(i).	{ "pile_set_name": "DM Mathematics" }
63z2 Find the second derivative of -3599134i*2s*3 - is*3 - 2is2 + 59535is + 6 wrt i. -7198268s*3 What is the first derivative of 16m*2x - 28m2 + 4m - 2x - 28461 wrt m? 32mx - 56m + 4 What is the derivative of -2f4 - 22f3 - f2 + 770f - 1347689 wrt f? -8f*3 - 66f*2 - 2f + 770 What is the second derivative of 11o5 - 10107o*2 - 533990o wrt o? 220o3 - 20214 What is the second derivative of -j5w - 18598j4w - j + 15w wrt j? -20j*3w - 223176j2w What is the second derivative of -14u4 - 2400u*2y*2 + 17uy2 - 296uy + y2 wrt u? -168u*2 - 4800y*2 Find the second derivative of 18ad3 - ad*2 - 83ad - 23a - 26d4 + 3d*2 wrt d. 108ad - 2a - 312d2 + 6 What is the first derivative of -4753904b*2 - 6630606 wrt b? -9507808b Find the third derivative of 2f2s*3 + 3f*2s2 - f2s + 37f*2 + 9870s*3 + 406s wrt s. 12f2 + 59220 What is the third derivative of -26706a*4 - 5a*2 - 2210a + 1 wrt a? -640944a What is the third derivative of 582x*5 + 1293x*3 - 14535x*2 + 6 wrt x? 34920x*2 + 7758 Find the first derivative of 2j*3 + 2j*2 - 61j + 63096. 6j2 + 4j - 61 Differentiate -437066r + 11719 wrt r. -437066 Find the first derivative of -18kst*2 + 10kt2 - 67kt - k + 4st2 - 3604st - 7t*2 + 4t wrt s. -18kt*2 + 4t*2 - 3604t What is the second derivative of 1121584i4j2 + i2 + ij2 - 501671j*2 wrt i? 13459008i*2j*2 + 2 Find the second derivative of -3f*2v*2 + 218f*2v + 13f2 + 11fv2 + fv + 7163v2 wrt f. -6v*2 + 436v + 26 What is the second derivative of -5b2cv2 - 2b*2cv - b2c - 26b2v - 43bcv2 + 3c - 97v2 + 96v wrt v? -10b2c - 86bc - 194 Find the third derivative of -42j3lz2 - 8095j*3lz - 40j*2lz2 + 27j*2lz + 2j*2l - 2j2z*2 + 10jl - 5lz wrt j. -252lz2 - 48570lz Find the third derivative of 50086j*5 - 187838j*2 wrt j. 3005160j*2 What is the second derivative of 43126w*2 + 1951w + 2 wrt w? 86252 What is the second derivative of -5ikm2 + 159ikm - i + 600km*2 + 12k + 37m2 - 31m wrt m? -10ik + 1200k + 74 Find the third derivative of -61148v*4 + 2v*2 - 310v + 9. -1467552v Find the third derivative of -6151v*4 - 32v*3 - 2v*2 - 3962v - 20. -147624v - 192 Find the second derivative of 1548k*2q*5 - 3925k*2 + 2q*5 + q wrt q. 30960k*2q*3 + 40q*3 Differentiate 64v*2 - 4132v - 2388290 wrt v. 128v - 4132 What is the second derivative of 27412d*3 + 121d*2 + 132088d - 6 wrt d? 164472d + 242 Find the first derivative of -x2 + 11014x - 191612. -2x + 11014 Find the first derivative of 62927g*2l*4 - 2g*2l*2 - 4447720g*2 wrt l. 251708g*2l*3 - 4g*2l What is the first derivative of -295t3u + 23301t3 + 3t*2u + 3t2 - 4t + 41u wrt u? -295t*3 + 3t*2 + 41 What is the third derivative of 80593t*3v*6 + 2t*3v*3 - 4t*3 + 5161tv2 wrt v? 9671160t*3v*3 + 12t*3 What is the second derivative of 6x*5 - 3662x*4 - 3292x + 11? 120x3 - 43944x*2 Find the third derivative of 40j*3o*2r3 + j3or*2 - 7j*3or + 1315jo2r*2 - 3444o*2r*3 wrt r. 240j*3o*2 - 20664o*2 What is the derivative of -177x*2 - 33x - 101849 wrt x? -354x - 33 What is the second derivative of -189127it2 - it + 2i - 2t*5 - 1056t - 1 wrt t? -378254i - 40t*3 Differentiate -21435ao2w - 6aouw + 15aow + 2o*2uw + 27178uw - 2w with respect to u. -6aow + 2o*2w + 27178w Find the second derivative of -492069j*2 - 149713j - 2 wrt j. -984138 What is the second derivative of 39512x2 - 1115x - 2 wrt x? 79024 Find the second derivative of 9m4 - 21421m*2 - 1471220m wrt m. 108m2 - 42842 Find the second derivative of 27893v*4 + 3v*3 + 44472v wrt v. 334716v2 + 18v What is the first derivative of ko + k - 30760o - 14222 wrt o? k - 30760 What is the first derivative of 2750r2 + 12r + 1760232 wrt r? 5500r + 12 What is the derivative of -2m*2r + 2m2 - 18521mr + 39836 wrt r? -2m*2 - 18521m Find the second derivative of -13210c5 + 7932c wrt c. -264200c3 What is the second derivative of -2g*5 - 44g*4 - 4g3 - g2 + 1327410g wrt g? -40g*3 - 528g*2 - 24g - 2 Differentiate -257110i4 - 3i*3q - 3956733q wrt i. -1028440i*3 - 9i*2q What is the first derivative of m*2tw + 263538m*2w + 18125m2 - 35t wrt w? m*2t + 263538m2 What is the derivative of -8b*2x - 3b2 - 1990bx + 10x + 325 wrt b? -16bx - 6b - 1990x Find the third derivative of 553a3h*3 - 801a*3h*2 + 4a*2h*2 + 6ah4 + 3h wrt h. 3318a3 + 144ah What is the second derivative of -30o*2x*2 + 8011o*2x - 17x2 wrt x? -60o*2 - 34 Differentiate -50978l + 32236 wrt l. -50978 What is the derivative of cdx + 5cd + 2cx + 3c - dx + 10d - 23656x + 6 wrt x? cd + 2c - d - 23656 What is the second derivative of v*4 - 164554v*3 + 1892368v wrt v? 12v2 - 987324v Find the third derivative of 2o2t3 - o2t2 - 3o*2t - 4o2 + ot*3 + 998t*3 + 34t*2 - 3t wrt t. 12o2 + 6o + 5988 What is the third derivative of -3km*4 - 20km2 - 2km + 43161m*5 + 2m*4 - 36m*2 + 4m - 3 wrt m? -72km + 2589660m2 + 48m What is the third derivative of -3663828x6 + 823586x*2 wrt x? -439659360x*3 What is the derivative of 3k*2l*3 - 54975k*2 + 76kl2 + 10l*2 wrt l? 9k*2l*2 + 152kl + 20l What is the third derivative of -46825mn*3 - 4mn2 + m - 2n3 - n2 - 2967n wrt n? -280950m - 12 What is the second derivative of -b*3r*3 - 2b*3r + 1185br*3 - 13b + 7r3y - 2ry - 77r wrt r? -6b*3r + 7110br + 42ry What is the third derivative of 1195180l6p - 2l6 + 87l*2p - 1208lp - 2p wrt l? 143421600l*3p - 240l3 Find the first derivative of -18541h*3 + 19361. -55623h*2 What is the third derivative of -3228i*5l - 54i4l*3 + 13716i*2l*2 - 4il3 - 5il wrt i? -193680i*2l - 1296il*3 What is the third derivative of -180910b*3m*4 + 440b*3 + 185b*2m*2 wrt m? -4341840b*3m What is the first derivative of -69896p2 - 37673? -139792p Find the third derivative of 891d4 + 1182d*3 + 3d*2 - 1323d - 29 wrt d. 21384d + 7092 What is the third derivative of -2d*2u*3 + 1400650d*2u*2 - 29455u*3 + 3u*2 wrt u? -12d*2 - 176730 What is the second derivative of -78ju3 + ju*2 + 307182ju - 2j + u*3 + 420u*2 wrt u? -468ju + 2j + 6u + 840 What is the derivative of -14fh2 - 144f - 2h3 - 88h*2 - 2h - 138 wrt h? -28fh - 6h2 - 176h - 2 Differentiate 3z3 - z2 - 183z - 36545 with respect to z. 9z2 - 2z - 183 What is the third derivative of 375078n3 - n2 + 46983n wrt n? 2250468 Find the second derivative of -94k3v*2 - 166k*3v - k*3 + 13k*2v - 9v3 + 9v*2 - v wrt v. -188k*3 - 54v + 18 Differentiate -74j3z + 8j3 + 94j*2 - 40jz2 + 2 with respect to z. -74j*3 - 80jz What is the second derivative of 219f*2m*3 - 12f*2m + 5591fm - 44m5 wrt m? 1314f*2m - 880m3 What is the second derivative of 77453f*2 + 24355f? 154906 What is the first derivative of -19525p2 - 9796 wrt p? -39050p Find the third derivative of -8340q4 - 2q*3 + 2q*2 - 23826. -200160q - 12 What is the first derivative of -69x2 - 2308x + 4743585? -138x - 2308 Differentiate 1542h*3i*2 + 3h*3 + 4253h + 8i3 - 3 wrt i. 3084h*3i + 24i2 What is the second derivative of 2t*2u*2 - 4t*2u + tu2 + 31tu + 2633u*2 - 253 wrt u? 4t*2 + 2t + 5266 Find the third derivative of -23309v3 + v2 + 3v - 400. -139854 What is the first derivative of -951fj*2 + 18fj - 4f + 862 wrt j? -1902fj + 18f What is the derivative of -258848x*4 - 84714 wrt x? -1035392x*3 Find the third derivative of -273l*4 - 172l*3 + 4l*2 + 7060l + 2 wrt l. -6552l - 1032 Find the second derivative of -1294t*5 - 21t*3 + 6487t + 2 wrt t. -25880t3 - 126t What is the derivative of 117r2x - 293784r2 + 1395rx wrt x? 117r*2 + 1395r	{ "pile_set_name": "DM Mathematics" }
it of b? 5 Let f be (-31425)/(-25) - (-1 + (-2 - -2)). Suppose f = 5t - 12. What is the hundreds digit of t? 2 Let o be (-3 - (-260)/15)60. Suppose 3z = -p + 635, -4z = -2p + 6p - o. What is the hundreds digit of z? 2 Let x(l) = -2l + 21. Let b be x(11). Let h be (255 + b)(14/4 - 3). Let z = -52 + h. What is the units digit of z? 5 Let w = -186 - -203. Let g = w + 136. What is the units digit of g? 3 Suppose 0 = 3d + 4q - 427, 5q = 22 - 2. Let t = 244 - d. Suppose t + 88 = 3b - 5a, 0 = -4a. What is the units digit of b? 5 Let o(j) = -21j + 50 + 67j*2 + 20 + 48j*2 + 59j. What is the hundreds digit of o(-2)? 4 Suppose 32 + 8 = 4a. Let f(x) = 3x*2 + 8x + 13. What is the tens digit of f(a)? 9 Let w be (2/10 + -2)(33 - 38). Let m(a) = 18a*2 - 43a + 30. What is the hundreds digit of m(w)? 1 Let w(u) = -124u3 - 21u*2 - 49u - 5. What is the units digit of w(-7)? 1 Let w = -320 - -353. Suppose 2k + 43 = 13. Let o = w + k. What is the tens digit of o? 1 Let b be 0 + -4 - (13 + -19). Suppose 0 = -5i + s - 3s + 3031, bi - 1207 = s. What is the units digit of i? 5 Suppose 2q + 5 = 3q, 0 = -3r - 4q - 3487. Let y = r - -2189. What is the units digit of y? 0 Let p(d) = -7d - 17. Let o = 17 - 4. Let x be (-24)/10(o + -8). What is the tens digit of p(x)? 6 Suppose 4k + 968 = -4b, -10b + k = -12b - 482. Let f = b + 370. Let v = f - 9. What is the tens digit of v? 2 Let d = 37 - 7. Suppose 2i + 1 = -7n + 6n, -3n = 5i + 3. Suppose i = 3z - d - 141. What is the tens digit of z? 5 Suppose 116792 = 4k - 4p, -151585 + 34802 = -4k + p. What is the hundreds digit of k? 1 Let f = -7637 - -33399. What is the ten thousands digit of f? 2 Let l(s) = 3s*2 + 29s - 7. Let t(i) = i*2 + i. Let b(p) = -l(p) + 6t(p). What is the tens digit of b(16)? 0 Suppose 16n = 14n + 10. Suppose 4s = -na + 31, -4a - s - 2s + 24 = 0. Suppose -ah = -6, -r - 2r - h = -452. What is the units digit of r? 0 Let u(o) = o*3 - 9o*2 - 8o - 10. Let a be u(10). Suppose -ay = 3037 - 907. Let t = y - -324. What is the units digit of t? 1 Suppose -6h + 2h = -2p + 34, 2p = 3h + 33. Let y be 3/(7/(140/p)). Suppose -yt - w + 348 = 0, 0 = -2t + 4t + 3w - 184. What is the tens digit of t? 8 Let s be (-2)/(-4 + (-28)/(-8)). Suppose -3f + 16 = -2f + 3t, -st = -16. What is the units digit of f? 4 Let o(r) = -r*3 + 10r*2 - 7r - 10. Let m be o(9). Suppose -ma - 6 = 2. What is the units digit of (-9)/(a/(-2) + 39/(-60))? 0 Let m(s) = 10s + 2034. What is the tens digit of m(0)? 3 Let v(k) = 600k2 + 47k - 418. What is the ten thousands digit of v(8)? 3 Let j be 1/6 + 3908/24. Let y = -87 + j. What is the tens digit of y? 7 Suppose 3b + 2y = 13600, -2473 - 20203 = -5b - y. What is the units digit of b? 6 Let f = -96 - -104. What is the units digit of 16/f(506/4 + 1)? 5 Let d(q) = 12q2 - 86q + 1307. What is the thousands digit of d(31)? 0 What is the units digit of (-30)/(-42) + -2735(-663)/455? 6 Suppose 7j + 21 = 301. Let q = 173 + j. Let c = q + -145. What is the units digit of c? 8 Suppose -4r - 3n = -64, -3r - 2n = -39 - 10. Suppose 15b = rb + 248. Let p = b + 114. What is the units digit of p? 2 Suppose -y = 9y - 40. Suppose 1 = -yk + 25. Suppose 0c = kc - 618. What is the tens digit of c? 0 Suppose -924 = 7y - 0y. Let m be -237 + (-4 - (0 - 2)). Let f = y - m. What is the tens digit of f? 0 Suppose 2b = 4z - 126424 + 22378, 5z - 2b = 130057. What is the units digit of z? 1 What is the units digit of 18 - -9057 - -15 - -101? 0 Suppose -3k + 48 = 453. Let n = k + 105. Let d = n + 163. What is the tens digit of d? 3 Let c = 686 - 684. Let l be 1(4 - -2) - 3. Suppose lo + 2d - 634 = 0, -co + 2d + 505 = 69. What is the tens digit of o? 1 What is the hundreds digit of (81/15 - -3)(20 - -1075)? 1 Let c be (-5 - 0) + -11 + 54. Let d(x) = 13x - 186. What is the hundreds digit of d(c)? 3 Suppose 8g = 14823 + 25633. What is the thousands digit of g? 5 Let p = -695 + 253. Let o = p + 921. What is the units digit of o? 9 Suppose 19 = 5g + 5a - 6, 4a = g. What is the units digit of 1/g - (26621/(-28) - -10)? 1 Suppose -l - 12q = -8q - 11490, -17q = -85. What is the hundreds digit of l? 4 Suppose -96507 + 526254 = 25h - 47403. What is the tens digit of h? 8 Suppose -3911 = -7b + 548. Let u = 904 - b. What is the tens digit of u? 6 Let l = 101 - 101. Suppose l = 34z - 37z + 12. Suppose 0a - 3y + 42 = a, 4a = -zy + 208. What is the units digit of a? 7 Let o(y) = 62y2 + 1376y + 37. What is the hundreds digit of o(-30)? 5 Let v(o) = -72o + 7091. What is the ten thousands digit of v(-120)? 1 Suppose -3s = 3z - 16964 + 2540, -z = 2. What is the hundreds digit of s? 8 Let z = -8051 + 12405. What is the tens digit of z? 5 Suppose 5c - 166 = 29. Let r = c - -52. What is the tens digit of r? 9 Suppose 2l - 7l = -30. Let i = 216 - 244. What is the tens digit of (i/(-3))/(l/9)? 1 Let l(y) = -216y3 - 3y*2 - 2y + 5. Let k be l(-2). Let o = k + -1017. What is the hundreds digit of o? 7 Let w(j) = j*3 + 5j2 + j + 7. Let z(c) = c3 + c*2 + c - 5. Let n be z(0). Let o be w(n). Suppose -5 + 21 = op. What is the units digit of p? 8 Let k(y) = -6y3 - 4y*2 - 4y - 1. Let c be k(-1). Suppose -2021 = -5l + 3u - 157, -cu - 1128 = -3l. Let r = l + -107. What is the hundreds digit of r? 2 What is the units digit of -1 - (9 - (26978 - (8 - 5)))? 5 Let j = -3631 + 9168. What is the thousands digit of j? 5 Let y(u) = -4u2 + 146u + 76. Let d be y(37). Suppose -4z - 2i = -8234, -3i - 2184 - 1913 = -dz. What is the units digit of z? 6 Suppose -2r = -3r. Suppose -16f = -426 - 1238. What is the units digit of f/1 - 3 - r? 1 Let p(h) = 7h*2 - 20h + 78. Let k(l) = -3l2 + 10l - 40. Let x(r) = 5k(r) + 3p(r). What is the units digit of x(13)? 8 Suppose 10m - 1067 = 2173. Suppose -m = -p - 77. What is the units digit of p? 7 Let u(i) be the third derivative of -i6/120 + 17i*5/60 - 5i*4/24 - 11i*3/3 - 12i*2 + 4. What is the tens digit of u(8)? 1 Let h(a) = 317a*2 + 231a - 688. What is the units digit of h(3)? 8 Let r = -2229 + 3814. What is the tens digit of r? 8 Let v = 59 - -58. Let k = 281 - v. Suppose k = -3f + 5f. What is the tens digit of f? 8 Suppose -96w = -8w - 2234320. What is the units digit of w? 0 Let r be (-2)/12 - 143/78. Let d(s) be the third derivative of 7s5/20 + s4/24 - s3/3 + 6s*2. What is the units digit of d(r)? 0 Let t be (-35)/14(-2416)/10. What is the hundreds digit of (-8 - -1 - -41) + t? 6 Let q(y) = -6082y + 400. What is the units digit of q(-1)? 2 Suppose 0 = -7y - 205 + 177. What is the hundreds digit of 6 - -390 - y? 2 Let k(w) = -5w + 122. Suppose -17 + 38 = i. What is the units digit of k(i)? 7 Suppose -8c + 18 = -2c. Suppose -cu = 3, 3u - 6u = -5i + 3148. What is the units digit of i? 9 Suppose -3390 = 12k + 26910. Let q = k + 3563. What is the thousands digit of q? 1 Let f(t) = t*3 + 44t*2 + 48t + 114. What is the tens digit of f(-37)? 2 Suppose 0 = -19y - 36y + 829125. What is the units digit of y? 5 Let k(u) = u*2 - 16u + 30. Let h be k(14). Suppose 0 = -hf + 2 + 6, -w + 4f = 298. Let a = w + 405. What is the tens digit of a? 2 Suppose -73 = 6h + 1055. Let k = 32 - h. What is the units digit of k? 0 Let o = 33037 - 8789. What is the hundreds digit of o? 2 Suppose -29k + 50k - 65604 = 0. What is the tens digit of k? 2 Suppose 2f + 3f - 4k - 30 = 0, 2f + 4k = 40. What is the tens digit of (-1 - -3) + 41015/f? 1 Let f be 12/20 - (-17)/(340/1048). Suppose 2l - 5i = 249, i = l - i - 124. Let b = l - f. What is the units digit of b? 9 Suppose 11j - 2015 = 5784. Suppose 19v - 868 = j. What is the units digit of v? 3 Let z be 1/((10/4)/5). Let f(s) = 2s*2 - 61s + 170. Let t be f(3). Suppose -4a + 725 = -tn, -za + n + 375 = -4n. What is the hundreds digit of a? 1 Let x(l) be the second derivative of 7l3/6 + 105l*2/2 + 42l. What is the units digit of x(37)? 4 Suppose 4r + 0r + 316 = 0. Suppose 14c - 15c + 158 = 4n, -2c = 3n - 326. Let l = c + r. What is the units digit of l? 7 Let a(t) = t3 - 24t*2 + 84t - 35. Let z be a(19). Let y = 1411 + z. What is the hun	{ "pile_set_name": "DM Mathematics" }
nd 12:18 AM? 456 What is 559 minutes after 2:12 AM? 11:31 AM What is 552 minutes before 8:18 AM? 11:06 PM What is 171 minutes after 9:17 AM? 12:08 PM How many minutes are there between 9:59 AM and 11:49 AM? 110 What is 634 minutes before 2:06 PM? 3:32 AM What is 387 minutes before 4:35 AM? 10:08 PM What is 186 minutes after 3:24 PM? 6:30 PM What is 91 minutes after 8:07 PM? 9:38 PM How many minutes are there between 6:42 AM and 12:36 PM? 354 What is 14 minutes before 9:57 PM? 9:43 PM What is 376 minutes after 7:47 AM? 2:03 PM What is 444 minutes before 3:55 AM? 8:31 PM How many minutes are there between 12:51 PM and 6:28 PM? 337 How many minutes are there between 9:38 PM and 2:29 AM? 291 What is 576 minutes after 3:52 PM? 1:28 AM How many minutes are there between 7:32 AM and 11:23 AM? 231 How many minutes are there between 1:11 AM and 11:58 AM? 647 What is 672 minutes before 3:36 AM? 4:24 PM How many minutes are there between 6:43 PM and 1:39 AM? 416 What is 549 minutes after 2:56 AM? 12:05 PM How many minutes are there between 12:27 PM and 8:39 PM? 492 What is 209 minutes after 9:39 AM? 1:08 PM How many minutes are there between 11:15 AM and 7:39 PM? 504 How many minutes are there between 5:59 PM and 8:27 PM? 148 How many minutes are there between 6:40 AM and 1:38 PM? 418 How many minutes are there between 9:07 AM and 12:21 PM? 194 How many minutes are there between 8:00 PM and 3:08 AM? 428 What is 568 minutes after 9:58 AM? 7:26 PM What is 52 minutes after 4:50 PM? 5:42 PM What is 446 minutes after 3:52 PM? 11:18 PM What is 159 minutes before 11:31 PM? 8:52 PM How many minutes are there between 12:01 PM and 2:23 PM? 142 What is 126 minutes after 12:06 PM? 2:12 PM How many minutes are there between 4:36 PM and 1:55 AM? 559 How many minutes are there between 10:44 PM and 12:44 AM? 120 How many minutes are there between 12:25 AM and 7:58 AM? 453 What is 488 minutes after 4:45 AM? 12:53 PM What is 687 minutes before 2:37 PM? 3:10 AM What is 130 minutes before 12:09 PM? 9:59 AM What is 702 minutes after 1:46 AM? 1:28 PM How many minutes are there between 7:09 AM and 6:34 PM? 685 What is 366 minutes before 5:52 AM? 11:46 PM How many minutes are there between 11:27 AM and 7:38 PM? 491 What is 194 minutes before 6:22 PM? 3:08 PM What is 20 minutes before 11:30 PM? 11:10 PM What is 543 minutes after 8:46 PM? 5:49 AM What is 277 minutes before 10:50 AM? 6:13 AM What is 89 minutes after 3:40 PM? 5:09 PM What is 641 minutes after 7:21 PM? 6:02 AM How many minutes are there between 2:49 PM and 8:44 PM? 355 What is 457 minutes before 10:57 AM? 3:20 AM How many minutes are there between 6:59 AM and 10:13 AM? 194 What is 296 minutes after 11:04 PM? 4:00 AM What is 260 minutes before 12:04 PM? 7:44 AM What is 657 minutes after 2:27 PM? 1:24 AM How many minutes are there between 8:30 AM and 1:16 PM? 286 How many minutes are there between 4:48 AM and 9:40 AM? 292 What is 170 minutes after 9:56 PM? 12:46 AM How many minutes are there between 8:21 PM and 5:07 AM? 526 What is 439 minutes after 7:37 AM? 2:56 PM What is 700 minutes after 1:56 AM? 1:36 PM What is 104 minutes before 3:25 PM? 1:41 PM What is 719 minutes before 11:32 AM? 11:33 PM What is 6 minutes before 6:07 PM? 6:01 PM How many minutes are there between 12:51 PM and 12:50 AM? 719 What is 586 minutes after 12:39 PM? 10:25 PM What is 126 minutes before 1:12 AM? 11:06 PM What is 173 minutes after 7:44 AM? 10:37 AM What is 458 minutes after 7:21 AM? 2:59 PM How many minutes are there between 5:14 PM and 12:24 AM? 430 How many minutes are there between 1:18 PM and 4:23 PM? 185 What is 52 minutes before 2:23 PM? 1:31 PM What is 568 minutes after 1:40 AM? 11:08 AM What is 496 minutes after 9:03 PM? 5:19 AM How many minutes are there between 8:44 AM and 9:33 AM? 49 How many minutes are there between 2:48 PM and 3:30 PM? 42 How many minutes are there between 12:25 AM and 3:20 AM? 175 How many minutes are there between 12:10 PM and 6:58 PM? 408 How many minutes are there between 5:59 PM and 12:40 AM? 401 How many minutes are there between 12:36 AM and 1:17 AM? 41 What is 625 minutes after 9:45 PM? 8:10 AM What is 556 minutes after 8:00 AM? 5:16 PM How many minutes are there between 4:01 AM and 3:06 PM? 665 How many minutes are there between 12:56 PM and 12:27 AM? 691 How many minutes are there between 11:06 AM and 11:57 AM? 51 How many minutes are there between 6:27 PM and 5:01 AM? 634 What is 470 minutes before 1:40 AM? 5:50 PM What is 194 minutes after 3:53 PM? 7:07 PM What is 507 minutes after 6:47 PM? 3:14 AM How many minutes are there between 9:31 AM and 9:40 AM? 9 How many minutes are there between 8:33 AM and 3:45 PM? 432 What is 687 minutes after 2:40 PM? 2:07 AM How many minutes are there between 7:27 PM and 9:24 PM? 117 How many minutes are there between 5:56 AM and 2:07 PM? 491 What is 300 minutes after 9:22 AM? 2:22 PM What is 439 minutes before 10:00 PM? 2:41 PM What is 148 minutes before 1:55 AM? 11:27 PM What is 175 minutes after 12:39 PM? 3:34 PM How many minutes are there between 9:16 PM and 8:53 AM? 697 What is 558 minutes before 8:26 PM? 11:08 AM How many minutes are there between 9:57 AM and 6:55 PM? 538 How many minutes are there between 1:08 PM and 12:53 AM? 705 What is 231 minutes before 10:27 PM? 6:36 PM What is 609 minutes after 4:34 AM? 2:43 PM How many minutes are there between 11:07 PM and 8:43 AM? 576 What is 454 minutes after 1:58 PM? 9:32 PM What is 607 minutes after 1:22 AM? 11:29 AM What is 428 minutes before 3:37 PM? 8:29 AM How many minutes are there between 11:05 AM and 12:49 PM? 104 What is 283 minutes before 7:30 AM? 2:47 AM What is 675 minutes after 3:59 AM? 3:14 PM How many minutes are there between 8:28 PM and 6:12 AM? 584 What is 92 minutes before 6:56 AM? 5:24 AM What is 462 minutes before 5:13 AM? 9:31 PM What is 171 minutes before 4:02 PM? 1:11 PM What is 448 minutes before 5:41 PM? 10:13 AM How many minutes are there between 10:12 AM and 10:02 PM? 710 How many minutes are there between 2:07 PM and 3:01 PM? 54 How many minutes are there between 10:20 AM and 3:29 PM? 309 How many minutes are there between 7:31 AM and 3:47 PM? 496 What is 706 minutes after 5:10 PM? 4:56 AM What is 223 minutes after 6:06 AM? 9:49 AM How many minutes are there between 3:33 AM and 8:46 AM? 313 What is 480 minutes after 7:16 PM? 3:16 AM How many minutes are there between 2:25 AM and 7:14 AM? 289 How many minutes are there between 12:37 PM and 8:24 PM? 467 What is 265 minutes after 3:29 AM? 7:54 AM What is 77 minutes before 8:18 PM? 7:01 PM What is 42 minutes before 11:07 AM? 10:25 AM How many minutes are there between 11:01 AM and 1:54 PM? 173 How many minutes are there between 12:16 PM and 12:04 AM? 708 How many minutes are there between 5:40 PM and 6:22 PM? 42 What is 706 minutes before 6:58 PM? 7:12 AM How many minutes are there between 5:14 PM and 11:27 PM? 373 What is 625 minutes after 1:22 AM? 11:47 AM What is 391 minutes before 9:05 PM? 2:34 PM What is 71 minutes before 8:06 PM? 6:55 PM What is 582 minutes after 1:30 AM? 11:12 AM How many minutes are there between 10:45 PM and 3:37 AM? 292 What is 53 minutes after 7:52 AM? 8:45 AM What is 91 minutes after 4:13 PM? 5:44 PM What is 249 minutes after 7:52 AM? 12:01 PM What is 155 minutes before 4:51 PM? 2:16 PM What is 359 minutes before 6:03 PM? 12:04 PM How many minutes are there between 12:36 AM and 4:05 AM? 209 What is 581 minutes before 3:22 PM? 5:41 AM What is 101 minutes after 1:39 PM? 3:20 PM What is 315 minutes before 7:25 PM? 2:10 PM How many minutes are there between 11:53 PM and 3:24 AM? 211 What is 374 minutes after 12:55 PM? 7:09 PM How many minutes are there between 2:19 PM and 2:14 AM? 715 How many minutes are there between 1:45 PM and 12:12 AM? 627 How many minutes are there between 6:19 PM and 3:49 AM? 570 How many minutes are there between 3:08 PM and 10:51 PM? 463 How many minutes are there between 4:37 PM and 1:55 AM? 558 What is 36 minutes after 12:30 PM? 1:06 PM How many minutes are there between 4:54 PM and 2:26 AM? 572 What is 367 minutes before 5:14 PM? 11:07 AM How many minutes are there between 3:39 PM and 7:10 PM? 211 How many minutes are there between 4:55 AM and 8:59 AM? 244 How many minutes are th	{ "pile_set_name": "DM Mathematics" }
7) Simplify (g(3/4))(7/2) assuming g is positive. g*(21/8) Simplify gg/(ggg*(2/3))gggg/(g/g(1/2))g/((((g/g*(-1/9))/g)/gg)/g)gg((g(1/3)/g)/g)/g assuming g is positive. g(73/18) Simplify h(-6)/h(-2/35) assuming h is positive. h(-208/35) Simplify v18vv(-1/8) assuming v is positive. v(151/8) Simplify (j(-1/7)j(-10))(5/12) assuming j is positive. j(-355/84) Simplify s(13/4)s(17/5) assuming s is positive. s(133/20) Simplify cc/(ccc/(cc(2/11)))c/(cc1/c)(c(-2/5))(-7/10) assuming c is positive. c(127/275) Simplify (z(-2/3)z)(-5/6) assuming z is positive. z(-5/18) Simplify d(-6)d*2d(d(-6/5)/d)/(d(2/13)d) assuming d is positive. d(-413/65) Simplify ((j/j(-2/9))/j)/(j*9j)j(-2/3)j1/j assuming j is positive. j(-94/9) Simplify (b(1/6)/(b(4/3)b))(-21) assuming b is positive. b(91/2) Simplify ((jj(3/5))/(j(-3/7)/j))28 assuming j is positive. j(424/5) Simplify (qq12)/qq/(qq/q(1/10)qq) assuming q is positive. q(91/10) Simplify (t(1/2))(-4) assuming t is positive. t(-2) Simplify (d(5/2))7 assuming d is positive. d(35/2) Simplify (r/(rr(-2/19)))0 assuming r is positive. 1 Simplify (o*(-1)/ooo)(-23)o*(1/3)/(ooo(-1)) assuming o is positive. o(-2/3) Simplify (((ff*(1/3)f)/f)/f)/(f/(f/(f/f*(-5)f))) assuming f is positive. f(-20/3) Simplify ((w(-12)w)/w)/((w/w(-11)w)/w) assuming w is positive. w(-24) Simplify (f5/f)(-8/3) assuming f is positive. f(-32/3) Simplify (b*8b)/b*6bb/b4b/(b(bb*(-6)bb)/b)b assuming b is positive. b6 Simplify b/(b/b17)b(-24) assuming b is positive. b(-7) Simplify ((h1/h)8)(48/7) assuming h is positive. 1 Simplify (b(1/5))(-19)/(b2)(-26/7) assuming b is positive. b(127/35) Simplify (bbb(-2/3))2 assuming b is positive. b(8/3) Simplify ((ccc/(c/c(-1/9))c)/((c/(cc(-2/7)c))/c))(-2/5) assuming c is positive. c(-116/63) Simplify (m*(-7/3)mm)/(m(-1/38)/m) assuming m is positive. m(79/114) Simplify (v(2/41)/(vvv(-2/17)))(-5/8) assuming v is positive. v(3195/2788) Simplify (w(-1/4)/w)(1/6)(w*(-2/5)w)32 assuming w is positive. w(2279/120) Simplify (v/(vvv(-3/2)))(-21/8) assuming v is positive. v*(-21/16) Simplify (qq*(-4)/qq(-9))(-2) assuming q is positive. q26 Simplify (w(-5/6)w/(w(-2/13)/www))/(w(1/2))(-10/13) assuming w is positive. w(-23/78) Simplify ((dd*(-3))/d)/(((dd*(1/2))/dd)/d)(d(-2/5))(-41) assuming d is positive. d(129/10) Simplify (((j/(j/(j/(jj/(j*0/j)j))jj))/j)15)7 assuming j is positive. j*(-630) Simplify (b/(bbb/(b7b)))/(bb/b6)b*10bb(-3/7) assuming b is positive. b(144/7) Simplify ((c6/c)/(c(-2)c))(-32) assuming c is positive. c(-192) Simplify (i/(((i*(-3)ii)/i)/i))/((i/(ii(3/17)))/i) assuming i is positive. i(88/17) Simplify (f*3f(1/4)/f)/(f/f(2/7))23 assuming f is positive. f(-397/28) Simplify ii36iii/i(-3/11) assuming i is positive. i(443/11) Simplify kk(1/5)(k*(2/51)k)/k assuming k is positive. k*(316/255) Simplify ((nn(-1))/n)(3/25)n(-1/8)n*(2/15)n assuming n is positive. n(533/600) Simplify (g/((g1g)/g))(-24)(gg/g(-2)g)(-20/9) assuming g is positive. g(-100/9) Simplify (mm9)(-2/15) assuming m is positive. m(-4/3) Simplify (m1/m)(1/18)(m(-3))(-13) assuming m is positive. m39 Simplify u/(u/(u/((u(-13)u)/u)))(u/u26)/u assuming u is positive. u(-12) Simplify y18/y(-1/4) assuming y is positive. y*(73/4) Simplify mm*(-1/2)/mm*(2/3)(m/(m((mm*(-1))/m)/m)m)(-1/3) assuming m is positive. m(-5/6) Simplify (q2)(-7/3)/(q(-9)/(q(1/10)/q)) assuming q is positive. q(103/30) Simplify (u6/(uuu*5u))/(uu/(uu/u*(-3/8))u/(uu(-6)u)) assuming u is positive. u*(-53/8) Simplify (((yy(-5))/y)/(y(3/7)/y))(-5/13) assuming y is positive. y(155/91) Simplify (bb0b)/(b*(-2)b)(b(-1/3))47 assuming b is positive. b(-38/3) Simplify (u(-1/6)/((u2uu)/u))/(u/(u(-1/5)/u)u(u(2/9)/uu)/u) assuming u is positive. u*(-503/90) Simplify (o/(o/(oo*(-20)o)))/(o(-1/7)/o) assuming o is positive. o(-118/7) Simplify (zz(-1/3))(18/7) assuming z is positive. z(12/7) Simplify ((y/(y(2/9)/y))/y(-1/4))/(y(-2)y(-3)) assuming y is positive. y(253/36) Simplify (t3)14/(t*(-2/25)(t(-5)/t)/t) assuming t is positive. t(1227/25) Simplify g/(g/(g/(g/(g/g*(1/17))gg)))g*22g assuming g is positive. g(373/17) Simplify (a(-3)(aa*(-1/3))/aa)/(a*(2/19)/aa(2/15)/a) assuming a is positive. a(-163/285) Simplify (t(-4/7)/(t/t(1/6)))(10/17) assuming t is positive. t(-295/357) Simplify ((w/w(-3))/w)(-1/31) assuming w is positive. w*(-3/31) Simplify (ww(w/((ww*(1/3))/ww))/ww/(w10w))/(w*1ww(-5)) assuming w is positive. w(-19/3) Simplify ((vv/(vvv/(v*4/vv)v))/v(5/4))(-30) assuming v is positive. v(-45/2) Simplify ((gg*(-1)g)/gggg/(g/(g6/g)))(-4/3) assuming g is positive. g(-28/3) Simplify (c/c(-2/17))/(c/(cc*(-3/10)))c/(ccc*(-9))ccc/c(2/13) assuming c is positive. c(25777/2210) Simplify (w2/w(-2/19))(16/9) assuming w is positive. w(640/171) Simplify (d(1/9)/d)/(d/d(3/10)) assuming d is positive. d(-143/90) Simplify w(-5)/(w*7/w)w*(-2/3)/w((ww/(w/(w(ww(3/2))/w))ww)/w)/w assuming w is positive. w(-55/6) Simplify (z(4/3)z*(1/3)/z)/((z(zz(2/3))/z)/z)(29/3) assuming z is positive. z(-52/9) Simplify (l0)(-50) assuming l is positive. 1 Simplify g(-2/11)g(-6) assuming g is positive. g(-68/11) Simplify (jj(2/13))/(j(1/11)/j)j*(3/10)j*(-4)j assuming j is positive. j*(-911/1430) Simplify (d/(dd*(2/43))d)/d(d/(dd/(d/(dddd(2/89)d))))/d assuming d is positive. d*(-19399/3827) Simplify (ll*(3/2))/((ll/((l*(2/7)/l)/l)l)/l) assuming l is positive. l(-17/14) Simplify (k(2/11))(-37)/((k/(k/(k/((k/(k(-6)/k))/k))))/(k(k(2/7)/k)/k)) assuming k is positive. k(-111/77) Simplify y(-4)/(y/y(-2)yy)y(-3/8)/(y(-4)/y) assuming y is positive. y(-35/8) Simplify (a(-7)a((aaa*(-1/2))/a)/a)/(a((a*2/a)/a)/aa*(-4)/aaa) assuming a is positive. a(-7/2) Simplify ((jj(1/4))/j)(2/35)/((j/(j(1/5)/j))/j(2/9)) assuming j is positive. j(-197/126) Simplify (((k1k)/k)(5/6))(-3/7) assuming k is positive. k(-5/14) Simplify ((c(-2)/c)/c)(3/25)/((c/(cc*(-9)c))/(c(1/5)/c)) assuming c is positive. c(-232/25) Simplify (tt(-1/5)t*(2/7))/(tt/(t/t*(-4))t(-1)) assuming t is positive. t(178/35) Simplify ((o/((o*(-3)o)/o))18)(-20) assuming o is positive. o*(-1440) Simplify (ss*5s)/s(1/7) assuming s is positive. s(48/7) Simplify (d*6ddd0)(6/7) assuming d is positive. d(48/7) Simplify ((n(1/3))(-4/5))(-21) assuming n is positive. n*(28/5) Simplify (kk0)(-6)k/k(-2/9)kkk1 assuming k is positive. k(-16/9) Simplify ((nn0nn)(-50))(-3/23) assuming n is positive. n(450/23) Simplify l(1/17)/(l/l(-7)) assuming l is positive. l(-135/17) Simplify (z/(z/((((z/((z(2/7)/z)/z))/z)/z)/z)))(-6/35) assuming z is positive. z(12/245) Simplify (t(2/17))(-33) assuming t is positive. t(-66/17) Simplify (x(2/3))35x*(4/5)xx(1/4) assuming x is positive. x(1523/60) Simplify (c(-1/3))(-25)/(cc/(cc0)(c/c4)/c) assuming c is positive. c(34/3) Simplify ((x(2/7)/x)(-2/63))(-2/7) assuming x is positive. x(-20/3087) Simplify (((v*(-1)/vv)/v)(-2/7))(5/9) assuming v is positive. v(20/63) Simplify (u(1/2)/u)(-17)/(u8u(-6)) assuming u is positive. u(13/2) Simplify (((dd/(dd(-4/3))d)/dd)/dd((ddd(-1/3)/d)/d)/d)(-7) assuming d is positive. d(-14) Simplify (((t(1/4)/t)/tt)/t8)/(((t(-2/3)t)/t)/t(3/7)) assuming t is positive. t(-643/84) Simplify (((t/t15)/t)/t)(-15) assuming t is positive. t240 Simplify a(-3/13)/(aa*(-11)a) assuming a is positive. a(114/13) Simplify d/(d(-1/2)/d)dd*(-1/3)d assuming d is positive. d(25/6) Simplify (r0)(-49)/(r0)**(3/8)	{ "pile_set_name": "DM Mathematics" }
576979.3 Convert 8.572013 micrometers to nanometers. 8572.013 How many milliseconds are there in 2103.299 hours? 7571876400 Convert 38296.68 weeks to seconds. 23161832064 Convert 848.184 months to years. 70.682 What is 1/20 of a litre in millilitres? 50 How many months are there in twenty-seven quarters of a year? 81 How many micrometers are there in 813161.8 kilometers? 813161800000000 What is 73282.36 years in millennia? 73.28236 What is 7/8 of a centimeter in micrometers? 8750 What is 2.40633 millilitres in litres? 0.00240633 How many meters are there in thirteen quarters of a kilometer? 3250 What is 324.3071 hours in nanoseconds? 1167505560000000 How many seconds are there in 11/10 of a day? 95040 What is 7/8 of a decade in months? 105 What is 433.8486 microseconds in seconds? 0.0004338486 How many months are there in 0.3103609 years? 3.7243308 What is 1/4 of a litre in millilitres? 250 How many micrometers are there in 37/5 of a centimeter? 74000 How many minutes are there in 3/10 of a hour? 18 What is 0.5634932 centuries in decades? 5.634932 What is 72/5 of a litre in millilitres? 14400 What is 2213.699 micrograms in milligrams? 2.213699 What is 2555.63532ns in days? 0.0000000000295791125 Convert 447.3581t to kilograms. 447358.1 What is thirteen quarters of a millennium in months? 39000 How many seconds are there in 3/5 of a minute? 36 What is 9/10 of a micrometer in nanometers? 900 What is 73/4 of a litre in millilitres? 18250 What is fourty-nine fifths of a gram in milligrams? 9800 How many years are there in three eighths of a millennium? 375 What is 41/2 of a tonne in kilograms? 20500 What is eleven eighths of a litre in millilitres? 1375 Convert 9.05582 micrometers to nanometers. 9055.82 How many nanometers are there in 3/5 of a micrometer? 600 How many kilograms are there in thirteen eighths of a tonne? 1625 How many months are there in 0.04972 centuries? 59.664 How many nanograms are there in 867.699ug? 867699 What is 991.6485 hours in microseconds? 3569934600000 What is seven halves of a litre in millilitres? 3500 How many micrograms are there in 8.046952t? 8046952000000 Convert 8918.383 litres to millilitres. 8918383 How many centuries are there in 73.51512 millennia? 735.1512 How many centuries are there in 3/10 of a millennium? 3 What is 7.223059ml in litres? 0.007223059 What is 8.187513ns in seconds? 0.000000008187513 What is one fifteenth of a century in months? 80 What is 13/4 of a millennium in years? 3250 Convert 9.006289ng to milligrams. 0.000009006289 How many grams are there in 11/4 of a kilogram? 2750 How many months are there in thirty-three fifths of a century? 7920 What is 7.8711822 minutes in days? 0.00546609875 Convert 5.265762 millennia to years. 5265.762 What is 1/5 of a milligram in micrograms? 200 What is 93.31654 centuries in years? 9331.654 How many micrometers are there in 98146.31 meters? 98146310000 How many minutes are there in 2/15 of a week? 1344 What is 3/5 of a hour in seconds? 2160 How many nanometers are there in 32/5 of a micrometer? 6400 Convert 40711.23us to hours. 0.000011308675 How many microseconds are there in fifty-one quarters of a millisecond? 12750 How many centimeters are there in 1/4 of a kilometer? 25000 How many nanometers are there in thirty-one halves of a micrometer? 15500 What is 8/25 of a meter in millimeters? 320 How many millilitres are there in fifty-four fifths of a litre? 10800 What is 74/5 of a centimeter in millimeters? 148 How many decades are there in 0.1821346 years? 0.01821346 How many centimeters are there in 18/5 of a meter? 360 How many millilitres are there in 29.34106 litres? 29341.06 What is 0.8235232 millilitres in litres? 0.0008235232 What is 49/5 of a microgram in nanograms? 9800 What is 8864.094l in millilitres? 8864094 What is 64/5 of a millisecond in microseconds? 12800 What is twenty-one halves of a day in hours? 252 How many days are there in 2/7 of a week? 2 What is 6/25 of a meter in centimeters? 24 How many months are there in 32/5 of a millennium? 76800 What is 37/5 of a centimeter in micrometers? 74000 How many months are there in 727.3076 millennia? 8727691.2 How many nanograms are there in 3/10 of a microgram? 300 How many seconds are there in 6/25 of a day? 20736 Convert 0.5916815 centuries to months. 710.0178 What is 1/4 of a tonne in kilograms? 250 How many nanograms are there in thirteen fifths of a microgram? 2600 Convert 99331.82mg to kilograms. 0.09933182 What is nineteen quarters of a second in milliseconds? 4750 How many nanometers are there in 1/4 of a micrometer? 250 What is 806649.2 litres in millilitres? 806649200 What is seven quarters of a meter in millimeters? 1750 How many millilitres are there in 11/8 of a litre? 1375 How many nanoseconds are there in 3/40 of a microsecond? 75 Convert 59.78607m to kilometers. 0.05978607 What is 0.3585732t in milligrams? 358573200 What is one fifteenth of a week in minutes? 672 What is 1/20 of a second in microseconds? 50000 How many hours are there in twenty-eight thirds of a week? 1568 What is 1/4 of a micrometer in nanometers? 250 What is 4740.692mg in kilograms? 0.004740692 What is 0.8686938l in millilitres? 868.6938 How many micrograms are there in 45.07778 tonnes? 45077780000000 What is eleven quarters of a litre in millilitres? 2750 What is five quarters of a meter in centimeters? 125 What is five quarters of a minute in seconds? 75 What is 41930.22mg in kilograms? 0.04193022 Convert 68566.1g to kilograms. 68.5661 What is fourty-six fifths of a litre in millilitres? 9200 How many hours are there in 61/4 of a day? 366 Convert 0.7302057 minutes to seconds. 43.812342 How many years are there in 7425.396 centuries? 742539.6 How many seconds are there in seven quarters of a minute? 105 Convert 198461.655 hours to weeks. 1181.319375 What is 67/5 of a gram in milligrams? 13400 What is fifteen quarters of a millennium in months? 45000 What is 1/10 of a decade in months? 12 What is 32.6422 days in seconds? 2820286.08 Convert 4915.86165ms to weeks. 0.000008128078125 How many millilitres are there in 11/4 of a litre? 2750 What is 325.1576 millilitres in litres? 0.3251576 Convert 1076396.1 months to decades. 8969.9675 How many seconds are there in 4/15 of a hour? 960 How many milligrams are there in three eighths of a gram? 375 How many millilitres are there in thirteen fifths of a litre? 2600 How many litres are there in 92719.43 millilitres? 92.71943 What is 3/40 of a milligram in micrograms? 75 How many millilitres are there in 0.2934671l? 293.4671 Convert 5383.82g to tonnes. 0.00538382 How many millilitres are there in 7675.838 litres? 7675838 How many millilitres are there in 91.63931 litres? 91639.31 What is 53/4 of a hour in seconds? 47700 What is three fifths of a kilometer in meters? 600 What is 1/4 of a centimeter in micrometers? 2500 What is seven eighths of a micrometer in nanometers? 875 How many millilitres are there in seven eighths of a litre? 875 What is 1.879943ug in kilograms? 0.000000001879943 What is 14.451057 months in years? 1.20425475 How many kilometers are there in 888.327 centimeters? 0.00888327 How many micrograms are there in 87.54992t? 87549920000000 What is 64281.25um in millimeters? 64.28125 What is 9440.116 tonnes in grams? 9440116000 Convert 5768.142 litres to millilitres. 5768142 How many nanoseconds are there in 3/5 of a microsecond? 600 How many millilitres are there in one fifth of a litre? 200 What is 5/4 of a day in hours? 30 How many months are there in 45/2 of a decade? 2700 What is seven quarters of a tonne in kilograms? 1750 What is 68290.73mg in nanograms? 68290730000 What is one sixteenth of a kilogram in milligrams? 62500 How many kilograms are there in 373.8595ng? 0.0000000003738595 What is 1/15 of a millennium in months? 800 How many millilitres are there in 5/4 of a litre? 1250 How many months are there in thirteen quarters of a year? 39 How many millilitres are there in thirty-one halves of a litre? 15500 How many millilitres are there in 61101.75l? 61101750 What is 3/32 of a millennium in months? 1125 How many months are there in 686.0001 centuries? 823200.12 What is 0.0005774 litres in millilitres? 0.5774 How many litres are there in 3137.673 m	{ "pile_set_name": "DM Mathematics" }
1 - (-12)/(-16)). Suppose 0 = -9c - uc. Solve z + 0z - 4j = -5, 3z - 4j + 15 = c for z. -5 Suppose 21q - 12q = 0. Suppose -5y + 5j - 8 - 2 = 0, 19 = 3y + 2j. Suppose -yg = 2 - 17. Solve -gp - t + 8 = q, -p + 2t + 13 = 6t for p. 1 Suppose -4i + 18 = 134. Let h be 5 - (30/35)/((-6)/(-273)). Let c = i - h. Solve x = -o + 4o - 10, -co + 26 = 3x for o. 4 Let t(r) = -r*3 + 14r*2 + 31r + 18. Let j be t(16). Solve -p - jo - 5 = -3o, 5p + 5o - 5 = 0 for p. -2 Suppose 3y - l - 12 = 0, 54l - 58l + 12 = 0. Solve yz - 1 = 4c, -z + 1 = -3c + 3 for z. 1 Suppose -20p = -28p + 200. Solve p = 5f - 10f + 4h, h = 0 for f. -5 Suppose 2 = 24y - 70. Solve 2r + y + 1 = 2w, 2w = 4r + 4 for w. 2 Let a be ((-8)/6 + 2)-15. Let m = a - -12. Suppose 10 + 14 = mj. Solve 6q - 11 = 3q - 4x, 2q = -5x + j for q. 1 Suppose o = -3n + 46, 0n + 2n + 5o - 35 = 0. Suppose 11a = -n + 59. Solve 5d + 35 = 5h, -d - 6 - 7 = -ah for d. -5 Let f(x) = x + 7. Let g be f(-3). Solve 0 = 2n - 6, c - 2 = -3n + gn for c. 5 Let r(l) = 26l + 135. Let w be r(-5). Solve g + 5 = b - 3b, 4b + 13 = -wg for b. -2 Let a = -705 + 711. Solve 2 = j + y, -y = -2j - 2 - a for j. -2 Let w(n) = -n2 - 5n - 3. Let s be w(-2). Let y be (5/(-3))/((-1)/s). Solve 8 = -2h, -4h + 1 = -3k + y for k. -4 Let v = -25 - -26. Let k be (v2/(-3))/(2/(-9)). Solve -17 = 3d + h, -2h + kh + 7 = -d for d. -5 Suppose -50i = -44i - 18. Solve 3v + 4d = 11, 0 = 3v - 6v + id - 3 for v. 1 Let s(d) = -d*3 + 2d*2 - d + 2. Let h be 3/7 - (-3)/(-7). Let p be s(h). Solve -pw - 4 = -0m + m, w = 2m - 2 for w. -2 Let s(j) be the first derivative of -j*3/3 - 9j*2 - 30j + 2. Let n be s(-16). Solve k + 5 = -ny, 0 = 4k - 2k + 3y + 10 for k. -5 Suppose 13v - 33v = -80. Solve 4r - 5z = 9, 0 = r + vr + 4z - 1 for r. 1 Let z(t) = t*2 + 2t + 4. Let k be z(-3). Solve -2d - k = 2b - d, 0 = -2d + 2 for b. -4 Suppose -25x - 2 = -27x. Solve -w = -3l + 2, -2w - 2w = -5l + x for w. 1 Let b(n) = 3n3 - n2 - n - 5. Let r(v) = -4 + 2v3 + v - 2v + 0. Let h(i) = 3b(i) - 4r(i). Let x be h(3). Solve 2g + 2 = -x, -2c - 2g = 16 for c. -5 Let y = -9 - 7. Let h(b) = b2 + 15b + 9. Let o be h(y). Solve f + 2f + 4j + 23 = 0, 3f + 5j = -o for f. -5 Let f(w) = -w*3 + 9w*2 - 8w + 9. Let r be f(8). Suppose -4x = -r - 3, 2b = x + 5. Solve -2n = bm - 12, -14 = -4m + 3n - 2 for m. 3 Suppose -2r = -x - 10, -3r + 4x + 10 + 10 = 0. Suppose -ri - 11 = 9. Let g = -2 - i. Solve -4z + 5l = z + 10, -gz - 2l = -9 for z. 1 Let w be 828/33 + 2/(-22). Solve -5n - 4 = -5h + 6, 5n + w = 0 for h. -3 Let i = 4 + -2. Let o(j) = 8. Let q(b) = 2b + 17. Let h(g) = -5o(g) + 2q(g). Let p be h(2). Solve pf + 5m = 14, -3m - 1 + 7 = if for f. -3 Let n(t) = 3t - 7. Let w be n(8). Suppose 8 = 5a - w. Solve -2f - 13 = -3f - 2p, -f = ap - 28 for f. 3 Suppose -17t - 2 = -87. Solve -g = -2o - tg + 2, 4o + 3 = -g for o. -1 Suppose -102c + 30 = -96c. Solve ch + 4v = 18, 6h - h + 3v - 16 = 0 for h. 2 Suppose 0x = 4l + 4x, -3l + 3x = -12. Suppose 4w = 4j + 32, -w + 3j - 9 + 27 = 0. Let i = 7592 - 7579. Solve -ld - 5b = i, wb + 3 = -0 for d. -4 Let h be 2/(4 + (-45)/10). Let j be (-1)/((0 + h)/80). Solve 2p = -3o - 8 - 9, -4o = 2p + j for o. -3 Let s(q) = -q2 + 26q - 19. Let p be s(24). Solve -4l - 10 = 2w, -3l = -5w - p + 4 for w. -5 Let q be 23/5 + (-6)/(-15). Suppose -2p + j + 2j + q = 0, -4p + 2j = -14. Solve 5d + 3f = 20, -2d + 6d - pf = 16 for d. 4 Let i be (-1 + (-4)/(-6))/((-32)/576). Let v(y) = 10y - 40. Let s be v(i). Solve m + 2m - 12 = 3u, -5u = 2m + s for m. 0 Suppose -5b + 4b + 5 = -m, b + 1 = 4m. Let u be 1/(-4) + 72/32. Suppose -ug = -bg + 20. Solve 4l + 10 = -2o - 8, gl + o = -15 for l. -3 Let j(u) = -u*2 - 15u - 32. Let n be j(-12). Solve -2r = -nh - 4, -4h + 0r = -3r for h. -3 Suppose -v + 4 = -4r + 3v, -2r + 18 = 2v. Suppose 4s - 24 = rj, 0 = -2s + 3s + 5j. Solve -2b - 7 = -3b + 2w, 0 = sb + 4w + 7 for b. 1 Suppose -5o + 27 = 4o. Solve 5g - 15 = 0, -q = -3q - og + 9 for q. 0 Suppose 0 = 4h + 5n, -3h - 29n + 7 = -27n. Solve -5i + 5 = 0, -hi - 1 = 5f - 2f for f. -2 Let d = 2 - -8. Solve 5b - 11 = -4i - 0b, -5b + d = 5i for i. -1 Let z = 379 - 378. Solve 1 = -2c - z, -4q - 19 = 3c for q. -4 Let q(r) = r3 + 18r*2 - 176r + 3. Let o be q(-25). Let l = 7 - 3. Solve -ln = 4c, -o = c + 3c - 3n for c. -4 Suppose -66p - 11p = 0. Solve 5z + 2r = 16, -2r - 13 + 9 = p for z. 4 Let b be (-4 - 3) + 3 - -25. Let l = -18 + b. Solve c - 12 = 2s, 3c - l = s + 13 for s. -4 Let h(b) = -7b - 24. Let n be h(-4). Suppose -18u + nu = -448. Solve 7g - 4t = 4g - u, 4t = 20 for g. -4 Suppose -6v + 18 = -12. Suppose n + 3 = v. Solve 0 = -h - 5s + 7, -ns = -5h - s - 17 for h. -3 Suppose -y + 5y - 3h - 6 = 0, 21 = 5y + 3h. Suppose yp + 4 = -p, 3z = -4p + 5. Suppose 0 = -27u + 18u + 18. Solve -j + u = x + 3j, -zj = -3 for x. -2 Suppose 0 = 2j - 7j. Suppose jd = -d + 7. Suppose 0 = -w - 5x - 3, 2w + 3x = -3w + d. Solve 5q - 2h = h + 32, -20 = -3q + wh for q. 4 Let z be (20 + -15)/(0 + (-5)/(-4)). Solve -5k + p + z + 24 = 0, -3k + 3 = 4p for k. 5 Suppose 40 = -3f + 4. Let j be (-9)/f + 3/12. Solve 5c + 2t + j = 0, 4c + 5 = 5t - 9 for c. -1 Let s(n) = -n*3 + 17n*2 - 30n. Let q be s(15). Solve -5 = -g - 3u, qu - 15 = -3g + 4u for g. 5 Let w = 1236 + -1235. Solve u = 0, 0n = -n + 3u + w for n. 1 Let t(w) = w*2 + 5. Let x be t(0). Solve -5b + 5 = -xu, u + 9 = -4u + 4b for u. -5 Suppose 3c - 57 = -2y - y, 0 = 5c - 15. Suppose 2n - 12 = y. Let h(k) = k + 13. Let t be h(-10). Solve 2l = -tv - n, -7l = 3v - 2l + 17 for v. -4 Let v(p) = p*2 + 6p - 3. Let y be v(-7). Let o(g) = 2g - 4. Let q be o(y). Let f = -6 + 13. Solve 2w + x - f = 0, 3w - qx = -12 - 5 for w. 1 Let m(k) = k*3 - 18k*2 + 15k + 36. Let c be m(17). Solve -3u = -4a - 17, 0 = cu - 4a - 5 - 13 for u. -1 Let j = -63 - -31. Let q be j/(-40)5 - (-1 - -2). Solve 20 - 2 = qk + 3u, -3k - u = -8 for k. 1 Suppose 0v + 4v + 2 = -3p, 3p - 2v - 28 = 0. Suppose n = pn. Let l be (2/(-4))/(724/(-144) - -5). Solve 3k - f - 17 = n, 2f + 7 = -3k + l for k. 5 Let k(t) = t + 7. Let g be k(-9). Let c(n) = n3 + 2n*2 - n + 1. Let u be c(g). Solve 0s - 17 = -5v - us, -3s = -3v + 15 for v. 4 Suppose -12h - 17 = -14h + 5a, -4a - 7 = 5h. Solve h = -d + c, 7c = 3d + 2c - 1 for d. -3 Let q = 141 - 133. Suppose 5c = c + q. Solve -19 = 5i - cr, 5i + 5 + 5 = 5r for i. -5 Let j(u) = -u2 + 3u + 5u + 5u - 9. Suppose -36 = -y - 24. Let q be j(y). Solve -28 = 5p - 3s, -4p + 3s - 8 = -qp for p. -5 Let t(d) = -d2 + 4d - 9. Let m be t(4). Let s = m + 24. Suppose s = -6z + 9z. Solve -p - 2p + 18 = zi, 0 = -4p - i + 7 for p. 1 Suppose -7l - d = -2l - 14, 3l + 5d = 4. Let b = 74 + -75. Let h be l/b-2 - 1. Solve -hg + 13 = -3u, 0u + 5u - 5g + 5 = 0 for u. 4 Let u = -29 - -33. Let y be 3 - (-3 + (u - 4)). Suppose yp - 15 = p. Solve -3t - 2r = 15, -pr = 8 + 1 for t. -3 Let r(k) = -15k + k*3 + 4 - 7k + 22k. Suppose -o = -0o. Let j be r(o). Solve jm - 4q = -2q + 14, -4m = 4q - 32 for m. 5 Suppose -10 = -l - l. Let i(v) = 4v + 108. Let a be i(-26). Solve -3z + az = lb - 24, -4b + 4z = -16 for b. 5 Let n(z) = -z3 + 2z*2 + 5z - 2. Let l be n(3). Suppose 0 = lq - 0q - 12. Suppose -2o = -3 - 3. Solve 4m - y + o = 0, -m + q - 10 = y for m. -2 Let z(v) = -v*3 - 14v*2 + 13v - 22. Let h be z(-15). Suppose 12m - hm = 16. Solve -o + mc = -5, 3o + 3c - 15 = -0c for o. 5 Suppose 5q - 6q + 25 = 0. Let l be q/7 + 4/(-7). Solve 0 = -5h + ld + 8, -3 = 4d - d for h. 1 Let p be 5/100/(-6). Solve 0 = 4v + 4d - 4, -4d + pd + 2 = 5v for v. -2 Suppose -11i - 12 = 10. Let m be (-3)/4(i - 4/6). Solve -9 = k - 3j, -5k - m = -3k - 2j for k. 3 Let d be -2(12/(-10) + 16/80). Solve dg + 3i - 1 = 0, 2g - 4g + 5i + 25 = 0 for g. 5 Let k = -17 + 24. Let z = 9 - k. Solve zh - 5i + 33 = 0, 8 + 18 = -4h + 2i for h. -4 Let r = -165 - -168. Solve 2f + c = -4*c - 20, -f + c = r	{ "pile_set_name": "DM Mathematics" }
3(q - 1)(q + 227) Determine o so that o*4/5 - 11o*3/5 + 24o*2/5 + 36o/5 = 0. -1, 0, 6 Factor -x*4 + 10x*3 - 24x*2 - 10x + 25. -(x - 5)*2(x - 1)(x + 1) Factor 3d*2 + 270d. 3d(d + 90) Determine p so that 5p4 - 130p*3 + 1205p*2 - 4680p + 6480 = 0. 4, 9 Suppose 4a2 - 776a + 37636 = 0. What is a? 97 Factor 3v5/4 - 29v*4 + 19v3. v3(v - 38)(3v - 2)/4 Factor -2y*4 + 20y*3 + 74y*2 + 52y. -2y(y - 13)(y + 1)(y + 2) Factor 4u5/7 - 156u*4 - 2196u*3/7 - 1100u*2/7. 4u*2(u - 275)(u + 1)2/7 Find i such that -4i*3/7 - 396i*2/7 - 9600i/7 + 10000/7 = 0. -50, 1 What is s in s*5/2 - 8s*4 + 51s*3/2 - 18s*2 = 0? 0, 1, 3, 12 Determine l, given that -3l*5 - 48l*4 - 306l*3 - 972l*2 - 1539l - 972 = 0. -4, -3 Factor -5r4 - 35r*3 - 30r*2. -5r*2(r + 1)(r + 6) Factor -5u*2 + 1760u - 154880. -5(u - 176)2 Factor -36g*3 - 22224g*2 + 14828g - 2472. -4(g + 618)(3g - 1)2 Let -2v*4/5 + 134v*3/5 - 958v*2/5 + 826v/5 = 0. What is v? 0, 1, 7, 59 Factor 3j2 - 78j + 507. 3(j - 13)2 Factor -3r*5 + 12r*4 + 36r*3. -3r*3(r - 6)(r + 2) Factor -2d*4/9 + 2d*3/9 + 2d*2/9 - 2d/9. -2d(d - 1)*2(d + 1)/9 Factor 3o5 - 21o*4 + 45o*3 - 27o*2. 3o*2(o - 3)*2(o - 1) Find n such that -5n2 - 660n - 1300 = 0. -130, -2 Find c such that 5c5/4 + 175c*4/4 - 975c*3/4 + 1025c*2/4 + 485c/2 - 300 = 0. -40, -1, 1, 2, 3 Factor -p*3 + 3p*2 + 4p. -p(p - 4)(p + 1) Solve -f*4/2 + 5f*3/4 + 3f*2/4 = 0 for f. -1/2, 0, 3 Find m such that 2m*3/11 + 474m*2/11 - 476m/11 = 0. -238, 0, 1 Solve 3k3 - 90k*2 + 456k - 576 = 0. 2, 4, 24 Suppose -28t2/9 + 34t/9 - 2/3 = 0. What is t? 3/14, 1 What is j in 44j4/3 + 1372j*3/3 + 12568j*2/3 + 28112j/3 + 1568 = 0? -14, -3, -2/11 Determine f, given that -4f4/9 - 20f*3/9 - 8f*2/3 = 0. -3, -2, 0 Factor 2l*3 - 14828l*2 - 14830l. 2l(l - 7415)(l + 1) Let 2t*2/5 - 122t/5 + 24 = 0. What is t? 1, 60 Factor -6d2/5 + 60d + 954/5. -6(d - 53)(d + 3)/5 Factor -4i2 - 1308i. -4i(i + 327) Factor -4p3/5 + 108p*2/5 - 504p/5. -4p(p - 21)(p - 6)/5 Factor -5j*2 - 18520j - 17149520. -5(j + 1852)2 Suppose -5q*3/3 - 80q*2/3 + 1085q/3 - 1000/3 = 0. What is q? -25, 1, 8 Factor -2x2/17 + 18x/17 + 72/17. -2(x - 12)(x + 3)/17 Suppose -5c2 + 118c + 48 = 0. What is c? -2/5, 24 Solve 8z5/5 + 326z*4/5 - 1114z*3/5 + 1306z*2/5 - 614z/5 + 88/5 = 0. -44, 1/4, 1 Factor -5o2 - 450o - 880. -5(o + 2)(o + 88) Determine o so that -o*5 + 5o*4 - 7o*3 + 3o*2 = 0. 0, 1, 3 Suppose -4d*4 - 232d*3 - 3984d*2 - 17888d - 21632 = 0. What is d? -26, -4, -2 Suppose 5s3 - 4285s*2 + 920200s - 915920 = 0. Calculate s. 1, 428 What is v in -110v2/13 + 226v/13 - 12/13 = 0? 3/55, 2 Factor -h*3 - 4h*2 + 5h. -h(h - 1)(h + 5) Factor -135g4/8 + 99g*3/8 + 6g*2 - 9g/2. -3g(3g - 2)2(5g + 3)/8 Suppose l2 + 154l - 795 = 0. Calculate l. -159, 5 Factor 3o2 + 6o + 3. 3(o + 1)2 Factor -g4/4. -g4/4 Determine l so that 2l*5 + 54l*4/5 + 68l*3/5 - 88l*2/5 - 48l - 128/5 = 0. -2, -1, 8/5 Let -2g2/17 + 56g/17 + 58/17 = 0. What is g? -1, 29 Factor f*2 + 307f/3 + 34. (f + 102)(3f + 1)/3 Factor 3q3 - 663q*2 + 2613q - 1953. 3(q - 217)(q - 3)(q - 1) Let 9o*3 + 1131o*2 + 5106o + 2904 = 0. What is o? -121, -4, -2/3 Solve 2h4 - 1280h*3 + 206076h*2 - 408320h + 203522 = 0 for h. 1, 319 Find q such that 2q4 - 14q*3 + 10q*2 + 14q - 12 = 0. -1, 1, 6 Factor -12f4 - 28f*3 - 12f*2 + 12f + 8. -4(f + 1)3(3f - 2) Factor -4r*3 - 256r*2 - 5460r - 38808. -4(r + 21)2(r + 22) Factor -2p3/7 + 12p*2/7 - 10p/7. -2p(p - 5)(p - 1)/7 Factor -15j*2 - 30640j + 10215. -5(j + 2043)(3j - 1) Factor 4a*3 + 8592a*2 + 6151872a + 1468246784. 4(a + 716)3 Factor a4/4 - 21a*3/4 - 27a*2/4 + 113a/4 - 33/2. (a - 22)(a - 1)2(a + 3)/4 Factor -g*3/2 - 3g*2 + g/2 + 3. -(g - 1)(g + 1)(g + 6)/2 Factor -5z*3 + 1480z*2 - 109520z. -5z(z - 148)2 Suppose -c2 + 507c - 1010 = 0. What is c? 2, 505 Factor 6a*3/7 - 2490a*2/7 + 708a. 6a(a - 413)(a - 2)/7 Let 9y*4 + 25y*3 - 15y*2 - 25y + 6 = 0. Calculate y. -3, -1, 2/9, 1 Find l, given that l5/4 - l4/4 - 27l3/4 + 77l*2/4 - 37l/2 + 6 = 0. -6, 1, 4 Find o such that 4o4 - 40o*3 + 84o*2 + 16o - 112 = 0. -1, 2, 7 Determine r so that 2r3/7 - 422r*2/7 - 1712r/7 - 1720/7 = 0. -2, 215 Factor 2c3/7 - 12c*2/7 + 22c/7 - 12/7. 2(c - 3)(c - 2)(c - 1)/7 Factor -50l*3/13 + 40l*2/13 - 8l/13. -2l(5l - 2)2/13 Let 5a*5 + 20a*4 - 15a*3 - 50a*2 + 40a = 0. What is a? -4, -2, 0, 1 Suppose -4d4/5 - 5d*3 - 38d*2/5 - 8d/5 = 0. Calculate d. -4, -2, -1/4, 0 Factor -5n3 + 60n*2 + 1260n + 4320. -5(n - 24)(n + 6)2 Determine w, given that w3/2 + 29w2/2 - 88w - 3630 = 0. -22, 15 Let -4r4 + 6596r*3 - 2722496r*2 + 2715904r = 0. Calculate r. 0, 1, 824 Find a, given that -2a4/3 - 4a*3/3 + 32a*2 = 0. -8, 0, 6 Factor -4d*3 + 68d*2 - 248d - 320. -4(d - 10)(d - 8)(d + 1) Factor o2/3 - 3438o + 8864883. (o - 5157)2/3 Factor h3/2 + 4h2 - 253h/2 - 130. (h - 13)(h + 1)(h + 20)/2 Solve -2b3/11 - 284b*2/11 + 1160b/11 - 1168/11 = 0. -146, 2 Factor -2k2 - 38k - 68. -2(k + 2)(k + 17) Find z, given that -2z2/3 + 68z/3 + 70/3 = 0. -1, 35 Determine u, given that -u*2/2 + 162u + 326 = 0. -2, 326 Factor h3/6 - h2 + 11h/6 - 1. (h - 3)(h - 2)(h - 1)/6 Suppose 2q*2 - 16q - 306 = 0. What is q? -9, 17 Factor -p*4 - 3p*3 + 4p*2 + 12p. -p(p - 2)(p + 2)(p + 3) Factor 7z*4 - 12z*3 - 4z2. z2(z - 2)(7z + 2) Solve -78q*3/5 + 176q*2/5 + 202q/5 - 84/5 = 0. -14/13, 1/3, 3 Find s such that 6s4 + 117s*3/2 + 331s*2/3 + 82s/3 - 44/3 = 0. -22/3, -2, -2/3, 1/4 Find p, given that p*3 - 10p*2 + 23p - 14 = 0. 1, 2, 7 Suppose 5w4 + 2670w*3 + 353765w*2 - 715560w + 359120 = 0. Calculate w. -268, 1 Solve -w*5 + 221w*4 - 12538w*3 + 36298w*2 - 35861w + 11881 = 0. 1, 109 Find b such that b*4/6 - 10b*3/3 + 23b*2/2 - 41b/3 + 16/3 = 0. 1, 2, 16 Solve -5z2 + 20340z - 20685780 = 0. 2034 Factor -u*2/4 + 61u/4 - 15. -(u - 60)(u - 1)/4 Solve -z2/5 + 27z/5 - 10 = 0. 2, 25 Solve 25g3 - 345g*2 - 72g + 28 = 0 for g. -2/5, 1/5, 14 Factor -4c2/9 + 176c/3 - 336. -4(c - 126)(c - 6)/9 Factor -4j3 - 68j*2 - 124j - 60. -4(j + 1)2(j + 15) Find n such that -5n3 + 17895n*2 - 16020495n + 16002605 = 0. 1, 1789 Determine p so that -14p4/3 - 76p*3 + 58p*2 + 68p/3 = 0. -17, -2/7, 0, 1 Let -2d3/3 - 5d*2/3 - d = 0. Calculate d. -3/2, -1, 0 What is m in 5m*4 - 40m*3 + 65m*2 + 150m - 360 = 0? -2, 3, 4 Factor -m*2 + 12m + 28. -(m - 14)(m + 2) Solve -84b*5 + 268b*4 + 28b*3 - 252b*2 + 72b = 0. -1, 0, 1/3, 6/7, 3 Suppose 8p4/3 - 4p*3 - 8p*2/3 = 0. What is p? -1/2, 0, 2 What is s in -2s*4 - 12s*3 - 18s*2 - 8s = 0? -4, -1, 0 Factor 8x4 + 36x*3 + 44x*2 - 16. 4(x + 1)(x + 2)2(2x - 1) Let 4i*3 + 780i*2 + 50700i + 1098500 = 0. What is i? -65 Let -2k4/9 - 62k*3/9 - 226k*2/9 - 274k/9 - 12 = 0. Calculate k. -27, -2, -1 Factor -5l2 + 1330l. -5l(l - 266) Factor -5a2 - 140a - 260. -5(a + 2)(a + 26) Factor 2k4 - 2k*3 - 6k*2 + 10k - 4. 2(k - 1)3(k + 2) Factor -11s2/6 + 2s - 1/6. -(s - 1)(11s - 1)/6 Find p, given that 20p3/3 + 62p*2/3 + 2p = 0. -3, -1/10, 0 Find b such that -12b5 + 68b*4 + 24b*3 - 384b*2 - 128b = 0. -2, -1/3, 0, 4 Suppose -10b5/9 - 58b*4/9 + 14b*3/3 + 194b*2/9 + 80b/9 - 8/3 = 0. Calculate b. -6, -1, 1/5, 2 Factor -3b3 - 42b*2 + 147b - 102. -3(b - 2)(b - 1)(b + 17) Factor -2o*3/5 - 94o*2/5 + 194o/5 - 98/5. -2(o - 1)2(o + 49)/5 Factor -2c3 - 28c*2 - 88c - 80. -2(c + 2)2(c + 10) Factor 2u3/9 + 16u*2/9 + 40u/9 + 32/9. 2(u + 2)2(u + 4)/9 Suppose -13520s5 - 107640s*4 - 266245s*3 - 205960s*2 + 8220s - 80 = 0. What is s? -4, -2, 1/52 Let b*4 + 13b*3 - 140b*2 = 0. What is b? -20, 0, 7 Determine j, given that -30j**5 + 36	{ "pile_set_name": "DM Mathematics" }
lculate rb(w) - g(w). 2w Let g(y) = -21y2 - 11y. Let c(v) = 4v2 + 2v. Let n(x) = x*2 - 4x - 7. Let j be n(5). Give jg(q) - 11c(q). -2q2 Let p(r) = 5r - 4. Let q(v) = 8v - 19. Let y(n) = -4n + 9. Let z(a) = 6q(a) + 13y(a). What is -2p(b) - 3z(b)? 2b - 1 Let w = 108 + -56. Let v(d) = 18d*3 + 26d*2 - 26d - 26. Let x(h) = -2h3 - 3h*2 + 3h + 3. What is wx(t) + 6v(t)? 4t3 Let c(p) = 4p + 1. Suppose -4k + 2 = -18. Let q(o) = -o. What is kq(l) + c(l)? -l + 1 Let l(o) = 5o + 0 + 4 - 8o - 4o. Let m(t) = t - 1. Calculate l(a) + 4m(a). -3a Let n(a) = 2a*3 - 3a + 3. Let d(m) = -2m3 + 3m - 2. Give 4d(u) + 3n(u). -2u3 + 3u + 1 Let l(n) = -6n. Let g(u) = -7u. Suppose v = 4r - 12, -5v - r + 15 = -9. Suppose v = -t + 1. Let m be (-4)/t18/4. Give ml(f) - 5g(f). -f Let y(c) = -6c3 - c2 - 5c - 8. Let j(o) = -o3 - o - 1. What is -5j(k) + y(k)? -k3 - k2 - 3 Let o(g) = 2g + 2. Let n = -7 + 10. Let p(c) = 3c + 3. Let t(f) = np(f) - 5o(f). Let d(l) = -7l - 4. Determine -d(j) + 6t(j). j - 2 Suppose 0 = 2k + 20 - 76. Suppose 5s - s = k. Let p(v) = 6v2 - 1 + 4v - s + 1. Let l(r) = 2r2 + r - 2. What is 7l(a) - 2p(a)? 2a*2 - a Let m(x) = -3x - 8x2 - x + 3x + 0x. Let o(w) = -w2. Suppose 0 = v + 2k - 7k - 26, -5v = 5k + 20. Give vm(n) - 6o(n). -2n*2 - n Suppose 0 = -4k + 6o - 4o + 26, -k - 10 = 5o. Let f(q) = 2q*3 - 5q*2 + 5q + 1. Let h(s) = s*2 - s. Calculate kh(y) + f(y). 2y3 + 1 Let d(o) = o2 + o + 2. Let l(m) = -2m*2 - 2m - 3. Let s = -95 - -92. What is sl(x) - 5d(x)? x*2 + x - 1 Let l(r) = -42r - 15. Let u(a) = a*2 + 7a - 5. Let d be u(-5). Let s(q) = -6q - 2. Determine ds(p) + 2l(p). 6p Let h(b) = 5b2 + 2b + 6. Let j(g) = g*2 - g + 1. Give -h(o) + 3j(o). -2o2 - 5o - 3 Let l(o) = 40o - 1. Let g(j) = 100j - 2. Give 5g(y) - 12l(y). 20y + 2 Let i = 9 - 6. Let x(c) = -4c*3 - 3c*2 + 3c + 3. Let w(n) be the second derivative of -n5/20 - n4/12 + n3/6 + n2/2 - 2n. Determine iw(t) - x(t). t*3 Let m(d) = d + 6. Let j be m(-4). Let c(z) = 15z*2 - 11 + 0z*3 + 16z*3 - 4z*2. Let n(h) = 3h*3 + 2h*2 - 2. Give jc(s) - 11n(s). -s3 Let o(g) = -2g - 5. Let y be 40/340 - 32/(-17). Let b(a) = 4a + 11. Determine yb(q) + 5o(q). -2q - 3 Let f(z) = 2z3 + 3z2 + 2. Let o(l) = -l3 + l*2 + l + 1. Calculate f(s) - 2o(s). 4s3 + s2 - 2s Let f(x) = -x3 + x2 + x + 1. Let u(v) = v*3 - 11v*2 - 5. Let t(c) = -5f(c) - u(c). Let j(m) = -4m3 - 7m*2 + 6m. What is -6j(w) - 7t(w)? -4w3 - w Let p(i) = 3i3 - i2 + 4. Let a(y) = -7y3 + 2y*2 - 9. Determine 4a(o) + 9p(o). -o3 - o2 Suppose -5m + 0l = 2l - 31, 2m - 3l = 1. Let i = m + -7. Let n be i + (1 + 2 - 3). Let a(x) = -x. Let u(q) = q + 1. Determine nu(t) - a(t). -t - 2 Let g be 2/(4 + 0)6. Let i(t) = 16 - 5t - 9t + gt - 3. Let d(o) = 5o - 6. Determine 9d(p) + 4i(p). p - 2 Let y(s) = 3s + 1. Let f(b) = 4b + 2. Let d(r) = -3r3 + 2r - 1. Let o be d(1). Determine of(c) + 3y(c). c - 1 Let y = 12 - 6. Let z = y + -11. Let x(i) = 5i2 - 6i + 6. Suppose -7b + 5b = 12. Let r(a) = -4a2 + 5a - 5. Determine br(k) + zx(k). -k*2 Let m be -123/2. Let q be (-7)/1 - -12 - 41. Let p(z) = z*2 - z. Let a(t) = 4t*2 - 3t. Determine mp(y) + qa(y). y*2 Let s(r) = -54r*2 + 34r + 34. Let g(v) = -5v2 + 3v + 3. What is 68g(i) - 6s(i)? -16i2 Let x = -22 - -29. Let f(h) = 11h - 5. Let w(c) = 16c - 7. Calculate xf(t) - 5w(t). -3t Let l(v) = v*3 - 2v*2 - 2v + 17. Let z(k) = -4k3 + 9k*2 + 9k - 67. Give 9l(w) + 2z(w). w3 + 19 Let q(u) be the first derivative of -u3/3 - 2u - 3. Let b be 0/(-1) + 2/(-1). Let t(a) = -5a*2 - 11. Calculate bt(y) + 11q(y). -y2 Let d(g) = -5g + 1. Suppose -25 - 17 = -14m. Let o(f) = 6f - 4. Let t(l) = l. Let r(s) = o(s) + 10t(s). Give mr(h) + 10d(h). -2h - 2 Let q(i) = -3i3 - 3i + i*2 + 4i3 - i2. Let u be (3(-1 + 0))/(-1). Let l(r) = ru + 3r - 4r - r. Give 3l(g) - 2q(g). g3 Let u(q) = -10q*3 - 8q*2 + q - 9. Let h(d) = -1 + 15d3 - d2 - 5d3 - 11d*3. Determine 18h(i) - 2u(i). 2i*3 - 2i*2 - 2i Let b(y) = y - 1. Let x(z) = -6. Calculate 3b(s) - x(s). 3s + 3 Let d(w) = 3w3 - 2w*2 + 2w + 2. Let f = 98 + -96. Let a(q) = -5q3 + 5q*2 - 5q - 5. Calculate fa(t) + 5d(t). 5t3 Let k(n) = 3n + 5. Let a(i) = 12i3 + i. Let h be a(1). Let p(z) = h + 5z - 5 + 0. Calculate -8k(c) + 5p(c). c Let c(x) = -2x - 4. Let i(z) = 3z + 9. What is 5c(d) + 3i(d)? -d + 7 Let g(x) = -3x3 - 4x*2 - 5x. Suppose b = -b - 2. Let a = -3 + 8. Let y(v) = -v3 - v2 - v. What is ay(h) + bg(h)? -2h3 - h2 Let f(i) = -3. Let t(q) = -2q*3 - 1. Let o be t(-1). Let d(z) = -9z + 9z + o + z2. Give 2d(x) + f(x). 2x2 - 1 Let i(y) = 2y*3 - 3. Let g be (-1)/2 - 42/(-12). Let p(w) = 1. What is gp(f) + i(f)? 2f3 Let b(y) = 15y*3 + 4y*2 - 15y + 11. Let r(s) = 4s3 + s2 - 4s + 3. Let g(z) = -z*2 - 7z + 8. Let v be g(3). Determine vr(f) + 6b(f). 2f3 + 2f*2 - 2f Let m(z) = z2 + 1. Let y(c) = -c3 - 5c2 + c - 4. Determine -4m(v) - y(v). v3 + v2 - v Let l = -1 + 3. Let o(m) = -4m2 + 2. Let b(x) = 5x*2 + 5x*2 - 5 + 2 - 5x*2. Give lb(y) + 3o(y). -2y*2 Let t(a) = 1. Let f(s) = s + 5. Calculate -3f(r) + 12t(r). -3r - 3 Let a(q) = 7q2 - q + 2. Let l(b) = -6b*2 + b - 1. Calculate 4a(f) + 5l(f). -2f*2 + f + 3 Let i(a) = -1. Let v(b) = 7b*3 + 28. Give 28i(w) + v(w). 7w3 Let y(d) = 40d - 15. Let g(q) = 10q - 4. Give -15g(x) + 4y(x). 10x Let b(k) = -3k + 3 + 1 + 2. Let m(i) = -3 + 5 - 2 + 13 - 7i. Calculate -9b(v) + 4m(v). -v - 2 Let l(m) = -2m - 3. Let u(w) = w - 1. Let o be u(6). Let g(a) = -a2 - 5a - 7. Give ol(n) - 2g(n). 2n2 - 1 Let m be (-8)/52 + 56/26. Suppose -m = f - 10. Let s(n) = -14n + 5. Let h(x) = -5x + 2. Determine fh(i) - 3s(i). 2i + 1 Let c(h) = -3h + 2. Let u = -24 + 29. Let p(x) = 3 - 3x + 3 - u + 1. What is 5c(z) - 4p(z)? -3z + 2 Let b(j) = -11 + 4 + 0j + 3j. Let i = -35 - -28. Let a(c) = -2c + 4. What is ia(k) - 4b(k)? 2k Let y(k) = -9k + 28k - 12k - 8k - k2. Let r(g) = 3g*2 + 2g. What is r(n) + 2y(n)? n2 Let s(p) be the first derivative of 2p*3 - 2p + 16. Let q(b) = 2b - b2 - 2b. Give 5q(a) + s(a). a2 - 2 Let t(x) = -10x*2 + 7x + 5. Suppose -5w + 26 = -5c - 14, 0 = 4c + 2w + 14. Let s(i) = -5i2 + 3i + 2. Calculate cs(g) + 2t(g). 5g2 - g Let j(c) = c2 - 4c + 5. Let u = -21 + 17. Let x(o) = 3o2 - 11o + 14. Determine ux(q) + 11j(q). -q*2 - 1 Let d(i) = 21i + 5. Let y(t) = -5t - 1. Give 4d(w) + 18y(w). -6w + 2 Let y(t) = -t - 2. Let h(f) = -f - 2. Let z(i) = 3i + 12. Let d be z(-7). Let c = 14 + d. Give cy(u) - 6h(u). u + 2 Let i(k) = 24k2 + 9. Let x(q) = q2 + 1. What is 2i(m) - 18x(m)? 30m2 Let s(f) = -3f - 8. Let r be 1(-1)/6 - 105/18. Let b(n) = 6n + 15. Determine rb(x) - 11s(x). -3x - 2 Let d = 2 + -8. Let s(k) = -9k*2 - 13k. Let l(g) = -5g2 - 7g. Suppose 5a - 3j = 67 - 6, 3j = 2a - 28. Give al(r) + ds(r). -r*2 + r Suppose 4s - 4o + 12 = 0, s + 4o = -2s - 16. Let w(v) = 3v*3 - 7v2. Let g(y) = y3 + 0y3 - 2y*2 + 0y*2. What is sw(l) + 14g(l)? 2l*3 Let i(f) = 5. Let y(t) = t - 4. Give -4i(c) - 5y(c). -5c Let f(w) = -5w2 - 3w - 6. Let q(j) = -j*2 - j + 1. Give f(a) - 3q(a). -2a2 - 9 Let y(r) = -8r2. Let b(d) be the third derivative of d5/60 - 17d2. Determine 6b(t) + y(t). -2t2 Let y(j) = j + 2. Suppose 5g - g = 56. Suppose -l + g = 5. Suppose 2q - s = -18, q + 2s = 6s - l. Let p(d) = -2d - 5. Give qy(b) - 4p(b). -b + 2 Let i(d) = 68 - 64 - 2d - 2d*2 + 4d - 5d. Let g(q) = -2q*2 - 2q + 3. Give -3g(m) + 2i(m). 2m2 - 1 Let b(v) = 17v - 55. Let p(z) = 4z - 14. What is 6b(j) - 26p(j)? -2j + 34 Let k(b) = 3b3 + 7b*2 - 2b + 3. Let h(n) = -3n3 - 8n*2 + 3n - 4. Determine 3h(l) + 4k(l). 3l3 + 4l*2 + l Let g(x) = x - 1. Let z = 4 + -3. Let d(r) = -r + 2. What is zd(b) + 2g(b)? b Let k(p) = 3p*2 - 2p - 4. Suppose -20 = 3*d - 5. Let	{ "pile_set_name": "DM Mathematics" }
0, -3g - 3m + 4 = -2 for g. 0 Suppose -4z = -42d + 43d - 10, 2d = 4z - 16. Suppose -5c = -c - zh, -5 = -3c + h. Solve -5l + 7 + c = 5o, 0 = l + 5o - 2 for l. 2 Suppose -13 = 5c - 3b, 2b = 5c + 12 - 0. Let j be ((3/90)/(-2))/c. Solve -w + d + 2 = j, -1 - 1 = -w - d for w. 2 Let d(y) = 2y3 - 3y*2 - y + 4. Let j = -145 + 147. Let w be d(j). Let b be (4 - -16)(1 + 0). Solve -5o - b = 0, 2t - o = -wo - 12 for t. 4 Let i be 2 + -5 - -1 - (-144)/4. Let m be 6/(-10) - 9/(-15). Suppose m = 6v - 9v + 15. Solve 0 = 3d + vn - i, 25 = 4d + 2n + 3 for d. 3 Suppose -5p - 2i = -12, -296i + 294i + 2 = 0. Solve 4g + 10 = -pn, 2g - 4 = -29n + 25n for n. 3 Let j = -8 + 14. Suppose -t = -3x + 31, -3t + j = 3x - x. Suppose 7z - xz = -14. Solve -n - o = -2o + z, -o = -4 for n. -3 Let p = -64 - -68. Suppose 3g - pg + 5 = 0. Let u(c) = -2c + 1. Let y be u(-1). Solve 3o - 9 = 7a - ya, -15 = -5o + ga for o. 3 Let g(u) = 22u2 - 13u - 3. Let d be g(1). Solve 3p + 2j + d = 0, 5p - 63j + 60j - 9 = 0 for p. 0 Let n = 1557 - 1554. Solve 2x + 0x = -s - 13, 3s = -nx - 24 for s. -3 Suppose -6s + 327 = 297. Suppose -2g + 4 = -r, sr + 32 - 24 = 4g. Solve rd - 4d - 4h = 8, -3 = -3h for d. -3 Suppose 2w = 6w - 40. Suppose -4y = j - 3, -3 = y - j - w. Suppose -y = 4b - 5b. Solve -bi - 1 + 9 = 4z, 8 = -4i for z. 3 Let h(t) = t3 + 18t*2 + 28t - 29. Let k be h(-16). Solve o + 5 = kq - 34q, -21 = -4q + 5o for q. 4 Suppose 4m + 4 + 8 = 0. Let k be m/2 + (-91)/(-14). Let r be 7(-12)/(-210) - (-46)/10. Solve -i = -3b - ri + 8, kb + 4 = 2i for b. 0 Let g be 1 - (-46 - (0/3)/2). Suppose 0 = -m + 35 - g. Let h be (m/(-3) - 0) + -4. Solve 0 = -3a - 2n - 3 - 5, 2a + 3n + 2 = h for a. -4 Suppose 0c + 4c = 128. Suppose -9n = 5 - c. Let s(r) = 4r + 8. Let x be s(-2). Solve -2l + 8 = 2u - nu, -2l - u + 8 = x for l. 4 Let p = -30 - -32. Suppose 26 - 16 = pc. Solve 2t = -5u - 3, 5u - 2t = -ct - 7 for u. 1 Let l = 122 - 77. Let z = l - 44. Let t be 1(z + 2 + 1). Solve 4i - 12 = td, i + 0d = 3d + 5 for i. 2 Suppose -2p = 2v - 2, 3p = 4v - 9v - 1. Solve -4j + 3u = 7, 0 = -pu - 0u - 9 for j. -4 Let a = -1521 - -1524. Solve 0v = av - 2b + 6, -5v = 2b + 26 for v. -4 Let i be 6/((-36)/681)(1 - 3). Let y = i - 227. Solve 0 = -4f + 4a + 4 + 20, y = -2f + 5a + 27 for f. 1 Let w = -70 + 72. Suppose 2y = -2c + w, -7y + 3y + c + 19 = 0. Solve -4q + 2s = y, -3q - 5s + 21 = -2 for q. 1 Let l = 42 + -46. Let m be 62-1l/(-8). Let k = 43 + m. Solve 2c - c - 16 = 4d, -k = 4d for c. 4 Let d(x) be the second derivative of -1 - 16x - 1/6x3 - 3/2x*2. Let c be d(-7). Solve 5j - 4i = -i - c, -2j + 5i + 6 = 0 for j. -2 Let f be (12 + -14 + 3)5. Solve 5s + 3 + 22 = -5a, 2a - fs = 4 for a. -3 Let r = 1772 - 1745. Solve -3m = 3j + r, 3j - 13 = 3m + 2m for m. -5 Suppose -1 + 3 = -2i, 3i + 3 = 2l. Let m(x) = 70 + 2x + x - 58 - 34. Let k be m(8). Solve -4n = -4w - 24, lw + w = kn - 8 for n. 2 Let k be 0-23(-4)/184. Solve -4 = 2s, -t - 4s - 73 + 64 = k for t. -1 Let s be 0 - -1 - (17 - 21). Suppose 10c + 145 = sc. Let o = c - -37. Solve -b = 4h + 8 - 21, -5b - h + o = 0 for b. 1 Let t = 15 - 10. Suppose -3d - td = -32. Let f be (154/(-6))/(-7) + d/(-6). Solve -2h - fh - 45 = -5s, -3h = 12 for s. 5 Let l = -16153 + 16157. Solve -25 = 5x - lq, 50x - 20 = 54x - 4q for x. -5 Let s be (0 - (-20)/6)(-162)/90. Let v be 7/(-7)(s - -3). Solve -45 = -5j - 5h, vh + 3 + 2 = 5j for j. 4 Suppose 0 = -26d + 29d + 3. Let s be (((-20)/(-12))/d)/(10/(-36)). Solve 2q = -3z - s, 15 = 2z - 0z - 5q for z. 0 Let f(o) be the second derivative of -2o*3/3 + 2o*2 - 13o. Let i be f(10). Let n = 42 + i. Solve -5h = -3j + 30, -3j - 6h + 3h + n = 0 for j. 5 Suppose -641b = -382b - 1036. Solve 0 = -bu + 3t - 37, -3t + 26 = -3u - 4 for u. -7 Suppose -242w + 1324 = 420w. Let d(t) = t3 - 4t*2 + 2t + 3. Let c be d(4). Solve -h - c = -a + 4a, wa + 5 = -3h for h. 1 Let k = -27 - -29. Suppose 0 = 5p - 5, -4p - 73 = kz + 55. Let h be z/(-36) - (-1)/6. Solve 3b = -2v - h - 2, -5v - 10 = 0 for b. 0 Let g = 183 - 55. Let k = g - 92. Suppose 18 = -6u + k. Solve 0 = -2l - 3s + 1 + u, -s - 2 = 0 for l. 5 Suppose -2u + 5 = m, 7m + 4u = 11m - 8. Solve -4j = 3b - 7, -mb + 47 - 46 = -2j for b. 1 Suppose 38 = h + 3w + 18, h - 3w - 26 = 0. Solve 7z - 8z = 4o + 22, -z = -5o - h for o. -5 Let k = 5 - -20. Let y = 4 + k. Let b = 34 - y. Solve 5t = 3p + 29, 2p + bt = 2t + 6 for p. -3 Let v(d) = -4d*2 - 167d - 275. Let s be v(-40). Solve 0 = -6b - 6, 0 = -2w + 7b - sb + 4 for w. 1 Let z(c) = c*3 + 4c*2 - 2c - 7. Let a(h) = 3h - 15. Let o be a(5). Let s be -82/4 + o. Let x be z(s). Solve 2q - j - x = 6q, 4j = -4q - 4 for q. 0 Let d(t) = t*2 - 17t + 77. Let l be d(9). Solve -2c - 4s + 2 = 0, -2s + 7 = l for c. -1 Let w = 2980 - 2958. Solve -5a - 12 = 2g - a, w = 3g - 4a for g. 2 Suppose 4b - 3a = 1338, -6b + 5b + 5a + 326 = 0. Suppose 20v - b = 6v. Solve -t - 2 + 6 = 0, -3t + v = -4k for k. -3 Let q = -13041 - -13045. Solve -4u - 4t = 20, -qu + 2u = -3t - 5 for u. -2 Let m be (1 - 1)(-7)/(-2 - -9). Suppose mt - 59 = -3t + 5c, 0 = 2c + 2. Solve -15 = -5f - 5d, -2f - 3f = 2d - t for f. 4 Let u = 579 - 576. Solve 5 = 2y - 5z + u, 2z + 12 = -2y for y. -4 Let z be (-2)/(-3) - 27/(-567)91. Solve -2g - 22 = -zw, 3w + 3g + 4 - 13 = 0 for w. 4 Let k = -43 + 49. Suppose 2n + 12 = kn. Solve -nm + c = 2c + 5, 0 = -3m - 4c - 20 for m. 0 Suppose -3b + 487 = -2u + 163, -8 = -4b. Let r be 6/5 + -1 + u/(-5). Let o = r + -32. Solve 3q - 6 = 2i, 4q - 2i - 8 = -oi for q. 2 Suppose 5t + 82 - 356 = -u, -u + 3t + 290 = 0. Let k = u - 280. Solve -2 = -m - ki - 10, 0 = 2m - 3i - 6 for m. 0 Let i be (-58/(-20) - 8)/(-45 - -44). Solve -3f + if + 4a = -7, 3a + 12 = 0 for f. 3 Let l = -324 + 441. Suppose -lz + 122z = 100. Solve 0u = -2o + 2u, -o - 4u + z = 0 for o. 4 Let g(a) = -a*3 + 28a*2 - 5a + 23. Let c(p) = p. Let t(w) = -4c(w) - g(w). Let s be t(28). Solve 2o + 2 = 0, sr - 4o = r - 4 for r. -2 Let h = 8 + -5. Suppose -86 = -6y - 506. Let p be (y/105)/(2/9-1). Solve -2d + d = -5s - 27, -hs = -pd + 21 for d. 2 Let m be (-6)/420/(-3). Let u(l) = -l3 - 4l*2 + 8l + 35. Let n = -907 + 904. Let a be u(n). Solve -3s = ad - m, s + 0s = -4d + 10 for d. 2 Let r(n) = 12n2 - 511n - 211. Let m be r(43). Suppose -o = 3o - 24. Solve mg = y + o + 8, -3g = -4y - 4 for g. 4 Let m(q) = -703q + 101. Let c be m(7). Let s be 2/27 - c/540. Solve 4r - 4b + s + 23 = 0, 0 = -2b + 6 for r. -5 Suppose 513f = 502f + 44. Solve 12 = c - 5c, 15 = -3w - fc for w. -1 Let b be ((-154)/63)/11 + 166/18. Suppose -13a = ba. Solve -3g + g + 4j = a, 0 = -2g + j - 6 for g. -4 Let d be 21(6/(-36))/(4/(-8)). Solve -dq = 4o - 0q - 2, 4o = -3q - 6 for o. -3 Let d be 2 + -4 + 8/2. Suppose -3s + 10 = -2o, do = s - 2o. Let g be 5/(-10) - (-10)/s. Solve 5n + 33 = -2m, 3m = 3n - n - g for m. -4 Let p = 9992 - 9985. Solve p = -2u + s, -7 = -5u + 4u - 3s for u. -2 Let t = -3655 + 3657. Solve -s + 7r = 2r + 17, tr = 2s + 2 for s. 3 Let h = 307 - 284. Suppose hl - 9l - 28 = 0. Solve -2m = -2u + 12, m + 3u - l = 12 for m. -1 Let g = 41347 - 41325. Solve 238o - 239o + g = -4u, u + 13 = 4o for o. 2 Let x be ((-171)/38)/(3/(-8)). Suppose -u - 4m + x = 0, -5u - 3m - 5 + 14 = 0. Solve 5y = -5l, u = -4l + 2y - 0y + 18 for l. 3 Suppose -3i - 5x + 1 = 0, 0x = -3i + x + 25. Suppose -q - 90 = -iq. Solve -c - 3 = l, 2l = 3c - 3l - q for c. 0 Suppose 0 = -30t + 23t - 34t + 123. Solve t = 3a - 5m, 3a + 0m - 2m = -6 for a. -4 Let g(v) = 29v*2 + 467v + 52. Let i be g(-16). Solve 4q + 7 = y + 5q, 2q - i = 3y for y. 2 Let n be ((-3)/2)/(120/(-400)). Suppose nc - 15 = -0. Solve -10 = -2x, -cg + 3x - 10 = 2g for g. 1 Suppose -108m + 11 + 11 = -107m. Solve -2 + m = -o + 3w, 0 = -o + 2w - 15 for o. -5 Let l = -314 + -94. Let m = l + 412. Solve -4c = -2c - 4a - 12, 0 = -mc - a + 6 for c. 2 Suppose -2o + 5*a = -152,	{ "pile_set_name": "DM Mathematics" }
, 7l + 5w + 10 = 12l for l. -1 Solve 0 = 4j + q + 2q + 15, 2q + 11 = -3j for j. -3 Solve 0 = 3g + 2x, 3g + 3x + 3 = -0 for g. 2 Solve 2m - 7 = -16c + 21c, 2c - 4m + 6 = 0 for c. -1 Solve -3v + 4 - 13 = 0, 4y + v = -19 for y. -4 Solve -5 = 3n - 4n, 4n - 15 = c for c. 5 Solve -4i = 5y + 6, i + 3i + 26 = 5y for y. 2 Solve 5d = 10p - 9p - 21, 19 = -p - 5d for p. 1 Solve -5k - 2 - 3 = 5r, k = -4r - 16 for r. -5 Solve 106c + 4w - 18 = 104c, -w + 2 = -2c for c. 1 Solve 3r - 39 = -5j + j, -3j + r = -13 for j. 6 Solve 4b - 5j + 19 = 0, -4j + 1 = 2b - 9 for b. -1 Solve 2y = 5z - 17, y + 41 = 5z + 5y for z. 5 Solve -3r - 2j - 9 = 0, 0 = -5r + 2j - 24 - 7 for r. -5 Solve -3p = 4w - 5p - 10, 0 = -2w + 5p - 7 for w. 4 Solve 0 = -2q + 3b - 9, -5q - 3b + 9 = -21 for q. 3 Solve m - f = 0, 3m - 9 = 5f - 11 for m. 1 Solve 0 = v + w - 7, 23w - 13 = v + 19w for v. 3 Solve -7c = -3r - 6c - 1, -3c = -4r - 3 for r. 0 Solve -7k = -5k + 5z - 8, 3z = 5k + 11 for k. -1 Solve -2k - 6 = 4t, 3k + 5t + 5 + 1 = 0 for k. 3 Solve -2f = 5w + 5, 0 = 3w + 4f - 11 for w. -3 Solve -y - 3k - 13 = 1, 6 = 3y - 3k for y. -2 Solve 5x + s = 2x - 10, 3s = 3x + 18 for x. -4 Solve -3m + 9v = 5v + 8, 4m - v - 11 = 0 for m. 4 Solve -5y = 3p + 10, -5p - 4 = 2y + 19 for y. 1 Solve -11b + y - 1 = -13b, -4y - 6 = -2b for b. 1 Solve 5g - 19 = l + 2l, 2l = 4g - 14 for g. 2 Solve 0 = -5n + 10, 3p + n + 2 = p for p. -2 Solve 0 = 2h + 4l + 18, -9 = 4h - 4l + 3 for h. -5 Solve 480b - 5c - 1 = 483b, b + 4c + 5 = 0 for b. 3 Solve 4z - 204h - 15 = -205h, -9 = -2z - h for z. 3 Solve -3p - 3z = 15, -7 = 3p - 5z - 0 for p. -4 Solve -23 = -2o - 5t, o = 2o - t + 6 for o. -1 Solve -f - 2v - 5 = 0, 4f + 11v = 13v + 30 for f. 5 Solve -2m + 24 = 2w + 2w, w - 15 = -5m for w. 5 Solve -5f + 9 = 3b, -2b = 3b + 10 for f. 3 Solve -3d + 10 = -5g + 19, d - 4g = -3 for d. -3 Solve -2h + 10 = -0v + 2v, -2v + 5h - 25 = 0 for v. 0 Solve 4 = d - p, p = -3d + 5d - 6 for d. 2 Solve 4j + 8 = 0, 6f - j - 4 = 5f for f. 2 Solve 2h + 28 = 3y, h - y + 11 = -0h for h. -5 Solve 4o + 10n = 11n + 21, -5n = 4o - 15 for o. 5 Solve -3k - 4d - 7 = 0, -31 = -5k + 19d - 15d for k. 3 Solve -4c + f = 3, 5f = -4c + c - 31 for c. -2 Solve -4m - 5b = -8 - 11, -5m - b = -8 for m. 1 Solve 0 = 4n - g + 5, -5n + 39g - 37g = 4 for n. -2 Solve 11a - 9a + 10 = 2k, -3k + 9 = 0 for a. -2 Solve 5 = -r, 3h = -5r - 30 - 10 for h. -5 Solve 13 = l - 3i, -3l + 2i - 6 = -6l for l. 4 Solve 31z - 35z + 37 = 5v, 0 = -2v + 2z + 4 for v. 5 Solve -3d + 3 = -25z + 27z, 0 = -5z + 2d - 2 for z. 0 Solve 5 = -5i, -4u + 2 = -6u + 2i for u. -2 Solve -3g + 20 = -8g + 2b, -g - 4 = -2b for g. -4 Solve -2n - 2d + 13 = -5d, 16 = 4n - 4d for n. -1 Solve -f + 2s = 2f + 10, 16 = -3f + 5s for f. -2 Solve -12l = -3b - 10l + 12, -4b = -l - 16 for b. 4 Solve -z = -k, 2k + 3 = z - 0 for k. -3 Solve -8 = 2f, f = u + 5f + 18 for u. -2 Solve 5w - 4j - 28 = 0, -3j - 10 = 8w - 9w for w. 4 Solve -4x + 2 = -2q + 16, 17 = -5x + 2q for x. -3 Solve -3m = y - 23 + 20, -3 = -3m - 2y for m. 1 Solve 21t - 17t + 8 = 2s, -4s = -2t - 22 for t. 1 Solve 29x + 3p = 27x + 8, 0 = -4x + 5p - 28 for x. -2 Solve a = 50i - 53i - 2, -42 = -5i + 4a for i. 2 Solve -21 = 3c + 4n, -13c + 10c + 2n - 3 = 0 for c. -3 Solve -4y - 8 = -0y - 2j, 2j = -3y - 13 for y. -3 Solve 5l = -35v + 38v + 18, -v - 16 = -5l for v. -1 Solve -12p + 11p - 4m = -15, -15 = -3m for p. -5 Solve -f = -5q + 4f - 15, 20 = -2q - 5f for q. -5 Solve 22m + 3q - 4 = 21m, 0 = -5m - 5q - 10 for m. -5 Solve 42v - a - 10 = 41v, -3v - 5a - 2 = 0 for v. 6 Solve 1 = -5k - 3v, 3v = 4k + 6v + 2 for k. 1 Solve -g + 17 = -3y, g + y - 1 = -4 for g. 2 Solve 0 = 3j + 2s - 18, 3s + 24 = 9j - 5j for j. 6 Solve -4j - 3c = 1, 91c = j + 87c + 24 for j. -4 Solve -6 = -t - j, j + 12 = -5t + 22 for t. 1 Solve 8 = 4g + 4b, 4g - b = -2 - 0 for g. 0 Solve -p - 25q + 9 = -26q, 0 = -3p + 4q + 32 for p. 4 Solve 3t + 182 = 2h + 189, -4t - 2h = 0 for t. 1 Solve -x - x - b + 5 = 0, 7 = 3x + b for x. 2 Solve 40x - 39x + 5v = -17, 4v = -5x - 1 for x. 3 Solve -10 = 4j - 2b, 0 = -5j - 0j - b - 9 for j. -2 Solve c + 14 = -0c + 4g, 3c = 3g - 15 for c. -2 Solve -19s = -17s + 2, 4n + 5s = -17 for n. -3 Solve 3f + 13 = -5l, 4l - 5 = 3f - 10 for f. -1 Solve -p = -6p + 3d + 4, 3d + 12 = -3p for p. -1 Solve 3z + 0n - 2n = 16, 4z - 23 = 3n for z. 2 Solve 0 = 5m - 10, 4m - 12 = 2c + 4 for c. -4 Solve 3y + 4b + 26 = 0, y + 5b - 10b = 23 for y. -2 Solve 3z - 18 = -g + 7z, 0 = 2g - 2z - 12 for g. 2 Solve -2k + 5h - 1 = 13, h = 2 for k. -2 Solve l + 5 = -5i, 3i = 8i + 2l + 5 for i. -1 Solve -5 = -70n + 65n + 5s, -3n - 3s + 15 = 0 for n. 3 Solve 4g - 7g = -t + 12, -t - 3 = 0 for g. -5 Solve 0 = 5i + 3w + 8, w - 1 = -2i + 4w for i. -1 Solve 0 = 3f + 5 - 8, 4o + 5f = 1 for o. -1 Solve 5j + 15 - 5 = 0, 3m = j + 8 for m. 2 Solve -5n + w + 23 + 7 = 0, -15 = n + 4w for n. 5 Solve s + 2 = -3m, -5s + 3m - 4m = 10 for s. -2 Solve -p + 4 = 2x, 2p + 5x + 4 - 12 = 0 for p. 4 Solve 3o - 5o = 5l - 6, 5l - 48 = 4o for l. 4 Solve l = 4b - 11 + 4, 10 = 2l for b. 3 Solve t - 19 = -5h, h = 2t + 5h - 14 for t. -1 Solve 2x - 5v - 25 = 0, 1 = x - v - 4 for x. 0 Solve 5u + 36 = -4x, 5x + 0 = 2u - 12 for x. -4 Solve 2 = 4c + 3s + 1, -2s = 4c - 6 for c. 4 Solve -68b - 16 = -65b - 5f, -3b = 3f for b. -2 Solve 16s - 12s = -4q + 36, -6q = 4s - 46 for q. 5 Solve 2c - 2t + 4 - 8 = 0, 4c + 4 = t for c. -2 Solve 2x - 4f = -8, 0 = -4x + 9x - f + 2 for x. 0 Solve 2s + 3j - 13 = 0, 0 = 5s - 5j - 4 - 16 for s. 5 Solve 0 = 3f - 15, 13n - 3f = 8n + 10 for n. 5 Solve 0 = -v - 4r - 4 - 3, 12 = -4r for v. 5 Solve 3r - 3u = -0u - 24, 3u = 12 for r. -4 Solve 11t + 25 = -5z + 7t, -t = 0 for z. -5 Solve 1582o - 1581o - 3g + 1 = 0, 0 = -2g - 2 for o. -4 Solve -5 = -4a + 5v, 3a - 4v - 5 = -2 for a. 5 Solve 16 = 5k + 4t, k - 2t = 5k - 14 for k. 4 Solve 0 = -5j + 15, -4o + 15 = j - 0 for o. 3 Solve -5h + h = -5x + 24, 16 = 4h + 5x for h. -1 Solve 17 = 4m - 3a + 8a, -2a + 4 = 3m for m. -2 Solve 0 = 6z - 3z - a, -5a - 15 = 0 for z. -1 Solve -n - 2 = h, 0 = 4n + h + 5 - 6 for n. 1 Solve 2x + 3g = -1, -4x - 9g + 19 = -10g for x. 4 Solve -y = 4q - 15, -2y = -2q + 12 + 8 for q. 5 Solve 5r + i + 12 = 3r, -4 = i for r. -4 Solve 5j - 2i + 15 = 0, -5j - 131 = 5i - 116 for j. -3 Solve 0 = 5l + 3s + 16, -l + 10 = -3s + 8s for l. -5 Solve -2x + 2w = 2, -w - 3 + 2 = -2x for x. 2 Solve 3b = 4n - 19, 2b + n - 14 = -3n for b. -1 Solve 0 = -2s - 3c - 14, 3s - 5c + 7 = -6c for s. -1 Solve -2g = l - 10, -5g + 3l = -2g - 6 for g. 4 Solve -z = -5, 5p + 0z + 10 = z for p. -1 Solve -5a - 5y - 25 = 0, 6a + 5 = 8a - 3y for a. -2 Solve -3z + 18 = 2k, 65k = 3z + 60k + 3 for z. 4 Solve 4v - 3m = -28, -v + 255 - 279 = -5m for v. -4 Solve -4s + 236u - 231u = -25, u + 5 = -2s for s. 0 Solve 7 = 4c - 3l, 9 = 3c - 2l + 5 for c. -2 Solve 2r = -4q - 0q - 14, -q - 6 = r for r. -5 Solve -15 = -x - 2h, 4x - 137h + 132h + 57 = 0 for x. -3 Solve 3m - 6 = -3p, -2m = 3m - p + 20 for m. -3 Solve -5m + 22 = w, 0 = 2m - 4w + 7 - 29 for m. 5 Solve 0 = k + t - 5, -13t = k - 16t + 11 for k. 1 Solve 4 = -5u - 4c - 28, 4 = -4u + 4c for u. -4 Solve -4y = 5o + 16, -o - y = 6 - 2 for o. 0 Solve 5c + 19 = h + 14, 0 = -3h + 5c + 15 for h. 5 Solve 22z + 3j = 18z + 4, z - 5j = 1 for z. 1 Solve 5f = 50, -p + 13f = 9f + 39 for p. 1 Solve 4a - 36 = -4l - 0, 0 = -2a - 4l + 28 for a. 4 Solve -5s = -l + 17 + 5, 3l + 4s = -10 for l. 2 Solve -3u = -3f + 6, -10 = 28u - 33u - 5f for u. 0 Solve -d + 1 = 2, n + 2d + 4 = 0 for n. -2 Solve 0 = 2p - 87i + 91i - 16, -3p = -3i + 12 for p. 0 Solve 0 = -5l - 5f - 40, f - 10 = -6l + 11l for l. -3 Solve 6y - 3y - 15 = 0, -s - 17 = -3y for s. -2 Solve m - 3 = 4i + 5, 3i + 6 = -3m for i. -2 Solve -4s = -9s, -2s -	{ "pile_set_name": "DM Mathematics" }
. Let q(u) = u*2 - 8u - 6. Determine q(t). -6 Let c = 19 - 19. Suppose -x + 2x + 4w + 11 = c, 0 = -2w - 4. Let o(j) = j2 + j. What is o(x)? 6 Let q(z) = z3 + 14z*2 + 11z + 6. Suppose 2u - 406 = -432. Determine q(u). 32 Let d(v) be the first derivative of 1/12v*4 - 2v*2 - 2/3v*3 - 3v + 4. Let g(u) be the first derivative of d(u). Calculate g(5). 1 Let n = -16 + 20. Let r(i) = -i*3 + 5i*2 - 6i + 2. Let m be r(n). Let d(c) be the first derivative of -c*4/4 - 2c*3 - 4. Determine d(m). 0 Suppose 5o = -2j + 34 + 31, 2o + 4j - 10 = 0. Let u(t) = ot + 18 - 20t - 9. Give u(7). -26 Suppose 2b - t - 6 = 3t, b - 6 = -t. Let u(p) = -b - 28p*2 - 4p + 27p2 + 0. What is u(-4)? -5 Suppose 30y + 224 = 554. Let b(m) = -m + 1. Let w(i) = 3i + 12. Let j(k) = -4b(k) - w(k). Determine j(y). -5 Let p(g) = 5g. Let s = -1 + 4. Suppose 8 = sw - 1. Suppose 2u = 10, -4q + u + 2 = wu. Give p(q). -10 Let y(t) = -t. Let i(g) = -1 - 6g + g*3 - 11g*2 + 10g*2 - 2g*3. Let w(c) = -i(c) + 3y(c). What is w(-2)? -9 Let q(y) = -y + 11. Let f be (2 - 3)1-8. Let v be q(f). Let z(r) = -2r + r + 2 + vr. Determine z(-2). -2 Suppose -152s = -151s - 5. Suppose i - 2n + 4 = 0, i - n = -s + 1. Let f(k) = k3 + 3k*2 - 5k - 5. Calculate f(i). -1 Suppose 10k - 6 = 16k. Let x(s) = -s*2. Let v(r) = 7r*2 - 4r - 1. Let l(t) = kv(t) - 4x(t). Calculate l(3). -14 Let i = -81 + 84. Let x(j) = -j + 4 - 3 + 5 - i. Give x(-4). 7 Let q = 33 - 39. Let p(f) = 6f - 8 - 2f*2 - 10f + f*2. What is p(q)? -20 Let o(d) = 11d*2 + 5 - 712d + d*3 - 5d*2 + 0d*3 + 702d. Calculate o(-8). -43 Let l(r) be the first derivative of r*3/3 - 2r*2 + 8r + 172. What is l(7)? 29 Let s(c) = -c*3 - 12c*2 + 10. Let r be s(-12). Suppose 0 = -2i + 3y + 9, i - 1 = -5y + r. Let l(u) = -3 + 0 + 1 - 7u - u3 + 7u2. Determine l(i). -8 Let n(r) = -r2 - 5r - 3. Let q be n(-4). Let h(k) = -2k + q + k + 8. Let a be 68/10 + (-6)/(-30). Give h(a). 2 Suppose 4m = -95 + 147. Let i(r) = -r2 + 14r - 13. What is i(m)? 0 Let c(a) = 18a2 - 3a - 11a + 5a*3 + 2a + 3. Suppose 262 = -25d + 62. Let i(r) = 2r*3 + 6r*2 - 4r + 1. Let y(g) = di(g) + 3c(g). Calculate y(5). 6 Let s(l) = -l*2 - 9l - 9. Let w(z) = z*2 + 9z + 8. Let b(h) = -2s(h) - 3w(h). Determine b(-5). 14 Let b(w) = 6w - 13w + w - 5 + 8 + 7w. What is b(-6)? -3 Let z = -642 - -19261/30. Let l(a) be the third derivative of 0a*4 + 0a + 0 + 11a2 + za*5 + 1/30a*6 - 1/6a*3. What is l(1)? 5 Let x(d) be the third derivative of -7d5/60 + d4/12 - d*3/6 + 967d2. Let m(v) = -2 - v2 + 3v + 3 - 2v. Let j be m(0). Give x(j). -6 Let l(x) = -8x2 + 2x - 1. Suppose -2s - 2z - 46 = 2s, 15 = 3z. Let d = 37 - 2. Let b be (-10)/d - 18/s. What is l(b)? -7 Let u(a) be the first derivative of -7 - 5/3a3 + a - 1/2a2. Let z = 2 - 1. Calculate u(z). -5 Let g be 57/11 - 10/55. Let o(k) be the second derivative of -k3/6 + 3k2 + 13k. Give o(g). 1 Let w(m) = m*3 + 7m*2 - 4m + 11. Let t(g) = -4g + 96. Let j be t(26). Give w(j). -21 Let f be (-4 + 18/4)(-72)/12. Let s(n) = n*2 + 8n + 14. Give s(f). -1 Let g(s) be the second derivative of s5/20 + s4/12 - 8s2 + 5s + 1. What is g(0)? -16 Suppose 4y + 5j = 7y + 5, -3y - 4j = -31. Let x(w) = w2 - 8w + 7. Determine x(y). -8 Let j(o) = 2o - 3 - 4o + 6o - o. What is j(2)? 3 Let c be (-8 - (-1 + -10))/(-2 + 1). Let t(s) be the second derivative of -s6/360 - s4/12 - s. Let o(a) be the third derivative of t(a). Calculate o(c). 6 Let c(y) = 1 - 2 - y2 + 2 - y. Let g = 1529 - 1531. What is c(g)? -1 Let j(x) = 7x + 3. Suppose 0s - w - 4 = -s, -3s - w = 8. Let a be 0 - (-1 - 3/s). Determine j(a). -11 Let f(p) = -p*2 + p + 1. Suppose 0 = 2k - 4y - 6, y + 17 - 8 = -k. Give f(k). -29 Let k(d) = -d3 + 6d*2 - 6d + 4. Suppose -6 = -j + 4j. Let l(h) = h3 - 7h*2 + 7h - 3. Let b(q) = jl(q) - 3k(q). Let w be (0 + 2)/(6/12). Give b(w). 10 Let b(d) = 6d. Let l(s) = s + 5. Let z(v) = -3v - 11. Let c(o) = -13l(o) - 6z(o). Let p(j) = 4b(j) - 5c(j). Determine p(-6). 1 Let g be (-1)/(-1) - (-1 + -4). Let u(s) be the third derivative of -s6/120 + s5/12 + 5s4/24 + s3/3 + 353s*2 + s. Determine u(g). -4 Let l = -1 - -6. Let a be 0 + (-48)/(-32)(-4)/(-6). Let w = l + a. Let s(f) = -f*3 + 5f*2 + 5f + 5. What is s(w)? -1 Let l(d) = d*3 - 3d*2 - 5d - 7. Suppose 18f + 3768 - 1284 = 0. Let g be (-4 - f/42)-7. Determine l(g). 18 Let z(q) be the first derivative of -q*4/4 - 7q*3/3 - 5q2/2 - q - 224. Determine z(-7). 34 Let k(r) be the first derivative of r4/4 + 7r3/3 + 5r*2/2 - 5r - 3. Let v(s) = -s - 6. Let q be v(-8). Suppose -qh - h = 18. What is k(h)? 1 Let a(s) = s3 - 9s*2 + 3. Let k = 14 - 5. Let m be a(k). Let q(z) = -z + 7 - 2 + mz + z. Determine q(-6). -13 Let p(m) = 6m + 125. Let o be p(-21). Let v(x) = 22x*3 - 2x2 - x. Give v(o). -23 Let d(t) = t3 + 12t2 + 8t - 6. Let b(v) = -2v3 - 25v*2 - 15v + 12. Let i(s) = -2b(s) - 5d(s). Give i(-9). 15 Let y(o) = -o + 20. Suppose -6h + h = b - 35, -3h + 4b + 21 = 0. What is y(h)? 13 Let j(r) = -r3 + 2. Let u be j(0). Let w(l) = ul - 2 + l*2 + 3l*2 + 1 - 4l. Determine w(2). 11 Let q(a) be the third derivative of a5/60 + a4/24 + 3a3 - 17a2. Let o(b) be the first derivative of q(b). Determine o(-1). -1 Suppose 0 = -w - 2 + 1. Let d(y) = y2 - 9y + 11. Let v be d(8). Let s(i) = 1 - 2i - vi + 0 - 2i. Give s(w). 8 Let n(b) = 5b + 15. Suppose 0 = -26u - 139 + 9. Calculate n(u). -10 Let w(s) = -106 + 54 + 47 + s. Calculate w(6). 1 Let b(s) be the second derivative of -23s5/20 + s3/6 + 873s. Let o be 2/(-5) - (-6)/(-10). Determine b(o). 22 Let b(k) be the third derivative of -k*6/120 + 7k*5/60 + 7k4/24 + k3 - k*2 - 184k. Suppose -4c = -2c - 16. Determine b(c). -2 Let b(k) be the first derivative of -k*4/4 + 3k*3 + 11k*2/2 - 6k + 1. Determine b(10). 4 Let f(g) = -g*2 + 10g - 13. Let q(x) be the second derivative of -x*4/6 + 10x*3/3 - 13x*2 - 48x. Let b(i) = 7f(i) - 4q(i). What is b(9)? 4 Let b = 1 + -4. Let x(v) be the first derivative of 1/2v2 - 11 + 3v. Give x(b). 0 Let z(j) be the first derivative of j3/3 - j2 + 300. Give z(5). 15 Let h(r) be the second derivative of r*3/3 - 2r2 - r. Let j(p) = p3 - 43p2 + 5. Let f be j(0). What is h(f)? 6 Let f(t) = -t2 - 7t + 2. Let l be f(-7). Let z be (2/(-6))/(l/(-18)). Let x(r) be the second derivative of -r*3/6 + 2r*2 - 215r. Give x(z). 1 Suppose 5u + 0 = 5o + 5, -2u + 10 = -4o. Let s be (u - (-84)/20)(-10)/4. Let m(d) = -d3 - 4d*2 - d. Give m(s). -6 Let s(q) = -q + 14. Let z(d) be the first derivative of -5d*2/2 + 57d - 15. Let m(i) = 9s(i) - 2z(i). Calculate m(-10). 2 Let j(w) = -w*2 + 4w + 7. Let u(c) = -c*2 + 1. Let y(o) = -j(o) + 2u(o). Determine y(-5). -10 Suppose -4j + 113 = 109. Let s(f) = -f + 1. Calculate s(j). 0 Let w(d) = 5d*3 + 6d + 0d3 - 7d2 - 6 + d2 - 4d3. Calculate w(6). 30 Let g(x) = 9120x*2 - 9121x*2 - 6x + 4 - 14. Give g(-7). -17 Suppose -l - 4b - 2 = 0, -l - 2b = l - 2. Suppose -lr - 4w = 4, 4r - 22 = 4w - 2w. Let i(f) = -4f + f*2 + 2f*2 + 10 - rf*2. Determine i(-7). -11 Let y(p) = 2p - 9. Let c(f) = -3f + 14. Let l(g) = -5c(g) - 8y(g). Let k be 184/44 - 2/11. Determine l(k). -2 Suppose -18 = 29x + 11. Let g(r) = -3r3 - 1. Determine g(x). 2 Let t(q) = 13q + 10. Let b(u) = 2u + 1. Let f(p) = -14b(p) + 2t(p). Give f(0). 6 Let f(s) = -5s - 20. Let c(h) = h + 5 - 5 + 1. Let b(g) = -7g2 + 160g + 27. Let a be b(23). Let p(r) = ac(r) + f(r). Determine p(0). -16 Let s(o) = 0o - 2o + 0o + 3 - 6. Determine s(4). -11 Let j(o) = -o. Let t(p) = -6p2 + 4p + 1. Let g(a) = 2j(a) + t(a). Calculate g(-1). -7 Let j = 371 + -155. Suppose 0h + 4h - j = 0. Let k be h/(-15) + 6/(-15). Let i(m) = -2m - 3. What is i(k)? 5 Let c(d) = -d - 4. Let l be c(0). Let s(n) = n*3 - 3n*2 - 8n - 8. Let u(a) = -2a3 + 2a*2 + 10a + 11. Let p(w) = 3s(w) + 2u(w). Determine p(l). -2 Let w be 4 - (-18 + 18)(1 + -2). Let c(i) = -13i - i + 3i + wi. Calculate c(-1). 7 Let s be (-36)/8*(-4)/	{ "pile_set_name": "DM Mathematics" }
3. Let w = -0.1 - p. Put w, -5, h in descending order. w, h, -5 Let q be (-2)/(-6 - -10 - -1 - 4). Put 17, 0, 5, q in descending order. 17, 5, 0, q Let g(o) = o*3 - 6o2 + o - 3. Let a be g(6). Suppose -j - 1 = a. Let b(z) = -z2 + 3z + 1. Let k be b(4). Sort j, k, -1. j, k, -1 Suppose 2 = 2j, 7j - 45 = 5d + 12j. Put 5, -1, d, -2 in ascending order. d, -2, -1, 5 Suppose -131d + 121d = 60. Let u(x) = 4x*3 - 2x*2 + 2x - 1. Let j be u(1). Put -4, d, j in ascending order. d, -4, j Let k = 284 - 283.3. Sort -3/4, k, 2, -0.4. -3/4, -0.4, k, 2 Let s be (-1)/(-3)0 + 3. Let r = 189.1 - 189. Sort r, s, -3 in increasing order. -3, r, s Let c be (-6)/(150/5) + 2/(-40). Put -1/2, 0.07, c in increasing order. -1/2, c, 0.07 Suppose 4l + 16 = 0, 2i - 5l - 10 + 0 = 0. Suppose -5q - 7 = 4a, -a + 1 = 2q + 2. Put q, 2, i in ascending order. i, q, 2 Suppose 4d + 495 = -9n + 4n, 3n + 497 = -4d. Put d, 3, 1, -4 in increasing order. d, -4, 1, 3 Let c = 228 - 230. Put -54, -3, c in ascending order. -54, -3, c Let j = 1208 - 1205. Let v = -2/11 - -17/33. Sort v, j, 21 in descending order. 21, j, v Let l be (-420)/675 + 4/10. Let w be (-32)/(-60) + (-2)/6. Sort -1, w, l in increasing order. -1, l, w Let r be 1246/63 - (-2)/9. Suppose -7b + 9b = -r. Let u be 1/(3 + 32/b). Put 4/3, -2/5, u in decreasing order. 4/3, -2/5, u Let t be (-945)/(-75) + -12 + 43/(-55). Put -1/8, t, -2/19, 5 in descending order. 5, -2/19, -1/8, t Let x = -0.026 - 19.974. Let w = 20.3 + x. Let v = -0.9 + 1.4. Sort v, w, -4. -4, w, v Suppose 5a - 20 = a. Suppose n - 17 = 4r, -an + r + 5 = -3r. Let c be (n + 4)0/(-2). Put -5, c, 3 in descending order. 3, c, -5 Let o = -2 - -1.6. Let s = 0.473 - 0.073. Let m = o + s. Sort m, 3, 0.1 in descending order. 3, 0.1, m Let j = -4 - -19. Let c = -94 - -108.6. Let s = j - c. Sort -1, 4, s in increasing order. -1, s, 4 Let a = 362 + -362.1. Put 0.04, a, 0.5 in increasing order. a, 0.04, 0.5 Let z = 0.05 - -1.95. Let c = 27 - 215/8. Put c, z, 11 in descending order. 11, z, c Suppose 4j - 3j = 2. Let n = -6 + 1. Let t be (-162)/18 + -11 - -20. Put t, n, j in ascending order. n, t, j Let c be 2/(-2)-51. Let p be 5/6(-36)/1215. Let l = p + 91/405. Sort 2/13, c, l in increasing order. 2/13, l, c Suppose 6p - p = -3u + 111, 0 = 2u - 3p - 93. Let a be ((-14)/(-6) + -2)/((-2)/u). Sort 5, 0, a, 2 in descending order. 5, 2, 0, a Let b be (-99)/(-132) + (-66)/56. Sort 16, b, 1 in ascending order. b, 1, 16 Suppose -3n - 2n = -15. Suppose 19 - 25 = -nb. Put 0, -2, b in descending order. b, 0, -2 Let k = 2.27 + -5.27. Let v = 11 + -7. Sort k, v, 1. k, 1, v Let v = -24 + 23.79. Let r = -0.79 + v. Put r, 4, 5 in ascending order. r, 4, 5 Let t be (-1 + 1)/((-4)/(-2)). Let v(f) = f2 + 4f - 1. Let j(r) = r. Let x be j(-4). Let l be v(x). Put t, -4, l in increasing order. -4, l, t Let m(n) = -3n + 13. Let z be m(4). Let r be (-6)/(-30) + (-11)/5. Let t = r - 1. Sort z, t, 3. t, z, 3 Let d(x) = 11x + 21. Let l be d(5). Let y = l - 75. Sort 0, -1, y, 4 in ascending order. -1, 0, y, 4 Let o = -50 + 37. Let a = o - -18. Sort a, 3, 6. 3, a, 6 Let k = 61 + -6. Let f = 52 - k. Put f, -13, -2 in descending order. -2, f, -13 Let a = 66 + -45. Let o = -106 + 83. Let h = o + a. Put 1/2, 0.1, h in ascending order. h, 0.1, 1/2 Suppose 4f = -0f - 12. Let n be 10(-4)/(-280) + (-2 - (-41)/7). Put 5, 0, n, f in decreasing order. 5, n, 0, f Let r = -0.1 - -0.3. Let k = -676 + 2707/4. Put k, 0.9, 3, r in decreasing order. 3, 0.9, k, r Let b(t) = 3t + 2. Let w be b(0). Let a = 4 - w. Suppose -am - 4 = -4k + 2m, 0 = 5k - 4m. Put 0.03, k, -5 in ascending order. -5, k, 0.03 Suppose 2g = -1 + 7. Suppose -4f - a + 14 = -35, ga = -3f + 39. Let z = f - 13. Sort z, 1/2, 2/13 in decreasing order. 1/2, 2/13, z Let o = 0.38 - 0.02. Let r = -0.06 + o. Let z be 72/(-18) - -29(-1)/(-7). Sort -2/7, z, r. -2/7, z, r Let l = 77/3 + -53/2. Let m = -265 + 266. Put m, l, -1/6, 0 in descending order. m, 0, -1/6, l Let g = -2.043 + 2.557. Sort 2, g, 5. g, 2, 5 Let t = 894.3 + -894. Put t, -2/21, 328 in decreasing order. 328, t, -2/21 Let u be (1 + 15/(-9))6. Let y(m) = -2m - 1. Let t be y(-3). Put u, t, -6 in increasing order. -6, u, t Suppose 3h + 20 - 35 = 0. Let v = 2 - 6. Let g be 10/v + (-1)/2. Sort h, g, 4 in increasing order. g, 4, h Suppose 3m + 4t - 2 = 0, -5t - 49 + 98 = -4m. Sort -2, 20, m in decreasing order. 20, -2, m Let o = -167.957 - 0.043. Let d = 167 + o. Sort -0.2, 9, d in descending order. 9, -0.2, d Suppose -4m = 69 - 1. Put m, -5, -1, 1 in ascending order. m, -5, -1, 1 Let q = -51 + 257/5. Let f = -3.9 + 0.9. Put f, q, -4, 2/7 in decreasing order. q, 2/7, f, -4 Let c(r) = 4r2 + 38r + 11. Let q be c(-10). Sort 0, 5, 4, q. 0, 4, 5, q Let p = 122 - 121.6. Let i = -0.5 + 0.3. Let u = i - 0.1. Sort u, p, -2. -2, u, p Let d = 5.3 + 16.7. Let a = 0.022 - 25.022. Let n = d + a. Put -1, -0.1, n in increasing order. n, -1, -0.1 Let l(q) = 2q2 + 41q + 16. Let d be l(-20). Suppose -15 = -5x, 0 = 5p + 3x - 8x. Put -1, d, p in ascending order. d, -1, p Let c = -1 + 2. Let j = 18.5 - 7.5. Let z = -14 + j. Sort z, c, -0.08. z, -0.08, c Let a = -1055.3 + 1055. Let z = -5 + 11. Sort z, a, 1/3 in decreasing order. z, 1/3, a Let y = -1.6 + 1. Let u = 0.09453 - -0.00547. Sort u, -3/4, -1, y in descending order. u, y, -3/4, -1 Let p(v) = -8v + 1. Suppose -3s + 4 = 1. Let d be p(s). Let k = 182 + -181. Sort -2, d, k. d, -2, k Let m = -129 + 134. Sort m, 2, -3, -7. -7, -3, 2, m Let l = -3 - -2. Let t be 326/120 + (-31)/620. Sort 4, t, l in descending order. 4, t, l Suppose -12n - 43 = 65. Let y be (0 - 0)/(n - -7). Put 3, y, 4, 2 in ascending order. y, 2, 3, 4 Suppose 20y - 110 = 19y. Let w = 1212/11 - y. Sort -0.2, -4, w, 1/3 in increasing order. -4, -0.2, w, 1/3 Let p = -1711 + 1688. Put 0.3, p, 0.4 in increasing order. p, 0.3, 0.4 Let b = 1.33 - 0.13. Let t = b + -1.6. Let l = -6 - -6.4. Sort t, -0.5, l in descending order. l, t, -0.5 Let s(n) = -n + 6. Suppose 0 = 2x + f - 21, -3x = f + 1 - 31. Let y be s(x). Put -4, 0, y in ascending order. -4, y, 0 Let j = -15 - -10. Let a be (-7 + 1)4/(-8). Suppose a = -2x - 3. Put -2, x, j in decreasing order. -2, x, j Let z(m) = 9m - 67. Let b be z(8). Let l be 01/(-4)2. Suppose x - 5x + 4 = l. Sort x, b, -1 in descending order. b, x, -1 Suppose -4m = -22m - 162. Let b(k) = k3 - 5k*2 - 7k + 7. Let v be b(6). Put m, 2, v in increasing order. m, v, 2 Let n = 305 - 308. Sort 2, n, -2, 5 in descending order. 5, 2, -2, n Let q(j) = -j*2 - 7j - 8. Let g be q(-6). Let u be (-12)/1414/(-3). Sort g, -5, u in increasing order. -5, g, u Suppose 23h - 31h = -16. Sort 1, -23, h in increasing order. -23, 1, h Let h(d) = -2d*3 - 29d*2 + 14d - 15. Let m be h(-15). Sort -0.3, -70, m. -70, -0.3, m Suppose 2b = -5o - 2b + 75, -4b = 3o - 45. Let w = -32 + 32. Put w, o, -3 in descending order. o, w, -3 Let o = 15 - 11. Let a be (-54)/13 + o(2 + -1). Put -1, a, -0.3 in ascending order. -1, -0.3, a Let r = -1726.96 - -1727. Sort r, 0.1, 9 in descending order. 9, 0.1, r Let u(o) = 4o + 87. Let j be u(-23). Sort -8, j, 4, 0 in ascending order. -8, j, 0, 4 Suppose -2d + 12 = -4o, -19o - 6 = -17o + 3d. Sort -5, 3, -27, o. -27, -5, o, 3 Let o(l) = -l*3 + 15l*2 - 11l - 37. Let c be o(14). Sort 0, 82, c in increasing order. 0, c, 82 Let s(m) be the first derivative of 3m2/2 - 3. Let l be s(3). Suppose li = 6i. Put i, 3/8, 2/11 in decreasing order. 3/8, 2/11, i Suppose -15s + 16s + 8s = 0. Put -3, s, 3 in ascending order. -3, s, 3 Let g = -167.67 + 167.57. Suppose -m - 4x = -9, 29 = -2m + 5x + 8. Sort m, g, -0.3, -2 in increasing order. m, -2, -0.3, g Let n be (-2 - -14)1/3. Suppose 14 = 590g - 583g. Sort -5, n, g in descending order. n, g, -5 Let o be 3 - 2 - 2/10. Let d be (-948)/16 - (-4)/16. Let z = d + 297/5. Put z, -1, o in ascending order. -1, z, o Suppose -4r = 3v - 31, -3r - 11 = -2r - 3v. Let h(f) = -2f*3 - 153f*2 + 232f - 141. Let g be h(-78). Sort r, -5, g, 5 in ascending order. -5, r, 5, g Let q = -1 + 1. Let d be 32/5 - 6/(-75)-5. Let l = d - 8. Sort q, -1, l in descending order. q, -1, l Suppose 0 = -4j - b + 4b + 274, 0 = 3j + 4*b -	{ "pile_set_name": "DM Mathematics" }
11)(-3j + 1 - 3 + 5j). 66j - 66 Expand (27y - 12y + 18y2 - 13y)(-1 + 1 + 1). 18y*2 + 2y Expand (0 - 3 + 6 + (6 - 4 + 0)(0 + 4 - 3))(3j2 - j2 + 0j*2). 10j*2 Expand (-6n + 6n + 3n*2)(-26n2 - 29n*2 + 61n*2). 18n*4 Expand (-20 + 20 + 8l*3)(-2l + 2l - 2l) + l4 - 3l*3 + 3l*3. -15l*4 Expand r - 9 + 9 + (-7r + r + 2r)(-2 + 5 - 2). -3r Expand (-4q + 4q + 3q*2)(2q3 + 4q - 4q) + q5 + 0q*5 + 2q*5 + (q + 0q + q)(3q*4 + 3q - 3q). 15q*5 Expand ((2 - 2 + v)(0 + 5 - 4) + 2v - 2 + 2 - 4v + 2v + 3v + 0v + v - 8v)(1 - 1 + v2). -3v3 Expand -n5 - 3n5 - 5n*5 + (2n*2 - 2n2 + n2)(n - n - 2n*3). -11n*5 Expand -3r*4 + 0r*4 + 4r4 + (0 + 0 - r3)(-3r + r + 0r) - 4r*4 + 4r*4 + 2r*4 + 2r*4 + 0r*3 + 0r*3 + (1 + 0 - 5)(-4 + r*4 + 4). 3r*4 Expand 7k*4 - 2k*4 - 3k*4 + (3k3 - k3 - 4k3)(k + 0k + k) + 7k4 - k4 - 3 - 5k4. -k4 - 3 Expand (-11n + 8n + 12n)(n2 - 2n2 - n2 + (-2n - 3n + 3n)(5 + 2n - 5)). -54n*3 Expand (-2i - i + i)(13i - 6i - 2 + 6i). -26i2 + 4i Expand -2 + 2 + 3g3 + (-1 + 3 + 0)(5 - 2 + 0)(-g3 + 2 - 2 - 2). -3g*3 - 12 Expand (10w - 10w - 14w*2)(1 - 4w - 1) + (-2w + 1 - 1)(-3w*2 + 0w*2 + 2w*2). 58w*3 Expand 3a + a*5 - 5a + 0a5 + (-2a*4 + 4a*4 - 3a*4)(-4a + 2a - 6a). 9a*5 - 2a Expand (-1 + 1 + 3j2)(2 - 8 + 2) - 3j2 + 3j2 - j2. -13j2 Expand (g + g + 0g)(3 + 0 - 1) + g + 10g - 4g. 11g Expand (r*2 - 2r2 - r2)(46r + 48r - 139r). 90r3 Expand (-4w3 + w3 + 4w3)(-3w - 6 + 6)(4 + 2 - 5)(-1 + 1 + w). -3w*5 Expand (2n*2 - 3n*2 + 5n*2)(-n + 0n + 3n)(n2 + 0n*2 - 3n*2)(5 - 8 + 5). -32n5 Expand (6h + 0h - 3h)(-4 + 1 + 17)(3 - 3 + 2). 84h Expand 5m - 3 - 2m + 3m + (-2m + 2m + m)(4 + 1 - 3). 8m - 3 Expand (2 - 5 - 4q + 0 + (-4 + 0 + 3)(-q - q + 0q))(5q - 4q + 0q). -2q*2 - 3q Expand (1 + 0 + 3)(-t + 5t - 3t). 4t Expand (1 + 0 - 3)(2 - 15 - 15)(2a - a + 0a). 56a Expand (8 - 8 + 8)(1 + 3g - 1). 24g Expand (8 + 6 + 38)(-2g + 6g - 3g). 52g Expand (0 + k + 0)(1 + 2 - 1)(-5 + 5 + 5) + 0k + 2k + 0k. 12k Expand (-3k + 3k - 2k)(5 - 3 + 1)(0 - 1 - 1) - k - 4k + 3k. 10k Expand -b4 + 1 - 1 - 8b*4 + 18b*4 + 6b*4 + (-4b*3 + 2b*3 + 3b*3)(4b - 4b - b). 14b4 Expand (-d - d + 3d)(-2d*2 - 1 + 1)(3 + 2 + 1). -12d3 Expand (-4 - 3 + 5)(-1 - 5 + 0)(4s + s - 3s). 24s Expand -2c - c - 4c - c - 3 + 3 + (-2 + 4 - 4)(-3c - 2c + 6c). -10c Expand (0 - b + 0)(-1 + 1 - 1) + 2 - 6b + 6b - 4b. -3b + 2 Expand (-k*3 + 0k*2 + 0k*2)(-40 + 40 + 3k + 0k - 5k + 4k + (-1 + 2 + 0)(-3k + 6k - k)). -4k*4 Expand (0c*2 + 0c*2 + 2c*2)(-c + c - 24c). -48c*3 Expand (-7 + 0 - x + 9)(-1 - 1 + 0). 2x - 4 Expand (-211r + 105r + 102r)(2 - 4 + 0). 8r Expand (3m - 2m - 3m)(0m4 + m3 - 3m*3 - 2m*4) - 16m*5 - 44m*2 + 44m*2. -12m*5 + 4m*4 Expand (25 - 25 + 6g)(0 + 9 + 4) - 3g + g + 0g. 76g Expand (4g - 4g + g*3)(3g2 - 2g*2 + 16g*2)(-2 + 0 + 0). -34g5 Expand (-z2 + 4z - 4z)(3 - 3 + 2z) - 27 - 3z - z*3 + 27. -3z*3 - 3z Expand 2r5 + 4r*5 - 4r5 + (-4 + 4 + r4)(-4r + 3r + 3r) + 5r5 - r5 + r5. 9r*5 Expand 5 + 2i*3 - 1 - 5 - 4 - 4i*3 + 4 + (4i + i - 4i)(2i2 - 6i*2 + 2i*2) + 0i3 + i3 + 7i3. 4i*3 - 1 Expand (2 - 1 + 1)(-3s - 2s + 3s + s - s + s + (0 - 4 + 2)(-3 + 3 + 2s) + 0s + 0s + s). -8s Expand 0s + 2s - s + (1 + 3 - 2)(0 - 2s + 0) - s - s + 3s - 2 + 2 + 2s + (-1 + 1 - 2)(-3s + 4s - 2s). 2s Expand (0m + 4m + 0m)(5m - 4m + 0 + 1). 4m*2 + 4m Expand (-2i4 - 3i*4 + 3i*4)(-i + 2 - 2 + (2 + 1 - 5)(-4i - 3i + 5i) - 3i + 0i + i). -2i5 Expand 0l*2 - 3l*2 + 6l*2 + (0l + 2l + 0l)(-2l + l - l) + l*2 + l - l + 2l*2 + 0l*2 - 4l*2 - 4l + 2 + 7l2 + 6l - 8l2. -3l*2 + 2l + 2 Expand (-q*2 + 2q2 + q2)(7q + 12q - 5q). 28q3 Expand (v2 - v2 + v2)(-1 + 3 - v - 1)(-50v - 3 - v*2 + 50v). v5 - v4 + 3v3 - 3v*2 Expand (-3 + 5 - 4)(3a - 2a - 3a) + 4116 - 4116 + 111a + (2 - 2 + a)(2 + 0 - 4). 113a Expand (-2a - 2a + 3a + 0a + a + 2a + (1 - 2 - 1)(0 + 0 - 3a) - 2 + 2 - a)(-3a - 2a*2 + 3a). -14a3 Expand (-9 + 9 - 11d)(d + 4d - 3d + (-3d + d + d)(0 - 2 + 0) + d + 1 - 1) - 2d*2 - 3 + 3. -57d*2 Expand (h + 0h - 3h)(5h - 5h - 2h) + h - h + 4h*2 + 6h*2 - 3h*2 - 4h*2. 7h*2 Expand (-3f*2 + 3f2 + f4)((-2f + 3f - 2f)(-4 + 2 + 1) + f - f + f + f + 4f - 2f). 5f*5 Expand 17l + 43l + 2l*2 + 10l + (-l + l - l*2)(1 + 2 - 5). 4l2 + 70l Expand (0 + 0 - 2t2)(6 - 9 + 13). -20t2 Expand (-194k + 194k + 22k*4)(-2 + 1 + 0). -22k4 Expand (1 + 1 + 1)(5d2 - 2d*2 + 0d*2)(-1 + 0 - 1). -18d2 Expand (-2 + 2u + 2)(1 + 2 - 5) - 2 + 2 - u + (3 - 3 + 2u)(4 - 5 + 2). -3u Expand ((-x + x - x*3)(3 + 0 - 2) + (x*2 + 0x*2 + 0x*2)(-x - 2 + 2) - 2x3 + x3 - x3)(4x + 2 - 2). -16x*4 Expand (444 + 13o - 444)(-o + 0 + 0). -13o*2 Expand (-3 + 2k + 3)(1 - 6 - 9) + (4 + 2 - 4)(3 + 2k - 3). -24k Expand (-4s + 0s + 2s)(-58s + 58s - 3s3)(3s - s - 4s + 3). -12s5 + 18s*4 Expand (-9s + 7s2 + 9s)((s2 + 3 - 3)(-1 - 4 + 4) + 3 - 3s2 - 3). -28s4 Expand -v5 - 4v3 + 4v3 + (-v5 - 4v5 + 4v*5)(3 - 2 - 2) + 3v - 3v - 2v5 - 10v*5 + 18v*3 - 18v*3. -12v*5 Expand (-1 + 0 - 4)(-2o - 9 + 9) + o - 3 + 3. 11o Expand (-3f - 3f + 4f)(-4 - 1 + 4) + 2f + 4f - 2f - 8 + 8 - 2f. 4f Expand 4w*3 - 4w*3 + 2w*3 + (0w + 3w - 6w)(-6w*2 + 3w*2 - 2w*2). 17w*3 Expand 0 + 0d*2 + 2 - 2d2 + d2 - d2 + d2 + (-2d - 4d + 3d)(-2d - 2d + 6d). -7d*2 + 2 Expand -1506 - 30n + 1506 + (3 - 5 + 0)(n - n + n). -32n Expand (-5 - 10 + 5)(-k + 2k + 0k)(1 - 1 + 2k3). -20k*4 Expand (2 + 0 - 4)(-4z2 - 10z*4 + 4z*2). 20z*4 Expand (-6 + 6 + 2f)(1 - 2 - 1) + 5f - 5f + f + (-3 - 2 + 4)(2f + 0f + 0f). -5f Expand (t*2 + 3t2 - t2 + (-t + 2 - 2)(0t + 4t - 3t))(0 - t + 0)(-t - 4t + 6t). -2t4 Expand (-2 - 3 + 7)(1 + p + 9 - 5p). -8p + 20 Expand (-2j + 2 - 1 + 0j)(8j*2 + 4j*2 - 4j*2). -16j*3 + 8j2 Expand (2 - 2 - l2)(-9 + 13 - 6) - 2l2 - l2 + 2l2 + (-3 + 5 - 3)(4l2 - 5l2 - l2). 3l2 Expand (0 + 1 - 3)(2 + 2w - 2 + 7)(4 - 4 - 2w). 8w*2 + 28w Expand -10l4 - 2l*4 + 3l4 + (-l2 - 2l2 + 2l*2)(0l2 + 0l2 + l2). -10l4 Expand (2z - 3z + 4z)(4 + 0 - 1)((0 - 4 + 2)(5 + 2z - 5) - 3z + 2z + 8z). 27z*2 Expand (0 + 0 - 1)((-4 + 1 + 1)(0m - 2m - m) - 4m + 3m + 2m). -7m Expand (-5 + 1 + 2)(5 - 4l2 + 0 + 3l*2). 2l*2 - 10 Expand (-22q*4 + 3q*3 - 2q*3 + 9q*4)(-q + 5q - 2q). -26q5 + 2q*4 Expand (-3j*2 + 0j2 + j2)((2j + 1 - 1)(3j + j - 2j) + 0j2 - j2 - j*2). -4j*4 Expand (-3d2 + d2 + 0d2 - 1)(-6d + 3d - 1 + 10d). -14d*3 + 2d*2 - 7d + 1 Expand -l*3 - 3l + 3l + (-2 + 2 + 4l*2)(0l + 3l - 3 - 1). 11l3 - 16l*2 Expand -4i*3 + 4i*3 + 2i*5 - 2i*5 - 2i*3 + 2i*3 - 2i5 - i5 + 4i5 + (3i - 5i + 4i)(0i*4 - 3i4 + i4) - 5i5 + 2i*5 + 2i*5. -4i*5 Expand (-2i*2 - 1 + 1)(-1 + 5 - 3 + (2 - 1 + 3)(-3 + 4 + 1)) - 3i*2 + 2i*2 + 0i*2. -19i2 Expand (-q2 + q4 + q2)(-q - 2q - 28 + 24). -3q5 - 4q*4 Expand (-2q - 3 + 3)(7 + 12 - 11)(4q - 4q - 2q)(-9 - 5 + 5). -288q2 Expand (-h - 2h - h)(-2 + 5 - 1)(-3h + 3h + h). -8h2 Expand 27i - 119i + 21i - 4i - i + 6i + (1 + 0 + 1)(-3i + 4i + 0i). -68i Expand -3 - 2p3 + 3 - p3 + 3p3 - p3 + 4p*3 + 0p3 - p3 + 3p3 - 4p*3 + 2p*3 + (5p - 4p + 0p)(2p + 2p2 - 2p). 5p3 Expand (-5j*3 + 4j*3 + 3j*3)(11j2 - 15j*2 + 5j*2). 2j*5 Expand (-10b + 6 - 6)((1 + 2 - 6)(0 + 0 - 1) + 4 - 5 - 1). -10b Expand -k + 0k + 3k + 0k + k - 2k + (-2k - k + 4k)(8 + 9 - 6) + (2k + 0 + 0)(2 - 1 + 1). 16*k Expan	{ "pile_set_name": "DM Mathematics" }
= 25. Is 10 a factor of r? True Let h(t) = -2t3 + 2t*2 - 5t + 4. Let a(l) = -l*2 + l - 1. Let s(k) = -4a(k) - h(k). Does 26 divide s(2)? True Let g be (8 - 0) + 8 + -9. Suppose 0 = -12l + gl + 90. Is l a multiple of 6? True Suppose 0 = -3i - 0 + 6, i + 8 = 2d. Suppose 3h = -4c + dh + 124, -2h + 4 = 0. Is c a multiple of 16? True Let x = -92 + 182. Is x a multiple of 10? True Let x(m) = -m*2 - 10m + 8. Let j be x(-7). Let u be -3((-46)/(-6) + -2). Let l = u + j. Does 6 divide l? True Let a(j) = 15j + 36. Let o(h) = 8h + 18. Let f(v) = -4a(v) + 7o(v). Does 13 divide f(-11)? True Suppose 40 = -2m + 12m. Is 4 a factor of m? True Suppose 0 = 4q + 4 - 28. Does 4 divide q? False Suppose 7 + 1 = 2k, -9 = -y + 3k. Is y a multiple of 8? False Let t(u) = -u*3 + 2u2. Let l be t(3). Let f(o) = -o2 - 11o - 4. Is f(l) a multiple of 6? False Suppose 2b - 984 = -4b. Is 25 a factor of b? False Suppose -3j = 2q - j - 308, 4q - 614 = -5j. Is q a multiple of 13? True Let d(x) = x - 5. Let k be d(5). Suppose k = 5j - j - 4. Is 9 a factor of 25j - (3 + -2)? False Let b be (-6)/(-15) + 8/5. Suppose -q = bq - 27. Does 3 divide q? True Let m(u) = u3 + u2 + u - 4. Is m(4) a multiple of 10? True Let c(b) = 2b2 - 6b - 23. Does 33 divide c(7)? True Suppose 5d - 3h - 390 = 0, d - 3h - 25 = 53. Does 13 divide d? True Suppose -604 = -2y + 5o - 141, 5o = -5y + 1070. Is 13 a factor of y? False Suppose 4y - 3a - 4 = 0, 5y + a - 4 - 1 = 0. Let b be ((-2)/4)/(y/78). Let s = -27 - b. Is 6 a factor of s? True Let n(x) = -28x + 11. Let w(u) = 14u - 5. Let r(k) = -3n(k) - 5w(k). Is 10 a factor of r(4)? False Is 20 a factor of ((-4)/2 - 0) + 22? True Let l be (4/2)/(-4)10. Let q(z) = -2z*2 - 4z + 1. Let k be q(-3). Is 8 a factor of (-114)/l + (-1)/k? False Suppose -c + 6c = -i + 12, 0 = 4c - 8. Suppose -5h - 10 = -30, -4k + ih + 72 = 0. Is k a multiple of 10? True Let s = 22 - 17. Suppose -9 = -su + 71. Does 8 divide u? True Let b(q) = -q - 5. Let i be b(-8). Suppose 0 = -2l - if + 21, 3f = -4l + 29 + 28. Does 7 divide l? False Let d(p) = -p3 - p2 - 3p + 4. Let t be d(-3). Suppose 3h - 5v = -t, -5v = 4h - h - 19. Does 6 divide (-4)/h - 3 - -14? False Let b be (1/(-2))/(6/(-36)). Let l(a) = a2 - a. Let h be l(b). Suppose -q - h + 28 = 0. Is 10 a factor of q? False Suppose -n = n - 6. Suppose nz = -2m + 88, 2z - 57 + 11 = 5m. Suppose l + l = z. Is l a multiple of 7? True Suppose -4b + 0 + 8 = 0. Suppose 5m = bm + 84. Is 14 a factor of m? True Let y = -8 - -12. Suppose -yr = -0r. Suppose 0x - 2x + 30 = r. Is x a multiple of 10? False Let a(j) = j + 3. Let k be a(-7). Is 410/8 + k/16 a multiple of 24? False Let w be (-2)/(-8) - 196/16. Let x = -6 - w. Does 5 divide x? False Let q(i) = i - 3. Let n be q(6). Suppose nz - 31 = 4j, 0j + 3j - 58 = -4z. Suppose -p + z = -0p. Is 5 a factor of p? False Suppose 2r = -5o + 4, -3r = 2o - r + 2. Is 5 a factor of (-184)/(-20) + o/(-10)? False Does 15 divide (0 + -55)/((-3)/(4 + 5))? True Suppose 3b - 20 = -2b. Suppose -bg = -7g + 27. Does 8 divide g? False Suppose -3q - 5c + 150 = 0, c = -3q + 5c + 177. Does 7 divide q? False Let u be 10/(1 + 0 + 1). Suppose -un = -5r - 0r - 110, 3n + 4r - 66 = 0. Is 11 a factor of n? True Let r(v) = 5v - 13. Let s be r(13). Suppose -5u = a + a - s, -4u - 2a = -42. Is 3 a factor of u? False Suppose 3n - 4n + 56 = 0. Does 13 divide n? False Suppose 2n = 4z + 24, 5n - 6 = 2z + 6. Is (-5)/(8/z + 1) a multiple of 3? True Does 30 divide (-59 - -2)(-2 - (-20)/(-15))? False Suppose 3z - 1 = 5, -5s = -z - 478. Let l = s - 38. Is 16 a factor of l? False Let o = -1 - -1. Suppose -3r = -5z + 117, z - 8r + 4r - 37 = 0. Suppose o = 2v + 5 - z. Is 3 a factor of v? False Let l = 36 - 21. Is l a multiple of 5? True Suppose -5f = -f - 308. Is f a multiple of 11? True Is (0 - 17)(-10 - -4 - -1) a multiple of 17? True Suppose 2n - 213 = -n. Is n a multiple of 8? False Let s be 4/(-3) - 10/15. Does 15 divide ((-20)/8 - s)-38? False Let r(w) = -8w*3 - 3w*2 - 4w - 2. Is 12 a factor of r(-2)? False Let t(b) = b3 + b2 - b + 49. Does 20 divide t(0)? False Let p(q) = -q*2 - q + 5. Let r be p(-4). Is 2/r - (-2248)/28 a multiple of 20? True Let r(o) = 4o + 6o - 4o + o*2 + 3 - 1. Is 9 a factor of r(-7)? True Is 16 a factor of 4 + -5 + 4 - -13? True Suppose -5g + 43 = 2m - 16, 5m - 4g = 164. Let p = 10 + m. Is p a multiple of 21? True Let g be (3 + 2)4/5. Suppose g = -c + 9. Suppose 5r = -2l - 0r + 22, cr = 2l - 22. Is 8 a factor of l? False Suppose 3r = -5n + 83, 0 = -8r + 13r - 2n - 190. Does 9 divide r? True Let j(l) be the third derivative of -l5/60 - l4/4 + l*3/3 - 4l2. Let v be j(-5). Let b(u) = -u3 + 6u2 + 11u - 6. Is b(v) a multiple of 9? False Let c(f) = -f - 1. Let l(g) be the second derivative of -g*3/2 - 5g*2/2 + g. Let j(p) = 2c(p) - l(p). Does 6 divide j(9)? True Suppose -89 = 3f + 40. Let u = f + 91. Does 12 divide u? True Suppose 3b - 40 = 8b. Let d = -11 - b. Is 11 a factor of (-132)/(-9) - (-2)/d? False Suppose 642 = 3s - 174. Is 36 a factor of s? False Let r(a) = -3a2 - a. Let x be r(2). Is (-4)/x + (-136)/(-14) a multiple of 10? True Let p(w) = 2w*2. Let n be p(-1). Let u be (-12)/n - -3. Suppose -12 + u = -2c. Is c even? False Suppose 0 = -4r + 2r + 2. Let y be (-1)/r1 - 7. Let k = y - -40. Does 13 divide k? False Let z(v) = 9v - 9. Is 3 a factor of z(2)? True Let j be -80(-1)/(-2 + 3). Suppose 2x = -3x + j. Is 5 a factor of x? False Let y(d) = 17 - 7d - 18 + 11 + d2. Does 18 divide y(8)? True Let h = -53 - -149. Is h a multiple of 31? False Suppose 72 = 5k - k. Is 11 a factor of k? False Does 10 divide (-2 - -2 - -30)2? True Let l be (-2)/(-11) + 1446/33. Let b = l - -4. Does 24 divide b? True Let r(f) be the first derivative of f4/4 + 5f3/3 - f2 - 2f - 7. Does 11 divide r(-4)? True Let l(n) = n3 + 5n*2 + 4n + 2. Let g = 18 - 20. Does 2 divide l(g)? True Let g = -8 - -13. Suppose -c - 4k + 55 = 20, -98 = -3c - gk. Is 16 a factor of c? False Suppose -239 = -5y + 3t, 0 = -5y - 2t - t + 221. Let k = 83 - y. Suppose -4u + k = -23. Is 15 a factor of u? True Let u = -8 - -5. Suppose k - 1 = -3f, -2f + 16 = -3k + 74. Let n = k + u. Is 13 a factor of n? True Let o(j) = j2 + 5j - 2. Let f(c) = -c + 2. Let p be f(-4). Let a be 31/6 - 1/p. Is 13 a factor of o(a)? False Suppose -5p + 5d + 40 = -20, 4p - 16 = -4d. Does 8 divide p? True Does 36 divide 0/1 + (93 - 1) + 0? False Suppose 0 = 3s + 5k - 91 + 25, -4s = 2k - 88. Does 11 divide s? True Let v be 141/6(-2)/1. Let a(l) = -19l - 15. Let d be a(-5). Let x = d + v. Is x a multiple of 21? False Suppose 4g - 5w - 88 = 0, 2g = 7g + 2w - 110. Does 3 divide g? False Let u = 25 + -19. Let n(t) = t + 14. Does 5 divide n(u)? True Suppose -3z + 40 = -26. Suppose 0 = 5k + 3v - z, -3 = k + 2v - 13. Is (-1410)/(-40) - k/8 a multiple of 13? False Let b(r) = -r3 + r2 - r + 27. Let z be b(0). Suppose 3o = 2g + 71, -2g + z = o - g. Is 14 a factor of o? False Let o(t) = t*3 - 7t*2 - 9t + 7. Let m be o(8). Let u(y) = -22y + 1. Let n be u(m). Suppose 21 = 2b - n. Is b a multiple of 12? False Suppose 0 = 3s - 4 - 2. Let k be (-4 - 1)/(s/(-4)). Suppose -2u + k = 3u. Is u a multiple of 2? True Let s be 225/21 - 2/(-7). Let k = s - -3. Does 7 divide k? True Let i(x) = -3x + 3 + 0x + 3 + 0x. Is i(-5) a multiple of 14? False Let m(x) = x - 4. Let y be m(8). Suppose -2 = 4a - 2b, 0a + yb - 30 = -5a. Suppose 16 = 2g + ag. Does 2 divide g? True Let x(v) = -v3 + 3v*2 + 6v - 6. Let f be x(4). Suppose 8 = -fg + 60. Does 21 divide g? False Suppose -3r + 8 = 2. Suppose 13 + 77 = 3y. Suppose -y = -rq - q. Is q a multiple of 10? True Let q(k) = -k + 21. Let s = 34 + -22. Let l be q(s). Let u(p) = -p*2 + 12p - 3. Does 15 divide u(l)? False Let m(k) = 8k + 87. Is m(-9) a multiple of 2? False Let f = -5 - -46. Is 7 a factor of f? False Suppose 5y = 4y + 15. Does 13 divide y? False Let q(w) = 11w + 5. Is 7 a factor of q(3)? False Suppose 4o = 175 - 23. Let f = o - 17. Suppose -2n = -17 - f. Does 19 divide n? True Suppos	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.