Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
4. 2sqrt(5) + 9 Simplify sqrt(114)/(sqrt(12)/sqrt(2)) - (-2 + -1 + sqrt(19)). 3 Simplify 1(sqrt(80) - sqrt(80)-1) - 1sqrt(20)/sqrt(4)4. 4sqrt(5) Simplify sqrt(68)/sqrt(4) + 4 + sqrt(102)/(sqrt(6)1 + sqrt(6)). 4 + 3sqrt(17)/2 Simplify (sqrt(8)/sqrt(4)6 + (sqrt(2) - (sqrt(72) + sqrt(2))-3) + -2)*2. -112sqrt(2) + 1572 Simplify sqrt(209)/(sqrt(55)/sqrt(5)) + (-21sqrt(19))*2. sqrt(19) + 76 Simplify (-3sqrt(132)1)/((sqrt(60)-2)/sqrt(5)). 3sqrt(11)/2 Simplify -4 + (sqrt(1872) - (0 + sqrt(1872) + (sqrt(1872) + sqrt(1872)2)*2)) + ((sqrt(1872) + 1)3)*2. 5 + 216sqrt(13) Simplify (-1-1sqrt(2057) + sqrt(2057))*2. 8228 Simplify (sqrt(1539)1 + sqrt(1539) + 3 - sqrt(1539))*2. 54sqrt(19) + 1548 Simplify sqrt(50)/(3sqrt(10)) + sqrt(1125)/sqrt(9). 16sqrt(5)/3 Simplify (sqrt(200) + -5 - sqrt(200))2 + sqrt(200) - ((sqrt(20)/sqrt(10))2 + 3). 10sqrt(2) + 20 Simplify (-5(sqrt(4) + sqrt(8)/sqrt(2)))/(sqrt(162)-2). 5sqrt(2)/9 Simplify (-1sqrt(76)3 + sqrt(76) + sqrt(76))-5. 10sqrt(19) Simplify 3 + (1sqrt(85))/sqrt(5). 3 + sqrt(17) Simplify sqrt(2) + ((sqrt(2) + 1 + 4)2 - sqrt(2)) + (sqrt(200) - (sqrt(200) - sqrt(200)-1))*2. 10sqrt(2) + 227 Simplify (-6(5 + 3 + sqrt(117) + 2 + sqrt(117)))2. 4320sqrt(13) + 20448 Simplify ((sqrt(84) - -1sqrt(84))-2 - sqrt(84))/(1sqrt(432) + sqrt(432)). -5sqrt(7)/12 Simplify -3 + sqrt(448) + sqrt(448) + 3. 16sqrt(7) Simplify sqrt(17) + (sqrt(17) + 1)21 - (-3 + sqrt(2448)). -9sqrt(17) + 21 Simplify ((sqrt(2058)-2)/sqrt(384))*2. 343/16 Simplify sqrt(5)-1 + sqrt(5) + 3 - ((sqrt(125)1)2 + sqrt(5) - sqrt(5)). -122 Simplify 1(sqrt(2) + (1sqrt(50))2 + sqrt(2)). 2sqrt(2) + 50 Simplify (1sqrt(5) + 2 - -2sqrt(605)) + 4. 6 + 23sqrt(5) Simplify 6(sqrt(612) + 1)-1. -36sqrt(17) - 6 Simplify sqrt(108)4 + sqrt(21)/sqrt(7) + 2. 2 + 25sqrt(3) Simplify -5(0 + sqrt(208))21. -40sqrt(13) Simplify (sqrt(11) - (2 + sqrt(1331)))*2 + sqrt(11)3 + 1. 43sqrt(11) + 1105 Simplify -4(sqrt(72) - sqrt(2) - sqrt(2)) + (sqrt(2)-4 + 3)2. -40sqrt(2) + 41 Simplify ((sqrt(33) - 4sqrt(165)/sqrt(5))/((sqrt(77) + (sqrt(77)1 - sqrt(77)) + sqrt(77) - sqrt(77))/sqrt(7)))*2. 27 Simplify (5 + sqrt(245)-2)*2. -140sqrt(5) + 1005 Simplify 12sqrt(78)/sqrt(6). 2sqrt(13) Simplify 5 + ((sqrt(68)-2-6 + sqrt(68) - sqrt(68)) + sqrt(68) - sqrt(68) - sqrt(68))/sqrt(4). 5 + 11sqrt(17) Simplify -1 + (sqrt(44) + -1)*2. -4sqrt(11) + 44 Simplify 2(sqrt(3) + 3 + 4). 2sqrt(3) + 14 Simplify (sqrt(77) + 41sqrt(77))/(sqrt(252)2). 5sqrt(11)/12 Simplify 4 + (sqrt(55)-3)/sqrt(11). -3sqrt(5) + 4 Simplify (sqrt(84)-1 + sqrt(21))/((sqrt(3) - sqrt(27))2). sqrt(7)/4 Simplify (sqrt(85) + sqrt(85)-2)/sqrt(5) + (-1sqrt(153) + sqrt(153))/sqrt(9) + -2. -sqrt(17) - 2 Simplify (((sqrt(95) - ((sqrt(95) - (5sqrt(95) - sqrt(95))) + sqrt(95)))-4)/sqrt(5)1)2. 2736 Simplify (sqrt(425) - (((-3 + sqrt(425))-1 + sqrt(425) - sqrt(425) - sqrt(425)) + sqrt(425)))*24. -240sqrt(17) + 6836 Simplify (sqrt(264)/(sqrt(24)/sqrt(2)))/sqrt(11). sqrt(2) Simplify (0 + sqrt(175) + sqrt(175) + -1 - (3 + sqrt(175)-1 + sqrt(175) + sqrt(175)))*2. -40sqrt(7) + 191 Simplify ((sqrt(84) + 4sqrt(84) + sqrt(84) - sqrt(84))2)/sqrt(12). 10sqrt(7) Simplify (((-2sqrt(40) + sqrt(40))/sqrt(4))/(sqrt(245) + sqrt(245) + (sqrt(245) - 2sqrt(245)) + sqrt(245)))2. 1/98 Simplify -6(((-1sqrt(459))/sqrt(9))/(sqrt(3) - sqrt(27)1))*2. -51/2 Simplify (2sqrt(208)4)2 + sqrt(52)2-1. -4sqrt(13) + 13312 Simplify (-1sqrt(63) + sqrt(7) + 5)2. -20sqrt(7) + 53 Simplify (3 + sqrt(3) + -2)*25. 10sqrt(3) + 20 Simplify -5 + 4sqrt(13) + 5(sqrt(78)/sqrt(6))2. 4sqrt(13) + 60 Simplify -4 + (sqrt(17)1 - sqrt(17)) + sqrt(17) - 3(sqrt(1088) + sqrt(17)). -26sqrt(17) - 4 Simplify -2 + sqrt(288)-5. -60sqrt(2) - 2 Simplify -6(3 + 1sqrt(17) - sqrt(204)/sqrt(192)). -9sqrt(17)/2 - 18 Simplify (sqrt(95)/(4(sqrt(5) + -4sqrt(5))))*2. 19/144 Simplify ((sqrt(5) - -2sqrt(5) - sqrt(5))6)2 + sqrt(320) + 0. 8sqrt(5) + 720 Simplify (0 + sqrt(704) + 1 + sqrt(704))*2. 32sqrt(11) + 2817 Simplify (sqrt(5) + -1sqrt(5) + -1 - sqrt(5))2 + (sqrt(5) - (((sqrt(20)/sqrt(2) - sqrt(10)) + sqrt(10))/sqrt(2))2). 1 + 3sqrt(5) Simplify ((-2(sqrt(65) + -2sqrt(65)))/(sqrt(5) + sqrt(5)2-1 - sqrt(5)))*2. 13 Simplify 2(sqrt(3) + 0 + sqrt(12)). 6sqrt(3) Simplify 4(sqrt(612) + -1sqrt(612) + (sqrt(17) - (sqrt(17) + sqrt(17)-3 + -3))). 12 + 12sqrt(17) Simplify ((sqrt(104) + sqrt(104)-1)/sqrt(4))/((sqrt(96)/sqrt(4) + sqrt(24))/sqrt(12) - sqrt(2)). 0 Simplify sqrt(136)/(sqrt(8) + 3sqrt(72)). sqrt(17)/10 Simplify sqrt(190)/(sqrt(1000)-2). -sqrt(19)/20 Simplify (sqrt(19)-1)2 + 2 - (sqrt(1539) + -1 + sqrt(19)). -10sqrt(19) + 22 Simplify (6(1(0 + sqrt(468)) - (1sqrt(468)5 + sqrt(468))))*2. 421200 Simplify 6(0 + sqrt(99) + sqrt(99)3)2. 9504 Simplify (21sqrt(42))/(2(-2sqrt(6) + sqrt(6))). -sqrt(7) Simplify (sqrt(300) + sqrt(300) + (sqrt(300) + sqrt(300)-1)5)2. 1200 Simplify sqrt(704)-1 + sqrt(704) + -4. -4 Simplify sqrt(84)/(-2sqrt(12) + sqrt(12) - sqrt(12)) - -1sqrt(21)/sqrt(3). sqrt(7)/2 Simplify (sqrt(19) + sqrt(209)/sqrt(275))*2 - (5 + sqrt(76)). -2sqrt(19) + 559/25 Simplify ((0 + sqrt(7))-3 - sqrt(7) - (sqrt(42)1)/sqrt(6))*2. 175 Simplify -4 + sqrt(320) + sqrt(320)1 + -2sqrt(15)/sqrt(3). -4 + 14sqrt(5) Simplify ((sqrt(78) + 1(sqrt(78)1 - sqrt(78)))/sqrt(6))*2. 13 Simplify (4 + (sqrt(13) + sqrt(208))-2 - (-3 + sqrt(143)/sqrt(176)))*2. -287sqrt(13)/2 + 22637/16 Simplify 2 + (sqrt(76) + 3 - (sqrt(133) - sqrt(133)-1)/sqrt(7)). 5 Simplify (sqrt(153) + 5 - sqrt(17)26)2. -90sqrt(17) + 1402 Simplify (sqrt(19) - (sqrt(171) + 0)) + 2. -2sqrt(19) + 2 Simplify 4 + (sqrt(288) - (sqrt(288)1 + 3)). 1 Simplify (sqrt(190)-2-6 + sqrt(190))/(sqrt(30)/sqrt(3)-6). -13sqrt(19)/6 Simplify (-3sqrt(343) - sqrt(7)) + sqrt(49)/(sqrt(21)/sqrt(3)). -21sqrt(7) Simplify (-2 + sqrt(5))*22 + (sqrt(55) + sqrt(55) + 1sqrt(55))/sqrt(11). -5sqrt(5) + 18 Simplify sqrt(52)/sqrt(4) + -4 - (-1 + sqrt(13)2). -sqrt(13) - 3 Simplify ((sqrt(52)/sqrt(4)5)*2 - (sqrt(13) + sqrt(65)/sqrt(5) + -5)) + -1. -2sqrt(13) + 329 Simplify (sqrt(3) - (1 + sqrt(15)/sqrt(5))*2)3. -12 - 3sqrt(3) Simplify ((sqrt(336)/(sqrt(6) + sqrt(384) + sqrt(6)))/sqrt(8))2. 7/100 Simplify sqrt(20)/sqrt(90) + 2. sqrt(2)/3 + 2 Simplify (sqrt(3969)-5 - sqrt(3969))/sqrt(7). -54sqrt(7) Simplify -1-6(sqrt(77) + (sqrt(77) - sqrt(77)15))/sqrt(7). -18sqrt(11) Simplify (-5(1 + sqrt(363)))2 + 3. 550sqrt(3) + 9103 Simplify -2sqrt(128) + sqrt(20)/sqrt(10) + 3. -15sqrt(2) + 3 Simplify (-2sqrt(14)2)/(sqrt(7) - 1sqrt(252)). 4sqrt(2)/5 Simplify ((sqrt(13) + sqrt(39)/sqrt(3))3 + sqrt(13))5. 35sqrt(13) Simplify 5 + (sqrt(216)/sqrt(3))2. 77 Simplify (-2sqrt(128) + sqrt(128) + -2)*22. 64sqrt(2) + 264 Simplify sqrt(1573) + sqrt(1573) + 2 + 0 - (sqrt(1573) + 2 + 0)2. -1575 - 22sqrt(13) Simplify (sqrt(378)/sqrt(3))/(-2(sqrt(7) - (sqrt(7) + sqrt(14)/sqrt(2)))). 3sqrt(2)/2 Simplify -4(-51sqrt(110))/sqrt(160). 5sqrt(11) Simplify 2sqrt(52)/sqrt(4)-4. -8sqrt(13) Simplify sqrt(605)2 + 1 + 2. 3 + 22sqrt(5) Simplify (sqrt(13) + -1)1 + -1. -2 + sqrt(13) Simplify sqrt(637) + sqrt(637) + (-1sqrt(637)1)*2 - (2 + (-2sqrt(637))*2). -1913 + 14sqrt(13) Simplify sqrt(8) + (1 + sqrt(72) - sqrt(8))*2 - 6(1 + sqrt(162) + sqrt(162) - sqrt(162))*2. -945 - 98sqrt(2) Simplify (((sqrt(42)/sqrt(6) - sqrt(7)) + sqrt(7))-6-1)*2. 252 Simplify (2sqrt(70)-5)/(5sqrt(20)/sqrt(2) - sqrt(10)). -5sqrt(7)/2 Simplify 4sqrt(7)-1-4 + -2. -2 + 16sqrt(7) Simplify (21sqrt(128) + (sqrt(128) - -3sqrt(128)) + 3)*2. 288sqrt(2) + 4617 Simplify 3 + sqrt(2)1 + 0. sqrt(2) + 3 Simplify sqrt(612)11. 6sqrt(17) Simplify 2 + -1sqrt(11) + -3. -sqrt(11) - 1 Simplify (sqrt(3)265)*2 - sqrt(15)/((sqrt(25) + sqrt(400))/sqrt(5)). -sqrt(3)/5 + 10800 Simplify ((3sqrt(1216) + 1)-3)2. 432sqrt(19) + 98505 Simplify (2sqrt(48) + 4)-5. -40sqrt(3) - 20 Simplify (5 + sqrt(200) + 0 + sqrt(200) + sqrt(200))2 + 5 + 2 + sqrt(200). 310sqrt(2) + 1832 Simplify (-4sqrt(70)-1)/(sqrt(1000) - (-2sqrt(1000) + sqrt(1000) - sqrt(1000) - sqrt(1000)) - sqrt(1000)). 2sqrt(	{ "pile_set_name": "DM Mathematics" }
nd 7221? 9416184 Calculate the lowest common multiple of 199983 and 112140. 11998980 Calculate the common denominator of -19/218416 and 125/2652. 8518224 What is the common denominator of -67/17895696 and 77/491640? 89478480 What is the common denominator of -47/174180 and 23/505122? 5051220 Calculate the least common multiple of 387 and 371600625. 1114801875 What is the least common multiple of 1300860 and 5346? 3902580 Calculate the common denominator of -71/24395938 and 79/508. 48791876 Calculate the least common multiple of 1365 and 20865. 146055 Calculate the lowest common multiple of 848439 and 100353. 9332829 What is the least common multiple of 3427 and 1005721? 149852429 Find the common denominator of 39/7771 and 53/2631915. 50006385 Find the common denominator of 65/32958384 and -67/65916768. 65916768 Calculate the lowest common multiple of 321104 and 60592. 173717264 Calculate the smallest common multiple of 126 and 109611. 1534554 Find the common denominator of -19/900 and 191/4069260. 20346300 Calculate the smallest common multiple of 3848752 and 563232. 23092512 Find the common denominator of 77/100720 and 1/18947950. 151583600 Calculate the common denominator of -19/3592470 and -149/3592470. 3592470 What is the common denominator of -133/4356 and 8/311781? 452706012 What is the common denominator of -139/71164476 and -21/16? 284657904 What is the least common multiple of 11662775 and 24695? 128290525 What is the lowest common multiple of 7939494 and 4836240? 952739280 Find the common denominator of 137/4034310 and 3/386. 778621830 Find the common denominator of -95/42009954 and -41/919926. 126029862 What is the smallest common multiple of 1300 and 307300? 3994900 What is the least common multiple of 3666160 and 14? 25663120 Calculate the least common multiple of 24744 and 876350. 10516200 Find the common denominator of -67/33 and -119/3909918. 43009098 What is the common denominator of -57/6580951 and 11/6259929? 256657089 Calculate the least common multiple of 9744 and 1670400. 11692800 Find the common denominator of -3/4753 and 109/609742. 4268194 Find the common denominator of -31/502391175 and 88/27403155. 1507173525 What is the least common multiple of 1582860 and 408480? 12662880 What is the common denominator of -89/177106508 and 109/774? 1593958572 What is the lowest common multiple of 48 and 398700? 1594800 What is the smallest common multiple of 61040 and 5886? 1648080 Calculate the common denominator of 47/74 and 17/595494. 22033278 Calculate the common denominator of 13/3116875 and -47/498700. 12467500 What is the smallest common multiple of 120 and 12228600? 12228600 What is the lowest common multiple of 8882874 and 319? 8882874 What is the lowest common multiple of 1099 and 7667723? 7667723 What is the common denominator of 61/16548 and -8/4137? 16548 Calculate the common denominator of 18/1275967 and 26/1589. 1275967 Calculate the lowest common multiple of 73339514 and 10. 366697570 Find the common denominator of -7/221600474 and -41/58658949. 1994404266 Calculate the common denominator of -139/30 and 25/178146. 890730 What is the smallest common multiple of 7772850 and 63? 54409950 Calculate the common denominator of -41/1107308 and 9/244. 67545788 Calculate the common denominator of 101/6056536 and 20/141571529. 1132572232 Calculate the lowest common multiple of 7410 and 717. 1770990 Calculate the common denominator of -59/4522 and -75/1718626. 29216642 What is the common denominator of 97/505288 and -19/602? 21727384 Calculate the smallest common multiple of 151063 and 1320. 18127560 Find the common denominator of 79/7016950 and -89/200. 28067800 What is the common denominator of -83/2725834 and -101/8792? 76323352 Find the common denominator of 39/201252680 and 115/3474. 1811274120 What is the least common multiple of 175584 and 13632? 24932928 What is the lowest common multiple of 7741286 and 219093? 23223858 What is the common denominator of -107/67095498 and -25/36? 402572988 Calculate the common denominator of -53/9690933 and -70/51. 164745861 What is the common denominator of -143/2784 and -11/4594122? 73505952 Calculate the smallest common multiple of 814 and 265208822. 2917297042 What is the common denominator of -141/70 and -22/16398599? 163985990 Calculate the smallest common multiple of 16 and 35732060. 142928240 What is the common denominator of 127/11432640 and -23/32? 11432640 What is the common denominator of -125/22861272 and -23/8572977? 68583816 Calculate the common denominator of 121/13887246 and -40/11829. 13887246 Find the common denominator of -79/107070238 and -69/3539512. 428280952 What is the least common multiple of 8279370 and 250890? 8279370 Calculate the common denominator of 17/12960 and -63/151280. 24507360 What is the smallest common multiple of 2748980 and 78916? 497565380 What is the common denominator of -73/4737876 and -101/22308? 61592388 Find the common denominator of -5/4 and 89/15951912. 15951912 Calculate the least common multiple of 452662 and 3129. 1357986 Calculate the common denominator of 97/102668 and -67/4256. 109238752 What is the least common multiple of 27577065 and 9515? 303347715 What is the least common multiple of 96768 and 1896? 7644672 Calculate the least common multiple of 129478120 and 56. 906346840 What is the common denominator of 47/171897 and -79/1617? 8422953 Calculate the lowest common multiple of 10103916 and 9. 30311748 What is the common denominator of -29/21140 and -101/61880? 9343880 What is the smallest common multiple of 211142 and 320542? 61864606 Calculate the lowest common multiple of 2334012 and 312. 60684312 Calculate the lowest common multiple of 61848 and 810. 2783160 What is the least common multiple of 248155 and 1550? 2481550 Find the common denominator of -66/35 and 137/1268976. 44414160 Calculate the smallest common multiple of 194184 and 6916. 335744136 What is the smallest common multiple of 36 and 16456132? 148105188 What is the common denominator of -101/3645242 and -15/12007856? 204133552 Calculate the smallest common multiple of 8416386 and 623436. 16832772 Calculate the common denominator of -131/57103272 and 127/18. 57103272 Calculate the common denominator of -11/23 and -21/2799353. 2799353 Calculate the lowest common multiple of 117 and 14017432. 126156888 Find the common denominator of 47/13034746 and 64/9. 117312714 Calculate the common denominator of -43/604995 and -81/1613320. 4839960 Find the common denominator of -65/154 and -53/560161. 12323542 Find the common denominator of 23/189597056 and -53/4182288. 568791168 Find the common denominator of -55/274 and -13/3425. 6850 Find the common denominator of -107/304380 and -151/5832. 49309560 Calculate the least common multiple of 1720 and 21590730. 86362920 What is the common denominator of -53/93205 and -68/32529? 433123635 Calculate the lowest common multiple of 15303996 and 10202664. 30607992 Find the common denominator of -39/36728125 and 149/30. 220368750 Calculate the least common multiple of 324 and 870264. 870264 Calculate the common denominator of 61/7402688 and 109/5136. 22208064 Find the common denominator of 163/660 and -109/149160. 149160 Calculate the smallest common multiple of 4125 and 64625. 193875 Calculate the common denominator of 87/653800 and 11/56040. 1961400 What is the least common multiple of 54 and 16378155? 98268930 What is the smallest common multiple of 69858604 and 17? 1187596268 Calculate the smallest common multiple of 736170 and 4958730. 262812690 Calculate the lowest common multiple of 312849 and 1216635. 10949715 Find the common denominator of 101/3137748 and -139/8692410. 643238340 Calculate the smallest common multiple of 21131 and 27305740. 3085548620 Calculate the common denominator of -23/14518 and -4/66551. 15839138 Calculate the lowest common multiple of 78 and 20780721. 41561442 Calculate the smallest common multiple of 4316136 and 4577720. 151064760 What is the lowest common multiple of 873 and 54765? 5312205 Calculate the common denominator of 169/3660 and 8/5385. 1313940 Calculate the smallest common multiple of 376136 and 1880680. 1880680 Calculate the least common multiple of 1837 and 10112685. 10112685 Find the c	{ "pile_set_name": "DM Mathematics" }
rounded to four dps? -0.0002 Let y = -0.213434 - -9.635534. Let c = y - 9.4. What is c rounded to three dps? 0.022 Let s be 1 - (-9)/(-2)-32. Suppose 0 = 2z - 6, p + 2z - 27 = -2p. Suppose px + s = 6x. What is x rounded to the nearest ten? -150 Let x be (-19349874)/(-30) - (-2)/10. Let c be x/5 + (-4)/(-5). What is c rounded to the nearest 10000? 130000 Let i = -1.021 - 32.609. Let a = i + 33.549968. Let l = a + 0.08. Round l to 5 decimal places. -0.00003 Let h = 0.65 - 0.6501683. What is h rounded to five dps? -0.00017 Let s = 0.2741 + -129.1741. Round s to the nearest 10. -130 Let j = -30835 - -17888. What is j rounded to the nearest 100? -12900 Suppose -3q = -4q - 48996. Let v be 7 + -4 - -1 - q. Round v to the nearest 10000. 50000 Let k be (-368064549)/6 - (-4)/(-8). Let a = k - -41544092. Round a to the nearest 1000000. -20000000 Let h = 573081286.517617 - 1240.517617. Let d = h + -573079885.0000077. Let n = d + -161. What is n rounded to 6 decimal places? -0.000008 Let s = -4529.118 + 4524. What is s rounded to one decimal place? -5.1 Suppose 0 = -6w + 8w - 8. Suppose 0 = 6l - wl + 24. What is l rounded to the nearest ten? -10 Let z = 1404.6786 + 0.3214. Let l = z - 978. Let f = 427.217 - l. Round f to 2 dps. 0.22 Let s = 2.787 - 3.1. Round s to 2 dps. -0.31 Let r = -47108 - -47209.755. Let h = r + -102. Let z = h + 0.136. Round z to two decimal places. -0.11 Let i = 0.103802132 + -0.1038. What is i rounded to six dps? 0.000002 Let i = -0.44 - 2.21. Let j = i - -37.85. Round j to the nearest integer. 35 Let t = 6.19 + -6.4. Let c = t + -0.91. What is c rounded to 1 dp? -1.1 Let v(s) = 8s3 - 6s*2 + 23s + 5. Let c be v(15). What is c rounded to the nearest ten thousand? 30000 Let i = 800 + -789.99. Round i to zero dps. 10 Suppose -1 + 4 = s. Suppose sh - 1030 = -241. Suppose d + 907 = -h. What is d rounded to the nearest one hundred? -1200 Suppose -15 = -5r, -4k - 4r + 133959 = -186589. Suppose -k = -3w - 21334. Round w to the nearest 1000. 20000 Let w be ((-3)/(-3) + 27)/2. Let f be (-3619640)/(-35) + (-4)/w. Suppose 0 = 2u - 158582 - f. What is u rounded to the nearest 10000? 130000 Let m = -1.2348 - 209.0852. What is m rounded to 0 decimal places? -210 Let s = -127.9 + 328.5. What is s rounded to the nearest ten? 200 Let g = -9.48 - -9.48000027. Round g to 7 decimal places. 0.0000003 Suppose -7v = -2v. Suppose 4s + 2z + 53 = -3z, v = -3z - 3. Let r be (50/(-6))/(s/619200). Round r to the nearest 100000. 400000 Let f = 4347.999994734 + -4348. What is f rounded to seven decimal places? -0.0000053 Let y = -154.77 - -153. Round y to the nearest integer. -2 Let s = -208631 - 427269. What is s rounded to the nearest 100000? -600000 Let v = -2244.4 - -2244.447901. Let h = v + -0.048. What is h rounded to 5 dps? -0.0001 Let m be (-1)/(-1) + (-54)/(-18). Let q be (-1)/((-8)/m) - 248002/4. What is q rounded to the nearest 10000? -60000 Suppose 3j - 1089297 = 4k + 2570712, -k - 2j = 914994. What is k rounded to the nearest 10000? -920000 Let i = 1537 - 7187. Let c be (12 - 4)/(4/i). Round c to the nearest 1000. -11000 Let j = -574 - -574.02026. What is j rounded to three dps? 0.02 Let m = 1577.358 + -1539.3. Let y = m - -0.142. What is y rounded to the nearest integer? 38 Suppose -4f + 0d = -5d + 72719995, -f + 3d - 18179997 = 0. Round f to the nearest 1000000. -18000000 Suppose 0 = 7h - 4h - 96. Suppose 2m = 5y - 2m + h, 3 = m. Let a = y + 4. What is a rounded to 3 dps? 0 Let t = -60 + 75. Suppose -2n + 78880000 = tn. What is n rounded to the nearest one hundred thousand? 4600000 Let g = -0.0099 - 0.2599. What is g rounded to 2 dps? -0.27 Let b = -0.39 - -0.21. Let t = -375121 - -375120.8199947. Let c = t - b. What is c rounded to six dps? -0.000005 Suppose 0 = 240k - 248k + 72. Suppose y = 2y - 352. Suppose q = kq - y. What is q rounded to the nearest 10? 40 Let q = -85.44067 + 6.44447. Let g = 79 + q. What is g rounded to 3 decimal places? 0.004 Let f = -3183 - -20717. Let c be (12/15)/((-12)/(-152010)). Let b = f - c. Round b to the nearest one thousand. 7000 Let h = -997 + 539. Let n = -0.09183 - 438.00817. Let i = n - h. What is i rounded to the nearest integer? 20 Let y = -55 - -62. Suppose -1817070 = yw + 1164930. Round w to the nearest 10000. -430000 Let t = 49557.011 + -49530. Let q = -27 + t. What is q rounded to three dps? 0.011 Let i = -6833012 + -2136988. What is i rounded to the nearest one million? -9000000 Let l(i) = -2i3 - i2 + 6i - 60000. Let n be l(0). What is n rounded to the nearest one hundred thousand? -100000 Suppose -2s - 27241527 - 68678498 = 5c, -2s + 3c = 95919985. Round s to the nearest one million. -48000000 Let q(l) = 2l - 5. Let f be q(4). Suppose 3c + fm - 12 = c, -c - 1 = -2m. Suppose -8s - 4500 = -cs. Round s to the nearest 100. -900 Let u(l) = -13l*3 + 24l*2 - 5l + 18. Suppose -5k + 22 = -63. Let f be u(k). Round f to the nearest ten thousand. -60000 Let i = 113.4 + -102. Let d = i - 11.40066. Round d to three decimal places. -0.001 Let o be -1 - (-1 - (9590002 + -2)). What is o rounded to the nearest one million? 10000000 Suppose 139a = 136a - 1668000. What is a rounded to the nearest one hundred thousand? -600000 Suppose -33216063 = 9h + 32933937. What is h rounded to the nearest 1000000? -7000000 Suppose -3b + 10 = -b. Let o = 20 - b. Let p be -80000-50o/(-8). Round p to the nearest one million. -8000000 Suppose -9 = -3k + 6. Suppose -kq + 5t = -42000025, t + 42000005 = 5q - 0t. What is q rounded to the nearest one million? 8000000 Let s = 248.000000276 + -248. What is s rounded to 7 decimal places? 0.0000003 Let s = -43 - -31. Let l = s + 12.027. Round l to 2 decimal places. 0.03 Let a be (-5)/((4/5)/(-4)). Suppose -a = 3w - 8w. Let p be (-6999)/w - 4/20. What is p rounded to the nearest 1000? -1000 Let f = 2.651 - -0.219. Let p = f + -3.506. Round p to one decimal place. -0.6 Let v = -447113.000064 - -447099. Let q = -28 + 14. Let a = q - v. What is a rounded to five decimal places? 0.00006 Let b = -188 + 84. What is b rounded to the nearest 100? -100 Let y(g) = 27500010g - 3. Let u be y(-3). Let t be u/11 - -31. Round t to the nearest 1000000. -8000000 Let l = -3052.368 + 3053.3680024. Let w = 1.7 - 0.7. Let x = l - w. What is x rounded to six dps? 0.000002 Let v = 3.4 + -27.68. Let z = v - -25. What is z rounded to 1 decimal place? 0.7 Let p = -492 + 497.738. What is p rounded to one decimal place? 5.7 Let s = 17 - 14.9. Let m = -14.9 - s. Let f = m + 17.00000044. What is f rounded to 7 decimal places? 0.0000004 Let d(l) = 9l + 7. Let j = -14 - -12. Let o be d(j). Let z = o + -38. What is z rounded to the nearest ten? -50 Let r = 75 + -51. Let a be r/(-9)(151 + -1). Round a to the nearest 100. -400 Let y = -784775.999925 + 784786. Let a = 10 - y. Round a to five decimal places. -0.00008 Let p = -0.69 + 0.646. Let y = -1.01 + 1.112. Let n = p - y. Round n to two dps. -0.15 Let m = 27.01 - 0.81. Let o = 26.200119 - m. What is o rounded to five decimal places? 0.00012 Let g = 0.337042 + -2.375712. Let h = g - -2.04. Round h to four decimal places. 0.0013 Let a = -8.76 + -0.44. Let q = a + -1.8. Let k = q - -11.0000032. Round k to six decimal places. 0.000003 Suppose -k = 8 - 5. Let l(h) = -13h2 + 8h + 4. Let i be l(k). What is i rounded to the nearest ten? -140 Let s = 1.01424 + -0.9373. Round s to three dps. 0.077 Let r = -1811.4602 - -1811. What is r rounded to 1 dp? -0.5 Let l(p) = -p*3 + 5p*2 + 5p + 5. Let x be l(6). Let g(w) = -571w2 - w. Let y be g(x). Round y to the nearest 100. -600 Let y = -2.53 + -207.47. Let g = y + 210.0654. Round g to three decimal places. 0.065 Let p = -1.6 + 1.512. Let k = 2302 + -2299.762. Let q = k + p. What is q rounded to 1 decimal place? 2.2 Let a = -1766 + 1454.7. Let j = 327 + a. Let g = j - 16. Round g to the nearest integer. 0 Let z = -93 + 93.16. Let y = -0.29 - z. Round y to one decimal place. -0.5 Let d = -8738573.59000136 + 8738574. Let s = d - 0.41. Round s to 7 decimal places. -0.0000014 Let j = 125.5 + 19.5. Let v = j - 145.38. Round v to one decimal place. -0.4 Let w be (-36 + 9 - -12)1706000/(-3). Round w to the nearest 1000000. 9000000 Let m = -0.062 + 0	{ "pile_set_name": "DM Mathematics" }
Put -1/8, x, 0.01 in increasing order. -1/8, 0.01, x Let n(i) = -i*3 + 5i*2 - 5i + 1. Let g be n(3). Suppose -4r = 10s - 7s + g, s - 4 = 0. Let w(b) = 7b*2 + b - 2. Let h be w(1). Sort h, r, 0. r, 0, h Let h be -4 - -3 - 42/1. Let z be (-1)/((-3)/9) + 162/4. Let i = z + h. Put 4, 0.7, i in decreasing order. 4, 0.7, i Let l = -38953/4 + 195847/20. Let w = -54 + l. Let v = 1389 - 1388.6. Put v, 3, w, -0.1 in descending order. 3, v, w, -0.1 Suppose 7u = 4u - 5j + 355, -3u + 5j = -395. Let a = -121 + u. Suppose -3g = -2 + 17. Sort 3, g, a in increasing order. g, 3, a Suppose -440 = 534q - 494q. Sort q, 2, 3 in decreasing order. 3, 2, q Let v = 1 - 1. Let d = 3845 - 3843. Sort 2/13, 6/7, d, v in increasing order. v, 2/13, 6/7, d Let u = -15619/2 + 7810. Put 0.29, -1, u, -2 in decreasing order. u, 0.29, -1, -2 Let v = 31541/3639 - 1/1213. Put 0, 45, -1/2, v in descending order. 45, v, 0, -1/2 Let q = 5554.06 + -5554. Sort -0.1, 0.1, 12, q. -0.1, q, 0.1, 12 Let j(b) = b3 - 21b*2 - 11b - 237. Let y be j(22). Sort 306, y, -1. -1, y, 306 Let h = 0.2 - -0.2. Let c = -397153 - -397152.6. Sort 0, c, h. c, 0, h Let k = 274 + -270. Suppose 0 = -4z - f + 115, -3f = -z + 2z - 15. Let l = z + -20. Put -1, k, l in increasing order. -1, k, l Let g be (-10)/(-66)7 - 1. Let w = 491.9733 - -0.0267. Let a = w + -489. Put -4, a, -1/4, g in descending order. a, g, -1/4, -4 Suppose 5c + 8 = -2b, c - 2b + 0 + 4 = 0. Suppose 0p = 4p + 64. Let q = p + 11. Put q, -1, c in increasing order. q, c, -1 Let r = 607 + -615. Put 1/4, r, -0.4, 0.1 in ascending order. r, -0.4, 0.1, 1/4 Let k = 2282 + -2313. Sort 0, 4, k in ascending order. k, 0, 4 Let u be 4/16 - 27/12. Let j = u - -4. Let m = 73/9 - 8. Sort m, j, 1/6. m, 1/6, j Suppose 163b = 152b + 11 - 0. Sort -1, b, 3298, -3. -3, -1, b, 3298 Let i(z) = 2z*2 - 11z - 133. Let t be i(-6). Put -1, t, 3/5, -29 in ascending order. -29, -1, 3/5, t Let p(m) = -3m. Let r be p(1). Let y(w) = w2 + 23w + 26. Let i be 2-13 + 24/(6 + 0). Let u be y(i). Put -5, u, r, 5 in descending order. 5, u, r, -5 Suppose -4q + q = 2w + 416, -4q - 524 = -5w. Let o = q + 44. Let f be 3 + o/(-28)-1. Put -4/7, f, 3 in increasing order. -4/7, f, 3 Let g be 304/190 + 15212/(-20). Put -3/4, 1, g in decreasing order. 1, -3/4, g Let t = -1004901962/21199 + 1374512/29. Let i = t - -108/17. Let l = i + -51/172. Put l, -4, -5, 0.1 in decreasing order. 0.1, l, -4, -5 Let y = -16510 - -16512. Sort -684, y, -2/3 in descending order. y, -2/3, -684 Let i be ((-2 + 1)0)/(-2). Let w(a) = 500a - 1496. Let m be w(3). Sort -16, i, m in descending order. m, i, -16 Suppose 0 = -256h - 1164 + 396. Put h, 137, -5 in descending order. 137, h, -5 Let i = 9 - 9.251. Let n = -0.749 + i. Let w be -121/(-14). Put n, -4, w, 1/2 in decreasing order. 1/2, w, n, -4 Let x(n) = 2n*2 - 43n - 23. Let k be x(22). Let i be (-3)/(-3) - (6 + (k - 5)). Sort 4, i, -2. -2, i, 4 Suppose 4c = 5o - 20, 23c - 20c + 5o + 15 = 0. Put 14, c, 1, 5, -7 in increasing order. -7, c, 1, 5, 14 Let z(w) = -25w*3 - 774w*2 + 35w + 88. Let o be z(-31). Put o, 11, -2, -3 in decreasing order. 11, -2, -3, o Let l = 13623 + -13624. Put l, 3, 17, 0, 9 in descending order. 17, 9, 3, 0, l Suppose 4q - 3u = 39 - 8, -q + 5 = 2u. Sort -3, q, 1/2, 3/8, 2/9 in descending order. q, 1/2, 3/8, 2/9, -3 Let x = -0.9 - -0.7. Let a = -415 + 414.9574. Let p = a + 0.9426. Sort 2/11, x, p in ascending order. x, 2/11, p Let m = -47 - -4. Suppose -29z + 5q = -33z + 35, -3z = -15q + 105. Sort -4, z, m. m, -4, z Let w = -1564/3 + 522. Let a(r) = -r*2 + 24r - 64. Let l be a(21). Sort l, w, -7 in increasing order. -7, l, w Let p(y) = y*3 - 5y*2 - 6y - 1. Let t be p(6). Suppose -464a + 3 + 3 - 6 = -536a. Put t, a, -52, 2 in increasing order. -52, t, a, 2 Let d = -6 - -9. Let c(t) = 282t - 13534. Let o be c(48). Put d, o, -5, 5 in decreasing order. 5, d, o, -5 Let g = -2744 + 2739. Put -0.1, -1/11, g, -11, 1 in ascending order. -11, g, -0.1, -1/11, 1 Let y = 4447.8 - 4448. Sort 4, -2.97, y in increasing order. -2.97, y, 4 Let m be 4/6 - 88/(-66). Let f be 3 + -3 + m + -6. Sort 1, f, 10 in descending order. 10, 1, f Let r be (-3)/(-30)5 - -1. Suppose 0 = 2n - 5k - 16, -4n = 4k - 8k - 20. Suppose np + 18 = 3o, -7 = 2p - o + 9. Sort -4, r, 1, p in increasing order. p, -4, 1, r Suppose 0 = -183r + 206r + 30751. Put 3, 0, r in increasing order. r, 0, 3 Let i(c) = c*3 - 2c*2 - 2c + 1. Let t be i(3). Let m be 33/(-9) - (1026/(-81) - -11). Put m, -4, 0, t in ascending order. -4, m, 0, t Let r(n) = -n*3 - 5n*2 - 2n + 3. Let l be r(-4). Let h be (1284/18)/(4/12). Let m = h - 223. Sort l, 3, m. m, l, 3 Let j = -2 + 3. Suppose -3p = -4u + 4, -5p - 5 + 6 = u. Put 0.43, p, j in ascending order. p, 0.43, j Let s = 740 + -740.0379. Let t = -4.0379 - s. Suppose 3j = 12, o + 1 + 3 = -j. Sort t, o, -0.1 in increasing order. o, t, -0.1 Let h = 218 + -218. Suppose -l - 11 = 5a, h = -l + a - 5 + 6. Put 0, 12, l in decreasing order. 12, 0, l Let j be 1273/(-570) + 5/6 + -1. Let g = -53/20 - j. Let p be (-1 - 1) + 14. Put g, p, 0.19 in ascending order. g, 0.19, p Suppose 0 = 23p - 25p. Suppose 8c + 12 + 4 = p. Put 2/13, c, 3, -3 in increasing order. -3, c, 2/13, 3 Let t = 502.778 + -0.778. Let b = -505 + t. Sort -0.7, -0.3, b, -1/5. b, -0.7, -0.3, -1/5 Let w = -123/8 - -855/56. Let t be 1/3 - (0 - (25 - 26)). Put -5, t, w in decreasing order. w, t, -5 Let r = -6842.95 - -6843. Put 61, r, 2 in descending order. 61, 2, r Let h = -2572 + 2563. Sort 3, h, 24, -3 in increasing order. h, -3, 3, 24 Let m(l) = 8l*2 + 199l - 12. Let r be m(-25). Sort -1, -5, 5, r in descending order. r, 5, -1, -5 Let d = 18164 + -18164. Sort 2/9, d, -2/119, 2/13, -1 in descending order. 2/9, 2/13, d, -2/119, -1 Let w = 3 - 1. Let a = 64 + -229. Let s be a/(-300) - (-6)/(-8). Put w, -3/2, s, -0.3 in increasing order. -3/2, -0.3, s, w Let q(x) = -x*2 - 34x - 95. Let b be q(-3). Let j be (b/4 - -1)(-308)/1386. Let h be (-6)/(-76)(-8)/6. Sort j, h, -0.1, 0 in decreasing order. 0, -0.1, h, j Let d be (-2)/6 - (-13)/3. Let j(u) = 9u + 86. Let g(o) = -9o*3 - 3o*2 + 4o - 2. Let f be g(1). Let n be j(f). Sort -6, n, 1, d in descending order. d, 1, n, -6 Let l = 72 - 68. Suppose 0 = -ly - 4w, 3w = 4y - 15 + 1. Suppose 0 = 5a - 0a + 10. Sort -1, -7, y, a. -7, a, -1, y Let l = -135.1 - -135.4. Sort l, -2, 0.5, -12.3. -12.3, -2, l, 0.5 Let x(g) = -22g - 3. Let r be x(-8). Suppose 0k + 5u = -3k + r, 3k - 163 = 5u. Let c = k - 57. Sort -2, c, 17. -2, c, 17 Suppose -24 = 8c + 192. Let m = -29 - c. Let s be (19/40)/(-1) + m/5. Sort 3/7, s, 1 in increasing order. s, 3/7, 1 Let o = -172 - -164. Let p = o - -4. Put p, -11, 0.5 in increasing order. -11, p, 0.5 Suppose -4b - 10 = 24 - 26. Sort -17, -23, b in descending order. b, -17, -23 Let b = 2.979 - 3.209. Sort -2/11, -6, b in decreasing order. -2/11, b, -6 Let d(r) = -r*2 + 506r + 3587. Let n be d(-7). Sort 8121, n, 0 in increasing order. n, 0, 8121 Let h = 3.46 + -0.67. Let t = h + -1.19. Sort t, 0.1, 16 in ascending order. 0.1, t, 16 Let q = -2.99262 - 0.00738. Put -4, 2/21, -4/5, q, 0.009 in ascending order. -4, q, -4/5, 0.009, 2/21 Let r = 1.255 + -1.146. Put r, 2, 5 in ascending order. r, 2, 5 Let q be 3/(2/((-2)/(-5))). Let s(p) = 2p3 - 583p*2 + 338p - 13690. Let x be s(291). Put -4, 0.5, x, q in decreasing order. q, 0.5, -4, x Let i(u) = -4u3 + 10u*2 - 123u + 119. Let l be i(6). Put -3, 4, -2, l, 3 in decreasing order. 4, 3, -2, -3, l Let l = -3295 + 3295. Sort -5, 2/3, l, -2/5, 65 in descending order. 65, 2/3, l, -2/5, -5 Let o = -2159 - -2160. Sort o, -1/2, 116, -0.2 in increasing order. -1/2, -0.2, o, 116 Let f = -10361 + 10399. Put -2, -1, f, 0 in decreasing order. f, 0, -1, -2 Let o(c) = -2c3 + 14c*2 + c - 1. Let s be o(7). Let w be (-1)/(-7)-27. Put w, -8, s, -4 in descending order. s, w, -4, -8 Let i(g) = g2 + 6g - 7. Let f be i(-7). Let p = f - 1. Let w = 2952 - 2951. Put w, -3, 0, p in descending order. w, 0, p, -3 Let b = 1066 - 7468/7. Let m = -7 + 7.1. Sort b, -0.3, -3/8, m. b, -3/8, -0.3, m Let x = 15462 - 15458. Put -1407, x, 0.6 in decreasing order. x, 0.6, -1407 Let s = 14039 + -	{ "pile_set_name": "DM Mathematics" }
y3 + 21y*2 - 63y*2 + 15y*2. 30y*3 Collect the terms in -57g*2 + 20g*2 + 12g*2 + 65829006g - 65829004g. -25g*2 + 2g Collect the terms in -776l2 + 643l*2 - 618l*2 - 2171l*2. -2922l*2 Collect the terms in -138289y*2 - 415168y*2 - 595101y*2. -1148558y*2 Collect the terms in -6445q*3 - 320q*3 + 77213q*2 - 77213q*2. -6765q*3 Collect the terms in -20n + 63n + 57n*2 - 17n - 6n + 8n*2 - 18n. 65n2 + 2n Collect the terms in -327 - 183 + 8n2 + 510. 8n*2 Collect the terms in -4047649z*3 + 2024143z*3 + 2023799z*3. 293z*3 Collect the terms in -33464c*2 - 15 + 16749c*2 + 6 + 16715c*2 + 3c*3. 3c*3 - 9 Collect the terms in 21 - 23 + 1048817z*2 - 1048818z2. -z2 - 2 Collect the terms in -20y2 + 2981y*2 - 334y*2 + 5837y*2. 8464y*2 Collect the terms in -4g*3 + 30 - 69 - 180436g + 180436g + 2 + 37. -4g3 Collect the terms in -i3 + 5i3 - 4i*3 + 7i*2 + 6i3 + i2 - 6i2. 6i*3 + 2i*2 Collect the terms in -44 - 1254b*3 + 14 - 65 + 95. -1254b*3 Collect the terms in -59 + 10 + 1608o + 25 + 22. 1608o - 2 Collect the terms in -577133 + 13987y*2 + 13978y*2 + 577133 - 27963y*2. 2y*2 Collect the terms in 39 + 2b*2 - 10270b - 10268b - 10281b + 30819b. 2b*2 + 39 Collect the terms in -26845q*2 + 53569q*2 - 26720q*2 - 4q*3. -4q*3 + 4q*2 Collect the terms in 178 - 86 - 38727c*2 - 92. -38727c*2 Collect the terms in -30s + 15s - 766907s*2 + 15s. -766907s2 Collect the terms in -7t - 15585606 + 15585579 + 4t. -3t - 27 Collect the terms in 1204 - 1204 - 877y2 - 2132y*2. -3009y*2 Collect the terms in -226570867g*2 - 226570881g*2 + 453141751g*2. 3g*2 Collect the terms in 18n*2 - 84 - 30n*2 + 13n*2 + 492n. n*2 + 492n - 84 Collect the terms in -661x3 + 1329x*3 - 292x*3 - 1 + 1 - 240x*3. 136x*3 Collect the terms in 5 - 194974z - 5 + 97529z + 97443z. -2z Collect the terms in -12o*3 - 2o*3 - 2o*3 + 7o3 + o2 - 5o - 54o - 23o3. -32o3 + o2 - 59o Collect the terms in -4656c - 34581c - 18600c. -57837c Collect the terms in -4 - 13718t*2 + 4 - 11285t*2 - 9769t*2. -34772t*2 Collect the terms in 126365 + 83672 - 318y + 33876. -318y + 243913 Collect the terms in 57w - 2 + 6 + 39w - 18 + 14. 96w Collect the terms in 112238916664870 - 2n2 - 112238916664870. -2n*2 Collect the terms in 6v*3 - 2948299024v*2 + 2948299024v*2. 6v*3 Collect the terms in -321 - 10w*3 - 277 - 275 + 31w*3 + 873. 21w*3 Collect the terms in 592121s*2 - 296052s*2 - 296093s*2. -24s*2 Collect the terms in -488f*2 + 164f*2 + 166f*2 - 108248f*3 + 158f*2. -108248f*3 Collect the terms in 112070a - 1 - 55590a - 56021a + 1. 459a Collect the terms in 207964b - 69302b - 69411b - 69240b. 11b Collect the terms in 41550q2 + 140q - 13875q2 - 13850q*2 - 13857q*2 + 138q - 278q. -32q*2 Collect the terms in 119 + 152a*3 - 27 - 4 - 81 - 7. 152a*3 Collect the terms in -2u + 141408936u3 - 3u - 70704474u3 + 5u - 70704465u3. -3u*3 Collect the terms in -1 + 436c - 39c + 0 + 344c + 140c. 881c - 1 Collect the terms in 0o + 0o + 99o3 - o2 - 27 + 26 + 0o*2. 99o3 - o2 - 1 Collect the terms in -92n3 + 35575 + 35580 - 106733 + 35579. -92n*3 + 1 Collect the terms in 9 - 18w + 12 - 45 + 2 + 22 + 17w. -w Collect the terms in -66 - 106 + 126p*2 - 137p*2 + 172. -11p*2 Collect the terms in 2q*2 + 93 + 15 + 5927 + 1825. 2q*2 + 7860 Collect the terms in 0p + 420 - p - 7 + 0p. -p + 413 Collect the terms in 3379l*3 - 11803l*3 + 8423l3. -l3 Collect the terms in -33468b3 - 12b + 12b - 33443b*3 + 66888b*3. -23b*3 Collect the terms in 303k + 391k + 383k + 390k - 1858k + 385k. -6k Collect the terms in 78x3 - 95x*3 - 204x*3 - 128x*3. -349x*3 Collect the terms in 104l*3 + 89l*3 + 153l - 303l + 150l - 176l3. 17l*3 Collect the terms in b + 26918 - 26918 - b - b + 8b - 10b. -3b Collect the terms in 3x3 - 6x*3 - 2x*3 - 196 + 194 - 152x*2 - 2x*3. -7x*3 - 152x*2 - 2 Collect the terms in -1687818i*2 - 1687838i*2 + 3375657i2. i2 Collect the terms in -3902 + 5937 - 989 - 2q2 - 1046. -2q*2 Collect the terms in 55564784 - 55564784 + 55s*2. 55s*2 Collect the terms in 126840x - 253593x + 145x*3 + 126753x. 145x3 Collect the terms in -1047b*2 - 882b*2 - 4b + 475b2 - 2b*3. -2b*3 - 1454b*2 - 4b Collect the terms in 8128s2 - 3s*3 + 434737 - 434737. -3s*3 + 8128s*2 Collect the terms in 12405 + r - 3321 + 4587. r + 13671 Collect the terms in 6d*3 + 6629 + 6633 + 6758 - 20020. 6d*3 Collect the terms in -175134797x - 648x2 + 175134797x. -648x2 Collect the terms in 49j + 51j - 335j + 47j + 138j + 57j. 7j Collect the terms in 3n3 - 31n*3 + 3n*3 + 19n*3 + 20n*2 - 8 + 8. -6n*3 + 20n*2 Collect the terms in 1196h + 16h3 - 1025h - 171h - 5h*3. 11h*3 Collect the terms in -14816c + 7756c + 7049c. -11c Collect the terms in 312898n - 312898n + 524n*2 - 22n*2. 502n*2 Collect the terms in -23 + 141912n*3 - 7 - 283830n*3 + 141916n*3. -2n*3 - 30 Collect the terms in 14835w + 109w + 479w - 420w. 15003w Collect the terms in -549t3 - 2752t*3 - 4090t*3. -7391t*3 Collect the terms in -3s - 30s - 15s + 9s - 30s - 54s. -123s Collect the terms in 108y + 103y + 118y + 144y - 700y + 123y + 103y. -y Collect the terms in 211a*2 - 414a*2 - 69 - 91a + 3a + 201a*2. -2a*2 - 88a - 69 Collect the terms in -4k - 625 - 438k*3 + 443k*3 + 46. 5k*3 - 4k - 579 Collect the terms in 16703q2 - 4q - 16q - 6q + 3q. 16703q*2 - 23q Collect the terms in -372f - 5 + 88f + 5 + 118f + 121f. -45f Collect the terms in -4p - 66p2 - 75p*2 - 157p*2 + 159p*2. -139p*2 - 4p Collect the terms in -4w3 + 1037w - 3085w - 2w*3 + 1025w + 1023w. -6w*3 Collect the terms in 9339d*2 - 37363d*2 - 18d*3 + 9341d*2 + 9342d*2 + 9341d*2 + 15d*3. -3d*3 Collect the terms in 23 + 7987m*2 - 30 - 7992m*2 + 10. -5m*2 + 3 Collect the terms in -57h - 65h - 57h + 227h - h2 + 0h*2 - 65h. -h*2 - 17h Collect the terms in 1141093h3 + 1122440h*3 + 3 - 3. 2263533h*3 Collect the terms in 7c*2 + 31224 - 93668 + 31210 + 31234. 7c*2 Collect the terms in 989117y - 494512y - 494617y - 2. -12y - 2 Collect the terms in 182123 - 33s + 181924 - 364050. -33s - 3 Collect the terms in -369 + 405785o*2 - 369 + 738. 405785o2 Collect the terms in k3 - 2 - 174k2 - 2k - 18k3 - 10k*3. -27k*3 - 174k*2 - 2k - 2 Collect the terms in 327249k3 + 327261k*3 - 654511k3. -k3 Collect the terms in 285 - 320871z3 + 160432z*3 + 160441z*3. 2z*3 + 285 Collect the terms in -565z + 0 + 0 - 314z - 1250z. -2129z Collect the terms in -17790a - 95786a + 30204a. -83372a Collect the terms in 431 + 98 + 43x*2 - 60x*2 + 16x2. -x2 + 529 Collect the terms in -4008w - 821 - 827 + 1648. -4008w Collect the terms in 118k2 + 32k*2 - 119k*2 + 11k*2 + 160k*2. 202k*2 Collect the terms in -52262p*3 + 16907p*3 - 76732p*3. -112087p*3 Collect the terms in 214d - 105d + 1 + 1 - 109d - 39d2. -39d*2 + 2 Collect the terms in 5 - 7103d*3 - 7 + 69355d*3 - 3d*2. 62252d*3 - 3d*2 - 2 Collect the terms in -254s*3 + 251s*3 + 776162s - 776162s. -3s*3 Collect the terms in 114y - 411y - 660y - 440y + 120y. -1277y Collect the terms in 27f*2 + 2335 + 2337 - 4672 + 188f*2. 215f*2 Collect the terms in 10r*2 - 25r*3 - 80r*2 - 88r*2 + 157r*2. -25r3 - r2 Collect the terms in 3216803 + 9544o - 3216803. 9544o Collect the terms in -9d2 - 6d + 49 + 2d + 3894d*3 - 49. 3894d*3 - 9d*2 - 4d Collect the terms in -173s - 90s - 18 - 108s + 16. -371s - 2 Collect the terms in 3 + 888271w2 - 187318w*2 - 3. 700953w*2 Collect the terms in -607w*2 - 6w + 6w - 606w*2 + 1944w*2 - 637w*2. 94w*2 Collect the terms in 697k*2 + 228k*2 - 1167k*2 + k + 409k*2. 167k*2 + k Collect the terms in -96 - 100k + 195 - 73k + 175k - 99. 2*	{ "pile_set_name": "DM Mathematics" }
+ (3m + 0m - m)(3m - 4m + 4m). 28m2 Expand (71 + 142k - 71)(1 + 2 - 2) + (3 - 3 - 2)(-4 + 4 - 3k). 148k Expand (295051 - 6760q - 295051)(q*2 + 0 + 0). -6760q*3 Expand (10d + 2d - 8d)(2d + 1 - 1)(-39 - 48 + 13). -592d*2 Expand -17 + 4h2 + h2 - 4h2 + (-83 - 167h + 83)(-2h + 0h + 4h). -333h2 - 17 Expand l3 + 0l*3 + 0l*3 - 4l*3 + 4l*3 - 2l*3 + (-4l + 0l + 2l)(-4l*2 + 5l*2 - 3l*2) + 95l*3 - 142l*3 + 96l*3. 52l*3 Expand (5v - 8v - 5v)(3 - 4 + 10) + (1 - 3 + 3)((0 - v + 0)(0 + 2 - 4) + 3v - 6v - v) - v - 3v + 2v. -76v Expand (76 - 42 + 14)(-856 - 19a + 856). -912a Expand (-4 + 4 - k)(5118 + 5117 + 5116 - 15355 - 794k). 794k*2 + 4k Expand (378 + 293 - 806 + 5q)(2q + 2q*3 - 2q). 10q4 - 270q*3 Expand (23 + 38 - 6)(5h + h - 3h)(3 + 0 - 4)(2h - 2 + 1 - 3). -330h*2 + 660h Expand (-1052h3 - 11 - 1076h*3 + 2087h*3)(-h*2 + 4h*2 - 6h*2). 123h*5 + 33h*2 Expand (-9 - 1 - 12)(0 + 1 - 2)(-31u - 3u - 9u). -946u Expand (-56z*2 + 2z*2 + 19z*2)(-2808z + 2808z - 385z2 + 1792z*2). -49245z*4 Expand (83c*3 + 174c*3 + 138c*3)(-4c + 0c + 3c) + (c + 0c - 5 + 3)(-c3 - 5c*3 + 3c*3). -398c*4 + 6c*3 Expand (4q - 2q3 + 4q - 2q)(28052 - 1332q2 - 28052). 2664q*5 - 7992q*3 Expand 2458 + 179v*2 - 2458 + (1 + 0 + 0)(v*2 - 3 + 3). 180v*2 Expand (519t*2 + 437t*2 - 196t*2)(-5 + 1 + 5 + (-2 - 1 + 5)(2 + 4 - 5) - 3 + 4 + 1). 3800t*2 Expand (-2 + 3y + 1 + 0)((1 - 3 + 1)(0 - 3 + 4) + 0 - 1 - 1 - 6 - 3 - 4). -48y + 16 Expand -3t*4 + 5t4 - t4 + (2381t2 - 2381t*2 - 2309t*3)(-2t - 2t - 2t). 13855t*4 Expand 21f*4 - 6f*4 + 3f4 + (f4 + 0f4 + 0f*4)(-4 + 0 + 3) - 4f4 + 3f*4 + 0f*4 + 7 - 3 - 3f*4 + 9. 13f*4 + 13 Expand (3z4 - z4 - 4z4)(3 - 3 - z) - 617z3 + 615z*3 + 15z*5 + 34z*2 + 448 - 449. 17z*5 - 2z*3 + 34z*2 - 1 Expand -2m + 2m - 2m*2 + 2m*2 + 2m*2 - 2m2 + (-m2 + 3m2 - m2)(4 - 1 + 0) + m*2 - 3 + 3 - 7m + 7m + m2. 5m*2 Expand (-2z - 3 + 3)(0 - 4 + 3) + (-4z - 4 + 4)(0 - 3 + 4) + (24 + 0 + 19)(229z - 104z - 117z). 342z Expand (z*2 - 1 + 1 + (0 + 2z + 0)(4z - 3z + 4z))(8 + 6 - 54)(-3 + 3z2 + 2 - 2z2) + z4 - 1 + 1. -439z4 + 440z*2 Expand (5892 + 2570b - 5892 - 766b)(3b + 6b - 5b)(0 + 3 - 1). 14432b2 Expand (7a*3 - 7a*3 + 5a*5)(15 + 4 - 5)(0 - 11 - 17) + (3 - 3 - 2a)(a4 + a4 - 3a*4). -1958a*5 Expand (-6g - 9 + 9)(-g - g + 0g)(18 + 5 + 20 + 2344g*2 - 43). 28128g*4 Expand -75c + 346 + 119c - 46c + (1 - 3 + 0)(1 - 1 + 2c) + 0c - c + 3c - 3c + 6c - 4c. -5c + 346 Expand (-z3 + z3 - 2z3)(-28 - 25 + 3225z2 - 8z - 3224z2). -2z*5 + 16z*4 + 106z*3 Expand (-30o*2 + 26o*2 - 105o*2)(4o2 - 2o - o + 2o). -436o*4 + 109o*3 Expand (-204y*2 - 29y*2 - 56y2 + y3 - 537y2 - 2y*3)(2 - 2 + 2y2). -2y*5 - 1652y*4 Expand (-5m*3 + 4m*3 + 0m*3)(-m*2 + 0m*2 + 2m*2) + 514m*5 + 1340 - 1340 - 8m*2 + 8m*2. 513m*5 Expand (-h - h + 4h)(-306 - 276 + 542)(-4 + 2 - 7)(0h - h + 0h). -720h*2 Expand (14 - 17 + 25)(0m - 2m + 0m + (2 + 4 - 4)(4 - 4 + m) + 1 - 1 - m)(-36 + 21m - 51m + 35m). -110m2 + 792m Expand (5t - 4t - 3t + (3t + 4t - 4t)(0 + 1 - 3)(-8 + 11 - 1))(3 + 3 - 5)(-1 - 3t + 1)(21 - 21 - 8t2). -336t*4 Expand -1 + 12i + 0 - 9 + 3i - i + 0i + (3i - 4i + 2i)(-3 + 3 + 1) - i - 7i + 2i + 1 - 1 + 2i. 11i - 10 Expand ((4 - 3 + 6)(-56 + 31 + 31 + 6p) + 3p - 5p + 3p)(11 - 11 + 3p). 129p*2 + 126p Expand (3q - 2q - 2q)(1 - 1 + 1) - 2777q - 452q + 10q. -3220q Expand (2h2 + 5h*2 - 4h*2)(25 - 5 + 3)(4 + 1 - 3) - 4h*2 + 0h*2 + 3h*2 + (3h + 0h + h)(0h + 4h - 2h) - 189 + 189 - 13h*2. 132h*2 Expand -1 + 5j*5 + 1 - 6j5 + 9 - 9 + (j2 - j*2 + 2j*4)(1 - 4j - 1) - 4j*5 + 2j5 + j5 - j2 + j2 + 4j5. -6j*5 Expand (3z*3 - 4z*3 - 2z*3)(-7 - 2 + 7) + (-z*2 + 1 - 1)(2z + 3 - 3) + 3z*3 + 0z + 0z. 7z*3 Expand -127y + 127y + 138y2 + y2 - 3y2 + 3y2 + y2 - y2 - y2 + (-2y + 4y - 3y)(5 - 5 + 3y) - 3y*2 + 3y*2 + 2y*2. 137y2 Expand (o3 - 5o3 + 2o*3)(-3o + 8o + 3o)(19o + 7o - 17o + o - 4o + 2o + 1 - o - 1 + (2o + 0 + 0)(-2 + 2 - 1)). -80o*5 Expand (5i - 3i - 4i)(-2i + 6 - 6)(-180i - 2 + 2 + 213i). 132i*3 Expand (-z - 5z + 2z)(849z3 - 1443z*3 + 1075z*3). -1924z*4 Expand (-17m - 4m - 2m)(166 - 149 - 201). 4232m Expand (-10 + 10 - 51w)((-3 + 0 + 4)(-5 + 1 + 2) - 7 + 2 - 1 + 1 + 0 + 0 + 3 + 3 - 4). 255w Expand (128l - 239l - 222l)(-3 + 5l + 1 - 3l). -666l2 + 666l Expand (1 - 7v2 - 1 + (-2 - 2v*2 + 2)(16 - 48 + 11))((2 + 0 - 1)(1 - 1 - 2v) + (2v - 6v + 2v)(-3 + 0 + 5)). -210v*3 Expand (-1001d - 3 + 2 + 990d)(-4 - 7 + 20)(126 - 126 - 51d). 5049d2 + 459d Expand (i + 2i - i + 2i - i + 0i + (-1 - 5 + 4)(-4i + 2i + 3i))(i + i - 4i)(-803i - 92i - 1152i). 4094i*3 Expand ((2 - 2 - 1)(-6l + 3l + 4l) + (-6l - 2l + l)(5 - 3 + 0))(l + 3l + 3l). -105l*2 Expand (-69b*2 + 59 - 59)(5b3 + 27b*3 + 7b*3). -2691b*5 Expand (0 - 2l + 0)(2 - 1 + 0) + 1 - 159l - 3 + 24 - 19. -161l + 3 Expand -2c*2 + 2c*5 + 2c*2 - 22c4 - c5 + 22c4 + (-2c*3 + 2c3 + c3)(13c*2 - 8c*2 - 40c2) + c5 + c2 - c2. -33c5 Expand 16f*3 - 628f*3 - 829f3 + f3 + 3 - 3 + (-f + f*2 + f)(4 + 2f - 4) + f3 - f + f - 2f + 2f + 2f*3. -1435f*3 Expand 2c*2 + 8c*2 - 4c*2 + 2c - 2c2 - 2c + (0c2 + 0c2 - c2)(2 - 1 + 1) + (4c - 6c - 1 + 12c)(-4c - 2c + 2c). -38c2 + 4c Expand 9d2 + 6d*2 + 4d*2 + (-1 - 2 + 1)(2d - 3d + 2d)(-d - 3d + 5d) - 2d - 2d*2 + 2d. 15d2 Expand (1618h - 2 + 2390h + 204h + 2)(-h2 - h2 + 7h + 0h2). -8424h*3 + 29484h*2 Expand 59z*2 - 20 + 18 - 47z*2 + 177z + (1 - 4 + 5)(-1 + 1 - 2z*2). 8z*2 + 177z - 2 Expand (-1 + 1 - 3z)(5z - 3z - 4z) + (-83z*2 - 85414z + 6 - 5 + 85415z)(1 - 2 - 1)(-2 + 0 - 1). -492z*2 + 6z + 6 Expand (-9t - t3 + 9t)(-6t2 + t2 + 4t2)(28 + 28 - 1) - 27t5 - 1519t + 180t5 + 1519t. 208t5 Expand (-g4 + g4 - g4)(-82 + 32 - 41 + (1 + 3 - 3)(-3 + 0 - 2)). 96g*4 Expand (-524a*4 - 327a*4 + 1092a*4)(1 - 2a - 1 - 4a + 0a + 3a - a - a + 3a - 2a + 5a - a + (2 + 0 - 1)(-5a + 6a + a) - 3a + 0a - 15a). -3856a*5 Expand (2 - 2 - 1)(y + 37 - 37)(85 + 10 + 76). -171y Expand (-3m - 4m + 5m)(5 - 9 + 7)(-2 - 9 + 12)(1 + 1 - 1). -6m Expand (2l - 4l + 4l)(2l3 - 2 + 2) - l4 + 10l - 26l*3 + 28l*3 - 85l. 3l4 + 2l*3 - 75l Expand (-4486q2 + 1422q*2 - 3510q*2 - 1060q*2)(q + q - 4q). 15268q*3 Expand (0n*3 + 3n*3 + 5n*3)(-6n + 25n - 6n)(0 - 4 - 2). -624n4 Expand (-6f + 152f2 - 152f*2 + 11f*3 - 2)(-9f + 0f - 24f). -363f*4 + 198f*2 + 66f Expand (3 + 9 - 21)((2f + 0 + 0)(-4 + 4 + 3) + (-1 + 0 + 0)(11 - 11 - 3f) + (-1 + 3 - 4)(f + 0f - 3f) + f - f + 2f)(82f2 + 17f*4 - 82f*2). -2295f*5 Expand (-91 + 103 + 180)(1 + 2 - 1)((-2 + 0 + 3)(5n2 + 0n*2 - 4n2) + n2 + 9 - 9). 768n2 Expand (-57 - 57 - 330)(-6y - 8y - 18y). 14208y Expand -2n5 - 5n*5 + 5n*5 + (-180n*4 + 175n*4 + 259n*4)(-4n - n + 4n) + 1 + 2n5 - 38n*3 + 37n*3 + 0n*5. -254n5 - n3 + 1 Expand (-2b2 + 4 - 4)((-60 + 26 + 27)(0b2 + b2 - 2b2) + 16b*2 + 16b*2 + 4b*2) - 5b*3 + 0b*4 + 4b3 + b4. -85b4 - b3 Expand ((1 - 1 - 2r)(309 + 8r - 309) + 2r2 - r2 - 3r*2)(-4r + 4r - r*2) + (-2r + 3r - 5r)(-4r3 + r3 + 4r3). 14r*4 Expand (-5 - 26 - 22)(3x - x - x) + 3x - 2x + x. -51x Expand (-8i + 8i + 8i)(30204 - 72i2 - 30204). -576i*3 Expand (11f*3 - 12f + 11f + 41f*3)(-28 + 28 + 7f). 364f*4 - 7f*2 Expand (-100c*2 - 136c*2 + 53c*2)(-1 + 0 + 2) + 10c2 + 0c - 9c2 - 2c. -182c2 - 2c Expand (3n2 - n2 - 3n*2)(-5217n*2 + 9	{ "pile_set_name": "DM Mathematics" }
test common factor of 21988 and 15679356? 956 Calculate the greatest common factor of 225630536 and 485. 97 What is the greatest common factor of 7607064 and 120? 24 Calculate the highest common divisor of 116717416 and 93124. 3004 What is the greatest common divisor of 5617 and 182983? 41 What is the greatest common factor of 16422 and 1728174? 966 Calculate the highest common factor of 21473140 and 180. 20 Calculate the greatest common factor of 54 and 47174805. 27 What is the greatest common factor of 40 and 6538808? 8 What is the greatest common factor of 108990 and 33562? 346 What is the greatest common factor of 14068 and 242212273? 3517 What is the highest common divisor of 320 and 2666816? 64 Calculate the greatest common factor of 102108 and 364. 4 What is the greatest common divisor of 15757980 and 3255? 105 What is the highest common factor of 9153 and 1759071? 339 What is the highest common factor of 11021534 and 45656? 878 What is the greatest common divisor of 232 and 21533768? 8 Calculate the greatest common divisor of 6800 and 1370880. 1360 What is the greatest common factor of 272526185 and 5? 5 Calculate the greatest common divisor of 1567272 and 209. 19 What is the highest common divisor of 21745295 and 5610? 935 What is the greatest common divisor of 683124 and 8580? 156 What is the highest common factor of 42 and 1324068? 6 What is the greatest common factor of 2622547 and 3107? 239 What is the highest common divisor of 1456628 and 6910? 1382 What is the greatest common divisor of 5120 and 3053840? 80 Calculate the highest common factor of 74845166 and 77. 11 What is the greatest common divisor of 86907 and 4396905? 1473 Calculate the greatest common factor of 779671 and 7820. 17 Calculate the greatest common divisor of 4002056 and 40. 8 What is the greatest common divisor of 972764 and 79768? 676 What is the highest common factor of 3080 and 1386154? 154 What is the highest common factor of 4264 and 674245? 533 What is the highest common divisor of 72 and 868338? 18 Calculate the highest common factor of 119531 and 15019. 23 What is the highest common factor of 20 and 70419088? 4 What is the highest common factor of 3080830 and 364538? 3226 What is the greatest common factor of 359229 and 1482117? 2379 Calculate the highest common divisor of 81 and 16360065. 9 Calculate the greatest common divisor of 2064 and 13117584. 48 Calculate the greatest common divisor of 42 and 4546353. 21 What is the greatest common divisor of 244525 and 50? 25 Calculate the greatest common factor of 8826565 and 220. 55 What is the highest common divisor of 349620 and 8940? 60 What is the greatest common factor of 2116488 and 1320? 264 Calculate the greatest common divisor of 468333150 and 500. 50 Calculate the highest common factor of 24 and 12600066. 6 Calculate the greatest common divisor of 23247 and 1078749. 63 What is the greatest common divisor of 497 and 1337640? 71 What is the greatest common factor of 4251147 and 3982? 181 What is the greatest common divisor of 284537 and 29777? 11 What is the greatest common divisor of 1105 and 4797468? 221 Calculate the highest common factor of 312 and 7890831. 39 What is the greatest common factor of 111860 and 393890? 1190 What is the highest common factor of 56107974 and 3510? 78 Calculate the greatest common divisor of 298 and 4363316. 298 What is the greatest common factor of 3131024 and 2080? 208 What is the highest common divisor of 3534208 and 640? 128 What is the highest common factor of 587 and 37186450? 587 What is the greatest common factor of 564 and 12176? 4 Calculate the greatest common divisor of 2368 and 30692832. 1184 What is the greatest common divisor of 538468301 and 98? 49 What is the highest common factor of 16757055 and 630? 315 What is the highest common factor of 2205 and 17169495? 105 Calculate the greatest common factor of 3480920 and 8840. 680 What is the highest common factor of 47685 and 106363560? 4335 Calculate the highest common factor of 2206344 and 19803. 483 Calculate the highest common divisor of 22496 and 2091425. 703 Calculate the greatest common divisor of 707162 and 26038. 94 Calculate the highest common factor of 2464 and 9061976. 616 Calculate the highest common factor of 9 and 38853468. 9 Calculate the highest common divisor of 10053013 and 13674. 43 Calculate the greatest common factor of 5920 and 5382464. 1184 What is the greatest common factor of 98833533 and 2298? 1149 Calculate the highest common divisor of 10168446 and 12233. 941 Calculate the highest common factor of 1070 and 1593270. 10 Calculate the highest common factor of 2277 and 33516681. 759 What is the highest common divisor of 29180983 and 624? 13 Calculate the greatest common divisor of 873556606 and 1196. 598 Calculate the highest common divisor of 142703452 and 1117. 1117 Calculate the highest common divisor of 112144848 and 52050. 2082 What is the greatest common divisor of 3872584221 and 23? 23 Calculate the highest common factor of 115 and 4280737. 23 What is the greatest common factor of 88822 and 65682? 178 What is the greatest common divisor of 1725 and 355143? 69 Calculate the highest common factor of 4446090 and 2835. 405 Calculate the highest common factor of 14983613 and 3111. 1037 Calculate the highest common divisor of 534664 and 2274389. 689 What is the greatest common factor of 3690 and 10372959? 369 Calculate the highest common factor of 167416 and 34544. 136 Calculate the highest common divisor of 1276 and 1496632. 116 Calculate the greatest common factor of 180 and 2036407410. 90 What is the greatest common divisor of 195 and 54566850? 195 Calculate the greatest common divisor of 20456268 and 77. 7 What is the highest common factor of 10 and 27016570? 10 Calculate the greatest common factor of 20296862 and 194. 194 Calculate the highest common factor of 9086340 and 4776. 2388 What is the highest common factor of 202302895 and 40? 5 Calculate the highest common factor of 14487300 and 25. 25 What is the greatest common divisor of 242730420 and 1020? 1020 What is the greatest common factor of 33 and 52623637? 11 What is the greatest common factor of 1941 and 7560842? 647 Calculate the greatest common divisor of 1122 and 190240710. 1122 Calculate the greatest common divisor of 91707176 and 3410. 682 Calculate the greatest common factor of 5744 and 2065472. 16 What is the highest common divisor of 63332 and 16047704? 284 What is the highest common factor of 916701 and 589? 31 What is the greatest common factor of 162215688 and 312? 24 Calculate the greatest common divisor of 3227 and 64666314. 461 Calculate the greatest common factor of 48265 and 1654240. 245 Calculate the highest common factor of 88934 and 27136. 106 What is the highest common divisor of 2215642 and 149098? 254 What is the greatest common divisor of 1819310 and 90? 10 Calculate the highest common factor of 310 and 347584. 2 Calculate the greatest common divisor of 39 and 1199354. 13 Calculate the greatest common factor of 6408 and 162828882. 1602 Calculate the greatest common factor of 25200 and 202950. 450 What is the greatest common divisor of 1541236 and 104440? 1492 Calculate the greatest common divisor of 2107 and 3068996. 301 Calculate the highest common factor of 10682 and 40757171. 5341 What is the highest common factor of 8216 and 212953? 13 Calculate the highest common factor of 880 and 19277060. 220 What is the greatest common divisor of 62158478 and 344? 86 Calculate the highest common factor of 2149141876 and 14. 14 What is the greatest common divisor of 538 and 77133060? 538 Calculate the highest common divisor of 117912 and 51153. 867 Calculate the greatest common factor of 37330 and 114930. 10 Calculate the greatest common divisor of 8445 and 7980. 15 What is the highest common divisor of 457273 and 3743? 19 Calculate the highest common divisor of 576 and 825568. 32 Calculate the greatest common factor of 18509 and 1091362. 223 What is the greatest common factor of 5175870 and 110? 10 Calculate the highest common divisor of 73047317 and 17255. 3451 Calculate the highest common divisor of 36197 and 46627. 7 What is the highest common factor of 114 and 41802508? 38 What is the highest commo	{ "pile_set_name": "DM Mathematics" }
11729154 + -16742438. Let r = s - -5013244.99973. Let z = -39 - r. What is z rounded to 4 decimal places? 0.0003 Let i be ((-2)/(-3))/((-1)/(-54)). Suppose -12l + 8l - 24 = 0. Let u be (-6)/i + (-30001)/l. What is u rounded to the nearest 10000? 10000 Let q be (84/(-10))/((-27)/(-20925)). What is q rounded to the nearest one thousand? -7000 Suppose 5a - 60025625 = -0a. Suppose -31608415 = -5s + a. Let l = -4422708 + s. What is l rounded to the nearest 1000000? 4000000 Let g = 226606 + -226604.29989. Let p = 1.7 - g. Round p to four dps. -0.0001 Let o = 0.1 + -3.1. Let b = o - -3.0000036. What is b rounded to six dps? 0.000004 Let s = 36.41 + -37. Let b = 0.669 + s. What is b rounded to 2 decimal places? 0.08 Let p = 6 + 5. Let q = -7 + p. Let s = -3.999988 + q. What is s rounded to five dps? 0.00001 Let s(d) = -513224d*2 - 2d - 2. Let b be s(3). Let p = 3223259 + b. Let t = -675765 - p. Round t to the nearest 100000. 700000 Let f = 4025.624 - 4228.6129. Let g = 270 + -67. Let i = f + g. Round i to 3 dps. 0.011 Let i(s) = s*3 + s + 902. Let g be i(0). Suppose -30j + 6 = -27j. Let y be (g - 2) + -2 + j. Round y to the nearest 1000. 1000 Let h = -15.2 - -8.3. Round h to the nearest integer. -7 Suppose -5z - 5090384 = -5h + 2059616, -3z - 1430000 = -h. What is h rounded to the nearest one hundred thousand? 1400000 Let a = 19 + -27. Let w = 12137119 - 12137111.0000013. Let m = a + w. Round m to 6 dps. -0.000001 Let v(a) = -1513a3 + 12a*2 + 19a - 16. Let c be v(-16). What is c rounded to the nearest 1000000? 6000000 Let o = -0.184 + -19.416. Let t = 141.6 + o. Let b = t + -122.00157. Round b to four decimal places. -0.0016 Let s(v) = -19v + 9. Let w be s(3). Round w to the nearest ten. -50 Suppose -l - l = -2650000. Let x be l4 - 0/(-2). Suppose 5m - x = 4m. Round m to the nearest 1000000. 5000000 Let l(q) = 63204q2 - 3q - 2. Let y be l(4). Suppose -4x + y = 7811250. What is x rounded to the nearest one million? -2000000 Let v = 3800.83 + -3803.23111. Let w = -31 - -28.6. Let p = v - w. Round p to 4 decimal places. -0.0011 Let u = 0.059 - 0.001. Let z = u + -0.04. Round z to 2 dps. 0.02 Let j = -3.07 - -3.1123. What is j rounded to three dps? 0.042 Let p = 0.04 + 0.47. Let n = p + -0.510033. What is n rounded to five decimal places? -0.00003 Suppose 5g + 2 - 17 = 0, 1512 = -3i + 4g. Let v be (-30400)/(-22/i). Round v to the nearest one million. -4000000 Let j = 104261.80400065 - 104276.804. Let f = j - -15. Round f to 7 dps. 0.0000007 Suppose 2o = 3o. Let d be (1 - o) + (-1254)/(-6). What is d rounded to the nearest one hundred? 200 Let b = -3.005 - -3. Let k = 21.026 - 21. Let p = b - k. Round p to 2 decimal places. -0.03 Suppose -n - 87 = -2y + 68, -4n = 20. Let o be ((-16)/20)/(3/y). Let r = o + -120. What is r rounded to the nearest one hundred? -100 Let l = -0.16300532 + 0.163. Round l to six decimal places. -0.000005 Let m = -53.3 - -71. What is m rounded to 0 dps? 18 Let m = -0.43 + 0.806. Let p = 44.69 + -45. Let d = m + p. What is d rounded to 2 decimal places? 0.07 Let i = 0.055 + -25.055. Let s = -29.8 - i. What is s rounded to the nearest integer? -5 Let m = 0.04 + 0.06. Let x = 4.9263 - 4.826295. Let q = x - m. Round q to five decimal places. 0.00001 Let c(u) = -8u - 10. Let z be c(-4). Let x = z - -26. What is x rounded to the nearest ten? 50 Let l = 2019 + -2019.00001163. Round l to 6 dps. -0.000012 Let q = -0.121 - -0.1210059. Round q to 6 decimal places. 0.000006 Let y = 226 - 226.371. What is y rounded to one decimal place? -0.4 Let j = 7 - 7.15. Let p = -0.2 - j. Let b = -0.061 - p. What is b rounded to 3 dps? -0.011 Let p = -0.03734 + 0.036. Round p to 3 dps. -0.001 Suppose 0 = -t - 4t - 5120890. Let d = -304178 - t. What is d rounded to the nearest one hundred thousand? 700000 Let a = 8 - 3. Suppose -2k + 5180 = -2u - 0u, 0 = -ak. Round u to the nearest one hundred. -2600 Let g = 3.6000019 - 3.6. What is g rounded to six decimal places? 0.000002 Let z = -170355 - -1130355. Suppose 0 = d - 5d + z. What is d rounded to the nearest one hundred thousand? 200000 Let i be (3 - 0)16/6. Suppose 3u + 22 = 5y, -4y + 0y + 12 = -u. Let c be 4/i0/y. What is c rounded to seven dps? 0 Let u(t) = 3601t2 + 3t - 18. Let h be u(3). Round h to the nearest 1000. 32000 Let a = -41 - -40.9999842. Round a to six decimal places. -0.000016 Let a = -95228809 - -95228766.000039. Let j = -43 - a. Round j to five decimal places. -0.00004 Let k = -18 + 18.14. Let f = k - 0.13999912. Round f to 7 dps. 0.0000009 Let b be 710157/(-12) - (-3)/(-12). Let z = 85658 + b. Let g = z + -18178. Round g to the nearest one thousand. 8000 Suppose 4d + 5v + 356 = -1511, -2355 = 5d + 2v. Suppose -2532 = -k - 5g, 2g - 5g - 10105 = -4k. Let c = k - d. Round c to the nearest ten thousand. 0 Let d = -0.01 + 0.13. Let w = d - 0.134. Round w to 2 decimal places. -0.01 Let g = -0.24 - -0.1. What is g rounded to one dp? -0.1 Let m be 6(175174/6 + 4). Let l be m/6 + 1/3. Round l to the nearest one thousand. 29000 Let u = -30111318850 - -30111318719.00000069. Let w = u + 131. What is w rounded to seven dps? 0.0000007 Let v be (-1)/2 + (-799995)/(-2). Suppose -280244 = -l - 4i - 80232, 2l = i + v. Round l to the nearest 100000. 200000 Let a = 48 + -59.6. Let f = 13.18 + a. Let w = f - 1.5800073. Round w to 6 dps. -0.000007 Let s = -10 - 4. Let g = s - -13.99999975. Round g to 7 decimal places. -0.0000003 Let y = 199 + -133. Let p = -65.59 + y. Round p to 1 dp. 0.4 Suppose 2 = -2t, 3n - 2t = 2n + 6. Suppose 2s = -np + 38, -4p + 18 = -0p - 2s. Let l be (-2)/p + (-4756)/14. What is l rounded to the nearest 100? -300 Let t = 0 + 0.87. What is t rounded to one decimal place? 0.9 Let q = 0.120964 + -0.121. Round q to six dps. -0.000036 Let f = -8 + 12. Let n(s) = -112s3 + 5s*2 - 2s - 4. Let l be n(f). What is l rounded to the nearest one thousand? -7000 Let w = 588.89 + -588.860049. Let p = 0.03 - w. What is p rounded to 5 dps? 0.00005 Let c = -218.3 + 218.29998847. Round c to six decimal places. -0.000012 Let p = -0.4229 + -1738.5771. Let h = -1740.00016 - p. Let m = h + 1. Round m to four dps. -0.0002 Let q be (36/(-28) + -3)-23100. Round q to the nearest 10000. 100000 Let c = 0.2 - 0. Let d = c + -0.4. Let g = d - -0.1998. Round g to three dps. 0 Let m = -16 + 16.035. Let t = m - 0.01. What is t rounded to 2 decimal places? 0.03 Let z(u) = u - 2. Let r be z(3). Round r to the nearest ten. 0 Let v = -89677 - 10323. What is v rounded to the nearest one hundred thousand? -100000 Let y = 8419 - 8424.001. Let z = y + 5. Round z to three decimal places. -0.001 Let r = 641461861.2973 - 641131999.3. Let h = r - 329795. Let m = -67 + h. Round m to 3 dps. -0.003 Let v = -212 - 199. Let y = v - -161. What is y rounded to the nearest one hundred? -300 Suppose -6b = -5m - 5b + 4523, 2 = b. Round m to the nearest one hundred. 900 Let k = 0 - -2. Suppose -45 - 1325 = kl. Let o = l - 345. What is o rounded to the nearest one hundred? -1000 Let s = 112.999812 - 113. Round s to five dps. -0.00019 Suppose 4g = 8g + 108000. What is g rounded to the nearest 10000? -30000 Let v = -0.42 - -0.5. Let r = 6.08 - v. Let g = r - 5.99. Round g to one decimal place. 0 Let t = -31 + 31.56. Let o = t - -67.44. Let h = -67.99947 + o. What is h rounded to 4 decimal places? 0.0005 Let h be ((-60)/(-25))/((-1)/(-875000)). What is h rounded to the nearest one million? 2000000 Let q = -54124.27 - -54171.86822. Let d = q + -48.569. Let k = d - -0.97. Round k to 4 dps. -0.0008 Let d be 8/(-3)378/(-24). Let r be (-12459998)/(-7) - (-12)/d. Suppose 5p = 3p + r. What is p rounded to the nearest one hundred thousand? 900000 Suppose 2 = p + p. Let n be p/2 - (-6162)/(-4). Round n to the nearest one hundred. -1500 Suppose 0 = 3z - 512 - 253. Suppose -4c + 5l - z = c, 4l + 126 = -2c. What is c rounded to the nearest 10? -60 Let c = -590733 - -590714.000048. Let j = c - -19. Round j to 5 dps. 0.00005 Let f(o) = -o + 2. Let d be f(3). Let k be -25 + -2 - (d + -3). What is k rounded to the nearest 10? -20 Suppose -4t + 873 + 1247 = 0. Round t to the nearest one hundred. 500 Let m = 0.093 + -1.913. Let q = 1.1 + m. Let v = -0.7253 - q. Rou	{ "pile_set_name": "DM Mathematics" }
is divided by 91? 85 What is the remainder when 4148 is divided by 346? 342 Calculate the remainder when 408899 is divided by 302. 293 Calculate the remainder when 15850 is divided by 1212. 94 What is the remainder when 18064 is divided by 63? 46 What is the remainder when 1664 is divided by 548? 20 Calculate the remainder when 2132 is divided by 63. 53 Calculate the remainder when 6326 is divided by 52. 34 What is the remainder when 47419 is divided by 99? 97 Calculate the remainder when 17600 is divided by 569. 530 What is the remainder when 2695 is divided by 1275? 145 Calculate the remainder when 1211703 is divided by 104. 103 Calculate the remainder when 68886 is divided by 73. 47 What is the remainder when 1123036 is divided by 13? 5 Calculate the remainder when 6110 is divided by 2035. 5 Calculate the remainder when 9878 is divided by 308. 22 What is the remainder when 6402 is divided by 156? 6 What is the remainder when 3617 is divided by 362? 359 What is the remainder when 2360 is divided by 18? 2 What is the remainder when 23324 is divided by 76? 68 What is the remainder when 5806 is divided by 1446? 22 Calculate the remainder when 1501 is divided by 924. 577 Calculate the remainder when 6764 is divided by 354. 38 Calculate the remainder when 13906 is divided by 835. 546 What is the remainder when 33089 is divided by 29? 0 Calculate the remainder when 5559 is divided by 6. 3 What is the remainder when 50935 is divided by 50934? 1 Calculate the remainder when 7033 is divided by 117. 13 What is the remainder when 8838 is divided by 82? 64 What is the remainder when 20527 is divided by 20? 7 Calculate the remainder when 2780 is divided by 34. 26 What is the remainder when 4094 is divided by 1343? 65 What is the remainder when 3419 is divided by 1124? 47 Calculate the remainder when 59421 is divided by 19706. 303 What is the remainder when 47675 is divided by 73? 6 What is the remainder when 6711 is divided by 1666? 47 What is the remainder when 9446 is divided by 126? 122 Calculate the remainder when 4091 is divided by 205. 196 Calculate the remainder when 5560 is divided by 266. 240 What is the remainder when 427 is divided by 39? 37 What is the remainder when 765 is divided by 57? 24 What is the remainder when 187712 is divided by 82? 14 Calculate the remainder when 154413 is divided by 373. 364 What is the remainder when 67069 is divided by 140? 9 What is the remainder when 4740 is divided by 31? 28 Calculate the remainder when 9041 is divided by 66. 65 Calculate the remainder when 3045 is divided by 744. 69 Calculate the remainder when 1276 is divided by 93. 67 Calculate the remainder when 2505 is divided by 833. 6 What is the remainder when 140 is divided by 62? 16 What is the remainder when 239132 is divided by 203? 201 Calculate the remainder when 93687 is divided by 54. 51 What is the remainder when 41333 is divided by 26? 19 Calculate the remainder when 230256 is divided by 234. 0 What is the remainder when 3551 is divided by 38? 17 What is the remainder when 43767 is divided by 256? 247 What is the remainder when 122813 is divided by 32? 29 What is the remainder when 2962 is divided by 57? 55 What is the remainder when 4618 is divided by 189? 82 What is the remainder when 35708 is divided by 2231? 12 What is the remainder when 1015 is divided by 44? 3 Calculate the remainder when 57397 is divided by 110. 87 What is the remainder when 9000 is divided by 163? 35 Calculate the remainder when 2336 is divided by 440. 136 Calculate the remainder when 22380 is divided by 1865. 0 Calculate the remainder when 25048 is divided by 167. 165 What is the remainder when 6240 is divided by 490? 360 Calculate the remainder when 31471 is divided by 281. 280 Calculate the remainder when 122137 is divided by 124. 121 Calculate the remainder when 38292 is divided by 65. 7 What is the remainder when 823314 is divided by 205827? 6 What is the remainder when 2491 is divided by 752? 235 What is the remainder when 690989 is divided by 76? 73 What is the remainder when 253665 is divided by 286? 269 What is the remainder when 612 is divided by 270? 72 Calculate the remainder when 130847 is divided by 113. 106 What is the remainder when 26507 is divided by 3785? 12 What is the remainder when 526 is divided by 462? 64 Calculate the remainder when 16327 is divided by 272. 7 Calculate the remainder when 247335 is divided by 40. 15 What is the remainder when 96610 is divided by 15? 10 Calculate the remainder when 1998 is divided by 609. 171 What is the remainder when 7618 is divided by 1228? 250 Calculate the remainder when 18756 is divided by 115. 11 Calculate the remainder when 25718 is divided by 1607. 6 What is the remainder when 205047 is divided by 38? 37 Calculate the remainder when 245925 is divided by 24. 21 Calculate the remainder when 745 is divided by 39. 4 Calculate the remainder when 203493 is divided by 29068. 17 Calculate the remainder when 26983 is divided by 26973. 10 Calculate the remainder when 3030 is divided by 2952. 78 Calculate the remainder when 2687048 is divided by 305. 303 What is the remainder when 1782089 is divided by 43? 40 What is the remainder when 1245 is divided by 72? 21 What is the remainder when 49092 is divided by 731? 115 Calculate the remainder when 1135 is divided by 224. 15 What is the remainder when 43999 is divided by 1759? 24 Calculate the remainder when 8383 is divided by 73. 61 What is the remainder when 25554 is divided by 4252? 42 What is the remainder when 6049 is divided by 6048? 1 What is the remainder when 18102 is divided by 9034? 34 What is the remainder when 530882 is divided by 1039? 992 Calculate the remainder when 36975 is divided by 7394. 5 What is the remainder when 32071 is divided by 46? 9 What is the remainder when 7232 is divided by 278? 4 Calculate the remainder when 82268 is divided by 38. 36 What is the remainder when 2365 is divided by 257? 52 Calculate the remainder when 57103 is divided by 235. 233 Calculate the remainder when 1568 is divided by 577. 414 What is the remainder when 20332 is divided by 637? 585 Calculate the remainder when 8356 is divided by 2088. 4 What is the remainder when 3895 is divided by 648? 7 Calculate the remainder when 19492 is divided by 74. 30 Calculate the remainder when 15998 is divided by 49. 24 What is the remainder when 1968 is divided by 1236? 732 Calculate the remainder when 190242 is divided by 699. 114 Calculate the remainder when 148207 is divided by 153. 103 What is the remainder when 16467 is divided by 305? 302 What is the remainder when 9621 is divided by 9587? 34 Calculate the remainder when 18921 is divided by 18894. 27 Calculate the remainder when 3854 is divided by 73. 58 What is the remainder when 3062 is divided by 192? 182 Calculate the remainder when 19194 is divided by 6299. 297 What is the remainder when 95464 is divided by 54? 46 Calculate the remainder when 609522 is divided by 225. 222 Calculate the remainder when 15042 is divided by 1253. 6 What is the remainder when 248369 is divided by 439? 334 Calculate the remainder when 5764 is divided by 1207. 936 Calculate the remainder when 1840 is divided by 25. 15 Calculate the remainder when 22285 is divided by 518. 11 What is the remainder when 8037 is divided by 324? 261 What is the remainder when 3469 is divided by 23? 19 What is the remainder when 924 is divided by 186? 180 Calculate the remainder when 9220574 is divided by 455. 454 What is the remainder when 4879 is divided by 77? 28 Calculate the remainder when 5670 is divided by 1040. 470 What is the remainder when 1192 is divided by 487? 218 Calculate the remainder when 16348 is divided by 3977. 440 Calculate the remainder when 3887 is divided by 137. 51 Calculate the remainder when 55741 is divided by 250. 241 What is the remainder when 1861 is divided by 1822? 39 What is the remainder when 45584 is divided by 15? 14 What is the remainder when 351371 is divided by 84? 83 Calculate the remainder when 319113 is divided by 79758. 81 What is the remainder when 1547 is divided by 12? 11 Calculate the remainder when 67205 is divided by 107. 9 Calculate the remainder when 3163 is divided by 1495. 173 What is the remainder when 231	{ "pile_set_name": "DM Mathematics" }
(26 - 11) + -13. 7 Evaluate -1 + -3 - (-3 + 3). -4 What is the value of (1 - 2) + -1 + (-1 - -1)? -2 5 + -2 - (-13 + 19) - -5 2 What is 7 - 16 - 0 - -5? -4 What is the value of (2 - -4 - (-10 - -23)) + 15? 8 What is the value of -2 + 0 - -3 - (12 + -7)? -4 What is (-4 - -6) + 5 + -6? 1 Evaluate (28 - 36) + 2 + 1. -5 What is the value of 62 - 59 - (-2 + 0)? 5 What is the value of 14 + (-3 - 6) + -1? 4 What is the value of -10 + (-3 - 1 - -5) + 4? -5 What is the value of -6 - (7 - (16 + 0))? 3 Calculate -8 - -3 - (-1 + -1). -3 Evaluate -4 + (4 - -3) - 0 - 8. -5 Calculate (-8 + 5 - -13) + -12. -2 What is the value of -42 + 34 - (-5 + -5)? 2 Evaluate (-3 + -5 - -2) + 7. 1 14 + -12 - (-5 - (-1 - 3)) 3 Evaluate (6 - 4 - 7) + 8. 3 What is 7 - (-6 - -2 - -9)? 2 What is -4 - ((1 - 2) + -3) - -6? 6 Calculate -2 + (1 + -11 - (-7 + 2)). -7 What is 4 - -1 - (3 - 0)? 2 What is (-20 - (8 + -23)) + (5 - 2)? -2 Calculate -5 - (-5 + 0 + 5). -5 Calculate 7 + 4 + (2 - 4). 9 -26 + 13 - (3 + -1 + -5) -10 What is (-35 - -35) + (-5 - 1)? -6 3 + (-1 - 3) - (-8 + 3) 4 What is 5 + (3 - 10) - -2? 0 Calculate 7 - ((-5 - -1) + 12). -1 Calculate -1 - (2 + -1) - (-31 - -31). -2 What is the value of -10 + 1 + 19 - 9? 1 Calculate (4 - 14 - -3) + 7. 0 (5 - (-5 + 11)) + -4 + 0 -5 Calculate -1 - (-12 - -2) - 5. 4 What is the value of 0 - 0 - (0 + 2)? -2 ((0 - 3) + 0 - -3) + 1 1 Calculate -7 + 2 - (-2 - -1). -4 -4 - (-4 + -3 + 0 + -2) 5 Evaluate 0 + -3 + (5 - 5). -3 -2 + (-3 + 3 - 2) -4 Calculate 43 + -37 - (0 + 0 - 0). 6 What is the value of 1 + -6 + (12 - 11)? -4 What is 5 + -4 - 8 - -1? -6 What is (-1 - 2) + (-11 - -28) + -7? 7 What is (-5 - -8) + -5 - -6 - 10? -6 0 + -10 - (-3 - -2) -9 What is the value of -5 + 5 + 4 + -3 + -6? -5 Evaluate (3 - (-4 + 3)) + -1. 3 -3 + -4 + (3 + -2 - -1) -5 What is -2 + -11 - -18 - 2? 3 What is 35 + -35 - (0 - 2)? 2 What is -4 - ((-5 - 1) + 4)? -2 Calculate 2 - -1 - 8 - (-2 + -1). -2 Evaluate 4 + 1 + -4 + -9. -8 Calculate 1 + 1 + 2 + 29 + -31. 2 (4 - 9) + (-1 - 1 - -2) -5 Calculate 3 - 1 - (21 - 19). 0 -4 - -1 - (-7 - (2 - 8)) -2 What is (-1 - -1) + -10 + 15? 5 What is the value of (-1 - 1) + -3 + -1 + 4? -2 Evaluate -1 + (-18 + 16 - (1 + -7)). 3 Calculate 1 - (6 - (3 - 2 - 0)). -4 6 - (-3 + 8 + 2) -1 What is -14 + 0 - (-80 - -59)? 7 Calculate 5 + -1 - (1 - (-16 + 22)). 9 Calculate -4 + (2 - (4 - (1 + 3))). -2 -13 - -4 - (0 + -1 + -3) -5 Evaluate -10 + (3 - 1 - 0 - -4). -4 Evaluate 3 + 8 - 5 - 5. 1 Evaluate 12 - (-1 - (2 + -8)). 7 What is (3 - 6) + -18 + 28? 7 Evaluate -7 + -3 + (-4 - (3 + -9)). -8 Evaluate 0 + (-3 - -5) + -6 + 9. 5 What is -7 - 3 - -11 - 6? -5 What is the value of (-9 - -1) + 2 - (-1 - 0)? -5 What is the value of -4 - -2 - 5 - -10? 3 What is the value of -3 + (6 + -2 - 7)? -6 What is the value of (8 - 8) + -5 + 1 + 2? -2 Calculate -3 + -2 + (6 - 6 - 0). -5 Calculate 12 - (4 + -6) - 5. 9 Calculate 2 + 1 + (3 - -10) + -22. -6 What is the value of 9 - (-5 + 13 + -7)? 8 What is the value of 5 - 2 - 5 - -5 - 0? 3 Evaluate -7 - ((-11 - 0) + 3). 1 Evaluate (-2 - 17 - -1) + 316 + -309. -11 What is the value of -1 + 2 + (-9 - (-6 + -4))? 2 Calculate 0 + (-2 - (1 - -2)) + 2. -3 Calculate 5 + 4 + -2 - 2. 5 Calculate 1 - (5 - -2) - -4. -2 -2 + 2 + 10 + -4 - 1 5 Calculate 15 + -14 - 2 - (0 + -8). 7 Evaluate 0 - (-2 - (-2 + 1)). 1 Evaluate (-17 - -21) + -2 + -1 + 1. 2 What is 0 + -3 + 1 + 5 - 3? 0 5 + -1 + (1 - 2) - 1 2 Evaluate 1 - (6 - (1 + 1 + 4)). 1 Calculate 5 + 0 + (-15 - -15). 5 What is the value of -8 + 14 + -14 + -3 + 6? -5 What is the value of (4 - 3 - -7) + (-3 - 1)? 4 -6 + -7 + 20 + -4 3 What is the value of -5 - (-10 + (6 - 1 - -1))? -1 Evaluate -10 + (0 - -8) + -3. -5 Evaluate (0 - 0) + 2 + 1. 3 What is (-8 - (-3 + 1)) + 3? -3 -5 - (-5 + (3 - 0)) - -6 3 Calculate -5 + -5 + 4 - (2 - -1). -9 What is the value of 3 + 0 + -9 + 9? 3 What is -9 + (0 - -6) + 2? -1 Calculate 11 + 2 + (-2 - 3) + 0. 8 Calculate 0 + 9 + -5 + (2 - 8). -2 What is the value of (-12 - (-10 - (-3 - 1))) + 4? -2 -4 + (14 - -1 - 7) 4 What is the value of -3 + (-6 - -5) - -10 - 4? 2 (-12 - 0) + -13 + 18 -7 Calculate (1 - -1) + -2 + -2. -2 40 + -42 - (-1 - -5) -6 Evaluate 1 + -2 + -115 + 119. 3 Calculate -2 + (4 - 2) - (21 - 16). -5 (-6 - -14) + (-6 - (3 - 5)) 4 Evaluate 3 - (-12 - (1 - 3) - -5). 8 Calculate -1 + 8 + (-6 - -3) + -3. 1 Calculate -1 + -9 + (-11 - -6) + 7. -8 What is the value of (-2 - 1) + (0 - -2)? -1 What is 0 + 4 + 1 + -2 - -3? 6 What is the value of -2 + 0 + (-2 - -3)? -1 Evaluate 1 + 1 + 2 - 13. -9 -3 - (6 - -6) - (4 - 11) -8 Calculate 3 + -1 - (7 - 8). 3 What is the value of 2 + -5 - 2 - 1? -6 Evaluate -3 + 1 + 3 + 0. 1 What is 4 + 2 + -5 + (0 - -2)? 3 Evaluate 1 + -5 + (3 - -1). 0 -7 + (-3 - (0 + -6)) + 2 -2 Calculate -5 + 6 + 9 + -5. 5 Evaluate 7 + (3 - 7) + 3. 6 -7 + (-5 - -6 - 1) -7 What is 0 - (0 + -4 + 8)? -4 What is 12 - 8 - (-1 - -8) - 1? -4 What is 1 + 3 - (-3 + 11)? -4 Evaluate 11 + 4 + (8 - 31). -8 Calculate (1 - -1) + (-9 + 12 - 7). -2 What is 11 - (0 - 2 - -12)? 1 What is the value of -1 + (-1 - 2) - 0? -4 Calculate 2 - (-1 + 0 + -1 + 4). 0 What is the value of 17 - 12 - (0 - -7)? -2 Calculate -3 + (0 + 2 - 3). -4 What is the value of 6 - 13 - (-9 + -3)? 5 What is the value of -6 - (2 - 0 - (-19 + 19))? -8 What is -3 + -4 - (1 + -5)? -3 What is -5 + (-5 - -7 - 0)? -3 What is 6 - (-2 - (-5 + -4 + 5))? 4 What is the value of 7 + -2 + (0 - (-2 - -5))? 2 Calculate -5 - (-2 + -3 + 3) - -9. 6 (-6 - -9) + -3 + -2 -2 1 + -5 - (3 + 0 + -6) -1 Calculate -3 - (-8 + 15 + -12). 2 What is the value of 2 + -4 + (9 - 2) + 0? 5 1 - -4 - (12 + (-6 - -3)) -4 What is 1 + 1 - (34 + -29)? -3 What is 1 - (-8 + 6 + -4 + 3)? 4 Evaluate -4 - ((5 - 9) + 4 - -2). -6 Evaluate (8 - 4) + 1 + -4. 1 Evaluate 11 - ((-7 - -23) + -9). 4 What is the value of -5 + -4 + 1 + 6? -2 What is (0 - -4 - 0) + (18 - 17)? 5 Calculate (-1 - 6) + -10 + 13 - -4. 0 What is -1 + (-1 - (-3 + -1 + 5))? -3 What is -2 - 0 - -4 - (-15 + 14)? 3 What is the value of -1 - (3 - 8) - 9? -5 Calculate 8 - (-4 + 8) - 7. -3 Calculate 0 - 1 - (11 + 21 + -24). -9 Calculate -9 + (-7 - -1 - -10). -5 What is (6 - 3 - -3) + -1? 5 What is 8 + (-13 - (3 + -4))? -4 (1 - (-1 - 2)) + (3 - 5) 2 Calculate (2 - 5) + -1 + 4 + -4. -4 What is (3 - 5 - 1) + (3 - 5)? -5 What is the value of -2 + 8 - (4 + 2)? 0 Calculate (1 - -8) + -2 + -25 + 21. 3 What is -4 - 6 - (-5 + -5 + 4)? -4 (-8 - -4) + (-1 - -7) 2 Calculate -4 + -5 - (-2 + -4). -3 Calculate (-30 - -34) + 1 + -2. 3 Evaluate 0 + -5 + 2 + -1. -4 What is the value of -1 - 1 - (29 - 26)? -5 What is the value of (3 + -6 - -1) + 2 + 1? 1 Evaluate (-4 - (-1 + 3)) + 4. -2 -56 + 61 - (5 + -1) 1 Evaluate (-4 - 0) + 0 + 8. 4 What is the value of 8 - (-3 + -7 + 8)? 10 Calculate 11 + -21 + (12 - 5). -3 Calculate -2 + 0 - -3 - (10 + -8). -1 What is -3 - (-5 - (2 - (3 - -2)))? -1 Calculate (-10 - 1) + -214 + 221. -4 (10 - 17) + (-1 - -3) -5 What is the value of (-2 - (2 - 7)) + -1 + 0? 2 What is the value of 0 + (-12 - -13) - (1 + -7)? 7 Evaluate (2 - 3) + -3 + 0. -4 What is the value of -1 - 5 - -4 - 0? -2 What is the value of 1 + (-4 - (6 + -5))? -4 6 + -4 + -2 + 0 0 What is the value of -5 + (4 - 5) + -4 + 8? -2 Calculate -4 + -5 + 3 + 1. -5 Calculate (-2 - -4) + (5 - (2 + 0)). 5 (-6 - -6) + (0 - (4 + 2)) -6 What is the value of (2 - 3) + -34 + 35? 0 What is -5 - (-5 + 0 + 1)? -1 What is -3 - -1 - -2 - (4 - 0)? -4 What is -4 + (6 + 1 - 4)? -1 What is the value of (1 - 5 - -4) + 23 + -17? 6 Calculate 7 + (0 + 0 - 10). -3 What is the value of 1 + 4 + (-5 - 3) + -5? -8 What is the value of 0 + (3 - 8) + 13? 8 What is -1 + (4 - 6) + 2 - 4? -5 Calculate (4 - (0 - 0)) + -3. 1 -3 + (-4 + 1 - (13 - 23)) 4 What is 2 - 5 - (1 + -2)? -2 3 - (-1 + -2 + 1) 5 -1 + (-3 - -1) - (0 - 4) 1 What is 6 - (4 - 5) - (6 + 3)? -2 Calculate -82 + 82 + (6 - 1). 5 Calculate (-2 - -6) + (0 - 2). 2 2 - (-6 - -10) - (-1 - 3) 2 What is the value of 1 + -3 + 0 - 1 - -8? 5 (5 - 5) + 2 + 0 + -5 -3 What is the value of -6 + (-3 - -7) + 6? 4 Calculate 0 + (-2 + 5 - (0 - -2)). 1 What is -7 - (-13 + (-1 - -2))? 5 Evaluate -2 + (6 - 1) + 5 + -1. 7 Calculate -4 + (-4 - -14) + 0 + -1. 5 9 + -7 + -2 + 2 + -6 -4 Evaluate -3 + (4 - 0) + -4 + 6. 3 -3 - (-1 + (-4 - 5)) 7 What is 3 + -5 + (-2 - -8) + -4? 0 What	{ "pile_set_name": "DM Mathematics" }
53. Does 21 divide i? False Suppose 3r + 38 = 2o - 43, -5r - 15 = 0. Is o a multiple of 9? True Suppose -6y + 2y = -224. Suppose x - y = 117. Suppose -2o = -3g + 3o + x, -g - 4o + 35 = 0. Is 23 a factor of g? False Suppose -24l = -20l - 320. Is l a multiple of 16? True Suppose 0 = -8n + 6n - 3i + 176, 4i - 8 = 0. Is n a multiple of 8? False Let r be 0/(-1)(-1)/1. Suppose r = -7o + 357 + 7. Is o a multiple of 13? True Suppose 4h + n - 59 = 0, 4h + 0n = 2n + 50. Let r = 36 + 0. Let g = r - h. Is 17 a factor of g? False Let s(x) be the first derivative of -x4/4 - 2x3 - x2 + 2x + 2. Is 3 a factor of s(-6)? False Let s(o) = o2 + 15o - 9. Let f be s(-14). Let q = 13 + -8. Let a = q - f. Is 14 a factor of a? True Suppose -f = f - 4. Suppose fj = -j + 5h - 24, 4j + 32 = -5h. Does 9 divide 105/4 + (-6)/j? True Suppose 2r - 5r = 0, -26 = -2j - 2r. Is j a multiple of 13? True Let d = -57 - -81. Is 3 a factor of d? True Let c be 72/(-32) + 1/4. Let r(k) = 43k - 2. Let f be r(c). Is 5 a factor of (-1)/(-3) + f/(-6)? True Let z(c) = 3c - 1. Let n be z(1). Suppose -2i + 0d - nd = -26, i + 2 = 2d. Is i a multiple of 8? True Let r be (0 + 2)/((-4)/(-10)). Suppose 5g - 505 = -0g - rb, 2b = -5g + 511. Suppose 3i - 3q - 2q = g, 5q + 25 = 0. Does 13 divide i? True Let l be 74 - (-3 - -2). Let j be 10/(-45) - l/(-9). Is 4 a factor of ((-2)/(-4))/(j/60)? False Suppose 15 + 25 = -5f + 4i, 2f + 2i = 2. Let o be (-23)/1 - (f - -6). Let g = o + 51. Is 19 a factor of g? False Let d(h) = 2h + 4. Let k(c) be the second derivative of -c3/6 - 3c*2/2 + 3c. Let g(b) = -5d(b) - 7k(b). Is g(-2) a multiple of 7? True Let d be -7 - 7 - (-4)/2. Let k(m) = -3m - 15. Is 5 a factor of k(d)? False Suppose 2d + 4j - 39 = -j, 2d - 31 = 3j. Suppose 3v = c - d, c + 23 = 4c - 2v. Suppose -t - 39 = -s + 19, 0 = ct - 15. Does 27 divide s? False Let r(a) = -4a + 1 + 2a + a + 0a. Let s be r(1). Suppose -4n - 5m + 3 + 31 = s, -n = -5m - 21. Is n a multiple of 11? True Is 7 a factor of 36 + 0/2 + -1? True Suppose 43 + 45 = 4t. Suppose y - 60 = -t. Is y a multiple of 17? False Let k(p) = p*2 - 5p + 6. Let a be k(4). Suppose 96 = 3t + t - aw, -t = -5w - 24. Does 18 divide t? False Is (32 - 0 - 0)/2 a multiple of 16? True Let b(u) = u + 7. Let v be b(-5). Suppose va = -a + 78. Is 13 a factor of a? True Suppose 3a - 1 + 4 = 0. Is (1 + (a - 1))-57 a multiple of 19? True Let m be -15(2 - 26/10). Let a(v) = 3v - 1. Does 13 divide a(m)? True Let h be (4/(-8))/(3/(-12)). Suppose -4a + 31 = r, 0 = -ha + 6a - 12. Is 7 a factor of r? False Let w(g) = 10g - 3. Let s be w(-3). Let l = s + 64. Is l a multiple of 16? False Let o = 165 - 75. Suppose 0m = -3m + o. Does 26 divide m? False Suppose c + 1 = -0c + m, -2c + 4 = m. Let z be -2 + 9 + 2/c. Does 10 divide ((-20)/(-3))/(3/z)? True Let o(p) = -7p + 4. Let d be o(-7). Is (-2)/(-2)-1 + d a multiple of 13? True Let i(r) be the first derivative of -r*4/12 - 3r*3/2 - 2r*2 - 2r + 1. Let k(l) be the first derivative of i(l). Is 14 a factor of k(-6)? True Let t be 86 - (0 + (-3)/(-1)). Is 28 a factor of 3 - ((-4)/(-2) - t)? True Let j be 1234/(-14) - 13/(-91). Is 13 a factor of j/(-2) + 4 + 4? True Let k(b) = 2b - 1. Let z be k(2). Suppose 22 = 5v + 4j, -4v + 18 = -0v + zj. Is v a multiple of 6? True Let n = 8 - 2. Let s = -6 + n. Is 8 a factor of s(-3)/(-9) + 16? True Let o(y) = 31y*2 - y - 2. Is 12 a factor of o(-1)? False Suppose 45b - 50b + 1050 = 0. Is 15 a factor of b? True Let z(q) = 8q - 7. Let w be z(11). Let y = -39 + w. Does 11 divide y? False Let h(c) = c*2 - 2c + 3. Let z(d) = -d*2 + 2d + 5. Let a(x) = -x*2 + 8x - 8. Let v be a(6). Let y be z(v). Is h(y) a multiple of 9? True Suppose -3r + 353 = -4u, -4r - 5u + 324 = -157. Is 17 a factor of r? True Let l = 20 - 14. Is 14 a factor of -23(-52)/l? False Suppose -4 = -2y - 0y. Suppose yj + 3j - 45 = 0. Let m = j - 4. Is m a multiple of 5? True Let h(p) = -3p + 6. Let b = -20 - -11. Does 11 divide h(b)? True Does 34 divide 3/(-33) + 8517/33? False Suppose 11s + 3s = 1540. Is 5 a factor of s? True Is (-2 - 0) + (2 - -50) a multiple of 12? False Let y be (4/10)/((-2)/(-10)). Suppose -32 = -ya - 0. Is a a multiple of 8? True Let z = 20 + -7. Suppose -z + 2 = -3b - 5g, -5g = 4b - 18. Let l(f) = 2f + 8. Is l(b) a multiple of 11? True Suppose j - 200 = -3j. Suppose 157 = 5b - s - 57, b - j = 2s. Does 14 divide b? True Suppose -j - j + 4 = 0. Suppose jy = 4n + 12, 5y - y - 19 = 3n. Suppose 2l = 3o + 78, -l - 44 = -2l + yo. Is l a multiple of 18? True Let n(s) = 2s2 - 11s + 1. Let p(b) = b*2 - 6b. Let j(l) = 3n(l) - 5p(l). Let q be j(3). Is 5 a factor of (-1)/q + (-62)/(-6)? True Let p(g) = -g*3 + 4g*2 - 2g. Let w be p(4). Let t be (-2)/w + 7/4. Suppose 0 = 5k + tc - 86, -4k - 2c = 17 - 85. Is 7 a factor of k? False Suppose 0 = -2g - 2, 3z + 44 = -g + 13. Let f = z + 16. Is f a multiple of 6? True Let u be 4/(-18) + 56/9. Let m be 1/3 - 38/u. Let c = m + 15. Does 3 divide c? True Suppose 0m + 10 = 5m. Suppose -3h - d + 56 = 0, md + 68 = -h + 5h. Does 18 divide h? True Let k be 1/2 - 129/(-6). Suppose 5a = -2h - 0a + 38, -h + k = a. Is 22 a factor of h? False Suppose 14o - 29 = 13o. Is o a multiple of 5? False Suppose 2i = -63 - 337. Let y be (-8)/(-6)36/(-8). Is y/21 - i/14 a multiple of 7? True Suppose 12 = -g + 5j, 2g + 3j = 2 + 13. Let i = -9 + g. Let b = i + 8. Is b a multiple of 2? True Let j be 1/(-1 - (-44)/48). Is j/(-10)(-35)/(-14) a multiple of 2? False Let q be (0 + -5)/(6/(-12)). Suppose 75 + q = 5m. Is 7 a factor of m? False Let p be (-6)/(-8)(-128)/(-4). Suppose c - 3c = -p. Is c a multiple of 4? True Suppose -5h = -2x + 3x - 148, -5h + 4x = -158. Is 3 a factor of h? True Suppose -3b - 11 = 10. Let q = -1 - b. Does 11 divide (20/q)/(3/27)? False Suppose 17 = -5y - 43. Does 9 divide (0 - y) + (5 - 8)? True Is -1(1 + -311) a multiple of 8? True Suppose 2b - 4 = 162. Is 18 a factor of b? False Let l(n) = -4n*3 + 6n*2 + 6n - 1. Let g be l(5). Is 15 a factor of 4/(-14) - g/21? True Is 13 a factor of 4/14 + (-1064)/(-49)? False Suppose -3x + 0x + 45 = 0. Suppose -2v - x = -3c, -2v = -c + 9 - 4. Is c a multiple of 2? False Suppose -4l - 3b + 124 = 0, -3l + 8l - 3b = 182. Let g = -16 + l. Does 7 divide g? False Let q(t) = -12t - 49. Does 27 divide q(-9)? False Let x be ((-1)/(-3))/((-2)/(-24)). Is 13 a factor of (-1)/4 + 69/x? False Suppose -3p = 4b - 466, 0p = 2p - 2b - 334. Is p a multiple of 27? True Let s = 3 + 6. Suppose 4g - sg = -75. Is 5 a factor of g? True Let d be 0 - 3(-1)/1. Let o = d - -2. Suppose 2b - 134 = -3b - u, 0 = 3b - ou - 58. Is 13 a factor of b? True Let i = 2 - 0. Suppose ig - 52 = -2g. Is 13 a factor of g? True Suppose -3s - 4 = -g - 14, 3s - 18 = -3g. Suppose gz + 16 = 6z. Is 9 a factor of 8/(0 + 2/z)? False Let n = -12 - -92. Is 16 a factor of n? True Let p(n) = n*3 - 8n2 - n + 3. Let r be p(8). Let u(a) = a3 + 5a2 - 5a. Is u(r) a multiple of 19? False Suppose 0p - v - 86 = -3p, -4p + 88 = 4v. Suppose 6 = -2m - 4g, -m - 3m + 5g + p = 0. Suppose 5 = a, m - 12 = 2h - 3a. Does 3 divide h? True Let o = -17 - -12. Let d be (-24)/(-15)o/(-2). Let a(l) = 2l*2 - 4l + 1. Is a(d) a multiple of 10? False Suppose 10 = c - 0c - 2r, -3r + 3 = 0. Is c a multiple of 12? True Let c = -6 + 1. Does 2 divide 1/c - 42/(-10)? True Suppose 0 = 4g - 0g - 12. Suppose -t + 2t + 4m - 8 = 0, 3t + 5m - 31 = 0. Suppose 3i - t = 0, 0 = gq - 5i - 84 + 20. Is q a multiple of 10? False Suppose 0 = 5f + 3d - 196 - 407, 4d = 4. Is f a multiple of 12? True Let u(m) = -m3 + m2 - m + 1. Let x(d) = -4d*3 + 10d*2 - 11d - 1. Let k(p) = 5u(p) - x(p). Suppose 0 = 4y + 16 + 8. Does 2 divide k(y)? True Let k(f) = f*2 - f + 2. Let x be k(0). Suppose -xg = -8 - 34. Is 7 a factor of g? True Let n = 10 + 1. Let s = n - 6. Suppose -4t = j - 0t - 9, -9 = -j + st. Is j a multiple of 8? False Let s = 10 - -30. Is 8 a factor of s? True Let m(u) = u3 + 6u*2 + 4u - 3. Let q be m(-5). Suppose -2t + 68 = qt. Does 14 divide t? False Suppose -	{ "pile_set_name": "DM Mathematics" }
What is the highest common divisor of 1134 and 1802076? 6 Calculate the greatest common divisor of 14635846 and 101126. 1714 Calculate the highest common divisor of 4296680 and 4890. 1630 Calculate the greatest common divisor of 50163 and 339. 3 Calculate the highest common factor of 2362308 and 312. 156 What is the highest common divisor of 177 and 43281633? 177 What is the highest common divisor of 10035696 and 16? 16 What is the highest common divisor of 2124 and 324028? 236 What is the greatest common factor of 9580 and 54934115? 2395 Calculate the highest common divisor of 10443 and 4050999. 177 What is the highest common divisor of 280028566 and 278? 278 Calculate the greatest common factor of 117899993 and 29. 29 What is the greatest common factor of 552 and 6466584? 24 Calculate the highest common factor of 158126605 and 425. 85 What is the greatest common factor of 2738592 and 333? 333 What is the greatest common divisor of 2650861 and 8303? 19 Calculate the highest common factor of 3136415 and 5695. 85 What is the greatest common divisor of 41612244 and 552? 276 Calculate the highest common factor of 189319743 and 684. 171 What is the greatest common divisor of 5446 and 569371131? 2723 Calculate the highest common divisor of 91393267 and 3437. 3437 Calculate the highest common divisor of 313276 and 778312. 1084 Calculate the greatest common factor of 53420 and 94420. 20 What is the greatest common divisor of 1570520 and 1065? 355 Calculate the highest common divisor of 8 and 37542248. 8 Calculate the greatest common factor of 27 and 12079467. 9 What is the highest common factor of 45797098 and 3? 1 What is the greatest common factor of 19665009 and 12168? 1521 Calculate the highest common factor of 9229 and 608124. 11 What is the greatest common divisor of 1520852800 and 449? 449 What is the highest common factor of 49905 and 28665? 45 Calculate the highest common divisor of 496766 and 6258. 298 Calculate the highest common factor of 7359398 and 22. 2 What is the greatest common factor of 154 and 87306450? 154 What is the greatest common factor of 137644 and 42068? 52 What is the highest common divisor of 61 and 268166858? 61 Calculate the greatest common divisor of 4965 and 277197605. 1655 What is the greatest common factor of 5263104 and 220? 44 What is the highest common divisor of 23762 and 5232? 218 Calculate the greatest common factor of 459 and 1955493. 153 What is the highest common divisor of 10384 and 6793732? 2596 Calculate the highest common factor of 4382774 and 11. 11 What is the highest common factor of 45493 and 592088? 679 What is the highest common factor of 18336960 and 960? 960 What is the greatest common divisor of 1925 and 1603855? 55 What is the greatest common factor of 5349 and 2019? 3 What is the greatest common divisor of 15264 and 2493279? 477 What is the greatest common factor of 2236 and 5016466? 1118 Calculate the highest common divisor of 3204 and 4061304. 36 Calculate the highest common factor of 8338 and 1137950. 22 What is the greatest common divisor of 64640 and 478740? 2020 Calculate the highest common divisor of 11 and 52157633. 11 What is the greatest common divisor of 31627162 and 828? 46 Calculate the greatest common factor of 4400914 and 182. 14 Calculate the highest common factor of 183889 and 1073. 29 Calculate the greatest common divisor of 48465 and 30375. 135 Calculate the greatest common factor of 11172 and 22632512. 196 What is the highest common divisor of 29690226 and 9? 9 Calculate the highest common factor of 5368 and 958648. 8 What is the greatest common factor of 208425 and 142100? 175 What is the highest common factor of 40 and 4730650? 10 Calculate the highest common factor of 66582336 and 3264. 3264 Calculate the highest common factor of 342 and 293882. 2 What is the highest common divisor of 3519 and 522537? 69 Calculate the highest common divisor of 14238 and 144405. 9 What is the greatest common factor of 610 and 443546250? 610 Calculate the highest common factor of 3550272 and 67199. 451 What is the highest common divisor of 80 and 33199280? 80 What is the highest common divisor of 152736 and 2666? 86 What is the highest common divisor of 446496883 and 3171? 1057 What is the highest common divisor of 13109216 and 84560? 2416 Calculate the highest common divisor of 654444 and 67536. 252 What is the highest common factor of 37059108 and 1524? 1524 What is the highest common factor of 5605 and 547402? 59 What is the highest common factor of 7 and 451196? 1 Calculate the greatest common factor of 120 and 79704. 24 What is the greatest common divisor of 5576518 and 587921? 5821 What is the highest common factor of 13147446 and 582686? 1898 Calculate the highest common factor of 322 and 38612791. 161 What is the greatest common factor of 1050 and 26278? 14 What is the greatest common divisor of 138 and 3375434? 46 Calculate the greatest common divisor of 252271 and 6119. 29 What is the greatest common divisor of 2553 and 21338529? 111 Calculate the highest common factor of 5629 and 31945441. 433 What is the greatest common factor of 56 and 262968? 8 Calculate the greatest common divisor of 7536113 and 5083. 13 What is the highest common divisor of 266 and 24808? 14 Calculate the highest common factor of 3172 and 12645971. 793 Calculate the highest common factor of 18925488 and 81. 81 Calculate the highest common divisor of 7655396 and 24038. 1414 Calculate the greatest common divisor of 562 and 436112. 562 What is the highest common factor of 477869670 and 90? 90 What is the highest common factor of 117547 and 4776422? 2867 Calculate the greatest common divisor of 1651895 and 203. 7 Calculate the highest common factor of 163684 and 1829792. 1084 What is the greatest common factor of 6310470 and 104880? 570 Calculate the greatest common factor of 1168256376 and 12656. 6328 What is the greatest common divisor of 3068 and 44133947? 767 What is the greatest common factor of 2110999 and 3311? 473 Calculate the greatest common factor of 404382 and 98736. 726 Calculate the highest common factor of 53696 and 83648. 64 Calculate the highest common factor of 3384 and 31530984. 1128 Calculate the greatest common factor of 19633337 and 379. 379 What is the greatest common divisor of 438 and 1135494852? 438 Calculate the highest common factor of 46494 and 14449428. 1134 Calculate the greatest common factor of 179299 and 87397. 901 Calculate the greatest common divisor of 5009004 and 630. 126 Calculate the greatest common factor of 1884662 and 2712294. 4498 What is the highest common factor of 154860791 and 2425? 97 What is the highest common divisor of 271618596 and 96? 12 What is the greatest common divisor of 16 and 188742256? 16 What is the greatest common divisor of 63572850 and 50? 50 Calculate the greatest common factor of 3905039 and 51088. 3193 Calculate the greatest common divisor of 12474 and 44838360. 1134 Calculate the greatest common factor of 408600036 and 67977. 9711 Calculate the greatest common factor of 6 and 3083784. 6 What is the highest common factor of 1952 and 20917266? 122 Calculate the greatest common factor of 3027924 and 305724. 4188 Calculate the greatest common factor of 24544553 and 44. 11 What is the highest common divisor of 1640 and 805160? 40 What is the highest common factor of 7769157 and 3201? 33 What is the highest common divisor of 174087 and 6760799? 841 What is the highest common divisor of 289868 and 108? 4 What is the highest common factor of 93280 and 3088840? 2120 Calculate the highest common divisor of 1106948 and 129611. 3503 Calculate the greatest common divisor of 23 and 4276685021. 23 Calculate the greatest common divisor of 65230294 and 90690. 6046 What is the greatest common divisor of 10070327 and 74? 37 Calculate the highest common divisor of 31595 and 383590. 445 What is the highest common divisor of 34575092 and 1572? 524 What is the highest common factor of 270 and 1018395? 45 Calculate the highest common divisor of 17670 and 14818930. 310 What is the greatest common divisor of 278862 and 1002? 6 What is the greatest common factor of 279 and 705661587? 279 Calculate the greatest common factor of 410492 and 12956. 164 What is the g	{ "pile_set_name": "DM Mathematics" }
ominator of 32/5 and -38/759? 3795 What is the smallest common multiple of 2680 and 180? 24120 Calculate the lowest common multiple of 736 and 8. 736 Calculate the smallest common multiple of 2052 and 2394. 14364 What is the lowest common multiple of 76 and 16? 304 What is the smallest common multiple of 416 and 2444? 19552 Find the common denominator of -95/312 and -3/20. 1560 What is the common denominator of -7/55 and 56/115? 1265 What is the least common multiple of 208 and 656? 8528 Find the common denominator of 1/1880 and 85/1504. 7520 Find the common denominator of 59/20 and -81/1006. 10060 What is the lowest common multiple of 76 and 140? 2660 Find the common denominator of -7/2 and 65/162. 162 Find the common denominator of -53/900 and 157/2100. 6300 Find the common denominator of -35/817 and 53/2. 1634 What is the common denominator of 28/199 and -59/10? 1990 What is the lowest common multiple of 273 and 378? 4914 What is the common denominator of 16/7 and -77/74? 518 Calculate the smallest common multiple of 270 and 10. 270 What is the smallest common multiple of 1462 and 172? 2924 What is the lowest common multiple of 120 and 36? 360 What is the lowest common multiple of 5952 and 22? 65472 What is the common denominator of 37/840 and 43/216? 7560 What is the lowest common multiple of 2366 and 22? 26026 Find the common denominator of 143/96 and 113/672. 672 Calculate the least common multiple of 322 and 253. 3542 Find the common denominator of -17/36 and -29/20. 180 What is the common denominator of 7/275 and -37/825? 825 Calculate the common denominator of 151/48 and 62/3. 48 Calculate the least common multiple of 988 and 221. 16796 What is the common denominator of 29/1273 and 67/8? 10184 What is the smallest common multiple of 162 and 14? 1134 Calculate the lowest common multiple of 11 and 10. 110 What is the lowest common multiple of 600 and 660? 6600 What is the lowest common multiple of 1323 and 8379? 25137 What is the least common multiple of 6492 and 30? 32460 Find the common denominator of -3/7 and 14/13. 91 What is the lowest common multiple of 1080 and 540? 1080 Find the common denominator of -45/14 and -91/76. 532 Calculate the smallest common multiple of 45 and 55. 495 Find the common denominator of 2/21 and 107/6. 42 What is the common denominator of -67/297 and 76/1089? 3267 Calculate the least common multiple of 72 and 5856. 17568 Calculate the common denominator of -49/6 and -121/282. 282 What is the common denominator of -41/6 and 51/172? 516 What is the smallest common multiple of 243 and 3? 243 Find the common denominator of -81/104 and 50/117. 936 Calculate the common denominator of -119/12 and 37/1566. 3132 Calculate the lowest common multiple of 600 and 70. 4200 Calculate the least common multiple of 12 and 606. 1212 Calculate the lowest common multiple of 29768 and 28. 208376 What is the common denominator of 93/304 and 67/418? 3344 What is the common denominator of -53/110 and -93/100? 1100 Calculate the common denominator of -69/200 and -31/2. 200 What is the least common multiple of 192 and 624? 2496 Find the common denominator of -31/1915 and -29/45. 17235 Calculate the common denominator of -73/444 and 55/6. 444 What is the common denominator of 43/1100 and 57/770? 7700 Calculate the common denominator of -121/2580 and -103/430. 2580 Calculate the least common multiple of 447 and 6. 894 Calculate the smallest common multiple of 33 and 10674. 117414 Calculate the common denominator of 21/682 and 11/744. 8184 Find the common denominator of -36/799 and 1/470. 7990 What is the least common multiple of 8848 and 3792? 26544 Calculate the smallest common multiple of 516 and 18. 1548 Calculate the common denominator of -33/190 and 91/18. 1710 Find the common denominator of 77/3340 and -127/2004. 10020 What is the smallest common multiple of 11 and 2? 22 What is the least common multiple of 150 and 750? 750 Calculate the lowest common multiple of 33 and 5862. 64482 Calculate the least common multiple of 12 and 14816. 44448 What is the lowest common multiple of 250 and 125? 250 What is the common denominator of -3/62 and -73/266? 8246 What is the common denominator of 121/20 and -18/65? 260 Calculate the common denominator of -80/231 and -32/69. 5313 Find the common denominator of -68/747 and 43/249. 747 Calculate the common denominator of -25/12108 and -1/16. 48432 Calculate the lowest common multiple of 9 and 135. 135 Calculate the common denominator of -79/3034 and -57/2294. 94054 What is the common denominator of 73/69 and -13/48? 1104 Calculate the smallest common multiple of 45 and 374. 16830 What is the lowest common multiple of 1548 and 516? 1548 What is the common denominator of 4/9 and -18/853? 7677 What is the least common multiple of 2500 and 175? 17500 What is the common denominator of -37/14 and 35/43066? 301462 What is the common denominator of 85/72 and -137/10332? 20664 What is the common denominator of -21 and 59/98? 98 Find the common denominator of -97/96 and 29/2. 96 Find the common denominator of 47/668 and -81/28. 4676 What is the common denominator of 131/150 and 31/60? 300 Calculate the common denominator of 111/880 and 59/440. 880 Find the common denominator of 26/3649 and 56/267. 10947 What is the smallest common multiple of 4020 and 22? 44220 What is the lowest common multiple of 1064 and 228? 3192 What is the lowest common multiple of 960 and 2112? 10560 What is the least common multiple of 298 and 10? 1490 What is the smallest common multiple of 3 and 2340? 2340 What is the smallest common multiple of 231 and 57? 4389 Find the common denominator of 131/12 and -71/120. 120 Find the common denominator of -5/48 and 91/250. 6000 What is the least common multiple of 24 and 66? 264 What is the common denominator of -63/470 and 37/1034? 5170 Calculate the common denominator of 29/1344 and -67/1568. 9408 What is the common denominator of 19/7 and 51/172? 1204 Calculate the common denominator of 123/20 and -45/88. 440 What is the common denominator of -18 and -52/15? 15 Calculate the smallest common multiple of 1110 and 333. 3330 Calculate the lowest common multiple of 154 and 77. 154 What is the common denominator of 125/972 and 55/54? 972 Calculate the common denominator of -55/102 and 119/30. 510 Calculate the common denominator of -31/72 and 46/33. 792 Calculate the least common multiple of 20 and 126. 1260 What is the least common multiple of 55 and 50? 550 Calculate the least common multiple of 14 and 35. 70 Calculate the common denominator of -21/368 and 19/4. 368 Calculate the common denominator of -43/7 and 1/289. 2023 What is the lowest common multiple of 493 and 11? 5423 What is the smallest common multiple of 10 and 34? 170 What is the common denominator of -83/96 and 19/84? 672 What is the least common multiple of 6 and 12772? 38316 What is the smallest common multiple of 22 and 18? 198 What is the smallest common multiple of 40 and 210? 840 What is the common denominator of -91/150 and 47/9? 450 Find the common denominator of -41/154 and -121/10. 770 Find the common denominator of -59/10 and -77/102. 510 What is the lowest common multiple of 852 and 100? 21300 Calculate the least common multiple of 39 and 36. 468 Calculate the smallest common multiple of 4 and 747. 2988 What is the smallest common multiple of 132 and 384? 4224 What is the common denominator of 31/22 and 95/214? 2354 What is the least common multiple of 1716 and 9? 5148 What is the smallest common multiple of 4338 and 482? 4338 What is the least common multiple of 33 and 12? 132 What is the common denominator of -77/838 and 99/2? 838 Calculate the common denominator of -15/16 and -71/554. 4432 What is the common denominator of 7/60 and 121/168? 840 What is the least common multiple of 1380 and 22? 15180 What is the least common multiple of 3 and 333? 333 What is the lowest common multiple of 1827 and 12006? 84042 Calculate the smallest common multiple of 40 and 104. 520 Calculate the common denominator of -67/148 and -59/6. 444 Find the common denominator of -113/80 and -23/50. 400 Find the common denominator of -53/18 and 9/28. 252 Calculate the smallest common multiple of 12 and 84. 84 Calculate the lowest	{ "pile_set_name": "DM Mathematics" }
e 204062? False Does 7 divide 168749? True Is 300 a factor of 54702? False Does 189 divide 193631? False Does 1074 divide 11496096? True Is 5 a factor of 205124? False Does 4 divide 640357? False Is 851200 a multiple of 256? True Does 72 divide 31755? False Is 305004 a multiple of 69? False Does 50 divide 577600? True Is 5 a factor of 220990? True Does 73 divide 105704? True Is 1420997 a multiple of 10? False Does 231 divide 7044227? False Is 14 a factor of 318244? False Is 15 a factor of 2349868? False Is 8 a factor of 4425256? True Is 449481 a multiple of 17? False Is 1139218 a multiple of 26? False Does 5 divide 27840? True Is 242504 a multiple of 6? False Is 51 a factor of 1886119? False Is 55616 a multiple of 23? False Is 3 a factor of 3484843? False Is 171 a factor of 1565886? False Does 32 divide 699186? False Is 251 a factor of 4305905? True Does 285 divide 9074970? True Does 20 divide 3628800? True Is 758 a factor of 1672898? False Is 236 a factor of 1818616? True Is 3128441 a multiple of 10? False Is 6 a factor of 10053? False Does 332 divide 51476? False Is 799 a factor of 5151153? True Is 14 a factor of 177060? False Does 1525 divide 5389742? False Is 6117587 a multiple of 164? False Does 2 divide 28957? False Is 16 a factor of 365442? False Does 9 divide 66510? True Is 13952 a multiple of 4? True Is 339 a factor of 34756992? True Does 15 divide 247483? False Is 1662424 a multiple of 38? True Is 212111 a multiple of 5? False Is 4144651 a multiple of 333? False Is 554450 a multiple of 50? True Does 17 divide 53125? True Is 247 a factor of 290966? True Does 77 divide 1659504? True Is 313538 a multiple of 446? True Does 7 divide 27671? True Does 56 divide 46312? True Is 361008 a multiple of 18? True Is 21 a factor of 19362? True Does 144 divide 2519218? False Is 620169 a multiple of 94? False Does 650 divide 3138554? False Is 6303094 a multiple of 526? False Is 10 a factor of 7971880? True Is 37 a factor of 397972? True Is 3 a factor of 463211? False Is 25 a factor of 61800? True Does 31 divide 281442? False Is 15 a factor of 15079? False Is 14 a factor of 5220423? False Does 42 divide 628110? True Is 279 a factor of 2392255? False Is 124418 a multiple of 67? False Does 8 divide 607682? False Does 23 divide 91686? False Does 151 divide 412505? False Is 458582 a multiple of 25? False Is 85 a factor of 1761200? True Does 434 divide 728252? True Is 23 a factor of 28589? True Is 219936 a multiple of 58? True Is 17 a factor of 944168? False Is 210132 a multiple of 78? True Is 4 a factor of 156227? False Is 87637 a multiple of 11? True Does 58 divide 312968? True Is 329068 a multiple of 3? False Is 2898167 a multiple of 103? False Is 4659137 a multiple of 649? False Does 61 divide 388761? False Is 417 a factor of 4413945? True Does 29 divide 20416? True Is 179 a factor of 1787494? True Is 2190020 a multiple of 10? True Is 15 a factor of 2886887? False Is 49 a factor of 8383349? False Does 321 divide 776328? False Does 695 divide 9597719? False Is 2483190 a multiple of 17? True Is 181 a factor of 263817? False Is 29 a factor of 995019? True Does 14 divide 3314318? True Is 26520 a multiple of 120? True Is 247066 a multiple of 262? True Does 32 divide 42432? True Is 9 a factor of 1250172? True Is 80 a factor of 462640? True Is 19 a factor of 1686616? False Is 20 a factor of 656587? False Is 3609962 a multiple of 38? True Does 50 divide 677575? False Is 23331122 a multiple of 242? False Is 83421 a multiple of 15? False Is 75 a factor of 4875? True Is 331482 a multiple of 101? True Is 33887 a multiple of 114? False Does 25 divide 258539? False Does 576 divide 3416832? True Does 31 divide 620589? True Is 1078656 a multiple of 24? True Is 127699 a multiple of 13? True Is 98 a factor of 3043897? False Does 28 divide 10470992? True Is 172 a factor of 5933828? True Does 36 divide 136436? False Is 209735 a multiple of 5? True Is 256 a factor of 728827? False Does 7 divide 64073? False Does 6 divide 2652602? False Is 1204344 a multiple of 516? True Is 373857 a multiple of 493? False Is 55753 a multiple of 55? False Is 230 a factor of 5088997? False Does 7 divide 8434706? True Is 14305650 a multiple of 674? True Does 16 divide 481872? True Is 13 a factor of 8122985? True Is 4302962 a multiple of 19? False Is 147450 a multiple of 10? True Does 12 divide 10989? False Is 47 a factor of 3126064? True Is 72 a factor of 20268576? True Is 13 a factor of 433316? True Is 744960 a multiple of 320? True Does 771 divide 9150999? True Does 5 divide 34426? False Is 806174 a multiple of 356? False Does 77 divide 3076271? False Is 46 a factor of 1092776? True Does 7 divide 82835? False Is 159160 a multiple of 184? True Is 5 a factor of 210820? True Is 193 a factor of 2146160? True Is 845921 a multiple of 49? False Is 3252679 a multiple of 181? False Is 48430 a multiple of 29? True Is 669574 a multiple of 2? True Does 21 divide 142548? True Does 9 divide 280014? False Is 304 a factor of 3972243? False Is 749142 a multiple of 3? True Is 42 a factor of 698502? True Is 726496 a multiple of 73? True Is 94 a factor of 56863? False Does 39 divide 5473885? False Is 1236078 a multiple of 7? False Is 184 a factor of 307648? True Does 128 divide 3511242? False Is 81 a factor of 87399? True Is 107 a factor of 4374648? False Does 179 divide 488133? True Is 85 a factor of 10123547? False Is 109915 a multiple of 65? True Does 22 divide 153660? False Is 206 a factor of 3378606? True Is 497098 a multiple of 14? True Does 87 divide 5632150? False Is 574480 a multiple of 59? False Is 9232633 a multiple of 1018? False Does 472 divide 5488697? False Is 17 a factor of 832242? False Does 124 divide 1623408? True Does 215 divide 1002272? False Does 26 divide 680824? False Is 27 a factor of 174167? False Is 319 a factor of 322190? True Does 3 divide 9186590? False Is 60675 a multiple of 25? True Does 46 divide 1773933? False Is 369 a factor of 2791337? False Is 703527 a multiple of 11? True Is 435301 a multiple of 18? False Is 4693107 a multiple of 55? False Does 277 divide 2271513? False Does 2 divide 730540? True Is 72577 a multiple of 5? False Does 105 divide 78042? False Is 60 a factor of 703327? False Is 349860 a multiple of 476? True Is 63 a factor of 85773? False Is 537 a factor of 6470850? True Is 35 a factor of 133261? False Is 13984164 a multiple of 12? True Is 4054941 a multiple of 123? True Is 653 a factor of 621656? True Is 37 a factor of 15843203? False Is 244647 a multiple of 17? True Does 14 divide 12924537? False Does 121 divide 408361? False Is 49320 a multiple of 90? True Is 531 a factor of 1403433? True Is 4864566 a multiple of 18? False Is 1923900 a multiple of 590? False Is 1177854 a multiple of 327? True Does 90 divide 20520? True Is 899286 a multiple of 30? False Is 1399166 a multiple of 10? False Is 87 a factor of 668160? True Is 45 a factor of 149647? False Is 11198134 a multiple of 78? False Does 23 divide 7503796? True Does 85 divide 1361530? True Is 8 a factor of 471671? False Is 14 a factor of 4376694? True Does 8 divide 2462528? True Is 133 a factor of 4636500? False Does 22 divide 7766? True Is 47 a factor of 418158? False Is 1534488 a multiple of 34? True Does 49 divide 1369759? False Is 147494 a multiple of 229? False Is 4 a factor of 229221? False Is 28 a factor of 4541? False Is 595 a factor of 1946245? True Is 685623 a multiple of 261? False Does 25 divide 36850? True Is 149 a factor of 224096? True Does 26 divide 3453008? True Does 14 divide 1684466? True Is 1326968 a multiple of 49? False Does 723 divide 10072836? True Does 85 divide 2890? True Is 9 a factor of 181281? False Is 20 a factor of 208900? True Is 536112 a multiple of 918? True Is 3242420 a multiple of 20? True Does 220 divide 86460? True Does 66 divide 1375214? False Does 12 divide 989280? True Is 628 a factor of 461580? True Does 3 divide 625491? True Is 13000573 a multiple of 212? False Does 3 divide 33455? False Does 68 divide 139974? False Does 5 divide 102719? False Does 87 divide 1987950? True Is 313 a factor of 309870? True Is 8030 a multiple of 11? True Is 100 a factor of 233100? True Is 83705 a multiple of 105? False Is 139 a factor of 205859? True Is 36 a factor of 314709? False	{ "pile_set_name": "DM Mathematics" }
277189, 399120? 543201 What is the next term in 20595, 20550, 20517, 20496, 20487, 20490, 20505? 20532 What is the next term in 3918, 8625, 14266, 20847, 28374, 36853? 46290 What is the next term in -35094, -70297, -105498, -140697, -175894, -211089? -246282 What is the next term in 4954688, 9909376, 14864060, 19818740, 24773416? 29728088 What is next in 648193, 648687, 650031, 652651, 656973, 663423, 672427, 684411? 699801 What is next in 1258, 1241, 1224, 1219, 1238? 1293 What is next in 3953, 7874, 11819, 15842, 19997? 24338 What comes next: -9896852, -9896858, -9896868, -9896882, -9896900, -9896922, -9896948? -9896978 What is the next term in -17812, -17678, -17316, -16612, -15452, -13722, -11308? -8096 What is the next term in -243, -9409, -34299, -82779, -162715, -281973, -448419? -669919 What is next in -621655, -2486324, -5594005, -9944698, -15538403, -22375120, -30454849? -39777590 What comes next: -32760, -262122, -884688, -2097060, -4095840, -7077630? -11239032 What comes next: 264536, 528563, 792590? 1056617 What is the next term in 15930, 16093, 16354, 16707, 17146, 17665? 18258 What is next in -537044, -2148208, -4833498, -8592926, -13426504, -19334244, -26316158, -34372258? -43502556 What comes next: -821, -5934, -19861, -47006, -91773, -158566, -251789? -375846 What is next in 2087, 9835, 22751, 40835, 64087, 92507, 126095? 164851 What is the next term in 51110730, 51110731, 51110732? 51110733 What is next in -819, -785, -805, -945, -1271? -1849 What is the next term in 5558348, 5558358, 5558368, 5558378? 5558388 What comes next: 658988, 658992, 658996? 659000 What comes next: -428, -1745, -3876, -6767, -10364, -14613, -19460, -24851? -30732 What comes next: 48403, 193574, 435513, 774208, 1209647, 1741818? 2370709 What is next in 138428, 276999, 415570, 554141? 692712 What is the next term in -38611876, -38611870, -38611864? -38611858 What is next in -4329, 13880, 32089, 50298, 68507? 86716 What is the next term in -970657, -970661, -970665? -970669 What is next in 1266, -269, -2828, -6411, -11018, -16649? -23304 What is the next term in -507357, -2029488, -4566373, -8118012? -12684405 What is next in 5258, 5526, 5800, 6080, 6366? 6658 What is the next term in 252815, 504491, 756167? 1007843 What comes next: -311, 1002, 4537, 11410, 22737, 39634? 63217 What is next in 18757980, 37515960, 56273940, 75031920, 93789900, 112547880? 131305860 What is the next term in 1996187, 1996183, 1996177, 1996169? 1996159 What comes next: 79191, 80311, 82177, 84789, 88147, 92251? 97101 What is the next term in 4865293, 9730580, 14595867, 19461154, 24326441? 29191728 What is next in -3300, -6920, -10878, -15174, -19808? -24780 What is next in 256345, 521311, 786265, 1051201, 1316113? 1580995 What is next in -1136478, -1136497, -1136518, -1136541? -1136566 What comes next: 4000, 31519, 106060, 251131, 490240, 846895, 1344604, 2006875? 2857216 What comes next: 12752, 13893, 15034, 16175, 17316? 18457 What is next in -208514, -207109, -204768, -201491, -197278, -192129, -186044? -179023 What is the next term in -3851473, -3851449, -3851425, -3851401, -3851377, -3851353? -3851329 What is next in -7770, -7767, -7758, -7737, -7698? -7635 What is the next term in 2886, 10087, 21604, 37437, 57586, 82051? 110832 What comes next: 3382722, 3382678, 3382634? 3382590 What is the next term in -838, -3740, -8742, -15844, -25046, -36348? -49750 What comes next: 698558, 1397076, 2095522, 2793860, 3492054, 4190068, 4887866, 5585412? 6282670 What is next in -3430807, -3430805, -3430803, -3430801, -3430799? -3430797 What comes next: 245, 1041, 2521, 4811, 8037, 12325, 17801? 24591 What comes next: 8366, 8582, 8794, 8990, 9158, 9286, 9362? 9374 What comes next: -291759, -579584, -867409, -1155234, -1443059, -1730884? -2018709 What is the next term in -3909, -4051, -4341, -4827, -5557, -6579? -7941 What is the next term in -5117520, -5117509, -5117484, -5117439, -5117368, -5117265? -5117124 What is next in -1953, -3965, -6049, -8205, -10433, -12733, -15105? -17549 What is the next term in -22157, -44327, -66479, -88619, -110753, -132887, -155027? -177179 What is the next term in -44206, -41941, -39674, -37405, -35134? -32861 What is the next term in 69467037, 69467035, 69467033? 69467031 What comes next: -30285, -29977, -29667, -29355, -29041? -28725 What is the next term in -3667741, -3667743, -3667745, -3667747? -3667749 What comes next: 246067, 492255, 738443, 984631? 1230819 What comes next: 5846, 6645, 7970, 9821? 12198 What comes next: -7675018, -15350007, -23024982, -30699937, -38374866? -46049763 What is the next term in 9509, 18696, 27515, 35966, 44049? 51764 What comes next: -346651, -1386548, -3119709, -5546134, -8665823, -12478776? -16984993 What is next in -688671, -2754564, -6197715, -11018124, -17215791, -24790716? -33742899 What comes next: -59763964, -59763975, -59763988, -59764003? -59764020 What is the next term in -5130, -10357, -15662, -21045, -26506, -32045? -37662 What is the next term in -73399, -73596, -73921, -74374, -74955, -75664? -76501 What comes next: -7465, -2981, 13457, 41855, 82219? 134555 What is next in 459441, 459535, 459629, 459723, 459817? 459911 What is next in -168800, -337754, -506708, -675662? -844616 What is next in -77786, -79322, -80858? -82394 What is the next term in -5610, -11196, -16962, -22992, -29370, -36180? -43506 What comes next: 1408, 11171, 37632, 89131, 174008, 300603, 477256? 712307 What is the next term in -147066, -294118, -441158, -588186, -735202, -882206, -1029198? -1176178 What is next in 98745, 197505, 296263, 395019, 493773, 592525? 691275 What is the next term in -240, -2452, -8566, -20532, -40300, -69820, -111042, -165916? -236392 What is the next term in 26174983, 26175044, 26175103, 26175160? 26175215 What comes next: -7679, -7536, -7309, -6998, -6603, -6124? -5561 What is next in -1318, -2986, -5772, -9670, -14674, -20778? -27976 What comes next: -1338, 250, 3636, 9720, 19402, 33582, 53160? 79036 What is the next term in -1800, -3358, -4652, -5682? -6448 What is the next term in 1493, 4683, 10001, 17453, 27045, 38783? 52673 What is next in 5061, 19601, 43617, 77109, 120077, 172521, 234441? 305837 What comes next: 7940, 7776, 7604, 7430, 7260, 7100? 6956 What comes next: -107411, -107228, -107045? -106862 What comes next: 65989, 131575, 240879, 393895, 590617, 831039, 1115155, 1442959? 1814445 What is next in 20316, 40630, 60954, 81294, 101656, 122046, 142470, 162934? 183444 What is the next term in -6369, -28007, -64071, -114561? -179477 What comes next: -152, 701, 1556, 2413, 3272? 4133 What is next in 430246, 430175, 430104, 430033, 429962, 429891? 429820 What is the next term in 204194, 215920, 227644, 239366, 251086, 262804? 274520 What comes next: 19311, 75438, 168985, 299952, 468339, 674146? 917373 What is next in -379, 711, 2629, 5375? 8949 What is the next term in 351476, 1405928, 3163348, 5623736? 8787092 What comes next: -274184, -548200, -822230, -1096280, -1370356, -1644464, -1918610, -2192800? -2467040 What is the next term in -14249444, -28498903, -42748376, -56997869, -71247388, -85496939, -99746528? -113996161 What comes next: 412494, 412733, 413128, 413679, 414386? 415249 What is the next term in 76865, 153559, 230253? 306947 What is next in 760, 841, 994, 1231, 1564, 2005? 2566 What is the next term in -19704, -40075, -60472, -80895? -101344 What comes next: 673, 2785, 6347, 11365, 17845? 25793 What is the next term in 903866933, 903866932, 903866931, 903866930? 903866929 What is the next term in 31761, 126864, 285365, 507264, 792561, 1141256? 1553349 What comes next: 142578, 284461, 426328, 568173, 709990, 851773, 993516? 1135213 What is the next term in -26435, -24433, -22431, -20429, -18427, -16425? -14423 What comes next: -13483002, -26966005, -40449008, -53932011? -67415014 What is next in 219553, 439119, 658685, 878251, 1097817? 1317383 What is next in -9867278, -9867277, -9867276? -9867275 What is the next term in 614, 2702, 7708, 17090, 32306, 54814? 86072 What is next in 6411913, 6411911, 6411909, 6411907, 6411905, 6411903? 6411901 What comes next: 304569, 304544, 304523, 304506? 304493 What comes next: -8582479, -8582477, -8582475, -8582473, -8582471, -8582469? -8	{ "pile_set_name": "DM Mathematics" }
204 What is 709 minutes after 9:21 AM? 9:10 PM How many minutes are there between 1:51 AM and 3:21 AM? 90 What is 488 minutes before 5:33 PM? 9:25 AM How many minutes are there between 10:19 PM and 6:43 AM? 504 What is 408 minutes before 5:58 PM? 11:10 AM How many minutes are there between 10:21 PM and 12:53 AM? 152 What is 2 minutes after 8:01 AM? 8:03 AM What is 605 minutes before 9:44 PM? 11:39 AM What is 402 minutes before 8:16 AM? 1:34 AM How many minutes are there between 3:04 AM and 7:47 AM? 283 What is 607 minutes before 5:20 AM? 7:13 PM How many minutes are there between 10:28 PM and 4:05 AM? 337 What is 456 minutes after 10:28 PM? 6:04 AM What is 488 minutes before 11:23 AM? 3:15 AM How many minutes are there between 3:48 PM and 4:51 PM? 63 What is 367 minutes after 12:36 AM? 6:43 AM What is 585 minutes before 2:23 AM? 4:38 PM How many minutes are there between 7:51 AM and 4:54 PM? 543 How many minutes are there between 4:36 AM and 5:58 AM? 82 What is 496 minutes before 12:37 AM? 4:21 PM What is 332 minutes after 6:22 PM? 11:54 PM What is 657 minutes after 7:49 AM? 6:46 PM How many minutes are there between 3:23 PM and 12:53 AM? 570 How many minutes are there between 4:36 PM and 9:22 PM? 286 What is 10 minutes before 2:27 PM? 2:17 PM How many minutes are there between 3:27 AM and 12:19 PM? 532 What is 385 minutes before 6:34 PM? 12:09 PM How many minutes are there between 9:05 PM and 7:21 AM? 616 What is 543 minutes after 9:45 AM? 6:48 PM How many minutes are there between 7:26 PM and 6:58 AM? 692 What is 142 minutes after 3:26 PM? 5:48 PM How many minutes are there between 3:58 AM and 11:59 AM? 481 What is 159 minutes after 1:14 PM? 3:53 PM What is 386 minutes after 3:00 PM? 9:26 PM How many minutes are there between 8:44 AM and 8:06 PM? 682 How many minutes are there between 4:59 PM and 10:24 PM? 325 How many minutes are there between 11:23 PM and 12:04 AM? 41 What is 231 minutes before 5:52 AM? 2:01 AM How many minutes are there between 7:51 PM and 1:46 AM? 355 How many minutes are there between 8:48 AM and 8:13 PM? 685 What is 634 minutes after 4:49 AM? 3:23 PM How many minutes are there between 2:25 PM and 3:54 PM? 89 How many minutes are there between 4:22 PM and 12:59 AM? 517 What is 564 minutes after 4:56 AM? 2:20 PM How many minutes are there between 3:46 PM and 2:48 AM? 662 What is 399 minutes before 4:52 PM? 10:13 AM What is 458 minutes after 9:49 PM? 5:27 AM How many minutes are there between 8:57 PM and 7:59 AM? 662 How many minutes are there between 1:07 PM and 7:55 PM? 408 How many minutes are there between 4:47 PM and 11:12 PM? 385 How many minutes are there between 7:38 AM and 6:09 PM? 631 What is 524 minutes before 2:06 AM? 5:22 PM How many minutes are there between 5:57 PM and 5:36 AM? 699 How many minutes are there between 12:57 AM and 8:01 AM? 424 How many minutes are there between 6:08 PM and 6:56 PM? 48 What is 616 minutes before 5:07 PM? 6:51 AM What is 203 minutes before 5:07 PM? 1:44 PM How many minutes are there between 12:29 PM and 2:35 PM? 126 How many minutes are there between 11:09 AM and 3:43 PM? 274 How many minutes are there between 8:59 AM and 8:31 PM? 692 What is 63 minutes before 5:49 AM? 4:46 AM What is 456 minutes before 11:07 AM? 3:31 AM How many minutes are there between 12:25 PM and 4:34 PM? 249 What is 628 minutes after 7:42 AM? 6:10 PM What is 115 minutes before 7:38 AM? 5:43 AM How many minutes are there between 11:52 PM and 10:39 AM? 647 What is 559 minutes before 5:37 AM? 8:18 PM How many minutes are there between 8:55 PM and 7:58 AM? 663 What is 454 minutes after 6:02 AM? 1:36 PM How many minutes are there between 7:38 AM and 6:22 PM? 644 How many minutes are there between 9:06 AM and 12:35 PM? 209 What is 260 minutes after 10:42 AM? 3:02 PM How many minutes are there between 5:08 PM and 4:30 AM? 682 What is 404 minutes after 9:40 PM? 4:24 AM How many minutes are there between 8:19 AM and 2:44 PM? 385 What is 320 minutes after 3:41 PM? 9:01 PM How many minutes are there between 4:58 AM and 6:39 AM? 101 How many minutes are there between 3:55 AM and 9:05 AM? 310 How many minutes are there between 7:14 AM and 5:03 PM? 589 How many minutes are there between 7:52 PM and 7:54 PM? 2 What is 552 minutes before 5:45 PM? 8:33 AM What is 669 minutes after 11:23 PM? 10:32 AM What is 126 minutes after 8:58 PM? 11:04 PM How many minutes are there between 12:33 AM and 2:49 AM? 136 What is 49 minutes after 12:21 AM? 1:10 AM What is 588 minutes after 10:58 AM? 8:46 PM How many minutes are there between 5:16 PM and 4:49 AM? 693 How many minutes are there between 12:39 PM and 5:43 PM? 304 How many minutes are there between 12:49 PM and 9:12 PM? 503 How many minutes are there between 10:03 AM and 6:55 PM? 532 What is 480 minutes before 9:25 AM? 1:25 AM How many minutes are there between 4:14 PM and 3:23 AM? 669 What is 559 minutes before 3:57 PM? 6:38 AM What is 9 minutes before 11:27 PM? 11:18 PM What is 493 minutes before 5:35 AM? 9:22 PM What is 322 minutes before 3:09 PM? 9:47 AM What is 207 minutes before 6:49 AM? 3:22 AM What is 679 minutes after 3:20 AM? 2:39 PM What is 252 minutes before 3:29 AM? 11:17 PM How many minutes are there between 9:20 PM and 11:41 PM? 141 What is 707 minutes after 12:49 AM? 12:36 PM How many minutes are there between 5:20 PM and 8:06 PM? 166 What is 705 minutes before 5:20 PM? 5:35 AM How many minutes are there between 7:04 PM and 10:31 PM? 207 How many minutes are there between 1:40 AM and 12:03 PM? 623 What is 585 minutes after 12:13 AM? 9:58 AM How many minutes are there between 1:55 PM and 3:55 PM? 120 What is 490 minutes before 2:59 PM? 6:49 AM What is 209 minutes before 6:23 PM? 2:54 PM What is 549 minutes before 10:44 AM? 1:35 AM How many minutes are there between 7:32 AM and 9:04 AM? 92 What is 508 minutes before 4:45 AM? 8:17 PM What is 25 minutes before 9:36 AM? 9:11 AM What is 315 minutes after 11:56 AM? 5:11 PM What is 253 minutes after 10:48 AM? 3:01 PM How many minutes are there between 10:41 AM and 12:03 PM? 82 How many minutes are there between 12:18 AM and 8:08 AM? 470 What is 251 minutes after 5:21 AM? 9:32 AM How many minutes are there between 10:44 AM and 8:25 PM? 581 What is 89 minutes after 12:22 AM? 1:51 AM What is 71 minutes after 8:42 PM? 9:53 PM How many minutes are there between 2:15 PM and 10:25 PM? 490 What is 505 minutes after 8:25 PM? 4:50 AM What is 439 minutes after 10:45 AM? 6:04 PM How many minutes are there between 6:07 AM and 12:41 PM? 394 What is 502 minutes before 12:23 PM? 4:01 AM How many minutes are there between 2:09 PM and 1:36 AM? 687 What is 41 minutes after 4:19 PM? 5:00 PM What is 418 minutes before 1:48 AM? 6:50 PM What is 320 minutes before 9:23 AM? 4:03 AM What is 584 minutes after 4:34 AM? 2:18 PM How many minutes are there between 4:05 PM and 5:37 PM? 92 How many minutes are there between 2:12 PM and 5:18 PM? 186 How many minutes are there between 8:33 PM and 10:04 PM? 91 What is 481 minutes after 7:58 PM? 3:59 AM What is 313 minutes after 6:14 AM? 11:27 AM What is 141 minutes after 1:34 AM? 3:55 AM How many minutes are there between 12:42 AM and 9:27 AM? 525 What is 360 minutes after 10:43 AM? 4:43 PM What is 324 minutes after 4:15 AM? 9:39 AM How many minutes are there between 2:42 PM and 6:56 PM? 254 What is 572 minutes before 2:20 PM? 4:48 AM How many minutes are there between 9:21 PM and 5:09 AM? 468 What is 11 minutes after 6:06 AM? 6:17 AM How many minutes are there between 11:11 AM and 2:38 PM? 207 What is 641 minutes before 10:31 PM? 11:50 AM How many minutes are there between 3:13 AM and 5:20 AM? 127 How many minutes are there between 2:39 PM and 4:30 PM? 111 How many minutes are there between 4:47 PM and 3:59 AM? 672 What is 508 minutes before 7:20 AM? 10:52 PM How many minutes are there between 4:29 AM and 7:15 AM? 166 How many minutes are there between 1:20 AM and 6:29 AM? 309 How many minutes are there between 8:37 PM and 4:02 AM? 445 How many minutes are there between 1:43 AM and 3:50 AM? 127 How many minutes are there between 5:20 PM and 10:42 PM? 322 How many minutes are there between 6:32 AM and 3:30 PM? 538 What is 130 minutes after 12:12 AM? 2:22 AM How many minutes are there between 5:21 AM an	{ "pile_set_name": "DM Mathematics" }
e 246 + 90 = 14c. Which is smaller: c or g? g Let j = 1621 - 1611.456. Let d = j + 0.456. Which is smaller: d or -1/2? -1/2 Let b = -93 + 97. Let g = 10.9455 + 0.0045. Let q = g - 11. Is b greater than q? True Suppose -11k + 8k - 22758 = 2c, -2c + 6 = 0. Which is smaller: k or -7587? k Let z be (-267)/273 - 2/(-7). Let c be 6(3 - (-21)/(-6))-9. Let y be (5 - 129/c)9 - 4. Which is smaller: y or z? y Let c = 39.741 + 0.259. Let u = -11 - -11.1. Is u >= c? False Let b(k) = 36k - 12. Let l be b(5). Let i = l - 110. Are 58 and i non-equal? False Let k be (-8)/28 + 0 + (-1550)/(-35). Suppose -215q + 226q - k = 0. Which is smaller: q or 9? q Let o = 80.4 - 80.2. Which is greater: 0.1851 or o? o Let w be 751-1. Let p be (-8 - 12)18/10. Is p < w? True Let r = -31029/4 + 7778. Suppose -4c + 60 = -c. Which is greater: c or r? r Suppose 56 = 19j + 20 + 17. Is j <= -4/13553? False Let n be (-601)/5 + (-20)/(-100). Let u = 121 + n. Which is smaller: 5 or u? u Let n = 160 - 159.966. Let t = n + -0.234. Are t and 0.006 equal? False Let c = 77407/82 - 944. Let m = c - -87/410. Which is bigger: m or 8? 8 Let h = 43 + 50. Let d = 97 - h. Which is greater: d or 2/19? d Let w = -398403/11 - -36053. Which is greater: w or -166? w Let u be (2 - 4) + (-1736)/14. Let q = -122 - u. Is -1 at most q? True Let z be (-3377309)/(-4302) + (-6)/4. Is z > 784? False Let m be (-1 + 25/(-20))(-30)/711. Which is smaller: m or -1? -1 Let c = 35 + 72. Suppose -640 = -5d - n, -d + c = -0d - 4n. Suppose 5o - 3y - 253 + 101 = 0, d = 4o + 3y. Is 0 <= o? True Let m(f) = -f3 + 20f*2 - 90f - 13. Let a be m(7). Let z(u) = -u*3 - 10u*2 - 23u - 38. Let g be z(a). Which is smaller: -298/7 or g? g Suppose -1452 = -11f + 2376. Is 348 > f? False Let r = -2287 + 2288.53. Which is smaller: r or 5? r Let c = 3420 + -3416. Suppose u + 2 = 3. Let p be u/(-2)-32. Which is greater: p or c? c Let l = -3919 - -1449. Is -2470 greater than l? False Let r be ((-1)/(-66))/((-23)/46)(-4)/134. Is 1 at least r? True Suppose -9 - 9 = 2n - 4q, 17 = -3n + 4q. Which is greater: n or -9/2764? n Let i = 76 - 71. Suppose -x - x - 14 = j, -86 = 3j - ix. Let w(n) = -2n3 + 22n*2 - n - 14. Let p be w(11). Is p greater than or equal to j? False Suppose -3z - 5m + 0m - 9 = 0, z = -m - 1. Suppose -zu - 2l + 1 = 3l, 11 = 2u - 5l. Let h = -1 + 6. Which is smaller: u or h? u Let j = 724/27 + -22471/837. Suppose -4c + 3t = 17, 2c + 30 = -3c + 2t. Let u be 4-12/c. Which is bigger: j or u? u Let f = 1858 - 1479. Is f equal to 381? False Let d = -0.6453 + -24.5547. Which is smaller: 3/7 or d? d Let o = 5279 + -26392/5. Does -522 = o? False Let d be (2/(-23))/((-12)/4). Is d >= 3.2? False Let x = 15 + -4. Let u = x + -7. Suppose 0f - 3 = g - f, 5g = -uf + 21. Which is bigger: g or 1/27? g Let g(t) = -679t + 589. Let k be g(1). Is k at least 0.103? False Let c(n) = 2n - 62. Let q be c(32). Let w be ((-1463)/(-165) - 9)/(q/(-3)). Which is smaller: 44 or w? w Let d = 102 + -42. Let p be 196/490 + 18/5. Suppose pn - 218 = 30. Is n equal to d? False Suppose k = -k - 3j - 1, 0 = 5k + 4j - 15. Suppose -2s + 26 = -4x, 9 + k = 4s + 4x. Suppose 0q - 77 = sq. Is -11 > q? False Let u be -52445/15-2. Let j be 2/12u/138. Which is smaller: 0.1 or j? 0.1 Let n(t) = t*3 - 10t*2 + 8t + 9. Suppose -11b + 8b + 252 = 0. Let r be 12(b/(-16))/(-7). Let k be n(r). Is k equal to 2/57? False Let s = -0.03325 + -5.96675. Let b = -3 + 1. Which is smaller: s or b? s Let q(u) = 3u*2 + 3u. Let j be q(5). Let f(l) = -48l2 + 1776l + 30. Let x be f(37). Let y be (-32)/j - (-10)/x. Is y at least 0? False Let r = 8784 - 12402. Which is smaller: -3616 or r? r Let j be 3822/7 + -8 + -7. Is j != 528? True Let t = -196 + 243. Is t at most 50? True Let m(u) = -5u - 25. Let w be m(-9). Suppose -t + g = -2, 4g + w + 6 = -2t. Does t = -4? False Let o = 261 + -56. Let q be o/10 + 6/(-12). Which is smaller: 23 or q? q Let n(a) = 32a + 23. Let x be n(-9). Let h = x - -268. Is h at most as big as 16? True Let j(i) = i*3 - 48i*2 - 41i - 666. Let f be j(54). Is 14616 at least f? True Suppose -4v + 2j + 1040 = v, -1060 = -5v - 2j. Let d = 182 - v. Are d and -32 non-equal? True Let p = -1824 + 1827. Which is smaller: 239 or p? p Let c(m) = -m*3 + 23m*2 + 118m + 78. Let d be c(29). Which is bigger: d or -3091/2? -3091/2 Suppose 5m + 4f = 94, 17 = m - 8f + 7f. Suppose -3v - mv + 63 = 0. Is 0 smaller than v? True Let y = -791 - -790. Are y and -3/443 equal? False Let n(y) = -2y2 + 33y - 16. Let u be n(16). Let r = -6101/31 - -17107012/86955. Let b = -2/33 - r. Are b and u non-equal? True Suppose 135 = -16w + 70 + 49. Which is greater: -5/1512 or w? -5/1512 Let n = 373 - 131. Let o = n + -95. Suppose 0 = 3p + 2b - 151, -4p + o = 5b - 52. Is 51 greater than or equal to p? True Suppose 27y = -676 - 1572 - 479. Which is smaller: y or -1314/13? -1314/13 Let y(w) be the first derivative of -2w3 + 4w*2 + 4w + 16. Let z be y(4). Let o be (252/z)/(1/5). Is -21 > o? False Suppose 87q = 21q. Which is greater: q or 9/2239? 9/2239 Let g = 69 - 60. Let p be 5/g20/50. Let i(b) = 3b*2 - 8b - 3. Let o be i(3). Is o greater than or equal to p? False Let f(a) = -a*2 - 26a - 1. Let d be f(-26). Let r be 8/(-28) - 1/((-14)/(-136)). Let p be -12/r + (-4)/220. Is p less than or equal to d? False Let k be (-30)/((-6)/3) + 0. Let g be ((-6)/k)/((-6)/(-10))-72. Let j = g + -48. Which is greater: j or -2/21? j Let b be ((-63)/(-168))/(-9 + (-47370)/20). Which is greater: 0 or b? 0 Let s = 6748 + -9088. Which is smaller: s or -2/11? s Let p be (-4346)/714 + (88/(-11))/40. Let m = 2/1785 + p. Is m greater than -6? False Suppose 13 = 2c - 5a, 3a = -3c + 6a + 15. Let i be (-8)/(-14) - c/7. Let m = i + -1/13. Is m at least 1? False Let q = 821 + -901. Let f be (-360)/q8/7146. Which is smaller: f or -1? -1 Let f(s) = -s + 20. Let z be f(17). Suppose -4 = -5w + 11, 40 = -u + zw. Suppose -4t + m - 114 = -m, 0 = -t + 4m - 18. Do u and t have different values? True Let a = 113447/6 + -18907. Let b = 18.92 + -28.8. Let v = -0.12 + b. Is v at most a? True Let r = 367 + -253. Suppose 3p + 3p = r. Let d(b) = b*3 - 18b*2 - 18b - 18. Let w be d(p). Do w and 2/11 have the same value? False Let p = 206 - 207. Let a(c) = -11c + 12. Let x be a(p). Which is smaller: x or 27? x Let w be (5 + -3 + -3)-5. Suppose -4s - 4g + 3g + 45 = 0, -ws - 5g + 60 = 0. Let i = -341 + 341. Is i at least s? False Let f(r) = -3r + 42. Let c be 3 + -4 - (-8)/((-16)/(-30)). Let q be f(c). Let y = 499 + -6477/13. Which is bigger: y or q? y Let h = -1337 + 1444. Does h = 106? False Suppose -3z - c - 3c + 49 = 0, -3z + 5c + 40 = 0. Suppose 6f = -f - 28. Let q be (-4)/114/f. Is z at least q? True Suppose -167 - 205 = 4t. Let j = t + 106. Let r be (-2)/2(6 - j - -2). Which is bigger: 1/4 or r? r Suppose 5q - 5l - 5 = 0, 17404q = 17406q + l + 4. Let z be 1 - (-1 + 149/70). Which is smaller: q or z? q Suppose 18 = 2g + 28. Let i = g + 23/4. Do i and 8 have the same value? False Let p = 17569.172 - 17576. Which is bigger: p or 2/7? 2/7 Let l = 510.319 + -512. Let f = 5.149 - l. Let v = -0.17 - f. Which is greater: 3 or v? 3 Let c(k) = 7k - 97. Let p be c(14). Which is bigger: 8/71 or p? p Let u be ((-222)/18 + 9)/(48/9). Which is greater: u or -1? u Let z be 76 - 8/12(-18)/(-4). Let j = 17 - z. Let q = 56 + j. Which is bigger: q or -3/49? q Let w be 2/124/(-42)-7. Let g(c) = c3 + c2 + 19. Let y be g(0). Is w less than or equal to y? True Suppose 6g - 50 = -4b + 8g, -b - 4g + 8 = 0. Let z be b/((-2)/(24/9)). Is z bigger than 0.1? False Let v = 191.107 + -12.107. Is 12 equal to v? False Let a be 3 - (7 - 9919/(-35) - 6). Is -281 at most a? False Let i(l) = l2 - 7l + 9. Let j be i(4). Let v be j/(-501)-338 - (0 + -2). Which is smaller: v or 0? v Let o = 2006 + -2035. Which is greater: o or -30? o Let l = 116 + -115.91. Let a = 23.4 + -16.4. Does l = a? False Let m be 2/(-17) + (-954)/(-306). Suppose 3k + mg = 12, -g - g + 4 = -2k. Do k and -1/200 have the same value? False Let k = 4493 + -5975. Which is smaller: -4 or k? k Let p = 793 + -716.8. Let v = p - 34.9. Le	{ "pile_set_name": "DM Mathematics" }
84. Calculate the lowest common multiple of p and 1. 21 Suppose 2h + 22 = 4h. Find the common denominator of 7/215/h and 0 - 3 - 31/(-16). 176 Let c(g) = -1259g*2 + 2g + 1. Let r be c(-1). Let f = r + 12721/10. Find the common denominator of 151/48 and f. 240 Let r = 165 - 341/2. What is the common denominator of 145/6 and r? 6 What is the least common multiple of 5 and (-704)/(-72) - (-2)/9? 10 What is the common denominator of (-3)/(-24)-3-1 and (-10)/45 + 214/(-36)? 24 Let n = 394 + -76. Calculate the common denominator of -5/16 and (-2)/4n/18. 48 Suppose 4c + 3d - 1934 = 200, -3d = -5c + 2654. Let i be (-6)/448/c. Let l = 7793/399 - i. Find the common denominator of -40/11 and l. 33 Let w = 6 - 12. What is the common denominator of -25/2 and 47/(-15)w/(-8)? 20 Suppose -3b = 2f + 8, 3b + 2 = 5f + 5b. Let m be (3 + -1)/((-3)/3). Let x(o) = -5o - 2. Calculate the smallest common multiple of x(m) and f. 8 Suppose j - 9 = -2s, 5j - j - 2s = -4. Find the common denominator of (42/20)/(j/2) and -56/5. 5 Suppose 4q + 1 - 57 = 0. What is the common denominator of 20/14 + 3/(-6) and (7 + -2)5/q? 14 Let f be -1 - (-1 - (-1990)/(-1392)). Let l = 3017 + -699947/232. Let z = l + f. What is the common denominator of z and -21/22? 132 Suppose l + 2 = -2g, 2g + 10 = -5l + 3g. Let n be ((-4)/(-8))/(l/(-52)). Let u = 23 - n. What is the lowest common multiple of u and 20? 20 Suppose 48 = 4u - 0. Let o be (5/5)/(1/u). What is the common denominator of -17/5 and o/(-54)(-41)/(-2)? 45 Let g(w) = -w*2 - 4w - 1. Let j be g(-4). Let c be (-1)/(-1(j - -2)). Calculate the lowest common multiple of 4 and (-2)/6(c + -4). 4 Calculate the common denominator of ((-963)/(-198))/(3 + -1) and 47/40. 440 Suppose 3q + 3w = -15 + 3, 0 = -2q + 5w + 27. Calculate the common denominator of q/(-6) + 438/(-36) and 4. 3 Calculate the smallest common multiple of 1 and 13/(-52) + 213/4. 53 Suppose -49 + 4 = 3f. What is the lowest common multiple of ((-48)/(-15))/((-3)/f) and 4? 16 Let n = -4 + 1. Let b = n + -73/2. Calculate the common denominator of b and 3/8. 8 Let v be 9869(-154)/(-69612) + -1. Let z = v + 3/5801. Calculate the common denominator of z and (-2 - 70/18)-1. 18 Let l = 29269/8 + -3654. Suppose -431 = 9i - 35. What is the common denominator of i and l? 8 Let i = -2486759/10 - -247714. Let h = -961 - i. Find the common denominator of h and 137/6. 30 Let z = -41/24 + 93/8. What is the common denominator of z and -77/6? 12 Let i(h) be the third derivative of h6/120 + h5/20 - h*4/6 + 2h3/3 + h2. Calculate the smallest common multiple of 3 and i(-4). 12 Let i = 13/14 - 1. Let v = -166/11 + 1073/66. Find the common denominator of i and v. 42 Calculate the smallest common multiple of 12 and (45/20)/((-15)/(-100)). 60 Let v = -23733/101 - 23691101/1818. Let t = v + 13262. Calculate the common denominator of t and 4/(-10) + 241/40. 72 Let z be -4 - -6 - -11. Suppose -zd + 12 = -d. What is the lowest common multiple of d and 22? 66 Let y = 53/9 + 148/9. Calculate the common denominator of y and -18/5. 15 Suppose 4z - 16 = i, -6 = -2z + 4. Let p be 4 + i/(3 - 5). Suppose -p - 6 = -2n. What is the smallest common multiple of n and 2? 4 Suppose -4z - 3n + 49 = 0, 6 + 1 = z - n. Calculate the lowest common multiple of 8 and z. 40 Suppose 4s - 80 = -0s. Calculate the common denominator of -41/5 and 19/s(-3 - -5). 10 Calculate the common denominator of -2 + 4 + 786/36 and (-32)/1010/20. 30 Let c = 4937/24 - 1163/6. Let s = 167/22 - 210/11. Find the common denominator of c and s. 8 Let a be -2 - (-2 - (-14566)/96). Let l = 895/6 + a. What is the common denominator of 0 - (-129)/10 - 1 and l? 80 Let x = -369779/11 + 33561. Let o = x - -584/11. Calculate the common denominator of 53/3 and o. 33 Let h = -28 + 19. Let w(r) = 2r*2 + r + 10. Calculate the least common multiple of w(2) and 164/9 - (-2)/h. 180 Suppose 0b + 22 = b. What is the common denominator of 73/6 and 734/(-44) + 4/b? 6 Suppose d + 789 = 2d. Let c be 1/(((-6)/d)/2). What is the common denominator of c/(-48) + 4/12 and 5/18? 144 Suppose 4m - 9m = -115. Let h(q) = -q3 + 4q*2 + 6q + 6. What is the smallest common multiple of m and h(5)? 253 Let r = -2 + 4. Let v be (-14)/6-3 - r. Suppose i + 48 = vi. What is the smallest common multiple of 16 and i? 48 Suppose a + 2b = -1, 0b + 3b = 0. Calculate the common denominator of 113/6 and (a - -3)/(21/(-57)). 42 Let o(d) = -d2 - 2 + 2d - 2 - 11d. Calculate the least common multiple of 4 and o(-7). 20 Suppose 21s + 2 = 23s. What is the smallest common multiple of s and 50? 50 Let u be (-33)/77 + (-599678)/126. Let w = u + 4752. Let j = 2263/55 + -213/5. What is the common denominator of w and j? 99 Suppose -250 = -2q - 8q. What is the lowest common multiple of 10 and q? 50 Suppose 0 = 2n + 2n + 12. Let d(i) = i2 + i + 2. What is the lowest common multiple of 7 and d(n)? 56 Let x = -4/733 + -69563/13194. Let q be 20901/783 + (-2)/9. Let b = 5/174 + q. What is the common denominator of b and x? 18 Suppose 5z = -0z + 40. What is the least common multiple of z and 20? 40 Let g = -9753 + 136607/14. Find the common denominator of -13/6 and g. 42 What is the smallest common multiple of (-12)/(-2)(-12)/(-9) and 10? 40 Suppose -3j = 3x + 24, -2x + 5 - 3 = 0. Suppose z = -z + 6. What is the smallest common multiple of z and 3/j + 52/12? 12 Let m = -8 - -14. What is the lowest common multiple of m and 22? 66 Suppose -3w = -5w - 7244. Let v = w - -36133/10. Calculate the common denominator of (-279)/240 - 2/5 and v. 80 Let l be 3/((-12)/(-4)) - 0. What is the common denominator of -43/16 and -3 + l - 430/(-20)? 16 Suppose 8c - 30 = 3c. What is the lowest common multiple of 26 and c? 78 Let t = -675/52 - -81/13. What is the common denominator of 57/22 and t? 44 Let m = 120 - 112. Calculate the smallest common multiple of m and 8. 8 Let z be 2/34426512/33. Let g = z + -2/473. What is the common denominator of g and 14(32/(-30) + 1/(-10))? 3 Find the common denominator of ((-77)/14)/(4/5) and 2/(-3) + (-91)/3. 8 Calculate the least common multiple of 12 and (55/10 - 6)/((-1)/228). 228 Suppose 0 = -2m - 0m + 4s + 118, -2m = s - 108. Let c = -18737/1544 + 2/193. Calculate the common denominator of c and 1 + 0 - m/(-6). 24 Let n(x) be the second derivative of 2x*3/3 + 2x. What is the lowest common multiple of n(2) and 16? 16 Suppose 2s = -s + 3. Let l = 44339/12 + -3697. What is the common denominator of (s - 91)2/56 and l? 84 Let o = 34541/2 + -16868. Let h = o - 371. What is the common denominator of -57/10 and h? 10 Let g(c) = c - 7. Let w be g(5). Calculate the common denominator of w/7 - 429/(-56) and (-4 - 53/(-14))/((-12)/(-388)). 56 Let g = -4527/4 + 1143. Find the common denominator of -76/3 and g. 12 Suppose 206 = -3t - 547. Let i = -139 - t. Find the common denominator of i/6 - (-4)/6 and -24/7. 21 Suppose 0 = -5k - 22 + 2. Let f be (-2 + 4)/(k/(-6)). Suppose 9 - 33 = -r + 5q, -2r = fq - 22. Calculate the smallest common multiple of r and 20. 140 Let i(s) = -3s - 7. Let j be i(-6). Suppose 31 = 5x + j. Suppose 9o = xo + 20. Calculate the least common multiple of o and 14. 28 Calculate the common denominator of -97/16 and (-357)/12 - (-4)/((-32)/6). 16 Let x be 326/14 - (-4)/(-14). Let k(a) = 3a*3 + 2a*2 - a. Calculate the least common multiple of k(1) and 1/(-1) - -1x. 44 Let m be (4093(-33)/6)/5. Let g = m - -4513. Find the common denominator of g and 23/2. 10 Let c(s) = 2s*3 + 2s. Let k be c(-4). Let o be k/14 + (-12)/42. Calculate the smallest common multiple of 10 and (-15)/312/o. 30 Suppose -d - 3 = 0, -4o - 1534 = -5d + 3423. Let n = o + 2575/2. Let c = -2924 + 32203/11. What is the common denominator of c and n? 22 What is the common denominator of (-2)/(-16) + (-105)/(-72) and -27/2? 12 Let f(b) = 6b*2 - b - 1. Let r = -16 + 10. Let o be (4/r)/(12/18). Calculate the lowest common multiple of 6 and f(o). 6 Suppose -2h - 2h + 66712 = -w, -h + 2w = -16678. Let x = 199985/12 - h. Find the common denominator of (6/45)/((-24)/(-430)) and x. 36 Suppose -4c - 5 = 7. Let g = c + 3. Suppose g = 4a - 7 - 5. What is the least common multiple of a and	{ "pile_set_name": "DM Mathematics" }
False Is 17519 composite? False Is 225689 composite? False Is 61211 prime? True Is 1117883 a composite number? True Is 44537 prime? True Is 57751 a prime number? True Is 137957 composite? False Is 19777 prime? True Is 47737 a composite number? False Is 77327 prime? False Is 37841 prime? False Is 6767 a composite number? True Is 24142 prime? False Is 107951 a prime number? True Is 12403 a prime number? False Is 74557 a prime number? False Is 101267 prime? True Is 15439 composite? False Is 26171 composite? False Is 3163 composite? False Is 118189 a composite number? False Is 5801 composite? False Is 245194 a prime number? False Is 1910149 a prime number? False Is 140347 composite? True Is 538903 a prime number? False Is 5981 composite? False Is 16057 composite? False Is 291 prime? False Is 45379 prime? False Is 27011 prime? True Is 578903 a composite number? True Is 92623 a composite number? False Is 26101 a prime number? False Is 54301 prime? False Is 127 prime? True Is 385129 a composite number? False Is 1943 a composite number? True Is 2867467 prime? True Is 4373 a composite number? False Is 34373 a composite number? True Is 24449 a composite number? True Is 139141 composite? True Is 1665007 composite? False Is 34147 prime? True Is 9259 a composite number? True Is 9073 a prime number? False Is 87839 composite? True Is 153967 a prime number? False Is 333386 composite? True Is 32961 a prime number? False Is 2151497 a prime number? True Is 77533 a composite number? True Is 33457 prime? True Is 3696769 a composite number? True Is 805479 a prime number? False Is 8039 composite? False Is 6437141 prime? True Is 4271 a composite number? False Is 20071 composite? False Is 50357 a composite number? True Is 1598999 composite? False Is 547 a composite number? False Is 21487 composite? False Is 477259 prime? True Is 50891 a prime number? True Is 951703 a composite number? True Is 41281 a composite number? False Is 134813 prime? False Is 3761 composite? False Is 129637 composite? True Is 49089 composite? True Is 2491 composite? True Is 181657 prime? False Is 846033 prime? False Is 51278 composite? True Is 8861 composite? False Is 9041 a prime number? True Is 31469 composite? False Is 17783 prime? True Is 14143 composite? False Is 7134079 composite? False Is 321001 prime? False Is 4049 prime? True Is 14054 a composite number? True Is 1574 composite? True Is 25867 composite? False Is 479023 composite? False Is 181157 composite? False Is 1043831 prime? True Is 28349 a composite number? False Is 29269 a prime number? True Is 469 a composite number? True Is 2897 prime? True Is 19121 a prime number? True Is 112097 a prime number? True Is 94679 a composite number? True Is 392043 a prime number? False Is 16145 a prime number? False Is 6997 a prime number? True Is 389 composite? False Is 253307 composite? False Is 2669 a composite number? True Is 143483 composite? False Is 105107 composite? False Is 208055 a prime number? False Is 546781 composite? False Is 4751 a composite number? False Is 7094 a prime number? False Is 111143 a composite number? False Is 578489 composite? False Is 730187 composite? False Is 14519 composite? False Is 27527 a composite number? False Is 299 a composite number? True Is 32603 composite? False Is 4583 prime? True Is 202661 a prime number? True Is 37811 a composite number? False Is 220769 composite? True Is 513965 a composite number? True Is 5623 a prime number? True Is 10111 a prime number? True Is 4846 a composite number? True Is 4637 a composite number? False Is 606737 composite? False Is 2567 a prime number? False Is 161193 composite? True Is 178617 prime? False Is 1251827 a prime number? True Is 2921 a prime number? False Is 32605 prime? False Is 683881 a prime number? False Is 444551 composite? True Is 5449 composite? False Is 437479 a composite number? True Is 70169 prime? False Is 2771 a prime number? False Is 167897 composite? True Is 14051 composite? False Is 242021 a composite number? True Is 14437 composite? False Is 56273 prime? False Is 1209001 prime? False Is 7921 a composite number? True Is 54737 a composite number? True Is 464069 composite? False Is 465581 prime? True Is 1117 prime? True Is 413 a prime number? False Is 139687 composite? True Is 3233 composite? True Is 2039 a prime number? True Is 649 prime? False Is 753 a prime number? False Is 428195 a prime number? False Is 6353 a composite number? False Is 51043 a composite number? False Is 89867 a composite number? False Is 635 a composite number? True Is 27319 composite? True Is 3085 a composite number? True Is 105407 a prime number? True Is 171991 a prime number? False Is 73663 composite? True Is 36149 prime? False Is 102814 a composite number? True Is 2861 a composite number? False Is 478615 prime? False Is 329689 a prime number? False Is 3681067 a prime number? False Is 8997 a composite number? True Is 4976133 a composite number? True Is 8663 a prime number? True Is 2021 a prime number? False Is 241673 composite? True Is 138551 prime? False Is 39826 composite? True Is 106705 a prime number? False Is 2590399 prime? False Is 42947 prime? False Is 19919 composite? False Is 458 prime? False Is 2567101 a composite number? True Is 1087 a prime number? True Is 259933 a composite number? False Is 17211 prime? False Is 63197 prime? True Is 44771 a composite number? False Is 3683 a composite number? True Is 2833 a composite number? False Is 65783 a prime number? False Is 1733 a composite number? False Is 120349 composite? False Is 3941 prime? False Is 247951 a prime number? False Is 62383 composite? False Is 2933 a prime number? False Is 8147 a composite number? False Is 141907 a prime number? True Is 467239 composite? False Is 192563 a prime number? False Is 131314 a composite number? True Is 137179 prime? False Is 53569 prime? True Is 89363 prime? True Is 82661 a prime number? False Is 17707 a prime number? True Is 80741 a prime number? False Is 5311 prime? False Is 635 a prime number? False Is 108809 a prime number? False Is 92135 prime? False Is 49303 composite? True Is 93289 composite? True Is 49222 a prime number? False Is 62435 prime? False Is 52645 a composite number? True Is 1611699 a composite number? True Is 188351 prime? True Is 1678 composite? True Is 5411 a composite number? True Is 15679 prime? True Is 7941 prime? False Is 13021 composite? True Is 23771 a prime number? False Is 701177 composite? False Is 9337 a prime number? True Is 6247 a prime number? True Is 1427999 prime? True Is 2923 composite? True Is 3901 prime? False Is 601739 composite? True Is 402197 a prime number? True Is 213377 composite? True Is 55889 composite? False Is 421559 a composite number? False Is 4550347 a composite number? False Is 25523 composite? False Is 485893 prime? True Is 57473 a composite number? True Is 2025539 a composite number? False Is 1663579 a composite number? False Is 2306327 composite? False Is 386761 composite? True Is 9773 a prime number? False Is 187597 composite? False Is 186931 composite? True Is 79031 composite? False Is 422537 prime? True Is 1923 a prime number? False Is 23713 a prime number? False Is 109331 a prime number? True Is 5333 a prime number? True Is 2174 a prime number? False Is 224689 a composite number? True Is 26121 composite? True Is 1413487 prime? True Is 621239 composite? False Is 87853 a composite number? False Is 15891 composite? True Is 68806 prime? False Is 131753 prime? False Is 120799 a composite number? True Is 602887 a prime number? True Is 5266 prime? False Is 153991 a composite number? False Is 173401 a prime number? False Is 2521 a prime number? True Is 57427 prime? True Is 389341 composite? True Is 9967 prime? True Is 13399 a composite number? False Is 49081 prime? True Is 278815 prime? False Is 2927 composite? False Is 1957453 a composite number? False Is 2460035 prime? False Is 78367 composite? False Is 44819 a composite number? False Is 25301 a composite number? False Is 212353 a prime number? True Is 62047 composite? False Is 7819 a prime number? False Is 21367 composite? True Is 641 a prime number? True Is 77981 prime? False Is 9491 prime? True Is 163243 a composite number? False Is 23603 a prime number? True Is 2281 pri	{ "pile_set_name": "DM Mathematics" }
2, 11, 59 Suppose 0 = 3h - 2h - r + 4, 2r = 2. Let d be ((-9)/h)/((-4)/(-12)). Suppose -dp + 355 = 22. List the prime factors of p. 37 What are the prime factors of -990(-1190)/20 + (-2 - 5)? 2, 7, 601 Suppose 2g - 105p + 100p - 11523 = 0, -g = -5p - 5769. List the prime factors of g. 2, 3, 7, 137 Let a be 8/(-12)3 - 10. Let u(g) be the third derivative of -g*5/60 - 7g4/12 + g3/2 + g*2. List the prime factors of u(a). 3 Let u(g) = 6g*3 + 9g*2 - 9g - 24. List the prime factors of u(9). 2, 3, 7, 17 Let m(x) = 3x2 + 10x - 37. Let h be m(-15). Suppose -481 - h = -3p. List the prime factors of p. 17, 19 Suppose -220a + 3m = -222a + 11082, -4a + 5m = -22164. List the prime factors of a. 3, 1847 Suppose -59647 - 64119 - 102326 = -249n. List the prime factors of n. 2, 227 Let r = 109 + -98. Suppose 4h + 1024 = 3f, -9f = -rf + 4h + 684. What are the prime factors of f? 2, 5, 17 Suppose 3 = f - y, 4y + 3 + 0 = f. Suppose 2n + l + 1294 = fn, 3n = l + 3886. List the prime factors of n. 2, 3 Suppose -52v + 8 = -50v. Suppose vx - 636 = -2k, 0x + 5x = -k + 303. List the prime factors of k. 2, 41 Let h(g) = -233g3 + 19g*2 + 86g + 16. List the prime factors of h(-6). 2, 7, 11, 41 Let v(l) be the second derivative of 71l4/12 + 17l*3/6 + 144l + 2. List the prime factors of v(-3). 2, 3, 7 Let y(i) = 3i3 - 23i*2 - 134i - 16. What are the prime factors of y(25)? 2, 7, 2081 Suppose 165239 = 12t - 5z, 13774 = t - 13z + 12z. List the prime factors of t. 3, 13, 353 Suppose 90i - 15242535 = -124i - 17i. List the prime factors of i. 3, 5, 53, 83 Let d(l) = -l2 + 21l + 17. Let k be d(17). Let r = 124 - k. Suppose 9 + r = 6f. What are the prime factors of f? 2 Suppose -n + 63787 = -2p, 3n - 204p + 209p = 191405. What are the prime factors of n? 3, 5, 4253 Let j = -758 - -8227. What are the prime factors of j? 7, 11, 97 Let l(f) = f3 + 8f*2 - 7f - 4. Let r be l(-6). Suppose -4n - 9v = 7, 0 = 2n - 2v - 0v - 16. Suppose -3k = -nk + r. List the prime factors of k. 5, 11 Let p(w) = -2w3 + w2 + 26w + 15. Let y be p(-10). Suppose -389 - y = -12n. Let x = -93 + n. What are the prime factors of x? 2, 47 Suppose 0 = 12d - 17d + 20. Suppose 2j = -dr + 274, 5 + 0 = -j. List the prime factors of r. 71 Let r = -343 - -253. Let j = r + 383. What are the prime factors of j? 293 Let k be (-8)/105/(-2). Suppose -4o + 264 = -2q, 5 = ko + 1. Let c = -79 - q. What are the prime factors of c? 7 Let z = -43 - -67. Suppose 3q - 7q - z = 0. What are the prime factors of q/21 + (-144)/(-14)? 2, 5 List the prime factors of (209545/(-14))/(3 + 28/(-8)). 5, 5987 Let i(y) = -3y2 + 22y - 2. Let p be i(7). Suppose 2450 = pd - 3k - k, 0 = 4d - 5k - 1951. List the prime factors of d. 2, 13, 19 Let v = 26914 + 654. List the prime factors of v. 2, 1723 List the prime factors of ((-6)/1266)/(21/(-5846043)). 2, 39769 Suppose -14i = -124 + 82. Suppose 2701 + 1052 = il. List the prime factors of l. 3, 139 Let n(c) = -c2 + 6c + 38. Let r be n(-4). List the prime factors of r/(-6)(-8 + 3077). 3, 11, 31 Suppose 5f - 176 = -2c, -c + 148 = c - 2f. Suppose 5w = 972 + c. What are the prime factors of w? 2, 3, 5, 7 What are the prime factors of (60 + 112)(-1269)/(-4)? 3, 43, 47 What are the prime factors of -11/5 - 6404648/(-340)? 3, 7, 13, 23 Let a = 38 - 188. Suppose -5s = -q - 98, -10q - 7s = -7q + 294. Let j = q - a. What are the prime factors of j? 2, 13 Let l = -156 - -197. Suppose -a + l = -175. What are the prime factors of a? 2, 3 Suppose 14p = 8936 + 4854. What are the prime factors of 1/(3 + (-2965)/p)-16? 2, 197 Suppose g - 26 = 3b, 4g - 4 = -20. Let n(o) = -13o + 7. Let y be n(b). Suppose v = -0v - 5t + 149, -y = -v - t. What are the prime factors of v? 2, 67 List the prime factors of -94854((-46)/4 + -66 + 77). 3, 15809 Let y(a) be the second derivative of -10a*3/3 + 17a*2 + 64a. List the prime factors of y(-3). 2, 47 Let a(z) be the third derivative of -z*4/6 + 5z*3/6 + 27z*2. Let l be a(-6). Suppose y - 133 = -2n, -3y = n - 25 - l. What are the prime factors of n? 3, 23 Suppose 0 = 4k - 2n - 38944, -82k - 2n - 19470 = -84k. What are the prime factors of k? 7, 13, 107 Suppose -10562 = -2s + f, 337s - 333s + 4f = 21148. List the prime factors of s. 3, 587 Let u = -5734 + 19535. List the prime factors of u. 37, 373 Suppose 0 = d - 2d + 5g + 1853, g = -5. Let j be (-4)/(-8) + d/8. Let h = -117 + j. What are the prime factors of h? 2, 7 Suppose 117 = -5x - 413. Let s = x - -158. Suppose 40 + s = 4d. List the prime factors of d. 23 Suppose -1008 = -3q + 3m, 3m + 342 = 4q - 3q. Suppose -u + q + 438 = 2o, 0 = -5o - u + 1926. What are the prime factors of o? 5, 7, 11 Suppose -2u - 2u + 2820 = 0. Let b(k) = -2k*3 + 10k*2 + 29k - 17. Let v be b(-8). What are the prime factors of 1/(v/u - 2)? 3, 47 Suppose 19 = 4m + 3. Suppose -3t = -2c - 14, 0t - 6 = 5t + mc. Suppose -314 = -3q + 4g, 2q + 3g = -tg + 240. List the prime factors of q. 2, 5, 11 Let c = 13298 + -9008. What are the prime factors of c? 2, 3, 5, 11, 13 Let k be 2/7 + (57/21 - -2). Let x = 7 - k. Suppose a - 111 = xy, 4a - 106 = 2y + 326. What are the prime factors of a? 107 Suppose -8w + 7528 = -28088. List the prime factors of w. 2, 3, 7, 53 Suppose 7142 = 7i - 4492. Suppose -10h = -i - 2438. List the prime factors of h. 2, 5, 41 Let g = -19385 + 36946. What are the prime factors of g? 17, 1033 Let v = 7191 - -21644. List the prime factors of v. 5, 73, 79 What are the prime factors of (-358/12 + 8 + -3)-268? 2, 19, 67 Let i be (7/3)/(4/12). Suppose 0 = 3h + ih - 190. Suppose 3r = -10j + 5j + h, 2j = 5r + 20. What are the prime factors of j? 5 Suppose 90 = -5p - 0p. Let v(o) = -o*3 - 17o*2 + 2o + 3. Let c be v(p). Let g = 502 - c. What are the prime factors of g? 211 Suppose 17p + 3p - 1097306 = -29p. What are the prime factors of p? 2, 11197 Let n(g) = g2 - 33g + 257. Let f be n(12). Suppose l = 4l, -l = q - 667. Suppose 3s - 600 - 79 = -fk, -5k + q = -s. What are the prime factors of k? 2, 67 Suppose 1643642 + 713818 = 63f. List the prime factors of f. 2, 5, 1871 Let s = -258 + 264. What are the prime factors of (-47)/(54/(-182) - s/(-39))? 7, 47 Let g = 42482 - 29044. What are the prime factors of g? 2, 6719 What are the prime factors of (2/45)/(79/395) + (-134427)/(-27)? 13, 383 Let t = -19819 + 31225. List the prime factors of t. 2, 3, 1901 What are the prime factors of -6 + (-91730)/(-10) - 2/((-8)/(-12))? 2, 29, 79 Suppose 362d - 361d = -8. List the prime factors of (11(-6)/(-2))/(d/(-424)). 3, 11, 53 Let l(u) = -69u + 58 + 108 + 66u + 86. List the prime factors of l(-35). 3, 7, 17 Suppose -4531427 - 591338 = -23a - 212a. List the prime factors of a. 21799 Let v(r) = r*2 + r + 15. Let c be v(0). Suppose cd - 16d + 119 = 0. Suppose 5p = d + 671. List the prime factors of p. 2, 79 Suppose 0 = -4k + 3k - 1. Let m be 2/9 - 61k/9. Suppose 4y - 442 = -mi + 4i, -556 = -4i + 3y. List the prime factors of i. 2, 71 Let w(p) = 44p2 + 130p - 119. List the prime factors of w(19). 5, 7, 521 Let c(q) = -q*2 - 8q + 30. Let p be c(-10). Suppose d + 3 = p. Suppose -15u + du + 544 = 0. List the prime factors of u. 2, 17 Let a(z) = -6z - 74. Let d(m) = -2m - 19. Let c(y) = -2a(y) + 9d(y). What are the prime factors of c(-26)? 7, 19 Suppose -2a - 5n = -a + 44, 5a + 2n = -128. Suppose -4m + m = -126. What are the prime factors of (2/3 + a/(-36))m? 2, 7 Let a(n) = 125n2 - 26n + 551. List the prime factors of a(13). 2, 47, 227 Let y(l) be the second derivative of 131l3/3 + 193l*2/2 + 254l. List the prime factors of y(3). 11, 89 Suppose 3i + i = 120. Suppose -3x - 12x + i = 0. Suppose -xs = -5y + 1182, -y - 3s = -7s - 240. List the prime factors of y. 2, 59 Suppose 5a = 2z + 25, 0a - 4a + 27 = -3z. Suppose -am + 36 = 36. Let c(y) = y2 + 3y + 75. What are the prime factors of c(m)? 3, 5 Suppose 0 = -4w + 3f + 32 - 10, -3f - 2 = w. Suppose wa - 8a = 20, -v - a + 225 = 0. What are the prime factors of v? 2, 5, 23 Let u(j) be the second derivative of j5/20 + 11j*4/6 + 5j**3/3 +	{ "pile_set_name": "DM Mathematics" }
is the third derivative of -389893839r4 + r2 - 1269r - 4619 wrt r? -9357452136r Find the third derivative of 27320331g3 - g2 - 6331494 wrt g. 163921986 Differentiate q*4 + 4400q*3 - 647q + 59533998 with respect to q. 4q3 + 13200q*2 - 647 What is the third derivative of 4052333t*4 + 9231t*2 + 227t? 97255992t Differentiate 6306367a*2 + 7415470. 12612734a Differentiate -35450216g4v*3 - 21v*3 + 44721v - 4 wrt g. -141800864g3v*3 Find the third derivative of -13222i*4 + 18321i*3 - 10i*2 - 200815. -317328i + 109926 Find the second derivative of -1164005343l4 - 1152l + 25085. -13968064116l2 Differentiate -22155173i - 8167505. -22155173 Find the third derivative of 16529253h5 - 400h*2 - 145h + 2 wrt h. 991755180h2 Find the second derivative of 746380624y*2 + 226483654y wrt y. 1492761248 What is the first derivative of 4372403f4 + 7381948 wrt f? 17489612f*3 Find the second derivative of -153856697d*3s - 2d2s*3 - ds*3 + 1676ds2 - 7ds + s3 - 13s*2 wrt d. -923140182ds - 4s*3 What is the first derivative of 968n*4 - 4096n*3 - 3n*2 + 6160379? 3872n*3 - 12288n*2 - 6n Find the third derivative of -1443029i3j3 + i2j2 + 72i*2 - 6ij3 - ij - 271j wrt i. -8658174j*3 Find the first derivative of 330jl3r + 88006jl*2r + 854jl - j - 2l3 - 7l*2 + 1070l wrt r. 330jl*3 + 88006jl2 Find the third derivative of 8594q*5 + 5149q*4 + 4591419q*2 - 2q - 1. 515640q2 + 123576q Find the third derivative of -161005f4w*2 - 69f*4 - 100341360f*2w*2 wrt f. -3864120fw2 - 1656f Find the first derivative of -14600024v3 - 24164542. -43800072v*2 What is the third derivative of 2du4 - 2du2 + 323du + 2951d - 260448u4 - 4u*2 wrt u? 48du - 6250752u Find the third derivative of -14d4qr - 9d*4q + 50d4 - 2d*2r + 7d2 - 1546dqr + 200dr wrt d. -336dqr - 216dq + 1200d What is the second derivative of 57860777v2z - 872vz + 307v + 4z + 3 wrt v? 115721554z Find the second derivative of -290777967n*2 + 915n - 186249 wrt n. -581555934 Find the first derivative of 720x3 - 8342x - 2692856. 2160x2 - 8342 What is the second derivative of 75959837c*3x*2 + 907615c*3x + 26c3 wrt x? 151919674c*3 Find the third derivative of -175679265l*4 - 72558849l*2. -4216302360l What is the derivative of 102abd + 617ab + 160ad - 2a - 95b + 363422d wrt a? 102bd + 617b + 160d - 2 Find the third derivative of 113f5 - 790f*4l - 256f4 - 6f*2l - 9343f2 - l + 6 wrt f. 6780f*2 - 18960fl - 6144f What is the derivative of 8ht*2 + 21ht - 167206h + 96907341t2 wrt h? 8t*2 + 21t - 167206 What is the second derivative of -380423757o2s*2 - 23os2 - 53o - s + 215 wrt o? -760847514s2 Find the second derivative of 783037645d*2 + 49505d - 642. 1566075290 What is the derivative of 59309122p + 82223797 wrt p? 59309122 What is the first derivative of -kt*3 - 3k + 4134643t - 2838718 wrt t? -3kt2 + 4134643 What is the first derivative of -8k*4 - 43800k*3 - 275519355? -32k*3 - 131400k*2 What is the second derivative of fg*2v - 1320113fg*2 + 2fgv - 12fg + 3f + 8g*2v - 99gv + g - v - 1842 wrt g? 2fv - 2640226f + 16v Find the second derivative of 3t4 + 121221t*2 + 15054698t wrt t. 36t2 + 242442 Find the second derivative of 808321401a*2 + 926276349a wrt a. 1616642802 Find the second derivative of 6452n2s*2 + 714n*2 - ns*2 - 2199ns + 680s - 1 wrt n. 12904s2 + 1428 Find the second derivative of 38i*2l*2 + 828559i*2l - 18il*2 - il - i + 75222l2 + 2l wrt i. 76l2 + 1657118l Differentiate -324230a3b - 2a3 - 58455093b with respect to a. -972690a2b - 6a2 What is the second derivative of -678353483d*3k*2 + 2d*3k - 7d3 - 37674d*2k - 2d2 + 4dk + 8d wrt k? -1356706966d3 Differentiate 2h*4 - 4h*3 - 27615h + 7138438 with respect to h. 8h3 - 12h*2 - 27615 Find the first derivative of -22dv2 - 4081dv + 269d - 240v2 + 2368v - 61 wrt d. -22v2 - 4081v + 269 What is the first derivative of -127l2 - 28694l - 51910718? -254l - 28694 What is the third derivative of -11819690p*3 - 727p*2 + 8786p? -70918140 Find the second derivative of 3691j3 - 18565j*2 + 825917844j. 22146j - 37130 What is the second derivative of -19g*3p + 536g2m*2p - 151g2p + 10231gm*2 + gmp - 64m*2p + 3p wrt g? -114gp + 1072m*2p - 302p Find the first derivative of 11d*2p*2 - 3dp2 - 129140dp + p2 + 2341p - 47 wrt d. 22dp*2 - 3p*2 - 129140p Find the third derivative of 336175385r4 - 14722r*2 - 1410. 8068209240r Find the third derivative of 9038457o3 - 5712364o*2 wrt o. 54230742 Find the second derivative of 5l*3x*2 + 21773l*3x + l*3 - 28x*3 - 247x*2 + 4x wrt x. 10l3 - 168x - 494 What is the derivative of -743j3 + 553j + 11543079 wrt j? -2229j2 + 553 Find the second derivative of -523j*5 - 16665j*4u + 26ju - 30j - 66593u wrt j. -10460j3 - 199980j*2u What is the second derivative of 410522864x2 + 690482300x? 821045728 Find the second derivative of 36245514t2z*2 - 2t*2 - 68tz - 7z - 1267 wrt z. 72491028t2 Find the third derivative of 74843967n*3 - 98n*2 - 55516 wrt n. 449063802 Find the third derivative of 23452728u*3 + 981217u*2 - 6u wrt u. 140716368 Differentiate 5130616d2z*3 + 2431812d*2 + 2dz2 with respect to z. 15391848d*2z*2 + 4dz Find the third derivative of 81310154p*6 - 3047928p*2. 9757218480p*3 Find the third derivative of 11120891r*3u - 2r2u - 120r2 - 18r + 299 wrt r. 66725346u What is the second derivative of -3425n*5 - 33819n*2 + 230752843n wrt n? -68500n3 - 67638 What is the second derivative of -18727937i*4n - 12197724in wrt i? -224735244i2n Find the second derivative of -35c5 - 17857c*4 - 43199c + 810 wrt c. -700c3 - 214284c*2 Find the second derivative of -23298181l*2 - 515606715l wrt l. -46596362 What is the third derivative of -86i3z + 830514i3 - i2z + 469680i2 + 2iz wrt i? -516z + 4983084 Find the second derivative of 2n2t*2 + 59171n*2 + 631nt2 - 67485t*2 + 26t wrt t. 4n2 + 1262n - 134970 What is the derivative of -10030j4 - 2j*2 - 1469jq2 + 50139q*2 + 78 wrt j? -40120j*3 - 4j - 1469q2 Differentiate -959jl2 + 24jl + 1061jo + 5l*2o + 3l2 + 60169lo + o wrt j. -959l*2 + 24l + 1061o Find the third derivative of -713602029f*3 + 217f*2 - 97369 wrt f. -4281612174 Find the third derivative of 92503976h*4 - 177h*2 - 5h - 1226. 2220095424h Find the second derivative of -123493789o*5 + 40036594o - 1 wrt o. -2469875780o3 Find the third derivative of 819167436d*4 - 7d*2 - 78765613d. 19660018464d Find the second derivative of 29116k*5u*2 - 130k*2u*2 + 1071ku2 + 3972k wrt k. 582320k3u*2 - 260u*2 Find the third derivative of -73d*2o*5 - 4d*2 - 32603do3 + 564353o*2 wrt o. -4380d*2o*2 - 195618d What is the second derivative of -52a3 + 332928a*2 + 321a - 19493 wrt a? -312a + 665856 Differentiate -342f*3 - 3946f*2 - 4f + 49669859 with respect to f. -1026f2 - 7892f - 4 Differentiate -15g4 + 5500934g*3 + 286884771 wrt g. -60g*3 + 16502802g*2 Find the first derivative of -60a*4 + 4172a*3 + 6a*2 + 17120007 wrt a. -240a*3 + 12516a*2 + 12a What is the third derivative of -4216639d3m*2 + 2d*2m2 - d2 + dm2 - 9958d - 2m2 wrt d? -25299834m*2 Find the second derivative of -51k*3s + 130880k2s - 1833ks + 2k + 33s + 5 wrt k. -306ks + 261760s What is the first derivative of -161122788o - 76874588 wrt o? -161122788 Differentiate 44924644c - 26801301 wrt c. 44924644 What is the first derivative of 2bc2l + bcl + 204838bl + 1352c2 + 91l wrt b? 2c2l + cl + 204838l Find the third derivative of 2b2s*3 - 31b*2s2 - b2 + 11bs*4 + 3bs2 - 147bs - 559269s*3 - 2s*2 wrt s. 12b*2 + 264b*s - 3355614 Find the second derivative of	{ "pile_set_name": "DM Mathematics" }
81427 What is the t'th term of 384, 625, 958, 1383, 1900? 46t2 + 103t + 235 What is the i'th term of -42359590, -42359594, -42359600, -42359608, -42359618, -42359630, -42359644? -i*2 - i - 42359588 What is the w'th term of 10572802, 21145597, 31718392, 42291187, 52863982, 63436777? 10572795w + 7 What is the h'th term of 47392920, 94785834, 142178748, 189571662? 47392914h + 6 What is the o'th term of -3002380, -3001722, -3001066, -3000412, -2999760, -2999110? -o2 + 661o - 3003040 What is the q'th term of -1880496, -3760976, -5641456, -7521936? -1880480q - 16 What is the p'th term of -7229852, -14459769, -21689686? -7229917p + 65 What is the i'th term of -3274198, -6548395, -9822594, -13096795, -16370998, -19645203, -22919410? -i*2 - 3274194i - 3 What is the m'th term of -33673812, -67347623, -101021434, -134695245, -168369056? -33673811m - 1 What is the y'th term of -1197, -1455, -1881, -2559, -3573, -5007, -6945? -14y*3 - 160y - 1023 What is the s'th term of -203, -3019, -10673, -25583, -50167? -403s3 - s2 + 8s + 193 What is the w'th term of 967, 7541, 25251, 59623, 116183, 200457? 921w3 + 42w*2 + w + 3 What is the x'th term of -58681, -58037, -57397, -56761, -56129, -55501, -54877? -2x*2 + 650x - 59329 What is the m'th term of 14124, 29077, 44030, 58983? 14953m - 829 What is the o'th term of 21416453, 21416441, 21416429, 21416417? -12o + 21416465 What is the s'th term of -267528, -2140016, -7222496, -17119968, -33437432, -57779888, -91752336, -136959776? -267500s3 + 4s*2 - 32 What is the t'th term of 113766, 455070, 1023910, 1820286, 2844198? 113768t2 - 2 What is the b'th term of 5232943, 10465886, 15698827, 20931766? -b2 + 5232946b - 2 What is the h'th term of 202124, 806734, 1813844, 3223460, 5035588, 7250234? h3 + 201244h*2 + 871h + 8 What is the y'th term of 1119, 720, 241, -324, -981, -1736? -y*3 - 34y*2 - 290y + 1444 What is the g'th term of 136263, 272754, 409687, 547284, 685767, 825358, 966279, 1108752? 37g3 - g2 + 136235g - 8 What is the i'th term of -417, -2892, -9443, -22056, -42717, -73412, -116127, -172848? -331i3 - 52i*2 - 2i - 32 What is the i'th term of 62687082, 125374163, 188061244, 250748325, 313435406? 62687081i + 1 What is the x'th term of -167, -703, -2081, -4721, -9043, -15467, -24413? -70x3 - x2 - 43x - 53 What is the h'th term of 100708072, 201416143, 302124214, 402832285? 100708071h + 1 What is the u'th term of -109563, -438665, -987169, -1755075, -2742383, -3949093, -5375205? -109701u2 + u + 137 What is the x'th term of -18559, -36016, -53487, -70972, -88471, -105984, -123511? -7x*2 - 17436x - 1116 What is the t'th term of -204541, -204480, -204421, -204364, -204309? -t*2 + 64t - 204604 What is the z'th term of -691950, -691268, -690132, -688542? 227z2 + z - 692178 What is the w'th term of 622778, 1247524, 1872272, 2497022, 3121774, 3746528? w2 + 624743w - 1966 What is the c'th term of 2072969, 2072967, 2072965, 2072963, 2072961? -2c + 2072971 What is the x'th term of -1292253, -1292266, -1292287, -1292316, -1292353? -4x*2 - x - 1292248 What is the c'th term of -7811, -13332, -18849, -24362, -29871, -35376, -40877? 2c*2 - 5527c - 2286 What is the c'th term of -29390, -59074, -89054, -119330? -148c2 - 29240c - 2 What is the u'th term of 36310, 72553, 108776, 144979, 181162? -10u2 + 36273u + 47 What is the p'th term of -4114, -6421, -8728? -2307p - 1807 What is the g'th term of 170994, 341941, 512888, 683835? 170947g + 47 What is the u'th term of 2947, 23923, 80935, 192007, 375163? 3004u3 - 6u*2 - 34u - 17 What is the l'th term of 2526, 2626, 2800, 3054, 3394? l*3 + 31l*2 + 2494 What is the k'th term of 1064, 2126, 3284, 4586, 6080? 8k*3 + 1006k + 50 What is the v'th term of -145559, -290971, -436383, -581795, -727207? -145412v - 147 What is the i'th term of -42625, -42405, -42219, -42085, -42021, -42045, -42175, -42429? -3i3 + i2 + 238i - 42861 What is the z'th term of -42999, -42932, -42759, -42426, -41879, -41064? 9z3 - z2 + 7z - 43014 What is the k'th term of 22474302, 44948602, 67422900, 89897196, 112371490, 134845782? -k2 + 22474303k What is the g'th term of 15986, 64108, 144376, 256790, 401350? 16073g2 - 97g + 10 What is the p'th term of 336003, 335912, 335665, 335184, 334391? -13p3 + 336016 What is the s'th term of -58069, -232617, -523525, -930793, -1454421, -2094409? -58180s*2 - 8s + 119 What is the f'th term of -25428486, -50856975, -76285464, -101713953, -127142442, -152570931? -25428489f + 3 What is the j'th term of 29, 21, 255, 929, 2241? 33j*3 - 77j*2 - 8j + 81 What is the o'th term of -5482, -5383, -5282, -5179, -5074, -4967, -4858? o*2 + 96o - 5579 What is the s'th term of 823939, 6591591, 22246653, 52732831, 102993831, 177973359, 282615121? 823951s3 - s2 - 2s - 9 What is the w'th term of -1581, -1213, -603, 243, 1319? -w*3 + 127w*2 - 6w - 1701 What is the i'th term of 15400, 14988, 14576, 14164? -412i + 15812 What is the y'th term of 683, 7815, 27175, 64877, 127035, 219763, 349175, 521385? 1019y*3 - y - 335 What is the f'th term of -4723, -13408, -26049, -42646, -63199, -87708, -116173? -1978f*2 - 2751f + 6 What is the y'th term of -16677, -14238, -11803, -9372, -6945, -4522? -2y2 + 2445y - 19120 What is the f'th term of 375, 1024, 1949, 3150, 4627? 138f2 + 235f + 2 What is the f'th term of 236767, 947120, 2131049, 3788560, 5919659? f*3 + 236782f*2 - 16 What is the c'th term of -6810, -14213, -21616, -29019, -36422, -43825? -7403c + 593 What is the x'th term of 168084652, 336169303, 504253954? 168084651x + 1 What is the s'th term of 3955719, 7911357, 11866995, 15822633? 3955638s + 81 What is the q'th term of -1053710, -2107393, -3161050, -4214681, -5268286, -6321865, -7375418? 13q2 - 1053722q - 1 What is the u'th term of -1530, -1494, -1396, -1242, -1038, -790, -504, -186? -u*3 + 37u*2 - 68u - 1498 What is the w'th term of 2906480, 5812956, 8719432, 11625908, 14532384, 17438860? 2906476w + 4 What is the y'th term of -108089, -432234, -972437, -1728698, -2701017, -3889394, -5293829? -108029y*2 - 58y - 2 What is the k'th term of 886830, 3547327, 7981490, 14189319, 22170814? 886833k2 - 2k - 1 What is the p'th term of -322052, -644171, -966290, -1288409, -1610528? -322119p + 67 What is the h'th term of 1761, 3621, 5577, 7629, 9777, 12021, 14361? 48h*2 + 1716h - 3 What is the u'th term of 445, 7437, 14429, 21421, 28413? 6992u - 6547 What is the a'th term of 19461, 19736, 20193, 20832, 21653, 22656? 91a*2 + 2a + 19368 What is the o'th term of 7756040, 15512079, 23268116, 31024151, 38780184, 46536215? -o*2 + 7756042o - 1 What is the h'th term of 20811, 166599, 562301, 1332873, 2603271, 4498451, 7143369, 10662981? 20826h3 + h2 + 3h - 19 What is the w'th term of 7075, 15475, 23875, 32275, 40675, 49075? 8400w - 1325 What is the k'th term of 658, 2622, 5808, 10144, 15558, 21978, 29332? -12k*3 + 683k2 - k - 12 What is the t'th term of 280537, 561278, 842027, 1122790, 1403573, 1684382? t3 - 2t2 + 280740t - 202 What is the o'th term of -105496, -105448, -105400, -105352? 48o - 105544 What is the i'th term of -63204, -126578, -189952, -253326, -316700? -63374i + 170 What is the t'th term of 1704, 3423, 5142, 6861, 8580? 1719t - 15 What is the k'th term of 3236, 1526, -3146, -12262, -27304, -49754, -81094, -122806? -247k3 + k2 + 16k + 3466 What is the u'th term of 8592, 16997, 25016, 32457, 39128, 44837, 49392, 52601? -32u3 - u2 + 8632u - 7 What is the q'th term of 34763214, 69526428, 104289642, 139052856, 173816070, 208579284? 34763214q What is the y'th term of 42675784, 42675777, 42675770, 42675763, 42675756, 42675749? -7y + 42675791 What is the a'th term of -195728, -391455, -587182? -195727a - 1 What is the f'th term of 28627, 131693, 303469, 543955, 853151, 1231057, 1677673? 34355f2 + f - 5729 What is the l'th term of 68555445, 274221777, 616999005, 1096887135, 1713886173, 2467996125? l3 + 68555442l*2 - l + 3 What is the x'th term of 51282, 51536, 51790? 254x + 51028 What is the v'th term of -1039538, -2079166, -3118784, -4158386, -5197966? v3 - v2 - 103963	{ "pile_set_name": "DM Mathematics" }
ulate the highest common factor of 32 and w. 32 Let j = 20165 + -12260. Calculate the highest common factor of j and 60. 15 Let z be (-1824)/11 + (-6)/33. Let u = -134 - z. Suppose -39x + 4 = -38x. What is the highest common divisor of x and u? 4 Suppose x - 718l - 23 = -717l, -74 = -4x - 2l. What is the greatest common factor of x and 320? 20 Suppose 15w - 6 = 18w, 0 = -5m - w + 1243. Suppose 0 = -4y + 4f + 500, 5y - m = -f + 382. Calculate the greatest common factor of y and 36. 18 Suppose -4c + 2c = -6. Suppose 0 = cq - 2q - 14. Let t = 275 - 163. Calculate the greatest common divisor of q and t. 14 Let x be (-387)/3(-4)/12. Let r = 52 - x. Calculate the highest common factor of 432 and r. 9 Let i(u) = u + 48. Let n = -512 - -472. Let f be i(n). Calculate the greatest common divisor of 488 and f. 8 Let r = -1149 + 2244. Calculate the highest common divisor of 105 and r. 15 Let t = -6132 + 6135. Calculate the greatest common divisor of 1083 and t. 3 Let b(g) be the third derivative of 0 + 1/4g*4 + 0g - 8/3g3 + 1/20g*5 + 37g*2. Let z be b(4). What is the highest common factor of 8 and z? 8 Let r be ((-52)/(-8) + -8)/(1/(-10)). Let v be 516/(-40)-82 + 3/r. Calculate the highest common divisor of v and 46. 46 Let q(t) = -6t3 - 15t*2 - 22t - 82. Let a be q(-6). Calculate the greatest common factor of 26 and a. 26 Let j be (-1 + -50)/(3/(-2)). Let y(q) = 161q2 + 785q - 15. Let z be y(-5). What is the highest common factor of j and z? 17 Let u be (11/(-2))/((-3)/96). Suppose 4k + 26 = 6k. Suppose 5f + 10t = kt + 116, -92 = -4f + 2t. Calculate the greatest common divisor of u and f. 22 Suppose -50o - 2032 = -58o. Suppose 4y + w - o = 0, 5y + 2w - 181 = 138. Calculate the highest common factor of y and 9. 9 Let a = 45 + -67. Let j(d) = -3d - 46. Let q be j(a). Let o be 5/(q/4)5. Calculate the highest common divisor of 5 and o. 5 Suppose 4y - 220 - 221 = -5c, -5y = c - 525. Suppose 472w = 463w + 1170. Calculate the greatest common divisor of w and y. 26 Suppose -72s - 20 = -74s. Let l be ((-8)/10 - (-11 + 7))s. Calculate the greatest common divisor of l and 24. 8 Let n = 214 - 78. Suppose 6342f = 6429f + 690 - 2778. Calculate the highest common divisor of n and f. 8 Let v(a) = -157a3 + a. Let g be v(-1). Suppose r + 111 = 3j + 11, -5j = 3r - 204. What is the greatest common factor of j and g? 12 Suppose 67m + 118825 = -74m + 176m. Calculate the greatest common divisor of 5 and m. 5 Let n(o) = -24o + 800. Let k be n(30). Calculate the highest common divisor of 360 and k. 40 Suppose 7d + 36 = -2d. Let c be ((-2)/d)/(1/4). Let l be 1/((-1 + 2)/14). Calculate the highest common factor of l and c. 2 Let w = -35 - -30. Let u be 1 + 4/(-10) + (-32)/w. Suppose -3h + uh = 528. What is the greatest common factor of h and 12? 12 Suppose -19448 = -4q - 21i + 19i, 0 = q + 5i - 4889. What is the highest common divisor of q and 226? 113 Suppose -t = 4f - 43, -2t + 6 = -2f - 70. What is the greatest common factor of 2301 and t? 39 Let p be (-206)/(-4) - (-1)/2. Suppose -3d + 356 = b + 81, -5d + b + 453 = 0. Calculate the highest common divisor of d and p. 13 Suppose 5q + 1 = 2m - 3, 4m - 8 = q. Suppose -360 = -5r - 0l + 5l, -3l + 144 = mr. Calculate the greatest common factor of 120 and r. 24 Suppose -1 + 61 = b - 4r, 0 = b + r - 85. Suppose 1441 = 4d - k, 2d - 188k + 186k - 722 = 0. What is the highest common divisor of b and d? 40 Let f be 2/((-10)/(1574 + 6)). Let w be 2256 + (0 - 0). Let g = w + f. What is the highest common divisor of g and 28? 28 Let a(p) be the second derivative of p5/20 + p4/12 + p3 - 19p*2/2 + 2p - 1. Let g be a(3). Calculate the highest common factor of 28 and g. 7 Let z be (-2 + 7/2)/((-192)/(-37248)). Calculate the highest common factor of z and 3977. 97 Let b(x) = -x*2 + 18x + 106. Let p be b(19). Suppose 104 = 4a + 3k - 3, -k - p = -4a. Calculate the greatest common divisor of a and 1357. 23 Let c = 94 + -86. Let x(w) = -w3 - 19w*2 + 37w + 31. Let j be x(-21). Calculate the highest common factor of j and c. 8 Suppose 50f - 10 = 100f - 52f. Let b(h) = 20h*2 + 3h - 1. Let t be b(2). What is the highest common divisor of f and t? 5 Suppose -4o = -3o - 1. Let w(z) = 143z + 10. Let x be w(o). What is the greatest common divisor of x and 9? 9 Suppose -w = -19 - 10. Suppose -4r + 358 = -5y, 20 - 366 = -4r - y. What is the highest common divisor of w and r? 29 Suppose 28k - 302 = 930. Calculate the highest common factor of k and 2585. 11 Let u be 7 + 23 - (-14)/(-35)-5. What is the greatest common divisor of 3872 and u? 32 Suppose 5z - 5f - 15 = 0, -8z - 3f + 19 = -4z. What is the greatest common factor of 214 and z? 2 Let i = 3262 + -2718. Calculate the greatest common divisor of 17 and i. 17 Suppose 0 = -114773d + 114831d - 928. Let g(i) = i + 272. Let j be g(0). Calculate the highest common divisor of j and d. 16 Let f = -3505 - -3846. Calculate the greatest common factor of 352 and f. 11 Let j be (11/3)/(1/48). Let l be (-2)/8 - (-279)/124. Suppose 5o - 5k = 85, -lk - 19 = -o - 1. Calculate the highest common divisor of o and j. 16 Let h be 1/(-12)-1558 - 12/(-72). Suppose 0 = -2z - 3z + h. Calculate the highest common divisor of z and 221. 13 Let d = -1372 + 1960. Calculate the greatest common divisor of 49 and d. 49 Let n be (-8)/(-2) - (-16 + -35). Let m be 1/5 + 1694/n. What is the highest common divisor of 341 and m? 31 Let z(h) = -h2 + 29h + 62. Let j be z(23). Let b be ((-72)/(-30))/(6/j). Calculate the greatest common factor of b and 200. 40 Suppose 0 = a - 2a + 153. Let m = -55 - -57. Suppose -mt = 5t - 119. What is the highest common factor of t and a? 17 Let p = -4 - -13. Let t be (-4)/1015(-5 + 6). Let b be ((21/14)/1)/((-1)/t). What is the greatest common factor of b and p? 9 Let p be -7 + (-322)/(-56) + 741/4. Calculate the greatest common factor of 408 and p. 8 Let p(k) = 2k*2 + 166k + 1844. Let r be p(-13). Let i be (-1 + -11)/((-1)/18). What is the highest common divisor of i and r? 24 Suppose -260 = 65u - 67u. Let i be (577 + 5)/3 + 1. Calculate the highest common factor of u and i. 65 Let z be (-26)/(-14) + 4/28 - (-946)/43. Calculate the highest common divisor of 10572 and z. 12 Let v = 10 - 3. Let n(a) = -2a2 - 8a2 + 9 - a2 + 6a2 - 39a - 35. Let o be n(-6). Calculate the greatest common factor of v and o. 7 Let n = 23 - 14. Suppose 0 = 8z - 184 + 56. Let b(d) = d3 - 16d*2 + 1. Let f be b(z). Calculate the highest common factor of n and f. 1 Let r = -95 + 65. Let h = -27 - r. Suppose hk + 0k - 87 = 0. What is the greatest common divisor of 58 and k? 29 Suppose 2r + 5y - 976 = 0, 0 = 5r + 3y - 1387 - 1072. Let o = 40 + -11. Calculate the highest common divisor of o and r. 29 Suppose -2m - 9y = -7y - 90, -m + 65 = -4y. What is the greatest common factor of 8771 and m? 49 Let z(h) = -36h + 239. Let y be z(-13). Let o = y - 547. What is the greatest common divisor of o and 50? 10 Let f be (-8)/14 + (33/21 - -5). Suppose -3o - f = -4o. Let v(a) = -a*2 + 4a + 20. Let g be v(6). Calculate the highest common factor of o and g. 2 Let o(k) = 18k - 118. Let c(s) = 17s - 121. Let d(y) = 2c(y) - 3o(y). Let h be d(3). Calculate the highest common divisor of 4 and h. 4 Let b(k) = k*2 + 12k + 13. Let p = 45 - 61. Let g be 12/16p/(-12)-12. Let s be b(g). Calculate the greatest common factor of s and 39. 13 Let y = 5 - -7. Let k be (-65)/13 - -1 - -214. What is the highest common divisor of y and k? 12 Suppose -u = -2m - 158 + 481, 0 = -3m - 3u + 471. Calculate the highest common divisor of 384 and m. 32 Let z = 3035 - 2087. What is the highest common factor of 395 and z? 79 Suppose -2m + 5m + 4h + 198 = 0, -3m - 5h - 195 = 0. Let t = -63 + m. Let c be 82/4 - (t/(-14))/(-19). Calculate the highest common factor of c and 21. 21 Let f be (-1836)/(-9)(95/10 - 5). Calculate the greatest common divisor of f and 17. 17 Suppose 1092 = -181q + 220q. Calculate the highest common divisor of q and 581. 7 Let a(h) = h*2 + 5h - 31. Let u be a(-9). Suppose -6p + 78 = 5b - 2p, -33 = -b + up. Calculate the greatest common divisor of b a	{ "pile_set_name": "DM Mathematics" }
Let t = 2 + a. What is the derivative of 4n4 - n4 - 5n*t + 1 + 1 wrt n? -8n*3 Let i be -1 - 1 - (-8)/2. Find the third derivative of -176 + 3v*i + 18v*4 + 176 wrt v. 432v Let q(f) be the second derivative of -29f9/15120 - f5/12 - 5f*4/12 - 20f. Let d(a) be the third derivative of q(a). Differentiate d(w) wrt w. -116w3 Suppose -9z = -6z - 57. Let v = -17 + z. Find the second derivative of 2h*v - 10h - 2h2 + h - 8h*5 wrt h. -160h*3 Let n = -4 + 12. Suppose 5o = 4s + 29, -5o + 32 = s + n. What is the first derivative of z*4 + oz4 + 2 - z4 wrt z? 20z3 Let n(m) be the first derivative of 0m*2 - 47/3m*3 + 40 + 43m. Differentiate n(f) with respect to f. -94f Let x be (-2)/((-2)/(-3)) + 11. What is the second derivative of 4q - xq4 - 14q - 9q4 + 4q*4 wrt q? -156q*2 Let u(j) be the first derivative of 3j*6/10 + 9j*2 - 12j - 3. Let m(h) be the first derivative of u(h). Differentiate m(y) with respect to y. 36y3 Let q(p) be the first derivative of 10/3p*3 - 11p*2 + 0p*4 + 0p + 3/5p5 + 30. Find the second derivative of q(d) wrt d. 36d*2 + 20 Find the third derivative of -28d*3 + 77 - 159d*2 + 161d2 - d4 + 0d4 wrt d. -24d - 168 Suppose -4f = 1763 - 1763. Let o(y) be the first derivative of 1 + fy*3 - 1/2y*2 + 3y*4 + 0y. What is the second derivative of o(n) wrt n? 72n Let y(h) = h2 + 16h + 16. Let l be y(-14). Let s = l + 14. What is the derivative of 4z + 9 + sz - z wrt z? 5 Let u(t) = -526t + 600. Let n(x) = 789x - 897. Let v(l) = -5n(l) - 8u(l). Differentiate v(a) with respect to a. 263 Let x(o) = 25o3 + 52o*2 - 70o + 23. Let r(p) = 6p3 + 13p*2 - 18p + 6. Let g(d) = -9r(d) + 2x(d). Find the second derivative of g(w) wrt w. -24w - 26 Suppose -7x + 15x - 16 = 0. What is the first derivative of -1 + xy*4 + 179y - 179y - 14 wrt y? 8y3 Let z be (7 + -8)/(2/16). Let j = z - -11. What is the second derivative of -1 - n3 + 9n + 3n*j + 1 wrt n? 12n Let q(h) be the first derivative of h9/252 - h6/72 - h*3/3 - 10. Let i(w) be the third derivative of q(w). What is the third derivative of i(t) wrt t? 720t2 Let r(h) = -h3 - h + 1. Let z(n) = -403n5 + 4n*3 + 12n + 9. Let a(d) = 3r(d) + z(d). What is the second derivative of a(k) wrt k? -8060k*3 + 6k Suppose -2f = -5a + 12 + 2, 0 = a - 3f + 5. What is the third derivative of la - 2l*4 - 2l*4 - 10l2 - l4 wrt l? -96l Let m(i) be the first derivative of i7/42 - 3i*5/20 + 11i*2/2 - 8. Let v(q) be the second derivative of m(q). Find the third derivative of v(r) wrt r. 120r Let j(z) = z*2 + 15z + 1. Let p be j(-15). Differentiate 3 - 26g2 + 0 - p - 4 with respect to g. -52g Find the first derivative of 115 + 136s3 + s2 + 0s2 - s2 - 50s3 wrt s. 258s*2 What is the second derivative of -125g - 16g4 - 70g + 36g5 + 16g*4 - 3g*5 wrt g? 660g*3 Let g(h) = 322h + 240. Let m(o) = 643o + 478. Let t(a) = -9g(a) + 4m(a). Differentiate t(k) wrt k. -326 Let y(b) be the first derivative of 0b*4 + 0b*2 + 40b - 23/5b5 - 17 + 0b*3. Differentiate y(d) with respect to d. -92d*3 Let q(g) be the second derivative of -159g*5/20 + 125g*3/6 - 149g. Find the second derivative of q(i) wrt i. -954i Suppose 3r + 17 = 4m + m, 4 = -r. Let v(g) = g3 + g. Let h(t) = 4t*3 - 4t. Let z(y) = mh(y) - 2v(y). Find the second derivative of z(u) wrt u. 12u Let p(m) be the second derivative of -m7/420 - 7m*5/120 + 13m*4/12 + 6m. Let r(z) be the third derivative of p(z). Differentiate r(h) with respect to h. -12h Let z(k) be the first derivative of 371k*5/5 + 251k*3/3 + 192. Find the third derivative of z(m) wrt m. 8904m What is the second derivative of -18 - 89h3 - 104h - 42 + 102h wrt h? -534h Let v(s) be the second derivative of -s8/48 + s4/4 - 8s2 - 32s. Let t(o) be the first derivative of v(o). What is the second derivative of t(y) wrt y? -140y3 Suppose -4f = 0, 0r = -4r - 3f + 12. Find the second derivative of -4h - 21h2 + h - 11h - rh2 wrt h. -48 Suppose -g + 0g = -4. Suppose -2j + 4b + 20 = 0, -12b + 19 = 4j - 13b. Differentiate -j - 3x*g - 10x*4 + 3 with respect to x. -52x*3 Let a = -40 - -43. Find the third derivative of 6z - 11z3 - 18z*4 + 3z2 + za + 17z4 wrt z. -24z - 60 Let j(f) = f3 - f2 + f + 1. Let h(l) = -94l3 + 2l*2 - 2l - 29. Let u(g) = -h(g) - 2j(g). What is the derivative of u(t) wrt t? 276t*2 Let f(y) = -29y + 35. Suppose -8 + 20 = -2u. Let n(r) = r - 1. Let t(l) = un(l) - f(l). What is the derivative of t(q) wrt q? 23 Suppose -c = 4, 5c + 47 = 3z - 3. What is the second derivative of -17r3 - 15r*3 + 10r*3 - zr wrt r? -132r What is the third derivative of -2s*3 + 132s*5 + 0s*3 + 117s*2 - 236s*2 + 225s*5 + 83s + 117s2 wrt s? 21420s*2 - 12 Let f be -2 - (2 + 0 + -7). Suppose 6 = 5q - 4v, -5q + fv - 3 = -10. What is the derivative of -qb - 4 - 3b + 11 - 14 wrt b? -5 Let o(k) be the third derivative of 7k*5/6 - 205k*4/24 - 313k*2. What is the second derivative of o(d) wrt d? 140 Suppose t - 18 = -2t. Let n(q) = 5q4 - 22. Let z(s) = 1. Let k(f) = tz(f) - n(f). What is the first derivative of k(y) wrt y? -20y3 Let h(o) be the second derivative of 89o*5/5 - 106o*2 + 95o. Find the first derivative of h(d) wrt d. 1068d2 Find the third derivative of -266p*2 - 250p*2 - 279p*2 + 1103p*3 - 642p*3 wrt p. 2766 Suppose -4t - 91 = -11t. Suppose 9 = 6o - 3o. Differentiate 8a + 9 - tao - 7a - a with respect to a. -39a2 What is the first derivative of -5 - 38d - 43 - 95 - 109 wrt d? -38 Let s(i) be the third derivative of -17i7/210 + i6/60 - 11i5/60 - i4/6 + 3i2 - 19. Find the third derivative of s(q) wrt q. -408q + 12 What is the third derivative of 150a5 + 2431a*2 - 2a + 2a - 2449a*2 wrt a? 9000a*2 Find the third derivative of -29 + 2g*3 - 2g*3 - 953928g*4 + 954262g*4 - 2g*2 - 17 wrt g. 8016g Let v = -11/810 - -20/81. Let w(t) be the second derivative of 6t + 0t*4 + 0t*2 - vt*6 + 0t*5 + 7/3t*3 + 0. Find the second derivative of w(n) wrt n. -84n*2 Find the second derivative of 319 - 3c - c - 323 + c*5 - 188c*3 - 2c*5 wrt c. -20c*3 - 1128c Let i(s) = 15s2. Let a(t) = -t4. Let k(n) = 2n - 33. Let j be k(16). Let m(q) = ji(q) - 6a(q). What is the third derivative of m(y) wrt y? 144y Let o(l) = l - 10. Let u(g) = -1 + 0 + 1 - 6. Let t(x) = 13. Let m(n) = 3t(n) + 5u(n). Let d(r) = 6m(r) + 5o(r). What is the derivative of d(i) wrt i? 5 Let s = -4 + 9. Find the second derivative of 12o*5 - 8o - 7o - so*5 wrt o. 140o*3 Let k be (3/((-6)/8))/(-1). Suppose 5l - 48 = -g, 2g - 8 = -2. Find the second derivative of -lm*5 + km*5 - m + 12m wrt m. -100m3 Let y = 0 + 2. What is the third derivative of -gy - 12g*6 + 6g*6 - 8g*6 - 4g*2 wrt g? -1680g*3 What is the second derivative of 5s*2 + 4s*2 - 5s*2 + 66s*2 + s wrt s? 140 Let r(g) = g + 20. Let c be r(-14). Let u be 0 + -1 + 0 - -3. What is the third derivative of 0o*2 - 3o*c - 7o*u + 0o*6 wrt o? -360o3 Let f(q) be the first derivative of q5/5 + 23q4 + q2 - 81q - 160. Find the second derivative of f(k) wrt k. 12k2 + 552k Let g(f) = -f3 - f2 - f. Let m(t) = -3t4 + t3 + 6t*2 - 16t. Let q(r) = -5g(r) - m(r). What is the third derivative of q(a) wrt a? 72a + 24 Find the third derivative of 2m3 - 60007 + 60007 - 2m*2 - 51m*5 + 75m wrt m. -3060m2 + 12 Let w(n) be the third derivative of -5n8/336 + n4/6 - 2n2 + 29n. What is the second derivative of w(y) wrt y? -100y3 Let t(a) = 282a*3 + 7a*2 - 65a + 18. Let q(g) = 142g3 + 4g*2 - 32g + 10. Let k(z) = -7q(z) + 4t(z). What is the second derivative of k(u) wrt u? 804u Let p(l) = 47l - 20. Let r be p(8). Find the second derivative of rz4 + 0z - 9z - 353z*4 wrt z. 36z*2 Differentiate 213o + 29o + 283 + 79o - 33o + 13o wrt o. 301 Let m(c) be the second derivative of -29c + 3/5c*6 + 0c*5 + 0c*4 + 0 + 0c*3 + 16c*2. Find the first derivative of m(x) wrt x. 72x**3 Let j(y)	{ "pile_set_name": "DM Mathematics" }
a*2 + a. Let w be n(1). Determine g so that 42 - 2g*w - 7g - 34 + g = 0. -4, 1 Suppose -110k + 112k = 3j - 28, -j + 9k + 76 = 0. Factor -g*2 + 1/2g*5 + 4g*3 + 3g*j - 2 - 9/2g. (g - 1)(g + 1)3(g + 4)/2 Let y(a) be the first derivative of -a*4/2 - 8a*3 + 31a*2 + 84a - 408. Factor y(w). -2(w - 3)(w + 1)(w + 14) Let t be -4 + -66(-6)/90. Let u(d) be the second derivative of 3d + td*2 + 1/5d*3 + 0 + 1/30d*4. Factor u(k). 2(k + 1)(k + 2)/5 Suppose 5s + 7 = -2k, -4k + 3s = -2k - 17. Let t(b) be the first derivative of 2 + 2/25b5 - 2/15b*3 + 0b + 1/10bk - 1/5b*2. Factor t(i). 2i(i - 1)(i + 1)*2/5 Suppose -2/15i*2 + 0 - 32/15i = 0. Calculate i. -16, 0 Factor 124/9 + 34f - 10/9f*2. -2(f - 31)(5f + 2)/9 Suppose 3m + 11f = 9f + 24, 104 = 13m - 4f. Factor -56 - md - 2/7d2. -2(d + 14)*2/7 Let r be (36/162)/((-4)/3 - -2). Let y(w) be the first derivative of -1/3w*2 + 4 + rw*4 + 0w*3 - 1/9w*6 + 0w + 0w5. Find j such that y(j) = 0. -1, 0, 1 Let y(s) be the first derivative of s5/5 + 23s*4/4 - 8s3 + 500. Factor y(k). k2(k - 1)(k + 24) Let d(n) = 2n4 + 26n*3 + 52n*2 + 16n - 6. Let q(z) = -5z4 - 77z*3 - 156z*2 - 50z + 17. Let w(h) = 17d(h) + 6q(h). Factor w(i). 4i(i - 7)(i + 1)2 Let l(t) = 90t*3 - 5400t*2 - 14t - 42. Let j(x) = -19x3 + 1080x*2 + 3x + 9. Let o(s) = 14j(s) + 3l(s). Solve o(q) = 0 for q. 0, 270 Suppose -2/17i + 2/17i*2 + 0 = 0. Calculate i. 0, 1 Let j be 22/(-60)(-2448)/6732. Solve -jz2 - 4/15z - 2/15 = 0 for z. -1 Let z(c) be the first derivative of 9 + 3/4c - 3/4c*2 + 1/4c*3. Solve z(p) = 0. 1 Factor 4i*2 - 2/5i*3 - 10i + 0. -2i(i - 5)*2/5 Let t be ((-42)/(-14) - 2)/(1/2). Suppose m - i - 5 = 0, m - 5i - 17 = -2m. Determine q so that 0q*t + 0q - 2/3qm + 2/3q*3 + 0 = 0. 0, 1 Let q(h) = -3h*2 + 9h + 2. Let f(z) = z*2 - z. Let d(r) = 5f(r) + q(r). Let v be d(-2). Factor -18g + 16 - 4g*v - 6g*3 + 74g - 8g3. -2(g - 2)(g + 2)(7g + 2) Let j(r) be the second derivative of 0r*3 - 1/21r*7 + 0 - 1/10r*5 - 2/15r*6 + 11r + 0r4 + 0r*2. Factor j(h). -2h*3(h + 1)*2 Factor 3347a + 25a3 - 20a*4 - 10a*2 + 5a*5 - 3347a. 5a2(a - 2)(a - 1)2 Let k(a) = -2a*3 + 5a*2 - a + 4. Let l be k(2). Suppose lb - 14 = -b. Suppose 0tb - 3t*4 + 0 - 13/2t*3 + 2t = 0. What is t? -2, -2/3, 0, 1/2 Let n(t) be the first derivative of -2t3/21 + 3t*2/7 - 4t/7 - 66. Factor n(q). -2(q - 2)(q - 1)/7 Let n(u) be the first derivative of -2u5/5 - 3u*4 - 26u*3/3 - 12u*2 - 8u + 90. Suppose n(q) = 0. What is q? -2, -1 Find f, given that -5f3 + 10f*4 - 5f*3 - 17f*4 + 5f*4 = 0. -5, 0 Let t(w) = 5w - 23. Let a be t(5). Let v(h) be the first derivative of 10/33h3 - 2/11h + 4 - 4/11ha. Determine g, given that v(g) = 0. -1/5, 1 Let r(j) be the third derivative of 0j - 4/3j3 - 1/60j*6 + 0 - 3/4j*4 - 1/5j*5 + 14j*2. Factor r(f). -2(f + 1)*2(f + 4) Let a(w) be the second derivative of 0w5 - 1/3w*6 - 5/6w*3 + 0w*2 - 15w + 0 + 5/6w4 + 5/42w7. Solve a(f) = 0. -1, 0, 1 Let h(f) be the third derivative of f9/52920 + f8/3920 + f7/1764 + 3f4/8 - 19f*2. Let j(n) be the second derivative of h(n). Factor j(o). 2o*2(o + 1)(o + 5)/7 Let m(y) be the second derivative of -y6/45 - 7y*5/60 + 5y*4/18 + 11y*3/6 - 3y*2 - 4y + 11. Suppose m(d) = 0. Calculate d. -3, 1/2, 2 Let c(g) be the second derivative of 0g2 + 0 - 1/4g*4 + 0g*3 + 2g + 1/28g7 + 1/10g*6 - 3/40g5. Solve c(u) = 0. -2, -1, 0, 1 Let l(w) be the second derivative of -w6/330 + 4w5/55 - 47w*4/66 + 40w*3/11 - 225w*2/22 + 85w. Suppose l(n) = 0. Calculate n. 3, 5 Let r(s) be the first derivative of -s*6/10 - 99s*5/25 - 177s*4/20 + 97s*3/5 + 36s*2 - 372s/5 - 529. Determine g so that r(g) = 0. -31, -2, 1 Suppose -108y + 15y = 0. Factor -4/5 + yv + 57/5v*2 + 28/5v*3. (v + 2)(4v - 1)(7v + 2)/5 Let g(m) = -m3 + 2m*2 + 33m - 64. Let r be g(2). Let 1/2h2 + 2 + rh = 0. Calculate h. -2 Let m(r) = 8r3 + 24r*2 - 4r - 92. Let u(t) = t3 + t2 + t + 1. Let y(f) = -m(f) + 4u(f). Factor y(p). -4(p - 2)(p + 3)(p + 4) Let r(m) be the third derivative of m8/1512 + m7/945 - m*6/270 + 15m*2 - 3m. Factor r(y). 2y3(y - 1)(y + 2)/9 Let m = -89 + 93. Factor -3y - 10y3 + 87y*4 - 81y*m + 3y + 4y2. 2y*2(y - 1)(3y - 2) Let k(s) = 12s2 - 110s + 790. Let w(c) = c*2 - 3c - 1. Let q(y) = -k(y) + 10w(y). Find n such that q(n) = 0. 20 Let o(j) be the third derivative of 0 - 18j*2 - 1/42j*4 + 0j + 1/21j3 + 1/210j*5. Factor o(z). 2(z - 1)*2/7 Let z = 158 - 63. Let t(w) = -zw*2 + 97w*2 - 2w - 2w. Let n(l) = -1. Let h(d) = -2n(d) + t(d). Factor h(v). 2(v - 1)2 Let f(c) be the third derivative of c8/5040 + c7/420 + c6/90 - 3c*5/20 - 12c2. Let t(r) be the third derivative of f(r). Find n, given that t(n) = 0. -2, -1 Let a(q) = q3 + q. Let o = -41 - -45. Let s(y) = 2y4 + 4y*3 - 36y - 32. Let i(l) = oa(l) + s(l). What is p in i(p) = 0? -2, 2 Let q(s) be the third derivative of 0 + 0s + 5/48s4 - 30s*2 + 1/120s*5 - 1/2s*3. Let q(z) = 0. Calculate z. -6, 1 Let b = 17313/5 + -3514. Let w = b + 52. Factor w - 3/5d*2 + 1/5d*3 - 1/5d. (d - 3)(d - 1)(d + 1)/5 Let t(s) be the second derivative of -49s5/50 - 7s*4/6 - 2s*3/5 + 50s. Factor t(o). -2o(7o + 2)(7o + 3)/5 Determine i, given that -6i3 + i3 - 85i - 368i*2 - 418i*2 - 140 + 0i*3 + 836i*2 = 0. -1, 4, 7 Suppose 22p - 1799 = 15p. Factor 2b + 2b + 263b*2 + 2b*3 - pb*2. 2b(b + 1)(b + 2) Let p(h) = -h + 7. Let m(i) = -22i2 + 16i + 36. Let t(x) = 2m(x) - 10p(x). Factor t(z). -2(z - 1)(22z + 1) Factor 0 - 1/8m*3 + 5/8m*2 + 3/4m. -m(m - 6)(m + 1)/8 Let d(y) = 18y3 - y2 - y - 1. Let m be d(-1). Let z = 22 + m. Factor 0h + zh4 + 15/7h*5 + 0 + 0h*2 + 6/7h*3. 3h*3(h + 1)(5h + 2)/7 Let v(h) be the second derivative of -h7/5880 - h6/630 - h5/168 - h4/84 + 8h3/3 + 7h. Let p(c) be the second derivative of v(c). Factor p(g). -(g + 1)*2(g + 2)/7 Find c, given that 16/11 + 450/11c4 + 1230/11c*3 + 548/11c*2 - 216/11c = 0. -2, -1, 2/15 Let c(t) be the second derivative of -35/6t3 - 25/2t*2 - 1/20t*5 + 0 + 16t - 11/12t4. Find y such that c(y) = 0. -5, -1 Factor 12w*2 + 20w*3 + 4w*3 + 32w*4 - 23w*4. 3w*2(w + 2)(3w + 2) Let b(p) be the first derivative of -p4/4 + p - 19. Let o(w) = w4 + 7w3 + 9w*2 + 7w. Let z(m) = 2b(m) + o(m). Factor z(f). (f + 1)3(f + 2) Let j(x) be the first derivative of -x*3/30 + 3x*2/5 + 13x/10 + 223. What is q in j(q) = 0? -1, 13 Let o(y) = -81y + 1625. Let m be o(20). Factor 5/2u*5 - mu*3 + 0 + 5/2u + 0u4 + 0u*2. 5u(u - 1)2(u + 1)2/2 Let g(c) be the third derivative of c7/1170 + c6/312 + c5/195 + 19c4/24 - 10c*2. Let o(h) be the second derivative of g(h). Factor o(w). 2(2w + 1)(7w + 4)/13 Suppose 0 - 2b*2 + 1/2b*3 + 0b = 0. Calculate b. 0, 4 Let i be 54/(-45)(-7 + (-678)/(-99)). Let -iy*2 + 6/11y - 4/11 = 0. Calculate y. 1, 2 Let u(i) be the first derivative of -2/5i5 + 0i - 10/3i3 + 2i*2 + 2i*4 + 1. Factor u(c). -2c(c - 2)(c - 1)*2 Factor 0i + 3/4i3 - 1/2i*2 + 0 - 1/4i4. -i2(i - 2)(i - 1)/4 Let c(p) be the first derivative of -16 - 2/17p2 + 0p + 1/34p4 - 2/51p*3. Find h, given that c(h) = 0. -1, 0, 2 Let w = 9 - -646. Determine m, given that 2m*3 - 655m*2 + wm2 - m - m5 = 0. -1, 0, 1 Let r(n) = -35n2 + 174n + 7. Let q be r(5). Find b, given that 0 + 1/8bq + 1/4b = 0. -2, 0 Let o(v) be the second derivative of 2v7/21 - 2v*6/5 - 18v*5/5 - 4v*4/3 + 16v*3 + v - 179. Factor o(b). 4b(b - 6)(b - 1)(b + 2)2 Let r(f) = -17f*4 + 9f*3 + 16f*2 - 60f + 40. Let j(o) = 15o4 - 10o*3 - 15o*2 + 60o - 40. Let x(t) = -6j(t) - 5r(t). Factor x(y). -5(y - 2)2(y - 1)(y + 2) Factor -392n + 25n2 + 0n*2 - 21n*2 + 388. 4(n - 97)(n - 1) Let j(y) be the second derivative of -y6/80 + 3y5/80 + y4/4 - 9y3/8 + 27	{ "pile_set_name": "DM Mathematics" }
fourth biggest value in 2/15, -34, -4, -10, 18? -10 Which is the third biggest value? (a) 0.06916 (b) 0.3 (c) -6 c Which is the biggest value? (a) -0.209 (b) -1/6 (c) -2/21 (d) -269 c What is the second biggest value in -24, -14, -0.07, 2/15, -3/2? -0.07 What is the second smallest value in 4, -14370, 5, 2? 2 What is the smallest value in 1, 872, -0.1, -2/3, 2/13, -0.5? -2/3 Which is the fifth smallest value? (a) -1/4 (b) -12/7 (c) 3 (d) -3/2 (e) 0.06 c Which is the second smallest value? (a) -0.32 (b) 3 (c) -0.372 a Which is the smallest value? (a) 19 (b) -11 (c) 7 b What is the third biggest value in 192, 52, -5, 1? 1 Which is the fourth biggest value? (a) -4 (b) 3 (c) -1.4 (d) -6/5 (e) -7 (f) 0.05 c Which is the fourth biggest value? (a) -3 (b) 8/35 (c) -0.4 (d) -528 d Which is the second biggest value? (a) 34.9 (b) 0.5 (c) 4/5 (d) 0.4 (e) 5 (f) -0.4 e Which is the second biggest value? (a) 18 (b) -11 (c) 3/1477 c Which is the biggest value? (a) -40 (b) -19/5 (c) -2/7 c What is the biggest value in 14.3, -4, -2.3, 0.2, 4? 14.3 Which is the biggest value? (a) -0.5 (b) 3 (c) 158/47 (d) 2/7 c What is the second biggest value in 0.6, -19, 12? 0.6 What is the biggest value in -0.00869, 98, -5? 98 Which is the biggest value? (a) 5 (b) -1 (c) 0.047 (d) -88 a What is the third biggest value in 798, 5, 3, -1, 1/10, -2? 3 Which is the third smallest value? (a) 4 (b) 54/13 (c) 0.07 (d) 0 a What is the biggest value in -0.541, 5, 1/5, 18? 18 Which is the third smallest value? (a) 3 (b) -3.26 (c) -0.5 (d) -50 c Which is the second smallest value? (a) 62 (b) -1.42 (c) -3 b What is the second smallest value in -1/6, 326, -5, 0.1, 2/9? -1/6 What is the smallest value in -1/4, 6/173, 4.5? -1/4 What is the fifth smallest value in 4, 1/5, 3/8, -8/3, 7? 7 Which is the third biggest value? (a) -8 (b) 10.53 (c) 0 a Which is the biggest value? (a) -3/2 (b) 5/4 (c) 0.7 (d) -1/12 (e) -4 b What is the fifth biggest value in 12, 617, 0.2, -1/9, 5? -1/9 Which is the fourth smallest value? (a) -32/7 (b) 108 (c) 0.4 (d) 0.05 b What is the smallest value in 0.1013, 3/8, 0.5, 8, 0.3? 0.1013 What is the biggest value in -3.6, -3/4, -1/3, 1? 1 What is the second smallest value in 2/15, 3/7, 0.51, -587? 2/15 What is the second biggest value in -32/5, 69, -15? -32/5 What is the biggest value in 4984, -1/7, 2? 4984 Which is the biggest value? (a) -1/7 (b) -11 (c) -3/4 (d) 2 d Which is the third smallest value? (a) 9/94 (b) -0.02 (c) 4/5 (d) 9 (e) 1/2 (f) 4 e What is the fourth biggest value in 18, 0.2, -7/4, -0.4, -8? -7/4 Which is the fourth smallest value? (a) -43 (b) 1/5 (c) -4 (d) -2.1 (e) -0.1 (f) 0.5 e Which is the third biggest value? (a) -313 (b) 1298 (c) -0.3 (d) 3 c What is the biggest value in 4, 0, 3, 67, 1, -2/21? 67 What is the third biggest value in 3/89, -3/2, 1/17, 3/7, -2? 3/89 Which is the fourth smallest value? (a) -26 (b) -881 (c) 0.3 (d) 1/5 c What is the second smallest value in 0.2, 1089, 1? 1 Which is the biggest value? (a) 2/29 (b) -0.1 (c) 293 (d) -4 c Which is the fourth biggest value? (a) -3 (b) 5 (c) -12 (d) 2412 (e) -0.5 (f) -1/5 e Which is the fourth biggest value? (a) -9/4 (b) 2 (c) 6/7 (d) 21/2 a What is the second smallest value in 0.03, 4/5, 2/17, -3/2, 4, -17738? -3/2 What is the third biggest value in -0.3, -3/884, -7/17? -7/17 What is the fourth smallest value in -2, -5, 0.3, 0, 4, -431? 0 Which is the second biggest value? (a) -10 (b) 58 (c) 1/4 c What is the third biggest value in 2/43, 9/4, 5, 0.05, 2/9? 2/9 Which is the smallest value? (a) -0.062 (b) -3929 (c) 2/11 b What is the second biggest value in -2/11, 1/2, -3, 0.24, 119, 5? 5 Which is the fifth biggest value? (a) -2 (b) -1 (c) -5 (d) -7250 (e) -4 d Which is the third smallest value? (a) 1/2 (b) -9 (c) -0.693 (d) 7 (e) 2/13 (f) 5/4 e Which is the second biggest value? (a) -39 (b) -2/65 (c) 0.1 (d) 0.5 (e) -17/23 c Which is the second smallest value? (a) 0 (b) 33 (c) 5 (d) -115 a What is the third biggest value in 15, 5, -4, -3/7, 20, -2/7? 5 What is the biggest value in 2/157, 22.3, -0.2? 22.3 Which is the second smallest value? (a) -2/27 (b) -2 (c) -4/9 (d) 0.3 (e) 34 (f) 3/5 c Which is the second biggest value? (a) -1.6 (b) 0.0367 (c) -0.5 c Which is the second smallest value? (a) -4 (b) -255/4 (c) 33/7 a Which is the biggest value? (a) 16 (b) 55/2 (c) 0.5 (d) 0 b What is the third smallest value in -2, -5, 408, -224/9? -2 Which is the fourth biggest value? (a) 2/5 (b) 1/2 (c) 313 (d) -0.49 (e) -1/4 (f) -0.3 e Which is the second biggest value? (a) 12.6 (b) 0.244 (c) 5 c What is the smallest value in -0.03, 27/5, -6, -12? -12 Which is the second smallest value? (a) -0.4 (b) -0.1 (c) 54 (d) 3 (e) 4 (f) 58 b What is the smallest value in 1, -3/11, 3/19, -2/3, -1? -1 Which is the smallest value? (a) -4/331 (b) 2/159 (c) 3 (d) -2/15 d What is the fifth smallest value in -4, 0, -207, -28, 3? 3 What is the second biggest value in 71, 3/2, -4, -1150.7? 3/2 What is the third smallest value in 4/3, -13, 674, -4? 4/3 What is the second biggest value in -1/10, -2/73, 3, -4, 4? 3 What is the second biggest value in -4, -34, 1717, 1? 1 What is the fourth biggest value in 4, -27, 3/4, -1/5, 9/5? -1/5 What is the biggest value in -0.05627, 4, 0.4? 4 What is the second smallest value in 3, -14, 0.5, 0.056, 1/6, -1/3? -1/3 What is the third smallest value in 4, -0.3, -1/2, -2614? -0.3 Which is the second biggest value? (a) -2.9 (b) 0.22 (c) -23 (d) 1/3 b What is the smallest value in 4, -3/7, -142, -0.06, 2/13, -2/7? -142 What is the fourth smallest value in -0.3, -4, -39, 3/19, 9.7? 3/19 Which is the fourth smallest value? (a) -0.28 (b) 1 (c) 0 (d) -273 b What is the fourth biggest value in -0.54, 13, 9, 3/8? -0.54 What is the second smallest value in 9, -0.01, 1/8, -5? -0.01 Which is the fourth biggest value? (a) 8 (b) 1/5 (c) -9 (d) -58 d What is the smallest value in 24, 2/5, 836, 3? 2/5 Which is the fourth smallest value? (a) -2 (b) 14.7 (c) 4 (d) 27 (e) 0.4 b Which is the fifth smallest value? (a) 0.4 (b) -9.9 (c) 1 (d) 0.08 (e) -5 c What is the third biggest value in -0.111, -2, 0.01, -3? -2 What is the biggest value in -1/23, -2/15, -4, -1, 268? 268 What is the sixth biggest value in 18, 33, 10, -5, -8, -1? -8 What is the fourth biggest value in 65, -1, 25, -7? -7 Which is the second biggest value? (a) -1 (b) -0.4 (c) 8/7 (d) 3/5 (e) 119 c What is the third smallest value in -0.05485, 1/7, 0.5, 2/5? 2/5 Which is the third smallest value? (a) -4/7 (b) -0.93 (c) 13 c What is the second smallest value in -1274, -6, -3/5, -5, 3/7? -6 What is the smallest value in -1/79, 819, -3, -2/3? -3 Which is the biggest value? (a) 2/51 (b) 75.8 (c) -1 b What is the third smallest value in -14, 9, -77, 0, -5? -5 What is the biggest value in 4, -1, -3.8, 2.1? 4 Which is the second biggest value? (a) -2.2 (b) -1/4 (c) -17 (d) -0.3 d Which is the second biggest value? (a) 2/7 (b) -3 (c) -1173 (d) 2/9 (e) 5 (f) 0.04 a Which is the third biggest value? (a) -56 (b) 0.15 (c) -2 (d) -1/9 c What is the fourth biggest value in 2/3, -12/167, 3, -8? -8 What is the sixth biggest value in -3/8, 6, 2, 3, -15, -2? -15 Which is the fourth biggest value? (a) 344 (b) 2 (c) -0.7 (d) -127 d What is the third biggest value in 1, -2/121, 3, -4, 1.3? 1 What is the second biggest value in -2/23, 0, -1.2, 0.1, -5? 0 What is the biggest value in -18, -0.1, 1/4, 5.75? 5.75 What is the third biggest value in -53, 4014, -0.5? -53 What is the third smallest value in 0.5, 1/20, -0.22, 1, -3/4, 5? 1/20 What is the fourth smallest value in 69, -2, 1, 2/21, 8, -4? 1 What is the second biggest value in -78, 3, -8/29? -8/29 What is the third biggest value in -865, -4, 1? -865 What is the smallest value in -2, -313, -0.24? -313 Which is the second biggest value? (a) -0.24 (b) 1/4 (c) 0.04 (d) -0.2 (e) 0.27 (f) -2/15 b Which is the third biggest value? (a) 373 (b) -2 (c) -26/5 (d) 4 (e) -4 b What is the fourth smallest value in 4.4, 0.5, -2, 3, 0.25, 12? 3 Which is the smallest value? (a) 0.44 (b) 0.3 (	{ "pile_set_name": "DM Mathematics" }
e? False Is 301177 composite? False Is 15055 a composite number? True Is 669733 a prime number? True Is 320627 a composite number? False Is 19769 a composite number? True Is 316631 a prime number? False Is 126571 a prime number? False Is 219911 composite? False Is 1059985 a composite number? True Is 14273 prime? False Is 305543 composite? True Is 38299 a prime number? True Is 3487 a prime number? False Is 644477 a prime number? False Is 2345649 composite? True Is 82261 composite? False Is 65183 a composite number? False Is 72739 prime? True Is 42011 composite? True Is 71069 a prime number? True Is 310019 prime? True Is 1457 a prime number? False Is 5153 a prime number? True Is 67591 a prime number? False Is 7229 prime? True Is 14591 prime? True Is 89867 a prime number? True Is 94873 composite? False Is 108631 a composite number? False Is 1943 composite? True Is 21001 prime? True Is 76597 prime? True Is 3813893 a composite number? False Is 766345 prime? False Is 22549 composite? False Is 85721 a prime number? False Is 13799 composite? False Is 1785127 a prime number? False Is 459353 composite? False Is 223467 prime? False Is 943471 composite? False Is 3119 prime? True Is 1251007 prime? False Is 13273 a prime number? False Is 1381783 a composite number? True Is 37043 a composite number? True Is 64765 a composite number? True Is 489479 prime? True Is 170426 a composite number? True Is 107807 a prime number? False Is 87 composite? True Is 37477 composite? True Is 297683 prime? True Is 18737 prime? False Is 60373 prime? True Is 10627 a composite number? False Is 96598 a composite number? True Is 1113941 a composite number? False Is 15991 a composite number? False Is 107837 a prime number? True Is 28111 composite? False Is 50459 prime? True Is 18131 a prime number? True Is 42193 a prime number? True Is 1993 composite? False Is 67699 prime? True Is 83203 a prime number? True Is 30881 composite? False Is 2479219 composite? False Is 3025591 composite? True Is 4987 a composite number? False Is 3896661 composite? True Is 6879 a prime number? False Is 109229 a prime number? True Is 8353 prime? True Is 3151 prime? False Is 23927 prime? False Is 5981 a composite number? False Is 4783 a prime number? True Is 3341081 a prime number? False Is 49673 a composite number? True Is 52223 a prime number? True Is 156263 prime? False Is 18823 composite? True Is 10351 a composite number? True Is 158867 prime? True Is 133799 composite? True Is 22343 composite? False Is 1124053 a prime number? False Is 63901 a composite number? False Is 44567 a composite number? True Is 229937 composite? False Is 101431 prime? False Is 19814 composite? True Is 28723 prime? True Is 107207 prime? False Is 8609 a prime number? True Is 691 a composite number? False Is 1471 a prime number? True Is 4341 prime? False Is 262453 a composite number? True Is 35377 composite? True Is 27239 prime? True Is 2477 a prime number? True Is 1137439 a prime number? True Is 13517 composite? True Is 1231715 a prime number? False Is 2777 a composite number? False Is 88307 a prime number? False Is 230539 a prime number? True Is 4367 prime? False Is 875293 composite? True Is 5779 a composite number? False Is 50222 a composite number? True Is 23678 prime? False Is 204251 composite? False Is 97327 a prime number? True Is 21377 a prime number? True Is 25385 a composite number? True Is 2031 prime? False Is 20977 a composite number? True Is 3449 a composite number? False Is 4954 a composite number? True Is 24943 prime? True Is 13453 a composite number? True Is 1768181 a composite number? False Is 221159 composite? False Is 462697 composite? False Is 19571 composite? False Is 853 a prime number? True Is 967663 a prime number? True Is 7649 composite? False Is 124739 a composite number? False Is 29033 a composite number? False Is 43691 prime? True Is 51767 a composite number? False Is 2255863 composite? True Is 2447 composite? False Is 3319 a prime number? True Is 566653 composite? False Is 6261 composite? True Is 17371 composite? True Is 8579 a prime number? False Is 199931 a prime number? True Is 71747 prime? False Is 5079 prime? False Is 38167 prime? True Is 71963 a prime number? True Is 272117 composite? True Is 19531 a composite number? False Is 24861 prime? False Is 6031 composite? True Is 708893 composite? False Is 589 a composite number? True Is 38083 a composite number? False Is 9871 a composite number? False Is 431983 composite? False Is 63241 composite? False Is 156413 composite? True Is 376757 prime? True Is 15683 a composite number? False Is 2893 a prime number? False Is 24721 a composite number? True Is 192313 prime? False Is 48407 a prime number? True Is 11579 prime? True Is 211 a composite number? False Is 1693 prime? True Is 364699 a prime number? True Is 378199 prime? False Is 320123 composite? True Is 649 a prime number? False Is 13537 prime? True Is 57949 a composite number? True Is 22433 prime? True Is 30553 a composite number? False Is 379351 composite? True Is 6065 a prime number? False Is 131101 composite? False Is 305 prime? False Is 811403 composite? True Is 16361 composite? False Is 73397 a composite number? True Is 1019503 a prime number? True Is 13523 composite? False Is 23801 a prime number? True Is 4483 prime? True Is 260171 prime? True Is 1669163 a composite number? False Is 4171 a prime number? False Is 312701 a prime number? True Is 59233 prime? True Is 512651 a prime number? False Is 1288477 a composite number? True Is 3821 a composite number? False Is 1531 composite? False Is 43801 a composite number? False Is 2173 composite? True Is 1721914 composite? True Is 2059 a prime number? False Is 60149 a prime number? True Is 730031 composite? True Is 33827 composite? False Is 323567 prime? True Is 1969 a prime number? False Is 2196011 a prime number? True Is 72001 a prime number? False Is 2939 composite? False Is 46073 a prime number? True Is 6739 prime? False Is 15517 a composite number? True Is 850717 a prime number? False Is 152249 a prime number? True Is 124471 a prime number? True Is 260815 a prime number? False Is 25663 a composite number? True Is 7789 a composite number? False Is 100379 a prime number? True Is 1765 a prime number? False Is 2227 prime? False Is 8887 a composite number? False Is 18947 a composite number? False Is 328991 a composite number? True Is 89041 a prime number? True Is 21269 prime? True Is 91079 prime? True Is 37451 a prime number? False Is 35195 a prime number? False Is 779 prime? False Is 28529 a prime number? False Is 1411541 a composite number? False Is 3196757 a composite number? True Is 2203 a prime number? True Is 20455 a prime number? False Is 6881 prime? False Is 12055 prime? False Is 75769 a composite number? True Is 368477 a prime number? False Is 1011577 prime? False Is 1005667 a prime number? False Is 8977 a prime number? False Is 12469 a prime number? False Is 331754 prime? False Is 476579 composite? False Is 31281 a prime number? False Is 579167 prime? False Is 31549 prime? False Is 213635 prime? False Is 23239 prime? False Is 8083 a composite number? True Is 77005 a composite number? True Is 85661 a prime number? True Is 7829 a prime number? True Is 7059683 prime? True Is 9093739 a prime number? True Is 16033 a prime number? True Is 38803 a composite number? False Is 4629 prime? False Is 2735 a composite number? True Is 11677 prime? True Is 47347 prime? False Is 10435 prime? False Is 108973 composite? True Is 31555 composite? True Is 10411 a prime number? False Is 4861 composite? False Is 487867 a composite number? True Is 589859 a composite number? False Is 299 a composite number? True Is 81633 a prime number? False Is 3389 a composite number? False Is 1060513 a prime number? True Is 9781 prime? True Is 25867 a prime number? True Is 166955 prime? False Is 136783 a composite number? True Is 18709 a composite number? True Is 14719 composite? True Is 360257 composite? False Is 863767 composite? False Is 474949 a prime number? True Is 20153 composite? True Is 12689 a composite number? False Is 148921 prime? True Is 6481 prime? True Is 1314043 prime? True Is 107791 prime? True Is 1257541 a prime number? False Is 2881 a prime number? False Is 919	{ "pile_set_name": "DM Mathematics" }
3/7 - 53400o2 - 570312o/7 = 0. -3, 0, 178 Let -l*4 - 45819l*3 - 45818l*2 = 0. Calculate l. -45818, -1, 0 Let -153t*4/7 + 186t*3/7 + 108t*2/7 - 186t/7 + 45/7 = 0. What is t? -1, 1/3, 15/17, 1 Solve 2t5/3 + 2638t*4/3 + 863264t*3/3 - 4361264t*2/3 + 7001312t/3 - 3505952/3 = 0 for t. -662, 1, 2 Solve -4h2 + 106092h + 106096 = 0. -1, 26524 Solve 4t2/7 + 184t/7 + 1860/7 = 0 for t. -31, -15 Factor -20y4 - 104948y*3/3 - 20398004y*2 - 3965824852y - 1585242296/3. -4(y + 583)3(15y + 2)/3 Factor n2 - 688n + 60736. (n - 584)(n - 104) Suppose -2q*2/9 + 3326q/3 = 0. What is q? 0, 4989 Factor -2f2/11 - 42f + 3824/11. -2(f - 8)(f + 239)/11 Find q, given that -2q3/5 + 370q*2 - 62368q/5 + 12104 = 0. 1, 34, 890 Find x, given that 4x4 + 176x*3 + 1316x*2 + 1864x - 3360 = 0. -35, -6, -4, 1 Let -y*3/6 + 2625y*2 - 5249y/2 - 15749/3 = 0. What is y? -1, 2, 15749 Factor q*3 - 5237q*2 + 146048q - 1020964. (q - 5209)(q - 14)2 Solve -8r*5/9 + 1030r*4 - 43898r*3/9 + 17698r*2/3 - 11534r/9 - 2308/3 = 0. -1/4, 1, 3, 1154 Factor -i*2 - 554i. -i(i + 554) Solve -22b*5/5 + 1948b*4/5 - 59972b*3/5 + 725048b*2/5 - 2597862b/5 + 242172 = 0 for b. 6/11, 5, 21, 31 Let -u*5/8 - 69u*4/4 - 4607u*3/8 + 5815u*2/4 + 16275u/2 + 6125 = 0. What is u? -70, -2, -1, 5 Solve -3o4 + 438o*3 - 18015o*2 + 147288o - 291312 = 0 for o. 3, 7, 68 Find m, given that -3m4 + 195m*3 + 2685m*2 + 6645m + 4158 = 0. -9, -2, -1, 77 Solve 88u3 - 1338u*2 + 3438u - 648 = 0. 9/44, 3, 12 Factor -12a3 - 2656a*2 - 6052a + 17520. -4(a + 4)(a + 219)(3a - 5) Let -3u5/4 + 111u*4 - 7839u*3/4 + 10227u*2/2 - 3264u = 0. What is u? 0, 1, 2, 17, 128 Factor 2t2 + 886044t + 98134246242. 2(t + 221511)2 Determine v, given that 2v*2/11 - 5270v/11 - 230308/11 = 0. -43, 2678 Factor -2w4 + 62w*3 - 388w*2 - 1040w. -2w(w - 20)(w - 13)(w + 2) Factor 2l4/3 - 514l*3 - 7810l*2 - 117650l/3 - 65500. 2(l - 786)(l + 5)3/3 Solve j5 + 77j4 + 357j*3 - 233j*2 - 1234j - 720 = 0 for j. -72, -5, -1, 2 Suppose 4m2 - 111644m + 223272 = 0. What is m? 2, 27909 Suppose 24d4 + 1228d*3 + 108d*2 - 4912d - 816 = 0. Calculate d. -51, -2, -1/6, 2 Find n such that 2n5/9 - 742n*4/9 + 65360n*3/9 + 72176n*2 + 9120n - 866400 = 0. -6, 3, 190 Determine g, given that -2g2 - 464g + 24930 = 0. -277, 45 Determine n, given that n*5 - 370n*4 - 16851n*3 = 0. -41, 0, 411 Suppose 4i*3 - 2296i*2 - 52640i + 114432 = 0. Calculate i. -24, 2, 596 Factor -64p3 - 9952p*2 + 25180p - 15800. -4(p + 158)(4p - 5)2 Suppose -4b*3/7 - 5136b*2/7 - 5132b/7 = 0. What is b? -1283, -1, 0 Solve -5i4 + 41180i*3 - 41155i*2 - 164720i + 164700 = 0 for i. -2, 1, 2, 8235 Determine z so that z*5 + 5891z*4 + 11565996z*3 + 7564157456z*2 - 7575729344z = 0. -1964, 0, 1 Let -3g4 - 4692g*3 - 1834569g*2 + 4692g + 1834572 = 0. What is g? -782, -1, 1 Let -5t3 - 2060t*2 - 12225t - 18270 = 0. What is t? -406, -3 Let -3y5/4 - 41521y*4/4 - 71857277y*3/2 - 167588559y*2/2 - 239376643y/4 - 47872561/4 = 0. What is y? -6919, -1, -1/3 Factor -h*2/9 + 1429h/9 - 6136/3. -(h - 1416)(h - 13)/9 Factor -m3/4 + 3697m*2/4 - 863860m + 17735781. -(m - 1838)*2(m - 21)/4 Factor 3t2 - 336942t + 9460825947. 3(t - 56157)2 Factor -c3 - 303c*2 - 1191c + 1495. -(c - 1)(c + 5)(c + 299) Factor c*2 - 4010c + 4009. (c - 4009)(c - 1) What is i in 4785i*2/2 + 14361i/2 + 9 = 0? -3, -2/1595 Factor 8b3 + 23876b*2 - 71655b/2 + 13437. (b + 2986)(4b - 3)*2/2 Factor 255r*4/4 - 166521r*3/4 + 1959r*2/2. 3r*2(r - 653)(85r - 2)/4 Factor -2v3/3 - 8v*2/3 + 94v/3 + 140. -2(v - 7)(v + 5)(v + 6)/3 Factor 2p*3/11 + 1302p*2/11 + 231750p/11 + 572886. 2(p + 33)(p + 309)2/11 Find x such that x5/6 - 1960x4/3 - 11808x*3 - 71093x*2/3 + 1646447x/6 - 238249 = 0. -11, 1, 3, 3938 Suppose q*2 + 776680q + 150807955600 = 0. Calculate q. -388340 Factor -2t3 + 3780t*2 - 1759296t - 25376512. -2(t - 952)2(t + 14) Solve -3y5 - 546y*4/5 + 3393y*3/5 - 5616y*2/5 + 2268y/5 = 0 for y. -42, 0, 3/5, 2, 3 Determine m, given that 1521m3 - 31629m*2 - 6540m - 252 = 0. -2/13, -2/39, 21 Factor 3f2 - 4236078f + 1495363068507. 3(f - 706013)2 Factor p4/3 + 11p*3/3 + 34p*2/3 + 8p. p(p + 1)(p + 4)(p + 6)/3 Factor -2m*2/5 - 276m + 15422/5. -2(m - 11)(m + 701)/5 Find a such that -a*3 + 111a*2/2 + 19037a/2 - 4773 = 0. -74, 1/2, 129 Find w such that w*2/6 - 307w/2 - 462 = 0. -3, 924 Solve p*5 - 38p*4 + 281p*3 + 56p*2 - 2460p + 3024 = 0. -3, 2, 9, 28 Find p such that -3p5 - 507p*4 - 24249p*3 - 223749p*2 + 522288p - 273780 = 0. -78, -15, 1 Find h, given that -12h5 - 263374h*4 - 1445100216h*3 + 240857352h*2 = 0. -10974, 0, 1/6 Determine l so that 4l*2 + 374856l - 2624188 = 0. -93721, 7 What is x in -3x2/2 - 7755x/2 - 3876 = 0? -2584, -1 Factor -k*2/4 - 533k/4. -k(k + 533)/4 Find a such that -2a*3 - 464a*2 - 8130a - 7668 = 0. -213, -18, -1 Determine l so that 18l3 + 10275l*2 - 269913l + 44700 = 0. -596, 1/6, 25 Factor 4z2 - 472z - 960. 4(z - 120)(z + 2) Suppose -2b3 - 438b*2 - 14256b - 38880 = 0. What is b? -180, -36, -3 Factor b*3/10 - 41471b*2/10 + 82939b/10 - 41469/10. (b - 41469)(b - 1)2/10 Determine k, given that -2k*4/5 + 2k*3 + 3292k*2/5 + 30144k/5 - 370944/5 = 0. -24, 7, 46 Factor p*3 - 12406p2. p2(p - 12406) Factor h5/5 + 2237h*4/5 - 6717h*3/5 + 6719h*2/5 - 448h. h(h - 1)3(h + 2240)/5 Suppose 22a2 + 164306a - 89628 = 0. Calculate a. -7469, 6/11 Determine j, given that 5j3/2 + 2975j*2 - 17885j/2 + 5965 = 0. -1193, 1, 2 Factor -5l2 + 530l - 1545. -5(l - 103)(l - 3) Suppose n*5/8 + 193n*4/8 + 6029n*3/4 + 57895n*2/2 - 97759n + 67280 = 0. Calculate n. -80, -58, 1, 2 Factor 3q3 + 600q*2 + 15975q + 114750. 3(q + 15)2(q + 170) Suppose 525z4 - 3960z*3 + 10926z*2 - 12936z + 5445 = 0. Calculate z. 1, 15/7, 11/5 Factor -3x3 - 14883x*2 - 18195432x + 655200420. -3(x - 35)(x + 2498)*2 Let 3t*2 - 3990t + 132192 = 0. Calculate t. 34, 1296 Factor -5v2 + 3125v + 9420. -5(v - 628)(v + 3) Factor -y*2/5 - 122724y/5 - 3765295044/5. -(y + 61362)*2/5 Factor 5g*3 - 295g*2 + 4760g - 11760. 5(g - 28)2(g - 3) Let 10g5 - 1165g*4 - 4310g*3 + 13200g*2 = 0. Calculate g. -11/2, 0, 2, 120 Solve -4z*5 - 38024z*4 - 90097156z*3 + 1270006144z*2 + 2810151680z + 1450086400 = 0. -4760, -1, 16 Let -q*5/2 - 12q*4 + 10q*3 + 537q*2 + 1997q/2 + 483 = 0. Calculate q. -23, -6, -1, 7 Find l such that 3l2/7 - 137628l/7 + 137607 = 0. 7, 45869 Let 3n4/4 + 8403n*3/2 + 46125n*2 - 8403n/2 - 184503/4 = 0. Calculate n. -5591, -11, -1, 1 Factor 5w2 - 9052450w + 4097342550125. 5(w - 905245)2 Find v, given that 2v*3 + 206v*2 + 5668v + 19504 = 0. -53, -46, -4 What is u in 28u5 + 1240u*4 + 6484u*3 - 8216u*2 - 17744u - 4256 = 0? -38, -7, -1, -2/7, 2 Factor -5t2 - 13670t. -5t(t + 2734) Suppose 23t4/2 + 91t*3/4 - 127t*2 - 541t/4 + 3 = 0. What is t? -4, -1, 1/46, 3 Factor -2s4/3 + 185s*3/3 - 4004s*2/3 + 8428s. -s(s - 14)2(2s - 129)/3 Solve l2/3 + 14l/3 - 41285 = 0 for l. -359, 345 Let -4i2/7 - 1844i/7 + 264 = 0. What is i? -462, 1 What is m in 2m5/5 - 18588m*4/5 - 74372m*3/5 - 111568m*2/5 - 74382m/5 - 18596/5 = 0? -1, 9298 Factor -3t3 + 7929t*2 - 5397849t + 208189923. -3(t - 1301)2(t - 41) Find w such that -3w2 + 89199w + 89202 = 0. -1, 29734 Factor -k*3/2 + 1281k*2 + 5130k + 5132. -(k - 2566)(k + 2)2/2 Let -c4/5 + 2054c*3/5 + 98131c*2/5 + 1292764c/5 + 3050652/5 = 0. Calculate c. -22, -3, 2101 Find i such that -2i2/7 - 584i/7 + 1770/7 = 0. -295, 3 Find w such that 3w5 + 8727w*4 + 6351021w*3 + 6194085w*2 - 107689056w + 95135220 = 0. -1454, -5, 1, 3 Factor -5c3 + 1975c*2 - 11670c. -5c(c - 389)(c - 6) Suppose 3z*2/2 + 285z/2 - 12069 = 0. What is z? -149, 54 Suppose 10z4 - 8765z*3 + 39300z*2 - 52340z + 17440 = 0. What is z? 1/2, 2	{ "pile_set_name": "DM Mathematics" }
rt(170)4)))/((-5sqrt(120))/sqrt(12) - (sqrt(10) - sqrt(30)/sqrt(147))). -21sqrt(17)/41 Simplify (-4(sqrt(80)4 - sqrt(80)) - -1(sqrt(80) + sqrt(80) + -3 + sqrt(80)) - (0 + (2sqrt(80) + sqrt(80))-2 + sqrt(80) + 2 + sqrt(80) + -2))*2. 120sqrt(5) + 2009 Simplify (sqrt(170) - (sqrt(170) + (1sqrt(170)-6 - sqrt(170))) - sqrt(170))/(sqrt(120)/(3sqrt(12))) - ((1sqrt(833)5)2 - (sqrt(85)-2-2)/sqrt(5)). -20825 + 22sqrt(17) Simplify -5 + ((-5(-2 + sqrt(612) + 4) - (sqrt(612) + -1 + -4 - sqrt(612))-1)51)*2. 22500sqrt(17) + 388120 Simplify (-5(sqrt(2) + -4 + sqrt(2)) + sqrt(2) + 4 + sqrt(242) + sqrt(2) + 2 + -1((sqrt(126)/sqrt(7))/sqrt(9) + sqrt(2)) + -2)*2. 48sqrt(2) + 578 Simplify -2 + ((sqrt(88) + (6sqrt(88)-1 - sqrt(88)))2)/(sqrt(128) - 2sqrt(128)1). -2 + 3sqrt(11) Simplify (4(sqrt(192) + (sqrt(192) + -3)-5)-4 - ((1 + (sqrt(192) - 1sqrt(192)) - sqrt(192)) + 5 + sqrt(192) + -2 + sqrt(192) + 2))*2. -247968sqrt(3) + 822564 Simplify ((sqrt(119) + -2(-2sqrt(119) + sqrt(119)))/(sqrt(49)/(2sqrt(7))) - -5(sqrt(425) + 1)-6) + 5. -144sqrt(17) - 25 Simplify -3 + 3 + ((sqrt(567) + 1sqrt(567))26 - sqrt(567)) + -4 + 3 + -4 + sqrt(567) + 0 + sqrt(567). 9sqrt(7) + 13603 Simplify ((sqrt(312)/sqrt(6)-3 - sqrt(520)/(sqrt(70)/sqrt(7))) + -3 + sqrt(5200) + sqrt(5200) + sqrt(5200) + 1 + sqrt(5200) + 0 + sqrt(5200))*2. -368sqrt(13) + 110036 Simplify (-4sqrt(19))2 + 0 - (1 + sqrt(95)/sqrt(5)) - (4 + (sqrt(1216) - (sqrt(1216) - (2 + (sqrt(1216) + 0)2)))). -919 - sqrt(19) Simplify (((2 + (-4 + sqrt(700) - sqrt(700)))-4)*2 - -25-3sqrt(343)) + 3. -210sqrt(7) + 67 Simplify (-1((sqrt(54)/sqrt(3) - sqrt(18)) + sqrt(18)))/(3sqrt(81)) - (0 + ((sqrt(36) + sqrt(72)/sqrt(2))/sqrt(3))/(sqrt(54)/(sqrt(9)2))). -37sqrt(2)/9 Simplify ((sqrt(4114)2 + sqrt(102)/sqrt(3)2)2)/((sqrt(44)/sqrt(32))/(sqrt(132)/sqrt(192))). 48sqrt(17) Simplify (5 + (-2 + sqrt(288) + -3 + sqrt(288)2 - ((-1 + sqrt(288))6 + (sqrt(288) - (sqrt(288) - (-2 + sqrt(288) + 4 + sqrt(288))))))2)-2. -14412 - 240sqrt(2) Simplify (1(sqrt(88) + (4sqrt(88)-1 - sqrt(88)))-3)/(-4(sqrt(8) - sqrt(16)/(sqrt(8)/sqrt(4)) - sqrt(8) - (-4sqrt(32) - sqrt(8)))). -3sqrt(11)/8 Simplify (2 + ((sqrt(684) - (-6(0 + sqrt(684)) + sqrt(684)))-6 - ((-1 + sqrt(684))-4 + -1(sqrt(684) - -2sqrt(684) - sqrt(684))))3)*2-4. -22162000 - 43200sqrt(19) Simplify (((sqrt(1500) - sqrt(1500)-1) + sqrt(1500))-3 - 2(sqrt(1500) + 1sqrt(1500) + sqrt(1500)))/(-2sqrt(225)/(2sqrt(5) - sqrt(5))). 25sqrt(3) Simplify ((sqrt(112) + -1 + 3 + sqrt(112))-3 + 5)2 - ((sqrt(112) + sqrt(112) + 2 + sqrt(112) + sqrt(112))2-4 - (sqrt(112) + (sqrt(112) + -2)-3)). 296sqrt(7) + 11223 Simplify (sqrt(4032) + -1sqrt(4032))/(sqrt(27)/sqrt(3)6 + sqrt(9)) - (2 + sqrt(175))-35. 30 + 75sqrt(7) Simplify (-5sqrt(4455) - -4sqrt(880))/((sqrt(5) - sqrt(50)/(sqrt(80)/sqrt(8) + sqrt(10)) - sqrt(5)) + -6sqrt(405)). 58sqrt(11)/109 Simplify -1 + (sqrt(91) - (sqrt(91) + (sqrt(91) - 1sqrt(91)2)) - (-3sqrt(91) - sqrt(91))6)/(sqrt(252)-2 + sqrt(21)/(sqrt(3)-1)). -25sqrt(13)/13 - 1 Simplify ((sqrt(104) - (sqrt(104) - -2sqrt(104) - sqrt(104) - sqrt(104)))-3)/(-3sqrt(200)) - ((sqrt(1573) + 1 - (sqrt(832))2) + 4). -11sqrt(13) + 827 Simplify ((sqrt(513)3)/sqrt(9)-4)/(sqrt(33)/(sqrt(33)/sqrt(3)6 - sqrt(11) - sqrt(11))). -48sqrt(19) Simplify (sqrt(180)-11 + (0 + sqrt(180)2 + sqrt(180) + sqrt(180) - sqrt(180) - sqrt(180)))2 - -5(sqrt(320)/sqrt(4) + -4 + 0). 20sqrt(5) + 160 Simplify (1sqrt(150)/((sqrt(6) + sqrt(6) + sqrt(6) + sqrt(18)/sqrt(3) + sqrt(6))-6))/(3((sqrt(45)-1)/sqrt(9) + 2sqrt(5)1)). -sqrt(5)/90 Simplify ((-1sqrt(480)-1 + sqrt(480) - sqrt(480))/(sqrt(96)/(sqrt(72)/sqrt(6))))/(42sqrt(768) + (sqrt(768) - (2sqrt(768)-3 - sqrt(768)))). sqrt(5)/128 Simplify 5 + (-3 + 4 + sqrt(396)2 - 1sqrt(396)-13)2-55. -247520 - 1500sqrt(11) Simplify ((1sqrt(250))/(2sqrt(125) + sqrt(125) + sqrt(125)) + (3sqrt(12)2)/((-1sqrt(72))/sqrt(12)))-6. 69sqrt(2)/2 Simplify (4(-62sqrt(76) + sqrt(76))6)/(-42sqrt(100) + -5(sqrt(100)1 + sqrt(100)))-2. -88sqrt(19)/15 Simplify (((-1 + sqrt(847) + sqrt(847) - sqrt(847))2 + -3)-3 + ((sqrt(7)-33)*2 - (4sqrt(7)2)2))-2. -132sqrt(7) + 4832 Simplify (sqrt(4212) - (sqrt(4212) - (1sqrt(4212) - sqrt(4212))))/((sqrt(400) - (sqrt(400) + 2sqrt(400))) + sqrt(400)) + (sqrt(468)-3-3 + 1)2. 108sqrt(13) + 37909 Simplify 2 + (2(-3sqrt(121) + sqrt(121)) - -5(1sqrt(121) - sqrt(121)))/(-5(sqrt(11) - -1sqrt(11)-2)5). -4sqrt(11)/25 + 2 Simplify 4(sqrt(204) + -5(sqrt(204) + (-1sqrt(204) - sqrt(204)) + sqrt(204) - sqrt(204)) + sqrt(204))/sqrt(12) - (sqrt(153) - (-1sqrt(153)-5)*2)6. 10sqrt(17) + 22950 Simplify (-2(sqrt(144) + 1sqrt(144)-6))/(sqrt(192) + sqrt(192)-1 + sqrt(3)25)-1. -4sqrt(3) Simplify 3 + -2sqrt(18)/(sqrt(45)/sqrt(5)) - 1(sqrt(98) + 3 - sqrt(98))2-5. -2sqrt(2) + 48 Simplify (-4(sqrt(297) - (sqrt(297) - sqrt(297)-2))2)/(sqrt(1323)/sqrt(9) + 2sqrt(3)-6). -48sqrt(11)/5 Simplify (-4-2sqrt(16) + sqrt(160)/(sqrt(10)-3))/((-1(sqrt(64) - (sqrt(64) + sqrt(64)2)))/(sqrt(128)-1)). -46sqrt(2)/3 Simplify (4 + -264((sqrt(75) + 0 - sqrt(75))5 + (2 + -2 + sqrt(75) - sqrt(75) - sqrt(75))))*23. 5760sqrt(3) + 518448 Simplify (3 + (3 + 2 + sqrt(1872) - ((sqrt(1872) + (sqrt(1872)-1 + sqrt(1872))3 - sqrt(1872)) + sqrt(1872)) - 5(sqrt(1872) - (3 + sqrt(1872)-1)))-2)*2. -17760sqrt(13) + 750169 Simplify 1 + -2((sqrt(192) - (sqrt(192) + 2 + sqrt(192)))-3)2 + (sqrt(192) - ((1 + sqrt(192) - sqrt(192)) + 5)2)-1 + -2. -3493 - 584sqrt(3) Simplify (3(sqrt(288) + sqrt(288) + (1 + sqrt(288) - sqrt(288))1)-6 - -6(sqrt(288) + 0 + sqrt(288) + 5 - (sqrt(288) - (1 + sqrt(288) + 0 + sqrt(288)))))*2. -7776sqrt(2) + 93636 Simplify (55(2sqrt(228)3 + sqrt(228) - sqrt(228)))/((sqrt(84) - 6(2sqrt(84) - sqrt(84) - sqrt(84)))/(-1sqrt(847))). -1650sqrt(19) Simplify 1 + ((-1 + sqrt(468) + 0 + -1)2 - (-1 + 2 + (sqrt(468) + 0 - sqrt(468) - sqrt(468)))2) + 2. -12sqrt(13) + 6 Simplify (sqrt(3) + 0)-5-5 - (-5 + sqrt(189)/sqrt(7)) - (4sqrt(72)/sqrt(2))/(sqrt(432)4). 5 + 131sqrt(3)/6 Simplify ((3-5sqrt(99)-24)/(sqrt(9) - sqrt(63)/sqrt(175) - -3(sqrt(9)-3 - sqrt(9) - sqrt(9))))*2. 3960000/5041 Simplify ((4 + 1 + (sqrt(242)-4 + 4)-4-15)4)*2. -2393600sqrt(2) + 24896400 Simplify 3(3 + 1 + (-5(-2 + sqrt(200) + sqrt(200) + 1) - (sqrt(200) + (0 + sqrt(200))6 - sqrt(200))6))*2. -24840sqrt(2) + 1269843 Simplify 2(-2-1sqrt(900) - -5(sqrt(900) - sqrt(900)1))/((sqrt(180)-1)/(sqrt(99)/(sqrt(44)/sqrt(4)))). -12sqrt(5) Simplify (2 + -2(sqrt(1700) - (sqrt(1700) + (-6(sqrt(1700) + -1) - sqrt(1700)) + sqrt(1700))) - (2 + sqrt(1700) + 2 + 1 + -5))2. -3640sqrt(17) + 287496 Simplify (-5 + (5 + (3 + sqrt(612) + sqrt(612) - sqrt(612)) + -1 + 4)-4)2. 2352sqrt(17) + 12193 Simplify ((-1sqrt(504)-5)/(sqrt(27)/sqrt(3)5))/((sqrt(64)/sqrt(2))/sqrt(4) - sqrt(800)-1). sqrt(7)/11 Simplify ((2sqrt(99)-1)/(sqrt(81)1 - sqrt(9)))2-6 - (-56sqrt(44)/((sqrt(4) + sqrt(12)/sqrt(3))1))2. -2541 Simplify (-2sqrt(704)4 + -1sqrt(704)-2 + (0 + 1sqrt(704) - sqrt(704)) + 5)*2-3. -76107 + 1440sqrt(11) Simplify (sqrt(12)/(-1(sqrt(4) - sqrt(4)-2)) + 3 + -5)43. -24 - 4sqrt(3) Simplify (-4 + -22(-4 + 2(sqrt(153) + 0) - (sqrt(153) + (-3 + (sqrt(153) - (-1 + sqrt(153))) + sqrt(153) - sqrt(153)))-2))*2. -2688sqrt(17) + 39952 Simplify (2 + sqrt(7))-6 + sqrt(700) + -4 - ((sqrt(700) - (sqrt(700) + 1 - sqrt(700))) + 5 + 0 + sqrt(700) + 3)2. -2865 - 276sqrt(7) Simplify (-5(sqrt(6776) + -1sqrt(6776)-4))/(43sqrt(968)-5). 5sqrt(7)/12 Simplify ((sqrt(128) + 2sqrt(128))/sqrt(8) + sqrt(160)/(sqrt(40)/sqrt(4)) + sqrt(16))/((-2sqrt(144))/(-2sqrt(242))). 55sqrt(2)/3 Simplify ((-3 + sqrt(891) + -1 + sqrt(891) + 4 + sqrt(891)3)2 + 0 + 0 + sqrt(891) + sqrt(891) + 5 + -3sqrt(891)-6)2. 2700sqrt(11) + 801925 Simplify (14sqrt(153)2-6)/(sqrt(36)/sqrt(100) + (-2sqrt(1296) - sqrt(1296))). 240sqrt(17)/179 Simplify (3(1 + -5-2(-2 + sqrt(1100) + 0 + -2)-1))*2. -73800sqrt(11) + 1005129 Simplify -2(4 + -2 + -2(sqrt(175) + 0) + (-1*(sqrt(175) + 2) + sqrt(1	{ "pile_set_name": "DM Mathematics" }
Divide -247 by 176956. -19/13612 What is 311934098 divided by 627634? 497 What is -438912 divided by 762? -576 129134657 divided by 2188723 59 What is -46 divided by 856681? -2/37247 What is -156263162 divided by -14205742? 11 -6254640 divided by 6254640 -1 -666086350 divided by 5 -133217270 Divide 154898 by -4195. -154898/4195 Divide 1469009 by 83. 1469009/83 What is -6380661 divided by -61? 104601 29882275 divided by -25 -1195291 16216326 divided by 10066 1611 Calculate -1044936006 divided by 6. -174156001 647267 divided by -5 -647267/5 Divide 1 by 97030316. 1/97030316 Divide 1 by 41808188. 1/41808188 1611128 divided by -43544 -37 Calculate 52996 divided by 3833. 52996/3833 -2285280 divided by 60 -38088 Divide -88681770 by 985353. -90 17 divided by -710113 -17/710113 Calculate 3704580 divided by 112260. 33 What is 0 divided by -974050? 0 What is 110 divided by -2199379? -110/2199379 What is -133 divided by -368061? 133/368061 What is -25646495 divided by 5? -5129299 Divide 6899928 by -2814. -2452 -69560605 divided by -13912121 5 What is -36046040 divided by 2? -18023020 -700482806 divided by 2 -350241403 What is -3328 divided by 24116? -832/6029 262563596 divided by 6 131281798/3 Calculate -221 divided by 30436. -221/30436 What is 358902375 divided by -11531? -31125 Calculate -6855499 divided by 979357. -7 Calculate -315959388 divided by -7628. 41421 Divide -126 by 2565886. -63/1282943 210317844 divided by -5 -210317844/5 What is 7249239 divided by 2416413? 3 62557 divided by 96 62557/96 What is 274225 divided by -22? -274225/22 Divide -70346340 by 1164. -60435 -279896776 divided by -5 279896776/5 -6021775 divided by -79 76225 Calculate -3 divided by 22622432. -3/22622432 4993809 divided by 1664603 3 Calculate 15104 divided by -22339. -15104/22339 -3718406 divided by 68 -1859203/34 What is 16403432 divided by 110834? 148 What is 3798608 divided by 176? 21583 Divide -200187546 by -7699521. 26 Divide -5 by 2004042. -5/2004042 9880516 divided by 9 9880516/9 What is 40349 divided by -284? -40349/284 What is -6 divided by -71539? 6/71539 35347095 divided by 5 7069419 Calculate 0 divided by 13958. 0 114834 divided by -3 -38278 Calculate -415182 divided by -1416. 69197/236 Calculate -749499 divided by 20. -749499/20 33836028 divided by -1 -33836028 8956500 divided by 106625 84 Calculate -528 divided by 45184. -33/2824 Divide 201342 by -3. -67114 What is 4 divided by 8911911? 4/8911911 Divide 24 by -6300037. -24/6300037 -14101 divided by -576 14101/576 Calculate 1254330 divided by 62. 627165/31 Calculate -668181 divided by 6. -222727/2 Calculate -387 divided by 12811. -387/12811 Calculate 175311936 divided by -352032. -498 What is 50744288 divided by -11923? -4256 What is 7715352 divided by -2252? -3426 Divide 74849550 by -2494985. -30 Calculate 4 divided by -101810541. -4/101810541 Calculate 125927 divided by -110. -125927/110 Divide -87 by -8883670. 87/8883670 Divide -32498173 by -22459. 1447 Divide 21465566 by 3106. 6911 50 divided by 6014 25/3007 Calculate 3908671 divided by 13. 300667 Calculate -5049090 divided by -5. 1009818 Calculate 12376 divided by -623. -1768/89 341565588 divided by 5421676 63 Divide 31567162 by 15783581. 2 28273406 divided by -266 -106291 Calculate -67704952 divided by -4. 16926238 What is 119 divided by -311887? -119/311887 Calculate 70584560 divided by 5. 14116912 What is 2239226 divided by 63? 2239226/63 What is -1677286 divided by 31? -54106 -17201580 divided by -6 2866930 Divide -93377332 by 82708. -1129 18503484 divided by -17 -18503484/17 -1444686 divided by -41 1444686/41 Divide -13599828 by 2. -6799914 -818471843 divided by 116924549 -7 Calculate 292178256 divided by -2. -146089128 -7 divided by 609834 -7/609834 Calculate 686799102 divided by 3. 228933034 Calculate -34993056 divided by 1666336. -21 Calculate -26360966 divided by -29. 26360966/29 Divide 177187794 by 1797. 98602 Divide 39889932 by -93. -428924 61995318 divided by 1878646 33 Calculate 7366 divided by 7414. 3683/3707 What is 4643125 divided by -2125? -2185 Calculate 0 divided by -3583602. 0 Divide -1726104 by -3. 575368 -124159 divided by 8343 -124159/8343 Calculate 2185177842 divided by -6. -364196307 Calculate 15826371 divided by 5275457. 3 What is 34862484 divided by 934? 37326 Calculate 93626533 divided by -143. -654731 Divide -12754030 by 21617. -590 5723 divided by -38513 -5723/38513 Calculate 1778513 divided by 448. 1778513/448 What is 36748776 divided by 36748776? 1 Divide 152542221 by 152542221. 1 Divide -4535401 by -6. 4535401/6 Divide -13860371 by -4. 13860371/4 4 divided by 43624120 1/10906030 Divide 157920840 by -44310. -3564 Calculate -62164 divided by 1541. -62164/1541 What is 0 divided by 662361? 0 What is -12063574 divided by 1? -12063574 Calculate -3243 divided by 223465. -3243/223465 What is 28479148 divided by -28479148? -1 What is -34 divided by -5300040? 17/2650020 49014 divided by 2849 7002/407 Divide -6612023 by -601093. 11 Divide 41655129 by 3. 13885043 Divide -1438598 by -211. 6818 56673 divided by -3818 -56673/3818 Calculate -424185147 divided by -35019. 12113 Divide -51652 by 415. -51652/415 What is 18312 divided by -4498? -9156/2249 What is -2010 divided by -2940? 67/98 Divide 1455914222 by -15734. -92533 What is 502225860 divided by 167408620? 3 Calculate 9706599 divided by 9. 1078511 Calculate -150233052 divided by 25038842. -6 62057880 divided by 18636 3330 What is 13464164 divided by -110362? -122 Divide -197150677 by 1. -197150677 Divide 10248 by 17016. 427/709 Divide 784224 by -30. -130704/5 12 divided by -23000755 -12/23000755 What is 2045 divided by -13566? -2045/13566 -6 divided by -6404032 3/3202016 Calculate 15561627 divided by 1083. 14369 908117 divided by -2107 -431 54092986 divided by -67 -807358 -529154048 divided by 64 -8268032 Divide 20902940 by 478. 43730 -146571510 divided by 551 -266010 Calculate -6900152 divided by 985736. -7 Calculate 33989290 divided by -399874. -85 Calculate 725866631 divided by -3760967. -193 3500130 divided by 22 1750065/11 Divide -52936338 by 6. -8822723 Calculate 432 divided by 1303836. 36/108653 Calculate -21353775 divided by -1423585. 15 Divide 0 by 22570560. 0 What is 439493832 divided by -531? -827672 What is -98157 divided by 497? -98157/497 What is 756611790 divided by -30? -25220393 6404 divided by -6601 -6404/6601 Divide -22593061 by -22593061. 1 Divide -238392716 by 508. -469277 What is -45550869 divided by 3? -15183623 What is 2110828 divided by 2018? 1046 Divide -1210320 by 151290. -8 What is 69119690 divided by 5? 13823938 What is 65 divided by -14315182? -65/14315182 1 divided by -1349510 -1/1349510 Calculate 165259976 divided by 56. 2951071 Divide 8 by 48993741. 8/48993741 -141287 divided by 1948 -141287/1948 Calculate 4885114 divided by -97. -50362 Divide -2739395 by 47. -58285 Calculate 81258078 divided by 3693549. 22 Calculate 15731471 divided by -7. -2247353 Divide 173424342 by 91. 1905762 -7367 divided by -3283 7367/3283 Calculate 0 divided by 35520748. 0 Calculate -1527 divided by -82419. 509/27473 -14 divided by -5832034 7/2916017 What is 2 divided by -212668812? -1/106334406 What is 455 divided by -4936? -455/4936 169346 divided by -29 -169346/29 What is -792 divided by -6798? 12/103 What is -33586944 divided by -2? 16793472 Calculate 4917 divided by 2973. 1639/991 Calculate 24151545 divided by -1. -24151545 Divide -4748780 by -4. 1187195 590529 divided by 8 590529/8 Divide 19 by 468718. 19/468718 -1870370019 divided by 63 -29688413 23944416 divided by -1 -23944416 Calculate -221584720 divided by -8. 27698090 What is -3298 divided by -194068? 1649/97034 Calculate 312835626 divided by 65874. 4749 3983160 divided by 41928 95 Calculate 99693 divided by 1687. 99693/1687 Divide 211987 by 166. 211987/166 Calculate -294297614 divided by 870703. -338 What is 35057672 divided by -5372? -6526 Divide 21291126 by -52963. -402 What is 18568 divided by 785? 18568/785 -3 divided by -71838263 3/71838263 Calculate 257 divided by 21074. 1/82 Divide -1214943255 by 80996217. -15 -2958 divided by -6315 986/2105 What is -4557048 divided by -3? 1519016 Calculate 139571560 divided by -27154. -5140 What is -2827578 divided by -942526? 3 Calculate 404652 divided by 2. 202326	{ "pile_set_name": "DM Mathematics" }
2, 8869 Sort -5053, -97, 35 in ascending order. -5053, -97, 35 Sort 6, 66593, -1 in decreasing order. 66593, 6, -1 Sort 4/9, 2, 4529, -1, -68. -68, -1, 4/9, 2, 4529 Sort -57/4, -22, 2, 314, 1, -0.2 in decreasing order. 314, 2, 1, -0.2, -57/4, -22 Sort -4, 4, 1390, 2, 146 in ascending order. -4, 2, 4, 146, 1390 Put 652, -81, 2/5 in descending order. 652, 2/5, -81 Sort -0.163, 4/3, -2484, -1 in decreasing order. 4/3, -0.163, -1, -2484 Sort 16, 1, -4, -9, 160, -36 in increasing order. -36, -9, -4, 1, 16, 160 Put 2214, 80907, 0, 2 in descending order. 80907, 2214, 2, 0 Sort 7746, -0.1127, 2. -0.1127, 2, 7746 Sort -5, 5, -2, 149, -3, -11628 in increasing order. -11628, -5, -3, -2, 5, 149 Put 83, 17, -324 in decreasing order. 83, 17, -324 Put -21014, 126, 47 in descending order. 126, 47, -21014 Put 17/7, -0.4, 137/7, -0.5 in decreasing order. 137/7, 17/7, -0.4, -0.5 Sort -142, 967, 4, -3. -142, -3, 4, 967 Sort 9, 0, -1, 3, -3, 5, -64 in ascending order. -64, -3, -1, 0, 3, 5, 9 Sort 2, -0.69, 4, -1035, 1/3 in decreasing order. 4, 2, 1/3, -0.69, -1035 Sort 7970, 296, -3 in decreasing order. 7970, 296, -3 Put -2, -541592, 17 in ascending order. -541592, -2, 17 Put -6573, -7, -17 in increasing order. -6573, -17, -7 Sort -3, 4, -27, 1, 292, 13 in decreasing order. 292, 13, 4, 1, -3, -27 Sort -4, -1, -8, 0, -16, 5, -7 in descending order. 5, 0, -1, -4, -7, -8, -16 Sort -1/2, -0.4, -92, 62870, 1 in ascending order. -92, -1/2, -0.4, 1, 62870 Sort 5, -1, 42, -42533 in descending order. 42, 5, -1, -42533 Sort 4, 141848, -3, 8 in ascending order. -3, 4, 8, 141848 Sort -0.5, 0.4, -2756926, 0.3, -2 in descending order. 0.4, 0.3, -0.5, -2, -2756926 Put 4, 3, 1, 200, 20, 8 in decreasing order. 200, 20, 8, 4, 3, 1 Sort -4, -7, -53, 42, 2, 6 in increasing order. -53, -7, -4, 2, 6, 42 Sort -1, 173, 4, -5024 in descending order. 173, 4, -1, -5024 Put 22, -1, 26, -5, -32, 4 in decreasing order. 26, 22, 4, -1, -5, -32 Put 393, 4, -50, 6, 1, -2 in ascending order. -50, -2, 1, 4, 6, 393 Put 5, -2, -0.1, 0.0357, 57, 3 in descending order. 57, 5, 3, 0.0357, -0.1, -2 Put 0, -84/4339, -1, -2, -2/3 in descending order. 0, -84/4339, -2/3, -1, -2 Sort 132145, 5, -17. -17, 5, 132145 Sort -3979, 70.76, 0 in decreasing order. 70.76, 0, -3979 Sort -6, -2, -2148535, 3 in ascending order. -2148535, -6, -2, 3 Sort -1688, -1023, -55. -1688, -1023, -55 Put 2/11, -1/2, -2, 4, 298 in decreasing order. 298, 4, 2/11, -1/2, -2 Sort 4, -915.7, -15, -0.0697 in descending order. 4, -0.0697, -15, -915.7 Put -3, 3, 1, -21, -7, 139, 5 in increasing order. -21, -7, -3, 1, 3, 5, 139 Put -1, 4, -3, 23374855 in ascending order. -3, -1, 4, 23374855 Sort 0.09436, -91, 43, 2 in decreasing order. 43, 2, 0.09436, -91 Sort 5, -81, -5, -11, -3, 4 in descending order. 5, 4, -3, -5, -11, -81 Sort 30, 13, 1, -11, -106, -4, 5 in decreasing order. 30, 13, 5, 1, -4, -11, -106 Sort 1, -3, -4, -5, 245, -1 in decreasing order. 245, 1, -1, -3, -4, -5 Sort 12/11, 36/11, 3/4, -10, 19.19 in descending order. 19.19, 36/11, 12/11, 3/4, -10 Sort -41, 2, 954347. -41, 2, 954347 Sort 2, -5, -3, -0.2, -918 in increasing order. -918, -5, -3, -0.2, 2 Sort 19, 334, -2, 20, -47, 1. -47, -2, 1, 19, 20, 334 Put -0.09, -1/6, 7848 in descending order. 7848, -0.09, -1/6 Sort -97, 3, -200113 in decreasing order. 3, -97, -200113 Put 1, -1, 9, -5, 3, -38, 43 in decreasing order. 43, 9, 3, 1, -1, -5, -38 Sort 15, 5, 50943, 0.3 in ascending order. 0.3, 5, 15, 50943 Sort -2636153, 1, 4 in increasing order. -2636153, 1, 4 Put 3, 13, 12, -2, -29 in descending order. 13, 12, 3, -2, -29 Put -4, -27, 1.79, -3/8 in decreasing order. 1.79, -3/8, -4, -27 Put 14, 3, -7, 5, 4, -18, -5 in ascending order. -18, -7, -5, 3, 4, 5, 14 Put -24, 209, -0.29, -0.1, 0 in descending order. 209, 0, -0.1, -0.29, -24 Sort -270, 0, 77, 4, -5, 2, -19 in increasing order. -270, -19, -5, 0, 2, 4, 77 Put 5, -1, -2670, 18, -10, 10 in decreasing order. 18, 10, 5, -1, -10, -2670 Put -1/1117, 419, 7/2, 0.4, 0.1 in descending order. 419, 7/2, 0.4, 0.1, -1/1117 Put -5, 2, -92, 0, 1155 in decreasing order. 1155, 2, 0, -5, -92 Put -994, 8, -30483 in descending order. 8, -994, -30483 Sort 690222, 16, -1/10 in decreasing order. 690222, 16, -1/10 Put -6, 3, 16153, 1, -30 in descending order. 16153, 3, 1, -6, -30 Put 4, 3, 0.09, -345418 in decreasing order. 4, 3, 0.09, -345418 Put -12, -3, 9, -4, 0, 5 in descending order. 9, 5, 0, -3, -4, -12 Sort 2, -1, -112, 56739, 5 in descending order. 56739, 5, 2, -1, -112 Put 759, -13540, -49 in increasing order. -13540, -49, 759 Put 1, -5, -45, -4, 22, 160 in decreasing order. 160, 22, 1, -4, -5, -45 Sort 2459, -1837, 0 in decreasing order. 2459, 0, -1837 Put 5, -4141, 3, 2, -1, -4, 265 in descending order. 265, 5, 3, 2, -1, -4, -4141 Sort 5, -109/23, 0.3, 0.05, 12 in ascending order. -109/23, 0.05, 0.3, 5, 12 Sort -3/116, 1.96, -3/5, 3, -5, 0.1 in ascending order. -5, -3/5, -3/116, 0.1, 1.96, 3 Sort 4, 6399, 82 in ascending order. 4, 82, 6399 Put -4, -5, -7, -110218, -1 in descending order. -1, -4, -5, -7, -110218 Sort 2, 13039, 39. 2, 39, 13039 Sort -3, 0.1, 3/3575, -19.76. -19.76, -3, 3/3575, 0.1 Sort 4, 11, 5, -8, -3, -14491 in increasing order. -14491, -8, -3, 4, 5, 11 Sort 37/15, -3741, -4 in ascending order. -3741, -4, 37/15 Sort -4, -25, 11, 5, 10. -25, -4, 5, 10, 11 Sort 16, 13572, -3, -3/5, 0.3 in descending order. 13572, 16, 0.3, -3/5, -3 Put 21.8, 4, -24720 in increasing order. -24720, 4, 21.8 Sort 0, -4, 1/6, 2208.93, -0.01, -2 in descending order. 2208.93, 1/6, 0, -0.01, -2, -4 Sort -1156, 28, 95 in descending order. 95, 28, -1156 Sort -3187, 1/3, -469, -5, 0.2 in descending order. 1/3, 0.2, -5, -469, -3187 Put -50, -5983, 2, 39 in decreasing order. 39, 2, -50, -5983 Sort -12, 3, -160, 1, 4, -44, -4 in increasing order. -160, -44, -12, -4, 1, 3, 4 Sort 747, 1.468, -8/7 in decreasing order. 747, 1.468, -8/7 Sort -5, -2, -92, 2, 0, 4, -16. -92, -16, -5, -2, 0, 2, 4 Put -0.5, 1669, 0.1, -2/261, 9, -3 in ascending order. -3, -0.5, -2/261, 0.1, 9, 1669 Put 2, -2, 13903594, 0 in descending order. 13903594, 2, 0, -2 Sort -3, -2, 52, 27, 1, 4. -3, -2, 1, 4, 27, 52 Put -2, -1, 0.4, 0.29699, 1/6 in decreasing order. 0.4, 0.29699, 1/6, -1, -2 Put -23, -1.2, -0.05, 1, -6/7, 62 in decreasing order. 62, 1, -0.05, -6/7, -1.2, -23 Sort 0, 174, -22, -5. -22, -5, 0, 174 Sort 118, 2, -24, 6, -2, 4, -7 in descending order. 118, 6, 4, 2, -2, -7, -24 Sort 18, 3, -3/2, -4, 38.6, 2, 5 in ascending order. -4, -3/2, 2, 3, 5, 18, 38.6 Sort 18, 3, 40, 1, 6, -8. -8, 1, 3, 6, 18, 40 Sort -0.26, 2.15, -1341 in ascending order. -1341, -0.26, 2.15 Sort 53, -124, -36409. -36409, -124, 53 Put 3/2, 0.7127, -8 in increasing order. -8, 0.7127, 3/2 Sort -25, -202644, 5 in descending order. 5, -25, -202644 Sort 2/71, -126/233, 488, 4, -5 in increasing order. -5, -126/233, 2/71, 4, 488 Sort 80, 1/2, -1.95, -61, 4 in ascending order. -61, -1.95, 1/2, 4, 80 Sort 1, 671, 217, 19 in increasing order. 1, 19, 217, 671 Put -0.14, -1768, -0.06, 0.1 in decreasing order. 0.1, -0.06, -0.14, -1768 Put -109, 2981, 14.5, -5 in descending order. 2981, 14.5, -5, -109 Sort -3, 4573, -286 in increasing order. -286, -3, 4573 Put -37, -9, 1, 9, 48, 2 in increasing order. -37, -9, 1, 2, 9, 48 Sort 0, 1191, 24, -2/9, 0.1 in decreasing order. 1191, 24, 0.1, 0, -2/9 Sort 1, -77320, 79. -77320, 1, 79 Sort -5, -9, -778929, 4 in descending order. 4, -5, -9, -778929 Sort 2, 1, -3, 11, -20, -274. -274, -20, -3, 1, 2, 11 Sort -24.426, -0.25, 5. -24.426, -0.25, 5 Sort 8, 0.18, 11/32, 0.5, -1/3, 2/5 in increasing order. -1/3, 0.18, 11/32, 2/5, 0.5, 8 Sort -5, -2/3, -108284, 2/3, -1/2 in descending order. 2/3, -1/2, -2/3, -5, -108284 Sort -14, 2005, 3, 9, -3, 1, 0. -14, -3, 0, 1, 3, 9, 2005 Put -0.32, -0.5, 394, 1/8, 4, -66 in decreasing order. 394, 4, 1/8, -0.32, -0.5, -66 Put -4, 77, 5, -7, 1, 6 in descending order. 77, 6, 5, 1, -4, -7 Put -5, 15, 5, -2, -1, 451, 7 in descending order. 451, 15, 7, 5, -1, -2, -5 Put 5, -0.1, 1, -18.04, 77 in descending order. 77, 5, 1, -0.1, -18.04 Put -2, -25, -19, 1745 in increasing order. -25, -19, -2, 1745 Put -4/7, -1/328506, -3/7, -0.1 in decreasing order. -1/328506, -0.1, -3/7, -4/7 Sort 13405, -6960, -5 in increasing order. -6960, -5, 13405 Put 5, -7, -35	{ "pile_set_name": "DM Mathematics" }
0.2, o in descending order. o, 0.2, -1/5, x Let r(l) = l + 1. Let k be r(3). Suppose 0 = 764m - 760m - 20. Sort 3, m, k in decreasing order. m, k, 3 Let p = 6 + -3. Let z be 1/(2 + (-13)/3). Let t be 45/(-66) + ((-51)/6)/(-17). Put t, z, p in decreasing order. p, t, z Let h = 2 - -3. Let c = 1182 - 1186. Sort h, 0, c, -3 in decreasing order. h, 0, -3, c Let r be (-1)/(-510/100). Put -5, r, 6, 3 in increasing order. -5, r, 3, 6 Suppose -21s - 18 = -19s. Let i = -5 - s. Sort 2, i, 27. 2, i, 27 Suppose -n + 3n = 3h + 13, n + 6 = -h. Sort -1, 317, h. h, -1, 317 Let z(h) = h + 8. Let d be z(-4). Suppose -4q = 164 - 32. Let s be (-1)/(-2) - q/(-30). Sort -1/2, d, s. s, -1/2, d Let k be (-14 - -7) + 3 + 17/3. Let m = 0.08 + -12.08. Let j = m - -17. Put k, 0.5, j in decreasing order. j, k, 0.5 Let g be -4 + (-9)/(-2) + (-3)/(-2). Suppose gz - 1 = -c + 6z, -z = -4c - 11. Put -4, 5, 4, c in descending order. 5, 4, c, -4 Let b be (2 + 0)/(12/(-2)). Suppose h = 5h. Sort 2, b, h in ascending order. b, h, 2 Let i = 0.0105 + -10.0105. Sort 0.2, 5, i, -3. i, -3, 0.2, 5 Let b(s) = -2s2 - 2s + 180. Let n be b(-10). Let o = -1.6 + 2. Sort 2, o, n in increasing order. n, o, 2 Let d = -1/112849 + 40851815/53828973. Let v = d + 1/53. Sort v, -0.1, 0.5 in descending order. v, 0.5, -0.1 Suppose 0 = 2o + 2o + 20. Suppose -4b = 4y - 8, 4y + 2 - 7 = -5b. Suppose 0t = -3t - 5m - 1, 2m = -2t + 2. Sort t, b, o. o, b, t Let i(j) = -j3 + j2 - 2j + 8. Let o be i(2). Sort -0.3, o, -21. -21, -0.3, o Suppose -4i - 72 = -2w, w + 27 = 2w + i. Let d = 35 - w. Sort d, 0, 0.1 in ascending order. 0, 0.1, d Let h = 5/22 + -1/198. Let i be ((-22)/6 - (4 - 6))(-50)/(-50). Put h, -0.5, i in descending order. h, -0.5, i Let x = -13.15 - -0.15. Let o = x + 13.14. Let p = o + 0.06. Sort 4/7, p, -3. -3, p, 4/7 Let y = 38 - 24. Let r = y + -13.97. Let q = r + -2.03. Put 1, 0.1, q in ascending order. q, 0.1, 1 Let j be ((-9)/6 + -2)(-48)/42. Put -16, -3, j, -2 in ascending order. -16, -3, -2, j Let m = -1538 + 1535. Sort m, 42, -4. -4, m, 42 Let u = 7 - 5. Let b be (-9)/(-5) + 8/40. Suppose -bo - 12 = -6o. Sort 1, o, u in decreasing order. o, u, 1 Let a(p) = 56p - 281. Let v be a(5). Sort 21, -2, -4, v in decreasing order. 21, v, -2, -4 Let m = -3.16 + 0.26. Let k = -2.8 - m. Let a = 4.08 + -0.08. Sort a, k, 0. 0, k, a Suppose -5d + z + 43 = 3z, 0 = 3d - 4z - 31. Let j be 6/d - (-22)/(-12). Let h = j + 43/42. Sort 0, h, -1. -1, h, 0 Let s be 346/18 - (-2)/(-9). Let t = s - 15. Suppose 0p - 3i - 10 = p, -5p - ti = 17. Put -3, 1, p in descending order. 1, p, -3 Let q(p) = 2p - 1. Let x be q(5). Suppose 2u = 3t - 5, -u - 4t = 11 - 36. Let w = -7 + 10. Sort w, u, x in increasing order. w, u, x Let u be (-11)/(143/78) + (1 - 5). Sort -1, u, 30. u, -1, 30 Let n = -0.081 + 46.581. Let r = n - 47. Sort r, -5, 1/5 in decreasing order. 1/5, r, -5 Suppose -45 + 30 = 5s. Put s, 2, 16 in ascending order. s, 2, 16 Let s(n) = -2n*3 + 11n*2 + 3n + 19. Let t be s(6). Sort t, 4, -259 in increasing order. -259, t, 4 Let f = 1485 - 1489. Sort f, -0.3, -0.5 in decreasing order. -0.3, -0.5, f Suppose -8 = 55a - 53a, 0 = 3t + a + 10. Put -38, 1, t in decreasing order. 1, t, -38 Let h = 68 - 53. Let o be (3/(-2))/((-48)/64). Let z = 7/32 + -13/352. Sort o, z, h in increasing order. z, o, h Let l = 0.161 - 0.761. Sort 2, l, -0.07. l, -0.07, 2 Suppose -4n = q + 21, 3q - 4q + 4n = -19. Let r be (1 - -2) + (0 - q). Put 0, 18, r in descending order. 18, r, 0 Suppose m = -6 + 2. Put m, 2, 5 in descending order. 5, 2, m Let m = 8.43 + -8.83. Sort m, -2, 5/7, 0 in decreasing order. 5/7, 0, m, -2 Let b(i) = i2 + 10i - 83. Let k be b(-15). Suppose 2y - 3h + h - 30 = 0, 5h = -2y + 51. Let p be ((-3)/y)/((-2)/k). Sort p, 0.2, 3 in ascending order. p, 0.2, 3 Let a = -0.43 - 0.42. Let q = -0.15 + a. Let o = q + 6. Put o, -1/5, -5 in descending order. o, -1/5, -5 Let z = -3097 + 3094. Put -5, 5, -16, z in decreasing order. 5, z, -5, -16 Let o be (-31)/(-3(-2)/6). Let w be 55/2 - (-9)/6. Let m = o + w. Put m, -1, 1 in descending order. 1, -1, m Let w = -7628 + 7632. Let y(v) = v. Let m(j) = j - 1. Let h(r) = -3m(r) + 2y(r). Let s be h(5). Sort 1/2, s, w in descending order. w, 1/2, s Let x be (-2 - 20/(-8))/(3/(-204)). Put x, -4, 1 in decreasing order. 1, -4, x Let n(j) = 4j - 6. Let z be n(4). Let l = z + -9. Suppose -c + 2c = l. Put c, -2, -4 in increasing order. -4, -2, c Suppose -5m - 12 + 6 = g, 4m + 20 = 3g. Sort 18, 0, g in ascending order. 0, g, 18 Suppose a - 91t + 95t = -13, -4a + 5t = 10. Let z(d) = d + 4. Let s be z(-3). Put -1, s, a in ascending order. a, -1, s Let o = 216 + -212. Sort o, -1, -3, 3 in increasing order. -3, -1, 3, o Let r be -1 - -11 - (3 + -1). Suppose 2j + r = 14. Let u be 3 - 2/j9. Put u, 4, 1 in descending order. 4, 1, u Suppose -z + 4t = 33 - 21, 5t = -4z + 36. Sort z, 0.1, 0.2, -9/8 in descending order. z, 0.2, 0.1, -9/8 Let l(f) = 3f - 28. Let c be l(8). Let k = -16 - -11. Sort k, c, -2, 2. k, c, -2, 2 Let a = -0.0919 + -0.1081. Put 0, 2, a, 22/7 in increasing order. a, 0, 2, 22/7 Suppose -3n - 16 = 2o, 2n + 24 = 2o - 6o. Sort -3, o, -1, -9 in increasing order. -9, o, -3, -1 Let o(b) = -b + 16. Let s be o(8). Let g be (-12)/18 - s/(-3). Sort -4, g, 4 in ascending order. -4, g, 4 Let t(g) = 57g + 492. Let b be t(-9). Put 8, b, 0 in descending order. 8, 0, b Let a be (-2)/7(-630)/(-45). Sort a, 2, -5 in descending order. 2, a, -5 Suppose -26i - 5m - 25 = -24i, -9 = 3m. Sort 4, i, 0, 2 in descending order. 4, 2, 0, i Let t be 0 + 83/(-6) + 0. Sort t, 6, 14 in decreasing order. 14, 6, t Let s be (4/6)/((-10)/45). Let n = 31 + -28. Sort n, s, -2. s, -2, n Suppose 0 = 2q - 3t - 122, 0q + 3q - 2t - 178 = 0. Let v = 53 - q. Sort 5, v, -4, 4 in decreasing order. 5, 4, -4, v Let c be 2/8(-157 + 157). Let l = -2 + 1. Sort 1, 4, l, c in decreasing order. 4, 1, c, l Let a = -31 + 36. Suppose 5v + 6d = 2d + 8, 0 = -v - 3d - a. Sort v, 5, -4, 1 in descending order. 5, v, 1, -4 Let j be 1/6(-14 - -12). Sort 0.1, j, 0, -0.1 in increasing order. j, -0.1, 0, 0.1 Let i be ((-81)/21)/(-3) - (-18)/(-12). Let m = i - -43/70. Sort -3/5, -2/3, -0.02, m. -2/3, -3/5, -0.02, m Let s = -0.11 - -0.23. Let k = s - 0.18. Let g = k - 7.94. Put -2/7, g, 4 in decreasing order. 4, -2/7, g Suppose -3c = 4l + 157, 5l + 230 = 3c - 0c. Sort 2, l, 3, -2 in descending order. 3, 2, -2, l Suppose -4 = 4o - 40. Suppose 2h + 56 = oh. Suppose -3 = hw - 7w. Sort -0.2, w, 0.4 in increasing order. w, -0.2, 0.4 Let o = -0.2 - 1. Let g = 64 + -61.2. Let b = g - o. Put -5, -8, b in descending order. b, -5, -8 Let v(j) = -j2 + 6j - 1. Let g be v(3). Put g, -5, 4 in decreasing order. g, 4, -5 Suppose -3w + 3 = 5s + 27, -s = w + 6. Suppose l = 6l + 25. Sort s, l, 1. l, s, 1 Let d(q) = q3 - 7q*2 - q + 1. Let u be d(7). Let f be (-2 + u/(-4))-4. Sort -5, -6, f in ascending order. -6, -5, f Let y = -12 - -17. Suppose 3b = m - ym + 1, -5m + 8 = -3b. Let u = -24 + 29. Sort u, -2, b in ascending order. -2, b, u Let q be 3 + 0 + (107588/(-2880))/13. Let n be 142/288 + (-2)/4. Let u = q - n. Sort -4, 0.5, u. -4, u, 0.5 Let p be -1 - (-3)/3 - -5. Let y be 10/51 + (0 - 22). Let i be 4/(y/(-5))(2 - -1). Sort p, i, -15 in increasing order. -15, i, p Let i be (-4 - 0)3/21. Sort 4, 3, -3/5, i. -3/5, i, 3, 4 Suppose 5i - 2 = 8. Let a(f) = -37f + 156. Let d be a(4). Suppose 2l + 8 = 0, l - d = -ik - 2k. Put k, -2, 2 in increasing order. -2, 2, k Let m = -7 + 12. Let c be ((-1)/(-1) - 3) + 22/6. Sort m, 0.3, c in decreasing order. m, c, 0.3 Let j(f) be the third derivative of 1/24f4 + 0 - 2/3f*3 - 5f*2 + 0f. Let z be j(6). Put -2, 3, z in increasing order. -2, z, 3 Let v = 0.41 - 0.61. Put 0.14, -0.7, v in ascending order. -0.7, v, 0.14 Let n = -1.2 + 1. Let z = 235/354 - 39/118. Put n, -1, z, 9 in ascending order. -1, n, z, 9 Let t = 1.234 + -0.334. Sort 0.3, t, -0.34 in descending order. t, 0.3, -0.34 Let s be 22/4(-83 - -85). Put s, 4, 1 in decreasing order. s, 4, 1 Let y(h) = h3 - 4h*2 + h + 1. Let u be y(4). Let c be 36/(-144) + 81/4. Put -4, c, 1, u in increasing order. -4, 1, u, c Let x(q) = -5q + 80.	{ "pile_set_name": "DM Mathematics" }
h. Let f(r) be the first derivative of 0r*z + 0r - 2 + 1/3r3. Give g(f(o)). 50o*4 Let t(f) = 148f*2. Let r(s) = 2s + 11320. Give r(t(h)). 296h2 + 11320 Let r(v) be the third derivative of -9653v*4/12 + 3v2 - 820. Let c(a) = -a2. Calculate c(r(w)). -372721636w2 Let x(s) be the third derivative of s5/60 + 110s*4/3 + 4s*2 + 68s. Let y(w) = -w2. Give x(y(l)). l4 - 880l2 Let n(b) = b. Let d(f) = -f2 - f - 1. Let m(c) = 105 + 2c - c*2 - 113 + 2c*2. Let q(z) = -4d(z) - 2m(z). Give n(q(p)). 2p*2 + 20 Let p(k) = 46k. Let l = 763 - 693. Let r(t) = -25t - 14t + lt - 22t. Calculate r(p(j)). 414j Suppose -72v - 2265 = -128v - 95v. Let r(k) be the third derivative of 0k3 + 1/24k*4 + vk*2 + 0 + 0k. Let g(u) = 10u. Give g(r(t)). 10t Let w = 2 - -5. Let y(b) = 5b - 14286b*2 + 7141b*2 + 7139b*2. Let r(l) = -9l*2 + 7l. Let c(j) = wy(j) - 5r(j). Let n(a) = -a*2. Calculate n(c(g)). -9g*4 Let b(i) = -2i. Let o(z) = -305603135z + 2. Determine o(b(m)). 611206270m + 2 Let s(q) = 20q2. Let d(v) = -v2 + 4v. Let k(m) = 3m2 - 10m. Let l be 4 + 17/(-2) + 5/10. Let p(h) = lk(h) - 10d(h). Calculate s(p(b)). 80b4 Let z(y) be the second derivative of -25y*4/12 - 219y. Let g(v) = 3v + 15. Let j(k) = 32k + 168. Let m(s) = 56g(s) - 5j(s). Calculate m(z(a)). -200a2 Let h(z) = -2z*2. Suppose 3s - 75 = -3k + 5s, -4k + 4s = -96. Let d = -21 + k. Let p(c) = -306 + dc2 + 306. Calculate h(p(f)). -72f*4 Let v(l) be the second derivative of 0l*2 - 3l - 1/4l4 + 0l3 - 3. Let i(x) be the third derivative of x4/4 - x*2. What is v(i(p))? -108p*2 Let g(r) = 2r + 12. Let q(c) = 112c - 227. Let w(f) = 19g(f) + q(f). Let u(v) = -3v2 + 4v*2 + 0v*2. What is w(u(a))? 150a*2 + 1 Let g(t) be the first derivative of 0t + 0t2 - 16 - 2/3t*3. Let c(v) = -17v*2 - 2. Calculate c(g(w)). -68w4 - 2 Let r(c) = -c2 - 30c + 6. Let q(u) = -4u*2 - 135u + 27. Let l(k) = -4q(k) + 18r(k). Let m(x) = 808x2. Determine m(l(y)). 3232y*4 Let l(i) = 3i. Let z(h) = 23834h2 + 84h. Give l(z(k)). 71502k2 + 252k Let z(w) = 2w + 3w + 4w. Let i(d) be the second derivative of -13d*3/6 + 453d. Determine z(i(m)). -117m Let b(z) = -38z. Suppose 24v = 5v + 38. Let s(c) = 3c - 75c*2 + 73c*v - c - 2c. Determine s(b(i)). -2888i2 Let b(q) = q3 + 9q*2. Let y be b(-9). Let o(k) = -2k*2 + yk2 + k2. Let g(n) be the second derivative of 13n3/6 + 1458n - 1. What is g(o(x))? -13x2 Let z(w) = -57w*2 + 17399 + 58w*2 - 17399. Let k(o) = 346o. What is z(k(h))? 119716h2 Let z(n) = -n. Let x(g) = -421375297g. Give z(x(p)). 421375297p Let m(z) = -66z*2. Let g(h) = 34h*2 - 29h + 3. Let d(a) = -102a2 + 77a - 8. Let c(r) = -3d(r) - 8g(r). What is c(m(u))? 148104u4 - 66u*2 Let j(r) = -4704821r*2. Let t(d) = -2d. Give j(t(g)). -18819284g2 Let i(m) = 1206017m. Let u(j) = 2j + 5. What is u(i(d))? 2412034d + 5 Let p(c) be the second derivative of -c*4/12 + 2c. Let q(n) be the second derivative of 0n2 + 0n*3 + 0 - 323n - 3/2n4. Calculate p(q(o)). -324o*4 Let q(f) = 7f*2 - 2f + 6. Let g(l) = -3l2 + l - 3. Let c(y) = 2g(y) + q(y). Let m(z) = 3z - 5. Calculate m(c(r)). 3r*2 - 5 Suppose 2l = 4r + 24, -l + 27 = -4r - r. Let v(p) = 9 - 12pl - 9. Let a(c) = -34997c + 34997c - c2. Determine a(v(j)). -144j*4 Let c(p) = -35514535p2. Let g(m) = m2. Determine c(g(u)). -35514535u4 Let p(h) be the first derivative of 5h - 69 + 31 + h*2 - 5h. Let d(c) = 30c2. Determine p(d(s)). 60s2 Let j(b) = -b2 + 6. Let f(y) be the first derivative of 2y3/3 - 1027. Give f(j(n)). 2n*4 - 24n*2 + 72 Let p(b) = 120b - 3. Let u(x) = -124x. Let i(z) = 103z. Let o(c) = 6i(c) + 5u(c). Calculate p(o(d)). -240d - 3 Let a(l) be the second derivative of -4l*3/3 - l. Let m(h) = 0 + 0 + 15587929h*2 - 15587935h*2 + 0. Give a(m(o)). 48o*2 Let y(h) = h - h - h + 0. Let f(a) = -28a*2 + 21a - 168. Let s(v) = 5v2 - 4v + 32. Let r(q) = -8f(q) - 42s(q). Calculate y(r(u)). -14u2 Let f(w) = w2 - 7w + 4. Let o be f(7). Let m be 1/(-1)(-14 + o). Let b(d) = -md*2 + 7d*2 + 2d*2 + 2d*2. Let s(j) = -35j*2. What is b(s(z))? 1225z*4 Let d(t) = 43t - 579t + 189t + 22t. Let z(p) = -3p*2. Give d(z(n)). 975n*2 Let s(l) = 1090054l + 3. Let d(p) = -p. Give s(d(m)). -1090054m + 3 Let o(s) = -2s + 47s2 - 115s*2 + 67s*2 - 15s. Let y(q) = -25q. Give o(y(p)). -625p*2 + 425p Let q(g) be the first derivative of 5g2/2 - 2940. Let l(j) = 767j + 1. Determine l(q(c)). 3835c + 1 Let g = 20 - 20. Let o(i) = gi + 5i - 2i + i. Let q(t) = -309t2 - 318t*2 + 613t*2. Determine o(q(m)). -56m*2 Let g(w) = -14w. Let r(s) be the first derivative of -29 + 23/2s2 + 0s. Give g(r(m)). -322m Let o(x) = 2x*2. Let d(u) be the second derivative of -2915u3/6 - u2/2 + 4054u. Calculate d(o(c)). -5830c*2 - 1 Let y(n) = -2n - 3. Let v(t) = -4t2 - 270t - 20. Calculate y(v(o)). 8o2 + 540o + 37 Let o(x) = x*2. Let p(i) = 6478i + 123. Let b(h) = -209h - 4. Let y = 233 + -110. Let q(a) = yb(a) + 4p(a). Calculate o(q(c)). 42025c2 Let c(u) = -u2 - 378893u + 378893u - u*2. Let p(j) = 8j*2 - 4j - 6. Let a(y) = 25y2 - 11y - 17. Let m(t) = 6a(t) - 17p(t). What is m(c(b))? 56b4 - 4b2 Let z(j) = j2. Let q(a) = 20a2 - 5a + 11. Let x(n) = 10n2 - 3n + 6. Let h = 90 - 87. Let r(c) = hq(c) - 5x(c). Calculate z(r(g)). 100g4 + 60g*2 + 9 Let u = 1066 - -378. Let t(w) = -uw - w*2 + 1444w. Let n(r) = -2r - 11. Let c(j) = -2j - 11. Let k(g) = 2c(g) - 3n(g). Determine k(t(s)). -2s2 + 11 Let z(s) = 2s*2 + 15s. Let l(t) = t. Let m(o) = -o. Let r(h) = -2l(h) - m(h). Let a(v) = -2v. Let p(c) = -a(c) + r(c). What is z(p(k))? 2k2 + 15k Let m(u) = -u. Let r(x) = 184x - 4234. Give r(m(h)). -184h - 4234 Let u(y) = -14y. Suppose 0 = l - 5o - 69 - 275, -4o + 1633 = 5l. Let g(r) = -2r - l + 329 - 2r + 2r. What is g(u(h))? 28h Let f(s) = -s. Suppose -23p + 208 = -15p. Let h(d) = -64d - 176d + pd - 21d - 116d. Give h(f(m)). 351m Let b(k) = 4k. Let a(u) = 3u*2 + 3809726. Calculate a(b(j)). 48j2 + 3809726 Let l(z) = z2 - 1. Let q(y) = 928y2 - 5. What is q(l(s))? 928s*4 - 1856s2 + 923 Let h be 3 - 3 - ((-4)/2 + 0). Let u(l) = -l2 + 7l2 - 2l*h - 12l*2. Let z(w) = 5w*2. Give z(u(m)). 320m*4 Let q(d) = -2d. Let c(b) = 805359b - 1. What is c(q(w))? -1610718w - 1 Let w(v) = -787v2. Let h(p) = -145p*2 - 628p. What is h(w(f))? -89808505f4 + 494236f*2 Let l(o) = -2o*2. Let t(i) = -2298i*2 - 447i. What is t(l(r))? -9192r4 + 894r2 Let s(x) = -x2 - 105087x - 1. Let u(r) = -10r. Determine u(s(t)). 10t2 + 1050870t + 10 Let s(l) = -9l + 11073. Let d(w) = 2w - 70. What is s(d(g))? -18g + 11703 Let i(a) = 9a*2. Let c(n) = -1. Let j(f) = f - 9. Let k(p) = 3c(p) - j(p). Let o(t) = 6. Let s(y) = -3k(y) + 3o(y). Determine s(i(q)). 27q2 Let y(a) = -a2 - 6a - 111415. Let p(o) = 24o. Give y(p(c)). -576c*2 - 144c - 111415 Let y(n) = -5n2. Let w(m) be the second derivative of 17m*4/3 - 39m. Let t(i) = 6w(i) + 85y(i). Let z(x) = 2x. Determine z(t(h)). -34h*2 Let y(f) = 98f. Let u(n) = 780689n. Give u(y(b)). 76507522b Let f(a) be the second derivative of -2a4/3 + 488a. Let y(i) = -2. Let g(l) = l*2 + 7. Let k(u) = -6g(u) - 21y(u). Determine k(f(d)). -384d*4 Let r(g) = g. Let q(i) = 40i + 3. Let m(b) = b*2 + 8b - 19. Let j be m(-10). Let d be q(j). Let f(o) = -o + o + do2. Determine f(r(l)). 43l*2 Let f(c) be the first derivative of -41c*3/3 - 1589. Let o(r) = 45r + 3. What is f(o(y))? -83025y2 - 11070y - 369 Let t(u) = 9u2. Let n(c) = 222 + 468c - 447 - 88c + 225. Give n(t(b)). 3420b*2 Let b(u) be the first derivative of -1/2u*2 + 0u + 7. Let i(s) = -6s. Calculate i(b(v)). 6v Let l(h) = h*2. Let w(f) be the third derivative of -89f*5/60 - 5f*4/12 + 2f*2 + 22. Calculate w(l(j)). -89j*4 - 10j*2 Let u(q) be the third derivative of 0q*3 + 69q*2 + 0 + 1/12q*4 + 0q. Let m(h) = 11*h - 1. What i	{ "pile_set_name": "DM Mathematics" }
x - 18 Find the second derivative of 164326760hr4 + 27hr + 4h + 181r - 59 wrt r. 1971921120hr2 Find the first derivative of -4423032y*3 + 5769524 wrt y. -13269096y*2 Find the first derivative of -2518320i*3 - 5226177. -7554960i*2 Differentiate -5m*3v + 1084082m2v - 2603571v wrt m. -15m*2v + 2168164mv Find the second derivative of 2xz*3 - 35560xz2 + 52xz - 167z*3 - 16z*2 - 4z - 707189 wrt z. 12xz - 71120x - 1002z - 32 Find the third derivative of -56i6 + 47625i*5 + 13940334i*2 + 3i. -6720i3 + 2857500i*2 Find the second derivative of -126tv3 + 7tv2 + 206432tv + 3t + 10v3 - 23v*2 + 45v wrt v. -756tv + 14t + 60v - 46 Differentiate 657918850a3oy2 - 8a*3y + 6a3 + ay*2 + 194084a wrt o. 657918850a3y*2 Find the first derivative of 146754666k*4 + 2k*2 + 75484836 wrt k. 587018664k*3 + 4k Find the first derivative of 191405gl + 9g - 3l - 815261 wrt g. 191405l + 9 Find the second derivative of 12549388u*2 - 2806u + 56. 25098776 What is the derivative of -10n2 - 317985n + 2296854 wrt n? -20n - 317985 What is the derivative of 111721368cj + 42258120j wrt c? 111721368j Differentiate 850422b*3 + 40942914 with respect to b. 2551266b2 Differentiate -c2j - 27397230c*2 - 3011145j wrt j. -c*2 - 3011145 Find the second derivative of -22805651h*2o + 34905636ho wrt h. -45611302o Differentiate -22025545j*2 - 9j - 79084266 wrt j. -44051090j - 9 What is the derivative of -110533837p*4 + 891392478 wrt p? -442135348p*3 Find the third derivative of 655659913g*3 - 740927791g*2. 3933959478 What is the third derivative of 3804221b5 - b4 - b*3 - 561b*2 - 226b - 48 wrt b? 228253260b2 - 24b - 6 What is the third derivative of 12009y3z*2 + 15y*3 - 76y*2z*2 + 5633yz + y + 2 wrt y? 72054z*2 + 90 Differentiate -113n*2 - 514n + 345846 wrt n. -226n - 514 Find the first derivative of 16ht - 101147h + 6505353t wrt h. 16t - 101147 Find the second derivative of 18885m4 + m3 - 559m*2 + 774m - 4005. 226620m2 + 6m - 1118 What is the third derivative of 965u5 - 3709u*4 + 10u*3 + 90642726u*2 + u? 57900u*2 - 89016u + 60 What is the second derivative of -8931i3t*3 + 278i*3t*2 + 76717291i*3t wrt t? -53586i3t + 556i3 What is the second derivative of -14w*5 + 186114w*3 - 24w*2 - 211363591w? -280w3 + 1116684w - 48 Find the third derivative of 4h2q*4 + 3h*2q*2 + 7h*2 - 60835374hq5 + 2hq - 50473 wrt q. 96h*2q - 3650122440hq*2 Find the first derivative of -204i*3 + 250882i*2jx + 11jx - 43j + 16579x - 2 wrt i. -612i*2 + 501764ijx What is the first derivative of 7q4x - 746839q3x - 9025473x wrt q? 28q*3x - 2240517q2x Find the second derivative of 15hjq + 2hj + 678hq2 + 2hq + 25h - 39jq*2 - j + 15q*2 + q - 1 wrt q. 1356h - 78j + 30 What is the derivative of -11636957hx2 - 5x*2 - 1109094x wrt h? -11636957x2 What is the derivative of 497844957x + 36908143? 497844957 What is the second derivative of 83646m3 + 27m*2 + 88027m + 1 wrt m? 501876m + 54 Find the first derivative of -73740871l*4 - 71883710 wrt l. -294963484l*3 Find the third derivative of -85935565i*3 + 101471533i*2 wrt i. -515613390 Find the first derivative of 198857832u*2 + 288184585. 397715664u What is the derivative of 69516a3 + 2002a + 413014597? 208548a2 + 2002 Differentiate bo*2y - 11bo*2 - 358bo - 199by + b - 117040o*2y + 919o2 with respect to y. bo*2 - 199b - 117040o2 What is the second derivative of 14385556l*2 - 48l - 717541 wrt l? 28771112 Find the third derivative of 133u6 - 757u*4 + 2u*3 - 114864156u*2 wrt u. 15960u*3 - 18168u + 12 Find the second derivative of -14143254t3 - 24t*2 + 1384257941t. -84859524t - 48 Find the second derivative of -250636aq4w + 3aw - 85q3w + 38q + 39134w wrt q. -3007632aq*2w - 510qw Find the second derivative of 71330l2v*3x - 66l2v*2x + 19lx + 396v3x + 85v wrt l. 142660v*3x - 132v2x What is the second derivative of 22969h3q*3 + 2h*3 + 162h*2 + 114hq3 + h + 7854q*3 + 1 wrt h? 137814hq3 + 12h + 324 What is the derivative of 384899907bj + 87913461b wrt j? 384899907b What is the third derivative of 9551g6 + 6664g5 - g2 - 34169g - 9 wrt g? 1146120g*3 + 399840g*2 What is the first derivative of 16059847d*2 + 13629944? 32119694d Differentiate 45033454r4 - 12599996 wrt r. 180133816r*3 Differentiate -423078474c + 694951237 with respect to c. -423078474 Differentiate 453627806pz*2 - 74z*2 + 536616 with respect to p. 453627806z*2 Find the third derivative of -68134y*5 + 6y*3 + 8933476y*2. -4088040y*2 + 36 Differentiate -96b*2 + 3845b - 9750237 wrt b. -192b + 3845 Find the second derivative of 14450358a*5 + 854a - 3569. 289007160a3 Find the second derivative of -6i*3 - 33953697i*2 + 3i - 61926373 wrt i. -36i - 67907394 What is the derivative of -29970fu2 + 32fu + 12u*2 + 1000u - 2 wrt f? -29970u2 + 32u What is the third derivative of -52532701u4 - 26751483u*2 wrt u? -1260784824u Find the first derivative of -4f3v - 5f3 + 6f*2v - 210fv - 97429f + 852v + 9 wrt v. -4f3 + 6f*2 - 210f + 852 Differentiate -9999059u2 + 4736886 wrt u. -19998118u Find the third derivative of -13172146r3z*3 + 2r*3z2 - r2z3 + 50r*2 + 847rz3 - 6r + z*3 wrt r. -79032876z*3 + 12z*2 Find the second derivative of 150u*4 + 17929u*3 + 375u - 4896 wrt u. 1800u2 + 107574u What is the second derivative of -13230007f4t*2 - 2ft2 + 2ft - 54t*2 - 2t - 5373 wrt f? -158760084f2t*2 What is the second derivative of 18708653l*2 - 6852768l wrt l? 37417306 What is the derivative of -923431cy - 3c + 77023 wrt y? -923431c Find the third derivative of 1230m3o*2s + 123m3o*2 - 15m*3s - 4m2o*2s + 3199m2o*2 - 13m*2s - 7ms wrt m. 7380o2s + 738o2 - 90s Find the first derivative of 19545158n2 - 4n + 106539298 wrt n. 39090316n - 4 Find the third derivative of -63949cm3t + 2ct + 18m3t*2 + 7m*2t*2 + 11927m*2t + 10t2 wrt m. -383694ct + 108t*2 What is the third derivative of -2vy3 - 7vy2 - 4vy - 118919086y*3 + 2y*2 - 9y + 27682 wrt y? -12v - 713514516 What is the first derivative of -990mouy + 18moy - 150169my + 305ou - 2oy - o wrt u? -990moy + 305o Differentiate -2i2 - 7008901i - 6178336 with respect to i. -4i - 7008901 Find the third derivative of -2824px3 + 2px2 + 5500916px + 2p + 70x3 + 2x*2 wrt x. -16944p + 420 Find the second derivative of -292697b2z*3 + 97b*2z + 8891bz*3 + 83bz2 wrt b. -585394z*3 + 194z Find the first derivative of -322173no*3 - no - 16672496n - 985o*4 + 14 wrt o. -966519no2 - n - 3940o*3 What is the third derivative of 537546685b*3 + 7b*2 - 49640832b wrt b? 3225280110 What is the first derivative of 1010g3o + 46175854g3 + 86g*2o wrt o? 1010g3 + 86g*2 Find the second derivative of 4i*2ry - 21630i*2r - 24i2 + 8266ir - 2i - 188ry wrt i. 8ry - 43260r - 48 What is the second derivative of 11k*3 + 117k*2p + 36k2 + 32kp - 9k + 319p - 14 wrt k? 66k + 234p + 72 What is the second derivative of 12595267l*3 - 6519130l wrt l? 75571602l What is the first derivative of -16345325h*3 - 18556612 wrt h? -49035975h*2 What is the first derivative of -123716304i*3 + 146687194 wrt i? -371148912i*2 Find the second derivative of 8994738h*2ry + h2r + 2h2y - hry - hr - 898hy - ry - 1009y - 5 wrt h. 17989476ry + 2r + 4y Differentiate -33s*3 + 4s*2 + 625080s + 336269909. -99s2 + 8s + 625080 Differentiate -454504561vy*3 - 17978426y*3 - 15y*2 with respect to v. -454504561y*3 Find the third derivative of 7582921c*4 - 8757500c*2 wrt c. 181990104c What is the third derivative of -3485684d3j*3 - 5879d*3j*2l*3 - 5239d*3 + 5dj3l3 + j2l wrt j? -20914104d*3 + 30dl*3 Find the first deri	{ "pile_set_name": "DM Mathematics" }
is the nearest to -1/4? (a) u (b) p (c) 3 b Let b = 26 + -26.4. Let d = -3.7 - 0.3. Let v = 2 + d. What is the closest to 0 in v, -1, b? b Let l(v) = v*3 - 17v*2 + 255. Let f be l(16). Which is the nearest to -5/7? (a) f (b) 2 (c) -0.3 (d) 1/4 a Let i = 0.04 - -2.96. Which is the nearest to -2/5? (a) i (b) 48 (c) 2 c Suppose -3k + 5k = 6. Let s = 9.07 - 9. Let r = 0.27 - s. What is the closest to r in -0.4, -1/6, k? -1/6 Let a = -0.60068 - -0.10068. Let m be 12/(-7) + 6/(-21). What is the closest to -0.1 in m, a, 1? a Let a = -15.7 - -18.7. What is the closest to 7 in 2/7, a, 2/9? a Let o be 16/104 + (-10672)/78. Let n = 138 + o. What is the nearest to -3 in 0, n, -0.4? -0.4 Let u = 9 - 6. Let o = -3.2 + u. Suppose 0 = -8d + 12d. What is the closest to d in o, 4, 3? o Let n = -492 + 494. Let p = -0.1 - 0.4. Which is the nearest to n? (a) p (b) -0.1 (c) -11 b Suppose -3v + 7v - 32 = 4o, -3o = -2v + 19. Which is the nearest to 3? (a) -0.4 (b) o (c) 2/15 (d) 26 c Let m(v) = -38v + 1258. Let l be m(33). Let d(w) = w + 9. Let g be d(-5). Suppose 0n + g = -3n + x, -4 = 2n - 2x. What is the closest to -1/3 in n, l, -4? n Let x = 77 - -18. Let i = 96 - x. Which is the closest to i? (a) 0.7 (b) -1 (c) 2/9 a Let u = 0.15 - 0.02. Let d = -0.03 + u. Suppose 56i = 55i + 5. Which is the closest to 1/14? (a) d (b) i (c) 0.4 a Let u = -0.064 - 0.336. Let m = 255 - 250. Let f = 0.1 - 0. Which is the nearest to f? (a) -2/9 (b) u (c) m a Let j(z) = -z3 + 13z*2 + 27z + 52. Let d be j(15). Which is the nearest to d? (a) -4 (b) 3 (c) 0.2 b Let j = 1403/5 + -280. Let m(u) = 7u2 - u + 2. Let a be m(-2). Let t = 63/2 - a. What is the nearest to -2 in t, 0.5, j? t Let k be (3/30)/((-2)/8). Let d = -1.073 + 0.073. Which is the nearest to k? (a) -0.1 (b) -4 (c) d a Let l be -1 - -1 - 4/6. Suppose 5k - 28 = 4k. Let b be (-9)/k - 12/(-21). What is the nearest to b in l, -1, 1/4? 1/4 Let k = -5.6 - -6. Suppose 0 = -2v + 5v. Let n = 760 + -759. Which is the closest to -0.1? (a) v (b) k (c) n a Suppose 4r = -294 + 290. What is the nearest to 0.1 in 3, 24, r? r Let s = 2.35 + -2.6. Let u = -0.55 - s. Let q = 0.1 + u. What is the nearest to q in 2, 2/9, -1? 2/9 Let l = -6.8 + -0.2. Let r = l - -7.1. Let y(n) = 3n - 1. Let j be y(1). Which is the closest to 2? (a) r (b) -0.1 (c) j c Let c = -153 + 256. Let h = c + -521/5. Let d = -47/8 + 321/56. What is the closest to 1 in 5, d, h? d Let n = -1.5 - -1.6. Let m = 0 + -0.05. Let b = m + 5.05. What is the closest to n in -0.5, b, 3/7? 3/7 Let v = 374 - 372.27. Let f = v - -1.27. What is the closest to -3 in f, 0.1, -0.4? -0.4 Let x(f) = -f3 + 5f*2 + 6f - 3. Let u be x(4). Which is the closest to -1? (a) 3 (b) u (c) 0.3 (d) -0.1 d Let r = 113.295 + 1.705. Which is the nearest to -1? (a) 3/4 (b) -1 (c) r b Let r be (2 + 81/(-39))-2. Let l = -0.012 - -4.012. Let a = 1.89 + 0.11. What is the nearest to a in -1/5, l, r? r Let v = 120 - 118. What is the nearest to 4 in -3/4, v, -0.07? v Let p = 51 + -56.2. Let i = p + 1.2. Which is the closest to 0.1? (a) -1/3 (b) i (c) 2/9 c Let l = -97 + 55. Let t = l - -41.9. What is the nearest to t in 6/5, -2/15, 3? -2/15 Let s = 0.24 - 0.14. Let n = -1.9 - 0.1. Let h = -40 + 45. Which is the closest to n? (a) s (b) 0.5 (c) h a Let u = 0.1222 + 0.1778. Let p = 0.1 + -0.15. Let d = p + -2.95. Which is the nearest to 0.1? (a) -1/4 (b) d (c) u c Let f = 88 + -87.8. Which is the closest to 2/7? (a) -0.4 (b) 1 (c) f c Let d = 1 + -85. Let p be 2/8 + 33/d. What is the nearest to p in -2/9, -4, -0.3? -2/9 Let t be (-22)/(-110) + 2 + (-44)/20. Which is the nearest to t? (a) -0.5 (b) 1 (c) -1/4 c Let x = 0.09 + 4.91. Let n = 1.5 - 1.6. Let i = 34 + -35. What is the nearest to i in n, x, -3? n Let o = -4.74 + 4.64. Let j = -6 - -5. What is the closest to j in o, 0.4, 3? o Let i = -2774/9 - -308. What is the nearest to i in -5, -0.3, 0.4? -0.3 Let i = 4.9 - 10. Let k = i + 5.1. Which is the closest to 0? (a) 0.3 (b) k (c) 0.07 b Let t be ((-1)/(-10) - 0)(-10)/(-4). Let n = 2 - 1. Let d = -0.27 + -0.13. Which is the closest to t? (a) 0 (b) d (c) n a Let r = -3.0011 + 0.0011. What is the nearest to 0.06 in 1/17, 2, -0.3, r? 1/17 Let n(y) = 3y + y2 - 2y - 6y. Let i = 56 + -51. Let g be n(i). Which is the closest to g? (a) -0.4 (b) -0.1 (c) 5 b Let v be 4/(-7)((-36)/8 + 1). Suppose 4r = -vr. Suppose 4p = -7 + 27. Which is the closest to r? (a) p (b) -8 (c) 1/5 c Let p = -5 - -1.6. Let w = 0.6 - p. Let n = -0.314 - -0.314. Which is the nearest to n? (a) 5 (b) 2 (c) w b Let w = -231/1255 + -4/251. Let s = -4.9 - -0.9. Suppose 2r - 16 = -3r + 2u, 2u + 6 = 0. Which is the nearest to w? (a) r (b) s (c) -4/9 c Let u = 3.22 - 3.32. Which is the closest to u? (a) 1/4 (b) 2 (c) 4 a Let q be 8/32 - (-84)/(-208). Let d = -5 - -1. What is the nearest to 0.1 in -0.2, q, d? q Let v = -21 + -17. Let j = 33 + v. Which is the nearest to 0.2? (a) j (b) 0.4 (c) -4 b Let o = -18.1 - -17.1. Which is the nearest to o? (a) 2/5 (b) -2 (c) -0.3 c Suppose 43p = 32p + 22. Let g = -3 - -2.5. Let v be 2/7 + 40/(-42). Which is the closest to -2/9? (a) v (b) p (c) g c Let v = -35 - -34.97. What is the nearest to 0.1 in -3, v, -0.2? v Let p be (-1(3 + -1))/(61 + -64). Let t = -1 + 1. Which is the closest to p? (a) -4 (b) -3/5 (c) t c Let z(a) = -2a - 8. Let g be z(7). Let r be 1/g(-8 + 4). What is the nearest to -3 in r, -2, -0.2? -2 Let z = 4.0769 - 0.0769. What is the nearest to 1 in -0.28, -4, z? -0.28 Let d(s) = -s*2 - 12s - 36. Let y be d(-7). Which is the closest to y? (a) 5 (b) -5 (c) 2/15 c Let r be 3 + (57/36)/((-5)/10). Which is the nearest to 2? (a) -11 (b) -1 (c) r c Let r = -39.7 - -39.5. Which is the closest to -1/3? (a) 0 (b) r (c) 3 b Let p be -6 + (972/17)/9. Which is the nearest to 0? (a) 0.3 (b) p (c) 0.4 (d) -4 a Suppose -17k + 12 = -13k. Suppose kd - 5m + m = 0, m = -d - 7. What is the nearest to -2 in d, 0.3, 0.2? d Let d be -5 - -31 - (-2048)/(-80). Let p = 0 + 0.4. Let k = 0.2 - 0.3. Which is the closest to d? (a) k (b) 0.5 (c) p c Let q = -3 - -2.9. Let f = 2086 + -2085.7. What is the nearest to q in f, 0.1, 3? 0.1 Let g = 75 + -72. What is the closest to -0.1 in -2/3, 12, g? -2/3 Suppose 5s - 7s - 26 = -4f, -8 = -4s - 4f. Which is the nearest to -21? (a) -4 (b) -3/4 (c) s (d) 3 a Let c = 7873 - 7872. Let u = -3 - -6. What is the closest to -1/5 in -3, u, c? c Let m = -12.5 - 3.5. Let i = m + 16. Let q(b) = -b2 + 17b - 29. Let w be q(15). What is the closest to w in i, -4, -5? i Let m(p) = p + 5p + 4 + p - 4p. Let z be m(-2). Which is the closest to 1/5? (a) -3/2 (b) z (c) 5 a Let y = 93.5 - 17.5. Let p = y + -87. Which is the closest to -0.2? (a) 4 (b) p (c) 0 c Let n be (-137086)/(-3)12/20. Let u = n - 11514229/420. Let j = u - 25/12. Which is the closest to -2? (a) -4 (b) -0.2 (c) j b Let j = -11.27 - -16.27. What is the closest to 1/2 in 1/6, 2/7, j, 2/9? 2/7 Let u = -2.7 - 1.3. Let z = 2906/5 + -579. Let q = z + -87/35. Which is the closest to q? (a) -1/4 (b) u (c) -2/3 a Let t = -0.1 + 0.2. What is the nearest to -6 in t, 1, 0.2? t Let o = 72.5 - 78. Let d = -5.7 - o. Which is the nearest to -2? (a) 3 (b) 5/4 (c) d c Let p(l) = l3 + 7l*2 + 4l + 26. Let n be p(-7). Which is the nearest to n? (a) 0.24 (b) -1/11 (c) 1/8 b Let k = -79 - -157/2. Let w = -2484/1565 + -4/313. Which is the closest to k? (a) 0.3 (b) w (c) -0.4 c Let x(v) = -v - 26. Let q be x(-23). Let u = -6.9 - -8. Let r = u - 1.4. Which is the nearest to 0? (a) q (b) r (c) -2 b Let f = 154 - 159. Suppose -2x = u - x - 1, -2u = -5*x + 19. Which is the nearest to 0.1? (a) 4/9 (b) f (c) u a Let v = -0.41 + 0.41. Let x be ((-4)/6)/(2/303). Let k = x - -503/5. Which is the nearest to v? (a) 4 (b) 0.5 (c) k c Let z be (147/294)/((-3)/(-2)). What is the closest to -0.8 in -3, 5, 4, z? z Let m = -2.06 + 0.06. Let v = -6.7 - -2.7. Let k = m - v. What is the closest to 1/7 in -4, k, 1? 1 Let k = 102 + -143. Let l = 40 + k. What is the nearest to 2/9 in -5, 2/11, l? 2/11 Let v = 3 + 0. Let z = -0.1594 + 1.1594. What is the closest to z in	{ "pile_set_name": "DM Mathematics" }
65403 to seven dps. -0.0000465 What is 451965300 rounded to the nearest one million? 452000000 What is -0.521746 rounded to 3 dps? -0.522 What is 182627000 rounded to the nearest 1000000? 183000000 What is -14168000 rounded to the nearest 100000? -14200000 Round 68144 to the nearest 1000. 68000 Round -937780000 to the nearest 1000000. -938000000 What is -317.54 rounded to the nearest integer? -318 What is 1.5589 rounded to 3 decimal places? 1.559 What is 0.00001865 rounded to four dps? 0 What is -0.705838 rounded to zero dps? -1 What is -0.001276348 rounded to six decimal places? -0.001276 Round -5.051303 to one dp. -5.1 Round 361441 to the nearest ten thousand. 360000 What is -0.0028 rounded to 2 decimal places? 0 Round -0.01366917 to four dps. -0.0137 What is 0.00959388 rounded to 3 decimal places? 0.01 What is 0.00000025997 rounded to 7 decimal places? 0.0000003 Round -0.615549 to 1 decimal place. -0.6 Round -0.0012737086 to 7 decimal places. -0.0012737 What is -50.83956 rounded to the nearest 10? -50 Round -741.94 to the nearest 10. -740 Round -18562.7 to the nearest one thousand. -19000 Round -0.03199939 to three decimal places. -0.032 What is -236372 rounded to the nearest ten thousand? -240000 Round 0.014245824 to 3 dps. 0.014 What is -33473.7 rounded to the nearest one thousand? -33000 What is 0.0059834701 rounded to 5 dps? 0.00598 Round 2800920 to the nearest ten thousand. 2800000 What is 73.3624 rounded to 0 dps? 73 Round -478.42835 to the nearest 10. -480 What is -0.000020362 rounded to seven dps? -0.0000204 What is 661693.2 rounded to the nearest ten thousand? 660000 What is 1690710000 rounded to the nearest one million? 1691000000 Round -1.0701518 to 3 dps. -1.07 Round 355032790 to the nearest one million. 355000000 Round -5.1952 to the nearest integer. -5 Round -50097 to the nearest one thousand. -50000 Round 0.000291187 to four dps. 0.0003 Round -566687.46 to the nearest ten thousand. -570000 Round 6721.6 to the nearest 1000. 7000 Round 268108 to the nearest 10000. 270000 Round -0.014335297 to 6 dps. -0.014335 What is 0.000349519 rounded to six dps? 0.00035 What is 0.0000505417 rounded to seven dps? 0.0000505 Round -22728 to the nearest ten thousand. -20000 What is -40517460 rounded to the nearest ten thousand? -40520000 What is 283.171 rounded to one decimal place? 283.2 Round -23480.716 to the nearest 10. -23480 What is 0.002992827 rounded to 6 dps? 0.002993 What is -4308640 rounded to the nearest ten thousand? -4310000 Round -1492.441 to the nearest 100. -1500 Round -0.0001710616 to six dps. -0.000171 Round 0.00002624588 to six dps. 0.000026 What is 11301947000 rounded to the nearest 1000000? 11302000000 What is -0.194812 rounded to 3 dps? -0.195 Round -4.8295412 to three decimal places. -4.83 Round -30058000 to the nearest 100000. -30100000 Round -4616.252 to the nearest one hundred. -4600 What is -436628.4 rounded to the nearest 1000? -437000 Round -157.2067 to 1 decimal place. -157.2 What is -19778600 rounded to the nearest 1000000? -20000000 Round -38293.1 to the nearest 1000. -38000 What is -0.3776323 rounded to three dps? -0.378 Round 2.466676 to 1 decimal place. 2.5 What is -791824.53 rounded to the nearest one thousand? -792000 What is 0.30318608 rounded to 1 dp? 0.3 Round 0.0138173 to 3 decimal places. 0.014 What is -0.00040343 rounded to six decimal places? -0.000403 What is -0.130448 rounded to two dps? -0.13 What is 334430 rounded to the nearest one hundred thousand? 300000 Round 44.73516 to 1 dp. 44.7 What is 0.0008047788 rounded to 4 decimal places? 0.0008 What is -0.00000011353 rounded to seven decimal places? -0.0000001 Round -0.000003037677 to 6 decimal places. -0.000003 What is -33084.686 rounded to the nearest one hundred? -33100 What is -0.039807 rounded to 2 dps? -0.04 What is -5.5689084 rounded to 1 dp? -5.6 What is 0.0010501987 rounded to 6 dps? 0.00105 Round -0.002556092 to six decimal places. -0.002556 What is 0.068511 rounded to 1 dp? 0.1 What is 0.0025955 rounded to three decimal places? 0.003 What is 509.37 rounded to the nearest ten? 510 Round 2872.99 to the nearest 100. 2900 Round -55.14493 to the nearest one hundred. -100 Round 0.005380415 to 4 decimal places. 0.0054 Round -0.006991 to 3 decimal places. -0.007 What is 1069.235 rounded to the nearest 100? 1100 Round 0.0009853953 to six dps. 0.000985 What is 16.8528 rounded to one dp? 16.9 What is 0.0000908551 rounded to six dps? 0.000091 What is 0.00014349618 rounded to 5 decimal places? 0.00014 What is -4907390 rounded to the nearest 1000000? -5000000 Round 1910530 to the nearest 10000. 1910000 What is 0.0236926 rounded to three dps? 0.024 Round -0.0012161027 to 5 dps. -0.00122 What is 21974.85 rounded to the nearest one thousand? 22000 Round 0.514694 to 1 decimal place. 0.5 What is -4859.9364 rounded to the nearest ten? -4860 What is 494439000 rounded to the nearest one million? 494000000 What is -0.0000392906 rounded to six dps? -0.000039 What is -10.4234 rounded to 1 decimal place? -10.4 What is -127.1692 rounded to the nearest 10? -130 Round -0.00000086277 to 6 decimal places. -0.000001 What is 0.00012774572 rounded to seven decimal places? 0.0001277 What is -0.00007603 rounded to six dps? -0.000076 What is 9141.13 rounded to the nearest 1000? 9000 Round -0.0000002007994 to seven dps. -0.0000002 Round -25976.727 to the nearest one thousand. -26000 Round -7.323143 to two dps. -7.32 What is 0.0696773 rounded to two dps? 0.07 What is 56.51765 rounded to 1 decimal place? 56.5 Round -240.8272 to 1 dp. -240.8 Round 0.02463573 to 5 dps. 0.02464 Round -7.05263 to one decimal place. -7.1 Round 0.0344023 to two dps. 0.03 What is -0.051320997 rounded to four dps? -0.0513 What is 228.997 rounded to 0 dps? 229 Round 0.03457018 to three decimal places. 0.035 What is -0.0307637 rounded to one dp? 0 Round -6.31678 to 2 dps. -6.32 What is 0.00193092 rounded to five decimal places? 0.00193 Round -0.56232 to two dps. -0.56 What is -0.123996728 rounded to 2 dps? -0.12 What is 16861800 rounded to the nearest 1000000? 17000000 Round -0.0000004130795 to seven decimal places. -0.0000004 Round -288.94176 to 1 dp. -288.9 Round -88.525749 to one decimal place. -88.5 Round -351.87649 to zero decimal places. -352 What is -199809 rounded to the nearest one thousand? -200000 What is 0.0000116248 rounded to five dps? 0.00001 Round 9197.94 to the nearest one hundred. 9200 Round -45.638433 to the nearest ten. -50 Round -729.283 to the nearest ten. -730 Round -14427.3 to the nearest ten thousand. -10000 Round 0.001846854 to 4 dps. 0.0018 What is -0.00000542358 rounded to 7 decimal places? -0.0000054 Round -0.0011996883 to 5 decimal places. -0.0012 Round -37.317692 to 1 decimal place. -37.3 Round -256965.59 to the nearest 1000. -257000 What is -0.07368654 rounded to 3 dps? -0.074 What is 0.0013584 rounded to 3 decimal places? 0.001 What is -1966696000 rounded to the nearest one million? -1967000000 Round 0.0332751 to 3 decimal places. 0.033 Round -2.051934 to three dps. -2.052 Round -0.03253898 to 4 dps. -0.0325 Round -1493.14 to the nearest 10. -1490 Round -0.000010345327 to six decimal places. -0.00001 What is 0.00000407708 rounded to seven dps? 0.0000041 What is -1877.327 rounded to the nearest 10? -1880 What is 62.9919 rounded to the nearest one hundred? 100 Round 0.002016181 to 4 decimal places. 0.002 Round 4.34488 to 0 decimal places. 4 What is 5.29376 rounded to 2 dps? 5.29 What is 0.02866858 rounded to 5 decimal places? 0.02867 What is 388.374 rounded to the nearest integer? 388 What is 4.338397 rounded to 1 decimal place? 4.3 Round 675352.2 to the nearest 10000. 680000 What is -239423 rounded to the nearest one thousand? -239000 What is -585.1204 rounded to 1 dp? -585.1 Round 7.692033 to 2 dps. 7.69 What is 0.00088147 rounded to 3 dps? 0.001 What is -0.5016017 rounded to 2 decimal places? -0.5 Round -0.09967289 to four dps. -0.0997 Round -0.0013141 to 5 dps. -0.00131 Round -0.000013367 to five decimal places. -0.00001 What is -0.005033723 rounded to 6 decimal places? -0.005034 Round -0.0469022 to two dps. -0.05 Round -0.01375148 to four dps. -0.0138 Round 0.2196224 to 2 decimal places. 0.22 What is -244839300 rounded to the nearest 1000000? -245000000 Round 0.001	{ "pile_set_name": "DM Mathematics" }
t*2vw + 15tw + 177vw wrt v? -2lw - 3t*2w + 177w What is the first derivative of -90cu3 + 69cu + 22740u*3 wrt c? -90u*3 + 69u What is the third derivative of 261m6y - 1475m2y wrt m? 31320m3y Find the first derivative of 229z4 - 344 wrt z. 916z*3 What is the first derivative of -246l*2p3 - l2p2 - 3p*3 + 66p*2 wrt l? -492lp3 - 2lp2 Find the third derivative of -152p*2z3 - p2z2 - 42p*2z wrt z. -912p2 What is the first derivative of 964g*2 - 2494? 1928g What is the second derivative of -972z5 + 3105z wrt z? -19440z3 What is the second derivative of 35c*3rz4 - 27c*3rz + 21c*3 + 2c*2rz - cz + 2rz - 17z4 wrt z? 420c*3rz2 - 204z*2 Differentiate 51l*3z2 - l3z - 368l*3 + 4z*3 wrt z. 102l*3z - l*3 + 12z*2 Find the third derivative of 6p*6v - 11p4v + 47p2v - v wrt p. 720p3v - 264pv Find the third derivative of 58f3r*2 + 3f*2r + 2fr*2 + 6r wrt f. 348r2 What is the second derivative of 23a*2 + 448a? 46 What is the third derivative of -2d2m3 - d2m + 5339dm3 - dm*2 - 986d - m wrt m? -12d2 + 32034d What is the second derivative of -676t2 - 1168t? -1352 Find the second derivative of -b*3h3 + b3 - 2b2h*2v - 2bhv + 69bh + 104h*3 wrt h. -6b*3h - 4b2v + 624h Find the first derivative of -468n*3 - 849. -1404n2 Differentiate k4 + k*3 - 163k - 7386 wrt k. 4k3 + 3k*2 - 163 What is the third derivative of -2a*2c*3q*2 + 7a*2c - ac2q - acq2 + c3q2 - 38c*3 wrt c? -12a*2q*2 + 6q*2 - 228 What is the third derivative of -3g*3z*3 + 12g*3z + 3g2z*3 + 19gz3 - 2z*3 wrt g? -18z*3 + 72z Differentiate 3t3z*3 + 64t*2z*2 - 12z*3 - 9z wrt t. 9t2z*3 + 128tz2 Differentiate 1723s*3t + 210s3 + 5s*2 + t wrt t. 1723s*3 + 1 What is the third derivative of -466x*3 + 63x*2? -2796 What is the second derivative of 32d*4z*3 + 2dz3 - 15dz2 - 3 wrt d? 384d*2z*3 What is the first derivative of -5b*2hl + 3b*2l - 3bh - 122hl - 3h - 2l wrt b? -10bhl + 6bl - 3h What is the second derivative of -1353l2 + 2l - 1063? -2706 What is the third derivative of 29f5 + 3f*4 - 5f*2 + 101f? 1740f2 + 72f Find the second derivative of -5144w2 - 10698w. -10288 What is the first derivative of 634j4 + 932 wrt j? 2536j*3 What is the third derivative of 1051x*3 + 3404x2? 6306 What is the second derivative of -c5 - 285c3 - 4563c wrt c? -20c3 - 1710c What is the third derivative of 5319i4n3 - i3n3 - i2n*2 - 3i*2n + 526in3 + n3 wrt i? 127656in*3 - 6n*3 What is the first derivative of -3u*3z3 + u3z2 - 2u*3 - 15u + z*2 wrt z? -9u*3z*2 + 2u*3z + 2z What is the second derivative of 79y*4 + 7y*2 + 72y - 6? 948y2 + 14 Differentiate 5537f*3 + 748. 16611f*2 What is the first derivative of -2a*2vw + 10a*2v + 2a2w + 28avw + 3av - 10v wrt w? -2a2v + 2a2 + 28av What is the second derivative of -24b4 + b3 - 14b - 1? -288b*2 + 6b Find the second derivative of 58f2 + 2f - 161. 116 Differentiate 6d3o*3 - 20d*3o + 3o3 + 237o with respect to d. 18d2o*3 - 60d*2o What is the derivative of 246i3 - 48? 738i*2 Find the second derivative of -43k3 - k2 + 194k wrt k. -258k - 2 Find the second derivative of -404s5 + 2s*4y - 4s + 19y wrt s. -8080s3 + 24s*2y Differentiate 330n4u*2 + 13u*2 - 8 with respect to n. 1320n*3u*2 What is the third derivative of -2269l*2x*3 - 2l*2x - 40l2 - 7x*2 wrt x? -13614l*2 What is the second derivative of -18cs2 - 2cs - 2c + 2s2 + 7s wrt s? -36c + 4 Find the second derivative of -18m*4 + 115m wrt m. -216m2 Find the third derivative of -2a*3f*4 - 20a*3f*2 - 76a*2f*5 + 1 wrt f. -48a*3f - 4560a2f*2 Differentiate io*3p - 24io*3 - 9io2p - 109i - 2op - 140p with respect to p. io3 - 9io2 - 2o - 140 Find the third derivative of -a*3c*3 + 8a*3c*2t + 240a3ct - 2a*2c*3t - a*2ct + a2c - 5ac*2t - 58c3t wrt a. -6c3 + 48c*2t + 1440ct What is the second derivative of -2l4 + 2922l*3 - 4l - 916? -24l2 + 17532l What is the third derivative of 1163gt*3 + 232gt - 4t*2 wrt t? 6978g Differentiate 13023d3g*2 - 13755g*2 wrt d. 39069d*2g*2 What is the first derivative of 12n*4 - 2n*3 + 266? 48n*3 - 6n*2 Find the second derivative of 1571g*5 + g + 365. 31420g*3 What is the third derivative of 338u6 + u5x3 + 153u*2x3 + u2 wrt u? 40560u3 + 60u*2x*3 What is the derivative of 7a*4c*2 + 2ac2 - ac - 156c2 wrt a? 28a*3c*2 + 2c*2 - c What is the third derivative of 817a*3 + 855a*2 wrt a? 4902 What is the first derivative of 25g + 396? 25 Find the third derivative of 10i5 + 2i*3 + 28i*2. 600i*2 + 12 Find the third derivative of 156g*4k*2 - 3g*3k*2 + 409g*2k*2 + 2k*2 wrt g. 3744gk2 - 18k*2 What is the derivative of -1103a + 512 wrt a? -1103 Find the second derivative of -7215l4 - 3411l - 2 wrt l. -86580l2 Differentiate 2d*3 + 21d*2 + 75d - 6549 with respect to d. 6d2 + 42d + 75 Differentiate -588qu - 841q wrt u. -588q What is the second derivative of -73d5y*2 - 6d*2y*2 + 4dy2 - 653dy - 2 wrt d? -1460d*3y*2 - 12y*2 What is the second derivative of -8u*3y - u*3 + 178u*2 + 1567u + y wrt u? -48uy - 6u + 356 Find the second derivative of 6fk2 - 11f - 54k2 - 2k wrt k. 12f - 108 What is the second derivative of -2h*2k*5 + 2h*2 - 35k*2m*2 - 2km2 - 79m*2 wrt k? -40h*2k*3 - 70m*2 Find the third derivative of -433h*2w*3 + 352h*2w*2 + 6hw3 - 2hw2 - 2w*3 + 1 wrt w. -2598h*2 + 36h - 12 Differentiate 1480n2 + 5n - 4387 wrt n. 2960n + 5 Find the third derivative of -2268h*3j + 2h2 + 21h - 21j wrt h. -13608j What is the first derivative of 25f2x*2 - 27f*2x - 7f2 + 2fx2 - 30f wrt x? 50f2x - 27f2 + 4fx What is the second derivative of -398a*4 + 9a - 17? -4776a2 What is the third derivative of cq*4 + 113cq - 20q*5 - 2q*2 wrt q? 24cq - 1200q*2 What is the third derivative of -56f*3r*3 - 3f3 + f2r4 - 152fr2 - 5fr + 7r*4 wrt r? -336f*3 + 24f*2r + 168r Find the second derivative of 2n*5 - 1051n*4 - 719n wrt n. 40n3 - 12612n*2 What is the third derivative of -29f*3h2 + f3hv*3 + 3f*2h*2v + f*2v*3 - 4fh2v*3 wrt f? -174h*2 + 6hv3 Find the second derivative of -k5 + 951k*4 - 2461k - 4. -20k3 + 11412k*2 Find the second derivative of -4x*3z*4 - 27x*3z*3 + 22x*3 - 11x*2z wrt z. -48x3z*2 - 162x*3z Differentiate 3y3 + 26y + 230 with respect to y. 9y2 + 26 What is the third derivative of -113r*2x*4 + 4r*2x*2 - 69r*2x - 57rx*5 + 3r + 1 wrt x? -2712r2x - 3420rx*2 What is the second derivative of -3a*5f*2 - 133a*2f*2 + 11af2 - 23a wrt a? -60a3f*2 - 266f*2 What is the third derivative of -80c*6 + 16c*5 + 36c*2 + 2c + 15? -9600c3 + 960c2 What is the second derivative of -f4 - 9f3 - 9f + 10? -12f2 - 54f Find the second derivative of -4hn*2 + 11hn + 3h + 132n2 - 5 wrt n. -8h + 264 Find the first derivative of -17bk*3 + 2b + 183k3 wrt b. -17k*3 + 2 Find the third derivative of -26dhry3 - 808dh - 2dr2y*2 - 2dr2 - 3hr2y*3 + hr*2y2 + y3 wrt y. -156dhr - 18hr2 + 6 What is the derivative of 29mou*2 + 3mu2 + 6mu + 2o + 2u2 wrt o? 29mu2 + 2 What is the second derivative of -2592s*5 - 1200s wrt s? -51840s3 What is the first derivative of 73ij3 + ij*2o*2 + ijo2 + 3j*3o*2 + 29j*2o*2 wrt i? 73j3 + j2o2 + jo*2 What is the third derivative of -896d4 + d3 - 1565d2 wrt d? -21504d + 6 Differentiate 2g2s*3x - 119g2s*2 + 2g*2x - sx - 299x wrt s. 6g2s*2x - 238g2s - x What is the	{ "pile_set_name": "DM Mathematics" }
a = 2 + 4. What is the units digit of a? 6 Let o(l) = 4l. Let b(i) = i - 3. Let c be b(4). What is the units digit of o(c)? 4 Suppose 40 = -3h - h. Let s(x) be the third derivative of x6/120 + x5/6 - x*4/24 - 3x*3/2 + 7x*2. What is the units digit of s(h)? 1 Suppose -40 = -k + 33. What is the units digit of k? 3 Let r = 11 - 15. Let c = 5 + r. Suppose 8 = 3o - c. What is the units digit of o? 3 Suppose 5w = 3h - 98, -4h + 5w = -156 + 27. What is the tens digit of h? 3 Let j be -3 + 2 + 5 + -1. Suppose -jd + 3t = -4d - 3, -5d - t = 15. What is the units digit of d(-20)/6 + 1? 1 What is the units digit of -321/(-9) + -2? 5 Suppose 2r = k + 3r - 76, -4r + 158 = 2k. What is the tens digit of k? 7 What is the tens digit of (1 - (-4 - 14)) + -4? 1 Suppose -r + 8 = -3s, -3r + 3s + 8 = 2s. Let q = 6 + r. What is the units digit of q? 8 Let y be 37 + 1(-1 + 1). Suppose 9 = 4o + y. Let l(n) = n*2 + 8n + 8. What is the units digit of l(o)? 1 Suppose 2g = 2x + 22, -3g - 12 + 43 = -x. What is the units digit of -14(-4)/(-2 + g)? 7 Suppose -4j + 3z = -2z - 8, 3z = 0. Let o be 1/2 - (-3)/2. What is the units digit of j(-3 + o) + 8? 6 Let s = -6 - -78. What is the units digit of s? 2 Suppose -3p + 15 = 63. What is the units digit of p/(-5)25/5? 6 Let v(s) be the first derivative of -s2 + 5s + 4. What is the tens digit of v(-7)? 1 Let a = -8 - -11. Suppose 7 - 13 = -ay. Suppose 0 = 5t - 4s - 10, 3t - yt + s = 11. What is the units digit of t? 6 Let c = 145 - 78. What is the units digit of c? 7 Suppose s - 46 = -18. What is the units digit of s? 8 What is the tens digit of 4/18 + 7700/99? 7 Suppose 4z - 3z = -4o + 19, -3z - 23 = -4o. Suppose oa = a + 80. Suppose a = 5g + 3f, g + 3g - 2f = 16. What is the units digit of g? 4 Let q be 2/3 - (-51)/(-9). Let c be q1/(-1 + 2). Let b(m) = m*3 + 5m*2 - 3m - 3. What is the tens digit of b(c)? 1 Let z be (-4)/615/2. Let p = 8 - z. What is the tens digit of p? 1 Let r be (-3)/(-2)-2 + 11. Suppose 0 = -2b - 3u + 14, -24 = -4b - 5u + r. Suppose g = 4c - 18 + 41, -c + b = g. What is the tens digit of g? 1 Suppose 3z - 9 = -3. Suppose -zv + 3v = 24. What is the units digit of v? 4 Let d be 0 + 3 - 0 - -1. What is the units digit of 21 - 4/(d/(-3))? 4 Suppose 4r - 5 = 3. Let c(m) = -2m - 2m3 - 3m*2 + 3m*3 + 4m*r + 3 - 2m*2. What is the units digit of c(2)? 3 Suppose i + 2c = 13, i = 4c + c - 15. Suppose -id = 5o - 38 + 13, -4d = -2o - 8. What is the units digit of (8/(-10))/(o/(-10))? 4 Let x(h) = -h3 + 5h*2 + 4h + 7. Let g be x(6). Let t = -3 - g. Let r = t + -1. What is the units digit of r? 1 Let z = 291 - 145. What is the hundreds digit of z? 1 Let h(u) = u*3 + 6u*2 + 6u + 5. Let g = 0 + -4. What is the tens digit of h(g)? 1 Suppose 2d + 2 = 2p, -2 = -2p + 4. What is the tens digit of (d/(-6))/(8/(-936))? 3 Suppose -30 = -2s + 4a, 0 = -6s + s + 3a + 40. Suppose 4n + sv = 6, -n + 8 + 1 = 5v. What is the units digit of n(2 - 1) - -3? 2 Let p(h) = h3 + 6h*2 + 4h + 3. Let o be p(-5). Let k = o - 5. What is the units digit of k/(-6) + 18/4? 4 Suppose 5r = 2r - 18. Let f = r - 1. What is the units digit of (0 - f/3)3? 7 Let h = -5 - -1. Let y = -2 - h. What is the units digit of y? 2 Let k be (0 - -2) + -2 + 10. Suppose k = 5q - 15. What is the units digit of q? 5 Let d(h) = 3h2 + 2h + 11. Let b be d(5). Suppose -4p + 0 + b = 0. What is the tens digit of p? 2 Let d be (-12)/(-6) + (-1 - -1). Suppose 2a + 0a - d = 0. What is the units digit of a? 1 Let a(g) = -g3 - 10g*2 - 3g + 14. What is the units digit of a(-10)? 4 What is the units digit of (13 + 79)(-2)/(-4)? 6 Let l = 8 + -3. Let y(c) = -c2 + 10c + 4. What is the tens digit of y(l)? 2 Let j be 158/18 - (-8)/36. Suppose -3 + j = 2z. Suppose za - 3k = -5 - 4, 3 = 4a - k. What is the units digit of a? 2 What is the tens digit of 6/39 - (-2986)/26 - -1? 1 Let z = -21 + 17. Let g(b) = -b*3 - 2b*2 - 3. What is the tens digit of g(z)? 2 Suppose -c + 5z = -2c + 20, 3z = -2c + 12. What is the units digit of 2 + (-2)/(-2 + c)? 3 What is the hundreds digit of 3062/8 - -1 - (-4)/16? 3 Suppose 2b - 4 = b. Let p(i) = i*3 - 7i*2 + i - 5. Let k be p(7). Suppose 2u = k + b. What is the units digit of u? 3 Let x = -1 + 7. What is the units digit of x? 6 Suppose 5l - 4 = l. Suppose -2t - l = -i, -3 = 3t - i - 4. Suppose -x + 2x = t. What is the units digit of x? 2 Let d(w) = -w*2 + 16w + 7. What is the units digit of d(8)? 1 Suppose -2 = 2z - 12. Suppose -zu + d + 149 = 0, 8u - 5d - 145 = 3u. What is the tens digit of u? 3 Suppose 2y = 3d - 9, y + 2y - 4d = -15. Let m(h) = -h3 - 9h*2 - 2h - 9. Let k be m(y). Suppose -2a + k + 5 = 0. What is the units digit of a? 7 Let a(w) = -w2 - 8w - 10. Let y be a(-6). Let f = y - -20. What is the units digit of f? 2 Let g(k) = 5k3 - 5k*2 - 3k - 5. Let x(l) = -6l3 + 4l*2 + 2l + 4. Let j(a) = -3g(a) - 4x(a). What is the units digit of j(1)? 8 Suppose 0 = -6g + 3g + 24. Suppose -k = k - g. Let w = 18 - k. What is the tens digit of w? 1 Let b = 6 - 6. Suppose 2r + br = 10. What is the units digit of r? 5 Let f(p) = p*2 + 5p - 10. Let d be f(-7). Suppose r + 20 = 2r + 4u, dr - 5u + 4 = 0. What is the units digit of r? 4 What is the tens digit of (-1)/3 - 100/(-3)? 3 Suppose 0 = -5r + 304 + 61. Suppose r = 5l - 12. What is the units digit of l? 7 Let j = -184 - -265. What is the tens digit of j? 8 Let x(j) = -j*2 + 4j. Let l be x(3). Suppose 5i = lw + 44, -2i + 11 + 17 = 4w. Suppose -i = 5u, -3q + 13 + 12 = u. What is the units digit of q? 9 Let u(v) = -v + 41. What is the units digit of u(-20)? 1 Let s be 2/(-16/(-75)). Suppose -2m + s = 3m. Suppose -mk = -27 - 33. What is the tens digit of k? 1 Let x = 5 + 0. Let l(j) = -j*2 - 2j - 1. Let z be l(-1). Suppose -i - q + xq = -3, -i + 2q + 7 = z. What is the tens digit of i? 1 Suppose 0 = -l - 10l + 275. What is the units digit of l? 5 Let h be ((-2)/(-6))/(2/6). Suppose -3s + 8 = -h. Suppose 0 = -3v + 15 + s. What is the units digit of v? 6 Suppose 3i = -5w + 339, -2i - 3w + 211 = -16. Suppose 6b = -34 + i. What is the tens digit of b? 1 Suppose -5o - l = -297, 3o - 127 = -4l + 41. What is the tens digit of o? 6 Suppose 0 = a - 22 - 8. Let d be 0 + (-1)/((-1)/a). Suppose c = -4c + d. What is the units digit of c? 6 Let f be -5 - (-2)/1 - -70. Let a = -29 + f. What is the units digit of a? 8 What is the units digit of (18)/((-5)/(-25))? 0 Let y(q) = -q3 + 9q*2 + 14q + 4. What is the units digit of y(10)? 4 Let t(w) = -w + 2. What is the tens digit of t(-11)? 1 Suppose 0 = -w + 3w - 40. What is the units digit of w? 0 Let x be (16/(-10))/(10/(-125)). Let u = 4 + -4. Suppose a + a - x = u. What is the tens digit of a? 1 Let g = 91 + -42. What is the tens digit of g? 4 Suppose o - 195 = -4o. Suppose 2g - o = -5z, -z - 7g - 3 = -3g. What is the units digit of z? 9 Let s be (2/3)/(2/(-6)). Let c be (-10)/4(8 - s). Let d = -15 - c. What is the tens digit of d? 1 Let a(p) = -p3 + 9p*2 + p - 11. What is the units digit of a(8)? 1 Let n(y) = 6y - 6. Let i(z) = z - 1. Let a(m) = -16i(m) + 3n(m). Let b be a(-3). Let r = b + 19. What is the units digit of r? 1 Let a(z) = z*2 + 2z - 3. Let l be a(-6). Suppose 0 = u - 5v - l, 2v = 3 - 11. What is the units digit of u? 1 Suppose -3q + 121 = -2b, 4q + 40 = -4b + 188. What is the units digit of q? 9 Suppose 3h - 2h = 2. Suppose -h - 6 = -4d. What is the units digit of 18d/((-12)/(-2))? 6 Let i = -11 - -25. Let w be ((-3)/(18/4))/(2/15). Let n = i + w. What is the units digit of n? 9 Let z = 32 - -65. What is the units digit of z? 7 Let z(w) = w - 4. Let i be (6 + 0 - 3)/(-1). Let b(j) = -3j - 3. Let p be b(i). What is the units digit of z(p)? 2 What is the tens digit of 12496/80 + (-4)/(-5)? 5 Suppose 0 = 3l - 6q + 4q + 101, 5q - 51 = l. Let a = l - -19. What is the units digit of ((-30)/4)/(9/a)? 0 Let o(b) = b3 - 6b*2 + 2b - 9. Let y be o(6). Suppose ya = -2s - 19, a + 3 = -s + 2*s. What is the units digit of 14/2 - (a + 4)? 8 What is the units digit of (8/28)/1 - (-117)/7? 7 Let x(t) = -t + 14.	{ "pile_set_name": "DM Mathematics" }
7 = -x + 3b for x. 2 Let w(s) = -185s*2 - 4s - 4. Let v be w(-1). Let j = -183 - v. Solve -f - f = 4m + 14, -m - jf - 2 = 0 for m. -4 Let n = -64 + 66. Let u(b) = 4b2 + 4 - 3b + b*2 - 8b*2 + 2b*2. Let a be u(-4). Solve 0 = -4s - v + n + 5, -2v + 6 = a for s. 1 Let o = 8 - 20. Let q(v) be the third derivative of -v5/60 - 7v*4/12 - 4v*3 + 1472v*2. Let p be q(o). Solve 3 = h - g, p = -0h - h + 3g + 9 for h. 0 Let u be 32/16 - -31. Let n(g) = g*3 - 25g*2 + 83g + 21. Let y be n(21). Solve -2h = y, -2m + uh = 3m - 15 for m. 3 Let j(c) = c - 19 + c*2 - 6 - 5c + 2c. Let x be j(-5). Solve -5n - 5q + x = 0, 4n - 2q + 9 = -13 for n. -3 Let p(w) = -w3 - w2 + 33w + 7. Let d(m) = -m*2 - 7m - 5. Let a be d(-5). Let f be p(a). Solve -t - 18 = 4o, -3t - 2o - f = 2o for t. -2 Let s be ((-15)/(-2) - 5)/((-1)/(-2)). Suppose 4k + 405 = -sb, 5b - k = -0k - 430. Let u = -85 - b. Solve -c = -3j - 2c + 10, 2j + 4c = u for j. 4 Suppose -6v - 51 + 63 = 0. Solve -5m = -vm + t + 1, 3m = t - 5 for m. -1 Let u(l) be the second derivative of l*5/20 - 19l*4/12 - 10l*3/3 + 4l*2 + 4l + 1. Let f be u(20). Solve -18 = -2g + 4d - f, 5 = g + 4d for g. 5 Suppose -3m + 3w = -63, -4m + 3w + 105 = 6w. Suppose -13d + 12d + m = 0. Solve -3h + o - 13 = 5, -3h + 3o = d for h. -5 Let c be (-19 + 16)/((-6)/16). Let g(a) = a3 + 11a*2 + a + 15. Let s be g(-11). Solve 0 = so + 4n - 5n - c, -5o = 5n - 10 for o. 2 Suppose -3r - 12i + 16i = -23, 2r = -5i. Suppose c - 3 = r. Solve -c = 4d, 0 = 4g + 3d - 7d - 20 for g. 3 Let t(m) = 23 - 43 + 25 - 10m. Let o be t(1). Let r(p) = p + 9. Let f be r(o). Solve -11 = fc - 3x, c - 3c = x + 3 for c. -2 Let d = -15034 + 15040. Solve -2i - dn - 27 = -7i, i = -2n - 1 for i. 3 Let q = 4393 - 4381. Solve -x - 8 = -3b, -3x + 16b - q = 13b for x. -2 Suppose o - 20 = -4s, -3s - 5o + 4 = -7o. Suppose 3h + 4i + 32 = 81, si = 2h - 26. Solve q + 5w = 3, w + w + h = 5q for q. 3 Let g(s) = -s2 + 12s + 52. Let r be g(15). Let p be 2 + r + -5 + 1 + 0. Solve -pm - 2 = 5d + 3, -5m = d + 1 for m. 0 Let y be 8/(-6) + 12/(-18) - -12. Suppose 9i + 5 = yi. Suppose -ic - 4 = -x - 0x, -4x = 2c - 16. Solve -x = -2p - o, -6 = -2p + 2o - 2 for p. 2 Let s(j) = -53j - 1824. Let w be s(-35). Solve -3u - w = 2b - 16, -2b - 21 = 5u for u. -3 Suppose 0 = -b + v + 10, 72v - 14 = -b + 77v. Solve by - 14y + 38 = 3x, 3y - 3x = 18 for y. 7 Let n be 4/7((-1470)/(-20))/21. Solve -s = -nv + 12, -4v - 5s = 61 - 57 for v. 4 Suppose -3a = 2 - 11. Let m be 48/(-6) + (-3 - -8). Let t = a + m. Solve -u - 4i = t, -u - 2i = -2u for u. 0 Let m = 546 - 496. Suppose 5j = -5j + m. Solve r - 2x - 16 = 2x, jx = -15 for r. 4 Let n be (52/8)/13 - ((-33)/6 + -5). Solve -5c = 3o - 35, o + 21c = 25c - n for o. 5 Suppose k + 0k = 3. Let v be (-1 + (4 - 21))4/(-18). Suppose -30 = -vm - 18. Solve 1 = -5s - 3h + 3, mh - 6 = -ks for s. -2 Let x(o) = 266o - 3424. Let i be x(13). Solve -4w - 29 = 29p - ip, 0 = -4p + 20 for w. -1 Suppose -16 = -4f, -5z + 364 = -5f + 6f. Let m be z/9 - -2 - (6 + -2). Solve 3x - 10 = 4b + 1, 2b + m = 2x for x. 1 Let f be -4-1(-5)/4. Let y be ((-3)/(-3))/((-1)/f). Suppose -18o - 16o + 39o = -63o. Solve -2r = -ou - 2u + 10, -3r - 25 = -yu for r. 0 Let x be ((-6)/72 - 3/(-4))18. Suppose 17 = u + x. Solve -5d - 11 = 5c + 24, -c + ud + 5 = 0 for c. -5 Let n = -88 - -40. Let a be (-1)/(2/n)(-28)/(-12). Suppose 58k = ak + 8. Solve -kh - 4u = -16, 0h + 2h = -5u + 17 for h. 1 Let a be 665/266(3 + -1). Solve 5n - 6n = 3u + 2, 0 = au + 5 for n. 1 Let b be (0/(-17 + 12))/9. Solve -3x = -4h + 14 - 19, -2h - 3x - 7 = b for h. -2 Let r = -23197 - -23208. Solve 4w + 2 = -5o, -19 = -ro + 9o + 5w for o. 2 Let b = 1352 - 1330. Solve -5m - 5p = -b + 12, 0 = -5p - 15 for m. 5 Let z(x) = -10x + 29. Let d(n) = 11n - 31. Let c(v) = 3d(v) + 4z(v). Let q be c(3). Solve 0 = -l - 3j - 10, -5l + qj + 40 = -j for l. 5 Suppose 3q = -3r - 9, -351r + 346r = -4q + 42. Solve 3n = -qp - 6, -21p = 4n - 16p + 4 for n. -6 Suppose 5h - 10h - d + 605 = 0, -145 = -h - 5d. Suppose 123x - hx = 12. Solve -xg = g - 5i, 0 = -5g - 5i - 30 for g. -3 Let y(h) be the third derivative of h5/20 - 8h*2. Let o be y(-1). Suppose 4p - 3m = 14, p = m - 0m + 4. Solve 0 = -b + 4c - 1, -oc - p = 2b for b. -1 Suppose 0 = 47t - 161 - 121. Let i(d) = -d + 11. Suppose 3s + 2b = -0b + 25, 3b - 32 = -4s. Let h be i(s). Solve -ty + y = u, y = h for u. 0 Suppose 0 = -0x + x + 19. Let q = x - -23. Suppose -10 = 2b + 37m - 35m, 25 = 3b - 5m. Solve b = -2l - 2o, 2l - qo + 0o = 30 for l. 5 Let k(h) = 2h*2 + 15h - 14. Let v be k(-7). Let m be (v - -25)(0 + 1). Solve -24 = r + 8l - 3l, ml = r - 12 for r. -4 Let y = 4564 - 4562. Solve -yb = 5f - 31, 4b + 25 = 2f + 27 for f. 5 Let s(x) = x*3 + 9x*2 - 13x - 12. Let b be s(-8). Let p be 336/b + 3/(78/(-4)). Suppose -w + pw = 5w. Solve 3t + w = -4h + 3, 5t = -2h + 19 for h. -3 Suppose -57v + 49v = -32. Let q = -1 + 9. Solve vu - 4 = -4o + q, 2o = -u + 7 for o. 4 Let i be (-2)/(8/(-30))(-46 - (-6174)/105). Solve io + 2p = 98o + 14, 3o - 4p + 26 = 0 for o. -2 Let s be 10/(-25) + (-14)/(-10). Let w be (1 - s)11/(-55). Solve 5z + 9 = 4d, 2z = 2d - wz - 4 for d. 1 Suppose 0 = 167o - 825 + 157. Solve 26 = -2c - ou, -7 - 21 = -2c + 5u for c. -1 Suppose -3t + k + 9 = -2k, 2t - k - 5 = 0. Suppose q - 1 = t. Solve 5c = -3u + 5 + 8, 0 = -qu + 4c - 32 for u. -4 Suppose -3h - 65h + 171 = 103h. Solve 3q = -3u - 6, 4q - 2q = 3u + h for u. -1 Suppose 13x = 898 - 833. Solve 27 = -4s + 31r - 36r, 2s - xr - 9 = 0 for s. -3 Suppose 0 = 6p + 2 - 14. Suppose g - 4t + 4 = 0, pg + 3g - 3t = 14. Let v = -7 + 10. Solve 0 = -vn, -5n - 6 = gz + 2 for z. -2 Let k be 27/20797 - 43/(-11). Solve 0 = 2x - 4u + 12, 9x - 8x - 24 = -ku for x. 4 Let z(u) = u2 + 2u - 3. Let n be z(1). Let r(g) = g*2 + g + 43. Let m be r(n). Let a = -40 + m. Solve -5i + 0 - 21 = -4w, 0 = 2w - ai - 11 for w. 4 Let d be 1/(-11) - (-4)/44. Suppose d = 4l + 4c - 44, -4l + 2l - 6 = -5c. Solve -4h + 5g - l = 0, -g - 11 + 4 = -5h for h. 2 Suppose 212w - 2x + 10 = 213w, -13 = -w + x. Solve -2q = r + w - 5, -3q = -5r + 4 for r. -1 Let t be -3(3 + 20/(-12)). Let b(l) = -3l2 - l + 14. Let u be b(t). Let o = 30 + u. Solve 2a - 16 = -4k, -6a + a + 3k + 1 = o for a. 2 Let m(g) = -g3 - 6g*2 + 9g - 2. Let s be m(-8). Let l be 0/9 + -53 + 2. Let c = l + s. Solve c = -u + j, 3j - 7 = -u + 3u for u. -2 Suppose 22y = 20y + 12. Suppose -4q = -4n + 84, 9n - 4q = yn + 66. Solve -2k = -4r + n, -r + 5 = -0 for k. 1 Suppose -4r - 5w + 67 = 0, 0 = 2r + 4w + w - 21. Let s be 4/10 - (-1316)/235. Let j be (18/(-4))/(s/(-4)). Solve c - r = 5p, -5c + 0p + 27 = -jp for c. 3 Suppose 0 = -37l - 10l + 329. Solve -4n + l = 3x, 2n - 2x + 21 = 7 for n. -2 Let j(h) = 35h + 108. Let d be j(-3). Solve -dx = 3a + 10 - 7, -4x = -a + 14 for x. -3 Let w(z) = z2 - 24z + 56. Let g be w(22). Suppose -4c + 4f = -16, -26c - g = -28c + f. Solve h - c = 3l, -h + l + 4l = -10 for h. 5 Suppose -62f + 64f - 8 = 0. Suppose -fq = -2c + 91 + 283, 5q + 5c + 490 = 0. Let g = 99 + q. Solve g = 2v - 2o, -2o = -7o - 10 for v. 0 Suppose 0 = c - o - 86 + 462, 0 = 2c + 3o + 742. Let w = 377 + c. Solve q = wi + 8, 2i + 28 = -2q - 3i for q. -4 Suppose 3x + 42 = 3w, 4w - 3w = -2x + 14. Let i(g) = 4g*2 - 57g + 18. Let p be i(w). Solve 5q + z + 20 = 0, 4q + 2z = p - 14 for q. -5 Let o = -2436 - -2436. Solve 60g - 9 = 57g + 3i, 4g + 5i + 33 = o for g. -2 Let s(d) = 798d - 1589. Let z be s(2). Solve -4k - z + 5 = o, -3o = 2k - 4 for k. -1 Suppose 0b = -8b. Suppose b = -34m + 37m. Solve m = 2y + 4d - 18, -3y + d = -8 + 2 for y. 3 Let t = 140 + -132. Let y be (10/32)/((-2)/t)-4. Solve v + 3v = -g - 6, -11 = 3g + yv for g. -2 Let k(a) = 595a - 17250. Let z be k(29). Solve z = f, -44j + 45j + 25 = 5f for j. 0 Let y(u) = -2u + 2. Let r(a) = a*3 + 2a*2 + 2a + 2. Let i	{ "pile_set_name": "DM Mathematics" }
the closest to u? (a) -2/9 (b) 5 (c) w a Let p = 15.8 - 15.6. Let j = 22 - 24.2. Let g = p + j. Which is the closest to -0.1? (a) 2/9 (b) g (c) -0.3 c Let g = 1 + -0.9. Suppose 24 = 5o - m, m + m = 5o - 23. Which is the nearest to g? (a) -3 (b) 0 (c) o b Suppose -3d = -5h - 12, 3h + 16 = 8h + 4d. Let p be (-74)/(-666) + ((-4)/(-18) - 1). What is the closest to h in 1/5, 18, p? 1/5 Let j(u) = 2u*2 + 11u + 15. Let p be j(-3). Which is the closest to p? (a) 7 (b) -2/5 (c) -5 b Let l = -0.1825 - -0.0825. What is the nearest to l in -1/4, -1, -2, -0.4? -1/4 Let o = 16 - 31. Let v = -15.5 - o. Which is the closest to 4? (a) -2/11 (b) 1/6 (c) v b Let s = -729.4 + 729. What is the closest to -1/4 in -2/15, -4, s, 2/5? -2/15 Suppose -21y = -22y - 5m + 5, 5y - 2m + 29 = 0. Which is the nearest to 4? (a) y (b) -1 (c) 5/2 c Let s = 1.203 + -1.303. Which is the closest to 1/5? (a) s (b) -2 (c) -8 a Let i = -0.043 + -42.957. Let g = 38 + i. Which is the nearest to 0.1? (a) 4 (b) 0.02 (c) g b Let j = -51 + 43. Let z = j + 5. What is the nearest to 2/9 in 0.2, -1/2, z? 0.2 Let r = 435 + -434.9. Which is the nearest to -3? (a) r (b) 3 (c) -2 c Let k = -2.46 - -0.46. Which is the closest to k? (a) -0.3 (b) 1 (c) 4/5 a Let q be (-13 - -13)/(1 - -3 - 3). Let z be (-2)/(-10) - 2/10. Let s be ((-1)/(-3))/((-1)/(-3)). What is the closest to z in s, -1/5, q? q Let j = 1957 + -1958. Let p be (-4)/(-6) + 50/(-48). What is the closest to j in p, -0.9, -1? -1 Let t = 6 - 6.3. Which is the closest to 0? (a) -15/8 (b) t (c) 5 b Let d = 0.1 - 0.1. Let u(w) = -w3 + 3w*2. Let j be u(3). Which is the nearest to d? (a) j (b) 5 (c) -1/7 a Let j = -4.64 - -5.14. Which is the nearest to -2? (a) j (b) 0 (c) 7 b Let w = -129.9 - -129. Let t = 1.3 + w. What is the closest to 28 in t, -1, 2? 2 Let u = -6.9 + 6.4. What is the nearest to 1 in -0.03, 4, u, -0.2? -0.03 Let p = 1/9 - -7/18. Suppose 0 = -l + 3l + 4. Let y be (-2)/(-4)4 - l. What is the closest to 1 in -1, y, p? p Let z = -17 - 3. Let h = 33 + -51. Let r = z - h. Which is the nearest to -1? (a) 2/5 (b) r (c) -0.3 c Let i = -13 - 52. Let x = i - -63. Which is the closest to 3/8? (a) 3/5 (b) x (c) 3 a Let t = 64 + -66. Which is the closest to t? (a) -27 (b) 0.1 (c) 0.2 b Let r = 4 + -8. Let x = 13 + -8. Let u be 2(1 - 42/36)2. Which is the nearest to -1? (a) r (b) u (c) x b Let y be ((-87)/116)/((-1)/4). Which is the nearest to -2/13? (a) y (b) 3/7 (c) 0.06 c Let m = -0.21 - -0.61. Let w = m - 1.4. Which is the nearest to w? (a) 3 (b) 5 (c) -3 c Let y = -11 - -7. Suppose 0l - 2v = l - 6, -5v + 18 = 4l. Which is the closest to 0? (a) l (b) 0 (c) y b Let y = 2 + 0. Suppose -yx + 7x = 25. Let s be (-2)/x - 14/35. Which is the closest to 0.1? (a) s (b) -1/2 (c) -1 b Let y = -562 + 539. Which is the closest to -0.1? (a) 2/5 (b) y (c) 0.1 (d) 1 c Suppose -3s + 4r + 5 = 0, 4r = 5s + r - 1. Which is the closest to s? (a) -0.5 (b) -0.05 (c) -9 (d) 3/2 a Suppose 8z - 42 = z. Let n be 12/(z - 0)4. What is the nearest to -2 in 0.4, -4, n? -4 Suppose -4a + 15 = 3. Let u be (2/(-3))/((-10)/a). Let k = 180 + -179.6. What is the closest to 2 in k, u, 1/4? k Let h = -2.87 - 0.13. Let l = h + -6. Let o = l + 9. What is the closest to -0.1 in -3, o, 0.4? o Let f = -0.26 + -0.18. Let q = 1.54 + f. What is the closest to -1/2 in q, 0.3, 1? 0.3 Let t = 24.07 + -24. Let z = 2.07 - t. Which is the nearest to -0.4? (a) -1 (b) z (c) 3/5 a Let v = -559 - -7265/13. What is the nearest to -1 in 4/9, 0.2, v? v Let u be 45/18(-4)/(-5) + 0. Let y be 4((-15)/(-7) - u). Let i be 2 + -1 - (-2 - -1). What is the closest to y in i, 2/7, 4? 2/7 Let u(d) = -d - 3. Let j be u(0). Suppose -4r + 8r = 8. Suppose -z = 0, 5z = -2k + rz - 8. Which is the closest to 0? (a) j (b) 1/7 (c) k b Let q = -5639 + 5636. Let f = -0.3 - -0.5. Which is the nearest to f? (a) 3/2 (b) q (c) -0.1 c Let g = 0.0266 - 0.3266. Which is the closest to 1? (a) 2/3 (b) -74 (c) g a Let j be -2(8/16 - 2). Let w = -3 - -2.97. Which is the nearest to 0? (a) w (b) -0.4 (c) j a Let p = 57.8 + -57.7. Let u = 9 + -5. Let i = -596/7 - -85. Which is the closest to p? (a) i (b) 0.2 (c) u b Let r = 0.08 - 0.02. Let b = r - 0.26. Let q = -4 + 3.7. What is the closest to b in q, 2/7, -0.4? q Let s(y) = y + 23. Let t be s(-7). Let o be (6/(-4))/((-12)/t). Which is the closest to o? (a) -2/19 (b) 0.3 (c) 4 b Let u = 0.23 + -21.23. Let m = u + 20. Suppose 3s - p - 4 = 0, 5s + 4p = -0p + 1. What is the nearest to m in -2/7, s, 4? -2/7 Let j = -6 + 10. Let z = -9 + 10. Let v = z + j. What is the closest to 0.4 in -1/3, v, -1? -1/3 Let o = -14.8 + 17. Let i = o - 15.2. Let z = -13.01 - i. Which is the closest to 1/3? (a) z (b) 5 (c) 0.5 c Let q = -138 + 127. What is the nearest to -2/7 in q, 0.2, -2/5? -2/5 Suppose 16 = -9o + 5o. Let r = 1.18 - 0.98. What is the nearest to r in 3, 0.5, o? 0.5 Let r = -1.3 - -0.3. Let s = 5.21 + 0.79. Let p = s + -7. Which is the closest to p? (a) 0.2 (b) 2 (c) r c Let i = -509 - -508.8. Which is the nearest to 0? (a) 2/3 (b) i (c) -22 (d) -3 b Let p = -1.4 + 1.7. Suppose 0 = 5q + 3j + 282, 1 = -2j + 3j. Let g = -173/3 - q. Which is the nearest to g? (a) 4/5 (b) -1/5 (c) p b Let x = 0.04486 - 0.24486. Let l = -5 - -7. Which is the nearest to l? (a) 2 (b) 3 (c) x a Let h be (205/246)/((-10)/(-3)). Which is the nearest to h? (a) -4 (b) -0.4 (c) 0 c Let j = -0.0837 - -0.1837. Let f = -43/70 + 3/14. Which is the nearest to f? (a) 4 (b) j (c) -0.3 c Let l = 14 - -20. Let k = l + -35. Which is the closest to 1? (a) k (b) -0.4 (c) -3 b Let j = -402 - -403. Let q = 3 + 0. Which is the nearest to -0.1? (a) q (b) j (c) 2/9 c Let z = 1421 + -1420. What is the nearest to z in 0.2, 28, 2/7, 0? 2/7 Let q = -3 - -11. Suppose 5i = 4f + 4i + 16, -2f = -4i + q. Let g be 40/16 + f/2. Which is the nearest to 0? (a) 2 (b) g (c) -1/7 c Let g = 18.912 - -0.088. Let s = g + -19. Which is the closest to s? (a) -2/5 (b) -2/7 (c) 2 b Let o = -17739 - -17744. Let q(h) = h3 - 6h*2 - h + 3. Let y be 9/(6/41). Let v be q(y). What is the closest to 0 in -0.5, o, v? -0.5 Let p = -1.6 - -2. Let a = 3161 - 3158. What is the closest to 0 in p, -13, a? p Let k = 14 + -19. Suppose 3i + 5u - 70 = 0, 5i - 4u - 166 = -0u. Let b be (-2)/6i/(-40). What is the nearest to 0.1 in -1/7, k, b? b Let t = -0.3975 + -0.6025. Let z = 2.95 + 0.05. Let n = z + -2. Which is the nearest to t? (a) n (b) -5 (c) -0.4 c Let l be 0 - -1 - (7 - 7). What is the closest to l in -3, -1, 4? -1 Let d = 6 + -6. Let a be 58/(-30) + 6/(-9). Let b = 3 + a. What is the nearest to b in d, 1, -5/2? d Let l be (2/24)/(3/(-8)). Let j = 119 + -1307/11. Let s = 0.29 + 4.71. What is the closest to l in -5, j, s? j Let h = 0.0005 + -0.0005. What is the nearest to 0.1 in h, 2, 0.4? h Let k = 1.9 + -10.9. Let y = k + 9.04. Let z(v) = -v*3 + v. Let g be z(0). What is the nearest to 0.2 in g, y, -5? y Let z = 7 + -6.7. Let o = -0.5 + 0.4. Let v = -1916/11 + 174. What is the nearest to o in v, 3/4, z? v Let x be 14/(-78) + 1/3. Let t = 2.501 - 2.401. What is the nearest to t in x, 0.5, 0.7? x Let b be (-2482)/(-42) + (-6 - -7). Let g = b - 179/3. What is the nearest to 0 in -4, g, -2? g Let g = 57/2 - 29. Let y be ((-84)/35)/((-4)/50). Suppose y - 22 = 4q. Which is the nearest to 0? (a) g (b) q (c) 3 a Let s = -106 - -111. Let a = 932/5 - 187. Let h = -3 + 4. What is the nearest to h in s, a, -0.5? -0.5 Let h = -3.6 + 1.6. Let r be 1/(6/(-57) + -1). Let o = 11/7 + r. Which is the closest to h? (a) o (b) 4 (c) 5/2 a Suppose 0 = -0p + 4p - 104. Suppose 0 = l - 10 - p. Let s be 2/l-58 + 3. What is the nearest to 0.1 in 1, s, -0.2? -0.2 Let n(i) = 2i + 0i - 4i + 20 + 3i. Let p be n(-24). Which is the nearest to 1? (a) 0 (b) p (c) -0.2 a Let k = -1995 + 1995.5. Let g = 0.2 + -0.3. What is the nearest to g in -1, -0.4, k? -0.4 Suppose 5l + 43 = 2g + 2g, -4l - 12 = 0. Let m be ((-1)/g)/(1/4). Let t be (8/(-42))/2-3. Which is the closest to 1? (a) m (b) t (c) 1 c Let b = 344.1 - 344. What is the closest to b in -2/5, -0.2, 0.3, -2/13? 0.3 Suppose 0	{ "pile_set_name": "DM Mathematics" }
d - 3u = w. Is d a multiple of 17? False Let a be (-274)/18 + (-4)/(-18). Let u = -10 - a. Suppose -us + 36 = -2s. Does 11 divide s? False Let j be 3/9 - 8/(-3). Suppose -4o = j + 5. Is ((-1)/1)/(o/6) a multiple of 2? False Suppose 0 = -0h - 5h + 50. Let x = h + 0. Does 5 divide x? True Suppose 2x + 162 = 6x + 2c, x + 5c - 63 = 0. Is x a multiple of 38? True Let c = -36 + 24. Let s(j) = -j*3 - 13j*2 - 11j + 15. Let x be s(c). Suppose xr + r - 148 = 0. Is 18 a factor of r? False Let w = 31 + -25. Is w a multiple of 6? True Let a be 6/((20/74)/5). Let x = a + -43. Is 22 a factor of x? False Suppose m + 0m = 1. Let w be (0 - -2) + m + -86. Let t = 131 + w. Is 21 a factor of t? False Let b be (-20)/(-6)(-12)/(-10). Suppose 2r + p - 5 = 0, -2r + 0p = 2p - b. Suppose -ro = -o - 3h - 12, -4o + 5h = -26. Is o a multiple of 6? False Let a = 8 - 5. Suppose 0 = -2p - 3i + 25, i + ai - 59 = -5p. Is p a multiple of 4? False Let l = 134 - 65. Does 23 divide l? True Suppose -4b + 23 = -13. Let o be 2/6 + (-120)/b. Let z = o - -29. Does 8 divide z? True Suppose 3z - 88 - 37 = -5s, z = s + 47. Is 9 a factor of z? True Suppose 0 = 2d + 4r - 18, -3r - 2r = -2d. Suppose 5 = v - 5t + 1, 20 = 5v + dt. Is v a multiple of 4? True Let h = 211 - 99. Is 6 a factor of (h/(-35))/((-1)/5)? False Let a be (-2 + 2)/((-12)/4). Is 2 a factor of -5 + (2 - a) - -8? False Suppose 4p - 7 - 10 = 5i, 4p = i - 3. Let l = i - -9. Let o = 4 + l. Is o a multiple of 4? True Let h = 46 + -28. Let z be (-4)/h + 7664/(-18). Does 14 divide z/(-15) - (-2)/(-5)? True Let q = 3 - 1. Suppose qx + x = 42. Is 3 a factor of x? False Suppose -6z - 164 = -1154. Does 33 divide z? True Does 28 divide 1(-297 - 5)(-2)/4? False Suppose -a + 18 = -11. Is a a multiple of 9? False Let i(d) be the third derivative of -d6/120 - d5/6 + 7d*4/24 + 7d*3/3 + 3d*2. Let m be i(-10). Is 24 a factor of (7/2)/((-4)/m)? False Let f = 95 - 62. Does 16 divide f? False Suppose 4b + 0 + 17 = -q, 4b + 5q = -37. Let z(n) = 4n3 + 5n2 - n2 - 3n3 - n2 - 2n + 3. Does 7 divide z(b)? False Suppose 4d - 4x = 20, -3d + 21 = 5x - 10. Is d a multiple of 2? False Let v be 0 + -1 + 0 + 2. Let o be 6(-1)/(-3v). Does 7 divide o/4 + (-156)/(-8)? False Let m = 11 - -25. Is m a multiple of 4? True Suppose 0 = 2f - 2. Let t = f + -3. Let o(z) = -8z - 1. Is o(t) a multiple of 5? True Suppose 2o = 0, -o = 6s - 2s - 8. Suppose i + 2t - 4t = -1, si - 16 = -5t. Is i even? False Let x be ((-15)/(-2))/(2/(-4)). Let g be 4 + -2 - 132. Let q = x - g. Does 9 divide q? True Let k(r) = r*2 - 6r + 7. Let d be k(5). Is d + -5 + (-58)/(-2) a multiple of 8? False Let n = -145 - -176. Is 5 a factor of n? False Suppose -7 = -u - 3u - 5q, 0 = -3u - 4q + 5. Suppose -4v - 2y + 1 = 5, 5y = -2v + 14. Is (-27)/v2/u a multiple of 6? True Suppose -643 = 3v + 3j - 1699, 0 = -3v - 2j + 1061. Does 51 divide v? True Suppose -15 = 4x + x. Let n be 256/6 + x/(-9). Suppose 3l + 2r = 3r + 29, 5l - 3r - n = 0. Is l a multiple of 5? False Let i(w) = -2w*3 + 4w*2 - 7w + 1. Let t(y) = y3 - y2 + y - 1. Let r(h) = -i(h) - 3t(h). Does 4 divide r(-3)? True Let t(w) = -5w3 - w2 - 2w - 1. Let v be t(-1). Suppose vx + 2p = 155, -3x = -2p + 5p - 102. Let i = x + 1. Does 8 divide i? False Suppose 172 = 2v - 4n - 52, -v = 4n - 136. Is 15 a factor of v? True Does 18 divide 20/90 + (-968)/(-18)? True Suppose -4b = -5c + 14, -b - 2c = b - 2. Is 12 a factor of b/3 - (-420)/18? False Suppose 0 = -4c + 4y + 1612, 3c + 2y - 6y = 1204. Suppose c = -r + 7r. Does 29 divide r? False Suppose d - 10 + 54 = -2k, -108 = 5k + 3d. Let t be 280/k + (-4)/(-6). Let x = 55 + t. Is x a multiple of 17? False Let r = -82 - -57. Let o = r + 55. Is 15 a factor of o? True Is 12 a factor of 18 + (-2 + 4)/(-2)? False Does 21 divide (-7)/(-2)(23 - -1)? True Let s(x) = 2x2 + 3x - 4. Let u be s(-3). Suppose -2a - 4p = 3a - 329, -3p + 3 = 0. Suppose uz - a = -0z. Is z a multiple of 13? True Let m(i) = -i*2 + 1. Let z be m(1). Suppose 42u = 39u + 57. Suppose z = -5k + u + 11. Is k a multiple of 4? False Let g = -62 - -44. Is 8 a factor of (-25)/(-3) + 6/g? True Let p(f) be the second derivative of f*3/6 + 17f*2/2 - 9f. Is p(0) a multiple of 12? False Suppose -3f - 9 = -6f, -2f + 176 = 5w. Suppose 2g = b + 2 - 13, 5g + 11 = -3b. Suppose l + w = 3q, -bl = -5q + 64 - 10. Does 9 divide q? False Let t be (-65)/(-30) + (-2)/12. Suppose j = -0j + 6. Suppose -56 = -th - j. Is h a multiple of 16? False Let c(r) = -r + 18. Suppose -40 = -0i - 5i. Let x be c(i). Is 11 a factor of (1 + (-2 - x))/(-1)? True Let j be -2 - (3 - (-2 - -12)). Suppose -jt + 123 + 172 = 0. Is 15 a factor of t? False Suppose 2x + 4o - 47 = -o, -3x = -5o - 8. Suppose t - 33 = x. Is 22 a factor of t? True Does 22 divide ((-11)/1)/((-2 - -5)/(-6))? True Suppose -66 = 4d - 6d. Suppose 48 + d = 3t. Is 9 a factor of t? True Let w = 316 + -137. Does 11 divide w? False Let p be (7/(-7))/(1/(-10)). Let f(v) = -3v + 1. Let k be f(1). Let i = k + p. Is 4 a factor of i? True Let q = 2 - 2. Suppose q = 4p + h - 13, -2h - 5 = 5p - 5h. Suppose 2g - 4d - 35 = 5, 0 = 5g + pd - 76. Is 9 a factor of g? False Suppose 0f - 4f = -3n + 7, 2n + 2f = 14. Let b = n - -17. Does 20 divide b? False Suppose 8z = 3z + 220. Suppose c + 2o - 22 = o, -2c = -o - z. Is c a multiple of 8? False Is 7/(7/(-12))(-3)/4 a multiple of 2? False Suppose -i + 7 = 4. Suppose -id - u = -116, 0u = -2d + 5u + 83. Is d a multiple of 13? True Suppose 3f + 5a = 2, -3a + 5 = f + 3. Let h = 2 + f. Suppose -3 = -d + h. Does 2 divide d? True Let h(w) = w*2 - w + 44. Let b = -5 + 5. Is h(b) a multiple of 7? False Suppose -3r + 1 = -11, -x - 4r = -15. Does 14 divide -2 - (x + -15)/1? True Let o(d) = -d - 11. Let p be o(-6). Suppose 6x - 3x - 7 = 4f, -11 = -4x + 5f. Let i = p + x. Does 2 divide i? True Let x(v) be the second derivative of -v*5/20 + 11v*4/12 + 5v*3/2 + 4v*2 + 4v. Is 22 a factor of x(12)? True Let g(n) = 10n + 2. Let d(p) = -9p - 2. Let i(t) = -6d(t) - 5g(t). Let v be i(-2). Is v(-33)/6 + 1 a multiple of 17? True Let z = 7 + -4. Suppose 0 = -h + g - z, -18 = -2h - 3g - g. Does 6 divide 7(57/21 - h)? True Let q = -3 - 5. Let z(f) = -f*2 - 9f - 8. Let y be z(q). Suppose -10 + y = -5w, -3d + 4w = -82. Is 12 a factor of d? False Suppose -3f + 5a = -21, -4f + 26 = 3a - 31. Suppose -f = s - 3s. Is s a multiple of 3? True Suppose 42c + 1120 = 52c. Is 16 a factor of c? True Let m = -50 + 87. Does 7 divide m? False Let f be ((-4)/6)/(30/135). Does 21 divide 35 - (f + (-4 - -4))? False Suppose 6p - 5p - 24 = 0. Suppose 3f = -4q + 3q + 351, 3q = 4f - 455. Suppose f = 4h + p. Does 9 divide h? False Is (-28)/(-70) - -53(-2)/(-10) a multiple of 2? False Let i = 71 + 3. Let c = 104 - i. Is c a multiple of 23? False Is 168/32(-1 + 5) a multiple of 9? False Let s(m) = -m*2 - m + 1. Let h be s(-4). Let z = h - -28. Is 11 a factor of z? False Is 26 a factor of (-102)/910-3? False Suppose 0q - 2q = -30. Is q a multiple of 7? False Let w be (-3)/(2 + 3-1). Suppose -r + 5k + 4 = 0, wk + 37 = -r + 1. Let q = r - -51. Is 15 a factor of q? True Let y = 96 - 201. Let w = 8 + -6. Does 12 divide (-1)/((-207)/y - w)? False Does 3 divide (-78)/412/(-18)? False Let q = -7 - -26. Suppose 0 = -0j + j - q. Is j/((6/(-2))/(-3)) a multiple of 19? True Let o(p) = -p*3 - 24p*2 + 50p + 8. Is 10 a factor of o(-26)? True Let i(l) = 11l + 13. Does 16 divide i(6)? False Suppose -4k + 37 = -55. Suppose 2w = -5g + k, 3w - 29 = -3g + 28. Is 12 a factor of w? True Let t(o) = -37o3 - 1. Let j be t(-1). Suppose 4a - j = -4c, 5a - c - 62 = 1. Is 12 a factor of a? True Let c = 334 + -34. Does 20 divide (-14)/(-2)c/105? True Suppose 0 = 5b - m + 95, 2b = 2m - 58 + 12. Suppose 35 + 7 = 2t. Let h = t - b. Is 19 a factor of h? False Suppose 6s = 5s + 104. Suppose -4v - s = -0v. Let l = -4 - v. Is 11 a factor of l? True Let v(r) be the second derivative of -23r7/840 - r6/360 - r*3/3 + 3r. Let g(d) be the second derivative of v(d). Is g(-1) a multiple of 22?	{ "pile_set_name": "DM Mathematics" }
5, 17, 31 List the prime factors of 1204412. 2, 11, 31, 883 What are the prime factors of 11584010? 2, 5, 1158401 List the prime factors of 475889. 475889 List the prime factors of 11297. 11, 13, 79 List the prime factors of 6987414. 2, 3, 7, 43, 53, 73 List the prime factors of 146254. 2, 73127 List the prime factors of 1247495. 5, 249499 What are the prime factors of 5214573? 3, 7, 13, 6367 What are the prime factors of 12098433? 3, 4032811 List the prime factors of 454183. 454183 What are the prime factors of 1904701? 1904701 List the prime factors of 17096271. 3, 17, 335221 List the prime factors of 9028897. 41, 220217 What are the prime factors of 413918? 2, 43, 4813 List the prime factors of 27525. 3, 5, 367 What are the prime factors of 5661151? 23, 101, 2437 List the prime factors of 2504486. 2, 151, 8293 What are the prime factors of 328808? 2, 23, 1787 What are the prime factors of 1349446? 2, 7, 113, 853 What are the prime factors of 551527? 467, 1181 List the prime factors of 24838098. 2, 3, 463, 8941 What are the prime factors of 837104? 2, 113, 463 List the prime factors of 25296126. 2, 3, 43, 98047 List the prime factors of 186337. 17, 97, 113 List the prime factors of 13387904. 2, 104593 What are the prime factors of 5651548? 2, 7, 17, 31, 383 List the prime factors of 10773468. 2, 3, 101, 2963 What are the prime factors of 167495? 5, 139, 241 List the prime factors of 465986. 2, 151, 1543 List the prime factors of 2368563. 3, 23, 34327 List the prime factors of 366660. 2, 3, 5, 7, 97 List the prime factors of 23464736. 2, 733273 What are the prime factors of 55948? 2, 71, 197 List the prime factors of 44359374. 2, 3, 37, 211, 947 List the prime factors of 6150. 2, 3, 5, 41 List the prime factors of 6328963. 101, 223, 281 What are the prime factors of 5242988? 2, 23, 56989 What are the prime factors of 167827? 11, 19, 73 List the prime factors of 4323866. 2, 2161933 What are the prime factors of 2995357? 47, 101, 631 What are the prime factors of 13429407? 3, 29, 163, 947 What are the prime factors of 3089205? 3, 5, 7, 467 What are the prime factors of 10615? 5, 11, 193 What are the prime factors of 436836? 2, 3, 59, 617 What are the prime factors of 1948592? 2, 121787 What are the prime factors of 4562336? 2, 142573 What are the prime factors of 1376359? 1376359 What are the prime factors of 647568? 2, 3, 1499 What are the prime factors of 4062571? 4062571 What are the prime factors of 26811340? 2, 5, 827, 1621 What are the prime factors of 286299? 3, 13, 2447 List the prime factors of 136310. 2, 5, 43, 317 List the prime factors of 917631. 3, 11, 13, 23, 31 What are the prime factors of 3170981? 11, 41, 79, 89 List the prime factors of 64197. 3, 7, 1019 What are the prime factors of 316118? 2, 11, 14369 What are the prime factors of 2640105? 3, 5, 13, 4513 List the prime factors of 146919. 3, 48973 List the prime factors of 1279313. 7, 179, 1021 List the prime factors of 1139583. 3, 101, 3761 List the prime factors of 19415037. 3, 17, 199, 1913 What are the prime factors of 515761? 515761 List the prime factors of 8672728. 2, 197, 5503 List the prime factors of 314740. 2, 5, 15737 What are the prime factors of 1661701? 61, 27241 What are the prime factors of 1105585? 5, 13, 73, 233 List the prime factors of 1370810. 2, 5, 7, 19583 List the prime factors of 16290530. 2, 5, 41, 39733 What are the prime factors of 3571593? 3, 157, 7583 List the prime factors of 1133530. 2, 5, 263, 431 What are the prime factors of 6234415? 5, 11, 263, 431 What are the prime factors of 230652? 2, 3, 43, 149 What are the prime factors of 1506224? 2, 23, 4093 List the prime factors of 569519. 251, 2269 List the prime factors of 757156. 2, 73, 2593 What are the prime factors of 19649166? 2, 3, 293, 11177 List the prime factors of 2385760. 2, 5, 13, 31, 37 What are the prime factors of 9628391? 113, 139, 613 What are the prime factors of 11258229? 3, 353, 10631 List the prime factors of 657503. 7, 11, 8539 What are the prime factors of 10564362? 2, 3, 586909 What are the prime factors of 2619396? 2, 3, 13, 29, 193 What are the prime factors of 5156931? 3, 13, 132229 What are the prime factors of 1354540? 2, 5, 11, 47, 131 List the prime factors of 48804. 2, 3, 7, 83 List the prime factors of 396412. 2, 99103 List the prime factors of 390067. 390067 What are the prime factors of 40319? 23, 1753 List the prime factors of 574149. 3, 23, 53, 157 List the prime factors of 4839400. 2, 5, 24197 What are the prime factors of 2180757? 3, 31, 131, 179 What are the prime factors of 1356660? 2, 3, 5, 7537 What are the prime factors of 13213910? 2, 5, 1321391 What are the prime factors of 51542? 2, 25771 What are the prime factors of 161540? 2, 5, 41, 197 What are the prime factors of 1737960? 2, 3, 5, 7, 2069 What are the prime factors of 157020? 2, 3, 5, 2617 What are the prime factors of 1998188? 2, 109, 4583 What are the prime factors of 7432237? 97, 193, 397 List the prime factors of 49254. 2, 3, 8209 List the prime factors of 55219. 55219 List the prime factors of 80779. 80779 List the prime factors of 2770791. 3, 43, 47, 457 What are the prime factors of 3765534? 2, 3, 17, 19, 29, 67 List the prime factors of 3423302. 2, 1711651 List the prime factors of 6298346. 2, 3149173 List the prime factors of 16762. 2, 17, 29 What are the prime factors of 9017670? 2, 3, 5, 300589 List the prime factors of 13024337. 13024337 What are the prime factors of 732297? 3, 23, 10613 List the prime factors of 115996. 2, 47, 617 List the prime factors of 178737. 3, 13, 4583 List the prime factors of 6067. 6067 What are the prime factors of 161673? 3, 53891 List the prime factors of 536945. 5, 17, 6317 What are the prime factors of 753699? 3, 251233 What are the prime factors of 1269270? 2, 3, 5, 1567 What are the prime factors of 250762? 2, 19, 6599 What are the prime factors of 22620289? 22620289 List the prime factors of 1374392. 2, 171799 List the prime factors of 2046744. 2, 3, 7, 31, 131 What are the prime factors of 17497444? 2, 4374361 What are the prime factors of 406794? 2, 3, 151, 449 What are the prime factors of 492350? 2, 5, 43, 229 List the prime factors of 466267. 466267 What are the prime factors of 1265235? 3, 5, 84349 List the prime factors of 364253. 43, 197 What are the prime factors of 3576345? 3, 5, 238423 List the prime factors of 2896199. 41, 70639 List the prime factors of 2032292. 2, 508073 What are the prime factors of 3865229? 3865229 List the prime factors of 432228. 2, 3, 181, 199 What are the prime factors of 370831? 97, 3823 What are the prime factors of 753302? 2, 11, 97, 353 What are the prime factors of 36160184? 2, 4520023 List the prime factors of 9227270. 2, 5, 13, 70979 List the prime factors of 552929. 13, 42533 List the prime factors of 388811. 293, 1327 List the prime factors of 55595. 5, 11119 What are the prime factors of 267942? 2, 3, 44657 What are the prime factors of 1148489? 1148489 What are the prime factors of 158804? 2, 29, 37 List the prime factors of 65885. 5, 13177 What are the prime factors of 810221? 23, 35227 List the prime factors of 1398230. 2, 5, 37, 3779 What are the prime factors of 497126? 2, 7, 35509 What are the prime factors of 12756748? 2, 31, 102877 List the prime factors of 3418880. 2, 5, 2671 What are the prime factors of 302857? 302857 List the prime factors of 5846362. 2, 61, 173, 277 What are the prime factors of 1080211? 11, 283, 347 List the prime factors of 59458. 2, 7, 31, 137 List the prime factors of 208800. 2, 3, 5, 29 List the prime factors of 13998684. 2, 3, 7, 17, 9803 What are the prime factors of 1800782? 2, 19, 47389 List the prime factors of 3880662. 2, 3, 137, 4721 What are the prime factors of 7036183? 7, 11, 23, 29, 137 List the prime factors of 18882250. 2, 5, 47, 1607 What are the prime factors of 239090? 2, 5, 23909 List the prime factors of 541040. 2, 5, 6763 List the prime factors of 58589. 41, 1429 What are the prime factors of 1649344? 2, 25771 What are the prime factors of 358678? 2, 37, 131 What are the prime factors of 632511? 3, 11, 6389 What are the prime factors of 397447? 53, 7499 What are the prime factors of 632903? 389, 1627 What are the prime factors of 414506? 2,	{ "pile_set_name": "DM Mathematics" }
2 + hp and give j. -1 Express -56k*3 - 3k*2 - 4 - 65k*3 - k + 119k*3 as ok*3 + w + qk*2 + nk and give q. -3 Rearrange -b*3 + 4b*3 - 2b*3 + (0b + 0b + 2b)(-4b*2 + 4b*2 + 5b*2) to the form zb + n + gb2 + rb*3 and give r. 11 Express -6j - j*3 - 2j2 + j2 + 2j + 3j in the form h + nj + tj*3 + ij*2 and give i. -1 Express 18v + 3v2 - 1 + 4 - 16v in the form lv + a + sv*2 and give a. 3 Rearrange (-3g - g + 3g)(6 + 0 - 3) + 4 + 6g - 4 to the form zg + s and give z. 3 Express -20f + 20f - f*3 + 2 - 3f*4 as b + kf*3 + vf*4 + lf + rf2 and give b. 2 Express -4n*2 + 1 - 139n*3 + 3n - 2n + 141n*3 in the form o + bn + ln2 + un*3 and give l. -4 Rearrange 7 - 3 - 2o + 4o + (1 - 1 + 2)(3o - 2o + o) - o + 3o + 3o to a + po and give p. 11 Rearrange (3t - 4t + 2t + (2 - 1 - 3)(-3t + 3t - 2t) - 4 + t + 4)(3t*2 - 2t*2 - 6t*2) to gt*3 + j + bt + yt2 and give b. 0 Rearrange (17 - 1 + 3)(-6 + 12r + 6) to the form u + vr and give v. 228 Rearrange (3 - 2 - 3)(-1 - a + 1) + (-4a - a + 3a)(-1 + 4 - 1) - 6a + 3a - a to the form ua + k and give u. -6 Express -2 + 0u*2 + 3u*4 - 2u*3 + 7u*2 - 5u2 - u2 in the form w + iu4 + mu*3 + yu + tu2 and give w. -2 Express 3 - 1 - 10t2 + t2 + 18t2 as it + f + wt2 and give i. 0 Express (t - 4t + t)(-2t - 2t + 2t) + 2t - 2t + 2t2 + 19t*2 + 74t - 74t in the form at + ct2 + f and give a. 0 Express (-4a + 2a + 4a)(-5a + 5a + 2a) + a2 + 19 - 19 - a2 - 2a2 + 5a*2 in the form w + ia*2 + va and give i. 7 Express -c - 4 + 6 - 3c - 2c as zc + s and give s. 2 Express (2 + 2 - 3)(-k3 + k3 - 3k4) + 4k*4 + 0k*4 - 3k*4 as bk*2 + gk + a + ik3 + ck*4 and give g. 0 Rearrange -443 + 443 - 2v*2 to the form k + xv + cv2 and give c. -2 Rearrange (-1 - 1 + 4)((0 + 6 + 8)(-i + i + i) - 4 + 4 - 2i) to li + w and give l. 24 Express (-p - 4p - p)(2 + 27 - 1) as yp + s and give y. -168 Rearrange 0 - 4 - 5o2 + 3o*2 + 13o*2 to the form po*2 + ko + u and give u. -4 Rearrange -8s2 - 5s*2 - 333 + 330 to the form xs*2 + m + ps and give x. -13 Rearrange -2g + 2g*3 + 0g + 2g - 7g*2 to the form p + ig*3 + bg*2 + ng and give i. 2 Express (-2b - 1 + 3b*2 + 2b)(6 - 1 + 1) in the form t + fb + mb2 and give t. -6 Express 90p - 23 + 46 - 23 in the form hp + o and give h. 90 Rearrange 4x - 3x - 2x*2 + 10x*4 - 4x to the form vx + n + cx*3 + hx*2 + kx*4 and give k. 10 Rearrange 11 + 14p - 19 + 11 to sp + u and give u. 3 Express 5 - 5 - f + (2 - 3 + 2)(-1 + 1 - 2f) + 4f - f - f + (3f - f + 0f)(0 + 3 - 5) - 3 - f + 3 - f - 2f - f in the form h + of and give o. -10 Express (0 + 0 - 3 + (-2 - 2 + 6 + 0 - 5 + 3 + 0 + 2 - 3 + 3 - 1 - 1 + (-1 + 4 - 5)(0 - 2 + 1))(-29 - 25 + 57))(5w - w - 2w) as nw + u and give n. 6 Rearrange -3i*2 - 70 + 2i*3 - 2i*4 + 37 + 35 + 4i to ki2 + r + yi*3 + li*4 + di and give r. 2 Express 1 - 3l2 - 15l + 2 - l*4 + 17l in the form x + gl4 + wl + sl3 + ul*2 and give w. 2 Rearrange 2m + m*4 + 0m*3 - 6m*3 - 3m4 + m3 to the form c + wm + dm*3 + bm*2 + pm*4 and give w. 2 Rearrange 17l + 4l2 - 16l - 5l2 - 2l*3 + 2 - 2l*4 to the form hl*2 + yl*3 + i + ql + pl4 and give y. -2 Express -9h*3 - 3 - 11h + 7h + 8h*3 as k + qh*3 + vh*2 + wh and give k. -3 Express -6 + 2r + 0 + 0 + (4 - 2 - 4)(2r + 0r + 0r) as mr + f and give f. -6 Express (2 + 2 + 0)(-4f*4 + 13f*4 + 7f*4) as lf*2 + y + cf*4 + qf + hf3 and give c. 64 Rearrange (5 + 4 - 3 + 19)(3y + 7y - 2y) to the form i + gy and give g. 200 Rearrange (-4w2 + 3w*2 + 0w*2 + (-w - 2w + 8w)(-4w + 0w + 7w))(0 + 0 - w) to the form z + mw2 + sw + kw3 and give k. -14 Express (2c + c - 2c)((1 - 4 + 1)(0 + 3 - 1) - 2 - 1 + 0) as n + hc and give h. -7 Express (-2z + 4z + 0z)(-2z2 + 2z*2 + 2z2) + z3 - 3z3 + 0z*3 - 2z*3 + 2z + z3 + z2 - 2z2 as lz + kz3 + gz*2 + b and give k. 1 Rearrange ((-3 + 2 + 0)(-3j + 2j + 3j) - 2j - 2j + j - 3j + 3j - 2j - 2j + j - j + (2 - j - 2)(6 - 2 - 3))(-1 - 4 + 4) to h + ij and give i. 10 Rearrange 3s2 - 2s*2 - 2s*3 - 6 + 2s3 + s4 to gs + cs*4 + ls*3 + i + bs*2 and give b. 1 Express (1 + 0 + 0)(y2 + y2 - y*2) - 3y*2 + 4y2 + y2 + 3y2 - 6y2 + y2 - 13y + 13y + 10y2 in the form dy + ry2 + c and give r. 11 Express -29 + 29 + 27y as wy + z and give w. 27 Express (-s2 + 3s*2 - 4s*2)(-s*2 + 0 + 0) + (-2s + 0s + s)(0s3 + 0s*3 - 4s*3) as bs + hs3 + g + us*4 + ms*2 and give u. 6 Rearrange -2m - 67m3 - 24m*3 - 31m*3 to the form p + lm + wm2 + im*3 and give i. -122 Rearrange (5z + z - 5z)(0 + 3 - 5)(-15z - 10z - 6z + (-3z + 3z + 2z)(-2 + 3 - 3)) to bz2 + fz + a and give b. 70 Rearrange 0 - 227n2 + 0 + 171n*2 to on + tn2 + i and give t. -56 Rearrange 16l - 49l - 10l to the form wl + d and give w. -43 Express -56k - 20k2 + 56k in the form sk2 + a + tk and give s. -20 Express (0j3 + 3j3 + j3)(3 - 3 - 3 + (-1 + 3 - 1)(4 + 1 - 4) - 2 + 0 + 0) as qj2 + yj + p + vj3 and give v. -16 Rearrange 18j - 1 + j4 + j3 - 8j - 9j + (4j + 0j - 2j)(2j3 + 5j*3 - 5j*3) to the form cj + d + fj3 + qj*2 + bj*4 and give f. 1 Express -5b + 12b3 - b4 - 9b*3 - 1 + b - 2b*2 as wb*2 + a + mb + vb4 + pb3 and give w. -2 Express -1 + i4 + 1 + (-1 + 2 + 0)(25i*4 + 42i - 42i) in the form ri*3 + o + qi*2 + zi*4 + xi and give z. 26 Rearrange (-9l3 + 0l*3 + 4l*3)(5 - 2 - 2l - 2) to ul*2 + hl*3 + kl*4 + il + q and give k. 10 Rearrange -1 + 19x - 35x + 20x to the form l + nx and give l. -1 Express 0u2 - 7u*2 - 3u - 3u2 + 4u*2 as z + nu + du2 and give n. -3 Rearrange 7a - 5 + a + 5 + 3a2 to na*2 + la + g and give n. 3 Express (-5 + 5f2 + 5)(5f - 5f - 2f) as d + wf*3 + cf + xf2 and give w. -10 Express -j2 - 4j*2 - 12j*2 in the form n + pj*2 + tj and give t. 0 Rearrange -4r2 - 3r2 + r2 + 5r2 to the form o + lr*2 + hr and give l. -1 Express (4 + 2 + 10)(-x - 4x + 8x) in the form lx + t and give l. 48 Rearrange -12s - 2 - 13s + 2 to fs + l and give f. -25 Rearrange 2r - 2r + r3 + (-5r*2 + 21 - 21 + (-1 + 1 - 2r)(2r + 1 - 1))(3r - 2r + r) to jr + ar2 + z + fr*3 and give f. -17 Express (0r + r + 0r)(-2r - 2 + 2) - 3 - 75r*2 - r + 73r*2 - 2r as nr2 + w + tr and give w. -3 Rearrange 0d + 0d + d - 4d + d + 4d + (-2d + 0 + 0)(3 - 4 - 1) + d - d - d + 0d + 0d + 2d - 4 + 4 - d to ld + m and give m. 0 Express (-2c + 2c - 2c)(-4c + 9 + 7c - 5) in the form bc + r + yc*2 and give b. -8 Express -57r - 4r2 - 55r + 1 + 117r + 5r*2 as w + ir*2 + nr and give w. 1 Express m*4 - m + 3m*2 + 13m*3 + 0m*4 - 4m4 + m4 as lm + fm*2 + dm*3 + om*4 + k and give o. -2 Rearrange ((-3 - 1 + 5)(-1 + 1 + 3) + 2 - 4 + 3 + 1 - 4 + 1)(-35 + 35 + 3t) to h + dt and give d. 6 Rearrange -5n*3 + 2n*4 - 28n*2 + 0n*4 + 25n*2 to an*4 + ln*2 + dn + sn3 + g and give l. -3 Rearrange 26y - 26y + 2 - 2y*3 to xy + d + qy2 + ny*3 and give n. -2 Express 121p*4 - 1 + 115p*4 - 238p*4 - 16p*2 in the form d + mp*2 + wp + bp3 + ip*4 and give d. -1 Express 2b*2 + 3b*2 - 6b*2 + (1 + 3 - 1)(3b - 3b - 5b2) - 3b*2 + 4b - 4b in the form q + rb*2 + jb and give r. -19 Rearrange 2c3 + 2c*2 + 108c - 110c + 6c*2 to h + yc*2 + oc*3 + xc and give x. -2 Rearrange (-s + 0s - s)(s*2 - 13s*2 + 71s*2) to v + ms*3 + cs + hs2 and give m. -118 Express 3 - 3 + 3a*3 + 89a - 1 - a*2 + 3a*4 - 87a in the form f + pa2 + ua*3 + ta + wa4 and give w. 3 Rearrange 5a - 21a + 7a to pa + t and give p. -9 Express 2s + 3s2 - 2s + (-2s - s + 4s)(-4 + 4 - 4s) in the form m + ys + xs*2 and give x. -1 Express (x - 3x - 31x)(x + x - 3x) in the form ox*2 + q + tx and give o. 33 Rearrange (-3 + 2	{ "pile_set_name": "DM Mathematics" }
6/11, -4, -2? -0.4 What is the closest to -1 in 1, 2, 0.07897? 0.07897 Which is the closest to 0.4? (a) 2/51 (b) 0.4 (c) 87 b What is the nearest to 0 in 3/5, 326, 0.3, 5? 0.3 Which is the nearest to -2? (a) 1/5 (b) 91 (c) -1 (d) 5/4 (e) -6 c What is the nearest to 0.23 in 5, -1.79, 1, -5, -0.1? -0.1 What is the nearest to -21 in -0.19, 5, -1? -1 Which is the nearest to 0.3? (a) -0.5 (b) -3/5 (c) -835 (d) -2/11 d Which is the closest to 4? (a) 3 (b) 1/6 (c) -110 (d) 4 d Which is the nearest to -0.2? (a) 7 (b) 28.172 (c) 1 c Which is the closest to -2/15? (a) 0.5 (b) 1 (c) -178 a Which is the nearest to 1? (a) -0.39 (b) -0.64 (c) 2/7 (d) 0.01 (e) 2 c What is the nearest to -2.4 in 0.02, 4, -14, 0.7? 0.02 Which is the closest to 0.44? (a) 5 (b) -9 (c) 18 (d) -0.1 d Which is the closest to 914/7? (a) -2 (b) -3/2 (c) 3 (d) 0.2 c Which is the nearest to 17? (a) -60 (b) -2/9 (c) -3.6 (d) 5 d What is the closest to -398 in 43, -4, 2/3, 0.5? -4 What is the nearest to -1 in 1, -8.5, 3, 425? 1 What is the nearest to 0 in 0.07, 5, 0.0029? 0.0029 Which is the closest to 0? (a) 6 (b) -2 (c) -186 b What is the closest to 2 in -4/3, -105, 0? 0 What is the closest to -3 in -0.4, 0.1, -0.9, -8, 2.26? -0.9 What is the nearest to -0.2 in 126, -3/8, 3/37, -2/19? -2/19 Which is the nearest to -2? (a) 3514 (b) -2/5 (c) 5 (d) 1/2 b What is the nearest to 6/13 in 5, 0.4, 0, 2, 25? 0.4 What is the closest to 193 in 1/2, -1, -2, -18? 1/2 What is the nearest to -1 in 7/5, 35, 1/11, 1, -2/45? -2/45 Which is the closest to -0.02? (a) -1/1728 (b) -5 (c) 2/9 (d) 1 (e) -1 a Which is the closest to -1/2? (a) 0.4 (b) 3783 (c) -0.4 c Which is the closest to 1538? (a) -2 (b) 1 (c) -29 b What is the nearest to -168 in 1/10, -1, 5/2, 0? -1 What is the nearest to 0 in 82/55, -2/7, -1/4? -1/4 Which is the nearest to 14? (a) 5 (b) 3 (c) 5/8138 a What is the nearest to 2/3 in 1/6, 2, 4759, 4, -8? 1/6 Which is the nearest to -25? (a) 0.51 (b) 6 (c) -4 c Which is the nearest to 1/3? (a) -1/3 (b) 0.6 (c) -2/13085 b What is the nearest to -2/11 in -23548, -2.9, -1/4, 5? -1/4 Which is the nearest to 37? (a) -5 (b) -96 (c) 5 c Which is the closest to 44? (a) -2/7 (b) 1 (c) 0 (d) -0.5 b Which is the nearest to 0.3? (a) -46/7 (b) -1/5 (c) 2 b What is the closest to 2 in -1/4, 2/13, -10, -4/5? 2/13 What is the closest to 0.1 in 1/92, 6, 0.2, 1, -0.34? 1/92 What is the closest to 0.1 in -0.06, -0.3, -19/12, 0.4, 3? -0.06 What is the nearest to -3/4 in 1/106, 36, -1/3? -1/3 Which is the closest to 2/3? (a) -0.8 (b) -9 (c) -13.6 (d) 0.4 d Which is the closest to 2/3? (a) 2/9 (b) 159 (c) -147 a Which is the closest to -9/7? (a) 2 (b) 1/4 (c) 280 (d) -0.2 d What is the nearest to 0 in 771, -5, 2/3? 2/3 Which is the closest to 1? (a) 29 (b) -0.9 (c) -2/5 (d) 0.09 d Which is the closest to -37? (a) -2/11 (b) 286 (c) -2/17 a Which is the closest to -1? (a) 0.4 (b) -2/23 (c) 116 (d) 1115 (e) -2 b What is the closest to 1/3 in -1/9, 4.6, 0.3, 10? 0.3 Which is the nearest to -8? (a) 3 (b) 2/5 (c) -493 (d) -0.3 (e) -3 e Which is the closest to -2/37811? (a) 1/6 (b) -1 (c) 0.4 a Which is the nearest to 2788? (a) 3/2 (b) -10 (c) 2 (d) 3/10 (e) 4 e Which is the closest to -2/5? (a) -63 (b) 4 (c) 1 (d) 0 d What is the closest to 10 in -2/17, -4, -0.15, 0.5? 0.5 What is the closest to 0 in -3, 2/9, -4, -5, 3.6? 2/9 What is the nearest to -1/4 in 2/7, -3, 0.03, -5, 1? 0.03 Which is the closest to -2? (a) -4 (b) 3 (c) -8/3 (d) 125 c Which is the closest to 0.4? (a) 0 (b) 34 (c) -25 a Which is the closest to -1/3? (a) -0.4 (b) 0.7 (c) -92 (d) -8 a What is the nearest to 0 in -3.615, 3, -2/9, 0.5, -2? -2/9 Which is the closest to -1? (a) -1.1 (b) 2/2863 (c) 3 (d) 5 a What is the closest to -1 in 2/5, -2/11, -2, -283? -2/11 Which is the closest to 0.3? (a) -0.118 (b) -2/9 (c) -1 (d) 40 (e) 0.2 e Which is the closest to -12/41? (a) -0.196 (b) 0 (c) -5 a Which is the nearest to 0? (a) -5 (b) 7555 (c) 0 (d) -3/4 c What is the closest to 4/3 in 0.3, -2, 25? 0.3 Which is the closest to -85/3? (a) -4 (b) 0.4 (c) 19 a Which is the closest to 9/2? (a) -173 (b) -2/55 (c) 1/3 c What is the nearest to -6/11 in -0.2, 12, 2/9? -0.2 What is the closest to 0.1 in 5, 1, 1.234, 3? 1 Which is the closest to -2/11? (a) 4 (b) 2/5 (c) 0.26 (d) 5 (e) -2/9 e What is the closest to 4851 in 2/7, 26, -2, -0.3? 26 What is the closest to 0.2 in -5, -2, -0.9, -0.03, 5? -0.03 What is the nearest to -3 in -0.8, 5, -1/3, -1/15, 13/8? -0.8 What is the closest to 6 in -20, 0.353, 2, 4, 0? 4 Which is the nearest to -1? (a) -5/2 (b) 693 (c) 4 a What is the nearest to 2/5 in 189/38, -0.5, 5? -0.5 What is the closest to 0.1 in 2, 1, 4/5, -1, -13/9? 4/5 Which is the nearest to 0.05? (a) -0.1 (b) -1/848 (c) 1 (d) 5 b What is the nearest to 7 in -1/5, 2/135, -37? 2/135 Which is the closest to -0.3? (a) 0 (b) 38/3 (c) 2/21 (d) 3/5 a What is the closest to 1 in 3.4, -2/3, 13, 0? 0 What is the closest to -0.3 in -1, -119, 7? -1 Which is the closest to -2? (a) 1/2 (b) -1 (c) 0.03 (d) -649 (e) 0.1 b What is the nearest to 0.042 in -1/4, -15, -4? -1/4 What is the closest to 0.52 in 1/5, 6/11, -0.18, 1/7? 6/11 Which is the closest to 31? (a) 5 (b) 4.6 (c) -2/9 (d) 1/2 (e) -2 a What is the closest to -0.8 in -4, -391, 0.2, -5? 0.2 What is the closest to -1/141 in -7, 2/15, 0, 4, 1/4? 0 Which is the nearest to 1/4? (a) 24/71 (b) -5 (c) -0.071 (d) 3/5 a Which is the closest to -1/562? (a) -2 (b) -5 (c) -1/6 (d) -1 c Which is the nearest to 6? (a) 3 (b) 0.1 (c) -23/5 (d) 2/9 a Which is the nearest to 85? (a) 2 (b) -1438 (c) 5 c Which is the nearest to 1.5? (a) 2 (b) -4 (c) -74 a Which is the closest to 2? (a) -2/161 (b) 1 (c) -0.3 b What is the closest to -0.1 in 0, 0.04, 4, -10.444, -2? 0 Which is the nearest to 0? (a) 12 (b) 1.5 (c) -56 b Which is the closest to 0? (a) -4/39 (b) 3/5 (c) -1/8 (d) -2/7 (e) 5 a Which is the nearest to 0.01? (a) -0.1 (b) 3/275 (c) -1/4 b Which is the nearest to 5/2? (a) 2/3 (b) 3 (c) -48 (d) 0 b Which is the nearest to -1.2? (a) -2/11 (b) -2/49 (c) -16 (d) 7 a What is the closest to 104 in 2/19, 5, -5, 3, 1/8? 5 Which is the closest to -0.1? (a) -0.01 (b) -7 (c) 10 (d) 4/7 a Which is the nearest to 1/28? (a) 0.05 (b) 2 (c) -128 (d) 0.5 a Which is the closest to 1/4? (a) 2 (b) -8 (c) 7240 a Which is the closest to -2? (a) -30 (b) -1/20 (c) -5 (d) 1/2 b Which is the nearest to -8? (a) 47 (b) 18 (c) 0.2 c What is the closest to -1/3 in -19, -13, -0.1, 2/9? -0.1 Which is the closest to 1? (a) 2/5 (b) 5 (c) -538 (d) -0.3 (e) 3 a What is the nearest to -0.3 in 0.5, 0.4, -6, -8038? 0.4 What is the closest to 1 in 1.2, -26, 4? 1.2 What is the nearest to 0.04 in -0.1, -5, 14? -0.1 What is the nearest to -1/108 in -1/5, 3/5, -2/11? -2/11 Which is the closest to 77? (a) 5 (b) -10/29 (c) -1 (d) -2 a What is the closest to 4 in 0.4, -2, -9/2? 0.4 Which is the closest to -0.021? (a) 1/2 (b) -0.4 (c) -5 (d) -0.7 (e) 0.2 e Which is the closest to -1/4? (a) -0.169 (b) 1 (c) -5/3 a What is the closest to 0.0303 in -2, -0.4, -1/7, 3/2, 1/5? 1/5 Which is the closest to 23/9? (a) -2 (b) -0.5 (c) 32 b Which is the nearest to 9/4? (a) -1317/8 (b) 5 (c) 2/11 c Which is the closest to 0? (a) -87 (b) 0.03 (c) -2/5 b What is the closest to -0.634 in -3, -2/3, 0.5, 3? -2/3 Which is the nearest to 6? (a) -2/11 (b) 569 (c) -7 a Which is the nearest to 0.1? (a) -12 (b) -2/7 (c) 164 (d) -2 b What is the closest to -7/12 in -2, -87/4, -5? -2 Which is the nearest to -1/2? (a) -1005 (b) 0.1 (c) -3 b Which is the nearest to 1/3? (a) 0.81 (b) -9 (c) 17/4 a Which is the nearest to -0.1? (a) 2 (b) 0.3 (c) 48852 (d) 0 (e) -2/7 d Which is the closest to 3? (a) -1/17 (b) -51 (c) -2/3 a What is the nearest to -2/5 in -0.5, 0.4, -1591? -0.5 What is the nearest to 0.02 in -32, -0.13, -2? -0.13 What is the closest to -5 in 5/4, 1.9, 3, 0.4? 0.4 What is the nearest to -2/3 in -4, -7/2, -22/13, -12/13? -12/13 Which is the nearest to 2.135? (a) 0.03 (b) -1 (c) -2/85 a Which is the closest to 0? (a)	{ "pile_set_name": "DM Mathematics" }
e nearest to 0.000457? (a) -2 (b) -1/3 (c) -4 b Which is the closest to 1.9? (a) 67/2 (b) -2.8 (c) 16/3 (d) -2 c What is the closest to 4230 in 682, -1/2, 5? 682 What is the closest to -2/3 in 8, 67893/4, 0.4? 0.4 What is the closest to 0.1 in -38, -2, 46911/8, -3, 3? -2 Which is the closest to 18? (a) -13 (b) 3 (c) -240 (d) 0.4 b What is the closest to 0.077 in 0, 51, 7, -3, -2/3, -7? 0 What is the nearest to -6 in -2/15, 63, -0.4, -498.1? -0.4 What is the closest to -2/7 in -9, 0.107, 3/7, 4, 2? 0.107 Which is the nearest to 3/5? (a) 1017 (b) -19 (c) 2 (d) -9 (e) 0.5 e Which is the closest to -20? (a) -0.4 (b) -3 (c) -2.06 b Which is the closest to 1? (a) -75 (b) -161 (c) 20/57 (d) 0.2 (e) 0.1 c Which is the nearest to 2? (a) -0.3 (b) 5 (c) 0 (d) 0.3686371 d Which is the closest to -1? (a) -121 (b) -3/34 (c) 36.2 (d) 2 (e) 1 b Which is the closest to -0.06? (a) 5 (b) -4 (c) 0.92 (d) -0.07 (e) -2/79 d Which is the nearest to 1/4? (a) 223.6 (b) 361 (c) 64 (d) -2 d What is the closest to -8 in -5, 2, -4, 3/13, 4/337? -5 What is the closest to 1/2 in 44.8, 184, 53, 4? 4 Which is the nearest to 163? (a) 3 (b) -2 (c) 2 (d) -2/3 (e) 2/9 (f) -5 a Which is the closest to 7? (a) -8/47 (b) 2 (c) 733 (d) 0.3 b What is the nearest to -0.1896 in 1, -1, 2/19? 2/19 What is the closest to 11 in -13/4, 4, -0.11, -4/5, -0.2, 16? 16 What is the closest to -2 in 1/6, -1/3, 1612, 34, -6/7? -6/7 What is the closest to -3/2 in -262.8, 25752, 2? 2 Which is the closest to -388? (a) -0.4 (b) 0.5 (c) 1/315 (d) 0.9 a What is the nearest to -5/208 in -3, -1/4, 1286, -2/7? -1/4 Which is the closest to 3/5? (a) -3 (b) 21 (c) 51 (d) 0.1 (e) -4 d What is the closest to -7 in -1/2, -3, -1, 398, -0.09, 5? -3 Which is the closest to 2/11? (a) 219 (b) -13/5 (c) 1.64 c What is the nearest to 6/11 in 6, -1/6, -10, 1/3, -8? 1/3 What is the closest to 0.1 in 10/206307, -2, -10? 10/206307 Which is the closest to 0.087? (a) 605.6 (b) 4 (c) -4 (d) -1/6 d Which is the closest to -3? (a) -68 (b) 4 (c) -2.5 (d) -10.6 (e) -0.5 c What is the closest to -7 in 4, -2, -0.2, 3, 7/10, 1/5? -2 What is the nearest to 1/6 in -3/94, 3, 1/7, 0.5, -460? 1/7 What is the nearest to 0.1 in -945700, 4, -3? -3 What is the nearest to 0 in -10505, -1/9, -1, 70? -1/9 Which is the closest to -2/3? (a) -1/174 (b) 0.4 (c) 2 (d) -2084 (e) 1/21 a What is the nearest to -1/5 in 4, 11, 3, -1370, -231? 3 Which is the closest to -0.4? (a) 2/21 (b) 0.3 (c) 0.5 (d) -1/8 (e) -3 d What is the closest to -38 in -3, -7/449, -284? -3 Which is the nearest to 0.53? (a) -10 (b) 1.4 (c) -0.6 (d) -0.2 (e) -1 d What is the nearest to 35 in 1/5, -41, -32, -0.02? 1/5 Which is the closest to 2/195? (a) -16 (b) -39 (c) -4 (d) 1/2 d Which is the closest to -61? (a) -5 (b) 0.02 (c) 3 (d) 1.4 a What is the closest to -0.01 in -3.35, 1/3, -2, 2? 1/3 Which is the nearest to 1? (a) -3/48368 (b) 9.3 (c) -3 a What is the nearest to -2/7 in -20535, -4/3, 13/2, 3/11? 3/11 Which is the closest to 2/15? (a) 5 (b) -31 (c) -0.4 (d) -0.1 (e) -6/5 d Which is the nearest to -3/2? (a) -58 (b) 518 (c) 7 c Which is the closest to 3? (a) 0.4 (b) 7233 (c) 7 (d) -5 (e) -6 a Which is the closest to 0.09? (a) -4 (b) 18/1313 (c) 3 (d) 4/7 (e) -2/3 b What is the nearest to 0.1 in 49, -0.5, 5, -119? -0.5 Which is the closest to 2360? (a) -1 (b) -5 (c) 0 (d) -1/2 (e) -1338 (f) 2 f Which is the closest to 0.1? (a) -60/7 (b) -201 (c) -6.7 (d) 4 d What is the closest to -2 in 3, 6.847, 51? 3 Which is the nearest to 0.06? (a) 8.4 (b) -1.4 (c) 2 (d) -14 (e) -3 b Which is the nearest to 0.1? (a) 18 (b) 0.1 (c) 32/175 (d) -0.21 b Which is the closest to -2/5? (a) 952/5 (b) 1 (c) 5 (d) -11.7 (e) 0.4 e Which is the closest to -0.88? (a) 6 (b) -4 (c) -4/9 (d) 5 (e) 0.04 c Which is the closest to 2? (a) -0.22 (b) -2/3 (c) -1022 (d) -200 a What is the closest to -69.7 in 0.41, 3/2, 3, 70? 0.41 Which is the closest to -5? (a) 10088 (b) 24 (c) 0 c Which is the closest to -0.1? (a) 1/4 (b) 2 (c) -0.0132 (d) 5 (e) -0.59 (f) 0.53 c Which is the closest to -2/3? (a) -2/9 (b) -0.03 (c) 14 (d) 2439.1 a What is the nearest to 142580/7 in 1/7, 34, -0.4? 34 What is the nearest to 1/3 in -1/4, -0.5, 5/4, 3/1945? 3/1945 What is the nearest to -30 in 13, 280.3, 23, 0.2? 0.2 What is the nearest to 1 in 0.4, 0.1, 1064, -2, -2/17? 0.4 Which is the closest to 0? (a) 73440 (b) 5 (c) 7 (d) 0.5 d Which is the closest to -8? (a) 3 (b) -2/9 (c) 2/5 (d) 0.75 (e) -0.051 (f) 11/17 b What is the nearest to 1507/3 in -3, -0.4, -11? -0.4 What is the closest to -1 in -1/6, 0.1, -32, -2/3, 26/11? -2/3 What is the nearest to 2/9 in -3, -0.4, 459209? -0.4 What is the nearest to -1/3 in -2428, -2, 13, 0.2? 0.2 What is the closest to 1/398 in 2, -1, 9.93? -1 What is the closest to 3/7 in 1615, -10, 1/2, 1? 1/2 What is the closest to 64 in 1839.5, -3/7, 0.1? 0.1 What is the nearest to -2778 in 3/97, 2/7, 1? 3/97 What is the closest to -178 in -0.12, -68, -0.2? -68 Which is the nearest to 3? (a) 1/5 (b) -214/59 (c) -75 (d) -1/3 a What is the closest to 9943 in -4/7, 0.5, 4.3, -5? 4.3 What is the nearest to 1 in -6, -36, -2/7, 3, -5333? -2/7 What is the nearest to -63 in 4, 8, -0.4, 180, -1/14, 5? -0.4 What is the closest to 1/5 in 20, 5329, -4, -1/5, 4/9? 4/9 What is the nearest to -33 in 0, -2/7, -1, -0.24, 37992? -1 Which is the closest to -2.24? (a) -2 (b) 1 (c) -0.2 (d) 0.3 (e) 4 a Which is the closest to -0.6? (a) -2/31 (b) 0.3 (c) -2/271 (d) 0 (e) 4 a What is the closest to -0.5 in 2/9, 3.9, 5, 8875, -0.3? -0.3 What is the nearest to -24/5 in 79, -23, -1? -1 What is the closest to -0.1 in -694/43, 0.7, -5? 0.7 What is the closest to -1904 in -1, 1/2, 5, 3/28? -1 Which is the nearest to 1? (a) 1 (b) -1/24 (c) 7 (d) -402 a What is the nearest to 3 in 0.6578, 4, 2/13, -1, 0.014? 4 Which is the closest to -2/1471? (a) 2/15 (b) 0 (c) 1/2 (d) -3 (e) -1.38 b What is the closest to 5/7 in 0.153, -152, -3, 1, 0? 1 What is the closest to -1 in -124, -0.5, 27, -13, 0.4? -0.5 What is the closest to 0 in 2/3, 3/4, -2/15, 88, 25, 0.88? -2/15 Which is the nearest to 4? (a) -0.059 (b) 5 (c) -232/9 (d) 1/3 b What is the closest to 59/2 in 26, -3/8, 5, 0? 26 What is the closest to 0.2 in 3/4, -1, -0.61, 264, 1? 3/4 What is the closest to -323 in -10/21, 5, 7, 6? -10/21 Which is the closest to 1074? (a) 2/3 (b) -2 (c) 1 (d) -22/5 (e) 0 c What is the closest to 1/3 in -0.12, -0.3, -1, 161/6, -0.05? -0.05 Which is the nearest to 0? (a) -3 (b) -3023 (c) 2/5 (d) 7.8 c What is the nearest to 1 in -686, -842, 14, -4? -4 What is the closest to -0.56 in -5, 29, 0, -4? 0 What is the closest to -10 in 2, 5, -2/9, 0, -27? -2/9 Which is the nearest to 0.7578? (a) 2 (b) 2/7 (c) -2 (d) 0 (e) -0.7 b What is the nearest to 2 in 0.2, 3, 3.6, 18, 20? 3 What is the closest to -17.58 in -0.5, 0.5, 1, -46.9, -7? -7 Which is the closest to -2/3? (a) 0.2 (b) -0.32 (c) -0.1 (d) -2087/18 (e) 0.5 b Which is the closest to -2.5? (a) 1.8 (b) -218 (c) 3/7 (d) 1/11 (e) -2/5 e What is the closest to 18 in -1, 1/7, -1/88, 451? 1/7 Which is the closest to -98.1? (a) -2 (b) -5.911 (c) -0.2 b What is the closest to -2/9 in 2/7, 5/87, 2, 0.4, 7.1, -4? 5/87 What is the closest to -13719 in 0, -3, -2/33? -3 What is the closest to -0.2 in -383, 2, 67/4, 2/11, -1/4? -1/4 What is the closest to -9.62 in -1, -5, -6/5, 17? -5 Which is the nearest to 1? (a) 13.5 (b) 3.2 (c) 0.04 (d) -3 c Which is the nearest to -14? (a) -1/2 (b) -0.3 (c) 5 (d) 4 (e) -3.238 e Which is the nearest to -2/57? (a) -27.07 (b) 0.2 (c) -2 (d) -3/4 (e) -1 b Which is the closest to -2026? (a) -2/5 (b) -631/5 (c) -0.3 (d) 2/5 b Which is the nearest to -21639? (a) 1 (b) -3/2 (c) 5 b What is the closest to -3/2 in 2/9, 2/5, -5.945? 2/9 Which is the closest to 2? (a) 0.3 (b) -95.1 (c) -2/25 (d) -1/288 (e) -4/5 a What is the closest to 2 in -1, -74, 0.1, 12362? 0.1 Which is the nearest to 0? (a) 3 (b) 0.4 (c) -586/95 (d) -0.47 b What is the nearest to -48.6 in -5, 20/267, 2/23, 4, -2? -5 Which is the closest to -15? (a) 74 (b) 2.3 (c) 0.1	{ "pile_set_name": "DM Mathematics" }
((-72)/147) + 50/75. 17 What is (((-63)/70)/9)/((-92)/(-805))? -7/8 Calculate ((-2)/(-8))/(648/288). 1/9 What is the value of (-1800)/(-140) + 4 + -17? -1/7 (7/(-2) - 2310/(-440)) + -1 3/4 Calculate (18/37821)/(-1). -1 What is the value of -3 - ((-44)/(-28) - 4)? -4/7 What is ((-24)/30)/((3/2)/((-45)/12))? 2 -4 + 18 + 32 + -61 -15 Calculate ((-5)/15)/((-8)/(-36)-3)-14. -7 (-19)/((-95)/110) - (-36)/(-18) 20 What is the value of (-210)/(-28) + (-42)/88/(-28)? 9 (-168)/39 - 8/39/(-6) -4/13 What is the value of -22110/30? -14 What is the value of 2 - -131/6(-7 + 5)? -7/3 Calculate (24/(-98))/((-38)/(-133)). -6/7 What is (-1)/(13/1 + -3)? -1/10 Evaluate (31/(-930) - (-16)/(-20))/(-30). 1/36 Evaluate (1 + 51/(-45))/(-1810/(-300)). -2/9 What is (-108)/(-390) - 142/1846? 1/5 Evaluate 295/23 + (-7)/((-133)/(-247)). -4/23 What is (-42)/(-45)33/539? 2/35 What is ((-20)/(-50))/((-9)/(-24)(-12)/15)? -4/3 What is the value of (-6)/(-4) - (-3920)/(-2016)? -4/9 What is the value of ((-12)/(-70))/(11/((-539)/(-21)))? 2/5 Evaluate (32/(-5))/(699/582510/3). -16 Evaluate (-28)/63 - (-5 - 663/(-27)). -20 What is 12 - ((-96577)/(-8165) - (-1)/5)? -2/71 What is the value of (-294)/(-252)8/14? 2/3 (1170/975)/(2/(-5)) -3 What is the value of (-36)/(-48) + 4 + 78/(-24)? 3/2 What is -4 + (-78)/(-21) + (-176)/560? -3/5 What is the value of 30810/2844(-9)/30? -13/4 ((6 + 540/(-96))-1)/(2/8) -3/2 2((-7)/(-2) - 6) -5 What is the value of 29/58(6 - 1)(-26)/(-5)? 13 Calculate -1 + -4(-4 + -3 + 9) + 5. -4 What is ((-2)/2)/((-588)/54 + (-44)/(-4))? -9 Evaluate 20/14(34 + (-17332)/504). -5/9 What is ((-6)/4)/((-20)/(-160)) + 8/1? -4 What is the value of (36/144)/(3 - (-1674)/(-552))? -23/3 What is -1 + -11 - (29 - (-375)/(-9))? 2/3 What is the value of (21/(21/(-2)))/(((-77)/(-70))/11)? -20 What is (3160/(-3792))/((-2)/(-36))? -15 Evaluate ((-2)/4)/((-48)/672). 7 What is ((-49)/(-7) + 1)/(-9)(-2)/4? 4/9 What is 31/(-31) + (-105)/(-195) + 71/182? -1/14 Evaluate (-26)/7 - (-28)/7. 2/7 (-6 - -2)1 + (8 + -176)/(-8) 17 Evaluate ((-168)/(-42) + (-12)/3)/(-2). 0 What is the value of 34/4 + (296/259)/(1/(-7))? 1/2 Calculate 1/(-2)(32120/374 + -86). 1/17 Evaluate 14/(-2) + 623/89. 0 What is 24/10 + (-23)/(230/20)? 2/5 Evaluate (-8968)/(-3068) + (3 - (5 - -1)). -1/13 ((-567)/28)/(-27)8 6 -1(6 + 348/(-60))1-155 31 Evaluate (-6)/10 - (24 - (-63899)/(-2590)). 1/14 (-3614)/364 - 104/70 -21/2 What is the value of (55/40)/(-11) + -1 + 3/8? -3/4 ((1 - 0) + (-18)/36)120/(-330) -2/11 What is the value of (6/20)/((-13)/(624/9))? -8/5 Calculate ((-128)/(-272))/((-18)/(-153)). 4 What is (2 + (-1)/5)/((-91)/455)? -9 -69 - -26 - -27 - -29 13 Calculate ((-9)/(-10) - 3) + (-1)/(-45)27. -3/2 Calculate (-126)/(-85) - 214/(-1819). 8/5 What is (240/3920)/((-6)/(-7))? 1/14 What is the value of ((-5)/3)/(320/(-384))? 2 Evaluate (-1 + 2/4)0 - (-208)/(-416). -1/2 Calculate 7 + (315/(-165) - 5/55). 5 What is 18/(-30)(-28)/(-84) - (-37)/10? 7/2 What is (1100 + -1103)/(0 + 0 + (-6)/(-14))? -7 What is (-6)/2 + (-2889)/321? -12 Calculate (-280)/1260(-162)/(-4). -9 6/44 - 53001/(-7722) 7 What is -29(42/(-4) + 3)? -29 What is (-7080)/14750(-5)/(-4)? -3/5 1/(-4)(-1)/2(-214 + 234) 5/2 (-7)/(-1) - (6000/(-376) + 23) -2/47 What is (19/152 - (-9)/120)/(32/96)? 3/5 What is the value of 5 + (-339)/78 + 38/(-76)? 2/13 77/70 - 12/24 3/5 Evaluate (-1 - (-21)/9)(-1554)/1332. -14/9 Evaluate 11(-19)/95 + 4/(-5)-1. -7/5 What is 2091/510 + (-28)/8? 3/5 Calculate (-270)/(-58968)-21(6/(-5))/3. 1/26 What is the value of 7650/(-250) + 52/(-130)? -31 Calculate (3627/(-124) - -29)76. -19 Calculate (-48)/160(-4 + (-1120)/(-270)). -2/45 Calculate (77 + -70)/(4/(4 + 0)1). 7 What is ((-1)/((-26)/(-6) - 2))/((-39)/52)? 4/7 Calculate (30 - 22 - 34/4)/(4/28). -7/2 What is the value of (-7644)/(-686) + (-96)/(3 - -5)? -6/7 Calculate (2/(-32))/(317/99538) + 17. -21/8 Evaluate (-7)/126-18 - ((-30)/(-2) - -1). -15 What is the value of 342/304((-1170)/(-189) - 6)? 3/14 Calculate (-455)/(-858) - (-41)/(-246). 4/11 Calculate (-150)/6024/20. -3 What is (-3 - 1)(-93)/(-186)? -2 What is (1 - 588/30) + 4/(-10)? -19 What is (66/396)/((-2)/(-18))? 3/2 -8 - (-2)/3(-186)/(-496)-32 -16 What is (-43 - (-84 + 43)) + -3(-2 + 0)? 4 Evaluate (2/(-221))/((-116)/986). 1/13 Calculate (3/99)/((-269)/(-2421)). 3/11 What is the value of 33/((-15840)/(-2360)) + (-7)/6? 15/4 24/(-14)(390 - 397) 12 What is (-81)/12(-488)/(-183)? -18 Calculate (-405)/81 + (-136)/17. -13 What is the value of 1/4(-32)/((-1248)/117)? 3/4 What is (2 - 85/68) + 29/(-28)? -2/7 What is the value of (6/12)/(15/(-20))12? -8 What is (1242/(-1380))/(2/(140/(-3)))? 21 Calculate 130/325 - (0 - 174/15). 12 What is the value of 1/(-4((-4)/80)/1)? 5 Evaluate 18/117 + ((-2526)/702 - -3). -4/9 (-14)/((-70)/45) - (4 - 1) 6 What is (-7 + 2)(-5 + (-1431)/(-285))? -2/19 What is 21/(-54)3-5(-4)/105? -2/9 Calculate 1208/(-1057) + (-1 - 45/(-21)). 0 (56/(-16) + 5)/(1/((-12)/20)) -9/10 What is the value of (-255)/68 - 10/8 - -5? 0 Calculate 17/60 - (-94)/(-1128). 1/5 Evaluate 10/55(-836)/(-133). 8/7 What is the value of (5/20 - (-414)/(-56)) + (142 - 135)? -1/7 Evaluate 5/(6 + 56/(-12))(-20)/15. -5 Calculate 5/(-25) + ((-26)/312 - (-1634)/4920). 2/41 What is -22/24 - 6168/(-16191)? 3/14 Evaluate -18 - 2775/(-74) - (-1)/(-2). 19 (-1 + -4)((2695/(-25))/11 + 10) -1 Calculate (-195)/90 + 45/10. -1/6 Evaluate (2/(-7))/((-894)/4172) - 1/12. 5/4 Evaluate (-3 + (-29)/(-10))/(219/(-24) - -9). 4/5 Calculate ((-1)/10)/(18/(-45))23. 3/2 Evaluate -110(-67 - -66). 10 ((3/(-2))/1)/(2/4) -3 Evaluate 8/(-20)(325/205)/13. -2/41 What is (24/10)/4(6200/225 + -28)? -4/15 What is the value of 4/(-42) + (-11968)/(-5712)? 2 Evaluate (82 + 9)/(-13) - (-13 - -2). 4 Calculate ((760/(-57))/10)/((-44)/(-18)). -6/11 Evaluate (-15)/(162/48 - 6/16). -5 What is the value of (-110)/20 + (-1130)/(-220)? -4/11 ((-14)/(-7) - 4)(-13)/123 2/41 What is the value of (-29)/195 - (55/25)/(-11)? 2/39 Calculate 16/(-3) - ((-1512)/117)/6. 2/13 Evaluate (40/20 - (-1 + 2 + 3)) + -11. -13 What is the value of 46/(-897) + 1244/(-78)? -16 Calculate (34/204)/(2/8). 2/3 What is the value of 12/(-40)644/483? -2/5 Calculate 56/60 - (-380)/(-285). -2/5 What is -5 + 14/3((-420)/(-49) - 6)? 7 What is ((30/(-14))/(243/(-378)))/8? 5/12 What is the value of ((-4)/3)/((-90)/(-27))? -2/5 Evaluate (3/(-105))/(240/4800). -4/7 What is 4/15(-95)/342? -2/27 What is the value of (-38/240)/(35/(-20))? 2/35 (-6)/(-9)12/(-20)(-25)/(-70) -1/7 15/((-540)/(-6))9/8 3/16 Evaluate 113/(-550) + 959/21098. -4/25 Calculate 88/(-8) - 1 - (-13 - (-256)/(-16)). 17 Calculate 558/(-525) + 208/182. 2/25 What is the value of 0/((-37)/(333/(-54))) + (-33)/1? -33 What is the value of (-2)/11 - 89735/(-37675)? 11/5 Calculate ((-44144)/11160)/(21) + 2. 1/45 Calculate ((-544)/(-5304))/(54/39). 2/27 (151)/(3740/136 + -29) -10 ((-5)/(-50))/(-5 - (1 + (-31)/5)) 1/2 What is 21762/(-806) - (-82)/4? -13/2 What is the value of (-61 + (74 - 13))/(-12)? 0 (9 - (19 - 15))24/(-20) -6 What is 56/22(-21 + 17) - (-4)/22? -10 What is ((-2)/61)/((-22)/(-297)9)? -1/2 What is the value of 44/(-506) + 928/2208? 1/3 What is (-6)/(-58)(680/51 - 14)? -2/29 What is ((-168)/(-18)1/(-2))/((-11)/33)? 14 What is 45/24/(-10)(-305)/(-183)? -15 ((-216)/96(-16)/(-6))/((-4)/14) 21 What is 8(19 - (-6 + 23))? 16 Evaluate 4/(-62) + (-464422)/(-41974). 11 2979/(-135) + 13 + 9 -1/15 Evaluate (-3)/2((-4720)/(-264) - 18). 2/11 910/45 - ((-106)/9 + (-1776)/(-148)) 20 What is (5 + -3)((-395)/553 + 18/(-14))? -4 Evaluate (47/5 - -3) + 96/(-12). 22/5 Calculate ((-838)/84 - -10)/((-75)/(-20) - 4). -2/21 What is the value of (6 - (-19 + 5))/1? 20 8 - (-490)/42 - (-20)/(-12) 18 What is ((-3)/(30/(-40)))/(-110)? -2/55 Evaluate -1177/105 - (-20)/5. -19/5 -12(-22)/(-264)-41/(-1) -4 Calculate (40/4509)/((-142)/(-5)). 2/71 (-35)/4 - 10491/3228 -12 (-231)/(-99)(2 + -5) -7 Evaluate (-6)/(-15) - 354/(-15) - 8. 16 170/18 - 3 - (1 + (-20)/(-4)) 4/9 What is the value of (-4 + 2 + 18/14)2? -10/7 What is -6(-21)/(-14) - -11 - 10? -8 ((-400)/300)/(26/(-3)) 2/13 Calculate 8/(-144) - 21/108. -1/4 Evaluate (-168)/((-13 - 25/(-5))/2). 17 What is ((-8)/(-10))/((-	{ "pile_set_name": "DM Mathematics" }
-101, -186, -309, -476, -693, -966? -j*3 - 7j*2 + j - 14 What is the r'th term of -9, -24, -49, -84, -129? -5r*2 - 4 What is the d'th term of -4596, -9192, -13788, -18384, -22980, -27576? -4596d What is the z'th term of 1334, 2652, 3970, 5288, 6606? 1318z + 16 What is the v'th term of 55, 132, 231, 364, 543? 2v3 - v2 + 66v - 12 What is the g'th term of 2507, 5021, 7537, 10055, 12575, 15097? g2 + 2511g - 5 What is the s'th term of -58, -56, -56, -58? -s*2 + 5s - 62 What is the d'th term of 142, 154, 190, 262, 382, 562? 2d3 - 2d + 142 What is the g'th term of -35, -31, -27, -23, -19, -15? 4g - 39 What is the f'th term of 953, 941, 915, 869, 797, 693, 551? -f3 - f2 - 2f + 957 What is the q'th term of 21, 2, -31, -78? -7q2 + 2q + 26 What is the b'th term of -3267, -6543, -9817, -13089, -16359, -19627, -22893? b*2 - 3279b + 11 What is the w'th term of 3, 3, -11, -45, -105, -197? -w3 - w2 + 10w - 5 What is the h'th term of -164, -133, -96, -53? 3h*2 + 22h - 189 What is the k'th term of 154, 310, 466, 622, 778? 156k - 2 What is the i'th term of -5831, -5827, -5821, -5813, -5803? i2 + i - 5833 What is the n'th term of -133, -127, -119, -109, -97, -83, -67? n2 + 3n - 137 What is the b'th term of -1287, -1269, -1225, -1143, -1011, -817? 2b3 + b2 + b - 1291 What is the j'th term of 11, 40, 101, 206, 367, 596? 2j*3 + 4j*2 + 3j + 2 What is the h'th term of -64, -100, -124, -130, -112? h*3 - 43h - 22 What is the r'th term of -71, -285, -639, -1133, -1767, -2541? -70r2 - 4r + 3 What is the u'th term of 38, 49, 60? 11u + 27 What is the u'th term of -325, -658, -997, -1342? -3u*2 - 324u + 2 What is the h'th term of 11784, 11788, 11794, 11802, 11812, 11824, 11838? h2 + h + 11782 What is the f'th term of 183, 189, 205, 237, 291, 373, 489, 645? f3 - f*2 + 2f + 181 What is the c'th term of 579, 1163, 1747, 2331? 584c - 5 What is the r'th term of 34, 23, -10, -77, -190, -361, -602? -2r3 + r2 + 35 What is the t'th term of -13483, -13484, -13485, -13486? -t - 13482 What is the y'th term of 73, 297, 669, 1189, 1857, 2673, 3637? 74y2 + 2y - 3 What is the s'th term of -29, -40, -51? -11s - 18 What is the b'th term of 257, 490, 723, 956, 1189? 233b + 24 What is the r'th term of -752, -1507, -2262, -3017, -3772? -755r + 3 What is the x'th term of 160, 329, 498, 667? 169x - 9 What is the d'th term of 146, 155, 176, 215, 278, 371, 500? d*3 + 2d + 143 What is the g'th term of 353, 349, 345, 341, 337? -4g + 357 What is the m'th term of 10, 26, 56, 100, 158? 7m*2 - 5m + 8 What is the t'th term of 850, 843, 832, 817, 798, 775, 748? -2t2 - t + 853 What is the w'th term of -26520, -53041, -79562, -106083, -132604, -159125? -26521w + 1 What is the o'th term of -353, -699, -1045, -1391, -1737? -346o - 7 What is the z'th term of -4668, -9335, -14002, -18669, -23336? -4667z - 1 What is the v'th term of -61, -127, -193? -66v + 5 What is the l'th term of 50, 75, 100, 125, 150, 175? 25l + 25 What is the m'th term of 580, 579, 578, 577? -m + 581 What is the c'th term of 36, 30, 24? -6c + 42 What is the u'th term of -15, -19, -21, -21? u2 - 7u - 9 What is the l'th term of -749, -751, -753, -755, -757, -759? -2l - 747 What is the t'th term of -232, -254, -286, -322, -356? t3 - 11t*2 + 4t - 226 What is the u'th term of -27, -195, -649, -1533, -2991, -5167, -8205, -12249? -24u3 + u2 - 3u - 1 What is the x'th term of 227, 231, 237, 245, 255? x*2 + x + 225 What is the q'th term of -3274, -6546, -9818? -3272q - 2 What is the j'th term of 3, -13, -41, -81, -133, -197? -6j2 + 2j + 7 What is the t'th term of 125, 145, 187, 257, 361, 505, 695, 937? t*3 + 5t*2 - 2t + 121 What is the w'th term of -245, -497, -751, -1007? -w*2 - 249w + 5 What is the g'th term of 17, 18, 23, 32, 45? 2g2 - 5g + 20 What is the o'th term of -1960, -3914, -5868, -7822? -1954o - 6 What is the d'th term of -162, -317, -472, -627, -782? -155d - 7 What is the u'th term of -509, -489, -447, -371, -249? 2u3 - u2 + 9u - 519 What is the w'th term of 44, 16, -2, -4, 16, 64? w3 - w2 - 32w + 76 What is the a'th term of -9, 11, 79, 219, 455? 4a*3 - 8a - 5 What is the f'th term of 195, 791, 1781, 3165? 197f2 + 5f - 7 What is the x'th term of -3147, -3145, -3143, -3141, -3139? 2x - 3149 What is the n'th term of 9, -51, -165, -339, -579, -891? -n3 - 21n*2 + 10n + 21 What is the q'th term of 35, 241, 797, 1877, 3655? 29q3 + q2 + 5 What is the m'th term of 266, 532, 798, 1064? 266m What is the l'th term of 3, 1, -27, -93, -209? -2l3 - l2 + 15l - 9 What is the l'th term of -1545, -1547, -1549, -1551, -1553? -2l - 1543 What is the r'th term of 1699, 1691, 1679, 1663? -2r*2 - 2r + 1703 What is the t'th term of -865, -3503, -7895, -14035, -21917, -31535, -42883? t*3 - 883t*2 + 4t + 13 What is the z'th term of -2, 25, 86, 187, 334, 533, 790? z*3 + 11z*2 - 13z - 1 What is the n'th term of -30, -48, -56, -48, -18, 40? n3 - n2 - 22n - 8 What is the b'th term of 52, 63, 76, 91, 108, 127? b2 + 8b + 43 What is the q'th term of -34, -67, -116, -175, -238, -299, -352, -391? q*3 - 14q*2 + 2q - 23 What is the w'th term of -32, -29, -16, 13, 64, 143? w3 - w2 - w - 31 What is the f'th term of -228, -462, -704, -954, -1212, -1478, -1752? -4f2 - 222f - 2 What is the d'th term of -5, -25, -47, -65, -73, -65, -35, 23? d*3 - 7d*2 - 6d + 7 What is the d'th term of 20, 132, 436, 1028, 2004? 16d3 + 4 What is the p'th term of -1, 80, 295, 710, 1391, 2404, 3815? 11p3 + p2 + p - 14 What is the z'th term of -1459, -2918, -4377? -1459z What is the q'th term of 43, 26, -3, -44? -6q2 + q + 48 What is the r'th term of -235, -226, -221, -226, -247? -r3 + 4r2 + 4r - 242 What is the z'th term of 24, 75, 158, 273? 16z2 + 3z + 5 What is the c'th term of 453, 1783, 4007, 7131, 11161? c*3 + 441c*2 + 11 What is the j'th term of -5071, -5072, -5073, -5074, -5075, -5076? -j - 5070 What is the t'th term of -75, -152, -229, -306? -77t + 2 What is the o'th term of -16, -55, -128, -241, -400? -o*3 - 11o*2 + o - 5 What is the c'th term of 572, 565, 558? -7c + 579 What is the y'th term of -186, -183, -180, -177? 3y - 189 What is the j'th term of -34, -34, -36, -40, -46, -54? -j2 + 3j - 36 What is the k'th term of 922, 911, 886, 841, 770? -k3 - k2 - k + 925 What is the f'th term of -123, -128, -135, -144, -155, -168? -f*2 - 2f - 120 What is the f'th term of -266, -538, -824, -1130, -1462, -1826, -2228, -2674? -f3 - f2 - 262f - 2 What is the u'th term of -31, -243, -815, -1927, -3759, -6491, -10303, -15375? -30u*3 - 2u + 1 What is the p'th term of 16040, 16037, 16034? -3p + 16043 What is the x'th term of -100, -209, -324, -445, -572, -705? -3x*2 - 100x + 3 What is the l'th term of 320, 646, 974, 1304, 1636, 1970? l*2 + 323l - 4 What is the v'th term of -6, 12, 52, 126, 246, 424, 672? 2v3 - v2 + 7v - 14 What is the x'th term of 11, 17, 23, 29? 6x + 5 What is the p'th term of 56, 32, 2, -28, -52, -64, -58? p3 - 9p*2 - 4p + 68 What is the z'th term of 261, 1048, 2365, 4218, 6613, 9556, 13053, 17110? z*3 + 259z*2 + 3z - 2 What is the v'th term of 8866, 8860, 8852, 8842, 8830? -v*2 - 3v + 8870 What is the f'th term of 482, 475, 468, 461, 454? -7f + 489 What is the h'th term of -135, -249, -365, -483, -603? -h2 - 111h - 23 What is the j'th term of -62, -106, -176, -284, -442, -662? -2j3 - j2 - 27j - 32 What is the g'th term of 141, 165, 213, 291, 405? g*3 + 6g2 - g + 135 What is the h'th term of 177, 764, 1751, 3144, 4949, 7172? h3 + 194h2 - 2h - 16 What is the h'th term of -735, -1462, -2189, -2916, -3643? -727h - 8 What is the i'th term of -123, -205, -347, -555, -835, -1193, -1635, -2167? -i3 - 24i*2 - 3i - 95 What is the r'th term of 36, 68, 108, 150, 188, 216? -r*3 + 10r*2 + 9r + 18 What is the i'th term of 807, 1619, 2429, 3237, 4043, 4847? -i*2 + 815i - 7 What is the f'th term of 14, -4, -48, -124, -238, -396, -604? -f*3 - 7f*2 + 10f + 12 What is the f'th term of -10, 56, 122, 188, 254, 320? 66f - 76 What is the t'th term of -11, 1, 21, 49, 85, 129, 181? 4t**2 - 15 What	{ "pile_set_name": "DM Mathematics" }
65494x2/7 + 16386x/7 - 98244/7 = 0. What is x? -3, -2, 1, 8187 Solve c*3/2 - 10349c*2/2 - 20701c/2 - 10351/2 = 0 for c. -1, 10351 Factor 2g2 - 24892g + 49776. 2(g - 12444)(g - 2) Suppose -3w5/4 - 133w*4/4 - 1425w*3/4 - 2635w*2/4 + 42w + 377 = 0. What is w? -29, -13, -2, -1, 2/3 Factor 3l3/8 - 9891l*2/8 + 14823l/4. 3l(l - 3294)(l - 3)/8 Factor 4m*2 + 126824m. 4m(m + 31706) Suppose -y*4/3 - 44y*3/3 + 7642y*2 + 1752236y/3 + 1729267/3 = 0. What is y? -103, -1, 163 Let 4p3 + 350p*2 + 854p + 340 = 0. Calculate p. -85, -2, -1/2 Factor 2p2 + 5176p - 25930. 2(p - 5)(p + 2593) Factor 2c2 + 19770c - 19772. 2(c - 1)(c + 9886) Let 3x2/7 - 89994x/7 + 179976/7 = 0. What is x? 2, 29996 Suppose 2f4 + 5846f*3 - 5868f*2 - 58496f - 46784 = 0. Calculate f. -2924, -2, -1, 4 Find i such that 3i3 - 1458i*2 + 33696i + 40300416 = 0. -138, 312 Determine k, given that -k*3/2 - 3337k*2 - 5584432k - 55511120 = 0. -3332, -10 Find m, given that m*4/10 - 3m*3/2 - 437m*2/10 + 183m/2 - 232/5 = 0. -16, 1, 29 Factor -2d2/15 + 34d/15 + 76/15. -2(d - 19)(d + 2)/15 Factor -15272464o3 - 91681680o*2 - 281412o - 216. -4(o + 6)(1954o + 3)2 What is y in -12y*4 + 15489y*3 + 66006y*2 + 50505y = 0? -13/4, -1, 0, 1295 Determine x, given that 3x2 - 1581x - 16110 = 0. -10, 537 Factor -5j2 - 147685j + 147690. -5(j - 1)(j + 29538) Solve -2z2/9 - 123196z/9 + 41066/3 = 0 for z. -61599, 1 Solve -x*4/5 - 859x*3/5 - 5959x*2/5 + 867x + 12780 = 0 for x. -852, -5, 3 Factor -b*2/3 + 51908b/3 - 673610116/3. -(b - 25954)*2/3 Let -2g*3 + 3918g*2 - 1920798g + 1916882 = 0. What is g? 1, 979 Suppose -5i2/2 - 10605310i - 11247260019610 = 0. Calculate i. -2121062 Factor -4q4 + 70496q*3 - 310534872q*2 - 621281248q - 310675876. -4(q - 8813)2(q + 1)*2 Solve 4z*5 - 928z*4 - 25608z*3 - 23744z*2 + 25604z + 24672 = 0 for z. -24, -1, 1, 257 Factor d*4 + 3042d*3 - 203676d*2 + 4502168d - 33093984. (d - 22)*3(d + 3108) Factor -3c3/7 + 33c*2/7 + 373200c/7 + 49320000/7. -3(c - 411)(c + 200)*2/7 Solve -2w*4/9 - 8w*3/9 + 1180w*2/9 - 376w - 5130 = 0. -27, -5, 9, 19 Determine s, given that 5s2 - 76865s = 0. 0, 15373 Factor -5f2/4 - 1825f/4 - 1805. -5(f + 4)(f + 361)/4 Let 3c5/5 - 87c*4/5 + 192c*3/5 + 1128c*2/5 - 816c/5 - 624 = 0. Calculate c. -2, 2, 5, 26 Factor -u*4/4 - 4u*3 - 15u2. -u2(u + 6)(u + 10)/4 Factor r*4/3 - 70r*3/3 + 1621r*2/3 - 4392r + 6804. (r - 27)*2(r - 14)(r - 2)/3 Find c such that -5c*2/4 + 19473c/2 - 7789/4 = 0. 1/5, 7789 Suppose -c*2/7 + 46938c/7 - 550793961/7 = 0. What is c? 23469 Let -t*3/2 + 551t*2/2 = 0. What is t? 0, 551 Suppose 31u*4/5 - 10916u*3/5 + 993563u*2/5 - 5694814u/5 + 718296/5 = 0. Calculate u. 4/31, 6, 173 Factor 4l2 + 2346l - 11830. 2(l - 5)(2l + 1183) Factor 2k*2/9 - 7934k/3 - 23804/9. 2(k - 11902)(k + 1)/9 Factor 3o3/7 + 600o*2/7 + 14079o/7 + 88218/7. 3(o + 13)2(o + 174)/7 Factor 17d3/4 - 509d*2/2 - 3333d/4 - 189/2. (d - 63)(d + 3)(17d + 2)/4 Factor -w2/5 - 3354w/5 - 89829/5. -(w + 27)(w + 3327)/5 Solve 2p*2/7 - 132p/7 - 4784/7 = 0 for p. -26, 92 Find c, given that 5c2 + 5805c + 437400 = 0. -1080, -81 Factor -3t2 + 14508t - 29004. -3(t - 4834)(t - 2) Factor -2w3/9 + 908w*2 - 959346w + 64448784. -2(w - 2007)2(w - 72)/9 Find f, given that -2f2/11 + 125280f/11 - 1961884800/11 = 0. 31320 What is u in 268u4 - 808u*3 + 816u*2 - 280u + 4 = 0? 1/67, 1 Suppose -875o5 - 342550o*4 - 300765o*3 + 761570o*2 - 39260o - 78120 = 0. What is o? -1953/5, -2, -2/7, 2/5, 1 Solve 2s5/5 + 10758s*4/5 - 75422s*3/5 - 96934s*2/5 + 15084s + 86176/5 = 0 for s. -5386, -1, 1, 8 Suppose 4t4 - 40424t*3 + 102131236t*2 = 0. What is t? 0, 5053 Factor -4v*2 - 59976v - 224820036. -4(v + 7497)2 Factor 3c*2 - 3642c - 3645. 3(c - 1215)(c + 1) Let -4q3 - 2284q*2 - 4456q + 54624 = 0. Calculate q. -569, -6, 4 Suppose 2f5/3 - 26f*4 + 282f*3 - 414f*2 - 2592f + 5832 = 0. Calculate f. -3, 3, 18 Let 4w2/5 - 1404616w/5 + 123309131716/5 = 0. Calculate w. 175577 Factor 5g4 - 700g*3 + 27855g*2 - 352520g + 325360. 5(g - 83)(g - 28)*2(g - 1) Suppose 3p3/2 - 176769p*2/4 + 22095p + 88383/4 = 0. What is p? -1/2, 1, 29461 Solve -3u5/8 + 45u*4/8 + 435u*3/4 - 1485u*2/4 - 867u/8 + 2925/8 = 0 for u. -13, -1, 1, 3, 25 Find j, given that 6j5/13 + 4484j*4/13 + 840744j*3/13 + 1114524j*2/13 + 278258j/13 = 0. -373, -1, -1/3, 0 Suppose b*5/3 + 185b*4 + 25576b*3 - 77284b*2/3 = 0. What is b? -278, 0, 1 Factor 5n*2 - 390n - 12240. 5(n - 102)(n + 24) Factor -2u2/11 + 198300u/11 - 4915361250/11. -2(u - 49575)2/11 Factor -5s*3 - 7165s*2 - 2584680s - 12744900. -5(s + 5)(s + 714)*2 Let 3s*4/11 + 25s*3/11 + 40s*2/11 - 100s/11 - 208/11 = 0. Calculate s. -13/3, -4, -2, 2 Factor 3l3 + 669l*2 + 2628l. 3l(l + 4)(l + 219) Factor c3/5 - 15929c*2/5 - c/5 + 15929/5. (c - 15929)(c - 1)(c + 1)/5 Factor -u2/3 + 12301u/3 - 16396. -(u - 12297)(u - 4)/3 Solve 2s*3 - 96s*2 + 738s - 1404 = 0. 3, 6, 39 What is d in 4975d5 - 9920d*4 - 14985d*3 + 19810d*2 + 20020d + 120 = 0? -1, -6/995, 2 Let 3a2/7 + 1245a/7 - 196542/7 = 0. What is a? -537, 122 Factor -5a3 + 5720a*2 - 11420a. -5a(a - 1142)(a - 2) What is u in -u2/6 - 41u/2 + 24215/3 = 0? -290, 167 Suppose 2g5/9 - 148g*4/9 + 328g*3 - 5788g*2/9 - 67690g/9 - 19600/3 = 0. What is g? -3, -1, 8, 35 Solve -2k3/9 + 56k*2/9 - 146k/3 + 96 = 0. 3, 9, 16 Determine h so that -3h3 - 1074h*2 + 4344h = 0. -362, 0, 4 Suppose 12d4 + 67204d*3 + 22384d*2 - 89600d = 0. Calculate d. -5600, -4/3, 0, 1 Factor -3f3/2 + 61f*2/2 - 38f. -f(f - 19)(3f - 4)/2 Solve -2d*5/7 + 1244d*4/7 - 3720d*3/7 + 3716d*2/7 - 1238d/7 = 0. 0, 1, 619 Let 62m2 - 1744m + 224 = 0. What is m? 4/31, 28 Find c, given that -2c3/3 + 20866c*2 - 163302528c + 489719808 = 0. 3, 15648 Factor 2y4/7 - 4090y*3/7 - 12282y*2/7 - 12286y/7 - 4096/7. 2(y - 2048)(y + 1)3/7 What is r in -r3/8 + 600r2 - 9597r/8 + 2399/4 = 0? 1, 4798 Factor 943938w2/5 + 1330032w/5 + 468512/5. 2(687w + 484)*2/5 Factor 2s*2 + 238s - 14760. 2(s - 45)(s + 164) Factor -12i3 + 798580i*2 - 13286175104i + 4428636304. -4(i - 33274)2(3i - 1) Suppose 4l*4 - 49820l*3 - 398816l2 = 0. What is l? -8, 0, 12463 Factor f2/4 - 5025f/4 + 17563/2. (f - 5018)(f - 7)/4 Factor 3l3/4 + 351l*2 - 37287l + 210924. 3(l - 84)(l - 6)(l + 558)/4 Solve m5/5 + 38m*4/5 + 61m*3/5 - 408m*2/5 - 396m/5 + 1296/5 = 0 for m. -36, -3, 2 Suppose -3o3/4 - 419241o*2/4 - 838473o/4 - 419235/4 = 0. Calculate o. -139745, -1 Determine q so that -105q5 + 31435q*4 - 494100q*3 + 2079460q*2 - 632640q - 362240 = 0. -2/7, 2/3, 8, 283 Let 18w5/7 + 330w*4/7 + 1772w*3/7 + 3776w*2/7 + 2816w/7 = 0. Calculate w. -11, -8/3, -2, 0 Solve 4h4 + 2996h*3 + 20840h*2 + 47536h + 35616 = 0. -742, -3, -2 Let 2z4 - 3910z*3 + 3890z*2 + 35190z - 35172 = 0. What is z? -3, 1, 3, 1954 Let 2t3 + 3430t*2 - 44928t = 0. What is t? -1728, 0, 13 Find f such that 3f2/4 - 97f/4 + 391/2 = 0. 46/3, 17 Factor 3u4/2 + 62355u*3/2 - 187083u*2/2 + 187089u/2 - 31182. 3(u - 1)3(u + 20788)/2 Let o*5 - 38o*4 - 85o*3 + 194o*2 + 240o = 0. What is o? -3, -1, 0, 2, 40 Suppose -3g4/2 - 78g*3 + 216g*2 + 35448g + 297528 = 0. What is g? -46, -14, 22 What is u in 4u3/7 + 1958436u*2/7 + 239715993660u/7 - 239717952100/7 = 0? -244805, 1 Suppose 5d5 - 1845d*4 - 5610d*3 + 11120d*2 + 14880d = 0. What is d? -4, -1, 0, 2, 372 Factor -4x2 + 6420408x - 2576352430404. -4(x - 802551)2 Factor 4f*4 - 8504f*3 + 4511364f*2 + 9048256f + 4528384. 4(f - 1064)2(f + 1)2 Find b such that b3/6 - 2471b2/3 + 137563b/6 + 23751 = 0. -1, 29, 4914 Factor j*5/3 + 2948j*4/3 + 2118640j*3/3 - 26712768j2. j2(j - 36)(j + 1492)*2/3 Solve -2n*3/11 - 272n*2/11 - 456n = 0. -114, -22, 0 Determine o, given that 4o*3	{ "pile_set_name": "DM Mathematics" }
unded to 1 decimal place? 20.7 Suppose -8 = 9v - 71. Suppose -va + 3k = -9a - 229003, -5a = 4k + 572504. Round a to the nearest 10000. -110000 Let q = -155.35 + 154. Let m = -1.3499367 - q. What is m rounded to 6 dps? 0.000063 Suppose -2v - 17958089 = -3f + 4907913, 5f = 3v + 38110003. Round f to the nearest one million. 8000000 Let p = -11.59 - -11.65937. Round p to 3 decimal places. 0.069 Let l = 27.6578378672 - -0.0421594328. Let x = l + -27.7. Round x to six decimal places. -0.000003 Let i = 2342468341.0313 + -2342357494. Let v = i - 110960. Let h = v + 113. Round h to three dps. 0.031 Let w = 97.2 - -1.8. Let q = 179 - w. Let b = q - 79.99913. What is b rounded to four decimal places? 0.0009 Let u = 64.141 + -64.1380473. What is u rounded to 4 dps? 0.003 Suppose 0 = -552s + 554s + d + 527, 4s + 1057 = -5d. Let b = -1151 - -678. Let j = s - b. What is j rounded to the nearest 100? 200 Let n = 2275887.999914 + -2275912. Let h = -31.64 + 7.64. Let k = n - h. What is k rounded to 5 dps? -0.00009 Let f = -0.9214 - -0.921390846. Round f to six decimal places. -0.000009 Let l = -0.0297 - -2.2937. Let c = l + -0.572. What is c rounded to 1 decimal place? 1.7 Let n = 868.1285 - 866.1. Let i = -1.9 + n. What is i rounded to three decimal places? 0.129 Let j = 2.981 + -0.263. Let d = 2.5193 - j. Round d to 2 dps. -0.2 Let s(u) be the first derivative of -95u3/3 - 17u*2/2 + 58u - 31. Let m be s(14). Round m to the nearest one thousand. -19000 Suppose 8y = y + 35. Suppose 25 = -yo, -3o + 177379 = p + 28694. What is p rounded to the nearest ten thousand? 150000 Let y = 21288 + -21287.9956966. What is y rounded to 4 dps? 0.0043 Let k = 1928.68 - 1846. Let z = 82 - k. Let j = z + 0.67999992. What is j rounded to seven decimal places? -0.0000001 Let l = 203.56907 - -0.03093. Let o = 168 + -420. Let s = l + o. What is s rounded to 0 dps? -48 Let p = 467 - 468.19. Let h = -485015077 - -485015075.809999345. Let o = h - p. What is o rounded to seven dps? -0.0000007 Let x = 0.146 + -2.656. Let y = -0.9 - x. Let f = y + -1.531. Round f to two decimal places. 0.08 Let w = -9897.9972495 + 9898. What is w rounded to three dps? 0.003 Suppose -8 = -4l - 0l. Let a be (l/4)/((-5)/30). Let k be (-6)/(a - -4) - 4. Round k to the nearest one hundred. 0 Let t be ((1000/14)/((-27)/(-6867)))/((-1)/(-12)). Round t to the nearest 100000. 200000 Let u(s) = s2 + 17s - 35. Let y be u(-13). Let h = y + 128. Let g = -365 - h. Round g to the nearest 10. -410 Let j = -283.98 - 1.02. Let i = -200 - j. Let a = i - 88.76. What is a rounded to the nearest integer? -4 Let i = -89 + 89.018. Let u = i - 0.034. Let l = -0.0296 - u. What is l rounded to three dps? -0.014 Let c = -21983 + 21982.9956071. What is c rounded to 4 decimal places? -0.0044 Let j = 1616 + -1065. Let w = j + -551.00000718. What is w rounded to seven dps? -0.0000072 Let g = -71.13 + 63.9308. Let f = -769.9108 + 770. Let x = f + g. What is x rounded to zero decimal places? -7 Let g = -199411542 - -304666861. Let s be ((-648246379030)/(-60))/(-67) - 5/6. Let f = g + s. What is f rounded to the nearest one million? -56000000 Let t = 3072372.9001852 - 3072353.9. Let s = t + -19. What is s rounded to 5 dps? 0.00019 Let b be (-3)/(-12)-243/(-6). Let d(k) = 2393362k - 86. Let m be d(b). Round m to the nearest one hundred thousand. 7200000 Suppose 0 = -15d + 17752584 + 7239518 + 14715898. What is d rounded to the nearest ten thousand? 2650000 Let k = -104.7909775 + 104.79. Round k to five dps. -0.00098 Let p = -1984 + 1250. Let m = p + 733.99568. What is m rounded to 3 dps? -0.004 Let p be 460642440/(-75) - (6 + 312/(-60)). Round p to the nearest one million. -6000000 Let g = -136.4 + 136.39984447. Round g to 5 dps. -0.00016 Let s = 1.08244 - 7072.78244. Let t = s - -6634. What is t rounded to the nearest ten? -440 Suppose 5h = 3d + 47, 3d - d = 3h - 29. Suppose hj = 3x + 9j - 11100008, -x + 3700016 = 4j. What is x rounded to the nearest 100000? 3700000 Suppose 5b - 10 = 0, -2z + 22b - 25b + 2106678 = 0. Let k = 70336 - z. What is k rounded to the nearest one hundred thousand? -1000000 Let f = -7481 + 7429.71. Round f to the nearest 10. -50 Let v be 4/6(-51)/85-5. Suppose n = vo - 4924, 4n = 5o - 3o - 4936. Round o to the nearest 1000. 2000 Let x = 117.39 - 117. Let q = x + -0.389999513. What is q rounded to seven dps? 0.0000005 Let l = 0.523 - 1.219. Let f = l + 0.79. Round f to two dps. 0.09 Suppose -16 = -5m - 6. Suppose 2397234 = -mq - 322766. Round q to the nearest 1000000. -1000000 Suppose 11928442 = -9j - 120229286. Suppose 5m = -23305102 - 6273938. Let n = j + m. Round n to the nearest 1000000. -21000000 Let h(x) = -2x - 1. Let i(k) = 424983k - 22. Let a(w) = -4h(w) + i(w). Let n be a(-2). What is n rounded to the nearest one hundred thousand? -900000 Let j = 18240 + -18170.535. What is j rounded to one decimal place? 69.5 Let s = -0.8821 - -0.8809092. Round s to 5 dps. -0.00119 Let a = -0.913 + 0.083. Let o = a + 0.793. Let g = o - -0.036989. What is g rounded to 5 decimal places? -0.00001 Let b = -322 + 360. Suppose 19m - bm = -6710800. What is m rounded to the nearest 100000? 400000 Let y(b) = b2 + 475b - 470b + 1 - 4 - 127b*3. Let g be y(-3). What is g rounded to the nearest one thousand? 3000 Let g = -560414074493 - -560414077544.000002574. Let t = -3051 + g. Round t to seven dps. 0.0000026 Let y = -17.881 - -407.621. What is y rounded to 0 decimal places? 390 Let a = -186761 + 186760.99883367. Round a to 4 decimal places. -0.0012 Let y = 365 + -524.6. Let t = y - -137. Let f = -22.989 - t. What is f rounded to two dps? -0.39 Let m = -1208531 + 1207905.409. Let n = m - -625. What is n rounded to 1 dp? -0.6 Let y = 29145262 - 13400860. Suppose 5 = 2a - 1. Suppose 18455598 + y = -ao. What is o rounded to the nearest 1000000? -11000000 Let g = 3.95067 + -3.97. What is g rounded to two decimal places? -0.02 Let o = 25.8 - 2.8. Let v = 82638.0044 - 82661. Let k = o + v. What is k rounded to three decimal places? 0.004 Let y = -86 - -80. Let d be 1/y + (-4548)/(-72). Let i be 7/(d/15)3. Round i to the nearest 10. 10 Let n = 2.7 + -427.7. Let o = 424.9815 + n. What is o rounded to two decimal places? -0.02 Let u = 0.1132 + 0.0268. Let z = -6998824 + 6998823.86000043. Let h = z + u. Round h to seven dps. 0.0000004 Suppose 3c - 104917821 + 28249836 = -4i, -i + 19166985 = 3c. What is i rounded to the nearest one million? 19000000 Let w = 46572 - 17883. What is w rounded to the nearest ten thousand? 30000 Let z = -0.07381 + 0.07234226. Round z to 4 dps. -0.0015 Let j = 0.005 + 0. Let w = 2.481 + -2.486022. Let v = w + j. What is v rounded to 6 dps? -0.000022 Let v = 625 - 622.07. Let x = -2.9300484 + v. What is x rounded to five decimal places? -0.00005 Suppose -116a + 3514500000 = -138a. What is a rounded to the nearest one million? -160000000 Let i(m) = 260647m - 21. Let x be i(-5). Let q = x + 5333256. What is q rounded to the nearest one million? 4000000 Let d = 10.482842 + -10.571. Let u = d + 0.088. Round u to five decimal places. -0.00016 Let b = 702.1 + -702.105678. What is b rounded to 3 decimal places? -0.006 Let x = -16.05 - -16.15885. Round x to two dps. 0.11 Let q = -15360.33582 + 15360. Let z = -28.767 + 29.1. Let b = q + z. What is b rounded to four dps? -0.0028 Suppose 0 = -4x - 2r - 99180, -24795 = x - 11r + 6r. Let t = x - -3343. Let d = -14182 - t. What is d rounded to the nearest 1000? 7000 Suppose -2d + 407666 = 2t - t, 0 = -4t - 4d + 1630672. Suppose -t = -22m + 889890. Round m to the nearest 10000. 60000 Let t = 0.0038 - -0.2391. Let v = 0.0419 - t. What is v rounded to two decimal places? -0.2 Let d(f) = -135282f - 2066. Let v be d(2). What is v rounded to the nearest one thousand? -273000 Let d = -0.02 - -0.2. Let x = -0.92 - d. Let w = x + 1.09999927. Round w to seven decimal places. -0.0000007 Let z(a) = 112600a + 1410. Let o be z(2). What is o rounded to the nearest 1000? 227000 Suppose -4v + 11 = u, -2v + 0v + u + 1 = 0. Suppose -5l - 16819975 = a, -4l + 45198486 - 11558466 = -v*a. What is a rounded to the nearest one million? -17000000 Let y = -2122671786.99999945 - -2122671741. Let v = -46 - y. What i	{ "pile_set_name": "DM Mathematics" }
ss 5m3 + 1 - 2m*4 + 3m + 6m2 - 2m*2 - 2m*2 + 0m*2 in the form ym*4 + tm*2 + d + qm + um3 and give t. 2 Express -2m + 16m + 2m + 4m as cm + a and give a. 0 Express -136v2 + 2v*3 + 103v*2 + 2v - 2v in the form p + av + rv3 + cv*2 and give r. 2 Express -r + 2r*2 + 4r*2 - 7r*2 - 2r*4 as g + wr + hr4 + xr*2 + tr*3 and give w. -1 Express -2p + 124p2 + 3 + 117p*2 - 236p*2 in the form l + up*2 + xp and give x. -2 Express -6k2 + 5k*2 + 0k*2 + (3 + k - 3)(0k + 4k - 5k) - 5k*2 - 4k*2 + 4k*2 + (-k + k - 2k*2)(-1 + 3 + 0) as dk + lk*2 + q and give l. -11 Express -2m*3 + 2m3 - m3 + (-1 + 1 + 2m)(-m*2 - 2 + 2) - 3m*3 - 3m*3 + 4m*3 as t + rm*3 + jm + lm2 and give r. -5 Express (1 - 1 - 2z)(0 + 3 - 2) + 5z - 2z - 2z - 2z + 5z + 2z + (0 + 2 - 1)(4z + 2z - 4z) in the form qz + j and give q. 6 Rearrange 8b2 - 1 + 2b*2 - 4b*2 - 3b*4 - 4b*2 to pb*3 + jb*4 + ob + ab2 + t and give t. -1 Express -c3 + 2c4 + c3 - 1 + 2c3 - c2 + c3 as mc*2 + zc*4 + hc + p + xc3 and give p. -1 Rearrange (-m - m + 0m)(1 - 6 - 5) to o + qm and give q. 20 Express -2z2 + 28z*3 - 6 - 8 - 12 + 24 in the form pz*2 + jz + oz3 + s and give j. 0 Rearrange -6c*2 - 3c*2 - 3 - 10 + 10 to the form hc*2 + wc + m and give h. -9 Express 2n - 16n - 5n in the form ln + k and give l. -19 Rearrange -f*2 + 2f3 + f2 + (-3 + 3 + f*3)((-5 - 2 + 6)(-2 + 0 + 1) - 35 - 11 + 26) to the form df + rf3 + g + wf*2 and give r. -17 Rearrange -14n + 25 - 25 to the form rn + t and give r. -14 Rearrange p2 + 39 - 9p*2 + 10p*2 - p to the form up + o + wp2 and give u. -1 Rearrange (-n3 - 2 + 134n*2 - 3n - 134n2)(-n + 3n + 0n) to the form vn2 + fn + r + qn3 + on*4 and give o. -2 Rearrange -13z + 0 + 0 + 52z to the form d + kz and give k. 39 Rearrange (-11n + n + 0n)(-13 - 18 + 6) to o + qn and give o. 0 Rearrange -5a + a4 + 3a + 3a + 4a*2 - 2a*4 to the form ba + l + qa4 + va*3 + ca*2 and give b. 1 Rearrange -1 + 2x + 2 + 117x2 - 116x2 - x4 to the form kx + bx*2 + gx*4 + ax*3 + h and give h. 1 Rearrange 2x*2 - 2x*2 - 3x*2 + (-2x - 4x + 5x)(-x + 0x - x) to the form vx + gx2 + n and give g. -1 Rearrange 32 - 64 - z2 + 49 - 2z to yz*2 + hz + d and give y. -1 Rearrange 0m2 + 9m - 3 + m*2 + 6 + 0m to im2 + u + cm and give u. 3 Express (14 - 8 + 12)(-5y + y + 3y) + y + 2 - 2 as gy + l and give g. -17 Rearrange 2g2 + 508g + 2g2 - 508g - 1 to s + cg + qg2 and give q. 4 Express -24 + o3 + 24 - 2o in the form zo + bo3 + a + co2 and give b. 1 Rearrange -m2 + 2m2 + 4m*2 + ((-2m + 0m + 0m)(5 - 4 - 3) - 2m + 1 - 1)(2m + 0m + m) to the form v + am + km2 and give v. 0 Express 2h*2 + 7 - 15 - 1 - 3h*3 - 3h*2 - h in the form lh*2 + zh + k + ch3 and give z. -1 Rearrange (4d*3 - 2d*3 + 0d*3)(-5 + 3 + 4) - 220d + 220d - 12d3 + (0d + 3d - 2d)(-1 + 1 - 2d*2) to jd*2 + c + fd*3 + od and give f. -10 Express (-2v + 2v + 2v)(305 + 14v - 305 + (-3v + 4v + v)(1 - 1 + 2)) as jv2 + x + sv and give s. 0 Express 3 - 1 + t + 4t4 + 15t*4 + 2 in the form rt*3 + b + dt*2 + jt + at4 and give j. 1 Express -1 + 11 + 3m*3 - 5m*3 + 3 as g + im*3 + om + vm2 and give o. 0 Express -29 + a - 3a + 21 - 2a4 as ya*3 + va*2 + p + ra + ta4 and give r. -2 Rearrange (-6s*2 + 0s*2 + 7s*2)(5s + s2 - 5s) to the form qs + ls*3 + j + vs*2 + os*4 and give o. 1 Express (-6y*2 + 3y2 + y2)(-2 - 1 - 1) + (-y + y - 2y*2)(-2 + 2 + 2) - y2 + y2 + y*2 as d + iy + ay2 and give a. 5 Rearrange -2 - 2o*4 + 2o*3 - 1 + 0 + 0 to ko + go3 + f + yo*2 + io*4 and give i. -2 Express (0p - p - 3p + (1 + 0 + 0)(2p + p - p))(0 - 5 + 1) in the form m + bp and give b. 8 Rearrange -3s*2 - 4s2 - s3 - s*2 + 6s*2 + 7s to the form vs + ns*3 + ps*2 + q and give p. -2 Rearrange (5c + c + 0c)(9 + c - 9)(1 - 1 - 2) to v + tc*2 + kc and give t. -12 Rearrange -m*3 - 3m*2 + 3m*2 + (0 + 0 + 1)(2m + 0m - m)(m - m - 2m2) - m3 + m2 - m2 to sm + a + zm*3 + gm*2 and give g. 0 Rearrange 11u*2 - 3u*3 - 3u*2 + 2 + u - 9u*2 to the form v + cu + du3 + pu*2 and give d. -3 Express (0a*3 - 6a3 + a3)(-1 + 2a + 1 + 4a - 3a - 3a + (4a + 2a - 4a)(-2 + 1 - 1)) in the form c + za*3 + pa*2 + da + ja4 and give j. 20 Express 2r*2 + 4r + 0r2 + r2 as ur*2 + xr + i and give x. 4 Express -2l2 + 1 - 1 + (-3 + 1 + 0)(1 - 2l2 - 1) - 3l*2 + 6l*2 + 5l*2 + (4l*2 - 6l*2 + 0l*2)(2 + 1 - 1) as wl2 + gl + z and give w. 6 Express (2 + 4 - 5 - 3 + 1 + 3 + (-3 + 3 + 1)(-1 + 3 + 0))(-2u + u + 3u) in the form h + gu and give g. 8 Express -2a + 22a3 - 5a*3 - 6 - 15a*3 + 6a*2 as pa*3 + z + xa + qa2 and give x. -2 Rearrange -t - 5t4 - t3 - 9 + t*2 + 5 + 8t*4 + 2t*3 to the form st*3 + ht*2 + k + gt + vt4 and give g. -1 Express (2l - l - 2l2 - 2l)(-19 + 3l + 5l - 7l) in the form hl3 + jl + z + dl2 and give d. 37 Rearrange (q2 - q + q)((5 + 0 - 3)(-1 - 1 + 1) + 9 - 59 + 0) to the form a + tq + lq2 and give l. -52 Rearrange 37w*2 + 14w - 3w - 38w*2 to the form mw + h + pw2 and give p. -1 Express (-4 + 3 + 2)(-2y4 + 2y*4 + 2y*4) + (0y*3 + 4y*3 - 2y*3)(-7y + 4y - 6y) as by*3 + ay + dy4 + ny*2 + j and give d. -16 Rearrange -18g*4 - 4 + 4g - 2g + 21g*4 + 1 to the form i + lg*2 + yg + hg3 + cg*4 and give i. -3 Express (0 - 1 + 4)(a - 2 + 2)(-1 + 1 + 5a)(-2 - 1 + 1) in the form j + ma + ha2 and give m. 0 Rearrange 5o*3 - 2o*4 - 5o*3 - 3 + 53o*2 - 2o - 50o2 to the form to*3 + v + fo*2 + jo + wo4 and give j. -2 Rearrange (-1 + 11112b - 11112b - 19b*2)(b*2 + 2 - 2) to yb + tb4 + c + qb*2 + ub*3 and give t. -19 Express -3s + 13s4 + 7s + 1 - 12s4 - 3s*2 as ds + xs4 + bs*3 + p + ms*2 and give b. 0 Express (-2u*3 + 3u*3 - 3u*3)(-u + 0 - 1 + 6)(-4 + 1 + 2) as a + cu*2 + zu*4 + mu + fu3 and give c. 0 Rearrange (-55 + 2g + 58 - 3g)(-7 - 2 + 3) + (-4g + g + 2g)(-1 + 0 + 0) to the form r + pg and give p. 7 Express 5 + 2 + 3g2 + g - 7 in the form xg*2 + u + jg and give j. 1 Rearrange -24l + 6l - 10l to cl + g and give c. -28 Rearrange -10i3 + 4i*3 + 5i*3 + 7i + 7i3 to the form zi + ni2 + bi*3 + g and give b. 6 Express (-11t - 11t - 11t)(-t2 + 2t - 2t) as it + vt3 + o + yt*2 and give v. 33 Express (-2v*2 - 5 + 5)(-4 + 6 - 1)(-2 + 4 - 1) as zv + yv2 + g and give y. -2 Rearrange (f - 2f - f)(f - 2f + 3f) + 5 - 2f*2 - 5 + (2f - 4f + 4f)(f + 3f + 0f) to the form uf*2 + b + if and give u. 2 Rearrange (0 - 4 + 2)(7p + 8p + 1 - 14p) to sp + g and give s. -2 Rearrange 22s - 2s2 - 50s + 1 + 20s + 2s*3 to d + ys + js2 + zs*3 and give d. 1 Rearrange 13d - 5d - d to the form ad + u and give a. 7 Rearrange 5 + 3o3 - 5 + 2o*3 - 2o*3 + 2o*3 + (3o2 - o3 - 3o2)(0 + 2 - 3) + 4 + 2o3 - 4 to go*2 + j + lo + ao3 and give a. 8 Rearrange (4 + 0 - 6)(-2 + 0 + 0)(9n - n - 10n) to bn + g and give b. -8 Express (-1 + 1 - 2x)(2x2 + 1 - 1) as c + kx*2 + zx*3 + ux and give z. -4 Express -5y3 - 12 + 11 - y3 + y3 + 2y*2 in the form g + ly*2 + dy + wy3 and give l. 2 Express -w3 + 0 + 2w*3 + 0 - 7w in the form pw2 + h + kw + bw3 and give b. 1 Rearrange 55s - 2 + 4 + 6s3 - 55s to the form rs + us*2 + js*3 + b and give j. 6 Rearrange 584 + 19r - 584 to d + pr and give d. 0 Rearrange -5k + 0k + 4k - 8k - k2 to the form ck*2 + lk + i and give c. -1 Rearrange 140d3 + 102d*3 - 8d*3 + 73d*3 + (2d*2 + 0d*2 - 4d*2)(3d + d - 6d) to the form sd3 + f + kd*2 + id and give k. 0 Express (-m - 3m - 2m)(-m3 - 3m3 + m3) in the form c + pm4 + bm*3 + vm*2 + sm and give p. 18 Express 2j + 0j + 167 - 167 as n + h*j and give h. 2 R	{ "pile_set_name": "DM Mathematics" }
n: 3, a: 3, f: 1, j: 2, q: 1}. What is prob of picking 1 y and 1 j? 2/55 Four letters picked without replacement from ieiiiwwiqy. What is prob of picking 2 w and 2 q? 0 Four letters picked without replacement from omffmioofmsoflsimmml. Give prob of picking 1 l, 1 s, and 2 i. 4/4845 What is prob of picking 1 u and 1 b when two letters picked without replacement from ubuouubbhuuua? 7/26 Three letters picked without replacement from {r: 5, h: 4, w: 8}. What is prob of picking 2 h and 1 r? 3/68 Calculate prob of picking 1 m and 1 i when two letters picked without replacement from {i: 9, m: 2, j: 2}. 3/13 Three letters picked without replacement from {l: 3, p: 2}. Give prob of picking 3 l. 1/10 What is prob of picking 2 w when two letters picked without replacement from {w: 2, a: 4}? 1/15 What is prob of picking 1 t and 3 m when four letters picked without replacement from mtmmmttmtttttt? 90/1001 Three letters picked without replacement from {f: 1, y: 2, r: 1, q: 2}. What is prob of picking 1 r and 2 y? 1/20 Three letters picked without replacement from mdmwgdmdwwwddmdm. What is prob of picking 1 m, 1 w, and 1 g? 1/28 Three letters picked without replacement from dszzl. What is prob of picking 1 d and 2 z? 1/10 Calculate prob of picking 1 k and 1 x when two letters picked without replacement from iiiiikiniixiiiixi. 1/68 Four letters picked without replacement from {b: 2, p: 4, w: 1, o: 2, q: 1}. Give prob of picking 1 q, 1 w, 1 o, and 1 p. 4/105 Calculate prob of picking 2 i and 2 m when four letters picked without replacement from {i: 2, m: 8}. 2/15 Two letters picked without replacement from {y: 6}. Give prob of picking 2 y. 1 Calculate prob of picking 1 u, 1 n, and 1 f when three letters picked without replacement from ufunnffuuuouuffupuuu. 11/114 Four letters picked without replacement from {g: 10, c: 2}. What is prob of picking 2 g and 2 c? 1/11 What is prob of picking 1 o and 1 u when two letters picked without replacement from {u: 1, c: 1, o: 1, i: 1, w: 1}? 1/10 Three letters picked without replacement from {n: 11, u: 9}. What is prob of picking 3 n? 11/76 What is prob of picking 1 u, 2 y, and 1 j when four letters picked without replacement from yyyyjuuyj? 20/63 Two letters picked without replacement from {u: 2, c: 1, a: 6, n: 3}. What is prob of picking 1 n and 1 c? 1/22 Four letters picked without replacement from ykhhopyohhyppy. Give prob of picking 1 k, 2 y, and 1 o. 12/1001 Three letters picked without replacement from atawjjb. What is prob of picking 1 j, 1 w, and 1 t? 2/35 Calculate prob of picking 3 x when three letters picked without replacement from nnhxxnnxxnnxn. 5/143 Two letters picked without replacement from {d: 9, j: 1, z: 4, l: 2}. Give prob of picking 1 z and 1 l. 1/15 Three letters picked without replacement from llzlllllzzzzzzzzllzl. What is prob of picking 2 z and 1 l? 15/38 Two letters picked without replacement from {j: 1, v: 1, q: 1}. What is prob of picking 1 v and 1 j? 1/3 Three letters picked without replacement from aeeeaeoeeeeeoeoeaaee. What is prob of picking 3 a? 1/285 Three letters picked without replacement from fzfpfcfpfzpfp. What is prob of picking 1 f, 1 z, and 1 p? 24/143 Two letters picked without replacement from wdbvdddddbdddzkwdkd. What is prob of picking 1 w and 1 z? 2/171 Two letters picked without replacement from {s: 1, l: 3, b: 1}. Give prob of picking 2 l. 3/10 Two letters picked without replacement from {j: 4, e: 3, t: 2, p: 3, h: 1, d: 2}. Give prob of picking 1 d and 1 j. 8/105 Three letters picked without replacement from {x: 3, o: 5, l: 5, a: 2}. Give prob of picking 1 o and 2 l. 10/91 Calculate prob of picking 1 r and 3 v when four letters picked without replacement from {r: 1, v: 8, t: 11}. 56/4845 Two letters picked without replacement from igiagqiaiqijaa. Give prob of picking 2 i. 10/91 Three letters picked without replacement from adaddaffaaffdaada. What is prob of picking 3 a? 7/85 Four letters picked without replacement from {k: 2, n: 1, u: 3, d: 3, i: 1, l: 1}. What is prob of picking 1 d, 2 k, and 1 i? 1/110 What is prob of picking 1 y and 1 s when two letters picked without replacement from yysywjjjwywjjyyswwy? 14/171 Two letters picked without replacement from wwwwxwxuww. What is prob of picking 1 u and 1 x? 2/45 Two letters picked without replacement from nnnyyyenn. What is prob of picking 1 e and 1 y? 1/12 What is prob of picking 1 j, 1 z, 1 s, and 1 e when four letters picked without replacement from cxezjxszs? 2/63 Two letters picked without replacement from ffbmxgfwwwbmmb. What is prob of picking 1 f and 1 x? 3/91 Calculate prob of picking 2 p and 2 k when four letters picked without replacement from kppppkppp. 1/6 Four letters picked without replacement from {e: 8, r: 1, f: 1, c: 2, n: 1, d: 2}. What is prob of picking 2 c and 2 d? 1/1365 What is prob of picking 2 m and 1 p when three letters picked without replacement from {m: 5, p: 11}? 11/56 What is prob of picking 1 z, 1 r, and 2 e when four letters picked without replacement from {r: 4, z: 1, n: 1, p: 1, e: 2}? 2/63 Calculate prob of picking 2 h and 2 q when four letters picked without replacement from {h: 3, q: 7, n: 1, s: 1}. 7/55 Two letters picked without replacement from {d: 2, x: 7}. Give prob of picking 1 d and 1 x. 7/18 Calculate prob of picking 1 d, 1 e, and 1 a when three letters picked without replacement from edae. 1/2 Three letters picked without replacement from dnddnd. What is prob of picking 3 n? 0 Calculate prob of picking 2 u when two letters picked without replacement from uuxxu. 3/10 Four letters picked without replacement from {d: 4, l: 2, x: 2, o: 4, f: 1, y: 1}. What is prob of picking 1 y, 2 d, and 1 x? 12/1001 Calculate prob of picking 4 v when four letters picked without replacement from vvvvv. 1 What is prob of picking 4 a when four letters picked without replacement from aaaaaa? 1 Four letters picked without replacement from tgttj. Give prob of picking 1 g and 3 t. 1/5 Two letters picked without replacement from {x: 9, z: 1, y: 3, r: 3, c: 1, q: 1}. What is prob of picking 1 z and 1 x? 1/17 Two letters picked without replacement from iitiiiiiiiiit. Give prob of picking 1 t and 1 i. 11/39 Calculate prob of picking 3 g when three letters picked without replacement from zzzzzzzzggzgzgzzzgzz. 1/114 Four letters picked without replacement from {m: 2, t: 10}. What is prob of picking 1 m and 3 t? 16/33 What is prob of picking 1 v and 3 f when four letters picked without replacement from vvfvfvhvhhhhvvfhf? 1/85 Three letters picked without replacement from wtoweowtditt. What is prob of picking 1 t, 1 i, and 1 e? 1/55 Three letters picked without replacement from tjzttjdzftz. What is prob of picking 1 j and 2 t? 4/55 Three letters picked without replacement from {k: 4, v: 8, m: 4}. Give prob of picking 2 m and 1 k. 3/70 Two letters picked without replacement from sesssxieiessi. Give prob of picking 1 i and 1 x. 1/26 Two letters picked without replacement from aaaaaaakavavk. What is prob of picking 1 k and 1 v? 2/39 Four letters picked without replacement from {l: 4, n: 1, h: 3, w: 2, a: 8, q: 2}. Give prob of picking 1 n, 1 a, 1 w, and 1 q. 32/4845 Three letters picked without replacement from {h: 15, i: 5}. What is prob of picking 3 h? 91/228 Four letters picked without replacement from bbbbbbb. What is prob of picking 4 b? 1 Calculate prob of picking 1 k and 1 e when two letters picked without replacement from {e: 2, a: 3, p: 1, u: 1, k: 5}. 5/33 Four letters picked without replacement from {n: 3, t: 10, u: 1, i: 1}. Give prob of picking 4 t. 2/13 Two letters picked without replacement from {c: 3, x: 1, i: 3, z: 2, l: 7, t: 2}. Give prob of picking 1 t and 1 z. 4/153 What is prob of picking 3 c and 1 j when four letters picked without replacement from {x: 6, j: 1, c: 3, z: 1, m: 1}? 1/495 Calculate prob of picking 1 c and 3 q when four letters picked without replacement from {c: 4, q: 4, w: 7}. 16/1365 Two letters picked without replacement from piiikpciiiiiiipciii. What is prob of picking 1 i and 1 p? 13/57 What is prob of picking 1 s and 2 x when three letters picked without replacement from {o: 1, x: 5, s: 2, q: 1}? 5/21 Two letters picked without replacement from orxrqmx. What is prob of	{ "pile_set_name": "DM Mathematics" }
und 0.00000531580688 to 5 decimal places. 0.00001 Round 3.3389014 to 1 decimal place. 3.3 What is -7131046.442 rounded to the nearest one million? -7000000 What is -910740.7144 rounded to the nearest 100? -910700 Round -0.00086363973 to 7 dps. -0.0008636 What is 0.05790353 rounded to two decimal places? 0.06 What is -0.000098336622 rounded to 7 decimal places? -0.0000983 What is 200.1013348 rounded to 1 decimal place? 200.1 Round 17.50342258 to three dps. 17.503 Round -0.00001718946344 to seven dps. -0.0000172 What is -1447.48019 rounded to the nearest 10? -1450 What is 0.493291957 rounded to three dps? 0.493 Round -692.829918 to the nearest 100. -700 Round -0.018712006 to two dps. -0.02 What is -24584.94175 rounded to the nearest 10000? -20000 What is -16.6778249 rounded to the nearest integer? -17 What is 41.08696 rounded to the nearest one hundred? 0 Round -28718.068 to the nearest 10. -28720 What is 0.00083023317 rounded to six decimal places? 0.00083 Round -0.000228054979 to 6 dps. -0.000228 Round -584761.931 to the nearest 1000. -585000 What is -69958.701 rounded to the nearest 10000? -70000 What is 633.373903 rounded to the nearest one hundred? 600 Round 5044570.37 to the nearest one thousand. 5045000 Round -560.92509 to the nearest one hundred. -600 Round 0.001693754873 to four dps. 0.0017 Round -7898098.7 to the nearest ten thousand. -7900000 Round 1777861440 to the nearest one million. 1778000000 Round -0.03245561578 to 4 dps. -0.0325 Round -1036.0754 to the nearest one hundred. -1000 What is -0.00026118739 rounded to six dps? -0.000261 Round 222937.855 to the nearest ten thousand. 220000 What is -18988153240 rounded to the nearest one million? -18988000000 Round -209969532.6 to the nearest ten thousand. -209970000 What is -0.068610284 rounded to 5 decimal places? -0.06861 Round 9727.1979 to the nearest 1000. 10000 What is -878019.904 rounded to the nearest one thousand? -878000 Round -0.00106102701 to six decimal places. -0.001061 Round 0.001210691902 to 4 decimal places. 0.0012 Round 1868.23562 to zero decimal places. 1868 What is -2925.20362 rounded to zero decimal places? -2925 What is -0.0866646743 rounded to 6 dps? -0.086665 What is 0.98241986 rounded to two dps? 0.98 Round -5503857464 to the nearest one hundred thousand. -5503900000 Round -0.083638486 to three decimal places. -0.084 Round -14.58039792 to three decimal places. -14.58 Round -1.044180546 to three decimal places. -1.044 What is 0.00261669595 rounded to 7 dps? 0.0026167 Round 14903.61137 to the nearest 10. 14900 Round -0.176465556 to two dps. -0.18 Round 0.00000050139262 to six dps. 0.000001 What is 17658.88712 rounded to the nearest one thousand? 18000 What is 0.00316297232 rounded to seven dps? 0.003163 Round 69090.985 to the nearest 1000. 69000 What is 0.44016183 rounded to two decimal places? 0.44 What is -11179.68645 rounded to the nearest 100? -11200 What is 13709160.551 rounded to the nearest one million? 14000000 Round -1358912.1 to the nearest one hundred thousand. -1400000 What is 13.766261857 rounded to four decimal places? 13.7663 What is -0.0000032808125498 rounded to 7 dps? -0.0000033 Round 0.514294896 to three dps. 0.514 What is -574.899707 rounded to zero dps? -575 What is 8561.9455 rounded to the nearest ten? 8560 What is -6.802929315 rounded to 2 decimal places? -6.8 What is -10.695681 rounded to the nearest ten? -10 What is 74354038.2 rounded to the nearest one hundred thousand? 74400000 Round 155.961438 to two decimal places. 155.96 Round 251278940 to the nearest one million. 251000000 What is 0.305969879 rounded to four decimal places? 0.306 Round -37.56153025 to 3 decimal places. -37.562 What is -21561061.9 rounded to the nearest 1000? -21561000 Round 1131.7938 to 1 dp. 1131.8 What is -0.000033809003 rounded to seven dps? -0.0000338 What is 0.00073146543 rounded to three decimal places? 0.001 Round 13004.45206 to the nearest one hundred. 13000 What is -4302.26055 rounded to 0 dps? -4302 What is 63743752 rounded to the nearest one hundred thousand? 63700000 What is 394307.851 rounded to the nearest 10000? 390000 What is -24.22104018 rounded to 2 dps? -24.22 Round 204.3501304 to the nearest integer. 204 Round 0.0000201127804 to 6 decimal places. 0.00002 What is -0.02675098618 rounded to three dps? -0.027 Round 3926.4751 to the nearest one hundred. 3900 Round 0.0003052521931 to 6 decimal places. 0.000305 Round -9118448.9 to the nearest 100000. -9100000 Round 31554.6351 to the nearest ten. 31550 Round 0.1388087213 to five dps. 0.13881 Round 0.000007218913 to 6 decimal places. 0.000007 Round -3855.1301 to zero decimal places. -3855 What is -1197457.38 rounded to the nearest ten thousand? -1200000 Round -7319578522 to the nearest 100000. -7319600000 Round -1947325900 to the nearest 1000000. -1947000000 What is 0.0148998257 rounded to five decimal places? 0.0149 Round 1.299005643 to 3 dps. 1.299 What is 280786358 rounded to the nearest 10000? 280790000 What is 283554.6364 rounded to the nearest 100000? 300000 What is 0.677182884 rounded to 3 dps? 0.677 What is -48113.61 rounded to the nearest one thousand? -48000 What is 2945223938 rounded to the nearest 100000? 2945200000 Round 156347.75454 to the nearest 10000. 160000 Round 2.001413761 to one decimal place. 2 Round 140765.923 to the nearest ten thousand. 140000 Round 7.39526389 to 3 decimal places. 7.395 Round 0.46359483 to 4 decimal places. 0.4636 Round 3109.62498 to the nearest one hundred. 3100 What is 0.0057093858 rounded to six decimal places? 0.005709 Round 3699.92583 to the nearest integer. 3700 Round -21845911.83 to the nearest one hundred thousand. -21800000 Round 11347.448979 to the nearest integer. 11347 What is 1.83004271 rounded to 3 decimal places? 1.83 Round 144.5902802 to the nearest 10. 140 Round 67363901.5 to the nearest 1000000. 67000000 Round -6554685 to the nearest one thousand. -6555000 What is -5596.68237 rounded to the nearest ten? -5600 What is 0.0778125249 rounded to four dps? 0.0778 Round -0.008186297475 to 5 dps. -0.00819 Round -1366887.88 to the nearest one hundred thousand. -1400000 What is 2948184.84 rounded to the nearest 10000? 2950000 Round 0.2131754393 to 3 dps. 0.213 Round -93314544.8 to the nearest one million. -93000000 What is 35876.6452 rounded to the nearest one thousand? 36000 What is -8.78033585 rounded to four dps? -8.7803 What is -57204970.4 rounded to the nearest one million? -57000000 What is 39.7638411 rounded to 3 dps? 39.764 What is -0.093566654 rounded to five dps? -0.09357 What is 0.0224095296 rounded to three dps? 0.022 What is -26220.3991 rounded to the nearest ten? -26220 Round -0.000003582873758 to six dps. -0.000004 What is 1.16795271 rounded to 4 decimal places? 1.168 What is 31.81790194 rounded to two dps? 31.82 What is -424728.386 rounded to the nearest one million? 0 Round 5717502510 to the nearest one million. 5718000000 Round -56246.5891 to the nearest 10000. -60000 Round 573489.6 to the nearest 10000. 570000 Round 91742.351 to the nearest one hundred. 91700 Round -0.81877601 to 4 decimal places. -0.8188 Round 0.04312729359 to 3 decimal places. 0.043 Round -88.7328257 to zero decimal places. -89 What is -164485752 rounded to the nearest one hundred thousand? -164500000 What is -449614752.6 rounded to the nearest 10000? -449610000 Round -335.31026 to the nearest 10. -340 What is 0.0167668832 rounded to three decimal places? 0.017 What is -0.0001144659183 rounded to seven dps? -0.0001145 Round 0.000208088387 to seven decimal places. 0.0002081 Round -29.3715852 to 1 dp. -29.4 Round 31.0741483 to 3 decimal places. 31.074 What is 0.358471703 rounded to one dp? 0.4 Round -0.083421966 to 3 dps. -0.083 What is 7507455.9 rounded to the nearest 1000? 7507000 Round -0.001113985476 to 6 decimal places. -0.001114 Round 0.000358641523 to seven dps. 0.0003586 Round 0.0000152868836 to 7 dps. 0.0000153 Round 0.0000135422204 to six dps. 0.000014 What is 1733641.6041 rounded to the nearest 10000? 1730000 What is -10966267.98 rounded to the nearest 10000? -10970000 What is -5094008.314 rounded to the nearest 100? -5094000 Round -5788223.84 to the nearest 100000. -5800000 What is 86.00010966 rounded to two decimal places? 86 Round -1349641110 to the ne	{ "pile_set_name": "DM Mathematics" }
of 136? False Is 13 a factor of 917? False Is 4 a factor of 111? False Does 79 divide 711? True Does 2 divide 90? True Does 15 divide 465? True Does 67 divide 2359? False Is 2142 a multiple of 34? True Is 630 a multiple of 105? True Is 244 a factor of 46116? True Is 4186 a multiple of 56? False Does 3 divide 787? False Does 32 divide 1091? False Is 7 a factor of 5033? True Is 13 a factor of 4023? False Is 5642 a multiple of 7? True Is 21392 a multiple of 128? False Is 108 a multiple of 27? True Does 30 divide 36210? True Is 41228 a multiple of 22? True Is 7 a factor of 10745? True Does 65 divide 4875? True Is 25754 a multiple of 145? False Does 28 divide 784? True Does 81 divide 2094? False Is 40 a factor of 18610? False Is 675 a multiple of 45? True Does 2 divide 232? True Is 882 a multiple of 20? False Does 42 divide 9408? True Is 6 a factor of 3830? False Does 72 divide 26998? False Is 132 a factor of 184852? False Does 33 divide 2697? False Does 19 divide 503? False Is 2052 a multiple of 12? True Is 9 a factor of 71901? True Is 300 a multiple of 10? True Does 7 divide 55? False Is 13572 a multiple of 58? True Is 41 a factor of 3521? False Does 7 divide 26685? False Is 16 a factor of 848? True Is 8 a factor of 344? True Does 27 divide 8136? False Is 4 a factor of 192? True Is 9841 a multiple of 13? True Does 10 divide 130? True Does 28 divide 23968? True Is 10 a factor of 950? True Is 52 a factor of 1196? True Is 3866 a multiple of 39? False Does 5 divide 2353? False Is 13 a factor of 5613? False Does 32 divide 896? True Does 28 divide 86? False Is 8 a factor of 1920? True Is 614 a multiple of 97? False Does 2 divide 1763? False Is 97 a factor of 1453? False Is 10035 a multiple of 12? False Does 13 divide 802? False Is 98 a factor of 6064? False Is 1019 a multiple of 59? False Is 1560 a multiple of 39? True Is 15 a factor of 47610? True Is 807 a multiple of 5? False Is 102 a multiple of 17? True Is 12 a factor of 900? True Is 7 a factor of 13181? True Is 16 a factor of 192? True Is 1956 a multiple of 22? False Is 2820 a multiple of 30? True Is 5558 a multiple of 122? False Is 14 a factor of 425? False Is 78 a factor of 3146? False Does 12 divide 504? True Does 10 divide 4389? False Does 172 divide 15366? False Does 44 divide 660? True Does 19 divide 18636? False Is 4261 a multiple of 25? False Is 748 a multiple of 4? True Is 5280 a multiple of 33? True Is 64 a factor of 15296? True Is 18 a factor of 51840? True Is 50 a factor of 300? True Does 278 divide 79786? True Does 24 divide 14772? False Does 10 divide 4300? True Does 22 divide 35288? True Does 39 divide 20085? True Does 5 divide 340? True Is 57018 a multiple of 34? True Is 4030 a multiple of 130? True Is 390 a multiple of 10? True Is 6 a factor of 1425? False Does 10 divide 30? True Is 26 a factor of 1165? False Does 241 divide 51654? False Is 1166 a multiple of 15? False Does 69 divide 69? True Does 21 divide 11046? True Is 189 a multiple of 21? True Is 40 a factor of 13040? True Is 42 a factor of 1092? True Is 4 a factor of 608? True Does 28 divide 1176? True Does 15 divide 1605? True Does 23 divide 23690? True Is 26 a factor of 681? False Is 5960 a multiple of 10? True Does 5 divide 3000? True Is 210 a factor of 12661? False Does 47 divide 188? True Does 46 divide 12696? True Is 10353 a multiple of 9? False Is 337 a multiple of 21? False Is 650 a multiple of 39? False Is 1684 a multiple of 14? False Is 3585 a multiple of 78? False Does 8 divide 12658? False Is 22 a factor of 21978? True Does 67 divide 536? True Does 50 divide 32099? False Is 248 a multiple of 4? True Does 9 divide 115? False Is 10 a factor of 4910? True Is 7 a factor of 240? False Is 14 a factor of 238? True Is 46 a factor of 53826? False Is 9 a factor of 580? False Does 187 divide 445? False Is 17 a factor of 1190? True Does 12 divide 6646? False Is 4 a factor of 123? False Is 4664 a multiple of 212? True Does 32 divide 1836? False Is 15358 a multiple of 14? True Does 6 divide 13482? True Is 21 a factor of 19399? False Is 55796 a multiple of 116? True Is 12 a factor of 21732? True Is 21284 a multiple of 61? False Is 11 a factor of 627? True Is 205 a factor of 119573? False Does 47 divide 4653? True Is 111 a factor of 5618? False Does 117 divide 1214? False Does 26 divide 182? True Does 28 divide 2744? True Does 58 divide 42224? True Is 740 a multiple of 74? True Is 7 a factor of 371? True Is 89238 a multiple of 278? True Is 8 a factor of 15880? True Is 1631 even? False Is 4784 a multiple of 46? True Does 4 divide 360? True Is 9903 a multiple of 19? False Is 12474 a multiple of 54? True Is 2 a factor of 126? True Is 11 a factor of 660? True Is 27 a factor of 1053? True Is 1707 a multiple of 17? False Is 12 a factor of 6102? False Is 28 a factor of 149? False Does 4 divide 1761? False Is 15 a factor of 10506? False Is 9936 a multiple of 18? True Is 163 a factor of 16227? False Is 24 a factor of 2796? False Does 31 divide 1271? True Is 372 a multiple of 4? True Is 14 a factor of 168? True Is 28 a factor of 831? False Is 17876 a multiple of 82? True Is 364 a multiple of 14? True Is 12 a factor of 13023? False Does 33 divide 6673? False Is 1491 a multiple of 79? False Is 22 a factor of 7480? True Is 16 a factor of 15536? True Is 9725 a multiple of 52? False Does 12 divide 766? False Does 34 divide 8976? True Is 42 a factor of 13524? True Is 36 a factor of 184? False Is 3564 a multiple of 12? True Does 3 divide 39? True Does 19 divide 1893? False Is 2196 a multiple of 4? True Is 206 a multiple of 5? False Is 381 a multiple of 5? False Does 28 divide 196? True Is 18328 a multiple of 76? False Does 14 divide 4452? True Does 142 divide 60492? True Is 1386 a multiple of 24? False Is 13610 a multiple of 10? True Is 6627 a multiple of 9? False Is 1122 a multiple of 50? False Does 7 divide 658? True Is 882 a multiple of 49? True Is 11 a factor of 6974? True Is 3 a factor of 351? True Does 8 divide 216? True Is 12 a factor of 792? True Is 37 a factor of 362? False Is 87 a factor of 3706? False Is 10993 a multiple of 262? False Is 45 a factor of 135? True Does 49 divide 9527? False Is 8 a factor of 321? False Is 10 a factor of 240? True Is 64781 a multiple of 86? False Is 29 a factor of 3045? True Is 125 a multiple of 25? True Does 7 divide 3810? False Is 6 a factor of 1836? True Does 47 divide 49632? True Is 1116 a multiple of 124? True Is 22 a factor of 2478? False Is 17 a factor of 551? False Does 19 divide 4997? True Is 360 even? True Does 23 divide 4301? True Does 6 divide 1662? True Is 480 a multiple of 2? True Does 27 divide 3011? False Is 14265 a multiple of 15? True Is 44668 a multiple of 26? True Is 7108 a multiple of 26? False Does 9 divide 63? True Does 3 divide 216? True Is 838 a multiple of 2? True Is 19 a factor of 3249? True Is 143 a factor of 35300? False Is 1867 a multiple of 23? False Is 53 a factor of 20764? False Is 88 a factor of 16728? False Is 5858 a multiple of 58? True Does 27 divide 2187? True Is 1254 even? True Is 13 a factor of 11377? False Is 1081 a multiple of 47? True Does 63 divide 15777? False Is 21 a factor of 833? False Is 4911 a multiple of 7? False Is 5202 a multiple of 63? False Is 115 a factor of 2657? False Does 20 divide 520? True Is 8579 a multiple of 46? False Is 744 a multiple of 31? True Is 906 a multiple of 13? False Does 82 divide 5033? False Does 43 divide 578? False Does 49 divide 32144? True Is 3 a factor of 15? True Is 169 a multiple of 19? False Does 11 divide 9240? True Does 49 divide 616? False Does 64 divide 2816? True Does 88 divide 1320? True Is 706 a multiple of 13? False Does 21 divide 116660? False Does 15 divide 315? True Is 152 a factor of 20747? False Does 40 divide 22280? True Is 252 a multiple of 36? True Is 135 a factor of 10800? True Is 13 a factor of 73? False Is 328 a multiple of 22? False Is 117 a factor of 2106? True Is 128 a factor of 41561? False Does 41 divide 3526? True Is 840 a multiple of 30? True Does 60 divide 1920? True Is 16888 a multiple of 15? False Does 10 divide 1400? True Is 3 a factor of 14956? False Is 124 a factor of 6324? True Is 13418 a multiple of 92? False Is 8844 a multiple of 11? True Is 618 a multiple of 46? False Does 56 divid	{ "pile_set_name": "DM Mathematics" }
-1/2 Sort 27, 3, 17, 0. 0, 3, 17, 27 Put -46, -34, 0 in increasing order. -46, -34, 0 Put 0.01, 3/19, 1 in descending order. 1, 3/19, 0.01 Sort -17, -5, -7 in ascending order. -17, -7, -5 Put 53, 3, 4, -1, -6 in decreasing order. 53, 4, 3, -1, -6 Sort -95, -1, 3 in ascending order. -95, -1, 3 Put 0, 133, -4 in ascending order. -4, 0, 133 Sort -5, -1, 5, 2, -7 in decreasing order. 5, 2, -1, -5, -7 Sort 3, 4, -5, 8, -2 in decreasing order. 8, 4, 3, -2, -5 Sort 2, 67, 19 in descending order. 67, 19, 2 Put 1, 0, 3, 372 in increasing order. 0, 1, 3, 372 Sort 2, -6639, 5 in descending order. 5, 2, -6639 Put 4, 3/8, -0.07, 2 in descending order. 4, 2, 3/8, -0.07 Sort 73, -4/3, 5. -4/3, 5, 73 Put -3, -2, 1885 in descending order. 1885, -2, -3 Sort -4, 11/3, 0.6, 0.1 in decreasing order. 11/3, 0.6, 0.1, -4 Put 5, -17, -1, -29 in decreasing order. 5, -1, -17, -29 Sort -4, -0.14, 4/9, 37 in descending order. 37, 4/9, -0.14, -4 Put -0.08, -4, 3/7 in descending order. 3/7, -0.08, -4 Put -10, 0, 15 in decreasing order. 15, 0, -10 Put 68, -0.3, 0.2, -7 in ascending order. -7, -0.3, 0.2, 68 Sort 8.3, -0.3, -2, 0.5 in ascending order. -2, -0.3, 0.5, 8.3 Sort 59/6, 1, -2/7 in descending order. 59/6, 1, -2/7 Sort 5/6, 27, -5, -3/2, -0.5 in decreasing order. 27, 5/6, -0.5, -3/2, -5 Sort -71, 3, 4 in descending order. 4, 3, -71 Sort 2, -0.07504, -2/5. -2/5, -0.07504, 2 Sort 3, 131/4, 0.1. 0.1, 3, 131/4 Sort -5, -4, 4, 0, 1 in ascending order. -5, -4, 0, 1, 4 Sort 3, -6, 4, 6 in increasing order. -6, 3, 4, 6 Sort 1, 1/7, -1, 43/4, -13/4 in decreasing order. 43/4, 1, 1/7, -1, -13/4 Put -1, -13, 4 in decreasing order. 4, -1, -13 Sort -1, -5, -4, 3941 in decreasing order. 3941, -1, -4, -5 Sort -3, 2, 113, -2 in decreasing order. 113, 2, -2, -3 Sort -2, 2, 856. -2, 2, 856 Sort -3, 0, 4, 3, -2. -3, -2, 0, 3, 4 Sort -0.5, -2, -838/13, 0 in decreasing order. 0, -0.5, -2, -838/13 Sort 5, 0, 4, 81 in increasing order. 0, 4, 5, 81 Put -19, -289, -1 in descending order. -1, -19, -289 Sort -2/11, 1/8, 2014 in increasing order. -2/11, 1/8, 2014 Put 3/8, 543, -2/11 in descending order. 543, 3/8, -2/11 Sort -5, -2, -1115, 0 in descending order. 0, -2, -5, -1115 Put 2, -5, -124, -2/13 in decreasing order. 2, -2/13, -5, -124 Sort -23, 0, -2 in descending order. 0, -2, -23 Put -8/9, -0.3, 2/3, -1/3 in decreasing order. 2/3, -0.3, -1/3, -8/9 Put -3, 72, 5 in ascending order. -3, 5, 72 Sort 5, 0, -1. -1, 0, 5 Put 15, 14, -1 in ascending order. -1, 14, 15 Sort 47/33, 0.5, 5 in increasing order. 0.5, 47/33, 5 Sort -21, -3, -4 in decreasing order. -3, -4, -21 Put -6, -25, -5 in increasing order. -25, -6, -5 Put 5, 1, 13, -4 in decreasing order. 13, 5, 1, -4 Sort 1.9, -5, -0.1, 2/5 in descending order. 1.9, 2/5, -0.1, -5 Put -1/9, -0.5, 0.24 in decreasing order. 0.24, -1/9, -0.5 Sort 2, -10, 0, -5, -2 in decreasing order. 2, 0, -2, -5, -10 Sort -4, 1, -16. -16, -4, 1 Sort 8, 5, 4. 4, 5, 8 Sort -1, -2, -14, 7, -4 in decreasing order. 7, -1, -2, -4, -14 Sort 0, -1, 7, 1, -23 in decreasing order. 7, 1, 0, -1, -23 Put -4, -11, 4, -1 in ascending order. -11, -4, -1, 4 Sort -18, 4, 9 in increasing order. -18, 4, 9 Sort -0.2, -8/5, -4 in ascending order. -4, -8/5, -0.2 Put -3/14, -2, -19 in increasing order. -19, -2, -3/14 Put -4, 1, -24, -2, -1 in decreasing order. 1, -1, -2, -4, -24 Sort 9, -4, 100 in descending order. 100, 9, -4 Sort 5, 17, 1, 2 in descending order. 17, 5, 2, 1 Put 17, 1, 7, -1, 5 in descending order. 17, 7, 5, 1, -1 Sort -1, -3, -4, 5 in decreasing order. 5, -1, -3, -4 Sort 5, 30, -1, -3, -5 in decreasing order. 30, 5, -1, -3, -5 Sort 0.5, 0.2, 2, -0.05. -0.05, 0.2, 0.5, 2 Put 5, -29, 4, -4 in descending order. 5, 4, -4, -29 Put -0.5, 3/2, 3/5, -5 in descending order. 3/2, 3/5, -0.5, -5 Put 2, 4, -1, 5, 0.029 in ascending order. -1, 0.029, 2, 4, 5 Sort -2.8, -2/7, -0.1. -2.8, -2/7, -0.1 Sort 3, 0, 39, -5, -1. -5, -1, 0, 3, 39 Sort -5, -1/15, -0.7. -5, -0.7, -1/15 Put 1, 0, -0.4, -270, -2/13 in ascending order. -270, -0.4, -2/13, 0, 1 Put 4, 2, -80, -4 in increasing order. -80, -4, 2, 4 Sort -0.4, 1/3, 5, -3, -932. -932, -3, -0.4, 1/3, 5 Put -4, -1/12, 0.5, -2/7 in descending order. 0.5, -1/12, -2/7, -4 Sort -4, 7/9, -1. -4, -1, 7/9 Sort -4, -97, -1, -2, 4 in decreasing order. 4, -1, -2, -4, -97 Sort 17/4, -2/15, -4/5, -1/3 in decreasing order. 17/4, -2/15, -1/3, -4/5 Sort 13, -3, 49. -3, 13, 49 Sort 0.4, 2, 1/8, -11/4 in decreasing order. 2, 0.4, 1/8, -11/4 Put 1, -1, -3, -30 in descending order. 1, -1, -3, -30 Sort 2/9, -21, -2, 14 in increasing order. -21, -2, 2/9, 14 Sort -10, -2, 1, -7 in ascending order. -10, -7, -2, 1 Put 3, -2, -4, 4, -10/7 in descending order. 4, 3, -10/7, -2, -4 Sort 3, -1, -3 in decreasing order. 3, -1, -3 Sort 4, -7, -1, 6, -5. -7, -5, -1, 4, 6 Sort 2, 9, 3, 64 in ascending order. 2, 3, 9, 64 Sort 10, 3, 5, 11 in increasing order. 3, 5, 10, 11 Sort 0.1, 2, 2055 in decreasing order. 2055, 2, 0.1 Sort 0.3, -2, 14, 0 in decreasing order. 14, 0.3, 0, -2 Put -3, 2, -6, 4, 5 in ascending order. -6, -3, 2, 4, 5 Sort 26/7, 1, -5, 2/5, -2/7. -5, -2/7, 2/5, 1, 26/7 Put 6/11, 0.1, -4 in ascending order. -4, 0.1, 6/11 Sort 1/3, 10, -1.8. -1.8, 1/3, 10 Put -2, 27, -8, 3 in descending order. 27, 3, -2, -8 Put -3, -13/37, 0.5, 0.2 in descending order. 0.5, 0.2, -13/37, -3 Sort -14, 4, 12 in ascending order. -14, 4, 12 Sort -216, -0.2, -2/9, 4 in descending order. 4, -0.2, -2/9, -216 Put -4/3, 6/67, -22 in increasing order. -22, -4/3, 6/67 Put 5, -1, -0.3, -25 in ascending order. -25, -1, -0.3, 5 Sort 0.073, 5/7, -1/2 in decreasing order. 5/7, 0.073, -1/2 Put 2, 9, -0.06, -4, 5 in descending order. 9, 5, 2, -0.06, -4 Put -15, 18, 0.1, 4/5 in descending order. 18, 4/5, 0.1, -15 Put 146, -2, -0.4 in decreasing order. 146, -0.4, -2 Put 0.05, -0.52, 4 in decreasing order. 4, 0.05, -0.52 Put -5, -11, 6 in decreasing order. 6, -5, -11 Put -79, -3, 1 in increasing order. -79, -3, 1 Sort -2/15, 0, 1, -3/5. -3/5, -2/15, 0, 1 Sort -2/7, 44, -42 in decreasing order. 44, -2/7, -42 Sort -2, -3, 1, 1509, 4 in increasing order. -3, -2, 1, 4, 1509 Put -5, 0.1, 4289 in ascending order. -5, 0.1, 4289 Put -2/15, 4, 1/4, 20.4 in descending order. 20.4, 4, 1/4, -2/15 Sort 0.4, -0.06, 5, -0.5. -0.5, -0.06, 0.4, 5 Sort 8, -0.061, 1/9 in decreasing order. 8, 1/9, -0.061 Sort 3, -1, 4, -5, 15 in decreasing order. 15, 4, 3, -1, -5 Put -1/7, 0.05, 0.08 in decreasing order. 0.08, 0.05, -1/7 Sort 10.8, -3, 4, 0.3 in increasing order. -3, 0.3, 4, 10.8 Sort 25, -9, 2 in increasing order. -9, 2, 25 Put 2, -1, 20 in descending order. 20, 2, -1 Sort -5/4, 0.2, -0.5, 29/10. -5/4, -0.5, 0.2, 29/10 Sort 0, 4, 5, 3. 0, 3, 4, 5 Sort -6, -0.1, 0.05, 3, 21 in increasing order. -6, -0.1, 0.05, 3, 21 Sort 2/3, 3, -2, 5, 85. -2, 2/3, 3, 5, 85 Sort 0.05, -1/5, -3/2, 2, 0.1 in increasing order. -3/2, -1/5, 0.05, 0.1, 2 Sort 0, -0.1, 2, -3/4 in ascending order. -3/4, -0.1, 0, 2 Sort -4, 2, 5, 2/9, -168 in increasing order. -168, -4, 2/9, 2, 5 Sort -4, -24, -2, -8. -24, -8, -4, -2 Sort 3, 0.08, 13/3. 0.08, 3, 13/3 Sort 5/4, -0.5, 4/5, 0.07 in decreasing order. 5/4, 4/5, 0.07, -0.5 Put 2, -1/4, -241 in descending order. 2, -1/4, -241 Put -173, -3, -4 in increasing order. -173, -4, -3 Sort 12, -14, -5, 4, 2 in decreasing order. 12, 4, 2, -5, -14 Sort 2, -3, 23, -4 in increasing order. -4, -3, 2, 23 Sort 0.22, 0.4, 1/2, 1 in increasing order. 0.22, 0.4, 1/2, 1 Sort 0, 717, 2 in decreasing order. 717, 2, 0 Sort 0, 2, -4, 65, 3 in increasing order. -4, 0, 2, 3, 65 Put 0.06, -3/8, 3/5 in descending order. 3/5, 0.06, -3/8 Sort -6, -1, -5, 30 in decreasing order. 30, -1, -5, -6 Put -2, -105, 2 in decreasing order. 2, -2, -105 Put 1/3, 4/9, -16, 5 in ascending order. -16, 1/3, 4/9, 5 Put 91, -2, -3 in ascending order. -3, -2, 91 Put 0.14, 2/7, -2/5, 0.2 in descending order. 2/7, 0.2, 0.14, -2/5 Sort -4, -69, 4, -2 in ascending order. -69, -4, -2, 4 Put 18, 2, 11, -3 in decreasing order. 18, 11, 2, -3 Put 0.4, 19, 2, -3 in decreasing order. 19, 2, 0.4, -3 Put -4, 2/5, 4, -4/5 in descending order. 4, 2/5, -4/5, -4 Sort -1/2, -52, -9 in decreasing order. -1/2, -9, -52 Put 3, 1, 50, -3, -1 in descending order. 50, 3, 1, -1, -3 Sort -9, 1, 70, 2 in increasing order. -9, 1, 2, 70 Sort -4, -5, -159, 0, -3. -159, -5, -4,	{ "pile_set_name": "DM Mathematics" }
0. Suppose -5b + 141 = k, b - 32 = -k - mk. What is the greatest common factor of b and 70? 14 Let d be -23((-206)/12 + 25/150). Calculate the highest common divisor of d and 23. 23 Let w(s) = 3s - 14. Let k be w(6). Let n be 134 - (k + (3 - 8)). Calculate the highest common divisor of 27 and n. 27 Suppose -2s - l + 144 = 0, -5l = -s + 44 + 6. What is the greatest common factor of 28 and s? 14 Let a(v) = 2v3 - 9v - 3v3 + 32v*2 - 42v*2 + 15. Let g be a(-9). What is the highest common divisor of 105 and g? 15 Let y(p) = 4p*2 + 2p - 1. Let m be y(1). Suppose -mj + 400 = -j + 4a, 4j - 2a = 430. What is the highest common factor of 42 and j? 21 Suppose -4x = -85 - 23. Suppose r - 2 = 7m - 9m, -r = -3m + 13. Calculate the highest common factor of x and m. 3 Let w(f) = -f3 - f + 4. Let o be w(0). Let j(z) = -z2 + 4z - 1. Let i be j(o). Let d be (-158)/(-10) - i/5. Calculate the highest common factor of d and 4. 4 Let a = 147 - 136. Let s be (-5)/(-3)(31 + 2). Calculate the highest common divisor of s and a. 11 Suppose -m - 32 = -4o, 3o - 1 = -m - 4m. Suppose 68 = 2j - 2. Calculate the greatest common divisor of j and o. 7 Suppose 0 = -2a - 10, 3n + 5a - 4a = 100. What is the greatest common factor of 245 and n? 35 Let q be 24/10 - ((-168)/30 - -6). Let u be (q - (-14)/(-4))/((-15)/50). What is the highest common divisor of u and 5? 5 Let x = -4045 + 6818. Calculate the greatest common divisor of 47 and x. 47 Suppose 2l - 5j = 20, 3l - 3j = -2j + 4. Suppose w + 5 = 2c, -2c + l = 5w + 1. Calculate the highest common factor of c and 1. 1 Suppose 62 - 287 = -15k. What is the greatest common divisor of k and 195? 15 Suppose 0 = -k + 153 + 17. Calculate the greatest common divisor of k and 34. 34 Suppose -5k + 13 = -7. Suppose 2r - 32 = -k. Suppose -2m = 2j - 50, 0m + m = -2j + 46. What is the highest common factor of j and r? 7 Suppose 5k + 0r = -3r + 3, 4r - 4 = 0. Suppose 2y - 68 + 48 = k. Calculate the greatest common factor of y and 25. 5 Suppose 4x = -5n + 207, -5x + 6 = -3x. Let o(l) = 75l2 + 1796l - 83. Let p be o(-24). Calculate the greatest common factor of n and p. 13 Suppose -150 = -6i + i. Let j = i - 22. Let m be 0 + -1 + (-42)/(-2). Calculate the highest common divisor of m and j. 4 Let b = -5 + 68. Let n be -1(19/7 - 2/(-7)). Let a be (-62)/n + (-3)/(-9). What is the highest common divisor of b and a? 21 Suppose d - 3d - 5t = -2088, 2d = 5t + 2108. Let z = d - 709. Calculate the greatest common factor of 20 and z. 20 Suppose 2d = 5m - 3m + 26, 3d + 4m = 39. Suppose 11k - dk - 6 = 0. Let b(n) = -20n - 5. Let i be b(k). Calculate the highest common factor of i and 11. 11 Suppose 200 = -2s + 6s. What is the greatest common divisor of 250 and s? 50 Suppose 2y = 5 - 1. Suppose 2u - y = k, -k + 4u + 1 = 7. What is the greatest common factor of 22 and k? 2 Let r = 201 - 81. What is the highest common factor of r and 15? 15 Let z = -45 + 99. Let o = z - 30. Suppose 9 = 4b - 3. What is the highest common divisor of o and b? 3 Suppose 3j + 2 = 8. Let g be 3 - 0(-1 + j). Suppose a + 33 - 148 = l, l + g = 0. Calculate the greatest common factor of a and 28. 28 Suppose 10 = 5m, 2m = i - 3m - 179. What is the highest common divisor of i and 27? 27 Let g = -156 + 165. Let n = 31 + -4. Calculate the highest common factor of n and g. 9 Suppose -26r - 4r + 3600 = 0. What is the highest common divisor of r and 780? 60 Let c = -16 + 37. Let s = -419 - -433. Calculate the highest common divisor of c and s. 7 Suppose 0 = 2l - 13 - 23. Let m(f) = -f*2 - 11f + 2. Let j be m(-11). Suppose -jg - g + 162 = 0. What is the greatest common factor of g and l? 18 Let r = 3 - -19. Let p(a) = -2a*3 - 95a*2 - 44a + 143. Let y be p(-47). Calculate the highest common divisor of y and r. 2 Suppose 0 = -6y + 24 - 0. What is the greatest common factor of y and 44? 4 Let g be -11 + 3 - (0 + -14). What is the highest common divisor of 162 and g? 6 Let z(v) = -32v - 144. Let a(b) = -11b - 48. Let p(n) = -17a(n) + 6z(n). Let l be p(-11). Calculate the highest common divisor of l and 63. 7 Let j be 1/((-3 + 1)/(-8)). Let a = 1 + j. Let p(b) = -3b*3 - 7b*2 - 4b - 5. Let y be p(-3). Calculate the greatest common factor of y and a. 5 Suppose w + 0q - 2q - 2 = 0, -14 = 5w + 2q. Let c be -2w/2 - -7. What is the greatest common divisor of 3 and c? 3 Suppose -29m + 15m = -56. Calculate the highest common factor of 244 and m. 4 Let x be 8/(-10) - (-114)/30. Let k(v) = v2 - 2. Let h be k(2). Suppose -2j + hf + 2f = 14, -f = xj - 7. What is the highest common factor of 5 and j? 1 Suppose -16 = 2n - 5a, -2a - a + 14 = n. Suppose 0 = -0k - nk + 2. Suppose g + 44g = 225. Calculate the greatest common divisor of g and k. 1 Let k = -320 - -527. What is the highest common divisor of 9 and k? 9 Let g(w) = -4w + 1. Let c = 7 + -8. Let u be g(c). Suppose 3d + 23 - 8 = 0, uv - d - 55 = 0. Calculate the highest common divisor of v and 40. 10 Let x(l) = -14l + 16. Let d be x(-20). What is the highest common divisor of d and 8? 8 Let q(u) = -u + 2. Let k be q(0). Let n be -3 + 0 + k + 27. Let d = n - 13. What is the greatest common factor of 13 and d? 13 Let o be (-4)/(-10) - 1664/(-40). Suppose -3s - o = -s. Let q = s + 27. What is the greatest common factor of q and 30? 6 Suppose 9y - 35 = 1. Suppose -28c + 720 = -yc. Suppose 4m - 24 = -3b, 2 + 1 = -m. What is the greatest common factor of b and c? 6 Let m be -5 + 1 + -2 + 26. Let r be ((-16)/m)/((-4)/90). Calculate the highest common factor of 18 and r. 18 Suppose 62 = 3r + 5v, 35v = 2r + 38v - 40. What is the highest common divisor of r and 672? 14 Let g = 208 + -194. What is the highest common divisor of g and 350? 14 Suppose 3204 = -60k + 62k - 4x, 0 = -5k - 2x + 8046. What is the highest common factor of 24 and k? 24 Let q be (-1380)/135 - -14 - 2/(-9). Let x(n) = n3 - 7n*2 + 8n - 2. Let l be x(6). What is the highest common factor of l and q? 2 Let r = -3 + -1. Let f = -39 - r. Let q = 7 - f. What is the highest common divisor of q and 6? 6 Let r(f) = -f*2 - f + 2. Let n(p) = -5 - 12 - p + 17 - 15. Let w be n(-15). Let q be r(w). What is the highest common divisor of q and 6? 2 Let y = -1629 - -1644. Suppose 420 = 4l + 2m - 5m, 4m - 105 = -l. Calculate the highest common divisor of y and l. 15 Let d(n) = 4n + 111. Let u be d(-22). What is the greatest common divisor of 253 and u? 23 Let x be (2 - 1)/(6/15181). Calculate the highest common divisor of x and 23. 23 Let c be (-6)/(-1) - (-18 - 20). Let g be -12 + 2 + 1 + 3. Let f be ((-4)/(-6))/(g/(-99)). What is the greatest common factor of f and c? 11 Let t(n) = 32n - 88. Let u be t(7). Calculate the greatest common factor of u and 34. 34 Suppose -2f + 57 - 9 = 0. Let i = 40 - f. Let a = -2014 - -2018. What is the highest common divisor of a and i? 4 Let p = 246 - 230. Calculate the highest common divisor of 1744 and p. 16 Let g(u) = -67u*2 - 3u + 2. Let f be g(1). Let o be 5/(-15) + f/(-6). Let v = 61 + o. Calculate the highest common divisor of v and 12. 12 Let a = 801 - 502. What is the greatest common factor of a and 69? 23 Let n(x) = -x*3 + 8x*2 - 34x - 202. Let y be n(-5). Calculate the greatest common divisor of 1 and y. 1 Suppose 0 = 57m - 48m - 216. What is the highest common factor of 64 and m? 8 Suppose 117 - 9 = 12l. Calculate the greatest common factor of l and 171. 9 Suppose -3s - 57 = -282. Let k = s - 52. What is the highest common factor of k and 184? 23 Suppose 0 = -p + 6p - 95. Suppose -267 = 3n + 3x, -5n - 87 = -5x + 348. Let m be 9/(-6)(2 - n/(-6)). What is the greatest common factor of m and p? 19 Suppose 0 = -6k + k + 4w + 8, -5k + 5w + 5 = 0. Let c = 7 - k. Suppose -32 = -cr + v, 2v = -0r + 2r - 24. What is the highest common factor of 40 and r? 10 Let o be 4/(12/21)1. Let c = o - 5. Suppose 4j + 5n - 45 = 0, -4j + 15 = -cj + n. What is the greatest common factor of 25 and j? 5 Suppose -1 = 2x - 5. Let z(v) = -v*3 + 8v*2 + v - 11. Let c be z(8). Let i be x + -5(c + 1). What is the greatest common divisor of i and 6? 6 Let w be (-1729)/(-8) - (-80)/(-640). Let q = 11 - -16	{ "pile_set_name": "DM Mathematics" }
(4z*3 - 5z*3 + 2z*3) + 3z - z*3 - 3z + z2 + z3 - z*2 + 0z*3 - 2z*3 - 4z*3. -4z*3 Expand (-3w*2 + 2w*2 + 0w*2)(2 - w*3 - 2)(0 + 3 - 4). -w*5 Expand 2z - 3z - z + (4z + z + 0z)(-6 + 1 + 3). -12z Expand -3r - 2r3 + 3r - 1 + 1 + 2r3 + (0 - 2r + 0)(r2 - 2r*2 + 0r*2) + (0r*2 + 2r2 - r2)(15 - 15 + 6r). 8r3 Expand 5i*2 - 5i2 - i2 + (i + 1 - 1)(4 - 4 - 2i) - 3i2 + 7i*2 + 3i - i. i*2 + 2i Expand (-2m3 + 0m*3 + 4m*3 + (-6m*2 + 2m*2 + 2m*2)(0 - m + 0))(-1 - 2 + 1). -8m*3 Expand (-14b - 7b - 6b)(2b - b + b) + (4 + 2b - 4)(-b + b - 2b) + 3b - 3b + b2 + 2b - 2b + 2b*2 - 2b2 + b2 - b*2. -57b*2 Expand (m + 2m - 2m)(37 + 37 - 69). 5m Expand (-7 + 110j*2 + 7)(0j2 - 4j*2 + 3j*2 + (4j*2 + 0j*2 - 2j*2)(0 + 1 - 3)). -550j4 Expand ((0q + 2q - 3q)(5 + 0 - 4) - q + 3q + 0q)(q*3 + 7q*3 + 0q*3). 8q*4 Expand (c + 0 + 0)(3 - 1 + 0)(-c + 6c - 3c + (1 + 2c - 1)(2 - 4 + 0) - 3c - 4c + 6c). -6c2 Expand ((-w - 2w + 4w)(1 + 2 - 5) + 2w - 5w + w - w - 3w + 3w)(4w*4 - 6w*4 + 17w*4). -75w*5 Expand (-2n*3 + 4n*3 + 0n*3)(6 - 2 + 9)(-6n + n + 3n + (2n + 0 + 0)(4 - 4 - 1) - 1 + 1 - n). -130n4 Expand (z3 + 4z3 - 3z*3)(-z - 1 + 1) - 5z4 + z4 - z4 - z2 - 2z4 + z2 + 4z4 + 0z4 - z4. -6z4 Expand 2t*3 - 7t*3 + 3t*3 - 2t*3 - 2t*3 + 2t3 + (1 - t3 - 1)(2 + 0 + 0). -6t*3 Expand (-4 - 4 + 6)(29z - 5z*3 - 29z) + z + 2z3 - z. 12z*3 Expand (-3i + 2i - i + (4 - 5 + 3)(i - 7i + 4i))(1175 - 1175 - 63i*2) - 2i*3 + 5i*3 - 2i*3 + (0i2 - i2 + 3i2)(-i - i + 3i). 381i*3 Expand n - n + 2n*2 + (2n + n - 5n)(-3 - 2n + 3) + 0n*2 + 0n*2 - 3n*2 + (-4n - n + 3n)(-n + 2n - 3n). 7n2 Expand (4q - 12q + 7q + (4 - 1 - 2)(-3q + 3q + 2q))(-2 + 1 + 2). q Expand (45 - 32 - 120 - 82)(s + 0s + s). -378s Expand (6 - 6 - v*3)(-v - 2v - v). 4v*4 Expand (3p - 4p + 4p)(-5p*2 + 5p2 + p3)(7 - 7 - 5p). -15p5 Expand (2 + 2 - 3)(0a4 - a4 + 0a*4) + 0a4 + a4 + a*4 + (33a + 4 - 34a + 25)(4a3 - 2a*3 - 4a*3). 3a*4 - 58a*3 Expand (0d - d - d)(3 + 3 - 4)((5 - 3 - 3)(-3d + 2d2 + 3d) - d*2 - 4d2 + d2). 24d3 Expand (0o*3 + 3o*3 - 12o*3 + (-2o*2 + 2o2 + o3)(3 + 2 - 3))(-2o - 2o + 2o). 14o*4 Expand (-3 + 2 + 4)(3j + 3j - 4j)(j - 3j + j + (-2j + j + 2j)(1 - 6 + 4)). -12j2 Expand (1 + 2 - 2)(5n - 4n + 0n)(5 - 2n3 - 5). -2n*4 Expand ((0d - d*2 + 0d)(-d2 + 6d*2 - 3d*2) + 105d*2 - 105d*2 + 10d*4)(0d + 3d - d). 16d5 Expand (4q - q*2 + 0q*2 - 3q)(q2 - 27q + 27q). -q4 + q3 Expand (-2 + 2 + 2o)(0o + 0o + 2o) - 8o2 + 2o*2 + 28o*2. 26o*2 Expand (-5d + 0d + 3d)(6 - 18 - 22). 68d Expand (18 - 18 - 13)(-3v*2 + 5v*2 - 4v*2)(-3v + 3v - 2v2). -52v*4 Expand (0l*2 + 0l*2 - 4l*2)(-2l - l + 4l) + 0l3 - l3 - 2l*3. -7l*3 Expand (-3r + 5r - 4r + (0 - r + 0)(-3 - 2 - 1))(4 - 4 + 2)(2r*2 - 2r*2 - 3r*4). -24r*5 Expand (-1 + w + 0 + 0w)(-7 + 2w + 7). 2w2 - 2w Expand (4r - 2r - 4r + (1 - 1 - r)(-9 + 3 - 8))(-6 + 3 + 12)(-1 + 2 + 0). 108r Expand -14b + 26b - 9b + (-4b - 3b + 5b)(1 - 2 - 1) + (3 + 4 - 6)(0b - b - b). 5b Expand (-2 - 2 + 5)(2b + 4 - b - 1). b + 3 Expand (n2 - n4 - 4n*4 + 6n*4)(2n - 4n + 4n). 2n*5 + 2n*3 Expand (5x*4 - 2x4 - x4)(-4x + 4x + x) + 6x*5 - 9x*5 + 7x*5. 6x*5 Expand (2x + 4 - 6 + 4)(32x - 32x - 3x*2). -6x*3 - 6x*2 Expand (-3 + 0 + 1)(4i - 4i + i) + i + 0 + 0 + 4i + 0i - 2i - i - i + 0i + 2i - 1 + 1 + (i - 2i + 0i)(4 - 3 - 3). 3i Expand -5f*2 - 3f*2 + 6f*2 - 3f*3 + (-f - 2f*2 + f)(1 + 3f - 1). -9f*3 - 2f*2 Expand (-6h*4 + 5h*4 + 0h*4)(2 + 5h - 2h - 4h) + 11h*5 + 24h*2 - 24h*2. 12h*5 - 2h*4 Expand (-6q + 3q + 5q)(3q - 3q - 2q) + 3q2 - 2q2 + q2 - 10q - 6q*2 + 10q. -8q2 Expand (2u*2 - 4u2 - u2)(4u - u + 0u)(-3 + 0 + 1). 18u3 Expand -3 + 3 + 2a*3 + (-4a + 4a - a)(5a2 - 10a + 10a) - 3a*3 + 3a3 + a3. -2a3 Expand (-1 + 1 + p)(4 - 5 + 0) + (-1 + 3 - 1)(0p - 4p + 2p) - 2p + 2p + p. -2p Expand 2f*2 + 2 - 2 + (0f - 5f + 3f)(4f - 21f - 6f). 48f2 Expand (4 - 4 + 2j*2)(-6j2 + 3j*2 - 1 + 2). -6j*4 + 2j*2 Expand (0d + 0d - 2d)(4 + d - 4) - 3d*2 + 2d*2 + 0d*2 - 7d*2 + 3d*2 - 16d*2. -23d*2 Expand (17v + 938 - 938)(3v - 3v + 2v*2). 34v3 Expand (-s2 + 4s2 - 2s*2)(2s2 - s2 + s2)(-1 - 2 - 1) - 4s4 + 5s*4 - 3s*4. -10s*4 Expand 2c*2 - 23c3 - c2 + 22c3 + (2 - 1 + 1)(0c3 + 6c*3 - 4c*3) + 4c3 - c3 - 2c3. 4c3 + c2 Expand (r + 3r2 - 3r2 + r3 + 1)(3r - 3r + r). r4 + r2 + r Expand -l + l + 2l + (1 - 1 - 2l)(5 + 1 + 11) + l - 3 + 3. -31l Expand (-1 + 3 + 0)(-6i + 7 - 7). -12i Expand (26n2 - 2n*2 + 14n*2)(1 + 1 - 3)(0n - n + 3n). -76n*3 Expand (-4q + 4q - 5q*2 + (-4q + 3q + 2q)(0q + q + 0q) + 0q*2 - 2q*2 + 4q*2)(0q3 + q3 - 3q*3). 4q5 Expand -g4 - 41 + 5g4 + 37 + (3 - 2 - 3)(2g4 - g4 - 3g*4) - 4g*4 + 3g4 - g4. 6g4 - 4 Expand -3j*3 + 1 - 1 + 4j*3 - 2j*3 - 3j*3 + (-2 + j + 2)(-j*2 + 1 - 1). -5j3 Expand c2 + c*3 + 0c*3 + 2c*3 + (10c + 2c + 2c)(-c + c + c2). 17c3 + c2 Expand (8r + 16 - 16)(3r2 - r3 - 2r2 + r2). -8r4 + 16r*3 Expand (-29l*2 + 8l*3 + 30l2 + l3)(2l2 - l2 - 2l2). -9l5 - l4 Expand (2f3 - 2f3 + f3 + (-f*2 + 1 - 1)(-f - 2f + 5f) + 3 - 3 - 2f3 + f2 - f2 + 2f*3)(-5f - f + 2f)(-f - f + 3f). 4f5 Expand (-2l*4 + 2l4 + l4)(-6 + 3 + 1) + (0l - 4l + 5l)(-4l*3 + 0l*3 + 2l*3). -4l*4 Expand (2l*2 + 3l - 3l)(-1 + 2 - 2) + (3l + l - l)(2l + 3l - 6l) - 4l*2 + 2l2 + l2. -6l2 Expand (107v - 16v + 63v)(-1 + 2 - v - 2)(3v + 2v - 3v). -308v*3 - 308v*2 Expand (-5b*3 + 5b*3 + 3b*3)(-1 + 0 + 2)(-2b + 4b + 0b). 6b4 Expand (0v2 - v2 + 3v2)(1 - v - 1) + 3178v2 - 117v*3 - 3178v*2. -119v*3 Expand (-1 - 2 + 2)(0t + 2t + 0t) + (0 - 3 + 5)(3t - t - t) + 3t - 4 + 4. 3t Expand (-2 + 2 - 3 + (-5 - 3 + 3)(2 + 3 - 6))(-2 + 0 - h2 + 0h*2). -2h2 - 4 Expand (-q2 + 4q2 - 2q*2)(2q - 4q + 0q - 3 + 3 + q + (1 + 3 - 6)(-q - 2q + 4q) + 2q + 5q - 8q)(3 - 3 + 2q). -8q*4 Expand (f - 18f - 5f)(0 + 0 - 2f). 44f*2 Expand (-5 + 0 + 1)((3 - 2j - 3)(3 - 4 + 3) + j - 3j + 0j). 24j Expand (34 - 34 + 20g)(2g*2 + 0g + 0g). 40g*3 Expand 4i*3 - 3i*3 - 2i*3 - 2 + (i - 4i + 5i)(21i - 7i*2 - 21i). -15i3 - 2 Expand ((-n2 - n2 + n2)(-n - 3 + 3) - 3n + 3n + 2n3 + 0 - n3 + 0 + 1 - 1 + 3n*3 + (0n - n*2 + 0n)(2n + 4n - 4n))(-4n - 2n + 4n). -6n4 Expand (0x - x - 2x + (x - 2x + 2x)(-4 + 1 + 5))(-11 + 3 - 5). 13x Expand (o + 3o + 2o*2 + 0o*2)(4o - 2o - 3o + 0o - 2o + 3o + (0o - 2o + 0o)(2 + 3 - 4)). -4o3 - 8o*2 Expand -2d*3 + 6d*3 - 3d*3 + (d - d - d)(d*2 - 3d2 + d2) + 2d3 + d2 - d2. 4d*3 Expand (2 - 1 - 9)(-2 + 1 + 3 + 4g). -32g - 16 Expand (-5g + 6g - 3g)(2 - 33 + 16). 30g Expand (-6 + 3 + 2)(0 - 3a + 0)(a - 3a + 5a). 9a2 Expand (-8h*4 - 2h - h*4 + 7h*4)(3 - 2 + 1). -4h4 - 4h Expand (19 + 0 + 5)(-q3 + 4q3 - q3). 48q3 Expand (-1 + 0 - 2)(-21k - 4k - k). 78k Expand (-2q*3 - 2q*5 + 2q*3)(-1 - 3 + 1). 6q5 Expand (-2 - 1 + 0)((-2l + 0 + 0)(-2 + 2 + 2l2) + 3l*3 - 2l + 2l). 3l3 Expand (q3 + 2q3 - 2q*3)(2q - q - 3q) - 6q4 - 3 + 8q*4 + 5q*4. 5q*4 - 3 Expand -8 + 3s - 4 - 2s + (0 + 2 - 1)(0s - 3s + 4s). 2s - 12 Expand -2o2 + 2o*5 + 2o*2 + 3o*5 - 6o*5 + 0o*5 + (4o3 - o4 - 4o3)(4o + 0o - o). -4o5 Expand (0y2 + y2 + 0y2)(3 - 5 + 0 + 0 - 1 - 1 + (2 + 0 - 1)(5 - 2 - 2) + 0 + 4 - 3 + 3 + 1 + 2). 4y*2 Expand -3b	{ "pile_set_name": "DM Mathematics" }
1i/i*(2/3)(i(-1)/i)(1/95)) assuming i is positive. i(-1675/399) Simplify ((h(-6)/h)/hh(2/5))(12/11)/((((h/(hhh4)h)/h)/(h/h(-2/13)))/(h/((h(2/7)/hh)/hh)(h/h(-1/5)h)/hh)) assuming h is positive. h(778/1001) Simplify n(-2/17)/((nn*(-2/9))/n)nn(-3/7)n*(-1/7)/nn(((n(n*(-1)n)/nn)/n)36)25 assuming n is positive. n(571/1071) Simplify ((((hh/h(-1/5))/h)(5/9)h(-2/5)/h(-2))(-12))(-14) assuming h is positive. h(1904/5) Simplify ((p/p(-4))/(pp/(pp4)p))*(-47)(p*(-6)/(pp/(pp(-3/5)p)p))/(p/(p/p0)pp5) assuming p is positive. p(-1713/5) Simplify ((s(-18)/s)(7/4)(s(s/(s/(ss*31/s)))/sss)/s(-28))(-1/13) assuming s is positive. s(-111/52) Simplify (sss(1/6))/s(-7)(s(1/2))(-45)(s(-2)/(sss/((s(3/2)s)/s)))(-2/31) assuming s is positive. s(-1219/93) Simplify (d*(2/5)dd/(ddd/(d(-5)/d))(d*(8/3)d)/((d(-10)/d)/d))(-1/16) assuming d is positive. d*(-17/30) Simplify (hh(-34)/h)(-26)/(h*(19/4)h/(h(h/h(6/13))/hhh)) assuming h is positive. h(45801/52) Simplify (ddddd13dd(1/7))(-6/13)(d/((d/(d/(d/(d/(d/d0)))))/d))(18/13)(dd(-6))/d(1/4) assuming d is positive. d*(-4455/364) Simplify (((ll/(ll3))/l)/(l/l(2/7))l*(3/4)l*(-2/5)l)/((ll/l(-2/7))(-1/10))(20/3) assuming l is positive. l(-353/420) Simplify (((bbb(-2/7)b)*(4/7)(bbb*3bb)(31/2))(-1/6))26 assuming b is positive. b(-46735/98) Simplify ((jj0)(3/47)/(j/(jj(9/2)j)j(-2/5)/jj))(-2/27) assuming j is positive. j(-2803/6345) Simplify ((b/((bb/b(-11)b)/b)bb*(5/6)b((bb(-6))/b)/b(-1/11))(-44))(1/21) assuming b is positive. b*(1990/63) Simplify ((r/(rrr(-5)/rr))(-26))(-49)((r/(r(2/53)/r))/(rr/(r/(r/(r/(r*(-2/19)/r))r))rr))(-29) assuming r is positive. r(5158903/1007) Simplify (b*(-2/21)b/b*4b(-6)/(b(2/13)/b))/((b0)1/(b(-1))(-42)) assuming b is positive. b(9214/273) Simplify (g(-3)g5/gg)10/(g(3/2)g2/g(g/((g*(-1/2)g)/g)g)(-37)) assuming g is positive. g110 Simplify (h(2/11)/(hh*(-9))(h/(h(hh/h*(3/4))/h)h)/(h*(-5)h))(3/19) assuming h is positive. h(1707/836) Simplify ((y*2yy5)/(y/y0)39)/((yy/(y/(y/(y*(-6)y))))/(yy(1/4)))(-47) assuming y is positive. y(957/4) Simplify ((((aa1)(2/15))(6/7))(-7))(-25/3) assuming a is positive. a(40/3) Simplify ((l*1/(ll*3))/(ll*(-6)ll(-3)))/(l5(ll(-2)l)/ll/(ll(l/l(3/2))/l)l*0) assuming l is positive. 1/sqrt(l) Simplify ((w/(w/(w(w*(-2/7)w)/w)w)w5/w)/(w(-1)ww)(7/6))(5/13) assuming w is positive. w(535/546) Simplify (y13/(y/y*(-1/38))y*7(y/y(-12))/y)50 assuming y is positive. y(29425/19) Simplify (i(-12/5)i(2/21)i/i*(-1/2)ii/(i/(i/(ii/(i*(1/5)i)))))(-1/45) assuming i is positive. i(-83/9450) Simplify ((y*(2/55)/y)/yyyy/y*(1/3)(yy(2/69))/(y/y43))(10/11) assuming y is positive. y(110642/2783) Simplify (((l/l(-2))/l)(2/25)/(l(-1/5)l/l(1/5)))/((l(2/11)l(-2/17))/(l(2/7))(9/4)) assuming l is positive. l(9077/65450) Simplify ((l/l(-1/3)l)(5/4))(-43)l(-2/5)/(l3/ll)(l/(l(-1/7)ll))/(l/l(2/5)l) assuming l is positive. l(-11027/84) Simplify (c(-3/4)(c/c0cc)/c)/((c(-4)/c)/ccc(1/2)c)(c(-5)c(-2/7))/(c(-4)/((ccc*(-3/7))/cc)) assuming c is positive. c(141/28) Simplify (s4/ss(-8)s*14/(ss/s(3/5)))(-3) assuming s is positive. s(-114/5) Simplify (k(-3)k/(k((kk(-4))/k)/k))/((k/((kk*(2/3))/k)k)/(k/k*(-4/7)))(k1)(-18)/(k(2/3)/k2) assuming k is positive. k*(-101/7) Simplify ((((z(zz(-13))/zzz)/zz)/(zz(2/85)))(8/3))(1/6) assuming z is positive. z(-3748/765) Simplify (((((x/(xx*(-2/5)))/x)/(xx(-2/23)))6)(1/5))(-3/35) assuming x is positive. x(3132/20125) Simplify (((((s/s(-11))/s)/ssss(sss(-6/5))/s)/(s(2/9)/s1))(-28/5))25 assuming s is positive. s(-17108/9) Simplify (((k(-20))(-6/11))22)(19/6) assuming k is positive. k760 Simplify (((w(-1/3)/w)/(ww(1/10)))/((ww*5w)/((((ww18w)/w)/w)/w)))(-40) assuming w is positive. w(-908/3) Simplify (a*(5/4)/(aa/(a*(-1/5)/aa))a(-6/13)/((aa(1/22)/a)/a))(-43) assuming a is positive. a*(56201/2860) Simplify ((vvv(-5)vvv)/(v/v*(-5))(vv/v(-2))8)(-10) assuming v is positive. v(-260) Simplify ((((u((u/(u/(u/u(-3/8))))/u)/u)/(u/(u(-12)u)u))/(u3/(u7u)))(-16/3))(-32) assuming u is positive. u(-3904/3) Simplify (j(-1/4))(-45)(jjj*(6/7)jjj)/j*(-5)(j/j0)(-20)j1/j5 assuming j is positive. j(-53/28) Simplify ((z7zz(-2/11))/(z(1/3))43)/((z(z/((z*(-1)z)/z))/zzz)*(7/6)/((zz7)/z(4/3))) assuming z is positive. z*(-149/33) Simplify ((nn(-1/4))23)50/(n(-2/7)/n((nn*(-8)nn)/nn)/n)(1/64) assuming n is positive. n(386451/448) Simplify ((f/((f*4/f)/ff))/(f/(f((f6f)/f)/f)f))(-48)/((f/(f(2/9)f)f(-7)ff)/(f/(f(-1/3)ff))(-1/10)) assuming f is positive. f(-4082/45) Simplify ((s2ss)(-18))(2/19)(s(1/4))(-2/17)/((ss/(s/s1))/s)(-3/14) assuming s is positive. s(-16718/2261) Simplify (v/v(3/11))(-32)v/(v/(vv/(v/(v/(v/(v((v*(-29)/v)/vv)/vvv))))vv))v(-44) assuming v is positive. v(-1015/11) Simplify (q(-7)/q)/(q(-2/3)/q)qq5qq/(qq*(-1/3))(q/(q/q*(2/13)q)qqq/(qq(q(-1/3)/q)/q))(-24) assuming q is positive. q(-763/13) Simplify (((r(2/3)r/(r*(-7/4)/r)r)24)(-45))27 assuming r is positive. r(-157950) Simplify ll(-1/3)/ll*6l*(-2/7)l*0(l(-2/5))(-1/14)l(1/15)ll(-1) assuming l is positive. l(115/21) Simplify y(-6)/y(-8)(yy(-2))(15/2)((yy/((y(-1/3)/yy)/y)yy)/yy)(-47)yyyy(4/7)yy3yy assuming y is positive. y(-10357/42) Simplify ((x/x6x/x*(-2)(x(-1/3))9)13)(1/7) assuming x is positive. x(-65/7) Simplify (z(4/7)z)(-8/11)(z/(z/(z*4zz)))(-9) assuming z is positive. z(-386/7) Simplify (q(-1/2))(4/13)q*5qq(1/4)q(q/(q/q0qq))/(q(-1)q)(q/(qq*(-1/4))qq)(-2/127) assuming q is positive. q(33421/6604) Simplify ((gg/g*(-1/30)((g12/g)/g)/g)/(g21)(-30))0 assuming g is positive. 1 Simplify (aa/(aa/(a/((aaa*8)/a)))(a*(-2/21)/a)/aa*(4/5)aa4)/(((a/a(2/7))/a)(23/3)a(1/2)/a(2/3)) assuming a is positive. a(-407/210) Simplify (((l(1/3))(-3/20)/(l(3/5)l(-2/9)/l))0)(-1) assuming l is positive. 1 Simplify ((d/(d/(ddd(1/15))))(-21)(d/(d/d(-1/5)))(6/11))(2/35) assuming d is positive. d(-4786/1925) Simplify ((g*(-5/4)g/(g*(-2)g)g)/(g(-1/6)gg)(-22))(2/7) assuming g is positive. g(505/42) Simplify ((jj(7/3))/j)11(((j(-4/7)j)/jj)/j)/(jj18) assuming j is positive. j(128/21) Simplify (((oo(-1/2)oo(-2/9))44)1)13 assuming o is positive. o(6578/9) Simplify ((oo(-17))15o28/(o/((oooo1)/o)))(-1/12) assuming o is positive. o(35/2) Simplify ((s(4/11)s(1/10))/(s(-8/5)/s(-1)))/(s/((sss(1/2)s)/s)s(7/2)((s/((ss(-2/11)s)/s))/s)/((ss(5/2)s)/s)) assuming s is positive. s*(186/55) Simplify ((hhh(2/7))(-1/18))27(((h/(hh0))/h)(4/13))8 assuming h is positive. h(-536/91) Simplify ((((w(-2/3))(-3/7))(1/6))(-4/3))12 assuming w is positive. w(-16/21) Simplify (f(-1/2)(f(-4/5)/f)/f)(7/3)/((f(-1/4))(-19)/(f*(2/5)f)36) assuming f is positive. f(759/20) Simplify (m(-46)/(m/(m/(m/(m/m(-19))))))/(m*(2/7)m(-2/47)) assuming m is positive. m(-8963/329) Simplify ((a1)0/(aa/a(1/4)aa)(2/39))/((a/(aa*(-4)/aa)a(1/2))/(((aa(2/9))/a)/a)(-2/113)) assuming a is positive. a(-61855/13221) Simplify ((q(2/5))43/(q(-2/69)qq/(q/(((qqq*(-1/23)qq)/q)/q))))(-8) assuming q is positive. q(-39392/345) Simplify (x/(x(-1)x)(x/(x/(xx/(xx(-2)))))/x)50((x(3/4)/x)/(x/x(-4)))/(x*6xx(-4/3)) assuming x is positive. x(1669/12) Simplify ((h/h(-1))/(h/h(-4)))/((h(1/11)h)/((hhh*5)/hh))(h/((((h3/h)/h)/hh)/h)h(1/6))*(3/7) a	{ "pile_set_name": "DM Mathematics" }
sqrt(19) + sqrt(19))*2 + -4 + (1sqrt(684))*2). 5400 Simplify ((2-1sqrt(17) + sqrt(17))2 - sqrt(17)) + sqrt(170)/(sqrt(10)1). 17 Simplify (sqrt(33)12)/sqrt(108). sqrt(11)/3 Simplify (3sqrt(2299)3)2. 186219 Simplify (sqrt(200) + 0 + 3)2. 60sqrt(2) + 209 Simplify sqrt(104)/(1sqrt(8)1). sqrt(13) Simplify -4(-3 + sqrt(180) + ((sqrt(180) - (sqrt(180) + 1) - sqrt(180)) + 1 - sqrt(180))*2). -2868 - 24sqrt(5) Simplify (-4 + sqrt(2448) + (sqrt(2448) - (sqrt(2448)1 + sqrt(2448))) + (sqrt(2448) - (-2 + sqrt(2448)))4)*2. 16 Simplify ((sqrt(204)-1)/sqrt(6))/((sqrt(200) + sqrt(200)2 - sqrt(200)) + sqrt(200)). -sqrt(17)/30 Simplify (sqrt(7) - (sqrt(84)1)/sqrt(12) - sqrt(252))*2. 252 Simplify (5sqrt(19)-4 - (sqrt(76) + 3))2. 132sqrt(19) + 9205 Simplify ((3sqrt(42)/sqrt(2))/(-5sqrt(112)))*2. 27/400 Simplify sqrt(114)/(sqrt(6) + sqrt(96)) + sqrt(19) + sqrt(133)/sqrt(252). 41sqrt(19)/30 Simplify (sqrt(119)/(sqrt(7) + (sqrt(35)/(sqrt(15)/sqrt(3)) - sqrt(7))))*2. 17 Simplify sqrt(117)/(sqrt(9) + (sqrt(9) - sqrt(9)4-2)). sqrt(13)/10 Simplify 2sqrt(27) - (sqrt(15)/(sqrt(45) - sqrt(5)))*2. -3/4 + 6sqrt(3) Simplify -3 + (sqrt(7) - ((sqrt(7) - (sqrt(14)/sqrt(2)6)2) + sqrt(7))). -sqrt(7) + 249 Simplify (0 + sqrt(304) + -1 + sqrt(304) + sqrt(57)/(sqrt(3)-1)-3)2. -22sqrt(19) + 2300 Simplify sqrt(99)/(2sqrt(9)) - (sqrt(11)25)2. -1100 + sqrt(11)/2 Simplify sqrt(2) + sqrt(2) + (sqrt(12)/sqrt(6))2 + 2 + (sqrt(96)/sqrt(8))/sqrt(6). 4 + 3sqrt(2) Simplify -5 + ((-4(sqrt(17) + (-1sqrt(17) - sqrt(17)) + sqrt(17)) - (sqrt(17) - (1 + sqrt(17) + -3))) + 2)*2. -5 Simplify (sqrt(19) + -4sqrt(931) - sqrt(57)/sqrt(75))2. 351424/25 Simplify ((sqrt(55)/sqrt(5))2 + -5 + 1)-5. -35 Simplify (sqrt(1216) - -2sqrt(1216)3) + 3. 3 + 56sqrt(19) Simplify (sqrt(160)/(sqrt(4)-3))/(5sqrt(16)/sqrt(2)). -sqrt(5)/15 Simplify (sqrt(60)/(sqrt(132)/(-2sqrt(11) + sqrt(11))))2-2. -10 Simplify -1(-5 + -4sqrt(19)-4). -16sqrt(19) + 5 Simplify 5 + (sqrt(3500) + -2sqrt(3500))/sqrt(5). -10sqrt(7) + 5 Simplify sqrt(35)/sqrt(5) + -3 + (sqrt(70)-1 + sqrt(70))/sqrt(10). -3 + sqrt(7) Simplify ((sqrt(19)3 + 4)-4 + -2)2. 432sqrt(19) + 3060 Simplify ((2sqrt(76) - sqrt(38)/sqrt(2)-2)-1)2. 684 Simplify ((-2sqrt(231) + sqrt(231) + sqrt(231))/sqrt(11))/sqrt(3). 0 Simplify -3(0 + sqrt(5)) + -5 + sqrt(45). -5 Simplify ((2sqrt(196))/sqrt(7))*2. 112 Simplify (-2 + sqrt(33)/(sqrt(3) - (sqrt(3) - sqrt(27)-1)))*2. 4sqrt(11)/3 + 47/9 Simplify 2((sqrt(72)-2 - sqrt(2) - sqrt(2))*2 + -4). 776 Simplify sqrt(50)/(sqrt(10) + -1sqrt(160)). -sqrt(5)/3 Simplify -1(sqrt(19) + -1)-2. -2 + 2sqrt(19) Simplify ((1sqrt(3648))/(sqrt(3) - -1sqrt(3)-5))*2. 76 Simplify 6(3 + (3sqrt(76))/sqrt(4)). 18 + 18sqrt(19) Simplify 0 + sqrt(2299) + sqrt(2299) + 5(1 + sqrt(19)). 5 + 27sqrt(19) Simplify (sqrt(28) - (sqrt(4032) - (sqrt(4032) + 1sqrt(4032))))/sqrt(4). 13sqrt(7) Simplify (sqrt(66)/sqrt(6))*23 - sqrt(77)/(sqrt(21)/sqrt(3)). -sqrt(11) + 33 Simplify (sqrt(21) - (sqrt(21) - (sqrt(3024) - -1sqrt(3024) - sqrt(3024) - sqrt(3024))))/sqrt(7)-2. 0 Simplify 4sqrt(99) + 3 + -4. -1 + 12sqrt(11) Simplify (sqrt(99) + (sqrt(99) - (sqrt(99) - (sqrt(99) - ((-3sqrt(99) - sqrt(99)) + sqrt(99) + sqrt(99) - sqrt(99)))-4)) + sqrt(99))/sqrt(9). -14sqrt(11) Simplify (sqrt(17) + sqrt(1088)-1 + (sqrt(204)2)/sqrt(12))2. 425 Simplify sqrt(4032)/sqrt(9) + 5. 5 + 8sqrt(7) Simplify (sqrt(297)/sqrt(3))*2 - (2 + 3sqrt(11)). -3sqrt(11) + 97 Simplify (sqrt(48) + -1sqrt(48))*2 - (sqrt(33)/sqrt(11)3)2. -27 Simplify (sqrt(20) + 0)2-2. -40 Simplify 5(3 + sqrt(833)) + -4. 11 + 35sqrt(17) Simplify ((sqrt(4617) - sqrt(4617)1)/(sqrt(108)/sqrt(4)))*2. 0 Simplify sqrt(28)/(sqrt(20)/sqrt(5)) + 5. sqrt(7) + 5 Simplify (1sqrt(1331)-4)2. 21296 Simplify (((2 + sqrt(363) - sqrt(363)) + sqrt(363))2 + 1 - sqrt(363)) + 0. 33sqrt(3) + 368 Simplify (sqrt(49) - ((-2sqrt(3969) - sqrt(3969)) + sqrt(3969) + sqrt(3969) + sqrt(49)))/(sqrt(28)-5). -9sqrt(7)/10 Simplify 2((sqrt(11) - (sqrt(539) + -1)*2) + (sqrt(11) - (sqrt(11) + 1)2))1. -1084 + 28sqrt(11) Simplify (sqrt(7) - (sqrt(56)/sqrt(2) + sqrt(28))) + (-4 + sqrt(7))*2-6. -138 + 45sqrt(7) Simplify (-6(sqrt(147) - (sqrt(147) + -3)))*2 + 4. 328 Simplify ((sqrt(165)2)/sqrt(11))/((1sqrt(36))/sqrt(12)). 2sqrt(5) Simplify ((sqrt(55)2)/sqrt(11) - (sqrt(180) + 1))2 + -1sqrt(405)-5. 81 + 53sqrt(5) Simplify (sqrt(19) + -1)3 - (sqrt(19) - (sqrt(57)/sqrt(3))2)6. -3sqrt(19) + 111 Simplify sqrt(136)/(sqrt(96)/sqrt(300)). 5sqrt(17) Simplify (-6(sqrt(170) + -1sqrt(170) + sqrt(170)))/(sqrt(160)4). -3sqrt(17)/8 Simplify sqrt(13) + (sqrt(13) + sqrt(468) + 5)*2 + ((4sqrt(52))/sqrt(4))*2. 71sqrt(13) + 870 Simplify -1(sqrt(12)/sqrt(4)-3 - (sqrt(3) + sqrt(3) + -2sqrt(3)-2)*2). 3sqrt(3) + 108 Simplify (2sqrt(114)1)/(sqrt(150)2). sqrt(19)/5 Simplify -1((-1sqrt(88))/sqrt(8) + sqrt(11) + (sqrt(11) - (sqrt(11) + (sqrt(110)-2)/sqrt(10)))). -2sqrt(11) Simplify (3 + (0 + sqrt(99) - sqrt(99)))2. 9 Simplify (sqrt(228)/(-1sqrt(12) - sqrt(12)))*2 + (sqrt(19) + sqrt(57)/sqrt(3)6 + sqrt(19) - sqrt(19) - sqrt(19))*2. 2755/4 Simplify (5 + (sqrt(192) - sqrt(192)-2 - sqrt(192)))*2. 160sqrt(3) + 793 Simplify (sqrt(133)/(sqrt(7)1 + sqrt(7))-2)2. 19 Simplify (sqrt(22)/(sqrt(14)/sqrt(7)))23 + 3. 36 Simplify (sqrt(1053) - -1(sqrt(1053) + 0))*2. 4212 Simplify ((1sqrt(396)-1)2 + sqrt(396) + sqrt(396))-22. -1584 - 48sqrt(11) Simplify (4 + -61sqrt(7))*2. -48sqrt(7) + 268 Simplify -4(1-2(-1 + sqrt(3)))2 + 1. -63 + 32sqrt(3) Simplify sqrt(128) + 2 + sqrt(128) + -1. 1 + 16sqrt(2) Simplify sqrt(121)/(sqrt(55)/(sqrt(5)-2)). -2sqrt(11) Simplify (4 + -2sqrt(171))*2 + 2. -48sqrt(19) + 702 Simplify (0 + sqrt(1280)1)2. 1280 Simplify -6(-2 + sqrt(17) + 3). -6sqrt(17) - 6 Simplify (((sqrt(133) - sqrt(133)-2 - sqrt(133))/sqrt(7) + sqrt(19))3 - (2sqrt(38)/sqrt(2) + -1))*2. 14sqrt(19) + 932 Simplify (sqrt(70) - sqrt(70)-14)/((sqrt(10) - (sqrt(30)/sqrt(3) + sqrt(10)))1). -5sqrt(7) Simplify 0 + (sqrt(2) - sqrt(20)/(sqrt(10) - sqrt(60)/sqrt(6) - sqrt(10))). 2sqrt(2) Simplify -3((-1 + sqrt(475))*2 + 3). -1437 + 30sqrt(19) Simplify -3 + sqrt(243) + -3. -6 + 9sqrt(3) Simplify 4(sqrt(720)1 + 0)2. 2880 Simplify -6sqrt(68) + (sqrt(34)/sqrt(2) - sqrt(17))*2 + 0. -12sqrt(17) Simplify 4 + (sqrt(1900) + 1)*2 - sqrt(209)/(sqrt(77)/(2sqrt(7) + sqrt(7))). 17sqrt(19) + 1905 Simplify ((1sqrt(1008) + sqrt(1008) + sqrt(1008))/sqrt(9))*2. 1008 Simplify (sqrt(25) + 2sqrt(900))/(sqrt(5)-13). -13sqrt(5)/3 Simplify sqrt(34)/(sqrt(288) + (sqrt(288)1 - sqrt(288)) + sqrt(288))-5. -5sqrt(17)/24 Simplify (sqrt(20) + (sqrt(140) - -4sqrt(140))/sqrt(7))/sqrt(4) + 1. 1 + 6sqrt(5) Simplify -1(0 + (sqrt(68) - (1 + sqrt(68)))2 - sqrt(68)-15). -10sqrt(17) - 1 Simplify (sqrt(105)/sqrt(3)1)/(sqrt(77)/sqrt(176)). 4sqrt(5) Simplify (1 + 1sqrt(5))2. 2 + 2sqrt(5) Simplify sqrt(98)-2 + -5. -14sqrt(2) - 5 Simplify sqrt(3) - (3 + -1sqrt(3))2 - (sqrt(300) + -1)2. -313 + 27sqrt(3) Simplify 3 + -1 + sqrt(19)3 + -1. 1 + 3sqrt(19) Simplify -2 + sqrt(6)/sqrt(3)-2. -2sqrt(2) - 2 Simplify 3 + 5-4(5 + sqrt(11)2). -40sqrt(11) - 97 Simplify (5 + 0 + sqrt(13))5. 5sqrt(13) + 25 Simplify 3sqrt(49)/sqrt(7)-6. -18sqrt(7) Simplify (sqrt(27) + sqrt(27)1 + -52sqrt(3))2. 48 Simplify (-2-2sqrt(170))/(2sqrt(490)). 2sqrt(17)/7 Simplify (sqrt(11) - -2(sqrt(11) + 1)) + sqrt(11) + sqrt(396)2. 2 + 16sqrt(11) Simplify (1 + sqrt(162) + sqrt(98) + 2)*2. 96sqrt(2) + 521 Simplify -1 + sqrt(1300) + sqrt(130)/(-2sqrt(10)). -1 + 19sqrt(13)/2 Simplify (sqrt(288)-2)/sqrt(4)-2. 24sqrt(2) Simplify 4 + -1 + (sqrt(11) + 1)2 + ((sqrt(99)/(sqrt(36)/sqrt(4)))2 - (1sqrt(275))*2). -249 + 2sqrt(11) Simplify (5((sqrt(2) + -1)2 + sqrt(6)/sqrt(3) + -2))*2. -600sqrt(2) + 850 Simplify (6sqrt(51)/sqrt(3) + sqrt(1377) + 1)2. 30sqrt(17) + 3826 Simplify sqrt(720) + -1 + 0 + sqrt(720). -1 + 24sqrt(5) Simplify sqrt(27)/(sqrt(108)/sqrt(3)). sqrt(3)/2 Simplify -6((sqrt(3) + -1)*2 + sqrt(3) + sqrt(3)) - (2 + -4 + sqrt(3)). -22 - sqrt(3) Simplify (sqrt(104)-3)/sqrt(2). -6*sqrt(13	{ "pile_set_name": "DM Mathematics" }
the third derivative of -1/12m4 + 0m + 1/9m3 + 1/30m*5 + 2m*2 - 1/180m*6 + 0. Suppose z(n) = 0. Calculate n. 1 Suppose -13 = -4s - 5. Suppose -sy = -7y + 10. Find q, given that -2/3q3 - 1/3 + 1/3q*5 + 1/3q - 1/3q4 + 2/3q*y = 0. -1, 1 Suppose -2q - 21 = -z - 27, 3z = 0. Find r such that 10/3r*2 - 6 - 2/3r*q - 2r = 0. -1, 3 Let b(k) be the second derivative of k9/3024 - k8/840 + k6/180 - k5/120 - k*3/3 + 2k. Let h(z) be the second derivative of b(z). Factor h(s). s(s - 1)3(s + 1) Suppose 3q = 367 + 104. Let p = q - 1095/7. What is r in 2/7r - 2/7r5 - pr*2 + 0r*3 + 4/7r*4 + 0 = 0? -1, 0, 1 Let u be (-3)/3 + (14 - 3). Let l be u/124/5. Suppose -1/3h3 + 0 + lh*2 - 1/3h = 0. What is h? 0, 1 Factor -1/11p3 + 1/11p*2 - 1/11 + 1/11p. -(p - 1)*2(p + 1)/11 Let h(c) be the third derivative of -8c2 + 0c - 1/36c4 - 1/18c*3 + 0 + 1/60c*5. Factor h(r). (r - 1)(3r + 1)/3 Let l(z) = -z2 - 2z + 2. Let k be l(-2). Determine r so that 4 + 0rk + r2 - 5 = 0. -1, 1 Suppose n - 4 = -3n. Let i(s) be the first derivative of 2/3s3 + 0s*2 + 0s - s4 - n. Let i(u) = 0. What is u? 0, 1/2 Let o(j) be the first derivative of j6/1980 + j5/660 - j4/66 + j*3/3 + 4. Let g(u) be the third derivative of o(u). Determine d, given that g(d) = 0. -2, 1 Determine p so that 18p - 10p3 - 5p + 16p2 - 8p*2 + 9p + 4 = 0. -1, -1/5, 2 Let f = -22 - -22. Let n(m) be the second derivative of 1/36m4 - 1/90m*6 + 0m*2 + 1/18m*3 + f - 2m - 1/60m5. Factor n(g). -g(g - 1)(g + 1)2/3 Let s be (-12)/(-15)40/16. Determine v, given that 0 - 1/4v3 + 1/4v + 1/4v4 - 1/4v*s = 0. -1, 0, 1 Let f be 430/24 + (-10)/8. Determine l so that 51/4l4 + 3l*2 + 0l - 12l3 + 0 - fl*5 = 0. 0, 2/5, 1, 2 Let s = 2/325 - -632/2925. Let h be (-10)/(-15)((-50)/15 + 5). What is z in hz2 + sz*3 + 8/9 + 16/9z = 0? -2, -1 Let s(u) be the first derivative of 4u5/5 + 3u4/2 - u2 + 5. Factor s(n). 2n(n + 1)*2(2n - 1) Factor -5p - 5 - 15p2 + 5p*3 + 10p + 8p + 2p. 5(p - 1)3 Let d(a) = -a - 4. Let j be d(-9). Suppose 0 = i - 3n + 13, 4n = -i - 4i + 30. What is r in 1/4r4 - 1/2r*i - 1/4r*j + 1/2r*3 + 1/4 - 1/4r = 0? -1, 1 Let v(u) be the first derivative of 6u4 - 12u*3 + 9u*2 - 3u + 2. Factor v(j). 3(2j - 1)*3 Let q(d) be the first derivative of 7d*4/32 - 9d*3/4 + 6d*2 + 4d - 28. Factor q(w). (w - 4)*2(7w + 2)/8 Let l(d) = -d4 + 11d*3 - 3d*2 - 11d + 10. Let o(y) = -y*4 + 10y*3 - 3y*2 - 10y + 9. Let n(f) = 5l(f) - 6o(f). Factor n(j). (j - 4)(j - 1)2(j + 1) Let t(z) be the first derivative of -1 - 2/15z5 + 0z - 2/3z2 - 4/9z*3 + 7/12z*4. Factor t(x). -x(x - 2)*2(2x + 1)/3 Let c(t) = t3 - 6t*2 - 5t - 4. Let d be c(7). Factor -9o - o3 + do*3 - 3o*2 + 3 + 0. 3(o - 1)(o + 1)(3o - 1) Suppose 5u = 2o + u + 6, 0 = 3o - 3u. Factor -5g*2 - o + 2g*2 - 2 + 2 - 6g. -3(g + 1)2 Let n be (4/(-34) - (-60)/510)/(-1). Solve 0x*2 + 1/3x - 1/3x3 + n = 0. -1, 0, 1 Let 2/5q*2 + 0 - 4/5q*3 + 0q + 2/5q4 = 0. What is q? 0, 1 Let c(f) be the third derivative of -f6/90 + f5/60 + f3/2 + 2f*2. Let x(i) be the first derivative of c(i). Factor x(p). -2p(2p - 1) Let t = 6 + -2. Let a(b) be the second derivative of 0 - 1/50b5 - b + 1/5b*3 + 0b*t + 2/5b*2. Factor a(f). -2(f - 2)(f + 1)2/5 Let n(b) be the third derivative of -b11/582120 - b5/20 - 8b2. Let z(o) be the third derivative of n(o). Determine q, given that z(q) = 0. 0 Let q be (-1)/(3/9) - -1. Let r(f) = f3 + 4f2 + 3f + 1. Let c be r(q). Factor -o*2 + co4 + o4 + 2o3 - 5o4. -o2(o - 1)2 Let g be 24/(-30) - 28/(-10). Let z(c) be the second derivative of 0c*3 + 0c*5 - 1/6c*4 + 0 - gc + 1/15c6 + 0c*2. Factor z(l). 2l*2(l - 1)(l + 1) Let h(p) be the second derivative of 0p*3 + 0 + 1/20p*4 + 1/100p*5 + 0p*2 + 3p. Solve h(a) = 0. -3, 0 Let t(p) be the first derivative of 0p2 + 0p + 3 + 1/12p3. Factor t(y). y2/4 Let x(w) be the first derivative of 6w5/5 + w4/2 - 2w3 - w2 + 42. Factor x(m). 2m(m - 1)(m + 1)(3m + 1) Let r(v) be the first derivative of -2v3/3 - 6v*2 - 18v - 6. Factor r(o). -2(o + 3)2 Suppose -15/2q + 5/2q2 + 5 = 0. Calculate q. 1, 2 Suppose -n + 16 = n. What is u in 6u2 + 3 - u5 + nu3 - 4u*3 - 9u*4 - 9u + 4u5 + 2u*3 = 0? -1, 1 Let f(p) be the first derivative of 4/21p*3 - 3/14p*4 - 1/42p*6 + 4/35p*5 - 1/14p*2 + 0p + 3. Factor f(t). -t(t - 1)4/7 Let s(l) be the second derivative of 0 + 1/12l*4 + 0l*3 + 3l + 1/20l5 + 0l2. Factor s(d). d2(d + 1) Let u(y) = y2 + 0 - y - 4y*3 - 4 + 5 + 5y*3. Let g(h) = -6h*3 - 8h*2 + 6h. Let w(s) = g(s) + 4u(s). Factor w(a). -2(a - 1)(a + 1)(a + 2) Let l(m) = 3m2 + 3m. Suppose -2v - 3f = -0f + 6, 4f = -v - 3. Let t be l(v). Factor -2k4 - tk*2 + 0k*4 + 8k + 10k3 + 2k*2. -2k(k - 2)2(k - 1) Let b(v) be the first derivative of 1/5v2 - 2/15v*3 + 1 + 0v. Find c, given that b(c) = 0. 0, 1 Let d(o) = -o*3 + 3o*2 + 3o + 4. Let l be d(4). Suppose 2s - 4t - 4 = l, 4s = 4t + 1 + 7. Factor -9/5i - 9/5i*s - 3/5 - 3/5i*3. -3(i + 1)*3/5 Let m(t) = -4t*2 + 4t + 5. Let x(j) = 5j2 - 5j - 6. Let o(f) = 4m(f) + 3x(f). Find q such that o(q) = 0. -1, 2 Suppose -33 - 7 = -4y. Factor -yt*5 - 2t*4 + 13t*5 - t + 6t*3 - 7t4 + t4. t(t - 1)3(3t + 1) Let v(j) be the second derivative of 1/5j*3 + 1/25j*6 - 1/105j*7 + 4j - 1/5j2 - 1/25j*5 - 1/15j4 + 0. Solve v(d) = 0. -1, 1 Let l(q) = q4 + 2q3 - q2 - q. Let v(y) = -12y*4 - 28y*3 + 20y*2 + 52y + 24. Let n(w) = -8l(w) - v(w). What is f in n(f) = 0? -3, -1, 2 Let h(j) be the third derivative of j7/5040 - j5/240 - j4/12 - 3j*2. Let g(t) be the second derivative of h(t). Factor g(k). (k - 1)(k + 1)/2 Let b = 23 + -19. Let p(u) be the second derivative of 1/30u6 - 1/10u*5 + 1/3u*3 + 0 + 0u*b - 1/2u*2 + u. Let p(s) = 0. What is s? -1, 1 Let b(q) be the third derivative of -1/420q*7 + 0 + 0q*3 + 0q*5 - 1/240q*6 + 0q*4 + 3q*2 + 0q. Suppose b(d) = 0. Calculate d. -1, 0 Let o be (-1)/(-3) + (-10)/120. Determine u, given that 0u2 + 0 + u4 + ou*3 + 0u = 0. -1/4, 0 Let r(z) be the second derivative of z8/20160 + z7/3024 + z*6/1440 + 7z*4/12 + z. Let v(i) be the third derivative of r(i). Let v(u) = 0. What is u? -3/2, -1, 0 Factor -8/3 + 4/3f - 1/3f3 + 2f*2 - 1/3f*4. -(f - 2)(f - 1)(f + 2)2/3 Determine o so that -15/2o*3 + 3o + 0 - 9/2o2 = 0. -1, 0, 2/5 Let j(r) be the third derivative of -r2 + 0r + 0r4 + 1/330r*6 + 0 - 1/330r*5 - 1/1155r*7 + 0r*3. Factor j(u). -2u*2(u - 1)*2/11 Let -8y - 2y3 - 4 + 4y*4 + 12y*3 + 0 - 2y*3 = 0. What is y? -1, 1 Suppose 5a + 5w - 20 = 0, 3a - 7 = -w + 1. Solve -x*a - 1 - 3x + 1 + 4x = 0 for x. 0, 1 Let m(l) be the third derivative of -1/6l*4 + 0 - 1/3l3 + l2 - 1/30l5 + 0l. Solve m(w) = 0 for w. -1 Let v(f) be the first derivative of -4/3f + 2 - 2/9f3 + f2. Solve v(m) = 0. 1, 2 Let r(f) be the first derivative of f5/2 + f4 + f3/6 - f2/2 + 5. Determine o so that r(o) = 0. -1, 0, 2/5 Suppose 3a + a = 0. Factor 2y3 - y3 + y*5 + ay*4 - 2y4. y3(y - 1)2 Let n(i) = i3 - 6i*2 - 7i. Let x be n(7). Let v be (8/(-6))/4 - -1. Factor -4/3l3 + vl*2 + 0l + x + 2/3l4. 2l*2(l - 1)2/3 Let s(i) be the third derivative of -i7/70 + 3i6/40 + 3i*5/20 - 7i*4/8 - 3i*3 + 31i2. Determine a so that s(a) = 0. -1, 2, 3 Let b(v) be the third derivative of v6/160 - v*4/32 - 44v*2. What is l in b(l) = 0? -1, 0, 1 Suppose -6l = -l + w - 2, 0 = 4l - 5w + 10. Let d be (-7)/14l/1. Factor -1/4z*4 - 1/4z*5 + d + 1/4z*2 + 0z + 1/4z3. -z2(z - 1)(z + 1)2/4 Factor -8j*3 - 13j*2 + 2j*2 + 5j*3 - 4j*2. -3j*2(j + 5) Let m(w) = -w2 - w - 1. Let j = 0 + -3. Let l(n) = -n3 + n*2 + 2n + 1. Let q(d) = jl(d) - 3m(d). Find t such that q(t) = 0. -1, 0, 1 Let t = 2 - 3. Let f = 2 - t. Suppose n + fn2 + n*2 -	{ "pile_set_name": "DM Mathematics" }
, 73, 2243 What are the prime factors of 15109139? 15109139 What are the prime factors of 14530404? 2, 3, 7, 172981 What are the prime factors of 8789780? 2, 5, 19, 23131 What are the prime factors of 3118069? 3118069 List the prime factors of 550768. 2, 29, 1187 What are the prime factors of 218722? 2, 7, 17, 919 List the prime factors of 133979. 133979 List the prime factors of 4745168. 2, 157, 1889 What are the prime factors of 881643? 3, 7, 41983 What are the prime factors of 2668195? 5, 223, 2393 What are the prime factors of 420467? 420467 List the prime factors of 643852. 2, 11, 14633 List the prime factors of 3295137. 3, 1098379 What are the prime factors of 24363093? 3, 53, 73, 2099 What are the prime factors of 309286? 2, 154643 List the prime factors of 560580. 2, 3, 5, 9343 List the prime factors of 25952. 2, 811 What are the prime factors of 660906? 2, 3, 12239 List the prime factors of 4931929. 271, 18199 What are the prime factors of 3146857? 7, 101, 4451 What are the prime factors of 750350? 2, 5, 43, 349 List the prime factors of 419106. 2, 3, 23, 3037 What are the prime factors of 3111467? 491, 6337 List the prime factors of 53943. 3, 17981 List the prime factors of 385337. 61, 6317 List the prime factors of 85309. 7, 1741 List the prime factors of 472765. 5, 23, 4111 What are the prime factors of 8200456? 2, 11, 93187 What are the prime factors of 11677395? 3, 5, 223, 3491 List the prime factors of 10720284. 2, 3, 293, 3049 List the prime factors of 1862899. 79, 23581 List the prime factors of 2821146. 2, 3, 241, 1951 List the prime factors of 384234. 2, 3, 17, 3767 List the prime factors of 2846668. 2, 11, 31, 2087 What are the prime factors of 4338000? 2, 3, 5, 241 List the prime factors of 1219798. 2, 29, 21031 List the prime factors of 2605720. 2, 5, 13, 5011 What are the prime factors of 11651669? 103, 113123 List the prime factors of 467145. 3, 5, 7, 1483 List the prime factors of 126233. 126233 What are the prime factors of 188324? 2, 23, 89 What are the prime factors of 37753713? 3, 4194857 List the prime factors of 3513302. 2, 13, 163, 829 What are the prime factors of 439130? 2, 5, 43913 List the prime factors of 219493. 103, 2131 List the prime factors of 126685. 5, 13, 1949 What are the prime factors of 363842? 2, 109, 1669 What are the prime factors of 405344? 2, 53, 239 List the prime factors of 2893302. 2, 3, 160739 What are the prime factors of 136925? 5, 5477 What are the prime factors of 740260? 2, 5, 37013 What are the prime factors of 1596534? 2, 3, 266089 What are the prime factors of 3241699? 3241699 List the prime factors of 3026875. 5, 29, 167 List the prime factors of 908568. 2, 3, 12619 List the prime factors of 123100. 2, 5, 1231 What are the prime factors of 504740? 2, 5, 25237 What are the prime factors of 362482? 2, 19, 9539 What are the prime factors of 1273949? 257, 4957 What are the prime factors of 137850? 2, 3, 5, 919 What are the prime factors of 23828916? 2, 3, 1985743 What are the prime factors of 3866306? 2, 83, 23291 List the prime factors of 475200. 2, 3, 5, 11 List the prime factors of 4762337. 4762337 What are the prime factors of 19646770? 2, 5, 11, 13, 1249 What are the prime factors of 537228? 2, 3, 14923 List the prime factors of 455103. 3, 11, 4597 What are the prime factors of 1399338? 2, 3, 17, 269 What are the prime factors of 162870? 2, 3, 5, 61, 89 List the prime factors of 4166431. 31, 134401 List the prime factors of 1251274. 2, 625637 List the prime factors of 308484. 2, 3, 11, 19, 41 List the prime factors of 132243. 3, 17, 2593 What are the prime factors of 19508958? 2, 3, 7, 73, 101 What are the prime factors of 19884142? 2, 79, 317, 397 List the prime factors of 28623341. 28623341 What are the prime factors of 132622? 2, 7, 9473 What are the prime factors of 1071233? 1071233 What are the prime factors of 18998692? 2, 127, 149, 251 List the prime factors of 16189848. 2, 3, 17, 4409 What are the prime factors of 219123? 3, 97, 251 What are the prime factors of 127995? 3, 5, 7, 23, 53 List the prime factors of 4420507. 7, 13, 31, 1567 What are the prime factors of 271508? 2, 103, 659 What are the prime factors of 334906? 2, 11, 13, 1171 List the prime factors of 438264. 2, 3, 2029 List the prime factors of 6162315. 3, 5, 109, 3769 List the prime factors of 4129975. 5, 31, 73 List the prime factors of 37762382. 2, 7, 151, 17863 What are the prime factors of 55310? 2, 5, 5531 List the prime factors of 1528147. 17, 89891 What are the prime factors of 3414269? 3414269 List the prime factors of 19488086. 2, 17, 573179 List the prime factors of 11627630. 2, 5, 7, 43, 3863 What are the prime factors of 776800? 2, 5, 971 List the prime factors of 689771. 689771 What are the prime factors of 91444? 2, 22861 List the prime factors of 1653203. 29, 109, 523 List the prime factors of 10165700. 2, 5, 59, 1723 What are the prime factors of 260849? 260849 What are the prime factors of 2538157? 2538157 What are the prime factors of 6939351? 3, 19, 167 What are the prime factors of 5518636? 2, 1379659 List the prime factors of 873366. 2, 3, 13, 11197 List the prime factors of 1870507. 1870507 What are the prime factors of 1545915? 3, 5, 7, 14723 List the prime factors of 8354708. 2, 53, 39409 What are the prime factors of 1302241? 19, 68539 What are the prime factors of 17013615? 3, 5, 1134241 What are the prime factors of 26703347? 11, 1277, 1901 List the prime factors of 4798763. 41, 117043 What are the prime factors of 23753263? 71, 97, 3449 What are the prime factors of 781149? 3, 23, 11321 What are the prime factors of 164439? 3, 11, 151 List the prime factors of 5119779. 3, 7, 243799 What are the prime factors of 3313952? 2, 103561 List the prime factors of 2960575. 5, 118423 List the prime factors of 176211. 3, 7, 2797 What are the prime factors of 108918? 2, 3, 2017 What are the prime factors of 71742? 2, 3, 11, 1087 List the prime factors of 327299. 7, 46757 What are the prime factors of 1178022? 2, 3, 196337 List the prime factors of 11226486. 2, 3, 1871081 What are the prime factors of 36505394? 2, 18252697 List the prime factors of 391191. 3, 19, 6863 List the prime factors of 1219184. 2, 23, 3313 What are the prime factors of 5531720? 2, 5, 41, 3373 What are the prime factors of 4266641? 439, 9719 What are the prime factors of 5424017? 5424017 What are the prime factors of 6857291? 7, 41, 23893 List the prime factors of 25755997. 25755997 List the prime factors of 7571400. 2, 3, 5, 12619 What are the prime factors of 575593? 575593 What are the prime factors of 261497? 19, 13763 What are the prime factors of 8345244? 2, 3, 79, 8803 What are the prime factors of 197755? 5, 39551 What are the prime factors of 870526? 2, 435263 List the prime factors of 2051566. 2, 11, 93253 List the prime factors of 2567121. 3, 149, 5743 List the prime factors of 64805. 5, 13, 997 List the prime factors of 12290538. 2, 3, 13, 157571 What are the prime factors of 938563? 938563 List the prime factors of 28251994. 2, 17, 269, 3089 List the prime factors of 265309. 11, 89, 271 What are the prime factors of 4083059? 4083059 What are the prime factors of 1585473? 3, 528491 What are the prime factors of 11806637? 131, 90127 List the prime factors of 15099182. 2, 7, 37, 103, 283 What are the prime factors of 18048992? 2, 13, 43, 1009 What are the prime factors of 5374607? 7, 79, 9719 List the prime factors of 1080986. 2, 19, 28447 What are the prime factors of 417963? 3, 7, 13, 1531 List the prime factors of 342844. 2, 85711 List the prime factors of 263450. 2, 5, 11, 479 What are the prime factors of 2722391? 7, 7937 What are the prime factors of 350417? 19, 18443 What are the prime factors of 271439? 7, 17, 2281 List the prime factors of 22241711. 821, 27091 List the prime factors of 945002. 2, 89, 5309 List the prime factors of 1130045. 5, 7, 83, 389 What are the prime factors of 23547043? 13, 29, 62459 List the prime factors of 9815578. 2, 4907789 What are the prime factors of 14670467? 7, 787, 2663 List the prime factors of 417872. 2, 7, 13, 41 What are the prime factors of 4657157? 1289, 3613 What are the prime factors of 317723? 7, 45389 What are the prime factors of 14478036? 2, 3, 71,	{ "pile_set_name": "DM Mathematics" }
term in -134, -170, -214, -272, -350? -454 What comes next: -24, -85, -208, -423, -760, -1249, -1920? -2803 What is next in -35, -60, -79, -92, -99? -100 What comes next: -8, 14, 58, 136, 260? 442 What is the next term in -37, 114, 359, 692, 1107? 1598 What is the next term in -75, -121, -165, -207, -247, -285? -321 What is the next term in 66, 272, 616, 1098? 1718 What is the next term in 39, 40, 39, 36, 31? 24 What comes next: -10, 31, 144, 365, 730? 1275 What is next in 170, 346, 522? 698 What is the next term in -75, -148, -221? -294 What is next in 61, 255, 569, 997, 1533, 2171, 2905, 3729? 4637 What comes next: 32, 37, 28, 5, -32, -83, -148? -227 What comes next: 114, 112, 116, 132, 166? 224 What is the next term in 3187, 3190, 3195, 3202, 3211, 3222, 3235? 3250 What is next in 24396, 24395, 24394, 24393? 24392 What is the next term in -12, -1, 10, 21? 32 What is next in -6, 10, 40, 90, 166, 274, 420, 610? 850 What comes next: 146, 230, 314, 398? 482 What comes next: 1416, 2834, 4252? 5670 What is the next term in -340, -320, -288, -244, -188, -120? -40 What is the next term in 118, 464, 1040, 1846, 2882? 4148 What is next in 144, 145, 146, 147? 148 What is next in 1083, 2160, 3237, 4314, 5391, 6468? 7545 What is next in -891, -1783, -2671, -3549, -4411, -5251, -6063, -6841? -7579 What comes next: -133, -134, -135, -136, -137, -138? -139 What is the next term in -127, -512, -1143, -2014, -3119? -4452 What is next in -3228, -3229, -3230, -3231, -3232? -3233 What comes next: 171, 185, 201, 219, 239, 261? 285 What is the next term in -12, -21, -32, -45, -60? -77 What comes next: -61, -56, -51? -46 What comes next: -4, 13, 36, 65, 100, 141? 188 What comes next: -36, -43, -52, -63, -76? -91 What is the next term in 177, 173, 161, 135, 89? 17 What is next in -94, -175, -256, -337? -418 What is next in 33, 31, 27, 21, 13, 3? -9 What is next in -1452, -2898, -4354, -5826, -7320, -8842? -10398 What comes next: -3, -9, -17, -27, -39, -53? -69 What is the next term in 197, 227, 267, 323, 401, 507, 647? 827 What is the next term in 1449, 5807, 13063, 23211, 36245? 52159 What is the next term in -70, -148, -234, -328, -430? -540 What is next in 2, -55, -148, -277, -442, -643, -880? -1153 What is next in -119, -205, -289, -371, -451? -529 What is next in -55, -67, -87, -115, -151, -195, -247? -307 What is next in 107, 133, 181, 257, 367? 517 What is next in -3, -12, -25, -42, -63? -88 What is next in 1, -24, -65, -122, -195, -284, -389? -510 What is next in -632, -633, -632, -629, -624, -617, -608? -597 What is next in -11, -38, -83, -140, -203, -266? -323 What comes next: 25, 50, 83, 130, 197, 290, 415, 578? 785 What is the next term in -14, -14, 6, 58, 154, 306? 526 What is next in 0, -15, -62, -147, -276, -455, -690, -987? -1352 What is next in -3, -6, -11, -18, -27, -38? -51 What is the next term in 15, 23, 31, 39? 47 What is the next term in 38, 211, 502, 911, 1438, 2083? 2846 What comes next: 1448, 1472, 1496, 1520? 1544 What is the next term in 19, 20, 21? 22 What is next in 98, 197, 296, 395, 494? 593 What is the next term in 127, 122, 119, 118, 119? 122 What is next in -11, -10, -9, -8, -7, -6? -5 What comes next: 841, 1681, 2521, 3361? 4201 What is the next term in 20, 47, 82, 125? 176 What comes next: 40, 187, 536, 1189, 2248, 3815, 5992? 8881 What is the next term in -529, -530, -531, -532? -533 What is next in 101, 191, 281? 371 What is the next term in 6753, 6760, 6771, 6786, 6805, 6828, 6855? 6886 What is next in 70, 163, 318, 535, 814, 1155, 1558? 2023 What is the next term in -32, -27, -22, -17, -12, -7? -2 What is the next term in 18, 40, 62, 84, 106? 128 What comes next: 144, 33, -78, -189? -300 What is next in -18, -35, -60, -99, -158, -243, -360? -515 What is the next term in 99, 456, 1057, 1908, 3015, 4384, 6021? 7932 What is the next term in 24, 73, 176, 351, 616, 989, 1488? 2131 What is the next term in -46, -38, -8, 50, 142? 274 What is next in -127, -261, -405, -559, -723, -897, -1081? -1275 What is next in 22, 28, 38, 52, 70, 92, 118? 148 What is next in -184, -184, -186, -190? -196 What comes next: -2618, -2620, -2622, -2624, -2626? -2628 What is the next term in -479, -957, -1435? -1913 What comes next: 36, 35, 40, 57, 92, 151, 240? 365 What comes next: 795, 790, 785? 780 What is the next term in -314, -306, -298, -290? -282 What is next in -110, -216, -322, -428, -534, -640? -746 What is the next term in -42, -88, -122, -138, -130, -92? -18 What comes next: 44, 75, 132, 221, 348, 519, 740? 1017 What comes next: -80, -30, 22, 76? 132 What is the next term in -2, 7, 20, 31, 34, 23? -8 What comes next: -404, -822, -1240? -1658 What comes next: -57, -122, -199, -288? -389 What is next in 142, 150, 170, 208, 270, 362, 490? 660 What comes next: 34, 74, 114, 154, 194, 234? 274 What is the next term in 1238, 1242, 1248, 1256, 1266? 1278 What is the next term in -128, -157, -188, -221? -256 What is the next term in -15, -36, -77, -150, -267, -440, -681? -1002 What is next in -11, -36, -63, -92? -123 What comes next: -24, -56, -90, -126, -164? -204 What comes next: -8, 18, 60, 118, 192, 282? 388 What is next in 35, 101, 231, 443, 755, 1185, 1751? 2471 What is next in -7, -3, 5, 17, 33, 53, 77? 105 What is the next term in 1299, 2592, 3885, 5178? 6471 What is next in -28, -40, -16, 62, 212, 452? 800 What is the next term in 14, 9, -6, -37, -90, -171? -286 What is the next term in -1, 13, 29, 47? 67 What is the next term in 200, 404, 610, 818, 1028, 1240, 1454? 1670 What is the next term in -24, -32, -52, -90, -152? -244 What comes next: 9, 8, -1, -18, -43, -76? -117 What is next in -2915, -2909, -2903? -2897 What is next in -23, -18, 1, 40, 105, 202, 337? 516 What is the next term in -39, -80, -123, -168, -215, -264, -315? -368 What is the next term in 27, 20, 15, 12, 11? 12 What comes next: 11, 81, 215, 425, 723? 1121 What is the next term in 3393, 6790, 10189, 13590, 16993? 20398 What is the next term in 4, -18, -64, -134, -228, -346, -488? -654 What is next in 64, 129, 194, 259, 324? 389 What is the next term in 176, 1380, 4646, 11006, 21492, 37136, 58970, 88026? 125336 What is the next term in -233, -952, -2159, -3860, -6061? -8768 What is next in 3342, 3339, 3334, 3327, 3318, 3307, 3294? 3279 What is the next term in 175, 184, 197, 214, 235, 260? 289 What comes next: -840, -839, -838? -837 What is the next term in -51, -46, -39, -30, -19? -6 What comes next: 88, 173, 258, 343, 428? 513 What comes next: 1529, 1517, 1499, 1475, 1445, 1409? 1367 What is next in 101, 184, 269, 356? 445 What is the next term in -180, -130, -94, -78, -88, -130, -210, -334? -508 What is the next term in -3, -19, -61, -141, -271, -463, -729? -1081 What comes next: -422, -849, -1276, -1703, -2130? -2557 What is next in -3, -31, -93, -207, -391, -663? -1041 What is the next term in 440, 471, 522, 593, 684, 795? 926 What comes next: 522, 1029, 1536, 2043? 2550 What is next in -719, -732, -759, -806, -879, -984, -1127, -1314? -1551 What comes next: -155, -168, -205, -278, -399, -580, -833? -1170 What is the next term in -72, -73, -80, -93, -112, -137? -168 What is next in 24, 58, 92, 126, 160, 194? 228 What is the next term in 1, 8, 15, 22? 29 What is next in 14, -153, -606, -1489, -2946, -5121, -8158? -12201 What comes next: -12, -42, -92, -162, -252? -362 What is next in -27, -40, -67, -114, -187, -292, -435? -622 What is the next term in 9, 58, 141, 258, 409, 594? 813 What is the next term in 86, 101, 106, 95, 62, 1, -94, -229? -410 What is the next term in 41, 43, 47, 53, 61, 71, 83? 97 What comes next: -3976, -3985, -3984, -3967, -3928? -3861 What is the next term in -7, -35, -81, -145, -227? -327 What is the next term in 202, 166, 130, 94, 58? 22 What is the next term in -613, -641, -695, -781, -905, -1073, -1291, -1565? -1901 What comes next: 868, 866, 864, 862? 860 What is next in -754, -755, -756? -757 What is the next term in -54, -166, -400, -816, -1474, -2434, -3756, -5500? -7726 What comes next: 35, 44, 65, 104, 167? 260 What is next in -3384, -3386, -3390, -3396, -3404, -3414, -3426? -3440 What comes next: 45, 160, 457, 1026, 1957, 3340, 5265? 7822 What is the next term in 397, 386, 371, 352, 329, 302? 271 What is the next term in 1040,	{ "pile_set_name": "DM Mathematics" }
ng c is positive. c*(-337/33) Simplify (hh(2/7))(3/23)/(h/(((h/(hh(1/6)/h))/hh)/h)h/(h(-4)/h)) assuming h is positive. h(-6761/966) Simplify ((a(-3/26)a)/a)/a(31/5) assuming a is positive. a(-821/130) Simplify f*13/((ff(-28))/f) assuming f is positive. f41 Simplify ((t1)(-40))(-9/4) assuming t is positive. t90 Simplify ((m*(-10)/mm)/(m*(-11)m))*(-46) assuming m is positive. 1 Simplify (nnnn*(1/6)n)/(nnn/((n/(n/((n(nn*(-1))/n)/n)))/n)n)n(-1)n(-1/7) assuming n is positive. n(-125/42) Simplify (c(c(-38)/cc)/c)/(cc(7/6)) assuming c is positive. c(-241/6) Simplify (u/u(-3/13)u)(4/17) assuming u is positive. u(116/221) Simplify ((mm(-33))/m)(2/15) assuming m is positive. m(-22/5) Simplify ((i/(i/(i31/i)))/iii)(-2/65) assuming i is positive. i(-62/65) Simplify ((y/(y(-2/19)/y))/y)(1/6) assuming y is positive. y(7/38) Simplify ((p/p4)/p(p/(pp9/pp))/p)/(p/(p/((p(p/p(1/3))/p)/pp)))(-3/11) assuming p is positive. p(-152/11) Simplify (o/o*(1/2)o)(2/63)/(o(-1/6)/o(-5)) assuming o is positive. o(-67/14) Simplify (nnn(-33))0 assuming n is positive. 1 Simplify k/(k*7/k)k*5/kk*(5/4)k(-1) assuming k is positive. k(-3/4) Simplify j*(-7)j*(2/3)(j/j(-1/2))(-3/7) assuming j is positive. j(-293/42) Simplify (v(-1))(-5/4)/(v(2/7))(14/9) assuming v is positive. v(29/36) Simplify (b*2b)*(1/4)b(2/13)/b(-1/5) assuming b is positive. b(287/260) Simplify ((h4h)/(((h/(hh*(-3)/hh))/h)/h))/((h/(h/(hhh*(-6/11))h))/(hh(-4))) assuming h is positive. h(6/11) Simplify (f11f)/(f/(f((f(-10)f)/f)/ffff)) assuming f is positive. f4 Simplify (s1)47(ss/s(-1))(-32) assuming s is positive. s(-49) Simplify (k(-3/5)/k)(-15) assuming k is positive. k24 Simplify (m/(m/m(-1/8)m))(11/2) assuming m is positive. m(-99/16) Simplify zz(2/7)z(z/(zzz(1/10)))/z assuming z is positive. z(13/70) Simplify (ww/(w/w*3w)w)(-49)/(ww/((w*7w)/w)www/w(-6)www) assuming w is positive. w(-203) Simplify (l3l)/(ll/l*(-1/7))(l/(lll/l0))(-40) assuming l is positive. l*(573/7) Simplify (qqq(-4)q)/q*8(qq(-4/3))/qqq/q(2/5) assuming q is positive. q(-131/15) Simplify ((d(-2/3)/d)(1/5))(4/33) assuming d is positive. d(-4/99) Simplify (b(-15))(-46) assuming b is positive. b690 Simplify (ll(2/3))2/(l*5l(l(l*(-2/13)l)/ll)/l) assuming l is positive. l(-137/39) Simplify x(-1/5)x21 assuming x is positive. x(104/5) Simplify m*(2/27)/(mm*(-2/5)mm) assuming m is positive. m(-341/135) Simplify (l/l(-1)l(-1/7))(6/17) assuming l is positive. l(78/119) Simplify (q(-18)/(q15/q))19 assuming q is positive. q*(-608) Simplify (vv/v*4v/v*2v)/(vv(v/(vvvv(-2/5)v))/v(((v4v)/v)/v)/v) assuming v is positive. v(-12/5) Simplify z(5/4)z(17/3) assuming z is positive. z(83/12) Simplify (c(-1))33cc/c(1/4)c/(c/(c/c(-2/7))) assuming c is positive. c(-839/28) Simplify (ii/i3(ii(-1))/i)40 assuming i is positive. i(-80) Simplify ((n(-3))(-4/7))(-21) assuming n is positive. n(-36) Simplify o17/oooo(1/6) assuming o is positive. o(109/6) Simplify (w*(-9)ww(-9)/w)/(((w(2/13)w)/w)/((www8)/w)) assuming w is positive. w(-119/13) Simplify h*(-6)h*(-1)(hh/(hh(5/4)))/((h(-5)h)/h) assuming h is positive. h(-9/4) Simplify (o(5/4))(-22) assuming o is positive. o(-55/2) Simplify (o(-4))(-13/2) assuming o is positive. o26 Simplify (x4)(-29/2) assuming x is positive. x(-58) Simplify ((r/(r/r2))/r(-7))/(r0)(-2/7) assuming r is positive. r9 Simplify (u(2/23)uu(2/5))/(uu*(-2/9)u*(-5)u) assuming u is positive. u(4874/1035) Simplify (l(3/7))(-42) assuming l is positive. l(-18) Simplify a/(aa/(((a(2/37)aa)/aa)/aaa))a/a22 assuming a is positive. a(-701/37) Simplify (a/a(-2))(19/3)/((a/((aaa/(a(1/5)aaa)aa)/a))/(a/(a/a*(-4))a)) assuming a is positive. a(79/5) Simplify k37k(10/13)k assuming k is positive. k(504/13) Simplify k(2/13)k(2/9)k(kk(-1/2))/k(-1/4) assuming k is positive. k(995/468) Simplify ((s(-4))(-1/5))35 assuming s is positive. s28 Simplify a(1/7)aa20 assuming a is positive. a(148/7) Simplify (h*15hh(-9)h)(3/7) assuming h is positive. h(24/7) Simplify (h(-1)/(h(3/4)hh))/(hh6/hh/(hhh/h*(-3/5))h) assuming h is positive. h(-163/20) Simplify ((b(5/3)/b)/b)/b*(-3/4)(b(1/2))(-2/163) assuming b is positive. b(803/1956) Simplify (p/(p(6/5)/p))/(p*(-3)p)(p/p(-8)p)/ppp(-4) assuming p is positive. p(44/5) Simplify (u*8u)(-11/2) assuming u is positive. u(-99/2) Simplify (x/(x/(x(x/(xx/(x/(xx(-2/9)xx)xx)x))/xxx)))40 assuming x is positive. x(80/9) Simplify (t/((tt((t*0t)/t)/t)/tt)tt)(-3/5)/(tt*(-2/15)t*(4/5)t) assuming t is positive. t*(-58/15) Simplify ((((q/(qq*8))/qqq)/q)/(q(-2/5)/q))(14/9) assuming q is positive. q(-154/15) Simplify (x/(x/x0)x(-2)/x)(-3) assuming x is positive. x*9 Simplify ((ff*1f)(-49))(-28/3) assuming f is positive. f*1372 Simplify (xx/((xx(-1))/x))(7/2)/(x(-4/7)/xxxxxx/(x/x2)) assuming x is positive. x(85/14) Simplify x((xx/(x*(-4/7)x))/x)/xxx*(-9)xxxx(1/18)/(x/(xx/(xx(-9/4))x)) assuming x is positive. x*(-283/252) Simplify ((f(ff/f(-1))/ff)/ff)38/(ff*(-2/7)/ff)40 assuming f is positive. f(864/7) Simplify z*(-27)z(-1/5) assuming z is positive. z(-136/5) Simplify (d5/d9)/(d/(dd/d(2/5))d((d(2/27)d)/dd)/d) assuming d is positive. d(-604/135) Simplify (j/j(1/4))/(jj(jj/(j/((jj/(j/j(2/5)j))/j)))/jj)(jjj(jj/j(-1))/j)(-3/5) assuming j is positive. j(-93/20) Simplify (i(-1/3))(2/41)/(i/(i(-2/5)/i))(-6/13) assuming i is positive. i(8726/7995) Simplify ((h/h(-1/2))(-2/37))(-5/17) assuming h is positive. h(15/629) Simplify (n/((n/n*(2/63))/n))/((n/(n(n/(n/n*(-6/11)nn))/n)n)/nn) assuming n is positive. n(-2435/693) Simplify (b(1/4))(-10/3)/((bb/(bbb/b*(-5)bb)bb)/(b/((b/(b/b4))/b))) assuming b is positive. b(19/6) Simplify c((c/c*30)/c)/c(cc(2/43))/c assuming c is positive. c(-1288/43) Simplify ((ii/i37)/i)35 assuming i is positive. i(-1260) Simplify (w(-6/5)w/(www8w))(-3) assuming w is positive. w(168/5) Simplify ((z*(-2/15)z)/(zzzz5))/(((zz*2/zz)/z)/(z(-1/10)/z)) assuming z is positive. z(-307/30) Simplify ((ll/(l(-3)/l)l)/l)/((l/(llll/l(-2/3)l))/l)((l(((((l/(l*(-2/5)/l))/l)/l)/l)/l)/lll)/l)(-38) assuming l is positive. l(517/15) Simplify k4/((k/k(-2/7))/k) assuming k is positive. k(26/7) Simplify b/(((b/(b/((b(4/9)b)/b)))/b)/bb)bbb(-35/6)/b assuming b is positive. b(-59/18) Simplify (c(5/6)/(c(-6)c))(-4/27) assuming c is positive. c(-70/81) Simplify k/(kk*(2/3)/k)(k*(1/2)/k)/k(k*(-2/5)kk)/(kk*(-3)k) assuming k is positive. k*(43/30) Simplify ((ss*(3/5))/(s/(ss*4s)))(-1/14) assuming s is positive. s(-33/70) Simplify ((yyyy(1/3))/y)0/(y(-2/13)/yy/(yy(-6))) assuming y is positive. y(-63/13) Simplify (w3)(1/4) assuming w is positive. w(3/4) Simplify (g/g(-2/15))(1/5) assuming g is positive. g(17/75) Simplify (x1x)*(-8/5)((x/(x/x*(-5)x))/xx)/x(-6) assuming x is positive. x(-16/5) Simplify (f(-1/4)/f2)(8/11) assuming f is positive. f(-18/11) Simplify (i(2/9)(i/i(-5/3))/i)(5/2) assuming i is positive. i(85/18) Simplify (h/h38)/h(-21) assuming h is positive. h(-16) Simplify ((cc/c(-18)cc)/c)/(c(-2/21)/c) assuming c is positive. c(464/21) Simplify n/(n/(n(2/11)n))n(2/23) assuming n is positive. n(321/253) Simplify ((m(8/3))(-4))(-17) assuming m is positive. m(544/3) Simplify (b(-2)b)/(b/(b(b/((b/b(2/9)b)/b))/b))(bbb(1/4))(-11/3) assuming b is positive. b(-361/36) Simplify (w(2/5)/w(-8))/(((www1ww)/www)/w)(8/5) assuming w is positive. w(2/5) Simplify (u(uuu*(3/19)u*u)	{ "pile_set_name": "DM Mathematics" }
et j(s) = -s + 2. Let o be j(2). Suppose o = -2z - 0 + n. Solve -2 = q - z for q. 1 Let w(d) = -d3 + 8d*2 - 4d + 1. Let g be w(8). Let q = -22 - g. Solve 0c - 3c - q = 0 for c. -3 Suppose -1 = 3f - 4. Let a(v) = -v2 + 5v. Let t be a(4). Suppose 4m = -20, -3u = 2u + 5m. Solve u - f = -tc for c. -1 Suppose 6 = i + 2. Solve 0 = -3u - u + i for u. 1 Suppose 2t = -5v + 4, 5v + 4t - 8 = -0t. Suppose v = -0s + s - 84. Suppose -4z + 56 = 2f + 2f, s = 5z - 2f. Solve -2k - 2k + z = 0 for k. 4 Let q(s) = s + 4. Let g(t) = 2t*2 + 2t - 2. Let w be g(2). Suppose 5a = -4x - 0a + 10, 5a = 3x + w. Let l be q(x). Solve 4i + 8 = -l for i. -3 Suppose 13 + 1 = 7k. Solve -3v = kv for v. 0 Let c = -9 - -14. Solve 0 = -cr + 17 + 3 for r. 4 Let w(h) = h*3 - 7h*2 - h + 3. Let c be w(7). Let x be (-3)/12 + (-9)/c. Suppose z = -4j - 2, -2z + 0 = -2j + 4. Solve xn + 3n + 5 = j for n. -1 Let j be -2 - (-5 + -5 + 3). Solve 0h = jh - 25 for h. 5 Let v be (-28)/(-10)(2 - -8). Suppose 0z - 4s = -5z + v, 4z + 2s - 12 = 0. Solve 2p = p + z for p. 4 Let l be (-58)/(-18) + 2/(-9). Suppose 6 = 5v + m, 0 = -5m + m - 16. Let d = v + -1. Solve d = 2k + l for k. -1 Let l(q) = q*2 - 12q - 42. Let j be l(15). Solve k + j = -0k for k. -3 Let m be (25/(-10))/((-2)/4). Suppose -m = -3i - 4g + 1, -2i = 4g - 4. Let u be 9/i6/9. Solve -5s - u = -18 for s. 3 Let s(g) = -g2 + 2g + 8. Let j be (2 + -8)2/(-4). Let q(v) = v + 1. Let w(c) = jq(c) - s(c). Let o be w(4). Solve -f - o = 4f for f. -3 Let n(w) = -w + 4. Let m be n(-6). Let y = 12 - m. Solve 0 = 3k + yk for k. 0 Let g(j) = -j3 - 2j*2 + 3j. Let l be g(-3). Suppose lh = 4h. Solve -2v + h - 6 = 0 for v. -3 Let s = 1 + -9. Let i = s - -7. Let w be (-4 + -12)i/2. Solve 3 = z + w for z. -5 Let z(u) = -5u3 - 8u*2 - 6u - 6. Let x(o) = -9o3 - 15o*2 - 11o - 11. Let i(j) = -6x(j) + 11z(j). Let c be i(2). Solve 3y + 1 - 10 = c for y. 3 Suppose 0 = -5n + r + r + 21, 5n - 35 = -5r. Suppose -nb + 2 = 5a + 67, -57 = 5b - 3a. Let s = 20 + b. Solve -g - g = s for g. -4 Let o = -94 + 97. Solve -4 = q - o for q. -1 Let q = 9 - 4. Suppose qh - 10 = 0, 6o + 3h - 166 = o. Suppose 3j - 4k - o = 3, -j + 3k = -20. Solve jc + 5 = 4c for c. -5 Let r(y) = y + 11. Let o be r(-11). Suppose 0 = 3j - 6, oz + 2z - 8 = -4j. Solve 3 + z = 3a for a. 1 Let w be (-80)/3108/(-48). Suppose -4v + 41 = 3f, 2f - 6f + w = 4v. Solve 1 = -4b - f for b. -5 Let r = -63 - -66. Solve rk + 12 = 3 for k. -3 Suppose -c + 4t - 2 = 4, t = -5c + 12. Solve -j + cj = -5 for j. -5 Let i(z) = z + 11. Let v be i(-6). Suppose -5x + 60 = 40. Solve vw = x + 21 for w. 5 Let k be 15/(-20)(-8)/(-2). Let p(x) = -x2 - 2x + 4. Let l be p(k). Let u(s) = s*2 - 5s - 6. Let a be u(6). Solve a = 4r + 19 + l for r. -5 Suppose 3v + 5k = -25, -4k + k = -v - 13. Let c = 11 + v. Solve -c - 1 = n for n. -2 Let q = -10 + 14. Let p(b) = -b*2 + 5b + 2. Let v be p(4). Let z(l) = l*2 - 6l. Let s be z(v). Solve qw + w = s for w. 0 Let f = 112 - 103. Solve fp - 11p = -8 for p. 4 Suppose -3u + 3 + 3 = 0. Suppose 0 = um - 0m. Solve c = -mc - 2 for c. -2 Let u be (2/(-4))/(1/(-22)). Suppose -4p - u = -2t + 1, 12 = -3p. Let w = t - -3. Solve w = 5h - 4 for h. 1 Let f = -8 + 11. Suppose -5r + 2b - 6b = -20, -fb = -3r - 15. Solve 0n + n - 5 = r for n. 5 Let n be 3/6-1-6. Suppose 2h - 4 = -0h - r, h - 1 = -r. Let p = n - h. Solve pi + 4 = 4i for i. 1 Let t be (-54)/(-16) + (-12)/32. Solve 2j = tj for j. 0 Suppose -45 + 95 = 5i. Solve -15 = 5v - iv for v. 3 Let k = 17 + -5. Let d = k + -8. Solve -6 = -2f + d for f. 5 Let m be 20/(-30)(-3)/2. Solve 2a - m - 3 = 0 for a. 2 Suppose 0 = -g + 4j - 13, 8 = 2j - 0j. Solve gh = -7 - 8 for h. -5 Let s be ((-21)/28)/(2/(-8)). Let q(x) = -x3 + 4x*2 - 2x. Let a be q(s). Solve -ay + 0y = 12 for y. -4 Suppose 3z + 29 = 3i - 2z, i + 2z - 6 = 0. Suppose -g + i - 4 = 0. Solve 0a - 20 = -ga for a. 5 Suppose 43 = 5x + 18. Solve -8 = -xw + 7 for w. 3 Suppose -s - 2s + 5s = 0. Let a = 1 - 1. Let t = a - 0. Solve s = -ti - i - 2 for i. -2 Let i = -20 + 20. Solve -6 + i = 2c for c. -3 Let u(r) = -r*2 - 1. Let i be u(0). Let k = -1 - i. Solve k = -c + 3 - 1 for c. 2 Suppose -n = -6n + 15. Suppose -nf + 1 = -5. Solve fo - 3o - 1 = 0 for o. -1 Let o(x) = -x2 - 3. Let u be o(0). Let j be (u/2 + 1)0. Suppose j = -2t + 2f, 4t - t - 2f = 0. Solve 7l - 4l = t for l. 0 Let x(h) = -h*2 - 4h - 1. Let a be x(-3). Let i be (2 + (-10)/4)a. Let k be 0/(-2)-1i. Solve -b = -k - 2 for b. 2 Let r = 11 - 6. Let c = r + -1. Solve -ch = -h for h. 0 Let k = -7 - -10. Suppose -5m + 59 = -3w, -kw + 23 = 2m - 4w. Let g = -2 + 2. Solve g = -2x + 2 - m for x. -4 Suppose 3c = 7c - 5v - 28, 16 = 2c - 3v. Solve 25 = -cn - 3n for n. -5 Suppose 0u - 6 = 2u. Let h be ((-16)/u)/((-18)/(-27)). Solve 0 = f + f + h for f. -4 Let t = 12 - -7. Let w = -12 + t. Suppose -wu + 68 = -3u. Solve -u = -4v + 3 for v. 5 Let l = -2 - -21. Let r = -14 + l. Let g = 2 - -1. Solve rt - g = 22 for t. 5 Suppose 5n - 3n = 0. Suppose -2l - 1 + 9 = n. Let k be ((-2)/(-3))/(l/30). Solve -km - 28 = -3 for m. -5 Let m = 25 - 12. Let h = m - 11. Solve ht - 12 = -2t for t. 3 Suppose -c + 5c - 28 = 0. Solve -5p + cp = 8 for p. 4 Let n = 5 - -5. Solve -3a = -a + n for a. -5 Suppose -3 = -6d + 21. Let b(a) = a*2 + 5a - 5. Let s be b(-6). Let k = s - 1. Solve -dt - 1 - 3 = k for t. -1 Let x be 32 + 0/3. Let w be x(3 + 14/(-6)). Solve -m + w = -1 for m. 5 Let a = -5 - -9. Solve 2g = -a - 0 for g. -2 Let j = 12 - 7. Suppose -12 = 3u + 4q, 2q + j = u - 1. Solve k + 4 = -uk for k. -4 Let t = 7 + -7. Let u be (t/(-1))/(-1) + 8. Let h be -2(-10)/82. Solve -f + u = -hf for f. -2 Let m(l) = -l2 + 5l + 4. Let h be m(5). Solve -1 = g + h for g. -5 Let g be (2/(-5))/((-1)/5). Let v be 2/((-1)/((-26)/4)). Suppose -3z + v = y, -3z = -2z - 5y + 1. Solve -gt + zt - 8 = 0 for t. 4 Let k = -38 + 54. Let r = -25 + k. Let x = r - -11. Solve -4 - x = 3m for m. -2 Suppose 4s = 5o, -4s + 5s + 4o - 21 = 0. Solve h = sh - 8 for h. 2 Let a = 3 + 0. Suppose -3y - 2g + 3 = -16, 4y = -ag + 27. Solve -yw = -7w - 8 for w. -2 Let f(p) = 2p - 9. Let a be f(7). Suppose 0 = 3u + b - 0b - 1, -2u - 5b + 5 = 0. Let x(m) = -m + 2. Let s be x(u). Solve -s = ad + 3 for d. -1 Let i = 10 + -7. Let t(g) = g2 - 8g + 9. Let p be t(7). Suppose k - 6x + px = 25, -20 = -k + 3x. Solve -kc - i = 7 for c. -2 Let i be 1/(-2) + (-18)/(-4). Let d(r) = 3r3 + r2 - r. Let q be d(1). Solve ql - 3 = il for l. -3 Let x be (-3 - (-200)/35) + (-2)/(-7). Solve 7 - x = s for s. 4 Let h(u) = 47 + 5u - 50 - u. Let m = 7 + 0. Let y be h(m). Solve -4n - n = y for n. -5 Suppose 6r + 175 = 13r. Solve 5z + r = -0 for z. -5 Suppose 5s = 4j + 1 - 22, 4s = -4j + 12. Let g = 31 - 21. Solve -2 + g = -jt for t. -2 Suppose -2v - 6 = -5v. Solve -5a - 6 = -va for a. -2 Let h be (3/2)/(10/20). Suppose 3r + 0 = 6. Suppose -rq = -q. Solve 0 = -qw + w - h for w. 3 Let x(k) = k*2 - 2k + 3. Let w be x(1). Solve 0 = wc - 3c - 5 for c. -5 Let o = -11 + 19. Suppose 3m - 3z = 20 - o, -z + 8 = 2m. Solve -mv + 9v = -20 for v. -4 Let o = 43 + -33. Solve -6k + k = -o for k. 2 Suppose 5u - 60 = 3f, 0u - 2u + 5f = -5. Solve 0 = 7n - 2n - u for n. 3 Let b(r) = -7r + 1. Let f be b(0). Suppose 4h = -0h + 12. Solve -hu - 11 = f for u. -4 Let z(o) = -o - 8. Let i be z(-10). Solve w - iw = -2 for w. 2 Let o be (5 + -2)(-208)/12. Let r be 6/21 + o/(-14). Solve 5f = r + 1 for f. 1 Suppose 0p - 5p = a + 7, 0 = a + 2p + 1. Suppose aj - 8 = 1. Solve 2w + jw - 15 = 0 for w. 3 Suppose 7k - 3r + 2 = 3k, -5k = 2r + 14. Let x be (5 + -2)/((-3)/k). Solve -x - 3 = f for f. -5 Suppose 0 = -9m + 4m + g - 30, -3g + 30 = -3m. Let u = 5 + m. Solve uw - 4w = -8 for w. 2 Let c(t) = 2t - 25. Let f be c(14). Solve -5v = -fv for v. 0 Let d be (8/(-4))/(4/(-22)). Let q(p) = -2p2 + 2p - 4. Let x(n) = -n*2 + n - 2. Let o(k) = dx(k) - 6q(k). Let t be o(0). Solve -t = -2w + 8 for w. 5 Let p be (-16)/(-40) - (-26)/10. Solv	{ "pile_set_name": "DM Mathematics" }
- (-4 - -2 - 4))? 9 What is -359 + 354 - (92 - ((-9 - -4) + 7))? -95 What is the value of -2 - -20 - (-8 + -53)? 79 What is (-22 + 17 - -6 - (4 + -4)) + -92? -91 (15 + -5 - 5) + (1 + -1 - 15) -10 What is -77 + 1 - (24 + -7 + -10 + 22 + -17)? -88 What is the value of -123 + (98 - -91 - -19)? 85 Evaluate 7 - (111 - (63 - (39 - 19))). -61 13 + (1 + (8 - 21) - -3 - 72) -68 Evaluate -3 + 2 + (0 - 6) - (60 - (52 - -28)). 13 What is the value of -37 - (-135 - 8 - -46)? 60 Evaluate 1 + (38 - 145) - (-16 + -4) - 2. -88 (-14 + 30 - 5 - -13) + 45 69 What is 55 + (51 - (50 - (46 + -27)))? 75 Calculate (431 - 497) + 15 + 0 + -7. -58 (-132 + 58 - -12) + 138 76 Evaluate (15 - (3 - (2 - (4 - 0)))) + (-333 - -421). 98 What is the value of 8 + 2 + -3 + 48 + (-133 - -86)? 8 Evaluate -8 + (-13 + -7 + 16 - 10) + 15. -7 What is the value of (5 - 6) + (2 - ((7 - 5) + -12))? 11 Evaluate -50 - (13 + 2 + -14) - 1. -52 1 + -23 + (-66 - -55 - -81) 48 What is the value of 35 + 17 + -5 + -34? 13 What is 87 + (-45 - 47 - -72)? 67 Calculate -41 + 30 + (2 + 38 + -11 - -5). 23 Calculate 15 + -37 - (-8 + (-18 - 2)) - 85. -79 What is (32 - -30) + (151 - 255)? -42 What is the value of -23 + -18 - -21 - (9 + -80)? 51 Evaluate 23 + (3 - -22) - (1 + 18 + (-27 - -18)). 38 Evaluate -22 - 60 - -84 - -86. 88 What is the value of -27 + 19 - (69 - 86)? 9 96 + (-32 - 12) + (-8 - -23) 67 -9 + (4 - 46) - 16 -67 What is the value of -30 - (-9 - ((-63 - -34) + 166))? 116 What is 157 + -122 - (52 + 2)? -19 -17 + 12 + -8 + (-1 - (0 - (-1 + -10))) -25 -10 - (0 + 1) - (-14 - ((-38 - -97) + -157)) -95 5 + 9 + 2 - 17 - (-48 + -6) 53 Calculate -13 - (-29 - ((-5 - -7) + 10)). 28 Evaluate 484 + -493 - (-7 - -7). -9 (-16 - (29 + -21)) + 6 - (1 - 84) 65 (87 - -21) + -79 + -29 + 0 0 What is the value of 88 + (-24 - (-19 + 1 + 6)) + (10 - -3)? 89 Calculate 42 - (135 + -64 - 107). 78 Evaluate (-52 - -12) + 23 - (-2 - 5) - 9. -19 What is -77 - (3 - (-8 - (5 - -1)) - 15)? -79 -7 - (-8 + 7 + (3 - 14) + 57) -52 What is the value of 81 - (-30 + 59) - 144? -92 What is (1 - 4) + (2 - 7 - ((55 - 95) + -8))? 40 What is the value of -29 - 40 - (-10 - 52)? -7 Calculate (-33 - -44 - 90) + 37. -42 Evaluate 16478 + -16497 + (-1 - (1 - -22)). -43 -84 - (-89 + 104) - -60 -39 Calculate (40 - (59 - (59 + -39))) + (2 + -1 - 112). -110 What is the value of 1 + 13 + (55 - 39) + -3? 27 Calculate -35 - (10 - 36 - 9) - (-7 + 0). 7 What is (3101 - 3083 - (108 - (-2 + 4))) + 9? -79 -106 + -1 + 4 + -12 + (-24 - -23) -116 Calculate -21 + 7 + -9 + 28 - 4. 1 Evaluate -3 + -63 - (1 - 34). -33 What is the value of -12 + (-7 + 25 - 9) + -4 + 0? -7 20 + (-95 - (8 - 2 - (144 + -152))) -89 What is 42384 + -42332 - ((1 - 1) + 4 + (0 - -1))? 47 Calculate 66 + (-76 - -42) + 41. 73 28 + 55 + (-123 - 26) -66 Calculate -12 + (26 - 13 - 0) - (6 + -70) - 4. 61 Evaluate 6 - 63 - -61 - 20. -16 Calculate -14 + 14 + (5 - (-6 + 2)). 9 Evaluate 73 + -11 + -57 + 49. 54 3 + (8 - (9 + -13) - (-5 + 19)) 1 What is the value of (30 - (-1 + 2)) + -5 + (-11 - -23) + -6? 30 Evaluate (-2 - -29) + 73 + (-78 - -48) + -61. 9 What is the value of -7 + 3 + (11 - (3 + -59) - -3) + -6? 60 What is 14 + (24 - 14 - -1) - 20? 5 What is (38 - -5) + (-6 - ((-17 - -29) + -12))? 37 Evaluate -7 + (45 - (-11 + (5 - (-14 + 13)))). 43 What is the value of 31 + -4 + -4 + -91 + 22? -46 What is the value of (91 - 70 - -11) + -26? 6 Calculate 29 + (2 - 19) - (-5 + -7 + 61 - 4). -33 -66 - (1 + -6) - (-4 - (-41 - -37)) -61 21 + 4 + -21 + 6 + 34 + -2 42 What is 45 - (4 - 8 - (10 + -17)) - (-1 + -1)? 44 What is 2 + 150 + (2461 - 2662)? -49 What is the value of 1 + (-13 - (-2 - -1 - 2)) + (269 - 238)? 22 What is -32 - (-22 + 45 + -6) - (-1 + 5)? -53 What is (-15 - 7) + 12 + 0 + (-17 - -2)? -25 9 + 2 - (-3 + ((5 - 3) + -7 - -11)) 8 What is (2 + 4 - 5 - (5 - 15)) + 311 + -369? -47 Calculate 8 + (-3 - -4) + -85 + 3 + -14. -87 What is the value of (-10 + -20 + 44 - -7) + 31? 52 What is 9 + (-49 - (-29 - -5)) + 20? 4 What is the value of (-49 - 54) + 115 + -108? -96 What is -4 + 1 + 7 + -8 + (10 - (-11 - -19))? -2 Evaluate (-2 - 25) + (-164 - -164). -27 Calculate 131 + (-63 - -27) + -59. 36 What is (-25 + 24 + 6 - -77) + -4 + 9 + -4? 83 What is -1638 - -1661 - ((-1 - 0) + 88)? -64 What is the value of 20 + (-4 - 0) + 418 + -426? 8 What is the value of (-6 - (-16 + 6) - -15) + -31? -12 What is the value of 11 + (49 - (3 - (0 + -8 - -8)))? 57 15 + (-2 - -13 - (70 + -46)) + 9 11 -3 - (-8 + 56) - -27 -24 Evaluate 43 + (-43 - -25) + (3 - 0). 28 What is the value of 18 + (34 + (2 - 24) - -43)? 73 What is -66 - (-50 - 32 - -33)? -17 What is (-5 - (-4 + (-3 - (8 - 6)))) + -1 + 5? 8 What is the value of 1335 - 1392 - (-12 + 0) - 24? -69 Evaluate (11 - 0) + (-58 - (33 - 86)) - (0 + 22). -16 What is (-46 - 1) + (-138 - (-40 + -87))? -58 -10 + 1 + 16 + (29 - 14 - 81) -59 -13 + 34 + (8 - (-24 + 1)) 52 Evaluate 1 + -9 - (-7 + 36 + -23 - 51). 37 What is -257 - -173 - (-32 - 87)? 35 What is the value of -5 - -93 - ((-30 - -3) + 53 - 23)? 85 Evaluate -3 - -61 - (-98 - (-102 + -22)). 32 What is the value of (-2553 - -2519) + (58 - 0)? 24 What is 5 - (445 + -453 + 3 + -2 + 0)? 12 Calculate -58 + 39 - ((33 - 3) + -11). -38 Evaluate -1433 - -1391 - (-70 + -1). 29 What is -72 + ((-3 - -10) + -3 - (-3 - (-8 - 1)))? -74 22 - (9 + 6 - 14 - 4) 25 75 - (-13 + 23 + 4) 61 71 + -121 + 157 + -6 101 (-42 + 38 - (1 - (55 - 0)) - 4) + -1 45 What is the value of -41 - (-21 + 61 + -26) - 7? -62 (0 - -105 - 1) + (9 - (-32 - (7 + -41))) 111 What is 25 - (-155 - (-183 - -130))? 127 What is 1 + 1 + (-3 - -50) + (9 - 145)? -87 Evaluate -40 - (13 + (0 + 2 - (44 - 41))). -52 -120 + 9 + 67 + (-2 - -8) -38 Calculate -21 + 5 + (0 - 74 - -18). -72 -18 + (23 + (30 - 46) - ((8 - 2) + 1)) -18 Evaluate 1027 + -992 - (-1 - -2). 34 -43 + -16 + 17 + 0 + 0 -42 -11 - (-5 - (-1 - 2) - 10) 1 What is the value of -1 + 5 + (-285 - (-253 + 18))? -46 24 + (1 - (-24 + 2 + 6 - -10)) 31 What is the value of 5 + -18 - (-14 + (24 - (38 - 20)))? -5 What is -94 + 72 - -9 - (-29 - 1)? 17 What is the value of -17 + -84 + 65 + (2 - -29)? -5 What is 2 - 32 - (-1 + -2) - (-25 + -11 + 27)? -18 Evaluate -145 + (46 - (-26 - -68)). -141 Calculate (-3 - 54) + (9 - (34 + -15 + 0 - 3)). -64 Calculate 36 + -33 + -54 - 5 - (-1 - 6). -49 Evaluate (5 - (-2 - -2)) + -8 - (441 - 404). -40 Evaluate -44 - (25 + 55 + 45) - -46. -123 What is -68 + -8 + (-25 + 21 + 1 - (-12 - 0))? -67 Calculate 12 - (-8 + -3 - -8) - (-25 - 11). 51 Evaluate -16 + (-9 - 33 - -12) + 24. -22 What is (46 - 91) + 119 - 181? -107 What is -142 + (265 - 144) - (-3 + -1 + -11)? -6 What is the value of -34 - (71 - (15 - -18))? -72 Calculate (227 - 216) + (42 - 15) + (-1 - 8). 29 Calculate 1 - -68 - (-9414 - -9449). 34 Calculate 0 - (-3 + -48 + (13 + 8 - 16)). 46 Calculate (-10 - -16) + 7 - (25 + -3 + 16 + 3). -28 What is (-41 - -19 - 44 - -8) + 10? -48 Evaluate (-94 - -62) + -5 + 64. 27 Evaluate (-39 - (16 + -66)) + 30. 41 Evaluate 4 - 3 - (0 + -11) - (6192 - 6187). 7 What is the value of -64 + 58 - (12 - (-1 + -8))? -27 What is 12 + (-54 - (11 + -55)) + -21 + -1? -20 (-8 - -1) + 3 - (1555 + -1472) -87 Evaluate (1115 - 1119) + (0 + -1 - 13). -18 Evaluate -623 + 557 - (-8 - -20). -78 What is the value of 4 + -5 + 2 - (-109 - -115)? -5 What is 49 - -40 - ((-3 - -1 - 4) + (2 - -2))? 91 What is (-3 - 24) + (29 - (116 - 59))? -55 Calculate (34 - (63 - 47)) + -87 + 1. -68 What is the value of 7 - (-51 - (-37 + 17) - 24)? 62 Calculate 10 + 26 + -19 - (30 - -9) - 46. -68 (33 - 23) + -14 - (-4 + (-9 - -11) - 52) 50 (-23 - -55) + (59 - 29) + 64 126 What is the value of -13 + (14 - -2 - (7 - -3)) + 4 + -3? -6 What is (21 - -9 - 1) + (0 + 1 - -1)? 31 Calculate 25 + (117 - 355) + 122. -91 What is (3 - (-70 + 55)) + (0 - 44)? -26 Evaluate 34 - (-8 + 23 + 40). -21 What is 326 + -343 - (-11 - (4 - 152))? -154 What is (-75 - -1) + -16 + (-1 - -10) + 21? -60 -45 + (-83 - (-99 + 15)) -44 Calculate 1 + 4 - 0 - (56 - 78). 27 -15 + -8 + (89 - (56 + 32)) -22 Evaluate 32 - (10 - (60 - (82 + -45))). 45 9 + 54 - 74 - 40 -51 6 + -17 + 12 - (9 - -7) -15 (-1 - -9) + (-17 + 10 - -1) - (-53 - -7) 48 3 + -11 + 16 + (-16 - 18 - 13) -39 What is 8 + -2 + -12 + 2 - (1 - (-4 - 55))? -64 What is the value of (32 + -19 - 12) + -7 + 6 + (5 - 6)? -1	{ "pile_set_name": "DM Mathematics" }
rivative of 1579k4 + 1487k + 943478 wrt k? 6316k3 + 1487 Differentiate 992d*2 + 6816d - 31293963 wrt d. 1984d + 6816 What is the second derivative of -19071y*3 + 17y*2 - 1015y + 9353? -114426y + 34 What is the derivative of 67338761d*2 + 77490515 wrt d? 134677522d Find the second derivative of -4847662gk*2 + 8g + 3k - 210944 wrt k. -9695324g What is the third derivative of 274996a5m3 - a5 - 86285a2m*3 - 4a + 3m3 wrt a? 16499760a*2m*3 - 60a*2 What is the second derivative of -112252cm2q*2 + 76cm2 + 19cmq*2 - 12cmq - 5432c + 9mq2 + 2q wrt q? -224504cm*2 + 38cm + 18m Find the third derivative of 12724078t3 + 14135t*2 - 527t wrt t. 76344468 What is the first derivative of 4822704d4o*3 - 28do3 + 2o*3 - 184016763o wrt d? 19290816d3o*3 - 28o*3 Differentiate -1112m*2w*2 - 24563mw3 + 41607w*3 + 247w wrt m. -2224mw*2 - 24563w*3 What is the second derivative of 3q*4t*2 + 148209q*4 - 371qt2 + 2q - 105t2 + 16 wrt q? 36q*2t*2 + 1778508q*2 What is the second derivative of 1170720664g*2 - 851306370g wrt g? 2341441328 Find the first derivative of 65457816b3 - 186635336. 196373448b*2 What is the derivative of -601h*4 - 12285h*2w - 137901368w wrt h? -2404h*3 - 24570hw Find the third derivative of -976679at3 - 10at2 + 1578at + 2a - 3t6 wrt t. -5860074a - 360t3 Find the third derivative of -51179832p3 + p2 - 1713542p + 8. -307078992 Differentiate -29123916dh2 + 3h*2 - 4258932 wrt d. -29123916h*2 What is the second derivative of 120853493n*2 - 17381845n wrt n? 241706986 What is the first derivative of -2209418hl*3 + hl*2 - 13h + 1237l3 + 48368l*2 wrt h? -2209418l3 + l2 - 13 What is the second derivative of 221236a3s*2 - 4a*3 + 388a*2s - 3as*3 - 1626s wrt s? 442472a3 - 18as Find the first derivative of -38688816y*2 - 31136919 wrt y. -77377632y Find the second derivative of -31f3 + 270932f*2 + 28720025f wrt f. -186f + 541864 What is the third derivative of 115s*4 + 3832s*3 + 163s*2 + 21124 wrt s? 2760s + 22992 Find the third derivative of 144c3f*4 + 9c*3 + 10157c*2f*5 + 91c*2 + 97f*2 + 1 wrt f. 3456c*3f + 609420c2f2 What is the third derivative of -l5 + 9l4 - 56174l*3 + 11473689l*2? -60l*2 + 216l - 337044 Find the second derivative of -19533g3y*2 - 18g*3y - 3g2y*2 + 3gy2 + gy + 3g - 45y - 2 wrt y. -39066g3 - 6g*2 + 6g What is the third derivative of 2n4 + 5251883n*3 - 15423632n*2? 48n + 31511298 Find the second derivative of 14919c2w*2 + 616c*2 - cw*2 - 21cw - 2w*2 - 10329w + 1 wrt c. 29838w2 + 1232 Find the first derivative of 7877641p*4 + 14p*2 + 350686536. 31510564p*3 + 28p Differentiate 42503548f + 167426094. 42503548 Differentiate 203b*2r*2 + 2240br3 - r3 + 15r*2 + 27725r + 2 with respect to b. 406br*2 + 2240r*3 What is the derivative of 4217508a*2 + 11107248 wrt a? 8435016a What is the derivative of -15l4 + 2130l*3 - 3l*2 + 56601510 wrt l? -60l*3 + 6390l*2 - 6l What is the second derivative of -46088103h2 + 14h - 22154878 wrt h? -92176206 What is the third derivative of -1031795a3 - 4a*2 + 548960a + 1 wrt a? -6190770 What is the second derivative of 3244172u5 - 5u*2 + 4u + 7369979? 64883440u3 - 10 Differentiate 13d*2g*2 - 12716577dg3 - 99g*3 - 643953g*2 with respect to d. 26dg2 - 12716577g*3 Find the first derivative of -7757o*2 - 39o - 51456095 wrt o. -15514o - 39 What is the second derivative of 29220389c*3 + 135333437c wrt c? 175322334c Find the first derivative of 864746a*3 + 340086. 2594238a*2 What is the second derivative of -65824259c*2 + 192811870c? -131648518 Find the third derivative of 21187654c4 + c2 + 3821565c. 508503696c What is the first derivative of -w4 + 9044w*3 - 44w*2 + 4935782? -4w*3 + 27132w*2 - 88w What is the third derivative of 85021159f3o*3 + 3f*2 - fo*3 + fo*2 + 3862o*2 - 63 wrt f? 510126954o*3 Find the third derivative of 2814602t3 - t2 + 10146576t. 16887612 What is the second derivative of 2167c*3d - 119c3 + c2d + 3cd - 5c + 2d + 58573 wrt c? 13002cd - 714c + 2d What is the first derivative of -2r3y*2 + 3743r*3y - 812r3 - 9r - 71y2 - 7 wrt y? -4r*3y + 3743r3 - 142y What is the second derivative of 4536w5 - 1097w*2 + 75195545w wrt w? 90720w3 - 2194 Find the third derivative of -4236113cq5 + 4368cq2 - 339cq + 4q*5 + 2q*2 wrt q. -254166780cq2 + 240q2 Find the third derivative of -t5 + 4t4 + 3319302t*3 - 1172441t*2 - 19t. -60t2 + 96t + 19915812 Differentiate 1956151q - 350178. 1956151 What is the second derivative of 165494k*5t + 798k5 - 1616681kt + 12k wrt k? 3309880k3t + 15960k3 What is the derivative of -409f*4 + 5919f + 112216049 wrt f? -1636f3 + 5919 Differentiate 66o*3 - 10o*2 - 3031o + 521578551 wrt o. 198o2 - 20o - 3031 What is the first derivative of -80766327g3 + 474141389 wrt g? -242298981g*2 Find the second derivative of 2a*3 - 11549473a*2 - 1869a + 3323 wrt a. 12a - 23098946 What is the third derivative of -2f*5 - 2766798f*3 - 7075004f*2 wrt f? -120f*2 - 16600788 Find the third derivative of -2g*2y*3 - 113g*2y - 495765gy*3 - 173gy + 3g - 7y3 - y2 + 1 wrt y. -12g*2 - 2974590g - 42 Find the second derivative of 13799779d2 - 2d - 3626248 wrt d. 27599558 What is the third derivative of 51239199m3 - 15052m*2 + 1195m? 307435194 Differentiate 7ors2y - 39orsy - 1447oy - 36rs - 186r + 3s*2y + 3s2 with respect to o. 7rs2y - 39rsy - 1447y What is the second derivative of -36825734q4 - 16q - 1473356? -441908808q2 Differentiate 3866561k*4 + 3k*3 + 96190207. 15466244k*3 + 9k*2 Find the third derivative of -101238431y*3 + 133122098y*2 wrt y. -607430586 What is the second derivative of 1088153483c*2f*2h + 2c2fh + 2c*2f + 457ch + 649fh - 40 wrt f? 2176306966c2h Find the third derivative of -337i3x*3 - 64i*3x + 3333i3 - 148i*2x*2 + 7954x*3 wrt i. -2022x*3 - 384x + 19998 What is the second derivative of 287819779h3 - 3891h + 8939? 1726918674h What is the third derivative of 19642691w*3 + 12703714w*2? 117856146 Find the third derivative of 12270582dv5 - dv*2 + 1109066d wrt v. 736234920dv*2 What is the third derivative of 4523q*4 - 57755q*3 - 252068746q*2 wrt q? 108552q - 346530 Find the second derivative of 7i2n*2 + 11756892i*2x + 7909in*2x - 55in - 23n2x wrt i. 14n2 + 23513784x Differentiate 77d2l*2 + 141766564d*2 + 83507dl2 with respect to l. 154d*2l + 167014dl What is the first derivative of 3tx*2 - 5tx - 397703313t - 86254x2 - 53x wrt x? 6tx - 5t - 172508x - 53 What is the first derivative of 6125964d + 6387486? 6125964 What is the third derivative of 15i*4x + 51775i3x*2 + 2i*3x - 2i2x*2 + 56i*2x + 5978x2 wrt i? 360ix + 310650x*2 + 12x Find the third derivative of 83140174d3 + 43422137d*2 + 2d. 498841044 Find the third derivative of -20516238o3u*3 + 2o*3u*2 + 17o*3u + 3o3 - 4o*2u*3 + 248o*2u2 - o2u - 76o*2 wrt u. -123097428o*3 - 24o*2 Find the third derivative of 2j*2k*3 + 156j*2 + 4857348jk4 - 6jk2 - jk + j - k*2 wrt k. 12j*2 + 116576352jk Find the first derivative of -288d*3q + 15431d3 - 35545d*2q + 48 wrt q. -288d3 - 35545d*2 What is the derivative of 4b3 - b2 + 19087617b - 223482142 wrt b? 12b*2 - 2b + 19087617 Differentiate -37561djv2 - 2dv3 + 67dv2 + 5780dv + 63jv3 with respect to j. -37561dv2 + 63v*3 Find the third derivative of 266118293a*6 + 235363031a*2. 31934195160a*3 What is the third derivative of 3088859n*5 - 12n*3 + 157877392n*2 + 1 wrt n? 185331540n*2 - 72 Find the third derivative of -30s*4u - s*4 + 258602s*3u + 47s2u - 86s2 + 2su + 3s - 31u - 1 wrt s. -720su - 24s + 155	{ "pile_set_name": "DM Mathematics" }
27642 Find the second derivative of -97j5 - 10243j*4 + 2j*2 - 138068292j. -1940j3 - 122916j*2 + 4 What is the third derivative of 126866659u*3 - 99273727u*2? 761199954 What is the third derivative of 1458a*5 - 6610a*4 + 11702a*2 - 2a - 186? 87480a2 - 158640a What is the derivative of -477962n2 + 5n - 23977252? -955924n + 5 Find the first derivative of -4875942x - 10036519. -4875942 What is the second derivative of -5393f3 - 514f*2 + 11638f - 785 wrt f? -32358f - 1028 What is the third derivative of -46555367r*3w - 1553255r2w + 6rw wrt r? -279332202w Find the second derivative of 163998394c*5 - 16846c - 156. 3279967880c3 Find the third derivative of 6453478l*6 + 10680933l*2. 774417360l*3 What is the third derivative of -79h*6 + 31114h*3w - 2h2w - 851734hw - 2 wrt h? -9480h3 + 186684w Find the second derivative of 14u2y + 244869u2 + 890uy + 5768 wrt u. 28y + 489738 What is the first derivative of 11658347q2 - 15318954 wrt q? 23316694q What is the first derivative of -985t4 + 10050t*2 - t + 23994812 wrt t? -3940t*3 + 20100t - 1 What is the second derivative of 6196915a2 - 10820188a? 12393830 Find the second derivative of -12736238b2 - 12119b - 869. -25472476 What is the third derivative of 25838z6 + z4 - 393z*3 - 95330728z*2? 3100560z*3 + 24z - 2358 Find the third derivative of 1054u4 - 23320u*3 - 1875u*2 - 2u - 4137. 25296u - 139920 What is the second derivative of 109w*4 + 4179w3 - w2 - 10025195w wrt w? 1308w*2 + 25074w - 2 Differentiate -9k2r - 242kr*2 - 35kr - k + 16156267r*2 with respect to k. -18kr - 242r*2 - 35r - 1 What is the first derivative of f*3m + f*3 + 2693344f*2m + 106279f2 + fm - 2f - 21 wrt m? f3 + 2693344f*2 + f What is the second derivative of 64750h*4 + 55h*3 - 3190867h wrt h? 777000h2 + 330h Find the first derivative of 45484572p2 + 54826082. 90969144p What is the first derivative of 647180721h2 + 259459361? 1294361442h Find the second derivative of -464429cfl2 + 103cfl - 44cl*2 - 6cl + 872c - 26fl wrt l. -928858cf - 88c Differentiate -2317472u*3 - 30561245 with respect to u. -6952416u*2 Find the third derivative of 107125528r*3 + 4r*2 - 1291r + 949. 642753168 Find the second derivative of 791014763x3 + 596x + 122480. 4746088578x What is the third derivative of 275443a*3l*4 + 9939495a*3l*2 - 2a*3l - 1481al*4 - 12a wrt l? 6610632a3l - 35544al What is the second derivative of -2296766o2 + 4736855o wrt o? -4593532 Differentiate 194285h3q + 15192733h3 - 2h*2q + 5q with respect to q. 194285h*3 - 2h*2 + 5 What is the second derivative of 6146805f*3 + 1893f + 169? 36880830f Differentiate -19j*3 - 34278j*2 + 9177892. -57j*2 - 68556j Differentiate -bhn*2 + 67bn3 + bn*2 - 3b + 310603922hn*3 + 6n*3 - 2n + 14174 wrt h. -bn2 + 310603922n*3 Find the second derivative of -8694636a*3 + 352114a - 15 wrt a. -52167816a Find the second derivative of -3l*4 - 240l*3 - 3587l*2 + 4l - 591284 wrt l. -36l2 - 1440l - 7174 Differentiate 3089c2 - 2177cl3 - 127l*3 - 2l*2 - 10225 wrt c. 6178c - 2177l3 What is the first derivative of 112747216n + 995978175? 112747216 What is the second derivative of -38363414s3 - 3s*2 - 238726233s wrt s? -230180484s - 6 Find the second derivative of 8478r*2s*2 + 780r*2 - 2rs2 - 1761r - 2429s2 + 1 wrt r. 16956s*2 + 1560 Differentiate -4c*2o - 4204541c2 - 4co - 2o - 116054695 wrt c. -8co - 8409082c - 4o What is the third derivative of 124b4f + 17b4 + b3f - 233b3 - 8b*2f + 2bf - 181b - 257f wrt b? 2976bf + 408b + 6f - 1398 Differentiate 23731cj*2 + 46cj + 307732994c + 11j2 wrt j. 47462cj + 46c + 22j Find the second derivative of 22a*3s*2 - 5424a*2s*3 - 39as2 - 522s*3 - 3s wrt a. 132as*2 - 10848s*3 What is the derivative of 361541474aq + 146586205q wrt a? 361541474q Find the third derivative of 5tx3 + 2tx2 + 45460tx - 32262861x*6 - 223x*2 + 9 wrt x. 30t - 3871543320x3 Differentiate -2116o*4 - 316o*2 - 45o + 123141231. -8464o3 - 632o - 45 Find the second derivative of -10b3f*2 + 45b*3 - 118693b*2f - 138bf*2 + 134b + 5f2 - 172 wrt b. -60bf2 + 270b - 237386f Find the second derivative of 2639987b*2cu2 - 25b*2c - 2b2u*2 - 3bc - 191bu2 - cu + c - 601u wrt b. 5279974cu2 - 50c - 4u2 What is the second derivative of 272i*3n - 3i3 - 18i*2n + 59i2 + 10in + 452n - 5 wrt i? 1632in - 18i - 36n + 118 Find the third derivative of 6660a5 - 4295a*4 - 845451a*2 - 17a - 1. 399600a2 - 103080a What is the third derivative of -120245x4 - 2x*3 - 659x*2 + 931 wrt x? -2885880x - 12 Find the third derivative of 5783656q3 + 1386381q*2 + 4q wrt q. 34701936 What is the first derivative of -40i3 - 227i*2 - i - 7460340 wrt i? -120i*2 - 454i - 1 What is the first derivative of -108h4 - 3h*3 - 8703h + 13763693? -432h3 - 9h*2 - 8703 Differentiate -2734168np2 + 6npq + 3nq - 6722p2q + pq with respect to q. 6np + 3n - 6722p2 + p Find the second derivative of -3426788b*2diu - 3b2iu - b2 + 3bdu - 3biu - 4b - 53diu - 32du + 4iu - 2 wrt b. -6853576diu - 6iu - 2 What is the derivative of 7855024a + 15146968? 7855024 Find the second derivative of 914b*3 + 259935b*2 - 4867b - 25111 wrt b. 5484b + 519870 What is the derivative of 41m*2w*2 + mw*2 + 211730mw + 380418w*2 - 74w - 2 wrt m? 82mw2 + w2 + 211730w What is the first derivative of 1515839d*3l*3 - 4d*3l - 2476655d3 + 5d wrt l? 4547517d3l*2 - 4d*3 Differentiate -32220uy + 177u - 89029335y with respect to u. -32220y + 177 Find the first derivative of 179636an*3 + 4an - 50a + n*2 + 18n + 1035720 wrt n. 538908an*2 + 4a + 2n + 18 Find the third derivative of 360947061w*3 + 98w*2 + 836w - 543. 2165682366 What is the third derivative of 11x6 - 118695x*4 + 2x*2 - 11602195x wrt x? 1320x3 - 2848680x What is the second derivative of -240734092n4 - 161939120n wrt n? -2888809104n2 What is the third derivative of -7880209y5 - y2 - 1305531y wrt y? -472812540y*2 Differentiate -42761704g + 24804842. -42761704 Find the third derivative of -1676c5n - 660c3n2 + c2n2 - 37c*2n + cn2 - 325c + 2n wrt c. -100560c*2n - 3960n2 What is the third derivative of -200824184b*5 + 168631b*2 - 243 wrt b? -12049451040b*2 Find the second derivative of 20789346j*2 - 4864665j - 4. 41578692 Find the second derivative of 92976972x2 + 9643x - 10875 wrt x. 185953944 Find the second derivative of -3580366r2 + 36r - 29441. -7160732 What is the third derivative of -9240527z3 - 5973902z*2 wrt z? -55443162 What is the second derivative of -2572828n*3v*2 + 9n*3v + 318n3 + 2nv2 + 796nv wrt v? -5145656n*3 + 4n Find the third derivative of 894087ot*5 - 10ot4 + ot*2 - 142ot + 2o + 2t2 + 1040 wrt t. 53645220ot2 - 240ot What is the derivative of -588813o*3 + 21o*2 - 16o + 801089267? -1766439o2 + 42o - 16 What is the second derivative of -51816319h2 - 481h - 13690? -103632638 Find the second derivative of -889682z5 + 3z*4 - 2z*2 + 12192346z. -17793640z3 + 36z*2 - 4 Find the first derivative of -402500712x*2 - 275665630 wrt x. -805001424x What is the first derivative of -247170786f2 + 176622215? -494341572f Find the third derivative of 1975632s5 + 2s*2 - 108199s + 13. 118537920s2 Find the second derivative of 4i*3v*3 + 192669i*2ov3 - 265471iov - 16iv*3 + ov*2 wrt i. 24iv3 + 385338ov3 Find the third derivative of 2f*3v*2 + 2f*3v - 9853902f3 + f2v*2 - 2f*2v - 8848f2 + 12f - v wrt f. 12v2 + 12v - 59123412 Differentiate -53779ag*3 - 17ag2 + 1696a + 1161 wrt g. -161337ag*2 - 34ag What is the third derivative of -207383145d*3 - 440387819d**2? -1244298870 What is the second derivat	{ "pile_set_name": "DM Mathematics" }
and. 990000 Round -0.0007725133 to 5 decimal places. -0.00077 Round 9093.62 to the nearest 100. 9100 What is -42.16121 rounded to the nearest integer? -42 What is 13038 rounded to the nearest 10? 13040 Round -0.0714057 to 3 dps. -0.071 Round 0.0000526817 to five dps. 0.00005 What is 0.004079557 rounded to 3 dps? 0.004 Round -0.00000115286 to seven dps. -0.0000012 Round 6776.04 to the nearest 100. 6800 Round -18529590 to the nearest 10000. -18530000 Round -2.651224 to 2 decimal places. -2.65 What is -1413797 rounded to the nearest ten thousand? -1410000 Round -5967920 to the nearest one hundred thousand. -6000000 Round 474.60819 to the nearest one hundred. 500 What is -55057000 rounded to the nearest one million? -55000000 What is -0.1223564 rounded to 2 dps? -0.12 Round 462426.9 to the nearest ten thousand. 460000 What is -0.187282 rounded to one decimal place? -0.2 What is -62.09113 rounded to the nearest integer? -62 What is -12.0847 rounded to one dp? -12.1 Round 0.0001883 to four decimal places. 0.0002 Round 223.5088 to the nearest ten. 220 What is -20640.3 rounded to the nearest ten thousand? -20000 Round -0.710285 to three dps. -0.71 Round 64374.75 to the nearest 100. 64400 Round -152057.47 to the nearest one thousand. -152000 What is 139622100 rounded to the nearest one million? 140000000 Round 1361.631 to the nearest 100. 1400 Round -391698 to the nearest 100000. -400000 Round 20845.35 to the nearest one thousand. 21000 Round -0.00027824 to 5 dps. -0.00028 What is -0.40083225 rounded to four decimal places? -0.4008 What is 0.000019156 rounded to five dps? 0.00002 Round 200157.46 to the nearest 10000. 200000 Round -10613570 to the nearest ten thousand. -10610000 Round 0.0000009527264 to 7 decimal places. 0.000001 What is 49.79048 rounded to the nearest integer? 50 What is -0.000001048199 rounded to six decimal places? -0.000001 Round 0.803178 to 3 decimal places. 0.803 What is 0.03114346 rounded to four dps? 0.0311 Round -2566 to the nearest 100. -2600 What is -310622.3 rounded to the nearest 10000? -310000 What is -0.00012008017 rounded to seven dps? -0.0001201 Round 335847.8 to the nearest 100. 335800 Round -1134.482 to the nearest one hundred. -1100 Round -31.6323 to the nearest integer. -32 Round 28386000 to the nearest 100000. 28400000 What is 13574.49 rounded to the nearest 100? 13600 What is -0.0018108712 rounded to five dps? -0.00181 What is 0.009181008 rounded to five decimal places? 0.00918 What is -0.000683651 rounded to four dps? -0.0007 What is -0.00000258191 rounded to seven dps? -0.0000026 What is -101.2579 rounded to the nearest ten? -100 What is -0.016953 rounded to three decimal places? -0.017 Round 0.051422 to one dp. 0.1 Round 0.0000003417453 to seven decimal places. 0.0000003 Round 0.000019435215 to seven decimal places. 0.0000194 Round -0.0001197888 to 7 decimal places. -0.0001198 Round -0.00003436974 to 6 dps. -0.000034 What is -0.04529435 rounded to 3 dps? -0.045 What is 0.00001996953 rounded to 6 dps? 0.00002 Round 0.0000072740926 to 7 dps. 0.0000073 Round 2262.2379 to the nearest ten. 2260 What is -7.016382 rounded to 0 dps? -7 What is 7514.921 rounded to the nearest 10? 7510 Round -322540 to the nearest 100000. -300000 What is -2.1676253 rounded to 2 decimal places? -2.17 What is 0.00000911863 rounded to 7 decimal places? 0.0000091 What is 27.06007 rounded to 2 decimal places? 27.06 What is -4236580 rounded to the nearest one hundred thousand? -4200000 What is 733.371 rounded to the nearest 10? 730 Round -276857900 to the nearest one million. -277000000 Round 0.000025158 to six decimal places. 0.000025 What is 1.0696206 rounded to two dps? 1.07 Round 7442.959 to the nearest 100. 7400 Round -0.000312537 to 6 decimal places. -0.000313 Round 1108749 to the nearest ten thousand. 1110000 What is -257.51835 rounded to the nearest one hundred? -300 Round -113549000 to the nearest 1000000. -114000000 What is -40532000 rounded to the nearest 100000? -40500000 What is 593840 rounded to the nearest one hundred thousand? 600000 Round -3086.6 to the nearest one thousand. -3000 Round -0.00050897 to 5 decimal places. -0.00051 What is -242398.2 rounded to the nearest 1000? -242000 What is 9935710 rounded to the nearest one hundred thousand? 9900000 What is 0.0001158599 rounded to 5 dps? 0.00012 What is -11.295735 rounded to the nearest integer? -11 Round 0.0000035549 to 6 decimal places. 0.000004 Round -0.0000630366 to 5 dps. -0.00006 What is -0.1148486 rounded to 3 decimal places? -0.115 What is 13284310 rounded to the nearest 10000? 13280000 Round -0.00230621 to five dps. -0.00231 Round -157904.64 to the nearest 10. -157900 What is -0.562874 rounded to two decimal places? -0.56 Round 0.0000254136 to six dps. 0.000025 Round 38.513055 to 0 decimal places. 39 Round 3120.168 to the nearest 10. 3120 Round -0.31806177 to two decimal places. -0.32 Round 1.487181 to 2 decimal places. 1.49 Round 0.01160565 to 3 decimal places. 0.012 What is 0.0235445 rounded to 3 dps? 0.024 Round -10292.47 to the nearest ten thousand. -10000 What is -0.0018509289 rounded to 5 decimal places? -0.00185 Round -0.00554967 to 4 dps. -0.0055 Round -0.0004004928 to 6 dps. -0.0004 What is 4725.1901 rounded to the nearest 1000? 5000 What is -5.70631 rounded to one decimal place? -5.7 Round 722768.6 to the nearest 10000. 720000 What is -632685.1 rounded to the nearest one hundred thousand? -600000 Round 9946.615 to the nearest 100. 9900 Round 441446 to the nearest 10000. 440000 What is -272734.2 rounded to the nearest one thousand? -273000 What is -0.13122155 rounded to 2 decimal places? -0.13 What is -0.00011927305 rounded to five dps? -0.00012 Round -0.0307185 to two decimal places. -0.03 What is -0.001229097 rounded to three decimal places? -0.001 Round -574.0349 to one dp. -574 What is 522953 rounded to the nearest ten thousand? 520000 What is 22771.5 rounded to the nearest 1000? 23000 What is 0.0001067854 rounded to seven decimal places? 0.0001068 What is 4693.635 rounded to the nearest one hundred? 4700 What is -168001900 rounded to the nearest 1000000? -168000000 What is -1905.37 rounded to the nearest 100? -1900 Round 4.338612 to three decimal places. 4.339 Round -43443969 to the nearest ten thousand. -43440000 Round 0.186802 to two dps. 0.19 What is -52348.63 rounded to the nearest 10000? -50000 Round 0.06349573 to five decimal places. 0.0635 Round 19.022235 to one dp. 19 What is 0.0000654313 rounded to six decimal places? 0.000065 What is 0.001731441 rounded to five decimal places? 0.00173 What is 0.00000214605 rounded to six dps? 0.000002 Round -0.0108486874 to three dps. -0.011 What is 77866600 rounded to the nearest one million? 78000000 Round -12.0456 to 1 dp. -12 What is 531.4181 rounded to the nearest one hundred? 500 Round 0.0000449618 to 5 dps. 0.00004 Round 0.00000003423702 to seven dps. 0 What is 409271.5 rounded to the nearest 1000? 409000 Round 1393.208 to the nearest 100. 1400 Round -1880.438 to the nearest integer. -1880 What is -48001.21 rounded to the nearest one thousand? -48000 What is -48383050 rounded to the nearest one hundred thousand? -48400000 What is -7993200 rounded to the nearest one hundred thousand? -8000000 Round -0.002311547 to 4 dps. -0.0023 What is 81585280 rounded to the nearest one million? 82000000 What is -0.00001514917 rounded to seven decimal places? -0.0000151 Round 0.187508 to one decimal place. 0.2 Round -2218.996 to the nearest one hundred. -2200 What is -2.4284364 rounded to two dps? -2.43 What is -888.2589 rounded to the nearest one hundred? -900 Round 9628450 to the nearest 100000. 9600000 What is -109.26462 rounded to 1 decimal place? -109.3 What is -10915.5 rounded to the nearest one hundred? -10900 Round -0.0000125033 to six decimal places. -0.000013 What is 325369 rounded to the nearest ten thousand? 330000 Round 612547.67 to the nearest 1000. 613000 What is 12.91828 rounded to 1 dp? 12.9 What is 7.279386 rounded to 3 decimal places? 7.279 What is 1091.6458 rounded to the nearest ten? 1090 Round 0.11469367 to two dps. 0.11 What is -44985.37 rounded to the nearest 10000? -40000 What is -986.91773 rounded to the nearest ten? -990 What is 0.00021933483 rounded to seven dps? 0.0002193 What is 0.0000	{ "pile_set_name": "DM Mathematics" }
tive of -v*3/6 + 5v*2/2 + 2v - 675. Let m = 3 - 0. Suppose -4w + 7 = -mw. Give g(w). -2 Let g(o) = -o*3 - 7o + 17. Let m be g(0). Let f(a) = -a*3 + 15a*2 + 32a + 40. Determine f(m). 6 Let i(y) = -y + 12. Let f(u) = -u*2 - u. Let c be f(9). Let l be (-20)/c + (-148)/18. Let x be l/(-28) - (-4)/(-14). Calculate i(x). 12 Suppose r - b - 2 = -2b, 5r = -4b + 9. Let a(j) = -11j3 - j2 - 4j + 4. What is a(r)? -12 Let f(n) = 4n - n - 1 + 5. Suppose 7l - 44 + 107 = 49. What is f(l)? -2 Let v(r) = r + 4. Let g be v(-3). Suppose -2n - 9 = g. Let c(t) = 13t - 2t3 + 7t*2 + 186t2 + t3 - 197t2 + 6 - 6t. Determine c(n). -4 Let o(m) = -945m + 3785m - 4 - 945m - 945m - 951m. Let w = -11 - -11. Calculate o(w). -4 Let s(t) = 3 - 10t + 7t - t2 - 5. Suppose 0 = 3o - z - 30, 0 = -3o + 2z + z + 30. Suppose oj + 20 = 5j. What is s(j)? -6 Let c be ((27/2)/3)/(774/(-2064)). Let x(n) = n*2 + 4n - 67. Give x(c). 29 Let r(n) be the second derivative of n5/20 - n4/3 - 5n3/6 - 7n. Let q = 80 + -65. Suppose 2y = 5y - q. Determine r(y). 0 Let u(i) be the second derivative of -i5/20 - i4/3 + 7i3/6 + i2/2 - 47i - 41. What is u(2)? -9 Suppose 3z - 6 = -3. Let t = -115 + 117. Let j(v) = -331v + 6v2 + tv*2 + 330v. What is j(z)? 7 Let n(t) = -t*3 + 7t*2 - 6t + 1. Let z(v) = -5v + 41. Let c be z(9). Let a be c/(56/(-35))2. What is n(a)? 21 Let h be (-29)/185 - 322/(-5796). Let u(s) = 3s + 38. Determine u(h). 14 Suppose -2t + 6t - 36 = -4m, -3t - 2m = -24. Let y(o) = o2 - o - 8. Let q be y(t). Let s = q - 16. Let p(v) = 2v - 4. Give p(s). 8 Suppose -3l = l - 3f - 85, -4f + 64 = 4l. Suppose l = 5b - 26. Suppose 3r - 12 - 6 = 4s, -b = -3r + s. Let p(z) = -z*3 - 2z2 - z + 1. Give p(r). -17 Let l(i) = i3 + 3i2 - 3i + 3. Suppose 4p + 24 = -2m, 3p - 5m + 3m + 18 = 0. Let k be ((-2)/p)/(-45/180). What is l(k)? 12 Let o(z) = -41z + 3z - 7 + 7 - 5. Let d(m) = 11m + 2. Let y(p) = -7d(p) - 2o(p). Let a(g) = g3 + 7g*2 + 6g - 6. Let r be a(-6). Give y(r). 2 Let y be (-26)/91 + (-130)/(-14). Let t(f) = -866f + y - 3 - 5f*2 + 865f + f3. Calculate t(5). 1 Let c(l) = -l2 + 18l - 19. Let g(d) = -12d*2 - 101d - 26. Let w be g(-8). Determine c(w). 37 Let u(k) = 7k2 + 72k - 197. Let n(a) = -3a2 - 37a + 97. Let y(h) = 5n(h) + 2u(h). What is y(-43)? 5 Let w(n) = n + 7. Let y(t) = t + 6. Let a(z) = z*2 - 36z + 182. Let r be a(30). Let u = 5 - 8. Let g(x) = ry(x) + uw(x). Calculate g(-4). -5 Let f = -320 - -443. Let s = f + -121. Let q(z) = -3z + 1. Give q(s). -5 Let m(b) = -3b - 2. Suppose 144 = -8z + 2664. Let x = -318 + z. Calculate m(x). 7 Let a(v) be the first derivative of v3/3 - 4v*2 - v + 1045. Let k = 1 - -6. Determine a(k). -8 Let z be -6(-1 - 2/(-4)). Let s(u) = -5u + 16u + 14 - 9u - 19u*2 - 16 + 18u*2. Calculate s(z). -5 Let q(j) = -11j*3 + 14j*2 + 18j - 2. Let p(v) = -9v3 + 12v*2 + 16v - 1. Let h(b) = 6p(b) - 5q(b). Calculate h(-4). -52 Let b(r) = -r + 12. Let v = -1350 + 1358. Give b(v). 4 Let k(x) be the first derivative of 8 - x*2 + 12 - 8x + 10 + 7x + 6x*3. Let n = -1 + 0. What is k(n)? 19 Let b(p) = -23p - 2. Let h(t) = -70t - 5. Let g(r) = -8b(r) + 3h(r). Suppose -4y - 40 = 4x, 5y - 3y + 4x + 38 = 0. Give g(y). 27 Suppose -154s - 5f - 16 = -153s, 0 = -5s + f + 24. Let u(w) be the second derivative of 1/12ws + 4/3w*3 + 0 + 5/2w*2 - 8w. What is u(-7)? -2 Let j = -10868 - -10883. Let o(c) = -c*3 + 16c*2 - 18c + 33. Give o(j). -12 Let c = 154 - -72. Let g = c + -232. Let x(p) = -p*2 - 4p + 12. Determine x(g). 0 Let c = 30 + -26. Let z = 2 + c. Let j(v) = z + 5 + 3v - 15. Give j(3). 5 Let s(j) be the third derivative of -j6/120 - j5/20 + j4/4 + 2j*3/3 + 15077j*2. Let c = -10 - -6. Give s(c). -4 Let j be -17 + 15 - (1 - (-4)/1). Let g be (-3 + 3 + -3)(j - -6). Let d(y) = 8y2 - 2y*2 - 6y*3 - 2y*g - 4y*2 - 2y + 1. What is d(1)? -7 Let n(g) = g2 + g - 2. Let x be n(-2). Let o(p) = p2 - 23p + 18. Let d be o(24). Let q(j) = -d + j - 35 + 85. Give q(x). 8 Suppose 4y - 8y + 34 = 2u, 2u - 24 = -3y. Let z(t) = t*2 - 10t + 26. Determine z(y). 26 Let n(b) = 4b + 6. Let f = -84 + 150. Let s = f - 69. Determine n(s). -6 Let g(s) be the third derivative of -s6/60 - 11s*4/24 + 13s2. Let w(k) = k3 + 5k. Let j(n) = -4g(n) - 9w(n). What is j(1)? -2 Let g be -15 - (-198)/(-126)-7. Let b(h) = -14 + h + 0h + 9. Calculate b(g). -9 Let l(w) = 3w*3 + 3w*2 + 5w + 2. Suppose -26y + 4 = -24y. Let j(h) = 10h3 + 8h*2 + 16h + 7. Let r(o) = yj(o) - 7l(o). Let z = 4 + -8. Give r(z). -4 Let f = 11 + -4. Let m(k) = -17k - 4. Let l(p) = -10p - 3. Let a(j) = -5l(j) + 3m(j). Calculate a(f). -4 Let v(h) = -h*3 - 8h*2 - 8h - 13. Suppose -3l + 4s = 15, 3s - 19 = 3l - 4. Determine v(l). -48 Let o(f) = -2f2 + 6f + 3. Let n(a) = a*3 + 49a*2 - 5a - 242. Let g be n(-49). Give o(g). 3 Let w be ((0/(-3))/(-2 + 1))/3. Suppose 4i + 3 - 7 = w. Let b be (-3)/((i + (-3)/2)-2). Let t(z) = z*3 + 2z*2 - z - 1. Calculate t(b). -7 Let j(c) be the first derivative of -17c*3/3 + 2c*2 + 3c - 1990. What is j(-1)? -18 Let g(a) = a*2 + 10a - 5. Suppose 0 = 2m - 4m - u - 1, -m + 2 = -2u. Suppose p + 0n - n + 12 = m, -2 = -2n. Calculate g(p). 6 Let f(t) be the second derivative of t5/60 + t4/12 - 5t*3/6 - 61t*2/2 - 28t. Let d(m) be the first derivative of f(m). What is d(4)? 19 Suppose 0 = 41j - 65j. Let u(h) = -h*2 + 3h - 20. Determine u(j). -20 Let b(o) = o + 4. Let a(l) = -14l + 42. Let y(r) = a(r) + 7b(r). Calculate y(10). 0 Let v be -9 - 16 - -14 - -24. Let f(g) = -g*2 + 13g + 29. Determine f(v). 29 Let v(p) = p3 + p2 - p + 35. Let c be (-4 - -1)/(2/20). Let u = c + 30. Calculate v(u). 35 Let z(f) = -308 - 6f + 312 + 0f*2 + 3f*2 - 4f*2. Give z(-8). -12 Let x(n) = -71n + 100. Let t(y) = -18y + 25. Let h(m) = 13t(m) - 3x(m). Calculate h(1). 4 Suppose -22r = -21r - 1. Let b be (2 + -3 - -1) + r. Let i(h) = 1 + b + 3 + 3 - h. Calculate i(5). 3 Let h(n) = 5n*2 + 14n - 12. Suppose 0 = -4u + 5j + 5, -2j - 15 = 4u - 3j. What is h(u)? 43 Let h(c) = c2 - 3c - 15. Suppose -155j + 154j = 5q + 6, 5j = -4q + 33. What is h(q)? 3 Let c(j) = j3 - 3j*2 + 2j - 6. Let p(w) = 395w - 1183. Let d be p(3). What is c(d)? -6 Let o(j) = -j3 - 62 + 0j*3 - 113j*2 + 57j + 20 + 119j2 + 19. What is o(11)? -1 Let g(f) be the third derivative of 5f*4/24 + 2f*3/3 + 112f*2 - f. Give g(1). 9 Let y(a) = 2a - 13a2 + 4 + a3 - 3a + a + 17a2. Let u = 38 + -42. Calculate y(u). 4 Let q(k) = 15k + 670. Let l be q(-44). Let y(n) = -2n - 11. Give y(l). -31 Let r(n) = n. Let a be (-2)/6795/53. Give r(a). -5 Let n(l) = 7l3 - 2l*2 - l. Let v be n(-1). Let q be (4 + 2)v/(-12). Let r(p) = 5p - 3 - p2 + 4 + 3p - 4p. Calculate r(q). 1 Let p(c) be the first derivative of 40c*3/3 - 3c*2/2 - 6c - 6864. What is p(-1)? 37 Let r(y) be the third derivative of -y5/60 - y4/4 - y*3/2 + 1001y*2 - 2y + 1. Let m be 15/6(1 - 3). Calculate r(m). 2 Let a(s) = 52s - 309. Suppose -792 = -37l - 95l. Give a(l). 3 Let t(n) be the second derivative of n*5/20 - 4n*4/3 + 17n3/6 - n2/2 - n - 496. Determine t(15). 29 Let l = 0 - -11. Let a(v) = lv - 15v + 2v3 - v3 + 9v + 8v2 - 3. Calculate a(-7). 11 Let x(w) = 4w*2 + w + 1. Let f(m) = -87m - 53. Let o be f(-3). Let r = -210 + o. Determine x(r). 15 Suppose 4w + 0 + 4 = -3h, 5w - 18 = 2h. Let z be ((-9)/(-6))/(-1) + (-6)/h. Let s(j) = j + 0 + zj + 13. Determine s(-9). 4 Let f = -915 - -917. Let k(i) = -43i + 11. Give k(f). -75 Let k = 1240 - 1229. Let t(v) = 6v - 62. Determine t(k). 4 Let k(l) be the second derivative of l5/20 + 5l4/12 + l3/6 - 20861l. Let a(o) = o2 + 5o - 1. Let t be a(-4). Determine k(t). -5 Let i(b) = 14b - 5b + 1 - 11b + 9b*2 - 4b. Let x(a) = -11a2 + 8a - 1. Let s(k) = -5i(k) - 4x(k). Determine s(-4). -9 Let a = 20 + -12. Let s be (a/(-2) + 1)/(-1). Let p(o) = o - so - 7o3 + 0 - 1. Determine p(-1). 8 Let g(p) = p3 + 8p2 - 11p - 17. Suppose 0 = -4a - 5i + 4i + 20, 0 = 3	{ "pile_set_name": "DM Mathematics" }
arest to -0.5 in 124, -29, 0.11? 0.11 What is the closest to -12/5 in -0.5, 22/45, -0.2, -0.17? -0.5 Which is the closest to 0? (a) 0 (b) 0.4 (c) 1/23013231 a What is the nearest to 1 in 240, -2544, 2/21? 2/21 What is the closest to 1/2 in 0.1, -5, 0.6098, 720? 0.6098 What is the closest to 7/3 in 3, 6/7, -2, -3392, -0.19, 1? 3 What is the nearest to -5.2 in 2/35, -1, 382? -1 Which is the nearest to 0.4? (a) -34 (b) 1 (c) 8 (d) 7.5 (e) 0.4 (f) -0.4 e Which is the nearest to 2? (a) 0 (b) -0.5 (c) 608585 a What is the nearest to -2/5 in -14, 19, -3/5, 0.28192? -3/5 Which is the closest to -47? (a) -0.3 (b) -4 (c) -236909 b What is the closest to -1 in 2/21, 457300, 14, 1, 3? 2/21 Which is the nearest to -0.07? (a) 9/43 (b) 0.01 (c) -3 (d) -2/9 (e) -2 b Which is the closest to 3.377? (a) 5/3 (b) -1 (c) 1 (d) 0.51 a Which is the closest to -206? (a) -4/3 (b) 0.1 (c) -0.2 (d) 79 (e) -4 e What is the closest to 3/26 in 3/8, 0.04, 3, -0.3, -0.25? 0.04 What is the closest to 70245 in 21, -3, 0.022? 21 Which is the closest to 0? (a) 4 (b) 2897.85 (c) 10 (d) 0.5 (e) 2 d Which is the closest to 2/7? (a) -731 (b) -0.4 (c) 2.705 b Which is the closest to 0.1? (a) -2/9 (b) 2 (c) -8/362451 (d) 4/9 c What is the nearest to 1/3 in -234, 2, 48, 1/16? 1/16 Which is the closest to 18? (a) -4 (b) -51 (c) 159 a What is the nearest to -0.13 in 7, 1, -77782? 1 Which is the nearest to -85? (a) -5/3 (b) -74 (c) 26 (d) -5 (e) 5/3 b What is the nearest to 0.1 in 0, 12, 56, 13, 0.03, 19? 0.03 Which is the nearest to -0.1? (a) -2/63 (b) 2 (c) -4 (d) 95 a Which is the closest to 4? (a) 1019 (b) 0.1 (c) -243 b Which is the closest to 36? (a) -11 (b) 0 (c) 65 (d) 0.13 (e) 0.6 c What is the nearest to -31 in 4, -3/7, -6/11, -358/3? -6/11 Which is the closest to -338? (a) -7/22 (b) 39 (c) 0 a What is the nearest to 0 in -0.2, 2350, -1, -14, 38? -0.2 What is the nearest to -2/9 in -17, -0.012, 21/4, -3? -0.012 What is the closest to -1 in 0.5, 40.345843, 2? 0.5 What is the closest to 0.04 in -2028, -382, 1/5, -1? 1/5 What is the closest to 2.1 in -36, -2/3, -17.3, -3/2, -0.1, 2/7? 2/7 What is the closest to -1/4 in 0.1, -146, -29.5? 0.1 What is the nearest to 2/7 in -152/15, 0.2, -7, -154? 0.2 Which is the nearest to 356.7? (a) -0.14 (b) -0.1 (c) 0.3 c Which is the closest to 2/2069? (a) 9 (b) 0.4 (c) 29 (d) 61 b What is the closest to 1.6 in -3/5, 12, -29, 1/96? 1/96 Which is the nearest to 430/13? (a) -4/3 (b) -2/5 (c) -98/9 (d) 3 d What is the nearest to -2/25 in 1556, 0.2, 4? 0.2 What is the nearest to -2/5 in -42, -1/5, 2/7, 22, 3? -1/5 What is the nearest to 0 in 1/2, 36, -1/1093? -1/1093 What is the closest to 0.1 in 8, -4, 31510.7? -4 Which is the closest to 4? (a) -30 (b) -1 (c) -0.3 (d) 0.4 (e) -3/49 d What is the closest to -17/18 in 0.2, 12, 4, 0.4, -114, 48? 0.2 What is the closest to -0.09 in 77, -5, -20/3, -1.4, -0.2, -2/9? -0.2 Which is the nearest to -2? (a) -0.037 (b) -1.5 (c) -0.09 (d) 0.03 (e) -1/5 b Which is the nearest to -2? (a) 1236 (b) 3 (c) -19/216 c What is the nearest to 0.048 in -99, -23, -4, 0.3, 0.2? 0.2 What is the nearest to -1 in 8/7, 4, 4163, 0, -0.2? -0.2 What is the closest to 3 in 14, -50, 2/3681? 2/3681 Which is the nearest to 5? (a) 2/11 (b) 66 (c) -1.2 (d) -41 (e) -4 (f) 2/9 f Which is the nearest to -1? (a) -48366 (b) -5 (c) 5 b What is the closest to 0.4 in 237, 0.1, 199, 0.2? 0.2 Which is the closest to -47/7? (a) -2 (b) 72 (c) -1/87 (d) -5 (e) -11 d What is the closest to -5751 in -4/5, -12/115, 1? -4/5 Which is the nearest to 12? (a) -2/561 (b) 1/6 (c) 4214 b Which is the nearest to 1? (a) -2044 (b) -5 (c) -0.4 (d) -83/2 (e) 0.5 e What is the closest to -4 in 1, 1/1590, 5, -70? 1/1590 What is the nearest to -0.5 in -127, 0.28, -0.7, -0.4, 7/4? -0.4 What is the closest to 9/4 in -4/7, 464, -8, 0.4, -0.1? 0.4 Which is the nearest to 0.2? (a) -3 (b) -7 (c) 306 (d) -16 a Which is the closest to -0.19? (a) 94.7 (b) -1/42 (c) 1/6 b Which is the nearest to 70453? (a) -33 (b) 3/2 (c) -2 (d) 5 d What is the closest to 4 in 100, 17, 4, -1/5? 4 Which is the nearest to 0? (a) -3/2 (b) -28536.2 (c) -2/15 (d) 4/5 c What is the closest to 4/97 in -9, 0.5, 22/7, 5? 0.5 Which is the nearest to 5908/223? (a) 0.4 (b) 5 (c) -0.1 (d) 0.3 (e) -0.5 (f) -2/7 b Which is the nearest to -2? (a) 17/2 (b) 5/4 (c) 1/28 (d) -3/4 (e) -7 d What is the closest to -8/7 in 87, 1.2, -4? 1.2 What is the nearest to 3 in 0, 2/7, 4.8, -5, -0.015? 4.8 Which is the nearest to -49? (a) 5 (b) -8 (c) 148 (d) 0 (e) 30 (f) 10 b Which is the closest to 2/3? (a) -4/3 (b) 52 (c) 145 (d) -18/13 a What is the closest to 4 in 4, 14/33, -0.3, -2/15, -3? 4 What is the closest to 2 in -9/20, -2.8, -301? -9/20 What is the closest to 1/3 in -347377, -0.4, 0.5? 0.5 Which is the nearest to 0? (a) 3/2 (b) -0.208 (c) 344 (d) 0.15 d What is the closest to -147645 in -0.5, 0, -7/4? -7/4 What is the nearest to -2351 in -27, -3, 3, 4? -27 What is the closest to -17 in -0.4, -10746, 3/17? -0.4 Which is the closest to 43/7? (a) -0.073 (b) -2/3 (c) -1/3 (d) -2/17 (e) 5/3 e Which is the closest to -3? (a) 812 (b) 3 (c) -1 (d) -0.1 (e) 1.1 c Which is the closest to -1? (a) 1787 (b) -2/5 (c) 0.11 (d) -4 b What is the closest to 2 in -8/19, 36, 2/13, -0.4, -2/7? 2/13 What is the nearest to 0.2 in 0.5, 1, 3, 613, -28? 0.5 Which is the nearest to -8? (a) -0.3 (b) 526 (c) 360 a Which is the closest to -0.48? (a) -5/14 (b) 2 (c) 107 a Which is the nearest to 1/260? (a) 2/7 (b) 7/5 (c) 1 (d) 3/139 (e) 7 d What is the nearest to -0.56 in 2/21, 0.06, -0.05, 0.4, -0.4? -0.4 What is the closest to -0.1 in -0.31, 2, 6247/17? -0.31 What is the nearest to -2.5 in -1, -67, -0.3, 0.215, -3? -3 What is the nearest to 0 in -0.5, -4, -17/479, -3, -4/5? -17/479 What is the nearest to 0.14 in 2.2, 8, -156? 2.2 What is the nearest to -131.9 in 40, -1/2, 0.2, -0.01? -1/2 Which is the nearest to -0.1? (a) -2/5 (b) 4 (c) -16828 (d) -0.1 (e) -1/17 d What is the closest to -2/9 in 2/5, 3/5, 22/7, 1/6, 27? 1/6 What is the closest to -21.5 in -12, 1/5, 1868/5? -12 Which is the closest to -2? (a) -2 (b) 10175 (c) 7 (d) 0.15 a Which is the closest to 0.1? (a) 0.4 (b) 45/41 (c) -0.6 (d) -2/7 (e) -0.13 (f) 2/17 f What is the nearest to -0.1 in -2, -9, -3/14, 4, 0.13? -3/14 What is the closest to -2/7 in 3/287, 0, 20705, 1? 0 Which is the closest to -4? (a) -4 (b) 2/3 (c) 5 (d) -5 (e) 0.5 (f) -177 a Which is the closest to -0.1? (a) 2/7 (b) -4/7 (c) -0.07 (d) -13903 (e) 3/5 c What is the closest to -1 in -1964, -961, -5, -2/13? -2/13 What is the nearest to 2/25 in -16, -69, -5, -6, 3/5, 1/2? 1/2 Which is the nearest to 3? (a) 4 (b) -0.007 (c) -1 (d) -2770 a What is the nearest to -1 in -1.0307, -1, -719, -5? -1 Which is the nearest to 2037? (a) 4 (b) 0.05 (c) -4/3 (d) -5 a What is the closest to 4 in 0.1, 42, -14/11, -2/7? 0.1 What is the closest to -1/2 in -4, -3, 0, -14843, 30? 0 Which is the nearest to 4? (a) 0 (b) -20 (c) -8209/37 a What is the nearest to -97/20 in -0.183, -4, -3/5, -2, -6/7, -5? -5 Which is the closest to 0.1? (a) 2/13 (b) 381 (c) 5/2 (d) 1861.36 a What is the nearest to 0 in 0.899, 1381/5, -3? 0.899 What is the closest to -56404 in -1/8, 32, 0, 5, -4? -4 Which is the closest to -3? (a) 2 (b) 0.1 (c) 906545 b Which is the nearest to 1/3? (a) -4.798 (b) -10 (c) 29 (d) -3/5 (e) 1 e Which is the nearest to 0.2? (a) 2 (b) 1140 (c) 5/8 (d) -13 c Which is the closest to 0? (a) -1/5 (b) 6/175 (c) -740 b What is the closest to -1489 in -2/5, 4/9, 3.1, 1? -2/5 Which is the nearest to -3/5? (a) 12/41 (b) 323 (c) 0.2 c Which is the nearest to 0.08? (a) -17 (b) 4 (c) 0.052 (d) 6 (e) -0.2 c Which is the nearest to 3? (a) -2/215 (b) -1/10 (c) -1/8 (d) 12 a What is the closest to -0.1 in 0.53, -15/79, 5/6, 2/9, 1? -15/79 Which is the nearest to 1/8? (a) 5/3 (b) -5 (c) -4 (d) 51 (e) 20 (f) 5 a Which is the nearest to 0.4? (a) 13 (b) 509/79 (c) -0.1 (d) -5 c What is the nearest to 1 in -0.13, 2/5, -0.1, -11, -110/9? 2/5 Which is the nearest to -317? (a) -4 (b) -31 (c) -5 b Wha	{ "pile_set_name": "DM Mathematics" }
. Let c = -1.62 - -2.02. What is the nearest to 0 in c, -3/4, t? c Let i be 0 + 2 + (-7)/4. Suppose 0 = -t - 0w + 3w - 549, 2154 = -4t - 2w. Let f be (t/(-16))/9 + -3. Which is the nearest to i? (a) f (b) 8 (c) 5 a Suppose 3o - h + 20 = h, -4o - 2h - 22 = 0. Let g(j) = -3j - 64. Let q be g(-21). What is the nearest to q in -5, o, 3/4? 3/4 Let x be (-2)/((-24)/(-9) - 2). Let f = -1628 + 21166/13. Which is the nearest to -1? (a) -12 (b) f (c) x b Let k be (7/140)/(1/44). What is the nearest to 0.1 in 0.03, k, -44? 0.03 Suppose 4v + 3x - 10 = 5v, -4v = 5x + 23. Let h be v/15 - (-28)/42. What is the nearest to -2 in -1, -4, h, 5? -1 Suppose -60w + 19 = 5j - 64w, 3w + 13 = 5j. Let y be (1 + (-2)/(-2))/2. Which is the closest to 1? (a) j (b) y (c) 1/5 (d) -0.5 b Suppose -28v + 12v + 24v = 0. Which is the closest to 7.8? (a) v (b) -2/7 (c) 2/15 (d) 4/7 d Let w = 3714 - 3714.3. Which is the closest to 130? (a) w (b) -2/15 (c) 3 c Let f = -18 - -15.5. Let l = f + -0.5. Let g = -6.09 - -6.39. Which is the nearest to l? (a) -1/2 (b) g (c) 1/4 a Let i = 8423.94 + -8424. What is the closest to 2/27 in -1/7, i, -4, -5? i Let g = 0.224 - 0.324. Let z be 0 + 1 - (-8)/60-6. What is the nearest to g in z, -19, 1? z Let u = -28 - -39. Let b = 90.2 - -39.8. Let a = b - 129.5. What is the nearest to 1 in -0.4, u, a? a Let f = 2547.3 - 2548. Which is the closest to -1? (a) f (b) 3 (c) -3 (d) -4/3 a Let h = -2/166805 - 94912031/1167635. Let t = h + 81. Let j = 6.5 - 11.5. Which is the nearest to t? (a) j (b) -0.5 (c) 0.1 b Let t = -3982 - -3978. Which is the nearest to -1? (a) 0.5 (b) -0.1 (c) 1/109 (d) t b Let q = 41 + -40.14. Let v = 0.66 - q. Let g = 0.1 + -0.2. Which is the nearest to g? (a) 5 (b) -2.8 (c) v c Let w = 18771/110 + -345/2. Let z = 27/11 + w. Let f = 12 - 17. What is the closest to -0.1 in f, z, -4? z Suppose -743r = -738r + 5x + 10, x + 2 = -4r. Let m = -164/237 + 2/79. What is the nearest to m in -2/19, -0.3, r? -0.3 Let x = 9666 - 9648. What is the nearest to -1 in -1/8, -0.06, x? -1/8 Let s = 25.11 - 25. Let v = 4.11 - s. Let n be 31 - 20 - 17/55. Which is the closest to 1? (a) 5 (b) n (c) v c Let x be (-2)/((17/(-1156))/((-7)/(-8))). Let p = 75 + -77. Which is the nearest to 1? (a) -0.2 (b) x (c) p a Let x be 269/(-220) + (-4)/(-20). Let w = -14/11 - x. Let n = 0.0412 + 0.0588. What is the closest to 0 in 1, w, n? n Let t = 6/5 + 3/10. Let g = -12117 + 12116.6. What is the closest to -2 in t, g, 2/11? g Let w = -55/27 - -67/27. Which is the closest to 0.07? (a) -0.03 (b) w (c) -5 a Let t = 0.04006 - 2.04006. What is the nearest to t in -2/7, 0.1, 0.02, -5? -2/7 Let o = 19 + -18.6. Let d be ((-69)/24 - -2)(-44)/33. What is the closest to 1/2 in o, d, -3? o Let t = 33/13 - 5927/2340. Let y = t - -59/180. Which is the closest to -5? (a) 3/2 (b) -0.5 (c) y b Let c = -50.3 + 50.3. Let o = -14.2 - -16.2. Let a = 1 + 2. What is the closest to o in 5, a, c? a Let f = -406 + 405.9819. Let s = f + 0.5181. Let l(b) = b*2 + 5b - 4. Let u be l(-6). What is the nearest to 0 in s, u, -1/4? -1/4 Let p = -106 + 103. Let f be -2 - (-1 - (-12)/p). Let j be (-2)/((1 + -4)/(f/(-15))). What is the nearest to 1 in 0.03, j, -2/5? 0.03 Let g = -28646 - -200524/7. Which is the closest to 1.8? (a) g (b) -2/9 (c) 0.07 (d) 2/23 a Let d be 4 + (0 + 1)6. Suppose 0 = dm - 13 + 33. Which is the nearest to -0.1? (a) -6 (b) m (c) 0.5 c Let m = -26167 - -26154. Let t = 0.3 + -0.2. Which is the closest to 2/7? (a) t (b) -4 (c) m a Let k be 4/(27 + -14 - 15). Let s = 3 - 3. Let t be 1-51/(-1). What is the closest to s in k, t, 0? 0 Let t be 10/30 - 91/147. Let a be 4/2 + 1 - 1. Suppose -3r + ax - 6x = -3, 5r - 5x = 40. What is the nearest to t in r, 3, -10? 3 Let f = -20326/5 + 4064. Which is the nearest to 2/3? (a) 3 (b) f (c) 5/7 (d) 0 c Let g = -8.13 + 1.43. Let v = -3.8 - g. Let f = -1.1 - v. Which is the closest to 0.2? (a) f (b) -5 (c) -2/5 c Let v = -370.7 + 368.7. Let r = 7 + -12. Which is the closest to v? (a) -1/2 (b) 4/7 (c) r a Let t = -85/99 - -7/11. Let i = -31.45 - -31.55. Which is the closest to 0? (a) -1/5 (b) t (c) i c Let y = 8966 - 8924. Which is the nearest to 0.1? (a) -2/11 (b) 3/8 (c) y (d) 0.2 d Let o = -13473 - -229043/17. Which is the closest to -0.0436? (a) 4 (b) -2 (c) o c Suppose -39o + 37o + 12 = 0. Let f be 2/o + (-87)/(-9) + -8. Which is the nearest to -0.2? (a) f (b) -0.4 (c) 3 b Let u be (-6)/(-1) + 14/21108/(-32). What is the nearest to -3 in u, -2/3, 2, -4? -4 Let q = 100 + -100.2. Let p(n) = -n*3 + 6n*2 - 7n + 14. Let j be p(5). Suppose k + j = 3h, 2k + 2 = h + k. What is the nearest to h in 2, q, -0.06? 2 Let j = -16 + 11. Let d = -3.883 - -0.883. Let c = 57 + -59. What is the closest to c in d, 0.1, j? d Suppose 5w = -4k + 21, 5k + 3w - 12 = 11. Let g = -0.6 - 4.4. Let z = g - -5.5. Which is the nearest to -0.1? (a) k (b) -5 (c) z c Let g(z) = z*3 + 5z*2 - 7z - 8. Let x be g(-6). Let v = -1.713 - 3.287. Let o = 4.94 + 0.06. What is the closest to x in o, v, 4? v Let v = -3473 - -3471. Which is the nearest to 2? (a) -4 (b) v (c) -1/3 (d) -4/5 c Let y = -227217 + 1821909/8. Let c = 522 - y. Let r = -5 + 5.2. What is the closest to 1 in -0.1, c, r? c Let m = -2723.9 - -2728.9. Which is the closest to 0.106? (a) -0.2 (b) -0.4 (c) m (d) 1/3 d Let l(k) = 37k - 8. Let a(p) = -75p + 18. Let g(b) = 6a(b) + 13l(b). Let f be g(-1). What is the nearest to f in 0.4, 0, -5? -5 Let n = 20 + -28. Let h = -9 - n. Let t = -1583 - -1584. What is the closest to h in 6, 3, t? t Suppose -47k - 165 = -306. What is the nearest to 2/53 in -4, -0.3, k, -2? -0.3 Let g = -7142 + 7142.2. What is the closest to 5 in 0.5, g, -0.09, 3? 3 Let x = 2817 + -2818.2. Which is the nearest to 1/4? (a) x (b) -2/5 (c) 1/3 (d) -0.1 c Let t = 0.328 + 2.672. Let l be 15/15 + 20/(-16). Which is the nearest to 0? (a) -1/11 (b) l (c) 0.1 (d) t a Let q = 0.3 + -0.2. Let g = 195855 - 195855. Which is the closest to q? (a) g (b) -2 (c) 74 (d) 3 a Let t = -2315 - -2314. Let l = -0.012 - -7.812. Let u = l + -8. Which is the closest to 1? (a) 2 (b) u (c) t a Let n be ((-4)/12)/(1/24). Let t be -4 - n/(-28) - -4. Which is the nearest to -9/4? (a) -3/2 (b) t (c) 0 a Let o = -2272 + 2270.871. Let d = o + 0.8. Let h = d + -0.071. What is the nearest to 3 in 4/7, h, 3/7? 4/7 Let i be (1/(-3))/(4/(-3)). Let z = 218 + -308. Let h = -89.5 - z. What is the nearest to i in 0.8, 0.3, h? 0.3 Let d = 2105 - 2105.054. Which is the closest to 0.2? (a) d (b) 5 (c) -1/6 a Let y = 62 + -62.3. Let p = -0.4178 - -0.0778. What is the nearest to -0.1 in -1/5, y, p? -1/5 Let p = -339 + 177. Let h be (0 - (-2)/16) + p/(-1008). Which is the nearest to -2? (a) h (b) 3/5 (c) -2/3 c Let d = -425.1056 + 0.1056. Let o = d - -425.1. Which is the nearest to o? (a) -0.07 (b) 7 (c) -3/2 a Let d = -231 + 231.068. Let h = 0.568 - d. Which is the nearest to 0? (a) 0.7 (b) h (c) -0.2 c Suppose 0 = -1021s + 1032s + 352. What is the closest to 2/3 in s, 3/4, 4? 3/4 Let q = 84 - 64. Suppose 2o + 235 = 5g, 0o + q = -4o. Let j = -43 + g. What is the closest to 0 in -0.3, j, 0.05? 0.05 Let m = 115.3 - 114.3. Let o = 212 + -1277/6. What is the closest to m in o, 0.1, 0.04, -0.04? 0.1 Suppose -46k = -50k. Suppose v - 18 = 5o, -2v + v - 3 = 2o. Let m = -557/7 - -80. Which is the nearest to k? (a) o (b) m (c) 0.2 c Let z = 0.09523 + 0.00477. Which is the closest to 2/5? (a) 1 (b) 7/18 (c) z b Let s be -2(-56 + (-2 - -2)). Let l be 655/39318/(-15). Which is the nearest to s? (a) l (b) 3/7 (c) -0.3 b Let j = -1.8 + -8.2. Let h = 6210 - 6206. Which is the nearest to j? (a) -5 (b) h (c) 2 a Suppose 4q - 7q + 3 = -3x, 15 = 5x. Let y be 4 + 1 + q/(84/(-111)). What is the closest to y in -0.3, 3, 0.05? -0.3 Let b = -0.9494 + 5.9494. Let p = 42.9 - 43. What is the nearest to -0.1 in p, 31, b? p Let l = 246.53 - 243.53. What is the closest to 0.1 in -203, 4, l? l Let w = -5.536 + -0.264. Let m = -5.7 - w. What is the closest to m in -3, 0.3, 0.63? 0.3 Suppose 4o - 16 = s, -86s = -88*s. Let d be 0 + o/(-22) + 9/(-11). Which is the closest	{ "pile_set_name": "DM Mathematics" }
(b) 4 (c) o c Let k = -0.0799 - 2.0201. Let h = 1.6 + 0.8. Let c = h + k. What is the closest to -1 in -0.4, -0.2, c? -0.4 Let r = 0.143 - -569.857. Let p = r - 569.9. What is the closest to 1/4 in 0.5, p, 2/11? 2/11 Let v = 34 - 33.5. Let h = v + -3.5. Let g be (-2)/(98/56 + 1/4). Which is the closest to 0.2? (a) h (b) 0.5 (c) g b Suppose -3l - 4h = -31, -l + 6 = -49h + 46h. Let z = -1.4 - -2.4. Which is the nearest to -0.1? (a) l (b) -5 (c) z c Let f = 0.01 - 0.71. Let v be (2/20)/1548/(-137). Which is the closest to f? (a) 4 (b) v (c) 3 b Let h = 13 + -9. Let m = -136 - -135.7. Let j = -276/1639 + -2/149. Which is the nearest to j? (a) -0.1 (b) m (c) h a Let v = 133/282 + -13/94. Suppose 0 = 2n - 5t - 14, 0n = -4n + 3t. Which is the nearest to v? (a) n (b) -3/8 (c) 0.056 c Let r = 41/4 + -10. Let v be 5/(-3)(71 - 74). Which is the closest to r? (a) 4/5 (b) v (c) -2/51 c Suppose 0 = m - p, 5p - 41 + 14 = -4m. Suppose -10w + 6w = 12. What is the nearest to m in -1/7, -3/5, -0.3, w? -1/7 Let p = -0.01926 - 0.18074. What is the nearest to p in -4, 0.4, 1/72, -5? 1/72 Let a = -2184 + 2181. What is the nearest to -3/4 in 0, -6, 1/11, a? 0 Let y = 184 + -183. Let d be 4 + (y + 2 - 7). Which is the closest to d? (a) 4 (b) -5 (c) 0 c Let y = 11.363 - 8.363. Which is the closest to y? (a) 1 (b) 85 (c) -5 a Let o = 4.98939 + 0.01061. Which is the closest to -1/4? (a) o (b) -3/7 (c) -2 (d) 2/7 b Let m(n) = 27n + 147. Let g be m(-5). Let v be (98/336)/((-9)/g). Which is the closest to -2? (a) -6 (b) 1 (c) v c Let d be (-1 + 0)/(-3 - -4). Let h(v) = 2v*2 - v - 4 + 2 - 5v + 3v. Let m be h(d). Which is the closest to -1/3? (a) m (b) 2 (c) 4 b Let c(n) = -2n*3 - 34n*2 + 38n + 30. Let l be c(-18). Let q = -3291 - -16458/5. What is the closest to 2 in 0.1, q, -2/9, l? q Let h be 13/(468/84) - 2. Let b = 19 + -17. What is the nearest to -1 in b, h, -0.2, 5/3? -0.2 Let q = 2.292 - 2.09. Let v = q - -0.098. Which is the nearest to 0.1? (a) v (b) -6/7 (c) 3 a Let h = -2 + 1.8. Let n = 3.81434 - -0.18566. What is the nearest to 1 in h, -1, n? h Let x = -331.1 + 331. Let q = -21 + 17.6. Let z = q - 0.6. Which is the nearest to x? (a) -2/5 (b) 2/5 (c) z a Let w be ((-2)/8)/((-3)/(-8)). Suppose -3s + 6s - 110 = -5i, -i + 5s = 6. Suppose -if = -14f - 105. What is the closest to w in 2/9, 2, f? 2/9 Suppose d + d + 2f = 0, -3f - 3 = 2d. Let g = -0.5886 + 0.5886. Which is the nearest to -2? (a) d (b) -6 (c) g c Let j = -12 + 12. Let n be (-18)/(-4)(4004/495 + -8). Which is the closest to n? (a) j (b) -3/4 (c) 5 a Let x = 0.68 - 0.68. Let u(j) = -j + 14. Let p be u(15). Which is the closest to p? (a) x (b) -30 (c) -5 a Let d be 2/((-18)/(-45))(-8)/(-220). Let a(v) = -14v + 4. Let n be a(-3). What is the nearest to 2/7 in d, 0, n? d Let k = -2 - -1. Let d(l) = 3l2 + 112l - 87. Let f be d(-38). Let t be (f/9 - -1)/(12 + -13). What is the nearest to k in 2/11, 2, t? 2/11 Let g = 35.946 + -36. Let o = 0.554 + g. Let d be (-52)/20 + (-15)/(-5). Which is the nearest to 1? (a) d (b) o (c) 2/17 b Let t = 9341 - 9346. What is the nearest to 0.1 in 752, t, -1, 0.2? 0.2 Suppose -o = j + 2, -j - 2o - 22 = 3o. Let s = -173 - -117. Let m = s + 58. What is the closest to 1/2 in j, m, 5? m Let y = 842.8 + -842.82. Which is the closest to -2? (a) y (b) 25 (c) -0.4 (d) -4 c Suppose -4s = 3n + s + 31, 0 = -5n + 2s. Let p = -1860.824 + 1868. Let w = p - 0.176. What is the nearest to 2 in 0, n, w? 0 Let t = 2955 - 11805/4. What is the closest to 1 in 1, t, -5? 1 Let j = -354651 + 354649. Suppose -2s = -4s. Which is the closest to j? (a) s (b) 20/7 (c) -5/3 (d) -2/9 c Let f = 0.73 + -0.2. Let i = -5.53 - -4. Let n = f + i. Which is the closest to 0.1? (a) 6 (b) 4 (c) n c Let l(w) = -4w2 + 16w - 1. Let g be l(12). Let r be ((-16)/(-10))/(22/g). Let u = r + 28. Which is the closest to u? (a) -2 (b) -4 (c) -1/3 c Let a = 25.4 + -25.4. Let w = -173 + 173.1. What is the nearest to a in w, 5, -0.4? w Let p = -23.5 - 24.4. Let d = p - -48. Let x = -21/19 + 277/285. Which is the nearest to 3? (a) x (b) d (c) 4 c Let v = -115/381 - 4/127. Let l = -0.5 - 0.5. Which is the nearest to 0.1? (a) -3 (b) v (c) l (d) 1 b Let k = -50.273 - -0.273. Let f = k - -49. What is the closest to 0.1 in -1/2, f, 4? -1/2 Suppose -2p - c + 24 = 3p, -3c = 4p - 17. Let q be (-12)/(-15)p/(-2). Let o = -20.21 + 20.71. What is the nearest to 2 in o, q, 1/4? o Let v = -16594 + 16594.1. Which is the nearest to -1/17? (a) 2 (b) -6 (c) v c Let j = 0.1607 - 1.5607. Let t be 99/(-22)(-4)/15. Which is the closest to -1/3? (a) j (b) t (c) -1/9 c Suppose -4b = 8, -3d + 3b + 11 = -8d. What is the closest to d in 19/5, 3, 0.07? 0.07 Let j be (280/75 + -4)/(2/(-5)). Let s = 35/24 - 67/24. Let o = -17/4 - -15/4. Which is the closest to o? (a) s (b) j (c) -5 a Let s = -235/4 + 59. Let h = 22740/947 + -59078004/2419585. Let m = h + 2/511. Which is the closest to m? (a) 0.4 (b) s (c) -3/8 c Let t = 150.3 - 150.3. What is the closest to t in -6/11, -5, -0.5? -0.5 Let u = -54/19 - -416/133. What is the nearest to -2/9 in u, 8/3, 0, -1? 0 Let w be (-4)/(-14)(-6 - -7). Let i = 2372/5 - 475. Let a be 26/(-42) - (-4)/14. What is the closest to 0 in a, w, i? w Let r be 6/15 - ((-91)/(-15) + -5). Let f = -65 - -58.8. Let y = 6 + f. What is the closest to -0.1 in 4, r, y? y Let l be (-9 - 9/27) + (12 - 2). Let j = 2.6 + -18.6. Which is the closest to 0? (a) -3 (b) j (c) l c Let x be ((-2)/(-6))/(21/9(-117)/(-273)). What is the nearest to 0 in x, 7/3, -0.4, 0.5? x Let r(o) = 739 - 6o + o3 - 5o - 752 - 11o2. Let b be r(12). Let l(w) = -2w - 2. Let j be l(-2). What is the closest to -8 in b, -0.1, j? b Let g = -0.9 - -0.85. Let z = -0.15 + g. Let i = -81 - -80. Which is the closest to -1? (a) -5 (b) z (c) i c Let n = 0.2 + -0.7. Let b(s) = -s*2 - 3s - 1. Let y be b(-3). Let u = -11/2 - -51/10. What is the closest to u in y, 5, n? n Let m = 4 + 13. Let s = m + -16.8. Let v = -122 + 126. What is the closest to -1/3 in v, 1/3, s? s Let c(k) = -6k2 + 32k + 22. Let y be c(6). What is the nearest to -0.113 in -2/3, y, 5, -1/6? -1/6 Let o = -2191.99 + 2191.9. What is the closest to -1 in 12, -2, o? o Suppose 7k = -3k + 110. Suppose 5a - 2x = 2a + k, a + 1 = -4x. Suppose 0 = -3j - a - 9. What is the closest to 0 in j, 0.2, -5? 0.2 Let m = 0.4586 - -0.0094. Let p = -4.532 - m. Let n be (-4)/(-22) + (0 - 0). Which is the nearest to 0.1? (a) -2/7 (b) n (c) p b Let y = 15530 - 15531. Let f = -4.8 + 5. Let r = 0.7 - f. What is the nearest to -1/16 in r, y, -0.4? -0.4 Let f = 100.22 + -0.22. Let i = 97 - f. Let s = -0.1 - 0.4. What is the closest to -0.1 in 0, s, i? 0 Let q = 578 + -316. Let i = q - 266. Which is the closest to 10? (a) 0 (b) -4/7 (c) -3 (d) i a Let p = -488 - -712. Let o = p - 228. Which is the nearest to 0? (a) 0.4 (b) -21 (c) o a Let r = 0.8 + -0.5. Let s be (4 + 30/(-12))692/(-1557). What is the nearest to r in s, 9, 0.5? 0.5 Let s = -504.227 + 504. Let v = 17.227 + s. What is the nearest to v in 0.7, -1, 2? 2 Let h = -0.31 + -0.04. Let j = 0.15 - h. Let l = 0.6 - j. What is the closest to l in -2, 1/6, 2/17? 2/17 Let k = 62.45 + -62.45. What is the nearest to -1.5 in -2/7, 1/5, -0.05, k? -2/7 Suppose 96 = 4m - 2h, -4m + 6m + 3h = 56. Let u = -1172 - -1176. Let f = 1.4 - 1.3. What is the nearest to f in -2/9, m, u? -2/9 Let i(r) = -25r - 273. Let y be i(-11). Let x = -9 + 13. Which is the nearest to -3? (a) x (b) 0.3 (c) y b Let w = 25/36 - 17/18. Let n = -13 + 19. What is the nearest to w in n, 0.3, -1? 0.3 Let q = 61247.1 + -61247. Let o = -2 - -9/4. Which is the nearest to q? (a) -1/10 (b) o (c) 4/7 b Let b = 80306747/221144872 + 3/395608. Let y = b + -9/43. Let a = -91 - -90.7. What is the closest to y in 1, a, -2? a Let q be 17 + 175/(-10) - 0(-1)/(-3). What is the closest to q in 0.2, -5, -4, -4.3? 0.2 Suppose d = -15d - 627 + 643. What is the nearest to -3 in 4, d, -68? d Let y = -34.2202 + 0.2202. Which is the closest to -2? (a) 0 (b) -2 (c) y b Let f(g) = -141*g + 1131. Let j be f(8). What is the nearest to -1/3 in j, 5, -1, -0.03	{ "pile_set_name": "DM Mathematics" }
e 14) in base 12? -23bb73 What is -627788 (base 9) in base 14? -99dca -14020627 (base 9) to base 8 -32320176 What is -45eac (base 16) in base 14? -7651a What is 4312603 (base 7) in base 14? d9173 -3ce43d (base 15) to base 11 -1724261 What is 259110a (base 14) in base 2? 1000101000010001011110110 Convert 14d17 (base 14) to base 9. 78244 Convert 15333716 (base 8) to base 12. 121937a What is -3b125 (base 13) in base 7? -635563 What is 10020210021121 (base 3) in base 8? 6456677 cbec0 (base 16) to base 11 520601 12303241 (base 7) to base 14 20c958 -a4a94 (base 14) to base 9 -664802 What is 3794169 (base 10) in base 8? 16362371 What is 3154815 (base 10) in base 3? 12221021121000 -2122100200112 (base 3) to base 8 -5267212 -784d8 (base 15) to base 7 -3152045 47baa8 (base 14) to base 9 4547170 16440 (base 7) to base 16 124b -1001001010111110 (base 2) to base 12 -198a6 What is 41b81 (base 14) in base 12? 779b1 -33212131233 (base 4) to base 14 -7865c3 What is -66a18 (base 11) in base 16? -17b25 What is -41132240 (base 5) in base 3? -121221101211 What is 317a6 (base 11) in base 7? 251513 -b0fb0 (base 16) to base 4 -2300332300 What is -1044222024 (base 5) in base 7? -25566113 What is 1110200002220 (base 3) in base 16? bea25 What is -4b72a (base 12) in base 10? -102994 What is 14003243 (base 5) in base 11? 96a99 -1d1df (base 16) to base 4 -131013133 What is -8cb3a7 (base 15) in base 9? -13572654 -71536d (base 14) to base 6 -213454005 3b373 (base 12) to base 13 2b284 What is 32ab2 (base 12) in base 3? 10102020022 What is 200022000010 (base 3) in base 10? 360129 What is -121110122 (base 3) in base 14? -4537 Convert 2b85a (base 13) to base 11. 57167 What is 21041 (base 9) in base 3? 201001101 What is -101111000101010111111 (base 2) in base 9? -2811344 10010000110001101 (base 2) to base 3 10202200101 -1552517 (base 8) to base 3 -211202022001 209990 (base 10) to base 11 133850 67276 (base 10) to base 13 24811 -98318 (base 10) to base 8 -300016 Convert -215403142 (base 6) to base 16. -3b9306 Convert 214002665 (base 7) to base 6. 1134513532 -2231400422 (base 5) to base 15 -67ba77 -167210 (base 8) to base 9 -102678 Convert -334b6 (base 12) to base 2. -10000101000001010 -1101100011110101011010 (base 2) to base 13 -975c58 1011001101111001001 (base 2) to base 16 59bc9 1011111011101111011 (base 2) to base 8 1373573 What is 110112111112 (base 3) in base 16? 3c3ef Convert 249169 (base 10) to base 3. 110122210111 -2080509 (base 12) to base 3 -102112212120000 What is -135415500 (base 6) in base 5? -1203130424 What is -34a16 (base 12) in base 7? -412524 Convert -241141304 (base 6) to base 14. -8621a8 What is -19466 (base 11) in base 16? -6a28 What is -1406327 (base 8) in base 10? -396503 Convert -866571 (base 9) to base 2. -1111110000111111001 Convert 2622d (base 16) to base 10. 156205 Convert 16031535 (base 7) to base 8. 5672346 Convert -16a909 (base 13) to base 16. -8a38f 14776077 (base 8) to base 4 30333300333 Convert 317764 (base 11) to base 13. 14a311 270 (base 11) to base 5 2234 What is 13522615 (base 7) in base 6? 43050331 102220111200 (base 3) to base 2 111001001110001010 What is 131a5b (base 12) in base 16? 4cba7 Convert -1605340 (base 7) to base 16. -35cdd What is 14042324 (base 6) in base 8? 1632354 What is -22b0ca (base 13) in base 5? -202332131 Convert -12120200111 (base 4) to base 15. -230b92 Convert -c119 (base 15) to base 2. -1001111100101101 What is 170a1 (base 16) in base 7? 542062 3798a (base 14) to base 13 4a09b 2461319 (base 12) to base 6 412014033 Convert 17047667 (base 8) to base 12. 13a7447 Convert 112270 (base 8) to base 5. 2204242 8dcd33 (base 14) to base 16 49d091 What is -142103043 (base 5) in base 2? -10110100001001101010 What is -129a67 (base 14) in base 7? -5310660 What is 1111010011111110010 (base 2) in base 7? 4156550 14428 (base 16) to base 2 10100010000101000 6f486 (base 16) to base 12 19b946 What is 58d25 (base 16) in base 4? 1120310211 What is -14c0b8 (base 13) in base 15? -a1abc -184652 (base 9) to base 6 -2244202 1000110001001101 (base 2) to base 4 20301031 13453203 (base 6) to base 10 458211 Convert 11000001101100001001 (base 2) to base 9. 1438243 -617657 (base 8) to base 2 -110001111110101111 What is bb1c73 (base 13) in base 7? 52264620 -43340603 (base 7) to base 10 -3707441 What is -124142532 (base 6) in base 15? -332d1e 2411111 (base 5) to base 2 1010110111110011 What is 13341412 (base 5) in base 11? 94013 -8773045 (base 9) to base 5 -2201304101 -22220220121012 (base 3) to base 14 -8b611b Convert 19521 (base 16) to base 6. 2120053 What is 1099b6c (base 13) in base 16? 4de7ac What is -b95c1 (base 13) in base 11? -209717 Convert -38514 (base 10) to base 3. -1221211110 97265 (base 12) to base 3 101010002112 Convert -33333221 (base 4) to base 16. -ffe9 Convert 432354 (base 8) to base 16. 234ec What is -23212102 (base 4) in base 16? -b992 What is -3dd508 (base 14) in base 13? -5a3523 Convert 662551 (base 8) to base 3. 102022022022 What is -22078 (base 9) in base 10? -14651 What is 124732 (base 10) in base 8? 363474 What is 153987 (base 10) in base 5? 14411422 What is -11000010000011101 (base 2) in base 9? -161256 What is 21007245 (base 8) in base 4? 101000322211 101010000000101 (base 2) to base 10 21509 What is 149630 (base 10) in base 5? 14242010 What is -152a793 (base 12) in base 15? -59b1b0 What is -2868568 (base 13) in base 8? -60703013 -3808700 (base 10) to base 12 -1338138 51fba (base 16) to base 8 1217672 Convert 2c536 (base 16) to base 5. 21302213 92371 (base 10) to base 2 10110100011010011 Convert -1626100 (base 8) to base 7. -3665332 -155094 (base 10) to base 6 -3154010 Convert 2c30e (base 16) to base 15. 38971 Convert -21324c (base 15) to base 6. -53510530 Convert 8312735 (base 11) to base 7. 235503562 What is 20510205 (base 6) in base 9? 1114185 Convert 214963 (base 11) to base 15. 6ba6a 1010143242 (base 5) to base 16 1f164a 5de308 (base 16) to base 4 113132030020 What is 3141034 (base 5) in base 10? 52644 Convert -3379 (base 15) to base 11. -8222 What is -47729 (base 14) in base 11? -109a38 182781 (base 11) to base 16 44cb1 Convert -110001000110100 (base 2) to base 13. -b59b Convert -10222010010212 (base 3) to base 13. -58a876 Convert -40415432 (base 6) to base 3. -2011121011002 Convert 99430 (base 11) to base 14. 3a809 What is -342647 (base 8) in base 14? -30475 What is 530441 (base 6) in base 13? 1670b What is -12311001302 (base 4) in base 9? -3327452 -122266 (base 8) to base 9 -63751 Convert -5b2cb (base 15) to base 12. -12040b Convert -1431235 (base 6) to base 10. -81959 Convert -11011010010010100 (base 2) to base 9. -180272 Convert -2023224441 (base 5) to base 6. -224130252 What is -350384 (base 9) in base 7? -1534015 What is -496864a (base 11) in base 10? -8634977 What is 303535 (base 7) in base 11? 3594a 5324015 (base 6) to base 10 260075 Convert -10001100110001000101 (base 2) to base 13. -172595 111001101001001110100 (base 2) to base 10 1888884 Convert -39cc4 (base 16) to base 6. -5024004 5514353 (base 6) to base 7 2222115 Convert 37009 (base 11) to base 8. 150001 -1b2469a (base 12) to base 13 -12715a8 -11202111110 (base 3) to base 16 -16deb -11424344 (base 5) to base 8 -323103 What is -1031244303 (base 5) in base 15? -2da81d Convert -102111201 (base 4) to base 10. -75105 -10211201020 (base 4) to base 8 -4454110 What is -2880716 (base 10) in base 2? -1010111111010011001100 Convert -11334426 (base 7) to base 10. -1000404 722515 (base 8) to base 16 3a54d -21478 (base 9) to base 2 -11011110100110 -13100440202 (base 5) to base 16 -f49bd5 -102060533 (base 7) to base 9 -12276642 Convert 102212111102011 (base 3) to base 2. 11000000100000111110010 Convert 13101032022 (base 4) to base 11. 1091735 What is 2336371 (base 8) in base 7? 5265434 3b3034 (base 13) to base 16 15e43c Convert 114401 (base 6) to base 13. 4786 What is 233032332 (base 5) in base 8? 4037415 24461513 (base 8) to base 5 2340234441 345016 (base 14) to base 9 3313811 Convert 15533423 (base 6) to base 14. 106cab What is 113210414 (base 5) in base 12? 212529 Convert 4a042 (base 13) to base 10. 136268 -122100000212 (base 3) to base 13 -bc3ba What is 4dfd5e (base 16) in base 8? 23376536 What is -240132032 (base 5) in base 13? -2c630a 20012120112 (base 3) to b	{ "pile_set_name": "DM Mathematics" }
earest 1000000? 2526000000 Round 0.00094898869 to 7 decimal places. 0.000949 What is -12008.3765 rounded to the nearest 10? -12010 What is 1444608070 rounded to the nearest one million? 1445000000 What is 3578200.314 rounded to the nearest 1000000? 4000000 Round -995.297 to the nearest 10. -1000 What is 0.129941476 rounded to 4 dps? 0.1299 Round 23947156.1 to the nearest 10000. 23950000 What is -9433701.2 rounded to the nearest 1000? -9434000 Round -0.0000594980098 to 5 decimal places. -0.00006 Round 129194879 to the nearest one hundred thousand. 129200000 What is 68.518457 rounded to 1 dp? 68.5 Round 0.000061156686 to 5 dps. 0.00006 What is 5.714987157 rounded to 4 decimal places? 5.715 Round -2378833.27 to the nearest one million. -2000000 What is 83.372456 rounded to the nearest ten? 80 What is 45908571.9 rounded to the nearest one thousand? 45909000 What is 13.82071907 rounded to 1 decimal place? 13.8 Round -169.990079 to 2 decimal places. -169.99 Round 152465004 to the nearest 100000. 152500000 Round -0.018643334988 to 3 decimal places. -0.019 Round 2.026390877 to 4 dps. 2.0264 Round 0.02872767287 to 4 dps. 0.0287 What is 0.026711855 rounded to 3 dps? 0.027 What is -0.0175659345 rounded to two dps? -0.02 What is 139409.46767 rounded to the nearest one thousand? 139000 What is -196.969334 rounded to the nearest 100? -200 What is -1779304.62 rounded to the nearest one thousand? -1779000 Round 238566.68 to the nearest 10000. 240000 What is -8.546116275 rounded to 2 dps? -8.55 What is -0.266493743 rounded to four decimal places? -0.2665 What is 78.7980652 rounded to the nearest ten? 80 What is 12822037.38 rounded to the nearest one thousand? 12822000 Round 0.0000020356981 to five decimal places. 0 What is 0.000128636936 rounded to 5 dps? 0.00013 What is 0.0140250291 rounded to three dps? 0.014 What is -50180.74 rounded to the nearest ten thousand? -50000 What is 0.0369430266 rounded to 2 decimal places? 0.04 What is -8.24303035 rounded to one decimal place? -8.2 Round 12571330.251 to the nearest 100000. 12600000 Round 890.50027 to the nearest 10. 890 What is -0.00001459079373 rounded to six dps? -0.000015 What is 28479460 rounded to the nearest 10000? 28480000 What is 0.329592303 rounded to 1 decimal place? 0.3 Round 0.000082390687 to 4 dps. 0.0001 What is -76.118102 rounded to two dps? -76.12 Round 11836525.12 to the nearest 1000. 11837000 What is 99650.2402 rounded to the nearest one hundred? 99700 Round 5026737.92 to the nearest one thousand. 5027000 What is 873.223968 rounded to the nearest 100? 900 What is -102.5258529 rounded to 2 decimal places? -102.53 Round 886039.27 to the nearest 1000. 886000 Round -26054229.9 to the nearest one thousand. -26054000 Round 7.43685248 to one dp. 7.4 Round 3582147.8 to the nearest 1000000. 4000000 What is -172881.2198 rounded to the nearest one hundred thousand? -200000 Round 10907.9177 to the nearest 10. 10910 What is 11887.363 rounded to the nearest 100? 11900 Round 0.0056620163 to 4 decimal places. 0.0057 Round 20663.72179 to the nearest 10. 20660 What is 123.9951903 rounded to 2 decimal places? 124 What is -93893.23396 rounded to the nearest 10000? -90000 What is 5.7052914 rounded to the nearest integer? 6 Round 0.001213496014 to seven dps. 0.0012135 Round 55988662.8 to the nearest 1000000. 56000000 What is 0.186170344 rounded to 2 decimal places? 0.19 What is -57299.7842 rounded to the nearest ten thousand? -60000 What is 0.00176240755 rounded to seven decimal places? 0.0017624 Round -0.009831723992 to 6 dps. -0.009832 Round 0.000007961606 to 5 dps. 0.00001 Round 924.145905 to the nearest 100. 900 Round 50.7640495 to 2 dps. 50.76 Round -0.0000039024652 to six dps. -0.000004 Round -0.75245909 to 4 decimal places. -0.7525 What is -0.214516622 rounded to five dps? -0.21452 Round 1927.89146 to the nearest 100. 1900 What is 11.119601 rounded to the nearest 100? 0 Round -185104.5904 to the nearest 10000. -190000 What is 0.000198123713 rounded to 6 decimal places? 0.000198 Round -0.000056982166 to 6 decimal places. -0.000057 Round 0.1777347667 to 4 dps. 0.1777 Round 1442823028 to the nearest 1000000. 1443000000 Round 2.209536471 to 1 decimal place. 2.2 What is -12863.57049 rounded to the nearest one thousand? -13000 What is -0.395799622 rounded to four decimal places? -0.3958 Round -326.35265 to the nearest one hundred. -300 Round -0.00000498955182 to 6 dps. -0.000005 What is -332.710541 rounded to 0 dps? -333 Round -1.5528965 to 1 dp. -1.6 What is 91.36279 rounded to the nearest one hundred? 100 What is 7523852 rounded to the nearest one million? 8000000 Round -0.0000571234276 to 5 decimal places. -0.00006 What is -534642.5 rounded to the nearest one hundred thousand? -500000 Round -0.000000293329335 to 7 decimal places. -0.0000003 What is 810.40188 rounded to one dp? 810.4 What is -4845388600 rounded to the nearest one million? -4845000000 Round 986517.37 to the nearest 1000. 987000 What is -1397350160 rounded to the nearest one hundred thousand? -1397400000 What is 0.000333720578 rounded to 5 dps? 0.00033 What is 459.378624 rounded to one decimal place? 459.4 What is -300.9111205 rounded to one dp? -300.9 Round -0.4892469466 to 3 dps. -0.489 What is -322192.886 rounded to the nearest 1000? -322000 What is -0.02276834453 rounded to six dps? -0.022768 What is -1125167.17 rounded to the nearest one hundred thousand? -1100000 What is 3464129.38 rounded to the nearest 1000? 3464000 What is -8107136.428 rounded to the nearest ten thousand? -8110000 What is 0.122982917 rounded to 4 decimal places? 0.123 Round -1057542.647 to the nearest 100. -1057500 Round -0.00008161810608 to 7 dps. -0.0000816 What is -25.96432053 rounded to three decimal places? -25.964 What is 0.0195034733 rounded to four dps? 0.0195 What is 17682.6242 rounded to the nearest ten? 17680 Round 0.000140554279 to 7 dps. 0.0001406 What is 223897838 rounded to the nearest 10000? 223900000 What is 17.433704 rounded to three decimal places? 17.434 What is 0.009510878 rounded to 2 dps? 0.01 Round 652339.7068 to the nearest 10000. 650000 Round -18239200940 to the nearest one million. -18239000000 Round 234392.7763 to the nearest 100. 234400 What is -40.68661055 rounded to the nearest 10? -40 Round -9.9962952 to 0 dps. -10 Round 0.000001256303 to five dps. 0 What is 5.71565249 rounded to 0 dps? 6 Round 3919872.52 to the nearest 10000. 3920000 What is 0.00003602634572 rounded to 5 decimal places? 0.00004 Round 0.016408134173 to five decimal places. 0.01641 What is 0.0093878656 rounded to 5 dps? 0.00939 Round 2561.84396 to the nearest one hundred. 2600 What is 33318439880 rounded to the nearest one million? 33318000000 What is 1.25840033 rounded to four dps? 1.2584 Round -1.83450358 to 2 decimal places. -1.83 Round -170027.089 to the nearest one thousand. -170000 What is 0.000008303428 rounded to 6 dps? 0.000008 What is 0.14532121 rounded to 2 dps? 0.15 Round -0.0517315713 to 5 decimal places. -0.05173 What is -3182612531 rounded to the nearest one million? -3183000000 Round -1311833911 to the nearest 10000. -1311830000 What is -23725.7375 rounded to zero dps? -23726 What is -1706850.69 rounded to the nearest ten thousand? -1710000 What is -3.7829676 rounded to the nearest integer? -4 What is 85.157118 rounded to two dps? 85.16 Round 25.86649084 to 1 decimal place. 25.9 Round -0.000451757619 to five decimal places. -0.00045 What is 16.78361694 rounded to 3 decimal places? 16.784 Round 2404.8545 to the nearest 100. 2400 What is 0.003360237 rounded to 3 dps? 0.003 What is 5365.11453 rounded to zero dps? 5365 Round -27830.8665 to the nearest 1000. -28000 What is -2610290.38 rounded to the nearest 1000? -2610000 What is 0.657875769 rounded to one dp? 0.7 What is -60.121365 rounded to the nearest 10? -60 What is 154785193.5 rounded to the nearest 10000? 154790000 What is -9810.6921 rounded to the nearest 10? -9810 Round 0.000214824223 to four decimal places. 0.0002 Round -2074.62649 to the nearest 10. -2070 What is -0.0000101914347 rounded to seven dps? -0.0000102 What is 1040964.1783 rounded to the nearest 10000? 1040000 What is 0.001807149055 rounded to 5 dps? 0.00181 What is -764658200 rounded to the nearest 100000? -764700000 Round 699914.243 to t	{ "pile_set_name": "DM Mathematics" }
k be -3 - (-5 + (4 - 2)). Suppose 69 = -kl + 3l + i, -57 = -2l + 3i. What is the units digit of l? 4 Let o = -11 + -23. Let l = o - -56. What is the units digit of l? 2 Let x(v) = v3 + v2 + 7. Let g be x(0). Suppose -3j + 196 = -gj. What is the tens digit of (-2)/(-3) - j/3? 1 Let n(l) = 62l + 3. Let o be n(-4). Let y = -17 - -13. What is the units digit of 2/y + o/(-14)? 7 Let p(w) = -w3 - 17w*2 + 14w + 25. What is the tens digit of p(-18)? 9 Let m = 5 + -3. Let y(r) = -r*2 + 6r - 7. Let k(p) = p*2 - 5p + 6. Let g(f) = 5k(f) + 4y(f). What is the units digit of g(m)? 4 What is the units digit of -111(4/12)/(-1)? 7 Suppose 3n - 43 - 20 = -2g, 2n + 3g = 47. What is the units digit of n? 9 Let v(u) = u3 - 2u - 5u2 + 1 + 2u. Let y be (10/3)/((-4)/(-6)). What is the units digit of v(y)? 1 Let f = 2 + -2. Suppose 2v - 6 - 10 = f. What is the units digit of v? 8 Suppose 9 = 3f - 6. Suppose -fr = u - 94, 2r - 75 = -2r - u. What is the units digit of r? 9 Suppose -2g + g + 49 = 0. What is the tens digit of g? 4 Let r = -6 + 9. Suppose 4p - 3v - 3 = 0, rv + 4 = p - v. Suppose o = 4o + 3l + 12, -4o - 5l - 21 = p. What is the units digit of o? 1 Let s(i) = 2i*2 + 5i + 5. What is the tens digit of s(-5)? 3 Suppose -5q - 2a = -356, -3q + 25 = -5a - 170. Suppose 3z = 41 + q. What is the tens digit of z? 3 Let b(r) = r + 7. Let y be b(-9). What is the units digit of (y - -56) + (-3 - 0)? 1 Let i(x) = 2x*2 + 13x - 10. What is the tens digit of i(-11)? 8 Suppose 0 = -3t - 4g + 33, 2t - 81 = -3t + 2g. Let s = 8 - t. Let a(l) = -l + 2. What is the units digit of a(s)? 9 Let k(v) = v2. Let x be k(-2). Suppose z - 102 = xz. What is the units digit of (-2)/6 - z/3? 1 Let n(a) = -4a + 2a + 0a + a2 + 3a. What is the units digit of n(-5)? 0 Suppose 28 = -x + 3x. What is the tens digit of x? 1 Let d = 0 - -2. Suppose 3c - 24 = -3a - 0c, a - c + d = 0. What is the units digit of a? 3 Let g(a) = a + 17. Let y be g(0). Let v = -12 + y. Suppose 0 = -vj + 10 + 20. What is the units digit of j? 6 Let a(u) = -u2 + 29u + 7. What is the hundreds digit of a(12)? 2 Suppose 0 = -3q + 308 - 89. What is the units digit of q? 3 Let k(c) = -2c*2 - 7c - 4. Let o be k(-4). Let i(r) = -r + 4. What is the tens digit of i(o)? 1 Let b = 164 - 97. What is the tens digit of b? 6 Let l(w) = -w - 2. Let f be l(5). Let s = 10 + f. What is the units digit of s? 3 Let q(y) = y*3 + 6y*2 - 8y - 5. Let i be q(-7). Let d(p) = 4pi + 3 + 3p - 3. What is the tens digit of d(-2)? 1 Let a(c) = 30c + 3. What is the tens digit of a(2)? 6 Suppose c - 381 = 2i - 4i, -5c - 3i = -1891. What is the tens digit of c? 7 Suppose 4q + 2 = -x, -5q = 4x + 7 + 12. Let y(w) = w*2 + 2w - 7. What is the units digit of y(x)? 7 Let w(l) = 3l3 - l2 - 2l + 1. Let x be w(2). Let y = -7 + x. What is the units digit of y? 0 Let u(w) = -15w - 42. What is the units digit of u(-6)? 8 Let l(d) = 4d. What is the tens digit of l(4)? 1 Let r(t) = -t*3 - 19t*2 - 21t + 43. What is the units digit of r(-18)? 7 Let j(w) = w*2 + 9w + 3. Let b be j(-10). Let s = -27 - -19. Let k = b + s. What is the units digit of k? 5 Suppose -5v = 3i - 210, v + 2v = -2i + 139. Let n = -34 + i. Suppose 21 + n = 4m. What is the tens digit of m? 1 Suppose -3a - 5g + 46 = 0, 5g + 2 + 3 = 0. What is the tens digit of a? 1 Let i(l) = -l*3 - 2l*2. Let h be i(-2). Suppose hb - 4b = 5k - 94, 5b = -4k + 68. Suppose 0 = 4x - 50 + k. What is the units digit of x? 7 What is the units digit of ((-656)/24)/((-2)/3)? 1 Suppose 20 = -5m, 5j - 4m + 4 + 0 = 0. What is the tens digit of 467/15 + j/30? 3 Suppose -199 = -5o + 56. What is the tens digit of o? 5 Let a(y) = y2 + 8y + 7. Let u be a(-5). Let n(m) = -2m - 3. What is the units digit of n(u)? 3 Let t = 5 - 0. Suppose -p = 5o - 22, -tp + o - 6o + 30 = 0. Suppose pg = 2 + 8. What is the units digit of g? 5 Let q(w) = -w - 1. Let o(l) = -l2 + 12l - 3. Let t(i) = o(i) + 3q(i). What is the tens digit of t(3)? 1 Let f = -249 - -475. What is the tens digit of f? 2 Let s = 40 - 15. Suppose 3d - 8d + s = 0. What is the units digit of d? 5 Let a(y) = -3y - 1. Let g be a(1). Let m = 7 + g. What is the units digit of (m/(-6))/(2/(-16))? 4 Let m(f) = f*3 + 8f - 2f + f2 - 10f*2 - 7. What is the tens digit of m(9)? 4 Suppose 1 = -2v + 17. Let m be 3(v + -12). Suppose -n = 2n - m. What is the units digit of n? 6 Suppose 4z + 5d = -27, z - 5d - 21 = -9. What is the tens digit of (-40)/z - 3/9? 1 Suppose 4b + 3q = 194, b = 5q - 10 + 70. What is the tens digit of b? 5 Suppose z + m + 2 = 0, 2z + 3m + 14 = 3z. Let f(g) = -g*3 + 3g - 1. Let a be f(z). Let k = a + 7. What is the units digit of k? 4 Let p be (-9)/(-3) + -13. Suppose o + o - 12 = p. Suppose d - o = -2. What is the units digit of d? 4 Suppose -4y = 2c - 5y - 6, 2y = 2c - 8. Suppose -1 = -ct - 7. Let j(m) = -m. What is the units digit of j(t)? 3 Suppose 2t - 69 + 9 = 0. Suppose -2v + 5v = t. What is the tens digit of v? 1 Let c(h) = h*3 - 6h*2 - 8h + 7. Let z be c(7). Suppose -4n + n + 27 = z. What is the units digit of n? 9 Let d be (-1)/(-3)(2 - -4). Let i(t) = 0t + 7 + t - 2t*d + 3t*2. What is the units digit of i(0)? 7 What is the units digit of (63 - 11) + 0/(-1) + 1? 3 Let q = -3 + 1. Let k be (-16)/(-40) + q/5. Suppose 0 = 3u + a + a - 5, k = -2u + 4a - 2. What is the units digit of u? 1 Let f(k) be the first derivative of 2k3/3 + k2/2 - 2k + 2. What is the tens digit of f(3)? 1 Suppose -z + 70 = -r - 2r, -4z + r + 313 = 0. What is the units digit of z? 9 Let h(i) = 4i2 - 9i + 9. Let w(y) = 5y2 - 10y + 10. Let x(o) = -4h(o) + 3w(o). What is the units digit of x(4)? 2 Let j = 18 - 9. Let i be 2/3 + 210/j. Suppose -4h = -0h - i. What is the units digit of h? 6 Suppose 2y - 2 = 4r, 4y + 2 = -r - 3. What is the units digit of (-19)/r - (1 - 3)? 1 Let j be (-1 - 0)/((-2)/10). Let i be 26 + j/((-5)/(-2)). Suppose -4o - z = -31, 0 = o + 4z - i + 9. What is the units digit of o? 7 Suppose 0 = y + 4k - 31, -k - 3k + 53 = 3y. What is the tens digit of y? 1 Let j(c) be the third derivative of c5/30 - c3/6 + 4c2. What is the units digit of j(-2)? 7 What is the hundreds digit of 1704/10 + -2 - 30/75? 1 Suppose 2 = -4s - 6. Let b(a) = -4a3 + a2 + 2a - 1. Let g be b(s). Suppose -4f + g + 25 = 0. What is the units digit of f? 4 Let v(f) = f3 + 4f*2 + 3f + 1. Let o = 9 - 11. Let b be v(o). Suppose -3r = 5d - 6, -br - 3d = -9 + 3. What is the units digit of r? 2 Suppose 2 = 5g - 268. What is the tens digit of g? 5 Suppose 0 = 2y + 2k - 2 - 4, 24 = 5y + 2k. Let b = y + -10. What is the units digit of ((-2)/b)/((-1)/(-6))? 3 Suppose x = -5g + 6x + 210, 3g = -4x + 161. What is the units digit of g? 7 Let x(d) = -2d + 4 + 5 + 2 + 1. What is the units digit of x(-5)? 2 Suppose -15 = -4z + 81. Let o = z + -17. Suppose 3c = -3q + 6, 0 = -4c + oq - 2q - 1. What is the units digit of c? 1 Let s = 32 - -10. What is the units digit of -1(s/(-3))/1? 4 Suppose -23 = -p - 8. What is the units digit of ((-6)/4)/(p/(-20))? 2 Suppose -99 = -0q - 3q. Suppose -3z = -21 - q. What is the units digit of z? 8 Let t(r) = 3 - 3r + 2r - r + 0r. What is the units digit of t(-4)? 1 Let z = 12 + -2. Suppose -z = -4d - d. Suppose -4a - do - 1 = -25, 0 = -4a + 4o + 12. What is the units digit of a? 5 Let u = 115 + -67. What is the units digit of u? 8 Let x = 56 + -29. What is the units digit of x? 7 Let j be (-3)/(-6)(-4)/(-1). What is the tens digit of 20/2545/j? 1 Suppose w = -4k + k - 12, -22 = -4w + 2k. Suppose 0t - w = n + 2t, 3n = 4t + 11. What is the units digit of n? 1 Let n(q) = q3 - 8q*2 - 10q + 4. Let i be 2 + -2 - (-1 - 8). Let l be n(i). Let k(j) = -2j - 7. What is the units digit of k(l)? 3 Let u(y) = -y3 + 6y*2 + 7y + 4. Let i be u(7). Suppose i + 2 = 3p. What is the units digit of p? 2 Let g be -2 - (-6 + 3)/(-3). Let n be (-2)/g(-1 - -4). Suppose 3q = nq + 1. What is the units digit of q? 1 Let i = 5 + -5. Suppose i = -2*a - a + 21. Let q = -5 + a. What is the units digit of q? 2 Let x(u) be the third d	{ "pile_set_name": "DM Mathematics" }
- (sqrt(416)-4 - sqrt(416)))))/(sqrt(96)/(sqrt(120)/sqrt(10))))2. -200sqrt(13) + 5225 Simplify (((-2sqrt(190) + sqrt(190) - sqrt(190))-4 + -5-2sqrt(190))4)/((-3sqrt(490)-2 - sqrt(490))4). 18sqrt(19)/35 Simplify 4 + (-4sqrt(100)/(sqrt(10)2))/(-3sqrt(72)-2). -sqrt(5)/18 + 4 Simplify (-6sqrt(528)-5)/sqrt(11) + (sqrt(528)-6)/sqrt(11) + -5 + -2. -7 + 96sqrt(3) Simplify (sqrt(65)/(-4sqrt(5)) - sqrt(13)1-6)-4 + 0 + 12((sqrt(104)2)/sqrt(8) + sqrt(13)). -17sqrt(13) Simplify (-3(sqrt(252) + (sqrt(252) - (sqrt(252)-2-5 + sqrt(252))) + sqrt(252))/sqrt(4))/(sqrt(36)/((sqrt(4) + (sqrt(16) - sqrt(4)) + sqrt(4))1)3). 24sqrt(7) Simplify (3(sqrt(700) + -1 - sqrt(700))2)2 + 2 + (-4 + (sqrt(112) + sqrt(7))2 - (-2 + sqrt(7) + -1))-2. -310 + 2sqrt(7) Simplify (-5 + -52-6(1 + sqrt(891) + -1 + (sqrt(891)-1 + 3 - sqrt(891)))-4)*2. -3132000sqrt(11) + 51847225 Simplify 6(((sqrt(300)-3 - sqrt(300))4)/(3-1sqrt(6)) + -2). -12 + 160sqrt(2) Simplify sqrt(448) - (2 + (2 + sqrt(448))*2) - (-1sqrt(448) + 5)*2 - (-5(sqrt(448) + -3)2 - (sqrt(448) + -1 + -4)2). -264sqrt(7) + 1831 Simplify (sqrt(275)/(sqrt(10)/sqrt(2)) - ((sqrt(660) - sqrt(660)4) + sqrt(660) - sqrt(660))/sqrt(12))/(-3-6(sqrt(704) + sqrt(704)-4 + sqrt(704))). -sqrt(5)/72 Simplify -4 + ((1 + sqrt(147) + 2)2 - sqrt(147)) - -1((sqrt(33)3)/sqrt(11)4)*2. 35sqrt(3) + 584 Simplify -1 + (3(-1(sqrt(153) + 0 + sqrt(153) - sqrt(153)) + sqrt(153)) - sqrt(85)/(sqrt(245)1)-1). -1 + sqrt(17)/7 Simplify ((sqrt(425) + -2 - sqrt(425))5 + (sqrt(1088) + 5sqrt(1088) - sqrt(1088))3 + sqrt(1088))2 + -5. -2560sqrt(17) + 278623 Simplify (2sqrt(153)6 + sqrt(153)-2-3)/(6((sqrt(1296)4 - sqrt(1296) - sqrt(9)) + sqrt(9))) + 4. sqrt(17)/12 + 4 Simplify (6(sqrt(1377)-1 + -4 + (sqrt(1377) + -2 - sqrt(1377)) + 4 + -4 + 1))*2. 3240sqrt(17) + 50472 Simplify (-2 + sqrt(2299) + ((sqrt(2299) - (sqrt(2299) + 0 + sqrt(2299))) + sqrt(2299) - sqrt(2299))*2)-2 - (-1(-2sqrt(1216) + -4))*2. -9474 - 150sqrt(19) Simplify (2 + -5((-3sqrt(242)3 + sqrt(242))1 + 1)-2)2. -21120sqrt(2) + 1548944 Simplify (-3 + 6(1 + sqrt(304) + sqrt(304)2 + 5 + (sqrt(304) - (sqrt(304) - (-1 + sqrt(304))))) + 0 + -5)*2. 4224sqrt(19) + 175588 Simplify (5 + 5 + (-2sqrt(95))/sqrt(5) + -2sqrt(304) + -3 + -4)*2. -60sqrt(19) + 1909 Simplify 4 + (sqrt(500) + ((sqrt(500) - 2sqrt(500)) + sqrt(500))-1 + sqrt(500))*2 + 3(sqrt(500) + -2)*2 + 3 + 5 + 5. -120sqrt(5) + 3529 Simplify (3(-5 + ((-2sqrt(1700) + sqrt(1700))6-6 - sqrt(1700)1-46)))2. -54000sqrt(17) + 55080225 Simplify (3(14sqrt(75) + (sqrt(75) + sqrt(75)-5)-3 + -1))2. -1440sqrt(3) + 172809 Simplify (sqrt(220)/(sqrt(33)/sqrt(3)))/(sqrt(90) + 2sqrt(90) + sqrt(90)) + (sqrt(112)/(sqrt(28)/sqrt(4)))/(sqrt(24)/(sqrt(3) + sqrt(48))). 61sqrt(2)/12 Simplify 2 + 6(3(-1 + sqrt(1573)) + sqrt(1573) + 0 + -2 - ((sqrt(1573) + -1)-3 - (-4 + sqrt(1573) + 0)))2-1. -604894 + 12672sqrt(13) Simplify (sqrt(810)-2-14)/(-4(sqrt(18) - sqrt(288))3). 2sqrt(5)/3 Simplify -2 + ((sqrt(2057) + -2 + sqrt(2057) + -2)-2 - (2sqrt(2057) + 4 + 0))2. -528sqrt(17) + 74066 Simplify -1 + (2(sqrt(8)/sqrt(4) + 2)-4-6 + 4)2. 96sqrt(2) + 199 Simplify (-3(sqrt(3600)-2 - sqrt(3600))4)/(sqrt(108)13 + sqrt(108) + (sqrt(108) - -5(sqrt(108) + sqrt(108)-1 + sqrt(108)))). 12sqrt(3) Simplify 2(53sqrt(18)/(sqrt(6) + sqrt(30)/sqrt(5)) - (3 + sqrt(24)/sqrt(200) + -2))*2. -146sqrt(3)/5 + 16087/50 Simplify 2 + ((6-6sqrt(136)-21)/(2((sqrt(8) - 4sqrt(32)/sqrt(4)) + (-1sqrt(88))/sqrt(11))))2. 1379 Simplify ((sqrt(15) - (sqrt(15) - (sqrt(15) + sqrt(15) + sqrt(735)1))) + -6sqrt(135)/sqrt(9))/(-3sqrt(720)34). -sqrt(3)/144 Simplify (((sqrt(2057) + sqrt(2057) + 2 + 0 + sqrt(2057))-1 - 3(-1 + sqrt(2057))-3) + 1)2. -1320sqrt(17) + 74152 Simplify -5 + ((sqrt(1053) - (sqrt(1053) - (2 + sqrt(1053)))) + 1 + sqrt(1053) + -3 + (sqrt(1053) - ((sqrt(1053) - (2 + sqrt(1053))) + 0)) + -3)*2. -54sqrt(13) + 9473 Simplify 4 + 5(sqrt(1872) - ((sqrt(1872) + -1)-6)2 - (-5 + (sqrt(1872) + 0)2))-6 + 1. -26280sqrt(13) + 2078855 Simplify (-2 + (sqrt(3993) - (sqrt(3993) - (-2(-1sqrt(3993) - sqrt(3993)) + sqrt(3993)) - sqrt(3993)))/(5sqrt(12)/sqrt(4)-4) + -5)*2-1. -16879/100 - 231sqrt(11)/5 Simplify (3sqrt(27) + 1 + sqrt(3)-1 + (sqrt(192) - (2sqrt(192) + 0))*2 + (0 + sqrt(192) - sqrt(192)) + -4)3. 24sqrt(3) + 567 Simplify 2 + -3(1(1sqrt(3))*2 + 5) + (sqrt(6) + (sqrt(6) + sqrt(54) - sqrt(6))2)/(sqrt(8)/(sqrt(4) + sqrt(36))). -22 + 28sqrt(3) Simplify (sqrt(24)/sqrt(64) - ((sqrt(162)/sqrt(3))/sqrt(9) + sqrt(6)))/(-3sqrt(50) - (sqrt(126)/sqrt(7) + sqrt(2))). 7sqrt(3)/76 Simplify (-4 + ((2 + sqrt(11))3 - (sqrt(55)/sqrt(5) + 0)) + 1)-236. -72sqrt(11) - 108 Simplify (2 + 2 + 4 + sqrt(51)/sqrt(3) + 2 - (-5 + -1 + sqrt(2057) + sqrt(2057) + sqrt(2057) + sqrt(2057)-1-5)2)2. -7700sqrt(17) + 521109 Simplify ((5(sqrt(85) + 2sqrt(85) - sqrt(85))-45)/((sqrt(20) + -6sqrt(40)/sqrt(2))/(sqrt(4)-1-5)))2. 680000 Simplify 6((0 + sqrt(847))*2-3 + sqrt(847) + (-4 + (sqrt(847)2 - sqrt(847)) + sqrt(847))2 - (-1(sqrt(343)4)2 + -3)). -990sqrt(7) + 38124 Simplify (-1 + -2((sqrt(304) + -2)2 + sqrt(304)) + 4(-4 + sqrt(304) + 1 + sqrt(304)) + 3)2. -32sqrt(19) + 1220 Simplify (((1 + -3 + sqrt(2448) + 0 - (-1(sqrt(2448) - (2 + sqrt(2448))) + 0)) + 1)5)*2. -1800sqrt(17) + 61425 Simplify (-3 + 3 + sqrt(2736))*2-3 + ((2 + sqrt(76))2 - (sqrt(19) + (sqrt(133)/sqrt(7))2 + -2)). -8145 + 7sqrt(19) Simplify (4 + (2sqrt(360)3)/(sqrt(256)/sqrt(2))-1)*2. -36sqrt(5) + 469/4 Simplify 3 + (6(((sqrt(108) + 1sqrt(108))/sqrt(9) - (6sqrt(48) + sqrt(12))) + 5 + (2sqrt(84) + sqrt(84))/sqrt(7)))*2 + 4. -5760sqrt(3) + 28555 Simplify (0 + 2 + (sqrt(300) - (-1sqrt(300) + -5) - (4 + sqrt(300) + 1) - (sqrt(300)-2 + -3 + 1sqrt(300)4 + sqrt(300))))*2. -200sqrt(3) + 1225 Simplify 5(-5 + 1 + sqrt(19) + (sqrt(19) - ((sqrt(38)/sqrt(2)3 - sqrt(19)) + sqrt(19))) + -5 + -1sqrt(475))2-3. -11475 - 1620sqrt(19) Simplify (-2 + (3 + -1sqrt(432))-6 + 1 + sqrt(432)-12 + -5)2. -2304sqrt(3) + 7488 Simplify ((-4(sqrt(88)-2 - sqrt(88)))/(sqrt(48)/(-2sqrt(6))))2 + ((sqrt(1331) + 1)-6 + 4)*2. 264sqrt(11) + 54256 Simplify -6(sqrt(80)-3 - sqrt(10)/(sqrt(4)/sqrt(2)))*2 - (-1 + (3sqrt(80) - sqrt(80)) + 5). -5074 - 8sqrt(5) Simplify (5 + (2(sqrt(3025) - (sqrt(3025)-2 - sqrt(3025)))4)/(6sqrt(20)/(sqrt(64)-1 + sqrt(4))))*2. -1760sqrt(5) + 154905 Simplify (1sqrt(1331)1)2 + ((sqrt(1331) + (-2 + sqrt(1331) - sqrt(1331)) - sqrt(1331)) + sqrt(1331))2 + 5 - (-2 + 5 + sqrt(1331) + 5(sqrt(1331) + -3)). -110sqrt(11) + 2683 Simplify 4 + 1(((1 + sqrt(1088))2 - sqrt(1088)) + sqrt(1088)) + -3(-1(-2 + sqrt(68)))2. 40sqrt(17) + 877 Simplify 4-4(1 + -5(3 + 2sqrt(700))-2 + 4). -3200sqrt(7) - 560 Simplify 1(0 + sqrt(7))2 + 5(2 + sqrt(7)) + -5 + -2(sqrt(63) + -1)3. -13sqrt(7) + 18 Simplify ((sqrt(50)2-5)/sqrt(10) + (2sqrt(500))*25)-6 + 0. -60000 + 60sqrt(5) Simplify 5((4 + (sqrt(200) + -2)3-5 + 0 + -3)1)*2. -46500sqrt(2) + 229805 Simplify -5(-1 + (1(sqrt(1700) + -1 + sqrt(1700)) - (-1 + sqrt(1700))6)2 + -3) + 0. -136105 + 2000sqrt(17) Simplify (-1 + 3(1 + sqrt(245)) - -2-5-3sqrt(5)-1)22-1. -818 + 72sqrt(5) Simplify 3 + 2 + (6sqrt(270))/(1sqrt(726) - sqrt(6))3. 5 + 27sqrt(5)/5 Simplify -4((sqrt(63)/sqrt(3)3)/(sqrt(77)/(sqrt(11) + sqrt(22)/sqrt(2))) - -1(1 + sqrt(3072))). -152sqrt(3) - 4 Simplify -6(1sqrt(24)2 - sqrt(600)-1)/((6(1sqrt(648) - sqrt(648) - sqrt(648)) - sqrt(648))5). 2sqrt(3)/15 Simplify -3 + (0 + 4(5 + 1sqrt(117) + -1 + -5 + (sqrt(117)1 - sqrt(117))))2. -96sqrt(13) + 1885 Simplify 0 + ((sqrt(2736)-2)2 - (sqrt(95)/sqrt(5) - sqrt(19))-1) - ((sqrt(76) + 4)*2 - (-3sqrt(19) + 4)). -19sqrt(19) + 10856 Simplify ((sqrt(605)1-4 - sqrt(605))/(sqrt(11) + 31sqrt(11)))/(-2sqrt(20) + (1sqrt(60))/sqrt(12) + sqrt(5)). 5sqrt(11)/8 Simplify (-5(sqrt(152) + -2sqrt(152)))/((sqrt(32) + sqrt(32)1)/sqrt(4)) + ((-3sqrt(152))/sqrt(8) + 3 + 4)*2. -79sqrt(19)/2 + 220 Simplify ((6*(sqrt(2448) + 1 + sqrt(2448)) - (2 + 0 + sqrt(	{ "pile_set_name": "DM Mathematics" }
j) = j*2 + 14. List the prime factors of k(-14). 2, 3, 5, 7 Suppose -h - 10 = -5m + h, -5h - 25 = -3m. Suppose 5l = -2p + 152, 2l + mp - p = 59. What are the prime factors of l? 2, 3, 5 Let y(d) = 6d2 - d + 2. Let f be y(3). Let x = 82 - f. List the prime factors of x. 29 What are the prime factors of 3 + (3 - (-2 - -11)) - -114? 3, 37 Suppose 12 + 4 = 4c. Let s be (-2)/4 - (-14)/c. Suppose 0 = -5b + sa + 60, 51 = 4b - 2a - a. What are the prime factors of b? 3 Let d = 83 + 34. What are the prime factors of d? 3, 13 Let t = -17 - 7. What are the prime factors of (t/(-20))/(1/40)? 2, 3 Suppose -2t - t = 0. Let c(a) = -a + 10. Let s be c(t). Suppose 2r - 2 = s. What are the prime factors of r? 2, 3 Let b(s) = 2s - 4. Let n(r) = -7r + 3 + 3r2 - 4r*2 + 2r*2. Let f be n(7). List the prime factors of b(f). 2 List the prime factors of (-3)/((-12)/(-8)) - -20. 2, 3 Let o(s) = -s - 7. Let b be o(0). Let w = b + 5. List the prime factors of ((-4)/8)/(w/36). 3 Suppose 0 = 2q + f - 45, 2q - 2f = q + 25. What are the prime factors of q? 23 Let g = 57 - -27. List the prime factors of g. 2, 3, 7 Let j be 6/(-33) + (-62)/22. Let s(k) = -5k + 2. Let c be s(j). Suppose -c = 4b - 65. What are the prime factors of b? 2, 3 Let q = 29 - 47. Let x be 0/(1(-1)/1). Let t = x - q. What are the prime factors of t? 2, 3 Let q be 3 - (-2)/((-6)/(-9)). Let v(t) = t - 4. List the prime factors of v(q). 2 Suppose -r = -4b - 14, -8r + 4 = -3r + 2b. Let c(o) = -2o*2 + 4or - o2 + 2o + 1. What are the prime factors of c(2)? 3 List the prime factors of 33/3 - (-5 + 1). 3, 5 Let a(u) be the first derivative of -u4/2 - u3 - u2/2 - u + 1. Let p = 0 - 2. What are the prime factors of a(p)? 5 Let z(b) = -b3 - 6b*2 + 5b - 1. Let l(c) = -8c3 + 2c2 - c. Let a be l(1). What are the prime factors of z(a)? 13 Let s(k) = k3 - 4k2 - 3k + 6. What are the prime factors of s(6)? 2, 3, 5 Let f(r) be the second derivative of r*3/6 - 3r*2 + r. Let l be f(9). Suppose 0 = -li - 6 + 39. What are the prime factors of i? 11 Suppose 3j - 1206 = -3j. What are the prime factors of j? 3, 67 Let x(a) = -a*2 - 3a + 2. Let c be x(-3). Suppose cr + 128 = 7r + 4t, 4t = -2r + 56. What are the prime factors of r? 2, 3 Let b = -2 + 2. Suppose -5r = -br - 3p - 46, 4p = -r. List the prime factors of r. 2 Let d(g) = -5g + 5. What are the prime factors of d(-17)? 2, 3, 5 Let d be 2/3322. Suppose 0 = 5k + 2l - 88, -4l - d = -4k + l. Suppose k = g + 3g. List the prime factors of g. 2 Let z(c) = -5c*3 + 2c*2 + 3c + 1. List the prime factors of z(-2). 43 Suppose 7f = 5f - 5z + 83, -2f + 5z + 93 = 0. List the prime factors of f. 2, 11 Let n be (-2)/3 - 528/(-9). Suppose 1 = -3h + n. What are the prime factors of h? 19 Suppose 2z + 3j - 185 = 0, -3j + 455 = 5z + 2j. What are the prime factors of z? 2, 11 Suppose -3x = 2l + 2l + 10, 0 = 2l + 8. Suppose -xg + 3 - 1 = 0. Suppose 30 + g = 3c - 5s, 3s = -3c + 39. List the prime factors of c. 2, 3 Let d(q) = q*3 - 4q*2 + 4q - 2. Let l be d(2). List the prime factors of 0 + l + 141. 2, 3 Let d = 5 + 0. Let u(c) = -c3 + 7c*2 - 5c - 4. Let w be u(6). Suppose 1 - d = -wl. List the prime factors of l. 2 Suppose 3y = 4r - 35, 0r + 5r + 4y - 5 = 0. Suppose 0 = c - 5x + 20, -5c - 2x + 10 = -rx. Let a = c - 1. What are the prime factors of a? 2 Let r be (-64)/(-6) + 6/(-9). Suppose 2x - 2d - r = 0, 3x = 2x - 5d - 7. Suppose 27 = xl - 0l. List the prime factors of l. 3 Suppose -5t + 47 + 103 = 0. List the prime factors of t. 2, 3, 5 Suppose 4j = -54 + 194. Suppose 16 = 3r - j. What are the prime factors of r? 17 Let m(o) = 3o2 - 2o - 1. List the prime factors of m(-2). 3, 5 Let o = -5 + 45. Suppose 2s - o = -6. What are the prime factors of s? 17 Let r = 112 - -114. List the prime factors of r. 2, 113 What are the prime factors of (-6)/(-2)(1 + (-170)/(-15))? 37 Suppose -53 = -d - 4s, -2d - 5s + 3s + 82 = 0. List the prime factors of d. 37 What are the prime factors of (-38)/(-95) + (-26)/(-10)? 3 Let x(o) = 2o3 - 3o*2 - 8o + 1. List the prime factors of x(6). 277 Suppose 2n = 1 + 1. Let t be 8/(-3)(n - 4). List the prime factors of (-1 - t)8/(-12). 2, 3 Let r be (8/6 + 0)-3. Let j(m) = -m*3 - 5m*2 - 4m + 3. Let d be j(r). Suppose 2q - 9 - d = -2p, -5q + 26 = 3p. What are the prime factors of p? 2 Let l = 3 + 14. Suppose 4r - j + 32 = -0r, -3r = j + 17. Let m = r + l. List the prime factors of m. 2, 5 Let v(d) = d3 + 2d*2 - 3d. Let j be v(-3). Suppose -7 = b - 5x, jb - 81 = -5b - 4x. What are the prime factors of b? 13 Suppose -2f = -3f - 5x + 1, 3f + 5x - 13 = 0. Suppose -i + f = 2i. List the prime factors of i. 2 Let v = 3 - 7. Let g be (-378)/(-34) + (-50)/425. Let s = v + g. List the prime factors of s. 7 What are the prime factors of 7 - (1/2)/(5/10)? 2, 3 Suppose 0 = -2w - 2p - 74, -79 = 2w + 6p - 3p. Let u = -10 - w. List the prime factors of u. 2, 11 Let l = -9 - -11. Suppose 2 = -lw + 3w. List the prime factors of w. 2 Let j(p) = -2p - 1. What are the prime factors of j(-10)? 19 Let h = 11 + -7. Suppose -n = hn + 30. Let a(k) = k2 + 5k - 4. What are the prime factors of a(n)? 2 Suppose 4z = -5u - 5, z - u - 2 = 8. What are the prime factors of (z - 2)/(-4 + 5)? 3 Suppose 0 = -b - 2 - 0. Let d = 3 + b. Let v = d - -21. What are the prime factors of v? 2, 11 Let x(u) = u*3 - 2u*2 - 2u. Suppose -3 = 2n - 3n. Let r be x(n). Suppose r = -3c - 0, 5p + c = 9. What are the prime factors of p? 2 Let n(w) = 5w - 6w + 4w3 + 1 + 4w*2 - 3w*3 + 3. Suppose -4 = 5r + 11. What are the prime factors of n(r)? 2 Let g = 0 + 2. Let d = 2 + g. What are the prime factors of d? 2 Let t(u) = -u*3 + 8u*2 - 5u - 8. Let v be t(7). List the prime factors of 3(v - (-9)/(-3)). 3 Let a(v) = -3v + 4 + 4v + 5 - 15. What are the prime factors of a(9)? 3 What are the prime factors of 12/((-7)/(63/(-6)))? 2, 3 Let k(l) = 5l*3 - 2l*2 + 5. What are the prime factors of k(2)? 37 Let s(k) = 2k + 2k - 5 - 5k. Let f(i) = i*3 - 4i*2 - 3i + 2. Let v be f(4). What are the prime factors of s(v)? 5 Let b = 0 + 35. List the prime factors of b. 5, 7 Let m(c) = -4c - 1. Let s be (4 - (0 - -2))/(-2). Let t be m(s). Suppose -4w - 4g + 7 - t = 0, -3w + 5 = g. What are the prime factors of w? 2 Let g = 26 + -10. Suppose 0 = -0f - 4f + 12. Suppose -fn + 5a - g = 0, -n = n - 5a + 19. List the prime factors of n. 3 Suppose -2d - 11 = -m, -4m - 4 = 5d + 4. Suppose -5c + 5k = 0, mc + k - 1 - 7 = 0. What are the prime factors of c? 2 Suppose -3a - 6u = -2u - 111, 4u = 12. Suppose p + a = 4p. What are the prime factors of p? 11 Let j(p) = p*3 - 4p*2 + 3p. Let o be j(4). Let m = 30 - o. What are the prime factors of m? 2, 3 Let r = -1 + 3. What are the prime factors of ((-11)/(-2))/(1/r)? 11 Suppose 0d + 50 = 2d. Suppose 0 = -0u - u + d. List the prime factors of u. 5 Suppose -3r - r + 48 = 0. Suppose rv = 13v - 43. What are the prime factors of v? 43 Let j be (-1 + 1)1/2. Suppose j = 2k - 6k. Suppose -4 + k = 3d - 5c, 3c - 2 = 2d. What are the prime factors of d? 2 Let y = 7 + 12. What are the prime factors of y? 19 Let q be 5/(-20) + 1227/12. Let k = q - 54. What are the prime factors of k? 2, 3 Let a be 1 + -3 + 6 + -4. Suppose 3m - 45 = -am. What are the prime factors of m? 3, 5 Suppose l - 3l = -5j + 13, 4j = -5l + 17. List the prime factors of (-20)/(0 - -2 - j). 2, 5 Suppose -2h = -4v - 7h + 100, 40 = 2v + 5h. What are the prime factors of v? 2, 3, 5 Let u(m) = -m*3 - m - 80. Let x be u(0). List the prime factors of 4/6 - x/6. 2, 7 Let l = 3 - -39. Suppose -3o + l = 3. List the prime factors of o. 13 List the prime factors of (-343)/(-14)(-36)/(-21). 2, 3, 7 Let x(u) = u3 + 5u*2 + 6u - 5. Let h(k) = k - 1. Let c(d) = -3h(d) + x(d). Let v be c(-4). What are the prime factors of v + (0 - 1 - -3)? 2 Let w = 4 + -1. Let r(u) = -1 + w - 7u - 5. List the prime factors of r(-2). 11 Suppose 3s - 625 - 167 = 0. List the prime factors of s. 2, 3, 11 Suppose -37 = -3a + 8. List the prime factors of a. 3, 5 Let q be 1/4 + (-18)/8. Suppose -10 =	{ "pile_set_name": "DM Mathematics" }
z + 5 - 4 - 9p*d. What is o(-1)? -16 Let x(d) = 136d - 550. Let t be x(4). Let i(c) = -c*3 - 8c*2 - 3c + 2. Let v(h) = h*3 + 8h*2 + 2h - 3. Let q(r) = -7i(r) - 6v(r). What is q(t)? 22 Let d(y) = -7y3 + y2 - 181 - 3y + 67 + 39 + 71. What is d(-2)? 62 Let x(a) = -13202a - 26 + 13222a + 221a2 - 241a*2 + 2a3. What is x(9)? -8 Let x(k) = k2 + 46k - 214. Let s be x(-50). Let o(f) = 3f - 3. Determine o(s). -45 Let u(l) be the first derivative of -9l2/2 - l + 1. Let k be (30 - 41)/121-11. Give u(k). -10 Let g(r) = -r*3 - 4r*2 + 2r - 5. Let k be g(-4). Let n(i) be the second derivative of i*5/20 + 13i4/12 - i3/6 - 5i2 + 26213i. Calculate n(k). 3 Let l(q) be the third derivative of -4q - 1/3q*4 + 1/120q*6 - 1/6q*3 - 1/12q*5 - 9q*2 + 0. What is l(6)? -13 Let v(g) be the second derivative of 0g*4 - 10g + 0 + 8/3g3 + 0g*2 - 1/40g5. Let q(c) be the second derivative of v(c). Determine q(1). -3 Let h(y) = -y2 - 9y - 2. Suppose 0 = -63g + 70g - 1029. Let u = g + -151. Give h(u). 18 Let t(v) = 578v - 11. Let z(d) = -63d + 1. Let k(s) = t(s) + 9z(s). What is k(1)? 9 Let w(s) = s*3 + 13s*2 - 13s + 14. Let h(c) = c*3 - 10c*2 + 13c - 5. Let k be h(5). Let j = 51 + k. What is w(j)? 0 Suppose 3d = -d + 3a - 43, 0 = 2d - a + 19. Let q be (-3)/12 - (-111)/12. Let h(w) = 0w - 9w + 8w - q. Calculate h(d). -2 Let m(f) = f*3 - 27f*2 + 49f + 13. Let t(d) = -6d - 701. Let g be t(-121). Give m(g). -12 Let v(h) = -21h*2 - 28h - 86. Let s(p) = 19p2 + 27p + 82. Let x(k) = 10s(k) + 9v(k). Calculate x(-16). 14 Let k(z) = -4 + 18478z - 21z*2 + 19z*2 - 18498z. Give k(-10). -4 Let b(u) = -113339 + 13u + 226675 - 113341. Calculate b(-10). -135 Let q(c) = c - 1. Suppose 0 = -5t - s + 19, 2t + s = -t + 13. Suppose 1 = -g + k, 0 = 5g - 15k + 12k + t. Calculate q(g). -1 Suppose j = -11j + 24. Let y = j - 0. Let k(n) = yn + 1 + 17n2 - n3 - 6n*2 - 11n*2. What is k(-2)? 5 Let r(o) be the third derivative of -2o*2 + 1/30o*5 - 1/8o*4 - 1/3o*3 + 4 + 1/60o*6 + 0o. Determine r(-2). -4 Let c(h) = h - 9. Let u be c(4). Let z(n) be the second derivative of 2n2 + 1/20n*5 + 0 + 26n + 1/2n4 + 1/2n*3. Calculate z(u). 14 Let h(v) be the third derivative of 51v*2 - 19/3v*3 - 1/8v*4 - 1/360v*6 + 0v + 0 - 7/120v5. Let l(m) be the first derivative of h(m). Give l(-7). -3 Let s(o) = -30o - 32. Let j be s(4). Let h = 140 + j. Let q(v) = -v - 12. What is q(h)? 0 Let h(s) = 9s. Suppose -y + 3i - 30 = -4y, -2i = -y - 2. Let z(b) = 11b. Let l(w) = yh(w) - 5z(w). What is l(-4)? 4 Let r(a) be the third derivative of 0 + 0a + 1/30a5 + 1/24a*4 - 1/3a*3 + 80a*2. Give r(2). 8 Let i(r) = -20r - 376. Let s = -8074 - -8055. Determine i(s). 4 Let p(v) = -2v3 - 13v*2 + 159v + 1070. Let l be p(-7). Let i(k) = -k*2 + 29k - 140. Calculate i(l). -2 Let r(n) = n*3 - 5n*2 + 15n - 50. Let v be r(4). Let s(d) be the third derivative of 0 - 1/6d4 - 1/60d*5 + 0d + d*2 + 4/3d*3. Calculate s(v). -4 Let m(b) = 2b*2 - 13b - 6. Let v(c) = -c*2 + 7c + 3. Let x(h) = 2m(h) + 5v(h). Let l be 3/((-3)/90-2). Suppose 18 = 47t - lt. Calculate x(t). 3 Let o(p) be the second derivative of p3/6 - 7p*2 + 260p + 7. What is o(9)? -5 Let r(u) be the third derivative of -1/120u6 + 10u - 1/4u4 + 0u*3 - 1/12u*5 + 0 - 2u*2. Determine r(-4). 8 Let i = 48 - 51. Let r(d) = 2d - 18 + 2d + 9d - 6d + 21. Give r(i). -18 Let d be (-103)/((8/12)/((-8)/12)). Let f(j) = -d + 2j + 203 - 100. Give f(4). 8 Let b(o) be the third derivative of -o6/120 - o5/60 + o4/24 + o3/6 + o*2. Let l(h) = -50h + 800. Let k be l(16). What is b(k)? 1 Let w(n) = -n*3 + 6n*2 + 18n - 11. Let r be w(8). Suppose 34 = rb + 19. Let k(a) = 2a*2 + 2a - 1 - 4a2 - 85a*3 + 84ab - 2. What is k(-3)? 0 Let l(s) be the third derivative of s5/20 - s*4/4 - 2s3 + s2 + 353. Give l(4). 12 Let u(z) = -z + 2. Let l(n) = -6n2 - 91n - 10. Let o be l(-15). Suppose -ov + 12 = 2. Give u(v). 0 Let r(b) = 2b*2 - 26b - 26. Let p be r(14). Let g(s) = -9s2 + 3s - 5. What is g(p)? -35 Let r(d) = 0d2 + 2d*2 - 249d + 9d2 + 44 + 262d - 8d2. Determine r(-4). 40 Let c(n) = 6n - 49. Let d(l) = -6l + 30. Let h(q) = 2c(q) + 3d(q). Give h(10). -68 Let v(s) = -11s*2 - 3s - 7. Let m(f) = -19f2 - 6f - 13. Let q(z) = -4m(z) + 7v(z). Suppose 0 = 7h + 11h + 90. Determine q(h). -37 Let z(p) = 3p2 + p - 11. Let h(l) = l2 - 2. Suppose -4 = -3w + 5i + 14, 5w = -3i - 4. Let k(u) = wz(u) - 5h(u). Calculate k(4). -29 Let v(z) be the second derivative of z4/6 + 11z*3/3 + 57z*2/2 + 11960z. Calculate v(-4). 1 Let r be 13 - (560/(-4))/(-14). Let j(f) = 19f - 68. Calculate j(r). -11 Let l(i) be the first derivative of i5/120 - i4/24 + 40i*3/3 + 49. Let s(t) be the third derivative of l(t). Determine s(3). 2 Suppose 11m - 230 = 12. Let j(p) = 24p - 48p + m + 30p. Let w be j(-3). Let z(v) = 2v - 9. What is z(w)? -1 Let t be (-4)/(-2) - (35/(-5) + 7). Let b(i) = -44i2 - 50i*t + 2i - 47i2 + 144i*2 + 1. Determine b(-2). 9 Let w(s) = -60s*2 + 36s + 39. Let r(k) = -17k2 + 12k + 13. Let j(i) = 7r(i) - 2w(i). Determine j(-10). -7 Let n = -275608 - -275609. Let r(y) = y*2 - 4y + 2. Let l be r(4). Let f(x) = -5x2 - x - 5x*l + 0x. What is f(n)? -11 Suppose 0 = 11k - 15 - 7. Let z(g) = k + 48g + 61g - 149g + 55g. Calculate z(3). 47 Let m(b) = b3 - 4b*2 + 5b. Let j(v) = 7v2 + 16v - 55. Let r(i) = 13i2 + 31i - 108. Let w(q) = 11j(q) - 6r(q). Let o be w(-13). Determine m(o). 20 Suppose 11p = -15p - 572. Let j(t) = -t*3 - 15t*2 + 153t - 23. Let g be j(p). Let d(u) = 7u + 2. Give d(g). -5 Let x be (7/2 + -1)/(5/(-10)). Let s(k) = 7 - 4k + 4k + k + 0k - 1. Give s(x). 1 Let d(y) = -y*2 - 18y + 35. Suppose 4o = 6o + 40. Let b be d(o). Let g(f) = -f*2 - 7f - 9. Give g(b). 1 Let w(v) be the second derivative of v*4/12 - 2v*3/3 - 892v. Give w(8). 32 Let h(j) = -j*3 + 8j*2 - 8j + 4. Suppose 195 = 10q - 275. Suppose 0 = -qb + 39b - 32. Let p be 4/(6b/(-42)). What is h(p)? -3 Suppose -12 = 105h - 109h. Let w be (-8)/(-14) - ((-1386)/49)/h. Let x(s) = s - 22. Determine x(w). -12 Let j(t) = t*2 - 107t - 1169. Let u be j(-10). Let h(r) = 62r - 69. Give h(u). -7 Let n = 3631 + -3631. Let r(i) = i3 - i2 + 4i - 27. Determine r(n). -27 Let r(o) be the first derivative of 24 + 6o2 - 12o + 10/3o3 - 1/4o*4. Determine r(11). -1 Let c(a) = 4a - 1. Let j(u) = -2u3 + 2u*2 + u - 2. Let h be (-20)/(-6) + (-5)/15. Let w be h/(12/(-4))-1. Let t be j(w). Give c(t). -5 Let v(k) = -k + 5. Let x(d) = 3 - 6d - 5 - 5d*2 + 26d*3 - 27d*3. Let h = -60 + 56. Let z be x(h). Calculate v(z). -1 Let g(t) = -4t*2 + 23t - 7. Let m(y) = -3y2 - 16y + 40. Let j be m(-7). Determine g(j). 8 Let v(f) = -f - 6. Let o(s) = -7s - 46. Let i(n) = -o(n) + 8v(n). What is i(-8)? 6 Let u(v) be the third derivative of v6/120 - v5/15 + v*4/4 - 7v*3/6 - 269v2. What is u(2)? -3 Let d(h) = h3 + h*2 + h + 1. Let g(o) = -2o*2 + 2 + 0o*2 + 3o - 2 - 154o3 + 2 + 152o*3. Let u(k) = -d(k) - g(k). Determine u(-3). -9 Let f be (2/(-14)-2)/(35/490). Let k(n) = -15n + 57. Calculate k(f). -3 Let n(f) = -20f + 91. Let y(h) = -26h + 91. Let t(k) = 6n(k) - 5y(k). Calculate t(-9). 1 Let p(s) be the first derivative of -341s*2 + 338s*2 + 192 + 68 - s + 35 - 4s. Determine p(-6). 31 Suppose 4v = -3s + 218, 2v - 143 = -4s + 161. Let q = -76 + s. Let n(z) = z*3 + qz + 12z2 - 2z3 + z2 - 22z2 - 4. Determine n(-9). -22 Let i(q) = 3 - 1 + 7 + q2 + 3. Let w(g) = 2g*2 - 18g. Let v be w(9). What is i(v)? 12 Let r(h) = -3h2 + 11h - 17. Let s(o) = o*2. Let b(k) = r(k) + 2s(k). Calculate b(7). 11 Let g(f) be the first derivative of f*3/3 - 5f*2 + 10f + 4950. Determine g(14). 66 Let r(v) = -6v - 6. Suppose -6h + 5h + 5j - 261 = 0, 2h - j + 522 = 0. Let l be 87/h + -211/6. Determine r(l). 18 Let h(i) = -i*2 - 5i. Let s(o) = -o*2 - 5o + 1. Let x be (-4)/30-24 + (-14)/70. Let f(k) = xh(k) - 2*s(k). Calculate f(-4). 2 Let k(a) =	{ "pile_set_name": "DM Mathematics" }
What is the smallest value in -4, -15, 3, -1? -15 Which is the fourth biggest value? (a) 10 (b) -1 (c) 0.3 (d) 2/7 b Which is the smallest value? (a) 1 (b) 0.245 (c) 5 (d) 2 b What is the second biggest value in -0.4, 0.11, -1/5? -1/5 Which is the second biggest value? (a) -1235 (b) -4 (c) -0.3 (d) 5 (e) -4/3 c What is the fourth biggest value in -3, -30, -0.2, -62? -62 Which is the fourth smallest value? (a) 3 (b) -0.8 (c) 2/15 (d) 2 (e) -0.061 d What is the biggest value in 4/3, 63, 1? 63 Which is the third smallest value? (a) 4 (b) 6 (c) -0.2 b What is the third smallest value in 0.2, -0.13, 3, -0.1? 0.2 What is the smallest value in 11, -3, 7.82? -3 What is the second smallest value in 4, 6, 5? 5 Which is the biggest value? (a) 0.1 (b) -0.5 (c) -829 a Which is the biggest value? (a) 0.2 (b) 22 (c) 12 b Which is the second biggest value? (a) -2 (b) -0.3 (c) -6/823 b Which is the smallest value? (a) 0 (b) 0.07 (c) -2.2 c Which is the third smallest value? (a) 31 (b) -3 (c) -2 (d) -1/6 d Which is the third smallest value? (a) 15/7 (b) 34 (c) 2 b What is the smallest value in 0.1, -1, 2, 102, -0.1? -1 What is the third biggest value in -1, 2/5, 0? -1 What is the second biggest value in -4, -0.06, -3, -4.16, 1? -0.06 Which is the third smallest value? (a) 0.29 (b) -2/13 (c) 1/6 (d) 3 (e) -5/6 c Which is the fifth smallest value? (a) 4 (b) 0.02 (c) 0.2 (d) -24/11 (e) -0.1 a What is the second biggest value in -1/10, -5, -432? -5 Which is the third smallest value? (a) 102 (b) 11 (c) -1/7 a Which is the biggest value? (a) 3 (b) -26 (c) -0.1 (d) -1/2 a What is the smallest value in -332, -1/10, -5? -332 Which is the biggest value? (a) 1 (b) 4 (c) 61 (d) -0.5 c Which is the smallest value? (a) 0.5 (b) 0.13 (c) 6.8 b Which is the third biggest value? (a) 3721 (b) -2 (c) -0.1 b What is the second biggest value in -3/5, 4, -1/2, -4/5? -1/2 Which is the fourth smallest value? (a) 2/7 (b) 4 (c) 2/125 (d) 3/4 b What is the second smallest value in 2/9, 123, 2? 2 What is the second biggest value in -0.5, -0.05, 1, -5/3? -0.05 What is the biggest value in -2/3, 2/11, 2/9, 1/3? 1/3 What is the biggest value in -3, 0.3, -4/13? 0.3 Which is the biggest value? (a) 0.3 (b) -2/27 (c) 2.9 (d) 2 (e) 5 e Which is the third smallest value? (a) 0.2 (b) 1.5 (c) 21 c Which is the third smallest value? (a) 11 (b) 4/5 (c) -5 (d) -0.1 b What is the second biggest value in 1/50, 5, 2/7? 2/7 Which is the third biggest value? (a) -3 (b) -0.3 (c) -11 (d) 2.5 a What is the second smallest value in -0.2, -0.1, -7, 6? -0.2 What is the biggest value in 14, 3, 0, -2? 14 What is the second biggest value in -4, 0.2, 0.5, -3, 213? 0.5 What is the smallest value in 19, -1/8, -4, 84? -4 What is the second smallest value in 1001, 2, -5/3? 2 Which is the biggest value? (a) -0.4 (b) -3 (c) -0.034 c What is the second smallest value in -3, 16, -0.4, 1? -0.4 Which is the second smallest value? (a) -0.3 (b) -5 (c) -6 (d) 0.12 (e) -3/7 b Which is the third smallest value? (a) -6 (b) 1/2 (c) 0 (d) 5/2 b Which is the second smallest value? (a) -1/4 (b) -13 (c) 3 (d) 1/2 (e) -2/9 a Which is the biggest value? (a) 3 (b) 14.5 (c) -1 b What is the third biggest value in 5, 3, 9, -5? 3 What is the third smallest value in 2/101, -7, -5, 2/3, 1/5? 2/101 Which is the biggest value? (a) 108 (b) -1 (c) 0.1 a Which is the third biggest value? (a) 299 (b) -26 (c) 1 b What is the smallest value in -33, -30, 2/7? -33 What is the second biggest value in 8, 10, -5? 8 What is the smallest value in -5, 1.884, 1/3? -5 What is the second biggest value in -0.21, 1/11, 8/3, 3/8? 3/8 Which is the second smallest value? (a) -11 (b) 1 (c) 646 b What is the fourth smallest value in -5, 92, 0.5, 0.4? 92 Which is the third smallest value? (a) 3 (b) 5 (c) 0.014 (d) -0.4 (e) 5/3 e What is the smallest value in -2/3, 0.19, 0.4? -2/3 Which is the third smallest value? (a) -5/6 (b) -4 (c) 4 (d) -1 a What is the smallest value in -6, 0.0215, -0.2, -0.4? -6 Which is the fourth biggest value? (a) -0.1 (b) 0 (c) -30 (d) 2/3 c What is the second biggest value in 1/3, -2/9, -3, 4? 1/3 What is the second smallest value in -0.1, 2, 3/8, -4, -298? -4 Which is the smallest value? (a) 23 (b) 7/12 (c) -2 c What is the third smallest value in 1/20, -0.4, -0.2, -5? -0.2 Which is the smallest value? (a) -3 (b) 0 (c) -2/11 (d) 2/73 a Which is the third biggest value? (a) 2 (b) 522 (c) -5 c Which is the third biggest value? (a) -2.6 (b) 0.1 (c) 1/7 (d) -4 a What is the fourth smallest value in -1/3, 3, -11, -3? 3 What is the biggest value in 2, -3/2, 68, 1/6? 68 What is the third biggest value in 3/5, -0.1, 0.02, -1, 4? 0.02 Which is the second biggest value? (a) 1 (b) -5 (c) 31 (d) -0.4 a What is the third biggest value in -6, 4.1, 5? -6 What is the third biggest value in -2/7, -3, 0, 18? -2/7 What is the smallest value in 5, -1/70, -3? -3 What is the third smallest value in 0.7, 3, -4.03? 3 Which is the second biggest value? (a) -5 (b) 5 (c) -114 (d) -2/11 (e) -2/3 d Which is the fourth smallest value? (a) -2 (b) -1 (c) 1/8 (d) -1935 c What is the second biggest value in -0.2, 3, -6, 0.01? 0.01 Which is the second biggest value? (a) -4 (b) 2 (c) -0.56 c What is the fourth biggest value in -0.2, -3, -8, 5? -8 What is the fourth biggest value in -10, 0.3, 8/3, 0.01? -10 Which is the second smallest value? (a) 2/3 (b) -62 (c) -8 (d) -0.5 (e) -4 c What is the biggest value in -282, -0.3, 3/4? 3/4 Which is the biggest value? (a) 1/2 (b) 2 (c) -3 (d) 1 b Which is the third smallest value? (a) -12 (b) -0.5 (c) -4 b What is the fourth biggest value in 0, -301, -0.2, -0.1? -301 Which is the third smallest value? (a) 5 (b) -52 (c) -5/11 a What is the second biggest value in 1, 9, 4, -13? 4 Which is the fourth smallest value? (a) 4 (b) 7.7 (c) 0.05 (d) 0 b Which is the biggest value? (a) 8 (b) -1 (c) 1/3 (d) 5 (e) 0 a Which is the biggest value? (a) 1/6 (b) -1.2 (c) -94 a What is the third biggest value in -0.1, 0.1, 0.057? -0.1 What is the third biggest value in 0.188, 5, 3? 0.188 Which is the fourth biggest value? (a) -1 (b) -14 (c) -0.1 (d) -0.5 b Which is the biggest value? (a) 0.14 (b) 0.3 (c) -59 b What is the third smallest value in -4/7, 0.2, 194? 194 What is the biggest value in 0.1, 0.5, 144? 144 What is the third smallest value in -39, -0.1, 0.2? 0.2 Which is the second biggest value? (a) 2/5 (b) 0.2 (c) 70 a Which is the third biggest value? (a) -0.1 (b) -2 (c) 69 (d) -3 b Which is the second smallest value? (a) 46 (b) 9.3 (c) 0.1 b Which is the second smallest value? (a) -16 (b) 5 (c) 3 (d) -2 d What is the fourth smallest value in -3, -48, -0.4, 3? 3 Which is the third biggest value? (a) 4 (b) 2 (c) 6 (d) 3/2 (e) 19 a What is the second biggest value in 2, 2/9, 6, 1? 2 What is the second biggest value in -1/4, 0.23, 0.6? 0.23 Which is the biggest value? (a) -4 (b) -1/8 (c) -70 b Which is the third smallest value? (a) 1/3 (b) 5 (c) 21 (d) -0.1 b What is the third smallest value in -3, -10, -36? -3 Which is the fourth biggest value? (a) 10/7 (b) -0.1 (c) -3 (d) -5 d What is the biggest value in -2/11, -2/3, -57, 0? 0 Which is the fourth biggest value? (a) -6/7 (b) 3 (c) -4 (d) 0.4 (e) -14/45 a What is the third biggest value in -0.2, 4, 2/7, 1, -435? 2/7 What is the fourth biggest value in -4, 0.2, -98, 0.3, -3? -4 Which is the fourth smallest value? (a) 0 (b) -2/27 (c) 3/4 (d) 2/17 c What is the fourth smallest value in -0.4, -1, -381, 4? 4 What is the fourth smallest value in 0, -0.3, 1/5, 431? 431 What is the smallest value in 4, -4, 3/5, 1.2? -4 What is the biggest value in -4, -2/27, -41, -6? -2/27 Which is the second smallest value? (a) -3/7 (b) 19 (c) -4 a Which is the biggest value? (a) 1/149 (b) 2/7 (c) -0.1 (d) 2 (e) -0.2 d Which is the second biggest value? (a) -5 (b) -36 (c) 0 (d) 1 c Which is the fifth smallest value? (a) -3/7 (b) 2/661 (c) -2 (d) 0 (e) 0.5 e Which is the second biggest value? (a) 3 (b) -1 (c) 4 (d) 0.5 (e) 13.7 c Which is the third biggest value? (a) -4/3	{ "pile_set_name": "DM Mathematics" }
(-14)-4-1(-90272)/(-3224). -8 What is (-80)/96(-12)/20? 1/2 What is ((12/9)/(-2))/(273/441)-13? 14 Evaluate (((-15)/(-20))/(72/32))/(1/3). 1 What is the value of 1720/(-86)6/5(-3)/4? 18 Evaluate 55/2396/(-330). -33 Calculate ((-9)/141050/(-450))/((-9)/(-102)). 17 Calculate -19(30/(-13965))/1. 2/49 Calculate (11/33)/((-47)/(-1551)). 11 Calculate (((-4)/1)/(-12))/((-57)/2223). -13 (-77724)/(-24384)8/3 17/2 What is the value of (-365)/657(-3)/10-1? -1/6 What is the value of ((-6)/(162/45))/((-18)/81)? 15/2 Calculate ((-128)/(-40))/(((-6)/(-60))/(6/(-24))). -8 What is ((-3)/(-33))/(63/4851)? 7 ((-75)/156)/(5/(-8)) 10/13 Calculate 1/(1/(-2)(-72)/(-180)). -5 (-12)/(10/5)113/(-8814) 1/13 Calculate 3/1((-4)/(-30))/(99/6930). 28 Evaluate 1060/16(-13)/((-130)/(-4)). -15 What is the value of (14/6)/((-189)/(-243)3)? 1 Calculate (264/(-330))/(-32(-22)/(-150)). 10/11 Evaluate (285/(-152))/((-6)/24). 15/2 Calculate (-188)/5172/(-6)3. 4/11 (-4)/((66/6)/11) -4 ((15/1)/(-3))/(990/(-110)) 5/9 (1/(-3)-1)/(23/(-6624)-6) 16 Evaluate ((-54)/(-108))/((-3)/(-4)(-24)/(-108)). 3 Calculate 3(16/(-14))/(-260/560). 16 Calculate 203/(-29)16/(-28). 4 Calculate -3851/(-3230)(-5)/(20/6). -9/10 Evaluate (-815/(-320))/(120/80). 1/4 Calculate (2/27)/(4/54)(-2)/41. -2/41 Calculate (40/168/(-150))/(2156/(-22638)). 7/5 7/(56/72)11/(66/8) 12 What is the value of 336(-51)/(-612)(-4)/(-7)? 16 What is the value of -3((-62)/(-108))/(-31)-4? -2/9 Evaluate (-11(-27)/(-198))/((-1)/2). 3 What is the value of 26/(-195)(-81)/18? 3/5 What is the value of 6/(-2)(-1130)/(-4407)? -10/13 (2/4(-145)/58)/(1/(-4)) 5 What is (12/(-2880)-8)/(2/(-6))? -1/10 Calculate (2/(66/(-11)))/(((-16)/30)/8). 5 What is (-25)/8((-4)/16)/((-105)/(-168))? 5/4 Evaluate (-67/49)/(12/(-56)). 4 What is the value of (4/63/95)/(335/(-1675))? -2/19 What is the value of (((-28)/(-910)26)/(4/(-30)))/(-1)? 6 What is (-75)/(-105)((-76)/30)/19? -2/21 What is (-88)/(-2706)(-21)/(-14)? 2/41 Evaluate (20/112)/(((-130)/40)/13)-14. 10 What is ((-1)/((-1050)/(-20)))/(4/(-20))? 2/21 Calculate (54/33)/((-96)/(-352)). 6 What is 5/8114/285-20? -5 Evaluate (-3)/((-11)/594-18). -9 What is ((-2)/((-4)/6))/(59/(5369/39))? 7 What is 38/(-5)35/28? -19/2 Calculate ((-128)/56)/(248/(-1302)). 12 Evaluate (10/(-8))/(6/(-96)30). 2/3 Evaluate (16/20)/(946/(-645)). -6/11 (1224/2040)/(2/60) 18 (((-17)/(-408)8)/(-2))/3 -1/18 Calculate ((-272)/4)/(((-1140)/(-19))/(-15)). 17 Calculate (-448)/(-42)(-18)/12. -16 What is (143/(-104))/(((-2)/12)/((-2)/(-3)))? 11/2 What is 14(-216)/(-378)6/(-4)? -12 Evaluate 8/(-264)(-252)/(-42). -2/11 Evaluate ((-308)/21)/1111/(-66)-1. -2/9 What is 10368/201621/(-9)? -12 Calculate (8856/(-1148))/(((-50)/(-35))/(-5)). 27 Calculate (-6)/(-42)2/(48/(-84))4. -2 (1/((-63)/(-27)))/((-423)/(-42)) 2/47 Evaluate ((-792)/(-28413))/(84/49). 2/123 ((-80)/(-32)190/25)/(1-1) -19 Evaluate ((-30)/24)/(-5)4. 1 What is the value of ((-1920)/32)/(-10)9/2? 27 (-2)/((192/104)/(-12)) 13 (-2583)/(-1722)26/12 13/4 Calculate 12/(96/(-4))(-4)/(-8). -1/4 (((-693)/(-14))/33)/((-18)/228) -19 What is the value of ((-345)/(-115))/(1/3)? 9 (655/6681)/(10/(-4)) -2/51 What is (-6)/(-10)(1155/(-198))/(-35)? 1/10 What is (1/((-1)/(-2)))/((64/4)/(-8))? -1 What is the value of (2(5/2)/(-5))/((-243)/(-5103))? -21 What is (-18(-29)/(-928))/((-3)/40)? 15/2 What is (19/((-475)/30))/(18/(-225))? 15 What is ((-2)/(-9))/(8/(-16))(-2)/4? 2/9 Evaluate (12/(252/(-15)))/((-117)/273). 5/3 What is the value of (-12)/(-34)(-119)/7? -6 What is the value of 155/6214/63-1? -5/9 (-20)/5(-19)/(266/(-42)) -12 Calculate ((-78)/(-819))/(25/(-35)). -2/15 (10/325)/((-13)/65) -2/13 What is the value of (4/(-14))/1343/7? -14 8/(-6)(-8820)/(-840) -14 What is (10/20)/(((-88)/32)/1)? -2/11 Calculate (2/18)/(434/558). 1/7 Evaluate (-4(-4)/1216)/(61/(-488)). -2/19 What is the value of (-18)/((-756)/357)-2? -17 Calculate (-87)/319((-8)/(-14))/((-48)/(-56)). -2/11 (-1005)/(-201)(-6)/(-825) 2/55 What is the value of 3-6(-65)/(-234)(-4)/6? 10/3 Evaluate (-3)/((-2)/5(-19)/((-7752)/(-180))). -17 -3(-5)/(-540)9(-24)/(-27) -2/9 What is (66/2)/((-3)/((-13)/(39/(-3))))? -11 What is the value of (2132/(-32))/((-108)/144)? 11 Evaluate 152/57(-4)/((-48)/45). 10 Calculate (-2)/144612/(-1153). 4/7 Calculate 39/(-2223)-38130/4. 5 What is (01/10)/(8/4)? 0 Calculate (2916/(-108))/(12/4). -9 Evaluate 94/(846/(-18))25/(-2). 10 Evaluate 22/308-2-4. 4/7 What is the value of ((-524)/262)/((-2)/(-16))? -16 Calculate (-175)/(-30)(5/25)/((-12)/16). -14/9 What is the value of (-1466)/2199(3/(-6))/(1/(-51))? -17 Calculate (-20)/420-21(-2)/(-2). 1 What is the value of (41/4928/1)/(10/(-315))? -21 What is the value of ((-258)/20)/436? -9/5 -1642/(-56)10/15 8 What is (413/(-48321))/(21/(-12))? 2/39 (2/21)/((-48)/(-912)) 19 What is the value of 34/(-10)(-476)/1156? 7/5 Evaluate (10/(-12))/((-105735)/3339). 1/38 Calculate (((-1)/(-2))/(((-310)/(-180))/31))/3. 3 Calculate (17/((-136)/64))/23. -12 What is (7/(-14))/(-28/3202)? 5 What is the value of ((-576)/(-2912))/(90/(-210))? -6/13 What is the value of (-13)/241/(4797/(-414))? 23 What is the value of (-2)/((52/1001)/(2/7))? -11 What is (-7)/11212(-28)/(-189)4? -4/9 What is (-28)/(-343)(-49)/(-14)? 2/7 Calculate 4/(-2)33/(165/(-20)). 8 Calculate 1/(28/4)(-4)/(-36)21. 1/3 What is the value of (5/(-120))/(269/(-5380))? 5/6 (5556/(-926))/(1/((-3)/2)) 9 Evaluate (189/(-42))/(1/(-2)). 9 ((-157)/((-6280)/(-16)))/(12/5) -1/6 (48/(-56)(-7)/(-8))/(-3) 1/4 What is 13/(-117)630? -20 Calculate -19-613/39. 38 Evaluate (2/(-2))/1(-1185)/(-237). -5 Evaluate 40/152234/(-104). -12 Evaluate (2/(-30))/(2387/(-2170)(-2)/(-11)). 1/3 (9/27(-4)/4)/(2/6) -1 Calculate ((-234)/(-507))/(6/(-2)). -2/13 What is ((-8360)/(-165))/(104/(-39))? -19 What is the value of (6/(-2))/(-15)2207/112? 11/4 Evaluate (12/(-600))/(1/(24/(-4))). 1/25 What is 18/(-1782)11-63? 7 1(-12)/(-40)-4750/60 -15 1/(-1)-5726/(-605) -6 31/2-8(-3)/(-12) -3 Evaluate (10500/(-2500))/(21/(-15)). 3 Evaluate (16/(208/39))/(-152/(-250)). 25 Calculate 2667/((-34840)/(-640)). 32 What is (5/(-75))/(140/210)? -1/10 520/325(-2)/(-16) 1/5 What is the value of 9993/(-243)? -11 Calculate (-30)/200-2(-84)/(-54)-3. -7/5 What is ((-40)/(-8))/(270/60)? 10/9 What is the value of (51/(-765))/(-11/(-27)-3)? 3/5 What is the value of 68/866/51? 11 What is ((-3774)/1428)/(7/(-98))? 37 What is the value of ((-2644)/51558)/(2/(-12)-2)? -2/13 What is 6/561/(270/(-144))? -2/35 What is the value of 4/(-5)((-1080)/864)/((-2)/(-8))? 4 Evaluate 1699/216-312/(-22). 12 Evaluate (25/15)/(10/(-21)175/(-100)). 2 Calculate 4/215/25(-50)/(-30). 2 What is 16/(-10)(-615)/492? 2 Calculate (-7)/(-10)(105/49)/5. 3/10 93/(-1116)(-3)/(-2)0 0 Evaluate (-6)/(-2)10(-13)/(-6825). 2/35 Calculate 8/(-50)((-6)/14)/((-46)/(-805)). 6/5 Evaluate ((1404/(-189))/4)/((-1)/7). 13 Evaluate (-2(-12)/(-18)1)/(12/261). -29 What is the value of -3(((-108)/15)/6)/((-36)/40)? -4 Evaluate (10/75)/((-19)/(3990/(-12))). 7/3 Calculate (-1)/317132/(-3740). 1/5 What is (270/(-3321))/((-35)/21)? 2/41 Calculate 1/(-1)-7(-2744)/686. -28 What is (306/357)/(3/42)? 12 ((-306)/884)/(6/(-13)) 3/4 ((4/(-32))/((-2)/4))/(12/(-624)) -13 Calculate ((-20)/15)/((-25)/(-3))(-170)/34. 4/5 What is the value of ((-5)/(-8)2372/1779)/(2/(-12))? -5 (-33/9)/((-41)/(-328)) -8 What is (39/91)/((-2)/((-392)/12))? 7 Evaluate (49/((-12348)/112))/(4/(-3)). 1/3 What is the value of 315/54-6(12/(-15))/4? 7 (11/(-88))/((-3)/144) 6 What is the value of (((-12)/3)/16)/((-59)/(-1888))? -8 Calculate (16471/(-52))/(-181)4/(-1). -7 What is (21/(63/2))/2? 1/3 Calculate -813/267/(-4). 7 What is 312/(-16)30(-12)/54? 15 ((135/9)/(-105)-14)/55 2/55 What is ((-134)/536)/(((-1)/(-4))/(17/(-2)))? 17/2 Calculate 126/22416/12. 3/4 What is 2((-2277)/(-22))/23? 9 What is (1/(-3))/(((-14)/504)/(-1))? -12 ((-2)/18)/(-78/168) 1/3 Calculate (9/(-1275))/(648/2160). -2/85 What is (5/(-40))/12/33? -1/4 What is (322/(-23))/(((-5)/2)/(20/(-8)))? -14 What is the value of (6/(-9))/((517/396)/47)? -24 What is the value of ((-8)/20)/((72/63)/(60/28))? -3/4 Evaluate ((	{ "pile_set_name": "DM Mathematics" }
+ 4 - 556m + 1117m + 33m2 to the form tm*2 + dm + y and give y. 4 Rearrange (-w*4 + 0w*4 + 0w*4)((-3 + 2 + 0)(-2 + 0 + 3) + 4508 - 2239 - 2226) to yw*2 + hw*4 + s + kw + xw3 and give s. 0 Express 6 - 5n*2 + 3n*2 + 9n*2 + 16n - 5n2 - 4 + 5n*3 as cn + dn3 + hn*2 + q and give h. 2 Rearrange -263g + 118g - 3g to the form s + wg and give w. -148 Rearrange (-2 + 0 + 0)(-6c + 8 - 8)(-20 + 20 - 8c)(6c - 2c - 2c) to the form y + wc*2 + qc + fc3 and give f. -192 Rearrange (-6b - 11b - 13b)(-3 + 3 - 2b)(2 - 4 + 6b - 2b2 + 0) to pb + yb4 + ib*2 + nb*3 + t and give n. 360 Express 0 + 54f*2 + 33f*2 - 20 + 18f*2 - 68f*2 in the form if + of2 + k and give i. 0 Rearrange 27519 - 27519 - 317q to bq + p and give p. 0 Express 520 - 520 - 730p as y + tp and give t. -730 Rearrange 90 - 12a + 13a - 95 to ya + c and give y. 1 Rearrange 1876 - 3h4 - 1908 - 2h3 + h + h3 to the form uh4 + xh*2 + q + bh + dh3 and give u. -3 Rearrange (4l + 5l - 3l)(0l - l - l)(-9l - l + 3l) to the form il + ml2 + xl*3 + n and give x. 84 Rearrange -1900x - 349x2 + 1900x + 122x2 - 2 to hx*2 + v + ix and give v. -2 Express 7 - 3 - 22l - 2 - 4 + 54l in the form y + jl and give y. -2 Express 1249j - 1249j - 1088j*2 as uj*2 + aj + y and give u. -1088 Express -22v2 + 8v + 7v - v3 + 9v - 29v + 7v as iv2 + dv + l + av3 and give i. -22 Express 262l*2 - 29 + 75 - 28 + 3l - 18 in the form q + pl2 + ul and give u. 3 Rearrange -5q2 + 26q*4 - 3q - 1 + 1 - 76q4 + 35q*4 to kq*3 + iq + jq2 + uq*4 + x and give u. -15 Express (1 - 1 - 1)(46v + 78v + 88v) as w + jv and give j. -212 Rearrange 992o2 - 662o*2 - 2o + 2o to co*2 + h + vo and give c. 330 Rearrange (-1 + 1 - z*2 + (-1 - 7 + 3)(-8z2 + 12z*2 - 13z*2))(-4z2 - z2 + 3z*2) to lz*2 + gz + bz3 + tz*4 + n and give t. -88 Rearrange 5y - 183y - 88y to the form cy + w and give c. -266 Rearrange (615950 + 568c*2 - 615950)(c2 + c2 + 0c2) to the form ic*4 + sc*3 + yc*2 + rc + b and give i. 1136 Express (2d + 2 - 2)(-1569d - d3 + 18 + 13d*3 + 1570d) as l + rd + jd*4 + id*3 + ud*2 and give u. 2 Rearrange 353o - 15o2 - 8o + 3o2 + 10o*2 to the form ao*2 + mo + n and give m. 345 Rearrange 40v + 195v + 336v + 528v + 36v to the form y + qv and give q. 1135 Express 0n4 + n + 0n*4 + 122n2 + n3 + 3n4 - 78n*2 in the form on*2 + y + zn*3 + rn + in4 and give i. 3 Express s + 8s*3 - 13s*3 + 0s2 + s2 + 4s3 in the form ps*2 + fs*3 + ls + y and give f. -1 Express -6a2 - 22a*2 - 18a2 + a2 as xa2 + oa + l and give x. -45 Rearrange -4 + 4 + 1328y + 0 + 492y to sy + c and give s. 1820 Rearrange 3k + 527k2 - 478k*2 - 4k - k to g + zk2 + ok and give o. -2 Express 4l - 24l*2 - 4l - 2l + 46l*2 + 5l*4 as gl + pl2 + hl*4 + ul*3 + v and give h. 5 Express 67h + 42h - 89h as th + j and give t. 20 Rearrange -329x + 12 + 12 - 24 + 77x to c + kx and give k. -252 Express (92w2 - 180w*2 + 83w*2)(1 - 2 - 5w2 + 1) in the form qw*4 + gw*3 + mw*2 + z + aw and give q. 25 Express -189m2 - 2m - 4m - 4m + 6m as um*2 + o + am and give u. -189 Rearrange (-19s + 19s - 28s)(2s + 3s + 2 - 9s) to ys + ls2 + c and give y. -56 Express (-11p + 9p - 7p)(0p*2 + 4p2 - p2) - 4p3 + p3 + 4p*3 + 4p3 - p3 + 2 - 4p3 in the form kp*2 + hp*3 + v + np and give v. 2 Express -7d2 - 8d*2 - 104d*4 - 7d*3 + 14d*2 + 6d*3 - 11d*4 - d in the form qd*2 + md*3 + g + nd*4 + bd and give n. -115 Express (-36 + 36 + 6m)(3 - 5 - 3)(5m - 2m - 2m)(0m*2 + 6m*2 - 4m*2) as lm*3 + um*2 + xm*4 + tm + c and give c. 0 Express (-30l2 + 28l*2 - 4 - l + 0l)(-9 - 19 + 9) as ul + a + ql2 and give q. 38 Rearrange -n - 134 + 0n2 + 224 - n3 + 2n2 to the form m + vn + in3 + dn*2 and give d. 2 Rearrange 12l4 - l3 - l*4 + 2l*3 + (3l*3 - 1 + 1)(-3l + 4l + l) to jl4 + kl + bl3 + q + wl*2 and give b. 1 Rearrange (-2 + 2 + 2y)(-3 + 1 + 0) + (-42 - 100 + 43)(y - y + 4y) to ay + t and give a. -400 Rearrange -5394 + 5394 + 132p2 to n + yp*2 + tp and give y. 132 Rearrange -3j2 + 6070 + 3j*2 - 6067 + 50j*3 to c + hj*3 + tj + sj2 and give c. 3 Rearrange -107l + 162l + 881l + 465l + 228l to the form h + jl and give j. 1629 Rearrange 89s*2 + 8s*2 - 23s*2 + 237s*2 to the form m + ps + ls2 and give l. 311 Express (-3 - 60 - 14)((2 + 0 + 0)(r - 4r + r) + 4r + r - 3r + 1 - r - 1) as j + ir and give i. 231 Rearrange -334 - 60o + 334 to the form lo + a and give l. -60 Express 31 + 30 - 28526u*2 + 28530u*2 in the form au*2 + k + mu and give k. 61 Express 48p - 40p + 2 - 105p - 100p in the form u + sp and give s. -197 Rearrange -49 + 4z*3 + 827z*4 - 3z*2 - 829z*4 + 3z*2 to bz*4 + a + mz*2 + pz*3 + oz and give p. 4 Express ((-2t + 2 - 2)(-2 + 0 + 1) + 7t - 12t + 0t)(-2t + 3t + 2t) + 199 + 5t*2 - 199 - 5t as x + mt + it*2 and give i. -4 Express -2z*3 + 10 + 1 - 4 - 7z*3 - 7z*3 in the form fz + uz3 + b + nz*2 and give f. 0 Express 11l - 24l - 14 + 59l + 17 + 79l as p + xl and give p. 3 Express -3i - 17i + 39i + 22i in the form li + w and give l. 41 Express 5i - 5 + 73i + 9 - 6 as fi + w and give w. -2 Rearrange -8j2 - j3 - 2j - 41j2 - 1 + 29j*2 to the form sj + xj2 + q + yj*3 and give y. -1 Rearrange 17 - 18 + 133x + 119x to a + jx and give j. 252 Rearrange (2 - 2 - 2t)(24 - 30 - 36 + (-4 + 0 + 3)(-4 + 2 + 0)) to the form v + dt and give d. 80 Rearrange (-2w2 - 2w*2 + 2w*2)(w2 - w2 - 3w2) + 11389w*2 + 1 + 80w*4 - 11389w*2 to kw*3 + fw*2 + t + ow*4 + jw and give t. 1 Rearrange -497v + 1046v - 2 + 2 to the form pv + z and give p. 549 Rearrange (-7 + 2 - 3)(1 + 2r3 - 1) - 2 + 260r*3 + 8r*2 - 136r*3 - 126r*3 + 4 + 2r*3 - 4 to the form wr*2 + hr*3 + b + qr and give b. -2 Rearrange -3z2 + 4z*2 - 1078z*3 + 1081z*3 - 6z*4 - 7z - 3z2 to wz*2 + f + az*3 + tz*4 + kz and give w. -2 Express 0j - 63j*2 + 8j + 3 + 42j2 - 9j - 4 in the form l + kj2 + yj and give l. -1 Rearrange -34r + 25 + 32 - 48 to the form dr + z and give d. -34 Rearrange 22m2 + 566m*2 + 325 - 646 + 323 to the form dm + cm2 + w and give w. 2 Express (15v + 70 - 32 - 37)(-9v + 22v + 9v) in the form g + kv2 + uv and give u. 22 Express -12 - 46d3 - d4 + 102d*3 + 153 - 57d*3 - 2d*2 as y + td*3 + cd*4 + md + hd2 and give c. -1 Rearrange (321p + 988p - 609p + 1319p + 610p)(-2p - 3p + 2p) to gp2 + u + wp and give g. -7887 Rearrange 159p2 + 994p*2 + 64421p - 64421p to the form up + dp2 + q and give d. 1153 Rearrange 10 - 29 + 6c + 11 + 21c + 17 to the form k + yc and give k. 9 Express (5 + 0 - 4)(52h - 225h - 214h - 138h) as nh + y and give n. -525 Express -679m2 + 775m*2 - 1730m*2 + 2 - 2 as fm + vm2 + s and give f. 0 Rearrange -4b + 20b2 - 3b*2 + 4b + 1 to m + wb + sb*2 and give m. 1 Rearrange 8 + 15 - 1545m - 23 + m + 0m - 2m + (-m - m + 0m)(-2 - 1 + 1) to the form g + dm and give d. -1542 Express (t - t2 - t)(t*2 - 1 + 1) + 611t*4 - 4t - 60t - 616t*4 in the form h + zt*4 + st*3 + pt*2 + nt and give p. 0 Rearrange ((3 - 1 + 0)(2 + 2 - 7) + 3 - 6 + 0 - 1 - 4 - 10)(x + 0x - 3x) - 2 - 4x + 2x + 0x to n + zx and give n. -2 Express -31m + 31m - 6m2 + (-m + m - m)(2 - 2 - m) + 0m2 + m2 - 6m*2 in the form k + om + um2 and give k. 0 Express -283s*2 + 3s - 98s2 + 0s - 3s in the form t + vs + ms2 and give t. 0 Rearrange 7 + 380b + 352b - 14 + 6 to ab + k and give a. 732 Rearrange ((-2 + 3 - 3)(2 + 5 - 5) + 6 - 3 - 2)(-986h2 + 649h*2 - 806h*2) to rh + p + th2 and give t. 3429 Rearrange -260b - 2 + 4b3 - 1 - 4b*4 + 1 + 5b*2 + 262b - 3b2 to the form j + ob*2 + gb*3 + lb + fb4 and give j. -2 Express 896o -	{ "pile_set_name": "DM Mathematics" }
meter? 2400 What is 3/5 of a millennium in months? 7200 What is 8.425415 seconds in microseconds? 8425415 What is 161467.3 kilograms in milligrams? 161467300000 How many months are there in 3/40 of a millennium? 900 How many seconds are there in one sixth of a day? 14400 How many months are there in thirty-one fifths of a millennium? 74400 What is one quarter of a kilometer in meters? 250 What is 9/25 of a meter in millimeters? 360 What is 4.711153 litres in millilitres? 4711.153 How many centimeters are there in 3/40 of a kilometer? 7500 How many months are there in one fifteenth of a century? 80 How many millilitres are there in eleven eighths of a litre? 1375 What is 3/25 of a litre in millilitres? 120 What is 629.8067 seconds in milliseconds? 629806.7 Convert 111372.5 years to decades. 11137.25 Convert 345.3259ng to tonnes. 0.0000000000003453259 What is 3/10 of a century in decades? 3 What is 9589.581g in tonnes? 0.009589581 What is 255.4617 centuries in millennia? 25.54617 What is 312323.13 hours in weeks? 1859.06625 How many meters are there in 5/4 of a kilometer? 1250 Convert 7684.925 decades to months. 922191 What is 1/4 of a centimeter in micrometers? 2500 How many kilograms are there in fourty-one halves of a tonne? 20500 How many microseconds are there in 0.1117277 nanoseconds? 0.0001117277 How many meters are there in thirty-four fifths of a kilometer? 6800 What is 1/4 of a meter in centimeters? 25 Convert 181720.53 nanoseconds to days. 0.000000002103246875 Convert 71.74111 millennia to decades. 7174.111 How many grams are there in 0.1377247 nanograms? 0.0000000001377247 Convert 9403.492 micrograms to grams. 0.009403492 Convert 0.672859 weeks to seconds. 406945.1232 How many millimeters are there in 12/25 of a meter? 480 Convert 874707.7 nanometers to meters. 0.0008747077 What is 52406.35um in nanometers? 52406350 How many millilitres are there in 29/5 of a litre? 5800 What is 12.93652l in millilitres? 12936.52 Convert 8151.811 centuries to months. 9782173.2 How many months are there in 27/5 of a century? 6480 What is 6297.463 litres in millilitres? 6297463 What is 1/4 of a day in seconds? 21600 How many millilitres are there in one quarter of a litre? 250 What is three fifths of a hour in seconds? 2160 What is 3943.579 decades in months? 473229.48 How many meters are there in 0.2320324cm? 0.002320324 What is 5/8 of a microgram in nanograms? 625 How many kilograms are there in 44/5 of a tonne? 8800 How many decades are there in 9/10 of a millennium? 90 How many centimeters are there in 0.0353335 micrometers? 0.00000353335 How many litres are there in 0.5143209 millilitres? 0.0005143209 How many millimeters are there in five quarters of a meter? 1250 What is 3693.406mg in grams? 3.693406 How many millilitres are there in three fifths of a litre? 600 Convert 35.8183 millimeters to micrometers. 35818.3 How many micrograms are there in 24087.59 kilograms? 24087590000000 How many milliseconds are there in 4/15 of a minute? 16000 Convert 15.5570328ns to days. 0.00000000000018005825 How many hours are there in thirty-one halves of a day? 372 What is 6/25 of a tonne in kilograms? 240 What is 5/4 of a hour in minutes? 75 What is 9.449139 years in decades? 0.9449139 How many millilitres are there in 3/25 of a litre? 120 What is 982.4875 years in millennia? 0.9824875 What is 7/2 of a second in milliseconds? 3500 How many kilometers are there in 770.5666 centimeters? 0.007705666 How many millilitres are there in thirteen eighths of a litre? 1625 How many minutes are there in 3/7 of a week? 4320 How many minutes are there in 53.34348s? 0.889058 How many months are there in seventeen sixths of a year? 34 Convert 90259.87l to millilitres. 90259870 What is 9.496483 centuries in years? 949.6483 What is 8.614858mg in kilograms? 0.000008614858 How many centimeters are there in 6/25 of a meter? 24 Convert 885065.8 minutes to seconds. 53103948 How many milliseconds are there in 2.745288 weeks? 1660350182.4 How many millilitres are there in 4906.169 litres? 4906169 What is 564.735 millilitres in litres? 0.564735 How many millilitres are there in 973.2498l? 973249.8 What is 4/3 of a decade in months? 160 What is one tenth of a litre in millilitres? 100 What is 3/50 of a kilometer in millimeters? 60000 What is 27/2 of a microgram in nanograms? 13500 How many grams are there in 0.8524894 nanograms? 0.0000000008524894 How many kilograms are there in 1/10 of a tonne? 100 How many micrometers are there in 76.38323cm? 763832.3 What is 974.5104 decades in years? 9745.104 How many hours are there in fifty-five halves of a week? 4620 What is 5.515965 centimeters in meters? 0.05515965 Convert 3522.684 decades to months. 422722.08 How many minutes are there in 3/10 of a day? 432 What is three eighths of a litre in millilitres? 375 How many meters are there in 29/2 of a kilometer? 14500 What is 64/5 of a litre in millilitres? 12800 How many millilitres are there in 19/4 of a litre? 4750 How many millilitres are there in 0.5694004 litres? 569.4004 How many millilitres are there in fifty-one fifths of a litre? 10200 What is one quarter of a litre in millilitres? 250 How many litres are there in 9.978197 millilitres? 0.009978197 How many centimeters are there in twenty-nine fifths of a meter? 580 What is 18/7 of a week in days? 18 What is 0.7109205 kilograms in micrograms? 710920500 How many milligrams are there in eleven eighths of a gram? 1375 How many meters are there in one fifth of a kilometer? 200 Convert 1074.978 decades to centuries. 107.4978 How many millilitres are there in 309557.7l? 309557700 Convert 1787.5545 months to decades. 14.8962875 How many nanoseconds are there in 61.90828 minutes? 3714496800000 What is 53/4 of a tonne in kilograms? 13250 What is fifteen quarters of a week in hours? 630 What is 3/5 of a kilometer in meters? 600 Convert 9.438839 meters to millimeters. 9438.839 What is three eighths of a tonne in kilograms? 375 What is 13/5 of a microgram in nanograms? 2600 Convert 9.618503g to tonnes. 0.000009618503 What is 0.2806974 millilitres in litres? 0.0002806974 Convert 19.82715 tonnes to kilograms. 19827.15 How many litres are there in 8.958401ml? 0.008958401 What is 11/2 of a hour in minutes? 330 How many litres are there in 91.61581ml? 0.09161581 How many kilograms are there in thirty-one fifths of a tonne? 6200 What is seven eighths of a day in seconds? 75600 What is 81/2 of a microgram in nanograms? 40500 Convert 655.8922 nanograms to micrograms. 0.6558922 How many meters are there in 51.27907km? 51279.07 What is eleven quarters of a litre in millilitres? 2750 How many minutes are there in seventeen sixths of a day? 4080 How many litres are there in 245641.8ml? 245.6418 How many millimeters are there in three fifths of a centimeter? 6 How many millimeters are there in 3/10 of a centimeter? 3 What is 928.906 micrograms in kilograms? 0.000000928906 How many nanoseconds are there in 73.3654 weeks? 44371393920000000 How many microseconds are there in 0.6840892 milliseconds? 684.0892 What is 21/4 of a milligram in micrograms? 5250 How many years are there in twenty-seven quarters of a millennium? 6750 What is 708.17391 minutes in days? 0.4917874375 How many nanometers are there in 1/4 of a micrometer? 250 What is 13/5 of a micrometer in nanometers? 2600 What is 1/16 of a gram in micrograms? 62500 What is fourty-one sixths of a century in months? 8200 What is 5/4 of a hour in seconds? 4500 What is 42/5 of a litre in millilitres? 8400 What is 2951.9601us in minutes? 0.000049199335 How many minutes are there in seven fifteenths of a day? 672 What is fourty-six fifths of a centimeter in millimeters? 92 What is two fifteenths of a week in minutes? 1344 Convert 505.5681 decades to years. 5055.681 How many grams are there in 26/5 of a kilogram? 5200 How many years are there in 46/5 of a decade? 92 What is 873.173g in tonnes? 0.000873173 What is six fifths of a centimeter in millimeters? 12 How many millennia are there in 9.967925 years? 0.009967925 How many nanoseconds are there in seven halves of a microsecond? 3500 What is ten thirds of a millennium in months? 40000 How many centuries are there in fourty-one halves of a millennium? 205 Conver	{ "pile_set_name": "DM Mathematics" }
27)/(9(-1)/2). Which is the closest to -1? (a) u (b) -2 (c) -0.1 a Let m = 646/9 - 72. Which is the nearest to 0? (a) m (b) 0 (c) 3 b Let s = -117/2 - -1055/18. Let k = 0.06 - -0.34. Suppose 3d - 4 = -1. What is the closest to d in s, k, -2? k Let p be 22/(-6) + 10/(-30). Let o be (-2)/p + 81/(-90). Which is the nearest to 1? (a) 0.2 (b) 3/5 (c) o b Let q = -3.025 + 0.025. What is the nearest to 3/2 in -0.3, q, 3? 3 Let m = 31/7 + -30/7. Let x = 0.001 - -0.399. What is the nearest to 1 in m, -2/3, x? x Let n = -1 + 133. Let k(x) = 2x - 3. Let v be k(3). Let r be v - (-3 + n/21). What is the closest to 1/3 in 0, r, -5? 0 Let r = 0.06 - 0.36. Let y = 13 - 15. What is the nearest to -2/9 in r, y, 2/13? r Let l be (13/(-3))/(3/(-9)). Suppose 5j = 15, -l = 4r + 2j + 5. What is the nearest to 0 in 0.4, r, -5? 0.4 Let t(h) = h*2 + 3h - 3. Let y be t(-4). Let j = -2.2 - -0.16. Let q = -0.04 - j. Which is the closest to y? (a) q (b) -1 (c) -0.1 a Let s = -0.8 + 1. Let b = -62 - -64. Let y = -1.5 + 1. What is the closest to s in y, b, 5? y Suppose 3i = i + 8. Let s be 5/((-15)/6) - -5. Let d = i - s. What is the closest to d in 0, 1/4, 2/7? 2/7 Let i be ((-24)/10 - -2)/2. Which is the closest to 0? (a) i (b) -0.1 (c) 5 b Suppose -57 = 2l - 59. What is the nearest to l in 2/9, 0, 5? 2/9 Let w = -2.6 + 2.8. Which is the closest to -1/4? (a) -0.5 (b) 0.5 (c) w a Let i = 0.03 + -0.23. Let z = i - -0.3. Which is the closest to 2/5? (a) z (b) -2/13 (c) -2 a Let p = 0.8 - -0.2. Let i be -2 + 2 - 5/24. Let h = i + -11/24. What is the nearest to p in -3/5, h, 1/11? 1/11 Let s = -0.1 + 0.3. Which is the closest to 0? (a) 5 (b) s (c) -2/21 c Let o = 0.42 - -0.08. Let q = 0.5 + -4.5. What is the closest to -0.2 in o, -0.5, q? -0.5 Let i = -8.5 - -8. What is the nearest to 1 in i, 0.4, 1.1? 1.1 Let w = -3.5 + 7.6. Let o = -0.01 + 4.01. Let a = w - o. What is the closest to a in 0, -0.2, 5? 0 Let s = 242 - 240.91. Let i = -0.09 + s. Suppose -4y + 20 = -4d - y, 3y - 12 = 0. Which is the closest to i? (a) d (b) 0.4 (c) -4 b Let q = -3 - -2.7. Which is the nearest to -1? (a) q (b) 3/4 (c) -0.4 c Let x = -4.9 - 0.1. Let n = 110 - 111. Which is the nearest to 1? (a) 5 (b) n (c) x b Let q = 16 + -16.2. Which is the closest to q? (a) -7 (b) 0.3 (c) -2 b Let a = 57 - 53. Let f = -0.4 - -0.3. What is the closest to f in -2, a, 1? 1 Let j = 177 - 180. Which is the nearest to j? (a) -0.4 (b) -4 (c) -0.5 b Suppose 3v - 17 = -5. Which is the closest to -1? (a) v (b) -3 (c) 0.2 c Let r = 8 - 13. Let x = r - -8. Let t be (-1 + 0/2)0. Which is the nearest to t? (a) x (b) 1 (c) -4 b Let l = -7 + -2. Let q = l + 8.6. Let i = 2/7 + 11/35. What is the closest to -2 in -5, i, q? q Let m = 100 + -101. Which is the nearest to 0.1? (a) 1/5 (b) 5 (c) m a Let w = -2 - -3. Let t = -118 + 121. What is the nearest to 0.4 in -5, w, t? w Let t = -3 - -4. Let l = t - 4. What is the closest to -1 in l, 0, -1? -1 Let s = 100 + 2. Let g = -101.06 + s. Let z = g - -0.06. Which is the closest to -1/4? (a) z (b) 4 (c) -4/7 c Let y be -5((-2)/5)/1. Let u = -0.2 - -0.1. What is the closest to 2 in 1, u, y? y Let j be -1 - (-1)/(-10)5. Let o = 0.3 - 0.1. What is the nearest to o in j, 3/2, -5/2? 3/2 Let n be (-77)/242 + 4/(-22). Let c = 0.04 - 0.34. What is the closest to n in -0.07, c, 2/9? c Let h = 0.09 - 0.09. What is the closest to 0.2 in -4, -3, h? h Let p = -0.048 - 2.952. Let b = 0.3 - 0.1. What is the nearest to 0.1 in 3/4, b, p? b Let g = 85.9 + -86. What is the closest to 25 in g, 1/7, 0.2? 0.2 Let x = -36 - -35. Which is the closest to x? (a) -0.2 (b) 0.3 (c) -6 a Let r = 699/4 + -176. Let z = 0.14 - 0.14. Which is the nearest to z? (a) -1 (b) 5 (c) r a Let j = -0.04 + -2.96. Let w = j - -9. Let i = -10 + w. What is the closest to 1/3 in i, -1/2, -0.4? -0.4 Let b = 1.36 + -0.06. Let r = b - 0.3. Let a = r + -1.2. What is the nearest to a in -1, 4/3, 0.5? 0.5 Let n be 55/(-15) + (2 - -2). What is the nearest to -3 in n, -3, 2? -3 Let p = -2.3 + 2. Let t = -3.1 - -3. What is the nearest to t in p, -0.4, 0? 0 Let r = -0.17 - 3.83. What is the closest to -2/7 in 0.2, r, 0.1? 0.1 Let d = 6 + 2. Let q = d + -7.7. Let j be 2/8 + 34/(-8). Which is the closest to 1? (a) 3 (b) q (c) j b Let r(q) = 3q - 20. Let x be r(6). Which is the closest to -4/5? (a) 2 (b) -2/15 (c) x b Suppose 0o - 2o - 10 = -4p, 15 = o + 2p. Suppose -3h = -oh. Let y = 38 + -38.3. What is the nearest to -1 in y, h, -0.2? y Let g = -25390933/4 - -6387857. Let v = g - 40367. Let j = -242 - v. What is the closest to 0.1 in j, -4, -2? j Let d be -1(-2 - (-5)/2). Let z be (-2)/(((-1)/(-3))/(21/(-189))). What is the closest to d in -3, z, -1/10? -1/10 Let o = 187.2 + -187. Which is the nearest to -1/3? (a) o (b) 14 (c) 1 a Let d be 2/3 - 4/6. Let w(b) = b3 - b + 2. Let x be w(-2). Let s = 10/3 + x. What is the closest to -0.1 in d, -2/17, s? -2/17 Let u = -0.094 + 1.094. What is the nearest to 0.03 in u, 5, 1/6? 1/6 Let j be (0 - -2)/(-2 + 4). Let t be (1 - 3)(-1)/j. Let v = -3 + 1. What is the closest to -1/2 in t, 5, v? v Let l = -17 + 27. Let r = l - 9.7. What is the closest to r in 4, -0.4, -5? -0.4 Let i = -0.121 - -5.121. What is the closest to 2 in 2/9, -8/7, i? 2/9 Suppose 5m + 0m + 45 = 0. Let x = -4 - m. Let n = -0.042 - -1.042. What is the closest to -2 in 2, x, n? n Let z = -3 - -3. Let t be (3/(-9))/(-1)z. Which is the nearest to -1? (a) -1 (b) 1 (c) t a Let y = 0.57 - 0.07. Let w = 2 - 1. Which is the closest to 1? (a) w (b) y (c) 0 a Let r = 0.02 + -0.02. Let z = 1 - r. Let k = z - 1.2. What is the nearest to 0.1 in -4, 0.2, k? 0.2 Let q = 0.12 - -0.08. Which is the closest to q? (a) -0.4 (b) 1/2 (c) -1 b Let m = -0.6 - -3.6. Let n be -1 + (-12)/(-4 - 0). What is the nearest to 1/4 in -5, m, n? n Let q(y) = -y3 + 3y*2 + 9y + 1. Let s be q(5). Which is the closest to 6/7? (a) 2 (b) s (c) -5 a Suppose -2j - 3g = 3j - 25, -g = 0. Let i = j + -5. Which is the nearest to i? (a) 1/3 (b) -2/7 (c) 5 b Let g(m) = -m + 7. Let h be g(0). Let k = -6 + h. Suppose 0x + x + k = 0. Which is the closest to 0.1? (a) -3/7 (b) x (c) -0.1 c Let m = 5 - 8. Let w = -3.1 - m. Which is the nearest to -0.1? (a) w (b) -1/7 (c) 4 a Let w be -12/6-1. Let t = -55 + 54.8. Which is the closest to 1? (a) t (b) w (c) -2/11 b Let a = -1/44 - -109/924. Let t = 20431/154 - 1116/11. Let v = -63/2 + t. What is the closest to -0.1 in v, 0.3, a? v Let g = 273 - 268. Let f = -0.1 + 0.3. Which is the closest to -1? (a) g (b) -2 (c) f b Suppose 20j - 25j - 30 = 0. Which is the closest to 1/4? (a) -0.4 (b) 3/2 (c) j a Let s = -4.6 - -5. Let o = 552 + -6619/12. Let q = 2/3 - o. Which is the nearest to 0.1? (a) s (b) q (c) -3/7 b Let k = 20/21 + -2/3. What is the nearest to 0.06 in k, -3, 0.1? 0.1 Suppose -5u - o = -20, -2u - 3o + 6 = -15. Which is the closest to 0.06? (a) -3/4 (b) -4 (c) u a Let i = 0.1 - 0. Let q = 4.8 + 0.2. Let w = q + -1. Which is the nearest to i? (a) 2/3 (b) w (c) 2/19 c Let n = -382/12027 - -3/211. Let q = -6/19 + n. Let s = -0.83 + -0.17. Which is the nearest to -0.1? (a) s (b) 0.4 (c) q c Let k be 6/(-9)(-4)/8. Let p = 0.38 + 0.12. Which is the nearest to 2? (a) -1/4 (b) k (c) p c Let r = -4.25 + 0.25. Which is the nearest to r? (a) -1 (b) 4 (c) 2 a Let b = -171 + 170. What is the closest to b in -0.3, 0.13, 1/4? -0.3 Let p = 0.055 - -0.145. What is the closest to -0.3 in p, 5, 2/3? p Let s = 761/4 + -190. Which is the nearest to 0.2? (a) s (b) 2/9 (c) -2 b Suppose 5d = 10 - 0. Which is the nearest to -5? (a) 0.4 (b) 5 (c) d a Let o be (1 - 1)(-1)/(-2). Let v be (-9)/15 - (o - 1). Let u = 4/27 - -2/27. What is the closest to 3 in -2/3, u, v? v Let k = 909 + -518. Let p = -250 + k. Let q = -989/7 + p. Which is the closest to q? (a) 0.2 (b) 2/15 (c) 5 b Let v = 8 + -6. Let h = 23/3 - 19/3. Which is the nearest to v? (a) -1/4 (b) -6 (c) h c Let l = 71/15 + -17/5. Let n(j) = -j*3 - 5j*2 - 5j - 3. Let k be n(-4). Which is the nearest to k? (a) l (b) -2 (c) -3 a Let r be (-2)/3 - (-160)/(-12). Let l be r/(-18) + (-4)/4. Which is the nearest to 0? (a) 0.4 (b) l (c	{ "pile_set_name": "DM Mathematics" }
= 49. Let w = 2/373 + -7099/2238. Calculate the common denominator of k and w. 6 Let m be (-13030554)/332 + 46/23. Let a = -39247 - m. Find the common denominator of -85/6 and a. 498 Let j be (-4 + (-8112)/(-2036))1/(-1). Let a = -30063/2036 + j. Calculate the common denominator of 25/2 and a. 4 Let r be ((-254168)/(-178) - -2)/(-44). Let w be (-3914)/979 + 3 + 1. Let s = r - w. Find the common denominator of s and 49/11. 22 Suppose 14g - 1717 = 19. Calculate the smallest common multiple of g and 2. 124 Let w(g) = 10g2 - 78g - 4. Calculate the smallest common multiple of w(12) and 160. 4000 Suppose 7i - 281 = 34. What is the least common multiple of i and 25? 225 Let o(f) = -2f*2 + 5f + 1. Let d be o(4). Suppose -2b = 5x + 68, -x + 3b = -0b. Calculate the common denominator of 9/16 and -3(847/x)/d. 16 Let b = -123 - -98. Calculate the common denominator of -79/15 and 5/b + 1502/60. 30 Let s = 65 - 68. What is the smallest common multiple of (-3 - (-25)/3)/((-2)/s) and 36? 72 Let a(j) = -678j. Let u be a(3). Let m be (0 - (-220047)/u)/(-11). Let q = -2/1243 + m. What is the common denominator of -13/4 and q? 12 Suppose 38250 - 9275 = 5u. Let z = u + -92751/16. Find the common denominator of -17/18 and z. 144 What is the common denominator of -9/20 and ((-41)/40 - -1)17220/336? 160 Let r(t) = t*3 - 9t*2 + 8t - 1. Let a be r(8). Let u(z) = 13z3 - z. Let j be u(a). What is the common denominator of -44/3 and (58/(-4))/((-66)/j)? 33 Suppose -b = -2x - 692, -4b = -4x + 2x - 704. Let q = 7/101 - -11977/606. Calculate the common denominator of 6/9 - x/(-66) and q. 66 Let k = -194 + 1361/7. Let o(u) = u2 - 4u. Let i be o(4). Suppose -c - 5 = i, 263 = -5y + 4c + 38. What is the common denominator of y and k? 7 Find the common denominator of -91/22 and (358/(-176) + 2)/((-4)/400). 22 Suppose a + 3r = 2r + 7, 0 = a + 4r - 22. Suppose 7c - 5 = a. Suppose c = 4o - 3. What is the lowest common multiple of 5 and o? 5 Let f = -88667/124 - -715. Find the common denominator of 53/124 and f. 124 Find the common denominator of 28/(-24) + 1 - 13/(-66) and 56/39. 429 Let b(u) = 2u*3 + 29u*2 - 28u - 21. Calculate the least common multiple of b(-15) and 14. 1218 Let t = -344380987/168 - -2049878. Let a = 22/21 - t. What is the common denominator of 111/14 and a? 56 Suppose 5g = -62 + 77. Calculate the lowest common multiple of 84 and g. 84 Let j(z) = -3z + 8. Let i be j(-3). Let v(a) = a*3 - 16a*2 - 16a + 5. What is the least common multiple of 18 and v(i)? 198 Find the common denominator of 522/(-20) - -2 and -25/213. 1065 Suppose -4r + 171 = 3b + r, -228 = -4b + 2r. Find the common denominator of -37/8 and (-6)/b(-17)/2. 152 Suppose -p = i - 149, -3p + 753 = -0i + 5i. Calculate the least common multiple of 7 and i. 1071 Let b(q) = -q3 - 9q*2 + 10q + 1. Let o be b(-10). Let f = o + 0. What is the least common multiple of 4 and 10 + f + -3 + 3? 44 Let i = -166 - -168. Calculate the least common multiple of ((-33)/(-2))/(1/i) and 12. 132 What is the common denominator of -23/378 and ((-945)/216)/(4/((-24)/81))? 756 Find the common denominator of 524/48 - (3 + -3 + 2) and 131/18. 36 Let c = 2108 + -12689/6. Calculate the common denominator of c and (7 - 0) + 2256/(-144). 6 What is the least common multiple of -44 - -23 - -164 - (-5 + 1) and 490? 1470 Let j = -7397/48 + 458/3. Calculate the common denominator of 113/420 and j. 1680 Suppose 3t + 0x - 478 = -4x, -t - 2x = -156. Calculate the lowest common multiple of 4 and t. 332 Let v(k) = k*2 - k - 4. Let p be v(3). Suppose -2x - 4y = -0x, px - y - 15 = 0. Suppose -15m + 168 = 6m. Calculate the lowest common multiple of x and m. 24 Suppose -50x = -13x - 740. What is the least common multiple of 402 and x? 4020 Let f = 2 + -1. Suppose 118h - 111h + 112 = 0. Calculate the common denominator of -109/6 and f + -1 - (-244)/h. 12 Let b(l) = -l3 + 11l*2 + 6l - 16. Let t be b(11). Suppose 0y - 5y = -t. Calculate the common denominator of -145/6 and -6(y/(-6) - 4). 6 Let b = 240/7 - 2477/70. Suppose 0 = n - 2z - 2512, 4n + z + 2z - 10048 = 0. Let x = 27609/11 - n. Calculate the common denominator of b and x. 110 Calculate the least common multiple of (10 + -1)/31 and ((-2)/(-6))/((-6)/(-108)). 6 Let z(m) = -6m + 22. What is the lowest common multiple of 4 and z(0)? 44 What is the common denominator of -83/126 and (-2)/(-28)(-1 - 549)/11? 126 Suppose -4l - 3y + 485 + 636 = 0, -5l - 4y + 1400 = 0. What is the lowest common multiple of 2 and l? 284 Let y = -13631/762 + 7/127. Find the common denominator of y and 101/14. 42 Let f(k) = 5 + 20k - 7 - 3k. Let h be f(-1). Let z = 29 + h. What is the smallest common multiple of 5 and z? 10 Let v be (-2 - -9)316/(-18). Let s = v - -15745/126. Calculate the common denominator of s and -97/24. 168 Let h = -1707 + 3505/2. Find the common denominator of 37/24 and h. 24 Suppose 760 = -4f + 9f. Suppose 2u + 3i = i - 354, 4i = u + f. Find the common denominator of 35/3 and 1/(-4) - u/112. 21 Suppose 0 = -5j + 14j - 423. Suppose -44n - 6 = -jn. Calculate the least common multiple of n and 110. 110 Let x = 1886 + -22543/12. Find the common denominator of 6/20(-15810)/(-2232) and x. 24 Suppose i + 3 + 3 = 0. What is the common denominator of (-2 + 2 - 1 - -2)/((-230)/207) and 67/42/i? 60 Suppose -4s + 5o - 388 = 0, -5o + 443 = -3s + 157. Let h = s + 110. Calculate the least common multiple of h and 5. 40 Let c = -1551/4 + 390. Find the common denominator of -149/78 and c. 156 Let f = -3769/4 + 947. Let j = -204/347 + -15661/15268. Find the common denominator of f and j. 44 Let t(m) = 6m - 5. Let r be t(-4). Suppose 4d = -97 - 67. Let c = r - d. Calculate the least common multiple of c and 2. 12 Let f(i) = 2i + 21. Let d be f(-11). Calculate the common denominator of 22 and (255/18)/d + -1. 6 Let k = -4716 + 42391/9. Find the common denominator of k and 37/302. 2718 Let z be (-4)/14 - (-815)/(-1680). Let p = -247/48 + z. What is the common denominator of p and (-254)/84/6? 12 Suppose -61 - 1 = -2a. Suppose -4h + 73 = 5p - a, 0 = 2h + 8. What is the common denominator of -17/2 and p? 2 Let r(j) = -4j*3 - 2j*2 - 4j - 12. Calculate the smallest common multiple of r(-3) and 18. 90 Let s(f) = -f*2 + 5f - 4. Suppose 6b - 2b - 64 = 0. What is the lowest common multiple of s(3) and b? 16 Find the common denominator of 3 - (-64)/(-96)111/11 and 115/1144. 1144 Let f be 2/(1 + 74/(-54)). Let v = f - -129/10. Calculate the common denominator of v and -23 - (-12 - 3) - (-14)/16. 8 Suppose 3h + 5 = 26. Suppose 0 = -d - 1 + h. Calculate the least common multiple of 18 and d. 18 Let g be (-1)/2(2 + -50). Find the common denominator of -55/8 and (1/3)/(176/g). 88 Let x = 725/98 + -44/49. What is the common denominator of 79/428 and x? 428 Find the common denominator of 99/14 and -1 - (-1 + 108/20) - 4. 70 Let i = -10/129 - 5695/1419. Let g(d) = d3 + 21d*2 - 21d - 26. Find the common denominator of g(-22) and i. 11 Suppose -9t + 2710 = -2231. Calculate the smallest common multiple of 244 and t. 2196 Let p = -13/305 - 5204/99735. What is the common denominator of p and 53/11? 3597 Let n = -313253/18 - -17398. Let m be (1 - -1) + (-70)/(-18). Let p = n + m. Calculate the common denominator of p and 9/10. 90 Suppose -w = -i - 3, -5i - 3 = -4w + 10. Suppose 0 = o + 4r - 4, -wo = 2r + 7 - 27. Calculate the smallest common multiple of o and 6. 12 Suppose 4y - a = 20 + 298, -a + 162 = 2y. What is the lowest common multiple of 80 and y? 80 What is the smallest common multiple of (7 - 2)2208/120 and 10? 460 Let v = 1158 + -86. Calculate the common denominator of -113/20 and (v/160)/(2/5). 20 Let g = -5996762607 - -191873101899/32. Let w = g - -4636923527/6368. Let i = 14/199 - w. Calculate the common denominator of i and -65/2. 8 Let q(i) = i2 - 2i - 17. Calculate the smallest common multiple of 2 and q(7). 18 Let q(a) = a + 9. Let d be q(-9). Suppose -n + 0n + 4 = d. What is the common denominator of 144/8442/n and 40/11? 11 Let h be (-1362)/25/(2-15). Let s = h - 136. What is the common denominator of s and 93/16? 16 Let f(s) = 2*s + 20. Let w be f(-11). Calculate th	{ "pile_set_name": "DM Mathematics" }
8q + 3q - v. Let c(u) = u + 1. What is 6c(k) + d(k)? k + 1 Suppose 0u + 8 = -2s - 5u, -u = -s + 10. Let b(j) be the second derivative of -j4/12 - j3/6 - j. Let g(v) = -8v2 - 5v - 2. What is sb(d) - g(d)? 2d*2 - d + 2 Let g(r) = -3r - 6. Let i be g(-4). Let p(m) = -6m - 10. Let d(s) = -8s - 11. Let a(q) = 4d(q) - 5p(q). Let u(y) = 2y - 5. What is iu(w) + 5a(w)? 2w Suppose -5c - 37 = -2w, -7 = 3c + 4w + 10. Let x(y) = 3y3 - y2 + 2. Let n(h) = 10h*3 - 3h*2 + 7. What is cx(o) + 2n(o)? -o3 + o2 Let h(l) = -11l*2 + 2. Let u(q) = -11q*2 + 2. What is 4h(z) - 5u(z)? 11z2 - 2 Let i(z) be the second derivative of -z3/6 - z*2 - 2z. Let o(h) = h3 + h + 3. Let x(s) = s3 - 3s2 + s - 1. Let y be x(2). Calculate yi(j) - 2o(j). -2j*3 + j Let c(u) = -4u + 1. Let v(t) be the first derivative of -23/2t2 - 7 + 6t. What is -34c(y) + 6v(y)? -2y + 2 Let m(z) = 11z*2. Let j(f) = -40f*2 - 25f - 25. Let a(c) = -5c2 - 3c - 3. Let h(i) = 25a(i) - 3j(i). What is -13h(d) - 6m(d)? -d*2 Let a(o) = 5o*2 + 3o. Let u(x) = 14x2 + 8x. Determine -17a(q) + 6u(q). -q*2 - 3q Let o(g) = 25g. Let h(r) = -49r. Determine 3h(x) + 5o(x). -22x Suppose 3c + 9 = -2j + 6j, 0 = 3j. Let i(d) = d2 + d + 1. Let l(b) = 2b*2 + 3b + 2. Determine cl(p) + 8i(p). 2p2 - p + 2 Let x = 7 - 6. Let c be 3/(-9)0 + x. Let i(y) = 2y2 + y. Let r(n) = -n2. What is cr(o) + i(o)? o*2 + o Let f = 49 - 43. Let h(n) = 8n*2 + 2n - 1. Let x(b) = -15b2 - 4b + 2. Give fx(l) + 11h(l). -2l2 - 2l + 1 Let s(r) = -2r - 3. Let v be s(-2). Let p(q) = 2. Let h(a) = 4 - 2 + 1 - 4 + a. Let t be 4/3(-6)/(-4). Calculate th(n) + vp(n). 2n Let h be (-5 + -10)(-4)/(-10). Let x = -8 - h. Let n(v) = 8v3 - 9. Let u(k) be the second derivative of -k5/10 + k2 + 3k. What is xn(c) - 9u(c)? 2c3 Let i(h) = 4h - 8. Let z(q) = 5q - 7. Give -5i(y) + 6z(y). 10y - 2 Let t(l) = -l*2. Let c(b) = 7b*2 - 1. Let s = -7 + 6. Suppose -r + 3r = -12. Determine rt(g) + sc(g). -g*2 + 1 Let v(g) = g + 2. Let i(f) = f + 4. Let n(t) = 3i(t) - 7v(t). Let j(a) = a. Let y(h) = h3 - h2 - 4h + 3. Let d be y(2). Determine dn(x) - 3j(x). x + 2 Let a(m) = m*2 + 28. Let k(s) = 2s*2 + 55. What is -5a(r) + 3k(r)? r2 + 25 Let g(n) = -2n + 3. Let v(i) = i - 2. Let q(m) = 2g(m) + 3v(m). Let u(d) = 7d + 2 + 1 - 2. Suppose -5 - 5 = -2k. Calculate kq(b) + u(b). 2b + 1 Suppose -t = -2t + 2. Let i(n) be the first derivative of 1/3n*3 + 0n + 1 - n2. Let b(r) = r3 - 2r2 + 5r. Determine tb(v) + 5i(v). 2v3 + v2 Let r(d) = -d2 + d. Suppose 2m - j = 25, 2m + 2m = -5j + 43. Let y(n) = 3n*3 - 12n*2 + 12n. Determine mr(t) - y(t). -3t*3 Let t(c) = 3c*2 + 5c - 5. Let i = 2 - 1. Let k(h) = 3h2 + 1. Let d be k(i). Let u(q) = -4 - 5q*2 + dq + 3q2 + 4q*2. What is -4t(j) + 5u(j)? -2j*2 Let v(x) = -1. Let z(k) = 23k - 115. Calculate 115v(m) - z(m). -23m Let v(r) = 4r3 - 2r*2 + 5r + 5. Let y(h) = -h - 5. Let t be y(-4). Let u be t - (-1)/1 - -5. Let x(a) = -11 + 19 - 9 - a - a*3. Calculate ux(w) + v(w). -w*3 - 2w2 Let x(b) be the third derivative of b6/40 + b4/4 - b3 - 13b2. Let o(j) = -2j*3 - 5j + 5. Give 6o(r) + 5x(r). 3r3 Let q(f) = -f2 + 9f - 7. Let c(g) = g*2 - 10g + 8. Calculate 5c(o) + 6q(o). -o*2 + 4o - 2 Let k(z) = -13z - 6. Let p(q) = -7q - 3. Give 4k(l) - 7p(l). -3l - 3 Let b(k) = -k3 + 2k*2 - 7k + 5. Let u(w) = -6w - 80. Let o be u(-14). Let r(d) = -4d*2 + 2d*2 + 4 + 4d*2 - 6d - d*3. Give ob(j) - 5r(j). j3 - 2j*2 + 2j Let q(x) = -27x - 3. Let m(w) = 9w + 1. Give -8m(t) - 3q(t). 9t + 1 Let u(g) = -g2 + 2g - 3. Let y be u(3). Let j(l) = -4l - 9. Let p(t) = 2t + 4. What is yj(z) - 13p(z)? -2z + 2 Let s(v) be the third derivative of -3v*4/8 - 49v*2. Let p(h) = -17h + 0h + 4h. Give 5p(o) - 7s(o). -2o Let d(x) = x3 + 3x*2 - 3x + 3. Let f(n) = -4n2 + 4n - 4. What is -4d(p) - 3f(p)? -4p3 Let f(a) = a + 0a + 0 + 0 - 3. Let s(z) = 2z - 4. Calculate -6f(n) + 4s(n). 2n + 2 Let v(n) = 15n + 13. Let t(j) = 8j + 7. Suppose 16m = 8m + 48. Give mv(g) - 11t(g). 2g + 1 Let a be -1 - -2(-1)/(-1). Let z(v) = v*3 + 2v. Let h(g) = -g. Let o(l) = -4l. Let x(y) = -7h(y) + 2o(y). Determine az(n) + 2x(n). n3 Let r(z) = -z + 1. Let b(m) be the second derivative of m4/4 - m3/2 + m2 + 11m. Give -b(h) + 3r(h). -3h2 + 1 Let d(r) be the third derivative of -r4/4 + 5r3/6 - r2. Let o = -3 + -1. Let h = 118 - 119. Let f(s) = s - 1. Calculate hd(z) + of(z). 2z - 1 Let l(z) = -6z2 + 1. Let p = -5 + 10. Let t(s) = s - s - 5s*2 + 1. Let a = -5 + 1. Give al(u) + pt(u). -u2 + 1 Let b(n) = -6n*2 - 26n + 16. Let k(z) = z*2 + 5z - 3. What is -2b(f) - 11k(f)? f*2 - 3f + 1 Let x(q) = -q + 2. Let h(o) = -4o + 9. Give -4h(t) + 18x(t). -2t Let n(f) = -4f2 - 2f + 0f2 + f3 + 6f*2. Let p(c) = -5c*3 - 9c*2 + 9c. Calculate -18n(s) - 4p(s). 2s3 Let d(o) = o - 1. Let z(g) = 2g*2. What is 2d(j) - z(j)? -2j2 + 2j - 2 Suppose 4x - 3x = -6. Let l be x/(((-21)/(-2))/7). Let w(a) = -6a - 1. Let c(d) = 5d + 1. Determine lw(g) - 5c(g). -g - 1 Let s(l) = 5l3 + 2l*2 - 2l. Let k(i) = -6i3 - 3i*2 + 3i + 1. Let u = -21 + 24. Calculate us(d) + 2k(d). 3d3 + 2 Let s(u) = -2u*3 - 4u*2 - 2u + 1. Let d = -18 + 27. Let o(g) = -4g3 - 9g*2 - 5g + 2. Calculate ds(x) - 4o(x). -2x3 + 2x + 1 Let q(s) = -s*2 + s. Let t(g) = -5g*3 - 3g*2 + 5g - 2. Give 5q(h) - t(h). 5h*3 - 2h*2 + 2 Let m(z) = -3z - 6. Let k(s) = 0 - 3 + 0 + 4. Give -6k(v) - m(v). 3v Let y(s) = 2s2 + 8s - 4. Let k(g) = g*2 + 7g - 3. Calculate 3k(m) - 2y(m). -m*2 + 5m - 1 Let l(i) = 5i + 3. Let q be (-2)/5 - 84/(-10). Let z = 4 - q. Let t(k) = 6k + 4. Let x = -8 - -11. Give xt(a) + zl(a). -2a Let p(x) = -x. Let v(j) = 12. Give 2p(f) - v(f). -2f - 12 Let u(i) = -9i*3 - 7i - 5. Let k(c) = 4c3 + 3c + 2. Determine 5k(p) + 2u(p). 2p3 + p Let t be -4 + (0 - (0 + 0)). Let y(m) = -2m. Let v be ((-10)/(-8))/(1/4). Let j be (-27)/v - 6/(-15). Let r(k) = 3k. What is jy(l) + tr(l)? -2l Let o(m) = -3m3 + 5m*2 - 5m - 7. Let d(n) = 3n + 25 + n3 - n2 - n2 - 22 - n. What is 5d(i) + 2o(i)? -i3 + 1 Suppose -3c + 36 + 18 = 0. Suppose 10v = 4v + c. Suppose -5n - 25 = 2h - h, -5n - 5h - 25 = 0. Let a(p) = p - 2. Let y(q) = q - 1. Give ny(u) + va(u). -2u - 1 Let t(o) = 4o*3 - 3o*2 + 3o - 3. Let v(q) = -25q3 + 17q*2 - 17q + 17. Determine 34t(m) + 6v(m). -14m3 Let g(i) = -i3 - i - 1. Let l(m) = -2m + 8. Give 2g(w) - l(w). -2w*3 - 10 Let y(w) be the first derivative of 4/3w*3 + 0w - 1/2w2 - 2. Suppose -i = -3p + 3 - 2, -2i - 5p + 9 = 0. Let k(b) = -b*2. Give iy(n) + 10k(n). -2n*2 - 2n Let g(x) = 3x2 + 4x + 7. Let z(j) = j + 1. What is g(k) - 5z(k)? 3k*2 - k + 2 Let w(y) = 3y*2 - 2y. Suppose -17 = f - 15. Let v(c) be the second derivative of -c4/3 + c3/2 + 2c. What is fv(i) - 3w(i)? -i2 Let r(q) = -2q*2 + 5 + 6q*2 + 9q3 + q2 + 0q3. Suppose -v + 4v - 15 = 0. Let i(y) = -4y3 - 2y*2 - 2. Determine vi(d) + 2r(d). -2d*3 Let a(y) = -13y*2 - 9y. Let n(x) = -4x2 - x - x2 + 11x*2 + 5x. Give 4a(t) + 9n(t). 2t2 Let x(d) = -2. Let p(q) be the third derivative of q5/120 + q4/24 + q3/3 - 2q*2. Let j(y) be the first derivative of p(y). Determine -2j(o) - 2x(o). -2o + 2 Let j(z) = 7z3 - 4z + 5. Let v(o) = -13o3 + 9o - 11. Give 7j(t) + 3v(t). 10t3 - t + 2 Let c(g) = g2 - 5g. Let k(t) = -t*2 - 5. Let n be k(0). Let o(l) = -2l - 36l2 + 37l*2 - 5l. Give no(q) + 7c(q). 2q2 Let t(p) = -p2 - p - 2. Let v be t(-2). Let n = 9 + v. Let j(o) = -o3 + 2o*2 - 2o - 4. Let q(b) = b*3 - 2b*2 + 2b + 5. Calculate nj(i) + 4q(i). -i*3 + 2i*2 - 2i Let x(j) = -j3 + j2 - 1. Let s(z) = -20z3 - 4z*2 + 4. What is s(r) + 4x(r)? -24r3 Let i(l) = -5l*2 + 5. Let k(y) = -4y*2 + 4. Let o(c) = 5i(c) - 6k(c). Let q(h) = 39h - 4 - 39h + 9h*2. Determine -6o(m) -	{ "pile_set_name": "DM Mathematics" }
2. 1792sqrt(7) + 22208 Simplify 3((-3((sqrt(5) + 0)6 - (sqrt(5) + 3)-4) + 3)2 + 4). 5940sqrt(5) + 16779 Simplify -3(0 + (2sqrt(128) - sqrt(128)) + sqrt(128) + sqrt(128) + sqrt(128) + -1 + 0 + -5(sqrt(128) - -2sqrt(128)) + -1sqrt(128) + 3)2. -55308 + 1152sqrt(2) Simplify 0 + (((sqrt(35) - sqrt(105)/sqrt(3))/sqrt(7) - (sqrt(500)-3 + sqrt(500)))2-6)2 + -3 + 0. 287997 Simplify sqrt(48)/(sqrt(6)-4)3 + (-3((sqrt(14) - (sqrt(56)/sqrt(4) - sqrt(14)))/sqrt(7) + 4))*2. 141sqrt(2)/2 + 162 Simplify (((sqrt(200)2 - sqrt(200))4-3)/((1sqrt(80)6)/sqrt(8)))21 + -2. 78 Simplify (5-5((sqrt(252) - (sqrt(252) + 2)) + sqrt(7)) - (sqrt(700)3 - sqrt(700))-31)2. 3500sqrt(7) + 11075 Simplify (2(4 + (sqrt(2352) - (0 + sqrt(2352))-1) + sqrt(2352) + 2))*2 + 4. 4032sqrt(3) + 84820 Simplify ((-4sqrt(300))/sqrt(10) + sqrt(30) + (sqrt(90)/(sqrt(3)2) - sqrt(30)))/(sqrt(40)/(sqrt(36) + sqrt(4)) + sqrt(10) + (-1sqrt(10) + sqrt(10))-3). -14sqrt(3)/5 Simplify -2((sqrt(66) + (-1sqrt(66) - sqrt(66)) + sqrt(66))-4-6-5)/((-2sqrt(48)5 - sqrt(48))/(sqrt(16)/(sqrt(8)/sqrt(4)))). 0 Simplify (-5(-3 + (sqrt(76) + -2sqrt(76)-4)/(sqrt(4) + (sqrt(88)/sqrt(2))/sqrt(11))) + -5)-5. -50 + 225sqrt(19)/2 Simplify 5(-1(6sqrt(136)-1 - (2sqrt(136) + sqrt(136) - sqrt(136))4))/((sqrt(8) - -1sqrt(8))-2 + (sqrt(8) - -1(sqrt(8) - sqrt(8)2))). -35sqrt(17)/2 Simplify 5((sqrt(208) - (-5 + 2sqrt(208))*2) + (1sqrt(208)3)2 + sqrt(208))5-6. -152250 - 13200sqrt(13) Simplify -5 + (6(sqrt(1088) - (sqrt(1088) + sqrt(1088)-1)2) - (0 + sqrt(1088))21 - (((sqrt(17) + 0)2 + 1)-6 + 0)). -985 + 48sqrt(17) Simplify 1 + -3 + (1sqrt(60)/sqrt(4)-2)/((sqrt(3) - sqrt(450)/sqrt(6))1). -2 + sqrt(5)/2 Simplify 5-63(((sqrt(119) + -2(sqrt(119) + sqrt(119) + (sqrt(119) - sqrt(119)-2 - sqrt(119)) + sqrt(119)))1)/((sqrt(196)-1)/sqrt(7)))2. -61965/2 Simplify 2(((sqrt(2448) + 1)-3 + 0 - (-2 + (-4 + 1sqrt(2448))*2)) + 1). -4928 + 120sqrt(17) Simplify -4(2 + (sqrt(19) - (sqrt(19) + 0)) + sqrt(19) + (sqrt(228)-5)/sqrt(12) + (-2 + sqrt(95)/sqrt(125))1). 76sqrt(19)/5 Simplify ((3(sqrt(209) + 1sqrt(209)) - (sqrt(209) + (sqrt(209) - 1sqrt(209))3 + sqrt(209)))6)/(-3(sqrt(55)/sqrt(5) + sqrt(11)) + 1sqrt(1584) + sqrt(11)). 24sqrt(19)/7 Simplify (-5 + 5 + -6((sqrt(51)/(sqrt(3) - (sqrt(3) - sqrt(27))) - sqrt(17) - sqrt(17) - ((-3sqrt(272) - sqrt(17)) + sqrt(17)))1)2)3. -32674 Simplify (sqrt(210)/(sqrt(250) + sqrt(10)) + sqrt(525)2)/(-6(sqrt(175) - sqrt(175)5)). 61sqrt(3)/720 Simplify (sqrt(160)/(sqrt(8) + sqrt(32)))/(sqrt(1440) + -2sqrt(1440)) - ((-2sqrt(10) + sqrt(10))-6)/(-5sqrt(25)/sqrt(5)). 211sqrt(2)/180 Simplify -3-4((sqrt(192)/sqrt(4) + -4)2 - ((-3 + 3sqrt(3))-4)2). -6144 + 3072sqrt(3) Simplify 2 + 0 + 3sqrt(180) + ((sqrt(5)-2-5)2 - ((sqrt(270)/sqrt(9))/sqrt(6))2). 18sqrt(5) + 497 Simplify (-1 + ((sqrt(300) + sqrt(300) + (sqrt(300) - 2sqrt(300)) + sqrt(300) + sqrt(300) - (sqrt(84)1)/sqrt(7))/(sqrt(1764)-1))25)3. 17 Simplify (((sqrt(972) + sqrt(972) + 3(sqrt(972) - -2sqrt(972)))4)/((1sqrt(30)-1)/(sqrt(5) + -3sqrt(80))))2. 37949472 Simplify (-3(5 + sqrt(27) + 4 + -1sqrt(3)))2 - 3(2 + (sqrt(12)/sqrt(4)-1)2). 324sqrt(3) + 822 Simplify 5 + -3(4 + sqrt(1872) + -2 + (-1sqrt(1872))*2 + -4)-1 + -5 + -5. 36sqrt(13) + 5605 Simplify 5(sqrt(325) + (sqrt(325) - ((sqrt(325) + 0)*2 + -2 + sqrt(325)))) + (-1sqrt(13)3 + sqrt(13))5-1. -1615 + 35sqrt(13) Simplify -2 + (((sqrt(425) - (1 + sqrt(425))) + 3 - sqrt(425) - sqrt(425)) + (-5sqrt(425) - sqrt(425)) + 3 + -2)2. -240sqrt(17) + 27207 Simplify -3 + 0 + (sqrt(76) + 1 + sqrt(76))*2 + (sqrt(19) + 1)4 + 1-3(sqrt(76)/sqrt(4))*2. 12sqrt(19) + 249 Simplify 3(-5 + -6(5 + sqrt(272) + -2sqrt(272) + -6(-5 + sqrt(272))) + -4)*2. -220752sqrt(17) + 1583307 Simplify (-2-2sqrt(88)-2 - ((-4(sqrt(88)2 - sqrt(88)) + sqrt(88) - sqrt(88)) + -6-1sqrt(88)))/(2(2sqrt(648)-3 + -1sqrt(648)-1)). sqrt(11)/9 Simplify -2 + ((1(sqrt(2448) - (sqrt(2448) + sqrt(2448) + 0 - sqrt(2448))) - (2 + sqrt(2448))-5)-221)2. 19200sqrt(17) + 980798 Simplify ((3sqrt(96)1)/sqrt(8)-3)/(6-1sqrt(3600)). sqrt(3)/20 Simplify ((sqrt(78)1-1)/((5-2sqrt(2) - sqrt(2)) + sqrt(2)))/((sqrt(24) - (-1sqrt(864) - sqrt(864)))/(sqrt(128)-1)). -2sqrt(13)/65 Simplify ((sqrt(27)/sqrt(81) - sqrt(75)-2)-5 - ((sqrt(3) - (sqrt(3) - (0 + sqrt(3) + 5))) + -1 - (sqrt(243) + 0 - (sqrt(6)/sqrt(2) + 3 - sqrt(3)))))*2. 1834sqrt(3)/3 + 17308/3 Simplify ((sqrt(40)/(-2sqrt(2)))/(sqrt(4) + 1sqrt(4)-6) + (4sqrt(720) - sqrt(55)/(sqrt(77)/sqrt(7))))*2. 221841/20 Simplify (-4sqrt(2176)-4)/(sqrt(72)1-2)-2. 64sqrt(17)/3 Simplify -2(-2(sqrt(140)/sqrt(160))/(sqrt(112) - -2sqrt(112))-11 + 0)*2. -1/144 Simplify 3 + (-5(sqrt(468) + -1 - sqrt(468)) + (sqrt(468) + -2)4)26 + -2 + 3. -864sqrt(13) + 44986 Simplify 2 + ((sqrt(1700) + 1 + -1 + sqrt(1700) + sqrt(1700) + 1sqrt(1700)2 + sqrt(1700) + 1sqrt(1700) + 3 + 2 + 2sqrt(1700))3 + -2)*2. 7020sqrt(17) + 1239471 Simplify (sqrt(66) + 62sqrt(66))/(sqrt(6) + 6sqrt(54)) - (-3 + (-1 + sqrt(176))-3 + 1(sqrt(176) + -1)2). -177 + 393sqrt(11)/19 Simplify -4 + (sqrt(540)-2 + sqrt(540) + sqrt(540) + sqrt(60) + sqrt(120)/(sqrt(4)/sqrt(2)))/(-5(sqrt(60)/(sqrt(30)/sqrt(6)) + sqrt(12))). -4 - sqrt(5)/5 Simplify 1(5 + -4(2sqrt(128)6 - (-3 + (sqrt(128) + sqrt(128)2 + sqrt(128))2))1). -384sqrt(2) + 8185 Simplify (1(4(sqrt(275) + 0) + -2 + 3 + sqrt(275) + (sqrt(275) + sqrt(275) + 2 + sqrt(275) + -3)6 + 4))*2. -230sqrt(11) + 145476 Simplify (23sqrt(88) - sqrt(88) - (sqrt(88) - (sqrt(88) + 2sqrt(88)-3)))/(((sqrt(176) - (sqrt(176) - sqrt(176)-2))/sqrt(11))/sqrt(72)). 3sqrt(11) Simplify (-6((sqrt(3) + sqrt(3)2)6 + 5) + (sqrt(12) + 1 - sqrt(3)) + (sqrt(30) - -2sqrt(30))/sqrt(10) + 3)*2. 5408sqrt(3) + 33124 Simplify (-2 + sqrt(2) + 0)43 - sqrt(162)-3-26. -312sqrt(2) - 24 Simplify 3 + (sqrt(405)/((3sqrt(108) - sqrt(108))/sqrt(12)) - (sqrt(180)/(-3sqrt(4)) + -1))*2. 5sqrt(5) + 141/4 Simplify ((sqrt(600)/sqrt(12) + sqrt(12)/sqrt(6)-3 + ((sqrt(16) - sqrt(576)) + sqrt(16))/sqrt(8) + sqrt(2) + (sqrt(8) + sqrt(2))1)-1)2. 8 Simplify (2 + 6(sqrt(76) - (-1sqrt(76)1 + sqrt(76))) + 4 + (sqrt(76) + -2)1)2. 112sqrt(19) + 3740 Simplify -5(5(-3sqrt(128) + 2 + sqrt(128) - (sqrt(128) + 1 + 5)))21. -146000 - 24000sqrt(2) Simplify 6(2sqrt(25))/sqrt(5) - (-1sqrt(20)/sqrt(4) - (2sqrt(720) - sqrt(720))2) - (6sqrt(15)/(1sqrt(243)) + -4)2. 55sqrt(5)/3 + 6316/9 Simplify (1(sqrt(2695)-3 + sqrt(55))-2)/((2sqrt(528)-2)/sqrt(12)). -5sqrt(5) Simplify (-1sqrt(70)31)/(-3sqrt(100)/sqrt(10)-6). -sqrt(7)/6 Simplify ((sqrt(36)/sqrt(24))/(2sqrt(12)/sqrt(4)) + (-3(sqrt(2) + sqrt(242) + -2 + 0))2)5. -8635sqrt(2)/4 + 13140 Simplify (3(sqrt(1900) + sqrt(1900)2-3 - sqrt(1900)) + -5((sqrt(114)/sqrt(6) - sqrt(19) - sqrt(19)) + sqrt(19))-4-3)2. 615600 Simplify 3 + (6(-2sqrt(56))/sqrt(8)-4 - (-4 + (sqrt(847)2 - sqrt(847)) - sqrt(847))3)*2. 1152sqrt(7) + 16275 Simplify 1 + ((-2sqrt(352)-2 - sqrt(352))/sqrt(8))/((sqrt(4) - (sqrt(196)-2 + sqrt(196))) + sqrt(44)/(sqrt(22)/sqrt(2))) + 0. 1 + sqrt(11)/3 Simplify (4sqrt(720) - sqrt(720))*2 + -3 + (-3(sqrt(720) + 3))*2 + -1sqrt(720) + sqrt(720) + -2 + 3sqrt(720) + sqrt(720) + 3. 696sqrt(5) + 13039 Simplify (-1(sqrt(880) + sqrt(55)))/(sqrt(5) + 1sqrt(20)) + ((sqrt(11) + -3)1)2 + sqrt(11) + 5(sqrt(11) + 1). -5sqrt(11)/3 + 25 Simplify (-6sqrt(78)1 - sqrt(78))/(sqrt(150)5 + sqrt(6)) - (4 + (2 + sqrt(117)1)1). -85sqrt(13)/26 - 6 Simplify (-5(sqrt(25) + (sqrt(25) - 5sqrt(3600)))/sqrt(5) + (sqrt(1000) + (sqrt(1000) - sqrt(1000)-1) + sqrt(1000))/(sqrt(8) - 5sqrt(128)))2. 150700500/361 Simplify 4(sqrt(20)/sqrt(4)-52)*2 + -1 - ((sqrt(2240) + 1sqrt(2240) + sqrt(2240) + sqrt(35))/(sqrt(21)/sqrt(3)-5)4)*2. -1 Simplify 5 + (-3(sqrt(900) - (sqrt(900) - 2sqrt(900)))5)/(-2sqrt(192)6 - sqrt(192)). 75sqrt(3)/26 + 5 Simplify 3 + (2sqrt(605) + 5 - sqrt(605)24 - (4 + sqrt(605) + -1 - 1(sqrt(605) + -1 + sqrt(605))))2 + 2. -110sqrt(5) + 15131 Simplify 3sqrt(152)/(sqrt(800)1) - (-5*	{ "pile_set_name": "DM Mathematics" }
581, -11601, -11625? -2j2 - 10j - 11553 What is the a'th term of -21351, -42696, -64039, -85380, -106719, -128056, -149391? a*2 - 21348a - 4 What is the z'th term of -25817, -51633, -77449, -103265, -129081? -25816z - 1 What is the q'th term of -7201, -7195, -7189, -7183? 6q - 7207 What is the j'th term of -42, -392, -1344, -3198, -6254, -10812, -17172, -25634? -50j3 - j2 + 3j + 6 What is the y'th term of -10830, -10831, -10832? -y - 10829 What is the i'th term of 274, 535, 762, 937, 1042? -3i3 + i2 + 279i - 3 What is the r'th term of -3314, -6463, -9612, -12761? -3149r - 165 What is the n'th term of -121, 23, 263, 599, 1031, 1559, 2183? 48n*2 - 169 What is the x'th term of 123, 79, -13, -165, -389? -2x*3 - 12x*2 + 6x + 131 What is the h'th term of 336, 340, 344, 348, 352, 356? 4h + 332 What is the j'th term of -3560, -7105, -10650? -3545j - 15 What is the u'th term of 35523, 35527, 35531, 35535? 4u + 35519 What is the m'th term of 4024, 16054, 36110, 64198, 100324, 144494, 196714, 256990? m3 + 4007m*2 + 2m + 14 What is the h'th term of -136960, -136963, -136966, -136969, -136972? -3h - 136957 What is the k'th term of 20625, 41250, 61889, 82548, 103233, 123950, 144705? k3 + k2 + 20615k + 8 What is the v'th term of -317, -2147, -7119, -16805, -32777, -56607, -89867, -134129? -262v3 + v2 + v - 57 What is the w'th term of -1394, -11120, -37524, -88946, -173726, -300204, -476720, -711614? -1390w3 + w2 + w - 6 What is the o'th term of 1768, 907, -1430, -5981, -13484? -123o3 + 1891 What is the b'th term of -533392, -533394, -533398, -533404, -533412, -533422? -b2 + b - 533392 What is the p'th term of 8451, 8524, 8597, 8670, 8743, 8816? 73p + 8378 What is the h'th term of 392878, 392872, 392866? -6h + 392884 What is the j'th term of 872, 908, 944, 980, 1016? 36j + 836 What is the z'th term of 1400, 2802, 4194, 5570, 6924, 8250, 9542? -z3 + z2 + 1406z - 6 What is the q'th term of 108, 929, 3208, 7689, 15116? 124q*3 - 15q*2 - 2q + 1 What is the o'th term of -1421, -5786, -13049, -23204, -36245, -52166? o*3 - 1455o*2 - 7o + 40 What is the j'th term of 18891, 18904, 18931, 18978, 19051, 19156, 19299, 19486? j3 + j2 + 3j + 18886 What is the b'th term of 1865, 3727, 5581, 7427? -4b*2 + 1874b - 5 What is the v'th term of -158, -344, -566, -830, -1142, -1508? -v*3 - 12v*2 - 143v - 2 What is the f'th term of -60025, -120059, -180109, -240181, -300281? -f*3 - 2f*2 - 60021f - 1 What is the q'th term of 4715, 4633, 4553, 4475, 4399? q*2 - 85q + 4799 What is the h'th term of 924, 1824, 2718, 3600, 4464? -h*3 + 3h*2 + 898h + 24 What is the t'th term of -364, -416, -468? -52t - 312 What is the i'th term of 93770, 93793, 93818, 93845, 93874? i2 + 20i + 93749 What is the k'th term of 93575, 93572, 93569? -3k + 93578 What is the f'th term of 5575, 5553, 5531, 5509, 5487, 5465? -22f + 5597 What is the b'th term of 85214, 85210, 85206, 85202, 85198, 85194? -4b + 85218 What is the k'th term of -1116, -1962, -2808? -846k - 270 What is the t'th term of 1304, 2586, 3846, 5084? -11t2 + 1315t What is the p'th term of 369, 737, 1073, 1377? -16p2 + 416p - 31 What is the p'th term of 6284, 6283, 6278, 6269, 6256, 6239? -2p2 + 5p + 6281 What is the b'th term of -41470, -82942, -124414, -165886? -41472b + 2 What is the g'th term of -1778, -2862, -3948, -5036, -6126? -g2 - 1081g - 696 What is the c'th term of -61, -276, -499, -736, -993, -1276, -1591? -c*3 + 2c*2 - 214c + 152 What is the g'th term of 3282, 3110, 2938? -172g + 3454 What is the h'th term of 103, -240, -1157, -2930, -5841, -10172? -47h*3 - 5h2 + h + 154 What is the x'th term of -1007, -1925, -2841, -3755, -4667, -5577? x2 - 921x - 87 What is the h'th term of -64, -5, 176, 479? 61h*2 - 124h - 1 What is the l'th term of -1016, -1033, -1074, -1151, -1276, -1461? -2l3 - 3l - 1011 What is the g'th term of 2853, 5707, 8561, 11415? 2854g - 1 What is the l'th term of 217, 1131, 3617, 8461, 16449, 28367, 45001? 131l*3 - 3l + 89 What is the a'th term of -1585, -3158, -4683, -6136, -7493, -8730, -9823? 4a3 - 1601a + 12 What is the y'th term of 1592, 1561, 1470, 1289, 988, 537, -94, -935? -5y3 + 4y + 1593 What is the u'th term of 11, 140, 355, 656, 1043, 1516? 43u2 - 32 What is the y'th term of -4641, -4369, -3917, -3285, -2473? 90y*2 + 2y - 4733 What is the z'th term of 761, 779, 773, 743, 689, 611? -12z2 + 54z + 719 What is the q'th term of 6564, 26256, 59076, 105024, 164100? 6564q2 What is the j'th term of -214, -526, -764, -892, -874, -674? 6j3 + j2 - 357j + 136 What is the o'th term of -11875, -11848, -11821, -11794, -11767, -11740? 27o - 11902 What is the j'th term of -54, -110, -152, -180, -194? 7j2 - 77j + 16 What is the a'th term of 9547, 9685, 9823, 9961? 138a + 9409 What is the c'th term of 567, 169, -487, -1395, -2549, -3943, -5571, -7427? c3 - 135c*2 + 701 What is the j'th term of -372390, -372399, -372408, -372417, -372426? -9j - 372381 What is the u'th term of 715, 638, 511, 334, 107, -170? -25u2 - 2u + 742 What is the x'th term of -150, -1162, -3890, -9192, -17926? -143x3 - 11x + 4 What is the m'th term of -434, -360, -236, -62, 162, 436, 760? 25m2 - m - 458 What is the c'th term of 2853, 23144, 78283, 185694, 362801, 627028? 2904c*3 - 37c - 14 What is the h'th term of -972, -963, -954, -945, -936? 9h - 981 What is the t'th term of -562, -471, -364, -241, -102, 53, 224? 8t*2 + 67t - 637 What is the h'th term of 365, 414, 539, 776, 1161, 1730, 2519, 3564? 6h3 + 2h*2 + h + 356 What is the i'th term of -56258, -112515, -168772, -225029? -56257i - 1 What is the w'th term of -1332, -3084, -4848, -6630, -8436? -w*3 - 1745w + 414 What is the s'th term of -5311, -10624, -15937, -21250, -26563, -31876? -5313s + 2 What is the m'th term of -89263, -178474, -267685, -356896, -446107, -535318? -89211m - 52 What is the i'th term of 57135, 57115, 57095, 57075, 57055, 57035? -20i + 57155 What is the i'th term of -113271, -226540, -339811, -453084, -566359, -679636? -i2 - 113266i - 4 What is the s'th term of -12028, -24061, -36094? -12033s + 5 What is the o'th term of 9706, 9692, 9652, 9574, 9446? -2o3 - o2 + 3o + 9706 What is the a'th term of -3604, -3644, -3710, -3802? -13a*2 - a - 3590 What is the k'th term of 772, 3086, 6954, 12376, 19352? 777k*2 - 17k + 12 What is the w'th term of 4, 51, 124, 223? 13w2 + 8w - 17 What is the p'th term of -6214, -12437, -18656, -24871, -31082, -37289? 2p2 - 6229p + 13 What is the n'th term of 31, 157, 371, 673, 1063? 44n2 - 6n - 7 What is the j'th term of -6740, -6744, -6748, -6752? -4j - 6736 What is the x'th term of -133, 139, 397, 635, 847? -x3 - x2 + 282x - 413 What is the m'th term of -424097, -848197, -1272297? -424100m + 3 What is the n'th term of 217976, 217974, 217972, 217970, 217968? -2n + 217978 What is the s'th term of -9964, -19904, -29822, -39718? 11s2 - 9973s - 2 What is the n'th term of 524, 467, 410, 353, 296? -57n + 581 What is the t'th term of -1138784, -2277565, -3416346, -4555127, -5693908, -6832689? -1138781t - 3 What is the u'th term of 191, 75, -45, -175, -321? -u*3 + 4u*2 - 121u + 309 What is the h'th term of 20073, 40144, 60211, 80280, 100357? h*3 - 8h*2 + 20088h - 8 What is the f'th term of -530, -1065, -1600, -2135, -2670, -3205? -535f + 5 What is the p'th term of 36171, 36117, 36065, 36015? p2 - 57p + 36227 What is the l'th term of -7817, -15634, -23451? -7817l What is the u'th term of 20972, 20970, 20968, 20966, 20964? -2u + 20974 What is the m'th term of 2210, 3615, 5950, 9209, 13386, 18475, 24470, 31365? -m*3 + 471m*2 - m + 1741 What is the r'th term of -2348, -9469, -21338, -37955, -59320, -85433, -116294? -2374r*2 + r + 25 What is the j'th term of -94, -365, -814, -1441? -89j*2 - 4j - 1 What is the k'th term of 430, 536, 710, 952? 34k2 + 4k + 392 What is the u'th term of 1632, 1753, 1872, 1989, 2104? -u*2 + 124u + 1509 What is the l'th term of 43773, 43772, 43771? -l + 43774 What is the s'th term of -2543, -2621, -2705, -2795, -2891, -2993? -3s2 - 69s - 2471 What is the k'th te	{ "pile_set_name": "DM Mathematics" }
quence sf when two letters picked without replacement from {i: 6, k: 1, s: 2, f: 3}. 1/22 Calculate prob of sequence uxm when three letters picked without replacement from {x: 1, m: 2, u: 2}. 1/15 Two letters picked without replacement from ffpfjzj. What is prob of sequence pz? 1/42 What is prob of sequence ka when two letters picked without replacement from {f: 7, a: 6, k: 6}? 2/19 Two letters picked without replacement from {i: 2, e: 3, n: 2, v: 4}. What is prob of sequence vv? 6/55 What is prob of sequence ucuc when four letters picked without replacement from {u: 2, c: 4}? 1/15 What is prob of sequence tm when two letters picked without replacement from {m: 2, b: 9, t: 7}? 7/153 Four letters picked without replacement from mmbokgq. What is prob of sequence gbom? 1/420 What is prob of sequence ttl when three letters picked without replacement from srlssrpsptrrwstrs? 1/2040 What is prob of sequence mrr when three letters picked without replacement from rrusum? 1/60 What is prob of sequence ddyd when four letters picked without replacement from dddyygd? 2/35 Calculate prob of sequence zz when two letters picked without replacement from {k: 11, z: 5}. 1/12 What is prob of sequence dzy when three letters picked without replacement from {h: 3, x: 2, z: 6, d: 1, y: 1}? 1/286 Calculate prob of sequence wddd when four letters picked without replacement from ddwdww. 1/20 Calculate prob of sequence ct when two letters picked without replacement from vccgtvv. 1/21 Calculate prob of sequence stpp when four letters picked without replacement from pttttptsispts. 9/1430 Three letters picked without replacement from ktttkirrctir. Give prob of sequence rct. 1/110 Calculate prob of sequence rvpc when four letters picked without replacement from ecopvrr. 1/420 What is prob of sequence gx when two letters picked without replacement from xggxxxhxxx? 7/45 Three letters picked without replacement from {d: 1, e: 4, j: 6}. What is prob of sequence jej? 4/33 Calculate prob of sequence dw when two letters picked without replacement from uwdwwuuuduwuwuuuuwu. 2/57 Calculate prob of sequence jy when two letters picked without replacement from {j: 8, y: 5}. 10/39 Calculate prob of sequence yzu when three letters picked without replacement from {x: 6, y: 1, p: 3, u: 3, z: 5}. 5/1632 Calculate prob of sequence soql when four letters picked without replacement from {h: 1, s: 4, l: 3, q: 10, o: 1}. 5/3876 What is prob of sequence po when two letters picked without replacement from oooooooooooooyoopo? 8/153 Three letters picked without replacement from xxxxxqkxx. What is prob of sequence xxx? 5/12 What is prob of sequence ll when two letters picked without replacement from ipkpwwwllwp? 1/55 Calculate prob of sequence zsjz when four letters picked without replacement from {z: 2, s: 2, y: 2, j: 4}. 1/315 Four letters picked without replacement from {q: 1, k: 2, j: 1, v: 1, u: 11, l: 3}. What is prob of sequence lvkl? 1/7752 What is prob of sequence mrh when three letters picked without replacement from mahrrmmmhjmmmrmma? 9/680 What is prob of sequence hh when two letters picked without replacement from hhhfffhfffhff? 5/39 Calculate prob of sequence vpev when four letters picked without replacement from mvyypevvgyvvmymvvm. 7/12240 What is prob of sequence eq when two letters picked without replacement from {q: 5, e: 13}? 65/306 Three letters picked without replacement from xqqxqqqqqxxaeetqq. What is prob of sequence qtx? 3/340 What is prob of sequence hrrr when four letters picked without replacement from {h: 9, r: 3}? 1/220 Two letters picked without replacement from {u: 1, r: 4, j: 3, k: 2, m: 1}. Give prob of sequence kj. 3/55 What is prob of sequence mqe when three letters picked without replacement from {h: 1, o: 1, m: 3, q: 3, e: 3, z: 2}? 9/572 Four letters picked without replacement from {m: 6, l: 2, x: 4}. What is prob of sequence lxlm? 2/495 Calculate prob of sequence ccq when three letters picked without replacement from cqcccqccccqccqqc. 55/336 Two letters picked without replacement from niddndnvdttiintbn. Give prob of sequence db. 1/68 Two letters picked without replacement from {k: 1, c: 7, s: 5}. What is prob of sequence sc? 35/156 Four letters picked without replacement from {n: 1, p: 2, i: 9, v: 6}. Give prob of sequence iviv. 1/34 Four letters picked without replacement from ydxdxsxsyyxxxstty. What is prob of sequence ydss? 1/1190 What is prob of sequence pmb when three letters picked without replacement from {p: 1, b: 1, j: 1, m: 1, x: 1}? 1/60 Four letters picked without replacement from vvnvannvvvafj. Give prob of sequence vjfn. 3/2860 Calculate prob of sequence nil when three letters picked without replacement from {s: 3, m: 1, g: 7, l: 2, i: 3, n: 3}. 1/323 Four letters picked without replacement from pcvpppvjcpgvgpcjpjp. Give prob of sequence vjvv. 1/5168 Calculate prob of sequence kbnz when four letters picked without replacement from nkznknnznnknnnkbnnk. 55/46512 What is prob of sequence iclx when four letters picked without replacement from {h: 1, c: 5, i: 3, l: 1, x: 2}? 1/396 Calculate prob of sequence fk when two letters picked without replacement from omofoomomokoofoom. 1/136 Three letters picked without replacement from zityx. Give prob of sequence yti. 1/60 Two letters picked without replacement from {z: 2, r: 1}. What is prob of sequence zz? 1/3 Calculate prob of sequence gq when two letters picked without replacement from negqi. 1/20 Three letters picked without replacement from {k: 1, e: 9, a: 1, g: 3}. What is prob of sequence eag? 9/728 Three letters picked without replacement from wbwtxbbxbbbt. What is prob of sequence wxt? 1/165 Calculate prob of sequence gqg when three letters picked without replacement from {q: 2, g: 2}. 1/6 Calculate prob of sequence vwtt when four letters picked without replacement from vtjtvwivtjt. 1/220 What is prob of sequence ar when two letters picked without replacement from dqdoard? 1/42 Two letters picked without replacement from {y: 14, c: 4}. Give prob of sequence cy. 28/153 Calculate prob of sequence qqq when three letters picked without replacement from xqxqqqqxqqqqqxxqxq. 55/204 Four letters picked without replacement from {t: 8, v: 2, o: 8}. What is prob of sequence otot? 98/2295 Two letters picked without replacement from kkkkkgkk. Give prob of sequence kg. 1/8 What is prob of sequence uq when two letters picked without replacement from {q: 1, o: 1, p: 1, n: 3, d: 2, u: 3}? 3/110 What is prob of sequence nfv when three letters picked without replacement from fnfvnhg? 2/105 Calculate prob of sequence hy when two letters picked without replacement from {d: 3, h: 3, a: 1, y: 1, m: 2}. 1/30 Four letters picked without replacement from {b: 5, h: 1, v: 5}. What is prob of sequence vbvh? 5/396 Four letters picked without replacement from jjjjjmmjjjjj. What is prob of sequence jjmm? 1/66 What is prob of sequence www when three letters picked without replacement from buuwuuuuwwuuwuuwuuuu? 1/114 Three letters picked without replacement from rrrii. What is prob of sequence iir? 1/10 What is prob of sequence vvs when three letters picked without replacement from pvsuuupusuuqqsusuqvs? 1/684 Calculate prob of sequence zpl when three letters picked without replacement from {v: 2, p: 2, l: 1, u: 4, a: 2, z: 3}. 1/364 Calculate prob of sequence ekk when three letters picked without replacement from {r: 2, k: 5, u: 1, z: 7, e: 4, j: 1}. 2/171 Three letters picked without replacement from {t: 3, r: 3, u: 1, n: 6}. Give prob of sequence utt. 1/286 Two letters picked without replacement from {a: 3, o: 10, e: 2, r: 1}. Give prob of sequence er. 1/120 What is prob of sequence ml when two letters picked without replacement from wyjmyyjlyw? 1/90 Three letters picked without replacement from {o: 5, f: 1, s: 3}. What is prob of sequence fss? 1/84 Calculate prob of sequence as when two letters picked without replacement from {x: 4, s: 8, a: 4}. 2/15 What is prob of sequence fb when two letters picked without replacement from btctffttttcffttd? 1/60 Calculate prob of sequence lll when three letters picked without replacement from {l: 6}. 1 What is prob of sequence ey when two letters picked without replacement from yyyeyyeyyyyye	{ "pile_set_name": "DM Mathematics" }
Let v = -60 + 59.5. Let y = -29 + 28.7. Which is the second biggest value? (a) 6 (b) y (c) -5 (d) v b Let y(l) = -2l3 + 3l*2 + 20l + 5. Let o be y(4). Suppose 5 = 3f - 4. Which is the second smallest value? (a) -5 (b) o (c) -4/5 (d) f c Let x = 20 + -161/8. Let i be (4/(-19))/((-2)/(-1)). Suppose -t = 2m + 1, -9 = -3m - 3t - 15. What is the third biggest value in i, x, m? x Let d be ((-1)/(-3))/(7/6). Let y be (-1)/(-4) + ((-45)/(-4))/(-5). Let q be (-30)/15y/(4/5). What is the biggest value in d, q, -0.5? q Let j be (-12)/138 + (-288)/(-138). Let l = -6 - -10. What is the biggest value in -4, j, l, -2? l Let m = 45 - 28. Suppose -4o - 14 + 62 = 0. Let l = m - o. Which is the smallest value? (a) -5 (b) l (c) -3/8 a Let k = 91/107 - 14106/18725. Let o = 6/25 - k. Which is the second biggest value? (a) -9 (b) -2 (c) o b Let u(q) = -6q - 10. Let k be u(-3). Suppose 20g = 22g + k. Which is the second smallest value? (a) -3 (b) g (c) -0.08 a Let o = -0.4 + 0.23. Let f = -0.32 - o. What is the third smallest value in -0.1, -0.5, f? -0.1 Let w be 0 - (-3 + -1 + 4)/(-1). Suppose -4x - 2t + 19 - 3 = w, 0 = x - 3t + 10. Which is the third biggest value? (a) 5 (b) -2/15 (c) -5 (d) x b Suppose 8 = -41k + 37k. Let v be 1 - (1 - (11 - 2)). Which is the biggest value? (a) k (b) -5 (c) v c Let j = 743/3 - 248. What is the third smallest value in -9/5, j, -0.2? -0.2 Let n = 1086 + -33671/31. Which is the fourth biggest value? (a) 4/3 (b) n (c) 1 (d) 2 b Let p = 1 - 11/13. Let d = -68 - -73. Which is the biggest value? (a) -0.07 (b) p (c) d c Let w = -0.159 + 0.089. Which is the third biggest value? (a) -0.5 (b) 3/5 (c) w a Let r = -24.6 + 25. Let w = -9 - -9. Which is the second biggest value? (a) 1/15 (b) w (c) r a Let q(m) = m - 14. Let r be q(15). Let v = 0 + 7. Suppose -6l = r - v. Which is the smallest value? (a) -4 (b) 0.2 (c) l a Suppose 5x = -f - 7, f - 4f + 11 = -x. Let s be 2/1 - 182/98. Which is the second biggest value? (a) s (b) f (c) 5 (d) 2/13 b Let t be 3 - (12-2)/4. Suppose -2 = 11x - tx. Which is the second smallest value? (a) x (b) -0.1 (c) 1/2 b Let y = -0.0211 + 0.1211. What is the third biggest value in 2, -53, y? -53 Suppose 0 = 121k - 119k - 4. Which is the biggest value? (a) -0.5 (b) -0.006 (c) 1/6 (d) k d Let x = -0.1101 + -0.1899. What is the third biggest value in x, 2/53, 2, -2? x Let w(u) = u*3 - 4u*2 + 3u - 3. Let m be w(2). Which is the third biggest value? (a) 0.08 (b) 1/9 (c) m (d) 3 a Let t be -3 + -1233/(-117). Let a = -49 - -50. What is the smallest value in -1/5, a, t, 0.1? -1/5 Let n = -4/43 + 157/301. Let z = -0.7 - -10.4. Let m = 6.7 - z. What is the smallest value in m, 0, n? m Let w = 221 + -223. Which is the third smallest value? (a) w (b) 12 (c) -4 b Let m = -59.143 - -0.143. Let o = -57 - m. Let b be (4/(-95))/(4/10). What is the second biggest value in 0.2, b, o? 0.2 Let w be 5 - (8/(-4) + -1). Let x be ((-2)/(-12))/(-4 - (-18)/w). Which is the third biggest value? (a) 1/4 (b) 4 (c) x c Let x = -78.68 - 3.82. Let k = 82 + x. Let i = 3 - 2.8. What is the third smallest value in k, i, 1? 1 Let i = 253 + -248. Which is the third biggest value? (a) 1/11 (b) -20 (c) i b Let c = -9697 - -9697. Suppose -9 = -4m - 3v + 8, -4m = -3v + 1. Let x be (-1)/(-11)(-2)/m. What is the smallest value in -0.3, c, x? -0.3 Let k = 1093.4 + -1092. Which is the fourth biggest value? (a) k (b) -0.5 (c) 2/9 (d) -0.3 b Let n be 2/(-7) - 30/(-7). Let m(t) = -t*3 + 5t*2 + 13t - 49. Let y be m(6). Let v = y + n. What is the third biggest value in 0.2, 0, v? v Let o = -38 - -37.6. Let u = 11 - 10.89. Let q = -4.89 - u. What is the third smallest value in q, -1, o? o Let g = -0.212 + -0.028. Let m = g + 0.04. Suppose 0j = j - 4. Which is the smallest value? (a) m (b) -5 (c) j b Let b be (-2)/((-40)/(-15))(-24)/3. What is the smallest value in 0.05, b, 0.5? 0.05 Let t be (-1 + (-5)/(-2))(59 - 61). Which is the biggest value? (a) t (b) -2 (c) 0 (d) -76 c Let k(g) = -3g + 2g2 + 5 - g - 3g. Let m be k(4). Let p be ((-2)/(-4)m)/(-12). What is the third smallest value in -5, 0.5, p? 0.5 Let h = -170.9 - -171. What is the biggest value in 0.5, h, 56, 3? 56 Let p be -2 - ((-18)/(-4))/(-3). Suppose 14d - 11d + 327 = 0. Let z = d - -105. Which is the third biggest value? (a) z (b) p (c) 0.04 a Let w be 4/(-10) - 68/(-70). Suppose 28p = 3k + 32p + 7, 4k - 1 = 5p. Which is the second biggest value? (a) w (b) 1 (c) 0.4 (d) k a Let i = 0.263 - -97.737. What is the smallest value in -4, i, 2/7, 0.1? -4 Let s = 5.541 + 0.059. Let o = 6 - s. Let c = 3 - 4. What is the second biggest value in o, c, -1/3? -1/3 Let k = -1.02 + 0.62. Which is the second biggest value? (a) 100 (b) k (c) -2 b Let k = 0.1 - 0.1. Let n = -2280 - -9117/4. Which is the fourth smallest value? (a) -0.3 (b) 1 (c) n (d) k b Let i(s) = -s*2 + 6s + 2. Let b be i(7). Suppose -27 = 8x - 17x. Suppose -4d - 5p - 20 = -7d, 12 = 4d - xp. What is the smallest value in d, b, -0.5? b Let l = -42.29 + 0.29. Let y = l + 42.5. Which is the third smallest value? (a) 0.4 (b) y (c) 0.7 c Let u = -17.96 + 19. Let n = 0.02 + -0.06. Let m = n + u. Which is the biggest value? (a) m (b) -2/9 (c) -4 a Suppose 19 = 2w - 9y - 10, -4w - 4y = 8. Which is the third smallest value? (a) w (b) -4 (c) -2 (d) 0.4 d Let c be ((-91)/(-42))/((-5)/903). What is the second biggest value in c, -0.13, -1/4? -1/4 Let t = 6.12 + -5.92. Which is the fourth smallest value? (a) 2 (b) t (c) 8 (d) 4 c Let k = -0.1 + -0.9. Let j = -2 - -2.1. Let w = j - -0.3. What is the smallest value in -0.05, k, w? k Let d = -8 - -25. Let i = -31.4 + 46.4. Let f = i - d. Which is the third biggest value? (a) -5 (b) f (c) 5/2 a Let h = 101 + -101.9. Let m = 78/11 + -524/77. What is the second biggest value in h, m, 5? m Let q be 6/(-8) - ((-121686)/6552)/17. Let z = q + 5/42. Which is the biggest value? (a) -3/4 (b) z (c) 0.4 b Let w = 15 - 14.6. Let g be 40/6 + 2/(-3). Let r = g + -13/2. What is the third biggest value in w, 0.3, r? r Let v = 371 - 366. Which is the second smallest value? (a) 0.2 (b) v (c) -7 a Let f = -4.28 - 21.72. Which is the second biggest value? (a) 0.3 (b) f (c) -10 c Let j = -14 - -20. Let r = j - 6.3. Let w = 0.7 + -0.1. Which is the biggest value? (a) w (b) 0.5 (c) r a Let x = 5 + -6.6. Let w = 6.6 + x. Let n = -118 + 117.8. Which is the biggest value? (a) n (b) 0.5 (c) w c Let b be -7 + 9(-47)/(-60). What is the second smallest value in 4, b, -1? b Let v = 8 + -7. Let u = -2.4 + 2. Which is the smallest value? (a) 0.4 (b) -4 (c) u (d) v b Let m = -3 + 0. Let d = -2.32 - 1.08. Let h = 2.6 + d. What is the second smallest value in 3/4, h, m? h Let z = -268 + 270. What is the biggest value in -3/4, z, 1? z Let b be (2/6)/(2/30). Suppose -18 = 4w - 10w. Suppose -w + 0 = 3t. What is the smallest value in -0.4, t, b? t Let u(t) = -3t + 20. Let c be u(6). Suppose 3z + cr = 5r + 12, 16 = 4z + 4r. Let s = 31/3 - 10. What is the second biggest value in z, s, -0.3? s Let u = 80/9 + -26/3. Let o = 0.31 + -0.11. Which is the third smallest value? (a) o (b) u (c) 0.4 c Let p = -17 - -103/6. Which is the third biggest value? (a) 1 (b) -2 (c) p (d) -4/9 d Let i = 111 - 113. Which is the second biggest value? (a) -0.5 (b) 2 (c) 4 (d) i b Let c be (-4 - -8)-1 - -2. Let b be 2/1(-1)/c. What is the third smallest value in 4, b, 0? 4 Let m = -30.8 + 30.1. Let y = -0.3 - -2.3. Which is the biggest value? (a) m (b) 1 (c) y c Let z(a) = a*3 + 6a*2 + 14a + 14. Let n be z(-2). What is the third biggest value in 0.2, -2/117, n, -1/2? -2/117 Let w = -0.432 - -0.632. Which is the biggest value? (a) 1 (b) w (c) -0.217 a Let s = -7 - -6.8. Let f(m) = -10m + 22. Let v be f(4). Let p be 19/36 + v/(-81). Which is the second biggest value? (a) -4 (b) s (c) p b Let x(k) = k3 - 5k*2 + k - 5. Let g be x(5). Let f = -66 - -67. Which is the fourth smallest value? (a) g (b) -0.1 (c) 12 (d) f c Let h = -11 + 18. Suppose -4k + 111 = -729. Let r be (-125)/k + 9/21. What is the smallest value in -2, r, h? -2 Let k = 17 + -16.	{ "pile_set_name": "DM Mathematics" }
w*2 + 94w - 19264 wrt w. 66206406 What is the first derivative of -216696069k2 + 189387131? -433392138k What is the derivative of -274026497o3t + 13o3 - 3o*2 - 15o - 3486 wrt t? -274026497o3 What is the derivative of -4931928p*2y + p*2 - 30py - 93399499p wrt y? -4931928p2 - 30p Find the second derivative of 24k3 + 3988841k*2 - 10k - 5512980 wrt k. 144k + 7977682 What is the second derivative of -10576561a*3 - 550109a? -63459366a Find the third derivative of -19224782t*3y + 3t2 - 35245ty wrt t. -115348692y What is the second derivative of 1297447ky*2 - 993554ky + 2y*2 + 6y wrt y? 2594894k + 4 What is the second derivative of -229994o*3z - o*3 + 32o*2 - 693oz + 2o - 154z wrt o? -1379964oz - 6o + 64 Differentiate -2664862l + 3016467 wrt l. -2664862 What is the second derivative of 3i*3 + 120363i*2 + 172i - 5053? 18i + 240726 What is the derivative of -31g*2 - 55433g - 2949066? -62g - 55433 What is the second derivative of 520m*3 + 123543m*2 - 190553579m - 1? 3120m + 247086 What is the derivative of 90n*4 + 465n3 + n2 + 3n - 15397520? 360n*3 + 1395n*2 + 2n + 3 What is the second derivative of 1422b3t*2 + 103b*3t - 29b2t - 3b2 - 4738bt4 - 2bt - 2b - 2 wrt t? 2844b3 - 56856bt2 What is the derivative of -1165480o*2 + 17363222 wrt o? -2330960o Find the third derivative of -26h5 - 2034237h*4 + 77028460h*2 wrt h. -1560h*2 - 48821688h What is the second derivative of -15607067p2 - 7408p - 16541? -31214134 Differentiate 184951569l3ry - 2l*3y - 886l3 - 10l*2y - 188y with respect to r. 184951569l*3y Find the second derivative of -1057x4 - 592x3 - x2 + 47145643x. -12684x*2 - 3552x - 2 What is the second derivative of 126125c5ly - 15c*2ly - 4cly + 21cy - 1158l wrt c? 2522500c*3ly - 30ly What is the second derivative of -3596w*5 - 178w*4 + 6283884w wrt w? -71920w3 - 2136w*2 What is the derivative of -7h*3jm + 10h*3m + 973164jm*2 + 340787m*2 wrt j? -7h*3m + 973164m2 What is the first derivative of -16725681n*4 - 16227924? -66902724n*3 Find the third derivative of -4d*2s3 - d2s2 - 17d*2 - 643772ds3 + d - 37504s wrt s. -24d2 - 3862632d What is the third derivative of -1719341j3 - 7j*2 - 502j + 699? -10316046 What is the derivative of 9428390l - 11274853 wrt l? 9428390 What is the third derivative of -819k*6 + 243991k*3 - 5k*2 - 13k + 9106? -98280k3 + 1463946 Differentiate -222142994h*2 - 404310226. -444285988h Find the first derivative of -10140wz*2 - 123wz + 1644094z*2 wrt w. -10140z*2 - 123z Find the first derivative of -30980877aj*3p - 3a - j3 - 1660833j wrt p. -30980877aj*3 What is the second derivative of -1372522d*3 + 64d*2 - 2d - 12759389? -8235132d + 128 Find the second derivative of 704uz3 + 3uz2 - 492uz + 782z3 + z2 - 41001 wrt z. 4224uz + 6u + 4692z + 2 Find the second derivative of 8927739w3 + 235682660w + 2 wrt w. 53566434w Find the first derivative of 129118612q*2 - 23856981 wrt q. 258237224q Differentiate -34500847fn + 5457572f wrt n. -34500847f What is the first derivative of 2f2h + 13f2r - 7132367fhr + fhw2 - 11201frw*2 + 2fw2 - rw*2 - 3 wrt h? 2f*2 - 7132367fr + fw*2 Find the second derivative of 20242o*2s*2 + 220o*2 + os*2 + 11279os - 2s*2 - 13s + 1 wrt o. 40484s2 + 440 What is the third derivative of 148lp3w - 729lw*3 - 4lw2 - 2lw - 11250p*3w*3 - pw*2 - 569p wrt w? -4374l - 67500p3 Find the first derivative of -d2r + 2d*2 + 2dr - 3433d + 12178944r wrt d. -2dr + 4d + 2r - 3433 Differentiate 1002747357a*3 - 402078037. 3008242071a*2 What is the third derivative of -2720c*5t*2 + 631c*5 + 505873c2 - t2 wrt c? -163200c2t*2 + 37860c*2 What is the second derivative of 2q5 + q3 - 1645113q2 + 7283450q wrt q? 40q3 + 6q - 3290226 What is the third derivative of -51791c5 - 1477c*3 - 23c*2 - 591502c wrt c? -3107460c2 - 8862 What is the second derivative of -231172835g*2n*2 + 3g*2 + 2gn2 - 67003248gn + 2g wrt g? -462345670n2 + 6 What is the first derivative of 18180975cr3 + 2363782c wrt r? 54542925cr2 Differentiate -g2 + 387315gl - 6l - 4464 with respect to g. -2g + 387315l What is the second derivative of -121j*2x*2 - 9628j*2x + 3j2 + 36jx2 - 2j + x*2 - x + 31116 wrt j? -242x*2 - 19256x + 6 What is the third derivative of -13671723l3n*3 + 2l*3 - 2ln2 - 1064986l wrt n? -82030338l3 Find the third derivative of 2hpq*3 + hpq - 37hq3 + hq - 254h + 49352pq3 - 23pq2 - 163p wrt q. 12hp - 222h + 296112p Find the second derivative of -1242a4 + 55a*3 - 5a*2 - 5670033a wrt a. -14904a2 + 330a - 10 Find the second derivative of -8891361f4 + f + 24722500. -106696332f*2 What is the derivative of 52136d*4 + 3d*3 - 6905370? 208544d*3 + 9d*2 What is the second derivative of -475080226c*2m + 4c - 1985397m + 2 wrt c? -950160452m Find the third derivative of 359h*3i*3w + 5018h3iw + 4h*3w - 13940h2i*3w + 2hi*2w - 2hi*2 + hi wrt i. 2154h3w - 83640h2w What is the second derivative of -9022834z3 - 2z*2 - 3570681z? -54137004z - 4 Find the second derivative of 7107229x*2 - 28349987x. 14214458 Find the third derivative of 6191a4 - 55a*3 - 11421417a*2 wrt a. 148584a - 330 Differentiate -9558j2z - 247j2 - 19z + 874591 with respect to j. -19116jz - 494j Find the second derivative of 27266570a*3b*2s2 - a3bs*2 + 5a*2b - a*2 - 54ab + 2bs2 + 288bs + 3s*2 wrt b. 54533140a*3s*2 Find the second derivative of -13921378o*3 + 37129465o wrt o. -83528268o Differentiate 690557065n + 857193751. 690557065 Find the second derivative of -5l2u + 38184l2 - 11lu - 103383l + u wrt l. -10u + 76368 Find the second derivative of -36k*3 + 234447k*2 - 42038k + 117 wrt k. -216k + 468894 What is the third derivative of 953582g*6t + 5g5t + 2134951g2t - 3gt wrt g? 114429840g3t + 300g2t Differentiate 1257238793z4 + 4008015 wrt z. 5028955172z*3 What is the first derivative of -108s*4 + 4801s + 6375909 wrt s? -432s3 + 4801 What is the third derivative of -29h*4 + 1132071h3 + h2 + 7855h + 1750? -696h + 6792426 What is the second derivative of 37313723o2 + 274458909o wrt o? 74627446 What is the third derivative of 1695289f5 + 6f*3 + 14131812f*2 wrt f? 101717340f*2 + 36 Find the third derivative of 44381290k*3 + 13723355k*2. 266287740 What is the second derivative of 2194u*5 - 11u*4 - 193u*2 - 50451229u wrt u? 43880u3 - 132u*2 - 386 What is the second derivative of 7086738t*4 + 5283608t? 85040856t2 What is the third derivative of 23555468f*5 + 11520701f*2? 1413328080f*2 Differentiate -25cgh + 3cg - 2ch - 2799733c - 291254gh - 2g - 3h - 3 wrt h. -25cg - 2c - 291254g - 3 What is the third derivative of 1317808i*3s2 - i3sv + 266i2s*2v + 77i2sv + 2s*2v + 25s wrt i? 7906848s*2 - 6sv Find the third derivative of 2429292p*3 + 32p*2 + 614p - 16. 14575752 Find the third derivative of 3284d3p*2rw + 1947d*3rw + 17d*2p*2rw - d2p*2 - 427d*2rw + d2r - 5dp*2 - 2dw + 2r wrt d. 19704p2rw + 11682rw What is the third derivative of -989241952s*3t*2 + 2s*2t*2 + 2s*2t - 244s - 12258t + 2 wrt s? -5935451712t2 Find the second derivative of -33515j*3s*5 - 39j*3s + 10620j3 + 14s*5 wrt s. -670300j*3s*3 + 280s*3 What is the derivative of 330h*2p + 11h2 + 56hp - 14h - 18300258p wrt h? 660hp + 22h + 56p - 14 Find the first derivative of 11125358b*2 - 14426020 wrt b. 22250716b What is the second derivative of -26306334h4 + 6760776h - 4? -315676008h2 What is the third derivative of -940a5 + a4 - 7385a3 - 3659459a*2? -56400a*2 + 24a - 44310 Find the third derivative of -14660747n5 - n3 + 40740950n*2 wrt n. -879644820n**	{ "pile_set_name": "DM Mathematics" }
at is prob of sequence bu when two letters picked without replacement from {b: 1, x: 1, h: 2, u: 1, d: 2}? 1/42 Four letters picked without replacement from kxkxkkkxkkxxkk. What is prob of sequence kxkk? 15/143 Four letters picked without replacement from {u: 7, f: 2}. Give prob of sequence fuuf. 1/36 What is prob of sequence fvqv when four letters picked without replacement from qfvqqqvv? 1/70 What is prob of sequence wwaw when four letters picked without replacement from {t: 2, a: 6, w: 5}? 3/143 Calculate prob of sequence sjss when four letters picked without replacement from {s: 1, u: 4, j: 2}. 0 Calculate prob of sequence dv when two letters picked without replacement from {g: 2, z: 1, v: 6, h: 1, d: 2, u: 5}. 3/68 Calculate prob of sequence sszs when four letters picked without replacement from zszzzzszzzzzzsszzz. 7/1530 Calculate prob of sequence wjpj when four letters picked without replacement from {j: 3, w: 3, p: 2}. 3/140 Calculate prob of sequence zvaz when four letters picked without replacement from zavz. 1/12 What is prob of sequence zj when two letters picked without replacement from peezjbz? 1/21 Two letters picked without replacement from {q: 3, b: 2}. What is prob of sequence qq? 3/10 Three letters picked without replacement from {f: 15, w: 3}. Give prob of sequence ffw. 35/272 Two letters picked without replacement from xcttcwtwuvcccw. What is prob of sequence uc? 5/182 Three letters picked without replacement from {c: 1, m: 4, h: 6, i: 1, n: 3}. What is prob of sequence mcn? 2/455 Three letters picked without replacement from {i: 1, q: 2, a: 2, x: 1, f: 2, z: 1}. Give prob of sequence xqi. 1/252 What is prob of sequence qbff when four letters picked without replacement from {b: 8, r: 5, q: 1, f: 3, x: 2}? 1/1938 What is prob of sequence fu when two letters picked without replacement from {m: 1, f: 1, u: 1, a: 1, n: 3}? 1/42 Four letters picked without replacement from {j: 7, c: 9}. What is prob of sequence jjcj? 9/208 What is prob of sequence gw when two letters picked without replacement from {u: 1, w: 1, s: 2, a: 1, g: 2, f: 1}? 1/28 What is prob of sequence xqxx when four letters picked without replacement from xxxqxxxxq? 5/36 What is prob of sequence xqv when three letters picked without replacement from qvvqqvqvqxqvvqqqqvq? 77/5814 Four letters picked without replacement from mxmmmmxmxmmxmmmmxm. Give prob of sequence mxxx. 13/1224 What is prob of sequence kkkk when four letters picked without replacement from {k: 9}? 1 Two letters picked without replacement from {b: 9}. Give prob of sequence bb. 1 What is prob of sequence sksi when four letters picked without replacement from skshi? 1/60 Two letters picked without replacement from rrgmqggmqmqqq. What is prob of sequence qq? 5/39 Four letters picked without replacement from okkkokkk. Give prob of sequence kkkk. 3/14 Two letters picked without replacement from {d: 1, z: 4, o: 1, y: 2, j: 1}. Give prob of sequence dj. 1/72 What is prob of sequence jjjv when four letters picked without replacement from jvjjvjjjjj? 2/15 Calculate prob of sequence uru when three letters picked without replacement from {c: 1, a: 3, r: 9, v: 4, u: 2}. 1/323 Calculate prob of sequence qpp when three letters picked without replacement from jjpjppjpqjpqp. 5/143 Two letters picked without replacement from {d: 2, w: 1, o: 2, u: 9}. Give prob of sequence dw. 1/91 Three letters picked without replacement from {b: 2, e: 3, x: 4, o: 1, t: 8, m: 2}. What is prob of sequence tot? 7/855 Three letters picked without replacement from {n: 1, k: 2, f: 1, d: 2, q: 4, o: 2}. Give prob of sequence ono. 1/660 Four letters picked without replacement from izzzzzzzzzq. What is prob of sequence zziq? 1/110 Calculate prob of sequence hx when two letters picked without replacement from hsrgxsggxss. 1/55 Calculate prob of sequence swqx when four letters picked without replacement from {x: 2, w: 3, s: 12, q: 1, t: 1}. 1/1292 What is prob of sequence vnd when three letters picked without replacement from nvvvvdvvvndd? 7/220 Four letters picked without replacement from {z: 2, t: 2, p: 1}. Give prob of sequence tzpz. 1/30 Four letters picked without replacement from xxsllclsxssll. Give prob of sequence slss. 1/143 Three letters picked without replacement from {e: 6, o: 4, v: 7}. Give prob of sequence vee. 7/136 Three letters picked without replacement from utduvpt. Give prob of sequence put. 2/105 Calculate prob of sequence nmp when three letters picked without replacement from mpfwntpw. 1/168 Two letters picked without replacement from yiuiiyy. Give prob of sequence yi. 3/14 Calculate prob of sequence ubbu when four letters picked without replacement from {u: 2, b: 7, m: 11}. 7/9690 What is prob of sequence wkew when four letters picked without replacement from {u: 6, w: 5, e: 3, k: 1}? 1/546 Two letters picked without replacement from ncnccccnncnnn. Give prob of sequence nn. 7/26 Calculate prob of sequence dnlf when four letters picked without replacement from ndddffdldfdffd. 5/3432 Calculate prob of sequence mrdd when four letters picked without replacement from rmsrdmsdmdrmrrmsm. 3/952 What is prob of sequence mc when two letters picked without replacement from {b: 2, m: 2, r: 1, d: 5, c: 1, y: 5}? 1/120 Calculate prob of sequence eece when four letters picked without replacement from cccceccececc. 1/220 Three letters picked without replacement from kkknkkkkrkkkkk. What is prob of sequence krn? 1/182 What is prob of sequence mycm when four letters picked without replacement from {m: 5, c: 2, y: 1, b: 1}? 5/378 Calculate prob of sequence cicx when four letters picked without replacement from liiclccllxlllc. 1/1001 Two letters picked without replacement from mmiiiim. Give prob of sequence ii. 2/7 Calculate prob of sequence uug when three letters picked without replacement from {h: 7, u: 4, g: 6, k: 1}. 1/68 Calculate prob of sequence mmd when three letters picked without replacement from {m: 11, d: 2}. 5/39 Four letters picked without replacement from wwbuwbufufwwbbfbufs. Give prob of sequence buuw. 25/7752 What is prob of sequence ri when two letters picked without replacement from {i: 1, e: 1, l: 1, r: 1, m: 5}? 1/72 Calculate prob of sequence jej when three letters picked without replacement from jjjhe. 1/10 Calculate prob of sequence lxr when three letters picked without replacement from {j: 2, x: 5, l: 6, r: 1, y: 2}. 1/112 Calculate prob of sequence okx when three letters picked without replacement from oknxvznv. 1/336 What is prob of sequence dwse when four letters picked without replacement from {e: 4, w: 9, d: 2, m: 1, s: 3}? 3/1292 What is prob of sequence tt when two letters picked without replacement from {t: 10}? 1 What is prob of sequence xxsv when four letters picked without replacement from {x: 5, w: 2, s: 2, e: 2, v: 2, q: 5}? 1/918 Three letters picked without replacement from qlqqqlqqrrq. What is prob of sequence lrr? 2/495 Calculate prob of sequence jj when two letters picked without replacement from yjjyjyyjjyjj. 7/22 Calculate prob of sequence ii when two letters picked without replacement from {o: 10, i: 10}. 9/38 Two letters picked without replacement from rrzrrrrrurr. Give prob of sequence uu. 0 Calculate prob of sequence rtir when four letters picked without replacement from txrxxrtiuxuxxttrut. 1/2448 Four letters picked without replacement from {j: 1, z: 2, b: 1, u: 2, p: 3, w: 6}. Give prob of sequence pjwz. 1/910 What is prob of sequence ej when two letters picked without replacement from zjxjxzjjexjjjz? 1/26 Calculate prob of sequence mv when two letters picked without replacement from uvouugmuggvh. 1/66 Calculate prob of sequence ps when two letters picked without replacement from {s: 3, o: 8, a: 3, c: 3, p: 2}. 1/57 Two letters picked without replacement from {q: 1, v: 2, s: 3, i: 4}. Give prob of sequence iv. 4/45 Three letters picked without replacement from ada. What is prob of sequence aad? 1/3 What is prob of sequence xsss when four letters picked without replacement from {s: 16, x: 2}? 14/153 Three letters picked without replacement from {r: 9}. Give prob of sequence rrr. 1 Four letters picked without replacement from {y: 1, d: 2, h: 2, u: 1, b: 1, m: 1}. Give prob of sequence d	{ "pile_set_name": "DM Mathematics" }
-1, w Let s(u) be the first derivative of -2u2 + 3u - 1. Let t be s(2). Sort t, -4, -2 in increasing order. t, -4, -2 Let q(g) = 2g2 - 10g. Let i be q(5). Sort -4, -2, i in ascending order. -4, -2, i Let h = 3 + 1. Let i(n) = -2n + 5. Let t be i(h). Let g be 4-11/(-2). Put t, 0, g in ascending order. t, 0, g Let m(s) = -s - 4. Let c be m(-6). Suppose -cg = 3g - 10. Let w = 0.17 + 0.33. Sort g, w, 2/9. 2/9, w, g Let k = -2.4 - -2. Let g = -12 - -24. Let t = 8 - g. Put k, t, -1 in decreasing order. k, -1, t Let g be ((-6)/4)/(3/(-16)). Let o = g - 12. Sort 1, o, 2 in increasing order. o, 1, 2 Let p(g) = -2g - 5. Let m be p(-2). Suppose -4j = -5d + 26, 0j + d = j + 6. Put m, j, 0 in decreasing order. 0, m, j Let f be -14 - 1 - (0 + 1). Let o be 4/(-6)3/(-1). Let u be 9/fo/(-3). Put -5/2, 0.3, u in decreasing order. u, 0.3, -5/2 Let y = 0.01 + 8.99. Let k = -8 + y. Put k, -1, -0.5 in descending order. k, -0.5, -1 Suppose -4b = -5b. Sort -3, b, 2 in decreasing order. 2, b, -3 Let i be 2/9 - (-16)/9. Let l = i - 3. Let t = -0.6 + 0.7. Sort -2/9, t, l in decreasing order. t, -2/9, l Suppose s - 1 = 5t - 13, -3s - 12 = -3t. Put 2, s, -6 in increasing order. -6, s, 2 Let d = 273017/8 + -34069. Let h = 58 - d. Let j = -40/13 - -334/117. Put j, 4, h in ascending order. j, h, 4 Suppose -2b + 2m - 12 = 0, -5b - 5m = 11 + 9. Sort 0, b, 4 in descending order. 4, 0, b Suppose 2o + 5g = 25, 4o + 5 = -o + g. Sort 3, -2, o, -4 in descending order. 3, o, -2, -4 Let r = -0.4 + 0.1. Let a = -0.12 - -5.12. Let c = -5 + a. Sort 5, r, c in ascending order. r, c, 5 Let t = 0.44 - 0.84. Sort -0.1, t, -1/2. -1/2, t, -0.1 Let n = -11 + 11.1. Sort n, -0.4, 2 in ascending order. -0.4, n, 2 Let z = -0.27 - 1.73. Let b = 1.5 + z. Sort 1, b, 4/5. b, 4/5, 1 Let j be (-7)/((-21)/(-12)) - -3. Sort 3, -5, j, 2. -5, j, 2, 3 Let s = 3 - -1.1. Let w = s - 0.1. Let z = -74 + 76. Sort w, z, -0.3 in descending order. w, z, -0.3 Let g = 6.7 - 2.7. Let c = 3 + -3. Sort 1/4, g, c in decreasing order. g, 1/4, c Let q be 7/9 - 1 - (-172)/(-36). Let d be (-3)/10 + (-3)/(-6). Sort -0.4, d, q. q, -0.4, d Suppose 3c + x - 10 = -x, 0 = -2c + 2x - 10. Suppose 0 = -4v - cv. Sort 5, v, -2 in decreasing order. 5, v, -2 Let o(r) = -r3 - r2 + r. Suppose -5t - 1 + 6 = 0. Let x be o(t). Sort 3, x, 5 in decreasing order. 5, 3, x Let g = 0.01 - -0.05. Let s = 0.34 + g. Sort -0.4, s, 3 in increasing order. -0.4, s, 3 Suppose 0 = 5g - 10g. Let t be -1(g - -9)/3. Let b be (-1 - 0)3/(-1). Sort -2, b, t in increasing order. t, -2, b Let k = 5 + -3. Let i = k + 1. Let m = -0.2 - -2.2. Put 0.1, m, i in decreasing order. i, m, 0.1 Let t be 80/(-182) - 12/(-42). Let i = 4/103 + -758/3605. Let s = -71/210 - i. Sort t, -0.2, s in decreasing order. t, s, -0.2 Let a = -130 - -133. Sort -2, 8, a in ascending order. -2, a, 8 Let g = -5 + 5. Suppose g = 3c - 6c - 3. Sort 2, 3, c. c, 2, 3 Let o be (-185)/(-25) + (-2)/5. Let z(v) = -v2 + 6v + 4. Let n be z(o). Put -5, n, 5 in decreasing order. 5, n, -5 Let t be (-1)/1(30/(-54))/(-5). Sort -3/8, 4/7, t, 4 in descending order. 4, 4/7, t, -3/8 Let k(a) = a3 - 5a*2 + 2a + 5. Let n be k(4). Sort 5, 7, n in descending order. 7, 5, n Suppose 2 - 17 = 3a, 2j = -a - 1. Let q be ((-3)/3 - -4)/j. Sort -2, -2/7, q in descending order. q, -2/7, -2 Suppose -3i = -3, -l + i = 2i - 6. Put -2, l, 9, 3 in ascending order. -2, 3, l, 9 Let w = 3.3 - -0.6. Let b = w - -0.1. Put -1/6, b, -4 in increasing order. -4, -1/6, b Let s(v) = v*3 - 4v2 + v + 2. Let x be s(3). Sort -1, 2, x in increasing order. x, -1, 2 Let w(y) = y2 - 3y + 3. Let g(h) = h3 + 3h*2 - 5h - 2. Let n be g(-4). Let v be w(n). Suppose 18 = 3s + 3. Put -4, s, v in descending order. s, v, -4 Let l be (0/(-4))/(-1 + 0). Suppose -8w - 5 = -3w + 2y, 24 = 4w - 4y. Put w, -5, l in ascending order. -5, l, w Suppose -4c - 121 + 109 = 0. Sort 1, -2, c in decreasing order. 1, -2, c Let x = 4.2 - 2.2. Sort 3, 4, x. x, 3, 4 Suppose r - 3s = -3, -s = -2r - 3s + 10. Sort r, 4, 5 in decreasing order. 5, 4, r Let w(z) = -z + 10 + 4 - 3. Let f be w(5). Let b = 4 - f. Put -3, 1, b in decreasing order. 1, b, -3 Let h = 24 - 16. Suppose -h = -4o + 12. Let x(b) = 4b*2 - b. Let p be x(1). Put -4, o, p in ascending order. -4, p, o Suppose -3z + 2z - 2j - 9 = 0, -2z = 2j + 8. Sort z, -2, -1. -2, -1, z Let u be ((-9)/(-21))/(4/(-14)). Sort u, -4, -1/4 in decreasing order. -1/4, u, -4 Let s = 108 - 106. Suppose -10 = -2j + 2v, 2j + 4 + 11 = -3v. Sort j, -1, s in decreasing order. s, j, -1 Suppose -3f - f + 8 = 0, m + 4f = 2. Let g be 12/(-7) - m/(-21). Sort 5, g, 4 in descending order. 5, 4, g Let x = 2 + -4. Let s be (3 - 3/2)2. Put s, -4, x in increasing order. -4, x, s Let i be 4/(-3)63/6. Let n be (-4)/i + 5/7. Put -7, n, -5 in decreasing order. n, -5, -7 Let v = 40 + -39. Sort v, 0, -0.4 in descending order. v, 0, -0.4 Let s = 0.4 + -0.3. Let g = -1/93 - -67/465. Put -2/5, s, g in descending order. g, s, -2/5 Let u = -1.1 - -5.1. Let o = 3.5 - u. Put 1/4, o, -3 in descending order. 1/4, o, -3 Suppose 3f + 0 - 6 = 3i, -2i - 19 = -5f. Sort i, 5, -5, -4 in decreasing order. 5, i, -4, -5 Suppose 0 = 4l + 4m + 16, -5m - 4 = -2l - 12. Let u = 142 + -1564/11. Let g = 1 - 1. Sort l, g, u in increasing order. l, u, g Let o = -0.4 - -1.3. Let n = o + 0.1. Let a = -4 - -8. Sort a, -3, n. -3, n, a Let r = -12 - -6. Let c = r - -7. Sort c, -4, -6. -6, -4, c Let h = -0.3 + 0.1. Let j = 0.008 - -4.892. Let a = -0.1 - j. Put 2/9, a, h in descending order. 2/9, h, a Let y(o) = -4o2 - o + 8 + o2 - o3 + 4o*2 + 7o*2. Let g be y(8). Sort -5, 4, g in decreasing order. 4, g, -5 Let t be (-4)/(-30) - (-344)/120 - 0. Put 1/4, t, -2/7, -0.4 in decreasing order. t, 1/4, -2/7, -0.4 Suppose 18h - 15h = 0. Put h, -3, 4, 22 in ascending order. -3, h, 4, 22 Suppose 0 = -i + 2 - 6. Put 3, i, 9 in descending order. 9, 3, i Suppose 2y - 6y - 16 = 0. Let a be 0-23/(-12). Suppose ar = -3r. Sort 1, y, r in ascending order. y, r, 1 Suppose 36 = -0g + 9g. Sort g, -19, -2 in increasing order. -19, -2, g Let y(f) = -1 - 7 + f + 2. Let o be y(7). Suppose -t + 3m + 9 = 0, -2t - 2m = 2m + 22. Sort o, t, 0. t, 0, o Let c = 3 + -3.13. Let v = -0.03 - c. Sort 0.6, v, 0.5. v, 0.5, 0.6 Let d = -3.47 + 3.3. Let m = d + -0.03. Put m, -2/3, -4 in ascending order. -4, -2/3, m Let p = 0.3 - 0.5. Let d = -2.5 - -3. Let h = -0.36 - 0.04. Put h, p, d in descending order. d, p, h Let b be (-2 + 2)/(-1) + 4. Suppose -8 = -bw, 3w + 0 = 4v - 6. Suppose 0 + 25 = -4s - 3k, 2s + k = -11. Sort s, v, -6 in descending order. v, s, -6 Let s = -0.82 + 0.12. Let w = -0.85 - s. Let v = w - -0.05. Sort v, 2, 5 in descending order. 5, 2, v Let t = -117/5 + 23. Put t, 2, -2/7 in ascending order. t, -2/7, 2 Let n = 31 - 35. Sort n, 3, -5 in increasing order. -5, n, 3 Suppose -5f + 10f = -5. Put 2, 4, 3, f in ascending order. f, 2, 3, 4 Let w = -17 + 2. Sort 3, w, -2/7 in ascending order. w, -2/7, 3 Let x = 0.41 - 1.11. Put 0.1, x, 5 in increasing order. x, 0.1, 5 Let a = 5.01 - 5. Let n = 0.99 + a. Put n, -4, -5 in ascending order. -5, -4, n Let o = -0.02 + 0.22. Sort -2, o, -1 in descending order. o, -1, -2 Let z = 0.4 + 0. Sort 4, -1, z, -4 in descending order. 4, z, -1, -4 Let n be (-5)/(-10)(13 + 1). Sort n, 5, -5 in increasing order. -5, 5, n Suppose -2j - 192 + 190 = 0. Put -5, -3, 0, j in increasing order. -5, -3, j, 0 Let f = 14 - 11. Put 12, f, -0.3 in descending order. 12, f, -0.3 Let x(m) = 2m - 11. Let t be x(6). Let d = 0.1 + -1.1. Sort t, d, -0.5 in decreasing order. t, -0.5, d Let j = -24.9 - -22.9. Let u = 2.3 - 2. Put u, j, -3 in ascending order. -3, j, u Let z(d) = d*2 - 5d - 1. Let x be z(6). Let s = 3 - 0. Suppose 8q = sq. Sort 3, x, q in decreasing order. x, 3, q Suppose 12 + 12 = 8c. Sort c, 5, -4. -4, c, 5 Suppose -2h - 5 = 5f, 5h + 2f = -f + 16. Sort 0.2, h, -0.4, -4 in decreasing order. h, 0.2, -0.4, -4 Suppose 202 = -2v - v + q, 0 = 4v - 5q + 262. Let j = v + 38. Let a be ((-4)/j)/(10/(-50)). Put 3, a, -2/7 in descending order. 3, -2/7, a Let l = 8/9 + -13/18. Sort l, 1/2, 2 in decreasing order. 2, 1/2, l Suppose 4k + 4w - 41 = -k, -5*w = 2	{ "pile_set_name": "DM Mathematics" }
Is -1/3 < 2210? True Which is greater: -0.18 or 0.25? 0.25 Which is greater: -3/736 or 1? 1 Which is bigger: 1064 or 1066? 1066 Which is smaller: 61 or 2/7? 2/7 Is -2 smaller than -83/6? False Is 0.94 smaller than -1? False Which is smaller: -29/4 or -30? -30 Which is smaller: 0.592 or 2/5? 2/5 Is 0.3 bigger than 2779? False Is 34 greater than 30? True Is 116 smaller than 117? True Which is smaller: -14 or -27? -27 Does 355 = 355? True Is -31 less than -25? True Which is bigger: -35 or -31? -31 Is 1 at most 18/581? False Is -0.5 equal to -31.71? False Do -84 and -1442/17 have the same value? False Which is greater: 3 or -0.23? 3 Is -762 at least as big as -765? True Which is smaller: 1/650 or 0.8? 1/650 Which is bigger: -752 or -751? -751 Is 431 at most as big as 438? True Is 1 at most -2/257? False Which is smaller: -252 or -6306/25? -6306/25 Which is smaller: 239 or 13? 13 Which is greater: 11177 or 11176? 11177 Which is smaller: -13 or -111/8? -111/8 Is -73 >= -0.04? False Which is smaller: -7/29 or 1? -7/29 Is 1486 not equal to 1486? False Which is bigger: 595 or 594? 595 Which is smaller: 27 or 230/9? 230/9 Are -438 and -19 non-equal? True Is 0 smaller than -1/332? False Is -4 not equal to 5? True Which is bigger: 1/4 or -154? 1/4 Which is greater: 1 or -1/46? 1 Is -7/5 >= -2? True Is -1/9 < -0.1214? False Is -15 less than -43? False Which is greater: -6/361 or 0? 0 Is -46 at least as big as -49? True Which is bigger: 1/14 or -1.2? 1/14 Which is bigger: -8 or -232/31? -232/31 Which is smaller: -4 or 490? -4 Which is greater: 15 or 210/13? 210/13 Is -16535 bigger than -16535? False Is 2.2 less than or equal to 0.02? False Is 113/360 at least 0? True Is 4/3 greater than -7/4? True Which is smaller: -40 or -42? -42 Which is greater: 22 or 1062/49? 22 Which is bigger: -96 or -97? -96 Which is smaller: -1/16 or -0.8? -0.8 Is 631 at least as big as 631? True Are -1383 and -1383 nonequal? False Which is bigger: -4921 or -9839/2? -9839/2 Is 386 at most as big as 384? False Which is bigger: -77/30 or -4? -77/30 Is 3 <= 62/41? False Which is bigger: -17 or 31? 31 Is 832 > 835? False Which is greater: 2318 or 2313? 2318 Are 96 and 100 equal? False Which is smaller: -1609 or -1636? -1636 Are 14 and 95/7 equal? False Which is smaller: 11 or -9? -9 Is -13 less than -130/9? False Which is smaller: 341 or 109? 109 Is -5690 != -5691? True Which is bigger: 1 or 39/184? 1 Which is smaller: 0 or 5/62? 0 Which is bigger: -0.544 or -6? -0.544 Which is smaller: 1 or 18/131? 18/131 Which is smaller: 57 or 81? 57 Is -19/55 greater than or equal to 1? False Is -24 >= 0.1? False Which is greater: -113/75 or -2? -113/75 Which is greater: 42/13 or 4? 4 Which is smaller: 8081 or -1? -1 Which is smaller: -1 or 0.1? -1 Is 0 != 1/6010? True Which is smaller: -13 or 1/4? -13 Are 9620 and 9621 non-equal? True Is -1 at most as big as -26/475? True Is 13 greater than -66? True Do 316 and 317 have the same value? False Which is smaller: -1 or -5/7301? -1 Is -1380 less than -1374? True Is -4 at most -2613/7? False Is 3.06 != -2? True Which is smaller: -38/11 or 0? -38/11 Which is greater: -11/4 or 6? 6 Which is smaller: 32295/2 or 16148? 32295/2 Is -0.043 >= 92? False Is 1161 less than or equal to 1159? False Which is smaller: -4213 or -8423/2? -4213 Which is smaller: 43 or -12? -12 Which is smaller: -439 or -444? -444 Which is greater: -2/9 or 8664? 8664 Which is bigger: -3/529 or 1? 1 Which is bigger: -1133 or -1135? -1133 Is -1441 != -1443? True Which is smaller: -216/7 or -10? -216/7 Is -1 greater than -5/2696? False Which is smaller: -18/37 or 0? -18/37 Which is bigger: -6 or 4? 4 Do -1244 and -1 have the same value? False Which is greater: 1/2 or -40? 1/2 Which is bigger: -2/259 or 0.11? 0.11 Is -1 less than or equal to 2/83? True Which is smaller: 0.2 or -3011? -3011 Is -349 smaller than -351? False Which is bigger: 2 or 63/97? 2 Which is smaller: 4 or -4? -4 Is 5/2601 less than 0? False Is 87/14 at most 7? True Is 2718 bigger than 2718? False Which is smaller: 6.28 or -2/27? -2/27 Which is greater: -13/761 or 1? 1 Is 228 at most as big as 1133/5? False Is -322 bigger than -321? False Are -26 and -139 equal? False Which is greater: 1 or 18/55? 1 Is 6750 > 6747? True Is 225 greater than 224? True Which is bigger: 22 or 21? 22 Which is smaller: -398 or -394? -398 Is -7136/5 less than -1426? True Which is smaller: 2497 or 14975/6? 14975/6 Which is bigger: -393 or -6/7? -6/7 Do -315/4 and -79 have the same value? False Which is smaller: -169 or -851/5? -851/5 Are -2/26585 and 1 equal? False Which is bigger: 1859 or 1860? 1860 Which is bigger: -10/11 or -1? -10/11 Is -3/44 at most -1? False Which is greater: 75 or -3/4? 75 Is -694 at least -694? True Which is smaller: -3/5 or -0.092? -3/5 Does 177 = 3004/17? False Which is smaller: 0 or 25? 0 Is -748 at least as big as -5? False Do -1080 and -1092 have the same value? False Which is smaller: -3 or -289? -289 Is 734 greater than 737? False Is 15/32 not equal to 0? True Is 12 smaller than -328? False Are -1/4 and -4573 non-equal? True Does 314/67 = 6? False Is 16/13 bigger than 3.8? False Is 265 <= 269? True Does 1 = -28/535? False Which is greater: -87 or -2? -2 Which is smaller: -19/12 or -2? -2 Is -781 bigger than -781? False Which is greater: -445/8 or -56? -445/8 Which is bigger: -315/131 or -1? -1 Is -2/3 at most -14? False Which is bigger: -989 or -991? -989 Which is greater: -3/26 or -25? -3/26 Is 4 less than or equal to -9? False Is 4 at most as big as -45/4? False Is -4597 bigger than -4598? True Which is smaller: -0.1 or 701? -0.1 Is 0.1 not equal to -8764? True Is 623 not equal to 623? False Is 191 at least 191? True Which is greater: -2/7 or 30? 30 Is 2712 greater than or equal to -2? True Is 1/57 < -1? False Is -199/23 != -8? True Is -3368 at most as big as -3368? True Is 0.2 != -0.127? True Are -1 and 8/193 nonequal? True Which is greater: 1 or 468? 468 Are 22 and 44 equal? False Which is greater: -8 or -2? -2 Which is greater: 1879 or 1880? 1880 Is 2 bigger than 1.4? True Which is smaller: 5326/5 or 1064? 1064 Are 18623 and 18623 equal? True Is 0 <= 0.2228? True Which is greater: -0.1 or -2719? -0.1 Is -13 > 307? False Is -17/19 greater than or equal to -2? True Which is bigger: 1 or 26/31? 1 Is -5 smaller than -585/164? True Is -6627 at least -6625? False Does -56 = 0.01? False Which is smaller: 18 or -0.8? -0.8 Is -1 at most -0.464? True Which is smaller: 18 or 7? 7 Are 319 and 1 non-equal? True Is -2834 != -2834? False Which is smaller: -1 or -7/599? -1 Does -1029 = -1030? False Which is smaller: 222 or 155? 155 Which is smaller: 1212 or 1214? 1212 Is -616 smaller than -615? True Which is bigger: 310/73 or 4? 310/73 Is -1 <= -873? False Is 1 less than or equal to -1/10860? False Is -1 equal to 13/283? False Which is smaller: -89 or -87? -89 Is 42/29 equal to 10? False Is 17567 at least 17567? True Is -166 at most -170? False Is -938 > -17? False Do -50 and -6/13 have the same value? False Which is greater: 668 or 0? 668 Which is bigger: -2.97 or 3? 3 Which is smaller: -1161/13 or -89? -1161/13 Which is greater: 479/5 or 97? 97 Which is smaller: 140 or 136? 136 Which is greater: -0.2 or 11/6? 11/6 Which is smaller: 1 or -4/195? -4/195 Is -63/2 smaller than -31? True Are 8612 and 8613 non-equal? True Is 1 != 1661? True Is -10 not equal to -12? True Is -2/15369 >= 0? False Is 103 > 94? True Which is smaller: 13540 or 13541? 13540 Which is greater: 0.1 or -28? 0.1 Which is greater: -2897 or -2899? -2897 Which is bigger: 3 or -3/4? 3 Which is smaller: 1830/31 or 60? 1830/31 Is 79 greater than or equal to 78? True Which is greater: -7 or 43? 43 Is -364 at least as big as -377? True Is -6081 bigger than -1/2? False Which is smaller: 260 or 267? 260 Is 0 < -2/17549? False Which is greater: -95 or -96? -95 Do 371 and 370 have different values? True Which is smaller: 60 or 7? 7 Are 6 and 71/10 equal? False Is 1431.3 greater than or equal to -1? True Which is smaller: -353/17 or -22? -22 Which is bigger: -606 or -605? -605 Which is smaller: -13.4 or 0? -13.4 Is -1986 greater than or equal to -2? False Is 1/98 > 0.3? False Which is smaller: -2/13 or -4/55? -2/13 Is 1/125 equal to 1? False Which is smaller: -283/6	{ "pile_set_name": "DM Mathematics" }
b. 3795 Express (-3042l2 + 3464l*2 + 3994l*2)(-2l + l - 2l) in the form pl3 + vl + b + il2 and give p. -13248 Express (2f + 2 - 2)(37f*2 + 589 - 720 - 38f*2) in the form x + pf + uf2 + mf3 and give p. -262 Express 1 + c2 + 3402c - 2c*3 + 3320c - 6651c in the form xc*2 + qc*3 + k + ic and give i. 71 Express -6o2 - 17o + o*3 + 480o*4 - 479o*4 + 27o*2 as uo + bo3 + k + jo*4 + io*2 and give k. 0 Rearrange 12008k*2 + 3k - 7k4 + 4k - 12009k2 to vk + ik2 + pk*3 + a + ok*4 and give o. -7 Rearrange -33n + 7n2 - 6n*2 + 8n*2 + 7n2 + 1 + n2 to yn + h + sn*2 and give h. 1 Express (-61a - 19 + 19)(2 - 1 + 0 + (0 - 2 + 4)(-3 + 1 + 3) - 15 - 50 + 18) in the form u + ha and give h. 2684 Rearrange -2f*2 + 6696 - 6697 + 2f - 6f3 - 6f*3 to of + i + uf3 + nf*2 and give o. 2 Rearrange (5 - 2r*2 - 4 + 0 + r)(17972r + 556r + 4905r) to the form yr + o + br2 + vr*3 and give v. -46866 Rearrange (590m + 712 - 712)(-1 + 0 - 2)(4 + m*3 - 4) to the form y + vm + jm4 + hm*2 + fm*3 and give f. 0 Express 1550f - 195f + 1837f + 4491f in the form mf + j and give m. 7683 Rearrange 0q3 - 41q + 1160q2 - 3q*3 - 4 - 1162q*2 + 17q + 0q3 to v + yq*2 + hq*3 + sq and give y. -2 Express 1507i2 - 13 - 512i*2 - 589i*2 - 2i - 570i2 as pi*2 + ti + u and give u. -13 Express (-5 + 3 - 1)(-4 - 1 + 2)(3n2 + 0n*2 - 4n*2)(1 - 9 - 5 + (2 + 2 - 1)(1 + 1 - 1) + 6 + 0 + 14) as vn + yn2 + r and give y. -90 Express (70w*2 - 3075w + 3075w)(4w + 0w + 2w)(-1 + 2 + 4) in the form uw + sw*2 + kw*3 + t and give k. 2100 Express -w - 2w*3 + 30868563 - 6w*2 + 59w*4 - 30868562 + 0w*3 in the form iw + yw4 + t + vw*2 + aw*3 and give i. -1 Rearrange 444h - 261h + 2333h - 1 + 12h to the form fh + w and give w. -1 Rearrange 68f3 - 2f*2 + 78f3 - f4 - 102f3 + 79f*3 to nf*2 + q + kf + hf4 + yf*3 and give y. 123 Express -18871u3 - u4 + 2 + 25u + 2u*2 - 23u + 18971u3 in the form d + bu*4 + xu + ku3 + lu*2 and give d. 2 Rearrange (180r + 74465 - 74465)(2r*3 + 4 - 4) to hr + t + lr2 + dr*3 + cr*4 and give c. 360 Express 1 - 1 + 189619469z - 189645201z as yz + h and give y. -25732 Rearrange -2095070 + 2095069 - 12h2 + h4 + 2h4 + h2 + 30h to oh*3 + fh*2 + y + ah*4 + nh and give y. -1 Express (0 + 0 - 2h2)(4 + 1 - 2) + (-1551 + 77h + 1551)(2h + 21 - 21) in the form w + mh*2 + yh and give m. 148 Express ((-2g + 0g + 0g)(2 - 4g3 - 2) - 5g*4 - 5g4 - g4)(-3 + 2 + 3) as rg*3 + jg + qg4 + ug*2 + d and give q. -6 Express 27a + 12a + 1 + 68a as wa + n and give w. 107 Express 12216198k2 + k4 - 5k - 12216196k2 - k3 - 33 + 3 as o + lk2 + yk*4 + dk + zk3 and give o. -30 Rearrange 13y*3 - 1 + y + 13y*3 - 1 - 2y*3 to sy + ty3 + w + qy*2 and give t. 24 Express -158m*2 - 935 + 849 - 1923m + 1921m in the form z + am*2 + cm and give z. -86 Rearrange 87g2 + 341 - 42g*2 - 760 - 733 - 47g*2 + 4g to the form z + cg2 + hg and give c. -2 Rearrange -2j3 + 3j4 + j3 - 10j - 2j*4 + (4j*3 - 3j3 + j3)(-3j + 4j - 5j) to nj4 + r + yj*3 + dj*2 + fj and give n. -7 Express (105 - 1947 - 1222)((c + 1 - 1)(3 + 2c - 3) - 2c*2 - 3c*2 + 7c*2) as wc*2 + lc + x and give x. 0 Express 2d4 + d3 + 6719087d + 2 - 3d2 - 6719089d - 98 as rd4 + ad*3 + bd*2 + j + yd and give j. -96 Rearrange 3y - 241y*2 + 413y*2 - y - 914y*2 - 408y*2 to d + ry*2 + wy and give r. -1150 Express -7 + 37790b + 6 + 3b*3 - 37751b as cb + hb*3 + rb*2 + g and give h. 3 Express (-81486 - 6n - 5565n2 + 2n*3 + 81486)(1 - 5 + 3) in the form an2 + ln + w + pn3 and give l. 6 Rearrange 1 - 6028f*2 - 2 + 12026f*2 - 6014f*2 + 20f*3 to df*3 + l + sf + hf2 and give l. -1 Rearrange -966i*2 - 2i*4 + 969i*2 - 10 - i + 14 - 3 - 36i*3 to the form yi*2 + pi*4 + vi + t + ni3 and give n. -36 Express 1723u - 2185u + 4048u - 235u + 4661u as ru + p and give r. 8012 Express (2x*3 + x - x)((23 + 11 - 8)(-2 + 3 - 3) + 35 + 50 - 71) as fx*3 + b + hx + jx2 and give f. -76 Express 736l*4 - 1 - 5l*3 - 738l*4 + 8l*3 + 2306l*2 as ol*3 + al*4 + y + ul + hl2 and give y. -1 Rearrange 35y - 9y2 - 35y + (1 - 1 - 3)(-y + 2y*2 + y) + 0y2 - y2 + 3y2 + 0y2 + y2 + 0y2 to the form xy + l + ny2 and give n. -12 Express 300g*2 - 297g*2 - 2g*3 - 233 + g + 259 + 9g*4 in the form zg*2 + pg*4 + hg + v + mg3 and give v. 26 Rearrange (98 - 2d*2 - 67d - 98)(107 + 80 + 81) to rd*2 + i + vd and give r. -536 Express 9808 + 4873b + 4888b - 9808 as vb + a and give v. 9761 Express (60 + 11r - 60 + (2r + 3r - 3r)(3 - 5 + 0) + r - 2r + 0r + (-2 + 5 - 2)(-4r - r + 3r)(3 - 3 - 2))(-4 + 4 - 1) as hr + k and give k. 0 Rearrange 57l3 - 75l - 2 + 76l + 437l*3 + 3 + 75l*3 to il + al3 + m + pl*2 and give i. 1 Rearrange -15387w - 3502w - 2171w to zw + u and give z. -21060 Rearrange 2a*3 - 84 + 13a - 11 - 81 - 15a - 135 to the form da*3 + o + pa + ta2 and give d. 2 Rearrange 1230 - 585 - 537 - o2 - o + 3o to the form qo2 + xo + s and give x. 2 Rearrange 1341n2 + 2n - 30 - 185n2 + 90n*2 + 30 to the form vn + j + un2 and give u. 1246 Rearrange (174893t - 20 + 20 - 185265t)(3t + 0t - 5t) to the form at*2 + gt + s and give a. 20744 Express -128m - m2 - 2m*2 + 25m - 75m + 17m as wm + xm*2 + g and give x. -3 Rearrange 1865s - 1961s + 4329s to the form vs + r and give v. 4233 Express 2k*2 + 65 + 30k - 119 + 67 in the form hk + xk*2 + n and give x. 2 Rearrange 149i*3 + 32i*3 - 10 + 4i*4 - 33i + 10 + 35i to the form x + li*3 + ti + ji4 + ci2 and give j. 4 Rearrange b4 - 21b3 - 8b*3 - 20b*3 + 45b*3 + 0 - 2b*2 + 11b + 1 to the form gb2 + q + hb + rb4 + cb*3 and give h. 11 Rearrange -2420g*2 - 2393g*2 - 2 + 4830g*2 - 20g to h + lg2 + tg and give h. -2 Express -8465p + 9047p + 5 - 5 - 3p2 + 7p*2 in the form f + hp + zp2 and give h. 582 Rearrange (0v*3 - 2v*3 + 0v*3)(196438v + 229 - 691 + 228 + 234) to the form mv*2 + hv + fv4 + i + gv*3 and give f. -392876 Rearrange 8x*2 - 1 + 11x*3 + 13x*2 - 14x*3 - 13x*2 - 5x*3 to the form ix*2 + jx*3 + ox + t and give j. -8 Rearrange -p*3 - 311001 - 17p*2 + 16p*2 + 85p*4 + 311000 to w + zp + yp4 + fp*3 + up*2 and give u. -1 Express 2j*2 - 6j + 107070j3 + 2 - 3j4 - j2 - 107189j3 in the form lj*4 + sj*2 + aj*3 + fj + z and give f. -6 Rearrange (2s3 - s3 - 2s*3)(-1 + 7 - 1 - 2s) - 49s*4 + 44s*4 + 4s3 - 1 - s3 to the form c + is3 + ds + vs4 + us*2 and give c. -1 Rearrange -28 + 19c*2 - 26c*3 + 30 - 16c*2 + 6c4 + (-c3 + 3c3 - c3)(-2c - 1 + 1) to xc*2 + p + qc*3 + bc*4 + wc and give x. 3 Express -2 - i + 2 + (-3 + 1 + 1)(-4 - 2i + 4) + 6i - i - 365 + 341 + (6i + 12i + 2i)(1 + 1 - 1) in the form k + xi and give x. 26 Express -235g4 + 187g*3 + 3 + 249g*4 - 3 + 2g*2 - 43g*3 in the form yg*2 + tg*4 + w + cg + mg3 and give m. 144 Rearrange (-36h - 235 + 33h + 169)(2h3 - h3 - 3h*3) to dh + c + xh2 + fh*4 + nh*3 and give n. 132 Express 122t - t*2 + 512t + 1 - 216t as yt + z + qt2 and give y. 418 Express -57h + 3 - 31h + 56h*2 - 41h*2 - 5 as xh*2 + kh + g and give k. -88 Express (m*2 + 3m*2 - 5m*2)(1 - 2 + 1734610m - 1734262m) as um3 + y + cm + sm2 and give u. -348 Rearrange -2972p*2 - 3951p*2 - 2802p*2 + (-1 + 1 - 2p)(-3p - p + 6p) to c + gp + tp2 and give c. 0 Express -11093f*2 + 23666f*2 - 10279f*2 + (0f + 4f - 2f)(-1 + 1 + f) in the form sf + uf2 + y and give u. 2296 Rearrange 7 - 4 - 5n*2 - 1 + 94n*3 - 57n*3 to the form yn*3 + h + xn + kn2 and give y. 37 Express -2w*4 - 403w + 10608 - 2w2 - 21263 + 10655 - 3w*3 as iw*4 + nw + vw2 + s + rw**3 and give r. -3 Rear	{ "pile_set_name": "DM Mathematics" }
Let s be (5/3)/((-2)/(-6)). What is the highest common factor of o and s? 5 Suppose 9w - 2 = 7. What is the highest common factor of w and 7? 1 Suppose -3b - 60 = -5b. Let w be (-3)/9 + (-10)/(-3). Suppose 3j - 6 = wp, -2j - j + b = 3p. Calculate the highest common factor of 15 and j. 3 Let r be -3 + 17 - (-3 + (3 - -2)). Suppose -2l - 2l + 336 = 0. What is the highest common divisor of r and l? 12 Let y = -1 - -5. Suppose -q - yq = -270. What is the greatest common divisor of 18 and q? 18 Suppose 2 = 2a + 12. Let d be (-137)/a - 2/5. Suppose -3u + u = 4b - 28, 3u = -3b + d. Calculate the greatest common factor of b and 10. 5 Let r = 9 - 2. Suppose -107 = -3v + t, 2v - rv - 2t + 160 = 0. Let h(o) = 20o + 5. Let i be h(4). What is the highest common divisor of v and i? 17 Let c = 60 + 12. Calculate the highest common divisor of c and 8. 8 Let a = 7 + 13. Let c = -17 + 77. What is the highest common factor of c and a? 20 Suppose 4p = -h + 7p, -2h + 3p = -3. Suppose -3y + 69 = hi, 15 = -2i + 3i + 3y. What is the greatest common factor of 3 and i? 3 Let l be 10/(-4)8/(-10). Suppose -4t = -lt - 80. Calculate the greatest common divisor of t and 20. 20 Suppose w - 19 = -2q, 0 = 4q + 9 - 5. What is the highest common divisor of 3 and w? 3 Suppose 6 = 5i - k - 19, -i - 5k = -31. Suppose ia - 64 = 2a. Calculate the highest common divisor of 16 and a. 16 Suppose 5d + 23 = 2k, k + 3k - 2d - 38 = 0. What is the greatest common factor of 1 and k? 1 Let v = -22 - -36. Suppose -d = -5i + 2d + 545, i - 107 = d. Calculate the highest common divisor of i and v. 14 Let w(z) = -z*3 - 3z*2 + z + 23. Let i be w(0). What is the highest common divisor of i and 161? 23 Let u = 2 - -8. Suppose 3m - 220 = m. Calculate the highest common factor of m and u. 10 Suppose 0a + 28 = 4a. Suppose -6j = -aj + 8. Let u = 14 - 10. What is the highest common factor of j and u? 4 Let m(g) = -g*3 + 7g*2 - 8g + 4. Let l be m(5). What is the greatest common factor of l and 8? 2 Let x(l) = 3l3 - 2l*2 - 2l + 2. Let a be x(-2). Suppose 0 = 5z - 50 - 30. Let c = z - a. What is the greatest common divisor of 6 and c? 6 Let v be (-36)/42(-84)/18. Calculate the greatest common divisor of 20 and v. 4 Let l(d) = 3d + 3. Let u be l(-6). Let t be (-2)/(-2 - 24/u). Suppose tj + 0j = 480. What is the highest common factor of 12 and j? 12 Let z be -1 - (-9 + -1 + -2). Suppose -5n + z + 4 = 0. What is the greatest common factor of 33 and n? 3 Suppose -2f = f. Suppose -204 = -3g - fg. Let p = -14 + 31. Calculate the greatest common divisor of g and p. 17 Let c(u) = u2 + 9u + 16. Let w be c(-7). Let o be 48/w - 4/2. Calculate the greatest common divisor of 11 and o. 11 Suppose -4h + 22 = -2h. Let g = 18 - h. Calculate the greatest common divisor of g and 1. 1 Let s(u) = u*3 + 6u*2 + 8u + 7. Let y be s(-5). Let c = y + 12. What is the greatest common divisor of 1 and c? 1 Suppose -4y = -3y - 35. Let f be (-2)/(8/(-10))2. Calculate the highest common divisor of f and y. 5 Suppose f + 2k - 13 = -k, 5f - 5k = 145. Suppose -3h + 25 = 2h. What is the greatest common divisor of f and h? 5 Let r(m) = m*3 + 5m*2 - 3m + 1. Let f be r(-5). Suppose -2t = -f - 28. Calculate the highest common factor of 55 and t. 11 Suppose k - 282 = 294. Suppose -a = 3a - k. Suppose t - 6t = -80. Calculate the greatest common factor of a and t. 16 Let n be ((-88)/10)/((-8)/20). What is the highest common divisor of 11 and n? 11 Let t be -48(-9)/217/4. What is the greatest common factor of t and 108? 36 Suppose 5q = 4q - 30. Let d = -16 - q. What is the greatest common factor of 28 and d? 14 Suppose -v = c - 10 - 2, 2v - 21 = -c. Calculate the highest common divisor of v and 9. 9 Suppose 2q + 154 = 4a - 68, 0 = a + 3q - 38. What is the highest common factor of a and 265? 53 Let z(x) = -x3 + 8x*2 - 9x + 16. Let p be z(7). What is the highest common factor of 2 and p? 2 Let y be ((-36)/15)/((-2)/5). Let k be 1 + (0 - 2) - -4. Suppose 0 = kf - 8f + 30. What is the highest common divisor of f and y? 6 Let i be 32/31. Suppose r = i + 9. What is the highest common factor of 11 and r? 11 Suppose 0 = 3i - 129 - 81. What is the highest common divisor of i and 14? 14 Suppose -6d + 114 = 6. What is the greatest common factor of d and 18? 18 Let p(v) = v - 3. Let c be p(0). Let a = c + 6. What is the highest common factor of 2 and a? 1 Suppose h = -2h. Suppose h = -r + 26 + 73. Calculate the greatest common divisor of 9 and r. 9 Let b(n) = n + 15. Let s be b(-3). What is the greatest common factor of s and 132? 12 Let x = 90 + -51. What is the highest common divisor of x and 13? 13 Suppose -17q + 19q = 114. What is the greatest common factor of q and 19? 19 Let o(f) be the first derivative of 11f4/4 - f2/2 + f - 3. Let d be o(1). What is the greatest common factor of d and 22? 11 Let m(h) = h + 35. Let j be m(0). Let f be 7-1(1 - 2). What is the highest common divisor of j and f? 7 Suppose -4f + 195 = 5m, 0 = -3f - m + 43 + 95. What is the greatest common factor of f and 15? 15 Let q be (6 + -6)2/6. Suppose q = d - 3d. Suppose 6f = 2m + f - 98, 2m - f - 90 = d. Calculate the greatest common factor of 4 and m. 4 Suppose 5s - 255 = 20. Let h = -139 - -243. Suppose 0 = b + z - 4z - 31, -2z = 5b - h. What is the greatest common divisor of s and b? 11 Suppose -16w + 41 + 55 = 0. What is the greatest common divisor of w and 48? 6 Let k be ((-4)/10)/((-3)/15). Suppose -kl = 2d + 6, -d + 2l - 23 = 7l. Suppose -1 = -di + 3. Calculate the highest common factor of i and 10. 2 Let f be 2/(-5) - 257/(-5). Calculate the highest common divisor of f and 85. 17 Suppose -j - f + 89 - 3 = 0, 5f - 160 = -2j. Calculate the highest common divisor of j and 18. 18 Let a(m) = -m*3 - 5m*2 - 6m - 2. Suppose 24 = -5z + 4. Let x be a(z). Let h be (-2)/(x/(-9)) + 0. What is the greatest common divisor of 3 and h? 3 Let h be 6 + (0/1 - 2). Let v = 15 - h. Let l(d) = 14d - 7. Let s be l(6). What is the greatest common divisor of v and s? 11 Let q(o) = 42o - 3. Suppose -12 = -6d + 3d. Let h be q(d). Calculate the greatest common divisor of 15 and h. 15 Suppose -v - 4v + 40 = 0. Let y(x) = x3 + x2 + x + 72. Let l be y(0). What is the greatest common divisor of l and v? 8 Let m(a) = -a*3 - 3a*2 + 3a - 4. Let g be m(-4). Suppose g = -4p + 5c + 43, -2p - 2p + 2c = -34. Calculate the highest common divisor of 7 and p. 7 Suppose 0 = 2d - 0 - 6. Suppose 0 = 3m - dl + 30, -4l = 5m + 11 + 12. Let k be m/(3 - 4 - 0). Calculate the greatest common divisor of 70 and k. 7 Suppose -2 = -r + 66. Calculate the highest common divisor of r and 17. 17 Let x(d) = 6d - 4d - 2 + d. Let k = 7 + 0. Let w be x(k). Calculate the highest common divisor of w and 209. 19 Suppose 0 = k - 14 - 6. Suppose -12l + 16l - k = 0. Calculate the highest common divisor of 20 and l. 5 Let k = 26 - 16. Calculate the highest common factor of 20 and k. 10 Suppose 0 = 5c - 2c. Let s(k) = k*2 + 15. Let v be s(c). Suppose 3z - g - 242 = -z, z - 70 = 5g. What is the highest common divisor of v and z? 15 Let g be (-3 - -28)(-2 + 3). Let x = 9 - 4. What is the greatest common divisor of g and x? 5 Let y(b) = b + 41. Let t be y(-10). What is the highest common factor of 279 and t? 31 Suppose 3a - 4t - 3 - 9 = 0, -5t = -2a + 15. Suppose a = -0m - m + 14. Calculate the greatest common divisor of 98 and m. 14 Let y be 43(-3)/(-18). Let f(k) = 6 + y - 2k - 5 + k*2. Let w be f(3). What is the highest common divisor of 6 and w? 6 Suppose 1556 = -2o + 6o + 4x, -o - 3x + 393 = 0. What is the greatest common divisor of 43 and o? 43 Let z(w) = 7w + 35. Let b be z(10). What is the greatest common divisor of b and 21? 21 Let s = 81 - 39. Calculate the greatest common divisor of 28 and s. 14 Let f = 3 + 1. Suppose -h + 7 = -f. What is the greatest common divisor of 55 and h? 11 Let y = -20 + 26. Let b be 522/y3. What is the highest common divisor of b and 11? 11 Let h = 87 - 62. Suppose -h + 97 = z. Calculate the highest common factor of 8 and z. 8 Suppose -14o + 328 = -6o. What is the highest common factor of o and 164? 41 Let z be (6/5)/	{ "pile_set_name": "DM Mathematics" }
ange -1 + 1 + 8v2 + 2 + 1 to the form fv*2 + j + hv and give j. 3 Express -2r + 7r - 5r - 23r*2 + 2 as y + gr + ar2 and give y. 2 Rearrange 0p*2 - 12p*2 - 2p2 - p2 + 0p + 0p + (0p - p + 0p)(-3p - 4p + 4p) - 1 - 2p2 + 1 to the form gp*2 + k + op and give g. -14 Rearrange -82v4 - 2v*3 - 1 + 84v*4 + 2v + 2 to uv + wv*2 + l + av*3 + tv*4 and give l. 1 Express 4m*2 + 16m*2 - 6m*2 - 3m*2 - 3m*2 + 4m*2 + (-1 - 2m + 1)(2m - 2 + 2) - m*2 + 3m*2 - 3m*2 as pm*2 + n + fm and give p. 7 Express (2s2 - s2 - 3s*2)(s + 0 + 0)(2 - 5 + 2) in the form ks*3 + ds*2 + ls + h and give h. 0 Rearrange (0 + 4 - 1)(-3r + 4r + 2r)(-7 + 3 + 2) to hr + l and give h. -18 Express -13h - h - 12h in the form oh + t and give o. -26 Express (3 + 6 - 3)(r*2 + 4r*2 - 2r*2 + (-2r - 3 + 3)(3r - 4r - 2r)) in the form w + mr2 + xr and give m. 54 Express (-2 - r*3 + 0r*3 + 1)(4 - 5 + 3) + 7r3 + 14 - 14 - r2 in the form gr + yr2 + j + dr*3 and give y. -1 Express -68 + 68 + 4j + 4 - 4 - j + 0 + 0 + j + 0 + 0 + 2j + (-3j + 2j + 3j)(3 - 3 + 2) + 0j + 2j - j in the form bj + h and give b. 11 Express -19i2 + 2i*3 - 11i2 - i2 in the form p + zi + hi*2 + xi*3 and give x. 2 Express -25 + 10 - h + 8 as i + th and give i. -7 Rearrange (0 + 2 - 3)((-1 + 5 - 5)(-1 + 1 + 2l) + 19l + 9l - 7l - 3l - 2l + 3l) to the form zl + o and give z. -17 Express -3 + 2 + o + 2o + 0o in the form go + h and give g. 3 Rearrange (1 - 3 + 0)(4y2 + 2y2 - y2) + (-3y - 3y*2 + 3y)(-2 + 1 + 0) to oy + zy2 + b and give z. -7 Express -6a*2 + 95a*2 + 49a*2 + (a + 3 - 3)(3 - 3 + 2a) in the form wa*2 + la + o and give w. 140 Rearrange 4 - 935v + 935v - 4v2 - 3 to the form av + b + dv2 and give b. 1 Rearrange 5 + 5u - 5 + (2 - 7 + 0)(-3u - 5u + u)(-4 + 1 + 2) to the form k + xu and give x. -30 Rearrange 5o - 3 - 5 + 0 to go + c and give c. -8 Express y - 4y + 5y4 - 2y*3 + y + 1 - 3y*3 in the form ty*4 + my + sy2 + oy*3 + z and give o. -5 Express (17 + 2 - 9)(0t + 2t - 3t) in the form x + rt and give r. -10 Rearrange (0 - 2 + 3)(-1 - 2 - 6)(-1 - 3n + 1) to cn + r and give c. 27 Express (-3l + l + l)(21l + 25l - 95l) in the form il + k + ol2 and give o. 49 Express 2a + 8 + 0a3 - 11 + 1 - 2a*3 in the form ka*2 + x + oa*3 + ua and give u. 2 Rearrange -5g2 + 8g2 - 5 - g2 to dg2 + v + tg and give d. 2 Rearrange (-20i - 119 + 119)(-2i + 0 - 1 + 3i) to the form s + ui + xi*2 and give u. 20 Express 2s*2 - s + 0s*2 + 3s in the form ms2 + j + ds and give d. 2 Rearrange (4t + 3t - 2t + (3t - 2t - 2t)(3 - 1 - 3) + 5t + t - 4t)(-3 + 3 + 1) to the form ct + o and give c. 8 Rearrange (2k*4 - 5k*4 + 2k*4)(0 + 6 - 3) to the form qk2 + wk*4 + jk*3 + gk + c and give w. -3 Rearrange -3a + 2 - 2a*3 - 1 + a + 3a*3 to the form ta*3 + da*2 + o + za and give z. -2 Express (4w - 1 + 72w*2 + 6w*3 - 72w*2)(2 + 0 - 3) as vw3 + kw + q + cw2 and give k. -4 Express 4c - 5 + 2 + 6 + 3 in the form h + vc and give h. 6 Express 164p*3 - 4p - p*2 - 84p*3 - 81p*3 - 4 in the form sp + o + ap3 + dp*2 and give a. -1 Rearrange (h + 2h*2 - h + (3 + 6 - 5)(-h2 + h2 + h*2))(4h - 4h - 2h) + 0h*2 + 0h2 - h3 to lh3 + sh*2 + th + i and give l. -13 Express s*3 - 6s + 7s + 5s*2 - 2s*2 as hs*3 + ps + k + is2 and give h. 1 Express -9d2 - d3 + 3d3 - 48 + 50 as vd*2 + kd + zd3 + u and give v. -9 Rearrange -4b*4 + 3b*4 + 12b*2 + 3b*4 + 2b*3 - 2 - 6b*2 to the form mb + db4 + ib*3 + t + vb*2 and give i. 2 Express (2o - 2o - 2o)(2o*3 + 2 - 2) + (-3o - o + 2o)(10o3 + 11o*3 + 0o*3) in the form no*2 + fo*4 + vo + ko3 + j and give f. -46 Rearrange 11 - 7 - 4 + 18r to qr + u and give q. 18 Rearrange ((-11f - 4f + 4f)(0 - 3 + 1) + f + f + 0f)(3f*2 - 4f*2 + 0f*2) to the form kf + yf2 + wf*3 + l and give w. -24 Rearrange 3p*3 + 3 - 7 + 5 to up*3 + dp*2 + f + qp and give u. 3 Express (b + 19b3 - 4b - 6 - 21b3)(3 - 6 + 2) as l + pb2 + zb + kb3 and give z. 3 Express 2u*4 + 2u*2 + 3u - 5 - 4u + 3 + 2u*4 as j + su*2 + nu + ru3 + cu*4 and give j. -2 Express 3 + 15r*2 - 1 - 11r*2 in the form nr*2 + m + qr and give n. 4 Rearrange 48 - 78 + 38 - 3v to pv + s and give p. -3 Rearrange -7r + 2r - 2r - 12r to m + jr and give j. -19 Express -12s + 26s2 - 50s*2 + 25s*2 in the form os + z + gs2 and give o. -12 Express (2c - 5 + 5)(0c*3 + 4c*3 - 2c3) + c4 - 3c4 + 5c*4 in the form lc*3 + gc + vc2 + uc*4 + r and give u. 7 Express ((-2 - 4x + 2)(-2 + 1 - 1) + x + x + 3x + x - 4x + 2x)(1 - 1 + x) as m + kx + cx2 and give c. 12 Rearrange -6 + 0z + z + 3 + 0 + 2z4 to qz*3 + t + jz*2 + yz + wz4 and give t. -3 Rearrange 6q + 2q4 - q - 1 + 2q*2 - 2q*3 + 2q*2 - 3q to the form hq3 + f + xq*2 + nq + rq4 and give f. -1 Express -w - 24 - 3w*4 + 28 + 2w*4 in the form q + hw*2 + sw + jw3 + fw*4 and give f. -1 Express (-4b*3 + 4b*3 - 3b*3)(1 - 3 + 1 + (-1 - 1 + 0)(-2 + 5 - 2) - 1 - 1 + 0 + 0 + 0 + 1) as db + vb3 + k + pb*2 and give v. 12 Express (1 + 6 - 3)(3x2 + 24 - 6x*4 - 24) in the form fx*3 + sx + px2 + ox*4 + l and give o. -24 Express -203 - 26y + 203 in the form hy + q and give q. 0 Rearrange 2v - v + 4v + 6v to the form cv + f and give c. 11 Rearrange (0j2 - j2 + 0j2)(6 - 6 - 11j) + 2j*3 - j - 3j*2 + 3j*2 to fj*2 + pj + n + sj3 and give s. 13 Rearrange 0d*2 - 3 - 3d*2 + 2d*3 + 4d*2 + 22d*4 - 17d*4 to t + ld*2 + pd*3 + zd + bd4 and give p. 2 Rearrange -5 + 74j*2 - 83j*2 - 2j + 3 to t + gj2 + uj and give g. -9 Rearrange 4 - 4b2 + 100b*3 - 102b*3 + 5b*2 - 2b*2 to nb*2 + sb + ob3 + j and give n. -1 Rearrange (15 + 3 - 1)(5i - 2i - 4i) to the form zi + f and give f. 0 Rearrange w - 18w3 + 2w*2 - 2w*2 + 15w*3 to the form jw*3 + z + sw*2 + fw and give f. 1 Express (3g - 60 - 43 + 81)(-2g2 + 2g2 + g2) in the form jg2 + dg + ng3 + f and give f. 0 Rearrange (-3k*2 - 5 + 5)(-17 - 71k2 + 4 + 72k*2) to jk*4 + dk*2 + zk + r + sk3 and give d. 39 Express 2 - 2 - 2a + (2 + 3 - 4)(-16a - 17a + 21a)(-1 - 1 + 4) as x + za and give z. -26 Express (-2n2 + 2n2 + n2 - n)(7 + 1 - 3)(1 - 1 + 1)(0 - 3 + 6) as mn*2 + xn + u and give m. 15 Rearrange -6 + 7 - 2p4 - 3p*3 + 6p*4 + 0p*3 to kp*4 + op*3 + h + zp + wp2 and give h. 1 Express -r4 + 27 - 6 + 282r - 280r in the form or*4 + wr*3 + q + jr*2 + dr and give o. -1 Express (-5g2 + 4g*2 - 2g*2)(-62 - 113 + 124) as ag2 + c + dg and give a. 153 Express 9h2 - h4 + 9h*2 - 4h - 17h2 + 2h*3 in the form m + yh + qh2 + th*3 + vh4 and give v. -1 Rearrange -c2 - 4c2 + 11c*2 - 7c*3 - 9c*2 to the form uc + h + nc3 + xc*2 and give x. -3 Express (-2 - 1 + 1)(-5v + 5v - v) + 2v + 89v + 8v in the form pv + w and give p. 101 Express 3 + 2 - 5 + 41o2 as ao*2 + bo + f and give a. 41 Express (-n*2 + 4n*2 - 2n*2)(-4 + 2 + 1) + n - 2n2 - n + (0 - 3n + 0)(3n - 6n + n) as gn*2 + wn + u and give g. 3 Express -13 + 4w - 16 + 29 as f + mw and give f. 0 Express -z3 - z - 5 - z + z3 + 2z4 as cz*4 + iz*2 + sz + oz3 + a and give a. -5 Rearrange 3 - 8q + 23q - 4 - 2q*3 to n + xq*3 + iq + cq2 and give x. -2 Express 0 - 24m + 16m2 - 7m*2 + 23m - 2 as p + am + tm*2 and give p. -2 Express -4v + 32 - 3v2 + 4v - 40 as n + sv2 + kv and give s. -3 Express 0 - 2 + 0x2 - 3x*2 in the form gx*2 + l + rx and give l. -2 Rearrange 5a4 - a + 2a*2 - 966 + 3a + 977 + a*3 - 4a*4 to the form ka + ia2 + la*3 + ta*4 + o and give o. 11 Rearrange -10t + 12t + 13t to the form rt + x and give r. 15 Express (-12 + 12 - 5w)(4 + 2 - 2) - w - 3w + 5w as z + kw and give k. -19 Express -3i3 + 23 + i*3	{ "pile_set_name": "DM Mathematics" }
-4)(r2r)/(r/(r/(r(r/(r/(rr*(2/11)r)))/rr))) assuming r is positive. r(-36741/308) Simplify (o/o(4/21))(9/7)(o/(oo(4/11)))36 assuming o is positive. o(-6495/539) Simplify (r(-1/4))(-1/4)(r(-1))(-4/25)(rrr/r(-1/3))(-1/17)/(r(r*1r)/rrr4) assuming r is positive. r(-142261/20400) Simplify ((f(-2/3))(-4/9))*24((ff/((f3/f)/f))/(f(1/11)f))(-44) assuming f is positive. f(100/9) Simplify (p(-7/8))(-2/7)/((pp(-1/2))/p18) assuming p is positive. p(71/4) Simplify ((((q4)(-6/17))5)(-50))9 assuming q is positive. q(54000/17) Simplify ((p(3/7)pp)(-46))29((pp(p*(-1)p)/pp)/p)(-1/5)pp(-7)ppp7 assuming p is positive. p(-113292/35) Simplify ((v(2/5)/v)/(v/((v(-4)/v)/v))(vv(2/23))/(v(-5)/v))/((v*(2/3)/vvv(-1)/vvvv)/((v4/v)/(v/v6))) assuming v is positive. v(2008/345) Simplify (q(-2/9)q)(2/97)/((q6/q)/q(2/9))(q/(q/q*10)qq/q(8/3))8 assuming q is positive. q(61027/873) Simplify ((y(1/5))(-1/23)y*3y(-1/6)/y)(2/41) assuming y is positive. y(1259/14145) Simplify ((x(-1/2))*(-2/3)(x*(-7)x)(-2/11))(-3) assuming x is positive. x*(-47/11) Simplify ((gg*(12/13)/g(gg(-4/7))/g)/(g(-19/4)g/((g*(11/2)g)/g)))(2/3) assuming g is positive. g(1165/182) Simplify (q1/((q5/q)/q))/(q/(q*(-3/5)/q)q*(-4/11))((((q/(q*(-4)/q)q)/q)/qq)/(qq/(q(2/5)/q)))/(q(-1/2)/qq/(q(-3)q)q) assuming q is positive. q(-367/110) Simplify ((((t(tt(-2/7)t)/ttt)/t)/(t*5/t))/(t/(t(tt(-1/4))/tt))*(-2/7))/((ttt/(t/(t1/t)))7/((tt(-3))/t(-2/5))) assuming t is positive. t*(-171/10) Simplify (((ff(f(9/5)f)/ffff)/f(1/4))/(f1)(35/2))/(f7/(f/f(1/6)))3 assuming f is positive. f(-589/20) Simplify b(-5)((b*(1/5)/bb)/bb)/bbb/(b(-37)/b)b(-17) assuming b is positive. b(86/5) Simplify (m2)(2/5)/(m*(-1)m)*(1/32)m*(2/7)mm(-1/6)(m/(m/(mm(1/7)/m))m)/(m/(m/(m/m*(-2/33)m))m) assuming m is positive. m(1/770) Simplify (((h/h(-38))/h)/((hh*8)/h))/((hh/(h*(-4/11)h))/h(2/31)) assuming h is positive. h(9787/341) Simplify (qqq*(-2/21)q/q(-2/7))(2/25)/(((q/(q/(q/q(2/11))))/(q/q(1/6)))/(q(1/3))(-7/9)) assuming q is positive. q(1157/103950) Simplify f(-2/23)ff*1/f(f(-1/3)/f)(-25)((f4)(-27))2 assuming f is positive. f(-12541/69) Simplify (w(-1/3)w*(1/2))/(ww*(-2)ww(-3/2))(w*(-1)w*1w)/(w(1/8)/(w(3/5)w)) assuming w is positive. w(497/120) Simplify ((h(-14))(-9)/(hh*7h)8)(7/8) assuming h is positive. h(189/4) Simplify (y(-2/11)y/y(-1/8))(-3/25)((yyy*10y)/(y(-6)/y))12 assuming y is positive. y(527751/2200) Simplify ((g(-2/11)gg((gg(6/13))/g)/g)/(((g/(g/g(3/10)))/g)/ggg4))15 assuming g is positive. g*(-8667/286) Simplify ((s(s*(-1/3)s)/s)*41/(ss((ss*(-2/5))/ss)/sss)(-5/7))/((s(-2/7))(-6/19)/(s0)(-2/7)) assuming s is positive. s(11896/399) Simplify ((x(-3))(-18/5))(-32)/((x/x(2/9))/(xx/(x(1/4)x)x)x/x*0x(-3/4)) assuming x is positive. x(-31039/90) Simplify ((jj(-7)j)/(j/(j*(2/5)j)))/(j(-2/3))27j(-6)/j(-1/3)(j(1/3))(-25) assuming j is positive. j(-3/5) Simplify (t(-1)ttt/(t(2/19)t)(t0)(-1/10))/(t/((tt*4)/t)(t/((t*(2/5)/t)/t))/t(t(-1))(-1/25)) assuming t is positive. t*(1071/475) Simplify (xx/x*(-7)x*(-27/5)(x/(xx/((x/(x(-33)x))/x)))(-32))(-35) assuming x is positive. x34594 Simplify (h13hhh(h*7/h)/hh)(-3/29)/(h(-7/2)h/((h(-9)hh)/h))(1/25) assuming h is positive. h(-3619/1450) Simplify (((r(-1/4)/r)/r6(r(-2))(-1/67))(8/5))(-1/24) assuming r is positive. r*(129/268) Simplify (((((jj*(-4))/j)/jj)/(j/(j/j(-18/11))))/(j12j6))(-13) assuming j is positive. j(2912/11) Simplify ((kk/((k*1k)/k))/(k(1/17)/k))/(k(-1)kkkk/k*3k)(k(-3)/((k/k(-8))/k))(-23) assuming k is positive. k(4317/17) Simplify ((gggg(-3))/g(3/4))*29g/g*(1/2)g/g*(2/11)(gg(2/17))/g(2/11) assuming g is positive. g(-14583/748) Simplify ((bb1)/b)(-27)(b/b(-1/2))(-50)(b*(-2/17)/bbb4b)/(b*(2/5)/(b/(bb(b1/bbb)/b))) assuming b is positive. b(-8459/85) Simplify (r(-4)r*8(rr5/r)/(r(-1/8)/r))/((r(4/7)r)/r(-2/5))35 assuming r is positive. r(-471/8) Simplify (((((z(19/6)z)/z)/(z29/z))49)(-10))(-7) assuming z is positive. z(-255535/3) Simplify ((n(-2/29)n)/(n/n3))10/(nn/(n/n(-6))n/n*(2/7)nn(3/2)nn(-2/11)nn) assuming n is positive. n(126289/4466) Simplify (n(-6/5)/(nn/(n/n*(2/9))))/(nn*5(n/(n*(-8)/n)n)/n)((nn*3n)(12/19))0 assuming n is positive. n*(-829/45) Simplify ccc(cccc/((c(-2/109)ccc)/c)cccc)/cccc(c*43c)/c(ccc(-1/30)c)(3/8) assuming c is positive. c(480741/8720) Simplify (j*(-3)j(-1/3))(-7/6)/(j*(-3)j*(1/3)j*(-6/7)/(jj*0/jj)) assuming j is positive. j*(530/63) Simplify ((b/(bb(-5)))/b)/(b/b(-1/3))((b/(b4b))/b)/bb(2/11)/b(b(1/5)/b(-5))(1/65) assuming b is positive. b(-3359/825) Simplify (p*6ppp*(4/9)pppp(19/5)/p(1/26))39 assuming p is positive. p(17791/30) Simplify ((rrr(2/21))/r(2/13))(-44)/((r1/r)(-17))27 assuming r is positive. r(-23320/273) Simplify ((qq/((q*2q)/q)q)(-1/96)(q2)43)/(((q/(q/(q/((qq/((q/(qq*(2/3))q)/q))/q))))/q(-1/3))/(q(-2/5))(-39)) assuming q is positive. q(48923/480) Simplify ((v*(-10/3)v)/(vv(-28/3)vv))/(v42vv/v13) assuming v is positive. v(-27) Simplify ((aa0)(-49)(a(-2))(1/25))/((aaa/((aa*(-7)/a)/a))/(aa(2/19)))33 assuming a is positive. a*(-178413/475) Simplify (((s/(ss3/s))/s)/s(-2))(-13)/((s0)(1/9))(18/5) assuming s is positive. s*13 Simplify (ww/w*(7/5)w*(4/19)/www(-15)ww(-1/7))(2/39) assuming w is positive. w(-1364/1995) Simplify (h(-3)h(-1/4))(-10/3)(h/(h/((h/((h/h(1/4))/h))/h)h)h)(-26)hh/(((hh*5)/h)/hh)hh0 assuming h is positive. h(7/3) Simplify (((g/(g*(-3)g))/gg(-1/7))/(gg(2/3))(9/7))/((g1)32(g(1/5)g)/gg/g(1/9)) assuming g is positive. g(-10513/315) Simplify (z(-2))21/(z/z4zzz(z/(z/(z/z(-8)z)))/z)(((z(-2/7)/zzzz)/z)/(z/((z*(-4)z)/z)))(-44) assuming z is positive. z(963/7) Simplify ((ttt7/t)/t(2/5))*(1/35)/(((ttt(-2/3)/t)/t)12/(t(-3/4)ttt(-5))) assuming t is positive. t(3127/700) Simplify ((a*(2/5)a(-1/3))/(a3a)(2/75))(1/30) assuming a is positive. a(-1/750) Simplify ((w(-3/2))46ww(-5/4)/ww((w/(w/(wwww*(3/13)ww)))/w)/w)45 assuming w is positive. w(-154485/52) Simplify ((h(-11)/h(8/5))(3/14))(-2/109) assuming h is positive. h(27/545) Simplify (x(1/4)xx7)(-4/9)/((x7/(x/(x(1/5)x)x))/(x1(x/(xx(1/4)))/x)) assuming x is positive. x(-607/60) Simplify (g(-3)/g(-11))(-11)/(g(3/4)/gg*0(((ggg*(-2)/gg)/g)/g)44) assuming g is positive. g(1/4) Simplify ((ttt*1/t)/(tt(1/2)))(-3/11)((t/t13)/t(6/7))(2/11) assuming t is positive. t(-381/154) Simplify ((kk/(k/k(-2/3)))6(k(k((kk(-1))/k)/k)/k)(-20))/((k/k(2/7))10)(2/41) assuming k is positive. k(6214/287) Simplify (((g*(-9)/(gggg*(1/7)gg))(-31/5))(-2/81))(6/25) assuming g is positive. g(-1364/2625) Simplify (h36)(-20/7)/(h(-7/3)(h/(h/h*(-1/2)h))/h) assuming h is positive. h(-4117/42) Simplify (m1)(12/11)/(m5m/(m/m0))(mm(-5)/mmm(-3))/(m0/m(-2/5)) assuming m is positive. m(-622/55) Simplify ((c(-1/2))(-5/2)(c*(-3/4)/c)/cc/((c/(c*(-2/13)/c))/cc)c)/(c(-1/3)/cc(c0/c)/ccc(c/c(-1/3))(3/5)) assuming c is positive. c(-827/390) Simplify w(-1/3)w(2/3)w*(1/2)/www(-5/2)((ww(2/3)w)/ww3)(-2/41) assuming w is positive. w(-233/123) Simplify (g(1/9)/g(-2/13)gg/g(-3)g*(2/23)g)/((gg(-1/3))(14/3)/(gg*(-1/3)g)(-34)) assuming g is positive. g(-47923/897) Simplify (l/(l/l(-1/4)))(41/5)/(l/l0)(1/32)(l/(ll/l*(3/7))l)/(l/l*(-6)l)*(l/((l/l	{ "pile_set_name": "DM Mathematics" }
900)) - -2sqrt(1900)-1-3)22 + -5. -3 Simplify (sqrt(588) + 4sqrt(588) - sqrt(12) - 2sqrt(768))/(1-1-4sqrt(576)). 3sqrt(3)/8 Simplify -4(2 + -4 + -4sqrt(171)2)2-1. 384sqrt(19) + 43792 Simplify (1(1 + sqrt(3) + -1) + sqrt(15)/(-1sqrt(405)))2 - (-4 + sqrt(12) + -1 + 0 + sqrt(300) + sqrt(3) + -2)2. -14948/27 + 182sqrt(3) Simplify ((-1sqrt(189)/sqrt(3) - sqrt(63))-3)/(sqrt(81)/(sqrt(144)/sqrt(4)))23. 72sqrt(7) Simplify (1 + (sqrt(1088) + sqrt(1088) + -2 + sqrt(1088) + 5 - (sqrt(1088) - 4(sqrt(1088) - (sqrt(1088)-1 + sqrt(1088)))) - (4(-3 + sqrt(1088)) + -4)))*2. 640sqrt(17) + 4752 Simplify -5 + -3 + -3sqrt(45)5 - (sqrt(55)/(sqrt(11) - (sqrt(11)-1 + sqrt(11) - sqrt(11))) + 4 - -2-1sqrt(5)6). -67sqrt(5)/2 - 12 Simplify ((-3sqrt(540))/sqrt(9) + sqrt(60) + -1sqrt(8640) + sqrt(60) + sqrt(60))/(-6(sqrt(192) - (4(sqrt(192)-2 - sqrt(192)) + sqrt(192)))). sqrt(5)/24 Simplify 5(-2(sqrt(1331) - (1sqrt(1331)-6)*2) - ((-3sqrt(1331))*2 + -4 + -2)). -110sqrt(11) + 419295 Simplify (sqrt(224)/sqrt(196)-1)/(sqrt(128) + (sqrt(128) - (sqrt(128) - sqrt(128)2))-1) + 3. sqrt(7)/28 + 3 Simplify (-53-3sqrt(288)265 + -3)2 + -5. -194400sqrt(2) + 2099520004 Simplify 3-6(sqrt(17) - (sqrt(1700) + 1)) + 4 - -1(sqrt(833) + 11sqrt(833) + sqrt(833) - (sqrt(833) + 1 + 4)2). -836 + 113sqrt(17) Simplify -4(-2sqrt(68)2)/(-51sqrt(4)) - ((3sqrt(17) + 3)*2 + 51sqrt(17))6. -972 - 706sqrt(17)/5 Simplify 1(-4 + (sqrt(75) - (sqrt(75) - (sqrt(75) + sqrt(75) + 3))) + -5 + -3 + 4) + -5. -10 + 10sqrt(3) Simplify (sqrt(171) + 3sqrt(171)-2 - sqrt(171) - sqrt(171) - (21sqrt(171) - sqrt(171) - sqrt(171)))/(23-2sqrt(9)-6). -7sqrt(19)/72 Simplify 1 + (-1sqrt(1331) + -5 + sqrt(33)/sqrt(768))2 + -1. 875sqrt(11)/8 + 343275/256 Simplify (sqrt(84)-2-4-6)/(-2-2(-3sqrt(192) - sqrt(192))). 3sqrt(7)/4 Simplify ((-1sqrt(2793))/(sqrt(96)/sqrt(8)) + -5 + 6(0 + sqrt(475)))2. -265sqrt(19) + 53471/4 Simplify sqrt(54)/(sqrt(132)/sqrt(11))-556. -225sqrt(2) Simplify (((sqrt(21) + sqrt(84)/(sqrt(8)/sqrt(2)) - sqrt(126)/(sqrt(12)/sqrt(2)))5)/(4-1sqrt(1008)2) + 0)*2. 25/3072 Simplify (2 + (4(sqrt(325) - (sqrt(325) + -4sqrt(325)2)) + -5 + 0 + sqrt(325)2)2)-4. -1502908 + 6800sqrt(13) Simplify -1 + ((sqrt(66) + -4(sqrt(66) + -2sqrt(66)))/sqrt(3))/(-4sqrt(22)/sqrt(2)-4). -1 + 5sqrt(2)/16 Simplify ((sqrt(176)2)2 - sqrt(891)-1)2 + (5 + sqrt(99) + 1)5. 33sqrt(11) + 1438 Simplify (-46(sqrt(52) - sqrt(7488)))/(sqrt(44)/(sqrt(132)/sqrt(588))). 264sqrt(13)/7 Simplify ((sqrt(102)12 + sqrt(102)-1-2)/(sqrt(726) + sqrt(726) + sqrt(726) + sqrt(726) + sqrt(726) + -2sqrt(726)-3))*2. 272/14641 Simplify 3 + -2 + -3(5(sqrt(252) + -1sqrt(252)) - (1sqrt(252) + 5)2) + 3. 180sqrt(7) + 835 Simplify -5(4sqrt(850) - -3sqrt(136)/sqrt(4))/(sqrt(864)/sqrt(12)-4). 115sqrt(17)/24 Simplify (1(-3 + sqrt(171)-3 + 4) - ((sqrt(171) - ((sqrt(171) + -1 - sqrt(171)) + -1)) + (sqrt(171) + 2 + -1 - sqrt(171))))2. 48sqrt(19) + 2740 Simplify 4(-2 + (sqrt(8) + (3sqrt(512) - sqrt(512)) - -4(sqrt(32) - sqrt(8)))/(-41sqrt(144))). -8 - 7sqrt(2)/2 Simplify ((5(3 + sqrt(1539)) + -4)2 - (-4 + (sqrt(1539)-3 - sqrt(1539)) + 5)*2)-5. -69855 - 5310sqrt(19) Simplify 0 + sqrt(1872) + -3 + sqrt(1872) + 0 + (sqrt(1872) + 4 + -3 + -4)2. -48sqrt(13) + 1878 Simplify (1(sqrt(500) + sqrt(500)-2) + (sqrt(500) - 3sqrt(500)-1 - sqrt(500)))/(sqrt(30)/(-4sqrt(3)) - sqrt(40)5). -40sqrt(2)/41 Simplify -6-3(3(1 + sqrt(300) + sqrt(300)5)2-1)2 + 2. 77760sqrt(3) + 6999050 Simplify ((4 + -5(1 + -3 + -1sqrt(847)-1 + (sqrt(847) - (1sqrt(847)1 - sqrt(847)))) + -5)2)*2. -7920sqrt(7) + 339124 Simplify 3((0 + (sqrt(1700) - (sqrt(1700) + sqrt(1700) + 1sqrt(1700) + sqrt(1700) + -4)) - sqrt(1700)-211) + 2). -30sqrt(17) + 18 Simplify 2(-4 + -4 + (-3(-1sqrt(156) - sqrt(156)))/(2sqrt(192))). -16 + 3sqrt(13)/2 Simplify -4((sqrt(19) + 3 + -3 - (sqrt(19) + (sqrt(19)-5 - sqrt(19))6 - sqrt(19))) + 0 + 3 + sqrt(19)-1 + 5). -144sqrt(19) - 32 Simplify -4 + (-3-4sqrt(8640))/(sqrt(24)/(sqrt(242)4 + sqrt(242))). -4 + 7920sqrt(5) Simplify (sqrt(11) - sqrt(33)/(sqrt(3)-1) - (sqrt(891) + -5)) + ((-4 + sqrt(275) + -2)2 - sqrt(275))3. -202sqrt(11) + 938 Simplify (-1(sqrt(77)5 - sqrt(77) - sqrt(77)) + sqrt(77) + 1sqrt(77)-5)/((-6sqrt(70)/sqrt(2))/(sqrt(5) + sqrt(5) + (sqrt(45)-1)/sqrt(9))). 7sqrt(11)/6 Simplify 2-4((-5(sqrt(288) + 0 - sqrt(288)) + 2)2 + (-5 + (sqrt(6)/sqrt(3))2 - sqrt(48)/sqrt(6))). -8 + 16sqrt(2) Simplify -2(sqrt(110)/sqrt(99))/sqrt(5) + ((2sqrt(16) - sqrt(16))-5)/(1-2sqrt(8)). 11sqrt(2)/6 Simplify 5(0 + sqrt(567)) + -2(2sqrt(567) + sqrt(567)) + (0 + sqrt(567) + -2 + 0)2 + 0. -45sqrt(7) + 571 Simplify 0 + (-1(-62sqrt(968) + sqrt(968)))/((sqrt(144) - (1sqrt(144)-5 + sqrt(144) + sqrt(144) - sqrt(144) - sqrt(144)))4). 121sqrt(2)/144 Simplify -5 + 0 + ((1 + sqrt(3328) + sqrt(52)-2 + -2)*2 - (sqrt(117) + 3 - (1 + sqrt(325) + sqrt(325)))). -17sqrt(13) + 1866 Simplify ((2-1sqrt(121)15)/(sqrt(176)4 + sqrt(11) + (sqrt(99) - (sqrt(99) - (sqrt(99)-2 + sqrt(99) + sqrt(99))))/sqrt(9)))*2. 1100/289 Simplify -1(-6(2 + -5 + sqrt(7)1-2 - (1-1sqrt(7) - (1 + sqrt(42)/sqrt(6)))))2. -144 Simplify 3 + ((sqrt(432)-1 - sqrt(432)) + sqrt(3) + -3(sqrt(3) - (2 + sqrt(3))))2 + (-2 + sqrt(3) + -1 - sqrt(3) - (sqrt(108)/sqrt(3))/sqrt(12)). -277sqrt(3) + 1623 Simplify (3sqrt(85)1 + 21sqrt(85))/(1sqrt(40)/sqrt(2)). 5sqrt(17)/2 Simplify 4(((-2sqrt(72) + sqrt(72))-5)/sqrt(6))/((sqrt(64) - sqrt(64)-2)2) + 5. 5sqrt(3)/6 + 5 Simplify 2(sqrt(3456) + sqrt(3456) + sqrt(3456) + (sqrt(3456) + (sqrt(3456)-1 - sqrt(3456)) + sqrt(3456))-3 + sqrt(3456) - sqrt(3456))/(4-3sqrt(1728)). -sqrt(2)/2 Simplify 2((sqrt(209)/sqrt(176) - ((sqrt(19) - (2 + -1sqrt(19))) + sqrt(19)))2 - 3(1 + sqrt(76) + sqrt(19) + ((sqrt(19) + 1)2)2)). -88sqrt(19) - 1525/8 Simplify (-4(6(sqrt(252) + 2) + sqrt(252) + 2 + 3 + sqrt(252)) + -5)*2. 28032sqrt(7) + 263377 Simplify (2(sqrt(126)/(sqrt(22)/sqrt(176)))/(sqrt(108)/(3sqrt(192)))-1)2. 64512 Simplify (sqrt(140)/(-2sqrt(7)) + sqrt(60)/sqrt(3)3)24 - (((sqrt(20) - 3sqrt(320)) + -3)2 + 0). -1929 - 132sqrt(5) Simplify (-4(sqrt(495) + 3sqrt(495)-6 + sqrt(495))/(sqrt(11) - sqrt(66)/((sqrt(24)/sqrt(4) + sqrt(6) - sqrt(6)) + sqrt(6)) - sqrt(11))1)*2. 737280 Simplify (-6sqrt(132)/sqrt(48) + -3 + (sqrt(1331) + -3)6-6 + 1)*2. -84588sqrt(11) + 1762447 Simplify 2 + -3(4((2sqrt(72) + sqrt(72) + sqrt(72) - sqrt(72))4)/(-2-2sqrt(100)))*2. -7726/25 Simplify 4(2 + 564(sqrt(133)-1)/sqrt(7)6) + -5. -2880sqrt(19) + 3 Simplify -1(-4 + 1sqrt(17) + -1 + sqrt(272) - (-3sqrt(187)1)/(sqrt(11)21))*2. -2973/4 + 65sqrt(17) Simplify (((1sqrt(1536))/sqrt(6))/(3sqrt(6)/sqrt(3)-6)3)*2. 32/9 Simplify ((sqrt(136)25 - (6(sqrt(136) + (-2sqrt(136) + sqrt(136) - sqrt(136))) - sqrt(136)))/(1sqrt(128)2))2. 4913/64 Simplify 0 + (-4-1(sqrt(3) + (sqrt(3) - sqrt(3)2)))*2 + (sqrt(180)/sqrt(5)6 - sqrt(36) - sqrt(36))/(sqrt(12) - (sqrt(768) + sqrt(768)-2 + sqrt(768))). 4sqrt(3) Simplify (-5(sqrt(315)-2 - sqrt(315)) - (2(sqrt(315) + sqrt(315)-1) + sqrt(315)))/(2sqrt(720)-3). -7sqrt(7)/12 Simplify (4(sqrt(63)/(sqrt(9) - sqrt(225))-1 + (-5 + (sqrt(7) - (sqrt(7) + 0) - sqrt(7)) - 2sqrt(1008))) + 1)*2. 3762sqrt(7) + 68968 Simplify (sqrt(5040)-1 + sqrt(5040) + sqrt(5040) + -32sqrt(35))/((sqrt(480)/(sqrt(1452) - sqrt(12)))/sqrt(8)). 60sqrt(7) Simplify 4(-2(-4(-2sqrt(1377) + sqrt(1377))3 - ((-1 + sqrt(1377))1 + 4)))*2. -9504sqrt(17) + 2666016 Simplify (-5 + sqrt(40)/sqrt(5) + 3)*2 - -4((sqrt(1944) - sqrt(24))3)/sqrt(12). 12 + 88sqrt(2) Simplify (sqrt(1008) + (sqrt(1008) + 1)*2 + sqrt(1008))3-1 + ((sqrt(21) + sqrt(42)/sqrt(2) + sqrt(21))/sqrt(3) - ((sqrt(7)4)*2 + 2)). -3141 - 141sqrt(7) Simplify -3((4(sqrt(136)-1 + sqrt(136)) - -1sqrt(136)-1)/(2sqrt(968) + (sqrt(128) - (sqrt(128)2 - sqrt(128)))))2. -51/484 Simplify (6(sqrt(1764) + -1-1sqrt(1764)))/((sqrt(12) - sqrt(432)1 - (sqrt(972)1 + sqrt(972) - sqrt(12)))-2)3. 63*sqrt(3)/11 Simplify -5 + 0 + (-4 + ((2 +	{ "pile_set_name": "DM Mathematics" }
and (488 - 488 + 22s)(3s - 4s + 2s). 22s*2 Expand (-9 + 4 - 9)(4c3 - 10 + 10). -56c*3 Expand (0v - 4v + 3v)(9 - 7 + 5). -7v Expand 11 - 11 + 3d + (d - 4d + 4d)(-1 + 5 - 3) + 2d - 1 + 1. 6d Expand 5d3 - d3 - 2d*3 + (-4d*2 - 2d*2 + 5d*2)(-4d + d + d) + 31d*3 - 29d*3 - 30d*3. -24d*3 Expand (-1 - f + 1)(-3 + 1 + 1) + (-1 + 0 + 0)(0 + f + 0) - 2f + f + 3f + 3f - 6f + 4f. 3f Expand (-b + 0b - 2 + 0b)(5 - 2 + 0). -3b - 6 Expand (-5c*2 - 2c*2 + 5c*2)(2 + 2 - 5) - 6c2 - 4c2 - c2 + 0c2 + 0c*2 - 5c*2. -14c*2 Expand (2 - 3 - 5)(-x*4 - 4x*4 + 4x*4). 6x*4 Expand (-4 + 0 - 3)(s3 - s3 - s*4). 7s*4 Expand (-n + 3n + 2n4 - 3n)(-2 + 1 + 2)(-4 - 1 + 8). 6n4 - 3n Expand n2 - n2 + 3n4 + (3n - 2n + 0n)(-5n*3 + 2n3 + n3). n*4 Expand (19p - 7p3 - 19p)(-3 - 1 + 3 + (0 + 5 - 4)(-3 + 4 - 2) + 2 + 2 - 5). 21p3 Expand (-s3 + 0s*3 + 3s*3)((4 - 1 - 4)(4s*2 - 3s*2 - 2s*2) + 2s2 - s2 + s*2). 6s5 Expand (0 + 0 - c3)(5c*2 - 9c + 7c + 0c). -5c5 + 2c*4 Expand (2 + 12 + 5)(-2j5 + 6j*5 - 3j*5). 19j*5 Expand (2d*2 - 2d2 + d3)(-1 - 3 + 2) - 2d3 + d3 - d*3 + (-3d - 2d3 + 3d)(1 + 4 - 4). -6d*3 Expand 0r*2 - 2r2 + r2 + (2r2 + 3r*2 - 4r*2)(4 - 6 - 2) + 14r2 + 13r*2 - 38r*2. -16r*2 Expand (0 + 2j + 0)(j - 4j - 2j + (4j - 3j + j)(1 + 1 - 1)). -6j2 Expand (-3m - 2 + 2)(5 - 5 + 2) + (-3 + 20 - 13)(-3m + 3m - m). -10m Expand (-3m - 3m + 4m)((0 - 2 + 1)(15 - 15 + 12m) - 2m + m + 0m). 26m2 Expand -j2 - 1 + 1 + (-19 - 24j + 19)(-4 + 4 + 2j). -49j*2 Expand (2 + 3 + i - 6)(5i + 0i - 2i). 3i*2 - 3i Expand (3l - 4 + 4 + (2l + 2l - 2l)(3 - 1 - 3))(l*2 + 13l*2 + 0l*2). 14l*3 Expand (b + 2b - 4b)(-3 - 1 - 3)(b2 + b2 - 3b*2). -7b*3 Expand (-3a*3 - 4a*3 - 11a*3)(4a2 - 3a*2 - 3a*2). 36a*5 Expand 0s2 + s3 + 0s2 + (3 - 3 + 2s*2)((-s - 3s + 2s)(-3 + 0 + 5) - 3s - s + 2s + (0 - 1 - 1)(s - 3s + 4s)). -19s3 Expand (-2d + 3d - 3d)(-d + d3 + d) + 87d*4 + 32d*2 - 8d*2 - 86d4. -d4 + 24d2 Expand -2t*5 + 3t - 3t + (-6t*4 + 0t*4 + 2t*4)(-t - t - t). 10t5 Expand (-13q*3 - 13q*3 + 5q*3)(-3q + 4q - 3q). 42q*4 Expand 25 + u + 8 + 10 - u + 0u + 0u + 2u - 4u + 3u - 2u + 2u + u - 4u + 3u + 3u + (-3 + 3 + u)(-3 + 0 + 2). 3u + 43 Expand ((1 - 1 + h)(0 + 0 - h2) - h3 - h*2 - 2h*3 + 2h*3)(2h + 3h + 0h). -10h*4 - 5h*3 Expand (5l + l - 4l)(-l + 5 - 5) - 507l - 4l*2 + 507l - 1 + 1 + 2l2. -4l*2 Expand (-4 + 2g + 2g5 + 4)(10 - 3 + 2). 18g5 + 18g Expand (-1 - 4 + 3)(-2 + 2 + 2s*2) + 7s*2 + 6s*2 + 2s*2. 11s*2 Expand (3l + 2l5 - 3l)(-16 - 13 - 2). -62l*5 Expand (5t*4 + 7t*4 + 3t*4)(6 - 2 - 3). 15t4 Expand (4f - 4f + f)(-12 + 4 - 3). -11f Expand (-1 - 2 + 2)(4l - l - l)(-1 - 3 + 2). 4l Expand (3 + o - 2 + o)(-1 + 6 - 3). 4o + 2 Expand (l3 - l3 - 2l*4)(6 - 2 + 6). -20l4 Expand -2f + f - 3f + (5 - f - 5)(1 - 1 + 1). -5f Expand (-2y*3 + 3y*3 - 2y*3)(2y - 1 - 8y + 2). 6y4 - y3 Expand (-3w*3 - 21w*3 + 6w*3)(2 - w - 2 + (1 + 3 - 2)(-3w + 2w + 2w) + 3w - 7w + w). 36w4 Expand (2n - n + n)(-17n - 26 + 26)(0 - n2 + 0). 34n*4 Expand 722m*4 + 2m*5 - 722m4 + 1 - m3 + (-4m2 - 3m*2 + 5m*2)(3 - 2m3 - 3). 6m5 - m3 + 1 Expand (1 - 1 - 3s3 + (-1 + 2s + 1)(s2 - 6s*2 + 4s*2) - 4s*3 + 2s*3 + 3s*3)(3s2 - 3s*2 - 2s*2)(2 + 1 - 4). -8s5 Expand 4g3 - 1 + g5 - 4g3 + (g2 - g2 - 2g*4)(g - g - 2g) - 21g*5 - 29g*5 - 17g*5. -62g*5 - 1 Expand 3r*5 + 0r5 - r5 + (-r + 3r + 0r)(141 - 10r*4 - 141). -18r*5 Expand (-2 + 2 - 1)(4h - 6h + 0h)(-3h - 3h + 3h)(2 + 1 - 1). -12h2 Expand 24g*2 - 24g*2 - 17g*3 + (5g + 0g - 3g)(2g*2 + 2 - 2). -13g*3 Expand (-2d + 4d + 0d)(-7d + 45d - 18d). 40d2 Expand (2 - 3 + 2)(2i + 2i - 7i)(-2 - i + 2). 3i2 Expand 5n - 5n - n4 + (3n + 2n - 6n)(0 + 2n*3 + 0) + 2n*4 - 6n*4 + 3n*4. -4n4 Expand (-3 + 3 - d2)(4d - 3d + d)(-1 - 3 + 2). 4d3 Expand (-i2 + 4i*2 - 4i*2)(6 + 2 + 1) - 3i2 + i2 + 4i*2 + (-i - 3 + 3)(0i + 0i + i). -8i2 Expand (0o + 3o4 + 0o)(-2o - 3o + o). -12o*5 Expand (1506 + 50k*3 - 1506)(0k + k + k) + (-2k*2 + 2k*2 - 2k*2)(-2k + 2k*2 + 2k) + 0 + 3k4 + 0. 99k*4 Expand (1 - 3 + 0)(-59 + 59 + 11h). -22h Expand (-4r3 + 2r*3 + 3r*3)(0r + 0r - 2r) + (5r - 3r - 4r)(-2r*3 + 5r*3 - 4r*3) + 0r*4 + 4r*4 - 3r*4 + 0r*3 + 4r*4 + 0r*3. 5r*4 Expand (-b - b + 21 - 25)(3b + 0b - 2b). -2b*2 - 4b Expand -i4 + i4 + i*4 + 0i*4 + 2i*4 + 0i*4 + 0i4 - i4 + 2i4 + (3 - 3 + 2i*3)(1 - 1 + 2i) - 3i*4 - 3 + 3. 5i*4 Expand (0p + 7p - 2p)(0p + 5p + 4p). 45p2 Expand (3u*2 - 3u*2 + 3u*2)(-1 + 1 - 3)(-3u - 2u + 7u). -18u3 Expand (-2 - q2 + q3 + q2)(-30q2 + 20q*2 - 32q*2). -42q*5 + 84q*2 Expand (4k - 3k - 3k)(0k*3 - 5k*3 + 2k3) - 1 - k4 + 1. 5k4 Expand (d4 - 3d4 + d4)(2d - d - 3d + (2 - 2 - 1)(6d - 6d + 4d) + 2d + 3d - 6d). 7d5 Expand (8x*2 - 5x*2 + 2x*2)(-1 - 2x2 + 1) + (-x2 + 1 - 1)(-6x2 - 4x + 4x). -4x*4 Expand (-4s - 3s + 8s + 3)(2s - 5s + 0s). -3s2 - 9s Expand (2t3 - 10t*2 + 0t*3 + 12t*2)(-27t + 27t - 4t2). -8t*5 - 8t*4 Expand (-2o*4 + 2 - 2)(2 + 2o - 2) - 12169o + 12169o + 69o4 - o5. -5o5 + 69o*4 Expand 4s + 2s - 4s + (-3 - 1 + 1)(-3s - 3s - 2s). 26s Expand (-5 + 4 + 3)(-2c4 + 3c*4 + 0c*4). 2c*4 Expand (2g*2 - 3g*2 + 8g*2)(g*2 + 3g2 - g2). 21g4 Expand (-3m*2 + 0m2 + m2)(-4 + 4 - 2m) + 279m2 - 563m*2 + 277m*2 - 2m*3. 2m*3 - 7m*2 Expand (5g*2 - 5g*2 - 28g*2)(-1 + 2 - 3). 56g2 Expand ((2x*2 - 2x*2 + 2x*2)(3x + x - 2x) + 3x3 - x + x)(-2x2 + 5x2 - x2). 14x5 Expand (2n - 4n + 0n)(-1 + 2 + 0)(3 - 6 - 4). 14n Expand (5s*2 + 0s*2 - 4s*2)(4s3 + 21s - 21s + 1). 4s5 + s2 Expand -d*4 + 4d*4 - 5d4 + d4 - d*4 + 2d*4 + (-7d*3 + 3d*3 + 2d*3)(d - d - d) - 2d4 - d4 + 0d*4 + (-3 + 2 + 0)(0d - 2d*4 + 0d). d4 Expand (1 + v3 - 1)(-12 + 10 - 13). -15v*3 Expand -2r*3 + 2r*3 - 3r*3 + 4r*3 + 3r*3 - 5r*3 + (r + 2r - r)(r + 2r*2 - r). 3r*3 Expand -2o*4 + 3o*2 - 3o*2 + (0o3 - o3 + 0o3)(0o - o + 0o). -o*4 Expand (0 - 3 + 0)(7g - 7g + 18g). -54g Expand (2j2 - 2j2 - j3 + (-3j3 - j3 + 2j*3)(-1 - 2 + 1))(-6 + 1 - 18). -69j*3 Expand (8k - k - 10k - 3)(-1 + k*2 + 1). -3k*3 - 3k*2 Expand (-2s + 0s + 0s)(-3s + 3s + 2s4) + (s2 + s - s)(s + s3 - s) - 3s*5 + 4s*5 - 3s*5. -5s5 Expand n3 + 6n + 1 - 6n + (-2n - 3 + 3)(3 + 8n2 - 3). -15n*3 + 1 Expand (f - f - f)(-f*2 + 2f - 2f) + 3f*3 - 2f3 + f3 - f*3 + 2f3 + f3 + 3f2 + f3 - 3f*2 + 312f - 312f - 2f*3. 4f*3 Expand (-6x + 2x + 3x)(7x - 3x - 3x). -x*2 Expand (-3r + r + r)(-4 + 4 + r)(2 - 4 + 5)(2r + 5r - 4r). -9r3 Expand (-4f + 28f2 + 4f)(-f2 + 0 + 0). -28f*4 Expand 0n3 - n4 + 0n3 - n4 - 2n + 2n - 5n4 + n4 + 5n4 + (7n*3 - 2n*3 - 4n*3)(-4n + 3n + 3n) + 4n*4 - 1 + 1. 5n*4 Expand -3i*5 + 60i*5 + 28i*5 + (4i + i - 3i)(2i4 - 5i*4 + 2i*4). 83i*5 Expand (2q*2 - 17q + 17q)(1 + q - 1)(6 - 2 - 2). 4q3 Expand v5 - 6 + 6 + (v*3 - 2 + 2)(8v - 8v - 5v2) + 4 - v5 - 4 + (-v2 + 0v*2 + 3v*2)(v3 + v3 + 0v3). -v5 Expand r5 - r5 - r5 + (71r*4 - 48r + 92r - 43r)(0 + 0 - r). -72r5 - r2 Expand (-w + 3 - 3)(-2 + 2w + 6 - 15). -2w2 + 11w Expand 2w3 + w2 + 2w*2 + 8w*2 + (w + w - 4w)(2w*2 - 2w*2 + 2w*2). -2w*3 + 11w2 Expand -s2 - 20s2 - 1 + 34s*2 + (2s + s - 2s)(-s - s - s). 10s2 - 1 Expand (0 + 2t + 0)(3t - 5*	{ "pile_set_name": "DM Mathematics" }
rob of picking 2 b. 5/17 Two letters picked without replacement from {u: 1, g: 1, z: 2, f: 3, t: 5}. What is prob of picking 1 z and 1 t? 5/33 Three letters picked without replacement from pqlggqg. What is prob of picking 3 g? 1/35 What is prob of picking 1 g and 1 e when two letters picked without replacement from {a: 1, e: 1, g: 1, i: 1, k: 2, r: 1}? 1/21 What is prob of picking 1 r, 2 v, and 1 y when four letters picked without replacement from {v: 7, r: 2, j: 2, y: 1}? 14/165 What is prob of picking 2 j when two letters picked without replacement from jjjjjjjjjjjjjjjjjzjj? 9/10 Four letters picked without replacement from qqhqcxcqn. What is prob of picking 2 q, 1 n, and 1 c? 2/21 Four letters picked without replacement from {g: 13, y: 1, o: 2, b: 1, n: 3}. What is prob of picking 1 n, 1 y, and 2 o? 1/1615 What is prob of picking 2 f, 1 t, and 1 g when four letters picked without replacement from {n: 3, w: 3, f: 4, k: 4, g: 2, t: 1}? 3/595 Two letters picked without replacement from {g: 3, l: 3}. What is prob of picking 2 g? 1/5 Three letters picked without replacement from {p: 2, g: 4, r: 3, k: 1, b: 3, l: 2}. What is prob of picking 2 b and 1 g? 12/455 Three letters picked without replacement from evvbybvbvbv. What is prob of picking 1 b, 1 v, and 1 y? 4/33 What is prob of picking 2 g, 1 p, and 1 q when four letters picked without replacement from {e: 1, j: 4, p: 7, n: 1, q: 1, g: 4}? 7/510 Two letters picked without replacement from cmimicmcvgi. Give prob of picking 1 g and 1 m. 3/55 Three letters picked without replacement from lgllgl. Give prob of picking 2 l and 1 g. 3/5 What is prob of picking 4 t when four letters picked without replacement from ttlltllllllllllltl? 1/3060 Two letters picked without replacement from jfjufjujfjuuguj. Give prob of picking 1 g and 1 j. 2/35 Calculate prob of picking 1 o and 2 q when three letters picked without replacement from {w: 2, h: 2, q: 7, o: 1}. 21/220 Two letters picked without replacement from iiiiiitimt. What is prob of picking 2 i? 7/15 Two letters picked without replacement from gfggggf. What is prob of picking 2 f? 1/21 Calculate prob of picking 1 s and 1 p when two letters picked without replacement from swplbllll. 1/36 Two letters picked without replacement from oooipodpppood. Give prob of picking 1 o and 1 d. 2/13 Calculate prob of picking 1 n and 2 g when three letters picked without replacement from {n: 8, g: 5}. 40/143 Four letters picked without replacement from tktttkkkkttktkkk. Give prob of picking 2 k and 2 t. 27/65 Four letters picked without replacement from ulfluuuuvuupuyyulyu. What is prob of picking 2 u, 1 p, and 1 y? 45/1292 Two letters picked without replacement from {y: 18, n: 1}. Give prob of picking 2 y. 17/19 Four letters picked without replacement from occooooc. What is prob of picking 4 o? 1/14 Calculate prob of picking 3 g when three letters picked without replacement from eexegeegeegggeeggeg. 56/969 What is prob of picking 1 c and 3 x when four letters picked without replacement from cxxxxxxxc? 5/9 Calculate prob of picking 2 a when two letters picked without replacement from qlxaaqaqaqqxqaqqan. 5/51 Two letters picked without replacement from bfbfbebezeebebf. What is prob of picking 1 b and 1 e? 2/7 Two letters picked without replacement from {d: 9, u: 1, y: 1}. Give prob of picking 1 u and 1 y. 1/55 Two letters picked without replacement from rhelo. What is prob of picking 1 h and 1 l? 1/10 What is prob of picking 3 u when three letters picked without replacement from uuuukpupuykmp? 10/143 What is prob of picking 2 b when two letters picked without replacement from aababbaa? 3/28 What is prob of picking 1 c and 1 a when two letters picked without replacement from {a: 2, c: 4}? 8/15 Four letters picked without replacement from nnenddd. What is prob of picking 1 n and 3 d? 3/35 What is prob of picking 1 l and 1 j when two letters picked without replacement from {j: 5, l: 5}? 5/9 Four letters picked without replacement from wyutuuuuyuywutywy. What is prob of picking 2 w and 2 y? 3/238 What is prob of picking 2 q, 1 k, and 1 j when four letters picked without replacement from qkeeeeenjkekekeq? 1/455 Three letters picked without replacement from yvysxovyosfxvoyf. What is prob of picking 2 x and 1 v? 3/560 Four letters picked without replacement from {h: 6, m: 6}. Give prob of picking 1 h and 3 m. 8/33 What is prob of picking 2 z when two letters picked without replacement from izzjizjz? 3/14 Three letters picked without replacement from wpwpcpp. What is prob of picking 1 p and 2 w? 4/35 Two letters picked without replacement from trtttttrttrt. Give prob of picking 2 r. 1/22 Calculate prob of picking 1 p, 1 n, and 1 i when three letters picked without replacement from {p: 2, r: 1, s: 2, n: 4, i: 1}. 1/15 Two letters picked without replacement from {i: 6, d: 3, y: 2, c: 2, t: 1, n: 1}. What is prob of picking 1 n and 1 i? 2/35 Two letters picked without replacement from {g: 2, y: 10}. What is prob of picking 2 y? 15/22 What is prob of picking 1 j, 1 r, and 2 q when four letters picked without replacement from rrrjjrrqq? 5/63 Calculate prob of picking 1 s, 1 q, and 1 r when three letters picked without replacement from {k: 4, r: 1, t: 1, s: 1, q: 1}. 1/56 Four letters picked without replacement from {h: 2, q: 1, b: 2, x: 1}. What is prob of picking 1 x, 1 b, 1 h, and 1 q? 4/15 Calculate prob of picking 2 k and 2 h when four letters picked without replacement from klhkllhh. 3/70 Calculate prob of picking 1 e and 1 u when two letters picked without replacement from uule. 1/3 Calculate prob of picking 1 u, 1 f, 1 l, and 1 b when four letters picked without replacement from {u: 1, d: 2, l: 1, b: 3, f: 2, h: 3}. 2/165 Calculate prob of picking 1 y, 1 n, 1 l, and 1 q when four letters picked without replacement from sgyqnssnyyssl. 6/715 Calculate prob of picking 2 v when two letters picked without replacement from tvvv. 1/2 Four letters picked without replacement from {q: 5, j: 3, k: 3, w: 2, h: 3}. What is prob of picking 2 k and 2 w? 3/1820 Calculate prob of picking 3 r when three letters picked without replacement from rreererrrrrrrrrrrrrr. 34/57 Four letters picked without replacement from uqiccic. Give prob of picking 2 i, 1 c, and 1 q. 3/35 Three letters picked without replacement from bnxpenfxexnene. Give prob of picking 1 f, 1 n, and 1 x. 3/91 Four letters picked without replacement from fiwwwhfwhi. What is prob of picking 2 f, 1 h, and 1 i? 2/105 Calculate prob of picking 1 h and 1 m when two letters picked without replacement from ehheheemhhmeh. 2/13 What is prob of picking 2 k, 1 c, and 1 z when four letters picked without replacement from {p: 2, z: 3, k: 5, c: 1, l: 1, e: 3}? 2/91 Two letters picked without replacement from {d: 2, i: 1, g: 2, b: 1, r: 1, x: 1}. What is prob of picking 1 x and 1 r? 1/28 Three letters picked without replacement from {e: 4, z: 2, d: 3}. What is prob of picking 2 d and 1 e? 1/7 Calculate prob of picking 1 p and 2 x when three letters picked without replacement from pcpxycxppccpxxxcx. 15/136 Four letters picked without replacement from wowjybkyo. Give prob of picking 2 o, 1 j, and 1 b. 1/126 Four letters picked without replacement from {j: 1, s: 9, w: 4, h: 2}. What is prob of picking 2 w, 1 s, and 1 j? 27/910 Three letters picked without replacement from httqqqqhtqhqqquqquut. Give prob of picking 3 u. 1/1140 Two letters picked without replacement from {z: 3, j: 3, q: 1, u: 2, w: 2, f: 3}. What is prob of picking 1 u and 1 f? 6/91 Three letters picked without replacement from vdxoe. Give prob of picking 1 x, 1 v, and 1 e. 1/10 Calculate prob of picking 1 o and 2 m when three letters picked without replacement from mooommooommmommmoo. 27/68 Two letters picked without replacement from ytyk. Give prob of picking 1 y and 1 k. 1/3 Two letters picked without replacement from tsktp. What is prob of picking 1 t and 1 p? 1/5 What is prob of picking 2 i when two letters picked without replacement from iiiiiiihiiii? 5/6 Calculate prob of picking 1 y and 3 z when four letters picked without replacement from {n: 1, u: 1, y: 4, z: 5, r: 1}. 8/99 Two letters picked without replacement from sssdsssdsssssd. What is prob of picking 2 s? 55/91 Calcul	{ "pile_set_name": "DM Mathematics" }
tor of 43/16 and 73/21384? 42768 Calculate the common denominator of 67/40 and 61/10. 40 What is the common denominator of 41/14 and 7/1886? 13202 What is the common denominator of -43/2 and -137/6? 6 Calculate the common denominator of 117/98 and 69/134. 6566 Calculate the smallest common multiple of 345 and 207. 1035 What is the least common multiple of 333 and 9? 333 Calculate the smallest common multiple of 30 and 70. 210 Calculate the smallest common multiple of 1887 and 30. 18870 Calculate the smallest common multiple of 2443 and 126. 43974 What is the common denominator of -4/15 and -22/5? 15 Calculate the least common multiple of 13 and 10. 130 Calculate the least common multiple of 48 and 24. 48 What is the least common multiple of 630 and 567? 5670 Find the common denominator of -83/231 and 41/264. 1848 What is the smallest common multiple of 6 and 328? 984 What is the lowest common multiple of 5400 and 144? 10800 What is the smallest common multiple of 176 and 3432? 6864 What is the smallest common multiple of 1524 and 4? 1524 Calculate the smallest common multiple of 5544 and 660. 27720 Calculate the lowest common multiple of 231 and 1218. 13398 Find the common denominator of 73/81 and -115/72. 648 What is the least common multiple of 56 and 8? 56 What is the common denominator of 45/7 and -111/14? 14 Calculate the common denominator of 13/16 and 79/1764. 7056 Calculate the lowest common multiple of 585 and 3. 585 What is the least common multiple of 100 and 100? 100 Calculate the common denominator of -119/110 and -17/1805. 39710 Find the common denominator of 13/66 and 73/60. 660 What is the common denominator of -35/486 and -89/72? 1944 Calculate the common denominator of -9/23 and 57/226. 5198 Calculate the common denominator of -79/220 and 45/44. 220 Calculate the common denominator of -97/456 and 73/171. 1368 Calculate the smallest common multiple of 42 and 84. 84 What is the lowest common multiple of 88 and 304? 3344 Calculate the smallest common multiple of 762 and 60. 7620 Calculate the common denominator of 40/21 and 37/19. 399 What is the lowest common multiple of 50 and 385? 3850 Calculate the common denominator of -51/256 and 79/176. 2816 What is the smallest common multiple of 96 and 132? 1056 What is the smallest common multiple of 1307 and 9? 11763 Calculate the lowest common multiple of 4408 and 209. 48488 Calculate the lowest common multiple of 2 and 774. 774 Calculate the common denominator of 71/4575 and -57/35. 32025 What is the common denominator of 28/417 and -41/10? 4170 What is the smallest common multiple of 18 and 39? 234 Calculate the common denominator of 19/204 and 143/204. 204 What is the common denominator of 43/36 and -38/27? 108 What is the common denominator of -3/170 and 37/255? 510 Find the common denominator of 43/994 and -9/781. 10934 Calculate the common denominator of 73/225 and -76/9. 225 What is the smallest common multiple of 8 and 45? 360 What is the common denominator of 35/16 and -65/318? 2544 What is the lowest common multiple of 7032 and 8790? 35160 What is the least common multiple of 10 and 7654? 38270 Calculate the least common multiple of 342 and 190. 1710 Find the common denominator of 35/2 and 65/88. 88 What is the least common multiple of 2307 and 11? 25377 What is the common denominator of 13/1462 and -97/8? 5848 What is the smallest common multiple of 72 and 3? 72 What is the smallest common multiple of 300 and 7680? 38400 Find the common denominator of -45/1444 and 70/57. 4332 Calculate the common denominator of -103/6 and -67/174. 174 Calculate the least common multiple of 6786 and 4147. 74646 Calculate the common denominator of -61/196 and -97/252. 1764 Calculate the smallest common multiple of 28 and 28. 28 Find the common denominator of -29/98 and -73/28. 196 Calculate the lowest common multiple of 14 and 154. 154 Calculate the least common multiple of 375 and 375. 375 Find the common denominator of 47/280 and 27/2380. 4760 Calculate the lowest common multiple of 1668 and 72. 10008 Calculate the smallest common multiple of 872 and 10. 4360 Calculate the smallest common multiple of 748 and 17. 748 Calculate the common denominator of -13/430 and 109/2322. 11610 Calculate the lowest common multiple of 346 and 162. 28026 Find the common denominator of 55/6 and -13/2373. 4746 Calculate the common denominator of 97/56 and 23/40. 280 Find the common denominator of 35/18 and -29/219. 1314 Calculate the common denominator of -187/390 and -11/18. 1170 Calculate the smallest common multiple of 6 and 3. 6 What is the lowest common multiple of 42 and 35? 210 What is the lowest common multiple of 105 and 1407? 7035 Calculate the common denominator of -39/55 and 62/55. 55 What is the common denominator of -25/84 and 34/9? 252 Calculate the smallest common multiple of 80 and 8. 80 Calculate the least common multiple of 160 and 240. 480 Calculate the smallest common multiple of 32 and 64. 64 Calculate the lowest common multiple of 9 and 638. 5742 Calculate the lowest common multiple of 1222 and 54. 32994 Find the common denominator of 13/72 and -53/2520. 2520 What is the smallest common multiple of 7 and 393? 2751 What is the common denominator of 13/33 and 115/54? 594 Calculate the smallest common multiple of 50 and 20. 100 What is the lowest common multiple of 672 and 120? 3360 Find the common denominator of -61/444 and 27/74. 444 Find the common denominator of -62/9 and 25/13. 117 What is the least common multiple of 550 and 50? 550 Find the common denominator of -48/1955 and 32/17. 1955 What is the smallest common multiple of 408 and 156? 5304 Calculate the lowest common multiple of 1961 and 1. 1961 What is the least common multiple of 187 and 187? 187 Find the common denominator of 143/162 and 131/342. 3078 Find the common denominator of -63/220 and 26/7. 1540 Calculate the lowest common multiple of 99 and 1188. 1188 Calculate the least common multiple of 112 and 1. 112 Calculate the least common multiple of 1028 and 100. 25700 What is the lowest common multiple of 108 and 576? 1728 What is the common denominator of -31/52 and -70/39? 156 What is the lowest common multiple of 1271 and 310? 12710 What is the smallest common multiple of 616 and 36? 5544 What is the common denominator of -157/2490 and -109/18? 7470 Calculate the lowest common multiple of 4 and 125. 500 Calculate the common denominator of -2/75 and 9/8. 600 What is the common denominator of -37/40 and 41/3? 120 What is the common denominator of 71/10 and -1/17? 170 What is the lowest common multiple of 510 and 680? 2040 Calculate the least common multiple of 33 and 10065. 10065 Calculate the common denominator of 11/45 and -17/66. 990 What is the lowest common multiple of 72 and 216? 216 Calculate the lowest common multiple of 1456 and 3094. 24752 What is the lowest common multiple of 10 and 44? 220 What is the lowest common multiple of 1208 and 9? 10872 Calculate the lowest common multiple of 5375 and 10750. 10750 Calculate the common denominator of -77/12 and -13/46. 276 What is the least common multiple of 666 and 54? 1998 What is the smallest common multiple of 90 and 90? 90 Find the common denominator of 99/10 and -97/1080. 1080 Calculate the lowest common multiple of 219 and 2. 438 What is the lowest common multiple of 21 and 3972? 27804 Find the common denominator of -22/28881 and -31/3. 28881 Calculate the smallest common multiple of 36 and 198. 396 What is the least common multiple of 104 and 26? 104 Calculate the lowest common multiple of 15 and 5. 15 What is the smallest common multiple of 735 and 5? 735 What is the common denominator of -29/9 and -59/84? 252 Calculate the least common multiple of 240 and 112. 1680 Calculate the smallest common multiple of 123 and 81. 3321 What is the least common multiple of 18 and 443? 7974 What is the common denominator of 169/720 and -1/288? 1440 What is the lowest common multiple of 48 and 96? 96 Find the common denominator of -119/2334 and -49/2334. 2334 What is the common denominator of -51/100 and -28/625? 2500 Calculate the common denominator of 25/352 and -13/320. 3520 Find the common denominator of -127/24 and -13/12. 24 What is the lowest common multiple of	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.